Browse entries in the PDBbind-CN Database
HEADER 1W6R_COMPLEX COMPND 1W6R_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 482 SER GLU LEU LEU VAL ASN THR LYS SER GLY LYS VAL MET SEQRES 2 A 482 GLY THR ARG VAL PRO VAL LEU SER SER HIS ILE SER ALA SEQRES 3 A 482 PHE LEU GLY ILE PRO PHE ALA GLU PRO PRO VAL GLY ASN SEQRES 4 A 482 MET ARG PHE ARG ARG PRO GLU PRO LYS LYS PRO TRP SER SEQRES 5 A 482 GLY VAL TRP ASN ALA SER THR TYR PRO ASN ASN CYS GLN SEQRES 6 A 482 GLN TYR VAL ASP GLU GLN PHE PRO GLY PHE SER GLY SER SEQRES 7 A 482 GLU MET TRP ASN PRO ASN ARG GLU MET SER GLU ASP CYS SEQRES 8 A 482 LEU TYR LEU ASN ILE TRP VAL PRO SER PRO ARG PRO LYS SEQRES 9 A 482 SER THR THR VAL MET VAL TRP ILE TYR GLY GLY GLY PHE SEQRES 10 A 482 TYR SER GLY SER SER THR LEU ASP VAL TYR ASN GLY LYS SEQRES 11 A 482 TYR LEU ALA TYR THR GLU GLU VAL VAL LEU VAL SER LEU SEQRES 12 A 482 SER TYR ARG VAL GLY ALA PHE GLY PHE LEU ALA LEU HIS SEQRES 13 A 482 GLY SER GLN GLU ALA PRO GLY ASN VAL GLY LEU LEU ASP SEQRES 14 A 482 GLN ARG MET ALA LEU GLN TRP VAL HIS ASP ASN ILE GLN SEQRES 15 A 482 PHE PHE GLY GLY ASP PRO LYS THR VAL THR ILE PHE GLY SEQRES 16 A 482 GLU SER ALA GLY GLY ALA SER VAL GLY MET HIS ILE LEU SEQRES 17 A 482 SER PRO GLY SER ARG ASP LEU PHE ARG ARG ALA ILE LEU SEQRES 18 A 482 GLN SER GLY SER PRO ASN CYS PRO TRP ALA SER VAL SER SEQRES 19 A 482 VAL ALA GLU GLY ARG ARG ARG ALA VAL GLU LEU GLY ARG SEQRES 20 A 482 ASN LEU ASN CYS ASN LEU ASN SER ASP GLU GLU LEU ILE SEQRES 21 A 482 HIS CYS LEU ARG GLU LYS LYS PRO GLN GLU LEU ILE ASP SEQRES 22 A 482 VAL GLU TRP ASN VAL LEU PRO PHE ASP SER ILE PHE ARG SEQRES 23 A 482 PHE SER PHE VAL PRO VAL ILE ASP GLY GLU PHE PHE PRO SEQRES 24 A 482 THR SER LEU GLU SER MET LEU ASN SER GLY ASN PHE LYS SEQRES 25 A 482 LYS THR GLN ILE LEU LEU GLY VAL ASN LYS ASP GLU GLY SEQRES 26 A 482 SER PHE PHE LEU LEU TYR GLY ALA PRO GLY PHE SER LYS SEQRES 27 A 482 ASP SER GLU SER LYS ILE SER ARG GLU ASP PHE MET SER SEQRES 28 A 482 GLY VAL LYS LEU SER VAL PRO HIS ALA ASN ASP LEU GLY SEQRES 29 A 482 LEU ASP ALA VAL THR LEU GLN TYR THR ASP TRP MET ASP SEQRES 30 A 482 ASP ASN ASN GLY ILE LYS ASN ARG ASP GLY LEU ASP ASP SEQRES 31 A 482 ILE VAL GLY ASP HIS ASN VAL ILE CYS PRO LEU MET HIS SEQRES 32 A 482 PHE VAL ASN LYS TYR THR LYS PHE GLY ASN GLY THR TYR SEQRES 33 A 482 LEU TYR PHE PHE ASN HIS ARG ALA SER ASN LEU VAL TRP SEQRES 34 A 482 PRO GLU TRP MET GLY VAL ILE HIS GLY TYR GLU ILE GLU SEQRES 35 A 482 PHE VAL PHE GLY LEU PRO LEU VAL LYS GLU LEU ASN TYR SEQRES 36 A 482 THR ALA GLU GLU GLU ALA LEU SER ARG ARG ILE MET HIS SEQRES 37 A 482 TYR TRP ALA THR PHE ALA LYS THR GLY ASN PRO ASN GLU SEQRES 38 A 482 PRO SEQRES 1 A 46 SER LYS TRP PRO LEU PHE THR THR LYS GLU GLN LYS PHE SEQRES 2 A 46 ILE ASP LEU ASN THR GLU PRO MET LYS VAL HIS GLN ARG SEQRES 3 A 46 LEU ARG VAL GLN MET CYS VAL PHE TRP ASN GLN PHE LEU SEQRES 4 A 46 PRO LYS LEU LEU ASN ALA THR SEQRES 1 B 482 SER GLU LEU LEU VAL ASN THR LYS SER GLY LYS VAL MET SEQRES 2 B 482 GLY THR ARG VAL PRO VAL LEU SER SER HIS ILE SER ALA SEQRES 3 B 482 PHE LEU GLY ILE PRO PHE ALA GLU PRO PRO VAL GLY ASN SEQRES 4 B 482 MET ARG PHE ARG ARG PRO GLU PRO LYS LYS PRO TRP SER SEQRES 5 B 482 GLY VAL TRP ASN ALA SER THR TYR PRO ASN ASN CYS GLN SEQRES 6 B 482 GLN TYR VAL ASP GLU GLN PHE PRO GLY PHE SER GLY SER SEQRES 7 B 482 GLU MET TRP ASN PRO ASN ARG GLU MET SER GLU ASP CYS SEQRES 8 B 482 LEU TYR LEU ASN ILE TRP VAL PRO SER PRO ARG PRO LYS SEQRES 9 B 482 SER THR THR VAL MET VAL TRP ILE TYR GLY GLY GLY PHE SEQRES 10 B 482 TYR SER GLY SER SER THR LEU ASP VAL TYR ASN GLY LYS SEQRES 11 B 482 TYR LEU ALA TYR THR GLU GLU VAL VAL LEU VAL SER LEU SEQRES 12 B 482 SER TYR ARG VAL GLY ALA PHE GLY PHE LEU ALA LEU HIS SEQRES 13 B 482 GLY SER GLN GLU ALA PRO GLY ASN VAL GLY LEU LEU ASP SEQRES 14 B 482 GLN ARG MET ALA LEU GLN TRP VAL HIS ASP ASN ILE GLN SEQRES 15 B 482 PHE PHE GLY GLY ASP PRO LYS THR VAL THR ILE PHE GLY SEQRES 16 B 482 GLU SER ALA GLY GLY ALA SER VAL GLY MET HIS ILE LEU SEQRES 17 B 482 SER PRO GLY SER ARG ASP LEU PHE ARG ARG ALA ILE LEU SEQRES 18 B 482 GLN SER GLY SER PRO ASN CYS PRO TRP ALA SER VAL SER SEQRES 19 B 482 VAL ALA GLU GLY ARG ARG ARG ALA VAL GLU LEU GLY ARG SEQRES 20 B 482 ASN LEU ASN CYS ASN LEU ASN SER ASP GLU GLU LEU ILE SEQRES 21 B 482 HIS CYS LEU ARG GLU LYS LYS PRO GLN GLU LEU ILE ASP SEQRES 22 B 482 VAL GLU TRP ASN VAL LEU PRO PHE ASP SER ILE PHE ARG SEQRES 23 B 482 PHE SER PHE VAL PRO VAL ILE ASP GLY GLU PHE PHE PRO SEQRES 24 B 482 THR SER LEU GLU SER MET LEU ASN SER GLY ASN PHE LYS SEQRES 25 B 482 LYS THR GLN ILE LEU LEU GLY VAL ASN LYS ASP GLU GLY SEQRES 26 B 482 SER PHE PHE LEU LEU TYR GLY ALA PRO GLY PHE SER LYS SEQRES 27 B 482 ASP SER GLU SER LYS ILE SER ARG GLU ASP PHE MET SER SEQRES 28 B 482 GLY VAL LYS LEU SER VAL PRO HIS ALA ASN ASP LEU GLY SEQRES 29 B 482 LEU ASP ALA VAL THR LEU GLN TYR THR ASP TRP MET ASP SEQRES 30 B 482 ASP ASN ASN GLY ILE LYS ASN ARG ASP GLY LEU ASP ASP SEQRES 31 B 482 ILE VAL GLY ASP HIS ASN VAL ILE CYS PRO LEU MET HIS SEQRES 32 B 482 PHE VAL ASN LYS TYR THR LYS PHE GLY ASN GLY THR TYR SEQRES 33 B 482 LEU TYR PHE PHE ASN HIS ARG ALA SER ASN LEU VAL TRP SEQRES 34 B 482 PRO GLU TRP MET GLY VAL ILE HIS GLY TYR GLU ILE GLU SEQRES 35 B 482 PHE VAL PHE GLY LEU PRO LEU VAL LYS GLU LEU ASN TYR SEQRES 36 B 482 THR ALA GLU GLU GLU ALA LEU SER ARG ARG ILE MET HIS SEQRES 37 B 482 TYR TRP ALA THR PHE ALA LYS THR GLY ASN PRO ASN GLU SEQRES 38 B 482 PRO SEQRES 1 B 46 SER LYS TRP PRO LEU PHE THR THR LYS GLU GLN LYS PHE SEQRES 2 B 46 ILE ASP LEU ASN THR GLU PRO MET LYS VAL HIS GLN ARG SEQRES 3 B 46 LEU ARG VAL GLN MET CYS VAL PHE TRP ASN GLN PHE LEU SEQRES 4 B 46 PRO LYS LEU LEU ASN ALA THR HET MG A 1 1 HET MG A 2 1 HET GNT A1551 41 SSBOND 1 CYS A 67 CYS A 94 SSBOND 2 CYS A 254 CYS A 265 SSBOND 3 CYS A 402 CYS A 521 SSBOND 4 CYS B 67 CYS B 94 SSBOND 5 CYS B 254 CYS B 265 SSBOND 6 CYS B 402 CYS B 521 ATOM 1 N SER A 4 -12.968 87.973 34.903 1.00 55.90 N ATOM 2 CA SER A 4 -12.277 88.349 36.182 1.00 55.32 C ATOM 3 C SER A 4 -11.223 87.304 36.532 1.00 54.48 C ATOM 4 O SER A 4 -11.419 86.099 36.315 1.00 54.01 O ATOM 5 CB SER A 4 -13.267 88.435 37.347 1.00 55.55 C ATOM 6 OG SER A 4 -12.597 88.498 38.607 1.00 56.14 O ATOM 7 HA SER A 4 -11.816 89.325 36.028 1.00 0.00 H ATOM 8 HB2 SER A 4 -13.908 87.554 37.331 1.00 0.00 H ATOM 9 HB3 SER A 4 -13.878 89.330 37.226 1.00 0.00 H ATOM 10 HG SER A 4 -13.267 88.553 39.334 1.00 0.00 H ATOM 11 HN3 SER A 4 -13.428 87.047 35.018 1.00 0.00 H ATOM 12 HN2 SER A 4 -12.269 87.921 34.135 1.00 0.00 H ATOM 13 HN1 SER A 4 -13.684 88.691 34.673 1.00 0.00 H ATOM 14 N GLU A 5 -10.124 87.799 37.088 1.00 52.94 N ATOM 15 CA GLU A 5 -8.997 87.002 37.507 1.00 51.70 C ATOM 16 C GLU A 5 -9.390 86.062 38.656 1.00 49.56 C ATOM 17 O GLU A 5 -8.708 85.072 38.915 1.00 48.96 O ATOM 18 CB GLU A 5 -7.876 87.951 37.926 1.00 52.69 C ATOM 19 CG GLU A 5 -6.538 87.317 38.255 1.00 56.54 C ATOM 20 CD GLU A 5 -5.506 88.368 38.654 1.00 58.72 C ATOM 21 OE1 GLU A 5 -5.925 89.493 38.949 1.00 60.65 O ATOM 22 OE2 GLU A 5 -4.283 88.094 38.694 1.00 61.30 O ATOM 23 HA GLU A 5 -8.657 86.372 36.685 1.00 0.00 H ATOM 24 HB2 GLU A 5 -7.717 88.656 37.110 1.00 0.00 H ATOM 25 HB3 GLU A 5 -8.213 88.491 38.811 1.00 0.00 H ATOM 26 HG2 GLU A 5 -6.670 86.618 39.081 1.00 0.00 H ATOM 27 HG3 GLU A 5 -6.176 86.778 37.379 1.00 0.00 H ATOM 28 H GLU A 5 -10.072 88.828 37.231 1.00 0.00 H ATOM 29 N LEU A 6 -10.477 86.368 39.355 1.00 47.09 N ATOM 30 CA LEU A 6 -10.871 85.508 40.460 1.00 45.14 C ATOM 31 C LEU A 6 -11.876 84.468 40.057 1.00 44.43 C ATOM 32 O LEU A 6 -12.360 83.715 40.896 1.00 45.28 O ATOM 33 CB LEU A 6 -11.414 86.329 41.627 1.00 43.27 C ATOM 34 CG LEU A 6 -10.437 87.401 42.123 1.00 44.00 C ATOM 35 CD1 LEU A 6 -11.162 88.223 43.208 1.00 42.07 C ATOM 36 CD2 LEU A 6 -9.132 86.759 42.716 1.00 43.18 C ATOM 37 HA LEU A 6 -9.968 84.986 40.776 1.00 0.00 H ATOM 38 HB2 LEU A 6 -12.333 86.820 41.307 1.00 0.00 H ATOM 39 HB3 LEU A 6 -11.634 85.653 42.453 1.00 0.00 H ATOM 40 HG LEU A 6 -10.133 88.034 41.289 1.00 0.00 H ATOM 41 HD21 LEU A 6 -9.394 86.115 43.555 1.00 0.00 H ATOM 42 HD22 LEU A 6 -8.636 86.169 41.945 1.00 0.00 H ATOM 43 HD23 LEU A 6 -8.463 87.549 43.058 1.00 0.00 H ATOM 44 HD11 LEU A 6 -12.050 88.686 42.778 1.00 0.00 H ATOM 45 HD12 LEU A 6 -11.454 87.565 44.026 1.00 0.00 H ATOM 46 HD13 LEU A 6 -10.493 88.997 43.583 1.00 0.00 H ATOM 47 H LEU A 6 -11.038 87.210 39.116 1.00 0.00 H ATOM 48 N LEU A 7 -12.174 84.396 38.770 1.00 44.99 N ATOM 49 CA LEU A 7 -13.118 83.410 38.294 1.00 45.93 C ATOM 50 C LEU A 7 -12.388 82.383 37.432 1.00 44.98 C ATOM 51 O LEU A 7 -11.659 82.741 36.503 1.00 45.17 O ATOM 52 CB LEU A 7 -14.217 84.094 37.488 1.00 49.11 C ATOM 53 CG LEU A 7 -15.331 83.128 37.124 1.00 52.88 C ATOM 54 CD1 LEU A 7 -15.894 82.523 38.407 1.00 54.87 C ATOM 55 CD2 LEU A 7 -16.435 83.875 36.329 1.00 55.90 C ATOM 56 HA LEU A 7 -13.574 82.901 39.143 1.00 0.00 H ATOM 57 HB2 LEU A 7 -14.635 84.908 38.080 1.00 0.00 H ATOM 58 HB3 LEU A 7 -13.785 84.497 36.572 1.00 0.00 H ATOM 59 HG LEU A 7 -14.946 82.327 36.493 1.00 0.00 H ATOM 60 HD21 LEU A 7 -16.841 84.680 36.942 1.00 0.00 H ATOM 61 HD22 LEU A 7 -16.006 84.292 35.418 1.00 0.00 H ATOM 62 HD23 LEU A 7 -17.231 83.176 36.071 1.00 0.00 H ATOM 63 HD11 LEU A 7 -15.102 81.993 38.935 1.00 0.00 H ATOM 64 HD12 LEU A 7 -16.286 83.318 39.041 1.00 0.00 H ATOM 65 HD13 LEU A 7 -16.695 81.827 38.158 1.00 0.00 H ATOM 66 H LEU A 7 -11.727 85.052 38.098 1.00 0.00 H ATOM 67 N VAL A 8 -12.552 81.105 37.753 1.00 42.83 N ATOM 68 CA VAL A 8 -11.887 80.067 36.977 1.00 40.30 C ATOM 69 C VAL A 8 -12.848 78.943 36.731 1.00 39.80 C ATOM 70 O VAL A 8 -13.486 78.462 37.644 1.00 38.97 O ATOM 71 CB VAL A 8 -10.637 79.476 37.719 1.00 40.84 C ATOM 72 CG1 VAL A 8 -9.992 78.337 36.856 1.00 37.60 C ATOM 73 CG2 VAL A 8 -9.610 80.570 37.953 1.00 38.50 C ATOM 74 HA VAL A 8 -11.554 80.525 36.046 1.00 0.00 H ATOM 75 HB VAL A 8 -10.958 79.068 38.677 1.00 0.00 H ATOM 76 HG11 VAL A 8 -10.724 77.545 36.697 1.00 0.00 H ATOM 77 HG12 VAL A 8 -9.680 78.744 35.894 1.00 0.00 H ATOM 78 HG13 VAL A 8 -9.125 77.933 37.379 1.00 0.00 H ATOM 79 HG21 VAL A 8 -9.297 80.984 36.994 1.00 0.00 H ATOM 80 HG22 VAL A 8 -10.052 81.357 38.563 1.00 0.00 H ATOM 81 HG23 VAL A 8 -8.746 80.151 38.468 1.00 0.00 H ATOM 82 H VAL A 8 -13.156 80.845 38.559 1.00 0.00 H ATOM 83 N ASN A 9 -12.951 78.516 35.478 1.00 40.77 N ATOM 84 CA ASN A 9 -13.851 77.424 35.143 1.00 41.61 C ATOM 85 C ASN A 9 -13.045 76.145 35.025 1.00 40.87 C ATOM 86 O ASN A 9 -12.135 76.070 34.230 1.00 41.27 O ATOM 87 CB ASN A 9 -14.575 77.703 33.823 1.00 44.56 C ATOM 88 CG ASN A 9 -15.724 76.741 33.605 1.00 49.71 C ATOM 89 OD1 ASN A 9 -16.359 76.259 34.580 1.00 51.40 O ATOM 90 ND2 ASN A 9 -16.017 76.442 32.330 1.00 51.75 N ATOM 91 HA ASN A 9 -14.601 77.325 35.928 1.00 0.00 H ATOM 92 HB2 ASN A 9 -14.964 78.721 33.840 1.00 0.00 H ATOM 93 HB3 ASN A 9 -13.866 77.600 33.001 1.00 0.00 H ATOM 94 HD22 ASN A 9 -15.465 76.865 31.557 1.00 0.00 H ATOM 95 HD21 ASN A 9 -16.796 75.788 32.115 1.00 0.00 H ATOM 96 H ASN A 9 -12.384 78.966 34.731 1.00 0.00 H ATOM 97 N THR A 10 -13.368 75.149 35.832 1.00 39.93 N ATOM 98 CA THR A 10 -12.631 73.895 35.803 1.00 39.66 C ATOM 99 C THR A 10 -13.564 72.816 35.265 1.00 40.69 C ATOM 100 O THR A 10 -14.759 73.071 35.096 1.00 40.78 O ATOM 101 CB THR A 10 -12.198 73.456 37.240 1.00 38.90 C ATOM 102 OG1 THR A 10 -13.336 72.923 37.925 1.00 36.55 O ATOM 103 CG2 THR A 10 -11.674 74.650 38.074 1.00 38.68 C ATOM 104 HA THR A 10 -11.743 74.028 35.185 1.00 0.00 H ATOM 105 HB THR A 10 -11.402 72.719 37.133 1.00 0.00 H ATOM 106 HG1 THR A 10 -14.039 73.617 37.984 1.00 0.00 H ATOM 107 HG23 THR A 10 -10.804 75.082 37.580 1.00 0.00 H ATOM 108 HG21 THR A 10 -12.457 75.404 38.159 1.00 0.00 H ATOM 109 HG22 THR A 10 -11.394 74.302 39.068 1.00 0.00 H ATOM 110 H THR A 10 -14.160 75.263 36.497 1.00 0.00 H ATOM 111 N LYS A 11 -13.027 71.610 35.041 1.00 39.97 N ATOM 112 CA LYS A 11 -13.812 70.468 34.572 1.00 39.67 C ATOM 113 C LYS A 11 -14.850 70.050 35.593 1.00 40.76 C ATOM 114 O LYS A 11 -15.753 69.287 35.274 1.00 41.22 O ATOM 115 CB LYS A 11 -12.883 69.278 34.262 1.00 39.73 C ATOM 116 CG LYS A 11 -11.885 69.591 33.139 1.00 39.52 C ATOM 117 CD LYS A 11 -10.728 68.604 33.108 1.00 37.37 C ATOM 118 CE LYS A 11 -9.904 68.880 31.844 1.00 34.62 C ATOM 119 NZ LYS A 11 -8.594 68.121 31.818 1.00 36.59 N ATOM 120 HA LYS A 11 -14.332 70.774 33.664 1.00 0.00 H ATOM 121 HB2 LYS A 11 -12.327 69.024 35.164 1.00 0.00 H ATOM 122 HB3 LYS A 11 -13.493 68.426 33.961 1.00 0.00 H ATOM 123 HG2 LYS A 11 -12.407 69.550 32.183 1.00 0.00 H ATOM 124 HG3 LYS A 11 -11.487 70.594 33.292 1.00 0.00 H ATOM 125 HD2 LYS A 11 -10.105 68.736 33.992 1.00 0.00 H ATOM 126 HD3 LYS A 11 -11.112 67.584 33.084 1.00 0.00 H ATOM 127 HE2 LYS A 11 -9.689 69.947 31.795 1.00 0.00 H ATOM 128 HE3 LYS A 11 -10.493 68.589 30.974 1.00 0.00 H ATOM 129 HZ1 LYS A 11 -8.018 68.397 32.639 1.00 0.00 H ATOM 130 HZ2 LYS A 11 -8.786 67.100 31.855 1.00 0.00 H ATOM 131 HZ3 LYS A 11 -8.081 68.347 30.942 1.00 0.00 H ATOM 132 H LYS A 11 -12.009 71.480 35.207 1.00 0.00 H ATOM 133 N SER A 12 -14.728 70.508 36.838 1.00 40.44 N ATOM 134 CA SER A 12 -15.736 70.148 37.820 1.00 43.03 C ATOM 135 C SER A 12 -16.763 71.280 38.015 1.00 42.67 C ATOM 136 O SER A 12 -17.793 71.081 38.670 1.00 42.59 O ATOM 137 CB SER A 12 -15.090 69.829 39.172 1.00 45.33 C ATOM 138 OG SER A 12 -14.050 68.876 39.018 1.00 49.12 O ATOM 139 HA SER A 12 -16.249 69.264 37.440 1.00 0.00 H ATOM 140 HB2 SER A 12 -15.847 69.427 39.845 1.00 0.00 H ATOM 141 HB3 SER A 12 -14.677 70.744 39.597 1.00 0.00 H ATOM 142 HG SER A 12 -13.646 68.684 39.901 1.00 0.00 H ATOM 143 H SER A 12 -13.925 71.113 37.102 1.00 0.00 H ATOM 144 N GLY A 13 -16.491 72.446 37.430 1.00 42.97 N ATOM 145 CA GLY A 13 -17.392 73.579 37.587 1.00 43.19 C ATOM 146 C GLY A 13 -16.606 74.872 37.756 1.00 44.13 C ATOM 147 O GLY A 13 -15.359 74.849 37.737 1.00 42.66 O ATOM 148 HA3 GLY A 13 -18.016 73.421 38.467 1.00 0.00 H ATOM 149 HA2 GLY A 13 -18.026 73.658 36.704 1.00 0.00 H ATOM 150 H GLY A 13 -15.629 72.547 36.857 1.00 0.00 H ATOM 151 N LYS A 14 -17.333 75.991 37.886 1.00 43.72 N ATOM 152 CA LYS A 14 -16.750 77.332 38.067 1.00 42.88 C ATOM 153 C LYS A 14 -16.422 77.507 39.536 1.00 42.50 C ATOM 154 O LYS A 14 -17.134 77.017 40.427 1.00 42.52 O ATOM 155 CB LYS A 14 -17.724 78.466 37.683 1.00 45.31 C ATOM 156 CG LYS A 14 -17.938 78.691 36.182 1.00 50.62 C ATOM 157 CD LYS A 14 -17.940 80.215 35.856 1.00 53.53 C ATOM 158 CE LYS A 14 -18.047 80.539 34.343 1.00 53.79 C ATOM 159 NZ LYS A 14 -19.474 80.489 33.827 1.00 56.73 N ATOM 160 HA LYS A 14 -15.874 77.397 37.421 1.00 0.00 H ATOM 161 HB2 LYS A 14 -18.693 78.238 38.127 1.00 0.00 H ATOM 162 HB3 LYS A 14 -17.340 79.393 38.108 1.00 0.00 H ATOM 163 HG2 LYS A 14 -17.135 78.206 35.628 1.00 0.00 H ATOM 164 HG3 LYS A 14 -18.894 78.259 35.886 1.00 0.00 H ATOM 165 HD2 LYS A 14 -18.788 80.673 36.365 1.00 0.00 H ATOM 166 HD3 LYS A 14 -17.014 80.647 36.234 1.00 0.00 H ATOM 167 HE2 LYS A 14 -17.451 79.814 33.789 1.00 0.00 H ATOM 168 HE3 LYS A 14 -17.650 81.540 34.173 1.00 0.00 H ATOM 169 HZ1 LYS A 14 -19.862 79.535 33.975 1.00 0.00 H ATOM 170 HZ2 LYS A 14 -20.052 81.184 34.342 1.00 0.00 H ATOM 171 HZ3 LYS A 14 -19.482 80.714 32.812 1.00 0.00 H ATOM 172 H LYS A 14 -18.369 75.908 37.857 1.00 0.00 H ATOM 173 N VAL A 15 -15.369 78.267 39.778 1.00 41.45 N ATOM 174 CA VAL A 15 -14.883 78.484 41.104 1.00 42.62 C ATOM 175 C VAL A 15 -14.593 79.967 41.232 1.00 41.54 C ATOM 176 O VAL A 15 -14.085 80.586 40.296 1.00 41.19 O ATOM 177 CB VAL A 15 -13.596 77.598 41.238 1.00 44.25 C ATOM 178 CG1 VAL A 15 -12.370 78.434 41.382 1.00 45.23 C ATOM 179 CG2 VAL A 15 -13.785 76.583 42.284 1.00 44.17 C ATOM 180 HA VAL A 15 -15.583 78.212 41.894 1.00 0.00 H ATOM 181 HB VAL A 15 -13.434 77.042 40.315 1.00 0.00 H ATOM 182 HG11 VAL A 15 -12.261 79.071 40.504 1.00 0.00 H ATOM 183 HG12 VAL A 15 -12.457 79.054 42.274 1.00 0.00 H ATOM 184 HG13 VAL A 15 -11.498 77.786 41.472 1.00 0.00 H ATOM 185 HG21 VAL A 15 -13.980 77.076 43.236 1.00 0.00 H ATOM 186 HG22 VAL A 15 -14.631 75.947 42.023 1.00 0.00 H ATOM 187 HG23 VAL A 15 -12.884 75.975 42.366 1.00 0.00 H ATOM 188 H VAL A 15 -14.880 78.721 38.980 1.00 0.00 H ATOM 189 N MET A 16 -14.902 80.541 42.388 1.00 42.12 N ATOM 190 CA MET A 16 -14.645 81.960 42.585 1.00 43.55 C ATOM 191 C MET A 16 -13.699 82.144 43.741 1.00 41.50 C ATOM 192 O MET A 16 -13.998 81.766 44.880 1.00 40.53 O ATOM 193 CB MET A 16 -15.951 82.704 42.883 1.00 47.90 C ATOM 194 CG MET A 16 -15.760 84.140 43.371 1.00 54.37 C ATOM 195 SD MET A 16 -15.997 85.306 42.052 1.00 65.35 S ATOM 196 CE MET A 16 -14.405 85.454 41.407 1.00 60.36 C ATOM 197 HA MET A 16 -14.204 82.364 41.674 1.00 0.00 H ATOM 198 HB2 MET A 16 -16.545 82.730 41.970 1.00 0.00 H ATOM 199 HB3 MET A 16 -16.491 82.151 43.651 1.00 0.00 H ATOM 200 HG2 MET A 16 -14.750 84.250 43.766 1.00 0.00 H ATOM 201 HG3 MET A 16 -16.482 84.346 44.161 1.00 0.00 H ATOM 202 HE1 MET A 16 -13.732 85.819 42.183 1.00 0.00 H ATOM 203 HE2 MET A 16 -14.064 84.479 41.058 1.00 0.00 H ATOM 204 HE3 MET A 16 -14.416 86.156 40.574 1.00 0.00 H ATOM 205 H MET A 16 -15.327 79.978 43.152 1.00 0.00 H ATOM 206 N GLY A 17 -12.580 82.774 43.460 1.00 39.83 N ATOM 207 CA GLY A 17 -11.612 82.949 44.519 1.00 42.69 C ATOM 208 C GLY A 17 -11.710 84.303 45.212 1.00 43.33 C ATOM 209 O GLY A 17 -12.730 84.954 45.146 1.00 43.01 O ATOM 210 HA3 GLY A 17 -10.613 82.850 44.094 1.00 0.00 H ATOM 211 HA2 GLY A 17 -11.768 82.168 45.263 1.00 0.00 H ATOM 212 H GLY A 17 -12.396 83.136 42.503 1.00 0.00 H ATOM 213 N THR A 18 -10.620 84.713 45.843 1.00 43.49 N ATOM 214 CA THR A 18 -10.554 85.969 46.554 1.00 45.06 C ATOM 215 C THR A 18 -9.159 86.513 46.446 1.00 44.35 C ATOM 216 O THR A 18 -8.221 85.764 46.280 1.00 44.23 O ATOM 217 CB THR A 18 -10.940 85.789 48.038 1.00 45.63 C ATOM 218 OG1 THR A 18 -10.832 87.052 48.688 1.00 47.73 O ATOM 219 CG2 THR A 18 -10.006 84.780 48.761 1.00 46.64 C ATOM 220 HA THR A 18 -11.263 86.667 46.109 1.00 0.00 H ATOM 221 HB THR A 18 -11.958 85.401 48.081 1.00 0.00 H ATOM 222 HG1 THR A 18 -9.900 87.380 48.617 1.00 0.00 H ATOM 223 HG23 THR A 18 -10.078 83.807 48.274 1.00 0.00 H ATOM 224 HG21 THR A 18 -8.978 85.138 48.710 1.00 0.00 H ATOM 225 HG22 THR A 18 -10.309 84.689 49.804 1.00 0.00 H ATOM 226 H THR A 18 -9.776 84.105 45.826 1.00 0.00 H ATOM 227 N ARG A 19 -9.019 87.826 46.505 1.00 45.89 N ATOM 228 CA ARG A 19 -7.717 88.456 46.404 1.00 48.25 C ATOM 229 C ARG A 19 -7.105 88.562 47.803 1.00 47.86 C ATOM 230 O ARG A 19 -7.799 88.815 48.771 1.00 47.42 O ATOM 231 CB ARG A 19 -7.830 89.834 45.733 1.00 52.73 C ATOM 232 CG ARG A 19 -6.508 90.601 45.745 1.00 59.03 C ATOM 233 CD ARG A 19 -6.257 91.439 44.480 1.00 64.27 C ATOM 234 NE ARG A 19 -4.822 91.385 44.119 1.00 70.10 N ATOM 235 CZ ARG A 19 -4.261 92.021 43.084 1.00 71.46 C ATOM 236 NH1 ARG A 19 -5.011 92.777 42.293 1.00 72.63 N ATOM 237 NH2 ARG A 19 -2.956 91.900 42.839 1.00 71.71 N ATOM 238 HA ARG A 19 -7.063 87.848 45.778 1.00 0.00 H ATOM 239 HB2 ARG A 19 -8.144 89.695 44.699 1.00 0.00 H ATOM 240 HB3 ARG A 19 -8.580 90.421 46.263 1.00 0.00 H ATOM 241 HG2 ARG A 19 -6.508 91.271 46.605 1.00 0.00 H ATOM 242 HG3 ARG A 19 -5.695 89.882 45.846 1.00 0.00 H ATOM 243 HD2 ARG A 19 -6.544 92.473 44.668 1.00 0.00 H ATOM 244 HD3 ARG A 19 -6.852 91.041 43.658 1.00 0.00 H ATOM 245 HE ARG A 19 -4.200 90.806 44.718 1.00 0.00 H ATOM 246 HH12 ARG A 19 -4.580 93.274 41.487 1.00 0.00 H ATOM 247 HH11 ARG A 19 -6.030 92.873 42.479 1.00 0.00 H ATOM 248 HH22 ARG A 19 -2.530 92.399 42.032 1.00 0.00 H ATOM 249 HH21 ARG A 19 -2.364 91.307 43.455 1.00 0.00 H ATOM 250 H ARG A 19 -9.863 88.421 46.627 1.00 0.00 H ATOM 251 N VAL A 20 -5.808 88.306 47.925 1.00 47.22 N ATOM 252 CA VAL A 20 -5.205 88.371 49.241 1.00 46.84 C ATOM 253 C VAL A 20 -3.956 89.187 49.220 1.00 45.46 C ATOM 254 O VAL A 20 -3.135 89.071 48.322 1.00 45.47 O ATOM 255 CB VAL A 20 -4.874 86.941 49.839 1.00 47.76 C ATOM 256 CG1 VAL A 20 -6.078 86.035 49.684 1.00 48.74 C ATOM 257 CG2 VAL A 20 -3.669 86.335 49.166 1.00 47.95 C ATOM 258 HA VAL A 20 -5.948 88.843 49.884 1.00 0.00 H ATOM 259 HB VAL A 20 -4.640 87.053 50.898 1.00 0.00 H ATOM 260 HG11 VAL A 20 -6.926 86.465 50.218 1.00 0.00 H ATOM 261 HG12 VAL A 20 -6.325 85.938 48.627 1.00 0.00 H ATOM 262 HG13 VAL A 20 -5.847 85.053 50.096 1.00 0.00 H ATOM 263 HG21 VAL A 20 -3.865 86.230 48.099 1.00 0.00 H ATOM 264 HG22 VAL A 20 -2.806 86.984 49.316 1.00 0.00 H ATOM 265 HG23 VAL A 20 -3.468 85.355 49.598 1.00 0.00 H ATOM 266 H VAL A 20 -5.235 88.063 47.091 1.00 0.00 H ATOM 267 N PRO A 21 -3.800 90.041 50.222 1.00 45.37 N ATOM 268 CA PRO A 21 -2.606 90.887 50.302 1.00 46.06 C ATOM 269 C PRO A 21 -1.428 90.009 50.716 1.00 45.26 C ATOM 270 O PRO A 21 -1.610 89.051 51.479 1.00 45.30 O ATOM 271 CB PRO A 21 -2.986 91.924 51.364 1.00 45.33 C ATOM 272 CG PRO A 21 -3.869 91.123 52.313 1.00 46.23 C ATOM 273 CD PRO A 21 -4.708 90.244 51.363 1.00 46.01 C ATOM 274 HA PRO A 21 -2.309 91.373 49.373 1.00 0.00 H ATOM 275 HD3 PRO A 21 -4.968 89.295 51.832 1.00 0.00 H ATOM 276 HD2 PRO A 21 -5.619 90.757 51.054 1.00 0.00 H ATOM 277 HG3 PRO A 21 -4.508 91.782 52.902 1.00 0.00 H ATOM 278 HG2 PRO A 21 -3.266 90.509 52.983 1.00 0.00 H ATOM 279 HB2 PRO A 21 -2.102 92.305 51.876 1.00 0.00 H ATOM 280 HB3 PRO A 21 -3.535 92.756 50.923 1.00 0.00 H ATOM 281 N VAL A 22 -0.240 90.341 50.216 1.00 44.31 N ATOM 282 CA VAL A 22 0.987 89.595 50.502 1.00 45.08 C ATOM 283 C VAL A 22 2.155 90.550 50.337 1.00 45.06 C ATOM 284 O VAL A 22 2.366 91.048 49.216 1.00 42.73 O ATOM 285 CB VAL A 22 1.351 88.538 49.410 1.00 45.52 C ATOM 286 CG1 VAL A 22 2.146 87.389 50.021 1.00 42.73 C ATOM 287 CG2 VAL A 22 0.159 88.168 48.615 1.00 46.19 C ATOM 288 HA VAL A 22 0.826 89.144 51.481 1.00 0.00 H ATOM 289 HB VAL A 22 2.029 88.967 48.673 1.00 0.00 H ATOM 290 HG11 VAL A 22 3.066 87.777 50.459 1.00 0.00 H ATOM 291 HG12 VAL A 22 1.549 86.907 50.795 1.00 0.00 H ATOM 292 HG13 VAL A 22 2.390 86.664 49.244 1.00 0.00 H ATOM 293 HG21 VAL A 22 -0.599 87.745 49.274 1.00 0.00 H ATOM 294 HG22 VAL A 22 -0.239 89.056 48.125 1.00 0.00 H ATOM 295 HG23 VAL A 22 0.440 87.431 47.862 1.00 0.00 H ATOM 296 H VAL A 22 -0.180 91.171 49.592 1.00 0.00 H ATOM 297 N LEU A 23 2.923 90.756 51.404 1.00 45.50 N ATOM 298 CA LEU A 23 4.106 91.608 51.346 1.00 46.74 C ATOM 299 C LEU A 23 3.867 92.899 50.514 1.00 47.58 C ATOM 300 O LEU A 23 4.574 93.176 49.552 1.00 46.36 O ATOM 301 CB LEU A 23 5.259 90.765 50.759 1.00 46.55 C ATOM 302 CG LEU A 23 5.610 89.505 51.593 1.00 47.02 C ATOM 303 CD1 LEU A 23 6.460 88.545 50.815 1.00 44.43 C ATOM 304 CD2 LEU A 23 6.333 89.937 52.874 1.00 47.03 C ATOM 305 HA LEU A 23 4.356 91.951 52.350 1.00 0.00 H ATOM 306 HB2 LEU A 23 4.973 90.444 49.757 1.00 0.00 H ATOM 307 HB3 LEU A 23 6.147 91.394 50.698 1.00 0.00 H ATOM 308 HG LEU A 23 4.684 88.988 51.845 1.00 0.00 H ATOM 309 HD21 LEU A 23 7.247 90.470 52.612 1.00 0.00 H ATOM 310 HD22 LEU A 23 5.682 90.592 53.454 1.00 0.00 H ATOM 311 HD23 LEU A 23 6.582 89.055 53.464 1.00 0.00 H ATOM 312 HD11 LEU A 23 5.922 88.227 49.922 1.00 0.00 H ATOM 313 HD12 LEU A 23 7.389 89.036 50.526 1.00 0.00 H ATOM 314 HD13 LEU A 23 6.684 87.676 51.434 1.00 0.00 H ATOM 315 H LEU A 23 2.673 90.297 52.303 1.00 0.00 H ATOM 316 N SER A 24 2.833 93.647 50.873 1.00 49.68 N ATOM 317 CA SER A 24 2.486 94.900 50.184 1.00 53.25 C ATOM 318 C SER A 24 2.063 94.776 48.700 1.00 53.37 C ATOM 319 O SER A 24 2.082 95.766 47.951 1.00 55.14 O ATOM 320 CB SER A 24 3.643 95.889 50.264 1.00 53.83 C ATOM 321 OG SER A 24 4.422 95.715 49.088 1.00 58.20 O ATOM 322 HA SER A 24 1.602 95.246 50.720 1.00 0.00 H ATOM 323 HB2 SER A 24 4.248 95.686 51.148 1.00 0.00 H ATOM 324 HB3 SER A 24 3.261 96.909 50.313 1.00 0.00 H ATOM 325 HG SER A 24 4.759 94.785 49.051 1.00 0.00 H ATOM 326 H SER A 24 2.245 93.336 51.672 1.00 0.00 H ATOM 327 N SER A 25 1.695 93.571 48.275 1.00 52.33 N ATOM 328 CA SER A 25 1.209 93.322 46.922 1.00 50.01 C ATOM 329 C SER A 25 -0.024 92.439 47.104 1.00 49.11 C ATOM 330 O SER A 25 -0.601 92.399 48.186 1.00 47.14 O ATOM 331 CB SER A 25 2.265 92.629 46.065 1.00 50.22 C ATOM 332 OG SER A 25 1.783 92.455 44.742 1.00 50.72 O ATOM 333 HA SER A 25 0.975 94.250 46.400 1.00 0.00 H ATOM 334 HB2 SER A 25 2.496 91.655 46.496 1.00 0.00 H ATOM 335 HB3 SER A 25 3.168 93.239 46.043 1.00 0.00 H ATOM 336 HG SER A 25 2.476 92.005 44.196 1.00 0.00 H ATOM 337 H SER A 25 1.756 92.771 48.936 1.00 0.00 H ATOM 338 N HIS A 26 -0.444 91.730 46.073 1.00 49.19 N ATOM 339 CA HIS A 26 -1.645 90.894 46.203 1.00 50.68 C ATOM 340 C HIS A 26 -1.563 89.688 45.249 1.00 49.75 C ATOM 341 O HIS A 26 -0.859 89.747 44.233 1.00 49.06 O ATOM 342 CB HIS A 26 -2.918 91.703 45.811 1.00 54.69 C ATOM 343 CG HIS A 26 -3.251 92.865 46.719 1.00 60.52 C ATOM 344 ND1 HIS A 26 -2.716 94.132 46.554 1.00 62.99 N ATOM 345 CD2 HIS A 26 -4.101 92.958 47.781 1.00 62.10 C ATOM 346 CE1 HIS A 26 -3.221 94.948 47.472 1.00 63.77 C ATOM 347 NE2 HIS A 26 -4.064 94.261 48.228 1.00 63.10 N ATOM 348 HA HIS A 26 -1.703 90.564 47.240 1.00 0.00 H ATOM 349 HB2 HIS A 26 -2.772 92.093 44.804 1.00 0.00 H ATOM 350 HB3 HIS A 26 -3.766 91.019 45.815 1.00 0.00 H ATOM 351 HD2 HIS A 26 -4.700 92.150 48.200 1.00 0.00 H ATOM 352 HE1 HIS A 26 -2.982 96.005 47.584 1.00 0.00 H ATOM 353 H HIS A 26 0.074 91.763 45.172 1.00 0.00 H ATOM 354 N ILE A 27 -2.276 88.604 45.560 1.00 48.17 N ATOM 355 CA ILE A 27 -2.344 87.459 44.645 1.00 47.02 C ATOM 356 C ILE A 27 -3.742 86.917 44.799 1.00 45.81 C ATOM 357 O ILE A 27 -4.482 87.408 45.637 1.00 45.86 O ATOM 358 CB ILE A 27 -1.347 86.349 44.968 1.00 47.64 C ATOM 359 CG1 ILE A 27 -1.531 85.899 46.402 1.00 48.83 C ATOM 360 CG2 ILE A 27 0.068 86.820 44.716 1.00 47.90 C ATOM 361 CD1 ILE A 27 -0.509 84.876 46.764 1.00 53.30 C ATOM 362 HA ILE A 27 -2.098 87.789 43.636 1.00 0.00 H ATOM 363 HB ILE A 27 -1.532 85.497 44.314 1.00 0.00 H ATOM 364 HG12 ILE A 27 -1.428 86.759 47.064 1.00 0.00 H ATOM 365 HG13 ILE A 27 -2.526 85.469 46.518 1.00 0.00 H ATOM 366 HD11 ILE A 27 -0.611 84.013 46.106 1.00 0.00 H ATOM 367 HD12 ILE A 27 0.487 85.304 46.652 1.00 0.00 H ATOM 368 HD13 ILE A 27 -0.658 84.565 47.798 1.00 0.00 H ATOM 369 HG21 ILE A 27 0.175 87.100 43.668 1.00 0.00 H ATOM 370 HG22 ILE A 27 0.280 87.683 45.347 1.00 0.00 H ATOM 371 HG23 ILE A 27 0.765 86.016 44.952 1.00 0.00 H ATOM 372 H ILE A 27 -2.791 88.570 46.463 1.00 0.00 H ATOM 373 N SER A 28 -4.102 85.912 44.000 1.00 44.00 N ATOM 374 CA SER A 28 -5.432 85.309 44.088 1.00 43.60 C ATOM 375 C SER A 28 -5.337 84.030 44.903 1.00 44.04 C ATOM 376 O SER A 28 -4.310 83.335 44.866 1.00 45.89 O ATOM 377 CB SER A 28 -5.956 84.901 42.713 1.00 42.54 C ATOM 378 OG SER A 28 -5.759 85.903 41.743 1.00 42.69 O ATOM 379 HA SER A 28 -6.097 86.046 44.537 1.00 0.00 H ATOM 380 HB2 SER A 28 -7.023 84.695 42.792 1.00 0.00 H ATOM 381 HB3 SER A 28 -5.436 83.998 42.394 1.00 0.00 H ATOM 382 HG SER A 28 -6.114 85.592 40.873 1.00 0.00 H ATOM 383 H SER A 28 -3.424 85.549 43.300 1.00 0.00 H ATOM 384 N ALA A 29 -6.414 83.688 45.590 1.00 42.12 N ATOM 385 CA ALA A 29 -6.461 82.475 46.384 1.00 41.79 C ATOM 386 C ALA A 29 -7.805 81.812 46.128 1.00 41.43 C ATOM 387 O ALA A 29 -8.850 82.495 46.081 1.00 40.88 O ATOM 388 CB ALA A 29 -6.312 82.797 47.896 1.00 42.02 C ATOM 389 HA ALA A 29 -5.640 81.815 46.104 1.00 0.00 H ATOM 390 HB1 ALA A 29 -5.357 83.293 48.068 1.00 0.00 H ATOM 391 HB2 ALA A 29 -7.125 83.453 48.208 1.00 0.00 H ATOM 392 HB3 ALA A 29 -6.351 81.871 48.469 1.00 0.00 H ATOM 393 H ALA A 29 -7.250 84.306 45.560 1.00 0.00 H ATOM 394 N PHE A 30 -7.782 80.497 45.938 1.00 39.60 N ATOM 395 CA PHE A 30 -9.023 79.741 45.733 1.00 39.37 C ATOM 396 C PHE A 30 -9.006 78.716 46.846 1.00 40.33 C ATOM 397 O PHE A 30 -8.365 77.677 46.741 1.00 41.85 O ATOM 398 CB PHE A 30 -9.006 79.072 44.365 1.00 38.95 C ATOM 399 CG PHE A 30 -8.929 80.046 43.231 1.00 36.67 C ATOM 400 CD1 PHE A 30 -7.689 80.554 42.822 1.00 36.79 C ATOM 401 CD2 PHE A 30 -10.111 80.484 42.595 1.00 36.42 C ATOM 402 CE1 PHE A 30 -7.599 81.489 41.797 1.00 37.86 C ATOM 403 CE2 PHE A 30 -10.064 81.423 41.554 1.00 36.54 C ATOM 404 CZ PHE A 30 -8.801 81.941 41.143 1.00 37.77 C ATOM 405 HA PHE A 30 -9.919 80.362 45.757 1.00 0.00 H ATOM 406 HB2 PHE A 30 -8.141 78.411 44.313 1.00 0.00 H ATOM 407 HB3 PHE A 30 -9.917 78.484 44.256 1.00 0.00 H ATOM 408 HD2 PHE A 30 -11.074 80.087 42.917 1.00 0.00 H ATOM 409 HE2 PHE A 30 -10.981 81.752 41.066 1.00 0.00 H ATOM 410 HZ PHE A 30 -8.745 82.675 40.339 1.00 0.00 H ATOM 411 HE1 PHE A 30 -6.628 81.877 41.491 1.00 0.00 H ATOM 412 HD1 PHE A 30 -6.780 80.211 43.316 1.00 0.00 H ATOM 413 H PHE A 30 -6.871 79.996 45.935 1.00 0.00 H ATOM 414 N LEU A 31 -9.684 79.026 47.932 1.00 40.54 N ATOM 415 CA LEU A 31 -9.665 78.189 49.112 1.00 40.14 C ATOM 416 C LEU A 31 -10.867 77.303 49.213 1.00 40.54 C ATOM 417 O LEU A 31 -11.956 77.692 48.819 1.00 40.86 O ATOM 418 CB LEU A 31 -9.596 79.097 50.350 1.00 39.49 C ATOM 419 CG LEU A 31 -8.598 80.259 50.194 1.00 39.68 C ATOM 420 CD1 LEU A 31 -8.583 81.184 51.468 1.00 37.00 C ATOM 421 CD2 LEU A 31 -7.213 79.647 49.944 1.00 36.76 C ATOM 422 HA LEU A 31 -8.794 77.537 49.047 1.00 0.00 H ATOM 423 HB2 LEU A 31 -10.587 79.513 50.531 1.00 0.00 H ATOM 424 HB3 LEU A 31 -9.295 78.494 51.206 1.00 0.00 H ATOM 425 HG LEU A 31 -8.893 80.892 49.357 1.00 0.00 H ATOM 426 HD21 LEU A 31 -6.937 79.018 50.790 1.00 0.00 H ATOM 427 HD22 LEU A 31 -7.242 79.044 49.036 1.00 0.00 H ATOM 428 HD23 LEU A 31 -6.480 80.445 49.829 1.00 0.00 H ATOM 429 HD11 LEU A 31 -9.578 81.602 51.624 1.00 0.00 H ATOM 430 HD12 LEU A 31 -8.294 80.596 52.339 1.00 0.00 H ATOM 431 HD13 LEU A 31 -7.867 81.992 51.320 1.00 0.00 H ATOM 432 H LEU A 31 -10.250 79.899 47.942 1.00 0.00 H ATOM 433 N GLY A 32 -10.666 76.094 49.730 1.00 40.16 N ATOM 434 CA GLY A 32 -11.782 75.176 49.919 1.00 39.34 C ATOM 435 C GLY A 32 -12.419 74.561 48.672 1.00 39.81 C ATOM 436 O GLY A 32 -13.620 74.378 48.652 1.00 39.77 O ATOM 437 HA3 GLY A 32 -12.564 75.719 50.449 1.00 0.00 H ATOM 438 HA2 GLY A 32 -11.426 74.355 50.541 1.00 0.00 H ATOM 439 H GLY A 32 -9.705 75.802 50.001 1.00 0.00 H ATOM 440 N ILE A 33 -11.641 74.262 47.631 1.00 39.56 N ATOM 441 CA ILE A 33 -12.201 73.651 46.427 1.00 39.45 C ATOM 442 C ILE A 33 -12.364 72.169 46.750 1.00 38.78 C ATOM 443 O ILE A 33 -11.394 71.524 47.169 1.00 38.71 O ATOM 444 CB ILE A 33 -11.247 73.803 45.210 1.00 38.85 C ATOM 445 CG1 ILE A 33 -11.021 75.279 44.892 1.00 38.86 C ATOM 446 CG2 ILE A 33 -11.836 73.064 44.005 1.00 38.53 C ATOM 447 CD1 ILE A 33 -10.002 75.532 43.759 1.00 37.05 C ATOM 448 HA ILE A 33 -13.142 74.133 46.160 1.00 0.00 H ATOM 449 HB ILE A 33 -10.279 73.363 45.451 1.00 0.00 H ATOM 450 HG12 ILE A 33 -11.975 75.716 44.598 1.00 0.00 H ATOM 451 HG13 ILE A 33 -10.659 75.772 45.794 1.00 0.00 H ATOM 452 HD11 ILE A 33 -9.036 75.113 44.040 1.00 0.00 H ATOM 453 HD12 ILE A 33 -10.353 75.056 42.843 1.00 0.00 H ATOM 454 HD13 ILE A 33 -9.900 76.605 43.597 1.00 0.00 H ATOM 455 HG21 ILE A 33 -11.950 72.008 44.249 1.00 0.00 H ATOM 456 HG22 ILE A 33 -12.809 73.489 43.760 1.00 0.00 H ATOM 457 HG23 ILE A 33 -11.166 73.171 43.152 1.00 0.00 H ATOM 458 H ILE A 33 -10.622 74.466 47.676 1.00 0.00 H ATOM 459 N PRO A 34 -13.584 71.610 46.572 1.00 38.05 N ATOM 460 CA PRO A 34 -13.852 70.181 46.865 1.00 38.22 C ATOM 461 C PRO A 34 -13.269 69.274 45.791 1.00 37.80 C ATOM 462 O PRO A 34 -13.346 69.605 44.618 1.00 36.65 O ATOM 463 CB PRO A 34 -15.394 70.112 46.921 1.00 38.26 C ATOM 464 CG PRO A 34 -15.808 71.163 45.840 1.00 36.38 C ATOM 465 CD PRO A 34 -14.809 72.313 46.117 1.00 37.91 C ATOM 466 HA PRO A 34 -13.389 69.837 47.790 1.00 0.00 H ATOM 467 HD3 PRO A 34 -14.615 72.887 45.211 1.00 0.00 H ATOM 468 HD2 PRO A 34 -15.187 72.979 46.893 1.00 0.00 H ATOM 469 HG3 PRO A 34 -16.839 71.490 45.978 1.00 0.00 H ATOM 470 HG2 PRO A 34 -15.686 70.765 44.832 1.00 0.00 H ATOM 471 HB2 PRO A 34 -15.755 69.116 46.664 1.00 0.00 H ATOM 472 HB3 PRO A 34 -15.767 70.390 47.907 1.00 0.00 H ATOM 473 N PHE A 35 -12.651 68.144 46.162 1.00 37.74 N ATOM 474 CA PHE A 35 -12.092 67.293 45.111 1.00 36.92 C ATOM 475 C PHE A 35 -12.643 65.915 45.259 1.00 36.89 C ATOM 476 O PHE A 35 -12.380 65.044 44.435 1.00 38.60 O ATOM 477 CB PHE A 35 -10.541 67.273 45.106 1.00 36.68 C ATOM 478 CG PHE A 35 -9.928 66.757 46.401 1.00 35.75 C ATOM 479 CD1 PHE A 35 -9.909 65.387 46.681 1.00 35.78 C ATOM 480 CD2 PHE A 35 -9.424 67.656 47.350 1.00 33.07 C ATOM 481 CE1 PHE A 35 -9.384 64.917 47.931 1.00 35.68 C ATOM 482 CE2 PHE A 35 -8.905 67.204 48.570 1.00 34.75 C ATOM 483 CZ PHE A 35 -8.886 65.845 48.860 1.00 36.38 C ATOM 484 HA PHE A 35 -12.386 67.713 44.149 1.00 0.00 H ATOM 485 HB2 PHE A 35 -10.208 66.633 44.289 1.00 0.00 H ATOM 486 HB3 PHE A 35 -10.185 68.289 44.938 1.00 0.00 H ATOM 487 HD2 PHE A 35 -9.436 68.725 47.135 1.00 0.00 H ATOM 488 HE2 PHE A 35 -8.515 67.920 49.294 1.00 0.00 H ATOM 489 HZ PHE A 35 -8.483 65.498 49.812 1.00 0.00 H ATOM 490 HE1 PHE A 35 -9.372 63.851 48.157 1.00 0.00 H ATOM 491 HD1 PHE A 35 -10.293 64.676 45.950 1.00 0.00 H ATOM 492 H PHE A 35 -12.571 67.880 47.165 1.00 0.00 H ATOM 493 N ALA A 36 -13.429 65.703 46.297 1.00 37.51 N ATOM 494 CA ALA A 36 -14.050 64.389 46.468 1.00 38.33 C ATOM 495 C ALA A 36 -15.417 64.598 47.071 1.00 39.45 C ATOM 496 O ALA A 36 -15.727 65.696 47.536 1.00 39.40 O ATOM 497 CB ALA A 36 -13.208 63.506 47.418 1.00 37.06 C ATOM 498 HA ALA A 36 -14.118 63.888 45.502 1.00 0.00 H ATOM 499 HB1 ALA A 36 -12.210 63.373 47.000 1.00 0.00 H ATOM 500 HB2 ALA A 36 -13.133 63.990 48.392 1.00 0.00 H ATOM 501 HB3 ALA A 36 -13.689 62.534 47.530 1.00 0.00 H ATOM 502 H ALA A 36 -13.605 66.461 46.986 1.00 0.00 H ATOM 503 N GLU A 37 -16.259 63.561 47.030 1.00 40.62 N ATOM 504 CA GLU A 37 -17.551 63.630 47.697 1.00 40.79 C ATOM 505 C GLU A 37 -17.249 63.515 49.213 1.00 40.96 C ATOM 506 O GLU A 37 -16.322 62.835 49.596 1.00 39.43 O ATOM 507 CB GLU A 37 -18.418 62.443 47.265 1.00 41.94 C ATOM 508 CG GLU A 37 -19.024 62.586 45.832 1.00 45.91 C ATOM 509 CD GLU A 37 -19.983 63.772 45.765 1.00 47.36 C ATOM 510 OE1 GLU A 37 -20.859 63.811 46.647 1.00 48.71 O ATOM 511 OE2 GLU A 37 -19.859 64.652 44.877 1.00 47.47 O ATOM 512 HA GLU A 37 -18.081 64.550 47.453 1.00 0.00 H ATOM 513 HB2 GLU A 37 -17.804 61.543 47.289 1.00 0.00 H ATOM 514 HB3 GLU A 37 -19.238 62.341 47.976 1.00 0.00 H ATOM 515 HG2 GLU A 37 -18.217 62.738 45.116 1.00 0.00 H ATOM 516 HG3 GLU A 37 -19.565 61.674 45.580 1.00 0.00 H ATOM 517 H GLU A 37 -15.989 62.697 46.517 1.00 0.00 H ATOM 518 N PRO A 38 -18.019 64.204 50.084 1.00 41.89 N ATOM 519 CA PRO A 38 -17.786 64.113 51.527 1.00 41.58 C ATOM 520 C PRO A 38 -17.793 62.639 51.926 1.00 42.78 C ATOM 521 O PRO A 38 -18.749 61.918 51.611 1.00 42.19 O ATOM 522 CB PRO A 38 -18.982 64.853 52.107 1.00 42.08 C ATOM 523 CG PRO A 38 -19.144 66.006 51.095 1.00 41.40 C ATOM 524 CD PRO A 38 -19.066 65.213 49.776 1.00 41.54 C ATOM 525 HA PRO A 38 -16.838 64.529 51.869 1.00 0.00 H ATOM 526 HD3 PRO A 38 -20.019 64.737 49.542 1.00 0.00 H ATOM 527 HD2 PRO A 38 -18.768 65.853 48.946 1.00 0.00 H ATOM 528 HG3 PRO A 38 -18.338 66.735 51.178 1.00 0.00 H ATOM 529 HG2 PRO A 38 -20.103 66.512 51.207 1.00 0.00 H ATOM 530 HB2 PRO A 38 -19.868 64.219 52.136 1.00 0.00 H ATOM 531 HB3 PRO A 38 -18.772 65.228 53.109 1.00 0.00 H ATOM 532 N PRO A 39 -16.748 62.162 52.648 1.00 42.16 N ATOM 533 CA PRO A 39 -16.773 60.736 53.001 1.00 41.38 C ATOM 534 C PRO A 39 -17.455 60.522 54.347 1.00 43.52 C ATOM 535 O PRO A 39 -16.827 60.175 55.364 1.00 42.86 O ATOM 536 CB PRO A 39 -15.297 60.367 52.988 1.00 41.70 C ATOM 537 CG PRO A 39 -14.661 61.567 53.571 1.00 41.92 C ATOM 538 CD PRO A 39 -15.438 62.756 52.950 1.00 41.18 C ATOM 539 HA PRO A 39 -17.350 60.108 52.323 1.00 0.00 H ATOM 540 HD3 PRO A 39 -15.533 63.578 53.660 1.00 0.00 H ATOM 541 HD2 PRO A 39 -14.950 63.115 52.044 1.00 0.00 H ATOM 542 HG3 PRO A 39 -13.606 61.613 53.303 1.00 0.00 H ATOM 543 HG2 PRO A 39 -14.759 61.567 54.657 1.00 0.00 H ATOM 544 HB2 PRO A 39 -15.106 59.484 53.598 1.00 0.00 H ATOM 545 HB3 PRO A 39 -14.944 60.188 51.972 1.00 0.00 H ATOM 546 N VAL A 40 -18.769 60.717 54.325 1.00 43.27 N ATOM 547 CA VAL A 40 -19.573 60.624 55.521 1.00 43.45 C ATOM 548 C VAL A 40 -20.569 59.486 55.435 1.00 44.16 C ATOM 549 O VAL A 40 -20.827 58.957 54.341 1.00 44.52 O ATOM 550 CB VAL A 40 -20.296 61.950 55.729 1.00 43.32 C ATOM 551 CG1 VAL A 40 -19.237 63.095 55.713 1.00 43.73 C ATOM 552 CG2 VAL A 40 -21.300 62.179 54.565 1.00 41.31 C ATOM 553 HA VAL A 40 -18.921 60.417 56.370 1.00 0.00 H ATOM 554 HB VAL A 40 -20.833 61.938 56.677 1.00 0.00 H ATOM 555 HG11 VAL A 40 -18.516 62.933 56.514 1.00 0.00 H ATOM 556 HG12 VAL A 40 -18.721 63.097 54.753 1.00 0.00 H ATOM 557 HG13 VAL A 40 -19.737 64.052 55.861 1.00 0.00 H ATOM 558 HG21 VAL A 40 -20.758 62.203 53.619 1.00 0.00 H ATOM 559 HG22 VAL A 40 -22.026 61.366 54.548 1.00 0.00 H ATOM 560 HG23 VAL A 40 -21.817 63.127 54.714 1.00 0.00 H ATOM 561 H VAL A 40 -19.231 60.943 53.421 1.00 0.00 H ATOM 562 N GLY A 41 -21.098 59.111 56.601 1.00 43.60 N ATOM 563 CA GLY A 41 -22.080 58.043 56.689 1.00 43.77 C ATOM 564 C GLY A 41 -21.502 56.706 56.282 1.00 44.89 C ATOM 565 O GLY A 41 -20.442 56.274 56.785 1.00 44.90 O ATOM 566 HA3 GLY A 41 -22.917 58.279 56.032 1.00 0.00 H ATOM 567 HA2 GLY A 41 -22.435 57.975 57.717 1.00 0.00 H ATOM 568 H GLY A 41 -20.799 59.596 57.471 1.00 0.00 H ATOM 569 N ASN A 42 -22.206 56.023 55.387 1.00 44.20 N ATOM 570 CA ASN A 42 -21.738 54.730 54.907 1.00 43.25 C ATOM 571 C ASN A 42 -20.449 54.902 54.066 1.00 43.03 C ATOM 572 O ASN A 42 -19.816 53.937 53.686 1.00 41.78 O ATOM 573 CB ASN A 42 -22.856 54.028 54.114 1.00 44.24 C ATOM 574 HA ASN A 42 -21.487 54.096 55.757 1.00 0.00 H ATOM 575 HB2 ASN A 42 -23.721 53.880 54.761 1.00 0.00 H ATOM 576 HB3 ASN A 42 -23.139 54.647 53.263 1.00 0.00 H ATOM 577 H ASN A 42 -23.099 56.415 55.026 1.00 0.00 H ATOM 578 N MET A 43 -20.048 56.127 53.779 1.00 43.54 N ATOM 579 CA MET A 43 -18.795 56.290 53.050 1.00 44.81 C ATOM 580 C MET A 43 -17.564 56.387 53.996 1.00 43.60 C ATOM 581 O MET A 43 -16.421 56.410 53.510 1.00 43.20 O ATOM 582 CB MET A 43 -18.852 57.513 52.129 1.00 48.40 C ATOM 583 CG MET A 43 -19.622 57.295 50.790 1.00 55.64 C ATOM 584 SD MET A 43 -19.257 58.741 49.700 1.00 65.52 S ATOM 585 CE MET A 43 -20.968 59.288 49.295 1.00 65.14 C ATOM 586 HA MET A 43 -18.670 55.393 52.443 1.00 0.00 H ATOM 587 HB2 MET A 43 -19.340 58.323 52.672 1.00 0.00 H ATOM 588 HB3 MET A 43 -17.829 57.803 51.888 1.00 0.00 H ATOM 589 HG2 MET A 43 -20.693 57.234 50.982 1.00 0.00 H ATOM 590 HG3 MET A 43 -19.286 56.374 50.313 1.00 0.00 H ATOM 591 HE1 MET A 43 -21.497 58.479 48.792 1.00 0.00 H ATOM 592 HE2 MET A 43 -21.492 59.550 50.214 1.00 0.00 H ATOM 593 HE3 MET A 43 -20.924 60.158 48.640 1.00 0.00 H ATOM 594 H MET A 43 -20.611 56.954 54.065 1.00 0.00 H ATOM 595 N ARG A 44 -17.783 56.446 55.319 1.00 41.18 N ATOM 596 CA ARG A 44 -16.652 56.512 56.288 1.00 40.19 C ATOM 597 C ARG A 44 -15.810 55.223 56.129 1.00 40.03 C ATOM 598 O ARG A 44 -16.360 54.126 56.060 1.00 40.54 O ATOM 599 CB ARG A 44 -17.144 56.662 57.757 1.00 38.17 C ATOM 600 CG ARG A 44 -16.015 56.501 58.797 1.00 39.72 C ATOM 601 CD ARG A 44 -16.506 56.501 60.263 1.00 38.18 C ATOM 602 NE ARG A 44 -17.169 57.736 60.656 1.00 36.52 N ATOM 603 CZ ARG A 44 -17.801 57.867 61.818 1.00 40.00 C ATOM 604 NH1 ARG A 44 -17.830 56.818 62.640 1.00 41.12 N ATOM 605 NH2 ARG A 44 -18.346 59.043 62.189 1.00 37.19 N ATOM 606 HA ARG A 44 -16.051 57.395 56.072 1.00 0.00 H ATOM 607 HB2 ARG A 44 -17.586 57.652 57.875 1.00 0.00 H ATOM 608 HB3 ARG A 44 -17.902 55.902 57.948 1.00 0.00 H ATOM 609 HG2 ARG A 44 -15.505 55.557 58.606 1.00 0.00 H ATOM 610 HG3 ARG A 44 -15.312 57.324 58.671 1.00 0.00 H ATOM 611 HD2 ARG A 44 -15.646 56.349 60.915 1.00 0.00 H ATOM 612 HD3 ARG A 44 -17.208 55.677 60.392 1.00 0.00 H ATOM 613 HE ARG A 44 -17.147 58.546 60.004 1.00 0.00 H ATOM 614 HH12 ARG A 44 -18.317 56.889 63.556 1.00 0.00 H ATOM 615 HH11 ARG A 44 -17.366 55.929 62.365 1.00 0.00 H ATOM 616 HH22 ARG A 44 -18.836 59.124 63.103 1.00 0.00 H ATOM 617 HH21 ARG A 44 -18.276 59.869 61.562 1.00 0.00 H ATOM 618 H ARG A 44 -18.760 56.446 55.675 1.00 0.00 H ATOM 619 N PHE A 45 -14.491 55.381 56.039 1.00 38.26 N ATOM 620 CA PHE A 45 -13.515 54.286 55.843 1.00 38.20 C ATOM 621 C PHE A 45 -13.396 53.824 54.383 1.00 38.36 C ATOM 622 O PHE A 45 -12.446 53.103 54.047 1.00 37.25 O ATOM 623 CB PHE A 45 -13.776 53.040 56.712 1.00 38.47 C ATOM 624 CG PHE A 45 -13.976 53.323 58.197 1.00 40.84 C ATOM 625 CD1 PHE A 45 -13.059 54.074 58.920 1.00 38.45 C ATOM 626 CD2 PHE A 45 -15.105 52.811 58.869 1.00 39.80 C ATOM 627 CE1 PHE A 45 -13.262 54.321 60.305 1.00 40.92 C ATOM 628 CE2 PHE A 45 -15.316 53.052 60.251 1.00 41.24 C ATOM 629 CZ PHE A 45 -14.400 53.807 60.972 1.00 40.29 C ATOM 630 HA PHE A 45 -12.579 54.746 56.160 1.00 0.00 H ATOM 631 HB2 PHE A 45 -14.673 52.547 56.337 1.00 0.00 H ATOM 632 HB3 PHE A 45 -12.924 52.369 56.607 1.00 0.00 H ATOM 633 HD2 PHE A 45 -15.832 52.217 58.314 1.00 0.00 H ATOM 634 HE2 PHE A 45 -16.197 52.645 60.747 1.00 0.00 H ATOM 635 HZ PHE A 45 -14.555 54.001 62.033 1.00 0.00 H ATOM 636 HE1 PHE A 45 -12.534 54.913 60.860 1.00 0.00 H ATOM 637 HD1 PHE A 45 -12.177 54.477 58.422 1.00 0.00 H ATOM 638 H PHE A 45 -14.118 56.349 56.112 1.00 0.00 H ATOM 639 N ARG A 46 -14.336 54.239 53.521 1.00 38.08 N ATOM 640 CA ARG A 46 -14.288 53.869 52.110 1.00 39.85 C ATOM 641 C ARG A 46 -13.308 54.663 51.251 1.00 38.88 C ATOM 642 O ARG A 46 -12.917 55.777 51.577 1.00 36.33 O ATOM 643 CB ARG A 46 -15.667 54.042 51.436 1.00 44.27 C ATOM 644 CG ARG A 46 -16.734 53.027 51.848 1.00 46.52 C ATOM 645 CD ARG A 46 -17.704 52.845 50.680 1.00 49.78 C ATOM 646 NE ARG A 46 -18.852 52.009 51.041 1.00 54.20 N ATOM 647 HA ARG A 46 -13.956 52.831 52.148 1.00 0.00 H ATOM 648 HB2 ARG A 46 -16.038 55.037 51.681 1.00 0.00 H ATOM 649 HB3 ARG A 46 -15.526 53.963 50.358 1.00 0.00 H ATOM 650 HG2 ARG A 46 -16.263 52.074 52.087 1.00 0.00 H ATOM 651 HG3 ARG A 46 -17.274 53.394 52.721 1.00 0.00 H ATOM 652 HD2 ARG A 46 -17.173 52.375 49.852 1.00 0.00 H ATOM 653 HD3 ARG A 46 -18.067 53.824 50.368 1.00 0.00 H ATOM 654 HE ARG A 46 -18.930 51.619 52.002 1.00 0.00 H ATOM 655 H ARG A 46 -15.115 54.836 53.865 1.00 0.00 H ATOM 656 N ARG A 47 -12.925 54.082 50.130 1.00 39.16 N ATOM 657 CA ARG A 47 -12.091 54.815 49.177 1.00 40.22 C ATOM 658 C ARG A 47 -12.893 56.097 48.814 1.00 38.98 C ATOM 659 O ARG A 47 -14.137 56.108 48.855 1.00 36.51 O ATOM 660 CB ARG A 47 -11.858 53.959 47.925 1.00 42.15 C ATOM 661 CG ARG A 47 -11.140 52.643 48.283 1.00 46.36 C ATOM 662 CD ARG A 47 -10.710 51.900 47.036 1.00 50.86 C ATOM 663 NE ARG A 47 -10.723 50.455 47.249 1.00 57.11 N ATOM 664 CZ ARG A 47 -9.635 49.736 47.496 1.00 59.74 C ATOM 665 NH1 ARG A 47 -8.455 50.339 47.558 1.00 62.61 N ATOM 666 NH2 ARG A 47 -9.716 48.420 47.675 1.00 61.07 N ATOM 667 HA ARG A 47 -11.114 55.060 49.593 1.00 0.00 H ATOM 668 HB2 ARG A 47 -12.820 53.728 47.467 1.00 0.00 H ATOM 669 HB3 ARG A 47 -11.245 54.519 47.219 1.00 0.00 H ATOM 670 HG2 ARG A 47 -10.259 52.870 48.884 1.00 0.00 H ATOM 671 HG3 ARG A 47 -11.818 52.012 48.858 1.00 0.00 H ATOM 672 HD2 ARG A 47 -9.700 52.211 46.767 1.00 0.00 H ATOM 673 HD3 ARG A 47 -11.393 52.146 46.223 1.00 0.00 H ATOM 674 HE ARG A 47 -11.637 49.961 47.205 1.00 0.00 H ATOM 675 HH12 ARG A 47 -7.597 49.784 47.751 1.00 0.00 H ATOM 676 HH11 ARG A 47 -8.388 51.367 47.414 1.00 0.00 H ATOM 677 HH22 ARG A 47 -8.856 47.868 47.868 1.00 0.00 H ATOM 678 HH21 ARG A 47 -10.639 47.944 47.622 1.00 0.00 H ATOM 679 H ARG A 47 -13.215 53.105 49.924 1.00 0.00 H ATOM 680 N PRO A 48 -12.194 57.195 48.491 1.00 37.32 N ATOM 681 CA PRO A 48 -12.930 58.406 48.155 1.00 37.21 C ATOM 682 C PRO A 48 -13.589 58.320 46.776 1.00 39.04 C ATOM 683 O PRO A 48 -13.102 57.601 45.898 1.00 38.08 O ATOM 684 CB PRO A 48 -11.841 59.473 48.156 1.00 35.27 C ATOM 685 CG PRO A 48 -10.666 58.716 47.592 1.00 32.92 C ATOM 686 CD PRO A 48 -10.739 57.405 48.364 1.00 36.68 C ATOM 687 HA PRO A 48 -13.748 58.601 48.849 1.00 0.00 H ATOM 688 HD3 PRO A 48 -10.270 56.593 47.809 1.00 0.00 H ATOM 689 HD2 PRO A 48 -10.266 57.496 49.342 1.00 0.00 H ATOM 690 HG3 PRO A 48 -9.728 59.238 47.784 1.00 0.00 H ATOM 691 HG2 PRO A 48 -10.777 58.552 46.520 1.00 0.00 H ATOM 692 HB2 PRO A 48 -12.111 60.317 47.521 1.00 0.00 H ATOM 693 HB3 PRO A 48 -11.636 59.830 49.165 1.00 0.00 H ATOM 694 N GLU A 49 -14.671 59.077 46.604 1.00 40.83 N ATOM 695 CA GLU A 49 -15.376 59.195 45.321 1.00 42.83 C ATOM 696 C GLU A 49 -15.096 60.615 44.795 1.00 40.90 C ATOM 697 O GLU A 49 -15.082 61.579 45.567 1.00 40.14 O ATOM 698 CB GLU A 49 -16.894 59.048 45.511 1.00 46.76 C ATOM 699 CG GLU A 49 -17.314 57.651 45.983 1.00 55.21 C ATOM 700 CD GLU A 49 -16.847 56.564 45.010 1.00 59.44 C ATOM 701 OE1 GLU A 49 -16.790 55.357 45.379 1.00 62.42 O ATOM 702 OE2 GLU A 49 -16.533 56.933 43.848 1.00 62.88 O ATOM 703 HA GLU A 49 -15.036 58.417 44.637 1.00 0.00 H ATOM 704 HB2 GLU A 49 -17.222 59.777 46.252 1.00 0.00 H ATOM 705 HB3 GLU A 49 -17.384 59.254 44.559 1.00 0.00 H ATOM 706 HG2 GLU A 49 -16.876 57.461 46.963 1.00 0.00 H ATOM 707 HG3 GLU A 49 -18.401 57.615 46.059 1.00 0.00 H ATOM 708 H GLU A 49 -15.035 59.611 47.419 1.00 0.00 H ATOM 709 N PRO A 50 -14.901 60.765 43.483 1.00 40.09 N ATOM 710 CA PRO A 50 -14.640 62.091 42.895 1.00 41.31 C ATOM 711 C PRO A 50 -15.835 63.036 43.106 1.00 41.91 C ATOM 712 O PRO A 50 -16.973 62.592 43.122 1.00 41.61 O ATOM 713 CB PRO A 50 -14.394 61.775 41.421 1.00 42.25 C ATOM 714 CG PRO A 50 -15.192 60.510 41.209 1.00 43.01 C ATOM 715 CD PRO A 50 -15.005 59.718 42.459 1.00 39.74 C ATOM 716 HA PRO A 50 -13.798 62.613 43.350 1.00 0.00 H ATOM 717 HD3 PRO A 50 -15.859 59.067 42.645 1.00 0.00 H ATOM 718 HD2 PRO A 50 -14.096 59.118 42.414 1.00 0.00 H ATOM 719 HG3 PRO A 50 -14.815 59.960 40.347 1.00 0.00 H ATOM 720 HG2 PRO A 50 -16.246 60.743 41.057 1.00 0.00 H ATOM 721 HB2 PRO A 50 -14.757 62.580 40.781 1.00 0.00 H ATOM 722 HB3 PRO A 50 -13.335 61.608 41.227 1.00 0.00 H ATOM 723 N LYS A 51 -15.583 64.327 43.280 1.00 42.15 N ATOM 724 CA LYS A 51 -16.667 65.292 43.530 1.00 44.54 C ATOM 725 C LYS A 51 -17.532 65.440 42.281 1.00 45.32 C ATOM 726 O LYS A 51 -17.011 65.721 41.212 1.00 45.14 O ATOM 727 CB LYS A 51 -16.079 66.658 43.906 1.00 44.73 C ATOM 728 CG LYS A 51 -17.103 67.772 44.067 1.00 46.06 C ATOM 729 CD LYS A 51 -18.079 67.536 45.226 1.00 46.10 C ATOM 730 CE LYS A 51 -18.916 68.798 45.515 1.00 46.69 C ATOM 731 NZ LYS A 51 -19.730 68.678 46.782 1.00 49.73 N ATOM 732 HA LYS A 51 -17.279 64.924 44.353 1.00 0.00 H ATOM 733 HB2 LYS A 51 -15.545 66.549 44.850 1.00 0.00 H ATOM 734 HB3 LYS A 51 -15.378 66.952 43.125 1.00 0.00 H ATOM 735 HG2 LYS A 51 -16.572 68.707 44.246 1.00 0.00 H ATOM 736 HG3 LYS A 51 -17.676 67.852 43.143 1.00 0.00 H ATOM 737 HD2 LYS A 51 -18.749 66.716 44.966 1.00 0.00 H ATOM 738 HD3 LYS A 51 -17.513 67.272 46.119 1.00 0.00 H ATOM 739 HE2 LYS A 51 -19.594 68.966 44.679 1.00 0.00 H ATOM 740 HE3 LYS A 51 -18.242 69.649 45.612 1.00 0.00 H ATOM 741 HZ1 LYS A 51 -20.383 67.873 46.698 1.00 0.00 H ATOM 742 HZ2 LYS A 51 -19.092 68.525 47.589 1.00 0.00 H ATOM 743 HZ3 LYS A 51 -20.273 69.553 46.928 1.00 0.00 H ATOM 744 H LYS A 51 -14.600 64.664 43.239 1.00 0.00 H ATOM 745 N LYS A 52 -18.844 65.246 42.406 1.00 46.06 N ATOM 746 CA LYS A 52 -19.724 65.383 41.237 1.00 46.20 C ATOM 747 C LYS A 52 -19.682 66.826 40.760 1.00 45.05 C ATOM 748 O LYS A 52 -19.756 67.750 41.573 1.00 45.01 O ATOM 749 CB LYS A 52 -21.158 64.988 41.597 1.00 48.83 C ATOM 750 CG LYS A 52 -21.317 63.526 42.117 1.00 53.80 C ATOM 751 CD LYS A 52 -20.917 62.422 41.036 1.00 57.73 C ATOM 752 CE LYS A 52 -19.400 61.920 41.050 1.00 59.30 C ATOM 753 NZ LYS A 52 -19.015 60.741 41.985 1.00 57.59 N ATOM 754 HA LYS A 52 -19.380 64.721 40.443 1.00 0.00 H ATOM 755 HB2 LYS A 52 -21.513 65.666 42.373 1.00 0.00 H ATOM 756 HB3 LYS A 52 -21.776 65.102 40.706 1.00 0.00 H ATOM 757 HG2 LYS A 52 -20.680 63.399 42.993 1.00 0.00 H ATOM 758 HG3 LYS A 52 -22.358 63.371 42.401 1.00 0.00 H ATOM 759 HD2 LYS A 52 -21.554 61.553 41.200 1.00 0.00 H ATOM 760 HD3 LYS A 52 -21.118 62.838 40.049 1.00 0.00 H ATOM 761 HE2 LYS A 52 -18.782 62.771 41.335 1.00 0.00 H ATOM 762 HE3 LYS A 52 -19.152 61.618 40.033 1.00 0.00 H ATOM 763 HZ1 LYS A 52 -19.217 61.002 42.971 1.00 0.00 H ATOM 764 HZ2 LYS A 52 -19.570 59.900 41.727 1.00 0.00 H ATOM 765 HZ3 LYS A 52 -18.001 60.534 41.880 1.00 0.00 H ATOM 766 H LYS A 52 -19.246 64.997 43.332 1.00 0.00 H ATOM 767 N PRO A 53 -19.528 67.047 39.443 1.00 44.89 N ATOM 768 CA PRO A 53 -19.490 68.440 38.956 1.00 45.02 C ATOM 769 C PRO A 53 -20.744 69.250 39.405 1.00 45.62 C ATOM 770 O PRO A 53 -21.838 68.687 39.640 1.00 43.75 O ATOM 771 CB PRO A 53 -19.372 68.281 37.433 1.00 44.95 C ATOM 772 CG PRO A 53 -18.651 66.962 37.288 1.00 45.85 C ATOM 773 CD PRO A 53 -19.331 66.090 38.337 1.00 43.61 C ATOM 774 HA PRO A 53 -18.663 69.019 39.366 1.00 0.00 H ATOM 775 HD3 PRO A 53 -20.282 65.701 37.974 1.00 0.00 H ATOM 776 HD2 PRO A 53 -18.692 65.260 38.639 1.00 0.00 H ATOM 777 HG3 PRO A 53 -17.587 67.071 37.497 1.00 0.00 H ATOM 778 HG2 PRO A 53 -18.783 66.549 36.288 1.00 0.00 H ATOM 779 HB2 PRO A 53 -20.356 68.245 36.965 1.00 0.00 H ATOM 780 HB3 PRO A 53 -18.793 69.095 36.997 1.00 0.00 H ATOM 781 N TRP A 54 -20.559 70.553 39.567 1.00 44.72 N ATOM 782 CA TRP A 54 -21.634 71.418 40.025 1.00 46.21 C ATOM 783 C TRP A 54 -21.900 72.529 39.016 1.00 47.53 C ATOM 784 O TRP A 54 -21.004 72.946 38.259 1.00 47.46 O ATOM 785 CB TRP A 54 -21.262 72.045 41.388 1.00 44.42 C ATOM 786 CG TRP A 54 -20.001 72.861 41.333 1.00 42.58 C ATOM 787 CD1 TRP A 54 -19.884 74.144 40.900 1.00 43.07 C ATOM 788 CD2 TRP A 54 -18.662 72.407 41.592 1.00 41.62 C ATOM 789 NE1 TRP A 54 -18.554 74.526 40.856 1.00 42.32 N ATOM 790 CE2 TRP A 54 -17.785 73.474 41.277 1.00 41.07 C ATOM 791 CE3 TRP A 54 -18.114 71.197 42.050 1.00 39.87 C ATOM 792 CZ2 TRP A 54 -16.385 73.367 41.405 1.00 40.19 C ATOM 793 CZ3 TRP A 54 -16.725 71.093 42.170 1.00 37.75 C ATOM 794 CH2 TRP A 54 -15.878 72.172 41.849 1.00 37.23 C ATOM 795 HA TRP A 54 -22.535 70.814 40.132 1.00 0.00 H ATOM 796 HB2 TRP A 54 -22.080 72.690 41.709 1.00 0.00 H ATOM 797 HB3 TRP A 54 -21.126 71.244 42.114 1.00 0.00 H ATOM 798 HE1 TRP A 54 -18.199 75.456 40.554 1.00 0.00 H ATOM 799 HD1 TRP A 54 -20.722 74.784 40.625 1.00 0.00 H ATOM 800 HZ2 TRP A 54 -15.730 74.203 41.160 1.00 0.00 H ATOM 801 HH2 TRP A 54 -14.800 72.055 41.955 1.00 0.00 H ATOM 802 HZ3 TRP A 54 -16.288 70.157 42.519 1.00 0.00 H ATOM 803 HE3 TRP A 54 -18.759 70.356 42.307 1.00 0.00 H ATOM 804 H TRP A 54 -19.626 70.964 39.362 1.00 0.00 H ATOM 805 N SER A 55 -23.137 73.001 38.983 1.00 48.68 N ATOM 806 CA SER A 55 -23.441 74.101 38.087 1.00 51.16 C ATOM 807 C SER A 55 -23.319 75.323 38.992 1.00 51.71 C ATOM 808 O SER A 55 -23.169 75.176 40.223 1.00 52.37 O ATOM 809 CB SER A 55 -24.844 73.961 37.495 1.00 51.81 C ATOM 810 OG SER A 55 -25.815 73.998 38.526 1.00 56.11 O ATOM 811 HA SER A 55 -22.781 74.152 37.221 1.00 0.00 H ATOM 812 HB2 SER A 55 -24.918 73.012 36.964 1.00 0.00 H ATOM 813 HB3 SER A 55 -25.025 74.780 36.799 1.00 0.00 H ATOM 814 HG SER A 55 -26.718 73.907 38.131 1.00 0.00 H ATOM 815 H SER A 55 -23.877 72.591 39.588 1.00 0.00 H ATOM 816 N GLY A 56 -23.353 76.527 38.425 1.00 52.20 N ATOM 817 CA GLY A 56 -23.206 77.691 39.287 1.00 51.61 C ATOM 818 C GLY A 56 -21.736 77.876 39.651 1.00 52.22 C ATOM 819 O GLY A 56 -20.870 77.156 39.120 1.00 52.56 O ATOM 820 HA3 GLY A 56 -23.790 77.546 40.196 1.00 0.00 H ATOM 821 HA2 GLY A 56 -23.565 78.578 38.764 1.00 0.00 H ATOM 822 H GLY A 56 -23.481 76.633 37.398 1.00 0.00 H ATOM 823 N VAL A 57 -21.460 78.817 40.556 1.00 50.68 N ATOM 824 CA VAL A 57 -20.110 79.158 40.983 1.00 48.68 C ATOM 825 C VAL A 57 -19.823 78.732 42.420 1.00 48.21 C ATOM 826 O VAL A 57 -20.563 79.087 43.336 1.00 46.27 O ATOM 827 CB VAL A 57 -19.892 80.663 40.894 1.00 48.55 C ATOM 828 CG1 VAL A 57 -18.461 81.002 41.234 1.00 48.79 C ATOM 829 CG2 VAL A 57 -20.204 81.128 39.488 1.00 49.27 C ATOM 830 HA VAL A 57 -19.436 78.621 40.316 1.00 0.00 H ATOM 831 HB VAL A 57 -20.550 81.164 41.603 1.00 0.00 H ATOM 832 HG11 VAL A 57 -18.241 80.668 42.248 1.00 0.00 H ATOM 833 HG12 VAL A 57 -17.794 80.502 40.532 1.00 0.00 H ATOM 834 HG13 VAL A 57 -18.319 82.081 41.167 1.00 0.00 H ATOM 835 HG21 VAL A 57 -19.545 80.620 38.784 1.00 0.00 H ATOM 836 HG22 VAL A 57 -21.242 80.893 39.251 1.00 0.00 H ATOM 837 HG23 VAL A 57 -20.049 82.205 39.420 1.00 0.00 H ATOM 838 H VAL A 57 -22.254 79.337 40.981 1.00 0.00 H ATOM 839 N TRP A 58 -18.747 77.962 42.607 1.00 47.12 N ATOM 840 CA TRP A 58 -18.362 77.506 43.945 1.00 45.20 C ATOM 841 C TRP A 58 -17.642 78.670 44.607 1.00 44.30 C ATOM 842 O TRP A 58 -16.698 79.253 44.021 1.00 44.04 O ATOM 843 CB TRP A 58 -17.426 76.279 43.864 1.00 44.78 C ATOM 844 CG TRP A 58 -17.149 75.694 45.212 1.00 43.51 C ATOM 845 CD1 TRP A 58 -16.273 76.171 46.161 1.00 42.16 C ATOM 846 CD2 TRP A 58 -17.868 74.625 45.827 1.00 43.14 C ATOM 847 NE1 TRP A 58 -16.422 75.472 47.338 1.00 42.70 N ATOM 848 CE2 TRP A 58 -17.392 74.513 47.162 1.00 43.92 C ATOM 849 CE3 TRP A 58 -18.869 73.747 45.378 1.00 44.96 C ATOM 850 CZ2 TRP A 58 -17.892 73.553 48.062 1.00 42.25 C ATOM 851 CZ3 TRP A 58 -19.370 72.787 46.270 1.00 45.11 C ATOM 852 CH2 TRP A 58 -18.874 72.707 47.601 1.00 43.59 C ATOM 853 HA TRP A 58 -19.240 77.202 44.515 1.00 0.00 H ATOM 854 HB2 TRP A 58 -17.896 75.519 43.240 1.00 0.00 H ATOM 855 HB3 TRP A 58 -16.482 76.585 43.413 1.00 0.00 H ATOM 856 HE1 TRP A 58 -15.889 75.641 48.215 1.00 0.00 H ATOM 857 HD1 TRP A 58 -15.564 76.984 46.003 1.00 0.00 H ATOM 858 HZ2 TRP A 58 -17.516 73.483 49.083 1.00 0.00 H ATOM 859 HH2 TRP A 58 -19.284 71.954 48.274 1.00 0.00 H ATOM 860 HZ3 TRP A 58 -20.146 72.096 45.940 1.00 0.00 H ATOM 861 HE3 TRP A 58 -19.248 73.810 44.358 1.00 0.00 H ATOM 862 H TRP A 58 -18.172 77.681 41.787 1.00 0.00 H ATOM 863 N ASN A 59 -18.082 79.009 45.813 1.00 44.19 N ATOM 864 CA ASN A 59 -17.491 80.118 46.552 1.00 45.69 C ATOM 865 C ASN A 59 -16.210 79.572 47.201 1.00 44.69 C ATOM 866 O ASN A 59 -16.303 78.819 48.156 1.00 44.98 O ATOM 867 CB ASN A 59 -18.471 80.602 47.637 1.00 49.24 C ATOM 868 CG ASN A 59 -17.946 81.792 48.424 1.00 55.52 C ATOM 869 OD1 ASN A 59 -16.748 82.084 48.384 1.00 55.29 O ATOM 870 ND2 ASN A 59 -18.837 82.461 49.164 1.00 62.37 N ATOM 871 HA ASN A 59 -17.272 80.963 45.899 1.00 0.00 H ATOM 872 HB2 ASN A 59 -19.407 80.888 47.157 1.00 0.00 H ATOM 873 HB3 ASN A 59 -18.655 79.781 48.330 1.00 0.00 H ATOM 874 HD22 ASN A 59 -19.836 82.173 49.161 1.00 0.00 H ATOM 875 HD21 ASN A 59 -18.531 83.270 49.742 1.00 0.00 H ATOM 876 H ASN A 59 -18.864 78.472 46.239 1.00 0.00 H ATOM 877 N ALA A 60 -15.042 79.956 46.687 1.00 42.86 N ATOM 878 CA ALA A 60 -13.755 79.480 47.200 1.00 42.58 C ATOM 879 C ALA A 60 -13.008 80.645 47.813 1.00 42.87 C ATOM 880 O ALA A 60 -11.817 80.828 47.543 1.00 41.25 O ATOM 881 CB ALA A 60 -12.896 78.895 46.053 1.00 41.40 C ATOM 882 HA ALA A 60 -13.939 78.704 47.943 1.00 0.00 H ATOM 883 HB1 ALA A 60 -13.425 78.060 45.594 1.00 0.00 H ATOM 884 HB2 ALA A 60 -12.716 79.668 45.305 1.00 0.00 H ATOM 885 HB3 ALA A 60 -11.944 78.547 46.455 1.00 0.00 H ATOM 886 H ALA A 60 -15.044 80.622 45.888 1.00 0.00 H ATOM 887 N SER A 61 -13.692 81.431 48.638 1.00 42.00 N ATOM 888 CA SER A 61 -13.046 82.580 49.239 1.00 43.68 C ATOM 889 C SER A 61 -12.592 82.256 50.659 1.00 42.91 C ATOM 890 O SER A 61 -11.860 83.026 51.265 1.00 43.50 O ATOM 891 CB SER A 61 -14.032 83.756 49.254 1.00 41.95 C ATOM 892 OG SER A 61 -15.137 83.362 50.072 1.00 42.69 O ATOM 893 HA SER A 61 -12.166 82.846 48.654 1.00 0.00 H ATOM 894 HB2 SER A 61 -14.373 83.972 48.242 1.00 0.00 H ATOM 895 HB3 SER A 61 -13.553 84.642 49.672 1.00 0.00 H ATOM 896 HG SER A 61 -15.560 82.554 49.686 1.00 0.00 H ATOM 897 H SER A 61 -14.688 81.222 48.852 1.00 0.00 H ATOM 898 N THR A 62 -13.029 81.129 51.216 1.00 44.01 N ATOM 899 CA THR A 62 -12.612 80.833 52.592 1.00 43.82 C ATOM 900 C THR A 62 -12.062 79.430 52.843 1.00 42.82 C ATOM 901 O THR A 62 -12.395 78.490 52.131 1.00 41.09 O ATOM 902 CB THR A 62 -13.773 81.057 53.541 1.00 45.68 C ATOM 903 OG1 THR A 62 -14.788 80.091 53.258 1.00 46.64 O ATOM 904 CG2 THR A 62 -14.373 82.466 53.330 1.00 47.57 C ATOM 905 HA THR A 62 -11.782 81.517 52.769 1.00 0.00 H ATOM 906 HB THR A 62 -13.418 80.963 54.567 1.00 0.00 H ATOM 907 HG1 THR A 62 -14.420 79.181 53.384 1.00 0.00 H ATOM 908 HG23 THR A 62 -13.613 83.218 53.541 1.00 0.00 H ATOM 909 HG21 THR A 62 -14.708 82.566 52.298 1.00 0.00 H ATOM 910 HG22 THR A 62 -15.219 82.604 54.003 1.00 0.00 H ATOM 911 H THR A 62 -13.647 80.477 50.692 1.00 0.00 H ATOM 912 N TYR A 63 -11.218 79.291 53.866 1.00 41.42 N ATOM 913 CA TYR A 63 -10.668 77.976 54.190 1.00 40.02 C ATOM 914 C TYR A 63 -11.752 76.967 54.514 1.00 39.97 C ATOM 915 O TYR A 63 -12.796 77.309 55.059 1.00 38.63 O ATOM 916 CB TYR A 63 -9.707 78.017 55.382 1.00 36.98 C ATOM 917 CG TYR A 63 -8.303 78.409 54.998 1.00 39.69 C ATOM 918 CD1 TYR A 63 -7.701 77.886 53.832 1.00 40.01 C ATOM 919 CD2 TYR A 63 -7.515 79.204 55.859 1.00 39.97 C ATOM 920 CE1 TYR A 63 -6.354 78.125 53.545 1.00 38.96 C ATOM 921 CE2 TYR A 63 -6.153 79.446 55.581 1.00 39.09 C ATOM 922 CZ TYR A 63 -5.595 78.896 54.432 1.00 39.55 C ATOM 923 OH TYR A 63 -4.262 79.058 54.195 1.00 40.94 O ATOM 924 HA TYR A 63 -10.128 77.672 53.293 1.00 0.00 H ATOM 925 HB3 TYR A 63 -9.678 77.028 55.839 1.00 0.00 H ATOM 926 HB2 TYR A 63 -10.083 78.740 56.106 1.00 0.00 H ATOM 927 HD2 TYR A 63 -7.966 79.637 56.752 1.00 0.00 H ATOM 928 HE2 TYR A 63 -5.549 80.053 56.255 1.00 0.00 H ATOM 929 HE1 TYR A 63 -5.901 77.716 52.642 1.00 0.00 H ATOM 930 HD1 TYR A 63 -8.297 77.286 53.144 1.00 0.00 H ATOM 931 HH TYR A 63 -4.023 78.612 53.344 1.00 0.00 H ATOM 932 H TYR A 63 -10.951 80.120 54.434 1.00 0.00 H ATOM 933 N PRO A 64 -11.509 75.689 54.159 1.00 38.52 N ATOM 934 CA PRO A 64 -12.443 74.603 54.415 1.00 35.67 C ATOM 935 C PRO A 64 -12.321 74.097 55.877 1.00 35.17 C ATOM 936 O PRO A 64 -11.458 74.562 56.637 1.00 33.83 O ATOM 937 CB PRO A 64 -11.980 73.547 53.413 1.00 36.17 C ATOM 938 CG PRO A 64 -10.447 73.668 53.498 1.00 34.32 C ATOM 939 CD PRO A 64 -10.307 75.207 53.437 1.00 38.00 C ATOM 940 HA PRO A 64 -13.491 74.880 54.302 1.00 0.00 H ATOM 941 HD3 PRO A 64 -9.395 75.536 53.934 1.00 0.00 H ATOM 942 HD2 PRO A 64 -10.304 75.558 52.405 1.00 0.00 H ATOM 943 HG3 PRO A 64 -9.953 73.181 52.657 1.00 0.00 H ATOM 944 HG2 PRO A 64 -10.058 73.261 54.431 1.00 0.00 H ATOM 945 HB2 PRO A 64 -12.315 72.551 53.704 1.00 0.00 H ATOM 946 HB3 PRO A 64 -12.339 73.770 52.408 1.00 0.00 H ATOM 947 N ASN A 65 -13.204 73.177 56.271 1.00 33.73 N ATOM 948 CA ASN A 65 -13.114 72.554 57.573 1.00 35.90 C ATOM 949 C ASN A 65 -11.825 71.668 57.537 1.00 35.40 C ATOM 950 O ASN A 65 -11.311 71.341 56.459 1.00 36.77 O ATOM 951 CB ASN A 65 -14.308 71.604 57.821 1.00 38.69 C ATOM 952 CG ASN A 65 -15.673 72.319 57.755 1.00 43.07 C ATOM 953 OD1 ASN A 65 -15.844 73.383 58.336 1.00 43.82 O ATOM 954 ND2 ASN A 65 -16.638 71.723 57.042 1.00 44.33 N ATOM 955 HA ASN A 65 -13.103 73.318 58.350 1.00 0.00 H ATOM 956 HB2 ASN A 65 -14.290 70.819 57.065 1.00 0.00 H ATOM 957 HB3 ASN A 65 -14.197 71.158 58.809 1.00 0.00 H ATOM 958 HD22 ASN A 65 -16.449 70.819 56.564 1.00 0.00 H ATOM 959 HD21 ASN A 65 -17.577 72.165 56.966 1.00 0.00 H ATOM 960 H ASN A 65 -13.974 72.902 55.628 1.00 0.00 H ATOM 961 N ASN A 66 -11.346 71.276 58.708 1.00 34.66 N ATOM 962 CA ASN A 66 -10.170 70.402 58.854 1.00 36.99 C ATOM 963 C ASN A 66 -10.737 69.002 59.133 1.00 36.51 C ATOM 964 O ASN A 66 -11.834 68.907 59.682 1.00 35.92 O ATOM 965 CB ASN A 66 -9.331 70.840 60.066 1.00 34.29 C ATOM 966 CG ASN A 66 -8.775 72.257 59.909 1.00 37.29 C ATOM 967 OD1 ASN A 66 -8.701 73.008 60.882 1.00 37.66 O ATOM 968 ND2 ASN A 66 -8.371 72.622 58.680 1.00 37.26 N ATOM 969 HA ASN A 66 -9.537 70.436 57.968 1.00 0.00 H ATOM 970 HB2 ASN A 66 -9.958 70.806 60.957 1.00 0.00 H ATOM 971 HB3 ASN A 66 -8.497 70.148 60.184 1.00 0.00 H ATOM 972 HD22 ASN A 66 -8.452 71.955 57.886 1.00 0.00 H ATOM 973 HD21 ASN A 66 -7.977 73.572 58.523 1.00 0.00 H ATOM 974 H ASN A 66 -11.826 71.603 59.571 1.00 0.00 H ATOM 975 N CYS A 67 -10.020 67.931 58.780 1.00 34.96 N ATOM 976 CA CYS A 67 -10.544 66.591 59.089 1.00 36.15 C ATOM 977 C CYS A 67 -10.577 66.331 60.574 1.00 36.63 C ATOM 978 O CYS A 67 -9.849 66.956 61.339 1.00 35.70 O ATOM 979 CB CYS A 67 -9.716 65.500 58.388 1.00 35.69 C ATOM 980 SG CYS A 67 -9.750 65.685 56.578 1.00 37.21 S ATOM 981 HA CYS A 67 -11.567 66.557 58.715 1.00 0.00 H ATOM 982 HB2 CYS A 67 -10.123 64.524 58.651 1.00 0.00 H ATOM 983 HB3 CYS A 67 -8.683 65.566 58.730 1.00 0.00 H ATOM 984 H CYS A 67 -9.107 68.043 58.295 1.00 0.00 H ATOM 985 N GLN A 68 -11.441 65.399 60.982 1.00 37.43 N ATOM 986 CA GLN A 68 -11.599 65.043 62.375 1.00 36.35 C ATOM 987 C GLN A 68 -10.260 64.468 62.859 1.00 37.04 C ATOM 988 O GLN A 68 -9.667 63.644 62.166 1.00 36.61 O ATOM 989 CB GLN A 68 -12.726 64.001 62.516 1.00 36.24 C ATOM 990 CG GLN A 68 -14.119 64.587 62.358 1.00 37.53 C ATOM 991 CD GLN A 68 -14.586 65.417 63.592 1.00 41.14 C ATOM 992 OE1 GLN A 68 -15.689 65.981 63.592 1.00 43.55 O ATOM 993 NE2 GLN A 68 -13.752 65.488 64.627 1.00 39.33 N ATOM 994 HA GLN A 68 -11.869 65.911 62.976 1.00 0.00 H ATOM 995 HB2 GLN A 68 -12.585 63.235 61.753 1.00 0.00 H ATOM 996 HB3 GLN A 68 -12.653 63.546 63.504 1.00 0.00 H ATOM 997 HG2 GLN A 68 -14.123 65.237 61.483 1.00 0.00 H ATOM 998 HG3 GLN A 68 -14.823 63.769 62.205 1.00 0.00 H ATOM 999 HE22 GLN A 68 -12.834 65.001 64.590 1.00 0.00 H ATOM 1000 HE21 GLN A 68 -14.018 66.031 65.473 1.00 0.00 H ATOM 1001 H GLN A 68 -12.022 64.910 60.272 1.00 0.00 H ATOM 1002 N GLN A 69 -9.808 64.889 64.041 1.00 34.91 N ATOM 1003 CA GLN A 69 -8.514 64.427 64.555 1.00 34.91 C ATOM 1004 C GLN A 69 -8.341 64.685 66.048 1.00 34.76 C ATOM 1005 O GLN A 69 -9.029 65.545 66.650 1.00 33.14 O ATOM 1006 CB GLN A 69 -7.366 65.138 63.823 1.00 33.81 C ATOM 1007 CG GLN A 69 -7.478 66.691 63.855 1.00 31.53 C ATOM 1008 CD GLN A 69 -6.507 67.400 62.895 1.00 31.81 C ATOM 1009 OE1 GLN A 69 -5.339 67.697 63.260 1.00 33.33 O ATOM 1010 NE2 GLN A 69 -6.973 67.671 61.652 1.00 29.62 N ATOM 1011 HA GLN A 69 -8.490 63.351 64.382 1.00 0.00 H ATOM 1012 HB2 GLN A 69 -6.426 64.850 64.293 1.00 0.00 H ATOM 1013 HB3 GLN A 69 -7.366 64.813 62.783 1.00 0.00 H ATOM 1014 HG2 GLN A 69 -8.496 66.969 63.583 1.00 0.00 H ATOM 1015 HG3 GLN A 69 -7.269 67.031 64.869 1.00 0.00 H ATOM 1016 HE22 GLN A 69 -7.945 67.408 61.392 1.00 0.00 H ATOM 1017 HE21 GLN A 69 -6.359 68.142 60.958 1.00 0.00 H ATOM 1018 H GLN A 69 -10.379 65.552 64.604 1.00 0.00 H ATOM 1019 N TYR A 70 -7.387 63.955 66.620 1.00 34.17 N ATOM 1020 CA TYR A 70 -7.014 64.111 68.025 1.00 34.89 C ATOM 1021 C TYR A 70 -6.403 65.513 68.174 1.00 35.32 C ATOM 1022 O TYR A 70 -5.450 65.887 67.447 1.00 36.43 O ATOM 1023 CB TYR A 70 -5.984 63.051 68.394 1.00 35.53 C ATOM 1024 CG TYR A 70 -5.489 63.165 69.822 1.00 37.81 C ATOM 1025 CD1 TYR A 70 -6.214 62.610 70.880 1.00 34.35 C ATOM 1026 CD2 TYR A 70 -4.278 63.836 70.109 1.00 36.72 C ATOM 1027 CE1 TYR A 70 -5.741 62.709 72.202 1.00 38.84 C ATOM 1028 CE2 TYR A 70 -3.805 63.942 71.416 1.00 39.71 C ATOM 1029 CZ TYR A 70 -4.532 63.373 72.465 1.00 41.58 C ATOM 1030 OH TYR A 70 -4.014 63.438 73.758 1.00 45.41 O ATOM 1031 HA TYR A 70 -7.877 63.995 68.681 1.00 0.00 H ATOM 1032 HB3 TYR A 70 -5.131 63.150 67.723 1.00 0.00 H ATOM 1033 HB2 TYR A 70 -6.437 62.068 68.262 1.00 0.00 H ATOM 1034 HD2 TYR A 70 -3.704 64.278 69.294 1.00 0.00 H ATOM 1035 HE2 TYR A 70 -2.871 64.467 71.619 1.00 0.00 H ATOM 1036 HE1 TYR A 70 -6.312 62.271 73.020 1.00 0.00 H ATOM 1037 HD1 TYR A 70 -7.154 62.096 70.680 1.00 0.00 H ATOM 1038 HH TYR A 70 -3.900 64.386 74.019 1.00 0.00 H ATOM 1039 H TYR A 70 -6.888 63.246 66.046 1.00 0.00 H ATOM 1040 N VAL A 71 -6.924 66.303 69.098 1.00 34.86 N ATOM 1041 CA VAL A 71 -6.405 67.662 69.253 1.00 34.70 C ATOM 1042 C VAL A 71 -5.384 67.672 70.361 1.00 36.95 C ATOM 1043 O VAL A 71 -5.616 67.072 71.444 1.00 38.23 O ATOM 1044 CB VAL A 71 -7.563 68.655 69.544 1.00 34.13 C ATOM 1045 CG1 VAL A 71 -7.018 70.032 69.880 1.00 34.51 C ATOM 1046 CG2 VAL A 71 -8.497 68.721 68.291 1.00 32.67 C ATOM 1047 HA VAL A 71 -5.926 67.982 68.328 1.00 0.00 H ATOM 1048 HB VAL A 71 -8.133 68.307 70.406 1.00 0.00 H ATOM 1049 HG11 VAL A 71 -6.381 69.964 70.762 1.00 0.00 H ATOM 1050 HG12 VAL A 71 -6.436 70.406 69.038 1.00 0.00 H ATOM 1051 HG13 VAL A 71 -7.847 70.711 70.080 1.00 0.00 H ATOM 1052 HG21 VAL A 71 -7.924 69.063 67.430 1.00 0.00 H ATOM 1053 HG22 VAL A 71 -8.902 67.729 68.089 1.00 0.00 H ATOM 1054 HG23 VAL A 71 -9.314 69.416 68.485 1.00 0.00 H ATOM 1055 H VAL A 71 -7.694 65.962 69.708 1.00 0.00 H ATOM 1056 N ASP A 72 -4.243 68.325 70.123 1.00 36.44 N ATOM 1057 CA ASP A 72 -3.183 68.350 71.127 1.00 36.97 C ATOM 1058 C ASP A 72 -3.539 69.245 72.311 1.00 38.07 C ATOM 1059 O ASP A 72 -3.748 70.417 72.111 1.00 38.30 O ATOM 1060 CB ASP A 72 -1.892 68.869 70.473 1.00 38.14 C ATOM 1061 CG ASP A 72 -0.718 68.922 71.434 1.00 39.26 C ATOM 1062 OD1 ASP A 72 -0.837 68.413 72.572 1.00 39.20 O ATOM 1063 OD2 ASP A 72 0.341 69.450 71.029 1.00 39.87 O ATOM 1064 HA ASP A 72 -3.049 67.336 71.504 1.00 0.00 H ATOM 1065 HB2 ASP A 72 -1.633 68.210 69.644 1.00 0.00 H ATOM 1066 HB3 ASP A 72 -2.075 69.874 70.093 1.00 0.00 H ATOM 1067 H ASP A 72 -4.109 68.818 69.217 1.00 0.00 H ATOM 1068 N GLU A 73 -3.640 68.695 73.525 1.00 42.04 N ATOM 1069 CA GLU A 73 -3.909 69.500 74.739 1.00 45.56 C ATOM 1070 C GLU A 73 -2.713 69.389 75.686 1.00 44.97 C ATOM 1071 O GLU A 73 -2.854 69.702 76.858 1.00 45.93 O ATOM 1072 CB GLU A 73 -5.054 68.964 75.593 1.00 49.05 C ATOM 1073 CG GLU A 73 -6.225 68.439 74.913 1.00 55.47 C ATOM 1074 CD GLU A 73 -7.190 69.507 74.726 1.00 58.25 C ATOM 1075 OE1 GLU A 73 -6.730 70.461 74.076 1.00 60.83 O ATOM 1076 OE2 GLU A 73 -8.347 69.406 75.220 1.00 57.56 O ATOM 1077 HA GLU A 73 -4.129 70.501 74.367 1.00 0.00 H ATOM 1078 HB2 GLU A 73 -4.650 68.161 76.210 1.00 0.00 H ATOM 1079 HB3 GLU A 73 -5.390 69.779 76.234 1.00 0.00 H ATOM 1080 HG2 GLU A 73 -5.933 68.037 73.943 1.00 0.00 H ATOM 1081 HG3 GLU A 73 -6.671 67.646 75.514 1.00 0.00 H ATOM 1082 H GLU A 73 -3.526 67.666 73.621 1.00 0.00 H ATOM 1083 N GLN A 74 -1.584 68.860 75.238 1.00 44.82 N ATOM 1084 CA GLN A 74 -0.440 68.755 76.143 1.00 44.38 C ATOM 1085 C GLN A 74 -0.015 70.151 76.707 1.00 43.32 C ATOM 1086 O GLN A 74 0.402 70.244 77.847 1.00 40.60 O ATOM 1087 CB GLN A 74 0.736 68.070 75.436 1.00 45.34 C ATOM 1088 CG GLN A 74 2.027 67.915 76.291 1.00 51.45 C ATOM 1089 CD GLN A 74 1.823 67.017 77.512 1.00 54.92 C ATOM 1090 OE1 GLN A 74 2.186 67.368 78.641 1.00 57.55 O ATOM 1091 NE2 GLN A 74 1.229 65.861 77.290 1.00 57.33 N ATOM 1092 HA GLN A 74 -0.743 68.144 76.993 1.00 0.00 H ATOM 1093 HB2 GLN A 74 0.412 67.075 75.131 1.00 0.00 H ATOM 1094 HB3 GLN A 74 0.986 68.657 74.552 1.00 0.00 H ATOM 1095 HG2 GLN A 74 2.809 67.483 75.667 1.00 0.00 H ATOM 1096 HG3 GLN A 74 2.340 68.902 76.632 1.00 0.00 H ATOM 1097 HE22 GLN A 74 0.939 65.602 76.325 1.00 0.00 H ATOM 1098 HE21 GLN A 74 1.051 65.208 78.079 1.00 0.00 H ATOM 1099 H GLN A 74 -1.512 68.524 74.256 1.00 0.00 H ATOM 1100 N PHE A 75 -0.120 71.218 75.912 1.00 40.68 N ATOM 1101 CA PHE A 75 0.253 72.569 76.371 1.00 40.56 C ATOM 1102 C PHE A 75 -0.791 73.607 75.914 1.00 41.42 C ATOM 1103 O PHE A 75 -0.527 74.452 75.050 1.00 38.85 O ATOM 1104 CB PHE A 75 1.620 72.954 75.819 1.00 37.96 C ATOM 1105 CG PHE A 75 2.707 72.037 76.246 1.00 39.47 C ATOM 1106 CD1 PHE A 75 3.120 72.006 77.599 1.00 38.33 C ATOM 1107 CD2 PHE A 75 3.279 71.148 75.337 1.00 38.90 C ATOM 1108 CE1 PHE A 75 4.085 71.101 78.040 1.00 38.17 C ATOM 1109 CE2 PHE A 75 4.255 70.227 75.757 1.00 40.92 C ATOM 1110 CZ PHE A 75 4.665 70.200 77.126 1.00 38.01 C ATOM 1111 HA PHE A 75 0.290 72.558 77.460 1.00 0.00 H ATOM 1112 HB2 PHE A 75 1.568 72.946 74.730 1.00 0.00 H ATOM 1113 HB3 PHE A 75 1.861 73.960 76.163 1.00 0.00 H ATOM 1114 HD2 PHE A 75 2.967 71.167 74.293 1.00 0.00 H ATOM 1115 HE2 PHE A 75 4.698 69.535 75.040 1.00 0.00 H ATOM 1116 HZ PHE A 75 5.420 69.488 77.460 1.00 0.00 H ATOM 1117 HE1 PHE A 75 4.389 71.091 79.087 1.00 0.00 H ATOM 1118 HD1 PHE A 75 2.676 72.703 78.310 1.00 0.00 H ATOM 1119 H PHE A 75 -0.475 71.093 74.942 1.00 0.00 H ATOM 1120 N PRO A 76 -1.991 73.540 76.514 1.00 44.01 N ATOM 1121 CA PRO A 76 -3.142 74.412 76.235 1.00 45.04 C ATOM 1122 C PRO A 76 -2.699 75.848 76.058 1.00 45.30 C ATOM 1123 O PRO A 76 -2.080 76.406 76.938 1.00 45.13 O ATOM 1124 CB PRO A 76 -4.008 74.254 77.476 1.00 44.84 C ATOM 1125 CG PRO A 76 -3.699 72.864 77.922 1.00 46.17 C ATOM 1126 CD PRO A 76 -2.211 72.761 77.757 1.00 44.62 C ATOM 1127 HA PRO A 76 -3.666 74.151 75.316 1.00 0.00 H ATOM 1128 HD3 PRO A 76 -1.686 73.205 78.603 1.00 0.00 H ATOM 1129 HD2 PRO A 76 -1.895 71.725 77.638 1.00 0.00 H ATOM 1130 HG3 PRO A 76 -4.211 72.132 77.298 1.00 0.00 H ATOM 1131 HG2 PRO A 76 -3.986 72.716 78.963 1.00 0.00 H ATOM 1132 HB2 PRO A 76 -3.735 74.981 78.240 1.00 0.00 H ATOM 1133 HB3 PRO A 76 -5.065 74.363 77.234 1.00 0.00 H ATOM 1134 N GLY A 77 -3.006 76.428 74.906 1.00 45.59 N ATOM 1135 CA GLY A 77 -2.673 77.818 74.664 1.00 46.07 C ATOM 1136 C GLY A 77 -1.227 78.161 74.353 1.00 45.76 C ATOM 1137 O GLY A 77 -0.916 79.311 74.021 1.00 48.12 O ATOM 1138 HA3 GLY A 77 -2.955 78.379 75.555 1.00 0.00 H ATOM 1139 HA2 GLY A 77 -3.275 78.153 73.819 1.00 0.00 H ATOM 1140 H GLY A 77 -3.491 75.880 74.168 1.00 0.00 H ATOM 1141 N PHE A 78 -0.326 77.202 74.470 1.00 42.98 N ATOM 1142 CA PHE A 78 1.062 77.480 74.164 1.00 40.76 C ATOM 1143 C PHE A 78 1.213 77.580 72.654 1.00 40.34 C ATOM 1144 O PHE A 78 0.813 76.678 71.922 1.00 39.66 O ATOM 1145 CB PHE A 78 1.918 76.355 74.701 1.00 42.06 C ATOM 1146 CG PHE A 78 3.350 76.491 74.341 1.00 42.65 C ATOM 1147 CD1 PHE A 78 4.050 77.663 74.679 1.00 42.44 C ATOM 1148 CD2 PHE A 78 4.005 75.464 73.650 1.00 40.48 C ATOM 1149 CE1 PHE A 78 5.400 77.810 74.318 1.00 42.53 C ATOM 1150 CE2 PHE A 78 5.331 75.583 73.287 1.00 39.51 C ATOM 1151 CZ PHE A 78 6.036 76.755 73.614 1.00 42.36 C ATOM 1152 HA PHE A 78 1.378 78.417 74.623 1.00 0.00 H ATOM 1153 HB2 PHE A 78 1.833 76.342 75.788 1.00 0.00 H ATOM 1154 HB3 PHE A 78 1.546 75.413 74.298 1.00 0.00 H ATOM 1155 HD2 PHE A 78 3.459 74.556 73.395 1.00 0.00 H ATOM 1156 HE2 PHE A 78 5.828 74.775 72.751 1.00 0.00 H ATOM 1157 HZ PHE A 78 7.082 76.854 73.324 1.00 0.00 H ATOM 1158 HE1 PHE A 78 5.948 78.717 74.574 1.00 0.00 H ATOM 1159 HD1 PHE A 78 3.543 78.460 75.223 1.00 0.00 H ATOM 1160 H PHE A 78 -0.612 76.252 74.780 1.00 0.00 H ATOM 1161 N SER A 79 1.811 78.637 72.145 1.00 39.16 N ATOM 1162 CA SER A 79 1.878 78.723 70.697 1.00 39.61 C ATOM 1163 C SER A 79 2.669 77.637 69.951 1.00 39.48 C ATOM 1164 O SER A 79 2.281 77.271 68.826 1.00 37.90 O ATOM 1165 CB SER A 79 2.401 80.096 70.249 1.00 38.97 C ATOM 1166 OG SER A 79 3.791 80.200 70.550 1.00 43.28 O ATOM 1167 HA SER A 79 0.838 78.559 70.414 1.00 0.00 H ATOM 1168 HB2 SER A 79 1.856 80.881 70.774 1.00 0.00 H ATOM 1169 HB3 SER A 79 2.253 80.208 69.175 1.00 0.00 H ATOM 1170 HG SER A 79 4.125 81.086 70.260 1.00 0.00 H ATOM 1171 H SER A 79 2.217 79.377 72.753 1.00 0.00 H ATOM 1172 N GLY A 80 3.781 77.154 70.525 1.00 38.78 N ATOM 1173 CA GLY A 80 4.579 76.149 69.821 1.00 39.95 C ATOM 1174 C GLY A 80 3.767 74.904 69.489 1.00 38.80 C ATOM 1175 O GLY A 80 3.994 74.213 68.521 1.00 38.16 O ATOM 1176 HA3 GLY A 80 5.420 75.863 70.452 1.00 0.00 H ATOM 1177 HA2 GLY A 80 4.953 76.583 68.894 1.00 0.00 H ATOM 1178 H GLY A 80 4.074 77.491 71.464 1.00 0.00 H ATOM 1179 N SER A 81 2.806 74.636 70.350 1.00 38.78 N ATOM 1180 CA SER A 81 1.916 73.507 70.236 1.00 38.18 C ATOM 1181 C SER A 81 0.625 73.821 69.427 1.00 37.76 C ATOM 1182 O SER A 81 0.198 73.028 68.529 1.00 35.29 O ATOM 1183 CB SER A 81 1.594 73.078 71.678 1.00 39.34 C ATOM 1184 OG SER A 81 0.469 72.260 71.694 1.00 44.49 O ATOM 1185 HA SER A 81 2.395 72.706 69.673 1.00 0.00 H ATOM 1186 HB2 SER A 81 1.405 73.964 72.284 1.00 0.00 H ATOM 1187 HB3 SER A 81 2.443 72.532 72.090 1.00 0.00 H ATOM 1188 HG SER A 81 0.272 71.991 72.626 1.00 0.00 H ATOM 1189 H SER A 81 2.682 75.277 71.160 1.00 0.00 H ATOM 1190 N GLU A 82 0.023 74.982 69.708 1.00 35.45 N ATOM 1191 CA GLU A 82 -1.245 75.361 69.067 1.00 36.38 C ATOM 1192 C GLU A 82 -1.132 75.592 67.580 1.00 36.39 C ATOM 1193 O GLU A 82 -2.128 75.451 66.863 1.00 34.89 O ATOM 1194 CB GLU A 82 -1.864 76.617 69.694 1.00 38.14 C ATOM 1195 CG GLU A 82 -2.392 76.475 71.128 1.00 40.16 C ATOM 1196 CD GLU A 82 -3.496 75.430 71.292 1.00 42.39 C ATOM 1197 OE1 GLU A 82 -3.699 75.023 72.447 1.00 43.21 O ATOM 1198 OE2 GLU A 82 -4.155 75.004 70.298 1.00 42.21 O ATOM 1199 HA GLU A 82 -1.890 74.499 69.237 1.00 0.00 H ATOM 1200 HB2 GLU A 82 -1.102 77.397 69.697 1.00 0.00 H ATOM 1201 HB3 GLU A 82 -2.697 76.927 69.063 1.00 0.00 H ATOM 1202 HG2 GLU A 82 -1.559 76.196 71.773 1.00 0.00 H ATOM 1203 HG3 GLU A 82 -2.786 77.441 71.444 1.00 0.00 H ATOM 1204 H GLU A 82 0.461 75.630 70.394 1.00 0.00 H ATOM 1205 N MET A 83 0.086 75.915 67.121 1.00 34.19 N ATOM 1206 CA MET A 83 0.323 76.164 65.716 1.00 33.27 C ATOM 1207 C MET A 83 0.057 74.928 64.824 1.00 34.07 C ATOM 1208 O MET A 83 -0.116 75.080 63.616 1.00 32.93 O ATOM 1209 CB MET A 83 1.768 76.648 65.509 1.00 34.08 C ATOM 1210 CG MET A 83 2.859 75.584 65.764 1.00 32.59 C ATOM 1211 SD MET A 83 4.529 76.297 65.533 1.00 35.39 S ATOM 1212 CE MET A 83 4.681 76.259 63.773 1.00 30.47 C ATOM 1213 HA MET A 83 -0.385 76.934 65.411 1.00 0.00 H ATOM 1214 HB2 MET A 83 1.865 76.991 64.479 1.00 0.00 H ATOM 1215 HB3 MET A 83 1.945 77.483 66.187 1.00 0.00 H ATOM 1216 HG2 MET A 83 2.723 74.758 65.066 1.00 0.00 H ATOM 1217 HG3 MET A 83 2.766 75.214 66.785 1.00 0.00 H ATOM 1218 HE1 MET A 83 4.597 75.230 63.425 1.00 0.00 H ATOM 1219 HE2 MET A 83 3.888 76.860 63.328 1.00 0.00 H ATOM 1220 HE3 MET A 83 5.651 76.664 63.485 1.00 0.00 H ATOM 1221 H MET A 83 0.878 75.988 67.791 1.00 0.00 H ATOM 1222 N TRP A 84 -0.017 73.738 65.421 1.00 32.42 N ATOM 1223 CA TRP A 84 -0.277 72.497 64.667 1.00 33.61 C ATOM 1224 C TRP A 84 -1.735 72.056 64.795 1.00 34.67 C ATOM 1225 O TRP A 84 -2.207 71.241 63.997 1.00 35.70 O ATOM 1226 CB TRP A 84 0.638 71.357 65.178 1.00 31.87 C ATOM 1227 CG TRP A 84 2.129 71.761 65.154 1.00 31.22 C ATOM 1228 CD1 TRP A 84 2.934 72.028 66.234 1.00 31.05 C ATOM 1229 CD2 TRP A 84 2.952 71.922 63.992 1.00 31.31 C ATOM 1230 NE1 TRP A 84 4.222 72.353 65.809 1.00 32.27 N ATOM 1231 CE2 TRP A 84 4.259 72.280 64.439 1.00 31.76 C ATOM 1232 CE3 TRP A 84 2.716 71.805 62.604 1.00 31.27 C ATOM 1233 CZ2 TRP A 84 5.329 72.505 63.548 1.00 32.05 C ATOM 1234 CZ3 TRP A 84 3.796 72.047 61.714 1.00 31.62 C ATOM 1235 CH2 TRP A 84 5.079 72.383 62.194 1.00 29.32 C ATOM 1236 HA TRP A 84 -0.065 72.705 63.618 1.00 0.00 H ATOM 1237 HB2 TRP A 84 0.356 71.110 66.201 1.00 0.00 H ATOM 1238 HB3 TRP A 84 0.499 70.482 64.543 1.00 0.00 H ATOM 1239 HE1 TRP A 84 5.020 72.608 66.426 1.00 0.00 H ATOM 1240 HD1 TRP A 84 2.612 71.991 67.275 1.00 0.00 H ATOM 1241 HZ2 TRP A 84 6.321 72.767 63.915 1.00 0.00 H ATOM 1242 HH2 TRP A 84 5.889 72.550 61.484 1.00 0.00 H ATOM 1243 HZ3 TRP A 84 3.630 71.972 60.639 1.00 0.00 H ATOM 1244 HE3 TRP A 84 1.730 71.536 62.226 1.00 0.00 H ATOM 1245 H TRP A 84 0.113 73.683 66.451 1.00 0.00 H ATOM 1246 N ASN A 85 -2.453 72.601 65.777 1.00 34.13 N ATOM 1247 CA ASN A 85 -3.836 72.201 65.986 1.00 34.68 C ATOM 1248 C ASN A 85 -4.757 72.745 64.917 1.00 34.67 C ATOM 1249 O ASN A 85 -4.470 73.746 64.278 1.00 34.30 O ATOM 1250 CB ASN A 85 -4.361 72.636 67.391 1.00 36.21 C ATOM 1251 CG ASN A 85 -4.022 71.617 68.511 1.00 36.96 C ATOM 1252 OD1 ASN A 85 -3.900 70.405 68.266 1.00 36.79 O ATOM 1253 ND2 ASN A 85 -3.897 72.124 69.769 1.00 35.90 N ATOM 1254 HA ASN A 85 -3.843 71.113 65.927 1.00 0.00 H ATOM 1255 HB2 ASN A 85 -3.912 73.596 67.647 1.00 0.00 H ATOM 1256 HB3 ASN A 85 -5.444 72.746 67.338 1.00 0.00 H ATOM 1257 HD22 ASN A 85 -4.007 73.145 69.931 1.00 0.00 H ATOM 1258 HD21 ASN A 85 -3.692 71.490 70.567 1.00 0.00 H ATOM 1259 H ASN A 85 -2.022 73.316 66.397 1.00 0.00 H ATOM 1260 N PRO A 86 -5.888 72.085 64.708 1.00 34.25 N ATOM 1261 CA PRO A 86 -6.842 72.541 63.690 1.00 34.84 C ATOM 1262 C PRO A 86 -7.216 73.984 64.032 1.00 36.00 C ATOM 1263 O PRO A 86 -7.459 74.282 65.202 1.00 36.42 O ATOM 1264 CB PRO A 86 -8.056 71.633 63.900 1.00 34.86 C ATOM 1265 CG PRO A 86 -7.526 70.435 64.626 1.00 36.44 C ATOM 1266 CD PRO A 86 -6.363 70.912 65.456 1.00 33.74 C ATOM 1267 HA PRO A 86 -6.466 72.503 62.668 1.00 0.00 H ATOM 1268 HD3 PRO A 86 -6.684 71.190 66.460 1.00 0.00 H ATOM 1269 HD2 PRO A 86 -5.588 70.148 65.522 1.00 0.00 H ATOM 1270 HG3 PRO A 86 -7.195 69.680 63.913 1.00 0.00 H ATOM 1271 HG2 PRO A 86 -8.298 70.013 65.269 1.00 0.00 H ATOM 1272 HB2 PRO A 86 -8.814 72.139 64.498 1.00 0.00 H ATOM 1273 HB3 PRO A 86 -8.486 71.341 62.942 1.00 0.00 H ATOM 1274 N ASN A 87 -7.249 74.857 63.039 1.00 36.68 N ATOM 1275 CA ASN A 87 -7.639 76.226 63.255 1.00 39.07 C ATOM 1276 C ASN A 87 -9.006 76.508 62.588 1.00 41.11 C ATOM 1277 O ASN A 87 -9.446 77.667 62.495 1.00 40.48 O ATOM 1278 CB ASN A 87 -6.551 77.206 62.767 1.00 38.84 C ATOM 1279 CG ASN A 87 -6.279 77.103 61.274 1.00 40.46 C ATOM 1280 OD1 ASN A 87 -6.707 76.155 60.590 1.00 40.86 O ATOM 1281 ND2 ASN A 87 -5.548 78.071 60.761 1.00 39.29 N ATOM 1282 HA ASN A 87 -7.749 76.386 64.328 1.00 0.00 H ATOM 1283 HB2 ASN A 87 -6.874 78.223 62.991 1.00 0.00 H ATOM 1284 HB3 ASN A 87 -5.626 76.993 63.304 1.00 0.00 H ATOM 1285 HD22 ASN A 87 -5.210 78.845 61.368 1.00 0.00 H ATOM 1286 HD21 ASN A 87 -5.308 78.061 59.749 1.00 0.00 H ATOM 1287 H ASN A 87 -6.987 74.548 62.081 1.00 0.00 H ATOM 1288 N ARG A 88 -9.689 75.452 62.153 1.00 40.66 N ATOM 1289 CA ARG A 88 -11.032 75.590 61.559 1.00 43.09 C ATOM 1290 C ARG A 88 -11.912 74.569 62.282 1.00 43.57 C ATOM 1291 O ARG A 88 -11.412 73.763 63.034 1.00 44.61 O ATOM 1292 CB ARG A 88 -11.007 75.231 60.071 1.00 44.15 C ATOM 1293 CG ARG A 88 -10.320 76.207 59.269 1.00 45.82 C ATOM 1294 CD ARG A 88 -11.303 77.299 59.093 1.00 51.32 C ATOM 1295 NE ARG A 88 -10.638 78.565 59.245 1.00 56.35 N ATOM 1296 CZ ARG A 88 -11.044 79.676 58.665 1.00 58.67 C ATOM 1297 NH1 ARG A 88 -12.149 79.659 57.897 1.00 59.49 N ATOM 1298 NH2 ARG A 88 -10.283 80.768 58.783 1.00 58.98 N ATOM 1299 HA ARG A 88 -11.393 76.614 61.658 1.00 0.00 H ATOM 1300 HB2 ARG A 88 -10.506 74.270 59.954 1.00 0.00 H ATOM 1301 HB3 ARG A 88 -12.034 75.150 59.716 1.00 0.00 H ATOM 1302 HG2 ARG A 88 -9.429 76.569 59.782 1.00 0.00 H ATOM 1303 HG3 ARG A 88 -10.037 75.784 58.305 1.00 0.00 H ATOM 1304 HD2 ARG A 88 -12.088 77.207 59.843 1.00 0.00 H ATOM 1305 HD3 ARG A 88 -11.744 77.236 58.098 1.00 0.00 H ATOM 1306 HE ARG A 88 -9.790 78.606 59.846 1.00 0.00 H ATOM 1307 HH12 ARG A 88 -12.475 80.532 57.436 1.00 0.00 H ATOM 1308 HH11 ARG A 88 -12.677 78.773 57.764 1.00 0.00 H ATOM 1309 HH22 ARG A 88 -10.579 81.659 58.335 1.00 0.00 H ATOM 1310 HH21 ARG A 88 -9.395 80.727 59.322 1.00 0.00 H ATOM 1311 H ARG A 88 -9.265 74.506 62.234 1.00 0.00 H ATOM 1312 N GLU A 89 -13.212 74.567 62.055 1.00 44.23 N ATOM 1313 CA GLU A 89 -14.031 73.571 62.724 1.00 45.52 C ATOM 1314 C GLU A 89 -13.656 72.194 62.111 1.00 42.88 C ATOM 1315 O GLU A 89 -13.340 72.098 60.933 1.00 41.40 O ATOM 1316 CB GLU A 89 -15.524 73.874 62.489 1.00 50.22 C ATOM 1317 CG GLU A 89 -16.458 73.374 63.635 1.00 58.76 C ATOM 1318 CD GLU A 89 -17.765 72.693 63.114 1.00 64.13 C ATOM 1319 OE1 GLU A 89 -18.631 72.293 63.949 1.00 66.56 O ATOM 1320 OE2 GLU A 89 -17.932 72.542 61.870 1.00 67.29 O ATOM 1321 HA GLU A 89 -13.857 73.576 63.800 1.00 0.00 H ATOM 1322 HB2 GLU A 89 -15.645 74.953 62.393 1.00 0.00 H ATOM 1323 HB3 GLU A 89 -15.831 73.392 61.561 1.00 0.00 H ATOM 1324 HG2 GLU A 89 -15.909 72.652 64.239 1.00 0.00 H ATOM 1325 HG3 GLU A 89 -16.735 74.228 64.253 1.00 0.00 H ATOM 1326 H GLU A 89 -13.641 75.263 61.412 1.00 0.00 H ATOM 1327 N MET A 90 -13.658 71.138 62.901 1.00 40.34 N ATOM 1328 CA MET A 90 -13.349 69.828 62.345 1.00 40.77 C ATOM 1329 C MET A 90 -14.626 69.240 61.801 1.00 40.71 C ATOM 1330 O MET A 90 -15.708 69.476 62.343 1.00 41.16 O ATOM 1331 CB MET A 90 -12.819 68.888 63.427 1.00 41.44 C ATOM 1332 CG MET A 90 -11.430 69.280 63.918 1.00 40.27 C ATOM 1333 SD MET A 90 -10.716 68.087 65.009 1.00 40.16 S ATOM 1334 CE MET A 90 -11.624 68.408 66.504 1.00 38.49 C ATOM 1335 HA MET A 90 -12.591 69.940 61.570 1.00 0.00 H ATOM 1336 HB2 MET A 90 -13.506 68.907 64.273 1.00 0.00 H ATOM 1337 HB3 MET A 90 -12.773 67.878 63.020 1.00 0.00 H ATOM 1338 HG2 MET A 90 -11.504 70.231 64.445 1.00 0.00 H ATOM 1339 HG3 MET A 90 -10.776 69.395 63.054 1.00 0.00 H ATOM 1340 HE1 MET A 90 -11.456 69.439 66.816 1.00 0.00 H ATOM 1341 HE2 MET A 90 -12.687 68.251 66.323 1.00 0.00 H ATOM 1342 HE3 MET A 90 -11.284 67.730 67.287 1.00 0.00 H ATOM 1343 H MET A 90 -13.878 71.240 63.912 1.00 0.00 H ATOM 1344 N SER A 91 -14.509 68.465 60.740 1.00 40.89 N ATOM 1345 CA SER A 91 -15.671 67.803 60.148 1.00 39.70 C ATOM 1346 C SER A 91 -15.217 66.608 59.322 1.00 39.51 C ATOM 1347 O SER A 91 -14.120 66.655 58.771 1.00 39.30 O ATOM 1348 CB SER A 91 -16.406 68.768 59.209 1.00 39.82 C ATOM 1349 OG SER A 91 -17.518 68.110 58.606 1.00 37.24 O ATOM 1350 HA SER A 91 -16.331 67.484 60.955 1.00 0.00 H ATOM 1351 HB2 SER A 91 -15.722 69.107 58.431 1.00 0.00 H ATOM 1352 HB3 SER A 91 -16.760 69.627 59.779 1.00 0.00 H ATOM 1353 HG SER A 91 -17.985 68.740 58.002 1.00 0.00 H ATOM 1354 H SER A 91 -13.570 68.322 60.315 1.00 0.00 H ATOM 1355 N GLU A 92 -16.023 65.538 59.224 1.00 39.18 N ATOM 1356 CA GLU A 92 -15.628 64.446 58.319 1.00 39.45 C ATOM 1357 C GLU A 92 -15.742 64.937 56.867 1.00 39.87 C ATOM 1358 O GLU A 92 -15.202 64.296 55.938 1.00 38.36 O ATOM 1359 CB GLU A 92 -16.499 63.203 58.491 1.00 39.26 C ATOM 1360 CG GLU A 92 -16.076 62.311 59.644 1.00 39.89 C ATOM 1361 CD GLU A 92 -16.954 61.070 59.777 1.00 42.42 C ATOM 1362 OE1 GLU A 92 -18.043 61.172 60.388 1.00 45.62 O ATOM 1363 OE2 GLU A 92 -16.573 59.994 59.262 1.00 42.03 O ATOM 1364 HA GLU A 92 -14.603 64.168 58.563 1.00 0.00 H ATOM 1365 HB2 GLU A 92 -17.526 63.524 58.664 1.00 0.00 H ATOM 1366 HB3 GLU A 92 -16.452 62.621 57.571 1.00 0.00 H ATOM 1367 HG2 GLU A 92 -15.046 61.995 59.481 1.00 0.00 H ATOM 1368 HG3 GLU A 92 -16.137 62.883 60.570 1.00 0.00 H ATOM 1369 H GLU A 92 -16.904 65.482 59.774 1.00 0.00 H ATOM 1370 N ASP A 93 -16.465 66.056 56.663 1.00 38.71 N ATOM 1371 CA ASP A 93 -16.614 66.655 55.324 1.00 38.84 C ATOM 1372 C ASP A 93 -15.407 67.568 55.261 1.00 38.86 C ATOM 1373 O ASP A 93 -15.489 68.735 55.639 1.00 37.80 O ATOM 1374 CB ASP A 93 -17.921 67.474 55.244 1.00 39.42 C ATOM 1375 CG ASP A 93 -18.110 68.182 53.878 1.00 42.30 C ATOM 1376 OD1 ASP A 93 -17.197 68.179 53.003 1.00 41.30 O ATOM 1377 OD2 ASP A 93 -19.200 68.772 53.689 1.00 43.22 O ATOM 1378 HA ASP A 93 -16.666 65.930 54.511 1.00 0.00 H ATOM 1379 HB2 ASP A 93 -18.763 66.801 55.406 1.00 0.00 H ATOM 1380 HB3 ASP A 93 -17.906 68.231 56.028 1.00 0.00 H ATOM 1381 H ASP A 93 -16.932 66.510 57.474 1.00 0.00 H ATOM 1382 N CYS A 94 -14.276 67.051 54.765 1.00 39.08 N ATOM 1383 CA CYS A 94 -13.040 67.838 54.804 1.00 37.01 C ATOM 1384 C CYS A 94 -12.127 67.630 53.625 1.00 37.37 C ATOM 1385 O CYS A 94 -10.950 68.032 53.685 1.00 36.89 O ATOM 1386 CB CYS A 94 -12.258 67.472 56.104 1.00 35.57 C ATOM 1387 SG CYS A 94 -11.760 65.708 56.133 1.00 36.04 S ATOM 1388 HA CYS A 94 -13.344 68.884 54.777 1.00 0.00 H ATOM 1389 HB2 CYS A 94 -12.894 67.672 56.966 1.00 0.00 H ATOM 1390 HB3 CYS A 94 -11.363 68.092 56.163 1.00 0.00 H ATOM 1391 H CYS A 94 -14.274 66.096 54.354 1.00 0.00 H ATOM 1392 N LEU A 95 -12.623 66.983 52.568 1.00 35.92 N ATOM 1393 CA LEU A 95 -11.760 66.771 51.432 1.00 36.36 C ATOM 1394 C LEU A 95 -11.760 67.958 50.455 1.00 35.98 C ATOM 1395 O LEU A 95 -12.510 67.992 49.457 1.00 35.43 O ATOM 1396 CB LEU A 95 -12.111 65.442 50.743 1.00 35.07 C ATOM 1397 CG LEU A 95 -11.846 64.267 51.694 1.00 35.57 C ATOM 1398 CD1 LEU A 95 -12.133 62.949 51.004 1.00 35.54 C ATOM 1399 CD2 LEU A 95 -10.355 64.335 52.169 1.00 34.47 C ATOM 1400 HA LEU A 95 -10.736 66.703 51.799 1.00 0.00 H ATOM 1401 HB2 LEU A 95 -13.164 65.448 50.463 1.00 0.00 H ATOM 1402 HB3 LEU A 95 -11.499 65.327 49.848 1.00 0.00 H ATOM 1403 HG LEU A 95 -12.507 64.335 52.558 1.00 0.00 H ATOM 1404 HD21 LEU A 95 -9.696 64.269 51.303 1.00 0.00 H ATOM 1405 HD22 LEU A 95 -10.183 65.278 52.687 1.00 0.00 H ATOM 1406 HD23 LEU A 95 -10.152 63.505 52.846 1.00 0.00 H ATOM 1407 HD11 LEU A 95 -13.177 62.924 50.692 1.00 0.00 H ATOM 1408 HD12 LEU A 95 -11.489 62.850 50.130 1.00 0.00 H ATOM 1409 HD13 LEU A 95 -11.939 62.129 51.695 1.00 0.00 H ATOM 1410 H LEU A 95 -13.605 66.641 52.564 1.00 0.00 H ATOM 1411 N TYR A 96 -10.894 68.919 50.753 1.00 35.85 N ATOM 1412 CA TYR A 96 -10.783 70.123 49.927 1.00 37.28 C ATOM 1413 C TYR A 96 -9.333 70.450 49.666 1.00 36.36 C ATOM 1414 O TYR A 96 -8.441 69.905 50.333 1.00 38.06 O ATOM 1415 CB TYR A 96 -11.441 71.307 50.649 1.00 37.70 C ATOM 1416 CG TYR A 96 -12.898 71.084 50.918 1.00 37.63 C ATOM 1417 CD1 TYR A 96 -13.301 70.368 52.041 1.00 37.92 C ATOM 1418 CD2 TYR A 96 -13.872 71.529 50.005 1.00 36.08 C ATOM 1419 CE1 TYR A 96 -14.619 70.080 52.260 1.00 37.74 C ATOM 1420 CE2 TYR A 96 -15.190 71.252 50.207 1.00 37.69 C ATOM 1421 CZ TYR A 96 -15.573 70.524 51.333 1.00 39.16 C ATOM 1422 OH TYR A 96 -16.902 70.212 51.552 1.00 37.33 O ATOM 1423 HA TYR A 96 -11.286 69.940 48.977 1.00 0.00 H ATOM 1424 HB3 TYR A 96 -11.333 72.197 50.029 1.00 0.00 H ATOM 1425 HB2 TYR A 96 -10.931 71.463 51.599 1.00 0.00 H ATOM 1426 HD2 TYR A 96 -13.569 72.101 49.128 1.00 0.00 H ATOM 1427 HE2 TYR A 96 -15.939 71.597 49.494 1.00 0.00 H ATOM 1428 HE1 TYR A 96 -14.924 69.515 53.141 1.00 0.00 H ATOM 1429 HD1 TYR A 96 -12.553 70.031 52.758 1.00 0.00 H ATOM 1430 HH TYR A 96 -16.984 69.696 52.393 1.00 0.00 H ATOM 1431 H TYR A 96 -10.283 68.815 51.588 1.00 0.00 H ATOM 1432 N LEU A 97 -9.104 71.313 48.684 1.00 34.56 N ATOM 1433 CA LEU A 97 -7.769 71.768 48.367 1.00 34.35 C ATOM 1434 C LEU A 97 -7.747 73.285 48.201 1.00 35.04 C ATOM 1435 O LEU A 97 -8.781 73.926 47.947 1.00 35.83 O ATOM 1436 CB LEU A 97 -7.196 71.040 47.124 1.00 33.31 C ATOM 1437 CG LEU A 97 -7.899 71.020 45.751 1.00 34.74 C ATOM 1438 CD1 LEU A 97 -7.689 72.369 45.009 1.00 35.17 C ATOM 1439 CD2 LEU A 97 -7.273 69.884 44.902 1.00 33.29 C ATOM 1440 HA LEU A 97 -7.117 71.515 49.203 1.00 0.00 H ATOM 1441 HB2 LEU A 97 -6.213 71.477 46.949 1.00 0.00 H ATOM 1442 HB3 LEU A 97 -7.082 69.996 47.416 1.00 0.00 H ATOM 1443 HG LEU A 97 -8.967 70.861 45.896 1.00 0.00 H ATOM 1444 HD21 LEU A 97 -6.207 70.072 44.775 1.00 0.00 H ATOM 1445 HD22 LEU A 97 -7.417 68.931 45.411 1.00 0.00 H ATOM 1446 HD23 LEU A 97 -7.757 69.853 43.926 1.00 0.00 H ATOM 1447 HD11 LEU A 97 -8.105 73.180 45.607 1.00 0.00 H ATOM 1448 HD12 LEU A 97 -6.623 72.537 44.858 1.00 0.00 H ATOM 1449 HD13 LEU A 97 -8.193 72.333 44.043 1.00 0.00 H ATOM 1450 H LEU A 97 -9.906 71.671 48.128 1.00 0.00 H ATOM 1451 N ASN A 98 -6.550 73.852 48.329 1.00 35.55 N ATOM 1452 CA ASN A 98 -6.333 75.288 48.250 1.00 34.90 C ATOM 1453 C ASN A 98 -5.297 75.642 47.206 1.00 35.91 C ATOM 1454 O ASN A 98 -4.277 74.946 47.075 1.00 36.29 O ATOM 1455 CB ASN A 98 -5.849 75.833 49.624 1.00 34.27 C ATOM 1456 CG ASN A 98 -6.730 75.362 50.796 1.00 36.35 C ATOM 1457 OD1 ASN A 98 -7.945 75.654 50.850 1.00 33.89 O ATOM 1458 ND2 ASN A 98 -6.115 74.622 51.750 1.00 34.84 N ATOM 1459 HA ASN A 98 -7.285 75.741 47.972 1.00 0.00 H ATOM 1460 HB2 ASN A 98 -4.829 75.490 49.795 1.00 0.00 H ATOM 1461 HB3 ASN A 98 -5.864 76.922 49.592 1.00 0.00 H ATOM 1462 HD22 ASN A 98 -5.102 74.403 51.665 1.00 0.00 H ATOM 1463 HD21 ASN A 98 -6.656 74.274 52.567 1.00 0.00 H ATOM 1464 H ASN A 98 -5.728 73.237 48.494 1.00 0.00 H ATOM 1465 N ILE A 99 -5.539 76.742 46.483 1.00 35.04 N ATOM 1466 CA ILE A 99 -4.611 77.188 45.475 1.00 36.10 C ATOM 1467 C ILE A 99 -4.248 78.687 45.570 1.00 37.48 C ATOM 1468 O ILE A 99 -5.133 79.541 45.622 1.00 38.90 O ATOM 1469 CB ILE A 99 -5.160 76.943 44.038 1.00 34.29 C ATOM 1470 CG1 ILE A 99 -5.882 75.570 43.952 1.00 35.53 C ATOM 1471 CG2 ILE A 99 -3.989 77.077 43.052 1.00 32.42 C ATOM 1472 CD1 ILE A 99 -6.390 75.171 42.482 1.00 33.02 C ATOM 1473 HA ILE A 99 -3.716 76.596 45.665 1.00 0.00 H ATOM 1474 HB ILE A 99 -5.914 77.685 43.776 1.00 0.00 H ATOM 1475 HG12 ILE A 99 -5.190 74.800 44.293 1.00 0.00 H ATOM 1476 HG13 ILE A 99 -6.747 75.599 44.615 1.00 0.00 H ATOM 1477 HD11 ILE A 99 -7.096 75.922 42.127 1.00 0.00 H ATOM 1478 HD12 ILE A 99 -5.537 75.123 41.805 1.00 0.00 H ATOM 1479 HD13 ILE A 99 -6.881 74.199 42.520 1.00 0.00 H ATOM 1480 HG21 ILE A 99 -3.565 78.078 43.128 1.00 0.00 H ATOM 1481 HG22 ILE A 99 -3.225 76.338 43.294 1.00 0.00 H ATOM 1482 HG23 ILE A 99 -4.349 76.909 42.037 1.00 0.00 H ATOM 1483 H ILE A 99 -6.411 77.283 46.651 1.00 0.00 H ATOM 1484 N TRP A 100 -2.959 78.991 45.568 1.00 36.19 N ATOM 1485 CA TRP A 100 -2.506 80.369 45.577 1.00 37.09 C ATOM 1486 C TRP A 100 -1.980 80.561 44.184 1.00 38.68 C ATOM 1487 O TRP A 100 -1.165 79.758 43.702 1.00 38.72 O ATOM 1488 CB TRP A 100 -1.412 80.569 46.604 1.00 37.53 C ATOM 1489 CG TRP A 100 -2.029 80.694 47.991 1.00 38.76 C ATOM 1490 CD1 TRP A 100 -2.463 81.827 48.587 1.00 37.42 C ATOM 1491 CD2 TRP A 100 -2.240 79.636 48.931 1.00 38.67 C ATOM 1492 NE1 TRP A 100 -2.930 81.563 49.850 1.00 39.05 N ATOM 1493 CE2 TRP A 100 -2.801 80.224 50.101 1.00 38.48 C ATOM 1494 CE3 TRP A 100 -2.001 78.248 48.907 1.00 37.23 C ATOM 1495 CZ2 TRP A 100 -3.128 79.474 51.255 1.00 36.60 C ATOM 1496 CZ3 TRP A 100 -2.325 77.479 50.076 1.00 36.79 C ATOM 1497 CH2 TRP A 100 -2.878 78.104 51.226 1.00 37.40 C ATOM 1498 HA TRP A 100 -3.289 81.080 45.840 1.00 0.00 H ATOM 1499 HB2 TRP A 100 -0.735 79.715 46.584 1.00 0.00 H ATOM 1500 HB3 TRP A 100 -0.857 81.477 46.371 1.00 0.00 H ATOM 1501 HE1 TRP A 100 -3.319 82.267 50.510 1.00 0.00 H ATOM 1502 HD1 TRP A 100 -2.445 82.815 48.127 1.00 0.00 H ATOM 1503 HZ2 TRP A 100 -3.560 79.951 52.135 1.00 0.00 H ATOM 1504 HH2 TRP A 100 -3.111 77.500 52.103 1.00 0.00 H ATOM 1505 HZ3 TRP A 100 -2.145 76.404 50.081 1.00 0.00 H ATOM 1506 HE3 TRP A 100 -1.580 77.769 48.023 1.00 0.00 H ATOM 1507 H TRP A 100 -2.256 78.225 45.560 1.00 0.00 H ATOM 1508 N VAL A 101 -2.466 81.608 43.521 1.00 38.65 N ATOM 1509 CA VAL A 101 -2.111 81.868 42.140 1.00 38.97 C ATOM 1510 C VAL A 101 -1.545 83.277 41.938 1.00 40.44 C ATOM 1511 O VAL A 101 -2.205 84.252 42.267 1.00 39.11 O ATOM 1512 CB VAL A 101 -3.381 81.747 41.245 1.00 38.63 C ATOM 1513 CG1 VAL A 101 -3.036 82.057 39.745 1.00 35.93 C ATOM 1514 CG2 VAL A 101 -4.022 80.397 41.435 1.00 37.83 C ATOM 1515 HA VAL A 101 -1.350 81.137 41.868 1.00 0.00 H ATOM 1516 HB VAL A 101 -4.113 82.494 41.552 1.00 0.00 H ATOM 1517 HG11 VAL A 101 -2.644 83.071 39.666 1.00 0.00 H ATOM 1518 HG12 VAL A 101 -2.287 81.348 39.392 1.00 0.00 H ATOM 1519 HG13 VAL A 101 -3.938 81.966 39.140 1.00 0.00 H ATOM 1520 HG21 VAL A 101 -3.313 79.617 41.158 1.00 0.00 H ATOM 1521 HG22 VAL A 101 -4.307 80.276 42.480 1.00 0.00 H ATOM 1522 HG23 VAL A 101 -4.908 80.325 40.804 1.00 0.00 H ATOM 1523 H VAL A 101 -3.118 82.257 44.007 1.00 0.00 H ATOM 1524 N PRO A 102 -0.330 83.392 41.369 1.00 41.36 N ATOM 1525 CA PRO A 102 0.277 84.718 41.124 1.00 42.80 C ATOM 1526 C PRO A 102 -0.668 85.663 40.358 1.00 45.62 C ATOM 1527 O PRO A 102 -1.537 85.227 39.595 1.00 46.45 O ATOM 1528 CB PRO A 102 1.503 84.402 40.273 1.00 40.28 C ATOM 1529 CG PRO A 102 1.908 83.010 40.800 1.00 42.41 C ATOM 1530 CD PRO A 102 0.585 82.295 41.013 1.00 39.88 C ATOM 1531 HA PRO A 102 0.508 85.232 42.057 1.00 0.00 H ATOM 1532 HD3 PRO A 102 0.259 81.793 40.102 1.00 0.00 H ATOM 1533 HD2 PRO A 102 0.658 81.567 41.821 1.00 0.00 H ATOM 1534 HG3 PRO A 102 2.457 83.096 41.738 1.00 0.00 H ATOM 1535 HG2 PRO A 102 2.520 82.482 40.069 1.00 0.00 H ATOM 1536 HB2 PRO A 102 1.252 84.367 39.213 1.00 0.00 H ATOM 1537 HB3 PRO A 102 2.296 85.133 40.433 1.00 0.00 H ATOM 1538 N SER A 103 -0.482 86.964 40.550 1.00 47.27 N ATOM 1539 CA SER A 103 -1.303 87.946 39.845 1.00 48.62 C ATOM 1540 C SER A 103 -0.361 88.896 39.118 1.00 47.42 C ATOM 1541 O SER A 103 0.577 89.418 39.696 1.00 45.21 O ATOM 1542 CB SER A 103 -2.194 88.726 40.821 1.00 49.28 C ATOM 1543 OG SER A 103 -2.987 89.649 40.084 1.00 51.52 O ATOM 1544 HA SER A 103 -1.963 87.440 39.140 1.00 0.00 H ATOM 1545 HB2 SER A 103 -1.571 89.266 41.534 1.00 0.00 H ATOM 1546 HB3 SER A 103 -2.842 88.034 41.358 1.00 0.00 H ATOM 1547 HG SER A 103 -3.551 89.155 39.437 1.00 0.00 H ATOM 1548 H SER A 103 0.255 87.287 41.209 1.00 0.00 H ATOM 1549 N PRO A 104 -0.597 89.116 37.823 1.00 46.95 N ATOM 1550 CA PRO A 104 -1.699 88.533 37.040 1.00 46.65 C ATOM 1551 C PRO A 104 -1.509 87.014 36.826 1.00 45.26 C ATOM 1552 O PRO A 104 -0.386 86.494 36.897 1.00 44.51 O ATOM 1553 CB PRO A 104 -1.618 89.303 35.723 1.00 47.75 C ATOM 1554 CG PRO A 104 -0.080 89.451 35.543 1.00 47.71 C ATOM 1555 CD PRO A 104 0.373 89.830 36.964 1.00 46.76 C ATOM 1556 HA PRO A 104 -2.668 88.620 37.531 1.00 0.00 H ATOM 1557 HD3 PRO A 104 1.391 89.490 37.155 1.00 0.00 H ATOM 1558 HD2 PRO A 104 0.316 90.907 37.120 1.00 0.00 H ATOM 1559 HG3 PRO A 104 0.162 90.237 34.827 1.00 0.00 H ATOM 1560 HG2 PRO A 104 0.373 88.514 35.219 1.00 0.00 H ATOM 1561 HB2 PRO A 104 -2.062 88.738 34.903 1.00 0.00 H ATOM 1562 HB3 PRO A 104 -2.105 90.275 35.799 1.00 0.00 H ATOM 1563 N ARG A 105 -2.608 86.327 36.542 1.00 43.91 N ATOM 1564 CA ARG A 105 -2.595 84.871 36.340 1.00 44.23 C ATOM 1565 C ARG A 105 -1.596 84.314 35.329 1.00 42.57 C ATOM 1566 O ARG A 105 -1.598 84.709 34.181 1.00 41.78 O ATOM 1567 CB ARG A 105 -3.984 84.392 35.949 1.00 43.25 C ATOM 1568 CG ARG A 105 -4.075 82.866 35.937 1.00 44.49 C ATOM 1569 CD ARG A 105 -5.352 82.395 35.287 1.00 40.65 C ATOM 1570 NE ARG A 105 -6.492 82.877 36.042 1.00 41.64 N ATOM 1571 CZ ARG A 105 -7.733 82.867 35.590 1.00 39.91 C ATOM 1572 NH1 ARG A 105 -7.963 82.381 34.388 1.00 41.02 N ATOM 1573 NH2 ARG A 105 -8.730 83.362 36.311 1.00 40.45 N ATOM 1574 HA ARG A 105 -2.264 84.488 37.305 1.00 0.00 H ATOM 1575 HB2 ARG A 105 -4.707 84.783 36.665 1.00 0.00 H ATOM 1576 HB3 ARG A 105 -4.220 84.768 34.953 1.00 0.00 H ATOM 1577 HG2 ARG A 105 -3.226 82.464 35.384 1.00 0.00 H ATOM 1578 HG3 ARG A 105 -4.044 82.501 36.963 1.00 0.00 H ATOM 1579 HD2 ARG A 105 -5.367 81.305 35.264 1.00 0.00 H ATOM 1580 HD3 ARG A 105 -5.403 82.779 34.268 1.00 0.00 H ATOM 1581 HE ARG A 105 -6.322 83.253 36.997 1.00 0.00 H ATOM 1582 HH12 ARG A 105 -8.932 82.363 34.011 1.00 0.00 H ATOM 1583 HH11 ARG A 105 -7.176 82.015 33.816 1.00 0.00 H ATOM 1584 HH22 ARG A 105 -9.700 83.345 35.937 1.00 0.00 H ATOM 1585 HH21 ARG A 105 -8.541 83.767 37.250 1.00 0.00 H ATOM 1586 H ARG A 105 -3.511 86.837 36.459 1.00 0.00 H ATOM 1587 N PRO A 106 -0.722 83.378 35.749 1.00 42.81 N ATOM 1588 CA PRO A 106 0.256 82.806 34.799 1.00 40.85 C ATOM 1589 C PRO A 106 -0.467 82.019 33.708 1.00 40.05 C ATOM 1590 O PRO A 106 -1.647 81.721 33.837 1.00 39.61 O ATOM 1591 CB PRO A 106 1.086 81.862 35.660 1.00 41.80 C ATOM 1592 CG PRO A 106 0.859 82.360 37.058 1.00 41.28 C ATOM 1593 CD PRO A 106 -0.569 82.779 37.086 1.00 42.50 C ATOM 1594 HA PRO A 106 0.856 83.566 34.298 1.00 0.00 H ATOM 1595 HD3 PRO A 106 -1.233 81.925 37.219 1.00 0.00 H ATOM 1596 HD2 PRO A 106 -0.755 83.509 37.874 1.00 0.00 H ATOM 1597 HG3 PRO A 106 1.512 83.205 37.275 1.00 0.00 H ATOM 1598 HG2 PRO A 106 1.041 81.566 37.783 1.00 0.00 H ATOM 1599 HB2 PRO A 106 0.741 80.834 35.553 1.00 0.00 H ATOM 1600 HB3 PRO A 106 2.141 81.919 35.393 1.00 0.00 H ATOM 1601 N LYS A 107 0.252 81.666 32.654 1.00 40.45 N ATOM 1602 CA LYS A 107 -0.300 80.869 31.588 1.00 41.77 C ATOM 1603 C LYS A 107 0.068 79.388 31.808 1.00 43.35 C ATOM 1604 O LYS A 107 -0.762 78.493 31.647 1.00 41.23 O ATOM 1605 CB LYS A 107 0.284 81.326 30.259 1.00 42.62 C ATOM 1606 CG LYS A 107 0.089 82.813 29.997 1.00 45.06 C ATOM 1607 CD LYS A 107 -1.389 83.137 30.162 1.00 46.65 C ATOM 1608 CE LYS A 107 -1.684 84.600 29.899 1.00 48.54 C ATOM 1609 NZ LYS A 107 -3.064 84.889 30.368 1.00 50.00 N ATOM 1610 HA LYS A 107 -1.384 80.985 31.578 1.00 0.00 H ATOM 1611 HB2 LYS A 107 1.353 81.111 30.258 1.00 0.00 H ATOM 1612 HB3 LYS A 107 -0.199 80.767 29.458 1.00 0.00 H ATOM 1613 HG2 LYS A 107 0.676 83.393 30.709 1.00 0.00 H ATOM 1614 HG3 LYS A 107 0.409 83.054 28.983 1.00 0.00 H ATOM 1615 HD2 LYS A 107 -1.963 82.531 29.461 1.00 0.00 H ATOM 1616 HD3 LYS A 107 -1.691 82.895 31.181 1.00 0.00 H ATOM 1617 HE2 LYS A 107 -1.606 84.806 28.831 1.00 0.00 H ATOM 1618 HE3 LYS A 107 -0.972 85.223 30.441 1.00 0.00 H ATOM 1619 HZ1 LYS A 107 -3.738 84.290 29.850 1.00 0.00 H ATOM 1620 HZ2 LYS A 107 -3.132 84.688 31.386 1.00 0.00 H ATOM 1621 HZ3 LYS A 107 -3.285 85.891 30.195 1.00 0.00 H ATOM 1622 H LYS A 107 1.244 81.973 32.594 1.00 0.00 H