Browse entries in the PDBbind-CN Database
HEADER 1CSS_COMPLEX COMPND 1CSS_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 435 SER THR ASN LEU LYS ASP VAL LEU ALA SER LEU ILE PRO SEQRES 2 A 435 LYS GLU GLN ALA ARG ILE LYS THR PHE ARG GLN GLN HIS SEQRES 3 A 435 GLY ASN THR ALA VAL GLY GLN ILE THR VAL ASP MET SER SEQRES 4 A 435 TYR GLY GLY MET ARG GLY MET LYS GLY LEU ILE TYR GLU SEQRES 5 A 435 THR SER VAL LEU ASP PRO ASP GLU GLY ILE ARG PHE ARG SEQRES 6 A 435 GLY PHE SER ILE PRO GLU CYS GLN LYS LEU LEU PRO LYS SEQRES 7 A 435 ALA GLY GLY GLY GLU GLU PRO LEU PRO GLU GLY LEU PHE SEQRES 8 A 435 TRP LEU LEU VAL THR GLY GLN ILE PRO THR PRO GLU GLN SEQRES 9 A 435 VAL SER TRP VAL SER LYS GLU TRP ALA LYS ARG ALA ALA SEQRES 10 A 435 LEU PRO SER HIS VAL VAL THR MET LEU ASP ASN PHE PRO SEQRES 11 A 435 THR ASN LEU HIS PRO MET SER GLN LEU SER ALA ALA ILE SEQRES 12 A 435 THR ALA LEU ASN SER GLU SER ASN PHE ALA ARG ALA TYR SEQRES 13 A 435 ALA GLU GLY ILE ASN ARG THR LYS TYR TRP GLU PHE VAL SEQRES 14 A 435 TYR GLU ASP ALA MET ASP LEU ILE ALA LYS LEU PRO CYS SEQRES 15 A 435 VAL ALA ALA LYS ILE TYR ARG ASN LEU TYR ARG ALA GLY SEQRES 16 A 435 SER SER ILE GLY ALA ILE ASP SER LYS LEU ASP TRP SER SEQRES 17 A 435 HIS ASN PHE THR ASN MET LEU GLY TYR THR ASP PRO GLN SEQRES 18 A 435 PHE THR GLU LEU MET ARG LEU TYR LEU THR ILE HIS SER SEQRES 19 A 435 ASP HIS GLU GLY GLY ASN VAL SER ALA HIS THR SER HIS SEQRES 20 A 435 LEU VAL GLY SER ALA LEU SER ASP PRO TYR LEU SER PHE SEQRES 21 A 435 ALA ALA ALA MET ASN GLY LEU ALA GLY PRO LEU HIS GLY SEQRES 22 A 435 LEU ALA ASN GLN GLU VAL LEU LEU TRP LEU SER GLN LEU SEQRES 23 A 435 GLN LYS ASP LEU GLY ALA ASP ALA SER ASP GLU LYS LEU SEQRES 24 A 435 ARG ASP TYR ILE TRP ASN THR LEU ASN SER GLY ARG VAL SEQRES 25 A 435 VAL PRO GLY TYR GLY HIS ALA VAL LEU ARG LYS THR ASP SEQRES 26 A 435 PRO ARG TYR THR CYS GLN ARG GLU PHE ALA LEU LYS HIS SEQRES 27 A 435 LEU PRO SER ASP PRO MET PHE LYS LEU VAL ALA GLN LEU SEQRES 28 A 435 TYR LYS ILE VAL PRO ASN VAL LEU LEU GLU GLN GLY LYS SEQRES 29 A 435 ALA LYS ASN PRO TRP PRO ASN VAL ASP ALA HIS SER GLY SEQRES 30 A 435 VAL LEU LEU GLN TYR TYR GLY MET THR GLU MET ASN TYR SEQRES 31 A 435 TYR THR VAL LEU PHE GLY VAL SER ARG ALA LEU GLY VAL SEQRES 32 A 435 LEU ALA GLN LEU ILE TRP SER ARG ALA LEU GLY PHE PRO SEQRES 33 A 435 LEU GLU ARG PRO LYS SER MET SER THR ALA GLY LEU GLU SEQRES 34 A 435 LYS LEU SER ALA GLY GLY SEQRES 1 B 435 SER THR ASN LEU LYS ASP VAL LEU ALA SER LEU ILE PRO SEQRES 2 B 435 LYS GLU GLN ALA ARG ILE LYS THR PHE ARG GLN GLN HIS SEQRES 3 B 435 GLY ASN THR ALA VAL GLY GLN ILE THR VAL ASP MET SER SEQRES 4 B 435 TYR GLY GLY MET ARG GLY MET LYS GLY LEU ILE TYR GLU SEQRES 5 B 435 THR SER VAL LEU ASP PRO ASP GLU GLY ILE ARG PHE ARG SEQRES 6 B 435 GLY PHE SER ILE PRO GLU CYS GLN LYS LEU LEU PRO LYS SEQRES 7 B 435 ALA GLY GLY GLY GLU GLU PRO LEU PRO GLU GLY LEU PHE SEQRES 8 B 435 TRP LEU LEU VAL THR GLY GLN ILE PRO THR PRO GLU GLN SEQRES 9 B 435 VAL SER TRP VAL SER LYS GLU TRP ALA LYS ARG ALA ALA SEQRES 10 B 435 LEU PRO SER HIS VAL VAL THR MET LEU ASP ASN PHE PRO SEQRES 11 B 435 THR ASN LEU HIS PRO MET SER GLN LEU SER ALA ALA ILE SEQRES 12 B 435 THR ALA LEU ASN SER GLU SER ASN PHE ALA ARG ALA TYR SEQRES 13 B 435 ALA GLU GLY ILE ASN ARG THR LYS TYR TRP GLU PHE VAL SEQRES 14 B 435 TYR GLU ASP ALA MET ASP LEU ILE ALA LYS LEU PRO CYS SEQRES 15 B 435 VAL ALA ALA LYS ILE TYR ARG ASN LEU TYR ARG ALA GLY SEQRES 16 B 435 SER SER ILE GLY ALA ILE ASP SER LYS LEU ASP TRP SER SEQRES 17 B 435 HIS ASN PHE THR ASN MET LEU GLY TYR THR ASP PRO GLN SEQRES 18 B 435 PHE THR GLU LEU MET ARG LEU TYR LEU THR ILE HIS SER SEQRES 19 B 435 ASP HIS GLU GLY GLY ASN VAL SER ALA HIS THR SER HIS SEQRES 20 B 435 LEU VAL GLY SER ALA LEU SER ASP PRO TYR LEU SER PHE SEQRES 21 B 435 ALA ALA ALA MET ASN GLY LEU ALA GLY PRO LEU HIS GLY SEQRES 22 B 435 LEU ALA ASN GLN GLU VAL LEU LEU TRP LEU SER GLN LEU SEQRES 23 B 435 GLN LYS ASP LEU GLY ALA ASP ALA SER ASP GLU LYS LEU SEQRES 24 B 435 ARG ASP TYR ILE TRP ASN THR LEU ASN SER GLY ARG VAL SEQRES 25 B 435 VAL PRO GLY TYR GLY HIS ALA VAL LEU ARG LYS THR ASP SEQRES 26 B 435 PRO ARG TYR THR CYS GLN ARG GLU PHE ALA LEU LYS HIS SEQRES 27 B 435 LEU PRO SER ASP PRO MET PHE LYS LEU VAL ALA GLN LEU SEQRES 28 B 435 TYR LYS ILE VAL PRO ASN VAL LEU LEU GLU GLN GLY LYS SEQRES 29 B 435 ALA LYS ASN PRO TRP PRO ASN VAL ASP ALA HIS SER GLY SEQRES 30 B 435 VAL LEU LEU GLN TYR TYR GLY MET THR GLU MET ASN TYR SEQRES 31 B 435 TYR THR VAL LEU PHE GLY VAL SER ARG ALA LEU GLY VAL SEQRES 32 B 435 LEU ALA GLN LEU ILE TRP SER ARG ALA LEU GLY PHE PRO SEQRES 33 B 435 LEU GLU ARG PRO LYS SER MET SER THR ALA GLY LEU GLU SEQRES 34 B 435 LYS LEU SER ALA GLY GLY HET FCX A1161 84 ATOM 1 N SER A 3 10.470 5.049 -35.442 1.00 48.47 N ATOM 2 CA SER A 3 11.137 3.760 -35.714 1.00 44.43 C ATOM 3 C SER A 3 11.084 2.828 -34.502 1.00 19.55 C ATOM 4 O SER A 3 10.527 1.740 -34.595 1.00 28.21 O ATOM 5 CB SER A 3 12.539 3.835 -36.322 1.00 55.81 C ATOM 6 OG SER A 3 12.737 2.734 -37.191 1.00 79.11 O ATOM 7 HA SER A 3 10.541 3.326 -36.517 1.00 0.00 H ATOM 8 HB2 SER A 3 13.283 3.808 -35.525 1.00 0.00 H ATOM 9 HB3 SER A 3 12.643 4.764 -36.883 1.00 0.00 H ATOM 10 HG SER A 3 13.644 2.784 -37.584 1.00 0.00 H ATOM 11 HN3 SER A 3 10.942 5.521 -34.645 1.00 0.00 H ATOM 12 HN2 SER A 3 9.472 4.878 -35.203 1.00 0.00 H ATOM 13 HN1 SER A 3 10.527 5.653 -36.287 1.00 0.00 H ATOM 14 N THR A 4 11.665 3.226 -33.360 1.00 15.85 N ATOM 15 CA THR A 4 11.603 2.395 -32.192 1.00 16.22 C ATOM 16 C THR A 4 10.310 2.805 -31.488 1.00 19.00 C ATOM 17 O THR A 4 9.964 3.999 -31.444 1.00 10.94 O ATOM 18 CB THR A 4 12.747 2.682 -31.190 1.00 17.24 C ATOM 19 OG1 THR A 4 14.005 2.510 -31.796 1.00 31.01 O ATOM 20 CG2 THR A 4 12.583 1.810 -29.946 1.00 13.98 C ATOM 21 HA THR A 4 11.667 1.348 -32.490 1.00 0.00 H ATOM 22 HB THR A 4 12.690 3.724 -30.877 1.00 0.00 H ATOM 23 HG1 THR A 4 14.091 1.577 -32.117 1.00 0.00 H ATOM 24 HG23 THR A 4 11.597 1.978 -29.514 1.00 0.00 H ATOM 25 HG21 THR A 4 12.686 0.761 -30.223 1.00 0.00 H ATOM 26 HG22 THR A 4 13.350 2.071 -29.217 1.00 0.00 H ATOM 27 H THR A 4 12.161 4.139 -33.321 1.00 0.00 H ATOM 28 N ASN A 5 9.588 1.829 -30.945 1.00 17.64 N ATOM 29 CA ASN A 5 8.362 2.126 -30.235 1.00 11.56 C ATOM 30 C ASN A 5 8.099 0.946 -29.348 1.00 11.00 C ATOM 31 O ASN A 5 7.656 -0.069 -29.848 1.00 13.47 O ATOM 32 CB ASN A 5 7.152 2.526 -31.061 1.00 13.02 C ATOM 33 CG ASN A 5 6.045 3.106 -30.170 1.00 20.15 C ATOM 34 OD1 ASN A 5 5.084 3.688 -30.669 1.00 28.90 O ATOM 35 ND2 ASN A 5 6.074 2.899 -28.860 1.00 11.50 N ATOM 36 HA ASN A 5 8.520 3.048 -29.675 1.00 0.00 H ATOM 37 HB2 ASN A 5 7.452 3.277 -31.792 1.00 0.00 H ATOM 38 HB3 ASN A 5 6.768 1.648 -31.580 1.00 0.00 H ATOM 39 HD22 ASN A 5 6.883 2.408 -28.429 1.00 0.00 H ATOM 40 HD21 ASN A 5 5.288 3.228 -28.264 1.00 0.00 H ATOM 41 H ASN A 5 9.907 0.843 -31.031 1.00 0.00 H ATOM 42 N LEU A 6 8.413 1.082 -28.054 1.00 13.26 N ATOM 43 CA LEU A 6 8.222 -0.036 -27.118 1.00 13.01 C ATOM 44 C LEU A 6 6.798 -0.488 -27.122 1.00 6.00 C ATOM 45 O LEU A 6 6.473 -1.638 -27.056 1.00 10.56 O ATOM 46 CB LEU A 6 8.583 0.446 -25.685 1.00 10.67 C ATOM 47 CG LEU A 6 8.538 -0.571 -24.554 1.00 9.23 C ATOM 48 CD1 LEU A 6 9.340 -1.855 -24.924 1.00 9.02 C ATOM 49 CD2 LEU A 6 9.210 0.182 -23.387 1.00 19.66 C ATOM 50 HA LEU A 6 8.860 -0.865 -27.423 1.00 0.00 H ATOM 51 HB2 LEU A 6 9.597 0.844 -25.723 1.00 0.00 H ATOM 52 HB3 LEU A 6 7.890 1.247 -25.428 1.00 0.00 H ATOM 53 HG LEU A 6 7.529 -0.913 -24.323 1.00 0.00 H ATOM 54 HD21 LEU A 6 10.228 0.452 -23.669 1.00 0.00 H ATOM 55 HD22 LEU A 6 8.641 1.085 -23.163 1.00 0.00 H ATOM 56 HD23 LEU A 6 9.234 -0.461 -22.507 1.00 0.00 H ATOM 57 HD11 LEU A 6 8.909 -2.306 -25.818 1.00 0.00 H ATOM 58 HD12 LEU A 6 10.380 -1.590 -25.115 1.00 0.00 H ATOM 59 HD13 LEU A 6 9.290 -2.564 -24.097 1.00 0.00 H ATOM 60 H LEU A 6 8.795 1.985 -27.708 1.00 0.00 H ATOM 61 N LYS A 7 5.881 0.453 -27.204 1.00 7.54 N ATOM 62 CA LYS A 7 4.469 0.081 -27.207 1.00 13.62 C ATOM 63 C LYS A 7 4.099 -0.848 -28.354 1.00 8.47 C ATOM 64 O LYS A 7 3.209 -1.702 -28.183 1.00 10.79 O ATOM 65 CB LYS A 7 3.624 1.327 -27.207 1.00 8.48 C ATOM 66 CG LYS A 7 2.250 1.097 -26.568 1.00 18.32 C ATOM 67 CD LYS A 7 1.267 2.293 -26.687 1.00 9.17 C ATOM 68 CE LYS A 7 -0.057 2.137 -25.916 1.00 16.62 C ATOM 69 NZ LYS A 7 -0.723 3.452 -25.765 1.00 14.89 N ATOM 70 HA LYS A 7 4.273 -0.489 -26.299 1.00 0.00 H ATOM 71 HB2 LYS A 7 4.145 2.105 -26.648 1.00 0.00 H ATOM 72 HB3 LYS A 7 3.482 1.655 -28.237 1.00 0.00 H ATOM 73 HG2 LYS A 7 1.792 0.233 -27.049 1.00 0.00 H ATOM 74 HG3 LYS A 7 2.399 0.885 -25.509 1.00 0.00 H ATOM 75 HD2 LYS A 7 1.772 3.183 -26.312 1.00 0.00 H ATOM 76 HD3 LYS A 7 1.029 2.429 -27.742 1.00 0.00 H ATOM 77 HE2 LYS A 7 0.148 1.722 -24.929 1.00 0.00 H ATOM 78 HE3 LYS A 7 -0.715 1.461 -26.463 1.00 0.00 H ATOM 79 HZ1 LYS A 7 -0.098 4.097 -25.241 1.00 0.00 H ATOM 80 HZ2 LYS A 7 -0.922 3.848 -26.706 1.00 0.00 H ATOM 81 HZ3 LYS A 7 -1.614 3.330 -25.243 1.00 0.00 H ATOM 82 H LYS A 7 6.160 1.453 -27.266 1.00 0.00 H ATOM 83 N ASP A 8 4.771 -0.725 -29.535 1.00 9.77 N ATOM 84 CA ASP A 8 4.475 -1.614 -30.682 1.00 5.10 C ATOM 85 C ASP A 8 5.067 -2.985 -30.439 1.00 11.14 C ATOM 86 O ASP A 8 4.554 -4.031 -30.845 1.00 11.81 O ATOM 87 CB ASP A 8 4.988 -1.159 -32.050 1.00 7.51 C ATOM 88 CG ASP A 8 4.235 0.028 -32.612 1.00 15.74 C ATOM 89 OD1 ASP A 8 2.915 0.015 -32.448 1.00 16.67 O ATOM 90 OD2 ASP A 8 4.836 0.938 -33.126 1.00 16.16 O ATOM 91 HA ASP A 8 3.386 -1.604 -30.730 1.00 0.00 H ATOM 92 HB2 ASP A 8 6.039 -0.887 -31.952 1.00 0.00 H ATOM 93 HB3 ASP A 8 4.893 -1.990 -32.748 1.00 0.00 H ATOM 94 H ASP A 8 5.504 0.006 -29.632 1.00 0.00 H ATOM 95 N VAL A 9 6.190 -2.993 -29.720 1.00 5.21 N ATOM 96 CA VAL A 9 6.888 -4.227 -29.385 1.00 6.81 C ATOM 97 C VAL A 9 6.033 -5.010 -28.440 1.00 13.52 C ATOM 98 O VAL A 9 5.805 -6.200 -28.650 1.00 9.71 O ATOM 99 CB VAL A 9 8.269 -4.006 -28.812 1.00 9.29 C ATOM 100 CG1 VAL A 9 8.772 -5.256 -28.123 1.00 13.97 C ATOM 101 CG2 VAL A 9 9.220 -3.470 -29.897 1.00 8.83 C ATOM 102 HA VAL A 9 7.050 -4.783 -30.309 1.00 0.00 H ATOM 103 HB VAL A 9 8.224 -3.239 -28.039 1.00 0.00 H ATOM 104 HG11 VAL A 9 8.093 -5.521 -27.312 1.00 0.00 H ATOM 105 HG12 VAL A 9 8.817 -6.073 -28.843 1.00 0.00 H ATOM 106 HG13 VAL A 9 9.767 -5.071 -27.719 1.00 0.00 H ATOM 107 HG21 VAL A 9 9.284 -4.192 -30.711 1.00 0.00 H ATOM 108 HG22 VAL A 9 8.837 -2.523 -30.278 1.00 0.00 H ATOM 109 HG23 VAL A 9 10.210 -3.317 -29.467 1.00 0.00 H ATOM 110 H VAL A 9 6.580 -2.088 -29.387 1.00 0.00 H ATOM 111 N LEU A 10 5.527 -4.319 -27.435 1.00 12.76 N ATOM 112 CA LEU A 10 4.663 -4.989 -26.478 1.00 9.50 C ATOM 113 C LEU A 10 3.383 -5.551 -27.153 1.00 16.78 C ATOM 114 O LEU A 10 2.955 -6.635 -26.800 1.00 11.49 O ATOM 115 CB LEU A 10 4.241 -3.957 -25.436 1.00 4.99 C ATOM 116 CG LEU A 10 5.265 -3.999 -24.294 1.00 16.26 C ATOM 117 CD1 LEU A 10 4.974 -2.797 -23.395 1.00 11.56 C ATOM 118 CD2 LEU A 10 5.067 -5.263 -23.456 1.00 15.69 C ATOM 119 HA LEU A 10 5.208 -5.823 -26.036 1.00 0.00 H ATOM 120 HB2 LEU A 10 4.224 -2.963 -25.883 1.00 0.00 H ATOM 121 HB3 LEU A 10 3.249 -4.199 -25.054 1.00 0.00 H ATOM 122 HG LEU A 10 6.278 -3.986 -24.696 1.00 0.00 H ATOM 123 HD21 LEU A 10 4.061 -5.265 -23.036 1.00 0.00 H ATOM 124 HD22 LEU A 10 5.199 -6.141 -24.088 1.00 0.00 H ATOM 125 HD23 LEU A 10 5.800 -5.281 -22.649 1.00 0.00 H ATOM 126 HD11 LEU A 10 5.076 -1.879 -23.974 1.00 0.00 H ATOM 127 HD12 LEU A 10 3.958 -2.872 -23.007 1.00 0.00 H ATOM 128 HD13 LEU A 10 5.681 -2.786 -22.565 1.00 0.00 H ATOM 129 H LEU A 10 5.744 -3.307 -27.330 1.00 0.00 H ATOM 130 N ALA A 11 2.738 -4.839 -28.128 1.00 5.34 N ATOM 131 CA ALA A 11 1.537 -5.297 -28.817 1.00 9.94 C ATOM 132 C ALA A 11 1.753 -6.662 -29.502 1.00 10.23 C ATOM 133 O ALA A 11 0.825 -7.407 -29.629 1.00 12.90 O ATOM 134 CB ALA A 11 1.052 -4.260 -29.838 1.00 11.42 C ATOM 135 HA ALA A 11 0.765 -5.422 -28.057 1.00 0.00 H ATOM 136 HB1 ALA A 11 0.824 -3.326 -29.325 1.00 0.00 H ATOM 137 HB2 ALA A 11 1.833 -4.088 -30.578 1.00 0.00 H ATOM 138 HB3 ALA A 11 0.156 -4.632 -30.334 1.00 0.00 H ATOM 139 H ALA A 11 3.129 -3.913 -28.394 1.00 0.00 H ATOM 140 N SER A 12 2.979 -6.978 -29.923 1.00 9.72 N ATOM 141 CA SER A 12 3.240 -8.254 -30.561 1.00 15.15 C ATOM 142 C SER A 12 3.499 -9.347 -29.546 1.00 11.45 C ATOM 143 O SER A 12 3.110 -10.499 -29.757 1.00 16.50 O ATOM 144 CB SER A 12 4.538 -8.181 -31.373 1.00 20.20 C ATOM 145 OG SER A 12 4.440 -7.367 -32.513 1.00 24.94 O ATOM 146 HA SER A 12 2.362 -8.469 -31.170 1.00 0.00 H ATOM 147 HB2 SER A 12 4.804 -9.189 -31.690 1.00 0.00 H ATOM 148 HB3 SER A 12 5.325 -7.784 -30.732 1.00 0.00 H ATOM 149 HG SER A 12 5.308 -7.363 -32.990 1.00 0.00 H ATOM 150 H SER A 12 3.757 -6.301 -29.792 1.00 0.00 H ATOM 151 N LEU A 13 4.170 -8.980 -28.458 1.00 10.72 N ATOM 152 CA LEU A 13 4.560 -9.893 -27.395 1.00 16.02 C ATOM 153 C LEU A 13 3.350 -10.418 -26.595 1.00 13.37 C ATOM 154 O LEU A 13 3.172 -11.611 -26.359 1.00 15.53 O ATOM 155 CB LEU A 13 5.631 -9.082 -26.566 1.00 10.76 C ATOM 156 CG LEU A 13 7.097 -9.493 -26.262 1.00 28.56 C ATOM 157 CD1 LEU A 13 7.984 -8.327 -26.015 1.00 10.36 C ATOM 158 CD2 LEU A 13 7.276 -10.074 -24.861 1.00 33.60 C ATOM 159 HA LEU A 13 4.995 -10.824 -27.759 1.00 0.00 H ATOM 160 HB2 LEU A 13 5.710 -8.122 -27.076 1.00 0.00 H ATOM 161 HB3 LEU A 13 5.174 -8.935 -25.588 1.00 0.00 H ATOM 162 HG LEU A 13 7.318 -10.135 -27.114 1.00 0.00 H ATOM 163 HD21 LEU A 13 6.980 -9.331 -24.120 1.00 0.00 H ATOM 164 HD22 LEU A 13 6.654 -10.963 -24.755 1.00 0.00 H ATOM 165 HD23 LEU A 13 8.322 -10.341 -24.711 1.00 0.00 H ATOM 166 HD11 LEU A 13 7.994 -7.686 -26.897 1.00 0.00 H ATOM 167 HD12 LEU A 13 7.612 -7.764 -25.159 1.00 0.00 H ATOM 168 HD13 LEU A 13 8.995 -8.678 -25.808 1.00 0.00 H ATOM 169 H LEU A 13 4.432 -7.978 -28.361 1.00 0.00 H ATOM 170 N ILE A 14 2.469 -9.511 -26.158 1.00 14.95 N ATOM 171 CA ILE A 14 1.261 -9.790 -25.363 1.00 13.69 C ATOM 172 C ILE A 14 0.420 -11.000 -25.741 1.00 19.93 C ATOM 173 O ILE A 14 0.204 -11.894 -24.957 1.00 18.12 O ATOM 174 CB ILE A 14 0.456 -8.521 -25.003 1.00 9.42 C ATOM 175 CG1 ILE A 14 1.289 -7.695 -24.020 1.00 11.63 C ATOM 176 CG2 ILE A 14 -0.977 -8.724 -24.500 1.00 11.23 C ATOM 177 CD1 ILE A 14 0.838 -6.238 -23.946 1.00 11.03 C ATOM 178 HA ILE A 14 1.688 -10.152 -24.428 1.00 0.00 H ATOM 179 HB ILE A 14 0.290 -7.994 -25.942 1.00 0.00 H ATOM 180 HG12 ILE A 14 1.200 -8.139 -23.028 1.00 0.00 H ATOM 181 HG13 ILE A 14 2.332 -7.722 -24.337 1.00 0.00 H ATOM 182 HD11 ILE A 14 0.931 -5.780 -24.931 1.00 0.00 H ATOM 183 HD12 ILE A 14 -0.202 -6.197 -23.621 1.00 0.00 H ATOM 184 HD13 ILE A 14 1.464 -5.701 -23.234 1.00 0.00 H ATOM 185 HG21 ILE A 14 -1.561 -9.234 -25.266 1.00 0.00 H ATOM 186 HG22 ILE A 14 -0.960 -9.328 -23.593 1.00 0.00 H ATOM 187 HG23 ILE A 14 -1.426 -7.754 -24.285 1.00 0.00 H ATOM 188 H ILE A 14 2.654 -8.517 -26.402 1.00 0.00 H ATOM 189 N PRO A 15 -0.063 -11.054 -26.965 1.00 23.14 N ATOM 190 CA PRO A 15 -0.886 -12.171 -27.382 1.00 20.66 C ATOM 191 C PRO A 15 -0.180 -13.481 -27.377 1.00 15.86 C ATOM 192 O PRO A 15 -0.834 -14.469 -27.201 1.00 15.16 O ATOM 193 CB PRO A 15 -1.295 -11.916 -28.834 1.00 22.09 C ATOM 194 CG PRO A 15 -0.699 -10.570 -29.233 1.00 22.11 C ATOM 195 CD PRO A 15 0.170 -10.107 -28.080 1.00 22.04 C ATOM 196 HA PRO A 15 -1.716 -12.232 -26.678 1.00 0.00 H ATOM 197 HD3 PRO A 15 1.220 -10.120 -28.372 1.00 0.00 H ATOM 198 HD2 PRO A 15 -0.110 -9.097 -27.780 1.00 0.00 H ATOM 199 HG3 PRO A 15 -1.495 -9.848 -29.415 1.00 0.00 H ATOM 200 HG2 PRO A 15 -0.097 -10.680 -30.135 1.00 0.00 H ATOM 201 HB2 PRO A 15 -0.905 -12.704 -29.478 1.00 0.00 H ATOM 202 HB3 PRO A 15 -2.381 -11.885 -28.918 1.00 0.00 H ATOM 203 N LYS A 16 1.128 -13.500 -27.577 1.00 13.98 N ATOM 204 CA LYS A 16 1.828 -14.773 -27.575 1.00 12.02 C ATOM 205 C LYS A 16 1.962 -15.262 -26.152 1.00 22.85 C ATOM 206 O LYS A 16 1.776 -16.432 -25.861 1.00 18.03 O ATOM 207 CB LYS A 16 3.231 -14.590 -28.115 1.00 19.50 C ATOM 208 CG LYS A 16 3.318 -13.290 -28.887 1.00 76.56 C ATOM 209 CD LYS A 16 3.378 -13.566 -30.380 1.00 80.00 C ATOM 210 CE LYS A 16 4.675 -14.258 -30.787 1.00 80.00 C ATOM 211 NZ LYS A 16 5.827 -13.349 -30.796 1.00 80.00 N ATOM 212 HA LYS A 16 1.268 -15.480 -28.188 1.00 0.00 H ATOM 213 HB2 LYS A 16 3.938 -14.567 -27.286 1.00 0.00 H ATOM 214 HB3 LYS A 16 3.476 -15.421 -28.776 1.00 0.00 H ATOM 215 HG2 LYS A 16 2.440 -12.682 -28.668 1.00 0.00 H ATOM 216 HG3 LYS A 16 4.216 -12.751 -28.584 1.00 0.00 H ATOM 217 HD2 LYS A 16 2.538 -14.205 -30.653 1.00 0.00 H ATOM 218 HD3 LYS A 16 3.302 -12.620 -30.915 1.00 0.00 H ATOM 219 HE2 LYS A 16 4.550 -14.672 -31.788 1.00 0.00 H ATOM 220 HE3 LYS A 16 4.874 -15.066 -30.083 1.00 0.00 H ATOM 221 HZ1 LYS A 16 5.653 -12.577 -31.471 1.00 0.00 H ATOM 222 HZ2 LYS A 16 5.963 -12.954 -29.844 1.00 0.00 H ATOM 223 HZ3 LYS A 16 6.679 -13.874 -31.080 1.00 0.00 H ATOM 224 H LYS A 16 1.649 -12.614 -27.734 1.00 0.00 H ATOM 225 N GLU A 17 2.283 -14.375 -25.229 1.00 16.36 N ATOM 226 CA GLU A 17 2.421 -14.793 -23.824 1.00 7.62 C ATOM 227 C GLU A 17 1.055 -15.203 -23.289 1.00 11.78 C ATOM 228 O GLU A 17 0.983 -16.116 -22.497 1.00 21.63 O ATOM 229 CB GLU A 17 2.938 -13.613 -22.961 1.00 12.79 C ATOM 230 CG GLU A 17 4.436 -13.359 -23.142 1.00 24.43 C ATOM 231 CD GLU A 17 5.211 -14.640 -22.991 1.00 25.35 C ATOM 232 OE1 GLU A 17 4.853 -15.309 -21.907 1.00 34.36 O ATOM 233 OE2 GLU A 17 6.049 -15.008 -23.816 1.00 49.17 O ATOM 234 HA GLU A 17 3.125 -15.624 -23.774 1.00 0.00 H ATOM 235 HB2 GLU A 17 2.395 -12.711 -23.242 1.00 0.00 H ATOM 236 HB3 GLU A 17 2.747 -13.838 -21.912 1.00 0.00 H ATOM 237 HG2 GLU A 17 4.613 -12.948 -24.136 1.00 0.00 H ATOM 238 HG3 GLU A 17 4.772 -12.645 -22.390 1.00 0.00 H ATOM 239 H GLU A 17 2.438 -13.381 -25.494 1.00 0.00 H ATOM 240 N GLN A 18 -0.004 -14.507 -23.736 1.00 10.16 N ATOM 241 CA GLN A 18 -1.332 -14.876 -23.273 1.00 11.63 C ATOM 242 C GLN A 18 -1.646 -16.331 -23.605 1.00 22.47 C ATOM 243 O GLN A 18 -2.158 -17.094 -22.791 1.00 18.92 O ATOM 244 CB GLN A 18 -2.462 -14.019 -23.872 1.00 18.39 C ATOM 245 CG GLN A 18 -2.405 -12.576 -23.352 1.00 15.23 C ATOM 246 CD GLN A 18 -3.388 -11.758 -24.122 1.00 45.10 C ATOM 247 OE1 GLN A 18 -3.825 -12.127 -25.241 1.00 36.62 O ATOM 248 NE2 GLN A 18 -3.741 -10.661 -23.474 1.00 15.60 N ATOM 249 HA GLN A 18 -1.301 -14.709 -22.196 1.00 0.00 H ATOM 250 HB2 GLN A 18 -2.363 -14.009 -24.957 1.00 0.00 H ATOM 251 HB3 GLN A 18 -3.422 -14.457 -23.600 1.00 0.00 H ATOM 252 HG2 GLN A 18 -2.659 -12.556 -22.292 1.00 0.00 H ATOM 253 HG3 GLN A 18 -1.402 -12.174 -23.491 1.00 0.00 H ATOM 254 HE22 GLN A 18 -3.318 -10.445 -22.549 1.00 0.00 H ATOM 255 HE21 GLN A 18 -4.441 -10.014 -23.890 1.00 0.00 H ATOM 256 H GLN A 18 0.124 -13.718 -24.402 1.00 0.00 H ATOM 257 N ALA A 19 -1.347 -16.725 -24.838 1.00 21.33 N ATOM 258 CA ALA A 19 -1.587 -18.080 -25.354 1.00 18.44 C ATOM 259 C ALA A 19 -0.817 -19.179 -24.598 1.00 16.07 C ATOM 260 O ALA A 19 -1.372 -20.195 -24.174 1.00 23.91 O ATOM 261 CB ALA A 19 -1.378 -18.076 -26.876 1.00 19.48 C ATOM 262 HA ALA A 19 -2.624 -18.354 -25.161 1.00 0.00 H ATOM 263 HB1 ALA A 19 -2.076 -17.377 -27.336 1.00 0.00 H ATOM 264 HB2 ALA A 19 -0.356 -17.771 -27.100 1.00 0.00 H ATOM 265 HB3 ALA A 19 -1.554 -19.078 -27.268 1.00 0.00 H ATOM 266 H ALA A 19 -0.915 -16.030 -25.480 1.00 0.00 H ATOM 267 N ARG A 20 0.454 -18.901 -24.406 1.00 16.27 N ATOM 268 CA ARG A 20 1.394 -19.734 -23.720 1.00 15.62 C ATOM 269 C ARG A 20 0.966 -20.007 -22.287 1.00 20.69 C ATOM 270 O ARG A 20 1.015 -21.126 -21.786 1.00 12.63 O ATOM 271 CB ARG A 20 2.805 -19.201 -23.934 1.00 18.42 C ATOM 272 CG ARG A 20 3.671 -19.026 -22.682 1.00 53.84 C ATOM 273 CD ARG A 20 5.164 -18.797 -22.993 1.00 40.27 C ATOM 274 NE ARG A 20 5.813 -17.820 -22.107 1.00 80.00 N ATOM 275 CZ ARG A 20 6.730 -18.020 -21.127 1.00 80.00 C ATOM 276 NH1 ARG A 20 7.209 -19.222 -20.793 1.00 74.35 N ATOM 277 NH2 ARG A 20 7.190 -16.953 -20.441 1.00 65.62 N ATOM 278 HA ARG A 20 1.410 -20.736 -24.150 1.00 0.00 H ATOM 279 HB2 ARG A 20 3.322 -19.892 -24.600 1.00 0.00 H ATOM 280 HB3 ARG A 20 2.721 -18.227 -24.417 1.00 0.00 H ATOM 281 HG2 ARG A 20 3.299 -18.168 -22.122 1.00 0.00 H ATOM 282 HG3 ARG A 20 3.579 -19.924 -22.071 1.00 0.00 H ATOM 283 HD2 ARG A 20 5.251 -18.441 -24.019 1.00 0.00 H ATOM 284 HD3 ARG A 20 5.685 -19.749 -22.895 1.00 0.00 H ATOM 285 HE ARG A 20 5.528 -16.831 -22.253 1.00 0.00 H ATOM 286 HH12 ARG A 20 7.912 -19.308 -20.031 1.00 0.00 H ATOM 287 HH11 ARG A 20 6.879 -20.071 -21.295 1.00 0.00 H ATOM 288 HH22 ARG A 20 7.893 -17.084 -19.686 1.00 0.00 H ATOM 289 HH21 ARG A 20 6.841 -16.000 -20.667 1.00 0.00 H ATOM 290 H ARG A 20 0.806 -17.999 -24.785 1.00 0.00 H ATOM 291 N ILE A 21 0.502 -18.981 -21.616 1.00 14.24 N ATOM 292 CA ILE A 21 0.056 -19.158 -20.264 1.00 14.13 C ATOM 293 C ILE A 21 -1.258 -19.902 -20.269 1.00 21.90 C ATOM 294 O ILE A 21 -1.534 -20.717 -19.389 1.00 17.62 O ATOM 295 CB ILE A 21 -0.100 -17.797 -19.555 1.00 16.13 C ATOM 296 CG1 ILE A 21 1.315 -17.359 -19.203 1.00 10.08 C ATOM 297 CG2 ILE A 21 -0.938 -17.919 -18.273 1.00 11.47 C ATOM 298 CD1 ILE A 21 1.358 -15.920 -18.756 1.00 22.80 C ATOM 299 HA ILE A 21 0.800 -19.736 -19.716 1.00 0.00 H ATOM 300 HB ILE A 21 -0.614 -17.082 -20.197 1.00 0.00 H ATOM 301 HG12 ILE A 21 1.691 -17.991 -18.398 1.00 0.00 H ATOM 302 HG13 ILE A 21 1.950 -17.476 -20.081 1.00 0.00 H ATOM 303 HD11 ILE A 21 0.990 -15.281 -19.558 1.00 0.00 H ATOM 304 HD12 ILE A 21 0.730 -15.796 -17.874 1.00 0.00 H ATOM 305 HD13 ILE A 21 2.385 -15.647 -18.514 1.00 0.00 H ATOM 306 HG21 ILE A 21 -1.931 -18.293 -18.524 1.00 0.00 H ATOM 307 HG22 ILE A 21 -0.451 -18.611 -17.586 1.00 0.00 H ATOM 308 HG23 ILE A 21 -1.025 -16.940 -17.803 1.00 0.00 H ATOM 309 H ILE A 21 0.457 -18.043 -22.062 1.00 0.00 H ATOM 310 N LYS A 22 -2.079 -19.596 -21.262 1.00 16.00 N ATOM 311 CA LYS A 22 -3.388 -20.246 -21.353 1.00 17.00 C ATOM 312 C LYS A 22 -3.234 -21.760 -21.500 1.00 25.86 C ATOM 313 O LYS A 22 -3.829 -22.560 -20.787 1.00 25.04 O ATOM 314 CB LYS A 22 -4.264 -19.672 -22.452 1.00 29.38 C ATOM 315 CG LYS A 22 -5.179 -20.734 -23.026 1.00 65.01 C ATOM 316 CD LYS A 22 -6.396 -20.131 -23.709 1.00 80.00 C ATOM 317 CE LYS A 22 -7.548 -21.119 -23.877 1.00 80.00 C ATOM 318 NZ LYS A 22 -7.625 -21.737 -25.217 1.00 80.00 N ATOM 319 HA LYS A 22 -3.904 -20.038 -20.416 1.00 0.00 H ATOM 320 HB2 LYS A 22 -4.869 -18.864 -22.041 1.00 0.00 H ATOM 321 HB3 LYS A 22 -3.629 -19.280 -23.247 1.00 0.00 H ATOM 322 HG2 LYS A 22 -4.622 -21.322 -23.755 1.00 0.00 H ATOM 323 HG3 LYS A 22 -5.515 -21.383 -22.218 1.00 0.00 H ATOM 324 HD2 LYS A 22 -6.746 -19.289 -23.112 1.00 0.00 H ATOM 325 HD3 LYS A 22 -6.098 -19.776 -24.696 1.00 0.00 H ATOM 326 HE2 LYS A 22 -8.483 -20.590 -23.690 1.00 0.00 H ATOM 327 HE3 LYS A 22 -7.428 -21.913 -23.140 1.00 0.00 H ATOM 328 HZ1 LYS A 22 -7.752 -20.994 -25.933 1.00 0.00 H ATOM 329 HZ2 LYS A 22 -6.745 -22.258 -25.408 1.00 0.00 H ATOM 330 HZ3 LYS A 22 -8.431 -22.393 -25.249 1.00 0.00 H ATOM 331 H LYS A 22 -1.795 -18.895 -21.976 1.00 0.00 H ATOM 332 N THR A 23 -2.402 -22.172 -22.435 1.00 17.39 N ATOM 333 CA THR A 23 -2.228 -23.595 -22.553 1.00 26.13 C ATOM 334 C THR A 23 -1.605 -24.251 -21.328 1.00 24.40 C ATOM 335 O THR A 23 -1.963 -25.342 -20.950 1.00 28.95 O ATOM 336 CB THR A 23 -1.254 -23.824 -23.690 1.00 25.57 C ATOM 337 OG1 THR A 23 -1.807 -23.157 -24.805 1.00 50.46 O ATOM 338 CG2 THR A 23 -1.158 -25.330 -23.925 1.00 72.46 C ATOM 339 HA THR A 23 -3.218 -24.028 -22.697 1.00 0.00 H ATOM 340 HB THR A 23 -0.250 -23.449 -23.491 1.00 0.00 H ATOM 341 HG1 THR A 23 -1.901 -22.193 -24.598 1.00 0.00 H ATOM 342 HG23 THR A 23 -0.728 -25.807 -23.044 1.00 0.00 H ATOM 343 HG21 THR A 23 -2.155 -25.732 -24.107 1.00 0.00 H ATOM 344 HG22 THR A 23 -0.524 -25.522 -24.790 1.00 0.00 H ATOM 345 H THR A 23 -1.899 -21.505 -23.054 1.00 0.00 H ATOM 346 N PHE A 24 -0.643 -23.602 -20.716 1.00 19.27 N ATOM 347 CA PHE A 24 0.019 -24.158 -19.545 1.00 12.06 C ATOM 348 C PHE A 24 -0.946 -24.420 -18.444 1.00 19.10 C ATOM 349 O PHE A 24 -0.955 -25.448 -17.790 1.00 26.91 O ATOM 350 CB PHE A 24 1.043 -23.111 -19.049 1.00 8.30 C ATOM 351 CG PHE A 24 1.782 -23.491 -17.802 1.00 18.04 C ATOM 352 CD1 PHE A 24 2.332 -24.749 -17.573 1.00 17.96 C ATOM 353 CD2 PHE A 24 1.980 -22.524 -16.815 1.00 16.41 C ATOM 354 CE1 PHE A 24 3.024 -25.033 -16.393 1.00 24.58 C ATOM 355 CE2 PHE A 24 2.663 -22.783 -15.625 1.00 19.58 C ATOM 356 CZ PHE A 24 3.199 -24.057 -15.415 1.00 20.94 C ATOM 357 HA PHE A 24 0.491 -25.102 -19.819 1.00 0.00 H ATOM 358 HB2 PHE A 24 1.775 -22.951 -19.841 1.00 0.00 H ATOM 359 HB3 PHE A 24 0.509 -22.180 -18.856 1.00 0.00 H ATOM 360 HD2 PHE A 24 1.584 -21.522 -16.981 1.00 0.00 H ATOM 361 HE2 PHE A 24 2.777 -22.004 -14.871 1.00 0.00 H ATOM 362 HZ PHE A 24 3.746 -24.283 -14.500 1.00 0.00 H ATOM 363 HE1 PHE A 24 3.432 -26.031 -16.236 1.00 0.00 H ATOM 364 HD1 PHE A 24 2.221 -25.527 -18.328 1.00 0.00 H ATOM 365 H PHE A 24 -0.347 -22.672 -21.075 1.00 0.00 H ATOM 366 N ARG A 25 -1.784 -23.445 -18.227 1.00 21.79 N ATOM 367 CA ARG A 25 -2.755 -23.615 -17.177 1.00 16.16 C ATOM 368 C ARG A 25 -3.795 -24.639 -17.551 1.00 24.57 C ATOM 369 O ARG A 25 -4.496 -25.170 -16.683 1.00 21.12 O ATOM 370 CB ARG A 25 -3.519 -22.334 -16.925 1.00 14.28 C ATOM 371 CG ARG A 25 -2.676 -21.280 -16.251 1.00 17.37 C ATOM 372 CD ARG A 25 -3.560 -20.059 -16.021 1.00 13.15 C ATOM 373 NE ARG A 25 -4.491 -20.227 -14.919 1.00 20.03 N ATOM 374 CZ ARG A 25 -5.235 -19.207 -14.560 1.00 13.35 C ATOM 375 NH1 ARG A 25 -5.144 -18.025 -15.200 1.00 23.72 N ATOM 376 NH2 ARG A 25 -6.095 -19.312 -13.534 1.00 24.14 N ATOM 377 HA ARG A 25 -2.190 -23.924 -16.298 1.00 0.00 H ATOM 378 HB2 ARG A 25 -3.870 -21.943 -17.880 1.00 0.00 H ATOM 379 HB3 ARG A 25 -4.375 -22.557 -16.288 1.00 0.00 H ATOM 380 HG2 ARG A 25 -2.304 -21.655 -15.297 1.00 0.00 H ATOM 381 HG3 ARG A 25 -1.833 -21.014 -16.889 1.00 0.00 H ATOM 382 HD2 ARG A 25 -4.130 -19.867 -16.930 1.00 0.00 H ATOM 383 HD3 ARG A 25 -2.920 -19.203 -15.807 1.00 0.00 H ATOM 384 HE ARG A 25 -4.567 -21.138 -14.424 1.00 0.00 H ATOM 385 HH12 ARG A 25 -5.740 -17.226 -14.904 1.00 0.00 H ATOM 386 HH11 ARG A 25 -4.477 -17.911 -15.990 1.00 0.00 H ATOM 387 HH22 ARG A 25 -6.679 -18.496 -13.259 1.00 0.00 H ATOM 388 HH21 ARG A 25 -6.177 -20.209 -13.014 1.00 0.00 H ATOM 389 H ARG A 25 -1.752 -22.573 -18.793 1.00 0.00 H ATOM 390 N GLN A 26 -3.897 -24.895 -18.850 1.00 29.76 N ATOM 391 CA GLN A 26 -4.867 -25.872 -19.309 1.00 32.90 C ATOM 392 C GLN A 26 -4.352 -27.211 -18.836 1.00 26.94 C ATOM 393 O GLN A 26 -5.047 -28.034 -18.285 1.00 27.73 O ATOM 394 CB GLN A 26 -4.986 -25.924 -20.834 1.00 37.89 C ATOM 395 CG GLN A 26 -5.818 -24.761 -21.391 1.00 80.00 C ATOM 396 CD GLN A 26 -6.339 -25.094 -22.775 1.00 80.00 C ATOM 397 OE1 GLN A 26 -7.496 -25.542 -22.899 1.00 80.00 O ATOM 398 NE2 GLN A 26 -5.497 -24.923 -23.810 1.00 58.16 N ATOM 399 HA GLN A 26 -5.852 -25.611 -18.921 1.00 0.00 H ATOM 400 HB2 GLN A 26 -3.986 -25.879 -21.266 1.00 0.00 H ATOM 401 HB3 GLN A 26 -5.461 -26.863 -21.117 1.00 0.00 H ATOM 402 HG2 GLN A 26 -6.661 -24.572 -20.726 1.00 0.00 H ATOM 403 HG3 GLN A 26 -5.195 -23.869 -21.447 1.00 0.00 H ATOM 404 HE22 GLN A 26 -4.542 -24.545 -23.647 1.00 0.00 H ATOM 405 HE21 GLN A 26 -5.801 -25.169 -24.774 1.00 0.00 H ATOM 406 H GLN A 26 -3.288 -24.400 -19.532 1.00 0.00 H ATOM 407 N GLN A 27 -3.076 -27.421 -19.043 1.00 19.34 N ATOM 408 CA GLN A 27 -2.494 -28.657 -18.605 1.00 14.77 C ATOM 409 C GLN A 27 -2.150 -28.795 -17.116 1.00 34.32 C ATOM 410 O GLN A 27 -2.374 -29.873 -16.544 1.00 20.92 O ATOM 411 CB GLN A 27 -1.257 -28.976 -19.472 1.00 24.06 C ATOM 412 CG GLN A 27 -1.733 -29.613 -20.788 1.00 79.84 C ATOM 413 CD GLN A 27 -0.929 -29.133 -21.975 1.00 80.00 C ATOM 414 OE1 GLN A 27 -1.318 -28.165 -22.681 1.00 80.00 O ATOM 415 NE2 GLN A 27 0.204 -29.818 -22.178 1.00 80.00 N ATOM 416 HA GLN A 27 -3.293 -29.386 -18.739 1.00 0.00 H ATOM 417 HB2 GLN A 27 -0.710 -28.057 -19.685 1.00 0.00 H ATOM 418 HB3 GLN A 27 -0.605 -29.671 -18.942 1.00 0.00 H ATOM 419 HG2 GLN A 27 -1.634 -30.696 -20.711 1.00 0.00 H ATOM 420 HG3 GLN A 27 -2.780 -29.355 -20.945 1.00 0.00 H ATOM 421 HE22 GLN A 27 0.455 -30.607 -21.548 1.00 0.00 H ATOM 422 HE21 GLN A 27 0.833 -29.561 -22.965 1.00 0.00 H ATOM 423 H GLN A 27 -2.493 -26.702 -19.518 1.00 0.00 H ATOM 424 N HIS A 28 -1.612 -27.738 -16.484 1.00 24.78 N ATOM 425 CA HIS A 28 -1.219 -27.818 -15.098 1.00 19.63 C ATOM 426 C HIS A 28 -1.829 -26.944 -14.034 1.00 19.83 C ATOM 427 O HIS A 28 -1.254 -26.857 -12.927 1.00 27.03 O ATOM 428 CB HIS A 28 0.256 -27.465 -15.174 1.00 20.61 C ATOM 429 CG HIS A 28 1.072 -28.600 -15.706 1.00 32.93 C ATOM 430 ND1 HIS A 28 1.387 -29.705 -14.909 1.00 35.13 N ATOM 431 CD2 HIS A 28 1.646 -28.792 -16.936 1.00 30.25 C ATOM 432 CE1 HIS A 28 2.129 -30.528 -15.648 1.00 32.16 C ATOM 433 NE2 HIS A 28 2.301 -30.011 -16.868 1.00 31.03 N ATOM 434 HA HIS A 28 -1.551 -28.798 -14.755 1.00 0.00 H ATOM 435 HB2 HIS A 28 0.380 -26.603 -15.830 1.00 0.00 H ATOM 436 HB3 HIS A 28 0.611 -27.213 -14.175 1.00 0.00 H ATOM 437 HD2 HIS A 28 1.597 -28.121 -17.794 1.00 0.00 H ATOM 438 HE1 HIS A 28 2.535 -31.481 -15.308 1.00 0.00 H ATOM 439 H HIS A 28 -1.477 -26.847 -17.003 1.00 0.00 H ATOM 440 N GLY A 29 -2.953 -26.316 -14.332 1.00 17.08 N ATOM 441 CA GLY A 29 -3.502 -25.468 -13.319 1.00 11.76 C ATOM 442 C GLY A 29 -3.780 -26.117 -11.986 1.00 18.57 C ATOM 443 O GLY A 29 -3.787 -25.491 -10.928 1.00 22.41 O ATOM 444 HA3 GLY A 29 -4.442 -25.065 -13.696 1.00 0.00 H ATOM 445 HA2 GLY A 29 -2.800 -24.652 -13.152 1.00 0.00 H ATOM 446 H GLY A 29 -3.415 -26.432 -15.256 1.00 0.00 H ATOM 447 N ASN A 30 -4.030 -27.413 -12.015 1.00 20.37 N ATOM 448 CA ASN A 30 -4.355 -28.061 -10.763 1.00 13.94 C ATOM 449 C ASN A 30 -3.196 -28.753 -10.131 1.00 15.20 C ATOM 450 O ASN A 30 -3.368 -29.361 -9.079 1.00 20.23 O ATOM 451 CB ASN A 30 -5.579 -28.984 -10.895 1.00 27.22 C ATOM 452 CG ASN A 30 -5.382 -29.762 -12.171 1.00 80.00 C ATOM 453 OD1 ASN A 30 -5.349 -29.179 -13.276 1.00 80.00 O ATOM 454 ND2 ASN A 30 -4.857 -30.964 -11.973 1.00 80.00 N ATOM 455 HA ASN A 30 -4.624 -27.258 -10.076 1.00 0.00 H ATOM 456 HB2 ASN A 30 -5.635 -29.662 -10.043 1.00 0.00 H ATOM 457 HB3 ASN A 30 -6.494 -28.394 -10.949 1.00 0.00 H ATOM 458 HD22 ASN A 30 -4.911 -31.407 -11.033 1.00 0.00 H ATOM 459 HD21 ASN A 30 -4.392 -31.464 -12.757 1.00 0.00 H ATOM 460 H ASN A 30 -3.995 -27.949 -12.906 1.00 0.00 H ATOM 461 N THR A 31 -2.072 -28.644 -10.790 1.00 14.45 N ATOM 462 CA THR A 31 -0.885 -29.263 -10.238 1.00 22.10 C ATOM 463 C THR A 31 -0.437 -28.500 -8.968 1.00 24.38 C ATOM 464 O THR A 31 -0.426 -27.266 -8.960 1.00 13.24 O ATOM 465 CB THR A 31 0.196 -29.189 -11.303 1.00 22.16 C ATOM 466 OG1 THR A 31 -0.174 -29.830 -12.523 1.00 25.58 O ATOM 467 CG2 THR A 31 1.479 -29.732 -10.744 1.00 17.47 C ATOM 468 HA THR A 31 -1.079 -30.299 -9.958 1.00 0.00 H ATOM 469 HB THR A 31 0.338 -28.141 -11.569 1.00 0.00 H ATOM 470 HG1 THR A 31 0.567 -29.749 -13.175 1.00 0.00 H ATOM 471 HG23 THR A 31 1.718 -29.213 -9.816 1.00 0.00 H ATOM 472 HG21 THR A 31 1.365 -30.798 -10.546 1.00 0.00 H ATOM 473 HG22 THR A 31 2.282 -29.578 -11.465 1.00 0.00 H ATOM 474 H THR A 31 -2.031 -28.125 -11.690 1.00 0.00 H ATOM 475 N ALA A 32 -0.071 -29.213 -7.906 1.00 22.62 N ATOM 476 CA ALA A 32 0.333 -28.576 -6.668 1.00 27.83 C ATOM 477 C ALA A 32 1.793 -28.254 -6.660 1.00 35.91 C ATOM 478 O ALA A 32 2.599 -29.124 -6.978 1.00 33.48 O ATOM 479 CB ALA A 32 0.008 -29.459 -5.474 1.00 29.47 C ATOM 480 HA ALA A 32 -0.227 -27.644 -6.595 1.00 0.00 H ATOM 481 HB1 ALA A 32 -1.066 -29.642 -5.441 1.00 0.00 H ATOM 482 HB2 ALA A 32 0.537 -30.407 -5.570 1.00 0.00 H ATOM 483 HB3 ALA A 32 0.321 -28.958 -4.558 1.00 0.00 H ATOM 484 H ALA A 32 -0.075 -30.251 -7.965 1.00 0.00 H ATOM 485 N VAL A 33 2.111 -27.012 -6.295 1.00 25.91 N ATOM 486 CA VAL A 33 3.489 -26.587 -6.264 1.00 20.83 C ATOM 487 C VAL A 33 4.035 -26.457 -4.856 1.00 17.70 C ATOM 488 O VAL A 33 5.198 -26.159 -4.686 1.00 22.35 O ATOM 489 CB VAL A 33 3.678 -25.318 -7.096 1.00 24.44 C ATOM 490 CG1 VAL A 33 3.130 -25.668 -8.468 1.00 28.14 C ATOM 491 CG2 VAL A 33 2.910 -24.116 -6.542 1.00 23.30 C ATOM 492 HA VAL A 33 4.087 -27.374 -6.724 1.00 0.00 H ATOM 493 HB VAL A 33 4.728 -25.025 -7.099 1.00 0.00 H ATOM 494 HG11 VAL A 33 3.691 -26.508 -8.878 1.00 0.00 H ATOM 495 HG12 VAL A 33 2.078 -25.940 -8.379 1.00 0.00 H ATOM 496 HG13 VAL A 33 3.229 -24.806 -9.128 1.00 0.00 H ATOM 497 HG21 VAL A 33 1.844 -24.344 -6.525 1.00 0.00 H ATOM 498 HG22 VAL A 33 3.254 -23.902 -5.530 1.00 0.00 H ATOM 499 HG23 VAL A 33 3.087 -23.249 -7.178 1.00 0.00 H ATOM 500 H VAL A 33 1.359 -26.344 -6.030 1.00 0.00 H ATOM 501 N GLY A 34 3.179 -26.685 -3.853 1.00 17.57 N ATOM 502 CA GLY A 34 3.606 -26.582 -2.468 1.00 13.79 C ATOM 503 C GLY A 34 2.475 -26.760 -1.482 1.00 17.39 C ATOM 504 O GLY A 34 1.327 -26.961 -1.822 1.00 20.62 O ATOM 505 HA3 GLY A 34 4.049 -25.598 -2.314 1.00 0.00 H ATOM 506 HA2 GLY A 34 4.356 -27.350 -2.278 1.00 0.00 H ATOM 507 H GLY A 34 2.194 -26.940 -4.068 1.00 0.00 H ATOM 508 N GLN A 35 2.836 -26.690 -0.209 1.00 22.90 N ATOM 509 CA GLN A 35 1.850 -26.828 0.843 1.00 27.53 C ATOM 510 C GLN A 35 1.943 -25.640 1.782 1.00 21.92 C ATOM 511 O GLN A 35 2.956 -24.944 1.812 1.00 17.77 O ATOM 512 CB GLN A 35 2.072 -28.128 1.609 1.00 28.77 C ATOM 513 CG GLN A 35 1.667 -29.256 0.645 1.00 80.00 C ATOM 514 CD GLN A 35 1.348 -30.467 1.464 1.00 80.00 C ATOM 515 OE1 GLN A 35 2.134 -30.744 2.389 1.00 80.00 O ATOM 516 NE2 GLN A 35 0.107 -30.962 1.340 1.00 80.00 N ATOM 517 HA GLN A 35 0.854 -26.857 0.400 1.00 0.00 H ATOM 518 HB2 GLN A 35 3.120 -28.228 1.892 1.00 0.00 H ATOM 519 HB3 GLN A 35 1.451 -28.152 2.505 1.00 0.00 H ATOM 520 HG2 GLN A 35 0.791 -28.956 0.070 1.00 0.00 H ATOM 521 HG3 GLN A 35 2.489 -29.475 -0.036 1.00 0.00 H ATOM 522 HE22 GLN A 35 -0.488 -30.679 0.535 1.00 0.00 H ATOM 523 HE21 GLN A 35 -0.260 -31.629 2.049 1.00 0.00 H ATOM 524 H GLN A 35 3.835 -26.535 0.037 1.00 0.00 H ATOM 525 N ILE A 36 0.894 -25.420 2.533 1.00 17.58 N ATOM 526 CA ILE A 36 0.874 -24.322 3.469 1.00 16.69 C ATOM 527 C ILE A 36 0.871 -24.881 4.886 1.00 18.61 C ATOM 528 O ILE A 36 0.047 -25.728 5.179 1.00 13.16 O ATOM 529 CB ILE A 36 -0.368 -23.386 3.260 1.00 19.14 C ATOM 530 CG1 ILE A 36 -0.426 -22.723 1.892 1.00 10.05 C ATOM 531 CG2 ILE A 36 -0.461 -22.249 4.278 1.00 20.82 C ATOM 532 CD1 ILE A 36 -1.822 -22.183 1.546 1.00 24.81 C ATOM 533 HA ILE A 36 1.764 -23.716 3.300 1.00 0.00 H ATOM 534 HB ILE A 36 -1.197 -24.084 3.380 1.00 0.00 H ATOM 535 HG12 ILE A 36 0.281 -21.894 1.877 1.00 0.00 H ATOM 536 HG13 ILE A 36 -0.140 -23.456 1.138 1.00 0.00 H ATOM 537 HD11 ILE A 36 -2.539 -23.004 1.547 1.00 0.00 H ATOM 538 HD12 ILE A 36 -2.117 -21.441 2.287 1.00 0.00 H ATOM 539 HD13 ILE A 36 -1.797 -21.722 0.558 1.00 0.00 H ATOM 540 HG21 ILE A 36 -0.535 -22.667 5.282 1.00 0.00 H ATOM 541 HG22 ILE A 36 0.431 -21.626 4.207 1.00 0.00 H ATOM 542 HG23 ILE A 36 -1.345 -21.646 4.068 1.00 0.00 H ATOM 543 H ILE A 36 0.065 -26.044 2.454 1.00 0.00 H ATOM 544 N THR A 37 1.749 -24.417 5.783 1.00 11.97 N ATOM 545 CA THR A 37 1.716 -24.933 7.139 1.00 11.83 C ATOM 546 C THR A 37 1.348 -23.809 8.089 1.00 14.53 C ATOM 547 O THR A 37 1.369 -22.633 7.758 1.00 15.51 O ATOM 548 CB THR A 37 3.064 -25.420 7.629 1.00 9.67 C ATOM 549 OG1 THR A 37 4.008 -24.373 7.515 1.00 17.24 O ATOM 550 CG2 THR A 37 3.528 -26.488 6.633 1.00 15.45 C ATOM 551 HA THR A 37 1.003 -25.757 7.123 1.00 0.00 H ATOM 552 HB THR A 37 2.986 -25.776 8.656 1.00 0.00 H ATOM 553 HG1 THR A 37 4.890 -24.689 7.835 1.00 0.00 H ATOM 554 HG23 THR A 37 2.842 -27.335 6.665 1.00 0.00 H ATOM 555 HG21 THR A 37 3.540 -26.065 5.628 1.00 0.00 H ATOM 556 HG22 THR A 37 4.531 -26.821 6.900 1.00 0.00 H ATOM 557 H THR A 37 2.447 -23.695 5.512 1.00 0.00 H ATOM 558 N VAL A 38 1.014 -24.184 9.307 1.00 11.63 N ATOM 559 CA VAL A 38 0.639 -23.246 10.342 1.00 13.76 C ATOM 560 C VAL A 38 1.744 -22.216 10.504 1.00 18.75 C ATOM 561 O VAL A 38 1.506 -21.009 10.619 1.00 11.79 O ATOM 562 CB VAL A 38 0.377 -24.055 11.631 1.00 14.51 C ATOM 563 CG1 VAL A 38 0.364 -23.153 12.873 1.00 15.03 C ATOM 564 CG2 VAL A 38 -0.880 -24.930 11.514 1.00 12.82 C ATOM 565 HA VAL A 38 -0.268 -22.697 10.091 1.00 0.00 H ATOM 566 HB VAL A 38 1.212 -24.744 11.760 1.00 0.00 H ATOM 567 HG11 VAL A 38 1.329 -22.655 12.969 1.00 0.00 H ATOM 568 HG12 VAL A 38 -0.423 -22.406 12.770 1.00 0.00 H ATOM 569 HG13 VAL A 38 0.177 -23.760 13.759 1.00 0.00 H ATOM 570 HG21 VAL A 38 -1.746 -24.296 11.327 1.00 0.00 H ATOM 571 HG22 VAL A 38 -0.757 -25.632 10.689 1.00 0.00 H ATOM 572 HG23 VAL A 38 -1.025 -25.481 12.443 1.00 0.00 H ATOM 573 H VAL A 38 1.020 -25.199 9.534 1.00 0.00 H ATOM 574 N ASP A 39 2.973 -22.710 10.531 1.00 12.92 N ATOM 575 CA ASP A 39 4.091 -21.798 10.692 1.00 12.14 C ATOM 576 C ASP A 39 4.271 -20.812 9.547 1.00 12.84 C ATOM 577 O ASP A 39 4.810 -19.713 9.780 1.00 15.68 O ATOM 578 CB ASP A 39 5.417 -22.512 10.952 1.00 10.29 C ATOM 579 CG ASP A 39 5.620 -22.799 12.441 1.00 16.35 C ATOM 580 OD1 ASP A 39 5.002 -22.305 13.383 1.00 31.11 O ATOM 581 OD2 ASP A 39 6.535 -23.673 12.611 1.00 30.01 O ATOM 582 HA ASP A 39 3.815 -21.226 11.578 1.00 0.00 H ATOM 583 HB2 ASP A 39 5.424 -23.455 10.406 1.00 0.00 H ATOM 584 HB3 ASP A 39 6.233 -21.882 10.598 1.00 0.00 H ATOM 585 H ASP A 39 3.134 -23.733 10.438 1.00 0.00 H ATOM 586 N MET A 40 3.869 -21.200 8.339 1.00 13.33 N ATOM 587 CA MET A 40 4.017 -20.265 7.261 1.00 13.14 C ATOM 588 C MET A 40 3.010 -19.126 7.385 1.00 9.70 C ATOM 589 O MET A 40 3.306 -18.007 6.995 1.00 11.28 O ATOM 590 CB MET A 40 3.773 -20.857 5.878 1.00 12.33 C ATOM 591 CG MET A 40 4.856 -21.810 5.502 1.00 27.06 C ATOM 592 SD MET A 40 4.277 -22.721 4.055 1.00 28.22 S ATOM 593 CE MET A 40 5.362 -21.965 2.830 1.00 38.97 C ATOM 594 HA MET A 40 5.053 -19.936 7.345 1.00 0.00 H ATOM 595 HB2 MET A 40 2.819 -21.385 5.880 1.00 0.00 H ATOM 596 HB3 MET A 40 3.739 -20.050 5.146 1.00 0.00 H ATOM 597 HG2 MET A 40 5.052 -22.498 6.324 1.00 0.00 H ATOM 598 HG3 MET A 40 5.768 -21.264 5.261 1.00 0.00 H ATOM 599 HE1 MET A 40 5.180 -20.891 2.799 1.00 0.00 H ATOM 600 HE2 MET A 40 6.401 -22.151 3.103 1.00 0.00 H ATOM 601 HE3 MET A 40 5.159 -22.398 1.850 1.00 0.00 H ATOM 602 H MET A 40 3.463 -22.145 8.183 1.00 0.00 H ATOM 603 N SER A 41 1.817 -19.407 7.931 1.00 6.37 N ATOM 604 CA SER A 41 0.737 -18.439 8.138 1.00 8.54 C ATOM 605 C SER A 41 1.085 -17.428 9.229 1.00 18.49 C ATOM 606 O SER A 41 0.837 -16.253 9.141 1.00 8.70 O ATOM 607 CB SER A 41 -0.632 -19.121 8.347 1.00 13.88 C ATOM 608 OG SER A 41 -0.947 -19.742 7.109 1.00 45.70 O ATOM 609 HA SER A 41 0.635 -17.866 7.217 1.00 0.00 H ATOM 610 HB2 SER A 41 -1.390 -18.381 8.605 1.00 0.00 H ATOM 611 HB3 SER A 41 -0.568 -19.866 9.140 1.00 0.00 H ATOM 612 HG SER A 41 -1.822 -20.199 7.184 1.00 0.00 H ATOM 613 H SER A 41 1.646 -20.388 8.230 1.00 0.00 H ATOM 614 N TYR A 42 1.690 -17.895 10.270 1.00 7.76 N ATOM 615 CA TYR A 42 2.109 -17.094 11.403 1.00 9.56 C ATOM 616 C TYR A 42 3.369 -16.322 11.092 1.00 13.55 C ATOM 617 O TYR A 42 3.596 -15.228 11.617 1.00 16.04 O ATOM 618 CB TYR A 42 2.324 -17.968 12.630 1.00 11.05 C ATOM 619 CG TYR A 42 1.072 -18.213 13.406 1.00 7.03 C ATOM 620 CD1 TYR A 42 0.483 -17.192 14.151 1.00 12.89 C ATOM 621 CD2 TYR A 42 0.451 -19.455 13.395 1.00 9.14 C ATOM 622 CE1 TYR A 42 -0.686 -17.403 14.875 1.00 6.16 C ATOM 623 CE2 TYR A 42 -0.715 -19.697 14.117 1.00 11.47 C ATOM 624 CZ TYR A 42 -1.284 -18.664 14.860 1.00 7.63 C ATOM 625 OH TYR A 42 -2.420 -18.920 15.561 1.00 14.66 O ATOM 626 HA TYR A 42 1.313 -16.380 11.613 1.00 0.00 H ATOM 627 HB3 TYR A 42 3.046 -17.477 13.283 1.00 0.00 H ATOM 628 HB2 TYR A 42 2.724 -18.929 12.305 1.00 0.00 H ATOM 629 HD2 TYR A 42 0.888 -20.262 12.806 1.00 0.00 H ATOM 630 HE2 TYR A 42 -1.178 -20.684 14.101 1.00 0.00 H ATOM 631 HE1 TYR A 42 -1.131 -16.590 15.449 1.00 0.00 H ATOM 632 HD1 TYR A 42 0.949 -16.207 14.166 1.00 0.00 H ATOM 633 HH TYR A 42 -2.705 -18.099 16.036 1.00 0.00 H ATOM 634 H TYR A 42 1.890 -18.915 10.297 1.00 0.00 H ATOM 635 N GLY A 43 4.150 -16.928 10.217 1.00 5.94 N ATOM 636 CA GLY A 43 5.457 -16.413 9.726 1.00 8.03 C ATOM 637 C GLY A 43 5.526 -15.446 8.518 1.00 4.29 C ATOM 638 O GLY A 43 6.607 -15.400 7.869 1.00 9.77 O ATOM 639 HA3 GLY A 43 6.055 -17.285 9.461 1.00 0.00 H ATOM 640 HA2 GLY A 43 5.923 -15.896 10.565 1.00 0.00 H ATOM 641 H GLY A 43 3.825 -17.841 9.840 1.00 0.00 H ATOM 642 N GLY A 44 4.458 -14.699 8.237 1.00 7.59 N ATOM 643 CA GLY A 44 4.507 -13.751 7.116 1.00 8.18 C ATOM 644 C GLY A 44 4.727 -14.406 5.750 1.00 10.61 C ATOM 645 O GLY A 44 5.386 -13.883 4.861 1.00 8.14 O ATOM 646 HA3 GLY A 44 5.323 -13.051 7.295 1.00 0.00 H ATOM 647 HA2 GLY A 44 3.563 -13.207 7.087 1.00 0.00 H ATOM 648 H GLY A 44 3.594 -14.787 8.809 1.00 0.00 H ATOM 649 N MET A 45 4.104 -15.575 5.600 1.00 6.93 N ATOM 650 CA MET A 45 4.167 -16.377 4.408 1.00 4.46 C ATOM 651 C MET A 45 5.580 -16.811 4.034 1.00 8.71 C ATOM 652 O MET A 45 5.891 -17.043 2.857 1.00 6.52 O ATOM 653 CB MET A 45 3.639 -15.526 3.225 1.00 7.72 C ATOM 654 CG MET A 45 2.157 -15.195 3.360 1.00 6.69 C ATOM 655 SD MET A 45 1.631 -14.116 1.979 1.00 14.24 S ATOM 656 CE MET A 45 -0.033 -13.740 2.573 1.00 7.65 C ATOM 657 HA MET A 45 3.577 -17.272 4.604 1.00 0.00 H ATOM 658 HB2 MET A 45 4.203 -14.594 3.185 1.00 0.00 H ATOM 659 HB3 MET A 45 3.791 -16.081 2.299 1.00 0.00 H ATOM 660 HG2 MET A 45 1.986 -14.681 4.306 1.00 0.00 H ATOM 661 HG3 MET A 45 1.577 -16.118 3.339 1.00 0.00 H ATOM 662 HE1 MET A 45 -0.600 -14.666 2.673 1.00 0.00 H ATOM 663 HE2 MET A 45 0.032 -13.246 3.542 1.00 0.00 H ATOM 664 HE3 MET A 45 -0.532 -13.083 1.861 1.00 0.00 H ATOM 665 H MET A 45 3.536 -15.930 6.396 1.00 0.00 H ATOM 666 N ARG A 46 6.467 -16.888 5.013 1.00 7.47 N ATOM 667 CA ARG A 46 7.831 -17.253 4.623 1.00 5.86 C ATOM 668 C ARG A 46 7.891 -18.601 3.974 1.00 14.23 C ATOM 669 O ARG A 46 7.392 -19.571 4.521 1.00 16.15 O ATOM 670 CB ARG A 46 8.818 -17.211 5.782 1.00 10.17 C ATOM 671 CG ARG A 46 10.263 -16.958 5.334 1.00 3.25 C ATOM 672 CD ARG A 46 10.528 -15.528 4.851 1.00 6.94 C ATOM 673 NE ARG A 46 10.636 -14.591 5.976 1.00 5.29 N ATOM 674 CZ ARG A 46 9.656 -13.749 6.287 1.00 5.46 C ATOM 675 NH1 ARG A 46 8.595 -13.829 5.531 1.00 6.46 N ATOM 676 NH2 ARG A 46 9.652 -12.883 7.299 1.00 7.83 N ATOM 677 HA ARG A 46 8.127 -16.493 3.900 1.00 0.00 H ATOM 678 HB2 ARG A 46 8.521 -16.413 6.462 1.00 0.00 H ATOM 679 HB3 ARG A 46 8.779 -18.166 6.306 1.00 0.00 H ATOM 680 HG2 ARG A 46 10.924 -17.163 6.177 1.00 0.00 H ATOM 681 HG3 ARG A 46 10.494 -17.643 4.518 1.00 0.00 H ATOM 682 HD2 ARG A 46 9.707 -15.214 4.206 1.00 0.00 H ATOM 683 HD3 ARG A 46 11.460 -15.512 4.286 1.00 0.00 H ATOM 684 HE ARG A 46 11.505 -14.586 6.547 1.00 0.00 H ATOM 685 HH12 ARG A 46 7.782 -13.205 5.708 1.00 0.00 H ATOM 686 HH11 ARG A 46 8.562 -14.517 4.752 1.00 0.00 H ATOM 687 HH22 ARG A 46 8.828 -12.267 7.453 1.00 0.00 H ATOM 688 HH21 ARG A 46 10.473 -12.823 7.935 1.00 0.00 H ATOM 689 H ARG A 46 6.210 -16.700 6.003 1.00 0.00 H ATOM 690 N GLY A 47 8.480 -18.637 2.793 1.00 11.77 N ATOM 691 CA GLY A 47 8.579 -19.906 2.091 1.00 18.77 C ATOM 692 C GLY A 47 7.343 -20.217 1.244 1.00 24.58 C ATOM 693 O GLY A 47 7.348 -21.207 0.553 1.00 19.54 O ATOM 694 HA3 GLY A 47 8.706 -20.701 2.826 1.00 0.00 H ATOM 695 HA2 GLY A 47 9.450 -19.875 1.437 1.00 0.00 H ATOM 696 H GLY A 47 8.868 -17.769 2.371 1.00 0.00 H ATOM 697 N MET A 48 6.284 -19.403 1.252 1.00 14.86 N ATOM 698 CA MET A 48 5.167 -19.777 0.400 1.00 11.00 C ATOM 699 C MET A 48 5.301 -19.232 -1.017 1.00 7.96 C ATOM 700 O MET A 48 5.570 -18.042 -1.220 1.00 10.64 O ATOM 701 CB MET A 48 3.824 -19.257 0.932 1.00 13.69 C ATOM 702 CG MET A 48 3.470 -19.699 2.337 1.00 35.23 C ATOM 703 SD MET A 48 1.763 -19.284 2.823 1.00 37.16 S ATOM 704 CE MET A 48 1.133 -18.610 1.287 1.00 17.22 C ATOM 705 HA MET A 48 5.188 -20.867 0.397 1.00 0.00 H ATOM 706 HB2 MET A 48 3.855 -18.168 0.919 1.00 0.00 H ATOM 707 HB3 MET A 48 3.038 -19.605 0.261 1.00 0.00 H ATOM 708 HG2 MET A 48 4.154 -19.215 3.034 1.00 0.00 H ATOM 709 HG3 MET A 48 3.594 -20.780 2.400 1.00 0.00 H ATOM 710 HE1 MET A 48 1.729 -17.744 1.000 1.00 0.00 H ATOM 711 HE2 MET A 48 1.194 -19.369 0.507 1.00 0.00 H ATOM 712 HE3 MET A 48 0.094 -18.309 1.423 1.00 0.00 H ATOM 713 H MET A 48 6.260 -18.544 1.838 1.00 0.00 H ATOM 714 N LYS A 49 5.095 -20.094 -1.990 1.00 9.53 N ATOM 715 CA LYS A 49 5.162 -19.657 -3.383 1.00 10.72 C ATOM 716 C LYS A 49 3.821 -19.042 -3.594 1.00 15.35 C ATOM 717 O LYS A 49 2.881 -19.794 -3.754 1.00 21.33 O ATOM 718 CB LYS A 49 5.375 -20.767 -4.366 1.00 13.45 C ATOM 719 CG LYS A 49 6.865 -21.060 -4.354 1.00 21.00 C ATOM 720 CD LYS A 49 7.147 -22.384 -5.024 1.00 36.54 C ATOM 721 CE LYS A 49 8.405 -23.038 -4.482 1.00 54.05 C ATOM 722 NZ LYS A 49 8.090 -23.991 -3.406 1.00 80.00 N ATOM 723 HA LYS A 49 6.011 -18.994 -3.547 1.00 0.00 H ATOM 724 HB2 LYS A 49 4.813 -21.651 -4.066 1.00 0.00 H ATOM 725 HB3 LYS A 49 5.058 -20.457 -5.362 1.00 0.00 H ATOM 726 HG2 LYS A 49 7.391 -20.268 -4.887 1.00 0.00 H ATOM 727 HG3 LYS A 49 7.216 -21.097 -3.323 1.00 0.00 H ATOM 728 HD2 LYS A 49 6.302 -23.051 -4.855 1.00 0.00 H ATOM 729 HD3 LYS A 49 7.269 -22.218 -6.094 1.00 0.00 H ATOM 730 HE2 LYS A 49 9.067 -22.266 -4.090 1.00 0.00 H ATOM 731 HE3 LYS A 49 8.907 -23.569 -5.291 1.00 0.00 H ATOM 732 HZ1 LYS A 49 7.615 -23.489 -2.628 1.00 0.00 H ATOM 733 HZ2 LYS A 49 7.463 -24.734 -3.775 1.00 0.00 H ATOM 734 HZ3 LYS A 49 8.970 -24.421 -3.057 1.00 0.00 H ATOM 735 H LYS A 49 4.884 -21.088 -1.767 1.00 0.00 H ATOM 736 N GLY A 50 3.705 -17.700 -3.541 1.00 11.23 N ATOM 737 CA GLY A 50 2.373 -17.160 -3.698 1.00 12.75 C ATOM 738 C GLY A 50 2.073 -16.273 -4.870 1.00 13.16 C ATOM 739 O GLY A 50 0.898 -15.951 -5.009 1.00 11.14 O ATOM 740 HA3 GLY A 50 2.155 -16.584 -2.799 1.00 0.00 H ATOM 741 HA2 GLY A 50 1.691 -18.008 -3.758 1.00 0.00 H ATOM 742 H GLY A 50 4.531 -17.085 -3.395 1.00 0.00 H ATOM 743 N LEU A 51 3.039 -15.876 -5.671 1.00 10.69 N ATOM 744 CA LEU A 51 2.624 -15.011 -6.761 1.00 6.48 C ATOM 745 C LEU A 51 3.410 -15.212 -8.027 1.00 6.97 C ATOM 746 O LEU A 51 4.493 -15.769 -7.977 1.00 13.00 O ATOM 747 CB LEU A 51 3.100 -13.526 -6.567 1.00 23.73 C ATOM 748 CG LEU A 51 3.087 -12.941 -5.183 1.00 26.57 C ATOM 749 CD1 LEU A 51 4.051 -11.775 -5.115 1.00 24.61 C ATOM 750 CD2 LEU A 51 1.701 -12.322 -5.111 1.00 26.81 C ATOM 751 HA LEU A 51 1.554 -15.219 -6.792 1.00 0.00 H ATOM 752 HB2 LEU A 51 4.126 -13.467 -6.931 1.00 0.00 H ATOM 753 HB3 LEU A 51 2.459 -12.899 -7.187 1.00 0.00 H ATOM 754 HG LEU A 51 3.335 -13.672 -4.414 1.00 0.00 H ATOM 755 HD21 LEU A 51 1.599 -11.570 -5.893 1.00 0.00 H ATOM 756 HD22 LEU A 51 0.950 -13.099 -5.253 1.00 0.00 H ATOM 757 HD23 LEU A 51 1.563 -11.855 -4.136 1.00 0.00 H ATOM 758 HD11 LEU A 51 5.057 -12.122 -5.353 1.00 0.00 H ATOM 759 HD12 LEU A 51 3.749 -11.013 -5.834 1.00 0.00 H ATOM 760 HD13 LEU A 51 4.039 -11.353 -4.110 1.00 0.00 H ATOM 761 H LEU A 51 4.029 -16.162 -5.533 1.00 0.00 H ATOM 762 N ILE A 52 2.824 -14.719 -9.132 1.00 6.14 N ATOM 763 CA ILE A 52 3.496 -14.798 -10.425 1.00 3.60 C ATOM 764 C ILE A 52 4.019 -13.395 -10.697 1.00 14.62 C ATOM 765 O ILE A 52 3.195 -12.491 -10.618 1.00 7.15 O ATOM 766 CB ILE A 52 2.626 -15.294 -11.566 1.00 8.81 C ATOM 767 CG1 ILE A 52 2.393 -16.815 -11.406 1.00 12.68 C ATOM 768 CG2 ILE A 52 3.449 -15.065 -12.831 1.00 5.95 C ATOM 769 CD1 ILE A 52 3.621 -17.691 -11.735 1.00 17.49 C ATOM 770 HA ILE A 52 4.289 -15.544 -10.374 1.00 0.00 H ATOM 771 HB ILE A 52 1.662 -14.786 -11.592 1.00 0.00 H ATOM 772 HG12 ILE A 52 2.104 -17.008 -10.373 1.00 0.00 H ATOM 773 HG13 ILE A 52 1.579 -17.106 -12.070 1.00 0.00 H ATOM 774 HD11 ILE A 52 3.919 -17.523 -12.770 1.00 0.00 H ATOM 775 HD12 ILE A 52 4.444 -17.425 -11.071 1.00 0.00 H ATOM 776 HD13 ILE A 52 3.365 -18.741 -11.595 1.00 0.00 H ATOM 777 HG21 ILE A 52 3.672 -14.003 -12.931 1.00 0.00 H ATOM 778 HG22 ILE A 52 4.380 -15.628 -12.764 1.00 0.00 H ATOM 779 HG23 ILE A 52 2.881 -15.401 -13.698 1.00 0.00 H ATOM 780 H ILE A 52 1.885 -14.278 -9.065 1.00 0.00 H ATOM 781 N TYR A 53 5.328 -13.229 -10.994 1.00 6.68 N ATOM 782 CA TYR A 53 5.951 -11.911 -11.228 1.00 3.00 C ATOM 783 C TYR A 53 6.985 -12.249 -12.271 1.00 6.50 C ATOM 784 O TYR A 53 7.858 -13.047 -12.043 1.00 10.24 O ATOM 785 CB TYR A 53 6.479 -11.454 -9.798 1.00 3.00 C ATOM 786 CG TYR A 53 6.931 -10.024 -9.743 1.00 4.74 C ATOM 787 CD1 TYR A 53 8.247 -9.685 -10.077 1.00 8.96 C ATOM 788 CD2 TYR A 53 6.062 -8.999 -9.356 1.00 9.72 C ATOM 789 CE1 TYR A 53 8.664 -8.348 -10.031 1.00 7.12 C ATOM 790 CE2 TYR A 53 6.451 -7.656 -9.333 1.00 6.41 C ATOM 791 CZ TYR A 53 7.765 -7.331 -9.667 1.00 7.09 C ATOM 792 OH TYR A 53 8.152 -6.000 -9.587 1.00 3.28 O ATOM 793 HA TYR A 53 5.352 -11.077 -11.595 1.00 0.00 H ATOM 794 HB3 TYR A 53 7.320 -12.091 -9.523 1.00 0.00 H ATOM 795 HB2 TYR A 53 5.673 -11.587 -9.076 1.00 0.00 H ATOM 796 HD2 TYR A 53 5.045 -9.256 -9.062 1.00 0.00 H ATOM 797 HE2 TYR A 53 5.740 -6.877 -9.059 1.00 0.00 H ATOM 798 HE1 TYR A 53 9.695 -8.095 -10.280 1.00 0.00 H ATOM 799 HD1 TYR A 53 8.950 -10.463 -10.374 1.00 0.00 H ATOM 800 HH TYR A 53 9.103 -5.918 -9.851 1.00 0.00 H ATOM 801 H TYR A 53 5.928 -14.076 -11.061 1.00 0.00 H ATOM 802 N GLU A 54 6.845 -11.669 -13.444 1.00 10.02 N ATOM 803 CA GLU A 54 7.709 -11.989 -14.535 1.00 7.23 C ATOM 804 C GLU A 54 9.056 -11.363 -14.730 1.00 12.33 C ATOM 805 O GLU A 54 9.929 -11.985 -15.340 1.00 8.74 O ATOM 806 CB GLU A 54 6.874 -11.783 -15.865 1.00 6.08 C ATOM 807 CG GLU A 54 5.471 -12.458 -15.773 1.00 5.70 C ATOM 808 CD GLU A 54 5.423 -13.925 -16.161 1.00 10.36 C ATOM 809 OE1 GLU A 54 6.440 -14.622 -15.759 1.00 15.89 O ATOM 810 OE2 GLU A 54 4.363 -14.434 -16.492 1.00 13.69 O ATOM 811 HA GLU A 54 8.014 -13.000 -14.265 1.00 0.00 H ATOM 812 HB2 GLU A 54 6.742 -10.715 -16.038 1.00 0.00 H ATOM 813 HB3 GLU A 54 7.423 -12.220 -16.699 1.00 0.00 H ATOM 814 HG2 GLU A 54 5.124 -12.371 -14.743 1.00 0.00 H ATOM 815 HG3 GLU A 54 4.793 -11.914 -16.431 1.00 0.00 H ATOM 816 H GLU A 54 6.092 -10.965 -13.579 1.00 0.00 H ATOM 817 N THR A 55 9.171 -10.122 -14.271 1.00 6.66 N ATOM 818 CA THR A 55 10.384 -9.401 -14.494 1.00 8.20 C ATOM 819 C THR A 55 11.702 -9.834 -13.856 1.00 8.51 C ATOM 820 O THR A 55 12.766 -9.597 -14.414 1.00 8.74 O ATOM 821 CB THR A 55 10.068 -7.935 -14.243 1.00 3.16 C ATOM 822 OG1 THR A 55 9.505 -7.924 -12.918 1.00 6.98 O ATOM 823 CG2 THR A 55 9.041 -7.453 -15.234 1.00 6.72 C ATOM 824 HA THR A 55 10.653 -9.646 -15.521 1.00 0.00 H ATOM 825 HB THR A 55 10.942 -7.292 -14.341 1.00 0.00 H ATOM 826 HG1 THR A 55 10.169 -8.279 -12.275 1.00 0.00 H ATOM 827 HG23 THR A 55 9.471 -7.463 -16.235 1.00 0.00 H ATOM 828 HG21 THR A 55 8.172 -8.111 -15.204 1.00 0.00 H ATOM 829 HG22 THR A 55 8.739 -6.438 -14.977 1.00 0.00 H ATOM 830 H THR A 55 8.385 -9.679 -13.754 1.00 0.00 H ATOM 831 N SER A 56 11.647 -10.439 -12.687 1.00 8.45 N ATOM 832 CA SER A 56 12.892 -10.847 -12.042 1.00 7.48 C ATOM 833 C SER A 56 12.517 -11.968 -11.081 1.00 5.13 C ATOM 834 O SER A 56 11.374 -12.162 -10.624 1.00 7.76 O ATOM 835 CB SER A 56 13.596 -9.708 -11.318 1.00 8.34 C ATOM 836 OG SER A 56 12.754 -9.065 -10.346 1.00 10.27 O ATOM 837 HA SER A 56 13.610 -11.176 -12.793 1.00 0.00 H ATOM 838 HB2 SER A 56 13.909 -8.967 -12.054 1.00 0.00 H ATOM 839 HB3 SER A 56 14.474 -10.107 -10.810 1.00 0.00 H ATOM 840 HG SER A 56 11.956 -8.691 -10.798 1.00 0.00 H ATOM 841 H SER A 56 10.731 -10.623 -12.230 1.00 0.00 H ATOM 842 N VAL A 57 13.515 -12.751 -10.820 1.00 5.75 N ATOM 843 CA VAL A 57 13.359 -13.916 -9.950 1.00 8.11 C ATOM 844 C VAL A 57 14.587 -14.022 -9.064 1.00 9.51 C ATOM 845 O VAL A 57 15.732 -13.907 -9.486 1.00 6.81 O ATOM 846 CB VAL A 57 13.274 -15.216 -10.771 1.00 12.32 C ATOM 847 CG1 VAL A 57 12.958 -16.355 -9.801 1.00 10.56 C ATOM 848 CG2 VAL A 57 12.076 -15.161 -11.707 1.00 11.47 C ATOM 849 HA VAL A 57 12.444 -13.791 -9.371 1.00 0.00 H ATOM 850 HB VAL A 57 14.206 -15.351 -11.319 1.00 0.00 H ATOM 851 HG11 VAL A 57 13.750 -16.426 -9.056 1.00 0.00 H ATOM 852 HG12 VAL A 57 12.008 -16.155 -9.305 1.00 0.00 H ATOM 853 HG13 VAL A 57 12.891 -17.293 -10.353 1.00 0.00 H ATOM 854 HG21 VAL A 57 11.164 -15.045 -11.121 1.00 0.00 H ATOM 855 HG22 VAL A 57 12.184 -14.314 -12.384 1.00 0.00 H ATOM 856 HG23 VAL A 57 12.024 -16.085 -12.283 1.00 0.00 H ATOM 857 H VAL A 57 14.446 -12.547 -11.237 1.00 0.00 H ATOM 858 N LEU A 58 14.370 -14.199 -7.771 1.00 8.19 N ATOM 859 CA LEU A 58 15.527 -14.276 -6.885 1.00 3.00 C ATOM 860 C LEU A 58 15.819 -15.712 -6.456 1.00 4.90 C ATOM 861 O LEU A 58 14.925 -16.478 -6.058 1.00 12.51 O ATOM 862 CB LEU A 58 15.136 -13.445 -5.627 1.00 6.06 C ATOM 863 CG LEU A 58 16.120 -13.325 -4.462 1.00 13.38 C ATOM 864 CD1 LEU A 58 17.416 -12.621 -4.876 1.00 13.51 C ATOM 865 CD2 LEU A 58 15.428 -12.601 -3.315 1.00 10.31 C ATOM 866 HA LEU A 58 16.420 -13.905 -7.389 1.00 0.00 H ATOM 867 HB2 LEU A 58 14.926 -12.432 -5.970 1.00 0.00 H ATOM 868 HB3 LEU A 58 14.224 -13.888 -5.226 1.00 0.00 H ATOM 869 HG LEU A 58 16.413 -14.323 -4.137 1.00 0.00 H ATOM 870 HD21 LEU A 58 15.121 -11.609 -3.646 1.00 0.00 H ATOM 871 HD22 LEU A 58 14.551 -13.170 -3.004 1.00 0.00 H ATOM 872 HD23 LEU A 58 16.118 -12.508 -2.477 1.00 0.00 H ATOM 873 HD11 LEU A 58 17.898 -13.188 -5.672 1.00 0.00 H ATOM 874 HD12 LEU A 58 17.185 -11.617 -5.232 1.00 0.00 H ATOM 875 HD13 LEU A 58 18.084 -12.558 -4.017 1.00 0.00 H ATOM 876 H LEU A 58 13.403 -14.281 -7.397 1.00 0.00 H ATOM 877 N ASP A 59 17.086 -16.073 -6.541 1.00 10.85 N ATOM 878 CA ASP A 59 17.560 -17.357 -6.126 1.00 13.37 C ATOM 879 C ASP A 59 18.184 -17.128 -4.704 1.00 10.28 C ATOM 880 O ASP A 59 18.978 -16.212 -4.488 1.00 7.51 O ATOM 881 CB ASP A 59 18.595 -17.807 -7.170 1.00 12.22 C ATOM 882 CG ASP A 59 19.132 -19.145 -6.720 1.00 27.66 C ATOM 883 OD1 ASP A 59 18.223 -20.081 -6.760 1.00 37.87 O ATOM 884 OD2 ASP A 59 20.109 -19.248 -6.020 1.00 17.08 O ATOM 885 HA ASP A 59 16.797 -18.132 -6.061 1.00 0.00 H ATOM 886 HB2 ASP A 59 18.122 -17.904 -8.147 1.00 0.00 H ATOM 887 HB3 ASP A 59 19.405 -17.080 -7.230 1.00 0.00 H ATOM 888 H ASP A 59 17.771 -15.392 -6.927 1.00 0.00 H ATOM 889 N PRO A 60 17.820 -17.929 -3.708 1.00 9.60 N ATOM 890 CA PRO A 60 18.340 -17.743 -2.379 1.00 9.00 C ATOM 891 C PRO A 60 19.838 -17.783 -2.209 1.00 11.06 C ATOM 892 O PRO A 60 20.390 -17.205 -1.269 1.00 15.89 O ATOM 893 CB PRO A 60 17.785 -18.940 -1.592 1.00 15.72 C ATOM 894 CG PRO A 60 16.600 -19.461 -2.360 1.00 16.97 C ATOM 895 CD PRO A 60 16.966 -19.144 -3.798 1.00 14.50 C ATOM 896 HA PRO A 60 18.050 -16.742 -2.059 1.00 0.00 H ATOM 897 HD3 PRO A 60 17.518 -19.970 -4.246 1.00 0.00 H ATOM 898 HD2 PRO A 60 16.072 -18.943 -4.388 1.00 0.00 H ATOM 899 HG3 PRO A 60 15.684 -18.948 -2.065 1.00 0.00 H ATOM 900 HG2 PRO A 60 16.477 -20.534 -2.213 1.00 0.00 H ATOM 901 HB2 PRO A 60 18.545 -19.716 -1.505 1.00 0.00 H ATOM 902 HB3 PRO A 60 17.476 -18.623 -0.596 1.00 0.00 H ATOM 903 N ASP A 61 20.491 -18.501 -3.122 1.00 8.53 N ATOM 904 CA ASP A 61 21.944 -18.634 -3.073 1.00 14.69 C ATOM 905 C ASP A 61 22.672 -17.730 -4.040 1.00 17.65 C ATOM 906 O ASP A 61 23.721 -17.170 -3.681 1.00 19.58 O ATOM 907 CB ASP A 61 22.458 -20.044 -3.404 1.00 12.59 C ATOM 908 CG ASP A 61 21.860 -21.134 -2.546 1.00 13.27 C ATOM 909 OD1 ASP A 61 22.137 -20.937 -1.242 1.00 14.81 O ATOM 910 OD2 ASP A 61 21.182 -22.057 -3.014 1.00 41.92 O ATOM 911 HA ASP A 61 22.153 -18.368 -2.037 1.00 0.00 H ATOM 912 HB2 ASP A 61 22.222 -20.259 -4.446 1.00 0.00 H ATOM 913 HB3 ASP A 61 23.539 -20.055 -3.268 1.00 0.00 H ATOM 914 H ASP A 61 19.958 -18.973 -3.880 1.00 0.00 H ATOM 915 N GLU A 62 22.122 -17.623 -5.259 1.00 16.72 N ATOM 916 CA GLU A 62 22.755 -16.820 -6.289 1.00 16.67 C ATOM 917 C GLU A 62 22.307 -15.388 -6.373 1.00 24.44 C ATOM 918 O GLU A 62 22.990 -14.591 -7.019 1.00 19.29 O ATOM 919 CB GLU A 62 22.663 -17.521 -7.655 1.00 20.72 C ATOM 920 CG GLU A 62 24.025 -18.196 -7.882 1.00 75.39 C ATOM 921 CD GLU A 62 23.980 -19.349 -8.825 1.00 80.00 C ATOM 922 OE1 GLU A 62 23.018 -20.198 -8.539 1.00 80.00 O ATOM 923 OE2 GLU A 62 24.730 -19.428 -9.787 1.00 80.00 O ATOM 924 HA GLU A 62 23.798 -16.746 -5.981 1.00 0.00 H ATOM 925 HB2 GLU A 62 21.868 -18.267 -7.645 1.00 0.00 H ATOM 926 HB3 GLU A 62 22.466 -16.793 -8.442 1.00 0.00 H ATOM 927 HG2 GLU A 62 24.714 -17.452 -8.282 1.00 0.00 H ATOM 928 HG3 GLU A 62 24.395 -18.553 -6.921 1.00 0.00 H ATOM 929 H GLU A 62 21.233 -18.121 -5.468 1.00 0.00 H ATOM 930 N GLY A 63 21.184 -15.051 -5.736 1.00 14.34 N ATOM 931 CA GLY A 63 20.796 -13.657 -5.851 1.00 8.67 C ATOM 932 C GLY A 63 19.848 -13.432 -7.020 1.00 14.96 C ATOM 933 O GLY A 63 19.331 -14.346 -7.652 1.00 7.39 O ATOM 934 HA3 GLY A 63 21.690 -13.052 -5.999 1.00 0.00 H ATOM 935 HA2 GLY A 63 20.300 -13.351 -4.930 1.00 0.00 H ATOM 936 H GLY A 63 20.625 -15.740 -5.194 1.00 0.00 H ATOM 937 N ILE A 64 19.633 -12.171 -7.307 1.00 4.68 N ATOM 938 CA ILE A 64 18.696 -11.801 -8.362 1.00 4.93 C ATOM 939 C ILE A 64 19.042 -11.935 -9.821 1.00 10.01 C ATOM 940 O ILE A 64 20.156 -11.678 -10.208 1.00 9.75 O ATOM 941 CB ILE A 64 18.327 -10.317 -8.068 1.00 10.30 C ATOM 942 CG1 ILE A 64 17.050 -9.925 -8.848 1.00 11.17 C ATOM 943 CG2 ILE A 64 19.413 -9.365 -8.609 1.00 9.07 C ATOM 944 CD1 ILE A 64 15.719 -10.362 -8.241 1.00 7.09 C ATOM 945 HA ILE A 64 17.912 -12.555 -8.291 1.00 0.00 H ATOM 946 HB ILE A 64 18.207 -10.232 -6.988 1.00 0.00 H ATOM 947 HG12 ILE A 64 17.034 -8.838 -8.933 1.00 0.00 H ATOM 948 HG13 ILE A 64 17.121 -10.365 -9.843 1.00 0.00 H ATOM 949 HD11 ILE A 64 15.697 -11.449 -8.160 1.00 0.00 H ATOM 950 HD12 ILE A 64 15.611 -9.921 -7.250 1.00 0.00 H ATOM 951 HD13 ILE A 64 14.902 -10.028 -8.881 1.00 0.00 H ATOM 952 HG21 ILE A 64 20.365 -9.592 -8.130 1.00 0.00 H ATOM 953 HG22 ILE A 64 19.506 -9.498 -9.687 1.00 0.00 H ATOM 954 HG23 ILE A 64 19.132 -8.335 -8.391 1.00 0.00 H ATOM 955 H ILE A 64 20.134 -11.429 -6.778 1.00 0.00 H ATOM 956 N ARG A 65 18.077 -12.312 -10.629 1.00 4.50 N ATOM 957 CA ARG A 65 18.228 -12.413 -12.087 1.00 8.63 C ATOM 958 C ARG A 65 17.121 -11.572 -12.696 1.00 4.60 C ATOM 959 O ARG A 65 15.959 -11.695 -12.357 1.00 9.21 O ATOM 960 CB ARG A 65 18.167 -13.792 -12.692 1.00 7.97 C ATOM 961 CG ARG A 65 19.466 -14.430 -12.224 1.00 8.47 C ATOM 962 CD ARG A 65 19.790 -15.769 -12.868 1.00 11.02 C ATOM 963 NE ARG A 65 21.196 -16.142 -12.689 1.00 80.00 N ATOM 964 CZ ARG A 65 22.113 -16.148 -13.677 1.00 80.00 C ATOM 965 NH1 ARG A 65 21.822 -15.796 -14.938 1.00 27.80 N ATOM 966 NH2 ARG A 65 23.374 -16.512 -13.402 1.00 80.00 N ATOM 967 HA ARG A 65 19.240 -12.074 -12.307 1.00 0.00 H ATOM 968 HB2 ARG A 65 17.303 -14.345 -12.322 1.00 0.00 H ATOM 969 HB3 ARG A 65 18.125 -13.741 -13.780 1.00 0.00 H ATOM 970 HG2 ARG A 65 20.281 -13.741 -12.446 1.00 0.00 H ATOM 971 HG3 ARG A 65 19.401 -14.579 -11.146 1.00 0.00 H ATOM 972 HD2 ARG A 65 19.576 -15.707 -13.935 1.00 0.00 H ATOM 973 HD3 ARG A 65 19.162 -16.537 -12.417 1.00 0.00 H ATOM 974 HE ARG A 65 21.507 -16.421 -11.736 1.00 0.00 H ATOM 975 HH12 ARG A 65 22.563 -15.816 -15.668 1.00 0.00 H ATOM 976 HH11 ARG A 65 20.856 -15.503 -15.186 1.00 0.00 H ATOM 977 HH22 ARG A 65 24.089 -16.520 -14.157 1.00 0.00 H ATOM 978 HH21 ARG A 65 23.637 -16.786 -12.434 1.00 0.00 H ATOM 979 H ARG A 65 17.155 -12.552 -10.213 1.00 0.00 H ATOM 980 N PHE A 66 17.492 -10.732 -13.597 1.00 8.96 N ATOM 981 CA PHE A 66 16.581 -9.878 -14.285 1.00 5.94 C ATOM 982 C PHE A 66 16.325 -10.514 -15.629 1.00 11.35 C ATOM 983 O PHE A 66 17.222 -10.489 -16.481 1.00 11.39 O ATOM 984 CB PHE A 66 17.229 -8.527 -14.543 1.00 8.22 C ATOM 985 CG PHE A 66 17.578 -7.744 -13.304 1.00 12.68 C ATOM 986 CD1 PHE A 66 16.609 -7.369 -12.364 1.00 10.77 C ATOM 987 CD2 PHE A 66 18.899 -7.336 -13.077 1.00 21.10 C ATOM 988 CE1 PHE A 66 16.990 -6.644 -11.228 1.00 8.08 C ATOM 989 CE2 PHE A 66 19.283 -6.607 -11.948 1.00 16.55 C ATOM 990 CZ PHE A 66 18.313 -6.249 -11.013 1.00 12.98 C ATOM 991 HA PHE A 66 15.672 -9.744 -13.698 1.00 0.00 H ATOM 992 HB2 PHE A 66 18.146 -8.693 -15.108 1.00 0.00 H ATOM 993 HB3 PHE A 66 16.540 -7.929 -15.139 1.00 0.00 H ATOM 994 HD2 PHE A 66 19.660 -7.598 -13.812 1.00 0.00 H ATOM 995 HE2 PHE A 66 20.325 -6.323 -11.801 1.00 0.00 H ATOM 996 HZ PHE A 66 18.582 -5.671 -10.129 1.00 0.00 H ATOM 997 HE1 PHE A 66 16.232 -6.380 -10.490 1.00 0.00 H ATOM 998 HD1 PHE A 66 15.564 -7.640 -12.516 1.00 0.00 H ATOM 999 H PHE A 66 18.503 -10.673 -13.834 1.00 0.00 H ATOM 1000 N ARG A 67 15.110 -11.052 -15.803 1.00 10.03 N ATOM 1001 CA ARG A 67 14.740 -11.716 -17.055 1.00 19.77 C ATOM 1002 C ARG A 67 15.811 -12.759 -17.371 1.00 17.81 C ATOM 1003 O ARG A 67 16.216 -12.940 -18.512 1.00 11.88 O ATOM 1004 CB ARG A 67 14.501 -10.761 -18.237 1.00 12.53 C ATOM 1005 CG ARG A 67 13.253 -9.924 -18.071 1.00 8.13 C ATOM 1006 CD ARG A 67 11.976 -10.759 -18.219 1.00 12.05 C ATOM 1007 NE ARG A 67 10.819 -9.895 -18.503 1.00 10.55 N ATOM 1008 CZ ARG A 67 9.647 -10.321 -18.870 1.00 10.06 C ATOM 1009 NH1 ARG A 67 9.410 -11.604 -19.002 1.00 17.61 N ATOM 1010 NH2 ARG A 67 8.648 -9.459 -19.107 1.00 13.77 N ATOM 1011 HA ARG A 67 13.770 -12.192 -16.909 1.00 0.00 H ATOM 1012 HB2 ARG A 67 15.359 -10.094 -18.325 1.00 0.00 H ATOM 1013 HB3 ARG A 67 14.406 -11.351 -19.148 1.00 0.00 H ATOM 1014 HG2 ARG A 67 13.263 -9.469 -17.080 1.00 0.00 H ATOM 1015 HG3 ARG A 67 13.251 -9.141 -18.829 1.00 0.00 H ATOM 1016 HD2 ARG A 67 11.796 -11.305 -17.293 1.00 0.00 H ATOM 1017 HD3 ARG A 67 12.104 -11.467 -19.038 1.00 0.00 H ATOM 1018 HE ARG A 67 10.949 -8.868 -18.403 1.00 0.00 H ATOM 1019 HH12 ARG A 67 8.468 -11.931 -19.296 1.00 0.00 H ATOM 1020 HH11 ARG A 67 10.164 -12.294 -18.812 1.00 0.00 H ATOM 1021 HH22 ARG A 67 7.715 -9.812 -19.400 1.00 0.00 H ATOM 1022 HH21 ARG A 67 8.806 -8.437 -18.998 1.00 0.00 H ATOM 1023 H ARG A 67 14.414 -10.997 -15.032 1.00 0.00 H ATOM 1024 N GLY A 68 16.294 -13.439 -16.364 1.00 9.96 N ATOM 1025 CA GLY A 68 17.317 -14.429 -16.689 1.00 9.45 C ATOM 1026 C GLY A 68 18.773 -13.975 -16.529 1.00 18.71 C ATOM 1027 O GLY A 68 19.679 -14.799 -16.421 1.00 11.68 O ATOM 1028 HA3 GLY A 68 17.174 -14.727 -17.727 1.00 0.00 H ATOM 1029 HA2 GLY A 68 17.164 -15.291 -16.040 1.00 0.00 H ATOM 1030 H GLY A 68 15.969 -13.284 -15.389 1.00 0.00 H ATOM 1031 N PHE A 69 19.063 -12.681 -16.507 1.00 10.10 N ATOM 1032 CA PHE A 69 20.430 -12.216 -16.350 1.00 12.39 C ATOM 1033 C PHE A 69 20.822 -11.718 -14.969 1.00 13.86 C ATOM 1034 O PHE A 69 20.150 -10.938 -14.315 1.00 14.10 O ATOM 1035 CB PHE A 69 20.751 -11.048 -17.276 1.00 10.75 C ATOM 1036 CG PHE A 69 20.435 -11.385 -18.715 1.00 16.75 C ATOM 1037 CD1 PHE A 69 21.350 -12.044 -19.529 1.00 18.33 C ATOM 1038 CD2 PHE A 69 19.199 -11.042 -19.254 1.00 17.49 C ATOM 1039 CE1 PHE A 69 21.038 -12.333 -20.861 1.00 24.86 C ATOM 1040 CE2 PHE A 69 18.857 -11.331 -20.571 1.00 23.00 C ATOM 1041 CZ PHE A 69 19.795 -11.969 -21.380 1.00 28.90 C ATOM 1042 HA PHE A 69 20.986 -13.126 -16.577 1.00 0.00 H ATOM 1043 HB2 PHE A 69 20.159 -10.183 -16.975 1.00 0.00 H ATOM 1044 HB3 PHE A 69 21.811 -10.809 -17.192 1.00 0.00 H ATOM 1045 HD2 PHE A 69 18.474 -10.529 -18.622 1.00 0.00 H ATOM 1046 HE2 PHE A 69 17.875 -11.064 -20.962 1.00 0.00 H ATOM 1047 HZ PHE A 69 19.557 -12.184 -22.422 1.00 0.00 H ATOM 1048 HE1 PHE A 69 21.765 -12.842 -21.493 1.00 0.00 H ATOM 1049 HD1 PHE A 69 22.319 -12.338 -19.125 1.00 0.00 H ATOM 1050 H PHE A 69 18.296 -11.985 -16.604 1.00 0.00 H ATOM 1051 N SER A 70 22.005 -12.139 -14.556 1.00 12.97 N ATOM 1052 CA SER A 70 22.503 -11.694 -13.290 1.00 9.60 C ATOM 1053 C SER A 70 23.113 -10.316 -13.468 1.00 11.20 C ATOM 1054 O SER A 70 23.372 -9.790 -14.549 1.00 13.63 O ATOM 1055 CB SER A 70 23.653 -12.595 -12.882 1.00 21.65 C ATOM 1056 OG SER A 70 24.738 -12.450 -13.775 1.00 17.28 O ATOM 1057 HA SER A 70 21.694 -11.697 -12.560 1.00 0.00 H ATOM 1058 HB2 SER A 70 23.317 -13.632 -12.891 1.00 0.00 H ATOM 1059 HB3 SER A 70 23.978 -12.329 -11.876 1.00 0.00 H ATOM 1060 HG SER A 70 25.478 -13.045 -13.493 1.00 0.00 H ATOM 1061 H SER A 70 22.568 -12.786 -15.144 1.00 0.00 H ATOM 1062 N ILE A 71 23.408 -9.693 -12.338 1.00 8.89 N ATOM 1063 CA ILE A 71 24.001 -8.375 -12.360 1.00 17.86 C ATOM 1064 C ILE A 71 25.303 -8.283 -13.176 1.00 23.96 C ATOM 1065 O ILE A 71 25.440 -7.396 -14.002 1.00 16.81 O ATOM 1066 CB ILE A 71 24.103 -7.913 -10.916 1.00 20.83 C ATOM 1067 CG1 ILE A 71 22.670 -7.589 -10.504 1.00 23.79 C ATOM 1068 CG2 ILE A 71 24.948 -6.652 -10.796 1.00 19.81 C ATOM 1069 CD1 ILE A 71 22.536 -7.174 -9.054 1.00 24.58 C ATOM 1070 HA ILE A 71 23.365 -7.682 -12.911 1.00 0.00 H ATOM 1071 HB ILE A 71 24.570 -8.676 -10.293 1.00 0.00 H ATOM 1072 HG12 ILE A 71 22.306 -6.775 -11.131 1.00 0.00 H ATOM 1073 HG13 ILE A 71 22.055 -8.474 -10.668 1.00 0.00 H ATOM 1074 HD11 ILE A 71 22.885 -7.983 -8.412 1.00 0.00 H ATOM 1075 HD12 ILE A 71 23.136 -6.282 -8.876 1.00 0.00 H ATOM 1076 HD13 ILE A 71 21.490 -6.960 -8.834 1.00 0.00 H ATOM 1077 HG21 ILE A 71 25.953 -6.853 -11.168 1.00 0.00 H ATOM 1078 HG22 ILE A 71 24.494 -5.855 -11.384 1.00 0.00 H ATOM 1079 HG23 ILE A 71 25.000 -6.349 -9.750 1.00 0.00 H ATOM 1080 H ILE A 71 23.212 -10.155 -11.427 1.00 0.00 H ATOM 1081 N PRO A 72 26.259 -9.192 -12.984 1.00 17.70 N ATOM 1082 CA PRO A 72 27.497 -9.124 -13.749 1.00 15.78 C ATOM 1083 C PRO A 72 27.192 -9.172 -15.223 1.00 22.40 C ATOM 1084 O PRO A 72 27.821 -8.439 -15.964 1.00 13.26 O ATOM 1085 CB PRO A 72 28.347 -10.317 -13.305 1.00 18.00 C ATOM 1086 CG PRO A 72 27.835 -10.627 -11.896 1.00 20.22 C ATOM 1087 CD PRO A 72 26.433 -10.047 -11.786 1.00 15.50 C ATOM 1088 HA PRO A 72 28.036 -8.193 -13.572 1.00 0.00 H ATOM 1089 HD3 PRO A 72 25.691 -10.845 -11.777 1.00 0.00 H ATOM 1090 HD2 PRO A 72 26.337 -9.453 -10.877 1.00 0.00 H ATOM 1091 HG3 PRO A 72 28.488 -10.169 -11.153 1.00 0.00 H ATOM 1092 HG2 PRO A 72 27.806 -11.705 -11.738 1.00 0.00 H ATOM 1093 HB2 PRO A 72 28.198 -11.169 -13.969 1.00 0.00 H ATOM 1094 HB3 PRO A 72 29.405 -10.054 -13.285 1.00 0.00 H ATOM 1095 N GLU A 73 26.202 -10.008 -15.609 1.00 17.37 N ATOM 1096 CA GLU A 73 25.775 -10.147 -16.999 1.00 12.97 C ATOM 1097 C GLU A 73 25.171 -8.843 -17.476 1.00 14.16 C ATOM 1098 O GLU A 73 25.435 -8.384 -18.581 1.00 25.56 O ATOM 1099 CB GLU A 73 24.740 -11.227 -17.121 1.00 11.84 C ATOM 1100 CG GLU A 73 25.406 -12.604 -17.280 1.00 14.31 C ATOM 1101 CD GLU A 73 24.512 -13.782 -16.904 1.00 31.98 C ATOM 1102 OE1 GLU A 73 23.328 -13.707 -16.672 1.00 23.91 O ATOM 1103 OE2 GLU A 73 25.158 -14.889 -16.677 1.00 72.91 O ATOM 1104 HA GLU A 73 26.644 -10.405 -17.605 1.00 0.00 H ATOM 1105 HB2 GLU A 73 24.119 -11.231 -16.225 1.00 0.00 H ATOM 1106 HB3 GLU A 73 24.116 -11.028 -17.993 1.00 0.00 H ATOM 1107 HG2 GLU A 73 25.705 -12.721 -18.322 1.00 0.00 H ATOM 1108 HG3 GLU A 73 26.291 -12.631 -16.645 1.00 0.00 H ATOM 1109 H GLU A 73 25.723 -10.578 -14.883 1.00 0.00 H ATOM 1110 N CYS A 74 24.336 -8.192 -16.656 1.00 10.37 N ATOM 1111 CA CYS A 74 23.790 -6.913 -17.118 1.00 10.37 C ATOM 1112 C CYS A 74 24.876 -5.853 -17.260 1.00 17.11 C ATOM 1113 O CYS A 74 24.874 -5.053 -18.187 1.00 16.82 O ATOM 1114 CB CYS A 74 22.791 -6.372 -16.094 1.00 8.41 C ATOM 1115 SG CYS A 74 21.322 -7.418 -16.179 1.00 15.56 S ATOM 1116 HA CYS A 74 23.322 -7.104 -18.084 1.00 0.00 H ATOM 1117 HB2 CYS A 74 22.530 -5.341 -16.334 1.00 0.00 H ATOM 1118 HB3 CYS A 74 23.222 -6.413 -15.094 1.00 0.00 H ATOM 1119 HG CYS A 74 21.668 -8.720 -15.880 1.00 0.00 H ATOM 1120 H CYS A 74 24.084 -8.580 -15.725 1.00 0.00 H ATOM 1121 N GLN A 75 25.817 -5.851 -16.343 1.00 18.11 N ATOM 1122 CA GLN A 75 26.892 -4.888 -16.391 1.00 20.48 C ATOM 1123 C GLN A 75 27.621 -5.023 -17.690 1.00 23.01 C ATOM 1124 O GLN A 75 28.064 -4.084 -18.343 1.00 24.19 O ATOM 1125 CB GLN A 75 27.934 -5.163 -15.291 1.00 26.99 C ATOM 1126 CG GLN A 75 28.478 -3.891 -14.631 1.00 68.47 C ATOM 1127 CD GLN A 75 28.523 -4.015 -13.121 1.00 80.00 C ATOM 1128 OE1 GLN A 75 28.405 -5.116 -12.536 1.00 80.00 O ATOM 1129 NE2 GLN A 75 28.722 -2.857 -12.497 1.00 80.00 N ATOM 1130 HA GLN A 75 26.449 -3.900 -16.263 1.00 0.00 H ATOM 1131 HB2 GLN A 75 27.469 -5.779 -14.522 1.00 0.00 H ATOM 1132 HB3 GLN A 75 28.769 -5.706 -15.734 1.00 0.00 H ATOM 1133 HG2 GLN A 75 29.487 -3.705 -15.000 1.00 0.00 H ATOM 1134 HG3 GLN A 75 27.835 -3.052 -14.897 1.00 0.00 H ATOM 1135 HE22 GLN A 75 28.811 -1.979 -13.047 1.00 0.00 H ATOM 1136 HE21 GLN A 75 28.788 -2.830 -11.459 1.00 0.00 H ATOM 1137 H GLN A 75 25.787 -6.551 -15.574 1.00 0.00 H ATOM 1138 N LYS A 76 27.740 -6.267 -18.052 1.00 19.18 N ATOM 1139 CA LYS A 76 28.436 -6.490 -19.287 1.00 17.41 C ATOM 1140 C LYS A 76 27.639 -6.258 -20.563 1.00 32.19 C ATOM 1141 O LYS A 76 28.186 -5.658 -21.499 1.00 24.19 O ATOM 1142 CB LYS A 76 29.163 -7.814 -19.186 1.00 23.27 C ATOM 1143 CG LYS A 76 28.935 -8.753 -20.352 1.00 61.93 C ATOM 1144 CD LYS A 76 30.207 -9.538 -20.616 1.00 80.00 C ATOM 1145 CE LYS A 76 31.373 -8.945 -19.815 1.00 80.00 C ATOM 1146 NZ LYS A 76 32.512 -9.849 -19.534 1.00 80.00 N ATOM 1147 HA LYS A 76 29.174 -5.698 -19.411 1.00 0.00 H ATOM 1148 HB2 LYS A 76 30.232 -7.610 -19.118 1.00 0.00 H ATOM 1149 HB3 LYS A 76 28.831 -8.315 -18.277 1.00 0.00 H ATOM 1150 HG2 LYS A 76 28.124 -9.441 -20.113 1.00 0.00 H ATOM 1151 HG3 LYS A 76 28.671 -8.177 -21.239 1.00 0.00 H ATOM 1152 HD2 LYS A 76 30.058 -10.576 -20.319 1.00 0.00 H ATOM 1153 HD3 LYS A 76 30.442 -9.495 -21.679 1.00 0.00 H ATOM 1154 HE2 LYS A 76 30.978 -8.604 -18.858 1.00 0.00 H ATOM 1155 HE3 LYS A 76 31.758 -8.091 -20.373 1.00 0.00 H ATOM 1156 HZ1 LYS A 76 32.177 -10.666 -18.985 1.00 0.00 H ATOM 1157 HZ2 LYS A 76 32.922 -10.177 -20.432 1.00 0.00 H ATOM 1158 HZ3 LYS A 76 33.234 -9.336 -18.989 1.00 0.00 H ATOM 1159 H LYS A 76 27.356 -7.049 -17.484 1.00 0.00 H ATOM 1160 N LEU A 77 26.371 -6.712 -20.592 1.00 24.34 N ATOM 1161 CA LEU A 77 25.515 -6.581 -21.754 1.00 16.18 C ATOM 1162 C LEU A 77 24.755 -5.291 -21.982 1.00 21.37 C ATOM 1163 O LEU A 77 24.522 -4.930 -23.150 1.00 22.09 O ATOM 1164 CB LEU A 77 24.476 -7.704 -21.772 1.00 14.34 C ATOM 1165 CG LEU A 77 25.106 -9.081 -21.728 1.00 27.11 C ATOM 1166 CD1 LEU A 77 24.019 -10.066 -21.323 1.00 18.53 C ATOM 1167 CD2 LEU A 77 25.643 -9.406 -23.123 1.00 24.62 C ATOM 1168 HA LEU A 77 26.254 -6.615 -22.555 1.00 0.00 H ATOM 1169 HB2 LEU A 77 23.824 -7.590 -20.906 1.00 0.00 H ATOM 1170 HB3 LEU A 77 23.885 -7.619 -22.684 1.00 0.00 H ATOM 1171 HG LEU A 77 25.929 -9.133 -21.015 1.00 0.00 H ATOM 1172 HD21 LEU A 77 24.822 -9.392 -23.839 1.00 0.00 H ATOM 1173 HD22 LEU A 77 26.387 -8.662 -23.407 1.00 0.00 H ATOM 1174 HD23 LEU A 77 26.101 -10.395 -23.113 1.00 0.00 H ATOM 1175 HD11 LEU A 77 23.629 -9.792 -20.342 1.00 0.00 H ATOM 1176 HD12 LEU A 77 23.213 -10.038 -22.056 1.00 0.00 H ATOM 1177 HD13 LEU A 77 24.439 -11.071 -21.281 1.00 0.00 H ATOM 1178 H LEU A 77 25.990 -7.177 -19.743 1.00 0.00 H ATOM 1179 N LEU A 78 24.343 -4.620 -20.934 1.00 14.53 N ATOM 1180 CA LEU A 78 23.583 -3.428 -21.173 1.00 13.89 C ATOM 1181 C LEU A 78 24.355 -2.233 -21.708 1.00 12.69 C ATOM 1182 O LEU A 78 25.494 -1.999 -21.336 1.00 9.92 O ATOM 1183 CB LEU A 78 22.735 -3.049 -19.950 1.00 10.72 C ATOM 1184 CG LEU A 78 21.761 -4.139 -19.435 1.00 14.12 C ATOM 1185 CD1 LEU A 78 21.117 -3.640 -18.142 1.00 15.99 C ATOM 1186 CD2 LEU A 78 20.629 -4.364 -20.431 1.00 18.24 C ATOM 1187 HA LEU A 78 22.926 -3.701 -21.999 1.00 0.00 H ATOM 1188 HB2 LEU A 78 23.416 -2.798 -19.136 1.00 0.00 H ATOM 1189 HB3 LEU A 78 22.145 -2.171 -20.212 1.00 0.00 H ATOM 1190 HG LEU A 78 22.321 -5.062 -19.289 1.00 0.00 H ATOM 1191 HD21 LEU A 78 20.077 -3.434 -20.568 1.00 0.00 H ATOM 1192 HD22 LEU A 78 21.045 -4.685 -21.386 1.00 0.00 H ATOM 1193 HD23 LEU A 78 19.958 -5.133 -20.049 1.00 0.00 H ATOM 1194 HD11 LEU A 78 21.893 -3.452 -17.400 1.00 0.00 H ATOM 1195 HD12 LEU A 78 20.572 -2.717 -18.341 1.00 0.00 H ATOM 1196 HD13 LEU A 78 20.428 -4.396 -17.766 1.00 0.00 H ATOM 1197 H LEU A 78 24.559 -4.939 -19.968 1.00 0.00 H ATOM 1198 N PRO A 79 23.707 -1.449 -22.593 1.00 11.91 N ATOM 1199 CA PRO A 79 24.387 -0.280 -23.098 1.00 4.87 C ATOM 1200 C PRO A 79 24.773 0.688 -21.969 1.00 21.73 C ATOM 1201 O PRO A 79 24.086 0.850 -20.946 1.00 15.92 O ATOM 1202 CB PRO A 79 23.441 0.452 -24.067 1.00 8.93 C ATOM 1203 CG PRO A 79 22.501 -0.629 -24.543 1.00 12.64 C ATOM 1204 CD PRO A 79 22.561 -1.758 -23.496 1.00 11.83 C ATOM 1205 HA PRO A 79 25.301 -0.604 -23.596 1.00 0.00 H ATOM 1206 HD3 PRO A 79 21.632 -1.791 -22.926 1.00 0.00 H ATOM 1207 HD2 PRO A 79 22.719 -2.718 -23.988 1.00 0.00 H ATOM 1208 HG3 PRO A 79 22.818 -1.002 -25.517 1.00 0.00 H ATOM 1209 HG2 PRO A 79 21.486 -0.239 -24.618 1.00 0.00 H ATOM 1210 HB2 PRO A 79 22.895 1.243 -23.553 1.00 0.00 H ATOM 1211 HB3 PRO A 79 23.996 0.879 -24.902 1.00 0.00 H ATOM 1212 N LYS A 80 25.895 1.385 -22.176 1.00 16.98 N ATOM 1213 CA LYS A 80 26.483 2.343 -21.257 1.00 7.02 C ATOM 1214 C LYS A 80 26.442 3.694 -21.889 1.00 11.35 C ATOM 1215 O LYS A 80 26.134 3.846 -23.083 1.00 17.46 O ATOM 1216 CB LYS A 80 27.934 1.882 -21.038 1.00 14.22 C ATOM 1217 CG LYS A 80 27.979 0.745 -20.063 1.00 15.00 C ATOM 1218 CD LYS A 80 28.856 -0.423 -20.451 1.00 41.01 C ATOM 1219 CE LYS A 80 28.331 -1.776 -20.016 1.00 31.83 C ATOM 1220 NZ LYS A 80 27.714 -2.442 -21.177 1.00 41.54 N ATOM 1221 HA LYS A 80 25.952 2.399 -20.307 1.00 0.00 H ATOM 1222 HB2 LYS A 80 28.355 1.557 -21.989 1.00 0.00 H ATOM 1223 HB3 LYS A 80 28.520 2.714 -20.648 1.00 0.00 H ATOM 1224 HG2 LYS A 80 28.342 1.134 -19.112 1.00 0.00 H ATOM 1225 HG3 LYS A 80 26.962 0.372 -19.937 1.00 0.00 H ATOM 1226 HD2 LYS A 80 28.955 -0.429 -21.537 1.00 0.00 H ATOM 1227 HD3 LYS A 80 29.837 -0.277 -19.999 1.00 0.00 H ATOM 1228 HE2 LYS A 80 27.587 -1.645 -19.230 1.00 0.00 H ATOM 1229 HE3 LYS A 80 29.153 -2.384 -19.639 1.00 0.00 H ATOM 1230 HZ1 LYS A 80 26.931 -1.858 -21.535 1.00 0.00 H ATOM 1231 HZ2 LYS A 80 28.427 -2.564 -21.924 1.00 0.00 H ATOM 1232 HZ3 LYS A 80 27.350 -3.373 -20.888 1.00 0.00 H ATOM 1233 H LYS A 80 26.391 1.227 -23.076 1.00 0.00 H ATOM 1234 N ALA A 81 26.763 4.687 -21.073 1.00 17.32 N ATOM 1235 CA ALA A 81 26.791 6.060 -21.568 1.00 14.75 C ATOM 1236 C ALA A 81 28.084 6.232 -22.388 1.00 15.26 C ATOM 1237 O ALA A 81 29.048 5.465 -22.238 1.00 21.55 O ATOM 1238 CB ALA A 81 26.834 7.058 -20.401 1.00 9.84 C ATOM 1239 HA ALA A 81 25.898 6.249 -22.164 1.00 0.00 H ATOM 1240 HB1 ALA A 81 25.949 6.926 -19.779 1.00 0.00 H ATOM 1241 HB2 ALA A 81 27.729 6.880 -19.805 1.00 0.00 H ATOM 1242 HB3 ALA A 81 26.854 8.074 -20.794 1.00 0.00 H ATOM 1243 H ALA A 81 26.995 4.488 -20.079 1.00 0.00 H ATOM 1244 N GLY A 82 28.125 7.243 -23.247 1.00 32.86 N ATOM 1245 CA GLY A 82 29.342 7.459 -24.014 1.00 25.57 C ATOM 1246 C GLY A 82 30.483 7.756 -23.033 1.00 22.66 C ATOM 1247 O GLY A 82 30.496 8.765 -22.314 1.00 40.26 O ATOM 1248 HA3 GLY A 82 29.207 8.304 -24.690 1.00 0.00 H ATOM 1249 HA2 GLY A 82 29.576 6.566 -24.593 1.00 0.00 H ATOM 1250 H GLY A 82 27.303 7.868 -23.369 1.00 0.00 H ATOM 1251 N GLY A 83 31.455 6.840 -23.002 1.00 31.23 N ATOM 1252 CA GLY A 83 32.599 6.964 -22.139 1.00 31.37 C ATOM 1253 C GLY A 83 32.319 6.393 -20.772 1.00 41.63 C ATOM 1254 O GLY A 83 33.202 6.461 -19.911 1.00 49.62 O ATOM 1255 HA3 GLY A 83 32.855 8.019 -22.038 1.00 0.00 H ATOM 1256 HA2 GLY A 83 33.438 6.429 -22.583 1.00 0.00 H ATOM 1257 H GLY A 83 31.382 6.009 -23.623 1.00 0.00 H ATOM 1258 N GLY A 84 31.100 5.828 -20.594 1.00 22.47 N ATOM 1259 CA GLY A 84 30.735 5.251 -19.315 1.00 24.58 C ATOM 1260 C GLY A 84 31.165 3.797 -19.153 1.00 15.89 C ATOM 1261 O GLY A 84 31.626 3.139 -20.069 1.00 19.22 O ATOM 1262 HA3 GLY A 84 29.651 5.303 -19.210 1.00 0.00 H ATOM 1263 HA2 GLY A 84 31.204 5.839 -18.526 1.00 0.00 H ATOM 1264 H GLY A 84 30.421 5.808 -21.381 1.00 0.00 H ATOM 1265 N GLU A 85 30.970 3.314 -17.939 1.00 11.27 N ATOM 1266 CA GLU A 85 31.274 1.970 -17.553 1.00 20.22 C ATOM 1267 C GLU A 85 30.050 1.319 -16.934 1.00 21.50 C ATOM 1268 O GLU A 85 29.942 0.107 -17.042 1.00 22.42 O ATOM 1269 CB GLU A 85 32.282 1.977 -16.396 1.00 31.00 C ATOM 1270 CG GLU A 85 33.736 1.959 -16.832 1.00 80.00 C ATOM 1271 CD GLU A 85 34.556 1.293 -15.773 1.00 80.00 C ATOM 1272 OE1 GLU A 85 34.279 1.314 -14.570 1.00 80.00 O ATOM 1273 OE2 GLU A 85 35.615 0.729 -16.295 1.00 80.00 O ATOM 1274 HA GLU A 85 31.635 1.456 -18.444 1.00 0.00 H ATOM 1275 HB2 GLU A 85 32.115 2.876 -15.803 1.00 0.00 H ATOM 1276 HB3 GLU A 85 32.100 1.097 -15.779 1.00 0.00 H ATOM 1277 HG2 GLU A 85 33.830 1.408 -17.768 1.00 0.00 H ATOM 1278 HG3 GLU A 85 34.087 2.981 -16.977 1.00 0.00 H ATOM 1279 H GLU A 85 30.571 3.950 -17.219 1.00 0.00 H ATOM 1280 N GLU A 86 29.163 2.100 -16.292 1.00 15.40 N ATOM 1281 CA GLU A 86 27.943 1.568 -15.641 1.00 9.41 C ATOM 1282 C GLU A 86 26.727 1.519 -16.583 1.00 14.23 C ATOM 1283 O GLU A 86 26.538 2.402 -17.420 1.00 17.28 O ATOM 1284 CB GLU A 86 27.624 2.303 -14.342 1.00 8.60 C ATOM 1285 CG GLU A 86 28.839 2.410 -13.404 1.00 10.88 C ATOM 1286 CD GLU A 86 29.384 1.091 -12.900 1.00 18.48 C ATOM 1287 OE1 GLU A 86 28.622 0.064 -13.144 1.00 29.18 O ATOM 1288 OE2 GLU A 86 30.494 0.970 -12.420 1.00 28.89 O ATOM 1289 HA GLU A 86 28.168 0.533 -15.385 1.00 0.00 H ATOM 1290 HB2 GLU A 86 27.282 3.309 -14.586 1.00 0.00 H ATOM 1291 HB3 GLU A 86 26.830 1.766 -13.824 1.00 0.00 H ATOM 1292 HG2 GLU A 86 29.637 2.921 -13.943 1.00 0.00 H ATOM 1293 HG3 GLU A 86 28.546 3.006 -12.540 1.00 0.00 H ATOM 1294 H GLU A 86 29.342 3.124 -16.251 1.00 0.00 H ATOM 1295 N PRO A 87 25.918 0.457 -16.442 1.00 10.60 N ATOM 1296 CA PRO A 87 24.756 0.278 -17.292 1.00 14.94 C ATOM 1297 C PRO A 87 23.743 1.404 -17.096 1.00 10.88 C ATOM 1298 O PRO A 87 23.570 1.927 -16.003 1.00 13.34 O ATOM 1299 CB PRO A 87 24.202 -1.114 -16.904 1.00 13.70 C ATOM 1300 CG PRO A 87 24.706 -1.439 -15.509 1.00 18.67 C ATOM 1301 CD PRO A 87 25.999 -0.661 -15.427 1.00 9.41 C ATOM 1302 HA PRO A 87 24.998 0.321 -18.354 1.00 0.00 H ATOM 1303 HD3 PRO A 87 26.123 -0.248 -14.426 1.00 0.00 H ATOM 1304 HD2 PRO A 87 26.842 -1.313 -15.657 1.00 0.00 H ATOM 1305 HG3 PRO A 87 24.884 -2.508 -15.395 1.00 0.00 H ATOM 1306 HG2 PRO A 87 23.999 -1.106 -14.749 1.00 0.00 H ATOM 1307 HB2 PRO A 87 23.112 -1.095 -16.910 1.00 0.00 H ATOM 1308 HB3 PRO A 87 24.555 -1.865 -17.611 1.00 0.00 H ATOM 1309 N LEU A 88 23.060 1.792 -18.162 1.00 8.64 N ATOM 1310 CA LEU A 88 22.064 2.862 -18.090 1.00 10.15 C ATOM 1311 C LEU A 88 20.755 2.183 -17.596 1.00 7.04 C ATOM 1312 O LEU A 88 20.405 1.092 -18.078 1.00 9.52 O ATOM 1313 CB LEU A 88 21.941 3.457 -19.512 1.00 11.37 C ATOM 1314 CG LEU A 88 23.048 4.478 -19.914 1.00 15.00 C ATOM 1315 CD1 LEU A 88 22.562 5.134 -21.184 1.00 14.17 C ATOM 1316 CD2 LEU A 88 23.232 5.610 -18.900 1.00 20.45 C ATOM 1317 HA LEU A 88 22.315 3.678 -17.412 1.00 0.00 H ATOM 1318 HB2 LEU A 88 21.970 2.632 -20.224 1.00 0.00 H ATOM 1319 HB3 LEU A 88 20.978 3.962 -19.582 1.00 0.00 H ATOM 1320 HG LEU A 88 23.993 3.940 -19.996 1.00 0.00 H ATOM 1321 HD21 LEU A 88 22.298 6.163 -18.801 1.00 0.00 H ATOM 1322 HD22 LEU A 88 23.511 5.189 -17.934 1.00 0.00 H ATOM 1323 HD23 LEU A 88 24.018 6.281 -19.246 1.00 0.00 H ATOM 1324 HD11 LEU A 88 22.425 4.375 -21.954 1.00 0.00 H ATOM 1325 HD12 LEU A 88 21.613 5.634 -20.993 1.00 0.00 H ATOM 1326 HD13 LEU A 88 23.298 5.865 -21.519 1.00 0.00 H ATOM 1327 H LEU A 88 23.236 1.324 -19.074 1.00 0.00 H ATOM 1328 N PRO A 89 20.061 2.764 -16.631 1.00 9.30 N ATOM 1329 CA PRO A 89 18.842 2.137 -16.169 1.00 9.69 C ATOM 1330 C PRO A 89 17.769 2.073 -17.271 1.00 9.87 C ATOM 1331 O PRO A 89 16.890 1.240 -17.204 1.00 8.60 O ATOM 1332 CB PRO A 89 18.336 3.018 -15.020 1.00 9.48 C ATOM 1333 CG PRO A 89 19.265 4.210 -14.894 1.00 12.66 C ATOM 1334 CD PRO A 89 20.472 3.893 -15.735 1.00 4.98 C ATOM 1335 HA PRO A 89 19.038 1.109 -15.865 1.00 0.00 H ATOM 1336 HD3 PRO A 89 20.761 4.761 -16.327 1.00 0.00 H ATOM 1337 HD2 PRO A 89 21.307 3.591 -15.103 1.00 0.00 H ATOM 1338 HG3 PRO A 89 19.556 4.354 -13.854 1.00 0.00 H ATOM 1339 HG2 PRO A 89 18.775 5.112 -15.261 1.00 0.00 H ATOM 1340 HB2 PRO A 89 17.323 3.360 -15.235 1.00 0.00 H ATOM 1341 HB3 PRO A 89 18.337 2.449 -14.090 1.00 0.00 H ATOM 1342 N GLU A 90 17.840 2.938 -18.280 1.00 8.57 N ATOM 1343 CA GLU A 90 16.909 2.919 -19.372 1.00 7.04 C ATOM 1344 C GLU A 90 16.929 1.546 -20.053 1.00 10.63 C ATOM 1345 O GLU A 90 15.918 0.997 -20.446 1.00 8.04 O ATOM 1346 CB GLU A 90 17.351 3.851 -20.505 1.00 8.24 C ATOM 1347 CG GLU A 90 17.003 5.310 -20.235 1.00 3.45 C ATOM 1348 CD GLU A 90 18.141 6.010 -19.544 1.00 10.88 C ATOM 1349 OE1 GLU A 90 18.746 5.540 -18.604 1.00 12.33 O ATOM 1350 OE2 GLU A 90 18.247 7.256 -19.871 1.00 10.25 O ATOM 1351 HA GLU A 90 15.946 3.197 -18.944 1.00 0.00 H ATOM 1352 HB2 GLU A 90 18.431 3.766 -20.626 1.00 0.00 H ATOM 1353 HB3 GLU A 90 16.858 3.539 -21.426 1.00 0.00 H ATOM 1354 HG2 GLU A 90 16.797 5.810 -21.181 1.00 0.00 H ATOM 1355 HG3 GLU A 90 16.117 5.355 -19.601 1.00 0.00 H ATOM 1356 H GLU A 90 18.596 3.652 -18.277 1.00 0.00 H ATOM 1357 N GLY A 91 18.108 1.000 -20.218 1.00 8.50 N ATOM 1358 CA GLY A 91 18.329 -0.289 -20.866 1.00 11.01 C ATOM 1359 C GLY A 91 17.800 -1.397 -19.971 1.00 12.60 C ATOM 1360 O GLY A 91 17.250 -2.399 -20.412 1.00 10.06 O ATOM 1361 HA3 GLY A 91 19.396 -0.434 -21.034 1.00 0.00 H ATOM 1362 HA2 GLY A 91 17.805 -0.311 -21.822 1.00 0.00 H ATOM 1363 H GLY A 91 18.939 1.517 -19.865 1.00 0.00 H ATOM 1364 N LEU A 92 17.980 -1.251 -18.663 1.00 3.93 N ATOM 1365 CA LEU A 92 17.471 -2.270 -17.781 1.00 4.68 C ATOM 1366 C LEU A 92 15.937 -2.281 -17.887 1.00 7.55 C ATOM 1367 O LEU A 92 15.287 -3.322 -17.910 1.00 9.36 O ATOM 1368 CB LEU A 92 17.860 -1.919 -16.302 1.00 9.79 C ATOM 1369 CG LEU A 92 17.230 -2.938 -15.335 1.00 14.90 C ATOM 1370 CD1 LEU A 92 17.984 -4.254 -15.527 1.00 16.61 C ATOM 1371 CD2 LEU A 92 17.400 -2.480 -13.906 1.00 44.12 C ATOM 1372 HA LEU A 92 17.887 -3.239 -18.055 1.00 0.00 H ATOM 1373 HB2 LEU A 92 18.945 -1.945 -16.198 1.00 0.00 H ATOM 1374 HB3 LEU A 92 17.497 -0.920 -16.061 1.00 0.00 H ATOM 1375 HG LEU A 92 16.165 -3.048 -15.537 1.00 0.00 H ATOM 1376 HD21 LEU A 92 18.462 -2.384 -13.680 1.00 0.00 H ATOM 1377 HD22 LEU A 92 16.911 -1.515 -13.775 1.00 0.00 H ATOM 1378 HD23 LEU A 92 16.949 -3.211 -13.235 1.00 0.00 H ATOM 1379 HD11 LEU A 92 17.879 -4.584 -16.560 1.00 0.00 H ATOM 1380 HD12 LEU A 92 19.039 -4.104 -15.298 1.00 0.00 H ATOM 1381 HD13 LEU A 92 17.570 -5.009 -14.859 1.00 0.00 H ATOM 1382 H LEU A 92 18.477 -0.420 -18.284 1.00 0.00 H ATOM 1383 N PHE A 93 15.307 -1.113 -18.014 1.00 11.76 N ATOM 1384 CA PHE A 93 13.853 -1.079 -18.139 1.00 9.44 C ATOM 1385 C PHE A 93 13.414 -1.835 -19.409 1.00 5.62 C ATOM 1386 O PHE A 93 12.508 -2.647 -19.409 1.00 4.01 O ATOM 1387 CB PHE A 93 13.442 0.382 -18.150 1.00 8.68 C ATOM 1388 CG PHE A 93 11.980 0.534 -18.301 1.00 3.21 C ATOM 1389 CD1 PHE A 93 11.116 0.332 -17.227 1.00 11.53 C ATOM 1390 CD2 PHE A 93 11.415 0.898 -19.526 1.00 11.59 C ATOM 1391 CE1 PHE A 93 9.735 0.466 -17.361 1.00 12.00 C ATOM 1392 CE2 PHE A 93 10.035 1.041 -19.666 1.00 12.29 C ATOM 1393 CZ PHE A 93 9.185 0.817 -18.590 1.00 10.50 C ATOM 1394 HA PHE A 93 13.361 -1.581 -17.306 1.00 0.00 H ATOM 1395 HB2 PHE A 93 13.751 0.844 -17.212 1.00 0.00 H ATOM 1396 HB3 PHE A 93 13.938 0.883 -18.981 1.00 0.00 H ATOM 1397 HD2 PHE A 93 12.063 1.073 -20.385 1.00 0.00 H ATOM 1398 HE2 PHE A 93 9.618 1.332 -20.630 1.00 0.00 H ATOM 1399 HZ PHE A 93 8.106 0.915 -18.707 1.00 0.00 H ATOM 1400 HE1 PHE A 93 9.085 0.296 -16.502 1.00 0.00 H ATOM 1401 HD1 PHE A 93 11.531 0.062 -16.256 1.00 0.00 H ATOM 1402 H PHE A 93 15.851 -0.227 -18.024 1.00 0.00 H ATOM 1403 N TRP A 94 14.068 -1.578 -20.526 1.00 5.77 N ATOM 1404 CA TRP A 94 13.695 -2.306 -21.767 1.00 6.26 C ATOM 1405 C TRP A 94 13.802 -3.799 -21.590 1.00 11.13 C ATOM 1406 O TRP A 94 12.920 -4.593 -22.007 1.00 12.08 O ATOM 1407 CB TRP A 94 14.650 -1.900 -22.855 1.00 6.91 C ATOM 1408 CG TRP A 94 14.260 -2.485 -24.170 1.00 6.98 C ATOM 1409 CD1 TRP A 94 14.482 -3.755 -24.662 1.00 10.53 C ATOM 1410 CD2 TRP A 94 13.550 -1.776 -25.168 1.00 9.24 C ATOM 1411 NE1 TRP A 94 13.989 -3.897 -25.946 1.00 9.29 N ATOM 1412 CE2 TRP A 94 13.411 -2.667 -26.271 1.00 4.55 C ATOM 1413 CE3 TRP A 94 13.082 -0.442 -25.256 1.00 6.82 C ATOM 1414 CZ2 TRP A 94 12.736 -2.235 -27.419 1.00 13.53 C ATOM 1415 CZ3 TRP A 94 12.412 -0.019 -26.417 1.00 9.38 C ATOM 1416 CH2 TRP A 94 12.254 -0.921 -27.493 1.00 15.22 C ATOM 1417 HA TRP A 94 12.663 -2.057 -22.014 1.00 0.00 H ATOM 1418 HB2 TRP A 94 14.653 -0.813 -22.937 1.00 0.00 H ATOM 1419 HB3 TRP A 94 15.651 -2.246 -22.596 1.00 0.00 H ATOM 1420 HE1 TRP A 94 14.038 -4.745 -26.546 1.00 0.00 H ATOM 1421 HD1 TRP A 94 14.984 -4.548 -24.107 1.00 0.00 H ATOM 1422 HZ2 TRP A 94 12.586 -2.919 -28.254 1.00 0.00 H ATOM 1423 HH2 TRP A 94 11.747 -0.588 -28.399 1.00 0.00 H ATOM 1424 HZ3 TRP A 94 12.018 0.995 -26.487 1.00 0.00 H ATOM 1425 HE3 TRP A 94 13.240 0.251 -24.430 1.00 0.00 H ATOM 1426 H TRP A 94 14.834 -0.875 -20.538 1.00 0.00 H ATOM 1427 N LEU A 95 14.884 -4.225 -20.937 1.00 8.49 N ATOM 1428 CA LEU A 95 15.059 -5.650 -20.729 1.00 4.79 C ATOM 1429 C LEU A 95 13.943 -6.236 -19.896 1.00 7.55 C ATOM 1430 O LEU A 95 13.411 -7.306 -20.179 1.00 11.98 O ATOM 1431 CB LEU A 95 16.420 -5.897 -20.020 1.00 4.52 C ATOM 1432 CG LEU A 95 16.617 -7.294 -19.395 1.00 10.26 C ATOM 1433 CD1 LEU A 95 16.832 -8.307 -20.516 1.00 9.27 C ATOM 1434 CD2 LEU A 95 17.939 -7.327 -18.642 1.00 10.27 C ATOM 1435 HA LEU A 95 15.041 -6.141 -21.702 1.00 0.00 H ATOM 1436 HB2 LEU A 95 17.211 -5.746 -20.755 1.00 0.00 H ATOM 1437 HB3 LEU A 95 16.520 -5.159 -19.224 1.00 0.00 H ATOM 1438 HG LEU A 95 15.754 -7.509 -18.764 1.00 0.00 H ATOM 1439 HD21 LEU A 95 18.755 -7.118 -19.334 1.00 0.00 H ATOM 1440 HD22 LEU A 95 17.926 -6.573 -17.855 1.00 0.00 H ATOM 1441 HD23 LEU A 95 18.079 -8.313 -18.200 1.00 0.00 H ATOM 1442 HD11 LEU A 95 15.960 -8.313 -21.170 1.00 0.00 H ATOM 1443 HD12 LEU A 95 17.716 -8.030 -21.090 1.00 0.00 H ATOM 1444 HD13 LEU A 95 16.972 -9.299 -20.086 1.00 0.00 H ATOM 1445 H LEU A 95 15.590 -3.548 -20.583 1.00 0.00 H ATOM 1446 N LEU A 96 13.554 -5.513 -18.801 1.00 7.80 N ATOM 1447 CA LEU A 96 12.525 -6.044 -17.906 1.00 5.66 C ATOM 1448 C LEU A 96 11.195 -6.137 -18.611 1.00 11.23 C ATOM 1449 O LEU A 96 10.467 -7.078 -18.440 1.00 10.82 O ATOM 1450 CB LEU A 96 12.222 -5.135 -16.673 1.00 4.61 C ATOM 1451 CG LEU A 96 13.398 -4.957 -15.715 1.00 11.38 C ATOM 1452 CD1 LEU A 96 12.941 -4.088 -14.539 1.00 13.55 C ATOM 1453 CD2 LEU A 96 13.834 -6.315 -15.166 1.00 21.60 C ATOM 1454 HA LEU A 96 12.931 -7.005 -17.591 1.00 0.00 H ATOM 1455 HB2 LEU A 96 11.928 -4.151 -17.039 1.00 0.00 H ATOM 1456 HB3 LEU A 96 11.394 -5.577 -16.118 1.00 0.00 H ATOM 1457 HG LEU A 96 14.229 -4.492 -16.245 1.00 0.00 H ATOM 1458 HD21 LEU A 96 13.002 -6.774 -14.632 1.00 0.00 H ATOM 1459 HD22 LEU A 96 14.137 -6.959 -15.992 1.00 0.00 H ATOM 1460 HD23 LEU A 96 14.673 -6.177 -14.484 1.00 0.00 H ATOM 1461 HD11 LEU A 96 12.614 -3.117 -14.912 1.00 0.00 H ATOM 1462 HD12 LEU A 96 12.114 -4.579 -14.026 1.00 0.00 H ATOM 1463 HD13 LEU A 96 13.771 -3.952 -13.846 1.00 0.00 H ATOM 1464 H LEU A 96 13.989 -4.589 -18.605 1.00 0.00 H ATOM 1465 N VAL A 97 10.888 -5.106 -19.374 1.00 11.28 N ATOM 1466 CA VAL A 97 9.626 -5.102 -20.039 1.00 6.59 C ATOM 1467 C VAL A 97 9.517 -6.079 -21.205 1.00 7.21 C ATOM 1468 O VAL A 97 8.489 -6.730 -21.326 1.00 7.95 O ATOM 1469 CB VAL A 97 9.440 -3.696 -20.543 1.00 16.27 C ATOM 1470 CG1 VAL A 97 8.473 -3.749 -21.688 1.00 21.95 C ATOM 1471 CG2 VAL A 97 8.858 -2.889 -19.400 1.00 17.75 C ATOM 1472 HA VAL A 97 8.859 -5.425 -19.335 1.00 0.00 H ATOM 1473 HB VAL A 97 10.374 -3.245 -20.879 1.00 0.00 H ATOM 1474 HG11 VAL A 97 8.878 -4.385 -22.475 1.00 0.00 H ATOM 1475 HG12 VAL A 97 7.524 -4.158 -21.342 1.00 0.00 H ATOM 1476 HG13 VAL A 97 8.317 -2.743 -22.077 1.00 0.00 H ATOM 1477 HG21 VAL A 97 7.903 -3.321 -19.101 1.00 0.00 H ATOM 1478 HG22 VAL A 97 9.547 -2.908 -18.556 1.00 0.00 H ATOM 1479 HG23 VAL A 97 8.707 -1.859 -19.724 1.00 0.00 H ATOM 1480 H VAL A 97 11.551 -4.313 -19.488 1.00 0.00 H ATOM 1481 N THR A 98 10.529 -6.165 -22.054 1.00 7.77 N ATOM 1482 CA THR A 98 10.484 -7.086 -23.230 1.00 3.88 C ATOM 1483 C THR A 98 11.198 -8.408 -23.049 1.00 17.79 C ATOM 1484 O THR A 98 10.963 -9.332 -23.818 1.00 15.58 O ATOM 1485 CB THR A 98 11.204 -6.414 -24.409 1.00 6.72 C ATOM 1486 OG1 THR A 98 12.625 -6.376 -24.171 1.00 5.92 O ATOM 1487 CG2 THR A 98 10.651 -5.024 -24.696 1.00 14.70 C ATOM 1488 HA THR A 98 9.423 -7.283 -23.382 1.00 0.00 H ATOM 1489 HB THR A 98 11.019 -7.014 -25.300 1.00 0.00 H ATOM 1490 HG1 THR A 98 12.806 -5.861 -23.345 1.00 0.00 H ATOM 1491 HG23 THR A 98 9.577 -5.091 -24.871 1.00 0.00 H ATOM 1492 HG21 THR A 98 10.842 -4.375 -23.841 1.00 0.00 H ATOM 1493 HG22 THR A 98 11.140 -4.615 -25.581 1.00 0.00 H ATOM 1494 H THR A 98 11.374 -5.579 -21.899 1.00 0.00 H ATOM 1495 N GLY A 99 12.097 -8.515 -22.072 1.00 8.92 N ATOM 1496 CA GLY A 99 12.814 -9.757 -21.898 1.00 6.44 C ATOM 1497 C GLY A 99 13.985 -9.816 -22.878 1.00 8.92 C ATOM 1498 O GLY A 99 14.675 -10.829 -22.969 1.00 18.43 O ATOM 1499 HA3 GLY A 99 12.141 -10.594 -22.086 1.00 0.00 H ATOM 1500 HA2 GLY A 99 13.192 -9.818 -20.877 1.00 0.00 H ATOM 1501 H GLY A 99 12.281 -7.711 -21.439 1.00 0.00 H ATOM 1502 N GLN A 100 14.237 -8.742 -23.635 1.00 12.05 N ATOM 1503 CA GLN A 100 15.345 -8.773 -24.552 1.00 11.20 C ATOM 1504 C GLN A 100 16.245 -7.615 -24.237 1.00 10.00 C ATOM 1505 O GLN A 100 15.742 -6.551 -23.865 1.00 12.65 O ATOM 1506 CB GLN A 100 14.949 -8.488 -26.016 1.00 14.93 C ATOM 1507 CG GLN A 100 13.838 -9.350 -26.625 1.00 37.45 C ATOM 1508 CD GLN A 100 13.300 -8.617 -27.837 1.00 80.00 C ATOM 1509 OE1 GLN A 100 13.684 -7.448 -28.091 1.00 80.00 O ATOM 1510 NE2 GLN A 100 12.398 -9.280 -28.563 1.00 80.00 N ATOM 1511 HA GLN A 100 15.779 -9.768 -24.449 1.00 0.00 H ATOM 1512 HB2 GLN A 100 14.625 -7.449 -26.071 1.00 0.00 H ATOM 1513 HB3 GLN A 100 15.841 -8.622 -26.629 1.00 0.00 H ATOM 1514 HG2 GLN A 100 14.240 -10.318 -26.924 1.00 0.00 H ATOM 1515 HG3 GLN A 100 13.041 -9.499 -25.896 1.00 0.00 H ATOM 1516 HE22 GLN A 100 12.125 -10.247 -28.296 1.00 0.00 H ATOM 1517 HE21 GLN A 100 11.968 -8.829 -29.396 1.00 0.00 H ATOM 1518 H GLN A 100 13.639 -7.894 -23.561 1.00 0.00 H ATOM 1519 N ILE A 101 17.540 -7.873 -24.465 1.00 8.15 N ATOM 1520 CA ILE A 101 18.630 -6.895 -24.291 1.00 14.99 C ATOM 1521 C ILE A 101 18.447 -5.860 -25.382 1.00 12.38 C ATOM 1522 O ILE A 101 18.351 -6.178 -26.583 1.00 16.41 O ATOM 1523 CB ILE A 101 20.016 -7.518 -24.405 1.00 25.84 C ATOM 1524 CG1 ILE A 101 20.195 -8.517 -23.255 1.00 26.18 C ATOM 1525 CG2 ILE A 101 21.101 -6.425 -24.345 1.00 19.29 C ATOM 1526 CD1 ILE A 101 21.291 -8.087 -22.289 1.00 78.75 C ATOM 1527 HA ILE A 101 18.576 -6.468 -23.289 1.00 0.00 H ATOM 1528 HB ILE A 101 20.114 -8.034 -25.360 1.00 0.00 H ATOM 1529 HG12 ILE A 101 19.255 -8.596 -22.708 1.00 0.00 H ATOM 1530 HG13 ILE A 101 20.455 -9.490 -23.671 1.00 0.00 H ATOM 1531 HD11 ILE A 101 22.237 -8.012 -22.825 1.00 0.00 H ATOM 1532 HD12 ILE A 101 21.036 -7.117 -21.861 1.00 0.00 H ATOM 1533 HD13 ILE A 101 21.381 -8.825 -21.492 1.00 0.00 H ATOM 1534 HG21 ILE A 101 20.956 -5.725 -25.168 1.00 0.00 H ATOM 1535 HG22 ILE A 101 21.027 -5.893 -23.397 1.00 0.00 H ATOM 1536 HG23 ILE A 101 22.085 -6.887 -24.428 1.00 0.00 H ATOM 1537 H ILE A 101 17.794 -8.829 -24.787 1.00 0.00 H ATOM 1538 N PRO A 102 18.370 -4.621 -24.996 1.00 6.10 N ATOM 1539 CA PRO A 102 18.140 -3.631 -26.033 1.00 10.51 C ATOM 1540 C PRO A 102 19.374 -3.142 -26.713 1.00 15.91 C ATOM 1541 O PRO A 102 20.479 -3.347 -26.225 1.00 11.78 O ATOM 1542 CB PRO A 102 17.646 -2.360 -25.316 1.00 14.21 C ATOM 1543 CG PRO A 102 18.268 -2.452 -23.930 1.00 10.12 C ATOM 1544 CD PRO A 102 18.479 -3.947 -23.661 1.00 10.92 C ATOM 1545 HA PRO A 102 17.475 -4.102 -26.757 1.00 0.00 H ATOM 1546 HD3 PRO A 102 19.464 -4.120 -23.227 1.00 0.00 H ATOM 1547 HD2 PRO A 102 17.714 -4.323 -22.982 1.00 0.00 H ATOM 1548 HG3 PRO A 102 17.598 -2.023 -23.185 1.00 0.00 H ATOM 1549 HG2 PRO A 102 19.221 -1.924 -23.906 1.00 0.00 H ATOM 1550 HB2 PRO A 102 17.987 -1.465 -25.835 1.00 0.00 H ATOM 1551 HB3 PRO A 102 16.558 -2.349 -25.253 1.00 0.00 H ATOM 1552 N THR A 103 19.143 -2.471 -27.855 1.00 12.13 N ATOM 1553 CA THR A 103 20.231 -1.874 -28.623 1.00 19.31 C ATOM 1554 C THR A 103 20.461 -0.487 -28.045 1.00 19.38 C ATOM 1555 O THR A 103 19.643 0.050 -27.315 1.00 14.81 O ATOM 1556 CB THR A 103 19.992 -1.789 -30.128 1.00 14.24 C ATOM 1557 OG1 THR A 103 18.959 -0.825 -30.345 1.00 15.40 O ATOM 1558 CG2 THR A 103 19.609 -3.189 -30.617 1.00 7.92 C ATOM 1559 HA THR A 103 21.102 -2.523 -28.531 1.00 0.00 H ATOM 1560 HB THR A 103 20.873 -1.470 -30.684 1.00 0.00 H ATOM 1561 HG1 THR A 103 18.781 -0.747 -31.316 1.00 0.00 H ATOM 1562 HG23 THR A 103 20.432 -3.877 -30.425 1.00 0.00 H ATOM 1563 HG21 THR A 103 18.720 -3.527 -30.085 1.00 0.00 H ATOM 1564 HG22 THR A 103 19.403 -3.155 -31.687 1.00 0.00 H ATOM 1565 H THR A 103 18.166 -2.375 -28.199 1.00 0.00 H ATOM 1566 N PRO A 104 21.586 0.110 -28.364 1.00 14.54 N ATOM 1567 CA PRO A 104 21.829 1.421 -27.821 1.00 18.48 C ATOM 1568 C PRO A 104 20.849 2.381 -28.445 1.00 12.98 C ATOM 1569 O PRO A 104 20.455 3.392 -27.893 1.00 13.44 O ATOM 1570 CB PRO A 104 23.272 1.792 -28.170 1.00 19.41 C ATOM 1571 CG PRO A 104 23.917 0.500 -28.644 1.00 29.50 C ATOM 1572 CD PRO A 104 22.841 -0.587 -28.673 1.00 16.39 C ATOM 1573 HA PRO A 104 21.697 1.454 -26.739 1.00 0.00 H ATOM 1574 HD3 PRO A 104 22.790 -1.049 -29.659 1.00 0.00 H ATOM 1575 HD2 PRO A 104 23.049 -1.352 -27.925 1.00 0.00 H ATOM 1576 HG3 PRO A 104 24.715 0.212 -27.959 1.00 0.00 H ATOM 1577 HG2 PRO A 104 24.330 0.638 -29.643 1.00 0.00 H ATOM 1578 HB2 PRO A 104 23.293 2.542 -28.961 1.00 0.00 H ATOM 1579 HB3 PRO A 104 23.790 2.178 -27.292 1.00 0.00 H ATOM 1580 N GLU A 105 20.425 2.030 -29.655 1.00 12.23 N ATOM 1581 CA GLU A 105 19.483 2.899 -30.303 1.00 12.02 C ATOM 1582 C GLU A 105 18.162 2.899 -29.537 1.00 14.81 C ATOM 1583 O GLU A 105 17.529 3.926 -29.327 1.00 15.51 O ATOM 1584 CB GLU A 105 19.265 2.486 -31.772 1.00 12.58 C ATOM 1585 CG GLU A 105 20.399 2.993 -32.647 1.00 24.87 C ATOM 1586 CD GLU A 105 21.662 2.171 -32.507 1.00 30.78 C ATOM 1587 OE1 GLU A 105 21.424 0.879 -32.256 1.00 27.32 O ATOM 1588 OE2 GLU A 105 22.778 2.666 -32.678 1.00 34.73 O ATOM 1589 HA GLU A 105 19.889 3.910 -30.303 1.00 0.00 H ATOM 1590 HB2 GLU A 105 19.222 1.399 -31.836 1.00 0.00 H ATOM 1591 HB3 GLU A 105 18.324 2.907 -32.126 1.00 0.00 H ATOM 1592 HG2 GLU A 105 20.077 2.962 -33.688 1.00 0.00 H ATOM 1593 HG3 GLU A 105 20.621 4.023 -32.367 1.00 0.00 H ATOM 1594 H GLU A 105 20.762 1.160 -30.114 1.00 0.00 H ATOM 1595 N GLN A 106 17.768 1.707 -29.143 1.00 9.78 N ATOM 1596 CA GLN A 106 16.525 1.571 -28.397 1.00 8.77 C ATOM 1597 C GLN A 106 16.634 2.267 -27.054 1.00 16.65 C ATOM 1598 O GLN A 106 15.663 2.857 -26.585 1.00 15.15 O ATOM 1599 CB GLN A 106 16.274 0.102 -28.189 1.00 5.98 C ATOM 1600 CG GLN A 106 15.535 -0.455 -29.434 1.00 8.67 C ATOM 1601 CD GLN A 106 15.694 -1.941 -29.561 1.00 16.61 C ATOM 1602 OE1 GLN A 106 15.112 -2.535 -30.456 1.00 30.98 O ATOM 1603 NE2 GLN A 106 16.421 -2.582 -28.678 1.00 10.01 N ATOM 1604 HA GLN A 106 15.705 2.029 -28.950 1.00 0.00 H ATOM 1605 HB2 GLN A 106 17.223 -0.419 -28.062 1.00 0.00 H ATOM 1606 HB3 GLN A 106 15.659 -0.044 -27.301 1.00 0.00 H ATOM 1607 HG2 GLN A 106 14.474 -0.220 -29.349 1.00 0.00 H ATOM 1608 HG3 GLN A 106 15.941 0.021 -30.327 1.00 0.00 H ATOM 1609 HE22 GLN A 106 16.908 -2.056 -27.925 1.00 0.00 H ATOM 1610 HE21 GLN A 106 16.511 -3.617 -28.731 1.00 0.00 H ATOM 1611 H GLN A 106 18.341 0.867 -29.363 1.00 0.00 H ATOM 1612 N VAL A 107 17.839 2.194 -26.465 1.00 10.39 N ATOM 1613 CA VAL A 107 18.082 2.814 -25.182 1.00 13.40 C ATOM 1614 C VAL A 107 17.944 4.320 -25.320 1.00 17.77 C ATOM 1615 O VAL A 107 17.316 5.032 -24.527 1.00 11.82 O ATOM 1616 CB VAL A 107 19.430 2.366 -24.628 1.00 16.03 C ATOM 1617 CG1 VAL A 107 19.868 3.216 -23.458 1.00 17.09 C ATOM 1618 CG2 VAL A 107 19.371 0.940 -24.125 1.00 14.67 C ATOM 1619 HA VAL A 107 17.339 2.494 -24.451 1.00 0.00 H ATOM 1620 HB VAL A 107 20.134 2.462 -25.455 1.00 0.00 H ATOM 1621 HG11 VAL A 107 19.957 4.254 -23.778 1.00 0.00 H ATOM 1622 HG12 VAL A 107 19.129 3.143 -22.660 1.00 0.00 H ATOM 1623 HG13 VAL A 107 20.833 2.862 -23.095 1.00 0.00 H ATOM 1624 HG21 VAL A 107 18.627 0.866 -23.331 1.00 0.00 H ATOM 1625 HG22 VAL A 107 19.095 0.278 -24.946 1.00 0.00 H ATOM 1626 HG23 VAL A 107 20.348 0.652 -23.737 1.00 0.00 H ATOM 1627 H VAL A 107 18.610 1.683 -26.940 1.00 0.00 H ATOM 1628 N SER A 108 18.501 4.896 -26.364 1.00 9.67 N ATOM 1629 CA SER A 108 18.319 6.355 -26.445 1.00 13.16 C ATOM 1630 C SER A 108 16.879 6.780 -26.703 1.00 8.12 C ATOM 1631 O SER A 108 16.409 7.910 -26.424 1.00 10.21 O ATOM 1632 CB SER A 108 19.275 7.021 -27.416 1.00 26.21 C ATOM 1633 OG SER A 108 19.364 6.136 -28.474 1.00 37.74 O ATOM 1634 HA SER A 108 18.572 6.715 -25.448 1.00 0.00 H ATOM 1635 HB2 SER A 108 20.251 7.171 -26.955 1.00 0.00 H ATOM 1636 HB3 SER A 108 18.881 7.981 -27.748 1.00 0.00 H ATOM 1637 HG SER A 108 19.712 5.268 -28.148 1.00 0.00 H ATOM 1638 H SER A 108 19.031 4.360 -27.080 1.00 0.00 H ATOM 1639 N TRP A 109 16.095 5.849 -27.259 1.00 13.21 N ATOM 1640 CA TRP A 109 14.710 6.266 -27.468 1.00 10.70 C ATOM 1641 C TRP A 109 14.051 6.402 -26.107 1.00 9.80 C ATOM 1642 O TRP A 109 13.309 7.351 -25.849 1.00 11.14 O ATOM 1643 CB TRP A 109 13.994 5.160 -28.271 1.00 9.82 C ATOM 1644 CG TRP A 109 12.557 5.464 -28.394 1.00 13.32 C ATOM 1645 CD1 TRP A 109 11.987 6.274 -29.276 1.00 12.48 C ATOM 1646 CD2 TRP A 109 11.519 4.931 -27.559 1.00 7.91 C ATOM 1647 NE1 TRP A 109 10.628 6.301 -29.069 1.00 14.48 N ATOM 1648 CE2 TRP A 109 10.300 5.457 -28.031 1.00 12.92 C ATOM 1649 CE3 TRP A 109 11.536 4.049 -26.479 1.00 9.66 C ATOM 1650 CZ2 TRP A 109 9.069 5.144 -27.427 1.00 11.17 C ATOM 1651 CZ3 TRP A 109 10.326 3.731 -25.892 1.00 14.90 C ATOM 1652 CH2 TRP A 109 9.120 4.269 -26.378 1.00 13.97 C ATOM 1653 HA TRP A 109 14.659 7.212 -28.006 1.00 0.00 H ATOM 1654 HB2 TRP A 109 14.434 5.096 -29.266 1.00 0.00 H ATOM 1655 HB3 TRP A 109 14.117 4.206 -27.758 1.00 0.00 H ATOM 1656 HE1 TRP A 109 9.950 6.872 -29.614 1.00 0.00 H ATOM 1657 HD1 TRP A 109 12.516 6.833 -30.048 1.00 0.00 H ATOM 1658 HZ2 TRP A 109 8.130 5.574 -27.775 1.00 0.00 H ATOM 1659 HH2 TRP A 109 8.187 3.976 -25.898 1.00 0.00 H ATOM 1660 HZ3 TRP A 109 10.305 3.053 -25.039 1.00 0.00 H ATOM 1661 HE3 TRP A 109 12.470 3.625 -26.111 1.00 0.00 H ATOM 1662 H TRP A 109 16.443 4.905 -27.521 1.00 0.00 H ATOM 1663 N VAL A 110 14.360 5.471 -25.210 1.00 6.66 N ATOM 1664 CA VAL A 110 13.759 5.509 -23.850 1.00 5.65 C ATOM 1665 C VAL A 110 14.121 6.842 -23.185 1.00 10.96 C ATOM 1666 O VAL A 110 13.275 7.533 -22.625 1.00 5.20 O ATOM 1667 CB VAL A 110 14.175 4.318 -22.988 1.00 10.09 C ATOM 1668 CG1 VAL A 110 13.542 4.417 -21.593 1.00 8.12 C ATOM 1669 CG2 VAL A 110 13.763 3.005 -23.666 1.00 12.77 C ATOM 1670 HA VAL A 110 12.676 5.432 -23.949 1.00 0.00 H ATOM 1671 HB VAL A 110 15.259 4.332 -22.877 1.00 0.00 H ATOM 1672 HG11 VAL A 110 13.872 5.337 -21.110 1.00 0.00 H ATOM 1673 HG12 VAL A 110 12.456 4.424 -21.688 1.00 0.00 H ATOM 1674 HG13 VAL A 110 13.850 3.560 -20.994 1.00 0.00 H ATOM 1675 HG21 VAL A 110 12.681 2.990 -23.799 1.00 0.00 H ATOM 1676 HG22 VAL A 110 14.251 2.931 -24.638 1.00 0.00 H ATOM 1677 HG23 VAL A 110 14.065 2.165 -23.041 1.00 0.00 H ATOM 1678 H VAL A 110 15.025 4.712 -25.460 1.00 0.00 H ATOM 1679 N SER A 111 15.416 7.175 -23.293 1.00 8.74 N ATOM 1680 CA SER A 111 15.906 8.406 -22.723 1.00 11.88 C ATOM 1681 C SER A 111 15.170 9.612 -23.237 1.00 12.70 C ATOM 1682 O SER A 111 14.852 10.520 -22.494 1.00 13.08 O ATOM 1683 CB SER A 111 17.368 8.668 -22.998 1.00 13.13 C ATOM 1684 OG SER A 111 18.169 7.652 -22.493 1.00 10.36 O ATOM 1685 HA SER A 111 15.745 8.264 -21.654 1.00 0.00 H ATOM 1686 HB2 SER A 111 17.654 9.610 -22.531 1.00 0.00 H ATOM 1687 HB3 SER A 111 17.520 8.737 -24.075 1.00 0.00 H ATOM 1688 HG SER A 111 18.040 7.587 -21.514 1.00 0.00 H ATOM 1689 H SER A 111 16.072 6.540 -23.792 1.00 0.00 H ATOM 1690 N LYS A 112 14.913 9.681 -24.536 1.00 7.63 N ATOM 1691 CA LYS A 112 14.195 10.840 -25.057 1.00 9.96 C ATOM 1692 C LYS A 112 12.721 10.838 -24.633 1.00 9.66 C ATOM 1693 O LYS A 112 12.142 11.890 -24.307 1.00 14.67 O ATOM 1694 CB LYS A 112 14.228 10.894 -26.589 1.00 16.57 C ATOM 1695 CG LYS A 112 15.408 11.650 -27.184 1.00 41.21 C ATOM 1696 CD LYS A 112 16.038 10.976 -28.399 1.00 52.85 C ATOM 1697 CE LYS A 112 15.088 10.090 -29.205 1.00 80.00 C ATOM 1698 NZ LYS A 112 15.767 8.993 -29.938 1.00 35.98 N ATOM 1699 HA LYS A 112 14.706 11.708 -24.640 