ATOM 1623 N SER A 108 1.333 79.135 32.151 1.00 44.30 N ATOM 1624 CA SER A 108 1.775 77.762 32.365 1.00 46.34 C ATOM 1625 C SER A 108 3.019 77.778 33.223 1.00 45.75 C ATOM 1626 O SER A 108 4.141 77.634 32.720 1.00 48.13 O ATOM 1627 CB SER A 108 2.089 77.095 31.031 1.00 47.72 C ATOM 1628 OG SER A 108 1.951 75.672 31.098 1.00 49.63 O ATOM 1629 HA SER A 108 0.983 77.201 32.861 1.00 0.00 H ATOM 1630 HB2 SER A 108 3.114 77.337 30.749 1.00 0.00 H ATOM 1631 HB3 SER A 108 1.405 77.480 30.275 1.00 0.00 H ATOM 1632 HG SER A 108 2.163 75.279 30.214 1.00 0.00 H ATOM 1633 H SER A 108 2.006 79.920 32.266 1.00 0.00 H ATOM 1634 N THR A 109 2.834 77.951 34.515 1.00 42.57 N ATOM 1635 CA THR A 109 4.002 78.006 35.369 1.00 41.87 C ATOM 1636 C THR A 109 4.206 76.784 36.304 1.00 41.40 C ATOM 1637 O THR A 109 3.327 75.894 36.403 1.00 41.00 O ATOM 1638 CB THR A 109 3.996 79.311 36.189 1.00 39.83 C ATOM 1639 OG1 THR A 109 5.314 79.531 36.689 1.00 42.08 O ATOM 1640 CG2 THR A 109 3.010 79.251 37.362 1.00 36.40 C ATOM 1641 HA THR A 109 4.852 77.979 34.687 1.00 0.00 H ATOM 1642 HB THR A 109 3.679 80.126 35.539 1.00 0.00 H ATOM 1643 HG1 THR A 109 5.329 80.367 37.219 1.00 0.00 H ATOM 1644 HG23 THR A 109 2.003 79.083 36.980 1.00 0.00 H ATOM 1645 HG21 THR A 109 3.289 78.434 38.028 1.00 0.00 H ATOM 1646 HG22 THR A 109 3.040 80.193 37.909 1.00 0.00 H ATOM 1647 H THR A 109 1.877 78.045 34.911 1.00 0.00 H ATOM 1648 N THR A 110 5.368 76.745 36.958 1.00 40.38 N ATOM 1649 CA THR A 110 5.700 75.681 37.908 1.00 39.29 C ATOM 1650 C THR A 110 4.633 75.491 39.016 1.00 37.71 C ATOM 1651 O THR A 110 4.197 76.453 39.647 1.00 38.27 O ATOM 1652 CB THR A 110 7.046 75.969 38.580 1.00 40.46 C ATOM 1653 OG1 THR A 110 8.069 76.025 37.584 1.00 40.70 O ATOM 1654 CG2 THR A 110 7.401 74.845 39.616 1.00 39.87 C ATOM 1655 HA THR A 110 5.742 74.763 37.322 1.00 0.00 H ATOM 1656 HB THR A 110 6.976 76.922 39.104 1.00 0.00 H ATOM 1657 HG1 THR A 110 8.940 76.211 38.017 1.00 0.00 H ATOM 1658 HG23 THR A 110 6.624 74.797 40.379 1.00 0.00 H ATOM 1659 HG21 THR A 110 7.467 73.886 39.102 1.00 0.00 H ATOM 1660 HG22 THR A 110 8.358 75.074 40.084 1.00 0.00 H ATOM 1661 H THR A 110 6.064 77.498 36.787 1.00 0.00 H ATOM 1662 N VAL A 111 4.223 74.243 39.246 1.00 35.60 N ATOM 1663 CA VAL A 111 3.226 73.913 40.254 1.00 32.85 C ATOM 1664 C VAL A 111 3.851 73.104 41.419 1.00 33.55 C ATOM 1665 O VAL A 111 4.594 72.136 41.175 1.00 32.46 O ATOM 1666 CB VAL A 111 2.072 73.039 39.614 1.00 34.52 C ATOM 1667 CG1 VAL A 111 1.046 72.610 40.684 1.00 29.77 C ATOM 1668 CG2 VAL A 111 1.359 73.825 38.479 1.00 33.19 C ATOM 1669 HA VAL A 111 2.828 74.853 40.637 1.00 0.00 H ATOM 1670 HB VAL A 111 2.526 72.142 39.192 1.00 0.00 H ATOM 1671 HG11 VAL A 111 1.548 72.020 41.451 1.00 0.00 H ATOM 1672 HG12 VAL A 111 0.603 73.497 41.137 1.00 0.00 H ATOM 1673 HG13 VAL A 111 0.264 72.011 40.217 1.00 0.00 H ATOM 1674 HG21 VAL A 111 0.927 74.739 38.887 1.00 0.00 H ATOM 1675 HG22 VAL A 111 2.083 74.079 37.704 1.00 0.00 H ATOM 1676 HG23 VAL A 111 0.569 73.207 38.052 1.00 0.00 H ATOM 1677 H VAL A 111 4.633 73.472 38.681 1.00 0.00 H ATOM 1678 N MET A 112 3.544 73.504 42.663 1.00 32.08 N ATOM 1679 CA MET A 112 3.981 72.799 43.878 1.00 33.43 C ATOM 1680 C MET A 112 2.714 72.453 44.685 1.00 33.72 C ATOM 1681 O MET A 112 1.811 73.301 44.857 1.00 33.47 O ATOM 1682 CB MET A 112 4.928 73.646 44.724 1.00 33.99 C ATOM 1683 CG MET A 112 6.231 74.021 43.946 1.00 36.19 C ATOM 1684 SD MET A 112 7.387 74.998 44.919 1.00 37.32 S ATOM 1685 CE MET A 112 7.933 73.769 46.165 1.00 35.94 C ATOM 1686 HA MET A 112 4.533 71.902 43.599 1.00 0.00 H ATOM 1687 HB2 MET A 112 4.415 74.563 45.015 1.00 0.00 H ATOM 1688 HB3 MET A 112 5.200 73.084 45.617 1.00 0.00 H ATOM 1689 HG2 MET A 112 5.953 74.594 43.061 1.00 0.00 H ATOM 1690 HG3 MET A 112 6.728 73.101 43.640 1.00 0.00 H ATOM 1691 HE1 MET A 112 7.070 73.423 46.735 1.00 0.00 H ATOM 1692 HE2 MET A 112 8.399 72.923 45.659 1.00 0.00 H ATOM 1693 HE3 MET A 112 8.653 74.232 46.839 1.00 0.00 H ATOM 1694 H MET A 112 2.965 74.360 42.774 1.00 0.00 H ATOM 1695 N VAL A 113 2.613 71.179 45.097 1.00 31.48 N ATOM 1696 CA VAL A 113 1.484 70.677 45.885 1.00 30.14 C ATOM 1697 C VAL A 113 2.047 70.175 47.217 1.00 30.43 C ATOM 1698 O VAL A 113 2.828 69.214 47.262 1.00 30.66 O ATOM 1699 CB VAL A 113 0.748 69.472 45.178 1.00 27.73 C ATOM 1700 CG1 VAL A 113 -0.490 68.994 46.063 1.00 25.15 C ATOM 1701 CG2 VAL A 113 0.343 69.863 43.779 1.00 26.32 C ATOM 1702 HA VAL A 113 0.760 71.483 46.009 1.00 0.00 H ATOM 1703 HB VAL A 113 1.427 68.624 45.090 1.00 0.00 H ATOM 1704 HG11 VAL A 113 -0.133 68.673 47.041 1.00 0.00 H ATOM 1705 HG12 VAL A 113 -1.190 69.821 46.184 1.00 0.00 H ATOM 1706 HG13 VAL A 113 -0.991 68.163 45.566 1.00 0.00 H ATOM 1707 HG21 VAL A 113 -0.331 70.719 43.823 1.00 0.00 H ATOM 1708 HG22 VAL A 113 1.231 70.127 43.205 1.00 0.00 H ATOM 1709 HG23 VAL A 113 -0.164 69.025 43.301 1.00 0.00 H ATOM 1710 H VAL A 113 3.373 70.516 44.844 1.00 0.00 H ATOM 1711 N TRP A 114 1.624 70.838 48.287 1.00 31.26 N ATOM 1712 CA TRP A 114 2.006 70.554 49.666 1.00 31.41 C ATOM 1713 C TRP A 114 1.089 69.469 50.305 1.00 31.03 C ATOM 1714 O TRP A 114 -0.149 69.504 50.188 1.00 31.25 O ATOM 1715 CB TRP A 114 1.888 71.843 50.514 1.00 30.83 C ATOM 1716 CG TRP A 114 2.140 71.620 51.985 1.00 31.66 C ATOM 1717 CD1 TRP A 114 1.226 71.720 53.015 1.00 32.93 C ATOM 1718 CD2 TRP A 114 3.395 71.324 52.595 1.00 31.56 C ATOM 1719 NE1 TRP A 114 1.850 71.513 54.232 1.00 31.63 N ATOM 1720 CE2 TRP A 114 3.179 71.272 54.001 1.00 32.15 C ATOM 1721 CE3 TRP A 114 4.696 71.111 52.089 1.00 31.01 C ATOM 1722 CZ2 TRP A 114 4.219 71.015 54.914 1.00 33.23 C ATOM 1723 CZ3 TRP A 114 5.732 70.857 52.984 1.00 31.39 C ATOM 1724 CH2 TRP A 114 5.490 70.813 54.391 1.00 31.96 C ATOM 1725 HA TRP A 114 3.032 70.187 49.652 1.00 0.00 H ATOM 1726 HB2 TRP A 114 2.614 72.567 50.145 1.00 0.00 H ATOM 1727 HB3 TRP A 114 0.882 72.245 50.393 1.00 0.00 H ATOM 1728 HE1 TRP A 114 1.389 71.536 55.164 1.00 0.00 H ATOM 1729 HD1 TRP A 114 0.164 71.932 52.887 1.00 0.00 H ATOM 1730 HZ2 TRP A 114 4.035 70.976 55.988 1.00 0.00 H ATOM 1731 HH2 TRP A 114 6.321 70.617 55.069 1.00 0.00 H ATOM 1732 HZ3 TRP A 114 6.741 70.690 52.606 1.00 0.00 H ATOM 1733 HE3 TRP A 114 4.886 71.145 51.016 1.00 0.00 H ATOM 1734 H TRP A 114 0.965 71.626 48.128 1.00 0.00 H ATOM 1735 N ILE A 115 1.723 68.497 50.940 1.00 29.53 N ATOM 1736 CA ILE A 115 1.002 67.445 51.650 1.00 29.70 C ATOM 1737 C ILE A 115 1.388 67.561 53.115 1.00 29.69 C ATOM 1738 O ILE A 115 2.557 67.301 53.480 1.00 29.05 O ATOM 1739 CB ILE A 115 1.377 66.016 51.139 1.00 29.89 C ATOM 1740 CG1 ILE A 115 1.103 65.917 49.628 1.00 29.21 C ATOM 1741 CG2 ILE A 115 0.498 64.959 51.917 1.00 27.51 C ATOM 1742 CD1 ILE A 115 1.458 64.483 49.008 1.00 32.75 C ATOM 1743 HA ILE A 115 -0.068 67.572 51.487 1.00 0.00 H ATOM 1744 HB ILE A 115 2.435 65.820 51.315 1.00 0.00 H ATOM 1745 HG12 ILE A 115 0.045 66.116 49.455 1.00 0.00 H ATOM 1746 HG13 ILE A 115 1.702 66.672 49.118 1.00 0.00 H ATOM 1747 HD11 ILE A 115 2.516 64.273 49.163 1.00 0.00 H ATOM 1748 HD12 ILE A 115 0.859 63.717 49.500 1.00 0.00 H ATOM 1749 HD13 ILE A 115 1.240 64.486 47.940 1.00 0.00 H ATOM 1750 HG21 ILE A 115 0.699 65.037 52.985 1.00 0.00 H ATOM 1751 HG22 ILE A 115 -0.557 65.157 51.729 1.00 0.00 H ATOM 1752 HG23 ILE A 115 0.748 63.956 51.572 1.00 0.00 H ATOM 1753 H ILE A 115 2.763 68.482 50.933 1.00 0.00 H ATOM 1754 N TYR A 116 0.431 67.960 53.960 1.00 29.72 N ATOM 1755 CA TYR A 116 0.756 68.114 55.401 1.00 31.19 C ATOM 1756 C TYR A 116 1.078 66.826 56.163 1.00 30.20 C ATOM 1757 O TYR A 116 0.642 65.747 55.789 1.00 30.06 O ATOM 1758 CB TYR A 116 -0.355 68.890 56.144 1.00 29.05 C ATOM 1759 CG TYR A 116 -1.767 68.227 56.148 1.00 28.52 C ATOM 1760 CD1 TYR A 116 -2.020 67.043 56.860 1.00 28.64 C ATOM 1761 CD2 TYR A 116 -2.822 68.810 55.461 1.00 29.03 C ATOM 1762 CE1 TYR A 116 -3.286 66.453 56.888 1.00 28.33 C ATOM 1763 CE2 TYR A 116 -4.141 68.226 55.469 1.00 26.95 C ATOM 1764 CZ TYR A 116 -4.350 67.062 56.168 1.00 30.35 C ATOM 1765 OH TYR A 116 -5.589 66.443 56.124 1.00 31.53 O ATOM 1766 HA TYR A 116 1.687 68.681 55.390 1.00 0.00 H ATOM 1767 HB3 TYR A 116 -0.448 69.870 55.676 1.00 0.00 H ATOM 1768 HB2 TYR A 116 -0.041 69.012 57.181 1.00 0.00 H ATOM 1769 HD2 TYR A 116 -2.650 69.730 54.903 1.00 0.00 H ATOM 1770 HE2 TYR A 116 -4.960 68.701 54.928 1.00 0.00 H ATOM 1771 HE1 TYR A 116 -3.456 65.537 57.455 1.00 0.00 H ATOM 1772 HD1 TYR A 116 -1.204 66.570 57.407 1.00 0.00 H ATOM 1773 HH TYR A 116 -6.278 67.061 56.474 1.00 0.00 H ATOM 1774 H TYR A 116 -0.529 68.160 53.612 1.00 0.00 H ATOM 1775 N GLY A 117 1.888 66.977 57.213 1.00 31.34 N ATOM 1776 CA GLY A 117 2.258 65.889 58.106 1.00 30.22 C ATOM 1777 C GLY A 117 1.289 65.912 59.302 1.00 31.25 C ATOM 1778 O GLY A 117 0.227 66.623 59.293 1.00 31.80 O ATOM 1779 HA3 GLY A 117 3.281 66.027 58.455 1.00 0.00 H ATOM 1780 HA2 GLY A 117 2.179 64.936 57.583 1.00 0.00 H ATOM 1781 H GLY A 117 2.276 67.923 57.403 1.00 0.00 H ATOM 1782 N GLY A 118 1.645 65.157 60.339 1.00 31.22 N ATOM 1783 CA GLY A 118 0.823 65.029 61.537 1.00 29.18 C ATOM 1784 C GLY A 118 0.755 63.546 61.981 1.00 31.34 C ATOM 1785 O GLY A 118 -0.247 63.102 62.548 1.00 31.08 O ATOM 1786 HA3 GLY A 118 -0.184 65.388 61.324 1.00 0.00 H ATOM 1787 HA2 GLY A 118 1.258 65.626 62.339 1.00 0.00 H ATOM 1788 H GLY A 118 2.545 64.638 60.293 1.00 0.00 H ATOM 1789 N GLY A 119 1.829 62.777 61.737 1.00 32.17 N ATOM 1790 CA GLY A 119 1.851 61.374 62.153 1.00 31.43 C ATOM 1791 C GLY A 119 0.712 60.486 61.620 1.00 31.74 C ATOM 1792 O GLY A 119 0.444 59.404 62.171 1.00 29.38 O ATOM 1793 HA3 GLY A 119 1.810 61.350 63.242 1.00 0.00 H ATOM 1794 HA2 GLY A 119 2.794 60.943 61.817 1.00 0.00 H ATOM 1795 H GLY A 119 2.652 63.182 61.248 1.00 0.00 H ATOM 1796 N PHE A 120 0.100 60.925 60.515 1.00 30.29 N ATOM 1797 CA PHE A 120 -1.037 60.259 59.881 1.00 30.97 C ATOM 1798 C PHE A 120 -2.278 60.285 60.766 1.00 31.33 C ATOM 1799 O PHE A 120 -3.346 59.724 60.382 1.00 32.11 O ATOM 1800 CB PHE A 120 -0.730 58.801 59.432 1.00 28.37 C ATOM 1801 CG PHE A 120 0.229 58.716 58.292 1.00 29.91 C ATOM 1802 CD1 PHE A 120 -0.161 59.053 56.999 1.00 29.13 C ATOM 1803 CD2 PHE A 120 1.559 58.286 58.503 1.00 29.20 C ATOM 1804 CE1 PHE A 120 0.757 58.961 55.920 1.00 30.88 C ATOM 1805 CE2 PHE A 120 2.479 58.184 57.445 1.00 29.47 C ATOM 1806 CZ PHE A 120 2.080 58.521 56.145 1.00 30.77 C ATOM 1807 HA PHE A 120 -1.237 60.837 58.979 1.00 0.00 H ATOM 1808 HB2 PHE A 120 -0.307 58.261 60.279 1.00 0.00 H ATOM 1809 HB3 PHE A 120 -1.665 58.328 59.132 1.00 0.00 H ATOM 1810 HD2 PHE A 120 1.879 58.027 59.512 1.00 0.00 H ATOM 1811 HE2 PHE A 120 3.497 57.845 57.635 1.00 0.00 H ATOM 1812 HZ PHE A 120 2.783 58.444 55.316 1.00 0.00 H ATOM 1813 HE1 PHE A 120 0.439 59.231 54.913 1.00 0.00 H ATOM 1814 HD1 PHE A 120 -1.181 59.391 56.813 1.00 0.00 H ATOM 1815 H PHE A 120 0.457 61.798 60.077 1.00 0.00 H ATOM 1816 N TYR A 121 -2.193 60.950 61.918 1.00 31.24 N ATOM 1817 CA TYR A 121 -3.386 61.021 62.781 1.00 31.37 C ATOM 1818 C TYR A 121 -3.904 62.437 62.962 1.00 33.06 C ATOM 1819 O TYR A 121 -4.948 62.623 63.612 1.00 33.77 O ATOM 1820 CB TYR A 121 -3.126 60.440 64.190 1.00 32.03 C ATOM 1821 CG TYR A 121 -2.196 61.259 65.085 1.00 30.96 C ATOM 1822 CD1 TYR A 121 -2.687 62.286 65.900 1.00 32.24 C ATOM 1823 CD2 TYR A 121 -0.838 60.960 65.151 1.00 32.65 C ATOM 1824 CE1 TYR A 121 -1.835 63.000 66.768 1.00 32.99 C ATOM 1825 CE2 TYR A 121 0.010 61.626 66.018 1.00 32.48 C ATOM 1826 CZ TYR A 121 -0.495 62.644 66.830 1.00 32.39 C ATOM 1827 OH TYR A 121 0.338 63.226 67.751 1.00 35.25 O ATOM 1828 HA TYR A 121 -4.133 60.424 62.258 1.00 0.00 H ATOM 1829 HB3 TYR A 121 -2.687 59.450 64.068 1.00 0.00 H ATOM 1830 HB2 TYR A 121 -4.086 60.350 64.698 1.00 0.00 H ATOM 1831 HD2 TYR A 121 -0.433 60.182 64.504 1.00 0.00 H ATOM 1832 HE2 TYR A 121 1.065 61.358 66.067 1.00 0.00 H ATOM 1833 HE1 TYR A 121 -2.222 63.816 67.379 1.00 0.00 H ATOM 1834 HD1 TYR A 121 -3.747 62.538 65.863 1.00 0.00 H ATOM 1835 HH TYR A 121 -0.158 63.925 68.247 1.00 0.00 H ATOM 1836 H TYR A 121 -1.304 61.409 62.202 1.00 0.00 H ATOM 1837 N SER A 122 -3.185 63.429 62.419 1.00 30.99 N ATOM 1838 CA SER A 122 -3.604 64.799 62.584 1.00 32.51 C ATOM 1839 C SER A 122 -3.069 65.591 61.421 1.00 32.91 C ATOM 1840 O SER A 122 -2.404 65.013 60.550 1.00 32.49 O ATOM 1841 CB SER A 122 -3.071 65.360 63.919 1.00 31.16 C ATOM 1842 OG SER A 122 -1.649 65.383 63.959 1.00 33.81 O ATOM 1843 HA SER A 122 -4.692 64.865 62.608 1.00 0.00 H ATOM 1844 HB2 SER A 122 -3.436 64.735 64.734 1.00 0.00 H ATOM 1845 HB3 SER A 122 -3.443 66.376 64.047 1.00 0.00 H ATOM 1846 HG SER A 122 -1.302 64.462 63.850 1.00 0.00 H ATOM 1847 H SER A 122 -2.324 63.211 61.878 1.00 0.00 H ATOM 1848 N GLY A 123 -3.343 66.902 61.408 1.00 31.72 N ATOM 1849 CA GLY A 123 -2.875 67.733 60.324 1.00 31.58 C ATOM 1850 C GLY A 123 -4.019 68.504 59.639 1.00 32.82 C ATOM 1851 O GLY A 123 -5.171 68.056 59.603 1.00 32.77 O ATOM 1852 HA3 GLY A 123 -2.386 67.100 59.583 1.00 0.00 H ATOM 1853 HA2 GLY A 123 -2.156 68.451 60.718 1.00 0.00 H ATOM 1854 H GLY A 123 -3.895 67.323 62.182 1.00 0.00 H ATOM 1855 N SER A 124 -3.677 69.655 59.089 1.00 32.43 N ATOM 1856 CA SER A 124 -4.646 70.539 58.432 1.00 33.90 C ATOM 1857 C SER A 124 -3.926 71.289 57.334 1.00 33.68 C ATOM 1858 O SER A 124 -2.734 71.605 57.446 1.00 33.89 O ATOM 1859 CB SER A 124 -5.203 71.570 59.438 1.00 32.90 C ATOM 1860 OG SER A 124 -5.938 70.948 60.493 1.00 35.49 O ATOM 1861 HA SER A 124 -5.469 69.944 58.036 1.00 0.00 H ATOM 1862 HB2 SER A 124 -5.862 72.258 58.908 1.00 0.00 H ATOM 1863 HB3 SER A 124 -4.371 72.126 59.869 1.00 0.00 H ATOM 1864 HG SER A 124 -5.345 70.326 60.984 1.00 0.00 H ATOM 1865 H SER A 124 -2.679 69.947 59.123 1.00 0.00 H ATOM 1866 N SER A 125 -4.635 71.582 56.264 1.00 33.92 N ATOM 1867 CA SER A 125 -4.016 72.303 55.177 1.00 35.07 C ATOM 1868 C SER A 125 -4.060 73.824 55.419 1.00 36.07 C ATOM 1869 O SER A 125 -3.422 74.586 54.673 1.00 37.05 O ATOM 1870 CB SER A 125 -4.770 72.025 53.886 1.00 35.84 C ATOM 1871 OG SER A 125 -6.092 72.568 53.906 1.00 36.43 O ATOM 1872 HA SER A 125 -2.980 71.971 55.111 1.00 0.00 H ATOM 1873 HB2 SER A 125 -4.835 70.946 53.742 1.00 0.00 H ATOM 1874 HB3 SER A 125 -4.220 72.468 53.056 1.00 0.00 H ATOM 1875 HG SER A 125 -6.544 72.364 53.049 1.00 0.00 H ATOM 1876 H SER A 125 -5.633 71.296 56.202 1.00 0.00 H ATOM 1877 N THR A 126 -4.782 74.219 56.471 1.00 35.73 N ATOM 1878 CA THR A 126 -5.100 75.622 56.792 1.00 37.04 C ATOM 1879 C THR A 126 -4.287 76.353 57.835 1.00 37.14 C ATOM 1880 O THR A 126 -4.552 77.514 58.127 1.00 37.57 O ATOM 1881 CB THR A 126 -6.585 75.685 57.184 1.00 35.95 C ATOM 1882 OG1 THR A 126 -6.803 74.923 58.394 1.00 35.79 O ATOM 1883 CG2 THR A 126 -7.429 75.072 56.053 1.00 34.65 C ATOM 1884 HA THR A 126 -4.834 76.157 55.880 1.00 0.00 H ATOM 1885 HB THR A 126 -6.872 76.724 57.349 1.00 0.00 H ATOM 1886 HG1 THR A 126 -6.254 75.302 59.125 1.00 0.00 H ATOM 1887 HG23 THR A 126 -7.272 75.639 55.136 1.00 0.00 H ATOM 1888 HG21 THR A 126 -7.128 74.036 55.897 1.00 0.00 H ATOM 1889 HG22 THR A 126 -8.483 75.108 56.328 1.00 0.00 H ATOM 1890 H THR A 126 -5.146 73.483 57.110 1.00 0.00 H ATOM 1891 N LEU A 127 -3.294 75.671 58.389 1.00 37.30 N ATOM 1892 CA LEU A 127 -2.412 76.236 59.399 1.00 38.80 C ATOM 1893 C LEU A 127 -1.659 77.473 58.900 1.00 39.04 C ATOM 1894 O LEU A 127 -1.228 77.531 57.726 1.00 37.24 O ATOM 1895 CB LEU A 127 -1.366 75.183 59.827 1.00 37.07 C ATOM 1896 CG LEU A 127 -1.921 73.834 60.330 1.00 37.90 C ATOM 1897 CD1 LEU A 127 -0.731 72.929 60.687 1.00 35.98 C ATOM 1898 CD2 LEU A 127 -2.862 74.026 61.528 1.00 35.05 C ATOM 1899 HA LEU A 127 -3.045 76.531 60.235 1.00 0.00 H ATOM 1900 HB2 LEU A 127 -0.728 74.980 58.967 1.00 0.00 H ATOM 1901 HB3 LEU A 127 -0.767 75.616 60.628 1.00 0.00 H ATOM 1902 HG LEU A 127 -2.516 73.365 59.546 1.00 0.00 H ATOM 1903 HD21 LEU A 127 -2.317 74.502 62.343 1.00 0.00 H ATOM 1904 HD22 LEU A 127 -3.700 74.657 61.232 1.00 0.00 H ATOM 1905 HD23 LEU A 127 -3.234 73.055 61.856 1.00 0.00 H ATOM 1906 HD11 LEU A 127 -0.115 72.775 59.801 1.00 0.00 H ATOM 1907 HD12 LEU A 127 -0.136 73.404 61.467 1.00 0.00 H ATOM 1908 HD13 LEU A 127 -1.101 71.969 61.045 1.00 0.00 H ATOM 1909 H LEU A 127 -3.138 74.688 58.088 1.00 0.00 H ATOM 1910 N ASP A 128 -1.440 78.428 59.802 1.00 39.10 N ATOM 1911 CA ASP A 128 -0.706 79.631 59.423 1.00 38.69 C ATOM 1912 C ASP A 128 0.670 79.284 58.856 1.00 36.87 C ATOM 1913 O ASP A 128 1.128 79.966 57.943 1.00 35.82 O ATOM 1914 CB ASP A 128 -0.519 80.588 60.620 1.00 41.66 C ATOM 1915 CG ASP A 128 -1.846 81.151 61.177 1.00 45.11 C ATOM 1916 OD1 ASP A 128 -2.847 81.314 60.435 1.00 47.07 O ATOM 1917 OD2 ASP A 128 -1.867 81.443 62.397 1.00 49.28 O ATOM 1918 HA ASP A 128 -1.303 80.128 58.658 1.00 0.00 H ATOM 1919 HB2 ASP A 128 -0.012 80.046 61.419 1.00 0.00 H ATOM 1920 HB3 ASP A 128 0.102 81.424 60.299 1.00 0.00 H ATOM 1921 H ASP A 128 -1.791 78.317 60.774 1.00 0.00 H ATOM 1922 N VAL A 129 1.351 78.252 59.386 1.00 37.03 N ATOM 1923 CA VAL A 129 2.668 77.914 58.838 1.00 36.02 C ATOM 1924 C VAL A 129 2.604 77.336 57.442 1.00 36.23 C ATOM 1925 O VAL A 129 3.671 77.113 56.856 1.00 35.25 O ATOM 1926 CB VAL A 129 3.484 76.791 59.574 1.00 35.82 C ATOM 1927 CG1 VAL A 129 4.483 77.363 60.412 1.00 36.31 C ATOM 1928 CG2 VAL A 129 2.575 75.804 60.217 1.00 36.16 C ATOM 1929 HA VAL A 129 3.143 78.891 58.929 1.00 0.00 H ATOM 1930 HB VAL A 129 4.045 76.198 58.851 1.00 0.00 H ATOM 1931 HG11 VAL A 129 5.167 77.957 59.806 1.00 0.00 H ATOM 1932 HG12 VAL A 129 4.008 78.001 61.158 1.00 0.00 H ATOM 1933 HG13 VAL A 129 5.036 76.567 60.912 1.00 0.00 H ATOM 1934 HG21 VAL A 129 1.945 76.313 60.946 1.00 0.00 H ATOM 1935 HG22 VAL A 129 1.949 75.339 59.456 1.00 0.00 H ATOM 1936 HG23 VAL A 129 3.168 75.039 60.718 1.00 0.00 H ATOM 1937 H VAL A 129 0.949 77.702 60.172 1.00 0.00 H ATOM 1938 N TYR A 130 1.407 77.009 56.936 1.00 35.85 N ATOM 1939 CA TYR A 130 1.331 76.457 55.566 1.00 36.99 C ATOM 1940 C TYR A 130 0.717 77.487 54.595 1.00 38.11 C ATOM 1941 O TYR A 130 0.328 77.140 53.475 1.00 38.25 O ATOM 1942 CB TYR A 130 0.471 75.153 55.508 1.00 33.94 C ATOM 1943 CG TYR A 130 0.899 74.012 56.413 1.00 32.75 C ATOM 1944 CD1 TYR A 130 2.255 73.791 56.734 1.00 33.09 C ATOM 1945 CD2 TYR A 130 -0.063 73.111 56.921 1.00 32.47 C ATOM 1946 CE1 TYR A 130 2.648 72.691 57.565 1.00 32.31 C ATOM 1947 CE2 TYR A 130 0.305 72.026 57.717 1.00 30.52 C ATOM 1948 CZ TYR A 130 1.663 71.820 58.044 1.00 31.73 C ATOM 1949 OH TYR A 130 2.006 70.757 58.863 1.00 31.45 O ATOM 1950 HA TYR A 130 2.353 76.222 55.270 1.00 0.00 H ATOM 1951 HB3 TYR A 130 0.495 74.787 54.482 1.00 0.00 H ATOM 1952 HB2 TYR A 130 -0.552 75.420 55.774 1.00 0.00 H ATOM 1953 HD2 TYR A 130 -1.116 73.267 56.686 1.00 0.00 H ATOM 1954 HE2 TYR A 130 -0.455 71.338 58.086 1.00 0.00 H ATOM 1955 HE1 TYR A 130 3.696 72.536 57.819 1.00 0.00 H ATOM 1956 HD1 TYR A 130 3.016 74.467 56.344 1.00 0.00 H ATOM 1957 HH TYR A 130 1.722 69.909 58.438 1.00 0.00 H ATOM 1958 H TYR A 130 0.543 77.142 57.499 1.00 0.00 H ATOM 1959 N ASN A 131 0.602 78.737 55.026 1.00 39.97 N ATOM 1960 CA ASN A 131 0.008 79.774 54.159 1.00 40.72 C ATOM 1961 C ASN A 131 0.853 79.876 52.894 1.00 40.50 C ATOM 1962 O ASN A 131 1.990 80.340 52.931 1.00 40.41 O ATOM 1963 CB ASN A 131 -0.042 81.115 54.908 1.00 40.64 C ATOM 1964 CG ASN A 131 -0.933 82.181 54.200 1.00 42.83 C ATOM 1965 OD1 ASN A 131 -1.110 82.172 52.980 1.00 41.90 O ATOM 1966 ND2 ASN A 131 -1.463 83.122 54.994 1.00 43.57 N ATOM 1967 HA ASN A 131 -1.015 79.512 53.888 1.00 0.00 H ATOM 1968 HB2 ASN A 131 -0.440 80.939 55.908 1.00 0.00 H ATOM 1969 HB3 ASN A 131 0.972 81.507 54.986 1.00 0.00 H ATOM 1970 HD22 ASN A 131 -1.290 83.095 56.019 1.00 0.00 H ATOM 1971 HD21 ASN A 131 -2.047 83.879 54.585 1.00 0.00 H ATOM 1972 H ASN A 131 0.932 78.987 55.980 1.00 0.00 H ATOM 1973 N GLY A 132 0.292 79.462 51.753 1.00 40.91 N ATOM 1974 CA GLY A 132 1.090 79.474 50.529 1.00 38.99 C ATOM 1975 C GLY A 132 1.302 80.790 49.786 1.00 40.01 C ATOM 1976 O GLY A 132 2.060 80.849 48.794 1.00 37.42 O ATOM 1977 HA3 GLY A 132 0.611 78.788 49.830 1.00 0.00 H ATOM 1978 HA2 GLY A 132 2.078 79.094 50.790 1.00 0.00 H ATOM 1979 H GLY A 132 -0.696 79.137 51.737 1.00 0.00 H ATOM 1980 N LYS A 133 0.666 81.859 50.274 1.00 41.12 N ATOM 1981 CA LYS A 133 0.778 83.124 49.554 1.00 41.52 C ATOM 1982 C LYS A 133 2.221 83.615 49.392 1.00 40.97 C ATOM 1983 O LYS A 133 2.565 84.097 48.317 1.00 38.86 O ATOM 1984 CB LYS A 133 -0.119 84.190 50.203 1.00 41.56 C ATOM 1985 CG LYS A 133 0.466 84.837 51.455 1.00 42.85 C ATOM 1986 CD LYS A 133 -0.643 85.517 52.216 1.00 43.68 C ATOM 1987 CE LYS A 133 -0.086 86.649 53.088 1.00 45.09 C ATOM 1988 NZ LYS A 133 -1.207 87.332 53.755 1.00 44.12 N ATOM 1989 HA LYS A 133 0.426 82.939 48.539 1.00 0.00 H ATOM 1990 HB2 LYS A 133 -0.301 84.974 49.468 1.00 0.00 H ATOM 1991 HB3 LYS A 133 -1.065 83.720 50.473 1.00 0.00 H ATOM 1992 HG2 LYS A 133 0.925 84.073 52.082 1.00 0.00 H ATOM 1993 HG3 LYS A 133 1.219 85.572 51.170 1.00 0.00 H ATOM 1994 HD2 LYS A 133 -1.362 85.930 51.509 1.00 0.00 H ATOM 1995 HD3 LYS A 133 -1.141 84.786 52.853 1.00 0.00 H ATOM 1996 HE2 LYS A 133 0.457 87.359 52.464 1.00 0.00 H ATOM 1997 HE3 LYS A 133 0.589 86.236 53.837 1.00 0.00 H ATOM 1998 HZ1 LYS A 133 -1.849 87.724 53.037 1.00 0.00 H ATOM 1999 HZ2 LYS A 133 -1.722 86.651 54.348 1.00 0.00 H ATOM 2000 HZ3 LYS A 133 -0.838 88.102 54.349 1.00 0.00 H ATOM 2001 H LYS A 133 0.104 81.791 51.147 1.00 0.00 H ATOM 2002 N TYR A 134 3.070 83.455 50.413 1.00 40.37 N ATOM 2003 CA TYR A 134 4.461 83.938 50.302 1.00 41.80 C ATOM 2004 C TYR A 134 5.293 83.229 49.263 1.00 42.63 C ATOM 2005 O TYR A 134 6.064 83.862 48.525 1.00 44.13 O ATOM 2006 CB TYR A 134 5.201 83.844 51.645 1.00 42.50 C ATOM 2007 CG TYR A 134 4.425 84.467 52.767 1.00 43.77 C ATOM 2008 CD1 TYR A 134 3.805 83.673 53.717 1.00 43.80 C ATOM 2009 CD2 TYR A 134 4.241 85.858 52.828 1.00 44.94 C ATOM 2010 CE1 TYR A 134 3.013 84.221 54.705 1.00 44.52 C ATOM 2011 CE2 TYR A 134 3.436 86.440 53.824 1.00 45.16 C ATOM 2012 CZ TYR A 134 2.829 85.602 54.755 1.00 46.86 C ATOM 2013 OH TYR A 134 2.030 86.121 55.741 1.00 48.87 O ATOM 2014 HA TYR A 134 4.351 84.976 49.987 1.00 0.00 H ATOM 2015 HB3 TYR A 134 6.159 84.356 51.554 1.00 0.00 H ATOM 2016 HB2 TYR A 134 5.373 82.793 51.878 1.00 0.00 H ATOM 2017 HD2 TYR A 134 4.730 86.497 52.092 1.00 0.00 H ATOM 2018 HE2 TYR A 134 3.291 87.520 53.866 1.00 0.00 H ATOM 2019 HE1 TYR A 134 2.534 83.577 55.443 1.00 0.00 H ATOM 2020 HD1 TYR A 134 3.946 82.593 53.684 1.00 0.00 H ATOM 2021 HH TYR A 134 1.686 85.385 56.307 1.00 0.00 H ATOM 2022 H TYR A 134 2.750 82.990 51.286 1.00 0.00 H ATOM 2023 N LEU A 135 5.176 81.906 49.216 1.00 42.22 N ATOM 2024 CA LEU A 135 5.945 81.140 48.259 1.00 41.28 C ATOM 2025 C LEU A 135 5.388 81.375 46.854 1.00 41.69 C ATOM 2026 O LEU A 135 6.142 81.619 45.898 1.00 41.62 O ATOM 2027 CB LEU A 135 5.876 79.666 48.645 1.00 43.09 C ATOM 2028 CG LEU A 135 6.735 78.594 48.007 1.00 44.40 C ATOM 2029 CD1 LEU A 135 8.215 78.988 47.991 1.00 43.25 C ATOM 2030 CD2 LEU A 135 6.503 77.299 48.843 1.00 44.51 C ATOM 2031 HA LEU A 135 6.989 81.454 48.264 1.00 0.00 H ATOM 2032 HB2 LEU A 135 6.094 79.627 49.712 1.00 0.00 H ATOM 2033 HB3 LEU A 135 4.843 79.361 48.475 1.00 0.00 H ATOM 2034 HG LEU A 135 6.459 78.446 46.963 1.00 0.00 H ATOM 2035 HD21 LEU A 135 6.800 77.477 49.877 1.00 0.00 H ATOM 2036 HD22 LEU A 135 5.447 77.030 48.808 1.00 0.00 H ATOM 2037 HD23 LEU A 135 7.100 76.488 48.427 1.00 0.00 H ATOM 2038 HD11 LEU A 135 8.338 79.910 47.423 1.00 0.00 H ATOM 2039 HD12 LEU A 135 8.560 79.141 49.014 1.00 0.00 H ATOM 2040 HD13 LEU A 135 8.796 78.192 47.525 1.00 0.00 H ATOM 2041 H LEU A 135 4.529 81.419 49.869 1.00 0.00 H ATOM 2042 N ALA A 136 4.068 81.339 46.719 1.00 41.15 N ATOM 2043 CA ALA A 136 3.470 81.553 45.404 1.00 41.95 C ATOM 2044 C ALA A 136 3.912 82.928 44.879 1.00 42.54 C ATOM 2045 O ALA A 136 4.368 83.101 43.731 1.00 41.86 O ATOM 2046 CB ALA A 136 1.936 81.486 45.518 1.00 38.97 C ATOM 2047 HA ALA A 136 3.798 80.780 44.710 1.00 0.00 H ATOM 2048 HB1 ALA A 136 1.643 80.506 45.895 1.00 0.00 H ATOM 2049 HB2 ALA A 136 1.590 82.259 46.204 1.00 0.00 H ATOM 2050 HB3 ALA A 136 1.493 81.646 44.535 1.00 0.00 H ATOM 2051 H ALA A 136 3.463 81.159 47.545 1.00 0.00 H ATOM 2052 N TYR A 137 3.801 83.902 45.767 1.00 43.61 N ATOM 2053 CA TYR A 137 4.133 85.248 45.416 1.00 44.27 C ATOM 2054 C TYR A 137 5.589 85.405 45.104 1.00 44.42 C ATOM 2055 O TYR A 137 5.950 85.843 44.014 1.00 44.09 O ATOM 2056 CB TYR A 137 3.737 86.193 46.545 1.00 45.17 C ATOM 2057 CG TYR A 137 4.183 87.603 46.285 1.00 48.03 C ATOM 2058 CD1 TYR A 137 5.287 88.148 46.952 1.00 48.51 C ATOM 2059 CD2 TYR A 137 3.508 88.393 45.347 1.00 49.13 C ATOM 2060 CE1 TYR A 137 5.714 89.457 46.694 1.00 50.40 C ATOM 2061 CE2 TYR A 137 3.915 89.699 45.074 1.00 50.09 C ATOM 2062 CZ TYR A 137 5.009 90.224 45.743 1.00 51.15 C ATOM 2063 OH TYR A 137 5.390 91.502 45.443 1.00 52.72 O ATOM 2064 HA TYR A 137 3.575 85.499 44.514 1.00 0.00 H ATOM 2065 HB3 TYR A 137 4.194 85.845 47.471 1.00 0.00 H ATOM 2066 HB2 TYR A 137 2.652 86.181 46.649 1.00 0.00 H ATOM 2067 HD2 TYR A 137 2.648 87.980 44.820 1.00 0.00 H ATOM 2068 HE2 TYR A 137 3.377 90.301 44.341 1.00 0.00 H ATOM 2069 HE1 TYR A 137 6.574 89.875 47.218 1.00 0.00 H ATOM 2070 HD1 TYR A 137 5.823 87.544 47.684 1.00 0.00 H ATOM 2071 HH TYR A 137 6.178 91.747 45.990 1.00 0.00 H ATOM 2072 H TYR A 137 3.469 83.687 46.729 1.00 0.00 H ATOM 2073 N THR A 138 6.443 84.997 46.036 1.00 44.79 N ATOM 2074 CA THR A 138 7.877 85.203 45.854 1.00 44.07 C ATOM 2075 C THR A 138 8.493 84.458 44.711 1.00 43.97 C ATOM 2076 O THR A 138 9.319 85.019 43.999 1.00 43.83 O ATOM 2077 CB THR A 138 8.657 84.893 47.137 1.00 43.55 C ATOM 2078 OG1 THR A 138 8.132 85.678 48.210 1.00 42.52 O ATOM 2079 CG2 THR A 138 10.062 85.275 46.985 1.00 44.57 C ATOM 2080 HA THR A 138 7.955 86.261 45.605 1.00 0.00 H ATOM 2081 HB THR A 138 8.569 83.825 47.337 1.00 0.00 H ATOM 2082 HG1 THR A 138 7.176 85.458 48.341 1.00 0.00 H ATOM 2083 HG23 THR A 138 10.508 84.700 46.174 1.00 0.00 H ATOM 2084 HG21 THR A 138 10.125 86.339 46.755 1.00 0.00 H ATOM 2085 HG22 THR A 138 10.595 85.070 47.913 1.00 0.00 H ATOM 2086 H THR A 138 6.090 84.531 46.896 1.00 0.00 H ATOM 2087 N GLU A 139 8.075 83.213 44.485 1.00 43.67 N ATOM 2088 CA GLU A 139 8.705 82.438 43.423 1.00 42.90 C ATOM 2089 C GLU A 139 7.908 82.278 42.151 1.00 42.99 C ATOM 2090 O GLU A 139 8.348 81.591 41.228 1.00 41.68 O ATOM 2091 CB GLU A 139 9.117 81.065 43.971 1.00 43.86 C ATOM 2092 CG GLU A 139 10.158 81.146 45.093 1.00 40.90 C ATOM 2093 CD GLU A 139 11.485 81.615 44.571 1.00 40.07 C ATOM 2094 OE1 GLU A 139 11.847 81.225 43.451 1.00 39.85 O ATOM 2095 OE2 GLU A 139 12.179 82.364 45.273 1.00 42.16 O ATOM 2096 HA GLU A 139 9.571 83.025 43.119 1.00 0.00 H ATOM 2097 HB2 GLU A 139 8.229 80.566 44.359 1.00 0.00 H ATOM 2098 HB3 GLU A 139 9.534 80.477 43.153 1.00 0.00 H ATOM 2099 HG2 GLU A 139 9.808 81.844 45.853 1.00 0.00 H ATOM 2100 HG3 GLU A 139 10.280 80.158 45.537 1.00 0.00 H ATOM 2101 H GLU A 139 7.311 82.801 45.058 1.00 0.00 H ATOM 2102 N GLU A 140 6.734 82.905 42.120 1.00 43.36 N ATOM 2103 CA GLU A 140 5.866 82.856 40.973 1.00 45.15 C ATOM 2104 C GLU A 140 5.448 81.453 40.604 1.00 43.14 C ATOM 2105 O GLU A 140 5.537 81.040 39.466 1.00 42.96 O ATOM 2106 CB GLU A 140 6.543 83.582 39.804 1.00 49.87 C ATOM 2107 CG GLU A 140 6.854 85.047 40.209 1.00 58.35 C ATOM 2108 CD GLU A 140 7.518 85.896 39.121 1.00 63.30 C ATOM 2109 OE1 GLU A 140 8.747 85.704 38.834 1.00 65.33 O ATOM 2110 OE2 GLU A 140 6.790 86.761 38.563 1.00 65.65 O ATOM 2111 HA GLU A 140 4.937 83.367 41.227 1.00 0.00 H ATOM 2112 HB2 GLU A 140 7.471 83.071 39.549 1.00 0.00 H ATOM 2113 HB3 GLU A 140 5.878 83.578 38.940 1.00 0.00 H ATOM 2114 HG2 GLU A 140 5.916 85.527 40.486 1.00 0.00 H ATOM 2115 HG3 GLU A 140 7.519 85.025 41.073 1.00 0.00 H ATOM 2116 H GLU A 140 6.434 83.449 42.954 1.00 0.00 H ATOM 2117 N VAL A 141 4.964 80.712 41.591 1.00 42.52 N ATOM 2118 CA VAL A 141 4.513 79.361 41.325 1.00 40.39 C ATOM 2119 C VAL A 141 3.055 79.294 41.713 1.00 39.36 C ATOM 2120 O VAL A 141 2.586 80.112 42.513 1.00 37.67 O ATOM 2121 CB VAL A 141 5.288 78.281 42.198 1.00 40.02 C ATOM 2122 CG1 VAL A 141 6.793 78.319 41.932 1.00 39.91 C ATOM 2123 CG2 VAL A 141 5.015 78.500 43.636 1.00 38.94 C ATOM 2124 HA VAL A 141 4.690 79.139 40.273 1.00 0.00 H ATOM 2125 HB VAL A 141 4.926 77.294 41.910 1.00 0.00 H ATOM 2126 HG11 VAL A 141 6.980 78.110 40.879 1.00 0.00 H ATOM 2127 HG12 VAL A 141 7.180 79.307 42.182 1.00 0.00 H ATOM 2128 HG13 VAL A 141 7.288 77.567 42.546 1.00 0.00 H ATOM 2129 HG21 VAL A 141 5.349 79.498 43.920 1.00 0.00 H ATOM 2130 HG22 VAL A 141 3.944 78.408 43.819 1.00 0.00 H ATOM 2131 HG23 VAL A 141 5.551 77.755 44.224 1.00 0.00 H ATOM 2132 H VAL A 141 4.908 81.100 42.554 1.00 0.00 H ATOM 2133 N VAL A 142 2.346 78.320 41.137 1.00 38.91 N ATOM 2134 CA VAL A 142 0.968 78.069 41.527 1.00 38.94 C ATOM 2135 C VAL A 142 1.141 77.061 42.692 1.00 39.38 C ATOM 2136 O VAL A 142 1.654 75.954 42.493 1.00 39.67 O ATOM 2137 CB VAL A 142 0.145 77.456 40.370 1.00 37.96 C ATOM 2138 CG1 VAL A 142 -1.125 76.841 40.875 1.00 35.75 C ATOM 2139 CG2 VAL A 142 -0.198 78.557 39.364 1.00 38.00 C ATOM 2140 HA VAL A 142 0.423 78.972 41.801 1.00 0.00 H ATOM 2141 HB VAL A 142 0.741 76.676 39.897 1.00 0.00 H ATOM 2142 HG11 VAL A 142 -0.887 76.053 41.589 1.00 0.00 H ATOM 2143 HG12 VAL A 142 -1.728 77.606 41.364 1.00 0.00 H ATOM 2144 HG13 VAL A 142 -1.681 76.419 40.038 1.00 0.00 H ATOM 2145 HG21 VAL A 142 -0.782 79.332 39.861 1.00 0.00 H ATOM 2146 HG22 VAL A 142 0.723 78.989 38.972 1.00 0.00 H ATOM 2147 HG23 VAL A 142 -0.778 78.131 38.545 1.00 0.00 H ATOM 2148 H VAL A 142 2.785 77.733 40.399 1.00 0.00 H ATOM 2149 N LEU A 143 0.737 77.458 43.902 1.00 38.55 N ATOM 2150 CA LEU A 143 0.902 76.600 45.069 1.00 37.69 C ATOM 2151 C LEU A 143 -0.397 75.948 45.516 1.00 36.94 C ATOM 2152 O LEU A 143 -1.411 76.617 45.755 1.00 37.74 O ATOM 2153 CB LEU A 143 1.498 77.402 46.218 1.00 40.41 C ATOM 2154 CG LEU A 143 2.089 76.619 47.393 1.00 42.73 C ATOM 2155 CD1 LEU A 143 2.943 77.555 48.228 1.00 46.60 C ATOM 2156 CD2 LEU A 143 0.997 76.115 48.275 1.00 42.15 C ATOM 2157 HA LEU A 143 1.577 75.795 44.778 1.00 0.00 H ATOM 2158 HB2 LEU A 143 2.293 78.023 45.806 1.00 0.00 H ATOM 2159 HB3 LEU A 143 0.709 78.041 46.615 1.00 0.00 H ATOM 2160 HG LEU A 143 2.673 75.787 46.999 1.00 0.00 H ATOM 2161 HD21 LEU A 143 0.423 76.959 48.659 1.00 0.00 H ATOM 2162 HD22 LEU A 143 0.342 75.460 47.701 1.00 0.00 H ATOM 2163 HD23 LEU A 143 1.431 75.560 49.107 1.00 0.00 H ATOM 2164 HD11 LEU A 143 3.747 77.958 47.612 1.00 0.00 H ATOM 2165 HD12 LEU A 143 2.326 78.372 48.602 1.00 0.00 H ATOM 2166 HD13 LEU A 143 3.368 77.005 49.068 1.00 0.00 H ATOM 2167 H LEU A 143 0.298 78.394 44.013 1.00 0.00 H ATOM 2168 N VAL A 144 -0.372 74.625 45.624 1.00 35.07 N ATOM 2169 CA VAL A 144 -1.551 73.892 46.051 1.00 33.42 C ATOM 2170 C VAL A 144 -1.287 73.179 47.384 1.00 34.15 C ATOM 2171 O VAL A 144 -0.181 72.619 47.606 1.00 33.78 O ATOM 2172 CB VAL A 144 -1.975 72.786 44.966 1.00 33.33 C ATOM 2173 CG1 VAL A 144 -3.137 71.946 45.475 1.00 32.46 C ATOM 2174 CG2 VAL A 144 -2.323 73.451 43.588 1.00 33.14 C ATOM 2175 HA VAL A 144 -2.356 74.618 46.164 1.00 0.00 H ATOM 2176 HB VAL A 144 -1.123 72.124 44.810 1.00 0.00 H ATOM 2177 HG11 VAL A 144 -2.843 71.441 46.395 1.00 0.00 H ATOM 2178 HG12 VAL A 144 -3.992 72.592 45.671 1.00 0.00 H ATOM 2179 HG13 VAL A 144 -3.405 71.205 44.722 1.00 0.00 H ATOM 2180 HG21 VAL A 144 -3.152 74.146 43.721 1.00 0.00 H ATOM 2181 HG22 VAL A 144 -1.452 73.990 43.216 1.00 0.00 H ATOM 2182 HG23 VAL A 144 -2.606 72.678 42.874 1.00 0.00 H ATOM 2183 H VAL A 144 0.502 74.107 45.400 1.00 0.00 H ATOM 2184 N SER A 145 -2.278 73.222 48.283 1.00 33.13 N ATOM 2185 CA SER A 145 -2.181 72.396 49.483 1.00 33.61 C ATOM 2186 C SER A 145 -3.445 71.531 49.440 1.00 34.79 C ATOM 2187 O SER A 145 -4.602 72.052 49.260 1.00 32.81 O ATOM 2188 CB SER A 145 -2.081 73.198 50.804 1.00 33.21 C ATOM 2189 OG SER A 145 -3.143 74.143 51.004 1.00 33.83 O ATOM 2190 HA SER A 145 -1.258 71.816 49.480 1.00 0.00 H ATOM 2191 HB2 SER A 145 -1.136 73.741 50.803 1.00 0.00 H ATOM 2192 HB3 SER A 145 -2.092 72.492 51.634 1.00 0.00 H ATOM 2193 HG SER A 145 -3.008 74.612 51.865 1.00 0.00 H ATOM 2194 H SER A 145 -3.104 73.834 48.129 1.00 0.00 H ATOM 2195 N LEU A 146 -3.251 70.208 49.531 1.00 33.65 N ATOM 2196 CA LEU A 146 -4.420 69.287 49.552 1.00 33.57 C ATOM 2197 C LEU A 146 -4.753 68.855 51.023 1.00 34.20 C ATOM 2198 O LEU A 146 -4.173 69.347 51.978 1.00 32.63 O ATOM 2199 CB LEU A 146 -4.126 68.039 48.661 1.00 32.74 C ATOM 2200 CG LEU A 146 -2.769 67.313 48.898 1.00 31.19 C ATOM 2201 CD1 LEU A 146 -2.777 66.565 50.260 1.00 29.61 C ATOM 2202 CD2 LEU A 146 -2.512 66.287 47.721 1.00 32.01 C ATOM 2203 HA LEU A 146 -5.289 69.807 49.149 1.00 0.00 H ATOM 2204 HB2 LEU A 146 -4.922 67.315 48.833 1.00 0.00 H ATOM 2205 HB3 LEU A 146 -4.150 68.363 47.621 1.00 0.00 H ATOM 2206 HG LEU A 146 -1.971 68.055 48.920 1.00 0.00 H ATOM 2207 HD21 LEU A 146 -3.319 65.555 47.696 1.00 0.00 H ATOM 2208 HD22 LEU A 146 -2.478 66.824 46.773 1.00 0.00 H ATOM 2209 HD23 LEU A 146 -1.562 65.778 47.885 1.00 0.00 H ATOM 2210 HD11 LEU A 146 -2.940 67.281 51.065 1.00 0.00 H ATOM 2211 HD12 LEU A 146 -3.578 65.826 50.262 1.00 0.00 H ATOM 2212 HD13 LEU A 146 -1.819 66.065 50.404 1.00 0.00 H ATOM 2213 H LEU A 146 -2.285 69.826 49.587 1.00 0.00 H ATOM 2214 N SER A 147 -5.719 67.962 51.213 1.00 33.96 N ATOM 2215 CA SER A 147 -6.014 67.495 52.539 1.00 33.50 C ATOM 2216 C SER A 147 -6.295 66.035 52.323 1.00 32.76 C ATOM 2217 O SER A 147 -6.425 65.597 51.182 1.00 32.95 O ATOM 2218 CB SER A 147 -7.241 68.196 53.149 1.00 34.19 C ATOM 2219 OG SER A 147 -8.357 68.085 52.279 1.00 39.58 O ATOM 2220 HA SER A 147 -5.202 67.694 53.238 1.00 0.00 H ATOM 2221 HB2 SER A 147 -7.012 69.250 53.307 1.00 0.00 H ATOM 2222 HB3 SER A 147 -7.483 67.731 54.105 1.00 0.00 H ATOM 2223 HG SER A 147 -8.141 68.509 51.411 1.00 0.00 H ATOM 2224 H SER A 147 -6.261 67.602 50.402 1.00 0.00 H ATOM 2225 N TYR A 148 -6.371 65.283 53.408 1.00 32.97 N ATOM 2226 CA TYR A 148 -6.663 63.843 53.348 1.00 33.61 C ATOM 2227 C TYR A 148 -7.117 63.396 54.737 1.00 34.09 C ATOM 2228 O TYR A 148 -6.763 64.027 55.783 1.00 33.10 O ATOM 2229 CB TYR A 148 -5.432 63.019 52.908 1.00 31.00 C ATOM 2230 CG TYR A 148 -4.198 63.199 53.777 1.00 32.47 C ATOM 2231 CD1 TYR A 148 -3.370 64.330 53.640 1.00 32.66 C ATOM 2232 CD2 TYR A 148 -3.850 62.231 54.726 1.00 31.96 C ATOM 2233 CE1 TYR A 148 -2.209 64.495 54.436 1.00 31.93 C ATOM 2234 CE2 TYR A 148 -2.693 62.387 55.547 1.00 31.31 C ATOM 2235 CZ TYR A 148 -1.882 63.520 55.391 1.00 33.77 C ATOM 2236 OH TYR A 148 -0.748 63.639 56.185 1.00 31.76 O ATOM 2237 HA TYR A 148 -7.442 63.672 52.606 1.00 0.00 H ATOM 2238 HB3 TYR A 148 -5.175 63.311 51.890 1.00 0.00 H ATOM 2239 HB2 TYR A 148 -5.707 61.964 52.924 1.00 0.00 H ATOM 2240 HD2 TYR A 148 -4.473 61.344 54.840 1.00 0.00 H ATOM 2241 HE2 TYR A 148 -2.442 61.630 56.290 1.00 0.00 H ATOM 2242 HE1 TYR A 148 -1.575 65.372 54.307 1.00 0.00 H ATOM 2243 HD1 TYR A 148 -3.627 65.094 52.907 1.00 0.00 H ATOM 2244 HH TYR A 148 -0.279 64.483 55.964 1.00 0.00 H ATOM 2245 H TYR A 148 -6.219 65.726 54.337 1.00 0.00 H ATOM 2246 N ARG A 149 -7.902 62.328 54.756 1.00 32.90 N ATOM 2247 CA ARG A 149 -8.402 61.811 56.035 1.00 33.26 C ATOM 2248 C ARG A 149 -7.247 61.242 56.860 1.00 32.33 C ATOM 2249 O ARG A 149 -6.365 60.574 56.312 1.00 33.24 O ATOM 2250 CB ARG A 149 -9.433 60.713 55.780 1.00 30.73 C ATOM 2251 CG ARG A 149 -10.842 61.260 55.395 1.00 34.61 C ATOM 2252 CD ARG A 149 -11.793 60.148 54.927 1.00 31.47 C ATOM 2253 NE ARG A 149 -11.400 59.713 53.578 1.00 32.40 N ATOM 2254 CZ ARG A 149 -11.899 58.641 52.986 1.00 32.16 C ATOM 2255 NH1 ARG A 149 -12.805 57.914 53.660 1.00 32.39 N ATOM 2256 NH2 ARG A 149 -11.529 58.322 51.724 1.00 31.53 N ATOM 2257 HA ARG A 149 -8.868 62.628 56.587 1.00 0.00 H ATOM 2258 HB2 ARG A 149 -9.073 60.083 54.966 1.00 0.00 H ATOM 2259 HB3 ARG A 149 -9.531 60.114 56.685 1.00 0.00 H ATOM 2260 HG2 ARG A 149 -11.278 61.750 56.266 1.00 0.00 H ATOM 2261 HG3 ARG A 149 -10.728 61.986 54.590 1.00 0.00 H ATOM 2262 HD2 ARG A 149 -12.815 60.527 54.905 1.00 0.00 H ATOM 2263 HD3 ARG A 149 -11.734 59.304 55.614 1.00 0.00 H ATOM 2264 HE ARG A 149 -10.694 60.277 53.064 1.00 0.00 H ATOM 2265 HH12 ARG A 149 -13.218 57.065 53.225 1.00 0.00 H ATOM 2266 HH11 ARG A 149 -13.093 58.200 54.617 1.00 0.00 H ATOM 2267 HH22 ARG A 149 -11.925 57.478 51.264 1.00 0.00 H ATOM 2268 HH21 ARG A 149 -10.849 58.921 51.214 1.00 0.00 H ATOM 2269 H ARG A 149 -8.163 61.857 53.866 1.00 0.00 H ATOM 2270 N VAL A 150 -7.258 61.492 58.166 1.00 31.39 N ATOM 2271 CA VAL A 150 -6.212 60.976 59.039 1.00 31.11 C ATOM 2272 C VAL A 150 -6.854 60.100 60.125 1.00 32.80 C ATOM 2273 O VAL A 150 -8.123 60.007 60.237 1.00 32.66 O ATOM 2274 CB VAL A 150 -5.407 62.145 59.725 1.00 31.53 C ATOM 2275 CG1 VAL A 150 -4.591 62.922 58.658 1.00 31.43 C ATOM 2276 CG2 VAL A 150 -6.355 63.085 60.484 1.00 29.63 C ATOM 2277 HA VAL A 150 -5.517 60.392 58.436 1.00 0.00 H ATOM 2278 HB VAL A 150 -4.713 61.717 60.449 1.00 0.00 H ATOM 2279 HG11 VAL A 150 -3.893 62.242 58.170 1.00 0.00 H ATOM 2280 HG12 VAL A 150 -5.271 63.340 57.916 1.00 0.00 H ATOM 2281 HG13 VAL A 150 -4.038 63.728 59.141 1.00 0.00 H ATOM 2282 HG21 VAL A 150 -7.074 63.514 59.787 1.00 0.00 H ATOM 2283 HG22 VAL A 150 -6.884 62.522 61.253 1.00 0.00 H ATOM 2284 HG23 VAL A 150 -5.777 63.884 60.949 1.00 0.00 H ATOM 2285 H VAL A 150 -8.026 62.065 58.571 1.00 0.00 H ATOM 2286 N GLY A 151 -5.992 59.463 60.930 1.00 31.63 N ATOM 2287 CA GLY A 151 -6.469 58.610 62.021 1.00 30.98 C ATOM 2288 C GLY A 151 -7.266 57.423 61.490 1.00 31.71 C ATOM 2289 O GLY A 151 -7.111 57.016 60.343 1.00 32.01 O ATOM 2290 HA3 GLY A 151 -7.106 59.199 62.680 1.00 0.00 H ATOM 2291 HA2 GLY A 151 -5.612 58.239 62.583 1.00 0.00 H ATOM 2292 H GLY A 151 -4.969 59.576 60.778 1.00 0.00 H ATOM 2293 N ALA A 152 -8.153 56.887 62.311 1.00 32.97 N ATOM 2294 CA ALA A 152 -8.981 55.772 61.893 1.00 33.55 C ATOM 2295 C ALA A 152 -9.759 56.117 60.583 1.00 34.76 C ATOM 2296 O ALA A 152 -9.878 55.266 59.667 1.00 33.75 O ATOM 2297 CB ALA A 152 -9.982 55.431 63.049 1.00 33.78 C ATOM 2298 HA ALA A 152 -8.348 54.909 61.684 1.00 0.00 H ATOM 2299 HB1 ALA A 152 -9.422 55.163 63.945 1.00 0.00 H ATOM 2300 HB2 ALA A 152 -10.606 56.300 63.256 1.00 0.00 H ATOM 2301 HB3 ALA A 152 -10.611 54.594 62.748 1.00 0.00 H ATOM 2302 H ALA A 152 -8.259 57.271 63.272 1.00 0.00 H ATOM 2303 N PHE A 153 -10.268 57.358 60.481 1.00 32.93 N ATOM 2304 CA PHE A 153 -11.015 57.746 59.276 1.00 34.27 C ATOM 2305 C PHE A 153 -10.226 57.615 57.994 1.00 33.59 C ATOM 2306 O PHE A 153 -10.823 57.395 56.925 1.00 31.72 O ATOM 2307 CB PHE A 153 -11.529 59.188 59.384 1.00 34.66 C ATOM 2308 CG PHE A 153 -12.127 59.486 60.705 1.00 37.20 C ATOM 2309 CD1 PHE A 153 -13.511 59.328 60.921 1.00 38.64 C ATOM 2310 CD2 PHE A 153 -11.300 59.851 61.777 1.00 35.57 C ATOM 2311 CE1 PHE A 153 -14.070 59.529 62.200 1.00 38.92 C ATOM 2312 CE2 PHE A 153 -11.825 60.055 63.064 1.00 37.60 C ATOM 2313 CZ PHE A 153 -13.216 59.895 63.291 1.00 38.33 C ATOM 2314 HA PHE A 153 -11.846 57.042 59.226 1.00 0.00 H ATOM 2315 HB2 PHE A 153 -10.694 59.869 59.217 1.00 0.00 H ATOM 2316 HB3 PHE A 153 -12.285 59.347 58.615 1.00 0.00 H ATOM 2317 HD2 PHE A 153 -10.231 59.979 61.609 1.00 0.00 H ATOM 2318 HE2 PHE A 153 -11.166 60.335 63.885 1.00 0.00 H ATOM 2319 HZ PHE A 153 -13.632 60.049 64.287 1.00 0.00 H ATOM 2320 HE1 PHE A 153 -15.142 59.407 62.357 1.00 0.00 H ATOM 2321 HD1 PHE A 153 -14.157 59.047 60.089 1.00 0.00 H ATOM 2322 H PHE A 153 -10.133 58.042 61.253 1.00 0.00 H ATOM 2323 N GLY A 154 -8.892 57.750 58.077 1.00 33.39 N ATOM 2324 CA GLY A 154 -8.091 57.640 56.869 1.00 32.24 C ATOM 2325 C GLY A 154 -7.364 56.316 56.716 1.00 32.43 C ATOM 2326 O GLY A 154 -7.082 55.902 55.596 1.00 33.09 O ATOM 2327 HA3 GLY A 154 -7.348 58.438 56.878 1.00 0.00 H ATOM 2328 HA2 GLY A 154 -8.750 57.769 56.010 1.00 0.00 H ATOM 2329 H GLY A 154 -8.438 57.931 58.995 1.00 0.00 H ATOM 2330 N PHE A 155 -7.096 55.627 57.825 1.00 32.23 N ATOM 2331 CA PHE A 155 -6.277 54.438 57.759 1.00 31.43 C ATOM 2332 C PHE A 155 -6.708 53.147 58.467 1.00 32.79 C ATOM 2333 O PHE A 155 -5.948 52.152 58.530 1.00 32.36 O ATOM 2334 CB PHE A 155 -4.867 54.875 58.182 1.00 29.58 C ATOM 2335 CG PHE A 155 -4.290 55.969 57.278 1.00 31.05 C ATOM 2336 CD1 PHE A 155 -3.723 55.652 56.029 1.00 32.25 C ATOM 2337 CD2 PHE A 155 -4.412 57.304 57.618 1.00 32.12 C ATOM 2338 CE1 PHE A 155 -3.279 56.637 55.126 1.00 32.47 C ATOM 2339 CE2 PHE A 155 -3.971 58.330 56.715 1.00 32.30 C ATOM 2340 CZ PHE A 155 -3.404 57.999 55.478 1.00 31.35 C ATOM 2341 HA PHE A 155 -6.370 54.089 56.731 1.00 0.00 H ATOM 2342 HB2 PHE A 155 -4.911 55.253 59.203 1.00 0.00 H ATOM 2343 HB3 PHE A 155 -4.207 54.008 58.145 1.00 0.00 H ATOM 2344 HD2 PHE A 155 -4.846 57.580 58.579 1.00 0.00 H ATOM 2345 HE2 PHE A 155 -4.079 59.378 56.996 1.00 0.00 H ATOM 2346 HZ PHE A 155 -3.065 58.780 54.798 1.00 0.00 H ATOM 2347 HE1 PHE A 155 -2.845 56.352 54.168 1.00 0.00 H ATOM 2348 HD1 PHE A 155 -3.624 54.603 55.750 1.00 0.00 H ATOM 2349 H PHE A 155 -7.477 55.945 58.739 1.00 0.00 H ATOM 2350 N LEU A 156 -7.918 53.136 58.987 1.00 33.81 N ATOM 2351 CA LEU A 156 -8.421 51.912 59.618 1.00 36.56 C ATOM 2352 C LEU A 156 -8.349 50.867 58.481 1.00 36.15 C ATOM 2353 O LEU A 156 -8.875 51.095 57.390 1.00 34.77 O ATOM 2354 CB LEU A 156 -9.873 52.093 60.050 1.00 38.68 C ATOM 2355 CG LEU A 156 -10.445 50.844 60.738 1.00 39.45 C ATOM 2356 CD1 LEU A 156 -10.468 51.052 62.238 1.00 38.65 C ATOM 2357 CD2 LEU A 156 -11.863 50.585 60.213 1.00 38.38 C ATOM 2358 HA LEU A 156 -7.855 51.633 60.507 1.00 0.00 H ATOM 2359 HB2 LEU A 156 -9.929 52.931 60.745 1.00 0.00 H ATOM 2360 HB3 LEU A 156 -10.475 52.313 59.168 1.00 0.00 H ATOM 2361 HG LEU A 156 -9.818 49.980 60.517 1.00 0.00 H ATOM 2362 HD21 LEU A 156 -12.494 51.446 60.433 1.00 0.00 H ATOM 2363 HD22 LEU A 156 -11.827 50.426 59.135 1.00 0.00 H ATOM 2364 HD23 LEU A 156 -12.273 49.699 60.699 1.00 0.00 H ATOM 2365 HD11 LEU A 156 -9.453 51.229 62.595 1.00 0.00 H ATOM 2366 HD12 LEU A 156 -11.093 51.913 62.475 1.00 0.00 H ATOM 2367 HD13 LEU A 156 -10.875 50.163 62.721 1.00 0.00 H ATOM 2368 H LEU A 156 -8.512 53.989 58.950 1.00 0.00 H ATOM 2369 N ALA A 157 -7.680 49.748 58.721 1.00 36.04 N ATOM 2370 CA ALA A 157 -7.533 48.750 57.673 1.00 36.72 C ATOM 2371 C ALA A 157 -7.990 47.306 58.028 1.00 39.57 C ATOM 2372 O ALA A 157 -7.384 46.646 58.902 1.00 38.99 O ATOM 2373 CB ALA A 157 -6.086 48.712 57.220 1.00 31.42 C ATOM 2374 HA ALA A 157 -8.212 49.074 56.884 1.00 0.00 H ATOM 2375 HB1 ALA A 157 -5.801 49.691 56.836 1.00 0.00 H ATOM 2376 HB2 ALA A 157 -5.449 48.452 58.065 1.00 0.00 H ATOM 2377 HB3 ALA A 157 -5.972 47.965 56.434 1.00 0.00 H ATOM 2378 H ALA A 157 -7.260 49.584 59.658 1.00 0.00 H ATOM 2379 N LEU A 158 -9.040 46.827 57.344 1.00 40.11 N ATOM 2380 CA LEU A 158 -9.526 45.458 57.528 1.00 41.77 C ATOM 2381 C LEU A 158 -9.316 44.858 56.160 1.00 42.95 C ATOM 2382 O LEU A 158 -10.227 44.785 55.333 1.00 43.93 O ATOM 2383 CB LEU A 158 -11.003 45.455 57.945 1.00 42.22 C ATOM 2384 CG LEU A 158 -11.141 45.851 59.447 1.00 42.83 C ATOM 2385 CD1 LEU A 158 -12.568 46.281 59.762 1.00 39.96 C ATOM 2386 CD2 LEU A 158 -10.666 44.697 60.361 1.00 41.67 C ATOM 2387 HA LEU A 158 -9.017 44.903 58.316 1.00 0.00 H ATOM 2388 HB2 LEU A 158 -11.552 46.170 57.332 1.00 0.00 H ATOM 2389 HB3 LEU A 158 -11.417 44.458 57.796 1.00 0.00 H ATOM 2390 HG LEU A 158 -10.496 46.707 59.644 1.00 0.00 H ATOM 2391 HD21 LEU A 158 -11.273 43.812 60.172 1.00 0.00 H ATOM 2392 HD22 LEU A 158 -9.620 44.474 60.149 1.00 0.00 H ATOM 2393 HD23 LEU A 158 -10.771 44.995 61.404 1.00 0.00 H ATOM 2394 HD11 LEU A 158 -12.832 47.140 59.145 1.00 0.00 H ATOM 2395 HD12 LEU A 158 -13.249 45.457 59.550 1.00 0.00 H ATOM 2396 HD13 LEU A 158 -12.640 46.553 60.815 1.00 0.00 H ATOM 2397 H LEU A 158 -9.523 47.447 56.663 1.00 0.00 H ATOM 2398 N HIS A 159 -8.080 44.482 55.886 1.00 43.72 N ATOM 2399 CA HIS A 159 -7.744 43.910 54.582 1.00 46.91 C ATOM 2400 C HIS A 159 -8.638 42.747 54.153 1.00 48.09 C ATOM 2401 O HIS A 159 -8.853 41.800 54.913 1.00 48.13 O ATOM 2402 CB HIS A 159 -6.302 43.429 54.556 1.00 45.08 C ATOM 2403 CG HIS A 159 -5.836 43.049 53.196 1.00 45.85 C ATOM 2404 ND1 HIS A 159 -5.723 43.967 52.168 1.00 46.56 N ATOM 2405 CD2 HIS A 159 -5.399 41.863 52.699 1.00 44.64 C ATOM 2406 CE1 HIS A 159 -5.226 43.362 51.102 1.00 45.22 C ATOM 2407 NE2 HIS A 159 -5.021 42.085 51.397 1.00 43.97 N ATOM 2408 HA HIS A 159 -7.903 44.726 53.877 1.00 0.00 H ATOM 2409 HB2 HIS A 159 -5.663 44.229 54.931 1.00 0.00 H ATOM 2410 HB3 HIS A 159 -6.215 42.560 55.208 1.00 0.00 H ATOM 2411 HD2 HIS A 159 -5.356 40.914 53.233 1.00 0.00 H ATOM 2412 HE1 HIS A 159 -5.019 43.834 50.141 1.00 0.00 H ATOM 2413 H HIS A 159 -7.337 44.594 56.605 1.00 0.00 H ATOM 2414 N GLY A 160 -9.114 42.817 52.911 1.00 49.77 N ATOM 2415 CA GLY A 160 -10.003 41.794 52.390 1.00 49.85 C ATOM 2416 C GLY A 160 -11.387 42.402 52.285 1.00 50.77 C ATOM 2417 O GLY A 160 -12.198 41.974 51.476 1.00 50.91 O ATOM 2418 HA3 GLY A 160 -10.022 40.939 53.065 1.00 0.00 H ATOM 2419 HA2 GLY A 160 -9.663 41.471 51.406 1.00 0.00 H ATOM 2420 H GLY A 160 -8.844 43.618 52.304 1.00 0.00 H ATOM 2421 N SER A 161 -11.661 43.416 53.104 1.00 50.32 N ATOM 2422 CA SER A 161 -12.949 44.083 53.073 1.00 50.60 C ATOM 2423 C SER A 161 -12.905 45.244 52.074 1.00 51.11 C ATOM 2424 O SER A 161 -11.861 45.900 51.913 1.00 51.78 O ATOM 2425 CB SER A 161 -13.274 44.607 54.463 1.00 51.79 C ATOM 2426 OG SER A 161 -14.057 45.783 54.366 1.00 55.93 O ATOM 2427 HA SER A 161 -13.720 43.378 52.762 1.00 0.00 H ATOM 2428 HB2 SER A 161 -12.347 44.833 54.990 1.00 0.00 H ATOM 2429 HB3 SER A 161 -13.829 43.848 55.015 1.00 0.00 H ATOM 2430 HG SER A 161 -14.263 46.117 55.275 1.00 0.00 H ATOM 2431 H SER A 161 -10.937 43.736 53.779 1.00 0.00 H ATOM 2432 N GLN A 162 -14.006 45.503 51.380 1.00 50.41 N ATOM 2433 CA GLN A 162 -14.000 46.620 50.449 1.00 50.72 C ATOM 2434 C GLN A 162 -14.575 47.848 51.140 1.00 49.93 C ATOM 2435 O GLN A 162 -14.522 48.965 50.599 1.00 50.59 O ATOM 2436 CB GLN A 162 -14.808 46.321 49.189 1.00 53.53 C ATOM 2437 CG GLN A 162 -14.116 45.410 48.156 1.00 57.54 C ATOM 2438 CD GLN A 162 -12.635 45.748 47.928 1.00 59.71 C ATOM 2439 OE1 GLN A 162 -12.247 46.927 47.782 1.00 60.65 O ATOM 2440 NE2 GLN A 162 -11.794 44.699 47.889 1.00 60.19 N ATOM 2441 HA GLN A 162 -12.969 46.798 50.145 1.00 0.00 H ATOM 2442 HB2 GLN A 162 -15.737 45.839 49.492 1.00 0.00 H ATOM 2443 HB3 GLN A 162 -15.034 47.270 48.702 1.00 0.00 H ATOM 2444 HG2 GLN A 162 -14.184 44.380 48.505 1.00 0.00 H ATOM 2445 HG3 GLN A 162 -14.641 45.506 47.206 1.00 0.00 H ATOM 2446 HE22 GLN A 162 -12.160 43.734 48.015 1.00 0.00 H ATOM 2447 HE21 GLN A 162 -10.777 44.853 47.732 1.00 0.00 H ATOM 2448 H GLN A 162 -14.857 44.918 51.500 1.00 0.00 H ATOM 2449 N GLU A 163 -15.114 47.651 52.339 1.00 48.10 N ATOM 2450 CA GLU A 163 -15.684 48.749 53.082 1.00 47.83 C ATOM 2451 C GLU A 163 -14.629 49.569 53.867 1.00 46.93 C ATOM 2452 O GLU A 163 -14.783 50.784 53.996 1.00 46.78 O ATOM 2453 CB GLU A 163 -16.797 48.238 54.019 1.00 50.65 C ATOM 2454 CG GLU A 163 -18.022 47.675 53.292 1.00 53.38 C ATOM 2455 CD GLU A 163 -18.645 48.673 52.315 1.00 55.79 C ATOM 2456 OE1 GLU A 163 -19.058 48.236 51.213 1.00 58.82 O ATOM 2457 OE2 GLU A 163 -18.730 49.888 52.623 1.00 55.78 O ATOM 2458 HA GLU A 163 -16.115 49.435 52.352 1.00 0.00 H ATOM 2459 HB2 GLU A 163 -16.380 47.451 54.647 1.00 0.00 H ATOM 2460 HB3 GLU A 163 -17.123 49.067 54.647 1.00 0.00 H ATOM 2461 HG2 GLU A 163 -17.720 46.787 52.737 1.00 0.00 H ATOM 2462 HG3 GLU A 163 -18.772 47.400 54.034 1.00 0.00 H ATOM 2463 H GLU A 163 -15.125 46.694 52.746 1.00 0.00 H ATOM 2464 N ALA A 164 -13.578 48.924 54.388 1.00 43.58 N ATOM 2465 CA ALA A 164 -12.509 49.635 55.128 1.00 41.82 C ATOM 2466 C ALA A 164 -11.226 48.913 54.725 1.00 40.29 C ATOM 2467 O ALA A 164 -10.619 48.181 55.505 1.00 39.88 O ATOM 2468 CB ALA A 164 -12.743 49.536 56.652 1.00 39.37 C ATOM 2469 HA ALA A 164 -12.475 50.699 54.895 1.00 0.00 H ATOM 2470 HB1 ALA A 164 -13.704 49.986 56.901 1.00 0.00 H ATOM 2471 HB2 ALA A 164 -12.743 48.488 56.951 1.00 0.00 H ATOM 2472 HB3 ALA A 164 -11.947 50.065 57.176 1.00 0.00 H ATOM 2473 H ALA A 164 -13.510 47.893 54.270 1.00 0.00 H ATOM 2474 N PRO A 165 -10.803 49.119 53.484 1.00 39.35 N ATOM 2475 CA PRO A 165 -9.602 48.455 52.975 1.00 38.36 C ATOM 2476 C PRO A 165 -8.266 48.974 53.458 1.00 38.56 C ATOM 2477 O PRO A 165 -7.256 48.278 53.334 1.00 38.40 O ATOM 2478 CB PRO A 165 -9.755 48.588 51.473 1.00 37.79 C ATOM 2479 CG PRO A 165 -10.416 50.020 51.325 1.00 38.65 C ATOM 2480 CD PRO A 165 -11.383 50.082 52.518 1.00 38.52 C ATOM 2481 HA PRO A 165 -9.558 47.432 53.349 1.00 0.00 H ATOM 2482 HD3 PRO A 165 -11.417 51.086 52.941 1.00 0.00 H ATOM 2483 HD2 PRO A 165 -12.388 49.780 52.222 1.00 0.00 H ATOM 2484 HG3 PRO A 165 -10.953 50.108 50.381 1.00 0.00 H ATOM 2485 HG2 PRO A 165 -9.664 50.807 51.389 1.00 0.00 H ATOM 2486 HB2 PRO A 165 -8.788 48.546 50.972 1.00 0.00 H ATOM 2487 HB3 PRO A 165 -10.404 47.810 51.072 1.00 0.00 H ATOM 2488 N GLY A 166 -8.264 50.178 54.031 1.00 37.61 N ATOM 2489 CA GLY A 166 -7.008 50.783 54.450 1.00 35.12 C ATOM 2490 C GLY A 166 -6.481 51.715 53.339 1.00 35.81 C ATOM 2491 O GLY A 166 -6.992 51.716 52.194 1.00 33.48 O ATOM 2492 HA3 GLY A 166 -6.275 50.000 54.643 1.00 0.00 H ATOM 2493 HA2 GLY A 166 -7.170 51.360 55.360 1.00 0.00 H ATOM 2494 H GLY A 166 -9.160 50.685 54.179 1.00 0.00 H ATOM 2495 N ASN A 167 -5.515 52.562 53.710 1.00 33.97 N ATOM 2496 CA ASN A 167 -4.870 53.485 52.807 1.00 33.63 C ATOM 2497 C ASN A 167 -5.793 54.548 52.176 1.00 32.91 C ATOM 2498 O ASN A 167 -5.354 55.264 51.267 1.00 32.21 O ATOM 2499 CB ASN A 167 -4.154 52.677 51.683 1.00 33.39 C ATOM 2500 CG ASN A 167 -2.951 51.873 52.232 1.00 35.31 C ATOM 2501 OD1 ASN A 167 -2.378 52.246 53.262 1.00 33.88 O ATOM 2502 ND2 ASN A 167 -2.583 50.775 51.557 1.00 30.71 N ATOM 2503 HA ASN A 167 -4.164 54.050 53.415 1.00 0.00 H ATOM 2504 HB2 ASN A 167 -4.868 51.985 51.236 1.00 0.00 H ATOM 2505 HB3 ASN A 167 -3.797 53.371 50.922 1.00 0.00 H ATOM 2506 HD22 ASN A 167 -3.094 50.499 50.695 1.00 0.00 H ATOM 2507 HD21 ASN A 167 -1.786 50.199 51.896 1.00 0.00 H ATOM 2508 H ASN A 167 -5.212 52.555 54.705 1.00 0.00 H ATOM 2509 N VAL A 168 -7.028 54.672 52.652 1.00 32.85 N ATOM 2510 CA VAL A 168 -7.953 55.626 51.975 1.00 33.92 C ATOM 2511 C VAL A 168 -7.505 57.093 52.048 1.00 32.86 C ATOM 2512 O VAL A 168 -7.785 57.869 51.116 1.00 33.71 O ATOM 2513 CB VAL A 168 -9.484 55.413 52.415 1.00 33.65 C ATOM 2514 CG1 VAL A 168 -9.861 53.919 52.189 1.00 31.98 C ATOM 2515 CG2 VAL A 168 -9.750 55.838 53.857 1.00 31.17 C ATOM 2516 HA VAL A 168 -7.897 55.376 50.916 1.00 0.00 H ATOM 2517 HB VAL A 168 -10.113 56.056 51.799 1.00 0.00 H ATOM 2518 HG11 VAL A 168 -9.739 53.670 51.135 1.00 0.00 H ATOM 2519 HG12 VAL A 168 -9.209 53.286 52.791 1.00 0.00 H ATOM 2520 HG13 VAL A 168 -10.898 53.759 52.483 1.00 0.00 H ATOM 2521 HG21 VAL A 168 -9.125 55.250 54.529 1.00 0.00 H ATOM 2522 HG22 VAL A 168 -9.514 56.896 53.972 1.00 0.00 H ATOM 2523 HG23 VAL A 168 -10.800 55.671 54.096 1.00 0.00 H ATOM 2524 H VAL A 168 -7.341 54.118 53.475 1.00 0.00 H ATOM 2525 N GLY A 169 -6.757 57.437 53.110 1.00 33.46 N ATOM 2526 CA GLY A 169 -6.178 58.775 53.236 1.00 31.61 C ATOM 2527 C GLY A 169 -5.154 59.015 52.111 1.00 31.44 C ATOM 2528 O GLY A 169 -5.032 60.125 51.594 1.00 30.16 O ATOM 2529 HA3 GLY A 169 -5.681 58.864 54.202 1.00 0.00 H ATOM 2530 HA2 GLY A 169 -6.971 59.520 53.167 1.00 0.00 H ATOM 2531 H GLY A 169 -6.586 56.736 53.859 1.00 0.00 H ATOM 2532 N LEU A 170 -4.390 57.985 51.746 1.00 30.78 N ATOM 2533 CA LEU A 170 -3.414 58.093 50.651 1.00 31.35 C ATOM 2534 C LEU A 170 -4.212 58.229 49.341 1.00 31.89 C ATOM 2535 O LEU A 170 -3.796 58.977 48.440 1.00 31.60 O ATOM 2536 CB LEU A 170 -2.518 56.842 50.559 1.00 28.94 C ATOM 2537 CG LEU A 170 -1.438 56.761 51.665 1.00 30.48 C ATOM 2538 CD1 LEU A 170 -0.786 55.399 51.680 1.00 26.65 C ATOM 2539 CD2 LEU A 170 -0.398 57.826 51.436 1.00 28.86 C ATOM 2540 HA LEU A 170 -2.767 58.952 50.830 1.00 0.00 H ATOM 2541 HB2 LEU A 170 -3.153 55.959 50.633 1.00 0.00 H ATOM 2542 HB3 LEU A 170 -2.018 56.848 49.590 1.00 0.00 H ATOM 2543 HG LEU A 170 -1.917 56.922 52.631 1.00 0.00 H ATOM 2544 HD21 LEU A 170 0.068 57.674 50.463 1.00 0.00 H ATOM 2545 HD22 LEU A 170 -0.872 58.807 51.464 1.00 0.00 H ATOM 2546 HD23 LEU A 170 0.360 57.765 52.217 1.00 0.00 H ATOM 2547 HD11 LEU A 170 -1.542 54.638 51.870 1.00 0.00 H ATOM 2548 HD12 LEU A 170 -0.316 55.212 50.715 1.00 0.00 H ATOM 2549 HD13 LEU A 170 -0.031 55.368 52.466 1.00 0.00 H ATOM 2550 H LEU A 170 -4.487 57.080 52.250 1.00 0.00 H ATOM 2551 N LEU A 171 -5.342 57.518 49.235 1.00 31.58 N ATOM 2552 CA LEU A 171 -6.178 57.635 48.019 1.00 33.43 C ATOM 2553 C LEU A 171 -6.785 59.057 47.962 1.00 33.09 C ATOM 2554 O LEU A 171 -6.999 59.607 46.865 1.00 32.24 O ATOM 2555 CB LEU A 171 -7.281 56.538 47.987 1.00 33.85 C ATOM 2556 CG LEU A 171 -6.667 55.117 47.769 1.00 35.42 C ATOM 2557 CD1 LEU A 171 -7.820 54.065 47.871 1.00 34.99 C ATOM 2558 CD2 LEU A 171 -5.934 55.007 46.402 1.00 30.89 C ATOM 2559 HA LEU A 171 -5.558 57.479 47.136 1.00 0.00 H ATOM 2560 HB2 LEU A 171 -7.821 56.550 48.934 1.00 0.00 H ATOM 2561 HB3 LEU A 171 -7.973 56.754 47.173 1.00 0.00 H ATOM 2562 HG LEU A 171 -5.917 54.928 48.537 1.00 0.00 H ATOM 2563 HD21 LEU A 171 -6.641 55.202 45.595 1.00 0.00 H ATOM 2564 HD22 LEU A 171 -5.127 55.738 46.364 1.00 0.00 H ATOM 2565 HD23 LEU A 171 -5.523 54.004 46.292 1.00 0.00 H ATOM 2566 HD11 LEU A 171 -8.281 54.127 48.857 1.00 0.00 H ATOM 2567 HD12 LEU A 171 -8.568 54.272 47.105 1.00 0.00 H ATOM 2568 HD13 LEU A 171 -7.412 53.065 47.722 1.00 0.00 H ATOM 2569 H LEU A 171 -5.632 56.884 50.007 1.00 0.00 H ATOM 2570 N ASP A 172 -7.059 59.660 49.133 1.00 33.96 N ATOM 2571 CA ASP A 172 -7.556 61.049 49.136 1.00 33.01 C ATOM 2572 C ASP A 172 -6.454 61.929 48.505 1.00 32.59 C ATOM 2573 O ASP A 172 -6.697 62.745 47.644 1.00 32.00 O ATOM 2574 CB ASP A 172 -7.796 61.555 50.566 1.00 33.64 C ATOM 2575 CG ASP A 172 -8.947 60.856 51.265 1.00 34.47 C ATOM 2576 OD1 ASP A 172 -9.769 60.189 50.590 1.00 34.23 O ATOM 2577 OD2 ASP A 172 -9.040 60.989 52.512 1.00 35.41 O ATOM 2578 HA ASP A 172 -8.497 61.094 48.588 1.00 0.00 H ATOM 2579 HB2 ASP A 172 -6.888 61.393 51.147 1.00 0.00 H ATOM 2580 HB3 ASP A 172 -8.013 62.622 50.524 1.00 0.00 H ATOM 2581 H ASP A 172 -6.921 59.151 50.029 1.00 0.00 H ATOM 2582 N GLN A 173 -5.214 61.743 48.935 1.00 32.05 N ATOM 2583 CA GLN A 173 -4.135 62.559 48.389 1.00 30.88 C ATOM 2584 C GLN A 173 -4.048 62.347 46.905 1.00 30.85 C ATOM 2585 O GLN A 173 -3.880 63.308 46.138 1.00 31.31 O ATOM 2586 CB GLN A 173 -2.785 62.202 49.032 1.00 27.65 C ATOM 2587 CG GLN A 173 -2.739 62.359 50.555 1.00 27.05 C ATOM 2588 CD GLN A 173 -1.411 61.842 51.149 1.00 30.91 C ATOM 2589 OE1 GLN A 173 -0.469 61.498 50.403 1.00 28.98 O ATOM 2590 NE2 GLN A 173 -1.333 61.776 52.507 1.00 29.23 N ATOM 2591 HA GLN A 173 -4.355 63.604 48.608 1.00 0.00 H ATOM 2592 HB2 GLN A 173 -2.558 61.164 48.791 1.00 0.00 H ATOM 2593 HB3 GLN A 173 -2.022 62.849 48.601 1.00 0.00 H ATOM 2594 HG2 GLN A 173 -2.849 63.414 50.804 1.00 0.00 H ATOM 2595 HG3 GLN A 173 -3.563 61.796 50.992 1.00 0.00 H ATOM 2596 HE22 GLN A 173 -2.142 62.073 53.089 1.00 0.00 H ATOM 2597 HE21 GLN A 173 -0.465 61.429 52.962 1.00 0.00 H ATOM 2598 H GLN A 173 -5.012 61.021 49.656 1.00 0.00 H ATOM 2599 N ARG A 174 -4.176 61.084 46.485 1.00 30.39 N ATOM 2600 CA ARG A 174 -4.046 60.796 45.059 1.00 31.20 C ATOM 2601 C ARG A 174 -5.168 61.471 44.281 1.00 30.29 C ATOM 2602 O ARG A 174 -4.942 61.986 43.194 1.00 31.12 O ATOM 2603 CB ARG A 174 -4.036 59.260 44.792 1.00 30.36 C ATOM 2604 CG ARG A 174 -4.045 58.907 43.297 1.00 34.38 C ATOM 2605 CD ARG A 174 -4.264 57.383 43.054 1.00 32.54 C ATOM 2606 NE ARG A 174 -3.168 56.595 43.597 1.00 32.55 N ATOM 2607 CZ ARG A 174 -3.168 55.265 43.680 1.00 34.10 C ATOM 2608 NH1 ARG A 174 -4.215 54.540 43.273 1.00 34.15 N ATOM 2609 NH2 ARG A 174 -2.072 54.637 44.083 1.00 33.80 N ATOM 2610 HA ARG A 174 -3.092 61.197 44.716 1.00 0.00 H ATOM 2611 HB2 ARG A 174 -3.139 58.835 45.243 1.00 0.00 H ATOM 2612 HB3 ARG A 174 -4.919 58.821 45.257 1.00 0.00 H ATOM 2613 HG2 ARG A 174 -4.849 59.460 42.810 1.00 0.00 H ATOM 2614 HG3 ARG A 174 -3.089 59.199 42.861 1.00 0.00 H ATOM 2615 HD2 ARG A 174 -4.334 57.201 41.982 1.00 0.00 H ATOM 2616 HD3 ARG A 174 -5.193 57.077 43.535 1.00 0.00 H ATOM 2617 HE ARG A 174 -2.329 57.103 43.943 1.00 0.00 H ATOM 2618 HH12 ARG A 174 -4.190 53.503 43.348 1.00 0.00 H ATOM 2619 HH11 ARG A 174 -5.054 55.013 42.881 1.00 0.00 H ATOM 2620 HH22 ARG A 174 -2.063 53.599 44.151 1.00 0.00 H ATOM 2621 HH21 ARG A 174 -1.222 55.182 44.331 1.00 0.00 H ATOM 2622 H ARG A 174 -4.365 60.319 47.163 1.00 0.00 H ATOM 2623 N MET A 175 -6.377 61.449 44.833 1.00 31.73 N ATOM 2624 CA MET A 175 -7.514 62.082 44.141 1.00 33.31 C ATOM 2625 C MET A 175 -7.285 63.575 43.946 1.00 34.38 C ATOM 2626 O MET A 175 -7.636 64.122 42.902 1.00 33.87 O ATOM 2627 CB MET A 175 -8.797 61.902 44.924 1.00 33.69 C ATOM 2628 CG MET A 175 -10.040 62.326 44.072 1.00 38.72 C ATOM 2629 SD MET A 175 -11.369 61.092 44.296 1.00 45.55 S ATOM 2630 CE MET A 175 -12.092 61.880 45.167 1.00 37.27 C ATOM 2631 HA MET A 175 -7.598 61.594 43.170 1.00 0.00 H ATOM 2632 HB2 MET A 175 -8.899 60.854 45.206 1.00 0.00 H ATOM 2633 HB3 MET A 175 -8.755 62.516 45.823 1.00 0.00 H ATOM 2634 HG2 MET A 175 -9.761 62.376 43.019 1.00 0.00 H ATOM 2635 HG3 MET A 175 -10.391 63.304 44.400 1.00 0.00 H ATOM 2636 HE1 MET A 175 -11.483 62.104 46.043 1.00 0.00 H ATOM 2637 HE2 MET A 175 -12.370 62.809 44.669 1.00 0.00 H ATOM 2638 HE3 MET A 175 -12.992 61.348 45.475 1.00 0.00 H ATOM 2639 H MET A 175 -6.521 60.985 45.753 1.00 0.00 H ATOM 2640 N ALA A 176 -6.706 64.232 44.955 1.00 32.52 N ATOM 2641 CA ALA A 176 -6.425 65.654 44.844 1.00 34.06 C ATOM 2642 C ALA A 176 -5.323 65.837 43.766 1.00 33.86 C ATOM 2643 O ALA A 176 -5.332 66.807 42.994 1.00 32.90 O ATOM 2644 CB ALA A 176 -5.956 66.211 46.221 1.00 32.04 C ATOM 2645 HA ALA A 176 -7.320 66.204 44.553 1.00 0.00 H ATOM 2646 HB1 ALA A 176 -6.741 66.056 46.961 1.00 0.00 H ATOM 2647 HB2 ALA A 176 -5.052 65.689 46.534 1.00 0.00 H ATOM 2648 HB3 ALA A 176 -5.748 67.277 46.128 1.00 0.00 H ATOM 2649 H ALA A 176 -6.455 63.722 45.826 1.00 0.00 H ATOM 2650 N LEU A 177 -4.375 64.893 43.709 1.00 33.86 N ATOM 2651 CA LEU A 177 -3.307 65.001 42.718 1.00 33.97 C ATOM 2652 C LEU A 177 -3.896 64.803 41.310 1.00 32.85 C ATOM 2653 O LEU A 177 -3.422 65.391 40.356 1.00 32.29 O ATOM 2654 CB LEU A 177 -2.159 63.987 42.988 1.00 33.55 C ATOM 2655 CG LEU A 177 -1.304 64.198 44.251 1.00 37.15 C ATOM 2656 CD1 LEU A 177 -0.247 63.063 44.326 1.00 35.72 C ATOM 2657 CD2 LEU A 177 -0.591 65.628 44.229 1.00 35.25 C ATOM 2658 HA LEU A 177 -2.869 65.997 42.791 1.00 0.00 H ATOM 2659 HB2 LEU A 177 -2.608 62.997 43.060 1.00 0.00 H ATOM 2660 HB3 LEU A 177 -1.487 64.018 42.130 1.00 0.00 H ATOM 2661 HG LEU A 177 -1.945 64.168 45.132 1.00 0.00 H ATOM 2662 HD21 LEU A 177 0.055 65.697 43.354 1.00 0.00 H ATOM 2663 HD22 LEU A 177 -1.349 66.410 44.185 1.00 0.00 H ATOM 2664 HD23 LEU A 177 0.006 65.749 45.133 1.00 0.00 H ATOM 2665 HD11 LEU A 177 -0.754 62.099 44.376 1.00 0.00 H ATOM 2666 HD12 LEU A 177 0.385 63.097 43.438 1.00 0.00 H ATOM 2667 HD13 LEU A 177 0.367 63.199 45.216 1.00 0.00 H ATOM 2668 H LEU A 177 -4.399 64.088 44.366 1.00 0.00 H ATOM 2669 N GLN A 178 -4.924 63.965 41.200 1.00 33.45 N ATOM 2670 CA GLN A 178 -5.590 63.713 39.908 1.00 34.51 C ATOM 2671 C GLN A 178 -6.318 64.990 39.502 1.00 33.49 C ATOM 2672 O GLN A 178 -6.254 65.408 38.350 1.00 34.62 O ATOM 2673 CB GLN A 178 -6.611 62.559 40.030 1.00 34.95 C ATOM 2674 CG GLN A 178 -7.301 62.170 38.694 1.00 36.72 C ATOM 2675 CD GLN A 178 -6.317 61.604 37.684 1.00 36.96 C ATOM 2676 OE1 GLN A 178 -5.761 60.533 37.896 1.00 39.59 O ATOM 2677 NE2 GLN A 178 -6.077 62.337 36.592 1.00 37.18 N ATOM 2678 HA GLN A 178 -4.847 63.430 39.163 1.00 0.00 H ATOM 2679 HB2 GLN A 178 -6.090 61.682 40.413 1.00 0.00 H ATOM 2680 HB3 GLN A 178 -7.383 62.860 40.738 1.00 0.00 H ATOM 2681 HG2 GLN A 178 -8.065 61.420 38.898 1.00 0.00 H ATOM 2682 HG3 GLN A 178 -7.769 63.058 38.269 1.00 0.00 H ATOM 2683 HE22 GLN A 178 -6.572 63.241 36.453 1.00 0.00 H ATOM 2684 HE21 GLN A 178 -5.395 62.003 35.881 1.00 0.00 H ATOM 2685 H GLN A 178 -5.268 63.473 42.050 1.00 0.00 H ATOM 2686 N TRP A 179 -6.932 65.646 40.477 1.00 32.94 N ATOM 2687 CA TRP A 179 -7.672 66.881 40.214 1.00 34.24 C ATOM 2688 C TRP A 179 -6.716 67.977 39.744 1.00 35.67 C ATOM 2689 O TRP A 179 -7.028 68.723 38.794 1.00 36.50 O ATOM 2690 CB TRP A 179 -8.404 67.338 41.472 1.00 32.58 C ATOM 2691 CG TRP A 179 -9.474 68.345 41.206 1.00 34.07 C ATOM 2692 CD1 TRP A 179 -10.818 68.112 40.978 1.00 34.27 C ATOM 2693 CD2 TRP A 179 -9.290 69.772 41.105 1.00 33.65 C ATOM 2694 NE1 TRP A 179 -11.467 69.316 40.739 1.00 33.05 N ATOM 2695 CE2 TRP A 179 -10.551 70.340 40.816 1.00 32.98 C ATOM 2696 CE3 TRP A 179 -8.181 70.610 41.224 1.00 32.22 C ATOM 2697 CZ2 TRP A 179 -10.723 71.707 40.645 1.00 32.37 C ATOM 2698 CZ3 TRP A 179 -8.358 71.975 41.056 1.00 34.31 C ATOM 2699 CH2 TRP A 179 -9.615 72.511 40.769 1.00 33.42 C ATOM 2700 HA TRP A 179 -8.404 66.687 39.430 1.00 0.00 H ATOM 2701 HB2 TRP A 179 -8.859 66.466 41.942 1.00 0.00 H ATOM 2702 HB3 TRP A 179 -7.677 67.779 42.154 1.00 0.00 H ATOM 2703 HE1 TRP A 179 -12.481 69.426 40.535 1.00 0.00 H ATOM 2704 HD1 TRP A 179 -11.295 67.132 40.985 1.00 0.00 H ATOM 2705 HZ2 TRP A 179 -11.703 72.128 40.420 1.00 0.00 H ATOM 2706 HH2 TRP A 179 -9.720 73.588 40.641 1.00 0.00 H ATOM 2707 HZ3 TRP A 179 -7.501 72.641 41.150 1.00 0.00 H ATOM 2708 HE3 TRP A 179 -7.195 70.200 41.445 1.00 0.00 H ATOM 2709 H TRP A 179 -6.887 65.276 41.448 1.00 0.00 H ATOM 2710 N VAL A 180 -5.552 68.073 40.385 1.00 35.74 N ATOM 2711 CA VAL A 180 -4.547 69.073 39.987 1.00 35.06 C ATOM 2712 C VAL A 180 -4.080 68.724 38.553 1.00 36.99 C ATOM 2713 O VAL A 180 -3.971 69.593 37.686 1.00 37.46 O ATOM 2714 CB VAL A 180 -3.349 69.014 40.982 1.00 34.73 C ATOM 2715 CG1 VAL A 180 -2.106 69.686 40.440 1.00 33.77 C ATOM 2716 CG2 VAL A 180 -3.775 69.610 42.317 1.00 33.45 C ATOM 2717 HA VAL A 180 -4.962 70.081 40.006 1.00 0.00 H ATOM 2718 HB VAL A 180 -3.077 67.968 41.126 1.00 0.00 H ATOM 2719 HG11 VAL A 180 -1.800 69.192 39.518 1.00 0.00 H ATOM 2720 HG12 VAL A 180 -2.321 70.735 40.237 1.00 0.00 H ATOM 2721 HG13 VAL A 180 -1.305 69.614 41.176 1.00 0.00 H ATOM 2722 HG21 VAL A 180 -4.078 70.647 42.170 1.00 0.00 H ATOM 2723 HG22 VAL A 180 -4.612 69.039 42.718 1.00 0.00 H ATOM 2724 HG23 VAL A 180 -2.939 69.570 43.015 1.00 0.00 H ATOM 2725 H VAL A 180 -5.350 67.432 41.179 1.00 0.00 H ATOM 2726 N HIS A 181 -3.801 67.444 38.302 1.00 36.24 N ATOM 2727 CA HIS A 181 -3.367 67.030 36.972 1.00 35.85 C ATOM 2728 C HIS A 181 -4.395 67.445 35.911 1.00 35.87 C ATOM 2729 O HIS A 181 -4.039 67.985 34.887 1.00 34.92 O ATOM 2730 CB HIS A 181 -3.191 65.522 36.939 1.00 37.85 C ATOM 2731 CG HIS A 181 -2.669 65.011 35.635 1.00 42.62 C ATOM 2732 ND1 HIS A 181 -1.328 65.025 35.314 1.00 44.44 N ATOM 2733 CD2 HIS A 181 -3.312 64.486 34.563 1.00 41.86 C ATOM 2734 CE1 HIS A 181 -1.164 64.520 34.104 1.00 44.99 C ATOM 2735 NE2 HIS A 181 -2.352 64.187 33.630 1.00 46.12 N ATOM 2736 HA HIS A 181 -2.418 67.519 36.751 1.00 0.00 H ATOM 2737 HB2 HIS A 181 -2.492 65.239 37.726 1.00 0.00 H ATOM 2738 HB3 HIS A 181 -4.158 65.057 37.130 1.00 0.00 H ATOM 2739 HD2 HIS A 181 -4.386 64.331 34.462 1.00 0.00 H ATOM 2740 HE1 HIS A 181 -0.213 64.399 33.586 1.00 0.00 H ATOM 2741 H HIS A 181 -3.893 66.737 39.059 1.00 0.00 H ATOM 2742 N ASP A 182 -5.669 67.198 36.184 1.00 35.16 N ATOM 2743 CA ASP A 182 -6.733 67.517 35.265 1.00 36.60 C ATOM 2744 C ASP A 182 -7.142 69.012 35.156 1.00 37.29 C ATOM 2745 O ASP A 182 -7.630 69.408 34.113 1.00 39.56 O ATOM 2746 CB ASP A 182 -8.023 66.779 35.637 1.00 35.26 C ATOM 2747 CG ASP A 182 -7.882 65.269 35.644 1.00 35.79 C ATOM 2748 OD1 ASP A 182 -6.959 64.681 35.047 1.00 38.56 O ATOM 2749 OD2 ASP A 182 -8.728 64.658 36.274 1.00 39.78 O ATOM 2750 HA ASP A 182 -6.301 67.212 34.312 1.00 0.00 H ATOM 2751 HB2 ASP A 182 -8.329 67.101 36.632 1.00 0.00 H ATOM 2752 HB3 ASP A 182 -8.794 67.049 34.916 1.00 0.00 H ATOM 2753 H ASP A 182 -5.910 66.758 37.095 1.00 0.00 H ATOM 2754 N ASN A 183 -6.925 69.816 36.188 1.00 35.42 N ATOM 2755 CA ASN A 183 -7.425 71.185 36.199 1.00 35.43 C ATOM 2756 C ASN A 183 -6.489 72.325 36.463 1.00 37.07 C ATOM 2757 O ASN A 183 -6.864 73.507 36.234 1.00 37.61 O ATOM 2758 CB ASN A 183 -8.502 71.291 37.275 1.00 35.94 C ATOM 2759 CG ASN A 183 -9.707 70.412 36.985 1.00 37.20 C ATOM 2760 OD1 ASN A 183 -10.579 70.758 36.155 1.00 36.97 O ATOM 2761 ND2 ASN A 183 -9.756 69.264 37.640 1.00 35.17 N ATOM 2762 HA ASN A 183 -7.736 71.314 35.162 1.00 0.00 H ATOM 2763 HB2 ASN A 183 -8.072 70.990 38.230 1.00 0.00 H ATOM 2764 HB3 ASN A 183 -8.833 72.328 37.337 1.00 0.00 H ATOM 2765 HD22 ASN A 183 -9.008 69.021 38.320 1.00 0.00 H ATOM 2766 HD21 ASN A 183 -10.543 68.604 37.475 1.00 0.00 H ATOM 2767 H ASN A 183 -6.388 69.463 37.005 1.00 0.00 H ATOM 2768 N ILE A 184 -5.284 72.035 36.959 1.00 36.04 N ATOM 2769 CA ILE A 184 -4.402 73.148 37.301 1.00 35.93 C ATOM 2770 C ILE A 184 -4.065 74.092 36.115 1.00 36.13 C ATOM 2771 O ILE A 184 -3.719 75.276 36.337 1.00 36.24 O ATOM 2772 CB ILE A 184 -3.096 72.653 38.025 1.00 35.91 C ATOM 2773 CG1 ILE A 184 -2.561 73.805 38.899 1.00 35.02 C ATOM 2774 CG2 ILE A 184 -2.038 72.171 37.001 1.00 34.50 C ATOM 2775 CD1 ILE A 184 -3.440 74.026 40.158 1.00 32.95 C ATOM 2776 HA ILE A 184 -4.977 73.756 37.999 1.00 0.00 H ATOM 2777 HB ILE A 184 -3.324 71.796 38.658 1.00 0.00 H ATOM 2778 HG12 ILE A 184 -1.545 73.567 39.214 1.00 0.00 H ATOM 2779 HG13 ILE A 184 -2.552 74.721 38.309 1.00 0.00 H ATOM 2780 HD11 ILE A 184 -4.457 74.271 39.851 1.00 0.00 H ATOM 2781 HD12 ILE A 184 -3.449 73.116 40.757 1.00 0.00 H ATOM 2782 HD13 ILE A 184 -3.029 74.846 40.747 1.00 0.00 H ATOM 2783 HG21 ILE A 184 -2.448 71.346 36.418 1.00 0.00 H ATOM 2784 HG22 ILE A 184 -1.777 72.994 36.335 1.00 0.00 H ATOM 2785 HG23 ILE A 184 -1.147 71.835 37.532 1.00 0.00 H ATOM 2786 H ILE A 184 -4.983 71.049 37.097 1.00 0.00 H ATOM 2787 N GLN A 185 -4.168 73.586 34.879 1.00 34.40 N ATOM 2788 CA GLN A 185 -3.890 74.410 33.686 1.00 35.44 C ATOM 2789 C GLN A 185 -4.812 75.647 33.665 1.00 35.72 C ATOM 2790 O GLN A 185 -4.412 76.724 33.204 1.00 35.49 O ATOM 2791 CB GLN A 185 -4.115 73.598 32.386 1.00 35.27 C ATOM 2792 CG GLN A 185 -5.533 73.189 32.185 1.00 36.21 C ATOM 2793 CD GLN A 185 -5.690 72.049 31.169 1.00 41.16 C ATOM 2794 OE1 GLN A 185 -5.258 70.923 31.429 1.00 41.90 O ATOM 2795 NE2 GLN A 185 -6.304 72.338 30.012 1.00 38.99 N ATOM 2796 HA GLN A 185 -2.847 74.724 33.736 1.00 0.00 H ATOM 2797 HB2 GLN A 185 -3.808 74.210 31.538 1.00 0.00 H ATOM 2798 HB3 GLN A 185 -3.498 72.700 32.427 1.00 0.00 H ATOM 2799 HG2 GLN A 185 -5.939 72.860 33.142 1.00 0.00 H ATOM 2800 HG3 GLN A 185 -6.097 74.052 31.830 1.00 0.00 H ATOM 2801 HE22 GLN A 185 -6.653 73.302 29.835 1.00 0.00 H ATOM 2802 HE21 GLN A 185 -6.431 71.598 29.292 1.00 0.00 H ATOM 2803 H GLN A 185 -4.450 72.592 34.757 1.00 0.00 H ATOM 2804 N PHE A 186 -6.028 75.490 34.182 1.00 35.71 N ATOM 2805 CA PHE A 186 -6.990 76.607 34.183 1.00 37.73 C ATOM 2806 C PHE A 186 -6.600 77.720 35.147 1.00 38.48 C ATOM 2807 O PHE A 186 -7.060 78.852 35.004 1.00 39.00 O ATOM 2808 CB PHE A 186 -8.376 76.075 34.515 1.00 35.13 C ATOM 2809 CG PHE A 186 -8.824 75.040 33.553 1.00 39.11 C ATOM 2810 CD1 PHE A 186 -8.828 75.323 32.166 1.00 36.19 C ATOM 2811 CD2 PHE A 186 -9.116 73.740 33.986 1.00 36.65 C ATOM 2812 CE1 PHE A 186 -9.102 74.340 31.230 1.00 38.02 C ATOM 2813 CE2 PHE A 186 -9.389 72.746 33.055 1.00 38.68 C ATOM 2814 CZ PHE A 186 -9.384 73.038 31.659 1.00 38.90 C ATOM 2815 HA PHE A 186 -6.987 77.048 33.186 1.00 0.00 H ATOM 2816 HB2 PHE A 186 -8.355 75.640 35.514 1.00 0.00 H ATOM 2817 HB3 PHE A 186 -9.084 76.903 34.495 1.00 0.00 H ATOM 2818 HD2 PHE A 186 -9.129 73.509 35.051 1.00 0.00 H ATOM 2819 HE2 PHE A 186 -9.609 71.734 33.394 1.00 0.00 H ATOM 2820 HZ PHE A 186 -9.598 72.254 30.933 1.00 0.00 H ATOM 2821 HE1 PHE A 186 -9.098 74.579 30.166 1.00 0.00 H ATOM 2822 HD1 PHE A 186 -8.611 76.336 31.828 1.00 0.00 H ATOM 2823 H PHE A 186 -6.302 74.573 34.588 1.00 0.00 H ATOM 2824 N PHE A 187 -5.736 77.396 36.115 1.00 38.09 N ATOM 2825 CA PHE A 187 -5.284 78.369 37.090 1.00 36.83 C ATOM 2826 C PHE A 187 -3.913 78.892 36.679 1.00 37.00 C ATOM 2827 O PHE A 187 -3.273 79.629 37.428 1.00 36.49 O ATOM 2828 CB PHE A 187 -5.203 77.735 38.474 1.00 35.72 C ATOM 2829 CG PHE A 187 -6.520 77.261 38.990 1.00 36.46 C ATOM 2830 CD1 PHE A 187 -7.027 75.994 38.616 1.00 35.75 C ATOM 2831 CD2 PHE A 187 -7.281 78.084 39.847 1.00 34.59 C ATOM 2832 CE1 PHE A 187 -8.257 75.555 39.079 1.00 35.07 C ATOM 2833 CE2 PHE A 187 -8.502 77.674 40.320 1.00 31.81 C ATOM 2834 CZ PHE A 187 -9.018 76.395 39.941 1.00 34.04 C ATOM 2835 HA PHE A 187 -5.995 79.194 37.128 1.00 0.00 H ATOM 2836 HB2 PHE A 187 -4.525 76.883 38.424 1.00 0.00 H ATOM 2837 HB3 PHE A 187 -4.805 78.474 39.170 1.00 0.00 H ATOM 2838 HD2 PHE A 187 -6.893 79.060 40.138 1.00 0.00 H ATOM 2839 HE2 PHE A 187 -9.077 78.321 40.983 1.00 0.00 H ATOM 2840 HZ PHE A 187 -9.989 76.065 40.310 1.00 0.00 H ATOM 2841 HE1 PHE A 187 -8.638 74.577 38.786 1.00 0.00 H ATOM 2842 HD1 PHE A 187 -6.442 75.355 37.955 1.00 0.00 H ATOM 2843 H PHE A 187 -5.379 76.421 36.170 1.00 0.00 H ATOM 2844 N GLY A 188 -3.456 78.522 35.488 1.00 37.28 N ATOM 2845 CA GLY A 188 -2.139 78.982 35.061 1.00 36.13 C ATOM 2846 C GLY A 188 -0.972 78.030 35.349 1.00 38.07 C ATOM 2847 O GLY A 188 0.206 78.338 35.030 1.00 37.64 O ATOM 2848 HA3 GLY A 188 -1.934 79.925 35.567 1.00 0.00 H ATOM 2849 HA2 GLY A 188 -2.176 79.149 33.985 1.00 0.00 H ATOM 2850 H GLY A 188 -4.029 77.913 34.869 1.00 0.00 H ATOM 2851 N GLY A 189 -1.270 76.873 35.945 1.00 37.09 N ATOM 2852 CA GLY A 189 -0.193 75.928 36.248 1.00 37.32 C ATOM 2853 C GLY A 189 0.080 74.917 35.132 1.00 38.42 C ATOM 2854 O GLY A 189 -0.818 74.510 34.417 1.00 37.80 O ATOM 2855 HA3 GLY A 189 -0.462 75.379 37.150 1.00 0.00 H ATOM 2856 HA2 GLY A 189 0.720 76.495 36.428 1.00 0.00 H ATOM 2857 H GLY A 189 -2.255 76.646 36.191 1.00 0.00 H ATOM 2858 N ASP A 190 1.340 74.530 34.983 1.00 37.66 N ATOM 2859 CA ASP A 190 1.754 73.550 34.020 1.00 37.84 C ATOM 2860 C ASP A 190 1.601 72.135 34.659 1.00 38.14 C ATOM 2861 O ASP A 190 2.431 71.722 35.472 1.00 40.51 O ATOM 2862 CB ASP A 190 3.220 73.838 33.631 1.00 37.59 C ATOM 2863 CG ASP A 190 3.776 72.819 32.654 1.00 37.82 C ATOM 2864 OD1 ASP A 190 3.106 71.807 32.357 1.00 38.29 O ATOM 2865 OD2 ASP A 190 4.909 73.026 32.209 1.00 38.14 O ATOM 2866 HA ASP A 190 1.142 73.591 33.119 1.00 0.00 H ATOM 2867 HB2 ASP A 190 3.272 74.826 33.173 1.00 0.00 H ATOM 2868 HB3 ASP A 190 3.830 73.825 34.534 1.00 0.00 H ATOM 2869 H ASP A 190 2.064 74.958 35.595 1.00 0.00 H ATOM 2870 N PRO A 191 0.563 71.371 34.285 1.00 37.71 N ATOM 2871 CA PRO A 191 0.452 70.050 34.911 1.00 38.60 C ATOM 2872 C PRO A 191 1.612 69.098 34.624 1.00 40.50 C ATOM 2873 O PRO A 191 1.672 68.036 35.208 1.00 42.63 O ATOM 2874 CB PRO A 191 -0.875 69.513 34.391 1.00 37.31 C ATOM 2875 CG PRO A 191 -0.908 70.095 32.952 1.00 37.49 C ATOM 2876 CD PRO A 191 -0.314 71.494 33.099 1.00 37.18 C ATOM 2877 HA PRO A 191 0.493 70.135 35.997 1.00 0.00 H ATOM 2878 HD3 PRO A 191 0.261 71.769 32.215 1.00 0.00 H ATOM 2879 HD2 PRO A 191 -1.096 72.235 33.267 1.00 0.00 H ATOM 2880 HG3 PRO A 191 -1.931 70.146 32.579 1.00 0.00 H ATOM 2881 HG2 PRO A 191 -0.306 69.488 32.276 1.00 0.00 H ATOM 2882 HB2 PRO A 191 -0.886 68.423 34.380 1.00 0.00 H ATOM 2883 HB3 PRO A 191 -1.712 69.877 34.987 1.00 0.00 H ATOM 2884 N LYS A 192 2.541 69.455 33.751 1.00 41.53 N ATOM 2885 CA LYS A 192 3.630 68.539 33.499 1.00 42.71 C ATOM 2886 C LYS A 192 4.821 68.856 34.356 1.00 42.52 C ATOM 2887 O LYS A 192 5.849 68.167 34.311 1.00 40.61 O ATOM 2888 CB LYS A 192 3.998 68.548 32.009 1.00 46.15 C ATOM 2889 CG LYS A 192 2.924 67.787 31.237 1.00 51.35 C ATOM 2890 CD LYS A 192 2.530 66.468 32.031 1.00 52.69 C ATOM 2891 CE LYS A 192 1.304 65.769 31.437 1.00 52.75 C ATOM 2892 NZ LYS A 192 0.121 66.671 31.383 1.00 53.09 N ATOM 2893 HA LYS A 192 3.300 67.535 33.765 1.00 0.00 H ATOM 2894 HB2 LYS A 192 4.050 69.576 31.650 1.00 0.00 H ATOM 2895 HB3 LYS A 192 4.965 68.065 31.866 1.00 0.00 H ATOM 2896 HG2 LYS A 192 2.043 68.419 31.122 1.00 0.00 H ATOM 2897 HG3 LYS A 192 3.307 67.517 30.253 1.00 0.00 H ATOM 2898 HD2 LYS A 192 3.373 65.778 32.003 1.00 0.00 H ATOM 2899 HD3 LYS A 192 2.314 66.734 33.066 1.00 0.00 H ATOM 2900 HE2 LYS A 192 1.059 64.903 32.052 1.00 0.00 H ATOM 2901 HE3 LYS A 192 1.542 65.439 30.426 1.00 0.00 H ATOM 2902 HZ1 LYS A 192 -0.118 66.986 32.345 1.00 0.00 H ATOM 2903 HZ2 LYS A 192 0.343 67.497 30.792 1.00 0.00 H ATOM 2904 HZ3 LYS A 192 -0.686 66.158 30.975 1.00 0.00 H ATOM 2905 H LYS A 192 2.489 70.370 33.260 1.00 0.00 H ATOM 2906 N THR A 193 4.673 69.892 35.163 1.00 40.63 N ATOM 2907 CA THR A 193 5.760 70.289 36.033 1.00 41.65 C ATOM 2908 C THR A 193 5.209 70.461 37.463 1.00 40.19 C ATOM 2909 O THR A 193 5.275 71.587 38.013 1.00 39.59 O ATOM 2910 CB THR A 193 6.307 71.610 35.532 1.00 44.22 C ATOM 2911 OG1 THR A 193 6.567 71.471 34.133 1.00 48.66 O ATOM 2912 CG2 THR A 193 7.559 72.006 36.244 1.00 45.35 C ATOM 2913 HA THR A 193 6.550 69.539 36.038 1.00 0.00 H ATOM 2914 HB THR A 193 5.574 72.394 35.722 1.00 0.00 H ATOM 2915 HG1 THR A 193 5.725 71.246 33.663 1.00 0.00 H ATOM 2916 HG23 THR A 193 7.352 72.110 37.309 1.00 0.00 H ATOM 2917 HG21 THR A 193 8.319 71.240 36.093 1.00 0.00 H ATOM 2918 HG22 THR A 193 7.916 72.957 35.847 1.00 0.00 H ATOM 2919 H THR A 193 3.778 70.421 35.173 1.00 0.00 H ATOM 2920 N VAL A 194 4.556 69.401 37.963 1.00 35.87 N ATOM 2921 CA VAL A 194 3.993 69.365 39.303 1.00 34.08 C ATOM 2922 C VAL A 194 4.978 68.694 40.269 1.00 33.72 C ATOM 2923 O VAL A 194 5.393 67.532 40.086 1.00 34.77 O ATOM 2924 CB VAL A 194 2.664 68.553 39.376 1.00 34.67 C ATOM 2925 CG1 VAL A 194 2.244 68.388 40.834 1.00 33.24 C ATOM 2926 CG2 VAL A 194 1.520 69.263 38.585 1.00 33.17 C ATOM 2927 HA VAL A 194 3.796 70.402 39.575 1.00 0.00 H ATOM 2928 HB VAL A 194 2.839 67.577 38.924 1.00 0.00 H ATOM 2929 HG11 VAL A 194 3.025 67.856 41.378 1.00 0.00 H ATOM 2930 HG12 VAL A 194 2.094 69.371 41.281 1.00 0.00 H ATOM 2931 HG13 VAL A 194 1.315 67.820 40.881 1.00 0.00 H ATOM 2932 HG21 VAL A 194 1.346 70.252 39.009 1.00 0.00 H ATOM 2933 HG22 VAL A 194 1.810 69.361 37.539 1.00 0.00 H ATOM 2934 HG23 VAL A 194 0.608 68.670 38.657 1.00 0.00 H ATOM 2935 H VAL A 194 4.447 68.561 37.360 1.00 0.00 H ATOM 2936 N THR A 195 5.358 69.426 41.308 1.00 33.62 N ATOM 2937 CA THR A 195 6.245 68.888 42.321 1.00 31.44 C ATOM 2938 C THR A 195 5.456 68.697 43.578 1.00 31.58 C ATOM 2939 O THR A 195 4.880 69.684 44.108 1.00 32.28 O ATOM 2940 CB THR A 195 7.407 69.838 42.627 1.00 29.62 C ATOM 2941 OG1 THR A 195 8.181 69.960 41.457 1.00 31.25 O ATOM 2942 CG2 THR A 195 8.364 69.282 43.740 1.00 30.14 C ATOM 2943 HA THR A 195 6.658 67.950 41.950 1.00 0.00 H ATOM 2944 HB THR A 195 6.981 70.781 42.969 1.00 0.00 H ATOM 2945 HG1 THR A 195 7.620 70.326 40.728 1.00 0.00 H ATOM 2946 HG23 THR A 195 7.809 69.169 44.671 1.00 0.00 H ATOM 2947 HG21 THR A 195 8.756 68.314 43.430 1.00 0.00 H ATOM 2948 HG22 THR A 195 9.189 69.979 43.889 1.00 0.00 H ATOM 2949 H THR A 195 5.014 70.403 41.398 1.00 0.00 H ATOM 2950 N ILE A 196 5.400 67.454 44.073 1.00 29.83 N ATOM 2951 CA ILE A 196 4.729 67.217 45.366 1.00 29.54 C ATOM 2952 C ILE A 196 5.817 67.327 46.441 1.00 29.96 C ATOM 2953 O ILE A 196 6.985 66.928 46.225 1.00 29.98 O ATOM 2954 CB ILE A 196 4.026 65.832 45.444 1.00 31.03 C ATOM 2955 CG1 ILE A 196 5.000 64.688 45.125 1.00 28.28 C ATOM 2956 CG2 ILE A 196 2.897 65.787 44.432 1.00 27.91 C ATOM 2957 CD1 ILE A 196 4.338 63.276 45.329 1.00 29.30 C ATOM 2958 HA ILE A 196 3.935 67.951 45.505 1.00 0.00 H ATOM 2959 HB ILE A 196 3.651 65.705 46.459 1.00 0.00 H ATOM 2960 HG12 ILE A 196 5.323 64.779 44.088 1.00 0.00 H ATOM 2961 HG13 ILE A 196 5.866 64.769 45.782 1.00 0.00 H ATOM 2962 HD11 ILE A 196 4.018 63.172 46.366 1.00 0.00 H ATOM 2963 HD12 ILE A 196 3.475 63.182 44.670 1.00 0.00 H ATOM 2964 HD13 ILE A 196 5.064 62.498 45.092 1.00 0.00 H ATOM 2965 HG21 ILE A 196 2.178 66.575 44.656 1.00 0.00 H ATOM 2966 HG22 ILE A 196 3.302 65.936 43.431 1.00 0.00 H ATOM 2967 HG23 ILE A 196 2.402 64.817 44.484 1.00 0.00 H ATOM 2968 H ILE A 196 5.826 66.662 43.551 1.00 0.00 H ATOM 2969 N PHE A 197 5.472 67.990 47.548 1.00 30.61 N ATOM 2970 CA PHE A 197 6.399 68.172 48.642 1.00 29.71 C ATOM 2971 C PHE A 197 5.639 68.075 49.958 1.00 29.69 C ATOM 2972 O PHE A 197 4.463 68.387 50.039 1.00 31.89 O ATOM 2973 CB PHE A 197 7.204 69.481 48.477 1.00 30.83 C ATOM 2974 CG PHE A 197 6.459 70.780 48.787 1.00 30.26 C ATOM 2975 CD1 PHE A 197 5.310 71.152 48.097 1.00 29.37 C ATOM 2976 CD2 PHE A 197 7.038 71.706 49.683 1.00 30.59 C ATOM 2977 CE1 PHE A 197 4.738 72.448 48.291 1.00 31.50 C ATOM 2978 CE2 PHE A 197 6.495 73.012 49.898 1.00 29.95 C ATOM 2979 CZ PHE A 197 5.350 73.393 49.211 1.00 30.27 C ATOM 2980 HA PHE A 197 7.147 67.379 48.641 1.00 0.00 H ATOM 2981 HB2 PHE A 197 8.067 69.426 49.141 1.00 0.00 H ATOM 2982 HB3 PHE A 197 7.546 69.533 47.443 1.00 0.00 H ATOM 2983 HD2 PHE A 197 7.933 71.414 50.232 1.00 0.00 H ATOM 2984 HE2 PHE A 197 6.975 73.701 50.594 1.00 0.00 H ATOM 2985 HZ PHE A 197 4.918 74.383 49.359 1.00 0.00 H ATOM 2986 HE1 PHE A 197 3.837 72.729 47.746 1.00 0.00 H ATOM 2987 HD1 PHE A 197 4.843 70.452 47.405 1.00 0.00 H ATOM 2988 H PHE A 197 4.513 68.385 47.625 1.00 0.00 H ATOM 2989 N GLY A 198 6.288 67.590 50.990 1.00 29.01 N ATOM 2990 CA GLY A 198 5.588 67.428 52.254 1.00 28.63 C ATOM 2991 C GLY A 198 6.590 67.113 53.350 1.00 28.39 C ATOM 2992 O GLY A 198 7.743 66.733 53.089 1.00 27.88 O ATOM 2993 HA3 GLY A 198 4.871 66.611 52.171 1.00 0.00 H ATOM 2994 HA2 GLY A 198 5.060 68.350 52.498 1.00 0.00 H ATOM 2995 H GLY A 198 7.290 67.325 50.905 1.00 0.00 H ATOM 2996 N GLU A 199 6.156 67.301 54.581 1.00 28.75 N ATOM 2997 CA GLU A 199 7.042 67.090 55.693 1.00 28.70 C ATOM 2998 C GLU A 199 6.573 65.977 56.634 1.00 28.42 C ATOM 2999 O GLU A 199 5.398 65.853 56.879 1.00 28.34 O ATOM 3000 CB GLU A 199 7.187 68.438 56.476 1.00 28.21 C ATOM 3001 CG GLU A 199 8.210 68.383 57.645 1.00 27.54 C ATOM 3002 CD GLU A 199 7.583 68.003 58.979 1.00 29.52 C ATOM 3003 OE1 GLU A 199 6.303 67.950 59.076 1.00 28.63 O ATOM 3004 OE2 GLU A 199 8.376 67.754 59.955 1.00 30.54 O ATOM 3005 HA GLU A 199 8.004 66.764 55.298 1.00 0.00 H ATOM 3006 HB2 GLU A 199 7.508 69.209 55.775 1.00 0.00 H ATOM 3007 HB3 GLU A 199 6.212 68.704 56.885 1.00 0.00 H ATOM 3008 HG2 GLU A 199 8.976 67.647 57.400 1.00 0.00 H ATOM 3009 HG3 GLU A 199 8.672 69.365 57.747 1.00 0.00 H ATOM 3010 H GLU A 199 5.174 67.601 54.747 1.00 0.00 H ATOM 3011 N SER A 200 7.512 65.188 57.154 1.00 27.81 N ATOM 3012 CA SER A 200 7.221 64.110 58.139 1.00 28.61 C ATOM 3013 C SER A 200 6.182 63.144 57.541 1.00 27.26 C ATOM 3014 O SER A 200 6.459 62.593 56.502 1.00 29.44 O ATOM 3015 CB SER A 200 6.784 64.739 59.474 1.00 27.69 C ATOM 3016 OG SER A 200 6.659 63.782 60.544 1.00 30.67 O ATOM 3017 HA SER A 200 8.112 63.520 58.352 1.00 0.00 H ATOM 3018 HB2 SER A 200 5.818 65.223 59.328 1.00 0.00 H ATOM 3019 HB3 SER A 200 7.523 65.486 59.763 1.00 0.00 H ATOM 3020 HG SER A 200 6.377 64.248 61.371 1.00 0.00 H ATOM 3021 H SER A 200 8.498 65.332 56.857 1.00 0.00 H ATOM 3022 N ALA A 201 4.997 62.942 58.114 1.00 28.49 N ATOM 3023 CA ALA A 201 4.073 61.982 57.464 1.00 28.04 C ATOM 3024 C ALA A 201 3.749 62.453 56.018 1.00 29.35 C ATOM 3025 O ALA A 201 3.412 61.646 55.166 1.00 27.99 O ATOM 3026 CB ALA A 201 2.770 61.793 58.313 1.00 25.12 C ATOM 3027 HA ALA A 201 4.562 61.009 57.405 1.00 0.00 H ATOM 3028 HB1 ALA A 201 3.033 61.412 59.300 1.00 0.00 H ATOM 3029 HB2 ALA A 201 2.263 62.752 58.416 1.00 0.00 H ATOM 3030 HB3 ALA A 201 2.111 61.084 57.812 1.00 0.00 H ATOM 3031 H ALA A 201 4.729 63.440 58.987 1.00 0.00 H ATOM 3032 N GLY A 202 3.888 63.763 55.758 1.00 29.24 N ATOM 3033 CA GLY A 202 3.673 64.294 54.426 1.00 29.13 C ATOM 3034 C GLY A 202 4.855 63.953 53.523 1.00 31.84 C ATOM 3035 O GLY A 202 4.692 63.779 52.285 1.00 31.96 O ATOM 3036 HA3 GLY A 202 3.565 65.377 54.483 1.00 0.00 H ATOM 3037 HA2 GLY A 202 2.764 63.861 54.008 1.00 0.00 H ATOM 3038 H GLY A 202 4.155 64.410 56.527 1.00 0.00 H ATOM 3039 N GLY A 203 6.055 63.857 54.107 1.00 31.30 N ATOM 3040 CA GLY A 203 7.215 63.488 53.303 1.00 31.16 C ATOM 3041 C GLY A 203 7.117 61.972 53.056 1.00 30.36 C ATOM 3042 O GLY A 203 7.442 61.483 51.975 1.00 31.83 O ATOM 3043 HA3 GLY A 203 8.134 63.723 53.839 1.00 0.00 H ATOM 3044 HA2 GLY A 203 7.202 64.025 52.355 1.00 0.00 H ATOM 3045 H GLY A 203 6.160 64.044 55.125 1.00 0.00 H ATOM 3046 N ALA A 204 6.669 61.211 54.063 1.00 31.47 N ATOM 3047 CA ALA A 204 6.497 59.746 53.873 1.00 31.53 C ATOM 3048 C ALA A 204 5.466 59.560 52.751 1.00 31.26 C ATOM 3049 O ALA A 204 5.649 58.702 51.857 1.00 30.81 O ATOM 3050 CB ALA A 204 5.978 59.053 55.187 1.00 30.18 C ATOM 3051 HA ALA A 204 7.454 59.288 53.622 1.00 0.00 H ATOM 3052 HB1 ALA A 204 6.696 59.216 55.990 1.00 0.00 H ATOM 3053 HB2 ALA A 204 5.015 59.481 55.466 1.00 0.00 H ATOM 3054 HB3 ALA A 204 5.864 57.983 55.011 1.00 0.00 H ATOM 3055 H ALA A 204 6.441 61.646 54.980 1.00 0.00 H ATOM 3056 N SER A 205 4.358 60.321 52.831 1.00 30.47 N ATOM 3057 CA SER A 205 3.330 60.224 51.808 1.00 29.72 C ATOM 3058 C SER A 205 3.919 60.496 50.415 1.00 30.36 C ATOM 3059 O SER A 205 3.640 59.744 49.469 1.00 31.83 O ATOM 3060 CB SER A 205 2.170 61.222 52.057 1.00 28.01 C ATOM 3061 OG SER A 205 1.424 60.901 53.207 1.00 27.56 O ATOM 3062 HA SER A 205 2.938 59.208 51.856 1.00 0.00 H ATOM 3063 HB2 SER A 205 1.505 61.209 51.193 1.00 0.00 H ATOM 3064 HB3 SER A 205 2.588 62.222 52.178 1.00 0.00 H ATOM 3065 HG SER A 205 2.018 60.917 53.999 1.00 0.00 H ATOM 3066 H SER A 205 4.237 60.980 53.627 1.00 0.00 H ATOM 3067 N VAL A 206 4.715 61.568 50.274 1.00 28.38 N ATOM 3068 CA VAL A 206 5.320 61.854 48.991 1.00 28.95 C ATOM 3069 C VAL A 206 6.110 60.604 48.500 1.00 29.33 C ATOM 3070 O VAL A 206 5.970 60.184 47.352 1.00 30.73 O ATOM 3071 CB VAL A 206 6.257 63.125 49.079 1.00 30.64 C ATOM 3072 CG1 VAL A 206 7.178 63.210 47.854 1.00 28.06 C ATOM 3073 CG2 VAL A 206 5.388 64.419 49.189 1.00 29.07 C ATOM 3074 HA VAL A 206 4.535 62.080 48.269 1.00 0.00 H ATOM 3075 HB VAL A 206 6.880 63.034 49.969 1.00 0.00 H ATOM 3076 HG11 VAL A 206 7.801 62.317 47.806 1.00 0.00 H ATOM 3077 HG12 VAL A 206 6.573 63.281 46.950 1.00 0.00 H ATOM 3078 HG13 VAL A 206 7.812 64.092 47.938 1.00 0.00 H ATOM 3079 HG21 VAL A 206 4.750 64.502 48.310 1.00 0.00 H ATOM 3080 HG22 VAL A 206 4.769 64.365 50.085 1.00 0.00 H ATOM 3081 HG23 VAL A 206 6.041 65.290 49.249 1.00 0.00 H ATOM 3082 H VAL A 206 4.897 62.192 51.086 1.00 0.00 H ATOM 3083 N GLY A 207 6.917 60.003 49.355 1.00 29.37 N ATOM 3084 CA GLY A 207 7.662 58.816 48.940 1.00 28.15 C ATOM 3085 C GLY A 207 6.741 57.630 48.612 1.00 29.37 C ATOM 3086 O GLY A 207 7.067 56.785 47.765 1.00 31.13 O ATOM 3087 HA3 GLY A 207 8.334 58.525 49.747 1.00 0.00 H ATOM 3088 HA2 GLY A 207 8.246 59.062 48.053 1.00 0.00 H ATOM 3089 H GLY A 207 7.022 60.373 50.321 1.00 0.00 H ATOM 3090 N MET A 208 5.591 57.556 49.274 1.00 29.35 N ATOM 3091 CA MET A 208 4.650 56.494 48.978 1.00 29.04 C ATOM 3092 C MET A 208 4.044 56.689 47.573 1.00 31.46 C ATOM 3093 O MET A 208 3.712 55.699 46.897 1.00 30.27 O ATOM 3094 CB MET A 208 3.569 56.423 50.060 1.00 26.83 C ATOM 3095 CG MET A 208 4.136 55.872 51.387 1.00 28.57 C ATOM 3096 SD MET A 208 3.020 56.011 52.780 1.00 30.93 S ATOM 3097 CE MET A 208 3.909 55.091 54.065 1.00 27.36 C ATOM 3098 HA MET A 208 5.178 55.540 48.978 1.00 0.00 H ATOM 3099 HB2 MET A 208 3.172 57.424 50.232 1.00 0.00 H ATOM 3100 HB3 MET A 208 2.767 55.769 49.718 1.00 0.00 H ATOM 3101 HG2 MET A 208 5.047 56.421 51.623 1.00 0.00 H ATOM 3102 HG3 MET A 208 4.375 54.818 51.245 1.00 0.00 H ATOM 3103 HE1 MET A 208 4.058 54.062 53.736 1.00 0.00 H ATOM 3104 HE2 MET A 208 4.876 55.561 54.243 1.00 0.00 H ATOM 3105 HE3 MET A 208 3.325 55.099 54.985 1.00 0.00 H ATOM 3106 H MET A 208 5.366 58.261 50.005 1.00 0.00 H ATOM 3107 N HIS A 209 3.873 57.942 47.126 1.00 30.57 N ATOM 3108 CA HIS A 209 3.337 58.152 45.762 1.00 31.66 C ATOM 3109 C HIS A 209 4.423 57.892 44.732 1.00 31.18 C ATOM 3110 O HIS A 209 4.118 57.584 43.555 1.00 32.83 O ATOM 3111 CB HIS A 209 2.791 59.585 45.580 1.00 30.64 C ATOM 3112 CG HIS A 209 1.557 59.836 46.390 1.00 33.94 C ATOM 3113 ND1 HIS A 209 0.384 59.139 46.176 1.00 31.12 N ATOM 3114 CD2 HIS A 209 1.336 60.638 47.466 1.00 32.59 C ATOM 3115 CE1 HIS A 209 -0.506 59.499 47.088 1.00 33.57 C ATOM 3116 NE2 HIS A 209 0.045 60.403 47.883 1.00 33.68 N ATOM 3117 HA HIS A 209 2.514 57.452 45.619 1.00 0.00 H ATOM 3118 HB2 HIS A 209 3.560 60.294 45.886 1.00 0.00 H ATOM 3119 HB3 HIS A 209 2.555 59.738 44.527 1.00 0.00 H ATOM 3120 HD2 HIS A 209 2.046 61.334 47.913 1.00 0.00 H ATOM 3121 HE1 HIS A 209 -1.523 59.115 47.170 1.00 0.00 H ATOM 3122 H HIS A 209 4.114 58.754 47.729 1.00 0.00 H ATOM 3123 N ILE A 210 5.688 58.042 45.143 1.00 30.67 N ATOM 3124 CA ILE A 210 6.780 57.738 44.236 1.00 31.37 C ATOM 3125 C ILE A 210 6.770 56.180 44.023 1.00 31.99 C ATOM 3126 O ILE A 210 7.022 55.671 42.925 1.00 31.26 O ATOM 3127 CB ILE A 210 8.119 58.195 44.866 1.00 32.73 C ATOM 3128 CG1 ILE A 210 8.300 59.704 44.712 1.00 30.76 C ATOM 3129 CG2 ILE A 210 9.295 57.453 44.259 1.00 32.39 C ATOM 3130 CD1 ILE A 210 9.469 60.156 45.505 1.00 30.57 C ATOM 3131 HA ILE A 210 6.667 58.255 43.283 1.00 0.00 H ATOM 3132 HB ILE A 210 8.085 57.956 45.929 1.00 0.00 H ATOM 3133 HG12 ILE A 210 8.461 59.944 43.661 1.00 0.00 H ATOM 3134 HG13 ILE A 210 7.404 60.214 45.066 1.00 0.00 H ATOM 3135 HD11 ILE A 210 9.307 59.918 46.556 1.00 0.00 H ATOM 3136 HD12 ILE A 210 10.366 59.648 45.150 1.00 0.00 H ATOM 3137 HD13 ILE A 210 9.590 61.233 45.389 1.00 0.00 H ATOM 3138 HG21 ILE A 210 9.177 56.383 44.432 1.00 0.00 H ATOM 3139 HG22 ILE A 210 9.331 57.647 43.187 1.00 0.00 H ATOM 3140 HG23 ILE A 210 10.219 57.797 44.723 1.00 0.00 H ATOM 3141 H ILE A 210 5.888 58.375 46.108 1.00 0.00 H ATOM 3142 N LEU A 211 6.442 55.443 45.077 1.00 31.33 N ATOM 3143 CA LEU A 211 6.413 53.973 45.009 1.00 32.42 C ATOM 3144 C LEU A 211 5.132 53.393 44.366 1.00 32.70 C ATOM 3145 O LEU A 211 5.212 52.503 43.520 1.00 34.18 O ATOM 3146 CB LEU A 211 6.559 53.379 46.403 1.00 30.35 C ATOM 3147 CG LEU A 211 7.946 53.526 47.054 1.00 35.44 C ATOM 3148 CD1 LEU A 211 7.755 53.392 48.538 1.00 36.66 C ATOM 3149 CD2 LEU A 211 8.927 52.455 46.593 1.00 38.19 C ATOM 3150 HA LEU A 211 7.250 53.699 44.367 1.00 0.00 H ATOM 3151 HB2 LEU A 211 5.832 53.867 47.052 1.00 0.00 H ATOM 3152 HB3 LEU A 211 6.331 52.315 46.339 1.00 0.00 H ATOM 3153 HG LEU A 211 8.364 54.491 46.769 1.00 0.00 H ATOM 3154 HD21 LEU A 211 8.537 51.471 46.853 1.00 0.00 H ATOM 3155 HD22 LEU A 211 9.055 52.522 45.513 1.00 0.00 H ATOM 3156 HD23 LEU A 211 9.888 52.608 47.084 1.00 0.00 H ATOM 3157 HD11 LEU A 211 7.081 54.174 48.888 1.00 0.00 H ATOM 3158 HD12 LEU A 211 7.327 52.415 48.761 1.00 0.00 H ATOM 3159 HD13 LEU A 211 8.719 53.491 49.037 1.00 0.00 H ATOM 3160 H LEU A 211 6.200 55.915 45.972 1.00 0.00 H ATOM 3161 N SER A 212 3.966 53.908 44.740 1.00 30.99 N ATOM 3162 CA SER A 212 2.714 53.361 44.232 1.00 32.41 C ATOM 3163 C SER A 212 2.501 53.547 42.738 1.00 32.29 C ATOM 3164 O SER A 212 2.391 54.679 42.272 1.00 32.16 O ATOM 3165 CB SER A 212 1.527 53.974 44.962 1.00 32.71 C ATOM 3166 OG SER A 212 0.380 53.189 44.691 1.00 34.82 O ATOM 3167 HA SER A 212 2.786 52.289 44.416 1.00 0.00 H ATOM 3168 HB2 SER A 212 1.366 54.994 44.612 1.00 0.00 H ATOM 3169 HB3 SER A 212 1.720 53.985 46.035 1.00 0.00 H ATOM 3170 HG SER A 212 0.532 52.264 45.009 1.00 0.00 H ATOM 3171 H SER A 212 3.946 54.710 45.402 1.00 0.00 H ATOM 3172 N PRO A 213 2.429 52.429 41.976 1.00 31.83 N ATOM 3173 CA PRO A 213 2.226 52.501 40.523 1.00 32.46 C ATOM 3174 C PRO A 213 1.057 53.421 40.169 1.00 32.27 C ATOM 3175 O PRO A 213 1.157 54.187 39.218 1.00 32.24 O ATOM 3176 CB PRO A 213 1.945 51.048 40.123 1.00 33.03 C ATOM 3177 CG PRO A 213 2.770 50.265 41.187 1.00 33.94 C ATOM 3178 CD PRO A 213 2.455 51.034 42.459 1.00 30.36 C ATOM 3179 HA PRO A 213 3.084 52.920 39.997 1.00 0.00 H ATOM 3180 HD3 PRO A 213 1.490 50.739 42.872 1.00 0.00 H ATOM 3181 HD2 PRO A 213 3.230 50.890 43.212 1.00 0.00 H ATOM 3182 HG3 PRO A 213 3.836 50.292 40.961 1.00 0.00 H ATOM 3183 HG2 PRO A 213 2.442 49.228 41.259 1.00 0.00 H ATOM 3184 HB2 PRO A 213 0.883 50.814 40.192 1.00 0.00 H ATOM 3185 HB3 PRO A 213 2.297 50.838 39.113 1.00 0.00 H ATOM 3186 N GLY A 214 -0.028 53.359 40.945 1.00 32.45 N ATOM 3187 CA GLY A 214 -1.186 54.191 40.632 1.00 34.41 C ATOM 3188 C GLY A 214 -1.045 55.702 40.920 1.00 35.97 C ATOM 3189 O GLY A 214 -1.963 56.475 40.666 1.00 35.52 O ATOM 3190 HA3 GLY A 214 -2.029 53.819 41.215 1.00 0.00 H ATOM 3191 HA2 GLY A 214 -1.401 54.074 39.570 1.00 0.00 H ATOM 3192 H GLY A 214 -0.048 52.722 41.767 1.00 0.00 H ATOM 3193 N SER A 215 0.096 56.155 41.437 1.00 35.20 N ATOM 3194 CA SER A 215 0.206 57.574 41.711 1.00 35.36 C ATOM 3195 C SER A 215 1.283 58.191 40.852 1.00 34.97 C ATOM 3196 O SER A 215 1.273 59.395 40.603 1.00 34.25 O ATOM 3197 CB SER A 215 0.614 57.843 43.198 1.00 31.72 C ATOM 3198 OG SER A 215 -0.373 57.465 44.116 1.00 34.86 O ATOM 3199 HA SER A 215 -0.772 58.008 41.502 1.00 0.00 H ATOM 3200 HB2 SER A 215 0.809 58.909 43.317 1.00 0.00 H ATOM 3201 HB3 SER A 215 1.523 57.282 43.415 1.00 0.00 H ATOM 3202 HG SER A 215 -0.059 57.658 45.035 1.00 0.00 H ATOM 3203 H SER A 215 0.886 55.509 41.638 1.00 0.00 H ATOM 3204 N ARG A 216 2.240 57.368 40.446 1.00 35.32 N ATOM 3205 CA ARG A 216 3.402 57.881 39.710 1.00 37.10 C ATOM 3206 C ARG A 216 3.167 58.815 38.572 1.00 37.73 C ATOM 3207 O ARG A 216 3.935 59.755 38.388 1.00 37.70 O ATOM 3208 CB ARG A 216 4.268 56.744 39.126 1.00 36.49 C ATOM 3209 CG ARG A 216 4.710 55.730 40.146 1.00 38.45 C ATOM 3210 CD ARG A 216 5.499 54.556 39.498 1.00 35.82 C ATOM 3211 NE ARG A 216 5.772 53.546 40.504 1.00 36.89 N ATOM 3212 CZ ARG A 216 6.204 52.317 40.239 1.00 36.82 C ATOM 3213 NH1 ARG A 216 6.421 51.462 41.235 1.00 34.25 N ATOM 3214 NH2 ARG A 216 6.428 51.963 38.975 1.00 34.65 N ATOM 3215 HA ARG A 216 3.884 58.451 40.504 1.00 0.00 H ATOM 3216 HB2 ARG A 216 3.689 56.230 38.359 1.00 0.00 H ATOM 3217 HB3 ARG A 216 5.156 57.186 38.674 1.00 0.00 H ATOM 3218 HG2 ARG A 216 5.350 56.223 40.878 1.00 0.00 H ATOM 3219 HG3 ARG A 216 3.830 55.328 40.647 1.00 0.00 H ATOM 3220 HD2 ARG A 216 6.439 54.929 39.092 1.00 0.00 H ATOM 3221 HD3 ARG A 216 4.906 54.119 38.695 1.00 0.00 H ATOM 3222 HE ARG A 216 5.619 53.801 41.501 1.00 0.00 H ATOM 3223 HH12 ARG A 216 6.759 50.500 41.030 1.00 0.00 H ATOM 3224 HH11 ARG A 216 6.253 51.756 42.218 1.00 0.00 H ATOM 3225 HH22 ARG A 216 6.766 51.004 38.756 1.00 0.00 H ATOM 3226 HH21 ARG A 216 6.265 52.645 38.207 1.00 0.00 H ATOM 3227 H ARG A 216 2.167 56.351 40.651 1.00 0.00 H ATOM 3228 N ASP A 217 2.126 58.540 37.796 1.00 36.88 N ATOM 3229 CA ASP A 217 1.919 59.339 36.588 1.00 38.18 C ATOM 3230 C ASP A 217 1.378 60.740 36.856 1.00 37.61 C ATOM 3231 O ASP A 217 1.418 61.569 35.963 1.00 38.16 O ATOM 3232 CB ASP A 217 0.954 58.628 35.609 1.00 36.30 C ATOM 3233 CG ASP A 217 1.412 57.190 35.215 1.00 40.85 C ATOM 3234 OD1 ASP A 217 2.533 56.713 35.543 1.00 41.27 O ATOM 3235 OD2 ASP A 217 0.615 56.514 34.541 1.00 41.14 O ATOM 3236 HA ASP A 217 2.912 59.442 36.150 1.00 0.00 H ATOM 3237 HB2 ASP A 217 -0.027 58.561 36.079 1.00 0.00 H ATOM 3238 HB3 ASP A 217 0.880 59.227 34.701 1.00 0.00 H ATOM 3239 H ASP A 217 1.470 57.771 38.042 1.00 0.00 H ATOM 3240 N LEU A 218 0.898 60.993 38.075 1.00 35.85 N ATOM 3241 CA LEU A 218 0.281 62.267 38.413 1.00 35.20 C ATOM 3242 C LEU A 218 1.200 63.436 38.774 1.00 36.37 C ATOM 3243 O LEU A 218 0.714 64.551 39.042 1.00 38.93 O ATOM 3244 CB LEU A 218 -0.700 62.049 39.559 1.00 34.94 C ATOM 3245 CG LEU A 218 -1.743 60.964 39.248 1.00 36.59 C ATOM 3246 CD1 LEU A 218 -2.679 60.853 40.454 1.00 34.39 C ATOM 3247 CD2 LEU A 218 -2.530 61.305 37.969 1.00 34.68 C ATOM 3248 HA LEU A 218 -0.189 62.581 37.481 1.00 0.00 H ATOM 3249 HB2 LEU A 218 -0.140 61.751 40.446 1.00 0.00 H ATOM 3250 HB3 LEU A 218 -1.220 62.986 39.757 1.00 0.00 H ATOM 3251 HG LEU A 218 -1.247 60.010 39.070 1.00 0.00 H ATOM 3252 HD21 LEU A 218 -3.044 62.257 38.103 1.00 0.00 H ATOM 3253 HD22 LEU A 218 -1.840 61.379 37.128 1.00 0.00 H ATOM 3254 HD23 LEU A 218 -3.261 60.520 37.773 1.00 0.00 H ATOM 3255 HD11 LEU A 218 -2.101 60.580 41.337 1.00 0.00 H ATOM 3256 HD12 LEU A 218 -3.169 61.812 40.621 1.00 0.00 H ATOM 3257 HD13 LEU A 218 -3.431 60.088 40.260 1.00 0.00 H ATOM 3258 H LEU A 218 0.967 60.257 38.806 1.00 0.00 H ATOM 3259 N PHE A 219 2.516 63.229 38.808 1.00 33.66 N ATOM 3260 CA PHE A 219 3.353 64.346 39.195 1.00 32.44 C ATOM 3261 C PHE A 219 4.682 64.200 38.530 1.00 31.99 C ATOM 3262 O PHE A 219 4.998 63.139 37.978 1.00 32.69 O ATOM 3263 CB PHE A 219 3.459 64.429 40.757 1.00 31.88 C ATOM 3264 CG PHE A 219 4.093 63.207 41.403 1.00 31.77 C ATOM 3265 CD1 PHE A 219 3.326 62.025 41.668 1.00 30.73 C ATOM 3266 CD2 PHE A 219 5.471 63.212 41.711 1.00 29.11 C ATOM 3267 CE1 PHE A 219 3.961 60.860 42.243 1.00 29.23 C ATOM 3268 CE2 PHE A 219 6.106 62.089 42.271 1.00 29.78 C ATOM 3269 CZ PHE A 219 5.351 60.890 42.545 1.00 29.38 C ATOM 3270 HA PHE A 219 2.914 65.288 38.867 1.00 0.00 H ATOM 3271 HB2 PHE A 219 4.059 65.302 41.014 1.00 0.00 H ATOM 3272 HB3 PHE A 219 2.454 64.548 41.163 1.00 0.00 H ATOM 3273 HD2 PHE A 219 6.057 64.109 41.510 1.00 0.00 H ATOM 3274 HE2 PHE A 219 7.171 62.124 42.499 1.00 0.00 H ATOM 3275 HZ PHE A 219 5.840 60.018 42.978 1.00 0.00 H ATOM 3276 HE1 PHE A 219 3.377 59.962 42.444 1.00 0.00 H ATOM 3277 HD1 PHE A 219 2.261 62.004 41.435 1.00 0.00 H ATOM 3278 H PHE A 219 2.925 62.304 38.567 1.00 0.00 H ATOM 3279 N ARG A 220 5.485 65.248 38.589 1.00 31.92 N ATOM 3280 CA ARG A 220 6.764 65.210 37.921 1.00 33.30 C ATOM 3281 C ARG A 220 7.992 64.882 38.791 1.00 33.12 C ATOM 3282 O ARG A 220 8.829 64.065 38.399 1.00 34.01 O ATOM 3283 CB ARG A 220 6.950 66.573 37.203 1.00 34.14 C ATOM 3284 CG ARG A 220 8.273 66.814 36.471 1.00 35.75 C ATOM 3285 CD ARG A 220 8.535 65.780 35.399 1.00 40.33 C ATOM 3286 NE ARG A 220 9.607 66.186 34.470 1.00 44.19 N ATOM 3287 CZ ARG A 220 9.433 67.029 33.441 1.00 44.66 C ATOM 3288 NH1 ARG A 220 8.228 67.575 33.198 1.00 43.48 N ATOM 3289 NH2 ARG A 220 10.458 67.302 32.626 1.00 43.02 N ATOM 3290 HA ARG A 220 6.726 64.366 37.232 1.00 0.00 H ATOM 3291 HB2 ARG A 220 6.149 66.667 36.470 1.00 0.00 H ATOM 3292 HB3 ARG A 220 6.846 67.355 37.955 1.00 0.00 H ATOM 3293 HG2 ARG A 220 8.242 67.800 36.007 1.00 0.00 H ATOM 3294 HG3 ARG A 220 9.086 66.781 37.196 1.00 0.00 H ATOM 3295 HD2 ARG A 220 7.618 65.627 34.829 1.00 0.00 H ATOM 3296 HD3 ARG A 220 8.824 64.845 35.879 1.00 0.00 H ATOM 3297 HE ARG A 220 10.558 65.794 34.623 1.00 0.00 H ATOM 3298 HH12 ARG A 220 8.105 68.227 32.397 1.00 0.00 H ATOM 3299 HH11 ARG A 220 7.420 67.345 33.811 1.00 0.00 H ATOM 3300 HH22 ARG A 220 10.328 67.955 31.827 1.00 0.00 H ATOM 3301 HH21 ARG A 220 11.385 66.861 32.791 1.00 0.00 H ATOM 3302 H ARG A 220 5.196 66.097 39.115 1.00 0.00 H ATOM 3303 N ARG A 221 8.138 65.563 39.922 1.00 32.27 N ATOM 3304 CA ARG A 221 9.269 65.363 40.830 1.00 33.56 C ATOM 3305 C ARG A 221 8.809 65.537 42.271 1.00 32.79 C ATOM 3306 O ARG A 221 7.658 65.912 42.524 1.00 31.98 O ATOM 3307 CB ARG A 221 10.451 66.291 40.493 1.00 35.71 C ATOM 3308 CG ARG A 221 10.111 67.771 40.345 1.00 36.82 C ATOM 3309 CD ARG A 221 11.334 68.577 39.766 1.00 37.71 C ATOM 3310 NE ARG A 221 11.812 68.081 38.483 1.00 35.52 N ATOM 3311 CZ ARG A 221 11.570 68.650 37.295 1.00 39.29 C ATOM 3312 NH1 ARG A 221 10.843 69.771 37.214 1.00 40.41 N ATOM 3313 NH2 ARG A 221 12.026 68.088 36.169 1.00 34.77 N ATOM 3314 HA ARG A 221 9.635 64.344 40.702 1.00 0.00 H ATOM 3315 HB2 ARG A 221 11.190 66.195 41.289 1.00 0.00 H ATOM 3316 HB3 ARG A 221 10.886 65.952 39.553 1.00 0.00 H ATOM 3317 HG2 ARG A 221 9.262 67.876 39.669 1.00 0.00 H ATOM 3318 HG3 ARG A 221 9.848 68.176 41.322 1.00 0.00 H ATOM 3319 HD2 ARG A 221 12.153 68.521 40.483 1.00 0.00 H ATOM 3320 HD3 ARG A 221 11.032 69.617 39.642 1.00 0.00 H ATOM 3321 HE ARG A 221 12.388 67.215 38.490 1.00 0.00 H ATOM 3322 HH12 ARG A 221 10.660 70.206 36.287 1.00 0.00 H ATOM 3323 HH11 ARG A 221 