1.00 0.00 H ATOM 1700 HB2 LYS A 112 14.260 9.870 -26.963 1.00 0.00 H ATOM 1701 HB3 LYS A 112 13.312 11.376 -26.930 1.00 0.00 H ATOM 1702 HG2 LYS A 112 15.064 12.640 -27.483 1.00 0.00 H ATOM 1703 HG3 LYS A 112 16.173 11.750 -26.414 1.00 0.00 H ATOM 1704 HD2 LYS A 112 16.419 11.755 -29.060 1.00 0.00 H ATOM 1705 HD3 LYS A 112 16.867 10.358 -28.053 1.00 0.00 H ATOM 1706 HE2 LYS A 112 14.566 10.715 -29.929 1.00 0.00 H ATOM 1707 HE3 LYS A 112 14.365 9.649 -28.519 1.00 0.00 H ATOM 1708 HZ1 LYS A 112 16.454 9.397 -30.606 1.00 0.00 H ATOM 1709 HZ2 LYS A 112 16.262 8.379 -29.260 1.00 0.00 H ATOM 1710 HZ3 LYS A 112 15.060 8.437 -30.460 1.00 0.00 H ATOM 1711 H LYS A 112 15.219 8.920 -25.175 1.00 0.00 H ATOM 1712 N GLU A 113 12.117 9.626 -24.617 1.00 10.11 N ATOM 1713 CA GLU A 113 10.742 9.535 -24.222 1.00 6.73 C ATOM 1714 C GLU A 113 10.582 10.031 -22.803 1.00 10.64 C ATOM 1715 O GLU A 113 9.651 10.742 -22.482 1.00 10.52 O ATOM 1716 CB GLU A 113 10.297 8.067 -24.341 1.00 10.74 C ATOM 1717 CG GLU A 113 8.788 7.918 -24.561 1.00 24.26 C ATOM 1718 CD GLU A 113 8.224 8.735 -25.694 1.00 14.82 C ATOM 1719 OE1 GLU A 113 8.777 8.874 -26.749 1.00 19.72 O ATOM 1720 OE2 GLU A 113 7.056 9.251 -25.463 1.00 26.86 O ATOM 1721 HA GLU A 113 10.120 10.155 -24.868 1.00 0.00 H ATOM 1722 HB2 GLU A 113 10.818 7.612 -25.183 1.00 0.00 H ATOM 1723 HB3 GLU A 113 10.568 7.545 -23.423 1.00 0.00 H ATOM 1724 HG2 GLU A 113 8.578 6.868 -24.764 1.00 0.00 H ATOM 1725 HG3 GLU A 113 8.281 8.217 -23.643 1.00 0.00 H ATOM 1726 H GLU A 113 12.644 8.772 -24.888 1.00 0.00 H ATOM 1727 N TRP A 114 11.486 9.622 -21.926 1.00 11.27 N ATOM 1728 CA TRP A 114 11.391 10.041 -20.538 1.00 14.91 C ATOM 1729 C TRP A 114 11.685 11.534 -20.382 1.00 13.80 C ATOM 1730 O TRP A 114 11.162 12.195 -19.488 1.00 20.96 O ATOM 1731 CB TRP A 114 12.219 9.167 -19.564 1.00 4.92 C ATOM 1732 CG TRP A 114 11.732 7.738 -19.403 1.00 5.35 C ATOM 1733 CD1 TRP A 114 10.557 7.205 -19.819 1.00 5.46 C ATOM 1734 CD2 TRP A 114 12.463 6.686 -18.778 1.00 6.32 C ATOM 1735 NE1 TRP A 114 10.493 5.865 -19.504 1.00 10.81 N ATOM 1736 CE2 TRP A 114 11.661 5.531 -18.881 1.00 9.16 C ATOM 1737 CE3 TRP A 114 13.742 6.631 -18.194 1.00 7.47 C ATOM 1738 CZ2 TRP A 114 12.071 4.332 -18.399 1.00 3.22 C ATOM 1739 CZ3 TRP A 114 14.143 5.420 -17.707 1.00 10.90 C ATOM 1740 CH2 TRP A 114 13.320 4.270 -17.809 1.00 14.32 C ATOM 1741 HA TRP A 114 10.354 9.880 -20.244 1.00 0.00 H ATOM 1742 HB2 TRP A 114 13.245 9.134 -19.929 1.00 0.00 H ATOM 1743 HB3 TRP A 114 12.199 9.643 -18.584 1.00 0.00 H ATOM 1744 HE1 TRP A 114 9.699 5.224 -19.705 1.00 0.00 H ATOM 1745 HD1 TRP A 114 9.771 7.760 -20.332 1.00 0.00 H ATOM 1746 HZ2 TRP A 114 11.438 3.448 -18.474 1.00 0.00 H ATOM 1747 HH2 TRP A 114 13.679 3.319 -17.415 1.00 0.00 H ATOM 1748 HZ3 TRP A 114 15.119 5.335 -17.229 1.00 0.00 H ATOM 1749 HE3 TRP A 114 14.381 7.512 -18.133 1.00 0.00 H ATOM 1750 H TRP A 114 12.263 9.002 -22.230 1.00 0.00 H ATOM 1751 N ALA A 115 12.511 12.104 -21.262 1.00 9.59 N ATOM 1752 CA ALA A 115 12.785 13.513 -21.095 1.00 7.51 C ATOM 1753 C ALA A 115 11.579 14.299 -21.574 1.00 18.41 C ATOM 1754 O ALA A 115 11.248 15.360 -21.027 1.00 15.09 O ATOM 1755 CB ALA A 115 14.067 13.908 -21.841 1.00 12.74 C ATOM 1756 HA ALA A 115 12.956 13.742 -20.043 1.00 0.00 H ATOM 1757 HB1 ALA A 115 14.907 13.336 -21.446 1.00 0.00 H ATOM 1758 HB2 ALA A 115 13.948 13.695 -22.903 1.00 0.00 H ATOM 1759 HB3 ALA A 115 14.254 14.973 -21.701 1.00 0.00 H ATOM 1760 H ALA A 115 12.940 11.557 -22.036 1.00 0.00 H ATOM 1761 N LYS A 116 10.913 13.741 -22.591 1.00 18.61 N ATOM 1762 CA LYS A 116 9.740 14.351 -23.189 1.00 10.63 C ATOM 1763 C LYS A 116 8.550 14.384 -22.273 1.00 16.10 C ATOM 1764 O LYS A 116 7.757 15.307 -22.325 1.00 17.07 O ATOM 1765 CB LYS A 116 9.162 13.598 -24.396 1.00 22.70 C ATOM 1766 CG LYS A 116 10.123 13.396 -25.545 1.00 48.12 C ATOM 1767 CD LYS A 116 9.410 12.939 -26.819 1.00 50.35 C ATOM 1768 CE LYS A 116 9.626 11.477 -27.264 1.00 80.00 C ATOM 1769 NZ LYS A 116 10.888 10.768 -26.907 1.00 80.00 N ATOM 1770 HA LYS A 116 10.138 15.332 -23.449 1.00 0.00 H ATOM 1771 HB2 LYS A 116 8.831 12.617 -24.056 1.00 0.00 H ATOM 1772 HB3 LYS A 116 8.305 14.161 -24.767 1.00 0.00 H ATOM 1773 HG2 LYS A 116 10.633 14.338 -25.746 1.00 0.00 H ATOM 1774 HG3 LYS A 116 10.856 12.640 -25.262 1.00 0.00 H ATOM 1775 HD2 LYS A 116 8.340 13.080 -26.665 1.00 0.00 H ATOM 1776 HD3 LYS A 116 9.747 13.582 -27.632 1.00 0.00 H ATOM 1777 HE2 LYS A 116 9.555 11.465 -28.352 1.00 0.00 H ATOM 1778 HE3 LYS A 116 8.807 10.895 -26.841 1.00 0.00 H ATOM 1779 HZ1 LYS A 116 11.698 11.278 -27.314 1.00 0.00 H ATOM 1780 HZ2 LYS A 116 10.984 10.733 -25.872 1.00 0.00 H ATOM 1781 HZ3 LYS A 116 10.860 9.800 -27.286 1.00 0.00 H ATOM 1782 H LYS A 116 11.250 12.832 -22.969 1.00 0.00 H ATOM 1783 N ARG A 117 8.395 13.373 -21.454 1.00 14.52 N ATOM 1784 CA ARG A 117 7.253 13.273 -20.547 1.00 6.39 C ATOM 1785 C ARG A 117 7.404 13.878 -19.174 1.00 12.08 C ATOM 1786 O ARG A 117 6.415 13.834 -18.462 1.00 15.44 O ATOM 1787 CB ARG A 117 6.908 11.763 -20.405 1.00 6.77 C ATOM 1788 CG ARG A 117 6.558 11.102 -21.733 1.00 11.98 C ATOM 1789 CD ARG A 117 6.433 9.621 -21.475 1.00 6.91 C ATOM 1790 NE ARG A 117 5.964 8.891 -22.648 1.00 10.59 N ATOM 1791 CZ ARG A 117 4.759 8.321 -22.829 1.00 20.33 C ATOM 1792 NH1 ARG A 117 3.764 8.343 -21.901 1.00 13.73 N ATOM 1793 NH2 ARG A 117 4.549 7.704 -24.005 1.00 11.03 N ATOM 1794 HA ARG A 117 6.465 13.872 -21.003 1.00 0.00 H ATOM 1795 HB2 ARG A 117 7.769 11.249 -19.978 1.00 0.00 H ATOM 1796 HB3 ARG A 117 6.056 11.663 -19.732 1.00 0.00 H ATOM 1797 HG2 ARG A 117 5.614 11.497 -22.110 1.00 0.00 H ATOM 1798 HG3 ARG A 117 7.346 11.289 -22.463 1.00 0.00 H ATOM 1799 HD2 ARG A 117 5.726 9.466 -20.660 1.00 0.00 H ATOM 1800 HD3 ARG A 117 7.410 9.232 -21.187 1.00 0.00 H ATOM 1801 HE ARG A 117 6.639 8.801 -23.434 1.00 0.00 H ATOM 1802 HH12 ARG A 117 2.854 7.882 -22.103 1.00 0.00 H ATOM 1803 HH11 ARG A 117 3.914 8.820 -20.989 1.00 0.00 H ATOM 1804 HH22 ARG A 117 3.635 7.247 -24.196 1.00 0.00 H ATOM 1805 HH21 ARG A 117 5.301 7.684 -24.723 1.00 0.00 H ATOM 1806 H ARG A 117 9.108 12.616 -21.449 1.00 0.00 H ATOM 1807 N ALA A 118 8.588 14.401 -18.794 1.00 11.50 N ATOM 1808 CA ALA A 118 8.843 14.974 -17.479 1.00 7.09 C ATOM 1809 C ALA A 118 8.285 16.359 -17.341 1.00 31.37 C ATOM 1810 O ALA A 118 8.802 17.319 -17.889 1.00 62.08 O ATOM 1811 CB ALA A 118 10.392 15.045 -17.296 1.00 5.03 C ATOM 1812 HA ALA A 118 8.360 14.350 -16.727 1.00 0.00 H ATOM 1813 HB1 ALA A 118 10.811 14.041 -17.364 1.00 0.00 H ATOM 1814 HB2 ALA A 118 10.820 15.673 -18.077 1.00 0.00 H ATOM 1815 HB3 ALA A 118 10.622 15.470 -16.319 1.00 0.00 H ATOM 1816 H ALA A 118 9.367 14.395 -19.483 1.00 0.00 H ATOM 1817 N ALA A 119 7.217 16.480 -16.609 1.00 14.88 N ATOM 1818 CA ALA A 119 6.552 17.771 -16.390 1.00 10.00 C ATOM 1819 C ALA A 119 5.657 17.629 -15.194 1.00 23.51 C ATOM 1820 O ALA A 119 4.917 16.655 -15.133 1.00 26.27 O ATOM 1821 CB ALA A 119 5.766 18.232 -17.616 1.00 16.73 C ATOM 1822 HA ALA A 119 7.305 18.539 -16.213 1.00 0.00 H ATOM 1823 HB1 ALA A 119 6.445 18.340 -18.462 1.00 0.00 H ATOM 1824 HB2 ALA A 119 5.001 17.493 -17.855 1.00 0.00 H ATOM 1825 HB3 ALA A 119 5.293 19.191 -17.403 1.00 0.00 H ATOM 1826 H ALA A 119 6.819 15.630 -16.162 1.00 0.00 H ATOM 1827 N LEU A 120 5.750 18.565 -14.261 1.00 16.26 N ATOM 1828 CA LEU A 120 4.911 18.493 -13.072 1.00 17.06 C ATOM 1829 C LEU A 120 3.794 19.503 -13.059 1.00 21.31 C ATOM 1830 O LEU A 120 3.988 20.658 -13.399 1.00 19.95 O ATOM 1831 CB LEU A 120 5.726 18.810 -11.824 1.00 13.77 C ATOM 1832 CG LEU A 120 6.860 17.834 -11.543 1.00 20.43 C ATOM 1833 CD1 LEU A 120 7.457 18.165 -10.189 1.00 15.02 C ATOM 1834 CD2 LEU A 120 6.337 16.404 -11.489 1.00 12.85 C ATOM 1835 HA LEU A 120 4.508 17.480 -13.085 1.00 0.00 H ATOM 1836 HB2 LEU A 120 6.155 19.805 -11.941 1.00 0.00 H ATOM 1837 HB3 LEU A 120 5.052 18.805 -10.967 1.00 0.00 H ATOM 1838 HG LEU A 120 7.602 17.919 -12.337 1.00 0.00 H ATOM 1839 HD21 LEU A 120 5.594 16.320 -10.696 1.00 0.00 H ATOM 1840 HD22 LEU A 120 5.880 16.149 -12.445 1.00 0.00 H ATOM 1841 HD23 LEU A 120 7.164 15.723 -11.287 1.00 0.00 H ATOM 1842 HD11 LEU A 120 7.839 19.186 -10.202 1.00 0.00 H ATOM 1843 HD12 LEU A 120 6.688 18.073 -9.422 1.00 0.00 H ATOM 1844 HD13 LEU A 120 8.272 17.473 -9.974 1.00 0.00 H ATOM 1845 H LEU A 120 6.421 19.351 -14.377 1.00 0.00 H ATOM 1846 N PRO A 121 2.619 19.067 -12.630 1.00 12.17 N ATOM 1847 CA PRO A 121 1.480 19.946 -12.537 1.00 11.77 C ATOM 1848 C PRO A 121 1.676 20.907 -11.361 1.00 9.12 C ATOM 1849 O PRO A 121 2.338 20.594 -10.346 1.00 16.64 O ATOM 1850 CB PRO A 121 0.288 19.021 -12.412 1.00 11.91 C ATOM 1851 CG PRO A 121 0.797 17.647 -12.045 1.00 14.57 C ATOM 1852 CD PRO A 121 2.295 17.658 -12.273 1.00 11.23 C ATOM 1853 HA PRO A 121 1.337 20.597 -13.400 1.00 0.00 H ATOM 1854 HD3 PRO A 121 2.823 17.361 -11.367 1.00 0.00 H ATOM 1855 HD2 PRO A 121 2.564 16.984 -13.087 1.00 0.00 H ATOM 1856 HG3 PRO A 121 0.327 16.892 -12.675 1.00 0.00 H ATOM 1857 HG2 PRO A 121 0.578 17.433 -10.999 1.00 0.00 H ATOM 1858 HB2 PRO A 121 -0.384 19.386 -11.635 1.00 0.00 H ATOM 1859 HB3 PRO A 121 -0.246 18.976 -13.361 1.00 0.00 H ATOM 1860 N SER A 122 1.125 22.109 -11.493 1.00 17.08 N ATOM 1861 CA SER A 122 1.343 23.074 -10.412 1.00 11.83 C ATOM 1862 C SER A 122 0.828 22.721 -9.057 1.00 12.38 C ATOM 1863 O SER A 122 1.380 23.151 -8.039 1.00 11.48 O ATOM 1864 CB SER A 122 0.846 24.463 -10.756 1.00 23.83 C ATOM 1865 OG SER A 122 -0.532 24.385 -10.964 1.00 40.41 O ATOM 1866 HA SER A 122 2.430 23.045 -10.337 1.00 0.00 H ATOM 1867 HB2 SER A 122 1.338 24.819 -11.661 1.00 0.00 H ATOM 1868 HB3 SER A 122 1.059 25.147 -9.935 1.00 0.00 H ATOM 1869 HG SER A 122 -0.882 25.283 -11.191 1.00 0.00 H ATOM 1870 H SER A 122 0.561 22.355 -12.331 1.00 0.00 H ATOM 1871 N HIS A 123 -0.225 21.954 -9.028 1.00 10.08 N ATOM 1872 CA HIS A 123 -0.701 21.645 -7.696 1.00 9.56 C ATOM 1873 C HIS A 123 0.319 20.804 -6.944 1.00 12.40 C ATOM 1874 O HIS A 123 0.402 20.908 -5.709 1.00 8.85 O ATOM 1875 CB HIS A 123 -2.114 20.981 -7.675 1.00 11.24 C ATOM 1876 CG HIS A 123 -2.165 19.594 -8.285 1.00 13.37 C ATOM 1877 ND1 HIS A 123 -2.380 18.425 -7.521 1.00 17.14 N ATOM 1878 CD2 HIS A 123 -2.043 19.205 -9.603 1.00 15.00 C ATOM 1879 CE1 HIS A 123 -2.370 17.391 -8.365 1.00 8.52 C ATOM 1880 NE2 HIS A 123 -2.173 17.832 -9.629 1.00 18.30 N ATOM 1881 HA HIS A 123 -0.819 22.599 -7.182 1.00 0.00 H ATOM 1882 HB2 HIS A 123 -2.442 20.910 -6.638 1.00 0.00 H ATOM 1883 HB3 HIS A 123 -2.800 21.622 -8.228 1.00 0.00 H ATOM 1884 HD2 HIS A 123 -1.876 19.858 -10.460 1.00 0.00 H ATOM 1885 HE1 HIS A 123 -2.501 16.347 -8.079 1.00 0.00 H ATOM 1886 H HIS A 123 -0.685 21.594 -9.889 1.00 0.00 H ATOM 1887 N VAL A 124 1.095 19.969 -7.666 1.00 10.81 N ATOM 1888 CA VAL A 124 2.059 19.145 -6.991 1.00 9.50 C ATOM 1889 C VAL A 124 3.229 19.987 -6.582 1.00 11.16 C ATOM 1890 O VAL A 124 3.813 19.832 -5.524 1.00 11.60 O ATOM 1891 CB VAL A 124 2.475 17.963 -7.879 1.00 12.47 C ATOM 1892 CG1 VAL A 124 3.526 17.184 -7.122 1.00 14.98 C ATOM 1893 CG2 VAL A 124 1.291 17.011 -8.027 1.00 19.61 C ATOM 1894 HA VAL A 124 1.617 18.720 -6.090 1.00 0.00 H ATOM 1895 HB VAL A 124 2.821 18.327 -8.846 1.00 0.00 H ATOM 1896 HG11 VAL A 124 4.380 17.831 -6.919 1.00 0.00 H ATOM 1897 HG12 VAL A 124 3.106 16.828 -6.181 1.00 0.00 H ATOM 1898 HG13 VAL A 124 3.848 16.333 -7.722 1.00 0.00 H ATOM 1899 HG21 VAL A 124 0.995 16.646 -7.044 1.00 0.00 H ATOM 1900 HG22 VAL A 124 0.456 17.540 -8.486 1.00 0.00 H ATOM 1901 HG23 VAL A 124 1.580 16.169 -8.657 1.00 0.00 H ATOM 1902 H VAL A 124 0.996 19.922 -8.700 1.00 0.00 H ATOM 1903 N VAL A 125 3.586 20.932 -7.440 1.00 10.11 N ATOM 1904 CA VAL A 125 4.693 21.818 -7.104 1.00 16.02 C ATOM 1905 C VAL A 125 4.390 22.616 -5.822 1.00 22.21 C ATOM 1906 O VAL A 125 5.196 22.770 -4.912 1.00 16.55 O ATOM 1907 CB VAL A 125 5.065 22.755 -8.238 1.00 17.65 C ATOM 1908 CG1 VAL A 125 6.093 23.784 -7.739 1.00 14.30 C ATOM 1909 CG2 VAL A 125 5.702 21.915 -9.348 1.00 13.15 C ATOM 1910 HA VAL A 125 5.557 21.177 -6.927 1.00 0.00 H ATOM 1911 HB VAL A 125 4.181 23.278 -8.603 1.00 0.00 H ATOM 1912 HG11 VAL A 125 5.661 24.359 -6.920 1.00 0.00 H ATOM 1913 HG12 VAL A 125 6.985 23.264 -7.390 1.00 0.00 H ATOM 1914 HG13 VAL A 125 6.358 24.456 -8.555 1.00 0.00 H ATOM 1915 HG21 VAL A 125 6.591 21.417 -8.960 1.00 0.00 H ATOM 1916 HG22 VAL A 125 4.987 21.168 -9.693 1.00 0.00 H ATOM 1917 HG23 VAL A 125 5.980 22.564 -10.179 1.00 0.00 H ATOM 1918 H VAL A 125 3.082 21.040 -8.343 1.00 0.00 H ATOM 1919 N THR A 126 3.175 23.160 -5.728 1.00 15.38 N ATOM 1920 CA THR A 126 2.763 23.941 -4.572 1.00 9.83 C ATOM 1921 C THR A 126 2.791 23.144 -3.303 1.00 6.80 C ATOM 1922 O THR A 126 3.231 23.624 -2.276 1.00 10.22 O ATOM 1923 CB THR A 126 1.323 24.345 -4.809 1.00 13.11 C ATOM 1924 OG1 THR A 126 1.315 25.259 -5.877 1.00 20.90 O ATOM 1925 CG2 THR A 126 0.774 25.027 -3.574 1.00 16.11 C ATOM 1926 HA THR A 126 3.445 24.784 -4.462 1.00 0.00 H ATOM 1927 HB THR A 126 0.712 23.470 -5.032 1.00 0.00 H ATOM 1928 HG1 THR A 126 0.385 25.544 -6.059 1.00 0.00 H ATOM 1929 HG23 THR A 126 0.777 24.324 -2.741 1.00 0.00 H ATOM 1930 HG21 THR A 126 1.397 25.887 -3.328 1.00 0.00 H ATOM 1931 HG22 THR A 126 -0.246 25.359 -3.767 1.00 0.00 H ATOM 1932 H THR A 126 2.500 23.021 -6.507 1.00 0.00 H ATOM 1933 N MET A 127 2.288 21.921 -3.354 1.00 7.60 N ATOM 1934 CA MET A 127 2.254 21.074 -2.173 1.00 10.17 C ATOM 1935 C MET A 127 3.667 20.826 -1.644 1.00 8.41 C ATOM 1936 O MET A 127 3.951 20.858 -0.456 1.00 12.56 O ATOM 1937 CB MET A 127 1.566 19.758 -2.629 1.00 11.79 C ATOM 1938 CG MET A 127 1.149 18.769 -1.559 1.00 23.85 C ATOM 1939 SD MET A 127 0.883 17.079 -2.189 1.00 24.59 S ATOM 1940 CE MET A 127 1.257 17.265 -3.905 1.00 18.88 C ATOM 1941 HA MET A 127 1.708 21.536 -1.350 1.00 0.00 H ATOM 1942 HB2 MET A 127 0.669 20.035 -3.183 1.00 0.00 H ATOM 1943 HB3 MET A 127 2.258 19.243 -3.295 1.00 0.00 H ATOM 1944 HG2 MET A 127 0.220 19.119 -1.109 1.00 0.00 H ATOM 1945 HG3 MET A 127 1.929 18.735 -0.799 1.00 0.00 H ATOM 1946 HE1 MET A 127 0.581 17.997 -4.346 1.00 0.00 H ATOM 1947 HE2 MET A 127 2.286 17.606 -4.016 1.00 0.00 H ATOM 1948 HE3 MET A 127 1.134 16.306 -4.408 1.00 0.00 H ATOM 1949 H MET A 127 1.911 21.560 -4.254 1.00 0.00 H ATOM 1950 N LEU A 128 4.582 20.528 -2.537 1.00 7.15 N ATOM 1951 CA LEU A 128 5.951 20.250 -2.101 1.00 10.72 C ATOM 1952 C LEU A 128 6.610 21.448 -1.435 1.00 11.23 C ATOM 1953 O LEU A 128 7.278 21.401 -0.393 1.00 16.21 O ATOM 1954 CB LEU A 128 6.760 19.845 -3.326 1.00 9.94 C ATOM 1955 CG LEU A 128 6.477 18.409 -3.804 1.00 14.29 C ATOM 1956 CD1 LEU A 128 7.214 18.155 -5.099 1.00 11.65 C ATOM 1957 CD2 LEU A 128 6.977 17.362 -2.833 1.00 16.57 C ATOM 1958 HA LEU A 128 5.918 19.454 -1.358 1.00 0.00 H ATOM 1959 HB2 LEU A 128 6.523 20.532 -4.138 1.00 0.00 H ATOM 1960 HB3 LEU A 128 7.819 19.925 -3.082 1.00 0.00 H ATOM 1961 HG LEU A 128 5.395 18.331 -3.907 1.00 0.00 H ATOM 1962 HD21 LEU A 128 8.055 17.468 -2.710 1.00 0.00 H ATOM 1963 HD22 LEU A 128 6.485 17.497 -1.870 1.00 0.00 H ATOM 1964 HD23 LEU A 128 6.750 16.369 -3.222 1.00 0.00 H ATOM 1965 HD11 LEU A 128 6.874 18.864 -5.854 1.00 0.00 H ATOM 1966 HD12 LEU A 128 8.285 18.280 -4.937 1.00 0.00 H ATOM 1967 HD13 LEU A 128 7.013 17.138 -5.437 1.00 0.00 H ATOM 1968 H LEU A 128 4.336 20.490 -3.547 1.00 0.00 H ATOM 1969 N ASP A 129 6.378 22.562 -2.082 1.00 12.66 N ATOM 1970 CA ASP A 129 6.904 23.802 -1.588 1.00 9.02 C ATOM 1971 C ASP A 129 6.285 24.200 -0.267 1.00 16.54 C ATOM 1972 O ASP A 129 6.842 24.965 0.485 1.00 25.82 O ATOM 1973 CB ASP A 129 6.639 24.946 -2.576 1.00 8.47 C ATOM 1974 CG ASP A 129 7.543 24.939 -3.798 1.00 19.80 C ATOM 1975 OD1 ASP A 129 8.416 23.973 -3.861 1.00 22.24 O ATOM 1976 OD2 ASP A 129 7.413 25.731 -4.735 1.00 21.98 O ATOM 1977 HA ASP A 129 7.974 23.639 -1.459 1.00 0.00 H ATOM 1978 HB2 ASP A 129 5.606 24.872 -2.915 1.00 0.00 H ATOM 1979 HB3 ASP A 129 6.781 25.891 -2.051 1.00 0.00 H ATOM 1980 H ASP A 129 5.812 22.548 -2.954 1.00 0.00 H ATOM 1981 N ASN A 130 5.125 23.722 0.063 1.00 13.20 N ATOM 1982 CA ASN A 130 4.487 24.073 1.337 1.00 15.58 C ATOM 1983 C ASN A 130 4.729 23.073 2.473 1.00 15.81 C ATOM 1984 O ASN A 130 4.349 23.320 3.616 1.00 15.63 O ATOM 1985 CB ASN A 130 2.972 24.341 1.210 1.00 14.24 C ATOM 1986 CG ASN A 130 2.694 25.627 0.473 1.00 20.23 C ATOM 1987 OD1 ASN A 130 1.721 25.745 -0.282 1.00 31.57 O ATOM 1988 ND2 ASN A 130 3.348 26.663 0.948 1.00 23.25 N ATOM 1989 HA ASN A 130 4.990 25.002 1.608 1.00 0.00 H ATOM 1990 HB2 ASN A 130 2.511 23.516 0.667 1.00 0.00 H ATOM 1991 HB3 ASN A 130 2.539 24.405 2.208 1.00 0.00 H ATOM 1992 HD22 ASN A 130 4.161 26.519 1.580 1.00 0.00 H ATOM 1993 HD21 ASN A 130 3.052 27.627 0.692 1.00 0.00 H ATOM 1994 H ASN A 130 4.637 23.076 -0.590 1.00 0.00 H ATOM 1995 N PHE A 131 5.353 21.945 2.179 1.00 12.74 N ATOM 1996 CA PHE A 131 5.633 20.943 3.190 1.00 13.87 C ATOM 1997 C PHE A 131 6.671 21.393 4.228 1.00 24.34 C ATOM 1998 O PHE A 131 7.661 22.078 3.941 1.00 11.65 O ATOM 1999 CB PHE A 131 6.196 19.700 2.457 1.00 12.33 C ATOM 2000 CG PHE A 131 5.179 18.695 1.928 1.00 8.26 C ATOM 2001 CD1 PHE A 131 3.926 18.500 2.517 1.00 19.94 C ATOM 2002 CD2 PHE A 131 5.563 17.905 0.837 1.00 13.14 C ATOM 2003 CE1 PHE A 131 3.059 17.538 1.983 1.00 16.58 C ATOM 2004 CE2 PHE A 131 4.709 16.952 0.290 1.00 17.01 C ATOM 2005 CZ PHE A 131 3.457 16.780 0.879 1.00 6.35 C ATOM 2006 HA PHE A 131 4.707 20.745 3.730 1.00 0.00 H ATOM 2007 HB2 PHE A 131 6.782 20.054 1.609 1.00 0.00 H ATOM 2008 HB3 PHE A 131 6.849 19.174 3.153 1.00 0.00 H ATOM 2009 HD2 PHE A 131 6.555 18.040 0.406 1.00 0.00 H ATOM 2010 HE2 PHE A 131 5.010 16.358 -0.573 1.00 0.00 H ATOM 2011 HZ PHE A 131 2.773 16.037 0.469 1.00 0.00 H ATOM 2012 HE1 PHE A 131 2.076 17.381 2.428 1.00 0.00 H ATOM 2013 HD1 PHE A 131 3.627 19.091 3.383 1.00 0.00 H ATOM 2014 H PHE A 131 5.651 21.772 1.198 1.00 0.00 H ATOM 2015 N PRO A 132 6.461 20.996 5.465 1.00 17.88 N ATOM 2016 CA PRO A 132 7.420 21.399 6.466 1.00 13.42 C ATOM 2017 C PRO A 132 8.684 20.562 6.383 1.00 16.18 C ATOM 2018 O PRO A 132 8.676 19.437 5.885 1.00 18.59 O ATOM 2019 CB PRO A 132 6.719 21.055 7.777 1.00 16.62 C ATOM 2020 CG PRO A 132 5.662 20.002 7.456 1.00 22.62 C ATOM 2021 CD PRO A 132 5.334 20.169 5.978 1.00 13.03 C ATOM 2022 HA PRO A 132 7.708 22.444 6.356 1.00 0.00 H ATOM 2023 HD3 PRO A 132 5.298 19.203 5.475 1.00 0.00 H ATOM 2024 HD2 PRO A 132 4.381 20.682 5.845 1.00 0.00 H ATOM 2025 HG3 PRO A 132 4.771 20.163 8.062 1.00 0.00 H ATOM 2026 HG2 PRO A 132 6.053 19.003 7.646 1.00 0.00 H ATOM 2027 HB2 PRO A 132 7.438 20.658 8.493 1.00 0.00 H ATOM 2028 HB3 PRO A 132 6.247 21.945 8.194 1.00 0.00 H ATOM 2029 N THR A 133 9.790 21.108 6.896 1.00 12.37 N ATOM 2030 CA THR A 133 11.058 20.408 6.864 1.00 14.95 C ATOM 2031 C THR A 133 11.111 19.202 7.806 1.00 24.67 C ATOM 2032 O THR A 133 11.985 18.361 7.667 1.00 25.60 O ATOM 2033 CB THR A 133 12.256 21.372 7.014 1.00 19.23 C ATOM 2034 OG1 THR A 133 12.264 21.787 8.357 1.00 25.32 O ATOM 2035 CG2 THR A 133 12.058 22.569 6.091 1.00 29.91 C ATOM 2036 HA THR A 133 11.146 19.975 5.868 1.00 0.00 H ATOM 2037 HB THR A 133 13.199 20.894 6.749 1.00 0.00 H ATOM 2038 HG1 THR A 133 13.019 22.410 8.504 1.00 0.00 H ATOM 2039 HG23 THR A 133 12.054 22.231 5.055 1.00 0.00 H ATOM 2040 HG21 THR A 133 11.107 23.050 6.321 1.00 0.00 H ATOM 2041 HG22 THR A 133 12.871 23.279 6.240 1.00 0.00 H ATOM 2042 H THR A 133 9.740 22.053 7.326 1.00 0.00 H ATOM 2043 N ASN A 134 10.188 19.064 8.753 1.00 18.70 N ATOM 2044 CA ASN A 134 10.298 17.892 9.560 1.00 17.49 C ATOM 2045 C ASN A 134 9.455 16.773 8.970 1.00 16.49 C ATOM 2046 O ASN A 134 9.277 15.767 9.647 1.00 22.40 O ATOM 2047 CB ASN A 134 9.885 18.172 11.014 1.00 24.42 C ATOM 2048 CG ASN A 134 8.401 18.490 11.099 1.00 23.68 C ATOM 2049 OD1 ASN A 134 7.875 19.130 10.183 1.00 28.92 O ATOM 2050 ND2 ASN A 134 7.734 18.120 12.208 1.00 23.90 N ATOM 2051 HA ASN A 134 11.343 17.582 9.569 1.00 0.00 H ATOM 2052 HB2 ASN A 134 10.098 17.293 11.623 1.00 0.00 H ATOM 2053 HB3 ASN A 134 10.455 19.021 11.391 1.00 0.00 H ATOM 2054 HD22 ASN A 134 8.221 17.581 12.952 1.00 0.00 H ATOM 2055 HD21 ASN A 134 6.731 18.373 12.320 1.00 0.00 H ATOM 2056 H ASN A 134 9.434 19.766 8.897 1.00 0.00 H ATOM 2057 N LEU A 135 8.908 16.896 7.760 1.00 7.97 N ATOM 2058 CA LEU A 135 8.096 15.808 7.202 1.00 6.90 C ATOM 2059 C LEU A 135 9.113 14.968 6.455 1.00 3.15 C ATOM 2060 O LEU A 135 9.813 15.485 5.597 1.00 7.00 O ATOM 2061 CB LEU A 135 7.018 16.391 6.248 1.00 8.14 C ATOM 2062 CG LEU A 135 6.115 15.334 5.648 1.00 5.72 C ATOM 2063 CD1 LEU A 135 5.470 14.413 6.690 1.00 3.00 C ATOM 2064 CD2 LEU A 135 5.073 15.890 4.705 1.00 10.46 C ATOM 2065 HA LEU A 135 7.551 15.230 7.949 1.00 0.00 H ATOM 2066 HB2 LEU A 135 6.403 17.094 6.809 1.00 0.00 H ATOM 2067 HB3 LEU A 135 7.521 16.917 5.437 1.00 0.00 H ATOM 2068 HG LEU A 135 6.792 14.721 5.053 1.00 0.00 H ATOM 2069 HD21 LEU A 135 4.438 16.594 5.242 1.00 0.00 H ATOM 2070 HD22 LEU A 135 5.568 16.402 3.880 1.00 0.00 H ATOM 2071 HD23 LEU A 135 4.465 15.074 4.316 1.00 0.00 H ATOM 2072 HD11 LEU A 135 6.250 13.896 7.249 1.00 0.00 H ATOM 2073 HD12 LEU A 135 4.865 15.008 7.374 1.00 0.00 H ATOM 2074 HD13 LEU A 135 4.838 13.682 6.186 1.00 0.00 H ATOM 2075 H LEU A 135 9.057 17.766 7.210 1.00 0.00 H ATOM 2076 N HIS A 136 9.266 13.676 6.829 1.00 4.84 N ATOM 2077 CA HIS A 136 10.277 12.830 6.167 1.00 4.40 C ATOM 2078 C HIS A 136 10.189 12.850 4.640 1.00 5.24 C ATOM 2079 O HIS A 136 9.071 12.869 4.069 1.00 8.30 O ATOM 2080 CB HIS A 136 10.122 11.388 6.745 1.00 9.49 C ATOM 2081 CG HIS A 136 11.233 10.496 6.342 1.00 6.61 C ATOM 2082 ND1 HIS A 136 12.264 10.152 7.213 1.00 10.28 N ATOM 2083 CD2 HIS A 136 11.475 9.928 5.146 1.00 3.33 C ATOM 2084 CE1 HIS A 136 13.124 9.379 6.582 1.00 3.00 C ATOM 2085 NE2 HIS A 136 12.666 9.214 5.328 1.00 8.08 N ATOM 2086 HA HIS A 136 11.270 13.227 6.378 1.00 0.00 H ATOM 2087 HB2 HIS A 136 10.097 11.447 7.833 1.00 0.00 H ATOM 2088 HB3 HIS A 136 9.184 10.965 6.384 1.00 0.00 H ATOM 2089 HD2 HIS A 136 10.877 10.006 4.238 1.00 0.00 H ATOM 2090 HE1 HIS A 136 14.037 8.953 6.998 1.00 0.00 H ATOM 2091 H HIS A 136 8.670 13.280 7.584 1.00 0.00 H ATOM 2092 N PRO A 137 11.375 12.819 3.993 1.00 6.79 N ATOM 2093 CA PRO A 137 11.432 12.826 2.534 1.00 3.00 C ATOM 2094 C PRO A 137 10.582 11.720 1.899 1.00 5.66 C ATOM 2095 O PRO A 137 9.949 11.917 0.848 1.00 3.10 O ATOM 2096 CB PRO A 137 12.904 12.755 2.177 1.00 3.00 C ATOM 2097 CG PRO A 137 13.655 13.221 3.403 1.00 10.36 C ATOM 2098 CD PRO A 137 12.735 13.002 4.582 1.00 8.17 C ATOM 2099 HA PRO A 137 10.989 13.734 2.124 1.00 0.00 H ATOM 2100 HD3 PRO A 137 13.033 12.114 5.139 1.00 0.00 H ATOM 2101 HD2 PRO A 137 12.751 13.867 5.245 1.00 0.00 H ATOM 2102 HG3 PRO A 137 13.905 14.278 3.312 1.00 0.00 H ATOM 2103 HG2 PRO A 137 14.570 12.642 3.527 1.00 0.00 H ATOM 2104 HB2 PRO A 137 13.184 11.732 1.927 1.00 0.00 H ATOM 2105 HB3 PRO A 137 13.120 13.406 1.330 1.00 0.00 H ATOM 2106 N MET A 138 10.520 10.515 2.492 1.00 3.88 N ATOM 2107 CA MET A 138 9.694 9.463 1.863 1.00 3.09 C ATOM 2108 C MET A 138 8.228 9.770 1.907 1.00 5.08 C ATOM 2109 O MET A 138 7.453 9.451 1.009 1.00 4.87 O ATOM 2110 CB MET A 138 9.950 8.051 2.479 1.00 3.15 C ATOM 2111 CG MET A 138 11.301 7.457 2.055 1.00 3.00 C ATOM 2112 SD MET A 138 11.259 6.994 0.335 1.00 8.07 S ATOM 2113 CE MET A 138 9.981 5.729 0.305 1.00 10.44 C ATOM 2114 HA MET A 138 10.008 9.448 0.819 1.00 0.00 H ATOM 2115 HB2 MET A 138 9.931 8.135 3.566 1.00 0.00 H ATOM 2116 HB3 MET A 138 9.156 7.379 2.154 1.00 0.00 H ATOM 2117 HG2 MET A 138 11.513 6.575 2.660 1.00 0.00 H ATOM 2118 HG3 MET A 138 12.085 8.199 2.209 1.00 0.00 H ATOM 2119 HE1 MET A 138 10.271 4.906 0.959 1.00 0.00 H ATOM 2120 HE2 MET A 138 9.040 6.156 0.652 1.00 0.00 H ATOM 2121 HE3 MET A 138 9.860 5.360 -0.714 1.00 0.00 H ATOM 2122 H MET A 138 11.041 10.328 3.372 1.00 0.00 H ATOM 2123 N SER A 139 7.792 10.402 2.995 1.00 5.05 N ATOM 2124 CA SER A 139 6.369 10.765 3.150 1.00 7.02 C ATOM 2125 C SER A 139 6.096 11.903 2.169 1.00 6.49 C ATOM 2126 O SER A 139 4.996 11.955 1.591 1.00 7.26 O ATOM 2127 CB SER A 139 5.993 11.299 4.527 1.00 7.98 C ATOM 2128 OG SER A 139 6.380 10.387 5.511 1.00 14.96 O ATOM 2129 HA SER A 139 5.793 9.855 2.983 1.00 0.00 H ATOM 2130 HB2 SER A 139 4.914 11.448 4.575 1.00 0.00 H ATOM 2131 HB3 SER A 139 6.498 12.250 4.697 1.00 0.00 H ATOM 2132 HG SER A 139 7.360 10.253 5.468 1.00 0.00 H ATOM 2133 H SER A 139 8.466 10.644 3.749 1.00 0.00 H ATOM 2134 N GLN A 140 7.082 12.812 1.990 1.00 7.58 N ATOM 2135 CA GLN A 140 6.857 13.892 1.045 1.00 3.00 C ATOM 2136 C GLN A 140 6.663 13.255 -0.364 1.00 9.73 C ATOM 2137 O GLN A 140 5.783 13.597 -1.183 1.00 3.33 O ATOM 2138 CB GLN A 140 8.036 14.908 0.995 1.00 3.00 C ATOM 2139 CG GLN A 140 8.224 15.559 2.369 1.00 6.08 C ATOM 2140 CD GLN A 140 8.964 16.865 2.285 1.00 14.17 C ATOM 2141 OE1 GLN A 140 9.500 17.313 3.307 1.00 16.03 O ATOM 2142 NE2 GLN A 140 9.029 17.478 1.118 1.00 3.85 N ATOM 2143 HA GLN A 140 5.977 14.450 1.364 1.00 0.00 H ATOM 2144 HB2 GLN A 140 8.951 14.386 0.714 1.00 0.00 H ATOM 2145 HB3 GLN A 140 7.817 15.679 0.256 1.00 0.00 H ATOM 2146 HG2 GLN A 140 7.243 15.739 2.809 1.00 0.00 H ATOM 2147 HG3 GLN A 140 8.787 14.877 3.006 1.00 0.00 H ATOM 2148 HE22 GLN A 140 8.563 17.063 0.286 1.00 0.00 H ATOM 2149 HE21 GLN A 140 9.547 18.376 1.030 1.00 0.00 H ATOM 2150 H GLN A 140 7.977 12.739 2.515 1.00 0.00 H ATOM 2151 N LEU A 141 7.518 12.266 -0.665 1.00 5.04 N ATOM 2152 CA LEU A 141 7.473 11.566 -1.950 1.00 5.35 C ATOM 2153 C LEU A 141 6.173 10.840 -2.220 1.00 5.53 C ATOM 2154 O LEU A 141 5.542 10.939 -3.257 1.00 4.25 O ATOM 2155 CB LEU A 141 8.683 10.645 -2.155 1.00 3.41 C ATOM 2156 CG LEU A 141 8.726 9.809 -3.451 1.00 8.16 C ATOM 2157 CD1 LEU A 141 9.279 10.633 -4.605 1.00 5.38 C ATOM 2158 CD2 LEU A 141 9.658 8.571 -3.290 1.00 5.55 C ATOM 2159 HA LEU A 141 7.525 12.359 -2.696 1.00 0.00 H ATOM 2160 HB2 LEU A 141 9.576 11.269 -2.138 1.00 0.00 H ATOM 2161 HB3 LEU A 141 8.711 9.950 -1.316 1.00 0.00 H ATOM 2162 HG LEU A 141 7.703 9.493 -3.654 1.00 0.00 H ATOM 2163 HD21 LEU A 141 10.669 8.906 -3.057 1.00 0.00 H ATOM 2164 HD22 LEU A 141 9.287 7.942 -2.481 1.00 0.00 H ATOM 2165 HD23 LEU A 141 9.668 8.002 -4.219 1.00 0.00 H ATOM 2166 HD11 LEU A 141 8.642 11.502 -4.767 1.00 0.00 H ATOM 2167 HD12 LEU A 141 10.290 10.962 -4.363 1.00 0.00 H ATOM 2168 HD13 LEU A 141 9.300 10.023 -5.508 1.00 0.00 H ATOM 2169 H LEU A 141 8.234 11.988 0.036 1.00 0.00 H ATOM 2170 N SER A 142 5.733 10.039 -1.257 1.00 4.50 N ATOM 2171 CA SER A 142 4.505 9.248 -1.400 1.00 6.62 C ATOM 2172 C SER A 142 3.294 10.154 -1.566 1.00 10.66 C ATOM 2173 O SER A 142 2.449 9.967 -2.421 1.00 5.14 O ATOM 2174 CB SER A 142 4.420 8.399 -0.150 1.00 10.98 C ATOM 2175 OG SER A 142 3.252 7.644 -0.289 1.00 23.84 O ATOM 2176 HA SER A 142 4.522 8.620 -2.291 1.00 0.00 H ATOM 2177 HB2 SER A 142 4.362 9.031 0.736 1.00 0.00 H ATOM 2178 HB3 SER A 142 5.289 7.746 -0.073 1.00 0.00 H ATOM 2179 HG SER A 142 3.317 7.084 -1.103 1.00 0.00 H ATOM 2180 H SER A 142 6.276 9.970 -0.373 1.00 0.00 H ATOM 2181 N ALA A 143 3.177 11.188 -0.722 1.00 3.16 N ATOM 2182 CA ALA A 143 2.041 12.179 -0.843 1.00 3.01 C ATOM 2183 C ALA A 143 2.049 12.882 -2.250 1.00 3.00 C ATOM 2184 O ALA A 143 1.002 13.055 -2.872 1.00 3.43 O ATOM 2185 CB ALA A 143 2.058 13.178 0.320 1.00 8.40 C ATOM 2186 HA ALA A 143 1.099 11.635 -0.774 1.00 0.00 H ATOM 2187 HB1 ALA A 143 1.954 12.639 1.262 1.00 0.00 H ATOM 2188 HB2 ALA A 143 3.001 13.724 0.315 1.00 0.00 H ATOM 2189 HB3 ALA A 143 1.231 13.879 0.208 1.00 0.00 H ATOM 2190 H ALA A 143 3.882 11.312 0.032 1.00 0.00 H ATOM 2191 N ALA A 144 3.223 13.292 -2.777 1.00 5.24 N ATOM 2192 CA ALA A 144 3.259 13.931 -4.098 1.00 5.29 C ATOM 2193 C ALA A 144 2.847 12.961 -5.226 1.00 9.51 C ATOM 2194 O ALA A 144 2.149 13.368 -6.183 1.00 9.30 O ATOM 2195 CB ALA A 144 4.614 14.617 -4.360 1.00 6.40 C ATOM 2196 HA ALA A 144 2.508 14.721 -4.097 1.00 0.00 H ATOM 2197 HB1 ALA A 144 4.785 15.382 -3.602 1.00 0.00 H ATOM 2198 HB2 ALA A 144 5.411 13.874 -4.315 1.00 0.00 H ATOM 2199 HB3 ALA A 144 4.601 15.078 -5.348 1.00 0.00 H ATOM 2200 H ALA A 144 4.106 13.154 -2.244 1.00 0.00 H ATOM 2201 N ILE A 145 3.248 11.672 -5.160 1.00 5.43 N ATOM 2202 CA ILE A 145 2.879 10.694 -6.187 1.00 3.00 C ATOM 2203 C ILE A 145 1.368 10.445 -6.159 1.00 4.34 C ATOM 2204 O ILE A 145 0.676 10.308 -7.192 1.00 10.78 O ATOM 2205 CB ILE A 145 3.651 9.410 -6.017 1.00 3.61 C ATOM 2206 CG1 ILE A 145 5.121 9.674 -6.374 1.00 6.83 C ATOM 2207 CG2 ILE A 145 3.069 8.315 -6.906 1.00 10.36 C ATOM 2208 CD1 ILE A 145 5.822 8.768 -5.375 1.00 33.90 C ATOM 2209 HA ILE A 145 3.141 11.101 -7.164 1.00 0.00 H ATOM 2210 HB ILE A 145 3.580 9.070 -4.984 1.00 0.00 H ATOM 2211 HG12 ILE A 145 5.343 9.386 -7.402 1.00 0.00 H ATOM 2212 HG13 ILE A 145 5.389 10.720 -6.225 1.00 0.00 H ATOM 2213 HD11 ILE A 145 5.556 9.072 -4.362 1.00 0.00 H ATOM 2214 HD12 ILE A 145 5.510 7.737 -5.540 1.00 0.00 H ATOM 2215 HD13 ILE A 145 6.901 8.848 -5.508 1.00 0.00 H ATOM 2216 HG21 ILE A 145 2.028 8.142 -6.633 1.00 0.00 H ATOM 2217 HG22 ILE A 145 3.125 8.627 -7.949 1.00 0.00 H ATOM 2218 HG23 ILE A 145 3.639 7.396 -6.769 1.00 0.00 H ATOM 2219 H ILE A 145 3.835 11.366 -4.358 1.00 0.00 H ATOM 2220 N THR A 146 0.845 10.380 -4.913 1.00 5.56 N ATOM 2221 CA THR A 146 -0.597 10.189 -4.729 1.00 3.73 C ATOM 2222 C THR A 146 -1.290 11.362 -5.426 1.00 10.60 C ATOM 2223 O THR A 146 -2.162 11.142 -6.238 1.00 12.24 O ATOM 2224 CB THR A 146 -1.018 10.042 -3.255 1.00 7.79 C ATOM 2225 OG1 THR A 146 -0.498 8.803 -2.822 1.00 10.09 O ATOM 2226 CG2 THR A 146 -2.548 10.080 -3.053 1.00 3.00 C ATOM 2227 HA THR A 146 -0.901 9.242 -5.174 1.00 0.00 H ATOM 2228 HB THR A 146 -0.631 10.882 -2.679 1.00 0.00 H ATOM 2229 HG1 THR A 146 0.488 8.810 -2.913 1.00 0.00 H ATOM 2230 HG23 THR A 146 -2.934 11.041 -3.391 1.00 0.00 H ATOM 2231 HG21 THR A 146 -3.009 9.278 -3.630 1.00 0.00 H ATOM 2232 HG22 THR A 146 -2.777 9.947 -1.996 1.00 0.00 H ATOM 2233 H THR A 146 1.467 10.466 -4.084 1.00 0.00 H ATOM 2234 N ALA A 147 -0.872 12.588 -5.097 1.00 6.19 N ATOM 2235 CA ALA A 147 -1.464 13.807 -5.699 1.00 7.36 C ATOM 2236 C ALA A 147 -1.355 13.889 -7.214 1.00 10.86 C ATOM 2237 O ALA A 147 -2.115 14.611 -7.887 1.00 13.05 O ATOM 2238 CB ALA A 147 -0.908 15.069 -5.072 1.00 8.51 C ATOM 2239 HA ALA A 147 -2.528 13.725 -5.475 1.00 0.00 H ATOM 2240 HB1 ALA A 147 -1.129 15.071 -4.005 1.00 0.00 H ATOM 2241 HB2 ALA A 147 0.171 15.102 -5.221 1.00 0.00 H ATOM 2242 HB3 ALA A 147 -1.367 15.939 -5.541 1.00 0.00 H ATOM 2243 H ALA A 147 -0.109 12.690 -4.398 1.00 0.00 H ATOM 2244 N LEU A 148 -0.411 13.163 -7.799 1.00 8.43 N ATOM 2245 CA LEU A 148 -0.269 13.197 -9.252 1.00 9.27 C ATOM 2246 C LEU A 148 -1.340 12.381 -9.963 1.00 14.17 C ATOM 2247 O LEU A 148 -1.500 12.457 -11.178 1.00 11.15 O ATOM 2248 CB LEU A 148 1.108 12.574 -9.616 1.00 12.65 C ATOM 2249 CG LEU A 148 2.218 13.615 -9.606 1.00 15.86 C ATOM 2250 CD1 LEU A 148 3.601 12.998 -9.825 1.00 12.62 C ATOM 2251 CD2 LEU A 148 1.965 14.568 -10.758 1.00 11.55 C ATOM 2252 HA LEU A 148 -0.361 14.236 -9.570 1.00 0.00 H ATOM 2253 HB2 LEU A 148 1.347 11.796 -8.891 1.00 0.00 H ATOM 2254 HB3 LEU A 148 1.045 12.134 -10.611 1.00 0.00 H ATOM 2255 HG LEU A 148 2.210 14.106 -8.633 1.00 0.00 H ATOM 2256 HD21 LEU A 148 1.973 14.013 -11.696 1.00 0.00 H ATOM 2257 HD22 LEU A 148 0.994 15.046 -10.626 1.00 0.00 H ATOM 2258 HD23 LEU A 148 2.746 15.328 -10.777 1.00 0.00 H ATOM 2259 HD11 LEU A 148 3.807 12.279 -9.032 1.00 0.00 H ATOM 2260 HD12 LEU A 148 3.623 12.492 -10.790 1.00 0.00 H ATOM 2261 HD13 LEU A 148 4.355 13.785 -9.809 1.00 0.00 H ATOM 2262 H LEU A 148 0.225 12.573 -7.226 1.00 0.00 H ATOM 2263 N ASN A 149 -2.079 11.600 -9.194 1.00 5.80 N ATOM 2264 CA ASN A 149 -3.087 10.782 -9.821 1.00 4.47 C ATOM 2265 C ASN A 149 -4.165 11.519 -10.578 1.00 13.07 C ATOM 2266 O ASN A 149 -4.876 10.922 -11.351 1.00 13.72 O ATOM 2267 CB ASN A 149 -3.571 9.544 -9.025 1.00 7.68 C ATOM 2268 CG ASN A 149 -5.026 9.729 -8.509 1.00 4.11 C ATOM 2269 OD1 ASN A 149 -5.892 8.836 -8.651 1.00 9.67 O ATOM 2270 ND2 ASN A 149 -5.324 10.860 -7.898 1.00 4.05 N ATOM 2271 HA ASN A 149 -2.503 10.324 -10.619 1.00 0.00 H ATOM 2272 HB2 ASN A 149 -3.534 8.669 -9.674 1.00 0.00 H ATOM 2273 HB3 ASN A 149 -2.910 9.391 -8.172 1.00 0.00 H ATOM 2274 HD22 ASN A 149 -4.599 11.596 -7.784 1.00 0.00 H ATOM 2275 HD21 ASN A 149 -6.284 11.015 -7.530 1.00 0.00 H ATOM 2276 H ASN A 149 -1.937 11.576 -8.164 1.00 0.00 H ATOM 2277 N SER A 150 -4.268 12.819 -10.395 1.00 12.52 N ATOM 2278 CA SER A 150 -5.270 13.576 -11.136 1.00 10.01 C ATOM 2279 C SER A 150 -4.921 13.557 -12.618 1.00 16.99 C ATOM 2280 O SER A 150 -5.704 13.836 -13.501 1.00 15.21 O ATOM 2281 CB SER A 150 -5.205 15.011 -10.623 1.00 7.51 C ATOM 2282 OG SER A 150 -3.923 15.562 -10.725 1.00 11.25 O ATOM 2283 HA SER A 150 -6.265 13.151 -11.002 1.00 0.00 H ATOM 2284 HB2 SER A 150 -5.507 15.022 -9.576 1.00 0.00 H ATOM 2285 HB3 SER A 150 -5.895 15.622 -11.205 1.00 0.00 H ATOM 2286 HG SER A 150 -3.641 15.565 -11.674 1.00 0.00 H ATOM 2287 H SER A 150 -3.637 13.304 -9.725 1.00 0.00 H ATOM 2288 N GLU A 151 -3.691 13.205 -12.948 1.00 11.95 N ATOM 2289 CA GLU A 151 -3.243 13.166 -14.310 1.00 17.18 C ATOM 2290 C GLU A 151 -3.331 11.760 -14.876 1.00 10.56 C ATOM 2291 O GLU A 151 -2.986 11.578 -16.040 1.00 14.26 O ATOM 2292 CB GLU A 151 -1.740 13.562 -14.395 1.00 18.66 C ATOM 2293 CG GLU A 151 -1.287 14.826 -13.636 1.00 28.21 C ATOM 2294 CD GLU A 151 -2.118 16.005 -14.003 1.00 52.47 C ATOM 2295 OE1 GLU A 151 -1.873 16.395 -15.245 1.00 37.33 O ATOM 2296 OE2 GLU A 151 -2.887 16.532 -13.207 1.00 47.61 O ATOM 2297 HA GLU A 151 -3.878 13.854 -14.867 1.00 0.00 H ATOM 2298 HB2 GLU A 151 -1.160 12.724 -14.008 1.00 0.00 H ATOM 2299 HB3 GLU A 151 -1.502 13.711 -15.448 1.00 0.00 H ATOM 2300 HG2 GLU A 151 -1.376 14.648 -12.564 1.00 0.00 H ATOM 2301 HG3 GLU A 151 -0.246 15.035 -13.883 1.00 0.00 H ATOM 2302 H GLU A 151 -3.024 12.947 -12.193 1.00 0.00 H ATOM 2303 N SER A 152 -3.770 10.773 -14.083 1.00 5.08 N ATOM 2304 CA SER A 152 -3.836 9.407 -14.591 1.00 5.23 C ATOM 2305 C SER A 152 -4.597 9.139 -15.873 1.00 6.85 C ATOM 2306 O SER A 152 -5.819 9.365 -15.971 1.00 9.07 O ATOM 2307 CB SER A 152 -4.152 8.413 -13.455 1.00 3.07 C ATOM 2308 OG SER A 152 -4.207 7.118 -13.960 1.00 7.39 O ATOM 2309 HA SER A 152 -2.824 9.231 -14.956 1.00 0.00 H ATOM 2310 HB2 SER A 152 -5.113 8.668 -13.008 1.00 0.00 H ATOM 2311 HB3 SER A 152 -3.372 8.472 -12.695 1.00 0.00 H ATOM 2312 HG SER A 152 -3.334 6.885 -14.364 1.00 0.00 H ATOM 2313 H SER A 152 -4.063 10.980 -13.107 1.00 0.00 H ATOM 2314 N ASN A 153 -3.894 8.605 -16.883 1.00 7.07 N ATOM 2315 CA ASN A 153 -4.605 8.290 -18.114 1.00 5.82 C ATOM 2316 C ASN A 153 -5.432 7.011 -17.912 1.00 7.82 C ATOM 2317 O ASN A 153 -6.497 6.833 -18.478 1.00 9.39 O ATOM 2318 CB ASN A 153 -3.598 8.186 -19.296 1.00 7.48 C ATOM 2319 CG ASN A 153 -2.783 9.499 -19.471 1.00 20.05 C ATOM 2320 OD1 ASN A 153 -1.734 9.618 -20.191 1.00 40.93 O ATOM 2321 ND2 ASN A 153 -3.086 10.471 -18.617 1.00 80.00 N ATOM 2322 HA ASN A 153 -5.303 9.088 -18.368 1.00 0.00 H ATOM 2323 HB2 ASN A 153 -2.908 7.364 -19.102 1.00 0.00 H ATOM 2324 HB3 ASN A 153 -4.150 7.987 -20.215 1.00 0.00 H ATOM 2325 HD22 ASN A 153 -3.935 10.394 -18.022 1.00 0.00 H ATOM 2326 HD21 ASN A 153 -2.474 11.309 -18.544 1.00 0.00 H ATOM 2327 H ASN A 153 -2.874 8.422 -16.790 1.00 0.00 H ATOM 2328 N PHE A 154 -4.930 6.114 -17.043 1.00 5.44 N ATOM 2329 CA PHE A 154 -5.644 4.868 -16.765 1.00 8.90 C ATOM 2330 C PHE A 154 -6.938 5.145 -16.009 1.00 9.62 C ATOM 2331 O PHE A 154 -8.013 4.646 -16.342 1.00 9.19 O ATOM 2332 CB PHE A 154 -4.753 3.917 -16.007 1.00 9.42 C ATOM 2333 CG PHE A 154 -5.517 2.677 -15.663 1.00 7.21 C ATOM 2334 CD1 PHE A 154 -5.631 1.634 -16.578 1.00 12.35 C ATOM 2335 CD2 PHE A 154 -6.173 2.528 -14.442 1.00 9.49 C ATOM 2336 CE1 PHE A 154 -6.370 0.489 -16.278 1.00 16.58 C ATOM 2337 CE2 PHE A 154 -6.910 1.392 -14.105 1.00 9.53 C ATOM 2338 CZ PHE A 154 -7.001 0.358 -15.040 1.00 17.79 C ATOM 2339 HA PHE A 154 -5.913 4.397 -17.711 1.00 0.00 H ATOM 2340 HB2 PHE A 154 -3.894 3.654 -16.625 1.00 0.00 H ATOM 2341 HB3 PHE A 154 -4.407 4.396 -15.091 1.00 0.00 H ATOM 2342 HD2 PHE A 154 -6.107 3.338 -13.716 1.00 0.00 H ATOM 2343 HE2 PHE A 154 -7.403 1.313 -13.136 1.00 0.00 H ATOM 2344 HZ PHE A 154 -7.562 -0.546 -14.804 1.00 0.00 H ATOM 2345 HE1 PHE A 154 -6.455 -0.309 -17.016 1.00 0.00 H ATOM 2346 HD1 PHE A 154 -5.135 1.713 -17.545 1.00 0.00 H ATOM 2347 H PHE A 154 -4.027 6.308 -16.565 1.00 0.00 H ATOM 2348 N ALA A 155 -6.840 5.979 -14.967 1.00 7.49 N ATOM 2349 CA ALA A 155 -7.993 6.324 -14.155 1.00 7.07 C ATOM 2350 C ALA A 155 -9.068 6.909 -15.061 1.00 17.55 C ATOM 2351 O ALA A 155 -10.254 6.611 -14.929 1.00 12.25 O ATOM 2352 CB ALA A 155 -7.664 7.178 -12.914 1.00 8.27 C ATOM 2353 HA ALA A 155 -8.385 5.414 -13.701 1.00 0.00 H ATOM 2354 HB1 ALA A 155 -6.973 6.632 -12.272 1.00 0.00 H ATOM 2355 HB2 ALA A 155 -7.205 8.115 -13.230 1.00 0.00 H ATOM 2356 HB3 ALA A 155 -8.582 7.389 -12.366 1.00 0.00 H ATOM 2357 H ALA A 155 -5.914 6.391 -14.733 1.00 0.00 H ATOM 2358 N ARG A 156 -8.637 7.745 -15.983 1.00 12.35 N ATOM 2359 CA ARG A 156 -9.492 8.410 -16.953 1.00 12.93 C ATOM 2360 C ARG A 156 -10.140 7.440 -17.911 1.00 11.11 C ATOM 2361 O ARG A 156 -11.351 7.510 -18.137 1.00 16.86 O ATOM 2362 CB ARG A 156 -8.719 9.535 -17.651 1.00 17.00 C ATOM 2363 CG ARG A 156 -9.548 10.354 -18.630 1.00 68.60 C ATOM 2364 CD ARG A 156 -8.780 11.507 -19.287 1.00 45.67 C ATOM 2365 NE ARG A 156 -7.679 12.029 -18.456 1.00 80.00 N ATOM 2366 CZ ARG A 156 -6.417 12.180 -18.897 1.00 80.00 C ATOM 2367 NH1 ARG A 156 -6.099 11.862 -20.165 1.00 48.74 N ATOM 2368 NH2 ARG A 156 -5.472 12.664 -18.065 1.00 49.58 N ATOM 2369 HA ARG A 156 -10.325 8.870 -16.422 1.00 0.00 H ATOM 2370 HB2 ARG A 156 -8.331 10.208 -16.886 1.00 0.00 H ATOM 2371 HB3 ARG A 156 -7.887 9.090 -18.197 1.00 0.00 H ATOM 2372 HG2 ARG A 156 -9.906 9.689 -19.416 1.00 0.00 H ATOM 2373 HG3 ARG A 156 -10.400 10.771 -18.093 1.00 0.00 H ATOM 2374 HD2 ARG A 156 -9.479 12.320 -19.484 1.00 0.00 H ATOM 2375 HD3 ARG A 156 -8.363 11.152 -20.229 1.00 0.00 H ATOM 2376 HE ARG A 156 -7.890 12.296 -17.473 1.00 0.00 H ATOM 2377 HH12 ARG A 156 -5.122 11.980 -20.501 1.00 0.00 H ATOM 2378 HH11 ARG A 156 -6.830 11.498 -20.809 1.00 0.00 H ATOM 2379 HH22 ARG A 156 -4.495 12.783 -18.401 1.00 0.00 H ATOM 2380 HH21 ARG A 156 -5.721 12.918 -17.088 1.00 0.00 H ATOM 2381 H ARG A 156 -7.617 7.943 -16.020 1.00 0.00 H ATOM 2382 N ALA A 157 -9.397 6.508 -18.483 1.00 13.63 N ATOM 2383 CA ALA A 157 -9.985 5.566 -19.385 1.00 10.96 C ATOM 2384 C ALA A 157 -10.937 4.654 -18.678 1.00 10.57 C ATOM 2385 O ALA A 157 -11.946 4.307 -19.233 1.00 18.37 O ATOM 2386 CB ALA A 157 -8.889 4.758 -20.046 1.00 9.39 C ATOM 2387 HA ALA A 157 -10.549 6.115 -20.139 1.00 0.00 H ATOM 2388 HB1 ALA A 157 -8.227 5.427 -20.596 1.00 0.00 H ATOM 2389 HB2 ALA A 157 -8.320 4.228 -19.283 1.00 0.00 H ATOM 2390 HB3 ALA A 157 -9.334 4.039 -20.734 1.00 0.00 H ATOM 2391 H ALA A 157 -8.379 6.459 -18.276 1.00 0.00 H ATOM 2392 N TYR A 158 -10.582 4.258 -17.465 1.00 10.94 N ATOM 2393 CA TYR A 158 -11.402 3.391 -16.647 1.00 6.79 C ATOM 2394 C TYR A 158 -12.778 4.062 -16.488 1.00 10.98 C ATOM 2395 O TYR A 158 -13.830 3.513 -16.766 1.00 9.88 O ATOM 2396 CB TYR A 158 -10.793 2.999 -15.269 1.00 7.13 C ATOM 2397 CG TYR A 158 -11.755 1.998 -14.646 1.00 5.45 C ATOM 2398 CD1 TYR A 158 -12.883 2.382 -13.913 1.00 7.67 C ATOM 2399 CD2 TYR A 158 -11.579 0.629 -14.839 1.00 10.64 C ATOM 2400 CE1 TYR A 158 -13.802 1.482 -13.369 1.00 14.44 C ATOM 2401 CE2 TYR A 158 -12.460 -0.303 -14.272 1.00 7.52 C ATOM 2402 CZ TYR A 158 -13.596 0.113 -13.571 1.00 8.90 C ATOM 2403 OH TYR A 158 -14.476 -0.833 -13.066 1.00 11.56 O ATOM 2404 HA TYR A 158 -11.480 2.434 -17.164 1.00 0.00 H ATOM 2405 HB3 TYR A 158 -10.700 3.879 -14.633 1.00 0.00 H ATOM 2406 HB2 TYR A 158 -9.811 2.545 -15.405 1.00 0.00 H ATOM 2407 HD2 TYR A 158 -10.742 0.277 -15.441 1.00 0.00 H ATOM 2408 HE2 TYR A 158 -12.256 -1.368 -14.379 1.00 0.00 H ATOM 2409 HE1 TYR A 158 -14.661 1.838 -12.800 1.00 0.00 H ATOM 2410 HD1 TYR A 158 -13.055 3.447 -13.757 1.00 0.00 H ATOM 2411 HH TYR A 158 -15.220 -0.375 -12.601 1.00 0.00 H ATOM 2412 H TYR A 158 -9.672 4.585 -17.083 1.00 0.00 H ATOM 2413 N ALA A 159 -12.778 5.332 -16.067 1.00 11.39 N ATOM 2414 CA ALA A 159 -13.985 6.104 -15.893 1.00 13.84 C ATOM 2415 C ALA A 159 -14.820 6.217 -17.161 1.00 21.79 C ATOM 2416 O ALA A 159 -16.031 6.330 -17.099 1.00 18.31 O ATOM 2417 CB ALA A 159 -13.673 7.484 -15.334 1.00 14.49 C ATOM 2418 HA ALA A 159 -14.591 5.555 -15.172 1.00 0.00 H ATOM 2419 HB1 ALA A 159 -13.181 7.380 -14.367 1.00 0.00 H ATOM 2420 HB2 ALA A 159 -13.015 8.013 -16.023 1.00 0.00 H ATOM 2421 HB3 ALA A 159 -14.600 8.044 -15.213 1.00 0.00 H ATOM 2422 H ALA A 159 -11.866 5.784 -15.855 1.00 0.00 H ATOM 2423 N GLU A 160 -14.167 6.184 -18.311 1.00 19.74 N ATOM 2424 CA GLU A 160 -14.864 6.268 -19.587 1.00 15.34 C ATOM 2425 C GLU A 160 -15.443 4.914 -19.993 1.00 24.45 C ATOM 2426 O GLU A 160 -16.192 4.848 -20.946 1.00 31.61 O ATOM 2427 CB GLU A 160 -14.006 6.869 -20.704 1.00 23.35 C ATOM 2428 CG GLU A 160 -14.478 8.308 -21.010 1.00 73.92 C ATOM 2429 CD GLU A 160 -13.528 9.425 -20.656 1.00 80.00 C ATOM 2430 OE1 GLU A 160 -12.491 9.477 -21.481 1.00 47.26 O ATOM 2431 OE2 GLU A 160 -13.820 10.310 -19.846 1.00 80.00 O ATOM 2432 HA GLU A 160 -15.692 6.961 -19.438 1.00 0.00 H ATOM 2433 HB2 GLU A 160 -12.963 6.889 -20.388 1.00 0.00 H ATOM 2434 HB3 GLU A 160 -14.101 6.258 -21.602 1.00 0.00 H ATOM 2435 HG2 GLU A 160 -14.676 8.370 -22.080 1.00 0.00 H ATOM 2436 HG3 GLU A 160 -15.404 8.476 -20.460 1.00 0.00 H ATOM 2437 H GLU A 160 -13.131 6.096 -18.304 1.00 0.00 H ATOM 2438 N GLY A 161 -15.122 3.826 -19.293 1.00 13.32 N ATOM 2439 CA GLY A 161 -15.702 2.559 -19.640 1.00 14.88 C ATOM 2440 C GLY A 161 -14.920 1.729 -20.619 1.00 17.89 C ATOM 2441 O GLY A 161 -15.453 0.866 -21.311 1.00 19.51 O ATOM 2442 HA3 GLY A 161 -16.685 2.748 -20.071 1.00 0.00 H ATOM 2443 HA2 GLY A 161 -15.814 1.979 -18.724 1.00 0.00 H ATOM 2444 H GLY A 161 -14.454 3.894 -18.499 1.00 0.00 H ATOM 2445 N ILE A 162 -13.650 1.962 -20.661 1.00 13.32 N ATOM 2446 CA ILE A 162 -12.852 1.165 -21.566 1.00 9.51 C ATOM 2447 C ILE A 162 -12.980 -0.363 -21.327 1.00 13.61 C ATOM 2448 O ILE A 162 -13.118 -0.857 -20.206 1.00 11.85 O ATOM 2449 CB ILE A 162 -11.417 1.680 -21.372 1.00 22.21 C ATOM 2450 CG1 ILE A 162 -10.600 1.430 -22.612 1.00 29.94 C ATOM 2451 CG2 ILE A 162 -10.738 1.108 -20.129 1.00 21.26 C ATOM 2452 CD1 ILE A 162 -11.118 2.263 -23.781 1.00 42.39 C ATOM 2453 HA ILE A 162 -13.192 1.277 -22.596 1.00 0.00 H ATOM 2454 HB ILE A 162 -11.483 2.755 -21.205 1.00 0.00 H ATOM 2455 HG12 ILE A 162 -9.562 1.697 -22.416 1.00 0.00 H ATOM 2456 HG13 ILE A 162 -10.659 0.373 -22.872 1.00 0.00 H ATOM 2457 HD11 ILE A 162 -12.155 1.997 -23.984 1.00 0.00 H ATOM 2458 HD12 ILE A 162 -11.056 3.321 -23.527 1.00 0.00 H ATOM 2459 HD13 ILE A 162 -10.511 2.064 -24.664 1.00 0.00 H ATOM 2460 HG21 ILE A 162 -11.311 1.384 -19.244 1.00 0.00 H ATOM 2461 HG22 ILE A 162 -10.692 0.022 -20.209 1.00 0.00 H ATOM 2462 HG23 ILE A 162 -9.728 1.511 -20.050 1.00 0.00 H ATOM 2463 H ILE A 162 -13.217 2.696 -20.065 1.00 0.00 H ATOM 2464 N ASN A 163 -12.959 -1.142 -22.392 1.00 3.38 N ATOM 2465 CA ASN A 163 -13.039 -2.581 -22.289 1.00 5.03 C ATOM 2466 C ASN A 163 -11.747 -3.031 -21.596 1.00 9.84 C ATOM 2467 O ASN A 163 -10.664 -2.510 -21.900 1.00 12.07 O ATOM 2468 CB ASN A 163 -13.062 -3.099 -23.760 1.00 11.03 C ATOM 2469 CG ASN A 163 -13.303 -4.599 -23.860 1.00 21.48 C ATOM 2470 OD1 ASN A 163 -12.608 -5.396 -23.218 1.00 10.94 O ATOM 2471 ND2 ASN A 163 -14.298 -4.994 -24.652 1.00 9.56 N ATOM 2472 HA ASN A 163 -13.906 -2.945 -21.737 1.00 0.00 H ATOM 2473 HB2 ASN A 163 -13.857 -2.583 -24.298 1.00 0.00 H ATOM 2474 HB3 ASN A 163 -12.103 -2.870 -24.224 1.00 0.00 H ATOM 2475 HD22 ASN A 163 -14.858 -4.290 -25.174 1.00 0.00 H ATOM 2476 HD21 ASN A 163 -14.515 -6.006 -24.748 1.00 0.00 H ATOM 2477 H ASN A 163 -12.883 -0.707 -23.334 1.00 0.00 H ATOM 2478 N ARG A 164 -11.876 -4.006 -20.696 1.00 10.26 N ATOM 2479 CA ARG A 164 -10.751 -4.517 -19.952 1.00 9.94 C ATOM 2480 C ARG A 164 -9.574 -4.999 -20.747 1.00 9.68 C ATOM 2481 O ARG A 164 -8.427 -5.015 -20.267 1.00 12.96 O ATOM 2482 CB ARG A 164 -11.208 -5.518 -18.900 1.00 14.82 C ATOM 2483 CG ARG A 164 -12.037 -6.611 -19.522 1.00 35.37 C ATOM 2484 CD ARG A 164 -11.799 -7.936 -18.823 1.00 80.00 C ATOM 2485 NE ARG A 164 -12.740 -8.152 -17.735 1.00 68.36 N ATOM 2486 CZ ARG A 164 -12.535 -8.986 -16.703 1.00 36.29 C ATOM 2487 NH1 ARG A 164 -11.417 -9.715 -16.555 1.00 80.00 N ATOM 2488 NH2 ARG A 164 -13.506 -9.060 -15.792 1.00 80.00 N ATOM 2489 HA ARG A 164 -10.336 -3.641 -19.454 1.00 0.00 H ATOM 2490 HB2 ARG A 164 -10.333 -5.960 -18.424 1.00 0.00 H ATOM 2491 HB3 ARG A 164 -11.805 -5.000 -18.150 1.00 0.00 H ATOM 2492 HG2 ARG A 164 -13.092 -6.349 -19.441 1.00 0.00 H ATOM 2493 HG3 ARG A 164 -11.768 -6.709 -20.574 1.00 0.00 H ATOM 2494 HD2 ARG A 164 -10.786 -7.945 -18.420 1.00 0.00 H ATOM 2495 HD3 ARG A 164 -11.908 -8.742 -19.549 1.00 0.00 H ATOM 2496 HE ARG A 164 -13.635 -7.623 -17.758 1.00 0.00 H ATOM 2497 HH12 ARG A 164 -11.312 -10.345 -15.735 1.00 0.00 H ATOM 2498 HH11 ARG A 164 -10.656 -9.649 -17.261 1.00 0.00 H ATOM 2499 HH22 ARG A 164 -13.402 -9.690 -14.971 1.00 0.00 H ATOM 2500 HH21 ARG A 164 -14.368 -8.488 -15.903 1.00 0.00 H ATOM 2501 H ARG A 164 -12.818 -4.411 -20.525 1.00 0.00 H ATOM 2502 N THR A 165 -9.734 -5.441 -22.004 1.00 5.92 N ATOM 2503 CA THR A 165 -8.599 -5.912 -22.817 1.00 7.39 C ATOM 2504 C THR A 165 -7.594 -4.794 -23.107 1.00 5.39 C ATOM 2505 O THR A 165 -6.432 -5.044 -23.410 1.00 13.68 O ATOM 2506 CB THR A 165 -9.028 -6.605 -24.158 1.00 13.63 C ATOM 2507 OG1 THR A 165 -9.700 -5.686 -25.065 1.00 21.05 O ATOM 2508 CG2 THR A 165 -9.981 -7.743 -23.808 1.00 19.11 C ATOM 2509 HA THR A 165 -8.116 -6.671 -22.203 1.00 0.00 H ATOM 2510 HB THR A 165 -8.133 -6.965 -24.665 1.00 0.00 H ATOM 2511 HG1 THR A 165 -10.515 -5.330 -24.629 1.00 0.00 H ATOM 2512 HG23 THR A 165 -9.484 -8.435 -23.129 1.00 0.00 H ATOM 2513 HG21 THR A 165 -10.870 -7.336 -23.327 1.00 0.00 H ATOM 2514 HG22 THR A 165 -10.267 -8.268 -24.719 1.00 0.00 H ATOM 2515 H THR A 165 -10.688 -5.451 -22.417 1.00 0.00 H ATOM 2516 N LYS A 166 -8.014 -3.503 -22.975 1.00 5.96 N ATOM 2517 CA LYS A 166 -7.080 -2.445 -23.259 1.00 10.23 C ATOM 2518 C LYS A 166 -6.398 -1.808 -22.074 1.00 11.25 C ATOM 2519 O LYS A 166 -5.677 -0.849 -22.300 1.00 11.43 O ATOM 2520 CB LYS A 166 -7.803 -1.395 -24.049 1.00 10.31 C ATOM 2521 CG LYS A 166 -7.925 -1.766 -25.518 1.00 27.59 C ATOM 2522 CD LYS A 166 -8.491 -0.648 -26.355 1.00 41.23 C ATOM 2523 CE LYS A 166 -7.433 -0.148 -27.306 1.00 31.89 C ATOM 2524 NZ LYS A 166 -6.326 0.513 -26.596 1.00 63.59 N ATOM 2525 HA LYS A 166 -6.262 -2.912 -23.808 1.00 0.00 H ATOM 2526 HB2 LYS A 166 -8.803 -1.269 -23.634 1.00 0.00 H ATOM 2527 HB3 LYS A 166 -7.256 -0.455 -23.968 1.00 0.00 H ATOM 2528 HG2 LYS A 166 -6.935 -2.019 -25.897 1.00 0.00 H ATOM 2529 HG3 LYS A 166 -8.579 -2.633 -25.606 1.00 0.00 H ATOM 2530 HD2 LYS A 166 -9.346 -1.015 -26.923 1.00 0.00 H ATOM 2531 HD3 LYS A 166 -8.811 0.167 -25.705 1.00 0.00 H ATOM 2532 HE2 LYS A 166 -7.886 0.565 -27.995 1.00 0.00 H ATOM 2533 HE3 LYS A 166 -7.037 -0.993 -27.869 1.00 0.00 H ATOM 2534 HZ1 LYS A 166 -6.695 1.325 -26.061 1.00 0.00 H ATOM 2535 HZ2 LYS A 166 -5.883 -0.163 -25.941 1.00 0.00 H ATOM 2536 HZ3 LYS A 166 -5.621 0.842 -27.286 1.00 0.00 H ATOM 2537 H LYS A 166 -8.987 -3.288 -22.676 1.00 0.00 H ATOM 2538 N TYR A 167 -6.676 -2.311 -20.855 1.00 4.95 N ATOM 2539 CA TYR A 167 -6.085 -1.783 -19.657 1.00 5.03 C ATOM 2540 C TYR A 167 -4.569 -1.565 -19.836 1.00 7.67 C ATOM 2541 O TYR A 167 -4.027 -0.484 -19.564 1.00 13.01 O ATOM 2542 CB TYR A 167 -6.297 -2.665 -18.398 1.00 4.59 C ATOM 2543 CG TYR A 167 -7.706 -2.688 -17.896 1.00 5.35 C ATOM 2544 CD1 TYR A 167 -8.649 -1.723 -18.274 1.00 3.85 C ATOM 2545 CD2 TYR A 167 -8.092 -3.683 -17.002 1.00 6.13 C ATOM 2546 CE1 TYR A 167 -9.957 -1.757 -17.782 1.00 8.30 C ATOM 2547 CE2 TYR A 167 -9.400 -3.732 -16.518 1.00 8.42 C ATOM 2548 CZ TYR A 167 -10.328 -2.763 -16.895 1.00 7.58 C ATOM 2549 OH TYR A 167 -11.625 -2.829 -16.427 1.00 11.55 O ATOM 2550 HA TYR A 167 -6.602 -0.838 -19.492 1.00 0.00 H ATOM 2551 HB3 TYR A 167 -5.656 -2.285 -17.602 1.00 0.00 H ATOM 2552 HB2 TYR A 167 -6.004 -3.686 -18.642 1.00 0.00 H ATOM 2553 HD2 TYR A 167 -7.367 -4.429 -16.678 1.00 0.00 H ATOM 2554 HE2 TYR A 167 -9.698 -4.533 -15.841 1.00 0.00 H ATOM 2555 HE1 TYR A 167 -10.680 -1.002 -18.090 1.00 0.00 H ATOM 2556 HD1 TYR A 167 -8.357 -0.931 -18.964 1.00 0.00 H ATOM 2557 HH TYR A 167 -12.145 -2.069 -16.790 1.00 0.00 H ATOM 2558 H TYR A 167 -7.340 -3.108 -20.779 1.00 0.00 H ATOM 2559 N TRP A 168 -3.851 -2.567 -20.265 1.00 7.66 N ATOM 2560 CA TRP A 168 -2.390 -2.434 -20.434 1.00 6.94 C ATOM 2561 C TRP A 168 -1.903 -1.214 -21.194 1.00 7.48 C ATOM 2562 O TRP A 168 -0.856 -0.681 -20.906 1.00 6.19 O ATOM 2563 CB TRP A 168 -1.709 -3.733 -20.910 1.00 8.35 C ATOM 2564 CG TRP A 168 -1.792 -3.883 -22.413 1.00 10.11 C ATOM 2565 CD1 TRP A 168 -2.768 -4.547 -23.093 1.00 14.89 C ATOM 2566 CD2 TRP A 168 -0.915 -3.297 -23.387 1.00 6.38 C ATOM 2567 NE1 TRP A 168 -2.548 -4.439 -24.459 1.00 17.38 N ATOM 2568 CE2 TRP A 168 -1.403 -3.688 -24.669 1.00 16.13 C ATOM 2569 CE3 TRP A 168 0.264 -2.506 -23.307 1.00 10.70 C ATOM 2570 CZ2 TRP A 168 -0.738 -3.278 -25.843 1.00 21.05 C ATOM 2571 CZ3 TRP A 168 0.918 -2.132 -24.466 1.00 11.50 C ATOM 2572 CH2 TRP A 168 0.409 -2.495 -25.719 1.00 14.71 C ATOM 2573 HA TRP A 168 -2.057 -2.245 -19.413 1.00 0.00 H ATOM 2574 HB2 TRP A 168 -0.660 -3.713 -20.613 1.00 0.00 H ATOM 2575 HB3 TRP A 168 -2.202 -4.584 -20.441 1.00 0.00 H ATOM 2576 HE1 TRP A 168 -3.145 -4.854 -25.203 1.00 0.00 H ATOM 2577 HD1 TRP A 168 -3.598 -5.083 -22.633 1.00 0.00 H ATOM 2578 HZ2 TRP A 168 -1.112 -3.567 -26.825 1.00 0.00 H ATOM 2579 HH2 TRP A 168 0.922 -2.157 -26.619 1.00 0.00 H ATOM 2580 HZ3 TRP A 168 1.837 -1.550 -24.404 1.00 0.00 H ATOM 2581 HE3 TRP A 168 0.650 -2.196 -22.336 1.00 0.00 H ATOM 2582 H TRP A 168 -4.314 -3.471 -20.491 1.00 0.00 H ATOM 2583 N GLU A 169 -2.672 -0.784 -22.201 1.00 9.89 N ATOM 2584 CA GLU A 169 -2.246 0.363 -23.014 1.00 6.91 C ATOM 2585 C GLU A 169 -2.184 1.592 -22.185 1.00 7.12 C ATOM 2586 O GLU A 169 -1.236 2.351 -22.344 1.00 8.12 O ATOM 2587 CB GLU A 169 -3.135 0.537 -24.300 1.00 3.09 C ATOM 2588 CG GLU A 169 -3.181 -0.836 -25.017 1.00 10.08 C ATOM 2589 CD GLU A 169 -3.831 -0.724 -26.378 1.00 18.24 C ATOM 2590 OE1 GLU A 169 -3.554 0.421 -26.944 1.00 25.75 O ATOM 2591 OE2 GLU A 169 -4.563 -1.572 -26.877 1.00 35.36 O ATOM 2592 HA GLU A 169 -1.238 0.167 -23.379 1.00 0.00 H ATOM 2593 HB2 GLU A 169 -4.142 0.845 -24.019 1.00 0.00 H ATOM 2594 HB3 GLU A 169 -2.697 1.287 -24.958 1.00 0.00 H ATOM 2595 HG2 GLU A 169 -2.164 -1.208 -25.139 1.00 0.00 H ATOM 2596 HG3 GLU A 169 -3.752 -1.536 -24.407 1.00 0.00 H ATOM 2597 H GLU A 169 -3.572 -1.262 -22.408 1.00 0.00 H ATOM 2598 N PHE A 170 -3.175 1.776 -21.297 1.00 3.02 N ATOM 2599 CA PHE A 170 -3.185 2.952 -20.447 1.00 9.68 C ATOM 2600 C PHE A 170 -2.237 2.845 -19.263 1.00 3.67 C ATOM 2601 O PHE A 170 -1.681 3.871 -18.819 1.00 9.04 O ATOM 2602 CB PHE A 170 -4.581 3.347 -20.008 1.00 9.44 C ATOM 2603 CG PHE A 170 -5.397 3.597 -21.229 1.00 14.54 C ATOM 2604 CD1 PHE A 170 -5.482 4.831 -21.878 1.00 17.56 C ATOM 2605 CD2 PHE A 170 -6.096 2.494 -21.709 1.00 17.63 C ATOM 2606 CE1 PHE A 170 -6.273 4.968 -23.026 1.00 23.03 C ATOM 2607 CE2 PHE A 170 -6.879 2.621 -22.850 1.00 24.72 C ATOM 2608 CZ PHE A 170 -6.961 3.851 -23.504 1.00 18.20 C ATOM 2609 HA PHE A 170 -2.807 3.759 -21.075 1.00 0.00 H ATOM 2610 HB2 PHE A 170 -5.027 2.542 -19.424 1.00 0.00 H ATOM 2611 HB3 PHE A 170 -4.536 4.252 -19.402 1.00 0.00 H ATOM 2612 HD2 PHE A 170 -6.030 1.536 -21.193 1.00 0.00 H ATOM 2613 HE2 PHE A 170 -7.428 1.761 -23.234 1.00 0.00 H ATOM 2614 HZ PHE A 170 -7.572 3.941 -24.402 1.00 0.00 H ATOM 2615 HE1 PHE A 170 -6.350 5.928 -23.536 1.00 0.00 H ATOM 2616 HD1 PHE A 170 -4.932 5.689 -21.491 1.00 0.00 H ATOM 2617 H PHE A 170 -3.938 1.073 -21.218 1.00 0.00 H ATOM 2618 N VAL A 171 -2.021 1.631 -18.783 1.00 7.02 N ATOM 2619 CA VAL A 171 -1.087 1.484 -17.699 1.00 8.35 C ATOM 2620 C VAL A 171 0.295 1.827 -18.263 1.00 9.77 C ATOM 2621 O VAL A 171 1.114 2.491 -17.649 1.00 8.23 O ATOM 2622 CB VAL A 171 -1.105 0.035 -17.223 1.00 3.32 C ATOM 2623 CG1 VAL A 171 0.079 -0.284 -16.300 1.00 6.49 C ATOM 2624 CG2 VAL A 171 -2.376 -0.127 -16.383 1.00 7.35 C ATOM 2625 HA VAL A 171 -1.337 2.131 -16.859 1.00 0.00 H ATOM 2626 HB VAL A 171 -1.057 -0.624 -18.090 1.00 0.00 H ATOM 2627 HG11 VAL A 171 1.012 -0.114 -16.836 1.00 0.00 H ATOM 2628 HG12 VAL A 171 0.039 0.363 -15.423 1.00 0.00 H ATOM 2629 HG13 VAL A 171 0.023 -1.327 -15.987 1.00 0.00 H ATOM 2630 HG21 VAL A 171 -2.342 0.562 -15.539 1.00 0.00 H ATOM 2631 HG22 VAL A 171 -3.248 0.093 -16.999 1.00 0.00 H ATOM 2632 HG23 VAL A 171 -2.439 -1.151 -16.015 1.00 0.00 H ATOM 2633 H VAL A 171 -2.513 0.805 -19.179 1.00 0.00 H ATOM 2634 N TYR A 172 0.619 1.418 -19.469 1.00 5.86 N ATOM 2635 CA TYR A 172 1.908 1.708 -20.069 1.00 3.00 C ATOM 2636 C TYR A 172 2.164 3.238 -20.138 1.00 5.31 C ATOM 2637 O TYR A 172 3.242 3.734 -19.827 1.00 7.43 O ATOM 2638 CB TYR A 172 1.927 1.076 -21.498 1.00 7.32 C ATOM 2639 CG TYR A 172 3.027 1.641 -22.393 1.00 7.00 C ATOM 2640 CD1 TYR A 172 2.910 2.865 -23.072 1.00 9.48 C ATOM 2641 CD2 TYR A 172 4.237 0.958 -22.514 1.00 6.17 C ATOM 2642 CE1 TYR A 172 3.922 3.385 -23.888 1.00 15.33 C ATOM 2643 CE2 TYR A 172 5.259 1.467 -23.312 1.00 7.78 C ATOM 2644 CZ TYR A 172 5.123 2.672 -24.002 1.00 12.07 C ATOM 2645 OH TYR A 172 6.191 3.062 -24.769 1.00 8.34 O ATOM 2646 HA TYR A 172 2.704 1.282 -19.459 1.00 0.00 H ATOM 2647 HB3 TYR A 172 0.964 1.264 -21.973 1.00 0.00 H ATOM 2648 HB2 TYR A 172 2.079 0.001 -21.399 1.00 0.00 H ATOM 2649 HD2 TYR A 172 4.384 0.019 -21.980 1.00 0.00 H ATOM 2650 HE2 TYR A 172 6.191 0.908 -23.400 1.00 0.00 H ATOM 2651 HE1 TYR A 172 3.779 4.324 -24.423 1.00 0.00 H ATOM 2652 HD1 TYR A 172 1.989 3.436 -22.958 1.00 0.00 H ATOM 2653 HH TYR A 172 5.983 3.924 -25.209 1.00 0.00 H ATOM 2654 H TYR A 172 -0.074 0.866 -20.014 1.00 0.00 H ATOM 2655 N GLU A 173 1.139 3.980 -20.539 1.00 8.02 N ATOM 2656 CA GLU A 173 1.288 5.421 -20.621 1.00 7.47 C ATOM 2657 C GLU A 173 1.544 6.037 -19.284 1.00 10.11 C ATOM 2658 O GLU A 173 2.450 6.850 -19.217 1.00 11.39 O ATOM 2659 CB GLU A 173 0.110 6.154 -21.284 1.00 3.00 C ATOM 2660 CG GLU A 173 -0.116 5.553 -22.713 1.00 7.00 C ATOM 2661 CD GLU A 173 0.880 6.001 -23.772 1.00 12.79 C ATOM 2662 OE1 GLU A 173 1.643 6.996 -23.380 1.00 15.64 O ATOM 2663 OE2 GLU A 173 1.103 5.384 -24.810 1.00 11.40 O ATOM 2664 HA GLU A 173 2.156 5.551 -21.268 1.00 0.00 H ATOM 2665 HB2 GLU A 173 -0.790 6.021 -20.683 1.00 0.00 H ATOM 2666 HB3 GLU A 173 0.338 7.217 -21.365 1.00 0.00 H ATOM 2667 HG2 GLU A 173 -0.059 4.467 -22.635 1.00 0.00 H ATOM 2668 HG3 GLU A 173 -1.113 5.840 -23.046 1.00 0.00 H ATOM 2669 H GLU A 173 0.236 3.532 -20.793 1.00 0.00 H ATOM 2670 N ASP A 174 0.728 5.659 -18.274 1.00 7.58 N ATOM 2671 CA ASP A 174 0.940 6.218 -16.947 1.00 5.83 C ATOM 2672 C ASP A 174 2.291 5.764 -16.411 1.00 11.47 C ATOM 2673 O ASP A 174 2.964 6.466 -15.692 1.00 7.11 O ATOM 2674 CB ASP A 174 -0.125 5.754 -15.967 1.00 4.74 C ATOM 2675 CG ASP A 174 -1.447 6.446 -16.123 1.00 7.85 C ATOM 2676 OD1 ASP A 174 -1.325 7.683 -16.595 1.00 8.03 O ATOM 2677 OD2 ASP A 174 -2.411 6.088 -15.478 1.00 8.47 O ATOM 2678 HA ASP A 174 0.895 7.303 -17.040 1.00 0.00 H ATOM 2679 HB2 ASP A 174 -0.279 4.685 -16.110 1.00 0.00 H ATOM 2680 HB3 ASP A 174 0.239 5.935 -14.955 1.00 0.00 H ATOM 2681 H ASP A 174 -0.040 4.979 -18.443 1.00 0.00 H ATOM 2682 N ALA A 175 2.736 4.554 -16.786 1.00 3.25 N ATOM 2683 CA ALA A 175 4.046 4.077 -16.303 1.00 11.63 C ATOM 2684 C ALA A 175 5.225 4.923 -16.797 1.00 11.15 C ATOM 2685 O ALA A 175 6.144 5.339 -16.072 1.00 7.46 O ATOM 2686 CB ALA A 175 4.287 2.600 -16.687 1.00 6.31 C ATOM 2687 HA ALA A 175 4.001 4.175 -15.218 1.00 0.00 H ATOM 2688 HB1 ALA A 175 3.508 1.979 -16.244 1.00 0.00 H ATOM 2689 HB2 ALA A 175 4.261 2.499 -17.772 1.00 0.00 H ATOM 2690 HB3 ALA A 175 5.261 2.283 -16.315 1.00 0.00 H ATOM 2691 H ALA A 175 2.161 3.956 -17.413 1.00 0.00 H ATOM 2692 N MET A 176 5.232 5.162 -18.095 1.00 3.00 N ATOM 2693 CA MET A 176 6.274 5.942 -18.717 1.00 4.79 C ATOM 2694 C MET A 176 6.208 7.429 -18.202 1.00 9.05 C ATOM 2695 O MET A 176 7.224 8.094 -17.989 1.00 9.26 O ATOM 2696 CB MET A 176 5.971 5.898 -20.235 1.00 7.00 C ATOM 2697 CG MET A 176 6.157 4.498 -20.846 1.00 7.08 C ATOM 2698 SD MET A 176 7.941 4.048 -21.015 1.00 11.10 S ATOM 2699 CE MET A 176 8.664 4.992 -22.387 1.00 12.00 C ATOM 2700 HA MET A 176 7.266 5.554 -18.487 1.00 0.00 H ATOM 2701 HB2 MET A 176 4.939 6.212 -20.393 1.00 0.00 H ATOM 2702 HB3 MET A 176 6.642 6.591 -20.743 1.00 0.00 H ATOM 2703 HG2 MET A 176 5.694 4.480 -21.833 1.00 0.00 H ATOM 2704 HG3 MET A 176 5.668 3.766 -20.204 1.00 0.00 H ATOM 2705 HE1 MET A 176 8.136 4.752 -23.310 1.00 0.00 H ATOM 2706 HE2 MET A 176 8.572 6.058 -22.181 1.00 0.00 H ATOM 2707 HE3 MET A 176 9.717 4.730 -22.491 1.00 0.00 H ATOM 2708 H MET A 176 4.466 4.778 -18.685 1.00 0.00 H ATOM 2709 N ASP A 177 5.000 7.967 -17.990 1.00 3.00 N ATOM 2710 CA ASP A 177 4.861 9.315 -17.488 1.00 4.93 C ATOM 2711 C ASP A 177 5.329 9.372 -16.078 1.00 9.24 C ATOM 2712 O ASP A 177 5.983 10.322 -15.696 1.00 6.80 O ATOM 2713 CB ASP A 177 3.372 9.622 -17.424 1.00 7.26 C ATOM 2714 CG ASP A 177 2.791 10.142 -18.726 1.00 3.97 C ATOM 2715 OD1 ASP A 177 3.613 10.135 -19.751 1.00 9.21 O ATOM 2716 OD2 ASP A 177 1.601 10.202 -18.841 1.00 7.85 O ATOM 2717 HA ASP A 177 5.422 10.000 -18.124 1.00 0.00 H ATOM 2718 HB2 ASP A 177 2.845 8.707 -17.155 1.00 0.00 H ATOM 2719 HB3 ASP A 177 3.210 10.374 -16.652 1.00 0.00 H ATOM 2720 H ASP A 177 4.148 7.405 -18.190 1.00 0.00 H ATOM 2721 N LEU A 178 5.001 8.353 -15.257 1.00 4.38 N ATOM 2722 CA LEU A 178 5.429 8.404 -13.861 1.00 3.00 C ATOM 2723 C LEU A 178 6.964 8.294 -13.680 1.00 3.00 C ATOM 2724 O LEU A 178 7.607 8.986 -12.853 1.00 7.63 O ATOM 2725 CB LEU A 178 4.617 7.347 -13.047 1.00 6.06 C ATOM 2726 CG LEU A 178 5.095 7.012 -11.638 1.00 8.46 C ATOM 2727 CD1 LEU A 178 5.310 8.268 -10.820 1.00 10.49 C ATOM 2728 CD2 LEU A 178 4.068 6.137 -10.907 1.00 6.28 C ATOM 2729 HA LEU A 178 5.205 9.392 -13.460 1.00 0.00 H ATOM 2730 HB2 LEU A 178 3.595 7.716 -12.964 1.00 0.00 H ATOM 2731 HB3 LEU A 178 4.622 6.420 -13.621 1.00 0.00 H ATOM 2732 HG LEU A 178 6.038 6.475 -11.742 1.00 0.00 H ATOM 2733 HD21 LEU A 178 3.120 6.671 -10.839 1.00 0.00 H ATOM 2734 HD22 LEU A 178 3.925 5.209 -11.460 1.00 0.00 H ATOM 2735 HD23 LEU A 178 4.432 5.912 -9.905 1.00 0.00 H ATOM 2736 HD11 LEU A 178 6.062 8.891 -11.304 1.00 0.00 H ATOM 2737 HD12 LEU A 178 4.372 8.818 -10.748 1.00 0.00 H ATOM 2738 HD13 LEU A 178 5.650 7.996 -9.821 1.00 0.00 H ATOM 2739 H LEU A 178 4.452 7.544 -15.612 1.00 0.00 H ATOM 2740 N ILE A 179 7.603 7.413 -14.469 1.00 3.00 N ATOM 2741 CA ILE A 179 9.059 7.199 -14.451 1.00 7.01 C ATOM 2742 C ILE A 179 9.700 8.509 -14.875 1.00 8.80 C ATOM 2743 O ILE A 179 10.725 8.935 -14.317 1.00 6.37 O ATOM 2744 CB ILE A 179 9.542 6.060 -15.343 1.00 3.38 C ATOM 2745 CG1 ILE A 179 9.202 4.763 -14.621 1.00 8.37 C ATOM 2746 CG2 ILE A 179 11.063 6.151 -15.484 1.00 3.00 C ATOM 2747 CD1 ILE A 179 9.126 3.600 -15.616 1.00 12.96 C ATOM 2748 HA ILE A 179 9.347 6.899 -13.444 1.00 0.00 H ATOM 2749 HB ILE A 179 9.079 6.106 -16.329 1.00 0.00 H ATOM 2750 HG12 ILE A 179 9.973 4.552 -13.880 1.00 0.00 H ATOM 2751 HG13 ILE A 179 8.239 4.872 -14.121 1.00 0.00 H ATOM 2752 HD11 ILE A 179 8.354 3.807 -16.357 1.00 0.00 H ATOM 2753 HD12 ILE A 179 10.089 3.487 -16.115 1.00 0.00 H ATOM 2754 HD13 ILE A 179 8.882 2.682 -15.082 1.00 0.00 H ATOM 2755 HG21 ILE A 179 11.328 7.108 -15.932 1.00 0.00 H ATOM 2756 HG22 ILE A 179 11.523 6.069 -14.499 1.00 0.00 H ATOM 2757 HG23 ILE A 179 11.417 5.340 -16.121 1.00 0.00 H ATOM 2758 H ILE A 179 7.034 6.849 -15.132 1.00 0.00 H ATOM 2759 N ALA A 180 9.072 9.159 -15.861 1.00 5.50 N ATOM 2760 CA ALA A 180 9.569 10.445 -16.356 1.00 4.42 C ATOM 2761 C ALA A 180 9.564 11.538 -15.289 1.00 12.98 C ATOM 2762 O ALA A 180 10.461 12.358 -15.114 1.00 12.47 O ATOM 2763 CB ALA A 180 8.710 10.939 -17.559 1.00 8.04 C ATOM 2764 HA ALA A 180 10.600 10.267 -16.661 1.00 0.00 H ATOM 2765 HB1 ALA A 180 8.760 10.207 -18.365 1.00 0.00 H ATOM 2766 HB2 ALA A 180 7.675 11.059 -17.240 1.00 0.00 H ATOM 2767 HB3 ALA A 180 9.096 11.895 -17.911 1.00 0.00 H ATOM 2768 H ALA A 180 8.217 8.745 -16.283 1.00 0.00 H ATOM 2769 N LYS A 181 8.534 11.578 -14.531 1.00 9.61 N ATOM 2770 CA LYS A 181 8.383 12.590 -13.534 1.00 7.85 C ATOM 2771 C LYS A 181 9.084 12.387 -12.218 1.00 8.86 C ATOM 2772 O LYS A 181 9.417 13.364 -11.484 1.00 6.89 O ATOM 2773 CB LYS A 181 6.882 12.765 -13.271 1.00 6.50 C ATOM 2774 CG LYS A 181 6.038 13.325 -14.415 1.00 9.37 C ATOM 2775 CD LYS A 181 4.542 13.238 -14.070 1.00 18.19 C ATOM 2776 CE LYS A 181 3.645 13.000 -15.266 1.00 20.13 C ATOM 2777 NZ LYS A 181 3.878 14.033 -16.274 1.00 25.56 N ATOM 2778 HA LYS A 181 8.873 13.468 -13.953 1.00 0.00 H ATOM 2779 HB2 LYS A 181 6.477 11.787 -13.012 1.00 0.00 H ATOM 2780 HB3 LYS A 181 6.773 13.439 -12.421 1.00 0.00 H ATOM 2781 HG2 LYS A 181 6.308 14.367 -14.584 1.00 0.00 H ATOM 2782 HG3 LYS A 181 6.232 12.749 -15.320 1.00 0.00 H ATOM 2783 HD2 LYS A 181 4.400 12.418 -13.366 1.00 0.00 H ATOM 2784 HD3 LYS A 181 4.244 14.175 -13.599 1.00 0.00 H ATOM 2785 HE2 LYS A 181 2.603 13.032 -14.949 1.00 0.00 H ATOM 2786 HE3 LYS A 181 3.863 12.021 -15.693 1.00 0.00 H ATOM 2787 HZ1 LYS A 181 3.668 14.967 -15.867 1.00 0.00 H ATOM 2788 HZ2 LYS A 181 4.872 14.001 -16.578 1.00 0.00 H ATOM 2789 HZ3 LYS A 181 3.259 13.863 -17.092 1.00 0.00 H ATOM 2790 H LYS A 181 7.791 10.859 -14.643 1.00 0.00 H ATOM 2791 N LEU A 182 9.294 11.113 -11.866 1.00 14.04 N ATOM 2792 CA LEU A 182 9.946 10.816 -10.613 1.00 7.73 C ATOM 2793 C LEU A 182 11.186 11.639 -10.202 1.00 5.29 C ATOM 2794 O LEU A 182 11.254 12.129 -9.061 1.00 10.14 O ATOM 2795 CB LEU A 182 10.234 9.306 -10.469 1.00 7.12 C ATOM 2796 CG LEU A 182 9.020 8.605 -9.876 1.00 11.10 C ATOM 2797 CD1 LEU A 182 9.211 7.094 -10.033 1.00 11.46 C ATOM 2798 CD2 LEU A 182 8.895 8.914 -8.368 1.00 16.38 C ATOM 2799 HA LEU A 182 9.192 11.151 -9.900 1.00 0.00 H ATOM 2800 HB2 LEU A 182 10.453 8.884 -11.450 1.00 0.00 H ATOM 2801 HB3 LEU A 182 11.092 9.162 -9.813 1.00 0.00 H ATOM 2802 HG LEU A 182 8.125 8.952 -10.391 1.00 0.00 H ATOM 2803 HD21 LEU A 182 9.790 8.567 -7.852 1.00 0.00 H ATOM 2804 HD22 LEU A 182 8.786 9.989 -8.227 1.00 0.00 H ATOM 2805 HD23 LEU A 182 8.021 8.403 -7.965 1.00 0.00 H ATOM 2806 HD11 LEU A 182 9.304 6.849 -11.091 1.00 0.00 H ATOM 2807 HD12 LEU A 182 10.114 6.787 -9.506 1.00 0.00 H ATOM 2808 HD13 LEU A 182 8.350 6.575 -9.613 1.00 0.00 H ATOM 2809 H LEU A 182 8.989 10.341 -12.492 1.00 0.00 H ATOM 2810 N PRO A 183 12.136 11.762 -11.077 1.00 10.75 N ATOM 2811 CA PRO A 183 13.296 12.503 -10.743 1.00 7.59 C ATOM 2812 C PRO A 183 13.025 13.963 -10.449 1.00 11.00 C ATOM 2813 O PRO A 183 13.736 14.552 -9.649 1.00 3.71 O ATOM 2814 CB PRO A 183 14.256 12.410 -11.911 1.00 12.30 C ATOM 2815 CG PRO A 183 13.725 11.294 -12.745 1.00 12.60 C ATOM 2816 CD PRO A 183 12.279 11.069 -12.383 1.00 6.69 C ATOM 2817 HA PRO A 183 13.706 12.075 -9.828 1.00 0.00 H ATOM 2818 HD3 PRO A 183 11.617 11.506 -13.131 1.00 0.00 H ATOM 2819 HD2 PRO A 183 12.062 10.005 -12.286 1.00 0.00 H ATOM 2820 HG3 PRO A 183 14.298 10.387 -12.552 1.00 0.00 H ATOM 2821 HG2 PRO A 183 13.803 11.554 -13.801 1.00 0.00 H ATOM 2822 HB2 PRO A 183 14.267 13.342 -12.476 1.00 0.00 H ATOM 2823 HB3 PRO A 183 15.265 12.185 -11.564 1.00 0.00 H ATOM 2824 N CYS A 184 12.013 14.538 -11.060 1.00 6.22 N ATOM 2825 CA CYS A 184 11.733 15.938 -10.831 1.00 7.33 C ATOM 2826 C CYS A 184 11.101 16.087 -9.454 1.00 9.21 C ATOM 2827 O CYS A 184 11.338 17.072 -8.733 1.00 7.18 O ATOM 2828 CB CYS A 184 10.712 16.454 -11.894 1.00 13.79 C ATOM 2829 SG CYS A 184 11.298 16.395 -13.598 1.00 16.03 S ATOM 2830 HA CYS A 184 12.659 16.509 -10.900 1.00 0.00 H ATOM 2831 HB2 CYS A 184 10.468 17.489 -11.655 1.00 0.00 H ATOM 2832 HB3 CYS A 184 9.812 15.844 -11.824 1.00 0.00 H ATOM 2833 HG CYS A 184 10.313 16.874 -14.438 1.00 0.00 H ATOM 2834 H CYS A 184 11.414 13.987 -11.707 1.00 0.00 H ATOM 2835 N VAL A 185 10.290 15.111 -9.115 1.00 5.78 N ATOM 2836 CA VAL A 185 9.674 15.189 -7.816 1.00 7.42 C ATOM 2837 C VAL A 185 10.713 14.981 -6.722 1.00 7.59 C ATOM 2838 O VAL A 185 10.743 15.691 -5.702 1.00 7.13 O ATOM 2839 CB VAL A 185 8.622 14.070 -7.598 1.00 6.10 C ATOM 2840 CG1 VAL A 185 8.098 14.089 -6.154 1.00 6.54 C ATOM 2841 CG2 VAL A 185 7.351 14.261 -8.412 1.00 8.12 C ATOM 2842 HA VAL A 185 9.208 16.173 -7.769 1.00 0.00 H ATOM 2843 HB VAL A 185 9.150 13.159 -7.878 1.00 0.00 H ATOM 2844 HG11 VAL A 185 8.928 13.931 -5.465 1.00 0.00 H ATOM 2845 HG12 VAL A 185 7.634 15.054 -5.950 1.00 0.00 H ATOM 2846 HG13 VAL A 185 7.362 13.296 -6.026 1.00 0.00 H ATOM 2847 HG21 VAL A 185 6.883 15.206 -8.136 1.00 0.00 H ATOM 2848 HG22 VAL A 185 7.599 14.273 -9.473 1.00 0.00 H ATOM 2849 HG23 VAL A 185 6.663 13.440 -8.207 1.00 0.00 H ATOM 2850 H VAL A 185 10.101 14.316 -9.758 1.00 0.00 H ATOM 2851 N ALA A 186 11.538 13.948 -6.912 1.00 3.00 N ATOM 2852 CA ALA A 186 12.533 13.659 -5.929 1.00 7.11 C ATOM 2853 C ALA A 186 13.524 14.807 -5.798 1.00 9.85 C ATOM 2854 O ALA A 186 13.989 15.123 -4.702 1.00 6.81 O ATOM 2855 CB ALA A 186 13.252 12.370 -6.277 1.00 6.75 C ATOM 2856 HA ALA A 186 12.037 13.536 -4.966 1.00 0.00 H ATOM 2857 HB1 ALA A 186 12.533 11.552 -6.310 1.00 0.00 H ATOM 2858 HB2 ALA A 186 13.730 12.474 -7.251 1.00 0.00 H ATOM 2859 HB3 ALA A 186 14.008 12.161 -5.520 1.00 0.00 H ATOM 2860 H ALA A 186 11.457 13.361 -7.766 1.00 0.00 H ATOM 2861 N ALA A 187 13.913 15.435 -6.922 1.00 3.00 N ATOM 2862 CA ALA A 187 14.886 16.535 -6.868 1.00 3.72 C ATOM 2863 C ALA A 187 14.327 17.777 -6.216 1.00 10.26 C ATOM 2864 O ALA A 187 15.097 18.448 -5.558 1.00 10.61 O ATOM 2865 CB ALA A 187 15.467 16.951 -8.196 1.00 4.85 C ATOM 2866 HA ALA A 187 15.686 16.102 -6.267 1.00 0.00 H ATOM 2867 HB1 ALA A 187 15.984 16.104 -8.647 1.00 0.00 H ATOM 2868 HB2 ALA A 187 14.664 17.281 -8.855 1.00 0.00 H ATOM 2869 HB3 ALA A 187 16.172 17.768 -8.043 1.00 0.00 H ATOM 2870 H ALA A 187 13.521 15.139 -7.839 1.00 0.00 H ATOM 2871 N LYS A 188 13.022 18.075 -6.414 1.00 4.75 N ATOM 2872 CA LYS A 188 12.403 19.203 -5.823 1.00 9.00 C ATOM 2873 C LYS A 188 12.441 19.013 -4.287 1.00 9.05 C ATOM 2874 O LYS A 188 12.690 19.961 -3.505 1.00 10.37 O ATOM 2875 CB LYS A 188 10.994 19.323 -6.362 1.00 13.20 C ATOM 2876 CG LYS A 188 10.314 20.549 -5.831 1.00 28.70 C ATOM 2877 CD LYS A 188 9.922 21.481 -6.939 1.00 44.14 C ATOM 2878 CE LYS A 188 9.910 22.891 -6.378 1.00 23.40 C ATOM 2879 NZ LYS A 188 11.277 23.386 -6.137 1.00 80.00 N ATOM 2880 HA LYS A 188 12.921 20.131 -6.064 1.00 0.00 H ATOM 2881 HB2 LYS A 188 11.033 19.380 -7.450 1.00 0.00 H ATOM 2882 HB3 LYS A 188 10.423 18.443 -6.066 1.00 0.00 H ATOM 2883 HG2 LYS A 188 9.419 20.250 -5.285 1.00 0.00 H ATOM 2884 HG3 LYS A 188 10.994 21.067 -5.155 1.00 0.00 H ATOM 2885 HD2 LYS A 188 10.643 21.412 -7.754 1.00 0.00 H ATOM 2886 HD3 LYS A 188 8.930 21.221 -7.309 1.00 0.00 H ATOM 2887 HE2 LYS A 188 9.361 22.894 -5.437 1.00 0.00 H ATOM 2888 HE3 LYS A 188 9.414 23.552 -7.089 1.00 0.00 H ATOM 2889 HZ1 LYS A 188 11.755 22.763 -5.455 1.00 0.00 H ATOM 2890 HZ2 LYS A 188 11.805 23.391 -7.033 1.00 0.00 H ATOM 2891 HZ3 LYS A 188 11.232 24.352 -5.754 1.00 0.00 H ATOM 2892 H LYS A 188 12.453 17.453 -7.023 1.00 0.00 H ATOM 2893 N ILE A 189 12.196 17.785 -3.834 1.00 10.76 N ATOM 2894 CA ILE A 189 12.240 17.582 -2.378 1.00 3.96 C ATOM 2895 C ILE A 189 13.650 17.841 -1.822 1.00 5.72 C ATOM 2896 O ILE A 189 13.828 18.480 -0.774 1.00 7.60 O ATOM 2897 CB ILE A 189 11.786 16.150 -2.082 1.00 6.90 C ATOM 2898 CG1 ILE A 189 10.361 15.903 -2.515 1.00 12.46 C ATOM 2899 CG2 ILE A 189 12.054 15.695 -0.656 1.00 8.84 C ATOM 2900 CD1 ILE A 189 10.038 14.425 -2.301 1.00 11.00 C ATOM 2901 HA ILE A 189 11.574 18.291 -1.887 1.00 0.00 H ATOM 2902 HB ILE A 189 12.421 15.514 -2.699 1.00 0.00 H ATOM 2903 HG12 ILE A 189 9.684 16.517 -1.921 1.00 0.00 H ATOM 2904 HG13 ILE A 189 10.248 16.155 -3.569 1.00 0.00 H ATOM 2905 HD11 ILE A 189 10.719 13.816 -2.896 1.00 0.00 H ATOM 2906 HD12 ILE A 189 10.155 14.178 -1.246 1.00 0.00 H ATOM 2907 HD13 ILE A 189 9.011 14.231 -2.610 1.00 0.00 H ATOM 2908 HG21 ILE A 189 13.125 15.740 -0.457 1.00 0.00 H ATOM 2909 HG22 ILE A 189 11.526 16.349 0.038 1.00 0.00 H ATOM 2910 HG23 ILE A 189 11.703 14.671 -0.531 1.00 0.00 H ATOM 2911 H ILE A 189 11.982 17.001 -4.483 1.00 0.00 H ATOM 2912 N TYR A 190 14.656 17.341 -2.540 1.00 3.49 N ATOM 2913 CA TYR A 190 16.044 17.470 -2.152 1.00 6.03 C ATOM 2914 C TYR A 190 16.436 18.957 -2.029 1.00 13.84 C ATOM 2915 O TYR A 190 17.004 19.384 -1.031 1.00 9.46 O ATOM 2916 CB TYR A 190 16.958 16.771 -3.190 1.00 7.03 C ATOM 2917 CG TYR A 190 18.386 16.636 -2.689 1.00 7.56 C ATOM 2918 CD1 TYR A 190 18.752 15.626 -1.791 1.00 5.83 C ATOM 2919 CD2 TYR A 190 19.351 17.563 -3.084 1.00 13.79 C ATOM 2920 CE1 TYR A 190 20.058 15.485 -1.312 1.00 10.88 C ATOM 2921 CE2 TYR A 190 20.661 17.470 -2.605 1.00 9.11 C ATOM 2922 CZ TYR A 190 20.989 16.441 -1.727 1.00 7.80 C ATOM 2923 OH TYR A 190 22.288 16.357 -1.293 1.00 11.50 O ATOM 2924 HA TYR A 190 16.174 16.991 -1.182 1.00 0.00 H ATOM 2925 HB3 TYR A 190 16.961 17.357 -4.109 1.00 0.00 H ATOM 2926 HB2 TYR A 190 16.561 15.777 -3.396 1.00 0.00 H ATOM 2927 HD2 TYR A 190 19.082 18.365 -3.771 1.00 0.00 H ATOM 2928 HE2 TYR A 190 21.415 18.193 -2.915 1.00 0.00 H ATOM 2929 HE1 TYR A 190 20.337 14.668 -0.646 1.00 0.00 H ATOM 2930 HD1 TYR A 190 17.990 14.923 -1.453 1.00 0.00 H ATOM 2931 HH TYR A 190 22.887 16.234 -2.071 1.00 0.00 H ATOM 2932 H TYR A 190 14.433 16.834 -3.420 1.00 0.00 H ATOM 2933 N ARG A 191 16.107 19.730 -3.049 1.00 6.10 N ATOM 2934 CA ARG A 191 16.369 21.163 -3.090 1.00 5.17 C ATOM 2935 C ARG A 191 15.630 21.937 -1.995 1.00 13.44 C ATOM 2936 O ARG A 191 16.167 22.789 -1.288 1.00 9.32 O ATOM 2937 CB ARG A 191 16.030 21.742 -4.439 1.00 3.08 C ATOM 2938 CG ARG A 191 16.842 21.165 -5.580 1.00 17.09 C ATOM 2939 CD ARG A 191 17.998 22.071 -5.951 1.00 14.33 C ATOM 2940 NE ARG A 191 18.681 21.603 -7.155 1.00 14.18 N ATOM 2941 CZ ARG A 191 19.416 22.376 -7.948 1.00 16.36 C ATOM 2942 NH1 ARG A 191 19.573 23.657 -7.664 1.00 19.21 N ATOM 2943 NH2 ARG A 191 19.992 21.871 -9.019 1.00 11.55 N ATOM 2944 HA ARG A 191 17.438 21.276 -2.907 1.00 0.00 H ATOM 2945 HB2 ARG A 191 14.975 21.552 -4.638 1.00 0.00 H ATOM 2946 HB3 ARG A 191 16.204 22.817 -4.404 1.00 0.00 H ATOM 2947 HG2 ARG A 191 17.235 20.194 -5.280 1.00 0.00 H ATOM 2948 HG3 ARG A 191 16.195 21.041 -6.449 1.00 0.00 H ATOM 2949 HD2 ARG A 191 18.710 22.093 -5.126 1.00 0.00 H ATOM 2950 HD3 ARG A 191 17.617 23.077 -6.128 1.00 0.00 H ATOM 2951 HE ARG A 191 18.586 20.599 -7.408 1.00 0.00 H ATOM 2952 HH12 ARG A 191 20.148 24.261 -8.285 1.00 0.00 H ATOM 2953 HH11 ARG A 191 19.121 24.061 -6.819 1.00 0.00 H ATOM 2954 HH22 ARG A 191 20.566 22.480 -9.637 1.00 0.00 H ATOM 2955 HH21 ARG A 191 19.873 20.863 -9.247 1.00 0.00 H ATOM 2956 H ARG A 191 15.636 19.292 -3.866 1.00 0.00 H ATOM 2957 N ASN A 192 14.362 21.655 -1.810 1.00 8.44 N ATOM 2958 CA ASN A 192 13.554 22.330 -0.821 1.00 11.09 C ATOM 2959 C ASN A 192 14.049 22.090 0.579 1.00 12.71 C ATOM 2960 O ASN A 192 14.022 22.957 1.435 1.00 11.11 O ATOM 2961 CB ASN A 192 12.095 21.799 -0.851 1.00 8.69 C ATOM 2962 CG ASN A 192 11.271 22.445 -1.950 1.00 14.30 C ATOM 2963 OD1 ASN A 192 10.100 22.084 -2.207 1.00 29.86 O ATOM 2964 ND2 ASN A 192 11.801 23.511 -2.493 1.00 14.56 N ATOM 2965 HA ASN A 192 13.610 23.390 -1.069 1.00 0.00 H ATOM 2966 HB2 ASN A 192 12.117 20.722 -1.016 1.00 0.00 H ATOM 2967 HB3 ASN A 192 11.625 22.009 0.110 1.00 0.00 H ATOM 2968 HD22 ASN A 192 12.777 23.784 -2.258 1.00 0.00 H ATOM 2969 HD21 ASN A 192 11.246 24.086 -3.159 1.00 0.00 H ATOM 2970 H ASN A 192 13.922 20.918 -2.397 1.00 0.00 H ATOM 2971 N LEU A 193 14.458 20.872 0.835 1.00 6.99 N ATOM 2972 CA LEU A 193 14.914 20.553 2.155 1.00 9.69 C ATOM 2973 C LEU A 193 16.362 20.919 2.378 1.00 7.95 C ATOM 2974 O LEU A 193 16.691 21.420 3.444 1.00 12.54 O ATOM 2975 CB LEU A 193 14.924 19.016 2.393 1.00 12.40 C ATOM 2976 CG LEU A 193 13.814 18.425 3.245 1.00 23.93 C ATOM 2977 CD1 LEU A 193 12.641 19.350 3.368 1.00 24.18 C ATOM 2978 CD2 LEU A 193 13.417 17.060 2.715 1.00 12.87 C ATOM 2979 HA LEU A 193 14.235 21.102 2.807 1.00 0.00 H ATOM 2980 HB2 LEU A 193 14.876 18.535 1.416 1.00 0.00 H ATOM 2981 HB3 LEU A 193 15.870 18.767 2.873 1.00 0.00 H ATOM 2982 HG LEU A 193 14.197 18.295 4.257 1.00 0.00 H ATOM 2983 HD21 LEU A 193 13.065 17.159 1.688 1.00 0.00 H ATOM 2984 HD22 LEU A 193 14.281 16.396 2.742 1.00 0.00 H ATOM 2985 HD23 LEU A 193 12.621 16.648 3.335 1.00 0.00 H ATOM 2986 HD11 LEU A 193 12.963 20.283 3.830 1.00 0.00 H ATOM 2987 HD12 LEU A 193 12.236 19.554 2.377 1.00 0.00 H ATOM 2988 HD13 LEU A 193 11.875 18.883 3.986 1.00 0.00 H ATOM 2989 H LEU A 193 14.452 20.146 0.090 1.00 0.00 H ATOM 2990 N TYR A 194 17.217 20.646 1.426 1.00 8.57 N ATOM 2991 CA TYR A 194 18.590 20.912 1.657 1.00 9.22 C ATOM 2992 C TYR A 194 19.267 21.988 0.854 1.00 11.22 C ATOM 2993 O TYR A 194 20.446 22.174 1.094 1.00 12.68 O ATOM 2994 CB TYR A 194 19.347 19.603 1.358 1.00 6.99 C ATOM 2995 CG TYR A 194 18.686 18.493 2.090 1.00 11.06 C ATOM 2996 CD1 TYR A 194 18.527 18.527 3.471 1.00 6.15 C ATOM 2997 CD2 TYR A 194 18.177 17.411 1.371 1.00 10.67 C ATOM 2998 CE1 TYR A 194 17.916 17.436 4.101 1.00 9.94 C ATOM 2999 CE2 TYR A 194 17.531 16.342 1.982 1.00 10.80 C ATOM 3000 CZ TYR A 194 17.400 16.363 3.367 1.00 15.78 C ATOM 3001 OH TYR A 194 16.766 15.333 4.028 1.00 20.37 O ATOM 3002 HA TYR A 194 18.621 21.282 2.682 1.00 0.00 H ATOM 3003 HB3 TYR A 194 20.382 19.694 1.687 1.00 0.00 H ATOM 3004 HB2 TYR A 194 19.324 19.402 0.287 1.00 0.00 H ATOM 3005 HD2 TYR A 194 18.290 17.403 0.287 1.00 0.00 H ATOM 3006 HE2 TYR A 194 17.139 15.512 1.394 1.00 0.00 H ATOM 3007 HE1 TYR A 194 17.841 17.423 5.188 1.00 0.00 H ATOM 3008 HD1 TYR A 194 18.870 19.384 4.050 1.00 0.00 H ATOM 3009 HH TYR A 194 16.767 15.517 5.001 1.00 0.00 H ATOM 3010 H TYR A 194 16.897 20.244 0.522 1.00 0.00 H ATOM 3011 N ARG A 195 18.615 22.640 -0.097 1.00 9.84 N ATOM 3012 CA ARG A 195 19.322 23.685 -0.840 1.00 5.90 C ATOM 3013 C ARG A 195 18.297 24.826 -1.030 1.00 6.87 C ATOM 3014 O ARG A 195 18.158 25.351 -2.174 1.00 10.72 O ATOM 3015 CB ARG A 195 19.752 23.277 -2.242 1.00 7.94 C ATOM 3016 CG ARG A 195 20.582 21.997 -2.353 1.00 9.91 C ATOM 3017 CD ARG A 195 22.015 22.133 -1.830 1.00 23.97 C ATOM 3018 NE ARG A 195 22.849 20.968 -2.141 1.00 32.49 N ATOM 3019 CZ ARG A 195 23.175 20.048 -1.216 1.00 29.86 C ATOM 3020 NH1 ARG A 195 22.774 20.153 0.078 1.00 18.60 N ATOM 3021 NH2 ARG A 195 23.934 19.014 -1.601 1.00 52.81 N ATOM 3022 HA ARG A 195 20.222 23.939 -0.281 1.00 0.00 H ATOM 3023 HB2 ARG A 195 18.850 23.141 -2.839 1.00 0.00 H ATOM 3024 HB3 ARG A 195 20.343 24.093 -2.659 1.00 0.00 H ATOM 3025 HG2 ARG A 195 20.082 21.214 -1.783 1.00 0.00 H ATOM 3026 HG3 ARG A 195 20.627 21.708 -3.403 1.00 0.00 H ATOM 3027 HD2 ARG A 195 21.980 22.257 -0.748 1.00 0.00 H ATOM 3028 HD3 ARG A 195 22.468 23.016 -2.281 1.00 0.00 H ATOM 3029 HE ARG A 195 23.201 20.849 -3.112 1.00 0.00 H ATOM 3030 HH12 ARG A 195 23.045 19.423 0.767 1.00 0.00 H ATOM 3031 HH11 ARG A 195 22.197 20.964 0.379 1.00 0.00 H ATOM 3032 HH22 ARG A 195 24.206 18.283 -0.912 1.00 0.00 H ATOM 3033 HH21 ARG A 195 24.252 18.942 -2.589 1.00 0.00 H ATOM 3034 H ARG A 195 17.623 22.415 -0.311 1.00 0.00 H ATOM 3035 N ALA A 196 17.576 25.145 0.077 1.00 9.20 N ATOM 3036 CA ALA A 196 16.512 26.162 0.099 1.00 13.96 C ATOM 3037 C ALA A 196 16.875 27.445 -0.659 1.00 15.53 C ATOM 3038 O ALA A 196 17.944 27.989 -0.422 1.00 12.62 O ATOM 3039 CB ALA A 196 15.911 26.350 1.501 1.00 18.64 C ATOM 3040 HA ALA A 196 15.682 25.771 -0.489 1.00 0.00 H ATOM 3041 HB1 ALA A 196 15.483 25.407 1.841 1.00 0.00 H ATOM 3042 HB2 ALA A 196 16.694 26.665 2.191 1.00 0.00 H ATOM 3043 HB3 ALA A 196 15.131 27.111 1.462 1.00 0.00 H ATOM 3044 H ALA A 196 17.789 24.641 0.961 1.00 0.00 H ATOM 3045 N GLY A 197 15.987 27.881 -1.565 1.00 12.73 N ATOM 3046 CA GLY A 197 16.104 29.056 -2.435 1.00 15.61 C ATOM 3047 C GLY A 197 16.656 28.772 -3.846 1.00 15.87 C ATOM 3048 O GLY A 197 16.688 29.639 -4.733 1.00 14.54 O ATOM 3049 HA3 GLY A 197 16.768 29.771 -1.950 1.00 0.00 H ATOM 3050 HA2 GLY A 197 15.113 29.497 -2.542 1.00 0.00 H ATOM 3051 H GLY A 197 15.116 27.322 -1.662 1.00 0.00 H ATOM 3052 N SER A 198 17.118 27.544 -4.105 1.00 9.93 N ATOM 3053 CA SER A 198 17.637 27.206 -5.412 1.00 12.75 C ATOM 3054 C SER A 198 16.484 26.489 -6.155 1.00 10.51 C ATOM 3055 O SER A 198 15.432 26.240 -5.535 1.00 25.74 O ATOM 3056 CB SER A 198 18.910 26.394 -5.320 1.00 8.97 C ATOM 3057 OG SER A 198 18.661 25.102 -4.793 1.00 12.13 O ATOM 3058 HA SER A 198 17.940 28.091 -5.971 1.00 0.00 H ATOM 3059 HB2 SER A 198 19.616 26.912 -4.671 1.00 0.00 H ATOM 3060 HB3 SER A 198 19.340 26.294 -6.316 1.00 0.00 H ATOM 3061 HG SER A 198 18.274 25.186 -3.885 1.00 0.00 H ATOM 3062 H SER A 198 17.104 26.822 -3.356 1.00 0.00 H ATOM 3063 N SER A 199 16.676 26.191 -7.464 1.00 15.45 N ATOM 3064 CA SER A 199 15.767 25.556 -8.477 1.00 15.28 C ATOM 3065 C SER A 199 16.368 24.313 -9.134 1.00 10.23 C ATOM 3066 O SER A 199 17.555 24.267 -9.398 1.00 17.28 O ATOM 3067 CB SER A 199 15.666 26.549 -9.643 1.00 23.94 C ATOM 3068 OG SER A 199 15.014 25.956 -10.758 1.00 52.15 O ATOM 3069 HA SER A 199 14.839 25.301 -7.965 1.00 0.00 H ATOM 3070 HB2 SER A 199 16.669 26.857 -9.938 1.00 0.00 H ATOM 3071 HB3 SER A 199 15.099 27.422 -9.321 1.00 0.00 H ATOM 3072 HG SER A 199 14.961 26.614 -11.496 1.00 0.00 H ATOM 3073 H SER A 199 17.615 26.446 -7.830 1.00 0.00 H ATOM 3074 N ILE A 200 15.542 23.283 -9.432 1.00 14.20 N ATOM 3075 CA ILE A 200 16.047 22.063 -10.050 1.00 12.34 C ATOM 3076 C ILE A 200 16.473 22.241 -11.480 1.00 15.75 C ATOM 3077 O ILE A 200 17.280 21.496 -12.083 1.00 21.56 O ATOM 3078 CB ILE A 200 15.050 20.926 -9.952 1.00 23.98 C ATOM 3079 CG1 ILE A 200 13.775 21.328 -10.687 1.00 23.00 C ATOM 3080 CG2 ILE A 200 14.749 20.597 -8.496 1.00 26.36 C ATOM 3081 CD1 ILE A 200 12.770 20.171 -10.728 1.00 22.43 C ATOM 3082 HA ILE A 200 16.939 21.809 -9.477 1.00 0.00 H ATOM 3083 HB ILE A 200 15.471 20.032 -10.411 1.00 0.00 H ATOM 3084 HG12 ILE A 200 13.321 22.176 -10.174 1.00 0.00 H ATOM 3085 HG13 ILE A 200 14.028 21.616 -11.707 1.00 0.00 H ATOM 3086 HD11 ILE A 200 13.217 19.322 -11.245 1.00 0.00 H ATOM 3087 HD12 ILE A 200 12.509 19.882 -9.710 1.00 0.00 H ATOM 3088 HD13 ILE A 200 11.873 20.490 -11.258 1.00 0.00 H ATOM 3089 HG21 ILE A 200 15.670 20.302 -7.993 1.00 0.00 H ATOM 3090 HG22 ILE A 200 14.331 21.476 -8.005 1.00 0.00 H ATOM 3091 HG23 ILE A 200 14.031 19.778 -8.451 1.00 0.00 H ATOM 3092 H ILE A 200 14.528 23.363 -9.216 1.00 0.00 H ATOM 3093 N GLY A 201 15.900 23.288 -12.030 1.00 15.20 N ATOM 3094 CA GLY A 201 16.284 23.546 -13.395 1.00 16.50 C ATOM 3095 C GLY A 201 15.400 22.827 -14.391 1.00 26.16 C ATOM 3096 O GLY A 201 14.282 22.449 -14.066 1.00 29.15 O ATOM 3097 HA3 GLY A 201 17.313 23.215 -13.538 1.00 0.00 H ATOM 3098 HA2 GLY A 201 16.219 24.618 -13.580 1.00 0.00 H ATOM 3099 H GLY A 201 15.220 23.886 -11.518 1.00 0.00 H ATOM 3100 N ALA A 202 15.934 22.677 -15.596 1.00 35.78 N ATOM 3101 CA ALA A 202 15.228 22.033 -16.687 1.00 36.96 C ATOM 3102 C ALA A 202 15.887 20.763 -17.203 1.00 19.26 C ATOM 3103 O ALA A 202 17.053 20.538 -17.004 1.00 24.07 O ATOM 3104 CB ALA A 202 15.055 23.033 -17.818 1.00 38.41 C ATOM 3105 HA ALA A 202 14.264 21.714 -16.291 1.00 0.00 H ATOM 3106 HB1 ALA A 202 14.482 23.888 -17.461 1.00 0.00 H ATOM 3107 HB2 ALA A 202 16.035 23.368 -18.158 1.00 0.00 H ATOM 3108 HB3 ALA A 202 14.525 22.558 -18.643 1.00 0.00 H ATOM 3109 H ALA A 202 16.896 23.035 -15.765 1.00 0.00 H ATOM 3110 N ILE A 203 15.075 19.956 -17.884 1.00 18.85 N ATOM 3111 CA ILE A 203 15.481 18.688 -18.451 1.00 11.51 C ATOM 3112 C ILE A 203 16.112 18.960 -19.785 1.00 19.07 C ATOM 3113 O ILE A 203 15.618 19.800 -20.517 1.00 28.94 O ATOM 3114 CB ILE A 203 14.287 17.688 -18.529 1.00 15.27 C ATOM 3115 CG1 ILE A 203 14.309 16.757 -17.298 1.00 22.15 C ATOM 3116 CG2 ILE A 203 14.487 16.743 -19.730 1.00 22.29 C ATOM 3117 CD1 ILE A 203 13.076 16.797 -16.434 1.00 24.23 C ATOM 3118 HA ILE A 203 16.215 18.200 -17.809 1.00 0.00 H ATOM 3119 HB ILE A 203 13.367 18.269 -18.598 1.00 0.00 H ATOM 3120 HG12 ILE A 203 14.439 15.734 -17.652 1.00 0.00 H ATOM 3121 HG13 ILE A 203 15.162 17.037 -16.680 1.00 0.00 H ATOM 3122 HD11 ILE A 203 12.933 17.808 -16.053 1.00 0.00 H ATOM 3123 HD12 ILE A 203 12.209 16.505 -17.027 1.00 0.00 H ATOM 3124 HD13 ILE A 203 13.196 16.107 -15.599 1.00 0.00 H ATOM 3125 HG21 ILE A 203 14.532 17.329 -20.648 1.00 0.00 H ATOM 3126 HG22 ILE A 203 15.418 16.190 -19.604 1.00 0.00 H ATOM 3127 HG23 ILE A 203 13.652 16.044 -19.784 1.00 0.00 H ATOM 3128 H ILE A 203 14.088 20.256 -18.016 1.00 0.00 H ATOM 3129 N ASP A 204 17.196 18.237 -20.056 1.00 10.44 N ATOM 3130 CA ASP A 204 17.933 18.325 -21.267 1.00 14.48 C ATOM 3131 C ASP A 204 17.531 17.069 -21.955 1.00 21.95 C ATOM 3132 O ASP A 204 17.834 15.963 -21.527 1.00 17.59 O ATOM 3133 CB ASP A 204 19.400 18.295 -20.933 1.00 11.79 C ATOM 3134 CG ASP A 204 20.264 18.566 -22.131 1.00 22.27 C ATOM 3135 OD1 ASP A 204 19.769 18.084 -23.261 1.00 30.06 O ATOM 3136 OD2 ASP A 204 21.349 19.096 -22.011 1.00 28.59 O ATOM 3137 HA ASP A 204 17.753 19.222 -21.860 1.00 0.00 H ATOM 3138 HB2 ASP A 204 19.603 19.052 -20.176 1.00 0.00 H ATOM 3139 HB3 ASP A 204 19.649 17.311 -20.536 1.00 0.00 H ATOM 3140 H ASP A 204 17.525 17.564 -19.334 1.00 0.00 H ATOM 3141 N SER A 205 16.825 17.263 -23.049 1.00 20.43 N ATOM 3142 CA SER A 205 16.350 16.119 -23.812 1.00 21.54 C ATOM 3143 C SER A 205 17.443 15.238 -24.390 1.00 21.01 C ATOM 3144 O SER A 205 17.175 14.113 -24.829 1.00 31.25 O ATOM 3145 CB SER A 205 15.525 16.732 -24.907 1.00 25.66 C ATOM 3146 OG SER A 205 15.655 18.120 -24.666 1.00 48.97 O ATOM 3147 HA SER A 205 15.799 15.438 -23.163 1.00 0.00 H ATOM 3148 HB2 SER A 205 14.484 16.418 -24.836 1.00 0.00 H ATOM 3149 HB3 SER A 205 15.917 16.466 -25.889 1.00 0.00 H ATOM 3150 HG SER A 205 15.139 18.622 -25.346 1.00 0.00 H ATOM 3151 H SER A 205 16.608 18.229 -23.366 1.00 0.00 H ATOM 3152 N LYS A 206 18.673 15.760 -24.367 1.00 17.47 N ATOM 3153 CA LYS A 206 19.841 15.079 -24.874 1.00 21.20 C ATOM 3154 C LYS A 206 20.590 14.223 -23.868 1.00 22.07 C ATOM 3155 O LYS A 206 21.538 13.537 -24.259 1.00 22.91 O ATOM 3156 CB LYS A 206 20.793 16.088 -25.496 1.00 35.24 C ATOM 3157 CG LYS A 206 20.307 16.536 -26.867 1.00 29.21 C ATOM 3158 CD LYS A 206 19.686 15.364 -27.616 1.00 36.94 C ATOM 3159 CE LYS A 206 18.242 15.574 -28.064 1.00 80.00 C ATOM 3160 NZ LYS A 206 17.647 14.369 -28.668 1.00 75.00 N ATOM 3161 HA LYS A 206 19.460 14.377 -25.616 1.00 0.00 H ATOM 3162 HB2 LYS A 206 20.865 16.958 -24.843 1.00 0.00 H ATOM 3163 HB3 LYS A 206 21.777 15.631 -25.600 1.00 0.00 H ATOM 3164 HG2 LYS A 206 19.561 17.322 -26.746 1.00 0.00 H ATOM 3165 HG3 LYS A 206 21.150 16.923 -27.439 1.00 0.00 H ATOM 3166 HD2 LYS A 206 20.290 15.171 -28.502 1.00 0.00 H ATOM 3167 HD3 LYS A 206 19.714 14.492 -26.962 1.00 0.00 H ATOM 3168 HE2 LYS A 206 18.219 16.379 -28.799 1.00 0.00 H ATOM 3169 HE3 LYS A 206 17.647 15.859 -27.197 1.00 0.00 H ATOM 3170 HZ1 LYS A 206 18.201 14.092 -29.503 1.00 0.00 H ATOM 3171 HZ2 LYS A 206 17.654 13.595 -27.973 1.00 0.00 H ATOM 3172 HZ3 LYS A 206 16.667 14.573 -28.952 1.00 0.00 H ATOM 3173 H LYS A 206 18.796 16.710 -23.961 1.00 0.00 H ATOM 3174 N LEU A 207 20.199 14.232 -22.597 1.00 18.71 N ATOM 3175 CA LEU A 207 20.937 13.401 -21.654 1.00 18.65 C ATOM 3176 C LEU A 207 20.135 12.205 -21.198 1.00 12.31 C ATOM 3177 O LEU A 207 18.926 12.178 -21.392 1.00 12.47 O ATOM 3178 CB LEU A 207 21.203 14.185 -20.379 1.00 17.36 C ATOM 3179 CG LEU A 207 21.805 15.549 -20.606 1.00 25.01 C ATOM 3180 CD1 LEU A 207 22.044 16.144 -19.238 1.00 20.53 C ATOM 3181 CD2 LEU A 207 23.117 15.405 -21.358 1.00 21.37 C ATOM 3182 HA LEU A 207 21.844 13.092 -22.173 1.00 0.00 H ATOM 3183 HB2 LEU A 207 20.257 14.312 -19.852 1.00 0.00 H ATOM 3184 HB3 LEU A 207 21.889 13.607 -19.759 1.00 0.00 H ATOM 3185 HG LEU A 207 21.149 16.187 -21.197 1.00 0.00 H ATOM 3186 HD21 LEU A 207 23.805 14.796 -20.772 1.00 0.00 H ATOM 3187 HD22 LEU A 207 22.933 14.924 -22.319 1.00 0.00 H ATOM 3188 HD23 LEU A 207 23.551 16.392 -21.521 1.00 0.00 H ATOM 3189 HD11 LEU A 207 21.096 16.219 -18.705 1.00 0.00 H ATOM 3190 HD12 LEU A 207 22.727 15.504 -18.679 1.00 0.00 H ATOM 3191 HD13 LEU A 207 22.481 17.137 -19.346 1.00 0.00 H ATOM 3192 H LEU A 207 19.394 14.812 -22.286 1.00 0.00 H ATOM 3193 N ASP A 208 20.852 11.235 -20.579 1.00 13.48 N ATOM 3194 CA ASP A 208 20.243 10.067 -20.048 1.00 12.89 C ATOM 3195 C ASP A 208 19.522 10.500 -18.781 1.00 8.06 C ATOM 3196 O ASP A 208 19.777 11.545 -18.148 1.00 10.38 O ATOM 3197 CB ASP A 208 21.208 8.880 -19.886 1.00 11.91 C ATOM 3198 CG ASP A 208 22.323 9.188 -18.948 1.00 19.66 C ATOM 3199 OD1 ASP A 208 23.321 9.838 -19.473 1.00 23.91 O ATOM 3200 OD2 ASP A 208 22.382 8.659 -17.880 1.00 16.42 O ATOM 3201 HA ASP A 208 19.520 9.650 -20.749 1.00 0.00 H ATOM 3202 HB2 ASP A 208 20.652 8.024 -19.503 1.00 0.00 H ATOM 3203 HB3 ASP A 208 21.627 8.632 -20.861 1.00 0.00 H ATOM 3204 H ASP A 208 21.882 11.350 -20.490 1.00 0.00 H ATOM 3205 N TRP A 209 18.554 9.710 -18.385 1.00 8.10 N ATOM 3206 CA TRP A 209 17.719 9.973 -17.226 1.00 7.73 C ATOM 3207 C TRP A 209 18.531 10.199 -15.950 1.00 4.88 C ATOM 3208 O TRP A 209 18.200 11.133 -15.205 1.00 9.32 O ATOM 3209 CB TRP A 209 16.866 8.700 -17.099 1.00 6.72 C ATOM 3210 CG TRP A 209 15.674 8.688 -16.177 1.00 5.31 C ATOM 3211 CD1 TRP A 209 14.531 9.442 -16.213 1.00 8.35 C ATOM 3212 CD2 TRP A 209 15.540 7.783 -15.062 1.00 10.82 C ATOM 3213 NE1 TRP A 209 13.693 9.049 -15.176 1.00 9.36 N ATOM 3214 CE2 TRP A 209 14.288 8.045 -14.456 1.00 9.07 C ATOM 3215 CE3 TRP A 209 16.390 6.789 -14.570 1.00 8.78 C ATOM 3216 CZ2 TRP A 209 13.839 7.308 -13.349 1.00 7.65 C ATOM 3217 CZ3 TRP A 209 15.959 6.077 -13.486 1.00 10.83 C ATOM 3218 CH2 TRP A 209 14.678 6.328 -12.901 1.00 10.86 C ATOM 3219 HA TRP A 209 17.135 10.885 -17.352 1.00 0.00 H ATOM 3220 HB2 TRP A 209 16.496 8.466 -18.097 1.00 0.00 H ATOM 3221 HB3 TRP A 209 17.532 7.905 -16.765 1.00 0.00 H ATOM 3222 HE1 TRP A 209 12.757 9.455 -14.976 1.00 0.00 H ATOM 3223 HD1 TRP A 209 14.313 10.225 -16.939 1.00 0.00 H ATOM 3224 HZ2 TRP A 209 12.878 7.506 -12.875 1.00 0.00 H ATOM 3225 HH2 TRP A 209 14.358 5.711 -12.062 1.00 0.00 H ATOM 3226 HZ3 TRP A 209 16.601 5.306 -13.061 1.00 0.00 H ATOM 3227 HE3 TRP A 209 17.357 6.590 -15.032 1.00 0.00 H ATOM 3228 H TRP A 209 18.373 8.844 -18.933 1.00 0.00 H ATOM 3229 N SER A 210 19.525 9.351 -15.676 1.00 10.54 N ATOM 3230 CA SER A 210 20.353 9.513 -14.474 1.00 3.48 C ATOM 3231 C SER A 210 21.091 10.889 -14.452 1.00 8.02 C ATOM 3232 O SER A 210 21.234 11.565 -13.408 1.00 10.96 O ATOM 3233 CB SER A 210 21.444 8.420 -14.454 1.00 5.00 C ATOM 3234 OG SER A 210 20.784 7.141 -14.408 1.00 9.25 O ATOM 3235 HA SER A 210 19.685 9.444 -13.615 1.00 0.00 H ATOM 3236 HB2 SER A 210 22.077 8.543 -13.575 1.00 0.00 H ATOM 3237 HB3 SER A 210 22.056 8.490 -15.353 1.00 0.00 H ATOM 3238 HG SER A 210 20.209 7.039 -15.207 1.00 0.00 H ATOM 3239 H SER A 210 19.716 8.562 -16.325 1.00 0.00 H ATOM 3240 N HIS A 211 21.619 11.294 -15.612 1.00 10.22 N ATOM 3241 CA HIS A 211 22.350 12.541 -15.767 1.00 8.91 C ATOM 3242 C HIS A 211 21.416 13.725 -15.530 1.00 14.10 C ATOM 3243 O HIS A 211 21.757 14.700 -14.842 1.00 14.19 O ATOM 3244 CB HIS A 211 22.978 12.533 -17.182 1.00 11.26 C ATOM 3245 CG HIS A 211 24.012 13.619 -17.261 1.00 14.11 C ATOM 3246 ND1 HIS A 211 24.934 13.702 -18.315 1.00 13.46 N ATOM 3247 CD2 HIS A 211 24.257 14.639 -16.402 1.00 12.14 C ATOM 3248 CE1 HIS A 211 25.692 14.771 -18.048 1.00 13.33 C ATOM 3249 NE2 HIS A 211 25.310 15.360 -16.899 1.00 10.44 N ATOM 3250 HA HIS A 211 23.149 12.639 -15.032 1.00 0.00 H ATOM 3251 HB2 HIS A 211 23.447 11.567 -17.369 1.00 0.00 H ATOM 3252 HB3 HIS A 211 22.203 12.710 -17.928 1.00 0.00 H ATOM 3253 HD2 HIS A 211 23.713 14.848 -15.481 1.00 0.00 H ATOM 3254 HE1 HIS A 211 26.511 15.119 -18.677 1.00 0.00 H ATOM 3255 H HIS A 211 21.500 10.685 -16.447 1.00 0.00 H ATOM 3256 N ASN A 212 20.200 13.698 -16.085 1.00 8.70 N ATOM 3257 CA ASN A 212 19.308 14.841 -15.809 1.00 10.10 C ATOM 3258 C ASN A 212 19.026 14.852 -14.304 1.00 7.12 C ATOM 3259 O ASN A 212 18.971 15.895 -13.678 1.00 12.30 O ATOM 3260 CB ASN A 212 17.962 14.651 -16.514 1.00 7.81 C ATOM 3261 CG ASN A 212 18.037 15.133 -17.962 1.00 26.05 C ATOM 3262 OD1 ASN A 212 17.502 14.557 -18.937 1.00 16.41 O ATOM 3263 ND2 ASN A 212 18.422 16.395 -18.047 1.00 14.74 N ATOM 3264 HA ASN A 212 19.781 15.760 -16.155 1.00 0.00 H ATOM 3265 HB2 ASN A 212 17.698 13.594 -16.502 1.00 0.00 H ATOM 3266 HB3 ASN A 212 17.198 15.221 -15.986 1.00 0.00 H ATOM 3267 HD22 ASN A 212 18.865 16.860 -17.229 1.00 0.00 H ATOM 3268 HD21 ASN A 212 18.282 16.923 -18.932 1.00 0.00 H ATOM 3269 H ASN A 212 19.896 12.905 -16.686 1.00 0.00 H ATOM 3270 N PHE A 213 18.841 13.661 -13.721 1.00 6.21 N ATOM 3271 CA PHE A 213 18.544 13.544 -12.290 1.00 12.54 C ATOM 3272 C PHE A 213 19.665 14.135 -11.444 1.00 8.10 C ATOM 3273 O PHE A 213 19.393 14.936 -10.603 1.00 9.26 O ATOM 3274 CB PHE A 213 18.341 12.054 -11.893 1.00 7.03 C ATOM 3275 CG PHE A 213 17.793 11.872 -10.501 1.00 6.53 C ATOM 3276 CD1 PHE A 213 17.150 12.912 -9.834 1.00 5.87 C ATOM 3277 CD2 PHE A 213 17.910 10.655 -9.838 1.00 7.34 C ATOM 3278 CE1 PHE A 213 16.641 12.756 -8.551 1.00 6.21 C ATOM 3279 CE2 PHE A 213 17.374 10.455 -8.564 1.00 9.04 C ATOM 3280 CZ PHE A 213 16.742 11.522 -7.917 1.00 7.43 C ATOM 3281 HA PHE A 213 17.626 14.101 -12.102 1.00 0.00 H ATOM 3282 HB2 PHE A 213 17.646 11.600 -12.600 1.00 0.00 H ATOM 3283 HB3 PHE A 213 19.303 11.546 -11.954 1.00 0.00 H ATOM 3284 HD2 PHE A 213 18.435 9.834 -10.327 1.00 0.00 H ATOM 3285 HE2 PHE A 213 17.447 9.481 -8.080 1.00 0.00 H ATOM 3286 HZ PHE A 213 16.329 11.387 -6.917 1.00 0.00 H ATOM 3287 HE1 PHE A 213 16.165 13.596 -8.044 1.00 0.00 H ATOM 3288 HD1 PHE A 213 17.043 13.875 -10.333 1.00 0.00 H ATOM 3289 H PHE A 213 18.910 12.798 -14.297 1.00 0.00 H ATOM 3290 N THR A 214 20.938 13.742 -11.691 1.00 9.77 N ATOM 3291 CA THR A 214 22.070 14.263 -10.931 1.00 11.82 C ATOM 3292 C THR A 214 22.223 15.767 -11.142 1.00 14.21 C ATOM 3293 O THR A 214 22.608 16.468 -10.256 1.00 13.26 O ATOM 3294 CB THR A 214 23.390 13.534 -11.156 1.00 10.93 C ATOM 3295 OG1 THR A 214 23.632 13.755 -12.506 1.00 16.44 O ATOM 3296 CG2 THR A 214 23.337 12.010 -10.947 1.00 3.54 C ATOM 3297 HA THR A 214 21.823 14.069 -9.887 1.00 0.00 H ATOM 3298 HB THR A 214 24.136 13.897 -10.449 1.00 0.00 H ATOM 3299 HG1 THR A 214 23.698 14.729 -12.673 1.00 0.00 H ATOM 3300 HG23 THR A 214 23.148 11.795 -9.895 1.00 0.00 H ATOM 3301 HG21 THR A 214 22.536 11.589 -11.555 1.00 0.00 H ATOM 3302 HG22 THR A 214 24.289 11.571 -11.243 1.00 0.00 H ATOM 3303 H THR A 214 21.114 13.048 -12.445 1.00 0.00 H ATOM 3304 N ASN A 215 21.935 16.301 -12.322 1.00 9.51 N ATOM 3305 CA ASN A 215 22.020 17.738 -12.544 1.00 10.90 C ATOM 3306 C ASN A 215 20.920 18.438 -11.717 1.00 17.89 C ATOM 3307 O ASN A 215 21.102 19.506 -11.116 1.00 10.82 O ATOM 3308 CB ASN A 215 21.659 18.049 -13.994 1.00 20.04 C ATOM 3309 CG ASN A 215 22.774 17.762 -14.985 1.00 17.75 C ATOM 3310 OD1 ASN A 215 22.503 17.838 -16.198 1.00 27.58 O ATOM 3311 ND2 ASN A 215 24.026 17.652 -14.524 1.00 13.23 N ATOM 3312 HA ASN A 215 23.026 18.067 -12.282 1.00 0.00 H ATOM 3313 HB2 ASN A 215 20.793 17.447 -14.268 1.00 0.00 H ATOM 3314 HB3 ASN A 215 21.402 19.106 -14.064 1.00 0.00 H ATOM 3315 HD22 ASN A 215 24.200 17.592 -13.500 1.00 0.00 H ATOM 3316 HD21 ASN A 215 24.825 17.627 -15.189 1.00 0.00 H ATOM 3317 H ASN A 215 21.643 15.681 -13.104 1.00 0.00 H ATOM 3318 N MET A 216 19.731 17.845 -11.646 1.00 10.89 N ATOM 3319 CA MET A 216 18.669 18.460 -10.852 1.00 7.96 C ATOM 3320 C MET A 216 18.979 18.451 -9.341 1.00 12.00 C ATOM 3321 O MET A 216 18.501 19.337 -8.661 1.00 10.47 O ATOM 3322 CB MET A 216 17.224 17.927 -11.084 1.00 9.70 C ATOM 3323 CG MET A 216 16.770 18.064 -12.532 1.00 7.51 C ATOM 3324 SD MET A 216 15.049 17.548 -12.738 1.00 18.43 S ATOM 3325 CE MET A 216 15.301 15.764 -12.892 1.00 12.30 C ATOM 3326 HA MET A 216 18.669 19.481 -11.234 1.00 0.00 H ATOM 3327 HB2 MET A 216 17.192 16.873 -10.807 1.00 0.00 H ATOM 3328 HB3 MET A 216 16.539 18.489 -10.449 1.00 0.00 H ATOM 3329 HG2 MET A 216 17.405 17.442 -13.163 1.00 0.00 H ATOM 3330 HG3 MET A 216 16.867 19.106 -12.837 1.00 0.00 H ATOM 3331 HE1 MET A 216 15.938 15.561 -13.753 1.00 0.00 H ATOM 3332 HE2 MET A 216 15.779 15.387 -11.988 1.00 0.00 H ATOM 3333 HE3 MET A 216 14.338 15.273 -13.027 1.00 0.00 H ATOM 3334 H MET A 216 19.559 16.952 -12.151 1.00 0.00 H ATOM 3335 N LEU A 217 19.730 17.433 -8.849 1.00 10.80 N ATOM 3336 CA LEU A 217 20.159 17.240 -7.424 1.00 10.46 C ATOM 3337 C LEU A 217 21.287 18.217 -7.143 1.00 16.83 C ATOM 3338 O LEU A 217 21.610 18.562 -6.018 1.00 11.37 O ATOM 3339 CB LEU A 217 20.729 15.843 -7.176 1.00 9.11 C ATOM 3340 CG LEU A 217 19.600 14.821 -7.116 1.00 11.89 C ATOM 3341 CD1 LEU A 217 20.204 13.429 -7.078 1.00 8.38 C ATOM 3342 CD2 LEU A 217 18.625 15.107 -5.949 1.00 14.58 C ATOM 3343 HA LEU A 217 19.285 17.389 -6.790 1.00 0.00 H ATOM 3344 HB2 LEU A 217 21.410 15.582 -7.986 1.00 0.00 H ATOM 3345 HB3 LEU A 217 21.272 15.837 -6.231 1.00 0.00 H ATOM 3346 HG LEU A 217 18.984 14.896 -8.012 1.00 0.00 H ATOM 3347 HD21 LEU A 217 19.169 15.071 -5.005 1.00 0.00 H ATOM 3348 HD22 LEU A 217 18.185 16.096 -6.079 1.00 0.00 H ATOM 3349 HD23 LEU A 217 17.836 14.355 -5.944 1.00 0.00 H ATOM 3350 HD11 LEU A 217 20.801 13.269 -7.976 1.00 0.00 H ATOM 3351 HD12 LEU A 217 20.838 13.333 -6.196 1.00 0.00 H ATOM 3352 HD13 LEU A 217 19.405 12.689 -7.035 1.00 0.00 H ATOM 3353 H LEU A 217 20.040 16.712 -9.531 1.00 0.00 H ATOM 3354 N GLY A 218 21.923 18.657 -8.216 1.00 11.22 N ATOM 3355 CA GLY A 218 23.025 19.623 -8.217 1.00 12.38 C ATOM 3356 C GLY A 218 24.436 19.086 -8.126 1.00 9.26 C ATOM 3357 O GLY A 218 25.302 19.802 -7.658 1.00 17.44 O ATOM 3358 HA3 GLY A 218 22.875 20.288 -7.367 1.00 0.00 H ATOM 3359 HA2 GLY A 218 22.954 20.196 -9.142 1.00 0.00 H ATOM 3360 H GLY A 218 21.615 18.286 -9.137 1.00 0.00 H ATOM 3361 N TYR A 219 24.678 17.847 -8.569 1.00 9.71 N ATOM 3362 CA TYR A 219 26.019 17.311 -8.475 1.00 8.10 C ATOM 3363 C TYR A 219 26.769 17.365 -9.765 1.00 9.69 C ATOM 3364 O TYR A 219 26.216 17.044 -10.796 1.00 15.24 O ATOM 3365 CB TYR A 219 25.936 15.884 -7.964 1.00 5.62 C ATOM 3366 CG TYR A 219 25.584 15.932 -6.491 1.00 3.49 C ATOM 3367 CD1 TYR A 219 24.263 15.999 -6.047 1.00 9.10 C ATOM 3368 CD2 TYR A 219 26.582 15.876 -5.519 1.00 14.81 C ATOM 3369 CE1 TYR A 219 23.942 16.049 -4.688 1.00 8.41 C ATOM 3370 CE2 TYR A 219 26.287 15.906 -4.159 1.00 13.05 C ATOM 3371 CZ TYR A 219 24.959 15.994 -3.737 1.00 15.64 C ATOM 3372 OH TYR A 219 24.723 16.058 -2.394 1.00 14.42 O ATOM 3373 HA TYR A 219 26.580 17.936 -7.781 1.00 0.00 H ATOM 3374 HB3 TYR A 219 26.896 15.386 -8.099 1.00 0.00 H ATOM 3375 HB2 TYR A 219 25.166 15.339 -8.511 1.00 0.00 H ATOM 3376 HD2 TYR A 219 27.623 15.807 -5.833 1.00 0.00 H ATOM 3377 HE2 TYR A 219 27.091 15.861 -3.425 1.00 0.00 H ATOM 3378 HE1 TYR A 219 22.902 16.131 -4.373 1.00 0.00 H ATOM 3379 HD1 TYR A 219 23.458 16.013 -6.782 1.00 0.00 H ATOM 3380 HH TYR A 219 23.748 16.117 -2.234 1.00 0.00 H ATOM 3381 H TYR A 219 23.911 17.275 -8.976 1.00 0.00 H ATOM 3382 N THR A 220 28.019 17.774 -9.693 1.00 15.74 N ATOM 3383 CA THR A 220 28.789 17.874 -10.917 1.00 32.34 C ATOM 3384 C THR A 220 29.729 16.721 -11.238 1.00 27.31 C ATOM 3385 O THR A 220 29.970 16.418 -12.404 1.00 31.60 O ATOM 3386 CB THR A 220 29.558 19.219 -10.932 1.00 30.69 C ATOM 3387 OG1 THR A 220 30.529 19.154 -9.902 1.00 23.11 O ATOM 3388 CG2 THR A 220 28.606 20.366 -10.600 1.00 29.45 C ATOM 3389 HA THR A 220 28.046 17.821 -11.713 1.00 0.00 H ATOM 3390 HB THR A 220 30.004 19.386 -11.912 1.00 0.00 H ATOM 3391 HG1 THR A 220 30.077 19.019 -9.032 1.00 0.00 H ATOM 3392 HG23 THR A 220 27.845 20.441 -11.377 1.00 0.00 H ATOM 3393 HG21 THR A 220 28.128 20.174 -9.639 1.00 0.00 H ATOM 3394 HG22 THR A 220 29.167 21.299 -10.548 1.00 0.00 H ATOM 3395 H THR A 220 28.445 18.020 -8.777 1.00 0.00 H ATOM 3396 N ASP A 221 30.257 16.081 -10.202 1.00 12.56 N ATOM 3397 CA ASP A 221 31.195 14.970 -10.343 1.00 5.75 C ATOM 3398 C ASP A 221 30.685 13.897 -11.293 1.00 19.20 C ATOM 3399 O ASP A 221 29.603 13.342 -11.129 1.00 23.58 O ATOM 3400 CB ASP A 221 31.555 14.402 -8.972 1.00 16.52 C ATOM 3401 CG ASP A 221 32.807 13.571 -8.968 1.00 15.14 C ATOM 3402 OD1 ASP A 221 33.049 12.920 -10.092 1.00 18.46 O ATOM 3403 OD2 ASP A 221 33.476 13.467 -7.965 1.00 35.17 O ATOM 3404 HA ASP A 221 32.106 15.359 -10.797 1.00 0.00 H ATOM 3405 HB2 ASP A 221 31.692 15.234 -8.281 1.00 0.00 H ATOM 3406 HB3 ASP A 221 30.728 13.779 -8.630 1.00 0.00 H ATOM 3407 H ASP A 221 29.990 16.385 -9.244 1.00 0.00 H ATOM 3408 N PRO A 222 31.508 13.615 -12.309 1.00 27.86 N ATOM 3409 CA PRO A 222 31.219 12.621 -13.328 1.00 22.10 C ATOM 3410 C PRO A 222 31.200 11.221 -12.739 1.00 13.61 C ATOM 3411 O PRO A 222 30.491 10.382 -13.264 1.00 14.25 O ATOM 3412 CB PRO A 222 32.337 12.698 -14.343 1.00 21.37 C ATOM 3413 CG PRO A 222 33.091 13.984 -14.026 1.00 30.04 C ATOM 3414 CD PRO A 222 32.667 14.475 -12.657 1.00 27.96 C ATOM 3415 HA PRO A 222 30.242 12.818 -13.769 1.00 0.00 H ATOM 3416 HD3 PRO A 222 33.473 14.351 -11.934 1.00 0.00 H ATOM 3417 HD2 PRO A 222 32.374 15.524 -12.695 1.00 0.00 H ATOM 3418 HG3 PRO A 222 32.857 14.740 -14.775 1.00 0.00 H ATOM 3419 HG2 PRO A 222 34.164 13.790 -14.030 1.00 0.00 H ATOM 3420 HB2 PRO A 222 32.997 11.836 -14.248 1.00 0.00 H ATOM 3421 HB3 PRO A 222 31.931 12.734 -15.354 1.00 0.00 H ATOM 3422 N GLN A 223 31.946 10.949 -11.671 1.00 12.04 N ATOM 3423 CA GLN A 223 31.918 9.613 -11.107 1.00 10.49 C ATOM 3424 C GLN A 223 30.611 9.417 -10.371 1.00 12.32 C ATOM 3425 O GLN A 223 30.107 8.284 -10.203 1.00 10.56 O ATOM 3426 CB GLN A 223 33.107 9.282 -10.189 1.00 10.59 C ATOM 3427 CG GLN A 223 33.983 8.142 -10.714 1.00 41.79 C ATOM 3428 CD GLN A 223 33.414 7.531 -11.974 1.00 80.00 C ATOM 3429 OE1 GLN A 223 33.415 8.190 -13.032 1.00 80.00 O ATOM 3430 NE2 GLN A 223 32.864 6.310 -11.828 1.00 35.31 N ATOM 3431 HA GLN A 223 32.004 8.919 -11.943 1.00 0.00 H ATOM 3432 HB2 GLN A 223 33.725 10.174 -10.088 1.00 0.00 H ATOM 3433 HB3 GLN A 223 32.720 8.998 -9.211 1.00 0.00 H ATOM 3434 HG2 GLN A 223 34.978 8.532 -10.929 1.00 0.00 H ATOM 3435 HG3 GLN A 223 34.054 7.370 -9.948 1.00 0.00 H ATOM 3436 HE22 GLN A 223 32.907 5.827 -10.908 1.00 0.00 H ATOM 3437 HE21 GLN A 223 32.396 5.850 -12.635 1.00 0.00 H ATOM 3438 H GLN A 223 32.543 11.687 -11.245 1.00 0.00 H ATOM 3439 N PHE A 224 30.074 10.555 -9.921 1.00 14.57 N ATOM 3440 CA PHE A 224 28.819 10.542 -9.186 1.00 6.91 C ATOM 3441 C PHE A 224 27.686 10.129 -10.139 1.00 13.33 C ATOM 3442 O PHE A 224 26.763 9.409 -9.729 1.00 12.11 O ATOM 3443 CB PHE A 224 28.444 11.874 -8.508 1.00 10.75 C ATOM 3444 CG PHE A 224 27.170 11.743 -7.676 1.00 11.02 C ATOM 3445 CD1 PHE A 224 27.142 10.919 -6.546 1.00 14.52 C ATOM 3446 CD2 PHE A 224 25.994 12.412 -8.020 1.00 10.21 C ATOM 3447 CE1 PHE A 224 26.026 10.761 -5.732 1.00 12.89 C ATOM 3448 CE2 PHE A 224 24.850 12.268 -7.230 1.00 13.52 C ATOM 3449 CZ PHE A 224 24.875 11.464 -6.086 1.00 12.88 C ATOM 3450 HA PHE A 224 28.958 9.827 -8.375 1.00 0.00 H ATOM 3451 HB2 PHE A 224 29.262 12.182 -7.857 1.00 0.00 H ATOM 3452 HB3 PHE A 224 28.288 12.631 -9.277 1.00 0.00 H ATOM 3453 HD2 PHE A 224 25.968 13.047 -8.905 1.00 0.00 H ATOM 3454 HE2 PHE A 224 23.932 12.786 -7.508 1.00 0.00 H ATOM 3455 HZ PHE A 224 23.984 11.386 -5.463 1.00 0.00 H ATOM 3456 HE1 PHE A 224 26.050 10.115 -4.854 1.00 0.00 H ATOM 3457 HD1 PHE A 224 28.047 10.369 -6.289 1.00 0.00 H ATOM 3458 H PHE A 224 30.558 11.458 -10.098 1.00 0.00 H ATOM 3459 N THR A 225 27.742 10.588 -11.418 1.00 13.78 N ATOM 3460 CA THR A 225 26.737 10.276 -12.443 1.00 9.26 C ATOM 3461 C THR A 225 26.788 8.745 -12.684 1.00 3.00 C ATOM 3462 O THR A 225 25.759 8.079 -12.813 1.00 9.88 O ATOM 3463 CB THR A 225 26.845 11.098 -13.784 1.00 12.13 C ATOM 3464 OG1 THR A 225 27.085 12.533 -13.699 1.00 25.40 O ATOM 3465 CG2 THR A 225 25.577 10.790 -14.594 1.00 19.55 C ATOM 3466 HA THR A 225 25.765 10.590 -12.062 1.00 0.00 H ATOM 3467 HB THR A 225 27.765 10.767 -14.265 1.00 0.00 H ATOM 3468 HG1 THR A 225 27.129 12.914 -14.612 1.00 0.00 H ATOM 3469 HG23 THR A 225 25.428 9.711 -14.637 1.00 0.00 H ATOM 3470 HG21 THR A 225 24.718 11.258 -14.113 1.00 0.00 H ATOM 3471 HG22 THR A 225 25.688 11.184 -15.604 1.00 0.00 H ATOM 3472 H THR A 225 28.543 11.195 -11.686 1.00 0.00 H ATOM 3473 N GLU A 226 28.007 8.184 -12.724 1.00 9.49 N ATOM 3474 CA GLU A 226 28.283 6.770 -12.937 1.00 9.01 C ATOM 3475 C GLU A 226 27.706 5.981 -11.780 1.00 8.80 C ATOM 3476 O GLU A 226 27.076 4.913 -11.930 1.00 13.31 O ATOM 3477 CB GLU A 226 29.792 6.491 -13.221 1.00 9.21 C ATOM 3478 CG GLU A 226 30.135 6.900 -14.680 1.00 9.88 C ATOM 3479 CD GLU A 226 29.767 5.768 -15.619 1.00 7.10 C ATOM 3480 OE1 GLU A 226 30.383 4.726 -15.616 1.00 29.36 O ATOM 3481 OE2 GLU A 226 28.665 5.981 -16.325 1.00 13.54 O ATOM 3482 HA GLU A 226 27.788 6.431 -13.847 1.00 0.00 H ATOM 3483 HB2 GLU A 226 30.404 7.069 -12.529 1.00 0.00 H ATOM 3484 HB3 GLU A 226 29.996 5.429 -13.085 1.00 0.00 H ATOM 3485 HG2 GLU A 226 29.573 7.794 -14.949 1.00 0.00 H ATOM 3486 HG3 GLU A 226 31.202 7.106 -14.759 1.00 0.00 H ATOM 3487 H GLU A 226 28.824 8.813 -12.592 1.00 0.00 H ATOM 3488 N LEU A 227 27.894 6.516 -10.574 1.00 13.51 N ATOM 3489 CA LEU A 227 27.352 5.841 -9.368 1.00 12.37 C ATOM 3490 C LEU A 227 25.811 5.788 -9.445 1.00 10.18 C ATOM 3491 O LEU A 227 25.149 4.764 -9.157 1.00 10.28 O ATOM 3492 CB LEU A 227 27.829 6.495 -8.036 1.00 7.79 C ATOM 3493 CG LEU A 227 27.042 5.950 -6.823 1.00 8.80 C ATOM 3494 CD1 LEU A 227 27.311 4.464 -6.605 1.00 13.90 C ATOM 3495 CD2 LEU A 227 27.202 6.818 -5.561 1.00 7.74 C ATOM 3496 HA LEU A 227 27.747 4.825 -9.359 1.00 0.00 H ATOM 3497 HB2 LEU A 227 28.889 6.281 -7.896 1.00 0.00 H ATOM 3498 HB3 LEU A 227 27.682 7.573 -8.098 1.00 0.00 H ATOM 3499 HG LEU A 227 25.981 6.027 -7.061 1.00 0.00 H ATOM 3500 HD21 LEU A 227 28.255 6.860 -5.281 1.00 0.00 H ATOM 3501 HD22 LEU A 227 26.839 7.825 -5.766 1.00 0.00 H ATOM 3502 HD23 LEU A 227 26.625 6.381 -4.746 1.00 0.00 H ATOM 3503 HD11 LEU A 227 27.009 3.907 -7.492 1.00 0.00 H ATOM 3504 HD12 LEU A 227 28.375 4.311 -6.424 1.00 0.00 H ATOM 3505 HD13 LEU A 227 26.741 4.115 -5.744 1.00 0.00 H ATOM 3506 H LEU A 227 28.421 7.407 -10.478 1.00 0.00 H ATOM 3507 N MET A 228 25.230 6.903 -9.853 1.00 7.04 N ATOM 3508 CA MET A 228 23.802 7.000 -9.974 1.00 8.60 C ATOM 3509 C MET A 228 23.243 5.970 -10.974 1.00 10.35 C ATOM 3510 O MET A 228 22.257 5.311 -10.739 1.00 10.06 O ATOM 3511 CB MET A 228 23.365 8.471 -10.116 1.00 6.91 C ATOM 3512 CG MET A 228 21.861 8.578 -10.124 1.00 15.20 C ATOM 3513 SD MET A 228 21.088 8.465 -8.460 1.00 20.66 S ATOM 3514 CE MET A 228 22.572 8.906 -7.503 1.00 17.75 C ATOM 3515 HA MET A 228 23.313 6.693 -9.050 1.00 0.00 H ATOM 3516 HB2 MET A 228 23.761 9.045 -9.279 1.00 0.00 H ATOM 3517 HB3 MET A 228 23.758 8.874 -11.049 1.00 0.00 H ATOM 3518 HG2 MET A 228 21.464 7.772 -10.741 1.00 0.00 H ATOM 3519 HG3 MET A 228 21.589 9.538 -10.563 1.00 0.00 H ATOM 3520 HE1 MET A 228 23.360 8.180 -7.703 1.00 0.00 H ATOM 3521 HE2 MET A 228 22.909 9.900 -7.795 1.00 0.00 H ATOM 3522 HE3 MET A 228 22.332 8.900 -6.440 1.00 0.00 H ATOM 3523 H MET A 228 25.819 7.727 -10.091 1.00 0.00 H ATOM 3524 N ARG A 229 23.901 5.828 -12.102 1.00 8.14 N ATOM 3525 CA ARG A 229 23.492 4.888 -13.129 1.00 7.00 C ATOM 3526 C ARG A 229 23.507 3.498 -12.550 1.00 11.09 C ATOM 3527 O ARG A 229 22.596 2.689 -12.754 1.00 9.62 O ATOM 3528 CB ARG A 229 24.269 4.975 -14.453 1.00 11.61 C ATOM 3529 CG ARG A 229 24.174 6.334 -15.149 1.00 8.73 C ATOM 3530 CD ARG A 229 25.281 6.472 -16.211 1.00 4.91 C ATOM 3531 NE ARG A 229 25.000 7.624 -17.004 1.00 13.22 N ATOM 3532 CZ ARG A 229 25.972 8.450 -17.359 1.00 19.49 C ATOM 3533 NH1 ARG A 229 27.253 8.210 -17.022 1.00 13.32 N ATOM 3534 NH2 ARG A 229 25.672 9.508 -18.092 1.00 13.88 N ATOM 3535 HA ARG A 229 22.480 5.166 -13.423 1.00 0.00 H ATOM 3536 HB2 ARG A 229 25.319 4.769 -14.247 1.00 0.00 H ATOM 3537 HB3 ARG A 229 23.877 4.216 -15.130 1.00 0.00 H ATOM 3538 HG2 ARG A 229 23.200 6.424 -15.631 1.00 0.00 H ATOM 3539 HG3 ARG A 229 24.286 7.126 -14.408 1.00 0.00 H ATOM 3540 HD2 ARG A 229 25.298 5.584 -16.843 1.00 0.00 H ATOM 3541 HD3 ARG A 229 26.249 6.588 -15.722 1.00 0.00 H ATOM 3542 HE ARG A 229 24.024 7.817 -17.306 1.00 0.00 H ATOM 3543 HH12 ARG A 229 28.000 8.873 -17.312 1.00 0.00 H ATOM 3544 HH11 ARG A 229 27.496 7.362 -16.472 1.00 0.00 H ATOM 3545 HH22 ARG A 229 26.421 10.169 -18.382 1.00 0.00 H ATOM 3546 HH21 ARG A 229 24.687 9.679 -18.379 1.00 0.00 H ATOM 3547 H ARG A 229 24.747 6.411 -12.265 1.00 0.00 H ATOM 3548 N LEU A 230 24.561 3.169 -11.808 1.00 9.29 N ATOM 3549 CA LEU A 230 24.627 1.824 -11.226 1.00 8.94 C ATOM 3550 C LEU A 230 23.568 1.642 -10.144 1.00 3.64 C ATOM 3551 O LEU A 230 22.848 0.668 -10.078 1.00 7.51 O ATOM 3552 CB LEU A 230 26.037 1.646 -10.625 1.00 11.97 C ATOM 3553 CG LEU A 230 26.215 0.260 -9.981 1.00 12.69 C ATOM 3554 CD1 LEU A 230 26.129 -0.788 -11.104 1.00 16.93 C ATOM 3555 CD2 LEU A 230 27.555 0.209 -9.229 1.00 26.58 C ATOM 3556 HA LEU A 230 24.436 1.076 -11.996 1.00 0.00 H ATOM 3557 HB2 LEU A 230 26.776 1.764 -11.418 1.00 0.00 H ATOM 3558 HB3 LEU A 230 26.196 2.411 -9.865 1.00 0.00 H ATOM 3559 HG LEU A 230 25.436 0.053 -9.247 1.00 0.00 H ATOM 3560 HD21 LEU A 230 28.370 0.391 -9.929 1.00 0.00 H ATOM 3561 HD22 LEU A 230 27.564 0.974 -8.452 1.00 0.00 H ATOM 3562 HD23 LEU A 230 27.678 -0.774 -8.774 1.00 0.00 H ATOM 3563 HD11 LEU A 230 25.157 -0.717 -11.592 1.00 0.00 H ATOM 3564 HD12 LEU A 230 26.918 -0.603 -11.833 1.00 0.00 H ATOM 3565 HD13 LEU A 230 26.252 -1.784 -10.680 1.00 0.00 H ATOM 3566 H LEU A 230 25.326 3.854 -11.643 1.00 0.00 H ATOM 3567 N TYR A 231 23.462 2.643 -9.278 1.00 10.75 N ATOM 3568 CA TYR A 231 22.494 2.608 -8.181 1.00 11.71 C ATOM 3569 C TYR A 231 21.088 2.364 -8.677 1.00 5.26 C ATOM 3570 O TYR A 231 20.408 1.446 -8.201 1.00 3.04 O ATOM 3571 CB TYR A 231 22.548 3.923 -7.404 1.00 5.94 C ATOM 3572 CG TYR A 231 21.807 3.968 -6.087 1.00 7.93 C ATOM 3573 CD1 TYR A 231 20.416 3.859 -6.047 1.00 9.11 C ATOM 3574 CD2 TYR A 231 22.506 4.106 -4.885 1.00 9.05 C ATOM 3575 CE1 TYR A 231 19.692 3.899 -4.852 1.00 4.36 C ATOM 3576 CE2 TYR A 231 21.808 4.139 -3.677 1.00 13.01 C ATOM 3577 CZ TYR A 231 20.409 4.043 -3.671 1.00 9.47 C ATOM 3578 OH TYR A 231 19.692 4.087 -2.473 1.00 15.02 O ATOM 3579 HA TYR A 231 22.762 1.778 -7.527 1.00 0.00 H ATOM 3580 HB3 TYR A 231 22.132 4.701 -8.043 1.00 0.00 H ATOM 3581 HB2 TYR A 231 23.596 4.143 -7.201 1.00 0.00 H ATOM 3582 HD2 TYR A 231 23.593 4.188 -4.891 1.00 0.00 H ATOM 3583 HE2 TYR A 231 22.351 4.240 -2.737 1.00 0.00 H ATOM 3584 HE1 TYR A 231 18.605 3.820 -4.847 1.00 0.00 H ATOM 3585 HD1 TYR A 231 19.873 3.738 -6.984 1.00 0.00 H ATOM 3586 HH TYR A 231 19.978 3.339 -1.891 1.00 0.00 H ATOM 3587 H TYR A 231 24.082 3.472 -9.382 1.00 0.00 H ATOM 3588 N LEU A 232 20.658 3.198 -9.635 1.00 4.64 N ATOM 3589 CA LEU A 232 19.364 3.082 -10.160 1.00 6.28 C ATOM 3590 C LEU A 232 19.112 1.766 -10.903 1.00 10.20 C ATOM 3591 O LEU A 232 17.995 1.230 -11.010 1.00 8.34 O ATOM 3592 CB LEU A 232 19.165 4.351 -10.985 1.00 9.56 C ATOM 3593 CG LEU A 232 18.932 5.646 -10.191 1.00 9.94 C ATOM 3594 CD1 LEU A 232 18.708 6.712 -11.259 1.00 7.31 C ATOM 3595 CD2 LEU A 232 17.812 5.604 -9.123 1.00 5.94 C ATOM 3596 HA LEU A 232 18.608 3.016 -9.378 1.00 0.00 H ATOM 3597 HB2 LEU A 232 20.055 4.492 -11.599 1.00 0.00 H ATOM 3598 HB3 LEU A 232 18.301 4.196 -11.631 1.00 0.00 H ATOM 3599 HG LEU A 232 19.795 5.851 -9.558 1.00 0.00 H ATOM 3600 HD21 LEU A 232 16.862 5.371 -9.604 1.00 0.00 H ATOM 3601 HD22 LEU A 232 18.044 4.837 -8.385 1.00 0.00 H ATOM 3602 HD23 LEU A 232 17.744 6.574 -8.631 1.00 0.00 H ATOM 3603 HD11 LEU A 232 19.590 6.778 -11.896 1.00 0.00 H ATOM 3604 HD12 LEU A 232 17.842 6.443 -11.863 1.00 0.00 H ATOM 3605 HD13 LEU A 232 18.533 7.675 -10.779 1.00 0.00 H ATOM 3606 H LEU A 232 21.293 3.940 -9.993 1.00 0.00 H ATOM 3607 N THR A 233 20.152 1.169 -11.456 1.00 6.98 N ATOM 3608 CA THR A 233 19.941 -0.090 -12.153 1.00 6.92 C ATOM 3609 C THR A 233 19.776 -1.244 -11.159 1.00 8.61 C ATOM 3610 O THR A 233 18.874 -2.052 -11.301 1.00 8.97 O ATOM 3611 CB THR A 233 21.179 -0.407 -13.078 1.00 3.11 C ATOM 3612 OG1 THR A 233 21.223 0.521 -14.124 1.00 9.72 O ATOM 3613 CG2 THR A 233 21.122 -1.818 -13.684 1.00 6.83 C ATOM 3614 HA THR A 233 19.034 0.008 -12.750 1.00 0.00 H ATOM 3615 HB THR A 233 22.069 -0.346 -12.452 1.00 0.00 H ATOM 3616 HG1 THR A 233 21.312 1.433 -13.751 1.00 0.00 H ATOM 3617 HG23 THR A 233 21.087 -2.555 -12.882 1.00 0.00 H ATOM 3618 HG21 THR A 233 20.230 -1.910 -14.303 1.00 0.00 H ATOM 3619 HG22 THR A 233 22.009 -1.986 -14.295 1.00 0.00 H ATOM 3620 H THR A 233 21.101 1.590 -11.394 1.00 0.00 H ATOM 3621 N ILE A 234 20.647 -1.332 -10.141 1.00 5.01 N ATOM 3622 CA ILE A 234 20.598 -2.413 -9.192 1.00 7.13 C ATOM 3623 C ILE A 234 19.491 -2.440 -8.196 1.00 3.00 C ATOM 3624 O ILE A 234 19.193 -3.543 -7.705 1.00 5.31 O ATOM 3625 CB ILE A 234 21.959 -2.687 -8.571 1.00 8.62 C ATOM 3626 CG1 ILE A 234 22.345 -1.599 -7.572 1.00 8.22 C ATOM 3627 CG2 ILE A 234 23.003 -2.891 -9.684 1.00 11.83 C ATOM 3628 CD1 ILE A 234 23.526 -2.002 -6.671 1.00 13.48 C ATOM 3629 HA ILE A 234 20.316 -3.253 -9.827 1.00 0.00 H ATOM 3630 HB ILE A 234 21.915 -3.610 -7.992 1.00 0.00 H ATOM 3631 HG12 ILE A 234 22.620 -0.701 -8.125 1.00 0.00 H ATOM 3632 HG13 ILE A 234 21.483 -1.385 -6.940 1.00 0.00 H ATOM 3633 HD11 ILE A 234 23.261 -2.894 -6.104 1.00 0.00 H ATOM 3634 HD12 ILE A 234 24.399 -2.209 -7.290 1.00 0.00 H ATOM 3635 HD13 ILE A 234 23.752 -1.187 -5.984 1.00 0.00 H ATOM 3636 HG21 ILE A 234 22.710 -3.738 -10.304 1.00 0.00 H ATOM 3637 HG22 ILE A 234 23.059 -1.992 -10.298 1.00 0.00 H ATOM 3638 HG23 ILE A 234 23.977 -3.087 -9.235 1.00 0.00 H ATOM 3639 H ILE A 234 21.377 -0.599 -10.035 1.00 0.00 H ATOM 3640 N HIS A 235 18.927 -1.243 -7.931 1.00 3.16 N ATOM 3641 CA HIS A 235 17.848 -1.245 -6.956 1.00 3.65 C ATOM 3642 C HIS A 235 16.478 -1.435 -7.637 1.00 5.94 C ATOM 3643 O HIS A 235 15.458 -1.455 -6.943 1.00 5.96 O ATOM 3644 CB HIS A 235 17.795 0.042 -6.130 1.00 3.16 C ATOM 3645 CG HIS A 235 18.897 0.184 -5.119 1.00 4.63 C ATOM 3646 ND1 HIS A 235 20.184 0.542 -5.467 1.00 9.30 N ATOM 3647 CD2 HIS A 235 18.853 -0.001 -3.765 1.00 7.26 C ATOM 3648 CE1 HIS A 235 20.906 0.607 -4.335 1.00 5.32 C ATOM 3649 NE2 HIS A 235 20.125 0.275 -3.308 1.00 3.76 N ATOM 3650 HA HIS A 235 18.059 -2.082 -6.290 1.00 0.00 H ATOM 3651 HB2 HIS A 235 17.851 0.888 -6.815 1.00 0.00 H ATOM 3652 HB3 HIS A 235 16.843 0.067 -5.601 1.00 0.00 H ATOM 3653 HD2 HIS A 235 17.991 -0.304 -3.170 1.00 0.00 H ATOM 3654 HE1 HIS A 235 21.958 0.886 -4.268 1.00 0.00 H ATOM 3655 H HIS A 235 19.246 -0.370 -8.397 1.00 0.00 H ATOM 3656 N SER A 236 16.479 -1.565 -8.970 1.00 6.34 N ATOM 3657 CA SER A 236 15.288 -1.658 -9.793 1.00 4.22 C ATOM 3658 C SER A 236 14.169 -2.646 -9.498 1.00 7.58 C ATOM 3659 O SER A 236 12.985 -2.262 -9.566 1.00 5.63 O ATOM 3660 CB SER A 236 15.713 -1.716 -11.248 1.00 3.56 C ATOM 3661 OG SER A 236 16.217 -3.031 -11.451 1.00 5.53 O ATOM 3662 HA SER A 236 14.756 -0.751 -9.505 1.00 0.00 H ATOM 3663 HB2 SER A 236 16.489 -0.977 -11.447 1.00 0.00 H ATOM 3664 HB3 SER A 236 14.860 -1.531 -11.901 1.00 0.00 H ATOM 3665 HG SER A 236 16.984 -3.186 -10.845 1.00 0.00 H ATOM 3666 H SER A 236 17.401 -1.602 -9.450 1.00 0.00 H ATOM 3667 N ASP A 237 14.514 -3.911 -9.212 1.00 4.83 N ATOM 3668 CA ASP A 237 13.475 -4.913 -8.966 1.00 3.24 C ATOM 3669 C ASP A 237 14.088 -6.018 -8.126 1.00 6.44 C ATOM 3670 O ASP A 237 15.297 -6.204 -8.175 1.00 3.96 O ATOM 3671 CB ASP A 237 13.196 -5.514 -10.380 1.00 8.15 C ATOM 3672 CG ASP A 237 11.775 -5.976 -10.470 1.00 8.98 C ATOM 3673 OD1 ASP A 237 10.904 -5.505 -9.771 1.00 8.75 O ATOM 3674 OD2 ASP A 237 11.619 -7.021 -11.237 1.00 7.67 O ATOM 3675 HA ASP A 237 12.591 -4.507 -8.474 1.00 0.00 H ATOM 3676 HB2 ASP A 237 13.377 -4.752 -11.138 1.00 0.00 H ATOM 3677 HB3 ASP A 237 13.862 -6.360 -10.551 1.00 0.00 H ATOM 3678 H ASP A 237 15.518 -4.179 -9.165 1.00 0.00 H ATOM 3679 N HIS A 238 13.275 -6.763 -7.411 1.00 5.27 N ATOM 3680 CA HIS A 238 13.876 -7.835 -6.639 1.00 3.35 C ATOM 3681 C HIS A 238 12.812 -8.895 -6.519 1.00 11.01 C ATOM 3682 O HIS A 238 12.457 -9.301 -5.432 1.00 4.96 O ATOM 3683 CB HIS A 238 14.457 -7.357 -5.292 1.00 7.68 C ATOM 3684 CG HIS A 238 15.644 -8.168 -4.804 1.00 4.51 C ATOM 3685 ND1 HIS A 238 15.641 -8.744 -3.558 1.00 6.25 N ATOM 3686 CD2 HIS A 238 16.848 -8.475 -5.396 1.00 11.18 C ATOM 3687 CE1 HIS A 238 16.828 -9.370 -3.408 1.00 7.71 C ATOM 3688 NE2 HIS A 238 17.574 -9.234 -4.487 1.00 7.73 N ATOM 3689 HA HIS A 238 14.756 -8.243 -7.137 1.00 0.00 H ATOM 3690 HB2 HIS A 238 14.774 -6.320 -5.405 1.00 0.00 H ATOM 3691 HB3 HIS A 238 13.670 -7.415 -4.540 1.00 0.00 H ATOM 3692 HD2 HIS A 238 17.172 -8.178 -6.393 1.00 0.00 H ATOM 3693 HE1 HIS A 238 17.130 -9.915 -2.514 1.00 0.00 H ATOM 3694 H HIS A 238 12.249 -6.592 -7.399 1.00 0.00 H ATOM 3695 N GLU A 239 12.286 -9.321 -7.656 1.00 3.00 N ATOM 3696 CA GLU A 239 11.213 -10.298 -7.671 1.00 3.00 C ATOM 3697 C GLU A 239 9.950 -9.722 -7.100 1.00 5.40 C ATOM 3698 O GLU A 239 9.918 -8.559 -6.784 1.00 10.82 O ATOM 3699 CB GLU A 239 11.513 -11.776 -7.313 1.00 3.07 C ATOM 3700 CG GLU A 239 11.546 -12.105 -5.817 1.00 7.42 C ATOM 3701 CD GLU A 239 11.325 -13.601 -5.530 1.00 6.85 C ATOM 3702 OE1 GLU A 239 11.892 -14.436 -6.396 1.00 10.12 O ATOM 3703 OE2 GLU A 239 10.617 -13.949 -4.591 1.00 10.00 O ATOM 3704 HA GLU A 239 11.056 -10.475 -8.735 1.00 0.00 H ATOM 3705 HB2 GLU A 239 10.744 -12.395 -7.775 1.00 0.00 H ATOM 3706 HB3 GLU A 239 12.485 -12.032 -7.734 1.00 0.00 H ATOM 3707 HG2 GLU A 239 12.517 -11.813 -5.417 1.00 0.00 H ATOM 3708 HG3 GLU A 239 10.763 -11.535 -5.317 1.00 0.00 H ATOM 3709 H GLU A 239 12.649 -8.948 -8.557 1.00 0.00 H ATOM 3710 N GLY A 240 8.881 -10.473 -6.961 1.00 7.52 N ATOM 3711 CA GLY A 240 7.608 -9.970 -6.486 1.00 3.00 C ATOM 3712 C GLY A 240 7.187 -9.979 -5.087 1.00 3.00 C ATOM 3713 O GLY A 240 6.264 -9.292 -4.722 1.00 9.71 O ATOM 3714 HA3 GLY A 240 6.849 -10.537 -7.025 1.00 0.00 H ATOM 3715 HA2 GLY A 240 7.570 -8.926 -6.798 1.00 0.00 H ATOM 3716 H GLY A 240 8.952 -11.482 -7.205 1.00 0.00 H ATOM 3717 N GLY A 241 7.836 -10.738 -4.277 1.00 3.70 N ATOM 3718 CA GLY A 241 7.403 -10.814 -2.859 1.00 3.00 C ATOM 3719 C GLY A 241 7.930 -9.870 -1.862 1.00 5.96 C ATOM 3720 O GLY A 241 7.552 -9.956 -0.712 1.00 3.64 O ATOM 3721 HA3 GLY A 241 7.659 -11.814 -2.508 1.00 0.00 H ATOM 3722 HA2 GLY A 241 6.319 -10.697 -2.857 1.00 0.00 H ATOM 3723 H GLY A 241 8.652 -11.290 -4.610 1.00 0.00 H ATOM 3724 N ASN A 242 8.813 -9.002 -2.295 1.00 4.39 N ATOM 3725 CA ASN A 242 9.368 -8.017 -1.409 1.00 3.00 C ATOM 3726 C ASN A 242 8.236 -7.045 -1.139 1.00 8.63 C ATOM 3727 O ASN A 242 7.317 -6.930 -1.930 1.00 3.10 O ATOM 3728 CB ASN A 242 10.640 -7.370 -1.963 1.00 5.64 C ATOM 3729 CG ASN A 242 10.362 -6.520 -3.156 1.00 8.71 C ATOM 3730 OD1 ASN A 242 9.882 -5.422 -2.948 1.00 4.23 O ATOM 3731 ND2 ASN A 242 10.876 -6.869 -4.319 1.00 3.00 N ATOM 3732 HA ASN A 242 9.720 -8.457 -0.476 1.00 0.00 H ATOM 3733 HB2 ASN A 242 11.087 -6.750 -1.186 1.00 0.00 H ATOM 3734 HB3 ASN A 242 11.340 -8.156 -2.246 1.00 0.00 H ATOM 3735 HD22 ASN A 242 11.275 -7.821 -4.447 1.00 0.00 H ATOM 3736 HD21 ASN A 242 10.883 -6.192 -5.109 1.00 0.00 H ATOM 3737 H ASN A 242 9.114 -9.027 -3.290 1.00 0.00 H ATOM 3738 N VAL A 243 8.264 -6.390 0.021 1.00 3.00 N ATOM 3739 CA VAL A 243 7.195 -5.505 0.460 1.00 3.00 C ATOM 3740 C VAL A 243 6.668 -4.461 -0.542 1.00 3.37 C ATOM 3741 O VAL A 243 5.449 -4.377 -0.716 1.00 6.49 O ATOM 3742 CB VAL A 243 7.428 -4.927 1.833 1.00 5.97 C ATOM 3743 CG1 VAL A 243 6.334 -3.938 2.139 1.00 3.00 C ATOM 3744 CG2 VAL A 243 7.366 -6.045 2.872 1.00 5.81 C ATOM 3745 HA VAL A 243 6.357 -6.199 0.524 1.00 0.00 H ATOM 3746 HB VAL A 243 8.403 -4.441 1.862 1.00 0.00 H ATOM 3747 HG11 VAL A 243 6.348 -3.141 1.396 1.00 0.00 H ATOM 3748 HG12 VAL A 243 5.369 -4.445 2.111 1.00 0.00 H ATOM 3749 HG13 VAL A 243 6.495 -3.515 3.131 1.00 0.00 H ATOM 3750 HG21 VAL A 243 6.384 -6.517 2.837 1.00 0.00 H ATOM 3751 HG22 VAL A 243 8.135 -6.786 2.653 1.00 0.00 H ATOM 3752 HG23 VAL A 243 7.534 -5.627 3.864 1.00 0.00 H ATOM 3753 H VAL A 243 9.089 -6.517 0.642 1.00 0.00 H ATOM 3754 N SER A 244 7.608 -3.709 -1.111 1.00 4.02 N ATOM 3755 CA SER A 244 7.301 -2.659 -2.070 1.00 7.52 C ATOM 3756 C SER A 244 6.694 -3.246 -3.302 1.00 4.60 C ATOM 3757 O SER A 244 5.612 -2.866 -3.739 1.00 3.09 O ATOM 3758 CB SER A 244 8.397 -1.683 -2.327 1.00 3.00 C ATOM 3759 OG SER A 244 9.543 -2.321 -2.850 1.00 6.97 O ATOM 3760 HA SER A 244 6.552 -2.021 -1.601 1.00 0.00 H ATOM 3761 HB2 SER A 244 8.661 -1.191 -1.391 1.00 0.00 H ATOM 3762 HB3 SER A 244 8.048 -0.938 -3.042 1.00 0.00 H ATOM 3763 HG SER A 244 9.868 -2.996 -2.203 1.00 0.00 H ATOM 3764 H SER A 244 8.603 -3.879 -0.860 1.00 0.00 H ATOM 3765 N ALA A 245 7.351 -4.213 -3.938 1.00 5.24 N ATOM 3766 CA ALA A 245 6.722 -4.786 -5.126 1.00 5.50 C ATOM 3767 C ALA A 245 5.411 -5.487 -4.862 1.00 9.10 C ATOM 3768 O ALA A 245 4.487 -5.296 -5.681 1.00 6.51 O ATOM 3769 CB ALA A 245 7.608 -5.780 -5.844 1.00 3.00 C ATOM 3770 HA ALA A 245 6.544 -3.907 -5.745 1.00 0.00 H ATOM 3771 HB1 ALA A 245 8.525 -5.284 -6.161 1.00 0.00 H ATOM 3772 HB2 ALA A 245 7.852 -6.601 -5.170 1.00 0.00 H ATOM 3773 HB3 ALA A 245 7.083 -6.169 -6.717 1.00 0.00 H ATOM 3774 H ALA A 245 8.277 -4.548 -3.602 1.00 0.00 H ATOM 3775 N HIS A 246 5.299 -6.306 -3.772 1.00 4.30 N ATOM 3776 CA HIS A 246 4.054 -7.004 -3.479 1.00 3.01 C ATOM 3777 C HIS A 246 2.930 -5.971 -3.271 1.00 4.74 C ATOM 3778 O HIS A 246 1.808 -6.131 -3.732 1.00 4.97 O ATOM 3779 CB HIS A 246 4.290 -7.920 -2.267 1.00 3.36 C ATOM 3780 CG HIS A 246 3.082 -8.744 -1.971 1.00 3.00 C ATOM 3781 ND1 HIS A 246 2.973 -9.437 -0.793 1.00 6.69 N ATOM 3782 CD2 HIS A 246 1.923 -8.927 -2.712 1.00 3.11 C ATOM 3783 CE1 HIS A 246 1.796 -10.056 -0.802 1.00 7.73 C ATOM 3784 NE2 HIS A 246 1.147 -9.787 -1.925 1.00 5.74 N ATOM 3785 HA HIS A 246 3.735 -7.638 -4.306 1.00 0.00 H ATOM 3786 HB2 HIS A 246 5.129 -8.582 -2.479 1.00 0.00 H ATOM 3787 HB3 HIS A 246 4.524 -7.306 -1.397 1.00 0.00 H ATOM 3788 HD2 HIS A 246 1.674 -8.500 -3.683 1.00 0.00 H ATOM 3789 HE1 HIS A 246 1.420 -10.693 -0.001 1.00 0.00 H ATOM 3790 H HIS A 246 6.116 -6.433 -3.142 1.00 0.00 H ATOM 3791 N THR A 247 3.235 -4.879 -2.569 1.00 3.00 N ATOM 3792 CA THR A 247 2.265 -3.793 -2.309 1.00 3.00 C ATOM 3793 C THR A 247 1.798 -3.192 -3.641 1.00 3.00 C ATOM 3794 O THR A 247 0.586 -2.999 -3.852 1.00 3.07 O ATOM 3795 CB THR A 247 2.872 -2.707 -1.379 1.00 3.00 C ATOM 3796 OG1 THR A 247 3.185 -3.228 -0.093 1.00 5.92 O ATOM 3797 CG2 THR A 247 1.823 -1.617 -1.151 1.00 3.00 C ATOM 3798 HA THR A 247 1.401 -4.208 -1.790 1.00 0.00 H ATOM 3799 HB THR A 247 3.777 -2.334 -1.859 1.00 0.00 H ATOM 3800 HG1 THR A 247 3.843 -3.961 -0.187 1.00 0.00 H ATOM 3801 HG23 THR A 247 1.543 -1.178 -2.109 1.00 0.00 H ATOM 3802 HG21 THR A 247 0.943 -2.054 -0.679 1.00 0.00 H ATOM 3803 HG22 THR A 247 2.238 -0.845 -0.504 1.00 0.00 H ATOM 3804 H THR A 247 4.198 -4.787 -2.187 1.00 0.00 H ATOM 3805 N SER A 248 2.682 -2.864 -4.591 1.00 6.71 N ATOM 3806 CA SER A 248 2.198 -2.303 -5.858 1.00 3.21 C ATOM 3807 C SER A 248 1.326 -3.307 -6.616 1.00 11.07 C ATOM 3808 O SER A 248 0.351 -2.972 -7.292 1.00 6.66 O ATOM 3809 CB SER A 248 3.375 -1.888 -6.765 1.00 6.38 C ATOM 3810 OG SER A 248 4.102 -3.059 -7.200 1.00 6.01 O ATOM 3811 HA SER A 248 1.602 -1.426 -5.607 1.00 0.00 H ATOM 3812 HB2 SER A 248 4.045 -1.233 -6.209 1.00 0.00 H ATOM 3813 HB3 SER A 248 2.990 -1.358 -7.636 1.00 0.00 H ATOM 3814 HG SER A 248 4.454 -3.540 -6.410 1.00 0.00 H ATOM 3815 H SER A 248 3.700 -3.005 -4.433 1.00 0.00 H ATOM 3816 N HIS A 249 1.683 -4.596 -6.482 1.00 5.12 N ATOM 3817 CA HIS A 249 0.969 -5.664 -7.157 1.00 5.91 C ATOM 3818 C HIS A 249 -0.434 -5.816 -6.614 1.00 4.21 C ATOM 3819 O HIS A 249 -1.434 -5.904 -7.311 1.00 8.09 O ATOM 3820 CB HIS A 249 1.705 -7.001 -6.881 1.00 4.36 C ATOM 3821 CG HIS A 249 1.299 -8.169 -7.670 1.00 3.00 C ATOM 3822 ND1 HIS A 249 1.652 -8.343 -8.992 1.00 7.61 N ATOM 3823 CD2 HIS A 249 0.587 -9.277 -7.297 1.00 6.73 C ATOM 3824 CE1 HIS A 249 1.156 -9.530 -9.409 1.00 3.04 C ATOM 3825 NE2 HIS A 249 0.519 -10.133 -8.386 1.00 4.62 N ATOM 3826 HA HIS A 249 0.928 -5.424 -8.219 1.00 0.00 H ATOM 3827 HB2 HIS A 249 2.766 -6.835 -7.065 1.00 0.00 H ATOM 3828 HB3 HIS A 249 1.554 -7.247 -5.830 1.00 0.00 H ATOM 3829 HD2 HIS A 249 0.150 -9.455 -6.315 1.00 0.00 H ATOM 3830 HE1 HIS A 249 1.256 -9.936 -10.416 1.00 0.00 H ATOM 3831 H HIS A 249 2.494 -4.835 -5.877 1.00 0.00 H ATOM 3832 N LEU A 250 -0.536 -5.885 -5.312 1.00 7.90 N ATOM 3833 CA LEU A 250 -1.791 -6.026 -4.651 1.00 7.05 C ATOM 3834 C LEU A 250 -2.705 -4.808 -4.874 1.00 6.19 C ATOM 3835 O LEU A 250 -3.899 -4.964 -5.174 1.00 6.71 O ATOM 3836 CB LEU A 250 -1.369 -6.167 -3.184 1.00 7.21 C ATOM 3837 CG LEU A 250 -2.529 -6.084 -2.206 1.00 6.89 C ATOM 3838 CD1 LEU A 250 -3.636 -7.097 -2.492 1.00 3.87 C ATOM 3839 CD2 LEU A 250 -1.997 -6.282 -0.802 1.00 7.84 C ATOM 3840 HA LEU A 250 -2.382 -6.866 -5.017 1.00 0.00 H ATOM 3841 HB2 LEU A 250 -0.880 -7.133 -3.057 1.00 0.00 H ATOM 3842 HB3 LEU A 250 -0.663 -5.370 -2.950 1.00 0.00 H ATOM 3843 HG LEU A 250 -2.982 -5.099 -2.318 1.00 0.00 H ATOM 3844 HD21 LEU A 250 -1.521 -7.260 -0.730 1.00 0.00 H ATOM 3845 HD22 LEU A 250 -1.267 -5.504 -0.578 1.00 0.00 H ATOM 3846 HD23 LEU A 250 -2.821 -6.224 -0.091 1.00 0.00 H ATOM 3847 HD11 LEU A 250 -4.036 -6.924 -3.491 1.00 0.00 H ATOM 3848 HD12 LEU A 250 -3.228 -8.106 -2.432 1.00 0.00 H ATOM 3849 HD13 LEU A 250 -4.432 -6.981 -1.756 1.00 0.00 H ATOM 3850 H LEU A 250 0.330 -5.835 -4.738 1.00 0.00 H ATOM 3851 N VAL A 251 -2.184 -3.581 -4.743 1.00 3.00 N ATOM 3852 CA VAL A 251 -3.008 -2.398 -4.942 1.00 3.00 C ATOM 3853 C VAL A 251 -3.415 -2.290 -6.422 1.00 10.33 C ATOM 3854 O VAL A 251 -4.519 -1.987 -6.700 1.00 3.97 O ATOM 3855 CB VAL A 251 -2.260 -1.129 -4.438 1.00 4.58 C ATOM 3856 CG1 VAL A 251 -2.899 0.205 -4.875 1.00 6.49 C ATOM 3857 CG2 VAL A 251 -2.167 -1.297 -2.906 1.00 3.85 C ATOM 3858 HA VAL A 251 -3.923 -2.483 -4.356 1.00 0.00 H ATOM 3859 HB VAL A 251 -1.272 -1.059 -4.894 1.00 0.00 H ATOM 3860 HG11 VAL A 251 -2.917 0.258 -5.964 1.00 0.00 H ATOM 3861 HG12 VAL A 251 -3.917 0.262 -4.490 1.00 0.00 H ATOM 3862 HG13 VAL A 251 -2.312 1.034 -4.479 1.00 0.00 H ATOM 3863 HG21 VAL A 251 -3.171 -1.364 -2.487 1.00 0.00 H ATOM 3864 HG22 VAL A 251 -1.614 -2.207 -2.675 1.00 0.00 H ATOM 3865 HG23 VAL A 251 -1.650 -0.438 -2.478 1.00 0.00 H ATOM 3866 H VAL A 251 -1.180 -3.472 -4.496 1.00 0.00 H ATOM 3867 N GLY A 252 -2.496 -2.570 -7.320 1.00 3.00 N ATOM 3868 CA GLY A 252 -2.784 -2.492 -8.718 1.00 3.00 C ATOM 3869 C GLY A 252 -3.827 -3.509 -9.090 1.00 6.85 C ATOM 3870 O GLY A 252 -4.561 -3.245 -10.021 1.00 5.39 O ATOM 3871 HA3 GLY A 252 -1.873 -2.686 -9.285 1.00 0.00 H ATOM 3872 HA2 GLY A 252 -3.153 -1.494 -8.955 1.00 0.00 H ATOM 3873 H GLY A 252 -1.545 -2.853 -7.008 1.00 0.00 H ATOM 3874 N SER A 253 -3.909 -4.646 -8.357 1.00 3.76 N ATOM 3875 CA SER A 253 -4.857 -5.714 -8.645 1.00 8.18 C ATOM 3876 C SER A 253 -6.302 -5.291 -8.504 1.00 6.91 C ATOM 3877 O SER A 253 -7.167 -5.901 -9.101 1.00 6.62 O ATOM 3878 CB SER A 253 -4.548 -7.049 -7.941 1.00 3.94 C ATOM 3879 OG SER A 253 -5.029 -6.897 -6.606 1.00 3.00 O ATOM 3880 HA SER A 253 -4.709 -5.921 -9.705 1.00 0.00 H ATOM 3881 HB2 SER A 253 -3.475 -7.240 -7.940 1.00 0.00 H ATOM 3882 HB3 SER A 253 -5.062 -7.871 -8.440 1.00 0.00 H ATOM 3883 HG SER A 253 -4.560 -6.142 -6.171 1.00 0.00 H ATOM 3884 H SER A 253 -3.264 -4.762 -7.550 1.00 0.00 H ATOM 3885 N ALA A 254 -6.537 -4.225 -7.712 1.00 3.00 N ATOM 3886 CA ALA A 254 -7.867 -3.681 -7.502 1.00 6.24 C ATOM 3887 C ALA A 254 -8.227 -2.655 -8.572 1.00 8.13 C ATOM 3888 O ALA A 254 -9.292 -2.037 -8.526 1.00 3.03 O ATOM 3889 CB ALA A 254 -7.958 -3.086 -6.118 1.00 3.00 C ATOM 3890 HA ALA A 254 -8.592 -4.491 -7.585 1.00 0.00 H ATOM 3891 HB1 ALA A 254 -7.762 -3.861 -5.377 1.00 0.00 H ATOM 3892 HB2 ALA A 254 -7.220 -2.290 -6.017 1.00 0.00 H ATOM 3893 HB3 ALA A 254 -8.957 -2.679 -5.964 1.00 0.00 H ATOM 3894 H ALA A 254 -5.732 -3.774 -7.232 1.00 0.00 H ATOM 3895 N LEU A 255 -7.296 -2.499 -9.510 1.00 3.37 N ATOM 3896 CA LEU A 255 -7.558 -1.519 -10.561 1.00 5.94 C ATOM 3897 C LEU A 255 -7.225 -0.072 -10.254 1.00 9.62 C ATOM 3898 O LEU A 255 -7.570 0.844 -10.997 1.00 6.84 O ATOM 3899 CB LEU A 255 -8.701 -1.720 -11.522 1.00 10.96 C ATOM 3900 CG LEU A 255 -8.682 -3.140 -12.068 1.00 14.72 C ATOM 3901 CD1 LEU A 255 -10.034 -3.364 -12.757 1.00 13.41 C ATOM 3902 CD2 LEU A 255 -7.472 -3.494 -12.944 1.00 9.27 C ATOM 3903 HA LEU A 255 -6.745 -1.858 -11.203 1.00 0.00 H ATOM 3904 HB2 LEU A 255 -9.644 -1.546 -11.003 1.00 0.00 H ATOM 3905 HB3 LEU A 255 -8.606 -1.015 -12.348 1.00 0.00 H ATOM 3906 HG LEU A 255 -8.550 -3.837 -11.240 1.00 0.00 H ATOM 3907 HD21 LEU A 255 -7.444 -2.831 -13.808 1.00 0.00 H ATOM 3908 HD22 LEU A 255 -6.557 -3.374 -12.363 1.00 0.00 H ATOM 3909 HD23 LEU A 255 -7.558 -4.527 -13.280 1.00 0.00 H ATOM 3910 HD11 LEU A 255 -10.836 -3.238 -12.030 1.00 0.00 H ATOM 3911 HD12 LEU A 255 -10.154 -2.639 -13.562 1.00 0.00 H ATOM 3912 HD13 LEU A 255 -10.069 -4.374 -13.167 1.00 0.00 H ATOM 3913 H LEU A 255 -6.416 -3.053 -9.495 1.00 0.00 H ATOM 3914 N SER A 256 -6.524 0.113 -9.115 1.00 8.03 N ATOM 3915 CA SER A 256 -6.061 1.422 -8.713 1.00 3.27 C ATOM 3916 C SER A 256 -4.996 1.762 -9.773 1.00 5.93 C ATOM 3917 O SER A 256 -4.268 0.880 -10.267 1.00 5.36 O ATOM 3918 CB SER A 256 -5.416 1.459 -7.334 1.00 3.00 C ATOM 3919 OG SER A 256 -6.452 1.354 -6.401 1.00 9.19 O ATOM 3920 HA SER A 256 -6.898 2.118 -8.649 1.00 0.00 H ATOM 3921 HB2 SER A 256 -4.879 2.398 -7.195 1.00 0.00 H ATOM 3922 HB3 SER A 256 -4.723 0.625 -7.221 1.00 0.00 H ATOM 3923 HG SER A 256 -6.074 1.374 -5.486 1.00 0.00 H ATOM 3924 H SER A 256 -6.312 -0.707 -8.512 1.00 0.00 H ATOM 3925 N ASP A 257 -4.899 3.069 -10.156 1.00 3.00 N ATOM 3926 CA ASP A 257 -3.960 3.504 -11.158 1.00 3.00 C ATOM 3927 C ASP A 257 -2.517 3.356 -10.730 1.00 5.23 C ATOM 3928 O ASP A 257 -2.232 3.231 -9.540 1.00 5.20 O ATOM 3929 CB ASP A 257 -4.442 4.891 -11.657 1.00 5.23 C ATOM 3930 CG ASP A 257 -4.090 5.893 -10.595 1.00 5.89 C ATOM 3931 OD1 ASP A 257 -2.911 6.088 -10.279 1.00 6.53 O ATOM 3932 OD2 ASP A 257 -5.082 6.578 -10.120 1.00 4.49 O ATOM 3933 HA ASP A 257 -3.949 2.848 -12.029 1.00 0.00 H ATOM 3934 HB2 ASP A 257 -3.942 5.146 -12.592 1.00 0.00 H ATOM 3935 HB3 ASP A 257 -5.520 4.877 -11.815 1.00 0.00 H ATOM 3936 H ASP A 257 -5.522 3.772 -9.710 1.00 0.00 H ATOM 3937 N PRO A 258 -1.594 3.353 -11.661 1.00 4.17 N ATOM 3938 CA PRO A 258 -0.218 3.207 -11.320 1.00 6.05 C ATOM 3939 C PRO A 258 0.344 4.227 -10.325 1.00 9.65 C ATOM 3940 O PRO A 258 1.261 3.928 -9.548 1.00 4.36 O ATOM 3941 CB PRO A 258 0.546 3.251 -12.636 1.00 7.42 C ATOM 3942 CG PRO A 258 -0.501 2.857 -13.659 1.00 3.78 C ATOM 3943 CD PRO A 258 -1.794 3.455 -13.139 1.00 3.15 C ATOM 3944 HA PRO A 258 -0.104 2.265 -10.783 1.00 0.00 H ATOM 3945 HD3 PRO A 258 -1.910 4.492 -13.455 1.00 0.00 H ATOM 3946 HD2 PRO A 258 -2.660 2.878 -13.465 1.00 0.00 H ATOM 3947 HG3 PRO A 258 -0.580 1.772 -13.730 1.00 0.00 H ATOM 3948 HG2 PRO A 258 -0.255 3.267 -14.639 1.00 0.00 H ATOM 3949 HB2 PRO A 258 0.928 4.253 -12.833 1.00 0.00 H ATOM 3950 HB3 PRO A 258 1.374 2.542 -12.631 1.00 0.00 H ATOM 3951 N TYR A 259 -0.181 5.449 -10.269 1.00 4.80 N ATOM 3952 CA TYR A 259 0.308 6.458 -9.309 1.00 5.12 C ATOM 3953 C TYR A 259 -0.078 6.036 -7.889 1.00 5.05 C ATOM 3954 O TYR A 259 0.753 6.071 -6.997 1.00 7.24 O ATOM 3955 CB TYR A 259 -0.275 7.839 -9.616 1.00 4.33 C ATOM 3956 CG TYR A 259 0.217 8.454 -10.935 1.00 3.92 C ATOM 3957 CD1 TYR A 259 -0.446 8.263 -12.145 1.00 7.90 C ATOM 3958 CD2 TYR A 259 1.340 9.281 -10.952 1.00 12.41 C ATOM 3959 CE1 TYR A 259 -0.007 8.838 -13.339 1.00 12.03 C ATOM 3960 CE2 TYR A 259 1.807 9.873 -12.131 1.00 8.42 C ATOM 3961 CZ TYR A 259 1.127 9.646 -13.322 1.00 10.05 C ATOM 3962 OH TYR A 259 1.575 10.228 -14.485 1.00 15.57 O ATOM 3963 HA TYR A 259 1.393 6.522 -9.395 1.00 0.00 H ATOM 3964 HB3 TYR A 259 -0.004 8.513 -8.803 1.00 0.00 H ATOM 3965 HB2 TYR A 259 -1.360 7.749 -9.665 1.00 0.00 H ATOM 3966 HD2 TYR A 259 1.870 9.472 -10.019 1.00 0.00 H ATOM 3967 HE2 TYR A 259 2.695 10.505 -12.116 1.00 0.00 H ATOM 3968 HE1 TYR A 259 -0.544 8.657 -14.270 1.00 0.00 H ATOM 3969 HD1 TYR A 259 -1.341 7.641 -12.160 1.00 0.00 H ATOM 3970 HH TYR A 259 0.982 9.966 -15.233 1.00 0.00 H ATOM 3971 H TYR A 259 -0.955 5.699 -10.918 1.00 0.00 H ATOM 3972 N LEU A 260 -1.313 5.612 -7.744 1.00 3.76 N ATOM 3973 CA LEU A 260 -1.833 5.133 -6.461 1.00 3.90 C ATOM 3974 C LEU A 260 -1.079 3.852 -6.079 1.00 8.00 C ATOM 3975 O LEU A 260 -0.651 3.676 -4.925 1.00 4.61 O ATOM 3976 CB LEU A 260 -3.347 4.838 -6.491 1.00 4.22 C ATOM 3977 CG LEU A 260 -4.197 6.092 -6.797 1.00 5.78 C ATOM 3978 CD1 LEU A 260 -5.662 5.738 -6.526 1.00 4.07 C ATOM 3979 CD2 LEU A 260 -3.799 7.092 -5.710 1.00 8.06 C ATOM 3980 HA LEU A 260 -1.680 5.925 -5.728 1.00 0.00 H ATOM 3981 HB2 LEU A 260 -3.541 4.090 -7.260 1.00 0.00 H ATOM 3982 HB3 LEU A 260 -3.644 4.444 -5.519 1.00 0.00 H ATOM 3983 HG LEU A 260 -4.060 6.457 -7.815 1.00 0.00 H ATOM 3984 HD21 LEU A 260 -4.028 6.672 -4.730 1.00 0.00 H ATOM 3985 HD22 LEU A 260 -2.730 7.296 -5.779 1.00 0.00 H ATOM 3986 HD23 LEU A 260 -4.356 8.018 -5.849 1.00 0.00 H ATOM 3987 HD11 LEU A 260 -5.960 4.911 -7.170 1.00 0.00 H ATOM 3988 HD12 LEU A 260 -5.777 5.447 -5.482 1.00 0.00 H ATOM 3989 HD13 LEU A 260 -6.288 6.606 -6.734 1.00 0.00 H ATOM 3990 H LEU A 260 -1.945 5.617 -8.570 1.00 0.00 H ATOM 3991 N SER A 261 -0.898 2.929 -7.012 1.00 3.00 N ATOM 3992 CA SER A 261 -0.188 1.696 -6.692 1.00 4.96 C ATOM 3993 C SER A 261 1.286 1.928 -6.279 1.00 7.32 C ATOM 3994 O SER A 261 1.798 1.319 -5.328 1.00 6.74 O ATOM 3995 CB SER A 261 -0.255 0.772 -7.905 1.00 3.25 C ATOM 3996 OG SER A 261 -1.431 1.072 -8.647 1.00 80.00 O ATOM 3997 HA SER A 261 -0.675 1.245 -5.828 1.00 0.00 H ATOM 3998 HB2 SER A 261 -0.286 -0.266 -7.574 1.00 0.00 H ATOM 3999 HB3 SER A 261 0.623 0.926 -8.532 1.00 0.00 H ATOM 4000 HG SER A 261 -1.400 2.016 -8.945 1.00 0.00 H ATOM 4001 H SER A 261 -1.263 3.084 -7.974 1.00 0.00 H ATOM 4002 N PHE A 262 2.010 2.800 -6.990 1.00 3.00 N ATOM 4003 CA PHE A 262 3.390 3.082 -6.683 1.00 3.00 C ATOM 4004 C PHE A 262 3.514 3.859 -5.364 1.00 6.88 C ATOM 4005 O PHE A 262 4.421 3.591 -4.591 1.00 3.75 O ATOM 4006 CB PHE A 262 4.025 3.940 -7.776 1.00 3.38 C ATOM 4007 CG PHE A 262 5.491 4.182 -7.534 1.00 7.97 C ATOM 4008 CD1 PHE A 262 6.383 3.121 -7.687 1.00 11.16 C ATOM 4009 CD2 PHE A 262 5.986 5.428 -7.157 1.00 12.13 C ATOM 4010 CE1 PHE A 262 7.752 3.270 -7.458 1.00 13.60 C ATOM 4011 CE2 PHE A 262 7.356 5.615 -6.930 1.00 13.57 C ATOM 4012 CZ PHE A 262 8.219 4.530 -7.090 1.00 5.36 C ATOM 4013 HA PHE A 262 3.898 2.121 -6.606 1.00 0.00 H ATOM 4014 HB2 PHE A 262 3.907 3.432 -8.733 1.00 0.00 H ATOM 4015 HB3 PHE A 262 3.512 4.901 -7.810 1.00 0.00 H ATOM 4016 HD2 PHE A 262 5.300 6.267 -7.037 1.00 0.00 H ATOM 4017 HE2 PHE A 262 7.741 6.591 -6.634 1.00 0.00 H ATOM 4018 HZ PHE A 262 9.287 4.672 -6.923 1.00 0.00 H ATOM 4019 HE1 PHE A 262 8.434 2.427 -7.564 1.00 0.00 H ATOM 4020 HD1 PHE A 262 6.000 2.148 -7.994 1.00 0.00 H ATOM 4021 H PHE A 262 1.562 3.291 -7.790 1.00 0.00 H ATOM 4022 N ALA A 263 2.618 4.833 -5.071 1.00 5.49 N ATOM 4023 CA ALA A 263 2.685 5.598 -3.803 1.00 5.43 C ATOM 4024 C ALA A 263 2.497 4.622 -2.621 1.00 8.74 C ATOM 4025 O ALA A 263 3.168 4.727 -1.601 1.00 6.65 O ATOM 4026 CB ALA A 263 1.563 6.646 -3.739 1.00 7.21 C ATOM 4027 HA ALA A 263 3.651 6.100 -3.751 1.00 0.00 H ATOM 4028 HB1 ALA A 263 1.666 7.339 -4.574 1.00 0.00 H ATOM 4029 HB2 ALA A 263 0.596 6.146 -3.798 1.00 0.00 H ATOM 4030 HB3 ALA A 263 1.633 7.194 -2.800 1.00 0.00 H ATOM 4031 H ALA A 263 1.864 5.049 -5.754 1.00 0.00 H ATOM 4032 N ALA A 264 1.568 3.656 -2.731 1.00 5.40 N ATOM 4033 CA ALA A 264 1.352 2.718 -1.640 1.00 3.41 C ATOM 4034 C ALA A 264 2.638 1.914 -1.521 1.00 6.41 C ATOM 4035 O ALA A 264 3.016 1.595 -0.412 1.00 3.56 O ATOM 4036 CB ALA A 264 0.186 1.774 -1.981 1.00 4.12 C ATOM 4037 HA ALA A 264 1.107 3.235 -0.712 1.00 0.00 H ATOM 4038 HB1 ALA A 264 -0.720 2.359 -2.136 1.00 0.00 H ATOM 4039 HB2 ALA A 264 0.422 1.220 -2.890 1.00 0.00 H ATOM 4040 HB3 ALA A 264 0.033 1.076 -1.158 1.00 0.00 H ATOM 4041 H ALA A 264 1.001 3.579 -3.600 1.00 0.00 H ATOM 4042 N ALA A 265 3.331 1.606 -2.650 1.00 8.30 N ATOM 4043 CA ALA A 265 4.561 0.824 -2.566 1.00 4.39 C ATOM 4044 C ALA A 265 5.618 1.548 -1.784 1.00 4.91 C ATOM 4045 O ALA A 265 6.421 0.985 -1.055 1.00 6.68 O ATOM 4046 CB ALA A 265 5.061 0.437 -3.966 1.00 4.48 C ATOM 4047 HA ALA A 265 4.336 -0.097 -2.028 1.00 0.00 H ATOM 4048 HB1 ALA A 265 4.300 -0.159 -4.470 1.00 0.00 H ATOM 4049 HB2 ALA A 265 5.258 1.341 -4.543 1.00 0.00 H ATOM 4050 HB3 ALA A 265 5.978 -0.145 -3.875 1.00 0.00 H ATOM 4051 H ALA A 265 2.984 1.928 -3.576 1.00 0.00 H ATOM 4052 N MET A 266 5.591 2.858 -1.951 1.00 3.00 N ATOM 4053 CA MET A 266 6.564 3.706 -1.272 1.00 3.00 C ATOM 4054 C MET A 266 6.346 3.740 0.236 1.00 3.07 C ATOM 4055 O MET A 266 7.308 3.875 1.009 1.00 6.71 O ATOM 4056 CB MET A 266 6.674 5.131 -1.788 1.00 3.00 C ATOM 4057 CG MET A 266 7.183 5.338 -3.214 1.00 5.55 C ATOM 4058 SD MET A 266 8.824 4.625 -3.421 1.00 8.05 S ATOM 4059 CE MET A 266 8.478 2.940 -3.945 1.00 9.12 C ATOM 4060 HA MET A 266 7.511 3.220 -1.508 1.00 0.00 H ATOM 4061 HB2 MET A 266 5.680 5.575 -1.730 1.00 0.00 H ATOM 4062 HB3 MET A 266 7.349 5.667 -1.121 1.00 0.00 H ATOM 4063 HG2 MET A 266 7.229 6.406 -3.425 1.00 0.00 H ATOM 4064 HG3 MET A 266 6.495 4.860 -3.912 1.00 0.00 H ATOM 4065 HE1 MET A 266 7.897 2.433 -3.174 1.00 0.00 H ATOM 4066 HE2 MET A 266 7.911 2.959 -4.876 1.00 0.00 H ATOM 4067 HE3 MET A 266 9.417 2.409 -4.101 1.00 0.00 H ATOM 4068 H MET A 266 4.873 3.287 -2.569 1.00 0.00 H ATOM 4069 N ASN A 267 5.130 3.647 0.666 1.00 3.00 N ATOM 4070 CA ASN A 267 4.889 3.674 2.107 1.00 3.16 C ATOM 4071 C ASN A 267 5.431 2.378 2.692 1.00 6.60 C ATOM 4072 O ASN A 267 5.823 2.393 3.856 1.00 8.76 O ATOM 4073 CB ASN A 267 3.359 3.739 2.322 1.00 3.00 C ATOM 4074 CG ASN A 267 2.891 5.194 2.231 1.00 6.23 C ATOM 4075 OD1 ASN A 267 1.759 5.514 2.669 1.00 17.35 O ATOM 4076 ND2 ASN A 267 3.785 6.074 1.769 1.00 4.43 N ATOM 4077 HA ASN A 267 5.372 4.527 2.584 1.00 0.00 H ATOM 4078 HB2 ASN A 267 2.859 3.148 1.555 1.00 0.00 H ATOM 4079 HB3 ASN A 267 3.113 3.339 3.306 1.00 0.00 H ATOM 4080 HD22 ASN A 267 4.707 5.744 1.419 1.00 0.00 H ATOM 4081 HD21 ASN A 267 3.558 7.089 1.759 1.00 0.00 H ATOM 4082 H ASN A 267 4.338 3.555 -0.002 1.00 0.00 H ATOM 4083 N GLY A 268 5.441 1.274 1.918 1.00 5.06 N ATOM 4084 CA GLY A 268 5.992 -0.016 2.375 1.00 3.00 C ATOM 4085 C GLY A 268 7.533 0.078 2.340 1.00 3.00 C ATOM 4086 O GLY A 268 8.268 -0.371 3.219 1.00 5.67 O ATOM 4087 HA3 GLY A 268 5.656 -0.816 1.715 1.00 0.00 H ATOM 4088 HA2 GLY A 268 5.658 -0.221 3.392 1.00 0.00 H ATOM 4089 H GLY A 268 5.044 1.334 0.959 1.00 0.00 H ATOM 4090 N LEU A 269 8.135 0.700 1.298 1.00 6.33 N ATOM 4091 CA LEU A 269 9.616 0.864 1.214 1.00 4.40 C ATOM 4092 C LEU A 269 10.139 1.716 2.383 1.00 7.16 C ATOM 4093 O LEU A 269 11.303 1.603 2.818 1.00 5.29 O ATOM 4094 CB LEU A 269 9.980 1.474 -0.193 1.00 3.00 C ATOM 4095 CG LEU A 269 11.453 1.456 -0.623 1.00 4.80 C ATOM 4096 CD1 LEU A 269 11.926 -0.035 -0.846 1.00 3.00 C ATOM 4097 CD2 LEU A 269 11.733 2.266 -1.873 1.00 7.46 C ATOM 4098 HA LEU A 269 10.107 -0.105 1.303 1.00 0.00 H ATOM 4099 HB2 LEU A 269 9.416 0.920 -0.943 1.00 0.00 H ATOM 4100 HB3 LEU A 269 9.655 2.514 -0.190 1.00 0.00 H ATOM 4101 HG LEU A 269 12.014 1.925 0.186 1.00 0.00 H ATOM 4102 HD21 LEU A 269 11.148 1.867 -2.702 1.00 0.00 H ATOM 4103 HD22 LEU A 269 11.458 3.306 -1.700 1.00 0.00 H ATOM 4104 HD23 LEU A 269 12.794 2.205 -2.114 1.00 0.00 H ATOM 4105 HD11 LEU A 269 11.814 -0.593 0.083 1.00 0.00 H ATOM 4106 HD12 LEU A 269 11.317 -0.496 -1.624 1.00 0.00 H ATOM 4107 HD13 LEU A 269 12.972 -0.041 -1.151 1.00 0.00 H ATOM 4108 H LEU A 269 7.544 1.077 0.529 1.00 0.00 H ATOM 4109 N ALA A 270 9.289 2.596 2.945 1.00 3.03 N ATOM 4110 CA ALA A 270 9.702 3.441 4.062 1.00 10.90 C ATOM 4111 C ALA A 270 9.719 2.697 5.384 1.00 3.98 C ATOM 4112 O ALA A 270 10.025 3.325 6.400 1.00 7.81 O ATOM 4113 CB ALA A 270 8.759 4.617 4.159 1.00 7.53 C ATOM 4114 HA ALA A 270 10.722 3.772 3.868 1.00 0.00 H ATOM 4115 HB1 ALA A 270 8.795 5.188 3.231 1.00 0.00 H ATOM 4116 HB2 ALA A 270 7.744 4.255 4.325 1.00 0.00 H ATOM 4117 HB3 ALA A 270 9.059 5.254 4.991 1.00 0.00 H ATOM 4118 H ALA A 270 8.320 2.675 2.577 1.00 0.00 H ATOM 4119 N GLY A 271 9.432 1.398 5.389 1.00 3.00 N ATOM 4120 CA GLY A 271 9.482 0.746 6.701 1.00 4.41 C ATOM 4121 C GLY A 271 10.941 0.405 6.992 1.00 5.93 C ATOM 4122 O GLY A 271 11.712 0.074 6.117 1.00 8.16 O ATOM 4123 HA3 GLY A 271 8.883 -0.164 6.687 1.00 0.00 H ATOM 4124 HA2 GLY A 271 9.098 1.420 7.466 1.00 0.00 H ATOM 4125 H GLY A 271 9.189 0.880 4.521 1.00 0.00 H ATOM 4126 N PRO A 272 11.374 0.447 8.267 1.00 4.32 N ATOM 4127 CA PRO A 272 12.731 0.151 8.710 1.00 5.32 C ATOM 4128 C PRO A 272 13.307 -1.227 8.372 1.00 6.53 C ATOM 4129 O PRO A 272 14.509 -1.428 8.224 1.00 7.26 O ATOM 4130 CB PRO A 272 12.636 0.275 10.236 1.00 10.79 C ATOM 4131 CG PRO A 272 11.488 1.197 10.553 1.00 10.74 C ATOM 4132 CD PRO A 272 10.556 1.054 9.340 1.00 3.00 C ATOM 4133 HA PRO A 272 13.410 0.829 8.192 1.00 0.00 H ATOM 4134 HD3 PRO A 272 9.712 0.409 9.584 1.00 0.00 H ATOM 4135 HD2 PRO A 272 10.187 2.031 9.028 1.00 0.00 H ATOM 4136 HG3 PRO A 272 11.833 2.225 10.658 1.00 0.00 H ATOM 4137 HG2 PRO A 272 10.984 0.889 11.469 1.00 0.00 H ATOM 4138 HB2 PRO A 272 12.457 -0.705 10.677 1.00 0.00 H ATOM 4139 HB3 PRO A 272 13.564 0.687 10.633 1.00 0.00 H ATOM 4140 N LEU A 273 12.436 -2.180 8.217 1.00 3.00 N ATOM 4141 CA LEU A 273 12.753 -3.568 7.876 1.00 3.00 C ATOM 4142 C LEU A 273 12.849 -3.724 6.341 1.00 16.49 C ATOM 4143 O LEU A 273 13.269 -4.798 5.882 1.00 7.89 O ATOM 4144 CB LEU A 273 11.704 -4.573 8.407 1.00 3.56 C ATOM 4145 CG LEU A 273 11.499 -4.600 9.924 1.00 7.39 C ATOM 4146 CD1 LEU A 273 10.684 -5.876 10.241 1.00 5.01 C ATOM 4147 CD2 LEU A 273 12.908 -4.741 10.519 1.00 3.99 C ATOM 4148 HA LEU A 273 13.707 -3.794 8.353 1.00 0.00 H ATOM 4149 HB2 LEU A 273 10.747 -4.329 7.946 1.00 0.00 H ATOM 4150 HB3 LEU A 273 12.012 -5.571 8.095 1.00 0.00 H ATOM 4151 HG LEU A 273 10.986 -3.721 10.314 1.00 0.00 H ATOM 4152 HD21 LEU A 273 13.362 -5.664 10.159 1.00 0.00 H ATOM 4153 HD22 LEU A 273 13.517 -3.891 10.212 1.00 0.00 H ATOM 4154 HD23 LEU A 273 12.841 -4.767 11.607 1.00 0.00 H ATOM 4155 HD11 LEU A 273 9.727 -5.833 9.721 1.00 0.00 H ATOM 4156 HD12 LEU A 273 11.240 -6.753 9.909 1.00 0.00 H ATOM 4157 HD13 LEU A 273 10.512 -5.938 11.316 1.00 0.00 H ATOM 4158 H LEU A 273 11.433 -1.937 8.346 1.00 0.00 H ATOM 4159 N HIS A 274 12.468 -2.685 5.560 1.00 5.33 N ATOM 4160 CA HIS A 274 12.570 -2.735 4.083 1.00 3.00 C ATOM 4161 C HIS A 274 13.602 -1.692 3.646 1.00 5.76 C ATOM 4162 O HIS A 274 14.695 -1.598 4.152 1.00 3.65 O ATOM 4163 CB HIS A 274 11.171 -2.591 3.439 1.00 3.01 C ATOM 4164 CG HIS A 274 11.058 -2.930 1.997 1.00 3.00 C ATOM 4165 ND1 HIS A 274 12.110 -3.530 1.294 1.00 5.09 N ATOM 4166 CD2 HIS A 274 10.072 -2.712 1.153 1.00 5.31 C ATOM 4167 CE1 HIS A 274 11.729 -3.729 0.045 1.00 3.71 C ATOM 4168 NE2 HIS A 274 10.501 -3.216 -0.072 1.00 3.00 N ATOM 4169 HA HIS A 274 12.928 -3.702 3.730 1.00 0.00 H ATOM 4170 HB2 HIS A 274 10.488 -3.242 3.985 1.00 0.00 H ATOM 4171 HB3 HIS A 274 10.858 -1.554 3.560 1.00 0.00 H ATOM 4172 HD2 HIS A 274 9.116 -2.235 1.369 1.00 0.00 H ATOM 4173 HE1 HIS A 274 12.306 -4.218 -0.740 1.00 0.00 H ATOM 4174 H HIS A 274 12.093 -1.826 6.011 1.00 0.00 H ATOM 4175 N GLY A 275 13.278 -0.843 2.709 1.00 3.48 N ATOM 4176 CA GLY A 275 14.190 0.153 2.192 1.00 3.45 C ATOM 4177 C GLY A 275 14.703 1.213 3.132 1.00 8.07 C ATOM 4178 O GLY A 275 15.796 1.715 2.857 1.00 7.66 O ATOM 4179 HA3 GLY A 275 13.679 0.665 1.376 1.00 0.00 H ATOM 4180 HA2 GLY A 275 15.058 -0.377 1.800 1.00 0.00 H ATOM 4181 H GLY A 275 12.317 -0.885 2.315 1.00 0.00 H ATOM 4182 N LEU A 276 13.949 1.524 4.208 1.00 4.72 N ATOM 4183 CA LEU A 276 14.497 2.546 5.086 1.00 3.00 C ATOM 4184 C LEU A 276 15.776 2.073 5.743 1.00 8.66 C ATOM 4185 O LEU A 276 16.494 2.867 6.359 1.00 3.35 O ATOM 4186 CB LEU A 276 13.421 2.921 6.113 1.00 6.86 C ATOM 4187 CG LEU A 276 13.607 4.318 6.743 1.00 8.60 C ATOM 4188 CD1 LEU A 276 13.064 5.416 5.816 1.00 8.73 C ATOM 4189 CD2 LEU A 276 12.905 4.342 8.090 1.00 5.82 C ATOM 4190 HA LEU A 276 14.765 3.432 4.511 1.00 0.00 H ATOM 4191 HB2 LEU A 276 12.451 2.896 5.617 1.00 0.00 H ATOM 4192 HB3 LEU A 276 13.438 2.180 6.912 1.00 0.00 H ATOM 4193 HG LEU A 276 14.669 4.516 6.885 1.00 0.00 H ATOM 4194 HD21 LEU A 276 11.844 4.137 7.949 1.00 0.00 H ATOM 4195 HD22 LEU A 276 13.340 3.582 8.739 1.00 0.00 H ATOM 4196 HD23 LEU A 276 13.029 5.324 8.546 1.00 0.00 H ATOM 4197 HD11 LEU A 276 13.599 5.386 4.867 1.00 0.00 H ATOM 4198 HD12 LEU A 276 12.001 5.249 5.641 1.00 0.00 H ATOM 4199 HD13 LEU A 276 13.208 6.389 6.285 1.00 0.00 H ATOM 4200 H LEU A 276 13.036 1.063 4.397 1.00 0.00 H ATOM 4201 N ALA A 277 16.094 0.768 5.640 1.00 9.98 N ATOM 4202 CA ALA A 277 17.317 0.267 6.246 1.00 6.44 C ATOM 4203 C ALA A 277 18.518 0.973 5.663 1.00 13.28 C ATOM 4204 O ALA A 277 19.576 1.037 6.280 1.00 6.02 O ATOM 4205 CB ALA A 277 17.494 -1.228 5.956 1.00 6.34 C ATOM 4206 HA ALA A 277 17.242 0.443 7.319 1.00 0.00 H ATOM 4207 HB1 ALA A 277 16.647 -1.779 6.365 1.00 0.00 H ATOM 4208 HB2 ALA A 277 17.545 -1.384 4.878 1.00 0.00 H ATOM 4209 HB3 ALA A 277 18.416 -1.580 6.419 1.00 0.00 H ATOM 4210 H ALA A 277 15.464 0.119 5.127 1.00 0.00 H ATOM 4211 N ASN A 278 18.436 1.524 4.428 1.00 7.70 N ATOM 4212 CA ASN A 278 19.623 2.191 3.850 1.00 5.70 C ATOM 4213 C ASN A 278 19.989 3.448 4.649 1.00 7.15 C ATOM 4214 O ASN A 278 21.138 3.816 4.795 1.00 10.46 O ATOM 4215 CB ASN A 278 19.638 2.335 2.293 1.00 7.11 C ATOM 4216 CG ASN A 278 18.648 3.262 1.586 1.00 11.44 C ATOM 4217 OD1 ASN A 278 18.642 3.373 0.314 1.00 12.09 O ATOM 4218 ND2 ASN A 278 17.925 4.037 2.352 1.00 3.00 N ATOM 4219 HA ASN A 278 20.456 1.499 3.976 1.00 0.00 H ATOM 4220 HB2 ASN A 278 20.636 2.679 2.021 1.00 0.00 H ATOM 4221 HB3 ASN A 278 19.476 1.337 1.886 1.00 0.00 H ATOM 4222 HD22 ASN A 278 17.953 3.920 3.385 1.00 0.00 H ATOM 4223 HD21 ASN A 278 17.322 4.771 1.928 1.00 0.00 H ATOM 4224 H ASN A 278 17.546 1.478 3.891 1.00 0.00 H ATOM 4225 N GLN A 279 18.964 4.084 5.185 1.00 3.93 N ATOM 4226 CA GLN A 279 19.131 5.276 6.028 1.00 3.97 C ATOM 4227 C GLN A 279 19.610 4.829 7.419 1.00 5.42 C ATOM 4228 O GLN A 279 20.526 5.448 8.020 1.00 6.15 O ATOM 4229 CB GLN A 279 17.759 5.939 6.217 1.00 3.00 C ATOM 4230 CG GLN A 279 17.691 6.871 7.438 1.00 5.77 C ATOM 4231 CD GLN A 279 16.243 7.208 7.717 1.00 12.28 C ATOM 4232 OE1 GLN A 279 15.639 7.874 6.917 1.00 6.99 O ATOM 4233 NE2 GLN A 279 15.634 6.726 8.812 1.00 8.17 N ATOM 4234 HA GLN A 279 19.841 5.960 5.564 1.00 0.00 H ATOM 4235 HB2 GLN A 279 17.531 6.522 5.325 1.00 0.00 H ATOM 4236 HB3 GLN A 279 17.011 5.156 6.338 1.00 0.00 H ATOM 4237 HG2 GLN A 279 18.124 6.372 8.305 1.00 0.00 H ATOM 4238 HG3 GLN A 279 18.247 7.786 7.232 1.00 0.00 H ATOM 4239 HE22 GLN A 279 16.169 6.152 9.494 1.00 0.00 H ATOM 4240 HE21 GLN A 279 14.627 6.927 8.978 1.00 0.00 H ATOM 4241 H GLN A 279 18.003 3.729 5.004 1.00 0.00 H ATOM 4242 N GLU A 280 18.957 3.798 7.939 1.00 3.33 N ATOM 4243 CA GLU A 280 19.235 3.215 9.258 1.00 3.00 C ATOM 4244 C GLU A 280 20.679 2.764 9.413 1.00 10.75 C ATOM 4245 O GLU A 280 21.280 2.882 10.483 1.00 7.81 O ATOM 4246 CB GLU A 280 18.347 2.011 9.665 1.00 10.54 C ATOM 4247 CG GLU A 280 16.848 2.410 9.825 1.00 5.11 C ATOM 4248 CD GLU A 280 16.557 3.319 10.994 1.00 10.84 C ATOM 4249 OE1 GLU A 280 16.650 3.004 12.164 1.00 19.44 O ATOM 4250 OE2 GLU A 280 16.417 4.555 10.621 1.00 11.88 O ATOM 4251 HA GLU A 280 19.003 4.051 9.918 1.00 0.00 H ATOM 4252 HB2 GLU A 280 18.425 1.242 8.897 1.00 0.00 H ATOM 4253 HB3 GLU A 280 18.708 1.614 10.614 1.00 0.00 H ATOM 4254 HG2 GLU A 280 16.533 2.918 8.913 1.00 0.00 H ATOM 4255 HG3 GLU A 280 16.265 1.497 9.951 1.00 0.00 H ATOM 4256 H GLU A 280 18.195 3.373 7.373 1.00 0.00 H ATOM 4257 N VAL A 281 21.209 2.216 8.346 1.00 10.93 N ATOM 4258 CA VAL A 281 22.616 1.734 8.365 1.00 3.17 C ATOM 4259 C VAL A 281 23.530 2.962 8.628 1.00 8.59 C ATOM 4260 O VAL A 281 24.409 2.937 9.482 1.00 8.02 O ATOM 4261 CB VAL A 281 23.020 1.065 7.013 1.00 5.61 C ATOM 4262 CG1 VAL A 281 24.512 0.871 7.013 1.00 12.35 C ATOM 4263 CG2 VAL A 281 22.345 -0.284 6.845 1.00 5.34 C ATOM 4264 HA VAL A 281 22.725 0.980 9.144 1.00 0.00 H ATOM 4265 HB VAL A 281 22.706 1.707 6.190 1.00 0.00 H ATOM 4266 HG11 VAL A 281 25.003 1.839 7.115 1.00 0.00 H ATOM 4267 HG12 VAL A 281 24.794 0.230 7.848 1.00 0.00 H ATOM 4268 HG13 VAL A 281 24.816 0.404 6.076 1.00 0.00 H ATOM 4269 HG21 VAL A 281 22.642 -0.942 7.662 1.00 0.00 H ATOM 4270 HG22 VAL A 281 21.263 -0.152 6.859 1.00 0.00 H ATOM 4271 HG23 VAL A 281 22.647 -0.724 5.894 1.00 0.00 H ATOM 4272 H VAL A 281 20.641 2.118 7.480 1.00 0.00 H ATOM 4273 N LEU A 282 23.331 4.073 7.893 1.00 4.57 N ATOM 4274 CA LEU A 282 24.152 5.268 8.095 1.00 13.27 C ATOM 4275 C LEU A 282 23.986 5.894 9.481 1.00 15.13 C ATOM 4276 O LEU A 282 24.964 6.359 10.097 1.00 15.60 O ATOM 4277 CB LEU A 282 23.836 6.347 7.053 1.00 9.32 C ATOM 4278 CG LEU A 282 25.061 6.629 6.205 1.00 18.59 C ATOM 4279 CD1 LEU A 282 26.220 6.949 7.131 1.00 29.29 C ATOM 4280 CD2 LEU A 282 25.445 5.379 5.453 1.00 20.38 C ATOM 4281 HA LEU A 282 25.180 4.920 7.991 1.00 0.00 H ATOM 4282 HB2 LEU A 282 23.025 6.002 6.412 1.00 0.00 H ATOM 4283 HB3 LEU A 282 23.531 7.262 7.562 1.00 0.00 H ATOM 4284 HG LEU A 282 24.846 7.449 5.520 1.00 0.00 H ATOM 4285 HD21 LEU A 282 25.668 4.583 6.164 1.00 0.00 H ATOM 4286 HD22 LEU A 282 24.618 5.074 4.811 1.00 0.00 H ATOM 4287 HD23 LEU A 282 26.326 5.580 4.843 1.00 0.00 H ATOM 4288 HD11 LEU A 282 25.972 7.824 7.732 1.00 0.00 H ATOM 4289 HD12 LEU A 282 26.406 6.097 7.785 1.00 0.00 H ATOM 4290 HD13 LEU A 282 27.111 7.155 6.538 1.00 0.00 H ATOM 4291 H LEU A 282 22.583 4.082 7.171 1.00 0.00 H ATOM 4292 N LEU A 283 22.764 5.917 9.997 1.00 12.69 N ATOM 4293 CA LEU A 283 22.545 6.480 11.321 1.00 10.93 C ATOM 4294 C LEU A 283 23.269 5.608 12.391 1.00 20.32 C ATOM 4295 O LEU A 283 23.823 6.133 13.367 1.00 14.21 O ATOM 4296 CB LEU A 283 21.067 6.616 11.676 1.00 14.99 C ATOM 4297 CG LEU A 283 20.242 7.543 10.789 1.00 17.41 C ATOM 4298 CD1 LEU A 283 18.745 7.448 11.144 1.00 11.32 C ATOM 4299 CD2 LEU A 283 20.761 8.951 11.021 1.00 17.14 C ATOM 4300 HA LEU A 283 22.961 7.488 11.310 1.00 0.00 H ATOM 4301 HB2 LEU A 283 20.620 5.623 11.626 1.00 0.00 H ATOM 4302 HB3 LEU A 283 21.004 6.990 12.698 1.00 0.00 H ATOM 4303 HG LEU A 283 20.338 7.263 9.740 1.00 0.00 H ATOM 4304 HD21 LEU A 283 20.640 9.213 12.072 1.00 0.00 H ATOM 4305 HD22 LEU A 283 21.816 8.997 10.753 1.00 0.00 H ATOM 4306 HD23 LEU A 283 20.197 9.651 10.404 1.00 0.00 H ATOM 4307 HD11 LEU A 283 18.403 6.423 10.998 1.00 0.00 H ATOM 4308 HD12 LEU A 283 18.601 7.736 12.185 1.00 0.00 H ATOM 4309 HD13 LEU A 283 18.177 8.118 10.499 1.00 0.00 H ATOM 4310 H LEU A 283 21.963 5.533 9.456 1.00 0.00 H ATOM 4311 N TRP A 284 23.279 4.264 12.213 1.00 16.27 N ATOM 4312 CA TRP A 284 23.922 3.281 13.112 1.00 12.51 C ATOM 4313 C TRP A 284 25.435 3.440 13.065 1.00 8.47 C ATOM 4314 O TRP A 284 26.110 3.401 14.087 1.00 17.13 O ATOM 4315 CB TRP A 284 23.469 1.913 12.654 1.00 13.02 C ATOM 4316 CG TRP A 284 23.815 0.850 13.626 1.00 15.26 C ATOM 4317 CD1 TRP A 284 23.220 0.560 14.802 1.00 18.51 C ATOM 4318 CD2 TRP A 284 24.881 -0.090 13.452 1.00 14.16 C ATOM 4319 NE1 TRP A 284 23.856 -0.527 15.371 1.00 13.82 N ATOM 4320 CE2 TRP A 284 24.886 -0.930 14.571 1.00 15.23 C ATOM 4321 CE3 TRP A 284 25.809 -0.286 12.443 1.00 16.67 C ATOM 4322 CZ2 TRP A 284 25.816 -1.972 14.701 1.00 16.20 C ATOM 4323 CZ3 TRP A 284 26.730 -1.304 12.574 1.00 25.05 C ATOM 4324 CH2 TRP A 284 26.735 -2.148 13.688 1.00 20.00 C ATOM 4325 HA TRP A 284 23.635 3.431 14.153 1.00 0.00 H ATOM 4326 HB2 TRP A 284 22.387 1.928 12.521 1.00 0.00 H ATOM 4327 HB3 TRP A 284 23.947 1.686 11.701 1.00 0.00 H ATOM 4328 HE1 TRP A 284 23.590 -0.971 16.273 1.00 0.00 H ATOM 4329 HD1 TRP A 284 22.375 1.096 15.233 1.00 0.00 H ATOM 4330 HZ2 TRP A 284 25.812 -2.622 15.576 1.00 0.00 H ATOM 4331 HH2 TRP A 284 27.470 -2.950 13.757 1.00 0.00 H ATOM 4332 HZ3 TRP A 284 27.472 -1.454 11.790 1.00 0.00 H ATOM 4333 HE3 TRP A 284 25.811 0.353 11.560 1.00 0.00 H ATOM 4334 H TRP A 284 22.793 3.892 11.372 1.00 0.00 H ATOM 4335 N LEU A 285 25.964 3.636 11.864 1.00 6.66 N ATOM 4336 CA LEU A 285 27.377 3.839 11.632 1.00 6.62 C ATOM 4337 C LEU A 285 27.795 5.143 12.252 1.00 16.92 C ATOM 4338 O LEU A 285 28.831 5.233 12.871 1.00 18.99 O ATOM 4339 CB LEU A 285 27.802 3.842 10.175 1.00 11.61 C ATOM 4340 CG LEU A 285 27.690 2.521 9.436 1.00 17.76 C ATOM 4341 CD1 LEU A 285 28.089 2.776 7.984 1.00 17.57 C ATOM 4342 CD2 LEU A 285 28.627 1.468 9.972 1.00 12.10 C ATOM 4343 HA LEU A 285 27.870 2.980 12.088 1.00 0.00 H ATOM 4344 HB2 LEU A 285 27.183 4.569 9.650 1.00 0.00 H ATOM 4345 HB3 LEU A 285 28.844 4.158 10.134 1.00 0.00 H ATOM 4346 HG LEU A 285 26.668 2.159 9.552 1.00 0.00 H ATOM 4347 HD21 LEU A 285 29.655 1.816 9.877 1.00 0.00 H ATOM 4348 HD22 LEU A 285 28.400 1.282 11.022 1.00 0.00 H ATOM 4349 HD23 LEU A 285 28.500 0.547 9.403 1.00 0.00 H ATOM 4350 HD11 LEU A 285 27.418 3.516 7.549 1.00 0.00 H ATOM 4351 HD12 LEU A 285 29.113 3.148 7.950 1.00 0.00 H ATOM 4352 HD13 LEU A 285 28.020 1.845 7.421 1.00 0.00 H ATOM 4353 H LEU A 285 25.326 3.644 11.043 1.00 0.00 H ATOM 4354 N SER A 286 26.980 6.183 12.081 1.00 13.71 N ATOM 4355 CA SER A 286 27.298 7.497 12.676 1.00 20.30 C ATOM 4356 C SER A 286 27.352 7.481 14.201 1.00 18.82 C ATOM 4357 O SER A 286 28.155 8.180 14.780 1.00 22.02 O ATOM 4358 CB SER A 286 26.293 8.552 12.241 1.00 16.15 C ATOM 4359 OG SER A 286 26.419 8.603 10.848 1.00 22.33 O ATOM 4360 HA SER A 286 28.294 7.741 12.308 1.00 0.00 H ATOM 4361 HB2 SER A 286 26.532 9.518 12.685 1.00 0.00 H ATOM 4362 HB3 SER A 286 25.282 8.262 12.526 1.00 0.00 H ATOM 4363 HG SER A 286 26.210 7.714 10.466 1.00 0.00 H ATOM 4364 H SER A 286 26.110 6.068 11.522 1.00 0.00 H ATOM 4365 N GLN A 287 26.490 6.712 14.882 1.00 18.90 N ATOM 4366 CA GLN A 287 26.472 6.612 16.337 1.00 15.59 C ATOM 4367 C GLN A 287 27.670 5.761 16.752 1.00 30.53 C ATOM 4368 O GLN A 287 28.224 5.851 17.853 1.00 25.20 O ATOM 4369 CB GLN A 287 25.308 5.742 16.770 1.00 25.58 C ATOM 4370 CG GLN A 287 24.384 6.349 17.805 1.00 66.72 C ATOM 4371 CD GLN A 287 23.288 6.859 16.936 1.00 80.00 C ATOM 4372 OE1 GLN A 287 23.551 7.787 16.156 1.00 80.00 O ATOM 4373 NE2 GLN A 287 22.294 5.988 16.767 1.00 80.00 N ATOM 4374 HA GLN A 287 26.444 7.619 16.754 1.00 0.00 H ATOM 4375 HB2 GLN A 287 24.715 5.511 15.885 1.00 0.00 H ATOM 4376 HB3 GLN A 287 25.715 4.819 17.184 1.00 0.00 H ATOM 4377 HG2 GLN A 287 24.022 5.600 18.509 1.00 0.00 H ATOM 4378 HG3 GLN A 287 24.870 7.156 18.353 1.00 0.00 H ATOM 4379 HE22 GLN A 287 22.137 5.236 17.468 1.00 0.00 H ATOM 4380 HE21 GLN A 287 21.675 6.061 15.935 1.00 0.00 H ATOM 4381 H GLN A 287 25.796 6.156 14.343 1.00 0.00 H ATOM 4382 N LEU A 288 28.049 4.874 15.834 1.00 20.36 N ATOM 4383 CA LEU A 288 29.160 3.987 16.090 1.00 14.84 C ATOM 4384 C LEU A 288 30.446 4.780 16.212 1.00 24.20 C ATOM 4385 O LEU A 288 31.122 4.779 17.222 1.00 19.75 O ATOM 4386 CB LEU A 288 29.226 2.944 14.977 1.00 15.03 C ATOM 4387 CG LEU A 288 30.141 1.794 15.334 1.00 25.51 C ATOM 4388 CD1 LEU A 288 29.772 0.559 14.501 1.00 25.69 C ATOM 4389 CD2 LEU A 288 31.589 2.219 15.071 1.00 22.85 C ATOM 4390 HA LEU A 288 29.019 3.466 17.037 1.00 0.00 H ATOM 4391 HB2 LEU A 288 28.224 2.555 14.799 1.00 0.00 H ATOM 4392 HB3 LEU A 288 29.596 3.420 14.069 1.00 0.00 H ATOM 4393 HG LEU A 288 30.030 1.536 16.387 1.00 0.00 H ATOM 4394 HD21 LEU A 288 31.706 2.473 14.017 1.00 0.00 H ATOM 4395 HD22 LEU A 288 31.828 3.088 15.684 1.00 0.00 H ATOM 4396 HD23 LEU A 288 32.259 1.398 15.325 1.00 0.00 H ATOM 4397 HD11 LEU A 288 28.740 0.277 14.709 1.00 0.00 H ATOM 4398 HD12 LEU A 288 29.880 0.791 13.442 1.00 0.00 H ATOM 4399 HD13 LEU A 288 30.435 -0.266 14.763 1.00 0.00 H ATOM 4400 H LEU A 288 27.542 4.820 14.927 1.00 0.00 H ATOM 4401 N GLN A 289 30.753 5.458 15.126 1.00 24.57 N ATOM 4402 CA GLN A 289 31.935 6.283 15.013 1.00 27.16 C ATOM 4403 C GLN A 289 31.878 7.360 16.065 1.00 32.70 C ATOM 4404 O GLN A 289 32.886 7.914 16.460 1.00 32.17 O ATOM 4405 CB GLN A 289 31.935 7.009 13.674 1.00 29.93 C ATOM 4406 CG GLN A 289 32.445 6.123 12.533 1.00 40.56 C ATOM 4407 CD GLN A 289 32.649 6.991 11.313 1.00 80.00 C ATOM 4408 OE1 GLN A 289 33.602 6.779 10.532 1.00 73.44 O ATOM 4409 NE2 GLN A 289 31.799 8.029 11.230 1.00 80.00 N ATOM 4410 HA GLN A 289 32.813 5.646 15.118 1.00 0.00 H ATOM 4411 HB2 GLN A 289 30.917 7.324 13.446 1.00 0.00 H ATOM 4412 HB3 GLN A 289 32.577 7.887 13.751 1.00 0.00 H ATOM 4413 HG2 GLN A 289 33.390 5.661 12.819 1.00 0.00 H ATOM 4414 HG3 GLN A 289 31.713 5.345 12.314 1.00 0.00 H ATOM 4415 HE22 GLN A 289 31.031 8.129 11.924 1.00 0.00 H ATOM 4416 HE21 GLN A 289 31.909 8.732 10.472 1.00 0.00 H ATOM 4417 H GLN A 289 30.113 5.397 14.308 1.00 0.00 H ATOM 4418 N LYS A 290 30.683 7.654 16.538 1.00 31.96 N ATOM 4419 CA LYS A 290 30.584 8.681 17.551 1.00 27.93 C ATOM 4420 C LYS A 290 30.925 8.160 18.940 1.00 41.56 C ATOM 4421 O LYS A 290 31.648 8.800 19.706 1.00 46.52 O ATOM 4422 CB LYS A 290 29.281 9.469 17.494 1.00 26.83 C ATOM 4423 CG LYS A 290 28.583 9.646 18.827 1.00 39.08 C ATOM 4424 CD LYS A 290 27.376 10.565 18.660 1.00 80.00 C ATOM 4425 CE LYS A 290 26.356 10.114 17.599 1.00 80.00 C ATOM 4426 NZ LYS A 290 25.857 11.157 16.669 1.00 80.00 N ATOM 4427 HA LYS A 290 31.354 9.414 17.312 1.00 0.00 H ATOM 4428 HB2 LYS A 290 29.501 10.458 17.093 1.00 0.00 H ATOM 4429 HB3 LYS A 290 28.599 8.948 16.821 1.00 0.00 H ATOM 4430 HG2 LYS A 290 28.251 8.675 19.194 1.00 0.00 H ATOM 4431 HG3 LYS A 290 29.277 10.086 19.544 1.00 0.00 H ATOM 4432 HD2 LYS A 290 26.862 10.626 19.619 1.00 0.00 H ATOM 4433 HD3 LYS A 290 27.740 11.554 18.381 1.00 0.00 H ATOM 4434 HE2 LYS A 290 25.495 9.699 18.123 1.00 0.00 H ATOM 4435 HE3 LYS A 290 26.825 9.334 17.000 1.00 0.00 H ATOM 4436 HZ1 LYS A 290 25.386 11.908 17.213 1.00 0.00 H ATOM 4437 HZ2 LYS A 290 26.657 11.559 16.140 1.00 0.00 H ATOM 4438 HZ3 LYS A 290 25.179 10.732 16.005 1.00 0.00 H ATOM 4439 H LYS A 290 29.835 7.161 16.192 1.00 0.00 H ATOM 4440 N ASP A 291 30.396 6.985 19.263 1.00 38.87 N ATOM 4441 CA ASP A 291 30.636 6.358 20.544 1.00 32.66 C ATOM 4442 C ASP A 291 32.081 5.911 20.581 1.00 49.60 C ATOM 4443 O ASP A 291 32.851 6.291 21.455 1.00 60.02 O ATOM 4444 CB ASP A 291 29.782 5.084 20.782 1.00 34.86 C ATOM 4445 CG ASP A 291 28.600 5.184 21.735 1.00 80.00 C ATOM 4446 OD1 ASP A 291 27.666 6.029 21.335 1.00 80.00 O ATOM 4447 OD2 ASP A 291 28.399 4.374 22.642 1.00 80.00 O ATOM 4448 HA ASP A 291 30.379 7.093 21.306 1.00 0.00 H ATOM 4449 HB2 ASP A 291 29.392 4.769 19.814 1.00 0.00 H ATOM 4450 HB3 ASP A 291 30.449 4.315 21.172 1.00 0.00 H ATOM 4451 H ASP A 291 29.789 6.500 18.572 1.00 0.00 H ATOM 4452 N LEU A 292 32.438 5.073 19.620 1.00 34.99 N ATOM 4453 CA LEU A 292 33.786 4.543 19.555 1.00 28.58 C ATOM 4454 C LEU A 292 34.847 5.396 18.898 1.00 43.03 C ATOM 4455 O LEU A 292 36.035 5.220 19.155 1.00 57.20 O ATOM 4456 CB LEU A 292 33.781 3.129 18.976 1.00 27.67 C ATOM 4457 CG LEU A 292 32.600 2.364 19.526 1.00 22.18 C ATOM 4458 CD1 LEU A 292 32.562 0.959 18.962 1.00 22.98 C ATOM 4459 CD2 LEU A 292 32.711 2.347 21.024 1.00 32.28 C ATOM 4460 HA LEU A 292 34.100 4.537 20.599 1.00 0.00 H ATOM 4461 HB2 LEU A 292 33.707 3.181 17.890 1.00 0.00 H ATOM 4462 HB3 LEU A 292 34.704 2.620 19.252 1.00 0.00 H ATOM 4463 HG LEU A 292 31.669 2.849 19.234 1.00 0.00 H ATOM 4464 HD21 LEU A 292 33.642 1.859 21.313 1.00 0.00 H ATOM 4465 HD22 LEU A 292 32.704 3.370 21.399 1.00 0.00 H ATOM 4466 HD23 LEU A 292 31.867 1.799 21.443 1.00 0.00 H ATOM 4467 HD11 LEU A 292 32.477 1.007 17.876 1.00 0.00 H ATOM 4468 HD12 LEU A 292 33.479 0.435 19.233 1.00 0.00 H ATOM 4469 HD13 LEU A 292 31.703 0.427 19.372 1.00 0.00 H ATOM 4470 H LEU A 292 31.741 4.791 18.901 1.00 0.00 H ATOM 4471 N GLY A 293 34.436 6.309 18.047 1.00 48.05 N ATOM 4472 CA GLY A 293 35.407 7.152 17.392 1.00 51.72 C ATOM 4473 C GLY A 293 36.189 6.410 16.315 1.00 72.76 C ATOM 4474 O GLY A 293 36.900 5.452 16.599 1.00 80.00 O ATOM 4475 HA3 GLY A 293 36.108 7.525 18.139 1.00 0.00 H ATOM 4476 HA2 GLY A 293 34.887 7.992 16.931 1.00 0.00 H ATOM 4477 H GLY A 293 33.422 6.423 17.848 1.00 0.00 H ATOM 4478 N ALA A 294 36.022 6.908 15.084 1.00 79.71 N ATOM 4479 CA ALA A 294 36.594 6.505 13.791 1.00 80.00 C ATOM 4480 C ALA A 294 37.287 5.156 13.623 1.00 80.00 C ATOM 4481 O ALA A 294 36.703 4.270 12.974 1.00 80.00 O ATOM 4482 CB ALA A 294 37.266 7.634 12.997 1.00 80.00 C ATOM 4483 HA ALA A 294 35.643 6.268 13.314 1.00 0.00 H ATOM 4484 HB1 ALA A 294 36.534 8.413 12.785 1.00 0.00 H ATOM 4485 HB2 ALA A 294 38.084 8.052 13.584 1.00 0.00 H ATOM 4486 HB3 ALA A 294 37.656 7.236 12.060 1.00 0.00 H ATOM 4487 H ALA A 294 35.375 7.721 15.033 1.00 0.00 H ATOM 4488 N ASP A 295 38.514 4.998 14.165 1.00 62.71 N ATOM 4489 CA ASP A 295 39.224 3.730 14.030 1.00 61.46 C ATOM 4490 C ASP A 295 39.040 2.812 15.251 1.00 67.40 C ATOM 4491 O ASP A 295 39.734 2.927 16.264 1.00 74.18 O ATOM 4492 CB ASP A 295 40.680 3.907 13.561 1.00 66.47 C ATOM 4493 CG ASP A 295 41.445 2.621 13.344 1.00 80.00 C ATOM 4494 OD1 ASP A 295 40.807 1.724 12.587 1.00 80.00 O ATOM 4495 OD2 ASP A 295 42.577 2.466 13.807 1.00 80.00 O ATOM 4496 HA ASP A 295 38.748 3.187 13.214 1.00 0.00 H ATOM 4497 HB2 ASP A 295 40.667 4.456 12.619 1.00 0.00 H ATOM 4498 HB3 ASP A 295 41.209 4.492 14.314 1.00 0.00 H ATOM 4499 H ASP A 295 38.956 5.785 14.682 1.00 0.00 H ATOM 4500 N ALA A 296 38.074 1.886 15.157 1.00 47.68 N ATOM 4501 CA ALA A 296 37.787 0.978 16.245 1.00 35.68 C ATOM 4502 C ALA A 296 38.428 -0.410 16.128 1.00 30.25 C ATOM 4503 O ALA A 296 38.719 -0.931 15.062 1.00 30.54 O ATOM 4504 CB ALA A 296 36.267 0.917 16.480 1.00 30.92 C ATOM 4505 HA ALA A 296 38.272 1.392 17.129 1.00 0.00 H ATOM 4506 HB1 ALA A 296 35.899 1.912 16.731 1.00 0.00 H ATOM 4507 HB2 ALA A 296 35.774 0.564 15.574 1.00 0.00 H ATOM 4508 HB3 ALA A 296 36.055 0.232 17.301 1.00 0.00 H ATOM 4509 H ALA A 296 37.518 1.820 14.281 1.00 0.00 H ATOM 4510 N SER A 297 38.654 -1.033 17.281 1.00 21.78 N ATOM 4511 CA SER A 297 39.224 -2.361 17.354 1.00 15.32 C ATOM 4512 C SER A 297 38.072 -3.301 17.104 1.00 20.54 C ATOM 4513 O SER A 297 36.908 -2.899 17.248 1.00 18.70 O ATOM 4514 CB SER A 297 39.779 -2.730 18.729 1.00 28.99 C ATOM 4515 OG SER A 297 38.838 -2.515 19.791 1.00 40.25 O ATOM 4516 HA SER A 297 40.049 -2.416 16.644 1.00 0.00 H ATOM 4517 HB2 SER A 297 40.664 -2.123 18.921 1.00 0.00 H ATOM 4518 HB3 SER A 297 40.058 -3.784 18.720 1.00 0.00 H ATOM 4519 HG SER A 297 39.252 -2.770 20.653 1.00 0.00 H ATOM 4520 H SER A 297 38.411 -0.546 18.167 1.00 0.00 H ATOM 4521 N ASP A 298 38.396 -4.516 16.729 1.00 19.75 N ATOM 4522 CA ASP A 298 37.352 -5.463 16.469 1.00 22.43 C ATOM 4523 C ASP A 298 36.577 -5.806 17.725 1.00 25.34 C ATOM 4524 O ASP A 298 35.360 -5.999 17.670 1.00 20.87 O ATOM 4525 CB ASP A 298 37.908 -6.745 15.833 1.00 27.44 C ATOM 4526 CG ASP A 298 38.441 -6.626 14.414 1.00 44.17 C ATOM 4527 OD1 ASP A 298 38.223 -5.503 13.748 1.00 28.15 O ATOM 4528 OD2 ASP A 298 38.966 -7.585 13.884 1.00 44.41 O ATOM 4529 HA ASP A 298 36.668 -4.990 15.765 1.00 0.00 H ATOM 4530 HB2 ASP A 298 38.723 -7.101 16.464 1.00 0.00 H ATOM 4531 HB3 ASP A 298 37.107 -7.484 15.825 1.00 0.00 H ATOM 4532 H ASP A 298 39.394 -4.787 16.622 1.00 0.00 H ATOM 4533 N GLU A 299 37.255 -5.890 18.866 1.00 24.25 N ATOM 4534 CA GLU A 299 36.591 -6.233 20.116 1.00 20.48 C ATOM 4535 C GLU A 299 35.590 -5.152 20.471 1.00 19.70 C ATOM 4536 O GLU A 299 34.508 -5.466 20.951 1.00 22.12 O ATOM 4537 CB GLU A 299 37.523 -6.582 21.286 1.00 27.12 C ATOM 4538 CG GLU A 299 38.905 -5.919 21.133 1.00 80.00 C ATOM 4539 CD GLU A 299 39.712 -6.490 19.990 1.00 80.00 C ATOM 4540 OE1 GLU A 299 39.672 -7.686 19.682 1.00 80.00 O ATOM 4541 OE2 GLU A 299 40.313 -5.550 19.277 1.00 80.00 O ATOM 4542 HA GLU A 299 36.068 -7.172 19.937 1.00 0.00 H ATOM 4543 HB2 GLU A 299 37.068 -6.239 22.215 1.00 0.00 H ATOM 4544 HB3 GLU A 299 37.652 -7.664 21.324 1.00 0.00 H ATOM 4545 HG2 GLU A 299 38.761 -4.853 20.958 1.00 0.00 H ATOM 4546 HG3 GLU A 299 39.463 -6.062 22.058 1.00 0.00 H ATOM 4547 H GLU A 299 38.279 -5.707 18.866 1.00 0.00 H ATOM 4548 N LYS A 300 35.914 -3.883 20.209 1.00 22.44 N ATOM 4549 CA LYS A 300 34.965 -2.827 20.512 1.00 21.19 C ATOM 4550 C LYS A 300 33.738 -2.867 19.587 1.00 16.09 C ATOM 4551 O LYS A 300 32.596 -2.636 20.035 1.00 19.77 O ATOM 4552 CB LYS A 300 35.627 -1.465 20.547 1.00 27.00 C ATOM 4553 CG LYS A 300 36.476 -1.360 21.814 1.00 38.16 C ATOM 4554 CD LYS A 300 36.217 -0.080 22.588 1.00 62.69 C ATOM 4555 CE LYS A 300 36.410 -0.223 24.091 1.00 68.46 C ATOM 4556 NZ LYS A 300 35.826 -1.464 24.607 1.00 80.00 N ATOM 4557 HA LYS A 300 34.591 -3.013 21.519 1.00 0.00 H ATOM 4558 HB2 LYS A 300 36.262 -1.344 19.669 1.00 0.00 H ATOM 4559 HB3 LYS A 300 34.864 -0.687 20.552 1.00 0.00 H ATOM 4560 HG2 LYS A 300 36.249 -2.209 22.458 1.00 0.00 H ATOM 4561 HG3 LYS A 300 37.529 -1.391 21.532 1.00 0.00 H ATOM 4562 HD2 LYS A 300 36.901 0.687 22.224 1.00 0.00 H ATOM 4563 HD3 LYS A 300 35.190 0.233 22.401 1.00 0.00 H ATOM 4564 HE2 LYS A 300 35.935 0.623 24.589 1.00 0.00 H ATOM 4565 HE3 LYS A 300 37.478 -0.219 24.310 1.00 0.00 H ATOM 4566 HZ1 LYS A 300 34.805 -1.474 24.409 1.00 0.00 H ATOM 4567 HZ2 LYS A 300 36.278 -2.278 24.143 1.00 0.00 H ATOM 4568 HZ3 LYS A 300 35.982 -1.518 25.634 1.00 0.00 H ATOM 4569 H LYS A 300 36.838 -3.653 19.791 1.00 0.00 H ATOM 4570 N LEU A 301 33.956 -3.195 18.292 1.00 20.50 N ATOM 4571 CA LEU A 301 32.874 -3.294 17.309 1.00 17.03 C ATOM 4572 C LEU A 301 31.963 -4.411 17.737 1.00 10.66 C ATOM 4573 O LEU A 301 30.747 -4.304 17.642 1.00 19.95 O ATOM 4574 CB LEU A 301 33.389 -3.763 15.947 1.00 21.49 C ATOM 4575 CG LEU A 301 34.172 -2.688 15.233 1.00 22.89 C ATOM 4576 CD1 LEU A 301 34.620 -3.229 13.877 1.00 16.08 C ATOM 4577 CD2 LEU A 301 33.233 -1.499 15.045 1.00 24.17 C ATOM 4578 HA LEU A 301 32.405 -2.312 17.244 1.00 0.00 H ATOM 4579 HB2 LEU A 301 34.035 -4.629 16.095 1.00 0.00 H ATOM 4580 HB3 LEU A 301 32.538 -4.047 15.328 1.00 0.00 H ATOM 4581 HG LEU A 301 35.054 -2.386 15.798 1.00 0.00 H ATOM 4582 HD21 LEU A 301 32.373 -1.807 14.451 1.00 0.00 H ATOM 4583 HD22 LEU A 301 32.896 -1.146 16.020 1.00 0.00 H ATOM 4584 HD23 LEU A 301 33.763 -0.697 14.531 1.00 0.00 H ATOM 4585 HD11 LEU A 301 35.247 -4.108 14.027 1.00 0.00 H ATOM 4586 HD12 LEU A 301 33.744 -3.503 13.289 1.00 0.00 H ATOM 4587 HD13 LEU A 301 35.187 -2.461 13.350 1.00 0.00 H ATOM 4588 H LEU A 301 34.931 -3.384 17.982 1.00 0.00 H ATOM 4589 N ARG A 302 32.569 -5.513 18.212 1.00 13.88 N ATOM 4590 CA ARG A 302 31.719 -6.631 18.651 1.00 13.88 C ATOM 4591 C ARG A 302 30.767 -6.200 19.816 1.00 16.83 C ATOM 4592 O ARG A 302 29.597 -6.512 19.860 1.00 14.55 O ATOM 4593 CB ARG A 302 32.582 -7.730 19.237 1.00 21.94 C ATOM 4594 CG ARG A 302 33.047 -8.874 18.378 1.00 22.65 C ATOM 4595 CD ARG A 302 33.099 -10.074 19.320 1.00 47.07 C ATOM 4596 NE ARG A 302 32.206 -11.193 18.965 1.00 80.00 N ATOM 4597 CZ ARG A 302 32.320 -11.960 17.861 1.00 80.00 C ATOM 4598 NH1 ARG A 302 33.274 -11.786 16.929 1.00 80.00 N ATOM 4599 NH2 ARG A 302 31.435 -12.943 17.684 1.00 80.00 N ATOM 4600 HA ARG A 302 31.154 -6.956 17.778 1.00 0.00 H ATOM 4601 HB2 ARG A 302 33.478 -7.249 19.629 1.00 0.00 H ATOM 4602 HB3 ARG A 302 32.016 -8.167 20.060 1.00 0.00 H ATOM 4603 HG2 ARG A 302 32.344 -9.054 17.565 1.00 0.00 H ATOM 4604 HG3 ARG A 302 34.034 -8.667 17.964 1.00 0.00 H ATOM 4605 HD2 ARG A 302 32.829 -9.731 20.319 1.00 0.00 H ATOM 4606 HD3 ARG A 302 34.122 -10.450 19.331 1.00 0.00 H ATOM 4607 HE ARG A 302 31.426 -11.408 19.618 1.00 0.00 H ATOM 4608 HH12 ARG A 302 33.310 -12.411 16.098 1.00 0.00 H ATOM 4609 HH11 ARG A 302 33.976 -11.027 17.039 1.00 0.00 H ATOM 4610 HH22 ARG A 302 31.496 -13.552 16.843 1.00 0.00 H ATOM 4611 HH21 ARG A 302 30.685 -13.100 18.387 1.00 0.00 H ATOM 4612 H ARG A 302 33.606 -5.573 18.267 1.00 0.00 H ATOM 4613 N ASP A 303 31.326 -5.491 20.782 1.00 16.26 N ATOM 4614 CA ASP A 303 30.649 -4.990 21.976 1.00 16.22 C ATOM 4615 C ASP A 303 29.473 -4.142 21.551 1.00 16.69 C ATOM 4616 O ASP A 303 28.365 -4.330 22.040 1.00 12.92 O ATOM 4617 CB ASP A 303 31.609 -4.108 22.790 1.00 13.50 C ATOM 4618 CG ASP A 303 32.583 -4.896 23.673 1.00 19.51 C ATOM 4619 OD1 ASP A 303 32.241 -6.145 23.970 1.00 28.88 O ATOM 4620 OD2 ASP A 303 33.527 -4.313 24.187 1.00 44.32 O ATOM 4621 HA ASP A 303 30.319 -5.834 22.582 1.00 0.00 H ATOM 4622 HB2 ASP A 303 32.190 -3.501 22.095 1.00 0.00 H ATOM 4623 HB3 ASP A 303 31.016 -3.456 23.431 1.00 0.00 H ATOM 4624 H ASP A 303 32.337 -5.270 20.683 1.00 0.00 H ATOM 4625 N TYR A 304 29.751 -3.240 20.629 1.00 16.44 N ATOM 4626 CA TYR A 304 28.749 -2.352 20.078 1.00 17.49 C ATOM 4627 C TYR A 304 27.598 -3.130 19.388 1.00 17.15 C ATOM 4628 O TYR A 304 26.441 -2.782 19.559 1.00 15.22 O ATOM 4629 CB TYR A 304 29.457 -1.346 19.140 1.00 21.31 C ATOM 4630 CG TYR A 304 28.540 -0.263 18.687 1.00 21.43 C ATOM 4631 CD1 TYR A 304 28.393 0.892 19.457 1.00 22.22 C ATOM 4632 CD2 TYR A 304 27.825 -0.414 17.499 1.00 29.11 C ATOM 4633 CE1 TYR A 304 27.512 1.887 19.028 1.00 17.35 C ATOM 4634 CE2 TYR A 304 26.949 0.573 17.055 1.00 22.25 C ATOM 4635 CZ TYR A 304 26.804 1.722 17.830 1.00 28.15 C ATOM 4636 OH TYR A 304 25.938 2.679 17.375 1.00 80.00 O ATOM 4637 HA TYR A 304 28.262 -1.797 20.879 1.00 0.00 H ATOM 4638 HB3 TYR A 304 29.829 -1.881 18.266 1.00 0.00 H ATOM 4639 HB2 TYR A 304 30.295 -0.897 19.673 1.00 0.00 H ATOM 4640 HD2 TYR A 304 27.954 -1.321 16.908 1.00 0.00 H ATOM 4641 HE2 TYR A 304 26.392 0.450 16.126 1.00 0.00 H ATOM 4642 HE1 TYR A 304 27.375 2.790 19.624 1.00 0.00 H ATOM 4643 HD1 TYR A 304 28.958 1.016 20.381 1.00 0.00 H ATOM 4644 HH TYR A 304 26.236 2.996 16.485 1.00 0.00 H ATOM 4645 H TYR A 304 30.729 -3.164 20.284 1.00 0.00 H ATOM 4646 N ILE A 305 27.883 -4.196 18.598 1.00 13.22 N ATOM 4647 CA ILE A 305 26.850 -4.987 17.936 1.00 9.29 C ATOM 4648 C ILE A 305 25.997 -5.684 18.978 1.00 15.16 C ATOM 4649 O ILE A 305 24.762 -5.728 18.922 1.00 13.05 O ATOM 4650 CB ILE A 305 27.519 -5.974 16.979 1.00 9.75 C ATOM 4651 CG1 ILE A 305 28.129 -5.115 15.856 1.00 7.87 C ATOM 4652 CG2 ILE A 305 26.423 -6.902 16.412 1.00 8.74 C ATOM 4653 CD1 ILE A 305 29.435 -5.673 15.320 1.00 11.91 C ATOM 4654 HA ILE A 305 26.189 -4.347 17.352 1.00 0.00 H ATOM 4655 HB ILE A 305 28.283 -6.587 17.458 1.00 0.00 H ATOM 4656 HG12 ILE A 305 27.414 -5.058 15.036 1.00 0.00 H ATOM 4657 HG13 ILE A 305 28.314 -4.114 16.246 1.00 0.00 H ATOM 4658 HD11 ILE A 305 30.165 -5.727 16.128 1.00 0.00 H ATOM 4659 HD12 ILE A 305 29.264 -6.671 14.916 1.00 0.00 H ATOM 4660 HD13 ILE A 305 29.811 -5.021 14.532 1.00 0.00 H ATOM 4661 HG21 ILE A 305 25.942 -7.437 17.231 1.00 0.00 H ATOM 4662 HG22 ILE A 305 25.682 -6.305 15.881 1.00 0.00 H ATOM 4663 HG23 ILE A 305 26.874 -7.618 15.725 1.00 0.00 H ATOM 4664 H ILE A 305 28.879 -4.460 18.458 1.00 0.00 H ATOM 4665 N TRP A 306 26.675 -6.231 19.990 1.00 12.81 N ATOM 4666 CA TRP A 306 25.980 -6.920 21.059 1.00 11.60 C ATOM 4667 C TRP A 306 25.048 -6.005 21.801 1.00 6.64 C ATOM 4668 O TRP A 306 23.923 -6.387 22.131 1.00 7.25 O ATOM 4669 CB TRP A 306 26.899 -7.678 22.034 1.00 15.90 C ATOM 4670 CG TRP A 306 27.217 -9.054 21.546 1.00 13.37 C ATOM 4671 CD1 TRP A 306 28.440 -9.488 21.113 1.00 19.71 C ATOM 4672 CD2 TRP A 306 26.304 -10.136 21.396 1.00 14.89 C ATOM 4673 NE1 TRP A 306 28.351 -10.801 20.727 1.00 23.82 N ATOM 4674 CE2 TRP A 306 27.045 -11.212 20.887 1.00 25.74 C ATOM 4675 CE3 TRP A 306 24.952 -10.296 21.649 1.00 19.95 C ATOM 4676 CZ2 TRP A 306 26.433 -12.438 20.632 1.00 19.88 C ATOM 4677 CZ3 TRP A 306 24.346 -11.502 21.403 1.00 23.33 C ATOM 4678 CH2 TRP A 306 25.086 -12.567 20.873 1.00 21.63 C ATOM 4679 HA TRP A 306 25.390 -7.686 20.555 1.00 0.00 H ATOM 4680 HB2 TRP A 306 27.829 -7.121 22.147 1.00 0.00 H ATOM 4681 HB3 TRP A 306 26.402 -7.753 23.001 1.00 0.00 H ATOM 4682 HE1 TRP A 306 29.135 -11.386 20.374 1.00 0.00 H ATOM 4683 HD1 TRP A 306 29.346 -8.883 21.080 1.00 0.00 H ATOM 4684 HZ2 TRP A 306 27.012 -13.278 20.249 1.00 0.00 H ATOM 4685 HH2 TRP A 306 24.587 -13.510 20.649 1.00 0.00 H ATOM 4686 HZ3 TRP A 306 23.286 -11.632 21.621 1.00 0.00 H ATOM 4687 HE3 TRP A 306 24.369 -9.464 22.044 1.00 0.00 H ATOM 4688 H TRP A 306 27.712 -6.162 20.011 1.00 0.00 H ATOM 4689 N ASN A 307 25.493 -4.787 22.052 1.00 6.19 N ATOM 4690 CA ASN A 307 24.611 -3.862 22.756 1.00 9.72 C ATOM 4691 C ASN A 307 23.291 -3.660 21.954 1.00 18.97 C ATOM 4692 O ASN A 307 22.220 -3.622 22.513 1.00 6.68 O ATOM 4693 CB ASN A 307 25.320 -2.526 22.991 1.00 11.93 C ATOM 4694 CG ASN A 307 24.366 -1.542 23.645 1.00 31.76 C ATOM 4695 OD1 ASN A 307 23.759 -0.683 22.963 1.00 24.17 O ATOM 4696 ND2 ASN A 307 24.163 -1.701 24.940 1.00 11.69 N ATOM 4697 HA ASN A 307 24.357 -4.286 23.727 1.00 0.00 H ATOM 4698 HB2 ASN A 307 26.180 -2.683 23.642 1.00 0.00 H ATOM 4699 HB3 ASN A 307 25.657 -2.123 22.036 1.00 0.00 H ATOM 4700 HD22 ASN A 307 24.691 -2.428 25.464 1.00 0.00 H ATOM 4701 HD21 ASN A 307 23.475 -1.099 25.436 1.00 0.00 H ATOM 4702 H ASN A 307 26.446 -4.495 21.756 1.00 0.00 H ATOM 4703 N THR A 308 23.375 -3.537 20.619 1.00 10.29 N ATOM 4704 CA THR A 308 22.167 -3.366 19.809 1.00 8.99 C ATOM 4705 C THR A 308 21.298 -4.590 19.955 1.00 6.30 C ATOM 4706 O THR A 308 20.097 -4.489 20.179 1.00 8.95 O ATOM 4707 CB THR A 308 22.638 -3.223 18.343 1.00 7.84 C ATOM 4708 OG1 THR A 308 23.354 -2.021 18.182 1.00 14.33 O ATOM 4709 CG2 THR A 308 21.499 -3.323 17.332 1.00 9.88 C ATOM 4710 HA THR A 308 21.590 -2.495 20.120 1.00 0.00 H ATOM 4711 HB THR A 308 23.296 -4.067 18.135 1.00 0.00 H ATOM 4712 HG1 THR A 308 24.144 -2.026 18.779 1.00 0.00 H ATOM 4713 HG23 THR A 308 20.964 -4.261 17.481 1.00 0.00 H ATOM 4714 HG21 THR A 308 20.814 -2.487 17.474 1.00 0.00 H ATOM 4715 HG22 THR A 308 21.908 -3.292 16.322 1.00 0.00 H ATOM 4716 H THR A 308 24.306 -3.563 20.157 1.00 0.00 H ATOM 4717 N LEU A 309 21.908 -5.767 19.801 1.00 3.74 N ATOM 4718 CA LEU A 309 21.147 -6.997 19.892 1.00 9.90 C ATOM 4719 C LEU A 309 20.467 -7.178 21.256 1.00 13.30 C ATOM 4720 O LEU A 309 19.287 -7.595 21.409 1.00 10.05 O ATOM 4721 CB LEU A 309 22.017 -8.208 19.547 1.00 8.59 C ATOM 4722 CG LEU A 309 22.473 -8.221 18.064 1.00 6.50 C ATOM 4723 CD1 LEU A 309 23.479 -9.324 17.861 1.00 9.58 C ATOM 4724 CD2 LEU A 309 21.299 -8.522 17.127 1.00 10.87 C ATOM 4725 HA LEU A 309 20.348 -6.923 19.154 1.00 0.00 H ATOM 4726 HB2 LEU A 309 22.902 -8.193 20.183 1.00 0.00 H ATOM 4727 HB3 LEU A 309 21.445 -9.115 19.743 1.00 0.00 H ATOM 4728 HG LEU A 309 22.892 -7.240 17.841 1.00 0.00 H ATOM 4729 HD21 LEU A 309 20.881 -9.499 17.372 1.00 0.00 H ATOM 4730 HD22 LEU A 309 20.533 -7.757 17.249 1.00 0.00 H ATOM 4731 HD23 LEU A 309 21.651 -8.524 16.095 1.00 0.00 H ATOM 4732 HD11 LEU A 309 24.340 -9.152 18.506 1.00 0.00 H ATOM 4733 HD12 LEU A 309 23.022 -10.281 18.111 1.00 0.00 H ATOM 4734 HD13 LEU A 309 23.800 -9.334 16.819 1.00 0.00 H ATOM 4735 H LEU A 309 22.931 -5.802 19.615 1.00 0.00 H ATOM 4736 N ASN A 310 21.232 -6.842 22.277 1.00 11.35 N ATOM 4737 CA ASN A 310 20.695 -6.985 23.608 1.00 14.62 C ATOM 4738 C ASN A 310 19.603 -6.022 23.980 1.00 14.36 C ATOM 4739 O ASN A 310 18.880 -6.324 24.924 1.00 15.18 O ATOM 4740 CB ASN A 310 21.811 -6.913 24.634 1.00 5.71 C ATOM 4741 CG ASN A 310 22.715 -8.132 24.590 1.00 25.93 C ATOM 4742 OD1 ASN A 310 22.257 -9.211 24.171 1.00 31.55 O ATOM 4743 ND2 ASN A 310 23.980 -7.974 25.018 1.00 36.49 N ATOM 4744 HA ASN A 310 20.220 -7.966 23.607 1.00 0.00 H ATOM 4745 HB2 ASN A 310 22.411 -6.024 24.438 1.00 0.00 H ATOM 4746 HB3 ASN A 310 21.369 -6.840 25.628 1.00 0.00 H ATOM 4747 HD22 ASN A 310 24.302 -7.045 25.357 1.00 0.00 H ATOM 4748 HD21 ASN A 310 24.636 -8.781 25.010 1.00 0.00 H ATOM 4749 H ASN A 310 22.197 -6.484 22.126 1.00 0.00 H ATOM 4750 N SER A 311 19.496 -4.900 23.267 1.00 8.38 N ATOM 4751 CA SER A 311 18.513 -3.887 23.505 1.00 9.95 C ATOM 4752 C SER A 311 17.219 -4.120 22.746 1.00 7.82 C ATOM 4753 O SER A 311 16.396 -3.223 22.732 1.00 10.01 O ATOM 4754 CB SER A 311 19.102 -2.544 23.075 1.00 11.19 C ATOM 4755 OG SER A 311 20.122 -2.179 23.984 1.00 14.86 O ATOM 4756 HA SER A 311 18.267 -3.907 24.567 1.00 0.00 H ATOM 4757 HB2 SER A 311 18.321 -1.784 23.077 1.00 0.00 H ATOM 4758 HB3 SER A 311 19.520 -2.632 22.072 1.00 0.00 H ATOM 4759 HG SER A 311 20.829 -2.872 23.980 1.00 0.00 H ATOM 4760 H SER A 311 20.170 -4.752 22.489 1.00 0.00 H ATOM 4761 N GLY A 312 17.048 -5.295 22.117 1.00 10.40 N ATOM 4762 CA GLY A 312 15.813 -5.552 21.374 1.00 14.95 C ATOM 4763 C GLY A 312 15.665 -4.850 20.010 1.00 8.45 C ATOM 4764 O GLY A 312 14.528 -4.560 19.543 1.00 17.29 O ATOM 4765 HA3 GLY A 312 14.979 -5.236 22.000 1.00 0.00 H ATOM 4766 HA2 GLY A 312 15.749 -6.626 21.201 1.00 0.00 H ATOM 4767 H GLY A 312 17.792 -6.021 22.158 1.00 0.00 H ATOM 4768 N ARG A 313 16.833 -4.626 19.360 1.00 5.05 N ATOM 4769 CA ARG A 313 16.881 -3.971 18.044 1.00 5.78 C ATOM 4770 C ARG A 313 17.562 -4.833 16.958 1.00 14.19 C ATOM 4771 O ARG A 313 18.248 -5.805 17.227 1.00 15.56 O ATOM 4772 CB ARG A 313 17.668 -2.680 18.098 1.00 10.48 C ATOM 4773 CG ARG A 313 17.285 -1.785 19.257 1.00 14.48 C ATOM 4774 CD ARG A 313 18.332 -0.732 19.537 1.00 18.27 C ATOM 4775 NE ARG A 313 17.955 -0.013 20.758 1.00 18.31 N ATOM 4776 CZ ARG A 313 18.830 0.588 21.581 1.00 21.90 C ATOM 4777 NH1 ARG A 313 20.140 0.556 21.282 1.00 18.17 N ATOM 4778 NH2 ARG A 313 18.396 1.232 22.706 1.00 22.13 N ATOM 4779 HA ARG A 313 15.835 -3.802 17.788 1.00 0.00 H ATOM 4780 HB2 ARG A 313 18.726 -2.925 18.186 1.00 0.00 H ATOM 4781 HB3 ARG A 313 17.499 -2.134 17.170 1.00 0.00 H ATOM 4782 HG2 ARG A 313 16.343 -1.290 19.022 1.00 0.00 H ATOM 4783 HG3 ARG A 313 17.158 -2.400 20.148 1.00 0.00 H ATOM 4784 HD2 ARG A 313 18.385 -0.035 18.701 1.00 0.00 H ATOM 4785 HD3 ARG A 313 19.303 -1.207 19.675 1.00 0.00 H ATOM 4786 HE ARG A 313 16.945 0.035 21.003 1.00 0.00 H ATOM 4787 HH12 ARG A 313 20.828 1.017 21.911 1.00 0.00 H ATOM 4788 HH11 ARG A 313 20.465 0.070 20.422 1.00 0.00 H ATOM 4789 HH22 ARG A 313 19.081 1.695 23.337 1.00 0.00 H ATOM 4790 HH21 ARG A 313 17.381 1.259 22.931 1.00 0.00 H ATOM 4791 H ARG A 313 17.723 -4.927 19.806 1.00 0.00 H ATOM 4792 N VAL A 314 17.407 -4.472 15.686 1.00 8.47 N ATOM 4793 CA VAL A 314 18.085 -5.288 14.684 1.00 7.61 C ATOM 4794 C VAL A 314 19.349 -4.552 14.259 1.00 14.32 C ATOM 4795 O VAL A 314 19.486 -3.357 14.474 1.00 9.93 O ATOM 4796 CB VAL A 314 17.188 -5.495 13.435 1.00 8.90 C ATOM 4797 CG1 VAL A 314 15.912 -6.266 13.776 1.00 6.43 C ATOM 4798 CG2 VAL A 314 16.846 -4.175 12.748 1.00 6.21 C ATOM 4799 HA VAL A 314 18.314 -6.265 15.111 1.00 0.00 H ATOM 4800 HB VAL A 314 17.770 -6.094 12.734 1.00 0.00 H ATOM 4801 HG11 VAL A 314 16.176 -7.245 14.175 1.00 0.00 H ATOM 4802 HG12 VAL A 314 15.341 -5.711 14.520 1.00 0.00 H ATOM 4803 HG13 VAL A 314 15.312 -6.390 12.875 1.00 0.00 H ATOM 4804 HG21 VAL A 314 16.312 -3.531 13.447 1.00 0.00 H ATOM 4805 HG22 VAL A 314 17.765 -3.684 12.429 1.00 0.00 H ATOM 4806 HG23 VAL A 314 16.217 -4.371 11.880 1.00 0.00 H ATOM 4807 H VAL A 314 16.831 -3.648 15.419 1.00 0.00 H ATOM 4808 N VAL A 315 20.272 -5.275 13.641 1.00 10.62 N ATOM 4809 CA VAL A 315 21.492 -4.664 13.155 1.00 8.18 C ATOM 4810 C VAL A 315 21.065 -4.392 11.696 1.00 8.55 C ATOM 4811 O VAL A 315 20.796 -5.328 10.955 1.00 11.16 O ATOM 4812 CB VAL A 315 22.657 -5.660 13.216 1.00 14.07 C ATOM 4813 CG1 VAL A 315 23.789 -5.111 12.364 1.00 12.98 C ATOM 4814 CG2 VAL A 315 23.072 -5.891 14.684 1.00 11.63 C ATOM 4815 HA VAL A 315 21.842 -3.793 13.709 1.00 0.00 H ATOM 4816 HB VAL A 315 22.369 -6.634 12.819 1.00 0.00 H ATOM 4817 HG11 VAL A 315 23.445 -4.995 11.336 1.00 0.00 H ATOM 4818 HG12 VAL A 315 24.100 -4.142 12.756 1.00 0.00 H ATOM 4819 HG13 VAL A 315 24.631 -5.803 12.391 1.00 0.00 H ATOM 4820 HG21 VAL A 315 23.383 -4.944 15.125 1.00 0.00 H ATOM 4821 HG22 VAL A 315 22.225 -6.292 15.241 1.00 0.00 H ATOM 4822 HG23 VAL A 315 23.900 -6.599 14.719 1.00 0.00 H ATOM 4823 H VAL A 315 20.118 -6.294 13.503 1.00 0.00 H ATOM 4824 N PRO A 316 20.965 -3.112 11.286 1.00 9.02 N ATOM 4825 CA PRO A 316 20.509 -2.797 9.921 1.00 9.31 C ATOM 4826 C PRO A 316 21.484 -3.197 8.814 1.00 9.75 C ATOM 4827 O PRO A 316 22.694 -3.095 8.933 1.00 7.98 O ATOM 4828 CB PRO A 316 20.283 -1.235 9.884 1.00 11.21 C ATOM 4829 CG PRO A 316 21.029 -0.645 11.058 1.00 11.57 C ATOM 4830 CD PRO A 316 21.469 -1.833 11.912 1.00 10.38 C ATOM 4831 HA PRO A 316 19.606 -3.374 9.720 1.00 0.00 H ATOM 4832 HD3 PRO A 316 22.557 -1.859 11.967 1.00 0.00 H ATOM 4833 HD2 PRO A 316 21.058 -1.732 12.916 1.00 0.00 H ATOM 4834 HG3 PRO A 316 20.376 0.013 11.631 1.00 0.00 H ATOM 4835 HG2 PRO A 316 21.897 -0.083 10.713 1.00 0.00 H ATOM 4836 HB2 PRO A 316 20.669 -0.824 8.951 1.00 0.00 H ATOM 4837 HB3 PRO A 316 19.220 -1.010 9.966 1.00 0.00 H ATOM 4838 N GLY A 317 20.950 -3.631 7.699 1.00 5.25 N ATOM 4839 CA GLY A 317 21.806 -3.974 6.607 1.00 3.00 C ATOM 4840 C GLY A 317 22.262 -5.411 6.496 1.00 9.99 C ATOM 4841 O GLY A 317 22.976 -5.692 5.580 1.00 5.45 O ATOM 4842 HA3 GLY A 317 22.699 -3.354 6.686 1.00 0.00 H ATOM 4843 HA2 GLY A 317 21.275 -3.729 5.687 1.00 0.00 H ATOM 4844 H GLY A 317 19.918 -3.725 7.610 1.00 0.00 H ATOM 4845 N TYR A 318 21.878 -6.276 7.436 1.00 5.18 N ATOM 4846 CA TYR A 318 22.237 -7.700 7.495 1.00 11.94 C ATOM 4847 C TYR A 318 20.948 -8.526 7.529 1.00 13.29 C ATOM 4848 O TYR A 318 19.945 -8.023 8.043 1.00 6.80 O ATOM 4849 CB TYR A 318 23.113 -7.966 8.773 1.00 6.51 C ATOM 4850 CG TYR A 318 24.529 -7.486 8.439 1.00 12.66 C ATOM 4851 CD1 TYR A 318 24.892 -6.131 8.474 1.00 12.94 C ATOM 4852 CD2 TYR A 318 25.487 -8.416 8.046 1.00 10.69 C ATOM 4853 CE1 TYR A 318 26.177 -5.696 8.124 1.00 11.20 C ATOM 4854 CE2 TYR A 318 26.773 -8.011 7.697 1.00 5.38 C ATOM 4855 CZ TYR A 318 27.109 -6.661 7.746 1.00 16.72 C ATOM 4856 OH TYR A 318 28.387 -6.324 7.409 1.00 28.21 O ATOM 4857 HA TYR A 318 22.819 -7.987 6.619 1.00 0.00 H ATOM 4858 HB3 TYR A 318 23.122 -9.030 9.009 1.00 0.00 H ATOM 4859 HB2 TYR A 318 22.718 -7.410 9.623 1.00 0.00 H ATOM 4860 HD2 TYR A 318 25.228 -9.474 8.011 1.00 0.00 H ATOM 4861 HE2 TYR A 318 27.513 -8.748 7.387 1.00 0.00 H ATOM 4862 HE1 TYR A 318 26.439 -4.638 8.147 1.00 0.00 H ATOM 4863 HD1 TYR A 318 24.151 -5.394 8.783 1.00 0.00 H ATOM 4864 HH TYR A 318 28.499 -5.343 7.483 1.00 0.00 H ATOM 4865 H TYR A 318 21.270 -5.910 8.196 1.00 0.00 H ATOM 4866 N GLY A 319 20.997 -9.738 6.972 1.00 7.58 N ATOM 4867 CA GLY A 319 19.851 -10.606 6.944 1.00 6.85 C ATOM 4868 C GLY A 319 18.981 -10.372 5.690 1.00 10.15 C ATOM 4869 O GLY A 319 19.111 -9.383 4.945 1.00 10.12 O ATOM 4870 HA3 GLY A 319 19.247 -10.421 7.832 1.00 0.00 H ATOM 4871 HA2 GLY A 319 20.193 -11.641 6.948 1.00 0.00 H ATOM 4872 H GLY A 319 21.888 -10.063 6.547 1.00 0.00 H ATOM 4873 N HIS A 320 18.095 -11.333 5.463 1.00 6.74 N ATOM 4874 CA HIS A 320 17.194 -11.297 4.317 1.00 3.18 C ATOM 4875 C HIS A 320 16.065 -12.307 4.423 1.00 5.31 C ATOM 4876 O HIS A 320 16.209 -13.391 4.995 1.00 6.08 O ATOM 4877 CB HIS A 320 17.941 -11.462 2.960 1.00 4.05 C ATOM 4878 CG HIS A 320 17.230 -10.818 1.809 1.00 5.70 C ATOM 4879 ND1 HIS A 320 16.384 -11.570 0.968 1.00 7.32 N ATOM 4880 CD2 HIS A 320 17.219 -9.516 1.375 1.00 7.08 C ATOM 4881 CE1 HIS A 320 15.918 -10.719 0.042 1.00 6.73 C ATOM 4882 NE2 HIS A 320 16.412 -9.492 0.250 1.00 8.69 N ATOM 4883 HA HIS A 320 16.751 -10.301 4.336 1.00 0.00 H ATOM 4884 HB2 HIS A 320 18.929 -11.012 3.052 1.00 0.00 H ATOM 4885 HB3 HIS A 320 18.046 -12.526 2.750 1.00 0.00 H ATOM 4886 HD2 HIS A 320 17.740 -8.671 1.825 1.00 0.00 H ATOM 4887 HE1 HIS A 320 15.235 -10.988 -0.764 1.00 0.00 H ATOM 4888 H HIS A 320 18.041 -12.136 6.122 1.00 0.00 H ATOM 4889 N ALA A 321 14.896 -12.009 3.859 1.00 6.87 N ATOM 4890 CA ALA A 321 13.828 -12.972 3.960 1.00 6.29 C ATOM 4891 C ALA A 321 14.075 -14.178 3.063 1.00 14.75 C ATOM 4892 O ALA A 321 13.643 -15.269 3.354 1.00 14.04 O ATOM 4893 CB ALA A 321 12.542 -12.335 3.510 1.00 3.37 C ATOM 4894 HA ALA A 321 13.776 -13.297 4.999 1.00 0.00 H ATOM 4895 HB1 ALA A 321 12.322 -11.476 4.144 1.00 0.00 H ATOM 4896 HB2 ALA A 321 12.643 -12.007 2.475 1.00 0.00 H ATOM 4897 HB3 ALA A 321 11.733 -13.061 3.585 1.00 0.00 H ATOM 4898 H ALA A 321 14.757 -11.107 3.360 1.00 0.00 H ATOM 4899 N VAL A 322 14.801 -14.005 1.989 1.00 9.85 N ATOM 4900 CA VAL A 322 15.053 -15.094 1.057 1.00 3.51 C ATOM 4901 C VAL A 322 16.508 -15.429 0.766 1.00 3.40 C ATOM 4902 O VAL A 322 16.874 -16.624 0.676 1.00 10.85 O ATOM 4903 CB VAL A 322 14.403 -14.613 -0.249 1.00 6.25 C ATOM 4904 CG1 VAL A 322 14.659 -15.572 -1.417 1.00 14.10 C ATOM 4905 CG2 VAL A 322 12.884 -14.365 -0.095 1.00 7.39 C ATOM 4906 HA VAL A 322 14.660 -16.012 1.495 1.00 0.00 H ATOM 4907 HB VAL A 322 14.882 -13.661 -0.479 1.00 0.00 H ATOM 4908 HG11 VAL A 322 15.732 -15.658 -1.586 1.00 0.00 H ATOM 4909 HG12 VAL A 322 14.248 -16.553 -1.177 1.00 0.00 H ATOM 4910 HG13 VAL A 322 14.178 -15.185 -2.315 1.00 0.00 H ATOM 4911 HG21 VAL A 322 12.394 -15.292 0.204 1.00 0.00 H ATOM 4912 HG22 VAL A 322 12.717 -13.602 0.666 1.00 0.00 H ATOM 4913 HG23 VAL A 322 12.474 -14.027 -1.047 1.00 0.00 H ATOM 4914 H VAL A 322 15.208 -13.067 1.796 1.00 0.00 H ATOM 4915 N LEU A 323 17.335 -14.419 0.610 1.00 10.38 N ATOM 4916 CA LEU A 323 18.738 -14.652 0.364 1.00 6.17 C ATOM 4917 C LEU A 323 19.328 -15.402 1.568 1.00 11.85 C ATOM 4918 O LEU A 323 18.952 -15.176 2.718 1.00 8.14 O ATOM 4919 CB LEU A 323 19.503 -13.327 0.164 1.00 6.15 C ATOM 4920 CG LEU A 323 19.506 -12.834 -1.287 1.00 8.83 C ATOM 4921 CD1 LEU A 323 19.914 -11.368 -1.345 1.00 10.08 C ATOM 4922 CD2 LEU A 323 20.539 -13.622 -2.074 1.00 14.16 C ATOM 4923 HA LEU A 323 18.840 -15.240 -0.548 1.00 0.00 H ATOM 4924 HB2 LEU A 323 19.038 -12.563 0.787 1.00 0.00 H ATOM 4925 HB3 LEU A 323 20.536 -13.474 0.481 1.00 0.00 H ATOM 4926 HG LEU A 323 18.506 -12.963 -1.700 1.00 0.00 H ATOM 4927 HD21 LEU A 323 21.524 -13.471 -1.632 1.00 0.00 H ATOM 4928 HD22 LEU A 323 20.285 -14.682 -2.045 1.00 0.00 H ATOM 4929 HD23 LEU A 323 20.547 -13.277 -3.108 1.00 0.00 H ATOM 4930 HD11 LEU A 323 19.207 -10.772 -0.767 1.00 0.00 H ATOM 4931 HD12 LEU A 323 20.914 -11.254 -0.927 1.00 0.00 H ATOM 4932 HD13 LEU A 323 19.911 -11.032 -2.382 1.00 0.00 H ATOM 4933 H LEU A 323 16.976 -13.445 0.664 1.00 0.00 H ATOM 4934 N ARG A 324 20.220 -16.348 1.246 1.00 10.96 N ATOM 4935 CA ARG A 324 20.915 -17.175 2.230 1.00 11.05 C ATOM 4936 C ARG A 324 22.420 -16.996 2.193 1.00 6.34 C ATOM 4937 O ARG A 324 23.139 -17.618 2.972 1.00 13.83 O ATOM 4938 CB ARG A 324 20.543 -18.660 2.130 1.00 15.21 C ATOM 4939 CG ARG A 324 19.085 -18.886 2.515 1.00 27.97 C ATOM 4940 CD ARG A 324 18.715 -18.190 3.809 1.00 20.78 C ATOM 4941 NE ARG A 324 17.341 -18.421 4.287 1.00 55.29 N ATOM 4942 CZ ARG A 324 16.541 -17.427 4.711 1.00 36.59 C ATOM 4943 NH1 ARG A 324 16.955 -16.166 4.706 1.00 12.72 N ATOM 4944 NH2 ARG A 324 15.295 -17.702 5.142 1.00 25.09 N ATOM 4945 HA ARG A 324 20.567 -16.815 3.198 1.00 0.00 H ATOM 4946 HB2 ARG A 324 20.698 -18.998 1.105 1.00 0.00 H ATOM 4947 HB3 ARG A 324 21.182 -19.234 2.801 1.00 0.00 H ATOM 4948 HG2 ARG A 324 18.449 -18.504 1.717 1.00 0.00 H ATOM 4949 HG3 ARG A 324 18.915 -19.956 2.632 1.00 0.00 H ATOM 4950 HD2 ARG A 324 18.843 -17.118 3.662 1.00 0.00 H ATOM 4951 HD3 ARG A 324 19.402 -18.534 4.583 1.00 0.00 H ATOM 4952 HE ARG A 324 16.974 -19.394 4.297 1.00 0.00 H ATOM 4953 HH12 ARG A 324 16.323 -15.410 5.038 1.00 0.00 H ATOM 4954 HH11 ARG A 324 17.912 -15.934 4.371 1.00 0.00 H ATOM 4955 HH22 ARG A 324 14.677 -16.933 5.470 1.00 0.00 H ATOM 4956 HH21 ARG A 324 14.951 -18.684 5.147 1.00 0.00 H ATOM 4957 H ARG A 324 20.430 -16.503 0.239 1.00 0.00 H ATOM 4958 N LYS A 325 22.886 -16.119 1.302 1.00 3.00 N ATOM 4959 CA LYS A 325 24.267 -15.812 1.140 1.00 5.27 C ATOM 4960 C LYS A 325 24.374 -14.297 0.906 1.00 11.83 C ATOM 4961 O LYS A 325 23.372 -13.611 0.755 1.00 9.63 O ATOM 4962 CB LYS A 325 24.781 -16.403 -0.160 1.00 5.37 C ATOM 4963 CG LYS A 325 24.505 -17.869 -0.330 1.00 18.85 C ATOM 4964 CD LYS A 325 25.593 -18.648 0.364 1.00 28.59 C ATOM 4965 CE LYS A 325 25.488 -20.119 -0.014 1.00 44.63 C ATOM 4966 NZ LYS A 325 24.799 -20.864 1.039 1.00 40.85 N ATOM 4967 HA LYS A 325 24.812 -16.182 2.009 1.00 0.00 H ATOM 4968 HB2 LYS A 325 24.311 -15.870 -0.986 1.00 0.00 H ATOM 4969 HB3 LYS A 325 25.860 -16.253 -0.200 1.00 0.00 H ATOM 4970 HG2 LYS A 325 23.539 -18.114 0.111 1.00 0.00 H ATOM 4971 HG3 LYS A 325 24.493 -18.120 -1.391 1.00 0.00 H ATOM 4972 HD2 LYS A 325 26.566 -18.263 0.059 1.00 0.00 H ATOM 4973 HD3 LYS A 325 25.484 -18.542 1.443 1.00 0.00 H ATOM 4974 HE2 LYS A 325 26.489 -20.529 -0.149 1.00 0.00 H ATOM 4975 HE3 LYS A 325 24.930 -20.213 -0.946 1.00 0.00 H ATOM 4976 HZ1 LYS A 325 25.332 -20.778 1.928 1.00 0.00 H ATOM 4977 HZ2 LYS A 325 23.843 -20.476 1.167 1.00 0.00 H ATOM 4978 HZ3 LYS A 325 24.735 -21.866 0.768 1.00 0.00 H ATOM 4979 H LYS A 325 22.201 -15.631 0.690 1.00 0.00 H ATOM 4980 N THR A 326 25.600 -13.763 0.867 1.00 10.75 N ATOM 4981 CA THR A 326 25.839 -12.361 0.648 1.00 14.49 C ATOM 4982 C THR A 326 25.149 -11.883 -0.637 1.00 13.32 C ATOM 4983 O THR A 326 25.317 -12.466 -1.744 1.00 9.54 O ATOM 4984 CB THR A 326 27.334 -12.155 0.518 1.00 11.61 C ATOM 4985 OG1 THR A 326 27.934 -12.456 1.773 1.00 12.41 O ATOM 4986 CG2 THR A 326 27.628 -10.700 0.243 1.00 4.16 C ATOM 4987 HA THR A 326 25.436 -11.789 1.484 1.00 0.00 H ATOM 4988 HB THR A 326 27.713 -12.786 -0.286 1.00 0.00 H ATOM 4989 HG1 THR A 326 28.913 -12.327 1.709 1.00 0.00 H ATOM 4990 HG23 THR A 326 27.188 -10.416 -0.713 1.00 0.00 H ATOM 4991 HG21 THR A 326 27.201 -10.088 1.037 1.00 0.00 H ATOM 4992 HG22 THR A 326 28.707 -10.549 0.207 1.00 0.00 H ATOM 4993 H THR A 326 26.419 -14.390 1.001 1.00 0.00 H ATOM 4994 N ASP A 327 24.398 -10.785 -0.469 1.00 5.05 N ATOM 4995 CA ASP A 327 23.663 -10.171 -1.587 1.00 9.02 C ATOM 4996 C ASP A 327 24.647 -9.726 -2.698 1.00 12.58 C ATOM 4997 O ASP A 327 25.526 -8.942 -2.413 1.00 8.91 O ATOM 4998 CB ASP A 327 22.924 -8.934 -1.044 1.00 5.35 C ATOM 4999 CG ASP A 327 21.820 -8.320 -1.873 1.00 6.48 C ATOM 5000 OD1 ASP A 327 21.845 -8.520 -3.151 1.00 3.99 O ATOM 5001 OD2 ASP A 327 20.965 -7.653 -1.394 1.00 8.17 O ATOM 5002 HA ASP A 327 22.963 -10.892 -2.010 1.00 0.00 H ATOM 5003 HB2 ASP A 327 22.486 -9.217 -0.087 1.00 0.00 H ATOM 5004 HB3 ASP A 327 23.673 -8.158 -0.884 1.00 0.00 H ATOM 5005 H ASP A 327 24.333 -10.356 0.476 1.00 0.00 H ATOM 5006 N PRO A 328 24.480 -10.188 -3.978 1.00 5.21 N ATOM 5007 CA PRO A 328 25.352 -9.771 -5.059 1.00 8.13 C ATOM 5008 C PRO A 328 25.240 -8.241 -5.241 1.00 4.98 C ATOM 5009 O PRO A 328 26.160 -7.647 -5.753 1.00 8.87 O ATOM 5010 CB PRO A 328 24.924 -10.500 -6.295 1.00 10.21 C ATOM 5011 CG PRO A 328 23.585 -11.135 -5.934 1.00 13.05 C ATOM 5012 CD PRO A 328 23.574 -11.255 -4.401 1.00 5.99 C ATOM 5013 HA PRO A 328 26.395 -10.006 -4.844 1.00 0.00 H ATOM 5014 HD3 PRO A 328 22.571 -11.098 -4.003 1.00 0.00 H ATOM 5015 HD2 PRO A 328 23.942 -12.230 -4.082 1.00 0.00 H ATOM 5016 HG3 PRO A 328 23.497 -12.120 -6.392 1.00 0.00 H ATOM 5017 HG2 PRO A 328 22.763 -10.504 -6.271 1.00 0.00 H ATOM 5018 HB2 PRO A 328 24.808 -9.807 -7.128 1.00 0.00 H ATOM 5019 HB3 PRO A 328 25.653 -11.266 -6.560 1.00 0.00 H ATOM 5020 N ARG A 329 24.150 -7.591 -4.849 1.00 4.20 N ATOM 5021 CA ARG A 329 24.053 -6.135 -4.973 1.00 5.52 C ATOM 5022 C ARG A 329 25.041 -5.559 -3.967 1.00 7.06 C ATOM 5023 O ARG A 329 25.565 -4.460 -4.178 1.00 7.67 O ATOM 5024 CB ARG A 329 22.641 -5.656 -4.582 1.00 3.00 C ATOM 5025 CG ARG A 329 21.672 -6.115 -5.671 1.00 4.01 C ATOM 5026 CD ARG A 329 20.209 -5.799 -5.336 1.00 3.00 C ATOM 5027 NE ARG A 329 19.870 -6.443 -4.040 1.00 6.62 N ATOM 5028 CZ ARG A 329 18.724 -6.221 -3.381 1.00 4.97 C ATOM 5029 NH1 ARG A 329 17.770 -5.430 -3.877 1.00 7.50 N ATOM 5030 NH2 ARG A 329 18.456 -6.818 -2.210 1.00 3.00 N ATOM 5031 HA ARG A 329 24.259 -5.822 -5.997 1.00 0.00 H ATOM 5032 HB2 ARG A 329 22.354 -6.090 -3.624 1.00 0.00 H ATOM 5033 HB3 ARG A 329 22.626 -4.569 -4.506 1.00 0.00 H ATOM 5034 HG2 ARG A 329 21.932 -5.614 -6.603 1.00 0.00 H ATOM 5035 HG3 ARG A 329 21.776 -7.193 -5.798 1.00 0.00 H ATOM 5036 HD2 ARG A 329 19.560 -6.188 -6.121 1.00 0.00 H ATOM 5037 HD3 ARG A 329 20.075 -4.720 -5.257 1.00 0.00 H ATOM 5038 HE ARG A 329 20.559 -7.101 -3.622 1.00 0.00 H ATOM 5039 HH12 ARG A 329 16.891 -5.277 -3.342 1.00 0.00 H ATOM 5040 HH11 ARG A 329 17.905 -4.967 -4.798 1.00 0.00 H ATOM 5041 HH22 ARG A 329 17.558 -6.626 -1.722 1.00 0.00 H ATOM 5042 HH21 ARG A 329 19.146 -7.473 -1.790 1.00 0.00 H ATOM 5043 H ARG A 329 23.353 -8.125 -4.448 1.00 0.00 H ATOM 5044 N TYR A 330 25.318 -6.277 -2.843 1.00 6.09 N ATOM 5045 CA TYR A 330 26.291 -5.747 -1.868 1.00 5.59 C ATOM 5046 C TYR A 330 27.697 -5.844 -2.527 1.00 3.39 C ATOM 5047 O TYR A 330 28.475 -4.895 -2.552 1.00 9.89 O ATOM 5048 CB TYR A 330 26.225 -6.574 -0.549 1.00 6.32 C ATOM 5049 CG TYR A 330 27.285 -6.241 0.489 1.00 11.88 C ATOM 5050 CD1 TYR A 330 27.065 -5.257 1.453 1.00 8.77 C ATOM 5051 CD2 TYR A 330 28.515 -6.902 0.520 1.00 15.02 C ATOM 5052 CE1 TYR A 330 28.020 -4.928 2.421 1.00 9.72 C ATOM 5053 CE2 TYR A 330 29.495 -6.591 1.466 1.00 9.28 C ATOM 5054 CZ TYR A 330 29.249 -5.599 2.419 1.00 10.14 C ATOM 5055 OH TYR A 330 30.253 -5.361 3.351 1.00 15.92 O ATOM 5056 HA TYR A 330 26.071 -4.711 -1.609 1.00 0.00 H ATOM 5057 HB3 TYR A 330 26.328 -7.628 -0.808 1.00 0.00 H ATOM 5058 HB2 TYR A 330 25.248 -6.406 -0.096 1.00 0.00 H ATOM 5059 HD2 TYR A 330 28.716 -7.682 -0.214 1.00 0.00 H ATOM 5060 HE2 TYR A 330 30.448 -7.120 1.461 1.00 0.00 H ATOM 5061 HE1 TYR A 330 27.810 -4.160 3.166 1.00 0.00 H ATOM 5062 HD1 TYR A 330 26.114 -4.725 1.452 1.00 0.00 H ATOM 5063 HH TYR A 330 31.079 -5.082 2.881 1.00 0.00 H ATOM 5064 H TYR A 330 24.849 -7.189 -2.674 1.00 0.00 H ATOM 5065 N THR A 331 28.012 -6.997 -3.090 1.00 6.76 N ATOM 5066 CA THR A 331 29.273 -7.233 -3.731 1.00 6.69 C ATOM 5067 C THR A 331 29.512 -6.277 -4.866 1.00 10.36 C ATOM 5068 O THR A 331 30.599 -5.752 -5.090 1.00 13.16 O ATOM 5069 CB THR A 331 29.170 -8.618 -4.330 1.00 19.80 C ATOM 5070 OG1 THR A 331 29.078 -9.578 -3.296 1.00 14.49 O ATOM 5071 CG2 THR A 331 30.411 -8.827 -5.191 1.00 26.80 C ATOM 5072 HA THR A 331 30.081 -7.115 -3.009 1.00 0.00 H ATOM 5073 HB THR A 331 28.277 -8.727 -4.945 1.00 0.00 H ATOM 5074 HG1 THR A 331 29.886 -9.525 -2.726 1.00 0.00 H ATOM 5075 HG23 THR A 331 30.442 -8.068 -5.972 1.00 0.00 H ATOM 5076 HG21 THR A 331 31.302 -8.745 -4.568 1.00 0.00 H ATOM 5077 HG22 THR A 331 30.374 -9.817 -5.646 1.00 0.00 H ATOM 5078 H THR A 331 27.314 -7.768 -3.067 1.00 0.00 H ATOM 5079 N CYS A 332 28.482 -6.019 -5.652 1.00 8.95 N ATOM 5080 CA CYS A 332 28.627 -5.089 -6.778 1.00 9.75 C ATOM 5081 C CYS A 332 28.998 -3.671 -6.274 1.00 15.83 C ATOM 5082 O CYS A 332 29.803 -2.903 -6.851 1.00 10.62 O ATOM 5083 CB CYS A 332 27.357 -5.224 -7.664 1.00 13.74 C ATOM 5084 SG CYS A 332 27.243 -3.835 -8.759 1.00 28.55 S ATOM 5085 HA CYS A 332 29.468 -5.331 -7.428 1.00 0.00 H ATOM 5086 HB2 CYS A 332 26.473 -5.258 -7.028 1.00 0.00 H ATOM 5087 HB3 CYS A 332 27.418 -6.142 -8.248 1.00 0.00 H ATOM 5088 HG CYS A 332 26.114 -3.961 -9.543 1.00 0.00 H ATOM 5089 H CYS A 332 27.565 -6.476 -5.472 1.00 0.00 H ATOM 5090 N GLN A 333 28.452 -3.311 -5.142 1.00 7.44 N ATOM 5091 CA GLN A 333 28.743 -2.001 -4.532 1.00 6.06 C ATOM 5092 C GLN A 333 30.145 -1.965 -3.966 1.00 10.14 C ATOM 5093 O GLN A 333 30.831 -0.981 -4.154 1.00 8.32 O ATOM 5094 CB GLN A 333 27.712 -1.586 -3.473 1.00 4.94 C ATOM 5095 CG GLN A 333 26.401 -1.153 -4.175 1.00 7.71 C ATOM 5096 CD GLN A 333 25.264 -0.895 -3.215 1.00 12.61 C ATOM 5097 OE1 GLN A 333 24.801 0.253 -3.187 1.00 19.32 O ATOM 5098 NE2 GLN A 333 24.884 -1.932 -2.390 1.00 8.43 N ATOM 5099 HA GLN A 333 28.671 -1.267 -5.335 1.00 0.00 H ATOM 5100 HB2 GLN A 333 27.510 -2.429 -2.812 1.00 0.00 H ATOM 5101 HB3 GLN A 333 28.105 -0.753 -2.889 1.00 0.00 H ATOM 5102 HG2 GLN A 333 26.595 -0.238 -4.736 1.00 0.00 H ATOM 5103 HG3 GLN A 333 26.100 -1.943 -4.863 1.00 0.00 H ATOM 5104 HE22 GLN A 333 25.332 -2.866 -2.488 1.00 0.00 H ATOM 5105 HE21 GLN A 333 24.150 -1.781 -1.669 1.00 0.00 H ATOM 5106 H GLN A 333 27.799 -3.962 -4.662 1.00 0.00 H ATOM 5107 N ARG A 334 30.592 -3.023 -3.322 1.00 4.40 N ATOM 5108 CA ARG A 334 31.945 -3.147 -2.748 1.00 3.97 C ATOM 5109 C ARG A 334 32.976 -3.000 -3.859 1.00 12.51 C ATOM 5110 O ARG A 334 34.011 -2.344 -3.801 1.00 10.90 O ATOM 5111 CB ARG A 334 32.110 -4.590 -2.264 1.00 14.91 C ATOM 5112 CG ARG A 334 33.411 -4.855 -1.508 1.00 17.00 C ATOM 5113 CD ARG A 334 33.441 -6.239 -0.847 1.00 28.42 C ATOM 5114 NE ARG A 334 34.788 -6.756 -0.586 1.00 22.10 N ATOM 5115 CZ ARG A 334 35.478 -6.540 0.546 1.00 56.05 C ATOM 5116 NH1 ARG A 334 34.995 -5.818 1.578 1.00 26.51 N ATOM 5117 NH2 ARG A 334 36.695 -7.088 0.628 1.00 46.49 N ATOM 5118 HA ARG A 334 32.075 -2.402 -1.963 1.00 0.00 H ATOM 5119 HB2 ARG A 334 31.276 -4.826 -1.603 1.00 0.00 H ATOM 5120 HB3 ARG A 334 32.080 -5.247 -3.133 1.00 0.00 H ATOM 5121 HG2 ARG A 334 34.242 -4.785 -2.209 1.00 0.00 H ATOM 5122 HG3 ARG A 334 33.526 -4.096 -0.734 1.00 0.00 H ATOM 5123 HD2 ARG A 334 32.927 -6.942 -1.503 1.00 0.00 H ATOM 5124 HD3 ARG A 334 32.910 -6.175 0.103 1.00 0.00 H ATOM 5125 HE ARG A 334 35.240 -7.329 -1.327 1.00 0.00 H ATOM 5126 HH12 ARG A 334 35.572 -5.682 2.432 1.00 0.00 H ATOM 5127 HH11 ARG A 334 34.045 -5.398 1.519 1.00 0.00 H ATOM 5128 HH22 ARG A 334 37.270 -6.951 1.483 1.00 0.00 H ATOM 5129 HH21 ARG A 334 37.066 -7.651 -0.164 1.00 0.00 H ATOM 5130 H ARG A 334 29.944 -3.829 -3.210 1.00 0.00 H ATOM 5131 N GLU A 335 32.682 -3.638 -4.948 1.00 14.90 N ATOM 5132 CA GLU A 335 33.590 -3.544 -6.064 1.00 14.96 C ATOM 5133 C GLU A 335 33.732 -2.125 -6.609 1.00 22.20 C ATOM 5134 O GLU A 335 34.813 -1.719 -6.976 1.00 14.76 O ATOM 5135 CB GLU A 335 33.477 -4.774 -6.991 1.00 22.04 C ATOM 5136 CG GLU A 335 32.800 -4.652 -8.362 1.00 80.00 C ATOM 5137 CD GLU A 335 32.351 -6.023 -8.836 1.00 80.00 C ATOM 5138 OE1 GLU A 335 32.933 -7.009 -8.154 1.00 80.00 O ATOM 5139 OE2 GLU A 335 31.441 -6.178 -9.665 1.00 80.00 O ATOM 5140 HA GLU A 335 34.628 -3.659 -5.752 1.00 0.00 H ATOM 5141 HB2 GLU A 335 34.493 -5.123 -7.174 1.00 0.00 H ATOM 5142 HB3 GLU A 335 32.927 -5.535 -6.437 1.00 0.00 H ATOM 5143 HG2 GLU A 335 31.934 -3.995 -8.281 1.00 0.00 H ATOM 5144 HG3 GLU A 335 33.506 -4.234 -9.079 1.00 0.00 H ATOM 5145 H GLU A 335 31.812 -4.204 -5.015 1.00 0.00 H ATOM 5146 N PHE A 336 32.652 -1.357 -6.624 1.00 10.75 N ATOM 5147 CA PHE A 336 32.640 -0.008 -7.075 1.00 8.67 C ATOM 5148 C PHE A 336 33.472 0.809 -6.091 1.00 13.76 C ATOM 5149 O PHE A 336 34.253 1.654 -6.484 1.00 14.96 O ATOM 5150 CB PHE A 336 31.188 0.531 -7.103 1.00 16.27 C ATOM 5151 CG PHE A 336 31.141 2.007 -7.561 1.00 13.95 C ATOM 5152 CD1 PHE A 336 31.479 3.064 -6.714 1.00 11.65 C ATOM 5153 CD2 PHE A 336 30.800 2.345 -8.876 1.00 8.64 C ATOM 5154 CE1 PHE A 336 31.461 4.391 -7.150 1.00 10.90 C ATOM 5155 CE2 PHE A 336 30.774 3.661 -9.344 1.00 8.28 C ATOM 5156 CZ PHE A 336 31.099 4.695 -8.467 1.00 9.86 C ATOM 5157 HA PHE A 336 33.050 0.061 -8.083 1.00 0.00 H ATOM 5158 HB2 PHE A 336 30.599 -0.073 -7.793 1.00 0.00 H ATOM 5159 HB3 PHE A 336 30.763 0.457 -6.102 1.00 0.00 H ATOM 5160 HD2 PHE A 336 30.542 1.543 -9.568 1.00 0.00 H ATOM 5161 HE2 PHE A 336 30.504 3.876 -10.378 1.00 0.00 H ATOM 5162 HZ PHE A 336 31.071 5.731 -8.804 1.00 0.00 H ATOM 5163 HE1 PHE A 336 31.730 5.192 -6.462 1.00 0.00 H ATOM 5164 HD1 PHE A 336 31.765 2.848 -5.685 1.00 0.00 H ATOM 5165 H PHE A 336 31.758 -1.766 -6.285 1.00 0.00 H ATOM 5166 N ALA A 337 33.323 0.580 -4.796 1.00 12.94 N ATOM 5167 CA ALA A 337 34.076 1.276 -3.778 1.00 6.05 C ATOM 5168 C ALA A 337 35.600 1.016 -3.944 1.00 11.76 C ATOM 5169 O ALA A 337 36.432 1.912 -3.948 1.00 15.57 O ATOM 5170 CB ALA A 337 33.704 0.701 -2.416 1.00 10.21 C ATOM 5171 HA ALA A 337 33.853 2.340 -3.863 1.00 0.00 H ATOM 5172 HB1 ALA A 337 32.636 0.837 -2.245 1.00 0.00 H ATOM 5173 HB2 ALA A 337 33.945 -0.362 -2.394 1.00 0.00 H ATOM 5174 HB3 ALA A 337 34.266 1.219 -1.639 1.00 0.00 H ATOM 5175 H ALA A 337 32.630 -0.136 -4.497 1.00 0.00 H ATOM 5176 N LEU A 338 35.967 -0.256 -4.062 1.00 11.77 N ATOM 5177 CA LEU A 338 37.340 -0.619 -4.223 1.00 18.29 C ATOM 5178 C LEU A 338 37.981 0.063 -5.388 1.00 22.13 C ATOM 5179 O LEU A 338 39.181 0.365 -5.327 1.00 18.40 O ATOM 5180 CB LEU A 338 37.521 -2.121 -4.380 1.00 16.88 C ATOM 5181 CG LEU A 338 37.238 -2.871 -3.066 1.00 14.43 C ATOM 5182 CD1 LEU A 338 37.002 -4.352 -3.398 1.00 22.35 C ATOM 5183 CD2 LEU A 338 38.444 -2.818 -2.131 1.00 19.97 C ATOM 5184 HA LEU A 338 37.831 -0.289 -3.307 1.00 0.00 H ATOM 5185 HB2 LEU A 338 36.835 -2.481 -5.147 1.00 0.00 H ATOM 5186 HB3 LEU A 338 38.547 -2.323 -4.688 1.00 0.00 H ATOM 5187 HG LEU A 338 36.377 -2.407 -2.586 1.00 0.00 H ATOM 5188 HD21 LEU A 338 39.301 -3.281 -2.619 1.00 0.00 H ATOM 5189 HD22 LEU A 338 38.675 -1.779 -1.897 1.00 0.00 H ATOM 5190 HD23 LEU A 338 38.213 -3.356 -1.212 1.00 0.00 H ATOM 5191 HD11 LEU A 338 36.149 -4.441 -4.071 1.00 0.00 H ATOM 5192 HD12 LEU A 338 37.890 -4.761 -3.879 1.00 0.00 H ATOM 5193 HD13 LEU A 338 36.799 -4.901 -2.479 1.00 0.00 H ATOM 5194 H LEU A 338 35.242 -1.001 -4.037 1.00 0.00 H ATOM 5195 N LYS A 339 37.173 0.301 -6.411 1.00 20.80 N ATOM 5196 CA LYS A 339 37.681 0.975 -7.598 1.00 14.46 C ATOM 5197 C LYS A 339 37.794 2.487 -7.438 1.00 23.48 C ATOM 5198 O LYS A 339 38.798 3.066 -7.883 1.00 30.10 O ATOM 5199 CB LYS A 339 36.959 0.712 -8.918 1.00 12.95 C ATOM 5200 CG LYS A 339 36.793 -0.770 -9.242 1.00 76.94 C ATOM 5201 CD LYS A 339 37.766 -1.654 -8.450 1.00 80.00 C ATOM 5202 CE LYS A 339 37.194 -2.941 -7.839 1.00 80.00 C ATOM 5203 NZ LYS A 339 38.217 -3.896 -7.341 1.00 80.00 N ATOM 5204 HA LYS A 339 38.662 0.507 -7.671 1.00 0.00 H ATOM 5205 HB2 LYS A 339 35.969 1.166 -8.866 1.00 0.00 H ATOM 5206 HB3 LYS A 339 37.529 1.178 -9.721 1.00 0.00 H ATOM 5207 HG2 LYS A 339 35.773 -1.069 -9.002 1.00 0.00 H ATOM 5208 HG3 LYS A 339 36.972 -0.918 -10.307 1.00 0.00 H ATOM 5209 HD2 LYS A 339 38.574 -1.940 -9.123 1.00 0.00 H ATOM 5210 HD3 LYS A 339 38.169 -1.053 -7.635 1.00 0.00 H ATOM 5211 HE2 LYS A 339 36.600 -3.445 -8.601 1.00 0.00 H ATOM 5212 HE3 LYS A 339 36.551 -2.665 -7.003 1.00 0.00 H ATOM 5213 HZ1 LYS A 339 38.834 -4.183 -8.128 1.00 0.00 H ATOM 5214 HZ2 LYS A 339 38.787 -3.437 -6.602 1.00 0.00 H ATOM 5215 HZ3 LYS A 339 37.744 -4.734 -6.946 1.00 0.00 H ATOM 5216 H LYS A 339 36.177 0.007 -6.366 1.00 0.00 H ATOM 5217 N HIS A 340 36.791 3.105 -6.813 1.00 16.20 N ATOM 5218 CA HIS A 340 36.724 4.553 -6.634 1.00 18.04 C ATOM 5219 C HIS A 340 36.980 5.248 -5.344 1.00 16.60 C ATOM 5220 O HIS A 340 37.292 6.422 -5.398 1.00 21.45 O ATOM 5221 CB HIS A 340 35.377 5.093 -7.117 1.00 16.15 C ATOM 5222 CG HIS A 340 35.085 4.529 -8.477 1.00 22.51 C ATOM 5223 ND1 HIS A 340 35.670 5.048 -9.627 1.00 26.06 N ATOM 5224 CD2 HIS A 340 34.296 3.489 -8.867 1.00 25.37 C ATOM 5225 CE1 HIS A 340 35.206 4.334 -10.670 1.00 28.56 C ATOM 5226 NE2 HIS A 340 34.374 3.394 -10.251 1.00 27.73 N ATOM 5227 HA HIS A 340 37.618 4.784 -7.213 1.00 0.00 H ATOM 5228 HB2 HIS A 340 34.593 4.795 -6.421 1.00 0.00 H ATOM 5229 HB3 HIS A 340 35.418 6.181 -7.173 1.00 0.00 H ATOM 5230 HD2 HIS A 340 33.709 2.847 -8.211 1.00 0.00 H ATOM 5231 HE1 HIS A 340 35.477 4.506 -11.712 1.00 