10.461 70.207 38.078 1.00 0.00 H ATOM 3324 HH22 ARG A 221 11.834 68.535 35.250 1.00 0.00 H ATOM 3325 HH21 ARG A 221 12.572 67.204 36.213 1.00 0.00 H ATOM 3326 H ARG A 221 7.417 66.269 40.174 1.00 0.00 H ATOM 3327 N ALA A 222 9.712 65.309 43.211 1.00 31.88 N ATOM 3328 CA ALA A 222 9.333 65.239 44.626 1.00 32.53 C ATOM 3329 C ALA A 222 10.321 65.803 45.627 1.00 31.62 C ATOM 3330 O ALA A 222 11.530 65.814 45.390 1.00 34.70 O ATOM 3331 CB ALA A 222 9.030 63.726 44.983 1.00 31.22 C ATOM 3332 HA ALA A 222 8.462 65.887 44.722 1.00 0.00 H ATOM 3333 HB1 ALA A 222 8.214 63.363 44.358 1.00 0.00 H ATOM 3334 HB2 ALA A 222 9.922 63.126 44.803 1.00 0.00 H ATOM 3335 HB3 ALA A 222 8.746 63.652 46.033 1.00 0.00 H ATOM 3336 H ALA A 222 10.708 65.177 42.942 1.00 0.00 H ATOM 3337 N ILE A 223 9.774 66.322 46.723 1.00 31.63 N ATOM 3338 CA ILE A 223 10.555 66.891 47.806 1.00 30.81 C ATOM 3339 C ILE A 223 10.055 66.225 49.078 1.00 31.38 C ATOM 3340 O ILE A 223 8.855 66.220 49.334 1.00 30.24 O ATOM 3341 CB ILE A 223 10.332 68.422 47.909 1.00 32.30 C ATOM 3342 CG1 ILE A 223 10.930 69.123 46.674 1.00 32.11 C ATOM 3343 CG2 ILE A 223 10.988 68.980 49.215 1.00 31.36 C ATOM 3344 CD1 ILE A 223 10.635 70.639 46.688 1.00 30.76 C ATOM 3345 HA ILE A 223 11.620 66.725 47.641 1.00 0.00 H ATOM 3346 HB ILE A 223 9.261 68.620 47.946 1.00 0.00 H ATOM 3347 HG12 ILE A 223 12.009 68.972 46.668 1.00 0.00 H ATOM 3348 HG13 ILE A 223 10.498 68.686 45.774 1.00 0.00 H ATOM 3349 HD11 ILE A 223 9.557 70.798 46.688 1.00 0.00 H ATOM 3350 HD12 ILE A 223 11.069 71.084 47.583 1.00 0.00 H ATOM 3351 HD13 ILE A 223 11.071 71.101 45.802 1.00 0.00 H ATOM 3352 HG21 ILE A 223 10.538 68.495 50.082 1.00 0.00 H ATOM 3353 HG22 ILE A 223 12.059 68.776 49.198 1.00 0.00 H ATOM 3354 HG23 ILE A 223 10.822 70.056 49.272 1.00 0.00 H ATOM 3355 H ILE A 223 8.737 66.320 46.808 1.00 0.00 H ATOM 3356 N LEU A 224 10.976 65.682 49.872 1.00 29.39 N ATOM 3357 CA LEU A 224 10.619 65.029 51.107 1.00 30.14 C ATOM 3358 C LEU A 224 11.382 65.688 52.266 1.00 30.69 C ATOM 3359 O LEU A 224 12.633 65.723 52.285 1.00 31.62 O ATOM 3360 CB LEU A 224 10.956 63.528 51.022 1.00 29.44 C ATOM 3361 CG LEU A 224 10.311 62.702 49.890 1.00 29.46 C ATOM 3362 CD1 LEU A 224 11.001 62.940 48.549 1.00 26.81 C ATOM 3363 CD2 LEU A 224 10.368 61.218 50.295 1.00 28.19 C ATOM 3364 HA LEU A 224 9.548 65.132 51.282 1.00 0.00 H ATOM 3365 HB2 LEU A 224 12.037 63.444 50.909 1.00 0.00 H ATOM 3366 HB3 LEU A 224 10.655 63.074 51.966 1.00 0.00 H ATOM 3367 HG LEU A 224 9.275 63.013 49.755 1.00 0.00 H ATOM 3368 HD21 LEU A 224 11.407 60.920 50.435 1.00 0.00 H ATOM 3369 HD22 LEU A 224 9.820 61.076 51.226 1.00 0.00 H ATOM 3370 HD23 LEU A 224 9.917 60.611 49.510 1.00 0.00 H ATOM 3371 HD11 LEU A 224 10.928 63.996 48.287 1.00 0.00 H ATOM 3372 HD12 LEU A 224 12.050 62.655 48.626 1.00 0.00 H ATOM 3373 HD13 LEU A 224 10.515 62.339 47.780 1.00 0.00 H ATOM 3374 H LEU A 224 11.977 65.730 49.595 1.00 0.00 H ATOM 3375 N GLN A 225 10.634 66.225 53.225 1.00 30.64 N ATOM 3376 CA GLN A 225 11.219 66.924 54.393 1.00 30.70 C ATOM 3377 C GLN A 225 11.002 66.106 55.671 1.00 30.07 C ATOM 3378 O GLN A 225 9.872 65.905 56.158 1.00 28.96 O ATOM 3379 CB GLN A 225 10.579 68.335 54.541 1.00 29.70 C ATOM 3380 CG GLN A 225 10.850 69.229 53.338 1.00 29.66 C ATOM 3381 CD GLN A 225 9.913 70.477 53.229 1.00 31.68 C ATOM 3382 OE1 GLN A 225 9.573 70.882 52.120 1.00 31.43 O ATOM 3383 NE2 GLN A 225 9.527 71.084 54.368 1.00 30.76 N ATOM 3384 HA GLN A 225 12.292 67.036 54.234 1.00 0.00 H ATOM 3385 HB2 GLN A 225 9.501 68.220 54.655 1.00 0.00 H ATOM 3386 HB3 GLN A 225 10.988 68.813 55.431 1.00 0.00 H ATOM 3387 HG2 GLN A 225 11.880 69.581 53.401 1.00 0.00 H ATOM 3388 HG3 GLN A 225 10.726 68.631 52.435 1.00 0.00 H ATOM 3389 HE22 GLN A 225 9.837 70.710 55.288 1.00 0.00 H ATOM 3390 HE21 GLN A 225 8.919 71.927 54.328 1.00 0.00 H ATOM 3391 H GLN A 225 9.599 66.152 53.153 1.00 0.00 H ATOM 3392 N SER A 226 12.108 65.584 56.199 1.00 31.25 N ATOM 3393 CA SER A 226 12.065 64.798 57.430 1.00 30.33 C ATOM 3394 C SER A 226 11.078 63.634 57.411 1.00 30.76 C ATOM 3395 O SER A 226 10.382 63.385 58.427 1.00 28.96 O ATOM 3396 CB SER A 226 11.738 65.703 58.650 1.00 30.06 C ATOM 3397 OG SER A 226 12.695 66.747 58.838 1.00 29.69 O ATOM 3398 HA SER A 226 13.063 64.367 57.514 1.00 0.00 H ATOM 3399 HB2 SER A 226 11.717 65.084 59.547 1.00 0.00 H ATOM 3400 HB3 SER A 226 10.757 66.153 58.497 1.00 0.00 H ATOM 3401 HG SER A 226 12.717 67.322 58.032 1.00 0.00 H ATOM 3402 H SER A 226 13.021 65.739 55.725 1.00 0.00 H ATOM 3403 N GLY A 227 10.997 62.934 56.290 1.00 29.26 N ATOM 3404 CA GLY A 227 10.127 61.761 56.236 1.00 27.60 C ATOM 3405 C GLY A 227 10.454 60.977 54.989 1.00 28.81 C ATOM 3406 O GLY A 227 10.959 61.532 54.009 1.00 28.35 O ATOM 3407 HA3 GLY A 227 9.084 62.078 56.208 1.00 0.00 H ATOM 3408 HA2 GLY A 227 10.293 61.139 57.116 1.00 0.00 H ATOM 3409 H GLY A 227 11.548 63.217 55.455 1.00 0.00 H ATOM 3410 N SER A 228 10.192 59.678 55.025 1.00 28.98 N ATOM 3411 CA SER A 228 10.443 58.831 53.907 1.00 30.51 C ATOM 3412 C SER A 228 9.456 57.678 54.045 1.00 30.23 C ATOM 3413 O SER A 228 8.937 57.400 55.118 1.00 29.17 O ATOM 3414 CB SER A 228 11.930 58.422 53.758 1.00 31.49 C ATOM 3415 OG SER A 228 12.339 57.672 54.806 1.00 35.89 O ATOM 3416 HA SER A 228 10.278 59.348 52.962 1.00 0.00 H ATOM 3417 HB2 SER A 228 12.543 59.322 53.704 1.00 0.00 H ATOM 3418 HB3 SER A 228 12.050 57.846 52.840 1.00 0.00 H ATOM 3419 HG SER A 228 11.789 56.851 54.857 1.00 0.00 H ATOM 3420 H SER A 228 9.793 59.266 55.892 1.00 0.00 H ATOM 3421 N PRO A 229 9.135 57.047 52.922 1.00 30.42 N ATOM 3422 CA PRO A 229 8.135 55.970 52.987 1.00 30.45 C ATOM 3423 C PRO A 229 8.358 54.798 53.870 1.00 30.56 C ATOM 3424 O PRO A 229 7.392 54.219 54.370 1.00 29.92 O ATOM 3425 CB PRO A 229 7.910 55.584 51.496 1.00 30.58 C ATOM 3426 CG PRO A 229 9.340 55.876 50.841 1.00 32.41 C ATOM 3427 CD PRO A 229 9.791 57.172 51.594 1.00 29.14 C ATOM 3428 HA PRO A 229 7.260 56.360 53.507 1.00 0.00 H ATOM 3429 HD3 PRO A 229 10.876 57.206 51.696 1.00 0.00 H ATOM 3430 HD2 PRO A 229 9.448 58.066 51.072 1.00 0.00 H ATOM 3431 HG3 PRO A 229 9.255 56.051 49.768 1.00 0.00 H ATOM 3432 HG2 PRO A 229 10.032 55.053 51.020 1.00 0.00 H ATOM 3433 HB2 PRO A 229 7.639 54.533 51.398 1.00 0.00 H ATOM 3434 HB3 PRO A 229 7.135 56.202 51.042 1.00 0.00 H ATOM 3435 N ASN A 230 9.632 54.450 54.043 1.00 30.22 N ATOM 3436 CA ASN A 230 10.056 53.323 54.818 1.00 31.79 C ATOM 3437 C ASN A 230 10.227 53.650 56.295 1.00 31.98 C ATOM 3438 O ASN A 230 10.787 52.821 57.010 1.00 31.10 O ATOM 3439 CB ASN A 230 11.406 52.788 54.270 1.00 31.84 C ATOM 3440 CG ASN A 230 12.483 53.886 54.224 1.00 33.83 C ATOM 3441 OD1 ASN A 230 12.227 54.980 53.728 1.00 33.78 O ATOM 3442 ND2 ASN A 230 13.676 53.601 54.730 1.00 31.82 N ATOM 3443 HA ASN A 230 9.271 52.571 54.731 1.00 0.00 H ATOM 3444 HB2 ASN A 230 11.753 51.981 54.915 1.00 0.00 H ATOM 3445 HB3 ASN A 230 11.250 52.405 53.262 1.00 0.00 H ATOM 3446 HD22 ASN A 230 13.856 52.663 55.142 1.00 0.00 H ATOM 3447 HD21 ASN A 230 14.432 54.316 54.715 1.00 0.00 H ATOM 3448 H ASN A 230 10.363 55.032 53.587 1.00 0.00 H ATOM 3449 N CYS A 231 9.795 54.826 56.770 1.00 30.88 N ATOM 3450 CA CYS A 231 9.970 55.087 58.206 1.00 32.57 C ATOM 3451 C CYS A 231 9.274 53.960 59.012 1.00 33.72 C ATOM 3452 O CYS A 231 8.195 53.460 58.618 1.00 35.12 O ATOM 3453 CB CYS A 231 9.397 56.466 58.591 1.00 32.54 C ATOM 3454 SG CYS A 231 10.467 57.851 57.985 1.00 33.05 S ATOM 3455 HA CYS A 231 11.034 55.099 58.441 1.00 0.00 H ATOM 3456 HB2 CYS A 231 9.323 56.527 59.677 1.00 0.00 H ATOM 3457 HB3 CYS A 231 8.404 56.570 58.154 1.00 0.00 H ATOM 3458 HG CYS A 231 10.561 57.789 56.610 1.00 0.00 H ATOM 3459 H CYS A 231 9.352 55.529 56.145 1.00 0.00 H ATOM 3460 N PRO A 232 9.893 53.528 60.129 1.00 33.24 N ATOM 3461 CA PRO A 232 9.317 52.450 60.954 1.00 32.08 C ATOM 3462 C PRO A 232 7.918 52.721 61.495 1.00 32.60 C ATOM 3463 O PRO A 232 7.181 51.779 61.838 1.00 32.36 O ATOM 3464 CB PRO A 232 10.369 52.254 62.082 1.00 30.80 C ATOM 3465 CG PRO A 232 10.997 53.678 62.240 1.00 31.47 C ATOM 3466 CD PRO A 232 11.127 54.099 60.734 1.00 31.24 C ATOM 3467 HA PRO A 232 9.146 51.554 60.358 1.00 0.00 H ATOM 3468 HD3 PRO A 232 11.151 55.184 60.629 1.00 0.00 H ATOM 3469 HD2 PRO A 232 12.022 53.671 60.281 1.00 0.00 H ATOM 3470 HG3 PRO A 232 11.968 53.638 62.733 1.00 0.00 H ATOM 3471 HG2 PRO A 232 10.339 54.350 62.791 1.00 0.00 H ATOM 3472 HB2 PRO A 232 9.893 51.932 63.008 1.00 0.00 H ATOM 3473 HB3 PRO A 232 11.124 51.524 61.790 1.00 0.00 H ATOM 3474 N TRP A 233 7.550 53.999 61.611 1.00 32.75 N ATOM 3475 CA TRP A 233 6.217 54.381 62.109 1.00 31.54 C ATOM 3476 C TRP A 233 5.224 54.659 60.998 1.00 31.86 C ATOM 3477 O TRP A 233 4.049 54.884 61.280 1.00 34.46 O ATOM 3478 CB TRP A 233 6.280 55.678 62.941 1.00 30.42 C ATOM 3479 CG TRP A 233 7.084 56.769 62.183 1.00 30.13 C ATOM 3480 CD1 TRP A 233 8.446 56.966 62.244 1.00 30.09 C ATOM 3481 CD2 TRP A 233 6.582 57.751 61.256 1.00 30.02 C ATOM 3482 NE1 TRP A 233 8.819 58.001 61.424 1.00 29.36 N ATOM 3483 CE2 TRP A 233 7.704 58.513 60.808 1.00 29.91 C ATOM 3484 CE3 TRP A 233 5.297 58.074 60.768 1.00 29.59 C ATOM 3485 CZ2 TRP A 233 7.580 59.586 59.893 1.00 29.26 C ATOM 3486 CZ3 TRP A 233 5.160 59.154 59.857 1.00 28.90 C ATOM 3487 CH2 TRP A 233 6.302 59.900 59.427 1.00 29.95 C ATOM 3488 HA TRP A 233 5.893 53.526 62.703 1.00 0.00 H ATOM 3489 HB2 TRP A 233 5.267 56.038 63.122 1.00 0.00 H ATOM 3490 HB3 TRP A 233 6.766 55.470 63.894 1.00 0.00 H ATOM 3491 HE1 TRP A 233 9.792 58.343 61.290 1.00 0.00 H ATOM 3492 HD1 TRP A 233 9.131 56.382 62.858 1.00 0.00 H ATOM 3493 HZ2 TRP A 233 8.453 60.148 59.563 1.00 0.00 H ATOM 3494 HH2 TRP A 233 6.173 60.725 58.726 1.00 0.00 H ATOM 3495 HZ3 TRP A 233 4.172 59.418 59.480 1.00 0.00 H ATOM 3496 HE3 TRP A 233 4.424 57.503 61.086 1.00 0.00 H ATOM 3497 H TRP A 233 8.223 54.745 61.343 1.00 0.00 H ATOM 3498 N ALA A 234 5.685 54.694 59.752 1.00 31.81 N ATOM 3499 CA ALA A 234 4.808 55.065 58.647 1.00 31.00 C ATOM 3500 C ALA A 234 3.883 54.018 58.005 1.00 30.77 C ATOM 3501 O ALA A 234 3.070 54.374 57.155 1.00 28.98 O ATOM 3502 CB ALA A 234 5.643 55.734 57.541 1.00 29.18 C ATOM 3503 HA ALA A 234 4.095 55.723 59.145 1.00 0.00 H ATOM 3504 HB1 ALA A 234 6.126 56.626 57.941 1.00 0.00 H ATOM 3505 HB2 ALA A 234 6.402 55.036 57.188 1.00 0.00 H ATOM 3506 HB3 ALA A 234 4.991 56.013 56.713 1.00 0.00 H ATOM 3507 H ALA A 234 6.679 54.455 59.563 1.00 0.00 H ATOM 3508 N SER A 235 4.019 52.749 58.378 1.00 32.72 N ATOM 3509 CA SER A 235 3.177 51.711 57.811 1.00 33.38 C ATOM 3510 C SER A 235 3.165 50.471 58.713 1.00 35.14 C ATOM 3511 O SER A 235 3.998 50.340 59.623 1.00 36.06 O ATOM 3512 CB SER A 235 3.648 51.357 56.392 1.00 30.99 C ATOM 3513 OG SER A 235 4.892 50.664 56.380 1.00 30.46 O ATOM 3514 HA SER A 235 2.156 52.088 57.747 1.00 0.00 H ATOM 3515 HB2 SER A 235 3.757 52.279 55.821 1.00 0.00 H ATOM 3516 HB3 SER A 235 2.893 50.727 55.921 1.00 0.00 H ATOM 3517 HG SER A 235 5.588 51.231 56.798 1.00 0.00 H ATOM 3518 H SER A 235 4.738 52.497 59.085 1.00 0.00 H ATOM 3519 N VAL A 236 2.179 49.602 58.504 1.00 35.74 N ATOM 3520 CA VAL A 236 2.075 48.352 59.250 1.00 34.92 C ATOM 3521 C VAL A 236 1.646 47.249 58.255 1.00 36.59 C ATOM 3522 O VAL A 236 1.200 47.552 57.117 1.00 36.22 O ATOM 3523 CB VAL A 236 1.017 48.415 60.363 1.00 33.83 C ATOM 3524 CG1 VAL A 236 1.470 49.405 61.476 1.00 32.57 C ATOM 3525 CG2 VAL A 236 -0.362 48.830 59.778 1.00 33.19 C ATOM 3526 HA VAL A 236 3.041 48.153 59.715 1.00 0.00 H ATOM 3527 HB VAL A 236 0.911 47.425 60.806 1.00 0.00 H ATOM 3528 HG11 VAL A 236 2.416 49.066 61.899 1.00 0.00 H ATOM 3529 HG12 VAL A 236 1.598 50.399 61.047 1.00 0.00 H ATOM 3530 HG13 VAL A 236 0.712 49.441 62.259 1.00 0.00 H ATOM 3531 HG21 VAL A 236 -0.277 49.812 59.312 1.00 0.00 H ATOM 3532 HG22 VAL A 236 -0.674 48.099 59.032 1.00 0.00 H ATOM 3533 HG23 VAL A 236 -1.099 48.869 60.580 1.00 0.00 H ATOM 3534 H VAL A 236 1.459 49.821 57.786 1.00 0.00 H ATOM 3535 N SER A 237 1.783 45.994 58.675 1.00 33.99 N ATOM 3536 CA SER A 237 1.377 44.857 57.846 1.00 35.46 C ATOM 3537 C SER A 237 -0.153 44.826 57.886 1.00 35.85 C ATOM 3538 O SER A 237 -0.763 45.474 58.768 1.00 34.72 O ATOM 3539 CB SER A 237 1.873 43.548 58.476 1.00 32.77 C ATOM 3540 OG SER A 237 1.250 43.407 59.762 1.00 33.70 O ATOM 3541 HA SER A 237 1.779 44.954 56.837 1.00 0.00 H ATOM 3542 HB2 SER A 237 2.956 43.581 58.592 1.00 0.00 H ATOM 3543 HB3 SER A 237 1.602 42.706 57.840 1.00 0.00 H ATOM 3544 HG SER A 237 0.267 43.381 59.650 1.00 0.00 H ATOM 3545 H SER A 237 2.189 45.816 59.616 1.00 0.00 H ATOM 3546 N VAL A 238 -0.768 44.064 56.976 1.00 36.24 N ATOM 3547 CA VAL A 238 -2.224 43.979 56.998 1.00 38.05 C ATOM 3548 C VAL A 238 -2.662 43.266 58.261 1.00 37.85 C ATOM 3549 O VAL A 238 -3.733 43.558 58.783 1.00 38.22 O ATOM 3550 CB VAL A 238 -2.827 43.242 55.757 1.00 39.40 C ATOM 3551 CG1 VAL A 238 -2.473 43.982 54.499 1.00 40.60 C ATOM 3552 CG2 VAL A 238 -2.328 41.833 55.671 1.00 40.55 C ATOM 3553 HA VAL A 238 -2.599 45.002 56.969 1.00 0.00 H ATOM 3554 HB VAL A 238 -3.911 43.216 55.872 1.00 0.00 H ATOM 3555 HG11 VAL A 238 -2.877 44.993 54.548 1.00 0.00 H ATOM 3556 HG12 VAL A 238 -1.389 44.027 54.398 1.00 0.00 H ATOM 3557 HG13 VAL A 238 -2.897 43.461 53.641 1.00 0.00 H ATOM 3558 HG21 VAL A 238 -1.242 41.839 55.580 1.00 0.00 H ATOM 3559 HG22 VAL A 238 -2.616 41.291 56.572 1.00 0.00 H ATOM 3560 HG23 VAL A 238 -2.765 41.347 54.799 1.00 0.00 H ATOM 3561 H VAL A 238 -0.218 43.541 56.265 1.00 0.00 H ATOM 3562 N ALA A 239 -1.849 42.338 58.767 1.00 38.91 N ATOM 3563 CA ALA A 239 -2.226 41.636 60.024 1.00 40.30 C ATOM 3564 C ALA A 239 -2.250 42.606 61.232 1.00 39.08 C ATOM 3565 O ALA A 239 -3.180 42.595 62.049 1.00 38.49 O ATOM 3566 CB ALA A 239 -1.240 40.460 60.311 1.00 39.65 C ATOM 3567 HA ALA A 239 -3.231 41.238 59.887 1.00 0.00 H ATOM 3568 HB1 ALA A 239 -1.273 39.750 59.485 1.00 0.00 H ATOM 3569 HB2 ALA A 239 -0.228 40.853 60.414 1.00 0.00 H ATOM 3570 HB3 ALA A 239 -1.532 39.959 61.234 1.00 0.00 H ATOM 3571 H ALA A 239 -0.957 42.106 58.286 1.00 0.00 H ATOM 3572 N GLU A 240 -1.226 43.451 61.345 1.00 38.74 N ATOM 3573 CA GLU A 240 -1.194 44.426 62.463 1.00 37.38 C ATOM 3574 C GLU A 240 -2.323 45.489 62.289 1.00 35.54 C ATOM 3575 O GLU A 240 -3.007 45.857 63.249 1.00 35.43 O ATOM 3576 CB GLU A 240 0.197 45.087 62.561 1.00 36.23 C ATOM 3577 CG GLU A 240 0.310 46.210 63.676 1.00 36.68 C ATOM 3578 CD GLU A 240 -0.078 45.725 65.093 1.00 37.49 C ATOM 3579 OE1 GLU A 240 -0.190 44.494 65.293 1.00 36.71 O ATOM 3580 OE2 GLU A 240 -0.268 46.580 65.997 1.00 35.53 O ATOM 3581 HA GLU A 240 -1.376 43.898 63.399 1.00 0.00 H ATOM 3582 HB2 GLU A 240 0.929 44.311 62.783 1.00 0.00 H ATOM 3583 HB3 GLU A 240 0.429 45.539 61.597 1.00 0.00 H ATOM 3584 HG2 GLU A 240 1.340 46.564 63.704 1.00 0.00 H ATOM 3585 HG3 GLU A 240 -0.349 47.034 63.402 1.00 0.00 H ATOM 3586 H GLU A 240 -0.451 43.427 60.652 1.00 0.00 H ATOM 3587 N GLY A 241 -2.535 45.951 61.058 1.00 36.80 N ATOM 3588 CA GLY A 241 -3.630 46.891 60.817 1.00 37.25 C ATOM 3589 C GLY A 241 -4.969 46.279 61.229 1.00 38.22 C ATOM 3590 O GLY A 241 -5.812 46.924 61.871 1.00 36.77 O ATOM 3591 HA3 GLY A 241 -3.661 47.140 59.756 1.00 0.00 H ATOM 3592 HA2 GLY A 241 -3.457 47.798 61.397 1.00 0.00 H ATOM 3593 H GLY A 241 -1.926 45.645 60.273 1.00 0.00 H ATOM 3594 N ARG A 242 -5.168 45.005 60.866 1.00 38.60 N ATOM 3595 CA ARG A 242 -6.414 44.303 61.199 1.00 38.64 C ATOM 3596 C ARG A 242 -6.558 44.212 62.719 1.00 38.19 C ATOM 3597 O ARG A 242 -7.607 44.533 63.291 1.00 37.52 O ATOM 3598 CB ARG A 242 -6.388 42.906 60.537 1.00 38.55 C ATOM 3599 CG ARG A 242 -7.462 41.926 61.037 1.00 41.54 C ATOM 3600 CD ARG A 242 -7.640 40.689 60.065 1.00 41.25 C ATOM 3601 NE ARG A 242 -8.250 41.115 58.798 1.00 41.64 N ATOM 3602 CZ ARG A 242 -9.546 41.383 58.672 1.00 43.10 C ATOM 3603 NH1 ARG A 242 -10.053 41.803 57.503 1.00 41.94 N ATOM 3604 NH2 ARG A 242 -10.347 41.194 59.720 1.00 42.57 N ATOM 3605 HA ARG A 242 -7.279 44.847 60.819 1.00 0.00 H ATOM 3606 HB2 ARG A 242 -6.525 43.038 59.464 1.00 0.00 H ATOM 3607 HB3 ARG A 242 -5.411 42.461 60.725 1.00 0.00 H ATOM 3608 HG2 ARG A 242 -7.173 41.560 62.022 1.00 0.00 H ATOM 3609 HG3 ARG A 242 -8.413 42.454 61.112 1.00 0.00 H ATOM 3610 HD2 ARG A 242 -8.282 39.947 60.541 1.00 0.00 H ATOM 3611 HD3 ARG A 242 -6.664 40.247 59.863 1.00 0.00 H ATOM 3612 HE ARG A 242 -7.640 41.211 57.961 1.00 0.00 H ATOM 3613 HH12 ARG A 242 -11.069 42.008 57.421 1.00 0.00 H ATOM 3614 HH11 ARG A 242 -9.430 41.923 56.679 1.00 0.00 H ATOM 3615 HH22 ARG A 242 -11.364 41.398 59.641 1.00 0.00 H ATOM 3616 HH21 ARG A 242 -9.955 40.842 60.617 1.00 0.00 H ATOM 3617 H ARG A 242 -4.426 44.503 60.338 1.00 0.00 H ATOM 3618 N ARG A 243 -5.476 43.791 63.368 1.00 37.67 N ATOM 3619 CA ARG A 243 -5.458 43.689 64.815 1.00 38.75 C ATOM 3620 C ARG A 243 -5.816 45.026 65.503 1.00 38.14 C ATOM 3621 O ARG A 243 -6.553 45.035 66.499 1.00 37.62 O ATOM 3622 CB ARG A 243 -4.085 43.196 65.250 1.00 38.92 C ATOM 3623 CG ARG A 243 -3.944 42.861 66.731 1.00 40.69 C ATOM 3624 CD ARG A 243 -2.528 43.339 67.266 1.00 42.24 C ATOM 3625 NE ARG A 243 -2.936 44.071 68.432 1.00 47.51 N ATOM 3626 CZ ARG A 243 -2.600 45.288 68.800 1.00 45.75 C ATOM 3627 NH1 ARG A 243 -1.757 46.061 68.122 1.00 42.67 N ATOM 3628 NH2 ARG A 243 -3.223 45.728 69.877 1.00 49.18 N ATOM 3629 HA ARG A 243 -6.223 42.978 65.125 1.00 0.00 H ATOM 3630 HB2 ARG A 243 -3.855 42.296 64.679 1.00 0.00 H ATOM 3631 HB3 ARG A 243 -3.358 43.972 65.011 1.00 0.00 H ATOM 3632 HG2 ARG A 243 -4.731 43.366 67.292 1.00 0.00 H ATOM 3633 HG3 ARG A 243 -4.036 41.784 66.868 1.00 0.00 H ATOM 3634 HD2 ARG A 243 -2.017 43.978 66.545 1.00 0.00 H ATOM 3635 HD3 ARG A 243 -1.886 42.496 67.521 1.00 0.00 H ATOM 3636 HE ARG A 243 -3.585 43.571 69.072 1.00 0.00 H ATOM 3637 HH12 ARG A 243 -1.533 47.016 68.469 1.00 0.00 H ATOM 3638 HH11 ARG A 243 -1.321 45.711 67.245 1.00 0.00 H ATOM 3639 HH22 ARG A 243 -3.021 46.681 70.242 1.00 0.00 H ATOM 3640 HH21 ARG A 243 -3.916 45.122 70.361 1.00 0.00 H ATOM 3641 H ARG A 243 -4.627 43.530 62.828 1.00 0.00 H ATOM 3642 N ARG A 244 -5.334 46.155 64.968 1.00 37.55 N ATOM 3643 CA ARG A 244 -5.656 47.447 65.575 1.00 35.56 C ATOM 3644 C ARG A 244 -7.094 47.862 65.338 1.00 34.92 C ATOM 3645 O ARG A 244 -7.703 48.551 66.200 1.00 33.28 O ATOM 3646 CB ARG A 244 -4.702 48.559 65.076 1.00 36.32 C ATOM 3647 CG ARG A 244 -3.237 48.293 65.478 1.00 34.09 C ATOM 3648 CD ARG A 244 -2.281 49.377 64.977 1.00 35.31 C ATOM 3649 NE ARG A 244 -0.871 49.019 65.197 1.00 34.54 N ATOM 3650 CZ ARG A 244 0.163 49.841 65.029 1.00 32.74 C ATOM 3651 NH1 ARG A 244 -0.013 51.106 64.647 1.00 31.66 N ATOM 3652 NH2 ARG A 244 1.382 49.377 65.197 1.00 31.23 N ATOM 3653 HA ARG A 244 -5.521 47.316 66.649 1.00 0.00 H ATOM 3654 HB2 ARG A 244 -4.764 48.613 63.989 1.00 0.00 H ATOM 3655 HB3 ARG A 244 -5.017 49.510 65.505 1.00 0.00 H ATOM 3656 HG2 ARG A 244 -3.176 48.249 66.565 1.00 0.00 H ATOM 3657 HG3 ARG A 244 -2.929 47.335 65.059 1.00 0.00 H ATOM 3658 HD2 ARG A 244 -2.494 50.306 65.506 1.00 0.00 H ATOM 3659 HD3 ARG A 244 -2.444 49.523 63.909 1.00 0.00 H ATOM 3660 HE ARG A 244 -0.666 48.048 65.508 1.00 0.00 H ATOM 3661 HH12 ARG A 244 0.809 51.731 64.522 1.00 0.00 H ATOM 3662 HH11 ARG A 244 -0.972 51.468 64.474 1.00 0.00 H ATOM 3663 HH22 ARG A 244 2.200 50.006 65.069 1.00 0.00 H ATOM 3664 HH21 ARG A 244 1.528 48.381 65.457 1.00 0.00 H ATOM 3665 H ARG A 244 -4.731 46.114 64.122 1.00 0.00 H ATOM 3666 N ALA A 245 -7.651 47.473 64.186 1.00 34.87 N ATOM 3667 CA ALA A 245 -9.053 47.826 63.883 1.00 36.82 C ATOM 3668 C ALA A 245 -9.968 47.054 64.836 1.00 38.34 C ATOM 3669 O ALA A 245 -10.908 47.622 65.418 1.00 38.70 O ATOM 3670 CB ALA A 245 -9.408 47.475 62.413 1.00 38.30 C ATOM 3671 HA ALA A 245 -9.189 48.899 64.015 1.00 0.00 H ATOM 3672 HB1 ALA A 245 -8.753 48.029 61.740 1.00 0.00 H ATOM 3673 HB2 ALA A 245 -9.273 46.405 62.254 1.00 0.00 H ATOM 3674 HB3 ALA A 245 -10.446 47.745 62.217 1.00 0.00 H ATOM 3675 H ALA A 245 -7.096 46.921 63.502 1.00 0.00 H ATOM 3676 N VAL A 246 -9.658 45.767 65.021 1.00 39.14 N ATOM 3677 CA VAL A 246 -10.429 44.929 65.936 1.00 39.36 C ATOM 3678 C VAL A 246 -10.274 45.479 67.384 1.00 41.12 C ATOM 3679 O VAL A 246 -11.264 45.544 68.142 1.00 41.63 O ATOM 3680 CB VAL A 246 -9.955 43.437 65.871 1.00 38.43 C ATOM 3681 CG1 VAL A 246 -10.655 42.629 66.996 1.00 38.89 C ATOM 3682 CG2 VAL A 246 -10.248 42.811 64.478 1.00 36.32 C ATOM 3683 HA VAL A 246 -11.478 44.957 65.640 1.00 0.00 H ATOM 3684 HB VAL A 246 -8.876 43.404 66.019 1.00 0.00 H ATOM 3685 HG11 VAL A 246 -10.393 43.055 67.965 1.00 0.00 H ATOM 3686 HG12 VAL A 246 -11.735 42.676 66.857 1.00 0.00 H ATOM 3687 HG13 VAL A 246 -10.327 41.590 66.953 1.00 0.00 H ATOM 3688 HG21 VAL A 246 -11.320 42.843 64.285 1.00 0.00 H ATOM 3689 HG22 VAL A 246 -9.722 43.376 63.709 1.00 0.00 H ATOM 3690 HG23 VAL A 246 -9.907 41.776 64.467 1.00 0.00 H ATOM 3691 H VAL A 246 -8.854 45.355 64.505 1.00 0.00 H ATOM 3692 N GLU A 247 -9.060 45.895 67.773 1.00 38.62 N ATOM 3693 CA GLU A 247 -8.893 46.452 69.133 1.00 39.67 C ATOM 3694 C GLU A 247 -9.682 47.768 69.280 1.00 37.94 C ATOM 3695 O GLU A 247 -10.231 48.065 70.347 1.00 38.95 O ATOM 3696 CB GLU A 247 -7.396 46.677 69.466 1.00 40.38 C ATOM 3697 CG GLU A 247 -7.133 47.010 70.925 1.00 43.25 C ATOM 3698 CD GLU A 247 -7.568 45.887 71.906 1.00 46.77 C ATOM 3699 OE1 GLU A 247 -7.675 46.191 73.125 1.00 47.53 O ATOM 3700 OE2 GLU A 247 -7.781 44.723 71.466 1.00 47.10 O ATOM 3701 HA GLU A 247 -9.290 45.727 69.843 1.00 0.00 H ATOM 3702 HB2 GLU A 247 -6.848 45.768 69.217 1.00 0.00 H ATOM 3703 HB3 GLU A 247 -7.028 47.500 68.854 1.00 0.00 H ATOM 3704 HG2 GLU A 247 -6.065 47.184 71.052 1.00 0.00 H ATOM 3705 HG3 GLU A 247 -7.681 47.919 71.176 1.00 0.00 H ATOM 3706 H GLU A 247 -8.247 45.827 67.128 1.00 0.00 H ATOM 3707 N LEU A 248 -9.790 48.542 68.200 1.00 38.12 N ATOM 3708 CA LEU A 248 -10.557 49.800 68.273 1.00 37.63 C ATOM 3709 C LEU A 248 -12.022 49.410 68.548 1.00 38.66 C ATOM 3710 O LEU A 248 -12.634 49.938 69.465 1.00 39.01 O ATOM 3711 CB LEU A 248 -10.475 50.607 66.962 1.00 35.90 C ATOM 3712 CG LEU A 248 -11.122 52.016 67.019 1.00 37.06 C ATOM 3713 CD1 LEU A 248 -10.241 52.963 67.862 1.00 36.73 C ATOM 3714 CD2 LEU A 248 -11.327 52.582 65.633 1.00 33.11 C ATOM 3715 HA LEU A 248 -10.146 50.434 69.058 1.00 0.00 H ATOM 3716 HB2 LEU A 248 -9.423 50.728 66.704 1.00 0.00 H ATOM 3717 HB3 LEU A 248 -10.976 50.036 66.181 1.00 0.00 H ATOM 3718 HG LEU A 248 -12.102 51.924 67.488 1.00 0.00 H ATOM 3719 HD21 LEU A 248 -10.364 52.662 65.128 1.00 0.00 H ATOM 3720 HD22 LEU A 248 -11.982 51.921 65.065 1.00 0.00 H ATOM 3721 HD23 LEU A 248 -11.782 53.570 65.709 1.00 0.00 H ATOM 3722 HD11 LEU A 248 -10.149 52.567 68.873 1.00 0.00 H ATOM 3723 HD12 LEU A 248 -9.253 53.038 67.408 1.00 0.00 H ATOM 3724 HD13 LEU A 248 -10.702 53.950 67.897 1.00 0.00 H ATOM 3725 H LEU A 248 -9.335 48.260 67.309 1.00 0.00 H ATOM 3726 N GLY A 249 -12.563 48.481 67.761 1.00 39.82 N ATOM 3727 CA GLY A 249 -13.936 48.023 67.970 1.00 41.13 C ATOM 3728 C GLY A 249 -14.121 47.486 69.386 1.00 41.30 C ATOM 3729 O GLY A 249 -15.106 47.791 70.047 1.00 41.64 O ATOM 3730 HA3 GLY A 249 -14.161 47.231 67.255 1.00 0.00 H ATOM 3731 HA2 GLY A 249 -14.619 48.858 67.812 1.00 0.00 H ATOM 3732 H GLY A 249 -12.000 48.075 66.986 1.00 0.00 H ATOM 3733 N ARG A 250 -13.154 46.715 69.869 1.00 41.03 N ATOM 3734 CA ARG A 250 -13.210 46.178 71.222 1.00 42.04 C ATOM 3735 C ARG A 250 -13.300 47.316 72.279 1.00 43.84 C ATOM 3736 O ARG A 250 -13.938 47.150 73.316 1.00 45.88 O ATOM 3737 CB ARG A 250 -11.978 45.258 71.423 1.00 43.00 C ATOM 3738 CG ARG A 250 -11.950 44.355 72.699 1.00 43.76 C ATOM 3739 CD ARG A 250 -10.786 43.341 72.695 1.00 41.96 C ATOM 3740 NE ARG A 250 -10.929 42.299 71.665 1.00 43.33 N ATOM 3741 HA ARG A 250 -14.115 45.586 71.362 1.00 0.00 H ATOM 3742 HB2 ARG A 250 -11.917 44.600 70.556 1.00 0.00 H ATOM 3743 HB3 ARG A 250 -11.095 45.897 71.456 1.00 0.00 H ATOM 3744 HG2 ARG A 250 -11.850 44.995 73.576 1.00 0.00 H ATOM 3745 HG3 ARG A 250 -12.890 43.805 72.757 1.00 0.00 H ATOM 3746 HD2 ARG A 250 -10.742 42.859 73.672 1.00 0.00 H ATOM 3747 HD3 ARG A 250 -9.856 43.881 72.515 1.00 0.00 H ATOM 3748 HE ARG A 250 -11.756 42.302 71.034 1.00 0.00 H ATOM 3749 H ARG A 250 -12.337 46.489 69.267 1.00 0.00 H ATOM 3750 N ASN A 251 -12.707 48.491 72.015 1.00 44.12 N ATOM 3751 CA ASN A 251 -12.733 49.627 72.964 1.00 42.39 C ATOM 3752 C ASN A 251 -14.081 50.342 72.965 1.00 43.20 C ATOM 3753 O ASN A 251 -14.407 51.077 73.911 1.00 42.61 O ATOM 3754 CB ASN A 251 -11.632 50.672 72.613 1.00 42.10 C ATOM 3755 CG ASN A 251 -10.307 50.441 73.365 1.00 41.09 C ATOM 3756 OD1 ASN A 251 -10.062 51.048 74.418 1.00 42.05 O ATOM 3757 ND2 ASN A 251 -9.463 49.562 72.830 1.00 39.64 N ATOM 3758 HA ASN A 251 -12.551 49.203 73.951 1.00 0.00 H ATOM 3759 HB2 ASN A 251 -11.435 50.621 71.542 1.00 0.00 H ATOM 3760 HB3 ASN A 251 -12.004 51.665 72.866 1.00 0.00 H ATOM 3761 HD22 ASN A 251 -9.711 49.076 71.944 1.00 0.00 H ATOM 3762 HD21 ASN A 251 -8.556 49.361 73.297 1.00 0.00 H ATOM 3763 H ASN A 251 -12.210 48.608 71.109 1.00 0.00 H ATOM 3764 N LEU A 252 -14.859 50.135 71.901 1.00 44.25 N ATOM 3765 CA LEU A 252 -16.165 50.778 71.758 1.00 44.73 C ATOM 3766 C LEU A 252 -17.317 49.775 71.884 1.00 46.70 C ATOM 3767 O LEU A 252 -18.458 50.054 71.494 1.00 46.57 O ATOM 3768 CB LEU A 252 -16.224 51.520 70.420 1.00 43.54 C ATOM 3769 CG LEU A 252 -15.173 52.661 70.366 1.00 43.62 C ATOM 3770 CD1 LEU A 252 -15.071 53.182 68.977 1.00 43.77 C ATOM 3771 CD2 LEU A 252 -15.532 53.793 71.303 1.00 43.78 C ATOM 3772 HA LEU A 252 -16.285 51.493 72.572 1.00 0.00 H ATOM 3773 HB2 LEU A 252 -16.026 50.815 69.613 1.00 0.00 H ATOM 3774 HB3 LEU A 252 -17.219 51.946 70.293 1.00 0.00 H ATOM 3775 HG LEU A 252 -14.215 52.249 70.683 1.00 0.00 H ATOM 3776 HD21 LEU A 252 -16.501 54.203 71.020 1.00 0.00 H ATOM 3777 HD22 LEU A 252 -15.580 53.416 72.325 1.00 0.00 H ATOM 3778 HD23 LEU A 252 -14.773 54.572 71.237 1.00 0.00 H ATOM 3779 HD11 LEU A 252 -14.766 52.376 68.310 1.00 0.00 H ATOM 3780 HD12 LEU A 252 -16.041 53.568 68.663 1.00 0.00 H ATOM 3781 HD13 LEU A 252 -14.332 53.983 68.944 1.00 0.00 H ATOM 3782 H LEU A 252 -14.527 49.497 71.150 1.00 0.00 H ATOM 3783 N ASN A 253 -16.985 48.606 72.428 1.00 48.47 N ATOM 3784 CA ASN A 253 -17.950 47.548 72.667 1.00 50.46 C ATOM 3785 C ASN A 253 -18.676 47.167 71.391 1.00 50.54 C ATOM 3786 O ASN A 253 -19.900 47.056 71.358 1.00 50.67 O ATOM 3787 CB ASN A 253 -18.928 48.022 73.737 1.00 52.19 C ATOM 3788 CG ASN A 253 -18.199 48.589 74.981 1.00 56.21 C ATOM 3789 OD1 ASN A 253 -17.434 47.877 75.667 1.00 57.83 O ATOM 3790 ND2 ASN A 253 -18.412 49.878 75.251 1.00 56.45 N ATOM 3791 HA ASN A 253 -17.433 46.653 73.013 1.00 0.00 H ATOM 3792 HB2 ASN A 253 -19.561 48.802 73.314 1.00 0.00 H ATOM 3793 HB3 ASN A 253 -19.548 47.180 74.045 1.00 0.00 H ATOM 3794 HD22 ASN A 253 -19.057 50.435 74.654 1.00 0.00 H ATOM 3795 HD21 ASN A 253 -17.933 50.326 76.058 1.00 0.00 H ATOM 3796 H ASN A 253 -15.992 48.444 72.693 1.00 0.00 H ATOM 3797 N CYS A 254 -17.913 46.977 70.331 1.00 48.64 N ATOM 3798 CA CYS A 254 -18.511 46.607 69.070 1.00 49.27 C ATOM 3799 C CYS A 254 -18.669 45.108 68.930 1.00 48.87 C ATOM 3800 O CYS A 254 -17.902 44.335 69.503 1.00 48.23 O ATOM 3801 CB CYS A 254 -17.635 47.082 67.923 1.00 48.99 C ATOM 3802 SG CYS A 254 -17.739 48.846 67.533 1.00 47.74 S ATOM 3803 HA CYS A 254 -19.495 47.075 69.041 1.00 0.00 H ATOM 3804 HB2 CYS A 254 -17.920 46.524 67.031 1.00 0.00 H ATOM 3805 HB3 CYS A 254 -16.599 46.855 68.176 1.00 0.00 H ATOM 3806 H CYS A 254 -16.882 47.094 70.404 1.00 0.00 H ATOM 3807 N ASN A 255 -19.658 44.701 68.138 1.00 50.52 N ATOM 3808 CA ASN A 255 -19.873 43.279 67.844 1.00 49.87 C ATOM 3809 C ASN A 255 -18.669 42.971 66.971 1.00 49.81 C ATOM 3810 O ASN A 255 -18.469 43.659 65.945 1.00 48.86 O ATOM 3811 CB ASN A 255 -21.136 43.079 67.009 1.00 51.82 C ATOM 3812 CG ASN A 255 -21.436 41.592 66.744 1.00 54.52 C ATOM 3813 OD1 ASN A 255 -20.566 40.823 66.313 1.00 54.89 O ATOM 3814 ND2 ASN A 255 -22.677 41.189 67.002 1.00 54.51 N ATOM 3815 HA ASN A 255 -19.982 42.664 68.737 1.00 0.00 H ATOM 3816 HB2 ASN A 255 -21.980 43.517 67.541 1.00 0.00 H ATOM 3817 HB3 ASN A 255 -21.008 43.586 66.053 1.00 0.00 H ATOM 3818 HD22 ASN A 255 -23.379 41.866 67.363 1.00 0.00 H ATOM 3819 HD21 ASN A 255 -22.945 40.197 66.843 1.00 0.00 H ATOM 3820 H ASN A 255 -20.294 45.408 67.717 1.00 0.00 H ATOM 3821 N LEU A 256 -17.880 41.964 67.354 1.00 48.96 N ATOM 3822 CA LEU A 256 -16.691 41.583 66.598 1.00 49.35 C ATOM 3823 C LEU A 256 -16.804 40.296 65.803 1.00 51.32 C ATOM 3824 O LEU A 256 -15.777 39.769 65.357 1.00 52.19 O ATOM 3825 CB LEU A 256 -15.498 41.444 67.539 1.00 47.89 C ATOM 3826 CG LEU A 256 -15.391 42.626 68.510 1.00 48.18 C ATOM 3827 CD1 LEU A 256 -14.174 42.432 69.395 1.00 48.10 C ATOM 3828 CD2 LEU A 256 -15.312 43.963 67.704 1.00 46.55 C ATOM 3829 HA LEU A 256 -16.564 42.388 65.874 1.00 0.00 H ATOM 3830 HB2 LEU A 256 -15.608 40.525 68.114 1.00 0.00 H ATOM 3831 HB3 LEU A 256 -14.585 41.392 66.945 1.00 0.00 H ATOM 3832 HG LEU A 256 -16.274 42.675 69.148 1.00 0.00 H ATOM 3833 HD21 LEU A 256 -14.435 43.945 67.057 1.00 0.00 H ATOM 3834 HD22 LEU A 256 -16.210 44.073 67.097 1.00 0.00 H ATOM 3835 HD23 LEU A 256 -15.236 44.800 68.398 1.00 0.00 H ATOM 3836 HD11 LEU A 256 -14.279 41.504 69.956 1.00 0.00 H ATOM 3837 HD12 LEU A 256 -13.279 42.384 68.775 1.00 0.00 H ATOM 3838 HD13 LEU A 256 -14.093 43.270 70.088 1.00 0.00 H ATOM 3839 H LEU A 256 -18.120 41.435 68.217 1.00 0.00 H ATOM 3840 N ASN A 257 -18.015 39.787 65.589 1.00 51.20 N ATOM 3841 CA ASN A 257 -18.151 38.523 64.870 1.00 51.50 C ATOM 3842 C ASN A 257 -17.689 38.522 63.404 1.00 52.09 C ATOM 3843 O ASN A 257 -17.291 37.469 62.863 1.00 51.86 O ATOM 3844 CB ASN A 257 -19.604 38.036 64.958 1.00 51.87 C ATOM 3845 HA ASN A 257 -17.464 37.842 65.372 1.00 0.00 H ATOM 3846 HB2 ASN A 257 -19.874 37.890 66.004 1.00 0.00 H ATOM 3847 HB3 ASN A 257 -20.263 38.781 64.512 1.00 0.00 H ATOM 3848 H ASN A 257 -18.860 40.287 65.932 1.00 0.00 H ATOM 3849 N SER A 258 -17.741 39.685 62.753 1.00 50.98 N ATOM 3850 CA SER A 258 -17.325 39.793 61.350 1.00 49.07 C ATOM 3851 C SER A 258 -16.869 41.206 61.000 1.00 48.37 C ATOM 3852 O SER A 258 -17.179 42.168 61.727 1.00 48.33 O ATOM 3853 CB SER A 258 -18.499 39.458 60.433 1.00 48.83 C ATOM 3854 OG SER A 258 -19.481 40.488 60.518 1.00 48.97 O ATOM 3855 HA SER A 258 -16.497 39.097 61.211 1.00 0.00 H ATOM 3856 HB2 SER A 258 -18.940 38.510 60.740 1.00 0.00 H ATOM 3857 HB3 SER A 258 -18.145 39.377 59.405 1.00 0.00 H ATOM 3858 HG SER A 258 -19.080 41.349 60.239 1.00 0.00 H ATOM 3859 H SER A 258 -18.083 40.532 63.250 1.00 0.00 H ATOM 3860 N ASP A 259 -16.168 41.333 59.869 1.00 48.05 N ATOM 3861 CA ASP A 259 -15.714 42.642 59.412 1.00 47.89 C ATOM 3862 C ASP A 259 -16.918 43.554 59.252 1.00 48.57 C ATOM 3863 O ASP A 259 -16.892 44.697 59.692 1.00 48.29 O ATOM 3864 CB ASP A 259 -14.967 42.545 58.077 1.00 46.15 C ATOM 3865 CG ASP A 259 -13.555 42.030 58.247 1.00 46.89 C ATOM 3866 OD1 ASP A 259 -13.150 41.775 59.395 1.00 45.50 O ATOM 3867 OD2 ASP A 259 -12.825 41.893 57.245 1.00 49.08 O ATOM 3868 HA ASP A 259 -15.024 43.045 60.154 1.00 0.00 H ATOM 3869 HB2 ASP A 259 -15.511 41.868 57.419 1.00 0.00 H ATOM 3870 HB3 ASP A 259 -14.927 43.536 57.624 1.00 0.00 H ATOM 3871 H ASP A 259 -15.943 40.487 59.307 1.00 0.00 H ATOM 3872 N GLU A 260 -17.975 43.027 58.637 1.00 48.86 N ATOM 3873 CA GLU A 260 -19.212 43.775 58.380 1.00 49.70 C ATOM 3874 C GLU A 260 -19.830 44.291 59.686 1.00 49.18 C ATOM 3875 O GLU A 260 -20.294 45.447 59.766 1.00 49.07 O ATOM 3876 CB GLU A 260 -20.216 42.874 57.616 1.00 50.66 C ATOM 3877 CG GLU A 260 -19.558 41.988 56.458 1.00 53.62 C ATOM 3878 CD GLU A 260 -18.437 41.012 56.950 1.00 52.13 C ATOM 3879 HA GLU A 260 -18.973 44.643 57.766 1.00 0.00 H ATOM 3880 HB2 GLU A 260 -20.687 42.202 58.334 1.00 0.00 H ATOM 3881 HB3 GLU A 260 -20.975 43.514 57.167 1.00 0.00 H ATOM 3882 HG2 GLU A 260 -20.346 41.396 55.992 1.00 0.00 H ATOM 3883 HG3 GLU A 260 -19.124 42.661 55.718 1.00 0.00 H ATOM 3884 H GLU A 260 -17.922 42.037 58.323 1.00 0.00 H ATOM 3885 N GLU A 261 -19.842 43.439 60.712 1.00 49.07 N ATOM 3886 CA GLU A 261 -20.389 43.835 62.016 1.00 49.04 C ATOM 3887 C GLU A 261 -19.519 44.979 62.633 1.00 47.30 C ATOM 3888 O GLU A 261 -20.047 46.013 63.065 1.00 44.88 O ATOM 3889 CB GLU A 261 -20.424 42.608 62.965 1.00 52.63 C ATOM 3890 CG GLU A 261 -21.501 41.508 62.664 1.00 57.15 C ATOM 3891 CD GLU A 261 -22.870 41.882 63.252 1.00 61.78 C ATOM 3892 OE1 GLU A 261 -23.087 43.101 63.459 1.00 62.58 O ATOM 3893 OE2 GLU A 261 -23.728 40.984 63.511 1.00 63.38 O ATOM 3894 HA GLU A 261 -21.406 44.204 61.883 1.00 0.00 H ATOM 3895 HB2 GLU A 261 -19.445 42.131 62.923 1.00 0.00 H ATOM 3896 HB3 GLU A 261 -20.604 42.977 63.975 1.00 0.00 H ATOM 3897 HG2 GLU A 261 -21.598 41.394 61.584 1.00 0.00 H ATOM 3898 HG3 GLU A 261 -21.174 40.564 63.100 1.00 0.00 H ATOM 3899 H GLU A 261 -19.458 42.480 60.587 1.00 0.00 H ATOM 3900 N LEU A 262 -18.192 44.772 62.666 1.00 45.80 N ATOM 3901 CA LEU A 262 -17.231 45.749 63.211 1.00 44.77 C ATOM 3902 C LEU A 262 -17.343 47.107 62.493 1.00 43.89 C ATOM 3903 O LEU A 262 -17.508 48.162 63.134 1.00 43.06 O ATOM 3904 CB LEU A 262 -15.800 45.199 63.072 1.00 43.87 C ATOM 3905 CG LEU A 262 -14.627 46.085 63.504 1.00 43.30 C ATOM 3906 CD1 LEU A 262 -14.832 46.552 64.919 1.00 42.18 C ATOM 3907 CD2 LEU A 262 -13.325 45.274 63.415 1.00 43.21 C ATOM 3908 HA LEU A 262 -17.464 45.906 64.264 1.00 0.00 H ATOM 3909 HB2 LEU A 262 -15.748 44.286 63.664 1.00 0.00 H ATOM 3910 HB3 LEU A 262 -15.650 44.957 62.020 1.00 0.00 H ATOM 3911 HG LEU A 262 -14.568 46.954 62.848 1.00 0.00 H ATOM 3912 HD21 LEU A 262 -13.393 44.407 64.073 1.00 0.00 H ATOM 3913 HD22 LEU A 262 -13.175 44.941 62.388 1.00 0.00 H ATOM 3914 HD23 LEU A 262 -12.487 45.900 63.721 1.00 0.00 H ATOM 3915 HD11 LEU A 262 -15.758 47.124 64.981 1.00 0.00 H ATOM 3916 HD12 LEU A 262 -14.893 45.688 65.580 1.00 0.00 H ATOM 3917 HD13 LEU A 262 -13.994 47.181 65.218 1.00 0.00 H ATOM 3918 H LEU A 262 -17.823 43.876 62.288 1.00 0.00 H ATOM 3919 N ILE A 263 -17.317 47.071 61.165 1.00 43.45 N ATOM 3920 CA ILE A 263 -17.398 48.300 60.405 1.00 45.39 C ATOM 3921 C ILE A 263 -18.721 49.025 60.621 1.00 46.65 C ATOM 3922 O ILE A 263 -18.735 50.239 60.819 1.00 46.38 O ATOM 3923 CB ILE A 263 -17.146 48.056 58.884 1.00 45.02 C ATOM 3924 CG1 ILE A 263 -15.681 47.665 58.649 1.00 43.91 C ATOM 3925 CG2 ILE A 263 -17.518 49.305 58.110 1.00 43.80 C ATOM 3926 CD1 ILE A 263 -15.371 47.163 57.235 1.00 43.07 C ATOM 3927 HA ILE A 263 -16.604 48.946 60.780 1.00 0.00 H ATOM 3928 HB ILE A 263 -17.768 47.233 58.532 1.00 0.00 H ATOM 3929 HG12 ILE A 263 -15.061 48.540 58.843 1.00 0.00 H ATOM 3930 HG13 ILE A 263 -15.423 46.875 59.354 1.00 0.00 H ATOM 3931 HD11 ILE A 263 -15.971 46.278 57.025 1.00 0.00 H ATOM 3932 HD12 ILE A 263 -15.609 47.944 56.513 1.00 0.00 H ATOM 3933 HD13 ILE A 263 -14.313 46.911 57.164 1.00 0.00 H ATOM 3934 HG21 ILE A 263 -18.571 49.533 58.275 1.00 0.00 H ATOM 3935 HG22 ILE A 263 -16.906 50.139 58.453 1.00 0.00 H ATOM 3936 HG23 ILE A 263 -17.343 49.138 57.047 1.00 0.00 H ATOM 3937 H ILE A 263 -17.238 46.159 60.671 1.00 0.00 H ATOM 3938 N HIS A 264 -19.836 48.292 60.611 1.00 48.09 N ATOM 3939 CA HIS A 264 -21.141 48.925 60.829 1.00 48.75 C ATOM 3940 C HIS A 264 -21.147 49.619 62.184 1.00 48.00 C ATOM 3941 O HIS A 264 -21.622 50.761 62.312 1.00 48.50 O ATOM 3942 CB HIS A 264 -22.293 47.886 60.786 1.00 52.77 C ATOM 3943 CG HIS A 264 -23.662 48.486 60.990 1.00 56.28 C ATOM 3944 ND1 HIS A 264 -24.174 48.789 62.240 1.00 57.26 N ATOM 3945 CD2 HIS A 264 -24.587 48.922 60.094 1.00 58.13 C ATOM 3946 CE1 HIS A 264 -25.344 49.392 62.105 1.00 58.43 C ATOM 3947 NE2 HIS A 264 -25.617 49.488 60.812 1.00 59.44 N ATOM 3948 HA HIS A 264 -21.302 49.648 60.029 1.00 0.00 H ATOM 3949 HB2 HIS A 264 -22.275 47.393 59.814 1.00 0.00 H ATOM 3950 HB3 HIS A 264 -22.120 47.148 61.570 1.00 0.00 H ATOM 3951 HD2 HIS A 264 -24.525 48.839 59.009 1.00 0.00 H ATOM 3952 HE1 HIS A 264 -25.975 49.749 62.919 1.00 0.00 H ATOM 3953 H HIS A 264 -19.779 47.266 60.448 1.00 0.00 H ATOM 3954 N CYS A 265 -20.646 48.929 63.208 1.00 46.14 N ATOM 3955 CA CYS A 265 -20.600 49.509 64.543 1.00 45.74 C ATOM 3956 C CYS A 265 -19.740 50.789 64.521 1.00 45.00 C ATOM 3957 O CYS A 265 -20.179 51.839 64.987 1.00 43.43 O ATOM 3958 CB CYS A 265 -20.004 48.500 65.518 1.00 46.70 C ATOM 3959 SG CYS A 265 -19.719 49.142 67.208 1.00 52.94 S ATOM 3960 HA CYS A 265 -21.610 49.763 64.864 1.00 0.00 H ATOM 3961 HB2 CYS A 265 -19.048 48.164 65.117 1.00 0.00 H ATOM 3962 HB3 CYS A 265 -20.685 47.652 65.587 1.00 0.00 H ATOM 3963 H CYS A 265 -20.284 47.966 63.052 1.00 0.00 H ATOM 3964 N LEU A 266 -18.532 50.694 63.950 1.00 44.11 N ATOM 3965 CA LEU A 266 -17.630 51.858 63.888 1.00 44.93 C ATOM 3966 C LEU A 266 -18.243 53.014 63.095 1.00 46.15 C ATOM 3967 O LEU A 266 -17.956 54.178 63.369 1.00 48.21 O ATOM 3968 CB LEU A 266 -16.263 51.466 63.292 1.00 42.35 C ATOM 3969 CG LEU A 266 -15.407 50.527 64.148 1.00 41.89 C ATOM 3970 CD1 LEU A 266 -14.180 50.088 63.391 1.00 41.54 C ATOM 3971 CD2 LEU A 266 -15.013 51.241 65.450 1.00 43.08 C ATOM 3972 HA LEU A 266 -17.480 52.200 64.912 1.00 0.00 H ATOM 3973 HB2 LEU A 266 -16.443 50.976 62.335 1.00 0.00 H ATOM 3974 HB3 LEU A 266 -15.694 52.381 63.128 1.00 0.00 H ATOM 3975 HG LEU A 266 -15.987 49.636 64.390 1.00 0.00 H ATOM 3976 HD21 LEU A 266 -14.443 52.139 65.212 1.00 0.00 H ATOM 3977 HD22 LEU A 266 -15.914 51.516 65.999 1.00 0.00 H ATOM 3978 HD23 LEU A 266 -14.404 50.573 66.059 1.00 0.00 H ATOM 3979 HD11 LEU A 266 -14.482 49.563 62.485 1.00 0.00 H ATOM 3980 HD12 LEU A 266 -13.587 50.963 63.125 1.00 0.00 H ATOM 3981 HD13 LEU A 266 -13.587 49.422 64.018 1.00 0.00 H ATOM 3982 H LEU A 266 -18.226 49.786 63.545 1.00 0.00 H ATOM 3983 N ARG A 267 -19.116 52.720 62.136 1.00 46.18 N ATOM 3984 CA ARG A 267 -19.704 53.798 61.362 1.00 46.25 C ATOM 3985 C ARG A 267 -20.832 54.513 62.082 1.00 47.60 C ATOM 3986 O ARG A 267 -21.197 55.624 61.691 1.00 47.23 O ATOM 3987 CB ARG A 267 -20.207 53.297 60.007 1.00 45.34 C ATOM 3988 CG ARG A 267 -19.130 53.023 59.004 1.00 45.00 C ATOM 3989 CD ARG A 267 -19.715 52.588 57.695 1.00 44.85 C ATOM 3990 NE ARG A 267 -18.667 52.456 56.712 1.00 47.54 N ATOM 3991 CZ ARG A 267 -18.716 51.630 55.673 1.00 48.55 C ATOM 3992 NH1 ARG A 267 -19.785 50.864 55.496 1.00 48.41 N ATOM 3993 NH2 ARG A 267 -17.689 51.569 54.819 1.00 49.08 N ATOM 3994 HA ARG A 267 -18.900 54.519 61.215 1.00 0.00 H ATOM 3995 HB2 ARG A 267 -20.762 52.373 60.171 1.00 0.00 H ATOM 3996 HB3 ARG A 267 -20.874 54.052 59.592 1.00 0.00 H ATOM 3997 HG2 ARG A 267 -18.546 53.931 58.850 1.00 0.00 H ATOM 3998 HG3 ARG A 267 -18.480 52.235 59.384 1.00 0.00 H ATOM 3999 HD2 ARG A 267 -20.438 53.330 57.357 1.00 0.00 H ATOM 4000 HD3 ARG A 267 -20.215 51.628 57.823 1.00 0.00 H ATOM 4001 HE ARG A 267 -17.818 53.046 56.824 1.00 0.00 H ATOM 4002 HH12 ARG A 267 -19.831 50.215 54.685 1.00 0.00 H ATOM 4003 HH11 ARG A 267 -20.577 50.913 56.168 1.00 0.00 H ATOM 4004 HH22 ARG A 267 -17.727 50.922 54.005 1.00 0.00 H ATOM 4005 HH21 ARG A 267 -16.852 52.168 54.968 1.00 0.00 H ATOM 4006 H ARG A 267 -19.374 51.731 61.943 1.00 0.00 H ATOM 4007 N GLU A 268 -21.404 53.902 63.117 1.00 49.19 N ATOM 4008 CA GLU A 268 -22.468 54.601 63.852 1.00 50.81 C ATOM 4009 C GLU A 268 -21.875 55.466 64.953 1.00 50.61 C ATOM 4010 O GLU A 268 -22.554 56.355 65.427 1.00 52.51 O ATOM 4011 CB GLU A 268 -23.511 53.640 64.465 1.00 51.34 C ATOM 4012 CG GLU A 268 -24.455 52.919 63.431 1.00 53.51 C ATOM 4013 CD GLU A 268 -25.254 53.889 62.542 1.00 52.45 C ATOM 4014 HA GLU A 268 -22.984 55.223 63.121 1.00 0.00 H ATOM 4015 HB2 GLU A 268 -22.975 52.873 65.023 1.00 0.00 H ATOM 4016 HB3 GLU A 268 -24.137 54.214 65.149 1.00 0.00 H ATOM 4017 HG2 GLU A 268 -23.843 52.287 62.788 1.00 0.00 H ATOM 4018 HG3 GLU A 268 -25.160 52.298 63.983 1.00 0.00 H ATOM 4019 H GLU A 268 -21.104 52.948 63.400 1.00 0.00 H ATOM 4020 N LYS A 269 -20.631 55.220 65.373 1.00 49.15 N ATOM 4021 CA LYS A 269 -20.002 56.055 66.430 1.00 47.51 C ATOM 4022 C LYS A 269 -19.755 57.504 65.970 1.00 45.71 C ATOM 4023 O LYS A 269 -19.451 57.734 64.820 1.00 44.97 O ATOM 4024 CB LYS A 269 -18.659 55.462 66.841 1.00 48.50 C ATOM 4025 CG LYS A 269 -18.733 54.040 67.332 1.00 51.68 C ATOM 4026 CD LYS A 269 -19.539 53.992 68.638 1.00 53.23 C ATOM 4027 CE LYS A 269 -19.731 52.578 69.122 1.00 54.06 C ATOM 4028 NZ LYS A 269 -20.638 52.608 70.300 1.00 56.16 N ATOM 4029 HA LYS A 269 -20.701 56.066 67.267 1.00 0.00 H ATOM 4030 HB2 LYS A 269 -17.994 55.491 65.978 1.00 0.00 H ATOM 4031 HB3 LYS A 269 -18.244 56.078 67.639 1.00 0.00 H ATOM 4032 HG2 LYS A 269 -19.221 53.420 66.580 1.00 0.00 H ATOM 4033 HG3 LYS A 269 -17.726 53.664 67.512 1.00 0.00 H ATOM 4034 HD2 LYS A 269 -19.007 54.558 69.403 1.00 0.00 H ATOM 4035 HD3 LYS A 269 -20.516 54.443 68.467 1.00 0.00 H ATOM 4036 HE2 LYS A 269 -18.769 52.152 69.407 1.00 0.00 H ATOM 4037 HE3 LYS A 269 -20.174 51.974 68.330 1.00 0.00 H ATOM 4038 HZ1 LYS A 269 -20.211 53.188 71.050 1.00 0.00 H ATOM 4039 HZ2 LYS A 269 -21.552 53.018 70.022 1.00 0.00 H ATOM 4040 HZ3 LYS A 269 -20.783 51.639 70.649 1.00 0.00 H ATOM 4041 H LYS A 269 -20.095 54.433 64.955 1.00 0.00 H ATOM 4042 N LYS A 270 -19.885 58.490 66.856 1.00 45.44 N ATOM 4043 CA LYS A 270 -19.608 59.864 66.441 1.00 45.59 C ATOM 4044 C LYS A 270 -18.058 59.965 66.251 1.00 42.94 C ATOM 4045 O LYS A 270 -17.311 59.174 66.831 1.00 41.43 O ATOM 4046 CB LYS A 270 -20.122 60.864 67.497 1.00 48.98 C ATOM 4047 CG LYS A 270 -21.676 60.946 67.620 1.00 54.39 C ATOM 4048 CD LYS A 270 -22.404 61.893 66.583 1.00 58.90 C ATOM 4049 CE LYS A 270 -22.304 61.484 65.079 1.00 62.26 C ATOM 4050 NZ LYS A 270 -23.270 60.394 64.573 1.00 64.80 N ATOM 4051 HA LYS A 270 -20.121 60.113 65.512 1.00 0.00 H ATOM 4052 HB2 LYS A 270 -19.720 60.570 68.467 1.00 0.00 H ATOM 4053 HB3 LYS A 270 -19.750 61.855 67.236 1.00 0.00 H ATOM 4054 HG2 LYS A 270 -22.075 59.940 67.490 1.00 0.00 H ATOM 4055 HG3 LYS A 270 -21.913 61.303 68.622 1.00 0.00 H ATOM 4056 HD2 LYS A 270 -23.461 61.926 66.848 1.00 0.00 H ATOM 4057 HD3 LYS A 270 -21.974 62.889 66.685 1.00 0.00 H ATOM 4058 HE2 LYS A 270 -21.289 61.128 64.904 1.00 0.00 H ATOM 4059 HE3 LYS A 270 -22.481 62.380 64.484 1.00 0.00 H ATOM 4060 HZ1 LYS A 270 -23.112 59.517 65.109 1.00 0.00 H ATOM 4061 HZ2 LYS A 270 -24.251 60.712 64.708 1.00 0.00 H ATOM 4062 HZ3 LYS A 270 -23.096 60.221 63.562 1.00 0.00 H ATOM 4063 H LYS A 270 -20.180 58.285 67.832 1.00 0.00 H ATOM 4064 N PRO A 271 -17.567 60.918 65.431 1.00 40.68 N ATOM 4065 CA PRO A 271 -16.108 61.012 65.239 1.00 39.56 C ATOM 4066 C PRO A 271 -15.281 61.003 66.536 1.00 40.51 C ATOM 4067 O PRO A 271 -14.336 60.203 66.693 1.00 37.95 O ATOM 4068 CB PRO A 271 -15.929 62.339 64.461 1.00 39.59 C ATOM 4069 CG PRO A 271 -17.231 62.473 63.710 1.00 40.38 C ATOM 4070 CD PRO A 271 -18.277 61.978 64.690 1.00 37.96 C ATOM 4071 HA PRO A 271 -15.733 60.134 64.714 1.00 0.00 H ATOM 4072 HD3 PRO A 271 -18.596 62.777 65.359 1.00 0.00 H ATOM 4073 HD2 PRO A 271 -19.145 61.576 64.167 1.00 0.00 H ATOM 4074 HG3 PRO A 271 -17.223 61.859 62.809 1.00 0.00 H ATOM 4075 HG2 PRO A 271 -17.416 63.512 63.438 1.00 0.00 H ATOM 4076 HB2 PRO A 271 -15.782 63.176 65.143 1.00 0.00 H ATOM 4077 HB3 PRO A 271 -15.085 62.280 63.774 1.00 0.00 H ATOM 4078 N GLN A 272 -15.635 61.889 67.462 1.00 41.02 N ATOM 4079 CA GLN A 272 -14.896 61.993 68.729 1.00 43.64 C ATOM 4080 C GLN A 272 -14.783 60.707 69.583 1.00 43.32 C ATOM 4081 O GLN A 272 -13.846 60.559 70.390 1.00 40.83 O ATOM 4082 CB GLN A 272 -15.498 63.125 69.577 1.00 45.13 C ATOM 4083 CG GLN A 272 -14.534 63.621 70.658 1.00 49.11 C ATOM 4084 CD GLN A 272 -13.129 63.927 70.090 1.00 50.66 C ATOM 4085 OE1 GLN A 272 -12.991 64.586 69.038 1.00 49.05 O ATOM 4086 NE2 GLN A 272 -12.087 63.450 70.799 1.00 50.21 N ATOM 4087 HA GLN A 272 -13.869 62.199 68.427 1.00 0.00 H ATOM 4088 HB2 GLN A 272 -15.748 63.959 68.921 1.00 0.00 H ATOM 4089 HB3 GLN A 272 -16.405 62.758 70.058 1.00 0.00 H ATOM 4090 HG2 GLN A 272 -14.940 64.531 71.101 1.00 0.00 H ATOM 4091 HG3 GLN A 272 -14.443 62.854 71.427 1.00 0.00 H ATOM 4092 HE22 GLN A 272 -12.256 62.906 71.669 1.00 0.00 H ATOM 4093 HE21 GLN A 272 -11.114 63.626 70.476 1.00 0.00 H ATOM 4094 H GLN A 272 -16.446 62.517 67.288 1.00 0.00 H ATOM 4095 N GLU A 273 -15.730 59.782 69.395 1.00 43.52 N ATOM 4096 CA GLU A 273 -15.722 58.507 70.133 1.00 44.58 C ATOM 4097 C GLU A 273 -14.627 57.611 69.642 1.00 42.35 C ATOM 4098 O GLU A 273 -14.073 56.826 70.403 1.00 42.70 O ATOM 4099 CB GLU A 273 -17.048 57.758 69.980 1.00 47.28 C ATOM 4100 CG GLU A 273 -18.221 58.511 70.562 1.00 51.76 C ATOM 4101 CD GLU A 273 -19.517 57.767 70.314 1.00 54.62 C ATOM 4102 OE1 GLU A 273 -19.797 56.800 71.057 1.00 56.03 O ATOM 4103 OE2 GLU A 273 -20.235 58.130 69.359 1.00 55.33 O ATOM 4104 HA GLU A 273 -15.563 58.758 71.182 1.00 0.00 H ATOM 4105 HB2 GLU A 273 -17.233 57.592 68.919 1.00 0.00 H ATOM 4106 HB3 GLU A 273 -16.965 56.797 70.488 1.00 0.00 H ATOM 4107 HG2 GLU A 273 -18.075 58.626 71.636 1.00 0.00 H ATOM 4108 HG3 GLU A 273 -18.280 59.495 70.098 1.00 0.00 H ATOM 4109 H GLU A 273 -16.491 59.967 68.711 1.00 0.00 H ATOM 4110 N LEU A 274 -14.357 57.671 68.350 1.00 41.03 N ATOM 4111 CA LEU A 274 -13.261 56.877 67.813 1.00 41.70 C ATOM 4112 C LEU A 274 -11.936 57.525 68.289 1.00 40.26 C ATOM 4113 O LEU A 274 -10.995 56.818 68.715 1.00 37.53 O ATOM 4114 CB LEU A 274 -13.286 56.850 66.283 1.00 42.35 C ATOM 4115 CG LEU A 274 -14.056 55.742 65.547 1.00 43.98 C ATOM 4116 CD1 LEU A 274 -15.364 55.429 66.177 1.00 44.23 C ATOM 4117 CD2 LEU A 274 -14.273 56.190 64.133 1.00 44.27 C ATOM 4118 HA LEU A 274 -13.354 55.850 68.165 1.00 0.00 H ATOM 4119 HB2 LEU A 274 -13.712 57.799 65.958 1.00 0.00 H ATOM 4120 HB3 LEU A 274 -12.249 56.786 65.952 1.00 0.00 H ATOM 4121 HG LEU A 274 -13.464 54.828 65.592 1.00 0.00 H ATOM 4122 HD21 LEU A 274 -14.849 57.115 64.131 1.00 0.00 H ATOM 4123 HD22 LEU A 274 -13.308 56.360 63.655 1.00 0.00 H ATOM 4124 HD23 LEU A 274 -14.819 55.419 63.589 1.00 0.00 H ATOM 4125 HD11 LEU A 274 -15.202 55.096 67.202 1.00 0.00 H ATOM 4126 HD12 LEU A 274 -15.988 56.323 66.178 1.00 0.00 H ATOM 4127 HD13 LEU A 274 -15.859 54.640 65.611 1.00 0.00 H ATOM 4128 H LEU A 274 -14.922 58.279 67.723 1.00 0.00 H ATOM 4129 N ILE A 275 -11.870 58.855 68.214 1.00 39.60 N ATOM 4130 CA ILE A 275 -10.664 59.567 68.622 1.00 38.45 C ATOM 4131 C ILE A 275 -10.365 59.366 70.120 1.00 37.50 C ATOM 4132 O ILE A 275 -9.210 59.203 70.503 1.00 38.28 O ATOM 4133 CB ILE A 275 -10.784 61.076 68.245 1.00 38.19 C ATOM 4134 CG1 ILE A 275 -10.838 61.188 66.731 1.00 36.59 C ATOM 4135 CG2 ILE A 275 -9.583 61.921 68.818 1.00 37.60 C ATOM 4136 CD1 ILE A 275 -11.180 62.604 66.235 1.00 39.07 C ATOM 4137 HA ILE A 275 -9.814 59.149 68.082 1.00 0.00 H ATOM 4138 HB ILE A 275 -11.694 61.481 68.688 1.00 0.00 H ATOM 4139 HG12 ILE A 275 -9.865 60.906 66.328 1.00 0.00 H ATOM 4140 HG13 ILE A 275 -11.597 60.499 66.360 1.00 0.00 H ATOM 4141 HD11 ILE A 275 -12.157 62.897 66.621 1.00 0.00 H ATOM 4142 HD12 ILE A 275 -10.423 63.304 66.589 1.00 0.00 H ATOM 4143 HD13 ILE A 275 -11.201 62.611 65.145 1.00 0.00 H ATOM 4144 HG21 ILE A 275 -9.569 61.840 69.905 1.00 0.00 H ATOM 4145 HG22 ILE A 275 -8.646 61.540 68.412 1.00 0.00 H ATOM 4146 HG23 ILE A 275 -9.706 62.966 68.532 1.00 0.00 H ATOM 4147 H ILE A 275 -12.688 59.391 67.860 1.00 0.00 H ATOM 4148 N ASP A 276 -11.392 59.328 70.962 1.00 36.80 N ATOM 4149 CA ASP A 276 -11.191 59.110 72.406 1.00 36.49 C ATOM 4150 C ASP A 276 -10.464 57.823 72.764 1.00 35.69 C ATOM 4151 O ASP A 276 -9.867 57.745 73.835 1.00 35.71 O ATOM 4152 CB ASP A 276 -12.532 59.084 73.178 1.00 39.11 C ATOM 4153 CG ASP A 276 -13.166 60.473 73.348 1.00 42.05 C ATOM 4154 OD1 ASP A 276 -12.460 61.522 73.271 1.00 43.60 O ATOM 4155 OD2 ASP A 276 -14.389 60.496 73.566 1.00 44.42 O ATOM 4156 HA ASP A 276 -10.569 59.957 72.697 1.00 0.00 H ATOM 4157 HB2 ASP A 276 -13.232 58.449 72.634 1.00 0.00 H ATOM 4158 HB3 ASP A 276 -12.353 58.662 74.167 1.00 0.00 H ATOM 4159 H ASP A 276 -12.357 59.455 70.595 1.00 0.00 H ATOM 4160 N VAL A 277 -10.518 56.801 71.912 1.00 35.92 N ATOM 4161 CA VAL A 277 -9.859 55.517 72.244 1.00 33.62 C ATOM 4162 C VAL A 277 -8.771 55.122 71.239 1.00 34.81 C ATOM 4163 O VAL A 277 -8.133 54.060 71.369 1.00 35.99 O ATOM 4164 CB VAL A 277 -10.908 54.325 72.303 1.00 32.61 C ATOM 4165 CG1 VAL A 277 -11.874 54.508 73.480 1.00 31.99 C ATOM 4166 CG2 VAL A 277 -11.731 54.261 71.010 1.00 30.30 C ATOM 4167 HA VAL A 277 -9.401 55.680 73.220 1.00 0.00 H ATOM 4168 HB VAL A 277 -10.343 53.401 72.429 1.00 0.00 H ATOM 4169 HG11 VAL A 277 -11.309 54.527 74.412 1.00 0.00 H ATOM 4170 HG12 VAL A 277 -12.414 55.447 73.362 1.00 0.00 H ATOM 4171 HG13 VAL A 277 -12.582 53.680 73.499 1.00 0.00 H ATOM 4172 HG21 VAL A 277 -12.270 55.199 70.877 1.00 0.00 H ATOM 4173 HG22 VAL A 277 -11.063 54.101 70.163 1.00 0.00 H ATOM 4174 HG23 VAL A 277 -12.442 53.437 71.074 1.00 0.00 H ATOM 4175 H VAL A 277 -11.025 56.905 71.010 1.00 0.00 H ATOM 4176 N GLU A 278 -8.563 55.969 70.236 1.00 34.57 N ATOM 4177 CA GLU A 278 -7.568 55.733 69.176 1.00 35.02 C ATOM 4178 C GLU A 278 -6.196 55.272 69.691 1.00 35.88 C ATOM 4179 O GLU A 278 -5.597 54.304 69.186 1.00 35.52 O ATOM 4180 CB GLU A 278 -7.390 57.032 68.369 1.00 37.40 C ATOM 4181 CG GLU A 278 -6.257 57.039 67.300 1.00 37.88 C ATOM 4182 CD GLU A 278 -6.064 58.428 66.593 1.00 40.13 C ATOM 4183 OE1 GLU A 278 -7.049 59.237 66.496 1.00 37.96 O ATOM 4184 OE2 GLU A 278 -4.916 58.685 66.115 1.00 41.72 O ATOM 4185 HA GLU A 278 -7.953 54.919 68.562 1.00 0.00 H ATOM 4186 HB2 GLU A 278 -8.330 57.235 67.856 1.00 0.00 H ATOM 4187 HB3 GLU A 278 -7.183 57.835 69.076 1.00 0.00 H ATOM 4188 HG2 GLU A 278 -5.321 56.768 67.789 1.00 0.00 H ATOM 4189 HG3 GLU A 278 -6.497 56.296 66.539 1.00 0.00 H ATOM 4190 H GLU A 278 -9.130 56.840 70.198 1.00 0.00 H ATOM 4191 N TRP A 279 -5.702 55.955 70.708 1.00 35.97 N ATOM 4192 CA TRP A 279 -4.397 55.657 71.232 1.00 36.38 C ATOM 4193 C TRP A 279 -4.335 54.398 72.053 1.00 38.01 C ATOM 4194 O TRP A 279 -3.238 53.996 72.410 1.00 40.00 O ATOM 4195 CB TRP A 279 -3.871 56.809 72.058 1.00 36.73 C ATOM 4196 CG TRP A 279 -3.626 58.015 71.254 1.00 38.91 C ATOM 4197 CD1 TRP A 279 -4.458 59.088 71.104 1.00 39.12 C ATOM 4198 CD2 TRP A 279 -2.464 58.293 70.478 1.00 40.11 C ATOM 4199 NE1 TRP A 279 -3.881 60.027 70.278 1.00 39.46 N ATOM 4200 CE2 TRP A 279 -2.652 59.562 69.879 1.00 41.33 C ATOM 4201 CE3 TRP A 279 -1.277 57.598 70.234 1.00 41.52 C ATOM 4202 CZ2 TRP A 279 -1.685 60.158 69.043 1.00 42.06 C ATOM 4203 CZ3 TRP A 279 -0.305 58.190 69.396 1.00 44.68 C ATOM 4204 CH2 TRP A 279 -0.523 59.461 68.813 1.00 41.69 C ATOM 4205 HA TRP A 279 -3.771 55.497 70.354 1.00 0.00 H ATOM 4206 HB2 TRP A 279 -4.602 57.047 72.831 1.00 0.00 H ATOM 4207 HB3 TRP A 279 -2.935 56.505 72.526 1.00 0.00 H ATOM 4208 HE1 TRP A 279 -4.305 60.936 70.003 1.00 0.00 H ATOM 4209 HD1 TRP A 279 -5.438 59.187 71.571 1.00 0.00 H ATOM 4210 HZ2 TRP A 279 -1.853 61.137 68.595 1.00 0.00 H ATOM 4211 HH2 TRP A 279 0.244 59.894 68.171 1.00 0.00 H ATOM 4212 HZ3 TRP A 279 0.626 57.660 69.196 1.00 0.00 H ATOM 4213 HE3 TRP A 279 -1.104 56.619 70.681 1.00 0.00 H ATOM 4214 H TRP A 279 -6.265 56.718 71.135 1.00 0.00 H ATOM 4215 N ASN A 280 -5.466 53.742 72.328 1.00 36.41 N ATOM 4216 CA ASN A 280 -5.393 52.516 73.118 1.00 37.07 C ATOM 4217 C ASN A 280 -5.031 51.258 72.352 1.00 36.76 C ATOM 4218 O ASN A 280 -4.898 50.189 72.961 1.00 37.69 O ATOM 4219 CB ASN A 280 -6.719 52.252 73.857 1.00 36.92 C ATOM 4220 CG ASN A 280 -7.102 53.394 74.784 1.00 38.42 C ATOM 4221 OD1 ASN A 280 -6.251 54.209 75.166 1.00 40.10 O ATOM 4222 ND2 ASN A 280 -8.367 53.473 75.140 1.00 36.38 N ATOM 4223 HA ASN A 280 -4.573 52.713 73.809 1.00 0.00 H ATOM 4224 HB2 ASN A 280 -7.511 52.118 73.120 1.00 0.00 H ATOM 4225 HB3 ASN A 280 -6.616 51.341 74.447 1.00 0.00 H ATOM 4226 HD22 ASN A 280 -9.049 52.767 74.796 1.00 0.00 H ATOM 4227 HD21 ASN A 280 -8.684 54.241 75.765 1.00 0.00 H ATOM 4228 H ASN A 280 -6.381 54.098 71.986 1.00 0.00 H ATOM 4229 N VAL A 281 -4.813 51.361 71.047 1.00 37.20 N ATOM 4230 CA VAL A 281 -4.562 50.155 70.252 1.00 37.53 C ATOM 4231 C VAL A 281 -3.118 49.863 69.873 1.00 38.51 C ATOM 4232 O VAL A 281 -2.836 48.843 69.221 1.00 37.73 O ATOM 4233 CB VAL A 281 -5.444 50.155 68.941 1.00 39.46 C ATOM 4234 CG1 VAL A 281 -6.937 50.373 69.325 1.00 35.36 C ATOM 4235 CG2 VAL A 281 -4.978 51.260 67.943 1.00 36.68 C ATOM 4236 HA VAL A 281 -4.842 49.353 70.935 1.00 0.00 H ATOM 4237 HB VAL A 281 -5.328 49.191 68.445 1.00 0.00 H ATOM 4238 HG11 VAL A 281 -7.262 49.568 69.984 1.00 0.00 H ATOM 4239 HG12 VAL A 281 -7.043 51.329 69.837 1.00 0.00 H ATOM 4240 HG13 VAL A 281 -7.547 50.373 68.422 1.00 0.00 H ATOM 4241 HG21 VAL A 281 -5.064 52.237 68.419 1.00 0.00 H ATOM 4242 HG22 VAL A 281 -3.940 51.080 67.663 1.00 0.00 H ATOM 4243 HG23 VAL A 281 -5.606 51.232 67.053 1.00 0.00 H ATOM 4244 H VAL A 281 -4.820 52.295 70.589 1.00 0.00 H ATOM 4245 N LEU A 282 -2.211 50.756 70.253 1.00 36.33 N ATOM 4246 CA LEU A 282 -0.794 50.526 69.981 1.00 37.49 C ATOM 4247 C LEU A 282 -0.389 49.195 70.635 1.00 37.69 C ATOM 4248 O LEU A 282 -0.828 48.854 71.752 1.00 36.39 O ATOM 4249 CB LEU A 282 0.074 51.667 70.561 1.00 36.06 C ATOM 4250 CG LEU A 282 -0.058 52.932 69.689 1.00 38.51 C ATOM 4251 CD1 LEU A 282 0.858 53.989 70.313 1.00 38.23 C ATOM 4252 CD2 LEU A 282 0.340 52.667 68.190 1.00 33.19 C ATOM 4253 HA LEU A 282 -0.635 50.494 68.903 1.00 0.00 H ATOM 4254 HB2 LEU A 282 -0.257 51.892 71.575 1.00 0.00 H ATOM 4255 HB3 LEU A 282 1.117 51.351 70.582 1.00 0.00 H ATOM 4256 HG LEU A 282 -1.096 53.263 69.667 1.00 0.00 H ATOM 4257 HD21 LEU A 282 1.376 52.331 68.144 1.00 0.00 H ATOM 4258 HD22 LEU A 282 -0.311 51.899 67.773 1.00 0.00 H ATOM 4259 HD23 LEU A 282 0.230 53.588 67.618 1.00 0.00 H ATOM 4260 HD11 LEU A 282 0.539 54.186 71.336 1.00 0.00 H ATOM 4261 HD12 LEU A 282 1.885 53.623 70.315 1.00 0.00 H ATOM 4262 HD13 LEU A 282 0.800 54.908 69.730 1.00 0.00 H ATOM 4263 H LEU A 282 -2.510 51.622 70.746 1.00 0.00 H ATOM 4264 N PRO A 283 0.493 48.445 69.975 1.00 37.38 N ATOM 4265 CA PRO A 283 0.886 47.163 70.580 1.00 37.60 C ATOM 4266 C PRO A 283 1.886 47.299 71.729 1.00 40.00 C ATOM 4267 O PRO A 283 1.936 46.431 72.608 1.00 38.91 O ATOM 4268 CB PRO A 283 1.496 46.389 69.396 1.00 38.08 C ATOM 4269 CG PRO A 283 2.156 47.562 68.587 1.00 36.47 C ATOM 4270 CD PRO A 283 1.060 48.618 68.620 1.00 35.04 C ATOM 4271 HA PRO A 283 0.035 46.665 71.046 1.00 0.00 H ATOM 4272 HD3 PRO A 283 1.472 49.619 68.489 1.00 0.00 H ATOM 4273 HD2 PRO A 283 0.310 48.432 67.852 1.00 0.00 H ATOM 4274 HG3 PRO A 283 2.386 47.260 67.565 1.00 0.00 H ATOM 4275 HG2 PRO A 283 3.065 47.917 69.073 1.00 0.00 H ATOM 4276 HB2 PRO A 283 2.238 45.664 69.730 1.00 0.00 H ATOM 4277 HB3 PRO A 283 0.730 45.880 68.812 1.00 0.00 H ATOM 4278 N PHE A 284 2.683 48.374 71.728 1.00 39.44 N ATOM 4279 CA PHE A 284 3.680 48.536 72.764 1.00 39.08 C ATOM 4280 C PHE A 284 3.637 49.899 73.416 1.00 38.66 C ATOM 4281 O PHE A 284 3.041 50.827 72.886 1.00 38.40 O ATOM 4282 CB PHE A 284 5.072 48.371 72.159 1.00 42.78 C ATOM 4283 CG PHE A 284 5.227 47.159 71.307 1.00 44.58 C ATOM 4284 CD1 PHE A 284 5.217 45.882 71.884 1.00 47.17 C ATOM 4285 CD2 PHE A 284 5.435 47.288 69.933 1.00 46.95 C ATOM 4286 CE1 PHE A 284 5.422 44.734 71.103 1.00 47.26 C ATOM 4287 CE2 PHE A 284 5.646 46.163 69.125 1.00 48.32 C ATOM 4288 CZ PHE A 284 5.641 44.876 69.716 1.00 48.37 C ATOM 4289 HA PHE A 284 3.465 47.780 73.519 1.00 0.00 H ATOM 4290 HB2 PHE A 284 5.286 49.248 71.548 1.00 0.00 H ATOM 4291 HB3 PHE A 284 5.794 48.312 72.973 1.00 0.00 H ATOM 4292 HD2 PHE A 284 5.433 48.280 69.481 1.00 0.00 H ATOM 4293 HE2 PHE A 284 5.812 46.277 68.054 1.00 0.00 H ATOM 4294 HZ PHE A 284 5.807 43.993 69.098 1.00 0.00 H ATOM 4295 HE1 PHE A 284 5.412 43.745 71.562 1.00 0.00 H ATOM 4296 HD1 PHE A 284 5.047 45.779 72.956 1.00 0.00 H ATOM 4297 H PHE A 284 2.586 49.093 70.983 1.00 0.00 H ATOM 4298 N ASP A 285 4.283 50.012 74.572 1.00 36.14 N ATOM 4299 CA ASP A 285 4.414 51.301 75.255 1.00 35.69 C ATOM 4300 C ASP A 285 5.541 51.896 74.391 1.00 36.05 C ATOM 4301 O ASP A 285 6.650 51.363 74.325 1.00 37.72 O ATOM 4302 CB ASP A 285 4.908 51.062 76.680 1.00 36.66 C ATOM 4303 CG ASP A 285 4.886 52.298 77.499 1.00 36.98 C ATOM 4304 OD1 ASP A 285 4.342 53.326 77.009 1.00 38.64 O ATOM 4305 OD2 ASP A 285 5.400 52.233 78.632 1.00 38.67 O ATOM 4306 HA ASP A 285 3.513 51.908 75.343 1.00 0.00 H ATOM 4307 HB2 ASP A 285 4.268 50.317 77.153 1.00 0.00 H ATOM 4308 HB3 ASP A 285 5.931 50.687 76.638 1.00 0.00 H ATOM 4309 H ASP A 285 4.706 49.165 75.002 1.00 0.00 H ATOM 4310 N SER A 286 5.309 53.012 73.751 1.00 35.03 N ATOM 4311 CA SER A 286 6.327 53.476 72.847 1.00 35.54 C ATOM 4312 C SER A 286 6.161 54.928 72.548 1.00 35.05 C ATOM 4313 O SER A 286 5.132 55.519 72.914 1.00 33.97 O ATOM 4314 CB SER A 286 6.150 52.710 71.529 1.00 35.30 C ATOM 4315 OG SER A 286 4.800 52.894 71.065 1.00 38.73 O ATOM 4316 HA SER A 286 7.306 53.317 73.298 1.00 0.00 H ATOM 4317 HB2 SER A 286 6.340 51.649 71.693 1.00 0.00 H ATOM 4318 HB3 SER A 286 6.849 53.093 70.785 1.00 0.00 H ATOM 4319 HG SER A 286 4.675 52.403 70.214 1.00 0.00 H ATOM 4320 H SER A 286 4.425 53.542 73.890 1.00 0.00 H ATOM 4321 N ILE A 287 7.190 55.522 71.945 1.00 33.90 N ATOM 4322 CA ILE A 287 7.023 56.886 71.481 1.00 33.15 C ATOM 4323 C ILE A 287 7.269 56.811 69.973 1.00 34.00 C ATOM 4324 O ILE A 287 7.878 55.843 69.461 1.00 33.89 O ATOM 4325 CB ILE A 287 7.982 57.870 72.124 1.00 34.77 C ATOM 4326 CG1 ILE A 287 9.406 57.379 71.981 1.00 32.21 C ATOM 4327 CG2 ILE A 287 7.589 58.095 73.577 1.00 34.02 C ATOM 4328 CD1 ILE A 287 10.354 58.512 72.350 1.00 34.72 C ATOM 4329 HA ILE A 287 6.033 57.258 71.745 1.00 0.00 H ATOM 4330 HB ILE A 287 7.923 58.832 71.615 1.00 0.00 H ATOM 4331 HG12 ILE A 287 9.570 56.532 72.647 1.00 0.00 H ATOM 4332 HG13 ILE A 287 9.586 57.071 70.951 1.00 0.00 H ATOM 4333 HD11 ILE A 287 10.185 59.357 71.683 1.00 0.00 H ATOM 4334 HD12 ILE A 287 10.169 58.818 73.380 1.00 0.00 H ATOM 4335 HD13 ILE A 287 11.384 58.169 72.251 1.00 0.00 H ATOM 4336 HG21 ILE A 287 6.576 58.496 73.620 1.00 0.00 H ATOM 4337 HG22 ILE A 287 7.629 57.147 74.114 1.00 0.00 H ATOM 4338 HG23 ILE A 287 8.281 58.802 74.034 1.00 0.00 H ATOM 4339 H ILE A 287 8.091 55.020 71.810 1.00 0.00 H ATOM 4340 N PHE A 288 6.810 57.825 69.263 1.00 31.47 N ATOM 4341 CA PHE A 288 6.969 57.860 67.803 1.00 32.48 C ATOM 4342 C PHE A 288 6.257 56.689 67.108 1.00 33.02 C ATOM 4343 O PHE A 288 6.762 56.118 66.133 1.00 34.64 O ATOM 4344 CB PHE A 288 8.464 57.910 67.377 1.00 30.25 C ATOM 4345 CG PHE A 288 8.735 58.897 66.248 1.00 30.37 C ATOM 4346 CD1 PHE A 288 8.019 58.815 65.028 1.00 29.23 C ATOM 4347 CD2 PHE A 288 9.684 59.917 66.393 1.00 29.32 C ATOM 4348 CE1 PHE A 288 8.249 59.702 64.013 1.00 29.45 C ATOM 4349 CE2 PHE A 288 9.927 60.815 65.387 1.00 28.39 C ATOM 4350 CZ PHE A 288 9.204 60.717 64.174 1.00 30.86 C ATOM 4351 HA PHE A 288 6.492 58.783 67.475 1.00 0.00 H ATOM 4352 HB2 PHE A 288 9.061 58.200 68.242 1.00 0.00 H ATOM 4353 HB3 PHE A 288 8.764 56.915 67.047 1.00 0.00 H ATOM 4354 HD2 PHE A 288 10.241 59.998 67.326 1.00 0.00 H ATOM 4355 HE2 PHE A 288 10.672 61.599 65.520 1.00 0.00 H ATOM 4356 HZ PHE A 288 9.389 61.427 63.368 1.00 0.00 H ATOM 4357 HE1 PHE A 288 7.691 59.621 63.080 1.00 0.00 H ATOM 4358 HD1 PHE A 288 7.272 58.032 64.896 1.00 0.00 H ATOM 4359 H PHE A 288 6.329 58.611 69.745 1.00 0.00 H ATOM 4360 N ARG A 289 5.094 56.303 67.631 1.00 33.31 N ATOM 4361 CA ARG A 289 4.296 55.257 66.993 1.00 33.78 C ATOM 4362 C ARG A 289 2.859 55.803 67.047 1.00 33.80 C ATOM 4363 O ARG A 289 2.431 56.374 68.058 1.00 33.47 O ATOM 4364 CB ARG A 289 4.413 53.923 67.724 1.00 32.74 C ATOM 4365 CG ARG A 289 5.786 53.313 67.633 1.00 32.65 C ATOM 4366 CD ARG A 289 6.152 52.985 66.161 1.00 33.71 C ATOM 4367 NE ARG A 289 7.417 52.239 66.130 1.00 34.58 N ATOM 4368 CZ ARG A 289 8.622 52.784 65.957 1.00 33.67 C ATOM 4369 NH1 ARG A 289 8.757 54.094 65.798 1.00 31.36 N ATOM 4370 NH2 ARG A 289 9.687 51.996 65.905 1.00 32.90 N ATOM 4371 HA ARG A 289 4.629 55.047 65.977 1.00 0.00 H ATOM 4372 HB2 ARG A 289 4.174 54.082 68.775 1.00 0.00 H ATOM 4373 HB3 ARG A 289 3.695 53.227 67.291 1.00 0.00 H ATOM 4374 HG2 ARG A 289 6.516 54.016 68.034 1.00 0.00 H ATOM 4375 HG3 ARG A 289 5.808 52.394 68.219 1.00 0.00 H ATOM 4376 HD2 ARG A 289 6.261 53.912 65.598 1.00 0.00 H ATOM 4377 HD3 ARG A 289 5.362 52.381 65.715 1.00 0.00 H ATOM 4378 HE ARG A 289 7.369 51.207 66.252 1.00 0.00 H ATOM 4379 HH12 ARG A 289 9.702 54.507 65.664 1.00 0.00 H ATOM 4380 HH11 ARG A 289 7.918 54.708 65.807 1.00 0.00 H ATOM 4381 HH22 ARG A 289 10.632 52.408 65.771 1.00 0.00 H ATOM 4382 HH21 ARG A 289 9.577 50.966 65.999 1.00 0.00 H ATOM 4383 H ARG A 289 4.749 56.751 68.504 1.00 0.00 H ATOM 4384 N PHE A 290 2.150 55.616 65.937 1.00 33.70 N ATOM 4385 CA PHE A 290 0.793 56.125 65.728 1.00 33.69 C ATOM 4386 C PHE A 290 -0.107 54.986 65.325 1.00 32.74 C ATOM 4387 O PHE A 290 0.307 54.060 64.673 1.00 32.20 O ATOM 4388 CB PHE A 290 0.877 57.243 64.668 1.00 33.83 C ATOM 4389 CG PHE A 290 2.071 58.149 64.890 1.00 33.94 C ATOM 4390 CD1 PHE A 290 2.167 58.902 66.060 1.00 35.52 C ATOM 4391 CD2 PHE A 290 3.157 58.132 64.011 1.00 34.32 C ATOM 4392 CE1 PHE A 290 3.326 59.629 66.360 1.00 35.98 C ATOM 4393 CE2 PHE A 290 4.310 58.840 64.290 1.00 33.77 C ATOM 4394 CZ PHE A 290 4.405 59.602 65.471 1.00 34.33 C ATOM 4395 HA PHE A 290 0.364 56.549 66.636 1.00 0.00 H ATOM 4396 HB2 PHE A 290 0.960 56.787 63.681 1.00 0.00 H ATOM 4397 HB3 PHE A 290 -0.033 57.842 64.715 1.00 0.00 H ATOM 4398 HD2 PHE A 290 3.093 57.551 63.091 1.00 0.00 H ATOM 4399 HE2 PHE A 290 5.149 58.809 63.594 1.00 0.00 H ATOM 4400 HZ PHE A 290 5.312 60.166 65.690 1.00 0.00 H ATOM 4401 HE1 PHE A 290 3.386 60.211 67.279 1.00 0.00 H ATOM 4402 HD1 PHE A 290 1.326 58.925 66.753 1.00 0.00 H ATOM 4403 H PHE A 290 2.589 55.072 65.167 1.00 0.00 H ATOM 4404 N SER A 291 -1.351 55.063 65.764 1.00 33.23 N ATOM 4405 CA SER A 291 -2.303 53.991 65.576 1.00 33.03 C ATOM 4406 C SER A 291 -2.693 53.582 64.166 1.00 34.37 C ATOM 4407 O SER A 291 -2.460 52.422 63.763 1.00 34.01 O ATOM 4408 CB SER A 291 -3.557 54.309 66.384 1.00 33.13 C ATOM 4409 OG SER A 291 -3.210 54.180 67.751 1.00 33.24 O ATOM 4410 HA SER A 291 -1.760 53.112 65.923 1.00 0.00 H ATOM 4411 HB2 SER A 291 -4.353 53.609 66.132 1.00 0.00 H ATOM 4412 HB3 SER A 291 -3.889 55.326 66.176 1.00 0.00 H ATOM 4413 HG SER A 291 -4.001 54.379 68.311 1.00 0.00 H ATOM 4414 H SER A 291 -1.656 55.924 66.262 1.00 0.00 H ATOM 4415 N PHE A 292 -3.264 54.511 63.414 1.00 32.16 N ATOM 4416 CA PHE A 292 -3.724 54.164 62.072 1.00 32.90 C ATOM 4417 C PHE A 292 -2.870 54.806 61.000 1.00 32.39 C ATOM 4418 O PHE A 292 -2.857 56.032 60.835 1.00 32.27 O ATOM 4419 CB PHE A 292 -5.171 54.596 61.973 1.00 31.38 C ATOM 4420 CG PHE A 292 -6.007 53.915 62.968 1.00 33.61 C ATOM 4421 CD1 PHE A 292 -6.343 52.555 62.793 1.00 33.15 C ATOM 4422 CD2 PHE A 292 -6.379 54.567 64.139 1.00 32.37 C ATOM 4423 CE1 PHE A 292 -7.044 51.860 63.798 1.00 33.50 C ATOM 4424 CE2 PHE A 292 -7.071 53.884 65.150 1.00 35.14 C ATOM 4425 CZ PHE A 292 -7.402 52.516 64.972 1.00 35.30 C ATOM 4426 HA PHE A 292 -3.637 53.090 61.907 1.00 0.00 H ATOM 4427 HB2 PHE A 292 -5.231 55.672 62.137 1.00 0.00 H ATOM 4428 HB3 PHE A 292 -5.544 54.360 60.976 1.00 0.00 H ATOM 4429 HD2 PHE A 292 -6.130 55.620 64.272 1.00 0.00 H ATOM 4430 HE2 PHE A 292 -7.353 54.401 66.067 1.00 0.00 H ATOM 4431 HZ PHE A 292 -7.937 51.979 65.755 1.00 0.00 H ATOM 4432 HE1 PHE A 292 -7.305 50.811 63.657 1.00 0.00 H ATOM 4433 HD1 PHE A 292 -6.059 52.040 61.875 1.00 0.00 H ATOM 4434 H PHE A 292 -3.384 55.479 63.776 1.00 0.00 H ATOM 4435 N VAL A 293 -2.151 53.954 60.288 1.00 31.33 N ATOM 4436 CA VAL A 293 -1.247 54.408 59.286 1.00 31.17 C ATOM 4437 C VAL A 293 -1.370 53.524 58.033 1.00 31.97 C ATOM 4438 O VAL A 293 -2.076 52.503 58.031 1.00 31.75 O ATOM 4439 CB VAL A 293 0.259 54.342 59.817 1.00 31.55 C ATOM 4440 CG1 VAL A 293 0.480 55.264 61.051 1.00 27.51 C ATOM 4441 CG2 VAL A 293 0.641 52.876 60.162 1.00 28.94 C ATOM 4442 HA VAL A 293 -1.498 55.440 59.041 1.00 0.00 H ATOM 4443 HB VAL A 293 0.907 54.704 59.019 1.00 0.00 H ATOM 4444 HG11 VAL A 293 0.259 56.295 60.776 1.00 0.00 H ATOM 4445 HG12 VAL A 293 -0.182 54.952 61.859 1.00 0.00 H ATOM 4446 HG13 VAL A 293 1.517 55.188 61.379 1.00 0.00 H ATOM 4447 HG21 VAL A 293 -0.028 52.500 60.936 1.00 0.00 H ATOM 4448 HG22 VAL A 293 0.549 52.258 59.269 1.00 0.00 H ATOM 4449 HG23 VAL A 293 1.669 52.845 60.522 1.00 0.00 H ATOM 4450 H VAL A 293 -2.248 52.933 60.463 1.00 0.00 H ATOM 4451 N PRO A 294 -0.672 53.909 56.957 1.00 31.20 N ATOM 4452 CA PRO A 294 -0.695 53.139 55.708 1.00 31.99 C ATOM 4453 C PRO A 294 -0.427 51.625 55.962 1.00 34.20 C ATOM 4454 O PRO A 294 0.291 51.259 56.910 1.00 33.40 O ATOM 4455 CB PRO A 294 0.413 53.816 54.863 1.00 30.09 C ATOM 4456 CG PRO A 294 0.173 55.323 55.217 1.00 31.24 C ATOM 4457 CD PRO A 294 -0.057 55.254 56.775 1.00 31.60 C ATOM 4458 HA PRO A 294 -1.662 53.150 55.206 1.00 0.00 H ATOM 4459 HD3 PRO A 294 0.886 55.331 57.316 1.00 0.00 H ATOM 4460 HD2 PRO A 294 -0.731 56.043 57.108 1.00 0.00 H ATOM 4461 HG3 PRO A 294 -0.704 55.717 54.703 1.00 0.00 H ATOM 4462 HG2 PRO A 294 1.042 55.933 54.970 1.00 0.00 H ATOM 4463 HB2 PRO A 294 1.407 53.486 55.166 1.00 0.00 H ATOM 4464 HB3 PRO A 294 0.277 53.627 53.798 1.00 0.00 H ATOM 4465 N VAL A 295 -1.002 50.752 55.122 1.00 35.36 N ATOM 4466 CA VAL A 295 -0.795 49.301 55.251 1.00 36.76 C ATOM 4467 C VAL A 295 -0.161 48.775 54.001 1.00 36.11 C ATOM 4468 O VAL A 295 -0.493 49.215 52.916 1.00 35.60 O ATOM 4469 CB VAL A 295 -2.097 48.486 55.378 1.00 38.22 C ATOM 4470 CG1 VAL A 295 -2.450 48.323 56.759 1.00 39.57 C ATOM 4471 CG2 VAL A 295 -3.235 49.145 54.593 1.00 37.54 C ATOM 4472 HA VAL A 295 -0.192 49.187 56.152 1.00 0.00 H ATOM 4473 HB VAL A 295 -1.928 47.498 54.949 1.00 0.00 H ATOM 4474 HG11 VAL A 295 -1.648 47.797 57.278 1.00 0.00 H ATOM 4475 HG12 VAL A 295 -2.597 49.303 57.213 1.00 0.00 H ATOM 4476 HG13 VAL A 295 -3.372 47.745 56.831 1.00 0.00 H ATOM 4477 HG21 VAL A 295 -3.410 50.148 54.982 1.00 0.00 H ATOM 4478 HG22 VAL A 295 -2.961 49.205 53.540 1.00 0.00 H ATOM 4479 HG23 VAL A 295 -4.141 48.549 54.700 1.00 0.00 H ATOM 4480 H VAL A 295 -1.611 51.110 54.359 1.00 0.00 H ATOM 4481 N ILE A 296 0.726 47.803 54.152 1.00 36.32 N ATOM 4482 CA ILE A 296 1.397 47.208 53.015 1.00 37.54 C ATOM 4483 C ILE A 296 0.335 46.207 52.545 1.00 39.64 C ATOM 4484 O ILE A 296 0.173 45.091 53.075 1.00 39.37 O ATOM 4485 CB ILE A 296 2.715 46.553 53.486 1.00 37.92 C ATOM 4486 CG1 ILE A 296 3.592 47.642 54.120 1.00 36.83 C ATOM 4487 CG2 ILE A 296 3.416 45.877 52.296 1.00 38.33 C ATOM 4488 CD1 ILE A 296 3.718 48.966 53.228 1.00 33.78 C ATOM 4489 HA ILE A 296 1.705 47.885 52.218 1.00 0.00 H ATOM 4490 HB ILE A 296 2.521 45.779 54.229 1.00 0.00 H ATOM 4491 HG12 ILE A 296 3.160 47.915 55.083 1.00 0.00 H ATOM 4492 HG13 ILE A 296 4.591 47.234 54.274 1.00 0.00 H ATOM 4493 HD11 ILE A 296 4.160 48.713 52.264 1.00 0.00 H ATOM 4494 HD12 ILE A 296 2.728 49.394 53.074 1.00 0.00 H ATOM 4495 HD13 ILE A 296 4.352 49.689 53.741 1.00 0.00 H ATOM 4496 HG21 ILE A 296 2.762 45.112 51.878 1.00 0.00 H ATOM 4497 HG22 ILE A 296 3.637 46.624 51.534 1.00 0.00 H ATOM 4498 HG23 ILE A 296 4.344 45.418 52.636 1.00 0.00 H ATOM 4499 H ILE A 296 0.946 47.459 55.109 1.00 0.00 H ATOM 4500 N ASP A 297 -0.412 46.620 51.537 1.00 39.28 N ATOM 4501 CA ASP A 297 -1.562 45.823 51.161 1.00 40.27 C ATOM 4502 C ASP A 297 -1.546 44.989 49.919 1.00 40.85 C ATOM 4503 O ASP A 297 -2.506 44.261 49.716 1.00 41.79 O ATOM 4504 CB ASP A 297 -2.767 46.744 51.054 1.00 39.74 C ATOM 4505 CG ASP A 297 -2.591 47.761 49.947 1.00 40.84 C ATOM 4506 OD1 ASP A 297 -1.439 47.963 49.474 1.00 41.32 O ATOM 4507 OD2 ASP A 297 -3.589 48.384 49.549 1.00 44.51 O ATOM 4508 HA ASP A 297 -1.577 45.079 51.958 1.00 0.00 H ATOM 4509 HB2 ASP A 297 -3.654 46.145 50.847 1.00 0.00 H ATOM 4510 HB3 ASP A 297 -2.897 47.269 52.000 1.00 0.00 H ATOM 4511 H ASP A 297 -0.180 47.496 51.026 1.00 0.00 H ATOM 4512 N GLY A 298 -0.526 45.094 49.075 1.00 40.70 N ATOM 4513 CA GLY A 298 -0.567 44.314 47.840 1.00 40.90 C ATOM 4514 C GLY A 298 -1.345 45.085 46.758 1.00 42.32 C ATOM 4515 O GLY A 298 -1.428 44.622 45.642 1.00 43.08 O ATOM 4516 HA3 GLY A 298 -1.061 43.361 48.030 1.00 0.00 H ATOM 4517 HA2 GLY A 298 0.450 44.132 47.493 1.00 0.00 H ATOM 4518 H GLY A 298 0.281 45.715 49.287 1.00 0.00 H ATOM 4519 N GLU A 299 -1.929 46.253 47.061 1.00 41.99 N ATOM 4520 CA GLU A 299 -2.651 47.037 46.048 1.00 40.60 C ATOM 4521 C GLU A 299 -1.949 48.407 45.878 1.00 39.11 C ATOM 4522 O GLU A 299 -1.246 48.650 44.905 1.00 38.28 O ATOM 4523 CB GLU A 299 -4.096 47.270 46.482 1.00 43.63 C ATOM 4524 CG GLU A 299 -4.923 45.976 46.751 1.00 49.64 C ATOM 4525 HA GLU A 299 -2.649 46.487 45.107 1.00 0.00 H ATOM 4526 HB2 GLU A 299 -4.083 47.859 47.399 1.00 0.00 H ATOM 4527 HB3 GLU A 299 -4.598 47.835 45.696 1.00 0.00 H ATOM 4528 HG2 GLU A 299 -4.963 45.377 45.842 1.00 0.00 H ATOM 4529 HG3 GLU A 299 -4.448 45.401 47.546 1.00 0.00 H ATOM 4530 H GLU A 299 -1.870 46.613 48.035 1.00 0.00 H ATOM 4531 N PHE A 300 -2.131 49.304 46.845 1.00 37.04 N ATOM 4532 CA PHE A 300 -1.485 50.591 46.761 1.00 35.37 C ATOM 4533 C PHE A 300 0.029 50.325 46.753 1.00 35.32 C ATOM 4534 O PHE A 300 0.764 50.923 45.976 1.00 36.08 O ATOM 4535 CB PHE A 300 -1.952 51.470 47.942 1.00 34.33 C ATOM 4536 CG PHE A 300 -1.498 52.884 47.832 1.00 35.56 C ATOM 4537 CD1 PHE A 300 -0.156 53.219 48.084 1.00 34.79 C ATOM 4538 CD2 PHE A 300 -2.389 53.889 47.452 1.00 34.23 C ATOM 4539 CE1 PHE A 300 0.296 54.554 47.976 1.00 34.71 C ATOM 4540 CE2 PHE A 300 -1.956 55.213 47.331 1.00 33.12 C ATOM 4541 CZ PHE A 300 -0.584 55.540 47.609 1.00 32.46 C ATOM 4542 HA PHE A 300 -1.745 51.140 45.856 1.00 0.00 H ATOM 4543 HB2 PHE A 300 -3.041 51.457 47.975 1.00 0.00 H ATOM 4544 HB3 PHE A 300 -1.556 51.049 48.866 1.00 0.00 H ATOM 4545 HD2 PHE A 300 -3.430 53.640 47.248 1.00 0.00 H ATOM 4546 HE2 PHE A 300 -2.655 55.993 47.028 1.00 0.00 H ATOM 4547 HZ PHE A 300 -0.243 56.572 47.528 1.00 0.00 H ATOM 4548 HE1 PHE A 300 1.338 54.798 48.183 1.00 0.00 H ATOM 4549 HD1 PHE A 300 0.548 52.436 48.367 1.00 0.00 H ATOM 4550 H PHE A 300 -2.737 49.077 47.659 1.00 0.00 H ATOM 4551 N PHE A 301 0.498 49.410 47.610 1.00 35.57 N ATOM 4552 CA PHE A 301 1.915 48.998 47.633 1.00 34.79 C ATOM 4553 C PHE A 301 1.907 47.543 47.106 1.00 36.08 C ATOM 4554 O PHE A 301 1.471 46.624 47.799 1.00 36.18 O ATOM 4555 CB PHE A 301 2.464 49.061 49.079 1.00 33.65 C ATOM 4556 CG PHE A 301 2.385 50.445 49.692 1.00 33.64 C ATOM 4557 CD1 PHE A 301 3.228 51.479 49.228 1.00 32.53 C ATOM 4558 CD2 PHE A 301 1.466 50.727 50.699 1.00 30.99 C ATOM 4559 CE1 PHE A 301 3.138 52.796 49.794 1.00 32.43 C ATOM 4560 CE2 PHE A 301 1.367 52.028 51.261 1.00 33.53 C ATOM 4561 CZ PHE A 301 2.206 53.059 50.813 1.00 28.78 C ATOM 4562 HA PHE A 301 2.552 49.645 47.030 1.00 0.00 H ATOM 4563 HB2 PHE A 301 1.887 48.375 49.699 1.00 0.00 H ATOM 4564 HB3 PHE A 301 3.508 48.747 49.067 1.00 0.00 H ATOM 4565 HD2 PHE A 301 0.811 49.936 51.063 1.00 0.00 H ATOM 4566 HE2 PHE A 301 0.635 52.226 52.044 1.00 0.00 H ATOM 4567 HZ PHE A 301 2.136 54.055 51.251 1.00 0.00 H ATOM 4568 HE1 PHE A 301 3.792 53.591 49.434 1.00 0.00 H ATOM 4569 HD1 PHE A 301 3.950 51.277 48.437 1.00 0.00 H ATOM 4570 H PHE A 301 -0.161 48.973 48.285 1.00 0.00 H ATOM 4571 N PRO A 302 2.385 47.316 45.883 1.00 37.33 N ATOM 4572 CA PRO A 302 2.353 45.930 45.384 1.00 38.37 C ATOM 4573 C PRO A 302 3.157 44.888 46.169 1.00 40.06 C ATOM 4574 O PRO A 302 2.704 43.743 46.281 1.00 41.28 O ATOM 4575 CB PRO A 302 2.775 46.066 43.903 1.00 38.02 C ATOM 4576 CG PRO A 302 3.579 47.408 43.879 1.00 40.08 C ATOM 4577 CD PRO A 302 2.837 48.279 44.857 1.00 37.15 C ATOM 4578 HA PRO A 302 1.357 45.506 45.514 1.00 0.00 H ATOM 4579 HD3 PRO A 302 3.496 49.032 45.289 1.00 0.00 H ATOM 4580 HD2 PRO A 302 1.989 48.770 44.380 1.00 0.00 H ATOM 4581 HG3 PRO A 302 3.573 47.848 42.882 1.00 0.00 H ATOM 4582 HG2 PRO A 302 4.609 47.251 44.200 1.00 0.00 H ATOM 4583 HB2 PRO A 302 3.403 45.229 43.597 1.00 0.00 H ATOM 4584 HB3 PRO A 302 1.903 46.121 43.252 1.00 0.00 H ATOM 4585 N THR A 303 4.343 45.236 46.679 1.00 38.97 N ATOM 4586 CA THR A 303 5.088 44.280 47.504 1.00 39.95 C ATOM 4587 C THR A 303 5.644 45.049 48.682 1.00 38.88 C ATOM 4588 O THR A 303 5.279 46.208 48.858 1.00 39.46 O ATOM 4589 CB THR A 303 6.238 43.614 46.747 1.00 41.40 C ATOM 4590 OG1 THR A 303 7.230 44.600 46.375 1.00 43.33 O ATOM 4591 CG2 THR A 303 5.703 42.950 45.479 1.00 43.25 C ATOM 4592 HA THR A 303 4.414 43.481 47.812 1.00 0.00 H ATOM 4593 HB THR A 303 6.695 42.866 47.396 1.00 0.00 H ATOM 4594 HG1 THR A 303 7.586 45.032 47.191 1.00 0.00 H ATOM 4595 HG23 THR A 303 4.954 42.205 45.749 1.00 0.00 H ATOM 4596 HG21 THR A 303 5.250 43.706 44.838 1.00 0.00 H ATOM 4597 HG22 THR A 303 6.524 42.467 44.949 1.00 0.00 H ATOM 4598 H THR A 303 4.735 46.181 46.491 1.00 0.00 H ATOM 4599 N SER A 304 6.520 44.426 49.474 1.00 37.63 N ATOM 4600 CA SER A 304 7.127 45.097 50.635 1.00 37.91 C ATOM 4601 C SER A 304 7.874 46.354 50.158 1.00 36.15 C ATOM 4602 O SER A 304 8.365 46.383 49.045 1.00 35.92 O ATOM 4603 CB SER A 304 8.126 44.162 51.352 1.00 37.61 C ATOM 4604 OG SER A 304 9.314 44.014 50.569 1.00 40.71 O ATOM 4605 HA SER A 304 6.335 45.365 51.334 1.00 0.00 H ATOM 4606 HB2 SER A 304 7.665 43.185 51.496 1.00 0.00 H ATOM 4607 HB3 SER A 304 8.384 44.587 52.322 1.00 0.00 H ATOM 4608 HG SER A 304 9.081 43.626 49.688 1.00 0.00 H ATOM 4609 H SER A 304 6.780 43.441 49.265 1.00 0.00 H ATOM 4610 N LEU A 305 7.974 47.377 50.995 1.00 36.18 N ATOM 4611 CA LEU A 305 8.644 48.594 50.565 1.00 35.68 C ATOM 4612 C LEU A 305 10.110 48.321 50.235 1.00 37.35 C ATOM 4613 O LEU A 305 10.637 48.834 49.228 1.00 36.77 O ATOM 4614 CB LEU A 305 8.512 49.679 51.639 1.00 34.85 C ATOM 4615 CG LEU A 305 7.080 50.065 52.039 1.00 34.59 C ATOM 4616 CD1 LEU A 305 7.174 51.156 53.143 1.00 34.60 C ATOM 4617 CD2 LEU A 305 6.272 50.542 50.827 1.00 35.72 C ATOM 4618 HA LEU A 305 8.163 48.953 49.655 1.00 0.00 H ATOM 4619 HB2 LEU A 305 9.024 49.326 52.534 1.00 0.00 H ATOM 4620 HB3 LEU A 305 9.008 50.576 51.269 1.00 0.00 H ATOM 4621 HG LEU A 305 6.549 49.196 52.428 1.00 0.00 H ATOM 4622 HD21 LEU A 305 6.757 51.414 50.389 1.00 0.00 H ATOM 4623 HD22 LEU A 305 6.222 49.743 50.088 1.00 0.00 H ATOM 4624 HD23 LEU A 305 5.264 50.807 51.146 1.00 0.00 H ATOM 4625 HD11 LEU A 305 7.713 50.756 54.002 1.00 0.00 H ATOM 4626 HD12 LEU A 305 7.705 52.023 52.751 1.00 0.00 H ATOM 4627 HD13 LEU A 305 6.170 51.450 53.448 1.00 0.00 H ATOM 4628 H LEU A 305 7.576 47.310 51.953 1.00 0.00 H ATOM 4629 N GLU A 306 10.768 47.508 51.068 1.00 37.24 N ATOM 4630 CA GLU A 306 12.172 47.164 50.830 1.00 37.89 C ATOM 4631 C GLU A 306 12.416 46.445 49.496 1.00 37.77 C ATOM 4632 O GLU A 306 13.412 46.730 48.805 1.00 37.48 O ATOM 4633 CB GLU A 306 12.723 46.301 51.991 1.00 39.51 C ATOM 4634 CG GLU A 306 14.209 46.038 51.920 1.00 43.15 C ATOM 4635 CD GLU A 306 15.078 47.328 51.981 1.00 45.55 C ATOM 4636 OE1 GLU A 306 14.583 48.409 52.401 1.00 46.11 O ATOM 4637 OE2 GLU A 306 16.275 47.252 51.630 1.00 46.48 O ATOM 4638 HA GLU A 306 12.704 48.114 50.778 1.00 0.00 H ATOM 4639 HB2 GLU A 306 12.512 46.815 52.929 1.00 0.00 H ATOM 4640 HB3 GLU A 306 12.205 45.342 51.979 1.00 0.00 H ATOM 4641 HG2 GLU A 306 14.485 45.397 52.757 1.00 0.00 H ATOM 4642 HG3 GLU A 306 14.423 45.523 50.984 1.00 0.00 H ATOM 4643 H GLU A 306 10.277 47.115 51.896 1.00 0.00 H ATOM 4644 N SER A 307 11.542 45.519 49.097 1.00 37.39 N ATOM 4645 CA SER A 307 11.791 44.848 47.801 1.00 38.57 C ATOM 4646 C SER A 307 11.479 45.823 46.650 1.00 37.54 C ATOM 4647 O SER A 307 12.135 45.775 45.612 1.00 36.50 O ATOM 4648 CB SER A 307 10.964 43.550 47.651 1.00 39.43 C ATOM 4649 OG SER A 307 9.578 43.800 47.791 1.00 45.92 O ATOM 4650 HA SER A 307 12.842 44.562 47.765 1.00 0.00 H ATOM 4651 HB2 SER A 307 11.276 42.840 48.417 1.00 0.00 H ATOM 4652 HB3 SER A 307 11.150 43.123 46.665 1.00 0.00 H ATOM 4653 HG SER A 307 9.402 44.183 48.687 1.00 0.00 H ATOM 4654 H SER A 307 10.714 45.277 49.677 1.00 0.00 H ATOM 4655 N MET A 308 10.505 46.725 46.845 1.00 36.45 N ATOM 4656 CA MET A 308 10.236 47.697 45.798 1.00 37.07 C ATOM 4657 C MET A 308 11.495 48.581 45.675 1.00 37.49 C ATOM 4658 O MET A 308 11.949 48.851 44.587 1.00 35.91 O ATOM 4659 CB MET A 308 9.011 48.574 46.140 1.00 37.32 C ATOM 4660 CG MET A 308 7.684 47.853 46.092 1.00 34.31 C ATOM 4661 SD MET A 308 6.291 48.911 46.316 1.00 39.18 S ATOM 4662 CE MET A 308 6.388 49.774 44.599 1.00 34.01 C ATOM 4663 HA MET A 308 10.010 47.185 44.863 1.00 0.00 H ATOM 4664 HB2 MET A 308 9.147 48.969 47.147 1.00 0.00 H ATOM 4665 HB3 MET A 308 8.975 49.399 45.429 1.00 0.00 H ATOM 4666 HG2 MET A 308 7.673 47.099 46.879 1.00 0.00 H ATOM 4667 HG3 MET A 308 7.593 47.365 45.122 1.00 0.00 H ATOM 4668 HE1 MET A 308 7.349 50.279 44.501 1.00 0.00 H ATOM 4669 HE2 MET A 308 6.287 49.027 43.812 1.00 0.00 H ATOM 4670 HE3 MET A 308 5.583 50.504 44.514 1.00 0.00 H ATOM 4671 H MET A 308 9.954 46.729 47.727 1.00 0.00 H ATOM 4672 N LEU A 309 12.055 49.031 46.799 1.00 38.67 N ATOM 4673 CA LEU A 309 13.245 49.883 46.734 1.00 40.54 C ATOM 4674 C LEU A 309 14.443 49.158 46.112 1.00 43.14 C ATOM 4675 O LEU A 309 15.217 49.724 45.305 1.00 42.69 O ATOM 4676 CB LEU A 309 13.639 50.379 48.128 1.00 37.81 C ATOM 4677 CG LEU A 309 12.757 51.479 48.756 1.00 38.20 C ATOM 4678 CD1 LEU A 309 13.244 51.750 50.195 1.00 37.05 C ATOM 4679 CD2 LEU A 309 12.831 52.780 47.913 1.00 37.12 C ATOM 4680 HA LEU A 309 12.982 50.729 46.099 1.00 0.00 H ATOM 4681 HB2 LEU A 309 13.622 49.521 48.800 1.00 0.00 H ATOM 4682 HB3 LEU A 309 14.655 50.769 48.064 1.00 0.00 H ATOM 4683 HG LEU A 309 11.720 51.145 48.775 1.00 0.00 H ATOM 4684 HD21 LEU A 309 13.863 53.130 47.877 1.00 0.00 H ATOM 4685 HD22 LEU A 309 12.479 52.577 46.902 1.00 0.00 H ATOM 4686 HD23 LEU A 309 12.203 53.544 48.371 1.00 0.00 H ATOM 4687 HD11 LEU A 309 13.166 50.835 50.782 1.00 0.00 H ATOM 4688 HD12 LEU A 309 14.283 52.080 50.170 1.00 0.00 H ATOM 4689 HD13 LEU A 309 12.626 52.526 50.646 1.00 0.00 H ATOM 4690 H LEU A 309 11.647 48.777 47.721 1.00 0.00 H ATOM 4691 N ASN A 310 14.600 47.901 46.512 1.00 44.17 N ATOM 4692 CA ASN A 310 15.686 47.099 46.020 1.00 44.72 C ATOM 4693 C ASN A 310 15.643 46.821 44.552 1.00 43.91 C ATOM 4694 O ASN A 310 16.697 46.797 43.910 1.00 43.63 O ATOM 4695 CB ASN A 310 15.733 45.769 46.749 1.00 48.42 C ATOM 4696 CG ASN A 310 16.478 45.872 48.019 1.00 51.68 C ATOM 4697 OD1 ASN A 310 17.433 46.661 48.104 1.00 54.76 O ATOM 4698 ND2 ASN A 310 16.085 45.084 49.028 1.00 52.87 N ATOM 4699 HA ASN A 310 16.578 47.696 46.209 1.00 0.00 H ATOM 4700 HB2 ASN A 310 14.714 45.445 46.961 1.00 0.00 H ATOM 4701 HB3 ASN A 310 16.221 45.032 46.111 1.00 0.00 H ATOM 4702 HD22 ASN A 310 15.277 44.441 48.901 1.00 0.00 H ATOM 4703 HD21 ASN A 310 16.587 45.115 49.938 1.00 0.00 H ATOM 4704 H ASN A 310 13.927 47.491 47.191 1.00 0.00 H ATOM 4705 N SER A 311 14.441 46.627 44.015 1.00 41.81 N ATOM 4706 CA SER A 311 14.306 46.292 42.604 1.00 41.29 C ATOM 4707 C SER A 311 14.075 47.475 41.656 1.00 40.70 C ATOM 4708 O SER A 311 13.887 47.276 40.441 1.00 40.64 O ATOM 4709 CB SER A 311 13.169 45.263 42.426 1.00 41.60 C ATOM 4710 OG SER A 311 11.902 45.864 42.669 1.00 44.66 O ATOM 4711 HA SER A 311 15.275 45.884 42.317 1.00 0.00 H ATOM 4712 HB2 SER A 311 13.316 44.442 43.128 1.00 0.00 H ATOM 4713 HB3 SER A 311 13.192 44.877 41.407 1.00 0.00 H ATOM 4714 HG SER A 311 11.876 46.213 43.595 1.00 0.00 H ATOM 4715 H SER A 311 13.591 46.715 44.608 1.00 0.00 H ATOM 4716 N GLY A 312 14.108 48.700 42.185 1.00 40.07 N ATOM 4717 CA GLY A 312 13.868 49.868 41.340 1.00 37.82 C ATOM 4718 C GLY A 312 12.394 50.020 40.944 1.00 37.27 C ATOM 4719 O GLY A 312 12.051 50.737 40.023 1.00 37.11 O ATOM 4720 HA3 GLY A 312 14.465 49.771 40.433 1.00 0.00 H ATOM 4721 HA2 GLY A 312 14.177 50.761 41.883 1.00 0.00 H ATOM 4722 H GLY A 312 14.305 48.823 43.199 1.00 0.00 H ATOM 4723 N ASN A 313 11.513 49.336 41.653 1.00 37.33 N ATOM 4724 CA ASN A 313 10.086 49.404 41.376 1.00 37.66 C ATOM 4725 C ASN A 313 9.479 50.713 41.971 1.00 37.57 C ATOM 4726 O ASN A 313 8.797 50.693 43.035 1.00 36.55 O ATOM 4727 CB ASN A 313 9.390 48.172 41.965 1.00 37.01 C ATOM 4728 CG ASN A 313 7.943 48.076 41.519 1.00 40.62 C ATOM 4729 OD1 ASN A 313 7.482 48.931 40.768 1.00 39.84 O ATOM 4730 ND2 ASN A 313 7.229 47.059 41.978 1.00 39.70 N ATOM 4731 HA ASN A 313 9.931 49.417 40.297 1.00 0.00 H ATOM 4732 HB2 ASN A 313 9.920 47.277 41.639 1.00 0.00 H ATOM 4733 HB3 ASN A 313 9.421 48.235 43.053 1.00 0.00 H ATOM 4734 HD22 ASN A 313 7.667 46.361 42.612 1.00 0.00 H ATOM 4735 HD21 ASN A 313 6.231 46.959 41.704 1.00 0.00 H ATOM 4736 H ASN A 313 11.849 48.732 42.430 1.00 0.00 H ATOM 4737 N PHE A 314 9.756 51.829 41.285 1.00 36.66 N ATOM 4738 CA PHE A 314 9.273 53.155 41.692 1.00 36.17 C ATOM 4739 C PHE A 314 9.499 54.220 40.623 1.00 36.48 C ATOM 4740 O PHE A 314 10.269 54.019 39.668 1.00 35.41 O ATOM 4741 CB PHE A 314 9.936 53.593 43.020 1.00 34.76 C ATOM 4742 CG PHE A 314 11.448 53.461 43.033 1.00 32.66 C ATOM 4743 CD1 PHE A 314 12.251 54.424 42.442 1.00 33.17 C ATOM 4744 CD2 PHE A 314 12.052 52.384 43.692 1.00 33.51 C ATOM 4745 CE1 PHE A 314 13.646 54.338 42.509 1.00 34.49 C ATOM 4746 CE2 PHE A 314 13.452 52.270 43.775 1.00 33.52 C ATOM 4747 CZ PHE A 314 14.256 53.240 43.195 1.00 34.41 C ATOM 4748 HA PHE A 314 8.196 53.062 41.834 1.00 0.00 H ATOM 4749 HB2 PHE A 314 9.682 54.637 43.201 1.00 0.00 H ATOM 4750 HB3 PHE A 314 9.532 52.977 43.824 1.00 0.00 H ATOM 4751 HD2 PHE A 314 11.426 51.619 44.150 1.00 0.00 H ATOM 4752 HE2 PHE A 314 13.903 51.423 44.293 1.00 0.00 H ATOM 4753 HZ PHE A 314 15.342 53.167 43.261 1.00 0.00 H ATOM 4754 HE1 PHE A 314 14.265 55.103 42.041 1.00 0.00 H ATOM 4755 HD1 PHE A 314 11.789 55.260 41.917 1.00 0.00 H ATOM 4756 H PHE A 314 10.338 51.754 40.427 1.00 0.00 H ATOM 4757 N LYS A 315 8.849 55.373 40.801 1.00 36.25 N ATOM 4758 CA LYS A 315 8.974 56.443 39.821 1.00 35.49 C ATOM 4759 C LYS A 315 10.403 56.951 39.778 1.00 36.03 C ATOM 4760 O LYS A 315 10.965 57.290 40.805 1.00 34.87 O ATOM 4761 CB LYS A 315 8.047 57.632 40.150 1.00 34.20 C ATOM 4762 CG LYS A 315 7.943 58.680 39.017 1.00 30.91 C ATOM 4763 CD LYS A 315 7.232 59.924 39.594 1.00 32.94 C ATOM 4764 CE LYS A 315 7.242 61.082 38.625 1.00 32.35 C ATOM 4765 NZ LYS A 315 6.423 60.692 37.398 1.00 29.74 N ATOM 4766 HA LYS A 315 8.687 56.026 38.856 1.00 0.00 H ATOM 4767 HB2 LYS A 315 7.049 57.243 40.351 1.00 0.00 H ATOM 4768 HB3 LYS A 315 8.429 58.128 41.042 1.00 0.00 H ATOM 4769 HG2 LYS A 315 8.940 58.950 38.668 1.00 0.00 H ATOM 4770 HG3 LYS A 315 7.366 58.274 38.186 1.00 0.00 H ATOM 4771 HD2 LYS A 315 6.198 59.665 39.822 1.00 0.00 H ATOM 4772 HD3 LYS A 315 7.740 60.227 40.510 1.00 0.00 H ATOM 4773 HE2 LYS A 315 8.267 61.305 38.328 1.00 0.00 H ATOM 4774 HE3 LYS A 315 6.803 61.961 39.097 1.00 0.00 H ATOM 4775 HZ1 LYS A 315 6.845 59.852 36.953 1.00 0.00 H ATOM 4776 HZ2 LYS A 315 5.447 60.479 37.688 1.00 0.00 H ATOM 4777 HZ3 LYS A 315 6.420 61.480 36.720 1.00 0.00 H ATOM 4778 H LYS A 315 8.252 55.507 41.642 1.00 0.00 H ATOM 4779 N LYS A 316 10.997 57.005 38.587 1.00 36.84 N ATOM 4780 CA LYS A 316 12.366 57.488 38.496 1.00 37.77 C ATOM 4781 C LYS A 316 12.355 58.949 38.052 1.00 38.11 C ATOM 4782 O LYS A 316 11.903 59.264 36.949 1.00 39.28 O ATOM 4783 CB LYS A 316 13.135 56.568 37.540 1.00 41.82 C ATOM 4784 CG LYS A 316 13.165 55.126 38.109 1.00 44.47 C ATOM 4785 CD LYS A 316 13.611 54.102 37.111 1.00 47.96 C ATOM 4786 CE LYS A 316 13.461 52.685 37.706 1.00 49.74 C ATOM 4787 NZ LYS A 316 12.028 52.219 37.644 1.00 52.87 N ATOM 4788 HA LYS A 316 12.872 57.460 39.461 1.00 0.00 H ATOM 4789 HB2 LYS A 316 12.643 56.563 36.568 1.00 0.00 H ATOM 4790 HB3 LYS A 316 14.155 56.934 37.428 1.00 0.00 H ATOM 4791 HG2 LYS A 316 13.849 55.103 38.957 1.00 0.00 H ATOM 4792 HG3 LYS A 316 12.161 54.866 38.446 1.00 0.00 H ATOM 4793 HD2 LYS A 316 13.000 54.183 36.212 1.00 0.00 H ATOM 4794 HD3 LYS A 316 14.656 54.278 36.855 1.00 0.00 H ATOM 4795 HE2 LYS A 316 13.786 52.699 38.746 1.00 0.00 H ATOM 4796 HE3 LYS A 316 14.085 51.993 37.141 1.00 0.00 H ATOM 4797 HZ1 LYS A 316 11.428 52.873 38.186 1.00 0.00 H ATOM 4798 HZ2 LYS A 316 11.714 52.199 36.653 1.00 0.00 H ATOM 4799 HZ3 LYS A 316 11.957 51.264 38.051 1.00 0.00 H ATOM 4800 H LYS A 316 10.487 56.705 37.731 1.00 0.00 H ATOM 4801 N THR A 317 12.816 59.865 38.907 1.00 37.71 N ATOM 4802 CA THR A 317 12.807 61.283 38.541 1.00 35.57 C ATOM 4803 C THR A 317 13.812 61.926 39.464 1.00 35.92 C ATOM 4804 O THR A 317 14.658 61.223 39.995 1.00 35.60 O ATOM 4805 CB THR A 317 11.400 61.855 38.761 1.00 34.90 C ATOM 4806 OG1 THR A 317 11.389 63.242 38.420 1.00 34.51 O ATOM 4807 CG2 THR A 317 10.959 61.664 40.260 1.00 34.01 C ATOM 4808 HA THR A 317 13.061 61.459 37.496 1.00 0.00 H ATOM 4809 HB THR A 317 10.696 61.321 38.123 1.00 0.00 H ATOM 4810 HG1 THR A 317 10.480 63.609 38.563 1.00 0.00 H ATOM 4811 HG23 THR A 317 10.971 60.603 40.509 1.00 0.00 H ATOM 4812 HG21 THR A 317 11.650 62.199 40.912 1.00 0.00 H ATOM 4813 HG22 THR A 317 9.952 62.058 40.394 1.00 0.00 H ATOM 4814 H THR A 317 13.182 59.571 39.835 1.00 0.00 H ATOM 4815 N GLN A 318 13.743 63.241 39.655 1.00 36.30 N ATOM 4816 CA GLN A 318 14.657 63.918 40.580 1.00 35.87 C ATOM 4817 C GLN A 318 13.984 64.101 41.965 1.00 35.81 C ATOM 4818 O GLN A 318 12.788 64.324 42.060 1.00 33.67 O ATOM 4819 CB GLN A 318 15.053 65.328 40.073 1.00 36.32 C ATOM 4820 CG GLN A 318 15.598 65.365 38.662 1.00 38.45 C ATOM 4821 CD GLN A 318 14.472 65.376 37.609 1.00 40.83 C ATOM 4822 OE1 GLN A 318 13.361 65.880 37.864 1.00 39.72 O ATOM 4823 NE2 GLN A 318 14.755 64.820 36.423 1.00 42.11 N ATOM 4824 HA GLN A 318 15.546 63.291 40.652 1.00 0.00 H ATOM 4825 HB2 GLN A 318 14.168 65.963 40.112 1.00 0.00 H ATOM 4826 HB3 GLN A 318 15.815 65.727 40.742 1.00 0.00 H ATOM 4827 HG2 GLN A 318 16.202 66.264 38.541 1.00 0.00 H ATOM 4828 HG3 GLN A 318 16.222 64.485 38.502 1.00 0.00 H ATOM 4829 HE22 GLN A 318 15.696 64.410 36.252 1.00 0.00 H ATOM 4830 HE21 GLN A 318 14.034 64.798 35.674 1.00 0.00 H ATOM 4831 H GLN A 318 13.030 63.797 39.141 1.00 0.00 H ATOM 4832 N ILE A 319 14.758 63.998 43.039 1.00 34.44 N ATOM 4833 CA ILE A 319 14.197 64.246 44.337 1.00 34.73 C ATOM 4834 C ILE A 319 15.082 65.188 45.105 1.00 34.08 C ATOM 4835 O ILE A 319 16.289 65.249 44.873 1.00 34.47 O ATOM 4836 CB ILE A 319 13.977 62.949 45.187 1.00 34.21 C ATOM 4837 CG1 ILE A 319 15.299 62.181 45.388 1.00 33.69 C ATOM 4838 CG2 ILE A 319 12.887 62.121 44.536 1.00 35.56 C ATOM 4839 CD1 ILE A 319 15.225 61.012 46.392 1.00 30.32 C ATOM 4840 HA ILE A 319 13.214 64.684 44.162 1.00 0.00 H ATOM 4841 HB ILE A 319 13.644 63.207 46.192 1.00 0.00 H ATOM 4842 HG12 ILE A 319 15.608 61.780 44.423 1.00 0.00 H ATOM 4843 HG13 ILE A 319 16.050 62.886 45.744 1.00 0.00 H ATOM 4844 HD11 ILE A 319 14.932 61.393 47.370 1.00 0.00 H ATOM 4845 HD12 ILE A 319 14.489 60.285 46.048 1.00 0.00 H ATOM 4846 HD13 ILE A 319 16.202 60.535 46.465 1.00 0.00 H ATOM 4847 HG21 ILE A 319 11.965 62.701 44.499 1.00 0.00 H ATOM 4848 HG22 ILE A 319 13.191 61.854 43.524 1.00 0.00 H ATOM 4849 HG23 ILE A 319 12.724 61.214 45.119 1.00 0.00 H ATOM 4850 H ILE A 319 15.761 63.740 42.941 1.00 0.00 H ATOM 4851 N LEU A 320 14.471 65.961 45.994 1.00 33.48 N ATOM 4852 CA LEU A 320 15.240 66.852 46.858 1.00 33.58 C ATOM 4853 C LEU A 320 14.685 66.533 48.269 1.00 33.51 C ATOM 4854 O LEU A 320 13.472 66.462 48.473 1.00 33.36 O ATOM 4855 CB LEU A 320 15.052 68.304 46.422 1.00 33.52 C ATOM 4856 CG LEU A 320 15.742 69.318 47.320 1.00 34.16 C ATOM 4857 CD1 LEU A 320 16.037 70.611 46.506 1.00 34.85 C ATOM 4858 CD2 LEU A 320 14.858 69.573 48.527 1.00 33.23 C ATOM 4859 HA LEU A 320 16.320 66.708 46.822 1.00 0.00 H ATOM 4860 HB2 LEU A 320 15.451 68.413 45.413 1.00 0.00 H ATOM 4861 HB3 LEU A 320 13.984 68.524 46.415 1.00 0.00 H ATOM 4862 HG LEU A 320 16.700 68.943 47.680 1.00 0.00 H ATOM 4863 HD21 LEU A 320 13.896 69.963 48.195 1.00 0.00 H ATOM 4864 HD22 LEU A 320 14.706 68.639 49.068 1.00 0.00 H ATOM 4865 HD23 LEU A 320 15.340 70.299 49.182 1.00 0.00 H ATOM 4866 HD11 LEU A 320 16.685 70.369 45.664 1.00 0.00 H ATOM 4867 HD12 LEU A 320 15.100 71.028 46.137 1.00 0.00 H ATOM 4868 HD13 LEU A 320 16.532 71.339 47.149 1.00 0.00 H ATOM 4869 H LEU A 320 13.435 65.932 46.076 1.00 0.00 H ATOM 4870 N LEU A 321 15.570 66.297 49.233 1.00 33.39 N ATOM 4871 CA LEU A 321 15.098 65.886 50.529 1.00 32.69 C ATOM 4872 C LEU A 321 16.146 66.145 51.621 1.00 33.24 C ATOM 4873 O LEU A 321 17.318 66.421 51.336 1.00 33.99 O ATOM 4874 CB LEU A 321 14.741 64.370 50.473 1.00 32.56 C ATOM 4875 CG LEU A 321 15.866 63.283 50.432 1.00 31.37 C ATOM 4876 CD1 LEU A 321 15.180 61.837 50.452 1.00 28.38 C ATOM 4877 CD2 LEU A 321 16.726 63.421 49.115 1.00 30.31 C ATOM 4878 HA LEU A 321 14.215 66.472 50.784 1.00 0.00 H ATOM 4879 HB2 LEU A 321 14.137 64.160 51.356 1.00 0.00 H ATOM 4880 HB3 LEU A 321 14.136 64.226 49.578 1.00 0.00 H ATOM 4881 HG LEU A 321 16.520 63.415 51.294 1.00 0.00 H ATOM 4882 HD21 LEU A 321 16.080 63.294 48.246 1.00 0.00 H ATOM 4883 HD22 LEU A 321 17.187 64.408 49.086 1.00 0.00 H ATOM 4884 HD23 LEU A 321 17.502 62.656 49.107 1.00 0.00 H ATOM 4885 HD11 LEU A 321 14.591 61.728 51.363 1.00 0.00 H ATOM 4886 HD12 LEU A 321 14.530 61.732 49.583 1.00 0.00 H ATOM 4887 HD13 LEU A 321 15.953 61.069 50.424 1.00 0.00 H ATOM 4888 H LEU A 321 16.588 66.408 49.053 1.00 0.00 H ATOM 4889 N GLY A 322 15.719 66.021 52.870 1.00 31.62 N ATOM 4890 CA GLY A 322 16.611 66.259 53.970 1.00 31.34 C ATOM 4891 C GLY A 322 15.950 66.123 55.300 1.00 32.25 C ATOM 4892 O GLY A 322 14.722 65.789 55.413 1.00 32.98 O ATOM 4893 HA3 GLY A 322 17.009 67.270 53.882 1.00 0.00 H ATOM 4894 HA2 GLY A 322 17.430 65.542 53.914 1.00 0.00 H ATOM 4895 H GLY A 322 14.732 65.750 53.054 1.00 0.00 H ATOM 4896 N VAL A 323 16.769 66.362 56.329 1.00 32.23 N ATOM 4897 CA VAL A 323 16.341 66.247 57.720 1.00 30.78 C ATOM 4898 C VAL A 323 16.818 67.460 58.532 1.00 32.51 C ATOM 4899 O VAL A 323 17.610 68.273 58.037 1.00 33.75 O ATOM 4900 CB VAL A 323 16.941 64.986 58.366 1.00 29.45 C ATOM 4901 CG1 VAL A 323 16.564 63.742 57.570 1.00 29.95 C ATOM 4902 CG2 VAL A 323 18.479 65.102 58.398 1.00 28.82 C ATOM 4903 HA VAL A 323 15.252 66.193 57.725 1.00 0.00 H ATOM 4904 HB VAL A 323 16.546 64.900 59.378 1.00 0.00 H ATOM 4905 HG11 VAL A 323 15.479 63.643 57.545 1.00 0.00 H ATOM 4906 HG12 VAL A 323 16.946 63.833 56.553 1.00 0.00 H ATOM 4907 HG13 VAL A 323 16.999 62.863 58.045 1.00 0.00 H ATOM 4908 HG21 VAL A 323 18.856 65.202 57.380 1.00 0.00 H ATOM 4909 HG22 VAL A 323 18.764 65.978 58.980 1.00 0.00 H ATOM 4910 HG23 VAL A 323 18.900 64.207 58.856 1.00 0.00 H ATOM 4911 H VAL A 323 17.751 66.641 56.131 1.00 0.00 H ATOM 4912 N ASN A 324 16.311 67.577 59.756 1.00 31.89 N ATOM 4913 CA ASN A 324 16.699 68.643 60.691 1.00 34.40 C ATOM 4914 C ASN A 324 17.621 68.006 61.766 1.00 34.41 C ATOM 4915 O ASN A 324 17.614 66.778 61.986 1.00 32.56 O ATOM 4916 CB ASN A 324 15.488 69.232 61.383 1.00 32.94 C ATOM 4917 CG ASN A 324 14.562 69.923 60.433 1.00 34.66 C ATOM 4918 OD1 ASN A 324 14.861 70.078 59.240 1.00 34.76 O ATOM 4919 ND2 ASN A 324 13.419 70.373 60.954 1.00 35.77 N ATOM 4920 HA ASN A 324 17.201 69.440 60.143 1.00 0.00 H ATOM 4921 HB2 ASN A 324 14.944 68.428 61.879 1.00 0.00 H ATOM 4922 HB3 ASN A 324 15.827 69.953 62.127 1.00 0.00 H ATOM 4923 HD22 ASN A 324 13.211 70.220 61.961 1.00 0.00 H ATOM 4924 HD21 ASN A 324 12.736 70.877 60.353 1.00 0.00 H ATOM 4925 H ASN A 324 15.605 66.880 60.067 1.00 0.00 H ATOM 4926 N LYS A 325 18.390 68.852 62.436 1.00 35.06 N ATOM 4927 CA LYS A 325 19.380 68.400 63.425 1.00 35.00 C ATOM 4928 C LYS A 325 18.843 67.619 64.622 1.00 33.50 C ATOM 4929 O LYS A 325 19.421 66.595 64.970 1.00 30.51 O ATOM 4930 CB LYS A 325 20.235 69.601 63.907 1.00 35.89 C ATOM 4931 CG LYS A 325 21.428 69.231 64.839 1.00 38.62 C ATOM 4932 CD LYS A 325 22.255 70.431 65.246 1.00 40.74 C ATOM 4933 CE LYS A 325 22.549 70.428 66.773 1.00 44.95 C ATOM 4934 NZ LYS A 325 21.368 70.916 67.700 1.00 47.44 N ATOM 4935 HA LYS A 325 19.985 67.671 62.886 1.00 0.00 H ATOM 4936 HB2 LYS A 325 20.637 70.105 63.028 1.00 0.00 H ATOM 4937 HB3 LYS A 325 19.582 70.285 64.449 1.00 0.00 H ATOM 4938 HG2 LYS A 325 21.033 68.760 65.739 1.00 0.00 H ATOM 4939 HG3 LYS A 325 22.073 68.526 64.315 1.00 0.00 H ATOM 4940 HD2 LYS A 325 23.200 70.411 64.703 1.00 0.00 H ATOM 4941 HD3 LYS A 325 21.710 71.340 64.992 1.00 0.00 H ATOM 4942 HE2 LYS A 325 23.405 71.079 66.951 1.00 0.00 H ATOM 4943 HE3 LYS A 325 22.803 69.409 67.063 1.00 0.00 H ATOM 4944 HZ1 LYS A 325 21.117 71.895 67.453 1.00 0.00 H ATOM 4945 HZ2 LYS A 325 20.542 70.299 67.561 1.00 0.00 H ATOM 4946 HZ3 LYS A 325 21.670 70.874 68.694 1.00 0.00 H ATOM 4947 H LYS A 325 18.290 69.871 62.256 1.00 0.00 H ATOM 4948 N ASP A 326 17.741 68.083 65.233 1.00 33.05 N ATOM 4949 CA ASP A 326 17.199 67.413 66.428 1.00 32.56 C ATOM 4950 C ASP A 326 15.794 66.853 66.255 1.00 33.58 C ATOM 4951 O ASP A 326 14.797 67.333 66.873 1.00 33.53 O ATOM 4952 CB ASP A 326 17.257 68.398 67.594 1.00 33.32 C ATOM 4953 CG ASP A 326 18.647 69.086 67.696 1.00 35.23 C ATOM 4954 OD1 ASP A 326 19.605 68.417 68.127 1.00 34.94 O ATOM 4955 OD2 ASP A 326 18.779 70.273 67.319 1.00 34.52 O ATOM 4956 HA ASP A 326 17.818 66.537 66.621 1.00 0.00 H ATOM 4957 HB2 ASP A 326 16.494 69.163 67.449 1.00 0.00 H ATOM 4958 HB3 ASP A 326 17.060 67.860 68.521 1.00 0.00 H ATOM 4959 H ASP A 326 17.263 68.927 64.857 1.00 0.00 H ATOM 4960 N GLU A 327 15.721 65.826 65.407 1.00 32.94 N ATOM 4961 CA GLU A 327 14.461 65.213 65.064 1.00 31.11 C ATOM 4962 C GLU A 327 13.752 64.539 66.245 1.00 31.87 C ATOM 4963 O GLU A 327 12.518 64.528 66.277 1.00 32.22 O ATOM 4964 CB GLU A 327 14.640 64.204 63.907 1.00 31.27 C ATOM 4965 CG GLU A 327 15.218 64.744 62.577 1.00 31.36 C ATOM 4966 CD GLU A 327 14.221 65.581 61.778 1.00 33.15 C ATOM 4967 OE1 GLU A 327 13.212 66.050 62.379 1.00 35.11 O ATOM 4968 OE2 GLU A 327 14.429 65.771 60.550 1.00 33.35 O ATOM 4969 HA GLU A 327 13.815 66.031 64.746 1.00 0.00 H ATOM 4970 HB2 GLU A 327 15.307 63.417 64.259 1.00 0.00 H ATOM 4971 HB3 GLU A 327 13.661 63.778 63.690 1.00 0.00 H ATOM 4972 HG2 GLU A 327 16.086 65.363 62.803 1.00 0.00 H ATOM 4973 HG3 GLU A 327 15.527 63.897 61.965 1.00 0.00 H ATOM 4974 H GLU A 327 16.596 65.457 64.982 1.00 0.00 H ATOM 4975 N GLY A 328 14.478 64.020 67.233 1.00 31.63 N ATOM 4976 CA GLY A 328 13.792 63.365 68.322 1.00 32.06 C ATOM 4977 C GLY A 328 13.265 64.220 69.480 1.00 33.67 C ATOM 4978 O GLY A 328 12.288 63.836 70.178 1.00 32.25 O ATOM 4979 HA3 GLY A 328 14.485 62.639 68.748 1.00 0.00 H ATOM 4980 HA2 GLY A 328 12.937 62.841 67.894 1.00 0.00 H ATOM 4981 H GLY A 328 15.516 64.085 67.221 1.00 0.00 H ATOM 4982 N SER A 329 13.810 65.416 69.670 1.00 33.97 N ATOM 4983 CA SER A 329 13.388 66.144 70.872 1.00 33.70 C ATOM 4984 C SER A 329 11.886 66.356 71.134 1.00 33.91 C ATOM 4985 O SER A 329 11.408 66.194 72.282 1.00 32.39 O ATOM 4986 CB SER A 329 14.207 67.438 71.003 1.00 35.11 C ATOM 4987 OG SER A 329 13.933 68.346 69.996 1.00 39.21 O ATOM 4988 HA SER A 329 13.611 65.449 71.682 1.00 0.00 H ATOM 4989 HB2 SER A 329 15.267 67.186 70.967 1.00 0.00 H ATOM 4990 HB3 SER A 329 13.977 67.901 71.963 1.00 0.00 H ATOM 4991 HG SER A 329 14.484 69.158 70.126 1.00 0.00 H ATOM 4992 H SER A 329 14.500 65.816 69.002 1.00 0.00 H ATOM 4993 N PHE A 330 11.115 66.631 70.094 1.00 34.22 N ATOM 4994 CA PHE A 330 9.677 66.845 70.263 1.00 33.67 C ATOM 4995 C PHE A 330 8.976 65.632 70.863 1.00 34.80 C ATOM 4996 O PHE A 330 8.131 65.746 71.792 1.00 34.22 O ATOM 4997 CB PHE A 330 9.030 67.191 68.907 1.00 35.39 C ATOM 4998 CG PHE A 330 7.551 67.454 68.991 1.00 38.65 C ATOM 4999 CD1 PHE A 330 6.634 66.397 68.903 1.00 40.16 C ATOM 5000 CD2 PHE A 330 7.072 68.758 69.163 1.00 40.39 C ATOM 5001 CE1 PHE A 330 5.262 66.625 68.981 1.00 41.10 C ATOM 5002 CE2 PHE A 330 5.703 69.016 69.251 1.00 41.08 C ATOM 5003 CZ PHE A 330 4.794 67.949 69.159 1.00 41.19 C ATOM 5004 HA PHE A 330 9.558 67.676 70.959 1.00 0.00 H ATOM 5005 HB2 PHE A 330 9.516 68.083 68.511 1.00 0.00 H ATOM 5006 HB3 PHE A 330 9.193 66.357 68.225 1.00 0.00 H ATOM 5007 HD2 PHE A 330 7.779 69.585 69.229 1.00 0.00 H ATOM 5008 HE2 PHE A 330 5.343 70.035 69.390 1.00 0.00 H ATOM 5009 HZ PHE A 330 3.723 68.142 69.225 1.00 0.00 H ATOM 5010 HE1 PHE A 330 4.559 65.796 68.906 1.00 0.00 H ATOM 5011 HD1 PHE A 330 7.001 65.379 68.771 1.00 0.00 H ATOM 5012 