0.00 H ATOM 5232 H HIS A 340 36.016 2.525 -6.433 1.00 0.00 H ATOM 5233 N LEU A 341 36.813 4.606 -4.209 1.00 15.23 N ATOM 5234 CA LEU A 341 37.040 5.268 -2.957 1.00 15.23 C ATOM 5235 C LEU A 341 37.588 4.273 -1.956 1.00 15.91 C ATOM 5236 O LEU A 341 37.127 4.113 -0.824 1.00 13.78 O ATOM 5237 CB LEU A 341 35.714 5.874 -2.454 1.00 17.98 C ATOM 5238 CG LEU A 341 34.452 4.979 -2.394 1.00 15.88 C ATOM 5239 CD1 LEU A 341 33.787 5.263 -1.016 1.00 12.87 C ATOM 5240 CD2 LEU A 341 33.514 5.272 -3.595 1.00 12.56 C ATOM 5241 HA LEU A 341 37.766 6.071 -3.084 1.00 0.00 H ATOM 5242 HB2 LEU A 341 35.894 6.241 -1.443 1.00 0.00 H ATOM 5243 HB3 LEU A 341 35.479 6.714 -3.107 1.00 0.00 H ATOM 5244 HG LEU A 341 34.694 3.919 -2.475 1.00 0.00 H ATOM 5245 HD21 LEU A 341 33.207 6.317 -3.568 1.00 0.00 H ATOM 5246 HD22 LEU A 341 34.045 5.072 -4.526 1.00 0.00 H ATOM 5247 HD23 LEU A 341 32.634 4.632 -3.532 1.00 0.00 H ATOM 5248 HD11 LEU A 341 34.486 5.012 -0.218 1.00 0.00 H ATOM 5249 HD12 LEU A 341 33.524 6.319 -0.952 1.00 0.00 H ATOM 5250 HD13 LEU A 341 32.887 4.656 -0.917 1.00 0.00 H ATOM 5251 H LEU A 341 36.514 3.610 -4.219 1.00 0.00 H ATOM 5252 N PRO A 342 38.620 3.569 -2.362 1.00 16.35 N ATOM 5253 CA PRO A 342 39.211 2.580 -1.519 1.00 16.16 C ATOM 5254 C PRO A 342 39.724 2.995 -0.160 1.00 24.60 C ATOM 5255 O PRO A 342 39.783 2.179 0.760 1.00 23.62 O ATOM 5256 CB PRO A 342 40.351 1.983 -2.347 1.00 20.99 C ATOM 5257 CG PRO A 342 40.518 2.861 -3.565 1.00 24.92 C ATOM 5258 CD PRO A 342 39.406 3.876 -3.556 1.00 17.83 C ATOM 5259 HA PRO A 342 38.412 1.892 -1.243 1.00 0.00 H ATOM 5260 HD3 PRO A 342 39.810 4.887 -3.499 1.00 0.00 H ATOM 5261 HD2 PRO A 342 38.794 3.781 -4.453 1.00 0.00 H ATOM 5262 HG3 PRO A 342 40.461 2.256 -4.470 1.00 0.00 H ATOM 5263 HG2 PRO A 342 41.483 3.367 -3.528 1.00 0.00 H ATOM 5264 HB2 PRO A 342 41.272 1.972 -1.764 1.00 0.00 H ATOM 5265 HB3 PRO A 342 40.102 0.966 -2.649 1.00 0.00 H ATOM 5266 N SER A 343 40.085 4.263 -0.038 1.00 18.85 N ATOM 5267 CA SER A 343 40.605 4.712 1.240 1.00 22.35 C ATOM 5268 C SER A 343 39.604 5.452 2.108 1.00 22.85 C ATOM 5269 O SER A 343 39.924 5.965 3.184 1.00 23.31 O ATOM 5270 CB SER A 343 41.937 5.473 1.046 1.00 47.66 C ATOM 5271 OG SER A 343 43.018 4.676 0.502 1.00 35.50 O ATOM 5272 HA SER A 343 40.815 3.814 1.822 1.00 0.00 H ATOM 5273 HB2 SER A 343 42.253 5.857 2.016 1.00 0.00 H ATOM 5274 HB3 SER A 343 41.756 6.307 0.368 1.00 0.00 H ATOM 5275 HG SER A 343 43.828 5.238 0.411 1.00 0.00 H ATOM 5276 H SER A 343 39.998 4.921 -0.839 1.00 0.00 H ATOM 5277 N ASP A 344 38.359 5.523 1.672 1.00 18.43 N ATOM 5278 CA ASP A 344 37.422 6.214 2.524 1.00 11.11 C ATOM 5279 C ASP A 344 37.266 5.467 3.865 1.00 17.59 C ATOM 5280 O ASP A 344 37.128 4.239 3.896 1.00 17.73 O ATOM 5281 CB ASP A 344 36.104 6.345 1.768 1.00 15.91 C ATOM 5282 CG ASP A 344 35.068 7.071 2.562 1.00 23.01 C ATOM 5283 OD1 ASP A 344 35.212 8.363 2.482 1.00 22.94 O ATOM 5284 OD2 ASP A 344 34.176 6.513 3.165 1.00 25.76 O ATOM 5285 HA ASP A 344 37.782 7.213 2.771 1.00 0.00 H ATOM 5286 HB2 ASP A 344 36.283 6.891 0.842 1.00 0.00 H ATOM 5287 HB3 ASP A 344 35.732 5.347 1.534 1.00 0.00 H ATOM 5288 H ASP A 344 38.070 5.104 0.765 1.00 0.00 H ATOM 5289 N PRO A 345 37.314 6.208 4.974 1.00 24.93 N ATOM 5290 CA PRO A 345 37.208 5.686 6.330 1.00 21.43 C ATOM 5291 C PRO A 345 35.888 5.042 6.662 1.00 29.54 C ATOM 5292 O PRO A 345 35.841 4.121 7.469 1.00 13.95 O ATOM 5293 CB PRO A 345 37.474 6.838 7.321 1.00 22.88 C ATOM 5294 CG PRO A 345 37.535 8.099 6.497 1.00 22.93 C ATOM 5295 CD PRO A 345 37.611 7.674 5.029 1.00 30.71 C ATOM 5296 HA PRO A 345 37.949 4.891 6.410 1.00 0.00 H ATOM 5297 HD3 PRO A 345 36.877 8.226 4.442 1.00 0.00 H ATOM 5298 HD2 PRO A 345 38.609 7.868 4.635 1.00 0.00 H ATOM 5299 HG3 PRO A 345 38.418 8.679 6.765 1.00 0.00 H ATOM 5300 HG2 PRO A 345 36.642 8.700 6.667 1.00 0.00 H ATOM 5301 HB2 PRO A 345 36.667 6.902 8.051 1.00 0.00 H ATOM 5302 HB3 PRO A 345 38.420 6.679 7.840 1.00 0.00 H ATOM 5303 N MET A 346 34.841 5.534 6.020 1.00 16.88 N ATOM 5304 CA MET A 346 33.553 4.913 6.294 1.00 14.45 C ATOM 5305 C MET A 346 33.447 3.574 5.547 1.00 10.44 C ATOM 5306 O MET A 346 32.888 2.557 6.001 1.00 15.80 O ATOM 5307 CB MET A 346 32.481 5.865 5.838 1.00 15.59 C ATOM 5308 CG MET A 346 31.172 5.503 6.470 1.00 34.64 C ATOM 5309 SD MET A 346 30.372 7.014 7.018 1.00 60.59 S ATOM 5310 CE MET A 346 29.879 6.453 8.673 1.00 51.45 C ATOM 5311 HA MET A 346 33.441 4.708 7.359 1.00 0.00 H ATOM 5312 HB2 MET A 346 32.753 6.880 6.126 1.00 0.00 H ATOM 5313 HB3 MET A 346 32.386 5.810 4.754 1.00 0.00 H ATOM 5314 HG2 MET A 346 31.343 4.846 7.323 1.00 0.00 H ATOM 5315 HG3 MET A 346 30.540 4.994 5.743 1.00 0.00 H ATOM 5316 HE1 MET A 346 29.218 5.591 8.581 1.00 0.00 H ATOM 5317 HE2 MET A 346 30.767 6.173 9.240 1.00 0.00 H ATOM 5318 HE3 MET A 346 29.357 7.260 9.188 1.00 0.00 H ATOM 5319 H MET A 346 34.934 6.326 5.352 1.00 0.00 H ATOM 5320 N PHE A 347 34.033 3.598 4.361 1.00 11.52 N ATOM 5321 CA PHE A 347 34.051 2.428 3.527 1.00 13.54 C ATOM 5322 C PHE A 347 34.846 1.400 4.308 1.00 16.53 C ATOM 5323 O PHE A 347 34.456 0.232 4.434 1.00 16.12 O ATOM 5324 CB PHE A 347 34.749 2.692 2.169 1.00 16.00 C ATOM 5325 CG PHE A 347 35.164 1.420 1.458 1.00 18.55 C ATOM 5326 CD1 PHE A 347 34.222 0.396 1.352 1.00 20.75 C ATOM 5327 CD2 PHE A 347 36.430 1.194 0.914 1.00 20.88 C ATOM 5328 CE1 PHE A 347 34.513 -0.822 0.733 1.00 15.37 C ATOM 5329 CE2 PHE A 347 36.734 -0.012 0.275 1.00 17.85 C ATOM 5330 CZ PHE A 347 35.779 -1.031 0.187 1.00 17.31 C ATOM 5331 HA PHE A 347 33.036 2.105 3.296 1.00 0.00 H ATOM 5332 HB2 PHE A 347 34.061 3.241 1.526 1.00 0.00 H ATOM 5333 HB3 PHE A 347 35.638 3.296 2.347 1.00 0.00 H ATOM 5334 HD2 PHE A 347 37.193 1.969 0.989 1.00 0.00 H ATOM 5335 HE2 PHE A 347 37.723 -0.160 -0.158 1.00 0.00 H ATOM 5336 HZ PHE A 347 36.021 -1.975 -0.301 1.00 0.00 H ATOM 5337 HE1 PHE A 347 33.756 -1.604 0.677 1.00 0.00 H ATOM 5338 HD1 PHE A 347 33.226 0.552 1.766 1.00 0.00 H ATOM 5339 H PHE A 347 34.486 4.473 4.029 1.00 0.00 H ATOM 5340 N LYS A 348 35.987 1.835 4.850 1.00 12.09 N ATOM 5341 CA LYS A 348 36.823 0.949 5.619 1.00 17.83 C ATOM 5342 C LYS A 348 36.080 0.333 6.805 1.00 9.66 C ATOM 5343 O LYS A 348 36.257 -0.832 7.142 1.00 14.68 O ATOM 5344 CB LYS A 348 38.130 1.665 5.957 1.00 21.98 C ATOM 5345 CG LYS A 348 39.025 1.763 4.727 1.00 32.09 C ATOM 5346 CD LYS A 348 39.874 3.025 4.734 1.00 80.00 C ATOM 5347 CE LYS A 348 41.330 2.714 5.054 1.00 80.00 C ATOM 5348 NZ LYS A 348 41.707 1.318 4.737 1.00 80.00 N ATOM 5349 HA LYS A 348 37.094 0.076 5.025 1.00 0.00 H ATOM 5350 HB2 LYS A 348 37.905 2.669 6.317 1.00 0.00 H ATOM 5351 HB3 LYS A 348 38.652 1.109 6.736 1.00 0.00 H ATOM 5352 HG2 LYS A 348 39.685 0.896 4.702 1.00 0.00 H ATOM 5353 HG3 LYS A 348 38.398 1.766 3.835 1.00 0.00 H ATOM 5354 HD2 LYS A 348 39.819 3.495 3.752 1.00 0.00 H ATOM 5355 HD3 LYS A 348 39.484 3.711 5.486 1.00 0.00 H ATOM 5356 HE2 LYS A 348 41.497 2.886 6.117 1.00 0.00 H ATOM 5357 HE3 LYS A 348 41.964 3.385 4.475 1.00 0.00 H ATOM 5358 HZ1 LYS A 348 41.115 0.666 5.291 1.00 0.00 H ATOM 5359 HZ2 LYS A 348 41.562 1.143 3.722 1.00 0.00 H ATOM 5360 HZ3 LYS A 348 42.708 1.168 4.976 1.00 0.00 H ATOM 5361 H LYS A 348 36.275 2.825 4.715 1.00 0.00 H ATOM 5362 N LEU A 349 35.214 1.122 7.421 1.00 11.65 N ATOM 5363 CA LEU A 349 34.413 0.663 8.542 1.00 11.51 C ATOM 5364 C LEU A 349 33.405 -0.391 8.034 1.00 13.37 C ATOM 5365 O LEU A 349 33.245 -1.488 8.585 1.00 12.82 O ATOM 5366 CB LEU A 349 33.778 1.881 9.221 1.00 9.16 C ATOM 5367 CG LEU A 349 32.744 1.578 10.292 1.00 21.30 C ATOM 5368 CD1 LEU A 349 33.443 0.825 11.414 1.00 31.37 C ATOM 5369 CD2 LEU A 349 32.194 2.905 10.830 1.00 20.14 C ATOM 5370 HA LEU A 349 35.011 0.166 9.305 1.00 0.00 H ATOM 5371 HB2 LEU A 349 34.577 2.461 9.682 1.00 0.00 H ATOM 5372 HB3 LEU A 349 33.295 2.480 8.449 1.00 0.00 H ATOM 5373 HG LEU A 349 31.925 0.981 9.890 1.00 0.00 H ATOM 5374 HD21 LEU A 349 33.010 3.489 11.256 1.00 0.00 H ATOM 5375 HD22 LEU A 349 31.733 3.463 10.015 1.00 0.00 H ATOM 5376 HD23 LEU A 349 31.450 2.703 11.600 1.00 0.00 H ATOM 5377 HD11 LEU A 349 33.864 -0.101 11.021 1.00 0.00 H ATOM 5378 HD12 LEU A 349 34.242 1.444 11.823 1.00 0.00 H ATOM 5379 HD13 LEU A 349 32.723 0.594 12.199 1.00 0.00 H ATOM 5380 H LEU A 349 35.104 2.102 7.092 1.00 0.00 H ATOM 5381 N VAL A 350 32.727 -0.048 6.921 1.00 7.88 N ATOM 5382 CA VAL A 350 31.786 -1.002 6.325 1.00 4.64 C ATOM 5383 C VAL A 350 32.503 -2.360 5.997 1.00 8.71 C ATOM 5384 O VAL A 350 32.000 -3.469 6.196 1.00 13.95 O ATOM 5385 CB VAL A 350 31.124 -0.382 5.120 1.00 6.35 C ATOM 5386 CG1 VAL A 350 30.413 -1.389 4.190 1.00 9.68 C ATOM 5387 CG2 VAL A 350 30.282 0.804 5.559 1.00 10.89 C ATOM 5388 HA VAL A 350 31.000 -1.237 7.042 1.00 0.00 H ATOM 5389 HB VAL A 350 31.904 0.001 4.462 1.00 0.00 H ATOM 5390 HG11 VAL A 350 31.139 -2.112 3.817 1.00 0.00 H ATOM 5391 HG12 VAL A 350 29.634 -1.909 4.748 1.00 0.00 H ATOM 5392 HG13 VAL A 350 29.966 -0.855 3.352 1.00 0.00 H ATOM 5393 HG21 VAL A 350 29.519 0.466 6.260 1.00 0.00 H ATOM 5394 HG22 VAL A 350 30.921 1.542 6.043 1.00 0.00 H ATOM 5395 HG23 VAL A 350 29.804 1.251 4.687 1.00 0.00 H ATOM 5396 H VAL A 350 32.870 0.887 6.488 1.00 0.00 H ATOM 5397 N ALA A 351 33.760 -2.271 5.496 1.00 8.91 N ATOM 5398 CA ALA A 351 34.552 -3.454 5.156 1.00 10.89 C ATOM 5399 C ALA A 351 34.845 -4.254 6.409 1.00 17.46 C ATOM 5400 O ALA A 351 34.763 -5.496 6.443 1.00 15.18 O ATOM 5401 CB ALA A 351 35.824 -3.123 4.416 1.00 12.62 C ATOM 5402 HA ALA A 351 33.955 -4.056 4.471 1.00 0.00 H ATOM 5403 HB1 ALA A 351 35.579 -2.611 3.486 1.00 0.00 H ATOM 5404 HB2 ALA A 351 36.445 -2.476 5.035 1.00 0.00 H ATOM 5405 HB3 ALA A 351 36.364 -4.044 4.194 1.00 0.00 H ATOM 5406 H ALA A 351 34.176 -1.329 5.348 1.00 0.00 H ATOM 5407 N GLN A 352 35.190 -3.529 7.448 1.00 12.60 N ATOM 5408 CA GLN A 352 35.509 -4.185 8.710 1.00 14.05 C ATOM 5409 C GLN A 352 34.341 -4.882 9.338 1.00 8.31 C ATOM 5410 O GLN A 352 34.469 -5.928 9.972 1.00 17.27 O ATOM 5411 CB GLN A 352 35.990 -3.139 9.724 1.00 16.29 C ATOM 5412 CG GLN A 352 36.742 -3.748 10.915 1.00 20.42 C ATOM 5413 CD GLN A 352 37.207 -2.667 11.918 1.00 39.41 C ATOM 5414 OE1 GLN A 352 37.811 -2.986 12.961 1.00 80.00 O ATOM 5415 NE2 GLN A 352 37.135 -1.386 11.521 1.00 29.45 N ATOM 5416 HA GLN A 352 36.271 -4.927 8.471 1.00 0.00 H ATOM 5417 HB2 GLN A 352 36.656 -2.443 9.214 1.00 0.00 H ATOM 5418 HB3 GLN A 352 35.122 -2.599 10.102 1.00 0.00 H ATOM 5419 HG2 GLN A 352 36.081 -4.446 11.430 1.00 0.00 H ATOM 5420 HG3 GLN A 352 37.616 -4.284 10.544 1.00 0.00 H ATOM 5421 HE22 GLN A 352 36.626 -1.140 10.648 1.00 0.00 H ATOM 5422 HE21 GLN A 352 37.588 -0.640 12.087 1.00 0.00 H ATOM 5423 H GLN A 352 35.235 -2.493 7.371 1.00 0.00 H ATOM 5424 N LEU A 353 33.157 -4.283 9.175 1.00 10.62 N ATOM 5425 CA LEU A 353 31.986 -4.907 9.764 1.00 9.71 C ATOM 5426 C LEU A 353 31.642 -6.203 9.066 1.00 20.52 C ATOM 5427 O LEU A 353 31.029 -7.050 9.709 1.00 14.06 O ATOM 5428 CB LEU A 353 30.766 -3.998 9.702 1.00 9.98 C ATOM 5429 CG LEU A 353 30.880 -2.800 10.619 1.00 17.10 C ATOM 5430 CD1 LEU A 353 29.882 -1.726 10.197 1.00 18.89 C ATOM 5431 CD2 LEU A 353 30.632 -3.226 12.057 1.00 8.51 C ATOM 5432 HA LEU A 353 32.241 -5.101 10.806 1.00 0.00 H ATOM 5433 HB2 LEU A 353 30.647 -3.643 8.678 1.00 0.00 H ATOM 5434 HB3 LEU A 353 29.887 -4.575 9.990 1.00 0.00 H ATOM 5435 HG LEU A 353 31.886 -2.385 10.548 1.00 0.00 H ATOM 5436 HD21 LEU A 353 29.632 -3.651 12.141 1.00 0.00 H ATOM 5437 HD22 LEU A 353 31.371 -3.973 12.346 1.00 0.00 H ATOM 5438 HD23 LEU A 353 30.716 -2.358 12.711 1.00 0.00 H ATOM 5439 HD11 LEU A 353 30.094 -1.417 9.173 1.00 0.00 H ATOM 5440 HD12 LEU A 353 28.871 -2.129 10.255 1.00 0.00 H ATOM 5441 HD13 LEU A 353 29.971 -0.867 10.863 1.00 0.00 H ATOM 5442 H LEU A 353 33.077 -3.394 8.641 1.00 0.00 H ATOM 5443 N TYR A 354 32.036 -6.347 7.769 1.00 11.74 N ATOM 5444 CA TYR A 354 31.741 -7.571 7.004 1.00 6.48 C ATOM 5445 C TYR A 354 32.445 -8.757 7.631 1.00 5.20 C ATOM 5446 O TYR A 354 32.011 -9.907 7.568 1.00 7.49 O ATOM 5447 CB TYR A 354 32.130 -7.323 5.534 1.00 14.55 C ATOM 5448 CG TYR A 354 31.723 -8.446 4.621 1.00 8.72 C ATOM 5449 CD1 TYR A 354 30.627 -9.272 4.876 1.00 12.33 C ATOM 5450 CD2 TYR A 354 32.452 -8.715 3.466 1.00 14.00 C ATOM 5451 CE1 TYR A 354 30.266 -10.316 4.021 1.00 9.10 C ATOM 5452 CE2 TYR A 354 32.105 -9.744 2.592 1.00 16.84 C ATOM 5453 CZ TYR A 354 31.016 -10.567 2.873 1.00 11.76 C ATOM 5454 OH TYR A 354 30.652 -11.589 2.000 1.00 18.67 O ATOM 5455 HA TYR A 354 30.678 -7.813 7.028 1.00 0.00 H ATOM 5456 HB3 TYR A 354 33.212 -7.203 5.476 1.00 0.00 H ATOM 5457 HB2 TYR A 354 31.645 -6.407 5.196 1.00 0.00 H ATOM 5458 HD2 TYR A 354 33.323 -8.101 3.237 1.00 0.00 H ATOM 5459 HE2 TYR A 354 32.688 -9.906 1.685 1.00 0.00 H ATOM 5460 HE1 TYR A 354 29.398 -10.934 4.251 1.00 0.00 H ATOM 5461 HD1 TYR A 354 30.033 -9.096 5.773 1.00 0.00 H ATOM 5462 HH TYR A 354 29.862 -12.064 2.361 1.00 0.00 H ATOM 5463 H TYR A 354 32.557 -5.574 7.308 1.00 0.00 H ATOM 5464 N LYS A 355 33.588 -8.419 8.230 1.00 8.13 N ATOM 5465 CA LYS A 355 34.376 -9.433 8.901 1.00 14.22 C ATOM 5466 C LYS A 355 33.819 -9.768 10.286 1.00 19.26 C ATOM 5467 O LYS A 355 34.062 -10.840 10.863 1.00 15.14 O ATOM 5468 CB LYS A 355 35.771 -8.916 9.120 1.00 10.52 C ATOM 5469 CG LYS A 355 36.533 -8.710 7.832 1.00 15.48 C ATOM 5470 CD LYS A 355 37.900 -8.053 8.054 1.00 26.46 C ATOM 5471 CE LYS A 355 38.744 -8.004 6.795 1.00 40.27 C ATOM 5472 NZ LYS A 355 38.822 -9.320 6.141 1.00 80.00 N ATOM 5473 HA LYS A 355 34.355 -10.320 8.268 1.00 0.00 H ATOM 5474 HB2 LYS A 355 35.710 -7.962 9.644 1.00 0.00 H ATOM 5475 HB3 LYS A 355 36.315 -9.633 9.735 1.00 0.00 H ATOM 5476 HG2 LYS A 355 36.684 -9.679 7.357 1.00 0.00 H ATOM 5477 HG3 LYS A 355 35.942 -8.073 7.174 1.00 0.00 H ATOM 5478 HD2 LYS A 355 37.743 -7.034 8.407 1.00 0.00 H ATOM 5479 HD3 LYS A 355 38.439 -8.620 8.813 1.00 0.00 H ATOM 5480 HE2 LYS A 355 39.751 -7.679 7.057 1.00 0.00 H ATOM 5481 HE3 LYS A 355 38.302 -7.290 6.101 1.00 0.00 H ATOM 5482 HZ1 LYS A 355 39.249 -10.006 6.796 1.00 0.00 H ATOM 5483 HZ2 LYS A 355 37.865 -9.635 5.882 1.00 0.00 H ATOM 5484 HZ3 LYS A 355 39.407 -9.246 5.284 1.00 0.00 H ATOM 5485 H LYS A 355 33.912 -7.431 8.215 1.00 0.00 H ATOM 5486 N ILE A 356 33.035 -8.865 10.857 1.00 9.27 N ATOM 5487 CA ILE A 356 32.496 -9.130 12.202 1.00 8.63 C ATOM 5488 C ILE A 356 31.028 -9.383 12.418 1.00 14.66 C ATOM 5489 O ILE A 356 30.654 -10.269 13.183 1.00 10.85 O ATOM 5490 CB ILE A 356 32.838 -7.937 13.096 1.00 13.80 C ATOM 5491 CG1 ILE A 356 34.307 -7.604 12.954 1.00 21.49 C ATOM 5492 CG2 ILE A 356 32.472 -8.170 14.571 1.00 15.45 C ATOM 5493 CD1 ILE A 356 34.712 -6.413 13.791 1.00 34.29 C ATOM 5494 HA ILE A 356 32.963 -10.089 12.426 1.00 0.00 H ATOM 5495 HB ILE A 356 32.234 -7.093 12.763 1.00 0.00 H ATOM 5496 HG12 ILE A 356 34.894 -8.468 13.267 1.00 0.00 H ATOM 5497 HG13 ILE A 356 34.517 -7.384 11.907 1.00 0.00 H ATOM 5498 HD11 ILE A 356 34.137 -5.540 13.481 1.00 0.00 H ATOM 5499 HD12 ILE A 356 34.515 -6.625 14.842 1.00 0.00 H ATOM 5500 HD13 ILE A 356 35.775 -6.217 13.652 1.00 0.00 H ATOM 5501 HG21 ILE A 356 31.400 -8.351 14.654 1.00 0.00 H ATOM 5502 HG22 ILE A 356 33.018 -9.035 14.947 1.00 0.00 H ATOM 5503 HG23 ILE A 356 32.739 -7.288 15.154 1.00 0.00 H ATOM 5504 H ILE A 356 32.803 -7.980 10.362 1.00 0.00 H ATOM 5505 N VAL A 357 30.181 -8.599 11.804 1.00 14.67 N ATOM 5506 CA VAL A 357 28.775 -8.816 12.036 1.00 12.97 C ATOM 5507 C VAL A 357 28.190 -10.224 11.775 1.00 8.48 C ATOM 5508 O VAL A 357 27.396 -10.776 12.571 1.00 8.14 O ATOM 5509 CB VAL A 357 27.990 -7.735 11.279 1.00 11.64 C ATOM 5510 CG1 VAL A 357 26.496 -7.950 11.501 1.00 10.70 C ATOM 5511 CG2 VAL A 357 28.455 -6.318 11.649 1.00 8.85 C ATOM 5512 HA VAL A 357 28.662 -8.743 13.118 1.00 0.00 H ATOM 5513 HB VAL A 357 28.191 -7.829 10.212 1.00 0.00 H ATOM 5514 HG11 VAL A 357 26.213 -8.935 11.130 1.00 0.00 H ATOM 5515 HG12 VAL A 357 26.275 -7.884 12.566 1.00 0.00 H ATOM 5516 HG13 VAL A 357 25.936 -7.184 10.965 1.00 0.00 H ATOM 5517 HG21 VAL A 357 28.312 -6.157 12.718 1.00 0.00 H ATOM 5518 HG22 VAL A 357 29.511 -6.207 11.402 1.00 0.00 H ATOM 5519 HG23 VAL A 357 27.871 -5.588 11.089 1.00 0.00 H ATOM 5520 H VAL A 357 30.511 -7.844 11.169 1.00 0.00 H ATOM 5521 N PRO A 358 28.551 -10.839 10.645 1.00 9.19 N ATOM 5522 CA PRO A 358 28.015 -12.152 10.343 1.00 8.00 C ATOM 5523 C PRO A 358 28.347 -13.122 11.440 1.00 7.67 C ATOM 5524 O PRO A 358 27.493 -13.879 11.852 1.00 9.80 O ATOM 5525 CB PRO A 358 28.636 -12.528 9.008 1.00 6.19 C ATOM 5526 CG PRO A 358 29.118 -11.245 8.367 1.00 6.61 C ATOM 5527 CD PRO A 358 29.329 -10.266 9.512 1.00 5.15 C ATOM 5528 HA PRO A 358 26.927 -12.165 10.277 1.00 0.00 H ATOM 5529 HD3 PRO A 358 30.386 -10.195 9.768 1.00 0.00 H ATOM 5530 HD2 PRO A 358 28.953 -9.278 9.248 1.00 0.00 H ATOM 5531 HG3 PRO A 358 28.370 -10.862 7.673 1.00 0.00 H ATOM 5532 HG2 PRO A 358 30.054 -11.414 7.834 1.00 0.00 H ATOM 5533 HB2 PRO A 358 29.474 -13.207 9.163 1.00 0.00 H ATOM 5534 HB3 PRO A 358 27.893 -13.009 8.371 1.00 0.00 H ATOM 5535 N ASN A 359 29.560 -13.058 11.962 1.00 12.57 N ATOM 5536 CA ASN A 359 29.984 -13.937 13.058 1.00 12.12 C ATOM 5537 C ASN A 359 29.195 -13.718 14.349 1.00 16.58 C ATOM 5538 O ASN A 359 28.829 -14.621 15.077 1.00 18.41 O ATOM 5539 CB ASN A 359 31.499 -13.775 13.330 1.00 3.78 C ATOM 5540 CG ASN A 359 32.338 -14.102 12.088 1.00 26.71 C ATOM 5541 OD1 ASN A 359 32.926 -13.217 11.453 1.00 45.83 O ATOM 5542 ND2 ASN A 359 32.194 -15.331 11.651 1.00 21.64 N ATOM 5543 HA ASN A 359 29.775 -14.955 12.729 1.00 0.00 H ATOM 5544 HB2 ASN A 359 31.696 -12.745 13.629 1.00 0.00 H ATOM 5545 HB3 ASN A 359 31.787 -14.448 14.138 1.00 0.00 H ATOM 5546 HD22 ASN A 359 31.690 -16.033 12.229 1.00 0.00 H ATOM 5547 HD21 ASN A 359 32.584 -15.603 10.726 1.00 0.00 H ATOM 5548 H ASN A 359 30.235 -12.363 11.584 1.00 0.00 H ATOM 5549 N VAL A 360 28.927 -12.475 14.671 1.00 6.72 N ATOM 5550 CA VAL A 360 28.167 -12.194 15.844 1.00 13.82 C ATOM 5551 C VAL A 360 26.735 -12.672 15.598 1.00 16.06 C ATOM 5552 O VAL A 360 26.124 -13.258 16.465 1.00 13.01 O ATOM 5553 CB VAL A 360 28.128 -10.690 16.133 1.00 14.20 C ATOM 5554 CG1 VAL A 360 27.137 -10.460 17.296 1.00 12.80 C ATOM 5555 CG2 VAL A 360 29.498 -10.189 16.538 1.00 12.72 C ATOM 5556 HA VAL A 360 28.625 -12.699 16.694 1.00 0.00 H ATOM 5557 HB VAL A 360 27.817 -10.150 15.239 1.00 0.00 H ATOM 5558 HG11 VAL A 360 26.149 -10.816 17.005 1.00 0.00 H ATOM 5559 HG12 VAL A 360 27.478 -11.007 18.175 1.00 0.00 H ATOM 5560 HG13 VAL A 360 27.088 -9.395 17.525 1.00 0.00 H ATOM 5561 HG21 VAL A 360 29.824 -10.713 17.436 1.00 0.00 H ATOM 5562 HG22 VAL A 360 30.205 -10.375 15.730 1.00 0.00 H ATOM 5563 HG23 VAL A 360 29.447 -9.119 16.739 1.00 0.00 H ATOM 5564 H VAL A 360 29.268 -11.696 14.072 1.00 0.00 H ATOM 5565 N LEU A 361 26.148 -12.436 14.427 1.00 12.04 N ATOM 5566 CA LEU A 361 24.784 -12.876 14.192 1.00 11.07 C ATOM 5567 C LEU A 361 24.666 -14.401 14.290 1.00 14.28 C ATOM 5568 O LEU A 361 23.670 -14.939 14.769 1.00 12.25 O ATOM 5569 CB LEU A 361 24.291 -12.481 12.762 1.00 11.30 C ATOM 5570 CG LEU A 361 23.901 -11.012 12.621 1.00 6.26 C ATOM 5571 CD1 LEU A 361 23.321 -10.767 11.224 1.00 14.15 C ATOM 5572 CD2 LEU A 361 22.894 -10.644 13.732 1.00 11.02 C ATOM 5573 HA LEU A 361 24.178 -12.389 14.956 1.00 0.00 H ATOM 5574 HB2 LEU A 361 25.091 -12.693 12.053 1.00 0.00 H ATOM 5575 HB3 LEU A 361 23.421 -13.091 12.519 1.00 0.00 H ATOM 5576 HG LEU A 361 24.778 -10.374 12.734 1.00 0.00 H ATOM 5577 HD21 LEU A 361 22.006 -11.269 13.637 1.00 0.00 H ATOM 5578 HD22 LEU A 361 23.354 -10.809 14.706 1.00 0.00 H ATOM 5579 HD23 LEU A 361 22.614 -9.595 13.634 1.00 0.00 H ATOM 5580 HD11 LEU A 361 24.069 -11.018 10.472 1.00 0.00 H ATOM 5581 HD12 LEU A 361 22.439 -11.392 11.083 1.00 0.00 H ATOM 5582 HD13 LEU A 361 23.043 -9.717 11.126 1.00 0.00 H ATOM 5583 H LEU A 361 26.668 -11.935 13.678 1.00 0.00 H ATOM 5584 N LEU A 362 25.692 -15.078 13.808 1.00 11.92 N ATOM 5585 CA LEU A 362 25.717 -16.525 13.844 1.00 13.27 C ATOM 5586 C LEU A 362 25.799 -16.920 15.307 1.00 18.73 C ATOM 5587 O LEU A 362 25.127 -17.810 15.787 1.00 21.49 O ATOM 5588 CB LEU A 362 27.020 -17.060 13.212 1.00 24.72 C ATOM 5589 CG LEU A 362 27.005 -17.377 11.717 1.00 39.39 C ATOM 5590 CD1 LEU A 362 28.341 -16.996 11.061 1.00 37.76 C ATOM 5591 CD2 LEU A 362 26.714 -18.848 11.483 1.00 21.64 C ATOM 5592 HA LEU A 362 24.844 -16.914 13.319 1.00 0.00 H ATOM 5593 HB2 LEU A 362 27.795 -16.311 13.379 1.00 0.00 H ATOM 5594 HB3 LEU A 362 27.284 -17.978 13.737 1.00 0.00 H ATOM 5595 HG LEU A 362 26.213 -16.785 11.259 1.00 0.00 H ATOM 5596 HD21 LEU A 362 27.485 -19.450 11.964 1.00 0.00 H ATOM 5597 HD22 LEU A 362 25.741 -19.096 11.906 1.00 0.00 H ATOM 5598 HD23 LEU A 362 26.708 -19.050 10.412 1.00 0.00 H ATOM 5599 HD11 LEU A 362 28.517 -15.928 11.191 1.00 0.00 H ATOM 5600 HD12 LEU A 362 29.148 -17.558 11.530 1.00 0.00 H ATOM 5601 HD13 LEU A 362 28.303 -17.232 9.998 1.00 0.00 H ATOM 5602 H LEU A 362 26.496 -14.563 13.395 1.00 0.00 H ATOM 5603 N GLU A 363 26.645 -16.233 16.055 1.00 14.41 N ATOM 5604 CA GLU A 363 26.771 -16.559 17.466 1.00 13.39 C ATOM 5605 C GLU A 363 25.458 -16.405 18.189 1.00 18.14 C ATOM 5606 O GLU A 363 25.022 -17.233 18.994 1.00 20.08 O ATOM 5607 CB GLU A 363 28.061 -15.977 18.067 1.00 22.66 C ATOM 5608 CG GLU A 363 27.942 -15.348 19.454 1.00 70.63 C ATOM 5609 CD GLU A 363 29.201 -14.588 19.775 1.00 76.79 C ATOM 5610 OE1 GLU A 363 30.053 -14.333 18.946 1.00 52.09 O ATOM 5611 OE2 GLU A 363 29.314 -14.280 21.040 1.00 80.00 O ATOM 5612 HA GLU A 363 26.951 -17.623 17.617 1.00 0.00 H ATOM 5613 HB2 GLU A 363 28.791 -16.784 18.130 1.00 0.00 H ATOM 5614 HB3 GLU A 363 28.428 -15.210 17.385 1.00 0.00 H ATOM 5615 HG2 GLU A 363 27.092 -14.666 19.471 1.00 0.00 H ATOM 5616 HG3 GLU A 363 27.792 -16.132 20.196 1.00 0.00 H ATOM 5617 H GLU A 363 27.214 -15.468 15.639 1.00 0.00 H ATOM 5618 N GLN A 364 24.777 -15.333 17.888 1.00 10.43 N ATOM 5619 CA GLN A 364 23.495 -15.110 18.505 1.00 8.89 C ATOM 5620 C GLN A 364 22.508 -16.210 18.146 1.00 27.15 C ATOM 5621 O GLN A 364 21.583 -16.507 18.875 1.00 24.13 O ATOM 5622 CB GLN A 364 22.888 -13.783 18.082 1.00 19.06 C ATOM 5623 CG GLN A 364 21.599 -13.568 18.901 1.00 17.24 C ATOM 5624 CD GLN A 364 20.785 -12.459 18.279 1.00 27.56 C ATOM 5625 OE1 GLN A 364 20.177 -11.653 18.992 1.00 37.31 O ATOM 5626 NE2 GLN A 364 20.879 -12.374 16.963 1.00 14.78 N ATOM 5627 HA GLN A 364 23.675 -15.105 19.580 1.00 0.00 H ATOM 5628 HB2 GLN A 364 23.592 -12.974 18.279 1.00 0.00 H ATOM 5629 HB3 GLN A 364 22.652 -13.806 17.018 1.00 0.00 H ATOM 5630 HG2 GLN A 364 21.015 -14.488 18.907 1.00 0.00 H ATOM 5631 HG3 GLN A 364 21.859 -13.298 19.924 1.00 0.00 H ATOM 5632 HE22 GLN A 364 21.410 -13.094 16.432 1.00 0.00 H ATOM 5633 HE21 GLN A 364 20.422 -11.588 16.459 1.00 0.00 H ATOM 5634 H GLN A 364 25.157 -14.645 17.207 1.00 0.00 H ATOM 5635 N GLY A 365 22.664 -16.842 16.991 1.00 16.45 N ATOM 5636 CA GLY A 365 21.746 -17.911 16.588 1.00 30.67 C ATOM 5637 C GLY A 365 20.272 -17.609 16.236 1.00 23.25 C ATOM 5638 O GLY A 365 19.438 -18.530 16.222 1.00 27.67 O ATOM 5639 HA3 GLY A 365 21.727 -18.628 17.408 1.00 0.00 H ATOM 5640 HA2 GLY A 365 22.185 -18.380 15.707 1.00 0.00 H ATOM 5641 H GLY A 365 23.449 -16.576 16.362 1.00 0.00 H ATOM 5642 N LYS A 366 19.910 -16.368 15.938 1.00 13.81 N ATOM 5643 CA LYS A 366 18.531 -16.127 15.604 1.00 12.68 C ATOM 5644 C LYS A 366 18.362 -15.878 14.078 1.00 11.57 C ATOM 5645 O LYS A 366 17.421 -16.430 13.448 1.00 14.36 O ATOM 5646 CB LYS A 366 18.078 -14.905 16.382 1.00 23.02 C ATOM 5647 CG LYS A 366 17.279 -15.222 17.629 1.00 40.07 C ATOM 5648 CD LYS A 366 16.821 -13.949 18.323 1.00 29.01 C ATOM 5649 CE LYS A 366 15.567 -13.309 17.730 1.00 75.73 C ATOM 5650 NZ LYS A 366 15.553 -11.830 17.814 1.00 59.13 N ATOM 5651 HA LYS A 366 17.929 -16.998 15.862 1.00 0.00 H ATOM 5652 HB2 LYS A 366 18.962 -14.340 16.677 1.00 0.00 H ATOM 5653 HB3 LYS A 366 17.459 -14.292 15.726 1.00 0.00 H ATOM 5654 HG2 LYS A 366 16.405 -15.811 17.352 1.00 0.00 H ATOM 5655 HG3 LYS A 366 17.901 -15.798 18.314 1.00 0.00 H ATOM 5656 HD2 LYS A 366 16.619 -14.186 19.367 1.00 0.00 H ATOM 5657 HD3 LYS A 366 17.631 -13.222 18.267 1.00 0.00 H ATOM 5658 HE2 LYS A 366 14.699 -13.692 18.266 1.00 0.00 H ATOM 5659 HE3 LYS A 366 15.499 -13.594 16.680 1.00 0.00 H ATOM 5660 HZ1 LYS A 366 15.606 -11.540 18.811 1.00 0.00 H ATOM 5661 HZ2 LYS A 366 16.370 -11.447 17.297 1.00 0.00 H ATOM 5662 HZ3 LYS A 366 14.674 -11.468 17.393 1.00 0.00 H ATOM 5663 H LYS A 366 20.602 -15.592 15.946 1.00 0.00 H ATOM 5664 N ALA A 367 19.224 -15.063 13.463 1.00 14.67 N ATOM 5665 CA ALA A 367 19.050 -14.804 12.043 1.00 12.66 C ATOM 5666 C ALA A 367 19.260 -16.022 11.176 1.00 16.76 C ATOM 5667 O ALA A 367 20.146 -16.797 11.433 1.00 15.96 O ATOM 5668 CB ALA A 367 19.967 -13.729 11.522 1.00 8.42 C ATOM 5669 HA ALA A 367 18.012 -14.480 11.975 1.00 0.00 H ATOM 5670 HB1 ALA A 367 19.773 -12.798 12.054 1.00 0.00 H ATOM 5671 HB2 ALA A 367 21.003 -14.029 11.679 1.00 0.00 H ATOM 5672 HB3 ALA A 367 19.787 -13.584 10.457 1.00 0.00 H ATOM 5673 H ALA A 367 20.005 -14.622 13.990 1.00 0.00 H ATOM 5674 N LYS A 368 18.473 -16.192 10.144 1.00 7.25 N ATOM 5675 CA LYS A 368 18.657 -17.319 9.260 1.00 11.15 C ATOM 5676 C LYS A 368 19.762 -16.996 8.252 1.00 12.98 C ATOM 5677 O LYS A 368 20.527 -17.856 7.813 1.00 21.58 O ATOM 5678 CB LYS A 368 17.403 -17.708 8.486 1.00 9.73 C ATOM 5679 CG LYS A 368 16.152 -17.807 9.342 1.00 37.10 C ATOM 5680 CD LYS A 368 15.511 -19.164 9.278 1.00 27.13 C ATOM 5681 CE LYS A 368 15.385 -19.792 10.663 1.00 80.00 C ATOM 5682 NZ LYS A 368 14.318 -20.810 10.752 1.00 80.00 N ATOM 5683 HA LYS A 368 18.919 -18.164 9.897 1.00 0.00 H ATOM 5684 HB2 LYS A 368 17.231 -16.959 7.713 1.00 0.00 H ATOM 5685 HB3 LYS A 368 17.576 -18.677 8.018 1.00 0.00 H ATOM 5686 HG2 LYS A 368 16.420 -17.596 10.377 1.00 0.00 H ATOM 5687 HG3 LYS A 368 15.433 -17.065 8.996 1.00 0.00 H ATOM 5688 HD2 LYS A 368 14.517 -19.066 8.842 1.00 0.00 H ATOM 5689 HD3 LYS A 368 16.119 -19.814 8.649 1.00 0.00 H ATOM 5690 HE2 LYS A 368 15.170 -19.002 11.382 1.00 0.00 H ATOM 5691 HE3 LYS A 368 16.335 -20.264 10.916 1.00 0.00 H ATOM 5692 HZ1 LYS A 368 13.403 -20.372 10.523 1.00 0.00 H ATOM 5693 HZ2 LYS A 368 14.515 -21.577 10.078 1.00 0.00 H ATOM 5694 HZ3 LYS A 368 14.287 -21.195 11.718 1.00 0.00 H ATOM 5695 H LYS A 368 17.710 -15.510 9.959 1.00 0.00 H ATOM 5696 N ASN A 369 19.865 -15.740 7.857 1.00 9.66 N ATOM 5697 CA ASN A 369 20.884 -15.316 6.908 1.00 7.54 C ATOM 5698 C ASN A 369 21.778 -14.322 7.651 1.00 7.60 C ATOM 5699 O ASN A 369 21.320 -13.222 7.958 1.00 9.95 O ATOM 5700 CB ASN A 369 20.243 -14.569 5.712 1.00 13.33 C ATOM 5701 CG ASN A 369 21.284 -13.993 4.750 1.00 9.87 C ATOM 5702 OD1 ASN A 369 22.434 -14.409 4.755 1.00 17.89 O ATOM 5703 ND2 ASN A 369 20.976 -12.880 4.059 1.00 10.91 N ATOM 5704 HA ASN A 369 21.429 -16.182 6.532 1.00 0.00 H ATOM 5705 HB2 ASN A 369 19.609 -15.266 5.164 1.00 0.00 H ATOM 5706 HB3 ASN A 369 19.633 -13.752 6.097 1.00 0.00 H ATOM 5707 HD22 ASN A 369 19.998 -12.525 4.054 1.00 0.00 H ATOM 5708 HD21 ASN A 369 21.715 -12.375 3.530 1.00 0.00 H ATOM 5709 H ASN A 369 19.200 -15.035 8.234 1.00 0.00 H ATOM 5710 N PRO A 370 23.035 -14.624 7.966 1.00 9.98 N ATOM 5711 CA PRO A 370 23.812 -13.625 8.706 1.00 16.07 C ATOM 5712 C PRO A 370 24.642 -12.677 7.837 1.00 7.45 C ATOM 5713 O PRO A 370 25.483 -11.957 8.344 1.00 8.58 O ATOM 5714 CB PRO A 370 24.818 -14.526 9.458 1.00 8.87 C ATOM 5715 CG PRO A 370 25.131 -15.596 8.435 1.00 12.12 C ATOM 5716 CD PRO A 370 23.755 -15.943 7.897 1.00 6.62 C ATOM 5717 HA PRO A 370 23.152 -12.983 9.289 1.00 0.00 H ATOM 5718 HD3 PRO A 370 23.813 -16.307 6.871 1.00 0.00 H ATOM 5719 HD2 PRO A 370 23.266 -16.692 8.520 1.00 0.00 H ATOM 5720 HG3 PRO A 370 25.603 -16.461 8.900 1.00 0.00 H ATOM 5721 HG2 PRO A 370 25.778 -15.211 7.647 1.00 0.00 H ATOM 5722 HB2 PRO A 370 25.714 -13.971 9.734 1.00 0.00 H ATOM 5723 HB3 PRO A 370 24.369 -14.956 10.353 1.00 0.00 H ATOM 5724 N TRP A 371 24.418 -12.730 6.521 1.00 11.47 N ATOM 5725 CA TRP A 371 25.131 -11.950 5.527 1.00 6.60 C ATOM 5726 C TRP A 371 24.533 -10.604 5.219 1.00 10.03 C ATOM 5727 O TRP A 371 23.353 -10.347 5.426 1.00 10.77 O ATOM 5728 CB TRP A 371 25.240 -12.782 4.212 1.00 6.02 C ATOM 5729 CG TRP A 371 25.738 -14.170 4.511 1.00 3.71 C ATOM 5730 CD1 TRP A 371 25.047 -15.342 4.467 1.00 9.76 C ATOM 5731 CD2 TRP A 371 27.061 -14.494 4.900 1.00 9.41 C ATOM 5732 NE1 TRP A 371 25.880 -16.375 4.783 1.00 14.04 N ATOM 5733 CE2 TRP A 371 27.107 -15.889 5.066 1.00 19.90 C ATOM 5734 CE3 TRP A 371 28.199 -13.752 5.127 1.00 9.27 C ATOM 5735 CZ2 TRP A 371 28.290 -16.524 5.442 1.00 27.32 C ATOM 5736 CZ3 TRP A 371 29.370 -14.372 5.490 1.00 23.28 C ATOM 5737 CH2 TRP A 371 29.413 -15.765 5.648 1.00 21.80 C ATOM 5738 HA TRP A 371 26.109 -11.739 5.960 1.00 0.00 H ATOM 5739 HB2 TRP A 371 24.258 -12.845 3.744 1.00 0.00 H ATOM 5740 HB3 TRP A 371 25.934 -12.290 3.531 1.00 0.00 H ATOM 5741 HE1 TRP A 371 25.612 -17.380 4.803 1.00 0.00 H ATOM 5742 HD1 TRP A 371 23.990 -15.440 4.218 1.00 0.00 H ATOM 5743 HZ2 TRP A 371 28.321 -17.606 5.570 1.00 0.00 H ATOM 5744 HH2 TRP A 371 30.347 -16.248 5.937 1.00 0.00 H ATOM 5745 HZ3 TRP A 371 30.269 -13.779 5.656 1.00 0.00 H ATOM 5746 HE3 TRP A 371 28.170 -12.668 5.018 1.00 0.00 H ATOM 5747 H TRP A 371 23.678 -13.378 6.184 1.00 0.00 H ATOM 5748 N PRO A 372 25.380 -9.748 4.690 1.00 8.09 N ATOM 5749 CA PRO A 372 24.825 -8.435 4.394 1.00 7.04 C ATOM 5750 C PRO A 372 23.919 -8.394 3.175 1.00 7.73 C ATOM 5751 O PRO A 372 24.000 -9.223 2.283 1.00 7.18 O ATOM 5752 CB PRO A 372 26.010 -7.527 4.064 1.00 11.22 C ATOM 5753 CG PRO A 372 27.183 -8.493 3.820 1.00 9.35 C ATOM 5754 CD PRO A 372 26.860 -9.801 4.535 1.00 5.76 C ATOM 5755 HA PRO A 372 24.231 -8.137 5.258 1.00 0.00 H ATOM 5756 HD3 PRO A 372 27.160 -10.660 3.934 1.00 0.00 H ATOM 5757 HD2 PRO A 372 27.353 -9.848 5.506 1.00 0.00 H ATOM 5758 HG3 PRO A 372 28.104 -8.068 4.220 1.00 0.00 H ATOM 5759 HG2 PRO A 372 27.301 -8.673 2.751 1.00 0.00 H ATOM 5760 HB2 PRO A 372 25.806 -6.936 3.171 1.00 0.00 H ATOM 5761 HB3 PRO A 372 26.228 -6.860 4.898 1.00 0.00 H ATOM 5762 N ASN A 373 23.059 -7.371 3.157 1.00 6.18 N ATOM 5763 CA ASN A 373 22.119 -7.098 2.099 1.00 5.36 C ATOM 5764 C ASN A 373 22.530 -5.776 1.461 1.00 10.56 C ATOM 5765 O ASN A 373 23.452 -5.098 1.928 1.00 8.72 O ATOM 5766 CB ASN A 373 20.670 -7.203 2.563 1.00 3.30 C ATOM 5767 CG ASN A 373 20.352 -6.173 3.654 1.00 6.06 C ATOM 5768 OD1 ASN A 373 20.551 -4.947 3.403 1.00 8.81 O ATOM 5769 ND2 ASN A 373 19.736 -6.579 4.786 1.00 4.33 N ATOM 5770 HA ASN A 373 22.154 -7.862 1.322 1.00 0.00 H ATOM 5771 HB2 ASN A 373 20.012 -7.031 1.711 1.00 0.00 H ATOM 5772 HB3 ASN A 373 20.496 -8.204 2.959 1.00 0.00 H ATOM 5773 HD22 ASN A 373 19.588 -7.593 4.962 1.00 0.00 H ATOM 5774 HD21 ASN A 373 19.410 -5.877 5.481 1.00 0.00 H ATOM 5775 H ASN A 373 23.069 -6.722 3.969 1.00 0.00 H ATOM 5776 N VAL A 374 21.902 -5.389 0.346 1.00 7.46 N ATOM 5777 CA VAL A 374 22.166 -4.203 -0.418 1.00 6.50 C ATOM 5778 C VAL A 374 22.257 -2.928 0.438 1.00 9.38 C ATOM 5779 O VAL A 374 23.080 -2.023 0.226 1.00 11.71 O ATOM 5780 CB VAL A 374 21.124 -4.075 -1.559 1.00 4.26 C ATOM 5781 CG1 VAL A 374 19.720 -3.771 -0.976 1.00 4.23 C ATOM 5782 CG2 VAL A 374 21.515 -3.012 -2.579 1.00 3.92 C ATOM 5783 HA VAL A 374 23.158 -4.309 -0.857 1.00 0.00 H ATOM 5784 HB VAL A 374 21.097 -5.031 -2.081 1.00 0.00 H ATOM 5785 HG11 VAL A 374 19.421 -4.581 -0.310 1.00 0.00 H ATOM 5786 HG12 VAL A 374 19.754 -2.835 -0.419 1.00 0.00 H ATOM 5787 HG13 VAL A 374 19.001 -3.684 -1.790 1.00 0.00 H ATOM 5788 HG21 VAL A 374 21.594 -2.045 -2.082 1.00 0.00 H ATOM 5789 HG22 VAL A 374 22.475 -3.273 -3.024 1.00 0.00 H ATOM 5790 HG23 VAL A 374 20.754 -2.960 -3.358 1.00 0.00 H ATOM 5791 H VAL A 374 21.145 -6.011 -0.003 1.00 0.00 H ATOM 5792 N ASP A 375 21.404 -2.808 1.446 1.00 6.79 N ATOM 5793 CA ASP A 375 21.430 -1.604 2.239 1.00 5.93 C ATOM 5794 C ASP A 375 22.669 -1.364 3.090 1.00 12.93 C ATOM 5795 O ASP A 375 22.938 -0.202 3.491 1.00 7.85 O ATOM 5796 CB ASP A 375 20.186 -1.564 3.131 1.00 3.00 C ATOM 5797 CG ASP A 375 18.855 -1.708 2.467 1.00 5.83 C ATOM 5798 OD1 ASP A 375 18.720 -0.971 1.390 1.00 7.63 O ATOM 5799 OD2 ASP A 375 18.066 -2.542 2.767 1.00 16.02 O ATOM 5800 HA ASP A 375 21.450 -0.797 1.506 1.00 0.00 H ATOM 5801 HB2 ASP A 375 20.278 -2.372 3.857 1.00 0.00 H ATOM 5802 HB3 ASP A 375 20.189 -0.607 3.653 1.00 0.00 H ATOM 5803 H ASP A 375 20.728 -3.569 1.661 1.00 0.00 H ATOM 5804 N ALA A 376 23.407 -2.464 3.322 1.00 3.18 N ATOM 5805 CA ALA A 376 24.603 -2.266 4.118 1.00 3.18 C ATOM 5806 C ALA A 376 25.662 -1.501 3.364 1.00 12.15 C ATOM 5807 O ALA A 376 26.514 -0.960 4.085 1.00 7.63 O ATOM 5808 CB ALA A 376 25.233 -3.644 4.524 1.00 6.15 C ATOM 5809 HA ALA A 376 24.293 -1.701 4.997 1.00 0.00 H ATOM 5810 HB1 ALA A 376 24.511 -4.214 5.108 1.00 0.00 H ATOM 5811 HB2 ALA A 376 25.496 -4.201 3.625 1.00 0.00 H ATOM 5812 HB3 ALA A 376 26.129 -3.471 5.120 1.00 0.00 H ATOM 5813 H ALA A 376 23.137 -3.398 2.954 1.00 0.00 H ATOM 5814 N HIS A 377 25.636 -1.435 2.003 1.00 4.75 N ATOM 5815 CA HIS A 377 26.717 -0.754 1.303 1.00 6.92 C ATOM 5816 C HIS A 377 26.384 0.441 0.448 1.00 13.76 C ATOM 5817 O HIS A 377 27.244 1.041 -0.156 1.00 11.78 O ATOM 5818 CB HIS A 377 27.317 -1.800 0.316 1.00 8.68 C ATOM 5819 CG HIS A 377 28.807 -1.691 0.265 1.00 7.89 C ATOM 5820 ND1 HIS A 377 29.436 -0.496 -0.065 1.00 12.01 N ATOM 5821 CD2 HIS A 377 29.753 -2.628 0.517 1.00 11.34 C ATOM 5822 CE1 HIS A 377 30.762 -0.728 -0.010 1.00 13.69 C ATOM 5823 NE2 HIS A 377 30.982 -2.001 0.332 1.00 11.22 N ATOM 5824 HA HIS A 377 27.356 -0.372 2.099 1.00 0.00 H ATOM 5825 HB2 HIS A 377 27.043 -2.802 0.647 1.00 0.00 H ATOM 5826 HB3 HIS A 377 26.912 -1.625 -0.680 1.00 0.00 H ATOM 5827 HD2 HIS A 377 29.585 -3.665 0.807 1.00 0.00 H ATOM 5828 HE1 HIS A 377 31.538 0.010 -0.214 1.00 0.00 H ATOM 5829 H HIS A 377 24.854 -1.866 1.470 1.00 0.00 H ATOM 5830 N SER A 378 25.136 0.806 0.363 1.00 7.23 N ATOM 5831 CA SER A 378 24.705 1.906 -0.479 1.00 10.32 C ATOM 5832 C SER A 378 24.992 3.315 0.000 1.00 10.25 C ATOM 5833 O SER A 378 25.637 4.081 -0.733 1.00 6.89 O ATOM 5834 CB SER A 378 23.283 1.640 -0.938 1.00 5.72 C ATOM 5835 OG SER A 378 22.320 1.754 0.094 1.00 7.63 O ATOM 5836 HA SER A 378 25.364 1.912 -1.347 1.00 0.00 H ATOM 5837 HB2 SER A 378 23.235 0.629 -1.343 1.00 0.00 H ATOM 5838 HB3 SER A 378 23.035 2.356 -1.721 1.00 0.00 H ATOM 5839 HG SER A 378 21.420 1.569 -0.274 1.00 0.00 H ATOM 5840 H SER A 378 24.424 0.291 0.918 1.00 0.00 H ATOM 5841 N GLY A 379 24.561 3.648 1.196 1.00 10.09 N ATOM 5842 CA GLY A 379 24.796 5.005 1.701 1.00 11.21 C ATOM 5843 C GLY A 379 26.242 5.442 1.816 1.00 12.94 C ATOM 5844 O GLY A 379 26.524 6.636 1.745 1.00 10.25 O ATOM 5845 HA3 GLY A 379 24.350 5.071 2.693 1.00 0.00 H ATOM 5846 HA2 GLY A 379 24.292 5.700 1.030 1.00 0.00 H ATOM 5847 H GLY A 379 24.056 2.953 1.782 1.00 0.00 H ATOM 5848 N VAL A 380 27.143 4.495 1.991 1.00 15.07 N ATOM 5849 CA VAL A 380 28.578 4.714 2.132 1.00 15.96 C ATOM 5850 C VAL A 380 29.099 5.330 0.865 1.00 13.73 C ATOM 5851 O VAL A 380 29.924 6.230 0.885 1.00 11.92 O ATOM 5852 CB VAL A 380 29.393 3.486 2.569 1.00 12.55 C ATOM 5853 CG1 VAL A 380 30.863 3.737 2.379 1.00 22.47 C ATOM 5854 CG2 VAL A 380 29.342 3.510 4.094 1.00 26.75 C ATOM 5855 HA VAL A 380 28.714 5.401 2.968 1.00 0.00 H ATOM 5856 HB VAL A 380 29.022 2.607 2.042 1.00 0.00 H ATOM 5857 HG11 VAL A 380 31.063 3.940 1.327 1.00 0.00 H ATOM 5858 HG12 VAL A 380 31.164 4.595 2.979 1.00 0.00 H ATOM 5859 HG13 VAL A 380 31.424 2.857 2.694 1.00 0.00 H ATOM 5860 HG21 VAL A 380 29.783 4.439 4.456 1.00 0.00 H ATOM 5861 HG22 VAL A 380 28.305 3.446 4.423 1.00 0.00 H ATOM 5862 HG23 VAL A 380 29.902 2.662 4.488 1.00 0.00 H ATOM 5863 H VAL A 380 26.803 3.513 2.032 1.00 0.00 H ATOM 5864 N LEU A 381 28.578 4.846 -0.242 1.00 7.94 N ATOM 5865 CA LEU A 381 28.955 5.357 -1.518 1.00 7.19 C ATOM 5866 C LEU A 381 28.427 6.771 -1.703 1.00 9.25 C ATOM 5867 O LEU A 381 29.128 7.625 -2.225 1.00 11.06 O ATOM 5868 CB LEU A 381 28.349 4.459 -2.618 1.00 7.92 C ATOM 5869 CG LEU A 381 28.758 2.997 -2.517 1.00 11.51 C ATOM 5870 CD1 LEU A 381 28.216 2.254 -3.741 1.00 14.16 C ATOM 5871 CD2 LEU A 381 30.262 2.879 -2.465 1.00 21.18 C ATOM 5872 HA LEU A 381 30.043 5.368 -1.584 1.00 0.00 H ATOM 5873 HB2 LEU A 381 27.263 4.517 -2.549 1.00 0.00 H ATOM 5874 HB3 LEU A 381 28.671 4.839 -3.587 1.00 0.00 H ATOM 5875 HG LEU A 381 28.349 2.561 -1.606 1.00 0.00 H ATOM 5876 HD21 LEU A 381 30.690 3.308 -3.371 1.00 0.00 H ATOM 5877 HD22 LEU A 381 30.637 3.416 -1.594 1.00 0.00 H ATOM 5878 HD23 LEU A 381 30.540 1.828 -2.393 1.00 0.00 H ATOM 5879 HD11 LEU A 381 27.129 2.336 -3.762 1.00 0.00 H ATOM 5880 HD12 LEU A 381 28.633 2.695 -4.646 1.00 0.00 H ATOM 5881 HD13 LEU A 381 28.501 1.204 -3.683 1.00 0.00 H ATOM 5882 H LEU A 381 27.879 4.078 -0.185 1.00 0.00 H ATOM 5883 N LEU A 382 27.201 6.997 -1.299 1.00 8.80 N ATOM 5884 CA LEU A 382 26.586 8.320 -1.442 1.00 14.17 C ATOM 5885 C LEU A 382 27.313 9.437 -0.708 1.00 3.04 C ATOM 5886 O LEU A 382 27.608 10.484 -1.326 1.00 14.97 O ATOM 5887 CB LEU A 382 25.074 8.358 -1.104 1.00 10.39 C ATOM 5888 CG LEU A 382 24.285 7.383 -1.967 1.00 9.39 C ATOM 5889 CD1 LEU A 382 22.905 7.086 -1.390 1.00 12.01 C ATOM 5890 CD2 LEU A 382 24.194 7.924 -3.410 1.00 11.45 C ATOM 5891 HA LEU A 382 26.691 8.512 -2.510 1.00 0.00 H ATOM 5892 HB2 LEU A 382 24.938 8.093 -0.055 1.00 0.00 H ATOM 5893 HB3 LEU A 382 24.698 9.367 -1.274 1.00 0.00 H ATOM 5894 HG LEU A 382 24.817 6.432 -1.980 1.00 0.00 H ATOM 5895 HD21 LEU A 382 23.691 8.891 -3.403 1.00 0.00 H ATOM 5896 HD22 LEU A 382 25.198 8.038 -3.818 1.00 0.00 H ATOM 5897 HD23 LEU A 382 23.629 7.223 -4.024 1.00 0.00 H ATOM 5898 HD11 LEU A 382 23.014 6.648 -0.398 1.00 0.00 H ATOM 5899 HD12 LEU A 382 22.335 8.013 -1.319 1.00 0.00 H ATOM 5900 HD13 LEU A 382 22.383 6.386 -2.042 1.00 0.00 H ATOM 5901 H LEU A 382 26.654 6.224 -0.869 1.00 0.00 H ATOM 5902 N GLN A 383 27.581 9.204 0.597 1.00 13.14 N ATOM 5903 CA GLN A 383 28.265 10.086 1.518 1.00 13.79 C ATOM 5904 C GLN A 383 29.604 10.516 0.926 1.00 15.69 C ATOM 5905 O GLN A 383 30.010 11.655 0.993 1.00 16.16 O ATOM 5906 CB GLN A 383 28.495 9.275 2.845 1.00 16.42 C ATOM 5907 CG GLN A 383 29.815 9.386 3.654 1.00 60.93 C ATOM 5908 CD GLN A 383 31.196 8.890 3.186 1.00 38.23 C ATOM 5909 OE1 GLN A 383 32.192 9.596 3.449 1.00 80.00 O ATOM 5910 NE2 GLN A 383 31.395 7.647 2.733 1.00 11.34 N ATOM 5911 HA GLN A 383 27.678 10.984 1.710 1.00 0.00 H ATOM 5912 HB2 GLN A 383 27.694 9.566 3.525 1.00 0.00 H ATOM 5913 HB3 GLN A 383 28.384 8.223 2.584 1.00 0.00 H ATOM 5914 HG2 GLN A 383 29.943 10.450 3.852 1.00 0.00 H ATOM 5915 HG3 GLN A 383 29.623 8.864 4.591 1.00 0.00 H ATOM 5916 HE22 GLN A 383 30.582 7.040 2.507 1.00 0.00 H ATOM 5917 HE21 GLN A 383 32.363 7.288 2.607 1.00 0.00 H ATOM 5918 H GLN A 383 27.261 8.292 0.980 1.00 0.00 H ATOM 5919 N TYR A 384 30.335 9.603 0.339 1.00 7.73 N ATOM 5920 CA TYR A 384 31.632 9.912 -0.233 1.00 8.26 C ATOM 5921 C TYR A 384 31.596 11.003 -1.275 1.00 18.51 C ATOM 5922 O TYR A 384 32.557 11.725 -1.428 1.00 9.94 O ATOM 5923 CB TYR A 384 32.160 8.650 -0.918 1.00 14.61 C ATOM 5924 CG TYR A 384 33.446 8.925 -1.611 1.00 16.00 C ATOM 5925 CD1 TYR A 384 34.612 9.065 -0.865 1.00 17.86 C ATOM 5926 CD2 TYR A 384 33.516 9.050 -2.997 1.00 17.58 C ATOM 5927 CE1 TYR A 384 35.853 9.337 -1.439 1.00 19.23 C ATOM 5928 CE2 TYR A 384 34.749 9.328 -3.591 1.00 24.09 C ATOM 5929 CZ TYR A 384 35.907 9.467 -2.823 1.00 24.73 C ATOM 5930 OH TYR A 384 37.100 9.729 -3.432 1.00 36.76 O ATOM 5931 HA TYR A 384 32.262 10.259 0.586 1.00 0.00 H ATOM 5932 HB3 TYR A 384 31.427 8.306 -1.647 1.00 0.00 H ATOM 5933 HB2 TYR A 384 32.316 7.875 -0.168 1.00 0.00 H ATOM 5934 HD2 TYR A 384 32.621 8.933 -3.609 1.00 0.00 H ATOM 5935 HE2 TYR A 384 34.809 9.438 -4.674 1.00 0.00 H ATOM 5936 HE1 TYR A 384 36.748 9.444 -0.826 1.00 0.00 H ATOM 5937 HD1 TYR A 384 34.552 8.957 0.218 1.00 0.00 H ATOM 5938 HH TYR A 384 37.811 9.796 -2.747 1.00 0.00 H ATOM 5939 H TYR A 384 29.976 8.629 0.281 1.00 0.00 H ATOM 5940 N TYR A 385 30.497 11.115 -2.011 1.00 13.17 N ATOM 5941 CA TYR A 385 30.394 12.121 -3.050 1.00 15.65 C ATOM 5942 C TYR A 385 29.749 13.390 -2.546 1.00 13.01 C ATOM 5943 O TYR A 385 29.428 14.242 -3.366 1.00 11.46 O ATOM 5944 CB TYR A 385 29.624 11.617 -4.288 1.00 13.84 C ATOM 5945 CG TYR A 385 30.471 10.591 -4.969 1.00 11.89 C ATOM 5946 CD1 TYR A 385 31.569 10.989 -5.737 1.00 15.51 C ATOM 5947 CD2 TYR A 385 30.204 9.224 -4.881 1.00 7.85 C ATOM 5948 CE1 TYR A 385 32.412 10.095 -6.398 1.00 18.10 C ATOM 5949 CE2 TYR A 385 31.041 8.310 -5.532 1.00 13.87 C ATOM 5950 CZ TYR A 385 32.137 8.730 -6.301 1.00 13.64 C ATOM 5951 OH TYR A 385 32.950 7.840 -6.945 1.00 15.71 O ATOM 5952 HA TYR A 385 31.420 12.337 -3.347 1.00 0.00 H ATOM 5953 HB3 TYR A 385 29.430 12.447 -4.967 1.00 0.00 H ATOM 5954 HB2 TYR A 385 28.678 11.172 -3.980 1.00 0.00 H ATOM 5955 HD2 TYR A 385 29.347 8.869 -4.308 1.00 0.00 H ATOM 5956 HE2 TYR A 385 30.836 7.244 -5.439 1.00 0.00 H ATOM 5957 HE1 TYR A 385 33.264 10.454 -6.976 1.00 0.00 H ATOM 5958 HD1 TYR A 385 31.778 12.055 -5.824 1.00 0.00 H ATOM 5959 HH TYR A 385 33.659 8.333 -7.429 1.00 0.00 H ATOM 5960 H TYR A 385 29.698 10.472 -1.840 1.00 0.00 H ATOM 5961 N GLY A 386 29.531 13.532 -1.239 1.00 4.48 N ATOM 5962 CA GLY A 386 28.890 14.740 -0.730 1.00 10.59 C ATOM 5963 C GLY A 386 27.374 14.626 -0.368 1.00 13.62 C ATOM 5964 O GLY A 386 26.799 15.554 0.249 1.00 12.89 O ATOM 5965 HA3 GLY A 386 28.992 15.515 -1.490 1.00 0.00 H ATOM 5966 HA2 GLY A 386 29.424 15.044 0.170 1.00 0.00 H ATOM 5967 H GLY A 386 29.818 12.780 -0.580 1.00 0.00 H ATOM 5968 N MET A 387 26.689 13.522 -0.735 1.00 16.70 N ATOM 5969 CA MET A 387 25.277 13.390 -0.391 1.00 7.62 C ATOM 5970 C MET A 387 25.212 12.792 1.004 1.00 4.28 C ATOM 5971 O MET A 387 25.119 11.614 1.295 1.00 8.67 O ATOM 5972 CB MET A 387 24.595 12.539 -1.419 1.00 6.10 C ATOM 5973 CG MET A 387 23.119 12.620 -1.125 1.00 14.37 C ATOM 5974 SD MET A 387 22.150 11.670 -2.306 1.00 16.28 S ATOM 5975 CE MET A 387 22.029 12.847 -3.646 1.00 15.08 C ATOM 5976 HA MET A 387 24.760 14.349 -0.387 1.00 0.00 H ATOM 5977 HB2 MET A 387 24.802 12.917 -2.420 1.00 0.00 H ATOM 5978 HB3 MET A 387 24.939 11.507 -1.344 1.00 0.00 H ATOM 5979 HG2 MET A 387 22.807 13.663 -1.170 1.00 0.00 H ATOM 5980 HG3 MET A 387 22.936 12.230 -0.124 1.00 0.00 H ATOM 5981 HE1 MET A 387 21.530 13.749 -3.292 1.00 0.00 H ATOM 5982 HE2 MET A 387 23.029 13.098 -3.999 1.00 0.00 H ATOM 5983 HE3 MET A 387 21.454 12.409 -4.462 1.00 0.00 H ATOM 5984 H MET A 387 27.168 12.765 -1.263 1.00 0.00 H ATOM 5985 N THR A 388 25.301 13.670 1.957 1.00 7.12 N ATOM 5986 CA THR A 388 25.326 13.258 3.320 1.00 10.26 C ATOM 5987 C THR A 388 23.991 13.311 4.010 1.00 8.72 C ATOM 5988 O THR A 388 23.978 13.028 5.205 1.00 13.84 O ATOM 5989 CB THR A 388 26.342 14.174 4.090 1.00 14.19 C ATOM 5990 OG1 THR A 388 25.887 15.513 3.987 1.00 80.00 O ATOM 5991 CG2 THR A 388 27.843 14.058 3.614 1.00 20.23 C ATOM 5992 HA THR A 388 25.624 12.210 3.329 1.00 0.00 H ATOM 5993 HB THR A 388 26.363 13.830 5.124 1.00 0.00 H ATOM 5994 HG1 THR A 388 26.514 16.111 4.466 1.00 0.00 H ATOM 5995 HG23 THR A 388 28.172 13.022 3.701 1.00 0.00 H ATOM 5996 HG21 THR A 388 27.919 14.378 2.575 1.00 0.00 H ATOM 5997 HG22 THR A 388 28.471 14.694 4.238 1.00 0.00 H ATOM 5998 H THR A 388 25.354 14.682 1.723 1.00 0.00 H ATOM 5999 N GLU A 389 22.913 13.652 3.321 1.00 8.96 N ATOM 6000 CA GLU A 389 21.605 13.735 3.948 1.00 9.15 C ATOM 6001 C GLU A 389 21.014 12.340 3.953 1.00 10.42 C ATOM 6002 O GLU A 389 20.326 11.957 3.023 1.00 7.92 O ATOM 6003 CB GLU A 389 20.689 14.648 3.121 1.00 7.26 C ATOM 6004 CG GLU A 389 21.245 16.112 3.112 1.00 9.24 C ATOM 6005 CD GLU A 389 22.224 16.445 2.000 1.00 22.17 C ATOM 6006 OE1 GLU A 389 22.528 15.454 1.251 1.00 10.99 O ATOM 6007 OE2 GLU A 389 22.754 17.538 1.812 1.00 19.05 O ATOM 6008 HA GLU A 389 21.695 14.135 4.958 1.00 0.00 H ATOM 6009 HB2 GLU A 389 20.639 14.276 2.098 1.00 0.00 H ATOM 6010 HB3 GLU A 389 19.690 14.645 3.557 1.00 0.00 H ATOM 6011 HG2 GLU A 389 20.397 16.791 3.024 1.00 0.00 H ATOM 6012 HG3 GLU A 389 21.749 16.284 4.063 1.00 0.00 H ATOM 6013 H GLU A 389 23.005 13.865 2.307 1.00 0.00 H ATOM 6014 N MET A 390 21.317 11.584 5.026 1.00 3.00 N ATOM 6015 CA MET A 390 20.858 10.184 5.188 1.00 11.52 C ATOM 6016 C MET A 390 19.374 9.855 5.231 1.00 4.55 C ATOM 6017 O MET A 390 19.031 8.735 4.881 1.00 11.47 O ATOM 6018 CB MET A 390 21.679 9.378 6.198 1.00 16.83 C ATOM 6019 CG MET A 390 21.179 9.648 7.581 1.00 27.28 C ATOM 6020 SD MET A 390 22.308 10.746 8.475 1.00 41.42 S ATOM 6021 CE MET A 390 23.785 9.742 8.593 1.00 17.32 C ATOM 6022 HA MET A 390 21.084 9.833 4.181 1.00 0.00 H ATOM 6023 HB2 MET A 390 21.582 8.315 5.978 1.00 0.00 H ATOM 6024 HB3 MET A 390 22.727 9.668 6.128 1.00 0.00 H ATOM 6025 HG2 MET A 390 21.096 8.705 8.121 1.00 0.00 H ATOM 6026 HG3 MET A 390 20.197 10.118 7.520 1.00 0.00 H ATOM 6027 HE1 MET A 390 23.558 8.826 9.138 1.00 0.00 H ATOM 6028 HE2 MET A 390 24.134 9.493 7.591 1.00 0.00 H ATOM 6029 HE3 MET A 390 24.559 10.298 9.121 1.00 0.00 H ATOM 6030 H MET A 390 21.901 12.003 5.777 1.00 0.00 H ATOM 6031 N ASN A 391 18.532 10.833 5.645 1.00 5.53 N ATOM 6032 CA ASN A 391 17.093 10.645 5.683 1.00 4.28 C ATOM 6033 C ASN A 391 16.563 10.711 4.251 1.00 10.64 C ATOM 6034 O ASN A 391 15.405 10.449 4.010 1.00 10.38 O ATOM 6035 CB ASN A 391 16.340 11.672 6.553 1.00 15.16 C ATOM 6036 CG ASN A 391 16.600 11.398 8.014 1.00 25.79 C ATOM 6037 OD1 ASN A 391 15.940 11.940 8.907 1.00 48.69 O ATOM 6038 ND2 ASN A 391 17.653 10.628 8.265 1.00 80.00 N ATOM 6039 HA ASN A 391 16.912 9.674 6.145 1.00 0.00 H ATOM 6040 HB2 ASN A 391 16.685 12.676 6.307 1.00 0.00 H ATOM 6041 HB3 ASN A 391 15.271 11.598 6.356 1.00 0.00 H ATOM 6042 HD22 ASN A 391 18.178 10.193 7.480 1.00 0.00 H ATOM 6043 HD21 ASN A 391 17.952 10.460 9.247 1.00 0.00 H ATOM 6044 H ASN A 391 18.929 11.746 5.945 1.00 0.00 H ATOM 6045 N TYR A 392 17.389 11.073 3.303 1.00 8.12 N ATOM 6046 CA TYR A 392 16.932 11.165 1.930 1.00 6.24 C ATOM 6047 C TYR A 392 17.285 9.905 1.130 1.00 10.99 C ATOM 6048 O TYR A 392 16.781 9.652 0.030 1.00 6.82 O ATOM 6049 CB TYR A 392 17.650 12.362 1.256 1.00 11.46 C ATOM 6050 CG TYR A 392 17.159 12.594 -0.168 1.00 6.57 C ATOM 6051 CD1 TYR A 392 15.971 13.265 -0.468 1.00 4.49 C ATOM 6052 CD2 TYR A 392 17.943 12.175 -1.233 1.00 3.00 C ATOM 6053 CE1 TYR A 392 15.512 13.487 -1.773 1.00 3.00 C ATOM 6054 CE2 TYR A 392 17.493 12.375 -2.550 1.00 6.16 C ATOM 6055 CZ TYR A 392 16.294 13.034 -2.828 1.00 9.88 C ATOM 6056 OH TYR A 392 15.897 13.234 -4.142 1.00 5.08 O ATOM 6057 HA TYR A 392 15.849 11.286 1.940 1.00 0.00 H ATOM 6058 HB3 TYR A 392 18.721 12.162 1.231 1.00 0.00 H ATOM 6059 HB2 TYR A 392 17.464 13.261 1.844 1.00 0.00 H ATOM 6060 HD2 TYR A 392 18.903 11.693 -1.050 1.00 0.00 H ATOM 6061 HE2 TYR A 392 18.098 12.005 -3.378 1.00 0.00 H ATOM 6062 HE1 TYR A 392 14.568 14.001 -1.955 1.00 0.00 H ATOM 6063 HD1 TYR A 392 15.367 13.637 0.360 1.00 0.00 H ATOM 6064 HH TYR A 392 15.031 13.713 -4.155 1.00 0.00 H ATOM 6065 H TYR A 392 18.378 11.296 3.535 1.00 0.00 H ATOM 6066 N TYR A 393 18.183 9.044 1.618 1.00 5.05 N ATOM 6067 CA TYR A 393 18.606 7.831 0.885 1.00 11.76 C ATOM 6068 C TYR A 393 17.547 6.873 0.277 1.00 7.30 C ATOM 6069 O TYR A 393 17.661 6.303 -0.830 1.00 5.23 O ATOM 6070 CB TYR A 393 19.656 7.049 1.706 1.00 12.27 C ATOM 6071 CG TYR A 393 20.982 7.781 1.958 1.00 9.81 C ATOM 6072 CD1 TYR A 393 21.273 9.023 1.387 1.00 7.27 C ATOM 6073 CD2 TYR A 393 21.919 7.178 2.797 1.00 12.13 C ATOM 6074 CE1 TYR A 393 22.493 9.673 1.619 1.00 8.40 C ATOM 6075 CE2 TYR A 393 23.149 7.799 3.018 1.00 13.72 C ATOM 6076 CZ TYR A 393 23.434 9.039 2.437 1.00 11.09 C ATOM 6077 OH TYR A 393 24.626 9.643 2.706 1.00 13.50 O ATOM 6078 HA TYR A 393 19.020 8.265 -0.025 1.00 0.00 H ATOM 6079 HB3 TYR A 393 19.879 6.125 1.172 1.00 0.00 H ATOM 6080 HB2 TYR A 393 19.215 6.811 2.674 1.00 0.00 H ATOM 6081 HD2 TYR A 393 21.692 6.226 3.278 1.00 0.00 H ATOM 6082 HE2 TYR A 393 23.894 7.314 3.649 1.00 0.00 H ATOM 6083 HE1 TYR A 393 22.703 10.646 1.174 1.00 0.00 H ATOM 6084 HD1 TYR A 393 20.532 9.499 0.745 1.00 0.00 H ATOM 6085 HH TYR A 393 24.674 10.506 2.223 1.00 0.00 H ATOM 6086 H TYR A 393 18.601 9.235 2.551 1.00 0.00 H ATOM 6087 N THR A 394 16.491 6.653 1.069 1.00 7.72 N ATOM 6088 CA THR A 394 15.409 5.758 0.639 1.00 4.88 C ATOM 6089 C THR A 394 14.664 6.286 -0.611 1.00 5.06 C ATOM 6090 O THR A 394 14.099 5.541 -1.420 1.00 6.23 O ATOM 6091 CB THR A 394 14.478 5.469 1.840 1.00 3.13 C ATOM 6092 OG1 THR A 394 15.335 5.080 2.892 1.00 4.21 O ATOM 6093 CG2 THR A 394 13.566 4.275 1.508 1.00 4.64 C ATOM 6094 HA THR A 394 15.839 4.810 0.314 1.00 0.00 H ATOM 6095 HB THR A 394 13.862 6.334 2.087 1.00 0.00 H ATOM 6096 HG1 THR A 394 15.967 5.816 3.091 1.00 0.00 H ATOM 6097 HG23 THR A 394 12.892 4.549 0.696 1.00 0.00 H ATOM 6098 HG21 THR A 394 14.178 3.426 1.203 1.00 0.00 H ATOM 6099 HG22 THR A 394 12.984 4.007 2.390 1.00 0.00 H ATOM 6100 H THR A 394 16.436 7.120 1.997 1.00 0.00 H ATOM 6101 N VAL A 395 14.640 7.592 -0.780 1.00 5.69 N ATOM 6102 CA VAL A 395 13.996 8.196 -1.952 1.00 4.87 C ATOM 6103 C VAL A 395 14.685 7.741 -3.221 1.00 6.78 C ATOM 6104 O VAL A 395 14.032 7.506 -4.230 1.00 7.75 O ATOM 6105 CB VAL A 395 14.125 9.744 -1.917 1.00 6.87 C ATOM 6106 CG1 VAL A 395 13.724 10.320 -3.254 1.00 4.10 C ATOM 6107 CG2 VAL A 395 13.174 10.277 -0.842 1.00 6.66 C ATOM 6108 HA VAL A 395 12.950 7.892 -1.934 1.00 0.00 H ATOM 6109 HB VAL A 395 15.155 10.027 -1.698 1.00 0.00 H ATOM 6110 HG11 VAL A 395 14.376 9.920 -4.031 1.00 0.00 H ATOM 6111 HG12 VAL A 395 12.691 10.048 -3.470 1.00 0.00 H ATOM 6112 HG13 VAL A 395 13.817 11.406 -3.223 1.00 0.00 H ATOM 6113 HG21 VAL A 395 12.152 9.990 -1.089 1.00 0.00 H ATOM 6114 HG22 VAL A 395 13.448 9.855 0.125 1.00 0.00 H ATOM 6115 HG23 VAL A 395 13.248 11.364 -0.800 1.00 0.00 H ATOM 6116 H VAL A 395 15.086 8.207 -0.069 1.00 0.00 H ATOM 6117 N LEU A 396 16.019 7.587 -3.189 1.00 4.39 N ATOM 6118 CA LEU A 396 16.743 7.148 -4.386 1.00 4.50 C ATOM 6119 C LEU A 396 16.392 5.695 -4.664 1.00 8.49 C ATOM 6120 O LEU A 396 16.261 5.233 -5.810 1.00 11.26 O ATOM 6121 CB LEU A 396 18.240 7.221 -4.055 1.00 7.92 C ATOM 6122 CG LEU A 396 18.746 8.647 -3.943 1.00 13.18 C ATOM 6123 CD1 LEU A 396 20.248 8.453 -3.894 1.00 15.78 C ATOM 6124 CD2 LEU A 396 18.415 9.385 -5.230 1.00 10.18 C ATOM 6125 HA LEU A 396 16.489 7.765 -5.247 1.00 0.00 H ATOM 6126 HB2 LEU A 396 18.413 6.714 -3.106 1.00 0.00 H ATOM 6127 HB3 LEU A 396 18.797 6.714 -4.843 1.00 0.00 H ATOM 6128 HG LEU A 396 18.329 9.199 -3.101 1.00 0.00 H ATOM 6129 HD21 LEU A 396 18.899 8.885 -6.069 1.00 0.00 H ATOM 6130 HD22 LEU A 396 17.335 9.386 -5.380 1.00 0.00 H ATOM 6131 HD23 LEU A 396 18.774 10.412 -5.161 1.00 0.00 H ATOM 6132 HD11 LEU A 396 20.506 7.841 -3.030 1.00 0.00 H ATOM 6133 HD12 LEU A 396 20.579 7.955 -4.805 1.00 0.00 H ATOM 6134 HD13 LEU A 396 20.736 9.424 -3.812 1.00 0.00 H ATOM 6135 H LEU A 396 16.541 7.780 -2.311 1.00 0.00 H ATOM 6136 N PHE A 397 16.205 4.940 -3.582 1.00 3.00 N ATOM 6137 CA PHE A 397 15.821 3.543 -3.758 1.00 3.00 C ATOM 6138 C PHE A 397 14.435 3.547 -4.375 1.00 6.78 C ATOM 6139 O PHE A 397 14.184 2.774 -5.259 1.00 6.23 O ATOM 6140 CB PHE A 397 15.791 2.904 -2.336 1.00 3.00 C ATOM 6141 CG PHE A 397 15.721 1.414 -2.273 1.00 4.46 C ATOM 6142 CD1 PHE A 397 15.268 0.583 -3.302 1.00 3.00 C ATOM 6143 CD2 PHE A 397 16.129 0.811 -1.085 1.00 6.38 C ATOM 6144 CE1 PHE A 397 15.236 -0.807 -3.172 1.00 7.67 C ATOM 6145 CE2 PHE A 397 16.102 -0.572 -0.924 1.00 5.33 C ATOM 6146 CZ PHE A 397 15.648 -1.382 -1.964 1.00 6.33 C ATOM 6147 HA PHE A 397 16.504 2.982 -4.396 1.00 0.00 H ATOM 6148 HB2 PHE A 397 16.696 3.215 -1.814 1.00 0.00 H ATOM 6149 HB3 PHE A 397 14.919 3.298 -1.814 1.00 0.00 H ATOM 6150 HD2 PHE A 397 16.477 1.436 -0.263 1.00 0.00 H ATOM 6151 HE2 PHE A 397 16.435 -1.020 0.012 1.00 0.00 H ATOM 6152 HZ PHE A 397 15.614 -2.464 -1.836 1.00 0.00 H ATOM 6153 HE1 PHE A 397 14.896 -1.433 -3.997 1.00 0.00 H ATOM 6154 HD1 PHE A 397 14.929 1.034 -4.235 1.00 0.00 H ATOM 6155 H PHE A 397 16.330 5.339 -2.630 1.00 0.00 H ATOM 6156 N GLY A 398 13.542 4.424 -3.914 1.00 4.19 N ATOM 6157 CA GLY A 398 12.156 4.557 -4.405 1.00 3.00 C ATOM 6158 C GLY A 398 12.183 4.851 -5.892 1.00 7.97 C ATOM 6159 O GLY A 398 11.509 4.178 -6.644 1.00 8.88 O ATOM 6160 HA3 GLY A 398 11.659 5.373 -3.880 1.00 0.00 H ATOM 6161 HA2 GLY A 398 11.614 3.628 -4.226 1.00 0.00 H ATOM 6162 H GLY A 398 13.845 5.062 -3.151 1.00 0.00 H ATOM 6163 N VAL A 399 12.989 5.841 -6.329 1.00 4.45 N ATOM 6164 CA VAL A 399 13.087 6.186 -7.728 1.00 3.16 C ATOM 6165 C VAL A 399 13.515 4.966 -8.574 1.00 10.50 C ATOM 6166 O VAL A 399 12.938 4.710 -9.640 1.00 4.03 O ATOM 6167 CB VAL A 399 14.057 7.334 -7.918 1.00 3.00 C ATOM 6168 CG1 VAL A 399 14.117 7.644 -9.391 1.00 4.81 C ATOM 6169 CG2 VAL A 399 13.506 8.612 -7.270 1.00 3.68 C ATOM 6170 HA VAL A 399 12.101 6.500 -8.071 1.00 0.00 H ATOM 6171 HB VAL A 399 15.018 7.053 -7.487 1.00 0.00 H ATOM 6172 HG11 VAL A 399 14.461 6.763 -9.933 1.00 0.00 H ATOM 6173 HG12 VAL A 399 13.124 7.924 -9.743 1.00 0.00 H ATOM 6174 HG13 VAL A 399 14.809 8.469 -9.559 1.00 0.00 H ATOM 6175 HG21 VAL A 399 12.553 8.871 -7.732 1.00 0.00 H ATOM 6176 HG22 VAL A 399 13.359 8.443 -6.203 1.00 0.00 H ATOM 6177 HG23 VAL A 399 14.215 9.427 -7.416 1.00 0.00 H ATOM 6178 H VAL A 399 13.557 6.372 -5.638 1.00 0.00 H ATOM 6179 N SER A 400 14.511 4.199 -8.117 1.00 4.75 N ATOM 6180 CA SER A 400 14.938 3.012 -8.884 1.00 3.47 C ATOM 6181 C SER A 400 13.869 1.944 -8.952 1.00 10.63 C ATOM 6182 O SER A 400 13.646 1.340 -9.993 1.00 5.35 O ATOM 6183 CB SER A 400 16.067 2.418 -8.053 1.00 7.53 C ATOM 6184 OG SER A 400 16.581 1.282 -8.722 1.00 10.92 O ATOM 6185 HA SER A 400 15.192 3.304 -9.903 1.00 0.00 H ATOM 6186 HB2 SER A 400 15.686 2.125 -7.074 1.00 0.00 H ATOM 6187 HB3 SER A 400 16.858 3.158 -7.928 1.00 0.00 H ATOM 6188 HG SER A 400 16.925 1.551 -9.610 1.00 0.00 H ATOM 6189 H SER A 400 14.984 4.439 -7.222 1.00 0.00 H ATOM 6190 N ARG A 401 13.214 1.707 -7.809 1.00 4.35 N ATOM 6191 CA ARG A 401 12.166 0.678 -7.673 1.00 3.00 C ATOM 6192 C ARG A 401 11.004 0.804 -8.657 1.00 7.61 C ATOM 6193 O ARG A 401 10.380 -0.195 -9.033 1.00 8.91 O ATOM 6194 CB ARG A 401 11.699 0.454 -6.244 1.00 5.97 C ATOM 6195 CG ARG A 401 10.888 -0.865 -6.030 1.00 3.48 C ATOM 6196 CD ARG A 401 11.440 -2.188 -6.588 1.00 3.98 C ATOM 6197 NE ARG A 401 12.811 -2.628 -6.281 1.00 8.09 N ATOM 6198 CZ ARG A 401 13.175 -3.396 -5.207 1.00 3.00 C ATOM 6199 NH1 ARG A 401 12.290 -3.783 -4.279 1.00 4.13 N ATOM 6200 NH2 ARG A 401 14.441 -3.750 -5.043 1.00 3.00 N ATOM 6201 HA ARG A 401 12.682 -0.236 -7.968 1.00 0.00 H ATOM 6202 HB2 ARG A 401 12.577 0.423 -5.599 1.00 0.00 H ATOM 6203 HB3 ARG A 401 11.067 1.294 -5.956 1.00 0.00 H ATOM 6204 HG2 ARG A 401 10.773 -0.997 -4.954 1.00 0.00 H ATOM 6205 HG3 ARG A 401 9.908 -0.713 -6.483 1.00 0.00 H ATOM 6206 HD2 ARG A 401 11.372 -2.119 -7.674 1.00 0.00 H ATOM 6207 HD3 ARG A 401 10.775 -2.975 -6.233 1.00 0.00 H ATOM 6208 HE ARG A 401 13.565 -2.331 -6.933 1.00 0.00 H ATOM 6209 HH12 ARG A 401 12.600 -4.366 -3.476 1.00 0.00 H ATOM 6210 HH11 ARG A 401 11.293 -3.500 -4.362 1.00 0.00 H ATOM 6211 HH22 ARG A 401 14.716 -4.333 -4.227 1.00 0.00 H ATOM 6212 HH21 ARG A 401 15.160 -3.445 -5.730 1.00 0.00 H ATOM 6213 H ARG A 401 13.456 2.278 -6.974 1.00 0.00 H ATOM 6214 N ALA A 402 10.733 2.037 -9.049 1.00 3.00 N ATOM 6215 CA ALA A 402 9.651 2.327 -10.019 1.00 3.00 C ATOM 6216 C ALA A 402 9.899 1.509 -11.293 1.00 11.06 C ATOM 6217 O ALA A 402 8.969 0.998 -11.950 1.00 4.02 O ATOM 6218 CB ALA A 402 9.793 3.807 -10.441 1.00 3.39 C ATOM 6219 HA ALA A 402 8.681 2.101 -9.576 1.00 0.00 H ATOM 6220 HB1 ALA A 402 9.699 4.445 -9.562 1.00 0.00 H ATOM 6221 HB2 ALA A 402 10.769 3.960 -10.900 1.00 0.00 H ATOM 6222 HB3 ALA A 402 9.010 4.056 -11.157 1.00 0.00 H ATOM 6223 H ALA A 402 11.294 2.825 -8.666 1.00 0.00 H ATOM 6224 N LEU A 403 11.169 1.353 -11.703 1.00 5.64 N ATOM 6225 CA LEU A 403 11.459 0.616 -12.927 1.00 8.50 C ATOM 6226 C LEU A 403 10.931 -0.795 -12.941 1.00 11.04 C ATOM 6227 O LEU A 403 10.363 -1.206 -13.930 1.00 9.64 O ATOM 6228 CB LEU A 403 12.983 0.613 -13.244 1.00 6.80 C ATOM 6229 CG LEU A 403 13.517 2.056 -13.382 1.00 5.82 C ATOM 6230 CD1 LEU A 403 15.016 1.959 -13.630 1.00 10.12 C ATOM 6231 CD2 LEU A 403 12.955 2.760 -14.592 1.00 11.89 C ATOM 6232 HA LEU A 403 10.923 1.156 -13.708 1.00 0.00 H ATOM 6233 HB2 LEU A 403 13.515 0.110 -12.437 1.00 0.00 H ATOM 6234 HB3 LEU A 403 13.153 0.078 -14.178 1.00 0.00 H ATOM 6235 HG LEU A 403 13.243 2.603 -12.480 1.00 0.00 H ATOM 6236 HD21 LEU A 403 13.230 2.210 -15.492 1.00 0.00 H ATOM 6237 HD22 LEU A 403 11.869 2.807 -14.512 1.00 0.00 H ATOM 6238 HD23 LEU A 403 13.361 3.770 -14.644 1.00 0.00 H ATOM 6239 HD11 LEU A 403 15.490 1.453 -12.789 1.00 0.00 H ATOM 6240 HD12 LEU A 403 15.196 1.394 -14.544 1.00 0.00 H ATOM 6241 HD13 LEU A 403 15.431 2.961 -13.733 1.00 0.00 H ATOM 6242 H LEU A 403 11.947 1.759 -11.146 1.00 0.00 H ATOM 6243 N GLY A 404 11.175 -1.517 -11.872 1.00 4.91 N ATOM 6244 CA GLY A 404 10.716 -2.891 -11.847 1.00 3.00 C ATOM 6245 C GLY A 404 9.259 -3.038 -11.583 1.00 7.09 C ATOM 6246 O GLY A 404 8.515 -3.769 -12.230 1.00 5.81 O ATOM 6247 HA3 GLY A 404 11.261 -3.421 -11.066 1.00 0.00 H ATOM 6248 HA2 GLY A 404 10.937 -3.344 -12.813 1.00 0.00 H ATOM 6249 H GLY A 404 11.686 -1.112 -11.062 1.00 0.00 H ATOM 6250 N VAL A 405 8.768 -2.342 -10.621 1.00 3.04 N ATOM 6251 CA VAL A 405 7.367 -2.517 -10.346 1.00 3.00 C ATOM 6252 C VAL A 405 6.424 -2.092 -11.448 1.00 4.75 C ATOM 6253 O VAL A 405 5.380 -2.734 -11.651 1.00 7.40 O ATOM 6254 CB VAL A 405 6.917 -2.041 -8.965 1.00 17.05 C ATOM 6255 CG1 VAL A 405 7.879 -2.518 -7.891 1.00 4.17 C ATOM 6256 CG2 VAL A 405 6.873 -0.516 -8.885 1.00 6.11 C ATOM 6257 HA VAL A 405 7.282 -3.603 -10.320 1.00 0.00 H ATOM 6258 HB VAL A 405 5.921 -2.454 -8.805 1.00 0.00 H ATOM 6259 HG11 VAL A 405 7.914 -3.607 -7.894 1.00 0.00 H ATOM 6260 HG12 VAL A 405 8.874 -2.121 -8.094 1.00 0.00 H ATOM 6261 HG13 VAL A 405 7.538 -2.167 -6.917 1.00 0.00 H ATOM 6262 HG21 VAL A 405 7.867 -0.114 -9.082 1.00 0.00 H ATOM 6263 HG22 VAL A 405 6.172 -0.135 -9.627 1.00 0.00 H ATOM 6264 HG23 VAL A 405 6.549 -0.215 -7.889 1.00 0.00 H ATOM 6265 H VAL A 405 9.355 -1.685 -10.068 1.00 0.00 H ATOM 6266 N LEU A 406 6.778 -0.978 -12.145 1.00 4.73 N ATOM 6267 CA LEU A 406 5.970 -0.494 -13.227 1.00 3.43 C ATOM 6268 C LEU A 406 6.089 -1.422 -14.442 1.00 5.98 C ATOM 6269 O LEU A 406 5.144 -1.598 -15.162 1.00 7.28 O ATOM 6270 CB LEU A 406 6.191 0.988 -13.505 1.00 3.54 C ATOM 6271 CG LEU A 406 5.792 1.864 -12.305 1.00 3.66 C ATOM 6272 CD1 LEU A 406 6.272 3.299 -12.515 1.00 6.33 C ATOM 6273 CD2 LEU A 406 4.262 1.796 -12.127 1.00 11.69 C ATOM 6274 HA LEU A 406 4.921 -0.534 -12.933 1.00 0.00 H ATOM 6275 HB2 LEU A 406 7.246 1.152 -13.726 1.00 0.00 H ATOM 6276 HB3 LEU A 406 5.591 1.278 -14.368 1.00 0.00 H ATOM 6277 HG LEU A 406 6.267 1.495 -11.396 1.00 0.00 H ATOM 6278 HD21 LEU A 406 3.776 2.163 -13.031 1.00 0.00 H ATOM 6279 HD22 LEU A 406 3.964 0.763 -11.946 1.00 0.00 H ATOM 6280 HD23 LEU A 406 3.968 2.414 -11.278 1.00 0.00 H ATOM 6281 HD11 LEU A 406 7.357 3.306 -12.617 1.00 0.00 H ATOM 6282 HD12 LEU A 406 5.818 3.704 -13.419 1.00 0.00 H ATOM 6283 HD13 LEU A 406 5.982 3.907 -11.658 1.00 0.00 H ATOM 6284 H LEU A 406 7.648 -0.469 -11.889 1.00 0.00 H ATOM 6285 N ALA A 407 7.229 -2.051 -14.703 1.00 6.52 N ATOM 6286 CA ALA A 407 7.439 -2.971 -15.805 1.00 8.07 C ATOM 6287 C ALA A 407 6.495 -4.158 -15.559 1.00 11.18 C ATOM 6288 O ALA A 407 5.786 -4.646 -16.432 1.00 7.16 O ATOM 6289 CB ALA A 407 8.958 -3.243 -16.038 1.00 7.02 C ATOM 6290 HA ALA A 407 7.167 -2.574 -16.783 1.00 0.00 H ATOM 6291 HB1 ALA A 407 9.463 -2.305 -16.269 1.00 0.00 H ATOM 6292 HB2 ALA A 407 9.390 -3.677 -15.137 1.00 0.00 H ATOM 6293 HB3 ALA A 407 9.078 -3.936 -16.871 1.00 0.00 H ATOM 6294 H ALA A 407 8.033 -1.870 -14.069 1.00 0.00 H ATOM 6295 N GLN A 408 6.434 -4.680 -14.348 1.00 9.76 N ATOM 6296 CA GLN A 408 5.546 -5.805 -14.103 1.00 4.14 C ATOM 6297 C GLN A 408 4.070 -5.458 -14.160 1.00 6.94 C ATOM 6298 O GLN A 408 3.214 -6.238 -14.623 1.00 9.44 O ATOM 6299 CB GLN A 408 5.795 -6.465 -12.730 1.00 6.19 C ATOM 6300 CG GLN A 408 4.720 -7.503 -12.367 1.00 6.06 C ATOM 6301 CD GLN A 408 4.748 -8.748 -13.299 1.00 8.59 C ATOM 6302 OE1 GLN A 408 5.789 -9.096 -13.845 1.00 7.55 O ATOM 6303 NE2 GLN A 408 3.574 -9.326 -13.584 1.00 9.83 N ATOM 6304 HA GLN A 408 5.785 -6.490 -14.917 1.00 0.00 H ATOM 6305 HB2 GLN A 408 6.766 -6.961 -12.752 1.00 0.00 H ATOM 6306 HB3 GLN A 408 5.802 -5.688 -11.965 1.00 0.00 H ATOM 6307 HG2 GLN A 408 4.885 -7.832 -11.341 1.00 0.00 H ATOM 6308 HG3 GLN A 408 3.740 -7.032 -12.444 1.00 0.00 H ATOM 6309 HE22 GLN A 408 2.708 -9.008 -13.104 1.00 0.00 H ATOM 6310 HE21 GLN A 408 3.528 -10.092 -14.286 1.00 0.00 H ATOM 6311 H GLN A 408 7.015 -4.291 -13.578 1.00 0.00 H ATOM 6312 N LEU A 409 3.753 -4.268 -13.686 1.00 3.48 N ATOM 6313 CA LEU A 409 2.391 -3.743 -13.636 1.00 3.00 C ATOM 6314 C LEU A 409 1.729 -3.763 -15.017 1.00 8.97 C ATOM 6315 O LEU A 409 0.566 -4.115 -15.171 1.00 5.25 O ATOM 6316 CB LEU A 409 2.340 -2.343 -12.970 1.00 3.20 C ATOM 6317 CG LEU A 409 0.917 -1.945 -12.572 1.00 10.95 C ATOM 6318 CD1 LEU A 409 0.194 -2.887 -11.576 1.00 10.45 C ATOM 6319 CD2 LEU A 409 1.019 -0.574 -11.886 1.00 14.69 C ATOM 6320 HA LEU A 409 1.805 -4.407 -13.001 1.00 0.00 H ATOM 6321 HB2 LEU A 409 2.964 -2.356 -12.077 1.00 0.00 H ATOM 6322 HB3 LEU A 409 2.728 -1.605 -13.672 1.00 0.00 H ATOM 6323 HG LEU A 409 0.330 -1.972 -13.490 1.00 0.00 H ATOM 6324 HD21 LEU A 409 1.660 -0.655 -11.008 1.00 0.00 H ATOM 6325 HD22 LEU A 409 1.444 0.149 -12.582 1.00 0.00 H ATOM 6326 HD23 LEU A 409 0.025 -0.246 -11.583 1.00 0.00 H ATOM 6327 HD11 LEU A 409 0.117 -3.883 -12.011 1.00 0.00 H ATOM 6328 HD12 LEU A 409 0.763 -2.938 -10.648 1.00 0.00 H ATOM 6329 HD13 LEU A 409 -0.804 -2.500 -11.371 1.00 0.00 H ATOM 6330 H LEU A 409 4.521 -3.666 -13.326 1.00 0.00 H ATOM 6331 N ILE A 410 2.493 -3.408 -16.026 1.00 4.09 N ATOM 6332 CA ILE A 410 1.985 -3.419 -17.396 1.00 8.60 C ATOM 6333 C ILE A 410 1.618 -4.867 -17.771 1.00 10.56 C ATOM 6334 O ILE A 410 0.545 -5.198 -18.335 1.00 6.32 O ATOM 6335 CB ILE A 410 3.065 -2.894 -18.339 1.00 13.04 C ATOM 6336 CG1 ILE A 410 3.335 -1.413 -18.118 1.00 7.61 C ATOM 6337 CG2 ILE A 410 2.688 -3.202 -19.799 1.00 4.51 C ATOM 6338 CD1 ILE A 410 4.696 -0.908 -18.710 1.00 5.35 C ATOM 6339 HA ILE A 410 1.103 -2.783 -17.479 1.00 0.00 H ATOM 6340 HB ILE A 410 3.998 -3.411 -18.115 1.00 0.00 H ATOM 6341 HG12 ILE A 410 2.529 -0.846 -18.584 1.00 0.00 H ATOM 6342 HG13 ILE A 410 3.338 -1.223 -17.045 1.00 0.00 H ATOM 6343 HD11 ILE A 410 5.517 -1.454 -18.247 1.00 0.00 H ATOM 6344 HD12 ILE A 410 4.707 -1.077 -19.787 1.00 0.00 H ATOM 6345 HD13 ILE A 410 4.806 0.157 -18.507 1.00 0.00 H ATOM 6346 HG21 ILE A 410 2.592 -4.280 -19.929 1.00 0.00 H ATOM 6347 HG22 ILE A 410 1.740 -2.721 -20.037 1.00 0.00 H ATOM 6348 HG23 ILE A 410 3.466 -2.823 -20.462 1.00 0.00 H ATOM 6349 H ILE A 410 3.474 -3.115 -15.846 1.00 0.00 H ATOM 6350 N TRP A 411 2.530 -5.813 -17.453 1.00 6.81 N ATOM 6351 CA TRP A 411 2.331 -7.228 -17.711 1.00 4.89 C ATOM 6352 C TRP A 411 1.160 -7.792 -16.925 1.00 11.04 C ATOM 6353 O TRP A 411 0.347 -8.518 -17.467 1.00 7.64 O ATOM 6354 CB TRP A 411 3.654 -8.007 -17.499 1.00 4.61 C ATOM 6355 CG TRP A 411 4.534 -7.885 -18.693 1.00 11.59 C ATOM 6356 CD1 TRP A 411 5.662 -7.140 -18.796 1.00 10.00 C ATOM 6357 CD2 TRP A 411 4.305 -8.523 -19.962 1.00 9.29 C ATOM 6358 NE1 TRP A 411 6.177 -7.307 -20.060 1.00 6.59 N ATOM 6359 CE2 TRP A 411 5.349 -8.119 -20.802 1.00 12.59 C ATOM 6360 CE3 TRP A 411 3.314 -9.397 -20.420 1.00 7.00 C ATOM 6361 CZ2 TRP A 411 5.450 -8.609 -22.112 1.00 9.83 C ATOM 6362 CZ3 TRP A 411 3.386 -9.843 -21.734 1.00 4.74 C ATOM 6363 CH2 TRP A 411 4.447 -9.477 -22.530 1.00 4.29 C ATOM 6364 HA TRP A 411 2.055 -7.355 -18.758 1.00 0.00 H ATOM 6365 HB2 TRP A 411 4.172 -7.603 -16.629 1.00 0.00 H ATOM 6366 HB3 TRP A 411 3.426 -9.059 -17.328 1.00 0.00 H ATOM 6367 HE1 TRP A 411 7.062 -6.882 -20.405 1.00 0.00 H ATOM 6368 HD1 TRP A 411 6.088 -6.515 -18.011 1.00 0.00 H ATOM 6369 HZ2 TRP A 411 6.272 -8.324 -22.769 1.00 0.00 H ATOM 6370 HH2 TRP A 411 4.504 -9.888 -23.538 1.00 0.00 H ATOM 6371 HZ3 TRP A 411 2.601 -10.484 -22.135 1.00 0.00 H ATOM 6372 HE3 TRP A 411 2.506 -9.720 -19.763 1.00 0.00 H ATOM 6373 H TRP A 411 3.417 -5.513 -17.002 1.00 0.00 H ATOM 6374 N SER A 412 1.018 -7.418 -15.628 1.00 6.51 N ATOM 6375 CA SER A 412 -0.103 -7.928 -14.839 1.00 4.63 C ATOM 6376 C SER A 412 -1.437 -7.656 -15.523 1.00 4.01 C ATOM 6377 O SER A 412 -2.284 -8.530 -15.608 1.00 6.38 O ATOM 6378 CB SER A 412 -0.157 -7.327 -13.435 1.00 5.05 C ATOM 6379 OG SER A 412 1.065 -7.710 -12.848 1.00 7.34 O ATOM 6380 HA SER A 412 0.066 -9.002 -14.758 1.00 0.00 H ATOM 6381 HB2 SER A 412 -0.999 -7.731 -12.873 1.00 0.00 H ATOM 6382 HB3 SER A 412 -0.240 -6.241 -13.482 1.00 0.00 H ATOM 6383 HG SER A 412 1.111 -7.356 -11.924 1.00 0.00 H ATOM 6384 H SER A 412 1.706 -6.769 -15.195 1.00 0.00 H ATOM 6385 N ARG A 413 -1.624 -6.420 -16.008 1.00 3.10 N ATOM 6386 CA ARG A 413 -2.853 -6.020 -16.679 1.00 5.53 C ATOM 6387 C ARG A 413 -2.902 -6.669 -18.091 1.00 5.93 C ATOM 6388 O ARG A 413 -3.992 -7.088 -18.464 1.00 13.76 O ATOM 6389 CB ARG A 413 -3.013 -4.493 -16.770 1.00 4.96 C ATOM 6390 CG ARG A 413 -3.138 -3.748 -15.440 1.00 4.18 C ATOM 6391 CD ARG A 413 -4.361 -4.188 -14.625 1.00 5.83 C ATOM 6392 NE ARG A 413 -4.399 -5.546 -13.993 1.00 8.60 N ATOM 6393 CZ ARG A 413 -3.675 -5.868 -12.887 1.00 4.14 C ATOM 6394 NH1 ARG A 413 -2.905 -4.944 -12.367 1.00 5.55 N ATOM 6395 NH2 ARG A 413 -3.706 -7.068 -12.281 1.00 6.52 N ATOM 6396 HA ARG A 413 -3.691 -6.376 -16.080 1.00 0.00 H ATOM 6397 HB2 ARG A 413 -2.142 -4.097 -17.293 1.00 0.00 H ATOM 6398 HB3 ARG A 413 -3.910 -4.286 -17.353 1.00 0.00 H ATOM 6399 HG2 ARG A 413 -2.241 -3.935 -14.850 1.00 0.00 H ATOM 6400 HG3 ARG A 413 -3.221 -2.681 -15.645 1.00 0.00 H ATOM 6401 HD2 ARG A 413 -5.221 -4.129 -15.293 1.00 0.00 H ATOM 6402 HD3 ARG A 413 -4.478 -3.464 -13.819 1.00 0.00 H ATOM 6403 HE ARG A 413 -5.006 -6.275 -14.419 1.00 0.00 H ATOM 6404 HH12 ARG A 413 -2.338 -5.155 -11.521 1.00 0.00 H ATOM 6405 HH11 ARG A 413 -2.861 -3.999 -12.800 1.00 0.00 H ATOM 6406 HH22 ARG A 413 -3.123 -7.240 -11.437 1.00 0.00 H ATOM 6407 HH21 ARG A 413 -4.313 -7.824 -12.656 1.00 0.00 H ATOM 6408 H ARG A 413 -0.862 -5.720 -15.901 1.00 0.00 H ATOM 6409 N ALA A 414 -1.768 -6.756 -18.826 1.00 7.00 N ATOM 6410 CA ALA A 414 -1.790 -7.346 -20.135 1.00 5.39 C ATOM 6411 C ALA A 414 -2.272 -8.790 -20.047 1.00 10.48 C ATOM 6412 O ALA A 414 -3.035 -9.310 -20.869 1.00 9.60 O ATOM 6413 CB ALA A 414 -0.412 -7.276 -20.735 1.00 5.69 C ATOM 6414 HA ALA A 414 -2.480 -6.797 -20.775 1.00 0.00 H ATOM 6415 HB1 ALA A 414 -0.102 -6.234 -20.809 1.00 0.00 H ATOM 6416 HB2 ALA A 414 0.287 -7.820 -20.100 1.00 0.00 H ATOM 6417 HB3 ALA A 414 -0.427 -7.723 -21.729 1.00 0.00 H ATOM 6418 H ALA A 414 -0.874 -6.392 -18.439 1.00 0.00 H ATOM 6419 N LEU A 415 -1.814 -9.515 -19.020 1.00 11.28 N ATOM 6420 CA LEU A 415 -2.184 -10.909 -18.821 1.00 7.18 C ATOM 6421 C LEU A 415 -3.525 -11.152 -18.092 1.00 6.90 C ATOM 6422 O LEU A 415 -3.958 -12.276 -17.839 1.00 12.25 O ATOM 6423 CB LEU A 415 -1.036 -11.604 -18.127 1.00 12.18 C ATOM 6424 CG LEU A 415 0.272 -11.565 -18.967 1.00 6.91 C ATOM 6425 CD1 LEU A 415 1.428 -12.163 -18.130 1.00 10.88 C ATOM 6426 CD2 LEU A 415 0.147 -12.392 -20.243 1.00 11.05 C ATOM 6427 HA LEU A 415 -2.366 -11.332 -19.809 1.00 0.00 H ATOM 6428 HB2 LEU A 415 -0.854 -11.112 -17.171 1.00 0.00 H ATOM 6429 HB3 LEU A 415 -1.310 -12.644 -17.952 1.00 0.00 H ATOM 6430 HG LEU A 415 0.464 -10.526 -19.234 1.00 0.00 H ATOM 6431 HD21 LEU A 415 -0.064 -13.429 -19.983 1.00 0.00 H ATOM 6432 HD22 LEU A 415 -0.665 -11.996 -20.853 1.00 0.00 H ATOM 6433 HD23 LEU A 415 1.081 -12.339 -20.802 1.00 0.00 H ATOM 6434 HD11 LEU A 415 1.558 -11.576 -17.220 1.00 0.00 H ATOM 6435 HD12 LEU A 415 1.190 -13.194 -17.868 1.00 0.00 H ATOM 6436 HD13 LEU A 415 2.348 -12.138 -18.714 1.00 0.00 H ATOM 6437 H LEU A 415 -1.170 -9.066 -18.338 1.00 0.00 H ATOM 6438 N GLY A 416 -4.200 -10.102 -17.703 1.00 7.69 N ATOM 6439 CA GLY A 416 -5.464 -10.251 -17.029 1.00 4.10 C ATOM 6440 C GLY A 416 -5.369 -10.773 -15.626 1.00 10.50 C ATOM 6441 O GLY A 416 -6.323 -11.391 -15.238 1.00 13.23 O ATOM 6442 HA3 GLY A 416 -6.078 -10.941 -17.607 1.00 0.00 H ATOM 6443 HA2 GLY A 416 -5.949 -9.275 -16.996 1.00 0.00 H ATOM 6444 H GLY A 416 -3.821 -9.150 -17.882 1.00 0.00 H ATOM 6445 N PHE A 417 -4.276 -10.537 -14.871 1.00 8.24 N ATOM 6446 CA PHE A 417 -4.252 -11.078 -13.492 1.00 5.79 C ATOM 6447 C PHE A 417 -5.404 -10.553 -12.687 1.00 6.06 C ATOM 6448 O PHE A 417 -5.639 -9.332 -12.764 1.00 5.46 O ATOM 6449 CB PHE A 417 -2.949 -10.780 -12.730 1.00 7.31 C ATOM 6450 CG PHE A 417 -1.770 -11.539 -13.300 1.00 6.79 C ATOM 6451 CD1 PHE A 417 -1.897 -12.467 -14.333 1.00 6.50 C ATOM 6452 CD2 PHE A 417 -0.497 -11.279 -12.798 1.00 3.11 C ATOM 6453 CE1 PHE A 417 -0.767 -13.099 -14.848 1.00 14.31 C ATOM 6454 CE2 PHE A 417 0.648 -11.907 -13.284 1.00 9.68 C ATOM 6455 CZ PHE A 417 0.491 -12.834 -14.313 1.00 12.11 C ATOM 6456 HA PHE A 417 -4.327 -12.159 -13.612 1.00 0.00 H ATOM 6457 HB2 PHE A 417 -2.742 -9.712 -12.791 1.00 0.00 H ATOM 6458 HB3 PHE A 417 -3.079 -11.065 -11.686 1.00 0.00 H ATOM 6459 HD2 PHE A 417 -0.392 -10.554 -11.991 1.00 0.00 H ATOM 6460 HE2 PHE A 417 1.632 -11.681 -12.874 1.00 0.00 H ATOM 6461 HZ PHE A 417 1.363 -13.358 -14.704 1.00 0.00 H ATOM 6462 HE1 PHE A 417 -0.868 -13.804 -15.673 1.00 0.00 H ATOM 6463 HD1 PHE A 417 -2.882 -12.698 -14.738 1.00 0.00 H ATOM 6464 H PHE A 417 -3.474 -9.991 -15.246 1.00 0.00 H ATOM 6465 N PRO A 418 -6.114 -11.374 -11.919 1.00 8.36 N ATOM 6466 CA PRO A 418 -7.220 -10.805 -11.155 1.00 3.11 C ATOM 6467 C PRO A 418 -6.841 -10.258 -9.760 1.00 3.00 C ATOM 6468 O PRO A 418 -5.657 -10.251 -9.305 1.00 4.18 O ATOM 6469 CB PRO A 418 -8.047 -12.057 -10.893 1.00 3.09 C ATOM 6470 CG PRO A 418 -7.062 -13.177 -10.689 1.00 8.13 C ATOM 6471 CD PRO A 418 -5.870 -12.783 -11.520 1.00 13.31 C ATOM 6472 HA PRO A 418 -7.668 -9.969 -11.692 1.00 0.00 H ATOM 6473 HD3 PRO A 418 -4.954 -12.860 -10.934 1.00 0.00 H ATOM 6474 HD2 PRO A 418 -5.791 -13.421 -12.401 1.00 0.00 H ATOM 6475 HG3 PRO A 418 -7.477 -14.124 -11.034 1.00 0.00 H ATOM 6476 HG2 PRO A 418 -6.788 -13.263 -9.638 1.00 0.00 H ATOM 6477 HB2 PRO A 418 -8.660 -11.925 -10.001 1.00 0.00 H ATOM 6478 HB3 PRO A 418 -8.691 -12.270 -11.746 1.00 0.00 H ATOM 6479 N LEU A 419 -7.860 -9.796 -9.062 1.00 4.66 N ATOM 6480 CA LEU A 419 -7.764 -9.277 -7.686 1.00 5.25 C ATOM 6481 C LEU A 419 -6.966 -10.243 -6.819 1.00 7.10 C ATOM 6482 O LEU A 419 -7.266 -11.453 -6.880 1.00 6.52 O ATOM 6483 CB LEU A 419 -9.194 -9.109 -7.075 1.00 4.79 C ATOM 6484 CG LEU A 419 -9.274 -8.420 -5.714 1.00 3.09 C ATOM 6485 CD1 LEU A 419 -9.111 -6.941 -5.981 1.00 8.39 C ATOM 6486 CD2 LEU A 419 -10.660 -8.680 -5.084 1.00 5.00 C ATOM 6487 HA LEU A 419 -7.262 -8.310 -7.715 1.00 0.00 H ATOM 6488 HB2 LEU A 419 -9.789 -8.526 -7.778 1.00 0.00 H ATOM 6489 HB3 LEU A 419 -9.629 -10.103 -6.970 1.00 0.00 H ATOM 6490 HG LEU A 419 -8.510 -8.792 -5.031 1.00 0.00 H ATOM 6491 HD21 LEU A 419 -11.436 -8.282 -5.739 1.00 0.00 H ATOM 6492 HD22 LEU A 419 -10.805 -9.753 -4.957 1.00 0.00 H ATOM 6493 HD23 LEU A 419 -10.715 -8.187 -4.113 1.00 0.00 H ATOM 6494 HD11 LEU A 419 -8.146 -6.763 -6.456 1.00 0.00 H ATOM 6495 HD12 LEU A 419 -9.910 -6.602 -6.641 1.00 0.00 H ATOM 6496 HD13 LEU A 419 -9.160 -6.395 -5.039 1.00 0.00 H ATOM 6497 H LEU A 419 -8.797 -9.798 -9.514 1.00 0.00 H ATOM 6498 N GLU A 420 -5.981 -9.709 -6.029 1.00 5.44 N ATOM 6499 CA GLU A 420 -5.166 -10.501 -5.111 1.00 5.02 C ATOM 6500 C GLU A 420 -6.030 -10.539 -3.862 1.00 9.17 C ATOM 6501 O GLU A 420 -6.277 -9.504 -3.243 1.00 7.97 O ATOM 6502 CB GLU A 420 -3.790 -9.902 -4.803 1.00 3.88 C ATOM 6503 CG GLU A 420 -3.087 -10.822 -3.761 1.00 7.97 C ATOM 6504 CD GLU A 420 -1.683 -10.432 -3.520 1.00 8.61 C ATOM 6505 OE1 GLU A 420 -0.919 -10.509 -4.580 1.00 7.65 O ATOM 6506 OE2 GLU A 420 -1.263 -10.335 -2.380 1.00 4.72 O ATOM 6507 HA GLU A 420 -4.921 -11.475 -5.534 1.00 0.00 H ATOM 6508 HB2 GLU A 420 -3.195 -9.853 -5.715 1.00 0.00 H ATOM 6509 HB3 GLU A 420 -3.906 -8.899 -4.392 1.00 0.00 H ATOM 6510 HG2 GLU A 420 -3.633 -10.765 -2.819 1.00 0.00 H ATOM 6511 HG3 GLU A 420 -3.107 -11.848 -4.130 1.00 0.00 H ATOM 6512 H GLU A 420 -5.805 -8.686 -6.086 1.00 0.00 H ATOM 6513 N ARG A 421 -6.520 -11.765 -3.490 1.00 3.00 N ATOM 6514 CA ARG A 421 -7.375 -11.841 -2.350 1.00 3.00 C ATOM 6515 C ARG A 421 -7.310 -13.258 -1.760 1.00 12.10 C ATOM 6516 O ARG A 421 -8.074 -14.119 -2.156 1.00 5.43 O ATOM 6517 CB ARG A 421 -8.809 -11.449 -2.781 1.00 5.06 C ATOM 6518 CG ARG A 421 -9.751 -10.814 -1.721 1.00 4.01 C ATOM 6519 CD ARG A 421 -10.018 -11.708 -0.513 1.00 5.41 C ATOM 6520 NE ARG A 421 -10.986 -11.186 0.462 1.00 3.00 N ATOM 6521 CZ ARG A 421 -11.103 -11.577 1.725 1.00 10.38 C ATOM 6522 NH1 ARG A 421 -10.346 -12.533 2.242 1.00 5.21 N ATOM 6523 NH2 ARG A 421 -12.030 -11.015 2.509 1.00 4.89 N ATOM 6524 HA ARG A 421 -7.055 -11.149 -1.571 1.00 0.00 H ATOM 6525 HB2 ARG A 421 -8.716 -10.735 -3.599 1.00 0.00 H ATOM 6526 HB3 ARG A 421 -9.296 -12.354 -3.144 1.00 0.00 H ATOM 6527 HG2 ARG A 421 -9.296 -9.888 -1.369 1.00 0.00 H ATOM 6528 HG3 ARG A 421 -10.704 -10.590 -2.200 1.00 0.00 H ATOM 6529 HD2 ARG A 421 -9.072 -11.864 0.005 1.00 0.00 H ATOM 6530 HD3 ARG A 421 -10.393 -12.664 -0.879 1.00 0.00 H ATOM 6531 HE ARG A 421 -11.637 -10.445 0.133 1.00 0.00 H ATOM 6532 HH12 ARG A 421 -10.468 -12.812 3.237 1.00 0.00 H ATOM 6533 HH11 ARG A 421 -9.630 -13.005 1.653 1.00 0.00 H ATOM 6534 HH22 ARG A 421 -12.126 -11.317 3.499 1.00 0.00 H ATOM 6535 HH21 ARG A 421 -12.654 -10.276 2.128 1.00 0.00 H ATOM 6536 H ARG A 421 -6.274 -12.621 -4.027 1.00 0.00 H ATOM 6537 N PRO A 422 -6.353 -13.445 -0.813 1.00 7.20 N ATOM 6538 CA PRO A 422 -6.185 -14.764 -0.166 1.00 8.31 C ATOM 6539 C PRO A 422 -7.175 -14.834 0.993 1.00 12.44 C ATOM 6540 O PRO A 422 -7.838 -13.836 1.325 1.00 5.27 O ATOM 6541 CB PRO A 422 -4.778 -14.744 0.417 1.00 8.38 C ATOM 6542 CG PRO A 422 -4.408 -13.237 0.484 1.00 14.12 C ATOM 6543 CD PRO A 422 -5.276 -12.478 -0.506 1.00 12.47 C ATOM 6544 HA PRO A 422 -6.342 -15.598 -0.850 1.00 0.00 H ATOM 6545 HD3 PRO A 422 -5.680 -11.570 -0.058 1.00 0.00 H ATOM 6546 HD2 PRO A 422 -4.713 -12.220 -1.403 1.00 0.00 H ATOM 6547 HG3 PRO A 422 -3.357 -13.105 0.227 1.00 0.00 H ATOM 6548 HG2 PRO A 422 -4.585 -12.860 1.491 1.00 0.00 H ATOM 6549 HB2 PRO A 422 -4.766 -15.189 1.412 1.00 0.00 H ATOM 6550 HB3 PRO A 422 -4.085 -15.283 -0.229 1.00 0.00 H ATOM 6551 N LYS A 423 -7.271 -15.998 1.626 1.00 7.82 N ATOM 6552 CA LYS A 423 -8.167 -16.173 2.750 1.00 7.71 C ATOM 6553 C LYS A 423 -7.374 -16.000 4.023 1.00 8.06 C ATOM 6554 O LYS A 423 -6.215 -16.409 4.135 1.00 10.49 O ATOM 6555 CB LYS A 423 -8.760 -17.604 2.724 1.00 12.95 C ATOM 6556 CG LYS A 423 -9.794 -17.928 3.819 1.00 14.77 C ATOM 6557 CD LYS A 423 -11.180 -17.311 3.585 1.00 7.96 C ATOM 6558 CE LYS A 423 -12.196 -17.588 4.687 1.00 7.71 C ATOM 6559 NZ LYS A 423 -11.794 -17.032 5.985 1.00 10.67 N ATOM 6560 HA LYS A 423 -8.975 -15.443 2.697 1.00 0.00 H ATOM 6561 HB2 LYS A 423 -9.242 -17.748 1.757 1.00 0.00 H ATOM 6562 HB3 LYS A 423 -7.935 -18.309 2.825 1.00 0.00 H ATOM 6563 HG2 LYS A 423 -9.907 -19.011 3.872 1.00 0.00 H ATOM 6564 HG3 LYS A 423 -9.412 -17.557 4.770 1.00 0.00 H ATOM 6565 HD2 LYS A 423 -11.061 -16.231 3.497 1.00 0.00 H ATOM 6566 HD3 LYS A 423 -11.576 -17.709 2.651 1.00 0.00 H ATOM 6567 HE2 LYS A 423 -12.312 -18.667 4.791 1.00 0.00 H ATOM 6568 HE3 LYS A 423 -13.151 -17.147 4.400 1.00 0.00 H ATOM 6569 HZ1 LYS A 423 -10.888 -17.452 6.275 1.00 0.00 H ATOM 6570 HZ2 LYS A 423 -11.689 -16.001 5.901 1.00 0.00 H ATOM 6571 HZ3 LYS A 423 -12.522 -17.251 6.695 1.00 0.00 H ATOM 6572 H LYS A 423 -6.691 -16.800 1.308 1.00 0.00 H ATOM 6573 N SER A 424 -7.987 -15.374 5.004 1.00 6.86 N ATOM 6574 CA SER A 424 -7.300 -15.201 6.280 1.00 7.44 C ATOM 6575 C SER A 424 -8.014 -16.118 7.269 1.00 8.92 C ATOM 6576 O SER A 424 -9.115 -16.642 7.038 1.00 5.78 O ATOM 6577 CB SER A 424 -7.287 -13.780 6.812 1.00 3.00 C ATOM 6578 OG SER A 424 -8.566 -13.394 7.287 1.00 7.16 O ATOM 6579 HA SER A 424 -6.247 -15.447 6.139 1.00 0.00 H ATOM 6580 HB2 SER A 424 -6.987 -13.104 6.011 1.00 0.00 H ATOM 6581 HB3 SER A 424 -6.570 -13.714 7.630 1.00 0.00 H ATOM 6582 HG SER A 424 -8.842 -14.001 8.018 1.00 0.00 H ATOM 6583 H SER A 424 -8.951 -15.006 4.872 1.00 0.00 H ATOM 6584 N MET A 425 -7.366 -16.315 8.411 1.00 12.08 N ATOM 6585 CA MET A 425 -7.893 -17.149 9.475 1.00 8.84 C ATOM 6586 C MET A 425 -7.535 -16.516 10.819 1.00 4.36 C ATOM 6587 O MET A 425 -6.527 -15.800 10.948 1.00 11.00 O ATOM 6588 CB MET A 425 -7.025 -18.424 9.467 1.00 21.06 C ATOM 6589 CG MET A 425 -7.785 -19.649 9.811 1.00 45.28 C ATOM 6590 SD MET A 425 -8.311 -20.335 8.250 1.00 66.82 S ATOM 6591 CE MET A 425 -10.025 -19.745 8.153 1.00 65.20 C ATOM 6592 HA MET A 425 -8.965 -17.299 9.345 1.00 0.00 H ATOM 6593 HB2 MET A 425 -6.600 -18.548 8.471 1.00 0.00 H ATOM 6594 HB3 MET A 425 -6.220 -18.300 10.192 1.00 0.00 H ATOM 6595 HG2 MET A 425 -8.648 -19.402 10.429 1.00 0.00 H ATOM 6596 HG3 MET A 425 -7.149 -20.356 10.343 1.00 0.00 H ATOM 6597 HE1 MET A 425 -10.588 -20.128 9.004 1.00 0.00 H ATOM 6598 HE2 MET A 425 -10.034 -18.655 8.170 1.00 0.00 H ATOM 6599 HE3 MET A 425 -10.478 -20.099 7.227 1.00 0.00 H ATOM 6600 H MET A 425 -6.444 -15.853 8.548 1.00 0.00 H ATOM 6601 N SER A 426 -8.372 -16.820 11.805 1.00 3.22 N ATOM 6602 CA SER A 426 -8.065 -16.320 13.162 1.00 5.87 C ATOM 6603 C SER A 426 -7.287 -17.450 13.867 1.00 16.21 C ATOM 6604 O SER A 426 -7.323 -18.609 13.378 1.00 14.11 O ATOM 6605 CB SER A 426 -9.283 -15.953 13.988 1.00 18.88 C ATOM 6606 OG SER A 426 -10.071 -17.134 14.208 1.00 8.12 O ATOM 6607 HA SER A 426 -7.499 -15.393 13.068 1.00 0.00 H ATOM 6608 HB2 SER A 426 -9.877 -15.211 13.454 1.00 0.00 H ATOM 6609 HB3 SER A 426 -8.965 -15.542 14.946 1.00 0.00 H ATOM 6610 HG SER A 426 -10.868 -16.902 14.747 1.00 0.00 H ATOM 6611 H SER A 426 -9.221 -17.394 11.627 1.00 0.00 H ATOM 6612 N THR A 427 -6.604 -17.158 15.003 1.00 8.50 N ATOM 6613 CA THR A 427 -5.900 -18.238 15.713 1.00 12.32 C ATOM 6614 C THR A 427 -6.918 -19.299 16.213 1.00 17.44 C ATOM 6615 O THR A 427 -6.679 -20.499 16.178 1.00 16.24 O ATOM 6616 CB THR A 427 -5.122 -17.722 16.950 1.00 13.37 C ATOM 6617 OG1 THR A 427 -3.969 -17.078 16.496 1.00 7.10 O ATOM 6618 CG2 THR A 427 -4.742 -18.897 17.863 1.00 13.67 C ATOM 6619 HA THR A 427 -5.195 -18.666 15.001 1.00 0.00 H ATOM 6620 HB THR A 427 -5.741 -17.032 17.523 1.00 0.00 H ATOM 6621 HG1 THR A 427 -3.414 -17.719 15.985 1.00 0.00 H ATOM 6622 HG23 THR A 427 -5.648 -19.392 18.212 1.00 0.00 H ATOM 6623 HG21 THR A 427 -4.130 -19.606 17.305 1.00 0.00 H ATOM 6624 HG22 THR A 427 -4.179 -18.524 18.718 1.00 0.00 H ATOM 6625 H THR A 427 -6.578 -16.184 15.367 1.00 0.00 H ATOM 6626 N ALA A 428 -8.099 -18.855 16.691 1.00 15.38 N ATOM 6627 CA ALA A 428 -9.159 -19.702 17.177 1.00 13.36 C ATOM 6628 C ALA A 428 -9.710 -20.556 16.057 1.00 16.77 C ATOM 6629 O ALA A 428 -9.875 -21.763 16.141 1.00 21.26 O ATOM 6630 CB ALA A 428 -10.267 -18.866 17.789 1.00 16.44 C ATOM 6631 HA ALA A 428 -8.749 -20.357 17.946 1.00 0.00 H ATOM 6632 HB1 ALA A 428 -9.866 -18.286 18.620 1.00 0.00 H ATOM 6633 HB2 ALA A 428 -10.670 -18.190 17.034 1.00 0.00 H ATOM 6634 HB3 ALA A 428 -11.058 -19.523 18.150 1.00 0.00 H ATOM 6635 H ALA A 428 -8.256 -17.827 16.710 1.00 0.00 H ATOM 6636 N GLY A 429 -9.996 -19.941 14.955 1.00 12.99 N ATOM 6637 CA GLY A 429 -10.501 -20.721 13.856 1.00 12.98 C ATOM 6638 C GLY A 429 -9.476 -21.745 13.384 1.00 15.82 C ATOM 6639 O GLY A 429 -9.792 -22.883 13.032 1.00 23.71 O ATOM 6640 HA3 GLY A 429 -10.743 -20.054 13.029 1.00 0.00 H ATOM 6641 HA2 GLY A 429 -11.403 -21.243 14.176 1.00 0.00 H ATOM 6642 H GLY A 429 -9.865 -18.913 14.866 1.00 0.00 H ATOM 6643 N LEU A 430 -8.186 -21.379 13.370 1.00 19.11 N ATOM 6644 CA LEU A 430 -7.156 -22.319 12.936 1.00 20.66 C ATOM 6645 C LEU A 430 -6.951 -23.493 13.911 1.00 30.84 C ATOM 6646 O LEU A 430 -6.687 -24.630 13.522 1.00 22.81 O ATOM 6647 CB LEU A 430 -5.914 -21.491 12.659 1.00 19.36 C ATOM 6648 CG LEU A 430 -4.715 -22.211 12.147 1.00 20.06 C ATOM 6649 CD1 LEU A 430 -5.024 -22.889 10.826 1.00 27.50 C ATOM 6650 CD2 LEU A 430 -3.671 -21.119 11.921 1.00 26.24 C ATOM 6651 HA LEU A 430 -7.455 -22.838 12.026 1.00 0.00 H ATOM 6652 HB2 LEU A 430 -6.182 -20.734 11.922 1.00 0.00 H ATOM 6653 HB3 LEU A 430 -5.630 -21.003 13.592 1.00 0.00 H ATOM 6654 HG LEU A 430 -4.381 -22.983 12.841 1.00 0.00 H ATOM 6655 HD21 LEU A 430 -4.051 -20.399 11.196 1.00 0.00 H ATOM 6656 HD22 LEU A 430 -3.467 -20.613 12.864 1.00 0.00 H ATOM 6657 HD23 LEU A 430 -2.753 -21.568 11.542 1.00 0.00 H ATOM 6658 HD11 LEU A 430 -5.833 -23.605 10.967 1.00 0.00 H ATOM 6659 HD12 LEU A 430 -5.325 -22.138 10.095 1.00 0.00 H ATOM 6660 HD13 LEU A 430 -4.135 -23.409 10.469 1.00 0.00 H ATOM 6661 H LEU A 430 -7.917 -20.420 13.670 1.00 0.00 H ATOM 6662 N GLU A 431 -7.092 -23.208 15.203 1.00 19.31 N ATOM 6663 CA GLU A 431 -6.931 -24.239 16.208 1.00 17.79 C ATOM 6664 C GLU A 431 -8.037 -25.241 15.966 1.00 26.67 C ATOM 6665 O GLU A 431 -7.792 -26.426 15.941 1.00 26.77 O ATOM 6666 CB GLU A 431 -7.008 -23.620 17.604 1.00 11.62 C ATOM 6667 CG GLU A 431 -5.730 -22.888 18.041 1.00 19.34 C ATOM 6668 CD GLU A 431 -5.842 -22.329 19.448 1.00 8.35 C ATOM 6669 OE1 GLU A 431 -6.872 -22.233 19.997 1.00 18.27 O ATOM 6670 OE2 GLU A 431 -4.723 -21.812 19.909 1.00 32.50 O ATOM 6671 HA GLU A 431 -5.961 -24.732 16.144 1.00 0.00 H ATOM 6672 HB2 GLU A 431 -7.832 -22.907 17.617 1.00 0.00 H ATOM 6673 HB3 GLU A 431 -7.208 -24.417 18.321 1.00 0.00 H ATOM 6674 HG2 GLU A 431 -4.895 -23.588 18.006 1.00 0.00 H ATOM 6675 HG3 GLU A 431 -5.542 -22.066 17.350 1.00 0.00 H ATOM 6676 H GLU A 431 -7.320 -22.236 15.494 1.00 0.00 H ATOM 6677 N LYS A 432 -9.266 -24.758 15.755 1.00 22.51 N ATOM 6678 CA LYS A 432 -10.370 -25.653 15.495 1.00 21.04 C ATOM 6679 C LYS A 432 -10.152 -26.487 14.236 1.00 31.66 C ATOM 6680 O LYS A 432 -10.439 -27.696 14.196 1.00 36.67 O ATOM 6681 CB LYS A 432 -11.658 -24.858 15.442 1.00 31.47 C ATOM 6682 CG LYS A 432 -12.517 -25.221 14.244 1.00 80.00 C ATOM 6683 CD LYS A 432 -13.936 -25.644 14.614 1.00 80.00 C ATOM 6684 CE LYS A 432 -14.483 -24.944 15.854 1.00 80.00 C ATOM 6685 NZ LYS A 432 -15.258 -25.838 16.737 1.00 80.00 N ATOM 6686 HA LYS A 432 -10.438 -26.371 16.312 1.00 0.00 H ATOM 6687 HB2 LYS A 432 -12.226 -25.052 16.352 1.00 0.00 H ATOM 6688 HB3 LYS A 432 -11.412 -23.797 15.388 1.00 0.00 H ATOM 6689 HG2 LYS A 432 -12.576 -24.353 13.587 1.00 0.00 H ATOM 6690 HG3 LYS A 432 -12.039 -26.045 13.714 1.00 0.00 H ATOM 6691 HD2 LYS A 432 -14.592 -25.418 13.774 1.00 0.00 H ATOM 6692 HD3 LYS A 432 -13.938 -26.719 14.796 1.00 0.00 H ATOM 6693 HE2 LYS A 432 -15.131 -24.128 15.533 1.00 0.00 H ATOM 6694 HE3 LYS A 432 -13.645 -24.539 16.421 1.00 0.00 H ATOM 6695 HZ1 LYS A 432 -16.069 -26.224 16.212 1.00 0.00 H ATOM 6696 HZ2 LYS A 432 -14.649 -26.617 17.060 1.00 0.00 H ATOM 6697 HZ3 LYS A 432 -15.600 -25.300 17.559 1.00 0.00 H ATOM 6698 H LYS A 432 -9.428 -23.731 15.778 1.00 0.00 H ATOM 6699 N LEU A 433 -9.645 -25.850 13.193 1.00 19.46 N ATOM 6700 CA LEU A 433 -9.386 -26.563 11.940 1.00 20.33 C ATOM 6701 C LEU A 433 -8.486 -27.811 12.203 1.00 39.78 C ATOM 6702 O LEU A 433 -8.540 -28.899 11.627 1.00 27.27 O ATOM 6703 CB LEU A 433 -8.586 -25.629 10.990 1.00 20.59 C ATOM 6704 CG LEU A 433 -8.500 -26.138 9.567 1.00 32.43 C ATOM 6705 CD1 LEU A 433 -9.913 -26.138 9.015 1.00 43.88 C ATOM 6706 CD2 LEU A 433 -7.600 -25.267 8.672 1.00 21.71 C ATOM 6707 HA LEU A 433 -10.341 -26.864 11.509 1.00 0.00 H ATOM 6708 HB2 LEU A 433 -9.071 -24.653 10.978 1.00 0.00 H ATOM 6709 HB3 LEU A 433 -7.574 -25.526 11.381 1.00 0.00 H ATOM 6710 HG LEU A 433 -8.055 -27.133 9.573 1.00 0.00 H ATOM 6711 HD21 LEU A 433 -7.996 -24.252 8.639 1.00 0.00 H ATOM 6712 HD22 LEU A 433 -6.590 -25.251 9.081 1.00 0.00 H ATOM 6713 HD23 LEU A 433 -7.579 -25.684 7.665 1.00 0.00 H ATOM 6714 HD11 LEU A 433 -10.539 -26.791 9.623 1.00 0.00 H ATOM 6715 HD12 LEU A 433 -10.312 -25.124 9.040 1.00 0.00 H ATOM 6716 HD13 LEU A 433 -9.900 -26.499 7.987 1.00 0.00 H ATOM 6717 H LEU A 433 -9.429 -24.835 13.263 1.00 0.00 H ATOM 6718 N SER A 434 -7.563 -27.673 13.127 1.00 25.60 N ATOM 6719 CA SER A 434 -6.692 -28.789 13.401 1.00 20.54 C ATOM 6720 C SER A 434 -7.033 -29.612 14.649 1.00 25.12 C ATOM 6721 O SER A 434 -6.889 -30.805 14.579 1.00 48.62 O ATOM 6722 CB SER A 434 -5.279 -28.277 13.617 1.00 37.23 C ATOM 6723 OG SER A 434 -4.966 -27.337 12.612 1.00 51.74 O ATOM 6724 HA SER A 434 -6.810 -29.439 12.534 1.00 0.00 H ATOM 6725 HB2 SER A 434 -4.578 -29.110 13.568 1.00 0.00 H ATOM 6726 HB3 SER A 434 -5.209 -27.802 14.595 1.00 0.00 H ATOM 6727 HG SER A 434 -5.604 -26.581 12.658 1.00 0.00 H ATOM 6728 H SER A 434 -7.463 -26.779 13.649 1.00 0.00 H ATOM 6729 N ALA A 435 -7.438 -28.972 15.751 1.00 40.13 N ATOM 6730 CA ALA A 435 -7.771 -29.531 17.066 1.00 44.95 C ATOM 6731 C ALA A 435 -7.372 -28.510 18.147 1.00 67.65 C ATOM 6732 O ALA A 435 -8.068 -28.243 19.132 1.00 80.00 O ATOM 6733 CB ALA A 435 -6.943 -30.773 17.366 1.00 45.52 C ATOM 6734 HA ALA A 435 -8.835 -29.767 17.063 1.00 0.00 H ATOM 6735 HB1 ALA A 435 -7.139 -31.531 16.607 1.00 0.00 H ATOM 6736 HB2 ALA A 435 -5.884 -30.513 17.357 1.00 0.00 H ATOM 6737 HB3 ALA A 435 -7.215 -31.161 18.348 1.00 0.00 H ATOM 6738 H ALA A 435 -7.529 -27.940 15.664 1.00 0.00 H ATOM 6739 N GLY A 436 -6.204 -27.912 17.969 1.00 55.60 N ATOM 6740 CA GLY A 436 -5.747 -26.921 18.921 1.00 51.33 C ATOM 6741 C GLY A 436 -4.417 -27.289 19.504 1.00 48.09 C ATOM 6742 O GLY A 436 -3.873 -28.323 19.170 1.00 60.84 O ATOM 6743 HA3 GLY A 436 -6.477 -26.841 19.727 1.00 0.00 H ATOM 6744 HA2 GLY A 436 -5.658 -25.959 18.416 1.00 0.00 H ATOM 6745 H GLY A 436 -5.615 -28.154 17.146 1.00 0.00 H ATOM 6746 N GLY A 437 -3.876 -26.462 20.382 1.00 49.68 N ATOM 6747 CA GLY A 437 -2.599 -26.813 20.961 1.00 36.38 C ATOM 6748 C GLY A 437 -2.360 -25.833 22.078 1.00 28.31 C ATOM 6749 O GLY A 437 -1.943 -24.721 21.775 1.00 80.00 O ATOM 6750 HA3 GLY A 437 -1.810 -26.733 20.213 1.00 0.00 H ATOM 6751 HA2 GLY A 437 -2.627 -27.831 21.351 1.00 0.00 H ATOM 6752 H GLY A 437 -4.358 -25.580 20.650 1.00 0.00 H TER 6753 GLY A 437 ATOM 6754 N SER B 3 -10.470 5.049 35.442 1.00 48.47 N ATOM 6755 CA SER B 3 -11.137 3.760 35.714 1.00 44.43 C ATOM 6756 C SER B 3 -11.084 2.828 34.502 1.00 19.55 C ATOM 6757 O SER B 3 -10.527 1.740 34.595 1.00 28.21 O ATOM 6758 CB SER B 3 -12.539 3.835 36.322 1.00 55.81 C ATOM 6759 OG SER B 3 -12.737 2.734 37.191 1.00 79.11 O ATOM 6760 HA SER B 3 -10.541 3.326 36.517 1.00 0.00 H ATOM 6761 HB2 SER B 3 -13.283 3.808 35.525 1.00 0.00 H ATOM 6762 HB3 SER B 3 -12.643 4.764 36.883 1.00 0.00 H ATOM 6763 HG SER B 3 -13.644 2.784 37.584 1.00 0.00 H ATOM 6764 HN3 SER B 3 -10.942 5.521 34.645 1.00 0.00 H ATOM 6765 HN2 SER B 3 -9.472 4.878 35.203 1.00 0.00 H ATOM 6766 HN1 SER B 3 -10.527 5.653 36.287 1.00 0.00 H ATOM 6767 N THR B 4 -11.665 3.226 33.360 1.00 15.85 N ATOM 6768 CA THR B 4 -11.603 2.395 32.192 1.00 16.22 C ATOM 6769 C THR B 4 -10.310 2.805 31.488 1.00 19.00 C ATOM 6770 O THR B 4 -9.964 3.999 31.444 1.00 10.94 O ATOM 6771 CB THR B 4 -12.747 2.682 31.190 1.00 17.24 C ATOM 6772 OG1 THR B 4 -14.005 2.510 31.796 1.00 31.01 O ATOM 6773 CG2 THR B 4 -12.583 1.810 29.946 1.00 13.98 C ATOM 6774 HA THR B 4 -11.667 1.348 32.490 1.00 0.00 H ATOM 6775 HB THR B 4 -12.690 3.724 30.877 1.00 0.00 H ATOM 6776 HG1 THR B 4 -14.091 1.577 32.117 1.00 0.00 H ATOM 6777 HG23 THR B 4 -11.597 1.978 29.514 1.00 0.00 H ATOM 6778 HG21 THR B 4 -12.686 0.761 30.223 1.00 0.00 H ATOM 6779 HG22 THR B 4 -13.350 2.071 29.217 1.00 0.00 H ATOM 6780 H THR B 4 -12.161 4.139 33.321 1.00 0.00 H ATOM 6781 N ASN B 5 -9.588 1.829 30.945 1.00 17.64 N ATOM 6782 CA ASN B 5 -8.362 2.126 30.235 1.00 11.56 C ATOM 6783 C ASN B 5 -8.099 0.946 29.348 1.00 11.00 C ATOM 6784 O ASN B 5 -7.656 -0.069 29.848 1.00 13.47 O ATOM 6785 CB ASN B 5 -7.152 2.526 31.061 1.00 13.02 C ATOM 6786 CG ASN B 5 -6.045 3.106 30.170 1.00 20.15 C ATOM 6787 OD1 ASN B 5 -5.084 3.688 30.669 1.00 28.90 O ATOM 6788 ND2 ASN B 5 -6.074 2.899 28.860 1.00 11.50 N ATOM 6789 HA ASN B 5 -8.520 3.048 29.675 1.00 0.00 H ATOM 6790 HB2 ASN B 5 -7.452 3.277 31.792 1.00 0.00 H ATOM 6791 HB3 ASN B 5 -6.768 1.648 31.580 1.00 0.00 H ATOM 6792 HD22 ASN B 5 -6.883 2.408 28.429 1.00 0.00 H ATOM 6793 HD21 ASN B 5 -5.288 3.228 28.264 1.00 0.00 H ATOM 6794 H ASN B 5 -9.907 0.843 31.031 1.00 0.00 H ATOM 6795 N LEU B 6 -8.413 1.082 28.054 1.00 13.26 N ATOM 6796 CA LEU B 6 -8.222 -0.036 27.118 1.00 13.01 C ATOM 6797 C LEU B 6 -6.798 -0.488 27.122 1.00 6.00 C ATOM 6798 O LEU B 6 -6.473 -1.638 27.056 1.00 10.56 O ATOM 6799 CB LEU B 6 -8.583 0.446 25.685 1.00 10.67 C ATOM 6800 CG LEU B 6 -8.538 -0.571 24.554 1.00 9.23 C ATOM 6801 CD1 LEU B 6 -9.340 -1.855 24.924 1.00 9.02 C ATOM 6802 CD2 LEU B 6 -9.210 0.182 23.387 1.00 19.66 C ATOM 6803 HA LEU B 6 -8.860 -0.865 27.423 1.00 0.00 H ATOM 6804 HB2 LEU B 6 -9.597 0.844 25.723 1.00 0.00 H ATOM 6805 HB3 LEU B 6 -7.890 1.247 25.428 1.00 0.00 H ATOM 6806 HG LEU B 6 -7.529 -0.913 24.323 1.00 0.00 H ATOM 6807 HD21 LEU B 6 -10.228 0.452 23.669 1.00 0.00 H ATOM 6808 HD22 LEU B 6 -8.641 1.085 23.163 1.00 0.00 H ATOM 6809 HD23 LEU B 6 -9.234 -0.461 22.507 1.00 0.00 H ATOM 6810 HD11 LEU B 6 -8.909 -2.306 25.818 1.00 0.00 H ATOM 6811 HD12 LEU B 6 -10.380 -1.590 25.115 1.00 0.00 H ATOM 6812 HD13 LEU B 6 -9.290 -2.564 24.097 1.00 0.00 H ATOM 6813 H LEU B 6 -8.795 1.985 27.708 1.00 0.00 H ATOM 6814 N LYS B 7 -5.881 0.453 27.204 1.00 7.54 N ATOM 6815 CA LYS B 7 -4.469 0.081 27.207 1.00 13.62 C ATOM 6816 C LYS B 7 -4.099 -0.848 28.354 1.00 8.47 C ATOM 6817 O LYS B 7 -3.209 -1.702 28.183 1.00 10.79 O ATOM 6818 CB LYS B 7 -3.624 1.327 27.207 1.00 8.48 C ATOM 6819 CG LYS B 7 -2.250 1.097 26.568 1.00 18.32 C ATOM 6820 CD LYS B 7 -1.267 2.293 26.687 1.00 9.17 C ATOM 6821 CE LYS B 7 0.057 2.137 25.916 1.00 16.62 C ATOM 6822 NZ LYS B 7 0.723 3.452 25.765 1.00 14.89 N ATOM 6823 HA LYS B 7 -4.273 -0.489 26.299 1.00 0.00 H ATOM 6824 HB2 LYS B 7 -4.145 2.105 26.648 1.00 0.00 H ATOM 6825 HB3 LYS B 7 -3.482 1.655 28.237 1.00 0.00 H ATOM 6826 HG2 LYS B 7 -1.792 0.233 27.049 1.00 0.00 H ATOM 6827 HG3 LYS B 7 -2.399 0.885 25.509 1.00 0.00 H ATOM 6828 HD2 LYS B 7 -1.772 3.183 26.312 1.00 0.00 H ATOM 6829 HD3 LYS B 7 -1.029 2.429 27.742 1.00 0.00 H ATOM 6830 HE2 LYS B 7 -0.148 1.722 24.929 1.00 0.00 H ATOM 6831 HE3 LYS B 7 0.715 1.461 26.463 1.00 0.00 H ATOM 6832 HZ1 LYS B 7 0.098 4.097 25.241 1.00 0.00 H ATOM 6833 HZ2 LYS B 7 0.922 3.848 26.706 1.00 0.00 H ATOM 6834 HZ3 LYS B 7 1.614 3.330 25.243 1.00 0.00 H ATOM 6835 H LYS B 7 -6.160 1.453 27.266 1.00 0.00 H ATOM 6836 N ASP B 8 -4.771 -0.725 29.535 1.00 9.77 N ATOM 6837 CA ASP B 8 -4.475 -1.614 30.682 1.00 5.10 C ATOM 6838 C ASP B 8 -5.067 -2.985 30.439 1.00 11.14 C ATOM 6839 O ASP B 8 -4.554 -4.031 30.845 1.00 11.81 O ATOM 6840 CB ASP B 8 -4.988 -1.159 32.050 1.00 7.51 C ATOM 6841 CG ASP B 8 -4.235 0.028 32.612 1.00 15.74 C ATOM 6842 OD1 ASP B 8 -2.915 0.015 32.448 1.00 16.67 O ATOM 6843 OD2 ASP B 8 -4.836 0.938 33.126 1.00 16.16 O ATOM 6844 HA ASP B 8 -3.386 -1.604 30.730 1.00 0.00 H ATOM 6845 HB2 ASP B 8 -6.039 -0.887 31.952 1.00 0.00 H ATOM 6846 HB3 ASP B 8 -4.893 -1.990 32.748 1.00 0.00 H ATOM 6847 H ASP B 8 -5.504 0.006 29.632 1.00 0.00 H ATOM 6848 N VAL B 9 -6.190 -2.993 29.720 1.00 5.21 N ATOM 6849 CA VAL B 9 -6.888 -4.227 29.385 1.00 6.81 C ATOM 6850 C VAL B 9 -6.033 -5.010 28.440 1.00 13.52 C ATOM 6851 O VAL B 9 -5.805 -6.200 28.650 1.00 9.71 O ATOM 6852 CB VAL B 9 -8.269 -4.006 28.812 1.00 9.29 C ATOM 6853 CG1 VAL B 9 -8.772 -5.256 28.123 1.00 13.97 C ATOM 6854 CG2 VAL B 9 -9.220 -3.470 29.897 1.00 8.83 C ATOM 6855 HA VAL B 9 -7.050 -4.783 30.309 1.00 0.00 H ATOM 6856 HB VAL B 9 -8.224 -3.239 28.039 1.00 0.00 H ATOM 6857 HG11 VAL B 9 -8.093 -5.521 27.312 1.00 0.00 H ATOM 6858 HG12 VAL B 9 -8.817 -6.073 28.843 1.00 0.00 H ATOM 6859 HG13 VAL B 9 -9.767 -5.071 27.719 1.00 0.00 H ATOM 6860 HG21 VAL B 9 -9.284 -4.192 30.711 1.00 0.00 H ATOM 6861 HG22 VAL B 9 -8.837 -2.523 30.278 1.00 0.00 H ATOM 6862 HG23 VAL B 9 -10.210 -3.317 29.467 1.00 0.00 H ATOM 6863 H VAL B 9 -6.580 -2.088 29.387 1.00 0.00 H ATOM 6864 N LEU B 10 -5.527 -4.319 27.435 1.00 12.76 N ATOM 6865 CA LEU B 10 -4.663 -4.989 26.478 1.00 9.50 C ATOM 6866 C LEU B 10 -3.383 -5.551 27.153 1.00 16.78 C ATOM 6867 O LEU B 10 -2.955 -6.635 26.800 1.00 11.49 O ATOM 6868 CB LEU B 10 -4.241 -3.957 25.436 1.00 4.99 C ATOM 6869 CG LEU B 10 -5.265 -3.999 24.294 1.00 16.26 C ATOM 6870 CD1 LEU B 10 -4.974 -2.797 23.395 1.00 11.56 C ATOM 6871 CD2 LEU B 10 -5.067 -5.263 23.456 1.00 15.69 C ATOM 6872 HA LEU B 10 -5.208 -5.823 26.036 1.00 0.00 H ATOM 6873 HB2 LEU B 10 -4.224 -2.963 25.883 1.00 0.00 H ATOM 6874 HB3 LEU B 10 -3.249 -4.199 25.054 1.00 0.00 H ATOM 6875 HG LEU B 10 -6.278 -3.986 24.696 1.00 0.00 H ATOM 6876 HD21 LEU B 10 -4.061 -5.265 23.036 1.00 0.00 H ATOM 6877 HD22 LEU B 10 -5.199 -6.141 24.088 1.00 0.00 H ATOM 6878 HD23 LEU B 10 -5.800 -5.281 22.649 1.00 0.00 H ATOM 6879 HD11 LEU B 10 -5.076 -1.879 23.974 1.00 0.00 H ATOM 6880 HD12 LEU B 10 -3.958 -2.872 23.007 1.00 0.00 H ATOM 6881 HD13 LEU B 10 -5.681 -2.786 22.565 1.00 0.00 H ATOM 6882 H LEU B 10 -5.744 -3.307 27.330 1.00 0.00 H ATOM 6883 N ALA B 11 -2.738 -4.839 28.128 1.00 5.34 N ATOM 6884 CA ALA B 11 -1.537 -5.297 28.817 1.00 9.94 C ATOM 6885 C ALA B 11 -1.753 -6.662 29.502 1.00 10.23 C ATOM 6886 O ALA B 11 -0.825 -7.407 29.629 1.00 12.90 O ATOM 6887 CB ALA B 11 -1.052 -4.260 29.838 1.00 11.42 C ATOM 6888 HA ALA B 11 -0.765 -5.422 28.057 1.00 0.00 H ATOM 6889 HB1 ALA B 11 -0.824 -3.326 29.325 1.00 0.00 H ATOM 6890 HB2 ALA B 11 -1.833 -4.088 30.578 1.00 0.00 H ATOM 6891 HB3 ALA B 11 -0.156 -4.632 30.334 1.00 0.00 H ATOM 6892 H ALA B 11 -3.129 -3.913 28.394 1.00 0.00 H ATOM 6893 N SER B 12 -2.979 -6.978 29.923 1.00 9.72 N ATOM 6894 CA SER B 12 -3.240 -8.254 30.561 1.00 15.15 C ATOM 6895 C SER B 12 -3.499 -9.347 29.546 1.00 11.45 C ATOM 6896 O SER B 12 -3.110 -10.499 29.757 1.00 16.50 O ATOM 6897 CB SER B 12 -4.538 -8.181 31.373 1.00 20.20 C ATOM 6898 OG SER B 12 -4.440 -7.367 32.513 1.00 24.94 O ATOM 6899 HA SER B 12 -2.362 -8.469 31.170 1.00 0.00 H ATOM 6900 HB2 SER B 12 -4.804 -9.189 31.690 1.00 0.00 H ATOM 6901 HB3 SER B 12 -5.325 -7.784 30.732 1.00 0.00 H ATOM 6902 HG SER B 12 -5.308 -7.363 32.990 1.00 0.00 H ATOM 6903 H SER B 12 -3.757 -6.301 29.792 1.00 0.00 H ATOM 6904 N LEU B 13 -4.170 -8.980 28.458 1.00 10.72 N ATOM 6905 CA LEU B 13 -4.560 -9.893 27.395 1.00 16.02 C ATOM 6906 C LEU B 13 -3.350 -10.418 26.595 1.00 13.37 C ATOM 6907 O LEU B 13 -3.172 -11.611 26.359 1.00 15.53 O ATOM 6908 CB LEU B 13 -5.631 -9.082 26.566 1.00 10.76 C ATOM 6909 CG LEU B 13 -7.097 -9.493 26.262 1.00 28.56 C ATOM 6910 CD1 LEU B 13 -7.984 -8.327 26.015 1.00 10.36 C ATOM 6911 CD2 LEU B 13 -7.276 -10.074 24.861 1.00 33.60 C ATOM 6912 HA LEU B 13 -4.995 -10.824 27.759 1.00 0.00 H ATOM 6913 HB2 LEU B 13 -5.710 -8.122 27.076 1.00 0.00 H ATOM 6914 HB3 LEU B 13 -5.174 -8.935 25.588 1.00 0.00 H ATOM 6915 HG LEU B 13 -7.318 -10.135 27.114 1.00 0.00 H ATOM 6916 HD21 LEU B 13 -6.980 -9.331 24.120 1.00 0.00 H ATOM 6917 HD22 LEU B 13 -6.654 -10.963 24.755 1.00 0.00 H ATOM 6918 HD23 LEU B 13 -8.322 -10.341 24.711 1.00 0.00 H ATOM 6919 HD11 LEU B 13 -7.994 -7.686 26.897 1.00 0.00 H ATOM 6920 HD12 LEU B 13 -7.612 -7.764 25.159 1.00 0.00 H ATOM 6921 HD13 LEU B 13 -8.995 -8.678 25.808 1.00 0.00 H ATOM 6922 H LEU B 13 -4.432 -7.978 28.361 1.00 0.00 H ATOM 6923 N ILE B 14 -2.469 -9.511 26.158 1.00 14.95 N ATOM 6924 CA ILE B 14 -1.261 -9.790 25.363 1.00 13.69 C ATOM 6925 C ILE B 14 -0.420 -11.000 25.741 1.00 19.93 C ATOM 6926 O ILE B 14 -0.204 -11.894 24.957 1.00 18.12 O ATOM 6927 CB ILE B 14 -0.456 -8.521 25.003 1.00 9.42 C ATOM 6928 CG1 ILE B 14 -1.289 -7.695 24.020 1.00 11.63 C ATOM 6929 CG2 ILE B 14 0.977 -8.724 24.500 1.00 11.23 C ATOM 6930 CD1 ILE B 14 -0.838 -6.238 23.946 1.00 11.03 C ATOM 6931 HA ILE B 14 -1.688 -10.152 24.428 1.00 0.00 H ATOM 6932 HB ILE B 14 -0.290 -7.994 25.942 1.00 0.00 H ATOM 6933 HG12 ILE B 14 -1.200 -8.139 23.028 1.00 0.00 H ATOM 6934 HG13 ILE B 14 -2.332 -7.722 24.337 1.00 0.00 H ATOM 6935 HD11 ILE B 14 -0.931 -5.780 24.931 1.00 0.00 H ATOM 6936 HD12 ILE B 14 0.202 -6.197 23.621 1.00 0.00 H ATOM 6937 HD13 ILE B 14 -1.464 -5.701 23.234 1.00 0.00 H ATOM 6938 HG21 ILE B 14 1.561 -9.234 25.266 1.00 0.00 H ATOM 6939 HG22 ILE B 14 0.960 -9.328 23.593 1.00 0.00 H ATOM 6940 HG23 ILE B 14 1.426 -7.754 24.285 1.00 0.00 H ATOM 6941 H ILE B 14 -2.654 -8.517 26.402 1.00 0.00 H ATOM 6942 N PRO B 15 0.063 -11.054 26.965 1.00 23.14 N ATOM 6943 CA PRO B 15 0.886 -12.171 27.382 1.00 20.66 C ATOM 6944 C PRO B 15 0.180 -13.481 27.377 1.00 15.86 C ATOM 6945 O PRO B 15 0.834 -14.469 27.201 1.00 15.16 O ATOM 6946 CB PRO B 15 1.295 -11.916 28.834 1.00 22.09 C ATOM 6947 CG PRO B 15 0.699 -10.570 29.233 1.00 22.11 C ATOM 6948 CD PRO B 15 -0.170 -10.107 28.080 1.00 22.04 C ATOM 6949 HA PRO B 15 1.716 -12.232 26.678 1.00 0.00 H ATOM 6950 HD3 PRO B 15 -1.220 -10.120 28.372 1.00 0.00 H ATOM 6951 HD2 PRO B 15 0.110 -9.097 27.780 1.00 0.00 H ATOM 6952 HG3 PRO B 15 1.495 -9.848 29.415 1.00 0.00 H ATOM 6953 HG2 PRO B 15 0.097 -10.680 30.135 1.00 0.00 H ATOM 6954 HB2 PRO B 15 0.905 -12.704 29.478 1.00 0.00 H ATOM 6955 HB3 PRO B 15 2.381 -11.885 28.918 1.00 0.00 H ATOM 6956 N LYS B 16 -1.128 -13.500 27.577 1.00 13.98 N ATOM 6957 CA LYS B 16 -1.828 -14.773 27.575 1.00 12.02 C ATOM 6958 C LYS B 16 -1.962 -15.262 26.152 1.00 22.85 C ATOM 6959 O LYS B 16 -1.776 -16.432 25.861 1.00 18.03 O ATOM 6960 CB LYS B 16 -3.231 -14.590 28.115 1.00 19.50 C ATOM 6961 CG LYS B 16 -3.318 -13.290 28.887 1.00 76.56 C ATOM 6962 CD LYS B 16 -3.378 -13.566 30.380 1.00 80.00 C ATOM 6963 CE LYS B 16 -4.675 -14.258 30.787 1.00 80.00 C ATOM 6964 NZ LYS B 16 -5.827 -13.349 30.796 1.00 80.00 N ATOM 6965 HA LYS B 16 -1.268 -15.480 28.188 1.00 0.00 H ATOM 6966 HB2 LYS B 16 -3.938 -14.567 27.286 1.00 0.00 H ATOM 6967 HB3 LYS B 16 -3.476 -15.421 28.776 1.00 0.00 H ATOM 6968 HG2 LYS B 16 -2.440 -12.682 28.668 1.00 0.00 H ATOM 6969 HG3 LYS B 16 -4.216 -12.751 28.584 1.00 0.00 H ATOM 6970 HD2 LYS B 16 -2.538 -14.205 30.653 1.00 0.00 H ATOM 6971 HD3 LYS B 16 -3.302 -12.620 30.915 1.00 0.00 H ATOM 6972 HE2 LYS B 16 -4.550 -14.672 31.788 1.00 0.00 H ATOM 6973 HE3 LYS B 16 -4.874 -15.066 30.083 1.00 0.00 H ATOM 6974 HZ1 LYS B 16 -5.653 -12.577 31.471 1.00 0.00 H ATOM 6975 HZ2 LYS B 16 -5.963 -12.954 29.844 1.00 0.00 H ATOM 6976 HZ3 LYS B 16 -6.679 -13.874 31.080 1.00 0.00 H ATOM 6977 H LYS B 16 -1.649 -12.614 27.734 1.00 0.00 H ATOM 6978 N GLU B 17 -2.283 -14.375 25.229 1.00 16.36 N ATOM 6979 CA GLU B 17 -2.421 -14.793 23.824 1.00 7.62 C ATOM 6980 C GLU B 17 -1.055 -15.203 23.289 1.00 11.78 C ATOM 6981 O GLU B 17 -0.983 -16.116 22.497 1.00 21.63 O ATOM 6982 CB GLU B 17 -2.938 -13.613 22.961 1.00 12.79 C ATOM 6983 CG GLU B 17 -4.436 -13.359 23.142 1.00 24.43 C ATOM 6984 CD GLU B 17 -5.211 -14.640 22.991 1.00 25.35 C ATOM 6985 OE1 GLU B 17 -4.853 -15.309 21.907 1.00 34.36 O ATOM 6986 OE2 GLU B 17 -6.049 -15.008 23.816 1.00 49.17 O ATOM 6987 HA GLU B 17 -3.125 -15.624 23.774 1.00 0.00 H ATOM 6988 HB2 GLU B 17 -2.395 -12.711 23.242 1.00 0.00 H ATOM 6989 HB3 GLU B 17 -2.747 -13.838 21.912 1.00 0.00 H ATOM 6990 HG2 GLU B 17 -4.613 -12.948 24.136 1.00 0.00 H ATOM 6991 HG3 GLU B 17 -4.772 -12.645 22.390 1.00 0.00 H ATOM 6992 H GLU B 17 -2.438 -13.381 25.494 1.00 0.00 H ATOM 6993 N GLN B 18 0.004 -14.507 23.736 1.00 10.16 N ATOM 6994 CA GLN B 18 1.332 -14.876 23.273 1.00 11.63 C ATOM 6995 C GLN B 18 1.646 -16.331 23.605 1.00 22.47 C ATOM 6996 O GLN B 18 2.158 -17.094 22.791 1.00 18.92 O ATOM 6997 CB GLN B 18 2.462 -14.019 23.872 1.00 18.39 C ATOM 6998 CG GLN B 18 2.405 -12.576 23.352 1.00 15.23 C ATOM 6999 CD GLN B 18 3.388 -11.758 24.122 1.00 45.10 C ATOM 7000 OE1 GLN B 18 3.825 -12.127 25.241 1.00 36.62 O ATOM 7001 NE2 GLN B 18 3.741 -10.661 23.474 1.00 15.60 N ATOM 7002 HA GLN B 18 1.301 -14.709 22.196 1.00 0.00 H ATOM 7003 HB2 GLN B 18 2.363 -14.009 24.957 1.00 0.00 H ATOM 7004 HB3 GLN B 18 3.422 -14.457 23.600 1.00 0.00 H ATOM 7005 HG2 GLN B 18 2.659 -12.556 22.292 1.00 0.00 H ATOM 7006 HG3 GLN B 18 1.402 -12.174 23.491 1.00 0.00 H ATOM 7007 HE22 GLN B 18 3.318 -10.445 22.549 1.00 0.00 H ATOM 7008 HE21 GLN B 18 4.441 -10.014 23.890 1.00 0.00 H ATOM 7009 H GLN B 18 -0.124 -13.718 24.402 1.00 0.00 H ATOM 7010 N ALA B 19 1.347 -16.725 24.838 1.00 21.33 N ATOM 7011 CA ALA B 19 1.587 -18.080 25.354 1.00 18.44 C ATOM 7012 C ALA B 19 0.817 -19.179 24.598 1.00 16.07 C ATOM 7013 O ALA B 19 1.372 -20.195 24.174 1.00 23.91 O ATOM 7014 CB ALA B 19 1.378 -18.076 26.876 1.00 19.48 C ATOM 7015 HA ALA B 19 2.624 -18.354 25.161 1.00 0.00 H ATOM 7016 HB1 ALA B 19 2.076 -17.377 27.336 1.00 0.00 H ATOM 7017 HB2 ALA B 19 0.356 -17.771 27.100 1.00 0.00 H ATOM 7018 HB3 ALA B 19 1.554 -19.078 27.268 1.00 0.00 H ATOM 7019 H ALA B 19 0.915 -16.030 25.480 1.00 0.00 H ATOM 7020 N ARG B 20 -0.454 -18.901 24.406 1.00 16.27 N ATOM 7021 CA ARG B 20 -1.394 -19.734 23.720 1.00 15.62 C ATOM 7022 C ARG B 20 -0.966 -20.007 22.287 1.00 20.69 C ATOM 7023 O ARG B 20 -1.015 -21.126 21.786 1.00 12.63 O ATOM 7024 CB ARG B 20 -2.805 -19.201 23.934 1.00 18.42 C ATOM 7025 CG ARG B 20 -3.671 -19.026 22.682 1.00 53.84 C ATOM 7026 CD ARG B 20 -5.164 -18.797 22.993 1.00 40.27 C ATOM 7027 NE ARG B 20 -5.813 -17.820 22.107 1.00 80.00 N ATOM 7028 CZ ARG B 20 -6.730 -18.020 21.127 1.00 80.00 C ATOM 7029 NH1 ARG B 20 -7.209 -19.222 20.793 1.00 74.35 N ATOM 7030 NH2 ARG B 20 -7.190 -16.953 20.441 1.00 65.62 N ATOM 7031 HA ARG B 20 -1.410 -20.736 24.150 1.00 0.00 H ATOM 7032 HB2 ARG B 20 -3.322 -19.892 24.600 1.00 0.00 H ATOM 7033 HB3 ARG B 20 -2.721 -18.227 24.417 1.00 0.00 H ATOM 7034 HG2 ARG B 20 -3.299 -18.168 22.122 1.00 0.00 H ATOM 7035 HG3 ARG B 20 -3.579 -19.924 22.071 1.00 0.00 H ATOM 7036 HD2 ARG B 20 -5.251 -18.441 24.019 1.00 0.00 H ATOM 7037 HD3 ARG B 20 -5.685 -19.749 22.895 1.00 0.00 H ATOM 7038 HE ARG B 20 -5.528 -16.831 22.253 1.00 0.00 H ATOM 7039 HH12 ARG B 20 -7.912 -19.308 20.031 1.00 0.00 H ATOM 7040 HH11 ARG B 20 -6.879 -20.071 21.295 1.00 0.00 H ATOM 7041 HH22 ARG B 20 -7.893 -17.084 19.686 1.00 0.00 H ATOM 7042 HH21 ARG B 20 -6.841 -16.000 20.667 1.00 0.00 H ATOM 7043 H ARG B 20 -0.806 -17.999 24.785 1.00 0.00 H ATOM 7044 N ILE B 21 -0.502 -18.981 21.616 1.00 14.24 N ATOM 7045 CA ILE B 21 -0.056 -19.158 20.264 1.00 14.13 C ATOM 7046 C ILE B 21 1.258 -19.902 20.269 1.00 21.90 C ATOM 7047 O ILE B 21 1.534 -20.717 19.389 1.00 17.62 O ATOM 7048 CB ILE B 21 0.100 -17.797 19.555 1.00 16.13 C ATOM 7049 CG1 ILE B 21 -1.315 -17.359 19.203 1.00 10.08 C ATOM 7050 CG2 ILE B 21 0.938 -17.919 18.273 1.00 11.47 C ATOM 7051 CD1 ILE B 21 -1.358 -15.920 18.756 1.00 22.80 C ATOM 7052 HA ILE B 21 -0.800 -19.736 19.716 1.00 0.00 H ATOM 7053 HB ILE B 21 0.614 -17.082 20.197 1.00 0.00 H ATOM 7054 HG12 ILE B 21 -1.691 -17.991 18.398 1.00 0.00 H ATOM 7055 HG13 ILE B 21 -1.950 -17.476 20.081 1.00 0.00 H ATOM 7056 HD11 ILE B 21 -0.990 -15.281 19.558 1.00 0.00 H ATOM 7057 HD12 ILE B 21 -0.730 -15.796 17.874 1.00 0.00 H ATOM 7058 HD13 ILE B 21 -2.385 -15.647 18.514 1.00 0.00 H ATOM 7059 HG21 ILE B 21 1.931 -18.293 18.524 1.00 0.00 H ATOM 7060 HG22 ILE B 21 0.451 -18.611 17.586 1.00 0.00 H ATOM 7061 HG23 ILE B 21 1.025 -16.940 17.803 1.00 0.00 H ATOM 7062 H ILE B 21 -0.457 -18.043 22.062 1.00 0.00 H ATOM 7063 N LYS B 22 2.079 -19.596 21.262 1.00 16.00 N ATOM 7064 CA LYS B 22 3.388 -20.246 21.353 1.00 17.00 C ATOM 7065 C LYS B 22 3.234 -21.760 21.500 1.00 25.86 C ATOM 7066 O LYS B 22 3.829 -22.560 20.787 1.00 25.04 O ATOM 7067 CB LYS B 22 4.264 -19.672 22.452 1.00 29.38 C ATOM 7068 CG LYS B 22 5.179 -20.734 23.026 1.00 65.01 C ATOM 7069 CD LYS B 22 6.396 -20.131 23.709 1.00 80.00 C ATOM 7070 CE LYS B 22 7.548 -21.119 23.877 1.00 80.00 C ATOM 7071 NZ LYS B 22 7.625 -21.737 25.217 1.00 80.00 N ATOM 7072 HA LYS B 22 3.904 -20.038 20.416 1.00 0.00 H ATOM 7073 HB2 LYS B 22 4.869 -18.864 22.041 1.00 0.00 H ATOM 7074 HB3 LYS B 22 3.629 -19.280 23.247 1.00 0.00 H ATOM 7075 HG2 LYS B 22 4.622 -21.322 23.755 1.00 0.00 H ATOM 7076 HG3 LYS B 22 5.515 -21.383 22.218 1.00 0.00 H ATOM 7077 HD2 LYS B 22 6.746 -19.289 23.112 1.00 0.00 H ATOM 7078 HD3 LYS B 22 6.098 -19.776 24.696 1.00 0.00 H ATOM 7079 HE2 LYS B 22 8.483 -20.590 23.690 1.00 0.00 H ATOM 7080 HE3 LYS B 22 7.428 -21.913 23.140 1.00 0.00 H ATOM 7081 HZ1 LYS B 22 7.752 -20.994 25.933 1.00 0.00 H ATOM 7082 HZ2 LYS B 22 6.745 -22.258 25.408 1.00 0.00 H ATOM 7083 HZ3 LYS B 22 8.431 -22.393 25.249 1.00 0.00 H ATOM 7084 H LYS B 22 1.795 -18.895 21.976 1.00 0.00 H ATOM 7085 N THR B 23 2.402 -22.172 22.435 1.00 17.39 N ATOM 7086 CA THR B 23 2.228 -23.595 22.553 1.00 26.13 C ATOM 7087 C THR B 23 1.605 -24.251 21.328 1.00 24.40 C ATOM 7088 O THR B 23 1.963 -25.342 20.950 1.00 28.95 O ATOM 7089 CB THR B 23 1.254 -23.824 23.690 1.00 25.57 C ATOM 7090 OG1 THR B 23 1.807 -23.157 24.805 1.00 50.46 O ATOM 7091 CG2 THR B 23 1.158 -25.330 23.925 1.00 72.46 C ATOM 7092 HA THR B 23 3.218 -24.028 22.697 1.00 0.00 H ATOM 7093 HB THR B 23 0.250 -23.449 23.491 1.00 0.00 H ATOM 7094 HG1 THR B 23 1.901 -22.193 24.598 1.00 0.00 H ATOM 7095 HG23 THR B 23 0.728 -25.807 23.044 1.00 0.00 H ATOM 7096 HG21 THR B 23 2.155 -25.732 24.107 1.00 0.00 H ATOM 7097 HG22 THR B 23 0.524 -25.522 24.790 1.00 0.00 H ATOM 7098 H THR B 23 1.899 -21.505 23.054 1.00 0.00 H ATOM 7099 N PHE B 24 0.643 -23.602 20.716 1.00 19.27 N ATOM 7100 CA PHE B 24 -0.019 -24.158 19.545 1.00 12.06 C ATOM 7101 C PHE B 24 0.946 -24.420 18.444 1.00 19.10 C ATOM 7102 O PHE B 24 0.955 -25.448 17.790 1.00 26.91 O ATOM 7103 CB PHE B 24 -1.043 -23.111 19.049 1.00 8.30 C ATOM 7104 CG PHE B 24 -1.782 -23.491 17.802 1.00 18.04 C ATOM 7105 CD1 PHE B 24 -2.332 -24.749 17.573 1.00 17.96 C ATOM 7106 CD2 PHE B 24 -1.980 -22.524 16.815 1.00 16.41 C ATOM 7107 CE1 PHE B 24 -3.024 -25.033 16.393 1.00 24.58 C ATOM 7108 CE2 PHE B 24 -2.663 -22.783 15.625 1.00 19.58 C ATOM 7109 CZ PHE B 24 -3.199 -24.057 15.415 1.00 20.94 C ATOM 7110 HA PHE B 24 -0.491 -25.102 19.819 1.00 0.00 H ATOM 7111 HB2 PHE B 24 -1.775 -22.951 19.841 1.00 0.00 H ATOM 7112 HB3 PHE B 24 -0.509 -22.180 18.856 1.00 0.00 H ATOM 7113 HD2 PHE B 24 -1.584 -21.522 16.981 1.00 0.00 H ATOM 7114 HE2 PHE B 24 -2.777 -22.004 14.871 1.00 0.00 H ATOM 7115 HZ PHE B 24 -3.746 -24.283 14.500 1.00 0.00 H ATOM 7116 HE1 PHE B 24 -3.432 -26.031 16.236 1.00 0.00 H ATOM 7117 HD1 PHE B 24 -2.221 -25.527 18.328 1.00 0.00 H ATOM 7118 H PHE B 24 0.347 -22.672 21.075 1.00 0.00 H ATOM 7119 N ARG B 25 1.784 -23.445 18.227 1.00 21.79 N ATOM 7120 CA ARG B 25 2.755 -23.615 17.177 1.00 16.16 C ATOM 7121 C ARG B 25 3.795 -24.639 17.551 1.00 24.57 C ATOM 7122 O ARG B 25 4.496 -25.170 16.683 1.00 21.12 O ATOM 7123 CB ARG B 25 3.519 -22.334 16.925 1.00 14.28 C ATOM 7124 CG ARG B 25 2.676 -21.280 16.251 1.00 17.37 C ATOM 7125 CD ARG B 25 3.560 -20.059 16.021 1.00 13.15 C ATOM 7126 NE ARG B 25 4.491 -20.227 14.919 1.00 20.03 N ATOM 7127 CZ ARG B 25 5.235 -19.207 14.560 1.00 13.35 C ATOM 7128 NH1 ARG B 25 5.144 -18.025 15.200 1.00 23.72 N ATOM 7129 NH2 ARG B 25 6.095 -19.312 13.534 1.00 24.14 N ATOM 7130 HA ARG B 25 2.190 -23.924 16.298 1.00 0.00 H ATOM 7131 HB2 ARG B 25 3.870 -21.943 17.880 1.00 0.00 H ATOM 7132 HB3 ARG B 25 4.375 -22.557 16.288 1.00 0.00 H ATOM 7133 HG2 ARG B 25 2.304 -21.655 15.297 1.00 0.00 H ATOM 7134 HG3 ARG B 25 1.833 -21.014 16.889 1.00 0.00 H ATOM 7135 HD2 ARG B 25 4.130 -19.867 16.930 1.00 0.00 H ATOM 7136 HD3 ARG B 25 2.920 -19.203 15.807 1.00 0.00 H ATOM 7137 HE ARG B 25 4.567 -21.138 14.424 1.00 0.00 H ATOM 7138 HH12 ARG B 25 5.740 -17.226 14.904 1.00 0.00 H ATOM 7139 HH11 ARG B 25 4.477 -17.911 15.990 1.00 0.00 H ATOM 7140 HH22 ARG B 25 6.679 -18.496 13.259 1.00 0.00 H ATOM 7141 HH21 ARG B 25 6.177 -20.209 13.014 1.00 0.00 H ATOM 7142 H ARG B 25 1.752 -22.573 18.793 1.00 0.00 H ATOM 7143 N GLN B 26 3.897 -24.895 18.850 1.00 29.76 N ATOM 7144 CA GLN B 26 4.867 -25.872 19.309 1.00 32.90 C ATOM 7145 C GLN B 26 4.352 -27.211 18.836 1.00 26.94 C ATOM 7146 O GLN B 26 5.047 -28.034 18.285 1.00 27.73 O ATOM 7147 CB GLN B 26 4.986 -25.924 20.834 1.00 37.89 C ATOM 7148 CG GLN B 26 5.818 -24.761 21.391 1.00 80.00 C ATOM 7149 CD GLN B 26 6.339 -25.094 22.775 1.00 80.00 C ATOM 7150 OE1 GLN B 26 7.496 -25.542 22.899 1.00 80.00 O ATOM 7151 NE2 GLN B 26 5.497 -24.923 23.810 1.00 58.16 N ATOM 7152 HA GLN B 26 5.852 -25.611 18.921 1.00 0.00 H ATOM 7153 HB2 GLN B 26 3.986 -25.879 21.266 1.00 0.00 H ATOM 7154 HB3 GLN B 26 5.461 -26.863 21.117 1.00 0.00 H ATOM 7155 HG2 GLN B 26 6.661 -24.572 20.726 1.00 0.00 H ATOM 7156 HG3 GLN B 26 5.195 -23.869 21.447 1.00 0.00 H ATOM 7157 HE22 GLN B 26 4.542 -24.545 23.647 1.00 0.00 H ATOM 7158 HE21 GLN B 26 5.801 -25.169 24.774 1.00 0.00 H ATOM 7159 H GLN B 26 3.288 -24.400 19.532 1.00 0.00 H ATOM 7160 N GLN B 27 3.076 -27.421 19.043 1.00 19.34 N ATOM 7161 CA GLN B 27 2.494 -28.657 18.605 1.00 14.77 C ATOM 7162 C GLN B 27 2.150 -28.795 17.116 1.00 34.32 C ATOM 7163 O GLN B 27 2.374 -29.873 16.544 1.00 20.92 O ATOM 7164 CB GLN B 27 1.257 -28.976 19.472 1.00 24.06 C ATOM 7165 CG GLN B 27 1.733 -29.613 20.788 1.00 79.84 C ATOM 7166 CD GLN B 27 0.929 -29.133 21.975 1.00 80.00 C ATOM 7167 OE1 GLN B 27 1.318 -28.165 22.681 1.00 80.00 O ATOM 7168 NE2 GLN B 27 -0.204 -29.818 22.178 1.00 80.00 N ATOM 7169 HA GLN B 27 3.293 -29.386 18.739 1.00 0.00 H ATOM 7170 HB2 GLN B 27 0.710 -28.057 19.685 1.00 0.00 H ATOM 7171 HB3 GLN B 27 0.605 -29.671 18.942 1.00 0.00 H ATOM 7172 HG2 GLN B 27 1.634 -30.696 20.711 1.00 0.00 H ATOM 7173 HG3 GLN B 27 2.780 -29.355 20.945 1.00 0.00 H ATOM 7174 HE22 GLN B 27 -0.455 -30.607 21.548 1.00 0.00 H ATOM 7175 HE21 GLN B 27 -0.833 -29.561 22.965 1.00 0.00 H ATOM 7176 H GLN B 27 2.493 -26.702 19.518 1.00 0.00 H ATOM 7177 N HIS B 28 1.612 -27.738 16.484 1.00 24.78 N ATOM 7178 CA HIS B 28 1.219 -27.818 15.098 1.00 19.63 C ATOM 7179 C HIS B 28 1.829 -26.944 14.034 1.00 19.83 C ATOM 7180 O HIS B 28 1.254 -26.857 12.927 1.00 27.03 O ATOM 7181 CB HIS B 28 -0.256 -27.465 15.174 1.00 20.61 C ATOM 7182 CG HIS B 28 -1.072 -28.600 15.706 1.00 32.93 C ATOM 7183 ND1 HIS B 28 -1.387 -29.705 14.909 1.00 35.13 N ATOM 7184 CD2 HIS B 28 -1.646 -28.792 16.936 1.00 30.25 C ATOM 7185 CE1 HIS B 28 -2.129 -30.528 15.648 1.00 32.16 C ATOM 7186 NE2 HIS B 28 -2.301 -30.011 16.868 1.00 31.03 N ATOM 7187 HA HIS B 28 1.551 -28.798 14.755 1.00 0.00 H ATOM 7188 HB2 HIS B 28 -0.380 -26.603 15.830 1.00 0.00 H ATOM 7189 HB3 HIS B 28 -0.611 -27.213 14.175 1.00 0.00 H ATOM 7190 HD2 HIS B 28 -1.597 -28.121 17.794 1.00 0.00 H ATOM 7191 HE1 HIS B 28 -2.535 -31.481 15.308 1.00 0.00 H ATOM 7192 H HIS B 28 1.477 -26.847 17.003 1.00 0.00 H ATOM 7193 N GLY B 29 2.953 -26.316 14.332 1.00 17.08 N ATOM 7194 CA GLY B 29 3.502 -25.468 13.319 1.00 11.76 C ATOM 7195 C GLY B 29 3.780 -26.117 11.986 1.00 18.57 C ATOM 7196 O GLY B 29 3.787 -25.491 10.928 1.00 22.41 O ATOM 7197 HA3 GLY B 29 4.442 -25.065 13.696 1.00 0.00 H ATOM 7198 HA2 GLY B 29 2.800 -24.652 13.152 1.00 0.00 H ATOM 7199 H GLY B 29 3.415 -26.432 15.256 1.00 0.00 H ATOM 7200 N ASN B 30 4.030 -27.413 12.015 1.00 20.37 N ATOM 7201 CA ASN B 30 4.355 -28.061 10.763 1.00 13.94 C ATOM 7202 C ASN B 30 3.196 -28.753 10.131 1.00 15.20 C ATOM 7203 O ASN B 30 3.368 -29.361 9.079 1.00 20.23 O ATOM 7204 CB ASN B 30 5.579 -28.984 10.895 1.00 27.22 C ATOM 7205 CG ASN B 30 5.382 -29.762 12.171 1.00 80.00 C ATOM 7206 OD1 ASN B 30 5.349 -29.179 13.276 1.00 80.00 O ATOM 7207 ND2 ASN B 30 4.857 -30.964 11.973 1.00 80.00 N ATOM 7208 HA ASN B 30 4.624 -27.258 10.076 1.00 0.00 H ATOM 7209 HB2 ASN B 30 5.635 -29.662 10.043 1.00 0.00 H ATOM 7210 HB3 ASN B 30 6.494 -28.394 10.949 1.00 0.00 H ATOM 7211 HD22 ASN B 30 4.911 -31.407 11.033 1.00 0.00 H ATOM 7212 HD21 ASN B 30 4.392 -31.464 12.757 1.00 0.00 H ATOM 7213 H ASN B 30 3.995 -27.949 12.906 1.00 0.00 H ATOM 7214 N THR B 31 2.072 -28.644 10.790 1.00 14.45 N ATOM 7215 CA THR B 31 0.885 -29.263 10.238 1.00 22.10 C ATOM 7216 C THR B 31 0.437 -28.500 8.968 1.00 24.38 C ATOM 7217 O THR B 31 0.426 -27.266 8.960 1.00 13.24 O ATOM 7218 CB THR B 31 -0.196 -29.189 11.303 1.00 22.16 C ATOM 7219 OG1 THR B 31 0.174 -29.830 12.523 1.00 25.58 O ATOM 7220 CG2 THR B 31 -1.479 -29.732 10.744 1.00 17.47 C ATOM 7221 HA THR B 31 1.079 -30.299 9.958 1.00 0.00 H ATOM 7222 HB THR B 31 -0.338 -28.141 11.569 1.00 0.00 H ATOM 7223 HG1 THR B 31 -0.567 -29.749 13.175 1.00 0.00 H ATOM 7224 HG23 THR B 31 -1.718 -29.213 9.816 1.00 0.00 H ATOM 7225 HG21 THR B 31 -1.365 -30.798 10.546 1.00 0.00 H ATOM 7226 HG22 THR B 31 -2.282 -29.578 11.465 1.00 0.00 H ATOM 7227 H THR B 31 2.031 -28.125 11.690 1.00 0.00 H ATOM 7228 N ALA B 32 0.071 -29.213 7.906 1.00 22.62 N ATOM 7229 CA ALA B 32 -0.333 -28.576 6.668 1.00 27.83 C ATOM 7230 C ALA B 32 -1.793 -28.254 6.660 1.00 35.91 C ATOM 7231 O ALA B 32 -2.599 -29.124 6.978 1.00 33.48 O ATOM 7232 CB ALA B 32 -0.008 -29.459 5.474 1.00 29.47 C ATOM 7233 HA ALA B 32 0.227 -27.644 6.595 1.00 0.00 H ATOM 7234 HB1 ALA B 32 1.066 -29.642 5.441 1.00 0.00 H ATOM 7235 HB2 ALA B 32 -0.537 -30.407 5.570 1.00 0.00 H ATOM 7236 HB3 ALA B 32 -0.321 -28.958 4.558 1.00 0.00 H ATOM 7237 H ALA B 32 0.075 -30.251 7.965 1.00 0.00 H ATOM 7238 N VAL B 33 -2.111 -27.012 6.295 1.00 25.91 N ATOM 7239 CA VAL B 33 -3.489 -26.587 6.264 1.00 20.83 C ATOM 7240 C VAL B 33 -4.035 -26.457 4.856 1.00 17.70 C ATOM 7241 O VAL B 33 -5.198 -26.159 4.686 1.00 22.35 O ATOM 7242 CB VAL B 33 -3.678 -25.318 7.096 1.00 24.44 C ATOM 7243 CG1 VAL B 33 -3.130 -25.668 8.468 1.00 28.14 C ATOM 7244 CG2 VAL B 33 -2.910 -24.116 6.542 1.00 23.30 C ATOM 7245 HA VAL B 33 -4.087 -27.374 6.724 1.00 0.00 H ATOM 7246 HB VAL B 33 -4.728 -25.025 7.099 1.00 0.00 H ATOM 7247 HG11 VAL B 33 -3.691 -26.508 8.878 1.00 0.00 H ATOM 7248 HG12 VAL B 33 -2.078 -25.940 8.379 1.00 0.00 H ATOM 7249 HG13 VAL B 33 -3.229 -24.806 9.128 1.00 0.00 H ATOM 7250 HG21 VAL B 33 -1.844 -24.344 6.525 1.00 0.00 H ATOM 7251 HG22 VAL B 33 -3.254 -23.902 5.530 1.00 0.00 H ATOM 7252 HG23 VAL B 33 -3.087 -23.249 7.178 1.00 0.00 H ATOM 7253 H VAL B 33 -1.359 -26.344 6.030 1.00 0.00 H ATOM 7254 N GLY B 34 -3.179 -26.685 3.853 1.00 17.57 N ATOM 7255 CA GLY B 34 -3.606 -26.582 2.468 1.00 13.79 C ATOM 7256 C GLY B 34 -2.475 -26.760 1.482 1.00 17.39 C ATOM 7257 O GLY B 34 -1.327 -26.961 1.822 1.00 20.62 O ATOM 7258 HA3 GLY B 34 -4.049 -25.598 2.314 1.00 0.00 H ATOM 7259 HA2 GLY B 34 -4.356 -27.350 2.278 1.00 0.00 H ATOM 7260 H GLY B 34 -2.194 -26.940 4.068 1.00 0.00 H ATOM 7261 N GLN B 35 -2.836 -26.690 0.209 1.00 22.90 N ATOM 7262 CA GLN B 35 -1.850 -26.828 -0.843 1.00 27.53 C ATOM 7263 C GLN B 35 -1.943 -25.640 -1.782 1.00 21.92 C ATOM 7264 O GLN B 35 -2.956 -24.944 -1.812 1.00 17.77 O ATOM 7265 CB GLN B 35 -2.072 -28.128 -1.609 1.00 28.77 C ATOM 7266 CG GLN B 35 -1.667 -29.256 -0.645 1.00 80.00 C ATOM 7267 CD GLN B 35 -1.348 -30.467 -1.464 1.00 80.00 C ATOM 7268 OE1 GLN B 35 -2.134 -30.744 -2.389 1.00 80.00 O ATOM 7269 NE2 GLN B 35 -0.107 -30.962 -1.340 1.00 80.00 N ATOM 7270 HA GLN B 35 -0.854 -26.857 -0.400 1.00 0.00 H ATOM 7271 HB2 GLN B 35 -3.120 -28.228 -1.892 1.00 0.00 H ATOM 7272 HB3 GLN B 35 -1.451 -28.152 -2.505 1.00 0.00 H ATOM 7273 HG2 GLN B 35 -0.791 -28.956 -0.070 1.00 0.00 H ATOM 7274 HG3 GLN B 35 -2.489 -29.475 0.036 1.00 0.00 H ATOM 7275 HE22 GLN B 35 0.488 -30.679 -0.535 1.00 0.00 H ATOM 7276 HE21 GLN B 35 0.260 -31.629 -2.049 1.00 0.00 H ATOM 7277 H GLN B 35 -3.835 -26.535 -0.037 1.00 0.00 H ATOM 7278 N ILE B 36 -0.894 -25.420 -2.533 1.00 17.58 N ATOM 7279 CA ILE B 36 -0.874 -24.322 -3.469 1.00 16.69 C ATOM 7280 C ILE B 36 -0.871 -24.881 -4.886 1.00 18.61 C ATOM 7281 O ILE B 36 -0.047 -25.728 -5.179 1.00 13.16 O ATOM 7282 CB ILE B 36 0.368 -23.386 -3.260 1.00 19.14 C ATOM 7283 CG1 ILE B 36 0.426 -22.723 -1.892 1.00 10.05 C ATOM 7284 CG2 ILE B 36 0.461 -22.249 -4.278 1.00 20.82 C ATOM 7285 CD1 ILE B 36 1.822 -22.183 -1.546 1.00 24.81 C ATOM 7286 HA ILE B 36 -1.764 -23.716 -3.300 1.00 0.00 H ATOM 7287 HB ILE B 36 1.197 -24.084 -3.380 1.00 0.00 H ATOM 7288 HG12 ILE B 36 -0.281 -21.894 -1.877 1.00 0.00 H ATOM 7289 HG13 ILE B 36 0.140 -23.456 -1.138 1.00 0.00 H ATOM 7290 HD11 ILE B 36 2.539 -23.004 -1.547 1.00 0.00 H ATOM 7291 HD12 ILE B 36 2.117 -21.441 -2.287 1.00 0.00 H ATOM 7292 HD13 ILE B 36 1.797 -21.722 -0.558 1.00 0.00 H ATOM 7293 HG21 ILE B 36 0.535 -22.667 -5.282 1.00 0.00 H ATOM 7294 HG22 ILE B 36 -0.431 -21.626 -4.207 1.00 0.00 H ATOM 7295 HG23 ILE B 36 1.345 -21.646 -4.068 1.00 0.00 H ATOM 7296 H ILE B 36 -0.065 -26.044 -2.454 1.00 0.00 H ATOM 7297 N THR B 37 -1.749 -24.417 -5.783 1.00 11.97 N ATOM 7298 CA THR B 37 -1.716 -24.933 -7.139 1.00 11.83 C ATOM 7299 C THR B 37 -1.348 -23.809 -8.089 1.00 14.53 C ATOM 7300 O THR B 37 -1.369 -22.633 -7.758 1.00 15.51 O ATOM 7301 CB THR B 37 -3.064 -25.420 -7.629 1.00 9.67 C ATOM 7302 OG1 THR B 37 -4.008 -24.373 -7.515 1.00 17.24 O ATOM 7303 CG2 THR B 37 -3.528 -26.488 -6.633 1.00 15.45 C ATOM 7304 HA THR B 37 -1.003 -25.757 -7.123 1.00 0.00 H ATOM 7305 HB THR B 37 -2.986 -25.776 -8.656 1.00 0.00 H ATOM 7306 HG1 THR B 37 -4.890 -24.689 -7.835 1.00 0.00 H ATOM 7307 HG23 THR B 37 -2.842 -27.335 -6.665 1.00 0.00 H ATOM 7308 HG21 THR B 37 -3.540 -26.065 -5.628 1.00 0.00 H ATOM 7309 HG22 THR B 37 -4.531 -26.821 -6.900 1.00 0.00 H ATOM 7310 H THR B 37 -2.447 -23.695 -5.512 1.00 0.00 H ATOM 7311 N VAL B 38 -1.014 -24.184 -9.307 1.00 11.63 N ATOM 7312 CA VAL B 38 -0.639 -23.246 -10.342 1.00 13.76 C ATOM 7313 C VAL B 38 -1.744 -22.216 -10.504 1.00 18.75 C ATOM 7314 O VAL B 38 -1.506 -21.009 -10.619 1.00 11.79 O ATOM 7315 CB VAL B 38 -0.377 -24.055 -11.631 1.00 14.51 C ATOM 7316 CG1 VAL B 38 -0.364 -23.153 -12.873 1.00 15.03 C ATOM 7317 CG2 VAL B 38 0.880 -24.930 -11.514 1.00 12.82 C ATOM 7318 HA VAL B 38 0.268 -22.697 -10.091 1.00 0.00 H ATOM 7319 HB VAL B 38 -1.212 -24.744 -11.760 1.00 0.00 H ATOM 7320 HG11 VAL B 38 -1.329 -22.655 -12.969 1.00 0.00 H ATOM 7321 HG12 VAL B 38 0.423 -22.406 -12.770 1.00 0.00 H ATOM 7322 HG13 VAL B 38 -0.177 -23.760 -13.759 1.00 0.00 H ATOM 7323 HG21 VAL B 38 1.746 -24.296 -11.327 1.00 0.00 H ATOM 7324 HG22 VAL B 38 0.757 -25.632 -10.689 1.00 0.00 H ATOM 7325 HG23 VAL B 38 1.025 -25.481 -12.443 1.00 0.00 H ATOM 7326 H VAL B 38 -1.020 -25.199 -9.534 1.00 0.00 H ATOM 7327 N ASP B 39 -2.973 -22.710 -10.531 1.00 12.92 N ATOM 7328 CA ASP B 39 -4.091 -21.798 -10.692 1.00 12.14 C ATOM 7329 C ASP B 39 -4.271 -20.812 -9.547 1.00 12.84 C ATOM 7330 O ASP B 39 -4.810 -19.713 -9.780 1.00 15.68 O ATOM 7331 CB ASP B 39 -5.417 -22.512 -10.952 1.00 10.29 C ATOM 7332 CG ASP B 39 -5.620 -22.799 -12.441 1.00 16.35 C ATOM 7333 OD1 ASP B 39 -5.002 -22.305 -13.383 1.00 31.11 O ATOM 7334 OD2 ASP B 39 -6.535 -23.673 -12.611 1.00 30.01 O ATOM 7335 HA ASP B 39 -3.815 -21.226 -11.578 1.00 0.00 H ATOM 7336 HB2 ASP B 39 -5.424 -23.455 -10.406 1.00 0.00 H ATOM 7337 HB3 ASP B 39 -6.233 -21.882 -10.598 1.00 0.00 H ATOM 7338 H ASP B 39 -3.134 -23.733 -10.438 1.00 0.00 H ATOM 7339 N MET B 40 -3.869 -21.200 -8.339 1.00 13.33 N ATOM 7340 CA MET B 40 -4.017 -20.265 -7.261 1.00 13.14 C ATOM 7341 C MET B 40 -3.010 -19.126 -7.385 1.00 9.70 C ATOM 7342 O MET B 40 -3.306 -18.007 -6.995 1.00 11.28 O ATOM 7343 CB MET B 40 -3.773 -20.857 -5.878 1.00 12.33 C ATOM 7344 CG MET B 40 -4.856 -21.810 -5.502 1.00 27.06 C ATOM 7345 SD MET B 40 -4.277 -22.721 -4.055 1.00 28.22 S ATOM 7346 CE MET B 40 -5.362 -21.965 -2.830 1.00 38.97 C ATOM 7347 HA MET B 40 -5.053 -19.936 -7.345 1.00 0.00 H ATOM 7348 HB2 MET B 40 -2.819 -21.385 -5.880 1.00 0.00 H ATOM 7349 HB3 MET B 40 -3.739 -20.050 -5.146 1.00 0.00 H ATOM 7350 HG2 MET B 40 -5.052 -22.498 -6.324 1.00 0.00 H ATOM 7351 HG3 MET B 40 -5.768 -21.264 -5.261 1.00 0.00 H ATOM 7352 HE1 MET B 40 -5.180 -20.891 -2.799 1.00 0.00 H ATOM 7353 HE2 MET B 40 -6.401 -22.151 -3.103 1.00 0.00 H ATOM 7354 HE3 MET B 40 -5.159 -22.398 -1.850 1.00 0.00 H ATOM 7355 H MET B 40 -3.463 -22.145 -8.183 1.00 0.00 H ATOM 7356 N SER B 41 -1.817 -19.407 -7.931 1.00 6.37 N ATOM 7357 CA SER B 41 -0.737 -18.439 -8.138 1.00 8.54 C ATOM 7358 C SER B 41 -1.085 -17.428 -9.229 1.00 18.49 C ATOM 7359 O SER B 41 -0.837 -16.253 -9.141 1.00 8.70 O ATOM 7360 CB SER B 41 0.632 -19.121 -8.347 1.00 13.88 C ATOM 7361 OG SER B 41 0.947 -19.742 -7.109 1.00 45.70 O ATOM 7362 HA SER B 41 -0.635 -17.866 -7.217 1.00 0.00 H ATOM 7363 HB2 SER B 41 1.390 -18.381 -8.605 1.00 0.00 H ATOM 7364 HB3 SER B 41 0.568 -19.866 -9.140 1.00 0.00 H ATOM 7365 HG SER B 41 1.822 -20.199 -7.184 1.00 0.00 H ATOM 7366 H SER B 41 -1.646 -20.388 -8.230 1.00 0.00 H ATOM 7367 N TYR B 42 -1.690 -17.895 -10.270 1.00 7.76 N ATOM 7368 CA TYR B 42 -2.109 -17.094 -11.403 1.00 9.56 C ATOM 7369 C TYR B 42 -3.369 -16.322 -11.092 1.00 13.55 C ATOM 7370 O TYR B 42 -3.596 -15.228 -11.617 1.00 16.04 O ATOM 7371 CB TYR B 42 -2.324 -17.968 -12.630 1.00 11.05 C ATOM 7372 CG TYR B 42 -1.072 -18.213 -13.406 1.00 7.03 C ATOM 7373 CD1 TYR B 42 -0.483 -17.192 -14.151 1.00 12.89 C ATOM 7374 CD2 TYR B 42 -0.451 -19.455 -13.395 1.00 9.14 C ATOM 7375 CE1 TYR B 42 0.686 -17.403 -14.875 1.00 6.16 C ATOM 7376 CE2 TYR B 42 0.715 -19.697 -14.117 1.00 11.47 C ATOM 7377 CZ TYR B 42 1.284 -18.664 -14.860 1.00 7.63 C ATOM 7378 OH TYR B 42 2.420 -18.920 -15.561 1.00 14.66 O ATOM 7379 HA TYR B 42 -1.313 -16.380 -11.613 1.00 0.00 H ATOM 7380 HB3 TYR B 42 -3.046 -17.477 -13.283 1.00 0.00 H ATOM 7381 HB2 TYR B 42 -2.724 -18.929 -12.305 1.00 0.00 H ATOM 7382 HD2 TYR B 42 -0.888 -20.262 -12.806 1.00 0.00 H ATOM 7383 HE2 TYR B 42 1.178 -20.684 -14.101 1.00 0.00 H ATOM 7384 HE1 TYR B 42 1.131 -16.590 -15.449 1.00 0.00 H ATOM 7385 HD1 TYR B 42 -0.949 -16.207 -14.166 1.00 0.00 H ATOM 7386 HH TYR B 42 2.705 -18.099 -16.036 1.00 0.00 H ATOM 7387 H TYR B 42 -1.890 -18.915 -10.297 1.00 0.00 H ATOM 7388 N GLY B 43 -4.150 -16.928 -10.217 1.00 5.94 N ATOM 7389 CA GLY B 43 -5.457 -16.413 -9.726 1.00 8.03 C ATOM 7390 C GLY B 43 -5.526 -15.446 -8.518 1.00 4.29 C ATOM 7391 O GLY B 43 -6.607 -15.400 -7.869 1.00 9.77 O ATOM 7392 HA3 GLY B 43 -6.055 -17.285 -9.461 1.00 0.00 H ATOM 7393 HA2 GLY B 43 -5.923 -15.896 -10.565 1.00 0.00 H ATOM 7394 H GLY B 43 -3.825 -17.841 -9.840 1.00 0.00 H ATOM 7395 N GLY B 44 -4.458 -14.699 -8.237 1.00 7.59 N ATOM 7396 CA GLY B 44 -4.507 -13.751 -7.116 1.00 8.18 C ATOM 7397 C GLY B 44 -4.727 -14.406 -5.750 1.00 10.61 C ATOM 7398 O GLY B 44 -5.386 -13.883 -4.861 1.00 8.14 O ATOM 7399 HA3 GLY B 44 -5.323 -13.051 -7.295 1.00 0.00 H ATOM 7400 HA2 GLY B 44 -3.563 -13.207 -7.087 1.00 0.00 H ATOM 7401 H GLY B 44 -3.594 -14.787 -8.809 1.00 0.00 H ATOM 7402 N MET B 45 -4.104 -15.575 -5.600 1.00 6.93 N ATOM 7403 CA MET B 45 -4.167 -16.377 -4.408 1.00 4.46 C ATOM 7404 C MET B 45 -5.580 -16.811 -4.034 1.00 8.71 C ATOM 7405 O MET B 45 -5.891 -17.043 -2.857 1.00 6.52 O ATOM 7406 CB MET B 45 -3.639 -15.526 -3.225 1.00 7.72 C ATOM 7407 CG MET B 45 -2.157 -15.195 -3.360 1.00 6.69 C ATOM 7408 SD MET B 45 -1.631 -14.116 -1.979 1.00 14.24 S ATOM 7409 CE MET B 45 0.033 -13.740 -2.573 1.00 7.65 C ATOM 7410 HA MET B 45 -3.577 -17.272 -4.604 1.00 0.00 H ATOM 7411 HB2 MET B 45 -4.203 -14.594 -3.185 1.00 0.00 H ATOM 7412 HB3 MET B 45 -3.791 -16.081 -2.299 1.00 0.00 H ATOM 7413 HG2 MET B 45 -1.986 -14.681 -4.306 1.00 0.00 H ATOM 7414 HG3 MET B 45 -1.577 -16.118 -3.339 1.00 0.00 H ATOM 7415 HE1 MET B 45 0.600 -14.666 -2.673 1.00 0.00 H ATOM 7416 HE2 MET B 45 -0.032 -13.246 -3.542 1.00 0.00 H ATOM 7417 HE3 MET B 45 0.532 -13.083 -1.861 1.00 0.00 H ATOM 7418 H MET B 45 -3.536 -15.930 -6.396 1.00 0.00 H ATOM 7419 N ARG B 46 -6.467 -16.888 -5.013 1.00 7.47 N ATOM 7420 CA ARG B 46 -7.831 -17.253 -4.623 1.00 5.86 C ATOM 7421 C ARG B 46 -7.891 -18.601 -3.974 1.00 14.23 C ATOM 7422 O ARG B 46 -7.392 -19.571 -4.521 1.00 16.15 O ATOM 7423 CB ARG B 46 -8.818 -17.211 -5.782 1.00 10.17 C ATOM 7424 CG ARG B 46 -10.263 -16.958 -5.334 1.00 3.25 C ATOM 7425 CD ARG B 46 -10.528 -15.528 -4.851 1.00 6.94 C ATOM 7426 NE ARG B 46 -10.636 -14.591 -5.976 1.00 5.29 N ATOM 7427 CZ ARG B 46 -9.656 -13.749 -6.287 1.00 5.46 C ATOM 7428 NH1 ARG B 46 -8.595 -13.829 -5.531 1.00 6.46 N ATOM 7429 NH2 ARG B 46 -9.652 -12.883 -7.299 1.00 7.83 N ATOM 7430 HA ARG B 46 -8.127 -16.493 -3.900 1.00 0.00 H ATOM 7431 HB2 ARG B 46 -8.521 -16.413 -6.462 1.00 0.00 H ATOM 7432 HB3 ARG B 46 -8.779 -18.166 -6.306 1.00 0.00 H ATOM 7433 HG2 ARG B 46 -10.924 -17.163 -6.177 1.00 0.00 H ATOM 7434 HG3 ARG B 46 -10.494 -17.643 -4.518 1.00 0.00 H ATOM 7435 HD2 ARG B 46 -9.707 -15.214 -4.206 1.00 0.00 H ATOM 7436 HD3 ARG B 46 -11.460 -15.512 -4.286 1.00 0.00 H ATOM 7437 HE ARG B 46 -11.505 -14.586 -6.547 1.00 0.00 H ATOM 7438 HH12 ARG B 46 -7.782 -13.205 -5.708 1.00 0.00 H ATOM 7439 HH11 ARG B 46 -8.562 -14.517 -4.752 1.00 0.00 H ATOM 7440 HH22 ARG B 46 -8.828 -12.267 -7.453 1.00 0.00 H ATOM 7441 HH21 ARG B 46 -10.473 -12.823 -7.935 1.00 0.00 H ATOM 7442 H ARG B 46 -6.210 -16.700 -6.003 1.00 0.00 H ATOM 7443 N GLY B 47 -8.480 -18.637 -2.793 1.00 11.77 N ATOM 7444 CA GLY B 47 -8.579 -19.906 -2.091 1.00 18.77 C ATOM 7445 C GLY B 47 -7.343 -20.217 -1.244 1.00 24.58 C ATOM 7446 O GLY B 47 -7.348 -21.207 -0.553 1.00 19.54 O ATOM 7447 HA3 GLY B 47 -8.706 -20.701 -2.826 1.00 0.00 H ATOM 7448 HA2 GLY B 47 -9.450 -19.875 -1.437 1.00 0.00 H ATOM 7449 H GLY B 47 -8.868 -17.769 -2.371 1.00 0.00 H ATOM 7450 N MET B 48 -6.284 -19.403 -1.252 1.00 14.86 N ATOM 7451 CA MET B 48 -5.167 -19.777 -0.400 1.00 11.00 C ATOM 7452 C MET B 48 -5.301 -19.232 1.017 1.00 7.96 C ATOM 7453 O MET B 48 -5.570 -18.042 1.220 1.00 10.64 O ATOM 7454 CB MET B 48 -3.824 -19.257 -0.932 1.00 13.69 C ATOM 7455 CG MET B 48 -3.470 -19.699 -2.337 1.00 35.23 C ATOM 7456 SD MET B 48 -1.763 -19.284 -2.823 1.00 37.16 S ATOM 7457 CE MET B 48 -1.133 -18.610 -1.287 1.00 17.22 C ATOM 7458 HA MET B 48 -5.188 -20.867 -0.397 1.00 0.00 H ATOM 7459 HB2 MET B 48 -3.855 -18.168 -0.919 1.00 0.00 H ATOM 7460 HB3 MET B 48 -3.038 -19.605 -0.261 1.00 0.00 H ATOM 7461 HG2 MET B 48 -4.154 -19.215 -3.034 1.00 0.00 H ATOM 7462 HG3 MET B 48 -3.594 -20.780 -2.400 1.00 0.00 H ATOM 7463 HE1 MET B 48 -1.729 -17.744 -1.000 1.00 0.00 H ATOM 7464 HE2 MET B 48 -1.194 -19.369 -0.507 1.00 0.00 H ATOM 7465 HE3 MET B 48 -0.094 -18.309 -1.423 1.00 0.00 H ATOM 7466 H MET B 48 -6.260 -18.544 -1.838 1.00 0.00 H ATOM 7467 N LYS B 49 -5.095 -20.094 1.990 1.00 9.53 N ATOM 7468 CA LYS B 49 -5.162 -19.657 3.383 1.00 10.72 C ATOM 7469 C LYS B 49 -3.821 -19.042 3.594 1.00 15.35 C ATOM 7470 O LYS B 49 -2.881 -19.794 3.754 1.00 21.33 O ATOM 7471 CB LYS B 49 -5.375 -20.767 4.366 1.00 13.45 C ATOM 7472 CG LYS B 49 -6.865 -21.060 4.354 1.00 21.00 C ATOM 7473 CD LYS B 49 -7.147 -22.384 5.024 1.00 36.54 C ATOM 7474 CE LYS B 49 -8.405 -23.038 4.482 1.00 54.05 C ATOM 7475 NZ LYS B 49 -8.090 -23.991 3.406 1.00 80.00 N ATOM 7476 HA LYS B 49 -6.011 -18.994 3.547 1.00 0.00 H ATOM 7477 HB2 LYS B 49 -4.813 -21.651 4.066 1.00 0.00 H ATOM 7478 HB3 LYS B 49 -5.058 -20.457 5.362 1.00 0.00 H ATOM 7479 HG2 LYS B 49 -7.391 -20.268 4.887 1.00 0.00 H ATOM 7480 HG3 LYS B 49 -7.216 -21.097 3.323 1.00 0.00 H ATOM 7481 HD2 LYS B 49 -6.302 -23.051 4.855 1.00 0.00 H ATOM 7482 HD3 LYS B 49 -7.269 -22.218 6.094 1.00 0.00 H ATOM 7483 HE2 LYS B 49 -9.067 -22.266 4.090 1.00 0.00 H ATOM 7484 HE3 LYS B 49 -8.907 -23.569 5.291 1.00 0.00 H ATOM 7485 HZ1 LYS B 49 -7.615 -23.489 2.628 1.00 0.00 H ATOM 7486 HZ2 LYS B 49 -7.463 -24.734 3.775 1.00 0.00 H ATOM 7487 HZ3 LYS B 49 -8.970 -24.421 3.057 1.00 0.00 H ATOM 7488 H LYS B 49 -4.884 -21.088 1.767 1.00 0.00 H ATOM 7489 N GLY B 50 -3.705 -17.700 3.541 1.00 11.23 N ATOM 7490 CA GLY B 50 -2.373 -17.160 3.698 1.00 12.75 C ATOM 7491 C GLY B 50 -2.073 -16.273 4.870 1.00 13.16 C ATOM 7492 O GLY B 50 -0.898 -15.951 5.009 1.00 11.14 O ATOM 7493 HA3 GLY B 50 -2.155 -16.584 2.799 1.00 0.00 H ATOM 7494 HA2 GLY B 50 -1.691 -18.008 3.758 1.00 0.00 H ATOM 7495 H GLY B 50 -4.531 -17.085 3.395 1.00 0.00 H ATOM 7496 N LEU B 51 -3.039 -15.876 5.671 1.00 10.69 N ATOM 7497 CA LEU B 51 -2.624 -15.011 6.761 1.00 6.48 C ATOM 7498 C LEU B 51 -3.410 -15.212 8.027 1.00 6.97 C ATOM 7499 O LEU B 51 -4.493 -15.769 7.977 1.00 13.00 O ATOM 7500 CB LEU B 51 -3.100 -13.526 6.567 1.00 23.73 C ATOM 7501 CG LEU B 51 -3.087 -12.941 5.183 1.00 26.57 C ATOM 7502 CD1 LEU B 51 -4.051 -11.775 5.115 1.00 24.61 C ATOM 7503 CD2 LEU B 51 -1.701 -12.322 5.111 1.00 26.81 C ATOM 7504 HA LEU B 51 -1.554 -15.219 6.792 1.00 0.00 H ATOM 7505 HB2 LEU B 51 -4.126 -13.467 6.931 1.00 0.00 H ATOM 7506 HB3 LEU B 51 -2.459 -12.899 7.187 1.00 0.00 H ATOM 7507 HG LEU B 51 -3.335 -13.672 4.414 1.00 0.00 H ATOM 7508 HD21 LEU B 51 -1.599 -11.570 5.893 1.00 0.00 H ATOM 7509 HD22 LEU B 51 -0.950 -13.099 5.253 1.00 0.00 H ATOM 7510 HD23 LEU B 51 -1.563 -11.855 4.136 1.00 0.00 H ATOM 7511 HD11 LEU B 51 -5.057 -12.122 5.353 1.00 0.00 H ATOM 7512 HD12 LEU B 51 -3.749 -11.013 5.834 1.00 0.00 H ATOM 7513 HD13 LEU B 51 -4.039 -11.353 4.110 1.00 0.00 H ATOM 7514 H LEU B 51 -4.029 -16.162 5.533 1.00 0.00 H ATOM 7515 N ILE B 52 -2.824 -14.719 9.132 1.00 6.14 N ATOM 7516 CA ILE B 52 -3.496 -14.798 10.425 1.00 3.60 C ATOM 7517 C ILE B 52 -4.019 -13.395 10.697 1.00 14.62 C ATOM 7518 O ILE B 52 -3.195 -12.491 10.618 1.00 7.15 O ATOM 7519 CB ILE B 52 -2.626 -15.294 11.566 1.00 8.81 C ATOM 7520 CG1 ILE B 52 -2.393 -16.815 11.406 1.00 12.68 C ATOM 7521 CG2 ILE B 52 -3.449 -15.065 12.831 1.00 5.95 C ATOM 7522 CD1 ILE B 52 -3.621 -17.691 11.735 1.00 17.49 C ATOM 7523 HA ILE B 52 -4.289 -15.544 10.374 1.00 0.00 H ATOM 7524 HB ILE B 52 -1.662 -14.786 11.592 1.00 0.00 H ATOM 7525 HG12 ILE B 52 -2.104 -17.008 10.373 1.00 0.00 H ATOM 7526 HG13 ILE B 52 -1.579 -17.106 12.070 1.00 0.00 H ATOM 7527 HD11 ILE B 52 -3.919 -17.523 12.770 1.00 0.00 H ATOM 7528 HD12 ILE B 52 -4.444 -17.425 11.071 1.00 0.00 H ATOM 7529 HD13 ILE B 52 -3.365 -18.741 11.595 1.00 0.00 H ATOM 7530 HG21 ILE B 52 -3.672 -14.003 12.931 1.00 0.00 H ATOM 7531 HG22 ILE B 52 -4.380 -15.628 12.764 1.00 0.00 H ATOM 7532 HG23 ILE B 52 -2.881 -15.401 13.698 1.00 0.00 H ATOM 7533 H ILE B 52 -1.885 -14.278 9.065 1.00 0.00 H ATOM 7534 N TYR B 53 -5.328 -13.229 10.994 1.00 6.68 N ATOM 7535 CA TYR B 53 -5.951 -11.911 11.228 1.00 3.00 C ATOM 7536 C TYR B 53 -6.985 -12.249 12.271 1.00 6.50 C ATOM 7537 O TYR B 53 -7.858 -13.047 12.043 1.00 10.24 O ATOM 7538 CB TYR B 53 -6.479 -11.454 9.798 1.00 3.00 C ATOM 7539 CG TYR B 53 -6.931 -10.024 9.743 1.00 4.74 C ATOM 7540 CD1 TYR B 53 -8.247 -9.685 10.077 1.00 8.96 C ATOM 7541 CD2 TYR B 53 -6.062 -8.999 9.356 1.00 9.72 C ATOM 7542 CE1 TYR B 53 -8.664 -8.348 10.031 1.00 7.12 C ATOM 7543 CE2 TYR B 53 -6.451 -7.656 9.333 1.00 6.41 C ATOM 7544 CZ TYR B 53 -7.765 -7.331 9.667 1.00 7.09 C ATOM 7545 OH TYR B 53 -8.152 -6.000 9.587 1.00 3.28 O ATOM 7546 HA TYR B 53 -5.352 -11.077 11.595 1.00 0.00 H ATOM 7547 HB3 TYR B 53 -7.320 -12.091 9.523 1.00 0.00 H ATOM 7548 HB2 TYR B 53 -5.673 -11.587 9.076 1.00 0.00 H ATOM 7549 HD2 TYR B 53 -5.045 -9.256 9.062 1.00 0.00 H ATOM 7550 HE2 TYR B 53 -5.740 -6.877 9.059 1.00 0.00 H ATOM 7551 HE1 TYR B 53 -9.695 -8.095 10.280 1.00 0.00 H ATOM 7552 HD1 TYR B 53 -8.950 -10.463 10.374 1.00 0.00 H ATOM 7553 HH TYR B 53 -9.103 -5.918 9.851 1.00 0.00 H ATOM 7554 H TYR B 53 -5.928 -14.076 11.061 1.00 0.00 H ATOM 7555 N GLU B 54 -6.845 -11.669 13.444 1.00 10.02 N ATOM 7556 CA GLU B 54 -7.709 -11.989 14.535 1.00 7.23 C ATOM 7557 C GLU B 54 -9.056 -11.363 14.730 1.00 12.33 C ATOM 7558 O GLU B 54 -9.929 -11.985 15.340 1.00 8.74 O ATOM 7559 CB GLU B 54 -6.874 -11.783 15.865 1.00 6.08 C ATOM 7560 CG GLU B 54 -5.471 -12.458 15.773 1.00 5.70 C ATOM 7561 CD GLU B 54 -5.423 -13.925 16.161 1.00 10.36 C ATOM 7562 OE1 GLU B 54 -6.440 -14.622 15.759 1.00 15.89 O ATOM 7563 OE2 GLU B 54 -4.363 -14.434 16.492 1.00 13.69 O ATOM 7564 HA GLU B 54 -8.014 -13.000 14.265 1.00 0.00 H ATOM 7565 HB2 GLU B 54 -6.742 -10.715 16.038 1.00 0.00 H ATOM 7566 HB3 GLU B 54 -7.423 -12.220 16.699 1.00 0.00 H ATOM 7567 HG2 GLU B 54 -5.124 -12.371 14.743 1.00 0.00 H ATOM 7568 HG3 GLU B 54 -4.793 -11.914 16.431 1.00 0.00 H ATOM 7569 H GLU B 54 -6.092 -10.965 13.579 1.00 0.00 H ATOM 7570 N THR B 55 -9.171 -10.122 14.271 1.00 6.66 N ATOM 7571 CA THR B 55 -10.384 -9.401 14.494 1.00 8.20 C ATOM 7572 C THR B 55 -11.702 -9.834 13.856 1.00 8.51 C ATOM 7573 O THR B 55 -12.766 -9.597 14.414 1.00 8.74 O ATOM 7574 CB THR B 55 -10.068 -7.935 14.243 1.00 3.16 C ATOM 7575 OG1 THR B 55 -9.505 -7.924 12.918 1.00 6.98 O ATOM 7576 CG2 THR B 55 -9.041 -7.453 15.234 1.00 6.72 C ATOM 7577 HA THR B 55 -10.653 -9.646 15.521 1.00 0.00 H ATOM 7578 HB THR B 55 -10.942 -7.292 14.341 1.00 0.00 H ATOM 7579 HG1 THR B 55 -10.169 -8.279 12.275 1.00 0.00 H ATOM 7580 HG23 THR B 55 -9.471 -7.463 16.235 1.00 0.00 H ATOM 7581 HG21 THR B 55 -8.172 -8.111 15.204 1.00 0.00 H ATOM 7582 HG22 THR B 55 -8.739 -6.438 14.977 1.00 0.00 H ATOM 7583 H THR B 55 -8.385 -9.679 13.754 1.00 0.00 H ATOM 7584 N SER B 56 -11.647 -10.439 12.687 1.00 8.45 N ATOM 7585 CA SER B 56 -12.892 -10.847 12.042 1.00 7.48 C ATOM 7586 C SER B 56 -12.517 -11.968 11.081 1.00 5.13 C ATOM 7587 O SER B 56 -11.374 -12.162 10.624 1.00 7.76 O ATOM 7588 CB SER B 56 -13.596 -9.708 11.318 1.00 8.34 C ATOM 7589 OG SER B 56 -12.754 -9.065 10.346 1.00 10.27 O ATOM 7590 HA SER B 56 -13.610 -11.176 12.793 1.00 0.00 H ATOM 7591 HB2 SER B 56 -13.909 -8.967 12.054 1.00 0.00 H ATOM 7592 HB3 SER B 56 -14.474 -10.107 10.810 1.00 0.00 H ATOM 7593 HG SER B 56 -11.956 -8.691 10.798 1.00 0.00 H ATOM 7594 H SER B 56 -10.731 -10.623 12.230 1.00 0.00 H ATOM 7595 N VAL B 57 -13.515 -12.751 10.820 1.00 5.75 N ATOM 7596 CA VAL B 57 -13.359 -13.916 9.950 1.00 8.11 C ATOM 7597 C VAL B 57 -14.587 -14.022 9.064 1.00 9.51 C ATOM 7598 O VAL B 57 -15.732 -13.907 9.486 1.00 6.81 O ATOM 7599 CB VAL B 57 -13.274 -15.216 10.771 1.00 12.32 C ATOM 7600 CG1 VAL B 57 -12.958 -16.355 9.801 1.00 10.56 C ATOM 7601 CG2 VAL B 57 -12.076 -15.161 11.707 1.00 11.47 C ATOM 7602 HA VAL B 57 -12.444 -13.791 9.371 1.00 0.00 H ATOM 7603 HB VAL B 57 -14.206 -15.351 11.319 1.00 0.00 H ATOM 7604 HG11 VAL B 57 -13.750 -16.426 9.056 1.00 0.00 H ATOM 7605 HG12 VAL B 57 -12.008 -16.155 9.305 1.00 0.00 H ATOM 7606 HG13 VAL B 57 -12.891 -17.293 10.353 1.00 0.00 H ATOM 7607 HG21 VAL B 57 -11.164 -15.045 11.121 1.00 0.00 H ATOM 7608 HG22 VAL B 57 -12.184 -14.314 12.384 1.00 0.00 H ATOM 7609 HG23 VAL B 57 -12.024 -16.085 12.283 1.00 0.00 H ATOM 7610 H VAL B 57 -14.446 -12.547 11.237 1.00 0.00 H ATOM 7611 N LEU B 58 -14.370 -14.199 7.771 1.00 8.19 N ATOM 7612 CA LEU B 58 -15.527 -14.276 6.885 1.00 3.00 C ATOM 7613 C LEU B 58 -15.819 -15.712 6.456 1.00 4.90 C ATOM 7614 O LEU B 58 -14.925 -16.478 6.058 1.00 12.51 O ATOM 7615 CB LEU B 58 -15.136 -13.445 5.627 1.00 6.06 C ATOM 7616 CG LEU B 58 -16.120 -13.325 4.462 1.00 13.38 C ATOM 7617 CD1 LEU B 58 -17.416 -12.621 4.876 1.00 13.51 C ATOM 7618 CD2 LEU B 58 -15.428 -12.601 3.315 1.00 10.31 C ATOM 7619 HA LEU B 58 -16.420 -13.905 7.389 1.00 0.00 H ATOM 7620 HB2 LEU B 58 -14.926 -12.432 5.970 1.00 0.00 H ATOM 7621 HB3 LEU B 58 -14.224 -13.888 5.226 1.00 0.00 H ATOM 7622 HG LEU B 58 -16.413 -14.323 4.137 1.00 0.00 H ATOM 7623 HD21 LEU B 58 -15.121 -11.609 3.646 1.00 0.00 H ATOM 7624 HD22 LEU B 58 -14.551 -13.170 3.004 1.00 0.00 H ATOM 7625 HD23 LEU B 58 -16.118 -12.508 2.477 1.00 0.00 H ATOM 7626 HD11 LEU B 58 -17.898 -13.188 5.672 1.00 0.00 H ATOM 7627 HD12 LEU B 58 -17.185 -11.617 5.232 1.00 0.00 H ATOM 7628 HD13 LEU B 58 -18.084 -12.558 4.017 1.00 0.00 H ATOM 7629 H LEU B 58 -13.403 -14.281 7.397 1.00 0.00 H ATOM 7630 N ASP B 59 -17.086 -16.073 6.541 1.00 10.85 N ATOM 7631 CA ASP B 59 -17.560 -17.357 6.126 1.00 13.37 C ATOM 7632 C ASP B 59 -18.184 -17.128 4.704 1.00 10.28 C ATOM 7633 O ASP B 59 -18.978 -16.212 4.488 1.00 7.51 O ATOM 7634 CB ASP B 59 -18.595 -17.807 7.170 1.00 12.22 C ATOM 7635 CG ASP B 59 -19.132 -19.145 6.720 1.00 27.66 C ATOM 7636 OD1 ASP B 59 -18.223 -20.081 6.760 1.00 37.87 O ATOM 7637 OD2 ASP B 59 -20.109 -19.248 6.020 1.00 17.08 O ATOM 7638 HA ASP B 59 -16.797 -18.132 6.061 1.00 0.00 H ATOM 7639 HB2 ASP B 59 -18.122 -17.904 8.147 1.00 0.00 H ATOM 7640 HB3 ASP B 59 -19.405 -17.080 7.230 1.00 0.00 H ATOM 7641 H ASP B 59 -17.771 -15.392 6.927 1.00 0.00 H ATOM 7642 N PRO B 60 -17.820 -17.929 3.708 1.00 9.60 N ATOM 7643 CA PRO B 60 -18.340 -17.743 2.379 1.00 9.00 C ATOM 7644 C PRO B 60 -19.838 -17.783 2.209 1.00 11.06 C ATOM 7645 O PRO B 60 -20.390 -17.205 1.269 1.00 15.89 O ATOM 7646 CB PRO B 60 -17.785 -18.940 1.592 1.00 15.72 C ATOM 7647 CG PRO B 60 -16.600 -19.461 2.360 1.00 16.97 C ATOM 7648 CD PRO B 60 -16.966 -19.144 3.798 1.00 14.50 C ATOM 7649 HA PRO B 60 -18.050 -16.742 2.059 1.00 0.00 H ATOM 7650 HD3 PRO B 60 -17.518 -19.970 4.246 1.00 0.00 H ATOM 7651 HD2 PRO B 60 -16.072 -18.943 4.388 1.00 0.00 H ATOM 7652 HG3 PRO B 60 -15.684 -18.948 2.065 1.00 0.00 H ATOM 7653 HG2 PRO B 60 -16.477 -20.534 2.213 1.00 0.00 H ATOM 7654 HB2 PRO B 60 -18.545 -19.716 1.505 1.00 0.00 H ATOM 7655 HB3 PRO B 60 -17.476 -18.623 0.596 1.00 0.00 H ATOM 7656 N ASP B 61 -20.491 -18.501 3.122 1.00 8.53 N ATOM 7657 CA ASP B 61 -21.944 -18.634 3.073 1.00 14.69 C ATOM 7658 C ASP B 61 -22.672 -17.730 4.040 1.00 17.65 C ATOM 7659 O ASP B 61 -23.721 -17.170 3.681 1.00 19.58 O ATOM 7660 CB ASP B 61 -22.458 -20.044 3.404 1.00 12.59 C ATOM 7661 CG ASP B 61 -21.860 -21.134 2.546 1.00 13.27 C ATOM 7662 OD1 ASP B 61 -22.137 -20.937 1.242 1.00 14.81 O ATOM 7663 OD2 ASP B 61 -21.182 -22.057 3.014 1.00 41.92 O ATOM 7664 HA ASP B 61 -22.153 -18.368 2.037 1.00 0.00 H ATOM 7665 HB2 ASP B 61 -22.222 -20.259 4.446 1.00 0.00 H ATOM 7666 HB3 ASP B 61 -23.539 -20.055 3.268 1.00 0.00 H ATOM 7667 H ASP B 61 -19.958 -18.973 3.880 1.00 0.00 H ATOM 7668 N GLU B 62 -22.122 -17.623 5.259 1.00 16.72 N ATOM 7669 CA GLU B 62 -22.755 -16.820 6.289 1.00 16.67 C ATOM 7670 C GLU B 62 -22.307 -15.388 6.373 1.00 24.44 C ATOM 7671 O GLU B 62 -22.990 -14.591 7.019 1.00 19.29 O ATOM 7672 CB GLU B 62 -22.663 -17.521 7.655 1.00 20.72 C ATOM 7673 CG GLU B 62 -24.025 -18.196 7.882 1.00 75.39 C ATOM 7674 CD GLU B 62 -23.980 -19.349 8.825 1.00 80.00 C ATOM 7675 OE1 GLU B 62 -23.018 -20.198 8.539 1.00 80.00 O ATOM 7676 OE2 GLU B 62 -24.730 -19.428 9.787 1.00 80.00 O ATOM 7677 HA GLU B 62 -23.798 -16.746 5.981 1.00 0.00 H ATOM 7678 HB2 GLU B 62 -21.868 -18.267 7.645 1.00 0.00 H ATOM 7679 HB3 GLU B 62 -22.466 -16.793 8.442 1.00 0.00 H ATOM 7680 HG2 GLU B 62 -24.714 -17.452 8.282 1.00 0.00 H ATOM 7681 HG3 GLU B 62 -24.395 -18.553 6.921 1.00 0.00 H ATOM 7682 H GLU B 62 -21.233 -18.121 5.468 1.00 0.00 H ATOM 7683 N GLY B 63 -21.184 -15.051 5.736 1.00 14.34 N ATOM 7684 CA GLY B 63 -20.796 -13.657 5.851 1.00 8.67 C ATOM 7685 C GLY B 63 -19.848 -13.432 7.020 1.00 14.96 C ATOM 7686 O GLY B 63 -19.331 -14.346 7.652 1.00 7.39 O ATOM 7687 HA3 GLY B 63 -21.690 -13.052 5.999 1.00 0.00 H ATOM 7688 HA2 GLY B 63 -20.300 -13.351 4.930 1.00 0.00 H ATOM 7689 H GLY B 63 -20.625 -15.740 5.194 1.00 0.00 H ATOM 7690 N ILE B 64 -19.633 -12.171 7.307 1.00 4.68 N ATOM 7691 CA ILE B 64 -18.696 -11.801 8.362 1.00 4.93 C ATOM 7692 C ILE B 64 -19.042 -11.935 9.821 1.00 10.01 C ATOM 7693 O ILE B 64 -20.156 -11.678 10.208 1.00 9.75 O ATOM 7694 CB ILE B 64 -18.327 -10.317 8.068 1.00 10.30 C ATOM 7695 CG1 ILE B 64 -17.050 -9.925 8.848 1.00 11.17 C ATOM 7696 CG2 ILE B 64 -19.413 -9.365 8.609 1.00 9.07 C ATOM 7697 CD1 ILE B 64 -15.719 -10.362 8.241 1.00 7.09 C ATOM 7698 HA ILE B 64 -17.912 -12.555 8.291 1.00 0.00 H ATOM 7699 HB ILE B 64 -18.207 -10.232 6.988 1.00 0.00 H ATOM 7700 HG12 ILE B 64 -17.034 -8.838 8.933 1.00 0.00 H ATOM 7701 HG13 ILE B 64 -17.121 -10.365 9.843 1.00 0.00 H ATOM 7702 HD11 ILE B 64 -15.697 -11.449 8.160 1.00 0.00 H ATOM 7703 HD12 ILE B 64 -15.611 -9.921 7.250 1.00 0.00 H ATOM 7704 HD13 ILE B 64 -14.902 -10.028 8.881 1.00 0.00 H ATOM 7705 HG21 ILE B 64 -20.365 -9.592 8.130 1.00 0.00 H ATOM 7706 HG22 ILE B 64 -19.506 -9.498 9.687 1.00 0.00 H ATOM 7707 HG23 ILE B 64 -19.132 -8.335 8.391 1.00 0.00 H ATOM 7708 H ILE B 64 -20.134 -11.429 6.778 1.00 0.00 H ATOM 7709 N ARG B 65 -18.077 -12.312 10.629 1.00 4.50 N ATOM 7710 CA ARG B 65 -18.228 -12.413 12.087 1.00 8.63 C ATOM 7711 C ARG B 65 -17.121 -11.572 12.696 1.00 4.60 C ATOM 7712 O ARG B 65 -15.959 -11.695 12.357 1.00 9.21 O ATOM 7713 CB ARG B 65 -18.167 -13.792 12.692 1.00 7.97 C ATOM 7714 CG ARG B 65 -19.466 -14.430 12.224 1.00 8.47 C ATOM 7715 CD ARG B 65 -19.790 -15.769 12.868 1.00 11.02 C ATOM 7716 NE ARG B 65 -21.196 -16.142 12.689 1.00 80.00 N ATOM 7717 CZ ARG B 65 -22.113 -16.148 13.677 1.00 80.00 C ATOM 7718 NH1 ARG B 65 -21.822 -15.796 14.938 1.00 27.80 N ATOM 7719 NH2 ARG B 65 -23.374 -16.512 13.402 1.00 80.00 N ATOM 7720 HA ARG B 65 -19.240 -12.074 12.307 1.00 0.00 H ATOM 7721 HB2 ARG B 65 -17.303 -14.345 12.322 1.00 0.00 H ATOM 7722 HB3 ARG B 65 -18.125 -13.741 13.780 1.00 0.00 H ATOM 7723 HG2 ARG B 65 -20.281 -13.741 12.446 1.00 0.00 H ATOM 7724 HG3 ARG B 65 -19.401 -14.579 11.146 1.00 0.00 H ATOM 7725 HD2 ARG B 65 -19.576 -15.707 13.935 1.00 0.00 H ATOM 7726 HD3 ARG B 65 -19.162 -16.537 12.417 1.00 0.00 H ATOM 7727 HE ARG B 65 -21.507 -16.421 11.736 1.00 0.00 H ATOM 7728 HH12 ARG B 65 -22.563 -15.816 15.668 1.00 0.00 H ATOM 7729 HH11 ARG B 65 -20.856 -15.503 15.186 1.00 0.00 H ATOM 7730 HH22 ARG B 65 -24.089 -16.520 14.157 1.00 0.00 H ATOM 7731 HH21 ARG B 65 -23.637 -16.786 12.434 1.00 0.00 H ATOM 7732 H ARG B 65 -17.155 -12.552 10.213 1.00 0.00 H ATOM 7733 N PHE B 66 -17.492 -10.732 13.597 1.00 8.96 N ATOM 7734 CA PHE B 66 -16.581 -9.878 14.285 1.00 5.94 C ATOM 7735 C PHE B 66 -16.325 -10.514 15.629 1.00 11.35 C ATOM 7736 O PHE B 66 -17.222 -10.489 16.481 1.00 11.39 O ATOM 7737 CB PHE B 66 -17.229 -8.527 14.543 1.00 8.22 C ATOM 7738 CG PHE B 66 -17.578 -7.744 13.304 1.00 12.68 C ATOM 7739 CD1 PHE B 66 -16.609 -7.369 12.364 1.00 10.77 C ATOM 7740 CD2 PHE B 66 -18.899 -7.336 13.077 1.00 21.10 C ATOM 7741 CE1 PHE B 66 -16.990 -6.644 11.228 1.00 8.08 C ATOM 7742 CE2 PHE B 66 -19.283 -6.607 11.948 1.00 16.55 C ATOM 7743 CZ PHE B 66 -18.313 -6.249 11.013 1.00 12.98 C ATOM 7744 HA PHE B 66 -15.672 -9.744 13.698 1.00 0.00 H ATOM 7745 HB2 PHE B 66 -18.146 -8.693 15.108 1.00 0.00 H ATOM 7746 HB3 PHE B 66 -16.540 -7.929 15.139 1.00 0.00 H ATOM 7747 HD2 PHE B 66 -19.660 -7.598 13.812 1.00 0.00 H ATOM 7748 HE2 PHE B 66 -20.325 -6.323 11.801 1.00 0.00 H ATOM 7749 HZ PHE B 66 -18.582 -5.671 10.129 1.00 0.00 H ATOM 7750 HE1 PHE B 66 -16.232 -6.380 10.490 1.00 0.00 H ATOM 7751 HD1 PHE B 66 -15.564 -7.640 12.516 1.00 0.00 H ATOM 7752 H PHE B 66 -18.503 -10.673 13.834 1.00 0.00 H ATOM 7753 N ARG B 67 -15.110 -11.052 15.803 1.00 10.03 N ATOM 7754 CA ARG B 67 -14.740 -11.716 17.055 1.00 19.77 C ATOM 7755 C ARG B 67 -15.811 -12.759 17.371 1.00 17.81 C ATOM 7756 O ARG B 67 -16.216 -12.940 18.512 1.00 11.88 O ATOM 7757 CB ARG B 67 -14.501 -10.761 18.237 1.00 12.53 C ATOM 7758 CG ARG B 67 -13.253 -9.924 18.071 1.00 8.13 C ATOM 7759 CD ARG B 67 -11.976 -10.759 18.219 1.00 12.05 C ATOM 7760 NE ARG B 67 -10.819 -9.895 18.503 1.00 10.55 N ATOM 7761 CZ ARG B 67 -9.647 -10.321 18.870 1.00 10.06 C ATOM 7762 NH1 ARG B 67 -9.410 -11.604 19.002 1.00 17.61 N ATOM 7763 NH2 ARG B 67 -8.648 -9.459 19.107 1.00 13.77 N ATOM 7764 HA ARG B 67 -13.770 -12.192 16.909 1.00 0.00 H ATOM 7765 HB2 ARG B 67 -15.359 -10.094 18.325 1.00 0.00 H ATOM 7766 HB3 ARG B 67 -14.406 -11.351 19.148 1.00 0.00 H ATOM 7767 HG2 ARG B 67 -13.263 -9.469 17.080 1.00 0.00 H ATOM 7768 HG3 ARG B 67 -13.251 -9.141 18.829 1.00 0.00 H ATOM 7769 HD2 ARG B 67 -11.796 -11.305 17.293 1.00 0.00 H ATOM 7770 HD3 ARG B 67 -12.104 -11.467 19.038 1.00 0.00 H ATOM 7771 HE ARG B 67 -10.949 -8.868 18.403 1.00 0.00 H ATOM 7772 HH12 ARG B 67 -8.468 -11.931 19.296 1.00 0.00 H ATOM 7773 HH11 ARG B 67 -10.164 -12.294 18.812 1.00 0.00 H ATOM 7774 HH22 ARG B 67 -7.715 -9.812 19.400 1.00 0.00 H ATOM 7775 HH21 ARG B 67 -8.806 -8.437 18.998 1.00 0.00 H ATOM 7776 H ARG B 67 -14.414 -10.997 15.032 1.00 0.00 H ATOM 7777 N GLY B 68 -16.294 -13.439 16.364 1.00 9.96 N ATOM 7778 CA GLY B 68 -17.317 -14.429 16.689 1.00 9.45 C ATOM 7779 C GLY B 68 -18.773 -13.975 16.529 1.00 18.71 C ATOM 7780 O GLY B 68 -19.679 -14.799 16.421 1.00 11.68 O ATOM 7781 HA3 GLY B 68 -17.174 -14.727 17.727 1.00 0.00 H ATOM 7782 HA2 GLY B 68 -17.164 -15.291 16.040 1.00 0.00 H ATOM 7783 H GLY B 68 -15.969 -13.284 15.389 1.00 0.00 H ATOM 7784 N PHE B 69 -19.063 -12.681 16.507 1.00 10.10 N ATOM 7785 CA PHE B 69 -20.430 -12.216 16.350 1.00 12.39 C ATOM 7786 C PHE B 69 -20.822 -11.718 14.969 1.00 13.86 C ATOM 7787 O PHE B 69 -20.150 -10.938 14.315 1.00 14.10 O ATOM 7788 CB PHE B 69 -20.751 -11.048 17.276 1.00 10.75 C ATOM 7789 CG PHE B 69 -20.435 -11.385 18.715 1.00 16.75 C ATOM 7790 CD1 PHE B 69 -21.350 -12.044 19.529 1.00 18.33 C ATOM 7791 CD2 PHE B 69 -19.199 -11.042 19.254 1.00 17.49 C ATOM 7792 CE1 PHE B 69 -21.038 -12.333 20.861 1.00 24.86 C ATOM 7793 CE2 PHE B 69 -18.857 -11.331 20.571 1.00 23.00 C ATOM 7794 CZ PHE B 69 -19.795 -11.969 21.380 1.00 28.90 C ATOM 7795 HA PHE B 69 -20.986 -13.126 16.577 1.00 0.00 H ATOM 7796 HB2 PHE B 69 -20.159 -10.183 16.975 1.00 0.00 H ATOM 7797 HB3 PHE B 69 -21.811 -10.809 17.192 1.00 0.00 H ATOM 7798 HD2 PHE B 69 -18.474 -10.529 18.622 1.00 0.00 H ATOM 7799 HE2 PHE B 69 -17.875 -11.064 20.962 1.00 0.00 H ATOM 7800 HZ PHE B 69 -19.557 -12.184 22.422 1.00 0.00 H ATOM 7801 HE1 PHE B 69 -21.765 -12.842 21.493 1.00 0.00 H ATOM 7802 HD1 PHE B 69 -22.319 -12.338 19.125 1.00 0.00 H ATOM 7803 H PHE B 69 -18.296 -11.985 16.604 1.00 0.00 H ATOM 7804 N SER B 70 -22.005 -12.139 14.556 1.00 12.97 N ATOM 7805 CA SER B 70 -22.503 -11.694 13.290 1.00 9.60 C ATOM 7806 C SER B 70 -23.113 -10.316 13.468 1.00 11.20 C ATOM 7807 O SER B 70 -23.372 -9.790 14.549 1.00 13.63 O ATOM 7808 CB SER B 70 -23.653 -12.595 12.882 1.00 21.65 C ATOM 7809 OG SER B 70 -24.738 -12.450 13.775 1.00 17.28 O ATOM 7810 HA SER B 70 -21.694 -11.697 12.560 1.00 0.00 H ATOM 7811 HB2 SER B 70 -23.317 -13.632 12.891 1.00 0.00 H ATOM 7812 HB3 SER B 70 -23.978 -12.329 11.876 1.00 0.00 H ATOM 7813 HG SER B 70 -25.478 -13.045 13.493 1.00 0.00 H ATOM 7814 H SER B 70 -22.568 -12.786 15.144 1.00 0.00 H ATOM 7815 N ILE B 71 -23.408 -9.693 12.338 1.00 8.89 N ATOM 7816 CA ILE B 71 -24.001 -8.375 12.360 1.00 17.86 C ATOM 7817 C ILE B 71 -25.303 -8.283 13.176 1.00 23.96 C ATOM 7818 O ILE B 71 -25.440 -7.396 14.002 1.00 16.81 O ATOM 7819 CB ILE B 71 -24.103 -7.913 10.916 1.00 20.83 C ATOM 7820 CG1 ILE B 71 -22.670 -7.589 10.504 1.00 23.79 C ATOM 7821 CG2 ILE B 71 -24.948 -6.652 10.796 1.00 19.81 C ATOM 7822 CD1 ILE B 71 -22.536 -7.174 9.054 1.00 24.58 C ATOM 7823 HA ILE B 71 -23.365 -7.682 12.911 1.00 0.00 H ATOM 7824 HB ILE B 71 -24.570 -8.676 10.293 1.00 0.00 H ATOM 7825 HG12 ILE B 71 -22.306 -6.775 11.131 1.00 0.00 H ATOM 7826 HG13 ILE B 71 -22.055 -8.474 10.668 1.00 0.00 H ATOM 7827 HD11 ILE B 71 -22.885 -7.983 8.412 1.00 0.00 H ATOM 7828 HD12 ILE B 71 -23.136 -6.282 8.876 1.00 0.00 H ATOM 7829 HD13 ILE B 71 -21.490 -6.960 8.834 1.00 0.00 H ATOM 7830 HG21 ILE B 71 -25.953 -6.853 11.168 1.00 0.00 H ATOM 7831 HG22 ILE B 71 -24.494 -5.855 11.384 1.00 0.00 H ATOM 7832 HG23 ILE B 71 -25.000 -6.349 9.750 1.00 0.00 H ATOM 7833 H ILE B 71 -23.212 -10.155 11.427 1.00 0.00 H ATOM 7834 N PRO B 72 -26.259 -9.192 12.984 1.00 17.70 N ATOM 7835 CA PRO B 72 -27.497 -9.124 13.749 1.00 15.78 C ATOM 7836 C PRO B 72 -27.192 -9.172 15.223 1.00 22.40 C ATOM 7837 O PRO B 72 -27.821 -8.439 15.964 1.00 13.26 O ATOM 7838 CB PRO B 72 -28.347 -10.317 13.305 1.00 18.00 C ATOM 7839 CG PRO B 72 -27.835 -10.627 11.896 1.00 20.22 C ATOM 7840 CD PRO B 72 -26.433 -10.047 11.786 1.00 15.50 C ATOM 7841 HA PRO B 72 -28.036 -8.193 13.572 1.00 0.00 H ATOM 7842 HD3 PRO B 72 -25.691 -10.845 11.777 1.00 0.00 H ATOM 7843 HD2 PRO B 72 -26.337 -9.453 10.877 1.00 0.00 H ATOM 7844 HG3 PRO B 72 -28.488 -10.169 11.153 1.00 0.00 H ATOM 7845 HG2 PRO B 72 -27.806 -11.705 11.738 1.00 0.00 H ATOM 7846 HB2 PRO B 72 -28.198 -11.169 13.969 1.00 0.00 H ATOM 7847 HB3 PRO B 72 -29.405 -10.054 13.285 1.00 0.00 H ATOM 7848 N GLU B 73 -26.202 -10.008 15.609 1.00 17.37 N ATOM 7849 CA GLU B 73 -25.775 -10.147 16.999 1.00 12.97 C ATOM 7850 C GLU B 73 -25.171 -8.843 17.476 1.00 14.16 C ATOM 7851 O GLU B 73 -25.435 -8.384 18.581 1.00 25.56 O ATOM 7852 CB GLU B 73 -24.740 -11.227 17.121 1.00 11.84 C ATOM 7853 CG GLU B 73 -25.406 -12.604 17.280 1.00 14.31 C ATOM 7854 CD GLU B 73 -24.512 -13.782 16.904 1.00 31.98 C ATOM 7855 OE1 GLU B 73 -23.328 -13.707 16.672 1.00 23.91 O ATOM 7856 OE2 GLU B 73 -25.158 -14.889 16.677 1.00 72.91 O ATOM 7857 HA GLU B 73 -26.644 -10.405 17.605 1.00 0.00 H ATOM 7858 HB2 GLU B 73 -24.119 -11.231 16.225 1.00 0.00 H ATOM 7859 HB3 GLU B 73 -24.116 -11.028 17.993 1.00 0.00 H ATOM 7860 HG2 GLU B 73 -25.705 -12.721 18.322 1.00 0.00 H ATOM 7861 HG3 GLU B 73 -26.291 -12.631 16.645 1.00 0.00 H ATOM 7862 H GLU B 73 -25.723 -10.578 14.883 1.00 0.00 H ATOM 7863 N CYS B 74 -24.336 -8.192 16.656 1.00 10.37 N ATOM 7864 CA CYS B 74 -23.790 -6.913 17.118 1.00 10.37 C ATOM 7865 C CYS B 74 -24.876 -5.853 17.260 1.00 17.11 C ATOM 7866 O CYS B 74 -24.874 -5.053 18.187 1.00 16.82 O ATOM 7867 CB CYS B 74 -22.791 -6.372 16.094 1.00 8.41 C ATOM 7868 SG CYS B 74 -21.322 -7.418 16.179 1.00 15.56 S ATOM 7869 HA CYS B 74 -23.322 -7.104 18.084 1.00 0.00 H ATOM 7870 HB2 CYS B 74 -22.530 -5.341 16.334 1.00 0.00 H ATOM 7871 HB3 CYS B 74 -23.222 -6.413 15.094 1.00 0.00 H ATOM 7872 HG CYS B 74 -21.668 -8.720 15.880 1.00 0.00 H ATOM 7873 H CYS B 74 -24.084 -8.580 15.725 1.00 0.00 H ATOM 7874 N GLN B 75 -25.817 -5.851 16.343 1.00 18.11 N ATOM 7875 CA GLN B 75 -26.892 -4.888 16.391 1.00 20.48 C ATOM 7876 C GLN B 75 -27.621 -5.023 17.690 1.00 23.01 C ATOM 7877 O GLN B 75 -28.064 -4.084 18.343 1.00 24.19 O ATOM 7878 CB GLN B 75 -27.934 -5.163 15.291 1.00 26.99 C ATOM 7879 CG GLN B 75 -28.478 -3.891 14.631 1.00 68.47 C ATOM 7880 CD GLN B 75 -28.523 -4.015 13.121 1.00 80.00 C ATOM 7881 OE1 GLN B 75 -28.405 -5.116 12.536 1.00 80.00 O ATOM 7882 NE2 GLN B 75 -28.722 -2.857 12.497 1.00 80.00 N ATOM 7883 HA GLN B 75 -26.449 -3.900 16.263 1.00 0.00 H ATOM 7884 HB2 GLN B 75 -27.469 -5.779 14.522 1.00 0.00 H ATOM 7885 HB3 GLN B 75 -28.769 -5.706 15.734 1.00 0.00 H ATOM 7886 HG2 GLN B 75 -29.487 -3.705 15.000 1.00 0.00 H ATOM 7887 HG3 GLN B 75 -27.835 -3.052 14.897 1.00 0.00 H ATOM 7888 HE22 GLN B 75 -28.811 -1.979 13.047 1.00 0.00 H ATOM 7889 HE21 GLN B 75 -28.788 -2.830 11.459 1.00 0.00 H ATOM 7890 H GLN B 75 -25.787 -6.551 15.574 1.00 0.00 H ATOM 7891 N LYS B 76 -27.740 -6.267 18.052 1.00 19.18 N ATOM 7892 CA LYS B 76 -28.436 -6.490 19.287 1.00 17.41 C ATOM 7893 C LYS B 76 -27.639 -6.258 20.563 1.00 32.19 C ATOM 7894 O LYS B 76 -28.186 -5.658 21.499 1.00 24.19 O ATOM 7895 CB LYS B 76 -29.163 -7.814 19.186 1.00 23.27 C ATOM 7896 CG LYS B 76 -28.935 -8.753 20.352 1.00 61.93 C ATOM 7897 CD LYS B 76 -30.207 -9.538 20.616 1.00 80.00 C ATOM 7898 CE LYS B 76 -31.373 -8.945 19.815 1.00 80.00 C ATOM 7899 NZ LYS B 76 -32.512 -9.849 19.534 1.00 80.00 N ATOM 7900 HA LYS B 76 -29.174 -5.698 19.411 1.00 0.00 H ATOM 7901 HB2 LYS B 76 -30.232 -7.610 19.118 1.00 0.00 H ATOM 7902 HB3 LYS B 76 -28.831 -8.315 18.277 1.00 0.00 H ATOM 7903 HG2 LYS B 76 -28.124 -9.441 20.113 1.00 0.00 H ATOM 7904 HG3 LYS B 76 -28.671 -8.177 21.239 1.00 0.00 H ATOM 7905 HD2 LYS B 76 -30.058 -10.576 20.319 1.00 0.00 H ATOM 7906 HD3 LYS B 76 -30.442 -9.495 21.679 1.00 0.00 H ATOM 7907 HE2 LYS B 76 -30.978 -8.604 18.858 1.00 0.00 H ATOM 7908 HE3 LYS B 76 -31.758 -8.091 20.373 1.00 0.00 H ATOM 7909 HZ1 LYS B 76 -32.177 -10.666 18.985 1.00 0.00 H ATOM 7910 HZ2 LYS B 76 -32.922 -10.177 20.432 1.00 0.00 H ATOM 7911 HZ3 LYS B 76 -33.234 -9.336 18.989 1.00 0.00 H ATOM 7912 H LYS B 76 -27.356 -7.049 17.484 1.00 0.00 H ATOM 7913 N LEU B 77 -26.371 -6.712 20.592 1.00 24.34 N ATOM 7914 CA LEU B 77 -25.515 -6.581 21.754 1.00 16.18 C ATOM 7915 C LEU B 77 -24.755 -5.291 21.982 1.00 21.37 C ATOM 7916 O LEU B 77 -24.522 -4.930 23.150 1.00 22.09 O ATOM 7917 CB LEU B 77 -24.476 -7.704 21.772 1.00 14.34 C ATOM 7918 CG LEU B 77 -25.106 -9.081 21.728 1.00 27.11 C ATOM 7919 CD1 LEU B 77 -24.019 -10.066 21.323 1.00 18.53 C ATOM 7920 CD2 LEU B 77 -25.643 -9.406 23.123 1.00 24.62 C ATOM 7921 HA LEU B 77 -26.254 -6.615 22.555 1.00 0.00 H ATOM 7922 HB2 LEU B 77 -23.824 -7.590 20.906 1.00 0.00 H ATOM 7923 HB3 LEU B 77 -23.885 -7.619 22.684 1.00 0.00 H ATOM 7924 HG LEU B 77 -25.929 -9.133 21.015 1.00 0.00 H ATOM 7925 HD21 LEU B 77 -24.822 -9.392 23.839 1.00 0.00 H ATOM 7926 HD22 LEU B 77 -26.387 -8.662 23.407 1.00 0.00 H ATOM 7927 HD23 LEU B 77 -26.101 -10.395 23.113 1.00 0.00 H ATOM 7928 HD11 LEU B 77 -23.629 -9.792 20.342 1.00 0.00 H ATOM 7929 HD12 LEU B 77 -23.213 -10.038 22.056 1.00 0.00 H ATOM 7930 HD13 LEU B 77 -24.439 -11.071 21.281 1.00 0.00 H ATOM 7931 H LEU B 77 -25.990 -7.177 19.743 1.00 0.00 H ATOM 7932 N LEU B 78 -24.343 -4.620 20.934 1.00 14.53 N ATOM 7933 CA LEU B 78 -23.583 -3.428 21.173 1.00 13.89 C ATOM 7934 C LEU B 78 -24.355 -2.233 21.708 1.00 12.69 C ATOM 7935 O LEU B 78 -25.494 -1.999 21.336 1.00 9.92 O ATOM 7936 CB LEU B 78 -22.735 -3.049 19.950 1.00 10.72 C ATOM 7937 CG LEU B 78 -21.761 -4.139 19.435 1.00 14.12 C ATOM 7938 CD1 LEU B 78 -21.117 -3.640 18.142 1.00 15.99 C ATOM 7939 CD2 LEU B 78 -20.629 -4.364 20.431 1.00 18.24 C ATOM 7940 HA LEU B 78 -22.926 -3.701 21.999 1.00 0.00 H ATOM 7941 HB2 LEU B 78 -23.416 -2.798 19.136 1.00 0.00 H ATOM 7942 HB3 LEU B 78 -22.145 -2.171 20.212 1.00 0.00 H ATOM 7943 HG LEU B 78 -22.321 -5.062 19.289 1.00 0.00 H ATOM 7944 HD21 LEU B 78 -20.077 -3.434 20.568 1.00 0.00 H ATOM 7945 HD22 LEU B 78 -21.045 -4.685 21.386 1.00 0.00 H ATOM 7946 HD23 LEU B 78 -19.958 -5.133 20.049 1.00 0.00 H ATOM 7947 HD11 LEU B 78 -21.893 -3.452 17.400 1.00 0.00 H ATOM 7948 HD12 LEU B 78 -20.572 -2.717 18.341 1.00 0.00 H ATOM 7949 HD13 LEU B 78 -20.428 -4.396 17.766 1.00 0.00 H ATOM 7950 H LEU B 78 -24.559 -4.939 19.968 1.00 0.00 H ATOM 7951 N PRO B 79 -23.707 -1.449 22.593 1.00 11.91 N ATOM 7952 CA PRO B 79 -24.387 -0.280 23.098 1.00 4.87 C ATOM 7953 C PRO B 79 -24.773 0.688 21.969 1.00 21.73 C ATOM 7954 O PRO B 79 -24.086 0.850 20.946 1.00 15.92 O ATOM 7955 CB PRO B 79 -23.441 0.452 24.067 1.00 8.93 C ATOM 7956 CG PRO B 79 -22.501 -0.629 24.543 1.00 12.64 C ATOM 7957 CD PRO B 79 -22.561 -1.758 23.496 1.00 11.83 C ATOM 7958 HA PRO B 79 -25.301 -0.604 23.596 1.00 0.00 H ATOM 7959 HD3 PRO B 79 -21.632 -1.791 22.926 1.00 0.00 H ATOM 7960 HD2 PRO B 79 -22.719 -2.718 23.988 1.00 0.00 H ATOM 7961 HG3 PRO B 79 -22.818 -1.002 25.517 1.00 0.00 H ATOM 7962 HG2 PRO B 79 -21.486 -0.239 24.618 1.00 0.00 H ATOM 7963 HB2 PRO B 79 -22.895 1.243 23.553 1.00 0.00 H ATOM 7964 HB3 PRO B 79 -23.996 0.879 24.902 1.00 0.00 H ATOM 7965 N LYS B 80 -25.895 1.385 22.176 1.00 16.98 N ATOM 7966 CA LYS B 80 -26.483 2.343 21.257 1.00 7.02 C ATOM 7967 C LYS B 80 -26.442 3.694 21.889 1.00 11.35 C ATOM 7968 O LYS B 80 -26.134 3.846 23.083 1.00 17.46 O ATOM 7969 CB LYS B 80 -27.934 1.882 21.038 1.00 14.22 C ATOM 7970 CG LYS B 80 -27.979 0.745 20.063 1.00 15.00 C ATOM 7971 CD LYS B 80 -28.856 -0.423 20.451 1.00 41.01 C ATOM 7972 CE LYS B 80 -28.331 -1.776 20.016 1.00 31.83 C ATOM 7973 NZ LYS B 80 -27.714 -2.442 21.177 1.00 41.54 N ATOM 7974 HA LYS B 80 -25.952 2.399 20.307 1.00 0.00 H ATOM 7975 HB2 LYS B 80 -28.355 1.557 21.989 1.00 0.00 H ATOM 7976 HB3 LYS B 80 -28.520 2.714 20.648 1.00 0.00 H ATOM 7977 HG2 LYS B 80 -28.342 1.134 19.112 1.00 0.00 H ATOM 7978 HG3 LYS B 80 -26.962 0.372 19.937 1.00 0.00 H ATOM 7979 HD2 LYS B 80 -28.955 -0.429 21.537 1.00 0.00 H ATOM 7980 HD3 LYS B 80 -29.837 -0.277 19.999 1.00 0.00 H ATOM 7981 HE2 LYS B 80 -27.587 -1.645 19.230 1.00 0.00 H ATOM 7982 HE3 LYS B 80 -29.153 -2.384 19.639 1.00 0.00 H ATOM 7983 HZ1 LYS B 80 -26.931 -1.858 21.535 1.00 0.00 H ATOM 7984 HZ2 LYS B 80 -28.427 -2.564 21.924 1.00 0.00 H ATOM 7985 HZ3 LYS B 80 -27.350 -3.373 20.888 1.00 0.00 H ATOM 7986 H LYS B 80 -26.391 1.227 23.076 1.00 0.00 H ATOM 7987 N ALA B 81 -26.763 4.687 21.073 1.00 17.32 N ATOM 7988 CA ALA B 81 -26.791 6.060 21.568 1.00 14.75 C ATOM 7989 C ALA B 81 -28.084 6.232 22.388 1.00 15.26 C ATOM 7990 O ALA B 81 -29.048 5.465 22.238 1.00 21.55 O ATOM 7991 CB ALA B 81 -26.834 7.058 20.401 1.00 9.84 C ATOM 7992 HA ALA B 81 -25.898 6.249 22.164 1.00 0.00 H ATOM 7993 HB1 ALA B 81 -25.949 6.926 19.779 1.00 0.00 H ATOM 7994 HB2 ALA B 81 -27.729 6.880 19.805 1.00 0.00 H ATOM 7995 HB3 ALA B 81 -26.854 8.074 20.794 1.00 0.00 H ATOM 7996 H ALA B 81 -26.995 4.488 20.079 1.00 0.00 H ATOM 7997 N GLY B 82 -28.125 7.243 23.247 1.00 32.86 N ATOM 7998 CA GLY B 82 -29.342 7.459 24.014 1.00 25.57 C ATOM 7999 C GLY B 82 -30.483 7.756 23.033 1.00 22.66 C ATOM 8000 O GLY B 82 -30.496 8.765 22.314 1.00 40.26 O ATOM 8001 HA3 GLY B 82 -29.207 8.304 24.690 1.00 0.00 H ATOM 8002 HA2 GLY B 82 -29.576 6.566 24.593 1.00 0.00 H ATOM 8003 H GLY B 82 -27.303 7.868 23.369 1.00 0.00 H ATOM 8004 N GLY B 83 -31.455 6.840 23.002 1.00 31.23 N ATOM 8005 CA GLY B 83 -32.599 6.964 22.139 1.00 31.37 C ATOM 8006 C GLY B 83 -32.319 6.393 20.772 1.00 41.63 C ATOM 8007 O GLY B 83 -33.202 6.461 19.911 1.00 49.62 O ATOM 8008 HA3 GLY B 83 -32.855 8.019 22.038 1.00 0.00 H ATOM 8009 HA2 GLY B 83 -33.438 6.429 22.583 1.00 0.00 H ATOM 8010 H GLY B 83 -31.382 6.009 23.623 1.00 0.00 H ATOM 8011 N GLY B 84 -31.100 5.828 20.594 1.00 22.47 N ATOM 8012 CA GLY B 84 -30.735 5.251 19.315 1.00 24.58 C ATOM 8013 C GLY B 84 -31.165 3.797 19.153 1.00 15.89 C ATOM 8014 O GLY B 84 -31.626 3.139 20.069 1.00 19.22 O ATOM 8015 HA3 GLY B 84 -29.651 5.303 19.210 1.00 0.00 H ATOM 8016 HA2 GLY B 84 -31.204 5.839 18.526 1.00 0.00 H ATOM 8017 H GLY B 84 -30.421 5.808 21.381 1.00 0.00 H ATOM 8018 N GLU B 85 -30.970 3.314 17.939 1.00 11.27 N ATOM 8019 CA GLU B 85 -31.274 1.970 17.553 1.00 20.22 C ATOM 8020 C GLU B 85 -30.050 1.319 16.934 1.00 21.50 C ATOM 8021 O GLU B 85 -29.942 0.107 17.042 1.00 22.42 O ATOM 8022 CB GLU B 85 -32.282 1.977 16.396 1.00 31.00 C ATOM 8023 CG GLU B 85 -33.736 1.959 16.832 1.00 80.00 C ATOM 8024 CD GLU B 85 -34.556 1.293 15.773 1.00 80.00 C ATOM 8025 OE1 GLU B 85 -34.279 1.314 14.570 1.00 80.00 O ATOM 8026 OE2 GLU B 85 -35.615 0.729 16.295 1.00 80.00 O ATOM 8027 HA GLU B 85 -31.635 1.456 18.444 1.00 0.00 H ATOM 8028 HB2 GLU B 85 -32.115 2.876 15.803 1.00 0.00 H ATOM 8029 HB3 GLU B 85 -32.100 1.097 15.779 1.00 0.00 H ATOM 8030 HG2 GLU B 85 -33.830 1.408 17.768 1.00 0.00 H ATOM 8031 HG3 GLU B 85 -34.087 2.981 16.977 1.00 0.00 H ATOM 8032 H GLU B 85 -30.571 3.950 17.219 1.00 0.00 H ATOM 8033 N GLU B 86 -29.163 2.100 16.292 1.00 15.40 N ATOM 8034 CA GLU B 86 -27.943 1.568 15.641 1.00 9.41 C ATOM 8035 C GLU B 86 -26.727 1.519 16.583 1.00 14.23 C ATOM 8036 O GLU B 86 -26.538 2.402 17.420 1.00 17.28 O ATOM 8037 CB GLU B 86 -27.624 2.303 14.342 1.00 8.60 C ATOM 8038 CG GLU B 86 -28.839 2.410 13.404 1.00 10.88 C ATOM 8039 CD GLU B 86 -29.384 1.091 12.900 1.00 18.48 C ATOM 8040 OE1 GLU B 86 -28.622 0.064 13.144 1.00 29.18 O ATOM 8041 OE2 GLU B 86 -30.494 0.970 12.420 1.00 28.89 O ATOM 8042 HA GLU B 86 -28.168 0.533 15.385 1.00 0.00 H ATOM 8043 HB2 GLU B 86 -27.282 3.309 14.586 1.00 0.00 H ATOM 8044 HB3 GLU B 86 -26.830 1.766 13.824 1.00 0.00 H ATOM 8045 HG2 GLU B 86 -29.637 2.921 13.943 1.00 0.00 H ATOM 8046 HG3 GLU B 86 -28.546 3.006 12.540 1.00 0.00 H ATOM 8047 H GLU B 86 -29.342 3.124 16.251 1.00 0.00 H ATOM 8048 N PRO B 87 -25.918 0.457 16.442 1.00 10.60 N ATOM 8049 CA PRO B 87 -24.756 0.278 17.292 1.00 14.94 C ATOM 8050 C PRO B 87 -23.743 1.404 17.096 1.00 10.88 C ATOM 8051 O PRO B 87 -23.570 1.927 16.003 1.00 13.34 O ATOM 8052 CB PRO B 87 -24.202 -1.114 16.904 1.00 13.70 C ATOM 8053 CG PRO B 87 -24.706 -1.439 15.509 1.00 18.67 C ATOM 8054 CD PRO B 87 -25.999 -0.661 15.427 1.00 9.41 C ATOM 8055 HA PRO B 87 -24.998 0.321 18.354 1.00 0.00 H ATOM 8056 HD3 PRO B 87 -26.123 -0.248 14.426 1.00 0.00 H ATOM 8057 HD2 PRO B 87 -26.842 -1.313 15.657 1.00 0.00 H ATOM 8058 HG3 PRO B 87 -24.884 -2.508 15.395 1.00 0.00 H ATOM 8059 HG2 PRO B 87 -23.999 -1.106 14.749 1.00 0.00 H ATOM 8060 HB2 PRO B 87 -23.112 -1.095 16.910 1.00 0.00 H ATOM 8061 HB3 PRO B 87 -24.555 -1.865 17.611 1.00 0.00 H ATOM 8062 N LEU B 88 -23.060 1.792 18.162 1.00 8.64 N ATOM 8063 CA LEU B 88 -22.064 2.862 18.090 1.00 10.15 C ATOM 8064 C LEU B 88 -20.755 2.183 17.596 1.00 7.04 C ATOM 8065 O LEU B 88 -20.405 1.092 18.078 1.00 9.52 O ATOM 8066 CB LEU B 88 -21.941 3.457 19.512 1.00 11.37 C ATOM 8067 CG LEU B 88 -23.048 4.478 19.914 1.00 15.00 C ATOM 8068 CD1 LEU B 88 -22.562 5.134 21.184 1.00 14.17 C ATOM 8069 CD2 LEU B 88 -23.232 5.610 18.900 1.00 20.45 C ATOM 8070 HA LEU B 88 -22.315 3.678 17.412 1.00 0.00 H ATOM 8071 HB2 LEU B 88 -21.970 2.632 20.224 1.00 0.00 H ATOM 8072 HB3 LEU B 88 -20.978 3.962 19.582 1.00 0.00 H ATOM 8073 HG LEU B 88 -23.993 3.940 19.996 1.00 0.00 H ATOM 8074 HD21 LEU B 88 -22.298 6.163 18.801 1.00 0.00 H ATOM 8075 HD22 LEU B 88 -23.511 5.189 17.934 1.00 0.00 H ATOM 8076 HD23 LEU B 88 -24.018 6.281 19.246 1.00 0.00 H ATOM 8077 HD11 LEU B 88 -22.425 4.375 21.954 1.00 0.00 H ATOM 8078 HD12 LEU B 88 -21.613 5.634 20.993 1.00 0.00 H ATOM 8079 HD13 LEU B 88 -23.298 5.865 21.519 1.00 0.00 H ATOM 8080 H LEU B 88 -23.236 1.324 19.074 1.00 0.00 H ATOM 8081 N PRO B 89 -20.061 2.764 16.631 1.00 9.30 N ATOM 8082 CA PRO B 89 -18.842 2.137 16.169 1.00 9.69 C ATOM 8083 C PRO B 89 -17.769 2.073 17.271 1.00 9.87 C ATOM 8084 O PRO B 89 -16.890 1.240 17.204 1.00 8.60 O ATOM 8085 CB PRO B 89 -18.336 3.018 15.020 1.00 9.48 C ATOM 8086 CG PRO B 89 -19.265 4.210 14.894 1.00 12.66 C ATOM 8087 CD PRO B 89 -20.472 3.893 15.735 1.00 4.98 C ATOM 8088 HA PRO B 89 -19.038 1.109 15.865 1.00 0.00 H ATOM 8089 HD3 PRO B 89 -20.761 4.761 16.327 1.00 0.00 H ATOM 8090 HD2 PRO B 89 -21.307 3.591 15.103 1.00 0.00 H ATOM 8091 HG3 PRO B 89 -19.556 4.354 13.854 1.00 0.00 H ATOM 8092 HG2 PRO B 89 -18.775 5.112 15.261 1.00 0.00 H ATOM 8093 HB2 PRO B 89 -17.323 3.360 15.235 1.00 0.00 H ATOM 8094 HB3 PRO B 89 -18.337 2.449 14.090 1.00 0.00 H ATOM 8095 N GLU B 90 -17.840 2.938 18.280 1.00 8.57 N ATOM 8096 CA GLU B 90 -16.909 2.919 19.372 1.00 7.04 C ATOM 8097 C GLU B 90 -16.929 1.546 20.053 1.00 10.63 C ATOM 8098 O GLU B 90 -15.918 0.997 20.446 1.00 8.04 O ATOM 8099 CB GLU B 90 -17.351 3.851 20.505 1.00 8.24 C ATOM 8100 CG GLU B 90 -17.003 5.310 20.235 1.00 3.45 C ATOM 8101 CD GLU B 90 -18.141 6.010 19.544 1.00 10.88 C ATOM 8102 OE1 GLU B 90 -18.746 5.540 18.604 1.00 12.33 O ATOM 8103 OE2 GLU B 90 -18.247 7.256 19.871 1.00 10.25 O ATOM 8104 HA GLU B 90 -15.946 3.197 18.944 1.00 0.00 H ATOM 8105 HB2 GLU B 90 -18.431 3.766 20.626 1.00 0.00 H ATOM 8106 HB3 GLU B 90 -16.858 3.539 21.426 1.00 0.00 H ATOM 8107 HG2 GLU B 90 -16.797 5.810 21.181 1.00 0.00 H ATOM 8108 HG3 GLU B 90 -16.117 5.355 19.601 1.00 0.00 H ATOM 8109 H GLU B 90 -18.596 3.652 18.277 1.00 0.00 H ATOM 8110 N GLY B 91 -18.108 1.000 20.218 1.00 8.50 N ATOM 8111 CA GLY B 91 -18.329 -0.289 20.866 1.00 11.01 C ATOM 8112 C GLY B 91 -17.800 -1.397 19.971 1.00 12.60 C ATOM 8113 O GLY B 91 -17.250 -2.399 20.412 1.00 10.06 O ATOM 8114 HA3 GLY B 91 -19.396 -0.434 21.034 1.00 0.00 H ATOM 8115 HA2 GLY B 91 -17.805 -0.311 21.822 1.00 0.00 H ATOM 8116 H GLY B 91 -18.939 1.517 19.865 1.00 0.00 H ATOM 8117 N LEU B 92 -17.980 -1.251 18.663 1.00 3.93 N ATOM 8118 CA LEU B 92 -17.471 -2.270 17.781 1.00 4.68 C ATOM 8119 C LEU B 92 -15.937 -2.281 17.887 1.00 7.55 C ATOM 8120 O LEU B 92 -15.287 -3.322 17.910 1.00 9.36 O ATOM 8121 CB LEU B 92 -17.860 -1.919 16.302 1.00 9.79 C ATOM 8122 CG LEU B 92 -17.230 -2.938 15.335 1.00 14.90 C ATOM 8123 CD1 LEU B 92 -17.984 -4.254 15.527 1.00 16.61 C ATOM 8124 CD2 LEU B 92 -17.400 -2.480 13.906 1.00 44.12 C ATOM 8125 HA LEU B 92 -17.887 -3.239 18.055 1.00 0.00 H ATOM 8126 HB2 LEU B 92 -18.945 -1.945 16.198 1.00 0.00 H ATOM 8127 HB3 LEU B 92 -17.497 -0.920 16.061 1.00 0.00 H ATOM 8128 HG LEU B 92 -16.165 -3.048 15.537 1.00 0.00 H ATOM 8129 HD21 LEU B 92 -18.462 -2.384 13.680 1.00 0.00 H ATOM 8130 HD22 LEU B 92 -16.911 -1.515 13.775 1.00 0.00 H ATOM 8131 HD23 LEU B 92 -16.949 -3.211 13.235 1.00 0.00 H ATOM 8132 HD11 LEU B 92 -17.879 -4.584 16.560 1.00 0.00 H ATOM 8133 HD12 LEU B 92 -19.039 -4.104 15.298 1.00 0.00 H ATOM 8134 HD13 LEU B 92 -17.570 -5.009 14.859 1.00 0.00 H ATOM 8135 H LEU B 92 -18.477 -0.420 18.284 1.00 0.00 H ATOM 8136 N PHE B 93 -15.307 -1.113 18.014 1.00 11.76 N ATOM 8137 CA PHE B 93 -13.853 -1.079 18.139 1.00 9.44 C ATOM 8138 C PHE B 93 -13.414 -1.835 19.409 1.00 5.62 C ATOM 8139 O PHE B 93 -12.508 -2.647 19.409 1.00 4.01 O ATOM 8140 CB PHE B 93 -13.442 0.382 18.150 1.00 8.68 C ATOM 8141 CG PHE B 93 -11.980 0.534 18.301 1.00 3.21 C ATOM 8142 CD1 PHE B 93 -11.116 0.332 17.227 1.00 11.53 C ATOM 8143 CD2 PHE B 93 -11.415 0.898 19.526 1.00 11.59 C ATOM 8144 CE1 PHE B 93 -9.735 0.466 17.361 1.00 12.00 C ATOM 8145 CE2 PHE B 93 -10.035 1.041 19.666 1.00 12.29 C ATOM 8146 CZ PHE B 93 -9.185 0.817 18.590 1.00 10.50 C ATOM 8147 HA PHE B 93 -13.361 -1.581 17.306 1.00 0.00 H ATOM 8148 HB2 PHE B 93 -13.751 0.844 17.212 1.00 0.00 H ATOM 8149 HB3 PHE B 93 -13.938 0.883 18.981 1.00 0.00 H ATOM 8150 HD2 PHE B 93 -12.063 1.073 20.385 1.00 0.00 H ATOM 8151 HE2 PHE B 93 -9.618 1.332 20.630 1.00 0.00 H ATOM 8152 HZ PHE B 93 -8.106 0.915 18.707 1.00 0.00 H ATOM 8153 HE1 PHE B 93 -9.085 0.296 16.502 1.00 0.00 H ATOM 8154 HD1 PHE B 93 -11.531 0.062 16.256 1.00 0.00 H ATOM 8155 H PHE B 93 -15.851 -0.227 18.024 1.00 0.00 H ATOM 8156 N TRP B 94 -14.068 -1.578 20.526 1.00 5.77 N ATOM 8157 CA TRP B 94 -13.695 -2.306 21.767 1.00 6.26 C ATOM 8158 C TRP B 94 -13.802 -3.799 21.590 1.00 11.13 C ATOM 8159 O TRP B 94 -12.920 -4.593 22.007 1.00 12.08 O ATOM 8160 CB TRP B 94 -14.650 -1.900 22.855 1.00 6.91 C ATOM 8161 CG TRP B 94 -14.260 -2.485 24.170 1.00 6.98 C ATOM 8162 CD1 TRP B 94 -14.482 -3.755 24.662 1.00 10.53 C ATOM 8163 CD2 TRP B 94 -13.550 -1.776 25.168 1.00 9.24 C ATOM 8164 NE1 TRP B 94 -13.989 -3.897 25.946 1.00 9.29 N ATOM 8165 CE2 TRP B 94 -13.411 -2.667 26.271 1.00 4.55 C ATOM 8166 CE3 TRP B 94 -13.082 -0.442 25.256 1.00 6.82 C ATOM 8167 CZ2 TRP B 94 -12.736 -2.235 27.419 1.00 13.53 C ATOM 8168 CZ3 TRP B 94 -12.412 -0.019 26.417 1.00 9.38 C ATOM 8169 CH2 TRP B 94 -12.254 -0.921 27.493 1.00 15.22 C ATOM 8170 HA TRP B 94 -12.663 -2.057 22.014 1.00 0.00 H ATOM 8171 HB2 TRP B 94 -14.653 -0.813 22.937 1.00 0.00 H ATOM 8172 HB3 TRP B 94 -15.651 -2.246 22.596 1.00 0.00 H ATOM 8173 HE1 TRP B 94 -14.038 -4.745 26.546 1.00 0.00 H ATOM 8174 HD1 TRP B 94 -14.984 -4.548 24.107 1.00 0.00 H ATOM 8175 HZ2 TRP B 94 -12.586 -2.919 28.254 1.00 0.00 H ATOM 8176 HH2 TRP B 94 -11.747 -0.588 28.399 1.00 0.00 H ATOM 8177 HZ3 TRP B 94 -12.018 0.995 26.487 1.00 0.00 H ATOM 8178 HE3 TRP B 94 -13.240 0.251 24.430 1.00 0.00 H ATOM 8179 H TRP B 94 -14.834 -0.875 20.538 1.00 0.00 H ATOM 8180 N LEU B 95 -14.884 -4.225 20.937 1.00 8.49 N ATOM 8181 CA LEU B 95 -15.059 -5.650 20.729 1.00 4.79 C ATOM 8182 C LEU B 95 -13.943 -6.236 19.896 1.00 7.55 C ATOM 8183 O LEU B 95 -13.411 -7.306 20.179 1.00 11.98 O ATOM 8184 CB LEU B 95 -16.420 -5.897 20.020 1.00 4.52 C ATOM 8185 CG LEU B 95 -16.617 -7.294 19.395 1.00 10.26 C ATOM 8186 CD1 LEU B 95 -16.832 -8.307 20.516 1.00 9.27 C ATOM 8187 CD2 LEU B 95 -17.939 -7.327 18.642 1.00 10.27 C ATOM 8188 HA LEU B 95 -15.041 -6.141 21.702 1.00 0.00 H ATOM 8189 HB2 LEU B 95 -17.211 -5.746 20.755 1.00 0.00 H ATOM 8190 HB3 LEU B 95 -16.520 -5.159 19.224 1.00 0.00 H ATOM 8191 HG LEU B 95 -15.754 -7.509 18.764 1.00 0.00 H ATOM 8192 HD21 LEU B 95 -18.755 -7.118 19.334 1.00 0.00 H ATOM 8193 HD22 LEU B 95 -17.926 -6.573 17.855 1.00 0.00 H ATOM 8194 HD23 LEU B 95 -18.079 -8.313 18.200 1.00 0.00 H ATOM 8195 HD11 LEU B 95 -15.960 -8.313 21.170 1.00 0.00 H ATOM 8196 HD12 LEU B 95 -17.716 -8.030 21.090 1.00 0.00 H ATOM 8197 HD13 LEU B 95 -16.972 -9.299 20.086 1.00 0.00 H ATOM 8198 H LEU B 95 -15.590 -3.548 20.583 1.00 0.00 H ATOM 8199 N LEU B 96 -13.554 -5.513 18.801 1.00 7.80 N ATOM 8200 CA LEU B 96 -12.525 -6.044 17.906 1.00 5.66 C ATOM 8201 C LEU B 96 -11.195 -6.137 18.611 1.00 11.23 C ATOM 8202 O LEU B 96 -10.467 -7.078 18.440 1.00 10.82 O ATOM 8203 CB LEU B 96 -12.222 -5.135 16.673 1.00 4.61 C ATOM 8204 CG LEU B 96 -13.398 -4.957 15.715 1.00 11.38 C ATOM 8205 CD1 LEU B 96 -12.941 -4.088 14.539 1.00 13.55 C ATOM 8206 CD2 LEU B 96 -13.834 -6.315 15.166 1.00 21.60 C ATOM 8207 HA LEU B 96 -12.931 -7.005 17.591 1.00 0.00 H ATOM 8208 HB2 LEU B 96 -11.928 -4.151 17.039 1.00 0.00 H ATOM 8209 HB3 LEU B 96 -11.394 -5.577 16.118 1.00 0.00 H ATOM 8210 HG LEU B 96 -14.229 -4.492 16.245 1.00 0.00 H ATOM 8211 HD21 LEU B 96 -13.002 -6.774 14.632 1.00 0.00 H ATOM 8212 HD22 LEU B 96 -14.137 -6.959 15.992 1.00 0.00 H ATOM 8213 HD23 LEU B 96 -14.673 -6.177 14.484 1.00 0.00 H ATOM 8214 HD11 LEU B 96 -12.614 -3.117 14.912 1.00 0.00 H ATOM 8215 HD12 LEU B 96 -12.114 -4.579 14.026 1.00 0.00 H ATOM 8216 HD13 LEU B 96 -13.771 -3.952 13.846 1.00 0.00 H ATOM 8217 H LEU B 96 -13.989 -4.589 18.605 1.00 0.00 H ATOM 8218 N VAL B 97 -10.888 -5.106 19.374 1.00 11.28 N ATOM 8219 CA VAL B 97 -9.626 -5.102 20.039 1.00 6.59 C ATOM 8220 C VAL B 97 -9.517 -6.079 21.205 1.00 7.21 C ATOM 8221 O VAL B 97 -8.489 -6.730 21.326 1.00 7.95 O ATOM 8222 CB VAL B 97 -9.440 -3.696 20.543 1.00 16.27 C ATOM 8223 CG1 VAL B 97 -8.473 -3.749 21.688 1.00 21.95 C ATOM 8224 CG2 VAL B 97 -8.858 -2.889 19.400 1.00 17.75 C ATOM 8225 HA VAL B 97 -8.859 -5.425 19.335 1.00 0.00 H ATOM 8226 HB VAL B 97 -10.374 -3.245 20.879 1.00 0.00 H ATOM 8227 HG11 VAL B 97 -8.878 -4.385 22.475 1.00 0.00 H ATOM 8228 HG12 VAL B 97 -7.524 -4.158 21.342 1.00 0.00 H ATOM 8229 HG13 VAL B 97 -8.317 -2.743 22.077 1.00 0.00 H ATOM 8230 HG21 VAL B 97 -7.903 -3.321 19.101 1.00 0.00 H ATOM 8231 HG22 VAL B 97 -9.547 -2.908 18.556 1.00 0.00 H ATOM 8232 HG23 VAL B 97 -8.707 -1.859 19.724 1.00 0.00 H ATOM 8233 H VAL B 97 -11.551 -4.313 19.488 1.00 0.00 H ATOM 8234 N THR B 98 -10.529 -6.165 22.054 1.00 7.77 N ATOM 8235 CA THR B 98 -10.484 -7.086 23.230 1.00 3.88 C ATOM 8236 C THR B 98 -11.198 -8.408 23.049 1.00 17.79 C ATOM 8237 O THR B 98 -10.963 -9.332 23.818 1.00 15.58 O ATOM 8238 CB THR B 98 -11.204 -6.414 24.409 1.00 6.72 C ATOM 8239 OG1 THR B 98 -12.625 -6.376 24.171 1.00 5.92 O ATOM 8240 CG2 THR B 98 -10.651 -5.024 24.696 1.00 14.70 C ATOM 8241 HA THR B 98 -9.423 -7.283 23.382 1.00 0.00 H ATOM 8242 HB THR B 98 -11.019 -7.014 25.300 1.00 0.00 H ATOM 8243 HG1 THR B 98 -12.806 -5.861 23.345 1.00 0.00 H ATOM 8244 HG23 THR B 98 -9.577 -5.091 24.871 1.00 0.00 H ATOM 8245 HG21 THR B 98 -10.842 -4.375 23.841 1.00 0.00 H ATOM 8246 HG22 THR B 98 -11.140 -4.615 25.581 1.00 0.00 H ATOM 8247 H THR B 98 -11.374 -5.579 21.899 1.00 0.00 H ATOM 8248 N GLY B 99 -12.097 -8.515 22.072 1.00 8.92 N ATOM 8249 CA GLY B 99 -12.814 -9.757 21.898 1.00 6.44 C ATOM 8250 C GLY B 99 -13.985 -9.816 22.878 1.00 8.92 C ATOM 8251 O GLY B 99 -14.675 -10.829 22.969 1.00 18.43 O ATOM 8252 HA3 GLY B 99 -12.141 -10.594 22.086 1.00 0.00 H ATOM 8253 HA2 GLY B 99 -13.192 -9.818 20.877 1.00 0.00 H ATOM 8254 H GLY B 99 -12.281 -7.711 21.439 1.00 0.00 H ATOM 8255 N GLN B 100 -14.237 -8.742 23.635 1.00 12.05 N ATOM 8256 CA GLN B 100 -15.345 -8.773 24.552 1.00 11.20 C ATOM 8257 C GLN B 100 -16.245 -7.615 24.237 1.00 10.00 C ATOM 8258 O GLN B 100 -15.742 -6.551 23.865 1.00 12.65 O ATOM 8259 CB GLN B 100 -14.949 -8.488 26.016 1.00 14.93 C ATOM 8260 CG GLN B 100 -13.838 -9.350 26.625 1.00 37.45 C ATOM 8261 CD GLN B 100 -13.300 -8.617 27.837 1.00 80.00 C ATOM 8262 OE1 GLN B 100 -13.684 -7.448 28.091 1.00 80.00 O ATOM 8263 NE2 GLN B 100 -12.398 -9.280 28.563 1.00 80.00 N ATOM 8264 HA GLN B 100 -15.779 -9.768 24.449 1.00 0.00 H ATOM 8265 HB2 GLN B 100 -14.625 -7.449 26.071 1.00 0.00 H ATOM 8266 HB3 GLN B 100 -15.841 -8.622 26.629 1.00 0.00 H ATOM 8267 HG2 GLN B 100 -14.240 -10.318 26.924 1.00 0.00 H ATOM 8268 HG3 GLN B 100 -13.041 -9.499 25.896 1.00 0.00 H ATOM 8269 HE22 GLN B 100 -12.125 -10.247 28.296 1.00 0.00 H ATOM 8270 HE21 GLN B 100 -11.968 -8.829 29.396 1.00 0.00 H ATOM 8271 H GLN B 100 -13.639 -7.894 23.561 1.00 0.00 H ATOM 8272 N ILE B 101 -17.540 -7.873 24.465 1.00 8.15 N ATOM 8273 CA ILE B 101 -18.630 -6.895 24.291 1.00 14.99 C ATOM 8274 C ILE B 101 -18.447 -5.860 25.382 1.00 12.38 C ATOM 8275 O ILE B 101 -18.351 -6.178 26.583 1.00 16.41 O ATOM 8276 CB ILE B 101 -20.016 -7.518 24.405 1.00 25.84 C ATOM 8277 CG1 ILE B 101 -20.195 -8.517 23.255 1.00 26.18 C ATOM 8278 CG2 ILE B 101 -21.101 -6.425 24.345 1.00 19.29 C ATOM 8279 CD1 ILE B 101 -21.291 -8.087 22.289 1.00 78.75 C ATOM 8280 HA ILE B 101 -18.576 -6.468 23.289 1.00 0.00 H ATOM 8281 HB ILE B 101 -20.114 -8.034 25.360 1.00 0.00 H ATOM 8282 HG12 ILE B 101 -19.255 -8.596 22.708 1.00 0.00 H ATOM 8283 HG13 ILE B 101 -20.455 -9.490 23.671 1.00 0.00 H ATOM 8284 HD11 ILE B 101 -22.237 -8.012 22.825 1.00 0.00 H ATOM 8285 HD12 ILE B 101 -21.036 -7.117 21.861 1.00 0.00 H ATOM 8286 HD13 ILE B 101 -21.381 -8.825 21.492 1.00 0.00 H ATOM 8287 HG21 ILE B 101 -20.956 -5.725 25.168 1.00 0.00 H ATOM 8288 HG22 ILE B 101 -21.027 -5.893 23.397 1.00 0.00 H ATOM 8289 HG23 ILE B 101 -22.085 -6.887 24.428 1.00 0.00 H ATOM 8290 H ILE B 101 -17.794 -8.829 24.787 1.00 0.00 H ATOM 8291 N PRO B 102 -18.370 -4.621 24.996 1.00 6.10 N ATOM 8292 CA PRO B 102 -18.140 -3.631 26.033 1.00 10.51 C ATOM 8293 C PRO B 102 -19.374 -3.142 26.713 1.00 15.91 C ATOM 8294 O PRO B 102 -20.479 -3.347 26.225 1.00 11.78 O ATOM 8295 CB PRO B 102 -17.646 -2.360 25.316 1.00 14.21 C ATOM 8296 CG PRO B 102 -18.268 -2.452 23.930 1.00 10.12 C ATOM 8297 CD PRO B 102 -18.479 -3.947 23.661 1.00 10.92 C ATOM 8298 HA PRO B 102 -17.475 -4.102 26.757 1.00 0.00 H ATOM 8299 HD3 PRO B 102 -19.464 -4.120 23.227 1.00 0.00 H ATOM 8300 HD2 PRO B 102 -17.714 -4.323 22.982 1.00 0.00 H ATOM 8301 HG3 PRO B 102 -17.598 -2.023 23.185 1.00 0.00 H ATOM 8302 HG2 PRO B 102 -19.221 -1.924 23.906 1.00 0.00 H ATOM 8303 HB2 PRO B 102 -17.987 -1.465 25.835 1.00 0.00 H ATOM 8304 HB3 PRO B 102 -16.558 -2.349 25.253 1.00 0.00 H ATOM 8305 N THR B 103 -19.143 -2.471 27.855 1.00 12.13 N ATOM 8306 CA THR B 103 -20.231 -1.874 28.623 1.00 19.31 C ATOM 8307 C THR B 103 -20.461 -0.487 28.045 1.00 19.38 C ATOM 8308 O THR B 103 -19.643 0.050 27.315 1.00 14.81 O ATOM 8309 CB THR B 103 -19.992 -1.789 30.128 1.00 14.24 C ATOM 8310 OG1 THR B 103 -18.959 -0.825 30.345 1.00 15.40 O ATOM 8311 CG2 THR B 103 -19.609 -3.189 30.617 1.00 7.92 C ATOM 8312 HA THR B 103 -21.102 -2.523 28.531 1.00 0.00 H ATOM 8313 HB THR B 103 -20.873 -1.470 30.684 1.00 0.00 H ATOM 8314 HG1 THR B 103 -18.781 -0.747 31.316 1.00 0.00 H ATOM 8315 HG23 THR B 103 -20.432 -3.877 30.425 1.00 0.00 H ATOM 8316 HG21 THR B 103 -18.720 -3.527 30.085 1.00 0.00 H ATOM 8317 HG22 THR B 103 -19.403 -3.155 31.687 1.00 0.00 H ATOM 8318 H THR B 103 -18.166 -2.375 28.199 1.00 0.00 H ATOM 8319 N PRO B 104 -21.586 0.110 28.364 1.00 14.54 N ATOM 8320 CA PRO B 104 -21.829 1.421 27.821 1.00 18.48 C ATOM 8321 C PRO B 104 -20.849 2.381 28.445 1.00 12.98 C ATOM 8322 O PRO B 104 -20.455 3.392 27.893 1.00 13.44 O ATOM 8323 CB PRO B 104 -23.272 1.792 28.170 1.00 19.41 C ATOM 8324 CG PRO B 104 -23.917 0.500 28.644 1.00 29.50 C ATOM 8325 CD PRO B 104 -22.841 -0.587 28.673 1.00 16.39 C ATOM 8326 HA PRO B 104 -21.697 1.454 26.739 1.00 0.00 H ATOM 8327 HD3 PRO B 104 -22.790 -1.049 29.659 1.00 0.00 H ATOM 8328 HD2 PRO B 104 -23.049 -1.352 27.925 1.00 0.00 H ATOM 8329 HG3 PRO B 104 -24.715 0.212 27.959 1.00 0.00 H ATOM 8330 HG2 PRO B 104 -24.330 0.638 29.643 1.00 0.00 H ATOM 8331 HB2 PRO B 104 -23.293 2.542 28.961 1.00 0.00 H ATOM 8332 HB3 PRO B 104 -23.790 2.178 27.292 1.00 0.00 H ATOM 8333 N GLU B 105 -20.425 2.030 29.655 1.00 12.23 N ATOM 8334 CA GLU B 105 -19.483 2.899 30.303 1.00 12.02 C ATOM 8335 C GLU B 105 -18.162 2.899 29.537 1.00 14.81 C ATOM 8336 O GLU B 105 -17.529 3.926 29.327 1.00 15.51 O ATOM 8337 CB GLU B 105 -19.265 2.486 31.772 1.00 12.58 C ATOM 8338 CG GLU B 105 -20.399 2.993 32.647 1.00 24.87 C ATOM 8339 CD GLU B 105 -21.662 2.171 32.507 1.00 30.78 C ATOM 8340 OE1 GLU B 105 -21.424 0.879 32.256 1.00 27.32 O ATOM 8341 OE2 GLU B 105 -22.778 2.666 32.678 1.00 34.73 O ATOM 8342 HA GLU B 105 -19.889 3.910 30.303 1.00 0.00 H ATOM 8343 HB2 GLU B 105 -19.222 1.399 31.836 1.00 0.00 H ATOM 8344 HB3 GLU B 105 -18.324 2.907 32.126 1.00 0.00 H ATOM 8345 HG2 GLU B 105 -20.077 2.962 33.688 1.00 0.00 H ATOM 8346 HG3 GLU B 105 -20.621 4.023 32.367 1.00 0.00 H ATOM 8347 H GLU B 105 -20.762 1.160 30.114 1.00 0.00 H ATOM 8348 N GLN B 106 -17.768 1.707 29.143 1.00 9.78 N ATOM 8349 CA GLN B 106 -16.525 1.571 28.397 1.00 8.77 C ATOM 8350 C GLN B 106 -16.634 2.267 27.054 1.00 16.65 C ATOM 8351 O GLN B 106 -15.663 2.857 26.585 1.00 15.15 O ATOM 8352 CB GLN B 106 -16.274 0.102 28.189 1.00 5.98 C ATOM 8353 CG GLN B 106 -15.535 -0.455 29.434 1.00 8.67 C ATOM 8354 CD GLN B 106 -15.694 -1.941 29.561 1.00 16.61 C ATOM 8355 OE1 GLN B 106 -15.112 -2.535 30.456 1.00 30.98 O ATOM 8356 NE2 GLN B 106 -16.421 -2.582 28.678 1.00 10.01 N ATOM 8357 HA GLN B 106 -15.705 2.029 28.950 1.00 0.00 H ATOM 8358 HB2 GLN B 106 -17.223 -0.419 28.062 1.00 0.00 H ATOM 8359 HB3 GLN B 106 -15.659 -0.044 27.301 1.00 0.00 H ATOM 8360 HG2 GLN B 106 -14.474 -0.220 29.349 1.00 0.00 H ATOM 8361 HG3 GLN B 106 -15.941 0.021 30.327 1.00 0.00 H ATOM 8362 HE22 GLN B 106 -16.908 -2.056 27.925 1.00 0.00 H ATOM 8363 HE21 GLN B 106 -16.511 -3.617 28.731 1.00 0.00 H ATOM 8364 H GLN B 106 -18.341 0.867 29.363 1.00 0.00 H ATOM 8365 N VAL B 107 -17.839 2.194 26.465 1.00 10.39 N ATOM 8366 CA VAL B 107 -18.082 2.814 25.182 1.00 13.40 C ATOM 8367 C VAL B 107 -17.944 4.320 25.320 1.00 17.77 C ATOM 8368 O VAL B 107 -17.316 5.032 24.527 1.00 11.82 O ATOM 8369 CB VAL B 107 -19.430 2.366 24.628 1.00 16.03 C ATOM 8370 CG1 VAL B 107 -19.868 3.216 23.458 1.00 17.09 C ATOM 8371 CG2 VAL B 107 -19.371 0.940 24.125 1.00 14.67 C ATOM 8372 HA VAL B 107 -17.339 2.494 24.451 1.00 0.00 H ATOM 8373 HB VAL B 107 -20.134 2.462 25.455 1.00 0.00 H ATOM 8374 HG11 VAL B 107 -19.957 4.254 23.778 1.00 0.00 H ATOM 8375 HG12 VAL B 107 -19.129 3.143 22.660 1.00 0.00 H ATOM 8376 HG13 VAL B 107 -20.833 2.862 23.095 1.00 0.00 H ATOM 8377 HG21 VAL B 107 -18.627 0.866 23.331 1.00 0.00 H ATOM 8378 HG22 VAL B 107 -19.095 0.278 24.946 1.00 0.00 H ATOM 8379 HG23 VAL B 107 -20.348 0.652 23.737 1.00 0.00 H ATOM 8380 H VAL B 107 -18.610 1.683 26.940 1.00 0.00 H ATOM 8381 N SER B 108 -18.501 4.896 26.364 1.00 9.67 N ATOM 8382 CA SER B 108 -18.319 6.355 26.445 1.00 13.16 C ATOM 8383 C SER B 108 -16.879 6.780 26.703 1.00 8.12 C ATOM 8384 O SER B 108 -16.409 7.910 26.424 1.00 10.21 O ATOM 8385 CB SER B 108 -19.275 7.021 27.416 1.00 26.21 C ATOM 8386 OG SER B 108 -19.364 6.136 28.474 1.00 37.74 O ATOM 8387 HA SER B 108 -18.572 6.715 25.448 1.00 0.00 H ATOM 8388 HB2 SER B 108 -20.251 7.171 26.955 1.00 0.00 H ATOM 8389 HB3 SER B 108 -18.881 7.981 27.748 1.00 0.00 H ATOM 8390 HG SER B 108 -19.712 5.268 28.148 1.00 0.00 H ATOM 8391 H SER B 108 -19.031 4.360 27.080 1.00 0.00 H ATOM 8392 N TRP B 109 -16.095 5.849 27.259 1.00 13.21 N ATOM 8393 CA TRP B 109 -14.710 6.266 27.468 1.00 10.70 C ATOM 8394 C TRP B 109 -14.051 6.402 26.107 1.00 9.80 C ATOM 8395 O TRP B 109 -13.309 7.351 25.849 1.00 11.14 O ATOM 8396 CB TRP B 109 -13.994 5.160 28.271 1.00 9.82 C ATOM 8397 CG TRP B 109 -12.557 5.464 28.394 1.00 13.32 C ATOM 8398 CD1 TRP B 109 -11.987 6.274 29.276 1.00 12.48 C ATOM 8399 CD2 TRP B 109 -11.519 4.931 27.559 1.00 7.91 C ATOM 8400 NE1 TRP B 109 -10.628 6.301 29.069 1.00 14.48 N ATOM 8401 CE2 TRP B 109 -10.300 5.457 28.031 1.00 12.92 C ATOM 8402 CE3 TRP B 109 -11.536 4.049 26.479 1.00 9.66 C ATOM 8403 CZ2 TRP B 109 -9.069 5.144 27.427 1.00 11.17 C ATOM 8404 CZ3 TRP B 109 -10.326 3.731 25.892 1.00 14.90 C ATOM 8405 CH2 TRP B 109 -9.120 4.269 26.378 1.00 13.97 C ATOM 8406 HA TRP B 109 -14.659 7.212 28.006 1.00 0.00 H ATOM 8407 HB2 TRP B 109 -14.434 5.096 29.266 1.00 0.00 H ATOM 8408 HB3 TRP B 109 -14.117 4.206 27.758 1.00 0.00 H ATOM 8409 HE1 TRP B 109 -9.950 6.872 29.614 1.00 0.00 H ATOM 8410 HD1 TRP B 109 -12.516 6.833 30.048 1.00 0.00 H ATOM 8411 HZ2 TRP B 109 -8.130 5.574 27.775 1.00 0.00 H ATOM 8412 HH2 TRP B 109 -8.187 3.976 25.898 1.00 0.00 H ATOM 8413 HZ3 TRP B 109 -10.305 3.053 25.039 1.00 0.00 H ATOM 8414 HE3 TRP B 109 -12.470 3.625 26.111 1.00 0.00 H ATOM 8415 H TRP B 109 -16.443 4.905 27.521 1.00 0.00 H ATOM 8416 N VAL B 110 -14.360 5.471 25.210 1.00 6.66 N ATOM 8417 CA VAL B 110 -13.759 5.509 23.850 1.00 5.65 C ATOM 8418 C VAL B 110 -14.121 6.842 23.185 1.00 10.96 C ATOM 8419 O VAL B 110 -13.275 7.533 22.625 1.00 5.20 O ATOM 8420 CB VAL B 110 -14.175 4.318 22.988 1.00 10.09 C ATOM 8421 CG1 VAL B 110 -13.542 4.417 21.593 1.00 8.12 C ATOM 8422 CG2 VAL B 110 -13.763 3.005 23.666 1.00 12.77 C ATOM 8423 HA VAL B 110 -12.676 5.432 23.949 1.00 0.00 H ATOM 8424 HB VAL B 110 -15.259 4.332 22.877 1.00 0.00 H ATOM 8425 HG11 VAL B 110 -13.872 5.337 21.110 1.00 0.00 H ATOM 8426 HG12 VAL B 110 -12.456 4.424 21.688 1.00 0.00 H ATOM 8427 HG13 VAL B 110 -13.850 3.560 20.994 1.00 0.00 H ATOM 8428 HG21 VAL B 110 -12.681 2.990 23.799 1.00 0.00 H ATOM 8429 HG22 VAL B 110 -14.251 2.931 24.638 1.00 0.00 H ATOM 8430 HG23 VAL B 110 -14.065 2.165 23.041 1.00 0.00 H ATOM 8431 H VAL B 110 -15.025 4.712 25.460 1.00 0.00 H ATOM 8432 N SER B 111 -15.416 7.175 23.293 1.00 8.74 N ATOM 8433 CA SER B 111 -15.906 8.406 22.723 1.00 11.88 C ATOM 8434 C SER B 111 -15.170 9.612 23.237 1.00 12.70 C ATOM 8435 O SER B 111 -14.852 10.520 22.494 1.00 13.08 O ATOM 8436 CB SER B 111 -17.368 8.668 22.998 1.00 13.13 C ATOM 8437 OG SER B 111 -18.169 7.652 22.493 1.00 10.36 O ATOM 8438 HA SER B 111 -15.745 8.264 21.654 1.00 0.00 H ATOM 8439 HB2 SER B 111 -17.654 9.610 22.531 1.00 0.00 H ATOM 8440 HB3 SER B 111 -17.520 8.737 24.075 1.00 0.00 H ATOM 8441 HG SER B 111 -18.040 7.587 21.514 1.00 0.00 H ATOM 8442 H SER B 111 -16.072 6.540 23.792 1.00 0.00 H ATOM 8443 N LYS B 112 -14.913 9.681 24.536 1.00 7.63 N ATOM 8444 CA LYS B 112 -14.195 10.840 25.057 1.00 9.96 C ATOM 8445 C LYS B 112 -12.721 10.838 24.633 1.00 9.66 C ATOM 8446 O LYS B 112 -12.142 11.890 24.307 1.00 14.67 O ATOM 8447 CB LYS B 112 -14.228 10.894 26.589 1.00 16.57 C ATOM 8448 CG LYS B 112 -15.408 11.650 27.184 1.00 41.21 C ATOM 8449 CD LYS B 112 -16.038 10.976 28.399 1.00 52.85 C ATOM 8450 CE LYS B 112 -15.088 10.090 29.205 1.00 80.00 C ATOM 8451 NZ LYS B 112 -15.767 8.993 29.938 1.00 35.98 N ATOM 8452 HA LYS B 112 -14.706 11.708 24.640 1.00 0.00 H ATOM 8453 HB2 LYS B 112 -14.260 9.870 26.963 1.00 0.00 H ATOM 8454 HB3 LYS B 112 -13.312 11.376 26.930 1.00 0.00 H ATOM 8455 HG2 LYS B 112 -15.064 12.640 27.483 1.00 0.00 H ATOM 8456 HG3 LYS B 112 -16.173 11.750 26.414 1.00 0.00 H ATOM 8457 HD2 LYS B 112 -16.419 11.755 29.060 1.00 0.00 H ATOM 8458 HD3 LYS B 112 -16.867 10.358 28.053 1.00 0.00 H ATOM 8459 HE2 LYS B 112 -14.566 10.715 29.929 1.00 0.00 H ATOM 8460 HE3 LYS B 112 -14.365 9.649 28.519 1.00 0.00 H ATOM 8461 HZ1 LYS B 112 -16.454 9.397 30.606 1.00 0.00 H ATOM 8462 HZ2 LYS B 112 -16.262 8.379 29.260 1.00 0.00 H ATOM 8463 HZ3 LYS B 112 -15.060 8.437 30.460 1.00 0.00 H ATOM 8464 H LYS B 112 -15.219 8.920 25.175 1.00 0.00 H ATOM 8465 N GLU B 113 -12.117 9.626 24.617 1.00 10.11 N ATOM 8466 CA GLU B 113 -10.742 9.535 24.222 1.00 6.73 C ATOM 8467 C GLU B 113 -10.582 10.031 22.803 1.00 10.64 C ATOM 8468 O GLU B 113 -9.651 10.742 22.482 1.00 10.52 O ATOM 8469 CB GLU B 113 -10.297 8.067 24.341 1.00 10.74 C ATOM 8470 CG GLU B 113 -8.788 7.918 24.561 1.00 24.26 C ATOM 8471 CD GLU B 113 -8.224 8.735 25.694 1.00 14.82 C ATOM 8472 OE1 GLU B 113 -8.777 8.874 26.749 1.00 19.72 O ATOM 8473 OE2 GLU B 113 -7.056 9.251 25.463 1.00 26.86 O ATOM 8474 HA GLU B 113 -10.120 10.155 24.868 1.00 0.00 H ATOM 8475 HB2 GLU B 113 -10.818 7.612 25.183 1.00 0.00 H ATOM 8476 HB3 GLU B 113 -10.568 7.545 23.423 1.00 0.00 H ATOM 8477 HG2 GLU B 113 -8.578 6.868 24.764 1.00 0.00 H ATOM 8478 HG3 GLU B 113 -8.281 8.217 23.643 1.00 0.00 H ATOM 8479 H GLU B 113 -12.644 8.772 24.888 1.00 0.00 H ATOM 8480 N TRP B 114 -11.486 9.622 21.926 1.00 11.27 N ATOM 8481 CA TRP B 114 -11.391 10.041 20.538 1.00 14.91 C ATOM 8482 C TRP B 114 -11.685 11.534 20.382 1.00 13.80 C ATOM 8483 O TRP B 114 -11.162 12.195 19.488 1.00 20.96 O ATOM 8484 CB TRP B 114 -12.219 9.167 19.564 1.00 4.92 C ATOM 8485 CG TRP B 114 -11.732 7.738 19.403 1.00 5.35 C ATOM 8486 CD1 TRP B 114 -10.557 7.205 19.819 1.00 5.46 C ATOM 8487 CD2 TRP B 114 -12.463 6.686 18.778 1.00 6.32 C ATOM 8488 NE1 TRP B 114 -10.493 5.865 19.504 1.00 10.81 N ATOM 8489 CE2 TRP B 114 -11.661 5.531 18.881 1.00 9.16 C ATOM 8490 CE3 TRP B 114 -13.742 6.631 18.194 1.00 7.47 C ATOM 8491 CZ2 TRP B 114 -12.071 4.332 18.399 1.00 3.22 C ATOM 8492 CZ3 TRP B 114 -14.143 5.420 17.707 1.00 10.90 C ATOM 8493 CH2 TRP B 114 -13.320 4.270 17.809 1.00 14.32 C ATOM 8494 HA TRP B 114 -10.354 9.880 20.244 1.00 0.00 H ATOM 8495 HB2 TRP B 114 -13.245 9.134 19.929 1.00 0.00 H ATOM 8496 HB3 TRP B 114 -12.199 9.643 18.584 1.00 0.00 H ATOM 8497 HE1 TRP B 114 -9.699 5.224 19.705 1.00 0.00 H ATOM 8498 HD1 TRP B 114 -9.771 7.760 20.332 1.00 0.00 H ATOM 8499 HZ2 TRP B 114 -11.438 3.448 18.474 1.00 0.00 H ATOM 8500 HH2 TRP B 114 -13.679 3.319 17.415 1.00 0.00 H ATOM 8501 HZ3 TRP B 114 -15.119 5.335 17.229 1.00 0.00 H ATOM 8502 HE3 TRP B 114 -14.381 7.512 18.133 1.00 0.00 H ATOM 8503 H TRP B 114 -12.263 9.002 22.230 1.00 0.00 H ATOM 8504 N ALA B 115 -12.511 12.104 21.262 1.00 9.59 N ATOM 8505 CA ALA B 115 -12.785 13.513 21.095 1.00 7.51 C ATOM 8506 C ALA B 115 -11.579 14.299 21.574 1.00 18.41 C ATOM 8507 O ALA B 115 -11.248 15.360 21.027 1.00 15.09 O ATOM 8508 CB ALA B 115 -14.067 13.908 21.841 1.00 12.74 C ATOM 8509 HA ALA B 115 -12.956 13.742 20.043 1.00 0.00 H ATOM 8510 HB1 ALA B 115 -14.907 13.336 21.446 1.00 0.00 H ATOM 8511 HB2 ALA B 115 -13.948 13.695 22.903 1.00 0.00 H ATOM 8512 HB3 ALA B 115 -14.254 14.973 21.701 1.00 0.00 H ATOM 8513 H ALA B 115 -12.940 11.557 22.036 1.00 0.00 H ATOM 8514 N LYS B 116 -10.913 13.741 22.591 1.00 18.61 N ATOM 8515 CA LYS B 116 -9.740 14.351 23.189 1.00 10.63 C ATOM 8516 C LYS B 116 -8.550 14.384 22.273 1.00 16.10 C ATOM 8517 O LYS B 116 -7.757 15.307 22.325 1.00 17.07 O ATOM 8518 CB LYS B 116 -9.162 13.598 24.396 1.00 22.70 C ATOM 8519 CG LYS B 116 -10.123 13.396 25.545 1.00 48.12 C ATOM 8520 CD LYS B 116 -9.410 12.939 26.819 1.00 50.35 C ATOM 8521 CE LYS B 116 -9.626 11.477 27.264 1.00 80.00 C ATOM 8522 NZ LYS B 116 -10.888 10.768 26.907 1.00 80.00 N ATOM 8523 HA LYS B 116 -10.138 15.332 23.449 1.00 0.00 H ATOM 8524 HB2 LYS B 116 -8.831 12.617 24.056 1.00 0.00 H ATOM 8525 HB3 LYS B 116 -8.305 14.161 24.767 1.00 0.00 H ATOM 8526 HG2 LYS B 116 -10.633 14.338 25.746 1.00 0.00 H ATOM 8527 HG3 LYS B 116 -10.856 12.640 25.262 1.00 0.00 H ATOM 8528 HD2 LYS B 116 -8.340 13.080 26.665 1.00 0.00 H ATOM 8529 HD3 LYS B 116 -9.747 13.582 27.632 1.00 0.00 H ATOM 8530 HE2 LYS B 116 -9.555 11.465 28.352 1.00 0.00 H ATOM 8531 HE3 LYS B 116 -8.807 10.895 26.841 1.00 0.00 H ATOM 8532 HZ1 LYS B 116 -11.698 11.278 27.314 1.00 0.00 H ATOM 8533 HZ2 LYS B 116 -10.984 10.733 25.872 1.00 0.00 H ATOM 8534 HZ3 LYS B 116 -10.860 9.800 27.286 1.00 0.00 H ATOM 8535 H LYS B 116 -11.250 12.832 22.969 1.00 0.00 H ATOM 8536 N ARG B 117 -8.395 13.373 21.454 1.00 14.52 N ATOM 8537 CA ARG B 117 -7.253 13.273 20.547 1.00 6.39 C ATOM 8538 C ARG B 117 -7.404 13.878 19.174 1.00 12.08 C ATOM 8539 O ARG B 117 -6.415 13.834 18.462 1.00 15.44 O ATOM 8540 CB ARG B 117 -6.908 11.763 20.405 1.00 6.77 C ATOM 8541 CG ARG B 117 -6.558 11.102 21.733 1.00 11.98 C ATOM 8542 CD ARG B 117 -6.433 9.621 21.475 1.00 6.91 C ATOM 8543 NE ARG B 117 -5.964 8.891 22.648 1.00 10.59 N ATOM 8544 CZ ARG B 117 -4.759 8.321 22.829 1.00 20.33 C ATOM 8545 NH1 ARG B 117 -3.764 8.343 21.901 1.00 13.73 N ATOM 8546 NH2 ARG B 117 -4.549 7.704 24.005 1.00 11.03 N ATOM 8547 HA ARG B 117 -6.465 13.872 21.003 1.00 0.00 H ATOM 8548 HB2 ARG B 117 -7.769 11.249 19.978 1.00 0.00 H ATOM 8549 HB3 ARG B 117 -6.056 11.663 19.732 1.00 0.00 H ATOM 8550 HG2 ARG B 117 -5.614 11.497 22.110 1.00 0.00 H ATOM 8551 HG3 ARG B 117 -7.346 11.289 22.463 1.00 0.00 H ATOM 8552 HD2 ARG B 117 -5.726 9.466 20.660 1.00 0.00 H ATOM 8553 HD3 ARG B 117 -7.410 9.232 21.187 1.00 0.00 H ATOM 8554 HE ARG B 117 -6.639 8.801 23.434 1.00 0.00 H ATOM 8555 HH12 ARG B 117 -2.854 7.882 22.103 1.00 0.00 H ATOM 8556 HH11 ARG B 117 -3.914 8.820 20.989 1.00 0.00 H ATOM 8557 HH22 ARG B 117 -3.635 7.247 24.196 1.00 0.00 H ATOM 8558 HH21 ARG B 117 -5.301 7.684 24.723 1.00 0.00 H ATOM 8559 H ARG B 117 -9.108 12.616 21.449 1.00 0.00 H ATOM 8560 N ALA B 118 -8.588 14.401 18.794 1.00 11.50 N ATOM 8561 CA ALA B 118 -8.843 14.974 17.479 1.00 7.09 C ATOM 8562 C ALA B 118 -8.285 16.359 17.341 1.00 31.37 C ATOM 8563 O ALA B 118 -8.802 17.319 17.889 1.00 62.08 O ATOM 8564 CB ALA B 118 -10.392 15.045 17.296 1.00 5.03 C ATOM 8565 HA ALA B 118 -8.360 14.350 16.727 1.00 0.00 H ATOM 8566 HB1 ALA B 118 -10.811 14.041 17.364 1.00 0.00 H ATOM 8567 HB2 ALA B 118 -10.820 15.673 18.077 1.00 0.00 H ATOM 8568 HB3 ALA B 118 -10.622 15.470 16.319 1.00 0.00 H ATOM 8569 H ALA B 118 -9.367 14.395 19.483 1.00 0.00 H ATOM 8570 N ALA B 119 -7.217 16.480 16.609 1.00 14.88 N ATOM 8571 CA ALA B 119 -6.552 17.771 16.390 1.00 10.00 C ATOM 8572 C ALA B 119 -5.657 17.629 15.194 1.00 23.51 C ATOM 8573 O ALA B 119 -4.917 16.655 15.133 1.00 26.27 O ATOM 8574 CB ALA B 119 -5.766 18.232 17.616 1.00 16.73 C ATOM 8575 HA ALA B 119 -7.305 18.539 16.213 1.00 0.00 H ATOM 8576 HB1 ALA B 119 -6.445 18.340 18.462 1.00 0.00 H ATOM 8577 HB2 ALA B 119 -5.001 17.493 17.855 1.00 0.00 H ATOM 8578 HB3 ALA B 119 -5.293 19.191 17.403 1.00 0.00 H ATOM 8579 H ALA B 119 -6.819 15.630 16.162 1.00 0.00 H ATOM 8580 N LEU B 120 -5.750 18.565 14.261 1.00 16.26 N ATOM 8581 CA LEU B 120 -4.911 18.493 13.072 1.00 17.06 C ATOM 8582 C LEU B 120 -3.794 19.503 13.059 1.00 21.31 C ATOM 8583 O LEU B 120 -3.988 20.658 13.399 1.00 19.95 O ATOM 8584 CB LEU B 120 -5.726 18.810 11.824 1.00 13.77 C ATOM 8585 CG LEU B 120 -6.860 17.834 11.543 1.00 20.43 C ATOM 8586 CD1 LEU B 120 -7.457 18.165 10.189 1.00 15.02 C ATOM 8587 CD2 LEU B 120 -6.337 16.404 11.489 1.00 12.85 C ATOM 8588 HA LEU B 120 -4.508 17.480 13.085 1.00 0.00 H ATOM 8589 HB2 LEU B 120 -6.155 19.805 11.941 1.00 0.00 H ATOM 8590 HB3 LEU B 120 -5.052 18.805 10.967 1.00 0.00 H ATOM 8591 HG LEU B 120 -7.602 17.919 12.337 1.00 0.00 H ATOM 8592 HD21 LEU B 120 -5.594 16.320 10.696 1.00 0.00 H ATOM 8593 HD22 LEU B 120 -5.880 16.149 12.445 1.00 0.00 H ATOM 8594 HD23 LEU B 120 -7.164 15.723 11.287 1.00 0.00 H ATOM 8595 HD11 LEU B 120 -7.839 19.186 10.202 1.00 0.00 H ATOM 8596 HD12 LEU B 120 -6.688 18.073 9.422 1.00 0.00 H ATOM 8597 HD13 LEU B 120 -8.272 17.473 9.974 1.00 0.00 H ATOM 8598 H LEU B 120 -6.421 19.351 14.377 1.00 0.00 H ATOM 8599 N PRO B 121 -2.619 19.067 12.630 1.00 12.17 N ATOM 8600 CA PRO B 121 -1.480 19.946 12.537 1.00 11.77 C ATOM 8601 C PRO B 121 -1.676 20.907 11.361 1.00 9.12 C ATOM 8602 O PRO B 121 -2.338 20.594 10.346 1.00 16.64 O ATOM 8603 CB PRO B 121 -0.288 19.021 12.412 1.00 11.91 C ATOM 8604 CG PRO B 121 -0.797 17.647 12.045 1.00 14.57 C ATOM 8605 CD PRO B 121 -2.295 17.658 12.273 1.00 11.23 C ATOM 8606 HA PRO B 121 -1.337 20.597 13.400 1.00 0.00 H ATOM 8607 HD3 PRO B 121 -2.823 17.361 11.367 1.00 0.00 H ATOM 8608 HD2 PRO B 121 -2.564 16.984 13.087 1.00 0.00 H ATOM 8609 HG3 PRO B 121 -0.327 16.892 12.675 1.00 0.00 H ATOM 8610 HG2 PRO B 121 -0.578 17.433 10.999 1.00 0.00 H ATOM 8611 HB2 PRO B 121 0.384 19.386 11.635 1.00 0.00 H ATOM 8612 HB3 PRO B 121 0.246 18.976 13.361 1.00 0.00 H ATOM 8613 N SER B 122 -1.125 22.109 11.493 1.00 17.08 N ATOM 8614 CA SER B 122 -1.343 23.074 10.412 1.00 11.83 C ATOM 8615 C SER B 122 -0.828 22.721 9.057 1.00 12.38 C ATOM 8616 O SER B 122 -1.380 23.151 8.039 1.00 11.48 O ATOM 8617 CB SER B 122 -0.846 24.463 10.756 1.00 23.83 C ATOM 8618 OG SER B 122 0.532 24.385 10.964 1.00 40.41 O ATOM 8619 HA SER B 122 -2.430 23.045 10.337 1.00 0.00 H ATOM 8620 HB2 SER B 122 -1.338 24.819 11.661 1.00 0.00 H ATOM 8621 HB3 SER B 122 -1.059 25.147 9.935 1.00 0.00 H ATOM 8622 HG SER B 122 0.882 25.283 11.191 1.00 0.00 H ATOM 8623 H SER B 122 -0.561 22.355 12.331 1.00 0.00 H ATOM 8624 N HIS B 123 0.225 21.954 9.028 1.00 10.08 N ATOM 8625 CA HIS B 123 0.701 21.645 7.696 1.00 9.56 C ATOM 8626 C HIS B 123 -0.319 20.804 6.944 1.00 12.40 C ATOM 8627 O HIS B 123 -0.402 20.908 5.709 1.00 8.85 O ATOM 8628 CB HIS B 123 2.114 20.981 7.675 1.00 11.24 C ATOM 8629 CG HIS B 123 2.165 19.594 8.285 1.00 13.37 C ATOM 8630 ND1 HIS B 123 2.380 18.425 7.521 1.00 17.14 N ATOM 8631 CD2 HIS B 123 2.043 19.205 9.603 1.00 15.00 C ATOM 8632 CE1 HIS B 123 2.370 17.391 8.365 1.00 8.52 C ATOM 8633 NE2 HIS B 123 2.173 17.832 9.629 1.00 18.30 N ATOM 8634 HA HIS B 123 0.819 22.599 7.182 1.00 0.00 H ATOM 8635 HB2 HIS B 123 2.442 20.910 6.638 1.00 0.00 H ATOM 8636 HB3 HIS B 123 2.800 21.622 8.228 1.00 0.00 H ATOM 8637 HD2 HIS B 123 1.876 19.858 10.460 1.00 0.00 H ATOM 8638 HE1 HIS B 123 2.501 16.347 8.079 1.00 0.00 H ATOM 8639 H HIS B 123 0.685 21.594 9.889 1.00 0.00 H ATOM 8640 N VAL B 124 -1.095 19.969 7.666 1.00 10.81 N ATOM 8641 CA VAL B 124 -2.059 19.145 6.991 1.00 9.50 C ATOM 8642 C VAL B 124 -3.229 19.987 6.582 1.00 11.16 C ATOM 8643 O VAL B 124 -3.813 19.832 5.524 1.00 11.60 O ATOM 8644 CB VAL B 124 -2.475 17.963 7.879 1.00 12.47 C ATOM 8645 CG1 VAL B 124 -3.526 17.184 7.122 1.00 14.98 C ATOM 8646 CG2 VAL B 124 -1.291 17.011 8.027 1.00 19.61 C ATOM 8647 HA VAL B 124 -1.617 18.720 6.090 1.00 0.00 H ATOM 8648 HB VAL B 124 -2.821 18.327 8.846 1.00 0.00 H ATOM 8649 HG11 VAL B 124 -4.380 17.831 6.919 1.00 0.00 H ATOM 8650 HG12 VAL B 124 -3.106 16.828 6.181 1.00 0.00 H ATOM 8651 HG13 VAL B 124 -3.848 16.333 7.722 1.00 0.00 H ATOM 8652 HG21 VAL B 124 -0.995 16.646 7.044 1.00 0.00 H ATOM 8653 HG22 VAL B 124 -0.456 17.540 8.486 1.00 0.00 H ATOM 8654 HG23 VAL B 124 -1.580 16.169 8.657 1.00 0.00 H ATOM 8655 H VAL B 124 -0.996 19.922 8.700 1.00 0.00 H ATOM 8656 N VAL B 125 -3.586 20.932 7.440 1.00 10.11 N ATOM 8657 CA VAL B 125 -4.693 21.818 7.104 1.00 16.02 C ATOM 8658 C VAL B 125 -4.390 22.616 5.822 1.00 22.21 C ATOM 8659 O VAL B 125 -5.196 22.770 4.912 1.00 16.55 O ATOM 8660 CB VAL B 125 -5.065 22.755 8.238 1.00 17.65 C ATOM 8661 CG1 VAL B 125 -6.093 23.784 7.739 1.00 14.30 C ATOM 8662 CG2 VAL B 125 -5.702 21.915 9.348 1.00 13.15 C ATOM 8663 HA VAL B 125 -5.557 21.177 6.927 1.00 0.00 H ATOM 8664 HB VAL B 125 -4.181 23.278 8.603 1.00 0.00 H ATOM 8665 HG11 VAL B 125 -5.661 24.359 6.920 1.00 0.00 H ATOM 8666 HG12 VAL B 125 -6.985 23.264 7.390 1.00 0.00 H ATOM 8667 HG13 VAL B 125 -6.358 24.456 8.555 1.00 0.00 H ATOM 8668 HG21 VAL B 125 -6.591 21.417 8.960 1.00 0.00 H ATOM 8669 HG22 VAL B 125 -4.987 21.168 9.693 1.00 0.00 H ATOM 8670 HG23 VAL B 125 -5.980 22.564 10.179 1.00 0.00 H ATOM 8671 H VAL B 125 -3.082 21.040 8.343 1.00 0.00 H ATOM 8672 N THR B 126 -3.175 23.160 5.728 1.00 15.38 N ATOM 8673 CA THR B 126 -2.763 23.941 4.572 1.00 9.83 C ATOM 8674 C THR B 126 -2.791 23.144 3.303 1.00 6.80 C ATOM 8675 O THR B 126 -3.231 23.624 2.276 1.00 10.22 O ATOM 8676 CB THR B 126 -1.323 24.345 4.809 1.00 13.11 C ATOM 8677 OG1 THR B 126 -1.315 25.259 5.877 1.00 20.90 O ATOM 8678 CG2 THR B 126 -0.774 25.027 3.574 1.00 16.11 C ATOM 8679 HA THR B 126 -3.445 24.784 4.462 1.00 0.00 H ATOM 8680 HB THR B 126 -0.712 23.470 5.032 1.00 0.00 H ATOM 8681 HG1 THR B 126 -0.385 25.544 6.059 1.00 0.00 H ATOM 8682 HG23 THR B 126 -0.777 24.324 2.741 1.00 0.00 H ATOM 8683 HG21 THR B 126 -1.397 25.887 3.328 1.00 0.00 H ATOM 8684 HG22 THR B 126 0.246 25.359 3.767 1.00 0.00 H ATOM 8685 H THR B 126 -2.500 23.021 6.507 1.00 0.00 H ATOM 8686 N MET B 127 -2.288 21.921 3.354 1.00 7.60 N ATOM 8687 CA MET B 127 -2.254 21.074 2.173 1.00 10.17 C ATOM 8688 C MET B 127 -3.667 20.826 1.644 1.00 8.41 C ATOM 8689 O MET B 127 -3.951 20.858 0.456 1.00 12.56 O ATOM 8690 CB MET B 127 -1.566 19.758 2.629 1.00 11.79 C ATOM 8691 CG MET B 127 -1.149 18.769 1.559 1.00 23.85 C ATOM 8692 SD MET B 127 -0.883 17.079 2.189 1.00 24.59 S ATOM 8693 CE MET B 127 -1.257 17.265 3.905 1.00 18.88 C ATOM 8694 HA MET B 127 -1.708 21.536 1.350 1.00 0.00 H ATOM 8695 HB2 MET B 127 -0.669 20.035 3.183 1.00 0.00 H ATOM 8696 HB3 MET B 127 -2.258 19.243 3.295 1.00 0.00 H ATOM 8697 HG2 MET B 127 -0.220 19.119 1.109 1.00 0.00 H ATOM 8698 HG3 MET B 127 -1.929 18.735 0.799 1.00 0.00 H ATOM 8699 HE1 MET B 127 -0.581 17.997 4.346 1.00 0.00 H ATOM 8700 HE2 MET B 127 -2.286 17.606 4.016 1.00 0.00 H ATOM 8701 HE3 MET B 127 -1.134 16.306 4.408 1.00 0.00 H ATOM 8702 H MET B 127 -1.911 21.560 4.254 1.00 0.00 H ATOM 8703 N LEU B 128 -4.582 20.528 2.537 1.00 7.15 N ATOM 8704 CA LEU B 128 -5.951 20.250 2.101 1.00 10.72 C ATOM 8705 C LEU B 128 -6.610 21.448 1.435 1.00 11.23 C ATOM 8706 O LEU B 128 -7.278 21.401 0.393 1.00 16.21 O ATOM 8707 CB LEU B 128 -6.760 19.845 3.326 1.00 9.94 C ATOM 8708 CG LEU B 128 -6.477 18.409 3.804 1.00 14.29 C ATOM 8709 CD1 LEU B 128 -7.214 18.155 5.099 1.00 11.65 C ATOM 8710 CD2 LEU B 128 -6.977 17.362 2.833 1.00 16.57 C ATOM 8711 HA LEU B 128 -5.918 19.454 1.358 1.00 0.00 H ATOM 8712 HB2 LEU B 128 -6.523 20.532 4.138 1.00 0.00 H ATOM 8713 HB3 LEU B 128 -7.819 19.925 3.082 1.00 0.00 H ATOM 8714 HG LEU B 128 -5.395 18.331 3.907 1.00 0.00 H ATOM 8715 HD21 LEU B 128 -8.055 17.468 2.710 1.00 0.00 H ATOM 8716 HD22 LEU B 128 -6.485 17.497 1.870 1.00 0.00 H ATOM 8717 HD23 LEU B 128 -6.750 16.369 3.222 1.00 0.00 H ATOM 8718 HD11 LEU B 128 -6.874 18.864 5.854 1.00 0.00 H ATOM 8719 HD12 LEU B 128 -8.285 18.280 4.937 1.00 0.00 H ATOM 8720 HD13 LEU B 128 -7.013 17.138 5.437 1.00 0.00 H ATOM 8721 H LEU B 128 -4.336 20.490 3.547 1.00 0.00 H ATOM 8722 N ASP B 129 -6.378 22.562 2.082 1.00 12.66 N ATOM 8723 CA ASP B 129 -6.904 23.802 1.588 1.00 9.02 C ATOM 8724 C ASP B 129 -6.285 24.200 0.267 1.00 16.54 C ATOM 8725 O ASP B 129 -6.842 24.965 -0.485 1.00 25.82 O ATOM 8726 CB ASP B 129 -6.639 24.946 2.576 1.00 8.47 C ATOM 8727 CG ASP B 129 -7.543 24.939 3.798 1.00 19.80 C ATOM 8728 OD1 ASP B 129 -8.416 23.973 3.861 1.00 22.24 O ATOM 8729 OD2 ASP B 129 -7.413 25.731 4.735 1.00 21.98 O ATOM 8730 HA ASP B 129 -7.974 23.639 1.459 1.00 0.00 H ATOM 8731 HB2 ASP B 129 -5.606 24.872 2.915 1.00 0.00 H ATOM 8732 HB3 ASP B 129 -6.781 25.891 2.051 1.00 0.00 H ATOM 8733 H ASP B 129 -5.812 22.548 2.954 1.00 0.00 H ATOM 8734 N ASN B 130 -5.125 23.722 -0.063 1.00 13.20 N ATOM 8735 CA ASN B 130 -4.487 24.073 -1.337 1.00 15.58 C ATOM 8736 C ASN B 130 -4.729 23.073 -2.473 1.00 15.81 C ATOM 8737 O ASN B 130 -4.349 23.320 -3.616 1.00 15.63 O ATOM 8738 CB ASN B 130 -2.972 24.341 -1.210 1.00 14.24 C ATOM 8739 CG ASN B 130 -2.694 25.627 -0.473 1.00 20.23 C ATOM 8740 OD1 ASN B 130 -1.721 25.745 0.282 1.00 31.57 O ATOM 8741 ND2 ASN B 130 -3.348 26.663 -0.948 1.00 23.25 N ATOM 8742 HA ASN B 130 -4.990 25.002 -1.608 1.00 0.00 H ATOM 8743 HB2 ASN B 130 -2.511 23.516 -0.667 1.00 0.00 H ATOM 8744 HB3 ASN B 130 -2.539 24.405 -2.208 1.00 0.00 H ATOM 8745 HD22 ASN B 130 -4.161 26.519 -1.580 1.00 0.00 H ATOM 8746 HD21 ASN B 130 -3.052 27.627 -0.692 1.00 0.00 H ATOM 8747 H ASN B 130 -4.637 23.076 0.590 1.00 0.00 H ATOM 8748 N PHE B 131 -5.353 21.945 -2.179 1.00 12.74 N ATOM 8749 CA PHE B 131 -5.633 20.943 -3.190 1.00 13.87 C ATOM 8750 C PHE B 131 -6.671 21.393 -4.228 1.00 24.34 C ATOM 8751 O PHE B 131 -7.661 22.078 -3.941 1.00 11.65 O ATOM 8752 CB PHE B 131 -6.196 19.700 -2.457 1.00 12.33 C ATOM 8753 CG PHE B 131 -5.179 18.695 -1.928 1.00 8.26 C ATOM 8754 CD1 PHE B 131 -3.926 18.500 -2.517 1.00 19.94 C ATOM 8755 CD2 PHE B 131 -5.563 17.905 -0.837 1.00 13.14 C ATOM 8756 CE1 PHE B 131 -3.059 17.538 -1.983 1.00 16.58 C ATOM 