H PHE A 330 11.536 66.696 69.145 1.00 0.00 H ATOM 5013 N PHE A 331 9.328 64.450 70.362 1.00 34.82 N ATOM 5014 CA PHE A 331 8.673 63.238 70.867 1.00 33.56 C ATOM 5015 C PHE A 331 9.110 62.843 72.263 1.00 33.85 C ATOM 5016 O PHE A 331 8.317 62.262 72.993 1.00 34.49 O ATOM 5017 CB PHE A 331 8.858 62.083 69.881 1.00 32.43 C ATOM 5018 CG PHE A 331 8.447 62.449 68.487 1.00 33.04 C ATOM 5019 CD1 PHE A 331 9.334 63.163 67.667 1.00 31.81 C ATOM 5020 CD2 PHE A 331 7.127 62.244 68.067 1.00 31.50 C ATOM 5021 CE1 PHE A 331 8.930 63.701 66.420 1.00 32.77 C ATOM 5022 CE2 PHE A 331 6.694 62.766 66.838 1.00 33.01 C ATOM 5023 CZ PHE A 331 7.589 63.500 66.004 1.00 32.36 C ATOM 5024 HA PHE A 331 7.612 63.473 70.950 1.00 0.00 H ATOM 5025 HB2 PHE A 331 9.909 61.795 69.872 1.00 0.00 H ATOM 5026 HB3 PHE A 331 8.254 61.239 70.214 1.00 0.00 H ATOM 5027 HD2 PHE A 331 6.436 61.680 68.694 1.00 0.00 H ATOM 5028 HE2 PHE A 331 5.664 62.609 66.518 1.00 0.00 H ATOM 5029 HZ PHE A 331 7.244 63.904 65.052 1.00 0.00 H ATOM 5030 HE1 PHE A 331 9.632 64.255 65.796 1.00 0.00 H ATOM 5031 HD1 PHE A 331 10.362 63.308 67.998 1.00 0.00 H ATOM 5032 H PHE A 331 10.057 64.386 69.623 1.00 0.00 H ATOM 5033 N LEU A 332 10.362 63.118 72.617 1.00 32.98 N ATOM 5034 CA LEU A 332 10.871 62.809 73.965 1.00 34.73 C ATOM 5035 C LEU A 332 10.151 63.742 74.980 1.00 33.91 C ATOM 5036 O LEU A 332 9.726 63.303 76.045 1.00 33.60 O ATOM 5037 CB LEU A 332 12.408 63.030 74.040 1.00 33.79 C ATOM 5038 CG LEU A 332 13.245 62.060 73.203 1.00 32.99 C ATOM 5039 CD1 LEU A 332 14.651 62.640 72.914 1.00 29.42 C ATOM 5040 CD2 LEU A 332 13.275 60.719 73.976 1.00 31.31 C ATOM 5041 HA LEU A 332 10.673 61.763 74.200 1.00 0.00 H ATOM 5042 HB2 LEU A 332 12.621 64.043 73.697 1.00 0.00 H ATOM 5043 HB3 LEU A 332 12.714 62.928 75.081 1.00 0.00 H ATOM 5044 HG LEU A 332 12.809 61.897 72.218 1.00 0.00 H ATOM 5045 HD21 LEU A 332 13.726 60.876 74.956 1.00 0.00 H ATOM 5046 HD22 LEU A 332 12.257 60.349 74.098 1.00 0.00 H ATOM 5047 HD23 LEU A 332 13.863 59.992 73.416 1.00 0.00 H ATOM 5048 HD11 LEU A 332 14.551 63.577 72.365 1.00 0.00 H ATOM 5049 HD12 LEU A 332 15.168 62.823 73.856 1.00 0.00 H ATOM 5050 HD13 LEU A 332 15.221 61.928 72.318 1.00 0.00 H ATOM 5051 H LEU A 332 10.998 63.563 71.925 1.00 0.00 H ATOM 5052 N LEU A 333 9.996 65.016 74.623 1.00 34.97 N ATOM 5053 CA LEU A 333 9.297 65.974 75.476 1.00 35.11 C ATOM 5054 C LEU A 333 7.899 65.440 75.762 1.00 37.03 C ATOM 5055 O LEU A 333 7.456 65.369 76.924 1.00 37.11 O ATOM 5056 CB LEU A 333 9.153 67.330 74.754 1.00 35.09 C ATOM 5057 CG LEU A 333 8.077 68.260 75.358 1.00 37.62 C ATOM 5058 CD1 LEU A 333 8.413 68.446 76.920 1.00 37.66 C ATOM 5059 CD2 LEU A 333 8.032 69.621 74.642 1.00 36.73 C ATOM 5060 HA LEU A 333 9.864 66.110 76.397 1.00 0.00 H ATOM 5061 HB2 LEU A 333 10.113 67.844 74.798 1.00 0.00 H ATOM 5062 HB3 LEU A 333 8.893 67.137 73.713 1.00 0.00 H ATOM 5063 HG LEU A 333 7.092 67.812 75.229 1.00 0.00 H ATOM 5064 HD21 LEU A 333 9.001 70.111 74.735 1.00 0.00 H ATOM 5065 HD22 LEU A 333 7.801 69.468 73.588 1.00 0.00 H ATOM 5066 HD23 LEU A 333 7.262 70.244 75.097 1.00 0.00 H ATOM 5067 HD11 LEU A 333 8.395 67.474 77.413 1.00 0.00 H ATOM 5068 HD12 LEU A 333 9.403 68.890 77.027 1.00 0.00 H ATOM 5069 HD13 LEU A 333 7.669 69.099 77.375 1.00 0.00 H ATOM 5070 H LEU A 333 10.383 65.337 73.713 1.00 0.00 H ATOM 5071 N TYR A 334 7.184 65.099 74.694 1.00 37.69 N ATOM 5072 CA TYR A 334 5.827 64.601 74.867 1.00 39.56 C ATOM 5073 C TYR A 334 5.720 63.255 75.544 1.00 40.25 C ATOM 5074 O TYR A 334 4.796 63.052 76.292 1.00 41.19 O ATOM 5075 CB TYR A 334 5.072 64.525 73.536 1.00 37.85 C ATOM 5076 CG TYR A 334 4.440 65.830 73.144 1.00 36.01 C ATOM 5077 CD1 TYR A 334 5.223 66.976 73.028 1.00 35.34 C ATOM 5078 CD2 TYR A 334 3.061 65.931 72.907 1.00 34.23 C ATOM 5079 CE1 TYR A 334 4.666 68.199 72.688 1.00 35.30 C ATOM 5080 CE2 TYR A 334 2.476 67.167 72.545 1.00 34.87 C ATOM 5081 CZ TYR A 334 3.298 68.301 72.437 1.00 34.11 C ATOM 5082 OH TYR A 334 2.790 69.530 72.055 1.00 34.42 O ATOM 5083 HA TYR A 334 5.374 65.337 75.531 1.00 0.00 H ATOM 5084 HB3 TYR A 334 4.289 63.772 73.623 1.00 0.00 H ATOM 5085 HB2 TYR A 334 5.773 64.230 72.755 1.00 0.00 H ATOM 5086 HD2 TYR A 334 2.432 65.046 73.003 1.00 0.00 H ATOM 5087 HE2 TYR A 334 1.405 67.238 72.353 1.00 0.00 H ATOM 5088 HE1 TYR A 334 5.299 69.083 72.617 1.00 0.00 H ATOM 5089 HD1 TYR A 334 6.296 66.910 73.208 1.00 0.00 H ATOM 5090 HH TYR A 334 2.390 69.454 71.153 1.00 0.00 H ATOM 5091 H TYR A 334 7.592 65.187 73.741 1.00 0.00 H ATOM 5092 N GLY A 335 6.653 62.343 75.364 1.00 40.07 N ATOM 5093 CA GLY A 335 6.395 61.073 76.020 1.00 42.00 C ATOM 5094 C GLY A 335 7.460 60.320 76.808 1.00 42.59 C ATOM 5095 O GLY A 335 7.176 59.238 77.313 1.00 43.35 O ATOM 5096 HA3 GLY A 335 6.061 60.392 75.237 1.00 0.00 H ATOM 5097 HA2 GLY A 335 5.576 61.254 76.716 1.00 0.00 H ATOM 5098 H GLY A 335 7.507 62.518 74.797 1.00 0.00 H ATOM 5099 N ALA A 336 8.665 60.846 76.933 1.00 39.18 N ATOM 5100 CA ALA A 336 9.677 60.087 77.657 1.00 38.27 C ATOM 5101 C ALA A 336 9.908 60.654 79.062 1.00 39.34 C ATOM 5102 O ALA A 336 9.825 61.879 79.291 1.00 37.28 O ATOM 5103 CB ALA A 336 10.991 60.095 76.872 1.00 36.50 C ATOM 5104 HA ALA A 336 9.317 59.064 77.763 1.00 0.00 H ATOM 5105 HB1 ALA A 336 10.831 59.642 75.894 1.00 0.00 H ATOM 5106 HB2 ALA A 336 11.332 61.123 76.747 1.00 0.00 H ATOM 5107 HB3 ALA A 336 11.743 59.526 77.419 1.00 0.00 H ATOM 5108 H ALA A 336 8.886 61.777 76.526 1.00 0.00 H ATOM 5109 N PRO A 337 10.195 59.773 80.027 1.00 42.23 N ATOM 5110 CA PRO A 337 10.432 60.261 81.397 1.00 42.91 C ATOM 5111 C PRO A 337 11.694 61.117 81.542 1.00 43.20 C ATOM 5112 O PRO A 337 12.737 60.858 80.910 1.00 43.77 O ATOM 5113 CB PRO A 337 10.497 58.987 82.212 1.00 44.68 C ATOM 5114 CG PRO A 337 11.094 57.977 81.241 1.00 43.37 C ATOM 5115 CD PRO A 337 10.377 58.306 79.932 1.00 42.70 C ATOM 5116 HA PRO A 337 9.648 60.943 81.727 1.00 0.00 H ATOM 5117 HD3 PRO A 337 10.988 58.039 79.070 1.00 0.00 H ATOM 5118 HD2 PRO A 337 9.417 57.793 79.868 1.00 0.00 H ATOM 5119 HG3 PRO A 337 10.885 56.955 81.558 1.00 0.00 H ATOM 5120 HG2 PRO A 337 12.171 58.113 81.145 1.00 0.00 H ATOM 5121 HB2 PRO A 337 11.137 59.114 83.085 1.00 0.00 H ATOM 5122 HB3 PRO A 337 9.502 58.678 82.534 1.00 0.00 H ATOM 5123 N GLY A 338 11.580 62.148 82.379 1.00 42.83 N ATOM 5124 CA GLY A 338 12.698 63.050 82.592 1.00 41.14 C ATOM 5125 C GLY A 338 12.640 64.345 81.788 1.00 39.61 C ATOM 5126 O GLY A 338 13.246 65.331 82.199 1.00 39.62 O ATOM 5127 HA3 GLY A 338 13.614 62.524 82.322 1.00 0.00 H ATOM 5128 HA2 GLY A 338 12.728 63.309 83.650 1.00 0.00 H ATOM 5129 H GLY A 338 10.684 62.308 82.883 1.00 0.00 H ATOM 5130 N PHE A 339 11.933 64.354 80.652 1.00 37.76 N ATOM 5131 CA PHE A 339 11.831 65.564 79.835 1.00 37.71 C ATOM 5132 C PHE A 339 10.668 66.417 80.239 1.00 38.23 C ATOM 5133 O PHE A 339 9.577 65.910 80.508 1.00 40.24 O ATOM 5134 CB PHE A 339 11.670 65.216 78.343 1.00 36.09 C ATOM 5135 CG PHE A 339 12.836 64.483 77.790 1.00 34.09 C ATOM 5136 CD1 PHE A 339 13.814 65.165 77.060 1.00 32.98 C ATOM 5137 CD2 PHE A 339 12.968 63.110 78.003 1.00 30.23 C ATOM 5138 CE1 PHE A 339 14.921 64.480 76.532 1.00 31.80 C ATOM 5139 CE2 PHE A 339 14.061 62.416 77.483 1.00 33.16 C ATOM 5140 CZ PHE A 339 15.051 63.121 76.736 1.00 30.98 C ATOM 5141 HA PHE A 339 12.757 66.116 79.995 1.00 0.00 H ATOM 5142 HB2 PHE A 339 10.781 64.596 78.224 1.00 0.00 H ATOM 5143 HB3 PHE A 339 11.543 66.142 77.782 1.00 0.00 H ATOM 5144 HD2 PHE A 339 12.212 62.576 78.579 1.00 0.00 H ATOM 5145 HE2 PHE A 339 14.158 61.343 77.646 1.00 0.00 H ATOM 5146 HZ PHE A 339 15.909 62.587 76.327 1.00 0.00 H ATOM 5147 HE1 PHE A 339 15.676 65.021 75.962 1.00 0.00 H ATOM 5148 HD1 PHE A 339 13.717 66.239 76.899 1.00 0.00 H ATOM 5149 H PHE A 339 11.448 63.487 80.345 1.00 0.00 H ATOM 5150 N SER A 340 10.874 67.719 80.270 1.00 38.48 N ATOM 5151 CA SER A 340 9.771 68.626 80.610 1.00 38.92 C ATOM 5152 C SER A 340 9.993 69.829 79.766 1.00 38.51 C ATOM 5153 O SER A 340 11.132 70.106 79.404 1.00 38.38 O ATOM 5154 CB SER A 340 9.820 69.058 82.099 1.00 39.41 C ATOM 5155 OG SER A 340 9.851 67.931 82.954 1.00 43.12 O ATOM 5156 HA SER A 340 8.809 68.141 80.444 1.00 0.00 H ATOM 5157 HB2 SER A 340 8.936 69.654 82.327 1.00 0.00 H ATOM 5158 HB3 SER A 340 10.714 69.658 82.267 1.00 0.00 H ATOM 5159 HG SER A 340 10.655 67.388 82.754 1.00 0.00 H ATOM 5160 H SER A 340 11.816 68.103 80.054 1.00 0.00 H ATOM 5161 N LYS A 341 8.928 70.580 79.486 1.00 38.08 N ATOM 5162 CA LYS A 341 9.058 71.758 78.670 1.00 38.08 C ATOM 5163 C LYS A 341 9.817 72.921 79.327 1.00 39.27 C ATOM 5164 O LYS A 341 10.542 73.687 78.651 1.00 37.38 O ATOM 5165 CB LYS A 341 7.687 72.256 78.252 1.00 39.07 C ATOM 5166 CG LYS A 341 7.799 73.552 77.452 1.00 41.76 C ATOM 5167 CD LYS A 341 6.508 73.884 76.642 1.00 42.71 C ATOM 5168 CE LYS A 341 5.514 74.611 77.525 1.00 43.06 C ATOM 5169 NZ LYS A 341 6.130 75.848 78.100 1.00 45.27 N ATOM 5170 HA LYS A 341 9.653 71.441 77.814 1.00 0.00 H ATOM 5171 HB2 LYS A 341 7.203 71.497 77.637 1.00 0.00 H ATOM 5172 HB3 LYS A 341 7.086 72.437 79.143 1.00 0.00 H ATOM 5173 HG2 LYS A 341 7.995 74.371 78.144 1.00 0.00 H ATOM 5174 HG3 LYS A 341 8.632 73.459 76.755 1.00 0.00 H ATOM 5175 HD2 LYS A 341 6.767 74.517 75.793 1.00 0.00 H ATOM 5176 HD3 LYS A 341 6.060 72.958 76.281 1.00 0.00 H ATOM 5177 HE2 LYS A 341 5.206 73.952 78.337 1.00 0.00 H ATOM 5178 HE3 LYS A 341 4.642 74.887 76.932 1.00 0.00 H ATOM 5179 HZ1 LYS A 341 6.961 75.588 78.669 1.00 0.00 H ATOM 5180 HZ2 LYS A 341 6.422 76.480 77.327 1.00 0.00 H ATOM 5181 HZ3 LYS A 341 5.434 76.333 78.702 1.00 0.00 H ATOM 5182 H LYS A 341 7.995 70.312 79.860 1.00 0.00 H ATOM 5183 N ASP A 342 9.677 73.051 80.644 1.00 37.61 N ATOM 5184 CA ASP A 342 10.313 74.186 81.304 1.00 38.47 C ATOM 5185 C ASP A 342 11.592 73.918 82.087 1.00 38.43 C ATOM 5186 O ASP A 342 11.943 74.718 82.935 1.00 37.17 O ATOM 5187 CB ASP A 342 9.303 74.897 82.213 1.00 37.79 C ATOM 5188 CG ASP A 342 7.996 75.255 81.492 1.00 39.36 C ATOM 5189 OD1 ASP A 342 7.982 75.374 80.237 1.00 38.78 O ATOM 5190 OD2 ASP A 342 6.960 75.439 82.193 1.00 40.49 O ATOM 5191 HA ASP A 342 10.637 74.810 80.471 1.00 0.00 H ATOM 5192 HB2 ASP A 342 9.069 74.242 83.052 1.00 0.00 H ATOM 5193 HB3 ASP A 342 9.757 75.815 82.586 1.00 0.00 H ATOM 5194 H ASP A 342 9.126 72.359 81.191 1.00 0.00 H ATOM 5195 N SER A 343 12.247 72.783 81.859 1.00 39.66 N ATOM 5196 CA SER A 343 13.526 72.507 82.512 1.00 41.38 C ATOM 5197 C SER A 343 14.531 72.231 81.387 1.00 42.27 C ATOM 5198 O SER A 343 14.161 72.144 80.232 1.00 41.58 O ATOM 5199 CB SER A 343 13.461 71.307 83.420 1.00 41.19 C ATOM 5200 OG SER A 343 13.395 70.146 82.630 1.00 46.29 O ATOM 5201 HA SER A 343 13.809 73.356 83.134 1.00 0.00 H ATOM 5202 HB2 SER A 343 12.575 71.372 84.051 1.00 0.00 H ATOM 5203 HB3 SER A 343 14.351 71.273 84.048 1.00 0.00 H ATOM 5204 HG SER A 343 13.352 69.350 83.218 1.00 0.00 H ATOM 5205 H SER A 343 11.843 72.081 81.206 1.00 0.00 H ATOM 5206 N GLU A 344 15.798 71.968 81.742 1.00 40.14 N ATOM 5207 CA GLU A 344 16.813 71.877 80.704 1.00 41.54 C ATOM 5208 C GLU A 344 16.760 70.338 80.319 1.00 41.33 C ATOM 5209 O GLU A 344 17.499 69.868 79.397 1.00 41.50 O ATOM 5210 CB GLU A 344 18.144 72.236 81.459 1.00 43.00 C ATOM 5211 CG GLU A 344 18.819 73.554 80.832 1.00 50.56 C ATOM 5212 CD GLU A 344 20.100 73.612 81.483 1.00 54.49 C ATOM 5213 OE1 GLU A 344 20.206 73.523 82.697 1.00 55.47 O ATOM 5214 OE2 GLU A 344 21.215 73.422 80.900 1.00 57.03 O ATOM 5215 HA GLU A 344 16.706 72.507 79.821 1.00 0.00 H ATOM 5216 HB2 GLU A 344 17.921 72.414 82.511 1.00 0.00 H ATOM 5217 HB3 GLU A 344 18.840 71.402 81.372 1.00 0.00 H ATOM 5218 HG2 GLU A 344 18.933 73.458 79.752 1.00 0.00 H ATOM 5219 HG3 GLU A 344 18.226 74.441 81.056 1.00 0.00 H ATOM 5220 H GLU A 344 16.050 71.832 82.742 1.00 0.00 H ATOM 5221 N SER A 345 15.976 69.585 81.104 1.00 42.29 N ATOM 5222 CA SER A 345 15.786 68.171 80.826 1.00 40.74 C ATOM 5223 C SER A 345 17.052 67.325 80.830 1.00 43.41 C ATOM 5224 O SER A 345 17.329 66.530 79.875 1.00 42.38 O ATOM 5225 CB SER A 345 15.067 67.996 79.484 1.00 39.06 C ATOM 5226 OG SER A 345 13.716 68.398 79.556 1.00 38.02 O ATOM 5227 HA SER A 345 15.185 67.802 81.657 1.00 0.00 H ATOM 5228 HB2 SER A 345 15.108 66.946 79.196 1.00 0.00 H ATOM 5229 HB3 SER A 345 15.575 68.598 78.730 1.00 0.00 H ATOM 5230 HG SER A 345 13.287 68.270 78.673 1.00 0.00 H ATOM 5231 H SER A 345 15.499 70.017 81.921 1.00 0.00 H ATOM 5232 N LYS A 346 17.826 67.442 81.905 1.00 43.57 N ATOM 5233 CA LYS A 346 19.031 66.645 81.998 1.00 43.70 C ATOM 5234 C LYS A 346 18.499 65.277 82.393 1.00 43.28 C ATOM 5235 O LYS A 346 17.677 65.126 83.295 1.00 44.28 O ATOM 5236 CB LYS A 346 19.973 67.251 83.028 1.00 46.35 C ATOM 5237 CG LYS A 346 20.565 68.618 82.615 1.00 45.48 C ATOM 5238 CD LYS A 346 21.447 69.096 83.794 1.00 51.12 C ATOM 5239 CE LYS A 346 22.006 70.530 83.672 1.00 53.71 C ATOM 5240 NZ LYS A 346 22.435 71.030 85.035 1.00 56.38 N ATOM 5241 HA LYS A 346 19.622 66.594 81.083 1.00 0.00 H ATOM 5242 HB2 LYS A 346 19.423 67.383 83.960 1.00 0.00 H ATOM 5243 HB3 LYS A 346 20.797 66.556 83.190 1.00 0.00 H ATOM 5244 HG2 LYS A 346 21.169 68.509 81.714 1.00 0.00 H ATOM 5245 HG3 LYS A 346 19.764 69.334 82.430 1.00 0.00 H ATOM 5246 HD2 LYS A 346 20.848 69.046 84.703 1.00 0.00 H ATOM 5247 HD3 LYS A 346 22.292 68.413 83.879 1.00 0.00 H ATOM 5248 HE2 LYS A 346 21.234 71.187 83.272 1.00 0.00 H ATOM 5249 HE3 LYS A 346 22.864 70.528 83.000 1.00 0.00 H ATOM 5250 HZ1 LYS A 346 21.616 71.033 85.676 1.00 0.00 H ATOM 5251 HZ2 LYS A 346 23.173 70.404 85.416 1.00 0.00 H ATOM 5252 HZ3 LYS A 346 22.810 71.996 84.946 1.00 0.00 H ATOM 5253 H LYS A 346 17.569 68.098 82.670 1.00 0.00 H ATOM 5254 N ILE A 347 18.963 64.259 81.694 1.00 42.91 N ATOM 5255 CA ILE A 347 18.445 62.915 81.870 1.00 42.60 C ATOM 5256 C ILE A 347 19.352 61.959 82.646 1.00 42.86 C ATOM 5257 O ILE A 347 20.510 61.730 82.307 1.00 43.20 O ATOM 5258 CB ILE A 347 18.146 62.319 80.442 1.00 41.65 C ATOM 5259 CG1 ILE A 347 17.146 63.230 79.698 1.00 40.16 C ATOM 5260 CG2 ILE A 347 17.595 60.903 80.541 1.00 42.83 C ATOM 5261 CD1 ILE A 347 15.810 63.404 80.384 1.00 37.15 C ATOM 5262 HA ILE A 347 17.548 63.006 82.483 1.00 0.00 H ATOM 5263 HB ILE A 347 19.081 62.275 79.884 1.00 0.00 H ATOM 5264 HG12 ILE A 347 17.601 64.214 79.588 1.00 0.00 H ATOM 5265 HG13 ILE A 347 16.967 62.802 78.712 1.00 0.00 H ATOM 5266 HD11 ILE A 347 15.329 62.432 80.491 1.00 0.00 H ATOM 5267 HD12 ILE A 347 15.963 63.845 81.369 1.00 0.00 H ATOM 5268 HD13 ILE A 347 15.178 64.060 79.785 1.00 0.00 H ATOM 5269 HG21 ILE A 347 18.325 60.265 81.039 1.00 0.00 H ATOM 5270 HG22 ILE A 347 16.668 60.914 81.115 1.00 0.00 H ATOM 5271 HG23 ILE A 347 17.399 60.520 79.540 1.00 0.00 H ATOM 5272 H ILE A 347 19.719 64.424 80.999 1.00 0.00 H ATOM 5273 N SER A 348 18.781 61.358 83.661 1.00 44.63 N ATOM 5274 CA SER A 348 19.516 60.415 84.477 1.00 47.25 C ATOM 5275 C SER A 348 19.775 59.162 83.639 1.00 48.09 C ATOM 5276 O SER A 348 19.129 58.934 82.607 1.00 46.71 O ATOM 5277 CB SER A 348 18.683 60.040 85.676 1.00 47.11 C ATOM 5278 OG SER A 348 17.763 59.035 85.304 1.00 50.55 O ATOM 5279 HA SER A 348 20.456 60.854 84.811 1.00 0.00 H ATOM 5280 HB2 SER A 348 18.142 60.916 86.033 1.00 0.00 H ATOM 5281 HB3 SER A 348 19.331 59.666 86.469 1.00 0.00 H ATOM 5282 HG SER A 348 17.213 58.785 86.089 1.00 0.00 H ATOM 5283 H SER A 348 17.786 61.561 83.883 1.00 0.00 H ATOM 5284 N ARG A 349 20.727 58.365 84.095 1.00 48.02 N ATOM 5285 CA ARG A 349 21.101 57.150 83.430 1.00 49.01 C ATOM 5286 C ARG A 349 19.892 56.236 83.324 1.00 49.39 C ATOM 5287 O ARG A 349 19.699 55.521 82.349 1.00 49.25 O ATOM 5288 CB ARG A 349 22.162 56.450 84.257 1.00 50.50 C ATOM 5289 CG ARG A 349 22.829 55.341 83.543 1.00 53.29 C ATOM 5290 CD ARG A 349 23.577 55.985 82.439 1.00 56.29 C ATOM 5291 NE ARG A 349 23.706 55.046 81.369 1.00 57.98 N ATOM 5292 CZ ARG A 349 23.840 55.375 80.096 1.00 57.00 C ATOM 5293 NH1 ARG A 349 23.943 54.399 79.202 1.00 58.23 N ATOM 5294 NH2 ARG A 349 23.878 56.651 79.725 1.00 56.45 N ATOM 5295 HA ARG A 349 21.479 57.379 82.434 1.00 0.00 H ATOM 5296 HB2 ARG A 349 22.918 57.182 84.541 1.00 0.00 H ATOM 5297 HB3 ARG A 349 21.691 56.049 85.155 1.00 0.00 H ATOM 5298 HG2 ARG A 349 23.510 54.812 84.209 1.00 0.00 H ATOM 5299 HG3 ARG A 349 22.092 54.641 83.149 1.00 0.00 H ATOM 5300 HD2 ARG A 349 24.566 56.282 82.789 1.00 0.00 H ATOM 5301 HD3 ARG A 349 23.036 56.865 82.093 1.00 0.00 H ATOM 5302 HE ARG A 349 23.694 54.034 81.609 1.00 0.00 H ATOM 5303 HH12 ARG A 349 24.049 54.627 78.193 1.00 0.00 H ATOM 5304 HH11 ARG A 349 23.917 53.406 79.511 1.00 0.00 H ATOM 5305 HH22 ARG A 349 23.984 56.897 78.720 1.00 0.00 H ATOM 5306 HH21 ARG A 349 23.802 57.403 80.440 1.00 0.00 H ATOM 5307 H ARG A 349 21.224 58.629 84.970 1.00 0.00 H ATOM 5308 N GLU A 350 19.084 56.253 84.362 1.00 49.28 N ATOM 5309 CA GLU A 350 17.922 55.394 84.422 1.00 50.45 C ATOM 5310 C GLU A 350 16.835 55.799 83.429 1.00 49.78 C ATOM 5311 O GLU A 350 16.234 54.935 82.758 1.00 49.88 O ATOM 5312 CB GLU A 350 17.367 55.390 85.848 1.00 50.88 C ATOM 5313 CG GLU A 350 16.303 54.354 86.066 1.00 54.36 C ATOM 5314 CD GLU A 350 15.572 54.537 87.373 1.00 56.88 C ATOM 5315 HA GLU A 350 18.240 54.390 84.141 1.00 0.00 H ATOM 5316 HB2 GLU A 350 18.187 55.195 86.539 1.00 0.00 H ATOM 5317 HB3 GLU A 350 16.943 56.372 86.058 1.00 0.00 H ATOM 5318 HG2 GLU A 350 15.582 54.417 85.251 1.00 0.00 H ATOM 5319 HG3 GLU A 350 16.769 53.369 86.062 1.00 0.00 H ATOM 5320 H GLU A 350 19.285 56.896 85.154 1.00 0.00 H ATOM 5321 N ASP A 351 16.575 57.104 83.357 1.00 48.18 N ATOM 5322 CA ASP A 351 15.567 57.624 82.440 1.00 47.65 C ATOM 5323 C ASP A 351 16.042 57.414 80.985 1.00 46.97 C ATOM 5324 O ASP A 351 15.242 57.220 80.072 1.00 46.71 O ATOM 5325 CB ASP A 351 15.275 59.098 82.765 1.00 48.09 C ATOM 5326 CG ASP A 351 14.256 59.246 83.919 1.00 48.36 C ATOM 5327 OD1 ASP A 351 13.669 58.230 84.340 1.00 49.38 O ATOM 5328 OD2 ASP A 351 14.017 60.368 84.402 1.00 48.90 O ATOM 5329 HA ASP A 351 14.628 57.083 82.558 1.00 0.00 H ATOM 5330 HB2 ASP A 351 16.206 59.586 83.052 1.00 0.00 H ATOM 5331 HB3 ASP A 351 14.872 59.582 81.875 1.00 0.00 H ATOM 5332 H ASP A 351 17.100 57.764 83.966 1.00 0.00 H ATOM 5333 N PHE A 352 17.352 57.412 80.801 1.00 44.80 N ATOM 5334 CA PHE A 352 17.935 57.184 79.495 1.00 45.82 C ATOM 5335 C PHE A 352 17.525 55.777 79.046 1.00 46.77 C ATOM 5336 O PHE A 352 17.037 55.559 77.926 1.00 46.43 O ATOM 5337 CB PHE A 352 19.458 57.245 79.599 1.00 42.46 C ATOM 5338 CG PHE A 352 20.151 57.029 78.316 1.00 42.22 C ATOM 5339 CD1 PHE A 352 20.299 58.074 77.413 1.00 38.75 C ATOM 5340 CD2 PHE A 352 20.636 55.761 77.986 1.00 39.97 C ATOM 5341 CE1 PHE A 352 20.921 57.852 76.193 1.00 40.80 C ATOM 5342 CE2 PHE A 352 21.243 55.531 76.810 1.00 40.89 C ATOM 5343 CZ PHE A 352 21.398 56.568 75.884 1.00 38.82 C ATOM 5344 HA PHE A 352 17.593 57.938 78.786 1.00 0.00 H ATOM 5345 HB2 PHE A 352 19.738 58.227 79.980 1.00 0.00 H ATOM 5346 HB3 PHE A 352 19.786 56.478 80.300 1.00 0.00 H ATOM 5347 HD2 PHE A 352 20.520 54.943 78.696 1.00 0.00 H ATOM 5348 HE2 PHE A 352 21.616 54.534 76.577 1.00 0.00 H ATOM 5349 HZ PHE A 352 21.886 56.380 74.928 1.00 0.00 H ATOM 5350 HE1 PHE A 352 21.039 58.668 75.480 1.00 0.00 H ATOM 5351 HD1 PHE A 352 19.927 59.068 77.663 1.00 0.00 H ATOM 5352 H PHE A 352 17.979 57.578 81.614 1.00 0.00 H ATOM 5353 N MET A 353 17.737 54.820 79.938 1.00 46.96 N ATOM 5354 CA MET A 353 17.441 53.447 79.605 1.00 48.11 C ATOM 5355 C MET A 353 15.962 53.199 79.381 1.00 46.07 C ATOM 5356 O MET A 353 15.596 52.398 78.536 1.00 44.81 O ATOM 5357 CB MET A 353 18.025 52.500 80.668 1.00 50.02 C ATOM 5358 CG MET A 353 19.538 52.253 80.431 1.00 53.97 C ATOM 5359 SD MET A 353 20.253 51.030 81.591 1.00 62.09 S ATOM 5360 CE MET A 353 19.741 51.767 83.234 1.00 55.69 C ATOM 5361 HA MET A 353 17.923 53.235 78.651 1.00 0.00 H ATOM 5362 HB2 MET A 353 17.887 52.944 81.654 1.00 0.00 H ATOM 5363 HB3 MET A 353 17.498 51.547 80.623 1.00 0.00 H ATOM 5364 HG2 MET A 353 20.068 53.198 80.552 1.00 0.00 H ATOM 5365 HG3 MET A 353 19.676 51.888 79.413 1.00 0.00 H ATOM 5366 HE1 MET A 353 20.168 52.765 83.332 1.00 0.00 H ATOM 5367 HE2 MET A 353 18.654 51.830 83.280 1.00 0.00 H ATOM 5368 HE3 MET A 353 20.104 51.134 84.044 1.00 0.00 H ATOM 5369 H MET A 353 18.116 55.058 80.877 1.00 0.00 H ATOM 5370 N SER A 354 15.107 53.884 80.117 1.00 45.09 N ATOM 5371 CA SER A 354 13.701 53.656 79.889 1.00 45.98 C ATOM 5372 C SER A 354 13.267 54.430 78.560 1.00 45.56 C ATOM 5373 O SER A 354 12.324 54.018 77.853 1.00 43.52 O ATOM 5374 CB SER A 354 12.928 54.031 81.166 1.00 46.04 C ATOM 5375 OG SER A 354 12.727 55.405 81.207 1.00 51.79 O ATOM 5376 HA SER A 354 13.463 52.608 79.704 1.00 0.00 H ATOM 5377 HB2 SER A 354 13.501 53.722 82.040 1.00 0.00 H ATOM 5378 HB3 SER A 354 11.963 53.523 81.168 1.00 0.00 H ATOM 5379 HG SER A 354 13.603 55.866 81.207 1.00 0.00 H ATOM 5380 H SER A 354 15.435 54.562 80.834 1.00 0.00 H ATOM 5381 N GLY A 355 14.038 55.475 78.200 1.00 43.29 N ATOM 5382 CA GLY A 355 13.811 56.228 76.976 1.00 40.10 C ATOM 5383 C GLY A 355 14.183 55.327 75.799 1.00 39.27 C ATOM 5384 O GLY A 355 13.452 55.285 74.786 1.00 35.89 O ATOM 5385 HA3 GLY A 355 14.433 57.123 76.970 1.00 0.00 H ATOM 5386 HA2 GLY A 355 12.762 56.516 76.906 1.00 0.00 H ATOM 5387 H GLY A 355 14.825 55.754 78.820 1.00 0.00 H ATOM 5388 N VAL A 356 15.292 54.579 75.907 1.00 38.01 N ATOM 5389 CA VAL A 356 15.627 53.735 74.779 1.00 39.05 C ATOM 5390 C VAL A 356 14.618 52.612 74.607 1.00 38.03 C ATOM 5391 O VAL A 356 14.283 52.276 73.486 1.00 39.28 O ATOM 5392 CB VAL A 356 17.146 53.159 74.758 1.00 41.44 C ATOM 5393 CG1 VAL A 356 18.036 53.904 75.668 1.00 38.56 C ATOM 5394 CG2 VAL A 356 17.188 51.680 74.929 1.00 40.76 C ATOM 5395 HA VAL A 356 15.575 54.406 73.921 1.00 0.00 H ATOM 5396 HB VAL A 356 17.552 53.337 73.762 1.00 0.00 H ATOM 5397 HG11 VAL A 356 18.066 54.951 75.368 1.00 0.00 H ATOM 5398 HG12 VAL A 356 17.658 53.827 76.687 1.00 0.00 H ATOM 5399 HG13 VAL A 356 19.040 53.482 75.619 1.00 0.00 H ATOM 5400 HG21 VAL A 356 16.737 51.413 75.885 1.00 0.00 H ATOM 5401 HG22 VAL A 356 16.634 51.206 74.119 1.00 0.00 H ATOM 5402 HG23 VAL A 356 18.224 51.342 74.908 1.00 0.00 H ATOM 5403 H VAL A 356 15.884 54.604 76.762 1.00 0.00 H ATOM 5404 N LYS A 357 14.117 52.056 75.696 1.00 38.68 N ATOM 5405 CA LYS A 357 13.093 51.007 75.636 1.00 39.31 C ATOM 5406 C LYS A 357 11.812 51.557 74.937 1.00 38.46 C ATOM 5407 O LYS A 357 11.177 50.875 74.121 1.00 36.83 O ATOM 5408 CB LYS A 357 12.746 50.561 77.054 1.00 40.60 C ATOM 5409 CG LYS A 357 11.549 49.595 77.125 1.00 45.22 C ATOM 5410 CD LYS A 357 11.820 48.249 76.400 1.00 45.85 C ATOM 5411 CE LYS A 357 10.724 47.172 76.715 1.00 48.59 C ATOM 5412 HA LYS A 357 13.476 50.160 75.066 1.00 0.00 H ATOM 5413 HB2 LYS A 357 13.616 50.062 77.481 1.00 0.00 H ATOM 5414 HB3 LYS A 357 12.510 51.446 77.645 1.00 0.00 H ATOM 5415 HG2 LYS A 357 11.329 49.389 78.172 1.00 0.00 H ATOM 5416 HG3 LYS A 357 10.687 50.074 76.661 1.00 0.00 H ATOM 5417 HD2 LYS A 357 11.838 48.427 75.325 1.00 0.00 H ATOM 5418 HD3 LYS A 357 12.789 47.867 76.720 1.00 0.00 H ATOM 5419 HE2 LYS A 357 10.703 46.980 77.788 1.00 0.00 H ATOM 5420 HE3 LYS A 357 9.751 47.541 76.391 1.00 0.00 H ATOM 5421 H LYS A 357 14.460 52.372 76.626 1.00 0.00 H ATOM 5422 N LEU A 358 11.462 52.800 75.253 1.00 36.46 N ATOM 5423 CA LEU A 358 10.303 53.443 74.645 1.00 37.27 C ATOM 5424 C LEU A 358 10.553 53.736 73.144 1.00 37.54 C ATOM 5425 O LEU A 358 9.623 53.675 72.330 1.00 37.07 O ATOM 5426 CB LEU A 358 10.046 54.735 75.384 1.00 38.55 C ATOM 5427 CG LEU A 358 8.817 55.006 76.258 1.00 42.74 C ATOM 5428 CD1 LEU A 358 8.140 53.751 76.811 1.00 41.18 C ATOM 5429 CD2 LEU A 358 9.247 56.036 77.342 1.00 38.94 C ATOM 5430 HA LEU A 358 9.440 52.780 74.714 1.00 0.00 H ATOM 5431 HB2 LEU A 358 10.907 54.875 76.037 1.00 0.00 H ATOM 5432 HB3 LEU A 358 10.040 55.513 74.621 1.00 0.00 H ATOM 5433 HG LEU A 358 8.019 55.427 75.646 1.00 0.00 H ATOM 5434 HD21 LEU A 358 10.059 55.618 77.937 1.00 0.00 H ATOM 5435 HD22 LEU A 358 9.585 56.952 76.857 1.00 0.00 H ATOM 5436 HD23 LEU A 358 8.398 56.257 77.988 1.00 0.00 H ATOM 5437 HD11 LEU A 358 7.808 53.124 75.983 1.00 0.00 H ATOM 5438 HD12 LEU A 358 8.850 53.198 77.426 1.00 0.00 H ATOM 5439 HD13 LEU A 358 7.281 54.040 77.417 1.00 0.00 H ATOM 5440 H LEU A 358 12.028 53.326 75.950 1.00 0.00 H ATOM 5441 N SER A 359 11.806 54.049 72.784 1.00 36.25 N ATOM 5442 CA SER A 359 12.170 54.393 71.411 1.00 36.43 C ATOM 5443 C SER A 359 12.312 53.260 70.444 1.00 37.59 C ATOM 5444 O SER A 359 12.141 53.459 69.250 1.00 40.26 O ATOM 5445 CB SER A 359 13.464 55.159 71.385 1.00 36.37 C ATOM 5446 OG SER A 359 13.376 56.236 72.262 1.00 37.25 O ATOM 5447 HA SER A 359 11.314 54.979 71.077 1.00 0.00 H ATOM 5448 HB2 SER A 359 13.651 55.525 70.375 1.00 0.00 H ATOM 5449 HB3 SER A 359 14.281 54.505 71.691 1.00 0.00 H ATOM 5450 HG SER A 359 13.206 55.901 73.178 1.00 0.00 H ATOM 5451 H SER A 359 12.549 54.047 73.511 1.00 0.00 H ATOM 5452 N VAL A 360 12.616 52.069 70.931 1.00 37.15 N ATOM 5453 CA VAL A 360 12.776 50.922 70.037 1.00 38.91 C ATOM 5454 C VAL A 360 11.910 49.834 70.642 1.00 40.75 C ATOM 5455 O VAL A 360 12.404 48.794 71.089 1.00 41.18 O ATOM 5456 CB VAL A 360 14.244 50.501 70.040 1.00 38.10 C ATOM 5457 CG1 VAL A 360 14.522 49.569 68.872 1.00 37.21 C ATOM 5458 CG2 VAL A 360 15.110 51.786 69.959 1.00 38.27 C ATOM 5459 HA VAL A 360 12.490 51.135 69.007 1.00 0.00 H ATOM 5460 HB VAL A 360 14.488 49.957 70.952 1.00 0.00 H ATOM 5461 HG11 VAL A 360 13.895 48.682 68.959 1.00 0.00 H ATOM 5462 HG12 VAL A 360 14.298 50.083 67.937 1.00 0.00 H ATOM 5463 HG13 VAL A 360 15.572 49.276 68.885 1.00 0.00 H ATOM 5464 HG21 VAL A 360 14.874 52.325 69.041 1.00 0.00 H ATOM 5465 HG22 VAL A 360 14.898 52.421 70.819 1.00 0.00 H ATOM 5466 HG23 VAL A 360 16.165 51.512 69.960 1.00 0.00 H ATOM 5467 H VAL A 360 12.742 51.947 71.956 1.00 0.00 H ATOM 5468 N PRO A 361 10.588 50.053 70.637 1.00 43.04 N ATOM 5469 CA PRO A 361 9.598 49.132 71.208 1.00 44.79 C ATOM 5470 C PRO A 361 9.642 47.710 70.752 1.00 46.34 C ATOM 5471 O PRO A 361 9.382 46.803 71.532 1.00 46.63 O ATOM 5472 CB PRO A 361 8.277 49.818 70.889 1.00 45.01 C ATOM 5473 CG PRO A 361 8.578 50.546 69.591 1.00 43.61 C ATOM 5474 CD PRO A 361 9.931 51.120 69.860 1.00 42.40 C ATOM 5475 HA PRO A 361 9.791 48.984 72.271 1.00 0.00 H ATOM 5476 HD3 PRO A 361 10.466 51.317 68.931 1.00 0.00 H ATOM 5477 HD2 PRO A 361 9.860 52.041 70.439 1.00 0.00 H ATOM 5478 HG3 PRO A 361 7.846 51.331 69.398 1.00 0.00 H ATOM 5479 HG2 PRO A 361 8.601 49.857 68.747 1.00 0.00 H ATOM 5480 HB2 PRO A 361 7.478 49.089 70.754 1.00 0.00 H ATOM 5481 HB3 PRO A 361 7.998 50.518 71.676 1.00 0.00 H ATOM 5482 N HIS A 362 9.984 47.516 69.488 1.00 48.45 N ATOM 5483 CA HIS A 362 10.051 46.193 68.896 1.00 51.41 C ATOM 5484 C HIS A 362 11.352 45.388 69.218 1.00 52.24 C ATOM 5485 O HIS A 362 11.501 44.244 68.774 1.00 52.69 O ATOM 5486 CB HIS A 362 9.900 46.366 67.377 1.00 53.53 C ATOM 5487 CG HIS A 362 10.893 47.334 66.795 1.00 56.94 C ATOM 5488 ND1 HIS A 362 10.894 48.687 67.105 1.00 56.55 N ATOM 5489 CD2 HIS A 362 11.977 47.128 66.002 1.00 57.64 C ATOM 5490 CE1 HIS A 362 11.937 49.263 66.533 1.00 57.18 C ATOM 5491 NE2 HIS A 362 12.611 48.340 65.856 1.00 58.79 N ATOM 5492 HA HIS A 362 9.249 45.599 69.333 1.00 0.00 H ATOM 5493 HB2 HIS A 362 10.040 45.396 66.901 1.00 0.00 H ATOM 5494 HB3 HIS A 362 8.895 46.731 67.167 1.00 0.00 H ATOM 5495 HD2 HIS A 362 12.286 46.179 65.563 1.00 0.00 H ATOM 5496 HE1 HIS A 362 12.200 50.318 66.605 1.00 0.00 H ATOM 5497 H HIS A 362 10.213 48.341 68.898 1.00 0.00 H ATOM 5498 N ALA A 363 12.273 45.957 70.001 1.00 50.99 N ATOM 5499 CA ALA A 363 13.534 45.270 70.276 1.00 50.12 C ATOM 5500 C ALA A 363 13.582 44.372 71.491 1.00 48.95 C ATOM 5501 O ALA A 363 13.002 44.684 72.518 1.00 50.42 O ATOM 5502 CB ALA A 363 14.669 46.303 70.406 1.00 49.51 C ATOM 5503 HA ALA A 363 13.648 44.603 69.422 1.00 0.00 H ATOM 5504 HB1 ALA A 363 14.757 46.863 69.475 1.00 0.00 H ATOM 5505 HB2 ALA A 363 14.444 46.988 71.224 1.00 0.00 H ATOM 5506 HB3 ALA A 363 15.607 45.787 70.611 1.00 0.00 H ATOM 5507 H ALA A 363 12.092 46.893 70.417 1.00 0.00 H ATOM 5508 N ASN A 364 14.315 43.268 71.382 1.00 48.21 N ATOM 5509 CA ASN A 364 14.499 42.380 72.524 1.00 47.39 C ATOM 5510 C ASN A 364 15.593 43.014 73.415 1.00 46.39 C ATOM 5511 O ASN A 364 16.111 44.099 73.102 1.00 44.69 O ATOM 5512 CB ASN A 364 14.924 40.968 72.077 1.00 48.25 C ATOM 5513 CG ASN A 364 16.186 40.960 71.231 1.00 49.68 C ATOM 5514 OD1 ASN A 364 16.980 41.908 71.246 1.00 50.86 O ATOM 5515 ND2 ASN A 364 16.382 39.877 70.495 1.00 49.59 N ATOM 5516 HA ASN A 364 13.561 42.268 73.068 1.00 0.00 H ATOM 5517 HB2 ASN A 364 15.099 40.361 72.966 1.00 0.00 H ATOM 5518 HB3 ASN A 364 14.113 40.531 71.494 1.00 0.00 H ATOM 5519 HD22 ASN A 364 15.687 39.103 70.513 1.00 0.00 H ATOM 5520 HD21 ASN A 364 17.231 39.800 69.899 1.00 0.00 H ATOM 5521 H ASN A 364 14.762 43.035 70.472 1.00 0.00 H ATOM 5522 N ASP A 365 15.943 42.351 74.509 1.00 44.49 N ATOM 5523 CA ASP A 365 16.934 42.917 75.411 1.00 44.57 C ATOM 5524 C ASP A 365 18.346 43.070 74.829 1.00 43.24 C ATOM 5525 O ASP A 365 19.033 44.027 75.136 1.00 41.74 O ATOM 5526 CB ASP A 365 16.937 42.148 76.740 1.00 46.08 C ATOM 5527 CG ASP A 365 15.716 42.491 77.618 1.00 45.54 C ATOM 5528 HA ASP A 365 16.621 43.946 75.585 1.00 0.00 H ATOM 5529 HB2 ASP A 365 16.927 41.079 76.527 1.00 0.00 H ATOM 5530 HB3 ASP A 365 17.845 42.399 77.288 1.00 0.00 H ATOM 5531 H ASP A 365 15.510 41.429 74.721 1.00 0.00 H ATOM 5532 N LEU A 366 18.763 42.154 73.973 1.00 41.79 N ATOM 5533 CA LEU A 366 20.068 42.276 73.358 1.00 42.86 C ATOM 5534 C LEU A 366 20.045 43.541 72.453 1.00 42.01 C ATOM 5535 O LEU A 366 21.017 44.319 72.369 1.00 41.04 O ATOM 5536 CB LEU A 366 20.360 41.025 72.524 1.00 42.77 C ATOM 5537 CG LEU A 366 21.742 41.086 71.885 1.00 44.63 C ATOM 5538 CD1 LEU A 366 22.797 41.014 72.993 1.00 42.15 C ATOM 5539 CD2 LEU A 366 21.922 39.958 70.871 1.00 45.75 C ATOM 5540 HA LEU A 366 20.849 42.371 74.113 1.00 0.00 H ATOM 5541 HB2 LEU A 366 20.307 40.149 73.170 1.00 0.00 H ATOM 5542 HB3 LEU A 366 19.610 40.941 71.738 1.00 0.00 H ATOM 5543 HG LEU A 366 21.856 42.024 71.341 1.00 0.00 H ATOM 5544 HD21 LEU A 366 21.809 38.998 71.374 1.00 0.00 H ATOM 5545 HD22 LEU A 366 21.169 40.051 70.089 1.00 0.00 H ATOM 5546 HD23 LEU A 366 22.916 40.024 70.429 1.00 0.00 H ATOM 5547 HD11 LEU A 366 22.665 41.855 73.674 1.00 0.00 H ATOM 5548 HD12 LEU A 366 22.682 40.079 73.542 1.00 0.00 H ATOM 5549 HD13 LEU A 366 23.792 41.057 72.549 1.00 0.00 H ATOM 5550 H LEU A 366 18.153 41.344 73.741 1.00 0.00 H ATOM 5551 N GLY A 367 18.923 43.713 71.763 1.00 41.06 N ATOM 5552 CA GLY A 367 18.730 44.864 70.902 1.00 39.59 C ATOM 5553 C GLY A 367 18.796 46.157 71.729 1.00 37.86 C ATOM 5554 O GLY A 367 19.494 47.107 71.363 1.00 36.93 O ATOM 5555 HA3 GLY A 367 17.756 44.794 70.419 1.00 0.00 H ATOM 5556 HA2 GLY A 367 19.511 44.881 70.142 1.00 0.00 H ATOM 5557 H GLY A 367 18.165 43.005 71.842 1.00 0.00 H ATOM 5558 N LEU A 368 18.100 46.202 72.851 1.00 37.34 N ATOM 5559 CA LEU A 368 18.155 47.420 73.667 1.00 39.49 C ATOM 5560 C LEU A 368 19.578 47.673 74.193 1.00 41.31 C ATOM 5561 O LEU A 368 20.005 48.840 74.339 1.00 41.19 O ATOM 5562 CB LEU A 368 17.163 47.337 74.826 1.00 38.54 C ATOM 5563 CG LEU A 368 15.695 47.237 74.359 1.00 40.25 C ATOM 5564 CD1 LEU A 368 14.832 46.918 75.586 1.00 40.11 C ATOM 5565 CD2 LEU A 368 15.243 48.534 73.642 1.00 40.01 C ATOM 5566 HA LEU A 368 17.877 48.261 73.031 1.00 0.00 H ATOM 5567 HB2 LEU A 368 17.399 46.456 75.423 1.00 0.00 H ATOM 5568 HB3 LEU A 368 17.272 48.230 75.441 1.00 0.00 H ATOM 5569 HG LEU A 368 15.584 46.440 73.624 1.00 0.00 H ATOM 5570 HD21 LEU A 368 15.333 49.377 74.327 1.00 0.00 H ATOM 5571 HD22 LEU A 368 15.874 48.704 72.770 1.00 0.00 H ATOM 5572 HD23 LEU A 368 14.205 48.430 73.326 1.00 0.00 H ATOM 5573 HD11 LEU A 368 15.156 45.972 76.021 1.00 0.00 H ATOM 5574 HD12 LEU A 368 14.941 47.714 76.322 1.00 0.00 H ATOM 5575 HD13 LEU A 368 13.787 46.842 75.284 1.00 0.00 H ATOM 5576 H LEU A 368 17.524 45.389 73.150 1.00 0.00 H ATOM 5577 N ASP A 369 20.320 46.594 74.471 1.00 41.05 N ATOM 5578 CA ASP A 369 21.696 46.759 74.921 1.00 41.56 C ATOM 5579 C ASP A 369 22.546 47.360 73.788 1.00 39.19 C ATOM 5580 O ASP A 369 23.343 48.273 74.011 1.00 39.35 O ATOM 5581 CB ASP A 369 22.316 45.422 75.356 1.00 44.54 C ATOM 5582 CG ASP A 369 21.870 44.990 76.738 1.00 47.99 C ATOM 5583 OD1 ASP A 369 21.427 45.846 77.526 1.00 49.03 O ATOM 5584 OD2 ASP A 369 21.983 43.785 77.043 1.00 51.03 O ATOM 5585 HA ASP A 369 21.683 47.428 75.781 1.00 0.00 H ATOM 5586 HB2 ASP A 369 22.025 44.654 74.640 1.00 0.00 H ATOM 5587 HB3 ASP A 369 23.401 45.525 75.356 1.00 0.00 H ATOM 5588 H ASP A 369 19.916 45.642 74.366 1.00 0.00 H ATOM 5589 N ALA A 370 22.391 46.839 72.583 1.00 37.17 N ATOM 5590 CA ALA A 370 23.165 47.369 71.460 1.00 37.10 C ATOM 5591 C ALA A 370 22.930 48.881 71.296 1.00 37.86 C ATOM 5592 O ALA A 370 23.914 49.625 71.116 1.00 39.34 O ATOM 5593 CB ALA A 370 22.816 46.624 70.158 1.00 34.61 C ATOM 5594 HA ALA A 370 24.222 47.210 71.675 1.00 0.00 H ATOM 5595 HB1 ALA A 370 23.044 45.565 70.275 1.00 0.00 H ATOM 5596 HB2 ALA A 370 21.754 46.747 69.944 1.00 0.00 H ATOM 5597 HB3 ALA A 370 23.403 47.035 69.337 1.00 0.00 H ATOM 5598 H ALA A 370 21.722 46.056 72.434 1.00 0.00 H ATOM 5599 N VAL A 371 21.672 49.353 71.373 1.00 35.33 N ATOM 5600 CA VAL A 371 21.399 50.795 71.213 1.00 35.27 C ATOM 5601 C VAL A 371 22.068 51.605 72.330 1.00 36.48 C ATOM 5602 O VAL A 371 22.759 52.616 72.072 1.00 36.37 O ATOM 5603 CB VAL A 371 19.842 51.107 71.243 1.00 34.47 C ATOM 5604 CG1 VAL A 371 19.574 52.644 71.094 1.00 33.77 C ATOM 5605 CG2 VAL A 371 19.129 50.302 70.113 1.00 34.83 C ATOM 5606 HA VAL A 371 21.806 51.081 70.243 1.00 0.00 H ATOM 5607 HB VAL A 371 19.437 50.799 72.207 1.00 0.00 H ATOM 5608 HG11 VAL A 371 20.054 53.176 71.915 1.00 0.00 H ATOM 5609 HG12 VAL A 371 19.983 52.993 70.146 1.00 0.00 H ATOM 5610 HG13 VAL A 371 18.500 52.828 71.118 1.00 0.00 H ATOM 5611 HG21 VAL A 371 19.540 50.593 69.146 1.00 0.00 H ATOM 5612 HG22 VAL A 371 19.290 49.236 70.271 1.00 0.00 H ATOM 5613 HG23 VAL A 371 18.061 50.517 70.134 1.00 0.00 H ATOM 5614 H VAL A 371 20.885 48.696 71.547 1.00 0.00 H ATOM 5615 N THR A 372 21.852 51.166 73.569 1.00 37.17 N ATOM 5616 CA THR A 372 22.418 51.814 74.733 1.00 38.89 C ATOM 5617 C THR A 372 23.944 51.901 74.642 1.00 40.98 C ATOM 5618 O THR A 372 24.527 52.944 74.895 1.00 41.24 O ATOM 5619 CB THR A 372 21.987 51.057 75.996 1.00 40.98 C ATOM 5620 OG1 THR A 372 20.557 51.087 76.052 1.00 43.57 O ATOM 5621 CG2 THR A 372 22.548 51.706 77.287 1.00 38.99 C ATOM 5622 HA THR A 372 22.043 52.836 74.780 1.00 0.00 H ATOM 5623 HB THR A 372 22.375 50.040 75.943 1.00 0.00 H ATOM 5624 HG1 THR A 372 20.187 50.650 75.244 1.00 0.00 H ATOM 5625 HG23 THR A 372 23.637 51.689 77.257 1.00 0.00 H ATOM 5626 HG21 THR A 372 22.201 52.737 77.354 1.00 0.00 H ATOM 5627 HG22 THR A 372 22.199 51.146 78.155 1.00 0.00 H ATOM 5628 H THR A 372 21.254 50.326 73.705 1.00 0.00 H ATOM 5629 N LEU A 373 24.587 50.821 74.228 1.00 41.73 N ATOM 5630 CA LEU A 373 26.040 50.816 74.084 1.00 43.18 C ATOM 5631 C LEU A 373 26.480 51.857 73.049 1.00 43.47 C ATOM 5632 O LEU A 373 27.431 52.602 73.266 1.00 42.81 O ATOM 5633 CB LEU A 373 26.499 49.440 73.587 1.00 45.20 C ATOM 5634 CG LEU A 373 27.969 49.296 73.191 1.00 46.38 C ATOM 5635 CD1 LEU A 373 28.710 48.762 74.362 1.00 49.60 C ATOM 5636 CD2 LEU A 373 28.132 48.337 72.038 1.00 49.99 C ATOM 5637 HA LEU A 373 26.480 51.047 75.054 1.00 0.00 H ATOM 5638 HB2 LEU A 373 26.301 48.721 74.382 1.00 0.00 H ATOM 5639 HB3 LEU A 373 25.897 49.189 72.713 1.00 0.00 H ATOM 5640 HG LEU A 373 28.352 50.270 72.885 1.00 0.00 H ATOM 5641 HD21 LEU A 373 27.751 47.357 72.326 1.00 0.00 H ATOM 5642 HD22 LEU A 373 27.574 48.707 71.178 1.00 0.00 H ATOM 5643 HD23 LEU A 373 29.188 48.257 71.781 1.00 0.00 H ATOM 5644 HD11 LEU A 373 28.611 49.453 75.199 1.00 0.00 H ATOM 5645 HD12 LEU A 373 28.298 47.792 74.640 1.00 0.00 H ATOM 5646 HD13 LEU A 373 29.763 48.650 74.104 1.00 0.00 H ATOM 5647 H LEU A 373 24.048 49.961 74.001 1.00 0.00 H ATOM 5648 N GLN A 374 25.784 51.863 71.911 1.00 41.80 N ATOM 5649 CA GLN A 374 26.070 52.752 70.775 1.00 42.30 C ATOM 5650 C GLN A 374 25.923 54.245 71.092 1.00 40.88 C ATOM 5651 O GLN A 374 26.647 55.089 70.565 1.00 39.64 O ATOM 5652 CB GLN A 374 25.127 52.381 69.626 1.00 44.49 C ATOM 5653 CG GLN A 374 25.496 52.881 68.299 1.00 47.26 C ATOM 5654 CD GLN A 374 26.695 52.141 67.741 1.00 51.17 C ATOM 5655 OE1 GLN A 374 27.223 52.543 66.700 1.00 51.64 O ATOM 5656 NE2 GLN A 374 27.149 51.066 68.433 1.00 50.48 N ATOM 5657 HA GLN A 374 27.117 52.605 70.510 1.00 0.00 H ATOM 5658 HB2 GLN A 374 25.081 51.293 69.571 1.00 0.00 H ATOM 5659 HB3 GLN A 374 24.139 52.773 69.867 1.00 0.00 H ATOM 5660 HG2 GLN A 374 24.651 52.749 67.623 1.00 0.00 H ATOM 5661 HG3 GLN A 374 25.737 53.941 68.374 1.00 0.00 H ATOM 5662 HE22 GLN A 374 26.668 50.768 69.305 1.00 0.00 H ATOM 5663 HE21 GLN A 374 27.978 50.540 68.091 1.00 0.00 H ATOM 5664 H GLN A 374 24.990 51.198 71.822 1.00 0.00 H ATOM 5665 N TYR A 375 24.996 54.567 71.976 1.00 38.58 N ATOM 5666 CA TYR A 375 24.761 55.962 72.292 1.00 38.80 C ATOM 5667 C TYR A 375 25.275 56.440 73.652 1.00 39.71 C ATOM 5668 O TYR A 375 25.079 57.585 74.034 1.00 40.67 O ATOM 5669 CB TYR A 375 23.241 56.244 72.112 1.00 35.96 C ATOM 5670 CG TYR A 375 22.880 56.354 70.623 1.00 33.31 C ATOM 5671 CD1 TYR A 375 22.994 57.564 69.956 1.00 33.04 C ATOM 5672 CD2 TYR A 375 22.460 55.228 69.890 1.00 32.96 C ATOM 5673 CE1 TYR A 375 22.697 57.676 68.570 1.00 34.16 C ATOM 5674 CE2 TYR A 375 22.169 55.315 68.521 1.00 32.65 C ATOM 5675 CZ TYR A 375 22.289 56.540 67.870 1.00 33.71 C ATOM 5676 OH TYR A 375 21.999 56.633 66.521 1.00 36.51 O ATOM 5677 HA TYR A 375 25.361 56.549 71.597 1.00 0.00 H ATOM 5678 HB3 TYR A 375 22.989 57.180 72.611 1.00 0.00 H ATOM 5679 HB2 TYR A 375 22.671 55.430 72.559 1.00 0.00 H ATOM 5680 HD2 TYR A 375 22.359 54.268 70.397 1.00 0.00 H ATOM 5681 HE2 TYR A 375 21.851 54.430 67.970 1.00 0.00 H ATOM 5682 HE1 TYR A 375 22.787 58.636 68.061 1.00 0.00 H ATOM 5683 HD1 TYR A 375 23.318 58.448 70.505 1.00 0.00 H ATOM 5684 HH TYR A 375 22.135 57.566 66.219 1.00 0.00 H ATOM 5685 H TYR A 375 24.438 53.824 72.443 1.00 0.00 H ATOM 5686 N THR A 376 25.966 55.594 74.385 1.00 39.83 N ATOM 5687 CA THR A 376 26.448 56.033 75.698 1.00 38.89 C ATOM 5688 C THR A 376 27.925 56.412 75.687 1.00 39.37 C ATOM 5689 O THR A 376 28.749 55.739 75.076 1.00 36.60 O ATOM 5690 CB THR A 376 26.223 54.916 76.733 1.00 39.82 C ATOM 5691 OG1 THR A 376 24.814 54.717 76.904 1.00 38.42 O ATOM 5692 CG2 THR A 376 26.881 55.239 78.089 1.00 37.46 C ATOM 5693 HA THR A 376 25.881 56.925 75.963 1.00 0.00 H ATOM 5694 HB THR A 376 26.692 54.006 76.360 1.00 0.00 H ATOM 5695 HG1 THR A 376 24.411 54.457 76.038 1.00 0.00 H ATOM 5696 HG23 THR A 376 27.951 55.388 77.946 1.00 0.00 H ATOM 5697 HG21 THR A 376 26.438 56.147 78.499 1.00 0.00 H ATOM 5698 HG22 THR A 376 26.717 54.410 78.778 1.00 0.00 H ATOM 5699 H THR A 376 26.166 54.633 74.040 1.00 0.00 H ATOM 5700 N ASP A 377 28.262 57.536 76.304 1.00 39.89 N ATOM 5701 CA ASP A 377 29.668 57.890 76.426 1.00 40.61 C ATOM 5702 C ASP A 377 30.051 57.239 77.794 1.00 42.35 C ATOM 5703 O ASP A 377 29.749 57.810 78.859 1.00 40.36 O ATOM 5704 CB ASP A 377 29.806 59.389 76.510 1.00 41.97 C ATOM 5705 CG ASP A 377 31.205 59.826 76.892 1.00 44.10 C ATOM 5706 OD1 ASP A 377 32.043 58.961 77.271 1.00 43.89 O ATOM 5707 OD2 ASP A 377 31.452 61.051 76.832 1.00 44.85 O ATOM 5708 HA ASP A 377 30.288 57.561 75.592 1.00 0.00 H ATOM 5709 HB2 ASP A 377 29.559 59.817 75.538 1.00 0.00 H ATOM 5710 HB3 ASP A 377 29.107 59.763 77.258 1.00 0.00 H ATOM 5711 H ASP A 377 27.528 58.159 76.697 1.00 0.00 H ATOM 5712 N TRP A 378 30.681 56.054 77.768 1.00 42.68 N ATOM 5713 CA TRP A 378 31.022 55.377 79.015 1.00 44.99 C ATOM 5714 C TRP A 378 32.089 56.030 79.888 1.00 45.81 C ATOM 5715 O TRP A 378 32.328 55.565 81.001 1.00 46.68 O ATOM 5716 CB TRP A 378 31.361 53.872 78.801 1.00 44.73 C ATOM 5717 CG TRP A 378 30.212 53.102 78.211 1.00 45.44 C ATOM 5718 CD1 TRP A 378 30.092 52.706 76.915 1.00 47.25 C ATOM 5719 CD2 TRP A 378 28.978 52.743 78.856 1.00 44.81 C ATOM 5720 NE1 TRP A 378 28.863 52.126 76.706 1.00 48.48 N ATOM 5721 CE2 TRP A 378 28.157 52.137 77.879 1.00 46.57 C ATOM 5722 CE3 TRP A 378 28.489 52.881 80.156 1.00 44.48 C ATOM 5723 CZ2 TRP A 378 26.859 51.662 78.161 1.00 46.59 C ATOM 5724 CZ3 TRP A 378 27.201 52.410 80.446 1.00 46.08 C ATOM 5725 CH2 TRP A 378 26.403 51.811 79.455 1.00 46.49 C ATOM 5726 HA TRP A 378 30.097 55.478 79.583 1.00 0.00 H ATOM 5727 HB2 TRP A 378 32.215 53.798 78.127 1.00 0.00 H ATOM 5728 HB3 TRP A 378 31.620 53.431 79.764 1.00 0.00 H ATOM 5729 HE1 TRP A 378 28.524 51.741 75.802 1.00 0.00 H ATOM 5730 HD1 TRP A 378 30.860 52.831 76.152 1.00 0.00 H ATOM 5731 HZ2 TRP A 378 26.243 51.198 77.391 1.00 0.00 H ATOM 5732 HH2 TRP A 378 25.405 51.458 79.714 1.00 0.00 H ATOM 5733 HZ3 TRP A 378 26.811 52.510 81.459 1.00 0.00 H ATOM 5734 HE3 TRP A 378 29.097 53.346 80.931 1.00 0.00 H ATOM 5735 H TRP A 378 30.927 55.617 76.857 1.00 0.00 H ATOM 5736 N MET A 379 32.730 57.091 79.428 1.00 46.75 N ATOM 5737 CA MET A 379 33.662 57.754 80.340 1.00 49.40 C ATOM 5738 C MET A 379 32.850 58.770 81.108 1.00 49.93 C ATOM 5739 O MET A 379 33.362 59.384 82.037 1.00 51.46 O ATOM 5740 CB MET A 379 34.756 58.563 79.630 1.00 51.07 C ATOM 5741 CG MET A 379 35.396 57.895 78.440 1.00 55.86 C ATOM 5742 SD MET A 379 36.975 58.660 78.061 1.00 60.64 S ATOM 5743 CE MET A 379 37.997 57.651 79.236 1.00 58.98 C ATOM 5744 HA MET A 379 34.141 56.980 80.939 1.00 0.00 H ATOM 5745 HB2 MET A 379 34.313 59.499 79.291 1.00 0.00 H ATOM 5746 HB3 MET A 379 35.540 58.776 80.357 1.00 0.00 H ATOM 5747 HG2 MET A 379 34.736 57.989 77.578 1.00 0.00 H ATOM 5748 HG3 MET A 379 35.553 56.840 78.663 1.00 0.00 H ATOM 5749 HE1 MET A 379 37.636 57.804 80.253 1.00 0.00 H ATOM 5750 HE2 MET A 379 37.914 56.596 78.974 1.00 0.00 H ATOM 5751 HE3 MET A 379 39.039 57.962 79.169 1.00 0.00 H ATOM 5752 H MET A 379 32.578 57.439 78.460 1.00 0.00 H ATOM 5753 N ASP A 380 31.579 58.967 80.762 1.00 48.64 N ATOM 5754 CA ASP A 380 30.834 60.035 81.447 1.00 47.28 C ATOM 5755 C ASP A 380 29.334 59.749 81.374 1.00 47.20 C ATOM 5756 O ASP A 380 28.554 60.588 80.957 1.00 45.98 O ATOM 5757 CB ASP A 380 31.204 61.334 80.719 1.00 43.74 C ATOM 5758 CG ASP A 380 30.695 62.575 81.408 1.00 44.25 C ATOM 5759 OD1 ASP A 380 30.386 62.528 82.630 1.00 43.44 O ATOM 5760 OD2 ASP A 380 30.623 63.608 80.709 1.00 43.28 O ATOM 5761 HA ASP A 380 31.084 60.106 82.505 1.00 0.00 H ATOM 5762 HB2 ASP A 380 32.290 61.396 80.654 1.00 0.00 H ATOM 5763 HB3 ASP A 380 30.782 61.299 79.714 1.00 0.00 H ATOM 5764 H ASP A 380 31.127 58.383 80.030 1.00 0.00 H ATOM 5765 N ASP A 381 28.950 58.566 81.825 1.00 48.30 N ATOM 5766 CA ASP A 381 27.578 58.083 81.695 1.00 49.62 C ATOM 5767 C ASP A 381 26.448 58.715 82.509 1.00 50.15 C ATOM 5768 O ASP A 381 25.257 58.441 82.261 1.00 49.85 O ATOM 5769 CB ASP A 381 27.580 56.565 81.881 1.00 51.12 C ATOM 5770 CG ASP A 381 28.030 56.160 83.268 1.00 54.13 C ATOM 5771 OD1 ASP A 381 29.057 56.699 83.768 1.00 56.80 O ATOM 5772 OD2 ASP A 381 27.360 55.298 83.852 1.00 54.37 O ATOM 5773 HA ASP A 381 27.306 58.418 80.694 1.00 0.00 H ATOM 5774 HB2 ASP A 381 26.570 56.189 81.715 1.00 0.00 H ATOM 5775 HB3 ASP A 381 28.256 56.122 81.149 1.00 0.00 H ATOM 5776 H ASP A 381 29.653 57.956 82.290 1.00 0.00 H ATOM 5777 N ASN A 382 26.813 59.545 83.476 1.00 49.84 N ATOM 5778 CA ASN A 382 25.833 60.226 84.296 1.00 49.89 C ATOM 5779 C ASN A 382 25.679 61.667 83.828 1.00 49.32 C ATOM 5780 O ASN A 382 24.991 62.464 84.467 1.00 49.82 O ATOM 5781 CB ASN A 382 26.279 60.221 85.751 1.00 52.20 C ATOM 5782 CG ASN A 382 26.251 58.861 86.321 1.00 53.80 C ATOM 5783 OD1 ASN A 382 25.206 58.211 86.281 1.00 53.72 O ATOM 5784 ND2 ASN A 382 27.397 58.386 86.846 1.00 54.08 N ATOM 5785 HA ASN A 382 24.879 59.707 84.205 1.00 0.00 H ATOM 5786 HB2 ASN A 382 27.296 60.610 85.811 1.00 0.00 H ATOM 5787 HB3 ASN A 382 25.612 60.861 86.328 1.00 0.00 H ATOM 5788 HD22 ASN A 382 28.251 58.980 86.853 1.00 0.00 H ATOM 5789 HD21 ASN A 382 27.428 57.426 87.244 1.00 0.00 H ATOM 5790 H ASN A 382 27.825 59.711 83.649 1.00 0.00 H ATOM 5791 N ASN A 383 26.334 62.014 82.728 1.00 45.88 N ATOM 5792 CA ASN A 383 26.210 63.362 82.236 1.00 44.29 C ATOM 5793 C ASN A 383 24.761 63.552 81.668 1.00 44.01 C ATOM 5794 O ASN A 383 24.375 62.952 80.642 1.00 41.42 O ATOM 5795 CB ASN A 383 27.296 63.576 81.191 1.00 42.48 C ATOM 5796 CG ASN A 383 27.315 64.972 80.657 1.00 43.89 C ATOM 5797 OD1 ASN A 383 28.398 65.517 80.366 1.00 43.20 O ATOM 5798 ND2 ASN A 383 26.127 65.573 80.492 1.00 40.97 N ATOM 5799 HA ASN A 383 26.348 64.108 83.019 1.00 0.00 H ATOM 5800 HB2 ASN A 383 28.264 63.363 81.645 1.00 0.00 H ATOM 5801 HB3 ASN A 383 27.124 62.888 80.363 1.00 0.00 H ATOM 5802 HD22 ASN A 383 25.252 65.074 80.751 1.00 0.00 H ATOM 5803 HD21 ASN A 383 26.081 66.537 80.105 1.00 0.00 H ATOM 5804 H ASN A 383 26.929 61.323 82.228 1.00 0.00 H ATOM 5805 N GLY A 384 23.976 64.357 82.385 1.00 43.17 N ATOM 5806 CA GLY A 384 22.609 64.675 82.024 1.00 43.12 C ATOM 5807 C GLY A 384 22.418 65.299 80.644 1.00 43.88 C ATOM 5808 O GLY A 384 21.432 64.997 79.999 1.00 45.05 O ATOM 5809 HA3 GLY A 384 22.220 65.374 82.765 1.00 0.00 H ATOM 5810 HA2 GLY A 384 22.030 63.752 82.058 1.00 0.00 H ATOM 5811 H GLY A 384 24.366 64.780 83.251 1.00 0.00 H ATOM 5812 N ILE A 385 23.320 66.158 80.189 1.00 42.46 N ATOM 5813 CA ILE A 385 23.192 66.787 78.883 1.00 41.86 C ATOM 5814 C ILE A 385 23.425 65.714 77.783 1.00 42.66 C ATOM 5815 O ILE A 385 22.695 65.642 76.785 1.00 41.24 O ATOM 5816 CB ILE A 385 24.251 67.911 78.696 1.00 41.89 C ATOM 5817 CG1 ILE A 385 24.063 68.987 79.765 1.00 44.61 C ATOM 5818 CG2 ILE A 385 24.161 68.529 77.301 1.00 40.34 C ATOM 5819 CD1 ILE A 385 22.632 69.355 79.974 1.00 47.92 C ATOM 5820 HA ILE A 385 22.195 67.221 78.808 1.00 0.00 H ATOM 5821 HB ILE A 385 25.241 67.468 78.803 1.00 0.00 H ATOM 5822 HG12 ILE A 385 24.468 68.617 80.707 1.00 0.00 H ATOM 5823 HG13 ILE A 385 24.611 69.879 79.461 1.00 0.00 H ATOM 5824 HD11 ILE A 385 22.216 69.737 79.041 1.00 0.00 H ATOM 5825 HD12 ILE A 385 22.074 68.473 80.288 1.00 0.00 H ATOM 5826 HD13 ILE A 385 22.564 70.123 80.745 1.00 0.00 H ATOM 5827 HG21 ILE A 385 24.336 67.757 76.551 1.00 0.00 H ATOM 5828 HG22 ILE A 385 23.169 68.958 77.158 1.00 0.00 H ATOM 5829 HG23 ILE A 385 24.914 69.311 77.202 1.00 0.00 H ATOM 5830 H ILE A 385 24.142 66.389 80.782 1.00 0.00 H ATOM 5831 N LYS A 386 24.464 64.910 77.976 1.00 42.35 N ATOM 5832 CA LYS A 386 24.820 63.850 77.051 1.00 43.00 C ATOM 5833 C LYS A 386 23.741 62.790 76.932 1.00 41.35 C ATOM 5834 O LYS A 386 23.465 62.314 75.842 1.00 41.04 O ATOM 5835 CB LYS A 386 26.139 63.195 77.467 1.00 42.58 C ATOM 5836 CG LYS A 386 27.352 63.996 77.079 1.00 44.99 C ATOM 5837 CD LYS A 386 28.615 63.332 77.620 1.00 46.09 C ATOM 5838 CE LYS A 386 29.893 63.969 77.015 1.00 47.19 C ATOM 5839 NZ LYS A 386 31.195 63.457 77.592 1.00 47.85 N ATOM 5840 HA LYS A 386 24.931 64.317 76.072 1.00 0.00 H ATOM 5841 HB2 LYS A 386 26.138 63.072 78.550 1.00 0.00 H ATOM 5842 HB3 LYS A 386 26.204 62.216 76.992 1.00 0.00 H ATOM 5843 HG2 LYS A 386 27.413 64.055 75.992 1.00 0.00 H ATOM 5844 HG3 LYS A 386 27.268 65.001 77.492 1.00 0.00 H ATOM 5845 HD2 LYS A 386 28.640 63.447 78.704 1.00 0.00 H ATOM 5846 HD3 LYS A 386 28.594 62.272 77.369 1.00 0.00 H ATOM 5847 HE2 LYS A 386 29.848 65.045 77.183 1.00 0.00 H ATOM 5848 HE3 LYS A 386 29.896 63.770 75.943 1.00 0.00 H ATOM 5849 HZ1 LYS A 386 31.219 63.650 78.614 1.00 0.00 H ATOM 5850 HZ2 LYS A 386 31.266 62.432 77.429 1.00 0.00 H ATOM 5851 HZ3 LYS A 386 31.992 63.939 77.128 1.00 0.00 H ATOM 5852 H LYS A 386 25.047 65.046 78.826 1.00 0.00 H ATOM 5853 N ASN A 387 23.144 62.410 78.043 1.00 41.08 N ATOM 5854 CA ASN A 387 22.078 61.426 77.982 1.00 41.37 C ATOM 5855 C ASN A 387 20.860 62.037 77.223 1.00 40.05 C ATOM 5856 O ASN A 387 20.216 61.350 76.434 1.00 39.26 O ATOM 5857 CB ASN A 387 21.650 60.995 79.386 1.00 39.88 C ATOM 5858 CG ASN A 387 22.709 60.152 80.094 1.00 45.76 C ATOM 5859 OD1 ASN A 387 23.552 59.505 79.443 1.00 45.73 O ATOM 5860 ND2 ASN A 387 22.657 60.129 81.444 1.00 43.81 N ATOM 5861 HA ASN A 387 22.443 60.546 77.453 1.00 0.00 H ATOM 5862 HB2 ASN A 387 21.459 61.888 79.982 1.00 0.00 H ATOM 5863 HB3 ASN A 387 20.734 60.410 79.307 1.00 0.00 H ATOM 5864 HD22 ASN A 387 21.936 60.685 81.946 1.00 0.00 H ATOM 5865 HD21 ASN A 387 23.338 59.555 81.981 1.00 0.00 H ATOM 5866 H ASN A 387 23.434 62.812 78.957 1.00 0.00 H ATOM 5867 N ARG A 388 20.557 63.312 77.486 1.00 38.83 N ATOM 5868 CA ARG A 388 19.434 63.996 76.849 1.00 38.67 C ATOM 5869 C ARG A 388 19.697 64.067 75.352 1.00 38.41 C ATOM 5870 O ARG A 388 18.850 63.636 74.538 1.00 36.76 O ATOM 5871 CB ARG A 388 19.262 65.405 77.393 1.00 37.98 C ATOM 5872 CG ARG A 388 18.102 66.189 76.805 1.00 37.10 C ATOM 5873 CD ARG A 388 18.253 67.695 77.149 1.00 36.48 C ATOM 5874 NE ARG A 388 19.325 68.303 76.354 1.00 38.56 N ATOM 5875 CZ ARG A 388 20.016 69.400 76.699 1.00 39.25 C ATOM 5876 NH1 ARG A 388 20.965 69.879 75.888 1.00 37.53 N ATOM 5877 NH2 ARG A 388 19.778 70.018 77.861 1.00 39.11 N ATOM 5878 HA ARG A 388 18.521 63.439 77.058 1.00 0.00 H ATOM 5879 HB2 ARG A 388 19.110 65.335 78.470 1.00 0.00 H ATOM 5880 HB3 ARG A 388 20.179 65.958 77.192 1.00 0.00 H ATOM 5881 HG2 ARG A 388 18.093 66.065 75.722 1.00 0.00 H ATOM 5882 HG3 ARG A 388 17.166 65.815 77.220 1.00 0.00 H ATOM 5883 HD2 ARG A 388 18.490 67.799 78.208 1.00 0.00 H ATOM 5884 HD3 ARG A 388 17.315 68.207 76.936 1.00 0.00 H ATOM 5885 HE ARG A 388 19.569 67.848 75.451 1.00 0.00 H ATOM 5886 HH12 ARG A 388 21.499 70.730 76.158 1.00 0.00 H ATOM 5887 HH11 ARG A 388 21.169 69.401 74.987 1.00 0.00 H ATOM 5888 HH22 ARG A 388 20.320 70.868 78.119 1.00 0.00 H ATOM 5889 HH21 ARG A 388 19.051 69.649 78.507 1.00 0.00 H ATOM 5890 H ARG A 388 21.141 63.836 78.168 1.00 0.00 H ATOM 5891 N ASP A 389 20.867 64.577 74.969 1.00 37.56 N ATOM 5892 CA ASP A 389 21.173 64.648 73.541 1.00 37.30 C ATOM 5893 C ASP A 389 21.271 63.253 72.863 1.00 38.53 C ATOM 5894 O ASP A 389 20.898 63.090 71.675 1.00 36.29 O ATOM 5895 CB ASP A 389 22.476 65.419 73.317 1.00 38.13 C ATOM 5896 CG ASP A 389 22.369 66.901 73.711 1.00 38.82 C ATOM 5897 OD1 ASP A 389 21.234 67.439 73.844 1.00 38.36 O ATOM 5898 OD2 ASP A 389 23.444 67.504 73.883 1.00 39.22 O ATOM 5899 HA ASP A 389 20.338 65.172 73.075 1.00 0.00 H ATOM 5900 HB2 ASP A 389 23.262 64.956 73.914 1.00 0.00 H ATOM 5901 HB3 ASP A 389 22.740 65.358 72.261 1.00 0.00 H ATOM 5902 H ASP A 389 21.551 64.919 75.674 1.00 0.00 H ATOM 5903 N GLY A 390 21.775 62.264 73.607 1.00 37.03 N ATOM 5904 CA GLY A 390 21.910 60.908 73.065 1.00 38.29 C ATOM 5905 C GLY A 390 20.556 60.298 72.685 1.00 38.16 C ATOM 5906 O GLY A 390 20.430 59.621 71.671 1.00 37.63 O ATOM 5907 HA3 GLY A 390 22.382 60.275 73.816 1.00 0.00 H ATOM 5908 HA2 GLY A 390 22.540 60.946 72.176 1.00 0.00 H ATOM 5909 H GLY A 390 22.076 62.458 74.583 1.00 0.00 H ATOM 5910 N LEU A 391 19.550 60.557 73.517 1.00 37.81 N ATOM 5911 CA LEU A 391 18.182 60.100 73.306 1.00 36.61 C ATOM 5912 C LEU A 391 17.594 60.858 72.099 1.00 37.36 C ATOM 5913 O LEU A 391 16.875 60.283 71.253 1.00 34.56 O ATOM 5914 CB LEU A 391 17.383 60.383 74.573 1.00 37.17 C ATOM 5915 CG LEU A 391 16.646 59.225 75.295 1.00 39.95 C ATOM 5916 CD1 LEU A 391 17.329 57.880 75.058 1.00 41.53 C ATOM 5917 CD2 LEU A 391 16.500 59.492 76.786 1.00 37.71 C ATOM 5918 HA LEU A 391 18.146 59.031 73.098 1.00 0.00 H ATOM 5919 HB2 LEU A 391 18.077 60.814 75.294 1.00 0.00 H ATOM 5920 HB3 LEU A 391 16.627 61.123 74.311 1.00 0.00 H ATOM 5921 HG LEU A 391 15.647 59.175 74.861 1.00 0.00 H ATOM 5922 HD21 LEU A 391 17.488 59.601 77.233 1.00 0.00 H ATOM 5923 HD22 LEU A 391 15.929 60.408 76.936 1.00 0.00 H ATOM 5924 HD23 LEU A 391 15.979 58.657 77.254 1.00 0.00 H ATOM 5925 HD11 LEU A 391 17.342 57.664 73.990 1.00 0.00 H ATOM 5926 HD12 LEU A 391 18.351 57.922 75.434 1.00 0.00 H ATOM 5927 HD13 LEU A 391 16.780 57.098 75.582 1.00 0.00 H ATOM 5928 H LEU A 391 19.752 61.119 74.368 1.00 0.00 H ATOM 5929 N ASP A 392 17.929 62.145 71.966 1.00 37.45 N ATOM 5930 CA ASP A 392 17.391 62.876 70.831 1.00 38.32 C ATOM 5931 C ASP A 392 17.930 62.244 69.554 1.00 37.51 C ATOM 5932 O ASP A 392 17.203 62.073 68.573 1.00 38.17 O ATOM 5933 CB ASP A 392 17.720 64.379 70.913 1.00 39.33 C ATOM 5934 CG ASP A 392 17.476 65.115 69.584 1.00 40.02 C ATOM 5935 OD1 ASP A 392 16.354 65.139 69.047 1.00 39.63 O ATOM 5936 OD2 ASP A 392 18.448 65.675 69.065 1.00 44.77 O ATOM 5937 HA ASP A 392 16.303 62.809 70.836 1.00 0.00 H ATOM 5938 HB2 ASP A 392 17.094 64.832 71.682 1.00 0.00 H ATOM 5939 HB3 ASP A 392 18.769 64.492 71.187 1.00 0.00 H ATOM 5940 H ASP A 392 18.556 62.609 72.654 1.00 0.00 H ATOM 5941 N ASP A 393 19.201 61.876 69.556 1.00 36.79 N ATOM 5942 CA ASP A 393 19.777 61.235 68.386 1.00 35.33 C ATOM 5943 C ASP A 393 19.208 59.825 68.167 1.00 34.11 C ATOM 5944 O ASP A 393 19.000 59.399 67.047 1.00 34.02 O ATOM 5945 CB ASP A 393 21.271 61.150 68.537 1.00 36.53 C ATOM 5946 CG ASP A 393 21.938 62.467 68.279 1.00 39.60 C ATOM 5947 OD1 ASP A 393 21.503 63.222 67.362 1.00 38.50 O ATOM 5948 OD2 ASP A 393 22.920 62.730 68.981 1.00 39.44 O ATOM 5949 HA ASP A 393 19.519 61.842 67.518 1.00 0.00 H ATOM 5950 HB2 ASP A 393 21.505 60.830 69.552 1.00 0.00 H ATOM 5951 HB3 ASP A 393 21.655 60.416 67.829 1.00 0.00 H ATOM 5952 H ASP A 393 19.789 62.046 70.397 1.00 0.00 H ATOM 5953 N ILE A 394 18.970 59.087 69.243 1.00 33.10 N ATOM 5954 CA ILE A 394 18.413 57.738 69.077 1.00 31.63 C ATOM 5955 C ILE A 394 17.047 57.861 68.382 1.00 32.17 C ATOM 5956 O ILE A 394 16.781 57.204 67.366 1.00 31.82 O ATOM 5957 CB ILE A 394 18.234 57.042 70.446 1.00 30.87 C ATOM 5958 CG1 ILE A 394 19.618 56.578 70.972 1.00 28.84 C ATOM 5959 CG2 ILE A 394 17.216 55.796 70.335 1.00 30.59 C ATOM 5960 CD1 ILE A 394 19.526 56.141 72.424 1.00 30.02 C ATOM 5961 HA ILE A 394 19.098 57.137 68.478 1.00 0.00 H ATOM 5962 HB ILE A 394 17.803 57.753 71.150 1.00 0.00 H ATOM 5963 HG12 ILE A 394 19.967 55.741 70.368 1.00 0.00 H ATOM 5964 HG13 ILE A 394 20.326 57.403 70.891 1.00 0.00 H ATOM 5965 HD11 ILE A 394 19.181 56.977 73.033 1.00 0.00 H ATOM 5966 HD12 ILE A 394 18.822 55.313 72.509 1.00 0.00 H ATOM 5967 HD13 ILE A 394 20.509 55.821 72.769 1.00 0.00 H ATOM 5968 HG21 ILE A 394 16.244 56.152 69.994 1.00 0.00 H ATOM 5969 HG22 ILE A 394 17.608 55.070 69.623 1.00 0.00 H ATOM 5970 HG23 ILE A 394 17.110 55.327 71.313 1.00 0.00 H ATOM 5971 H ILE A 394 19.175 59.459 70.192 1.00 0.00 H ATOM 5972 N VAL A 395 16.201 58.730 68.911 1.00 30.94 N ATOM 5973 CA VAL A 395 14.867 58.872 68.361 1.00 33.03 C ATOM 5974 C VAL A 395 14.903 59.371 66.922 1.00 33.25 C ATOM 5975 O VAL A 395 14.283 58.754 66.035 1.00 33.95 O ATOM 5976 CB VAL A 395 13.995 59.803 69.259 1.00 32.20 C ATOM 5977 CG1 VAL A 395 12.606 60.009 68.620 1.00 31.60 C ATOM 5978 CG2 VAL A 395 13.843 59.193 70.632 1.00 30.60 C ATOM 5979 HA VAL A 395 14.407 57.884 68.349 1.00 0.00 H ATOM 5980 HB VAL A 395 14.488 60.771 69.349 1.00 0.00 H ATOM 5981 HG11 VAL A 395 12.724 60.467 67.638 1.00 0.00 H ATOM 5982 HG12 VAL A 395 12.109 59.045 68.516 1.00 0.00 H ATOM 5983 HG13 VAL A 395 12.008 60.661 69.257 1.00 0.00 H ATOM 5984 HG21 VAL A 395 13.360 58.220 70.544 1.00 0.00 H ATOM 5985 HG22 VAL A 395 14.827 59.072 71.085 1.00 0.00 H ATOM 5986 HG23 VAL A 395 13.233 59.848 71.254 1.00 0.00 H ATOM 5987 H VAL A 395 16.493 59.312 69.722 1.00 0.00 H ATOM 5988 N GLY A 396 15.630 60.480 66.712 1.00 33.41 N ATOM 5989 CA GLY A 396 15.784 61.047 65.386 1.00 31.68 C ATOM 5990 C GLY A 396 16.424 60.103 64.355 1.00 32.66 C ATOM 5991 O GLY A 396 15.929 59.977 63.211 1.00 31.35 O ATOM 5992 HA3 GLY A 396 16.409 61.936 65.467 1.00 0.00 H ATOM 5993 HA2 GLY A 396 14.797 61.330 65.021 1.00 0.00 H ATOM 5994 H GLY A 396 16.094 60.943 67.519 1.00 0.00 H ATOM 5995 N ASP A 397 17.546 59.462 64.716 1.00 31.88 N ATOM 5996 CA ASP A 397 18.223 58.542 63.808 1.00 31.79 C ATOM 5997 C ASP A 397 17.317 57.333 63.480 1.00 31.56 C ATOM 5998 O ASP A 397 17.161 56.968 62.329 1.00 28.55 O ATOM 5999 CB ASP A 397 19.535 57.980 64.403 1.00 32.29 C ATOM 6000 CG ASP A 397 20.629 59.052 64.594 1.00 34.41 C ATOM 6001 OD1 ASP A 397 20.536 60.123 63.989 1.00 32.46 O ATOM 6002 OD2 ASP A 397 21.599 58.802 65.347 1.00 34.31 O ATOM 6003 HA ASP A 397 18.450 59.122 62.913 1.00 0.00 H ATOM 6004 HB2 ASP A 397 19.313 57.536 65.373 1.00 0.00 H ATOM 6005 HB3 ASP A 397 19.918 57.211 63.732 1.00 0.00 H ATOM 6006 H ASP A 397 17.942 59.624 65.664 1.00 0.00 H ATOM 6007 N HIS A 398 16.745 56.705 64.498 1.00 31.18 N ATOM 6008 CA HIS A 398 15.910 55.524 64.230 1.00 31.60 C ATOM 6009 C HIS A 398 14.619 55.832 63.429 1.00 31.37 C ATOM 6010 O HIS A 398 14.264 55.094 62.505 1.00 31.52 O ATOM 6011 CB HIS A 398 15.534 54.844 65.546 1.00 30.28 C ATOM 6012 CG HIS A 398 14.472 53.800 65.396 1.00 31.98 C ATOM 6013 ND1 HIS A 398 14.580 52.744 64.513 1.00 31.74 N ATOM 6014 CD2 HIS A 398 13.297 53.624 66.046 1.00 33.02 C ATOM 6015 CE1 HIS A 398 13.526 51.958 64.624 1.00 30.14 C ATOM 6016 NE2 HIS A 398 12.731 52.469 65.550 1.00 34.32 N ATOM 6017 HA HIS A 398 16.515 54.865 63.607 1.00 0.00 H ATOM 6018 HB2 HIS A 398 16.426 54.372 65.958 1.00 0.00 H ATOM 6019 HB3 HIS A 398 15.174 55.606 66.238 1.00 0.00 H ATOM 6020 HD2 HIS A 398 12.878 54.273 66.815 1.00 0.00 H ATOM 6021 HE1 HIS A 398 13.342 51.048 64.053 1.00 0.00 H ATOM 6022 H HIS A 398 16.885 57.042 65.472 1.00 0.00 H ATOM 6023 N ASN A 399 13.965 56.940 63.743 1.00 30.90 N ATOM 6024 CA ASN A 399 12.704 57.260 63.112 1.00 31.18 C ATOM 6025 C ASN A 399 12.648 58.119 61.882 1.00 32.57 C ATOM 6026 O ASN A 399 11.704 58.026 61.089 1.00 33.82 O ATOM 6027 CB ASN A 399 11.794 57.870 64.161 1.00 31.66 C ATOM 6028 CG ASN A 399 11.360 56.842 65.217 1.00 33.31 C ATOM 6029 OD1 ASN A 399 10.607 55.891 64.904 1.00 32.66 O ATOM 6030 ND2 ASN A 399 11.830 57.025 66.474 1.00 30.80 N ATOM 6031 HA ASN A 399 12.402 56.291 62.715 1.00 0.00 H ATOM 6032 HB2 ASN A 399 12.325 58.682 64.658 1.00 0.00 H ATOM 6033 HB3 ASN A 399 10.905 58.266 63.669 1.00 0.00 H ATOM 6034 HD22 ASN A 399 12.453 57.831 66.684 1.00 0.00 H ATOM 6035 HD21 ASN A 399 11.568 56.360 67.229 1.00 0.00 H ATOM 6036 H ASN A 399 14.363 57.588 64.452 1.00 0.00 H ATOM 6037 N VAL A 400 13.644 58.972 61.720 1.00 32.59 N ATOM 6038 CA VAL A 400 13.641 59.896 60.618 1.00 31.29 C ATOM 6039 C VAL A 400 14.900 59.834 59.762 1.00 32.11 C ATOM 6040 O VAL A 400 14.868 59.463 58.567 1.00 32.58 O ATOM 6041 CB VAL A 400 13.537 61.328 61.141 1.00 30.36 C ATOM 6042 CG1 VAL A 400 13.712 62.287 59.975 1.00 28.67 C ATOM 6043 CG2 VAL A 400 12.128 61.532 61.927 1.00 27.30 C ATOM 6044 HA VAL A 400 12.787 59.611 60.004 1.00 0.00 H ATOM 6045 HB VAL A 400 14.326 61.537 61.864 1.00 0.00 H ATOM 6046 HG11 VAL A 400 14.690 62.129 59.520 1.00 0.00 H ATOM 6047 HG12 VAL A 400 12.932 62.105 59.236 1.00 0.00 H ATOM 6048 HG13 VAL A 400 13.640 63.313 60.336 1.00 0.00 H ATOM 6049 HG21 VAL A 400 11.301 61.338 61.244 1.00 0.00 H ATOM 6050 HG22 VAL A 400 12.078 60.838 62.766 1.00 0.00 H ATOM 6051 HG23 VAL A 400 12.064 62.556 62.296 1.00 0.00 H ATOM 6052 H VAL A 400 14.436 58.975 62.394 1.00 0.00 H ATOM 6053 N ILE A 401 16.030 60.147 60.382 1.00 32.76 N ATOM 6054 CA ILE A 401 17.281 60.211 59.616 1.00 32.53 C ATOM 6055 C ILE A 401 17.779 58.941 58.921 1.00 32.82 C ATOM 6056 O ILE A 401 17.962 58.944 57.672 1.00 33.15 O ATOM 6057 CB ILE A 401 18.398 60.825 60.460 1.00 31.58 C ATOM 6058 CG1 ILE A 401 17.906 62.195 60.944 1.00 32.72 C ATOM 6059 CG2 ILE A 401 19.685 61.004 59.620 1.00 32.23 C ATOM 6060 CD1 ILE A 401 18.855 62.926 61.858 1.00 31.73 C ATOM 6061 HA ILE A 401 17.005 60.849 58.777 1.00 0.00 H ATOM 6062 HB ILE A 401 18.635 60.171 61.299 1.00 0.00 H ATOM 6063 HG12 ILE A 401 17.730 62.820 60.069 1.00 0.00 H ATOM 6064 HG13 ILE A 401 16.967 62.048 61.478 1.00 0.00 H ATOM 6065 HD11 ILE A 401 19.034 62.325 62.750 1.00 0.00 H ATOM 6066 HD12 ILE A 401 19.798 63.098 61.339 1.00 0.00 H ATOM 6067 HD13 ILE A 401 18.417 63.882 62.145 1.00 0.00 H ATOM 6068 HG21 ILE A 401 20.015 60.033 59.252 1.00 0.00 H ATOM 6069 HG22 ILE A 401 19.478 61.663 58.776 1.00 0.00 H ATOM 6070 HG23 ILE A 401 20.465 61.442 60.242 1.00 0.00 H ATOM 6071 H ILE A 401 16.030 60.346 61.403 1.00 0.00 H ATOM 6072 N CYS A 402 18.003 57.868 59.672 1.00 32.15 N ATOM 6073 CA CYS A 402 18.512 56.659 59.007 1.00 30.94 C ATOM 6074 C CYS A 402 17.523 56.071 58.023 1.00 31.11 C ATOM 6075 O CYS A 402 17.934 55.546 57.011 1.00 31.03 O ATOM 6076 CB CYS A 402 19.006 55.667 60.054 1.00 31.63 C ATOM 6077 SG CYS A 402 20.418 56.403 60.959 1.00 34.07 S ATOM 6078 HA CYS A 402 19.366 56.934 58.388 1.00 0.00 H ATOM 6079 HB2 CYS A 402 19.326 54.748 59.564 1.00 0.00 H ATOM 6080 HB3 CYS A 402 18.201 55.443 60.754 1.00 0.00 H ATOM 6081 H CYS A 402 17.824 57.883 60.696 1.00 0.00 H ATOM 6082 N PRO A 403 16.191 56.122 58.305 1.00 31.79 N ATOM 6083 CA PRO A 403 15.290 55.564 57.260 1.00 32.86 C ATOM 6084 C PRO A 403 15.422 56.463 55.999 1.00 32.14 C ATOM 6085 O PRO A 403 15.379 55.978 54.853 1.00 32.12 O ATOM 6086 CB PRO A 403 13.862 55.723 57.841 1.00 30.95 C ATOM 6087 CG PRO A 403 14.103 55.674 59.352 1.00 32.63 C ATOM 6088 CD PRO A 403 15.479 56.384 59.571 1.00 30.42 C ATOM 6089 HA PRO A 403 15.516 54.530 57.000 1.00 0.00 H ATOM 6090 HD3 PRO A 403 15.347 57.454 59.733 1.00 0.00 H ATOM 6091 HD2 PRO A 403 16.013 55.953 60.418 1.00 0.00 H ATOM 6092 HG3 PRO A 403 14.146 54.642 59.699 1.00 0.00 H ATOM 6093 HG2 PRO A 403 13.311 56.202 59.883 1.00 0.00 H ATOM 6094 HB2 PRO A 403 13.421 56.674 57.544 1.00 0.00 H ATOM 6095 HB3 PRO A 403 13.214 54.907 57.520 1.00 0.00 H ATOM 6096 N LEU A 404 15.565 57.777 56.194 1.00 32.47 N ATOM 6097 CA LEU A 404 15.676 58.606 55.009 1.00 31.83 C ATOM 6098 C LEU A 404 17.005 58.346 54.262 1.00 32.22 C ATOM 6099 O LEU A 404 17.042 58.379 53.017 1.00 32.47 O ATOM 6100 CB LEU A 404 15.534 60.089 55.349 1.00 30.28 C ATOM 6101 CG LEU A 404 15.613 61.062 54.147 1.00 31.93 C ATOM 6102 CD1 LEU A 404 14.678 62.289 54.320 1.00 29.88 C ATOM 6103 CD2 LEU A 404 17.071 61.535 53.984 1.00 31.12 C ATOM 6104 HA LEU A 404 14.855 58.331 54.347 1.00 0.00 H ATOM 6105 HB2 LEU A 404 14.568 60.231 55.833 1.00 0.00 H ATOM 6106 HB3 LEU A 404 16.330 60.351 56.046 1.00 0.00 H ATOM 6107 HG LEU A 404 15.280 60.528 53.257 1.00 0.00 H ATOM 6108 HD21 LEU A 404 17.390 62.044 54.893 1.00 0.00 H ATOM 6109 HD22 LEU A 404 17.713 60.673 53.804 1.00 0.00 H ATOM 6110 HD23 LEU A 404 17.137 62.221 53.140 1.00 0.00 H ATOM 6111 HD11 LEU A 404 13.647 61.948 54.412 1.00 0.00 H ATOM 6112 HD12 LEU A 404 14.962 62.837 55.218 1.00 0.00 H ATOM 6113 HD13 LEU A 404 14.771 62.940 53.451 1.00 0.00 H ATOM 6114 H LEU A 404 15.595 58.186 57.150 1.00 0.00 H ATOM 6115 N MET A 405 18.085 58.109 54.999 1.00 31.16 N ATOM 6116 CA MET A 405 19.367 57.827 54.340 1.00 31.90 C ATOM 6117 C MET A 405 19.244 56.491 53.633 1.00 31.45 C ATOM 6118 O MET A 405 19.758 56.317 52.546 1.00 31.03 O ATOM 6119 CB MET A 405 20.549 57.816 55.343 1.00 31.91 C ATOM 6120 CG MET A 405 20.879 59.232 55.865 1.00 32.28 C ATOM 6121 SD MET A 405 21.012 60.490 54.540 1.00 37.23 S ATOM 6122 CE MET A 405 22.442 59.783 53.641 1.00 36.72 C ATOM 6123 HA MET A 405 19.585 58.619 53.624 1.00 0.00 H ATOM 6124 HB2 MET A 405 20.287 57.181 56.189 1.00 0.00 H ATOM 6125 HB3 MET A 405 21.430 57.410 54.845 1.00 0.00 H ATOM 6126 HG2 MET A 405 21.829 59.190 56.398 1.00 0.00 H ATOM 6127 HG3 MET A 405 20.091 59.538 56.553 1.00 0.00 H ATOM 6128 HE1 MET A 405 23.301 59.733 54.310 1.00 0.00 H ATOM 6129 HE2 MET A 405 22.192 58.781 53.294 1.00 0.00 H ATOM 6130 HE3 MET A 405 22.681 60.416 52.786 1.00 0.00 H ATOM 6131 H MET A 405 18.023 58.123 56.037 1.00 0.00 H ATOM 6132 N HIS A 406 18.512 55.548 54.204 1.00 31.58 N ATOM 6133 CA HIS A 406 18.368 54.282 53.485 1.00 32.10 C ATOM 6134 C HIS A 406 17.552 54.524 52.185 1.00 33.34 C ATOM 6135 O HIS A 406 17.875 54.002 51.114 1.00 33.13 O ATOM 6136 CB HIS A 406 17.661 53.245 54.384 1.00 32.23 C ATOM 6137 CG HIS A 406 17.523 51.896 53.748 1.00 36.56 C ATOM 6138 ND1 HIS A 406 18.610 51.078 53.489 1.00 37.77 N ATOM 6139 CD2 HIS A 406 16.424 51.210 53.335 1.00 35.71 C ATOM 6140 CE1 HIS A 406 18.184 49.946 52.950 1.00 36.97 C ATOM 6141 NE2 HIS A 406 16.863 50.000 52.850 1.00 36.91 N ATOM 6142 HA HIS A 406 19.352 53.894 53.221 1.00 0.00 H ATOM 6143 HB2 HIS A 406 18.237 53.136 55.303 1.00 0.00 H ATOM 6144 HB3 HIS A 406 16.665 53.617 54.623 1.00 0.00 H ATOM 6145 HD2 HIS A 406 15.391 51.554 53.380 1.00 0.00 H ATOM 6146 HE1 HIS A 406 18.813 49.111 52.641 1.00 0.00 H ATOM 6147 H HIS A 406 18.057 55.701 55.127 1.00 0.00 H ATOM 6148 N PHE A 407 16.491 55.319 52.268 1.00 32.93 N ATOM 6149 CA PHE A 407 15.699 55.583 51.073 1.00 32.52 C ATOM 6150 C PHE A 407 16.557 56.312 49.993 1.00 32.99 C ATOM 6151 O PHE A 407 16.528 55.922 48.798 1.00 31.70 O ATOM 6152 CB PHE A 407 14.486 56.450 51.441 1.00 31.18 C ATOM 6153 CG PHE A 407 13.688 56.908 50.266 1.00 30.43 C ATOM 6154 CD1 PHE A 407 12.839 56.038 49.602 1.00 30.96 C ATOM 6155 CD2 PHE A 407 13.811 58.219 49.794 1.00 31.93 C ATOM 6156 CE1 PHE A 407 12.105 56.473 48.458 1.00 31.44 C ATOM 6157 CE2 PHE A 407 13.087 58.667 48.648 1.00 28.48 C ATOM 6158 CZ PHE A 407 12.243 57.797 47.995 1.00 31.66 C ATOM 6159 HA PHE A 407 15.360 54.632 50.663 1.00 0.00 H ATOM 6160 HB2 PHE A 407 13.834 55.869 52.093 1.00 0.00 H ATOM 6161 HB3 PHE A 407 14.843 57.329 51.977 1.00 0.00 H ATOM 6162 HD2 PHE A 407 14.473 58.913 50.312 1.00 0.00 H ATOM 6163 HE2 PHE A 407 13.202 59.691 48.292 1.00 0.00 H ATOM 6164 HZ PHE A 407 11.683 58.131 47.122 1.00 0.00 H ATOM 6165 HE1 PHE A 407 11.438 55.782 47.943 1.00 0.00 H ATOM 6166 HD1 PHE A 407 12.731 55.013 49.956 1.00 0.00 H ATOM 6167 H PHE A 407 16.228 55.749 53.177 1.00 0.00 H ATOM 6168 N VAL A 408 17.324 57.340 50.395 1.00 33.53 N ATOM 6169 CA VAL A 408 18.076 58.075 49.400 1.00 35.90 C ATOM 6170 C VAL A 408 19.135 57.218 48.725 1.00 36.57 C ATOM 6171 O VAL A 408 19.332 57.320 47.510 1.00 35.57 O ATOM 6172 CB VAL A 408 18.720 59.404 49.941 1.00 38.46 C ATOM 6173 CG1 VAL A 408 19.755 59.143 50.902 1.00 38.78 C ATOM 6174 CG2 VAL A 408 19.387 60.179 48.781 1.00 40.15 C ATOM 6175 HA VAL A 408 17.333 58.362 48.656 1.00 0.00 H ATOM 6176 HB VAL A 408 17.914 59.975 50.402 1.00 0.00 H ATOM 6177 HG11 VAL A 408 19.335 58.597 51.747 1.00 0.00 H ATOM 6178 HG12 VAL A 408 20.540 58.547 50.436 1.00 0.00 H ATOM 6179 HG13 VAL A 408 20.173 60.088 51.250 1.00 0.00 H ATOM 6180 HG21 VAL A 408 20.164 59.560 48.332 1.00 0.00 H ATOM 6181 HG22 VAL A 408 18.636 60.424 48.030 1.00 0.00 H ATOM 6182 HG23 VAL A 408 19.830 61.097 49.167 1.00 0.00 H ATOM 6183 H VAL A 408 17.376 57.602 51.400 1.00 0.00 H ATOM 6184 N ASN A 409 19.784 56.337 49.485 1.00 38.89 N ATOM 6185 CA ASN A 409 20.779 55.486 48.855 1.00 39.33 C ATOM 6186 C ASN A 409 20.131 54.470 47.931 1.00 38.91 C ATOM 6187 O ASN A 409 20.643 54.229 46.848 1.00 38.83 O ATOM 6188 CB ASN A 409 21.685 54.847 49.909 1.00 41.16 C ATOM 6189 CG ASN A 409 22.796 55.814 50.332 1.00 43.07 C ATOM 6190 OD1 ASN A 409 23.694 56.126 49.527 1.00 45.45 O ATOM 6191 ND2 ASN A 409 22.729 56.314 51.561 1.00 43.70 N ATOM 6192 HA ASN A 409 21.418 56.102 48.223 1.00 0.00 H ATOM 6193 HB2 ASN A 409 21.088 54.585 50.782 1.00 0.00 H ATOM 6194 HB3 ASN A 409 22.135 53.945 49.494 1.00 0.00 H ATOM 6195 HD22 ASN A 409 21.961 56.024 52.199 1.00 0.00 H ATOM 6196 HD21 ASN A 409 23.445 56.995 51.885 1.00 0.00 H ATOM 6197 H ASN A 409 19.584 56.260 50.503 1.00 0.00 H ATOM 6198 N LYS A 410 18.999 53.891 48.310 1.00 37.39 N ATOM 6199 CA LYS A 410 18.336 52.945 47.400 1.00 38.56 C ATOM 6200 C LYS A 410 17.803 53.678 46.138 1.00 38.90 C ATOM 6201 O LYS A 410 17.952 53.218 44.984 1.00 36.96 O ATOM 6202 CB LYS A 410 17.162 52.270 48.112 1.00 39.06 C ATOM 6203 CG LYS A 410 17.615 51.263 49.158 1.00 42.23 C ATOM 6204 CD LYS A 410 18.397 50.137 48.481 1.00 44.38 C ATOM 6205 CE LYS A 410 18.744 49.057 49.452 1.00 47.08 C ATOM 6206 NZ LYS A 410 19.345 47.882 48.760 1.00 48.44 N ATOM 6207 HA LYS A 410 19.069 52.197 47.098 1.00 0.00 H ATOM 6208 HB2 LYS A 410 16.562 53.037 48.602 1.00 0.00 H ATOM 6209 HB3 LYS A 410 16.553 51.753 47.370 1.00 0.00 H ATOM 6210 HG2 LYS A 410 18.253 51.760 49.888 1.00 0.00 H ATOM 6211 HG3 LYS A 410 16.743 50.847 49.663 1.00 0.00 H ATOM 6212 HD2 LYS A 410 17.790 49.714 47.681 1.00 0.00 H ATOM 6213 HD3 LYS A 410 19.316 50.546 48.061 1.00 0.00 H ATOM 6214 HE2 LYS A 410 17.839 48.740 49.970 1.00 0.00 H ATOM 6215 HE3 LYS A 410 19.459 49.447 50.177 1.00 0.00 H ATOM 6216 HZ1 LYS A 410 18.665 47.503 48.070 1.00 0.00 H ATOM 6217 HZ2 LYS A 410 20.212 48.177 48.268 1.00 0.00 H ATOM 6218 HZ3 LYS A 410 19.575 47.149 49.461 1.00 0.00 H ATOM 6219 H LYS A 410 18.585 54.104 49.240 1.00 0.00 H ATOM 6220 N TYR A 411 17.212 54.844 46.376 1.00 38.25 N ATOM 6221 CA TYR A 411 16.623 55.635 45.305 1.00 37.34 C ATOM 6222 C TYR A 411 17.620 56.107 44.276 1.00 37.60 C ATOM 6223 O TYR A 411 17.385 55.983 43.080 1.00 36.05 O ATOM 6224 CB TYR A 411 15.893 56.873 45.858 1.00 35.96 C ATOM 6225 CG TYR A 411 15.070 57.544 44.782 1.00 34.96 C ATOM 6226 CD1 TYR A 411 13.767 57.111 44.520 1.00 33.23 C ATOM 6227 CD2 TYR A 411 15.633 58.545 43.953 1.00 33.59 C ATOM 6228 CE1 TYR A 411 13.021 57.628 43.462 1.00 31.81 C ATOM 6229 CE2 TYR A 411 14.899 59.083 42.876 1.00 33.50 C ATOM 6230 CZ TYR A 411 13.587 58.604 42.637 1.00 32.46 C ATOM 6231 OH TYR A 411 12.870 59.013 41.542 1.00 33.98 O ATOM 6232 HA TYR A 411 15.923 54.957 44.817 1.00 0.00 H ATOM 6233 HB3 TYR A 411 16.630 57.581 46.237 1.00 0.00 H ATOM 6234 HB2 TYR A 411 15.235 56.565 46.670 1.00 0.00 H ATOM 6235 HD2 TYR A 411 16.644 58.903 44.150 1.00 0.00 H ATOM 6236 HE2 TYR A 411 15.333 59.853 42.239 1.00 0.00 H ATOM 6237 HE1 TYR A 411 12.006 57.275 43.280 1.00 0.00 H ATOM 6238 HD1 TYR A 411 13.322 56.349 45.160 1.00 0.00 H ATOM 6239 HH TYR A 411 11.983 58.573 41.547 1.00 0.00 H ATOM 6240 H TYR A 411 17.169 55.201 47.352 1.00 0.00 H ATOM 6241 N THR A 412 18.724 56.655 44.768 1.00 39.16 N ATOM 6242 CA THR A 412 19.764 57.204 43.928 1.00 39.18 C ATOM 6243 C THR A 412 20.319 56.214 42.931 1.00 40.89 C ATOM 6244 O THR A 412 20.734 56.583 41.858 1.00 41.73 O ATOM 6245 CB THR A 412 20.872 57.796 44.805 1.00 38.35 C ATOM 6246 OG1 THR A 412 20.311 58.870 45.558 1.00 40.55 O ATOM 6247 CG2 THR A 412 22.009 58.365 43.977 1.00 38.14 C ATOM 6248 HA THR A 412 19.313 57.994 43.327 1.00 0.00 H ATOM 6249 HB THR A 412 21.266 57.001 45.438 1.00 0.00 H ATOM 6250 HG1 THR A 412 19.574 58.526 46.123 1.00 0.00 H ATOM 6251 HG23 THR A 412 22.462 57.568 43.387 1.00 0.00 H ATOM 6252 HG21 THR A 412 21.621 59.136 43.311 1.00 0.00 H ATOM 6253 HG22 THR A 412 22.758 58.798 44.640 1.00 0.00 H ATOM 6254 H THR A 412 18.846 56.691 45.800 1.00 0.00 H ATOM 6255 N LYS A 413 20.328 54.949 43.277 1.00 42.06 N ATOM 6256 CA LYS A 413 20.818 53.989 42.329 1.00 43.06 C ATOM 6257 C LYS A 413 19.983 53.977 41.028 1.00 43.30 C ATOM 6258 O LYS A 413 20.521 53.712 39.952 1.00 42.71 O ATOM 6259 CB LYS A 413 20.805 52.592 42.952 1.00 43.80 C ATOM 6260 CG LYS A 413 21.133 51.490 41.926 1.00 45.89 C ATOM 6261 HA LYS A 413 21.837 54.278 42.070 1.00 0.00 H ATOM 6262 HB2 LYS A 413 21.545 52.558 43.752 1.00 0.00 H ATOM 6263 HB3 LYS A 413 19.815 52.402 43.366 1.00 0.00 H ATOM 6264 HG2 LYS A 413 20.394 51.510 41.125 1.00 0.00 H ATOM 6265 HG3 LYS A 413 22.125 51.666 41.511 1.00 0.00 H ATOM 6266 H LYS A 413 19.989 54.649 44.213 1.00 0.00 H ATOM 6267 N PHE A 414 18.678 54.242 41.115 1.00 40.89 N ATOM 6268 CA PHE A 414 17.844 54.206 39.920 1.00 39.77 C ATOM 6269 C PHE A 414 17.312 55.560 39.458 1.00 38.81 C ATOM 6270 O PHE A 414 16.831 55.681 38.336 1.00 37.60 O ATOM 6271 CB PHE A 414 16.628 53.310 40.157 1.00 40.77 C ATOM 6272 CG PHE A 414 16.960 51.870 40.376 1.00 42.85 C ATOM 6273 CD1 PHE A 414 17.028 50.988 39.305 1.00 44.47 C ATOM 6274 CD2 PHE A 414 17.158 51.383 41.655 1.00 43.09 C ATOM 6275 CE1 PHE A 414 17.291 49.617 39.526 1.00 45.19 C ATOM 6276 CE2 PHE A 414 17.417 50.036 41.895 1.00 46.05 C ATOM 6277 CZ PHE A 414 17.484 49.149 40.830 1.00 45.04 C ATOM 6278 HA PHE A 414 18.507 53.829 39.141 1.00 0.00 H ATOM 6279 HB2 PHE A 414 16.100 53.677 41.037 1.00 0.00 H ATOM 6280 HB3 PHE A 414 15.976 53.382 39.287 1.00 0.00 H ATOM 6281 HD2 PHE A 414 17.110 52.072 42.498 1.00 0.00 H ATOM 6282 HE2 PHE A 414 17.566 49.680 42.914 1.00 0.00 H ATOM 6283 HZ PHE A 414 17.686 48.093 41.009 1.00 0.00 H ATOM 6284 HE1 PHE A 414 17.343 48.927 38.684 1.00 0.00 H ATOM 6285 HD1 PHE A 414 16.878 51.355 38.290 1.00 0.00 H ATOM 6286 H PHE A 414 18.256 54.474 42.036 1.00 0.00 H ATOM 6287 N GLY A 415 17.414 56.570 40.316 1.00 38.51 N ATOM 6288 CA GLY A 415 16.845 57.872 40.008 1.00 39.50 C ATOM 6289 C GLY A 415 17.531 58.738 38.988 1.00 39.79 C ATOM 6290 O GLY A 415 18.518 58.359 38.390 1.00 39.69 O ATOM 6291 HA3 GLY A 415 16.814 58.437 40.940 1.00 0.00 H ATOM 6292 HA2 GLY A 415 15.828 57.702 39.653 1.00 0.00 H ATOM 6293 H GLY A 415 17.908 56.427 41.220 1.00 0.00 H ATOM 6294 N ASN A 416 16.996 59.934 38.801 1.00 41.23 N ATOM 6295 CA ASN A 416 17.565 60.822 37.822 1.00 41.17 C ATOM 6296 C ASN A 416 18.152 62.098 38.409 1.00 40.63 C ATOM 6297 O ASN A 416 18.351 63.065 37.690 1.00 40.69 O ATOM 6298 CB ASN A 416 16.497 61.136 36.745 1.00 43.28 C ATOM 6299 CG ASN A 416 17.074 61.932 35.581 1.00 45.48 C ATOM 6300 OD1 ASN A 416 16.688 63.109 35.380 1.00 45.41 O ATOM 6301 ND2 ASN A 416 18.012 61.329 34.843 1.00 45.99 N ATOM 6302 HA ASN A 416 18.414 60.307 37.372 1.00 0.00 H ATOM 6303 HB2 ASN A 416 16.095 60.197 36.364 1.00 0.00 H ATOM 6304 HB3 ASN A 416 15.695 61.714 37.203 1.00 0.00 H ATOM 6305 HD22 ASN A 416 18.292 60.350 35.056 1.00 0.00 H ATOM 6306 HD21 ASN A 416 18.461 61.839 34.056 1.00 0.00 H ATOM 6307 H ASN A 416 16.169 60.230 39.358 1.00 0.00 H ATOM 6308 N GLY A 417 18.444 62.089 39.714 1.00 39.41 N ATOM 6309 CA GLY A 417 19.025 63.263 40.368 1.00 38.18 C ATOM 6310 C GLY A 417 18.499 63.446 41.793 1.00 36.82 C ATOM 6311 O GLY A 417 17.291 63.524 42.007 1.00 35.70 O ATOM 6312 HA3 GLY A 417 18.777 64.150 39.785 1.00 0.00 H ATOM 6313 HA2 GLY A 417 20.108 63.145 40.405 1.00 0.00 H ATOM 6314 H GLY A 417 18.255 61.233 40.274 1.00 0.00 H ATOM 6315 N THR A 418 19.427 63.497 42.746 1.00 36.53 N ATOM 6316 CA THR A 418 19.137 63.619 44.164 1.00 35.63 C ATOM 6317 C THR A 418 19.885 64.791 44.780 1.00 37.04 C ATOM 6318 O THR A 418 21.081 64.988 44.502 1.00 36.85 O ATOM 6319 CB THR A 418 19.593 62.351 44.926 1.00 36.89 C ATOM 6320 OG1 THR A 418 19.011 61.181 44.332 1.00 36.56 O ATOM 6321 CG2 THR A 418 19.185 62.433 46.427 1.00 34.91 C ATOM 6322 HA THR A 418 18.060 63.764 44.250 1.00 0.00 H ATOM 6323 HB THR A 418 20.679 62.287 44.861 1.00 0.00 H ATOM 6324 HG1 THR A 418 19.310 60.378 44.827 1.00 0.00 H ATOM 6325 HG23 THR A 418 19.629 63.322 46.875 1.00 0.00 H ATOM 6326 HG21 THR A 418 18.099 62.489 46.505 1.00 0.00 H ATOM 6327 HG22 THR A 418 19.543 61.545 46.948 1.00 0.00 H ATOM 6328 H THR A 418 20.425 63.446 42.456 1.00 0.00 H ATOM 6329 N TYR A 419 19.176 65.561 45.615 1.00 35.91 N ATOM 6330 CA TYR A 419 19.748 66.688 46.346 1.00 35.39 C ATOM 6331 C TYR A 419 19.371 66.525 47.803 1.00 34.69 C ATOM 6332 O TYR A 419 18.184 66.517 48.158 1.00 34.51 O ATOM 6333 CB TYR A 419 19.238 68.039 45.806 1.00 36.55 C ATOM 6334 CG TYR A 419 19.709 68.282 44.388 1.00 37.78 C ATOM 6335 CD1 TYR A 419 18.930 67.859 43.294 1.00 37.13 C ATOM 6336 CD2 TYR A 419 20.945 68.874 44.132 1.00 36.96 C ATOM 6337 CE1 TYR A 419 19.352 68.005 42.016 1.00 37.43 C ATOM 6338 CE2 TYR A 419 21.381 69.042 42.806 1.00 38.98 C ATOM 6339 CZ TYR A 419 20.575 68.597 41.769 1.00 39.37 C ATOM 6340 OH TYR A 419 20.976 68.704 40.449 1.00 41.60 O ATOM 6341 HA TYR A 419 20.831 66.692 46.222 1.00 0.00 H ATOM 6342 HB3 TYR A 419 19.610 68.840 46.445 1.00 0.00 H ATOM 6343 HB2 TYR A 419 18.148 68.039 45.823 1.00 0.00 H ATOM 6344 HD2 TYR A 419 21.573 69.206 44.959 1.00 0.00 H ATOM 6345 HE2 TYR A 419 22.340 69.516 42.596 1.00 0.00 H ATOM 6346 HE1 TYR A 419 18.732 67.658 41.189 1.00 0.00 H ATOM 6347 HD1 TYR A 419 17.959 67.401 43.482 1.00 0.00 H ATOM 6348 HH TYR A 419 20.271 68.335 39.860 1.00 0.00 H ATOM 6349 H TYR A 419 18.168 65.346 45.750 1.00 0.00 H ATOM 6350 N LEU A 420 20.400 66.396 48.640 1.00 34.48 N ATOM 6351 CA LEU A 420 20.246 66.168 50.041 1.00 32.05 C ATOM 6352 C LEU A 420 20.672 67.350 50.939 1.00 34.13 C ATOM 6353 O LEU A 420 21.736 67.961 50.739 1.00 34.16 O ATOM 6354 CB LEU A 420 21.022 64.897 50.379 1.00 30.46 C ATOM 6355 CG LEU A 420 20.965 64.449 51.857 1.00 33.59 C ATOM 6356 CD1 LEU A 420 19.539 63.952 52.168 1.00 31.78 C ATOM 6357 CD2 LEU A 420 21.998 63.285 52.106 1.00 31.46 C ATOM 6358 HA LEU A 420 19.183 66.057 50.254 1.00 0.00 H ATOM 6359 HB2 LEU A 420 20.622 64.088 49.768 1.00 0.00 H ATOM 6360 HB3 LEU A 420 22.067 65.064 50.120 1.00 0.00 H ATOM 6361 HG LEU A 420 21.218 65.287 52.506 1.00 0.00 H ATOM 6362 HD21 LEU A 420 21.752 62.439 51.464 1.00 0.00 H ATOM 6363 HD22 LEU A 420 23.003 63.638 51.875 1.00 0.00 H ATOM 6364 HD23 LEU A 420 21.951 62.976 53.150 1.00 0.00 H ATOM 6365 HD11 LEU A 420 18.829 64.761 51.998 1.00 0.00 H ATOM 6366 HD12 LEU A 420 19.298 63.112 51.516 1.00 0.00 H ATOM 6367 HD13 LEU A 420 19.486 63.633 53.209 1.00 0.00 H ATOM 6368 H LEU A 420 21.363 66.465 48.253 1.00 0.00 H ATOM 6369 N TYR A 421 19.854 67.675 51.943 1.00 32.95 N ATOM 6370 CA TYR A 421 20.205 68.780 52.860 1.00 34.90 C ATOM 6371 C TYR A 421 20.117 68.380 54.342 1.00 35.15 C ATOM 6372 O TYR A 421 19.483 67.376 54.689 1.00 35.49 O ATOM 6373 CB TYR A 421 19.269 69.998 52.642 1.00 33.67 C ATOM 6374 CG TYR A 421 17.854 69.784 53.142 1.00 32.17 C ATOM 6375 CD1 TYR A 421 17.560 69.819 54.500 1.00 33.11 C ATOM 6376 CD2 TYR A 421 16.813 69.505 52.247 1.00 33.77 C ATOM 6377 CE1 TYR A 421 16.219 69.572 54.969 1.00 33.95 C ATOM 6378 CE2 TYR A 421 15.490 69.252 52.684 1.00 31.81 C ATOM 6379 CZ TYR A 421 15.201 69.292 54.042 1.00 32.94 C ATOM 6380 OH TYR A 421 13.896 69.093 54.480 1.00 33.34 O ATOM 6381 HA TYR A 421 21.238 69.036 52.626 1.00 0.00 H ATOM 6382 HB3 TYR A 421 19.227 70.212 51.574 1.00 0.00 H ATOM 6383 HB2 TYR A 421 19.693 70.855 53.166 1.00 0.00 H ATOM 6384 HD2 TYR A 421 17.029 69.482 51.179 1.00 0.00 H ATOM 6385 HE2 TYR A 421 14.706 69.028 51.961 1.00 0.00 H ATOM 6386 HE1 TYR A 421 15.997 69.602 56.036 1.00 0.00 H ATOM 6387 HD1 TYR A 421 18.351 70.035 55.218 1.00 0.00 H ATOM 6388 HH TYR A 421 13.868 69.154 55.468 1.00 0.00 H ATOM 6389 H TYR A 421 18.967 67.149 52.080 1.00 0.00 H ATOM 6390 N PHE A 422 20.717 69.192 55.211 1.00 34.65 N ATOM 6391 CA PHE A 422 20.702 68.959 56.650 1.00 35.41 C ATOM 6392 C PHE A 422 20.410 70.348 57.190 1.00 36.38 C ATOM 6393 O PHE A 422 21.274 71.243 57.127 1.00 36.11 O ATOM 6394 CB PHE A 422 22.083 68.469 57.129 1.00 36.99 C ATOM 6395 CG PHE A 422 22.189 68.255 58.634 1.00 36.14 C ATOM 6396 CD1 PHE A 422 21.602 67.144 59.239 1.00 39.37 C ATOM 6397 CD2 PHE A 422 22.904 69.137 59.424 1.00 36.45 C ATOM 6398 CE1 PHE A 422 21.729 66.906 60.657 1.00 37.96 C ATOM 6399 CE2 PHE A 422 23.043 68.927 60.834 1.00 37.30 C ATOM 6400 CZ PHE A 422 22.454 67.812 61.446 1.00 37.53 C ATOM 6401 HA PHE A 422 19.987 68.201 56.971 1.00 0.00 H ATOM 6402 HB2 PHE A 422 22.300 67.522 56.634 1.00 0.00 H ATOM 6403 HB3 PHE A 422 22.828 69.209 56.837 1.00 0.00 H ATOM 6404 HD2 PHE A 422 23.371 70.008 58.965 1.00 0.00 H ATOM 6405 HE2 PHE A 422 23.610 69.638 61.435 1.00 0.00 H ATOM 6406 HZ PHE A 422 22.558 67.651 62.519 1.00 0.00 H ATOM 6407 HE1 PHE A 422 21.266 66.030 61.111 1.00 0.00 H ATOM 6408 HD1 PHE A 422 21.036 66.441 58.628 1.00 0.00 H ATOM 6409 H PHE A 422 21.218 70.028 54.847 1.00 0.00 H ATOM 6410 N PHE A 423 19.189 70.538 57.688 1.00 35.50 N ATOM 6411 CA PHE A 423 18.752 71.841 58.186 1.00 35.64 C ATOM 6412 C PHE A 423 19.104 71.946 59.661 1.00 36.58 C ATOM 6413 O PHE A 423 18.616 71.142 60.488 1.00 35.16 O ATOM 6414 CB PHE A 423 17.245 71.997 57.985 1.00 35.85 C ATOM 6415 CG PHE A 423 16.695 73.308 58.469 1.00 36.87 C ATOM 6416 CD1 PHE A 423 16.768 74.440 57.671 1.00 37.04 C ATOM 6417 CD2 PHE A 423 16.101 73.406 59.729 1.00 36.22 C ATOM 6418 CE1 PHE A 423 16.246 75.675 58.120 1.00 35.84 C ATOM 6419 CE2 PHE A 423 15.568 74.640 60.188 1.00 34.89 C ATOM 6420 CZ PHE A 423 15.647 75.761 59.377 1.00 34.28 C ATOM 6421 HA PHE A 423 19.255 72.636 57.636 1.00 0.00 H ATOM 6422 HB2 PHE A 423 17.030 71.907 56.920 1.00 0.00 H ATOM 6423 HB3 PHE A 423 16.742 71.194 58.525 1.00 0.00 H ATOM 6424 HD2 PHE A 423 16.046 72.525 60.368 1.00 0.00 H ATOM 6425 HE2 PHE A 423 15.100 74.705 61.171 1.00 0.00 H ATOM 6426 HZ PHE A 423 15.240 76.712 59.722 1.00 0.00 H ATOM 6427 HE1 PHE A 423 16.312 76.558 57.485 1.00 0.00 H ATOM 6428 HD1 PHE A 423 17.233 74.377 56.687 1.00 0.00 H ATOM 6429 H PHE A 423 18.528 69.736 57.723 1.00 0.00 H ATOM 6430 N ASN A 424 19.973 72.908 59.994 1.00 36.67 N ATOM 6431 CA ASN A 424 20.396 73.042 61.380 1.00 38.20 C ATOM 6432 C ASN A 424 20.393 74.450 61.958 1.00 39.86 C ATOM 6433 O ASN A 424 21.227 74.783 62.817 1.00 38.89 O ATOM 6434 CB ASN A 424 21.768 72.352 61.624 1.00 37.14 C ATOM 6435 CG ASN A 424 22.920 72.957 60.806 1.00 38.81 C ATOM 6436 OD1 ASN A 424 22.722 73.722 59.868 1.00 36.33 O ATOM 6437 ND2 ASN A 424 24.132 72.575 61.153 1.00 39.62 N ATOM 6438 HA ASN A 424 19.612 72.524 61.933 1.00 0.00 H ATOM 6439 HB2 ASN A 424 22.014 72.440 62.682 1.00 0.00 H ATOM 6440 HB3 ASN A 424 21.675 71.298 61.360 1.00 0.00 H ATOM 6441 HD22 ASN A 424 24.263 71.925 61.954 1.00 0.00 H ATOM 6442 HD21 ASN A 424 24.958 72.923 60.626 1.00 0.00 H ATOM 6443 H ASN A 424 20.343 73.554 59.268 1.00 0.00 H ATOM 6444 N HIS A 425 19.429 75.258 61.534 1.00 39.73 N ATOM 6445 CA HIS A 425 19.334 76.610 62.068 1.00 40.14 C ATOM 6446 C HIS A 425 18.252 76.644 63.121 1.00 41.42 C ATOM 6447 O HIS A 425 17.115 76.220 62.892 1.00 40.95 O ATOM 6448 CB HIS A 425 18.978 77.659 60.983 1.00 41.68 C ATOM 6449 CG HIS A 425 18.861 79.055 61.533 1.00 43.01 C ATOM 6450 ND1 HIS A 425 19.951 79.772 61.967 1.00 45.10 N ATOM 6451 CD2 HIS A 425 17.778 79.814 61.838 1.00 44.88 C ATOM 6452 CE1 HIS A 425 19.553 80.910 62.518 1.00 44.37 C ATOM 6453 NE2 HIS A 425 18.237 80.963 62.451 1.00 45.45 N ATOM 6454 HA HIS A 425 20.312 76.864 62.478 1.00 0.00 H ATOM 6455 HB2 HIS A 425 19.757 77.649 60.221 1.00 0.00 H ATOM 6456 HB3 HIS A 425 18.026 77.382 60.531 1.00 0.00 H ATOM 6457 HD2 HIS A 425 16.737 79.563 61.636 1.00 0.00 H ATOM 6458 HE1 HIS A 425 20.202 81.671 62.952 1.00 0.00 H ATOM 6459 H HIS A 425 18.745 74.927 60.824 1.00 0.00 H ATOM 6460 N ARG A 426 18.596 77.192 64.274 1.00 41.73 N ATOM 6461 CA ARG A 426 17.658 77.305 65.371 1.00 42.48 C ATOM 6462 C ARG A 426 17.090 78.717 65.247 1.00 41.98 C ATOM 6463 O ARG A 426 17.827 79.683 65.358 1.00 40.33 O ATOM 6464 CB ARG A 426 18.414 77.073 66.704 1.00 42.40 C ATOM 6465 CG ARG A 426 17.804 77.672 67.976 1.00 45.26 C ATOM 6466 CD ARG A 426 16.697 76.837 68.575 1.00 43.23 C ATOM 6467 NE ARG A 426 16.174 77.416 69.808 1.00 43.15 N ATOM 6468 CZ ARG A 426 15.444 76.731 70.701 1.00 45.11 C ATOM 6469 NH1 ARG A 426 14.981 77.345 71.785 1.00 42.56 N ATOM 6470 NH2 ARG A 426 15.191 75.413 70.530 1.00 41.38 N ATOM 6471 HA ARG A 426 16.853 76.570 65.349 1.00 0.00 H ATOM 6472 HB2 ARG A 426 18.490 75.996 66.854 1.00 0.00 H ATOM 6473 HB3 ARG A 426 19.413 77.494 66.591 1.00 0.00 H ATOM 6474 HG2 ARG A 426 18.594 77.779 68.719 1.00 0.00 H ATOM 6475 HG3 ARG A 426 17.400 78.655 67.733 1.00 0.00 H ATOM 6476 HD2 ARG A 426 17.086 75.842 68.792 1.00 0.00 H ATOM 6477 HD3 ARG A 426 15.885 76.759 67.852 1.00 0.00 H ATOM 6478 HE ARG A 426 16.379 78.416 70.006 1.00 0.00 H ATOM 6479 HH12 ARG A 426 14.415 76.817 72.480 1.00 0.00 H ATOM 6480 HH11 ARG A 426 15.185 78.353 71.939 1.00 0.00 H ATOM 6481 HH22 ARG A 426 14.623 74.897 71.232 1.00 0.00 H ATOM 6482 HH21 ARG A 426 15.564 74.916 69.696 1.00 0.00 H ATOM 6483 H ARG A 426 19.564 77.551 64.396 1.00 0.00 H ATOM 6484 N ALA A 427 15.787 78.818 64.985 1.00 40.71 N ATOM 6485 CA ALA A 427 15.143 80.104 64.819 1.00 41.61 C ATOM 6486 C ALA A 427 15.307 80.993 66.067 1.00 43.15 C ATOM 6487 O ALA A 427 15.129 80.552 67.217 1.00 43.98 O ATOM 6488 CB ALA A 427 13.670 79.919 64.483 1.00 40.79 C ATOM 6489 HA ALA A 427 15.634 80.614 63.990 1.00 0.00 H ATOM 6490 HB1 ALA A 427 13.578 79.353 63.556 1.00 0.00 H ATOM 6491 HB2 ALA A 427 13.180 79.377 65.292 1.00 0.00 H ATOM 6492 HB3 ALA A 427 13.201 80.895 64.362 1.00 0.00 H ATOM 6493 H ALA A 427 15.219 77.951 64.898 1.00 0.00 H ATOM 6494 N SER A 428 15.661 82.249 65.814 1.00 43.90 N ATOM 6495 CA SER A 428 15.912 83.232 66.863 1.00 45.37 C ATOM 6496 C SER A 428 14.692 83.495 67.704 1.00 46.31 C ATOM 6497 O SER A 428 14.822 83.855 68.865 1.00 46.32 O ATOM 6498 CB SER A 428 16.410 84.539 66.249 1.00 44.57 C ATOM 6499 OG SER A 428 15.434 85.036 65.331 1.00 47.18 O ATOM 6500 HA SER A 428 16.677 82.816 67.518 1.00 0.00 H ATOM 6501 HB2 SER A 428 17.347 84.359 65.722 1.00 0.00 H ATOM 6502 HB3 SER A 428 16.574 85.273 67.038 1.00 0.00 H ATOM 6503 HG SER A 428 15.287 84.369 64.614 1.00 0.00 H ATOM 6504 H SER A 428 15.764 82.545 64.822 1.00 0.00 H ATOM 6505 N ASN A 429 13.506 83.279 67.137 1.00 46.96 N ATOM 6506 CA ASN A 429 12.266 83.523 67.857 1.00 46.04 C ATOM 6507 C ASN A 429 11.556 82.241 68.271 1.00 47.01 C ATOM 6508 O ASN A 429 10.334 82.261 68.530 1.00 46.12 O ATOM 6509 CB ASN A 429 11.321 84.334 66.963 1.00 46.16 C ATOM 6510 CG ASN A 429 11.141 83.698 65.565 1.00 46.54 C ATOM 6511 OD1 ASN A 429 11.592 82.573 65.313 1.00 44.49 O ATOM 6512 ND2 ASN A 429 10.491 84.425 64.664 1.00 45.19 N ATOM 6513 HA ASN A 429 12.526 84.065 68.766 1.00 0.00 H ATOM 6514 HB2 ASN A 429 10.347 84.395 67.448 1.00 0.00 H ATOM 6515 HB3 ASN A 429 11.729 85.337 66.841 1.00 0.00 H ATOM 6516 HD22 ASN A 429 10.129 85.366 64.918 1.00 0.00 H ATOM 6517 HD21 ASN A 429 10.344 84.053 63.704 1.00 0.00 H ATOM 6518 H ASN A 429 13.466 82.928 66.159 1.00 0.00 H ATOM 6519 N LEU A 430 12.289 81.131 68.327 1.00 46.04 N ATOM 6520 CA LEU A 430 11.677 79.846 68.682 1.00 46.89 C ATOM 6521 C LEU A 430 11.056 79.931 70.091 1.00 46.25 C ATOM 6522 O LEU A 430 11.717 80.409 71.010 1.00 45.12 O ATOM 6523 CB LEU A 430 12.769 78.762 68.647 1.00 48.97 C ATOM 6524 CG LEU A 430 12.548 77.376 68.013 1.00 50.41 C ATOM 6525 CD1 LEU A 430 12.416 76.379 69.104 1.00 50.54 C ATOM 6526 CD2 LEU A 430 11.337 77.333 67.104 1.00 50.34 C ATOM 6527 HA LEU A 430 10.887 79.598 67.974 1.00 0.00 H ATOM 6528 HB2 LEU A 430 13.615 79.203 68.120 1.00 0.00 H ATOM 6529 HB3 LEU A 430 13.045 78.578 69.685 1.00 0.00 H ATOM 6530 HG LEU A 430 13.407 77.146 67.382 1.00 0.00 H ATOM 6531 HD21 LEU A 430 10.445 77.584 67.678 1.00 0.00 H ATOM 6532 HD22 LEU A 430 11.465 78.053 66.296 1.00 0.00 H ATOM 6533 HD23 LEU A 430 11.233 76.331 66.687 1.00 0.00 H ATOM 6534 HD11 LEU A 430 13.327 76.375 69.703 1.00 0.00 H ATOM 6535 HD12 LEU A 430 11.566 76.642 69.734 1.00 0.00 H ATOM 6536 HD13 LEU A 430 12.259 75.390 68.674 1.00 0.00 H ATOM 6537 H LEU A 430 13.307 81.175 68.117 1.00 0.00 H ATOM 6538 N VAL A 431 9.817 79.472 70.286 1.00 44.89 N ATOM 6539 CA VAL A 431 9.229 79.550 71.623 1.00 44.01 C ATOM 6540 C VAL A 431 9.471 78.291 72.453 1.00 43.59 C ATOM 6541 O VAL A 431 9.199 78.261 73.655 1.00 43.23 O ATOM 6542 CB VAL A 431 7.709 79.847 71.547 1.00 46.00 C ATOM 6543 CG1 VAL A 431 7.488 81.207 70.841 1.00 45.82 C ATOM 6544 CG2 VAL A 431 6.959 78.732 70.742 1.00 46.78 C ATOM 6545 HA VAL A 431 9.733 80.374 72.127 1.00 0.00 H ATOM 6546 HB VAL A 431 7.313 79.874 72.562 1.00 0.00 H ATOM 6547 HG11 VAL A 431 7.986 81.994 71.407 1.00 0.00 H ATOM 6548 HG12 VAL A 431 7.903 81.164 69.834 1.00 0.00 H ATOM 6549 HG13 VAL A 431 6.420 81.417 70.787 1.00 0.00 H ATOM 6550 HG21 VAL A 431 7.358 78.686 69.729 1.00 0.00 H ATOM 6551 HG22 VAL A 431 7.104 77.770 71.234 1.00 0.00 H ATOM 6552 HG23 VAL A 431 5.895 78.966 70.705 1.00 0.00 H ATOM 6553 H VAL A 431 9.277 79.064 69.497 1.00 0.00 H ATOM 6554 N TRP A 432 9.982 77.235 71.816 1.00 42.63 N ATOM 6555 CA TRP A 432 10.271 75.970 72.531 1.00 39.95 C ATOM 6556 C TRP A 432 11.601 76.132 73.261 1.00 39.53 C ATOM 6557 O TRP A 432 12.480 76.891 72.801 1.00 40.27 O ATOM 6558 CB TRP A 432 10.359 74.783 71.526 1.00 38.23 C ATOM 6559 CG TRP A 432 9.008 74.370 70.949 1.00 35.38 C ATOM 6560 CD1 TRP A 432 8.535 74.636 69.686 1.00 35.09 C ATOM 6561 CD2 TRP A 432 7.982 73.606 71.607 1.00 35.59 C ATOM 6562 NE1 TRP A 432 7.287 74.069 69.518 1.00 35.10 N ATOM 6563 CE2 TRP A 432 6.922 73.429 70.668 1.00 35.57 C ATOM 6564 CE3 TRP A 432 7.850 73.055 72.899 1.00 35.72 C ATOM 6565 CZ2 TRP A 432 5.733 72.705 70.973 1.00 34.35 C ATOM 6566 CZ3 TRP A 432 6.667 72.328 73.218 1.00 36.82 C ATOM 6567 CH2 TRP A 432 5.625 72.162 72.237 1.00 37.70 C ATOM 6568 HA TRP A 432 9.471 75.754 73.239 1.00 0.00 H ATOM 6569 HB2 TRP A 432 11.011 75.076 70.703 1.00 0.00 H ATOM 6570 HB3 TRP A 432 10.790 73.925 72.042 1.00 0.00 H ATOM 6571 HE1 TRP A 432 6.715 74.121 68.651 1.00 0.00 H ATOM 6572 HD1 TRP A 432 9.067 75.211 68.928 1.00 0.00 H ATOM 6573 HZ2 TRP A 432 4.939 72.585 70.236 1.00 0.00 H ATOM 6574 HH2 TRP A 432 4.732 71.595 72.499 1.00 0.00 H ATOM 6575 HZ3 TRP A 432 6.549 71.894 74.211 1.00 0.00 H ATOM 6576 HE3 TRP A 432 8.639 73.183 73.640 1.00 0.00 H ATOM 6577 H TRP A 432 10.181 77.302 70.797 1.00 0.00 H ATOM 6578 N PRO A 433 11.800 75.397 74.367 1.00 39.49 N ATOM 6579 CA PRO A 433 13.077 75.572 75.057 1.00 40.07 C ATOM 6580 C PRO A 433 14.291 75.215 74.241 1.00 41.99 C ATOM 6581 O PRO A 433 14.257 74.409 73.301 1.00 42.89 O ATOM 6582 CB PRO A 433 12.938 74.685 76.273 1.00 39.81 C ATOM 6583 CG PRO A 433 12.121 73.475 75.654 1.00 39.45 C ATOM 6584 CD PRO A 433 11.056 74.233 74.914 1.00 38.59 C ATOM 6585 HA PRO A 433 13.254 76.622 75.290 1.00 0.00 H ATOM 6586 HD3 PRO A 433 10.628 73.629 74.114 1.00 0.00 H ATOM 6587 HD2 PRO A 433 10.263 74.555 75.588 1.00 0.00 H ATOM 6588 HG3 PRO A 433 11.699 72.834 76.427 1.00 0.00 H ATOM 6589 HG2 PRO A 433 12.733 72.875 74.981 1.00 0.00 H ATOM 6590 HB2 PRO A 433 13.909 74.364 76.651 1.00 0.00 H ATOM 6591 HB3 PRO A 433 12.384 75.179 77.071 1.00 0.00 H ATOM 6592 N GLU A 434 15.385 75.826 74.646 1.00 43.57 N ATOM 6593 CA GLU A 434 16.684 75.673 74.054 1.00 44.40 C ATOM 6594 C GLU A 434 17.140 74.222 73.923 1.00 41.89 C ATOM 6595 O GLU A 434 17.754 73.839 72.913 1.00 40.65 O ATOM 6596 CB GLU A 434 17.684 76.426 74.910 1.00 48.08 C ATOM 6597 CG GLU A 434 18.768 77.067 74.099 1.00 56.71 C ATOM 6598 CD GLU A 434 18.220 78.199 73.253 1.00 61.68 C ATOM 6599 OE1 GLU A 434 17.412 78.993 73.811 1.00 64.43 O ATOM 6600 OE2 GLU A 434 18.593 78.302 72.047 1.00 64.80 O ATOM 6601 HA GLU A 434 16.623 76.068 73.040 1.00 0.00 H ATOM 6602 HB2 GLU A 434 17.156 77.203 75.463 1.00 0.00 H ATOM 6603 HB3 GLU A 434 18.139 75.727 75.612 1.00 0.00 H ATOM 6604 HG2 GLU A 434 19.530 77.461 74.771 1.00 0.00 H ATOM 6605 HG3 GLU A 434 19.214 76.318 73.445 1.00 0.00 H ATOM 6606 H GLU A 434 15.301 76.470 75.458 1.00 0.00 H ATOM 6607 N TRP A 435 16.856 73.407 74.934 1.00 40.95 N ATOM 6608 CA TRP A 435 17.326 72.023 74.871 1.00 39.79 C ATOM 6609 C TRP A 435 16.763 71.231 73.663 1.00 39.88 C ATOM 6610 O TRP A 435 17.358 70.233 73.250 1.00 37.12 O ATOM 6611 CB TRP A 435 17.038 71.265 76.163 1.00 38.91 C ATOM 6612 CG TRP A 435 15.603 70.914 76.433 1.00 40.88 C ATOM 6613 CD1 TRP A 435 14.756 71.580 77.259 1.00 40.28 C ATOM 6614 CD2 TRP A 435 14.854 69.771 75.928 1.00 41.62 C ATOM 6615 NE1 TRP A 435 13.541 70.939 77.319 1.00 40.73 N ATOM 6616 CE2 TRP A 435 13.567 69.832 76.503 1.00 41.53 C ATOM 6617 CE3 TRP A 435 15.149 68.711 75.046 1.00 41.94 C ATOM 6618 CZ2 TRP A 435 12.563 68.880 76.222 1.00 40.54 C ATOM 6619 CZ3 TRP A 435 14.139 67.754 74.764 1.00 42.18 C ATOM 6620 CH2 TRP A 435 12.861 67.860 75.355 1.00 41.05 C ATOM 6621 HA TRP A 435 18.405 72.099 74.734 1.00 0.00 H ATOM 6622 HB2 TRP A 435 17.606 70.335 76.135 1.00 0.00 H ATOM 6623 HB3 TRP A 435 17.390 71.879 76.992 1.00 0.00 H ATOM 6624 HE1 TRP A 435 12.729 71.244 77.892 1.00 0.00 H ATOM 6625 HD1 TRP A 435 15.004 72.494 77.799 1.00 0.00 H ATOM 6626 HZ2 TRP A 435 11.577 68.954 76.682 1.00 0.00 H ATOM 6627 HH2 TRP A 435 12.098 67.118 75.118 1.00 0.00 H ATOM 6628 HZ3 TRP A 435 14.352 66.929 74.084 1.00 0.00 H ATOM 6629 HE3 TRP A 435 16.135 68.628 74.589 1.00 0.00 H ATOM 6630 H TRP A 435 16.311 73.746 75.752 1.00 0.00 H ATOM 6631 N MET A 436 15.641 71.680 73.100 1.00 37.62 N ATOM 6632 CA MET A 436 15.058 70.966 71.970 1.00 38.07 C ATOM 6633 C MET A 436 15.805 71.156 70.648 1.00 36.80 C ATOM 6634 O MET A 436 15.695 70.290 69.750 1.00 36.14 O ATOM 6635 CB MET A 436 13.574 71.326 71.852 1.00 37.86 C ATOM 6636 CG MET A 436 12.784 70.735 73.057 1.00 35.45 C ATOM 6637 SD MET A 436 11.057 71.229 73.049 1.00 37.79 S ATOM 6638 CE MET A 436 10.353 69.908 71.806 1.00 35.71 C ATOM 6639 HA MET A 436 15.160 69.901 72.178 1.00 0.00 H ATOM 6640 HB2 MET A 436 13.465 72.411 71.846 1.00 0.00 H ATOM 6641 HB3 MET A 436 13.176 70.917 70.924 1.00 0.00 H ATOM 6642 HG2 MET A 436 13.244 71.082 73.982 1.00 0.00 H ATOM 6643 HG3 MET A 436 12.838 69.647 73.012 1.00 0.00 H ATOM 6644 HE1 MET A 436 10.853 70.014 70.843 1.00 0.00 H ATOM 6645 HE2 MET A 436 10.531 68.908 72.201 1.00 0.00 H ATOM 6646 HE3 MET A 436 9.282 70.065 71.679 1.00 0.00 H ATOM 6647 H MET A 436 15.182 72.538 73.466 1.00 0.00 H ATOM 6648 N GLY A 437 16.588 72.247 70.543 1.00 35.23 N ATOM 6649 CA GLY A 437 17.371 72.503 69.326 1.00 33.61 C ATOM 6650 C GLY A 437 16.582 72.835 68.051 1.00 34.17 C ATOM 6651 O GLY A 437 15.678 73.687 68.057 1.00 34.46 O ATOM 6652 HA3 GLY A 437 17.966 71.613 69.123 1.00 0.00 H ATOM 6653 HA2 GLY A 437 18.035 73.343 69.531 1.00 0.00 H ATOM 6654 H GLY A 437 16.639 72.919 71.335 1.00 0.00 H ATOM 6655 N VAL A 438 16.918 72.148 66.957 1.00 33.48 N ATOM 6656 CA VAL A 438 16.301 72.340 65.655 1.00 32.88 C ATOM 6657 C VAL A 438 15.322 71.184 65.520 1.00 33.78 C ATOM 6658 O VAL A 438 15.648 70.058 65.075 1.00 34.58 O ATOM 6659 CB VAL A 438 17.366 72.289 64.592 1.00 34.45 C ATOM 6660 CG1 VAL A 438 16.744 72.570 63.207 1.00 33.05 C ATOM 6661 CG2 VAL A 438 18.489 73.320 64.964 1.00 32.50 C ATOM 6662 HA VAL A 438 15.795 73.300 65.550 1.00 0.00 H ATOM 6663 HB VAL A 438 17.814 71.297 64.540 1.00 0.00 H ATOM 6664 HG11 VAL A 438 15.985 71.818 62.992 1.00 0.00 H ATOM 6665 HG12 VAL A 438 16.286 73.559 63.210 1.00 0.00 H ATOM 6666 HG13 VAL A 438 17.523 72.531 62.446 1.00 0.00 H ATOM 6667 HG21 VAL A 438 18.060 74.321 65.014 1.00 0.00 H ATOM 6668 HG22 VAL A 438 18.915 73.057 65.932 1.00 0.00 H ATOM 6669 HG23 VAL A 438 19.269 73.296 64.203 1.00 0.00 H ATOM 6670 H VAL A 438 17.667 71.432 67.041 1.00 0.00 H ATOM 6671 N ILE A 439 14.116 71.512 65.926 1.00 32.99 N ATOM 6672 CA ILE A 439 12.991 70.604 66.044 1.00 33.97 C ATOM 6673 C ILE A 439 12.303 70.101 64.778 1.00 32.91 C ATOM 6674 O ILE A 439 12.230 70.801 63.766 1.00 34.41 O ATOM 6675 CB ILE A 439 11.961 71.271 66.952 1.00 33.04 C ATOM 6676 CG1 ILE A 439 12.671 71.681 68.272 1.00 34.65 C ATOM 6677 CG2 ILE A 439 10.768 70.352 67.237 1.00 31.68 C ATOM 6678 CD1 ILE A 439 11.821 72.636 69.171 1.00 32.03 C ATOM 6679 HA ILE A 439 13.429 69.687 66.439 1.00 0.00 H ATOM 6680 HB ILE A 439 11.559 72.151 66.450 1.00 0.00 H ATOM 6681 HG12 ILE A 439 12.890 70.777 68.840 1.00 0.00 H ATOM 6682 HG13 ILE A 439 13.604 72.185 68.019 1.00 0.00 H ATOM 6683 HD11 ILE A 439 11.602 73.551 68.621 1.00 0.00 H ATOM 6684 HD12 ILE A 439 10.888 72.142 69.443 1.00 0.00 H ATOM 6685 HD13 ILE A 439 12.382 72.878 70.074 1.00 0.00 H ATOM 6686 HG21 ILE A 439 10.278 70.093 66.298 1.00 0.00 H ATOM 6687 HG22 ILE A 439 11.119 69.444 67.728 1.00 0.00 H ATOM 6688 HG23 ILE A 439 10.061 70.868 67.887 1.00 0.00 H ATOM 6689 H ILE A 439 13.955 72.506 66.184 1.00 0.00 H ATOM 6690 N HIS A 440 11.800 68.869 64.877 1.00 31.87 N ATOM 6691 CA HIS A 440 11.038 68.241 63.820 1.00 30.26 C ATOM 6692 C HIS A 440 9.945 69.239 63.455 1.00 30.25 C ATOM 6693 O HIS A 440 9.217 69.702 64.317 1.00 31.29 O ATOM 6694 CB HIS A 440 10.407 66.970 64.368 1.00 29.86 C ATOM 6695 CG HIS A 440 9.840 66.058 63.323 1.00 29.90 C ATOM 6696 ND1 HIS A 440 10.604 65.538 62.297 1.00 27.66 N ATOM 6697 CD2 HIS A 440 8.602 65.514 63.190 1.00 29.67 C ATOM 6698 CE1 HIS A 440 9.858 64.705 61.583 1.00 29.91 C ATOM 6699 NE2 HIS A 440 8.643 64.669 62.102 1.00 29.62 N ATOM 6700 HA HIS A 440 11.652 67.984 62.956 1.00 0.00 H ATOM 6701 HB2 HIS A 440 11.170 66.422 64.921 1.00 0.00 H ATOM 6702 HB3 HIS A 440 9.602 67.254 65.046 1.00 0.00 H ATOM 6703 HD2 HIS A 440 7.738 65.709 63.825 1.00 0.00 H ATOM 