8757 CE2 PHE B 131 -4.709 16.952 -0.290 1.00 17.01 C ATOM 8758 CZ PHE B 131 -3.457 16.780 -0.879 1.00 6.35 C ATOM 8759 HA PHE B 131 -4.707 20.745 -3.730 1.00 0.00 H ATOM 8760 HB2 PHE B 131 -6.782 20.054 -1.609 1.00 0.00 H ATOM 8761 HB3 PHE B 131 -6.849 19.174 -3.153 1.00 0.00 H ATOM 8762 HD2 PHE B 131 -6.555 18.040 -0.406 1.00 0.00 H ATOM 8763 HE2 PHE B 131 -5.010 16.358 0.573 1.00 0.00 H ATOM 8764 HZ PHE B 131 -2.773 16.037 -0.469 1.00 0.00 H ATOM 8765 HE1 PHE B 131 -2.076 17.381 -2.428 1.00 0.00 H ATOM 8766 HD1 PHE B 131 -3.627 19.091 -3.383 1.00 0.00 H ATOM 8767 H PHE B 131 -5.651 21.772 -1.198 1.00 0.00 H ATOM 8768 N PRO B 132 -6.461 20.996 -5.465 1.00 17.88 N ATOM 8769 CA PRO B 132 -7.420 21.399 -6.466 1.00 13.42 C ATOM 8770 C PRO B 132 -8.684 20.562 -6.383 1.00 16.18 C ATOM 8771 O PRO B 132 -8.676 19.437 -5.885 1.00 18.59 O ATOM 8772 CB PRO B 132 -6.719 21.055 -7.777 1.00 16.62 C ATOM 8773 CG PRO B 132 -5.662 20.002 -7.456 1.00 22.62 C ATOM 8774 CD PRO B 132 -5.334 20.169 -5.978 1.00 13.03 C ATOM 8775 HA PRO B 132 -7.708 22.444 -6.356 1.00 0.00 H ATOM 8776 HD3 PRO B 132 -5.298 19.203 -5.475 1.00 0.00 H ATOM 8777 HD2 PRO B 132 -4.381 20.682 -5.845 1.00 0.00 H ATOM 8778 HG3 PRO B 132 -4.771 20.163 -8.062 1.00 0.00 H ATOM 8779 HG2 PRO B 132 -6.053 19.003 -7.646 1.00 0.00 H ATOM 8780 HB2 PRO B 132 -7.438 20.658 -8.493 1.00 0.00 H ATOM 8781 HB3 PRO B 132 -6.247 21.945 -8.194 1.00 0.00 H ATOM 8782 N THR B 133 -9.790 21.108 -6.896 1.00 12.37 N ATOM 8783 CA THR B 133 -11.058 20.408 -6.864 1.00 14.95 C ATOM 8784 C THR B 133 -11.111 19.202 -7.806 1.00 24.67 C ATOM 8785 O THR B 133 -11.985 18.361 -7.667 1.00 25.60 O ATOM 8786 CB THR B 133 -12.256 21.372 -7.014 1.00 19.23 C ATOM 8787 OG1 THR B 133 -12.264 21.787 -8.357 1.00 25.32 O ATOM 8788 CG2 THR B 133 -12.058 22.569 -6.091 1.00 29.91 C ATOM 8789 HA THR B 133 -11.146 19.975 -5.868 1.00 0.00 H ATOM 8790 HB THR B 133 -13.199 20.894 -6.749 1.00 0.00 H ATOM 8791 HG1 THR B 133 -13.019 22.410 -8.504 1.00 0.00 H ATOM 8792 HG23 THR B 133 -12.054 22.231 -5.055 1.00 0.00 H ATOM 8793 HG21 THR B 133 -11.107 23.050 -6.321 1.00 0.00 H ATOM 8794 HG22 THR B 133 -12.871 23.279 -6.240 1.00 0.00 H ATOM 8795 H THR B 133 -9.740 22.053 -7.326 1.00 0.00 H ATOM 8796 N ASN B 134 -10.188 19.064 -8.753 1.00 18.70 N ATOM 8797 CA ASN B 134 -10.298 17.892 -9.560 1.00 17.49 C ATOM 8798 C ASN B 134 -9.455 16.773 -8.970 1.00 16.49 C ATOM 8799 O ASN B 134 -9.277 15.767 -9.647 1.00 22.40 O ATOM 8800 CB ASN B 134 -9.885 18.172 -11.014 1.00 24.42 C ATOM 8801 CG ASN B 134 -8.401 18.490 -11.099 1.00 23.68 C ATOM 8802 OD1 ASN B 134 -7.875 19.130 -10.183 1.00 28.92 O ATOM 8803 ND2 ASN B 134 -7.734 18.120 -12.208 1.00 23.90 N ATOM 8804 HA ASN B 134 -11.343 17.582 -9.569 1.00 0.00 H ATOM 8805 HB2 ASN B 134 -10.098 17.293 -11.623 1.00 0.00 H ATOM 8806 HB3 ASN B 134 -10.455 19.021 -11.391 1.00 0.00 H ATOM 8807 HD22 ASN B 134 -8.221 17.581 -12.952 1.00 0.00 H ATOM 8808 HD21 ASN B 134 -6.731 18.373 -12.320 1.00 0.00 H ATOM 8809 H ASN B 134 -9.434 19.766 -8.897 1.00 0.00 H ATOM 8810 N LEU B 135 -8.908 16.896 -7.760 1.00 7.97 N ATOM 8811 CA LEU B 135 -8.096 15.808 -7.202 1.00 6.90 C ATOM 8812 C LEU B 135 -9.113 14.968 -6.455 1.00 3.15 C ATOM 8813 O LEU B 135 -9.813 15.485 -5.597 1.00 7.00 O ATOM 8814 CB LEU B 135 -7.018 16.391 -6.248 1.00 8.14 C ATOM 8815 CG LEU B 135 -6.115 15.334 -5.648 1.00 5.72 C ATOM 8816 CD1 LEU B 135 -5.470 14.413 -6.690 1.00 3.00 C ATOM 8817 CD2 LEU B 135 -5.073 15.890 -4.705 1.00 10.46 C ATOM 8818 HA LEU B 135 -7.551 15.230 -7.949 1.00 0.00 H ATOM 8819 HB2 LEU B 135 -6.403 17.094 -6.809 1.00 0.00 H ATOM 8820 HB3 LEU B 135 -7.521 16.917 -5.437 1.00 0.00 H ATOM 8821 HG LEU B 135 -6.792 14.721 -5.053 1.00 0.00 H ATOM 8822 HD21 LEU B 135 -4.438 16.594 -5.242 1.00 0.00 H ATOM 8823 HD22 LEU B 135 -5.568 16.402 -3.880 1.00 0.00 H ATOM 8824 HD23 LEU B 135 -4.465 15.074 -4.316 1.00 0.00 H ATOM 8825 HD11 LEU B 135 -6.250 13.896 -7.249 1.00 0.00 H ATOM 8826 HD12 LEU B 135 -4.865 15.008 -7.374 1.00 0.00 H ATOM 8827 HD13 LEU B 135 -4.838 13.682 -6.186 1.00 0.00 H ATOM 8828 H LEU B 135 -9.057 17.766 -7.210 1.00 0.00 H ATOM 8829 N HIS B 136 -9.266 13.676 -6.829 1.00 4.84 N ATOM 8830 CA HIS B 136 -10.277 12.830 -6.167 1.00 4.40 C ATOM 8831 C HIS B 136 -10.189 12.850 -4.640 1.00 5.24 C ATOM 8832 O HIS B 136 -9.071 12.869 -4.069 1.00 8.30 O ATOM 8833 CB HIS B 136 -10.122 11.388 -6.745 1.00 9.49 C ATOM 8834 CG HIS B 136 -11.233 10.496 -6.342 1.00 6.61 C ATOM 8835 ND1 HIS B 136 -12.264 10.152 -7.213 1.00 10.28 N ATOM 8836 CD2 HIS B 136 -11.475 9.928 -5.146 1.00 3.33 C ATOM 8837 CE1 HIS B 136 -13.124 9.379 -6.582 1.00 3.00 C ATOM 8838 NE2 HIS B 136 -12.666 9.214 -5.328 1.00 8.08 N ATOM 8839 HA HIS B 136 -11.270 13.227 -6.378 1.00 0.00 H ATOM 8840 HB2 HIS B 136 -10.097 11.447 -7.833 1.00 0.00 H ATOM 8841 HB3 HIS B 136 -9.184 10.965 -6.384 1.00 0.00 H ATOM 8842 HD2 HIS B 136 -10.877 10.006 -4.238 1.00 0.00 H ATOM 8843 HE1 HIS B 136 -14.037 8.953 -6.998 1.00 0.00 H ATOM 8844 H HIS B 136 -8.670 13.280 -7.584 1.00 0.00 H ATOM 8845 N PRO B 137 -11.375 12.819 -3.993 1.00 6.79 N ATOM 8846 CA PRO B 137 -11.432 12.826 -2.534 1.00 3.00 C ATOM 8847 C PRO B 137 -10.582 11.720 -1.899 1.00 5.66 C ATOM 8848 O PRO B 137 -9.949 11.917 -0.848 1.00 3.10 O ATOM 8849 CB PRO B 137 -12.904 12.755 -2.177 1.00 3.00 C ATOM 8850 CG PRO B 137 -13.655 13.221 -3.403 1.00 10.36 C ATOM 8851 CD PRO B 137 -12.735 13.002 -4.582 1.00 8.17 C ATOM 8852 HA PRO B 137 -10.989 13.734 -2.124 1.00 0.00 H ATOM 8853 HD3 PRO B 137 -13.033 12.114 -5.139 1.00 0.00 H ATOM 8854 HD2 PRO B 137 -12.751 13.867 -5.245 1.00 0.00 H ATOM 8855 HG3 PRO B 137 -13.905 14.278 -3.312 1.00 0.00 H ATOM 8856 HG2 PRO B 137 -14.570 12.642 -3.527 1.00 0.00 H ATOM 8857 HB2 PRO B 137 -13.184 11.732 -1.927 1.00 0.00 H ATOM 8858 HB3 PRO B 137 -13.120 13.406 -1.330 1.00 0.00 H ATOM 8859 N MET B 138 -10.520 10.515 -2.492 1.00 3.88 N ATOM 8860 CA MET B 138 -9.694 9.463 -1.863 1.00 3.09 C ATOM 8861 C MET B 138 -8.228 9.770 -1.907 1.00 5.08 C ATOM 8862 O MET B 138 -7.453 9.451 -1.009 1.00 4.87 O ATOM 8863 CB MET B 138 -9.950 8.051 -2.479 1.00 3.15 C ATOM 8864 CG MET B 138 -11.301 7.457 -2.055 1.00 3.00 C ATOM 8865 SD MET B 138 -11.259 6.994 -0.335 1.00 8.07 S ATOM 8866 CE MET B 138 -9.981 5.729 -0.305 1.00 10.44 C ATOM 8867 HA MET B 138 -10.008 9.448 -0.819 1.00 0.00 H ATOM 8868 HB2 MET B 138 -9.931 8.135 -3.566 1.00 0.00 H ATOM 8869 HB3 MET B 138 -9.156 7.379 -2.154 1.00 0.00 H ATOM 8870 HG2 MET B 138 -11.513 6.575 -2.660 1.00 0.00 H ATOM 8871 HG3 MET B 138 -12.085 8.199 -2.209 1.00 0.00 H ATOM 8872 HE1 MET B 138 -10.271 4.906 -0.959 1.00 0.00 H ATOM 8873 HE2 MET B 138 -9.040 6.156 -0.652 1.00 0.00 H ATOM 8874 HE3 MET B 138 -9.860 5.360 0.714 1.00 0.00 H ATOM 8875 H MET B 138 -11.041 10.328 -3.372 1.00 0.00 H ATOM 8876 N SER B 139 -7.792 10.402 -2.995 1.00 5.05 N ATOM 8877 CA SER B 139 -6.369 10.765 -3.150 1.00 7.02 C ATOM 8878 C SER B 139 -6.096 11.903 -2.169 1.00 6.49 C ATOM 8879 O SER B 139 -4.996 11.955 -1.591 1.00 7.26 O ATOM 8880 CB SER B 139 -5.993 11.299 -4.527 1.00 7.98 C ATOM 8881 OG SER B 139 -6.380 10.387 -5.511 1.00 14.96 O ATOM 8882 HA SER B 139 -5.793 9.855 -2.983 1.00 0.00 H ATOM 8883 HB2 SER B 139 -4.914 11.448 -4.575 1.00 0.00 H ATOM 8884 HB3 SER B 139 -6.498 12.250 -4.697 1.00 0.00 H ATOM 8885 HG SER B 139 -7.360 10.253 -5.468 1.00 0.00 H ATOM 8886 H SER B 139 -8.466 10.644 -3.749 1.00 0.00 H ATOM 8887 N GLN B 140 -7.082 12.812 -1.990 1.00 7.58 N ATOM 8888 CA GLN B 140 -6.857 13.892 -1.045 1.00 3.00 C ATOM 8889 C GLN B 140 -6.663 13.255 0.364 1.00 9.73 C ATOM 8890 O GLN B 140 -5.783 13.597 1.183 1.00 3.33 O ATOM 8891 CB GLN B 140 -8.036 14.908 -0.995 1.00 3.00 C ATOM 8892 CG GLN B 140 -8.224 15.559 -2.369 1.00 6.08 C ATOM 8893 CD GLN B 140 -8.964 16.865 -2.285 1.00 14.17 C ATOM 8894 OE1 GLN B 140 -9.500 17.313 -3.307 1.00 16.03 O ATOM 8895 NE2 GLN B 140 -9.029 17.478 -1.118 1.00 3.85 N ATOM 8896 HA GLN B 140 -5.977 14.450 -1.364 1.00 0.00 H ATOM 8897 HB2 GLN B 140 -8.951 14.386 -0.714 1.00 0.00 H ATOM 8898 HB3 GLN B 140 -7.817 15.679 -0.256 1.00 0.00 H ATOM 8899 HG2 GLN B 140 -7.243 15.739 -2.809 1.00 0.00 H ATOM 8900 HG3 GLN B 140 -8.787 14.877 -3.006 1.00 0.00 H ATOM 8901 HE22 GLN B 140 -8.563 17.063 -0.286 1.00 0.00 H ATOM 8902 HE21 GLN B 140 -9.547 18.376 -1.030 1.00 0.00 H ATOM 8903 H GLN B 140 -7.977 12.739 -2.515 1.00 0.00 H ATOM 8904 N LEU B 141 -7.518 12.266 0.665 1.00 5.04 N ATOM 8905 CA LEU B 141 -7.473 11.566 1.950 1.00 5.35 C ATOM 8906 C LEU B 141 -6.173 10.840 2.220 1.00 5.53 C ATOM 8907 O LEU B 141 -5.542 10.939 3.257 1.00 4.25 O ATOM 8908 CB LEU B 141 -8.683 10.645 2.155 1.00 3.41 C ATOM 8909 CG LEU B 141 -8.726 9.809 3.451 1.00 8.16 C ATOM 8910 CD1 LEU B 141 -9.279 10.633 4.605 1.00 5.38 C ATOM 8911 CD2 LEU B 141 -9.658 8.571 3.290 1.00 5.55 C ATOM 8912 HA LEU B 141 -7.525 12.359 2.696 1.00 0.00 H ATOM 8913 HB2 LEU B 141 -9.576 11.269 2.138 1.00 0.00 H ATOM 8914 HB3 LEU B 141 -8.711 9.950 1.316 1.00 0.00 H ATOM 8915 HG LEU B 141 -7.703 9.493 3.654 1.00 0.00 H ATOM 8916 HD21 LEU B 141 -10.669 8.906 3.057 1.00 0.00 H ATOM 8917 HD22 LEU B 141 -9.287 7.942 2.481 1.00 0.00 H ATOM 8918 HD23 LEU B 141 -9.668 8.002 4.219 1.00 0.00 H ATOM 8919 HD11 LEU B 141 -8.642 11.502 4.767 1.00 0.00 H ATOM 8920 HD12 LEU B 141 -10.290 10.962 4.363 1.00 0.00 H ATOM 8921 HD13 LEU B 141 -9.300 10.023 5.508 1.00 0.00 H ATOM 8922 H LEU B 141 -8.234 11.988 -0.036 1.00 0.00 H ATOM 8923 N SER B 142 -5.733 10.039 1.257 1.00 4.50 N ATOM 8924 CA SER B 142 -4.505 9.248 1.400 1.00 6.62 C ATOM 8925 C SER B 142 -3.294 10.154 1.566 1.00 10.66 C ATOM 8926 O SER B 142 -2.449 9.967 2.421 1.00 5.14 O ATOM 8927 CB SER B 142 -4.420 8.399 0.150 1.00 10.98 C ATOM 8928 OG SER B 142 -3.252 7.644 0.289 1.00 23.84 O ATOM 8929 HA SER B 142 -4.522 8.620 2.291 1.00 0.00 H ATOM 8930 HB2 SER B 142 -4.362 9.031 -0.736 1.00 0.00 H ATOM 8931 HB3 SER B 142 -5.289 7.746 0.073 1.00 0.00 H ATOM 8932 HG SER B 142 -3.317 7.084 1.103 1.00 0.00 H ATOM 8933 H SER B 142 -6.276 9.970 0.373 1.00 0.00 H ATOM 8934 N ALA B 143 -3.177 11.188 0.722 1.00 3.16 N ATOM 8935 CA ALA B 143 -2.041 12.179 0.843 1.00 3.01 C ATOM 8936 C ALA B 143 -2.049 12.882 2.250 1.00 3.00 C ATOM 8937 O ALA B 143 -1.002 13.055 2.872 1.00 3.43 O ATOM 8938 CB ALA B 143 -2.058 13.178 -0.320 1.00 8.40 C ATOM 8939 HA ALA B 143 -1.099 11.635 0.774 1.00 0.00 H ATOM 8940 HB1 ALA B 143 -1.954 12.639 -1.262 1.00 0.00 H ATOM 8941 HB2 ALA B 143 -3.001 13.724 -0.315 1.00 0.00 H ATOM 8942 HB3 ALA B 143 -1.231 13.879 -0.208 1.00 0.00 H ATOM 8943 H ALA B 143 -3.882 11.312 -0.032 1.00 0.00 H ATOM 8944 N ALA B 144 -3.223 13.292 2.777 1.00 5.24 N ATOM 8945 CA ALA B 144 -3.259 13.931 4.098 1.00 5.29 C ATOM 8946 C ALA B 144 -2.847 12.961 5.226 1.00 9.51 C ATOM 8947 O ALA B 144 -2.149 13.368 6.183 1.00 9.30 O ATOM 8948 CB ALA B 144 -4.614 14.617 4.360 1.00 6.40 C ATOM 8949 HA ALA B 144 -2.508 14.721 4.097 1.00 0.00 H ATOM 8950 HB1 ALA B 144 -4.785 15.382 3.602 1.00 0.00 H ATOM 8951 HB2 ALA B 144 -5.411 13.874 4.315 1.00 0.00 H ATOM 8952 HB3 ALA B 144 -4.601 15.078 5.348 1.00 0.00 H ATOM 8953 H ALA B 144 -4.106 13.154 2.244 1.00 0.00 H ATOM 8954 N ILE B 145 -3.248 11.672 5.160 1.00 5.43 N ATOM 8955 CA ILE B 145 -2.879 10.694 6.187 1.00 3.00 C ATOM 8956 C ILE B 145 -1.368 10.445 6.159 1.00 4.34 C ATOM 8957 O ILE B 145 -0.676 10.308 7.192 1.00 10.78 O ATOM 8958 CB ILE B 145 -3.651 9.410 6.017 1.00 3.61 C ATOM 8959 CG1 ILE B 145 -5.121 9.674 6.374 1.00 6.83 C ATOM 8960 CG2 ILE B 145 -3.069 8.315 6.906 1.00 10.36 C ATOM 8961 CD1 ILE B 145 -5.822 8.768 5.375 1.00 33.90 C ATOM 8962 HA ILE B 145 -3.141 11.101 7.164 1.00 0.00 H ATOM 8963 HB ILE B 145 -3.580 9.070 4.984 1.00 0.00 H ATOM 8964 HG12 ILE B 145 -5.343 9.386 7.402 1.00 0.00 H ATOM 8965 HG13 ILE B 145 -5.389 10.720 6.225 1.00 0.00 H ATOM 8966 HD11 ILE B 145 -5.556 9.072 4.362 1.00 0.00 H ATOM 8967 HD12 ILE B 145 -5.510 7.737 5.540 1.00 0.00 H ATOM 8968 HD13 ILE B 145 -6.901 8.848 5.508 1.00 0.00 H ATOM 8969 HG21 ILE B 145 -2.028 8.142 6.633 1.00 0.00 H ATOM 8970 HG22 ILE B 145 -3.125 8.627 7.949 1.00 0.00 H ATOM 8971 HG23 ILE B 145 -3.639 7.396 6.769 1.00 0.00 H ATOM 8972 H ILE B 145 -3.835 11.366 4.358 1.00 0.00 H ATOM 8973 N THR B 146 -0.845 10.380 4.913 1.00 5.56 N ATOM 8974 CA THR B 146 0.597 10.189 4.729 1.00 3.73 C ATOM 8975 C THR B 146 1.290 11.362 5.426 1.00 10.60 C ATOM 8976 O THR B 146 2.162 11.142 6.238 1.00 12.24 O ATOM 8977 CB THR B 146 1.018 10.042 3.255 1.00 7.79 C ATOM 8978 OG1 THR B 146 0.498 8.803 2.822 1.00 10.09 O ATOM 8979 CG2 THR B 146 2.548 10.080 3.053 1.00 3.00 C ATOM 8980 HA THR B 146 0.901 9.242 5.174 1.00 0.00 H ATOM 8981 HB THR B 146 0.631 10.882 2.679 1.00 0.00 H ATOM 8982 HG1 THR B 146 -0.488 8.810 2.913 1.00 0.00 H ATOM 8983 HG23 THR B 146 2.934 11.041 3.391 1.00 0.00 H ATOM 8984 HG21 THR B 146 3.009 9.278 3.630 1.00 0.00 H ATOM 8985 HG22 THR B 146 2.777 9.947 1.996 1.00 0.00 H ATOM 8986 H THR B 146 -1.467 10.466 4.084 1.00 0.00 H ATOM 8987 N ALA B 147 0.872 12.588 5.097 1.00 6.19 N ATOM 8988 CA ALA B 147 1.464 13.807 5.699 1.00 7.36 C ATOM 8989 C ALA B 147 1.355 13.889 7.214 1.00 10.86 C ATOM 8990 O ALA B 147 2.115 14.611 7.887 1.00 13.05 O ATOM 8991 CB ALA B 147 0.908 15.069 5.072 1.00 8.51 C ATOM 8992 HA ALA B 147 2.528 13.725 5.475 1.00 0.00 H ATOM 8993 HB1 ALA B 147 1.129 15.071 4.005 1.00 0.00 H ATOM 8994 HB2 ALA B 147 -0.171 15.102 5.221 1.00 0.00 H ATOM 8995 HB3 ALA B 147 1.367 15.939 5.541 1.00 0.00 H ATOM 8996 H ALA B 147 0.109 12.690 4.398 1.00 0.00 H ATOM 8997 N LEU B 148 0.411 13.163 7.799 1.00 8.43 N ATOM 8998 CA LEU B 148 0.269 13.197 9.252 1.00 9.27 C ATOM 8999 C LEU B 148 1.340 12.381 9.963 1.00 14.17 C ATOM 9000 O LEU B 148 1.500 12.457 11.178 1.00 11.15 O ATOM 9001 CB LEU B 148 -1.108 12.574 9.616 1.00 12.65 C ATOM 9002 CG LEU B 148 -2.218 13.615 9.606 1.00 15.86 C ATOM 9003 CD1 LEU B 148 -3.601 12.998 9.825 1.00 12.62 C ATOM 9004 CD2 LEU B 148 -1.965 14.568 10.758 1.00 11.55 C ATOM 9005 HA LEU B 148 0.361 14.236 9.570 1.00 0.00 H ATOM 9006 HB2 LEU B 148 -1.347 11.796 8.891 1.00 0.00 H ATOM 9007 HB3 LEU B 148 -1.045 12.134 10.611 1.00 0.00 H ATOM 9008 HG LEU B 148 -2.210 14.106 8.633 1.00 0.00 H ATOM 9009 HD21 LEU B 148 -1.973 14.013 11.696 1.00 0.00 H ATOM 9010 HD22 LEU B 148 -0.994 15.046 10.626 1.00 0.00 H ATOM 9011 HD23 LEU B 148 -2.746 15.328 10.777 1.00 0.00 H ATOM 9012 HD11 LEU B 148 -3.807 12.279 9.032 1.00 0.00 H ATOM 9013 HD12 LEU B 148 -3.623 12.492 10.790 1.00 0.00 H ATOM 9014 HD13 LEU B 148 -4.355 13.785 9.809 1.00 0.00 H ATOM 9015 H LEU B 148 -0.225 12.573 7.226 1.00 0.00 H ATOM 9016 N ASN B 149 2.079 11.600 9.194 1.00 5.80 N ATOM 9017 CA ASN B 149 3.087 10.782 9.821 1.00 4.47 C ATOM 9018 C ASN B 149 4.165 11.519 10.578 1.00 13.07 C ATOM 9019 O ASN B 149 4.876 10.922 11.351 1.00 13.72 O ATOM 9020 CB ASN B 149 3.571 9.544 9.025 1.00 7.68 C ATOM 9021 CG ASN B 149 5.026 9.729 8.509 1.00 4.11 C ATOM 9022 OD1 ASN B 149 5.892 8.836 8.651 1.00 9.67 O ATOM 9023 ND2 ASN B 149 5.324 10.860 7.898 1.00 4.05 N ATOM 9024 HA ASN B 149 2.503 10.324 10.619 1.00 0.00 H ATOM 9025 HB2 ASN B 149 3.534 8.669 9.674 1.00 0.00 H ATOM 9026 HB3 ASN B 149 2.910 9.391 8.172 1.00 0.00 H ATOM 9027 HD22 ASN B 149 4.599 11.596 7.784 1.00 0.00 H ATOM 9028 HD21 ASN B 149 6.284 11.015 7.530 1.00 0.00 H ATOM 9029 H ASN B 149 1.937 11.576 8.164 1.00 0.00 H ATOM 9030 N SER B 150 4.268 12.819 10.395 1.00 12.52 N ATOM 9031 CA SER B 150 5.270 13.576 11.136 1.00 10.01 C ATOM 9032 C SER B 150 4.921 13.557 12.618 1.00 16.99 C ATOM 9033 O SER B 150 5.704 13.836 13.501 1.00 15.21 O ATOM 9034 CB SER B 150 5.205 15.011 10.623 1.00 7.51 C ATOM 9035 OG SER B 150 3.923 15.562 10.725 1.00 11.25 O ATOM 9036 HA SER B 150 6.265 13.151 11.002 1.00 0.00 H ATOM 9037 HB2 SER B 150 5.507 15.022 9.576 1.00 0.00 H ATOM 9038 HB3 SER B 150 5.895 15.622 11.205 1.00 0.00 H ATOM 9039 HG SER B 150 3.641 15.565 11.674 1.00 0.00 H ATOM 9040 H SER B 150 3.637 13.304 9.725 1.00 0.00 H ATOM 9041 N GLU B 151 3.691 13.205 12.948 1.00 11.95 N ATOM 9042 CA GLU B 151 3.243 13.166 14.310 1.00 17.18 C ATOM 9043 C GLU B 151 3.331 11.760 14.876 1.00 10.56 C ATOM 9044 O GLU B 151 2.986 11.578 16.040 1.00 14.26 O ATOM 9045 CB GLU B 151 1.740 13.562 14.395 1.00 18.66 C ATOM 9046 CG GLU B 151 1.287 14.826 13.636 1.00 28.21 C ATOM 9047 CD GLU B 151 2.118 16.005 14.003 1.00 52.47 C ATOM 9048 OE1 GLU B 151 1.873 16.395 15.245 1.00 37.33 O ATOM 9049 OE2 GLU B 151 2.887 16.532 13.207 1.00 47.61 O ATOM 9050 HA GLU B 151 3.878 13.854 14.867 1.00 0.00 H ATOM 9051 HB2 GLU B 151 1.160 12.724 14.008 1.00 0.00 H ATOM 9052 HB3 GLU B 151 1.502 13.711 15.448 1.00 0.00 H ATOM 9053 HG2 GLU B 151 1.376 14.648 12.564 1.00 0.00 H ATOM 9054 HG3 GLU B 151 0.246 15.035 13.883 1.00 0.00 H ATOM 9055 H GLU B 151 3.024 12.947 12.193 1.00 0.00 H ATOM 9056 N SER B 152 3.770 10.773 14.083 1.00 5.08 N ATOM 9057 CA SER B 152 3.836 9.407 14.591 1.00 5.23 C ATOM 9058 C SER B 152 4.597 9.139 15.873 1.00 6.85 C ATOM 9059 O SER B 152 5.819 9.365 15.971 1.00 9.07 O ATOM 9060 CB SER B 152 4.152 8.413 13.455 1.00 3.07 C ATOM 9061 OG SER B 152 4.207 7.118 13.960 1.00 7.39 O ATOM 9062 HA SER B 152 2.824 9.231 14.956 1.00 0.00 H ATOM 9063 HB2 SER B 152 5.113 8.668 13.008 1.00 0.00 H ATOM 9064 HB3 SER B 152 3.372 8.472 12.695 1.00 0.00 H ATOM 9065 HG SER B 152 3.334 6.885 14.364 1.00 0.00 H ATOM 9066 H SER B 152 4.063 10.980 13.107 1.00 0.00 H ATOM 9067 N ASN B 153 3.894 8.605 16.883 1.00 7.07 N ATOM 9068 CA ASN B 153 4.605 8.290 18.114 1.00 5.82 C ATOM 9069 C ASN B 153 5.432 7.011 17.912 1.00 7.82 C ATOM 9070 O ASN B 153 6.497 6.833 18.478 1.00 9.39 O ATOM 9071 CB ASN B 153 3.598 8.186 19.296 1.00 7.48 C ATOM 9072 CG ASN B 153 2.783 9.499 19.471 1.00 20.05 C ATOM 9073 OD1 ASN B 153 1.734 9.618 20.191 1.00 40.93 O ATOM 9074 ND2 ASN B 153 3.086 10.471 18.617 1.00 80.00 N ATOM 9075 HA ASN B 153 5.303 9.088 18.368 1.00 0.00 H ATOM 9076 HB2 ASN B 153 2.908 7.364 19.102 1.00 0.00 H ATOM 9077 HB3 ASN B 153 4.150 7.987 20.215 1.00 0.00 H ATOM 9078 HD22 ASN B 153 3.935 10.394 18.022 1.00 0.00 H ATOM 9079 HD21 ASN B 153 2.474 11.309 18.544 1.00 0.00 H ATOM 9080 H ASN B 153 2.874 8.422 16.790 1.00 0.00 H ATOM 9081 N PHE B 154 4.930 6.114 17.043 1.00 5.44 N ATOM 9082 CA PHE B 154 5.644 4.868 16.765 1.00 8.90 C ATOM 9083 C PHE B 154 6.938 5.145 16.009 1.00 9.62 C ATOM 9084 O PHE B 154 8.013 4.646 16.342 1.00 9.19 O ATOM 9085 CB PHE B 154 4.753 3.917 16.007 1.00 9.42 C ATOM 9086 CG PHE B 154 5.517 2.677 15.663 1.00 7.21 C ATOM 9087 CD1 PHE B 154 5.631 1.634 16.578 1.00 12.35 C ATOM 9088 CD2 PHE B 154 6.173 2.528 14.442 1.00 9.49 C ATOM 9089 CE1 PHE B 154 6.370 0.489 16.278 1.00 16.58 C ATOM 9090 CE2 PHE B 154 6.910 1.392 14.105 1.00 9.53 C ATOM 9091 CZ PHE B 154 7.001 0.358 15.040 1.00 17.79 C ATOM 9092 HA PHE B 154 5.913 4.397 17.711 1.00 0.00 H ATOM 9093 HB2 PHE B 154 3.894 3.654 16.625 1.00 0.00 H ATOM 9094 HB3 PHE B 154 4.407 4.396 15.091 1.00 0.00 H ATOM 9095 HD2 PHE B 154 6.107 3.338 13.716 1.00 0.00 H ATOM 9096 HE2 PHE B 154 7.403 1.313 13.136 1.00 0.00 H ATOM 9097 HZ PHE B 154 7.562 -0.546 14.804 1.00 0.00 H ATOM 9098 HE1 PHE B 154 6.455 -0.309 17.016 1.00 0.00 H ATOM 9099 HD1 PHE B 154 5.135 1.713 17.545 1.00 0.00 H ATOM 9100 H PHE B 154 4.027 6.308 16.565 1.00 0.00 H ATOM 9101 N ALA B 155 6.840 5.979 14.967 1.00 7.49 N ATOM 9102 CA ALA B 155 7.993 6.324 14.155 1.00 7.07 C ATOM 9103 C ALA B 155 9.068 6.909 15.061 1.00 17.55 C ATOM 9104 O ALA B 155 10.254 6.611 14.929 1.00 12.25 O ATOM 9105 CB ALA B 155 7.664 7.178 12.914 1.00 8.27 C ATOM 9106 HA ALA B 155 8.385 5.414 13.701 1.00 0.00 H ATOM 9107 HB1 ALA B 155 6.973 6.632 12.272 1.00 0.00 H ATOM 9108 HB2 ALA B 155 7.205 8.115 13.230 1.00 0.00 H ATOM 9109 HB3 ALA B 155 8.582 7.389 12.366 1.00 0.00 H ATOM 9110 H ALA B 155 5.914 6.391 14.733 1.00 0.00 H ATOM 9111 N ARG B 156 8.637 7.745 15.983 1.00 12.35 N ATOM 9112 CA ARG B 156 9.492 8.410 16.953 1.00 12.93 C ATOM 9113 C ARG B 156 10.140 7.440 17.911 1.00 11.11 C ATOM 9114 O ARG B 156 11.351 7.510 18.137 1.00 16.86 O ATOM 9115 CB ARG B 156 8.719 9.535 17.651 1.00 17.00 C ATOM 9116 CG ARG B 156 9.548 10.354 18.630 1.00 68.60 C ATOM 9117 CD ARG B 156 8.780 11.507 19.287 1.00 45.67 C ATOM 9118 NE ARG B 156 7.679 12.029 18.456 1.00 80.00 N ATOM 9119 CZ ARG B 156 6.417 12.180 18.897 1.00 80.00 C ATOM 9120 NH1 ARG B 156 6.099 11.862 20.165 1.00 48.74 N ATOM 9121 NH2 ARG B 156 5.472 12.664 18.065 1.00 49.58 N ATOM 9122 HA ARG B 156 10.325 8.870 16.422 1.00 0.00 H ATOM 9123 HB2 ARG B 156 8.331 10.208 16.886 1.00 0.00 H ATOM 9124 HB3 ARG B 156 7.887 9.090 18.197 1.00 0.00 H ATOM 9125 HG2 ARG B 156 9.906 9.689 19.416 1.00 0.00 H ATOM 9126 HG3 ARG B 156 10.400 10.771 18.093 1.00 0.00 H ATOM 9127 HD2 ARG B 156 9.479 12.320 19.484 1.00 0.00 H ATOM 9128 HD3 ARG B 156 8.363 11.152 20.229 1.00 0.00 H ATOM 9129 HE ARG B 156 7.890 12.296 17.473 1.00 0.00 H ATOM 9130 HH12 ARG B 156 5.122 11.980 20.501 1.00 0.00 H ATOM 9131 HH11 ARG B 156 6.830 11.498 20.809 1.00 0.00 H ATOM 9132 HH22 ARG B 156 4.495 12.783 18.401 1.00 0.00 H ATOM 9133 HH21 ARG B 156 5.721 12.918 17.088 1.00 0.00 H ATOM 9134 H ARG B 156 7.617 7.943 16.020 1.00 0.00 H ATOM 9135 N ALA B 157 9.397 6.508 18.483 1.00 13.63 N ATOM 9136 CA ALA B 157 9.985 5.566 19.385 1.00 10.96 C ATOM 9137 C ALA B 157 10.937 4.654 18.678 1.00 10.57 C ATOM 9138 O ALA B 157 11.946 4.307 19.233 1.00 18.37 O ATOM 9139 CB ALA B 157 8.889 4.758 20.046 1.00 9.39 C ATOM 9140 HA ALA B 157 10.549 6.115 20.139 1.00 0.00 H ATOM 9141 HB1 ALA B 157 8.227 5.427 20.596 1.00 0.00 H ATOM 9142 HB2 ALA B 157 8.320 4.228 19.283 1.00 0.00 H ATOM 9143 HB3 ALA B 157 9.334 4.039 20.734 1.00 0.00 H ATOM 9144 H ALA B 157 8.379 6.459 18.276 1.00 0.00 H ATOM 9145 N TYR B 158 10.582 4.258 17.465 1.00 10.94 N ATOM 9146 CA TYR B 158 11.402 3.391 16.647 1.00 6.79 C ATOM 9147 C TYR B 158 12.778 4.062 16.488 1.00 10.98 C ATOM 9148 O TYR B 158 13.830 3.513 16.766 1.00 9.88 O ATOM 9149 CB TYR B 158 10.793 2.999 15.269 1.00 7.13 C ATOM 9150 CG TYR B 158 11.755 1.998 14.646 1.00 5.45 C ATOM 9151 CD1 TYR B 158 12.883 2.382 13.913 1.00 7.67 C ATOM 9152 CD2 TYR B 158 11.579 0.629 14.839 1.00 10.64 C ATOM 9153 CE1 TYR B 158 13.802 1.482 13.369 1.00 14.44 C ATOM 9154 CE2 TYR B 158 12.460 -0.303 14.272 1.00 7.52 C ATOM 9155 CZ TYR B 158 13.596 0.113 13.571 1.00 8.90 C ATOM 9156 OH TYR B 158 14.476 -0.833 13.066 1.00 11.56 O ATOM 9157 HA TYR B 158 11.480 2.434 17.164 1.00 0.00 H ATOM 9158 HB3 TYR B 158 10.700 3.879 14.633 1.00 0.00 H ATOM 9159 HB2 TYR B 158 9.811 2.545 15.405 1.00 0.00 H ATOM 9160 HD2 TYR B 158 10.742 0.277 15.441 1.00 0.00 H ATOM 9161 HE2 TYR B 158 12.256 -1.368 14.379 1.00 0.00 H ATOM 9162 HE1 TYR B 158 14.661 1.838 12.800 1.00 0.00 H ATOM 9163 HD1 TYR B 158 13.055 3.447 13.757 1.00 0.00 H ATOM 9164 HH TYR B 158 15.220 -0.375 12.601 1.00 0.00 H ATOM 9165 H TYR B 158 9.672 4.585 17.083 1.00 0.00 H ATOM 9166 N ALA B 159 12.778 5.332 16.067 1.00 11.39 N ATOM 9167 CA ALA B 159 13.985 6.104 15.893 1.00 13.84 C ATOM 9168 C ALA B 159 14.820 6.217 17.161 1.00 21.79 C ATOM 9169 O ALA B 159 16.031 6.330 17.099 1.00 18.31 O ATOM 9170 CB ALA B 159 13.673 7.484 15.334 1.00 14.49 C ATOM 9171 HA ALA B 159 14.591 5.555 15.172 1.00 0.00 H ATOM 9172 HB1 ALA B 159 13.181 7.380 14.367 1.00 0.00 H ATOM 9173 HB2 ALA B 159 13.015 8.013 16.023 1.00 0.00 H ATOM 9174 HB3 ALA B 159 14.600 8.044 15.213 1.00 0.00 H ATOM 9175 H ALA B 159 11.866 5.784 15.855 1.00 0.00 H ATOM 9176 N GLU B 160 14.167 6.184 18.311 1.00 19.74 N ATOM 9177 CA GLU B 160 14.864 6.268 19.587 1.00 15.34 C ATOM 9178 C GLU B 160 15.443 4.914 19.993 1.00 24.45 C ATOM 9179 O GLU B 160 16.192 4.848 20.946 1.00 31.61 O ATOM 9180 CB GLU B 160 14.006 6.869 20.704 1.00 23.35 C ATOM 9181 CG GLU B 160 14.478 8.308 21.010 1.00 73.92 C ATOM 9182 CD GLU B 160 13.528 9.425 20.656 1.00 80.00 C ATOM 9183 OE1 GLU B 160 12.491 9.477 21.481 1.00 47.26 O ATOM 9184 OE2 GLU B 160 13.820 10.310 19.846 1.00 80.00 O ATOM 9185 HA GLU B 160 15.692 6.961 19.438 1.00 0.00 H ATOM 9186 HB2 GLU B 160 12.963 6.889 20.388 1.00 0.00 H ATOM 9187 HB3 GLU B 160 14.101 6.258 21.602 1.00 0.00 H ATOM 9188 HG2 GLU B 160 14.676 8.370 22.080 1.00 0.00 H ATOM 9189 HG3 GLU B 160 15.404 8.476 20.460 1.00 0.00 H ATOM 9190 H GLU B 160 13.131 6.096 18.304 1.00 0.00 H ATOM 9191 N GLY B 161 15.122 3.826 19.293 1.00 13.32 N ATOM 9192 CA GLY B 161 15.702 2.559 19.640 1.00 14.88 C ATOM 9193 C GLY B 161 14.920 1.729 20.619 1.00 17.89 C ATOM 9194 O GLY B 161 15.453 0.866 21.311 1.00 19.51 O ATOM 9195 HA3 GLY B 161 16.685 2.748 20.071 1.00 0.00 H ATOM 9196 HA2 GLY B 161 15.814 1.979 18.724 1.00 0.00 H ATOM 9197 H GLY B 161 14.454 3.894 18.499 1.00 0.00 H ATOM 9198 N ILE B 162 13.650 1.962 20.661 1.00 13.32 N ATOM 9199 CA ILE B 162 12.852 1.165 21.566 1.00 9.51 C ATOM 9200 C ILE B 162 12.980 -0.363 21.327 1.00 13.61 C ATOM 9201 O ILE B 162 13.118 -0.857 20.206 1.00 11.85 O ATOM 9202 CB ILE B 162 11.417 1.680 21.372 1.00 22.21 C ATOM 9203 CG1 ILE B 162 10.600 1.430 22.612 1.00 29.94 C ATOM 9204 CG2 ILE B 162 10.738 1.108 20.129 1.00 21.26 C ATOM 9205 CD1 ILE B 162 11.118 2.263 23.781 1.00 42.39 C ATOM 9206 HA ILE B 162 13.192 1.277 22.596 1.00 0.00 H ATOM 9207 HB ILE B 162 11.483 2.755 21.205 1.00 0.00 H ATOM 9208 HG12 ILE B 162 9.562 1.697 22.416 1.00 0.00 H ATOM 9209 HG13 ILE B 162 10.659 0.373 22.872 1.00 0.00 H ATOM 9210 HD11 ILE B 162 12.155 1.997 23.984 1.00 0.00 H ATOM 9211 HD12 ILE B 162 11.056 3.321 23.527 1.00 0.00 H ATOM 9212 HD13 ILE B 162 10.511 2.064 24.664 1.00 0.00 H ATOM 9213 HG21 ILE B 162 11.311 1.384 19.244 1.00 0.00 H ATOM 9214 HG22 ILE B 162 10.692 0.022 20.209 1.00 0.00 H ATOM 9215 HG23 ILE B 162 9.728 1.511 20.050 1.00 0.00 H ATOM 9216 H ILE B 162 13.217 2.696 20.065 1.00 0.00 H ATOM 9217 N ASN B 163 12.959 -1.142 22.392 1.00 3.38 N ATOM 9218 CA ASN B 163 13.039 -2.581 22.289 1.00 5.03 C ATOM 9219 C ASN B 163 11.747 -3.031 21.596 1.00 9.84 C ATOM 9220 O ASN B 163 10.664 -2.510 21.900 1.00 12.07 O ATOM 9221 CB ASN B 163 13.062 -3.099 23.760 1.00 11.03 C ATOM 9222 CG ASN B 163 13.303 -4.599 23.860 1.00 21.48 C ATOM 9223 OD1 ASN B 163 12.608 -5.396 23.218 1.00 10.94 O ATOM 9224 ND2 ASN B 163 14.298 -4.994 24.652 1.00 9.56 N ATOM 9225 HA ASN B 163 13.906 -2.945 21.737 1.00 0.00 H ATOM 9226 HB2 ASN B 163 13.857 -2.583 24.298 1.00 0.00 H ATOM 9227 HB3 ASN B 163 12.103 -2.870 24.224 1.00 0.00 H ATOM 9228 HD22 ASN B 163 14.858 -4.290 25.174 1.00 0.00 H ATOM 9229 HD21 ASN B 163 14.515 -6.006 24.748 1.00 0.00 H ATOM 9230 H ASN B 163 12.883 -0.707 23.334 1.00 0.00 H ATOM 9231 N ARG B 164 11.876 -4.006 20.696 1.00 10.26 N ATOM 9232 CA ARG B 164 10.751 -4.517 19.952 1.00 9.94 C ATOM 9233 C ARG B 164 9.574 -4.999 20.747 1.00 9.68 C ATOM 9234 O ARG B 164 8.427 -5.015 20.267 1.00 12.96 O ATOM 9235 CB ARG B 164 11.208 -5.518 18.900 1.00 14.82 C ATOM 9236 CG ARG B 164 12.037 -6.611 19.522 1.00 35.37 C ATOM 9237 CD ARG B 164 11.799 -7.936 18.823 1.00 80.00 C ATOM 9238 NE ARG B 164 12.740 -8.152 17.735 1.00 68.36 N ATOM 9239 CZ ARG B 164 12.535 -8.986 16.703 1.00 36.29 C ATOM 9240 NH1 ARG B 164 11.417 -9.715 16.555 1.00 80.00 N ATOM 9241 NH2 ARG B 164 13.506 -9.060 15.792 1.00 80.00 N ATOM 9242 HA ARG B 164 10.336 -3.641 19.454 1.00 0.00 H ATOM 9243 HB2 ARG B 164 10.333 -5.960 18.424 1.00 0.00 H ATOM 9244 HB3 ARG B 164 11.805 -5.000 18.150 1.00 0.00 H ATOM 9245 HG2 ARG B 164 13.092 -6.349 19.441 1.00 0.00 H ATOM 9246 HG3 ARG B 164 11.768 -6.709 20.574 1.00 0.00 H ATOM 9247 HD2 ARG B 164 10.786 -7.945 18.420 1.00 0.00 H ATOM 9248 HD3 ARG B 164 11.908 -8.742 19.549 1.00 0.00 H ATOM 9249 HE ARG B 164 13.635 -7.623 17.758 1.00 0.00 H ATOM 9250 HH12 ARG B 164 11.312 -10.345 15.735 1.00 0.00 H ATOM 9251 HH11 ARG B 164 10.656 -9.649 17.261 1.00 0.00 H ATOM 9252 HH22 ARG B 164 13.402 -9.690 14.971 1.00 0.00 H ATOM 9253 HH21 ARG B 164 14.368 -8.488 15.903 1.00 0.00 H ATOM 9254 H ARG B 164 12.818 -4.411 20.525 1.00 0.00 H ATOM 9255 N THR B 165 9.734 -5.441 22.004 1.00 5.92 N ATOM 9256 CA THR B 165 8.599 -5.912 22.817 1.00 7.39 C ATOM 9257 C THR B 165 7.594 -4.794 23.107 1.00 5.39 C ATOM 9258 O THR B 165 6.432 -5.044 23.410 1.00 13.68 O ATOM 9259 CB THR B 165 9.028 -6.605 24.158 1.00 13.63 C ATOM 9260 OG1 THR B 165 9.700 -5.686 25.065 1.00 21.05 O ATOM 9261 CG2 THR B 165 9.981 -7.743 23.808 1.00 19.11 C ATOM 9262 HA THR B 165 8.116 -6.671 22.203 1.00 0.00 H ATOM 9263 HB THR B 165 8.133 -6.965 24.665 1.00 0.00 H ATOM 9264 HG1 THR B 165 10.515 -5.330 24.629 1.00 0.00 H ATOM 9265 HG23 THR B 165 9.484 -8.435 23.129 1.00 0.00 H ATOM 9266 HG21 THR B 165 10.870 -7.336 23.327 1.00 0.00 H ATOM 9267 HG22 THR B 165 10.267 -8.268 24.719 1.00 0.00 H ATOM 9268 H THR B 165 10.688 -5.451 22.417 1.00 0.00 H ATOM 9269 N LYS B 166 8.014 -3.503 22.975 1.00 5.96 N ATOM 9270 CA LYS B 166 7.080 -2.445 23.259 1.00 10.23 C ATOM 9271 C LYS B 166 6.398 -1.808 22.074 1.00 11.25 C ATOM 9272 O LYS B 166 5.677 -0.849 22.300 1.00 11.43 O ATOM 9273 CB LYS B 166 7.803 -1.395 24.049 1.00 10.31 C ATOM 9274 CG LYS B 166 7.925 -1.766 25.518 1.00 27.59 C ATOM 9275 CD LYS B 166 8.491 -0.648 26.355 1.00 41.23 C ATOM 9276 CE LYS B 166 7.433 -0.148 27.306 1.00 31.89 C ATOM 9277 NZ LYS B 166 6.326 0.513 26.596 1.00 63.59 N ATOM 9278 HA LYS B 166 6.262 -2.912 23.808 1.00 0.00 H ATOM 9279 HB2 LYS B 166 8.803 -1.269 23.634 1.00 0.00 H ATOM 9280 HB3 LYS B 166 7.256 -0.455 23.968 1.00 0.00 H ATOM 9281 HG2 LYS B 166 6.935 -2.019 25.897 1.00 0.00 H ATOM 9282 HG3 LYS B 166 8.579 -2.633 25.606 1.00 0.00 H ATOM 9283 HD2 LYS B 166 9.346 -1.015 26.923 1.00 0.00 H ATOM 9284 HD3 LYS B 166 8.811 0.167 25.705 1.00 0.00 H ATOM 9285 HE2 LYS B 166 7.886 0.565 27.995 1.00 0.00 H ATOM 9286 HE3 LYS B 166 7.037 -0.993 27.869 1.00 0.00 H ATOM 9287 HZ1 LYS B 166 6.695 1.325 26.061 1.00 0.00 H ATOM 9288 HZ2 LYS B 166 5.883 -0.163 25.941 1.00 0.00 H ATOM 9289 HZ3 LYS B 166 5.621 0.842 27.286 1.00 0.00 H ATOM 9290 H LYS B 166 8.987 -3.288 22.676 1.00 0.00 H ATOM 9291 N TYR B 167 6.676 -2.311 20.855 1.00 4.95 N ATOM 9292 CA TYR B 167 6.085 -1.783 19.657 1.00 5.03 C ATOM 9293 C TYR B 167 4.569 -1.565 19.836 1.00 7.67 C ATOM 9294 O TYR B 167 4.027 -0.484 19.564 1.00 13.01 O ATOM 9295 CB TYR B 167 6.297 -2.665 18.398 1.00 4.59 C ATOM 9296 CG TYR B 167 7.706 -2.688 17.896 1.00 5.35 C ATOM 9297 CD1 TYR B 167 8.649 -1.723 18.274 1.00 3.85 C ATOM 9298 CD2 TYR B 167 8.092 -3.683 17.002 1.00 6.13 C ATOM 9299 CE1 TYR B 167 9.957 -1.757 17.782 1.00 8.30 C ATOM 9300 CE2 TYR B 167 9.400 -3.732 16.518 1.00 8.42 C ATOM 9301 CZ TYR B 167 10.328 -2.763 16.895 1.00 7.58 C ATOM 9302 OH TYR B 167 11.625 -2.829 16.427 1.00 11.55 O ATOM 9303 HA TYR B 167 6.602 -0.838 19.492 1.00 0.00 H ATOM 9304 HB3 TYR B 167 5.656 -2.285 17.602 1.00 0.00 H ATOM 9305 HB2 TYR B 167 6.004 -3.686 18.642 1.00 0.00 H ATOM 9306 HD2 TYR B 167 7.367 -4.429 16.678 1.00 0.00 H ATOM 9307 HE2 TYR B 167 9.698 -4.533 15.841 1.00 0.00 H ATOM 9308 HE1 TYR B 167 10.680 -1.002 18.090 1.00 0.00 H ATOM 9309 HD1 TYR B 167 8.357 -0.931 18.964 1.00 0.00 H ATOM 9310 HH TYR B 167 12.145 -2.069 16.790 1.00 0.00 H ATOM 9311 H TYR B 167 7.340 -3.108 20.779 1.00 0.00 H ATOM 9312 N TRP B 168 3.851 -2.567 20.265 1.00 7.66 N ATOM 9313 CA TRP B 168 2.390 -2.434 20.434 1.00 6.94 C ATOM 9314 C TRP B 168 1.903 -1.214 21.194 1.00 7.48 C ATOM 9315 O TRP B 168 0.856 -0.681 20.906 1.00 6.19 O ATOM 9316 CB TRP B 168 1.709 -3.733 20.910 1.00 8.35 C ATOM 9317 CG TRP B 168 1.792 -3.883 22.413 1.00 10.11 C ATOM 9318 CD1 TRP B 168 2.768 -4.547 23.093 1.00 14.89 C ATOM 9319 CD2 TRP B 168 0.915 -3.297 23.387 1.00 6.38 C ATOM 9320 NE1 TRP B 168 2.548 -4.439 24.459 1.00 17.38 N ATOM 9321 CE2 TRP B 168 1.403 -3.688 24.669 1.00 16.13 C ATOM 9322 CE3 TRP B 168 -0.264 -2.506 23.307 1.00 10.70 C ATOM 9323 CZ2 TRP B 168 0.738 -3.278 25.843 1.00 21.05 C ATOM 9324 CZ3 TRP B 168 -0.918 -2.132 24.466 1.00 11.50 C ATOM 9325 CH2 TRP B 168 -0.409 -2.495 25.719 1.00 14.71 C ATOM 9326 HA TRP B 168 2.057 -2.245 19.413 1.00 0.00 H ATOM 9327 HB2 TRP B 168 0.660 -3.713 20.613 1.00 0.00 H ATOM 9328 HB3 TRP B 168 2.202 -4.584 20.441 1.00 0.00 H ATOM 9329 HE1 TRP B 168 3.145 -4.854 25.203 1.00 0.00 H ATOM 9330 HD1 TRP B 168 3.598 -5.083 22.633 1.00 0.00 H ATOM 9331 HZ2 TRP B 168 1.112 -3.567 26.825 1.00 0.00 H ATOM 9332 HH2 TRP B 168 -0.922 -2.157 26.619 1.00 0.00 H ATOM 9333 HZ3 TRP B 168 -1.837 -1.550 24.404 1.00 0.00 H ATOM 9334 HE3 TRP B 168 -0.650 -2.196 22.336 1.00 0.00 H ATOM 9335 H TRP B 168 4.314 -3.471 20.491 1.00 0.00 H ATOM 9336 N GLU B 169 2.672 -0.784 22.201 1.00 9.89 N ATOM 9337 CA GLU B 169 2.246 0.363 23.014 1.00 6.91 C ATOM 9338 C GLU B 169 2.184 1.592 22.185 1.00 7.12 C ATOM 9339 O GLU B 169 1.236 2.351 22.344 1.00 8.12 O ATOM 9340 CB GLU B 169 3.135 0.537 24.300 1.00 3.09 C ATOM 9341 CG GLU B 169 3.181 -0.836 25.017 1.00 10.08 C ATOM 9342 CD GLU B 169 3.831 -0.724 26.378 1.00 18.24 C ATOM 9343 OE1 GLU B 169 3.554 0.421 26.944 1.00 25.75 O ATOM 9344 OE2 GLU B 169 4.563 -1.572 26.877 1.00 35.36 O ATOM 9345 HA GLU B 169 1.238 0.167 23.379 1.00 0.00 H ATOM 9346 HB2 GLU B 169 4.142 0.845 24.019 1.00 0.00 H ATOM 9347 HB3 GLU B 169 2.697 1.287 24.958 1.00 0.00 H ATOM 9348 HG2 GLU B 169 2.164 -1.208 25.139 1.00 0.00 H ATOM 9349 HG3 GLU B 169 3.752 -1.536 24.407 1.00 0.00 H ATOM 9350 H GLU B 169 3.572 -1.262 22.408 1.00 0.00 H ATOM 9351 N PHE B 170 3.175 1.776 21.297 1.00 3.02 N ATOM 9352 CA PHE B 170 3.185 2.952 20.447 1.00 9.68 C ATOM 9353 C PHE B 170 2.237 2.845 19.263 1.00 3.67 C ATOM 9354 O PHE B 170 1.681 3.871 18.819 1.00 9.04 O ATOM 9355 CB PHE B 170 4.581 3.347 20.008 1.00 9.44 C ATOM 9356 CG PHE B 170 5.397 3.597 21.229 1.00 14.54 C ATOM 9357 CD1 PHE B 170 5.482 4.831 21.878 1.00 17.56 C ATOM 9358 CD2 PHE B 170 6.096 2.494 21.709 1.00 17.63 C ATOM 9359 CE1 PHE B 170 6.273 4.968 23.026 1.00 23.03 C ATOM 9360 CE2 PHE B 170 6.879 2.621 22.850 1.00 24.72 C ATOM 9361 CZ PHE B 170 6.961 3.851 23.504 1.00 18.20 C ATOM 9362 HA PHE B 170 2.807 3.759 21.075 1.00 0.00 H ATOM 9363 HB2 PHE B 170 5.027 2.542 19.424 1.00 0.00 H ATOM 9364 HB3 PHE B 170 4.536 4.252 19.402 1.00 0.00 H ATOM 9365 HD2 PHE B 170 6.030 1.536 21.193 1.00 0.00 H ATOM 9366 HE2 PHE B 170 7.428 1.761 23.234 1.00 0.00 H ATOM 9367 HZ PHE B 170 7.572 3.941 24.402 1.00 0.00 H ATOM 9368 HE1 PHE B 170 6.350 5.928 23.536 1.00 0.00 H ATOM 9369 HD1 PHE B 170 4.932 5.689 21.491 1.00 0.00 H ATOM 9370 H PHE B 170 3.938 1.073 21.218 1.00 0.00 H ATOM 9371 N VAL B 171 2.021 1.631 18.783 1.00 7.02 N ATOM 9372 CA VAL B 171 1.087 1.484 17.699 1.00 8.35 C ATOM 9373 C VAL B 171 -0.295 1.827 18.263 1.00 9.77 C ATOM 9374 O VAL B 171 -1.114 2.491 17.649 1.00 8.23 O ATOM 9375 CB VAL B 171 1.105 0.035 17.223 1.00 3.32 C ATOM 9376 CG1 VAL B 171 -0.079 -0.284 16.300 1.00 6.49 C ATOM 9377 CG2 VAL B 171 2.376 -0.127 16.383 1.00 7.35 C ATOM 9378 HA VAL B 171 1.337 2.131 16.859 1.00 0.00 H ATOM 9379 HB VAL B 171 1.057 -0.624 18.090 1.00 0.00 H ATOM 9380 HG11 VAL B 171 -1.012 -0.114 16.836 1.00 0.00 H ATOM 9381 HG12 VAL B 171 -0.039 0.363 15.423 1.00 0.00 H ATOM 9382 HG13 VAL B 171 -0.023 -1.327 15.987 1.00 0.00 H ATOM 9383 HG21 VAL B 171 2.342 0.562 15.539 1.00 0.00 H ATOM 9384 HG22 VAL B 171 3.248 0.093 16.999 1.00 0.00 H ATOM 9385 HG23 VAL B 171 2.439 -1.151 16.015 1.00 0.00 H ATOM 9386 H VAL B 171 2.513 0.805 19.179 1.00 0.00 H ATOM 9387 N TYR B 172 -0.619 1.418 19.469 1.00 5.86 N ATOM 9388 CA TYR B 172 -1.908 1.708 20.069 1.00 3.00 C ATOM 9389 C TYR B 172 -2.164 3.238 20.138 1.00 5.31 C ATOM 9390 O TYR B 172 -3.242 3.734 19.827 1.00 7.43 O ATOM 9391 CB TYR B 172 -1.927 1.076 21.498 1.00 7.32 C ATOM 9392 CG TYR B 172 -3.027 1.641 22.393 1.00 7.00 C ATOM 9393 CD1 TYR B 172 -2.910 2.865 23.072 1.00 9.48 C ATOM 9394 CD2 TYR B 172 -4.237 0.958 22.514 1.00 6.17 C ATOM 9395 CE1 TYR B 172 -3.922 3.385 23.888 1.00 15.33 C ATOM 9396 CE2 TYR B 172 -5.259 1.467 23.312 1.00 7.78 C ATOM 9397 CZ TYR B 172 -5.123 2.672 24.002 1.00 12.07 C ATOM 9398 OH TYR B 172 -6.191 3.062 24.769 1.00 8.34 O ATOM 9399 HA TYR B 172 -2.704 1.282 19.459 1.00 0.00 H ATOM 9400 HB3 TYR B 172 -0.964 1.264 21.973 1.00 0.00 H ATOM 9401 HB2 TYR B 172 -2.079 0.001 21.399 1.00 0.00 H ATOM 9402 HD2 TYR B 172 -4.384 0.019 21.980 1.00 0.00 H ATOM 9403 HE2 TYR B 172 -6.191 0.908 23.400 1.00 0.00 H ATOM 9404 HE1 TYR B 172 -3.779 4.324 24.423 1.00 0.00 H ATOM 9405 HD1 TYR B 172 -1.989 3.436 22.958 1.00 0.00 H ATOM 9406 HH TYR B 172 -5.983 3.924 25.209 1.00 0.00 H ATOM 9407 H TYR B 172 0.074 0.866 20.014 1.00 0.00 H ATOM 9408 N GLU B 173 -1.139 3.980 20.539 1.00 8.02 N ATOM 9409 CA GLU B 173 -1.288 5.421 20.621 1.00 7.47 C ATOM 9410 C GLU B 173 -1.544 6.037 19.284 1.00 10.11 C ATOM 9411 O GLU B 173 -2.450 6.850 19.217 1.00 11.39 O ATOM 9412 CB GLU B 173 -0.110 6.154 21.284 1.00 3.00 C ATOM 9413 CG GLU B 173 0.116 5.553 22.713 1.00 7.00 C ATOM 9414 CD GLU B 173 -0.880 6.001 23.772 1.00 12.79 C ATOM 9415 OE1 GLU B 173 -1.643 6.996 23.380 1.00 15.64 O ATOM 9416 OE2 GLU B 173 -1.103 5.384 24.810 1.00 11.40 O ATOM 9417 HA GLU B 173 -2.156 5.551 21.268 1.00 0.00 H ATOM 9418 HB2 GLU B 173 0.790 6.021 20.683 1.00 0.00 H ATOM 9419 HB3 GLU B 173 -0.338 7.217 21.365 1.00 0.00 H ATOM 9420 HG2 GLU B 173 0.059 4.467 22.635 1.00 0.00 H ATOM 9421 HG3 GLU B 173 1.113 5.840 23.046 1.00 0.00 H ATOM 9422 H GLU B 173 -0.236 3.532 20.793 1.00 0.00 H ATOM 9423 N ASP B 174 -0.728 5.659 18.274 1.00 7.58 N ATOM 9424 CA ASP B 174 -0.940 6.218 16.947 1.00 5.83 C ATOM 9425 C ASP B 174 -2.291 5.764 16.411 1.00 11.47 C ATOM 9426 O ASP B 174 -2.964 6.466 15.692 1.00 7.11 O ATOM 9427 CB ASP B 174 0.125 5.754 15.967 1.00 4.74 C ATOM 9428 CG ASP B 174 1.447 6.446 16.123 1.00 7.85 C ATOM 9429 OD1 ASP B 174 1.325 7.683 16.595 1.00 8.03 O ATOM 9430 OD2 ASP B 174 2.411 6.088 15.478 1.00 8.47 O ATOM 9431 HA ASP B 174 -0.895 7.303 17.040 1.00 0.00 H ATOM 9432 HB2 ASP B 174 0.279 4.685 16.110 1.00 0.00 H ATOM 9433 HB3 ASP B 174 -0.239 5.935 14.955 1.00 0.00 H ATOM 9434 H ASP B 174 0.040 4.979 18.443 1.00 0.00 H ATOM 9435 N ALA B 175 -2.736 4.554 16.786 1.00 3.25 N ATOM 9436 CA ALA B 175 -4.046 4.077 16.303 1.00 11.63 C ATOM 9437 C ALA B 175 -5.225 4.923 16.797 1.00 11.15 C ATOM 9438 O ALA B 175 -6.144 5.339 16.072 1.00 7.46 O ATOM 9439 CB ALA B 175 -4.287 2.600 16.687 1.00 6.31 C ATOM 9440 HA ALA B 175 -4.001 4.175 15.218 1.00 0.00 H ATOM 9441 HB1 ALA B 175 -3.508 1.979 16.244 1.00 0.00 H ATOM 9442 HB2 ALA B 175 -4.261 2.499 17.772 1.00 0.00 H ATOM 9443 HB3 ALA B 175 -5.261 2.283 16.315 1.00 0.00 H ATOM 9444 H ALA B 175 -2.161 3.956 17.413 1.00 0.00 H ATOM 9445 N MET B 176 -5.232 5.162 18.095 1.00 3.00 N ATOM 9446 CA MET B 176 -6.274 5.942 18.717 1.00 4.79 C ATOM 9447 C MET B 176 -6.208 7.429 18.202 1.00 9.05 C ATOM 9448 O MET B 176 -7.224 8.094 17.989 1.00 9.26 O ATOM 9449 CB MET B 176 -5.971 5.898 20.235 1.00 7.00 C ATOM 9450 CG MET B 176 -6.157 4.498 20.846 1.00 7.08 C ATOM 9451 SD MET B 176 -7.941 4.048 21.015 1.00 11.10 S ATOM 9452 CE MET B 176 -8.664 4.992 22.387 1.00 12.00 C ATOM 9453 HA MET B 176 -7.266 5.554 18.487 1.00 0.00 H ATOM 9454 HB2 MET B 176 -4.939 6.212 20.393 1.00 0.00 H ATOM 9455 HB3 MET B 176 -6.642 6.591 20.743 1.00 0.00 H ATOM 9456 HG2 MET B 176 -5.694 4.480 21.833 1.00 0.00 H ATOM 9457 HG3 MET B 176 -5.668 3.766 20.204 1.00 0.00 H ATOM 9458 HE1 MET B 176 -8.136 4.752 23.310 1.00 0.00 H ATOM 9459 HE2 MET B 176 -8.572 6.058 22.181 1.00 0.00 H ATOM 9460 HE3 MET B 176 -9.717 4.730 22.491 1.00 0.00 H ATOM 9461 H MET B 176 -4.466 4.778 18.685 1.00 0.00 H ATOM 9462 N ASP B 177 -5.000 7.967 17.990 1.00 3.00 N ATOM 9463 CA ASP B 177 -4.861 9.315 17.488 1.00 4.93 C ATOM 9464 C ASP B 177 -5.329 9.372 16.078 1.00 9.24 C ATOM 9465 O ASP B 177 -5.983 10.322 15.696 1.00 6.80 O ATOM 9466 CB ASP B 177 -3.372 9.622 17.424 1.00 7.26 C ATOM 9467 CG ASP B 177 -2.791 10.142 18.726 1.00 3.97 C ATOM 9468 OD1 ASP B 177 -3.613 10.135 19.751 1.00 9.21 O ATOM 9469 OD2 ASP B 177 -1.601 10.202 18.841 1.00 7.85 O ATOM 9470 HA ASP B 177 -5.422 10.000 18.124 1.00 0.00 H ATOM 9471 HB2 ASP B 177 -2.845 8.707 17.155 1.00 0.00 H ATOM 9472 HB3 ASP B 177 -3.210 10.374 16.652 1.00 0.00 H ATOM 9473 H ASP B 177 -4.148 7.405 18.190 1.00 0.00 H ATOM 9474 N LEU B 178 -5.001 8.353 15.257 1.00 4.38 N ATOM 9475 CA LEU B 178 -5.429 8.404 13.861 1.00 3.00 C ATOM 9476 C LEU B 178 -6.964 8.294 13.680 1.00 3.00 C ATOM 9477 O LEU B 178 -7.607 8.986 12.853 1.00 7.63 O ATOM 9478 CB LEU B 178 -4.617 7.347 13.047 1.00 6.06 C ATOM 9479 CG LEU B 178 -5.095 7.012 11.638 1.00 8.46 C ATOM 9480 CD1 LEU B 178 -5.310 8.268 10.820 1.00 10.49 C ATOM 9481 CD2 LEU B 178 -4.068 6.137 10.907 1.00 6.28 C ATOM 9482 HA LEU B 178 -5.205 9.392 13.460 1.00 0.00 H ATOM 9483 HB2 LEU B 178 -3.595 7.716 12.964 1.00 0.00 H ATOM 9484 HB3 LEU B 178 -4.622 6.420 13.621 1.00 0.00 H ATOM 9485 HG LEU B 178 -6.038 6.475 11.742 1.00 0.00 H ATOM 9486 HD21 LEU B 178 -3.120 6.671 10.839 1.00 0.00 H ATOM 9487 HD22 LEU B 178 -3.925 5.209 11.460 1.00 0.00 H ATOM 9488 HD23 LEU B 178 -4.432 5.912 9.905 1.00 0.00 H ATOM 9489 HD11 LEU B 178 -6.062 8.891 11.304 1.00 0.00 H ATOM 9490 HD12 LEU B 178 -4.372 8.818 10.748 1.00 0.00 H ATOM 9491 HD13 LEU B 178 -5.650 7.996 9.821 1.00 0.00 H ATOM 9492 H LEU B 178 -4.452 7.544 15.612 1.00 0.00 H ATOM 9493 N ILE B 179 -7.603 7.413 14.469 1.00 3.00 N ATOM 9494 CA ILE B 179 -9.059 7.199 14.451 1.00 7.01 C ATOM 9495 C ILE B 179 -9.700 8.509 14.875 1.00 8.80 C ATOM 9496 O ILE B 179 -10.725 8.935 14.317 1.00 6.37 O ATOM 9497 CB ILE B 179 -9.542 6.060 15.343 1.00 3.38 C ATOM 9498 CG1 ILE B 179 -9.202 4.763 14.621 1.00 8.37 C ATOM 9499 CG2 ILE B 179 -11.063 6.151 15.484 1.00 3.00 C ATOM 9500 CD1 ILE B 179 -9.126 3.600 15.616 1.00 12.96 C ATOM 9501 HA ILE B 179 -9.347 6.899 13.444 1.00 0.00 H ATOM 9502 HB ILE B 179 -9.079 6.106 16.329 1.00 0.00 H ATOM 9503 HG12 ILE B 179 -9.973 4.552 13.880 1.00 0.00 H ATOM 9504 HG13 ILE B 179 -8.239 4.872 14.121 1.00 0.00 H ATOM 9505 HD11 ILE B 179 -8.354 3.807 16.357 1.00 0.00 H ATOM 9506 HD12 ILE B 179 -10.089 3.487 16.115 1.00 0.00 H ATOM 9507 HD13 ILE B 179 -8.882 2.682 15.082 1.00 0.00 H ATOM 9508 HG21 ILE B 179 -11.328 7.108 15.932 1.00 0.00 H ATOM 9509 HG22 ILE B 179 -11.523 6.069 14.499 1.00 0.00 H ATOM 9510 HG23 ILE B 179 -11.417 5.340 16.121 1.00 0.00 H ATOM 9511 H ILE B 179 -7.034 6.849 15.132 1.00 0.00 H ATOM 9512 N ALA B 180 -9.072 9.159 15.861 1.00 5.50 N ATOM 9513 CA ALA B 180 -9.569 10.445 16.356 1.00 4.42 C ATOM 9514 C ALA B 180 -9.564 11.538 15.289 1.00 12.98 C ATOM 9515 O ALA B 180 -10.461 12.358 15.114 1.00 12.47 O ATOM 9516 CB ALA B 180 -8.710 10.939 17.559 1.00 8.04 C ATOM 9517 HA ALA B 180 -10.600 10.267 16.661 1.00 0.00 H ATOM 9518 HB1 ALA B 180 -8.760 10.207 18.365 1.00 0.00 H ATOM 9519 HB2 ALA B 180 -7.675 11.059 17.240 1.00 0.00 H ATOM 9520 HB3 ALA B 180 -9.096 11.895 17.911 1.00 0.00 H ATOM 9521 H ALA B 180 -8.217 8.745 16.283 1.00 0.00 H ATOM 9522 N LYS B 181 -8.534 11.578 14.531 1.00 9.61 N ATOM 9523 CA LYS B 181 -8.383 12.590 13.534 1.00 7.85 C ATOM 9524 C LYS B 181 -9.084 12.387 12.218 1.00 8.86 C ATOM 9525 O LYS B 181 -9.417 13.364 11.484 1.00 6.89 O ATOM 9526 CB LYS B 181 -6.882 12.765 13.271 1.00 6.50 C ATOM 9527 CG LYS B 181 -6.038 13.325 14.415 1.00 9.37 C ATOM 9528 CD LYS B 181 -4.542 13.238 14.070 1.00 18.19 C ATOM 9529 CE LYS B 181 -3.645 13.000 15.266 1.00 20.13 C ATOM 9530 NZ LYS B 181 -3.878 14.033 16.274 1.00 25.56 N ATOM 9531 HA LYS B 181 -8.873 13.468 13.953 1.00 0.00 H ATOM 9532 HB2 LYS B 181 -6.477 11.787 13.012 1.00 0.00 H ATOM 9533 HB3 LYS B 181 -6.773 13.439 12.421 1.00 0.00 H ATOM 9534 HG2 LYS B 181 -6.308 14.367 14.584 1.00 0.00 H ATOM 9535 HG3 LYS B 181 -6.232 12.749 15.320 1.00 0.00 H ATOM 9536 HD2 LYS B 181 -4.400 12.418 13.366 1.00 0.00 H ATOM 9537 HD3 LYS B 181 -4.244 14.175 13.599 1.00 0.00 H ATOM 9538 HE2 LYS B 181 -2.603 13.032 14.949 1.00 0.00 H ATOM 9539 HE3 LYS B 181 -3.863 12.021 15.693 1.00 0.00 H ATOM 9540 HZ1 LYS B 181 -3.668 14.967 15.867 1.00 0.00 H ATOM 9541 HZ2 LYS B 181 -4.872 14.001 16.578 1.00 0.00 H ATOM 9542 HZ3 LYS B 181 -3.259 13.863 17.092 1.00 0.00 H ATOM 9543 H LYS B 181 -7.791 10.859 14.643 1.00 0.00 H ATOM 9544 N LEU B 182 -9.294 11.113 11.866 1.00 14.04 N ATOM 9545 CA LEU B 182 -9.946 10.816 10.613 1.00 7.73 C ATOM 9546 C LEU B 182 -11.186 11.639 10.202 1.00 5.29 C ATOM 9547 O LEU B 182 -11.254 12.129 9.061 1.00 10.14 O ATOM 9548 CB LEU B 182 -10.234 9.306 10.469 1.00 7.12 C ATOM 9549 CG LEU B 182 -9.020 8.605 9.876 1.00 11.10 C ATOM 9550 CD1 LEU B 182 -9.211 7.094 10.033 1.00 11.46 C ATOM 9551 CD2 LEU B 182 -8.895 8.914 8.368 1.00 16.38 C ATOM 9552 HA LEU B 182 -9.192 11.151 9.900 1.00 0.00 H ATOM 9553 HB2 LEU B 182 -10.453 8.884 11.450 1.00 0.00 H ATOM 9554 HB3 LEU B 182 -11.092 9.162 9.813 1.00 0.00 H ATOM 9555 HG LEU B 182 -8.125 8.952 10.391 1.00 0.00 H ATOM 9556 HD21 LEU B 182 -9.790 8.567 7.852 1.00 0.00 H ATOM 9557 HD22 LEU B 182 -8.786 9.989 8.227 1.00 0.00 H ATOM 9558 HD23 LEU B 182 -8.021 8.403 7.965 1.00 0.00 H ATOM 9559 HD11 LEU B 182 -9.304 6.849 11.091 1.00 0.00 H ATOM 9560 HD12 LEU B 182 -10.114 6.787 9.506 1.00 0.00 H ATOM 9561 HD13 LEU B 182 -8.350 6.575 9.613 1.00 0.00 H ATOM 9562 H LEU B 182 -8.989 10.341 12.492 1.00 0.00 H ATOM 9563 N PRO B 183 -12.136 11.762 11.077 1.00 10.75 N ATOM 9564 CA PRO B 183 -13.296 12.503 10.743 1.00 7.59 C ATOM 9565 C PRO B 183 -13.025 13.963 10.449 1.00 11.00 C ATOM 9566 O PRO B 183 -13.736 14.552 9.649 1.00 3.71 O ATOM 9567 CB PRO B 183 -14.256 12.410 11.911 1.00 12.30 C ATOM 9568 CG PRO B 183 -13.725 11.294 12.745 1.00 12.60 C ATOM 9569 CD PRO B 183 -12.279 11.069 12.383 1.00 6.69 C ATOM 9570 HA PRO B 183 -13.706 12.075 9.828 1.00 0.00 H ATOM 9571 HD3 PRO B 183 -11.617 11.506 13.131 1.00 0.00 H ATOM 9572 HD2 PRO B 183 -12.062 10.005 12.286 1.00 0.00 H ATOM 9573 HG3 PRO B 183 -14.298 10.387 12.552 1.00 0.00 H ATOM 9574 HG2 PRO B 183 -13.803 11.554 13.801 1.00 0.00 H ATOM 9575 HB2 PRO B 183 -14.267 13.342 12.476 1.00 0.00 H ATOM 9576 HB3 PRO B 183 -15.265 12.185 11.564 1.00 0.00 H ATOM 9577 N CYS B 184 -12.013 14.538 11.060 1.00 6.22 N ATOM 9578 CA CYS B 184 -11.733 15.938 10.831 1.00 7.33 C ATOM 9579 C CYS B 184 -11.101 16.087 9.454 1.00 9.21 C ATOM 9580 O CYS B 184 -11.338 17.072 8.733 1.00 7.18 O ATOM 9581 CB CYS B 184 -10.712 16.454 11.894 1.00 13.79 C ATOM 9582 SG CYS B 184 -11.298 16.395 13.598 1.00 16.03 S ATOM 9583 HA CYS B 184 -12.659 16.509 10.900 1.00 0.00 H ATOM 9584 HB2 CYS B 184 -10.468 17.489 11.655 1.00 0.00 H ATOM 9585 HB3 CYS B 184 -9.812 15.844 11.824 1.00 0.00 H ATOM 9586 HG CYS B 184 -10.313 16.874 14.438 1.00 0.00 H ATOM 9587 H CYS B 184 -11.414 13.987 11.707 1.00 0.00 H ATOM 9588 N VAL B 185 -10.290 15.111 9.115 1.00 5.78 N ATOM 9589 CA VAL B 185 -9.674 15.189 7.816 1.00 7.42 C ATOM 9590 C VAL B 185 -10.713 14.981 6.722 1.00 7.59 C ATOM 9591 O VAL B 185 -10.743 15.691 5.702 1.00 7.13 O ATOM 9592 CB VAL B 185 -8.622 14.070 7.598 1.00 6.10 C ATOM 9593 CG1 VAL B 185 -8.098 14.089 6.154 1.00 6.54 C ATOM 9594 CG2 VAL B 185 -7.351 14.261 8.412 1.00 8.12 C ATOM 9595 HA VAL B 185 -9.208 16.173 7.769 1.00 0.00 H ATOM 9596 HB VAL B 185 -9.150 13.159 7.878 1.00 0.00 H ATOM 9597 HG11 VAL B 185 -8.928 13.931 5.465 1.00 0.00 H ATOM 9598 HG12 VAL B 185 -7.634 15.054 5.950 1.00 0.00 H ATOM 9599 HG13 VAL B 185 -7.362 13.296 6.026 1.00 0.00 H ATOM 9600 HG21 VAL B 185 -6.883 15.206 8.136 1.00 0.00 H ATOM 9601 HG22 VAL B 185 -7.599 14.273 9.473 1.00 0.00 H ATOM 9602 HG23 VAL B 185 -6.663 13.440 8.207 1.00 0.00 H ATOM 9603 H VAL B 185 -10.101 14.316 9.758 1.00 0.00 H ATOM 9604 N ALA B 186 -11.538 13.948 6.912 1.00 3.00 N ATOM 9605 CA ALA B 186 -12.533 13.659 5.929 1.00 7.11 C ATOM 9606 C ALA B 186 -13.524 14.807 5.798 1.00 9.85 C ATOM 9607 O ALA B 186 -13.989 15.123 4.702 1.00 6.81 O ATOM 9608 CB ALA B 186 -13.252 12.370 6.277 1.00 6.75 C ATOM 9609 HA ALA B 186 -12.037 13.536 4.966 1.00 0.00 H ATOM 9610 HB1 ALA B 186 -12.533 11.552 6.310 1.00 0.00 H ATOM 9611 HB2 ALA B 186 -13.730 12.474 7.251 1.00 0.00 H ATOM 9612 HB3 ALA B 186 -14.008 12.161 5.520 1.00 0.00 H ATOM 9613 H ALA B 186 -11.457 13.361 7.766 1.00 0.00 H ATOM 9614 N ALA B 187 -13.913 15.435 6.922 1.00 3.00 N ATOM 9615 CA ALA B 187 -14.886 16.535 6.868 1.00 3.72 C ATOM 9616 C ALA B 187 -14.327 17.777 6.216 1.00 10.26 C ATOM 9617 O ALA B 187 -15.097 18.448 5.558 1.00 10.61 O ATOM 9618 CB ALA B 187 -15.467 16.951 8.196 1.00 4.85 C ATOM 9619 HA ALA B 187 -15.686 16.102 6.267 1.00 0.00 H ATOM 9620 HB1 ALA B 187 -15.984 16.104 8.647 1.00 0.00 H ATOM 9621 HB2 ALA B 187 -14.664 17.281 8.855 1.00 0.00 H ATOM 9622 HB3 ALA B 187 -16.172 17.768 8.043 1.00 0.00 H ATOM 9623 H ALA B 187 -13.521 15.139 7.839 1.00 0.00 H ATOM 9624 N LYS B 188 -13.022 18.075 6.414 1.00 4.75 N ATOM 9625 CA LYS B 188 -12.403 19.203 5.823 1.00 9.00 C ATOM 9626 C LYS B 188 -12.441 19.013 4.287 1.00 9.05 C ATOM 9627 O LYS B 188 -12.690 19.961 3.505 1.00 10.37 O ATOM 9628 CB LYS B 188 -10.994 19.323 6.362 1.00 13.20 C ATOM 9629 CG LYS B 188 -10.314 20.549 5.831 1.00 28.70 C ATOM 9630 CD LYS B 188 -9.922 21.481 6.939 1.00 44.14 C ATOM 9631 CE LYS B 188 -9.910 22.891 6.378 1.00 23.40 C ATOM 9632 NZ LYS B 188 -11.277 23.386 6.137 1.00 80.00 N ATOM 9633 HA LYS B 188 -12.921 20.131 6.064 1.00 0.00 H ATOM 9634 HB2 LYS B 188 -11.033 19.380 7.450 1.00 0.00 H ATOM 9635 HB3 LYS B 188 -10.423 18.443 6.066 1.00 0.00 H ATOM 9636 HG2 LYS B 188 -9.419 20.250 5.285 1.00 0.00 H ATOM 9637 HG3 LYS B 188 -10.994 21.067 5.155 1.00 0.00 H ATOM 9638 HD2 LYS B 188 -10.643 21.412 7.754 1.00 0.00 H ATOM 9639 HD3 LYS B 188 -8.930 21.221 7.309 1.00 0.00 H ATOM 9640 HE2 LYS B 188 -9.361 22.894 5.437 1.00 0.00 H ATOM 9641 HE3 LYS B 188 -9.414 23.552 7.089 1.00 0.00 H ATOM 9642 HZ1 LYS B 188 -11.755 22.763 5.455 1.00 0.00 H ATOM 9643 HZ2 LYS B 188 -11.805 23.391 7.033 1.00 0.00 H ATOM 9644 HZ3 LYS B 188 -11.232 24.352 5.754 1.00 0.00 H ATOM 9645 H LYS B 188 -12.453 17.453 7.023 1.00 0.00 H ATOM 9646 N ILE B 189 -12.196 17.785 3.834 1.00 10.76 N ATOM 9647 CA ILE B 189 -12.240 17.582 2.378 1.00 3.96 C ATOM 9648 C ILE B 189 -13.650 17.841 1.822 1.00 5.72 C ATOM 9649 O ILE B 189 -13.828 18.480 0.774 1.00 7.60 O ATOM 9650 CB ILE B 189 -11.786 16.150 2.082 1.00 6.90 C ATOM 9651 CG1 ILE B 189 -10.361 15.903 2.515 1.00 12.46 C ATOM 9652 CG2 ILE B 189 -12.054 15.695 0.656 1.00 8.84 C ATOM 9653 CD1 ILE B 189 -10.038 14.425 2.301 1.00 11.00 C ATOM 9654 HA ILE B 189 -11.574 18.291 1.887 1.00 0.00 H ATOM 9655 HB ILE B 189 -12.421 15.514 2.699 1.00 0.00 H ATOM 9656 HG12 ILE B 189 -9.684 16.517 1.921 1.00 0.00 H ATOM 9657 HG13 ILE B 189 -10.248 16.155 3.569 1.00 0.00 H ATOM 9658 HD11 ILE B 189 -10.719 13.816 2.896 1.00 0.00 H ATOM 9659 HD12 ILE B 189 -10.155 14.178 1.246 1.00 0.00 H ATOM 9660 HD13 ILE B 189 -9.011 14.231 2.610 1.00 0.00 H ATOM 9661 HG21 ILE B 189 -13.125 15.740 0.457 1.00 0.00 H ATOM 9662 HG22 ILE B 189 -11.526 16.349 -0.038 1.00 0.00 H ATOM 9663 HG23 ILE B 189 -11.703 14.671 0.531 1.00 0.00 H ATOM 9664 H ILE B 189 -11.982 17.001 4.483 1.00 0.00 H ATOM 9665 N TYR B 190 -14.656 17.341 2.540 1.00 3.49 N ATOM 9666 CA TYR B 190 -16.044 17.470 2.152 1.00 6.03 C ATOM 9667 C TYR B 190 -16.436 18.957 2.029 1.00 13.84 C ATOM 9668 O TYR B 190 -17.004 19.384 1.031 1.00 9.46 O ATOM 9669 CB TYR B 190 -16.958 16.771 3.190 1.00 7.03 C ATOM 9670 CG TYR B 190 -18.386 16.636 2.689 1.00 7.56 C ATOM 9671 CD1 TYR B 190 -18.752 15.626 1.791 1.00 5.83 C ATOM 9672 CD2 TYR B 190 -19.351 17.563 3.084 1.00 13.79 C ATOM 9673 CE1 TYR B 190 -20.058 15.485 1.312 1.00 10.88 C ATOM 9674 CE2 TYR B 190 -20.661 17.470 2.605 1.00 9.11 C ATOM 9675 CZ TYR B 190 -20.989 16.441 1.727 1.00 7.80 C ATOM 9676 OH TYR B 190 -22.288 16.357 1.293 1.00 11.50 O ATOM 9677 HA TYR B 190 -16.174 16.991 1.182 1.00 0.00 H ATOM 9678 HB3 TYR B 190 -16.961 17.357 4.109 1.00 0.00 H ATOM 9679 HB2 TYR B 190 -16.561 15.777 3.396 1.00 0.00 H ATOM 9680 HD2 TYR B 190 -19.082 18.365 3.771 1.00 0.00 H ATOM 9681 HE2 TYR B 190 -21.415 18.193 2.915 1.00 0.00 H ATOM 9682 HE1 TYR B 190 -20.337 14.668 0.646 1.00 0.00 H ATOM 9683 HD1 TYR B 190 -17.990 14.923 1.453 1.00 0.00 H ATOM 9684 HH TYR B 190 -22.887 16.234 2.071 1.00 0.00 H ATOM 9685 H TYR B 190 -14.433 16.834 3.420 1.00 0.00 H ATOM 9686 N ARG B 191 -16.107 19.730 3.049 1.00 6.10 N ATOM 9687 CA ARG B 191 -16.369 21.163 3.090 1.00 5.17 C ATOM 9688 C ARG B 191 -15.630 21.937 1.995 1.00 13.44 C ATOM 9689 O ARG B 191 -16.167 22.789 1.288 1.00 9.32 O ATOM 9690 CB ARG B 191 -16.030 21.742 4.439 1.00 3.08 C ATOM 9691 CG ARG B 191 -16.842 21.165 5.580 1.00 17.09 C ATOM 9692 CD ARG B 191 -17.998 22.071 5.951 1.00 14.33 C ATOM 9693 NE ARG B 191 -18.681 21.603 7.155 1.00 14.18 N ATOM 9694 CZ ARG B 191 -19.416 22.376 7.948 1.00 16.36 C ATOM 9695 NH1 ARG B 191 -19.573 23.657 7.664 1.00 19.21 N ATOM 9696 NH2 ARG B 191 -19.992 21.871 9.019 1.00 11.55 N ATOM 9697 HA ARG B 191 -17.438 21.276 2.907 1.00 0.00 H ATOM 9698 HB2 ARG B 191 -14.975 21.552 4.638 1.00 0.00 H ATOM 9699 HB3 ARG B 191 -16.204 22.817 4.404 1.00 0.00 H ATOM 9700 HG2 ARG B 191 -17.235 20.194 5.280 1.00 0.00 H ATOM 9701 HG3 ARG B 191 -16.195 21.041 6.449 1.00 0.00 H ATOM 9702 HD2 ARG B 191 -18.710 22.093 5.126 1.00 0.00 H ATOM 9703 HD3 ARG B 191 -17.617 23.077 6.128 1.00 0.00 H ATOM 9704 HE ARG B 191 -18.586 20.599 7.408 1.00 0.00 H ATOM 9705 HH12 ARG B 191 -20.148 24.261 8.285 1.00 0.00 H ATOM 9706 HH11 ARG B 191 -19.121 24.061 6.819 1.00 0.00 H ATOM 9707 HH22 ARG B 191 -20.566 22.480 9.637 1.00 0.00 H ATOM 9708 HH21 ARG B 191 -19.873 20.863 9.247 1.00 0.00 H ATOM 9709 H ARG B 191 -15.636 19.292 3.866 1.00 0.00 H ATOM 9710 N ASN B 192 -14.362 21.655 1.810 1.00 8.44 N ATOM 9711 CA ASN B 192 -13.554 22.330 0.821 1.00 11.09 C ATOM 9712 C ASN B 192 -14.049 22.090 -0.579 1.00 12.71 C ATOM 9713 O ASN B 192 -14.022 22.957 -1.435 1.00 11.11 O ATOM 9714 CB ASN B 192 -12.095 21.799 0.851 1.00 8.69 C ATOM 9715 CG ASN B 192 -11.271 22.445 1.950 1.00 14.30 C ATOM 9716 OD1 ASN B 192 -10.100 22.084 2.207 1.00 29.86 O ATOM 9717 ND2 ASN B 192 -11.801 23.511 2.493 1.00 14.56 N ATOM 9718 HA ASN B 192 -13.610 23.390 1.069 1.00 0.00 H ATOM 9719 HB2 ASN B 192 -12.117 20.722 1.016 1.00 0.00 H ATOM 9720 HB3 ASN B 192 -11.625 22.009 -0.110 1.00 0.00 H ATOM 9721 HD22 ASN B 192 -12.777 23.784 2.258 1.00 0.00 H ATOM 9722 HD21 ASN B 192 -11.246 24.086 3.159 1.00 0.00 H ATOM 9723 H ASN B 192 -13.922 20.918 2.397 1.00 0.00 H ATOM 9724 N LEU B 193 -14.458 20.872 -0.835 1.00 6.99 N ATOM 9725 CA LEU B 193 -14.914 20.553 -2.155 1.00 9.69 C ATOM 9726 C LEU B 193 -16.362 20.919 -2.378 1.00 7.95 C ATOM 9727 O LEU B 193 -16.691 21.420 -3.444 1.00 12.54 O ATOM 9728 CB LEU B 193 -14.924 19.016 -2.393 1.00 12.40 C ATOM 9729 CG LEU B 193 -13.814 18.425 -3.245 1.00 23.93 C ATOM 9730 CD1 LEU B 193 -12.641 19.350 -3.368 1.00 24.18 C ATOM 9731 CD2 LEU B 193 -13.417 17.060 -2.715 1.00 12.87 C ATOM 9732 HA LEU B 193 -14.235 21.102 -2.807 1.00 0.00 H ATOM 9733 HB2 LEU B 193 -14.876 18.535 -1.416 1.00 0.00 H ATOM 9734 HB3 LEU B 193 -15.870 18.767 -2.873 1.00 0.00 H ATOM 9735 HG LEU B 193 -14.197 18.295 -4.257 1.00 0.00 H ATOM 9736 HD21 LEU B 193 -13.065 17.159 -1.688 1.00 0.00 H ATOM 9737 HD22 LEU B 193 -14.281 16.396 -2.742 1.00 0.00 H ATOM 9738 HD23 LEU B 193 -12.621 16.648 -3.335 1.00 0.00 H ATOM 9739 HD11 LEU B 193 -12.963 20.283 -3.830 1.00 0.00 H ATOM 9740 HD12 LEU B 193 -12.236 19.554 -2.377 1.00 0.00 H ATOM 9741 HD13 LEU B 193 -11.875 18.883 -3.986 1.00 0.00 H ATOM 9742 H LEU B 193 -14.452 20.146 -0.090 1.00 0.00 H ATOM 9743 N TYR B 194 -17.217 20.646 -1.426 1.00 8.57 N ATOM 9744 CA TYR B 194 -18.590 20.912 -1.657 1.00 9.22 C ATOM 9745 C TYR B 194 -19.267 21.988 -0.854 1.00 11.22 C ATOM 9746 O TYR B 194 -20.446 22.174 -1.094 1.00 12.68 O ATOM 9747 CB TYR B 194 -19.347 19.603 -1.358 1.00 6.99 C ATOM 9748 CG TYR B 194 -18.686 18.493 -2.090 1.00 11.06 C ATOM 9749 CD1 TYR B 194 -18.527 18.527 -3.471 1.00 6.15 C ATOM 9750 CD2 TYR B 194 -18.177 17.411 -1.371 1.00 10.67 C ATOM 9751 CE1 TYR B 194 -17.916 17.436 -4.101 1.00 9.94 C ATOM 9752 CE2 TYR B 194 -17.531 16.342 -1.982 1.00 10.80 C ATOM 9753 CZ TYR B 194 -17.400 16.363 -3.367 1.00 15.78 C ATOM 9754 OH TYR B 194 -16.766 15.333 -4.028 1.00 20.37 O ATOM 9755 HA TYR B 194 -18.621 21.282 -2.682 1.00 0.00 H ATOM 9756 HB3 TYR B 194 -20.382 19.694 -1.687 1.00 0.00 H ATOM 9757 HB2 TYR B 194 -19.324 19.402 -0.287 1.00 0.00 H ATOM 9758 HD2 TYR B 194 -18.290 17.403 -0.287 1.00 0.00 H ATOM 9759 HE2 TYR B 194 -17.139 15.512 -1.394 1.00 0.00 H ATOM 9760 HE1 TYR B 194 -17.841 17.423 -5.188 1.00 0.00 H ATOM 9761 HD1 TYR B 194 -18.870 19.384 -4.050 1.00 0.00 H ATOM 9762 HH TYR B 194 -16.767 15.517 -5.001 1.00 0.00 H ATOM 9763 H TYR B 194 -16.897 20.244 -0.522 1.00 0.00 H ATOM 9764 N ARG B 195 -18.615 22.640 0.097 1.00 9.84 N ATOM 9765 CA ARG B 195 -19.322 23.685 0.840 1.00 5.90 C ATOM 9766 C ARG B 195 -18.297 24.826 1.030 1.00 6.87 C ATOM 9767 O ARG B 195 -18.158 25.351 2.174 1.00 10.72 O ATOM 9768 CB ARG B 195 -19.752 23.277 2.242 1.00 7.94 C ATOM 9769 CG ARG B 195 -20.582 21.997 2.353 1.00 9.91 C ATOM 9770 CD ARG B 195 -22.015 22.133 1.830 1.00 23.97 C ATOM 9771 NE ARG B 195 -22.849 20.968 2.141 1.00 32.49 N ATOM 9772 CZ ARG B 195 -23.175 20.048 1.216 1.00 29.86 C ATOM 9773 NH1 ARG B 195 -22.774 20.153 -0.078 1.00 18.60 N ATOM 9774 NH2 ARG B 195 -23.934 19.014 1.601 1.00 52.81 N ATOM 9775 HA ARG B 195 -20.222 23.939 0.281 1.00 0.00 H ATOM 9776 HB2 ARG B 195 -18.850 23.141 2.839 1.00 0.00 H ATOM 9777 HB3 ARG B 195 -20.343 24.093 2.659 1.00 0.00 H ATOM 9778 HG2 ARG B 195 -20.082 21.214 1.783 1.00 0.00 H ATOM 9779 HG3 ARG B 195 -20.627 21.708 3.403 1.00 0.00 H ATOM 9780 HD2 ARG B 195 -21.980 22.257 0.748 1.00 0.00 H ATOM 9781 HD3 ARG B 195 -22.468 23.016 2.281 1.00 0.00 H ATOM 9782 HE ARG B 195 -23.201 20.849 3.112 1.00 0.00 H ATOM 9783 HH12 ARG B 195 -23.045 19.423 -0.767 1.00 0.00 H ATOM 9784 HH11 ARG B 195 -22.197 20.964 -0.379 1.00 0.00 H ATOM 9785 HH22 ARG B 195 -24.206 18.283 0.912 1.00 0.00 H ATOM 9786 HH21 ARG B 195 -24.252 18.942 2.589 1.00 0.00 H ATOM 9787 H ARG B 195 -17.623 22.415 0.311 1.00 0.00 H ATOM 9788 N ALA B 196 -17.576 25.145 -0.077 1.00 9.20 N ATOM 9789 CA ALA B 196 -16.512 26.162 -0.099 1.00 13.96 C ATOM 9790 C ALA B 196 -16.875 27.445 0.659 1.00 15.53 C ATOM 9791 O ALA B 196 -17.944 27.989 0.422 1.00 12.62 O ATOM 9792 CB ALA B 196 -15.911 26.350 -1.501 1.00 18.64 C ATOM 9793 HA ALA B 196 -15.682 25.771 0.489 1.00 0.00 H ATOM 9794 HB1 ALA B 196 -15.483 25.407 -1.841 1.00 0.00 H ATOM 9795 HB2 ALA B 196 -16.694 26.665 -2.191 1.00 0.00 H ATOM 9796 HB3 ALA B 196 -15.131 27.111 -1.462 1.00 0.00 H ATOM 9797 H ALA B 196 -17.789 24.641 -0.961 1.00 0.00 H ATOM 9798 N GLY B 197 -15.987 27.881 1.565 1.00 12.73 N ATOM 9799 CA GLY B 197 -16.104 29.056 2.435 1.00 15.61 C ATOM 9800 C GLY B 197 -16.656 28.772 3.846 1.00 15.87 C ATOM 9801 O GLY B 197 -16.688 29.639 4.733 1.00 14.54 O ATOM 9802 HA3 GLY B 197 -16.768 29.771 1.950 1.00 0.00 H ATOM 9803 HA2 GLY B 197 -15.113 29.497 2.542 1.00 0.00 H ATOM 9804 H GLY B 197 -15.116 27.322 1.662 1.00 0.00 H ATOM 9805 N SER B 198 -17.118 27.544 4.105 1.00 9.93 N ATOM 9806 CA SER B 198 -17.637 27.206 5.412 1.00 12.75 C ATOM 9807 C SER B 198 -16.484 26.489 6.155 1.00 10.51 C ATOM 9808 O SER B 198 -15.432 26.240 5.535 1.00 25.74 O ATOM 9809 CB SER B 198 -18.910 26.394 5.320 1.00 8.97 C ATOM 9810 OG SER B 198 -18.661 25.102 4.793 1.00 12.13 O ATOM 9811 HA SER B 198 -17.940 28.091 5.971 1.00 0.00 H ATOM 9812 HB2 SER B 198 -19.616 26.912 4.671 1.00 0.00 H ATOM 9813 HB3 SER B 198 -19.340 26.294 6.316 1.00 0.00 H ATOM 9814 HG SER B 198 -18.274 25.186 3.885 1.00 0.00 H ATOM 9815 H SER B 198 -17.104 26.822 3.356 1.00 0.00 H ATOM 9816 N SER B 199 -16.676 26.191 7.464 1.00 15.45 N ATOM 9817 CA SER B 199 -15.767 25.556 8.477 1.00 15.28 C ATOM 9818 C SER B 199 -16.368 24.313 9.134 1.00 10.23 C ATOM 9819 O SER B 199 -17.555 24.267 9.398 1.00 17.28 O ATOM 9820 CB SER B 199 -15.666 26.549 9.643 1.00 23.94 C ATOM 9821 OG SER B 199 -15.014 25.956 10.758 1.00 52.15 O ATOM 9822 HA SER B 199 -14.839 25.301 7.965 1.00 0.00 H ATOM 9823 HB2 SER B 199 -16.669 26.857 9.938 1.00 0.00 H ATOM 9824 HB3 SER B 199 -15.099 27.422 9.321 1.00 0.00 H ATOM 9825 HG SER B 199 -14.961 26.614 11.496 1.00 0.00 H ATOM 9826 H SER B 199 -17.615 26.446 7.830 1.00 0.00 H ATOM 9827 N ILE B 200 -15.542 23.283 9.432 1.00 14.20 N ATOM 9828 CA ILE B 200 -16.047 22.063 10.050 1.00 12.34 C ATOM 9829 C ILE B 200 -16.473 22.241 11.480 1.00 15.75 C ATOM 9830 O ILE B 200 -17.280 21.496 12.083 1.00 21.56 O ATOM 9831 CB ILE B 200 -15.050 20.926 9.952 1.00 23.98 C ATOM 9832 CG1 ILE B 200 -13.775 21.328 10.687 1.00 23.00 C ATOM 9833 CG2 ILE B 200 -14.749 20.597 8.496 1.00 26.36 C ATOM 9834 CD1 ILE B 200 -12.770 20.171 10.728 1.00 22.43 C ATOM 9835 HA ILE B 200 -16.939 21.809 9.477 1.00 0.00 H ATOM 9836 HB ILE B 200 -15.471 20.032 10.411 1.00 0.00 H ATOM 9837 HG12 ILE B 200 -13.321 22.176 10.174 1.00 0.00 H ATOM 9838 HG13 ILE B 200 -14.028 21.616 11.707 1.00 0.00 H ATOM 9839 HD11 ILE B 200 -13.217 19.322 11.245 1.00 0.00 H ATOM 9840 HD12 ILE B 200 -12.509 19.882 9.710 1.00 0.00 H ATOM 9841 HD13 ILE B 200 -11.873 20.490 11.258 1.00 0.00 H ATOM 9842 HG21 ILE B 200 -15.670 20.302 7.993 1.00 0.00 H ATOM 9843 HG22 ILE B 200 -14.331 21.476 8.005 1.00 0.00 H ATOM 9844 HG23 ILE B 200 -14.031 19.778 8.451 1.00 0.00 H ATOM 9845 H ILE B 200 -14.528 23.363 9.216 1.00 0.00 H ATOM 9846 N GLY B 201 -15.900 23.288 12.030 1.00 15.20 N ATOM 9847 CA GLY B 201 -16.284 23.546 13.395 1.00 16.50 C ATOM 9848 C GLY B 201 -15.400 22.827 14.391 1.00 26.16 C ATOM 9849 O GLY B 201 -14.282 22.449 14.066 1.00 29.15 O ATOM 9850 HA3 GLY B 201 -17.313 23.215 13.538 1.00 0.00 H ATOM 9851 HA2 GLY B 201 -16.219 24.618 13.580 1.00 0.00 H ATOM 9852 H GLY B 201 -15.220 23.886 11.518 1.00 0.00 H ATOM 9853 N ALA B 202 -15.934 22.677 15.596 1.00 35.78 N ATOM 9854 CA ALA B 202 -15.228 22.033 16.687 1.00 36.96 C ATOM 9855 C ALA B 202 -15.887 20.763 17.203 1.00 19.26 C ATOM 9856 O ALA B 202 -17.053 20.538 17.004 1.00 24.07 O ATOM 9857 CB ALA B 202 -15.055 23.033 17.818 1.00 38.41 C ATOM 9858 HA ALA B 202 -14.264 21.714 16.291 1.00 0.00 H ATOM 9859 HB1 ALA B 202 -14.482 23.888 17.461 1.00 0.00 H ATOM 9860 HB2 ALA B 202 -16.035 23.368 18.158 1.00 0.00 H ATOM 9861 HB3 ALA B 202 -14.525 22.558 18.643 1.00 0.00 H ATOM 9862 H ALA B 202 -16.896 23.035 15.765 1.00 0.00 H ATOM 9863 N ILE B 203 -15.075 19.956 17.884 1.00 18.85 N ATOM 9864 CA ILE B 203 -15.481 18.688 18.451 1.00 11.51 C ATOM 9865 C ILE B 203 -16.112 18.960 19.785 1.00 19.07 C ATOM 9866 O ILE B 203 -15.618 19.800 20.517 1.00 28.94 O ATOM 9867 CB ILE B 203 -14.287 17.688 18.529 1.00 15.27 C ATOM 9868 CG1 ILE B 203 -14.309 16.757 17.298 1.00 22.15 C ATOM 9869 CG2 ILE B 203 -14.487 16.743 19.730 1.00 22.29 C ATOM 9870 CD1 ILE B 203 -13.076 16.797 16.434 1.00 24.23 C ATOM 9871 HA ILE B 203 -16.215 18.200 17.809 1.00 0.00 H ATOM 9872 HB ILE B 203 -13.367 18.269 18.598 1.00 0.00 H ATOM 9873 HG12 ILE B 203 -14.439 15.734 17.652 1.00 0.00 H ATOM 9874 HG13 ILE B 203 -15.162 17.037 16.680 1.00 0.00 H ATOM 9875 HD11 ILE B 203 -12.933 17.808 16.053 1.00 0.00 H ATOM 9876 HD12 ILE B 203 -12.209 16.505 17.027 1.00 0.00 H ATOM 9877 HD13 ILE B 203 -13.196 16.107 15.599 1.00 0.00 H ATOM 9878 HG21 ILE B 203 -14.532 17.329 20.648 1.00 0.00 H ATOM 9879 HG22 ILE B 203 -15.418 16.190 19.604 1.00 0.00 H ATOM 9880 HG23 ILE B 203 -13.652 16.044 19.784 1.00 0.00 H ATOM 9881 H ILE B 203 -14.088 20.256 18.016 1.00 0.00 H ATOM 9882 N ASP B 204 -17.196 18.237 20.056 1.00 10.44 N ATOM 9883 CA ASP B 204 -17.933 18.325 21.267 1.00 14.48 C ATOM 9884 C ASP B 204 -17.531 17.069 21.955 1.00 21.95 C ATOM 9885 O ASP B 204 -17.834 15.963 21.527 1.00 17.59 O ATOM 9886 CB ASP B 204 -19.400 18.295 20.933 1.00 11.79 C ATOM 9887 CG ASP B 204 -20.264 18.566 22.131 1.00 22.27 C ATOM 9888 OD1 ASP B 204 -19.769 18.084 23.261 1.00 30.06 O ATOM 9889 OD2 ASP B 204 -21.349 19.096 22.011 1.00 28.59 O ATOM 9890 HA ASP B 204 -17.753 19.222 21.860 1.00 0.00 H ATOM 9891 HB2 ASP B 204 -19.603 19.052 20.176 1.00 0.00 H ATOM 9892 HB3 ASP B 204 -19.649 17.311 20.536 1.00 0.00 H ATOM 9893 H ASP B 204 -17.525 17.564 19.334 1.00 0.00 H ATOM 9894 N SER B 205 -16.825 17.263 23.049 1.00 20.43 N ATOM 9895 CA SER B 205 -16.350 16.119 23.812 1.00 21.54 C ATOM 9896 C SER B 205 -17.443 15.238 24.390 1.00 21.01 C ATOM 9897 O SER B 205 -17.175 14.113 24.829 1.00 31.25 O ATOM 9898 CB SER B 205 -15.525 16.732 24.907 1.00 25.66 C ATOM 9899 OG SER B 205 -15.655 18.120 24.666 1.00 48.97 O ATOM 9900 HA SER B 205 -15.799 15.438 23.163 1.00 0.00 H ATOM 9901 HB2 SER B 205 -14.484 16.418 24.836 1.00 0.00 H ATOM 9902 HB3 SER B 205 -15.917 16.466 25.889 1.00 0.00 H ATOM 9903 HG SER B 205 -15.139 18.622 25.346 1.00 0.00 H ATOM 9904 H SER B 205 -16.608 18.229 23.366 1.00 0.00 H ATOM 9905 N LYS B 206 -18.673 15.760 24.367 1.00 17.47 N ATOM 9906 CA LYS B 206 -19.841 15.079 24.874 1.00 21.20 C ATOM 9907 C LYS B 206 -20.590 14.223 23.868 1.00 22.07 C ATOM 9908 O LYS B 206 -21.538 13.537 24.259 1.00 22.91 O ATOM 9909 CB LYS B 206 -20.793 16.088 25.496 1.00 35.24 C ATOM 9910 CG LYS B 206 -20.307 16.536 26.867 1.00 29.21 C ATOM 9911 CD LYS B 206 -19.686 15.364 27.616 1.00 36.94 C ATOM 9912 CE LYS B 206 -18.242 15.574 28.064 1.00 80.00 C ATOM 9913 NZ LYS B 206 -17.647 14.369 28.668 1.00 75.00 N ATOM 9914 HA LYS B 206 -19.460 14.377 25.616 1.00 0.00 H ATOM 9915 HB2 LYS B 206 -20.865 16.958 24.843 1.00 0.00 H ATOM 9916 HB3 LYS B 206 -21.777 15.631 25.600 1.00 0.00 H ATOM 9917 HG2 LYS B 206 -19.561 17.322 26.746 1.00 0.00 H ATOM 9918 HG3 LYS B 206 -21.150 16.923 27.439 1.00 0.00 H ATOM 9919 HD2 LYS B 206 -20.290 15.171 28.502 1.00 0.00 H ATOM 9920 HD3 LYS B 206 -19.714 14.492 26.962 1.00 0.00 H ATOM 9921 HE2 LYS B 206 -18.219 16.379 28.799 1.00 0.00 H ATOM 9922 HE3 LYS B 206 -17.647 15.859 27.197 1.00 0.00 H ATOM 9923 HZ1 LYS B 206 -18.201 14.092 29.503 1.00 0.00 H ATOM 9924 HZ2 LYS B 206 -17.654 13.595 27.973 1.00 0.00 H ATOM 9925 HZ3 LYS B 206 -16.667 14.573 28.952 1.00 0.00 H ATOM 9926 H LYS B 206 -18.796 16.710 23.961 1.00 0.00 H ATOM 9927 N LEU B 207 -20.199 14.232 22.597 1.00 18.71 N ATOM 9928 CA LEU B 207 -20.937 13.401 21.654 1.00 18.65 C ATOM 9929 C LEU B 207 -20.135 12.205 21.198 1.00 12.31 C ATOM 9930 O LEU B 207 -18.926 12.178 21.392 1.00 12.47 O ATOM 9931 CB LEU B 207 -21.203 14.185 20.379 1.00 17.36 C ATOM 9932 CG LEU B 207 -21.805 15.549 20.606 1.00 25.01 C ATOM 9933 CD1 LEU B 207 -22.044 16.144 19.238 1.00 20.53 C ATOM 9934 CD2 LEU B 207 -23.117 15.405 21.358 1.00 21.37 C ATOM 9935 HA LEU B 207 -21.844 13.092 22.173 1.00 0.00 H ATOM 9936 HB2 LEU B 207 -20.257 14.312 19.852 1.00 0.00 H ATOM 9937 HB3 LEU B 207 -21.889 13.607 19.759 1.00 0.00 H ATOM 9938 HG LEU B 207 -21.149 16.187 21.197 1.00 0.00 H ATOM 9939 HD21 LEU B 207 -23.805 14.796 20.772 1.00 0.00 H ATOM 9940 HD22 LEU B 207 -22.933 14.924 22.319 1.00 0.00 H ATOM 9941 HD23 LEU B 207 -23.551 16.392 21.521 1.00 0.00 H ATOM 9942 HD11 LEU B 207 -21.096 16.219 18.705 1.00 0.00 H ATOM 9943 HD12 LEU B 207 -22.727 15.504 18.679 1.00 0.00 H ATOM 9944 HD13 LEU B 207 -22.481 17.137 19.346 1.00 0.00 H ATOM 9945 H LEU B 207 -19.394 14.812 22.286 1.00 0.00 H ATOM 9946 N ASP B 208 -20.852 11.235 20.579 1.00 13.48 N ATOM 9947 CA ASP B 208 -20.243 10.067 20.048 1.00 12.89 C ATOM 9948 C ASP B 208 -19.522 10.500 18.781 1.00 8.06 C ATOM 9949 O ASP B 208 -19.777 11.545 18.148 1.00 10.38 O ATOM 9950 CB ASP B 208 -21.208 8.880 19.886 1.00 11.91 C ATOM 9951 CG ASP B 208 -22.323 9.188 18.948 1.00 19.66 C ATOM 9952 OD1 ASP B 208 -23.321 9.838 19.473 1.00 23.91 O ATOM 9953 OD2 ASP B 208 -22.382 8.659 17.880 1.00 16.42 O ATOM 9954 HA ASP B 208 -19.520 9.650 20.749 1.00 0.00 H ATOM 9955 HB2 ASP B 208 -20.652 8.024 19.503 1.00 0.00 H ATOM 9956 HB3 ASP B 208 -21.627 8.632 20.861 1.00 0.00 H ATOM 9957 H ASP B 208 -21.882 11.350 20.490 1.00 0.00 H ATOM 9958 N TRP B 209 -18.554 9.710 18.385 1.00 8.10 N ATOM 9959 CA TRP B 209 -17.719 9.973 17.226 1.00 7.73 C ATOM 9960 C TRP B 209 -18.531 10.199 15.950 1.00 4.88 C ATOM 9961 O TRP B 209 -18.200 11.133 15.205 1.00 9.32 O ATOM 9962 CB TRP B 209 -16.866 8.700 17.099 1.00 6.72 C ATOM 9963 CG TRP B 209 -15.674 8.688 16.177 1.00 5.31 C ATOM 9964 CD1 TRP B 209 -14.531 9.442 16.213 1.00 8.35 C ATOM 9965 CD2 TRP B 209 -15.540 7.783 15.062 1.00 10.82 C ATOM 9966 NE1 TRP B 209 -13.693 9.049 15.176 1.00 9.36 N ATOM 9967 CE2 TRP B 209 -14.288 8.045 14.456 1.00 9.07 C ATOM 9968 CE3 TRP B 209 -16.390 6.789 14.570 1.00 8.78 C ATOM 9969 CZ2 TRP B 209 -13.839 7.308 13.349 1.00 7.65 C ATOM 9970 CZ3 TRP B 209 -15.959 6.077 13.486 1.00 10.83 C ATOM 9971 CH2 TRP B 209 -14.678 6.328 12.901 1.00 10.86 C ATOM 9972 HA TRP B 209 -17.135 10.885 17.352 1.00 0.00 H ATOM 9973 HB2 TRP B 209 -16.496 8.466 18.097 1.00 0.00 H ATOM 9974 HB3 TRP B 209 -17.532 7.905 16.765 1.00 0.00 H ATOM 9975 HE1 TRP B 209 -12.757 9.455 14.976 1.00 0.00 H ATOM 9976 HD1 TRP B 209 -14.313 10.225 16.939 1.00 0.00 H ATOM 9977 HZ2 TRP B 209 -12.878 7.506 12.875 1.00 0.00 H ATOM 9978 HH2 TRP B 209 -14.358 5.711 12.062 1.00 0.00 H ATOM 9979 HZ3 TRP B 209 -16.601 5.306 13.061 1.00 0.00 H ATOM 9980 HE3 TRP B 209 -17.357 6.590 15.032 1.00 0.00 H ATOM 9981 H TRP B 209 -18.373 8.844 18.933 1.00 0.00 H ATOM 9982 N SER B 210 -19.525 9.351 15.676 1.00 10.54 N ATOM 9983 CA SER B 210 -20.353 9.513 14.474 1.00 3.48 C ATOM 9984 C SER B 210 -21.091 10.889 14.452 1.00 8.02 C ATOM 9985 O SER B 210 -21.234 11.565 13.408 1.00 10.96 O ATOM 9986 CB SER B 210 -21.444 8.420 14.454 1.00 5.00 C ATOM 9987 OG SER B 210 -20.784 7.141 14.408 1.00 9.25 O ATOM 9988 HA SER B 210 -19.685 9.444 13.615 1.00 0.00 H ATOM 9989 HB2 SER B 210 -22.077 8.543 13.575 1.00 0.00 H ATOM 9990 HB3 SER B 210 -22.056 8.490 15.353 1.00 0.00 H ATOM 9991 HG SER B 210 -20.209 7.039 15.207 1.00 0.00 H ATOM 9992 H SER B 210 -19.716 8.562 16.325 1.00 0.00 H ATOM 9993 N HIS B 211 -21.619 11.294 15.612 1.00 10.22 N ATOM 9994 CA HIS B 211 -22.350 12.541 15.767 1.00 8.91 C ATOM 9995 C HIS B 211 -21.416 13.725 15.530 1.00 14.10 C ATOM 9996 O HIS B 211 -21.757 14.700 14.842 1.00 14.19 O ATOM 9997 CB HIS B 211 -22.978 12.533 17.182 1.00 11.26 C ATOM 9998 CG HIS B 211 -24.012 13.619 17.261 1.00 14.11 C ATOM 9999 ND1 HIS B 211 -24.934 13.702 18.315 1.00 13.46 N ATOM 10000 CD2 HIS B 211 -24.257 14.639 16.402 1.00 12.14 C ATOM 10001 CE1 HIS B 211 -25.692 14.771 18.048 1.00 13.33 C ATOM 10002 NE2 HIS B 211 -25.310 15.360 16.899 1.00 10.44 N ATOM 10003 HA HIS B 211 -23.149 12.639 15.032 1.00 0.00 H ATOM 10004 HB2 HIS B 211 -23.447 11.567 17.369 1.00 0.00 H ATOM 10005 HB3 HIS B 211 -22.203 12.710 17.928 1.00 0.00 H ATOM 10006 HD2 HIS B 211 -23.713 14.848 15.481 1.00 0.00 H ATOM 10007 HE1 HIS B 211 -26.511 15.119 18.677 1.00 0.00 H ATOM 10008 H HIS B 211 -21.500 10.685 16.447 1.00 0.00 H ATOM 10009 N ASN B 212 -20.200 13.698 16.085 1.00 8.70 N ATOM 10010 CA ASN B 212 -19.308 14.841 15.809 1.00 10.10 C ATOM 10011 C ASN B 212 -19.026 14.852 14.304 1.00 7.12 C ATOM 10012 O ASN B 212 -18.971 15.895 13.678 1.00 12.30 O ATOM 10013 CB ASN B 212 -17.962 14.651 16.514 1.00 7.81 C ATOM 10014 CG ASN B 212 -18.037 15.133 17.962 1.00 26.05 C ATOM 10015 OD1 ASN B 212 -17.502 14.557 18.937 1.00 16.41 O ATOM 10016 ND2 ASN B 212 -18.422 16.395 18.047 1.00 14.74 N ATOM 10017 HA ASN B 212 -19.781 15.760 16.155 1.00 0.00 H ATOM 10018 HB2 ASN B 212 -17.698 13.594 16.502 1.00 0.00 H ATOM 10019 HB3 ASN B 212 -17.198 15.221 15.986 1.00 0.00 H ATOM 10020 HD22 ASN B 212 -18.865 16.860 17.229 1.00 0.00 H ATOM 10021 HD21 ASN B 212 -18.282 16.923 18.932 1.00 0.00 H ATOM 10022 H ASN B 212 -19.896 12.905 16.686 1.00 0.00 H ATOM 10023 N PHE B 213 -18.841 13.661 13.721 1.00 6.21 N ATOM 10024 CA PHE B 213 -18.544 13.544 12.290 1.00 12.54 C ATOM 10025 C PHE B 213 -19.665 14.135 11.444 1.00 8.10 C ATOM 10026 O PHE B 213 -19.393 14.936 10.603 1.00 9.26 O ATOM 10027 CB PHE B 213 -18.341 12.054 11.893 1.00 7.03 C ATOM 10028 CG PHE B 213 -17.793 11.872 10.501 1.00 6.53 C ATOM 10029 CD1 PHE B 213 -17.150 12.912 9.834 1.00 5.87 C ATOM 10030 CD2 PHE B 213 -17.910 10.655 9.838 1.00 7.34 C ATOM 10031 CE1 PHE B 213 -16.641 12.756 8.551 1.00 6.21 C ATOM 10032 CE2 PHE B 213 -17.374 10.455 8.564 1.00 9.04 C ATOM 10033 CZ PHE B 213 -16.742 11.522 7.917 1.00 7.43 C ATOM 10034 HA PHE B 213 -17.626 14.101 12.102 1.00 0.00 H ATOM 10035 HB2 PHE B 213 -17.646 11.600 12.600 1.00 0.00 H ATOM 10036 HB3 PHE B 213 -19.303 11.546 11.954 1.00 0.00 H ATOM 10037 HD2 PHE B 213 -18.435 9.834 10.327 1.00 0.00 H ATOM 10038 HE2 PHE B 213 -17.447 9.481 8.080 1.00 0.00 H ATOM 10039 HZ PHE B 213 -16.329 11.387 6.917 1.00 0.00 H ATOM 10040 HE1 PHE B 213 -16.165 13.596 8.044 1.00 0.00 H ATOM 10041 HD1 PHE B 213 -17.043 13.875 10.333 1.00 0.00 H ATOM 10042 H PHE B 213 -18.910 12.798 14.297 1.00 0.00 H ATOM 10043 N THR B 214 -20.938 13.742 11.691 1.00 9.77 N ATOM 10044 CA THR B 214 -22.070 14.263 10.931 1.00 11.82 C ATOM 10045 C THR B 214 -22.223 15.767 11.142 1.00 14.21 C ATOM 10046 O THR B 214 -22.608 16.468 10.256 1.00 13.26 O ATOM 10047 CB THR B 214 -23.390 13.534 11.156 1.00 10.93 C ATOM 10048 OG1 THR B 214 -23.632 13.755 12.506 1.00 16.44 O ATOM 10049 CG2 THR B 214 -23.337 12.010 10.947 1.00 3.54 C ATOM 10050 HA THR B 214 -21.823 14.069 9.887 1.00 0.00 H ATOM 10051 HB THR B 214 -24.136 13.897 10.449 1.00 0.00 H ATOM 10052 HG1 THR B 214 -23.698 14.729 12.673 1.00 0.00 H ATOM 10053 HG23 THR B 214 -23.148 11.795 9.895 1.00 0.00 H ATOM 10054 HG21 THR B 214 -22.536 11.589 11.555 1.00 0.00 H ATOM 10055 HG22 THR B 214 -24.289 11.571 11.243 1.00 0.00 H ATOM 10056 H THR B 214 -21.114 13.048 12.445 1.00 0.00 H ATOM 10057 N ASN B 215 -21.935 16.301 12.322 1.00 9.51 N ATOM 10058 CA ASN B 215 -22.020 17.738 12.544 1.00 10.90 C ATOM 10059 C ASN B 215 -20.920 18.438 11.717 1.00 17.89 C ATOM 10060 O ASN B 215 -21.102 19.506 11.116 1.00 10.82 O ATOM 10061 CB ASN B 215 -21.659 18.049 13.994 1.00 20.04 C ATOM 10062 CG ASN B 215 -22.774 17.762 14.985 1.00 17.75 C ATOM 10063 OD1 ASN B 215 -22.503 17.838 16.198 1.00 27.58 O ATOM 10064 ND2 ASN B 215 -24.026 17.652 14.524 1.00 13.23 N ATOM 10065 HA ASN B 215 -23.026 18.067 12.282 1.00 0.00 H ATOM 10066 HB2 ASN B 215 -20.793 17.447 14.268 1.00 0.00 H ATOM 10067 HB3 ASN B 215 -21.402 19.106 14.064 1.00 0.00 H ATOM 10068 HD22 ASN B 215 -24.200 17.592 13.500 1.00 0.00 H ATOM 10069 HD21 ASN B 215 -24.825 17.627 15.189 1.00 0.00 H ATOM 10070 H ASN B 215 -21.643 15.681 13.104 1.00 0.00 H ATOM 10071 N MET B 216 -19.731 17.845 11.646 1.00 10.89 N ATOM 10072 CA MET B 216 -18.669 18.460 10.852 1.00 7.96 C ATOM 10073 C MET B 216 -18.979 18.451 9.341 1.00 12.00 C ATOM 10074 O MET B 216 -18.501 19.337 8.661 1.00 10.47 O ATOM 10075 CB MET B 216 -17.224 17.927 11.084 1.00 9.70 C ATOM 10076 CG MET B 216 -16.770 18.064 12.532 1.00 7.51 C ATOM 10077 SD MET B 216 -15.049 17.548 12.738 1.00 18.43 S ATOM 10078 CE MET B 216 -15.301 15.764 12.892 1.00 12.30 C ATOM 10079 HA MET B 216 -18.669 19.481 11.234 1.00 0.00 H ATOM 10080 HB2 MET B 216 -17.192 16.873 10.807 1.00 0.00 H ATOM 10081 HB3 MET B 216 -16.539 18.489 10.449 1.00 0.00 H ATOM 10082 HG2 MET B 216 -17.405 17.442 13.163 1.00 0.00 H ATOM 10083 HG3 MET B 216 -16.867 19.106 12.837 1.00 0.00 H ATOM 10084 HE1 MET B 216 -15.938 15.561 13.753 1.00 0.00 H ATOM 10085 HE2 MET B 216 -15.779 15.387 11.988 1.00 0.00 H ATOM 10086 HE3 MET B 216 -14.338 15.273 13.027 1.00 0.00 H ATOM 10087 H MET B 216 -19.559 16.952 12.151 1.00 0.00 H ATOM 10088 N LEU B 217 -19.730 17.433 8.849 1.00 10.80 N ATOM 10089 CA LEU B 217 -20.159 17.240 7.424 1.00 10.46 C ATOM 10090 C LEU B 217 -21.287 18.217 7.143 1.00 16.83 C ATOM 10091 O LEU B 217 -21.610 18.562 6.018 1.00 11.37 O ATOM 10092 CB LEU B 217 -20.729 15.843 7.176 1.00 9.11 C ATOM 10093 CG LEU B 217 -19.600 14.821 7.116 1.00 11.89 C ATOM 10094 CD1 LEU B 217 -20.204 13.429 7.078 1.00 8.38 C ATOM 10095 CD2 LEU B 217 -18.625 15.107 5.949 1.00 14.58 C ATOM 10096 HA LEU B 217 -19.285 17.389 6.790 1.00 0.00 H ATOM 10097 HB2 LEU B 217 -21.410 15.582 7.986 1.00 0.00 H ATOM 10098 HB3 LEU B 217 -21.272 15.837 6.231 1.00 0.00 H ATOM 10099 HG LEU B 217 -18.984 14.896 8.012 1.00 0.00 H ATOM 10100 HD21 LEU B 217 -19.169 15.071 5.005 1.00 0.00 H ATOM 10101 HD22 LEU B 217 -18.185 16.096 6.079 1.00 0.00 H ATOM 10102 HD23 LEU B 217 -17.836 14.355 5.944 1.00 0.00 H ATOM 10103 HD11 LEU B 217 -20.801 13.269 7.976 1.00 0.00 H ATOM 10104 HD12 LEU B 217 -20.838 13.333 6.196 1.00 0.00 H ATOM 10105 HD13 LEU B 217 -19.405 12.689 7.035 1.00 0.00 H ATOM 10106 H LEU B 217 -20.040 16.712 9.531 1.00 0.00 H ATOM 10107 N GLY B 218 -21.923 18.657 8.216 1.00 11.22 N ATOM 10108 CA GLY B 218 -23.025 19.623 8.217 1.00 12.38 C ATOM 10109 C GLY B 218 -24.436 19.086 8.126 1.00 9.26 C ATOM 10110 O GLY B 218 -25.302 19.802 7.658 1.00 17.44 O ATOM 10111 HA3 GLY B 218 -22.875 20.288 7.367 1.00 0.00 H ATOM 10112 HA2 GLY B 218 -22.954 20.196 9.142 1.00 0.00 H ATOM 10113 H GLY B 218 -21.615 18.286 9.137 1.00 0.00 H ATOM 10114 N TYR B 219 -24.678 17.847 8.569 1.00 9.71 N ATOM 10115 CA TYR B 219 -26.019 17.311 8.475 1.00 8.10 C ATOM 10116 C TYR B 219 -26.769 17.365 9.765 1.00 9.69 C ATOM 10117 O TYR B 219 -26.216 17.044 10.796 1.00 15.24 O ATOM 10118 CB TYR B 219 -25.936 15.884 7.964 1.00 5.62 C ATOM 10119 CG TYR B 219 -25.584 15.932 6.491 1.00 3.49 C ATOM 10120 CD1 TYR B 219 -24.263 15.999 6.047 1.00 9.10 C ATOM 10121 CD2 TYR B 219 -26.582 15.876 5.519 1.00 14.81 C ATOM 10122 CE1 TYR B 219 -23.942 16.049 4.688 1.00 8.41 C ATOM 10123 CE2 TYR B 219 -26.287 15.906 4.159 1.00 13.05 C ATOM 10124 CZ TYR B 219 -24.959 15.994 3.737 1.00 15.64 C ATOM 10125 OH TYR B 219 -24.723 16.058 2.394 1.00 14.42 O ATOM 10126 HA TYR B 219 -26.580 17.936 7.781 1.00 0.00 H ATOM 10127 HB3 TYR B 219 -26.896 15.386 8.099 1.00 0.00 H ATOM 10128 HB2 TYR B 219 -25.166 15.339 8.511 1.00 0.00 H ATOM 10129 HD2 TYR B 219 -27.623 15.807 5.833 1.00 0.00 H ATOM 10130 HE2 TYR B 219 -27.091 15.861 3.425 1.00 0.00 H ATOM 10131 HE1 TYR B 219 -22.902 16.131 4.373 1.00 0.00 H ATOM 10132 HD1 TYR B 219 -23.458 16.013 6.782 1.00 0.00 H ATOM 10133 HH TYR B 219 -23.748 16.117 2.234 1.00 0.00 H ATOM 10134 H TYR B 219 -23.911 17.275 8.976 1.00 0.00 H ATOM 10135 N THR B 220 -28.019 17.774 9.693 1.00 15.74 N ATOM 10136 CA THR B 220 -28.789 17.874 10.917 1.00 32.34 C ATOM 10137 C THR B 220 -29.729 16.721 11.238 1.00 27.31 C ATOM 10138 O THR B 220 -29.970 16.418 12.404 1.00 31.60 O ATOM 10139 CB THR B 220 -29.558 19.219 10.932 1.00 30.69 C ATOM 10140 OG1 THR B 220 -30.529 19.154 9.902 1.00 23.11 O ATOM 10141 CG2 THR B 220 -28.606 20.366 10.600 1.00 29.45 C ATOM 10142 HA THR B 220 -28.046 17.821 11.713 1.00 0.00 H ATOM 10143 HB THR B 220 -30.004 19.386 11.912 1.00 0.00 H ATOM 10144 HG1 THR B 220 -30.077 19.019 9.032 1.00 0.00 H ATOM 10145 HG23 THR B 220 -27.845 20.441 11.377 1.00 0.00 H ATOM 10146 HG21 THR B 220 -28.128 20.174 9.639 1.00 0.00 H ATOM 10147 HG22 THR B 220 -29.167 21.299 10.548 1.00 0.00 H ATOM 10148 H THR B 220 -28.445 18.020 8.777 1.00 0.00 H ATOM 10149 N ASP B 221 -30.257 16.081 10.202 1.00 12.56 N ATOM 10150 CA ASP B 221 -31.195 14.970 10.343 1.00 5.75 C ATOM 10151 C ASP B 221 -30.685 13.897 11.293 1.00 19.20 C ATOM 10152 O ASP B 221 -29.603 13.342 11.129 1.00 23.58 O ATOM 10153 CB ASP B 221 -31.555 14.402 8.972 1.00 16.52 C ATOM 10154 CG ASP B 221 -32.807 13.571 8.968 1.00 15.14 C ATOM 10155 OD1 ASP B 221 -33.049 12.920 10.092 1.00 18.46 O ATOM 10156 OD2 ASP B 221 -33.476 13.467 7.965 1.00 35.17 O ATOM 10157 HA ASP B 221 -32.106 15.359 10.797 1.00 0.00 H ATOM 10158 HB2 ASP B 221 -31.692 15.234 8.281 1.00 0.00 H ATOM 10159 HB3 ASP B 221 -30.728 13.779 8.630 1.00 0.00 H ATOM 10160 H ASP B 221 -29.990 16.385 9.244 1.00 0.00 H ATOM 10161 N PRO B 222 -31.508 13.615 12.309 1.00 27.86 N ATOM 10162 CA PRO B 222 -31.219 12.621 13.328 1.00 22.10 C ATOM 10163 C PRO B 222 -31.200 11.221 12.739 1.00 13.61 C ATOM 10164 O PRO B 222 -30.491 10.382 13.264 1.00 14.25 O ATOM 10165 CB PRO B 222 -32.337 12.698 14.343 1.00 21.37 C ATOM 10166 CG PRO B 222 -33.091 13.984 14.026 1.00 30.04 C ATOM 10167 CD PRO B 222 -32.667 14.475 12.657 1.00 27.96 C ATOM 10168 HA PRO B 222 -30.242 12.818 13.769 1.00 0.00 H ATOM 10169 HD3 PRO B 222 -33.473 14.351 11.934 1.00 0.00 H ATOM 10170 HD2 PRO B 222 -32.374 15.524 12.695 1.00 0.00 H ATOM 10171 HG3 PRO B 222 -32.857 14.740 14.775 1.00 0.00 H ATOM 10172 HG2 PRO B 222 -34.164 13.790 14.030 1.00 0.00 H ATOM 10173 HB2 PRO B 222 -32.997 11.836 14.248 1.00 0.00 H ATOM 10174 HB3 PRO B 222 -31.931 12.734 15.354 1.00 0.00 H ATOM 10175 N GLN B 223 -31.946 10.949 11.671 1.00 12.04 N ATOM 10176 CA GLN B 223 -31.918 9.613 11.107 1.00 10.49 C ATOM 10177 C GLN B 223 -30.611 9.417 10.371 1.00 12.32 C ATOM 10178 O GLN B 223 -30.107 8.284 10.203 1.00 10.56 O ATOM 10179 CB GLN B 223 -33.107 9.282 10.189 1.00 10.59 C ATOM 10180 CG GLN B 223 -33.983 8.142 10.714 1.00 41.79 C ATOM 10181 CD GLN B 223 -33.414 7.531 11.974 1.00 80.00 C ATOM 10182 OE1 GLN B 223 -33.415 8.190 13.032 1.00 80.00 O ATOM 10183 NE2 GLN B 223 -32.864 6.310 11.828 1.00 35.31 N ATOM 10184 HA GLN B 223 -32.004 8.919 11.943 1.00 0.00 H ATOM 10185 HB2 GLN B 223 -33.725 10.174 10.088 1.00 0.00 H ATOM 10186 HB3 GLN B 223 -32.720 8.998 9.211 1.00 0.00 H ATOM 10187 HG2 GLN B 223 -34.978 8.532 10.929 1.00 0.00 H ATOM 10188 HG3 GLN B 223 -34.054 7.370 9.948 1.00 0.00 H ATOM 10189 HE22 GLN B 223 -32.907 5.827 10.908 1.00 0.00 H ATOM 10190 HE21 GLN B 223 -32.396 5.850 12.635 1.00 0.00 H ATOM 10191 H GLN B 223 -32.543 11.687 11.245 1.00 0.00 H ATOM 10192 N PHE B 224 -30.074 10.555 9.921 1.00 14.57 N ATOM 10193 CA PHE B 224 -28.819 10.542 9.186 1.00 6.91 C ATOM 10194 C PHE B 224 -27.686 10.129 10.139 1.00 13.33 C ATOM 10195 O PHE B 224 -26.763 9.409 9.729 1.00 12.11 O ATOM 10196 CB PHE B 224 -28.444 11.874 8.508 1.00 10.75 C ATOM 10197 CG PHE B 224 -27.170 11.743 7.676 1.00 11.02 C ATOM 10198 CD1 PHE B 224 -27.142 10.919 6.546 1.00 14.52 C ATOM 10199 CD2 PHE B 224 -25.994 12.412 8.020 1.00 10.21 C ATOM 10200 CE1 PHE B 224 -26.026 10.761 5.732 1.00 12.89 C ATOM 10201 CE2 PHE B 224 -24.850 12.268 7.230 1.00 13.52 C ATOM 10202 CZ PHE B 224 -24.875 11.464 6.086 1.00 12.88 C ATOM 10203 HA PHE B 224 -28.958 9.827 8.375 1.00 0.00 H ATOM 10204 HB2 PHE B 224 -29.262 12.182 7.857 1.00 0.00 H ATOM 10205 HB3 PHE B 224 -28.288 12.631 9.277 1.00 0.00 H ATOM 10206 HD2 PHE B 224 -25.968 13.047 8.905 1.00 0.00 H ATOM 10207 HE2 PHE B 224 -23.932 12.786 7.508 1.00 0.00 H ATOM 10208 HZ PHE B 224 -23.984 11.386 5.463 1.00 0.00 H ATOM 10209 HE1 PHE B 224 -26.050 10.115 4.854 1.00 0.00 H ATOM 10210 HD1 PHE B 224 -28.047 10.369 6.289 1.00 0.00 H ATOM 10211 H PHE B 224 -30.558 11.458 10.098 1.00 0.00 H ATOM 10212 N THR B 225 -27.742 10.588 11.418 1.00 13.78 N ATOM 10213 CA THR B 225 -26.737 10.276 12.443 1.00 9.26 C ATOM 10214 C THR B 225 -26.788 8.745 12.684 1.00 3.00 C ATOM 10215 O THR B 225 -25.759 8.079 12.813 1.00 9.88 O ATOM 10216 CB THR B 225 -26.845 11.098 13.784 1.00 12.13 C ATOM 10217 OG1 THR B 225 -27.085 12.533 13.699 1.00 25.40 O ATOM 10218 CG2 THR B 225 -25.577 10.790 14.594 1.00 19.55 C ATOM 10219 HA THR B 225 -25.765 10.590 12.062 1.00 0.00 H ATOM 10220 HB THR B 225 -27.765 10.767 14.265 1.00 0.00 H ATOM 10221 HG1 THR B 225 -27.129 12.914 14.612 1.00 0.00 H ATOM 10222 HG23 THR B 225 -25.428 9.711 14.637 1.00 0.00 H ATOM 10223 HG21 THR B 225 -24.718 11.258 14.113 1.00 0.00 H ATOM 10224 HG22 THR B 225 -25.688 11.184 15.604 1.00 0.00 H ATOM 10225 H THR B 225 -28.543 11.195 11.686 1.00 0.00 H ATOM 10226 N GLU B 226 -28.007 8.184 12.724 1.00 9.49 N ATOM 10227 CA GLU B 226 -28.283 6.770 12.937 1.00 9.01 C ATOM 10228 C GLU B 226 -27.706 5.981 11.780 1.00 8.80 C ATOM 10229 O GLU B 226 -27.076 4.913 11.930 1.00 13.31 O ATOM 10230 CB GLU B 226 -29.792 6.491 13.221 1.00 9.21 C ATOM 10231 CG GLU B 226 -30.135 6.900 14.680 1.00 9.88 C ATOM 10232 CD GLU B 226 -29.767 5.768 15.619 1.00 7.10 C ATOM 10233 OE1 GLU B 226 -30.383 4.726 15.616 1.00 29.36 O ATOM 10234 OE2 GLU B 226 -28.665 5.981 16.325 1.00 13.54 O ATOM 10235 HA GLU B 226 -27.788 6.431 13.847 1.00 0.00 H ATOM 10236 HB2 GLU B 226 -30.404 7.069 12.529 1.00 0.00 H ATOM 10237 HB3 GLU B 226 -29.996 5.429 13.085 1.00 0.00 H ATOM 10238 HG2 GLU B 226 -29.573 7.794 14.949 1.00 0.00 H ATOM 10239 HG3 GLU B 226 -31.202 7.106 14.759 1.00 0.00 H ATOM 10240 H GLU B 226 -28.824 8.813 12.592 1.00 0.00 H ATOM 10241 N LEU B 227 -27.894 6.516 10.574 1.00 13.51 N ATOM 10242 CA LEU B 227 -27.352 5.841 9.368 1.00 12.37 C ATOM 10243 C LEU B 227 -25.811 5.788 9.445 1.00 10.18 C ATOM 10244 O LEU B 227 -25.149 4.764 9.157 1.00 10.28 O ATOM 10245 CB LEU B 227 -27.829 6.495 8.036 1.00 7.79 C ATOM 10246 CG LEU B 227 -27.042 5.950 6.823 1.00 8.80 C ATOM 10247 CD1 LEU B 227 -27.311 4.464 6.605 1.00 13.90 C ATOM 10248 CD2 LEU B 227 -27.202 6.818 5.561 1.00 7.74 C ATOM 10249 HA LEU B 227 -27.747 4.825 9.359 1.00 0.00 H ATOM 10250 HB2 LEU B 227 -28.889 6.281 7.896 1.00 0.00 H ATOM 10251 HB3 LEU B 227 -27.682 7.573 8.098 1.00 0.00 H ATOM 10252 HG LEU B 227 -25.981 6.027 7.061 1.00 0.00 H ATOM 10253 HD21 LEU B 227 -28.255 6.860 5.281 1.00 0.00 H ATOM 10254 HD22 LEU B 227 -26.839 7.825 5.766 1.00 0.00 H ATOM 10255 HD23 LEU B 227 -26.625 6.381 4.746 1.00 0.00 H ATOM 10256 HD11 LEU B 227 -27.009 3.907 7.492 1.00 0.00 H ATOM 10257 HD12 LEU B 227 -28.375 4.311 6.424 1.00 0.00 H ATOM 10258 HD13 LEU B 227 -26.741 4.115 5.744 1.00 0.00 H ATOM 10259 H LEU B 227 -28.421 7.407 10.478 1.00 0.00 H ATOM 10260 N MET B 228 -25.230 6.903 9.853 1.00 7.04 N ATOM 10261 CA MET B 228 -23.802 7.000 9.974 1.00 8.60 C ATOM 10262 C MET B 228 -23.243 5.970 10.974 1.00 10.35 C ATOM 10263 O MET B 228 -22.257 5.311 10.739 1.00 10.06 O ATOM 10264 CB MET B 228 -23.365 8.471 10.116 1.00 6.91 C ATOM 10265 CG MET B 228 -21.861 8.578 10.124 1.00 15.20 C ATOM 10266 SD MET B 228 -21.088 8.465 8.460 1.00 20.66 S ATOM 10267 CE MET B 228 -22.572 8.906 7.503 1.00 17.75 C ATOM 10268 HA MET B 228 -23.313 6.693 9.050 1.00 0.00 H ATOM 10269 HB2 MET B 228 -23.761 9.045 9.279 1.00 0.00 H ATOM 10270 HB3 MET B 228 -23.758 8.874 11.049 1.00 0.00 H ATOM 10271 HG2 MET B 228 -21.464 7.772 10.741 1.00 0.00 H ATOM 10272 HG3 MET B 228 -21.589 9.538 10.563 1.00 0.00 H ATOM 10273 HE1 MET B 228 -23.360 8.180 7.703 1.00 0.00 H ATOM 10274 HE2 MET B 228 -22.909 9.900 7.795 1.00 0.00 H ATOM 10275 HE3 MET B 228 -22.332 8.900 6.440 1.00 0.00 H ATOM 10276 H MET B 228 -25.819 7.727 10.091 1.00 0.00 H ATOM 10277 N ARG B 229 -23.901 5.828 12.102 1.00 8.14 N ATOM 10278 CA ARG B 229 -23.492 4.888 13.129 1.00 7.00 C ATOM 10279 C ARG B 229 -23.507 3.498 12.550 1.00 11.09 C ATOM 10280 O ARG B 229 -22.596 2.689 12.754 1.00 9.62 O ATOM 10281 CB ARG B 229 -24.269 4.975 14.453 1.00 11.61 C ATOM 10282 CG ARG B 229 -24.174 6.334 15.149 1.00 8.73 C ATOM 10283 CD ARG B 229 -25.281 6.472 16.211 1.00 4.91 C ATOM 10284 NE ARG B 229 -25.000 7.624 17.004 1.00 13.22 N ATOM 10285 CZ ARG B 229 -25.972 8.450 17.359 1.00 19.49 C ATOM 10286 NH1 ARG B 229 -27.253 8.210 17.022 1.00 13.32 N ATOM 10287 NH2 ARG B 229 -25.672 9.508 18.092 1.00 13.88 N ATOM 10288 HA ARG B 229 -22.480 5.166 13.423 1.00 0.00 H ATOM 10289 HB2 ARG B 229 -25.319 4.769 14.247 1.00 0.00 H ATOM 10290 HB3 ARG B 229 -23.877 4.216 15.130 1.00 0.00 H ATOM 10291 HG2 ARG B 229 -23.200 6.424 15.631 1.00 0.00 H ATOM 10292 HG3 ARG B 229 -24.286 7.126 14.408 1.00 0.00 H ATOM 10293 HD2 ARG B 229 -25.298 5.584 16.843 1.00 0.00 H ATOM 10294 HD3 ARG B 229 -26.249 6.588 15.722 1.00 0.00 H ATOM 10295 HE ARG B 229 -24.024 7.817 17.306 1.00 0.00 H ATOM 10296 HH12 ARG B 229 -28.000 8.873 17.312 1.00 0.00 H ATOM 10297 HH11 ARG B 229 -27.496 7.362 16.472 1.00 0.00 H ATOM 10298 HH22 ARG B 229 -26.421 10.169 18.382 1.00 0.00 H ATOM 10299 HH21 ARG B 229 -24.687 9.679 18.379 1.00 0.00 H ATOM 10300 H ARG B 229 -24.747 6.411 12.265 1.00 0.00 H ATOM 10301 N LEU B 230 -24.561 3.169 11.808 1.00 9.29 N ATOM 10302 CA LEU B 230 -24.627 1.824 11.226 1.00 8.94 C ATOM 10303 C LEU B 230 -23.568 1.642 10.144 1.00 3.64 C ATOM 10304 O LEU B 230 -22.848 0.668 10.078 1.00 7.51 O ATOM 10305 CB LEU B 230 -26.037 1.646 10.625 1.00 11.97 C ATOM 10306 CG LEU B 230 -26.215 0.260 9.981 1.00 12.69 C ATOM 10307 CD1 LEU B 230 -26.129 -0.788 11.104 1.00 16.93 C ATOM 10308 CD2 LEU B 230 -27.555 0.209 9.229 1.00 26.58 C ATOM 10309 HA LEU B 230 -24.436 1.076 11.996 1.00 0.00 H ATOM 10310 HB2 LEU B 230 -26.776 1.764 11.418 1.00 0.00 H ATOM 10311 HB3 LEU B 230 -26.196 2.411 9.865 1.00 0.00 H ATOM 10312 HG LEU B 230 -25.436 0.053 9.247 1.00 0.00 H ATOM 10313 HD21 LEU B 230 -28.370 0.391 9.929 1.00 0.00 H ATOM 10314 HD22 LEU B 230 -27.564 0.974 8.452 1.00 0.00 H ATOM 10315 HD23 LEU B 230 -27.678 -0.774 8.774 1.00 0.00 H ATOM 10316 HD11 LEU B 230 -25.157 -0.717 11.592 1.00 0.00 H ATOM 10317 HD12 LEU B 230 -26.918 -0.603 11.833 1.00 0.00 H ATOM 10318 HD13 LEU B 230 -26.252 -1.784 10.680 1.00 0.00 H ATOM 10319 H LEU B 230 -25.326 3.854 11.643 1.00 0.00 H ATOM 10320 N TYR B 231 -23.462 2.643 9.278 1.00 10.75 N ATOM 10321 CA TYR B 231 -22.494 2.608 8.181 1.00 11.71 C ATOM 10322 C TYR B 231 -21.088 2.364 8.677 1.00 5.26 C ATOM 10323 O TYR B 231 -20.408 1.446 8.201 1.00 3.04 O ATOM 10324 CB TYR B 231 -22.548 3.923 7.404 1.00 5.94 C ATOM 10325 CG TYR B 231 -21.807 3.968 6.087 1.00 7.93 C ATOM 10326 CD1 TYR B 231 -20.416 3.859 6.047 1.00 9.11 C ATOM 10327 CD2 TYR B 231 -22.506 4.106 4.885 1.00 9.05 C ATOM 10328 CE1 TYR B 231 -19.692 3.899 4.852 1.00 4.36 C ATOM 10329 CE2 TYR B 231 -21.808 4.139 3.677 1.00 13.01 C ATOM 10330 CZ TYR B 231 -20.409 4.043 3.671 1.00 9.47 C ATOM 10331 OH TYR B 231 -19.692 4.087 2.473 1.00 15.02 O ATOM 10332 HA TYR B 231 -22.762 1.778 7.527 1.00 0.00 H ATOM 10333 HB3 TYR B 231 -22.132 4.701 8.043 1.00 0.00 H ATOM 10334 HB2 TYR B 231 -23.596 4.143 7.201 1.00 0.00 H ATOM 10335 HD2 TYR B 231 -23.593 4.188 4.891 1.00 0.00 H ATOM 10336 HE2 TYR B 231 -22.351 4.240 2.737 1.00 0.00 H ATOM 10337 HE1 TYR B 231 -18.605 3.820 4.847 1.00 0.00 H ATOM 10338 HD1 TYR B 231 -19.873 3.738 6.984 1.00 0.00 H ATOM 10339 HH TYR B 231 -19.978 3.339 1.891 1.00 0.00 H ATOM 10340 H TYR B 231 -24.082 3.472 9.382 1.00 0.00 H ATOM 10341 N LEU B 232 -20.658 3.198 9.635 1.00 4.64 N ATOM 10342 CA LEU B 232 -19.364 3.082 10.160 1.00 6.28 C ATOM 10343 C LEU B 232 -19.112 1.766 10.903 1.00 10.20 C ATOM 10344 O LEU B 232 -17.995 1.230 11.010 1.00 8.34 O ATOM 10345 CB LEU B 232 -19.165 4.351 10.985 1.00 9.56 C ATOM 10346 CG LEU B 232 -18.932 5.646 10.191 1.00 9.94 C ATOM 10347 CD1 LEU B 232 -18.708 6.712 11.259 1.00 7.31 C ATOM 10348 CD2 LEU B 232 -17.812 5.604 9.123 1.00 5.94 C ATOM 10349 HA LEU B 232 -18.608 3.016 9.378 1.00 0.00 H ATOM 10350 HB2 LEU B 232 -20.055 4.492 11.599 1.00 0.00 H ATOM 10351 HB3 LEU B 232 -18.301 4.196 11.631 1.00 0.00 H ATOM 10352 HG LEU B 232 -19.795 5.851 9.558 1.00 0.00 H ATOM 10353 HD21 LEU B 232 -16.862 5.371 9.604 1.00 0.00 H ATOM 10354 HD22 LEU B 232 -18.044 4.837 8.385 1.00 0.00 H ATOM 10355 HD23 LEU B 232 -17.744 6.574 8.631 1.00 0.00 H ATOM 10356 HD11 LEU B 232 -19.590 6.778 11.896 1.00 0.00 H ATOM 10357 HD12 LEU B 232 -17.842 6.443 11.863 1.00 0.00 H ATOM 10358 HD13 LEU B 232 -18.533 7.675 10.779 1.00 0.00 H ATOM 10359 H LEU B 232 -21.293 3.940 9.993 1.00 0.00 H ATOM 10360 N THR B 233 -20.152 1.169 11.456 1.00 6.98 N ATOM 10361 CA THR B 233 -19.941 -0.090 12.153 1.00 6.92 C ATOM 10362 C THR B 233 -19.776 -1.244 11.159 1.00 8.61 C ATOM 10363 O THR B 233 -18.874 -2.052 11.301 1.00 8.97 O ATOM 10364 CB THR B 233 -21.179 -0.407 13.078 1.00 3.11 C ATOM 10365 OG1 THR B 233 -21.223 0.521 14.124 1.00 9.72 O ATOM 10366 CG2 THR B 233 -21.122 -1.818 13.684 1.00 6.83 C ATOM 10367 HA THR B 233 -19.034 0.008 12.750 1.00 0.00 H ATOM 10368 HB THR B 233 -22.069 -0.346 12.452 1.00 0.00 H ATOM 10369 HG1 THR B 233 -21.312 1.433 13.751 1.00 0.00 H ATOM 10370 HG23 THR B 233 -21.087 -2.555 12.882 1.00 0.00 H ATOM 10371 HG21 THR B 233 -20.230 -1.910 14.303 1.00 0.00 H ATOM 10372 HG22 THR B 233 -22.009 -1.986 14.295 1.00 0.00 H ATOM 10373 H THR B 233 -21.101 1.590 11.394 1.00 0.00 H ATOM 10374 N ILE B 234 -20.647 -1.332 10.141 1.00 5.01 N ATOM 10375 CA ILE B 234 -20.598 -2.413 9.192 1.00 7.13 C ATOM 10376 C ILE B 234 -19.491 -2.440 8.196 1.00 3.00 C ATOM 10377 O ILE B 234 -19.193 -3.543 7.705 1.00 5.31 O ATOM 10378 CB ILE B 234 -21.959 -2.687 8.571 1.00 8.62 C ATOM 10379 CG1 ILE B 234 -22.345 -1.599 7.572 1.00 8.22 C ATOM 10380 CG2 ILE B 234 -23.003 -2.891 9.684 1.00 11.83 C ATOM 10381 CD1 ILE B 234 -23.526 -2.002 6.671 1.00 13.48 C ATOM 10382 HA ILE B 234 -20.316 -3.253 9.827 1.00 0.00 H ATOM 10383 HB ILE B 234 -21.915 -3.610 7.992 1.00 0.00 H ATOM 10384 HG12 ILE B 234 -22.620 -0.701 8.125 1.00 0.00 H ATOM 10385 HG13 ILE B 234 -21.483 -1.385 6.940 1.00 0.00 H ATOM 10386 HD11 ILE B 234 -23.261 -2.894 6.104 1.00 0.00 H ATOM 10387 HD12 ILE B 234 -24.399 -2.209 7.290 1.00 0.00 H ATOM 10388 HD13 ILE B 234 -23.752 -1.187 5.984 1.00 0.00 H ATOM 10389 HG21 ILE B 234 -22.710 -3.738 10.304 1.00 0.00 H ATOM 10390 HG22 ILE B 234 -23.059 -1.992 10.298 1.00 0.00 H ATOM 10391 HG23 ILE B 234 -23.977 -3.087 9.235 1.00 0.00 H ATOM 10392 H ILE B 234 -21.377 -0.599 10.035 1.00 0.00 H ATOM 10393 N HIS B 235 -18.927 -1.243 7.931 1.00 3.16 N ATOM 10394 CA HIS B 235 -17.848 -1.245 6.956 1.00 3.65 C ATOM 10395 C HIS B 235 -16.478 -1.435 7.637 1.00 5.94 C ATOM 10396 O HIS B 235 -15.458 -1.455 6.943 1.00 5.96 O ATOM 10397 CB HIS B 235 -17.795 0.042 6.130 1.00 3.16 C ATOM 10398 CG HIS B 235 -18.897 0.184 5.119 1.00 4.63 C ATOM 10399 ND1 HIS B 235 -20.184 0.542 5.467 1.00 9.30 N ATOM 10400 CD2 HIS B 235 -18.853 -0.001 3.765 1.00 7.26 C ATOM 10401 CE1 HIS B 235 -20.906 0.607 4.335 1.00 5.32 C ATOM 10402 NE2 HIS B 235 -20.125 0.275 3.308 1.00 3.76 N ATOM 10403 HA HIS B 235 -18.059 -2.082 6.290 1.00 0.00 H ATOM 10404 HB2 HIS B 235 -17.851 0.888 6.815 1.00 0.00 H ATOM 10405 HB3 HIS B 235 -16.843 0.067 5.601 1.00 0.00 H ATOM 10406 HD2 HIS B 235 -17.991 -0.304 3.170 1.00 0.00 H ATOM 10407 HE1 HIS B 235 -21.958 0.886 4.268 1.00 0.00 H ATOM 10408 H HIS B 235 -19.246 -0.370 8.397 1.00 0.00 H ATOM 10409 N SER B 236 -16.479 -1.565 8.970 1.00 6.34 N ATOM 10410 CA SER B 236 -15.288 -1.658 9.793 1.00 4.22 C ATOM 10411 C SER B 236 -14.169 -2.646 9.498 1.00 7.58 C ATOM 10412 O SER B 236 -12.985 -2.262 9.566 1.00 5.63 O ATOM 10413 CB SER B 236 -15.713 -1.716 11.248 1.00 3.56 C ATOM 10414 OG SER B 236 -16.217 -3.031 11.451 1.00 5.53 O ATOM 10415 HA SER B 236 -14.756 -0.751 9.505 1.00 0.00 H ATOM 10416 HB2 SER B 236 -16.489 -0.977 11.447 1.00 0.00 H ATOM 10417 HB3 SER B 236 -14.860 -1.531 11.901 1.00 0.00 H ATOM 10418 HG SER B 236 -16.984 -3.186 10.845 1.00 0.00 H ATOM 10419 H SER B 236 -17.401 -1.602 9.450 1.00 0.00 H ATOM 10420 N ASP B 237 -14.514 -3.911 9.212 1.00 4.83 N ATOM 10421 CA ASP B 237 -13.475 -4.913 8.966 1.00 3.24 C ATOM 10422 C ASP B 237 -14.088 -6.018 8.126 1.00 6.44 C ATOM 10423 O ASP B 237 -15.297 -6.204 8.175 1.00 3.96 O ATOM 10424 CB ASP B 237 -13.196 -5.514 10.380 1.00 8.15 C ATOM 10425 CG ASP B 237 -11.775 -5.976 10.470 1.00 8.98 C ATOM 10426 OD1 ASP B 237 -10.904 -5.505 9.771 1.00 8.75 O ATOM 10427 OD2 ASP B 237 -11.619 -7.021 11.237 1.00 7.67 O ATOM 10428 HA ASP B 237 -12.591 -4.507 8.474 1.00 0.00 H ATOM 10429 HB2 ASP B 237 -13.377 -4.752 11.138 1.00 0.00 H ATOM 10430 HB3 ASP B 237 -13.862 -6.360 10.551 1.00 0.00 H ATOM 10431 H ASP B 237 -15.518 -4.179 9.165 1.00 0.00 H ATOM 10432 N HIS B 238 -13.275 -6.763 7.411 1.00 5.27 N ATOM 10433 CA HIS B 238 -13.876 -7.835 6.639 1.00 3.35 C ATOM 10434 C HIS B 238 -12.812 -8.895 6.519 1.00 11.01 C ATOM 10435 O HIS B 238 -12.457 -9.301 5.432 1.00 4.96 O ATOM 10436 CB HIS B 238 -14.457 -7.357 5.292 1.00 7.68 C ATOM 10437 CG HIS B 238 -15.644 -8.168 4.804 1.00 4.51 C ATOM 10438 ND1 HIS B 238 -15.641 -8.744 3.558 1.00 6.25 N ATOM 10439 CD2 HIS B 238 -16.848 -8.475 5.396 1.00 11.18 C ATOM 10440 CE1 HIS B 238 -16.828 -9.370 3.408 1.00 7.71 C ATOM 10441 NE2 HIS B 238 -17.574 -9.234 4.487 1.00 7.73 N ATOM 10442 HA HIS B 238 -14.756 -8.243 7.137 1.00 0.00 H ATOM 10443 HB2 HIS B 238 -14.774 -6.320 5.405 1.00 0.00 H ATOM 10444 HB3 HIS B 238 -13.670 -7.415 4.540 1.00 0.00 H ATOM 10445 HD2 HIS B 238 -17.172 -8.178 6.393 1.00 0.00 H ATOM 10446 HE1 HIS B 238 -17.130 -9.915 2.514 1.00 0.00 H ATOM 10447 H HIS B 238 -12.249 -6.592 7.399 1.00 0.00 H ATOM 10448 N GLU B 239 -12.286 -9.321 7.656 1.00 3.00 N ATOM 10449 CA GLU B 239 -11.213 -10.298 7.671 1.00 3.00 C ATOM 10450 C GLU B 239 -9.950 -9.722 7.100 1.00 5.40 C ATOM 10451 O GLU B 239 -9.918 -8.559 6.784 1.00 10.82 O ATOM 10452 CB GLU B 239 -11.513 -11.776 7.313 1.00 3.07 C ATOM 10453 CG GLU B 239 -11.546 -12.105 5.817 1.00 7.42 C ATOM 10454 CD GLU B 239 -11.325 -13.601 5.530 1.00 6.85 C ATOM 10455 OE1 GLU B 239 -11.892 -14.436 6.396 1.00 10.12 O ATOM 10456 OE2 GLU B 239 -10.617 -13.949 4.591 1.00 10.00 O ATOM 10457 HA GLU B 239 -11.056 -10.475 8.735 1.00 0.00 H ATOM 10458 HB2 GLU B 239 -10.744 -12.395 7.775 1.00 0.00 H ATOM 10459 HB3 GLU B 239 -12.485 -12.032 7.734 1.00 0.00 H ATOM 10460 HG2 GLU B 239 -12.517 -11.813 5.417 1.00 0.00 H ATOM 10461 HG3 GLU B 239 -10.763 -11.535 5.317 1.00 0.00 H ATOM 10462 H GLU B 239 -12.649 -8.948 8.557 1.00 0.00 H ATOM 10463 N GLY B 240 -8.881 -10.473 6.961 1.00 7.52 N ATOM 10464 CA GLY B 240 -7.608 -9.970 6.486 1.00 3.00 C ATOM 10465 C GLY B 240 -7.187 -9.979 5.087 1.00 3.00 C ATOM 10466 O GLY B 240 -6.264 -9.292 4.722 1.00 9.71 O ATOM 10467 HA3 GLY B 240 -6.849 -10.537 7.025 1.00 0.00 H ATOM 10468 HA2 GLY B 240 -7.570 -8.926 6.798 1.00 0.00 H ATOM 10469 H GLY B 240 -8.952 -11.482 7.205 1.00 0.00 H ATOM 10470 N GLY B 241 -7.836 -10.738 4.277 1.00 3.70 N ATOM 10471 CA GLY B 241 -7.403 -10.814 2.859 1.00 3.00 C ATOM 10472 C GLY B 241 -7.930 -9.870 1.862 1.00 5.96 C ATOM 10473 O GLY B 241 -7.552 -9.956 0.712 1.00 3.64 O ATOM 10474 HA3 GLY B 241 -7.659 -11.814 2.508 1.00 0.00 H ATOM 10475 HA2 GLY B 241 -6.319 -10.697 2.857 1.00 0.00 H ATOM 10476 H GLY B 241 -8.652 -11.290 4.610 1.00 0.00 H ATOM 10477 N ASN B 242 -8.813 -9.002 2.295 1.00 4.39 N ATOM 10478 CA ASN B 242 -9.368 -8.017 1.409 1.00 3.00 C ATOM 10479 C ASN B 242 -8.236 -7.045 1.139 1.00 8.63 C ATOM 10480 O ASN B 242 -7.317 -6.930 1.930 1.00 3.10 O ATOM 10481 CB ASN B 242 -10.640 -7.370 1.963 1.00 5.64 C ATOM 10482 CG ASN B 242 -10.362 -6.520 3.156 1.00 8.71 C ATOM 10483 OD1 ASN B 242 -9.882 -5.422 2.948 1.00 4.23 O ATOM 10484 ND2 ASN B 242 -10.876 -6.869 4.319 1.00 3.00 N ATOM 10485 HA ASN B 242 -9.720 -8.457 0.476 1.00 0.00 H ATOM 10486 HB2 ASN B 242 -11.087 -6.750 1.186 1.00 0.00 H ATOM 10487 HB3 ASN B 242 -11.340 -8.156 2.246 1.00 0.00 H ATOM 10488 HD22 ASN B 242 -11.275 -7.821 4.447 1.00 0.00 H ATOM 10489 HD21 ASN B 242 -10.883 -6.192 5.109 1.00 0.00 H ATOM 10490 H ASN B 242 -9.114 -9.027 3.290 1.00 0.00 H ATOM 10491 N VAL B 243 -8.264 -6.390 -0.021 1.00 3.00 N ATOM 10492 CA VAL B 243 -7.195 -5.505 -0.460 1.00 3.00 C ATOM 10493 C VAL B 243 -6.668 -4.461 0.542 1.00 3.37 C ATOM 10494 O VAL B 243 -5.449 -4.377 0.716 1.00 6.49 O ATOM 10495 CB VAL B 243 -7.428 -4.927 -1.833 1.00 5.97 C ATOM 10496 CG1 VAL B 243 -6.334 -3.938 -2.139 1.00 3.00 C ATOM 10497 CG2 VAL B 243 -7.366 -6.045 -2.872 1.00 5.81 C ATOM 10498 HA VAL B 243 -6.357 -6.199 -0.524 1.00 0.00 H ATOM 10499 HB VAL B 243 -8.403 -4.441 -1.862 1.00 0.00 H ATOM 10500 HG11 VAL B 243 -6.348 -3.141 -1.396 1.00 0.00 H ATOM 10501 HG12 VAL B 243 -5.369 -4.445 -2.111 1.00 0.00 H ATOM 10502 HG13 VAL B 243 -6.495 -3.515 -3.131 1.00 0.00 H ATOM 10503 HG21 VAL B 243 -6.384 -6.517 -2.837 1.00 0.00 H ATOM 10504 HG22 VAL B 243 -8.135 -6.786 -2.653 1.00 0.00 H ATOM 10505 HG23 VAL B 243 -7.534 -5.627 -3.864 1.00 0.00 H ATOM 10506 H VAL B 243 -9.089 -6.517 -0.642 1.00 0.00 H ATOM 10507 N SER B 244 -7.608 -3.709 1.111 1.00 4.02 N ATOM 10508 CA SER B 244 -7.301 -2.659 2.070 1.00 7.52 C ATOM 10509 C SER B 244 -6.694 -3.246 3.302 1.00 4.60 C ATOM 10510 O SER B 244 -5.612 -2.866 3.739 1.00 3.09 O ATOM 10511 CB SER B 244 -8.397 -1.683 2.327 1.00 3.00 C ATOM 10512 OG SER B 244 -9.543 -2.321 2.850 1.00 6.97 O ATOM 10513 HA SER B 244 -6.552 -2.021 1.601 1.00 0.00 H ATOM 10514 HB2 SER B 244 -8.661 -1.191 1.391 1.00 0.00 H ATOM 10515 HB3 SER B 244 -8.048 -0.938 3.042 1.00 0.00 H ATOM 10516 HG SER B 244 -9.868 -2.996 2.203 1.00 0.00 H ATOM 10517 H SER B 244 -8.603 -3.879 0.860 1.00 0.00 H ATOM 10518 N ALA B 245 -7.351 -4.213 3.938 1.00 5.24 N ATOM 10519 CA ALA B 245 -6.722 -4.786 5.126 1.00 5.50 C ATOM 10520 C ALA B 245 -5.411 -5.487 4.862 1.00 9.10 C ATOM 10521 O ALA B 245 -4.487 -5.296 5.681 1.00 6.51 O ATOM 10522 CB ALA B 245 -7.608 -5.780 5.844 1.00 3.00 C ATOM 10523 HA ALA B 245 -6.544 -3.907 5.745 1.00 0.00 H ATOM 10524 HB1 ALA B 245 -8.525 -5.284 6.161 1.00 0.00 H ATOM 10525 HB2 ALA B 245 -7.852 -6.601 5.170 1.00 0.00 H ATOM 10526 HB3 ALA B 245 -7.083 -6.169 6.717 1.00 0.00 H ATOM 10527 H ALA B 245 -8.277 -4.548 3.602 1.00 0.00 H ATOM 10528 N HIS B 246 -5.299 -6.306 3.772 1.00 4.30 N ATOM 10529 CA HIS B 246 -4.054 -7.004 3.479 1.00 3.01 C ATOM 10530 C HIS B 246 -2.930 -5.971 3.271 1.00 4.74 C ATOM 10531 O HIS B 246 -1.808 -6.131 3.732 1.00 4.97 O ATOM 10532 CB HIS B 246 -4.290 -7.920 2.267 1.00 3.36 C ATOM 10533 CG HIS B 246 -3.082 -8.744 1.971 1.00 3.00 C ATOM 10534 ND1 HIS B 246 -2.973 -9.437 0.793 1.00 6.69 N ATOM 10535 CD2 HIS B 246 -1.923 -8.927 2.712 1.00 3.11 C ATOM 10536 CE1 HIS B 246 -1.796 -10.056 0.802 1.00 7.73 C ATOM 10537 NE2 HIS B 246 -1.147 -9.787 1.925 1.00 5.74 N ATOM 10538 HA HIS B 246 -3.735 -7.638 4.306 1.00 0.00 H ATOM 10539 HB2 HIS B 246 -5.129 -8.582 2.479 1.00 0.00 H ATOM 10540 HB3 HIS B 246 -4.524 -7.306 1.397 1.00 0.00 H ATOM 10541 HD2 HIS B 246 -1.674 -8.500 3.683 1.00 0.00 H ATOM 10542 HE1 HIS B 246 -1.420 -10.693 0.001 1.00 0.00 H ATOM 10543 H HIS B 246 -6.116 -6.433 3.142 1.00 0.00 H ATOM 10544 N THR B 247 -3.235 -4.879 2.569 1.00 3.00 N ATOM 10545 CA THR B 247 -2.265 -3.793 2.309 1.00 3.00 C ATOM 10546 C THR B 247 -1.798 -3.192 3.641 1.00 3.00 C ATOM 10547 O THR B 247 -0.586 -2.999 3.852 1.00 3.07 O ATOM 10548 CB THR B 247 -2.872 -2.707 1.379 1.00 3.00 C ATOM 10549 OG1 THR B 247 -3.185 -3.228 0.093 1.00 5.92 O ATOM 10550 CG2 THR B 247 -1.823 -1.617 1.151 1.00 3.00 C ATOM 10551 HA THR B 247 -1.401 -4.208 1.790 1.00 0.00 H ATOM 10552 HB THR B 247 -3.777 -2.334 1.859 1.00 0.00 H ATOM 10553 HG1 THR B 247 -3.843 -3.961 0.187 1.00 0.00 H ATOM 10554 HG23 THR B 247 -1.543 -1.178 2.109 1.00 0.00 H ATOM 10555 HG21 THR B 247 -0.943 -2.054 0.679 1.00 0.00 H ATOM 10556 HG22 THR B 247 -2.238 -0.845 0.504 1.00 0.00 H ATOM 10557 H THR B 247 -4.198 -4.787 2.187 1.00 0.00 H ATOM 10558 N SER B 248 -2.682 -2.864 4.591 1.00 6.71 N ATOM 10559 CA SER B 248 -2.198 -2.303 5.858 1.00 3.21 C ATOM 10560 C SER B 248 -1.326 -3.307 6.616 1.00 11.07 C ATOM 10561 O SER B 248 -0.351 -2.972 7.292 1.00 6.66 O ATOM 10562 CB SER B 248 -3.375 -1.888 6.765 1.00 6.38 C ATOM 10563 OG SER B 248 -4.102 -3.059 7.200 1.00 6.01 O ATOM 10564 HA SER B 248 -1.602 -1.426 5.607 1.00 0.00 H ATOM 10565 HB2 SER B 248 -4.045 -1.233 6.209 1.00 0.00 H ATOM 10566 HB3 SER B 248 -2.990 -1.358 7.636 1.00 0.00 H ATOM 10567 HG SER B 248 -4.454 -3.540 6.410 1.00 0.00 H ATOM 10568 H SER B 248 -3.700 -3.005 4.433 1.00 0.00 H ATOM 10569 N HIS B 249 -1.683 -4.596 6.482 1.00 5.12 N ATOM 10570 CA HIS B 249 -0.969 -5.664 7.157 1.00 5.91 C ATOM 10571 C HIS B 249 0.434 -5.816 6.614 1.00 4.21 C ATOM 10572 O HIS B 249 1.434 -5.904 7.311 1.00 8.09 O ATOM 10573 CB HIS B 249 -1.705 -7.001 6.881 1.00 4.36 C ATOM 10574 CG HIS B 249 -1.299 -8.169 7.670 1.00 3.00 C ATOM 10575 ND1 HIS B 249 -1.652 -8.343 8.992 1.00 7.61 N ATOM 10576 CD2 HIS B 249 -0.587 -9.277 7.297 1.00 6.73 C ATOM 10577 CE1 HIS B 249 -1.156 -9.530 9.409 1.00 3.04 C ATOM 10578 NE2 HIS B 249 -0.519 -10.133 8.386 1.00 4.62 N ATOM 10579 HA HIS B 249 -0.928 -5.424 8.219 1.00 0.00 H ATOM 10580 HB2 HIS B 249 -2.766 -6.835 7.065 1.00 0.00 H ATOM 10581 HB3 HIS B 249 -1.554 -7.247 5.830 1.00 0.00 H ATOM 10582 HD2 HIS B 249 -0.150 -9.455 6.315 1.00 0.00 H ATOM 10583 HE1 HIS B 249 -1.256 -9.936 10.416 1.00 0.00 H ATOM 10584 H HIS B 249 -2.494 -4.835 5.877 1.00 0.00 H ATOM 10585 N LEU B 250 0.536 -5.885 5.312 1.00 7.90 N ATOM 10586 CA LEU B 250 1.791 -6.026 4.651 1.00 7.05 C ATOM 10587 C LEU B 250 2.705 -4.808 4.874 1.00 6.19 C ATOM 10588 O LEU B 250 3.899 -4.964 5.174 1.00 6.71 O ATOM 10589 CB LEU B 250 1.369 -6.167 3.184 1.00 7.21 C ATOM 10590 CG LEU B 250 2.529 -6.084 2.206 1.00 6.89 C ATOM 10591 CD1 LEU B 250 3.636 -7.097 2.492 1.00 3.87 C ATOM 10592 CD2 LEU B 250 1.997 -6.282 0.802 1.00 7.84 C ATOM 10593 HA LEU B 250 2.382 -6.866 5.017 1.00 0.00 H ATOM 10594 HB2 LEU B 250 0.880 -7.133 3.057 1.00 0.00 H ATOM 10595 HB3 LEU B 250 0.663 -5.370 2.950 1.00 0.00 H ATOM 10596 HG LEU B 250 2.982 -5.099 2.318 1.00 0.00 H ATOM 10597 HD21 LEU B 250 1.521 -7.260 0.730 1.00 0.00 H ATOM 10598 HD22 LEU B 250 1.267 -5.504 0.578 1.00 0.00 H ATOM 10599 HD23 LEU B 250 2.821 -6.224 0.091 1.00 0.00 H ATOM 10600 HD11 LEU B 250 4.036 -6.924 3.491 1.00 0.00 H ATOM 10601 HD12 LEU B 250 3.228 -8.106 2.432 1.00 0.00 H ATOM 10602 HD13 LEU B 250 4.432 -6.981 1.756 1.00 0.00 H ATOM 10603 H LEU B 250 -0.330 -5.835 4.738 1.00 0.00 H ATOM 10604 N VAL B 251 2.184 -3.581 4.743 1.00 3.00 N ATOM 10605 CA VAL B 251 3.008 -2.398 4.942 1.00 3.00 C ATOM 10606 C VAL B 251 3.415 -2.290 6.422 1.00 10.33 C ATOM 10607 O VAL B 251 4.519 -1.987 6.700 1.00 3.97 O ATOM 10608 CB VAL B 251 2.260 -1.129 4.438 1.00 4.58 C ATOM 10609 CG1 VAL B 251 2.899 0.205 4.875 1.00 6.49 C ATOM 10610 CG2 VAL B 251 2.167 -1.297 2.906 1.00 3.85 C ATOM 10611 HA VAL B 251 3.923 -2.483 4.356 1.00 0.00 H ATOM 10612 HB VAL B 251 1.272 -1.059 4.894 1.00 0.00 H ATOM 10613 HG11 VAL B 251 2.917 0.258 5.964 1.00 0.00 H ATOM 10614 HG12 VAL B 251 3.917 0.262 4.490 1.00 0.00 H ATOM 10615 HG13 VAL B 251 2.312 1.034 4.479 1.00 0.00 H ATOM 10616 HG21 VAL B 251 3.171 -1.364 2.487 1.00 0.00 H ATOM 10617 HG22 VAL B 251 1.614 -2.207 2.675 1.00 0.00 H ATOM 10618 HG23 VAL B 251 1.650 -0.438 2.478 1.00 0.00 H ATOM 10619 H VAL B 251 1.180 -3.472 4.496 1.00 0.00 H ATOM 10620 N GLY B 252 2.496 -2.570 7.320 1.00 3.00 N ATOM 10621 CA GLY B 252 2.784 -2.492 8.718 1.00 3.00 C ATOM 10622 C GLY B 252 3.827 -3.509 9.090 1.00 6.85 C ATOM 10623 O GLY B 252 4.561 -3.245 10.021 1.00 5.39 O ATOM 10624 HA3 GLY B 252 1.873 -2.686 9.285 1.00 0.00 H ATOM 10625 HA2 GLY B 252 3.153 -1.494 8.955 1.00 0.00 H ATOM 10626 H GLY B 252 1.545 -2.853 7.008 1.00 0.00 H ATOM 10627 N SER B 253 3.909 -4.646 8.357 1.00 3.76 N ATOM 10628 CA SER B 253 4.857 -5.714 8.645 1.00 8.18 C ATOM 10629 C SER B 253 6.302 -5.291 8.504 1.00 6.91 C ATOM 10630 O SER B 253 7.167 -5.901 9.101 1.00 6.62 O ATOM 10631 CB SER B 253 4.548 -7.049 7.941 1.00 3.94 C ATOM 10632 OG SER B 253 5.029 -6.897 6.606 1.00 3.00 O ATOM 10633 HA SER B 253 4.709 -5.921 9.705 1.00 0.00 H ATOM 10634 HB2 SER B 253 3.475 -7.240 7.940 1.00 0.00 H ATOM 10635 HB3 SER B 253 5.062 -7.871 8.440 1.00 0.00 H ATOM 10636 HG SER B 253 4.560 -6.142 6.171 1.00 0.00 H ATOM 10637 H SER B 253 3.264 -4.762 7.550 1.00 0.00 H ATOM 10638 N ALA B 254 6.537 -4.225 7.712 1.00 3.00 N ATOM 10639 CA ALA B 254 7.867 -3.681 7.502 1.00 6.24 C ATOM 10640 C ALA B 254 8.227 -2.655 8.572 1.00 8.13 C ATOM 10641 O ALA B 254 9.292 -2.037 8.526 1.00 3.03 O ATOM 10642 CB ALA B 254 7.958 -3.086 6.118 1.00 3.00 C ATOM 10643 HA ALA B 254 8.592 -4.491 7.585 1.00 0.00 H ATOM 10644 HB1 ALA B 254 7.762 -3.861 5.377 1.00 0.00 H ATOM 10645 HB2 ALA B 254 7.220 -2.290 6.017 1.00 0.00 H ATOM 10646 HB3 ALA B 254 8.957 -2.679 5.964 1.00 0.00 H ATOM 10647 H ALA B 254 5.732 -3.774 7.232 1.00 0.00 H ATOM 10648 N LEU B 255 7.296 -2.499 9.510 1.00 3.37 N ATOM 10649 CA LEU B 255 7.558 -1.519 10.561 1.00 5.94 C ATOM 10650 C LEU B 255 7.225 -0.072 10.254 1.00 9.62 C ATOM 10651 O LEU B 255 7.570 0.844 10.997 1.00 6.84 O ATOM 10652 CB LEU B 255 8.701 -1.720 11.522 1.00 10.96 C ATOM 10653 CG LEU B 255 8.682 -3.140 12.068 1.00 14.72 C ATOM 10654 CD1 LEU B 255 10.034 -3.364 12.757 1.00 13.41 C ATOM 10655 CD2 LEU B 255 7.472 -3.494 12.944 1.00 9.27 C ATOM 10656 HA LEU B 255 6.745 -1.858 11.203 1.00 0.00 H ATOM 10657 HB2 LEU B 255 9.644 -1.546 11.003 1.00 0.00 H ATOM 10658 HB3 LEU B 255 8.606 -1.015 12.348 1.00 0.00 H ATOM 10659 HG LEU B 255 8.550 -3.837 11.240 1.00 0.00 H ATOM 10660 HD21 LEU B 255 7.444 -2.831 13.808 1.00 0.00 H ATOM 10661 HD22 LEU B 255 6.557 -3.374 12.363 1.00 0.00 H ATOM 10662 HD23 LEU B 255 7.558 -4.527 13.280 1.00 0.00 H ATOM 10663 HD11 LEU B 255 10.836 -3.238 12.030 1.00 0.00 H ATOM 10664 HD12 LEU B 255 10.154 -2.639 13.562 1.00 0.00 H ATOM 10665 HD13 LEU B 255 10.069 -4.374 13.167 1.00 0.00 H ATOM 10666 H LEU B 255 6.416 -3.053 9.495 1.00 0.00 H ATOM 10667 N SER B 256 6.524 0.113 9.115 1.00 8.03 N ATOM 10668 CA SER B 256 6.061 1.422 8.713 1.00 3.27 C ATOM 10669 C SER B 256 4.996 1.762 9.773 1.00 5.93 C ATOM 10670 O SER B 256 4.268 0.880 10.267 1.00 5.36 O ATOM 10671 CB SER B 256 5.416 1.459 7.334 1.00 3.00 C ATOM 10672 OG SER B 256 6.452 1.354 6.401 1.00 9.19 O ATOM 10673 HA SER B 256 6.898 2.118 8.649 1.00 0.00 H ATOM 10674 HB2 SER B 256 4.879 2.398 7.195 1.00 0.00 H ATOM 10675 HB3 SER B 256 4.723 0.625 7.221 1.00 0.00 H ATOM 10676 HG SER B 256 6.074 1.374 5.486 1.00 0.00 H ATOM 10677 H SER B 256 6.312 -0.707 8.512 1.00 0.00 H ATOM 10678 N ASP B 257 4.899 3.069 10.156 1.00 3.00 N ATOM 10679 CA ASP B 257 3.960 3.504 11.158 1.00 3.00 C ATOM 10680 C ASP B 257 2.517 3.356 10.730 1.00 5.23 C ATOM 10681 O ASP B 257 2.232 3.231 9.540 1.00 5.20 O ATOM 10682 CB ASP B 257 4.442 4.891 11.657 1.00 5.23 C ATOM 10683 CG ASP B 257 4.090 5.893 10.595 1.00 5.89 C ATOM 10684 OD1 ASP B 257 2.911 6.088 10.279 1.00 6.53 O ATOM 10685 OD2 ASP B 257 5.082 6.578 10.120 1.00 4.49 O ATOM 10686 HA ASP B 257 3.949 2.848 12.029 1.00 0.00 H ATOM 10687 HB2 ASP B 257 3.942 5.146 12.592 1.00 0.00 H ATOM 10688 HB3 ASP B 257 5.520 4.877 11.815 1.00 0.00 H ATOM 10689 H ASP B 257 5.522 3.772 9.710 1.00 0.00 H ATOM 10690 N PRO B 258 1.594 3.353 11.661 1.00 4.17 N ATOM 10691 CA PRO B 258 0.218 3.207 11.320 1.00 6.05 C ATOM 10692 C PRO B 258 -0.344 4.227 10.325 1.00 9.65 C ATOM 10693 O PRO B 258 -1.261 3.928 9.548 1.00 4.36 O ATOM 10694 CB PRO B 258 -0.546 3.251 12.636 1.00 7.42 C ATOM 10695 CG PRO B 258 0.501 2.857 13.659 1.00 3.78 C ATOM 10696 CD PRO B 258 1.794 3.455 13.139 1.00 3.15 C ATOM 10697 HA PRO B 258 0.104 2.265 10.783 1.00 0.00 H ATOM 10698 HD3 PRO B 258 1.910 4.492 13.455 1.00 0.00 H ATOM 10699 HD2 PRO B 258 2.660 2.878 13.465 1.00 0.00 H ATOM 10700 HG3 PRO B 258 0.580 1.772 13.730 1.00 0.00 H ATOM 10701 HG2 PRO B 258 0.255 3.267 14.639 1.00 0.00 H ATOM 10702 HB2 PRO B 258 -0.928 4.253 12.833 1.00 0.00 H ATOM 10703 HB3 PRO B 258 -1.374 2.542 12.631 1.00 0.00 H ATOM 10704 N TYR B 259 0.181 5.449 10.269 1.00 4.80 N ATOM 10705 CA TYR B 259 -0.308 6.458 9.309 1.00 5.12 C ATOM 10706 C TYR B 259 0.078 6.036 7.889 1.00 5.05 C ATOM 10707 O TYR B 259 -0.753 6.071 6.997 1.00 7.24 O ATOM 10708 CB TYR B 259 0.275 7.839 9.616 1.00 4.33 C ATOM 10709 CG TYR B 259 -0.217 8.454 10.935 1.00 3.92 C ATOM 10710 CD1 TYR B 259 0.446 8.263 12.145 1.00 7.90 C ATOM 10711 CD2 TYR B 259 -1.340 9.281 10.952 1.00 12.41 C ATOM 10712 CE1 TYR B 259 0.007 8.838 13.339 1.00 12.03 C ATOM 10713 CE2 TYR B 259 -1.807 9.873 12.131 1.00 8.42 C ATOM 10714 CZ TYR B 259 -1.127 9.646 13.322 1.00 10.05 C ATOM 10715 OH TYR B 259 -1.575 10.228 14.485 1.00 15.57 O ATOM 10716 HA TYR B 259 -1.393 6.522 9.395 1.00 0.00 H ATOM 10717 HB3 TYR B 259 0.004 8.513 8.803 1.00 0.00 H ATOM 10718 HB2 TYR B 259 1.360 7.749 9.665 1.00 0.00 H ATOM 10719 HD2 TYR B 259 -1.870 9.472 10.019 1.00 0.00 H ATOM 10720 HE2 TYR B 259 -2.695 10.505 12.116 1.00 0.00 H ATOM 10721 HE1 TYR B 259 0.544 8.657 14.270 1.00 0.00 H ATOM 10722 HD1 TYR B 259 1.341 7.641 12.160 1.00 0.00 H ATOM 10723 HH TYR B 259 -0.982 9.966 15.233 1.00 0.00 H ATOM 10724 H TYR B 259 0.955 5.699 10.918 1.00 0.00 H ATOM 10725 N LEU B 260 1.313 5.612 7.744 1.00 3.76 N ATOM 10726 CA LEU B 260 1.833 5.133 6.461 1.00 3.90 C ATOM 10727 C LEU B 260 1.079 3.852 6.079 1.00 8.00 C ATOM 10728 O LEU B 260 0.651 3.676 4.925 1.00 4.61 O ATOM 10729 CB LEU B 260 3.347 4.838 6.491 1.00 4.22 C ATOM 10730 CG LEU B 260 4.197 6.092 6.797 1.00 5.78 C ATOM 10731 CD1 LEU B 260 5.662 5.738 6.526 1.00 4.07 C ATOM 10732 CD2 LEU B 260 3.799 7.092 5.710 1.00 8.06 C ATOM 10733 HA LEU B 260 1.680 5.925 5.728 1.00 0.00 H ATOM 10734 HB2 LEU B 260 3.541 4.090 7.260 1.00 0.00 H ATOM 10735 HB3 LEU B 260 3.644 4.444 5.519 1.00 0.00 H ATOM 10736 HG LEU B 260 4.060 6.457 7.815 1.00 0.00 H ATOM 10737 HD21 LEU B 260 4.028 6.672 4.730 1.00 0.00 H ATOM 10738 HD22 LEU B 260 2.730 7.296 5.779 1.00 0.00 H ATOM 10739 HD23 LEU B 260 4.356 8.018 5.849 1.00 0.00 H ATOM 10740 HD11 LEU B 260 5.960 4.911 7.170 1.00 0.00 H ATOM 10741 HD12 LEU B 260 5.777 5.447 5.482 1.00 0.00 H ATOM 10742 HD13 LEU B 260 6.288 6.606 6.734 1.00 0.00 H ATOM 10743 H LEU B 260 1.945 5.617 8.570 1.00 0.00 H ATOM 10744 N SER B 261 0.898 2.929 7.012 1.00 3.00 N ATOM 10745 CA SER B 261 0.188 1.696 6.692 1.00 4.96 C ATOM 10746 C SER B 261 -1.286 1.928 6.279 1.00 7.32 C ATOM 10747 O SER B 261 -1.798 1.319 5.328 1.00 6.74 O ATOM 10748 CB SER B 261 0.255 0.772 7.905 1.00 3.25 C ATOM 10749 OG SER B 261 1.431 1.072 8.647 1.00 80.00 O ATOM 10750 HA SER B 261 0.675 1.245 5.828 1.00 0.00 H ATOM 10751 HB2 SER B 261 0.286 -0.266 7.574 1.00 0.00 H ATOM 10752 HB3 SER B 261 -0.623 0.926 8.532 1.00 0.00 H ATOM 10753 HG SER B 261 1.400 2.016 8.945 1.00 0.00 H ATOM 10754 H SER B 261 1.263 3.084 7.974 1.00 0.00 H ATOM 10755 N PHE B 262 -2.010 2.800 6.990 1.00 3.00 N ATOM 10756 CA PHE B 262 -3.390 3.082 6.683 1.00 3.00 C ATOM 10757 C PHE B 262 -3.514 3.859 5.364 1.00 6.88 C ATOM 10758 O PHE B 262 -4.421 3.591 4.591 1.00 3.75 O ATOM 10759 CB PHE B 262 -4.025 3.940 7.776 1.00 3.38 C ATOM 10760 CG PHE B 262 -5.491 4.182 7.534 1.00 7.97 C ATOM 10761 CD1 PHE B 262 -6.383 3.121 7.687 1.00 11.16 C ATOM 10762 CD2 PHE B 262 -5.986 5.428 7.157 1.00 12.13 C ATOM 10763 CE1 PHE B 262 -7.752 3.270 7.458 1.00 13.60 C ATOM 10764 CE2 PHE B 262 -7.356 5.615 6.930 1.00 13.57 C ATOM 10765 CZ PHE B 262 -8.219 4.530 7.090 1.00 5.36 C ATOM 10766 HA PHE B 262 -3.898 2.121 6.606 1.00 0.00 H ATOM 10767 HB2 PHE B 262 -3.907 3.432 8.733 1.00 0.00 H ATOM 10768 HB3 PHE B 262 -3.512 4.901 7.810 1.00 0.00 H ATOM 10769 HD2 PHE B 262 -5.300 6.267 7.037 1.00 0.00 H ATOM 10770 HE2 PHE B 262 -7.741 6.591 6.634 1.00 0.00 H ATOM 10771 HZ PHE B 262 -9.287 4.672 6.923 1.00 0.00 H ATOM 10772 HE1 PHE B 262 -8.434 2.427 7.564 1.00 0.00 H ATOM 10773 HD1 PHE B 262 -6.000 2.148 7.994 1.00 0.00 H ATOM 10774 H PHE B 262 -1.562 3.291 7.790 1.00 0.00 H ATOM 10775 N ALA B 263 -2.618 4.833 5.071 1.00 5.49 N ATOM 10776 CA ALA B 263 -2.685 5.598 3.803 1.00 5.43 C ATOM 10777 C ALA B 263 -2.497 4.622 2.621 1.00 8.74 C ATOM 10778 O ALA B 263 -3.168 4.727 1.601 1.00 6.65 O ATOM 10779 CB ALA B 263 -1.563 6.646 3.739 1.00 7.21 C ATOM 10780 HA ALA B 263 -3.651 6.100 3.751 1.00 0.00 H ATOM 10781 HB1 ALA B 263 -1.666 7.339 4.574 1.00 0.00 H ATOM 10782 HB2 ALA B 263 -0.596 6.146 3.798 1.00 0.00 H ATOM 10783 HB3 ALA B 263 -1.633 7.194 2.800 1.00 0.00 H ATOM 10784 H ALA B 263 -1.864 5.049 5.754 1.00 0.00 H ATOM 10785 N ALA B 264 -1.568 3.656 2.731 1.00 5.40 N ATOM 10786 CA ALA B 264 -1.352 2.718 1.640 1.00 3.41 C ATOM 10787 C ALA B 264 -2.638 1.914 1.521 1.00 6.41 C ATOM 10788 O ALA B 264 -3.016 1.595 0.412 1.00 3.56 O ATOM 10789 CB ALA B 264 -0.186 1.774 1.981 1.00 4.12 C ATOM 10790 HA ALA B 264 -1.107 3.235 0.712 1.00 0.00 H ATOM 10791 HB1 ALA B 264 0.720 2.359 2.136 1.00 0.00 H ATOM 10792 HB2 ALA B 264 -0.422 1.220 2.890 1.00 0.00 H ATOM 10793 HB3 ALA B 264 -0.033 1.076 1.158 1.00 0.00 H ATOM 10794 H ALA B 264 -1.001 3.579 3.600 1.00 0.00 H ATOM 10795 N ALA B 265 -3.331 1.606 2.650 1.00 8.30 N ATOM 10796 CA ALA B 265 -4.561 0.824 2.566 1.00 4.39 C ATOM 10797 C ALA B 265 -5.618 1.548 1.784 1.00 4.91 C ATOM 10798 O ALA B 265 -6.421 0.985 1.055 1.00 6.68 O ATOM 10799 CB ALA B 265 -5.061 0.437 3.966 1.00 4.48 C ATOM 10800 HA ALA B 265 -4.336 -0.097 2.028 1.00 0.00 H ATOM 10801 HB1 ALA B 265 -4.300 -0.159 4.470 1.00 0.00 H ATOM 10802 HB2 ALA B 265 -5.258 1.341 4.543 1.00 0.00 H ATOM 10803 HB3 ALA B 265 -5.978 -0.145 3.875 1.00 0.00 H ATOM 10804 H ALA B 265 -2.984 1.928 3.576 1.00 0.00 H ATOM 10805 N MET B 266 -5.591 2.858 1.951 1.00 3.00 N ATOM 10806 CA MET B 266 -6.564 3.706 1.272 1.00 3.00 C ATOM 10807 C MET B 266 -6.346 3.740 -0.236 1.00 3.07 C ATOM 10808 O MET B 266 -7.308 3.875 -1.009 1.00 6.71 O ATOM 10809 CB MET B 266 -6.674 5.131 1.788 1.00 3.00 C ATOM 10810 CG MET B 266 -7.183 5.338 3.214 1.00 5.55 C ATOM 10811 SD MET B 266 -8.824 4.625 3.421 1.00 8.05 S ATOM 10812 CE MET B 266 -8.478 2.940 3.945 1.00 9.12 C ATOM 10813 HA MET B 266 -7.511 3.220 1.508 1.00 0.00 H ATOM 10814 HB2 MET B 266 -5.680 5.575 1.730 1.00 0.00 H ATOM 10815 HB3 MET B 266 -7.349 5.667 1.121 1.00 0.00 H ATOM 10816 HG2 MET B 266 -7.229 6.406 3.425 1.00 0.00 H ATOM 10817 HG3 MET B 266 -6.495 4.860 3.912 1.00 0.00 H ATOM 10818 HE1 MET B 266 -7.897 2.433 3.174 1.00 0.00 H ATOM 10819 HE2 MET B 266 -7.911 2.959 4.876 1.00 0.00 H ATOM 10820 HE3 MET B 266 -9.417 2.409 4.101 1.00 0.00 H ATOM 10821 H MET B 266 -4.873 3.287 2.569 1.00 0.00 H ATOM 10822 N ASN B 267 -5.130 3.647 -0.666 1.00 3.00 N ATOM 10823 CA ASN B 267 -4.889 3.674 -2.107 1.00 3.16 C ATOM 10824 C ASN B 267 -5.431 2.378 -2.692 1.00 6.60 C ATOM 10825 O ASN B 267 -5.823 2.393 -3.856 1.00 8.76 O ATOM 10826 CB ASN B 267 -3.359 3.739 -2.322 1.00 3.00 C ATOM 10827 CG ASN B 267 -2.891 5.194 -2.231 1.00 6.23 C ATOM 10828 OD1 ASN B 267 -1.759 5.514 -2.669 1.00 17.35 O ATOM 10829 ND2 ASN B 267 -3.785 6.074 -1.769 1.00 4.43 N ATOM 10830 HA ASN B 267 -5.372 4.527 -2.584 1.00 0.00 H ATOM 10831 HB2 ASN B 267 -2.859 3.148 -1.555 1.00 0.00 H ATOM 10832 HB3 ASN B 267 -3.113 3.339 -3.306 1.00 0.00 H ATOM 10833 HD22 ASN B 267 -4.707 5.744 -1.419 1.00 0.00 H ATOM 10834 HD21 ASN B 267 -3.558 7.089 -1.759 1.00 0.00 H ATOM 10835 H ASN B 267 -4.338 3.555 0.002 1.00 0.00 H ATOM 10836 N GLY B 268 -5.441 1.274 -1.918 1.00 5.06 N ATOM 10837 CA GLY B 268 -5.992 -0.016 -2.375 1.00 3.00 C ATOM 10838 C GLY B 268 -7.533 0.078 -2.340 1.00 3.00 C ATOM 10839 O GLY B 268 -8.268 -0.371 -3.219 1.00 5.67 O ATOM 10840 HA3 GLY B 268 -5.656 -0.816 -1.715 1.00 0.00 H ATOM 10841 HA2 GLY B 268 -5.658 -0.221 -3.392 1.00 0.00 H ATOM 10842 H GLY B 268 -5.044 1.334 -0.959 1.00 0.00 H ATOM 10843 N LEU B 269 -8.135 0.700 -1.298 1.00 6.33 N ATOM 10844 CA LEU B 269 -9.616 0.864 -1.214 1.00 4.40 C ATOM 10845 C LEU B 269 -10.139 1.716 -2.383 1.00 7.16 C ATOM 10846 O LEU B 269 -11.303 1.603 -2.818 1.00 5.29 O ATOM 10847 CB LEU B 269 -9.980 1.474 0.193 1.00 3.00 C ATOM 10848 CG LEU B 269 -11.453 1.456 0.623 1.00 4.80 C ATOM 10849 CD1 LEU B 269 -11.926 -0.035 0.846 1.00 3.00 C ATOM 10850 CD2 LEU B 269 -11.733 2.266 1.873 1.00 7.46 C ATOM 10851 HA LEU B 269 -10.107 -0.105 -1.303 1.00 0.00 H ATOM 10852 HB2 LEU B 269 -9.416 0.920 0.943 1.00 0.00 H ATOM 10853 HB3 LEU B 269 -9.655 2.514 0.190 1.00 0.00 H ATOM 10854 HG LEU B 269 -12.014 1.925 -0.186 1.00 0.00 H ATOM 10855 HD21 LEU B 269 -11.148 1.867 2.702 1.00 0.00 H ATOM 10856 HD22 LEU B 269 -11.458 3.306 1.700 1.00 0.00 H ATOM 10857 HD23 LEU B 269 -12.794 2.205 2.114 1.00 0.00 H ATOM 10858 HD11 LEU B 269 -11.814 -0.593 -0.083 1.00 0.00 H ATOM 10859 HD12 LEU B 269 -11.317 -0.496 1.624 1.00 0.00 H ATOM 10860 HD13 LEU B 269 -12.972 -0.041 1.151 1.00 0.00 H ATOM 10861 H LEU B 269 -7.544 1.077 -0.529 1.00 0.00 H ATOM 10862 N ALA B 270 -9.289 2.596 -2.945 1.00 3.03 N ATOM 10863 CA ALA B 270 -9.702 3.441 -4.062 1.00 10.90 C ATOM 10864 C ALA B 270 -9.719 2.697 -5.384 1.00 3.98 C ATOM 10865 O ALA B 270 -10.025 3.325 -6.400 1.00 7.81 O ATOM 10866 CB ALA B 270 -8.759 4.617 -4.159 1.00 7.53 C ATOM 10867 HA ALA B 270 -10.722 3.772 -3.868 1.00 0.00 H ATOM 10868 HB1 ALA B 270 -8.795 5.188 -3.231 1.00 0.00 H ATOM 10869 HB2 ALA B 270 -7.744 4.255 -4.325 1.00 0.00 H ATOM 10870 HB3 ALA B 270 -9.059 5.254 -4.991 1.00 0.00 H ATOM 10871 H ALA B 270 -8.320 2.675 -2.577 1.00 0.00 H ATOM 10872 N GLY B 271 -9.432 1.398 -5.389 1.00 3.00 N ATOM 10873 CA GLY B 271 -9.482 0.746 -6.701 1.00 4.41 C ATOM 10874 C GLY B 271 -10.941 0.405 -6.992 1.00 5.93 C ATOM 10875 O GLY B 271 -11.712 0.074 -6.117 1.00 8.16 O ATOM 10876 HA3 GLY B 271 -8.883 -0.164 -6.687 1.00 0.00 H ATOM 10877 HA2 GLY B 271 -9.098 1.420 -7.466 1.00 0.00 H ATOM 10878 H GLY B 271 -9.189 0.880 -4.521 1.00 0.00 H ATOM 10879 N PRO B 272 -11.374 0.447 -8.267 1.00 4.32 N ATOM 10880 CA PRO B 272 -12.731 0.151 -8.710 1.00 5.32 C ATOM 10881 C PRO B 272 -13.307 -1.227 -8.372 1.00 6.53 C ATOM 10882 O PRO B 272 -14.509 -1.428 -8.224 1.00 7.26 O ATOM 10883 CB PRO B 272 -12.636 0.275 -10.236 1.00 10.79 C ATOM 10884 CG PRO B 272 -11.488 1.197 -10.553 1.00 10.74 C ATOM 10885 CD PRO B 272 -10.556 1.054 -9.340 1.00 3.00 C ATOM 10886 HA PRO B 272 -13.410 0.829 -8.192 1.00 0.00 H ATOM 10887 HD3 PRO B 272 -9.712 0.409 -9.584 1.00 0.00 H ATOM 10888 HD2 PRO B 272 -10.187 2.031 -9.028 1.00 0.00 H ATOM 10889 HG3 PRO B 272 -11.833 2.225 -10.658 1.00 0.00 H ATOM 10890 HG2 PRO B 272 -10.984 0.889 -11.469 1.00 0.00 H ATOM 10891 HB2 PRO B 272 -12.457 -0.705 -10.677 1.00 0.00 H ATOM 10892 HB3 PRO B 272 -13.564 0.687 -10.633 1.00 0.00 H ATOM 10893 N LEU B 273 -12.436 -2.180 -8.217 1.00 3.00 N ATOM 10894 CA LEU B 273 -12.753 -3.568 -7.876 1.00 3.00 C ATOM 10895 C LEU B 273 -12.849 -3.724 -6.341 1.00 16.49 C ATOM 10896 O LEU B 273 -13.269 -4.798 -5.882 1.00 7.89 O ATOM 10897 CB LEU B 273 -11.704 -4.573 -8.407 1.00 3.56 C ATOM 10898 CG LEU B 273 -11.499 -4.600 -9.924 1.00 7.39 C ATOM 10899 CD1 LEU B 273 -10.684 -5.876 -10.241 1.00 5.01 C ATOM 10900 CD2 LEU B 273 -12.908 -4.741 -10.519 1.00 3.99 C ATOM 10901 HA LEU B 273 -13.707 -3.794 -8.353 1.00 0.00 H ATOM 10902 HB2 LEU B 273 -10.747 -4.329 -7.946 1.00 0.00 H ATOM 10903 HB3 LEU B 273 -12.012 -5.571 -8.095 1.00 0.00 H ATOM 10904 HG LEU B 273 -10.986 -3.721 -10.314 1.00 0.00 H ATOM 10905 HD21 LEU B 273 -13.362 -5.664 -10.159 1.00 0.00 H ATOM 10906 HD22 LEU B 273 -13.517 -3.891 -10.212 1.00 0.00 H ATOM 10907 HD23 LEU B 273 -12.841 -4.767 -11.607 1.00 0.00 H ATOM 10908 HD11 LEU B 273 -9.727 -5.833 -9.721 1.00 0.00 H ATOM 10909 HD12 LEU B 273 -11.240 -6.753 -9.909 1.00 0.00 H ATOM 10910 HD13 LEU B 273 -10.512 -5.938 -11.316 1.00 0.00 H ATOM 10911 H LEU B 273 -11.433 -1.937 -8.346 1.00 0.00 H ATOM 10912 N HIS B 274 -12.468 -2.685 -5.560 1.00 5.33 N ATOM 10913 CA HIS B 274 -12.570 -2.735 -4.083 1.00 3.00 C ATOM 10914 C HIS B 274 -13.602 -1.692 -3.646 1.00 5.76 C ATOM 10915 O HIS B 274 -14.695 -1.598 -4.152 1.00 3.65 O ATOM 10916 CB HIS B 274 -11.171 -2.591 -3.439 1.00 3.01 C ATOM 10917 CG HIS B 274 -11.058 -2.930 -1.997 1.00 3.00 C ATOM 10918 ND1 HIS B 274 -12.110 -3.530 -1.294 1.00 5.09 N ATOM 10919 CD2 HIS B 274 -10.072 -2.712 -1.153 1.00 5.31 C ATOM 10920 CE1 HIS B 274 -11.729 -3.729 -0.045 1.00 3.71 C ATOM 10921 NE2 HIS B 274 -10.501 -3.216 0.072 1.00 3.00 N ATOM 10922 HA HIS B 274 -12.928 -3.702 -3.730 1.00 0.00 H ATOM 10923 HB2 HIS B 274 -10.488 -3.242 -3.985 1.00 0.00 H ATOM 10924 HB3 HIS B 274 -10.858 -1.554 -3.560 1.00 0.00 H ATOM 10925 HD2 HIS B 274 -9.116 -2.235 -1.369 1.00 0.00 H ATOM 10926 HE1 HIS B 274 -12.306 -4.218 0.740 1.00 0.00 H ATOM 10927 H HIS B 274 -12.093 -1.826 -6.011 1.00 0.00 H ATOM 10928 N GLY B 275 -13.278 -0.843 -2.709 1.00 3.48 N ATOM 10929 CA GLY B 275 -14.190 0.153 -2.192 1.00 3.45 C ATOM 10930 C GLY B 275 -14.703 1.213 -3.132 1.00 8.07 C ATOM 10931 O GLY B 275 -15.796 1.715 -2.857 1.00 7.66 O ATOM 10932 HA3 GLY B 275 -13.679 0.665 -1.376 1.00 0.00 H ATOM 10933 HA2 GLY B 275 -15.058 -0.377 -1.800 1.00 0.00 H ATOM 10934 H GLY B 275 -12.317 -0.885 -2.315 1.00 0.00 H ATOM 10935 N LEU B 276 -13.949 1.524 -4.208 1.00 4.72 N ATOM 10936 CA LEU B 276 -14.497 2.546 -5.086 1.00 3.00 C ATOM 10937 C LEU B 276 -15.776 2.073 -5.743 1.00 8.66 C ATOM 10938 O LEU B 276 -16.494 2.867 -6.359 1.00 3.35 O ATOM 10939 CB LEU B 276 -13.421 2.921 -6.113 1.00 6.86 C ATOM 10940 CG LEU B 276 -13.607 4.318 -6.743 1.00 8.60 C ATOM 10941 CD1 LEU B 276 -13.064 5.416 -5.816 1.00 8.73 C ATOM 10942 CD2 LEU B 276 -12.905 4.342 -8.090 1.00 5.82 C ATOM 10943 HA LEU B 276 -14.765 3.432 -4.511 1.00 0.00 H ATOM 10944 HB2 LEU B 276 -12.451 2.896 -5.617 1.00 0.00 H ATOM 10945 HB3 LEU B 276 -13.438 2.180 -6.912 1.00 0.00 H ATOM 10946 HG LEU B 276 -14.669 4.516 -6.885 1.00 0.00 H ATOM 10947 HD21 LEU B 276 -11.844 4.137 -7.949 1.00 0.00 H ATOM 10948 HD22 LEU B 276 -13.340 3.582 -8.739 1.00 0.00 H ATOM 10949 HD23 LEU B 276 -13.029 5.324 -8.546 1.00 0.00 H ATOM 10950 HD11 LEU B 276 -13.599 5.386 -4.867 1.00 0.00 H ATOM 10951 HD12 LEU B 276 -12.001 5.249 -5.641 1.00 0.00 H ATOM 10952 HD13 LEU B 276 -13.208 6.389 -6.285 1.00 0.00 H ATOM 10953 H LEU B 276 -13.036 1.063 -4.397 1.00 0.00 H ATOM 10954 N ALA B 277 -16.094 0.768 -5.640 1.00 9.98 N ATOM 10955 CA ALA B 277 -17.317 0.267 -6.246 1.00 6.44 C ATOM 10956 C ALA B 277 -18.518 0.973 -5.663 1.00 13.28 C ATOM 10957 O ALA B 277 -19.576 1.037 -6.280 1.00 6.02 O ATOM 10958 CB ALA B 277 -17.494 -1.228 -5.956 1.00 6.34 C ATOM 10959 HA ALA B 277 -17.242 0.443 -7.319 1.00 0.00 H ATOM 10960 HB1 ALA B 277 -16.647 -1.779 -6.365 1.00 0.00 H ATOM 10961 HB2 ALA B 277 -17.545 -1.384 -4.878 1.00 0.00 H ATOM 10962 HB3 ALA B 277 -18.416 -1.580 -6.419 1.00 0.00 H ATOM 10963 H ALA B 277 -15.464 0.119 -5.127 1.00 0.00 H ATOM 10964 N ASN B 278 -18.436 1.524 -4.428 1.00 7.70 N ATOM 10965 CA ASN B 278 -19.623 2.191 -3.850 1.00 5.70 C ATOM 10966 C ASN B 278 -19.989 3.448 -4.649 1.00 7.15 C ATOM 10967 O ASN B 278 -21.138 3.816 -4.795 1.00 10.46 O ATOM 10968 CB ASN B 278 -19.638 2.335 -2.293 1.00 7.11 C ATOM 10969 CG ASN B 278 -18.648 3.262 -1.586 1.00 11.44 C ATOM 10970 OD1 ASN B 278 -18.642 3.373 -0.314 1.00 12.09 O ATOM 10971 ND2 ASN B 278 -17.925 4.037 -2.352 1.00 3.00 N ATOM 10972 HA ASN B 278 -20.456 1.499 -3.976 1.00 0.00 H ATOM 10973 HB2 ASN B 278 -20.636 2.679 -2.021 1.00 0.00 H ATOM 10974 HB3 ASN B 278 -19.476 1.337 -1.886 1.00 0.00 H ATOM 10975 HD22 ASN B 278 -17.953 3.920 -3.385 1.00 0.00 H ATOM 10976 HD21 ASN B 278 -17.322 4.771 -1.928 1.00 0.00 H ATOM 10977 H ASN B 278 -17.546 1.478 -3.891 1.00 0.00 H ATOM 10978 N GLN B 279 -18.964 4.084 -5.185 1.00 3.93 N ATOM 10979 CA GLN B 279 -19.131 5.276 -6.028 1.00 3.97 C ATOM 10980 C GLN B 279 -19.610 4.829 -7.419 1.00 5.42 C ATOM 10981 O GLN B 279 -20.526 5.448 -8.020 1.00 6.15 O ATOM 10982 CB GLN B 279 -17.759 5.939 -6.217 1.00 3.00 C ATOM 10983 CG GLN B 279 -17.691 6.871 -7.438 1.00 5.77 C ATOM 10984 CD GLN B 279 -16.243 7.208 -7.717 1.00 12.28 C ATOM 10985 OE1 GLN B 279 -15.639 7.874 -6.917 1.00 6.99 O ATOM 10986 NE2 GLN B 279 -15.634 6.726 -8.812 1.00 8.17 N ATOM 10987 HA GLN B 279 -19.841 5.960 -5.564 1.00 0.00 H ATOM 10988 HB2 GLN B 279 -17.531 6.522 -5.325 1.00 0.00 H ATOM 10989 HB3 GLN B 279 -17.011 5.156 -6.338 1.00 0.00 H ATOM 10990 HG2 GLN B 279 -18.124 6.372 -8.305 1.00 0.00 H ATOM 10991 HG3 GLN B 279 -18.247 7.786 -7.232 1.00 0.00 H ATOM 10992 HE22 GLN B 279 -16.169 6.152 -9.494 1.00 0.00 H ATOM 10993 HE21 GLN B 279 -14.627 6.927 -8.978 1.00 0.00 H ATOM 10994 H GLN B 279 -18.003 3.729 -5.004 1.00 0.00 H ATOM 10995 N GLU B 280 -18.957 3.798 -7.939 1.00 3.33 N ATOM 10996 CA GLU B 280 -19.235 3.215 -9.258 1.00 3.00 C ATOM 10997 C GLU B 280 -20.679 2.764 -9.413 1.00 10.75 C ATOM 10998 O GLU B 280 -21.280 2.882 -10.483 1.00 7.81 O ATOM 10999 CB GLU B 280 -18.347 2.011 -9.665 1.00 10.54 C ATOM 11000 CG GLU B 280 -16.848 2.410 -9.825 1.00 5.11 C ATOM 11001 CD GLU B 280 -16.557 3.319 -10.994 1.00 10.84 C ATOM 11002 OE1 GLU B 280 -16.650 3.004 -12.164 1.00 19.44 O ATOM 11003 OE2 GLU B 280 -16.417 4.555 -10.621 1.00 11.88 O ATOM 11004 HA GLU B 280 -19.003 4.051 -9.918 1.00 0.00 H ATOM 11005 HB2 GLU B 280 -18.425 1.242 -8.897 1.00 0.00 H ATOM 11006 HB3 GLU B 280 -18.708 1.614 -10.614 1.00 0.00 H ATOM 11007 HG2 GLU B 280 -16.533 2.918 -8.913 1.00 0.00 H ATOM 11008 HG3 GLU B 280 -16.265 1.497 -9.951 1.00 0.00 H ATOM 11009 H GLU B 280 -18.195 3.373 -7.373 1.00 0.00 H ATOM 11010 N VAL B 281 -21.209 2.216 -8.346 1.00 10.93 N ATOM 11011 CA VAL B 281 -22.616 1.734 -8.365 1.00 3.17 C ATOM 11012 C VAL B 281 -23.530 2.962 -8.628 1.00 8.59 C ATOM 11013 O VAL B 281 -24.409 2.937 -9.482 1.00 8.02 O ATOM 11014 CB VAL B 281 -23.020 1.065 -7.013 1.00 5.61 C ATOM 11015 CG1 VAL B 281 -24.512 0.871 -7.013 1.00 12.35 C ATOM 11016 CG2 VAL B 281 -22.345 -0.284 -6.845 1.00 5.34 C ATOM 11017 HA VAL B 281 -22.725 0.980 -9.144 1.00 0.00 H ATOM 11018 HB VAL B 281 -22.706 1.707 -6.190 1.00 0.00 H ATOM 11019 HG11 VAL B 281 -25.003 1.839 -7.115 1.00 0.00 H ATOM 11020 HG12 VAL B 281 -24.794 0.230 -7.848 1.00 0.00 H ATOM 11021 HG13 VAL B 281 -24.816 0.404 -6.076 1.00 0.00 H ATOM 11022 HG21 VAL B 281 -22.642 -0.942 -7.662 1.00 0.00 H ATOM 11023 HG22 VAL B 281 -21.263 -0.152 -6.859 1.00 0.00 H ATOM 11024 HG23 VAL B 281 -22.647 -0.724 -5.894 1.00 0.00 H ATOM 11025 H VAL B 281 -20.641 2.118 -7.480 1.00 0.00 H ATOM 11026 N LEU B 282 -23.331 4.073 -7.893 1.00 4.57 N ATOM 11027 CA LEU B 282 -24.152 5.268 -8.095 1.00 13.27 C ATOM 11028 C LEU B 282 -23.986 5.894 -9.481 1.00 15.13 C ATOM 11029 O LEU B 282 -24.964 6.359 -10.097 1.00 15.60 O ATOM 11030 CB LEU B 282 -23.836 6.347 -7.053 1.00 9.32 C ATOM 11031 CG LEU B 282 -25.061 6.629 -6.205 1.00 18.59 C ATOM 11032 CD1 LEU B 282 -26.220 6.949 -7.131 1.00 29.29 C ATOM 11033 CD2 LEU B 282 -25.445 5.379 -5.453 1.00 20.38 C ATOM 11034 HA LEU B 282 -25.180 4.920 -7.991 1.00 0.00 H ATOM 11035 HB2 LEU B 282 -23.025 6.002 -6.412 1.00 0.00 H ATOM 11036 HB3 LEU B 282 -23.531 7.262 -7.562 1.00 0.00 H ATOM 11037 HG LEU B 282 -24.846 7.449 -5.520 1.00 0.00 H ATOM 11038 HD21 LEU B 282 -25.668 4.583 -6.164 1.00 0.00 H ATOM 11039 HD22 LEU B 282 -24.618 5.074 -4.811 1.00 0.00 H ATOM 11040 HD23 LEU B 282 -26.326 5.580 -4.843 1.00 0.00 H ATOM 11041 HD11 LEU B 282 -25.972 7.824 -7.732 1.00 0.00 H ATOM 11042 HD12 LEU B 282 -26.406 6.097 -7.785 1.00 0.00 H ATOM 11043 HD13 LEU B 282 -27.111 7.155 -6.538 1.00 0.00 H ATOM 11044 H LEU B 282 -22.583 4.082 -7.171 1.00 0.00 H ATOM 11045 N LEU B 283 -22.764 5.917 -9.997 1.00 12.69 N ATOM 11046 CA LEU B 283 -22.545 6.480 -11.321 1.00 10.93 C ATOM 11047 C LEU B 283 -23.269 5.608 -12.391 1.00 20.32 C ATOM 11048 O LEU B 283 -23.823 6.133 -13.367 1.00 14.21 O ATOM 11049 CB LEU B 283 -21.067 6.616 -11.676 1.00 14.99 C ATOM 11050 CG LEU B 283 -20.242 7.543 -10.789 1.00 17.41 C ATOM 11051 CD1 LEU B 283 -18.745 7.448 -11.144 1.00 11.32 C ATOM 11052 CD2 LEU B 283 -20.761 8.951 -11.021 1.00 17.14 C ATOM 11053 HA LEU B 283 -22.961 7.488 -11.310 1.00 0.00 H ATOM 11054 HB2 LEU B 283 -20.620 5.623 -11.626 1.00 0.00 H ATOM 11055 HB3 LEU B 283 -21.004 6.990 -12.698 1.00 0.00 H ATOM 11056 HG LEU B 283 -20.338 7.263 -9.740 1.00 0.00 H ATOM 11057 HD21 LEU B 283 -20.640 9.213 -12.072 1.00 0.00 H ATOM 11058 HD22 LEU B 283 -21.816 8.997 -10.753 1.00 0.00 H ATOM 11059 HD23 LEU B 283 -20.197 9.651 -10.404 1.00 0.00 H ATOM 11060 HD11 LEU B 283 -18.403 6.423 -10.998 1.00 0.00 H ATOM 11061 HD12 LEU B 283 -18.601 7.736 -12.185 1.00 0.00 H ATOM 11062 HD13 LEU B 283 -18.177 8.118 -10.499 1.00 0.00 H ATOM 11063 H LEU B 283 -21.963 5.533 -9.456 1.00 0.00 H ATOM 11064 N TRP B 284 -23.279 4.264 -12.213 1.00 16.27 N ATOM 11065 CA TRP B 284 -23.922 3.281 -13.112 1.00 12.51 C ATOM 11066 C TRP B 284 -25.435 3.440 -13.065 1.00 8.47 C ATOM 11067 O TRP B 284 -26.110 3.401 -14.087 1.00 17.13 O ATOM 11068 CB TRP B 284 -23.469 1.913 -12.654 1.00 13.02 C ATOM 11069 CG TRP B 284 -23.815 0.850 -13.626 1.00 15.26 C ATOM 11070 CD1 TRP B 284 -23.220 0.560 -14.802 1.00 18.51 C ATOM 11071 CD2 TRP B 284 -24.881 -0.090 -13.452 1.00 14.16 C ATOM 11072 NE1 TRP B 284 -23.856 -0.527 -15.371 1.00 13.82 N ATOM 11073 CE2 TRP B 284 -24.886 -0.930 -14.571 1.00 15.23 C ATOM 11074 CE3 TRP B 284 -25.809 -0.286 -12.443 1.00 16.67 C ATOM 11075 CZ2 TRP B 284 -25.816 -1.972 -14.701 1.00 16.20 C ATOM 11076 CZ3 TRP B 284 -26.730 -1.304 -12.574 1.00 25.05 C ATOM 11077 CH2 TRP B 284 -26.735 -2.148 -13.688 1.00 20.00 C ATOM 11078 HA TRP B 284 -23.635 3.431 -14.153 1.00 0.00 H ATOM 11079 HB2 TRP B 284 -22.387 1.928 -12.521 1.00 0.00 H ATOM 11080 HB3 TRP B 284 -23.947 1.686 -11.701 1.00 0.00 H ATOM 11081 HE1 TRP B 284 -23.590 -0.971 -16.273 1.00 0.00 H ATOM 11082 HD1 TRP B 284 -22.375 1.096 -15.233 1.00 0.00 H ATOM 11083 HZ2 TRP B 284 -25.812 -2.622 -15.576 1.00 0.00 H ATOM 11084 HH2 TRP B 284 -27.470 -2.950 -13.757 1.00 0.00 H ATOM 11085 HZ3 TRP B 284 -27.472 -1.454 -11.790 1.00 0.00 H ATOM 11086 HE3 TRP B 284 -25.811 0.353 -11.560 1.00 0.00 H ATOM 11087 H TRP B 284 -22.793 3.892 -11.372 1.00 0.00 H ATOM 11088 N LEU B 285 -25.964 3.636 -11.864 1.00 6.66 N ATOM 11089 CA LEU B 285 -27.377 3.839 -11.632 1.00 6.62 C ATOM 11090 C LEU B 285 -27.795 5.143 -12.252 1.00 16.92 C ATOM 11091 O LEU B 285 -28.831 5.233 -12.871 1.00 18.99 O ATOM 11092 CB LEU B 285 -27.802 3.842 -10.175 1.00 11.61 C ATOM 11093 CG LEU B 285 -27.690 2.521 -9.436 1.00 17.76 C ATOM 11094 CD1 LEU B 285 -28.089 2.776 -7.984 1.00 17.57 C ATOM 11095 CD2 LEU B 285 -28.627 1.468 -9.972 1.00 12.10 C ATOM 11096 HA LEU B 285 -27.870 2.980 -12.088 1.00 0.00 H ATOM 11097 HB2 LEU B 285 -27.183 4.569 -9.650 1.00 0.00 H ATOM 11098 HB3 LEU B 285 -28.844 4.158 -10.134 1.00 0.00 H ATOM 11099 HG LEU B 285 -26.668 2.159 -9.552 1.00 0.00 H ATOM 11100 HD21 LEU B 285 -29.655 1.816 -9.877 1.00 0.00 H ATOM 11101 HD22 LEU B 285 -28.400 1.282 -11.022 1.00 0.00 H ATOM 11102 HD23 LEU B 285 -28.500 0.547 -9.403 1.00 0.00 H ATOM 11103 HD11 LEU B 285 -27.418 3.516 -7.549 1.00 0.00 H ATOM 11104 HD12 LEU B 285 -29.113 3.148 -7.950 1.00 0.00 H ATOM 11105 HD13 LEU B 285 -28.020 1.845 -7.421 1.00 0.00 H ATOM 11106 H LEU B 285 -25.326 3.644 -11.043 1.00 0.00 H ATOM 11107 N SER B 286 -26.980 6.183 -12.081 1.00 13.71 N ATOM 11108 CA SER B 286 -27.298 7.497 -12.676 1.00 20.30 C ATOM 11109 C SER B 286 -27.352 7.481 -14.201 1.00 18.82 C ATOM 11110 O SER B 286 -28.155 8.180 -14.780 1.00 22.02 O ATOM 11111 CB SER B 286 -26.293 8.552 -12.241 1.00 16.15 C ATOM 11112 OG SER B 286 -26.419 8.603 -10.848 1.00 22.33 O ATOM 11113 HA SER B 286 -28.294 7.741 -12.308 1.00 0.00 H ATOM 11114 HB2 SER B 286 -26.532 9.518 -12.685 1.00 0.00 H ATOM 11115 HB3 SER B 286 -25.282 8.262 -12.526 1.00 0.00 H ATOM 11116 HG SER B 286 -26.210 7.714 -10.466 1.00 0.00 H ATOM 11117 H SER B 286 -26.110 6.068 -11.522 1.00 0.00 H ATOM 11118 N GLN B 287 -26.490 6.712 -14.882 1.00 18.90 N ATOM 11119 CA GLN B 287 -26.472 6.612 -16.337 1.00 15.59 C ATOM 11120 C GLN B 287 -27.670 5.761 -16.752 1.00 30.53 C ATOM 11121 O GLN B 287 -28.224 5.851 -17.853 1.00 25.20 O ATOM 11122 CB GLN B 287 -25.308 5.742 -16.770 1.00 25.58 C ATOM 11123 CG GLN B 287 -24.384 6.349 -17.805 1.00 66.72 C ATOM 11124 CD GLN B 287 -23.288 6.859 -16.936 1.00 80.00 C ATOM 11125 OE1 GLN B 287 -23.551 7.787 -16.156 1.00 80.00 O ATOM 11126 NE2 GLN B 287 -22.294 5.988 -16.767 1.00 80.00 N ATOM 11127 HA GLN B 287 -26.444 7.619 -16.754 1.00 0.00 H ATOM 11128 HB2 GLN B 287 -24.715 5.511 -15.885 1.00 0.00 H ATOM 11129 HB3 GLN B 287 -25.715 4.819 -17.184 1.00 0.00 H ATOM 11130 HG2 GLN B 287 -24.022 5.600 -18.509 1.00 0.00 H ATOM 11131 HG3 GLN B 287 -24.870 7.156 -18.353 1.00 0.00 H ATOM 11132 HE22 GLN B 287 -22.137 5.236 -17.468 1.00 0.00 H ATOM 11133 HE21 GLN B 287 -21.675 6.061 -15.935 1.00 0.00 H ATOM 11134 H GLN B 287 -25.796 6.156 -14.343 1.00 0.00 H ATOM 11135 N LEU B 288 -28.049 4.874 -15.834 1.00 20.36 N ATOM 11136 CA LEU B 288 -29.160 3.987 -16.090 1.00 14.84 C ATOM 11137 C LEU B 288 -30.446 4.780 -16.212 1.00 24.20 C ATOM 11138 O LEU B 288 -31.122 4.779 -17.222 1.00 19.75 O ATOM 11139 CB LEU B 288 -29.226 2.944 -14.977 1.00 15.03 C ATOM 11140 CG LEU B 288 -30.141 1.794 -15.334 1.00 25.51 C ATOM 11141 CD1 LEU B 288 -29.772 0.559 -14.501 1.00 25.69 C ATOM 11142 CD2 LEU B 288 -31.589 2.219 -15.071 1.00 22.85 C ATOM 11143 HA LEU B 288 -29.019 3.466 -17.037 1.00 0.00 H ATOM 11144 HB2 LEU B 288 -28.224 2.555 -14.799 1.00 0.00 H ATOM 11145 HB3 LEU B 288 -29.596 3.420 -14.069 1.00 0.00 H ATOM 11146 HG LEU B 288 -30.030 1.536 -16.387 1.00 0.00 H ATOM 11147 HD21 LEU B 288 -31.706 2.473 -14.017 1.00 0.00 H ATOM 11148 HD22 LEU B 288 -31.828 3.088 -15.684 1.00 0.00 H ATOM 11149 HD23 LEU B 288 -32.259 1.398 -15.325 1.00 0.00 H ATOM 11150 HD11 LEU B 288 -28.740 0.277 -14.709 1.00 0.00 H ATOM 11151 HD12 LEU B 288 -29.880 0.791 -13.442 1.00 0.00 H ATOM 11152 HD13 LEU B 288 -30.435 -0.266 -14.763 1.00 0.00 H ATOM 11153 H LEU B 288 -27.542 4.820 -14.927 1.00 0.00 H ATOM 11154 N GLN B 289 -30.753 5.458 -15.126 1.00 24.57 N ATOM 11155 CA GLN B 289 -31.935 6.283 -15.013 1.00 27.16 C ATOM 11156 C GLN B 289 -31.878 7.360 -16.065 1.00 32.70 C ATOM 11157 O GLN B 289 -32.886 7.914 -16.460 1.00 32.17 O ATOM 11158 CB GLN B 289 -31.935 7.009 -13.674 1.00 29.93 C ATOM 11159 CG GLN B 289 -32.445 6.123 -12.533 1.00 40.56 C ATOM 11160 CD GLN B 289 -32.649 6.991 -11.313 1.00 80.00 C ATOM 11161 OE1 GLN B 289 -33.602 6.779 -10.532 1.00 73.44 O ATOM 11162 NE2 GLN B 289 -31.799 8.029 -11.230 1.00 80.00 N ATOM 11163 HA GLN B 289 -32.813 5.646 -15.118 1.00 0.00 H ATOM 11164 HB2 GLN B 289 -30.917 7.324 -13.446 1.00 0.00 H ATOM 11165 HB3 GLN B 289 -32.577 7.887 -13.751 1.00 0.00 H ATOM 11166 HG2 GLN B 289 -33.390 5.661 -12.819 1.00 0.00 H ATOM 11167 HG3 GLN B 289 -31.713 5.345 -12.314 1.00 0.00 H ATOM 11168 HE22 GLN B 289 -31.031 8.129 -11.924 1.00 0.00 H ATOM 11169 HE21 GLN B 289 -31.909 8.732 -10.472 1.00 0.00 H ATOM 11170 H GLN B 289 -30.113 5.397 -14.308 1.00 0.00 H ATOM 11171 N LYS B 290 -30.683 7.654 -16.538 1.00 31.96 N ATOM 11172 CA LYS B 290 -30.584 8.681 -17.551 1.00 27.93 C ATOM 11173 C LYS B 290 -30.925 8.160 -18.940 1.00 41.56 C ATOM 11174 O LYS B 290 -31.648 8.800 -19.706 1.00 46.52 O ATOM 11175 CB LYS B 290 -29.281 9.469 -17.494 1.00 26.83 C ATOM 11176 CG LYS B 290 -28.583 9.646 -18.827 1.00 39.08 C ATOM 11177 CD LYS B 290 -27.376 10.565 -18.660 1.00 80.00 C ATOM 11178 CE LYS B 290 -26.356 10.114 -17.599 1.00 80.00 C ATOM 11179 NZ LYS B 290 -25.857 11.157 -16.669 1.00 80.00 N ATOM 11180 HA LYS B 290 -31.354 9.414 -17.312 1.00 0.00 H ATOM 11181 HB2 LYS B 290 -29.501 10.458 -17.093 1.00 0.00 H ATOM 11182 HB3 LYS B 290 -28.599 8.948 -16.821 1.00 0.00 H ATOM 11183 HG2 LYS B 290 -28.251 8.675 -19.194 1.00 0.00 H ATOM 11184 HG3 LYS B 290 -29.277 10.086 -19.544 1.00 0.00 H ATOM 11185 HD2 LYS B 290 -26.862 10.626 -19.619 1.00 0.00 H ATOM 11186 HD3 LYS B 290 -27.740 11.554 -18.381 1.00 0.00 H ATOM 11187 HE2 LYS B 290 -25.495 9.699 -18.123 1.00 0.00 H ATOM 11188 HE3 LYS B 290 -26.825 9.334 -17.000 1.00 0.00 H ATOM 11189 HZ1 LYS B 290 -25.386 11.908 -17.213 1.00 0.00 H ATOM 11190 HZ2 LYS B 290 -26.657 11.559 -16.140 1.00 0.00 H ATOM 11191 HZ3 LYS B 290 -25.179 10.732 -16.005 1.00 0.00 H ATOM 11192 H LYS B 290 -29.835 7.161 -16.192 1.00 0.00 H ATOM 11193 N ASP B 291 -30.396 6.985 -19.263 1.00 38.87 N ATOM 11194 CA ASP B 291 -30.636 6.358 -20.544 1.00 32.66 C ATOM 11195 C ASP B 291 -32.081 5.911 -20.581 1.00 49.60 C ATOM 11196 O ASP B 291 -32.851 6.291 -21.455 1.00 60.02 O ATOM 11197 CB ASP B 291 -29.782 5.084 -20.782 1.00 34.86 C ATOM 11198 CG ASP B 291 -28.600 5.184 -21.735 1.00 80.00 C ATOM 11199 OD1 ASP B 291 -27.666 6.029 -21.335 1.00 80.00 O ATOM 11200 OD2 ASP B 291 -28.399 4.374 -22.642 1.00 80.00 O ATOM 11201 HA ASP B 291 -30.379 7.093 -21.306 1.00 0.00 H ATOM 11202 HB2 ASP B 291 -29.392 4.769 -19.814 1.00 0.00 H ATOM 11203 HB3 ASP B 291 -30.449 4.315 -21.172 1.00 0.00 H ATOM 11204 H ASP B 291 -29.789 6.500 -18.572 1.00 0.00 H ATOM 11205 N LEU B 292 -32.438 5.073 -19.620 1.00 34.99 N ATOM 11206 CA LEU B 292 -33.786 4.543 -19.555 1.00 28.58 C ATOM 11207 C LEU B 292 -34.847 5.396 -18.898 1.00 43.03 C ATOM 11208 O LEU B 292 -36.035 5.220 -19.155 1.00 57.20 O ATOM 11209 CB LEU B 292 -33.781 3.129 -18.976 1.00 27.67 C ATOM 11210 CG LEU B 292 -32.600 2.364 -19.526 1.00 22.18 C ATOM 11211 CD1 LEU B 292 -32.562 0.959 -18.962 1.00 22.98 C ATOM 11212 CD2 LEU B 292 -32.711 2.347 -21.024 1.00 32.28 C ATOM 11213 HA LEU B 292 -34.100 4.537 -20.599 1.00 0.00 H ATOM 11214 HB2 LEU B 292 -33.707 3.181 -17.890 1.00 0.00 H ATOM 11215 HB3 LEU B 292 -34.704 2.620 -19.252 1.00 0.00 H ATOM 11216 HG LEU B 292 -31.669 2.849 -19.234 1.00 0.00 H ATOM 11217 HD21 LEU B 292 -33.642 1.859 -21.313 1.00 0.00 H ATOM 11218 HD22 LEU B 292 -32.704 3.370 -21.399 1.00 0.00 H ATOM 11219 HD23 LEU B 292 -31.867 1.799 -21.443 1.00 0.00 H ATOM 11220 HD11 LEU B 292 -32.477 1.007 -17.876 1.00 0.00 H ATOM 11221 HD12 LEU B 292 -33.479 0.435 -19.233 1.00 0.00 H ATOM 11222 HD13 LEU B 292 -31.703 0.427 -19.372 1.00 0.00 H ATOM 11223 H LEU B 292 -31.741 4.791 -18.901 1.00 0.00 H ATOM 11224 N GLY B 293 -34.436 6.309 -18.047 1.00 48.05 N ATOM 11225 CA GLY B 293 -35.407 7.152 -17.392 1.00 51.72 C ATOM 11226 C GLY B 293 -36.189 6.410 -16.315 1.00 72.76 C ATOM 11227 O GLY B 293 -36.900 5.452 -16.599 1.00 80.00 O ATOM 11228 HA3 GLY B 293 -36.108 7.525 -18.139 1.00 0.00 H ATOM 11229 HA2 GLY B 293 -34.887 7.992 -16.931 1.00 0.00 H ATOM 11230 H GLY B 293 -33.422 6.423 -17.848 1.00 0.00 H ATOM 11231 N ALA B 294 -36.022 6.908 -15.084 1.00 79.71 N ATOM 11232 CA ALA B 294 -36.594 6.505 -13.791 1.00 80.00 C ATOM 11233 C ALA B 294 -37.287 5.156 -13.623 1.00 80.00 C ATOM 11234 O ALA B 294 -36.703 4.270 -12.974 1.00 80.00 O ATOM 11235 CB ALA B 294 -37.266 7.634 -12.997 1.00 80.00 C ATOM 11236 HA ALA B 294 -35.643 6.268 -13.314 1.00 0.00 H ATOM 11237 HB1 ALA B 294 -36.534 8.413 -12.785 1.00 0.00 H ATOM 11238 HB2 ALA B 294 -38.084 8.052 -13.584 1.00 0.00 H ATOM 11239 HB3 ALA B 294 -37.656 7.236 -12.060 1.00 0.00 H ATOM 11240 H ALA B 294 -35.375 7.721 -15.033 1.00 0.00 H ATOM 11241 N ASP B 295 -38.514 4.998 -14.165 1.00 62.71 N ATOM 11242 CA ASP B 295 -39.224 3.730 -14.030 1.00 61.46 C ATOM 11243 C ASP B 295 -39.040 2.812 -15.251 1.00 67.40 C ATOM 11244 O ASP B 295 -39.734 2.927 -16.264 1.00 74.18 O ATOM 11245 CB ASP B 295 -40.680 3.907 -13.561 1.00 66.47 C ATOM 11246 CG ASP B 295 -41.445 2.621 -13.344 1.00 80.00 C ATOM 11247 OD1 ASP B 295 -40.807 1.724 -12.587 1.00 80.00 O ATOM 11248 OD2 ASP B 295 -42.577 2.466 -13.807 1.00 80.00 O ATOM 11249 HA ASP B 295 -38.748 3.187 -13.214 1.00 0.00 H ATOM 11250 HB2 ASP B 295 -40.667 4.456 -12.619 1.00 0.00 H ATOM 11251 HB3 ASP B 295 -41.209 4.492 -14.314 1.00 0.00 H ATOM 11252 H ASP B 295 -38.956 5.785 -14.682 1.00 0.00 H ATOM 11253 N ALA B 296 -38.074 1.886 -15.157 1.00 47.68 N ATOM 11254 CA ALA B 296 -37.787 0.978 -16.245 1.00 35.68 C ATOM 11255 C ALA B 296 -38.428 -0.410 -16.128 1.00 30.25 C ATOM 11256 O ALA B 296 -38.719 -0.931 -15.062 1.00 30.54 O ATOM 11257 CB ALA B 296 -36.267 0.917 -16.480 1.00 30.92 C ATOM 11258 HA ALA B 296 -38.272 1.392 -17.129 1.00 0.00 H ATOM 11259 HB1 ALA B 296 -35.899 1.912 -16.731 1.00 0.00 H ATOM 11260 HB2 ALA B 296 -35.774 0.564 -15.574 1.00 0.00 H ATOM 11261 HB3 ALA B 296 -36.055 0.232 -17.301 1.00 0.00 H ATOM 11262 H ALA B 296 -37.518 1.820 -14.281 1.00 0.00 H ATOM 11263 N SER B 297 -38.654 -1.033 -17.281 1.00 21.78 N ATOM 11264 CA SER B 297 -39.224 -2.361 -17.354 1.00 15.32 C ATOM 11265 C SER B 297 -38.072 -3.301 -17.104 1.00 20.54 C ATOM 11266 O SER B 297 -36.908 -2.899 -17.248 1.00 18.70 O ATOM 11267 CB SER B 297 -39.779 -2.730 -18.729 1.00 28.99 C ATOM 11268 OG SER B 297 -38.838 -2.515 -19.791 1.00 40.25 O ATOM 11269 HA SER B 297 -40.049 -2.416 -16.644 1.00 0.00 H ATOM 11270 HB2 SER B 297 -40.664 -2.123 -18.921 1.00 0.00 H ATOM 11271 HB3 SER B 297 -40.058 -3.784 -18.720 1.00 0.00 H ATOM 11272 HG SER B 297 -39.252 -2.770 -20.653 1.00 0.00 H ATOM 11273 H SER B 297 -38.411 -0.546 -18.167 1.00 0.00 H ATOM 11274 N ASP B 298 -38.396 -4.516 -16.729 1.00 19.75 N ATOM 11275 CA ASP B 298 -37.352 -5.463 -16.469 1.00 22.43 C ATOM 11276 C ASP B 298 -36.577 -5.806 -17.725 1.00 25.34 C ATOM 11277 O ASP B 298 -35.360 -5.999 -17.670 1.00 20.87 O ATOM 11278 CB ASP B 298 -37.908 -6.745 -15.833 1.00 27.44 C ATOM 11279 CG ASP B 298 -38.441 -6.626 -14.414 1.00 44.17 C ATOM 11280 OD1 ASP B 298 -38.223 -5.503 -13.748 1.00 28.15 O ATOM 11281 OD2 ASP B 298 -38.966 -7.585 -13.884 1.00 44.41 O ATOM 11282 HA ASP B 298 -36.668 -4.990 -15.765 1.00 0.00 H ATOM 11283 HB2 ASP B 298 -38.723 -7.101 -16.464 1.00 0.00 H ATOM 11284 HB3 ASP B 298 -37.107 -7.484 -15.825 1.00 0.00 H ATOM 11285 H ASP B 298 -39.394 -4.787 -16.622 1.00 0.00 H ATOM 11286 N GLU B 299 -37.255 -5.890 -18.866 1.00 24.25 N ATOM 11287 CA GLU B 299 -36.591 -6.233 -20.116 1.00 20.48 C ATOM 11288 C GLU B 299 -35.590 -5.152 -20.471 1.00 19.70 C ATOM 11289 O GLU B 299 -34.508 -5.466 -20.951 1.00 22.12 O ATOM 11290 CB GLU B 299 -37.523 -6.582 -21.286 1.00 27.12 C ATOM 11291 CG GLU B 299 -38.905 -5.919 -21.133 1.00 80.00 C ATOM 11292 CD GLU B 299 -39.712 -6.490 -19.990 1.00 80.00 C ATOM 11293 OE1 GLU B 299 -39.672 -7.686 -19.682 1.00 80.00 O ATOM 11294 OE2 GLU B 299 -40.313 -5.550 -19.277 1.00 80.00 O ATOM 11295 HA GLU B 299 -36.068 -7.172 -19.937 1.00 0.00 H ATOM 11296 HB2 GLU B 299 -37.068 -6.239 -22.215 1.00 0.00 H ATOM 11297 HB3 GLU B 299 -37.652 -7.664 -21.324 1.00 0.00 H ATOM 11298 HG2 GLU B 299 -38.761 -4.853 -20.958 1.00 0.00 H ATOM 11299 HG3 GLU B 299 -39.463 -6.062 -22.058 1.00 0.00 H ATOM 11300 H GLU B 299 -38.279 -5.707 -18.866 1.00 0.00 H ATOM 11301 N LYS B 300 -35.914 -3.883 -20.209 1.00 22.44 N ATOM 11302 CA LYS B 300 -34.965 -2.827 -20.512 1.00 21.19 C ATOM 11303 C LYS B 300 -33.738 -2.867 -19.587 1.00 16.09 C ATOM 11304 O LYS B 300 -32.596 -2.636 -20.035 1.00 19.77 O ATOM 11305 CB LYS B 300 -35.627 -1.465 -20.547 1.00 27.00 C ATOM 11306 CG LYS B 300 -36.476 -1.360 -21.814 1.00 38.16 C ATOM 11307 CD LYS B 300 -36.217 -0.080 -22.588 1.00 62.69 C ATOM 11308 CE LYS B 300 -36.410 -0.223 -24.091 1.00 68.46 C ATOM 11309 NZ LYS B 300 -35.826 -1.464 -24.607 1.00 80.00 N ATOM 11310 HA LYS B 300 -34.591 -3.013 -21.519 1.00 0.00 H ATOM 11311 HB2 LYS B 300 -36.262 -1.344 -19.669 1.00 0.00 H ATOM 11312 HB3 LYS B 300 -34.864 -0.687 -20.552 1.00 0.00 H ATOM 11313 HG2 LYS B 300 -36.249 -2.209 -22.458 1.00 0.00 H ATOM 11314 HG3 LYS B 300 -37.529 -1.391 -21.532 1.00 0.00 H ATOM 11315 HD2 LYS B 300 -36.901 0.687 -22.224 1.00 0.00 H ATOM 11316 HD3 LYS B 300 -35.190 0.233 -22.401 1.00 0.00 H ATOM 11317 HE2 LYS B 300 -35.935 0.623 -24.589 1.00 0.00 H ATOM 11318 HE3 LYS B 300 -37.478 -0.219 -24.310 1.00 0.00 H ATOM 11319 HZ1 LYS B 300 -34.805 -1.474 -24.409 1.00 0.00 H ATOM 11320 HZ2 LYS B 300 -36.278 -2.278 -24.143 1.00 0.00 H ATOM 11321 HZ3 LYS B 300 -35.982 -1.518 -25.634 1.00 0.00 H ATOM 11322 H LYS B 300 -36.838 -3.653 -19.791 1.00 0.00 H ATOM 11323 N LEU B 301 -33.956 -3.195 -18.292 1.00 20.50 N ATOM 11324 CA LEU B 301 -32.874 -3.294 -17.309 1.00 17.03 C ATOM 11325 C LEU B 301 -31.963 -4.411 -17.737 1.00 10.66 C ATOM 11326 O LEU B 301 -30.747 -4.304 -17.642 1.00 19.95 O ATOM 11327 CB LEU B 301 -33.389 -3.763 -15.947 1.00 21.49 C ATOM 11328 CG LEU B 301 -34.172 -2.688 -15.233 1.00 22.89 C ATOM 11329 CD1 LEU B 301 -34.620 -3.229 -13.877 1.00 16.08 C ATOM 11330 CD2 LEU B 301 -33.233 -1.499 -15.045 1.00 24.17 C ATOM 11331 HA LEU B 301 -32.405 -2.312 -17.244 1.00 0.00 H ATOM 11332 HB2 LEU B 301 -34.035 -4.629 -16.095 1.00 0.00 H ATOM 11333 HB3 LEU B 301 -32.538 -4.047 -15.328 1.00 0.00 H ATOM 11334 HG LEU B 301 -35.054 -2.386 -15.798 1.00 0.00 H ATOM 11335 HD21 LEU B 301 -32.373 -1.807 -14.451 1.00 0.00 H ATOM 11336 HD22 LEU B 301 -32.896 -1.146 -16.020 1.00 0.00 H ATOM 11337 HD23 LEU B 301 -33.763 -0.697 -14.531 1.00 0.00 H ATOM 11338 HD11 LEU B 301 -35.247 -4.108 -14.027 1.00 0.00 H ATOM 11339 HD12 LEU B 301 -33.744 -3.503 -13.289 1.00 0.00 H ATOM 11340 HD13 LEU B 301 -35.187 -2.461 -13.350 1.00 0.00 H ATOM 11341 H LEU B 301 -34.931 -3.384 -17.982 1.00 0.00 H ATOM 11342 N ARG B 302 -32.569 -5.513 -18.212 1.00 13.88 N ATOM 11343 CA ARG B 302 -31.719 -6.631 -18.651 1.00 13.88 C ATOM 11344 C ARG B 302 -30.767 -6.200 -19.816 1.00 16.83 C ATOM 11345 O ARG B 302 -29.597 -6.512 -19.860 1.00 14.55 O ATOM 11346 CB ARG B 302 -32.582 -7.730 -19.237 1.00 21.94 C ATOM 11347 CG ARG B 302 -33.047 -8.874 -18.378 1.00 22.65 C ATOM 11348 CD ARG B 302 -33.099 -10.074 -19.320 1.00 47.07 C ATOM 11349 NE ARG B 302 -32.206 -11.193 -18.965 1.00 80.00 N ATOM 11350 CZ ARG B 302 -32.320 -11.960 -17.861 1.00 80.00 C ATOM 11351 NH1 ARG B 302 -33.274 -11.786 -16.929 1.00 80.00 N ATOM 11352 NH2 ARG B 302 -31.435 -12.943 -17.684 1.00 80.00 N ATOM 11353 HA ARG B 302 -31.154 -6.956 -17.778 1.00 0.00 H ATOM 11354 HB2 ARG B 302 -33.478 -7.249 -19.629 1.00 0.00 H ATOM 11355 HB3 ARG B 302 -32.016 -8.167 -20.060 1.00 0.00 H ATOM 11356 HG2 ARG B 302 -32.344 -9.054 -17.565 1.00 0.00 H ATOM 11357 HG3 ARG B 302 -34.034 -8.667 -17.964 1.00 0.00 H ATOM 11358 HD2 ARG B 302 -32.829 -9.731 -20.319 1.00 0.00 H ATOM 11359 HD3 ARG B 302 -34.122 -10.450 -19.331 1.00 0.00 H ATOM 11360 HE ARG B 302 -31.426 -11.408 -19.618 1.00 0.00 H ATOM 11361 HH12 ARG B 302 -33.310 -12.411 -16.098 1.00 0.00 H ATOM 11362 HH11 ARG B 302 -33.976 -11.027 -17.039 1.00 0.00 H ATOM 11363 HH22 ARG B 302 -31.496 -13.552 -16.843 1.00 0.00 H ATOM 11364 HH21 ARG B 302 -30.685 -13.100 -18.387 1.00 0.00 H ATOM 11365 H ARG B 302 -33.606 -5.573 -18.267 1.00 0.00 H ATOM 11366 N ASP B 303 -31.326 -5.491 -20.782 1.00 16.26 N ATOM 11367 CA ASP B 303 -30.649 -4.990 -21.976 1.00 16.22 C ATOM 11368 C ASP B 303 -29.473 -4.142 -21.551 1.00 16.69 C ATOM 11369 O ASP B 303 -28.365 -4.330 -22.040 1.00 12.92 O ATOM 11370 CB ASP B 303 -31.609 -4.108 -22.790 1.00 13.50 C ATOM 11371 CG ASP B 303 -32.583 -4.896 -23.673 1.00 19.51 C ATOM 11372 OD1 ASP B 303 -32.241 -6.145 -23.970 1.00 28.88 O ATOM 11373 OD2 ASP B 303 -33.527 -4.313 -24.187 1.00 44.32 O ATOM 11374 HA ASP B 303 -30.319 -5.834 -22.582 1.00 0.00 H ATOM 11375 HB2 ASP B 303 -32.190 -3.501 -22.095 1.00 0.00 H ATOM 11376 HB3 ASP B 303 -31.016 -3.456 -23.431 1.00 0.00 H ATOM 11377 H ASP B 303 -32.337 -5.270 -20.683 1.00 0.00 H ATOM 11378 N TYR B 304 -29.751 -3.240 -20.629 1.00 16.44 N ATOM 11379 CA TYR B 304 -28.749 -2.352 -20.078 1.00 17.49 C ATOM 11380 C TYR B 304 -27.598 -3.130 -19.388 1.00 17.15 C ATOM 11381 O TYR B 304 -26.441 -2.782 -19.559 1.00 15.22 O ATOM 11382 CB TYR B 304 -29.457 -1.346 -19.140 1.00 21.31 C ATOM 11383 CG TYR B 304 -28.540 -0.263 -18.687 1.00 21.43 C ATOM 11384 CD1 TYR B 304 -28.393 0.892 -19.457 1.00 22.22 C ATOM 11385 CD2 TYR B 304 -27.825 -0.414 -17.499 1.00 29.11 C ATOM 11386 CE1 TYR B 304 -27.512 1.887 -19.028 1.00 17.35 C ATOM 11387 CE2 TYR B 304 -26.949 0.573 -17.055 1.00 22.25 C ATOM 11388 CZ TYR B 304 -26.804 1.722 -17.830 1.00 28.15 C ATOM 11389 OH TYR B 304 -25.938 2.679 -17.375 1.00 80.00 O ATOM 11390 HA TYR B 304 -28.262 -1.797 -20.879 1.00 0.00 H ATOM 11391 HB3 TYR B 304 -29.829 -1.881 -18.266 1.00 0.00 H ATOM 11392 HB2 TYR B 304 -30.295 -0.897 -19.673 1.00 0.00 H ATOM 11393 HD2 TYR B 304 -27.954 -1.321 -16.908 1.00 0.00 H ATOM 11394 HE2 TYR B 304 -26.392 0.450 -16.126 1.00 0.00 H ATOM 11395 HE1 TYR B 304 -27.375 2.790 -19.624 1.00 0.00 H ATOM 11396 HD1 TYR B 304 -28.958 1.016 -20.381 1.00 0.00 H ATOM 11397 HH TYR B 304 -26.236 2.996 -16.485 1.00 0.00 H ATOM 11398 H TYR B 304 -30.729 -3.164 -20.284 1.00 0.00 H ATOM 11399 N ILE B 305 -27.883 -4.196 -18.598 1.00 13.22 N ATOM 11400 CA ILE B 305 -26.850 -4.987 -17.936 1.00 9.29 C ATOM 11401 C ILE B 305 -25.997 -5.684 -18.978 1.00 15.16 C ATOM 11402 O ILE B 305 -24.762 -5.728 -18.922 1.00 13.05 O ATOM 11403 CB ILE B 305 -27.519 -5.974 -16.979 1.00 9.75 C ATOM 11404 CG1 ILE B 305 -28.129 -5.115 -15.856 1.00 7.87 C ATOM 11405 CG2 ILE B 305 -26.423 -6.902 -16.412 1.00 8.74 C ATOM 11406 CD1 ILE B 305 -29.435 -5.673 -15.320 1.00 11.91 C ATOM 11407 HA ILE B 305 -26.189 -4.347 -17.352 1.00 0.00 H ATOM 11408 HB ILE B 305 -28.283 -6.587 -17.458 1.00 0.00 H ATOM 11409 HG12 ILE B 305 -27.414 -5.058 -15.036 1.00 0.00 H ATOM 11410 HG13 ILE B 305 -28.314 -4.114 -16.246 1.00 0.00 H ATOM 11411 HD11 ILE B 305 -30.165 -5.727 -16.128 1.00 0.00 H ATOM 11412 HD12 ILE B 305 -29.264 -6.671 -14.916 1.00 0.00 H ATOM 11413 HD13 ILE B 305 -29.811 -5.021 -14.532 1.00 0.00 H ATOM 11414 HG21 ILE B 305 -25.942 -7.437 -17.231 1.00 0.00 H ATOM 11415 HG22 ILE B 305 -25.682 -6.305 -15.881 1.00 0.00 H ATOM 11416 HG23 ILE B 305 -26.874 -7.618 -15.725 1.00 0.00 H ATOM 11417 H ILE B 305 -28.879 -4.460 -18.458 1.00 0.00 H ATOM 11418 N TRP B 306 -26.675 -6.231 -19.990 1.00 12.81 N ATOM 11419 CA TRP B 306 -25.980 -6.920 -21.059 1.00 11.60 C ATOM 11420 C TRP B 306 -25.048 -6.005 -21.801 1.00 6.64 C ATOM 11421 O TRP B 306 -23.923 -6.387 -22.131 1.00 7.25 O ATOM 11422 CB TRP B 306 -26.899 -7.678 -22.034 1.00 15.90 C ATOM 11423 CG TRP B 306 -27.217 -9.054 -21.546 1.00 13.37 C ATOM 11424 CD1 TRP B 306 -28.440 -9.488 -21.113 1.00 19.71 C ATOM 11425 CD2 TRP B 306 -26.304 -10.136 -21.396 1.00 14.89 C ATOM 11426 NE1 TRP B 306 -28.351 -10.801 -20.727 1.00 23.82 N ATOM 11427 CE2 TRP B 306 -27.045 -11.212 -20.887 1.00 25.74 C ATOM 11428 CE3 TRP B 306 -24.952 -10.296 -21.649 1.00 19.95 C ATOM 11429 CZ2 TRP B 306 -26.433 -12.438 -20.632 1.00 19.88 C ATOM 11430 CZ3 TRP B 306 -24.346 -11.502 -21.403 1.00 23.33 C ATOM 11431 CH2 TRP B 306 -25.086 -12.567 -20.873 1.00 21.63 C ATOM 11432 HA TRP B 306 -25.390 -7.686 -20.555 1.00 0.00 H ATOM 11433 HB2 TRP B 306 -27.829 -7.121 -22.147 1.00 0.00 H ATOM 11434 HB3 TRP B 306 -26.402 -7.753 -23.001 1.00 0.00 H ATOM 11435 HE1 TRP B 306 -29.135 -11.386 -20.374 1.00 0.00 H ATOM 11436 HD1 TRP B 306 -29.346 -8.883 -21.080 1.00 0.00 H ATOM 11437 HZ2 TRP B 306 -27.012 -13.278 -20.249 1.00 0.00 H ATOM 11438 HH2 TRP B 306 -24.587 -13.510 -20.649 1.00 0.00 H ATOM 11439 HZ3 TRP B 306 -23.286 -11.632 -21.621 1.00 0.00 H ATOM 11440 HE3 TRP B 306 -24.369 -9.464 -22.044 1.00 0.00 H ATOM 11441 H TRP B 306 -27.712 -6.162 -20.011 1.00 0.00 H ATOM 11442 N ASN B 307 -25.493 -4.787 -22.052 1.00 6.19 N ATOM 11443 CA ASN B 307 -24.611 -3.862 -22.756 1.00 9.72 C ATOM 11444 C ASN B 307 -23.291 -3.660 -21.954 1.00 18.97 C ATOM 11445 O ASN B 307 -22.220 -3.622 -22.513 1.00 6.68 O ATOM 11446 CB ASN B 307 -25.320 -2.526 -22.991 1.00 11.93 C ATOM 11447 CG ASN B 307 -24.366 -1.542 -23.645 1.00 31.76 C ATOM 11448 OD1 ASN B 307 -23.759 -0.683 -22.963 1.00 24.17 O ATOM 11449 ND2 ASN B 307 -24.163 -1.701 -24.940 1.00 11.69 N ATOM 11450 HA ASN B 307 -24.357 -4.286 -23.727 1.00 0.00 H ATOM 11451 HB2 ASN B 307 -26.180 -2.683 -23.642 1.00 0.00 H ATOM 11452 HB3 ASN B 307 -25.657 -2.123 -22.036 1.00 0.00 H ATOM 11453 HD22 ASN B 307 -24.691 -2.428 -25.464 1.00 0.00 H ATOM 11454 HD21 ASN B 307 -23.475 -1.099 -25.436 1.00 0.00 H ATOM 11455 H ASN B 307 -26.446 -4.495 -21.756 1.00 0.00 H ATOM 11456 N THR B 308 -23.375 -3.537 -20.619 1.00 10.29 N ATOM 11457 CA THR B 308 -22.167 -3.366 -19.809 1.00 8.99 C ATOM 11458 C THR B 308 -21.298 -4.590 -19.955 1.00 6.30 C ATOM 11459 O THR B 308 -20.097 -4.489 -20.179 1.00 8.95 O ATOM 11460 CB THR B 308 -22.638 -3.223 -18.343 1.00 7.84 C ATOM 11461 OG1 THR B 308 -23.354 -2.021 -18.182 1.00 14.33 O ATOM 11462 CG2 THR B 308 -21.499 -3.323 -17.332 1.00 9.88 C ATOM 11463 HA THR B 308 -21.590 -2.495 -20.120 1.00 0.00 H ATOM 11464 HB THR B 308 -23.296 -4.067 -18.135 1.00 0.00 H ATOM 11465 HG1 THR B 308 -24.144 -2.026 -18.779 1.00 0.00 H ATOM 11466 HG23 THR B 308 -20.964 -4.261 -17.481 1.00 0.00 H ATOM 11467 HG21 THR B 308 -20.814 -2.487 -17.474 1.00 0.00 H ATOM 11468 HG22 THR B 308 -21.908 -3.292 -16.322 1.00 0.00 H ATOM 11469 H THR B 308 -24.306 -3.563 -20.157 1.00 0.00 H ATOM 11470 N LEU B 309 -21.908 -5.767 -19.801 1.00 3.74 N ATOM 11471 CA LEU B 309 -21.147 -6.997 -19.892 1.00 9.90 C ATOM 11472 C LEU B 309 -20.467 -7.178 -21.256 1.00 13.30 C ATOM 11473 O LEU B 309 -19.287 -7.595 -21.409 1.00 10.05 O ATOM 11474 CB LEU B 309 -22.017 -8.208 -19.547 1.00 8.59 C ATOM 11475 CG LEU B 309 -22.473 -8.221 -18.064 1.00 6.50 C ATOM 11476 CD1 LEU B 309 -23.479 -9.324 -17.861 1.00 9.58 C ATOM 11477 CD2 LEU B 309 -21.299 -8.522 -17.127 1.00 10.87 C ATOM 11478 HA LEU B 309 -20.348 -6.923 -19.154 1.00 0.00 H ATOM 11479 HB2 LEU B 309 -22.902 -8.193 -20.183 1.00 0.00 H ATOM 11480 HB3 LEU B 309 -21.445 -9.115 -19.743 1.00 0.00 H ATOM 11481 HG LEU B 309 -22.892 -7.240 -17.841 1.00 0.00 H ATOM 11482 HD21 LEU B 309 -20.881 -9.499 -17.372 1.00 0.00 H ATOM 11483 HD22 LEU B 309 -20.533 -7.757 -17.249 1.00 0.00 H ATOM 11484 HD23 LEU B 309 -21.651 -8.524 -16.095 1.00 0.00 H ATOM 11485 HD11 LEU B 309 -24.340 -9.152 -18.506 1.00 0.00 H ATOM 11486 HD12 LEU B 309 -23.022 -10.281 -18.111 1.00 0.00 H ATOM 11487 HD13 LEU B 309 -23.800 -9.334 -16.819 1.00 0.00 H ATOM 11488 H LEU B 309 -22.931 -5.802 -19.615 1.00 0.00 H ATOM 11489 N ASN B 310 -21.232 -6.842 -22.277 1.00 11.35 N ATOM 11490 CA ASN B 310 -20.695 -6.985 -23.608 1.00 14.62 C ATOM 11491 C ASN B 310 -19.603 -6.022 -23.980 1.00 14.36 C ATOM 11492 O ASN B 310 -18.880 -6.324 -24.924 1.00 15.18 O ATOM 11493 CB ASN B 310 -21.811 -6.913 -24.634 1.00 5.71 C ATOM 11494 CG ASN B 310 -22.715 -8.132 -24.590 1.00 25.93 C ATOM 11495 OD1 ASN B 310 -22.257 -9.211 -24.171 1.00 31.55 O ATOM 11496 ND2 ASN B 310 -23.980 -7.974 -25.018 1.00 36.49 N ATOM 11497 HA ASN B 310 -20.220 -7.966 -23.607 1.00 0.00 H ATOM 11498 HB2 ASN B 310 -22.411 -6.024 -24.438 1.00 0.00 H ATOM 11499 HB3 ASN B 310 -21.369 -6.840 -25.628 1.00 0.00 H ATOM 11500 HD22 ASN B 310 -24.302 -7.045 -25.357 1.00 0.00 H ATOM 11501 HD21 ASN B 310 -24.636 -8.781 -25.010 1.00 0.00 H ATOM 11502 H ASN B 310 -22.197 -6.484 -22.126 1.00 0.00 H ATOM 11503 N SER B 311 -19.496 -4.900 -23.267 1.00 8.38 N ATOM 11504 CA SER B 311 -18.513 -3.887 -23.505 1.00 9.95 C ATOM 11505 C SER B 311 -17.219 -4.120 -22.746 1.00 7.82 C ATOM 11506 O SER B 311 -16.396 -3.223 -22.732 1.00 10.01 O ATOM 11507 CB SER B 311 -19.102 -2.544 -23.075 1.00 11.19 C ATOM 11508 OG SER B 311 -20.122 -2.179 -23.984 1.00 14.86 O ATOM 11509 HA SER B 311 -18.267 -3.907 -24.567 1.00 0.00 H ATOM 11510 HB2 SER B 311 -18.321 -1.784 -23.077 1.00 0.00 H ATOM 11511 HB3 SER B 311 -19.520 -2.632 -22.072 1.00 0.00 H ATOM 11512 HG SER B 311 -20.829 -2.872 -23.980 1.00 0.00 H ATOM 11513 H SER B 311 -20.170 -4.752 -22.489 1.00 0.00 H ATOM 11514 N GLY B 312 -17.048 -5.295 -22.117 1.00 10.40 N ATOM 11515 CA GLY B 312 -15.813 -5.552 -21.374 1.00 14.95 C ATOM 11516 C GLY B 312 -15.665 -4.850 -20.010 1.00 8.45 C ATOM 11517 O GLY B 312 -14.528 -4.560 -19.543 1.00 17.29 O ATOM 11518 HA3 GLY B 312 -14.979 -5.236 -22.000 1.00 0.00 H ATOM 11519 HA2 GLY B 312 -15.749 -6.626 -21.201 1.00 0.00 H ATOM 11520 H GLY B 312 -17.792 -6.021 -22.158 1.00 0.00 H ATOM 11521 N ARG B 313 -16.833 -4.626 -19.360 1.00 5.05 N ATOM 11522 CA ARG B 313 -16.881 -3.971 -18.044 1.00 5.78 C ATOM 11523 C ARG B 313 -17.562 -4.833 -16.958 1.00 14.19 C ATOM 11524 O ARG B 313 -18.248 -5.805 -17.227 1.00 15.56 O ATOM 11525 CB ARG B 313 -17.668 -2.680 -18.098 1.00 10.48 C ATOM 11526 CG ARG B 313 -17.285 -1.785 -19.257 1.00 14.48 C ATOM 11527 CD ARG B 313 -18.332 -0.732 -19.537 1.00 18.27 C ATOM 11528 NE ARG B 313 -17.955 -0.013 -20.758 1.00 18.31 N ATOM 11529 CZ ARG B 313 -18.830 0.588 -21.581 1.00 21.90 C ATOM 11530 NH1 ARG B 313 -20.140 0.556 -21.282 1.00 18.17 N ATOM 11531 NH2 ARG B 313 -18.396 1.232 -22.706 1.00 22.13 N ATOM 11532 HA ARG B 313 -15.835 -3.802 -17.788 1.00 0.00 H ATOM 11533 HB2 ARG B 313 -18.726 -2.925 -18.186 1.00 0.00 H ATOM 11534 HB3 ARG B 313 -17.499 -2.134 -17.170 1.00 0.00 H ATOM 11535 HG2 ARG B 313 -16.343 -1.290 -19.022 1.00 0.00 H ATOM 11536 HG3 ARG B 313 -17.158 -2.400 -20.148 1.00 0.00 H ATOM 11537 HD2 ARG B 313 -18.385 -0.035 -18.701 1.00 0.00 H ATOM 11538 HD3 ARG B 313 -19.303 -1.207 -19.675 1.00 0.00 H ATOM 11539 HE ARG B 313 -16.945 0.035 -21.003 1.00 0.00 H ATOM 11540 HH12 ARG B 313 -20.828 1.017 -21.911 1.00 0.00 H ATOM 11541 HH11 ARG B 313 -20.465 0.070 -20.422 1.00 0.00 H ATOM 11542 HH22 ARG B 313 -19.081 1.695 -23.337 1.00 0.00 H ATOM 11543 HH21 ARG B 313 -17.381 1.259 -22.931 1.00 0.00 H ATOM 11544 H ARG B 313 -17.723 -4.927 -19.806 1.00 0.00 H ATOM 11545 N VAL B 314 -17.407 -4.472 -15.686 1.00 8.47 N ATOM 11546 CA VAL B 314 -18.085 -5.288 -14.684 1.00 7.61 C ATOM 11547 C VAL B 314 -19.349 -4.552 -14.259 1.00 14.32 C ATOM 11548 O VAL B 314 -19.486 -3.357 -14.474 1.00 9.93 O ATOM 11549 CB VAL B 314 -17.188 -5.495 -13.435 1.00 8.90 C ATOM 11550 CG1 VAL B 314 -15.912 -6.266 -13.776 1.00 6.43 C ATOM 11551 CG2 VAL B 314 -16.846 -4.175 -12.748 1.00 6.21 C ATOM 11552 HA VAL B 314 -18.314 -6.265 -15.111 1.00 0.00 H ATOM 11553 HB VAL B 314 -17.770 -6.094 -12.734 1.00 0.00 H ATOM 11554 HG11 VAL B 314 -16.176 -7.245 -14.175 1.00 0.00 H ATOM 11555 HG12 VAL B 314 -15.341 -5.711 -14.520 1.00 0.00 H ATOM 11556 HG13 VAL B 314 -15.312 -6.390 -12.875 1.00 0.00 H ATOM 11557 HG21 VAL B 314 -16.312 -3.531 -13.447 1.00 0.00 H ATOM 11558 HG22 VAL B 314 -17.765 -3.684 -12.429 1.00 0.00 H ATOM 11559 HG23 VAL B 314 -16.217 -4.371 -11.880 1.00 0.00 H ATOM 11560 H VAL B 314 -16.831 -3.648 -15.419 1.00 0.00 H ATOM 11561 N VAL B 315 -20.272 -5.275 -13.641 1.00 10.62 N ATOM 11562 CA VAL B 315 -21.492 -4.664 -13.155 1.00 8.18 C ATOM 11563 C VAL B 315 -21.065 -4.392 -11.696 1.00 8.55 C ATOM 11564 O VAL B 315 -20.796 -5.328 -10.955 1.00 11.16 O ATOM 11565 CB VAL B 315 -22.657 -5.660 -13.216 1.00 14.07 C ATOM 11566 CG1 VAL B 315 -23.789 -5.111 -12.364 1.00 12.98 C ATOM 11567 CG2 VAL B 315 -23.072 -5.891 -14.684 1.00 11.63 C ATOM 11568 HA VAL B 315 -21.842 -3.793 -13.709 1.00 0.00 H ATOM 11569 HB VAL B 315 -22.369 -6.634 -12.819 1.00 0.00 H ATOM 11570 HG11 VAL B 315 -23.445 -4.995 -11.336 1.00 0.00 H ATOM 11571 HG12 VAL B 315 -24.100 -4.142 -12.756 1.00 0.00 H ATOM 11572 HG13 VAL B 315 -24.631 -5.803 -12.391 1.00 0.00 H ATOM 11573 HG21 VAL B 315 -23.383 -4.944 -15.125 1.00 0.00 H ATOM 11574 HG22 VAL B 315 -22.225 -6.292 -15.241 1.00 0.00 H ATOM 11575 HG23 VAL B 315 -23.900 -6.599 -14.719 1.00 0.00 H ATOM 11576 H VAL B 315 -20.118 -6.294 -13.503 1.00 0.00 H ATOM 11577 N PRO B 316 -20.965 -3.112 -11.286 1.00 9.02 N ATOM 11578 CA PRO B 316 -20.509 -2.797 -9.921 1.00 9.31 C ATOM 11579 C PRO B 316 -21.484 -3.197 -8.814 1.00 9.75 C ATOM 11580 O PRO B 316 -22.694 -3.095 -8.933 1.00 7.98 O ATOM 11581 CB PRO B 316 -20.283 -1.235 -9.884 1.00 11.21 C ATOM 11582 CG PRO B 316 -21.029 -0.645 -11.058 1.00 11.57 C ATOM 11583 CD PRO B 316 -21.469 -1.833 -11.912 1.00 10.38 C ATOM 11584 HA PRO B 316 -19.606 -3.374 -9.720 1.00 0.00 H ATOM 11585 HD3 PRO B 316 -22.557 -1.859 -11.967 1.00 0.00 H ATOM 11586 HD2 PRO B 316 -21.058 -1.732 -12.916 1.00 0.00 H ATOM 11587 HG3 PRO B 316 -20.376 0.013 -11.631 1.00 0.00 H ATOM 11588 HG2 PRO B 316 -21.897 -0.083 -10.713 1.00 0.00 H ATOM 11589 HB2 PRO B 316 -20.669 -0.824 -8.951 1.00 0.00 H ATOM 11590 HB3 PRO B 316 -19.220 -1.010 -9.966 1.00 0.00 H ATOM 11591 N GLY B 317 -20.950 -3.631 -7.699 1.00 5.25 N ATOM 11592 CA GLY B 317 -21.806 -3.974 -6.607 1.00 3.00 C ATOM 11593 C GLY B 317 -22.262 -5.411 -6.496 1.00 9.99 C ATOM 11594 O GLY B 317 -22.976 -5.692 -5.580 1.00 5.45 O ATOM 11595 HA3 GLY B 317 -22.699 -3.354 -6.686 1.00 0.00 H ATOM 11596 HA2 GLY B 317 -21.275 -3.729 -5.687 1.00 0.00 H ATOM 11597 H GLY B 317 -19.918 -3.725 -7.610 1.00 0.00 H ATOM 11598 N TYR B 318 -21.878 -6.276 -7.436 1.00 5.18 N ATOM 11599 CA TYR B 318 -22.237 -7.700 -7.495 1.00 11.94 C ATOM 11600 C TYR B 318 -20.948 -8.526 -7.529 1.00 13.29 C ATOM 11601 O TYR B 318 -19.945 -8.023 -8.043 1.00 6.80 O ATOM 11602 CB TYR B 318 -23.113 -7.966 -8.773 1.00 6.51 C ATOM 11603 CG TYR B 318 -24.529 -7.486 -8.439 1.00 12.66 C ATOM 11604 CD1 TYR B 318 -24.892 -6.131 -8.474 1.00 12.94 C ATOM 11605 CD2 TYR B 318 -25.487 -8.416 -8.046 1.00 10.69 C ATOM 11606 CE1 TYR B 318 -26.177 -5.696 -8.124 1.00 11.20 C ATOM 11607 CE2 TYR B 318 -26.773 -8.011 -7.697 1.00 5.38 C ATOM 11608 CZ TYR B 318 -27.109 -6.661 -7.746 1.00 16.72 C ATOM 11609 OH TYR B 318 -28.387 -6.324 -7.409 1.00 28.21 O ATOM 11610 HA TYR B 318 -22.819 -7.987 -6.619 1.00 0.00 H ATOM 11611 HB3 TYR B 318 -23.122 -9.030 -9.009 1.00 0.00 H ATOM 11612 HB2 TYR B 318 -22.718 -7.410 -9.623 1.00 0.00 H ATOM 11613 HD2 TYR B 318 -25.228 -9.474 -8.011 1.00 0.00 H ATOM 11614 HE2 TYR B 318 -27.513 -8.748 -7.387 1.00 0.00 H ATOM 11615 HE1 TYR B 318 -26.439 -4.638 -8.147 1.00 0.00 H ATOM 11616 HD1 TYR B 318 -24.151 -5.394 -8.783 1.00 0.00 H ATOM 11617 HH TYR B 318 -28.499 -5.343 -7.483 1.00 0.00 H ATOM 11618 H TYR B 318 -21.270 -5.910 -8.196 1.00 0.00 H ATOM 11619 N GLY B 319 -20.997 -9.738 -6.972 1.00 7.58 N ATOM 11620 CA GLY B 319 -19.851 -10.606 -6.944 1.00 6.85 C ATOM 11621 C GLY B 319 -18.981 -10.372 -5.690 1.00 10.15 C ATOM 11622 O GLY B 319 -19.111 -9.383 -4.945 1.00 10.12 O ATOM 11623 HA3 GLY B 319 -19.247 -10.421 -7.832 1.00 0.00 H ATOM 11624 HA2 GLY B 319 -20.193 -11.641 -6.948 1.00 0.00 H ATOM 11625 H GLY B 319 -21.888 -10.063 -6.547 1.00 0.00 H ATOM 11626 N HIS B 320 -18.095 -11.333 -5.463 1.00 6.74 N ATOM 11627 CA HIS B 320 -17.194 -11.297 -4.317 1.00 3.18 C ATOM 11628 C HIS B 320 -16.065 -12.307 -4.423 1.00 5.31 C ATOM 11629 O HIS B 320 -16.209 -13.391 -4.995 1.00 6.08 O ATOM 11630 CB HIS B 320 -17.941 -11.462 -2.960 1.00 4.05 C ATOM 11631 CG HIS B 320 -17.230 -10.818 -1.809 1.00 5.70 C ATOM 11632 ND1 HIS B 320 -16.384 -11.570 -0.968 1.00 7.32 N ATOM 11633 CD2 HIS B 320 -17.219 -9.516 -1.375 1.00 7.08 C ATOM 11634 CE1 HIS B 320 -15.918 -10.719 -0.042 1.00 6.73 C ATOM 11635 NE2 HIS B 320 -16.412 -9.492 -0.250 1.00 8.69 N ATOM 11636 HA HIS B 320 -16.751 -10.301 -4.336 1.00 0.00 H ATOM 11637 HB2 HIS B 320 -18.929 -11.012 -3.052 1.00 0.00 H ATOM 11638 HB3 HIS B 320 -18.046 -12.526 -2.750 1.00 0.00 H ATOM 11639 HD2 HIS B 320 -17.740 -8.671 -1.825 1.00 0.00 H ATOM 11640 HE1 HIS B 320 -15.235 -10.988 0.764 1.00 0.00 H ATOM 11641 H HIS B 320 -18.041 -12.136 -6.122 1.00 0.00 H ATOM 11642 N ALA B 321 -14.896 -12.009 -3.859 1.00 6.87 N ATOM 11643 CA ALA B 321 -13.828 -12.972 -3.960 1.00 6.29 C ATOM 11644 C ALA B 321 -14.075 -14.178 -3.063 1.00 14.75 C ATOM 11645 O ALA B 321 -13.643 -15.269 -3.354 1.00 14.04 O ATOM 11646 CB ALA B 321 -12.542 -12.335 -3.510 1.00 3.37 C ATOM 11647 HA ALA B 321 -13.776 -13.297 -4.999 1.00 0.00 H ATOM 11648 HB1 ALA B 321 -12.322 -11.476 -4.144 1.00 0.00 H ATOM 11649 HB2 ALA B 321 -12.643 -12.007 -2.475 1.00 0.00 H ATOM 11650 HB3 ALA B 321 -11.733 -13.061 -3.585 1.00 0.00 H ATOM 11651 H ALA B 321 -14.757 -11.107 -3.360 1.00 0.00 H ATOM 11652 N VAL B 322 -14.801 -14.005 -1.989 1.00 9.85 N ATOM 11653 CA VAL B 322 -15.053 -15.094 -1.057 1.00 3.51 C ATOM 11654 C VAL B 322 -16.508 -15.429 -0.766 1.00 3.40 C ATOM 11655 O VAL B 322 -16.874 -16.624 -0.676 1.00 10.85 O ATOM 11656 CB VAL B 322 -14.403 -14.613 0.249 1.00 6.25 C ATOM 11657 CG1 VAL B 322 -14.659 -15.572 1.417 1.00 14.10 C ATOM 11658 CG2 VAL B 322 -12.884 -14.365 0.095 1.00 7.39 C ATOM 11659 HA VAL B 322 -14.660 -16.012 -1.495 1.00 0.00 H ATOM 11660 HB VAL B 322 -14.882 -13.661 0.479 1.00 0.00 H ATOM 11661 HG11 VAL B 322 -15.732 -15.658 1.586 1.00 0.00 H ATOM 11662 HG12 VAL B 322 -14.248 -16.553 1.177 1.00 0.00 H ATOM 11663 HG13 VAL B 322 -14.178 -15.185 2.315 1.00 0.00 H ATOM 11664 HG21 VAL B 322 -12.394 -15.292 -0.204 1.00 0.00 H ATOM 11665 HG22 VAL B 322 -12.717 -13.602 -0.666 1.00 0.00 H ATOM 11666 HG23 VAL B 322 -12.474 -14.027 1.047 1.00 0.00 H ATOM 11667 H VAL B 322 -15.208 -13.067 -1.796 1.00 0.00 H ATOM 11668 N LEU B 323 -17.335 -14.419 -0.610 1.00 10.38 N ATOM 11669 CA LEU B 323 -18.738 -14.652 -0.364 1.00 6.17 C ATOM 11670 C LEU B 323 -19.328 -15.402 -1.568 1.00 11.85 C ATOM 11671 O LEU B 323 -18.952 -15.176 -2.718 1.00 8.14 O ATOM 11672 CB LEU B 323 -19.503 -13.327 -0.164 1.00 6.15 C ATOM 11673 CG LEU B 323 -19.506 -12.834 1.287 1.00 8.83 C ATOM 11674 CD1 LEU B 323 -19.914 -11.368 1.345 1.00 10.08 C ATOM 11675 CD2 LEU B 323 -20.539 -13.622 2.074 1.00 14.16 C ATOM 11676 HA LEU B 323 -18.840 -15.240 0.548 1.00 0.00 H ATOM 11677 HB2 LEU B 323 -19.038 -12.563 -0.787 1.00 0.00 H ATOM 11678 HB3 LEU B 323 -20.536 -13.474 -0.481 1.00 0.00 H ATOM 11679 HG LEU B 323 -18.506 -12.963 1.700 1.00 0.00 H ATOM 11680 HD21 LEU B 323 -21.524 -13.471 1.632 1.00 0.00 H ATOM 11681 HD22 LEU B 323 -20.285 -14.682 2.045 1.00 0.00 H ATOM 11682 HD23 LEU B 323 -20.547 -13.277 3.108 1.00 0.00 H ATOM 11683 HD11 LEU B 323 -19.207 -10.772 0.767 1.00 0.00 H ATOM 11684 HD12 LEU B 323 -20.914 -11.254 0.927 1.00 0.00 H ATOM 11685 HD13 LEU B 323 -19.911 -11.032 2.382 1.00 0.00 H ATOM 11686 H LEU B 323 -16.976 -13.445 -0.664 1.00 0.00 H ATOM 11687 N ARG B 324 -20.220 -16.348 -1.246 1.00 10.96 N ATOM 11688 CA ARG B 324 -20.915 -17.175 -2.230 1.00 11.05 C ATOM 11689 C ARG B 324 -22.420 -16.996 -2.193 1.00 6.34 C ATOM 11690 O ARG B 324 -23.139 -17.618 -2.972 1.00 13.83 O ATOM 11691 CB ARG B 324 -20.543 -18.660 -2.130 1.00 15.21 C ATOM 11692 CG ARG B 324 -19.085 -18.886 -2.515 1.00 27.97 C ATOM 11693 CD ARG B 324 -18.715 -18.190 -3.809 1.00 20.78 C ATOM 11694 NE ARG B 324 -17.341 -18.421 -4.287 1.00 55.29 N ATOM 11695 CZ ARG B 324 -16.541 -17.427 -4.711 1.00 36.59 C ATOM 11696 NH1 ARG B 324 -16.955 -16.166 -4.706 1.00 12.72 N ATOM 11697 NH2 ARG B 324 -15.295 -17.702 -5.142 1.00 25.09 N ATOM 11698 HA ARG B 324 -20.567 -16.815 -3.198 1.00 0.00 H ATOM 11699 HB2 ARG B 324 -20.698 -18.998 -1.105 1.00 0.00 H ATOM 11700 HB3 ARG B 324 -21.182 -19.234 -2.801 1.00 0.00 H ATOM 11701 HG2 ARG B 324 -18.449 -18.504 -1.717 1.00 0.00 H ATOM 11702 HG3 ARG B 324 -18.915 -19.956 -2.632 1.00 0.00 H ATOM 11703 HD2 ARG B 324 -18.843 -17.118 -3.662 1.00 0.00 H ATOM 11704 HD3 ARG B 324 -19.402 -18.534 -4.583 1.00 0.00 H ATOM 11705 HE ARG B 324 -16.974 -19.394 -4.297 1.00 0.00 H ATOM 11706 HH12 ARG B 324 -16.323 -15.410 -5.038 1.00 0.00 H ATOM 11707 HH11 ARG B 324 -17.912 -15.934 -4.371 1.00 0.00 H ATOM 11708 HH22 ARG B 324 -14.677 -16.933 -5.470 1.00 0.00 H ATOM 11709 HH21 ARG B 324 -14.951 -18.684 -5.147 1.00 0.00 H ATOM 11710 H ARG B 324 -20.430 -16.503 -0.239 1.00 0.00 H ATOM 11711 N LYS B 325 -22.886 -16.119 -1.302 1.00 3.00 N ATOM 11712 CA LYS B 325 -24.267 -15.812 -1.140 1.00 5.27 C ATOM 11713 C LYS B 325 -24.374 -14.297 -0.906 1.00 11.83 C ATOM 11714 O LYS B 325 -23.372 -13.611 -0.755 1.00 9.63 O ATOM 11715 CB LYS B 325 -24.781 -16.403 0.160 1.00 5.37 C ATOM 11716 CG LYS B 325 -24.505 -17.869 0.330 1.00 18.85 C ATOM 11717 CD LYS B 325 -25.593 -18.648 -0.364 1.00 28.59 C ATOM 11718 CE LYS B 325 -25.488 -20.119 0.014 1.00 44.63 C ATOM 11719 NZ LYS B 325 -24.799 -20.864 -1.039 1.00 40.85 N ATOM 11720 HA LYS B 325 -24.812 -16.182 -2.009 1.00 0.00 H ATOM 11721 HB2 LYS B 325 -24.311 -15.870 0.986 1.00 0.00 H ATOM 11722 HB3 LYS B 325 -25.860 -16.253 0.200 1.00 0.00 H ATOM 11723 HG2 LYS B 325 -23.539 -18.114 -0.111 1.00 0.00 H ATOM 11724 HG3 LYS B 325 -24.493 -18.120 1.391 1.00 0.00 H ATOM 11725 HD2 LYS B 325 -26.566 -18.263 -0.059 1.00 0.00 H ATOM 11726 HD3 LYS B 325 -25.484 -18.542 -1.443 1.00 0.00 H ATOM 11727 HE2 LYS B 325 -26.489 -20.529 0.149 1.00 0.00 H ATOM 11728 HE3 LYS B 325 -24.930 -20.213 0.946 1.00 0.00 H ATOM 11729 HZ1 LYS B 325 -25.332 -20.778 -1.928 1.00 0.00 H ATOM 11730 HZ2 LYS B 325 -23.843 -20.476 -1.167 1.00 0.00 H ATOM 11731 HZ3 LYS B 325 -24.735 -21.866 -0.768 1.00 0.00 H ATOM 11732 H LYS B 325 -22.201 -15.631 -0.690 1.00 0.00 H ATOM 11733 N THR B 326 -25.600 -13.763 -0.867 1.00 10.75 N ATOM 11734 CA THR B 326 -25.839 -12.361 -0.648 1.00 14.49 C ATOM 11735 C THR B 326 -25.149 -11.883 0.637 1.00 13.32 C ATOM 11736 O THR B 326 -25.317 -12.466 1.744 1.00 9.54 O ATOM 11737 CB THR B 326 -27.334 -12.155 -0.518 1.00 11.61 C ATOM 11738 OG1 THR B 326 -27.934 -12.456 -1.773 1.00 12.41 O ATOM 11739 CG2 THR B 326 -27.628 -10.700 -0.243 1.00 4.16 C ATOM 11740 HA THR B 326 -25.436 -11.789 -1.484 1.00 0.00 H ATOM 11741 HB THR B 326 -27.713 -12.786 0.286 1.00 0.00 H ATOM 11742 HG1 THR B 326 -28.913 -12.327 -1.709 1.00 0.00 H ATOM 11743 HG23 THR B 326 -27.188 -10.416 0.713 1.00 0.00 H ATOM 11744 HG21 THR B 326 -27.201 -10.088 -1.037 1.00 0.00 H ATOM 11745 HG22 THR B 326 -28.707 -10.549 -0.207 1.00 0.00 H ATOM 11746 H THR B 326 -26.419 -14.390 -1.001 1.00 0.00 H ATOM 11747 N ASP B 327 -24.398 -10.785 0.469 1.00 5.05 N ATOM 11748 CA ASP B 327 -23.663 -10.171 1.587 1.00 9.02 C ATOM 11749 C ASP B 327 -24.647 -9.726 2.698 1.00 12.58 C ATOM 11750 O ASP B 327 -25.526 -8.942 2.413 1.00 8.91 O ATOM 11751 CB ASP B 327 -22.924 -8.934 1.044 1.00 5.35 C ATOM 11752 CG ASP B 327 -21.820 -8.320 1.873 1.00 6.48 C ATOM 11753 OD1 ASP B 327 -21.845 -8.520 3.151 1.00 3.99 O ATOM 11754 OD2 ASP B 327 -20.965 -7.653 1.394 1.00 8.17 O ATOM 11755 HA ASP B 327 -22.963 -10.892 2.010 1.00 0.00 H ATOM 11756 HB2 ASP B 327 -22.486 -9.217 0.087 1.00 0.00 H ATOM 11757 HB3 ASP B 327 -23.673 -8.158 0.884 1.00 0.00 H ATOM 11758 H ASP B 327 -24.333 -10.356 -0.476 1.00 0.00 H ATOM 11759 N PRO B 328 -24.480 -10.188 3.978 1.00 5.21 N ATOM 11760 CA PRO B 328 -25.352 -9.771 5.059 1.00 8.13 C ATOM 11761 C PRO B 328 -25.240 -8.241 5.241 1.00 4.98 C ATOM 11762 O PRO B 328 -26.160 -7.647 5.753 1.00 8.87 O ATOM 11763 CB PRO B 328 -24.924 -10.500 6.295 1.00 10.21 C ATOM 11764 CG PRO B 328 -23.585 -11.135 5.934 1.00 13.05 C ATOM 11765 CD PRO B 328 -23.574 -11.255 4.401 1.00 5.99 C ATOM 11766 HA PRO B 328 -26.395 -10.006 4.844 1.00 0.00 H ATOM 11767 HD3 PRO B 328 -22.571 -11.098 4.003 1.00 0.00 H ATOM 11768 HD2 PRO B 328 -23.942 -12.230 4.082 1.00 0.00 H ATOM 11769 HG3 PRO B 328 -23.497 -12.120 6.392 1.00 0.00 H ATOM 11770 HG2 PRO B 328 -22.763 -10.504 6.271 1.00 0.00 H ATOM 11771 HB2 PRO B 328 -24.808 -9.807 7.128 1.00 0.00 H ATOM 11772 HB3 PRO B 328 -25.653 -11.266 6.560 1.00 0.00 H ATOM 11773 N ARG B 329 -24.150 -7.591 4.849 1.00 4.20 N ATOM 11774 CA ARG B 329 -24.053 -6.135 4.973 1.00 5.52 C ATOM 11775 C ARG B 329 -25.041 -5.559 3.967 1.00 7.06 C ATOM 11776 O ARG B 329 -25.565 -4.460 4.178 1.00 7.67 O ATOM 11777 CB ARG B 329 -22.641 -5.656 4.582 1.00 3.00 C ATOM 11778 CG ARG B 329 -21.672 -6.115 5.671 1.00 4.01 C ATOM 11779 CD ARG B 329 -20.209 -5.799 5.336 1.00 3.00 C ATOM 11780 NE ARG B 329 -19.870 -6.443 4.040 1.00 6.62 N ATOM 11781 CZ ARG B 329 -18.724 -6.221 3.381 1.00 4.97 C ATOM 11782 NH1 ARG B 329 -17.770 -5.430 3.877 1.00 7.50 N ATOM 11783 NH2 ARG B 329 -18.456 -6.818 2.210 1.00 3.00 N ATOM 11784 HA ARG B 329 -24.259 -5.822 5.997 1.00 0.00 H ATOM 11785 HB2 ARG B 329 -22.354 -6.090 3.624 1.00 0.00 H ATOM 11786 HB3 ARG B 329 -22.626 -4.569 4.506 1.00 0.00 H ATOM 11787 HG2 ARG B 329 -21.932 -5.614 6.603 1.00 0.00 H ATOM 11788 HG3 ARG B 329 -21.776 -7.193 5.798 1.00 0.00 H ATOM 11789 HD2 ARG B 329 -19.560 -6.188 6.121 1.00 0.00 H ATOM 11790 HD3 ARG B 329 -20.075 -4.720 5.257 1.00 0.00 H ATOM 11791 HE ARG B 329 -20.559 -7.101 3.622 1.00 0.00 H ATOM 11792 HH12 ARG B 329 -16.891 -5.277 3.342 1.00 0.00 H ATOM 11793 HH11 ARG B 329 -17.905 -4.967 4.798 1.00 0.00 H ATOM 11794 HH22 ARG B 329 -17.558 -6.626 1.722 1.00 0.00 H ATOM 11795 HH21 ARG B 329 -19.146 -7.473 1.790 1.00 0.00 H ATOM 11796 H ARG B 329 -23.353 -8.125 4.448 1.00 0.00 H ATOM 11797 N TYR B 330 -25.318 -6.277 2.843 1.00 6.09 N ATOM 11798 CA TYR B 330 -26.291 -5.747 1.868 1.00 5.59 C ATOM 11799 C TYR B 330 -27.697 -5.844 2.527 1.00 3.39 C ATOM 11800 O TYR B 330 -28.475 -4.895 2.552 1.00 9.89 O ATOM 11801 CB TYR B 330 -26.225 -6.574 0.549 1.00 6.32 C ATOM 11802 CG TYR B 330 -27.285 -6.241 -0.489 1.00 11.88 C ATOM 11803 CD1 TYR B 330 -27.065 -5.257 -1.453 1.00 8.77 C ATOM 11804 CD2 TYR B 330 -28.515 -6.902 -0.520 1.00 15.02 C ATOM 11805 CE1 TYR B 330 -28.020 -4.928 -2.421 1.00 9.72 C ATOM 11806 CE2 TYR B 330 -29.495 -6.591 -1.466 1.00 9.28 C ATOM 11807 CZ TYR B 330 -29.249 -5.599 -2.419 1.00 10.14 C ATOM 11808 OH TYR B 330 -30.253 -5.361 -3.351 1.00 15.92 O ATOM 11809 HA TYR B 330 -26.071 -4.711 1.609 1.00 0.00 H ATOM 11810 HB3 TYR B 330 -26.328 -7.628 0.808 1.00 0.00 H ATOM 11811 HB2 TYR B 330 -25.248 -6.406 0.096 1.00 0.00 H ATOM 11812 HD2 TYR B 330 -28.716 -7.682 0.214 1.00 0.00 H ATOM 11813 HE2 TYR B 330 -30.448 -7.120 -1.461 1.00 0.00 H ATOM 11814 HE1 TYR B 330 -27.810 -4.160 -3.166 1.00 0.00 H ATOM 11815 HD1 TYR B 330 -26.114 -4.725 -1.452 1.00 0.00 H ATOM 11816 HH TYR B 330 -31.079 -5.082 -2.881 1.00 0.00 H ATOM 11817 H TYR B 330 -24.849 -7.189 2.674 1.00 0.00 H ATOM 11818 N THR B 331 -28.012 -6.997 3.090 1.00 6.76 N ATOM 11819 CA THR B 331 -29.273 -7.233 3.731 1.00 6.69 C ATOM 11820 C THR B 331 -29.512 -6.277 4.866 1.00 10.36 C ATOM 11821 O THR B 331 -30.599 -5.752 5.090 1.00 13.16 O ATOM 11822 CB THR B 331 -29.170 -8.618 4.330 1.00 19.80 C ATOM 11823 OG1 THR B 331 -29.078 -9.578 3.296 1.00 14.49 O ATOM 11824 CG2 THR B 331 -30.411 -8.827 5.191 1.00 26.80 C ATOM 11825 HA THR B 331 -30.081 -7.115 3.009 1.00 0.00 H ATOM 11826 HB THR B 331 -28.277 -8.727 4.945 1.00 0.00 H ATOM 11827 HG1 THR B 331 -29.886 -9.525 2.726 1.00 0.00 H ATOM 11828 HG23 THR B 331 -30.442 -8.068 5.972 1.00 0.00 H ATOM 11829 HG21 THR B 331 -31.302 -8.745 4.568 1.00 0.00 H ATOM 11830 HG22 THR B 331 -30.374 -9.817 5.646 1.00 0.00 H ATOM 11831 H THR B 331 -27.314 -7.768 3.067 1.00 0.00 H ATOM 11832 N CYS B 332 -28.482 -6.019 5.652 1.00 8.95 N ATOM 11833 CA CYS B 332 -28.627 -5.089 6.778 1.00 9.75 C ATOM 11834 C CYS B 332 -28.998 -3.671 6.274 1.00 15.83 C ATOM 11835 O CYS B 332 -29.803 -2.903 6.851 1.00 10.62 O ATOM 11836 CB CYS B 332 -27.357 -5.224 7.664 1.00 13.74 C ATOM 11837 SG CYS B 332 -27.243 -3.835 8.759 1.00 28.55 S ATOM 11838 HA CYS B 332 -29.468 -5.331 7.428 1.00 0.00 H ATOM 11839 HB2 CYS B 332 -26.473 -5.258 7.028 1.00 0.00 H ATOM 11840 HB3 CYS B 332 -27.418 -6.142 8.248 1.00 0.00 H ATOM 11841 HG CYS B 332 -26.114 -3.961 9.543 1.00 0.00 H ATOM 11842 H CYS B 332 -27.565 -6.476 5.472 1.00 0.00 H ATOM 11843 N GLN B 333 -28.452 -3.311 5.142 1.00 7.44 N ATOM 11844 CA GLN B 333 -28.743 -2.001 4.532 1.00 6.06 C ATOM 11845 C GLN B 333 -30.145 -1.965 3.966 1.00 10.14 C ATOM 11846 O GLN B 333 -30.831 -0.981 4.154 1.00 8.32 O ATOM 11847 CB GLN B 333 -27.712 -1.586 3.473 1.00 4.94 C ATOM 11848 CG GLN B 333 -26.401 -1.153 4.175 1.00 7.71 C ATOM 11849 CD GLN B 333 -25.264 -0.895 3.215 1.00 12.61 C ATOM 11850 OE1 GLN B 333 -24.801 0.253 3.187 1.00 19.32 O ATOM 11851 NE2 GLN B 333 -24.884 -1.932 2.390 1.00 8.43 N ATOM 11852 HA GLN B 333 -28.671 -1.267 5.335 1.00 0.00 H ATOM 11853 HB2 GLN B 333 -27.510 -2.429 2.812 1.00 0.00 H ATOM 11854 HB3 GLN B 333 -28.105 -0.753 2.889 1.00 0.00 H ATOM 11855 HG2 GLN B 333 -26.595 -0.238 4.736 1.00 0.00 H ATOM 11856 HG3 GLN B 333 -26.100 -1.943 4.863 1.00 0.00 H ATOM 11857 HE22 GLN B 333 -25.332 -2.866 2.488 1.00 0.00 H ATOM 11858 HE21 GLN B 333 -24.150 -1.781 1.669 1.00 0.00 H ATOM 11859 H GLN B 333 -27.799 -3.962 4.662 1.00 0.00 H ATOM 11860 N ARG B 334 -30.592 -3.023 3.322 1.00 4.40 N ATOM 11861 CA ARG B 334 -31.945 -3.147 2.748 1.00 3.97 C ATOM 11862 C ARG B 334 -32.976 -3.000 3.859 1.00 12.51 C ATOM 11863 O ARG B 334 -34.011 -2.344 3.801 1.00 10.90 O ATOM 11864 CB ARG B 334 -32.110 -4.590 2.264 1.00 14.91 C ATOM 11865 CG ARG B 334 -33.411 -4.855 1.508 1.00 17.00 C ATOM 11866 CD ARG B 334 -33.441 -6.239 0.847 1.00 28.42 C ATOM 11867 NE ARG B 334 -34.788 -6.756 0.586 1.00 22.10 N ATOM 11868 CZ ARG B 334 -35.478 -6.540 -0.546 1.00 56.05 C ATOM 11869 NH1 ARG B 334 -34.995 -5.818 -1.578 1.00 26.51 N ATOM 11870 NH2 ARG B 334 -36.695 -7.088 -0.628 1.00 46.49 N ATOM 11871 HA ARG B 334 -32.075 -2.402 1.963 1.00 0.00 H ATOM 11872 HB2 ARG B 334 -31.276 -4.826 1.603 1.00 0.00 H ATOM 11873 HB3 ARG B 334 -32.080 -5.247 3.133 1.00 0.00 H ATOM 11874 HG2 ARG B 334 -34.242 -4.785 2.209 1.00 0.00 H ATOM 11875 HG3 ARG B 334 -33.526 -4.096 0.734 1.00 0.00 H ATOM 11876 HD2 ARG B 334 -32.927 -6.942 1.503 1.00 0.00 H ATOM 11877 HD3 ARG B 334 -32.910 -6.175 -0.103 1.00 0.00 H ATOM 11878 HE ARG B 334 -35.240 -7.329 1.327 1.00 0.00 H ATOM 11879 HH12 ARG B 334 -35.572 -5.682 -2.432 1.00 0.00 H ATOM 11880 HH11 ARG B 334 -34.045 -5.398 -1.519 1.00 0.00 H ATOM 11881 HH22 ARG B 334 -37.270 -6.951 -1.483 1.00 0.00 H ATOM 11882 HH21 ARG B 334 -37.066 -7.651 0.164 1.00 0.00 H ATOM 11883 H ARG B 334 -29.944 -3.829 3.210 1.00 0.00 H ATOM 11884 N GLU B 335 -32.682 -3.638 4.948 1.00 14.90 N ATOM 11885 CA GLU B 335 -33.590 -3.544 6.064 1.00 14.96 C ATOM 11886 C GLU B 335 -33.732 -2.125 6.609 1.00 22.20 C ATOM 11887 O GLU B 335 -34.813 -1.719 6.976 1.00 14.76 O ATOM 11888 CB GLU B 335 -33.477 -4.774 6.991 1.00 22.04 C ATOM 11889 CG GLU B 335 -32.800 -4.652 8.362 1.00 80.00 C ATOM 11890 CD GLU B 335 -32.351 -6.023 8.836 1.00 80.00 C ATOM 11891 OE1 GLU B 335 -32.933 -7.009 8.154 1.00 80.00 O ATOM 11892 OE2 GLU B 335 -31.441 -6.178 9.665 1.00 80.00 O ATOM 11893 HA GLU B 335 -34.628 -3.659 5.752 1.00 0.00 H ATOM 11894 HB2 GLU B 335 -34.493 -5.123 7.174 1.00 0.00 H ATOM 11895 HB3 GLU B 335 -32.927 -5.535 6.437 1.00 0.00 H ATOM 11896 HG2 GLU B 335 -31.934 -3.995 8.281 1.00 0.00 H ATOM 11897 HG3 GLU B 335 -33.506 -4.234 9.079 1.00 0.00 H ATOM 11898 H GLU B 335 -31.812 -4.204 5.015 1.00 0.00 H ATOM 11899 N PHE B 336 -32.652 -1.357 6.624 1.00 10.75 N ATOM 11900 CA PHE B 336 -32.640 -0.008 7.075 1.00 8.67 C ATOM 11901 C PHE B 336 -33.472 0.809 6.091 1.00 13.76 C ATOM 11902 O PHE B 336 -34.253 1.654 6.484 1.00 14.96 O ATOM 11903 CB PHE B 336 -31.188 0.531 7.103 1.00 16.27 C ATOM 11904 CG PHE B 336 -31.141 2.007 7.561 1.00 13.95 C ATOM 11905 CD1 PHE B 336 -31.479 3.064 6.714 1.00 11.65 C ATOM 11906 CD2 PHE B 336 -30.800 2.345 8.876 1.00 8.64 C ATOM 11907 CE1 PHE B 336 -31.461 4.391 7.150 1.00 10.90 C ATOM 11908 CE2 PHE B 336 -30.774 3.661 9.344 1.00 8.28 C ATOM 11909 CZ PHE B 336 -31.099 4.695 8.467 1.00 9.86 C ATOM 11910 HA PHE B 336 -33.050 0.061 8.083 1.00 0.00 H ATOM 11911 HB2 PHE B 336 -30.599 -0.073 7.793 1.00 0.00 H ATOM 11912 HB3 PHE B 336 -30.763 0.457 6.102 1.00 0.00 H ATOM 11913 HD2 PHE B 336 -30.542 1.543 9.568 1.00 0.00 H ATOM 11914 HE2 PHE B 336 -30.504 3.876 10.378 1.00 0.00 H ATOM 11915 HZ PHE B 336 -31.071 5.731 8.804 1.00 0.00 H ATOM 11916 HE1 PHE B 336 -31.730 5.192 6.462 1.00 0.00 H ATOM 11917 HD1 PHE B 336 -31.765 2.848 5.685 1.00 0.00 H ATOM 11918 H PHE B 336 -31.758 -1.766 6.285 1.00 0.00 H ATOM 11919 N ALA B 337 -33.323 0.580 4.796 1.00 12.94 N ATOM 11920 CA ALA B 337 -34.076 1.276 3.778 1.00 6.05 C ATOM 11921 C ALA B 337 -35.600 1.016 3.944 1.00 11.76 C ATOM 11922 O ALA B 337 -36.432 1.912 3.948 1.00 15.57 O ATOM 11923 CB ALA B 337 -33.704 0.701 2.416 1.00 10.21 C ATOM 11924 HA ALA B 337 -33.853 2.340 3.863 1.00 0.00 H ATOM 11925 HB1 ALA B 337 -32.636 0.837 2.245 1.00 0.00 H ATOM 11926 HB2 ALA B 337 -33.945 -0.362 2.394 1.00 0.00 H ATOM 11927 HB3 ALA B 337 -34.266 1.219 1.639 1.00 0.00 H ATOM 11928 H ALA B 337 -32.630 -0.136 4.497 1.00 0.00 H ATOM 11929 N LEU B 338 -35.967 -0.256 4.062 1.00 11.77 N ATOM 11930 CA LEU B 338 -37.340 -0.619 4.223 1.00 18.29 C ATOM 11931 C LEU B 338 -37.981 0.063 5.388 1.00 22.13 C ATOM 11932 O LEU B 338 -39.181 0.365 5.327 1.00 18.40 O ATOM 11933 CB LEU B 338 -37.521 -2.121 4.380 1.00 16.88 C ATOM 11934 CG LEU B 338 -37.238 -2.871 3.066 1.00 14.43 C ATOM 11935 CD1 LEU B 338 -37.002 -4.352 3.398 1.00 22.35 C ATOM 11936 CD2 LEU B 338 -38.444 -2.818 2.131 1.00 19.97 C ATOM 11937 HA LEU B 338 -37.831 -0.289 3.307 1.00 0.00 H ATOM 11938 HB2 LEU B 338 -36.835 -2.481 5.147 1.00 0.00 H ATOM 11939 HB3 LEU B 338 -38.547 -2.323 4.688 1.00 0.00 H ATOM 11940 HG LEU B 338 -36.377 -2.407 2.586 1.00 0.00 H ATOM 11941 HD21 LEU B 338 -39.301 -3.281 2.619 1.00 0.00 H ATOM 11942 HD22 LEU B 338 -38.675 -1.779 1.897 1.00 0.00 H ATOM 11943 HD23 LEU B 338 -38.213 -3.356 1.212 1.00 0.00 H ATOM 11944 HD11 LEU B 338 -36.149 -4.441 4.071 1.00 0.00 H ATOM 11945 HD12 LEU B 338 -37.890 -4.761 3.879 1.00 0.00 H ATOM 11946 HD13 LEU B 338 -36.799 -4.901 2.479 1.00 0.00 H ATOM 11947 H LEU B 338 -35.242 -1.001 4.037 1.00 0.00 H ATOM 11948 N LYS B 339 -37.173 0.301 6.411 1.00 20.80 N ATOM 11949 CA LYS B 339 -37.681 0.975 7.598 1.00 14.46 C ATOM 11950 C LYS B 339 -37.794 2.487 7.438 1.00 23.48 C ATOM 11951 O LYS B 339 -38.798 3.066 7.883 1.00 30.10 O ATOM 11952 CB LYS B 339 -36.959 0.712 8.918 1.00 12.95 C ATOM 11953 CG LYS B 339 -36.793 -0.770 9.242 1.00 76.94 C ATOM 11954 CD LYS B 339 -37.766 -1.654 8.450 1.00 80.00 C ATOM 11955 CE LYS B 339 -37.194 -2.941 7.839 1.00 80.00 C ATOM 11956 NZ LYS B 339 -38.217 -3.896 7.341 1.00 80.00 N ATOM 11957 HA LYS B 339 -38.662 0.507 7.671 1.00 0.00 H ATOM 11958 HB2 LYS B 339 -35.969 1.166 8.866 1.00 0.00 H ATOM 11959 HB3 LYS B 339 -37.529 1.178 9.721 1.00 0.00 H ATOM 11960 HG2 LYS B 339 -35.773 -1.069 9.002 1.00 0.00 H ATOM 11961 HG3 LYS B 339 -36.972 -0.918 10.307 1.00 0.00 H ATOM 11962 HD2 LYS B 339 -38.574 -1.940 9.123 1.00 0.00 H ATOM 11963 HD3 LYS B 339 -38.169 -1.053 7.635 1.00 0.00 H ATOM 11964 HE2 LYS B 339 -36.600 -3.445 8.601 1.00 0.00 H ATOM 11965 HE3 LYS B 339 -36.551 -2.665 7.003 1.00 0.00 H ATOM 11966 HZ1 LYS B 339 -38.834 -4.183 8.128 1.00 0.00 H ATOM 11967 HZ2 LYS B 339 -38.787 -3.437 6.602 1.00 0.00 H ATOM 11968 HZ3 LYS B 339 -37.744 -4.734 6.946 1.00 0.00 H ATOM 11969 H LYS B 339 -36.177 0.007 6.366 1.00 0.00 H ATOM 11970 N HIS B 340 -36.791 3.105 6.813 1.00 16.20 N ATOM 11971 CA HIS B 340 -36.724 4.553 6.634 1.00 18.04 C ATOM 11972 C HIS B 340 -36.980 5.248 5.344 1.00 16.60 C ATOM 11973 O HIS B 340 -37.292 6.422 5.398 1.00 21.45 O ATOM 11974 CB HIS B 340 -35.377 5.093 7.117 1.00 16.15 C ATOM 11975 CG HIS B 340 -35.085 4.529 8.477 1.00 22.51 C ATOM 11976 ND1 HIS B 340 -35.670 5.048 9.627 1.00 26.06 N ATOM 11977 CD2 HIS B 340 -34.296 3.489 8.867 1.00 25.37 C ATOM 11978 CE1 HIS B 340 -35.206 4.334 10.670 1.00 28.56 C ATOM 11979 NE2 HIS B 340 -34.374 3.394 10.251 1.00 27.73 N ATOM 11980 HA HIS B 340 -37.618 4.784 7.213 1.00 0.00 H ATOM 11981 HB2 HIS B 340 -34.593 4.795 6.421 1.00 0.00 H ATOM 11982 HB3 HIS B 340 -35.418 6.181 7.173 1.00 0.00 H ATOM 11983 HD2 HIS B 340 -33.709 2.847 8.211 1.00 0.00 H ATOM 11984 HE1 HIS B 340 -35.477 4.506 11.712 1.00 0.00 H ATOM 11985 H HIS B 340 -36.016 2.525 6.433 1.00 0.00 H ATOM 11986 N LEU B 341 -36.813 4.606 4.209 1.00 15.23 N ATOM 11987 CA LEU B 341 -37.040 5.268 2.957 1.00 15.23 C ATOM 11988 C LEU B 341 -37.588 4.273 1.956 1.00 15.91 C ATOM 11989 O LEU B 341 -37.127 4.113 0.824 1.00 13.78 O ATOM 11990 CB LEU B 341 -35.714 5.874 2.454 1.00 17.98 C ATOM 11991 CG LEU B 341 -34.452 4.979 2.394 1.00 15.88 C ATOM 11992 CD1 LEU B 341 -33.787 5.263 1.016 1.00 12.87 C ATOM 11993 CD2 LEU B 341 -33.514 5.272 3.595 1.00 12.56 C ATOM 11994 HA LEU B 341 -37.766 6.071 3.084 1.00 0.00 H ATOM 11995 HB2 LEU B 341 -35.894 6.241 1.443 1.00 0.00 H ATOM 11996 HB3 LEU B 341 -35.479 6.714 3.107 1.00 0.00 H ATOM 11997 HG LEU B 341 -34.694 3.919 2.475 1.00 0.00 H ATOM 11998 HD21 LEU B 341 -33.207 6.317 3.568 1.00 0.00 H ATOM 11999 HD22 LEU B 341 -34.045 5.072 4.526 1.00 0.00 H ATOM 12000 HD23 LEU B 341 -32.634 4.632 3.532 1.00 0.00 H ATOM 12001 HD11 LEU B 341 -34.486 5.012 0.218 1.00 0.00 H ATOM 12002 HD12 LEU B 341 -33.524 6.319 0.952 1.00 0.00 H ATOM 12003 HD13 LEU B 341 -32.887 4.656 0.917 1.00 0.00 H ATOM 12004 H LEU B 341 -36.514 3.610 4.219 1.00 0.00 H ATOM 12005 N PRO B 342 -38.620 3.569 2.362 1.00 16.35 N ATOM 12006 CA PRO B 342 -39.211 2.580 1.519 1.00 16.16 C ATOM 12007 C PRO B 342 -39.724 2.995 0.160 1.00 24.60 C ATOM 12008 O PRO B 342 -39.783 2.179 -0.760 1.00 23.62 O ATOM 12009 CB PRO B 342 -40.351 1.983 2.347 1.00 20.99 C ATOM 12010 CG PRO B 342 -40.518 2.861 3.565 1.00 24.92 C ATOM 12011 CD PRO B 342 -39.406 3.876 3.556 1.00 17.83 C ATOM 12012 HA PRO B 342 -38.412 1.892 1.243 1.00 0.00 H ATOM 12013 HD3 PRO B 342 -39.810 4.887 3.499 1.00 0.00 H ATOM 12014 HD2 PRO B 342 -38.794 3.781 4.453 1.00 0.00 H ATOM 12015 HG3 PRO B 342 -40.461 2.256 4.470 1.00 0.00 H ATOM 12016 HG2 PRO B 342 -41.483 3.367 3.528 1.00 0.00 H ATOM 12017 HB2 PRO B 342 -41.272 1.972 1.764 1.00 0.00 H ATOM 12018 HB3 PRO B 342 -40.102 0.966 2.649 1.00 0.00 H ATOM 12019 N SER B 343 -40.085 4.263 0.038 1.00 18.85 N ATOM 12020 CA SER B 343 -40.605 4.712 -1.240 1.00 22.35 C ATOM 12021 C SER B 343 -39.604 5.452 -2.108 1.00 22.85 C ATOM 12022 O SER B 343 -39.924 5.965 -3.184 1.00 23.31 O ATOM 12023 CB SER B 343 -41.937 5.473 -1.046 1.00 47.66 C ATOM 12024 OG SER B 343 -43.018 4.676 -0.502 1.00 35.50 O ATOM 12025 HA SER B 343 -40.815 3.814 -1.822 1.00 0.00 H ATOM 12026 HB2 SER B 343 -42.253 5.857 -2.016 1.00 0.00 H ATOM 12027 HB3 SER B 343 -41.756 6.307 -0.368 1.00 0.00 H ATOM 12028 HG SER B 343 -43.828 5.238 -0.411 1.00 0.00 H ATOM 12029 H SER B 343 -39.998 4.921 0.839 1.00 0.00 H ATOM 12030 N ASP B 344 -38.359 5.523 -1.672 1.00 18.43 N ATOM 12031 CA ASP B 344 -37.422 6.214 -2.524 1.00 11.11 C ATOM 12032 C ASP B 344 -37.266 5.467 -3.865 1.00 17.59 C ATOM 12033 O ASP B 344 -37.128 4.239 -3.896 1.00 17.73 O ATOM 12034 CB ASP B 344 -36.104 6.345 -1.768 1.00 15.91 C ATOM 12035 CG ASP B 344 -35.068 7.071 -2.562 1.00 23.01 C ATOM 12036 OD1 ASP B 344 -35.212 8.363 -2.482 1.00 22.94 O ATOM 12037 OD2 ASP B 344 -34.176 6.513 -3.165 1.00 25.76 O ATOM 12038 HA ASP B 344 -37.782 7.213 -2.771 1.00 0.00 H ATOM 12039 HB2 ASP B 344 -36.283 6.891 -0.842 1.00 0.00 H ATOM 12040 HB3 ASP B 344 -35.732 5.347 -1.534 1.00 0.00 H ATOM 12041 H ASP B 344 -38.070 5.104 -0.765 1.00 0.00 H ATOM 12042 N PRO B 345 -37.314 6.208 -4.974 1.00 24.93 N ATOM 12043 CA PRO B 345 -37.208 5.686 -6.330 1.00 21.43 C ATOM 12044 C PRO B 345 -35.888 5.042 -6.662 1.00 29.54 C ATOM 12045 O PRO B 345 -35.841 4.121 -7.469 1.00 13.95 O ATOM 12046 CB PRO B 345 -37.474 6.838 -7.321 1.00 22.88 C ATOM 12047 CG PRO B 345 -37.535 8.099 -6.497 1.00 22.93 C ATOM 12048 CD PRO B 345 -37.611 7.674 -5.029 1.00 30.71 C ATOM 12049 HA PRO B 345 -37.949 4.891 -6.410 1.00 0.00 H ATOM 12050 HD3 PRO B 345 -36.877 8.226 -4.442 1.00 0.00 H ATOM 12051 HD2 PRO B 345 -38.609 7.868 -4.635 1.00 0.00 H ATOM 12052 HG3 PRO B 345 -38.418 8.679 -6.765 1.00 0.00 H ATOM 12053 HG2 PRO B 345 -36.642 8.700 -6.667 1.00 0.00 H ATOM 12054 HB2 PRO B 345 -36.667 6.902 -8.051 1.00 0.00 H ATOM 12055 HB3 PRO B 345 -38.420 6.679 -7.840 1.00 0.00 H ATOM 12056 N MET B 346 -34.841 5.534 -6.020 1.00 16.88 N ATOM 12057 CA MET B 346 -33.553 4.913 -6.294 1.00 14.45 C ATOM 12058 C MET B 346 -33.447 3.574 -5.547 1.00 10.44 C ATOM 12059 O MET B 346 -32.888 2.557 -6.001 1.00 15.80 O ATOM 12060 CB MET B 346 -32.481 5.865 -5.838 1.00 15.59 C ATOM 12061 CG MET B 346 -31.172 5.503 -6.470 1.00 34.64 C ATOM 12062 SD MET B 346 -30.372 7.014 -7.018 1.00 60.59 S ATOM 12063 CE MET B 346 -29.879 6.453 -8.673 1.00 51.45 C ATOM 12064 HA MET B 346 -33.441 4.708 -7.359 1.00 0.00 H ATOM 12065 HB2 MET B 346 -32.753 6.880 -6.126 1.00 0.00 H ATOM 12066 HB3 MET B 346 -32.386 5.810 -4.754 1.00 0.00 H ATOM 12067 HG2 MET B 346 -31.343 4.846 -7.323 1.00 0.00 H ATOM 12068 HG3 MET B 346 -30.540 4.994 -5.743 1.00 0.00 H ATOM 12069 HE1 MET B 346 -29.218 5.591 -8.581 1.00 0.00 H ATOM 12070 HE2 MET B 346 -30.767 6.173 -9.240 1.00 0.00 H ATOM 12071 HE3 MET B 346 -29.357 7.260 -9.188 1.00 0.00 H ATOM 12072 H MET B 346 -34.934 6.326 -5.352 1.00 0.00 H ATOM 12073 N PHE B 347 -34.033 3.598 -4.361 1.00 11.52 N ATOM 12074 CA PHE B 347 -34.051 2.428 -3.527 1.00 13.54 C ATOM 12075 C PHE B 347 -34.846 1.400 -4.308 1.00 16.53 C ATOM 12076 O PHE B 347 -34.456 0.232 -4.434 1.00 16.12 O ATOM 12077 CB PHE B 347 -34.749 2.692 -2.169 1.00 16.00 C ATOM 12078 CG PHE B 347 -35.164 1.420 -1.458 1.00 18.55 C ATOM 12079 CD1 PHE B 347 -34.222 0.396 -1.352 1.00 20.75 C ATOM 12080 CD2 PHE B 347 -36.430 1.194 -0.914 1.00 20.88 C ATOM 12081 CE1 PHE B 347 -34.513 -0.822 -0.733 1.00 15.37 C ATOM 12082 CE2 PHE B 347 -36.734 -0.012 -0.275 1.00 17.85 C ATOM 12083 CZ PHE B 347 -35.779 -1.031 -0.187 1.00 17.31 C ATOM 12084 HA PHE B 347 -33.036 2.105 -3.296 1.00 0.00 H ATOM 12085 HB2 PHE B 347 -34.061 3.241 -1.526 1.00 0.00 H ATOM 12086 HB3 PHE B 347 -35.638 3.296 -2.347 1.00 0.00 H ATOM 12087 HD2 PHE B 347 -37.193 1.969 -0.989 1.00 0.00 H ATOM 12088 HE2 PHE B 347 -37.723 -0.160 0.158 1.00 0.00 H ATOM 12089 HZ PHE B 347 -36.021 -1.975 0.301 1.00 0.00 H ATOM 12090 HE1 PHE B 347 -33.756 -1.604 -0.677 1.00 0.00 H ATOM 12091 HD1 PHE B 347 -33.226 0.552 -1.766 1.00 0.00 H ATOM 12092 H PHE B 347 -34.486 4.473 -4.029 1.00 0.00 H ATOM 12093 N LYS B 348 -35.987 1.835 -4.850 1.00 12.09 N ATOM 12094 CA LYS B 348 -36.823 0.949 -5.619 1.00 17.83 C ATOM 12095 C LYS B 348 -36.080 0.333 -6.805 1.00 9.66 C ATOM 12096 O LYS B 348 -36.257 -0.832 -7.142 1.00 14.68 O ATOM 12097 CB LYS B 348 -38.130 1.665 -5.957 1.00 21.98 C ATOM 12098 CG LYS B 348 -39.025 1.763 -4.727 1.00 32.09 C ATOM 12099 CD LYS B 348 -39.874 3.025 -4.734 1.00 80.00 C ATOM 12100 CE LYS B 348 -41.330 2.714 -5.054 1.00 80.00 C ATOM 12101 NZ LYS B 348 -41.707 1.318 -4.737 1.00 80.00 N ATOM 12102 HA LYS B 348 -37.094 0.076 -5.025 1.00 0.00 H ATOM 12103 HB2 LYS B 348 -37.905 2.669 -6.317 1.00 0.00 H ATOM 12104 HB3 LYS B 348 -38.652 1.109 -6.736 1.00 0.00 H ATOM 12105 HG2 LYS B 348 -39.685 0.896 -4.702 1.00 0.00 H ATOM 12106 HG3 LYS B 348 -38.398 1.766 -3.835 1.00 0.00 H ATOM 12107 HD2 LYS B 348 -39.819 3.495 -3.752 1.00 0.00 H ATOM 12108 HD3 LYS B 348 -39.484 3.711 -5.486 1.00 0.00 H ATOM 12109 HE2 LYS B 348 -41.497 2.886 -6.117 1.00 0.00 H ATOM 12110 HE3 LYS B 348 -41.964 3.385 -4.475 1.00 0.00 H ATOM 12111 HZ1 LYS B 348 -41.115 0.666 -5.291 1.00 0.00 H ATOM 12112 HZ2 LYS B 348 -41.562 1.143 -3.722 1.00 0.00 H ATOM 12113 HZ3 LYS B 348 -42.708 1.168 -4.976 1.00 0.00 H ATOM 12114 H LYS B 348 -36.275 2.825 -4.715 1.00 0.00 H ATOM 12115 N LEU B 349 -35.214 1.122 -7.421 1.00 11.65 N ATOM 12116 CA LEU B 349 -34.413 0.663 -8.542 1.00 11.51 C ATOM 12117 C LEU B 349 -33.405 -0.391 -8.034 1.00 13.37 C ATOM 12118 O LEU B 349 -33.245 -1.488 -8.585 1.00 12.82 O ATOM 12119 CB LEU B 349 -33.778 1.881 -9.221 1.00 9.16 C ATOM 12120 CG LEU B 349 -32.744 1.578 -10.292 1.00 21.30 C ATOM 12121 CD1 LEU B 349 -33.443 0.825 -11.414 1.00 31.37 C ATOM 12122 CD2 LEU B 349 -32.194 2.905 -10.830 1.00 20.14 C ATOM 12123 HA LEU B 349 -35.011 0.166 -9.305 1.00 0.00 H ATOM 12124 HB2 LEU B 349 -34.577 2.461 -9.682 1.00 0.00 H ATOM 12125 HB3 LEU B 349 -33.295 2.480 -8.449 1.00 0.00 H ATOM 12126 HG LEU B 349 -31.925 0.981 -9.890 1.00 0.00 H ATOM 12127 HD21 LEU B 349 -33.010 3.489 -11.256 1.00 0.00 H ATOM 12128 HD22 LEU B 349 -31.733 3.463 -10.015 1.00 0.00 H ATOM 12129 HD23 LEU B 349 -31.450 2.703 -11.600 1.00 0.00 H ATOM 12130 HD11 LEU B 349 -33.864 -0.101 -11.021 1.00 0.00 H ATOM 12131 HD12 LEU B 349 -34.242 1.444 -11.823 1.00 0.00 H ATOM 12132 HD13 LEU B 349 -32.723 0.594 -12.199 1.00 0.00 H ATOM 12133 H LEU B 349 -35.104 2.102 -7.092 1.00 0.00 H ATOM 12134 N VAL B 350 -32.727 -0.048 -6.921 1.00 7.88 N ATOM 12135 CA VAL B 350 -31.786 -1.002 -6.325 1.00 4.64 C ATOM 12136 C VAL B 350 -32.503 -2.360 -5.997 1.00 8.71 C ATOM 12137 O VAL B 350 -32.000 -3.469 -6.196 1.00 13.95 O ATOM 12138 CB VAL B 350 -31.124 -0.382 -5.120 1.00 6.35 C ATOM 12139 CG1 VAL B 350 -30.413 -1.389 -4.190 1.00 9.68 C ATOM 12140 CG2 VAL B 350 -30.282 0.804 -5.559 1.00 10.89 C ATOM 12141 HA VAL B 350 -31.000 -1.237 -7.042 1.00 0.00 H ATOM 12142 HB VAL B 350 -31.904 0.001 -4.462 1.00 0.00 H ATOM 12143 HG11 VAL B 350 -31.139 -2.112 -3.817 1.00 0.00 H ATOM 12144 HG12 VAL B 350 -29.634 -1.909 -4.748 1.00 0.00 H ATOM 12145 HG13 VAL B 350 -29.966 -0.855 -3.352 1.00 0.00 H ATOM 12146 HG21 VAL B 350 -29.519 0.466 -6.260 1.00 0.00 H ATOM 12147 HG22 VAL B 350 -30.921 1.542 -6.043 1.00 0.00 H ATOM 12148 HG23 VAL B 350 -29.804 1.251 -4.687 1.00 0.00 H ATOM 12149 H VAL B 350 -32.870 0.887 -6.488 1.00 0.00 H ATOM 12150 N ALA B 351 -33.760 -2.271 -5.496 1.00 8.91 N ATOM 12151 CA ALA B 351 -34.552 -3.454 -5.156 1.00 10.89 C ATOM 12152 C ALA B 351 -34.845 -4.254 -6.409 1.00 17.46 C ATOM 12153 O ALA B 351 -34.763 -5.496 -6.443 1.00 15.18 O ATOM 12154 CB ALA B 351 -35.824 -3.123 -4.416 1.00 12.62 C ATOM 12155 HA ALA B 351 -33.955 -4.056 -4.471 1.00 0.00 H ATOM 12156 HB1 ALA B 351 -35.579 -2.611 -3.486 1.00 0.00 H ATOM 12157 HB2 ALA B 351 -36.445 -2.476 -5.035 1.00 0.00 H ATOM 12158 HB3 ALA B 351 -36.364 -4.044 -4.194 1.00 0.00 H ATOM 12159 H ALA B 351 -34.176 -1.329 -5.348 1.00 0.00 H ATOM 12160 N GLN B 352 -35.190 -3.529 -7.448 1.00 12.60 N ATOM 12161 CA GLN B 352 -35.509 -4.185 -8.710 1.00 14.05 C ATOM 12162 C GLN B 352 -34.341 -4.882 -9.338 1.00 8.31 C ATOM 12163 O GLN B 352 -34.469 -5.928 -9.972 1.00 17.27 O ATOM 12164 CB GLN B 352 -35.990 -3.139 -9.724 1.00 16.29 C ATOM 12165 CG GLN B 352 -36.742 -3.748 -10.915 1.00 20.42 C ATOM 12166 CD GLN B 352 -37.207 -2.667 -11.918 1.00 39.41 C ATOM 12167 OE1 GLN B 352 -37.811 -2.986 -12.961 1.00 80.00 O ATOM 12168 NE2 GLN B 352 -37.135 -1.386 -11.521 1.00 29.45 N ATOM 12169 HA GLN B 352 -36.271 -4.927 -8.471 1.00 0.00 H ATOM 12170 HB2 GLN B 352 -36.656 -2.443 -9.214 1.00 0.00 H ATOM 12171 HB3 GLN B 352 -35.122 -2.599 -10.102 1.00 0.00 H ATOM 12172 HG2 GLN B 352 -36.081 -4.446 -11.430 1.00 0.00 H ATOM 12173 HG3 GLN B 352 -37.616 -4.284 -10.544 1.00 0.00 H ATOM 12174 HE22 GLN B 352 -36.626 -1.140 -10.648 1.00 0.00 H ATOM 12175 HE21 GLN B 352 -37.588 -0.640 -12.087 1.00 0.00 H ATOM 12176 H GLN B 352 -35.235 -2.493 -7.371 1.00 0.00 H ATOM 12177 N LEU B 353 -33.157 -4.283 -9.175 1.00 10.62 N ATOM 12178 CA LEU B 353 -31.986 -4.907 -9.764 1.00 9.71 C ATOM 12179 C LEU B 353 -31.642 -6.203 -9.066 1.00 20.52 C ATOM 12180 O LEU B 353 -31.029 -7.050 -9.709 1.00 14.06 O ATOM 12181 CB LEU B 353 -30.766 -3.998 -9.702 1.00 9.98 C ATOM 12182 CG LEU B 353 -30.880 -2.800 -10.619 1.00 17.10 C ATOM 12183 CD1 LEU B 353 -29.882 -1.726 -10.197 1.00 18.89 C ATOM 12184 CD2 LEU B 353 -30.632 -3.226 -12.057 1.00 8.51 C ATOM 12185 HA LEU B 353 -32.241 -5.101 -10.806 1.00 0.00 H ATOM 12186 HB2 LEU B 353 -30.647 -3.643 -8.678 1.00 0.00 H ATOM 12187 HB3 LEU B 353 -29.887 -4.575 -9.990 1.00 0.00 H ATOM 12188 HG LEU B 353 -31.886 -2.385 -10.548 1.00 0.00 H ATOM 12189 HD21 LEU B 353 -29.632 -3.651 -12.141 1.00 0.00 H ATOM 12190 HD22 LEU B 353 -31.371 -3.973 -12.346 1.00 0.00 H ATOM 12191 HD23 LEU B 353 -30.716 -2.358 -12.711 1.00 0.00 H ATOM 12192 HD11 LEU B 353 -30.094 -1.417 -9.173 1.00 0.00 H ATOM 12193 HD12 LEU B 353 -28.871 -2.129 -10.255 1.00 0.00 H ATOM 12194 HD13 LEU B 353 -29.971 -0.867 -10.863 1.00 0.00 H ATOM 12195 H LEU B 353 -33.077 -3.394 -8.641 1.00 0.00 H ATOM 12196 N TYR B 354 -32.036 -6.347 -7.769 1.00 11.74 N ATOM 12197 CA TYR B 354 -31.741 -7.571 -7.004 1.00 6.48 C ATOM 12198 C TYR B 354 -32.445 -8.757 -7.631 1.00 5.20 C ATOM 12199 O TYR B 354 -32.011 -9.907 -7.568 1.00 7.49 O ATOM 12200 CB TYR B 354 -32.130 -7.323 -5.534 1.00 14.55 C ATOM 12201 CG TYR B 354 -31.723 -8.446 -4.621 1.00 8.72 C ATOM 12202 CD1 TYR B 354 -30.627 -9.272 -4.876 1.00 12.33 C ATOM 12203 CD2 TYR B 354 -32.452 -8.715 -3.466 1.00 14.00 C ATOM 12204 CE1 TYR B 354 -30.266 -10.316 -4.021 1.00 9.10 C ATOM 12205 CE2 TYR B 354 -32.105 -9.744 -2.592 1.00 16.84 C ATOM 12206 CZ TYR B 354 -31.016 -10.567 -2.873 1.00 11.76 C ATOM 12207 OH TYR B 354 -30.652 -11.589 -2.000 1.00 18.67 O ATOM 12208 HA TYR B 354 -30.678 -7.813 -7.028 1.00 0.00 H ATOM 12209 HB3 TYR B 354 -33.212 -7.203 -5.476 1.00 0.00 H ATOM 12210 HB2 TYR B 354 -31.645 -6.407 -5.196 1.00 0.00 H ATOM 12211 HD2 TYR B 354 -33.323 -8.101 -3.237 1.00 0.00 H ATOM 12212 HE2 TYR B 354 -32.688 -9.906 -1.685 1.00 0.00 H ATOM 12213 HE1 TYR B 354 -29.398 -10.934 -4.251 1.00 0.00 H ATOM 12214 HD1 TYR B 354 -30.033 -9.096 -5.773 1.00 0.00 H ATOM 12215 HH TYR B 354 -29.862 -12.064 -2.361 1.00 0.00 H ATOM 12216 H TYR B 354 -32.557 -5.574 -7.308 1.00 0.00 H ATOM 12217 N LYS B 355 -33.588 -8.419 -8.230 1.00 8.13 N ATOM 12218 CA LYS B 355 -34.376 -9.433 -8.901 1.00 14.22 C ATOM 12219 C LYS B 355 -33.819 -9.768 -10.286 1.00 19.26 C ATOM 12220 O LYS B 355 -34.062 -10.840 -10.863 1.00 15.14 O ATOM 12221 CB LYS B 355 -35.771 -8.916 -9.120 1.00 10.52 C ATOM 12222 CG LYS B 355 -36.533 -8.710 -7.832 1.00 15.48 C ATOM 12223 CD LYS B 355 -37.900 -8.053 -8.054 1.00 26.46 C ATOM 12224 CE LYS B 355 -38.744 -8.004 -6.795 1.00 40.27 C ATOM 12225 NZ LYS B 355 -38.822 -9.320 -6.141 1.00 80.00 