6704 HE1 HIS A 440 10.192 64.143 60.711 1.00 0.00 H ATOM 6705 H HIS A 440 11.963 68.336 65.755 1.00 0.00 H ATOM 6706 N GLY A 441 9.868 69.591 62.181 1.00 31.04 N ATOM 6707 CA GLY A 441 8.824 70.493 61.724 1.00 32.89 C ATOM 6708 C GLY A 441 9.183 71.977 61.639 1.00 33.90 C ATOM 6709 O GLY A 441 8.489 72.771 61.007 1.00 32.17 O ATOM 6710 HA3 GLY A 441 7.981 70.396 62.408 1.00 0.00 H ATOM 6711 HA2 GLY A 441 8.521 70.169 60.728 1.00 0.00 H ATOM 6712 H GLY A 441 10.561 69.219 61.501 1.00 0.00 H ATOM 6713 N TYR A 442 10.313 72.346 62.215 1.00 34.33 N ATOM 6714 CA TYR A 442 10.624 73.760 62.256 1.00 34.40 C ATOM 6715 C TYR A 442 11.392 74.367 61.106 1.00 34.94 C ATOM 6716 O TYR A 442 11.771 75.572 61.155 1.00 35.56 O ATOM 6717 CB TYR A 442 11.193 74.110 63.654 1.00 33.84 C ATOM 6718 CG TYR A 442 10.060 74.104 64.646 1.00 32.77 C ATOM 6719 CD1 TYR A 442 9.529 72.892 65.150 1.00 32.53 C ATOM 6720 CD2 TYR A 442 9.353 75.283 64.905 1.00 33.89 C ATOM 6721 CE1 TYR A 442 8.314 72.872 65.864 1.00 33.15 C ATOM 6722 CE2 TYR A 442 8.144 75.270 65.610 1.00 33.07 C ATOM 6723 CZ TYR A 442 7.634 74.073 66.076 1.00 32.80 C ATOM 6724 OH TYR A 442 6.420 74.121 66.698 1.00 34.34 O ATOM 6725 HA TYR A 442 9.670 74.263 62.094 1.00 0.00 H ATOM 6726 HB3 TYR A 442 11.653 75.098 63.627 1.00 0.00 H ATOM 6727 HB2 TYR A 442 11.939 73.370 63.943 1.00 0.00 H ATOM 6728 HD2 TYR A 442 9.753 76.233 64.550 1.00 0.00 H ATOM 6729 HE2 TYR A 442 7.606 76.201 65.791 1.00 0.00 H ATOM 6730 HE1 TYR A 442 7.911 71.933 66.245 1.00 0.00 H ATOM 6731 HD1 TYR A 442 10.068 71.960 64.983 1.00 0.00 H ATOM 6732 HH TYR A 442 5.742 74.475 66.069 1.00 0.00 H ATOM 6733 H TYR A 442 10.959 71.643 62.626 1.00 0.00 H ATOM 6734 N GLU A 443 11.582 73.571 60.044 1.00 33.23 N ATOM 6735 CA GLU A 443 12.158 74.126 58.812 1.00 32.47 C ATOM 6736 C GLU A 443 10.964 74.591 57.912 1.00 33.67 C ATOM 6737 O GLU A 443 11.126 75.419 56.988 1.00 31.28 O ATOM 6738 CB GLU A 443 13.011 73.092 58.042 1.00 32.40 C ATOM 6739 CG GLU A 443 12.227 72.146 57.067 1.00 30.57 C ATOM 6740 CD GLU A 443 11.235 71.208 57.783 1.00 32.29 C ATOM 6741 OE1 GLU A 443 11.328 71.049 59.031 1.00 29.21 O ATOM 6742 OE2 GLU A 443 10.391 70.597 57.096 1.00 32.80 O ATOM 6743 HA GLU A 443 12.822 74.951 59.070 1.00 0.00 H ATOM 6744 HB2 GLU A 443 13.749 73.639 57.455 1.00 0.00 H ATOM 6745 HB3 GLU A 443 13.521 72.467 58.775 1.00 0.00 H ATOM 6746 HG2 GLU A 443 11.671 72.763 56.361 1.00 0.00 H ATOM 6747 HG3 GLU A 443 12.949 71.536 56.524 1.00 0.00 H ATOM 6748 H GLU A 443 11.323 72.565 60.092 1.00 0.00 H ATOM 6749 N ILE A 444 9.748 74.103 58.216 1.00 33.00 N ATOM 6750 CA ILE A 444 8.591 74.427 57.381 1.00 33.60 C ATOM 6751 C ILE A 444 8.419 75.967 57.211 1.00 35.78 C ATOM 6752 O ILE A 444 8.370 76.489 56.071 1.00 36.50 O ATOM 6753 CB ILE A 444 7.283 73.723 57.964 1.00 33.21 C ATOM 6754 CG1 ILE A 444 7.443 72.183 57.867 1.00 31.38 C ATOM 6755 CG2 ILE A 444 6.046 74.178 57.140 1.00 34.60 C ATOM 6756 CD1 ILE A 444 6.333 71.358 58.494 1.00 27.99 C ATOM 6757 HA ILE A 444 8.760 74.033 56.379 1.00 0.00 H ATOM 6758 HB ILE A 444 7.145 74.005 59.008 1.00 0.00 H ATOM 6759 HG12 ILE A 444 7.499 71.919 56.811 1.00 0.00 H ATOM 6760 HG13 ILE A 444 8.378 71.913 58.358 1.00 0.00 H ATOM 6761 HD11 ILE A 444 6.266 71.590 59.557 1.00 0.00 H ATOM 6762 HD12 ILE A 444 5.387 71.596 58.008 1.00 0.00 H ATOM 6763 HD13 ILE A 444 6.553 70.298 58.365 1.00 0.00 H ATOM 6764 HG21 ILE A 444 5.942 75.261 57.211 1.00 0.00 H ATOM 6765 HG22 ILE A 444 6.181 73.893 56.097 1.00 0.00 H ATOM 6766 HG23 ILE A 444 5.151 73.699 57.536 1.00 0.00 H ATOM 6767 H ILE A 444 9.630 73.492 59.049 1.00 0.00 H ATOM 6768 N GLU A 445 8.388 76.686 58.333 1.00 35.74 N ATOM 6769 CA GLU A 445 8.264 78.149 58.301 1.00 36.48 C ATOM 6770 C GLU A 445 9.288 78.811 57.372 1.00 36.58 C ATOM 6771 O GLU A 445 8.995 79.846 56.755 1.00 36.95 O ATOM 6772 CB GLU A 445 8.367 78.716 59.742 1.00 38.05 C ATOM 6773 CG GLU A 445 9.670 78.383 60.499 1.00 36.84 C ATOM 6774 CD GLU A 445 9.482 78.404 62.012 1.00 38.21 C ATOM 6775 OE1 GLU A 445 8.645 77.638 62.542 1.00 36.12 O ATOM 6776 OE2 GLU A 445 10.171 79.201 62.689 1.00 38.58 O ATOM 6777 HA GLU A 445 7.284 78.387 57.889 1.00 0.00 H ATOM 6778 HB2 GLU A 445 8.282 79.801 59.682 1.00 0.00 H ATOM 6779 HB3 GLU A 445 7.533 78.318 60.319 1.00 0.00 H ATOM 6780 HG2 GLU A 445 10.005 77.389 60.201 1.00 0.00 H ATOM 6781 HG3 GLU A 445 10.430 79.117 60.230 1.00 0.00 H ATOM 6782 H GLU A 445 8.453 76.201 59.251 1.00 0.00 H ATOM 6783 N PHE A 446 10.476 78.233 57.232 1.00 35.94 N ATOM 6784 CA PHE A 446 11.454 78.814 56.321 1.00 36.57 C ATOM 6785 C PHE A 446 11.068 78.481 54.875 1.00 38.25 C ATOM 6786 O PHE A 446 11.232 79.323 53.963 1.00 38.52 O ATOM 6787 CB PHE A 446 12.870 78.272 56.616 1.00 37.07 C ATOM 6788 CG PHE A 446 13.521 78.953 57.790 1.00 38.28 C ATOM 6789 CD1 PHE A 446 13.214 78.558 59.106 1.00 36.09 C ATOM 6790 CD2 PHE A 446 14.296 80.131 57.581 1.00 38.06 C ATOM 6791 CE1 PHE A 446 13.645 79.325 60.209 1.00 36.69 C ATOM 6792 CE2 PHE A 446 14.736 80.909 58.675 1.00 37.13 C ATOM 6793 CZ PHE A 446 14.413 80.518 59.979 1.00 38.12 C ATOM 6794 HA PHE A 446 11.461 79.895 56.463 1.00 0.00 H ATOM 6795 HB2 PHE A 446 12.798 77.205 56.828 1.00 0.00 H ATOM 6796 HB3 PHE A 446 13.493 78.425 55.735 1.00 0.00 H ATOM 6797 HD2 PHE A 446 14.552 80.435 56.566 1.00 0.00 H ATOM 6798 HE2 PHE A 446 15.325 81.810 58.504 1.00 0.00 H ATOM 6799 HZ PHE A 446 14.745 81.121 60.824 1.00 0.00 H ATOM 6800 HE1 PHE A 446 13.398 79.016 61.225 1.00 0.00 H ATOM 6801 HD1 PHE A 446 12.637 77.649 59.275 1.00 0.00 H ATOM 6802 H PHE A 446 10.706 77.372 57.768 1.00 0.00 H ATOM 6803 N VAL A 447 10.545 77.258 54.666 1.00 37.09 N ATOM 6804 CA VAL A 447 10.154 76.809 53.329 1.00 34.83 C ATOM 6805 C VAL A 447 8.956 77.644 52.857 1.00 35.59 C ATOM 6806 O VAL A 447 8.927 78.013 51.699 1.00 33.95 O ATOM 6807 CB VAL A 447 9.805 75.277 53.328 1.00 33.76 C ATOM 6808 CG1 VAL A 447 9.037 74.871 52.049 1.00 32.78 C ATOM 6809 CG2 VAL A 447 11.119 74.458 53.470 1.00 31.24 C ATOM 6810 HA VAL A 447 10.989 76.950 52.642 1.00 0.00 H ATOM 6811 HB VAL A 447 9.150 75.064 54.173 1.00 0.00 H ATOM 6812 HG11 VAL A 447 8.107 75.437 51.990 1.00 0.00 H ATOM 6813 HG12 VAL A 447 9.651 75.086 51.174 1.00 0.00 H ATOM 6814 HG13 VAL A 447 8.813 73.805 52.084 1.00 0.00 H ATOM 6815 HG21 VAL A 447 11.780 74.686 52.633 1.00 0.00 H ATOM 6816 HG22 VAL A 447 11.611 74.723 54.406 1.00 0.00 H ATOM 6817 HG23 VAL A 447 10.884 73.394 53.470 1.00 0.00 H ATOM 6818 H VAL A 447 10.416 76.617 55.474 1.00 0.00 H ATOM 6819 N PHE A 448 8.001 77.950 53.754 1.00 35.76 N ATOM 6820 CA PHE A 448 6.850 78.768 53.371 1.00 37.08 C ATOM 6821 C PHE A 448 7.104 80.307 53.480 1.00 39.10 C ATOM 6822 O PHE A 448 6.193 81.105 53.312 1.00 38.86 O ATOM 6823 CB PHE A 448 5.604 78.375 54.172 1.00 36.04 C ATOM 6824 CG PHE A 448 4.923 77.164 53.630 1.00 36.73 C ATOM 6825 CD1 PHE A 448 5.478 75.872 53.839 1.00 35.34 C ATOM 6826 CD2 PHE A 448 3.770 77.295 52.845 1.00 35.37 C ATOM 6827 CE1 PHE A 448 4.900 74.723 53.278 1.00 36.30 C ATOM 6828 CE2 PHE A 448 3.166 76.153 52.271 1.00 36.59 C ATOM 6829 CZ PHE A 448 3.737 74.855 52.488 1.00 35.91 C ATOM 6830 HA PHE A 448 6.682 78.559 52.314 1.00 0.00 H ATOM 6831 HB2 PHE A 448 5.901 78.176 55.202 1.00 0.00 H ATOM 6832 HB3 PHE A 448 4.901 79.208 54.153 1.00 0.00 H ATOM 6833 HD2 PHE A 448 3.337 78.281 52.676 1.00 0.00 H ATOM 6834 HE2 PHE A 448 2.267 76.259 51.664 1.00 0.00 H ATOM 6835 HZ PHE A 448 3.275 73.973 52.044 1.00 0.00 H ATOM 6836 HE1 PHE A 448 5.343 73.742 53.450 1.00 0.00 H ATOM 6837 HD1 PHE A 448 6.375 75.771 54.450 1.00 0.00 H ATOM 6838 H PHE A 448 8.082 77.601 54.730 1.00 0.00 H ATOM 6839 N GLY A 449 8.352 80.696 53.747 1.00 39.34 N ATOM 6840 CA GLY A 449 8.693 82.101 53.811 1.00 41.22 C ATOM 6841 C GLY A 449 8.176 82.994 54.927 1.00 42.63 C ATOM 6842 O GLY A 449 8.145 84.200 54.717 1.00 42.75 O ATOM 6843 HA3 GLY A 449 8.347 82.544 52.877 1.00 0.00 H ATOM 6844 HA2 GLY A 449 9.781 82.152 53.855 1.00 0.00 H ATOM 6845 H GLY A 449 9.089 79.981 53.911 1.00 0.00 H ATOM 6846 N LEU A 450 7.776 82.450 56.079 1.00 42.24 N ATOM 6847 CA LEU A 450 7.300 83.276 57.197 1.00 44.02 C ATOM 6848 C LEU A 450 8.355 84.346 57.619 1.00 45.07 C ATOM 6849 O LEU A 450 8.001 85.455 58.037 1.00 45.88 O ATOM 6850 CB LEU A 450 6.916 82.404 58.395 1.00 41.74 C ATOM 6851 CG LEU A 450 5.603 81.610 58.281 1.00 43.23 C ATOM 6852 CD1 LEU A 450 4.470 82.492 58.456 1.00 45.20 C ATOM 6853 CD2 LEU A 450 5.467 80.947 56.900 1.00 42.54 C ATOM 6854 HA LEU A 450 6.412 83.805 56.851 1.00 0.00 H ATOM 6855 HB2 LEU A 450 7.722 81.688 58.554 1.00 0.00 H ATOM 6856 HB3 LEU A 450 6.833 83.056 59.265 1.00 0.00 H ATOM 6857 HG LEU A 450 5.623 80.844 59.056 1.00 0.00 H ATOM 6858 HD21 LEU A 450 5.476 81.715 56.127 1.00 0.00 H ATOM 6859 HD22 LEU A 450 6.301 80.263 56.743 1.00 0.00 H ATOM 6860 HD23 LEU A 450 4.528 80.395 56.854 1.00 0.00 H ATOM 6861 HD11 LEU A 450 4.522 82.958 59.440 1.00 0.00 H ATOM 6862 HD12 LEU A 450 4.489 83.263 57.686 1.00 0.00 H ATOM 6863 HD13 LEU A 450 3.548 81.917 58.373 1.00 0.00 H ATOM 6864 H LEU A 450 7.802 81.416 56.188 1.00 0.00 H ATOM 6865 N PRO A 451 9.655 84.025 57.515 1.00 45.63 N ATOM 6866 CA PRO A 451 10.653 85.033 57.896 1.00 46.96 C ATOM 6867 C PRO A 451 10.622 86.327 57.052 1.00 48.46 C ATOM 6868 O PRO A 451 11.357 87.260 57.367 1.00 48.49 O ATOM 6869 CB PRO A 451 11.985 84.292 57.731 1.00 45.38 C ATOM 6870 CG PRO A 451 11.609 82.870 58.156 1.00 45.39 C ATOM 6871 CD PRO A 451 10.280 82.694 57.395 1.00 46.46 C ATOM 6872 HA PRO A 451 10.466 85.400 58.905 1.00 0.00 H ATOM 6873 HD3 PRO A 451 10.456 82.436 56.351 1.00 0.00 H ATOM 6874 HD2 PRO A 451 9.661 81.926 57.858 1.00 0.00 H ATOM 6875 HG3 PRO A 451 11.469 82.795 59.234 1.00 0.00 H ATOM 6876 HG2 PRO A 451 12.356 82.143 57.837 1.00 0.00 H ATOM 6877 HB2 PRO A 451 12.329 84.319 56.697 1.00 0.00 H ATOM 6878 HB3 PRO A 451 12.755 84.710 58.380 1.00 0.00 H ATOM 6879 N LEU A 452 9.830 86.378 55.974 1.00 48.57 N ATOM 6880 CA LEU A 452 9.785 87.593 55.160 1.00 49.34 C ATOM 6881 C LEU A 452 8.781 88.581 55.724 1.00 49.71 C ATOM 6882 O LEU A 452 8.742 89.706 55.259 1.00 50.76 O ATOM 6883 CB LEU A 452 9.409 87.349 53.686 1.00 46.92 C ATOM 6884 CG LEU A 452 10.007 86.231 52.818 1.00 50.68 C ATOM 6885 CD1 LEU A 452 9.711 86.569 51.328 1.00 46.75 C ATOM 6886 CD2 LEU A 452 11.500 85.989 53.080 1.00 47.22 C ATOM 6887 HA LEU A 452 10.801 87.985 55.193 1.00 0.00 H ATOM 6888 HB2 LEU A 452 8.332 87.183 53.680 1.00 0.00 H ATOM 6889 HB3 LEU A 452 9.635 88.280 53.166 1.00 0.00 H ATOM 6890 HG LEU A 452 9.535 85.285 53.084 1.00 0.00 H ATOM 6891 HD21 LEU A 452 12.057 86.902 52.869 1.00 0.00 H ATOM 6892 HD22 LEU A 452 11.643 85.707 54.123 1.00 0.00 H ATOM 6893 HD23 LEU A 452 11.856 85.187 52.433 1.00 0.00 H ATOM 6894 HD11 LEU A 452 8.633 86.628 51.177 1.00 0.00 H ATOM 6895 HD12 LEU A 452 10.167 87.527 51.076 1.00 0.00 H ATOM 6896 HD13 LEU A 452 10.126 85.789 50.690 1.00 0.00 H ATOM 6897 H LEU A 452 9.248 85.556 55.716 1.00 0.00 H ATOM 6898 N VAL A 453 7.960 88.178 56.691 1.00 50.82 N ATOM 6899 CA VAL A 453 7.019 89.126 57.253 1.00 52.60 C ATOM 6900 C VAL A 453 7.579 89.676 58.569 1.00 53.60 C ATOM 6901 O VAL A 453 7.830 88.953 59.556 1.00 53.07 O ATOM 6902 CB VAL A 453 5.566 88.531 57.419 1.00 53.36 C ATOM 6903 CG1 VAL A 453 5.469 87.145 56.776 1.00 54.23 C ATOM 6904 CG2 VAL A 453 5.135 88.533 58.856 1.00 53.25 C ATOM 6905 HA VAL A 453 6.903 89.949 56.548 1.00 0.00 H ATOM 6906 HB VAL A 453 4.867 89.178 56.888 1.00 0.00 H ATOM 6907 HG11 VAL A 453 5.698 87.222 55.713 1.00 0.00 H ATOM 6908 HG12 VAL A 453 6.181 86.473 57.255 1.00 0.00 H ATOM 6909 HG13 VAL A 453 4.459 86.757 56.904 1.00 0.00 H ATOM 6910 HG21 VAL A 453 5.827 87.928 59.442 1.00 0.00 H ATOM 6911 HG22 VAL A 453 5.136 89.556 59.233 1.00 0.00 H ATOM 6912 HG23 VAL A 453 4.131 88.117 58.933 1.00 0.00 H ATOM 6913 H VAL A 453 7.993 87.198 57.038 1.00 0.00 H ATOM 6914 N LYS A 454 7.798 90.982 58.555 1.00 54.47 N ATOM 6915 CA LYS A 454 8.370 91.699 59.699 1.00 56.24 C ATOM 6916 C LYS A 454 7.739 91.441 61.065 1.00 55.04 C ATOM 6917 O LYS A 454 8.431 91.135 62.023 1.00 54.34 O ATOM 6918 CB LYS A 454 8.384 93.206 59.385 1.00 59.46 C ATOM 6919 CG LYS A 454 9.668 93.688 58.658 1.00 63.12 C ATOM 6920 CD LYS A 454 10.055 92.892 57.364 1.00 65.22 C ATOM 6921 CE LYS A 454 11.401 93.415 56.789 1.00 66.75 C ATOM 6922 NZ LYS A 454 11.971 92.554 55.725 1.00 65.58 N ATOM 6923 HA LYS A 454 9.375 91.293 59.812 1.00 0.00 H ATOM 6924 HB2 LYS A 454 7.526 93.432 58.752 1.00 0.00 H ATOM 6925 HB3 LYS A 454 8.296 93.753 60.324 1.00 0.00 H ATOM 6926 HG2 LYS A 454 9.524 94.732 58.379 1.00 0.00 H ATOM 6927 HG3 LYS A 454 10.499 93.612 59.359 1.00 0.00 H ATOM 6928 HD2 LYS A 454 10.155 91.835 57.609 1.00 0.00 H ATOM 6929 HD3 LYS A 454 9.272 93.018 56.617 1.00 0.00 H ATOM 6930 HE2 LYS A 454 12.122 93.478 57.604 1.00 0.00 H ATOM 6931 HE3 LYS A 454 11.235 94.410 56.375 1.00 0.00 H ATOM 6932 HZ1 LYS A 454 12.146 91.603 56.107 1.00 0.00 H ATOM 6933 HZ2 LYS A 454 11.299 92.492 54.933 1.00 0.00 H ATOM 6934 HZ3 LYS A 454 12.866 92.965 55.391 1.00 0.00 H ATOM 6935 H LYS A 454 7.555 91.520 57.699 1.00 0.00 H ATOM 6936 N GLU A 455 6.430 91.552 61.164 1.00 55.09 N ATOM 6937 CA GLU A 455 5.798 91.314 62.440 1.00 56.89 C ATOM 6938 C GLU A 455 6.178 89.965 63.043 1.00 56.89 C ATOM 6939 O GLU A 455 5.990 89.756 64.234 1.00 57.69 O ATOM 6940 CB GLU A 455 4.280 91.378 62.296 1.00 59.25 C ATOM 6941 CG GLU A 455 3.799 92.517 61.416 1.00 64.77 C ATOM 6942 CD GLU A 455 3.985 92.232 59.921 1.00 67.49 C ATOM 6943 OE1 GLU A 455 3.091 91.569 59.332 1.00 68.72 O ATOM 6944 OE2 GLU A 455 5.023 92.662 59.342 1.00 68.61 O ATOM 6945 HA GLU A 455 6.153 92.095 63.112 1.00 0.00 H ATOM 6946 HB2 GLU A 455 3.935 90.439 61.863 1.00 0.00 H ATOM 6947 HB3 GLU A 455 3.845 91.501 63.288 1.00 0.00 H ATOM 6948 HG2 GLU A 455 2.739 92.684 61.610 1.00 0.00 H ATOM 6949 HG3 GLU A 455 4.360 93.416 61.672 1.00 0.00 H ATOM 6950 H GLU A 455 5.859 91.808 60.333 1.00 0.00 H ATOM 6951 N LEU A 456 6.690 89.026 62.253 1.00 56.25 N ATOM 6952 CA LEU A 456 7.004 87.731 62.848 1.00 55.92 C ATOM 6953 C LEU A 456 8.333 87.731 63.594 1.00 56.64 C ATOM 6954 O LEU A 456 8.674 86.773 64.274 1.00 57.68 O ATOM 6955 CB LEU A 456 6.939 86.613 61.797 1.00 54.67 C ATOM 6956 CG LEU A 456 5.517 86.274 61.317 1.00 53.88 C ATOM 6957 CD1 LEU A 456 5.533 84.982 60.486 1.00 53.29 C ATOM 6958 CD2 LEU A 456 4.586 86.135 62.515 1.00 50.64 C ATOM 6959 HA LEU A 456 6.239 87.532 63.598 1.00 0.00 H ATOM 6960 HB2 LEU A 456 7.526 86.923 60.933 1.00 0.00 H ATOM 6961 HB3 LEU A 456 7.377 85.713 62.229 1.00 0.00 H ATOM 6962 HG LEU A 456 5.150 87.082 60.684 1.00 0.00 H ATOM 6963 HD21 LEU A 456 4.947 85.337 63.164 1.00 0.00 H ATOM 6964 HD22 LEU A 456 4.566 87.074 63.068 1.00 0.00 H ATOM 6965 HD23 LEU A 456 3.581 85.895 62.167 1.00 0.00 H ATOM 6966 HD11 LEU A 456 6.181 85.117 59.620 1.00 0.00 H ATOM 6967 HD12 LEU A 456 5.909 84.162 61.098 1.00 0.00 H ATOM 6968 HD13 LEU A 456 4.521 84.753 60.153 1.00 0.00 H ATOM 6969 H LEU A 456 6.861 89.209 61.244 1.00 0.00 H ATOM 6970 N ASN A 457 9.092 88.808 63.452 1.00 57.15 N ATOM 6971 CA ASN A 457 10.315 88.958 64.215 1.00 57.17 C ATOM 6972 C ASN A 457 11.476 88.043 63.911 1.00 55.85 C ATOM 6973 O ASN A 457 12.068 87.520 64.864 1.00 55.93 O ATOM 6974 CB ASN A 457 10.030 88.778 65.720 1.00 59.94 C ATOM 6975 CG ASN A 457 9.101 89.846 66.308 1.00 62.04 C ATOM 6976 OD1 ASN A 457 8.523 89.652 67.395 1.00 63.19 O ATOM 6977 ND2 ASN A 457 8.965 90.971 65.614 1.00 62.92 N ATOM 6978 HA ASN A 457 10.629 89.958 63.915 1.00 0.00 H ATOM 6979 HB2 ASN A 457 9.568 87.802 65.868 1.00 0.00 H ATOM 6980 HB3 ASN A 457 10.978 88.815 66.256 1.00 0.00 H ATOM 6981 HD22 ASN A 457 9.467 91.089 64.711 1.00 0.00 H ATOM 6982 HD21 ASN A 457 8.356 91.734 65.974 1.00 0.00 H ATOM 6983 H ASN A 457 8.807 89.554 62.786 1.00 0.00 H ATOM 6984 N TYR A 458 11.805 87.798 62.652 1.00 53.10 N ATOM 6985 CA TYR A 458 12.997 86.978 62.405 1.00 50.83 C ATOM 6986 C TYR A 458 14.136 87.961 62.158 1.00 51.08 C ATOM 6987 O TYR A 458 13.903 89.153 61.956 1.00 51.94 O ATOM 6988 CB TYR A 458 12.840 86.071 61.167 1.00 48.55 C ATOM 6989 CG TYR A 458 11.860 84.925 61.371 1.00 45.30 C ATOM 6990 CD1 TYR A 458 10.475 85.120 61.223 1.00 44.86 C ATOM 6991 CD2 TYR A 458 12.316 83.648 61.689 1.00 43.77 C ATOM 6992 CE1 TYR A 458 9.546 84.055 61.386 1.00 41.22 C ATOM 6993 CE2 TYR A 458 11.414 82.565 61.843 1.00 43.68 C ATOM 6994 CZ TYR A 458 10.030 82.767 61.690 1.00 43.09 C ATOM 6995 OH TYR A 458 9.155 81.675 61.792 1.00 39.47 O ATOM 6996 HA TYR A 458 13.175 86.320 63.256 1.00 0.00 H ATOM 6997 HB3 TYR A 458 13.815 85.651 60.921 1.00 0.00 H ATOM 6998 HB2 TYR A 458 12.489 86.681 60.335 1.00 0.00 H ATOM 6999 HD2 TYR A 458 13.384 83.478 61.822 1.00 0.00 H ATOM 7000 HE2 TYR A 458 11.794 81.572 62.081 1.00 0.00 H ATOM 7001 HE1 TYR A 458 8.476 84.233 61.277 1.00 0.00 H ATOM 7002 HD1 TYR A 458 10.103 86.115 60.977 1.00 0.00 H ATOM 7003 HH TYR A 458 9.244 81.265 62.689 1.00 0.00 H ATOM 7004 H TYR A 458 11.238 88.174 61.865 1.00 0.00 H ATOM 7005 N THR A 459 15.368 87.474 62.170 1.00 50.63 N ATOM 7006 CA THR A 459 16.505 88.335 61.910 1.00 49.67 C ATOM 7007 C THR A 459 16.593 88.532 60.419 1.00 50.37 C ATOM 7008 O THR A 459 16.005 87.773 59.646 1.00 50.43 O ATOM 7009 CB THR A 459 17.794 87.689 62.343 1.00 48.73 C ATOM 7010 OG1 THR A 459 17.985 86.505 61.561 1.00 48.57 O ATOM 7011 CG2 THR A 459 17.752 87.348 63.850 1.00 47.83 C ATOM 7012 HA THR A 459 16.369 89.268 62.457 1.00 0.00 H ATOM 7013 HB THR A 459 18.626 88.375 62.186 1.00 0.00 H ATOM 7014 HG1 THR A 459 18.830 86.065 61.832 1.00 0.00 H ATOM 7015 HG23 THR A 459 17.606 88.263 64.424 1.00 0.00 H ATOM 7016 HG21 THR A 459 16.928 86.661 64.043 1.00 0.00 H ATOM 7017 HG22 THR A 459 18.692 86.880 64.142 1.00 0.00 H ATOM 7018 H THR A 459 15.521 86.465 62.368 1.00 0.00 H ATOM 7019 N ALA A 460 17.362 89.523 59.996 1.00 49.87 N ATOM 7020 CA ALA A 460 17.489 89.765 58.574 1.00 49.18 C ATOM 7021 C ALA A 460 18.154 88.570 57.928 1.00 48.84 C ATOM 7022 O ALA A 460 17.893 88.279 56.753 1.00 49.29 O ATOM 7023 CB ALA A 460 18.308 91.013 58.311 1.00 48.94 C ATOM 7024 HA ALA A 460 16.496 89.914 58.150 1.00 0.00 H ATOM 7025 HB1 ALA A 460 17.818 91.871 58.772 1.00 0.00 H ATOM 7026 HB2 ALA A 460 19.304 90.889 58.737 1.00 0.00 H ATOM 7027 HB3 ALA A 460 18.389 91.173 57.236 1.00 0.00 H ATOM 7028 H ALA A 460 17.870 90.122 60.678 1.00 0.00 H ATOM 7029 N GLU A 461 19.024 87.880 58.664 1.00 48.30 N ATOM 7030 CA GLU A 461 19.693 86.722 58.080 1.00 49.27 C ATOM 7031 C GLU A 461 18.739 85.525 57.951 1.00 47.31 C ATOM 7032 O GLU A 461 18.895 84.711 57.061 1.00 47.41 O ATOM 7033 CB GLU A 461 20.943 86.349 58.876 1.00 52.13 C ATOM 7034 CG GLU A 461 20.924 86.813 60.313 1.00 58.85 C ATOM 7035 CD GLU A 461 21.156 88.311 60.459 1.00 59.81 C ATOM 7036 OE1 GLU A 461 22.187 88.796 59.950 1.00 62.49 O ATOM 7037 OE2 GLU A 461 20.307 88.996 61.078 1.00 62.07 O ATOM 7038 HA GLU A 461 20.007 86.998 57.074 1.00 0.00 H ATOM 7039 HB2 GLU A 461 21.042 85.264 58.868 1.00 0.00 H ATOM 7040 HB3 GLU A 461 21.807 86.795 58.384 1.00 0.00 H ATOM 7041 HG2 GLU A 461 19.953 86.568 60.744 1.00 0.00 H ATOM 7042 HG3 GLU A 461 21.706 86.285 60.859 1.00 0.00 H ATOM 7043 H GLU A 461 19.224 88.164 59.644 1.00 0.00 H ATOM 7044 N GLU A 462 17.766 85.428 58.846 1.00 46.04 N ATOM 7045 CA GLU A 462 16.764 84.374 58.745 1.00 46.00 C ATOM 7046 C GLU A 462 15.874 84.647 57.513 1.00 46.21 C ATOM 7047 O GLU A 462 15.481 83.714 56.804 1.00 45.50 O ATOM 7048 CB GLU A 462 15.947 84.286 60.037 1.00 44.68 C ATOM 7049 CG GLU A 462 16.824 83.736 61.170 1.00 44.63 C ATOM 7050 CD GLU A 462 16.156 83.649 62.542 1.00 45.46 C ATOM 7051 OE1 GLU A 462 15.328 84.521 62.879 1.00 44.46 O ATOM 7052 OE2 GLU A 462 16.494 82.702 63.307 1.00 45.57 O ATOM 7053 HA GLU A 462 17.249 83.407 58.613 1.00 0.00 H ATOM 7054 HB2 GLU A 462 15.588 85.279 60.307 1.00 0.00 H ATOM 7055 HB3 GLU A 462 15.096 83.622 59.883 1.00 0.00 H ATOM 7056 HG2 GLU A 462 17.145 82.733 60.889 1.00 0.00 H ATOM 7057 HG3 GLU A 462 17.697 84.382 61.262 1.00 0.00 H ATOM 7058 H GLU A 462 17.717 86.111 59.629 1.00 0.00 H ATOM 7059 N GLU A 463 15.590 85.921 57.227 1.00 45.89 N ATOM 7060 CA GLU A 463 14.794 86.256 56.054 1.00 45.87 C ATOM 7061 C GLU A 463 15.583 85.821 54.840 1.00 45.66 C ATOM 7062 O GLU A 463 15.021 85.215 53.898 1.00 44.97 O ATOM 7063 CB GLU A 463 14.508 87.762 55.950 1.00 48.02 C ATOM 7064 CG GLU A 463 14.297 88.222 54.505 1.00 50.77 C ATOM 7065 CD GLU A 463 13.678 89.608 54.383 1.00 51.61 C ATOM 7066 OE1 GLU A 463 13.841 90.431 55.304 1.00 56.03 O ATOM 7067 OE2 GLU A 463 13.045 89.886 53.348 1.00 53.54 O ATOM 7068 HA GLU A 463 13.831 85.751 56.125 1.00 0.00 H ATOM 7069 HB2 GLU A 463 13.609 87.987 56.523 1.00 0.00 H ATOM 7070 HB3 GLU A 463 15.352 88.308 56.371 1.00 0.00 H ATOM 7071 HG2 GLU A 463 15.265 88.232 54.003 1.00 0.00 H ATOM 7072 HG3 GLU A 463 13.640 87.507 54.010 1.00 0.00 H ATOM 7073 H GLU A 463 15.940 86.679 57.847 1.00 0.00 H ATOM 7074 N ALA A 464 16.888 86.101 54.855 1.00 42.90 N ATOM 7075 CA ALA A 464 17.693 85.711 53.715 1.00 41.92 C ATOM 7076 C ALA A 464 17.769 84.167 53.547 1.00 41.30 C ATOM 7077 O ALA A 464 17.771 83.661 52.417 1.00 39.21 O ATOM 7078 CB ALA A 464 19.111 86.342 53.818 1.00 41.66 C ATOM 7079 HA ALA A 464 17.206 86.094 52.818 1.00 0.00 H ATOM 7080 HB1 ALA A 464 19.023 87.428 53.839 1.00 0.00 H ATOM 7081 HB2 ALA A 464 19.595 85.998 54.732 1.00 0.00 H ATOM 7082 HB3 ALA A 464 19.705 86.041 52.955 1.00 0.00 H ATOM 7083 H ALA A 464 17.318 86.588 55.667 1.00 0.00 H ATOM 7084 N LEU A 465 17.855 83.419 54.653 1.00 40.72 N ATOM 7085 CA LEU A 465 17.882 81.939 54.562 1.00 39.82 C ATOM 7086 C LEU A 465 16.545 81.443 53.947 1.00 38.10 C ATOM 7087 O LEU A 465 16.521 80.604 53.039 1.00 38.43 O ATOM 7088 CB LEU A 465 18.074 81.344 55.965 1.00 40.60 C ATOM 7089 CG LEU A 465 17.935 79.839 56.171 1.00 37.45 C ATOM 7090 CD1 LEU A 465 18.919 79.096 55.267 1.00 38.75 C ATOM 7091 CD2 LEU A 465 18.184 79.545 57.647 1.00 38.97 C ATOM 7092 HA LEU A 465 18.709 81.620 53.927 1.00 0.00 H ATOM 7093 HB2 LEU A 465 19.078 81.617 56.290 1.00 0.00 H ATOM 7094 HB3 LEU A 465 17.341 81.822 56.615 1.00 0.00 H ATOM 7095 HG LEU A 465 16.936 79.496 55.903 1.00 0.00 H ATOM 7096 HD21 LEU A 465 19.188 79.873 57.917 1.00 0.00 H ATOM 7097 HD22 LEU A 465 17.451 80.079 58.251 1.00 0.00 H ATOM 7098 HD23 LEU A 465 18.091 78.473 57.823 1.00 0.00 H ATOM 7099 HD11 LEU A 465 18.707 79.338 54.225 1.00 0.00 H ATOM 7100 HD12 LEU A 465 19.937 79.400 55.512 1.00 0.00 H ATOM 7101 HD13 LEU A 465 18.812 78.022 55.421 1.00 0.00 H ATOM 7102 H LEU A 465 17.903 83.879 55.584 1.00 0.00 H ATOM 7103 N SER A 466 15.436 81.996 54.425 1.00 37.40 N ATOM 7104 CA SER A 466 14.127 81.633 53.897 1.00 38.59 C ATOM 7105 C SER A 466 14.097 81.898 52.395 1.00 39.69 C ATOM 7106 O SER A 466 13.730 81.025 51.591 1.00 39.95 O ATOM 7107 CB SER A 466 13.027 82.418 54.621 1.00 37.50 C ATOM 7108 OG SER A 466 11.720 82.117 54.124 1.00 36.14 O ATOM 7109 HA SER A 466 13.944 80.572 54.067 1.00 0.00 H ATOM 7110 HB2 SER A 466 13.214 83.484 54.490 1.00 0.00 H ATOM 7111 HB3 SER A 466 13.063 82.172 55.682 1.00 0.00 H ATOM 7112 HG SER A 466 11.536 81.152 54.246 1.00 0.00 H ATOM 7113 H SER A 466 15.503 82.699 55.188 1.00 0.00 H ATOM 7114 N ARG A 467 14.543 83.074 51.975 1.00 40.93 N ATOM 7115 CA ARG A 467 14.513 83.339 50.539 1.00 41.68 C ATOM 7116 C ARG A 467 15.368 82.367 49.746 1.00 41.76 C ATOM 7117 O ARG A 467 14.961 81.964 48.639 1.00 39.76 O ATOM 7118 CB ARG A 467 14.904 84.790 50.207 1.00 43.02 C ATOM 7119 CG ARG A 467 13.808 85.839 50.532 1.00 44.98 C ATOM 7120 CD ARG A 467 14.356 87.303 50.335 1.00 44.90 C ATOM 7121 NE ARG A 467 13.359 88.301 50.735 1.00 43.16 N ATOM 7122 CZ ARG A 467 12.270 88.608 50.034 1.00 43.95 C ATOM 7123 NH1 ARG A 467 12.025 88.019 48.868 1.00 41.19 N ATOM 7124 NH2 ARG A 467 11.381 89.460 50.543 1.00 45.00 N ATOM 7125 HA ARG A 467 13.477 83.189 50.236 1.00 0.00 H ATOM 7126 HB2 ARG A 467 15.798 85.042 50.778 1.00 0.00 H ATOM 7127 HB3 ARG A 467 15.127 84.848 49.142 1.00 0.00 H ATOM 7128 HG2 ARG A 467 12.957 85.684 49.869 1.00 0.00 H ATOM 7129 HG3 ARG A 467 13.489 85.713 51.567 1.00 0.00 H ATOM 7130 HD2 ARG A 467 14.606 87.451 49.284 1.00 0.00 H ATOM 7131 HD3 ARG A 467 15.252 87.432 50.942 1.00 0.00 H ATOM 7132 HE ARG A 467 13.514 88.805 51.631 1.00 0.00 H ATOM 7133 HH12 ARG A 467 11.171 88.267 48.329 1.00 0.00 H ATOM 7134 HH11 ARG A 467 12.688 87.310 48.494 1.00 0.00 H ATOM 7135 HH22 ARG A 467 10.527 89.706 50.002 1.00 0.00 H ATOM 7136 HH21 ARG A 467 11.541 89.880 51.481 1.00 0.00 H ATOM 7137 H ARG A 467 14.902 83.784 52.645 1.00 0.00 H ATOM 7138 N ARG A 468 16.541 81.969 50.250 1.00 40.98 N ATOM 7139 CA ARG A 468 17.269 81.002 49.434 1.00 43.02 C ATOM 7140 C ARG A 468 16.629 79.607 49.455 1.00 40.29 C ATOM 7141 O ARG A 468 16.728 78.904 48.478 1.00 39.32 O ATOM 7142 CB ARG A 468 18.742 80.845 49.812 1.00 45.75 C ATOM 7143 CG ARG A 468 19.184 81.594 50.963 1.00 50.47 C ATOM 7144 CD ARG A 468 20.724 81.630 50.842 1.00 55.03 C ATOM 7145 NE ARG A 468 21.295 80.297 50.643 1.00 55.83 N ATOM 7146 CZ ARG A 468 21.723 79.514 51.636 1.00 55.57 C ATOM 7147 NH1 ARG A 468 21.631 79.941 52.888 1.00 55.47 N ATOM 7148 NH2 ARG A 468 22.293 78.324 51.375 1.00 54.40 N ATOM 7149 HA ARG A 468 17.211 81.428 48.433 1.00 0.00 H ATOM 7150 HB2 ARG A 468 18.925 79.789 50.011 1.00 0.00 H ATOM 7151 HB3 ARG A 468 19.341 81.161 48.958 1.00 0.00 H ATOM 7152 HG2 ARG A 468 18.773 82.604 50.946 1.00 0.00 H ATOM 7153 HG3 ARG A 468 18.882 81.096 51.885 1.00 0.00 H ATOM 7154 HD2 ARG A 468 21.138 82.057 51.756 1.00 0.00 H ATOM 7155 HD3 ARG A 468 20.995 82.258 49.994 1.00 0.00 H ATOM 7156 HE ARG A 468 21.372 79.938 49.670 1.00 0.00 H ATOM 7157 HH12 ARG A 468 21.962 79.338 53.669 1.00 0.00 H ATOM 7158 HH11 ARG A 468 21.228 80.878 53.089 1.00 0.00 H ATOM 7159 HH22 ARG A 468 22.623 77.723 52.157 1.00 0.00 H ATOM 7160 HH21 ARG A 468 22.404 78.005 50.391 1.00 0.00 H ATOM 7161 H ARG A 468 16.908 82.322 51.157 1.00 0.00 H ATOM 7162 N ILE A 469 16.000 79.216 50.568 1.00 39.81 N ATOM 7163 CA ILE A 469 15.360 77.905 50.620 1.00 38.13 C ATOM 7164 C ILE A 469 14.171 77.918 49.653 1.00 38.03 C ATOM 7165 O ILE A 469 14.003 77.009 48.807 1.00 38.68 O ATOM 7166 CB ILE A 469 14.954 77.549 52.121 1.00 37.01 C ATOM 7167 CG1 ILE A 469 16.228 77.151 52.902 1.00 33.64 C ATOM 7168 CG2 ILE A 469 13.917 76.409 52.164 1.00 34.54 C ATOM 7169 CD1 ILE A 469 15.984 76.993 54.374 1.00 31.91 C ATOM 7170 HA ILE A 469 16.043 77.117 50.303 1.00 0.00 H ATOM 7171 HB ILE A 469 14.495 78.424 52.582 1.00 0.00 H ATOM 7172 HG12 ILE A 469 16.597 76.205 52.507 1.00 0.00 H ATOM 7173 HG13 ILE A 469 16.982 77.924 52.755 1.00 0.00 H ATOM 7174 HD11 ILE A 469 15.623 77.936 54.784 1.00 0.00 H ATOM 7175 HD12 ILE A 469 15.238 76.215 54.536 1.00 0.00 H ATOM 7176 HD13 ILE A 469 16.915 76.713 54.867 1.00 0.00 H ATOM 7177 HG21 ILE A 469 13.021 76.714 51.624 1.00 0.00 H ATOM 7178 HG22 ILE A 469 14.338 75.519 51.697 1.00 0.00 H ATOM 7179 HG23 ILE A 469 13.662 76.191 53.201 1.00 0.00 H ATOM 7180 H ILE A 469 15.967 79.845 51.396 1.00 0.00 H ATOM 7181 N MET A 470 13.369 78.968 49.712 1.00 38.22 N ATOM 7182 CA MET A 470 12.247 79.049 48.782 1.00 39.21 C ATOM 7183 C MET A 470 12.709 78.994 47.315 1.00 38.54 C ATOM 7184 O MET A 470 12.081 78.297 46.469 1.00 36.92 O ATOM 7185 CB MET A 470 11.419 80.324 49.003 1.00 39.65 C ATOM 7186 CG MET A 470 10.665 80.371 50.334 1.00 40.36 C ATOM 7187 SD MET A 470 9.368 81.650 50.227 1.00 43.55 S ATOM 7188 CE MET A 470 10.417 83.114 50.655 1.00 40.13 C ATOM 7189 HA MET A 470 11.623 78.179 48.985 1.00 0.00 H ATOM 7190 HB2 MET A 470 12.094 81.179 48.964 1.00 0.00 H ATOM 7191 HB3 MET A 470 10.690 80.401 48.196 1.00 0.00 H ATOM 7192 HG2 MET A 470 11.357 80.617 51.139 1.00 0.00 H ATOM 7193 HG3 MET A 470 10.209 79.401 50.532 1.00 0.00 H ATOM 7194 HE1 MET A 470 10.844 82.975 51.648 1.00 0.00 H ATOM 7195 HE2 MET A 470 11.219 83.211 49.923 1.00 0.00 H ATOM 7196 HE3 MET A 470 9.803 84.015 50.645 1.00 0.00 H ATOM 7197 H MET A 470 13.535 79.722 50.408 1.00 0.00 H ATOM 7198 N HIS A 471 13.813 79.683 47.013 1.00 38.58 N ATOM 7199 CA HIS A 471 14.288 79.704 45.646 1.00 39.09 C ATOM 7200 C HIS A 471 14.888 78.353 45.292 1.00 39.35 C ATOM 7201 O HIS A 471 14.761 77.899 44.145 1.00 39.88 O ATOM 7202 CB HIS A 471 15.292 80.854 45.396 1.00 40.55 C ATOM 7203 CG HIS A 471 15.512 81.147 43.936 1.00 41.33 C ATOM 7204 ND1 HIS A 471 14.477 81.475 43.076 1.00 43.05 N ATOM 7205 CD2 HIS A 471 16.627 81.069 43.162 1.00 41.74 C ATOM 7206 CE1 HIS A 471 14.941 81.579 41.839 1.00 41.45 C ATOM 7207 NE2 HIS A 471 16.241 81.337 41.864 1.00 42.37 N ATOM 7208 HA HIS A 471 13.437 79.894 44.992 1.00 0.00 H ATOM 7209 HB2 HIS A 471 14.912 81.756 45.876 1.00 0.00 H ATOM 7210 HB3 HIS A 471 16.248 80.581 45.842 1.00 0.00 H ATOM 7211 HD2 HIS A 471 17.636 80.838 43.502 1.00 0.00 H ATOM 7212 HE1 HIS A 471 14.353 81.822 40.954 1.00 0.00 H ATOM 7213 H HIS A 471 14.327 80.200 47.754 1.00 0.00 H ATOM 7214 N TYR A 472 15.561 77.704 46.245 1.00 39.56 N ATOM 7215 CA TYR A 472 16.095 76.357 45.944 1.00 39.14 C ATOM 7216 C TYR A 472 14.886 75.424 45.650 1.00 37.18 C ATOM 7217 O TYR A 472 14.874 74.689 44.667 1.00 37.49 O ATOM 7218 CB TYR A 472 16.800 75.738 47.151 1.00 39.87 C ATOM 7219 CG TYR A 472 18.192 76.203 47.484 1.00 40.53 C ATOM 7220 CD1 TYR A 472 19.146 76.463 46.478 1.00 42.64 C ATOM 7221 CD2 TYR A 472 18.594 76.280 48.828 1.00 41.55 C ATOM 7222 CE1 TYR A 472 20.479 76.787 46.825 1.00 42.83 C ATOM 7223 CE2 TYR A 472 19.886 76.587 49.184 1.00 42.58 C ATOM 7224 CZ TYR A 472 20.829 76.843 48.190 1.00 45.00 C ATOM 7225 OH TYR A 472 22.104 77.193 48.601 1.00 48.03 O ATOM 7226 HA TYR A 472 16.794 76.455 45.114 1.00 0.00 H ATOM 7227 HB3 TYR A 472 16.852 74.663 46.978 1.00 0.00 H ATOM 7228 HB2 TYR A 472 16.177 75.934 48.024 1.00 0.00 H ATOM 7229 HD2 TYR A 472 17.860 76.091 49.611 1.00 0.00 H ATOM 7230 HE2 TYR A 472 20.171 76.630 50.235 1.00 0.00 H ATOM 7231 HE1 TYR A 472 21.221 76.989 46.052 1.00 0.00 H ATOM 7232 HD1 TYR A 472 18.855 76.414 45.429 1.00 0.00 H ATOM 7233 HH TYR A 472 22.675 77.348 47.807 1.00 0.00 H ATOM 7234 H TYR A 472 15.707 78.136 47.180 1.00 0.00 H ATOM 7235 N TRP A 473 13.887 75.433 46.536 1.00 36.50 N ATOM 7236 CA TRP A 473 12.734 74.543 46.339 1.00 35.01 C ATOM 7237 C TRP A 473 12.008 74.810 45.006 1.00 35.59 C ATOM 7238 O TRP A 473 11.651 73.874 44.293 1.00 36.09 O ATOM 7239 CB TRP A 473 11.701 74.688 47.478 1.00 32.66 C ATOM 7240 CG TRP A 473 11.800 73.687 48.688 1.00 32.74 C ATOM 7241 CD1 TRP A 473 10.756 73.076 49.333 1.00 29.65 C ATOM 7242 CD2 TRP A 473 12.982 73.371 49.453 1.00 31.42 C ATOM 7243 NE1 TRP A 473 11.211 72.403 50.478 1.00 30.65 N ATOM 7244 CE2 TRP A 473 12.571 72.575 50.565 1.00 32.39 C ATOM 7245 CE3 TRP A 473 14.350 73.688 49.309 1.00 30.59 C ATOM 7246 CZ2 TRP A 473 13.493 72.094 51.540 1.00 31.64 C ATOM 7247 CZ3 TRP A 473 15.270 73.201 50.274 1.00 31.87 C ATOM 7248 CH2 TRP A 473 14.824 72.411 51.382 1.00 30.87 C ATOM 7249 HA TRP A 473 13.145 73.534 46.331 1.00 0.00 H ATOM 7250 HB2 TRP A 473 11.799 75.696 47.880 1.00 0.00 H ATOM 7251 HB3 TRP A 473 10.711 74.569 47.037 1.00 0.00 H ATOM 7252 HE1 TRP A 473 10.620 71.867 51.145 1.00 0.00 H ATOM 7253 HD1 TRP A 473 9.718 73.108 49.003 1.00 0.00 H ATOM 7254 HZ2 TRP A 473 13.155 71.494 52.385 1.00 0.00 H ATOM 7255 HH2 TRP A 473 15.550 72.055 52.113 1.00 0.00 H ATOM 7256 HZ3 TRP A 473 16.330 73.431 50.170 1.00 0.00 H ATOM 7257 HE3 TRP A 473 14.694 74.296 48.472 1.00 0.00 H ATOM 7258 H TRP A 473 13.925 76.066 47.360 1.00 0.00 H ATOM 7259 N ALA A 474 11.760 76.080 44.672 1.00 35.77 N ATOM 7260 CA ALA A 474 11.005 76.397 43.441 1.00 35.06 C ATOM 7261 C ALA A 474 11.821 76.190 42.211 1.00 34.37 C ATOM 7262 O ALA A 474 11.295 75.791 41.188 1.00 35.12 O ATOM 7263 CB ALA A 474 10.456 77.828 43.483 1.00 35.18 C ATOM 7264 HA ALA A 474 10.166 75.702 43.399 1.00 0.00 H ATOM 7265 HB1 ALA A 474 9.789 77.935 44.339 1.00 0.00 H ATOM 7266 HB2 ALA A 474 11.284 78.531 43.576 1.00 0.00 H ATOM 7267 HB3 ALA A 474 9.906 78.032 42.564 1.00 0.00 H ATOM 7268 H ALA A 474 12.100 76.850 45.282 1.00 0.00 H ATOM 7269 N THR A 475 13.120 76.427 42.297 1.00 35.50 N ATOM 7270 CA THR A 475 13.946 76.207 41.125 1.00 36.14 C ATOM 7271 C THR A 475 14.036 74.690 40.890 1.00 36.76 C ATOM 7272 O THR A 475 14.079 74.231 39.734 1.00 35.35 O ATOM 7273 CB THR A 475 15.390 76.732 41.319 1.00 36.63 C ATOM 7274 OG1 THR A 475 15.354 78.156 41.568 1.00 37.36 O ATOM 7275 CG2 THR A 475 16.224 76.406 40.074 1.00 33.32 C ATOM 7276 HA THR A 475 13.494 76.739 40.288 1.00 0.00 H ATOM 7277 HB THR A 475 15.854 76.246 42.177 1.00 0.00 H ATOM 7278 HG1 THR A 475 14.824 78.334 42.385 1.00 0.00 H ATOM 7279 HG23 THR A 475 16.231 75.328 39.915 1.00 0.00 H ATOM 7280 HG21 THR A 475 15.787 76.900 39.206 1.00 0.00 H ATOM 7281 HG22 THR A 475 17.245 76.760 40.219 1.00 0.00 H ATOM 7282 H THR A 475 13.540 76.764 43.187 1.00 0.00 H ATOM 7283 N PHE A 476 14.103 73.917 41.981 1.00 36.08 N ATOM 7284 CA PHE A 476 14.154 72.473 41.796 1.00 36.23 C ATOM 7285 C PHE A 476 12.803 72.021 41.177 1.00 36.24 C ATOM 7286 O PHE A 476 12.767 71.180 40.254 1.00 35.43 O ATOM 7287 CB PHE A 476 14.353 71.738 43.147 1.00 35.38 C ATOM 7288 CG PHE A 476 14.128 70.254 43.053 1.00 35.61 C ATOM 7289 CD1 PHE A 476 15.118 69.425 42.557 1.00 34.55 C ATOM 7290 CD2 PHE A 476 12.902 69.690 43.441 1.00 36.68 C ATOM 7291 CE1 PHE A 476 14.912 68.022 42.448 1.00 35.09 C ATOM 7292 CE2 PHE A 476 12.675 68.299 43.336 1.00 34.68 C ATOM 7293 CZ PHE A 476 13.686 67.463 42.841 1.00 35.55 C ATOM 7294 HA PHE A 476 14.995 72.228 41.147 1.00 0.00 H ATOM 7295 HB2 PHE A 476 15.373 71.913 43.490 1.00 0.00 H ATOM 7296 HB3 PHE A 476 13.651 72.150 43.872 1.00 0.00 H ATOM 7297 HD2 PHE A 476 12.113 70.335 43.829 1.00 0.00 H ATOM 7298 HE2 PHE A 476 11.717 67.877 43.639 1.00 0.00 H ATOM 7299 HZ PHE A 476 13.521 66.388 42.762 1.00 0.00 H ATOM 7300 HE1 PHE A 476 15.705 67.382 42.060 1.00 0.00 H ATOM 7301 HD1 PHE A 476 16.070 69.854 42.245 1.00 0.00 H ATOM 7302 H PHE A 476 14.118 74.335 42.933 1.00 0.00 H ATOM 7303 N ALA A 477 11.693 72.580 41.670 1.00 35.03 N ATOM 7304 CA ALA A 477 10.383 72.162 41.160 1.00 35.30 C ATOM 7305 C ALA A 477 10.312 72.448 39.682 1.00 37.71 C ATOM 7306 O ALA A 477 9.809 71.629 38.875 1.00 37.82 O ATOM 7307 CB ALA A 477 9.276 72.892 41.878 1.00 32.43 C ATOM 7308 HA ALA A 477 10.258 71.093 41.335 1.00 0.00 H ATOM 7309 HB1 ALA A 477 9.328 72.670 42.944 1.00 0.00 H ATOM 7310 HB2 ALA A 477 9.390 73.965 41.723 1.00 0.00 H ATOM 7311 HB3 ALA A 477 8.313 72.567 41.484 1.00 0.00 H ATOM 7312 H ALA A 477 11.758 73.307 42.411 1.00 0.00 H ATOM 7313 N LYS A 478 10.863 73.600 39.307 1.00 38.63 N ATOM 7314 CA LYS A 478 10.807 73.998 37.921 1.00 40.14 C ATOM 7315 C LYS A 478 11.701 73.216 36.990 1.00 40.42 C ATOM 7316 O LYS A 478 11.280 72.827 35.888 1.00 41.70 O ATOM 7317 CB LYS A 478 11.139 75.489 37.776 1.00 42.39 C ATOM 7318 CG LYS A 478 11.163 75.928 36.277 1.00 46.00 C ATOM 7319 CD LYS A 478 10.868 77.419 36.127 1.00 49.61 C ATOM 7320 CE LYS A 478 12.102 78.280 36.332 1.00 52.49 C ATOM 7321 NZ LYS A 478 12.134 79.330 35.238 1.00 57.02 N ATOM 7322 HA LYS A 478 9.782 73.783 37.620 1.00 0.00 H ATOM 7323 HB2 LYS A 478 10.385 76.073 38.304 1.00 0.00 H ATOM 7324 HB3 LYS A 478 12.118 75.678 38.216 1.00 0.00 H ATOM 7325 HG2 LYS A 478 12.149 75.718 35.862 1.00 0.00 H ATOM 7326 HG3 LYS A 478 10.411 75.361 35.729 1.00 0.00 H ATOM 7327 HD2 LYS A 478 10.478 77.599 35.125 1.00 0.00 H ATOM 7328 HD3 LYS A 478 10.117 77.703 36.864 1.00 0.00 H ATOM 7329 HE2 LYS A 478 12.998 77.661 36.276 1.00 0.00 H ATOM 7330 HE3 LYS A 478 12.057 78.764 37.307 1.00 0.00 H ATOM 7331 HZ1 LYS A 478 12.174 78.861 34.310 1.00 0.00 H ATOM 7332 HZ2 LYS A 478 11.276 79.915 35.295 1.00 0.00 H ATOM 7333 HZ3 LYS A 478 12.974 79.931 35.361 1.00 0.00 H ATOM 7334 H LYS A 478 11.331 74.209 40.008 1.00 0.00 H ATOM 7335 N THR A 479 12.928 72.986 37.444 1.00 39.27 N ATOM 7336 CA THR A 479 13.939 72.353 36.642 1.00 39.05 C ATOM 7337 C THR A 479 14.470 71.008 37.028 1.00 40.04 C ATOM 7338 O THR A 479 15.108 70.392 36.194 1.00 40.76 O ATOM 7339 CB THR A 479 15.199 73.271 36.520 1.00 39.70 C ATOM 7340 OG1 THR A 479 15.912 73.282 37.768 1.00 37.49 O ATOM 7341 CG2 THR A 479 14.771 74.747 36.184 1.00 38.43 C ATOM 7342 HA THR A 479 13.371 72.193 35.725 1.00 0.00 H ATOM 7343 HB THR A 479 15.832 72.881 35.723 1.00 0.00 H ATOM 7344 HG1 THR A 479 16.709 73.864 37.686 1.00 0.00 H ATOM 7345 HG23 THR A 479 14.228 74.760 35.239 1.00 0.00 H ATOM 7346 HG21 THR A 479 14.130 75.128 36.979 1.00 0.00 H ATOM 7347 HG22 THR A 479 15.660 75.372 36.102 1.00 0.00 H ATOM 7348 H THR A 479 13.166 73.274 38.415 1.00 0.00 H ATOM 7349 N GLY A 480 14.258 70.550 38.267 1.00 39.33 N ATOM 7350 CA GLY A 480 14.822 69.268 38.678 1.00 37.56 C ATOM 7351 C GLY A 480 16.216 69.484 39.261 1.00 38.46 C ATOM 7352 O GLY A 480 16.956 68.521 39.493 1.00 37.51 O ATOM 7353 HA3 GLY A 480 14.888 68.607 37.814 1.00 0.00 H ATOM 7354 HA2 GLY A 480 14.179 68.814 39.432 1.00 0.00 H ATOM 7355 H GLY A 480 13.691 71.108 38.937 1.00 0.00 H ATOM 7356 N ASN A 481 16.574 70.753 39.501 1.00 38.10 N ATOM 7357 CA ASN A 481 17.885 71.129 40.052 1.00 39.33 C ATOM 7358 C ASN A 481 17.676 72.434 40.835 1.00 40.53 C ATOM 7359 O ASN A 481 17.227 73.438 40.267 1.00 41.55 O ATOM 7360 CB ASN A 481 18.861 71.348 38.879 1.00 40.52 C ATOM 7361 CG ASN A 481 20.277 71.762 39.321 1.00 39.44 C ATOM 7362 OD1 ASN A 481 20.490 72.273 40.411 1.00 40.61 O ATOM 7363 ND2 ASN A 481 21.239 71.572 38.431 1.00 39.51 N ATOM 7364 HA ASN A 481 18.297 70.360 40.706 1.00 0.00 H ATOM 7365 HB2 ASN A 481 18.934 70.419 38.314 1.00 0.00 H ATOM 7366 HB3 ASN A 481 18.458 72.131 38.237 1.00 0.00 H ATOM 7367 HD22 ASN A 481 21.020 71.134 37.514 1.00 0.00 H ATOM 7368 HD21 ASN A 481 22.214 71.861 38.649 1.00 0.00 H ATOM 7369 H ASN A 481 15.892 71.508 39.287 1.00 0.00 H ATOM 7370 N PRO A 482 18.001 72.445 42.143 1.00 40.27 N ATOM 7371 CA PRO A 482 17.817 73.650 42.957 1.00 41.11 C ATOM 7372 C PRO A 482 18.721 74.835 42.561 1.00 43.15 C ATOM 7373 O PRO A 482 18.447 75.968 42.932 1.00 41.43 O ATOM 7374 CB PRO A 482 18.141 73.161 44.368 1.00 41.15 C ATOM 7375 CG PRO A 482 19.285 72.184 44.100 1.00 39.29 C ATOM 7376 CD PRO A 482 18.780 71.420 42.875 1.00 40.46 C ATOM 7377 HA PRO A 482 16.813 74.056 42.836 1.00 0.00 H ATOM 7378 HD3 PRO A 482 19.610 71.053 42.272 1.00 0.00 H ATOM 7379 HD2 PRO A 482 18.148 70.582 43.168 1.00 0.00 H ATOM 7380 HG3 PRO A 482 19.440 71.515 44.947 1.00 0.00 H ATOM 7381 HG2 PRO A 482 20.213 72.712 43.881 1.00 0.00 H ATOM 7382 HB2 PRO A 482 18.461 73.982 45.010 1.00 0.00 H ATOM 7383 HB3 PRO A 482 17.286 72.659 44.821 1.00 0.00 H ATOM 7384 N ASN A 483 19.792 74.548 41.829 1.00 44.35 N ATOM 7385 CA ASN A 483 20.748 75.572 41.446 1.00 48.14 C ATOM 7386 C ASN A 483 20.342 76.432 40.273 1.00 51.03 C ATOM 7387 O ASN A 483 19.836 75.965 39.270 1.00 49.83 O ATOM 7388 CB ASN A 483 22.092 74.929 41.153 1.00 45.97 C ATOM 7389 CG ASN A 483 22.629 74.190 42.353 1.00 45.41 C ATOM 7390 OD1 ASN A 483 22.911 74.806 43.379 1.00 44.64 O ATOM 7391 ND2 ASN A 483 22.744 72.863 42.246 1.00 42.70 N ATOM 7392 HA ASN A 483 20.799 76.248 42.300 1.00 0.00 H ATOM 7393 HB2 ASN A 483 21.976 74.226 40.328 1.00 0.00 H ATOM 7394 HB3 ASN A 483 22.802 75.706 40.869 1.00 0.00 H ATOM 7395 HD22 ASN A 483 22.492 72.389 41.355 1.00 0.00 H ATOM 7396 HD21 ASN A 483 23.085 72.304 43.054 1.00 0.00 H ATOM 7397 H ASN A 483 19.950 73.567 41.523 1.00 0.00 H ATOM 7398 N GLU A 484 20.605 77.708 40.428 1.00 55.89 N ATOM 7399 CA GLU A 484 20.294 78.698 39.424 1.00 61.47 C ATOM 7400 C GLU A 484 21.489 78.624 38.444 1.00 63.89 C ATOM 7401 O GLU A 484 22.648 78.802 38.842 1.00 64.34 O ATOM 7402 CB GLU A 484 20.196 80.042 40.170 1.00 63.27 C ATOM 7403 CG GLU A 484 19.839 81.218 39.357 1.00 66.48 C ATOM 7404 CD GLU A 484 18.437 81.157 38.869 1.00 66.86 C ATOM 7405 OE1 GLU A 484 17.538 81.571 39.618 1.00 67.25 O ATOM 7406 OE2 GLU A 484 18.242 80.679 37.736 1.00 70.23 O ATOM 7407 HA GLU A 484 19.363 78.558 38.874 1.00 0.00 H ATOM 7408 HB2 GLU A 484 19.441 79.935 40.949 1.00 0.00 H ATOM 7409 HB3 GLU A 484 21.165 80.238 40.630 1.00 0.00 H ATOM 7410 HG2 GLU A 484 19.961 82.115 39.964 1.00 0.00 H ATOM 7411 HG3 GLU A 484 20.508 81.268 38.498 1.00 0.00 H ATOM 7412 H GLU A 484 21.057 78.020 41.311 1.00 0.00 H ATOM 7413 N PRO A 485 21.233 78.307 37.159 1.00 66.54 N ATOM 7414 CA PRO A 485 22.333 78.224 36.176 1.00 68.33 C ATOM 7415 C PRO A 485 23.167 79.521 36.024 1.00 69.05 C ATOM 7416 O PRO A 485 24.390 79.406 35.740 1.00 69.75 O ATOM 7417 CB PRO A 485 21.608 77.856 34.877 1.00 68.53 C ATOM 7418 CG PRO A 485 20.247 78.502 35.053 1.00 67.82 C ATOM 7419 CD PRO A 485 19.921 78.148 36.495 1.00 67.31 C ATOM 7420 HA PRO A 485 23.086 77.500 36.487 1.00 0.00 H ATOM 7421 HD3 PRO A 485 19.181 78.831 36.912 1.00 0.00 H ATOM 7422 HD2 PRO A 485 19.557 77.124 36.578 1.00 0.00 H ATOM 7423 HG3 PRO A 485 19.515 78.080 34.365 1.00 0.00 H ATOM 7424 HG2 PRO A 485 20.298 79.581 34.910 1.00 0.00 H ATOM 7425 HB2 PRO A 485 22.127 78.264 34.009 1.00 0.00 H ATOM 7426 HB3 PRO A 485 21.518 76.775 34.770 1.00 0.00 H TER 7427 PRO A 485 ATOM 7428 N SER A 490 27.104 79.874 44.307 1.00 57.64 N ATOM 7429 CA SER A 490 27.622 78.759 45.221 1.00 59.07 C ATOM 7430 C SER A 490 26.716 77.494 45.101 1.00 56.35 C ATOM 7431 O SER A 490 25.575 77.508 45.562 1.00 54.93 O ATOM 7432 CB SER A 490 27.644 79.254 46.675 1.00 61.06 C ATOM 7433 OG SER A 490 28.418 78.367 47.477 1.00 64.25 O ATOM 7434 HA SER A 490 28.633 78.491 44.916 1.00 0.00 H ATOM 7435 HB2 SER A 490 26.625 79.293 47.059 1.00 0.00 H ATOM 7436 HB3 SER A 490 28.083 80.251 46.711 1.00 0.00 H ATOM 7437 HG SER A 490 28.427 78.692 48.412 1.00 0.00 H ATOM 7438 HN3 SER A 490 26.133 80.124 44.583 1.00 0.00 H ATOM 7439 HN2 SER A 490 27.111 79.544 43.321 1.00 0.00 H ATOM 7440 HN1 SER A 490 27.718 80.709 44.398 1.00 0.00 H ATOM 7441 N LYS A 491 27.247 76.421 44.506 1.00 54.37 N ATOM 7442 CA LYS A 491 26.468 75.221 44.222 1.00 54.05 C ATOM 7443 C LYS A 491 26.139 74.108 45.250 1.00 52.24 C ATOM 7444 O LYS A 491 27.011 73.636 45.989 1.00 52.01 O ATOM 7445 CB LYS A 491 27.054 74.524 42.995 1.00 55.97 C ATOM 7446 CG LYS A 491 27.258 75.407 41.756 1.00 60.13 C ATOM 7447 CD LYS A 491 25.958 76.010 41.204 1.00 62.58 C ATOM 7448 CE LYS A 491 25.761 77.477 41.646 1.00 64.45 C ATOM 7449 NZ LYS A 491 24.467 78.033 41.125 1.00 66.12 N ATOM 7450 HA LYS A 491 25.495 75.706 44.146 1.00 0.00 H ATOM 7451 HB2 LYS A 491 28.024 74.113 43.276 1.00 0.00 H ATOM 7452 HB3 LYS A 491 26.382 73.711 42.719 1.00 0.00 H ATOM 7453 HG2 LYS A 491 27.930 76.223 42.022 1.00 0.00 H ATOM 7454 HG3 LYS A 491 27.716 74.802 40.974 1.00 0.00 H ATOM 7455 HD2 LYS A 491 25.988 75.972 40.115 1.00 0.00 H ATOM 7456 HD3 LYS A 491 25.116 75.419 41.564 1.00 0.00 H ATOM 7457 HE2 LYS A 491 26.586 78.078 41.263 1.00 0.00 H ATOM 7458 HE3 LYS A 491 25.755 77.523 42.735 1.00 0.00 H ATOM 7459 HZ1 LYS A 491 24.469 77.997 40.086 1.00 0.00 H ATOM 7460 HZ2 LYS A 491 23.675 77.467 41.491 1.00 0.00 H ATOM 7461 HZ3 LYS A 491 24.364 79.019 41.439 1.00 0.00 H ATOM 7462 H LYS A 491 28.251 76.443 44.236 1.00 0.00 H ATOM 7463 N TRP A 492 24.863 73.701 45.261 1.00 47.64 N ATOM 7464 CA TRP A 492 24.384 72.598 46.078 1.00 43.64 C ATOM 7465 C TRP A 492 24.731 71.425 45.173 1.00 42.93 C ATOM 7466 O TRP A 492 24.136 71.264 44.114 1.00 42.89 O ATOM 7467 CB TRP A 492 22.869 72.695 46.215 1.00 42.46 C ATOM 7468 CG TRP A 492 22.211 71.633 47.053 1.00 41.22 C ATOM 7469 CD1 TRP A 492 22.689 70.377 47.337 1.00 39.47 C ATOM 7470 CD2 TRP A 492 20.925 71.723 47.671 1.00 39.90 C ATOM 7471 NE1 TRP A 492 21.774 69.684 48.095 1.00 40.21 N ATOM 7472 CE2 TRP A 492 20.684 70.485 48.319 1.00 38.95 C ATOM 7473 CE3 TRP A 492 19.953 72.732 47.741 1.00 38.94 C ATOM 7474 CZ2 TRP A 492 19.516 70.221 49.035 1.00 37.10 C ATOM 7475 CZ3 TRP A 492 18.776 72.470 48.461 1.00 40.56 C ATOM 7476 CH2 TRP A 492 18.575 71.208 49.103 1.00 38.40 C ATOM 7477 HA TRP A 492 24.796 72.549 47.086 1.00 0.00 H ATOM 7478 HB2 TRP A 492 22.636 73.662 46.660 1.00 0.00 H ATOM 7479 HB3 TRP A 492 22.440 72.643 45.214 1.00 0.00 H ATOM 7480 HE1 TRP A 492 21.890 68.710 48.442 1.00 0.00 H ATOM 7481 HD1 TRP A 492 23.653 69.987 47.010 1.00 0.00 H ATOM 7482 HZ2 TRP A 492 19.360 69.259 49.524 1.00 0.00 H ATOM 7483 HH2 TRP A 492 17.653 71.031 49.657 1.00 0.00 H ATOM 7484 HZ3 TRP A 492 18.006 73.238 48.531 1.00 0.00 H ATOM 7485 HE3 TRP A 492 20.107 73.693 47.250 1.00 0.00 H ATOM 7486 H TRP A 492 24.181 74.199 44.655 1.00 0.00 H ATOM 7487 N PRO A 493 25.714 70.599 45.543 1.00 42.51 N ATOM 7488 CA PRO A 493 26.043 69.473 44.653 1.00 42.00 C ATOM 7489 C PRO A 493 25.038 68.331 44.608 1.00 42.91 C ATOM 7490 O PRO A 493 24.288 68.100 45.540 1.00 43.58 O ATOM 7491 CB PRO A 493 27.391 68.973 45.202 1.00 42.17 C ATOM 7492 CG PRO A 493 27.274 69.259 46.625 1.00 41.71 C ATOM 7493 CD PRO A 493 26.637 70.641 46.684 1.00 41.10 C ATOM 7494 HA PRO A 493 26.052 69.818 43.619 1.00 0.00 H ATOM 7495 HD3 PRO A 493 26.102 70.791 47.622 1.00 0.00 H ATOM 7496 HD2 PRO A 493 27.382 71.427 46.562 1.00 0.00 H ATOM 7497 HG3 PRO A 493 28.255 69.266 47.099 1.00 0.00 H ATOM 7498 HG2 PRO A 493 26.640 68.521 47.116 1.00 0.00 H ATOM 7499 HB2 PRO A 493 27.519 67.905 45.023 1.00 0.00 H ATOM 7500 HB3 PRO A 493 28.224 69.517 44.757 1.00 0.00 H ATOM 7501 N LEU A 494 25.044 67.612 43.506 1.00 41.58 N ATOM 7502 CA LEU A 494 24.207 66.463 43.340 1.00 41.52 C ATOM 7503 C LEU A 494 24.682 65.390 44.348 1.00 42.37 C ATOM 7504 O LEU A 494 25.889 65.267 44.609 1.00 41.27 O ATOM 7505 CB LEU A 494 24.424 65.971 41.936 1.00 42.11 C ATOM 7506 CG LEU A 494 23.524 65.001 41.236 1.00 45.12 C ATOM 7507 CD1 LEU A 494 22.133 65.640 40.971 1.00 43.64 C ATOM 7508 CD2 LEU A 494 24.222 64.602 39.914 1.00 44.21 C ATOM 7509 HA LEU A 494 23.153 66.685 43.509 1.00 0.00 H ATOM 7510 HB2 LEU A 494 24.439 66.863 41.310 1.00 0.00 H ATOM 7511 HB3 LEU A 494 25.412 65.510 41.934 1.00 0.00 H ATOM 7512 HG LEU A 494 23.351 64.117 41.850 1.00 0.00 H ATOM 7513 HD21 LEU A 494 24.377 65.492 39.304 1.00 0.00 H ATOM 7514 HD22 LEU A 494 25.184 64.141 40.137 1.00 0.00 H ATOM 7515 HD23 LEU A 494 23.595 63.893 39.373 1.00 0.00 H ATOM 7516 HD11 LEU A 494 21.678 65.923 41.920 1.00 0.00 H ATOM 7517 HD12 LEU A 494 22.254 66.525 40.346 1.00 0.00 H ATOM 7518 HD13 LEU A 494 21.494 64.918 40.462 1.00 0.00 H ATOM 7519 H LEU A 494 25.678 67.888 42.729 1.00 0.00 H ATOM 7520 N PHE A 495 23.742 64.649 44.942 1.00 39.74 N ATOM 7521 CA PHE A 495 24.101 63.565 45.846 1.00 38.50 C ATOM 7522 C PHE A 495 24.293 62.361 44.892 1.00 39.17 C ATOM 7523 O PHE A 495 23.435 62.080 44.053 1.00 38.98 O ATOM 7524 CB PHE A 495 22.949 63.294 46.884 1.00 37.46 C ATOM 7525 CG PHE A 495 23.078 61.962 47.648 1.00 36.26 C ATOM 7526 CD1 PHE A 495 22.749 60.744 47.032 1.00 34.80 C ATOM 7527 CD2 PHE A 495 23.548 61.938 48.986 1.00 34.74 C ATOM 7528 CE1 PHE A 495 22.879 59.528 47.736 1.00 35.13 C ATOM 7529 CE2 PHE A 495 23.683 60.742 49.684 1.00 34.75 C ATOM 7530 CZ PHE A 495 23.346 59.527 49.063 1.00 34.10 C ATOM 7531 HA PHE A 495 24.987 63.778 46.445 1.00 0.00 H ATOM 7532 HB2 PHE A 495 22.948 64.106 47.612 1.00 0.00 H ATOM 7533 HB3 PHE A 495 22.001 63.288 46.347 1.00 0.00 H ATOM 7534 HD2 PHE A 495 23.809 62.875 49.477 1.00 0.00 H ATOM 7535 HE2 PHE A 495 24.049 60.747 50.711 1.00 0.00 H ATOM 7536 HZ PHE A 495 23.446 58.588 49.607 1.00 0.00 H ATOM 7537 HE1 PHE A 495 22.617 58.588 47.251 1.00 0.00 H ATOM 7538 HD1 PHE A 495 22.391 60.738 46.003 1.00 0.00 H ATOM 7539 H PHE A 495 22.739 64.849 44.756 1.00 0.00 H ATOM 7540 N THR A 496 25.435 61.685 44.987 1.00 40.95 N ATOM 7541 CA THR A 496 25.717 60.512 44.148 1.00 42.43 C ATOM 7542 C THR A 496 26.021 59.295 45.009 1.00 44.18 C ATOM 7543 O THR A 496 26.426 59.418 46.183 1.00 44.01 O ATOM 7544 CB THR A 496 26.936 60.730 43.194 1.00 41.11 C ATOM 7545 OG1 THR A 496 28.115 60.987 43.962 1.00 43.29 O ATOM 7546 CG2 THR A 496 26.681 61.900 42.266 1.00 41.05 C ATOM 7547 HA THR A 496 24.820 60.355 43.549 1.00 0.00 H ATOM 7548 HB THR A 496 27.074 59.827 42.600 1.00 0.00 H ATOM 7549 HG1 THR A 496 28.882 61.124 43.351 1.00 0.00 H ATOM 7550 HG23 THR A 496 25.783 61.707 41.679 1.00 0.00 H ATOM 7551 HG21 THR A 496 26.544 62.807 42.856 1.00 0.00 H ATOM 7552 HG22 THR A 496 27.533 62.025 41.598 1.00 0.00 H ATOM 7553 H THR A 496 26.150 61.996 45.676 1.00 0.00 H ATOM 7554 N THR A 497 25.831 58.118 44.426 1.00 46.80 N ATOM 7555 CA THR A 497 26.080 56.877 45.149 1.00 48.75 C ATOM 7556 C THR A 497 27.510 56.858 45.666 1.00 49.17 C ATOM 7557 O THR A 497 27.756 56.491 46.821 1.00 48.60 O ATOM 7558 CB THR A 497 25.907 55.622 44.237 1.00 50.47 C ATOM 7559 OG1 THR A 497 24.593 55.603 43.673 1.00 52.15 O ATOM 7560 CG2 THR A 497 26.094 54.358 45.055 1.00 50.38 C ATOM 7561 HA THR A 497 25.356 56.839 45.963 1.00 0.00 H ATOM 7562 HB THR A 497 26.653 55.668 43.443 1.00 0.00 H ATOM 7563 HG1 THR A 497 24.456 56.420 43.132 1.00 0.00 H ATOM 7564 HG23 THR A 497 27.092 54.355 45.494 1.00 0.00 H ATOM 7565 HG21 THR A 497 25.347 54.326 45.848 1.00 0.00 H ATOM 7566 HG22 THR A 497 25.977 53.488 44.409 1.00 0.00 H ATOM 7567 H THR A 497 25.500 58.081 43.441 1.00 0.00 H ATOM 7568 N LYS A 498 28.447 57.269 44.803 1.00 49.31 N ATOM 7569 CA LYS A 498 29.869 57.279 45.148 1.00 49.47 C ATOM 7570 C LYS A 498 30.273 58.310 46.199 1.00 49.03 C ATOM 7571 O LYS A 498 30.911 57.969 47.209 1.00 49.15 O ATOM 7572 CB LYS A 498 30.725 57.518 43.896 1.00 48.65 C ATOM 7573 HA LYS A 498 30.048 56.295 45.581 1.00 0.00 H ATOM 7574 HB2 LYS A 498 30.541 56.722 43.174 1.00 0.00 H ATOM 7575 HB3 LYS A 498 30.461 58.479 43.455 1.00 0.00 H ATOM 7576 H LYS A 498 28.155 57.591 43.858 1.00 0.00 H ATOM 7577 N GLU A 499 29.900 59.563 45.952 1.00 48.00 N ATOM 7578 CA GLU A 499 30.277 60.665 46.820 1.00 47.53 C ATOM 7579 C GLU A 499 29.399 60.976 48.026 1.00 45.49 C ATOM 7580 O GLU A 499 29.894 61.431 49.053 1.00 43.16 O ATOM 7581 CB GLU A 499 30.367 61.912 45.974 1.00 51.88 C ATOM 7582 CG GLU A 499 31.734 62.483 45.838 1.00 57.89 C ATOM 7583 CD GLU A 499 32.648 61.528 45.157 1.00 60.75 C ATOM 7584 OE1 GLU A 499 32.307 61.137 44.024 1.00 63.80 O ATOM 7585 OE2 GLU A 499 33.692 61.167 45.752 1.00 63.82 O ATOM 7586 HA GLU A 499 31.217 60.336 47.264 1.00 0.00 H ATOM 7587 HB2 GLU A 499 30.000 61.671 44.976 1.00 0.00 H ATOM 7588 HB3 GLU A 499 29.726 62.672 46.422 1.00 0.00 H ATOM 7589 HG2 GLU A 499 31.680 63.402 45.254 1.00 0.00 H ATOM 7590 HG3 GLU A 499 32.127 62.707 46.830 1.00 0.00 H ATOM 7591 H GLU A 499 29.320 59.760 45.111 1.00 0.00 H ATOM 7592 N GLN A 500 28.086 60.814 47.859 1.00 45.08 N ATOM 7593 CA GLN A 500 27.111 61.064 48.935 1.00 43.38 C ATOM 7594 C GLN A 500 27.152 62.446 49.575 1.00 41.37 C ATOM 7595 O GLN A 500 27.037 62.599 50.788 1.00 39.97 O ATOM 7596 CB GLN A 500 27.289 59.975 49.968 1.00 44.59 C ATOM 7597 CG GLN A 500 26.898 58.653 49.311 1.00 48.18 C ATOM 7598 CD GLN A 500 27.229 57.447 50.138 1.00 48.89 C ATOM 7599 OE1 GLN A 500 26.934 57.408 51.317 1.00 46.16 O ATOM 7600 NE2 GLN A 500 27.842 56.437 49.506 1.00 51.25 N ATOM 7601 HA GLN A 500 26.122 61.043 48.477 1.00 0.00 H ATOM 7602 HB2 GLN A 500 28.329 59.936 50.294 1.00 0.00 H ATOM 7603 HB3 GLN A 500 26.647 60.168 50.828 1.00 0.00 H ATOM 7604 HG2 GLN A 500 25.823 58.663 49.131 1.00 0.00 H ATOM 7605 HG3 GLN A 500 27.424 58.573 48.359 1.00 0.00 H ATOM 7606 HE22 GLN A 500 28.073 56.520 48.495 1.00 0.00 H ATOM 7607 HE21 GLN A 500 28.087 55.570 50.026 1.00 0.00 H ATOM 7608 H GLN A 500 27.736 60.498 46.932 1.00 0.00 H ATOM 7609 N LYS A 501 27.316 63.457 48.744 1.00 40.71 N ATOM 7610 CA LYS A 501 27.386 64.826 49.239 1.00 40.93 C ATOM 7611 C LYS A 501 26.018 65.411 49.612 1.00 40.69 C ATOM 7612 O LYS A 501 24.965 65.043 49.033 1.00 39.79 O ATOM 7613 CB LYS A 501 28.008 65.733 48.171 1.00 40.67 C ATOM 7614 CG LYS A 501 29.399 65.310 47.751 1.00 44.92 C ATOM 7615 CD LYS A 501 30.015 66.282 46.720 1.00 47.56 C ATOM 7616 CE LYS A 501 31.482 65.873 46.457 1.00 49.33 C ATOM 7617 NZ LYS A 501 32.066 66.663 45.369 1.00 51.90 N ATOM 7618 HA LYS A 501 27.995 64.788 50.143 1.00 0.00 H ATOM 7619 HB2 LYS A 501 27.364 65.722 47.292 1.00 0.00 H ATOM 7620 HB3 LYS A 501 28.061 66.747 48.568 1.00 0.00 H ATOM 7621 HG2 LYS A 501 30.039 65.280 48.633 1.00 0.00 H ATOM 7622 HG3 LYS A 501 29.346 64.315 47.309 1.00 0.00 H ATOM 7623 HD2 LYS A 501 29.450 66.235 45.789 1.00 0.00 H ATOM 7624 HD3 LYS A 501 29.983 67.299 47.111 1.00 0.00 H ATOM 7625 HE2 LYS A 501 31.514 64.817 46.187 1.00 0.00 H ATOM 7626 HE3 LYS A 501 32.064 66.033 47.365 1.00 0.00 H ATOM 7627 HZ1 LYS A 501 31.517 66.511 44.499 1.00 0.00 H ATOM 7628 HZ2 LYS A 501 32.043 67.671 45.623 1.00 0.00 H ATOM 7629 HZ3 LYS A 501 33.051 66.366 45.216 1.00 0.00 H ATOM 7630 H LYS A 501 27.396 63.275 47.723 1.00 0.00 H ATOM 7631 N PHE A 502 26.058 66.345 50.552 1.00 38.80 N ATOM 7632 CA PHE A 502 24.866 67.055 50.976 1.00 38.57 C ATOM 7633 C PHE A 502 25.351 68.410 51.498 1.00 38.77 C ATOM 7634 O PHE A 502 26.561 68.604 51.722 1.00 39.65 O ATOM 7635 CB PHE A 502 24.146 66.263 52.074 1.00 36.55 C ATOM 7636 CG PHE A 502 24.902 66.169 53.376 1.00 34.46 C ATOM 7637 CD1 PHE A 502 24.675 67.093 54.398 1.00 33.14 C ATOM 7638 CD2 PHE A 502 25.748 65.093 53.620 1.00 34.62 C ATOM 7639 CE1 PHE A 502 25.259 66.942 55.660 1.00 35.31 C ATOM 7640 CE2 PHE A 502 26.346 64.922 54.864 1.00 34.66 C ATOM 7641 CZ PHE A 502 26.102 65.846 55.908 1.00 34.45 C ATOM 7642 HA PHE A 502 24.153 67.184 50.161 1.00 0.00 H ATOM 7643 HB2 PHE A 502 23.189 66.746 52.270 1.00 0.00 H ATOM 7644 HB3 PHE A 502 23.973 65.251 51.707 1.00 0.00 H ATOM 7645 HD2 PHE A 502 25.945 64.373 52.825 1.00 0.00 H ATOM 7646 HE2 PHE A 502 27.006 64.072 55.036 1.00 0.00 H ATOM 7647 HZ PHE A 502 26.560 65.710 56.888 1.00 0.00 H ATOM 7648 HE1 PHE A 502 25.061 67.670 56.446 1.00 0.00 H ATOM 7649 HD1 PHE A 502 24.029 67.950 54.208 1.00 0.00 H ATOM 7650 H PHE A 502 26.969 66.575 50.998 1.00 0.00 H ATOM 7651 N ILE A 503 24.430 69.350 51.674 1.00 38.76 N ATOM 7652 CA ILE A 503 24.800 70.666 52.193 1.00 38.02 C ATOM 7653 C ILE A 503 24.051 70.956 53.494 1.00 39.06 C ATOM 7654 O ILE A 503 23.018 70.343 53.780 1.00 38.02 O ATOM 7655 CB ILE A 503 24.438 71.804 51.196 1.00 39.27 C ATOM 7656 CG1 ILE A 503 22.922 71.793 50.955 1.00 39.36 C ATOM 7657 CG2 ILE A 503 25.204 71.648 49.878 1.00 37.54 C ATOM 7658 CD1 ILE A 503 22.363 73.114 50.484 1.00 43.39 C ATOM 7659 HA ILE A 503 25.878 70.643 52.353 1.00 0.00 H ATOM 7660 HB ILE A 503 24.729 72.763 51.625 1.00 0.00 H ATOM 7661 HG12 ILE A 503 22.701 71.039 50.200 1.00 0.00 H ATOM 7662 HG13 ILE A 503 22.429 71.526 51.889 1.00 0.00 H ATOM 7663 HD11 ILE A 503 22.564 73.880 51.233 1.00 0.00 H ATOM 7664 HD12 ILE A 503 22.836 73.392 49.542 1.00 0.00 H ATOM 7665 HD13 ILE A 503 21.287 73.020 50.338 1.00 0.00 H ATOM 7666 HG21 ILE A 503 26.275 71.685 50.075 1.00 0.00 H ATOM 7667 HG22 ILE A 503 24.950 70.691 49.423 1.00 0.00 H ATOM 7668 HG23 ILE A 503 24.930 72.458 49.202 1.00 0.00 H ATOM 7669 H ILE A 503 23.437 69.149 51.441 1.00 0.00 H ATOM 7670 N ASP A 504 24.585 71.876 54.289 1.00 38.96 N ATOM 7671 CA ASP A 504 23.925 72.273 55.506 1.00 41.43 C ATOM 7672 C ASP A 504 23.043 73.388 55.009 1.00 41.17 C ATOM 7673 O ASP A 504 23.367 74.054 54.020 1.00 40.93 O ATOM 7674 CB ASP A 504 24.860 72.910 56.547 1.00 44.35 C ATOM 7675 CG ASP A 504 25.899 71.962 57.081 1.00 48.52 C ATOM 7676 OD1 ASP A 504 25.579 70.767 57.273 1.00 48.24 O ATOM 7677 OD2 ASP A 504 27.042 72.430 57.321 1.00 50.83 O ATOM 7678 HA ASP A 504 23.457 71.417 55.991 1.00 0.00 H ATOM 7679 HB2 ASP A 504 25.369 73.754 56.083 1.00 0.00 H ATOM 7680 HB3 ASP A 504 24.256 73.266 57.382 1.00 0.00 H ATOM 7681 H ASP A 504 25.491 72.315 54.030 1.00 0.00 H ATOM 7682 N LEU A 505 21.949 73.607 55.709 1.00 40.30 N ATOM 7683 CA LEU A 505 21.053 74.670 55.341 1.00 42.85 C ATOM 7684 C LEU A 505 20.931 75.568 56.588 1.00 43.13 C ATOM 7685 O LEU A 505 20.240 75.210 57.575 1.00 42.92 O ATOM 7686 CB LEU A 505 19.718 74.056 54.947 1.00 42.40 C ATOM 7687 CG LEU A 505 18.936 74.434 53.706 1.00 44.47 C ATOM 7688 CD1 LEU A 505 19.820 74.984 52.564 1.00 41.60 C ATOM 7689 CD2 LEU A 505 18.153 73.186 53.318 1.00 40.79 C ATOM 7690 HA LEU A 505 21.404 75.259 54.494 1.00 0.00 H ATOM 7691 HB2 LEU A 505 19.900 72.984 54.865 1.00 0.00 H ATOM 7692 HB3 LEU A 505 19.048 74.246 55.786 1.00 0.00 H ATOM 7693 HG LEU A 505 18.264 75.268 53.910 1.00 0.00 H ATOM 7694 HD21 LEU A 505 18.848 72.371 53.117 1.00 0.00 H ATOM 7695 HD22 LEU A 505 17.489 72.906 54.136 1.00 0.00 H ATOM 7696 HD23 LEU A 505 17.564 73.392 52.424 1.00 0.00 H ATOM 7697 HD11 LEU A 505 20.340 75.878 52.907 1.00 0.00 H ATOM 7698 HD12 LEU A 505 20.549 74.227 52.273 1.00 0.00 H ATOM 7699 HD13 LEU A 505 19.192 75.233 51.708 1.00 0.00 H ATOM 7700 H LEU A 505 21.732 73.009 56.531 1.00 0.00 H ATOM 7701 N ASN A 506 21.623 76.714 56.566 1.00 43.38 N ATOM 7702 CA ASN A 506 21.572 77.640 57.706 1.00 44.91 C ATOM 7703 C ASN A 506 22.018 79.053 57.305 1.00 46.31 C ATOM 7704 O ASN A 506 22.198 79.335 56.117 1.00 46.81 O ATOM 7705 CB ASN A 506 22.430 77.106 58.852 1.00 44.33 C ATOM 7706 CG ASN A 506 23.879 76.954 58.456 1.00 44.24 C ATOM 7707 OD1 ASN A 506 24.448 77.839 57.839 1.00 44.71 O ATOM 7708 ND2 ASN A 506 24.478 75.836 58.810 1.00 42.97 N ATOM 7709 HA ASN A 506 20.537 77.709 58.041 1.00 0.00 H ATOM 7710 HB2 ASN A 506 22.366 77.799 59.691 1.00 0.00 H ATOM 7711 HB3 ASN A 506 22.045 76.133 59.155 1.00 0.00 H ATOM 7712 HD22 ASN A 506 23.953 75.109 59.336 1.00 0.00 H ATOM 7713 HD21 ASN A 506 25.476 75.680 58.564 1.00 0.00 H ATOM 7714 H ASN A 506 22.202 76.951 55.735 1.00 0.00 H ATOM 7715 N THR A 507 22.195 79.947 58.265 1.00 47.19 N ATOM 7716 CA THR A 507 22.581 81.325 57.912 1.00 49.74 C ATOM 7717 C THR A 507 24.086 81.563 57.609 1.00 51.30 C ATOM 7718 O THR A 507 24.486 82.662 57.215 1.00 52.79 O ATOM 7719 CB THR A 507 22.084 82.303 59.005 1.00 48.36 C ATOM 7720 OG1 THR A 507 22.603 81.902 60.271 1.00 49.59 O ATOM 7721 CG2 THR A 507 20.557 82.254 59.128 1.00 47.94 C ATOM 7722 HA THR A 507 22.090 81.516 56.958 1.00 0.00 H ATOM 7723 HB THR A 507 22.414 83.304 58.727 1.00 0.00 H ATOM 7724 HG1 THR A 507 22.290 80.986 60.479 1.00 0.00 H ATOM 7725 HG23 THR A 507 20.108 82.554 58.181 1.00 0.00 H ATOM 7726 HG21 THR A 507 20.246 81.239 59.374 1.00 0.00 H ATOM 7727 HG22 THR A 507 20.235 82.935 59.916 1.00 0.00 H ATOM 7728 H THR A 507 22.063 79.679 59.261 1.00 0.00 H ATOM 7729 N GLU A 508 24.902 80.523 57.758 1.00 52.43 N ATOM 7730 CA GLU A 508 26.347 80.596 57.519 1.00 52.80 C ATOM 7731 C GLU A 508 26.613 80.238 56.071 1.00 54.44 C ATOM 7732 O GLU A 508 25.743 79.695 55.399 1.00 54.36 O ATOM 7733 CB GLU A 508 27.104 79.609 58.433 1.00 51.62 C ATOM 7734 CG GLU A 508 26.895 79.821 59.940 1.00 51.66 C ATOM 7735 HA GLU A 508 26.695 81.605 57.738 1.00 0.00 H ATOM 7736 HB2 GLU A 508 26.775 78.600 58.185 1.00 0.00 H ATOM 7737 HB3 GLU A 508 28.169 79.704 58.223 1.00 0.00 H ATOM 7738 HG2 GLU A 508 27.232 80.820 60.215 1.00 0.00 H ATOM 7739 HG3 GLU A 508 25.836 79.715 60.177 1.00 0.00 H ATOM 7740 H GLU A 508 24.495 79.614 58.059 1.00 0.00 H ATOM 7741 N PRO A 509 27.816 80.551 55.553 1.00 55.57 N ATOM 7742 CA PRO A 509 28.109 80.215 54.156 1.00 56.32 C ATOM 7743 C PRO A 509 28.014 78.706 53.970 1.00 56.83 C ATOM 7744 O PRO A 509 28.536 77.945 54.771 1.00 57.07 O ATOM 7745 CB PRO A 509 29.536 80.710 53.961 1.00 55.31 C ATOM 7746 CG PRO A 509 29.638 81.835 54.945 1.00 56.14 C ATOM 7747 CD PRO A 509 28.929 81.297 56.161 1.00 56.05 C ATOM 7748 HA PRO A 509 27.420 80.661 53.439 1.00 0.00 H ATOM 7749 HD3 PRO A 509 29.577 80.641 56.741 1.00 0.00 H ATOM 7750 HD2 PRO A 509 28.566 82.103 56.799 1.00 0.00 H ATOM 7751 HG3 PRO A 509 29.143 82.730 54.568 1.00 0.00 H ATOM 7752 HG2 PRO A 509 30.680 82.065 55.170 1.00 0.00 H ATOM 7753 HB2 PRO A 509 30.258 79.925 54.186 1.00 0.00 H ATOM 7754 HB3 PRO A 509 29.693 81.064 52.942 1.00 0.00 H ATOM 7755 N MET A 510 27.365 78.291 52.893 1.00 57.33 N ATOM 7756 CA MET A 510 27.158 76.892 52.581 1.00 57.06 C ATOM 7757 C MET A 510 28.385 76.008 52.720 1.00 56.72 C ATOM 7758 O MET A 510 29.462 76.355 52.250 1.00 57.98 O ATOM 7759 CB MET A 510 26.638 76.779 51.156 1.00 58.65 C ATOM 7760 CG MET A 510 26.407 75.347 50.673 1.00 59.82 C ATOM 7761 SD MET A 510 26.117 75.262 48.887 1.00 61.87 S ATOM 7762 CE MET A 510 24.459 75.875 48.820 1.00 61.23 C ATOM 7763 HA MET A 510 26.444 76.529 53.320 1.00 0.00 H ATOM 7764 HB2 MET A 510 25.691 77.315 51.096 1.00 0.00 H ATOM 7765 HB3 MET A 510 27.363 77.249 50.491 1.00 0.00 H ATOM 7766 HG2 MET A 510 25.538 74.938 51.189 1.00 0.00 H ATOM 7767 HG3 MET A 510 27.286 74.749 50.915 1.00 0.00 H ATOM 7768 HE1 MET A 510 23.809 75.226 49.407 1.00 0.00 H ATOM 7769 HE2 MET A 510 24.430 76.886 49.227 1.00 0.00 H ATOM 7770 HE3 MET A 510 24.120 75.890 47.784 1.00 0.00 H ATOM 7771 H MET A 510 26.985 79.005 52.239 1.00 0.00 H ATOM 7772 N LYS A 511 28.223 74.866 53.378 1.00 55.23 N ATOM 7773 CA LYS A 511 29.306 73.882 53.511 1.00 53.94 C ATOM 7774 C LYS A 511 28.743 72.573 52.960 1.00 52.67 C ATOM 7775 O LYS A 511 27.545 72.262 53.135 1.00 52.66 O ATOM 7776 CB LYS A 511 29.726 73.655 54.959 1.00 55.15 C ATOM 7777 CG LYS A 511 30.484 74.797 55.569 1.00 58.89 C ATOM 7778 CD LYS A 511 31.064 74.399 56.947 1.00 62.25 C ATOM 7779 CE LYS A 511 31.694 75.609 57.685 1.00 63.42 C ATOM 7780 NZ LYS A 511 31.971 75.328 59.151 1.00 64.81 N ATOM 7781 HA LYS A 511 30.189 74.239 52.981 1.00 0.00 H ATOM 7782 HB2 LYS A 511 28.828 73.486 55.553 1.00 0.00 H ATOM 7783 HB3 LYS A 511 30.357 72.767 54.996 1.00 0.00 H ATOM 7784 HG2 LYS A 511 31.301 75.079 54.905 1.00 0.00 H ATOM 7785 HG3 LYS A 511 29.811 75.645 55.696 1.00 0.00 H ATOM 7786 HD2 LYS A 511 30.262 73.990 57.562 1.00 0.00 H ATOM 7787 HD3 LYS A 511 31.831 73.638 56.800 1.00 0.00 H ATOM 7788 HE2 LYS A 511 31.009 76.454 57.616 1.00 0.00 H ATOM 7789 HE3 LYS A 511 32.634 75.864 57.196 1.00 0.00 H ATOM 7790 HZ1 LYS A 511 31.080 75.092 59.632 1.00 0.00 H ATOM 7791 HZ2 LYS A 511 32.632 74.529 59.231 1.00 0.00 H ATOM 7792 HZ3 LYS A 511 32.391 76.172 59.591 1.00 0.00 H ATOM 7793 H LYS A 511 27.301 74.662 53.813 1.00 0.00 H ATOM 7794 N VAL A 512 29.605 71.839 52.271 1.00 49.47 N ATOM 7795 CA VAL A 512 29.264 70.566 51.690 1.00 48.16 C ATOM 7796 C VAL A 512 29.924 69.525 52.568 1.00 47.80 C ATOM 7797 O VAL A 512 31.066 69.713 53.008 1.00 47.71 O ATOM 7798 CB VAL A 512 29.822 70.439 50.267 1.00 47.12 C ATOM 7799 CG1 VAL A 512 29.605 69.017 49.738 1.00 47.71 C ATOM 7800 CG2 VAL A 512 29.154 71.480 49.346 1.00 46.49 C ATOM 7801 HA VAL A 512 28.182 70.448 51.632 1.00 0.00 H ATOM 7802 HB VAL A 512 30.894 70.633 50.284 1.00 0.00 H ATOM 7803 HG11 VAL A 512 30.117 68.307 50.387 1.00 0.00 H ATOM 7804 HG12 VAL A 512 28.538 68.795 49.725 1.00 0.00 H ATOM 7805 HG13 VAL A 512 30.006 68.942 48.727 1.00 0.00 H ATOM 7806 HG21 VAL A 512 28.078 71.309 49.327 1.00 0.00 H ATOM 7807 HG22 VAL A 512 29.358 72.482 49.724 1.00 0.00 H ATOM 7808 HG23 VAL A 512 29.556 71.382 48.338 1.00 0.00 H ATOM 7809 H VAL A 512 30.572 72.199 52.144 1.00 0.00 H ATOM 7810 N HIS A 513 29.206 68.442 52.851 1.00 46.50 N ATOM 7811 CA HIS A 513 29.767 67.351 53.667 1.00 45.50 C ATOM 7812 C HIS A 513 29.442 66.049 52.944 1.00 44.79 C ATOM 7813 O HIS A 513 28.788 66.059 51.888 1.00 45.91 O ATOM 7814 CB HIS A 513 29.106 67.288 55.045 1.00 45.68 C ATOM 7815 CG HIS A 513 29.066 68.590 55.773 1.00 46.61 C ATOM 7816 ND1 HIS A 513 30.169 69.118 56.415 1.00 48.56 N ATOM 7817 CD2 HIS A 513 28.034 69.421 56.050 1.00 47.53 C ATOM 7818 CE1 HIS A 513 29.809 70.212 57.067 1.00 48.02 C ATOM 7819 NE2 HIS A 513 28.519 70.417 56.863 1.00 47.44 N ATOM 7820 HA HIS A 513 30.837 67.512 53.800 1.00 0.00 H ATOM 7821 HB2 HIS A 513 28.082 66.938 54.916 1.00 0.00 H ATOM 7822 HB3 HIS A 513 29.658 66.573 55.655 1.00 0.00 H ATOM 7823 HD2 HIS A 513 27.009 69.319 55.694 1.00 0.00 H ATOM 7824 HE1 HIS A 513 30.466 70.839 57.671 1.00 0.00 H ATOM 7825 H HIS A 513 28.234 68.364 52.491 1.00 0.00 H ATOM 7826 N GLN A 514 29.851 64.928 53.523 1.00 43.42 N ATOM 7827 CA GLN A 514 29.581 63.624 52.924 1.00 42.82 C ATOM 7828 C GLN A 514 29.113 62.571 53.920 1.00 40.24 C ATOM 7829 O GLN A 514 29.454 62.617 55.081 1.00 37.62 O ATOM 7830 CB GLN A 514 30.833 63.105 52.226 1.00 44.76 C ATOM 7831 CG GLN A 514 31.190 63.925 51.024 1.00 48.75 C ATOM 7832 CD GLN A 514 32.495 63.491 50.403 1.00 51.07 C ATOM 7833 OE1 GLN A 514 33.566 63.939 50.802 1.00 53.70 O ATOM 7834 NE2 GLN A 514 32.413 62.600 49.431 1.00 52.40 N ATOM 7835 HA GLN A 514 28.767 63.786 52.218 1.00 0.00 H ATOM 7836 HB2 GLN A 514 31.665 63.132 52.930 1.00 0.00 H ATOM 7837 HB3 GLN A 514 30.659 62.076 51.911 1.00 0.00 H ATOM 7838 HG2 GLN A 514 30.398 63.824 50.282 1.00 0.00 H ATOM 7839 HG3 GLN A 514 31.274 64.969 51.324 1.00 0.00 H ATOM 7840 HE22 GLN A 514 31.483 62.248 49.125 1.00 0.00 H ATOM 7841 HE21 GLN A 514 33.278 62.251 48.972 1.00 0.00 H ATOM 7842 H GLN A 514 30.374 64.979 54.421 1.00 0.00 H ATOM 7843 N ARG A 515 28.330 61.618 53.426 1.00 40.59 N ATOM 7844 CA ARG A 515 27.843 60.500 54.233 1.00 40.23 C ATOM 7845 C ARG A 515 27.184 60.899 55.565 1.00 39.30 C ATOM 7846 O ARG A 515 27.704 60.626 56.666 1.00 35.77 O ATOM 7847 CB ARG A 515 29.018 59.556 54.478 1.00 40.49 C ATOM 7848 CG ARG A 515 29.605 58.975 53.171 1.00 42.12 C ATOM 7849 CD ARG A 515 30.751 57.964 53.452 1.00 43.30 C ATOM 7850 NE ARG A 515 31.225 57.271 52.252 1.00 44.31 N ATOM 7851 HA ARG A 515 27.043 60.019 53.670 1.00 0.00 H ATOM 7852 HB2 ARG A 515 29.803 60.105 54.998 1.00 0.00 H ATOM 7853 HB3 ARG A 515 28.677 58.731 55.104 1.00 0.00 H ATOM 7854 HG2 ARG A 515 28.812 58.466 52.623 1.00 0.00 H ATOM 7855 HG3 ARG A 515 29.996 59.793 52.566 1.00 0.00 H ATOM 7856 HD2 ARG A 515 30.389 57.219 54.161 1.00 0.00 H ATOM 7857 HD3 ARG A 515 31.589 58.505 53.892 1.00 0.00 H ATOM 7858 HE ARG A 515 30.796 57.479 51.328 1.00 0.00 H ATOM 7859 H ARG A 515 28.052 61.669 52.425 1.00 0.00 H ATOM 7860 N LEU A 516 26.038 61.557 55.420 1.00 39.11 N ATOM 7861 CA LEU A 516 25.221 62.059 56.535 1.00 40.14 C ATOM 7862 C LEU A 516 24.957 60.951 57.564 1.00 39.35 C ATOM 7863 O LEU A 516 24.297 59.968 57.264 1.00 38.00 O ATOM 7864 CB LEU A 516 23.883 62.634 55.972 1.00 40.07 C ATOM 7865 CG LEU A 516 22.802 63.144 56.919 1.00 41.47 C ATOM 7866 CD1 LEU A 516 23.438 63.934 58.004 1.00 42.99 C ATOM 7867 CD2 LEU A 516 21.827 64.034 56.145 1.00 41.40 C ATOM 7868 HA LEU A 516 25.762 62.854 57.048 1.00 0.00 H ATOM 7869 HB2 LEU A 516 24.150 63.468 55.323 1.00 0.00 H ATOM 7870 HB3 LEU A 516 23.429 61.843 55.376 1.00 0.00 H ATOM 7871 HG LEU A 516 22.261 62.301 57.348 1.00 0.00 H ATOM 7872 HD21 LEU A 516 22.368 64.879 55.720 1.00 0.00 H ATOM 7873 HD22 LEU A 516 21.367 63.456 55.344 1.00 0.00 H ATOM 7874 HD23 LEU A 516 21.054 64.399 56.822 1.00 0.00 H ATOM 7875 HD11 LEU A 516 24.136 63.301 58.551 1.00 0.00 H ATOM 7876 HD12 LEU A 516 23.974 64.778 57.571 1.00 0.00 H ATOM 7877 HD13 LEU A 516 22.669 64.301 58.684 1.00 0.00 H ATOM 7878 H LEU A 516 25.696 61.728 54.453 1.00 0.00 H ATOM 7879 N ARG A 517 25.484 61.161 58.774 1.00 39.68 N ATOM 7880 CA ARG A 517 25.398 60.241 59.908 1.00 39.15 C ATOM 7881 C ARG A 517 25.612 58.766 59.530 1.00 37.60 C ATOM 7882 O ARG A 517 24.926 57.870 60.055 1.00 36.22 O ATOM 7883 CB ARG A 517 24.054 60.478 60.651 1.00 39.37 C ATOM 7884 CG ARG A 517 24.111 61.822 61.444 1.00 41.14 C ATOM 7885 CD ARG A 517 22.894 62.091 62.308 1.00 40.83 C ATOM 7886 NE ARG A 517 22.873 61.281 63.530 1.00 41.27 N ATOM 7887 CZ ARG A 517 23.699 61.443 64.563 1.00 39.54 C ATOM 7888 NH1 ARG A 517 24.620 62.400 64.498 1.00 40.77 N ATOM 7889 NH2 ARG A 517 23.603 60.674 65.659 1.00 33.50 N ATOM 7890 HA ARG A 517 26.226 60.462 60.582 1.00 0.00 H ATOM 7891 HB2 ARG A 517 23.243 60.521 59.925 1.00 0.00 H ATOM 7892 HB3 ARG A 517 23.875 59.657 61.345 1.00 0.00 H ATOM 7893 HG2 ARG A 517 24.989 61.801 62.089 1.00 0.00 H ATOM 7894 HG3 ARG A 517 24.208 62.637 60.727 1.00 0.00 H ATOM 7895 HD2 ARG A 517 21.999 61.869 61.727 1.00 0.00 H ATOM 7896 HD3 ARG A 517 22.892 63.144 62.588 1.00 0.00 H ATOM 7897 HE ARG A 517 22.162 60.525 63.595 1.00 0.00 H ATOM 7898 HH12 ARG A 517 25.276 62.545 65.292 1.00 0.00 H ATOM 7899 HH11 ARG A 517 24.684 63.003 63.653 1.00 0.00 H ATOM 7900 HH22 ARG A 517 24.258 60.817 66.454 1.00 0.00 H ATOM 7901 HH21 ARG A 517 22.874 59.935 65.713 1.00 0.00 H ATOM 7902 H ARG A 517 25.998 62.053 58.922 1.00 0.00 H ATOM 7903 N VAL A 518 26.570 58.505 58.635 1.00 36.54 N ATOM 7904 CA VAL A 518 26.811 57.111 58.222 1.00 37.34 C ATOM 7905 C VAL A 518 27.027 56.131 59.370 1.00 37.41 C ATOM 7906 O VAL A 518 26.534 55.013 59.332 1.00 36.36 O ATOM 7907 CB VAL A 518 28.106 56.829 57.485 1.00 36.98 C ATOM 7908 CG1 VAL A 518 27.802 56.216 56.181 1.00 35.97 C ATOM 7909 CG2 VAL A 518 29.045 57.996 57.551 1.00 35.80 C ATOM 7910 HA VAL A 518 25.907 56.984 57.627 1.00 0.00 H ATOM 7911 HB VAL A 518 28.709 56.067 57.979 1.00 0.00 H ATOM 7912 HG11 VAL A 518 27.260 55.283 56.337 1.00 0.00 H ATOM 7913 HG12 VAL A 518 27.189 56.900 55.594 1.00 0.00 H ATOM 7914 HG13 VAL A 518 28.732 56.013 55.651 1.00 0.00 H ATOM 7915 HG21 VAL A 518 28.573 58.867 57.096 1.00 0.00 H ATOM 7916 HG22 VAL A 518 29.282 58.212 58.593 1.00 0.00 H ATOM 7917 HG23 VAL A 518 29.961 57.755 57.011 1.00 0.00 H ATOM 7918 H VAL A 518 27.139 59.278 58.234 1.00 0.00 H ATOM 7919 N GLN A 519 27.841 56.546 60.334 1.00 38.32 N ATOM 7920 CA GLN A 519 28.223 55.685 61.462 1.00 41.01 C ATOM 7921 C GLN A 519 26.989 55.142 62.178 1.00 39.86 C ATOM 7922 O GLN A 519 26.830 53.947 62.337 1.00 39.68 O ATOM 7923 CB GLN A 519 29.142 56.477 62.423 1.00 42.34 C ATOM 7924 CG GLN A 519 29.971 55.627 63.386 1.00 45.76 C ATOM 7925 CD GLN A 519 31.040 54.787 62.678 1.00 47.66 C ATOM 7926 OE1 GLN A 519 31.678 55.236 61.712 1.00 48.82 O ATOM 7927 NE2 GLN A 519 31.238 53.559 63.156 1.00 48.82 N ATOM 7928 HA GLN A 519 28.775 54.823 61.087 1.00 0.00 H ATOM 7929 HB2 GLN A 519 29.830 57.069 61.819 1.00 0.00 H ATOM 7930 HB3 GLN A 519 28.515 57.143 63.016 1.00 0.00 H ATOM 7931 HG2 GLN A 519 30.465 56.289 64.097 1.00 0.00 H ATOM 7932 HG3 GLN A 519 29.300 54.955 63.922 1.00 0.00 H ATOM 7933 HE22 GLN A 519 30.682 53.221 63.967 1.00 0.00 H ATOM 7934 HE21 GLN A 519 31.948 52.939 62.718 1.00 0.00 H ATOM 7935 H GLN A 519 28.221 57.513 60.289 1.00 0.00 H ATOM 7936 N MET A 520 26.107 56.034 62.587 1.00 39.35 N ATOM 7937 CA MET A 520 24.890 55.624 63.252 1.00 40.10 C ATOM 7938 C MET A 520 23.936 54.910 62.288 1.00 39.92 C ATOM 7939 O MET A 520 23.328 53.917 62.653 1.00 40.73 O ATOM 7940 CB MET A 520 24.210 56.850 63.894 1.00 42.27 C ATOM 7941 CG MET A 520 24.988 57.444 65.074 1.00 45.15 C ATOM 7942 SD MET A 520 25.326 56.138 66.417 1.00 53.36 S ATOM 7943 CE MET A 520 26.986 55.723 66.050 1.00 49.27 C ATOM 7944 HA MET A 520 25.148 54.911 64.035 1.00 0.00 H ATOM 7945 HB2 MET A 520 24.101 57.621 63.131 1.00 0.00 H ATOM 7946 HB3 MET A 520 23.224 56.550 64.249 1.00 0.00 H ATOM 7947 HG2 MET A 520 24.406 58.257 65.509 1.00 0.00 H ATOM 7948 HG3 MET A 520 25.939 57.833 64.711 1.00 0.00 H ATOM 7949 HE1 MET A 520 27.046 55.333 65.034 1.00 0.00 H ATOM 7950 HE2 MET A 520 27.609 56.613 66.136 1.00 0.00 H ATOM 7951 HE3 MET A 520 27.333 54.965 66.752 1.00 0.00 H ATOM 7952 H MET A 520 26.289 57.046 62.429 1.00 0.00 H ATOM 7953 N CYS A 521 23.790 55.390 61.049 1.00 38.78 N ATOM 7954 CA CYS A 521 22.868 54.711 60.168 1.00 37.59 C ATOM 7955 C CYS A 521 23.311 53.310 59.764 1.00 37.53 C ATOM 7956 O CYS A 521 22.474 52.464 59.466 1.00 36.01 O ATOM 7957 CB CYS A 521 22.564 55.580 58.965 1.00 38.09 C ATOM 7958 SG CYS A 521 21.647 57.078 59.488 1.00 37.09 S ATOM 7959 HA CYS A 521 21.950 54.554 60.735 1.00 0.00 H ATOM 7960 HB2 CYS A 521 21.959 55.016 58.255 1.00 0.00 H ATOM 7961 HB3 CYS A 521 23.498 55.877 58.488 1.00 0.00 H ATOM 7962 H CYS A 521 24.322 56.224 60.730 1.00 0.00 H ATOM 7963 N VAL A 522 24.614 53.017 59.772 1.00 37.97 N ATOM 7964 CA VAL A 522 25.000 51.619 59.478 1.00 37.42 C ATOM 7965 C VAL A 522 24.457 50.739 60.653 1.00 36.80 C ATOM 7966 O VAL A 522 24.042 49.580 60.464 1.00 37.04 O ATOM 7967 CB VAL A 522 26.528 51.450 59.382 1.00 38.86 C ATOM 7968 CG1 VAL A 522 26.904 49.929 59.393 1.00 37.79 C ATOM 7969 CG2 VAL A 522 27.029 52.077 58.066 1.00 37.15 C ATOM 7970 HA VAL A 522 24.583 51.323 58.515 1.00 0.00 H ATOM 7971 HB VAL A 522 26.993 51.944 60.235 1.00 0.00 H ATOM 7972 HG11 VAL A 522 26.551 49.475 60.319 1.00 0.00 H ATOM 7973 HG12 VAL A 522 26.435 49.434 58.543 1.00 0.00 H ATOM 7974 HG13 VAL A 522 27.987 49.823 59.325 1.00 0.00 H ATOM 7975 HG21 VAL A 522 26.553 51.577 57.223 1.00 0.00 H ATOM 7976 HG22 VAL A 522 26.777 53.137 58.051 1.00 0.00 H ATOM 7977 HG23 VAL A 522 28.110 51.958 57.997 1.00 0.00 H ATOM 7978 H VAL A 522 25.330 53.743 59.977 1.00 0.00 H ATOM 7979 N PHE A 523 24.452 51.287 61.865 1.00 34.97 N ATOM 7980 CA PHE A 523 23.903 50.559 63.017 1.00 34.02 C ATOM 7981 C PHE A 523 22.383 50.325 62.863 1.00 34.65 C ATOM 7982 O PHE A 523 21.897 49.197 62.990 1.00 33.74 O ATOM 7983 CB PHE A 523 24.159 51.327 64.316 1.00 32.12 C ATOM 7984 CG PHE A 523 23.413 50.787 65.489 1.00 34.76 C ATOM 7985 CD1 PHE A 523 23.948 49.744 66.260 1.00 36.07 C ATOM 7986 CD2 PHE A 523 22.172 51.327 65.849 1.00 34.93 C ATOM 7987 CE1 PHE A 523 23.250 49.253 67.400 1.00 34.87 C ATOM 7988 CE2 PHE A 523 21.471 50.856 66.954 1.00 34.43 C ATOM 7989 CZ PHE A 523 22.022 49.810 67.743 1.00 37.15 C ATOM 7990 HA PHE A 523 24.408 49.594 63.057 1.00 0.00 H ATOM 7991 HB2 PHE A 523 25.226 51.284 64.537 1.00 0.00 H ATOM 7992 HB3 PHE A 523 23.861 52.365 64.167 1.00 0.00 H ATOM 7993 HD2 PHE A 523 21.747 52.133 65.251 1.00 0.00 H ATOM 7994 HE2 PHE A 523 20.504 51.287 67.214 1.00 0.00 H ATOM 7995 HZ PHE A 523 21.483 49.444 68.617 1.00 0.00 H ATOM 7996 HE1 PHE A 523 23.674 48.447 67.999 1.00 0.00 H ATOM 7997 HD1 PHE A 523 24.907 49.305 65.984 1.00 0.00 H ATOM 7998 H PHE A 523 24.841 52.242 61.999 1.00 0.00 H ATOM 7999 N TRP A 524 21.639 51.392 62.592 1.00 33.59 N ATOM 8000 CA TRP A 524 20.183 51.271 62.425 1.00 34.12 C ATOM 8001 C TRP A 524 19.705 50.526 61.170 1.00 34.27 C ATOM 8002 O TRP A 524 18.717 49.819 61.236 1.00 34.47 O ATOM 8003 CB TRP A 524 19.510 52.660 62.431 1.00 31.49 C ATOM 8004 CG TRP A 524 19.579 53.297 63.817 1.00 31.69 C ATOM 8005 CD1 TRP A 524 20.415 54.314 64.208 1.00 28.64 C ATOM 8006 CD2 TRP A 524 18.828 52.919 64.978 1.00 29.02 C ATOM 8007 NE1 TRP A 524 20.226 54.590 65.524 1.00 31.05 N ATOM 8008 CE2 TRP A 524 19.256 53.747 66.031 1.00 30.10 C ATOM 8009 CE3 TRP A 524 17.834 51.974 65.223 1.00 29.94 C ATOM 8010 CZ2 TRP A 524 18.726 53.657 67.329 1.00 29.50 C ATOM 8011 CZ3 TRP A 524 17.293 51.884 66.519 1.00 29.04 C ATOM 8012 CH2 TRP A 524 17.743 52.721 67.556 1.00 30.02 C ATOM 8013 HA TRP A 524 19.886 50.664 63.280 1.00 0.00 H ATOM 8014 HB2 TRP A 524 20.019 53.306 61.716 1.00 0.00 H ATOM 8015 HB3 TRP A 524 18.465 52.551 62.140 1.00 0.00 H ATOM 8016 HE1 TRP A 524 20.732 55.320 66.065 1.00 0.00 H ATOM 8017 HD1 TRP A 524 21.126 54.824 63.558 1.00 0.00 H ATOM 8018 HZ2 TRP A 524 19.081 54.306 68.129 1.00 0.00 H ATOM 8019 HH2 TRP A 524 17.308 52.627 68.551 1.00 0.00 H ATOM 8020 HZ3 TRP A 524 16.511 51.152 66.723 1.00 0.00 H ATOM 8021 HE3 TRP A 524 17.482 51.318 64.427 1.00 0.00 H ATOM 8022 H TRP A 524 22.092 52.323 62.497 1.00 0.00 H ATOM 8023 N ASN A 525 20.405 50.677 60.049 1.00 35.37 N ATOM 8024 CA ASN A 525 19.971 50.056 58.797 1.00 37.82 C ATOM 8025 C ASN A 525 20.553 48.702 58.492 1.00 38.34 C ATOM 8026 O ASN A 525 19.960 47.967 57.752 1.00 38.10 O ATOM 8027 CB ASN A 525 20.242 50.978 57.598 1.00 36.04 C ATOM 8028 CG ASN A 525 19.519 52.327 57.741 1.00 39.95 C ATOM 8029 OD1 ASN A 525 18.519 52.404 58.444 1.00 40.90 O ATOM 8030 ND2 ASN A 525 20.029 53.379 57.095 1.00 35.97 N ATOM 8031 HA ASN A 525 18.904 49.901 58.955 1.00 0.00 H ATOM 8032 HB2 ASN A 525 21.315 51.158 57.526 1.00 0.00 H ATOM 8033 HB3 ASN A 525 19.896 50.486 56.689 1.00 0.00 H ATOM 8034 HD22 ASN A 525 20.881 53.266 56.509 1.00 0.00 H ATOM 8035 HD21 ASN A 525 19.575 54.311 57.178 1.00 0.00 H ATOM 8036 H ASN A 525 21.275 51.246 60.063 1.00 0.00 H ATOM 8037 N GLN A 526 21.699 48.367 59.060 1.00 37.80 N ATOM 8038 CA GLN A 526 22.292 47.083 58.732 1.00 39.04 C ATOM 8039 C GLN A 526 22.498 46.219 59.952 1.00 39.32 C ATOM 8040 O GLN A 526 22.026 45.078 59.990 1.00 40.58 O ATOM 8041 CB GLN A 526 23.637 47.285 57.990 1.00 39.23 C ATOM 8042 CG GLN A 526 23.503 48.126 56.687 1.00 44.32 C ATOM 8043 CD GLN A 526 24.861 48.407 55.979 1.00 43.98 C ATOM 8044 HA GLN A 526 21.591 46.563 58.079 1.00 0.00 H ATOM 8045 HB2 GLN A 526 24.329 47.794 58.661 1.00 0.00 H ATOM 8046 HB3 GLN A 526 24.039 46.306 57.730 1.00 0.00 H ATOM 8047 HG2 GLN A 526 22.859 47.586 55.993 1.00 0.00 H ATOM 8048 HG3 GLN A 526 23.043 49.081 56.940 1.00 0.00 H ATOM 8049 H GLN A 526 22.167 49.011 59.729 1.00 0.00 H ATOM 8050 N PHE A 527 23.195 46.735 60.967 1.00 38.93 N ATOM 8051 CA PHE A 527 23.434 45.910 62.136 1.00 37.96 C ATOM 8052 C PHE A 527 22.242 45.484 63.017 1.00 37.60 C ATOM 8053 O PHE A 527 22.008 44.284 63.228 1.00 35.96 O ATOM 8054 CB PHE A 527 24.479 46.553 63.046 1.00 36.17 C ATOM 8055 CG PHE A 527 24.861 45.664 64.208 1.00 36.82 C ATOM 8056 CD1 PHE A 527 25.586 44.489 63.983 1.00 35.72 C ATOM 8057 CD2 PHE A 527 24.441 45.960 65.502 1.00 35.71 C ATOM 8058 CE1 PHE A 527 25.878 43.633 65.032 1.00 38.09 C ATOM 8059 CE2 PHE A 527 24.733 45.103 66.574 1.00 37.76 C ATOM 8060 CZ PHE A 527 25.446 43.946 66.340 1.00 38.01 C ATOM 8061 HA PHE A 527 23.764 44.983 61.667 1.00 0.00 H ATOM 8062 HB2 PHE A 527 25.372 46.764 62.458 1.00 0.00 H ATOM 8063 HB3 PHE A 527 24.075 47.486 63.438 1.00 0.00 H ATOM 8064 HD2 PHE A 527 23.875 46.874 65.686 1.00 0.00 H ATOM 8065 HE2 PHE A 527 24.399 45.349 67.582 1.00 0.00 H ATOM 8066 HZ PHE A 527 25.676 43.272 67.165 1.00 0.00 H ATOM 8067 HE1 PHE A 527 26.441 42.718 64.848 1.00 0.00 H ATOM 8068 HD1 PHE A 527 25.923 44.245 62.976 1.00 0.00 H ATOM 8069 H PHE A 527 23.559 47.708 60.921 1.00 0.00 H ATOM 8070 N LEU A 528 21.506 46.452 63.546 1.00 37.58 N ATOM 8071 CA LEU A 528 20.410 46.135 64.443 1.00 38.93 C ATOM 8072 C LEU A 528 19.340 45.202 63.821 1.00 41.02 C ATOM 8073 O LEU A 528 18.845 44.281 64.492 1.00 41.28 O ATOM 8074 CB LEU A 528 19.799 47.433 65.013 1.00 36.48 C ATOM 8075 CG LEU A 528 18.694 47.185 66.068 1.00 38.40 C ATOM 8076 CD1 LEU A 528 19.263 46.384 67.301 1.00 36.22 C ATOM 8077 CD2 LEU A 528 18.107 48.494 66.533 1.00 35.53 C ATOM 8078 HA LEU A 528 20.829 45.556 65.266 1.00 0.00 H ATOM 8079 HB2 LEU A 528 20.595 48.014 65.478 1.00 0.00 H ATOM 8080 HB3 LEU A 528 19.368 48.002 64.189 1.00 0.00 H ATOM 8081 HG LEU A 528 17.910 46.590 65.600 1.00 0.00 H ATOM 8082 HD21 LEU A 528 18.892 49.105 66.978 1.00 0.00 H ATOM 8083 HD22 LEU A 528 17.674 49.019 65.682 1.00 0.00 H ATOM 8084 HD23 LEU A 528 17.332 48.300 67.274 1.00 0.00 H ATOM 8085 HD11 LEU A 528 19.647 45.422 66.962 1.00 0.00 H ATOM 8086 HD12 LEU A 528 20.068 46.955 67.763 1.00 0.00 H ATOM 8087 HD13 LEU A 528 18.466 46.223 68.027 1.00 0.00 H ATOM 8088 H LEU A 528 21.715 47.445 63.317 1.00 0.00 H ATOM 8089 N PRO A 529 18.931 45.449 62.562 1.00 42.53 N ATOM 8090 CA PRO A 529 17.929 44.533 61.986 1.00 44.56 C ATOM 8091 C PRO A 529 18.523 43.108 61.894 1.00 44.84 C ATOM 8092 O PRO A 529 17.855 42.101 62.160 1.00 43.70 O ATOM 8093 CB PRO A 529 17.647 45.135 60.596 1.00 44.16 C ATOM 8094 CG PRO A 529 17.902 46.617 60.793 1.00 43.77 C ATOM 8095 CD PRO A 529 19.095 46.670 61.739 1.00 42.59 C ATOM 8096 HA PRO A 529 17.018 44.439 62.577 1.00 0.00 H ATOM 8097 HD3 PRO A 529 20.034 46.645 61.186 1.00 0.00 H ATOM 8098 HD2 PRO A 529 19.063 47.566 62.359 1.00 0.00 H ATOM 8099 HG3 PRO A 529 17.034 47.103 61.238 1.00 0.00 H ATOM 8100 HG2 PRO A 529 18.139 47.098 59.844 1.00 0.00 H ATOM 8101 HB2 PRO A 529 18.321 44.720 59.847 1.00 0.00 H ATOM 8102 HB3 PRO A 529 16.615 44.954 60.295 1.00 0.00 H ATOM 8103 N LYS A 530 19.787 43.003 61.532 1.00 46.61 N ATOM 8104 CA LYS A 530 20.385 41.663 61.485 1.00 48.23 C ATOM 8105 C LYS A 530 20.359 41.027 62.899 1.00 48.68 C ATOM 8106 O LYS A 530 19.964 39.870 63.074 1.00 48.90 O ATOM 8107 CB LYS A 530 21.798 41.741 60.924 1.00 50.20 C ATOM 8108 CG LYS A 530 22.419 40.371 60.711 1.00 55.76 C ATOM 8109 CD LYS A 530 23.560 40.342 59.654 1.00 58.53 C ATOM 8110 CE LYS A 530 24.415 39.030 59.817 1.00 61.10 C ATOM 8111 NZ LYS A 530 25.632 38.888 58.920 1.00 61.42 N ATOM 8112 HA LYS A 530 19.803 41.024 60.821 1.00 0.00 H ATOM 8113 HB2 LYS A 530 21.766 42.262 59.967 1.00 0.00 H ATOM 8114 HB3 LYS A 530 22.420 42.302 61.621 1.00 0.00 H ATOM 8115 HG2 LYS A 530 22.826 40.029 61.662 1.00 0.00 H ATOM 8116 HG3 LYS A 530 21.635 39.687 60.386 1.00 0.00 H ATOM 8117 HD2 LYS A 530 23.127 40.368 58.654 1.00 0.00 H ATOM 8118 HD3 LYS A 530 24.203 41.211 59.793 1.00 0.00 H ATOM 8119 HE2 LYS A 530 23.759 38.182 59.619 1.00 0.00 H ATOM 8120 HE3 LYS A 530 24.760 38.988 60.850 1.00 0.00 H ATOM 8121 HZ1 LYS A 530 25.331 38.906 57.925 1.00 0.00 H ATOM 8122 HZ2 LYS A 530 26.287 39.675 59.100 1.00 0.00 H ATOM 8123 HZ3 LYS A 530 26.108 37.986 59.123 1.00 0.00 H ATOM 8124 H LYS A 530 20.345 43.846 61.287 1.00 0.00 H ATOM 8125 N LEU A 531 20.737 41.793 63.916 1.00 47.30 N ATOM 8126 CA LEU A 531 20.732 41.316 65.295 1.00 47.31 C ATOM 8127 C LEU A 531 19.346 40.818 65.766 1.00 48.10 C ATOM 8128 O LEU A 531 19.224 39.721 66.322 1.00 47.11 O ATOM 8129 CB LEU A 531 21.241 42.460 66.190 1.00 46.22 C ATOM 8130 CG LEU A 531 21.107 42.742 67.695 1.00 48.23 C ATOM 8131 CD1 LEU A 531 20.142 41.830 68.368 1.00 48.79 C ATOM 8132 CD2 LEU A 531 22.470 42.702 68.350 1.00 48.28 C ATOM 8133 HA LEU A 531 21.386 40.446 65.364 1.00 0.00 H ATOM 8134 HB2 LEU A 531 22.319 42.446 66.030 1.00 0.00 H ATOM 8135 HB3 LEU A 531 20.818 43.351 65.727 1.00 0.00 H ATOM 8136 HG LEU A 531 20.693 43.744 67.810 1.00 0.00 H ATOM 8137 HD21 LEU A 531 22.912 41.716 68.206 1.00 0.00 H ATOM 8138 HD22 LEU A 531 23.111 43.458 67.898 1.00 0.00 H ATOM 8139 HD23 LEU A 531 22.365 42.903 69.416 1.00 0.00 H ATOM 8140 HD11 LEU A 531 19.157 41.949 67.917 1.00 0.00 H ATOM 8141 HD12 LEU A 531 20.475 40.799 68.250 1.00 0.00 H ATOM 8142 HD13 LEU A 531 20.090 42.077 69.428 1.00 0.00 H ATOM 8143 H LEU A 531 21.047 42.767 63.723 1.00 0.00 H ATOM 8144 N LEU A 532 18.316 41.634 65.565 1.00 48.23 N ATOM 8145 CA LEU A 532 16.964 41.280 65.989 1.00 50.74 C ATOM 8146 C LEU A 532 16.463 40.052 65.224 1.00 52.49 C ATOM 8147 O LEU A 532 15.706 39.261 65.763 1.00 53.16 O ATOM 8148 CB LEU A 532 15.992 42.466 65.794 1.00 48.34 C ATOM 8149 CG LEU A 532 16.219 43.725 66.639 1.00 46.70 C ATOM 8150 CD1 LEU A 532 15.320 44.857 66.160 1.00 47.59 C ATOM 8151 CD2 LEU A 532 15.960 43.415 68.085 1.00 45.59 C ATOM 8152 HA LEU A 532 16.999 41.039 67.051 1.00 0.00 H ATOM 8153 HB2 LEU A 532 16.048 42.763 64.747 1.00 0.00 H ATOM 8154 HB3 LEU A 532 14.988 42.103 66.015 1.00 0.00 H ATOM 8155 HG LEU A 532 17.254 44.048 66.528 1.00 0.00 H ATOM 8156 HD21 LEU A 532 14.930 43.079 68.204 1.00 0.00 H ATOM 8157 HD22 LEU A 532 16.640 42.630 68.414 1.00 0.00 H ATOM 8158 HD23 LEU A 532 16.122 44.312 68.682 1.00 0.00 H ATOM 8159 HD11 LEU A 532 15.547 45.083 65.118 1.00 0.00 H ATOM 8160 HD12 LEU A 532 14.277 44.553 66.249 1.00 0.00 H ATOM 8161 HD13 LEU A 532 15.495 45.742 66.772 1.00 0.00 H ATOM 8162 H LEU A 532 18.477 42.547 65.094 1.00 0.00 H ATOM 8163 N ASN A 533 16.906 39.896 63.984 1.00 55.49 N ATOM 8164 CA ASN A 533 16.536 38.755 63.150 1.00 59.47 C ATOM 8165 C ASN A 533 17.184 37.440 63.617 1.00 61.12 C ATOM 8166 O ASN A 533 16.599 36.377 63.480 1.00 61.12 O ATOM 8167 CB ASN A 533 16.968 38.980 61.700 1.00 61.02 C ATOM 8168 CG ASN A 533 16.394 37.936 60.766 1.00 64.07 C ATOM 8169 OD1 ASN A 533 15.187 37.919 60.537 1.00 66.98 O ATOM 8170 ND2 ASN A 533 17.243 37.045 60.233 1.00 64.37 N ATOM 8171 HA ASN A 533 15.452 38.672 63.233 1.00 0.00 H ATOM 8172 HB2 ASN A 533 16.626 39.964 61.380 1.00 0.00 H ATOM 8173 HB3 ASN A 533 18.056 38.939 61.647 1.00 0.00 H ATOM 8174 HD22 ASN A 533 18.258 37.097 60.454 1.00 0.00 H ATOM 8175 HD21 ASN A 533 16.887 36.302 59.598 1.00 0.00 H ATOM 8176 H ASN A 533 17.544 40.616 63.589 1.00 0.00 H ATOM 8177 N ALA A 534 18.405 37.523 64.132 1.00 62.38 N ATOM 8178 CA ALA A 534 19.110 36.347 64.579 1.00 64.89 C ATOM 8179 C ALA A 534 18.698 35.945 65.981 1.00 67.14 C ATOM 8180 O ALA A 534 18.909 34.809 66.376 1.00 68.33 O ATOM 8181 CB ALA A 534 20.616 36.582 64.532 1.00 63.90 C ATOM 8182 HA ALA A 534 18.848 35.533 63.904 1.00 0.00 H ATOM 8183 HB1 ALA A 534 20.915 36.809 63.509 1.00 0.00 H ATOM 8184 HB2 ALA A 534 20.872 37.419 65.181 1.00 0.00 H ATOM 8185 HB3 ALA A 534 21.133 35.685 64.872 1.00 0.00 H ATOM 8186 H ALA A 534 18.862 38.454 64.215 1.00 0.00 H ATOM 8187 N THR A 535 18.105 36.873 66.730 1.00 69.21 N ATOM 8188 CA THR A 535 17.686 36.610 68.108 1.00 69.87 C ATOM 8189 C THR A 535 16.167 36.696 68.273 1.00 71.08 C ATOM 8190 O THR A 535 15.455 36.142 67.394 1.00 72.04 O ATOM 8191 CB THR A 535 18.359 37.618 69.083 1.00 70.41 C ATOM 8192 OG1 THR A 535 18.037 38.954 68.686 1.00 70.18 O ATOM 8193 CG2 THR A 535 19.878 37.466 69.058 1.00 70.52 C ATOM 8194 HA THR A 535 18.001 35.594 68.345 1.00 0.00 H ATOM 8195 HB THR A 535 17.991 37.414 70.089 1.00 0.00 H ATOM 8196 HG1 THR A 535 18.368 39.113 67.767 1.00 0.00 H ATOM 8197 HG23 THR A 535 20.145 36.453 69.358 1.00 0.00 H ATOM 8198 HG21 THR A 535 20.244 37.656 68.049 1.00 0.00 H ATOM 8199 HG22 THR A 535 20.325 38.181 69.749 1.00 0.00 H ATOM 8200 H THR A 535 17.934 37.815 66.323 1.00 0.00 H TER 8201 THR A 535 ATOM 8202 N SER B 4 82.671 32.756 102.270 1.00 55.90 N ATOM 8203 CA SER B 4 82.651 33.542 100.991 1.00 55.32 C ATOM 8204 C SER B 4 81.219 33.933 100.641 1.00 54.48 C ATOM 8205 O SER B 4 80.273 33.160 100.858 1.00 54.01 O ATOM 8206 CB SER B 4 83.221 32.728 99.826 1.00 55.55 C ATOM 8207 OG SER B 4 82.940 33.340 98.566 1.00 56.14 O ATOM 8208 HA SER B 4 83.266 34.429 101.145 1.00 0.00 H ATOM 8209 HB2 SER B 4 82.779 31.732 99.841 1.00 0.00 H ATOM 8210 HB3 SER B 4 84.301 32.647 99.947 1.00 0.00 H ATOM 8211 HG SER B 4 83.323 32.787 97.839 1.00 0.00 H ATOM 8212 HN3 SER B 4 82.099 31.895 102.155 1.00 0.00 H ATOM 8213 HN2 SER B 4 82.277 33.336 103.038 1.00 0.00 H ATOM 8214 HN1 SER B 4 83.651 32.495 102.500 1.00 0.00 H ATOM 8215 N GLU B 5 81.098 35.132 100.085 1.00 52.94 N ATOM 8216 CA GLU B 5 79.844 35.709 99.666 1.00 51.70 C ATOM 8217 C GLU B 5 79.227 34.899 98.517 1.00 49.56 C ATOM 8218 O GLU B 5 78.028 34.995 98.258 1.00 48.96 O ATOM 8219 CB GLU B 5 80.106 37.155 99.247 1.00 52.69 C ATOM 8220 CG GLU B 5 78.888 37.996 98.918 1.00 56.54 C ATOM 8221 CD GLU B 5 79.282 39.416 98.519 1.00 58.72 C ATOM 8222 OE1 GLU B 5 80.466 39.615 98.224 1.00 60.65 O ATOM 8223 OE2 GLU B 5 78.433 40.338 98.479 1.00 61.30 O ATOM 8224 HA GLU B 5 79.128 35.688 100.487 1.00 0.00 H ATOM 8225 HB2 GLU B 5 80.637 37.645 100.063 1.00 0.00 H ATOM 8226 HB3 GLU B 5 80.743 37.133 98.362 1.00 0.00 H ATOM 8227 HG2 GLU B 5 78.349 37.532 98.092 1.00 0.00 H ATOM 8228 HG3 GLU B 5 78.240 38.040 99.794 1.00 0.00 H ATOM 8229 H GLU B 5 81.963 35.692 99.942 1.00 0.00 H ATOM 8230 N LEU B 6 80.035 34.111 97.818 1.00 47.09 N ATOM 8231 CA LEU B 6 79.488 33.339 96.713 1.00 45.14 C ATOM 8232 C LEU B 6 79.089 31.949 97.116 1.00 44.43 C ATOM 8233 O LEU B 6 78.679 31.153 96.277 1.00 45.28 O ATOM 8234 CB LEU B 6 80.470 33.280 95.546 1.00 43.27 C ATOM 8235 CG LEU B 6 80.910 34.662 95.050 1.00 44.00 C ATOM 8236 CD1 LEU B 6 81.984 34.445 93.965 1.00 42.07 C ATOM 8237 CD2 LEU B 6 79.701 35.471 94.457 1.00 43.18 C ATOM 8238 HA LEU B 6 78.584 33.859 96.397 1.00 0.00 H ATOM 8239 HB2 LEU B 6 81.355 32.730 95.866 1.00 0.00 H ATOM 8240 HB3 LEU B 6 79.994 32.752 94.720 1.00 0.00 H ATOM 8241 HG LEU B 6 81.306 35.242 95.883 1.00 0.00 H ATOM 8242 HD21 LEU B 6 79.275 34.922 93.618 1.00 0.00 H ATOM 8243 HD22 LEU B 6 78.942 35.605 95.228 1.00 0.00 H ATOM 8244 HD23 LEU B 6 80.050 36.445 94.115 1.00 0.00 H ATOM 8245 HD11 LEU B 6 82.829 33.907 94.395 1.00 0.00 H ATOM 8246 HD12 LEU B 6 81.560 33.863 93.147 1.00 0.00 H ATOM 8247 HD13 LEU B 6 82.320 35.412 93.590 1.00 0.00 H ATOM 8248 H LEU B 6 81.045 34.046 98.057 1.00 0.00 H ATOM 8249 N LEU B 7 79.176 31.655 98.403 1.00 44.99 N ATOM 8250 CA LEU B 7 78.794 30.345 98.879 1.00 45.93 C ATOM 8251 C LEU B 7 77.540 30.463 99.741 1.00 44.98 C ATOM 8252 O LEU B 7 77.485 31.273 100.670 1.00 45.17 O ATOM 8253 CB LEU B 7 79.936 29.735 99.685 1.00 49.11 C ATOM 8254 CG LEU B 7 79.656 28.287 100.049 1.00 52.88 C ATOM 8255 CD1 LEU B 7 79.414 27.497 98.766 1.00 54.87 C ATOM 8256 CD2 LEU B 7 80.855 27.704 100.844 1.00 55.90 C ATOM 8257 HA LEU B 7 78.581 29.696 98.030 1.00 0.00 H ATOM 8258 HB2 LEU B 7 80.850 29.780 99.093 1.00 0.00 H ATOM 8259 HB3 LEU B 7 80.069 30.310 100.601 1.00 0.00 H ATOM 8260 HG LEU B 7 78.770 28.220 100.680 1.00 0.00 H ATOM 8261 HD21 LEU B 7 81.755 27.755 100.231 1.00 0.00 H ATOM 8262 HD22 LEU B 7 81.001 28.284 101.755 1.00 0.00 H ATOM 8263 HD23 LEU B 7 80.648 26.665 101.102 1.00 0.00 H ATOM 8264 HD11 LEU B 7 78.559 27.918 98.237 1.00 0.00 H ATOM 8265 HD12 LEU B 7 80.299 27.555 98.133 1.00 0.00 H ATOM 8266 HD13 LEU B 7 79.212 26.455 99.015 1.00 0.00 H ATOM 8267 H LEU B 7 79.521 32.370 99.075 1.00 0.00 H ATOM 8268 N VAL B 8 76.515 29.682 99.420 1.00 42.83 N ATOM 8269 CA VAL B 8 75.284 29.739 100.196 1.00 40.30 C ATOM 8270 C VAL B 8 74.791 28.345 100.442 1.00 39.80 C ATOM 8271 O VAL B 8 74.693 27.552 99.529 1.00 38.97 O ATOM 8272 CB VAL B 8 74.147 30.526 99.454 1.00 40.84 C ATOM 8273 CG1 VAL B 8 72.838 30.515 100.317 1.00 37.60 C ATOM 8274 CG2 VAL B 8 74.581 31.962 99.220 1.00 38.50 C ATOM 8275 HA VAL B 8 75.514 30.256 101.127 1.00 0.00 H ATOM 8276 HB VAL B 8 73.953 30.044 98.496 1.00 0.00 H ATOM 8277 HG11 VAL B 8 72.518 29.485 100.476 1.00 0.00 H ATOM 8278 HG12 VAL B 8 73.035 30.989 101.279 1.00 0.00 H ATOM 8279 HG13 VAL B 8 72.055 31.064 99.794 1.00 0.00 H ATOM 8280 HG21 VAL B 8 74.783 32.440 100.179 1.00 0.00 H ATOM 8281 HG22 VAL B 8 75.484 31.972 98.609 1.00 0.00 H ATOM 8282 HG23 VAL B 8 73.786 32.501 98.705 1.00 0.00 H ATOM 8283 H VAL B 8 76.591 29.029 98.614 1.00 0.00 H ATOM 8284 N ASN B 9 74.472 28.042 101.695 1.00 40.77 N ATOM 8285 CA ASN B 9 73.977 26.717 102.030 1.00 41.61 C ATOM 8286 C ASN B 9 72.466 26.775 102.148 1.00 40.87 C ATOM 8287 O ASN B 9 71.946 27.526 102.943 1.00 41.27 O ATOM 8288 CB ASN B 9 74.580 26.229 103.350 1.00 44.56 C ATOM 8289 CG ASN B 9 74.322 24.753 103.568 1.00 49.71 C ATOM 8290 OD1 ASN B 9 74.222 23.962 102.593 1.00 51.40 O ATOM 8291 ND2 ASN B 9 74.209 24.350 104.843 1.00 51.75 N ATOM 8292 HA ASN B 9 74.267 26.019 101.245 1.00 0.00 H ATOM 8293 HB2 ASN B 9 75.656 26.402 103.333 1.00 0.00 H ATOM 8294 HB3 ASN B 9 74.136 26.791 104.171 1.00 0.00 H ATOM 8295 HD22 ASN B 9 74.299 25.040 105.616 1.00 0.00 H ATOM 8296 HD21 ASN B 9 74.032 23.348 105.058 1.00 0.00 H ATOM 8297 H ASN B 9 74.577 28.758 102.442 1.00 0.00 H ATOM 8298 N THR B 10 71.765 25.997 101.341 1.00 39.93 N ATOM 8299 CA THR B 10 70.310 26.009 101.370 1.00 39.66 C ATOM 8300 C THR B 10 69.843 24.661 101.908 1.00 40.69 C ATOM 8301 O THR B 10 70.661 23.754 102.077 1.00 40.78 O ATOM 8302 CB THR B 10 69.714 26.164 99.933 1.00 38.90 C ATOM 8303 OG1 THR B 10 69.821 24.912 99.248 1.00 36.55 O ATOM 8304 CG2 THR B 10 70.486 27.215 99.099 1.00 38.68 C ATOM 8305 HA THR B 10 69.981 26.845 101.988 1.00 0.00 H ATOM 8306 HB THR B 10 68.678 26.484 100.040 1.00 0.00 H ATOM 8307 HG1 THR B 10 70.774 24.650 99.189 1.00 0.00 H ATOM 8308 HG23 THR B 10 70.425 28.185 99.593 1.00 0.00 H ATOM 8309 HG21 THR B 10 71.530 26.914 99.014 1.00 0.00 H ATOM 8310 HG22 THR B 10 70.044 27.284 98.105 1.00 0.00 H ATOM 8311 H THR B 10 72.260 25.368 100.677 1.00 0.00 H ATOM 8312 N LYS B 11 68.530 24.523 102.132 1.00 39.97 N ATOM 8313 CA LYS B 11 67.933 23.273 102.601 1.00 39.67 C ATOM 8314 C LYS B 11 68.090 22.165 101.580 1.00 40.76 C ATOM 8315 O LYS B 11 67.881 21.001 101.899 1.00 41.22 O ATOM 8316 CB LYS B 11 66.438 23.482 102.911 1.00 39.73 C ATOM 8317 CG LYS B 11 66.210 24.503 104.034 1.00 39.52 C ATOM 8318 CD LYS B 11 64.777 25.011 104.065 1.00 37.37 C ATOM 8319 CE LYS B 11 64.604 25.863 105.329 1.00 34.62 C ATOM 8320 NZ LYS B 11 63.291 26.618 105.355 1.00 36.59 N ATOM 8321 HA LYS B 11 68.458 22.977 103.509 1.00 0.00 H ATOM 8322 HB2 LYS B 11 65.939 23.836 102.009 1.00 0.00 H ATOM 8323 HB3 LYS B 11 66.006 22.528 103.212 1.00 0.00 H ATOM 8324 HG2 LYS B 11 66.436 24.031 104.990 1.00 0.00 H ATOM 8325 HG3 LYS B 11 66.880 25.349 103.881 1.00 0.00 H ATOM 8326 HD2 LYS B 11 64.579 25.616 103.180 1.00 0.00 H ATOM 8327 HD3 LYS B 11 64.086 24.168 104.089 1.00 0.00 H ATOM 8328 HE2 LYS B 11 65.421 26.583 105.378 1.00 0.00 H ATOM 8329 HE3 LYS B 11 64.646 25.208 106.199 1.00 0.00 H ATOM 8330 HZ1 LYS B 11 63.242 27.254 104.534 1.00 0.00 H ATOM 8331 HZ2 LYS B 11 62.502 25.941 105.318 1.00 0.00 H ATOM 8332 HZ3 LYS B 11 63.230 27.175 106.231 1.00 0.00 H ATOM 8333 H LYS B 11 67.908 25.340 101.965 1.00 0.00 H ATOM 8334 N SER B 12 68.426 22.499 100.335 1.00 40.44 N ATOM 8335 CA SER B 12 68.618 21.446 99.353 1.00 43.03 C ATOM 8336 C SER B 12 70.112 21.123 99.158 1.00 42.67 C ATOM 8337 O SER B 12 70.454 20.131 98.503 1.00 42.59 O ATOM 8338 CB SER B 12 68.019 21.846 98.001 1.00 45.33 C ATOM 8339 OG SER B 12 66.673 22.270 98.155 1.00 49.12 O ATOM 8340 HA SER B 12 68.109 20.560 99.733 1.00 0.00 H ATOM 8341 HB2 SER B 12 68.050 20.989 97.328 1.00 0.00 H ATOM 8342 HB3 SER B 12 68.605 22.661 97.577 1.00 0.00 H ATOM 8343 HG SER B 12 66.305 22.524 97.272 1.00 0.00 H ATOM 8344 H SER B 12 68.549 23.497 100.070 1.00 0.00 H ATOM 8345 N GLY B 13 70.986 21.941 99.743 1.00 42.97 N ATOM 8346 CA GLY B 13 72.417 21.728 99.586 1.00 43.19 C ATOM 8347 C GLY B 13 73.144 23.055 99.417 1.00 44.13 C ATOM 8348 O GLY B 13 72.501 24.123 99.436 1.00 42.66 O ATOM 8349 HA3 GLY B 13 72.592 21.109 98.706 1.00 0.00 H ATOM 8350 HA2 GLY B 13 72.802 21.219 100.469 1.00 0.00 H ATOM 8351 H GLY B 13 70.643 22.738 100.316 1.00 0.00 H ATOM 8352 N LYS B 14 74.477 22.985 99.287 1.00 43.72 N ATOM 8353 CA LYS B 14 75.347 24.160 99.106 1.00 42.88 C ATOM 8354 C LYS B 14 75.334 24.532 97.637 1.00 42.50 C ATOM 8355 O LYS B 14 75.266 23.670 96.746 1.00 42.52 O ATOM 8356 CB LYS B 14 76.816 23.884 99.490 1.00 45.31 C ATOM 8357 CG LYS B 14 77.117 23.811 100.991 1.00 50.62 C ATOM 8358 CD LYS B 14 78.438 24.571 101.317 1.00 53.53 C ATOM 8359 CE LYS B 14 78.772 24.640 102.830 1.00 53.79 C ATOM 8360 NZ LYS B 14 79.442 23.380 103.346 1.00 56.73 N ATOM 8361 HA LYS B 14 74.966 24.950 99.752 1.00 0.00 H ATOM 8362 HB2 LYS B 14 77.104 22.931 99.045 1.00 0.00 H ATOM 8363 HB3 LYS B 14 77.427 24.681 99.066 1.00 0.00 H ATOM 8364 HG2 LYS B 14 76.295 24.264 101.545 1.00 0.00 H ATOM 8365 HG3 LYS B 14 77.220 22.767 101.287 1.00 0.00 H ATOM 8366 HD2 LYS B 14 79.259 24.066 100.808 1.00 0.00 H ATOM 8367 HD3 LYS B 14 78.350 25.589 100.939 1.00 0.00 H ATOM 8368 HE2 LYS B 14 77.846 24.793 103.384 1.00 0.00 H ATOM 8369 HE3 LYS B 14 79.440 25.484 103.001 1.00 0.00 H ATOM 8370 HZ1 LYS B 14 78.810 22.567 103.198 1.00 0.00 H ATOM 8371 HZ2 LYS B 14 80.333 23.227 102.831 1.00 0.00 H ATOM 8372 HZ3 LYS B 14 79.641 23.485 104.361 1.00 0.00 H ATOM 8373 H LYS B 14 74.923 22.046 99.316 1.00 0.00 H ATOM 8374 N VAL B 15 75.466 25.824 97.395 1.00 41.45 N ATOM 8375 CA VAL B 15 75.411 26.353 96.069 1.00 42.62 C ATOM 8376 C VAL B 15 76.550 27.346 95.941 1.00 41.54 C ATOM 8377 O VAL B 15 76.832 28.095 96.877 1.00 41.19 O ATOM 8378 CB VAL B 15 74.000 27.024 95.935 1.00 44.25 C ATOM 8379 CG1 VAL B 15 74.111 28.504 95.791 1.00 45.23 C ATOM 8380 CG2 VAL B 15 73.215 26.353 94.889 1.00 44.17 C ATOM 8381 HA VAL B 15 75.526 25.611 95.279 1.00 0.00 H ATOM 8382 HB VAL B 15 73.438 26.886 96.858 1.00 0.00 H ATOM 8383 HG11 VAL B 15 74.608 28.917 96.669 1.00 0.00 H ATOM 8384 HG12 VAL B 15 74.692 28.738 94.899 1.00 0.00 H ATOM 8385 HG13 VAL B 15 73.114 28.935 95.701 1.00 0.00 H ATOM 8386 HG21 VAL B 15 73.739 26.431 93.937 1.00 0.00 H ATOM 8387 HG22 VAL B 15 73.087 25.302 95.150 1.00 0.00 H ATOM 8388 HG23 VAL B 15 72.238 26.830 94.808 1.00 0.00 H ATOM 8389 H VAL B 15 75.614 26.475 98.193 1.00 0.00 H ATOM 8390 N MET B 16 77.202 27.365 94.785 1.00 42.12 N ATOM 8391 CA MET B 16 78.302 28.297 94.588 1.00 43.55 C ATOM 8392 C MET B 16 77.988 29.208 93.432 1.00 41.50 C ATOM 8393 O MET B 16 77.810 28.760 92.293 1.00 40.53 O ATOM 8394 CB MET B 16 79.599 27.538 94.290 1.00 47.90 C ATOM 8395 CG MET B 16 80.747 28.421 93.802 1.00 54.37 C ATOM 8396 SD MET B 16 81.876 28.799 95.121 1.00 65.35 S ATOM 8397 CE MET B 16 81.208 30.252 95.766 1.00 60.36 C ATOM 8398 HA MET B 16 78.432 28.881 95.499 1.00 0.00 H ATOM 8399 HB2 MET B 16 79.919 27.036 95.203 1.00 0.00 H ATOM 8400 HB3 MET B 16 79.390 26.794 93.522 1.00 0.00 H