N ATOM 12226 HA LYS B 355 -34.355 -10.320 -8.268 1.00 0.00 H ATOM 12227 HB2 LYS B 355 -35.710 -7.962 -9.644 1.00 0.00 H ATOM 12228 HB3 LYS B 355 -36.315 -9.633 -9.735 1.00 0.00 H ATOM 12229 HG2 LYS B 355 -36.684 -9.679 -7.357 1.00 0.00 H ATOM 12230 HG3 LYS B 355 -35.942 -8.073 -7.174 1.00 0.00 H ATOM 12231 HD2 LYS B 355 -37.743 -7.034 -8.407 1.00 0.00 H ATOM 12232 HD3 LYS B 355 -38.439 -8.620 -8.813 1.00 0.00 H ATOM 12233 HE2 LYS B 355 -39.751 -7.679 -7.057 1.00 0.00 H ATOM 12234 HE3 LYS B 355 -38.302 -7.290 -6.101 1.00 0.00 H ATOM 12235 HZ1 LYS B 355 -39.249 -10.006 -6.796 1.00 0.00 H ATOM 12236 HZ2 LYS B 355 -37.865 -9.635 -5.882 1.00 0.00 H ATOM 12237 HZ3 LYS B 355 -39.407 -9.246 -5.284 1.00 0.00 H ATOM 12238 H LYS B 355 -33.912 -7.431 -8.215 1.00 0.00 H ATOM 12239 N ILE B 356 -33.035 -8.865 -10.857 1.00 9.27 N ATOM 12240 CA ILE B 356 -32.496 -9.130 -12.202 1.00 8.63 C ATOM 12241 C ILE B 356 -31.028 -9.383 -12.418 1.00 14.66 C ATOM 12242 O ILE B 356 -30.654 -10.269 -13.183 1.00 10.85 O ATOM 12243 CB ILE B 356 -32.838 -7.937 -13.096 1.00 13.80 C ATOM 12244 CG1 ILE B 356 -34.307 -7.604 -12.954 1.00 21.49 C ATOM 12245 CG2 ILE B 356 -32.472 -8.170 -14.571 1.00 15.45 C ATOM 12246 CD1 ILE B 356 -34.712 -6.413 -13.791 1.00 34.29 C ATOM 12247 HA ILE B 356 -32.963 -10.089 -12.426 1.00 0.00 H ATOM 12248 HB ILE B 356 -32.234 -7.093 -12.763 1.00 0.00 H ATOM 12249 HG12 ILE B 356 -34.894 -8.468 -13.267 1.00 0.00 H ATOM 12250 HG13 ILE B 356 -34.517 -7.384 -11.907 1.00 0.00 H ATOM 12251 HD11 ILE B 356 -34.137 -5.540 -13.481 1.00 0.00 H ATOM 12252 HD12 ILE B 356 -34.515 -6.625 -14.842 1.00 0.00 H ATOM 12253 HD13 ILE B 356 -35.775 -6.217 -13.652 1.00 0.00 H ATOM 12254 HG21 ILE B 356 -31.400 -8.351 -14.654 1.00 0.00 H ATOM 12255 HG22 ILE B 356 -33.018 -9.035 -14.947 1.00 0.00 H ATOM 12256 HG23 ILE B 356 -32.739 -7.288 -15.154 1.00 0.00 H ATOM 12257 H ILE B 356 -32.803 -7.980 -10.362 1.00 0.00 H ATOM 12258 N VAL B 357 -30.181 -8.599 -11.804 1.00 14.67 N ATOM 12259 CA VAL B 357 -28.775 -8.816 -12.036 1.00 12.97 C ATOM 12260 C VAL B 357 -28.190 -10.224 -11.775 1.00 8.48 C ATOM 12261 O VAL B 357 -27.396 -10.776 -12.571 1.00 8.14 O ATOM 12262 CB VAL B 357 -27.990 -7.735 -11.279 1.00 11.64 C ATOM 12263 CG1 VAL B 357 -26.496 -7.950 -11.501 1.00 10.70 C ATOM 12264 CG2 VAL B 357 -28.455 -6.318 -11.649 1.00 8.85 C ATOM 12265 HA VAL B 357 -28.662 -8.743 -13.118 1.00 0.00 H ATOM 12266 HB VAL B 357 -28.191 -7.829 -10.212 1.00 0.00 H ATOM 12267 HG11 VAL B 357 -26.213 -8.935 -11.130 1.00 0.00 H ATOM 12268 HG12 VAL B 357 -26.275 -7.884 -12.566 1.00 0.00 H ATOM 12269 HG13 VAL B 357 -25.936 -7.184 -10.965 1.00 0.00 H ATOM 12270 HG21 VAL B 357 -28.312 -6.157 -12.718 1.00 0.00 H ATOM 12271 HG22 VAL B 357 -29.511 -6.207 -11.402 1.00 0.00 H ATOM 12272 HG23 VAL B 357 -27.871 -5.588 -11.089 1.00 0.00 H ATOM 12273 H VAL B 357 -30.511 -7.844 -11.169 1.00 0.00 H ATOM 12274 N PRO B 358 -28.551 -10.839 -10.645 1.00 9.19 N ATOM 12275 CA PRO B 358 -28.015 -12.152 -10.343 1.00 8.00 C ATOM 12276 C PRO B 358 -28.347 -13.122 -11.440 1.00 7.67 C ATOM 12277 O PRO B 358 -27.493 -13.879 -11.852 1.00 9.80 O ATOM 12278 CB PRO B 358 -28.636 -12.528 -9.008 1.00 6.19 C ATOM 12279 CG PRO B 358 -29.118 -11.245 -8.367 1.00 6.61 C ATOM 12280 CD PRO B 358 -29.329 -10.266 -9.512 1.00 5.15 C ATOM 12281 HA PRO B 358 -26.927 -12.165 -10.277 1.00 0.00 H ATOM 12282 HD3 PRO B 358 -30.386 -10.195 -9.768 1.00 0.00 H ATOM 12283 HD2 PRO B 358 -28.953 -9.278 -9.248 1.00 0.00 H ATOM 12284 HG3 PRO B 358 -28.370 -10.862 -7.673 1.00 0.00 H ATOM 12285 HG2 PRO B 358 -30.054 -11.414 -7.834 1.00 0.00 H ATOM 12286 HB2 PRO B 358 -29.474 -13.207 -9.163 1.00 0.00 H ATOM 12287 HB3 PRO B 358 -27.893 -13.009 -8.371 1.00 0.00 H ATOM 12288 N ASN B 359 -29.560 -13.058 -11.962 1.00 12.57 N ATOM 12289 CA ASN B 359 -29.984 -13.937 -13.058 1.00 12.12 C ATOM 12290 C ASN B 359 -29.195 -13.718 -14.349 1.00 16.58 C ATOM 12291 O ASN B 359 -28.829 -14.621 -15.077 1.00 18.41 O ATOM 12292 CB ASN B 359 -31.499 -13.775 -13.330 1.00 3.78 C ATOM 12293 CG ASN B 359 -32.338 -14.102 -12.088 1.00 26.71 C ATOM 12294 OD1 ASN B 359 -32.926 -13.217 -11.453 1.00 45.83 O ATOM 12295 ND2 ASN B 359 -32.194 -15.331 -11.651 1.00 21.64 N ATOM 12296 HA ASN B 359 -29.775 -14.955 -12.729 1.00 0.00 H ATOM 12297 HB2 ASN B 359 -31.696 -12.745 -13.629 1.00 0.00 H ATOM 12298 HB3 ASN B 359 -31.787 -14.448 -14.138 1.00 0.00 H ATOM 12299 HD22 ASN B 359 -31.690 -16.033 -12.229 1.00 0.00 H ATOM 12300 HD21 ASN B 359 -32.584 -15.603 -10.726 1.00 0.00 H ATOM 12301 H ASN B 359 -30.235 -12.363 -11.584 1.00 0.00 H ATOM 12302 N VAL B 360 -28.927 -12.475 -14.671 1.00 6.72 N ATOM 12303 CA VAL B 360 -28.167 -12.194 -15.844 1.00 13.82 C ATOM 12304 C VAL B 360 -26.735 -12.672 -15.598 1.00 16.06 C ATOM 12305 O VAL B 360 -26.124 -13.258 -16.465 1.00 13.01 O ATOM 12306 CB VAL B 360 -28.128 -10.690 -16.133 1.00 14.20 C ATOM 12307 CG1 VAL B 360 -27.137 -10.460 -17.296 1.00 12.80 C ATOM 12308 CG2 VAL B 360 -29.498 -10.189 -16.538 1.00 12.72 C ATOM 12309 HA VAL B 360 -28.625 -12.699 -16.694 1.00 0.00 H ATOM 12310 HB VAL B 360 -27.817 -10.150 -15.239 1.00 0.00 H ATOM 12311 HG11 VAL B 360 -26.149 -10.816 -17.005 1.00 0.00 H ATOM 12312 HG12 VAL B 360 -27.478 -11.007 -18.175 1.00 0.00 H ATOM 12313 HG13 VAL B 360 -27.088 -9.395 -17.525 1.00 0.00 H ATOM 12314 HG21 VAL B 360 -29.824 -10.713 -17.436 1.00 0.00 H ATOM 12315 HG22 VAL B 360 -30.205 -10.375 -15.730 1.00 0.00 H ATOM 12316 HG23 VAL B 360 -29.447 -9.119 -16.739 1.00 0.00 H ATOM 12317 H VAL B 360 -29.268 -11.696 -14.072 1.00 0.00 H ATOM 12318 N LEU B 361 -26.148 -12.436 -14.427 1.00 12.04 N ATOM 12319 CA LEU B 361 -24.784 -12.876 -14.192 1.00 11.07 C ATOM 12320 C LEU B 361 -24.666 -14.401 -14.290 1.00 14.28 C ATOM 12321 O LEU B 361 -23.670 -14.939 -14.769 1.00 12.25 O ATOM 12322 CB LEU B 361 -24.291 -12.481 -12.762 1.00 11.30 C ATOM 12323 CG LEU B 361 -23.901 -11.012 -12.621 1.00 6.26 C ATOM 12324 CD1 LEU B 361 -23.321 -10.767 -11.224 1.00 14.15 C ATOM 12325 CD2 LEU B 361 -22.894 -10.644 -13.732 1.00 11.02 C ATOM 12326 HA LEU B 361 -24.178 -12.389 -14.956 1.00 0.00 H ATOM 12327 HB2 LEU B 361 -25.091 -12.693 -12.053 1.00 0.00 H ATOM 12328 HB3 LEU B 361 -23.421 -13.091 -12.519 1.00 0.00 H ATOM 12329 HG LEU B 361 -24.778 -10.374 -12.734 1.00 0.00 H ATOM 12330 HD21 LEU B 361 -22.006 -11.269 -13.637 1.00 0.00 H ATOM 12331 HD22 LEU B 361 -23.354 -10.809 -14.706 1.00 0.00 H ATOM 12332 HD23 LEU B 361 -22.614 -9.595 -13.634 1.00 0.00 H ATOM 12333 HD11 LEU B 361 -24.069 -11.018 -10.472 1.00 0.00 H ATOM 12334 HD12 LEU B 361 -22.439 -11.392 -11.083 1.00 0.00 H ATOM 12335 HD13 LEU B 361 -23.043 -9.717 -11.126 1.00 0.00 H ATOM 12336 H LEU B 361 -26.668 -11.935 -13.678 1.00 0.00 H ATOM 12337 N LEU B 362 -25.692 -15.078 -13.808 1.00 11.92 N ATOM 12338 CA LEU B 362 -25.717 -16.525 -13.844 1.00 13.27 C ATOM 12339 C LEU B 362 -25.799 -16.920 -15.307 1.00 18.73 C ATOM 12340 O LEU B 362 -25.127 -17.810 -15.787 1.00 21.49 O ATOM 12341 CB LEU B 362 -27.020 -17.060 -13.212 1.00 24.72 C ATOM 12342 CG LEU B 362 -27.005 -17.377 -11.717 1.00 39.39 C ATOM 12343 CD1 LEU B 362 -28.341 -16.996 -11.061 1.00 37.76 C ATOM 12344 CD2 LEU B 362 -26.714 -18.848 -11.483 1.00 21.64 C ATOM 12345 HA LEU B 362 -24.844 -16.914 -13.319 1.00 0.00 H ATOM 12346 HB2 LEU B 362 -27.795 -16.311 -13.379 1.00 0.00 H ATOM 12347 HB3 LEU B 362 -27.284 -17.978 -13.737 1.00 0.00 H ATOM 12348 HG LEU B 362 -26.213 -16.785 -11.259 1.00 0.00 H ATOM 12349 HD21 LEU B 362 -27.485 -19.450 -11.964 1.00 0.00 H ATOM 12350 HD22 LEU B 362 -25.741 -19.096 -11.906 1.00 0.00 H ATOM 12351 HD23 LEU B 362 -26.708 -19.050 -10.412 1.00 0.00 H ATOM 12352 HD11 LEU B 362 -28.517 -15.928 -11.191 1.00 0.00 H ATOM 12353 HD12 LEU B 362 -29.148 -17.558 -11.530 1.00 0.00 H ATOM 12354 HD13 LEU B 362 -28.303 -17.232 -9.998 1.00 0.00 H ATOM 12355 H LEU B 362 -26.496 -14.563 -13.395 1.00 0.00 H ATOM 12356 N GLU B 363 -26.645 -16.233 -16.055 1.00 14.41 N ATOM 12357 CA GLU B 363 -26.771 -16.559 -17.466 1.00 13.39 C ATOM 12358 C GLU B 363 -25.458 -16.405 -18.189 1.00 18.14 C ATOM 12359 O GLU B 363 -25.022 -17.233 -18.994 1.00 20.08 O ATOM 12360 CB GLU B 363 -28.061 -15.977 -18.067 1.00 22.66 C ATOM 12361 CG GLU B 363 -27.942 -15.348 -19.454 1.00 70.63 C ATOM 12362 CD GLU B 363 -29.201 -14.588 -19.775 1.00 76.79 C ATOM 12363 OE1 GLU B 363 -30.053 -14.333 -18.946 1.00 52.09 O ATOM 12364 OE2 GLU B 363 -29.314 -14.280 -21.040 1.00 80.00 O ATOM 12365 HA GLU B 363 -26.951 -17.623 -17.617 1.00 0.00 H ATOM 12366 HB2 GLU B 363 -28.791 -16.784 -18.130 1.00 0.00 H ATOM 12367 HB3 GLU B 363 -28.428 -15.210 -17.385 1.00 0.00 H ATOM 12368 HG2 GLU B 363 -27.092 -14.666 -19.471 1.00 0.00 H ATOM 12369 HG3 GLU B 363 -27.792 -16.132 -20.196 1.00 0.00 H ATOM 12370 H GLU B 363 -27.214 -15.468 -15.639 1.00 0.00 H ATOM 12371 N GLN B 364 -24.777 -15.333 -17.888 1.00 10.43 N ATOM 12372 CA GLN B 364 -23.495 -15.110 -18.505 1.00 8.89 C ATOM 12373 C GLN B 364 -22.508 -16.210 -18.146 1.00 27.15 C ATOM 12374 O GLN B 364 -21.583 -16.507 -18.875 1.00 24.13 O ATOM 12375 CB GLN B 364 -22.888 -13.783 -18.082 1.00 19.06 C ATOM 12376 CG GLN B 364 -21.599 -13.568 -18.901 1.00 17.24 C ATOM 12377 CD GLN B 364 -20.785 -12.459 -18.279 1.00 27.56 C ATOM 12378 OE1 GLN B 364 -20.177 -11.653 -18.992 1.00 37.31 O ATOM 12379 NE2 GLN B 364 -20.879 -12.374 -16.963 1.00 14.78 N ATOM 12380 HA GLN B 364 -23.675 -15.105 -19.580 1.00 0.00 H ATOM 12381 HB2 GLN B 364 -23.592 -12.974 -18.279 1.00 0.00 H ATOM 12382 HB3 GLN B 364 -22.652 -13.806 -17.018 1.00 0.00 H ATOM 12383 HG2 GLN B 364 -21.015 -14.488 -18.907 1.00 0.00 H ATOM 12384 HG3 GLN B 364 -21.859 -13.298 -19.924 1.00 0.00 H ATOM 12385 HE22 GLN B 364 -21.410 -13.094 -16.432 1.00 0.00 H ATOM 12386 HE21 GLN B 364 -20.422 -11.588 -16.459 1.00 0.00 H ATOM 12387 H GLN B 364 -25.157 -14.645 -17.207 1.00 0.00 H ATOM 12388 N GLY B 365 -22.664 -16.842 -16.991 1.00 16.45 N ATOM 12389 CA GLY B 365 -21.746 -17.911 -16.588 1.00 30.67 C ATOM 12390 C GLY B 365 -20.272 -17.609 -16.236 1.00 23.25 C ATOM 12391 O GLY B 365 -19.438 -18.530 -16.222 1.00 27.67 O ATOM 12392 HA3 GLY B 365 -21.727 -18.628 -17.408 1.00 0.00 H ATOM 12393 HA2 GLY B 365 -22.185 -18.380 -15.707 1.00 0.00 H ATOM 12394 H GLY B 365 -23.449 -16.576 -16.362 1.00 0.00 H ATOM 12395 N LYS B 366 -19.910 -16.368 -15.938 1.00 13.81 N ATOM 12396 CA LYS B 366 -18.531 -16.127 -15.604 1.00 12.68 C ATOM 12397 C LYS B 366 -18.362 -15.878 -14.078 1.00 11.57 C ATOM 12398 O LYS B 366 -17.421 -16.430 -13.448 1.00 14.36 O ATOM 12399 CB LYS B 366 -18.078 -14.905 -16.382 1.00 23.02 C ATOM 12400 CG LYS B 366 -17.279 -15.222 -17.629 1.00 40.07 C ATOM 12401 CD LYS B 366 -16.821 -13.949 -18.323 1.00 29.01 C ATOM 12402 CE LYS B 366 -15.567 -13.309 -17.730 1.00 75.73 C ATOM 12403 NZ LYS B 366 -15.553 -11.830 -17.814 1.00 59.13 N ATOM 12404 HA LYS B 366 -17.929 -16.998 -15.862 1.00 0.00 H ATOM 12405 HB2 LYS B 366 -18.962 -14.340 -16.677 1.00 0.00 H ATOM 12406 HB3 LYS B 366 -17.459 -14.292 -15.726 1.00 0.00 H ATOM 12407 HG2 LYS B 366 -16.405 -15.811 -17.352 1.00 0.00 H ATOM 12408 HG3 LYS B 366 -17.901 -15.798 -18.314 1.00 0.00 H ATOM 12409 HD2 LYS B 366 -16.619 -14.186 -19.367 1.00 0.00 H ATOM 12410 HD3 LYS B 366 -17.631 -13.222 -18.267 1.00 0.00 H ATOM 12411 HE2 LYS B 366 -14.699 -13.692 -18.266 1.00 0.00 H ATOM 12412 HE3 LYS B 366 -15.499 -13.594 -16.680 1.00 0.00 H ATOM 12413 HZ1 LYS B 366 -15.606 -11.540 -18.811 1.00 0.00 H ATOM 12414 HZ2 LYS B 366 -16.370 -11.447 -17.297 1.00 0.00 H ATOM 12415 HZ3 LYS B 366 -14.674 -11.468 -17.393 1.00 0.00 H ATOM 12416 H LYS B 366 -20.602 -15.592 -15.946 1.00 0.00 H ATOM 12417 N ALA B 367 -19.224 -15.063 -13.463 1.00 14.67 N ATOM 12418 CA ALA B 367 -19.050 -14.804 -12.043 1.00 12.66 C ATOM 12419 C ALA B 367 -19.260 -16.022 -11.176 1.00 16.76 C ATOM 12420 O ALA B 367 -20.146 -16.797 -11.433 1.00 15.96 O ATOM 12421 CB ALA B 367 -19.967 -13.729 -11.522 1.00 8.42 C ATOM 12422 HA ALA B 367 -18.012 -14.480 -11.975 1.00 0.00 H ATOM 12423 HB1 ALA B 367 -19.773 -12.798 -12.054 1.00 0.00 H ATOM 12424 HB2 ALA B 367 -21.003 -14.029 -11.679 1.00 0.00 H ATOM 12425 HB3 ALA B 367 -19.787 -13.584 -10.457 1.00 0.00 H ATOM 12426 H ALA B 367 -20.005 -14.622 -13.990 1.00 0.00 H ATOM 12427 N LYS B 368 -18.473 -16.192 -10.144 1.00 7.25 N ATOM 12428 CA LYS B 368 -18.657 -17.319 -9.260 1.00 11.15 C ATOM 12429 C LYS B 368 -19.762 -16.996 -8.252 1.00 12.98 C ATOM 12430 O LYS B 368 -20.527 -17.856 -7.813 1.00 21.58 O ATOM 12431 CB LYS B 368 -17.403 -17.708 -8.486 1.00 9.73 C ATOM 12432 CG LYS B 368 -16.152 -17.807 -9.342 1.00 37.10 C ATOM 12433 CD LYS B 368 -15.511 -19.164 -9.278 1.00 27.13 C ATOM 12434 CE LYS B 368 -15.385 -19.792 -10.663 1.00 80.00 C ATOM 12435 NZ LYS B 368 -14.318 -20.810 -10.752 1.00 80.00 N ATOM 12436 HA LYS B 368 -18.919 -18.164 -9.897 1.00 0.00 H ATOM 12437 HB2 LYS B 368 -17.231 -16.959 -7.713 1.00 0.00 H ATOM 12438 HB3 LYS B 368 -17.576 -18.677 -8.018 1.00 0.00 H ATOM 12439 HG2 LYS B 368 -16.420 -17.596 -10.377 1.00 0.00 H ATOM 12440 HG3 LYS B 368 -15.433 -17.065 -8.996 1.00 0.00 H ATOM 12441 HD2 LYS B 368 -14.517 -19.066 -8.842 1.00 0.00 H ATOM 12442 HD3 LYS B 368 -16.119 -19.814 -8.649 1.00 0.00 H ATOM 12443 HE2 LYS B 368 -15.170 -19.002 -11.382 1.00 0.00 H ATOM 12444 HE3 LYS B 368 -16.335 -20.264 -10.916 1.00 0.00 H ATOM 12445 HZ1 LYS B 368 -13.403 -20.372 -10.523 1.00 0.00 H ATOM 12446 HZ2 LYS B 368 -14.515 -21.577 -10.078 1.00 0.00 H ATOM 12447 HZ3 LYS B 368 -14.287 -21.195 -11.718 1.00 0.00 H ATOM 12448 H LYS B 368 -17.710 -15.510 -9.959 1.00 0.00 H ATOM 12449 N ASN B 369 -19.865 -15.740 -7.857 1.00 9.66 N ATOM 12450 CA ASN B 369 -20.884 -15.316 -6.908 1.00 7.54 C ATOM 12451 C ASN B 369 -21.778 -14.322 -7.651 1.00 7.60 C ATOM 12452 O ASN B 369 -21.320 -13.222 -7.958 1.00 9.95 O ATOM 12453 CB ASN B 369 -20.243 -14.569 -5.712 1.00 13.33 C ATOM 12454 CG ASN B 369 -21.284 -13.993 -4.750 1.00 9.87 C ATOM 12455 OD1 ASN B 369 -22.434 -14.409 -4.755 1.00 17.89 O ATOM 12456 ND2 ASN B 369 -20.976 -12.880 -4.059 1.00 10.91 N ATOM 12457 HA ASN B 369 -21.429 -16.182 -6.532 1.00 0.00 H ATOM 12458 HB2 ASN B 369 -19.609 -15.266 -5.164 1.00 0.00 H ATOM 12459 HB3 ASN B 369 -19.633 -13.752 -6.097 1.00 0.00 H ATOM 12460 HD22 ASN B 369 -19.998 -12.525 -4.054 1.00 0.00 H ATOM 12461 HD21 ASN B 369 -21.715 -12.375 -3.530 1.00 0.00 H ATOM 12462 H ASN B 369 -19.200 -15.035 -8.234 1.00 0.00 H ATOM 12463 N PRO B 370 -23.035 -14.624 -7.966 1.00 9.98 N ATOM 12464 CA PRO B 370 -23.812 -13.625 -8.706 1.00 16.07 C ATOM 12465 C PRO B 370 -24.642 -12.677 -7.837 1.00 7.45 C ATOM 12466 O PRO B 370 -25.483 -11.957 -8.344 1.00 8.58 O ATOM 12467 CB PRO B 370 -24.818 -14.526 -9.458 1.00 8.87 C ATOM 12468 CG PRO B 370 -25.131 -15.596 -8.435 1.00 12.12 C ATOM 12469 CD PRO B 370 -23.755 -15.943 -7.897 1.00 6.62 C ATOM 12470 HA PRO B 370 -23.152 -12.983 -9.289 1.00 0.00 H ATOM 12471 HD3 PRO B 370 -23.813 -16.307 -6.871 1.00 0.00 H ATOM 12472 HD2 PRO B 370 -23.266 -16.692 -8.520 1.00 0.00 H ATOM 12473 HG3 PRO B 370 -25.603 -16.461 -8.900 1.00 0.00 H ATOM 12474 HG2 PRO B 370 -25.778 -15.211 -7.647 1.00 0.00 H ATOM 12475 HB2 PRO B 370 -25.714 -13.971 -9.734 1.00 0.00 H ATOM 12476 HB3 PRO B 370 -24.369 -14.956 -10.353 1.00 0.00 H ATOM 12477 N TRP B 371 -24.418 -12.730 -6.521 1.00 11.47 N ATOM 12478 CA TRP B 371 -25.131 -11.950 -5.527 1.00 6.60 C ATOM 12479 C TRP B 371 -24.533 -10.604 -5.219 1.00 10.03 C ATOM 12480 O TRP B 371 -23.353 -10.347 -5.426 1.00 10.77 O ATOM 12481 CB TRP B 371 -25.240 -12.782 -4.212 1.00 6.02 C ATOM 12482 CG TRP B 371 -25.738 -14.170 -4.511 1.00 3.71 C ATOM 12483 CD1 TRP B 371 -25.047 -15.342 -4.467 1.00 9.76 C ATOM 12484 CD2 TRP B 371 -27.061 -14.494 -4.900 1.00 9.41 C ATOM 12485 NE1 TRP B 371 -25.880 -16.375 -4.783 1.00 14.04 N ATOM 12486 CE2 TRP B 371 -27.107 -15.889 -5.066 1.00 19.90 C ATOM 12487 CE3 TRP B 371 -28.199 -13.752 -5.127 1.00 9.27 C ATOM 12488 CZ2 TRP B 371 -28.290 -16.524 -5.442 1.00 27.32 C ATOM 12489 CZ3 TRP B 371 -29.370 -14.372 -5.490 1.00 23.28 C ATOM 12490 CH2 TRP B 371 -29.413 -15.765 -5.648 1.00 21.80 C ATOM 12491 HA TRP B 371 -26.109 -11.739 -5.960 1.00 0.00 H ATOM 12492 HB2 TRP B 371 -24.258 -12.845 -3.744 1.00 0.00 H ATOM 12493 HB3 TRP B 371 -25.934 -12.290 -3.531 1.00 0.00 H ATOM 12494 HE1 TRP B 371 -25.612 -17.380 -4.803 1.00 0.00 H ATOM 12495 HD1 TRP B 371 -23.990 -15.440 -4.218 1.00 0.00 H ATOM 12496 HZ2 TRP B 371 -28.321 -17.606 -5.570 1.00 0.00 H ATOM 12497 HH2 TRP B 371 -30.347 -16.248 -5.937 1.00 0.00 H ATOM 12498 HZ3 TRP B 371 -30.269 -13.779 -5.656 1.00 0.00 H ATOM 12499 HE3 TRP B 371 -28.170 -12.668 -5.018 1.00 0.00 H ATOM 12500 H TRP B 371 -23.678 -13.378 -6.184 1.00 0.00 H ATOM 12501 N PRO B 372 -25.380 -9.748 -4.690 1.00 8.09 N ATOM 12502 CA PRO B 372 -24.825 -8.435 -4.394 1.00 7.04 C ATOM 12503 C PRO B 372 -23.919 -8.394 -3.175 1.00 7.73 C ATOM 12504 O PRO B 372 -24.000 -9.223 -2.283 1.00 7.18 O ATOM 12505 CB PRO B 372 -26.010 -7.527 -4.064 1.00 11.22 C ATOM 12506 CG PRO B 372 -27.183 -8.493 -3.820 1.00 9.35 C ATOM 12507 CD PRO B 372 -26.860 -9.801 -4.535 1.00 5.76 C ATOM 12508 HA PRO B 372 -24.231 -8.137 -5.258 1.00 0.00 H ATOM 12509 HD3 PRO B 372 -27.160 -10.660 -3.934 1.00 0.00 H ATOM 12510 HD2 PRO B 372 -27.353 -9.848 -5.506 1.00 0.00 H ATOM 12511 HG3 PRO B 372 -28.104 -8.068 -4.220 1.00 0.00 H ATOM 12512 HG2 PRO B 372 -27.301 -8.673 -2.751 1.00 0.00 H ATOM 12513 HB2 PRO B 372 -25.806 -6.936 -3.171 1.00 0.00 H ATOM 12514 HB3 PRO B 372 -26.228 -6.860 -4.898 1.00 0.00 H ATOM 12515 N ASN B 373 -23.059 -7.371 -3.157 1.00 6.18 N ATOM 12516 CA ASN B 373 -22.119 -7.098 -2.099 1.00 5.36 C ATOM 12517 C ASN B 373 -22.530 -5.776 -1.461 1.00 10.56 C ATOM 12518 O ASN B 373 -23.452 -5.098 -1.928 1.00 8.72 O ATOM 12519 CB ASN B 373 -20.670 -7.203 -2.563 1.00 3.30 C ATOM 12520 CG ASN B 373 -20.352 -6.173 -3.654 1.00 6.06 C ATOM 12521 OD1 ASN B 373 -20.551 -4.947 -3.403 1.00 8.81 O ATOM 12522 ND2 ASN B 373 -19.736 -6.579 -4.786 1.00 4.33 N ATOM 12523 HA ASN B 373 -22.154 -7.862 -1.322 1.00 0.00 H ATOM 12524 HB2 ASN B 373 -20.012 -7.031 -1.711 1.00 0.00 H ATOM 12525 HB3 ASN B 373 -20.496 -8.204 -2.959 1.00 0.00 H ATOM 12526 HD22 ASN B 373 -19.588 -7.593 -4.962 1.00 0.00 H ATOM 12527 HD21 ASN B 373 -19.410 -5.877 -5.481 1.00 0.00 H ATOM 12528 H ASN B 373 -23.069 -6.722 -3.969 1.00 0.00 H ATOM 12529 N VAL B 374 -21.902 -5.389 -0.346 1.00 7.46 N ATOM 12530 CA VAL B 374 -22.166 -4.203 0.418 1.00 6.50 C ATOM 12531 C VAL B 374 -22.257 -2.928 -0.438 1.00 9.38 C ATOM 12532 O VAL B 374 -23.080 -2.023 -0.226 1.00 11.71 O ATOM 12533 CB VAL B 374 -21.124 -4.075 1.559 1.00 4.26 C ATOM 12534 CG1 VAL B 374 -19.720 -3.771 0.976 1.00 4.23 C ATOM 12535 CG2 VAL B 374 -21.515 -3.012 2.579 1.00 3.92 C ATOM 12536 HA VAL B 374 -23.158 -4.309 0.857 1.00 0.00 H ATOM 12537 HB VAL B 374 -21.097 -5.031 2.081 1.00 0.00 H ATOM 12538 HG11 VAL B 374 -19.421 -4.581 0.310 1.00 0.00 H ATOM 12539 HG12 VAL B 374 -19.754 -2.835 0.419 1.00 0.00 H ATOM 12540 HG13 VAL B 374 -19.001 -3.684 1.790 1.00 0.00 H ATOM 12541 HG21 VAL B 374 -21.594 -2.045 2.082 1.00 0.00 H ATOM 12542 HG22 VAL B 374 -22.475 -3.273 3.024 1.00 0.00 H ATOM 12543 HG23 VAL B 374 -20.754 -2.960 3.358 1.00 0.00 H ATOM 12544 H VAL B 374 -21.145 -6.011 0.003 1.00 0.00 H ATOM 12545 N ASP B 375 -21.404 -2.808 -1.446 1.00 6.79 N ATOM 12546 CA ASP B 375 -21.430 -1.604 -2.239 1.00 5.93 C ATOM 12547 C ASP B 375 -22.669 -1.364 -3.090 1.00 12.93 C ATOM 12548 O ASP B 375 -22.938 -0.202 -3.491 1.00 7.85 O ATOM 12549 CB ASP B 375 -20.186 -1.564 -3.131 1.00 3.00 C ATOM 12550 CG ASP B 375 -18.855 -1.708 -2.467 1.00 5.83 C ATOM 12551 OD1 ASP B 375 -18.720 -0.971 -1.390 1.00 7.63 O ATOM 12552 OD2 ASP B 375 -18.066 -2.542 -2.767 1.00 16.02 O ATOM 12553 HA ASP B 375 -21.450 -0.797 -1.506 1.00 0.00 H ATOM 12554 HB2 ASP B 375 -20.278 -2.372 -3.857 1.00 0.00 H ATOM 12555 HB3 ASP B 375 -20.189 -0.607 -3.653 1.00 0.00 H ATOM 12556 H ASP B 375 -20.728 -3.569 -1.661 1.00 0.00 H ATOM 12557 N ALA B 376 -23.407 -2.464 -3.322 1.00 3.18 N ATOM 12558 CA ALA B 376 -24.603 -2.266 -4.118 1.00 3.18 C ATOM 12559 C ALA B 376 -25.662 -1.501 -3.364 1.00 12.15 C ATOM 12560 O ALA B 376 -26.514 -0.960 -4.085 1.00 7.63 O ATOM 12561 CB ALA B 376 -25.233 -3.644 -4.524 1.00 6.15 C ATOM 12562 HA ALA B 376 -24.293 -1.701 -4.997 1.00 0.00 H ATOM 12563 HB1 ALA B 376 -24.511 -4.214 -5.108 1.00 0.00 H ATOM 12564 HB2 ALA B 376 -25.496 -4.201 -3.625 1.00 0.00 H ATOM 12565 HB3 ALA B 376 -26.129 -3.471 -5.120 1.00 0.00 H ATOM 12566 H ALA B 376 -23.137 -3.398 -2.954 1.00 0.00 H ATOM 12567 N HIS B 377 -25.636 -1.435 -2.003 1.00 4.75 N ATOM 12568 CA HIS B 377 -26.717 -0.754 -1.303 1.00 6.92 C ATOM 12569 C HIS B 377 -26.384 0.441 -0.448 1.00 13.76 C ATOM 12570 O HIS B 377 -27.244 1.041 0.156 1.00 11.78 O ATOM 12571 CB HIS B 377 -27.317 -1.800 -0.316 1.00 8.68 C ATOM 12572 CG HIS B 377 -28.807 -1.691 -0.265 1.00 7.89 C ATOM 12573 ND1 HIS B 377 -29.436 -0.496 0.065 1.00 12.01 N ATOM 12574 CD2 HIS B 377 -29.753 -2.628 -0.517 1.00 11.34 C ATOM 12575 CE1 HIS B 377 -30.762 -0.728 0.010 1.00 13.69 C ATOM 12576 NE2 HIS B 377 -30.982 -2.001 -0.332 1.00 11.22 N ATOM 12577 HA HIS B 377 -27.356 -0.372 -2.099 1.00 0.00 H ATOM 12578 HB2 HIS B 377 -27.043 -2.802 -0.647 1.00 0.00 H ATOM 12579 HB3 HIS B 377 -26.912 -1.625 0.680 1.00 0.00 H ATOM 12580 HD2 HIS B 377 -29.585 -3.665 -0.807 1.00 0.00 H ATOM 12581 HE1 HIS B 377 -31.538 0.010 0.214 1.00 0.00 H ATOM 12582 H HIS B 377 -24.854 -1.866 -1.470 1.00 0.00 H ATOM 12583 N SER B 378 -25.136 0.806 -0.363 1.00 7.23 N ATOM 12584 CA SER B 378 -24.705 1.906 0.479 1.00 10.32 C ATOM 12585 C SER B 378 -24.992 3.315 0.000 1.00 10.25 C ATOM 12586 O SER B 378 -25.637 4.081 0.733 1.00 6.89 O ATOM 12587 CB SER B 378 -23.283 1.640 0.938 1.00 5.72 C ATOM 12588 OG SER B 378 -22.320 1.754 -0.094 1.00 7.63 O ATOM 12589 HA SER B 378 -25.364 1.912 1.347 1.00 0.00 H ATOM 12590 HB2 SER B 378 -23.235 0.629 1.343 1.00 0.00 H ATOM 12591 HB3 SER B 378 -23.035 2.356 1.721 1.00 0.00 H ATOM 12592 HG SER B 378 -21.420 1.569 0.274 1.00 0.00 H ATOM 12593 H SER B 378 -24.424 0.291 -0.918 1.00 0.00 H ATOM 12594 N GLY B 379 -24.561 3.648 -1.196 1.00 10.09 N ATOM 12595 CA GLY B 379 -24.796 5.005 -1.701 1.00 11.21 C ATOM 12596 C GLY B 379 -26.242 5.442 -1.816 1.00 12.94 C ATOM 12597 O GLY B 379 -26.524 6.636 -1.745 1.00 10.25 O ATOM 12598 HA3 GLY B 379 -24.350 5.071 -2.693 1.00 0.00 H ATOM 12599 HA2 GLY B 379 -24.292 5.700 -1.030 1.00 0.00 H ATOM 12600 H GLY B 379 -24.056 2.953 -1.782 1.00 0.00 H ATOM 12601 N VAL B 380 -27.143 4.495 -1.991 1.00 15.07 N ATOM 12602 CA VAL B 380 -28.578 4.714 -2.132 1.00 15.96 C ATOM 12603 C VAL B 380 -29.099 5.330 -0.865 1.00 13.73 C ATOM 12604 O VAL B 380 -29.924 6.230 -0.885 1.00 11.92 O ATOM 12605 CB VAL B 380 -29.393 3.486 -2.569 1.00 12.55 C ATOM 12606 CG1 VAL B 380 -30.863 3.737 -2.379 1.00 22.47 C ATOM 12607 CG2 VAL B 380 -29.342 3.510 -4.094 1.00 26.75 C ATOM 12608 HA VAL B 380 -28.714 5.401 -2.968 1.00 0.00 H ATOM 12609 HB VAL B 380 -29.022 2.607 -2.042 1.00 0.00 H ATOM 12610 HG11 VAL B 380 -31.063 3.940 -1.327 1.00 0.00 H ATOM 12611 HG12 VAL B 380 -31.164 4.595 -2.979 1.00 0.00 H ATOM 12612 HG13 VAL B 380 -31.424 2.857 -2.694 1.00 0.00 H ATOM 12613 HG21 VAL B 380 -29.783 4.439 -4.456 1.00 0.00 H ATOM 12614 HG22 VAL B 380 -28.305 3.446 -4.423 1.00 0.00 H ATOM 12615 HG23 VAL B 380 -29.902 2.662 -4.488 1.00 0.00 H ATOM 12616 H VAL B 380 -26.803 3.513 -2.032 1.00 0.00 H ATOM 12617 N LEU B 381 -28.578 4.846 0.242 1.00 7.94 N ATOM 12618 CA LEU B 381 -28.955 5.357 1.518 1.00 7.19 C ATOM 12619 C LEU B 381 -28.427 6.771 1.703 1.00 9.25 C ATOM 12620 O LEU B 381 -29.128 7.625 2.225 1.00 11.06 O ATOM 12621 CB LEU B 381 -28.349 4.459 2.618 1.00 7.92 C ATOM 12622 CG LEU B 381 -28.758 2.997 2.517 1.00 11.51 C ATOM 12623 CD1 LEU B 381 -28.216 2.254 3.741 1.00 14.16 C ATOM 12624 CD2 LEU B 381 -30.262 2.879 2.465 1.00 21.18 C ATOM 12625 HA LEU B 381 -30.043 5.368 1.584 1.00 0.00 H ATOM 12626 HB2 LEU B 381 -27.263 4.517 2.549 1.00 0.00 H ATOM 12627 HB3 LEU B 381 -28.671 4.839 3.587 1.00 0.00 H ATOM 12628 HG LEU B 381 -28.349 2.561 1.606 1.00 0.00 H ATOM 12629 HD21 LEU B 381 -30.690 3.308 3.371 1.00 0.00 H ATOM 12630 HD22 LEU B 381 -30.637 3.416 1.594 1.00 0.00 H ATOM 12631 HD23 LEU B 381 -30.540 1.828 2.393 1.00 0.00 H ATOM 12632 HD11 LEU B 381 -27.129 2.336 3.762 1.00 0.00 H ATOM 12633 HD12 LEU B 381 -28.633 2.695 4.646 1.00 0.00 H ATOM 12634 HD13 LEU B 381 -28.501 1.204 3.683 1.00 0.00 H ATOM 12635 H LEU B 381 -27.879 4.078 0.185 1.00 0.00 H ATOM 12636 N LEU B 382 -27.201 6.997 1.299 1.00 8.80 N ATOM 12637 CA LEU B 382 -26.586 8.320 1.442 1.00 14.17 C ATOM 12638 C LEU B 382 -27.313 9.437 0.708 1.00 3.04 C ATOM 12639 O LEU B 382 -27.608 10.484 1.326 1.00 14.97 O ATOM 12640 CB LEU B 382 -25.074 8.358 1.104 1.00 10.39 C ATOM 12641 CG LEU B 382 -24.285 7.383 1.967 1.00 9.39 C ATOM 12642 CD1 LEU B 382 -22.905 7.086 1.390 1.00 12.01 C ATOM 12643 CD2 LEU B 382 -24.194 7.924 3.410 1.00 11.45 C ATOM 12644 HA LEU B 382 -26.691 8.512 2.510 1.00 0.00 H ATOM 12645 HB2 LEU B 382 -24.938 8.093 0.055 1.00 0.00 H ATOM 12646 HB3 LEU B 382 -24.698 9.367 1.274 1.00 0.00 H ATOM 12647 HG LEU B 382 -24.817 6.432 1.980 1.00 0.00 H ATOM 12648 HD21 LEU B 382 -23.691 8.891 3.403 1.00 0.00 H ATOM 12649 HD22 LEU B 382 -25.198 8.038 3.818 1.00 0.00 H ATOM 12650 HD23 LEU B 382 -23.629 7.223 4.024 1.00 0.00 H ATOM 12651 HD11 LEU B 382 -23.014 6.648 0.398 1.00 0.00 H ATOM 12652 HD12 LEU B 382 -22.335 8.013 1.319 1.00 0.00 H ATOM 12653 HD13 LEU B 382 -22.383 6.386 2.042 1.00 0.00 H ATOM 12654 H LEU B 382 -26.654 6.224 0.869 1.00 0.00 H ATOM 12655 N GLN B 383 -27.581 9.204 -0.597 1.00 13.14 N ATOM 12656 CA GLN B 383 -28.265 10.086 -1.518 1.00 13.79 C ATOM 12657 C GLN B 383 -29.604 10.516 -0.926 1.00 15.69 C ATOM 12658 O GLN B 383 -30.010 11.655 -0.993 1.00 16.16 O ATOM 12659 CB GLN B 383 -28.495 9.275 -2.845 1.00 16.42 C ATOM 12660 CG GLN B 383 -29.815 9.386 -3.654 1.00 60.93 C ATOM 12661 CD GLN B 383 -31.196 8.890 -3.186 1.00 38.23 C ATOM 12662 OE1 GLN B 383 -32.192 9.596 -3.449 1.00 80.00 O ATOM 12663 NE2 GLN B 383 -31.395 7.647 -2.733 1.00 11.34 N ATOM 12664 HA GLN B 383 -27.678 10.984 -1.710 1.00 0.00 H ATOM 12665 HB2 GLN B 383 -27.694 9.566 -3.525 1.00 0.00 H ATOM 12666 HB3 GLN B 383 -28.384 8.223 -2.584 1.00 0.00 H ATOM 12667 HG2 GLN B 383 -29.943 10.450 -3.852 1.00 0.00 H ATOM 12668 HG3 GLN B 383 -29.623 8.864 -4.591 1.00 0.00 H ATOM 12669 HE22 GLN B 383 -30.582 7.040 -2.507 1.00 0.00 H ATOM 12670 HE21 GLN B 383 -32.363 7.288 -2.607 1.00 0.00 H ATOM 12671 H GLN B 383 -27.261 8.292 -0.980 1.00 0.00 H ATOM 12672 N TYR B 384 -30.335 9.603 -0.339 1.00 7.73 N ATOM 12673 CA TYR B 384 -31.632 9.912 0.233 1.00 8.26 C ATOM 12674 C TYR B 384 -31.596 11.003 1.275 1.00 18.51 C ATOM 12675 O TYR B 384 -32.557 11.725 1.428 1.00 9.94 O ATOM 12676 CB TYR B 384 -32.160 8.650 0.918 1.00 14.61 C ATOM 12677 CG TYR B 384 -33.446 8.925 1.611 1.00 16.00 C ATOM 12678 CD1 TYR B 384 -34.612 9.065 0.865 1.00 17.86 C ATOM 12679 CD2 TYR B 384 -33.516 9.050 2.997 1.00 17.58 C ATOM 12680 CE1 TYR B 384 -35.853 9.337 1.439 1.00 19.23 C ATOM 12681 CE2 TYR B 384 -34.749 9.328 3.591 1.00 24.09 C ATOM 12682 CZ TYR B 384 -35.907 9.467 2.823 1.00 24.73 C ATOM 12683 OH TYR B 384 -37.100 9.729 3.432 1.00 36.76 O ATOM 12684 HA TYR B 384 -32.262 10.259 -0.586 1.00 0.00 H ATOM 12685 HB3 TYR B 384 -31.427 8.306 1.647 1.00 0.00 H ATOM 12686 HB2 TYR B 384 -32.316 7.875 0.168 1.00 0.00 H ATOM 12687 HD2 TYR B 384 -32.621 8.933 3.609 1.00 0.00 H ATOM 12688 HE2 TYR B 384 -34.809 9.438 4.674 1.00 0.00 H ATOM 12689 HE1 TYR B 384 -36.748 9.444 0.826 1.00 0.00 H ATOM 12690 HD1 TYR B 384 -34.552 8.957 -0.218 1.00 0.00 H ATOM 12691 HH TYR B 384 -37.811 9.796 2.747 1.00 0.00 H ATOM 12692 H TYR B 384 -29.976 8.629 -0.281 1.00 0.00 H ATOM 12693 N TYR B 385 -30.497 11.115 2.011 1.00 13.17 N ATOM 12694 CA TYR B 385 -30.394 12.121 3.050 1.00 15.65 C ATOM 12695 C TYR B 385 -29.749 13.390 2.546 1.00 13.01 C ATOM 12696 O TYR B 385 -29.428 14.242 3.366 1.00 11.46 O ATOM 12697 CB TYR B 385 -29.624 11.617 4.288 1.00 13.84 C ATOM 12698 CG TYR B 385 -30.471 10.591 4.969 1.00 11.89 C ATOM 12699 CD1 TYR B 385 -31.569 10.989 5.737 1.00 15.51 C ATOM 12700 CD2 TYR B 385 -30.204 9.224 4.881 1.00 7.85 C ATOM 12701 CE1 TYR B 385 -32.412 10.095 6.398 1.00 18.10 C ATOM 12702 CE2 TYR B 385 -31.041 8.310 5.532 1.00 13.87 C ATOM 12703 CZ TYR B 385 -32.137 8.730 6.301 1.00 13.64 C ATOM 12704 OH TYR B 385 -32.950 7.840 6.945 1.00 15.71 O ATOM 12705 HA TYR B 385 -31.420 12.337 3.347 1.00 0.00 H ATOM 12706 HB3 TYR B 385 -29.430 12.447 4.967 1.00 0.00 H ATOM 12707 HB2 TYR B 385 -28.678 11.172 3.980 1.00 0.00 H ATOM 12708 HD2 TYR B 385 -29.347 8.869 4.308 1.00 0.00 H ATOM 12709 HE2 TYR B 385 -30.836 7.244 5.439 1.00 0.00 H ATOM 12710 HE1 TYR B 385 -33.264 10.454 6.976 1.00 0.00 H ATOM 12711 HD1 TYR B 385 -31.778 12.055 5.824 1.00 0.00 H ATOM 12712 HH TYR B 385 -33.659 8.333 7.429 1.00 0.00 H ATOM 12713 H TYR B 385 -29.698 10.472 1.840 1.00 0.00 H ATOM 12714 N GLY B 386 -29.531 13.532 1.239 1.00 4.48 N ATOM 12715 CA GLY B 386 -28.890 14.740 0.730 1.00 10.59 C ATOM 12716 C GLY B 386 -27.374 14.626 0.368 1.00 13.62 C ATOM 12717 O GLY B 386 -26.799 15.554 -0.249 1.00 12.89 O ATOM 12718 HA3 GLY B 386 -28.992 15.515 1.490 1.00 0.00 H ATOM 12719 HA2 GLY B 386 -29.424 15.044 -0.170 1.00 0.00 H ATOM 12720 H GLY B 386 -29.818 12.780 0.580 1.00 0.00 H ATOM 12721 N MET B 387 -26.689 13.522 0.735 1.00 16.70 N ATOM 12722 CA MET B 387 -25.277 13.390 0.391 1.00 7.62 C ATOM 12723 C MET B 387 -25.212 12.792 -1.004 1.00 4.28 C ATOM 12724 O MET B 387 -25.119 11.614 -1.295 1.00 8.67 O ATOM 12725 CB MET B 387 -24.595 12.539 1.419 1.00 6.10 C ATOM 12726 CG MET B 387 -23.119 12.620 1.125 1.00 14.37 C ATOM 12727 SD MET B 387 -22.150 11.670 2.306 1.00 16.28 S ATOM 12728 CE MET B 387 -22.029 12.847 3.646 1.00 15.08 C ATOM 12729 HA MET B 387 -24.760 14.349 0.387 1.00 0.00 H ATOM 12730 HB2 MET B 387 -24.802 12.917 2.420 1.00 0.00 H ATOM 12731 HB3 MET B 387 -24.939 11.507 1.344 1.00 0.00 H ATOM 12732 HG2 MET B 387 -22.807 13.663 1.170 1.00 0.00 H ATOM 12733 HG3 MET B 387 -22.936 12.230 0.124 1.00 0.00 H ATOM 12734 HE1 MET B 387 -21.530 13.749 3.292 1.00 0.00 H ATOM 12735 HE2 MET B 387 -23.029 13.098 3.999 1.00 0.00 H ATOM 12736 HE3 MET B 387 -21.454 12.409 4.462 1.00 0.00 H ATOM 12737 H MET B 387 -27.168 12.765 1.263 1.00 0.00 H ATOM 12738 N THR B 388 -25.301 13.670 -1.957 1.00 7.12 N ATOM 12739 CA THR B 388 -25.326 13.258 -3.320 1.00 10.26 C ATOM 12740 C THR B 388 -23.991 13.311 -4.010 1.00 8.72 C ATOM 12741 O THR B 388 -23.978 13.028 -5.205 1.00 13.84 O ATOM 12742 CB THR B 388 -26.342 14.174 -4.090 1.00 14.19 C ATOM 12743 OG1 THR B 388 -25.887 15.513 -3.987 1.00 80.00 O ATOM 12744 CG2 THR B 388 -27.843 14.058 -3.614 1.00 20.23 C ATOM 12745 HA THR B 388 -25.624 12.210 -3.329 1.00 0.00 H ATOM 12746 HB THR B 388 -26.363 13.830 -5.124 1.00 0.00 H ATOM 12747 HG1 THR B 388 -26.514 16.111 -4.466 1.00 0.00 H ATOM 12748 HG23 THR B 388 -28.172 13.022 -3.701 1.00 0.00 H ATOM 12749 HG21 THR B 388 -27.919 14.378 -2.575 1.00 0.00 H ATOM 12750 HG22 THR B 388 -28.471 14.694 -4.238 1.00 0.00 H ATOM 12751 H THR B 388 -25.354 14.682 -1.723 1.00 0.00 H ATOM 12752 N GLU B 389 -22.913 13.652 -3.321 1.00 8.96 N ATOM 12753 CA GLU B 389 -21.605 13.735 -3.948 1.00 9.15 C ATOM 12754 C GLU B 389 -21.014 12.340 -3.953 1.00 10.42 C ATOM 12755 O GLU B 389 -20.326 11.957 -3.023 1.00 7.92 O ATOM 12756 CB GLU B 389 -20.689 14.648 -3.121 1.00 7.26 C ATOM 12757 CG GLU B 389 -21.245 16.112 -3.112 1.00 9.24 C ATOM 12758 CD GLU B 389 -22.224 16.445 -2.000 1.00 22.17 C ATOM 12759 OE1 GLU B 389 -22.528 15.454 -1.251 1.00 10.99 O ATOM 12760 OE2 GLU B 389 -22.754 17.538 -1.812 1.00 19.05 O ATOM 12761 HA GLU B 389 -21.695 14.135 -4.958 1.00 0.00 H ATOM 12762 HB2 GLU B 389 -20.639 14.276 -2.098 1.00 0.00 H ATOM 12763 HB3 GLU B 389 -19.690 14.645 -3.557 1.00 0.00 H ATOM 12764 HG2 GLU B 389 -20.397 16.791 -3.024 1.00 0.00 H ATOM 12765 HG3 GLU B 389 -21.749 16.284 -4.063 1.00 0.00 H ATOM 12766 H GLU B 389 -23.005 13.865 -2.307 1.00 0.00 H ATOM 12767 N MET B 390 -21.317 11.584 -5.026 1.00 3.00 N ATOM 12768 CA MET B 390 -20.858 10.184 -5.188 1.00 11.52 C ATOM 12769 C MET B 390 -19.374 9.855 -5.231 1.00 4.55 C ATOM 12770 O MET B 390 -19.031 8.735 -4.881 1.00 11.47 O ATOM 12771 CB MET B 390 -21.679 9.378 -6.198 1.00 16.83 C ATOM 12772 CG MET B 390 -21.179 9.648 -7.581 1.00 27.28 C ATOM 12773 SD MET B 390 -22.308 10.746 -8.475 1.00 41.42 S ATOM 12774 CE MET B 390 -23.785 9.742 -8.593 1.00 17.32 C ATOM 12775 HA MET B 390 -21.084 9.833 -4.181 1.00 0.00 H ATOM 12776 HB2 MET B 390 -21.582 8.315 -5.978 1.00 0.00 H ATOM 12777 HB3 MET B 390 -22.727 9.668 -6.128 1.00 0.00 H ATOM 12778 HG2 MET B 390 -21.096 8.705 -8.121 1.00 0.00 H ATOM 12779 HG3 MET B 390 -20.197 10.118 -7.520 1.00 0.00 H ATOM 12780 HE1 MET B 390 -23.558 8.826 -9.138 1.00 0.00 H ATOM 12781 HE2 MET B 390 -24.134 9.493 -7.591 1.00 0.00 H ATOM 12782 HE3 MET B 390 -24.559 10.298 -9.121 1.00 0.00 H ATOM 12783 H MET B 390 -21.901 12.003 -5.777 1.00 0.00 H ATOM 12784 N ASN B 391 -18.532 10.833 -5.645 1.00 5.53 N ATOM 12785 CA ASN B 391 -17.093 10.645 -5.683 1.00 4.28 C ATOM 12786 C ASN B 391 -16.563 10.711 -4.251 1.00 10.64 C ATOM 12787 O ASN B 391 -15.405 10.449 -4.010 1.00 10.38 O ATOM 12788 CB ASN B 391 -16.340 11.672 -6.553 1.00 15.16 C ATOM 12789 CG ASN B 391 -16.600 11.398 -8.014 1.00 25.79 C ATOM 12790 OD1 ASN B 391 -15.940 11.940 -8.907 1.00 48.69 O ATOM 12791 ND2 ASN B 391 -17.653 10.628 -8.265 1.00 80.00 N ATOM 12792 HA ASN B 391 -16.912 9.674 -6.145 1.00 0.00 H ATOM 12793 HB2 ASN B 391 -16.685 12.676 -6.307 1.00 0.00 H ATOM 12794 HB3 ASN B 391 -15.271 11.598 -6.356 1.00 0.00 H ATOM 12795 HD22 ASN B 391 -18.178 10.193 -7.480 1.00 0.00 H ATOM 12796 HD21 ASN B 391 -17.952 10.460 -9.247 1.00 0.00 H ATOM 12797 H ASN B 391 -18.929 11.746 -5.945 1.00 0.00 H ATOM 12798 N TYR B 392 -17.389 11.073 -3.303 1.00 8.12 N ATOM 12799 CA TYR B 392 -16.932 11.165 -1.930 1.00 6.24 C ATOM 12800 C TYR B 392 -17.285 9.905 -1.130 1.00 10.99 C ATOM 12801 O TYR B 392 -16.781 9.652 -0.030 1.00 6.82 O ATOM 12802 CB TYR B 392 -17.650 12.362 -1.256 1.00 11.46 C ATOM 12803 CG TYR B 392 -17.159 12.594 0.168 1.00 6.57 C ATOM 12804 CD1 TYR B 392 -15.971 13.265 0.468 1.00 4.49 C ATOM 12805 CD2 TYR B 392 -17.943 12.175 1.233 1.00 3.00 C ATOM 12806 CE1 TYR B 392 -15.512 13.487 1.773 1.00 3.00 C ATOM 12807 CE2 TYR B 392 -17.493 12.375 2.550 1.00 6.16 C ATOM 12808 CZ TYR B 392 -16.294 13.034 2.828 1.00 9.88 C ATOM 12809 OH TYR B 392 -15.897 13.234 4.142 1.00 5.08 O ATOM 12810 HA TYR B 392 -15.849 11.286 -1.940 1.00 0.00 H ATOM 12811 HB3 TYR B 392 -18.721 12.162 -1.231 1.00 0.00 H ATOM 12812 HB2 TYR B 392 -17.464 13.261 -1.844 1.00 0.00 H ATOM 12813 HD2 TYR B 392 -18.903 11.693 1.050 1.00 0.00 H ATOM 12814 HE2 TYR B 392 -18.098 12.005 3.378 1.00 0.00 H ATOM 12815 HE1 TYR B 392 -14.568 14.001 1.955 1.00 0.00 H ATOM 12816 HD1 TYR B 392 -15.367 13.637 -0.360 1.00 0.00 H ATOM 12817 HH TYR B 392 -15.031 13.713 4.155 1.00 0.00 H ATOM 12818 H TYR B 392 -18.378 11.296 -3.535 1.00 0.00 H ATOM 12819 N TYR B 393 -18.183 9.044 -1.618 1.00 5.05 N ATOM 12820 CA TYR B 393 -18.606 7.831 -0.885 1.00 11.76 C ATOM 12821 C TYR B 393 -17.547 6.873 -0.277 1.00 7.30 C ATOM 12822 O TYR B 393 -17.661 6.303 0.830 1.00 5.23 O ATOM 12823 CB TYR B 393 -19.656 7.049 -1.706 1.00 12.27 C ATOM 12824 CG TYR B 393 -20.982 7.781 -1.958 1.00 9.81 C ATOM 12825 CD1 TYR B 393 -21.273 9.023 -1.387 1.00 7.27 C ATOM 12826 CD2 TYR B 393 -21.919 7.178 -2.797 1.00 12.13 C ATOM 12827 CE1 TYR B 393 -22.493 9.673 -1.619 1.00 8.40 C ATOM 12828 CE2 TYR B 393 -23.149 7.799 -3.018 1.00 13.72 C ATOM 12829 CZ TYR B 393 -23.434 9.039 -2.437 1.00 11.09 C ATOM 12830 OH TYR B 393 -24.626 9.643 -2.706 1.00 13.50 O ATOM 12831 HA TYR B 393 -19.020 8.265 0.025 1.00 0.00 H ATOM 12832 HB3 TYR B 393 -19.879 6.125 -1.172 1.00 0.00 H ATOM 12833 HB2 TYR B 393 -19.215 6.811 -2.674 1.00 0.00 H ATOM 12834 HD2 TYR B 393 -21.692 6.226 -3.278 1.00 0.00 H ATOM 12835 HE2 TYR B 393 -23.894 7.314 -3.649 1.00 0.00 H ATOM 12836 HE1 TYR B 393 -22.703 10.646 -1.174 1.00 0.00 H ATOM 12837 HD1 TYR B 393 -20.532 9.499 -0.745 1.00 0.00 H ATOM 12838 HH TYR B 393 -24.674 10.506 -2.223 1.00 0.00 H ATOM 12839 H TYR B 393 -18.601 9.235 -2.551 1.00 0.00 H ATOM 12840 N THR B 394 -16.491 6.653 -1.069 1.00 7.72 N ATOM 12841 CA THR B 394 -15.409 5.758 -0.639 1.00 4.88 C ATOM 12842 C THR B 394 -14.664 6.286 0.611 1.00 5.06 C ATOM 12843 O THR B 394 -14.099 5.541 1.420 1.00 6.23 O ATOM 12844 CB THR B 394 -14.478 5.469 -1.840 1.00 3.13 C ATOM 12845 OG1 THR B 394 -15.335 5.080 -2.892 1.00 4.21 O ATOM 12846 CG2 THR B 394 -13.566 4.275 -1.508 1.00 4.64 C ATOM 12847 HA THR B 394 -15.839 4.810 -0.314 1.00 0.00 H ATOM 12848 HB THR B 394 -13.862 6.334 -2.087 1.00 0.00 H ATOM 12849 HG1 THR B 394 -15.967 5.816 -3.091 1.00 0.00 H ATOM 12850 HG23 THR B 394 -12.892 4.549 -0.696 1.00 0.00 H ATOM 12851 HG21 THR B 394 -14.178 3.426 -1.203 1.00 0.00 H ATOM 12852 HG22 THR B 394 -12.984 4.007 -2.390 1.00 0.00 H ATOM 12853 H THR B 394 -16.436 7.120 -1.997 1.00 0.00 H ATOM 12854 N VAL B 395 -14.640 7.592 0.780 1.00 5.69 N ATOM 12855 CA VAL B 395 -13.996 8.196 1.952 1.00 4.87 C ATOM 12856 C VAL B 395 -14.685 7.741 3.221 1.00 6.78 C ATOM 12857 O VAL B 395 -14.032 7.506 4.230 1.00 7.75 O ATOM 12858 CB VAL B 395 -14.125 9.744 1.917 1.00 6.87 C ATOM 12859 CG1 VAL B 395 -13.724 10.320 3.254 1.00 4.10 C ATOM 12860 CG2 VAL B 395 -13.174 10.277 0.842 1.00 6.66 C ATOM 12861 HA VAL B 395 -12.950 7.892 1.934 1.00 0.00 H ATOM 12862 HB VAL B 395 -15.155 10.027 1.698 1.00 0.00 H ATOM 12863 HG11 VAL B 395 -14.376 9.920 4.031 1.00 0.00 H ATOM 12864 HG12 VAL B 395 -12.691 10.048 3.470 1.00 0.00 H ATOM 12865 HG13 VAL B 395 -13.817 11.406 3.223 1.00 0.00 H ATOM 12866 HG21 VAL B 395 -12.152 9.990 1.089 1.00 0.00 H ATOM 12867 HG22 VAL B 395 -13.448 9.855 -0.125 1.00 0.00 H ATOM 12868 HG23 VAL B 395 -13.248 11.364 0.800 1.00 0.00 H ATOM 12869 H VAL B 395 -15.086 8.207 0.069 1.00 0.00 H ATOM 12870 N LEU B 396 -16.019 7.587 3.189 1.00 4.39 N ATOM 12871 CA LEU B 396 -16.743 7.148 4.386 1.00 4.50 C ATOM 12872 C LEU B 396 -16.392 5.695 4.664 1.00 8.49 C ATOM 12873 O LEU B 396 -16.261 5.233 5.810 1.00 11.26 O ATOM 12874 CB LEU B 396 -18.240 7.221 4.055 1.00 7.92 C ATOM 12875 CG LEU B 396 -18.746 8.647 3.943 1.00 13.18 C ATOM 12876 CD1 LEU B 396 -20.248 8.453 3.894 1.00 15.78 C ATOM 12877 CD2 LEU B 396 -18.415 9.385 5.230 1.00 10.18 C ATOM 12878 HA LEU B 396 -16.489 7.765 5.247 1.00 0.00 H ATOM 12879 HB2 LEU B 396 -18.413 6.714 3.106 1.00 0.00 H ATOM 12880 HB3 LEU B 396 -18.797 6.714 4.843 1.00 0.00 H ATOM 12881 HG LEU B 396 -18.329 9.199 3.101 1.00 0.00 H ATOM 12882 HD21 LEU B 396 -18.899 8.885 6.069 1.00 0.00 H ATOM 12883 HD22 LEU B 396 -17.335 9.386 5.380 1.00 0.00 H ATOM 12884 HD23 LEU B 396 -18.774 10.412 5.161 1.00 0.00 H ATOM 12885 HD11 LEU B 396 -20.506 7.841 3.030 1.00 0.00 H ATOM 12886 HD12 LEU B 396 -20.579 7.955 4.805 1.00 0.00 H ATOM 12887 HD13 LEU B 396 -20.736 9.424 3.812 1.00 0.00 H ATOM 12888 H LEU B 396 -16.541 7.780 2.311 1.00 0.00 H ATOM 12889 N PHE B 397 -16.205 4.940 3.582 1.00 3.00 N ATOM 12890 CA PHE B 397 -15.821 3.543 3.758 1.00 3.00 C ATOM 12891 C PHE B 397 -14.435 3.547 4.375 1.00 6.78 C ATOM 12892 O PHE B 397 -14.184 2.774 5.259 1.00 6.23 O ATOM 12893 CB PHE B 397 -15.791 2.904 2.336 1.00 3.00 C ATOM 12894 CG PHE B 397 -15.721 1.414 2.273 1.00 4.46 C ATOM 12895 CD1 PHE B 397 -15.268 0.583 3.302 1.00 3.00 C ATOM 12896 CD2 PHE B 397 -16.129 0.811 1.085 1.00 6.38 C ATOM 12897 CE1 PHE B 397 -15.236 -0.807 3.172 1.00 7.67 C ATOM 12898 CE2 PHE B 397 -16.102 -0.572 0.924 1.00 5.33 C ATOM 12899 CZ PHE B 397 -15.648 -1.382 1.964 1.00 6.33 C ATOM 12900 HA PHE B 397 -16.504 2.982 4.396 1.00 0.00 H ATOM 12901 HB2 PHE B 397 -16.696 3.215 1.814 1.00 0.00 H ATOM 12902 HB3 PHE B 397 -14.919 3.298 1.814 1.00 0.00 H ATOM 12903 HD2 PHE B 397 -16.477 1.436 0.263 1.00 0.00 H ATOM 12904 HE2 PHE B 397 -16.435 -1.020 -0.012 1.00 0.00 H ATOM 12905 HZ PHE B 397 -15.614 -2.464 1.836 1.00 0.00 H ATOM 12906 HE1 PHE B 397 -14.896 -1.433 3.997 1.00 0.00 H ATOM 12907 HD1 PHE B 397 -14.929 1.034 4.235 1.00 0.00 H ATOM 12908 H PHE B 397 -16.330 5.339 2.630 1.00 0.00 H ATOM 12909 N GLY B 398 -13.542 4.424 3.914 1.00 4.19 N ATOM 12910 CA GLY B 398 -12.156 4.557 4.405 1.00 3.00 C ATOM 12911 C GLY B 398 -12.183 4.851 5.892 1.00 7.97 C ATOM 12912 O GLY B 398 -11.509 4.178 6.644 1.00 8.88 O ATOM 12913 HA3 GLY B 398 -11.659 5.373 3.880 1.00 0.00 H ATOM 12914 HA2 GLY B 398 -11.614 3.628 4.226 1.00 0.00 H ATOM 12915 H GLY B 398 -13.845 5.062 3.151 1.00 0.00 H ATOM 12916 N VAL B 399 -12.989 5.841 6.329 1.00 4.45 N ATOM 12917 CA VAL B 399 -13.087 6.186 7.728 1.00 3.16 C ATOM 12918 C VAL B 399 -13.515 4.966 8.574 1.00 10.50 C ATOM 12919 O VAL B 399 -12.938 4.710 9.640 1.00 4.03 O ATOM 12920 CB VAL B 399 -14.057 7.334 7.918 1.00 3.00 C ATOM 12921 CG1 VAL B 399 -14.117 7.644 9.391 1.00 4.81 C ATOM 12922 CG2 VAL B 399 -13.506 8.612 7.270 1.00 3.68 C ATOM 12923 HA VAL B 399 -12.101 6.500 8.071 1.00 0.00 H ATOM 12924 HB VAL B 399 -15.018 7.053 7.487 1.00 0.00 H ATOM 12925 HG11 VAL B 399 -14.461 6.763 9.933 1.00 0.00 H ATOM 12926 HG12 VAL B 399 -13.124 7.924 9.743 1.00 0.00 H ATOM 12927 HG13 VAL B 399 -14.809 8.469 9.559 1.00 0.00 H ATOM 12928 HG21 VAL B 399 -12.553 8.871 7.732 1.00 0.00 H ATOM 12929 HG22 VAL B 399 -13.359 8.443 6.203 1.00 0.00 H ATOM 12930 HG23 VAL B 399 -14.215 9.427 7.416 1.00 0.00 H ATOM 12931 H VAL B 399 -13.557 6.372 5.638 1.00 0.00 H ATOM 12932 N SER B 400 -14.511 4.199 8.117 1.00 4.75 N ATOM 12933 CA SER B 400 -14.938 3.012 8.884 1.00 3.47 C ATOM 12934 C SER B 400 -13.869 1.944 8.952 1.00 10.63 C ATOM 12935 O SER B 400 -13.646 1.340 9.993 1.00 5.35 O ATOM 12936 CB SER B 400 -16.067 2.418 8.053 1.00 7.53 C ATOM 12937 OG SER B 400 -16.581 1.282 8.722 1.00 10.92 O ATOM 12938 HA SER B 400 -15.192 3.304 9.903 1.00 0.00 H ATOM 12939 HB2 SER B 400 -15.686 2.125 7.074 1.00 0.00 H ATOM 12940 HB3 SER B 400 -16.858 3.158 7.928 1.00 0.00 H ATOM 12941 HG SER B 400 -16.925 1.551 9.610 1.00 0.00 H ATOM 12942 H SER B 400 -14.984 4.439 7.222 1.00 0.00 H ATOM 12943 N ARG B 401 -13.214 1.707 7.809 1.00 4.35 N ATOM 12944 CA ARG B 401 -12.166 0.678 7.673 1.00 3.00 C ATOM 12945 C ARG B 401 -11.004 0.804 8.657 1.00 7.61 C ATOM 12946 O ARG B 401 -10.380 -0.195 9.033 1.00 8.91 O ATOM 12947 CB ARG B 401 -11.699 0.454 6.244 1.00 5.97 C ATOM 12948 CG ARG B 401 -10.888 -0.865 6.030 1.00 3.48 C ATOM 12949 CD ARG B 401 -11.440 -2.188 6.588 1.00 3.98 C ATOM 12950 NE ARG B 401 -12.811 -2.628 6.281 1.00 8.09 N ATOM 12951 CZ ARG B 401 -13.175 -3.396 5.207 1.00 3.00 C ATOM 12952 NH1 ARG B 401 -12.290 -3.783 4.279 1.00 4.13 N ATOM 12953 NH2 ARG B 401 -14.441 -3.750 5.043 1.00 3.00 N ATOM 12954 HA ARG B 401 -12.682 -0.236 7.968 1.00 0.00 H ATOM 12955 HB2 ARG B 401 -12.577 0.423 5.599 1.00 0.00 H ATOM 12956 HB3 ARG B 401 -11.067 1.294 5.956 1.00 0.00 H ATOM 12957 HG2 ARG B 401 -10.773 -0.997 4.954 1.00 0.00 H ATOM 12958 HG3 ARG B 401 -9.908 -0.713 6.483 1.00 0.00 H ATOM 12959 HD2 ARG B 401 -11.372 -2.119 7.674 1.00 0.00 H ATOM 12960 HD3 ARG B 401 -10.775 -2.975 6.233 1.00 0.00 H ATOM 12961 HE ARG B 401 -13.565 -2.331 6.933 1.00 0.00 H ATOM 12962 HH12 ARG B 401 -12.600 -4.366 3.476 1.00 0.00 H ATOM 12963 HH11 ARG B 401 -11.293 -3.500 4.362 1.00 0.00 H ATOM 12964 HH22 ARG B 401 -14.716 -4.333 4.227 1.00 0.00 H ATOM 12965 HH21 ARG B 401 -15.160 -3.445 5.730 1.00 0.00 H ATOM 12966 H ARG B 401 -13.456 2.278 6.974 1.00 0.00 H ATOM 12967 N ALA B 402 -10.733 2.037 9.049 1.00 3.00 N ATOM 12968 CA ALA B 402 -9.651 2.327 10.019 1.00 3.00 C ATOM 12969 C ALA B 402 -9.899 1.509 11.293 1.00 11.06 C ATOM 12970 O ALA B 402 -8.969 0.998 11.950 1.00 4.02 O ATOM 12971 CB ALA B 402 -9.793 3.807 10.441 1.00 3.39 C ATOM 12972 HA ALA B 402 -8.681 2.101 9.576 1.00 0.00 H ATOM 12973 HB1 ALA B 402 -9.699 4.445 9.562 1.00 0.00 H ATOM 12974 HB2 ALA B 402 -10.769 3.960 10.900 1.00 0.00 H ATOM 12975 HB3 ALA B 402 -9.010 4.056 11.157 1.00 0.00 H ATOM 12976 H ALA B 402 -11.294 2.825 8.666 1.00 0.00 H ATOM 12977 N LEU B 403 -11.169 1.353 11.703 1.00 5.64 N ATOM 12978 CA LEU B 403 -11.459 0.616 12.927 1.00 8.50 C ATOM 12979 C LEU B 403 -10.931 -0.795 12.941 1.00 11.04 C ATOM 12980 O LEU B 403 -10.363 -1.206 13.930 1.00 9.64 O ATOM 12981 CB LEU B 403 -12.983 0.613 13.244 1.00 6.80 C ATOM 12982 CG LEU B 403 -13.517 2.056 13.382 1.00 5.82 C ATOM 12983 CD1 LEU B 403 -15.016 1.959 13.630 1.00 10.12 C ATOM 12984 CD2 LEU B 403 -12.955 2.760 14.592 1.00 11.89 C ATOM 12985 HA LEU B 403 -10.923 1.156 13.708 1.00 0.00 H ATOM 12986 HB2 LEU B 403 -13.515 0.110 12.437 1.00 0.00 H ATOM 12987 HB3 LEU B 403 -13.153 0.078 14.178 1.00 0.00 H ATOM 12988 HG LEU B 403 -13.243 2.603 12.480 1.00 0.00 H ATOM 12989 HD21 LEU B 403 -13.230 2.210 15.492 1.00 0.00 H ATOM 12990 HD22 LEU B 403 -11.869 2.807 14.512 1.00 0.00 H ATOM 12991 HD23 LEU B 403 -13.361 3.770 14.644 1.00 0.00 H ATOM 12992 HD11 LEU B 403 -15.490 1.453 12.789 1.00 0.00 H ATOM 12993 HD12 LEU B 403 -15.196 1.394 14.544 1.00 0.00 H ATOM 12994 HD13 LEU B 403 -15.431 2.961 13.733 1.00 0.00 H ATOM 12995 H LEU B 403 -11.947 1.759 11.146 1.00 0.00 H ATOM 12996 N GLY B 404 -11.175 -1.517 11.872 1.00 4.91 N ATOM 12997 CA GLY B 404 -10.716 -2.891 11.847 1.00 3.00 C ATOM 12998 C GLY B 404 -9.259 -3.038 11.583 1.00 7.09 C ATOM 12999 O GLY B 404 -8.515 -3.769 12.230 1.00 5.81 O ATOM 13000 HA3 GLY B 404 -11.261 -3.421 11.066 1.00 0.00 H ATOM 13001 HA2 GLY B 404 -10.937 -3.344 12.813 1.00 0.00 H ATOM 13002 H GLY B 404 -11.686 -1.112 11.062 1.00 0.00 H ATOM 13003 N VAL B 405 -8.768 -2.342 10.621 1.00 3.04 N ATOM 13004 CA VAL B 405 -7.367 -2.517 10.346 1.00 3.00 C ATOM 13005 C VAL B 405 -6.424 -2.092 11.448 1.00 4.75 C ATOM 13006 O VAL B 405 -5.380 -2.734 11.651 1.00 7.40 O ATOM 13007 CB VAL B 405 -6.917 -2.041 8.965 1.00 17.05 C ATOM 13008 CG1 VAL B 405 -7.879 -2.518 7.891 1.00 4.17 C ATOM 13009 CG2 VAL B 405 -6.873 -0.516 8.885 1.00 6.11 C ATOM 13010 HA VAL B 405 -7.282 -3.603 10.320 1.00 0.00 H ATOM 13011 HB VAL B 405 -5.921 -2.454 8.805 1.00 0.00 H ATOM 13012 HG11 VAL B 405 -7.914 -3.607 7.894 1.00 0.00 H ATOM 13013 HG12 VAL B 405 -8.874 -2.121 8.094 1.00 0.00 H ATOM 13014 HG13 VAL B 405 -7.538 -2.167 6.917 1.00 0.00 H ATOM 13015 HG21 VAL B 405 -7.867 -0.114 9.082 1.00 0.00 H ATOM 13016 HG22 VAL B 405 -6.172 -0.135 9.627 1.00 0.00 H ATOM 13017 HG23 VAL B 405 -6.549 -0.215 7.889 1.00 0.00 H ATOM 13018 H VAL B 405 -9.355 -1.685 10.068 1.00 0.00 H ATOM 13019 N LEU B 406 -6.778 -0.978 12.145 1.00 4.73 N ATOM 13020 CA LEU B 406 -5.970 -0.494 13.227 1.00 3.43 C ATOM 13021 C LEU B 406 -6.089 -1.422 14.442 1.00 5.98 C ATOM 13022 O LEU B 406 -5.144 -1.598 15.162 1.00 7.28 O ATOM 13023 CB LEU B 406 -6.191 0.988 13.505 1.00 3.54 C ATOM 13024 CG LEU B 406 -5.792 1.864 12.305 1.00 3.66 C ATOM 13025 CD1 LEU B 406 -6.272 3.299 12.515 1.00 6.33 C ATOM 13026 CD2 LEU B 406 -4.262 1.796 12.127 1.00 11.69 C ATOM 13027 HA LEU B 406 -4.921 -0.534 12.933 1.00 0.00 H ATOM 13028 HB2 LEU B 406 -7.246 1.152 13.726 1.00 0.00 H ATOM 13029 HB3 LEU B 406 -5.591 1.278 14.368 1.00 0.00 H ATOM 13030 HG LEU B 406 -6.267 1.495 11.396 1.00 0.00 H ATOM 13031 HD21 LEU B 406 -3.776 2.163 13.031 1.00 0.00 H ATOM 13032 HD22 LEU B 406 -3.964 0.763 11.946 1.00 0.00 H ATOM 13033 HD23 LEU B 406 -3.968 2.414 11.278 1.00 0.00 H ATOM 13034 HD11 LEU B 406 -7.357 3.306 12.617 1.00 0.00 H ATOM 13035 HD12 LEU B 406 -5.818 3.704 13.419 1.00 0.00 H ATOM 13036 HD13 LEU B 406 -5.982 3.907 11.658 1.00 0.00 H ATOM 13037 H LEU B 406 -7.648 -0.469 11.889 1.00 0.00 H ATOM 13038 N ALA B 407 -7.229 -2.051 14.703 1.00 6.52 N ATOM 13039 CA ALA B 407 -7.439 -2.971 15.805 1.00 8.07 C ATOM 13040 C ALA B 407 -6.495 -4.158 15.559 1.00 11.18 C ATOM 13041 O ALA B 407 -5.786 -4.646 16.432 1.00 7.16 O ATOM 13042 CB ALA B 407 -8.958 -3.243 16.038 1.00 7.02 C ATOM 13043 HA ALA B 407 -7.167 -2.574 16.783 1.00 0.00 H ATOM 13044 HB1 ALA B 407 -9.463 -2.305 16.269 1.00 0.00 H ATOM 13045 HB2 ALA B 407 -9.390 -3.677 15.137 1.00 0.00 H ATOM 13046 HB3 ALA B 407 -9.078 -3.936 16.871 1.00 0.00 H ATOM 13047 H ALA B 407 -8.033 -1.870 14.069 1.00 0.00 H ATOM 13048 N GLN B 408 -6.434 -4.680 14.348 1.00 9.76 N ATOM 13049 CA GLN B 408 -5.546 -5.805 14.103 1.00 4.14 C ATOM 13050 C GLN B 408 -4.070 -5.458 14.160 1.00 6.94 C ATOM 13051 O GLN B 408 -3.214 -6.238 14.623 1.00 9.44 O ATOM 13052 CB GLN B 408 -5.795 -6.465 12.730 1.00 6.19 C ATOM 13053 CG GLN B 408 -4.720 -7.503 12.367 1.00 6.06 C ATOM 13054 CD GLN B 408 -4.748 -8.748 13.299 1.00 8.59 C ATOM 13055 OE1 GLN B 408 -5.789 -9.096 13.845 1.00 7.55 O ATOM 13056 NE2 GLN B 408 -3.574 -9.326 13.584 1.00 9.83 N ATOM 13057 HA GLN B 408 -5.785 -6.490 14.917 1.00 0.00 H ATOM 13058 HB2 GLN B 408 -6.766 -6.961 12.752 1.00 0.00 H ATOM 13059 HB3 GLN B 408 -5.802 -5.688 11.965 1.00 0.00 H ATOM 13060 HG2 GLN B 408 -4.885 -7.832 11.341 1.00 0.00 H ATOM 13061 HG3 GLN B 408 -3.740 -7.032 12.444 1.00 0.00 H ATOM 13062 HE22 GLN B 408 -2.708 -9.008 13.104 1.00 0.00 H ATOM 13063 HE21 GLN B 408 -3.528 -10.092 14.286 1.00 0.00 H ATOM 13064 H GLN B 408 -7.015 -4.291 13.578 1.00 0.00 H ATOM 13065 N LEU B 409 -3.753 -4.268 13.686 1.00 3.48 N ATOM 13066 CA LEU B 409 -2.391 -3.743 13.636 1.00 3.00 C ATOM 13067 C LEU B 409 -1.729 -3.763 15.017 1.00 8.97 C ATOM 13068 O LEU B 409 -0.566 -4.115 15.171 1.00 5.25 O ATOM 13069 CB LEU B 409 -2.340 -2.343 12.970 1.00 3.20 C ATOM 13070 CG LEU B 409 -0.917 -1.945 12.572 1.00 10.95 C ATOM 13071 CD1 LEU B 409 -0.194 -2.887 11.576 1.00 10.45 C ATOM 13072 CD2 LEU B 409 -1.019 -0.574 11.886 1.00 14.69 C ATOM 13073 HA LEU B 409 -1.805 -4.407 13.001 1.00 0.00 H ATOM 13074 HB2 LEU B 409 -2.964 -2.356 12.077 1.00 0.00 H ATOM 13075 HB3 LEU B 409 -2.728 -1.605 13.672 1.00 0.00 H ATOM 13076 HG LEU B 409 -0.330 -1.972 13.490 1.00 0.00 H ATOM 13077 HD21 LEU B 409 -1.660 -0.655 11.008 1.00 0.00 H ATOM 13078 HD22 LEU B 409 -1.444 0.149 12.582 1.00 0.00 H ATOM 13079 HD23 LEU B 409 -0.025 -0.246 11.583 1.00 0.00 H ATOM 13080 HD11 LEU B 409 -0.117 -3.883 12.011 1.00 0.00 H ATOM 13081 HD12 LEU B 409 -0.763 -2.938 10.648 1.00 0.00 H ATOM 13082 HD13 LEU B 409 0.804 -2.500 11.371 1.00 0.00 H ATOM 13083 H LEU B 409 -4.521 -3.666 13.326 1.00 0.00 H ATOM 13084 N ILE B 410 -2.493 -3.408 16.026 1.00 4.09 N ATOM 13085 CA ILE B 410 -1.985 -3.419 17.396 1.00 8.60 C ATOM 13086 C ILE B 410 -1.618 -4.867 17.771 1.00 10.56 C ATOM 13087 O ILE B 410 -0.545 -5.198 18.335 1.00 6.32 O ATOM 13088 CB ILE B 410 -3.065 -2.894 18.339 1.00 13.04 C ATOM 13089 CG1 ILE B 410 -3.335 -1.413 18.118 1.00 7.61 C ATOM 13090 CG2 ILE B 410 -2.688 -3.202 19.799 1.00 4.51 C ATOM 13091 CD1 ILE B 410 -4.696 -0.908 18.710 1.00 5.35 C ATOM 13092 HA ILE B 410 -1.103 -2.783 17.479 1.00 0.00 H ATOM 13093 HB ILE B 410 -3.998 -3.411 18.115 1.00 0.00 H ATOM 13094 HG12 ILE B 410 -2.529 -0.846 18.584 1.00 0.00 H ATOM 13095 HG13 ILE B 410 -3.338 -1.223 17.045 1.00 0.00 H ATOM 13096 HD11 ILE B 410 -5.517 -1.454 18.247 1.00 0.00 H ATOM 13097 HD12 ILE B 410 -4.707 -1.077 19.787 1.00 0.00 H ATOM 13098 HD13 ILE B 410 -4.806 0.157 18.507 1.00 0.00 H ATOM 13099 HG21 ILE B 410 -2.592 -4.280 19.929 1.00 0.00 H ATOM 13100 HG22 ILE B 410 -1.740 -2.721 20.037 1.00 0.00 H ATOM 13101 HG23 ILE B 410 -3.466 -2.823 20.462 1.00 0.00 H ATOM 13102 H ILE B 410 -3.474 -3.115 15.846 1.00 0.00 H ATOM 13103 N TRP B 411 -2.530 -5.813 17.453 1.00 6.81 N ATOM 13104 CA TRP B 411 -2.331 -7.228 17.711 1.00 4.89 C ATOM 13105 C TRP B 411 -1.160 -7.792 16.925 1.00 11.04 C ATOM 13106 O TRP B 411 -0.347 -8.518 17.467 1.00 7.64 O ATOM 13107 CB TRP B 411 -3.654 -8.007 17.499 1.00 4.61 C ATOM 13108 CG TRP B 411 -4.534 -7.885 18.693 1.00 11.59 C ATOM 13109 CD1 TRP B 411 -5.662 -7.140 18.796 1.00 10.00 C ATOM 13110 CD2 TRP B 411 -4.305 -8.523 19.962 1.00 9.29 C ATOM 13111 NE1 TRP B 411 -6.177 -7.307 20.060 1.00 6.59 N ATOM 13112 CE2 TRP B 411 -5.349 -8.119 20.802 1.00 12.59 C ATOM 13113 CE3 TRP B 411 -3.314 -9.397 20.420 1.00 7.00 C ATOM 13114 CZ2 TRP B 411 -5.450 -8.609 22.112 1.00 9.83 C ATOM 13115 CZ3 TRP B 411 -3.386 -9.843 21.734 1.00 4.74 C ATOM 13116 CH2 TRP B 411 -4.447 -9.477 22.530 1.00 4.29 C ATOM 13117 HA TRP B 411 -2.055 -7.355 18.758 1.00 0.00 H ATOM 13118 HB2 TRP B 411 -4.172 -7.603 16.629 1.00 0.00 H ATOM 13119 HB3 TRP B 411 -3.426 -9.059 17.328 1.00 0.00 H ATOM 13120 HE1 TRP B 411 -7.062 -6.882 20.405 1.00 0.00 H ATOM 13121 HD1 TRP B 411 -6.088 -6.515 18.011 1.00 0.00 H ATOM 13122 HZ2 TRP B 411 -6.272 -8.324 22.769 1.00 0.00 H ATOM 13123 HH2 TRP B 411 -4.504 -9.888 23.538 1.00 0.00 H ATOM 13124 HZ3 TRP B 411 -2.601 -10.484 22.135 1.00 0.00 H ATOM 13125 HE3 TRP B 411 -2.506 -9.720 19.763 1.00 0.00 H ATOM 13126 H TRP B 411 -3.417 -5.513 17.002 1.00 0.00 H ATOM 13127 N SER B 412 -1.018 -7.418 15.628 1.00 6.51 N ATOM 13128 CA SER B 412 0.103 -7.928 14.839 1.00 4.63 C ATOM 13129 C SER B 412 1.437 -7.656 15.523 1.00 4.01 C ATOM 13130 O SER B 412 2.284 -8.530 15.608 1.00 6.38 O ATOM 13131 CB SER B 412 0.157 -7.327 13.435 1.00 5.05 C ATOM 13132 OG SER B 412 -1.065 -7.710 12.848 1.00 7.34 O ATOM 13133 HA SER B 412 -0.066 -9.002 14.758 1.00 0.00 H ATOM 13134 HB2 SER B 412 0.999 -7.731 12.873 1.00 0.00 H ATOM 13135 HB3 SER B 412 0.240 -6.241 13.482 1.00 0.00 H ATOM 13136 HG SER B 412 -1.111 -7.356 11.924 1.00 0.00 H ATOM 13137 H SER B 412 -1.706 -6.769 15.195 1.00 0.00 H ATOM 13138 N ARG B 413 1.624 -6.420 16.008 1.00 3.10 N ATOM 13139 CA ARG B 413 2.853 -6.020 16.679 1.00 5.53 C ATOM 13140 C ARG B 413 2.902 -6.669 18.091 1.00 5.93 C ATOM 13141 O ARG B 413 3.992 -7.088 18.464 1.00 13.76 O ATOM 13142 CB ARG B 413 3.013 -4.493 16.770 1.00 4.96 C ATOM 13143 CG ARG B 413 3.138 -3.748 15.440 1.00 4.18 C ATOM 13144 CD ARG B 413 4.361 -4.188 14.625 1.00 5.83 C ATOM 13145 NE ARG B 413 4.399 -5.546 13.993 1.00 8.60 N ATOM 13146 CZ ARG B 413 3.675 -5.868 12.887 1.00 4.14 C ATOM 13147 NH1 ARG B 413 2.905 -4.944 12.367 1.00 5.55 N ATOM 13148 NH2 ARG B 413 3.706 -7.068 12.281 1.00 6.52 N ATOM 13149 HA ARG B 413 3.691 -6.376 16.080 1.00 0.00 H ATOM 13150 HB2 ARG B 413 2.142 -4.097 17.293 1.00 0.00 H ATOM 13151 HB3 ARG B 413 3.910 -4.286 17.353 1.00 0.00 H ATOM 13152 HG2 ARG B 413 2.241 -3.935 14.850 1.00 0.00 H ATOM 13153 HG3 ARG B 413 3.221 -2.681 15.645 1.00 0.00 H ATOM 13154 HD2 ARG B 413 5.221 -4.129 15.293 1.00 0.00 H ATOM 13155 HD3 ARG B 413 4.478 -3.464 13.819 1.00 0.00 H ATOM 13156 HE ARG B 413 5.006 -6.275 14.419 1.00 0.00 H ATOM 13157 HH12 ARG B 413 2.338 -5.155 11.521 1.00 0.00 H ATOM 13158 HH11 ARG B 413 2.861 -3.999 12.800 1.00 0.00 H ATOM 13159 HH22 ARG B 413 3.123 -7.240 11.437 1.00 0.00 H ATOM 13160 HH21 ARG B 413 4.313 -7.824 12.656 1.00 0.00 H ATOM 13161 H ARG B 413 0.862 -5.720 15.901 1.00 0.00 H ATOM 13162 N ALA B 414 1.768 -6.756 18.826 1.00 7.00 N ATOM 13163 CA ALA B 414 1.790 -7.346 20.135 1.00 5.39 C ATOM 13164 C ALA B 414 2.272 -8.790 20.047 1.00 10.48 C ATOM 13165 O ALA B 414 3.035 -9.310 20.869 1.00 9.60 O ATOM 13166 CB ALA B 414 0.412 -7.276 20.735 1.00 5.69 C ATOM 13167 HA ALA B 414 2.480 -6.797 20.775 1.00 0.00 H ATOM 13168 HB1 ALA B 414 0.102 -6.234 20.809 1.00 0.00 H ATOM 13169 HB2 ALA B 414 -0.287 -7.820 20.100 1.00 0.00 H ATOM 13170 HB3 ALA B 414 0.427 -7.723 21.729 1.00 0.00 H ATOM 13171 H ALA B 414 0.874 -6.392 18.439 1.00 0.00 H ATOM 13172 N LEU B 415 1.814 -9.515 19.020 1.00 11.28 N ATOM 13173 CA LEU B 415 2.184 -10.909 18.821 1.00 7.18 C ATOM 13174 C LEU B 415 3.525 -11.152 18.092 1.00 6.90 C ATOM 13175 O LEU B 415 3.958 -12.276 17.839 1.00 12.25 O ATOM 13176 CB LEU B 415 1.036 -11.604 18.127 1.00 12.18 C ATOM 13177 CG LEU B 415 -0.272 -11.565 18.967 1.00 6.91 C ATOM 13178 CD1 LEU B 415 -1.428 -12.163 18.130 1.00 10.88 C ATOM 13179 CD2 LEU B 415 -0.147 -12.392 20.243 1.00 11.05 C ATOM 13180 HA LEU B 415 2.366 -11.332 19.809 1.00 0.00 H ATOM 13181 HB2 LEU B 415 0.854 -11.112 17.171 1.00 0.00 H ATOM 13182 HB3 LEU B 415 1.310 -12.644 17.952 1.00 0.00 H ATOM 13183 HG LEU B 415 -0.464 -10.526 19.234 1.00 0.00 H ATOM 13184 HD21 LEU B 415 0.064 -13.429 19.983 1.00 0.00 H ATOM 13185 HD22 LEU B 415 0.665 -11.996 20.853 1.00 0.00 H ATOM 13186 HD23 LEU B 415 -1.081 -12.339 20.802 1.00 0.00 H ATOM 13187 HD11 LEU B 415 -1.558 -11.576 17.220 1.00 0.00 H ATOM 13188 HD12 LEU B 415 -1.190 -13.194 17.868 1.00 0.00 H ATOM 13189 HD13 LEU B 415 -2.348 -12.138 18.714 1.00 0.00 H ATOM 13190 H LEU B 415 1.170 -9.066 18.338 1.00 0.00 H ATOM 13191 N GLY B 416 4.200 -10.102 17.703 1.00 7.69 N ATOM 13192 CA GLY B 416 5.464 -10.251 17.029 1.00 4.10 C ATOM 13193 C GLY B 416 5.369 -10.773 15.626 1.00 10.50 C ATOM 13194 O GLY B 416 6.323 -11.391 15.238 1.00 13.23 O ATOM 13195 HA3 GLY B 416 6.078 -10.941 17.607 1.00 0.00 H ATOM 13196 HA2 GLY B 416 5.949 -9.275 16.996 1.00 0.00 H ATOM 13197 H GLY B 416 3.821 -9.150 17.882 1.00 0.00 H ATOM 13198 N PHE B 417 4.276 -10.537 14.871 1.00 8.24 N ATOM 13199 CA PHE B 417 4.252 -11.078 13.492 1.00 5.79 C ATOM 13200 C PHE B 417 5.404 -10.553 12.687 1.00 6.06 C ATOM 13201 O PHE B 417 5.639 -9.332 12.764 1.00 5.46 O ATOM 13202 CB PHE B 417 2.949 -10.780 12.730 1.00 7.31 C ATOM 13203 CG PHE B 417 1.770 -11.539 13.300 1.00 6.79 C ATOM 13204 CD1 PHE B 417 1.897 -12.467 14.333 1.00 6.50 C ATOM 13205 CD2 PHE B 417 0.497 -11.279 12.798 1.00 3.11 C ATOM 13206 CE1 PHE B 417 0.767 -13.099 14.848 1.00 14.31 C ATOM 13207 CE2 PHE B 417 -0.648 -11.907 13.284 1.00 9.68 C ATOM 13208 CZ PHE B 417 -0.491 -12.834 14.313 1.00 12.11 C ATOM 13209 HA PHE B 417 4.327 -12.159 13.612 1.00 0.00 H ATOM 13210 HB2 PHE B 417 2.742 -9.712 12.791 1.00 0.00 H ATOM 13211 HB3 PHE B 417 3.079 -11.065 11.686 1.00 0.00 H ATOM 13212 HD2 PHE B 417 0.392 -10.554 11.991 1.00 0.00 H ATOM 13213 HE2 PHE B 417 -1.632 -11.681 12.874 1.00 0.00 H ATOM 13214 HZ PHE B 417 -1.363 -13.358 14.704 1.00 0.00 H ATOM 13215 HE1 PHE B 417 0.868 -13.804 15.673 1.00 0.00 H ATOM 13216 HD1 PHE B 417 2.882 -12.698 14.738 1.00 0.00 H ATOM 13217 H PHE B 417 3.474 -9.991 15.246 1.00 0.00 H ATOM 13218 N PRO B 418 6.114 -11.374 11.919 1.00 8.36 N ATOM 13219 CA PRO B 418 7.220 -10.805 11.155 1.00 3.11 C ATOM 13220 C PRO B 418 6.841 -10.258 9.760 1.00 3.00 C ATOM 13221 O PRO B 418 5.657 -10.251 9.305 1.00 4.18 O ATOM 13222 CB PRO B 418 8.047 -12.057 10.893 1.00 3.09 C ATOM 13223 CG PRO B 418 7.062 -13.177 10.689 1.00 8.13 C ATOM 13224 CD PRO B 418 5.870 -12.783 11.520 1.00 13.31 C ATOM 13225 HA PRO B 418 7.668 -9.969 11.692 1.00 0.00 H ATOM 13226 HD3 PRO B 418 4.954 -12.860 10.934 1.00 0.00 H ATOM 13227 HD2 PRO B 418 5.791 -13.421 12.401 1.00 0.00 H ATOM 13228 HG3 PRO B 418 7.477 -14.124 11.034 1.00 0.00 H ATOM 13229 HG2 PRO B 418 6.788 -13.263 9.638 1.00 0.00 H ATOM 13230 HB2 PRO B 418 8.660 -11.925 10.001 1.00 0.00 H ATOM 13231 HB3 PRO B 418 8.691 -12.270 11.746 1.00 0.00 H ATOM 13232 N LEU B 419 7.860 -9.796 9.062 1.00 4.66 N ATOM 13233 CA LEU B 419 7.764 -9.277 7.686 1.00 5.25 C ATOM 13234 C LEU B 419 6.966 -10.243 6.819 1.00 7.10 C ATOM 13235 O LEU B 419 7.266 -11.453 6.880 1.00 6.52 O ATOM 13236 CB LEU B 419 9.194 -9.109 7.075 1.00 4.79 C ATOM 13237 CG LEU B 419 9.274 -8.420 5.714 1.00 3.09 C ATOM 13238 CD1 LEU B 419 9.111 -6.941 5.981 1.00 8.39 C ATOM 13239 CD2 LEU B 419 10.660 -8.680 5.084 1.00 5.00 C ATOM 13240 HA LEU B 419 7.262 -8.310 7.715 1.00 0.00 H ATOM 13241 HB2 LEU B 419 9.789 -8.526 7.778 1.00 0.00 H ATOM 13242 HB3 LEU B 419 9.629 -10.103 6.970 1.00 0.00 H ATOM 13243 HG LEU B 419 8.510 -8.792 5.031 1.00 0.00 H ATOM 13244 HD21 LEU B 419 11.436 -8.282 5.739 1.00 0.00 H ATOM 13245 HD22 LEU B 419 10.805 -9.753 4.957 1.00 0.00 H ATOM 13246 HD23 LEU B 419 10.715 -8.187 4.113 1.00 0.00 H ATOM 13247 HD11 LEU B 419 8.146 -6.763 6.456 1.00 0.00 H ATOM 13248 HD12 LEU B 419 9.910 -6.602 6.641 1.00 0.00 H ATOM 13249 HD13 LEU B 419 9.160 -6.395 5.039 1.00 0.00 H ATOM 13250 H LEU B 419 8.797 -9.798 9.514 1.00 0.00 H ATOM 13251 N GLU B 420 5.981 -9.709 6.029 1.00 5.44 N ATOM 13252 CA GLU B 420 5.166 -10.501 5.111 1.00 5.02 C ATOM 13253 C GLU B 420 6.030 -10.539 3.862 1.00 9.17 C ATOM 13254 O GLU B 420 6.277 -9.504 3.243 1.00 7.97 O ATOM 13255 CB GLU B 420 3.790 -9.902 4.803 1.00 3.88 C ATOM 13256 CG GLU B 420 3.087 -10.822 3.761 1.00 7.97 C ATOM 13257 CD GLU B 420 1.683 -10.432 3.520 1.00 8.61 C ATOM 13258 OE1 GLU B 420 0.919 -10.509 4.580 1.00 7.65 O ATOM 13259 OE2 GLU B 420 1.263 -10.335 2.380 1.00 4.72 O ATOM 13260 HA GLU B 420 4.921 -11.475 5.534 1.00 0.00 H ATOM 13261 HB2 GLU B 420 3.195 -9.853 5.715 1.00 0.00 H ATOM 13262 HB3 GLU B 420 3.906 -8.899 4.392 1.00 0.00 H ATOM 13263 HG2 GLU B 420 3.633 -10.765 2.819 1.00 0.00 H ATOM 13264 HG3 GLU B 420 3.107 -11.848 4.130 1.00 0.00 H ATOM 13265 H GLU B 420 5.805 -8.686 6.086 1.00 0.00 H ATOM 13266 N ARG B 421 6.520 -11.765 3.490 1.00 3.00 N ATOM 13267 CA ARG B 421 7.375 -11.841 2.350 1.00 3.00 C ATOM 13268 C ARG B 421 7.310 -13.258 1.760 1.00 12.10 C ATOM 13269 O ARG B 421 8.074 -14.119 2.156 1.00 5.43 O ATOM 13270 CB ARG B 421 8.809 -11.449 2.781 1.00 5.06 C ATOM 13271 CG ARG B 421 9.751 -10.814 1.721 1.00 4.01 C ATOM 13272 CD ARG B 421 10.018 -11.708 0.513 1.00 5.41 C ATOM 13273 NE ARG B 421 10.986 -11.186 -0.462 1.00 3.00 N ATOM 13274 CZ ARG B 421 11.103 -11.577 -1.725 1.00 10.38 C ATOM 13275 NH1 ARG B 421 10.346 -12.533 -2.242 1.00 5.21 N ATOM 13276 NH2 ARG B 421 12.030 -11.015 -2.509 1.00 4.89 N ATOM 13277 HA ARG B 421 7.055 -11.149 1.571 1.00 0.00 H ATOM 13278 HB2 ARG B 421 8.716 -10.735 3.599 1.00 0.00 H ATOM 13279 HB3 ARG B 421 9.296 -12.354 3.144 1.00 0.00 H ATOM 13280 HG2 ARG B 421 9.296 -9.888 1.369 1.00 0.00 H ATOM 13281 HG3 ARG B 421 10.704 -10.590 2.200 1.00 0.00 H ATOM 13282 HD2 ARG B 421 9.072 -11.864 -0.005 1.00 0.00 H ATOM 13283 HD3 ARG B 421 10.393 -12.664 0.879 1.00 0.00 H ATOM 13284 HE ARG B 421 11.637 -10.445 -0.133 1.00 0.00 H ATOM 13285 HH12 ARG B 421 10.468 -12.812 -3.237 1.00 0.00 H ATOM 13286 HH11 ARG B 421 9.630 -13.005 -1.653 1.00 0.00 H ATOM 13287 HH22 ARG B 421 12.126 -11.317 -3.499 1.00 0.00 H ATOM 13288 HH21 ARG B 421 12.654 -10.276 -2.128 1.00 0.00 H ATOM 13289 H ARG B 421 6.274 -12.621 4.027 1.00 0.00 H ATOM 13290 N PRO B 422 6.353 -13.445 0.813 1.00 7.20 N ATOM 13291 CA PRO B 422 6.185 -14.764 0.166 1.00 8.31 C ATOM 13292 C PRO B 422 7.175 -14.834 -0.993 1.00 12.44 C ATOM 13293 O PRO B 422 7.838 -13.836 -1.325 1.00 5.27 O ATOM 13294 CB PRO B 422 4.778 -14.744 -0.417 1.00 8.38 C ATOM 13295 CG PRO B 422 4.408 -13.237 -0.484 1.00 14.12 C ATOM 13296 CD PRO B 422 5.276 -12.478 0.506 1.00 12.47 C ATOM 13297 HA PRO B 422 6.342 -15.598 0.850 1.00 0.00 H ATOM 13298 HD3 PRO B 422 5.680 -11.570 0.058 1.00 0.00 H ATOM 13299 HD2 PRO B 422 4.713 -12.220 1.403 1.00 0.00 H ATOM 13300 HG3 PRO B 422 3.357 -13.105 -0.227 1.00 0.00 H ATOM 13301 HG2 PRO B 422 4.585 -12.860 -1.491 1.00 0.00 H ATOM 13302 HB2 PRO B 422 4.766 -15.189 -1.412 1.00 0.00 H ATOM 13303 HB3 PRO B 422 4.085 -15.283 0.229 1.00 0.00 H ATOM 13304 N LYS B 423 7.271 -15.998 -1.626 1.00 7.82 N ATOM 13305 CA LYS B 423 8.167 -16.173 -2.750 1.00 7.71 C ATOM 13306 C LYS B 423 7.374 -16.000 -4.023 1.00 8.06 C ATOM 13307 O LYS B 423 6.215 -16.409 -4.135 1.00 10.49 O ATOM 13308 CB LYS B 423 8.760 -17.604 -2.724 1.00 12.95 C ATOM 13309 CG LYS B 423 9.794 -17.928 -3.819 1.00 14.77 C ATOM 13310 CD LYS B 423 11.180 -17.311 -3.585 1.00 7.96 C ATOM 13311 CE LYS B 423 12.196 -17.588 -4.687 1.00 7.71 C ATOM 13312 NZ LYS B 423 11.794 -17.032 -5.985 1.00 10.67 N ATOM 13313 HA LYS B 423 8.975 -15.443 -2.697 1.00 0.00 H ATOM 13314 HB2 LYS B 423 9.242 -17.748 -1.757 1.00 0.00 H ATOM 13315 HB3 LYS B 423 7.935 -18.309 -2.825 1.00 0.00 H ATOM 13316 HG2 LYS B 423 9.907 -19.011 -3.872 1.00 0.00 H ATOM 13317 HG3 LYS B 423 9.412 -17.557 -4.770 1.00 0.00 H ATOM 13318 HD2 LYS B 423 11.061 -16.231 -3.497 1.00 0.00 H ATOM 13319 HD3 LYS B 423 11.576 -17.709 -2.651 1.00 0.00 H ATOM 13320 HE2 LYS B 423 12.312 -18.667 -4.791 1.00 0.00 H ATOM 13321 HE3 LYS B 423 13.151 -17.147 -4.400 1.00 0.00 H ATOM 13322 HZ1 LYS B 423 10.888 -17.452 -6.275 1.00 0.00 H ATOM 13323 HZ2 LYS B 423 11.689 -16.001 -5.901 1.00 0.00 H ATOM 13324 HZ3 LYS B 423 12.522 -17.251 -6.695 1.00 0.00 H ATOM 13325 H LYS B 423 6.691 -16.800 -1.308 1.00 0.00 H ATOM 13326 N SER B 424 7.987 -15.374 -5.004 1.00 6.86 N ATOM 13327 CA SER B 424 7.300 -15.201 -6.280 1.00 7.44 C ATOM 13328 C SER B 424 8.014 -16.118 -7.269 1.00 8.92 C ATOM 13329 O SER B 424 9.115 -16.642 -7.038 1.00 5.78 O ATOM 13330 CB SER B 424 7.287 -13.780 -6.812 1.00 3.00 C ATOM 13331 OG SER B 424 8.566 -13.394 -7.287 1.00 7.16 O ATOM 13332 HA SER B 424 6.247 -15.447 -6.139 1.00 0.00 H ATOM 13333 HB2 SER B 424 6.987 -13.104 -6.011 1.00 0.00 H ATOM 13334 HB3 SER B 424 6.570 -13.714 -7.630 1.00 0.00 H ATOM 13335 HG SER B 424 8.842 -14.001 -8.018 1.00 0.00 H ATOM 13336 H SER B 424 8.951 -15.006 -4.872 1.00 0.00 H ATOM 13337 N MET B 425 7.366 -16.315 -8.411 1.00 12.08 N ATOM 13338 CA MET B 425 7.893 -17.149 -9.475 1.00 8.84 C ATOM 13339 C MET B 425 7.535 -16.516 -10.819 1.00 4.36 C ATOM 13340 O MET B 425 6.527 -15.800 -10.948 1.00 11.00 O ATOM 13341 CB MET B 425 7.025 -18.424 -9.467 1.00 21.06 C ATOM 13342 CG MET B 425 7.785 -19.649 -9.811 1.00 45.28 C ATOM 13343 SD MET B 425 8.311 -20.335 -8.250 1.00 66.82 S ATOM 13344 CE MET B 425 10.025 -19.745 -8.153 1.00 65.20 C ATOM 13345 HA MET B 425 8.965 -17.299 -9.345 1.00 0.00 H ATOM 13346 HB2 MET B 425 6.600 -18.548 -8.471 1.00 0.00 H ATOM 13347 HB3 MET B 425 6.220 -18.300 -10.192 1.00 0.00 H ATOM 13348 HG2 MET B 425 8.648 -19.402 -10.429 1.00 0.00 H ATOM 13349 HG3 MET B 425 7.149 -20.356 -10.343 1.00 0.00 H ATOM 13350 HE1 MET B 425 10.588 -20.128 -9.004 1.00 0.00 H ATOM 13351 HE2 MET B 425 10.034 -18.655 -8.170 1.00 0.00 H ATOM 13352 HE3 MET B 425 10.478 -20.099 -7.227 1.00 0.00 H ATOM 13353 H MET B 425 6.444 -15.853 -8.548 1.00 0.00 H ATOM 13354 N SER B 426 8.372 -16.820 -11.805 1.00 3.22 N ATOM 13355 CA SER B 426 8.065 -16.320 -13.162 1.00 5.87 C ATOM 13356 C SER B 426 7.287 -17.450 -13.867 1.00 16.21 C ATOM 13357 O SER B 426 7.323 -18.609 -13.378 1.00 14.11 O ATOM 13358 CB SER B 426 9.283 -15.953 -13.988 1.00 18.88 C ATOM 13359 OG SER B 426 10.071 -17.134 -14.208 1.00 8.12 O ATOM 13360 HA SER B 426 7.499 -15.393 -13.068 1.00 0.00 H ATOM 13361 HB2 SER B 426 9.877 -15.211 -13.454 1.00 0.00 H ATOM 13362 HB3 SER B 426 8.965 -15.542 -14.946 1.00 0.00 H ATOM 13363 HG SER B 426 10.868 -16.902 -14.747 1.00 0.00 H ATOM 13364 H SER B 426 9.221 -17.394 -11.627 1.00 0.00 H ATOM 13365 N THR B 427 6.604 -17.158 -15.003 1.00 8.50 N ATOM 13366 CA THR B 427 5.900 -18.238 -15.713 1.00 12.32 C ATOM 13367 C THR B 427 6.918 -19.299 -16.213 1.00 17.44 C ATOM 13368 O THR B 427 6.679 -20.499 -16.178 1.00 16.24 O ATOM 13369 CB THR B 427 5.122 -17.722 -16.950 1.00 13.37 C ATOM 13370 OG1 THR B 427 3.969 -17.078 -16.496 1.00 7.10 O ATOM 13371 CG2 THR B 427 4.742 -18.897 -17.863 1.00 13.67 C ATOM 13372 HA THR B 427 5.195 -18.666 -15.001 1.00 0.00 H ATOM 13373 HB THR B 427 5.741 -17.032 -17.523 1.00 0.00 H ATOM 13374 HG1 THR B 427 3.414 -17.719 -15.985 1.00 0.00 H ATOM 13375 HG23 THR B 427 5.648 -19.392 -18.212 1.00 0.00 H ATOM 13376 HG21 THR B 427 4.130 -19.606 -17.305 1.00 0.00 H ATOM 13377 HG22 THR B 427 4.179 -18.524 -18.718 1.00 0.00 H ATOM 13378 H THR B 427 6.578 -16.184 -15.367 1.00 0.00 H ATOM 13379 N ALA B 428 8.099 -18.855 -16.691 1.00 15.38 N ATOM 13380 CA ALA B 428 9.159 -19.702 -17.177 1.00 13.36 C ATOM 13381 C ALA B 428 9.710 -20.556 -16.057 1.00 16.77 C ATOM 13382 O ALA B 428 9.875 -21.763 -16.141 1.00 21.26 O ATOM 13383 CB ALA B 428 10.267 -18.866 -17.789 1.00 16.44 C ATOM 13384 HA ALA B 428 8.749 -20.357 -17.946 1.00 0.00 H ATOM 13385 HB1 ALA B 428 9.866 -18.286 -18.620 1.00 0.00 H ATOM 13386 HB2 ALA B 428 10.670 -18.190 -17.034 1.00 0.00 H ATOM 13387 HB3 ALA B 428 11.058 -19.523 -18.150 1.00 0.00 H ATOM 13388 H ALA B 428 8.256 -17.827 -16.710 1.00 0.00 H ATOM 13389 N GLY B 429 9.996 -19.941 -14.955 1.00 12.99 N ATOM 13390 CA GLY B 429 10.501 -20.721 -13.856 1.00 12.98 C ATOM 13391 C GLY B 429 9.476 -21.745 -13.384 1.00 15.82 C ATOM 13392 O GLY B 429 9.792 -22.883 -13.032 1.00 23.71 O ATOM 13393 HA3 GLY B 429 10.743 -20.054 -13.029 1.00 0.00 H ATOM 13394 HA2 GLY B 429 11.403 -21.243 -14.176 1.00 0.00 H ATOM 13395 H GLY B 429 9.865 -18.913 -14.866 1.00 0.00 H ATOM 13396 N LEU B 430 8.186 -21.379 -13.370 1.00 19.11 N ATOM 13397 CA LEU B 430 7.156 -22.319 -12.936 1.00 20.66 C ATOM 13398 C LEU B 430 6.951 -23.493 -13.911 1.00 30.84 C ATOM 13399 O LEU B 430 6.687 -24.630 -13.522 1.00 22.81 O ATOM 13400 CB LEU B 430 5.914 -21.491 -12.659 1.00 19.36 C ATOM 13401 CG LEU B 430 4.715 -22.211 -12.147 1.00 20.06 C ATOM 13402 CD1 LEU B 430 5.024 -22.889 -10.826 1.00 27.50 C ATOM 13403 CD2 LEU B 430 3.671 -21.119 -11.921 1.00 26.24 C ATOM 13404 HA LEU B 430 7.455 -22.838 -12.026 1.00 0.00 H ATOM 13405 HB2 LEU B 430 6.182 -20.734 -11.922 1.00 0.00 H ATOM 13406 HB3 LEU B 430 5.630 -21.003 -13.592 1.00 0.00 H ATOM 13407 HG LEU B 430 4.381 -22.983 -12.841 1.00 0.00 H ATOM 13408 HD21 LEU B 430 4.051 -20.399 -11.196 1.00 0.00 H ATOM 13409 HD22 LEU B 430 3.467 -20.613 -12.864 1.00 0.00 H ATOM 13410 HD23 LEU B 430 2.753 -21.568 -11.542 1.00 0.00 H ATOM 13411 HD11 LEU B 430 5.833 -23.605 -10.967 1.00 0.00 H ATOM 13412 HD12 LEU B 430 5.325 -22.138 -10.095 1.00 0.00 H ATOM 13413 HD13 LEU B 430 4.135 -23.409 -10.469 1.00 0.00 H ATOM 13414 H LEU B 430 7.917 -20.420 -13.670 1.00 0.00 H ATOM 13415 N GLU B 431 7.092 -23.208 -15.203 1.00 19.31 N ATOM 13416 CA GLU B 431 6.931 -24.239 -16.208 1.00 17.79 C ATOM 13417 C GLU B 431 8.037 -25.241 -15.966 1.00 26.67 C ATOM 13418 O GLU B 431 7.792 -26.426 -15.941 1.00 26.77 O ATOM 13419 CB GLU B 431 7.008 -23.620 -17.604 1.00 11.62 C ATOM 13420 CG GLU B 431 5.730 -22.888 -18.041 1.00 19.34 C ATOM 13421 CD GLU B 431 5.842 -22.329 -19.448 1.00 8.35 C ATOM 13422 OE1 GLU B 431 6.872 -22.233 -19.997 1.00 18.27 O ATOM 13423 OE2 GLU B 431 4.723 -21.812 -19.909 1.00 32.50 O ATOM 13424 HA GLU B 431 5.961 -24.732 -16.144 1.00 0.00 H ATOM 13425 HB2 GLU B 431 7.832 -22.907 -17.617 1.00 0.00 H ATOM 13426 HB3 GLU B 431 7.208 -24.417 -18.321 1.00 0.00 H ATOM 13427 HG2 GLU B 431 4.895 -23.588 -18.006 1.00 0.00 H ATOM 13428 HG3 GLU B 431 5.542 -22.066 -17.350 1.00 0.00 H ATOM 13429 H GLU B 431 7.320 -22.236 -15.494 1.00 0.00 H ATOM 13430 N LYS B 432 9.266 -24.758 -15.755 1.00 22.51 N ATOM 13431 CA LYS B 432 10.370 -25.653 -15.495 1.00 21.04 C ATOM 13432 C LYS B 432 10.152 -26.487 -14.236 1.00 31.66 C ATOM 13433 O LYS B 432 10.439 -27.696 -14.196 1.00 36.67 O ATOM 13434 CB LYS B 432 11.658 -24.858 -15.442 1.00 31.47 C ATOM 13435 CG LYS B 432 12.517 -25.221 -14.244 1.00 80.00 C ATOM 13436 CD LYS B 432 13.936 -25.644 -14.614 1.00 80.00 C ATOM 13437 CE LYS B 432 14.483 -24.944 -15.854 1.00 80.00 C ATOM 13438 NZ LYS B 432 15.258 -25.838 -16.737 1.00 80.00 N ATOM 13439 HA LYS B 432 10.438 -26.371 -16.312 1.00 0.00 H ATOM 13440 HB2 LYS B 432 12.226 -25.052 -16.352 1.00 0.00 H ATOM 13441 HB3 LYS B 432 11.412 -23.797 -15.388 1.00 0.00 H ATOM 13442 HG2 LYS B 432 12.576 -24.353 -13.587 1.00 0.00 H ATOM 13443 HG3 LYS B 432 12.039 -26.045 -13.714 1.00 0.00 H ATOM 13444 HD2 LYS B 432 14.592 -25.418 -13.774 1.00 0.00 H ATOM 13445 HD3 LYS B 432 13.938 -26.719 -14.796 1.00 0.00 H ATOM 13446 HE2 LYS B 432 15.131 -24.128 -15.533 1.00 0.00 H ATOM 13447 HE3 LYS B 432 13.645 -24.539 -16.421 1.00 0.00 H ATOM 13448 HZ1 LYS B 432 16.069 -26.224 -16.212 1.00 0.00 H ATOM 13449 HZ2 LYS B 432 14.649 -26.617 -17.060 1.00 0.00 H ATOM 13450 HZ3 LYS B 432 15.600 -25.300 -17.559 1.00 0.00 H ATOM 13451 H LYS B 432 9.428 -23.731 -15.778 1.00 0.00 H ATOM 13452 N LEU B 433 9.645 -25.850 -13.193 1.00 19.46 N ATOM 13453 CA LEU B 433 9.386 -26.563 -11.940 1.00 20.33 C ATOM 13454 C LEU B 433 8.486 -27.811 -12.203 1.00 39.78 C ATOM 13455 O LEU B 433 8.540 -28.899 -11.627 1.00 27.27 O ATOM 13456 CB LEU B 433 8.586 -25.629 -10.990 1.00 20.59 C ATOM 13457 CG LEU B 433 8.500 -26.138 -9.567 1.00 32.43 C ATOM 13458 CD1 LEU B 433 9.913 -26.138 -9.015 1.00 43.88 C ATOM 13459 CD2 LEU B 433 7.600 -25.267 -8.672 1.00 21.71 C ATOM 13460 HA LEU B 433 10.341 -26.864 -11.509 1.00 0.00 H ATOM 13461 HB2 LEU B 433 9.071 -24.653 -10.978 1.00 0.00 H ATOM 13462 HB3 LEU B 433 7.574 -25.526 -11.381 1.00 0.00 H ATOM 13463 HG LEU B 433 8.055 -27.133 -9.573 1.00 0.00 H ATOM 13464 HD21 LEU B 433 7.996 -24.252 -8.639 1.00 0.00 H ATOM 13465 HD22 LEU B 433 6.590 -25.251 -9.081 1.00 0.00 H ATOM 13466 HD23 LEU B 433 7.579 -25.684 -7.665 1.00 0.00 H ATOM 13467 HD11 LEU B 433 10.539 -26.791 -9.623 1.00 0.00 H ATOM 13468 HD12 LEU B 433 10.312 -25.124 -9.040 1.00 0.00 H ATOM 13469 HD13 LEU B 433 9.900 -26.499 -7.987 1.00 0.00 H ATOM 13470 H LEU B 433 9.429 -24.835 -13.263 1.00 0.00 H ATOM 13471 N SER B 434 7.563 -27.673 -13.127 1.00 25.60 N ATOM 13472 CA SER B 434 6.692 -28.789 -13.401 1.00 20.54 C ATOM 13473 C SER B 434 7.033 -29.612 -14.649 1.00 25.12 C ATOM 13474 O SER B 434 6.889 -30.805 -14.579 1.00 48.62 O ATOM 13475 CB SER B 434 5.279 -28.277 -13.617 1.00 37.23 C ATOM 13476 OG SER B 434 4.966 -27.337 -12.612 1.00 51.74 O ATOM 13477 HA SER B 434 6.810 -29.439 -12.534 1.00 0.00 H ATOM 13478 HB2 SER B 434 4.578 -29.110 -13.568 1.00 0.00 H ATOM 13479 HB3 SER B 434 5.209 -27.802 -14.595 1.00 0.00 H ATOM 13480 HG SER B 434 5.604 -26.581 -12.658 1.00 0.00 H ATOM 13481 H SER B 434 7.463 -26.779 -13.649 1.00 0.00 H ATOM 13482 N ALA B 435 7.438 -28.972 -15.751 1.00 40.13 N ATOM 13483 CA ALA B 435 7.771 -29.531 -17.066 1.00 44.95 C ATOM 13484 C ALA B 435 7.372 -28.510 -18.147 1.00 67.65 C ATOM 13485 O ALA B 435 8.068 -28.243 -19.132 1.00 80.00 O ATOM 13486 CB ALA B 435 6.943 -30.773 -17.366 1.00 45.52 C ATOM 13487 HA ALA B 435 8.835 -29.767 -17.063 1.00 0.00 H ATOM 13488 HB1 ALA B 435 7.139 -31.531 -16.607 1.00 0.00 H ATOM 13489 HB2 ALA B 435 5.884 -30.513 -17.357 1.00 0.00 H ATOM 13490 HB3 ALA B 435 7.215 -31.161 -18.348 1.00 0.00 H ATOM 13491 H ALA B 435 7.529 -27.940 -15.664 1.00 0.00 H ATOM 13492 N GLY B 436 6.204 -27.912 -17.969 1.00 55.60 N ATOM 13493 CA GLY B 436 5.747 -26.921 -18.921 1.00 51.33 C ATOM 13494 C GLY B 436 4.417 -27.289 -19.504 1.00 48.09 C ATOM 13495 O GLY B 436 3.873 -28.323 -19.170 1.00 60.84 O ATOM 13496 HA3 GLY B 436 6.477 -26.841 -19.727 1.00 0.00 H ATOM 13497 HA2 GLY B 436 5.658 -25.959 -18.416 1.00 0.00 H ATOM 13498 H GLY B 436 5.615 -28.154 -17.146 1.00 0.00 H ATOM 13499 N GLY B 437 3.876 -26.462 -20.382 1.00 49.68 N ATOM 13500 CA GLY B 437 2.599 -26.813 -20.961 1.00 36.38 C ATOM 13501 C GLY B 437 2.360 -25.833 -22.078 1.00 28.31 C ATOM 13502 O GLY B 437 1.943 -24.721 -21.775 1.00 80.00 O ATOM 13503 HA3 GLY B 437 1.810 -26.733 -20.213 1.00 0.00 H ATOM 13504 HA2 GLY B 437 2.627 -27.831 -21.351 1.00 0.00 H ATOM 13505 H GLY B 437 4.358 -25.580 -20.650 1.00 0.00 H TER 13506 GLY B 437 HETATM13507 O HOH 1 1.018 -14.606 6.701 1.00 13.68 O HETATM13508 O HOH 2 1.702 -11.779 6.931 1.00 8.74 O HETATM13509 O HOH 3 5.046 -15.092 14.202 1.00 31.16 O HETATM13510 O HOH 4 3.402 -15.516 17.250 1.00 57.02 O HETATM13511 O HOH 5 2.187 -13.239 9.974 1.00 10.89 O HETATM13512 O HOH 6 9.421 -16.498 1.328 1.00 10.08 O HETATM13513 O HOH 7 0.592 -12.943 -9.462 1.00 7.77 O HETATM13514 O HOH 8 -3.080 -10.795 -9.230 1.00 10.36 O HETATM13515 O HOH 9 -2.257 -8.330 -10.455 1.00 10.54 O HETATM13516 O HOH 10 12.768 -19.818 -1.204 1.00 46.26 O HETATM13517 O HOH 11 9.497 -21.060 -1.702 1.00 30.67 O HETATM13518 O HOH 12 27.637 4.517 -18.336 1.00 13.71 O HETATM13519 O HOH 13 21.370 0.202 -20.527 1.00 8.86 O HETATM13520 O HOH 14 20.435 6.947 -16.943 1.00 10.31 O HETATM13521 O HOH 15 15.295 12.654 -18.372 1.00 23.99 O HETATM13522 O HOH 16 16.362 11.327 -20.352 1.00 20.03 O HETATM13523 O HOH 17 1.701 21.215 1.395 1.00 9.46 O HETATM13524 O HOH 18 7.601 12.391 8.686 1.00 10.41 O HETATM13525 O HOH 19 -8.653 3.560 -11.666 1.00 7.83 O HETATM13526 O HOH 20 -7.343 4.900 -9.749 1.00 7.99 O HETATM13527 O HOH 21 -10.790 5.003 -12.265 1.00 23.87 O HETATM13528 O HOH 22 -13.989 5.567 -12.120 1.00 33.08 O HETATM13529 O HOH 23 -16.583 3.244 -15.413 1.00 44.65 O HETATM13530 O HOH 24 -5.117 -5.292 -20.653 1.00 11.52 O HETATM13531 O HOH 25 -9.309 5.444 -7.935 1.00 11.84 O HETATM13532 O HOH 26 -10.631 6.894 -10.027 1.00 16.91 O HETATM13533 O HOH 27 -8.030 7.933 -5.713 1.00 27.06 O HETATM13534 O HOH 28 12.904 12.281 -16.697 1.00 16.84 O HETATM13535 O HOH 29 9.586 19.892 0.061 1.00 16.43 O HETATM13536 O HOH 30 17.074 -4.698 -6.672 1.00 6.83 O HETATM13537 O HOH 31 10.720 -5.982 -7.232 1.00 6.81 O HETATM13538 O HOH 32 5.491 -9.018 0.651 1.00 4.36 O HETATM13539 O HOH 33 -1.083 -5.745 -10.081 1.00 6.40 O HETATM13540 O HOH 34 1.713 -6.140 -10.695 1.00 8.48 O HETATM13541 O HOH 35 3.657 -4.353 -9.872 1.00 7.99 O HETATM13542 O HOH 36 17.680 -13.586 7.756 1.00 13.07 O HETATM13543 O HOH 37 22.069 -11.366 2.036 1.00 11.93 O HETATM13544 O HOH 38 29.259 -4.244 5.949 1.00 12.89 O HETATM13545 O HOH 39 27.440 -1.953 6.758 1.00 15.99 O HETATM13546 O HOH 40 25.222 -1.930 9.517 1.00 27.29 O HETATM13547 O HOH 41 23.364 2.352 3.523 1.00 8.45 O HETATM13548 O HOH 42 26.264 2.129 3.571 1.00 12.49 O HETATM13549 O HOH 43 26.650 -14.692 -13.570 1.00 40.49 O HETATM13550 O HOH 44 14.291 -15.671 6.566 1.00 18.00 O HETATM13551 O HOH 45 12.327 -13.282 -14.784 1.00 17.73 O HETATM13552 O HOH 46 14.823 -13.657 -14.088 1.00 17.94 O HETATM13553 O HOH 47 22.724 -10.974 -9.662 1.00 14.60 O HETATM13554 O HOH 48 17.799 11.894 -24.133 1.00 25.88 O HETATM13555 O HOH 49 7.790 20.944 -14.636 1.00 48.80 O HETATM13556 O HOH 50 -1.864 21.311 -4.045 1.00 16.03 O HETATM13557 O HOH 51 1.616 25.285 6.861 1.00 37.04 O HETATM13558 O HOH 52 0.419 22.872 -0.142 1.00 32.96 O HETATM13559 O HOH 53 7.833 10.669 11.757 1.00 31.16 O HETATM13560 O HOH 54 0.657 13.250 -17.749 1.00 56.50 O HETATM13561 O HOH 55 -19.203 4.059 -17.926 1.00 51.46 O HETATM13562 O HOH 56 -14.461 0.930 -17.346 1.00 29.91 O HETATM13563 O HOH 57 -13.550 -1.933 -17.819 1.00 22.76 O HETATM13564 O HOH 58 22.514 19.265 3.851 1.00 22.66 O HETATM13565 O HOH 59 15.698 12.569 -15.177 1.00 29.52 O HETATM13566 O HOH 60 25.214 16.189 -13.168 1.00 23.94 O HETATM13567 O HOH 61 23.525 19.515 -4.170 1.00 11.77 O HETATM13568 O HOH 62 29.560 17.121 -7.590 1.00 18.59 O HETATM13569 O HOH 63 10.740 -7.093 1.487 1.00 7.59 O HETATM13570 O HOH 64 12.953 -6.394 3.429 1.00 5.25 O HETATM13571 O HOH 65 13.834 -9.273 3.032 1.00 7.72 O HETATM13572 O HOH 66 -7.222 -7.140 -11.682 1.00 9.46 O HETATM13573 O HOH 67 -3.421 -2.079 -12.200 1.00 18.88 O HETATM13574 O HOH 68 18.143 -0.630 14.541 1.00 16.47 O HETATM13575 O HOH 69 20.445 -21.911 1.310 1.00 28.55 O HETATM13576 O HOH 70 27.478 -9.103 -8.248 1.00 40.82 O HETATM13577 O HOH 71 31.061 -1.553 -10.754 1.00 37.82 O HETATM13578 O HOH 72 32.579 15.248 0.876 1.00 50.67 O HETATM13579 O HOH 73 15.382 7.842 3.463 1.00 15.64 O HETATM13580 O HOH 74 20.156 0.665 -0.548 1.00 5.19 O HETATM13581 O HOH 75 -7.270 11.015 -14.592 1.00 26.55 O HETATM13582 O HOH 76 -7.041 8.453 -20.706 1.00 23.49 O HETATM13583 O HOH 77 -7.115 -6.597 -18.077 1.00 31.14 O HETATM13584 O HOH 78 -9.584 7.967 -22.238 1.00 53.54 O HETATM13585 O HOH 79 -6.344 -6.874 -15.309 1.00 19.44 O HETATM13586 O HOH 80 -6.235 -8.807 -20.843 1.00 26.36 O HETATM13587 O HOH 81 13.427 -8.783 11.857 1.00 13.00 O HETATM13588 O HOH 82 32.644 -4.129 1.847 1.00 19.66 O HETATM13589 O HOH 83 32.679 -12.356 8.633 1.00 12.86 O HETATM13590 O HOH 84 -11.905 -7.136 -13.788 1.00 15.06 O HETATM13591 O HOH 85 -9.371 -13.930 9.688 1.00 7.37 O HETATM13592 O HOH 86 21.168 -13.960 15.141 1.00 13.39 O HETATM13593 O HOH 87 13.178 7.937 9.921 1.00 19.00 O HETATM13594 O HOH 88 -16.727 0.005 -12.358 1.00 11.37 O HETATM13595 O HOH 89 16.809 -1.414 9.673 1.00 15.11 O HETATM13596 O HOH 90 0.205 9.901 -16.640 1.00 7.83 O HETATM13597 O HOH 91 18.094 24.463 2.923 1.00 26.42 O HETATM13598 O HOH 92 8.253 -15.883 -17.564 1.00 18.23 O HETATM13599 O HOH 93 -15.182 -2.359 -15.656 1.00 18.20 O HETATM13600 O HOH 94 20.051 -10.181 -5.074 1.00 11.93 O HETATM13601 O HOH 95 19.037 13.808 6.234 1.00 20.32 O HETATM13602 O HOH 96 19.889 3.030 13.001 1.00 17.83 O HETATM13603 O HOH 97 39.544 6.888 -1.183 1.00 26.47 O HETATM13604 O HOH 98 10.941 -14.688 10.721 1.00 21.72 O HETATM13605 O HOH 99 35.731 -6.967 4.255 1.00 20.94 O HETATM13606 O HOH 100 24.440 -12.550 -9.353 1.00 43.32 O HETATM13607 O HOH 101 27.653 0.530 -24.460 1.00 27.95 O HETATM13608 O HOH 102 10.114 20.795 2.339 1.00 26.15 O HETATM13609 O HOH 103 15.229 -18.767 1.260 1.00 21.54 O HETATM13610 O HOH 104 28.143 -4.385 24.793 1.00 27.51 O HETATM13611 O HOH 105 26.418 20.025 -4.863 1.00 29.61 O HETATM13612 O HOH 106 5.332 -23.145 -1.019 1.00 30.21 O HETATM13613 O HOH 107 -10.662 -18.827 11.167 1.00 20.40 O HETATM13614 O HOH 108 31.274 -9.392 -1.423 1.00 29.69 O HETATM13615 O HOH 109 19.470 18.605 -16.900 1.00 25.71 O HETATM13616 O HOH 110 12.463 16.026 6.666 1.00 21.97 O HETATM13617 O HOH 111 22.131 -17.016 13.033 1.00 23.77 O HETATM13618 O HOH 112 10.442 -9.696 10.428 1.00 14.60 O HETATM13619 O HOH 113 31.927 -11.992 -0.256 1.00 16.14 O HETATM13620 O HOH 114 8.964 -16.340 9.324 1.00 22.56 O HETATM13621 O HOH 115 3.756 3.593 -33.994 1.00 35.84 O HETATM13622 O HOH 116 18.172 -10.541 -25.954 1.00 49.63 O HETATM13623 O HOH 117 -12.951 -5.077 -15.396 1.00 30.80 O HETATM13624 O HOH 118 18.442 29.247 2.522 1.00 51.36 O HETATM13625 O HOH 119 -1.736 -6.773 -28.728 1.00 27.95 O HETATM13626 O HOH 120 17.348 -7.993 18.502 1.00 32.69 O HETATM13627 O HOH 121 17.278 -16.212 -9.979 1.00 36.34 O HETATM13628 O HOH 122 -9.325 -7.533 -13.732 1.00 21.53 O HETATM13629 O HOH 123 17.501 -1.296 -32.842 1.00 29.83 O HETATM13630 O HOH 124 30.400 14.813 -6.044 1.00 32.52 O HETATM13631 O HOH 125 7.253 -22.322 15.652 1.00 44.28 O HETATM13632 O HOH 126 6.382 -11.454 -19.962 1.00 17.89 O HETATM13633 O HOH 127 16.436 -5.611 -28.453 1.00 25.42 O HETATM13634 O HOH 128 37.708 3.418 9.635 1.00 39.63 O HETATM13635 O HOH 129 21.549 4.284 -0.015 1.00 21.20 O HETATM13636 O HOH 130 -12.216 -16.136 15.578 1.00 26.65 O HETATM13637 O HOH 131 5.391 4.737 -26.520 1.00 17.06 O HETATM13638 O HOH 132 -3.817 -14.063 -27.437 1.00 50.22 O HETATM13639 O HOH 133 12.392 -17.443 2.179 1.00 21.64 O HETATM13640 O HOH 134 17.461 27.375 -13.982 1.00 38.51 O HETATM13641 O HOH 135 15.617 -16.425 -13.769 1.00 24.98 O HETATM13642 O HOH 136 4.687 -13.958 -19.095 1.00 27.62 O HETATM13643 O HOH 137 15.335 0.648 -33.091 1.00 23.38 O HETATM13644 O HOH 138 24.266 -5.262 26.245 1.00 34.81 O HETATM13645 O HOH 139 2.494 -22.976 -23.296 1.00 33.75 O HETATM13646 O HOH 140 -9.138 8.925 -9.396 1.00 22.09 O HETATM13647 O HOH 141 10.807 -14.087 -17.686 1.00 51.77 O HETATM13648 O HOH 142 9.987 17.843 -20.608 1.00 42.39 O HETATM13649 O HOH 143 6.688 -25.216 7.798 1.00 26.80 O HETATM13650 O HOH 144 -3.859 0.247 -12.799 1.00 27.55 O HETATM13651 O HOH 145 21.526 -0.696 25.591 1.00 20.13 O HETATM13652 O HOH 146 -1.018 -14.606 -6.701 1.00 13.68 O HETATM13653 O HOH 147 -1.702 -11.779 -6.931 1.00 8.74 O HETATM13654 O HOH 148 -5.046 -15.092 -14.202 1.00 31.16 O HETATM13655 O HOH 149 -3.402 -15.516 -17.250 1.00 57.02 O HETATM13656 O HOH 150 -2.187 -13.239 -9.974 1.00 10.89 O HETATM13657 O HOH 151 -9.421 -16.498 -1.328 1.00 10.08 O HETATM13658 O HOH 152 -0.592 -12.943 9.462 1.00 7.77 O HETATM13659 O HOH 153 3.080 -10.795 9.230 1.00 10.36 O HETATM13660 O HOH 154 2.257 -8.330 10.455 1.00 10.54 O HETATM13661 O HOH 155 -12.768 -19.818 1.204 1.00 46.26 O HETATM13662 O HOH 156 -9.497 -21.060 1.702 1.00 30.67 O HETATM13663 O HOH 157 -27.637 4.517 18.336 1.00 13.71 O HETATM13664 O HOH 158 -21.370 0.202 20.527 1.00 8.86 O HETATM13665 O HOH 159 -20.435 6.947 16.943 1.00 10.31 O HETATM13666 O HOH 160 -15.295 12.654 18.372 1.00 23.99 O HETATM13667 O HOH 161 -16.362 11.327 20.352 1.00 20.03 O HETATM13668 O HOH 162 -1.701 21.215 -1.395 1.00 9.46 O HETATM13669 O HOH 163 -7.601 12.391 -8.686 1.00 10.41 O HETATM13670 O HOH 164 8.653 3.560 11.666 1.00 7.83 O HETATM13671 O HOH 165 7.343 4.900 9.749 1.00 7.99 O HETATM13672 O HOH 166 10.790 5.003 12.265 1.00 23.87 O HETATM13673 O HOH 167 13.989 5.567 12.120 1.00 33.08 O HETATM13674 O HOH 168 16.583 3.244 15.413 1.00 44.65 O HETATM13675 O HOH 169 5.117 -5.292 20.653 1.00 11.52 O HETATM13676 O HOH 170 9.309 5.444 7.935 1.00 11.84 O HETATM13677 O HOH 171 10.631 6.894 10.027 1.00 16.91 O HETATM13678 O HOH 172 8.030 7.933 5.713 1.00 27.06 O HETATM13679 O HOH 173 -12.904 12.281 16.697 1.00 16.84 O HETATM13680 O HOH 174 -9.586 19.892 -0.061 1.00 16.43 O HETATM13681 O HOH 175 -17.074 -4.698 6.672 1.00 6.83 O HETATM13682 O HOH 176 -10.720 -5.982 7.232 1.00 6.81 O HETATM13683 O HOH 177 -5.491 -9.018 -0.651 1.00 4.36 O HETATM13684 O HOH 178 1.083 -5.745 10.081 1.00 6.40 O HETATM13685 O HOH 179 -1.713 -6.140 10.695 1.00 8.48 O HETATM13686 O HOH 180 -3.657 -4.353 9.872 1.00 7.99 O HETATM13687 O HOH 181 -17.680 -13.586 -7.756 1.00 13.07 O HETATM13688 O HOH 182 -22.069 -11.366 -2.036 1.00 11.93 O HETATM13689 O HOH 183 -29.259 -4.244 -5.949 1.00 12.89 O HETATM13690 O HOH 184 -27.440 -1.953 -6.758 1.00 15.99 O HETATM13691 O HOH 185 -25.222 -1.930 -9.517 1.00 27.29 O HETATM13692 O HOH 186 -23.364 2.352 -3.523 1.00 8.45 O HETATM13693 O HOH 187 -26.264 2.129 -3.571 1.00 12.49 O HETATM13694 O HOH 188 -26.650 -14.692 13.570 1.00 40.49 O HETATM13695 O HOH 189 -14.291 -15.671 -6.566 1.00 18.00 O HETATM13696 O HOH 190 -12.327 -13.282 14.784 1.00 17.73 O HETATM13697 O HOH 191 -14.823 -13.657 14.088 1.00 17.94 O HETATM13698 O HOH 192 -22.724 -10.974 9.662 1.00 14.60 O HETATM13699 O HOH 193 -17.799 11.894 24.133 1.00 25.88 O HETATM13700 O HOH 194 -7.790 20.944 14.636 1.00 48.80 O HETATM13701 O HOH 195 1.864 21.311 4.045 1.00 16.03 O HETATM13702 O HOH 196 -1.616 25.285 -6.861 1.00 37.04 O HETATM13703 O HOH 197 -0.419 22.872 0.142 1.00 32.96 O HETATM13704 O HOH 198 -7.833 10.669 -11.757 1.00 31.16 O HETATM13705 O HOH 199 -0.657 13.250 17.749 1.00 56.50 O HETATM13706 O HOH 200 19.203 4.059 17.926 1.00 51.46 O HETATM13707 O HOH 201 14.461 0.930 17.346 1.00 29.91 O HETATM13708 O HOH 202 13.550 -1.933 17.819 1.00 22.76 O HETATM13709 O HOH 203 -22.514 19.265 -3.851 1.00 22.66 O HETATM13710 O HOH 204 -15.698 12.569 15.177 1.00 29.52 O HETATM13711 O HOH 205 -25.214 16.189 13.168 1.00 23.94 O HETATM13712 O HOH 206 -23.525 19.515 4.170 1.00 11.77 O HETATM13713 O HOH 207 -29.560 17.121 7.590 1.00 18.59 O HETATM13714 O HOH 208 -10.740 -7.093 -1.487 1.00 7.59 O HETATM13715 O HOH 209 -12.953 -6.394 -3.429 1.00 5.25 O HETATM13716 O HOH 210 -13.834 -9.273 -3.032 1.00 7.72 O HETATM13717 O HOH 211 7.222 -7.140 11.682 1.00 9.46 O HETATM13718 O HOH 212 3.421 -2.079 12.200 1.00 18.88 O HETATM13719 O HOH 213 -18.143 -0.630 -14.541 1.00 16.47 O HETATM13720 O HOH 214 -20.445 -21.911 -1.310 1.00 28.55 O HETATM13721 O HOH 215 -27.478 -9.103 8.248 1.00 40.82 O HETATM13722 O HOH 216 -31.061 -1.553 10.754 1.00 37.82 O HETATM13723 O HOH 217 -32.579 15.248 -0.876 1.00 50.67 O HETATM13724 O HOH 218 -15.382 7.842 -3.463 1.00 15.64 O HETATM13725 O HOH 219 -20.156 0.665 0.548 1.00 5.19 O HETATM13726 O HOH 220 7.270 11.015 14.592 1.00 26.55 O HETATM13727 O HOH 221 7.041 8.453 20.706 1.00 23.49 O HETATM13728 O HOH 222 7.115 -6.597 18.077 1.00 31.14 O HETATM13729 O HOH 223 9.584 7.967 22.238 1.00 53.54 O HETATM13730 O HOH 224 6.344 -6.874 15.309 1.00 19.44 O HETATM13731 O HOH 225 6.235 -8.807 20.843 1.00 26.36 O HETATM13732 O HOH 226 -13.427 -8.783 -11.857 1.00 13.00 O HETATM13733 O HOH 227 -32.644 -4.129 -1.847 1.00 19.66 O HETATM13734 O HOH 228 -32.679 -12.356 -8.633 1.00 12.86 O HETATM13735 O HOH 229 11.905 -7.136 13.788 1.00 15.06 O HETATM13736 O HOH 230 9.371 -13.930 -9.688 1.00 7.37 O HETATM13737 O HOH 231 -21.168 -13.960 -15.141 1.00 13.39 O HETATM13738 O HOH 232 -13.178 7.937 -9.921 1.00 19.00 O HETATM13739 O HOH 233 16.727 0.005 12.358 1.00 11.37 O HETATM13740 O HOH 234 -16.809 -1.414 -9.673 1.00 15.11 O HETATM13741 O HOH 235 -0.205 9.901 16.640 1.00 7.83 O HETATM13742 O HOH 236 -18.094 24.463 -2.923 1.00 26.42 O HETATM13743 O HOH 237 -8.253 -15.883 17.564 1.00 18.23 O HETATM13744 O HOH 238 15.182 -2.359 15.656 1.00 18.20 O HETATM13745 O HOH 239 -20.051 -10.181 5.074 1.00 11.93 O HETATM13746 O HOH 240 -19.037 13.808 -6.234 1.00 20.32 O HETATM13747 O HOH 241 -19.889 3.030 -13.001 1.00 17.83 O HETATM13748 O HOH 242 -39.544 6.888 1.183 1.00 26.47 O HETATM13749 O HOH 243 -10.941 -14.688 -10.721 1.00 21.72 O HETATM13750 O HOH 244 -35.731 -6.967 -4.255 1.00 20.94 O HETATM13751 O HOH 245 -24.440 -12.550 9.353 1.00 43.32 O HETATM13752 O HOH 246 -27.653 0.530 24.460 1.00 27.95 O HETATM13753 O HOH 247 -10.114 20.795 -2.339 1.00 26.15 O HETATM13754 O HOH 248 -15.229 -18.767 -1.260 1.00 21.54 O HETATM13755 O HOH 249 -28.143 -4.385 -24.793 1.00 27.51 O HETATM13756 O HOH 250 -26.418 20.025 4.863 1.00 29.61 O HETATM13757 O HOH 251 -5.332 -23.145 1.019 1.00 30.21 O HETATM13758 O HOH 252 10.662 -18.827 -11.167 1.00 20.40 O HETATM13759 O HOH 253 -31.274 -9.392 1.423 1.00 29.69 O HETATM13760 O HOH 254 -19.470 18.605 16.900 1.00 25.71 O HETATM13761 O HOH 255 -12.463 16.026 -6.666 1.00 21.97 O HETATM13762 O HOH 256 -22.131 -17.016 -13.033 1.00 23.77 O HETATM13763 O HOH 257 -10.442 -9.696 -10.428 1.00 14.60 O HETATM13764 O HOH 258 -31.927 -11.992 0.256 1.00 16.14 O HETATM13765 O HOH 259 -8.964 -16.340 -9.324 1.00 22.56 O HETATM13766 O HOH 260 -3.756 3.593 33.994 1.00 35.84 O HETATM13767 O HOH 261 -18.172 -10.541 25.954 1.00 49.63 O HETATM13768 O HOH 262 12.951 -5.077 15.396 1.00 30.80 O HETATM13769 O HOH 263 -18.442 29.247 -2.522 1.00 51.36 O HETATM13770 O HOH 264 1.736 -6.773 28.728 1.00 27.95 O HETATM13771 O HOH 265 -17.348 -7.993 -18.502 1.00 32.69 O HETATM13772 O HOH 266 -17.278 -16.212 9.979 1.00 36.34 O HETATM13773 O HOH 267 9.325 -7.533 13.732 1.00 21.53 O HETATM13774 O HOH 268 -17.501 -1.296 32.842 1.00 29.83 O HETATM13775 O HOH 269 -30.400 14.813 6.044 1.00 32.52 O HETATM13776 O HOH 270 -7.253 -22.322 -15.652 1.00 44.28 O HETATM13777 O HOH 271 -6.382 -11.454 19.962 1.00 17.89 O HETATM13778 O HOH 272 -16.436 -5.611 28.453 1.00 25.42 O HETATM13779 O HOH 273 -37.708 3.418 -9.635 1.00 39.63 O HETATM13780 O HOH 274 -21.549 4.284 0.015 1.00 21.20 O HETATM13781 O HOH 275 12.216 -16.136 -15.578 1.00 26.65 O HETATM13782 O HOH 276 -5.391 4.737 26.520 1.00 17.06 O HETATM13783 O HOH 277 3.817 -14.063 27.437 1.00 50.22 O HETATM13784 O HOH 278 -12.392 -17.443 -2.179 1.00 21.64 O HETATM13785 O HOH 279 -17.461 27.375 13.982 1.00 38.51 O HETATM13786 O HOH 280 -15.617 -16.425 13.769 1.00 24.98 O HETATM13787 O HOH 281 -4.687 -13.958 19.095 1.00 27.62 O HETATM13788 O HOH 282 -15.335 0.648 33.091 1.00 23.38 O HETATM13789 O HOH 283 -24.266 -5.262 -26.245 1.00 34.81 O HETATM13790 O HOH 284 -2.494 -22.976 23.296 1.00 33.75 O HETATM13791 O HOH 285 9.138 8.925 9.396 1.00 22.09 O HETATM13792 O HOH 286 -10.807 -14.087 17.686 1.00 51.77 O HETATM13793 O HOH 287 -9.987 17.843 20.608 1.00 42.39 O HETATM13794 O HOH 288 -6.688 -25.216 -7.798 1.00 26.80 O HETATM13795 O HOH 289 3.859 0.247 12.799 1.00 27.55 O HETATM13796 O HOH 290 -21.526 -0.696 -25.591 1.00 20.13 O HETATM13797 AN1 FCX A 291 19.532 -8.074 13.329 1.00 -0.27 N HETATM13798 AC2 FCX A 291 18.964 -8.638 14.399 1.00 0.05 C HETATM13799 AN3 FCX A 291 18.129 -9.680 14.473 1.00 -0.27 N HETATM13800 AC4 FCX A 291 17.905 -10.197 13.248 1.00 0.16 C HETATM13801 AC5 FCX A 291 18.391 -9.735 12.047 1.00 0.10 C HETATM13802 AC6 FCX A 291 19.269 -8.622 12.129 1.00 0.13 C HETATM13803 AN6 FCX A 291 19.805 -8.004 11.121 1.00 -0.32 N HETATM13804 H2 FCX A 291 19.656 -8.354 10.164 1.00 0.18 H HETATM13805 H3 FCX A 291 20.379 -7.163 11.278 1.00 0.18 H HETATM13806 AN7 FCX A 291 17.918 -10.530 10.998 1.00 -0.30 N HETATM13807 AC8 FCX A 291 17.145 -11.431 11.577 1.00 0.11 C HETATM13808 AN9 FCX A 291 17.105 -11.284 12.947 1.00 -0.19 N HETATM13809 AC1 FCX A 291 16.250 -12.058 13.816 1.00 0.20 C HETATM13810 AC2 FCX A 291 14.811 -11.765 13.323 1.00 0.14 C HETATM13811 AO2 FCX A 291 14.320 -10.469 13.672 1.00 -0.38 O HETATM13812 H7 FCX A 291 13.437 -10.365 13.337 1.00 0.21 H HETATM13813 AC3 FCX A 291 14.050 -12.922 13.957 1.00 0.15 C HETATM13814 AO3 FCX A 291 14.035 -12.729 15.380 1.00 -0.27 O HETATM13815 AP3 FCX A 291 12.646 -13.035 16.191 1.00 0.20 P HETATM13816 AO7 FCX A 291 11.534 -12.399 15.421 1.00 -0.55 O HETATM13817 AO8 FCX A 291 12.843 -12.700 17.628 1.00 -0.55 O HETATM13818 AO9 FCX A 291 12.546 -14.522 16.086 1.00 -0.55 O HETATM13819 AC4 FCX A 291 15.019 -14.086 13.689 1.00 0.12 C HETATM13820 AO4 FCX A 291 16.302 -13.431 13.514 1.00 -0.34 O HETATM13821 AC5 FCX A 291 14.746 -14.875 12.435 1.00 0.11 C HETATM13822 AO5 FCX A 291 14.425 -13.901 11.398 1.00 -0.25 O HETATM13823 AP1 FCX A 291 14.769 -14.331 9.900 1.00 0.30 P HETATM13824 AO1 FCX A 291 13.925 -15.518 9.572 1.00 -0.61 O HETATM13825 AO2 FCX A 291 16.225 -14.463 9.736 1.00 -0.61 O HETATM13826 AO3 FCX A 291 14.429 -12.980 9.165 1.00 -0.13 O HETATM13827 AP2 FCX A 291 13.063 -12.609 8.430 1.00 0.30 P HETATM13828 AO4 FCX A 291 13.022 -13.353 7.148 1.00 -0.61 O HETATM13829 AO5 FCX A 291 11.889 -12.636 9.311 1.00 -0.61 O HETATM13830 AO6 FCX A 291 13.374 -11.020 8.201 1.00 -0.25 O HETATM13831 PC12 FCX A 291 14.306 -10.563 7.224 1.00 0.09 C HETATM13832 PC11 FCX A 291 14.736 -9.153 7.586 1.00 0.04 C HETATM13833 PC13 FCX A 291 15.507 -8.607 6.351 1.00 -0.05 C HETATM13834 H14 FCX A 291 15.846 -7.581 6.555 1.00 0.02 H HETATM13835 H15 FCX A 291 14.842 -8.606 5.475 1.00 0.02 H HETATM13836 H16 FCX A 291 16.378 -9.248 6.150 1.00 0.02 H HETATM13837 PC14 FCX A 291 13.429 -8.338 7.826 1.00 -0.05 C HETATM13838 H17 FCX A 291 12.901 -8.741 8.703 1.00 0.02 H HETATM13839 H18 FCX A 291 12.781 -8.415 6.941 1.00 0.02 H HETATM13840 H19 FCX A 291 13.682 -7.282 8.004 1.00 0.02 H HETATM13841 PC10 FCX A 291 15.629 -9.281 8.851 1.00 0.15 C HETATM13842 PO10 FCX A 291 16.809 -9.947 8.353 1.00 -0.37 O HETATM13843 H21 FCX A 291 17.425 -10.072 9.065 1.00 0.21 H HETATM13844 PC9 FCX A 291 16.023 -7.912 9.410 1.00 0.21 C HETATM13845 PO9 FCX A 291 15.345 -7.350 10.270 1.00 -0.39 O HETATM13846 PN8 FCX A 291 17.126 -7.329 8.939 1.00 -0.28 N HETATM13847 PC7 FCX A 291 17.543 -5.999 9.445 1.00 0.05 C HETATM13848 PC6 FCX A 291 16.818 -4.908 8.653 1.00 0.06 C HETATM13849 PC5 FCX A 291 17.245 -4.793 7.192 1.00 0.18 C HETATM13850 PO5 FCX A 291 18.466 -4.810 6.913 1.00 -0.40 O HETATM13851 PN4 FCX A 291 16.256 -4.578 6.247 1.00 -0.29 N HETATM13852 PC3 FCX A 291 16.638 -4.427 4.848 1.00 0.04 C HETATM13853 PC2 FCX A 291 16.635 -5.690 4.016 1.00 0.01 C HETATM13854 C1 FCX A 291 16.501 -5.609 2.476 1.00 0.15 C HETATM13855 F1 FCX A 291 17.741 -5.526 1.881 1.00 -0.23 F HETATM13856 C2 FCX A 291 15.571 -4.523 2.014 1.00 0.07 C HETATM13857 O1 FCX A 291 14.397 -4.726 1.814 1.00 -0.57 O HETATM13858 O2 FCX A 291 16.129 -3.363 1.806 1.00 -0.57 O HETATM13859 H32 FCX A 291 16.053 -6.559 2.149 1.00 0.08 H HETATM13860 H30 FCX A 291 15.795 -6.303 4.375 1.00 0.03 H HETATM13861 H31 FCX A 291 17.583 -6.208 4.224 1.00 0.03 H HETATM13862 H28 FCX A 291 17.655 -4.010 4.821 1.00 0.05 H HETATM13863 H29 FCX A 291 15.938 -3.717 4.383 1.00 0.05 H HETATM13864 H27 FCX A 291 15.295 -4.527 6.520 1.00 0.19 H HETATM13865 H25 FCX A 291 17.011 -3.942 9.144 1.00 0.05 H HETATM13866 H26 FCX A 291 15.740 -5.124 8.679 1.00 0.05 H HETATM13867 H23 FCX A 291 18.630 -5.883 9.321 1.00 0.05 H HETATM13868 H24 FCX A 291 17.284 -5.913 10.511 1.00 0.05 H HETATM13869 H22 FCX A 291 17.674 -7.791 8.242 1.00 0.19 H HETATM13870 H20 FCX A 291 15.128 -9.873 9.631 1.00 0.08 H HETATM13871 H12 FCX A 291 13.832 -10.562 6.231 1.00 0.06 H HETATM13872 H13 FCX A 291 15.184 -11.226 7.211 1.00 0.06 H HETATM13873 H10 FCX A 291 13.898 -15.557 12.592 1.00 0.06 H HETATM13874 H11 FCX A 291 15.636 -15.456 12.149 1.00 0.06 H HETATM13875 H9 FCX A 291 15.029 -14.770 14.551 1.00 0.07 H HETATM13876 H8 FCX A 291 13.043 -13.070 13.540 1.00 0.07 H HETATM13877 H6 FCX A 291 14.768 -11.846 12.227 1.00 0.07 H HETATM13878 H5 FCX A 291 16.430 -11.838 14.879 1.00 0.10 H HETATM13879 H4 FCX A 291 16.601 -12.202 11.034 1.00 0.13 H HETATM13880 H1 FCX A 291 19.218 -8.183 15.349 1.00 0.10 H CONECT 1 2 11 12 13 CONECT 11 1 CONECT 12 1 CONECT 13 1 CONECT 6754 6755 6764 6765 6766 CONECT 6764 6754 CONECT 6765 6754 CONECT 6766 6754 CONECT137971379813802 CONECT13798137971379913880 CONECT137991379813800 CONECT13800137991380113808 CONECT13801138001380213806 CONECT13802137971380113803 CONECT13803138021380413805 CONECT1380413803 CONECT1380513803 CONECT138061380113807 CONECT13807138061380813879 CONECT13808138001380713809 CONECT1380913808138101382013878 CONECT1381013809138111381313877 CONECT138111381013812 CONECT1381213811 CONECT1381313810138141381913876 CONECT138141381313815 CONECT1381513814138161381713818 CONECT1381613815 CONECT1381713815 CONECT1381813815 CONECT1381913813138201382113875 CONECT138201380913819 CONECT1382113819138221387313874 CONECT138221382113823 CONECT1382313822138241382513826 CONECT1382413823 CONECT1382513823 CONECT138261382313827 CONECT1382713826138281382913830 CONECT1382813827 CONECT1382913827 CONECT138301382713831 CONECT1383113830138321387113872 CONECT1383213831138331383713841 CONECT1383313832138341383513836 CONECT1383413833 CONECT1383513833 CONECT1383613833 CONECT1383713832138381383913840 CONECT1383813837 CONECT1383913837 CONECT1384013837 CONECT1384113832138421384413870 CONECT138421384113843 CONECT1384313842 CONECT13844138411384513846 CONECT1384513844 CONECT13846138441384713869 CONECT1384713846138481386713868 CONECT1384813847138491386513866 CONECT13849138481385013851 CONECT1385013849 CONECT13851138491385213864 CONECT1385213851138531386213863 CONECT1385313852138541386013861 CONECT1385413853138551385613859 CONECT1385513854 CONECT13856138541385713858 CONECT1385713856 CONECT1385813856 CONECT1385913854 CONECT1386013853 CONECT1386113853 CONECT1386213852 CONECT1386313852 CONECT1386413851 CONECT1386513848 CONECT1386613848 CONECT1386713847 CONECT1386813847 CONECT1386913846 CONECT1387013841 CONECT1387113831 CONECT1387213831 CONECT1387313821 CONECT1387413821 CONECT1387513819 CONECT1387613813 CONECT1387713810 CONECT1387813809 CONECT1387913807 CONECT1388013798 MASTER 0 0 0 0 0 0 0 013878 2 92 68 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 1css
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
1csh
RCSB PDB
PDBbind
435aa, >1CSH_1|Chain... at 93%
1csi
RCSB PDB
PDBbind
435aa, >1CSI_1|Chain... at 93%
1csr
RCSB PDB
PDBbind
435aa, >1CSR_1|Chain... at 93%
4cts
RCSB PDB
PDBbind
437aa, >4CTS_1|Chains... *
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
No complexes with the same small molecule ligand are found!
Entry Information
PDB ID
1css
Complex Type
Protein-Ligand
PDBbind Subset
general set
Protein Name
citrate synthase
Ligand Name
FCX
EC.Number
E.C.4.1.3.7
Resolution
1.7(Å)
Affinity (Kd/Ki/IC50)
Ki=0.8uM
Release Year
1995
Protein/NA Sequence
Check fasta file
Primary Reference
Biochemistry v34 pp. 15459-66, 1995
Ligand Properties
Formula
C
2
3
H
4
0
FN
7
O
1
8
P
3
Molecular Weight
814.519
Exact Mass
814.163
No. of atoms
92
No. of bonds
94
Polar Surface Area
434.11
LOGP Value
-5.18 (
Computed with XLOGP3
)
-1.73 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 5
No. of Hydrogen Bond Acceptors: 16
No. of Rotatable Bonds: 22
No. of Nitrogen and Oxygen Atoms: 25
No. of Rings: 3
Canonical SMILES
O=C(NCC[C@@H](C(=O)O)F)CCNC(=O)[C@@H](C(COP(OP(OC[C@H]1O[C@H]([C@@H]([C@@H]1OP(O)(O)O)O)n1cnc2c1ncnc2N)(O)O)(O)O)(C)C)O
InChI String
InChI=1S/C23H43FN7O18P3/c1-23(2,17(34)20(35)27-6-4-13(32)26-5-3-11(24)22(36)37)8-46-52(43,44)49-51(41,42)45-7-12-16(48-50(38,39)40)15(33)21(47-12)31-10-30-14-18(25)28-9-29-19(14)31/h9-12,15-17,21,33-34,38-44,50-52H,3-8H2,1-2H3,(H,26,32)(H,27,35)(H,36,37)(H2,25,28,29)/t11-,12+,15+,16+,17-,21+/m0/s1
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
P23007
Entrez Gene ID
No matched NCBI Entrez Gene ID found!
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com