ATOM 8401 HG2 MET B 16 80.337 29.351 93.407 1.00 0.00 H ATOM 8402 HG3 MET B 16 81.286 27.899 93.012 1.00 0.00 H ATOM 8403 HE1 MET B 16 81.188 31.017 94.990 1.00 0.00 H ATOM 8404 HE2 MET B 16 80.193 30.060 96.115 1.00 0.00 H ATOM 8405 HE3 MET B 16 81.822 30.594 96.599 1.00 0.00 H ATOM 8406 H MET B 16 76.927 26.715 94.021 1.00 0.00 H ATOM 8407 N GLY B 17 77.974 30.492 93.713 1.00 39.83 N ATOM 8408 CA GLY B 17 77.642 31.418 92.654 1.00 42.69 C ATOM 8409 C GLY B 17 78.864 32.010 91.961 1.00 43.33 C ATOM 8410 O GLY B 17 79.937 31.453 92.027 1.00 43.01 O ATOM 8411 HA3 GLY B 17 77.057 32.233 93.079 1.00 0.00 H ATOM 8412 HA2 GLY B 17 77.044 30.892 91.910 1.00 0.00 H ATOM 8413 H GLY B 17 78.196 30.832 94.671 1.00 0.00 H ATOM 8414 N THR B 18 78.674 33.159 91.330 1.00 43.49 N ATOM 8415 CA THR B 18 79.728 33.844 90.619 1.00 45.06 C ATOM 8416 C THR B 18 79.502 35.325 90.727 1.00 44.35 C ATOM 8417 O THR B 18 78.384 35.762 90.893 1.00 44.23 O ATOM 8418 CB THR B 18 79.766 33.420 89.135 1.00 45.63 C ATOM 8419 OG1 THR B 18 80.805 34.145 88.485 1.00 47.73 O ATOM 8420 CG2 THR B 18 78.425 33.724 88.412 1.00 46.64 C ATOM 8421 HA THR B 18 80.687 33.578 91.064 1.00 0.00 H ATOM 8422 HB THR B 18 79.940 32.345 89.092 1.00 0.00 H ATOM 8423 HG1 THR B 18 80.622 35.115 88.555 1.00 0.00 H ATOM 8424 HG23 THR B 18 77.619 33.175 88.899 1.00 0.00 H ATOM 8425 HG21 THR B 18 78.221 34.793 88.463 1.00 0.00 H ATOM 8426 HG22 THR B 18 78.498 33.416 87.369 1.00 0.00 H ATOM 8427 H THR B 18 77.726 33.586 91.347 1.00 0.00 H ATOM 8428 N ARG B 19 80.569 36.102 90.668 1.00 45.89 N ATOM 8429 CA ARG B 19 80.464 37.545 90.769 1.00 48.25 C ATOM 8430 C ARG B 19 80.249 38.128 89.370 1.00 47.86 C ATOM 8431 O ARG B 19 80.816 37.653 88.402 1.00 47.42 O ATOM 8432 CB ARG B 19 81.713 38.136 91.440 1.00 52.73 C ATOM 8433 CG ARG B 19 81.717 39.664 91.428 1.00 59.03 C ATOM 8434 CD ARG B 19 82.317 40.301 92.693 1.00 64.27 C ATOM 8435 NE ARG B 19 81.553 41.517 93.054 1.00 70.10 N ATOM 8436 CZ ARG B 19 81.823 42.320 94.089 1.00 71.46 C ATOM 8437 NH1 ARG B 19 82.853 42.049 94.880 1.00 72.63 N ATOM 8438 NH2 ARG B 19 81.066 43.390 94.334 1.00 71.71 N ATOM 8439 HA ARG B 19 79.611 37.808 91.395 1.00 0.00 H ATOM 8440 HB2 ARG B 19 81.749 37.794 92.474 1.00 0.00 H ATOM 8441 HB3 ARG B 19 82.596 37.780 90.910 1.00 0.00 H ATOM 8442 HG2 ARG B 19 82.297 39.998 90.568 1.00 0.00 H ATOM 8443 HG3 ARG B 19 80.688 40.008 91.326 1.00 0.00 H ATOM 8444 HD2 ARG B 19 83.357 40.569 92.505 1.00 0.00 H ATOM 8445 HD3 ARG B 19 82.270 39.587 93.515 1.00 0.00 H ATOM 8446 HE ARG B 19 80.741 41.767 92.454 1.00 0.00 H ATOM 8447 HH12 ARG B 19 83.067 42.670 95.686 1.00 0.00 H ATOM 8448 HH11 ARG B 19 83.446 41.215 94.694 1.00 0.00 H ATOM 8449 HH22 ARG B 19 81.285 44.008 95.141 1.00 0.00 H ATOM 8450 HH21 ARG B 19 80.257 43.607 93.718 1.00 0.00 H ATOM 8451 H ARG B 19 81.506 35.669 90.546 1.00 0.00 H ATOM 8452 N VAL B 20 79.379 39.123 89.248 1.00 47.22 N ATOM 8453 CA VAL B 20 79.134 39.678 87.932 1.00 46.84 C ATOM 8454 C VAL B 20 79.216 41.167 87.953 1.00 45.46 C ATOM 8455 O VAL B 20 78.705 41.821 88.851 1.00 45.47 O ATOM 8456 CB VAL B 20 77.730 39.249 87.334 1.00 47.76 C ATOM 8457 CG1 VAL B 20 77.547 37.754 87.489 1.00 48.74 C ATOM 8458 CG2 VAL B 20 76.603 39.990 88.007 1.00 47.95 C ATOM 8459 HA VAL B 20 79.915 39.271 87.289 1.00 0.00 H ATOM 8460 HB VAL B 20 77.710 39.506 86.275 1.00 0.00 H ATOM 8461 HG11 VAL B 20 78.343 37.235 86.955 1.00 0.00 H ATOM 8462 HG12 VAL B 20 77.586 37.492 88.546 1.00 0.00 H ATOM 8463 HG13 VAL B 20 76.581 37.463 87.077 1.00 0.00 H ATOM 8464 HG21 VAL B 20 76.610 39.768 89.074 1.00 0.00 H ATOM 8465 HG22 VAL B 20 76.733 41.062 87.857 1.00 0.00 H ATOM 8466 HG23 VAL B 20 75.653 39.674 87.575 1.00 0.00 H ATOM 8467 H VAL B 20 78.882 39.497 90.082 1.00 0.00 H ATOM 8468 N PRO B 21 79.878 41.730 86.951 1.00 45.37 N ATOM 8469 CA PRO B 21 80.013 43.187 86.871 1.00 46.06 C ATOM 8470 C PRO B 21 78.664 43.768 86.457 1.00 45.26 C ATOM 8471 O PRO B 21 77.925 43.131 85.694 1.00 45.30 O ATOM 8472 CB PRO B 21 81.102 43.376 85.809 1.00 45.33 C ATOM 8473 CG PRO B 21 80.849 42.211 84.860 1.00 46.23 C ATOM 8474 CD PRO B 21 80.508 41.045 85.810 1.00 46.01 C ATOM 8475 HA PRO B 21 80.284 43.688 87.800 1.00 0.00 H ATOM 8476 HD3 PRO B 21 79.817 40.345 85.341 1.00 0.00 H ATOM 8477 HD2 PRO B 21 81.408 40.513 86.119 1.00 0.00 H ATOM 8478 HG3 PRO B 21 81.738 41.987 84.271 1.00 0.00 H ATOM 8479 HG2 PRO B 21 80.016 42.426 84.191 1.00 0.00 H ATOM 8480 HB2 PRO B 21 80.991 44.332 85.297 1.00 0.00 H ATOM 8481 HB3 PRO B 21 82.097 43.315 86.250 1.00 0.00 H ATOM 8482 N VAL B 22 78.358 44.963 86.957 1.00 44.31 N ATOM 8483 CA VAL B 22 77.098 45.652 86.671 1.00 45.08 C ATOM 8484 C VAL B 22 77.341 47.141 86.836 1.00 45.06 C ATOM 8485 O VAL B 22 77.667 47.573 87.957 1.00 42.73 O ATOM 8486 CB VAL B 22 76.001 45.439 87.763 1.00 45.52 C ATOM 8487 CG1 VAL B 22 74.608 45.553 87.152 1.00 42.73 C ATOM 8488 CG2 VAL B 22 76.276 44.222 88.558 1.00 46.19 C ATOM 8489 HA VAL B 22 76.787 45.287 85.692 1.00 0.00 H ATOM 8490 HB VAL B 22 76.034 46.241 88.500 1.00 0.00 H ATOM 8491 HG11 VAL B 22 74.485 46.544 86.714 1.00 0.00 H ATOM 8492 HG12 VAL B 22 74.489 44.795 86.378 1.00 0.00 H ATOM 8493 HG13 VAL B 22 73.858 45.402 87.929 1.00 0.00 H ATOM 8494 HG21 VAL B 22 76.288 43.354 87.899 1.00 0.00 H ATOM 8495 HG22 VAL B 22 77.244 44.321 89.048 1.00 0.00 H ATOM 8496 HG23 VAL B 22 75.497 44.098 89.311 1.00 0.00 H ATOM 8497 H VAL B 22 79.047 45.430 87.581 1.00 0.00 H ATOM 8498 N LEU B 23 77.135 47.909 85.769 1.00 45.50 N ATOM 8499 CA LEU B 23 77.282 49.360 85.827 1.00 46.74 C ATOM 8500 C LEU B 23 78.519 49.798 86.659 1.00 47.58 C ATOM 8501 O LEU B 23 78.406 50.549 87.621 1.00 46.36 O ATOM 8502 CB LEU B 23 75.975 49.937 86.414 1.00 46.55 C ATOM 8503 CG LEU B 23 74.709 49.611 85.580 1.00 47.02 C ATOM 8504 CD1 LEU B 23 73.452 49.867 86.358 1.00 44.43 C ATOM 8505 CD2 LEU B 23 74.721 50.453 84.299 1.00 47.03 C ATOM 8506 HA LEU B 23 77.455 49.748 84.823 1.00 0.00 H ATOM 8507 HB2 LEU B 23 75.840 49.529 87.416 1.00 0.00 H ATOM 8508 HB3 LEU B 23 76.076 51.021 86.475 1.00 0.00 H ATOM 8509 HG LEU B 23 74.724 48.551 85.328 1.00 0.00 H ATOM 8510 HD21 LEU B 23 74.726 51.511 84.561 1.00 0.00 H ATOM 8511 HD22 LEU B 23 75.613 50.217 83.719 1.00 0.00 H ATOM 8512 HD23 LEU B 23 73.833 50.227 83.709 1.00 0.00 H ATOM 8513 HD11 LEU B 23 73.446 49.243 87.251 1.00 0.00 H ATOM 8514 HD12 LEU B 23 73.413 50.917 86.647 1.00 0.00 H ATOM 8515 HD13 LEU B 23 72.588 49.626 85.739 1.00 0.00 H ATOM 8516 H LEU B 23 76.862 47.463 84.870 1.00 0.00 H ATOM 8517 N SER B 24 79.684 49.277 86.300 1.00 49.68 N ATOM 8518 CA SER B 24 80.943 49.603 86.989 1.00 53.25 C ATOM 8519 C SER B 24 81.047 49.175 88.473 1.00 53.37 C ATOM 8520 O SER B 24 81.895 49.686 89.222 1.00 55.14 O ATOM 8521 CB SER B 24 81.221 51.099 86.909 1.00 53.83 C ATOM 8522 OG SER B 24 80.681 51.687 88.085 1.00 58.20 O ATOM 8523 HA SER B 24 81.685 49.011 86.453 1.00 0.00 H ATOM 8524 HB2 SER B 24 80.743 51.522 86.025 1.00 0.00 H ATOM 8525 HB3 SER B 24 82.295 51.278 86.860 1.00 0.00 H ATOM 8526 HG SER B 24 79.707 51.514 88.122 1.00 0.00 H ATOM 8527 H SER B 24 79.709 48.612 85.501 1.00 0.00 H ATOM 8528 N SER B 25 80.187 48.253 88.898 1.00 52.33 N ATOM 8529 CA SER B 25 80.215 47.708 90.251 1.00 50.01 C ATOM 8530 C SER B 25 80.067 46.199 90.069 1.00 49.11 C ATOM 8531 O SER B 25 80.320 45.679 88.987 1.00 47.14 O ATOM 8532 CB SER B 25 79.087 48.276 91.108 1.00 50.22 C ATOM 8533 OG SER B 25 79.177 47.772 92.431 1.00 50.72 O ATOM 8534 HA SER B 25 81.136 47.969 90.773 1.00 0.00 H ATOM 8535 HB2 SER B 25 78.128 47.989 90.677 1.00 0.00 H ATOM 8536 HB3 SER B 25 79.163 49.363 91.130 1.00 0.00 H ATOM 8537 HG SER B 25 78.441 48.147 92.977 1.00 0.00 H ATOM 8538 H SER B 25 79.463 47.906 88.237 1.00 0.00 H ATOM 8539 N HIS B 26 79.662 45.480 91.100 1.00 49.19 N ATOM 8540 CA HIS B 26 79.539 44.022 90.970 1.00 50.68 C ATOM 8541 C HIS B 26 78.454 43.490 91.924 1.00 49.75 C ATOM 8542 O HIS B 26 78.153 44.130 92.940 1.00 49.06 O ATOM 8543 CB HIS B 26 80.876 43.324 91.362 1.00 54.69 C ATOM 8544 CG HIS B 26 82.049 43.617 90.454 1.00 60.52 C ATOM 8545 ND1 HIS B 26 82.879 44.714 90.619 1.00 62.99 N ATOM 8546 CD2 HIS B 26 82.555 42.927 89.392 1.00 62.10 C ATOM 8547 CE1 HIS B 26 83.838 44.684 89.701 1.00 63.77 C ATOM 8548 NE2 HIS B 26 83.664 43.611 88.945 1.00 63.10 N ATOM 8549 HA HIS B 26 79.283 43.807 89.933 1.00 0.00 H ATOM 8550 HB2 HIS B 26 81.141 43.645 92.369 1.00 0.00 H ATOM 8551 HB3 HIS B 26 80.708 42.247 91.358 1.00 0.00 H ATOM 8552 HD2 HIS B 26 82.155 42.003 88.974 1.00 0.00 H ATOM 8553 HE1 HIS B 26 84.635 45.419 89.589 1.00 0.00 H ATOM 8554 H HIS B 26 79.431 45.945 92.001 1.00 0.00 H ATOM 8555 N ILE B 27 77.871 42.331 91.613 1.00 48.17 N ATOM 8556 CA ILE B 27 76.914 41.700 92.528 1.00 47.02 C ATOM 8557 C ILE B 27 77.143 40.218 92.374 1.00 45.81 C ATOM 8558 O ILE B 27 77.939 39.822 91.536 1.00 45.86 O ATOM 8559 CB ILE B 27 75.454 42.008 92.205 1.00 47.64 C ATOM 8560 CG1 ILE B 27 75.156 41.624 90.771 1.00 48.83 C ATOM 8561 CG2 ILE B 27 75.154 43.469 92.457 1.00 47.90 C ATOM 8562 CD1 ILE B 27 73.759 41.997 90.409 1.00 53.30 C ATOM 8563 HA ILE B 27 77.078 42.078 93.537 1.00 0.00 H ATOM 8564 HB ILE B 27 74.809 41.421 92.859 1.00 0.00 H ATOM 8565 HG12 ILE B 27 75.849 42.143 90.109 1.00 0.00 H ATOM 8566 HG13 ILE B 27 75.282 40.548 90.654 1.00 0.00 H ATOM 8567 HD11 ILE B 27 73.063 41.476 91.067 1.00 0.00 H ATOM 8568 HD12 ILE B 27 73.631 43.074 90.521 1.00 0.00 H ATOM 8569 HD13 ILE B 27 73.565 41.713 89.375 1.00 0.00 H ATOM 8570 HG21 ILE B 27 75.343 43.702 93.505 1.00 0.00 H ATOM 8571 HG22 ILE B 27 75.795 44.084 91.826 1.00 0.00 H ATOM 8572 HG23 ILE B 27 74.109 43.670 92.221 1.00 0.00 H ATOM 8573 H ILE B 27 78.098 41.869 90.710 1.00 0.00 H ATOM 8574 N SER B 28 76.453 39.404 93.173 1.00 44.00 N ATOM 8575 CA SER B 28 76.596 37.950 93.085 1.00 43.60 C ATOM 8576 C SER B 28 75.441 37.393 92.270 1.00 44.04 C ATOM 8577 O SER B 28 74.325 37.935 92.307 1.00 45.89 O ATOM 8578 CB SER B 28 76.504 37.292 94.460 1.00 42.54 C ATOM 8579 OG SER B 28 77.274 37.964 95.430 1.00 42.69 O ATOM 8580 HA SER B 28 77.567 37.743 92.636 1.00 0.00 H ATOM 8581 HB2 SER B 28 76.859 36.264 94.381 1.00 0.00 H ATOM 8582 HB3 SER B 28 75.462 37.291 94.779 1.00 0.00 H ATOM 8583 HG SER B 28 77.182 37.502 96.301 1.00 0.00 H ATOM 8584 H SER B 28 75.800 39.810 93.873 1.00 0.00 H ATOM 8585 N ALA B 29 75.683 36.289 91.583 1.00 42.12 N ATOM 8586 CA ALA B 29 74.656 35.642 90.789 1.00 41.79 C ATOM 8587 C ALA B 29 74.754 34.147 91.045 1.00 41.43 C ATOM 8588 O ALA B 29 75.868 33.583 91.092 1.00 40.88 O ATOM 8589 CB ALA B 29 74.860 35.932 89.277 1.00 42.02 C ATOM 8590 HA ALA B 29 73.674 36.023 91.069 1.00 0.00 H ATOM 8591 HB1 ALA B 29 74.812 37.007 89.105 1.00 0.00 H ATOM 8592 HB2 ALA B 29 75.834 35.556 88.964 1.00 0.00 H ATOM 8593 HB3 ALA B 29 74.077 35.435 88.704 1.00 0.00 H ATOM 8594 H ALA B 29 76.636 35.873 91.613 1.00 0.00 H ATOM 8595 N PHE B 30 73.603 33.509 91.235 1.00 39.60 N ATOM 8596 CA PHE B 30 73.569 32.056 91.440 1.00 39.37 C ATOM 8597 C PHE B 30 72.673 31.559 90.327 1.00 40.33 C ATOM 8598 O PHE B 30 71.453 31.594 90.432 1.00 41.85 O ATOM 8599 CB PHE B 30 72.981 31.737 92.808 1.00 38.95 C ATOM 8600 CG PHE B 30 73.786 32.290 93.942 1.00 36.67 C ATOM 8601 CD1 PHE B 30 73.606 33.618 94.351 1.00 36.79 C ATOM 8602 CD2 PHE B 30 74.757 31.486 94.578 1.00 36.42 C ATOM 8603 CE1 PHE B 30 74.371 34.164 95.376 1.00 37.86 C ATOM 8604 CE2 PHE B 30 75.546 31.996 95.619 1.00 36.54 C ATOM 8605 CZ PHE B 30 75.364 33.349 96.030 1.00 37.77 C ATOM 8606 HA PHE B 30 74.554 31.590 91.416 1.00 0.00 H ATOM 8607 HB2 PHE B 30 71.976 32.157 92.859 1.00 0.00 H ATOM 8608 HB3 PHE B 30 72.927 30.654 92.918 1.00 0.00 H ATOM 8609 HD2 PHE B 30 74.895 30.454 94.255 1.00 0.00 H ATOM 8610 HE2 PHE B 30 76.289 31.366 96.108 1.00 0.00 H ATOM 8611 HZ PHE B 30 75.972 33.765 96.834 1.00 0.00 H ATOM 8612 HE1 PHE B 30 74.221 35.199 95.682 1.00 0.00 H ATOM 8613 HD1 PHE B 30 72.854 34.233 93.858 1.00 0.00 H ATOM 8614 H PHE B 30 72.713 34.048 91.238 1.00 0.00 H ATOM 8615 N LEU B 31 73.281 31.126 89.241 1.00 40.54 N ATOM 8616 CA LEU B 31 72.546 30.724 88.061 1.00 40.14 C ATOM 8617 C LEU B 31 72.380 29.240 87.960 1.00 40.54 C ATOM 8618 O LEU B 31 73.261 28.492 88.354 1.00 40.86 O ATOM 8619 CB LEU B 31 73.298 31.238 86.823 1.00 39.49 C ATOM 8620 CG LEU B 31 73.805 32.683 86.979 1.00 39.68 C ATOM 8621 CD1 LEU B 31 74.599 33.159 85.705 1.00 37.00 C ATOM 8622 CD2 LEU B 31 72.583 33.577 87.229 1.00 36.76 C ATOM 8623 HA LEU B 31 71.546 31.152 88.126 1.00 0.00 H ATOM 8624 HB2 LEU B 31 74.154 30.588 86.642 1.00 0.00 H ATOM 8625 HB3 LEU B 31 72.625 31.197 85.967 1.00 0.00 H ATOM 8626 HG LEU B 31 74.501 32.743 87.816 1.00 0.00 H ATOM 8627 HD21 LEU B 31 71.900 33.502 86.383 1.00 0.00 H ATOM 8628 HD22 LEU B 31 72.076 33.251 88.137 1.00 0.00 H ATOM 8629 HD23 LEU B 31 72.908 34.611 87.344 1.00 0.00 H ATOM 8630 HD11 LEU B 31 75.458 32.507 85.549 1.00 0.00 H ATOM 8631 HD12 LEU B 31 73.946 33.115 84.834 1.00 0.00 H ATOM 8632 HD13 LEU B 31 74.941 34.183 85.853 1.00 0.00 H ATOM 8633 H LEU B 31 74.320 31.072 89.232 1.00 0.00 H ATOM 8634 N GLY B 32 71.232 28.810 87.443 1.00 40.16 N ATOM 8635 CA GLY B 32 70.995 27.384 87.254 1.00 39.34 C ATOM 8636 C GLY B 32 70.781 26.525 88.501 1.00 39.81 C ATOM 8637 O GLY B 32 71.223 25.394 88.521 1.00 39.77 O ATOM 8638 HA3 GLY B 32 71.857 26.979 86.724 1.00 0.00 H ATOM 8639 HA2 GLY B 32 70.106 27.282 86.632 1.00 0.00 H ATOM 8640 H GLY B 32 70.499 29.496 87.172 1.00 0.00 H ATOM 8641 N ILE B 33 70.133 27.050 89.542 1.00 39.56 N ATOM 8642 CA ILE B 33 69.884 26.259 90.746 1.00 39.45 C ATOM 8643 C ILE B 33 68.682 25.377 90.423 1.00 38.78 C ATOM 8644 O ILE B 33 67.639 25.895 90.004 1.00 38.71 O ATOM 8645 CB ILE B 33 69.539 27.161 91.963 1.00 38.85 C ATOM 8646 CG1 ILE B 33 70.704 28.095 92.281 1.00 38.86 C ATOM 8647 CG2 ILE B 33 69.193 26.282 93.168 1.00 38.53 C ATOM 8648 CD1 ILE B 33 70.414 29.104 93.414 1.00 37.05 C ATOM 8649 HA ILE B 33 70.771 25.685 91.012 1.00 0.00 H ATOM 8650 HB ILE B 33 68.674 27.779 91.722 1.00 0.00 H ATOM 8651 HG12 ILE B 33 71.560 27.487 92.575 1.00 0.00 H ATOM 8652 HG13 ILE B 33 70.950 28.655 91.379 1.00 0.00 H ATOM 8653 HD11 ILE B 33 69.568 29.731 93.133 1.00 0.00 H ATOM 8654 HD12 ILE B 33 70.178 28.562 94.330 1.00 0.00 H ATOM 8655 HD13 ILE B 33 71.292 29.729 93.576 1.00 0.00 H ATOM 8656 HG21 ILE B 33 68.335 25.655 92.925 1.00 0.00 H ATOM 8657 HG22 ILE B 33 70.047 25.651 93.413 1.00 0.00 H ATOM 8658 HG23 ILE B 33 68.951 26.916 94.021 1.00 0.00 H ATOM 8659 H ILE B 33 69.801 28.034 89.497 1.00 0.00 H ATOM 8660 N PRO B 34 68.808 24.041 90.601 1.00 38.05 N ATOM 8661 CA PRO B 34 67.704 23.094 90.308 1.00 38.22 C ATOM 8662 C PRO B 34 66.627 23.146 91.382 1.00 37.80 C ATOM 8663 O PRO B 34 66.953 23.244 92.555 1.00 36.65 O ATOM 8664 CB PRO B 34 68.416 21.724 90.252 1.00 38.26 C ATOM 8665 CG PRO B 34 69.533 21.891 91.333 1.00 36.38 C ATOM 8666 CD PRO B 34 70.029 23.331 91.056 1.00 37.91 C ATOM 8667 HA PRO B 34 67.174 23.323 89.383 1.00 0.00 H ATOM 8668 HD3 PRO B 34 70.429 23.786 91.962 1.00 0.00 H ATOM 8669 HD2 PRO B 34 70.794 23.336 90.280 1.00 0.00 H ATOM 8670 HG3 PRO B 34 70.332 21.162 91.195 1.00 0.00 H ATOM 8671 HG2 PRO B 34 69.128 21.797 92.341 1.00 0.00 H ATOM 8672 HB2 PRO B 34 67.735 20.913 90.509 1.00 0.00 H ATOM 8673 HB3 PRO B 34 68.843 21.540 89.266 1.00 0.00 H ATOM 8674 N PHE B 35 65.340 23.116 91.011 1.00 37.74 N ATOM 8675 CA PHE B 35 64.323 23.174 92.062 1.00 36.92 C ATOM 8676 C PHE B 35 63.406 22.008 91.914 1.00 36.89 C ATOM 8677 O PHE B 35 62.520 21.801 92.738 1.00 38.60 O ATOM 8678 CB PHE B 35 63.531 24.508 92.067 1.00 36.68 C ATOM 8679 CG PHE B 35 62.777 24.781 90.772 1.00 35.75 C ATOM 8680 CD1 PHE B 35 61.581 24.112 90.492 1.00 35.78 C ATOM 8681 CD2 PHE B 35 63.304 25.667 89.823 1.00 33.07 C ATOM 8682 CE1 PHE B 35 60.912 24.332 89.242 1.00 35.68 C ATOM 8683 CE2 PHE B 35 62.653 25.890 88.603 1.00 34.75 C ATOM 8684 CZ PHE B 35 61.466 25.227 88.313 1.00 36.38 C ATOM 8685 HA PHE B 35 64.832 23.129 93.025 1.00 0.00 H ATOM 8686 HB2 PHE B 35 62.811 24.477 92.884 1.00 0.00 H ATOM 8687 HB3 PHE B 35 64.234 25.324 92.234 1.00 0.00 H ATOM 8688 HD2 PHE B 35 64.235 26.191 90.038 1.00 0.00 H ATOM 8689 HE2 PHE B 35 63.078 26.585 87.879 1.00 0.00 H ATOM 8690 HZ PHE B 35 60.964 25.403 87.362 1.00 0.00 H ATOM 8691 HE1 PHE B 35 59.983 23.809 89.016 1.00 0.00 H ATOM 8692 HD1 PHE B 35 61.157 23.424 91.223 1.00 0.00 H ATOM 8693 H PHE B 35 65.072 23.053 90.008 1.00 0.00 H ATOM 8694 N ALA B 36 63.615 21.222 90.876 1.00 37.51 N ATOM 8695 CA ALA B 36 62.788 20.027 90.705 1.00 38.33 C ATOM 8696 C ALA B 36 63.652 18.948 90.102 1.00 39.45 C ATOM 8697 O ALA B 36 64.758 19.228 89.637 1.00 39.40 O ATOM 8698 CB ALA B 36 61.602 20.314 89.755 1.00 37.06 C ATOM 8699 HA ALA B 36 62.388 19.718 91.671 1.00 0.00 H ATOM 8700 HB1 ALA B 36 60.988 21.111 90.173 1.00 0.00 H ATOM 8701 HB2 ALA B 36 61.984 20.621 88.781 1.00 0.00 H ATOM 8702 HB3 ALA B 36 61.001 19.411 89.643 1.00 0.00 H ATOM 8703 H ALA B 36 64.360 21.449 90.186 1.00 0.00 H ATOM 8704 N GLU B 37 63.175 17.700 90.143 1.00 40.62 N ATOM 8705 CA GLU B 37 63.881 16.615 89.476 1.00 40.79 C ATOM 8706 C GLU B 37 63.630 16.819 87.960 1.00 40.96 C ATOM 8707 O GLU B 37 62.578 17.282 87.577 1.00 39.43 O ATOM 8708 CB GLU B 37 63.286 15.271 89.908 1.00 41.94 C ATOM 8709 CG GLU B 37 63.713 14.818 91.341 1.00 45.91 C ATOM 8710 CD GLU B 37 65.220 14.580 91.408 1.00 47.36 C ATOM 8711 OE1 GLU B 37 65.691 13.841 90.526 1.00 48.71 O ATOM 8712 OE2 GLU B 37 65.920 15.128 92.296 1.00 47.47 O ATOM 8713 HA GLU B 37 64.943 16.616 89.720 1.00 0.00 H ATOM 8714 HB2 GLU B 37 62.199 15.353 89.884 1.00 0.00 H ATOM 8715 HB3 GLU B 37 63.607 14.509 89.198 1.00 0.00 H ATOM 8716 HG2 GLU B 37 63.441 15.594 92.057 1.00 0.00 H ATOM 8717 HG3 GLU B 37 63.193 13.894 91.594 1.00 0.00 H ATOM 8718 H GLU B 37 62.292 17.502 90.656 1.00 0.00 H ATOM 8719 N PRO B 38 64.612 16.497 87.089 1.00 41.89 N ATOM 8720 CA PRO B 38 64.416 16.653 85.646 1.00 41.58 C ATOM 8721 C PRO B 38 63.144 15.910 85.247 1.00 42.78 C ATOM 8722 O PRO B 38 62.997 14.722 85.562 1.00 42.19 O ATOM 8723 CB PRO B 38 65.655 15.988 85.066 1.00 42.08 C ATOM 8724 CG PRO B 38 66.735 16.424 86.078 1.00 41.40 C ATOM 8725 CD PRO B 38 66.009 16.095 87.397 1.00 41.54 C ATOM 8726 HA PRO B 38 64.301 17.682 85.304 1.00 0.00 H ATOM 8727 HD3 PRO B 38 66.073 15.032 87.631 1.00 0.00 H ATOM 8728 HD2 PRO B 38 66.414 16.673 88.227 1.00 0.00 H ATOM 8729 HG3 PRO B 38 66.963 17.487 85.995 1.00 0.00 H ATOM 8730 HG2 PRO B 38 67.653 15.847 85.965 1.00 0.00 H ATOM 8731 HB2 PRO B 38 65.550 14.903 85.037 1.00 0.00 H ATOM 8732 HB3 PRO B 38 65.874 16.357 84.064 1.00 0.00 H ATOM 8733 N PRO B 39 62.208 16.577 84.525 1.00 42.16 N ATOM 8734 CA PRO B 39 60.985 15.842 84.172 1.00 41.38 C ATOM 8735 C PRO B 39 61.141 15.145 82.826 1.00 43.52 C ATOM 8736 O PRO B 39 60.527 15.515 81.809 1.00 42.86 O ATOM 8737 CB PRO B 39 59.928 16.936 84.185 1.00 41.70 C ATOM 8738 CG PRO B 39 60.649 18.087 83.602 1.00 41.92 C ATOM 8739 CD PRO B 39 62.067 18.008 84.223 1.00 41.18 C ATOM 8740 HA PRO B 39 60.729 15.028 84.850 1.00 0.00 H ATOM 8741 HD3 PRO B 39 62.826 18.337 83.513 1.00 0.00 H ATOM 8742 HD2 PRO B 39 62.134 18.610 85.129 1.00 0.00 H ATOM 8743 HG3 PRO B 39 60.162 19.024 83.871 1.00 0.00 H ATOM 8744 HG2 PRO B 39 60.698 18.002 82.516 1.00 0.00 H ATOM 8745 HB2 PRO B 39 59.068 16.660 83.575 1.00 0.00 H ATOM 8746 HB3 PRO B 39 59.597 17.152 85.201 1.00 0.00 H ATOM 8747 N VAL B 40 61.967 14.104 82.848 1.00 43.27 N ATOM 8748 CA VAL B 40 62.288 13.361 81.652 1.00 43.45 C ATOM 8749 C VAL B 40 61.801 11.930 81.738 1.00 44.16 C ATOM 8750 O VAL B 40 61.472 11.442 82.832 1.00 44.52 O ATOM 8751 CB VAL B 40 63.798 13.398 81.444 1.00 43.32 C ATOM 8752 CG1 VAL B 40 64.260 14.888 81.460 1.00 43.73 C ATOM 8753 CG2 VAL B 40 64.499 12.643 82.608 1.00 41.31 C ATOM 8754 HA VAL B 40 61.782 13.822 80.804 1.00 0.00 H ATOM 8755 HB VAL B 40 64.056 12.927 80.496 1.00 0.00 H ATOM 8756 HG11 VAL B 40 63.759 15.431 80.659 1.00 0.00 H ATOM 8757 HG12 VAL B 40 64.004 15.336 82.420 1.00 0.00 H ATOM 8758 HG13 VAL B 40 65.339 14.934 81.312 1.00 0.00 H ATOM 8759 HG21 VAL B 40 64.250 13.124 83.554 1.00 0.00 H ATOM 8760 HG22 VAL B 40 64.159 11.608 82.625 1.00 0.00 H ATOM 8761 HG23 VAL B 40 65.578 12.670 82.459 1.00 0.00 H ATOM 8762 H VAL B 40 62.394 13.817 83.752 1.00 0.00 H ATOM 8763 N GLY B 41 61.741 11.284 80.572 1.00 43.60 N ATOM 8764 CA GLY B 41 61.307 9.900 80.484 1.00 43.77 C ATOM 8765 C GLY B 41 59.860 9.732 80.891 1.00 44.89 C ATOM 8766 O GLY B 41 58.956 10.434 80.388 1.00 44.90 O ATOM 8767 HA3 GLY B 41 61.930 9.293 81.141 1.00 0.00 H ATOM 8768 HA2 GLY B 41 61.425 9.559 79.456 1.00 0.00 H ATOM 8769 H GLY B 41 62.012 11.785 79.702 1.00 0.00 H ATOM 8770 N ASN B 42 59.620 8.780 81.786 1.00 44.20 N ATOM 8771 CA ASN B 42 58.267 8.539 82.266 1.00 43.25 C ATOM 8772 C ASN B 42 57.771 9.742 83.107 1.00 43.03 C ATOM 8773 O ASN B 42 56.619 9.807 83.487 1.00 41.78 O ATOM 8774 CB ASN B 42 58.218 7.220 83.059 1.00 44.24 C ATOM 8775 HA ASN B 42 57.592 8.439 81.416 1.00 0.00 H ATOM 8776 HB2 ASN B 42 58.522 6.397 82.412 1.00 0.00 H ATOM 8777 HB3 ASN B 42 58.896 7.284 83.910 1.00 0.00 H ATOM 8778 H ASN B 42 60.406 8.202 82.147 1.00 0.00 H ATOM 8779 N MET B 43 58.631 10.701 83.394 1.00 43.54 N ATOM 8780 CA MET B 43 58.146 11.868 84.123 1.00 44.81 C ATOM 8781 C MET B 43 57.615 12.983 83.177 1.00 43.60 C ATOM 8782 O MET B 43 57.063 13.984 83.663 1.00 43.20 O ATOM 8783 CB MET B 43 59.234 12.430 85.044 1.00 48.40 C ATOM 8784 CG MET B 43 59.430 11.654 86.383 1.00 55.64 C ATOM 8785 SD MET B 43 60.500 12.693 87.473 1.00 65.52 S ATOM 8786 CE MET B 43 61.829 11.485 87.878 1.00 65.14 C ATOM 8787 HA MET B 43 57.307 11.528 84.730 1.00 0.00 H ATOM 8788 HB2 MET B 43 60.179 12.412 84.501 1.00 0.00 H ATOM 8789 HB3 MET B 43 58.974 13.461 85.285 1.00 0.00 H ATOM 8790 HG2 MET B 43 59.912 10.696 86.191 1.00 0.00 H ATOM 8791 HG3 MET B 43 58.465 11.484 86.860 1.00 0.00 H ATOM 8792 HE1 MET B 43 61.393 10.622 88.381 1.00 0.00 H ATOM 8793 HE2 MET B 43 62.318 11.162 86.959 1.00 0.00 H ATOM 8794 HE3 MET B 43 62.561 11.958 88.533 1.00 0.00 H ATOM 8795 H MET B 43 59.628 10.627 83.108 1.00 0.00 H ATOM 8796 N ARG B 44 57.775 12.822 81.854 1.00 41.18 N ATOM 8797 CA ARG B 44 57.267 13.835 80.885 1.00 40.19 C ATOM 8798 C ARG B 44 55.730 13.920 81.044 1.00 40.03 C ATOM 8799 O ARG B 44 55.054 12.895 81.113 1.00 40.54 O ATOM 8800 CB ARG B 44 57.643 13.484 79.416 1.00 38.17 C ATOM 8801 CG ARG B 44 56.939 14.381 78.376 1.00 39.72 C ATOM 8802 CD ARG B 44 57.184 13.956 76.910 1.00 38.18 C ATOM 8803 NE ARG B 44 58.585 13.999 76.517 1.00 36.52 N ATOM 8804 CZ ARG B 44 59.015 13.517 75.355 1.00 40.00 C ATOM 8805 NH1 ARG B 44 58.121 12.968 74.533 1.00 41.12 N ATOM 8806 NH2 ARG B 44 60.306 13.633 74.984 1.00 37.19 N ATOM 8807 HA ARG B 44 57.732 14.797 81.101 1.00 0.00 H ATOM 8808 HB2 ARG B 44 58.721 13.597 79.298 1.00 0.00 H ATOM 8809 HB3 ARG B 44 57.364 12.448 79.225 1.00 0.00 H ATOM 8810 HG2 ARG B 44 55.866 14.351 78.567 1.00 0.00 H ATOM 8811 HG3 ARG B 44 57.301 15.401 78.502 1.00 0.00 H ATOM 8812 HD2 ARG B 44 56.622 14.625 76.258 1.00 0.00 H ATOM 8813 HD3 ARG B 44 56.821 12.936 76.781 1.00 0.00 H ATOM 8814 HE ARG B 44 59.275 14.423 77.170 1.00 0.00 H ATOM 8815 HH12 ARG B 44 58.425 12.582 73.617 1.00 0.00 H ATOM 8816 HH11 ARG B 44 57.119 12.926 74.808 1.00 0.00 H ATOM 8817 HH22 ARG B 44 60.621 13.249 74.070 1.00 0.00 H ATOM 8818 HH21 ARG B 44 60.987 14.107 75.611 1.00 0.00 H ATOM 8819 H ARG B 44 58.262 11.975 81.498 1.00 0.00 H ATOM 8820 N PHE B 45 55.207 15.141 81.134 1.00 38.26 N ATOM 8821 CA PHE B 45 53.771 15.439 81.330 1.00 38.20 C ATOM 8822 C PHE B 45 53.311 15.311 82.790 1.00 38.36 C ATOM 8823 O PHE B 45 52.212 15.773 83.126 1.00 37.25 O ATOM 8824 CB PHE B 45 52.822 14.590 80.461 1.00 38.47 C ATOM 8825 CG PHE B 45 53.167 14.558 78.976 1.00 40.84 C ATOM 8826 CD1 PHE B 45 53.359 15.728 78.253 1.00 38.45 C ATOM 8827 CD2 PHE B 45 53.288 13.324 78.304 1.00 39.80 C ATOM 8828 CE1 PHE B 45 53.674 15.675 76.868 1.00 40.92 C ATOM 8829 CE2 PHE B 45 53.602 13.262 76.922 1.00 41.24 C ATOM 8830 CZ PHE B 45 53.798 14.433 76.201 1.00 40.29 C ATOM 8831 HA PHE B 45 53.702 16.480 81.013 1.00 0.00 H ATOM 8832 HB2 PHE B 45 52.844 13.567 80.836 1.00 0.00 H ATOM 8833 HB3 PHE B 45 51.815 14.993 80.566 1.00 0.00 H ATOM 8834 HD2 PHE B 45 53.137 12.398 78.859 1.00 0.00 H ATOM 8835 HE2 PHE B 45 53.689 12.295 76.426 1.00 0.00 H ATOM 8836 HZ PHE B 45 54.043 14.396 75.140 1.00 0.00 H ATOM 8837 HE1 PHE B 45 53.822 16.602 76.313 1.00 0.00 H ATOM 8838 HD1 PHE B 45 53.268 16.693 78.751 1.00 0.00 H ATOM 8839 H PHE B 45 55.859 15.948 81.061 1.00 0.00 H ATOM 8840 N ARG B 46 54.140 14.704 83.652 1.00 38.08 N ATOM 8841 CA ARG B 46 53.796 14.561 85.063 1.00 39.85 C ATOM 8842 C ARG B 46 53.993 15.806 85.922 1.00 38.88 C ATOM 8843 O ARG B 46 54.763 16.702 85.596 1.00 36.33 O ATOM 8844 CB ARG B 46 54.635 13.453 85.737 1.00 44.27 C ATOM 8845 CG ARG B 46 54.290 12.021 85.325 1.00 46.52 C ATOM 8846 CD ARG B 46 54.617 11.090 86.493 1.00 49.78 C ATOM 8847 NE ARG B 46 54.467 9.678 86.132 1.00 54.20 N ATOM 8848 HA ARG B 46 52.731 14.330 85.025 1.00 0.00 H ATOM 8849 HB2 ARG B 46 55.683 13.630 85.493 1.00 0.00 H ATOM 8850 HB3 ARG B 46 54.496 13.535 86.815 1.00 0.00 H ATOM 8851 HG2 ARG B 46 53.229 11.952 85.085 1.00 0.00 H ATOM 8852 HG3 ARG B 46 54.878 11.737 84.452 1.00 0.00 H ATOM 8853 HD2 ARG B 46 53.944 11.315 87.321 1.00 0.00 H ATOM 8854 HD3 ARG B 46 55.646 11.266 86.805 1.00 0.00 H ATOM 8855 HE ARG B 46 54.168 9.416 85.171 1.00 0.00 H ATOM 8856 H ARG B 46 55.046 14.328 83.308 1.00 0.00 H ATOM 8857 N ARG B 47 53.299 15.848 87.043 1.00 39.16 N ATOM 8858 CA ARG B 47 53.517 16.936 87.996 1.00 40.22 C ATOM 8859 C ARG B 47 55.028 16.883 88.359 1.00 38.98 C ATOM 8860 O ARG B 47 55.660 15.811 88.318 1.00 36.51 O ATOM 8861 CB ARG B 47 52.659 16.710 89.248 1.00 42.15 C ATOM 8862 CG ARG B 47 51.160 16.674 88.890 1.00 46.36 C ATOM 8863 CD ARG B 47 50.302 16.675 90.137 1.00 50.86 C ATOM 8864 NE ARG B 47 49.057 15.941 89.924 1.00 57.11 N ATOM 8865 CZ ARG B 47 47.890 16.524 89.677 1.00 59.74 C ATOM 8866 NH1 ARG B 47 47.822 17.847 89.615 1.00 62.61 N ATOM 8867 NH2 ARG B 47 46.791 15.796 89.498 1.00 61.07 N ATOM 8868 HA ARG B 47 53.241 17.905 87.579 1.00 0.00 H ATOM 8869 HB2 ARG B 47 52.939 15.762 89.706 1.00 0.00 H ATOM 8870 HB3 ARG B 47 52.838 17.521 89.954 1.00 0.00 H ATOM 8871 HG2 ARG B 47 50.916 17.550 88.289 1.00 0.00 H ATOM 8872 HG3 ARG B 47 50.952 15.771 88.315 1.00 0.00 H ATOM 8873 HD2 ARG B 47 50.066 17.705 90.406 1.00 0.00 H ATOM 8874 HD3 ARG B 47 50.856 16.207 90.950 1.00 0.00 H ATOM 8875 HE ARG B 47 49.086 14.902 89.968 1.00 0.00 H ATOM 8876 HH12 ARG B 47 46.912 18.312 89.422 1.00 0.00 H ATOM 8877 HH11 ARG B 47 48.678 18.419 89.759 1.00 0.00 H ATOM 8878 HH22 ARG B 47 45.883 16.264 89.305 1.00 0.00 H ATOM 8879 HH21 ARG B 47 46.840 14.759 89.551 1.00 0.00 H ATOM 8880 H ARG B 47 52.598 15.108 87.249 1.00 0.00 H ATOM 8881 N PRO B 48 55.629 18.037 88.682 1.00 37.32 N ATOM 8882 CA PRO B 48 57.046 18.005 89.018 1.00 37.21 C ATOM 8883 C PRO B 48 57.301 17.392 90.397 1.00 39.04 C ATOM 8884 O PRO B 48 56.435 17.454 91.275 1.00 38.08 O ATOM 8885 CB PRO B 48 57.426 19.482 89.017 1.00 35.27 C ATOM 8886 CG PRO B 48 56.182 20.121 89.581 1.00 32.92 C ATOM 8887 CD PRO B 48 55.084 19.402 88.809 1.00 36.68 C ATOM 8888 HA PRO B 48 57.623 17.394 88.324 1.00 0.00 H ATOM 8889 HD3 PRO B 48 54.146 19.403 89.364 1.00 0.00 H ATOM 8890 HD2 PRO B 48 54.926 19.857 87.831 1.00 0.00 H ATOM 8891 HG3 PRO B 48 56.165 21.194 89.389 1.00 0.00 H ATOM 8892 HG2 PRO B 48 56.095 19.943 90.653 1.00 0.00 H ATOM 8893 HB2 PRO B 48 58.292 19.670 89.652 1.00 0.00 H ATOM 8894 HB3 PRO B 48 57.633 19.838 88.008 1.00 0.00 H ATOM 8895 N GLU B 49 58.498 16.833 90.569 1.00 40.83 N ATOM 8896 CA GLU B 49 58.952 16.282 91.852 1.00 42.83 C ATOM 8897 C GLU B 49 60.042 17.234 92.378 1.00 40.90 C ATOM 8898 O GLU B 49 60.870 17.728 91.606 1.00 40.14 O ATOM 8899 CB GLU B 49 59.584 14.893 91.662 1.00 46.76 C ATOM 8900 CG GLU B 49 58.584 13.831 91.190 1.00 55.21 C ATOM 8901 CD GLU B 49 57.409 13.692 92.163 1.00 59.44 C ATOM 8902 OE1 GLU B 49 56.336 13.138 91.794 1.00 62.42 O ATOM 8903 OE2 GLU B 49 57.572 14.149 93.325 1.00 62.88 O ATOM 8904 HA GLU B 49 58.108 16.188 92.535 1.00 0.00 H ATOM 8905 HB2 GLU B 49 60.380 14.973 90.921 1.00 0.00 H ATOM 8906 HB3 GLU B 49 60.007 14.572 92.614 1.00 0.00 H ATOM 8907 HG2 GLU B 49 58.201 14.116 90.210 1.00 0.00 H ATOM 8908 HG3 GLU B 49 59.096 12.872 91.113 1.00 0.00 H ATOM 8909 H GLU B 49 59.143 16.785 89.754 1.00 0.00 H ATOM 8910 N PRO B 50 60.075 17.478 93.690 1.00 40.09 N ATOM 8911 CA PRO B 50 61.092 18.367 94.278 1.00 41.31 C ATOM 8912 C PRO B 50 62.508 17.805 94.067 1.00 41.91 C ATOM 8913 O PRO B 50 62.693 16.597 94.051 1.00 41.61 O ATOM 8914 CB PRO B 50 60.696 18.422 95.752 1.00 42.25 C ATOM 8915 CG PRO B 50 59.999 17.098 95.964 1.00 43.01 C ATOM 8916 CD PRO B 50 59.220 16.864 94.714 1.00 39.74 C ATOM 8917 HA PRO B 50 61.123 19.357 93.823 1.00 0.00 H ATOM 8918 HD3 PRO B 50 59.084 15.799 94.527 1.00 0.00 H ATOM 8919 HD2 PRO B 50 58.246 17.351 94.759 1.00 0.00 H ATOM 8920 HG3 PRO B 50 59.334 17.149 96.826 1.00 0.00 H ATOM 8921 HG2 PRO B 50 60.728 16.302 96.116 1.00 0.00 H ATOM 8922 HB2 PRO B 50 61.574 18.510 96.391 1.00 0.00 H ATOM 8923 HB3 PRO B 50 60.022 19.256 95.946 1.00 0.00 H ATOM 8924 N LYS B 51 63.500 18.668 93.893 1.00 42.15 N ATOM 8925 CA LYS B 51 64.878 18.212 93.643 1.00 44.54 C ATOM 8926 C LYS B 51 65.439 17.537 94.892 1.00 45.32 C ATOM 8927 O LYS B 51 65.422 18.128 95.961 1.00 45.14 O ATOM 8928 CB LYS B 51 65.767 19.404 93.267 1.00 44.73 C ATOM 8929 CG LYS B 51 67.244 19.074 93.106 1.00 46.06 C ATOM 8930 CD LYS B 51 67.527 18.111 91.947 1.00 46.10 C ATOM 8931 CE LYS B 51 69.039 18.017 91.658 1.00 46.69 C ATOM 8932 NZ LYS B 51 69.342 17.252 90.391 1.00 49.73 N ATOM 8933 HA LYS B 51 64.865 17.498 92.820 1.00 0.00 H ATOM 8934 HB2 LYS B 51 65.406 19.812 92.323 1.00 0.00 H ATOM 8935 HB3 LYS B 51 65.671 20.158 94.048 1.00 0.00 H ATOM 8936 HG2 LYS B 51 67.788 20.001 92.927 1.00 0.00 H ATOM 8937 HG3 LYS B 51 67.600 18.618 94.030 1.00 0.00 H ATOM 8938 HD2 LYS B 51 67.152 17.121 92.207 1.00 0.00 H ATOM 8939 HD3 LYS B 51 67.015 18.469 91.054 1.00 0.00 H ATOM 8940 HE2 LYS B 51 69.524 17.514 92.494 1.00 0.00 H ATOM 8941 HE3 LYS B 51 69.440 19.026 91.561 1.00 0.00 H ATOM 8942 HZ1 LYS B 51 68.972 16.284 90.475 1.00 0.00 H ATOM 8943 HZ2 LYS B 51 68.891 17.728 89.584 1.00 0.00 H ATOM 8944 HZ3 LYS B 51 70.371 17.219 90.245 1.00 0.00 H ATOM 8945 H LYS B 51 63.301 19.688 93.934 1.00 0.00 H ATOM 8946 N LYS B 52 65.927 16.304 94.767 1.00 46.06 N ATOM 8947 CA LYS B 52 66.485 15.610 95.936 1.00 46.20 C ATOM 8948 C LYS B 52 67.714 16.368 96.413 1.00 45.05 C ATOM 8949 O LYS B 52 68.551 16.766 95.600 1.00 45.01 O ATOM 8950 CB LYS B 52 66.860 14.171 95.576 1.00 48.83 C ATOM 8951 CG LYS B 52 65.674 13.302 95.056 1.00 53.80 C ATOM 8952 CD LYS B 52 64.517 13.096 96.137 1.00 57.73 C ATOM 8953 CE LYS B 52 63.324 14.159 96.123 1.00 59.30 C ATOM 8954 NZ LYS B 52 62.111 13.903 95.188 1.00 57.59 N ATOM 8955 HA LYS B 52 65.739 15.577 96.730 1.00 0.00 H ATOM 8956 HB2 LYS B 52 67.625 14.203 94.800 1.00 0.00 H ATOM 8957 HB3 LYS B 52 67.268 13.693 96.467 1.00 0.00 H ATOM 8958 HG2 LYS B 52 65.246 13.790 94.180 1.00 0.00 H ATOM 8959 HG3 LYS B 52 66.061 12.323 94.773 1.00 0.00 H ATOM 8960 HD2 LYS B 52 64.083 12.110 95.973 1.00 0.00 H ATOM 8961 HD3 LYS B 52 64.977 13.129 97.124 1.00 0.00 H ATOM 8962 HE2 LYS B 52 63.753 15.120 95.838 1.00 0.00 H ATOM 8963 HE3 LYS B 52 62.938 14.223 97.140 1.00 0.00 H ATOM 8964 HZ1 LYS B 52 62.438 13.859 94.202 1.00 0.00 H ATOM 8965 HZ2 LYS B 52 61.660 13.002 95.446 1.00 0.00 H ATOM 8966 HZ3 LYS B 52 61.425 14.678 95.292 1.00 0.00 H ATOM 8967 H LYS B 52 65.913 15.832 93.841 1.00 0.00 H ATOM 8968 N PRO B 53 67.828 16.612 97.730 1.00 44.89 N ATOM 8969 CA PRO B 53 69.016 17.341 98.217 1.00 45.02 C ATOM 8970 C PRO B 53 70.344 16.660 97.768 1.00 45.62 C ATOM 8971 O PRO B 53 70.404 15.431 97.533 1.00 43.75 O ATOM 8972 CB PRO B 53 68.819 17.364 99.740 1.00 44.95 C ATOM 8973 CG PRO B 53 67.316 17.329 99.885 1.00 45.85 C ATOM 8974 CD PRO B 53 66.901 16.304 98.836 1.00 43.61 C ATOM 8975 HA PRO B 53 69.105 18.347 97.807 1.00 0.00 H ATOM 8976 HD3 PRO B 53 67.040 15.286 99.199 1.00 0.00 H ATOM 8977 HD2 PRO B 53 65.863 16.442 98.534 1.00 0.00 H ATOM 8978 HG3 PRO B 53 66.878 18.305 99.676 1.00 0.00 H ATOM 8979 HG2 PRO B 53 67.025 17.008 100.885 1.00 0.00 H ATOM 8980 HB2 PRO B 53 69.279 16.494 100.209 1.00 0.00 H ATOM 8981 HB3 PRO B 53 69.235 18.272 100.176 1.00 0.00 H ATOM 8982 N TRP B 54 71.380 17.472 97.606 1.00 44.72 N ATOM 8983 CA TRP B 54 72.667 16.973 97.148 1.00 46.21 C ATOM 8984 C TRP B 54 73.762 17.299 98.157 1.00 47.53 C ATOM 8985 O TRP B 54 73.675 18.283 98.914 1.00 47.46 O ATOM 8986 CB TRP B 54 73.024 17.609 95.785 1.00 44.42 C ATOM 8987 CG TRP B 54 73.100 19.109 95.840 1.00 42.58 C ATOM 8988 CD1 TRP B 54 74.153 19.852 96.273 1.00 43.07 C ATOM 8989 CD2 TRP B 54 72.037 20.042 95.581 1.00 41.62 C ATOM 8990 NE1 TRP B 54 73.818 21.195 96.317 1.00 42.32 N ATOM 8991 CE2 TRP B 54 72.523 21.335 95.896 1.00 41.07 C ATOM 8992 CE3 TRP B 54 70.715 19.911 95.123 1.00 39.87 C ATOM 8993 CZ2 TRP B 54 71.730 22.494 95.768 1.00 40.19 C ATOM 8994 CZ3 TRP B 54 69.931 21.062 95.003 1.00 37.75 C ATOM 8995 CH2 TRP B 54 70.442 22.335 95.324 1.00 37.23 C ATOM 8996 HA TRP B 54 72.595 15.891 97.042 1.00 0.00 H ATOM 8997 HB2 TRP B 54 73.992 17.223 95.464 1.00 0.00 H ATOM 8998 HB3 TRP B 54 72.262 17.326 95.059 1.00 0.00 H ATOM 8999 HE1 TRP B 54 74.445 21.968 96.619 1.00 0.00 H ATOM 9000 HD1 TRP B 54 75.127 19.446 96.548 1.00 0.00 H ATOM 9001 HZ2 TRP B 54 72.126 23.480 96.013 1.00 0.00 H ATOM 9002 HH2 TRP B 54 69.801 23.210 95.217 1.00 0.00 H ATOM 9003 HZ3 TRP B 54 68.902 20.973 94.654 1.00 0.00 H ATOM 9004 HE3 TRP B 54 70.309 18.932 94.867 1.00 0.00 H ATOM 9005 H TRP B 54 71.270 18.486 97.811 1.00 0.00 H ATOM 9006 N SER B 55 74.789 16.463 98.190 1.00 48.68 N ATOM 9007 CA SER B 55 75.894 16.750 99.086 1.00 51.16 C ATOM 9008 C SER B 55 76.891 17.467 98.181 1.00 51.71 C ATOM 9009 O SER B 55 76.689 17.523 96.950 1.00 52.37 O ATOM 9010 CB SER B 55 76.474 15.465 99.678 1.00 51.81 C ATOM 9011 OG SER B 55 76.992 14.643 98.647 1.00 56.11 O ATOM 9012 HA SER B 55 75.609 17.347 99.952 1.00 0.00 H ATOM 9013 HB2 SER B 55 75.689 14.926 100.209 1.00 0.00 H ATOM 9014 HB3 SER B 55 77.274 15.718 100.374 1.00 0.00 H ATOM 9015 HG SER B 55 77.364 13.815 99.042 1.00 0.00 H ATOM 9016 H SER B 55 74.803 15.617 97.585 1.00 0.00 H ATOM 9017 N GLY B 56 77.951 18.039 98.748 1.00 52.20 N ATOM 9018 CA GLY B 56 78.885 18.748 97.886 1.00 51.61 C ATOM 9019 C GLY B 56 78.311 20.114 97.522 1.00 52.22 C ATOM 9020 O GLY B 56 77.254 20.504 98.053 1.00 52.56 O ATOM 9021 HA3 GLY B 56 79.050 18.170 96.977 1.00 0.00 H ATOM 9022 HA2 GLY B 56 79.832 18.880 98.408 1.00 0.00 H ATOM 9023 H GLY B 56 78.107 17.981 99.775 1.00 0.00 H ATOM 9024 N VAL B 57 78.987 20.824 96.617 1.00 50.68 N ATOM 9025 CA VAL B 57 78.608 22.163 96.190 1.00 48.68 C ATOM 9026 C VAL B 57 78.095 22.199 94.753 1.00 48.21 C ATOM 9027 O VAL B 57 78.773 21.735 93.837 1.00 46.27 O ATOM 9028 CB VAL B 57 79.802 23.105 96.279 1.00 48.55 C ATOM 9029 CG1 VAL B 57 79.380 24.513 95.939 1.00 48.79 C ATOM 9030 CG2 VAL B 57 80.361 23.067 97.685 1.00 49.27 C ATOM 9031 HA VAL B 57 77.806 22.478 96.858 1.00 0.00 H ATOM 9032 HB VAL B 57 80.565 22.786 95.569 1.00 0.00 H ATOM 9033 HG11 VAL B 57 78.981 24.536 94.925 1.00 0.00 H ATOM 9034 HG12 VAL B 57 78.613 24.840 96.641 1.00 0.00 H ATOM 9035 HG13 VAL B 57 80.243 25.176 96.006 1.00 0.00 H ATOM 9036 HG21 VAL B 57 79.591 23.383 98.389 1.00 0.00 H ATOM 9037 HG22 VAL B 57 80.677 22.051 97.922 1.00 0.00 H ATOM 9038 HG23 VAL B 57 81.216 23.740 97.753 1.00 0.00 H ATOM 9039 H VAL B 57 79.834 20.396 96.192 1.00 0.00 H ATOM 9040 N TRP B 58 76.891 22.746 94.566 1.00 47.12 N ATOM 9041 CA TRP B 58 76.303 22.851 93.228 1.00 45.20 C ATOM 9042 C TRP B 58 76.951 24.057 92.566 1.00 44.30 C ATOM 9043 O TRP B 58 76.984 25.166 93.152 1.00 44.04 O ATOM 9044 CB TRP B 58 74.773 23.048 93.309 1.00 44.78 C ATOM 9045 CG TRP B 58 74.127 22.995 91.961 1.00 43.51 C ATOM 9046 CD1 TRP B 58 74.103 23.993 91.012 1.00 42.16 C ATOM 9047 CD2 TRP B 58 73.561 21.838 91.346 1.00 43.14 C ATOM 9048 NE1 TRP B 58 73.572 23.514 89.835 1.00 42.70 N ATOM 9049 CE2 TRP B 58 73.226 22.195 90.011 1.00 43.92 C ATOM 9050 CE3 TRP B 58 73.301 20.532 91.795 1.00 44.96 C ATOM 9051 CZ2 TRP B 58 72.645 21.282 89.111 1.00 42.25 C ATOM 9052 CZ3 TRP B 58 72.720 19.619 90.903 1.00 45.11 C ATOM 9053 CH2 TRP B 58 72.403 20.008 89.572 1.00 43.59 C ATOM 9054 HA TRP B 58 76.478 21.939 92.658 1.00 0.00 H ATOM 9055 HB2 TRP B 58 74.350 22.261 93.933 1.00 0.00 H ATOM 9056 HB3 TRP B 58 74.567 24.019 93.760 1.00 0.00 H ATOM 9057 HE1 TRP B 58 73.452 24.060 88.958 1.00 0.00 H ATOM 9058 HD1 TRP B 58 74.453 25.013 91.170 1.00 0.00 H ATOM 9059 HZ2 TRP B 58 72.397 21.572 88.090 1.00 0.00 H ATOM 9060 HH2 TRP B 58 71.956 19.277 88.898 1.00 0.00 H ATOM 9061 HZ3 TRP B 58 72.509 18.602 91.233 1.00 0.00 H ATOM 9062 HE3 TRP B 58 73.546 20.235 92.815 1.00 0.00 H ATOM 9063 H TRP B 58 76.361 23.104 95.386 1.00 0.00 H ATOM 9064 N ASN B 59 77.465 23.845 91.360 1.00 44.19 N ATOM 9065 CA ASN B 59 78.130 24.911 90.621 1.00 45.69 C ATOM 9066 C ASN B 59 77.016 25.748 89.972 1.00 44.69 C ATOM 9067 O ASN B 59 76.411 25.291 89.017 1.00 44.98 O ATOM 9068 CB ASN B 59 79.039 24.305 89.536 1.00 49.24 C ATOM 9069 CG ASN B 59 79.807 25.354 88.749 1.00 55.52 C ATOM 9070 OD1 ASN B 59 79.461 26.538 88.789 1.00 55.29 O ATOM 9071 ND2 ASN B 59 80.832 24.917 88.009 1.00 62.37 N ATOM 9072 HA ASN B 59 78.752 25.523 91.274 1.00 0.00 H ATOM 9073 HB2 ASN B 59 79.755 23.637 90.016 1.00 0.00 H ATOM 9074 HB3 ASN B 59 78.420 23.735 88.843 1.00 0.00 H ATOM 9075 HD22 ASN B 59 81.082 23.907 88.011 1.00 0.00 H ATOM 9076 HD21 ASN B 59 81.379 25.587 87.431 1.00 0.00 H ATOM 9077 H ASN B 59 77.392 22.899 90.934 1.00 0.00 H ATOM 9078 N ALA B 60 76.765 26.951 90.486 1.00 42.86 N ATOM 9079 CA ALA B 60 75.709 27.828 89.973 1.00 42.58 C ATOM 9080 C ALA B 60 76.345 29.057 89.360 1.00 42.87 C ATOM 9081 O ALA B 60 75.908 30.180 89.630 1.00 41.25 O ATOM 9082 CB ALA B 60 74.773 28.279 91.120 1.00 41.40 C ATOM 9083 HA ALA B 60 75.129 27.281 89.230 1.00 0.00 H ATOM 9084 HB1 ALA B 60 74.314 27.403 91.579 1.00 0.00 H ATOM 9085 HB2 ALA B 60 75.352 28.821 91.868 1.00 0.00 H ATOM 9086 HB3 ALA B 60 73.996 28.929 90.719 1.00 0.00 H ATOM 9087 H ALA B 60 77.343 27.282 91.285 1.00 0.00 H ATOM 9088 N SER B 61 77.367 28.858 88.535 1.00 42.00 N ATOM 9089 CA SER B 61 78.039 29.992 87.934 1.00 43.68 C ATOM 9090 C SER B 61 77.532 30.223 86.514 1.00 42.91 C ATOM 9091 O SER B 61 77.833 31.242 85.908 1.00 43.50 O ATOM 9092 CB SER B 61 79.551 29.726 87.919 1.00 41.95 C ATOM 9093 OG SER B 61 79.762 28.572 87.101 1.00 42.69 O ATOM 9094 HA SER B 61 77.829 30.887 88.519 1.00 0.00 H ATOM 9095 HB2 SER B 61 79.909 29.539 88.931 1.00 0.00 H ATOM 9096 HB3 SER B 61 80.079 30.583 87.501 1.00 0.00 H ATOM 9097 HG SER B 61 79.274 27.802 87.487 1.00 0.00 H ATOM 9098 H SER B 61 77.684 27.891 88.321 1.00 0.00 H ATOM 9099 N THR B 62 76.774 29.281 85.957 1.00 44.01 N ATOM 9100 CA THR B 62 76.309 29.494 84.581 1.00 43.82 C ATOM 9101 C THR B 62 74.819 29.269 84.330 1.00 42.82 C ATOM 9102 O THR B 62 74.172 28.511 85.042 1.00 41.09 O ATOM 9103 CB THR B 62 77.084 28.601 83.632 1.00 45.68 C ATOM 9104 OG1 THR B 62 76.755 27.239 83.915 1.00 46.64 O ATOM 9105 CG2 THR B 62 78.604 28.786 83.843 1.00 47.57 C ATOM 9106 HA THR B 62 76.486 30.555 84.404 1.00 0.00 H ATOM 9107 HB THR B 62 76.825 28.862 82.606 1.00 0.00 H ATOM 9108 HG1 THR B 62 75.783 27.102 83.788 1.00 0.00 H ATOM 9109 HG23 THR B 62 78.876 29.820 83.632 1.00 0.00 H ATOM 9110 HG21 THR B 62 78.858 28.546 84.875 1.00 0.00 H ATOM 9111 HG22 THR B 62 79.146 28.122 83.170 1.00 0.00 H ATOM 9112 H THR B 62 76.519 28.420 86.481 1.00 0.00 H ATOM 9113 N TYR B 63 74.277 29.930 83.307 1.00 41.42 N ATOM 9114 CA TYR B 63 72.863 29.749 82.983 1.00 40.02 C ATOM 9115 C TYR B 63 72.531 28.306 82.659 1.00 39.97 C ATOM 9116 O TYR B 63 73.350 27.573 82.114 1.00 38.63 O ATOM 9117 CB TYR B 63 72.418 30.602 81.791 1.00 36.98 C ATOM 9118 CG TYR B 63 72.056 32.014 82.175 1.00 39.69 C ATOM 9119 CD1 TYR B 63 71.302 32.274 83.341 1.00 40.01 C ATOM 9120 CD2 TYR B 63 72.350 33.094 81.314 1.00 39.97 C ATOM 9121 CE1 TYR B 63 70.835 33.560 83.628 1.00 38.96 C ATOM 9122 CE2 TYR B 63 71.879 34.394 81.592 1.00 39.09 C ATOM 9123 CZ TYR B 63 71.123 34.603 82.741 1.00 39.55 C ATOM 9124 OH TYR B 63 70.597 35.838 82.978 1.00 40.94 O ATOM 9125 HA TYR B 63 72.330 30.065 83.880 1.00 0.00 H ATOM 9126 HB3 TYR B 63 71.547 30.132 81.334 1.00 0.00 H ATOM 9127 HB2 TYR B 63 73.232 30.637 81.067 1.00 0.00 H ATOM 9128 HD2 TYR B 63 72.950 32.920 80.421 1.00 0.00 H ATOM 9129 HE2 TYR B 63 72.103 35.221 80.918 1.00 0.00 H ATOM 9130 HE1 TYR B 63 70.254 33.748 84.531 1.00 0.00 H ATOM 9131 HD1 TYR B 63 71.081 31.458 84.029 1.00 0.00 H ATOM 9132 HH TYR B 63 70.090 35.822 83.828 1.00 0.00 H ATOM 9133 H TYR B 63 74.861 30.576 82.738 1.00 0.00 H ATOM 9134 N PRO B 64 71.303 27.877 83.014 1.00 38.52 N ATOM 9135 CA PRO B 64 70.830 26.526 82.758 1.00 35.67 C ATOM 9136 C PRO B 64 70.330 26.378 81.296 1.00 35.17 C ATOM 9137 O PRO B 64 70.302 27.358 80.536 1.00 33.83 O ATOM 9138 CB PRO B 64 69.684 26.398 83.760 1.00 36.17 C ATOM 9139 CG PRO B 64 69.022 27.787 83.675 1.00 34.32 C ATOM 9140 CD PRO B 64 70.285 28.677 83.736 1.00 38.00 C ATOM 9141 HA PRO B 64 71.595 25.758 82.871 1.00 0.00 H ATOM 9142 HD3 PRO B 64 70.114 29.632 83.239 1.00 0.00 H ATOM 9143 HD2 PRO B 64 70.588 28.855 84.768 1.00 0.00 H ATOM 9144 HG3 PRO B 64 68.354 27.971 84.516 1.00 0.00 H ATOM 9145 HG2 PRO B 64 68.475 27.920 82.742 1.00 0.00 H ATOM 9146 HB2 PRO B 64 68.990 25.610 83.468 1.00 0.00 H ATOM 9147 HB3 PRO B 64 70.057 26.198 84.764 1.00 0.00 H ATOM 9148 N ASN B 65 69.975 25.154 80.902 1.00 33.73 N ATOM 9149 CA ASN B 65 69.391 24.920 79.600 1.00 35.90 C ATOM 9150 C ASN B 65 67.979 25.593 79.636 1.00 35.40 C ATOM 9151 O ASN B 65 67.439 25.875 80.714 1.00 36.77 O ATOM 9152 CB ASN B 65 69.165 23.411 79.352 1.00 38.69 C ATOM 9153 CG ASN B 65 70.467 22.586 79.418 1.00 43.07 C ATOM 9154 OD1 ASN B 65 71.474 22.970 78.837 1.00 43.82 O ATOM 9155 ND2 ASN B 65 70.433 21.453 80.131 1.00 44.33 N ATOM 9156 HA ASN B 65 70.048 25.311 78.823 1.00 0.00 H ATOM 9157 HB2 ASN B 65 68.476 23.034 80.108 1.00 0.00 H ATOM 9158 HB3 ASN B 65 68.723 23.284 78.364 1.00 0.00 H ATOM 9159 HD22 ASN B 65 69.555 21.165 80.608 1.00 0.00 H ATOM 9160 HD21 ASN B 65 71.285 20.861 80.207 1.00 0.00 H ATOM 9161 H ASN B 65 70.121 24.350 81.545 1.00 0.00 H ATOM 9162 N ASN B 66 67.400 25.812 78.465 1.00 34.66 N ATOM 9163 CA ASN B 66 66.055 26.393 78.319 1.00 36.99 C ATOM 9164 C ASN B 66 65.126 25.203 78.040 1.00 36.51 C ATOM 9165 O ASN B 66 65.592 24.205 77.491 1.00 35.92 O ATOM 9166 CB ASN B 66 66.015 27.339 77.107 1.00 34.29 C ATOM 9167 CG ASN B 66 66.964 28.529 77.264 1.00 37.29 C ATOM 9168 OD1 ASN B 66 67.577 28.969 76.291 1.00 37.66 O ATOM 9169 ND2 ASN B 66 67.078 29.061 78.493 1.00 37.26 N ATOM 9170 HA ASN B 66 65.767 26.958 79.206 1.00 0.00 H ATOM 9171 HB2 ASN B 66 66.300 26.779 76.216 1.00 0.00 H ATOM 9172 HB3 ASN B 66 64.999 27.715 76.989 1.00 0.00 H ATOM 9173 HD22 ASN B 66 66.541 28.657 79.287 1.00 0.00 H ATOM 9174 HD21 ASN B 66 67.703 29.877 78.650 1.00 0.00 H ATOM 9175 H ASN B 66 67.924 25.560 77.602 1.00 0.00 H ATOM 9176 N CYS B 67 63.840 25.288 78.393 1.00 34.96 N ATOM 9177 CA CYS B 67 62.941 24.164 78.084 1.00 36.15 C ATOM 9178 C CYS B 67 62.733 24.006 76.599 1.00 36.63 C ATOM 9179 O CYS B 67 62.910 24.948 75.834 1.00 35.70 O ATOM 9180 CB CYS B 67 61.583 24.336 78.785 1.00 35.69 C ATOM 9181 SG CYS B 67 61.760 24.399 80.595 1.00 37.21 S ATOM 9182 HA CYS B 67 63.422 23.260 78.458 1.00 0.00 H ATOM 9183 HB2 CYS B 67 60.941 23.495 78.522 1.00 0.00 H ATOM 9184 HB3 CYS B 67 61.124 25.263 78.443 1.00 0.00 H ATOM 9185 H CYS B 67 63.480 26.135 78.878 1.00 0.00 H ATOM 9186 N GLN B 68 62.358 22.791 76.191 1.00 37.43 N ATOM 9187 CA GLN B 68 62.128 22.477 74.798 1.00 36.35 C ATOM 9188 C GLN B 68 60.961 23.349 74.314 1.00 37.04 C ATOM 9189 O GLN B 68 59.951 23.450 75.007 1.00 36.61 O ATOM 9190 CB GLN B 68 61.789 20.980 74.657 1.00 36.24 C ATOM 9191 CG GLN B 68 62.993 20.066 74.815 1.00 37.53 C ATOM 9192 CD GLN B 68 63.946 20.077 73.581 1.00 41.14 C ATOM 9193 OE1 GLN B 68 64.986 19.403 73.581 1.00 43.55 O ATOM 9194 NE2 GLN B 68 63.590 20.834 72.546 1.00 39.33 N ATOM 9195 HA GLN B 68 63.015 22.678 74.197 1.00 0.00 H ATOM 9196 HB2 GLN B 68 61.055 20.719 75.420 1.00 0.00 H ATOM 9197 HB3 GLN B 68 61.358 20.815 73.669 1.00 0.00 H ATOM 9198 HG2 GLN B 68 63.558 20.386 75.691 1.00 0.00 H ATOM 9199 HG3 GLN B 68 62.636 19.047 74.967 1.00 0.00 H ATOM 9200 HE22 GLN B 68 62.709 21.386 72.584 1.00 0.00 H ATOM 9201 HE21 GLN B 68 64.193 20.874 71.699 1.00 0.00 H ATOM 9202 H GLN B 68 62.226 22.043 76.901 1.00 0.00 H ATOM 9203 N GLN B 69 61.099 23.951 73.132 1.00 34.91 N ATOM 9204 CA GLN B 69 60.052 24.840 72.618 1.00 34.91 C ATOM 9205 C GLN B 69 60.189 25.119 71.125 1.00 34.76 C ATOM 9206 O GLN B 69 61.278 24.953 70.523 1.00 33.14 O ATOM 9207 CB GLN B 69 60.094 26.190 73.350 1.00 33.81 C ATOM 9208 CG GLN B 69 61.495 26.869 73.318 1.00 31.53 C ATOM 9209 CD GLN B 69 61.624 28.065 74.278 1.00 31.81 C ATOM 9210 OE1 GLN B 69 61.297 29.225 73.913 1.00 33.33 O ATOM 9211 NE2 GLN B 69 62.091 27.797 75.521 1.00 29.62 N ATOM 9212 HA GLN B 69 59.108 24.323 72.791 1.00 0.00 H ATOM 9213 HB2 GLN B 69 59.374 26.860 72.880 1.00 0.00 H ATOM 9214 HB3 GLN B 69 59.812 26.028 74.390 1.00 0.00 H ATOM 9215 HG2 GLN B 69 62.244 26.126 73.591 1.00 0.00 H ATOM 9216 HG3 GLN B 69 61.685 27.219 72.303 1.00 0.00 H ATOM 9217 HE22 GLN B 69 62.350 26.824 75.781 1.00 0.00 H ATOM 9218 HE21 GLN B 69 62.191 28.565 76.216 1.00 0.00 H ATOM 9219 H GLN B 69 61.958 23.788 72.569 1.00 0.00 H ATOM 9220 N TYR B 70 59.080 25.580 70.553 1.00 34.17 N ATOM 9221 CA TYR B 70 59.029 25.981 69.148 1.00 34.89 C ATOM 9222 C TYR B 70 59.937 27.211 68.999 1.00 35.32 C ATOM 9223 O TYR B 70 59.785 28.224 69.726 1.00 36.43 O ATOM 9224 CB TYR B 70 57.596 26.343 68.779 1.00 35.53 C ATOM 9225 CG TYR B 70 57.447 26.829 67.351 1.00 37.81 C ATOM 9226 CD1 TYR B 70 57.329 25.924 66.293 1.00 34.35 C ATOM 9227 CD2 TYR B 70 57.423 28.213 67.064 1.00 36.72 C ATOM 9228 CE1 TYR B 70 57.178 26.383 64.971 1.00 38.84 C ATOM 9229 CE2 TYR B 70 57.278 28.676 65.757 1.00 39.71 C ATOM 9230 CZ TYR B 70 57.149 27.762 64.708 1.00 41.58 C ATOM 9231 OH TYR B 70 56.946 28.243 63.415 1.00 45.41 O ATOM 9232 HA TYR B 70 59.361 25.176 68.493 1.00 0.00 H ATOM 9233 HB3 TYR B 70 57.255 27.131 69.450 1.00 0.00 H ATOM 9234 HB2 TYR B 70 56.971 25.460 68.911 1.00 0.00 H ATOM 9235 HD2 TYR B 70 57.520 28.931 67.879 1.00 0.00 H ATOM 9236 HE2 TYR B 70 57.265 29.747 65.554 1.00 0.00 H ATOM 9237 HE1 TYR B 70 57.084 25.669 64.153 1.00 0.00 H ATOM 9238 HD1 TYR B 70 57.354 24.853 66.493 1.00 0.00 H ATOM 9239 HH TYR B 70 57.710 28.816 63.154 1.00 0.00 H ATOM 9240 H TYR B 70 58.216 25.658 71.127 1.00 0.00 H ATOM 9241 N VAL B 71 60.882 27.155 68.075 1.00 34.86 N ATOM 9242 CA VAL B 71 61.800 28.284 67.920 1.00 34.70 C ATOM 9243 C VAL B 71 61.298 29.173 66.812 1.00 36.95 C ATOM 9244 O VAL B 71 60.894 28.672 65.729 1.00 38.23 O ATOM 9245 CB VAL B 71 63.239 27.778 67.629 1.00 34.13 C ATOM 9246 CG1 VAL B 71 64.159 28.938 67.293 1.00 34.51 C ATOM 9247 CG2 VAL B 71 63.763 27.002 68.882 1.00 32.67 C ATOM 9248 HA VAL B 71 61.838 28.859 68.845 1.00 0.00 H ATOM 9249 HB VAL B 71 63.223 27.111 66.767 1.00 0.00 H ATOM 9250 HG11 VAL B 71 63.782 29.455 66.411 1.00 0.00 H ATOM 9251 HG12 VAL B 71 64.192 29.630 68.135 1.00 0.00 H ATOM 9252 HG13 VAL B 71 65.161 28.559 67.093 1.00 0.00 H ATOM 9253 HG21 VAL B 71 63.773 27.670 69.743 1.00 0.00 H ATOM 9254 HG22 VAL B 71 63.107 26.155 69.084 1.00 0.00 H ATOM 9255 HG23 VAL B 71 64.773 26.642 68.688 1.00 0.00 H ATOM 9256 H VAL B 71 60.972 26.317 67.465 1.00 0.00 H ATOM 9257 N ASP B 72 61.293 30.488 67.050 1.00 36.44 N ATOM 9258 CA ASP B 72 60.784 31.418 66.046 1.00 36.97 C ATOM 9259 C ASP B 72 61.737 31.558 64.862 1.00 38.07 C ATOM 9260 O ASP B 72 62.857 31.963 65.062 1.00 38.30 O ATOM 9261 CB ASP B 72 60.588 32.796 66.700 1.00 38.14 C ATOM 9262 CG ASP B 72 60.047 33.839 65.739 1.00 39.26 C ATOM 9263 OD1 ASP B 72 59.666 33.482 64.601 1.00 39.20 O ATOM 9264 OD2 ASP B 72 59.975 35.020 66.144 1.00 39.87 O ATOM 9265 HA ASP B 72 59.839 31.026 65.669 1.00 0.00 H ATOM 9266 HB2 ASP B 72 59.888 32.691 67.529 1.00 0.00 H ATOM 9267 HB3 ASP B 72 61.550 33.140 67.080 1.00 0.00 H ATOM 9268 H ASP B 72 61.654 30.851 67.955 1.00 0.00 H ATOM 9269 N GLU B 73 61.312 31.195 63.648 1.00 42.04 N ATOM 9270 CA GLU B 73 62.143 31.365 62.434 1.00 45.56 C ATOM 9271 C GLU B 73 61.449 32.345 61.487 1.00 44.97 C ATOM 9272 O GLU B 73 61.791 32.379 60.315 1.00 45.93 O ATOM 9273 CB GLU B 73 62.252 30.105 61.580 1.00 49.05 C ATOM 9274 CG GLU B 73 62.382 28.828 62.260 1.00 55.47 C ATOM 9275 CD GLU B 73 63.790 28.527 62.447 1.00 58.25 C ATOM 9276 OE1 GLU B 73 64.386 29.402 63.097 1.00 60.83 O ATOM 9277 OE2 GLU B 73 64.281 27.474 61.953 1.00 57.56 O ATOM 9278 HA GLU B 73 63.120 31.675 62.806 1.00 0.00 H ATOM 9279 HB2 GLU B 73 61.355 30.054 60.962 1.00 0.00 H ATOM 9280 HB3 GLU B 73 63.126 30.222 60.940 1.00 0.00 H ATOM 9281 HG2 GLU B 73 61.888 28.879 63.230 1.00 0.00 H ATOM 9282 HG3 GLU B 73 61.919 28.046 61.659 1.00 0.00 H ATOM 9283 H GLU B 73 60.364 30.778 63.552 1.00 0.00 H ATOM 9284 N GLN B 74 60.426 33.058 61.935 1.00 44.82 N ATOM 9285 CA GLN B 74 59.764 33.996 61.030 1.00 44.38 C ATOM 9286 C GLN B 74 60.760 35.062 60.466 1.00 43.32 C ATOM 9287 O GLN B 74 60.632 35.470 59.326 1.00 40.60 O ATOM 9288 CB GLN B 74 58.582 34.672 61.737 1.00 45.34 C ATOM 9289 CG GLN B 74 57.803 35.713 60.882 1.00 51.45 C ATOM 9290 CD GLN B 74 57.127 35.087 59.661 1.00 54.92 C ATOM 9291 OE1 GLN B 74 57.249 35.577 58.532 1.00 57.55 O ATOM 9292 NE2 GLN B 74 56.423 33.995 59.883 1.00 57.33 N ATOM 9293 HA GLN B 74 59.387 33.428 60.180 1.00 0.00 H ATOM 9294 HB2 GLN B 74 57.882 33.894 62.041 1.00 0.00 H ATOM 9295 HB3 GLN B 74 58.965 35.181 62.622 1.00 0.00 H ATOM 9296 HG2 GLN B 74 57.038 36.175 61.506 1.00 0.00 H ATOM 9297 HG3 GLN B 74 58.501 36.477 60.541 1.00 0.00 H ATOM 9298 HE22 GLN B 74 56.344 33.614 60.848 1.00 0.00 H ATOM 9299 HE21 GLN B 74 55.946 33.514 59.094 1.00 0.00 H ATOM 9300 H GLN B 74 60.099 32.952 62.916 1.00 0.00 H ATOM 9301 N PHE B 75 61.737 35.505 61.261 1.00 40.68 N ATOM 9302 CA PHE B 75 62.720 36.504 60.802 1.00 40.56 C ATOM 9303 C PHE B 75 64.141 36.118 61.259 1.00 41.42 C ATOM 9304 O PHE B 75 64.741 36.770 62.123 1.00 38.85 O ATOM 9305 CB PHE B 75 62.370 37.880 61.354 1.00 37.96 C ATOM 9306 CG PHE B 75 61.032 38.363 60.927 1.00 39.47 C ATOM 9307 CD1 PHE B 75 60.799 38.705 59.574 1.00 38.33 C ATOM 9308 CD2 PHE B 75 59.977 38.414 61.836 1.00 38.90 C ATOM 9309 CE1 PHE B 75 59.533 39.088 59.133 1.00 38.17 C ATOM 9310 CE2 PHE B 75 58.691 38.798 61.416 1.00 40.92 C ATOM 9311 CZ PHE B 75 58.462 39.140 60.047 1.00 38.01 C ATOM 9312 HA PHE B 75 62.692 36.531 59.713 1.00 0.00 H ATOM 9313 HB2 PHE B 75 62.389 37.831 62.443 1.00 0.00 H ATOM 9314 HB3 PHE B 75 63.121 38.592 61.010 1.00 0.00 H ATOM 9315 HD2 PHE B 75 60.150 38.154 62.880 1.00 0.00 H ATOM 9316 HE2 PHE B 75 57.871 38.835 62.133 1.00 0.00 H ATOM 9317 HZ PHE B 75 57.468 39.438 59.713 1.00 0.00 H ATOM 9318 HE1 PHE B 75 59.373 39.346 58.086 1.00 0.00 H ATOM 9319 HD1 PHE B 75 61.625 38.668 58.863 1.00 0.00 H ATOM 9320 H PHE B 75 61.807 35.135 62.231 1.00 0.00 H ATOM 9321 N PRO B 76 64.683 35.046 60.659 1.00 44.01 N ATOM 9322 CA PRO B 76 66.014 34.485 60.938 1.00 45.04 C ATOM 9323 C PRO B 76 67.036 35.587 61.115 1.00 45.30 C ATOM 9324 O PRO B 76 67.210 36.402 60.235 1.00 45.13 O ATOM 9325 CB PRO B 76 66.310 33.656 59.697 1.00 44.84 C ATOM 9326 CG PRO B 76 64.952 33.229 59.251 1.00 46.17 C ATOM 9327 CD PRO B 76 64.118 34.466 59.416 1.00 44.62 C ATOM 9328 HA PRO B 76 66.050 33.901 61.857 1.00 0.00 H ATOM 9329 HD3 PRO B 76 64.239 35.143 58.570 1.00 0.00 H ATOM 9330 HD2 PRO B 76 63.063 34.221 59.535 1.00 0.00 H ATOM 9331 HG3 PRO B 76 64.574 32.419 59.875 1.00 0.00 H ATOM 9332 HG2 PRO B 76 64.968 32.907 58.210 1.00 0.00 H ATOM 9333 HB2 PRO B 76 66.804 34.256 58.933 1.00 0.00 H ATOM 9334 HB3 PRO B 76 66.933 32.795 59.939 1.00 0.00 H ATOM 9335 N GLY B 77 67.692 35.611 62.267 1.00 45.59 N ATOM 9336 CA GLY B 77 68.729 36.594 62.509 1.00 46.07 C ATOM 9337 C GLY B 77 68.303 38.018 62.820 1.00 45.76 C ATOM 9338 O GLY B 77 69.143 38.862 63.152 1.00 48.12 O ATOM 9339 HA3 GLY B 77 69.356 36.630 61.618 1.00 0.00 H ATOM 9340 HA2 GLY B 77 69.320 36.240 63.354 1.00 0.00 H ATOM 9341 H GLY B 77 67.460 34.916 63.005 1.00 0.00 H ATOM 9342 N PHE B 78 67.022 38.319 62.703 1.00 42.98 N ATOM 9343 CA PHE B 78 66.569 39.660 63.009 1.00 40.76 C ATOM 9344 C PHE B 78 66.580 39.840 64.519 1.00 40.34 C ATOM 9345 O PHE B 78 65.999 39.043 65.251 1.00 39.66 O ATOM 9346 CB PHE B 78 65.166 39.839 62.472 1.00 42.06 C ATOM 9347 CG PHE B 78 64.568 41.147 62.832 1.00 42.65 C ATOM 9348 CD1 PHE B 78 65.233 42.339 62.494 1.00 42.44 C ATOM 9349 CD2 PHE B 78 63.351 41.200 63.523 1.00 40.48 C ATOM 9350 CE1 PHE B 78 64.685 43.581 62.855 1.00 42.53 C ATOM 9351 CE2 PHE B 78 62.791 42.408 63.886 1.00 39.51 C ATOM 9352 CZ PHE B 78 63.454 43.605 63.559 1.00 42.36 C ATOM 9353 HA PHE B 78 67.223 40.402 62.550 1.00 0.00 H ATOM 9354 HB2 PHE B 78 65.197 39.759 61.385 1.00 0.00 H ATOM 9355 HB3 PHE B 78 64.536 39.046 62.876 1.00 0.00 H ATOM 9356 HD2 PHE B 78 62.838 40.273 63.778 1.00 0.00 H ATOM 9357 HE2 PHE B 78 61.842 42.434 64.422 1.00 0.00 H ATOM 9358 HZ PHE B 78 63.017 44.560 63.850 1.00 0.00 H ATOM 9359 HE1 PHE B 78 65.196 44.509 62.599 1.00 0.00 H ATOM 9360 HD1 PHE B 78 66.177 42.299 61.950 1.00 0.00 H ATOM 9361 H PHE B 78 66.342 37.596 62.392 1.00 0.00 H ATOM 9362 N SER B 79 67.196 40.887 65.028 1.00 39.16 N ATOM 9363 CA SER B 79 67.237 40.988 66.476 1.00 39.61 C ATOM 9364 C SER B 79 65.901 41.130 67.222 1.00 39.48 C ATOM 9365 O SER B 79 65.778 40.611 68.347 1.00 37.90 O ATOM 9366 CB SER B 79 68.165 42.127 66.924 1.00 38.97 C ATOM 9367 OG SER B 79 67.560 43.383 66.623 1.00 43.28 O ATOM 9368 HA SER B 79 67.614 40.005 66.759 1.00 0.00 H ATOM 9369 HB2 SER B 79 69.117 42.047 66.399 1.00 0.00 H ATOM 9370 HB3 SER B 79 68.336 42.055 67.998 1.00 0.00 H ATOM 9371 HG SER B 79 68.160 44.115 66.913 1.00 0.00 H ATOM 9372 H SER B 79 67.633 41.609 64.420 1.00 0.00 H ATOM 9373 N GLY B 80 64.927 41.851 66.648 1.00 38.78 N ATOM 9374 CA GLY B 80 63.657 42.040 67.352 1.00 39.95 C ATOM 9375 C GLY B 80 62.985 40.714 67.684 1.00 38.80 C ATOM 9376 O GLY B 80 62.273 40.565 68.652 1.00 38.16 O ATOM 9377 HA3 GLY B 80 62.988 42.625 66.721 1.00 0.00 H ATOM 9378 HA2 GLY B 80 63.846 42.581 68.279 1.00 0.00 H ATOM 9379 H GLY B 80 65.073 42.273 65.709 1.00 0.00 H ATOM 9380 N SER B 81 63.234 39.748 66.823 1.00 38.78 N ATOM 9381 CA SER B 81 62.701 38.413 66.937 1.00 38.18 C ATOM 9382 C SER B 81 63.618 37.452 67.746 1.00 37.76 C ATOM 9383 O SER B 81 63.145 36.685 68.644 1.00 35.29 O ATOM 9384 CB SER B 81 62.490 37.919 65.495 1.00 39.34 C ATOM 9385 OG SER B 81 62.344 36.536 65.479 1.00 44.49 O ATOM 9386 HA SER B 81 61.768 38.428 67.500 1.00 0.00 H ATOM 9387 HB2 SER B 81 63.352 38.198 64.889 1.00 0.00 H ATOM 9388 HB3 SER B 81 61.593 38.381 65.083 1.00 0.00 H ATOM 9389 HG SER B 81 62.209 36.230 64.547 1.00 0.00 H ATOM 9390 H SER B 81 63.851 39.961 66.014 1.00 0.00 H ATOM 9391 N GLU B 82 64.925 37.511 67.465 1.00 35.45 N ATOM 9392 CA GLU B 82 65.887 36.602 68.106 1.00 36.38 C ATOM 9393 C GLU B 82 66.031 36.816 69.593 1.00 36.39 C ATOM 9394 O GLU B 82 66.406 35.883 70.310 1.00 34.89 O ATOM 9395 CB GLU B 82 67.284 36.694 67.479 1.00 38.14 C ATOM 9396 CG GLU B 82 67.425 36.166 66.045 1.00 40.16 C ATOM 9397 CD GLU B 82 67.072 34.687 65.881 1.00 42.39 C ATOM 9398 OE1 GLU B 82 66.821 34.308 64.726 1.00 43.21 O ATOM 9399 OE2 GLU B 82 67.033 33.904 66.875 1.00 42.21 O ATOM 9400 HA GLU B 82 65.462 35.613 67.936 1.00 0.00 H ATOM 9401 HB2 GLU B 82 67.578 37.744 67.477 1.00 0.00 H ATOM 9402 HB3 GLU B 82 67.969 36.128 68.110 1.00 0.00 H ATOM 9403 HG2 GLU B 82 66.766 36.748 65.400 1.00 0.00 H ATOM 9404 HG3 GLU B 82 68.459 36.308 65.729 1.00 0.00 H ATOM 9405 H GLU B 82 65.267 38.214 66.779 1.00 0.00 H ATOM 9406 N MET B 83 65.701 38.032 70.052 1.00 34.19 N ATOM 9407 CA MET B 83 65.799 38.362 71.457 1.00 33.27 C ATOM 9408 C MET B 83 64.861 37.513 72.349 1.00 34.07 C ATOM 9409 O MET B 83 65.079 37.440 73.557 1.00 32.93 O ATOM 9410 CB MET B 83 65.495 39.855 71.664 1.00 34.08 C ATOM 9411 CG MET B 83 64.028 40.268 71.409 1.00 32.59 C ATOM 9412 SD MET B 83 63.811 42.071 71.640 1.00 35.39 S ATOM 9413 CE MET B 83 63.702 42.183 73.400 1.00 30.47 C ATOM 9414 HA MET B 83 66.820 38.134 71.762 1.00 0.00 H ATOM 9415 HB2 MET B 83 65.744 40.111 72.694 1.00 0.00 H ATOM 9416 HB3 MET B 83 66.129 40.426 70.986 1.00 0.00 H ATOM 9417 HG2 MET B 83 63.381 39.737 72.107 1.00 0.00 H ATOM 9418 HG3 MET B 83 63.754 40.003 70.388 1.00 0.00 H ATOM 9419 HE1 MET B 83 62.852 41.596 73.748 1.00 0.00 H ATOM 9420 HE2 MET B 83 64.619 41.796 73.845 1.00 0.00 H ATOM 9421 HE3 MET B 83 63.568 43.225 73.689 1.00 0.00 H ATOM 9422 H MET B 83 65.367 38.754 69.383 1.00 0.00 H ATOM 9423 N TRP B 84 63.867 36.854 71.752 1.00 32.42 N ATOM 9424 CA TRP B 84 62.923 36.009 72.506 1.00 33.61 C ATOM 9425 C TRP B 84 63.270 34.525 72.378 1.00 34.67 C ATOM 9426 O TRP B 84 62.800 33.709 73.176 1.00 35.70 O ATOM 9427 CB TRP B 84 61.478 36.231 71.995 1.00 31.87 C ATOM 9428 CG TRP B 84 61.082 37.724 72.019 1.00 31.22 C ATOM 9429 CD1 TRP B 84 60.911 38.555 70.939 1.00 31.05 C ATOM 9430 CD2 TRP B 84 60.810 38.517 73.181 1.00 31.31 C ATOM 9431 NE1 TRP B 84 60.548 39.833 71.364 1.00 32.27 N ATOM 9432 CE2 TRP B 84 60.467 39.828 72.734 1.00 31.76 C ATOM 9433 CE3 TRP B 84 60.827 38.255 74.569 1.00 31.27 C ATOM 9434 CZ2 TRP B 84 60.127 40.867 73.625 1.00 32.05 C ATOM 9435 CZ3 TRP B 84 60.496 39.311 75.459 1.00 31.62 C ATOM 9436 CH2 TRP B 84 60.146 40.590 74.979 1.00 29.32 C ATOM 9437 HA TRP B 84 62.998 36.297 73.555 1.00 0.00 H ATOM 9438 HB2 TRP B 84 61.405 35.863 70.972 1.00 0.00 H ATOM 9439 HB3 TRP B 84 60.790 35.673 72.630 1.00 0.00 H ATOM 9440 HE1 TRP B 84 60.369 40.651 70.747 1.00 0.00 H ATOM 9441 HD1 TRP B 84 61.040 38.258 69.898 1.00 0.00 H ATOM 9442 HZ2 TRP B 84 59.858 41.857 73.257 1.00 0.00 H ATOM 9443 HH2 TRP B 84 59.886 41.375 75.689 1.00 0.00 H ATOM 9444 HZ3 TRP B 84 60.513 39.129 76.534 1.00 0.00 H ATOM 9445 HE3 TRP B 84 61.088 37.267 74.948 1.00 0.00 H ATOM 9446 H TRP B 84 63.754 36.939 70.722 1.00 0.00 H ATOM 9447 N ASN B 85 64.101 34.176 71.396 1.00 34.13 N ATOM 9448 CA ASN B 85 64.446 32.778 71.187 1.00 34.68 C ATOM 9449 C ASN B 85 65.377 32.253 72.256 1.00 34.67 C ATOM 9450 O ASN B 85 66.101 33.002 72.895 1.00 34.30 O ATOM 9451 CB ASN B 85 65.085 32.541 69.782 1.00 36.21 C ATOM 9452 CG ASN B 85 64.033 32.325 68.662 1.00 36.96 C ATOM 9453 OD1 ASN B 85 62.922 31.825 68.907 1.00 36.79 O ATOM 9454 ND2 ASN B 85 64.410 32.687 67.404 1.00 35.90 N ATOM 9455 HA ASN B 85 63.507 32.228 71.245 1.00 0.00 H ATOM 9456 HB2 ASN B 85 65.691 33.410 69.526 1.00 0.00 H ATOM 9457 HB3 ASN B 85 65.722 31.658 69.835 1.00 0.00 H ATOM 9458 HD22 ASN B 85 65.350 33.102 67.242 1.00 0.00 H ATOM 9459 HD21 ASN B 85 63.758 32.548 66.606 1.00 0.00 H ATOM 9460 H ASN B 85 64.505 34.907 70.776 1.00 0.00 H ATOM 9461 N PRO B 86 65.371 30.943 72.465 1.00 34.25 N ATOM 9462 CA PRO B 86 66.243 30.345 73.483 1.00 34.84 C ATOM 9463 C PRO B 86 67.680 30.743 73.141 1.00 36.00 C ATOM 9464 O PRO B 86 68.060 30.681 71.971 1.00 36.42 O ATOM 9465 CB PRO B 86 66.064 28.840 73.273 1.00 34.86 C ATOM 9466 CG PRO B 86 64.761 28.700 72.547 1.00 36.44 C ATOM 9467 CD PRO B 86 64.593 29.945 71.717 1.00 33.74 C ATOM 9468 HA PRO B 86 66.022 30.651 74.505 1.00 0.00 H ATOM 9469 HD3 PRO B 86 64.995 29.805 70.713 1.00 0.00 H ATOM 9470 HD2 PRO B 86 63.544 30.234 71.650 1.00 0.00 H ATOM 9471 HG3 PRO B 86 63.941 28.610 73.260 1.00 0.00 H ATOM 9472 HG2 PRO B 86 64.781 27.820 71.905 1.00 0.00 H ATOM 9473 HB2 PRO B 86 66.881 28.437 72.675 1.00 0.00 H ATOM 9474 HB3 PRO B 86 66.026 28.321 74.231 1.00 0.00 H ATOM 9475 N ASN B 87 68.453 31.151 74.134 1.00 36.68 N ATOM 9476 CA ASN B 87 69.833 31.497 73.918 1.00 39.07 C ATOM 9477 C ASN B 87 70.761 30.455 74.585 1.00 41.11 C ATOM 9478 O ASN B 87 71.985 30.653 74.678 1.00 40.48 O ATOM 9479 CB ASN B 87 70.138 32.930 74.406 1.00 38.84 C ATOM 9480 CG ASN B 87 69.913 33.114 75.899 1.00 40.46 C ATOM 9481 OD1 ASN B 87 69.306 32.269 76.583 1.00 40.86 O ATOM 9482 ND2 ASN B 87 70.385 34.231 76.412 1.00 39.29 N ATOM 9483 HA ASN B 87 70.026 31.481 72.845 1.00 0.00 H ATOM 9484 HB2 ASN B 87 71.180 33.159 74.181 1.00 0.00 H ATOM 9485 HB3 ASN B 87 69.491 33.624 73.870 1.00 0.00 H ATOM 9486 HD22 ASN B 87 70.886 34.911 75.805 1.00 0.00 H ATOM 9487 HD21 ASN B 87 70.256 34.434 77.424 1.00 0.00 H ATOM 9488 H ASN B 87 68.055 31.223 75.092 1.00 0.00 H ATOM 9489 N ARG B 88 70.188 29.335 75.020 1.00 40.66 N ATOM 9490 CA ARG B 88 70.979 28.241 75.614 1.00 43.09 C ATOM 9491 C ARG B 88 70.535 26.968 74.891 1.00 43.57 C ATOM 9492 O ARG B 88 69.587 26.998 74.139 1.00 44.61 O ATOM 9493 CB ARG B 88 70.656 28.083 77.102 1.00 44.15 C ATOM 9494 CG ARG B 88 71.157 29.166 77.904 1.00 45.82 C ATOM 9495 CD ARG B 88 72.594 28.861 78.080 1.00 51.32 C ATOM 9496 NE ARG B 88 73.358 30.070 77.928 1.00 56.35 N ATOM 9497 CZ ARG B 88 74.523 30.274 78.508 1.00 58.67 C ATOM 9498 NH1 ARG B 88 75.061 29.308 79.276 1.00 59.49 N ATOM 9499 NH2 ARG B 88 75.089 31.479 78.390 1.00 58.98 N ATOM 9500 HA ARG B 88 72.046 28.440 75.515 1.00 0.00 H ATOM 9501 HB2 ARG B 88 69.573 28.035 77.220 1.00 0.00 H ATOM 9502 HB3 ARG B 88 71.100 27.153 77.457 1.00 0.00 H ATOM 9503 HG2 ARG B 88 71.025 30.119 77.392 1.00 0.00 H ATOM 9504 HG3 ARG B 88 70.649 29.200 78.868 1.00 0.00 H ATOM 9505 HD2 ARG B 88 72.907 28.135 77.330 1.00 0.00 H ATOM 9506 HD3 ARG B 88 72.760 28.448 79.075 1.00 0.00 H ATOM 9507 HE ARG B 88 72.969 30.825 77.327 1.00 0.00 H ATOM 9508 HH12 ARG B 88 75.980 29.462 79.737 1.00 0.00 H ATOM 9509 HH11 ARG B 88 74.557 28.408 79.408 1.00 0.00 H ATOM 9510 HH22 ARG B 88 76.009 31.668 78.838 1.00 0.00 H ATOM 9511 HH21 ARG B 88 74.610 32.228 77.850 1.00 0.00 H ATOM 9512 H ARG B 88 69.157 29.229 74.939 1.00 0.00 H ATOM 9513 N GLU B 89 71.183 25.842 75.118 1.00 44.23 N ATOM 9514 CA GLU B 89 70.730 24.634 74.449 1.00 45.52 C ATOM 9515 C GLU B 89 69.350 24.271 75.062 1.00 42.88 C ATOM 9516 O GLU B 89 69.109 24.496 76.240 1.00 41.40 O ATOM 9517 CB GLU B 89 71.739 23.493 74.684 1.00 50.22 C ATOM 9518 CG GLU B 89 71.773 22.434 73.538 1.00 58.76 C ATOM 9519 CD GLU B 89 71.837 20.962 74.059 1.00 64.13 C ATOM 9520 OE1 GLU B 89 71.923 20.012 73.224 1.00 66.56 O ATOM 9521 OE2 GLU B 89 71.789 20.741 75.303 1.00 67.29 O ATOM 9522 HA GLU B 89 70.647 24.787 73.373 1.00 0.00 H ATOM 9523 HB2 GLU B 89 72.734 23.928 74.779 1.00 0.00 H ATOM 9524 HB3 GLU B 89 71.475 22.986 75.612 1.00 0.00 H ATOM 9525 HG2 GLU B 89 70.873 22.549 72.934 1.00 0.00 H ATOM 9526 HG3 GLU B 89 72.651 22.621 72.920 1.00 0.00 H ATOM 9527 H GLU B 89 72.000 25.819 75.761 1.00 0.00 H ATOM 9528 N MET B 90 68.436 23.741 74.272 1.00 40.34 N ATOM 9529 CA MET B 90 67.147 23.353 74.828 1.00 40.77 C ATOM 9530 C MET B 90 67.277 21.953 75.372 1.00 40.71 C ATOM 9531 O MET B 90 68.022 21.134 74.830 1.00 41.16 O ATOM 9532 CB MET B 90 66.068 23.342 73.746 1.00 41.44 C ATOM 9533 CG MET B 90 65.713 24.741 73.255 1.00 40.27 C ATOM 9534 SD MET B 90 64.323 24.763 72.164 1.00 40.16 S ATOM 9535 CE MET B 90 65.055 24.137 70.669 1.00 38.49 C ATOM 9536 HA MET B 90 66.865 24.065 75.604 1.00 0.00 H ATOM 9537 HB2 MET B 90 66.428 22.756 72.900 1.00 0.00 H ATOM 9538 HB3 MET B 90 65.170 22.877 74.153 1.00 0.00 H ATOM 9539 HG2 MET B 90 66.574 25.153 72.728 1.00 0.00 H ATOM 9540 HG3 MET B 90 65.485 25.365 74.119 1.00 0.00 H ATOM 9541 HE1 MET B 90 65.864 24.798 70.357 1.00 0.00 H ATOM 9542 HE2 MET B 90 65.450 23.138 70.850 1.00 0.00 H ATOM 9543 HE3 MET B 90 64.298 24.093 69.886 1.00 0.00 H ATOM 9544 H MET B 90 68.634 23.601 73.261 1.00 0.00 H ATOM 9545 N SER B 91 66.547 21.667 76.433 1.00 40.89 N ATOM 9546 CA SER B 91 66.555 20.330 77.025 1.00 39.70 C ATOM 9547 C SER B 91 65.293 20.126 77.851 1.00 39.51 C ATOM 9548 O SER B 91 64.785 21.099 78.402 1.00 39.30 O ATOM 9549 CB SER B 91 67.758 20.176 77.964 1.00 39.82 C ATOM 9550 OG SER B 91 67.744 18.884 78.567 1.00 37.24 O ATOM 9551 HA SER B 91 66.609 19.599 76.218 1.00 0.00 H ATOM 9552 HB2 SER B 91 67.709 20.938 78.742 1.00 0.00 H ATOM 9553 HB3 SER B 91 68.679 20.299 77.394 1.00 0.00 H ATOM 9554 HG SER B 91 68.524 18.794 79.171 1.00 0.00 H ATOM 9555 H SER B 91 65.953 22.408 76.857 1.00 0.00 H ATOM 9556 N GLU B 92 64.769 18.893 77.949 1.00 39.18 N ATOM 9557 CA GLU B 92 63.626 18.689 78.854 1.00 39.45 C ATOM 9558 C GLU B 92 64.108 18.835 80.306 1.00 39.87 C ATOM 9559 O GLU B 92 63.283 18.983 81.235 1.00 38.36 O ATOM 9560 CB GLU B 92 62.985 17.313 78.682 1.00 39.26 C ATOM 9561 CG GLU B 92 62.001 17.233 77.529 1.00 39.89 C ATOM 9562 CD GLU B 92 61.365 15.852 77.396 1.00 42.42 C ATOM 9563 OE1 GLU B 92 61.998 14.960 76.785 1.00 45.62 O ATOM 9564 OE2 GLU B 92 60.243 15.644 77.911 1.00 42.03 O ATOM 9565 HA GLU B 92 62.873 19.438 78.610 1.00 0.00 H ATOM 9566 HB2 GLU B 92 63.777 16.584 78.509 1.00 0.00 H ATOM 9567 HB3 GLU B 92 62.457 17.062 79.602 1.00 0.00 H ATOM 9568 HG2 GLU B 92 61.212 17.967 77.691 1.00 0.00 H ATOM 9569 HG3 GLU B 92 62.527 17.466 76.603 1.00 0.00 H ATOM 9570 H GLU B 92 65.161 18.102 77.399 1.00 0.00 H ATOM 9571 N ASP B 93 65.439 18.769 80.510 1.00 38.71 N ATOM 9572 CA ASP B 93 66.032 18.939 81.849 1.00 38.84 C ATOM 9573 C ASP B 93 66.219 20.441 81.912 1.00 38.86 C ATOM 9574 O ASP B 93 67.271 20.954 81.534 1.00 37.80 O ATOM 9575 CB ASP B 93 67.395 18.217 81.929 1.00 39.42 C ATOM 9576 CG ASP B 93 68.102 18.407 83.295 1.00 42.30 C ATOM 9577 OD1 ASP B 93 67.643 19.197 84.170 1.00 41.30 O ATOM 9578 OD2 ASP B 93 69.158 17.758 83.484 1.00 43.22 O ATOM 9579 HA ASP B 93 65.430 18.532 82.661 1.00 0.00 H ATOM 9580 HB2 ASP B 93 67.234 17.151 81.766 1.00 0.00 H ATOM 9581 HB3 ASP B 93 68.043 18.609 81.145 1.00 0.00 H ATOM 9582 H ASP B 93 66.066 18.593 79.699 1.00 0.00 H ATOM 9583 N CYS B 94 65.206 21.162 82.408 1.00 39.08 N ATOM 9584 CA CYS B 94 65.269 22.626 82.369 1.00 37.01 C ATOM 9585 C CYS B 94 64.633 23.313 83.548 1.00 37.37 C ATOM 9586 O CYS B 94 64.392 24.533 83.488 1.00 36.89 O ATOM 9587 CB CYS B 94 64.561 23.120 81.069 1.00 35.57 C ATOM 9588 SG CYS B 94 62.785 22.669 81.040 1.00 36.04 S ATOM 9589 HA CYS B 94 66.327 22.886 82.396 1.00 0.00 H ATOM 9590 HB2 CYS B 94 65.053 22.669 80.207 1.00 0.00 H ATOM 9591 HB3 CYS B 94 64.650 24.205 81.010 1.00 0.00 H ATOM 9592 H CYS B 94 64.378 20.686 82.819 1.00 0.00 H ATOM 9593 N LEU B 95 64.320 22.560 84.605 1.00 35.92 N ATOM 9594 CA LEU B 95 63.705 23.201 85.741 1.00 36.36 C ATOM 9595 C LEU B 95 64.733 23.794 86.718 1.00 35.98 C ATOM 9596 O LEU B 95 65.138 23.162 87.716 1.00 35.43 O ATOM 9597 CB LEU B 95 62.730 22.233 86.430 1.00 35.07 C ATOM 9598 CG LEU B 95 61.580 21.875 85.479 1.00 35.57 C ATOM 9599 CD1 LEU B 95 60.582 20.967 86.169 1.00 35.54 C ATOM 9600 CD2 LEU B 95 60.893 23.200 85.004 1.00 34.47 C ATOM 9601 HA LEU B 95 63.134 24.054 85.374 1.00 0.00 H ATOM 9602 HB2 LEU B 95 63.262 21.324 86.711 1.00 0.00 H ATOM 9603 HB3 LEU B 95 62.324 22.706 87.324 1.00 0.00 H ATOM 9604 HG LEU B 95 61.970 21.337 84.615 1.00 0.00 H ATOM 9605 HD21 LEU B 95 60.506 23.737 85.870 1.00 0.00 H ATOM 9606 HD22 LEU B 95 61.624 23.821 84.486 1.00 0.00 H ATOM 9607 HD23 LEU B 95 60.073 22.960 84.327 1.00 0.00 H ATOM 9608 HD11 LEU B 95 61.082 20.050 86.481 1.00 0.00 H ATOM 9609 HD12 LEU B 95 60.174 21.475 87.043 1.00 0.00 H ATOM 9610 HD13 LEU B 95 59.775 20.725 85.478 1.00 0.00 H ATOM 9611 H LEU B 95 64.515 21.538 84.609 1.00 0.00 H ATOM 9612 N TYR B 96 65.133 25.025 86.420 1.00 35.85 N ATOM 9613 CA TYR B 96 66.120 25.723 87.246 1.00 37.28 C ATOM 9614 C TYR B 96 65.678 27.142 87.507 1.00 36.36 C ATOM 9615 O TYR B 96 64.760 27.642 86.840 1.00 38.06 O ATOM 9616 CB TYR B 96 67.474 25.745 86.524 1.00 37.70 C ATOM 9617 CG TYR B 96 68.010 24.372 86.255 1.00 37.63 C ATOM 9618 CD1 TYR B 96 67.591 23.665 85.132 1.00 37.92 C ATOM 9619 CD2 TYR B 96 68.882 23.751 87.168 1.00 36.08 C ATOM 9620 CE1 TYR B 96 68.001 22.380 84.913 1.00 37.74 C ATOM 9621 CE2 TYR B 96 69.301 22.471 86.966 1.00 37.69 C ATOM 9622 CZ TYR B 96 68.862 21.775 85.840 1.00 39.16 C ATOM 9623 OH TYR B 96 69.256 20.468 85.621 1.00 37.33 O ATOM 9624 HA TYR B 96 66.213 25.196 88.196 1.00 0.00 H ATOM 9625 HB3 TYR B 96 68.191 26.284 87.143 1.00 0.00 H ATOM 9626 HB2 TYR B 96 67.354 26.265 85.574 1.00 0.00 H ATOM 9627 HD2 TYR B 96 69.225 24.299 88.045 1.00 0.00 H ATOM 9628 HE2 TYR B 96 69.974 21.994 87.679 1.00 0.00 H ATOM 9629 HE1 TYR B 96 67.664 21.834 84.032 1.00 0.00 H ATOM 9630 HD1 TYR B 96 66.925 24.144 84.415 1.00 0.00 H ATOM 9631 HH TYR B 96 68.850 20.139 84.780 1.00 0.00 H ATOM 9632 H TYR B 96 64.738 25.502 85.585 1.00 0.00 H ATOM 9633 N LEU B 97 66.311 27.772 88.489 1.00 34.56 N ATOM 9634 CA LEU B 97 66.037 29.156 88.806 1.00 34.35 C ATOM 9635 C LEU B 97 67.340 29.933 88.972 1.00 35.04 C ATOM 9636 O LEU B 97 68.412 29.358 89.226 1.00 35.83 O ATOM 9637 CB LEU B 97 65.120 29.288 90.049 1.00 33.31 C ATOM 9638 CG LEU B 97 65.455 28.669 91.422 1.00 34.74 C ATOM 9639 CD1 LEU B 97 66.518 29.526 92.164 1.00 35.17 C ATOM 9640 CD2 LEU B 97 64.158 28.643 92.271 1.00 33.29 C ATOM 9641 HA LEU B 97 65.491 29.594 87.971 1.00 0.00 H ATOM 9642 HB2 LEU B 97 65.006 30.358 90.224 1.00 0.00 H ATOM 9643 HB3 LEU B 97 64.159 28.865 89.757 1.00 0.00 H ATOM 9644 HG LEU B 97 65.852 27.664 91.277 1.00 0.00 H ATOM 9645 HD21 LEU B 97 63.788 29.660 92.398 1.00 0.00 H ATOM 9646 HD22 LEU B 97 63.404 28.042 91.762 1.00 0.00 H ATOM 9647 HD23 LEU B 97 64.373 28.208 93.247 1.00 0.00 H ATOM 9648 HD11 LEU B 97 67.428 29.572 91.565 1.00 0.00 H ATOM 9649 HD12 LEU B 97 66.130 30.533 92.315 1.00 0.00 H ATOM 9650 HD13 LEU B 97 66.740 29.072 93.130 1.00 0.00 H ATOM 9651 H LEU B 97 67.023 27.257 89.045 1.00 0.00 H ATOM 9652 N ASN B 98 67.233 31.253 88.844 1.00 35.55 N ATOM 9653 CA ASN B 98 68.368 32.160 88.923 1.00 34.90 C ATOM 9654 C ASN B 98 68.156 33.234 89.967 1.00 35.91 C ATOM 9655 O ASN B 98 67.044 33.769 90.098 1.00 36.29 O ATOM 9656 CB ASN B 98 68.598 32.851 87.549 1.00 34.27 C ATOM 9657 CG ASN B 98 68.630 31.853 86.377 1.00 36.35 C ATOM 9658 OD1 ASN B 98 69.491 30.946 86.323 1.00 33.89 O ATOM 9659 ND2 ASN B 98 67.682 32.015 85.423 1.00 34.84 N ATOM 9660 HA ASN B 98 69.236 31.563 89.202 1.00 0.00 H ATOM 9661 HB2 ASN B 98 67.791 33.564 87.378 1.00 0.00 H ATOM 9662 HB3 ASN B 98 69.549 33.382 87.581 1.00 0.00 H ATOM 9663 HD22 ASN B 98 66.985 32.782 85.507 1.00 0.00 H ATOM 9664 HD21 ASN B 98 67.651 31.372 84.606 1.00 0.00 H ATOM 9665 H ASN B 98 66.289 31.657 88.679 1.00 0.00 H ATOM 9666 N ILE B 99 69.230 33.574 90.690 1.00 35.04 N ATOM 9667 CA ILE B 99 69.152 34.601 91.698 1.00 36.10 C ATOM 9668 C ILE B 99 70.269 35.665 91.603 1.00 37.48 C ATOM 9669 O ILE B 99 71.451 35.325 91.551 1.00 38.90 O ATOM 9670 CB ILE B 99 69.215 34.003 93.135 1.00 34.29 C ATOM 9671 CG1 ILE B 99 68.386 32.691 93.221 1.00 35.53 C ATOM 9672 CG2 ILE B 99 68.745 35.084 94.121 1.00 32.42 C ATOM 9673 CD1 ILE B 99 68.295 32.052 94.691 1.00 33.02 C ATOM 9674 HA ILE B 99 68.192 35.081 91.508 1.00 0.00 H ATOM 9675 HB ILE B 99 70.235 33.721 93.397 1.00 0.00 H ATOM 9676 HG12 ILE B 99 67.373 32.906 92.880 1.00 0.00 H ATOM 9677 HG13 ILE B 99 68.843 31.956 92.558 1.00 0.00 H ATOM 9678 HD11 ILE B 99 69.298 31.816 95.046 1.00 0.00 H ATOM 9679 HD12 ILE B 99 67.827 32.767 95.368 1.00 0.00 H ATOM 9680 HD13 ILE B 99 67.698 31.141 94.653 1.00 0.00 H ATOM 9681 HG21 ILE B 99 69.399 35.952 94.045 1.00 0.00 H ATOM 9682 HG22 ILE B 99 67.723 35.375 93.879 1.00 0.00 H ATOM 9683 HG23 ILE B 99 68.780 34.688 95.136 1.00 0.00 H ATOM 9684 H ILE B 99 70.135 33.090 90.522 1.00 0.00 H ATOM 9685 N TRP B 100 69.888 36.933 91.605 1.00 36.19 N ATOM 9686 CA TRP B 100 70.855 38.014 91.596 1.00 37.09 C ATOM 9687 C TRP B 100 70.758 38.566 92.989 1.00 38.68 C ATOM 9688 O TRP B 100 69.655 38.870 93.471 1.00 38.72 O ATOM 9689 CB TRP B 100 70.481 39.062 90.569 1.00 37.53 C ATOM 9690 CG TRP B 100 70.898 38.590 89.182 1.00 38.76 C ATOM 9691 CD1 TRP B 100 72.096 38.781 88.586 1.00 37.42 C ATOM 9692 CD2 TRP B 100 70.087 37.878 88.242 1.00 38.67 C ATOM 9693 NE1 TRP B 100 72.101 38.244 87.323 1.00 39.05 N ATOM 9694 CE2 TRP B 100 70.876 37.686 87.072 1.00 38.48 C ATOM 9695 CE3 TRP B 100 68.765 37.391 88.266 1.00 37.23 C ATOM 9696 CZ2 TRP B 100 70.391 37.028 85.918 1.00 36.60 C ATOM 9697 CZ3 TRP B 100 68.261 36.726 87.097 1.00 36.79 C ATOM 9698 CH2 TRP B 100 69.079 36.560 85.947 1.00 37.40 C ATOM 9699 HA TRP B 100 71.862 37.690 91.333 1.00 0.00 H ATOM 9700 HB2 TRP B 100 69.403 39.222 90.589 1.00 0.00 H ATOM 9701 HB3 TRP B 100 70.990 39.997 90.803 1.00 0.00 H ATOM 9702 HE1 TRP B 100 72.905 38.259 86.663 1.00 0.00 H ATOM 9703 HD1 TRP B 100 72.942 39.292 89.046 1.00 0.00 H ATOM 9704 HZ2 TRP B 100 71.020 36.892 85.038 1.00 0.00 H ATOM 9705 HH2 TRP B 100 68.672 36.057 85.070 1.00 0.00 H ATOM 9706 HZ3 TRP B 100 67.240 36.345 87.092 1.00 0.00 H ATOM 9707 HE3 TRP B 100 68.140 37.516 89.150 1.00 0.00 H ATOM 9708 H TRP B 100 68.873 37.159 91.613 1.00 0.00 H ATOM 9709 N VAL B 101 71.908 38.668 93.652 1.00 38.65 N ATOM 9710 CA VAL B 101 71.955 39.106 95.033 1.00 38.97 C ATOM 9711 C VAL B 101 72.892 40.300 95.235 1.00 40.44 C ATOM 9712 O VAL B 101 74.067 40.216 94.906 1.00 39.11 O ATOM 9713 CB VAL B 101 72.486 37.946 95.928 1.00 38.63 C ATOM 9714 CG1 VAL B 101 72.581 38.399 97.428 1.00 35.93 C ATOM 9715 CG2 VAL B 101 71.637 36.715 95.738 1.00 37.83 C ATOM 9716 HA VAL B 101 70.941 39.400 95.305 1.00 0.00 H ATOM 9717 HB VAL B 101 73.499 37.686 95.621 1.00 0.00 H ATOM 9718 HG11 VAL B 101 73.262 39.246 97.508 1.00 0.00 H ATOM 9719 HG12 VAL B 101 71.592 38.692 97.781 1.00 0.00 H ATOM 9720 HG13 VAL B 101 72.954 37.572 98.033 1.00 0.00 H ATOM 9721 HG21 VAL B 101 70.607 36.939 96.016 1.00 0.00 H ATOM 9722 HG22 VAL B 101 71.674 36.407 94.693 1.00 0.00 H ATOM 9723 HG23 VAL B 101 72.018 35.912 96.368 1.00 0.00 H ATOM 9724 H VAL B 101 72.796 38.427 93.167 1.00 0.00 H ATOM 9725 N PRO B 102 72.385 41.410 95.804 1.00 41.36 N ATOM 9726 CA PRO B 102 73.229 42.599 96.049 1.00 42.80 C ATOM 9727 C PRO B 102 74.520 42.253 96.815 1.00 45.62 C ATOM 9728 O PRO B 102 74.577 41.282 97.578 1.00 46.45 O ATOM 9729 CB PRO B 102 72.343 43.503 96.900 1.00 40.28 C ATOM 9730 CG PRO B 102 70.935 43.157 96.373 1.00 42.41 C ATOM 9731 CD PRO B 102 70.977 41.654 96.160 1.00 39.88 C ATOM 9732 HA PRO B 102 73.558 43.056 95.116 1.00 0.00 H ATOM 9733 HD3 PRO B 102 70.705 41.121 97.071 1.00 0.00 H ATOM 9734 HD2 PRO B 102 70.310 41.354 95.352 1.00 0.00 H ATOM 9735 HG3 PRO B 102 70.734 43.675 95.435 1.00 0.00 H ATOM 9736 HG2 PRO B 102 70.172 43.423 97.104 1.00 0.00 H ATOM 9737 HB2 PRO B 102 72.439 43.268 97.960 1.00 0.00 H ATOM 9738 HB3 PRO B 102 72.579 44.555 96.740 1.00 0.00 H ATOM 9739 N SER B 103 75.554 43.065 96.623 1.00 47.27 N ATOM 9740 CA SER B 103 76.815 42.845 97.328 1.00 48.62 C ATOM 9741 C SER B 103 77.167 44.135 98.055 1.00 47.42 C ATOM 9742 O SER B 103 77.150 45.209 97.477 1.00 45.21 O ATOM 9743 CB SER B 103 77.936 42.463 96.352 1.00 49.28 C ATOM 9744 OG SER B 103 79.132 42.238 97.089 1.00 51.52 O ATOM 9745 HA SER B 103 76.706 42.021 98.033 1.00 0.00 H ATOM 9746 HB2 SER B 103 78.092 43.272 95.639 1.00 0.00 H ATOM 9747 HB3 SER B 103 77.660 41.555 95.815 1.00 0.00 H ATOM 9748 HG SER B 103 78.986 41.503 97.736 1.00 0.00 H ATOM 9749 H SER B 103 75.465 43.865 95.964 1.00 0.00 H ATOM 9750 N PRO B 104 77.475 44.041 99.350 1.00 46.95 N ATOM 9751 CA PRO B 104 77.521 42.795 100.133 1.00 46.65 C ATOM 9752 C PRO B 104 76.111 42.200 100.347 1.00 45.26 C ATOM 9753 O PRO B 104 75.099 42.913 100.276 1.00 44.51 O ATOM 9754 CB PRO B 104 78.148 43.250 101.450 1.00 47.75 C ATOM 9755 CG PRO B 104 77.507 44.656 101.630 1.00 47.71 C ATOM 9756 CD PRO B 104 77.609 45.238 100.209 1.00 46.76 C ATOM 9757 HA PRO B 104 78.080 41.999 99.642 1.00 0.00 H ATOM 9758 HD3 PRO B 104 76.806 45.950 100.018 1.00 0.00 H ATOM 9759 HD2 PRO B 104 78.571 45.727 100.053 1.00 0.00 H ATOM 9760 HG3 PRO B 104 78.066 45.258 102.346 1.00 0.00 H ATOM 9761 HG2 PRO B 104 76.469 44.580 101.954 1.00 0.00 H ATOM 9762 HB2 PRO B 104 77.881 42.583 102.270 1.00 0.00 H ATOM 9763 HB3 PRO B 104 79.233 43.314 101.373 1.00 0.00 H ATOM 9764 N ARG B 105 76.065 40.905 100.631 1.00 43.91 N ATOM 9765 CA ARG B 105 74.798 40.188 100.833 1.00 44.23 C ATOM 9766 C ARG B 105 73.816 40.775 101.844 1.00 42.57 C ATOM 9767 O ARG B 105 74.159 40.971 102.992 1.00 41.78 O ATOM 9768 CB ARG B 105 75.078 38.746 101.224 1.00 43.25 C ATOM 9769 CG ARG B 105 73.802 37.904 101.236 1.00 44.49 C ATOM 9770 CD ARG B 105 74.032 36.562 101.886 1.00 40.65 C ATOM 9771 NE ARG B 105 75.020 35.816 101.131 1.00 41.64 N ATOM 9772 CZ ARG B 105 75.631 34.736 101.583 1.00 39.91 C ATOM 9773 NH1 ARG B 105 75.326 34.294 102.785 1.00 41.02 N ATOM 9774 NH2 ARG B 105 76.559 34.121 100.862 1.00 40.45 N ATOM 9775 HA ARG B 105 74.300 40.282 99.868 1.00 0.00 H ATOM 9776 HB2 ARG B 105 75.779 38.316 100.508 1.00 0.00 H ATOM 9777 HB3 ARG B 105 75.521 38.730 102.220 1.00 0.00 H ATOM 9778 HG2 ARG B 105 73.030 38.438 101.789 1.00 0.00 H ATOM 9779 HG3 ARG B 105 73.470 37.749 100.209 1.00 0.00 H ATOM 9780 HD2 ARG B 105 73.096 36.004 101.908 1.00 0.00 H ATOM 9781 HD3 ARG B 105 74.390 36.709 102.905 1.00 0.00 H ATOM 9782 HE ARG B 105 75.262 36.151 100.177 1.00 0.00 H ATOM 9783 HH12 ARG B 105 75.795 33.445 103.161 1.00 0.00 H ATOM 9784 HH11 ARG B 105 74.616 34.794 103.358 1.00 0.00 H ATOM 9785 HH22 ARG B 105 77.029 33.272 101.235 1.00 0.00 H ATOM 9786 HH21 ARG B 105 76.817 34.488 99.924 1.00 0.00 H ATOM 9787 H ARG B 105 76.958 40.378 100.714 1.00 0.00 H ATOM 9788 N PRO B 106 72.569 41.064 101.424 1.00 42.81 N ATOM 9789 CA PRO B 106 71.584 41.625 102.374 1.00 40.85 C ATOM 9790 C PRO B 106 71.264 40.605 103.465 1.00 40.05 C ATOM 9791 O PRO B 106 71.596 39.434 103.336 1.00 39.61 O ATOM 9792 CB PRO B 106 70.352 41.871 101.513 1.00 41.80 C ATOM 9793 CG PRO B 106 70.896 41.924 100.115 1.00 41.28 C ATOM 9794 CD PRO B 106 71.973 40.897 100.087 1.00 42.50 C ATOM 9795 HA PRO B 106 71.942 42.524 102.875 1.00 0.00 H ATOM 9796 HD3 PRO B 106 71.565 39.895 99.954 1.00 0.00 H ATOM 9797 HD2 PRO B 106 72.698 41.100 99.299 1.00 0.00 H ATOM 9798 HG3 PRO B 106 71.301 42.912 99.898 1.00 0.00 H ATOM 9799 HG2 PRO B 106 70.118 41.685 99.390 1.00 0.00 H ATOM 9800 HB2 PRO B 106 69.634 41.058 101.620 1.00 0.00 H ATOM 9801 HB3 PRO B 106 69.873 42.813 101.780 1.00 0.00 H ATOM 9802 N LYS B 107 70.599 41.051 104.519 1.00 40.45 N ATOM 9803 CA LYS B 107 70.185 40.175 105.585 1.00 41.77 C ATOM 9804 C LYS B 107 68.718 39.753 105.365 1.00 43.35 C ATOM 9805 O LYS B 107 68.358 38.587 105.526 1.00 41.23 O ATOM 9806 CB LYS B 107 70.288 40.909 106.914 1.00 42.62 C ATOM 9807 CG LYS B 107 71.674 41.484 107.176 1.00 45.06 C ATOM 9808 CD LYS B 107 72.693 40.366 107.011 1.00 46.65 C ATOM 9809 CE LYS B 107 74.108 40.842 107.274 1.00 48.54 C ATOM 9810 NZ LYS B 107 75.048 39.791 106.805 1.00 50.00 N ATOM 9811 HA LYS B 107 70.828 39.295 105.595 1.00 0.00 H ATOM 9812 HB2 LYS B 107 69.567 41.727 106.915 1.00 0.00 H ATOM 9813 HB3 LYS B 107 70.045 40.211 107.715 1.00 0.00 H ATOM 9814 HG2 LYS B 107 71.883 42.282 106.464 1.00 0.00 H ATOM 9815 HG3 LYS B 107 71.723 41.881 108.190 1.00 0.00 H ATOM 9816 HD2 LYS B 107 72.455 39.566 107.712 1.00 0.00 H ATOM 9817 HD3 LYS B 107 72.634 39.984 105.992 1.00 0.00 H ATOM 9818 HE2 LYS B 107 74.248 41.012 108.342 1.00 0.00 H ATOM 9819 HE3 LYS B 107 74.292 41.770 106.732 1.00 0.00 H ATOM 9820 HZ1 LYS B 107 74.866 38.908 107.324 1.00 0.00 H ATOM 9821 HZ2 LYS B 107 74.908 39.632 105.787 1.00 0.00 H ATOM 9822 HZ3 LYS B 107 76.026 40.100 106.977 1.00 0.00 H ATOM 9823 H LYS B 107 70.369 42.063 104.579 1.00 0.00 H ATOM 9824 N SER B 108 67.866 40.722 105.022 1.00 44.30 N ATOM 9825 CA SER B 108 66.456 40.418 104.808 1.00 46.34 C ATOM 9826 C SER B 108 65.848 41.504 103.950 1.00 45.75 C ATOM 9827 O SER B 108 65.162 42.403 104.453 1.00 48.13 O ATOM 9828 CB SER B 108 65.722 40.357 106.142 1.00 47.72 C ATOM 9829 OG SER B 108 64.558 39.526 106.075 1.00 49.63 O ATOM 9830 HA SER B 108 66.365 39.451 104.312 1.00 0.00 H ATOM 9831 HB2 SER B 108 65.419 41.365 106.424 1.00 0.00 H ATOM 9832 HB3 SER B 108 66.398 39.957 106.898 1.00 0.00 H ATOM 9833 HG SER B 108 64.112 39.513 106.959 1.00 0.00 H ATOM 9834 H SER B 108 68.209 41.697 104.907 1.00 0.00 H ATOM 9835 N THR B 109 66.091 41.430 102.658 1.00 42.57 N ATOM 9836 CA THR B 109 65.554 42.469 101.804 1.00 41.87 C ATOM 9837 C THR B 109 64.394 42.035 100.869 1.00 41.40 C ATOM 9838 O THR B 109 64.063 40.828 100.770 1.00 41.00 O ATOM 9839 CB THR B 109 66.687 43.116 100.984 1.00 39.83 C ATOM 9840 OG1 THR B 109 66.219 44.368 100.484 1.00 42.08 O ATOM 9841 CG2 THR B 109 67.128 42.232 99.811 1.00 36.40 C ATOM 9842 HA THR B 109 65.105 43.191 102.486 1.00 0.00 H ATOM 9843 HB THR B 109 67.552 43.249 101.634 1.00 0.00 H ATOM 9844 HG1 THR B 109 66.935 44.799 99.954 1.00 0.00 H ATOM 9845 HG23 THR B 109 67.485 41.276 100.193 1.00 0.00 H ATOM 9846 HG21 THR B 109 66.281 42.065 99.145 1.00 0.00 H ATOM 9847 HG22 THR B 109 67.929 42.729 99.264 1.00 0.00 H ATOM 9848 H THR B 109 66.652 40.649 102.263 1.00 0.00 H ATOM 9849 N THR B 110 63.779 43.021 100.215 1.00 40.38 N ATOM 9850 CA THR B 110 62.692 42.777 99.265 1.00 39.29 C ATOM 9851 C THR B 110 63.061 41.758 98.157 1.00 37.71 C ATOM 9852 O THR B 110 64.112 41.861 97.526 1.00 38.27 O ATOM 9853 CB THR B 110 62.268 44.087 98.593 1.00 40.46 C ATOM 9854 OG1 THR B 110 61.805 45.001 99.589 1.00 40.70 O ATOM 9855 CG2 THR B 110 61.117 43.832 97.557 1.00 39.87 C ATOM 9856 HA THR B 110 61.875 42.354 99.850 1.00 0.00 H ATOM 9857 HB THR B 110 63.128 44.503 98.069 1.00 0.00 H ATOM 9858 HG1 THR B 110 61.531 45.848 99.156 1.00 0.00 H ATOM 9859 HG23 THR B 110 61.464 43.135 96.794 1.00 0.00 H ATOM 9860 HG21 THR B 110 60.254 43.409 98.071 1.00 0.00 H ATOM 9861 HG22 THR B 110 60.836 44.775 97.088 1.00 0.00 H ATOM 9862 H THR B 110 64.083 44.001 100.386 1.00 0.00 H ATOM 9863 N VAL B 111 62.185 40.779 97.927 1.00 35.60 N ATOM 9864 CA VAL B 111 62.398 39.750 96.919 1.00 32.85 C ATOM 9865 C VAL B 111 61.384 39.887 95.754 1.00 33.55 C ATOM 9866 O VAL B 111 60.175 40.047 95.998 1.00 32.46 O ATOM 9867 CB VAL B 111 62.218 38.314 97.559 1.00 34.52 C ATOM 9868 CG1 VAL B 111 62.359 37.211 96.489 1.00 29.77 C ATOM 9869 CG2 VAL B 111 63.255 38.089 98.694 1.00 33.19 C ATOM 9870 HA VAL B 111 63.411 39.875 96.536 1.00 0.00 H ATOM 9871 HB VAL B 111 61.215 38.259 97.981 1.00 0.00 H ATOM 9872 HG11 VAL B 111 61.597 37.351 95.722 1.00 0.00 H ATOM 9873 HG12 VAL B 111 63.348 37.271 96.035 1.00 0.00 H ATOM 9874 HG13 VAL B 111 62.231 36.235 96.956 1.00 0.00 H ATOM 9875 HG21 VAL B 111 64.262 38.171 98.286 1.00 0.00 H ATOM 9876 HG22 VAL B 111 63.113 38.843 99.469 1.00 0.00 H ATOM 9877 HG23 VAL B 111 63.115 37.096 99.121 1.00 0.00 H ATOM 9878 H VAL B 111 61.312 40.749 98.492 1.00 0.00 H ATOM 9879 N MET B 112 61.884 39.821 94.510 1.00 32.08 N ATOM 9880 CA MET B 112 61.055 39.847 93.295 1.00 33.43 C ATOM 9881 C MET B 112 61.389 38.577 92.488 1.00 33.72 C ATOM 9882 O MET B 112 62.575 38.219 92.316 1.00 33.47 O ATOM 9883 CB MET B 112 61.315 41.091 92.449 1.00 33.99 C ATOM 9884 CG MET B 112 60.989 42.407 93.227 1.00 36.19 C ATOM 9885 SD MET B 112 61.257 43.896 92.254 1.00 37.32 S ATOM 9886 CE MET B 112 59.919 43.755 91.008 1.00 35.94 C ATOM 9887 HA MET B 112 60.002 39.877 93.574 1.00 0.00 H ATOM 9888 HB2 MET B 112 62.365 41.105 92.157 1.00 0.00 H ATOM 9889 HB3 MET B 112 60.692 41.046 91.556 1.00 0.00 H ATOM 9890 HG2 MET B 112 61.625 42.453 94.111 1.00 0.00 H ATOM 9891 HG3 MET B 112 59.943 42.378 93.534 1.00 0.00 H ATOM 9892 HE1 MET B 112 60.050 42.835 90.438 1.00 0.00 H ATOM 9893 HE2 MET B 112 58.954 43.736 91.514 1.00 0.00 H ATOM 9894 HE3 MET B 112 59.960 44.611 90.334 1.00 0.00 H ATOM 9895 H MET B 112 62.915 39.747 94.399 1.00 0.00 H ATOM 9896 N VAL B 113 60.336 37.852 92.076 1.00 31.48 N ATOM 9897 CA VAL B 113 60.466 36.624 91.288 1.00 30.14 C ATOM 9898 C VAL B 113 59.750 36.860 89.956 1.00 30.43 C ATOM 9899 O VAL B 113 58.527 37.056 89.911 1.00 30.66 O ATOM 9900 CB VAL B 113 59.791 35.384 91.995 1.00 27.73 C ATOM 9901 CG1 VAL B 113 59.996 34.073 91.110 1.00 25.15 C ATOM 9902 CG2 VAL B 113 60.332 35.228 93.394 1.00 26.32 C ATOM 9903 HA VAL B 113 61.526 36.401 91.164 1.00 0.00 H ATOM 9904 HB VAL B 113 58.717 35.548 92.083 1.00 0.00 H ATOM 9905 HG11 VAL B 113 59.539 34.221 90.132 1.00 0.00 H ATOM 9906 HG12 VAL B 113 61.062 33.881 90.989 1.00 0.00 H ATOM 9907 HG13 VAL B 113 59.527 33.224 91.607 1.00 0.00 H ATOM 9908 HG21 VAL B 113 61.410 35.073 93.350 1.00 0.00 H ATOM 9909 HG22 VAL B 113 60.117 36.129 93.968 1.00 0.00 H ATOM 9910 HG23 VAL B 113 59.859 34.370 93.871 1.00 0.00 H ATOM 9911 H VAL B 113 59.382 38.179 92.329 1.00 0.00 H ATOM 9912 N TRP B 114 60.535 36.825 88.886 1.00 31.26 N ATOM 9913 CA TRP B 114 60.099 37.014 87.507 1.00 31.41 C ATOM 9914 C TRP B 114 59.617 35.678 86.868 1.00 31.03 C ATOM 9915 O TRP B 114 60.267 34.623 86.985 1.00 31.25 O ATOM 9916 CB TRP B 114 61.274 37.557 86.659 1.00 30.83 C ATOM 9917 CG TRP B 114 60.955 37.663 85.188 1.00 31.66 C ATOM 9918 CD1 TRP B 114 61.498 36.922 84.158 1.00 32.93 C ATOM 9919 CD2 TRP B 114 60.071 38.602 84.578 1.00 31.56 C ATOM 9920 NE1 TRP B 114 61.007 37.359 82.941 1.00 31.63 N ATOM 9921 CE2 TRP B 114 60.134 38.389 83.172 1.00 32.15 C ATOM 9922 CE3 TRP B 114 59.236 39.622 85.084 1.00 31.01 C ATOM 9923 CZ2 TRP B 114 59.391 39.161 82.259 1.00 33.23 C ATOM 9924 CZ3 TRP B 114 58.498 40.393 84.189 1.00 31.39 C ATOM 9925 CH2 TRP B 114 58.581 40.161 82.782 1.00 31.96 C ATOM 9926 HA TRP B 114 59.269 37.720 87.521 1.00 0.00 H ATOM 9927 HB2 TRP B 114 61.537 38.548 87.028 1.00 0.00 H ATOM 9928 HB3 TRP B 114 62.126 36.888 86.780 1.00 0.00 H ATOM 9929 HE1 TRP B 114 61.258 36.971 82.009 1.00 0.00 H ATOM 9930 HD1 TRP B 114 62.212 36.108 84.285 1.00 0.00 H ATOM 9931 HZ2 TRP B 114 59.449 38.981 81.185 1.00 0.00 H ATOM 9932 HH2 TRP B 114 57.996 40.782 82.104 1.00 0.00 H ATOM 9933 HZ3 TRP B 114 57.849 41.183 84.567 1.00 0.00 H ATOM 9934 HE3 TRP B 114 59.170 39.803 86.157 1.00 0.00 H ATOM 9935 H TRP B 114 61.547 36.648 89.045 1.00 0.00 H ATOM 9936 N ILE B 115 58.459 35.741 86.233 1.00 29.53 N ATOM 9937 CA ILE B 115 57.908 34.590 85.523 1.00 29.70 C ATOM 9938 C ILE B 115 57.816 34.983 84.058 1.00 29.69 C ATOM 9939 O ILE B 115 57.006 35.865 83.693 1.00 29.05 O ATOM 9940 CB ILE B 115 56.483 34.200 86.034 1.00 29.89 C ATOM 9941 CG1 ILE B 115 56.534 33.914 87.545 1.00 29.21 C ATOM 9942 CG2 ILE B 115 56.007 32.911 85.256 1.00 27.51 C ATOM 9943 CD1 ILE B 115 55.115 33.504 88.165 1.00 32.75 C ATOM 9944 HA ILE B 115 58.552 33.726 85.687 1.00 0.00 H ATOM 9945 HB ILE B 115 55.784 35.018 85.858 1.00 0.00 H ATOM 9946 HG12 ILE B 115 57.236 33.098 87.719 1.00 0.00 H ATOM 9947 HG13 ILE B 115 56.888 34.810 88.055 1.00 0.00 H ATOM 9948 HD11 ILE B 115 54.404 34.315 88.009 1.00 0.00 H ATOM 9949 HD12 ILE B 115 54.752 32.602 87.673 1.00 0.00 H ATOM 9950 HD13 ILE B 115 55.227 33.317 89.233 1.00 0.00 H ATOM 9951 HG21 ILE B 115 55.974 33.124 84.188 1.00 0.00 H ATOM 9952 HG22 ILE B 115 56.706 32.096 85.444 1.00 0.00 H ATOM 9953 HG23 ILE B 115 55.013 32.626 85.602 1.00 0.00 H ATOM 9954 H ILE B 115 57.926 36.634 86.239 1.00 0.00 H ATOM 9955 N TYR B 116 58.640 34.353 83.213 1.00 29.72 N ATOM 9956 CA TYR B 116 58.611 34.712 81.772 1.00 31.19 C ATOM 9957 C TYR B 116 57.334 34.347 81.010 1.00 30.20 C ATOM 9958 O TYR B 116 56.618 33.429 81.384 1.00 30.06 O ATOM 9959 CB TYR B 116 59.838 34.138 81.029 1.00 29.05 C ATOM 9960 CG TYR B 116 59.970 32.583 81.025 1.00 28.52 C ATOM 9961 CD1 TYR B 116 59.071 31.772 80.313 1.00 28.64 C ATOM 9962 CD2 TYR B 116 61.002 31.961 81.712 1.00 29.03 C ATOM 9963 CE1 TYR B 116 59.193 30.381 80.285 1.00 28.33 C ATOM 9964 CE2 TYR B 116 61.156 30.527 81.704 1.00 26.95 C ATOM 9965 CZ TYR B 116 60.252 29.764 81.005 1.00 30.35 C ATOM 9966 OH TYR B 116 60.336 28.381 81.049 1.00 31.53 O ATOM 9967 HA TYR B 116 58.637 35.802 81.783 1.00 0.00 H ATOM 9968 HB3 TYR B 116 60.733 34.548 81.497 1.00 0.00 H ATOM 9969 HB2 TYR B 116 59.786 34.471 79.992 1.00 0.00 H ATOM 9970 HD2 TYR B 116 61.713 32.570 82.271 1.00 0.00 H ATOM 9971 HE2 TYR B 116 61.977 30.056 82.244 1.00 0.00 H ATOM 9972 HE1 TYR B 116 58.485 29.776 79.718 1.00 0.00 H ATOM 9973 HD1 TYR B 116 58.254 32.242 79.766 1.00 0.00 H ATOM 9974 HH TYR B 116 61.216 28.094 80.698 1.00 0.00 H ATOM 9975 H TYR B 116 59.292 33.621 83.561 1.00 0.00 H ATOM 9976 N GLY B 117 57.060 35.124 79.960 1.00 31.34 N ATOM 9977 CA GLY B 117 55.932 34.900 79.067 1.00 30.22 C ATOM 9978 C GLY B 117 56.437 34.072 77.871 1.00 31.25 C ATOM 9979 O GLY B 117 57.584 33.508 77.880 1.00 31.80 O ATOM 9980 HA3 GLY B 117 55.539 35.855 78.718 1.00 0.00 H ATOM 9981 HA2 GLY B 117 55.146 34.355 79.591 1.00 0.00 H ATOM 9982 H GLY B 117 57.686 35.933 79.769 1.00 0.00 H ATOM 9983 N GLY B 118 55.605 34.003 76.834 1.00 31.22 N ATOM 9984 CA GLY B 118 55.905 33.227 75.636 1.00 29.18 C ATOM 9985 C GLY B 118 54.655 32.427 75.192 1.00 31.34 C ATOM 9986 O GLY B 118 54.771 31.337 74.625 1.00 31.08 O ATOM 9987 HA3 GLY B 118 56.719 32.535 75.849 1.00 0.00 H ATOM 9988 HA2 GLY B 118 56.204 33.902 74.834 1.00 0.00 H ATOM 9989 H GLY B 118 54.706 34.523 76.880 1.00 0.00 H ATOM 9990 N GLY B 119 53.452 32.972 75.436 1.00 32.17 N ATOM 9991 CA GLY B 119 52.226 32.290 75.020 1.00 31.43 C ATOM 9992 C GLY B 119 52.026 30.860 75.553 1.00 31.74 C ATOM 9993 O GLY B 119 51.223 30.087 75.002 1.00 29.38 O ATOM 9994 HA3 GLY B 119 52.226 32.242 73.931 1.00 0.00 H ATOM 9995 HA2 GLY B 119 51.381 32.891 75.356 1.00 0.00 H ATOM 9996 H GLY B 119 53.391 33.888 75.925 1.00 0.00 H ATOM 9997 N PHE B 120 52.713 30.549 76.658 1.00 30.29 N ATOM 9998 CA PHE B 120 52.704 29.231 77.292 1.00 30.97 C ATOM 9999 C PHE B 120 53.347 28.170 76.407 1.00 31.33 C ATOM 10000 O PHE B 120 53.395 26.964 76.791 1.00 32.11 O ATOM 10001 CB PHE B 120 51.288 28.768 77.741 1.00 28.37 C ATOM 10002 CG PHE B 120 50.735 29.556 78.881 1.00 29.91 C ATOM 10003 CD1 PHE B 120 51.222 29.387 80.174 1.00 29.13 C ATOM 10004 CD2 PHE B 120 49.698 30.493 78.670 1.00 29.20 C ATOM 10005 CE1 PHE B 120 50.683 30.136 81.253 1.00 30.88 C ATOM 10006 CE2 PHE B 120 49.149 31.239 79.728 1.00 29.47 C ATOM 10007 CZ PHE B 120 49.641 31.062 81.028 1.00 30.77 C ATOM 10008 HA PHE B 120 53.304 29.346 78.195 1.00 0.00 H ATOM 10009 HB2 PHE B 120 50.609 28.864 76.894 1.00 0.00 H ATOM 10010 HB3 PHE B 120 51.346 27.722 78.041 1.00 0.00 H ATOM 10011 HD2 PHE B 120 49.314 30.641 77.661 1.00 0.00 H ATOM 10012 HE2 PHE B 120 48.346 31.951 79.538 1.00 0.00 H ATOM 10013 HZ PHE B 120 49.224 31.633 81.857 1.00 0.00 H ATOM 10014 HE1 PHE B 120 51.076 29.996 82.260 1.00 0.00 H ATOM 10015 HD1 PHE B 120 52.024 28.673 80.360 1.00 0.00 H ATOM 10016 H PHE B 120 53.292 31.294 77.095 1.00 0.00 H ATOM 10017 N TYR B 121 53.881 28.576 75.255 1.00 31.24 N ATOM 10018 CA TYR B 121 54.539 27.578 74.392 1.00 31.37 C ATOM 10019 C TYR B 121 56.024 27.837 74.211 1.00 33.06 C ATOM 10020 O TYR B 121 56.707 27.026 73.561 1.00 33.77 O ATOM 10021 CB TYR B 121 53.906 27.513 72.983 1.00 32.03 C ATOM 10022 CG TYR B 121 54.150 28.728 72.088 1.00 30.96 C ATOM 10023 CD1 TYR B 121 55.285 28.816 71.273 1.00 32.24 C ATOM 10024 CD2 TYR B 121 53.212 29.754 72.022 1.00 32.65 C ATOM 10025 CE1 TYR B 121 55.477 29.911 70.405 1.00 32.99 C ATOM 10026 CE2 TYR B 121 53.365 30.822 71.155 1.00 32.48 C ATOM 10027 CZ TYR B 121 54.499 30.893 70.343 1.00 32.39 C ATOM 10028 OH TYR B 121 54.586 31.906 69.422 1.00 35.25 O ATOM 10029 HA TYR B 121 54.395 26.632 74.915 1.00 0.00 H ATOM 10030 HB3 TYR B 121 52.829 27.398 73.105 1.00 0.00 H ATOM 10031 HB2 TYR B 121 54.309 26.637 72.475 1.00 0.00 H ATOM 10032 HD2 TYR B 121 52.336 29.716 72.669 1.00 0.00 H ATOM 10033 HE2 TYR B 121 52.606 31.602 71.106 1.00 0.00 H ATOM 10034 HE1 TYR B 121 56.377 29.984 69.794 1.00 0.00 H ATOM 10035 HD1 TYR B 121 56.033 28.024 71.310 1.00 0.00 H ATOM 10036 HH TYR B 121 55.438 31.826 68.925 1.00 0.00 H ATOM 10037 H TYR B 121 53.834 29.575 74.971 1.00 0.00 H ATOM 10038 N SER B 122 56.524 28.956 74.754 1.00 30.99 N ATOM 10039 CA SER B 122 57.920 29.278 74.589 1.00 32.51 C ATOM 10040 C SER B 122 58.338 30.138 75.752 1.00 32.91 C ATOM 10041 O SER B 122 57.505 30.425 76.623 1.00 32.49 O ATOM 10042 CB SER B 122 58.139 30.020 73.254 1.00 31.16 C ATOM 10043 OG SER B 122 57.448 31.263 73.214 1.00 33.81 O ATOM 10044 HA SER B 122 58.521 28.369 74.565 1.00 0.00 H ATOM 10045 HB2 SER B 122 57.780 29.391 72.439 1.00 0.00 H ATOM 10046 HB3 SER B 122 59.205 30.206 73.125 1.00 0.00 H ATOM 10047 HG SER B 122 56.477 31.103 73.323 1.00 0.00 H ATOM 10048 H SER B 122 55.904 29.593 75.295 1.00 0.00 H ATOM 10049 N GLY B 123 59.610 30.556 75.765 1.00 31.72 N ATOM 10050 CA GLY B 123 60.096 31.377 76.849 1.00 31.58 C ATOM 10051 C GLY B 123 61.336 30.771 77.534 1.00 32.82 C ATOM 10052 O GLY B 123 61.524 29.550 77.570 1.00 32.77 O ATOM 10053 HA3 GLY B 123 59.304 31.484 77.590 1.00 0.00 H ATOM 10054 HA2 GLY B 123 60.358 32.359 76.455 1.00 0.00 H ATOM 10055 H GLY B 123 60.251 30.288 74.991 1.00 0.00 H ATOM 10056 N SER B 124 62.161 31.643 78.084 1.00 32.43 N ATOM 10057 CA SER B 124 63.412 31.246 78.741 1.00 33.90 C ATOM 10058 C SER B 124 63.701 32.245 79.839 1.00 33.68 C ATOM 10059 O SER B 124 63.379 33.435 79.727 1.00 33.89 O ATOM 10060 CB SER B 124 64.583 31.279 77.735 1.00 32.90 C ATOM 10061 OG SER B 124 64.412 30.331 76.680 1.00 35.49 O ATOM 10062 HA SER B 124 63.309 30.236 79.137 1.00 0.00 H ATOM 10063 HB2 SER B 124 65.508 31.053 78.265 1.00 0.00 H ATOM 10064 HB3 SER B 124 64.648 32.278 77.303 1.00 0.00 H ATOM 10065 HG SER B 124 63.577 30.533 76.188 1.00 0.00 H ATOM 10066 H SER B 124 61.914 32.653 78.050 1.00 0.00 H ATOM 10067 N SER B 125 64.309 31.777 80.909 1.00 33.92 N ATOM 10068 CA SER B 125 64.624 32.673 81.996 1.00 35.07 C ATOM 10069 C SER B 125 65.963 33.396 81.754 1.00 36.07 C ATOM 10070 O SER B 125 66.304 34.330 82.500 1.00 37.05 O ATOM 10071 CB SER B 125 64.760 31.882 83.287 1.00 35.84 C ATOM 10072 OG SER B 125 65.892 31.008 83.267 1.00 36.43 O ATOM 10073 HA SER B 125 63.818 33.404 82.062 1.00 0.00 H ATOM 10074 HB2 SER B 125 63.859 31.286 83.431 1.00 0.00 H ATOM 10075 HB3 SER B 125 64.869 32.580 84.117 1.00 0.00 H ATOM 10076 HG SER B 125 65.942 30.515 84.124 1.00 0.00 H ATOM 10077 H SER B 125 64.560 30.770 80.971 1.00 0.00 H ATOM 10078 N THR B 126 66.666 32.968 80.702 1.00 35.73 N ATOM 10079 CA THR B 126 68.041 33.394 80.381 1.00 37.04 C ATOM 10080 C THR B 126 68.267 34.464 79.338 1.00 37.14 C ATOM 10081 O THR B 126 69.405 34.815 79.046 1.00 37.57 O ATOM 10082 CB THR B 126 68.838 32.140 79.989 1.00 35.95 C ATOM 10083 OG1 THR B 126 68.287 31.570 78.779 1.00 35.79 O ATOM 10084 CG2 THR B 126 68.729 31.102 81.120 1.00 34.65 C ATOM 10085 HA THR B 126 68.372 33.891 81.293 1.00 0.00 H ATOM 10086 HB THR B 126 69.881 32.411 79.824 1.00 0.00 H ATOM 10087 HG1 THR B 126 68.341 32.235 78.048 1.00 0.00 H ATOM 10088 HG23 THR B 126 69.142 31.522 82.037 1.00 0.00 H ATOM 10089 HG21 THR B 126 67.681 30.845 81.276 1.00 0.00 H ATOM 10090 HG22 THR B 126 69.287 30.207 80.845 1.00 0.00 H ATOM 10091 H THR B 126 66.211 32.285 80.063 1.00 0.00 H ATOM 10092 N LEU B 127 67.180 34.983 78.784 1.00 37.30 N ATOM 10093 CA LEU B 127 67.228 36.029 77.774 1.00 38.80 C ATOM 10094 C LEU B 127 67.923 37.300 78.273 1.00 39.04 C ATOM 10095 O LEU B 127 67.758 37.702 79.447 1.00 37.24 O ATOM 10096 CB LEU B 127 65.793 36.408 77.346 1.00 37.07 C ATOM 10097 CG LEU B 127 64.903 35.253 76.843 1.00 37.90 C ATOM 10098 CD1 LEU B 127 63.524 35.831 76.486 1.00 35.98 C ATOM 10099 CD2 LEU B 127 65.539 34.534 75.645 1.00 35.05 C ATOM 10100 HA LEU B 127 67.800 35.628 76.938 1.00 0.00 H ATOM 10101 HB2 LEU B 127 65.298 36.859 78.206 1.00 0.00 H ATOM 10102 HB3 LEU B 127 65.868 37.143 76.545 1.00 0.00 H ATOM 10103 HG LEU B 127 64.795 34.503 77.627 1.00 0.00 H ATOM 10104 HD21 LEU B 127 65.679 35.243 74.829 1.00 0.00 H ATOM 10105 HD22 LEU B 127 66.505 34.123 75.940 1.00 0.00 H ATOM 10106 HD23 LEU B 127 64.884 33.727 75.318 1.00 0.00 H ATOM 10107 HD11 LEU B 127 63.082 36.287 77.372 1.00 0.00 H ATOM 10108 HD12 LEU B 127 63.638 36.584 75.706 1.00 0.00 H ATOM 10109 HD13 LEU B 127 62.877 35.030 76.127 1.00 0.00 H ATOM 10110 H LEU B 127 66.251 34.626 79.085 1.00 0.00 H ATOM 10111 N ASP B 128 68.641 37.967 77.371 1.00 39.10 N ATOM 10112 CA ASP B 128 69.316 39.204 77.750 1.00 38.69 C ATOM 10113 C ASP B 128 68.327 40.222 78.317 1.00 36.87 C ATOM 10114 O ASP B 128 68.689 40.960 79.230 1.00 35.82 O ATOM 10115 CB ASP B 128 70.051 39.844 76.553 1.00 41.66 C ATOM 10116 CG ASP B 128 71.202 38.977 75.996 1.00 45.11 C ATOM 10117 OD1 ASP B 128 71.844 38.191 76.738 1.00 47.07 O ATOM 10118 OD2 ASP B 128 71.465 39.105 74.776 1.00 49.28 O ATOM 10119 HA ASP B 128 70.045 38.936 78.515 1.00 0.00 H ATOM 10120 HB2 ASP B 128 69.328 40.011 75.754 1.00 0.00 H ATOM 10121 HB3 ASP B 128 70.464 40.800 76.874 1.00 0.00 H ATOM 10122 H ASP B 128 68.720 37.607 76.399 1.00 0.00 H ATOM 10123 N VAL B 129 67.093 40.296 77.787 1.00 37.03 N ATOM 10124 CA VAL B 129 66.141 41.268 78.335 1.00 36.02 C ATOM 10125 C VAL B 129 65.673 40.923 79.731 1.00 36.23 C ATOM 10126 O VAL B 129 64.946 41.736 80.317 1.00 35.25 O ATOM 10127 CB VAL B 129 64.761 41.413 77.599 1.00 35.82 C ATOM 10128 CG1 VAL B 129 64.757 42.564 76.761 1.00 36.31 C ATOM 10129 CG2 VAL B 129 64.361 40.132 76.956 1.00 36.16 C ATOM 10130 HA VAL B 129 66.749 42.168 78.244 1.00 0.00 H ATOM 10131 HB VAL B 129 63.967 41.602 78.321 1.00 0.00 H ATOM 10132 HG11 VAL B 129 64.929 43.454 77.367 1.00 0.00 H ATOM 10133 HG12 VAL B 129 65.547 42.472 76.016 1.00 0.00 H ATOM 10134 HG13 VAL B 129 63.792 42.645 76.261 1.00 0.00 H ATOM 10135 HG21 VAL B 129 65.117 39.841 76.227 1.00 0.00 H ATOM 10136 HG22 VAL B 129 64.272 39.357 77.717 1.00 0.00 H ATOM 10137 HG23 VAL B 129 63.402 40.263 76.454 1.00 0.00 H ATOM 10138 H VAL B 129 66.818 39.673 77.001 1.00 0.00 H ATOM 10139 N TYR B 130 65.988 39.723 80.237 1.00 35.85 N ATOM 10140 CA TYR B 130 65.548 39.381 81.607 1.00 36.99 C ATOM 10141 C TYR B 130 66.747 39.364 82.578 1.00 38.11 C ATOM 10142 O TYR B 130 66.641 38.854 83.698 1.00 38.25 O ATOM 10143 CB TYR B 130 64.849 37.984 81.665 1.00 33.94 C ATOM 10144 CG TYR B 130 63.647 37.785 80.760 1.00 32.75 C ATOM 10145 CD1 TYR B 130 62.777 38.848 80.439 1.00 33.09 C ATOM 10146 CD2 TYR B 130 63.347 36.501 80.252 1.00 32.47 C ATOM 10147 CE1 TYR B 130 61.628 38.639 79.608 1.00 32.31 C ATOM 10148 CE2 TYR B 130 62.224 36.277 79.456 1.00 30.52 C ATOM 10149 CZ TYR B 130 61.366 37.350 79.129 1.00 31.73 C ATOM 10150 OH TYR B 130 60.274 37.116 78.310 1.00 31.45 O ATOM 10151 HA TYR B 130 64.833 40.149 81.903 1.00 0.00 H ATOM 10152 HB3 TYR B 130 64.520 37.821 82.691 1.00 0.00 H ATOM 10153 HB2 TYR B 130 65.591 37.232 81.399 1.00 0.00 H ATOM 10154 HD2 TYR B 130 64.008 35.667 80.488 1.00 0.00 H ATOM 10155 HE2 TYR B 130 62.009 35.274 79.086 1.00 0.00 H ATOM 10156 HE1 TYR B 130 60.970 39.469 79.353 1.00 0.00 H ATOM 10157 HD1 TYR B 130 62.982 39.845 80.829 1.00 0.00 H ATOM 10158 HH TYR B 130 59.682 36.446 78.735 1.00 0.00 H ATOM 10159 H TYR B 130 66.535 39.041 79.674 1.00 0.00 H ATOM 10160 N ASN B 131 67.887 39.890 82.147 1.00 39.97 N ATOM 10161 CA ASN B 131 69.082 39.894 83.014 1.00 40.72 C ATOM 10162 C ASN B 131 68.748 40.677 84.279 1.00 40.50 C ATOM 10163 O ASN B 131 68.582 41.893 84.242 1.00 40.41 O ATOM 10164 CB ASN B 131 70.269 40.521 82.265 1.00 40.64 C ATOM 10165 CG ASN B 131 71.637 40.282 82.973 1.00 42.83 C ATOM 10166 OD1 ASN B 131 71.718 40.125 84.193 1.00 41.90 O ATOM 10167 ND2 ASN B 131 72.717 40.294 82.179 1.00 43.57 N ATOM 10168 HA ASN B 131 69.366 38.877 83.285 1.00 0.00 H ATOM 10169 HB2 ASN B 131 70.316 40.089 81.265 1.00 0.00 H ATOM 10170 HB3 ASN B 131 70.102 41.595 82.187 1.00 0.00 H ATOM 10171 HD22 ASN B 131 72.607 40.429 81.154 1.00 0.00 H ATOM 10172 HD21 ASN B 131 73.665 40.168 82.588 1.00 0.00 H ATOM 10173 H ASN B 131 67.939 40.302 81.193 1.00 0.00 H ATOM 10174 N GLY B 132 68.670 39.984 85.420 1.00 40.91 N ATOM 10175 CA GLY B 132 68.281 40.681 86.644 1.00 38.99 C ATOM 10176 C GLY B 132 69.315 41.523 87.387 1.00 40.01 C ATOM 10177 O GLY B 132 68.987 42.209 88.379 1.00 37.42 O ATOM 10178 HA3 GLY B 132 67.927 39.923 87.343 1.00 0.00 H ATOM 10179 HA2 GLY B 132 67.458 41.346 86.383 1.00 0.00 H ATOM 10180 H GLY B 132 68.883 38.966 85.436 1.00 0.00 H ATOM 10181 N LYS B 133 70.559 41.506 86.899 1.00 41.12 N ATOM 10182 CA LYS B 133 71.599 42.236 87.619 1.00 41.52 C ATOM 10183 C LYS B 133 71.302 43.731 87.781 1.00 40.97 C ATOM 10184 O LYS B 133 71.548 44.270 88.856 1.00 38.86 O ATOM 10185 CB LYS B 133 72.970 41.992 86.970 1.00 41.56 C ATOM 10186 CG LYS B 133 73.238 42.822 85.718 1.00 42.85 C ATOM 10187 CD LYS B 133 74.381 42.202 84.957 1.00 43.68 C ATOM 10188 CE LYS B 133 75.083 43.250 84.085 1.00 45.09 C ATOM 10189 NZ LYS B 133 76.235 42.621 83.418 1.00 44.12 N ATOM 10190 HA LYS B 133 71.616 41.839 88.634 1.00 0.00 H ATOM 10191 HB2 LYS B 133 73.741 42.226 87.705 1.00 0.00 H ATOM 10192 HB3 LYS B 133 73.036 40.938 86.700 1.00 0.00 H ATOM 10193 HG2 LYS B 133 72.346 42.838 85.091 1.00 0.00 H ATOM 10194 HG3 LYS B 133 73.498 43.841 86.003 1.00 0.00 H ATOM 10195 HD2 LYS B 133 75.098 41.786 85.664 1.00 0.00 H ATOM 10196 HD3 LYS B 133 73.997 41.405 84.320 1.00 0.00 H ATOM 10197 HE2 LYS B 133 75.427 44.075 84.709 1.00 0.00 H ATOM 10198 HE3 LYS B 133 74.388 43.628 83.336 1.00 0.00 H ATOM 10199 HZ1 LYS B 133 76.895 42.261 84.136 1.00 0.00 H ATOM 10200 HZ2 LYS B 133 75.903 41.834 82.824 1.00 0.00 H ATOM 10201 HZ3 LYS B 133 76.717 43.325 82.824 1.00 0.00 H ATOM 10202 H LYS B 133 70.781 40.985 86.027 1.00 0.00 H ATOM 10203 N TYR B 134 70.739 44.386 86.760 1.00 40.37 N ATOM 10204 CA TYR B 134 70.462 45.832 86.871 1.00 41.80 C ATOM 10205 C TYR B 134 69.432 46.198 87.910 1.00 42.63 C ATOM 10206 O TYR B 134 69.595 47.183 88.648 1.00 44.13 O ATOM 10207 CB TYR B 134 70.010 46.426 85.528 1.00 42.50 C ATOM 10208 CG TYR B 134 70.938 46.066 84.406 1.00 43.77 C ATOM 10209 CD1 TYR B 134 70.560 45.132 83.456 1.00 43.80 C ATOM 10210 CD2 TYR B 134 72.235 46.602 84.345 1.00 44.94 C ATOM 10211 CE1 TYR B 134 71.431 44.720 82.468 1.00 44.52 C ATOM 10212 CE2 TYR B 134 73.141 46.196 83.349 1.00 45.16 C ATOM 10213 CZ TYR B 134 72.719 45.251 82.418 1.00 46.86 C ATOM 10214 OH TYR B 134 73.568 44.819 81.432 1.00 48.87 O ATOM 10215 HA TYR B 134 71.416 46.255 87.186 1.00 0.00 H ATOM 10216 HB3 TYR B 134 69.974 47.512 85.619 1.00 0.00 H ATOM 10217 HB2 TYR B 134 69.014 46.049 85.295 1.00 0.00 H ATOM 10218 HD2 TYR B 134 72.544 47.344 85.081 1.00 0.00 H ATOM 10219 HE2 TYR B 134 74.148 46.611 83.307 1.00 0.00 H ATOM 10220 HE1 TYR B 134 71.113 43.983 81.730 1.00 0.00 H ATOM 10221 HD1 TYR B 134 69.554 44.714 83.489 1.00 0.00 H ATOM 10222 HH TYR B 134 73.103 44.153 80.866 1.00 0.00 H ATOM 10223 H TYR B 134 70.496 43.876 85.887 1.00 0.00 H ATOM 10224 N LEU B 135 68.345 45.435 87.957 1.00 42.22 N ATOM 10225 CA LEU B 135 67.297 45.718 88.914 1.00 41.28 C ATOM 10226 C LEU B 135 67.779 45.354 90.319 1.00 41.69 C ATOM 10227 O LEU B 135 67.613 46.129 91.275 1.00 41.62 O ATOM 10228 CB LEU B 135 66.055 44.922 88.528 1.00 43.09 C ATOM 10229 CG LEU B 135 64.697 45.130 89.166 1.00 44.40 C ATOM 10230 CD1 LEU B 135 64.298 46.608 89.182 1.00 43.25 C ATOM 10231 CD2 LEU B 135 63.691 44.281 88.330 1.00 44.51 C ATOM 10232 HA LEU B 135 67.047 46.779 88.909 1.00 0.00 H ATOM 10233 HB2 LEU B 135 65.912 45.091 87.461 1.00 0.00 H ATOM 10234 HB3 LEU B 135 66.307 43.875 88.698 1.00 0.00 H ATOM 10235 HG LEU B 135 64.707 44.817 90.210 1.00 0.00 H ATOM 10236 HD21 LEU B 135 63.697 44.627 87.296 1.00 0.00 H ATOM 10237 HD22 LEU B 135 63.986 43.232 88.365 1.00 0.00 H ATOM 10238 HD23 LEU B 135 62.690 44.393 88.746 1.00 0.00 H ATOM 10239 HD11 LEU B 135 65.035 47.176 89.750 1.00 0.00 H ATOM 10240 HD12 LEU B 135 64.258 46.983 88.159 1.00 0.00 H ATOM 10241 HD13 LEU B 135 63.318 46.713 89.648 1.00 0.00 H ATOM 10242 H LEU B 135 68.247 44.632 87.304 1.00 0.00 H ATOM 10243 N ALA B 136 68.408 44.193 90.454 1.00 41.15 N ATOM 10244 CA ALA B 136 68.892 43.782 91.769 1.00 41.95 C ATOM 10245 C ALA B 136 69.862 44.852 92.294 1.00 42.54 C ATOM 10246 O ALA B 136 69.784 45.333 93.442 1.00 41.86 O ATOM 10247 CB ALA B 136 69.601 42.420 91.655 1.00 38.97 C ATOM 10248 HA ALA B 136 68.058 43.680 92.463 1.00 0.00 H ATOM 10249 HB1 ALA B 136 68.899 41.677 91.278 1.00 0.00 H ATOM 10250 HB2 ALA B 136 70.443 42.507 90.969 1.00 0.00 H ATOM 10251 HB3 ALA B 136 69.961 42.116 92.638 1.00 0.00 H ATOM 10252 H ALA B 136 68.555 43.579 89.627 1.00 0.00 H ATOM 10253 N TYR B 137 70.761 45.243 91.406 1.00 43.61 N ATOM 10254 CA TYR B 137 71.760 46.203 91.757 1.00 44.27 C ATOM 10255 C TYR B 137 71.168 47.543 92.069 1.00 44.42 C ATOM 10256 O TYR B 137 71.367 48.074 93.159 1.00 44.09 O ATOM 10257 CB TYR B 137 72.777 46.333 90.628 1.00 45.17 C ATOM 10258 CG TYR B 137 73.775 47.424 90.888 1.00 48.03 C ATOM 10259 CD1 TYR B 137 73.695 48.653 90.221 1.00 48.51 C ATOM 10260 CD2 TYR B 137 74.797 47.234 91.826 1.00 49.13 C ATOM 10261 CE1 TYR B 137 74.615 49.677 90.479 1.00 50.40 C ATOM 10262 CE2 TYR B 137 75.724 48.240 92.099 1.00 50.09 C ATOM 10263 CZ TYR B 137 75.632 49.450 91.430 1.00 51.15 C ATOM 10264 OH TYR B 137 76.548 50.419 91.730 1.00 52.72 O ATOM 10265 HA TYR B 137 72.256 45.845 92.659 1.00 0.00 H ATOM 10266 HB3 TYR B 137 72.247 46.555 89.702 1.00 0.00 H ATOM 10267 HB2 TYR B 137 73.309 45.387 90.524 1.00 0.00 H ATOM 10268 HD2 TYR B 137 74.870 46.282 92.353 1.00 0.00 H ATOM 10269 HE2 TYR B 137 76.514 48.076 92.832 1.00 0.00 H ATOM 10270 HE1 TYR B 137 74.547 50.631 89.955 1.00 0.00 H ATOM 10271 HD1 TYR B 137 72.904 48.815 89.489 1.00 0.00 H ATOM 10272 HH TYR B 137 76.366 51.224 91.183 1.00 0.00 H ATOM 10273 H TYR B 137 70.741 44.848 90.444 1.00 0.00 H ATOM 10274 N THR B 138 70.388 48.078 91.137 1.00 44.79 N ATOM 10275 CA THR B 138 69.850 49.423 91.319 1.00 44.07 C ATOM 10276 C THR B 138 68.896 49.584 92.462 1.00 43.97 C ATOM 10277 O THR B 138 68.969 50.580 93.174 1.00 43.83 O ATOM 10278 CB THR B 138 69.191 49.944 90.036 1.00 43.55 C ATOM 10279 OG1 THR B 138 70.133 49.882 88.963 1.00 42.52 O ATOM 10280 CG2 THR B 138 68.819 51.351 90.188 1.00 44.57 C ATOM 10281 HA THR B 138 70.728 50.019 91.568 1.00 0.00 H ATOM 10282 HB THR B 138 68.310 49.334 89.836 1.00 0.00 H ATOM 10283 HG1 THR B 138 70.420 48.944 88.831 1.00 0.00 H ATOM 10284 HG23 THR B 138 68.098 51.449 90.999 1.00 0.00 H ATOM 10285 HG21 THR B 138 69.708 51.938 90.418 1.00 0.00 H ATOM 10286 HG22 THR B 138 68.375 51.710 89.260 1.00 0.00 H ATOM 10287 H THR B 138 70.160 47.539 90.277 1.00 0.00 H ATOM 10288 N GLU B 139 68.027 48.600 92.688 1.00 43.67 N ATOM 10289 CA GLU B 139 67.041 48.758 93.750 1.00 42.90 C ATOM 10290 C GLU B 139 67.301 47.987 95.022 1.00 42.99 C ATOM 10291 O GLU B 139 66.486 48.025 95.945 1.00 41.68 O ATOM 10292 CB GLU B 139 65.646 48.428 93.202 1.00 43.86 C ATOM 10293 CG GLU B 139 65.195 49.370 92.080 1.00 40.90 C ATOM 10294 CD GLU B 139 64.938 50.754 92.602 1.00 40.07 C ATOM 10295 OE1 GLU B 139 64.419 50.872 93.722 1.00 39.85 O ATOM 10296 OE2 GLU B 139 65.240 51.729 91.900 1.00 42.16 O ATOM 10297 HA GLU B 139 67.117 49.802 94.054 1.00 0.00 H ATOM 10298 HB2 GLU B 139 65.659 47.409 92.814 1.00 0.00 H ATOM 10299 HB3 GLU B 139 64.928 48.495 94.020 1.00 0.00 H ATOM 10300 HG2 GLU B 139 65.974 49.416 91.319 1.00 0.00 H ATOM 10301 HG3 GLU B 139 64.278 48.981 91.636 1.00 0.00 H ATOM 10302 H GLU B 139 68.052 47.732 92.115 1.00 0.00 H ATOM 10303 N GLU B 140 68.431 47.284 95.053 1.00 43.36 N ATOM 10304 CA GLU B 140 68.822 46.508 96.200 1.00 45.15 C ATOM 10305 C GLU B 140 67.816 45.445 96.569 1.00 43.14 C ATOM 10306 O GLU B 140 67.414 45.315 97.707 1.00 42.96 O ATOM 10307 CB GLU B 140 69.113 47.457 97.369 1.00 49.87 C ATOM 10308 CG GLU B 140 70.226 48.459 96.964 1.00 58.35 C ATOM 10309 CD GLU B 140 70.629 49.459 98.052 1.00 63.30 C ATOM 10310 OE1 GLU B 140 69.848 50.427 98.339 1.00 65.33 O ATOM 10311 OE2 GLU B 140 71.742 49.261 98.610 1.00 65.65 O ATOM 10312 HA GLU B 140 69.728 45.958 95.946 1.00 0.00 H ATOM 10313 HB2 GLU B 140 68.207 48.006 97.625 1.00 0.00 H ATOM 10314 HB3 GLU B 140 69.442 46.879 98.232 1.00 0.00 H ATOM 10315 HG2 GLU B 140 71.111 47.887 96.687 1.00 0.00 H ATOM 10316 HG3 GLU B 140 69.874 49.023 96.100 1.00 0.00 H ATOM 10317 H GLU B 140 69.053 47.296 94.219 1.00 0.00 H ATOM 10318 N VAL B 141 67.417 44.655 95.582 1.00 42.52 N ATOM 10319 CA VAL B 141 66.472 43.589 95.848 1.00 40.39 C ATOM 10320 C VAL B 141 67.143 42.293 95.460 1.00 39.36 C ATOM 10321 O VAL B 141 68.086 42.295 94.660 1.00 37.67 O ATOM 10322 CB VAL B 141 65.149 43.720 94.975 1.00 40.02 C ATOM 10323 CG1 VAL B 141 64.430 45.042 95.241 1.00 39.91 C ATOM 10324 CG2 VAL B 141 65.475 43.593 93.537 1.00 38.94 C ATOM 10325 HA VAL B 141 66.191 43.632 96.900 1.00 0.00 H ATOM 10326 HB VAL B 141 64.475 42.913 95.263 1.00 0.00 H ATOM 10327 HG11 VAL B 141 64.156 45.099 96.294 1.00 0.00 H ATOM 10328 HG12 VAL B 141 65.092 45.871 94.991 1.00 0.00 H ATOM 10329 HG13 VAL B 141 63.531 45.095 94.627 1.00 0.00 H ATOM 10330 HG21 VAL B 141 66.172 44.381 93.253 1.00 0.00 H ATOM 10331 HG22 VAL B 141 65.931 42.620 93.354 1.00 0.00 H ATOM 10332 HG23 VAL B 141 64.562 43.684 92.949 1.00 0.00 H ATOM 10333 H VAL B 141 67.781 44.800 94.619 1.00 0.00 H ATOM 10334 N VAL B 142 66.654 41.192 96.036 1.00 38.91 N ATOM 10335 CA VAL B 142 67.126 39.873 95.646 1.00 38.94 C ATOM 10336 C VAL B 142 66.166 39.519 94.481 1.00 39.38 C ATOM 10337 O VAL B 142 64.951 39.409 94.680 1.00 39.67 O ATOM 10338 CB VAL B 142 67.006 38.854 96.803 1.00 37.96 C ATOM 10339 CG1 VAL B 142 67.109 37.446 96.298 1.00 35.75 C ATOM 10340 CG2 VAL B 142 68.131 39.107 97.809 1.00 38.00 C ATOM 10341 HA VAL B 142 68.181 39.853 95.372 1.00 0.00 H ATOM 10342 HB VAL B 142 66.032 38.981 97.275 1.00 0.00 H ATOM 10343 HG11 VAL B 142 66.307 37.258 95.584 1.00 0.00 H ATOM 10344 HG12 VAL B 142 68.073 37.306 95.809 1.00 0.00 H ATOM 10345 HG13 VAL B 142 67.021 36.754 97.135 1.00 0.00 H ATOM 10346 HG21 VAL B 142 69.094 38.988 97.313 1.00 0.00 H ATOM 10347 HG22 VAL B 142 68.045 40.121 98.201 1.00 0.00 H ATOM 10348 HG23 VAL B 142 68.052 38.392 98.628 1.00 0.00 H ATOM 10349 H VAL B 142 65.926 41.279 96.773 1.00 0.00 H ATOM 10350 N LEU B 143 66.712 39.367 93.271 1.00 38.55 N ATOM 10351 CA LEU B 143 65.886 39.081 92.104 1.00 37.69 C ATOM 10352 C LEU B 143 65.971 37.630 91.657 1.00 36.94 C ATOM 10353 O LEU B 143 67.058 37.087 91.418 1.00 37.74 O ATOM 10354 CB LEU B 143 66.283 39.998 90.955 1.00 40.41 C ATOM 10355 CG LEU B 143 65.309 40.119 89.780 1.00 42.73 C ATOM 10356 CD1 LEU B 143 65.693 41.326 88.945 1.00 46.60 C ATOM 10357 CD2 LEU B 143 65.419 38.921 88.898 1.00 42.15 C ATOM 10358 HA LEU B 143 64.851 39.264 92.395 1.00 0.00 H ATOM 10359 HB2 LEU B 143 66.424 40.997 91.368 1.00 0.00 H ATOM 10360 HB3 LEU B 143 67.231 39.634 90.558 1.00 0.00 H ATOM 10361 HG LEU B 143 64.297 40.210 90.173 1.00 0.00 H ATOM 10362 HD21 LEU B 143 66.436 38.846 88.514 1.00 0.00 H ATOM 10363 HD22 LEU B 143 65.179 38.026 89.472 1.00 0.00 H ATOM 10364 HD23 LEU B 143 64.722 39.019 88.066 1.00 0.00 H ATOM 10365 HD11 LEU B 143 65.641 42.224 89.561 1.00 0.00 H ATOM 10366 HD12 LEU B 143 66.709 41.199 88.571 1.00 0.00 H ATOM 10367 HD13 LEU B 143 65.004 41.420 88.106 1.00 0.00 H ATOM 10368 H LEU B 143 67.742 39.454 93.160 1.00 0.00 H ATOM 10369 N VAL B 144 64.813 36.990 91.549 1.00 35.07 N ATOM 10370 CA VAL B 144 64.768 35.603 91.122 1.00 33.42 C ATOM 10371 C VAL B 144 64.018 35.475 89.789 1.00 34.15 C ATOM 10372 O VAL B 144 62.980 36.153 89.567 1.00 33.78 O ATOM 10373 CB VAL B 144 64.022 34.683 92.207 1.00 33.33 C ATOM 10374 CG1 VAL B 144 63.876 33.256 91.698 1.00 32.46 C ATOM 10375 CG2 VAL B 144 64.772 34.714 93.585 1.00 33.14 C ATOM 10376 HA VAL B 144 65.799 35.268 91.009 1.00 0.00 H ATOM 10377 HB VAL B 144 63.023 35.090 92.362 1.00 0.00 H ATOM 10378 HG11 VAL B 144 63.292 33.258 90.778 1.00 0.00 H ATOM 10379 HG12 VAL B 144 64.864 32.839 91.502 1.00 0.00 H ATOM 10380 HG13 VAL B 144 63.368 32.653 92.451 1.00 0.00 H ATOM 10381 HG21 VAL B 144 65.788 34.343 93.452 1.00 0.00 H ATOM 10382 HG22 VAL B 144 64.803 35.738 93.957 1.00 0.00 H ATOM 10383 HG23 VAL B 144 64.244 34.082 94.299 1.00 0.00 H ATOM 10384 H VAL B 144 63.928 37.488 91.773 1.00 0.00 H ATOM 10385 N SER B 145 64.551 34.638 88.890 1.00 33.13 N ATOM 10386 CA SER B 145 63.787 34.309 87.690 1.00 33.61 C ATOM 10387 C SER B 145 63.670 32.782 87.733 1.00 34.79 C ATOM 10388 O SER B 145 64.700 32.041 87.913 1.00 32.81 O ATOM 10389 CB SER B 145 64.432 34.797 86.369 1.00 33.21 C ATOM 10390 OG SER B 145 65.781 34.350 86.169 1.00 33.83 O ATOM 10391 HA SER B 145 62.823 34.818 87.693 1.00 0.00 H ATOM 10392 HB2 SER B 145 64.430 35.887 86.370 1.00 0.00 H ATOM 10393 HB3 SER B 145 63.826 34.435 85.539 1.00 0.00 H ATOM 10394 HG SER B 145 66.120 34.702 85.308 1.00 0.00 H ATOM 10395 H SER B 145 65.495 34.229 89.044 1.00 0.00 H ATOM 10396 N LEU B 146 62.427 32.289 87.642 1.00 33.65 N ATOM 10397 CA LEU B 146 62.214 30.816 87.621 1.00 33.57 C ATOM 10398 C LEU B 146 62.007 30.311 86.150 1.00 34.20 C ATOM 10399 O LEU B 146 62.143 31.060 85.195 1.00 32.63 O ATOM 10400 CB LEU B 146 60.986 30.446 88.512 1.00 32.74 C ATOM 10401 CG LEU B 146 59.679 31.259 88.275 1.00 31.19 C ATOM 10402 CD1 LEU B 146 59.035 30.878 86.913 1.00 29.61 C ATOM 10403 CD2 LEU B 146 58.662 30.968 89.452 1.00 32.01 C ATOM 10404 HA LEU B 146 63.099 30.324 88.024 1.00 0.00 H ATOM 10405 HB2 LEU B 146 60.757 29.394 88.339 1.00 0.00 H ATOM 10406 HB3 LEU B 146 61.278 30.586 89.553 1.00 0.00 H ATOM 10407 HG LEU B 146 59.922 32.321 88.253 1.00 0.00 H ATOM 10408 HD21 LEU B 146 58.431 29.903 89.476 1.00 0.00 H ATOM 10409 HD22 LEU B 146 59.111 31.265 90.400 1.00 0.00 H ATOM 10410 HD23 LEU B 146 57.746 31.536 89.288 1.00 0.00 H ATOM 10411 HD11 LEU B 146 59.737 31.095 86.108 1.00 0.00 H ATOM 10412 HD12 LEU B 146 58.795 29.815 86.911 1.00 0.00 H ATOM 10413 HD13 LEU B 146 58.124 31.458 86.769 1.00 0.00 H ATOM 10414 H LEU B 146 61.613 32.934 87.586 1.00 0.00 H ATOM 10415 N SER B 147 61.716 29.028 85.960 1.00 33.96 N ATOM 10416 CA SER B 147 61.459 28.539 84.634 1.00 33.50 C ATOM 10417 C SER B 147 60.336 27.566 84.850 1.00 32.76 C ATOM 10418 O SER B 147 60.021 27.234 85.991 1.00 32.95 O ATOM 10419 CB SER B 147 62.680 27.827 84.024 1.00 34.19 C ATOM 10420 OG SER B 147 63.142 26.805 84.894 1.00 39.58 O ATOM 10421 HA SER B 147 61.225 29.342 83.935 1.00 0.00 H ATOM 10422 HB2 SER B 147 63.478 28.553 83.866 1.00 0.00 H ATOM 10423 HB3 SER B 147 62.398 27.385 83.068 1.00 0.00 H ATOM 10424 HG SER B 147 63.401 27.204 85.762 1.00 0.00 H ATOM 10425 H SER B 147 61.674 28.378 86.771 1.00 0.00 H ATOM 10426 N TYR B 148 59.722 27.124 83.765 1.00 32.97 N ATOM 10427 CA TYR B 148 58.621 26.151 83.825 1.00 33.61 C ATOM 10428 C TYR B 148 58.461 25.535 82.436 1.00 34.09 C ATOM 10429 O TYR B 148 58.831 26.157 81.390 1.00 33.10 O ATOM 10430 CB TYR B 148 57.292 26.805 84.265 1.00 31.00 C ATOM 10431 CG TYR B 148 56.831 27.964 83.396 1.00 32.47 C ATOM 10432 CD1 TYR B 148 57.396 29.247 83.533 1.00 32.66 C ATOM 10433 CD2 TYR B 148 55.819 27.781 82.447 1.00 31.96 C ATOM 10434 CE1 TYR B 148 56.959 30.334 82.737 1.00 31.93 C ATOM 10435 CE2 TYR B 148 55.375 28.861 81.626 1.00 31.31 C ATOM 10436 CZ TYR B 148 55.951 30.130 81.782 1.00 33.77 C ATOM 10437 OH TYR B 148 55.487 31.172 80.988 1.00 31.76 O ATOM 10438 HA TYR B 148 58.862 25.390 84.567 1.00 0.00 H ATOM 10439 HB3 TYR B 148 57.416 27.173 85.283 1.00 0.00 H ATOM 10440 HB2 TYR B 148 56.516 26.040 84.249 1.00 0.00 H ATOM 10441 HD2 TYR B 148 55.362 26.798 82.333 1.00 0.00 H ATOM 10442 HE2 TYR B 148 54.594 28.700 80.883 1.00 0.00 H ATOM 10443 HE1 TYR B 148 57.402 31.322 82.865 1.00 0.00 H ATOM 10444 HD1 TYR B 148 58.186 29.407 84.267 1.00 0.00 H ATOM 10445 HH TYR B 148 55.983 32.000 81.209 1.00 0.00 H ATOM 10446 H TYR B 148 60.029 27.477 82.836 1.00 0.00 H ATOM 10447 N ARG B 149 57.929 24.321 82.417 1.00 32.90 N ATOM 10448 CA ARG B 149 57.731 23.629 81.138 1.00 33.26 C ATOM 10449 C ARG B 149 56.661 24.345 80.313 1.00 32.33 C ATOM 10450 O ARG B 149 55.641 24.775 80.861 1.00 33.24 O ATOM 10451 CB ARG B 149 57.295 22.187 81.393 1.00 30.73 C ATOM 10452 CG ARG B 149 58.474 21.241 81.778 1.00 34.61 C ATOM 10453 CD ARG B 149 57.986 19.861 82.246 1.00 31.47 C ATOM 10454 NE ARG B 149 57.413 19.984 83.595 1.00 32.40 N ATOM 10455 CZ ARG B 149 56.734 19.016 84.187 1.00 32.16 C ATOM 10456 NH1 ARG B 149 56.557 17.867 83.513 1.00 32.39 N ATOM 10457 NH2 ARG B 149 56.273 19.177 85.449 1.00 31.53 N ATOM 10458 HA ARG B 149 58.671 23.633 80.586 1.00 0.00 H ATOM 10459 HB2 ARG B 149 56.570 22.184 82.207 1.00 0.00 H ATOM 10460 HB3 ARG B 149 56.825 21.803 80.488 1.00 0.00 H ATOM 10461 HG2 ARG B 149 59.117 21.109 80.907 1.00 0.00 H ATOM 10462 HG3 ARG B 149 59.045 21.703 82.583 1.00 0.00 H ATOM 10463 HD2 ARG B 149 58.825 19.165 82.268 1.00 0.00 H ATOM 10464 HD3 ARG B 149 57.226 19.490 81.559 1.00 0.00 H ATOM 10465 HE ARG B 149 57.549 20.878 84.109 1.00 0.00 H ATOM 10466 HH12 ARG B 149 56.028 17.085 83.949 1.00 0.00 H ATOM 10467 HH11 ARG B 149 56.949 17.760 82.556 1.00 0.00 H ATOM 10468 HH22 ARG B 149 55.740 18.412 85.909 1.00 0.00 H ATOM 10469 HH21 ARG B 149 56.452 20.066 85.959 1.00 0.00 H ATOM 10470 H ARG B 149 57.652 23.860 83.307 1.00 0.00 H ATOM 10471 N VAL B 150 56.883 24.460 79.007 1.00 31.39 N ATOM 10472 CA VAL B 150 55.913 25.108 78.134 1.00 31.11 C ATOM 10473 C VAL B 150 55.475 24.114 77.048 1.00 32.80 C ATOM 10474 O VAL B 150 56.029 22.969 76.936 1.00 32.66 O ATOM 10475 CB VAL B 150 56.523 26.390 77.448 1.00 31.53 C ATOM 10476 CG1 VAL B 150 56.788 27.485 78.515 1.00 31.43 C ATOM 10477 CG2 VAL B 150 57.811 26.039 76.689 1.00 29.63 C ATOM 10478 HA VAL B 150 55.060 25.418 78.738 1.00 0.00 H ATOM 10479 HB VAL B 150 55.806 26.777 76.724 1.00 0.00 H ATOM 10480 HG11 VAL B 150 55.850 27.750 79.003 1.00 0.00 H ATOM 10481 HG12 VAL B 150 57.490 27.105 79.257 1.00 0.00 H ATOM 10482 HG13 VAL B 150 57.209 28.367 78.032 1.00 0.00 H ATOM 10483 HG21 VAL B 150 58.542 25.630 77.386 1.00 0.00 H ATOM 10484 HG22 VAL B 150 57.588 25.300 75.920 1.00 0.00 H ATOM 10485 HG23 VAL B 150 58.214 26.939 76.224 1.00 0.00 H ATOM 10486 H VAL B 150 57.763 24.081 78.602 1.00 0.00 H ATOM 10487 N GLY B 151 54.492 24.542 76.243 1.00 31.63 N ATOM 10488 CA GLY B 151 53.992 23.703 75.152 1.00 30.98 C ATOM 10489 C GLY B 151 53.363 22.419 75.683 1.00 31.71 C ATOM 10490 O GLY B 151 52.933 22.350 76.830 1.00 32.01 O ATOM 10491 HA3 GLY B 151 54.821 23.446 74.493 1.00 0.00 H ATOM 10492 HA2 GLY B 151 53.242 24.260 74.590 1.00 0.00 H ATOM 10493 H GLY B 151 54.078 25.484 76.396 1.00 0.00 H ATOM 10494 N ALA B 152 53.342 21.383 74.862 1.00 32.97 N ATOM 10495 CA ALA B 152 52.791 20.108 75.280 1.00 33.55 C ATOM 10496 C ALA B 152 53.478 19.607 76.590 1.00 34.76 C ATOM 10497 O ALA B 152 52.801 19.078 77.506 1.00 33.75 O ATOM 10498 CB ALA B 152 52.996 19.071 74.124 1.00 33.78 C ATOM 10499 HA ALA B 152 51.728 20.224 75.490 1.00 0.00 H ATOM 10500 HB1 ALA B 152 52.483 19.421 73.228 1.00 0.00 H ATOM 10501 HB2 ALA B 152 54.061 18.965 73.917 1.00 0.00 H ATOM 10502 HB3 ALA B 152 52.586 18.107 74.425 1.00 0.00 H ATOM 10503 H ALA B 152 53.727 21.484 73.901 1.00 0.00 H ATOM 10504 N PHE B 153 54.807 19.787 76.692 1.00 32.93 N ATOM 10505 CA PHE B 153 55.517 19.334 77.897 1.00 34.27 C ATOM 10506 C PHE B 153 55.009 19.951 79.179 1.00 33.59 C ATOM 10507 O PHE B 153 55.117 19.325 80.248 1.00 31.72 O ATOM 10508 CB PHE B 153 57.023 19.610 77.789 1.00 34.66 C ATOM 10509 CG PHE B 153 57.580 19.241 76.468 1.00 37.20 C ATOM 10510 CD1 PHE B 153 58.135 17.963 76.252 1.00 38.64 C ATOM 10511 CD2 PHE B 153 57.483 20.139 75.396 1.00 35.57 C ATOM 10512 CE1 PHE B 153 58.589 17.579 74.973 1.00 38.92 C ATOM 10513 CE2 PHE B 153 57.922 19.787 74.109 1.00 37.60 C ATOM 10514 CZ PHE B 153 58.479 18.502 73.882 1.00 38.33 C ATOM 10515 HA PHE B 153 55.323 18.262 77.947 1.00 0.00 H ATOM 10516 HB2 PHE B 153 57.195 20.673 77.955 1.00 0.00 H ATOM 10517 HB3 PHE B 153 57.539 19.035 78.558 1.00 0.00 H ATOM 10518 HD2 PHE B 153 57.059 21.129 75.564 1.00 0.00 H ATOM 10519 HE2 PHE B 153 57.835 20.498 73.288 1.00 0.00 H ATOM 10520 HZ PHE B 153 58.820 18.219 72.886 1.00 0.00 H ATOM 10521 HE1 PHE B 153 59.019 16.590 74.816 1.00 0.00 H ATOM 10522 HD1 PHE B 153 58.214 17.263 77.084 1.00 0.00 H ATOM 10523 H PHE B 153 55.331 20.246 75.920 1.00 0.00 H ATOM 10524 N GLY B 154 54.459 21.174 79.096 1.00 33.39 N ATOM 10525 CA GLY B 154 53.963 21.813 80.304 1.00 32.24 C ATOM 10526 C GLY B 154 52.453 21.781 80.457 1.00 32.43 C ATOM 10527 O GLY B 154 51.954 21.818 81.577 1.00 33.09 O ATOM 10528 HA3 GLY B 154 54.283 22.855 80.294 1.00 0.00 H ATOM 10529 HA2 GLY B 154 54.404 21.307 81.163 1.00 0.00 H ATOM 10530 H GLY B 154 54.389 21.658 78.178 1.00 0.00 H ATOM 10531 N PHE B 155 51.722 21.668 79.348 1.00 32.23 N ATOM 10532 CA PHE B 155 50.283 21.783 79.414 1.00 31.43 C ATOM 10533 C PHE B 155 49.381 20.764 78.706 1.00 32.79 C ATOM 10534 O PHE B 155 48.139 20.925 78.643 1.00 32.36 O ATOM 10535 CB PHE B 155 49.957 23.223 78.991 1.00 29.58 C ATOM 10536 CG PHE B 155 50.616 24.269 79.895 1.00 31.05 C ATOM 10537 CD1 PHE B 155 50.057 24.602 81.144 1.00 32.25 C ATOM 10538 CD2 PHE B 155 51.833 24.831 79.555 1.00 32.12 C ATOM 10539 CE1 PHE B 155 50.689 25.479 82.047 1.00 32.47 C ATOM 10540 CE2 PHE B 155 52.501 25.726 80.458 1.00 32.30 C ATOM 10541 CZ PHE B 155 51.931 26.052 81.695 1.00 31.35 C ATOM 10542 HA PHE B 155 50.026 21.528 80.442 1.00 0.00 H ATOM 10543 HB2 PHE B 155 50.307 23.374 77.970 1.00 0.00 H ATOM 10544 HB3 PHE B 155 48.876 23.361 79.028 1.00 0.00 H ATOM 10545 HD2 PHE B 155 52.289 24.593 78.594 1.00 0.00 H ATOM 10546 HE2 PHE B 155 53.462 26.156 80.177 1.00 0.00 H ATOM 10547 HZ PHE B 155 52.438 26.737 82.375 1.00 0.00 H ATOM 10548 HE1 PHE B 155 50.225 25.713 83.005 1.00 0.00 H ATOM 10549 HD1 PHE B 155 49.098 24.164 81.423 1.00 0.00 H ATOM 10550 H PHE B 155 52.188 21.497 78.434 1.00 0.00 H ATOM 10551 N LEU B 156 49.976 19.711 78.186 1.00 33.81 N ATOM 10552 CA LEU B 156 49.168 18.663 77.555 1.00 36.56 C ATOM 10553 C LEU B 156 48.227 18.203 78.692 1.00 36.15 C ATOM 10554 O LEU B 156 48.687 17.861 79.783 1.00 34.77 O ATOM 10555 CB LEU B 156 50.050 17.496 77.123 1.00 38.68 C ATOM 10556 CG LEU B 156 49.255 16.376 76.435 1.00 39.45 C ATOM 10557 CD1 LEU B 156 49.446 16.460 74.935 1.00 38.65 C ATOM 10558 CD2 LEU B 156 49.739 15.019 76.960 1.00 38.38 C ATOM 10559 HA LEU B 156 48.644 19.013 76.666 1.00 0.00 H ATOM 10560 HB2 LEU B 156 50.804 17.867 76.428 1.00 0.00 H ATOM 10561 HB3 LEU B 156 50.541 17.085 78.005 1.00 0.00 H ATOM 10562 HG LEU B 156 48.194 16.487 76.657 1.00 0.00 H ATOM 10563 HD21 LEU B 156 50.800 14.903 76.740 1.00 0.00 H ATOM 10564 HD22 LEU B 156 49.582 14.971 78.038 1.00 0.00 H ATOM 10565 HD23 LEU B 156 49.177 14.221 76.474 1.00 0.00 H ATOM 10566 HD11 LEU B 156 49.091 17.427 74.578 1.00 0.00 H ATOM 10567 HD12 LEU B 156 50.504 16.350 74.698 1.00 0.00 H ATOM 10568 HD13 LEU B 156 48.880 15.663 74.453 1.00 0.00 H ATOM 10569 H LEU B 156 51.012 19.623 78.223 1.00 0.00 H ATOM 10570 N ALA B 157 46.923 18.223 78.452 1.00 36.04 N ATOM 10571 CA ALA B 157 45.985 17.851 79.500 1.00 36.72 C ATOM 10572 C ALA B 157 44.963 16.733 79.145 1.00 39.57 C ATOM 10573 O ALA B 157 44.089 16.928 78.271 1.00 38.99 O ATOM 10574 CB ALA B 157 45.229 19.085 79.953 1.00 31.42 C ATOM 10575 HA ALA B 157 46.605 17.425 80.289 1.00 0.00 H ATOM 10576 HB1 ALA B 157 45.935 19.821 80.337 1.00 0.00 H ATOM 10577 HB2 ALA B 157 44.686 19.507 79.108 1.00 0.00 H ATOM 10578 HB3 ALA B 157 44.525 18.810 80.738 1.00 0.00 H ATOM 10579 H ALA B 157 46.571 18.505 77.515 1.00 0.00 H ATOM 10580 N LEU B 158 45.073 15.585 79.829 1.00 40.11 N ATOM 10581 CA LEU B 158 44.131 14.479 79.645 1.00 41.77 C ATOM 10582 C LEU B 158 43.506 14.361 81.013 1.00 42.95 C ATOM 10583 O LEU B 158 43.898 13.536 81.840 1.00 43.93 O ATOM 10584 CB LEU B 158 44.867 13.199 79.228 1.00 42.22 C ATOM 10585 CG LEU B 158 45.279 13.277 77.726 1.00 42.83 C ATOM 10586 CD1 LEU B 158 46.364 12.256 77.411 1.00 39.96 C ATOM 10587 CD2 LEU B 158 44.042 13.111 76.812 1.00 41.67 C ATOM 10588 HA LEU B 158 43.396 14.642 78.856 1.00 0.00 H ATOM 10589 HB2 LEU B 158 45.761 13.082 79.841 1.00 0.00 H ATOM 10590 HB3 LEU B 158 44.211 12.342 79.377 1.00 0.00 H ATOM 10591 HG LEU B 158 45.698 14.264 77.529 1.00 0.00 H ATOM 10592 HD21 LEU B 158 43.579 12.143 77.002 1.00 0.00 H ATOM 10593 HD22 LEU B 158 43.326 13.905 77.024 1.00 0.00 H ATOM 10594 HD23 LEU B 158 44.352 13.169 75.769 1.00 0.00 H ATOM 10595 HD11 LEU B 158 47.240 12.457 78.028 1.00 0.00 H ATOM 10596 HD12 LEU B 158 45.991 11.254 77.623 1.00 0.00 H ATOM 10597 HD13 LEU B 158 46.635 12.329 76.358 1.00 0.00 H ATOM 10598 H LEU B 158 45.851 15.477 80.511 1.00 0.00 H ATOM 10599 N HIS B 159 42.562 15.243 81.287 1.00 43.72 N ATOM 10600 CA HIS B 159 41.899 15.248 82.591 1.00 46.91 C ATOM 10601 C HIS B 159 41.339 13.893 83.020 1.00 48.09 C ATOM 10602 O HIS B 159 40.626 13.233 82.260 1.00 48.13 O ATOM 10603 CB HIS B 159 40.762 16.257 82.617 1.00 45.08 C ATOM 10604 CG HIS B 159 40.200 16.470 83.977 1.00 45.85 C ATOM 10605 ND1 HIS B 159 40.938 17.027 85.005 1.00 46.56 N ATOM 10606 CD2 HIS B 159 38.954 16.256 84.474 1.00 44.64 C ATOM 10607 CE1 HIS B 159 40.166 17.155 86.071 1.00 45.22 C ATOM 10608 NE2 HIS B 159 38.957 16.694 85.776 1.00 43.97 N ATOM 10609 HA HIS B 159 42.685 15.518 83.296 1.00 0.00 H ATOM 10610 HB2 HIS B 159 41.135 17.210 82.243 1.00 0.00 H ATOM 10611 HB3 HIS B 159 39.966 15.899 81.965 1.00 0.00 H ATOM 10612 HD2 HIS B 159 38.110 15.819 83.940 1.00 0.00 H ATOM 10613 HE1 HIS B 159 40.472 17.570 87.032 1.00 0.00 H ATOM 10614 H HIS B 159 42.287 15.942 80.568 1.00 0.00 H ATOM 10615 N GLY B 160 41.638 13.515 84.262 1.00 49.77 N ATOM 10616 CA GLY B 160 41.196 12.234 84.783 1.00 49.85 C ATOM 10617 C GLY B 160 42.415 11.340 84.888 1.00 50.77 C ATOM 10618 O GLY B 160 42.450 10.423 85.697 1.00 50.91 O ATOM 10619 HA3 GLY B 160 40.465 11.789 84.108 1.00 0.00 H ATOM 10620 HA2 GLY B 160 40.746 12.367 85.767 1.00 0.00 H ATOM 10621 H GLY B 160 42.197 14.148 84.868 1.00 0.00 H ATOM 10622 N SER B 161 43.430 11.609 84.069 1.00 50.32 N ATOM 10623 CA SER B 161 44.651 10.827 84.100 1.00 50.60 C ATOM 10624 C SER B 161 45.635 11.446 85.099 1.00 51.11 C ATOM 10625 O SER B 161 45.681 12.678 85.260 1.00 51.78 O ATOM 10626 CB SER B 161 45.268 10.808 82.710 1.00 51.79 C ATOM 10627 OG SER B 161 46.678 10.718 82.807 1.00 55.93 O ATOM 10628 HA SER B 161 44.425 9.807 84.411 1.00 0.00 H ATOM 10629 HB2 SER B 161 45.000 11.724 82.183 1.00 0.00 H ATOM 10630 HB3 SER B 161 44.888 9.948 82.158 1.00 0.00 H ATOM 10631 HG SER B 161 47.070 10.706 81.898 1.00 0.00 H ATOM 10632 H SER B 161 43.345 12.395 83.394 1.00 0.00 H ATOM 10633 N GLN B 162 46.410 10.622 85.793 1.00 50.41 N ATOM 10634 CA GLN B 162 47.374 11.186 86.724 1.00 50.72 C ATOM 10635 C GLN B 162 48.725 11.302 86.033 1.00 49.93 C ATOM 10636 O GLN B 162 49.666 11.906 86.574 1.00 50.59 O ATOM 10637 CB GLN B 162 47.519 10.336 87.984 1.00 53.53 C ATOM 10638 CG GLN B 162 46.384 10.480 89.017 1.00 57.54 C ATOM 10639 CD GLN B 162 45.936 11.932 89.245 1.00 59.71 C ATOM 10640 OE1 GLN B 162 46.764 12.857 89.391 1.00 60.65 O ATOM 10641 NE2 GLN B 162 44.608 12.136 89.284 1.00 60.19 N ATOM 10642 HA GLN B 162 47.012 12.168 87.028 1.00 0.00 H ATOM 10643 HB2 GLN B 162 47.566 9.290 87.680 1.00 0.00 H ATOM 10644 HB3 GLN B 162 48.454 10.614 88.471 1.00 0.00 H ATOM 10645 HG2 GLN B 162 45.526 9.906 88.668 1.00 0.00 H ATOM 10646 HG3 GLN B 162 46.730 10.073 89.967 1.00 0.00 H ATOM 10647 HE22 GLN B 162 43.955 11.336 89.158 1.00 0.00 H ATOM 10648 HE21 GLN B 162 44.233 13.093 89.441 1.00 0.00 H ATOM 10649 H GLN B 162 46.329 9.592 85.673 1.00 0.00 H ATOM 10650 N GLU B 163 48.824 10.736 84.834 1.00 48.10 N ATOM 10651 CA GLU B 163 50.060 10.792 84.091 1.00 47.83 C ATOM 10652 C GLU B 163 50.242 12.115 83.306 1.00 46.93 C ATOM 10653 O GLU B 163 51.372 12.589 83.177 1.00 46.78 O ATOM 10654 CB GLU B 163 50.174 9.572 83.154 1.00 50.65 C ATOM 10655 CG GLU B 163 50.299 8.230 83.881 1.00 53.38 C ATOM 10656 CD GLU B 163 51.475 8.190 84.858 1.00 55.79 C ATOM 10657 OE1 GLU B 163 51.303 7.613 85.960 1.00 58.82 O ATOM 10658 OE2 GLU B 163 52.569 8.723 84.550 1.00 55.78 O ATOM 10659 HA GLU B 163 50.869 10.762 84.820 1.00 0.00 H ATOM 10660 HB2 GLU B 163 49.284 9.539 82.526 1.00 0.00 H ATOM 10661 HB3 GLU B 163 51.055 9.704 82.526 1.00 0.00 H ATOM 10662 HG2 GLU B 163 49.379 8.048 84.436 1.00 0.00 H ATOM 10663 HG3 GLU B 163 50.436 7.443 83.139 1.00 0.00 H ATOM 10664 H GLU B 163 48.001 10.247 84.427 1.00 0.00 H ATOM 10665 N ALA B 164 49.158 12.703 82.785 1.00 43.58 N ATOM 10666 CA ALA B 164 49.240 13.984 82.045 1.00 41.82 C ATOM 10667 C ALA B 164 47.973 14.735 82.448 1.00 40.29 C ATOM 10668 O ALA B 164 47.035 14.894 81.668 1.00 39.88 O ATOM 10669 CB ALA B 164 49.271 13.732 80.521 1.00 39.37 C ATOM 10670 HA ALA B 164 50.145 14.545 82.278 1.00 0.00 H ATOM 10671 HB1 ALA B 164 50.141 13.124 80.272 1.00 0.00 H ATOM 10672 HB2 ALA B 164 48.363 13.209 80.222 1.00 0.00 H ATOM 10673 HB3 ALA B 164 49.331 14.686 79.997 1.00 0.00 H ATOM 10674 H ALA B 164 48.231 12.247 82.903 1.00 0.00 H ATOM 10675 N PRO B 165 47.940 15.204 83.689 1.00 39.35 N ATOM 10676 CA PRO B 165 46.764 15.912 84.198 1.00 38.36 C ATOM 10677 C PRO B 165 46.546 17.328 83.715 1.00 38.56 C ATOM 10678 O PRO B 165 45.438 17.855 83.839 1.00 38.40 O ATOM 10679 CB PRO B 165 46.956 15.846 85.700 1.00 37.79 C ATOM 10680 CG PRO B 165 48.527 15.989 85.848 1.00 38.65 C ATOM 10681 CD PRO B 165 49.064 15.183 84.655 1.00 38.52 C ATOM 10682 HA PRO B 165 45.856 15.439 83.824 1.00 0.00 H ATOM 10683 HD3 PRO B 165 49.950 15.656 84.232 1.00 0.00 H ATOM 10684 HD2 PRO B 165 49.305 14.162 84.951 1.00 0.00 H ATOM 10685 HG3 PRO B 165 48.871 15.567 86.792 1.00 0.00 H ATOM 10686 HG2 PRO B 165 48.833 17.033 85.785 1.00 0.00 H ATOM 10687 HB2 PRO B 165 46.436 16.663 86.201 1.00 0.00 H ATOM 10688 HB3 PRO B 165 46.607 14.895 86.101 1.00 0.00 H ATOM 10689 N GLY B 166 47.587 17.932 83.142 1.00 37.61 N ATOM 10690 CA GLY B 166 47.483 19.322 82.723 1.00 35.12 C ATOM 10691 C GLY B 166 48.027 20.245 83.834 1.00 35.81 C ATOM 10692 O GLY B 166 48.283 19.803 84.979 1.00 33.48 O ATOM 10693 HA3 GLY B 166 46.438 19.565 82.530 1.00 0.00 H ATOM 10694 HA2 GLY B 166 48.064 19.470 81.812 1.00 0.00 H ATOM 10695 H GLY B 166 48.474 17.410 82.994 1.00 0.00 H ATOM 10696 N ASN B 167 48.278 21.505 83.463 1.00 33.97 N ATOM 10697 CA ASN B 167 48.754 22.525 84.366 1.00 33.63 C ATOM 10698 C ASN B 167 50.136 22.257 84.997 1.00 32.91 C ATOM 10699 O ASN B 167 50.537 22.995 85.906 1.00 32.21 O ATOM 10700 CB ASN B 167 47.697 22.741 85.490 1.00 33.39 C ATOM 10701 CG ASN B 167 46.399 23.381 84.941 1.00 35.31 C ATOM 10702 OD1 ASN B 167 46.435 24.064 83.911 1.00 33.88 O ATOM 10703 ND2 ASN B 167 45.264 23.151 85.616 1.00 30.71 N ATOM 10704 HA ASN B 167 48.890 23.419 83.758 1.00 0.00 H ATOM 10705 HB2 ASN B 167 47.454 21.777 85.937 1.00 0.00 H ATOM 10706 HB3 ASN B 167 48.120 23.397 86.251 1.00 0.00 H ATOM 10707 HD22 ASN B 167 45.281 22.570 86.478 1.00 0.00 H ATOM 10708 HD21 ASN B 167 44.367 23.554 85.277 1.00 0.00 H ATOM 10709 H ASN B 167 48.121 21.764 82.468 1.00 0.00 H ATOM 10710 N VAL B 168 50.861 21.250 84.521 1.00 32.85 N ATOM 10711 CA VAL B 168 52.150 20.925 85.198 1.00 33.92 C ATOM 10712 C VAL B 168 53.197 22.047 85.125 1.00 32.86 C ATOM 10713 O VAL B 168 54.008 22.192 86.057 1.00 33.71 O ATOM 10714 CB VAL B 168 52.731 19.493 84.758 1.00 33.65 C ATOM 10715 CG1 VAL B 168 51.626 18.420 84.984 1.00 31.98 C ATOM 10716 CG2 VAL B 168 53.232 19.475 83.316 1.00 31.17 C ATOM 10717 HA VAL B 168 51.905 20.847 86.257 1.00 0.00 H ATOM 10718 HB VAL B 168 53.602 19.270 85.374 1.00 0.00 H ATOM 10719 HG11 VAL B 168 51.349 18.402 86.038 1.00 0.00 H ATOM 10720 HG12 VAL B 168 50.752 18.668 84.382 1.00 0.00 H ATOM 10721 HG13 VAL B 168 52.006 17.442 84.690 1.00 0.00 H ATOM 10722 HG21 VAL B 168 52.410 19.722 82.644 1.00 0.00 H ATOM 10723 HG22 VAL B 168 54.030 20.208 83.201 1.00 0.00 H ATOM 10724 HG23 VAL B 168 53.612 18.482 83.077 1.00 0.00 H ATOM 10725 H VAL B 168 50.538 20.703 83.698 1.00 0.00 H ATOM 10726 N GLY B 169 53.120 22.867 84.063 1.00 33.46 N ATOM 10727 CA GLY B 169 53.990 24.037 83.937 1.00 31.61 C ATOM 10728 C GLY B 169 53.685 25.044 85.062 1.00 31.44 C ATOM 10729 O GLY B 169 54.586 25.705 85.579 1.00 30.16 O ATOM 10730 HA3 GLY B 169 53.819 24.512 82.971 1.00 0.00 H ATOM 10731 HA2 GLY B 169 55.031 23.722 84.006 1.00 0.00 H ATOM 10732 H GLY B 169 52.427 22.666 83.314 1.00 0.00 H ATOM 10733 N LEU B 170 52.411 25.191 85.427 1.00 30.78 N ATOM 10734 CA LEU B 170 52.017 26.090 86.522 1.00 31.35 C ATOM 10735 C LEU B 170 52.534 25.467 87.832 1.00 31.89 C ATOM 10736 O LEU B 170 52.974 26.201 88.733 1.00 31.60 O ATOM 10737 CB LEU B 170 50.486 26.240 86.614 1.00 28.94 C ATOM 10738 CG LEU B 170 49.876 27.135 85.508 1.00 30.48 C ATOM 10739 CD1 LEU B 170 48.370 27.019 85.493 1.00 26.65 C ATOM 10740 CD2 LEU B 170 50.278 28.568 85.737 1.00 28.86 C ATOM 10741 HA LEU B 170 52.437 27.080 86.343 1.00 0.00 H ATOM 10742 HB2 LEU B 170 50.039 25.249 86.539 1.00 0.00 H ATOM 10743 HB3 LEU B 170 50.241 26.676 87.583 1.00 0.00 H ATOM 10744 HG LEU B 170 50.255 26.801 84.542 1.00 0.00 H ATOM 10745 HD21 LEU B 170 49.913 28.895 86.710 1.00 0.00 H ATOM 10746 HD22 LEU B 170 51.365 28.648 85.710 1.00 0.00 H ATOM 10747 HD23 LEU B 170 49.846 29.194 84.956 1.00 0.00 H ATOM 10748 HD11 LEU B 170 48.089 25.983 85.302 1.00 0.00 H ATOM 10749 HD12 LEU B 170 47.973 27.333 86.458 1.00 0.00 H ATOM 10750 HD13 LEU B 170 47.966 27.657 84.707 1.00 0.00 H ATOM 10751 H LEU B 170 51.676 24.655 84.923 1.00 0.00 H ATOM 10752 N LEU B 171 52.483 24.133 87.938 1.00 31.58 N ATOM 10753 CA LEU B 171 53.002 23.467 89.154 1.00 33.43 C ATOM 10754 C LEU B 171 54.537 23.652 89.211 1.00 33.09 C ATOM 10755 O LEU B 171 55.121 23.742 90.308 1.00 32.24 O ATOM 10756 CB LEU B 171 52.604 21.963 89.186 1.00 33.85 C ATOM 10757 CG LEU B 171 51.066 21.785 89.404 1.00 35.42 C ATOM 10758 CD1 LEU B 171 50.732 20.260 89.302 1.00 34.99 C ATOM 10759 CD2 LEU B 171 50.605 22.364 90.771 1.00 30.89 C ATOM 10760 HA LEU B 171 52.556 23.926 90.037 1.00 0.00 H ATOM 10761 HB2 LEU B 171 52.884 21.501 88.239 1.00 0.00 H ATOM 10762 HB3 LEU B 171 53.137 21.472 90.000 1.00 0.00 H ATOM 10763 HG LEU B 171 50.527 22.341 88.636 1.00 0.00 H ATOM 10764 HD21 LEU B 171 51.127 21.849 91.577 1.00 0.00 H ATOM 10765 HD22 LEU B 171 50.835 23.429 90.809 1.00 0.00 H ATOM 10766 HD23 LEU B 171 49.530 22.219 90.882 1.00 0.00 H ATOM 10767 HD11 LEU B 171 51.017 19.892 88.316 1.00 0.00 H ATOM 10768 HD12 LEU B 171 51.285 19.716 90.068 1.00 0.00 H ATOM 10769 HD13 LEU B 171 49.662 20.113 89.451 1.00 0.00 H ATOM 10770 H LEU B 171 52.079 23.565 87.166 1.00 0.00 H ATOM 10771 N ASP B 172 55.197 23.717 88.040 1.00 33.96 N ATOM 10772 CA ASP B 172 56.648 23.981 88.037 1.00 33.01 C ATOM 10773 C ASP B 172 56.859 25.375 88.668 1.00 32.59 C ATOM 10774 O ASP B 172 57.687 25.573 89.529 1.00 32.00 O ATOM 10775 CB ASP B 172 57.206 24.026 86.607 1.00 33.64 C ATOM 10776 CG ASP B 172 57.176 22.680 85.908 1.00 34.47 C ATOM 10777 OD1 ASP B 172 57.010 21.634 86.583 1.00 34.23 O ATOM 10778 OD2 ASP B 172 57.338 22.666 84.661 1.00 35.41 O ATOM 10779 HA ASP B 172 57.157 23.188 88.585 1.00 0.00 H ATOM 10780 HB2 ASP B 172 56.612 24.731 86.026 1.00 0.00 H ATOM 10781 HB3 ASP B 172 58.239 24.371 86.649 1.00 0.00 H ATOM 10782 H ASP B 172 54.687 23.582 87.143 1.00 0.00 H ATOM 10783 N GLN B 173 56.078 26.356 88.238 1.00 32.05 N ATOM 10784 CA GLN B 173 56.245 27.698 88.784 1.00 30.88 C ATOM 10785 C GLN B 173 56.018 27.668 90.268 1.00 30.85 C ATOM 10786 O GLN B 173 56.766 28.294 91.035 1.00 31.31 O ATOM 10787 CB GLN B 173 55.261 28.689 88.141 1.00 27.65 C ATOM 10788 CG GLN B 173 55.374 28.808 86.618 1.00 27.05 C ATOM 10789 CD GLN B 173 54.262 29.699 86.024 1.00 30.91 C ATOM 10790 OE1 GLN B 173 53.493 30.343 86.770 1.00 28.98 O ATOM 10791 NE2 GLN B 173 54.166 29.734 84.666 1.00 29.23 N ATOM 10792 HA GLN B 173 57.260 28.029 88.565 1.00 0.00 H ATOM 10793 HB2 GLN B 173 54.248 28.367 88.382 1.00 0.00 H ATOM 10794 HB3 GLN B 173 55.440 29.674 88.573 1.00 0.00 H ATOM 10795 HG2 GLN B 173 56.343 29.241 86.369 1.00 0.00 H ATOM 10796 HG3 GLN B 173 55.299 27.813 86.180 1.00 0.00 H ATOM 10797 HE22 GLN B 173 54.827 29.182 84.084 1.00 0.00 H ATOM 10798 HE21 GLN B 173 53.431 30.313 84.211 1.00 0.00 H ATOM 10799 H GLN B 173 55.352 26.170 87.517 1.00 0.00 H ATOM 10800 N ARG B 174 54.988 26.925 90.688 1.00 30.39 N ATOM 10801 CA ARG B 174 54.674 26.894 92.114 1.00 31.20 C ATOM 10802 C ARG B 174 55.819 26.260 92.892 1.00 30.29 C ATOM 10803 O ARG B 174 56.153 26.713 93.979 1.00 31.12 O ATOM 10804 CB ARG B 174 53.339 26.135 92.381 1.00 30.36 C ATOM 10805 CG ARG B 174 53.038 25.950 93.876 1.00 34.38 C ATOM 10806 CD ARG B 174 51.827 24.999 94.119 1.00 32.54 C ATOM 10807 NE ARG B 174 50.597 25.554 93.576 1.00 32.55 N ATOM 10808 CZ ARG B 174 49.445 24.889 93.493 1.00 34.10 C ATOM 10809 NH1 ARG B 174 49.340 23.620 93.900 1.00 34.15 N ATOM 10810 NH2 ARG B 174 48.353 25.524 93.090 1.00 33.80 N ATOM 10811 HA ARG B 174 54.545 27.921 92.456 1.00 0.00 H ATOM 10812 HB2 ARG B 174 52.523 26.699 91.930 1.00 0.00 H ATOM 10813 HB3 ARG B 174 53.400 25.151 91.915 1.00 0.00 H ATOM 10814 HG2 ARG B 174 53.918 25.529 94.362 1.00 0.00 H ATOM 10815 HG3 ARG B 174 52.814 26.923 94.312 1.00 0.00 H ATOM 10816 HD2 ARG B 174 51.705 24.848 95.191 1.00 0.00 H ATOM 10817 HD3 ARG B 174 52.026 24.041 93.639 1.00 0.00 H ATOM 10818 HE ARG B 174 50.618 26.534 93.230 1.00 0.00 H ATOM 10819 HH12 ARG B 174 48.429 23.123 93.824 1.00 0.00 H ATOM 10820 HH11 ARG B 174 50.169 23.129 94.292 1.00 0.00 H ATOM 10821 HH22 ARG B 174 47.450 25.013 93.022 1.00 0.00 H ATOM 10822 HH21 ARG B 174 48.400 26.533 92.842 1.00 0.00 H ATOM 10823 H ARG B 174 54.420 26.378 90.010 1.00 0.00 H ATOM 10824 N MET B 175 56.405 25.202 92.340 1.00 31.73 N ATOM 10825 CA MET B 175 57.522 24.534 93.032 1.00 33.31 C ATOM 10826 C MET B 175 58.700 25.479 93.227 1.00 34.38 C ATOM 10827 O MET B 175 59.349 25.448 94.271 1.00 33.87 O ATOM 10828 CB MET B 175 58.007 23.333 92.249 1.00 33.69 C ATOM 10829 CG MET B 175 58.996 22.468 93.101 1.00 38.72 C ATOM 10830 SD MET B 175 58.592 20.700 92.877 1.00 45.55 S ATOM 10831 CE MET B 175 59.636 20.468 92.006 1.00 37.27 C ATOM 10832 HA MET B 175 57.142 24.217 94.003 1.00 0.00 H ATOM 10833 HB2 MET B 175 57.150 22.721 91.967 1.00 0.00 H ATOM 10834 HB3 MET B 175 58.518 23.676 91.349 1.00 0.00 H ATOM 10835 HG2 MET B 175 58.900 22.734 94.154 1.00 0.00 H ATOM 10836 HG3 MET B 175 60.019 22.653 92.773 1.00 0.00 H ATOM 10837 HE1 MET B 175 59.525 21.107 91.130 1.00 0.00 H ATOM 10838 HE2 MET B 175 60.579 20.692 92.504 1.00 0.00 H ATOM 10839 HE3 MET B 175 59.625 19.422 91.698 1.00 0.00 H ATOM 10840 H MET B 175 56.075 24.846 91.420 1.00 0.00 H ATOM 10841 N ALA B 176 58.980 26.308 92.218 1.00 32.52 N ATOM 10842 CA ALA B 176 60.071 27.263 92.329 1.00 34.06 C ATOM 10843 C ALA B 176 59.678 28.309 93.407 1.00 33.86 C ATOM 10844 O ALA B 176 60.523 28.786 94.179 1.00 32.90 O ATOM 10845 CB ALA B 176 60.318 27.948 90.952 1.00 32.04 C ATOM 10846 HA ALA B 176 60.995 26.763 92.620 1.00 0.00 H ATOM 10847 HB1 ALA B 176 60.576 27.191 90.212 1.00 0.00 H ATOM 10848 HB2 ALA B 176 59.413 28.469 90.640 1.00 0.00 H ATOM 10849 HB3 ALA B 176 61.137 28.662 91.044 1.00 0.00 H ATOM 10850 H ALA B 176 58.414 26.270 91.347 1.00 0.00 H ATOM 10851 N LEU B 177 58.386 28.658 93.464 1.00 33.86 N ATOM 10852 CA LEU B 177 57.946 29.637 94.455 1.00 33.97 C ATOM 10853 C LEU B 177 58.069 29.027 95.863 1.00 32.85 C ATOM 10854 O LEU B 177 58.341 29.732 96.817 1.00 32.29 O ATOM 10855 CB LEU B 177 56.494 30.124 94.185 1.00 33.55 C ATOM 10856 CG LEU B 177 56.249 30.970 92.922 1.00 37.15 C ATOM 10857 CD1 LEU B 177 54.738 31.318 92.847 1.00 35.72 C ATOM 10858 CD2 LEU B 177 57.131 32.302 92.944 1.00 35.25 C ATOM 10859 HA LEU B 177 58.589 30.514 94.382 1.00 0.00 H ATOM 10860 HB2 LEU B 177 55.861 29.239 94.113 1.00 0.00 H ATOM 10861 HB3 LEU B 177 56.185 30.721 95.043 1.00 0.00 H ATOM 10862 HG LEU B 177 56.543 30.400 92.041 1.00 0.00 H ATOM 10863 HD21 LEU B 177 56.868 32.896 93.819 1.00 0.00 H ATOM 10864 HD22 LEU B 177 58.187 32.036 92.988 1.00 0.00 H ATOM 10865 HD23 LEU B 177 56.937 32.879 92.040 1.00 0.00 H ATOM 10866 HD11 LEU B 177 54.156 30.397 92.797 1.00 0.00 H ATOM 10867 HD12 LEU B 177 54.452 31.882 93.735 1.00 0.00 H ATOM 10868 HD13 LEU B 177 54.548 31.918 91.957 1.00 0.00 H ATOM 10869 H LEU B 177 57.700 28.235 92.807 1.00 0.00 H ATOM 10870 N GLN B 178 57.857 27.718 95.973 1.00 33.45 N ATOM 10871 CA GLN B 178 57.972 27.015 97.265 1.00 34.51 C ATOM 10872 C GLN B 178 59.442 27.023 97.671 1.00 33.49 C ATOM 10873 O GLN B 178 59.772 27.288 98.823 1.00 34.62 O ATOM 10874 CB GLN B 178 57.483 25.554 97.143 1.00 34.95 C ATOM 10875 CG GLN B 178 57.491 24.762 98.479 1.00 36.72 C ATOM 10876 CD GLN B 178 56.509 25.331 99.489 1.00 36.96 C ATOM 10877 OE1 GLN B 178 55.304 25.277 99.277 1.00 39.59 O ATOM 10878 NE2 GLN B 178 57.024 25.906 100.581 1.00 37.18 N ATOM 10879 HA GLN B 178 57.355 27.517 98.010 1.00 0.00 H ATOM 10880 HB2 GLN B 178 56.463 25.566 96.760 1.00 0.00 H ATOM 10881 HB3 GLN B 178 58.130 25.036 96.435 1.00 0.00 H ATOM 10882 HG2 GLN B 178 57.224 23.725 98.275 1.00 0.00 H ATOM 10883 HG3 GLN B 178 58.494 24.800 98.904 1.00 0.00 H ATOM 10884 HE22 GLN B 178 58.054 25.929 100.720 1.00 0.00 H ATOM 10885 HE21 GLN B 178 56.394 26.330 101.291 1.00 0.00 H ATOM 10886 H GLN B 178 57.603 27.175 95.123 1.00 0.00 H ATOM 10887 N TRP B 179 60.317 26.820 96.696 1.00 32.94 N ATOM 10888 CA TRP B 179 61.757 26.796 96.959 1.00 34.24 C ATOM 10889 C TRP B 179 62.228 28.172 97.429 1.00 35.67 C ATOM 10890 O TRP B 179 63.030 28.275 98.379 1.00 36.50 O ATOM 10891 CB TRP B 179 62.518 26.391 95.701 1.00 32.58 C ATOM 10892 CG TRP B 179 63.925 25.968 95.967 1.00 34.07 C ATOM 10893 CD1 TRP B 179 64.396 24.687 96.195 1.00 34.27 C ATOM 10894 CD2 TRP B 179 65.069 26.841 96.068 1.00 33.65 C ATOM 10895 NE1 TRP B 179 65.763 24.727 96.434 1.00 33.05 N ATOM 10896 CE2 TRP B 179 66.192 26.033 96.357 1.00 32.98 C ATOM 10897 CE3 TRP B 179 65.241 28.220 95.949 1.00 32.22 C ATOM 10898 CZ2 TRP B 179 67.462 26.567 96.528 1.00 32.37 C ATOM 10899 CZ3 TRP B 179 66.511 28.749 96.117 1.00 34.31 C ATOM 10900 CH2 TRP B 179 67.604 27.929 96.404 1.00 33.42 C ATOM 10901 HA TRP B 179 61.955 26.064 97.742 1.00 0.00 H ATOM 10902 HB2 TRP B 179 61.991 25.561 95.231 1.00 0.00 H ATOM 10903 HB3 TRP B 179 62.536 27.241 95.019 1.00 0.00 H ATOM 10904 HE1 TRP B 179 66.365 23.904 96.638 1.00 0.00 H ATOM 10905 HD1 TRP B 179 63.786 23.784 96.188 1.00 0.00 H ATOM 10906 HZ2 TRP B 179 68.317 25.929 96.753 1.00 0.00 H ATOM 10907 HH2 TRP B 179 68.589 28.377 96.532 1.00 0.00 H ATOM 10908 HZ3 TRP B 179 66.659 29.825 96.023 1.00 0.00 H ATOM 10909 HE3 TRP B 179 64.393 28.869 95.728 1.00 0.00 H ATOM 10910 H TRP B 179 59.974 26.675 95.725 1.00 0.00 H ATOM 10911 N VAL B 180 61.729 29.228 96.788 1.00 35.74 N ATOM 10912 CA VAL B 180 62.093 30.599 97.186 1.00 35.06 C ATOM 10913 C VAL B 180 61.557 30.829 98.620 1.00 36.99 C ATOM 10914 O VAL B 180 62.255 31.358 99.487 1.00 37.46 O ATOM 10915 CB VAL B 180 61.442 31.607 96.191 1.00 34.73 C ATOM 10916 CG1 VAL B 180 61.403 33.019 96.733 1.00 33.77 C ATOM 10917 CG2 VAL B 180 62.172 31.536 94.856 1.00 33.45 C ATOM 10918 HA VAL B 180 63.173 30.744 97.167 1.00 0.00 H ATOM 10919 HB VAL B 180 60.400 31.320 96.047 1.00 0.00 H ATOM 10920 HG11 VAL B 180 60.822 33.037 97.655 1.00 0.00 H ATOM 10921 HG12 VAL B 180 62.419 33.357 96.935 1.00 0.00 H ATOM 10922 HG13 VAL B 180 60.939 33.676 95.998 1.00 0.00 H ATOM 10923 HG21 VAL B 180 63.221 31.792 95.003 1.00 0.00 H ATOM 10924 HG22 VAL B 180 62.096 30.525 94.455 1.00 0.00 H ATOM 10925 HG23 VAL B 180 61.719 32.240 94.158 1.00 0.00 H ATOM 10926 H VAL B 180 61.073 29.082 95.995 1.00 0.00 H ATOM 10927 N HIS B 181 60.309 30.430 98.871 1.00 36.24 N ATOM 10928 CA HIS B 181 59.733 30.599 100.201 1.00 35.85 C ATOM 10929 C HIS B 181 60.607 29.916 101.262 1.00 35.87 C ATOM 10930 O HIS B 181 60.896 30.495 102.286 1.00 34.92 O ATOM 10931 CB HIS B 181 58.339 29.997 100.234 1.00 37.85 C ATOM 10932 CG HIS B 181 57.636 30.194 101.538 1.00 42.62 C ATOM 10933 ND1 HIS B 181 56.977 31.362 101.859 1.00 44.44 N ATOM 10934 CD2 HIS B 181 57.502 29.375 102.610 1.00 41.86 C ATOM 10935 CE1 HIS B 181 56.458 31.252 103.069 1.00 44.99 C ATOM 10936 NE2 HIS B 181 56.764 30.057 103.543 1.00 46.12 N ATOM 10937 HA HIS B 181 59.681 31.665 100.422 1.00 0.00 H ATOM 10938 HB2 HIS B 181 57.744 30.461 99.447 1.00 0.00 H ATOM 10939 HB3 HIS B 181 58.420 28.927 100.044 1.00 0.00 H ATOM 10940 HD2 HIS B 181 57.904 28.367 102.711 1.00 0.00 H ATOM 10941 HE1 HIS B 181 55.877 32.015 103.587 1.00 0.00 H ATOM 10942 H HIS B 181 59.743 29.996 98.114 1.00 0.00 H ATOM 10943 N ASP B 182 61.030 28.689 100.989 1.00 35.16 N ATOM 10944 CA ASP B 182 61.838 27.928 101.908 1.00 36.60 C ATOM 10945 C ASP B 182 63.337 28.321 102.017 1.00 37.29 C ATOM 10946 O ASP B 182 63.924 28.096 103.060 1.00 39.56 O ATOM 10947 CB ASP B 182 61.844 26.441 101.536 1.00 35.26 C ATOM 10948 CG ASP B 182 60.466 25.808 101.529 1.00 35.79 C ATOM 10949 OD1 ASP B 182 59.495 26.314 102.126 1.00 38.56 O ATOM 10950 OD2 ASP B 182 60.359 24.770 100.899 1.00 39.78 O ATOM 10951 HA ASP B 182 61.358 28.150 102.861 1.00 0.00 H ATOM 10952 HB2 ASP B 182 62.276 26.337 100.541 1.00 0.00 H ATOM 10953 HB3 ASP B 182 62.464 25.908 102.257 1.00 0.00 H ATOM 10954 H ASP B 182 60.769 28.260 100.078 1.00 0.00 H ATOM 10955 N ASN B 183 63.925 28.911 100.985 1.00 35.42 N ATOM 10956 CA ASN B 183 65.361 29.162 100.974 1.00 35.43 C ATOM 10957 C ASN B 183 65.880 30.543 100.710 1.00 37.07 C ATOM 10958 O ASN B 183 67.091 30.809 100.939 1.00 37.61 O ATOM 10959 CB ASN B 183 65.991 28.283 99.898 1.00 35.94 C ATOM 10960 CG ASN B 183 65.832 26.799 100.188 1.00 37.20 C ATOM 10961 OD1 ASN B 183 66.568 26.217 101.018 1.00 36.97 O ATOM 10962 ND2 ASN B 183 64.862 26.183 99.533 1.00 35.17 N ATOM 10963 HA ASN B 183 65.629 28.957 102.010 1.00 0.00 H ATOM 10964 HB2 ASN B 183 65.515 28.505 98.943 1.00 0.00 H ATOM 10965 HB3 ASN B 183 67.054 28.515 99.836 1.00 0.00 H ATOM 10966 HD22 ASN B 183 64.277 26.710 98.853 1.00 0.00 H ATOM 10967 HD21 ASN B 183 64.684 25.172 99.698 1.00 0.00 H ATOM 10968 H ASN B 183 63.351 29.200 100.168 1.00 0.00 H ATOM 10969 N ILE B 184 65.026 31.441 100.214 1.00 36.04 N ATOM 10970 CA ILE B 184 65.549 32.762 99.872 1.00 35.93 C ATOM 10971 C ILE B 184 66.198 33.526 101.058 1.00 36.13 C ATOM 10972 O ILE B 184 67.050 34.417 100.836 1.00 36.24 O ATOM 10973 CB ILE B 184 64.467 33.645 99.148 1.00 35.91 C ATOM 10974 CG1 ILE B 184 65.198 34.685 98.274 1.00 35.02 C ATOM 10975 CG2 ILE B 184 63.521 34.321 100.172 1.00 34.50 C ATOM 10976 CD1 ILE B 184 65.828 34.034 97.015 1.00 32.95 C ATOM 10977 HA ILE B 184 66.364 32.568 99.174 1.00 0.00 H ATOM 10978 HB ILE B 184 63.838 33.019 98.515 1.00 0.00 H ATOM 10979 HG12 ILE B 184 64.484 35.446 97.959 1.00 0.00 H ATOM 10980 HG13 ILE B 184 65.987 35.151 98.864 1.00 0.00 H ATOM 10981 HD11 ILE B 184 66.548 33.275 97.322 1.00 0.00 H ATOM 10982 HD12 ILE B 184 65.044 33.571 96.416 1.00 0.00 H ATOM 10983 HD13 ILE B 184 66.333 34.799 96.426 1.00 0.00 H ATOM 10984 HG21 ILE B 184 63.012 33.554 100.756 1.00 0.00 H ATOM 10985 HG22 ILE B 184 64.104 34.959 100.837 1.00 0.00 H ATOM 10986 HG23 ILE B 184 62.785 34.924 99.641 1.00 0.00 H ATOM 10987 H ILE B 184 64.022 31.208 100.076 1.00 0.00 H ATOM 10988 N GLN B 185 65.811 33.183 102.294 1.00 34.40 N ATOM 10989 CA GLN B 185 66.386 33.836 103.487 1.00 35.44 C ATOM 10990 C GLN B 185 67.918 33.656 103.508 1.00 35.72 C ATOM 10991 O GLN B 185 68.651 34.541 103.969 1.00 35.49 O ATOM 10992 CB GLN B 185 65.795 33.235 104.787 1.00 35.27 C ATOM 10993 CG GLN B 185 66.150 31.803 104.988 1.00 36.21 C ATOM 10994 CD GLN B 185 65.241 31.097 106.004 1.00 41.16 C ATOM 10995 OE1 GLN B 185 64.050 30.908 105.744 1.00 41.90 O ATOM 10996 NE2 GLN B 185 65.799 30.710 107.161 1.00 38.99 N ATOM 10997 HA GLN B 185 66.137 34.896 103.437 1.00 0.00 H ATOM 10998 HB2 GLN B 185 66.171 33.807 105.635 1.00 0.00 H ATOM 10999 HB3 GLN B 185 64.709 33.320 104.745 1.00 0.00 H ATOM 11000 HG2 GLN B 185 66.069 31.287 104.031 1.00 0.00 H ATOM 11001 HG3 GLN B 185 67.179 31.746 105.344 1.00 0.00 H ATOM 11002 HE22 GLN B 185 66.808 30.890 107.338 1.00 0.00 H ATOM 11003 HE21 GLN B 185 65.223 30.230 107.881 1.00 0.00 H ATOM 11004 H GLN B 185 65.091 32.442 102.416 1.00 0.00 H ATOM 11005 N PHE B 186 68.390 32.525 102.991 1.00 35.71 N ATOM 11006 CA PHE B 186 69.839 32.250 102.990 1.00 37.73 C ATOM 11007 C PHE B 186 70.608 33.144 102.026 1.00 38.48 C ATOM 11008 O PHE B 186 71.818 33.312 102.169 1.00 39.00 O ATOM 11009 CB PHE B 186 70.071 30.784 102.658 1.00 35.13 C ATOM 11010 CG PHE B 186 69.398 29.878 103.620 1.00 39.11 C ATOM 11011 CD1 PHE B 186 69.646 30.016 105.007 1.00 36.19 C ATOM 11012 CD2 PHE B 186 68.419 28.975 103.187 1.00 36.65 C ATOM 11013 CE1 PHE B 186 68.931 29.287 105.943 1.00 38.02 C ATOM 11014 CE2 PHE B 186 67.694 28.242 104.118 1.00 38.68 C ATOM 11015 CZ PHE B 186 67.945 28.392 105.514 1.00 38.90 C ATOM 11016 HA PHE B 186 70.220 32.473 103.987 1.00 0.00 H ATOM 11017 HB2 PHE B 186 69.684 30.585 101.659 1.00 0.00 H ATOM 11018 HB3 PHE B 186 71.142 30.585 102.678 1.00 0.00 H ATOM 11019 HD2 PHE B 186 68.226 28.848 102.122 1.00 0.00 H ATOM 11020 HE2 PHE B 186 66.927 27.546 103.779 1.00 0.00 H ATOM 11021 HZ PHE B 186 67.373 27.814 106.240 1.00 0.00 H ATOM 11022 HE1 PHE B 186 69.135 29.410 107.007 1.00 0.00 H ATOM 11023 HD1 PHE B 186 70.415 30.710 105.345 1.00 0.00 H ATOM 11024 H PHE B 186 67.732 31.829 102.584 1.00 0.00 H ATOM 11025 N PHE B 187 69.895 33.730 101.058 1.00 38.09 N ATOM 11026 CA PHE B 187 70.511 34.608 100.083 1.00 36.83 C ATOM 11027 C PHE B 187 70.279 36.057 100.494 1.00 37.00 C ATOM 11028 O PHE B 187 70.597 36.980 99.745 1.00 36.49 O ATOM 11029 CB PHE B 187 69.922 34.362 98.699 1.00 35.72 C ATOM 11030 CG PHE B 187 70.170 32.984 98.183 1.00 36.46 C ATOM 11031 CD1 PHE B 187 69.326 31.911 98.557 1.00 35.75 C ATOM 11032 CD2 PHE B 187 71.263 32.736 97.326 1.00 34.59 C ATOM 11033 CE1 PHE B 187 69.561 30.627 98.094 1.00 35.07 C ATOM 11034 CE2 PHE B 187 71.519 31.474 96.853 1.00 31.81 C ATOM 11035 CZ PHE B 187 70.669 30.388 97.232 1.00 34.04 C ATOM 11036 HA PHE B 187 71.581 34.404 100.045 1.00 0.00 H ATOM 11037 HB2 PHE B 187 68.845 34.524 98.748 1.00 0.00 H ATOM 11038 HB3 PHE B 187 70.364 35.076 98.004 1.00 0.00 H ATOM 11039 HD2 PHE B 187 71.914 33.560 97.035 1.00 0.00 H ATOM 11040 HE2 PHE B 187 72.367 31.300 96.191 1.00 0.00 H ATOM 11041 HZ PHE B 187 70.868 29.382 96.863 1.00 0.00 H ATOM 11042 HE1 PHE B 187 68.904 29.808 98.387 1.00 0.00 H ATOM 11043 HD1 PHE B 187 68.480 32.098 99.218 1.00 0.00 H ATOM 11044 H PHE B 187 68.872 33.551 101.003 1.00 0.00 H ATOM 11045 N GLY B 188 69.730 36.268 101.685 1.00 37.28 N ATOM 11046 CA GLY B 188 69.470 37.639 102.112 1.00 36.13 C ATOM 11047 C GLY B 188 68.062 38.173 101.824 1.00 38.07 C ATOM 11048 O GLY B 188 67.740 39.347 102.143 1.00 37.64 O ATOM 11049 HA3 GLY B 188 70.184 38.288 101.605 1.00 0.00 H ATOM 11050 HA2 GLY B 188 69.634 37.691 103.188 1.00 0.00 H ATOM 11051 H GLY B 188 69.489 35.468 102.304 1.00 0.00 H ATOM 11052 N GLY B 189 67.209 37.337 101.228 1.00 37.09 N ATOM 11053 CA GLY B 189 65.852 37.797 100.925 1.00 37.32 C ATOM 11054 C GLY B 189 64.840 37.528 102.041 1.00 38.42 C ATOM 11055 O GLY B 189 64.937 36.547 102.756 1.00 37.80 O ATOM 11056 HA3 GLY B 189 65.511 37.289 100.023 1.00 0.00 H ATOM 11057 HA2 GLY B 189 65.886 38.871 100.745 1.00 0.00 H ATOM 11058 H GLY B 189 67.504 36.371 100.982 1.00 0.00 H ATOM 11059 N ASP B 190 63.875 38.425 102.190 1.00 37.66 N ATOM 11060 CA ASP B 190 62.819 38.294 103.153 1.00 37.84 C ATOM 11061 C ASP B 190 61.670 37.454 102.514 1.00 38.14 C ATOM 11062 O ASP B 190 60.898 37.966 101.701 1.00 40.51 O ATOM 11063 CB ASP B 190 62.336 39.708 103.542 1.00 37.59 C ATOM 11064 CG ASP B 190 61.175 39.680 104.519 1.00 37.82 C ATOM 11065 OD1 ASP B 190 60.634 38.593 104.816 1.00 38.29 O ATOM 11066 OD2 ASP B 190 60.788 40.764 104.964 1.00 38.14 O ATOM 11067 HA ASP B 190 63.160 37.784 104.054 1.00 0.00 H ATOM 11068 HB2 ASP B 190 63.165 40.247 104.000 1.00 0.00 H ATOM 11069 HB3 ASP B 190 62.020 40.230 102.639 1.00 0.00 H ATOM 11070 H ASP B 190 63.884 39.266 101.578 1.00 0.00 H ATOM 11071 N PRO B 191 61.528 36.173 102.888 1.00 37.71 N ATOM 11072 CA PRO B 191 60.439 35.416 102.262 1.00 38.60 C ATOM 11073 C PRO B 191 59.035 35.945 102.549 1.00 40.50 C ATOM 11074 O PRO B 191 58.085 35.466 101.965 1.00 42.63 O ATOM 11075 CB PRO B 191 60.638 33.999 102.782 1.00 37.31 C ATOM 11076 CG PRO B 191 61.158 34.261 104.221 1.00 37.49 C ATOM 11077 CD PRO B 191 62.073 35.475 104.074 1.00 37.18 C ATOM 11078 HA PRO B 191 60.491 35.494 101.176 1.00 0.00 H ATOM 11079 HD3 PRO B 191 62.024 36.111 104.958 1.00 0.00 H ATOM 11080 HD2 PRO B 191 63.105 35.168 103.906 1.00 0.00 H ATOM 11081 HG3 PRO B 191 61.714 33.401 104.594 1.00 0.00 H ATOM 11082 HG2 PRO B 191 60.331 34.479 104.897 1.00 0.00 H ATOM 11083 HB2 PRO B 191 59.700 33.444 102.793 1.00 0.00 H ATOM 11084 HB3 PRO B 191 61.372 33.457 102.187 1.00 0.00 H ATOM 11085 N LYS B 192 58.879 36.928 103.422 1.00 41.53 N ATOM 11086 CA LYS B 192 57.541 37.413 103.674 1.00 42.71 C ATOM 11087 C LYS B 192 57.221 38.603 102.817 1.00 42.52 C ATOM 11088 O LYS B 192 56.110 39.149 102.862 1.00 40.61 O ATOM 11089 CB LYS B 192 57.365 37.736 105.164 1.00 46.15 C ATOM 11090 CG LYS B 192 57.243 36.426 105.936 1.00 51.35 C ATOM 11091 CD LYS B 192 56.298 35.425 105.142 1.00 52.69 C ATOM 11092 CE LYS B 192 56.306 34.014 105.736 1.00 52.75 C ATOM 11093 NZ LYS B 192 57.678 33.440 105.790 1.00 53.09 N ATOM 11094 HA LYS B 192 56.836 36.626 103.408 1.00 0.00 H ATOM 11095 HB2 LYS B 192 58.229 38.295 105.523 1.00 0.00 H ATOM 11096 HB3 LYS B 192 56.463 38.332 105.307 1.00 0.00 H ATOM 11097 HG2 LYS B 192 58.230 35.979 106.051 1.00 0.00 H ATOM 11098 HG3 LYS B 192 56.818 36.623 106.920 1.00 0.00 H ATOM 11099 HD2 LYS B 192 55.279 35.810 105.170 1.00 0.00 H ATOM 11100 HD3 LYS B 192 56.637 35.371 104.107 1.00 0.00 H ATOM 11101 HE2 LYS B 192 55.678 33.369 105.121 1.00 0.00 H ATOM 11102 HE3 LYS B 192 55.901 34.055 106.747 1.00 0.00 H ATOM 11103 HZ1 LYS B 192 58.070 33.390 104.828 1.00 0.00 H ATOM 11104 HZ2 LYS B 192 58.283 34.045 106.381 1.00 0.00 H ATOM 11105 HZ3 LYS B 192 57.637 32.485 106.199 1.00 0.00 H ATOM 11106 H LYS B 192 59.698 37.340 103.913 1.00 0.00 H ATOM 11107 N THR B 193 58.192 38.993 102.010 1.00 40.63 N ATOM 11108 CA THR B 193 57.992 40.133 101.140 1.00 41.65 C ATOM 11109 C THR B 193 58.416 39.742 99.710 1.00 40.19 C ATOM 11110 O THR B 193 59.359 40.362 99.160 1.00 39.59 O ATOM 11111 CB THR B 193 58.863 41.267 101.641 1.00 44.22 C ATOM 11112 OG1 THR B 193 58.612 41.423 103.040 1.00 48.66 O ATOM 11113 CG2 THR B 193 58.580 42.549 100.929 1.00 45.35 C ATOM 11114 HA THR B 193 56.947 40.442 101.136 1.00 0.00 H ATOM 11115 HB THR B 193 59.908 41.023 101.451 1.00 0.00 H ATOM 11116 HG1 THR B 193 58.837 40.582 103.510 1.00 0.00 H ATOM 11117 HG23 THR B 193 58.774 42.422 99.864 1.00 0.00 H ATOM 11118 HG21 THR B 193 57.536 42.824 101.080 1.00 0.00 H ATOM 11119 HG22 THR B 193 59.225 43.333 101.326 1.00 0.00 H ATOM 11120 H THR B 193 59.098 38.482 102.000 1.00 0.00 H ATOM 11121 N VAL B 194 57.825 38.646 99.210 1.00 35.87 N ATOM 11122 CA VAL B 194 58.075 38.141 97.870 1.00 34.08 C ATOM 11123 C VAL B 194 57.002 38.658 96.904 1.00 33.72 C ATOM 11124 O VAL B 194 55.788 38.437 97.087 1.00 34.77 O ATOM 11125 CB VAL B 194 58.037 36.584 97.797 1.00 34.67 C ATOM 11126 CG1 VAL B 194 58.104 36.137 96.339 1.00 33.24 C ATOM 11127 CG2 VAL B 194 59.224 35.948 98.588 1.00 33.17 C ATOM 11128 HA VAL B 194 59.071 38.490 97.598 1.00 0.00 H ATOM 11129 HB VAL B 194 57.104 36.248 98.250 1.00 0.00 H ATOM 11130 HG11 VAL B 194 57.253 36.546 95.795 1.00 0.00 H ATOM 11131 HG12 VAL B 194 59.030 36.498 95.892 1.00 0.00 H ATOM 11132 HG13 VAL B 194 58.077 35.048 96.292 1.00 0.00 H ATOM 11133 HG21 VAL B 194 60.167 36.292 98.164 1.00 0.00 H ATOM 11134 HG22 VAL B 194 59.164 36.248 99.634 1.00 0.00 H ATOM 11135 HG23 VAL B 194 59.166 34.862 98.516 1.00 0.00 H ATOM 11136 H VAL B 194 57.153 38.131 99.813 1.00 0.00 H ATOM 11137 N THR B 195 57.446 39.353 95.865 1.00 33.62 N ATOM 11138 CA THR B 195 56.536 39.852 94.852 1.00 31.44 C ATOM 11139 C THR B 195 56.765 39.074 93.595 1.00 31.58 C ATOM 11140 O THR B 195 57.908 39.068 93.065 1.00 32.28 O ATOM 11141 CB THR B 195 56.778 41.334 94.546 1.00 29.62 C ATOM 11142 OG1 THR B 195 56.497 42.065 95.716 1.00 31.25 O ATOM 11143 CG2 THR B 195 55.818 41.884 93.433 1.00 30.14 C ATOM 11144 HA THR B 195 55.517 39.740 95.223 1.00 0.00 H ATOM 11145 HB THR B 195 57.808 41.437 94.204 1.00 0.00 H ATOM 11146 HG1 THR B 195 57.095 41.762 96.445 1.00 0.00 H ATOM 11147 HG23 THR B 195 55.998 41.347 92.502 1.00 0.00 H ATOM 11148 HG21 THR B 195 54.783 41.739 93.743 1.00 0.00 H ATOM 11149 HG22 THR B 195 56.008 42.947 93.283 1.00 0.00 H ATOM 11150 H THR B 195 58.464 39.543 95.775 1.00 0.00 H ATOM 11151 N ILE B 196 55.717 38.404 93.100 1.00 29.83 N ATOM 11152 CA ILE B 196 55.847 37.704 91.807 1.00 29.54 C ATOM 11153 C ILE B 196 55.398 38.701 90.732 1.00 29.96 C ATOM 11154 O ILE B 196 54.469 39.513 90.948 1.00 29.98 O ATOM 11155 CB ILE B 196 54.999 36.403 91.729 1.00 31.03 C ATOM 11156 CG1 ILE B 196 53.522 36.674 92.048 1.00 28.28 C ATOM 11157 CG2 ILE B 196 55.525 35.402 92.741 1.00 27.91 C ATOM 11158 CD1 ILE B 196 52.630 35.395 91.844 1.00 29.30 C ATOM 11159 HA ILE B 196 56.879 37.383 91.668 1.00 0.00 H ATOM 11160 HB ILE B 196 55.076 36.015 90.713 1.00 0.00 H ATOM 11161 HG12 ILE B 196 53.440 36.999 93.085 1.00 0.00 H ATOM 11162 HG13 ILE B 196 53.159 37.465 91.391 1.00 0.00 H ATOM 11163 HD11 ILE B 196 52.700 35.067 90.807 1.00 0.00 H ATOM 11164 HD12 ILE B 196 52.981 34.600 92.503 1.00 0.00 H ATOM 11165 HD13 ILE B 196 51.594 35.635 92.081 1.00 0.00 H ATOM 11166 HG21 ILE B 196 56.567 35.174 92.517 1.00 0.00 H ATOM 11167 HG22 ILE B 196 55.452 35.827 93.742 1.00 0.00 H ATOM 11168 HG23 ILE B 196 54.932 34.489 92.689 1.00 0.00 H ATOM 11169 H ILE B 196 54.818 38.377 93.622 1.00 0.00 H ATOM 11170 N PHE B 197 56.145 38.734 89.625 1.00 30.61 N ATOM 11171 CA PHE B 197 55.839 39.628 88.531 1.00 29.71 C ATOM 11172 C PHE B 197 56.135 38.921 87.215 1.00 29.69 C ATOM 11173 O PHE B 197 56.993 38.059 87.134 1.00 31.89 O ATOM 11174 CB PHE B 197 56.570 40.979 88.696 1.00 30.83 C ATOM 11175 CG PHE B 197 58.068 40.984 88.386 1.00 30.26 C ATOM 11176 CD1 PHE B 197 58.964 40.175 89.076 1.00 29.37 C ATOM 11177 CD2 PHE B 197 58.580 41.948 87.490 1.00 30.59 C ATOM 11178 CE1 PHE B 197 60.373 40.327 88.882 1.00 31.50 C ATOM 11179 CE2 PHE B 197 59.983 42.131 87.275 1.00 29.95 C ATOM 11180 CZ PHE B 197 60.885 41.330 87.962 1.00 30.27 C ATOM 11181 HA PHE B 197 54.778 39.879 88.532 1.00 0.00 H ATOM 11182 HB2 PHE B 197 56.091 41.699 88.032 1.00 0.00 H ATOM 11183 HB3 PHE B 197 56.444 41.301 89.730 1.00 0.00 H ATOM 11184 HD2 PHE B 197 57.879 42.577 86.941 1.00 0.00 H ATOM 11185 HE2 PHE B 197 60.339 42.891 86.580 1.00 0.00 H ATOM 11186 HZ PHE B 197 61.958 41.451 87.814 1.00 0.00 H ATOM 11187 HE1 PHE B 197 61.067 39.687 89.427 1.00 0.00 H ATOM 11188 HD1 PHE B 197 58.591 39.421 89.769 1.00 0.00 H ATOM 11189 H PHE B 197 56.967 38.101 89.548 1.00 0.00 H ATOM 11190 N GLY B 198 55.391 39.241 86.183 1.00 29.01 N ATOM 11191 CA GLY B 198 55.600 38.553 84.919 1.00 28.63 C ATOM 11192 C GLY B 198 54.827 39.264 83.823 1.00 28.39 C ATOM 11193 O GLY B 198 53.921 40.072 84.084 1.00 27.88 O ATOM 11194 HA3 GLY B 198 55.250 37.524 85.003 1.00 0.00 H ATOM 11195 HA2 GLY B 198 56.662 38.555 84.675 1.00 0.00 H ATOM 11196 H GLY B 198 54.661 39.977 86.268 1.00 0.00 H ATOM 11197 N GLU B 199 55.206 38.982 82.592 1.00 28.75 N ATOM 11198 CA GLU B 199 54.581 39.644 81.480 1.00 28.70 C ATOM 11199 C GLU B 199 53.851 38.681 80.539 1.00 28.42 C ATOM 11200 O GLU B 199 54.331 37.601 80.294 1.00 28.34 O ATOM 11201 CB GLU B 199 55.675 40.443 80.697 1.00 28.21 C ATOM 11202 CG GLU B 199 55.116 41.302 79.528 1.00 27.54 C ATOM 11203 CD GLU B 199 55.101 40.569 78.194 1.00 29.52 C ATOM 11204 OE1 GLU B 199 55.695 39.434 78.097 1.00 28.63 O ATOM 11205 OE2 GLU B 199 54.489 41.131 77.218 1.00 30.54 O ATOM 11206 HA GLU B 199 53.819 40.315 81.876 1.00 0.00 H ATOM 11207 HB2 GLU B 199 56.183 41.106 81.398 1.00 0.00 H ATOM 11208 HB3 GLU B 199 56.392 39.732 80.287 1.00 0.00 H ATOM 11209 HG2 GLU B 199 54.095 41.597 79.772 1.00 0.00 H ATOM 11210 HG3 GLU B 199 55.736 42.193 79.426 1.00 0.00 H ATOM 11211 H GLU B 199 55.956 38.281 82.426 1.00 0.00 H ATOM 11212 N SER B 200 52.699 39.100 80.019 1.00 27.81 N ATOM 11213 CA SER B 200 51.910 38.309 79.034 1.00 28.61 C ATOM 11214 C SER B 200 51.593 36.926 79.632 1.00 27.26 C ATOM 11215 O SER B 200 50.978 36.890 80.671 1.00 29.44 O ATOM 11216 CB SER B 200 52.674 38.245 77.699 1.00 27.69 C ATOM 11217 OG SER B 200 51.907 37.658 76.629 1.00 30.67 O ATOM 11218 HA SER B 200 50.953 38.786 78.821 1.00 0.00 H ATOM 11219 HB2 SER B 200 53.576 37.651 77.845 1.00 0.00 H ATOM 11220 HB3 SER B 200 52.951 39.259 77.410 1.00 0.00 H ATOM 11221 HG SER B 200 52.451 37.646 75.802 1.00 0.00 H ATOM 11222 H SER B 200 52.332 40.027 80.316 1.00 0.00 H ATOM 11223 N ALA B 201 52.011 35.798 79.059 1.00 28.49 N ATOM 11224 CA ALA B 201 51.642 34.518 79.709 1.00 28.04 C ATOM 11225 C ALA B 201 52.211 34.473 81.155 1.00 29.35 C ATOM 11226 O ALA B 201 51.681 33.778 82.007 1.00 27.99 O ATOM 11227 CB ALA B 201 52.129 33.295 78.860 1.00 25.12 C ATOM 11228 HA ALA B 201 50.555 34.455 79.768 1.00 0.00 H ATOM 11229 HB1 ALA B 201 51.667 33.332 77.873 1.00 0.00 H ATOM 11230 HB2 ALA B 201 53.213 33.335 78.757 1.00 0.00 H ATOM 11231 HB3 ALA B 201 51.844 32.370 79.361 1.00 0.00 H ATOM 11232 H ALA B 201 52.576 35.815 78.186 1.00 0.00 H ATOM 11233 N GLY B 202 53.276 35.249 81.415 1.00 29.24 N ATOM 11234 CA GLY B 202 53.844 35.328 82.747 1.00 29.13 C ATOM 11235 C GLY B 202 52.957 36.181 83.650 1.00 31.84 C ATOM 11236 O GLY B 202 52.888 35.953 84.888 1.00 31.96 O ATOM 11237 HA3 GLY B 202 54.836 35.776 82.689 1.00 0.00 H ATOM 11238 HA2 GLY B 202 53.924 34.324 83.165 1.00 0.00 H ATOM 11239 H GLY B 202 53.702 35.804 80.646 1.00 0.00 H ATOM 11240 N GLY B 203 52.274 37.172 83.066 1.00 31.30 N ATOM 11241 CA GLY B 203 51.375 37.992 83.870 1.00 31.16 C ATOM 11242 C GLY B 203 50.111 37.150 84.117 1.00 30.36 C ATOM 11243 O GLY B 203 49.525 37.187 85.198 1.00 31.83 O ATOM 11244 HA3 GLY B 203 51.119 38.906 83.334 1.00 0.00 H ATOM 11245 HA2 GLY B 203 51.847 38.249 84.818 1.00 0.00 H ATOM 11246 H GLY B 203 52.383 37.356 82.048 1.00 0.00 H ATOM 11247 N ALA B 204 49.676 36.381 83.110 1.00 31.47 N ATOM 11248 CA ALA B 204 48.493 35.500 83.300 1.00 31.53 C ATOM 11249 C ALA B 204 48.847 34.514 84.422 1.00 31.26 C ATOM 11250 O ALA B 204 48.013 34.243 85.316 1.00 30.81 O ATOM 11251 CB ALA B 204 48.152 34.704 81.986 1.00 30.18 C ATOM 11252 HA ALA B 204 47.618 36.100 83.550 1.00 0.00 H ATOM 11253 HB1 ALA B 204 47.934 35.408 81.183 1.00 0.00 H ATOM 11254 HB2 ALA B 204 49.004 34.084 81.707 1.00 0.00 H ATOM 11255 HB3 ALA B 204 47.282 34.071 82.162 1.00 0.00 H ATOM 11256 H ALA B 204 50.167 36.400 82.193 1.00 0.00 H ATOM 11257 N SER B 205 50.060 33.935 84.342 1.00 30.47 N ATOM 11258 CA SER B 205 50.490 32.996 85.365 1.00 29.72 C ATOM 11259 C SER B 205 50.432 33.642 86.758 1.00 30.36 C ATOM 11260 O SER B 205 49.920 33.024 87.704 1.00 31.83 O ATOM 11261 CB SER B 205 51.935 32.490 85.116 1.00 28.01 C ATOM 11262 OG SER B 205 52.030 31.684 83.966 1.00 27.56 O ATOM 11263 HA SER B 205 49.806 32.149 85.317 1.00 0.00 H ATOM 11264 HB2 SER B 205 52.256 31.908 85.980 1.00 0.00 H ATOM 11265 HB3 SER B 205 52.592 33.351 84.996 1.00 0.00 H ATOM 11266 HG SER B 205 51.747 32.206 83.174 1.00 0.00 H ATOM 11267 H SER B 205 50.691 34.160 83.546 1.00 0.00 H ATOM 11268 N VAL B 206 50.962 34.867 86.899 1.00 28.38 N ATOM 11269 CA VAL B 206 50.907 35.534 88.182 1.00 28.95 C ATOM 11270 C VAL B 206 49.430 35.593 88.673 1.00 29.33 C ATOM 11271 O VAL B 206 49.136 35.262 89.821 1.00 30.73 O ATOM 11272 CB VAL B 206 51.539 36.981 88.094 1.00 30.64 C ATOM 11273 CG1 VAL B 206 51.153 37.821 89.319 1.00 28.06 C ATOM 11274 CG2 VAL B 206 53.094 36.876 87.984 1.00 29.07 C ATOM 11275 HA VAL B 206 51.495 34.967 88.904 1.00 0.00 H ATOM 11276 HB VAL B 206 51.148 37.475 87.204 1.00 0.00 H ATOM 11277 HG11 VAL B 206 50.068 37.914 89.367 1.00 0.00 H ATOM 11278 HG12 VAL B 206 51.518 37.332 90.223 1.00 0.00 H ATOM 11279 HG13 VAL B 206 51.600 38.811 89.234 1.00 0.00 H ATOM 11280 HG21 VAL B 206 53.485 36.365 88.863 1.00 0.00 H ATOM 11281 HG22 VAL B 206 53.356 36.313 87.088 1.00 0.00 H ATOM 11282 HG23 VAL B 206 53.521 37.877 87.924 1.00 0.00 H ATOM 11283 H VAL B 206 51.412 35.336 86.087 1.00 0.00 H ATOM 11284 N GLY B 207 48.506 35.992 87.818 1.00 29.37 N ATOM 11285 CA GLY B 207 47.105 36.044 88.233 1.00 28.15 C ATOM 11286 C GLY B 207 46.538 34.653 88.561 1.00 29.37 C ATOM 11287 O GLY B 207 45.644 34.513 89.408 1.00 31.13 O ATOM 11288 HA3 GLY B 207 46.517 36.481 87.426 1.00 0.00 H ATOM 11289 HA2 GLY B 207 47.026 36.673 89.120 1.00 0.00 H ATOM 11290 H GLY B 207 48.774 36.269 86.852 1.00 0.00 H ATOM 11291 N MET B 208 47.050 33.620 87.899 1.00 29.35 N ATOM 11292 CA MET B 208 46.600 32.274 88.195 1.00 29.04 C ATOM 11293 C MET B 208 47.072 31.847 89.600 1.00 31.46 C ATOM 11294 O MET B 208 46.381 31.064 90.276 1.00 30.27 O ATOM 11295 CB MET B 208 47.079 31.302 87.113 1.00 26.83 C ATOM 11296 CG MET B 208 46.319 31.518 85.786 1.00 28.57 C ATOM 11297 SD MET B 208 46.997 30.621 84.393 1.00 30.93 S ATOM 11298 CE MET B 208 45.756 30.931 83.108 1.00 27.36 C ATOM 11299 HA MET B 208 45.510 32.254 88.195 1.00 0.00 H ATOM 11300 HB2 MET B 208 48.144 31.458 86.942 1.00 0.00 H ATOM 11301 HB3 MET B 208 46.913 30.280 87.455 1.00 0.00 H ATOM 11302 HG2 MET B 208 46.340 32.582 85.550 1.00 0.00 H ATOM 11303 HG3 MET B 208 45.287 31.199 85.928 1.00 0.00 H ATOM 11304 HE1 MET B 208 44.791 30.546 83.436 1.00 0.00 H ATOM 11305 HE2 MET B 208 45.679 32.004 82.930 1.00 0.00 H ATOM 11306 HE3 MET B 208 46.055 30.429 82.188 1.00 0.00 H ATOM 11307 H MET B 208 47.773 33.778 87.169 1.00 0.00 H ATOM 11308 N HIS B 209 48.243 32.325 90.047 1.00 30.57 N ATOM 11309 CA HIS B 209 48.693 31.966 91.411 1.00 31.66 C ATOM 11310 C HIS B 209 47.924 32.776 92.441 1.00 31.18 C ATOM 11311 O HIS B 209 47.810 32.358 93.618 1.00 32.83 O ATOM 11312 CB HIS B 209 50.207 32.210 91.593 1.00 30.64 C ATOM 11313 CG HIS B 209 51.041 31.266 90.783 1.00 33.94 C ATOM 11314 ND1 HIS B 209 51.024 29.902 90.997 1.00 31.12 N ATOM 11315 CD2 HIS B 209 51.846 31.476 89.707 1.00 32.59 C ATOM 11316 CE1 HIS B 209 51.781 29.311 90.085 1.00 33.57 C ATOM 11317 NE2 HIS B 209 52.288 30.241 89.290 1.00 33.68 N ATOM 11318 HA HIS B 209 48.499 30.903 91.554 1.00 0.00 H ATOM 11319 HB2 HIS B 209 50.436 33.231 91.287 1.00 0.00 H ATOM 11320 HB3 HIS B 209 50.458 32.083 92.646 1.00 0.00 H ATOM 11321 HD2 HIS B 209 52.094 32.439 89.260 1.00 0.00 H ATOM 11322 HE1 HIS B 209 51.957 28.239 90.003 1.00 0.00 H ATOM 11323 H HIS B 209 48.827 32.939 89.444 1.00 0.00 H ATOM 11324 N ILE B 210 47.422 33.947 92.030 1.00 30.67 N ATOM 11325 CA ILE B 210 46.613 34.741 92.937 1.00 31.37 C ATOM 11326 C ILE B 210 45.268 33.953 93.150 1.00 31.99 C ATOM 11327 O ILE B 210 44.702 33.917 94.248 1.00 31.26 O ATOM 11328 CB ILE B 210 46.339 36.129 92.307 1.00 32.73 C ATOM 11329 CG1 ILE B 210 47.555 37.040 92.461 1.00 30.76 C ATOM 11330 CG2 ILE B 210 45.108 36.776 92.914 1.00 32.39 C ATOM 11331 CD1 ILE B 210 47.362 38.278 91.668 1.00 30.57 C ATOM 11332 HA ILE B 210 47.117 34.902 93.890 1.00 0.00 H ATOM 11333 HB ILE B 210 46.149 35.981 91.244 1.00 0.00 H ATOM 11334 HG12 ILE B 210 47.682 37.300 93.512 1.00 0.00 H ATOM 11335 HG13 ILE B 210 48.445 36.519 92.107 1.00 0.00 H ATOM 11336 HD11 ILE B 210 47.237 38.019 90.617 1.00 0.00 H ATOM 11337 HD12 ILE B 210 46.474 38.800 92.023 1.00 0.00 H ATOM 11338 HD13 ILE B 210 48.234 38.922 91.784 1.00 0.00 H ATOM 11339 HG21 ILE B 210 44.241 36.138 92.741 1.00 0.00 H ATOM 11340 HG22 ILE B 210 45.258 36.904 93.986 1.00 0.00 H ATOM 11341 HG23 ILE B 210 44.944 37.748 92.450 1.00 0.00 H ATOM 11342 H ILE B 210 47.611 34.286 91.065 1.00 0.00 H ATOM 11343 N LEU B 211 44.794 33.300 92.096 1.00 31.33 N ATOM 11344 CA LEU B 211 43.535 32.540 92.164 1.00 32.42 C ATOM 11345 C LEU B 211 43.674 31.141 92.807 1.00 32.70 C ATOM 11346 O LEU B 211 42.863 30.765 93.653 1.00 34.18 O ATOM 11347 CB LEU B 211 42.948 32.370 90.770 1.00 30.35 C ATOM 11348 CG LEU B 211 42.382 33.644 90.119 1.00 35.44 C ATOM 11349 CD1 LEU B 211 42.361 33.412 88.635 1.00 36.66 C ATOM 11350 CD2 LEU B 211 40.964 33.959 90.580 1.00 38.19 C ATOM 11351 HA LEU B 211 42.878 33.128 92.805 1.00 0.00 H ATOM 11352 HB2 LEU B 211 43.734 31.984 90.121 1.00 0.00 H ATOM 11353 HB3 LEU B 211 42.141 31.640 90.834 1.00 0.00 H ATOM 11354 HG LEU B 211 43.010 34.488 90.404 1.00 0.00 H ATOM 11355 HD21 LEU B 211 40.306 33.130 90.320 1.00 0.00 H ATOM 11356 HD22 LEU B 211 40.958 34.104 91.660 1.00 0.00 H ATOM 11357 HD23 LEU B 211 40.617 34.868 90.088 1.00 0.00 H ATOM 11358 HD11 LEU B 211 43.375 33.219 88.284 1.00 0.00 H ATOM 11359 HD12 LEU B 211 41.728 32.553 88.412 1.00 0.00 H ATOM 11360 HD13 LEU B 211 41.965 34.296 88.136 1.00 0.00 H ATOM 11361 H LEU B 211 45.324 33.326 91.202 1.00 0.00 H ATOM 11362 N SER B 212 44.703 30.389 92.433 1.00 30.99 N ATOM 11363 CA SER B 212 44.855 29.031 92.941 1.00 32.41 C ATOM 11364 C SER B 212 45.123 28.939 94.435 1.00 32.29 C ATOM 11365 O SER B 212 46.158 29.410 94.901 1.00 32.16 O ATOM 11366 CB SER B 212 45.979 28.309 92.211 1.00 32.71 C ATOM 11367 OG SER B 212 45.873 26.924 92.482 1.00 34.82 O ATOM 11368 HA SER B 212 43.890 28.559 92.757 1.00 0.00 H ATOM 11369 HB2 SER B 212 46.943 28.680 92.560 1.00 0.00 H ATOM 11370 HB3 SER B 212 45.892 28.482 91.138 1.00 0.00 H ATOM 11371 HG SER B 212 44.996 26.593 92.165 1.00 0.00 H ATOM 11372 H SER B 212 45.407 30.773 91.771 1.00 0.00 H ATOM 11373 N PRO B 213 44.190 28.318 95.197 1.00 31.83 N ATOM 11374 CA PRO B 213 44.354 28.178 96.650 1.00 32.46 C ATOM 11375 C PRO B 213 45.735 27.626 97.004 1.00 32.27 C ATOM 11376 O PRO B 213 46.349 28.096 97.955 1.00 32.24 O ATOM 11377 CB PRO B 213 43.236 27.208 97.050 1.00 33.03 C ATOM 11378 CG PRO B 213 42.146 27.531 95.986 1.00 33.94 C ATOM 11379 CD PRO B 213 42.969 27.643 94.714 1.00 30.36 C ATOM 11380 HA PRO B 213 44.288 29.130 97.176 1.00 0.00 H ATOM 11381 HD3 PRO B 213 43.196 26.660 94.301 1.00 0.00 H ATOM 11382 HD2 PRO B 213 42.456 28.242 93.962 1.00 0.00 H ATOM 11383 HG3 PRO B 213 41.637 28.468 96.212 1.00 0.00 H ATOM 11384 HG2 PRO B 213 41.412 26.728 95.914 1.00 0.00 H ATOM 11385 HB2 PRO B 213 43.565 26.171 96.981 1.00 0.00 H ATOM 11386 HB3 PRO B 213 42.878 27.408 98.060 1.00 0.00 H ATOM 11387 N GLY B 214 46.224 26.655 96.228 1.00 32.45 N ATOM 11388 CA GLY B 214 47.524 26.068 96.541 1.00 34.41 C ATOM 11389 C GLY B 214 48.762 26.946 96.253 1.00 35.97 C ATOM 11390 O GLY B 214 49.890 26.538 96.507 1.00 35.52 O ATOM 11391 HA3 GLY B 214 47.624 25.152 95.958 1.00 0.00 H ATOM 11392 HA2 GLY B 214 47.531 25.823 97.603 1.00 0.00 H ATOM 11393 H GLY B 214 45.682 26.319 95.406 1.00 0.00 H ATOM 11394 N SER B 215 48.584 28.161 95.736 1.00 35.20 N ATOM 11395 CA SER B 215 49.758 28.965 95.462 1.00 35.36 C ATOM 11396 C SER B 215 49.753 30.207 96.321 1.00 34.97 C ATOM 11397 O SER B 215 50.801 30.800 96.570 1.00 34.25 O ATOM 11398 CB SER B 215 49.786 29.453 93.975 1.00 31.72 C ATOM 11399 OG SER B 215 49.953 28.410 93.057 1.00 34.86 O ATOM 11400 HA SER B 215 50.623 28.335 95.671 1.00 0.00 H ATOM 11401 HB2 SER B 215 50.611 30.156 93.856 1.00 0.00 H ATOM 11402 HB3 SER B 215 48.845 29.959 93.758 1.00 0.00 H ATOM 11403 HG SER B 215 49.963 28.779 92.138 1.00 0.00 H ATOM 11404 H SER B 215 47.630 28.522 95.535 1.00 0.00 H ATOM 11405 N ARG B 216 48.562 30.624 96.727 1.00 35.32 N ATOM 11406 CA ARG B 216 48.425 31.887 97.463 1.00 37.10 C ATOM 11407 C ARG B 216 49.352 32.150 98.601 1.00 37.73 C ATOM 11408 O ARG B 216 49.782 33.285 98.785 1.00 37.70 O ATOM 11409 CB ARG B 216 47.008 32.068 98.047 1.00 36.49 C ATOM 11410 CG ARG B 216 45.909 31.944 97.027 1.00 38.45 C ATOM 11411 CD ARG B 216 44.497 32.040 97.675 1.00 35.82 C ATOM 11412 NE ARG B 216 43.486 31.772 96.669 1.00 36.89 N ATOM 11413 CZ ARG B 216 42.206 31.531 96.934 1.00 36.82 C ATOM 11414 NH1 ARG B 216 41.357 31.292 95.938 1.00 34.25 N ATOM 11415 NH2 ARG B 216 41.787 31.548 98.198 1.00 34.65 N ATOM 11416 HA ARG B 216 48.677 32.590 96.669 1.00 0.00 H ATOM 11417 HB2 ARG B 216 46.853 31.309 98.814 1.00 0.00 H ATOM 11418 HB3 ARG B 216 46.947 33.058 98.500 1.00 0.00 H ATOM 11419 HG2 ARG B 216 46.016 32.745 96.295 1.00 0.00 H ATOM 11420 HG3 ARG B 216 46.001 30.981 96.525 1.00 0.00 H ATOM 11421 HD2 ARG B 216 44.350 33.041 98.081 1.00 0.00 H ATOM 11422 HD3 ARG B 216 44.415 31.308 98.478 1.00 0.00 H ATOM 11423 HE ARG B 216 43.783 31.768 95.672 1.00 0.00 H ATOM 11424 HH12 ARG B 216 40.355 31.103 96.143 1.00 0.00 H ATOM 11425 HH11 ARG B 216 41.695 31.294 94.955 1.00 0.00 H ATOM 11426 HH22 ARG B 216 40.788 31.361 98.417 1.00 0.00 H ATOM 11427 HH21 ARG B 216 42.459 31.748 98.966 1.00 0.00 H ATOM 11428 H ARG B 216 47.718 30.052 96.523 1.00 0.00 H ATOM 11429 N ASP B 217 49.634 31.111 99.377 1.00 36.88 N ATOM 11430 CA ASP B 217 50.430 31.331 100.585 1.00 38.18 C ATOM 11431 C ASP B 217 51.913 31.563 100.317 1.00 37.61 C ATOM 11432 O ASP B 217 52.611 32.013 101.210 1.00 38.16 O ATOM 11433 CB ASP B 217 50.296 30.140 101.564 1.00 36.30 C ATOM 11434 CG ASP B 217 48.822 29.818 101.958 1.00 40.85 C ATOM 11435 OD1 ASP B 217 47.848 30.550 101.630 1.00 41.27 O ATOM 11436 OD2 ASP B 217 48.635 28.790 102.632 1.00 41.14 O ATOM 11437 HA ASP B 217 50.024 32.243 101.023 1.00 0.00 H ATOM 11438 HB2 ASP B 217 50.728 29.257 101.094 1.00 0.00 H ATOM 11439 HB3 ASP B 217 50.852 30.375 102.472 1.00 0.00 H ATOM 11440 H ASP B 217 49.296 30.159 99.131 1.00 0.00 H ATOM 11441 N LEU B 218 52.373 31.274 99.098 1.00 35.85 N ATOM 11442 CA LEU B 218 53.784 31.377 98.760 1.00 35.20 C ATOM 11443 C LEU B 218 54.337 32.757 98.399 1.00 36.37 C ATOM 11444 O LEU B 218 55.546 32.894 98.131 1.00 38.93 O ATOM 11445 CB LEU B 218 54.086 30.418 97.614 1.00 34.94 C ATOM 11446 CG LEU B 218 53.668 28.973 97.925 1.00 36.59 C ATOM 11447 CD1 LEU B 218 54.040 28.106 96.719 1.00 34.39 C ATOM 11448 CD2 LEU B 218 54.357 28.462 99.204 1.00 34.68 C ATOM 11449 HA LEU B 218 54.291 31.127 99.692 1.00 0.00 H ATOM 11450 HB2 LEU B 218 53.549 30.754 96.727 1.00 0.00 H ATOM 11451 HB3 LEU B 218 55.158 30.437 97.417 1.00 0.00 H ATOM 11452 HG LEU B 218 52.594 28.925 98.103 1.00 0.00 H ATOM 11453 HD21 LEU B 218 55.438 28.492 99.070 1.00 0.00 H ATOM 11454 HD22 LEU B 218 54.076 29.096 100.045 1.00 0.00 H ATOM 11455 HD23 LEU B 218 54.043 27.437 99.400 1.00 0.00 H ATOM 11456 HD11 LEU B 218 53.515 28.470 95.836 1.00 0.00 H ATOM 11457 HD12 LEU B 218 55.116 28.161 96.552 1.00 0.00 H ATOM 11458 HD13 LEU B 218 53.753 27.073 96.914 1.00 0.00 H ATOM 11459 H LEU B 218 51.701 30.965 98.366 1.00 0.00 H ATOM 11460 N PHE B 219 53.500 33.793 98.365 1.00 33.66 N ATOM 11461 CA PHE B 219 54.049 35.077 97.978 1.00 32.44 C ATOM 11462 C PHE B 219 53.258 36.155 98.643 1.00 31.99 C ATOM 11463 O PHE B 219 52.181 35.898 99.195 1.00 32.69 O ATOM 11464 CB PHE B 219 54.068 35.210 96.416 1.00 31.88 C ATOM 11465 CG PHE B 219 52.692 35.148 95.770 1.00 31.77 C ATOM 11466 CD1 PHE B 219 52.052 33.893 95.505 1.00 30.73 C ATOM 11467 CD2 PHE B 219 52.008 36.344 95.462 1.00 29.11 C ATOM 11468 CE1 PHE B 219 50.726 33.860 94.930 1.00 29.23 C ATOM 11469 CE2 PHE B 219 50.718 36.333 94.902 1.00 29.78 C ATOM 11470 CZ PHE B 219 50.057 35.079 94.628 1.00 29.38 C ATOM 11471 HA PHE B 219 55.084 35.169 98.306 1.00 0.00 H ATOM 11472 HB2 PHE B 219 54.524 36.166 96.159 1.00 0.00 H ATOM 11473 HB3 PHE B 219 54.674 34.399 96.011 1.00 0.00 H ATOM 11474 HD2 PHE B 219 52.492 37.300 95.663 1.00 0.00 H ATOM 11475 HE2 PHE B 219 50.216 37.273 94.674 1.00 0.00 H ATOM 11476 HZ PHE B 219 49.057 35.066 94.195 1.00 0.00 H ATOM 11477 HE1 PHE B 219 50.241 32.905 94.729 1.00 0.00 H ATOM 11478 HD1 PHE B 219 52.567 32.961 95.738 1.00 0.00 H ATOM 11479 H PHE B 219 52.494 33.685 98.606 1.00 0.00 H ATOM 11480 N ARG B 220 53.764 37.374 98.584 1.00 31.92 N ATOM 11481 CA ARG B 220 53.092 38.463 99.252 1.00 33.30 C ATOM 11482 C ARG B 220 52.194 39.362 98.382 1.00 33.12 C ATOM 11483 O ARG B 220 51.067 39.679 98.774 1.00 34.01 O ATOM 11484 CB ARG B 220 54.179 39.305 99.970 1.00 34.14 C ATOM 11485 CG ARG B 220 53.726 40.572 100.702 1.00 35.75 C ATOM 11486 CD ARG B 220 52.700 40.282 101.774 1.00 40.33 C ATOM 11487 NE ARG B 220 52.515 41.413 102.703 1.00 44.19 N ATOM 11488 CZ ARG B 220 53.332 41.684 103.732 1.00 44.66 C ATOM 11489 NH1 ARG B 220 54.408 40.913 103.975 1.00 43.48 N ATOM 11490 NH2 ARG B 220 53.056 42.708 104.547 1.00 43.02 N ATOM 11491 HA ARG B 220 52.380 38.009 99.941 1.00 0.00 H ATOM 11492 HB2 ARG B 220 54.661 38.659 100.704 1.00 0.00 H ATOM 11493 HB3 ARG B 220 54.909 39.606 99.218 1.00 0.00 H ATOM 11494 HG2 ARG B 220 54.595 41.038 101.166 1.00 0.00 H ATOM 11495 HG3 ARG B 220 53.290 41.259 99.977 1.00 0.00 H ATOM 11496 HD2 ARG B 220 53.026 39.412 102.344 1.00 0.00 H ATOM 11497 HD3 ARG B 220 51.746 40.064 101.294 1.00 0.00 H ATOM 11498 HE ARG B 220 51.699 42.040 102.551 1.00 0.00 H ATOM 11499 HH12 ARG B 220 55.035 41.132 104.775 1.00 0.00 H ATOM 11500 HH11 ARG B 220 54.613 40.098 103.362 1.00 0.00 H ATOM 11501 HH22 ARG B 220 53.687 42.921 105.346 1.00 0.00 H ATOM 11502 HH21 ARG B 220 52.211 43.291 104.382 1.00 0.00 H ATOM 11503 H ARG B 220 54.644 37.548 98.058 1.00 0.00 H ATOM 11504 N ARG B 221 52.710 39.829 97.251 1.00 32.27 N ATOM 11505 CA ARG B 221 51.971 40.709 96.343 1.00 33.56 C ATOM 11506 C ARG B 221 52.352 40.397 94.902 1.00 32.79 C ATOM 11507 O ARG B 221 53.252 39.588 94.649 1.00 31.98 O ATOM 11508 CB ARG B 221 52.184 42.196 96.680 1.00 35.71 C ATOM 11509 CG ARG B 221 53.636 42.642 96.828 1.00 36.82 C ATOM 11510 CD ARG B 221 53.722 44.104 97.407 1.00 37.71 C ATOM 11511 NE ARG B 221 53.054 44.270 98.690 1.00 35.52 N ATOM 11512 CZ ARG B 221 53.668 44.345 99.878 1.00 39.29 C ATOM 11513 NH1 ARG B 221 55.002 44.276 99.959 1.00 40.41 N ATOM 11514 NH2 ARG B 221 52.953 44.459 101.004 1.00 34.77 N ATOM 11515 HA ARG B 221 50.906 40.518 96.471 1.00 0.00 H ATOM 11516 HB2 ARG B 221 51.732 42.788 95.884 1.00 0.00 H ATOM 11517 HB3 ARG B 221 51.673 42.403 97.620 1.00 0.00 H ATOM 11518 HG2 ARG B 221 54.151 41.960 97.504 1.00 0.00 H ATOM 11519 HG3 ARG B 221 54.118 42.616 95.851 1.00 0.00 H ATOM 11520 HD2 ARG B 221 53.263 44.785 96.690 1.00 0.00 H ATOM 11521 HD3 ARG B 221 54.773 44.363 97.531 1.00 0.00 H ATOM 11522 HE ARG B 221 52.016 44.336 98.683 1.00 0.00 H ATOM 11523 HH12 ARG B 221 55.470 44.335 100.886 1.00 0.00 H ATOM 11524 HH11 ARG B 221 55.570 44.163 99.095 1.00 0.00 H ATOM 11525 HH22 ARG B 221 53.436 44.517 101.923 1.00 0.00 H ATOM 11526 HH21 ARG B 221 51.914 44.490 100.960 1.00 0.00 H ATOM 11527 H ARG B 221 53.682 39.558 96.999 1.00 0.00 H ATOM 11528 N ALA B 222 51.703 41.065 93.962 1.00 31.88 N ATOM 11529 CA ALA B 222 51.832 40.702 92.547 1.00 32.53 C ATOM 11530 C ALA B 222 51.827 41.840 91.546 1.00 31.62 C ATOM 11531 O ALA B 222 51.232 42.892 91.783 1.00 34.70 O ATOM 11532 CB ALA B 222 50.673 39.683 92.190 1.00 31.22 C ATOM 11533 HA ALA B 222 52.829 40.272 92.451 1.00 0.00 H ATOM 11534 HB1 ALA B 222 50.766 38.795 92.815 1.00 0.00 H ATOM 11535 HB2 ALA B 222 49.707 40.156 92.370 1.00 0.00 H ATOM 11536 HB3 ALA B 222 50.751 39.400 91.140 1.00 0.00 H ATOM 11537 H ALA B 222 51.091 41.861 94.231 1.00 0.00 H ATOM 11538 N ILE B 223 52.550 41.626 90.450 1.00 31.63 N ATOM 11539 CA ILE B 223 52.652 42.586 89.367 1.00 30.81 C ATOM 11540 C ILE B 223 52.325 41.820 88.095 1.00 31.38 C ATOM 11541 O ILE B 223 52.921 40.779 87.839 1.00 30.24 O ATOM 11542 CB ILE B 223 54.089 43.159 89.264 1.00 32.30 C ATOM 11543 CG1 ILE B 223 54.397 44.027 90.499 1.00 32.11 C ATOM 11544 CG2 ILE B 223 54.244 44.006 87.958 1.00 31.36 C ATOM 11545 CD1 ILE B 223 55.858 44.530 90.485 1.00 30.76 C ATOM 11546 HA ILE B 223 51.976 43.425 89.532 1.00 0.00 H ATOM 11547 HB ILE B 223 54.796 42.331 89.227 1.00 0.00 H ATOM 11548 HG12 ILE B 223 53.726 44.886 90.505 1.00 0.00 H ATOM 11549 HG13 ILE B 223 54.234 43.434 91.399 1.00 0.00 H ATOM 11550 HD11 ILE B 223 56.535 43.676 90.484 1.00 0.00 H ATOM 11551 HD12 ILE B 223 56.026 45.129 89.590 1.00 0.00 H ATOM 11552 HD13 ILE B 223 56.040 45.139 91.371 1.00 0.00 H ATOM 11553 HG21 ILE B 223 54.049 43.374 87.091 1.00 0.00 H ATOM 11554 HG22 ILE B 223 53.532 44.831 87.975 1.00 0.00 H ATOM 11555 HG23 ILE B 223 55.258 44.401 87.901 1.00 0.00 H ATOM 11556 H ILE B 223 53.067 40.727 90.365 1.00 0.00 H ATOM 11557 N LEU B 224 51.394 42.346 87.301 1.00 29.39 N ATOM 11558 CA LEU B 224 51.007 41.711 86.066 1.00 30.14 C ATOM 11559 C LEU B 224 51.197 42.701 84.907 1.00 30.69 C ATOM 11560 O LEU B 224 50.601 43.802 84.888 1.00 31.62 O ATOM 11561 CB LEU B 224 49.539 41.252 86.151 1.00 29.44 C ATOM 11562 CG LEU B 224 49.146 40.281 87.283 1.00 29.46 C ATOM 11563 CD1 LEU B 224 49.007 40.997 88.624 1.00 26.81 C ATOM 11564 CD2 LEU B 224 47.832 39.588 86.878 1.00 28.19 C ATOM 11565 HA LEU B 224 51.631 40.835 85.891 1.00 0.00 H ATOM 11566 HB2 LEU B 224 48.926 42.146 86.264 1.00 0.00 H ATOM 11567 HB3 LEU B 224 49.297 40.764 85.207 1.00 0.00 H ATOM 11568 HG LEU B 224 49.934 39.540 87.418 1.00 0.00 H ATOM 11569 HD21 LEU B 224 47.055 40.339 86.738 1.00 0.00 H ATOM 11570 HD22 LEU B 224 47.983 39.042 85.947 1.00 0.00 H ATOM 11571 HD23 LEU B 224 47.531 38.894 87.663 1.00 0.00 H ATOM 11572 HD11 LEU B 224 49.957 41.462 88.887 1.00 0.00 H ATOM 11573 HD12 LEU B 224 48.235 41.763 88.547 1.00 0.00 H ATOM 11574 HD13 LEU B 224 48.729 40.276 89.393 1.00 0.00 H ATOM 11575 H LEU B 224 50.935 43.237 87.579 1.00 0.00 H ATOM 11576 N GLN B 225 52.035 42.322 83.948 1.00 30.64 N ATOM 11577 CA GLN B 225 52.348 43.178 82.780 1.00 30.70 C ATOM 11578 C GLN B 225 51.748 42.581 81.502 1.00 30.07 C ATOM 11579 O GLN B 225 52.139 41.502 81.015 1.00 28.96 O ATOM 11580 CB GLN B 225 53.890 43.329 82.632 1.00 29.70 C ATOM 11581 CG GLN B 225 54.529 44.011 83.835 1.00 29.66 C ATOM 11582 CD GLN B 225 56.078 43.823 83.944 1.00 31.68 C ATOM 11583 OE1 GLN B 225 56.599 43.731 85.053 1.00 31.43 O ATOM 11584 NE2 GLN B 225 56.797 43.793 82.805 1.00 30.76 N ATOM 11585 HA GLN B 225 51.909 44.163 82.939 1.00 0.00 H ATOM 11586 HB2 GLN B 225 54.329 42.338 82.518 1.00 0.00 H ATOM 11587 HB3 GLN B 225 54.099 43.922 81.742 1.00 0.00 H ATOM 11588 HG2 GLN B 225 54.320 45.079 83.772 1.00 0.00 H ATOM 11589 HG3 GLN B 225 54.073 43.605 84.738 1.00 0.00 H ATOM 11590 HE22 GLN B 225 56.318 43.874 81.885 1.00 0.00 H ATOM 11591 HE21 GLN B 225 57.831 43.689 82.845 1.00 0.00 H ATOM 11592 H GLN B 225 52.488 41.389 84.020 1.00 0.00 H ATOM 11593 N SER B 226 50.743 43.278 80.974 1.00 31.25 N ATOM 11594 CA SER B 226 50.084 42.848 79.743 1.00 30.33 C ATOM 11595 C SER B 226 49.570 41.411 79.762 1.00 30.76 C ATOM 11596 O SER B 226 49.702 40.684 78.746 1.00 28.96 O ATOM 11597 CB SER B 226 51.032 43.017 78.523 1.00 30.06 C ATOM 11598 OG SER B 226 51.457 44.368 78.335 1.00 29.69 O ATOM 11599 HA SER B 226 49.212 43.496 79.659 1.00 0.00 H ATOM 11600 HB2 SER B 226 50.507 42.689 77.626 1.00 0.00 H ATOM 11601 HB3 SER B 226 51.912 42.393 78.677 1.00 0.00 H ATOM 11602 HG SER B 226 51.943 44.675 79.141 1.00 0.00 H ATOM 11603 H SER B 226 50.421 44.146 81.448 1.00 0.00 H ATOM 11604 N GLY B 227 49.004 40.991 80.883 1.00 29.26 N ATOM 11605 CA GLY B 227 48.423 39.651 80.937 1.00 27.60 C ATOM 11606 C GLY B 227 47.581 39.542 82.184 1.00 28.81 C ATOM 11607 O GLY B 227 47.809 40.257 83.164 1.00 28.35 O ATOM 11608 HA3 GLY B 227 49.218 38.906 80.964 1.00 0.00 H ATOM 11609 HA2 GLY B 227 47.801 39.484 80.058 1.00 0.00 H ATOM 11610 H GLY B 227 48.973 41.610 81.718 1.00 0.00 H ATOM 11611 N SER B 228 46.587 38.666 82.148 1.00 28.98 N ATOM 11612 CA SER B 228 45.728 38.459 83.266 1.00 30.51 C ATOM 11613 C SER B 228 45.223 37.028 83.128 1.00 30.23 C ATOM 11614 O SER B 228 45.241 36.440 82.055 1.00 29.17 O ATOM 11615 CB SER B 228 44.630 39.543 83.415 1.00 31.49 C ATOM 11616 OG SER B 228 43.776 39.522 82.367 1.00 35.89 O ATOM 11617 HA SER B 228 46.258 38.574 84.211 1.00 0.00 H ATOM 11618 HB2 SER B 228 45.103 40.524 83.469 1.00 0.00 H ATOM 11619 HB3 SER B 228 44.071 39.360 84.333 1.00 0.00 H ATOM 11620 HG SER B 228 43.340 38.635 82.316 1.00 0.00 H ATOM 11621 H SER B 228 46.430 38.115 81.280 1.00 0.00 H ATOM 11622 N PRO B 229 44.837 36.435 84.251 1.00 30.42 N ATOM 11623 CA PRO B 229 44.404 35.030 84.186 1.00 30.45 C ATOM 11624 C PRO B 229 43.278 34.637 83.303 1.00 30.56 C ATOM 11625 O PRO B 229 43.259 33.511 82.803 1.00 29.92 O ATOM 11626 CB PRO B 229 44.182 34.642 85.677 1.00 30.58 C ATOM 11627 CG PRO B 229 43.720 36.027 86.332 1.00 32.41 C ATOM 11628 CD PRO B 229 44.617 37.065 85.579 1.00 29.14 C ATOM 11629 HA PRO B 229 45.179 34.467 83.666 1.00 0.00 H ATOM 11630 HD3 PRO B 229 44.104 38.022 85.477 1.00 0.00 H ATOM 11631 HD2 PRO B 229 45.562 37.215 86.101 1.00 0.00 H ATOM 11632 HG3 PRO B 229 43.914 36.041 87.405 1.00 0.00 H ATOM 11633 HG2 PRO B 229 42.661 36.216 86.153 1.00 0.00 H ATOM 11634 HB2 PRO B 229 43.407 33.882 85.775 1.00 0.00 H ATOM 11635 HB3 PRO B 229 45.104 34.280 86.131 1.00 0.00 H ATOM 11636 N ASN B 230 42.339 35.567 83.130 1.00 30.22 N ATOM 11637 CA ASN B 230 41.151 35.370 82.355 1.00 31.79 C ATOM 11638 C ASN B 230 41.349 35.682 80.878 1.00 31.98 C ATOM 11639 O ASN B 230 40.351 35.752 80.163 1.00 31.10 O ATOM 11640 CB ASN B 230 40.013 36.272 82.903 1.00 31.84 C ATOM 11641 CG ASN B 230 40.425 37.754 82.949 1.00 33.83 C ATOM 11642 OD1 ASN B 230 41.501 38.079 83.445 1.00 33.78 O ATOM 11643 ND2 ASN B 230 39.582 38.644 82.443 1.00 31.82 N ATOM 11644 HA ASN B 230 40.892 34.315 82.442 1.00 0.00 H ATOM 11645 HB2 ASN B 230 39.140 36.169 82.258 1.00 0.00 H ATOM 11646 HB3 ASN B 230 39.759 35.945 83.911 1.00 0.00 H ATOM 11647 HD22 ASN B 230 38.680 38.330 82.031 1.00 0.00 H ATOM 11648 HD21 ASN B 230 39.823 39.656 82.458 1.00 0.00 H ATOM 11649 H ASN B 230 42.477 36.492 83.585 1.00 0.00 H ATOM 11650 N CYS B 231 42.583 35.896 80.403 1.00 30.88 N ATOM 11651 CA CYS B 231 42.722 36.178 78.967 1.00 32.57 C ATOM 11652 C CYS B 231 42.094 35.011 78.161 1.00 33.72 C ATOM 11653 O CYS B 231 42.200 33.827 78.555 1.00 35.12 O ATOM 11654 CB CYS B 231 44.203 36.371 78.582 1.00 32.54 C ATOM 11655 SG CYS B 231 44.867 37.990 79.188 1.00 33.05 S ATOM 11656 HA CYS B 231 42.200 37.106 78.732 1.00 0.00 H ATOM 11657 HB2 CYS B 231 44.293 36.337 77.496 1.00 0.00 H ATOM 11658 HB3 CYS B 231 44.790 35.563 79.019 1.00 0.00 H ATOM 11659 HG CYS B 231 44.766 38.041 80.563 1.00 0.00 H ATOM 11660 H CYS B 231 43.414 35.864 81.028 1.00 0.00 H ATOM 11661 N PRO B 232 41.410 35.332 77.044 1.00 33.24 N ATOM 11662 CA PRO B 232 40.764 34.294 76.219 1.00 32.08 C ATOM 11663 C PRO B 232 41.699 33.218 75.678 1.00 32.60 C ATOM 11664 O PRO B 232 41.251 32.108 75.335 1.00 32.36 O ATOM 11665 CB PRO B 232 40.069 35.107 75.091 1.00 30.80 C ATOM 11666 CG PRO B 232 40.988 36.363 74.933 1.00 31.47 C ATOM 11667 CD PRO B 232 41.288 36.686 76.439 1.00 31.24 C ATOM 11668 HA PRO B 232 40.073 33.698 76.815 1.00 0.00 H ATOM 11669 HD3 PRO B 232 42.215 37.249 76.544 1.00 0.00 H ATOM 11670 HD2 PRO B 232 40.471 37.247 76.892 1.00 0.00 H ATOM 11671 HG3 PRO B 232 40.467 37.184 74.441 1.00 0.00 H ATOM 11672 HG2 PRO B 232 41.899 36.129 74.382 1.00 0.00 H ATOM 11673 HB2 PRO B 232 40.028 34.534 74.165 1.00 0.00 H ATOM 11674 HB3 PRO B 232 39.059 35.396 75.383 1.00 0.00 H ATOM 11675 N TRP B 233 42.989 33.538 75.562 1.00 32.75 N ATOM 11676 CA TRP B 233 43.987 32.575 75.064 1.00 31.54 C ATOM 11677 C TRP B 233 44.724 31.854 76.175 1.00 31.86 C ATOM 11678 O TRP B 233 45.506 30.948 75.893 1.00 34.46 O ATOM 11679 CB TRP B 233 45.079 33.278 74.232 1.00 30.42 C ATOM 11680 CG TRP B 233 45.621 34.519 74.990 1.00 30.13 C ATOM 11681 CD1 TRP B 233 45.111 35.797 74.929 1.00 30.09 C ATOM 11682 CD2 TRP B 233 46.723 34.576 75.917 1.00 30.02 C ATOM 11683 NE1 TRP B 233 45.821 36.638 75.749 1.00 29.36 N ATOM 11684 CE2 TRP B 233 46.822 35.928 76.365 1.00 29.91 C ATOM 11685 CE3 TRP B 233 47.645 33.624 76.405 1.00 29.59 C ATOM 11686 CZ2 TRP B 233 47.813 36.358 77.280 1.00 29.26 C ATOM 11687 CZ3 TRP B 233 48.649 34.046 77.316 1.00 28.90 C ATOM 11688 CH2 TRP B 233 48.724 35.408 77.746 1.00 29.95 C ATOM 11689 HA TRP B 233 43.409 31.867 74.470 1.00 0.00 H ATOM 11690 HB2 TRP B 233 45.898 32.581 74.051 1.00 0.00 H ATOM 11691 HB3 TRP B 233 44.656 33.595 73.279 1.00 0.00 H ATOM 11692 HE1 TRP B 233 45.631 37.652 75.883 1.00 0.00 H ATOM 11693 HD1 TRP B 233 44.262 36.098 74.315 1.00 0.00 H ATOM 11694 HZ2 TRP B 233 47.863 37.396 77.610 1.00 0.00 H ATOM 11695 HH2 TRP B 233 49.503 35.708 78.447 1.00 0.00 H ATOM 11696 HZ3 TRP B 233 49.372 33.322 77.693 1.00 0.00 H ATOM 11697 HE3 TRP B 233 47.587 32.583 76.088 1.00 0.00 H ATOM 11698 H TRP B 233 43.299 34.494 75.831 1.00 0.00 H ATOM 11699 N ALA B 234 44.524 32.270 77.421 1.00 31.81 N ATOM 11700 CA ALA B 234 45.284 31.696 78.526 1.00 31.00 C ATOM 11701 C ALA B 234 44.840 30.372 79.168 1.00 30.77 C ATOM 11702 O ALA B 234 45.554 29.846 80.018 1.00 28.98 O ATOM 11703 CB ALA B 234 45.446 32.754 79.632 1.00 29.18 C ATOM 11704 HA ALA B 234 46.210 31.408 78.028 1.00 0.00 H ATOM 11705 HB1 ALA B 234 45.977 33.618 79.232 1.00 0.00 H ATOM 11706 HB2 ALA B 234 44.462 33.062 79.985 1.00 0.00 H ATOM 11707 HB3 ALA B 234 46.014 32.329 80.460 1.00 0.00 H ATOM 11708 H ALA B 234 43.819 33.011 77.610 1.00 0.00 H ATOM 11709 N SER B 235 43.672 29.855 78.795 1.00 32.72 N ATOM 11710 CA SER B 235 43.194 28.607 79.362 1.00 33.38 C ATOM 11711 C SER B 235 42.127 27.977 78.460 1.00 35.14 C ATOM 11712 O SER B 235 41.597 28.632 77.550 1.00 36.06 O ATOM 11713 CB SER B 235 42.653 28.838 80.781 1.00 30.99 C ATOM 11714 OG SER B 235 41.430 29.569 80.793 1.00 30.46 O ATOM 11715 HA SER B 235 44.030 27.911 79.426 1.00 0.00 H ATOM 11716 HB2 SER B 235 43.397 29.394 81.352 1.00 0.00 H ATOM 11717 HB3 SER B 235 42.485 27.869 81.252 1.00 0.00 H ATOM 11718 HG SER B 235 41.572 30.455 80.375 1.00 0.00 H ATOM 11719 H SER B 235 43.094 30.352 78.088 1.00 0.00 H ATOM 11720 N VAL B 236 41.867 26.688 78.669 1.00 35.74 N ATOM 11721 CA VAL B 236 40.837 25.973 77.923 1.00 34.92 C ATOM 11722 C VAL B 236 40.096 25.050 78.918 1.00 36.59 C ATOM 11723 O VAL B 236 40.581 24.815 80.056 1.00 36.22 O ATOM 11724 CB VAL B 236 41.420 25.088 76.810 1.00 33.83 C ATOM 11725 CG1 VAL B 236 42.051 25.976 75.697 1.00 32.57 C ATOM 11726 CG2 VAL B 236 42.469 24.102 77.395 1.00 33.19 C ATOM 11727 HA VAL B 236 40.182 26.710 77.458 1.00 0.00 H ATOM 11728 HB VAL B 236 40.616 24.501 76.367 1.00 0.00 H ATOM 11729 HG11 VAL B 236 41.285 26.626 75.274 1.00 0.00 H ATOM 11730 HG12 VAL B 236 42.848 26.583 76.127 1.00 0.00 H ATOM 11731 HG13 VAL B 236 42.461 25.338 74.914 1.00 0.00 H ATOM 11732 HG21 VAL B 236 43.277 24.667 77.860 1.00 0.00 H ATOM 11733 HG22 VAL B 236 41.992 23.467 78.141 1.00 0.00 H ATOM 11734 HG23 VAL B 236 42.871 23.483 76.593 1.00 0.00 H ATOM 11735 H VAL B 236 42.416 26.174 79.387 1.00 0.00 H ATOM 11736 N SER B 237 38.941 24.541 78.498 1.00 33.99 N ATOM 11737 CA SER B 237 38.159 23.621 79.327 1.00 35.46 C ATOM 11738 C SER B 237 38.897 22.280 79.287 1.00 35.85 C ATOM 11739 O SER B 237 39.763 22.076 78.405 1.00 34.72 O ATOM 11740 CB SER B 237 36.777 23.396 78.697 1.00 32.77 C ATOM 11741 OG SER B 237 36.967 22.786 77.411 1.00 33.70 O ATOM 11742 HA SER B 237 38.042 24.018 80.336 1.00 0.00 H ATOM 11743 HB2 SER B 237 36.264 24.350 78.581 1.00 0.00 H ATOM 11744 HB3 SER B 237 36.183 22.740 79.333 1.00 0.00 H ATOM 11745 HG SER B 237 37.436 21.921 77.523 1.00 0.00 H ATOM 11746 H SER B 237 38.584 24.803 77.557 1.00 0.00 H ATOM 11747 N VAL B 238 38.544 21.367 80.197 1.00 36.24 N ATOM 11748 CA VAL B 238 39.199 20.064 80.175 1.00 38.05 C ATOM 11749 C VAL B 238 38.800 19.328 78.912 1.00 37.85 C ATOM 11750 O VAL B 238 39.589 18.546 78.390 1.00 38.22 O ATOM 11751 CB VAL B 238 38.862 19.173 81.416 1.00 39.40 C ATOM 11752 CG1 VAL B 238 39.326 19.849 82.674 1.00 40.60 C ATOM 11753 CG2 VAL B 238 37.392 18.900 81.502 1.00 40.55 C ATOM 11754 HA VAL B 238 40.272 20.251 80.204 1.00 0.00 H ATOM 11755 HB VAL B 238 39.381 18.222 81.300 1.00 0.00 H ATOM 11756 HG11 VAL B 238 40.404 20.004 82.625 1.00 0.00 H ATOM 11757 HG12 VAL B 238 38.823 20.811 82.775 1.00 0.00 H ATOM 11758 HG13 VAL B 238 39.087 19.221 83.532 1.00 0.00 H ATOM 11759 HG21 VAL B 238 36.853 19.843 81.593 1.00 0.00 H ATOM 11760 HG22 VAL B 238 37.067 18.380 80.601 1.00 0.00 H ATOM 11761 HG23 VAL B 238 37.190 18.279 82.374 1.00 0.00 H ATOM 11762 H VAL B 238 37.816 21.582 80.908 1.00 0.00 H ATOM 11763 N ALA B 239 37.590 19.568 78.406 1.00 38.91 N ATOM 11764 CA ALA B 239 37.171 18.890 77.149 1.00 40.30 C ATOM 11765 C ALA B 239 38.023 19.354 75.941 1.00 39.08 C ATOM 11766 O ALA B 239 38.478 18.544 75.124 1.00 38.49 O ATOM 11767 CB ALA B 239 35.659 19.156 76.862 1.00 39.65 C ATOM 11768 HA ALA B 239 37.329 17.820 77.286 1.00 0.00 H ATOM 11769 HB1 ALA B 239 35.061 18.772 77.688 1.00 0.00 H ATOM 11770 HB2 ALA B 239 35.493 20.228 76.759 1.00 0.00 H ATOM 11771 HB3 ALA B 239 35.372 18.652 75.939 1.00 0.00 H ATOM 11772 H ALA B 239 36.943 20.225 78.887 1.00 0.00 H ATOM 11773 N GLU B 240 38.243 20.664 75.828 1.00 38.74 N ATOM 11774 CA GLU B 240 39.071 21.179 74.710 1.00 37.38 C ATOM 11775 C GLU B 240 40.556 20.733 74.884 1.00 35.54 C ATOM 11776 O GLU B 240 41.217 20.324 73.924 1.00 35.43 O ATOM 11777 CB GLU B 240 38.948 22.714 74.612 1.00 36.23 C ATOM 11778 CG GLU B 240 39.864 23.373 73.497 1.00 36.68 C ATOM 11779 CD GLU B 240 39.638 22.795 72.080 1.00 37.49 C ATOM 11780 OE1 GLU B 240 38.628 22.082 71.880 1.00 36.71 O ATOM 11781 OE2 GLU B 240 40.474 23.058 71.176 1.00 35.53 O ATOM 11782 HA GLU B 240 38.705 20.757 73.774 1.00 0.00 H ATOM 11783 HB2 GLU B 240 37.910 22.960 74.390 1.00 0.00 H ATOM 11784 HB3 GLU B 240 39.223 23.141 75.576 1.00 0.00 H ATOM 11785 HG2 GLU B 240 39.656 24.443 73.469 1.00 0.00 H ATOM 11786 HG3 GLU B 240 40.907 23.214 73.771 1.00 0.00 H ATOM 11787 H GLU B 240 37.835 21.323 76.522 1.00 0.00 H ATOM 11788 N GLY B 241 41.062 20.780 76.115 1.00 36.80 N ATOM 11789 CA GLY B 241 42.424 20.302 76.356 1.00 37.25 C ATOM 11790 C GLY B 241 42.563 18.836 75.944 1.00 38.22 C ATOM 11791 O GLY B 241 43.543 18.429 75.302 1.00 36.77 O ATOM 11792 HA3 GLY B 241 42.655 20.399 77.417 1.00 0.00 H ATOM 11793 HA2 GLY B 241 43.123 20.905 75.776 1.00 0.00 H ATOM 11794 H GLY B 241 40.492 21.154 76.901 1.00 0.00 H ATOM 11795 N ARG B 242 41.559 18.027 76.307 1.00 38.60 N ATOM 11796 CA ARG B 242 41.575 16.597 75.974 1.00 38.64 C ATOM 11797 C ARG B 242 41.568 16.427 74.454 1.00 38.19 C ATOM 11798 O ARG B 242 42.370 15.679 73.882 1.00 37.52 O ATOM 11799 CB ARG B 242 40.352 15.921 76.636 1.00 38.55 C ATOM 11800 CG ARG B 242 40.040 14.501 76.136 1.00 41.54 C ATOM 11801 CD ARG B 242 39.058 13.728 77.108 1.00 41.25 C ATOM 11802 NE ARG B 242 39.732 13.413 78.375 1.00 41.64 N ATOM 11803 CZ ARG B 242 40.612 12.424 78.501 1.00 43.10 C ATOM 11804 NH1 ARG B 242 41.229 12.195 79.670 1.00 41.94 N ATOM 11805 NH2 ARG B 242 40.849 11.636 77.453 1.00 42.57 N ATOM 11806 HA ARG B 242 42.479 16.120 76.354 1.00 0.00 H ATOM 11807 HB2 ARG B 242 40.535 15.869 77.709 1.00 0.00 H ATOM 11808 HB3 ARG B 242 39.478 16.545 76.448 1.00 0.00 H ATOM 11809 HG2 ARG B 242 39.578 14.569 75.151 1.00 0.00 H ATOM 11810 HG3 ARG B 242 40.973 13.942 76.061 1.00 0.00 H ATOM 11811 HD2 ARG B 242 38.737 12.802 76.632 1.00 0.00 H ATOM 11812 HD3 ARG B 242 38.187 14.352 77.310 1.00 0.00 H ATOM 11813 HE ARG B 242 39.511 13.990 79.212 1.00 0.00 H ATOM 11814 HH12 ARG B 242 41.915 11.418 79.752 1.00 0.00 H ATOM 11815 HH11 ARG B 242 41.022 12.795 80.494 1.00 0.00 H ATOM 11816 HH22 ARG B 242 41.534 10.857 77.532 1.00 0.00 H ATOM 11817 HH21 ARG B 242 40.349 11.800 76.556 1.00 0.00 H ATOM 11818 H ARG B 242 40.753 18.419 76.835 1.00 0.00 H ATOM 11819 N ARG B 243 40.662 17.153 73.805 1.00 37.67 N ATOM 11820 CA ARG B 243 40.565 17.118 72.358 1.00 38.75 C ATOM 11821 C ARG B 243 41.902 17.476 71.670 1.00 38.14 C ATOM 11822 O ARG B 243 42.278 16.842 70.674 1.00 37.62 O ATOM 11823 CB ARG B 243 39.451 18.060 71.923 1.00 38.92 C ATOM 11824 CG ARG B 243 39.091 18.015 70.442 1.00 40.69 C ATOM 11825 CD ARG B 243 38.797 19.480 69.907 1.00 42.24 C ATOM 11826 NE ARG B 243 39.635 19.493 68.741 1.00 47.51 N ATOM 11827 CZ ARG B 243 40.521 20.392 68.373 1.00 45.75 C ATOM 11828 NH1 ARG B 243 40.769 21.509 69.051 1.00 42.67 N ATOM 11829 NH2 ARG B 243 41.213 20.073 67.296 1.00 49.18 N ATOM 11830 HA ARG B 243 40.332 16.099 72.047 1.00 0.00 H ATOM 11831 HB2 ARG B 243 38.557 17.809 72.494 1.00 0.00 H ATOM 11832 HB3 ARG B 243 39.759 19.078 72.163 1.00 0.00 H ATOM 11833 HG2 ARG B 243 39.922 17.586 69.882 1.00 0.00 H ATOM 11834 HG3 ARG B 243 38.204 17.396 70.305 1.00 0.00 H ATOM 11835 HD2 ARG B 243 39.095 20.242 70.628 1.00 0.00 H ATOM 11836 HD3 ARG B 243 37.746 19.614 69.652 1.00 0.00 H ATOM 11837 HE ARG B 243 39.526 18.681 68.101 1.00 0.00 H ATOM 11838 HH12 ARG B 243 41.484 22.180 68.704 1.00 0.00 H ATOM 11839 HH11 ARG B 243 40.248 21.712 69.928 1.00 0.00 H ATOM 11840 HH22 ARG B 243 41.937 20.725 66.931 1.00 0.00 H ATOM 11841 HH21 ARG B 243 41.035 19.170 66.812 1.00 0.00 H ATOM 11842 H ARG B 243 40.011 17.757 74.345 1.00 0.00 H ATOM 11843 N ARG B 244 42.638 18.458 72.205 1.00 37.55 N ATOM 11844 CA ARG B 244 43.918 18.825 71.598 1.00 35.56 C ATOM 11845 C ARG B 244 44.997 17.787 71.835 1.00 34.92 C ATOM 11846 O ARG B 244 45.898 17.605 70.973 1.00 33.28 O ATOM 11847 CB ARG B 244 44.404 20.207 72.097 1.00 36.32 C ATOM 11848 CG ARG B 244 43.441 21.343 71.695 1.00 34.09 C ATOM 11849 CD ARG B 244 43.902 22.713 72.196 1.00 35.31 C ATOM 11850 NE ARG B 244 42.887 23.755 71.976 1.00 34.54 N ATOM 11851 CZ ARG B 244 43.082 25.062 72.144 1.00 32.74 C ATOM 11852 NH1 ARG B 244 44.266 25.542 72.526 1.00 31.66 N ATOM 11853 NH2 ARG B 244 42.071 25.885 71.976 1.00 31.23 N ATOM 11854 HA ARG B 244 43.736 18.876 70.524 1.00 0.00 H ATOM 11855 HB2 ARG B 244 44.482 20.181 73.184 1.00 0.00 H ATOM 11856 HB3 ARG B 244 45.385 20.410 71.668 1.00 0.00 H ATOM 11857 HG2 ARG B 244 43.373 21.374 70.608 1.00 0.00 H ATOM 11858 HG3 ARG B 244 42.457 21.131 72.114 1.00 0.00 H ATOM 11859 HD2 ARG B 244 44.813 22.992 71.667 1.00 0.00 H ATOM 11860 HD3 ARG B 244 44.110 22.645 73.264 1.00 0.00 H ATOM 11861 HE ARG B 244 41.944 23.447 71.665 1.00 0.00 H ATOM 11862 HH12 ARG B 244 44.396 26.566 72.651 1.00 0.00 H ATOM 11863 HH11 ARG B 244 45.059 24.892 72.699 1.00 0.00 H ATOM 11864 HH22 ARG B 244 42.207 26.908 72.103 1.00 0.00 H ATOM 11865 HH21 ARG B 244 41.135 25.513 71.716 1.00 0.00 H ATOM 11866 H ARG B 244 42.300 18.960 73.051 1.00 0.00 H ATOM 11867 N ALA B 245 44.938 17.110 72.987 1.00 34.87 N ATOM 11868 CA ALA B 245 45.945 16.073 73.290 1.00 36.82 C ATOM 11869 C ALA B 245 45.734 14.895 72.337 1.00 38.34 C ATOM 11870 O ALA B 245 46.696 14.364 71.755 1.00 38.70 O ATOM 11871 CB ALA B 245 45.819 15.590 74.760 1.00 38.30 C ATOM 11872 HA ALA B 245 46.942 16.493 73.158 1.00 0.00 H ATOM 11873 HB1 ALA B 245 45.971 16.434 75.433 1.00 0.00 H ATOM 11874 HB2 ALA B 245 44.825 15.171 74.920 1.00 0.00 H ATOM 11875 HB3 ALA B 245 46.572 14.827 74.956 1.00 0.00 H ATOM 11876 H ALA B 245 44.181 17.314 73.671 1.00 0.00 H ATOM 11877 N VAL B 246 44.464 14.519 72.152 1.00 39.14 N ATOM 11878 CA VAL B 246 44.124 13.433 71.237 1.00 39.36 C ATOM 11879 C VAL B 246 44.523 13.842 69.789 1.00 41.12 C ATOM 11880 O VAL B 246 45.074 13.017 69.031 1.00 41.63 O ATOM 11881 CB VAL B 246 42.595 13.097 71.302 1.00 38.43 C ATOM 11882 CG1 VAL B 246 42.245 12.087 70.177 1.00 38.89 C ATOM 11883 CG2 VAL B 246 42.199 12.530 72.695 1.00 36.32 C ATOM 11884 HA VAL B 246 44.673 12.539 71.533 1.00 0.00 H ATOM 11885 HB VAL B 246 42.027 14.015 71.154 1.00 0.00 H ATOM 11886 HG11 VAL B 246 42.482 12.527 69.208 1.00 0.00 H ATOM 11887 HG12 VAL B 246 42.826 11.175 70.315 1.00 0.00 H ATOM 11888 HG13 VAL B 246 41.182 11.851 70.220 1.00 0.00 H ATOM 11889 HG21 VAL B 246 42.763 11.618 72.888 1.00 0.00 H ATOM 11890 HG22 VAL B 246 42.425 13.269 73.464 1.00 0.00 H ATOM 11891 HG23 VAL B 246 41.132 12.308 72.705 1.00 0.00 H ATOM 11892 H VAL B 246 43.706 15.008 72.669 1.00 0.00 H ATOM 11893 N GLU B 247 44.276 15.101 69.400 1.00 38.62 N ATOM 11894 CA GLU B 247 44.675 15.524 68.040 1.00 39.67 C ATOM 11895 C GLU B 247 46.209 15.499 67.893 1.00 37.94 C ATOM 11896 O GLU B 247 46.741 15.172 66.826 1.00 38.95 O ATOM 11897 CB GLU B 247 44.121 16.933 67.707 1.00 40.38 C ATOM 11898 CG GLU B 247 44.278 17.328 66.248 1.00 43.25 C ATOM 11899 CD GLU B 247 43.523 16.389 65.267 1.00 46.77 C ATOM 11900 OE1 GLU B 247 43.840 16.449 64.048 1.00 47.53 O ATOM 11901 OE2 GLU B 247 42.622 15.623 65.707 1.00 47.10 O ATOM 11902 HA GLU B 247 44.246 14.817 67.330 1.00 0.00 H ATOM 11903 HB2 GLU B 247 43.060 16.952 67.956 1.00 0.00 H ATOM 11904 HB3 GLU B 247 44.650 17.663 68.319 1.00 0.00 H ATOM 11905 HG2 GLU B 247 43.894 18.340 66.121 1.00 0.00 H ATOM 11906 HG3 GLU B 247 45.339 17.309 65.997 1.00 0.00 H ATOM 11907 H GLU B 247 43.810 15.771 70.045 1.00 0.00 H ATOM 11908 N LEU B 248 46.934 15.793 68.973 1.00 38.12 N ATOM 11909 CA LEU B 248 48.407 15.757 68.900 1.00 37.63 C ATOM 11910 C LEU B 248 48.801 14.294 68.625 1.00 38.66 C ATOM 11911 O LEU B 248 49.565 14.028 67.708 1.00 39.01 O ATOM 11912 CB LEU B 248 49.064 16.232 70.211 1.00 35.90 C ATOM 11913 CG LEU B 248 50.608 16.376 70.154 1.00 37.06 C ATOM 11914 CD1 LEU B 248 50.988 17.613 69.311 1.00 36.73 C ATOM 11915 CD2 LEU B 248 51.201 16.482 71.540 1.00 33.11 C ATOM 11916 HA LEU B 248 48.752 16.429 68.114 1.00 0.00 H ATOM 11917 HB2 LEU B 248 48.642 17.204 70.469 1.00 0.00 H ATOM 11918 HB3 LEU B 248 48.819 15.513 70.993 1.00 0.00 H ATOM 11919 HG LEU B 248 51.018 15.481 69.685 1.00 0.00 H ATOM 11920 HD21 LEU B 248 50.789 17.356 72.044 1.00 0.00 H ATOM 11921 HD22 LEU B 248 50.957 15.584 72.108 1.00 0.00 H ATOM 11922 HD23 LEU B 248 52.284 16.582 71.464 1.00 0.00 H ATOM 11923 HD11 LEU B 248 50.599 17.495 68.300 1.00 0.00 H ATOM 11924 HD12 LEU B 248 50.559 18.506 69.765 1.00 0.00 H ATOM 11925 HD13 LEU B 248 52.073 17.707 69.276 1.00 0.00 H ATOM 11926 H LEU B 248 46.462 16.047 69.864 1.00 0.00 H ATOM 11927 N GLY B 249 48.267 13.361 69.412 1.00 39.82 N ATOM 11928 CA GLY B 249 48.557 11.943 69.203 1.00 41.13 C ATOM 11929 C GLY B 249 48.185 11.514 67.787 1.00 41.30 C ATOM 11930 O GLY B 249 48.941 10.813 67.126 1.00 41.64 O ATOM 11931 HA3 GLY B 249 47.984 11.352 69.917 1.00 0.00 H ATOM 11932 HA2 GLY B 249 49.621 11.769 69.361 1.00 0.00 H ATOM 11933 H GLY B 249 47.634 13.645 70.187 1.00 0.00 H ATOM 11934 N ARG B 250 47.033 11.966 67.304 1.00 41.03 N ATOM 11935 CA ARG B 250 46.596 11.649 65.951 1.00 42.04 C ATOM 11936 C ARG B 250 47.627 12.140 64.894 1.00 43.84 C ATOM 11937 O ARG B 250 47.802 11.504 63.857 1.00 45.88 O ATOM 11938 CB ARG B 250 45.184 12.256 65.750 1.00 43.00 C ATOM 11939 CG ARG B 250 44.388 11.829 64.474 1.00 43.76 C ATOM 11940 CD ARG B 250 42.927 12.329 64.478 1.00 41.96 C ATOM 11941 NE ARG B 250 42.096 11.685 65.508 1.00 43.33 N ATOM 11942 HA ARG B 250 46.536 10.570 65.811 1.00 0.00 H ATOM 11943 HB2 ARG B 250 44.584 11.980 66.617 1.00 0.00 H ATOM 11944 HB3 ARG B 250 45.296 13.340 65.717 1.00 0.00 H ATOM 11945 HG2 ARG B 250 44.892 12.236 63.597 1.00 0.00 H ATOM 11946 HG3 ARG B 250 44.383 10.741 64.416 1.00 0.00 H ATOM 11947 HD2 ARG B 250 42.488 12.125 63.501 1.00 0.00 H ATOM 11948 HD3 ARG B 250 42.929 13.404 64.657 1.00 0.00 H ATOM 11949 HE ARG B 250 42.511 10.971 66.140 1.00 0.00 H ATOM 11950 H ARG B 250 46.429 12.561 67.906 1.00 0.00 H ATOM 11951 N ASN B 251 48.348 13.241 65.158 1.00 44.12 N ATOM 11952 CA ASN B 251 49.345 13.786 64.209 1.00 42.39 C ATOM 11953 C ASN B 251 50.638 12.976 64.208 1.00 43.20 C ATOM 11954 O ASN B 251 51.438 13.062 63.262 1.00 42.61 O ATOM 11955 CB ASN B 251 49.699 15.262 64.560 1.00 42.10 C ATOM 11956 CG ASN B 251 48.837 16.294 63.808 1.00 41.09 C ATOM 11957 OD1 ASN B 251 49.240 16.810 62.755 1.00 42.05 O ATOM 11958 ND2 ASN B 251 47.654 16.586 64.343 1.00 39.64 N ATOM 11959 HA ASN B 251 48.887 13.731 63.221 1.00 0.00 H ATOM 11960 HB2 ASN B 251 49.556 15.407 65.631 1.00 0.00 H ATOM 11961 HB3 ASN B 251 50.745 15.436 64.308 1.00 0.00 H ATOM 11962 HD22 ASN B 251 47.357 16.129 65.228 1.00 0.00 H ATOM 11963 HD21 ASN B 251 47.027 17.272 63.876 1.00 0.00 H ATOM 11964 H ASN B 251 48.201 13.730 66.064 1.00 0.00 H ATOM 11965 N LEU B 252 50.848 12.199 65.272 1.00 44.25 N ATOM 11966 CA LEU B 252 52.057 11.390 65.415 1.00 44.73 C ATOM 11967 C LEU B 252 51.765 9.890 65.289 1.00 46.70 C ATOM 11968 O LEU B 252 52.577 9.042 65.679 1.00 46.57 O ATOM 11969 CB LEU B 252 52.730 11.710 66.753 1.00 43.54 C ATOM 11970 CG LEU B 252 53.192 13.190 66.807 1.00 43.62 C ATOM 11971 CD1 LEU B 252 53.593 13.539 68.196 1.00 43.77 C ATOM 11972 CD2 LEU B 252 54.352 13.445 65.870 1.00 43.78 C ATOM 11973 HA LEU B 252 52.736 11.643 64.601 1.00 0.00 H ATOM 11974 HB2 LEU B 252 52.021 11.529 67.561 1.00 0.00 H ATOM 11975 HB3 LEU B 252 53.597 11.061 66.880 1.00 0.00 H ATOM 11976 HG LEU B 252 52.356 13.813 66.490 1.00 0.00 H ATOM 11977 HD21 LEU B 252 55.192 12.811 66.153 1.00 0.00 H ATOM 11978 HD22 LEU B 252 54.049 13.215 64.848 1.00 0.00 H ATOM 11979 HD23 LEU B 252 54.647 14.492 65.936 1.00 0.00 H ATOM 11980 HD11 LEU B 252 52.743 13.400 68.864 1.00 0.00 H ATOM 11981 HD12 LEU B 252 54.412 12.892 68.510 1.00 0.00 H ATOM 11982 HD13 LEU B 252 53.917 14.579 68.229 1.00 0.00 H ATOM 11983 H LEU B 252 50.129 12.168 66.023 1.00 0.00 H ATOM 11984 N ASN B 253 50.587 9.594 64.745 1.00 48.47 N ATOM 11985 CA ASN B 253 50.153 8.229 64.506 1.00 50.46 C ATOM 11986 C ASN B 253 50.186 7.410 65.782 1.00 50.54 C ATOM 11987 O ASN B 253 50.702 6.294 65.815 1.00 50.67 O ATOM 11988 CB ASN B 253 51.052 7.619 63.436 1.00 52.19 C ATOM 11989 CG ASN B 253 51.179 8.534 62.192 1.00 56.21 C ATOM 11990 OD1 ASN B 253 50.180 8.840 61.506 1.00 57.83 O ATOM 11991 ND2 ASN B 253 52.402 8.994 61.922 1.00 56.45 N ATOM 11992 HA ASN B 253 49.119 8.229 64.160 1.00 0.00 H ATOM 11993 HB2 ASN B 253 52.044 7.460 63.859 1.00 0.00 H ATOM 11994 HB3 ASN B 253 50.632 6.662 63.127 1.00 0.00 H ATOM 11995 HD22 ASN B 253 53.206 8.714 62.519 1.00 0.00 H ATOM 11996 HD21 ASN B 253 52.551 9.632 61.115 1.00 0.00 H ATOM 11997 H ASN B 253 49.951 10.373 64.480 1.00 0.00 H ATOM 11998 N CYS B 254 49.640 7.975 66.842 1.00 48.64 N ATOM 11999 CA CYS B 254 49.618 7.272 68.103 1.00 49.27 C ATOM 12000 C CYS B 254 48.399 6.386 68.243 1.00 48.87 C ATOM 12001 O CYS B 254 47.346 6.664 67.670 1.00 48.23 O ATOM 12002 CB CYS B 254 49.592 8.269 69.250 1.00 48.99 C ATOM 12003 SG CYS B 254 51.171 9.061 69.640 1.00 47.74 S ATOM 12004 HA CYS B 254 50.515 6.653 68.132 1.00 0.00 H ATOM 12005 HB2 CYS B 254 49.251 7.744 70.142 1.00 0.00 H ATOM 12006 HB3 CYS B 254 48.878 9.053 68.996 1.00 0.00 H ATOM 12007 H CYS B 254 49.226 8.926 66.769 1.00 0.00 H ATOM 12008 N ASN B 255 48.541 5.326 69.035 1.00 50.52 N ATOM 12009 CA ASN B 255 47.417 4.429 69.329 1.00 49.87 C ATOM 12010 C ASN B 255 46.548 5.318 70.202 1.00 49.81 C ATOM 12011 O ASN B 255 47.044 5.835 71.228 1.00 48.86 O ATOM 12012 CB ASN B 255 47.876 3.235 70.164 1.00 51.82 C ATOM 12013 CG ASN B 255 46.738 2.232 70.429 1.00 54.52 C ATOM 12014 OD1 ASN B 255 45.637 2.601 70.860 1.00 54.89 O ATOM 12015 ND2 ASN B 255 47.009 0.956 70.171 1.00 54.51 N ATOM 12016 HA ASN B 255 46.938 4.027 68.436 1.00 0.00 H ATOM 12017 HB2 ASN B 255 48.678 2.723 69.632 1.00 0.00 H ATOM 12018 HB3 ASN B 255 48.251 3.600 71.120 1.00 0.00 H ATOM 12019 HD22 ASN B 255 47.946 0.686 69.810 1.00 0.00 H ATOM 12020 HD21 ASN B 255 46.284 0.228 70.330 1.00 0.00 H ATOM 12021 H ASN B 255 49.471 5.128 69.456 1.00 0.00 H ATOM 12022 N LEU B 256 45.282 5.497 69.819 1.00 48.96 N ATOM 12023 CA LEU B 256 44.357 6.337 70.575 1.00 49.35 C ATOM 12024 C LEU B 256 43.299 5.595 71.370 1.00 51.32 C ATOM 12025 O LEU B 256 42.330 6.221 71.816 1.00 52.19 O ATOM 12026 CB LEU B 256 43.641 7.300 69.634 1.00 47.89 C ATOM 12027 CG LEU B 256 44.611 7.984 68.663 1.00 48.18 C ATOM 12028 CD1 LEU B 256 43.834 8.941 67.778 1.00 48.10 C ATOM 12029 CD2 LEU B 256 45.729 8.721 69.469 1.00 46.55 C ATOM 12030 HA LEU B 256 44.990 6.850 71.299 1.00 0.00 H ATOM 12031 HB2 LEU B 256 42.900 6.745 69.059 1.00 0.00 H ATOM 12032 HB3 LEU B 256 43.140 8.064 70.227 1.00 0.00 H ATOM 12033 HG LEU B 256 45.095 7.244 68.025 1.00 0.00 H ATOM 12034 HD21 LEU B 256 45.274 9.471 70.116 1.00 0.00 H ATOM 12035 HD22 LEU B 256 46.274 7.998 70.076 1.00 0.00 H ATOM 12036 HD23 LEU B 256 46.416 9.206 68.775 1.00 0.00 H ATOM 12037 HD11 LEU B 256 43.082 8.386 67.217 1.00 0.00 H ATOM 12038 HD12 LEU B 256 43.345 9.692 68.399 1.00 0.00 H ATOM 12039 HD13 LEU B 256 44.519 9.430 67.085 1.00 0.00 H ATOM 12040 H LEU B 256 44.944 5.024 68.956 1.00 0.00 H ATOM 12041 N ASN B 257 43.464 4.292 71.584 1.00 51.20 N ATOM 12042 CA ASN B 257 42.437 3.542 72.303 1.00 51.50 C ATOM 12043 C ASN B 257 42.206 3.942 73.769 1.00 52.09 C ATOM 12044 O ASN B 257 41.095 3.760 74.310 1.00 51.86 O ATOM 12045 CB ASN B 257 42.742 2.040 72.215 1.00 51.87 C ATOM 12046 HA ASN B 257 41.504 3.796 71.801 1.00 0.00 H ATOM 12047 HB2 ASN B 257 42.751 1.733 71.169 1.00 0.00 H ATOM 12048 HB3 ASN B 257 43.716 1.842 72.661 1.00 0.00 H ATOM 12049 H ASN B 257 44.320 3.810 71.241 1.00 0.00 H ATOM 12050 N SER B 258 43.239 4.478 74.420 1.00 50.98 N ATOM 12051 CA SER B 258 43.124 4.893 75.823 1.00 49.07 C ATOM 12052 C SER B 258 44.120 5.994 76.173 1.00 48.37 C ATOM 12053 O SER B 258 45.108 6.207 75.446 1.00 48.33 O ATOM 12054 CB SER B 258 43.421 3.708 76.740 1.00 48.83 C ATOM 12055 OG SER B 258 44.804 3.373 76.655 1.00 48.97 O ATOM 12056 HA SER B 258 42.108 5.263 75.962 1.00 0.00 H ATOM 12057 HB2 SER B 258 42.820 2.852 76.433 1.00 0.00 H ATOM 12058 HB3 SER B 258 43.174 3.973 77.768 1.00 0.00 H ATOM 12059 HG SER B 258 45.349 4.151 76.935 1.00 0.00 H ATOM 12060 H SER B 258 44.144 4.604 73.924 1.00 0.00 H ATOM 12061 N ASP B 259 43.879 6.665 77.304 1.00 48.05 N ATOM 12062 CA ASP B 259 44.786 7.712 77.761 1.00 47.89 C ATOM 12063 C ASP B 259 46.178 7.126 77.921 1.00 48.57 C ATOM 12064 O ASP B 259 47.155 7.720 77.481 1.00 48.29 O ATOM 12065 CB ASP B 259 44.329 8.311 79.096 1.00 46.15 C ATOM 12066 CG ASP B 259 43.176 9.276 78.926 1.00 46.89 C ATOM 12067 OD1 ASP B 259 42.753 9.499 77.778 1.00 45.50 O ATOM 12068 OD2 ASP B 259 42.693 9.840 79.928 1.00 49.08 O ATOM 12069 HA ASP B 259 44.790 8.510 77.019 1.00 0.00 H ATOM 12070 HB2 ASP B 259 44.015 7.501 79.755 1.00 0.00 H ATOM 12071 HB3 ASP B 259 45.167 8.841 79.548 1.00 0.00 H ATOM 12072 H ASP B 259 43.034 6.437 77.865 1.00 0.00 H ATOM 12073 N GLU B 260 46.250 5.947 78.536 1.00 48.86 N ATOM 12074 CA GLU B 260 47.516 5.249 78.793 1.00 49.70 C ATOM 12075 C GLU B 260 48.272 4.972 77.487 1.00 49.18 C ATOM 12076 O GLU B 260 49.505 5.148 77.407 1.00 49.07 O ATOM 12077 CB GLU B 260 47.238 3.929 79.557 1.00 50.66 C ATOM 12078 CG GLU B 260 46.142 4.056 80.715 1.00 53.62 C ATOM 12079 CD GLU B 260 44.736 4.539 80.223 1.00 52.13 C ATOM 12080 HA GLU B 260 48.148 5.890 79.407 1.00 0.00 H ATOM 12081 HB2 GLU B 260 46.892 3.185 78.839 1.00 0.00 H ATOM 12082 HB3 GLU B 260 48.172 3.591 80.006 1.00 0.00 H ATOM 12083 HG2 GLU B 260 46.023 3.078 81.181 1.00 0.00 H ATOM 12084 HG3 GLU B 260 46.508 4.768 81.455 1.00 0.00 H ATOM 12085 H GLU B 260 45.366 5.498 78.850 1.00 0.00 H ATOM 12086 N GLU B 261 47.540 4.536 76.461 1.00 49.07 N ATOM 12087 CA GLU B 261 48.157 4.260 75.157 1.00 49.04 C ATOM 12088 C GLU B 261 48.712 5.586 74.540 1.00 47.30 C ATOM 12089 O GLU B 261 49.872 5.645 74.108 1.00 44.88 O ATOM 12090 CB GLU B 261 47.112 3.616 74.208 1.00 52.63 C ATOM 12091 CG GLU B 261 46.697 2.134 74.509 1.00 57.15 C ATOM 12092 CD GLU B 261 47.706 1.135 73.921 1.00 61.78 C ATOM 12093 OE1 GLU B 261 48.870 1.557 73.714 1.00 62.58 O ATOM 12094 OE2 GLU B 261 47.357 -0.057 73.662 1.00 63.38 O ATOM 12095 HA GLU B 261 48.985 3.564 75.290 1.00 0.00 H ATOM 12096 HB2 GLU B 261 46.209 4.226 74.250 1.00 0.00 H ATOM 12097 HB3 GLU B 261 47.522 3.645 73.198 1.00 0.00 H ATOM 12098 HG2 GLU B 261 46.646 1.993 75.589 1.00 0.00 H ATOM 12099 HG3 GLU B 261 45.716 1.945 74.073 1.00 0.00 H ATOM 12100 H GLU B 261 46.518 4.389 76.586 1.00 0.00 H ATOM 12101 N LEU B 262 47.870 6.631 74.507 1.00 45.80 N ATOM 12102 CA LEU B 262 48.235 7.952 73.962 1.00 44.77 C ATOM 12103 C LEU B 262 49.467 8.534 74.680 1.00 43.89 C ATOM 12104 O LEU B 262 50.464 8.919 74.039 1.00 43.06 O ATOM 12105 CB LEU B 262 47.044 8.916 74.101 1.00 43.87 C ATOM 12106 CG LEU B 262 47.224 10.375 73.669 1.00 43.30 C ATOM 12107 CD1 LEU B 262 47.731 10.431 72.254 1.00 42.18 C ATOM 12108 CD2 LEU B 262 45.871 11.097 73.758 1.00 43.21 C ATOM 12109 HA LEU B 262 48.487 7.828 72.909 1.00 0.00 H ATOM 12110 HB2 LEU B 262 46.227 8.504 73.509 1.00 0.00 H ATOM 12111 HB3 LEU B 262 46.760 8.925 75.153 1.00 0.00 H ATOM 12112 HG LEU B 262 47.946 10.861 74.325 1.00 0.00 H ATOM 12113 HD21 LEU B 262 45.154 10.605 73.100 1.00 0.00 H ATOM 12114 HD22 LEU B 262 45.508 11.060 74.785 1.00 0.00 H ATOM 12115 HD23 LEU B 262 45.994 12.136 73.451 1.00 0.00 H ATOM 12116 HD11 LEU B 262 48.690 9.916 72.192 1.00 0.00 H ATOM 12117 HD12 LEU B 262 47.013 9.946 71.593 1.00 0.00 H ATOM 12118 HD13 LEU B 262 47.856 11.472 71.955 1.00 0.00 H ATOM 12119 H LEU B 262 46.910 6.502 74.886 1.00 0.00 H ATOM 12120 N ILE B 263 49.423 8.539 76.008 1.00 43.45 N ATOM 12121 CA ILE B 263 50.528 9.083 76.768 1.00 45.39 C ATOM 12122 C ILE B 263 51.817 8.300 76.552 1.00 46.65 C ATOM 12123 O ILE B 263 52.876 8.895 76.354 1.00 46.38 O ATOM 12124 CB ILE B 263 50.191 9.179 78.289 1.00 45.02 C ATOM 12125 CG1 ILE B 263 49.120 10.252 78.524 1.00 43.91 C ATOM 12126 CG2 ILE B 263 51.458 9.482 79.063 1.00 43.80 C ATOM 12127 CD1 ILE B 263 48.530 10.270 79.938 1.00 43.07 C ATOM 12128 HA ILE B 263 50.691 10.093 76.393 1.00 0.00 H ATOM 12129 HB ILE B 263 49.790 8.229 78.641 1.00 0.00 H ATOM 12130 HG12 ILE B 263 49.568 11.227 78.330 1.00 0.00 H ATOM 12131 HG13 ILE B 263 48.307 10.080 77.819 1.00 0.00 H ATOM 12132 HD11 ILE B 263 48.064 9.307 80.148 1.00 0.00 H ATOM 12133 HD12 ILE B 263 49.325 10.455 80.660 1.00 0.00 H ATOM 12134 HD13 ILE B 263 47.783 11.060 80.008 1.00 0.00 H ATOM 12135 HG21 ILE B 263 52.182 8.684 78.898 1.00 0.00 H ATOM 12136 HG22 ILE B 263 51.874 10.429 78.720 1.00 0.00 H ATOM 12137 HG23 ILE B 263 51.226 9.550 80.126 1.00 0.00 H ATOM 12138 H ILE B 263 48.594 8.152 76.502 1.00 0.00 H ATOM 12139 N HIS B 264 51.740 6.968 76.562 1.00 48.09 N ATOM 12140 CA HIS B 264 52.941 6.154 76.344 1.00 48.75 C ATOM 12141 C HIS B 264 53.545 6.496 74.989 1.00 48.00 C ATOM 12142 O HIS B 264 54.771 6.655 74.861 1.00 48.50 O ATOM 12143 CB HIS B 264 52.617 4.637 76.387 1.00 52.77 C ATOM 12144 CG HIS B 264 53.821 3.751 76.183 1.00 56.28 C ATOM 12145 ND1 HIS B 264 54.340 3.459 74.933 1.00 57.26 N ATOM 12146 CD2 HIS B 264 54.661 3.168 77.079 1.00 58.13 C ATOM 12147 CE1 HIS B 264 55.447 2.748 75.068 1.00 58.43 C ATOM 12148 NE2 HIS B 264 55.666 2.559 76.361 1.00 59.44 N ATOM 12149 HA HIS B 264 53.648 6.376 77.144 1.00 0.00 H ATOM 12150 HB2 HIS B 264 52.181 4.406 77.359 1.00 0.00 H ATOM 12151 HB3 HIS B 264 51.892 4.418 75.603 1.00 0.00 H ATOM 12152 HD2 HIS B 264 54.558 3.180 78.164 1.00 0.00 H ATOM 12153 HE1 HIS B 264 56.072 2.380 74.254 1.00 0.00 H ATOM 12154 H HIS B 264 50.824 6.504 76.725 1.00 0.00 H ATOM 12155 N CYS B 265 52.697 6.585 73.965 1.00 46.14 N ATOM 12156 CA CYS B 265 53.176 6.914 72.630 1.00 45.74 C ATOM 12157 C CYS B 265 53.855 8.299 72.652 1.00 45.00 C ATOM 12158 O CYS B 265 54.983 8.444 72.186 1.00 43.43 O ATOM 12159 CB CYS B 265 52.004 6.926 71.655 1.00 46.70 C ATOM 12160 SG CYS B 265 52.418 7.494 69.965 1.00 52.94 S ATOM 12161 HA CYS B 265 53.900 6.165 72.309 1.00 0.00 H ATOM 12162 HB2 CYS B 265 51.235 7.586 72.056 1.00 0.00 H ATOM 12163 HB3 CYS B 265 51.610 5.912 71.585 1.00 0.00 H ATOM 12164 H CYS B 265 51.682 6.418 74.121 1.00 0.00 H ATOM 12165 N LEU B 266 53.168 9.298 73.223 1.00 44.11 N ATOM 12166 CA LEU B 266 53.725 10.661 73.285 1.00 44.93 C ATOM 12167 C LEU B 266 55.033 10.708 74.078 1.00 46.15 C ATOM 12168 O LEU B 266 55.898 11.539 73.804 1.00 48.21 O ATOM 12169 CB LEU B 266 52.702 11.649 73.881 1.00 42.35 C ATOM 12170 CG LEU B 266 51.461 11.921 73.025 1.00 41.89 C ATOM 12171 CD1 LEU B 266 50.468 12.764 73.782 1.00 41.54 C ATOM 12172 CD2 LEU B 266 51.883 12.619 71.723 1.00 43.08 C ATOM 12173 HA LEU B 266 53.947 10.962 72.261 1.00 0.00 H ATOM 12174 HB2 LEU B 266 52.367 11.248 74.838 1.00 0.00 H ATOM 12175 HB3 LEU B 266 53.210 12.599 74.045 1.00 0.00 H ATOM 12176 HG LEU B 266 50.979 10.974 72.783 1.00 0.00 H ATOM 12177 HD21 LEU B 266 52.376 13.562 71.961 1.00 0.00 H ATOM 12178 HD22 LEU B 266 52.571 11.976 71.174 1.00 0.00 H ATOM 12179 HD23 LEU B 266 51.000 12.813 71.114 1.00 0.00 H ATOM 12180 HD11 LEU B 266 50.164 12.240 74.688 1.00 0.00 H ATOM 12181 HD12 LEU B 266 50.929 13.715 74.048 1.00 0.00 H ATOM 12182 HD13 LEU B 266 49.595 12.945 73.155 1.00 0.00 H ATOM 12183 H LEU B 266 52.229 9.109 73.628 1.00 0.00 H ATOM 12184 N ARG B 267 55.215 9.805 75.037 1.00 46.18 N ATOM 12185 CA ARG B 267 56.442 9.835 75.811 1.00 46.25 C ATOM 12186 C ARG B 267 57.626 9.216 75.091 1.00 47.60 C ATOM 12187 O ARG B 267 58.770 9.455 75.482 1.00 47.23 O ATOM 12188 CB ARG B 267 56.260 9.149 77.166 1.00 45.34 C ATOM 12189 CG ARG B 267 55.484 9.944 78.169 1.00 45.00 C ATOM 12190 CD ARG B 267 55.400 9.220 79.478 1.00 44.85 C ATOM 12191 NE ARG B 267 54.762 10.062 80.461 1.00 47.54 N ATOM 12192 CZ ARG B 267 54.071 9.607 81.500 1.00 48.55 C ATOM 12193 NH1 ARG B 267 53.942 8.298 81.677 1.00 48.41 N ATOM 12194 NH2 ARG B 267 53.505 10.465 82.354 1.00 49.08 N ATOM 12195 HA ARG B 267 56.664 10.892 75.958 1.00 0.00 H ATOM 12196 HB2 ARG B 267 55.738 8.206 77.002 1.00 0.00 H ATOM 12197 HB3 ARG B 267 57.248 8.949 77.581 1.00 0.00 H ATOM 12198 HG2 ARG B 267 55.978 10.904 78.323 1.00 0.00 H ATOM 12199 HG3 ARG B 267 54.476 10.112 77.789 1.00 0.00 H ATOM 12200 HD2 ARG B 267 56.404 8.965 79.816 1.00 0.00 H ATOM 12201 HD3 ARG B 267 54.818 8.307 79.350 1.00 0.00 H ATOM 12202 HE ARG B 267 54.849 11.092 80.349 1.00 0.00 H ATOM 12203 HH12 ARG B 267 53.403 7.934 82.488 1.00 0.00 H ATOM 12204 HH11 ARG B 267 54.380 7.637 81.005 1.00 0.00 H ATOM 12205 HH22 ARG B 267 52.964 10.108 83.167 1.00 0.00 H ATOM 12206 HH21 ARG B 267 53.606 11.489 82.205 1.00 0.00 H ATOM 12207 H ARG B 267 54.488 9.087 75.230 1.00 0.00 H ATOM 12208 N GLU B 268 57.383 8.415 74.056 1.00 49.19 N ATOM 12209 CA GLU B 268 58.520 7.843 73.321 1.00 50.81 C ATOM 12210 C GLU B 268 58.972 8.789 72.220 1.00 50.61 C ATOM 12211 O GLU B 268 60.082 8.645 71.746 1.00 52.51 O ATOM 12212 CB GLU B 268 58.209 6.459 72.708 1.00 51.34 C ATOM 12213 CG GLU B 268 58.057 5.281 73.742 1.00 53.51 C ATOM 12214 CD GLU B 268 59.296 5.074 74.631 1.00 52.45 C ATOM 12215 HA GLU B 268 59.317 7.707 74.052 1.00 0.00 H ATOM 12216 HB2 GLU B 268 57.276 6.540 72.150 1.00 0.00 H ATOM 12217 HB3 GLU B 268 59.019 6.204 72.024 1.00 0.00 H ATOM 12218 HG2 GLU B 268 57.204 5.495 74.385 1.00 0.00 H ATOM 12219 HG3 GLU B 268 57.872 4.360 73.190 1.00 0.00 H ATOM 12220 H GLU B 268 56.406 8.198 73.773 1.00 0.00 H ATOM 12221 N LYS B 269 58.137 9.743 71.800 1.00 49.15 N ATOM 12222 CA LYS B 269 58.546 10.705 70.743 1.00 47.51 C ATOM 12223 C LYS B 269 59.677 11.644 71.203 1.00 45.71 C ATOM 12224 O LYS B 269 59.725 12.022 72.353 1.00 44.97 O ATOM 12225 CB LYS B 269 57.361 11.572 70.332 1.00 48.50 C ATOM 12226 CG LYS B 269 56.166 10.797 69.841 1.00 51.68 C ATOM 12227 CD LYS B 269 56.528 10.075 68.535 1.00 53.23 C ATOM 12228 CE LYS B 269 55.399 9.201 68.051 1.00 54.06 C ATOM 12229 NZ LYS B 269 55.879 8.431 66.873 1.00 56.16 N ATOM 12230 HA LYS B 269 58.905 10.105 69.907 1.00 0.00 H ATOM 12231 HB2 LYS B 269 57.054 12.162 71.195 1.00 0.00 H ATOM 12232 HB3 LYS B 269 57.687 12.239 69.534 1.00 0.00 H ATOM 12233 HG2 LYS B 269 55.873 10.064 70.593 1.00 0.00 H ATOM 12234 HG3 LYS B 269 55.337 11.482 69.661 1.00 0.00 H ATOM 12235 HD2 LYS B 269 56.753 10.819 67.770 1.00 0.00 H ATOM 12236 HD3 LYS B 269 57.408 9.454 68.706 1.00 0.00 H ATOM 12237 HE2 LYS B 269 54.549 9.820 67.766 1.00 0.00 H ATOM 12238 HE3 LYS B 269 55.098 8.515 68.843 1.00 0.00 H ATOM 12239 HZ1 LYS B 269 56.167 9.091 66.123 1.00 0.00 H ATOM 12240 HZ2 LYS B 269 56.691 7.844 67.151 1.00 0.00 H ATOM 12241 HZ3 LYS B 269 55.113 7.821 66.524 1.00 0.00 H ATOM 12242 H LYS B 269 57.187 9.814 72.218 1.00 0.00 H ATOM 12243 N LYS B 270 60.596 12.024 70.317 1.00 45.44 N ATOM 12244 CA LYS B 270 61.648 12.951 70.732 1.00 45.59 C ATOM 12245 C LYS B 270 60.960 14.344 70.922 1.00 42.94 C ATOM 12246 O LYS B 270 59.902 14.595 70.342 1.00 41.43 O ATOM 12247 CB LYS B 270 62.771 13.006 69.676 1.00 48.98 C ATOM 12248 CG LYS B 270 63.619 11.701 69.553 1.00 54.39 C ATOM 12249 CD LYS B 270 64.803 11.544 70.590 1.00 58.90 C ATOM 12250 CE LYS B 270 64.399 11.426 72.094 1.00 62.26 C ATOM 12251 NZ LYS B 270 63.938 10.045 72.600 1.00 64.80 N ATOM 12252 HA LYS B 270 62.121 12.631 71.661 1.00 0.00 H ATOM 12253 HB2 LYS B 270 62.315 13.207 68.706 1.00 0.00 H ATOM 12254 HB3 LYS B 270 63.443 13.824 69.937 1.00 0.00 H ATOM 12255 HG2 LYS B 270 62.947 10.853 69.683 1.00 0.00 H ATOM 12256 HG3 LYS B 270 64.047 11.674 68.551 1.00 0.00 H ATOM 12257 HD2 LYS B 270 65.360 10.645 70.324 1.00 0.00 H ATOM 12258 HD3 LYS B 270 65.451 12.414 70.488 1.00 0.00 H ATOM 12259 HE2 LYS B 270 63.583 12.127 72.269 1.00 0.00 H ATOM 12260 HE3 LYS B 270 65.264 11.720 72.689 1.00 0.00 H ATOM 12261 HZ1 LYS B 270 63.099 9.743 72.064 1.00 0.00 H ATOM 12262 HZ2 LYS B 270 64.704 9.354 72.465 1.00 0.00 H ATOM 12263 HZ3 LYS B 270 63.701 10.109 73.611 1.00 0.00 H ATOM 12264 H LYS B 270 60.566 11.666 69.341 1.00 0.00 H ATOM 12265 N PRO B 271 61.540 15.245 71.742 1.00 40.68 N ATOM 12266 CA PRO B 271 60.892 16.556 71.934 1.00 39.56 C ATOM 12267 C PRO B 271 60.471 17.268 70.637 1.00 40.51 C ATOM 12268 O PRO B 271 59.305 17.686 70.480 1.00 37.95 O ATOM 12269 CB PRO B 271 61.952 17.375 72.712 1.00 39.59 C ATOM 12270 CG PRO B 271 62.719 16.314 73.463 1.00 40.38 C ATOM 12271 CD PRO B 271 62.813 15.161 72.483 1.00 37.96 C ATOM 12272 HA PRO B 271 59.944 16.441 72.459 1.00 0.00 H ATOM 12273 HD3 PRO B 271 63.664 15.285 71.814 1.00 0.00 H ATOM 12274 HD2 PRO B 271 62.899 14.209 73.006 1.00 0.00 H ATOM 12275 HG3 PRO B 271 62.184 16.014 74.364 1.00 0.00 H ATOM 12276 HG2 PRO B 271 63.712 16.673 73.735 1.00 0.00 H ATOM 12277 HB2 PRO B 271 62.604 17.921 72.030 1.00 0.00 H ATOM 12278 HB3 PRO B 271 61.478 18.076 73.399 1.00 0.00 H ATOM 12279 N GLN B 272 61.415 17.404 69.711 1.00 41.02 N ATOM 12280 CA GLN B 272 61.136 18.096 68.444 1.00 43.64 C ATOM 12281 C GLN B 272 59.965 17.551 67.590 1.00 43.32 C ATOM 12282 O GLN B 272 59.369 18.288 66.783 1.00 40.83 O ATOM 12283 CB GLN B 272 62.417 18.141 67.596 1.00 45.13 C ATOM 12284 CG GLN B 272 62.364 19.224 66.515 1.00 49.11 C ATOM 12285 CD GLN B 272 61.927 20.593 67.083 1.00 50.66 C ATOM 12286 OE1 GLN B 272 62.429 21.043 68.135 1.00 49.05 O ATOM 12287 NE2 GLN B 272 60.993 21.257 66.374 1.00 50.21 N ATOM 12288 HA GLN B 272 60.802 19.089 68.746 1.00 0.00 H ATOM 12289 HB2 GLN B 272 63.264 18.342 68.252 1.00 0.00 H ATOM 12290 HB3 GLN B 272 62.553 17.172 67.115 1.00 0.00 H ATOM 12291 HG2 GLN B 272 63.355 19.327 66.072 1.00 0.00 H ATOM 12292 HG3 GLN B 272 61.654 18.919 65.747 1.00 0.00 H ATOM 12293 HE22 GLN B 272 60.606 20.839 65.504 1.00 0.00 H ATOM 12294 HE21 GLN B 272 60.659 22.188 66.697 1.00 0.00 H ATOM 12295 H GLN B 272 62.364 17.016 69.885 1.00 0.00 H ATOM 12296 N GLU B 273 59.638 16.268 67.778 1.00 43.52 N ATOM 12297 CA GLU B 273 58.529 15.638 67.040 1.00 44.58 C ATOM 12298 C GLU B 273 57.206 16.138 67.531 1.00 42.35 C ATOM 12299 O GLU B 273 56.249 16.225 66.770 1.00 42.70 O ATOM 12300 CB GLU B 273 58.544 14.115 67.193 1.00 47.28 C ATOM 12301 CG GLU B 273 59.782 13.476 66.611 1.00 51.76 C ATOM 12302 CD GLU B 273 59.786 11.981 66.859 1.00 54.62 C ATOM 12303 OE1 GLU B 273 59.089 11.255 66.116 1.00 56.03 O ATOM 12304 OE2 GLU B 273 60.460 11.541 67.814 1.00 55.33 O ATOM 12305 HA GLU B 273 58.666 15.902 65.991 1.00 0.00 H ATOM 12306 HB2 GLU B 273 58.493 13.872 68.254 1.00 0.00 H ATOM 12307 HB3 GLU B 273 57.670 13.706 66.686 1.00 0.00 H ATOM 12308 HG2 GLU B 273 59.808 13.660 65.537 1.00 0.00 H ATOM 12309 HG3 GLU B 273 60.664 13.918 67.075 1.00 0.00 H ATOM 12310 H GLU B 273 60.179 15.701 68.462 1.00 0.00 H ATOM 12311 N LEU B 274 57.123 16.402 68.823 1.00 41.03 N ATOM 12312 CA LEU B 274 55.887 16.954 69.360 1.00 41.70 C ATOM 12313 C LEU B 274 55.786 18.426 68.884 1.00 40.26 C ATOM 12314 O LEU B 274 54.703 18.887 68.458 1.00 37.53 O ATOM 12315 CB LEU B 274 55.877 16.919 70.890 1.00 42.35 C ATOM 12316 CG LEU B 274 55.302 15.698 71.626 1.00 43.98 C ATOM 12317 CD1 LEU B 274 55.685 14.409 70.996 1.00 44.23 C ATOM 12318 CD2 LEU B 274 55.798 15.734 73.040 1.00 44.27 C ATOM 12319 HA LEU B 274 55.044 16.360 69.008 1.00 0.00 H ATOM 12320 HB2 LEU B 274 56.912 17.024 71.214 1.00 0.00 H ATOM 12321 HB3 LEU B 274 55.304 17.785 71.221 1.00 0.00 H ATOM 12322 HG LEU B 274 54.214 15.754 71.580 1.00 0.00 H ATOM 12323 HD21 LEU B 274 56.887 15.697 73.043 1.00 0.00 H ATOM 12324 HD22 LEU B 274 55.463 16.655 73.518 1.00 0.00 H ATOM 12325 HD23 LEU B 274 55.403 14.876 73.584 1.00 0.00 H ATOM 12326 HD11 LEU B 274 55.316 14.383 69.971 1.00 0.00 H ATOM 12327 HD12 LEU B 274 56.771 14.315 70.995 1.00 0.00 H ATOM 12328 HD13 LEU B 274 55.249 13.586 71.562 1.00 0.00 H ATOM 12329 H LEU B 274 57.932 16.217 69.450 1.00 0.00 H ATOM 12330 N ILE B 275 56.905 19.148 68.959 1.00 39.60 N ATOM 12331 CA ILE B 275 56.919 20.548 68.551 1.00 38.45 C ATOM 12332 C ILE B 275 56.595 20.707 67.053 1.00 37.50 C ATOM 12333 O ILE B 275 55.876 21.625 66.670 1.00 38.28 O ATOM 12334 CB ILE B 275 58.285 21.199 68.928 1.00 38.19 C ATOM 12335 CG1 ILE B 275 58.409 21.208 70.442 1.00 36.59 C ATOM 12336 CG2 ILE B 275 58.417 22.661 68.355 1.00 37.60 C ATOM 12337 CD1 ILE B 275 59.807 21.620 70.938 1.00 39.07 C ATOM 12338 HA ILE B 275 56.132 21.075 69.091 1.00 0.00 H ATOM 12339 HB ILE B 275 59.091 20.614 68.484 1.00 0.00 H ATOM 12340 HG12 ILE B 275 57.678 21.910 70.845 1.00 0.00 H ATOM 12341 HG13 ILE B 275 58.192 20.206 70.813 1.00 0.00 H ATOM 12342 HD11 ILE B 275 60.549 20.921 70.552 1.00 0.00 H ATOM 12343 HD12 ILE B 275 60.035 22.625 70.584 1.00 0.00 H ATOM 12344 HD13 ILE B 275 59.824 21.605 72.028 1.00 0.00 H ATOM 12345 HG21 ILE B 275 58.340 22.632 67.268 1.00 0.00 H ATOM 12346 HG22 ILE B 275 57.618 23.282 68.761 1.00 0.00 H ATOM 12347 HG23 ILE B 275 59.383 23.076 68.641 1.00 0.00 H ATOM 12348 H ILE B 275 57.778 18.707 69.313 1.00 0.00 H ATOM 12349 N ASP B 276 57.076 19.798 66.211 1.00 36.80 N ATOM 12350 CA ASP B 276 56.786 19.863 64.767 1.00 36.49 C ATOM 12351 C ASP B 276 55.308 19.849 64.409 1.00 35.69 C ATOM 12352 O ASP B 276 54.942 20.327 63.338 1.00 35.71 O ATOM 12353 CB ASP B 276 57.434 18.689 63.995 1.00 39.11 C ATOM 12354 CG ASP B 276 58.954 18.834 63.825 1.00 42.05 C ATOM 12355 OD1 ASP B 276 59.510 19.970 63.902 1.00 43.60 O ATOM 12356 OD2 ASP B 276 59.586 17.787 63.607 1.00 44.42 O ATOM 12357 HA ASP B 276 57.208 20.825 64.477 1.00 0.00 H ATOM 12358 HB2 ASP B 276 57.234 17.766 64.538 1.00 0.00 H ATOM 12359 HB3 ASP B 276 56.979 18.633 63.006 1.00 0.00 H ATOM 12360 H ASP B 276 57.668 19.026 66.578 1.00 0.00 H ATOM 12361 N VAL B 277 54.450 19.292 65.261 1.00 35.92 N ATOM 12362 CA VAL B 277 53.009 19.220 64.929 1.00 33.62 C ATOM 12363 C VAL B 277 52.123 19.965 65.934 1.00 34.81 C ATOM 12364 O VAL B 277 50.884 19.987 65.804 1.00 35.99 O ATOM 12365 CB VAL B 277 52.501 17.716 64.870 1.00 32.61 C ATOM 12366 CG1 VAL B 277 53.142 16.971 63.693 1.00 31.99 C ATOM 12367 CG2 VAL B 277 52.857 16.971 66.163 1.00 30.30 C ATOM 12368 HA VAL B 277 52.921 19.697 63.953 1.00 0.00 H ATOM 12369 HB VAL B 277 51.419 17.744 64.745 1.00 0.00 H ATOM 12370 HG11 VAL B 277 52.876 17.469 62.761 1.00 0.00 H ATOM 12371 HG12 VAL B 277 54.226 16.972 63.811 1.00 0.00 H ATOM 12372 HG13 VAL B 277 52.779 15.944 63.674 1.00 0.00 H ATOM 12373 HG21 VAL B 277 53.939 16.973 66.296 1.00 0.00 H ATOM 12374 HG22 VAL B 277 52.385 17.469 67.010 1.00 0.00 H ATOM 12375 HG23 VAL B 277 52.499 15.943 66.099 1.00 0.00 H ATOM 12376 H VAL B 277 54.793 18.906 66.164 1.00 0.00 H ATOM 12377 N GLU B 278 52.752 20.569 66.937 1.00 34.57 N ATOM 12378 CA GLU B 278 52.050 21.312 67.997 1.00 35.02 C ATOM 12379 C GLU B 278 50.965 22.270 67.482 1.00 35.88 C ATOM 12380 O GLU B 278 49.827 22.305 67.987 1.00 35.52 O ATOM 12381 CB GLU B 278 53.086 22.116 68.804 1.00 37.40 C ATOM 12382 CG GLU B 278 52.526 23.101 69.873 1.00 37.88 C ATOM 12383 CD GLU B 278 53.632 23.962 70.580 1.00 40.13 C ATOM 12384 OE1 GLU B 278 54.825 23.514 70.677 1.00 37.96 O ATOM 12385 OE2 GLU B 278 53.281 25.085 71.058 1.00 41.72 O ATOM 12386 HA GLU B 278 51.538 20.571 68.611 1.00 0.00 H ATOM 12387 HB2 GLU B 278 53.732 21.403 69.317 1.00 0.00 H ATOM 12388 HB3 GLU B 278 53.678 22.697 68.097 1.00 0.00 H ATOM 12389 HG2 GLU B 278 51.824 23.777 69.384 1.00 0.00 H ATOM 12390 HG3 GLU B 278 52.002 22.522 70.633 1.00 0.00 H ATOM 12391 H GLU B 278 53.790 20.514 66.975 1.00 0.00 H ATOM 12392 N TRP B 279 51.309 23.039 66.465 1.00 35.97 N ATOM 12393 CA TRP B 279 50.399 24.021 65.941 1.00 36.38 C ATOM 12394 C TRP B 279 49.278 23.445 65.120 1.00 38.01 C ATOM 12395 O TRP B 279 48.381 24.194 64.763 1.00 40.00 O ATOM 12396 CB TRP B 279 51.133 25.052 65.115 1.00 36.73 C ATOM 12397 CG TRP B 279 52.056 25.867 65.919 1.00 38.91 C ATOM 12398 CD1 TRP B 279 53.401 25.683 66.069 1.00 39.12 C ATOM 12399 CD2 TRP B 279 51.715 27.013 66.695 1.00 40.11 C ATOM 12400 NE1 TRP B 279 53.925 26.652 66.895 1.00 39.46 N ATOM 12401 CE2 TRP B 279 52.908 27.484 67.294 1.00 41.33 C ATOM 12402 CE3 TRP B 279 50.520 27.693 66.939 1.00 41.52 C ATOM 12403 CZ2 TRP B 279 52.941 28.620 68.130 1.00 42.06 C ATOM 12404 CZ3 TRP B 279 50.547 28.831 67.777 1.00 44.68 C ATOM 12405 CH2 TRP B 279 51.756 29.278 68.360 1.00 41.69 C ATOM 12406 HA TRP B 279 49.949 24.484 66.819 1.00 0.00 H ATOM 12407 HB2 TRP B 279 51.704 24.538 64.341 1.00 0.00 H ATOM 12408 HB3 TRP B 279 50.401 25.711 64.648 1.00 0.00 H ATOM 12409 HE1 TRP B 279 54.924 26.739 67.171 1.00 0.00 H ATOM 12410 HD1 TRP B 279 53.977 24.884 65.602 1.00 0.00 H ATOM 12411 HZ2 TRP B 279 53.873 28.964 68.578 1.00 0.00 H ATOM 12412 HH2 TRP B 279 51.748 30.159 69.002 1.00 0.00 H ATOM 12413 HZ3 TRP B 279 49.622 29.372 67.977 1.00 0.00 H ATOM 12414 HE3 TRP B 279 49.586 27.353 66.492 1.00 0.00 H ATOM 12415 H TRP B 279 52.251 22.933 66.037 1.00 0.00 H ATOM 12416 N ASN B 280 49.275 22.137 64.845 1.00 36.41 N ATOM 12417 CA ASN B 280 48.177 21.587 64.055 1.00 37.07 C ATOM 12418 C ASN B 280 46.906 21.272 64.821 1.00 36.76 C ATOM 12419 O ASN B 280 45.914 20.853 64.212 1.00 37.69 O ATOM 12420 CB ASN B 280 48.611 20.307 63.316 1.00 36.92 C ATOM 12421 CG ASN B 280 49.792 20.547 62.389 1.00 38.42 C ATOM 12422 OD1 ASN B 280 50.072 21.691 62.007 1.00 40.10 O ATOM 12423 ND2 ASN B 280 50.492 19.491 62.033 1.00 36.38 N ATOM 12424 HA ASN B 280 47.938 22.395 63.364 1.00 0.00 H ATOM 12425 HB2 ASN B 280 48.891 19.554 64.053 1.00 0.00 H ATOM 12426 HB3 ASN B 280 47.771 19.941 62.726 1.00 0.00 H ATOM 12427 HD22 ASN B 280 50.222 18.548 62.377 1.00 0.00 H ATOM 12428 HD21 ASN B 280 51.316 19.600 61.407 1.00 0.00 H ATOM 12429 H ASN B 280 50.041 21.522 65.187 1.00 0.00 H ATOM 12430 N VAL B 281 46.886 21.512 66.126 1.00 37.20 N ATOM 12431 CA VAL B 281 45.717 21.127 66.921 1.00 37.53 C ATOM 12432 C VAL B 281 44.742 22.231 67.300 1.00 38.51 C ATOM 12433 O VAL B 281 43.717 21.965 67.952 1.00 37.73 O ATOM 12434 CB VAL B 281 46.157 20.363 68.232 1.00 39.46 C ATOM 12435 CG1 VAL B 281 47.093 19.179 67.848 1.00 35.36 C ATOM 12436 CG2 VAL B 281 46.882 21.319 69.230 1.00 36.68 C ATOM 12437 HA VAL B 281 45.163 20.484 66.238 1.00 0.00 H ATOM 12438 HB VAL B 281 45.264 19.982 68.728 1.00 0.00 H ATOM 12439 HG11 VAL B 281 46.559 18.495 67.188 1.00 0.00 H ATOM 12440 HG12 VAL B 281 47.975 19.566 67.337 1.00 0.00 H ATOM 12441 HG13 VAL B 281 47.398 18.651 68.751 1.00 0.00 H ATOM 12442 HG21 VAL B 281 47.771 21.732 68.754 1.00 0.00 H ATOM 12443 HG22 VAL B 281 46.208 22.129 69.510 1.00 0.00 H ATOM 12444 HG23 VAL B 281 47.171 20.761 70.121 1.00 0.00 H ATOM 12445 H VAL B 281 47.699 21.972 66.584 1.00 0.00 H ATOM 12446 N LEU B 282 45.062 23.463 66.920 1.00 36.33 N ATOM 12447 CA LEU B 282 44.154 24.575 67.192 1.00 37.49 C ATOM 12448 C LEU B 282 42.799 24.261 66.538 1.00 37.69 C ATOM 12449 O LEU B 282 42.723 23.710 65.421 1.00 36.39 O ATOM 12450 CB LEU B 282 44.708 25.898 66.612 1.00 36.06 C ATOM 12451 CG LEU B 282 45.870 26.416 67.484 1.00 38.51 C ATOM 12452 CD1 LEU B 282 46.327 27.738 66.860 1.00 38.23 C ATOM 12453 CD2 LEU B 282 45.441 26.628 68.983 1.00 33.19 C ATOM 12454 HA LEU B 282 44.047 24.695 68.270 1.00 0.00 H ATOM 12455 HB2 LEU B 282 45.068 25.724 65.598 1.00 0.00 H ATOM 12456 HB3 LEU B 282 43.913 26.643 66.591 1.00 0.00 H ATOM 12457 HG LEU B 282 46.676 25.683 67.506 1.00 0.00 H ATOM 12458 HD21 LEU B 282 44.632 27.357 69.028 1.00 0.00 H ATOM 12459 HD22 LEU B 282 45.101 25.680 69.400 1.00 0.00 H ATOM 12460 HD23 LEU B 282 46.294 26.993 69.555 1.00 0.00 H ATOM 12461 HD11 LEU B 282 46.657 27.560 65.836 1.00 0.00 H ATOM 12462 HD12 LEU B 282 45.496 28.444 66.858 1.00 0.00 H ATOM 12463 HD13 LEU B 282 47.152 28.147 67.443 1.00 0.00 H ATOM 12464 H LEU B 282 45.961 23.637 66.427 1.00 0.00 H ATOM 12465 N PRO B 283 41.708 24.649 67.198 1.00 37.38 N ATOM 12466 CA PRO B 283 40.401 24.349 66.593 1.00 37.60 C ATOM 12467 C PRO B 283 40.019 25.283 65.444 1.00 40.00 C ATOM 12468 O PRO B 283 39.242 24.892 64.565 1.00 38.91 O ATOM 12469 CB PRO B 283 39.426 24.490 67.777 1.00 38.08 C ATOM 12470 CG PRO B 283 40.112 25.648 68.586 1.00 36.47 C ATOM 12471 CD PRO B 283 41.574 25.227 68.553 1.00 35.04 C ATOM 12472 HA PRO B 283 40.395 23.364 66.127 1.00 0.00 H ATOM 12473 HD3 PRO B 283 42.235 26.084 68.683 1.00 0.00 H ATOM 12474 HD2 PRO B 283 41.788 24.485 69.322 1.00 0.00 H ATOM 12475 HG3 PRO B 283 39.735 25.696 69.608 1.00 0.00 H ATOM 12476 HG2 PRO B 283 39.965 26.613 68.100 1.00 0.00 H ATOM 12477 HB2 PRO B 283 38.427 24.770 67.443 1.00 0.00 H ATOM 12478 HB3 PRO B 283 39.368 23.572 68.361 1.00 0.00 H ATOM 12479 N PHE B 284 40.552 26.511 65.445 1.00 39.44 N ATOM 12480 CA PHE B 284 40.193 27.455 64.409 1.00 39.08 C ATOM 12481 C PHE B 284 41.395 28.099 63.757 1.00 38.66 C ATOM 12482 O PHE B 284 42.497 28.047 64.287 1.00 38.40 O ATOM 12483 CB PHE B 284 39.355 28.578 65.014 1.00 42.78 C ATOM 12484 CG PHE B 284 38.227 28.106 65.866 1.00 44.58 C ATOM 12485 CD1 PHE B 284 37.127 27.459 65.289 1.00 47.17 C ATOM 12486 CD2 PHE B 284 38.235 28.351 67.240 1.00 46.95 C ATOM 12487 CE1 PHE B 284 36.030 27.063 66.070 1.00 47.26 C ATOM 12488 CE2 PHE B 284 37.155 27.971 68.048 1.00 48.32 C ATOM 12489 CZ PHE B 284 36.043 27.323 67.457 1.00 48.37 C ATOM 12490 HA PHE B 284 39.645 26.891 63.654 1.00 0.00 H ATOM 12491 HB2 PHE B 284 40.008 29.201 65.625 1.00 0.00 H ATOM 12492 HB3 PHE B 284 38.943 29.174 64.200 1.00 0.00 H ATOM 12493 HD2 PHE B 284 39.095 28.846 67.692 1.00 0.00 H ATOM 12494 HE2 PHE B 284 37.171 28.172 69.119 1.00 0.00 H ATOM 12495 HZ PHE B 284 35.196 27.025 68.074 1.00 0.00 H ATOM 12496 HE1 PHE B 284 35.178 26.561 65.611 1.00 0.00 H ATOM 12497 HD1 PHE B 284 37.123 27.260 64.217 1.00 0.00 H ATOM 12498 H PHE B 284 41.224 26.786 66.190 1.00 0.00 H ATOM 12499 N ASP B 285 41.170 28.715 62.601 1.00 36.14 N ATOM 12500 CA ASP B 285 42.221 29.473 61.918 1.00 35.69 C ATOM 12501 C ASP B 285 42.173 30.747 62.782 1.00 36.05 C ATOM 12502 O ASP B 285 41.157 31.441 62.848 1.00 37.72 O ATOM 12503 CB ASP B 285 41.767 29.782 60.493 1.00 36.66 C ATOM 12504 CG ASP B 285 42.848 30.380 59.674 1.00 36.98 C ATOM 12505 OD1 ASP B 285 44.011 30.423 60.164 1.00 38.64 O ATOM 12506 OD2 ASP B 285 42.535 30.793 58.541 1.00 38.67 O ATOM 12507 HA ASP B 285 43.197 28.995 61.830 1.00 0.00 H ATOM 12508 HB2 ASP B 285 41.441 28.856 60.020 1.00 0.00 H ATOM 12509 HB3 ASP B 285 40.932 30.481 60.535 1.00 0.00 H ATOM 12510 H ASP B 285 40.225 28.657 62.171 1.00 0.00 H ATOM 12511 N SER B 286 43.255 31.104 63.422 1.00 35.03 N ATOM 12512 CA SER B 286 43.148 32.217 64.326 1.00 35.54 C ATOM 12513 C SER B 286 44.489 32.800 64.625 1.00 35.05 C ATOM 12514 O SER B 286 45.515 32.204 64.259 1.00 33.97 O ATOM 12515 CB SER B 286 42.573 31.681 65.644 1.00 35.30 C ATOM 12516 OG SER B 286 43.407 30.604 66.108 1.00 38.73 O ATOM 12517 HA SER B 286 42.521 32.985 63.875 1.00 0.00 H ATOM 12518 HB2 SER B 286 41.559 31.316 65.480 1.00 0.00 H ATOM 12519 HB3 SER B 286 42.555 32.478 66.388 1.00 0.00 H ATOM 12520 HG SER B 286 43.045 30.251 66.959 1.00 0.00 H ATOM 12521 H SER B 286 44.156 30.604 63.283 1.00 0.00 H ATOM 12522 N ILE B 287 44.489 33.988 65.228 1.00 33.90 N ATOM 12523 CA ILE B 287 45.753 34.525 65.692 1.00 33.15 C ATOM 12524 C ILE B 287 45.565 34.701 67.200 1.00 34.00 C ATOM 12525 O ILE B 287 44.422 34.744 67.712 1.00 33.89 O ATOM 12526 CB ILE B 287 46.126 35.848 65.049 1.00 34.77 C ATOM 12527 CG1 ILE B 287 44.989 36.835 65.192 1.00 32.21 C ATOM 12528 CG2 ILE B 287 46.517 35.620 63.596 1.00 34.02 C ATOM 12529 CD1 ILE B 287 45.496 38.223 64.823 1.00 34.72 C ATOM 12530 HA ILE B 287 46.570 33.853 65.428 1.00 0.00 H ATOM 12531 HB ILE B 287 46.989 36.278 65.558 1.00 0.00 H ATOM 12532 HG12 ILE B 287 44.173 36.554 64.526 1.00 0.00 H ATOM 12533 HG13 ILE B 287 44.632 36.837 66.222 1.00 0.00 H ATOM 12534 HD11 ILE B 287 46.312 38.499 65.490 1.00 0.00 H ATOM 12535 HD12 ILE B 287 45.853 38.216 63.793 1.00 0.00 H ATOM 12536 HD13 ILE B 287 44.684 38.943 64.923 1.00 0.00 H ATOM 12537 HG21 ILE B 287 47.370 34.943 63.553 1.00 0.00 H ATOM 12538 HG22 ILE B 287 45.676 35.181 63.059 1.00 0.00 H ATOM 12539 HG23 ILE B 287 46.784 36.573 63.139 1.00 0.00 H ATOM 12540 H ILE B 287 43.604 34.517 65.363 1.00 0.00 H ATOM 12541 N PHE B 288 46.673 34.810 67.910 1.00 31.47 N ATOM 12542 CA PHE B 288 46.624 34.965 69.370 1.00 32.48 C ATOM 12543 C PHE B 288 45.966 33.763 70.065 1.00 33.02 C ATOM 12544 O PHE B 288 45.219 33.915 71.040 1.00 34.64 O ATOM 12545 CB PHE B 288 45.919 36.285 69.796 1.00 30.25 C ATOM 12546 CG PHE B 288 46.639 37.013 70.925 1.00 30.37 C ATOM 12547 CD1 PHE B 288 46.926 36.352 72.145 1.00 29.23 C ATOM 12548 CD2 PHE B 288 47.048 38.345 70.780 1.00 29.32 C ATOM 12549 CE1 PHE B 288 47.579 36.995 73.160 1.00 29.45 C ATOM 12550 CE2 PHE B 288 47.704 39.005 71.786 1.00 28.39 C ATOM 12551 CZ PHE B 288 47.980 38.329 72.999 1.00 30.86 C ATOM 12552 HA PHE B 288 47.662 35.013 69.698 1.00 0.00 H ATOM 12553 HB2 PHE B 288 45.871 36.947 68.931 1.00 0.00 H ATOM 12554 HB3 PHE B 288 44.908 36.047 70.126 1.00 0.00 H ATOM 12555 HD2 PHE B 288 46.840 38.868 69.847 1.00 0.00 H ATOM 12556 HE2 PHE B 288 48.011 40.042 71.653 1.00 0.00 H ATOM 12557 HZ PHE B 288 48.503 38.844 73.805 1.00 0.00 H ATOM 12558 HE1 PHE B 288 47.787 36.471 74.093 1.00 0.00 H ATOM 12559 HD1 PHE B 288 46.621 35.314 72.277 1.00 0.00 H ATOM 12560 H PHE B 288 47.594 34.786 67.428 1.00 0.00 H ATOM 12561 N ARG B 289 46.213 32.563 69.542 1.00 33.31 N ATOM 12562 CA ARG B 289 45.706 31.349 70.180 1.00 33.78 C ATOM 12563 C ARG B 289 46.897 30.378 70.126 1.00 33.80 C ATOM 12564 O ARG B 289 47.606 30.292 69.115 1.00 33.47 O ATOM 12565 CB ARG B 289 44.492 30.783 69.449 1.00 32.74 C ATOM 12566 CG ARG B 289 43.277 31.667 69.540 1.00 32.65 C ATOM 12567 CD ARG B 289 42.810 31.820 71.012 1.00 33.71 C ATOM 12568 NE ARG B 289 41.532 32.543 71.043 1.00 34.58 N ATOM 12569 CZ ARG B 289 41.401 33.859 71.216 1.00 33.67 C ATOM 12570 NH1 ARG B 289 42.468 34.631 71.375 1.00 31.36 N ATOM 12571 NH2 ARG B 289 40.186 34.387 71.268 1.00 32.90 N ATOM 12572 HA ARG B 289 45.358 31.533 71.196 1.00 0.00 H ATOM 12573 HB2 ARG B 289 44.749 30.655 68.398 1.00 0.00 H ATOM 12574 HB3 ARG B 289 44.248 29.813 69.882 1.00 0.00 H ATOM 12575 HG2 ARG B 289 43.521 32.651 69.139 1.00 0.00 H ATOM 12576 HG3 ARG B 289 42.471 31.227 68.954 1.00 0.00 H ATOM 12577 HD2 ARG B 289 43.558 32.378 71.576 1.00 0.00 H ATOM 12578 HD3 ARG B 289 42.682 30.834 71.458 1.00 0.00 H ATOM 12579 HE ARG B 289 40.662 31.986 70.921 1.00 0.00 H ATOM 12580 HH12 ARG B 289 42.353 35.656 71.509 1.00 0.00 H ATOM 12581 HH11 ARG B 289 43.420 34.211 71.366 1.00 0.00 H ATOM 12582 HH22 ARG B 289 40.070 35.412 71.402 1.00 0.00 H ATOM 12583 HH21 ARG B 289 39.349 33.777 71.174 1.00 0.00 H ATOM 12584 H ARG B 289 46.773 32.489 68.669 1.00 0.00 H ATOM 12585 N PHE B 290 47.090 29.670 71.236 1.00 33.70 N ATOM 12586 CA PHE B 290 48.209 28.749 71.445 1.00 33.69 C ATOM 12587 C PHE B 290 47.673 27.400 71.848 1.00 32.74 C ATOM 12588 O PHE B 290 46.664 27.296 72.500 1.00 32.20 O ATOM 12589 CB PHE B 290 49.135 29.381 72.505 1.00 33.83 C ATOM 12590 CG PHE B 290 49.323 30.868 72.283 1.00 33.94 C ATOM 12591 CD1 PHE B 290 49.927 31.328 71.113 1.00 35.52 C ATOM 12592 CD2 PHE B 290 48.765 31.800 73.162 1.00 34.32 C ATOM 12593 CE1 PHE B 290 49.977 32.695 70.813 1.00 35.98 C ATOM 12594 CE2 PHE B 290 48.802 33.153 72.883 1.00 33.77 C ATOM 12595 CZ PHE B 290 49.414 33.616 71.702 1.00 34.33 C ATOM 12596 HA PHE B 290 48.790 28.589 70.537 1.00 0.00 H ATOM 12597 HB2 PHE B 290 48.699 29.225 73.492 1.00 0.00 H ATOM 12598 HB3 PHE B 290 50.108 28.892 72.458 1.00 0.00 H ATOM 12599 HD2 PHE B 290 48.293 31.455 74.082 1.00 0.00 H ATOM 12600 HE2 PHE B 290 48.356 33.864 73.579 1.00 0.00 H ATOM 12601 HZ PHE B 290 49.449 34.683 71.483 1.00 0.00 H ATOM 12602 HE1 PHE B 290 50.451 33.038 69.894 1.00 0.00 H ATOM 12603 HD1 PHE B 290 50.368 30.611 70.420 1.00 0.00 H ATOM 12604 H PHE B 290 46.400 29.778 72.007 1.00 0.00 H ATOM 12605 N SER B 291 48.361 26.361 71.409 1.00 33.23 N ATOM 12606 CA SER B 291 47.909 25.001 71.597 1.00 33.03 C ATOM 12607 C SER B 291 47.750 24.459 73.007 1.00 34.37 C ATOM 12608 O SER B 291 46.629 24.081 73.410 1.00 34.01 O ATOM 12609 CB SER B 291 48.812 24.074 70.789 1.00 33.13 C ATOM 12610 OG SER B 291 48.526 24.310 69.422 1.00 33.24 O ATOM 12611 HA SER B 291 46.876 25.031 71.250 1.00 0.00 H ATOM 12612 HB2 SER B 291 48.604 23.034 71.042 1.00 0.00 H ATOM 12613 HB3 SER B 291 49.859 24.295 70.997 1.00 0.00 H ATOM 12614 HG SER B 291 49.094 23.725 68.861 1.00 0.00 H ATOM 12615 H SER B 291 49.259 26.527 70.911 1.00 0.00 H ATOM 12616 N PHE B 292 48.840 24.429 73.759 1.00 32.16 N ATOM 12617 CA PHE B 292 48.769 23.857 75.101 1.00 32.90 C ATOM 12618 C PHE B 292 48.898 24.918 76.173 1.00 32.39 C ATOM 12619 O PHE B 292 49.954 25.542 76.338 1.00 32.27 O ATOM 12620 CB PHE B 292 49.867 22.820 75.200 1.00 31.38 C ATOM 12621 CG PHE B 292 49.695 21.755 74.205 1.00 33.61 C ATOM 12622 CD1 PHE B 292 48.685 20.784 74.380 1.00 33.15 C ATOM 12623 CD2 PHE B 292 50.446 21.759 73.034 1.00 32.37 C ATOM 12624 CE1 PHE B 292 48.434 19.830 73.375 1.00 33.50 C ATOM 12625 CE2 PHE B 292 50.200 20.818 72.023 1.00 35.14 C ATOM 12626 CZ PHE B 292 49.181 19.848 72.201 1.00 35.30 C ATOM 12627 HA PHE B 292 47.795 23.395 75.266 1.00 0.00 H ATOM 12628 HB2 PHE B 292 50.829 23.306 75.036 1.00 0.00 H ATOM 12629 HB3 PHE B 292 49.849 22.380 76.197 1.00 0.00 H ATOM 12630 HD2 PHE B 292 51.233 22.501 72.901 1.00 0.00 H ATOM 12631 HE2 PHE B 292 50.789 20.832 71.106 1.00 0.00 H ATOM 12632 HZ PHE B 292 48.983 19.116 71.418 1.00 0.00 H ATOM 12633 HE1 PHE B 292 47.656 19.079 73.516 1.00 0.00 H ATOM 12634 HD1 PHE B 292 48.097 20.773 75.298 1.00 0.00 H ATOM 12635 H PHE B 292 49.738 24.809 73.397 1.00 0.00 H ATOM 12636 N VAL B 293 47.801 25.114 76.885 1.00 31.33 N ATOM 12637 CA VAL B 293 47.742 26.124 77.887 1.00 31.17 C ATOM 12638 C VAL B 293 47.038 25.576 79.140 1.00 31.97 C ATOM 12639 O VAL B 293 46.507 24.454 79.142 1.00 31.75 O ATOM 12640 CB VAL B 293 46.932 27.395 77.356 1.00 31.55 C ATOM 12641 CG1 VAL B 293 47.620 28.048 76.122 1.00 27.51 C ATOM 12642 CG2 VAL B 293 45.471 26.993 77.011 1.00 28.94 C ATOM 12643 HA VAL B 293 48.761 26.422 78.131 1.00 0.00 H ATOM 12644 HB VAL B 293 46.922 28.137 78.154 1.00 0.00 H ATOM 12645 HG11 VAL B 293 48.624 28.373 76.397 1.00 0.00 H ATOM 12646 HG12 VAL B 293 47.681 27.319 75.314 1.00 0.00 H ATOM 12647 HG13 VAL B 293 47.036 28.908 75.795 1.00 0.00 H ATOM 12648 HG21 VAL B 293 45.480 26.225 76.237 1.00 0.00 H ATOM 12649 HG22 VAL B 293 44.982 26.605 77.904 1.00 0.00 H ATOM 12650 HG23 VAL B 293 44.930 27.868 76.650 1.00 0.00 H ATOM 12651 H VAL B 293 46.966 24.519 76.710 1.00 0.00 H ATOM 12652 N PRO B 294 47.023 26.372 80.216 1.00 31.20 N ATOM 12653 CA PRO B 294 46.367 25.968 81.465 1.00 31.99 C ATOM 12654 C PRO B 294 44.922 25.443 81.211 1.00 34.20 C ATOM 12655 O PRO B 294 44.246 25.881 80.263 1.00 33.40 O ATOM 12656 CB PRO B 294 46.400 27.266 82.310 1.00 30.09 C ATOM 12657 CG PRO B 294 47.825 27.811 81.956 1.00 31.24 C ATOM 12658 CD PRO B 294 47.880 27.578 80.398 1.00 31.60 C ATOM 12659 HA PRO B 294 46.859 25.135 81.968 1.00 0.00 H ATOM 12660 HD3 PRO B 294 47.475 28.434 79.858 1.00 0.00 H ATOM 12661 HD2 PRO B 294 48.900 27.389 80.064 1.00 0.00 H ATOM 12662 HG3 PRO B 294 48.605 27.248 82.470 1.00 0.00 H ATOM 12663 HG2 PRO B 294 47.919 28.868 82.203 1.00 0.00 H ATOM 12664 HB2 PRO B 294 45.618 27.962 82.008 1.00 0.00 H ATOM 12665 HB3 PRO B 294 46.304 27.054 83.375 1.00 0.00 H ATOM 12666 N VAL B 295 44.453 24.508 82.051 1.00 35.36 N ATOM 12667 CA VAL B 295 43.093 23.962 81.922 1.00 36.76 C ATOM 12668 C VAL B 295 42.321 24.248 83.172 1.00 36.11 C ATOM 12669 O VAL B 295 42.868 24.180 84.257 1.00 35.60 O ATOM 12670 CB VAL B 295 43.039 22.427 81.795 1.00 38.22 C ATOM 12671 CG1 VAL B 295 43.074 22.040 80.414 1.00 39.57 C ATOM 12672 CG2 VAL B 295 44.178 21.771 82.580 1.00 37.54 C ATOM 12673 HA VAL B 295 42.693 24.427 81.021 1.00 0.00 H ATOM 12674 HB VAL B 295 42.100 22.079 82.225 1.00 0.00 H ATOM 12675 HG11 VAL B 295 42.218 22.471 79.895 1.00 0.00 H ATOM 12676 HG12 VAL B 295 43.996 22.403 79.960 1.00 0.00 H ATOM 12677 HG13 VAL B 295 43.035 20.953 80.341 1.00 0.00 H ATOM 12678 HG21 VAL B 295 45.134 22.121 82.191 1.00 0.00 H ATOM 12679 HG22 VAL B 295 44.093 22.038 83.633 1.00 0.00 H ATOM 12680 HG23 VAL B 295 44.115 20.688 82.472 1.00 0.00 H ATOM 12681 H VAL B 295 45.068 24.160 82.814 1.00 0.00 H ATOM 12682 N ILE B 296 41.036 24.530 83.021 1.00 36.32 N ATOM 12683 CA ILE B 296 40.185 24.814 84.158 1.00 37.54 C ATOM 12684 C ILE B 296 39.849 23.394 84.628 1.00 39.64 C ATOM 12685 O ILE B 296 38.964 22.695 84.098 1.00 39.37 O ATOM 12686 CB ILE B 296 38.959 25.628 83.687 1.00 37.92 C ATOM 12687 CG1 ILE B 296 39.463 26.932 83.053 1.00 36.83 C ATOM 12688 CG2 ILE B 296 38.023 25.897 84.877 1.00 38.33 C ATOM 12689 CD1 ILE B 296 40.547 27.703 83.945 1.00 33.78 C ATOM 12690 HA ILE B 296 40.617 25.420 84.955 1.00 0.00 H ATOM 12691 HB ILE B 296 38.386 25.073 82.944 1.00 0.00 H ATOM 12692 HG12 ILE B 296 39.915 26.695 82.090 1.00 0.00 H ATOM 12693 HG13 ILE B 296 38.610 27.593 82.900 1.00 0.00 H ATOM 12694 HD11 ILE B 296 40.107 27.958 84.909 1.00 0.00 H ATOM 12695 HD12 ILE B 296 41.413 27.059 84.099 1.00 0.00 H ATOM 12696 HD13 ILE B 296 40.856 28.614 83.432 1.00 0.00 H ATOM 12697 HG21 ILE B 296 37.687 24.948 85.295 1.00 0.00 H ATOM 12698 HG22 ILE B 296 38.560 26.462 85.639 1.00 0.00 H ATOM 12699 HG23 ILE B 296 37.161 26.471 84.537 1.00 0.00 H ATOM 12700 H ILE B 296 40.629 24.548 82.064 1.00 0.00 H ATOM 12701 N ASP B 297 40.580 22.953 85.636 1.00 39.28 N ATOM 12702 CA ASP B 297 40.465 21.559 86.012 1.00 40.27 C ATOM 12703 C ASP B 297 39.735 21.156 87.254 1.00 40.85 C ATOM 12704 O ASP B 297 39.584 19.960 87.457 1.00 41.79 O ATOM 12705 CB ASP B 297 41.865 20.976 86.119 1.00 39.74 C ATOM 12706 CG ASP B 297 42.658 21.637 87.226 1.00 40.84 C ATOM 12707 OD1 ASP B 297 42.257 22.735 87.699 1.00 41.32 O ATOM 12708 OD2 ASP B 297 43.696 21.084 87.624 1.00 44.51 O ATOM 12709 HA ASP B 297 39.828 21.174 85.215 1.00 0.00 H ATOM 12710 HB2 ASP B 297 41.790 19.908 86.326 1.00 0.00 H ATOM 12711 HB3 ASP B 297 42.385 21.126 85.173 1.00 0.00 H ATOM 12712 H ASP B 297 41.223 23.591 86.147 1.00 0.00 H ATOM 12713 N GLY B 298 39.316 22.091 88.098 1.00 40.70 N ATOM 12714 CA GLY B 298 38.660 21.666 89.333 1.00 40.90 C ATOM 12715 C GLY B 298 39.717 21.378 90.415 1.00 42.32 C ATOM 12716 O GLY B 298 39.358 21.074 91.531 1.00 43.08 O ATOM 12717 HA3 GLY B 298 38.081 20.762 89.143 1.00 0.00 H ATOM 12718 HA2 GLY B 298 37.994 22.456 89.679 1.00 0.00 H ATOM 12719 H GLY B 298 39.451 23.100 87.886 1.00 0.00 H ATOM 12720 N GLU B 299 41.021 21.456 90.112 1.00 41.99 N ATOM 12721 CA GLU B 299 42.061 21.223 91.125 1.00 40.60 C ATOM 12722 C GLU B 299 42.896 22.516 91.295 1.00 39.11 C ATOM 12723 O GLU B 299 42.755 23.246 92.268 1.00 38.28 O ATOM 12724 CB GLU B 299 42.985 20.088 90.691 1.00 43.63 C ATOM 12725 CG GLU B 299 42.278 18.725 90.422 1.00 49.64 C ATOM 12726 HA GLU B 299 41.584 20.950 92.067 1.00 0.00 H ATOM 12727 HB2 GLU B 299 43.489 20.394 89.774 1.00 0.00 H ATOM 12728 HB3 GLU B 299 43.725 19.936 91.477 1.00 0.00 H ATOM 12729 HG2 GLU B 299 41.779 18.390 91.331 1.00 0.00 H ATOM 12730 HG3 GLU B 299 41.542 18.849 89.627 1.00 0.00 H ATOM 12731 H GLU B 299 41.303 21.687 89.138 1.00 0.00 H ATOM 12732 N PHE B 300 43.764 22.806 90.328 1.00 37.04 N ATOM 12733 CA PHE B 300 44.556 24.009 90.412 1.00 35.37 C ATOM 12734 C PHE B 300 43.568 25.188 90.420 1.00 35.32 C ATOM 12735 O PHE B 300 43.719 26.123 91.197 1.00 36.08 O ATOM 12736 CB PHE B 300 45.550 24.044 89.231 1.00 34.33 C ATOM 12737 CG PHE B 300 46.548 25.145 89.341 1.00 35.56 C ATOM 12738 CD1 PHE B 300 46.167 26.474 89.089 1.00 34.79 C ATOM 12739 CD2 PHE B 300 47.864 24.876 89.721 1.00 34.23 C ATOM 12740 CE1 PHE B 300 47.097 27.533 89.197 1.00 34.71 C ATOM 12741 CE2 PHE B 300 48.794 25.913 89.842 1.00 33.12 C ATOM 12742 CZ PHE B 300 48.391 27.264 89.564 1.00 32.46 C ATOM 12743 HA PHE B 300 45.162 24.058 91.317 1.00 0.00 H ATOM 12744 HB2 PHE B 300 46.083 23.094 89.197 1.00 0.00 H ATOM 12745 HB3 PHE B 300 44.987 24.176 88.307 1.00 0.00 H ATOM 12746 HD2 PHE B 300 48.169 23.850 89.925 1.00 0.00 H ATOM 12747 HE2 PHE B 300 49.819 25.698 90.145 1.00 0.00 H ATOM 12748 HZ PHE B 300 49.114 28.076 89.645 1.00 0.00 H ATOM 12749 HE1 PHE B 300 46.788 28.557 88.990 1.00 0.00 H ATOM 12750 HD1 PHE B 300 45.137 26.692 88.806 1.00 0.00 H ATOM 12751 H PHE B 300 43.871 22.167 89.514 1.00 0.00 H ATOM 12752 N PHE B 301 42.541 25.136 89.563 1.00 35.57 N ATOM 12753 CA PHE B 301 41.476 26.157 89.540 1.00 34.79 C ATOM 12754 C PHE B 301 40.220 25.423 90.067 1.00 36.08 C ATOM 12755 O PHE B 301 39.642 24.586 89.374 1.00 36.18 O ATOM 12756 CB PHE B 301 41.256 26.664 88.094 1.00 33.65 C ATOM 12757 CG PHE B 301 42.494 27.288 87.481 1.00 33.64 C ATOM 12758 CD1 PHE B 301 42.968 28.535 87.945 1.00 32.53 C ATOM 12759 CD2 PHE B 301 43.198 26.633 86.474 1.00 30.99 C ATOM 12760 CE1 PHE B 301 44.154 29.116 87.379 1.00 32.43 C ATOM 12761 CE2 PHE B 301 44.374 27.198 85.912 1.00 33.53 C ATOM 12762 CZ PHE B 301 44.847 28.440 86.360 1.00 28.78 C ATOM 12763 HA PHE B 301 41.718 27.032 90.143 1.00 0.00 H ATOM 12764 HB2 PHE B 301 40.951 25.821 87.474 1.00 0.00 H ATOM 12765 HB3 PHE B 301 40.462 27.411 88.106 1.00 0.00 H ATOM 12766 HD2 PHE B 301 42.840 25.670 86.110 1.00 0.00 H ATOM 12767 HE2 PHE B 301 44.911 26.664 85.129 1.00 0.00 H ATOM 12768 HZ PHE B 301 45.744 28.877 85.922 1.00 0.00 H ATOM 12769 HE1 PHE B 301 44.516 30.079 87.739 1.00 0.00 H ATOM 12770 HD1 PHE B 301 42.432 29.059 88.736 1.00 0.00 H ATOM 12771 H PHE B 301 42.492 24.346 88.888 1.00 0.00 H ATOM 12772 N PRO B 302 39.784 25.724 91.290 1.00 37.33 N ATOM 12773 CA PRO B 302 38.600 25.003 91.789 1.00 38.37 C ATOM 12774 C PRO B 302 37.296 25.178 91.004 1.00 40.06 C ATOM 12775 O PRO B 302 36.531 24.213 90.892 1.00 41.28 O ATOM 12776 CB PRO B 302 38.507 25.436 93.270 1.00 38.02 C ATOM 12777 CG PRO B 302 39.267 26.803 93.294 1.00 40.08 C ATOM 12778 CD PRO B 302 40.392 26.596 92.316 1.00 37.15 C ATOM 12779 HA PRO B 302 38.731 23.929 91.659 1.00 0.00 H ATOM 12780 HD3 PRO B 302 40.715 27.543 91.884 1.00 0.00 H ATOM 12781 HD2 PRO B 302 41.241 26.107 92.793 1.00 0.00 H ATOM 12782 HG3 PRO B 302 39.652 27.018 94.291 1.00 0.00 H ATOM 12783 HG2 PRO B 302 38.616 27.617 92.974 1.00 0.00 H ATOM 12784 HB2 PRO B 302 37.468 25.561 93.576 1.00 0.00 H ATOM 12785 HB3 PRO B 302 38.991 24.708 93.921 1.00 0.00 H ATOM 12786 N THR B 303 37.004 26.379 90.494 1.00 38.97 N ATOM 12787 CA THR B 303 35.804 26.546 89.669 1.00 39.95 C ATOM 12788 C THR B 303 36.192 27.412 88.491 1.00 38.88 C ATOM 12789 O THR B 303 37.378 27.676 88.315 1.00 39.46 O ATOM 12790 CB THR B 303 34.652 27.209 90.426 1.00 41.40 C ATOM 12791 OG1 THR B 303 35.010 28.561 90.798 1.00 43.33 O ATOM 12792 CG2 THR B 303 34.344 26.414 91.694 1.00 43.25 C ATOM 12793 HA THR B 303 35.449 25.562 89.361 1.00 0.00 H ATOM 12794 HB THR B 303 33.776 27.230 89.777 1.00 0.00 H ATOM 12795 HG1 THR B 303 35.206 29.086 89.982 1.00 0.00 H ATOM 12796 HG23 THR B 303 34.073 25.393 91.424 1.00 0.00 H ATOM 12797 HG21 THR B 303 35.225 26.400 92.336 1.00 0.00 H ATOM 12798 HG22 THR B 303 33.515 26.884 92.223 1.00 0.00 H ATOM 12799 H THR B 303 37.626 27.191 90.682 1.00 0.00 H ATOM 12800 N SER B 304 35.214 27.860 87.699 1.00 37.63 N ATOM 12801 CA SER B 304 35.492 28.721 86.538 1.00 37.91 C ATOM 12802 C SER B 304 36.207 29.996 87.015 1.00 36.15 C ATOM 12803 O SER B 304 35.986 30.436 88.128 1.00 35.92 O ATOM 12804 CB SER B 304 34.182 29.118 85.821 1.00 37.61 C ATOM 12805 OG SER B 304 33.460 30.073 86.604 1.00 40.71 O ATOM 12806 HA SER B 304 36.121 28.170 85.839 1.00 0.00 H ATOM 12807 HB2 SER B 304 33.566 28.230 85.678 1.00 0.00 H ATOM 12808 HB3 SER B 304 34.420 29.554 84.851 1.00 0.00 H ATOM 12809 HG SER B 304 33.241 29.678 87.485 1.00 0.00 H ATOM 12810 H SER B 304 34.231 27.594 87.908 1.00 0.00 H ATOM 12811 N LEU B 305 37.043 30.594 86.178 1.00 36.18 N ATOM 12812 CA LEU B 305 37.762 31.783 86.608 1.00 35.68 C ATOM 12813 C LEU B 305 36.792 32.916 86.938 1.00 37.35 C ATOM 12814 O LEU B 305 36.973 33.629 87.945 1.00 36.77 O ATOM 12815 CB LEU B 305 38.767 32.211 85.534 1.00 34.85 C ATOM 12816 CG LEU B 305 39.818 31.164 85.134 1.00 34.59 C ATOM 12817 CD1 LEU B 305 40.715 31.791 84.030 1.00 34.60 C ATOM 12818 CD2 LEU B 305 40.635 30.703 86.346 1.00 35.72 C ATOM 12819 HA LEU B 305 38.313 31.546 87.518 1.00 0.00 H ATOM 12820 HB2 LEU B 305 38.205 32.477 84.639 1.00 0.00 H ATOM 12821 HB3 LEU B 305 39.296 33.089 85.904 1.00 0.00 H ATOM 12822 HG LEU B 305 39.332 30.269 84.745 1.00 0.00 H ATOM 12823 HD21 LEU B 305 41.147 31.559 86.784 1.00 0.00 H ATOM 12824 HD22 LEU B 305 39.968 30.260 87.085 1.00 0.00 H ATOM 12825 HD23 LEU B 305 41.369 29.963 86.028 1.00 0.00 H ATOM 12826 HD11 LEU B 305 40.099 32.057 83.171 1.00 0.00 H ATOM 12827 HD12 LEU B 305 41.200 32.685 84.422 1.00 0.00 H ATOM 12828 HD13 LEU B 305 41.472 31.069 83.725 1.00 0.00 H ATOM 12829 H LEU B 305 37.184 30.215 85.220 1.00 0.00 H ATOM 12830 N GLU B 306 35.759 33.079 86.105 1.00 37.24 N ATOM 12831 CA GLU B 306 34.759 34.123 86.343 1.00 37.89 C ATOM 12832 C GLU B 306 34.014 33.975 87.677 1.00 37.77 C ATOM 12833 O GLU B 306 33.763 34.980 88.368 1.00 37.48 O ATOM 12834 CB GLU B 306 33.736 34.169 85.182 1.00 39.51 C ATOM 12835 CG GLU B 306 32.766 35.324 85.253 1.00 43.15 C ATOM 12836 CD GLU B 306 33.448 36.722 85.192 1.00 45.55 C ATOM 12837 OE1 GLU B 306 34.632 36.834 84.772 1.00 46.11 O ATOM 12838 OE2 GLU B 306 32.784 37.721 85.543 1.00 46.48 O ATOM 12839 HA GLU B 306 35.316 35.059 86.395 1.00 0.00 H ATOM 12840 HB2 GLU B 306 34.287 34.243 84.244 1.00 0.00 H ATOM 12841 HB3 GLU B 306 33.164 33.241 85.194 1.00 0.00 H ATOM 12842 HG2 GLU B 306 32.073 35.243 84.416 1.00 0.00 H ATOM 12843 HG3 GLU B 306 32.213 35.252 86.190 1.00 0.00 H ATOM 12844 H GLU B 306 35.664 32.457 85.277 1.00 0.00 H ATOM 12845 N SER B 307 33.650 32.755 88.076 1.00 37.39 N ATOM 12846 CA SER B 307 32.944 32.635 89.372 1.00 38.57 C ATOM 12847 C SER B 307 33.944 32.853 90.523 1.00 37.54 C ATOM 12848 O SER B 307 33.575 33.397 91.561 1.00 36.50 O ATOM 12849 CB SER B 307 32.233 31.270 89.522 1.00 39.43 C ATOM 12850 OG SER B 307 33.143 30.195 89.382 1.00 45.92 O ATOM 12851 HA SER B 307 32.170 33.402 89.408 1.00 0.00 H ATOM 12852 HB2 SER B 307 31.463 31.185 88.755 1.00 0.00 H ATOM 12853 HB3 SER B 307 31.770 31.217 90.508 1.00 0.00 H ATOM 12854 HG SER B 307 33.563 30.234 88.486 1.00 0.00 H ATOM 12855 H SER B 307 33.855 31.916 87.496 1.00 0.00 H ATOM 12856 N MET B 308 35.212 32.460 90.328 1.00 36.45 N ATOM 12857 CA MET B 308 36.189 32.713 91.375 1.00 37.07 C ATOM 12858 C MET B 308 36.325 34.245 91.498 1.00 37.49 C ATOM 12859 O MET B 308 36.332 34.774 92.586 1.00 35.91 O ATOM 12860 CB MET B 308 37.561 32.091 91.033 1.00 37.32 C ATOM 12861 CG MET B 308 37.600 30.581 91.081 1.00 34.31 C ATOM 12862 SD MET B 308 39.213 29.904 90.857 1.00 39.18 S ATOM 12863 CE MET B 308 39.911 30.419 92.574 1.00 34.01 C ATOM 12864 HA MET B 308 35.859 32.261 92.310 1.00 0.00 H ATOM 12865 HB2 MET B 308 37.835 32.406 90.026 1.00 0.00 H ATOM 12866 HB3 MET B 308 38.294 32.473 91.744 1.00 0.00 H ATOM 12867 HG2 MET B 308 36.952 30.195 90.294 1.00 0.00 H ATOM 12868 HG3 MET B 308 37.223 30.258 92.051 1.00 0.00 H ATOM 12869 HE1 MET B 308 39.867 31.504 92.672 1.00 0.00 H ATOM 12870 HE2 MET B 308 39.314 29.958 93.361 1.00 0.00 H ATOM 12871 HE3 MET B 308 40.946 30.087 92.659 1.00 0.00 H ATOM 12872 H MET B 308 35.490 31.984 89.446 1.00 0.00 H ATOM 12873 N LEU B 309 36.435 34.955 90.374 1.00 38.67 N ATOM 12874 CA LEU B 309 36.577 36.412 90.439 1.00 40.54 C ATOM 12875 C LEU B 309 35.351 37.087 91.061 1.00 43.14 C ATOM 12876 O LEU B 309 35.454 38.040 91.868 1.00 42.69 O ATOM 12877 CB LEU B 309 36.810 37.001 89.045 1.00 37.81 C ATOM 12878 CG LEU B 309 38.204 36.787 88.417 1.00 38.20 C ATOM 12879 CD1 LEU B 309 38.195 37.345 86.978 1.00 37.05 C ATOM 12880 CD2 LEU B 309 39.293 37.502 89.260 1.00 37.12 C ATOM 12881 HA LEU B 309 37.441 36.608 91.075 1.00 0.00 H ATOM 12882 HB2 LEU B 309 36.075 36.557 88.373 1.00 0.00 H ATOM 12883 HB3 LEU B 309 36.640 38.076 89.109 1.00 0.00 H ATOM 12884 HG LEU B 309 38.433 35.722 88.397 1.00 0.00 H ATOM 12885 HD21 LEU B 309 39.080 38.570 89.296 1.00 0.00 H ATOM 12886 HD22 LEU B 309 39.293 37.096 90.271 1.00 0.00 H ATOM 12887 HD23 LEU B 309 40.269 37.340 88.803 1.00 0.00 H ATOM 12888 HD11 LEU B 309 37.441 36.820 86.391 1.00 0.00 H ATOM 12889 HD12 LEU B 309 37.961 38.409 87.004 1.00 0.00 H ATOM 12890 HD13 LEU B 309 39.176 37.198 86.527 1.00 0.00 H ATOM 12891 H LEU B 309 36.420 34.475 89.452 1.00 0.00 H ATOM 12892 N ASN B 310 34.184 36.594 90.661 1.00 44.17 N ATOM 12893 CA ASN B 310 32.946 37.134 91.153 1.00 44.72 C ATOM 12894 C ASN B 310 32.727 36.958 92.621 1.00 43.91 C ATOM 12895 O ASN B 310 32.179 37.858 93.263 1.00 43.63 O ATOM 12896 CB ASN B 310 31.771 36.510 90.424 1.00 48.42 C ATOM 12897 CG ASN B 310 31.487 37.206 89.154 1.00 51.68 C ATOM 12898 OD1 ASN B 310 31.693 38.428 89.069 1.00 54.76 O ATOM 12899 ND2 ASN B 310 31.001 36.472 88.145 1.00 52.87 N ATOM 12900 HA ASN B 310 33.017 38.205 90.964 1.00 0.00 H ATOM 12901 HB2 ASN B 310 32.000 35.466 90.212 1.00 0.00 H ATOM 12902 HB3 ASN B 310 30.889 36.564 91.062 1.00 0.00 H ATOM 12903 HD22 ASN B 310 30.848 35.451 88.271 1.00 0.00 H ATOM 12904 HD21 ASN B 310 30.777 36.923 87.235 1.00 0.00 H ATOM 12905 H ASN B 310 34.166 35.806 89.982 1.00 0.00 H ATOM 12906 N SER B 311 33.160 35.820 93.158 1.00 41.81 N ATOM 12907 CA SER B 311 32.937 35.535 94.569 1.00 41.29 C ATOM 12908 C SER B 311 34.077 35.927 95.517 1.00 40.70 C ATOM 12909 O SER B 311 33.999 35.664 96.732 1.00 40.64 O ATOM 12910 CB SER B 311 32.614 34.036 94.747 1.00 41.60 C ATOM 12911 OG SER B 311 33.768 33.239 94.504 1.00 44.66 O ATOM 12912 HA SER B 311 32.098 36.169 94.856 1.00 0.00 H ATOM 12913 HB2 SER B 311 31.829 33.753 94.045 1.00 0.00 H ATOM 12914 HB3 SER B 311 32.268 33.863 95.766 1.00 0.00 H ATOM 12915 HG SER B 311 34.083 33.391 93.578 1.00 0.00 H ATOM 12916 H SER B 311 33.662 35.128 92.565 1.00 0.00 H ATOM 12917 N GLY B 312 35.121 36.568 94.988 1.00 40.07 N ATOM 12918 CA GLY B 312 36.253 36.944 95.833 1.00 37.82 C ATOM 12919 C GLY B 312 37.122 35.743 96.229 1.00 37.27 C ATOM 12920 O GLY B 312 37.914 35.805 97.150 1.00 37.11 O ATOM 12921 HA3 GLY B 312 35.871 37.412 96.740 1.00 0.00 H ATOM 12922 HA2 GLY B 312 36.872 37.658 95.290 1.00 0.00 H ATOM 12923 H GLY B 312 35.129 36.800 93.974 1.00 0.00 H ATOM 12924 N ASN B 313 36.970 34.639 95.520 1.00 37.33 N ATOM 12925 CA ASN B 313 37.742 33.437 95.797 1.00 37.66 C ATOM 12926 C ASN B 313 39.179 33.566 95.202 1.00 37.57 C ATOM 12927 O ASN B 313 39.503 32.965 94.138 1.00 36.55 O ATOM 12928 CB ASN B 313 37.023 32.218 95.208 1.00 37.01 C ATOM 12929 CG ASN B 313 37.663 30.917 95.654 1.00 40.62 C ATOM 12930 OD1 ASN B 313 38.635 30.945 96.405 1.00 39.84 O ATOM 12931 ND2 ASN B 313 37.140 29.790 95.195 1.00 39.70 N ATOM 12932 HA ASN B 313 37.831 33.309 96.876 1.00 0.00 H ATOM 12933 HB2 ASN B 313 35.983 32.230 95.534 1.00 0.00 H ATOM 12934 HB3 ASN B 313 37.062 32.276 94.120 1.00 0.00 H ATOM 12935 HD22 ASN B 313 36.316 29.819 94.561 1.00 0.00 H ATOM 12936 HD21 ASN B 313 37.553 28.876 95.469 1.00 0.00 H ATOM 12937 H ASN B 313 36.280 34.629 94.742 1.00 0.00 H ATOM 12938 N PHE B 314 40.007 34.363 95.888 1.00 36.66 N ATOM 12939 CA PHE B 314 41.397 34.608 95.481 1.00 36.17 C ATOM 12940 C PHE B 314 42.206 35.336 96.550 1.00 36.48 C ATOM 12941 O PHE B 314 41.647 35.903 97.505 1.00 35.41 O ATOM 12942 CB PHE B 314 41.445 35.401 94.153 1.00 34.76 C ATOM 12943 CG PHE B 314 40.575 36.645 94.140 1.00 32.66 C ATOM 12944 CD1 PHE B 314 41.007 37.822 94.731 1.00 33.17 C ATOM 12945 CD2 PHE B 314 39.340 36.629 93.481 1.00 33.51 C ATOM 12946 CE1 PHE B 314 40.235 38.987 94.664 1.00 34.49 C ATOM 12947 CE2 PHE B 314 38.541 37.785 93.398 1.00 33.52 C ATOM 12948 CZ PHE B 314 38.979 38.966 93.978 1.00 34.41 C ATOM 12949 HA PHE B 314 41.855 33.629 95.339 1.00 0.00 H ATOM 12950 HB2 PHE B 314 42.477 35.703 93.972 1.00 0.00 H ATOM 12951 HB3 PHE B 314 41.114 34.743 93.349 1.00 0.00 H ATOM 12952 HD2 PHE B 314 38.990 35.704 93.023 1.00 0.00 H ATOM 12953 HE2 PHE B 314 37.582 37.752 92.880 1.00 0.00 H ATOM 12954 HZ PHE B 314 38.373 39.869 93.912 1.00 0.00 H ATOM 12955 HE1 PHE B 314 40.588 39.906 95.132 1.00 0.00 H ATOM 12956 HD1 PHE B 314 41.962 37.840 95.256 1.00 0.00 H ATOM 12957 H PHE B 314 39.651 34.829 96.747 1.00 0.00 H ATOM 12958 N LYS B 315 43.530 35.350 96.372 1.00 36.25 N ATOM 12959 CA LYS B 315 44.394 35.993 97.352 1.00 35.49 C ATOM 12960 C LYS B 315 44.120 37.485 97.395 1.00 36.03 C ATOM 12961 O LYS B 315 44.132 38.141 96.368 1.00 34.87 O ATOM 12962 CB LYS B 315 45.887 35.785 97.023 1.00 34.20 C ATOM 12963 CG LYS B 315 46.847 36.219 98.156 1.00 30.91 C ATOM 12964 CD LYS B 315 48.280 36.225 97.579 1.00 32.94 C ATOM 12965 CE LYS B 315 49.278 36.813 98.548 1.00 32.35 C ATOM 12966 NZ LYS B 315 49.349 35.908 99.775 1.00 29.74 N ATOM 12967 HA LYS B 315 44.176 35.535 98.317 1.00 0.00 H ATOM 12968 HB2 LYS B 315 46.050 34.726 96.822 1.00 0.00 H ATOM 12969 HB3 LYS B 315 46.126 36.364 96.131 1.00 0.00 H ATOM 12970 HG2 LYS B 315 46.583 37.217 98.505 1.00 0.00 H ATOM 12971 HG3 LYS B 315 46.784 35.516 98.987 1.00 0.00 H ATOM 12972 HD2 LYS B 315 48.572 35.200 97.351 1.00 0.00 H ATOM 12973 HD3 LYS B 315 48.288 36.816 96.663 1.00 0.00 H ATOM 12974 HE2 LYS B 315 48.959 37.812 98.845 1.00 0.00 H ATOM 12975 HE3 LYS B 315 50.259 36.872 98.076 1.00 0.00 H ATOM 12976 HZ1 LYS B 315 48.410 35.854 100.219 1.00 0.00 H ATOM 12977 HZ2 LYS B 315 49.652 34.956 99.485 1.00 0.00 H ATOM 12978 HZ3 LYS B 315 50.033 36.299 100.454 1.00 0.00 H ATOM 12979 H LYS B 315 43.945 34.900 95.531 1.00 0.00 H ATOM 12980 N LYS B 316 43.869 38.026 98.586 1.00 36.84 N ATOM 12981 CA LYS B 316 43.603 39.453 98.677 1.00 37.77 C ATOM 12982 C LYS B 316 44.874 40.174 99.121 1.00 38.11 C ATOM 12983 O LYS B 316 45.373 39.940 100.224 1.00 39.28 O ATOM 12984 CB LYS B 316 42.422 39.659 99.633 1.00 41.82 C ATOM 12985 CG LYS B 316 41.158 38.964 99.064 1.00 44.47 C ATOM 12986 CD LYS B 316 40.048 38.839 100.062 1.00 47.96 C ATOM 12987 CE LYS B 316 38.896 38.000 99.467 1.00 49.74 C ATOM 12988 NZ LYS B 316 39.209 36.526 99.529 1.00 52.87 N ATOM 12989 HA LYS B 316 43.326 39.878 97.712 1.00 0.00 H ATOM 12990 HB2 LYS B 316 42.664 39.230 100.605 1.00 0.00 H ATOM 12991 HB3 LYS B 316 42.229 40.726 99.746 1.00 0.00 H ATOM 12992 HG2 LYS B 316 40.796 39.545 98.215 1.00 0.00 H ATOM 12993 HG3 LYS B 316 41.435 37.965 98.727 1.00 0.00 H ATOM 12994 HD2 LYS B 316 40.424 38.351 100.961 1.00 0.00 H ATOM 12995 HD3 LYS B 316 39.678 39.832 100.317 1.00 0.00 H ATOM 12996 HE2 LYS B 316 38.745 38.289 98.427 1.00 0.00 H ATOM 12997 HE3 LYS B 316 37.985 38.195 100.032 1.00 0.00 H ATOM 12998 HZ1 LYS B 316 40.075 36.334 98.987 1.00 0.00 H ATOM 12999 HZ2 LYS B 316 39.349 36.244 100.520 1.00 0.00 H ATOM 13000 HZ3 LYS B 316 38.418 35.987 99.122 1.00 0.00 H ATOM 13001 H LYS B 316 43.863 37.435 99.441 1.00 0.00 H ATOM 13002 N THR B 317 45.437 41.032 98.266 1.00 37.71 N ATOM 13003 CA THR B 317 46.669 41.733 98.632 1.00 35.57 C ATOM 13004 C THR B 317 46.724 42.925 97.709 1.00 35.92 C ATOM 13005 O THR B 317 45.692 43.306 97.178 1.00 35.60 O ATOM 13006 CB THR B 317 47.868 40.800 98.412 1.00 34.90 C ATOM 13007 OG1 THR B 317 49.075 41.484 98.753 1.00 34.51 O ATOM 13008 CG2 THR B 317 47.923 40.323 96.913 1.00 34.01 C ATOM 13009 HA THR B 317 46.694 42.041 99.677 1.00 0.00 H ATOM 13010 HB THR B 317 47.758 39.923 99.050 1.00 0.00 H ATOM 13011 HG1 THR B 317 49.847 40.880 98.610 1.00 0.00 H ATOM 13012 HG23 THR B 317 46.998 39.803 96.664 1.00 0.00 H ATOM 13013 HG21 THR B 317 48.041 41.189 96.262 1.00 0.00 H ATOM 13014 HG22 THR B 317 48.768 39.648 96.779 1.00 0.00 H ATOM 13015 H THR B 317 44.999 41.202 97.338 1.00 0.00 H ATOM 13016 N GLN B 318 47.897 43.522 97.518 1.00 36.30 N ATOM 13017 CA GLN B 318 48.026 44.652 96.593 1.00 35.87 C ATOM 13018 C GLN B 318 48.521 44.161 95.208 1.00 35.81 C ATOM 13019 O GLN B 318 49.312 43.237 95.113 1.00 33.67 O ATOM 13020 CB GLN B 318 49.049 45.700 97.100 1.00 36.32 C ATOM 13021 CG GLN B 318 48.809 46.191 98.511 1.00 38.45 C ATOM 13022 CD GLN B 318 49.381 45.221 99.564 1.00 40.83 C ATOM 13023 OE1 GLN B 318 50.373 44.511 99.309 1.00 39.72 O ATOM 13024 NE2 GLN B 318 48.758 45.188 100.750 1.00 42.11 N ATOM 13025 HA GLN B 318 47.038 45.108 96.521 1.00 0.00 H ATOM 13026 HB2 GLN B 318 50.042 45.252 97.061 1.00 0.00 H ATOM 13027 HB3 GLN B 318 49.014 46.560 96.431 1.00 0.00 H ATOM 13028 HG2 GLN B 318 49.286 47.164 98.632 1.00 0.00 H ATOM 13029 HG3 GLN B 318 47.736 46.292 98.671 1.00 0.00 H ATOM 13030 HE22 GLN B 318 47.933 45.798 100.921 1.00 0.00 H ATOM 13031 HE21 GLN B 318 49.100 44.553 101.499 1.00 0.00 H ATOM 13032 H GLN B 318 48.735 43.182 98.032 1.00 0.00 H ATOM 13033 N ILE B 319 48.045 44.780 94.134 1.00 34.44 N ATOM 13034 CA ILE B 319 48.540 44.418 92.836 1.00 34.73 C ATOM 13035 C ILE B 319 48.913 45.655 92.068 1.00 34.08 C ATOM 13036 O ILE B 319 48.363 46.731 92.300 1.00 34.47 O ATOM 13037 CB ILE B 319 47.527 43.579 91.986 1.00 34.21 C ATOM 13038 CG1 ILE B 319 46.201 44.340 91.785 1.00 33.69 C ATOM 13039 CG2 ILE B 319 47.355 42.221 92.637 1.00 35.56 C ATOM 13040 CD1 ILE B 319 45.225 43.691 90.781 1.00 30.32 C ATOM 13041 HA ILE B 319 49.411 43.786 93.011 1.00 0.00 H ATOM 13042 HB ILE B 319 47.917 43.420 90.981 1.00 0.00 H ATOM 13043 HG12 ILE B 319 45.699 44.407 92.750 1.00 0.00 H ATOM 13044 HG13 ILE B 319 46.436 45.343 91.429 1.00 0.00 H ATOM 13045 HD11 ILE B 319 45.701 43.627 89.803 1.00 0.00 H ATOM 13046 HD12 ILE B 319 44.963 42.690 91.125 1.00 0.00 H ATOM 13047 HD13 ILE B 319 44.323 44.299 90.708 1.00 0.00 H ATOM 13048 HG21 ILE B 319 48.318 41.713 92.674 1.00 0.00 H ATOM 13049 HG22 ILE B 319 46.972 42.351 93.649 1.00 0.00 H ATOM 13050 HG23 ILE B 319 46.651 41.627 92.054 1.00 0.00 H ATOM 13051 H ILE B 319 47.321 45.520 94.232 1.00 0.00 H ATOM 13052 N LEU B 320 49.888 45.513 91.179 1.00 33.48 N ATOM 13053 CA LEU B 320 50.276 46.624 90.315 1.00 33.58 C ATOM 13054 C LEU B 320 50.277 45.984 88.904 1.00 33.51 C ATOM 13055 O LEU B 320 50.822 44.898 88.700 1.00 33.36 O ATOM 13056 CB LEU B 320 51.627 47.187 90.751 1.00 33.52 C ATOM 13057 CG LEU B 320 52.160 48.292 89.853 1.00 34.16 C ATOM 13058 CD1 LEU B 320 53.132 49.194 90.667 1.00 34.85 C ATOM 13059 CD2 LEU B 320 52.823 47.654 88.646 1.00 33.23 C ATOM 13060 HA LEU B 320 49.612 47.488 90.351 1.00 0.00 H ATOM 13061 HB2 LEU B 320 51.522 47.587 91.760 1.00 0.00 H ATOM 13062 HB3 LEU B 320 52.351 46.372 90.758 1.00 0.00 H ATOM 13063 HG LEU B 320 51.356 48.934 89.493 1.00 0.00 H ATOM 13064 HD21 LEU B 320 53.642 47.016 88.978 1.00 0.00 H ATOM 13065 HD22 LEU B 320 52.090 47.055 88.105 1.00 0.00 H ATOM 13066 HD23 LEU B 320 53.211 48.434 87.991 1.00 0.00 H ATOM 13067 HD11 LEU B 320 52.598 49.634 91.509 1.00 0.00 H ATOM 13068 HD12 LEU B 320 53.962 48.591 91.036 1.00 0.00 H ATOM 13069 HD13 LEU B 320 53.515 49.987 90.024 1.00 0.00 H ATOM 13070 H LEU B 320 50.381 44.601 91.097 1.00 0.00 H ATOM 13071 N LEU B 321 49.630 46.633 87.940 1.00 33.39 N ATOM 13072 CA LEU B 321 49.510 46.018 86.644 1.00 32.69 C ATOM 13073 C LEU B 321 49.210 47.055 85.552 1.00 33.24 C ATOM 13074 O LEU B 321 48.863 48.208 85.837 1.00 33.99 O ATOM 13075 CB LEU B 321 48.376 44.951 86.700 1.00 32.56 C ATOM 13076 CG LEU B 321 46.872 45.382 86.741 1.00 31.37 C ATOM 13077 CD1 LEU B 321 45.962 44.065 86.721 1.00 28.38 C ATOM 13078 CD2 LEU B 321 46.561 46.196 88.058 1.00 30.31 C ATOM 13079 HA LEU B 321 50.459 45.546 86.390 1.00 0.00 H ATOM 13080 HB2 LEU B 321 48.496 44.323 85.817 1.00 0.00 H ATOM 13081 HB3 LEU B 321 48.553 44.355 87.595 1.00 0.00 H ATOM 13082 HG LEU B 321 46.660 46.014 85.878 1.00 0.00 H ATOM 13083 HD21 LEU B 321 46.774 45.574 88.927 1.00 0.00 H ATOM 13084 HD22 LEU B 321 47.185 47.089 88.088 1.00 0.00 H ATOM 13085 HD23 LEU B 321 45.510 46.485 88.065 1.00 0.00 H ATOM 13086 HD11 LEU B 321 46.162 43.501 85.810 1.00 0.00 H ATOM 13087 HD12 LEU B 321 46.196 43.450 87.590 1.00 0.00 H ATOM 13088 HD13 LEU B 321 44.911 44.351 86.749 1.00 0.00 H ATOM 13089 H LEU B 321 49.217 47.570 88.120 1.00 0.00 H ATOM 13090 N GLY B 322 49.316 46.624 84.303 1.00 31.62 N ATOM 13091 CA GLY B 322 49.077 47.515 83.203 1.00 31.34 C ATOM 13092 C GLY B 322 49.289 46.875 81.873 1.00 32.25 C ATOM 13093 O GLY B 322 49.614 45.644 81.760 1.00 32.98 O ATOM 13094 HA3 GLY B 322 49.754 48.364 83.291 1.00 0.00 H ATOM 13095 HA2 GLY B 322 48.047 47.866 83.259 1.00 0.00 H ATOM 13096 H GLY B 322 49.574 45.634 84.119 1.00 0.00 H ATOM 13097 N VAL B 323 49.087 47.703 80.844 1.00 32.23 N ATOM 13098 CA VAL B 323 49.201 47.275 79.453 1.00 30.78 C ATOM 13099 C VAL B 323 50.013 48.295 78.641 1.00 32.51 C ATOM 13100 O VAL B 323 50.321 49.387 79.136 1.00 33.75 O ATOM 13101 CB VAL B 323 47.809 47.164 78.807 1.00 29.45 C ATOM 13102 CG1 VAL B 323 46.920 46.216 79.603 1.00 29.95 C ATOM 13103 CG2 VAL B 323 47.141 48.554 78.775 1.00 28.82 C ATOM 13104 HA VAL B 323 49.699 46.305 79.448 1.00 0.00 H ATOM 13105 HB VAL B 323 47.932 46.778 77.795 1.00 0.00 H ATOM 13106 HG11 VAL B 323 47.377 45.227 79.629 1.00 0.00 H ATOM 13107 HG12 VAL B 323 46.808 46.592 80.620 1.00 0.00 H ATOM 13108 HG13 VAL B 323 45.941 46.153 79.128 1.00 0.00 H ATOM 13109 HG21 VAL B 323 47.040 48.930 79.793 1.00 0.00 H ATOM 13110 HG22 VAL B 323 47.758 49.239 78.193 1.00 0.00 H ATOM 13111 HG23 VAL B 323 46.155 48.472 78.317 1.00 0.00 H ATOM 13112 H VAL B 323 48.838 48.693 81.042 1.00 0.00 H ATOM 13113 N ASN B 324 50.368 47.914 77.417 1.00 31.89 N ATOM 13114 CA ASN B 324 51.097 48.783 76.482 1.00 34.40 C ATOM 13115 C ASN B 324 50.084 49.263 75.407 1.00 34.41 C ATOM 13116 O ASN B 324 49.024 48.643 75.187 1.00 32.56 O ATOM 13117 CB ASN B 324 52.213 48.029 75.790 1.00 32.94 C ATOM 13118 CG ASN B 324 53.274 47.573 76.740 1.00 34.66 C ATOM 13119 OD1 ASN B 324 53.259 47.909 77.933 1.00 34.76 O ATOM 13120 ND2 ASN B 324 54.235 46.808 76.219 1.00 35.77 N ATOM 13121 HA ASN B 324 51.536 49.616 77.030 1.00 0.00 H ATOM 13122 HB2 ASN B 324 51.789 47.156 75.294 1.00 0.00 H ATOM 13123 HB3 ASN B 324 52.668 48.683 75.046 1.00 0.00 H ATOM 13124 HD22 ASN B 324 54.206 46.551 75.212 1.00 0.00 H ATOM 13125 HD21 ASN B 324 55.013 46.469 76.820 1.00 0.00 H ATOM 13126 H ASN B 324 50.117 46.954 77.106 1.00 0.00 H ATOM 13127 N LYS B 325 50.433 50.352 74.737 1.00 35.06 N ATOM 13128 CA LYS B 325 49.546 50.984 73.748 1.00 35.00 C ATOM 13129 C LYS B 325 49.138 50.128 72.551 1.00 33.50 C ATOM 13130 O LYS B 325 47.962 50.117 72.203 1.00 30.51 O ATOM 13131 CB LYS B 325 50.159 52.325 73.266 1.00 35.89 C ATOM 13132 CG LYS B 325 49.242 53.173 72.334 1.00 38.62 C ATOM 13133 CD LYS B 325 49.867 54.489 71.927 1.00 40.74 C ATOM 13134 CE LYS B 325 49.718 54.742 70.400 1.00 44.95 C ATOM 13135 NZ LYS B 325 50.731 53.963 69.473 1.00 47.44 N ATOM 13136 HA LYS B 325 48.612 51.145 74.287 1.00 0.00 H ATOM 13137 HB2 LYS B 325 50.394 52.925 74.145 1.00 0.00 H ATOM 13138 HB3 LYS B 325 51.078 52.101 72.724 1.00 0.00 H ATOM 13139 HG2 LYS B 325 49.032 52.595 71.434 1.00 0.00 H ATOM 13140 HG3 LYS B 325 48.309 53.379 72.858 1.00 0.00 H ATOM 13141 HD2 LYS B 325 49.377 55.297 72.470 1.00 0.00 H ATOM 13142 HD3 LYS B 325 50.927 54.472 72.182 1.00 0.00 H ATOM 13143 HE2 LYS B 325 49.854 55.809 70.223 1.00 0.00 H ATOM 13144 HE3 LYS B 325 48.708 54.453 70.110 1.00 0.00 H ATOM 13145 HZ1 LYS B 325 51.704 54.235 69.720 1.00 0.00 H ATOM 13146 HZ2 LYS B 325 50.610 52.940 69.612 1.00 0.00 H ATOM 13147 HZ3 LYS B 325 50.544 54.204 68.479 1.00 0.00 H ATOM 13148 H LYS B 325 51.366 50.774 74.917 1.00 0.00 H ATOM 13149 N ASP B 326 50.091 49.406 71.940 1.00 33.05 N ATOM 13150 CA ASP B 326 49.782 48.601 70.745 1.00 32.56 C ATOM 13151 C ASP B 326 49.999 47.105 70.918 1.00 33.58 C ATOM 13152 O ASP B 326 50.914 46.481 70.300 1.00 33.53 O ATOM 13153 CB ASP B 326 50.606 49.144 69.579 1.00 33.32 C ATOM 13154 CG ASP B 326 50.507 50.692 69.477 1.00 35.23 C ATOM 13155 OD1 ASP B 326 49.448 51.187 69.046 1.00 34.94 O ATOM 13156 OD2 ASP B 326 51.469 51.400 69.854 1.00 34.52 O ATOM 13157 HA ASP B 326 48.714 48.699 70.552 1.00 0.00 H ATOM 13158 HB2 ASP B 326 51.650 48.865 69.724 1.00 0.00 H ATOM 13159 HB3 ASP B 326 50.239 48.704 68.652 1.00 0.00 H ATOM 13160 H ASP B 326 51.061 49.415 72.315 1.00 0.00 H ATOM 13161 N GLU B 327 49.147 46.528 71.766 1.00 32.94 N ATOM 13162 CA GLU B 327 49.246 45.130 72.109 1.00 31.11 C ATOM 13163 C GLU B 327 49.016 44.179 70.928 1.00 31.87 C ATOM 13164 O GLU B 327 49.624 43.105 70.896 1.00 32.22 O ATOM 13165 CB GLU B 327 48.282 44.781 73.266 1.00 31.27 C ATOM 13166 CG GLU B 327 48.461 45.551 74.596 1.00 31.36 C ATOM 13167 CD GLU B 327 49.684 45.106 75.395 1.00 33.15 C ATOM 13168 OE1 GLU B 327 50.595 44.467 74.794 1.00 35.11 O ATOM 13169 OE2 GLU B 327 49.745 45.381 76.623 1.00 33.35 O ATOM 13170 HA GLU B 327 50.278 44.979 72.427 1.00 0.00 H ATOM 13171 HB2 GLU B 327 47.267 44.966 72.914 1.00 0.00 H ATOM 13172 HB3 GLU B 327 48.402 43.720 73.483 1.00 0.00 H ATOM 13173 HG2 GLU B 327 48.563 46.612 74.370 1.00 0.00 H ATOM 13174 HG3 GLU B 327 47.573 45.395 75.208 1.00 0.00 H ATOM 13175 H GLU B 327 48.391 47.101 72.192 1.00 0.00 H ATOM 13176 N GLY B 328 48.204 44.548 69.940 1.00 31.63 N ATOM 13177 CA GLY B 328 47.980 43.627 68.851 1.00 32.06 C ATOM 13178 C GLY B 328 48.984 43.598 67.693 1.00 33.67 C ATOM 13179 O GLY B 328 49.140 42.560 66.995 1.00 32.25 O ATOM 13180 HA3 GLY B 328 47.005 43.865 68.425 1.00 0.00 H ATOM 13181 HA2 GLY B 328 47.954 42.625 69.278 1.00 0.00 H ATOM 13182 H GLY B 328 47.741 45.479 69.952 1.00 0.00 H ATOM 13183 N SER B 329 49.747 44.668 67.503 1.00 33.97 N ATOM 13184 CA SER B 329 50.588 44.666 66.301 1.00 33.70 C ATOM 13185 C SER B 329 51.523 43.472 66.039 1.00 33.91 C ATOM 13186 O SER B 329 51.622 42.977 64.891 1.00 32.39 O ATOM 13187 CB SER B 329 51.300 46.023 66.170 1.00 35.11 C ATOM 13188 OG SER B 329 52.223 46.239 67.177 1.00 39.21 O ATOM 13189 HA SER B 329 49.874 44.511 65.492 1.00 0.00 H ATOM 13190 HB2 SER B 329 50.552 46.815 66.206 1.00 0.00 H ATOM 13191 HB3 SER B 329 51.816 46.056 65.210 1.00 0.00 H ATOM 13192 HG SER B 329 52.651 47.122 67.047 1.00 0.00 H ATOM 13193 H SER B 329 49.748 45.465 68.171 1.00 0.00 H ATOM 13194 N PHE B 330 52.147 42.941 67.079 1.00 34.22 N ATOM 13195 CA PHE B 330 53.051 41.803 66.910 1.00 33.67 C ATOM 13196 C PHE B 330 52.351 40.589 66.310 1.00 34.80 C ATOM 13197 O PHE B 330 52.872 39.915 65.381 1.00 34.22 O ATOM 13198 CB PHE B 330 53.674 41.416 68.266 1.00 35.39 C ATOM 13199 CG PHE B 330 54.641 40.266 68.182 1.00 38.65 C ATOM 13200 CD1 PHE B 330 54.184 38.944 68.270 1.00 40.16 C ATOM 13201 CD2 PHE B 330 56.010 40.504 68.010 1.00 40.39 C ATOM 13202 CE1 PHE B 330 55.068 37.870 68.192 1.00 41.10 C ATOM 13203 CE2 PHE B 330 56.918 39.447 67.922 1.00 41.08 C ATOM 13204 CZ PHE B 330 56.449 38.126 68.014 1.00 41.19 C ATOM 13205 HA PHE B 330 53.830 42.115 66.214 1.00 0.00 H ATOM 13206 HB2 PHE B 330 54.203 42.283 68.662 1.00 0.00 H ATOM 13207 HB3 PHE B 330 52.870 41.140 68.948 1.00 0.00 H ATOM 13208 HD2 PHE B 330 56.372 41.530 67.944 1.00 0.00 H ATOM 13209 HE2 PHE B 330 57.981 39.645 67.783 1.00 0.00 H ATOM 13210 HZ PHE B 330 57.151 37.295 67.948 1.00 0.00 H ATOM 13211 HE1 PHE B 330 54.701 36.846 68.267 1.00 0.00 H ATOM 13212 HD1 PHE B 330 53.119 38.753 68.402 1.00 0.00 H ATOM 13213 H PHE B 330 51.993 43.338 68.028 1.00 0.00 H ATOM 13214 N PHE B 331 51.151 40.303 66.811 1.00 34.82 N ATOM 13215 CA PHE B 331 50.429 39.130 66.306 1.00 33.56 C ATOM 13216 C PHE B 331 49.869 39.311 64.910 1.00 33.85 C ATOM 13217 O PHE B 331 49.762 38.334 64.180 1.00 34.49 O ATOM 13218 CB PHE B 331 49.337 38.713 67.292 1.00 32.43 C ATOM 13219 CG PHE B 331 49.859 38.540 68.686 1.00 33.04 C ATOM 13220 CD1 PHE B 331 50.034 39.665 69.506 1.00 31.81 C ATOM 13221 CD2 PHE B 331 50.341 37.294 69.106 1.00 31.50 C ATOM 13222 CE1 PHE B 331 50.702 39.584 70.753 1.00 32.77 C ATOM 13223 CE2 PHE B 331 51.010 37.180 70.335 1.00 33.01 C ATOM 13224 CZ PHE B 331 51.198 38.322 71.169 1.00 32.36 C ATOM 13225 HA PHE B 331 51.163 38.328 66.222 1.00 0.00 H ATOM 13226 HB2 PHE B 331 48.562 39.480 67.301 1.00 0.00 H ATOM 13227 HB3 PHE B 331 48.907 37.768 66.959 1.00 0.00 H ATOM 13228 HD2 PHE B 331 50.197 36.414 68.479 1.00 0.00 H ATOM 13229 HE2 PHE B 331 51.389 36.210 70.655 1.00 0.00 H ATOM 13230 HZ PHE B 331 51.720 38.225 72.121 1.00 0.00 H ATOM 13231 HE1 PHE B 331 50.831 40.469 71.376 1.00 0.00 H ATOM 13232 HD1 PHE B 331 49.645 40.628 69.175 1.00 0.00 H ATOM 13233 H PHE B 331 50.731 40.903 67.550 1.00 0.00 H ATOM 13234 N LEU B 332 49.481 40.533 64.556 1.00 32.98 N ATOM 13235 CA LEU B 332 48.959 40.819 63.208 1.00 34.73 C ATOM 13236 C LEU B 332 50.127 40.662 62.193 1.00 33.91 C ATOM 13237 O LEU B 332 49.959 40.075 61.128 1.00 33.60 O ATOM 13238 CB LEU B 332 48.382 42.261 63.133 1.00 33.79 C ATOM 13239 CG LEU B 332 47.123 42.501 63.970 1.00 32.99 C ATOM 13240 CD1 LEU B 332 46.922 44.008 64.259 1.00 29.42 C ATOM 13241 CD2 LEU B 332 45.947 41.856 63.197 1.00 31.31 C ATOM 13242 HA LEU B 332 48.153 40.124 62.973 1.00 0.00 H ATOM 13243 HB2 LEU B 332 49.152 42.952 63.476 1.00 0.00 H ATOM 13244 HB3 LEU B 332 48.141 42.475 62.092 1.00 0.00 H ATOM 13245 HG LEU B 332 47.200 42.042 64.956 1.00 0.00 H ATOM 13246 HD21 LEU B 332 45.858 42.325 62.217 1.00 0.00 H ATOM 13247 HD22 LEU B 332 46.135 40.789 63.075 1.00 0.00 H ATOM 13248 HD23 LEU B 332 45.023 42.001 63.756 1.00 0.00 H ATOM 13249 HD11 LEU B 332 47.783 44.389 64.808 1.00 0.00 H ATOM 13250 HD12 LEU B 332 46.822 44.547 63.317 1.00 0.00 H ATOM 13251 HD13 LEU B 332 46.020 44.145 64.855 1.00 0.00 H ATOM 13252 H LEU B 332 49.548 41.306 65.248 1.00 0.00 H ATOM 13253 N LEU B 333 51.307 41.165 62.550 1.00 34.97 N ATOM 13254 CA LEU B 333 52.487 41.038 61.697 1.00 35.11 C ATOM 13255 C LEU B 333 52.723 39.561 61.411 1.00 37.03 C ATOM 13256 O LEU B 333 52.883 39.142 60.249 1.00 37.11 O ATOM 13257 CB LEU B 333 53.733 41.592 62.419 1.00 35.09 C ATOM 13258 CG LEU B 333 55.076 41.125 61.815 1.00 37.62 C ATOM 13259 CD1 LEU B 333 55.069 41.509 60.253 1.00 37.66 C ATOM 13260 CD2 LEU B 333 56.278 41.766 62.531 1.00 36.73 C ATOM 13261 HA LEU B 333 52.322 41.597 60.776 1.00 0.00 H ATOM 13262 HB2 LEU B 333 53.698 42.681 62.375 1.00 0.00 H ATOM 13263 HB3 LEU B 333 53.696 41.271 63.460 1.00 0.00 H ATOM 13264 HG LEU B 333 55.180 40.048 61.944 1.00 0.00 H ATOM 13265 HD21 LEU B 333 56.219 42.850 62.438 1.00 0.00 H ATOM 13266 HD22 LEU B 333 56.261 41.489 63.585 1.00 0.00 H ATOM 13267 HD23 LEU B 333 57.202 41.411 62.075 1.00 0.00 H ATOM 13268 HD11 LEU B 333 54.236 41.007 59.761 1.00 0.00 H ATOM 13269 HD12 LEU B 333 54.959 42.588 60.146 1.00 0.00 H ATOM 13270 HD13 LEU B 333 56.007 41.191 59.798 1.00 0.00 H ATOM 13271 H LEU B 333 51.391 41.661 63.460 1.00 0.00 H ATOM 13272 N TYR B 334 52.785 38.771 62.479 1.00 37.69 N ATOM 13273 CA TYR B 334 53.033 37.347 62.306 1.00 39.56 C ATOM 13274 C TYR B 334 51.920 36.581 61.629 1.00 40.25 C ATOM 13275 O TYR B 334 52.207 35.679 60.881 1.00 41.19 O ATOM 13276 CB TYR B 334 53.344 36.655 63.637 1.00 37.85 C ATOM 13277 CG TYR B 334 54.791 36.760 64.029 1.00 36.01 C ATOM 13278 CD1 TYR B 334 55.391 38.011 64.145 1.00 35.34 C ATOM 13279 CD2 TYR B 334 55.567 35.616 64.266 1.00 34.23 C ATOM 13280 CE1 TYR B 334 56.729 38.140 64.485 1.00 35.30 C ATOM 13281 CE2 TYR B 334 56.930 35.728 64.628 1.00 34.87 C ATOM 13282 CZ TYR B 334 57.501 37.007 64.736 1.00 34.11 C ATOM 13283 OH TYR B 334 58.820 37.181 65.118 1.00 34.42 O ATOM 13284 HA TYR B 334 53.898 37.323 61.643 1.00 0.00 H ATOM 13285 HB3 TYR B 334 53.083 35.600 63.550 1.00 0.00 H ATOM 13286 HB2 TYR B 334 52.738 37.115 64.418 1.00 0.00 H ATOM 13287 HD2 TYR B 334 55.115 34.629 64.170 1.00 0.00 H ATOM 13288 HE2 TYR B 334 57.527 34.837 64.820 1.00 0.00 H ATOM 13289 HE1 TYR B 334 57.178 39.130 64.556 1.00 0.00 H ATOM 13290 HD1 TYR B 334 54.797 38.907 63.965 1.00 0.00 H ATOM 13291 HH TYR B 334 58.954 36.797 66.020 1.00 0.00 H ATOM 13292 H TYR B 334 52.657 39.168 63.432 1.00 0.00 H ATOM 13293 N GLY B 335 50.664 36.933 61.809 1.00 40.07 N ATOM 13294 CA GLY B 335 49.693 36.075 61.153 1.00 42.00 C ATOM 13295 C GLY B 335 48.509 36.620 60.365 1.00 42.59 C ATOM 13296 O GLY B 335 47.714 35.834 59.860 1.00 43.35 O ATOM 13297 HA3 GLY B 335 49.270 35.445 61.936 1.00 0.00 H ATOM 13298 HA2 GLY B 335 50.259 35.456 60.457 1.00 0.00 H ATOM 13299 H GLY B 335 50.389 37.760 62.376 1.00 0.00 H ATOM 13300 N ALA B 336 48.362 37.927 60.240 1.00 39.18 N ATOM 13301 CA ALA B 336 47.198 38.424 59.516 1.00 38.27 C ATOM 13302 C ALA B 336 47.574 38.908 58.111 1.00 39.34 C ATOM 13303 O ALA B 336 48.676 39.448 57.882 1.00 37.28 O ATOM 13304 CB ALA B 336 46.548 39.566 60.301 1.00 36.50 C ATOM 13305 HA ALA B 336 46.491 37.601 59.410 1.00 0.00 H ATOM 13306 HB1 ALA B 336 46.236 39.201 61.279 1.00 0.00 H ATOM 13307 HB2 ALA B 336 47.268 40.375 60.426 1.00 0.00 H ATOM 13308 HB3 ALA B 336 45.679 39.932 59.754 1.00 0.00 H ATOM 13309 H ALA B 336 49.058 38.584 60.647 1.00 0.00 H ATOM 13310 N PRO B 337 46.667 38.716 57.146 1.00 42.23 N ATOM 13311 CA PRO B 337 46.972 39.165 55.776 1.00 42.91 C ATOM 13312 C PRO B 337 47.082 40.686 55.631 1.00 43.20 C ATOM 13313 O PRO B 337 46.336 41.460 56.263 1.00 43.77 O ATOM 13314 CB PRO B 337 45.836 38.584 54.961 1.00 44.68 C ATOM 13315 CG PRO B 337 44.663 38.596 55.932 1.00 43.37 C ATOM 13316 CD PRO B 337 45.306 38.140 57.241 1.00 42.70 C ATOM 13317 HA PRO B 337 47.955 38.827 55.447 1.00 0.00 H ATOM 13318 HD3 PRO B 337 44.769 38.536 58.103 1.00 0.00 H ATOM 13319 HD2 PRO B 337 45.342 37.052 57.305 1.00 0.00 H ATOM 13320 HG3 PRO B 337 43.883 37.904 55.615 1.00 0.00 H ATOM 13321 HG2 PRO B 337 44.242 39.597 56.028 1.00 0.00 H ATOM 13322 HB2 PRO B 337 45.626 39.202 54.088 1.00 0.00 H ATOM 13323 HB3 PRO B 337 46.066 37.568 54.639 1.00 0.00 H ATOM 13324 N GLY B 338 48.032 41.103 54.794 1.00 42.83 N ATOM 13325 CA GLY B 338 48.254 42.522 54.581 1.00 41.14 C ATOM 13326 C GLY B 338 49.404 43.119 55.385 1.00 39.61 C ATOM 13327 O GLY B 338 49.955 44.137 54.974 1.00 39.62 O ATOM 13328 HA3 GLY B 338 47.341 43.052 54.851 1.00 0.00 H ATOM 13329 HA2 GLY B 338 48.464 42.677 53.523 1.00 0.00 H ATOM 13330 H GLY B 338 48.618 40.407 54.290 1.00 0.00 H ATOM 13331 N PHE B 339 49.766 42.511 56.521 1.00 37.76 N ATOM 13332 CA PHE B 339 50.865 43.028 57.338 1.00 37.71 C ATOM 13333 C PHE B 339 52.185 42.447 56.934 1.00 38.23 C ATOM 13334 O PHE B 339 52.291 41.249 56.665 1.00 40.24 O ATOM 13335 CB PHE B 339 50.644 42.715 58.830 1.00 36.09 C ATOM 13336 CG PHE B 339 49.426 43.358 59.383 1.00 34.09 C ATOM 13337 CD1 PHE B 339 49.528 44.546 60.113 1.00 32.98 C ATOM 13338 CD2 PHE B 339 48.171 42.786 59.170 1.00 30.23 C ATOM 13339 CE1 PHE B 339 48.381 45.162 60.641 1.00 31.80 C ATOM 13340 CE2 PHE B 339 47.023 43.385 59.690 1.00 33.16 C ATOM 13341 CZ PHE B 339 47.139 44.595 60.437 1.00 30.98 C ATOM 13342 HA PHE B 339 50.880 44.106 57.177 1.00 0.00 H ATOM 13343 HB2 PHE B 339 50.552 41.635 58.949 1.00 0.00 H ATOM 13344 HB3 PHE B 339 51.509 43.068 59.391 1.00 0.00 H ATOM 13345 HD2 PHE B 339 48.087 41.865 58.593 1.00 0.00 H ATOM 13346 HE2 PHE B 339 46.045 42.932 59.527 1.00 0.00 H ATOM 13347 HZ PHE B 339 46.248 45.071 60.846 1.00 0.00 H ATOM 13348 HE1 PHE B 339 48.472 46.087 61.211 1.00 0.00 H ATOM 13349 HD1 PHE B 339 50.506 44.998 60.274 1.00 0.00 H ATOM 13350 H PHE B 339 49.258 41.657 56.828 1.00 0.00 H ATOM 13351 N SER B 340 53.209 43.277 56.903 1.00 38.48 N ATOM 13352 CA SER B 340 54.546 42.775 56.563 1.00 38.92 C ATOM 13353 C SER B 340 55.477 43.569 57.407 1.00 38.51 C ATOM 13354 O SER B 340 55.148 44.694 57.769 1.00 38.38 O ATOM 13355 CB SER B 340 54.896 43.033 55.074 1.00 39.41 C ATOM 13356 OG SER B 340 53.904 42.497 54.219 1.00 43.12 O ATOM 13357 HA SER B 340 54.607 41.699 56.729 1.00 0.00 H ATOM 13358 HB2 SER B 340 55.854 42.565 54.846 1.00 0.00 H ATOM 13359 HB3 SER B 340 54.969 44.107 54.906 1.00 0.00 H ATOM 13360 HG SER B 340 53.033 42.922 54.419 1.00 0.00 H ATOM 13361 H SER B 340 53.070 44.285 57.119 1.00 0.00 H ATOM 13362 N LYS B 341 56.660 43.022 57.687 1.00 38.08 N ATOM 13363 CA LYS B 341 57.615 43.724 58.503 1.00 38.08 C ATOM 13364 C LYS B 341 58.243 44.962 57.846 1.00 39.27 C ATOM 13365 O LYS B 341 58.544 45.973 58.522 1.00 37.38 O ATOM 13366 CB LYS B 341 58.732 42.785 58.921 1.00 39.07 C ATOM 13367 CG LYS B 341 59.798 43.530 59.721 1.00 41.76 C ATOM 13368 CD LYS B 341 60.731 42.578 60.531 1.00 42.71 C ATOM 13369 CE LYS B 341 61.858 42.081 59.648 1.00 43.06 C ATOM 13370 NZ LYS B 341 62.621 43.233 59.073 1.00 45.27 N ATOM 13371 HA LYS B 341 57.043 44.081 59.359 1.00 0.00 H ATOM 13372 HB2 LYS B 341 58.316 41.987 59.536 1.00 0.00 H ATOM 13373 HB3 LYS B 341 59.189 42.355 58.030 1.00 0.00 H ATOM 13374 HG2 LYS B 341 60.409 44.110 59.029 1.00 0.00 H ATOM 13375 HG3 LYS B 341 59.301 44.205 60.418 1.00 0.00 H ATOM 13376 HD2 LYS B 341 61.149 43.119 61.380 1.00 0.00 H ATOM 13377 HD3 LYS B 341 60.153 41.727 60.892 1.00 0.00 H ATOM 13378 HE2 LYS B 341 61.442 41.485 58.836 1.00 0.00 H ATOM 13379 HE3 LYS B 341 62.533 41.464 60.241 1.00 0.00 H ATOM 13380 HZ1 LYS B 341 61.980 43.822 58.504 1.00 0.00 H ATOM 13381 HZ2 LYS B 341 63.022 43.802 59.846 1.00 0.00 H ATOM 13382 HZ3 LYS B 341 63.389 42.873 58.471 1.00 0.00 H ATOM 13383 H LYS B 341 56.895 42.080 57.313 1.00 0.00 H ATOM 13384 N ASP B 342 58.425 44.906 56.529 1.00 37.61 N ATOM 13385 CA ASP B 342 59.090 46.024 55.869 1.00 38.47 C ATOM 13386 C ASP B 342 58.219 46.998 55.086 1.00 38.43 C ATOM 13387 O ASP B 342 58.736 47.702 54.238 1.00 37.17 O ATOM 13388 CB ASP B 342 60.211 45.505 54.960 1.00 37.79 C ATOM 13389 CG ASP B 342 61.175 44.552 55.681 1.00 39.36 C ATOM 13390 OD1 ASP B 342 61.285 44.600 56.936 1.00 38.78 O ATOM 13391 OD2 ASP B 342 61.852 43.747 54.980 1.00 40.49 O ATOM 13392 HA ASP B 342 59.468 46.617 56.702 1.00 0.00 H ATOM 13393 HB2 ASP B 342 59.761 44.975 54.121 1.00 0.00 H ATOM 13394 HB3 ASP B 342 60.779 46.357 54.587 1.00 0.00 H ATOM 13395 H ASP B 342 58.100 44.083 55.982 1.00 0.00 H ATOM 13396 N SER B 343 56.908 46.998 55.314 1.00 39.66 N ATOM 13397 CA SER B 343 56.030 47.967 54.661 1.00 41.38 C ATOM 13398 C SER B 343 55.288 48.700 55.786 1.00 42.27 C ATOM 13399 O SER B 343 55.398 48.336 56.941 1.00 41.58 O ATOM 13400 CB SER B 343 55.023 47.311 53.753 1.00 41.19 C ATOM 13401 OG SER B 343 54.051 46.673 54.543 1.00 46.29 O ATOM 13402 HA SER B 343 56.624 48.636 54.039 1.00 0.00 H ATOM 13403 HB2 SER B 343 55.522 46.576 53.121 1.00 0.00 H ATOM 13404 HB3 SER B 343 54.548 48.065 53.125 1.00 0.00 H ATOM 13405 HG SER B 343 53.383 46.238 53.955 1.00 0.00 H ATOM 13406 H SER B 343 56.502 46.298 55.967 1.00 0.00 H ATOM 13407 N GLU B 344 54.427 49.666 55.431 1.00 40.14 N ATOM 13408 CA GLU B 344 53.841 50.499 56.469 1.00 41.54 C ATOM 13409 C GLU B 344 52.535 49.684 56.854 1.00 41.33 C ATOM 13410 O GLU B 344 51.758 50.089 57.776 1.00 41.50 O ATOM 13411 CB GLU B 344 53.486 51.831 55.714 1.00 43.00 C ATOM 13412 CG GLU B 344 54.290 53.075 56.341 1.00 50.56 C ATOM 13413 CD GLU B 344 53.700 54.213 55.690 1.00 54.49 C ATOM 13414 OE1 GLU B 344 53.570 54.260 54.476 1.00 55.47 O ATOM 13415 OE2 GLU B 344 52.978 55.084 56.273 1.00 57.03 O ATOM 13416 HA GLU B 344 54.440 50.721 57.352 1.00 0.00 H ATOM 13417 HB2 GLU B 344 53.751 51.727 54.662 1.00 0.00 H ATOM 13418 HB3 GLU B 344 52.415 52.017 55.801 1.00 0.00 H ATOM 13419 HG2 GLU B 344 54.150 53.126 57.421 1.00 0.00 H ATOM 13420 HG3 GLU B 344 55.354 53.005 56.117 1.00 0.00 H ATOM 13421 H GLU B 344 54.183 49.816 54.431 1.00 0.00 H ATOM 13422 N SER B 345 52.274 48.628 56.069 1.00 42.29 N ATOM 13423 CA SER B 345 51.145 47.757 56.347 1.00 40.74 C ATOM 13424 C SER B 345 49.779 48.430 56.343 1.00 43.41 C ATOM 13425 O SER B 345 48.952 48.272 57.298 1.00 42.38 O ATOM 13426 CB SER B 345 51.353 47.046 57.689 1.00 39.06 C ATOM 13427 OG SER B 345 52.376 46.077 57.617 1.00 38.02 O ATOM 13428 HA SER B 345 51.126 47.052 55.516 1.00 0.00 H ATOM 13429 HB2 SER B 345 50.423 46.556 57.977 1.00 0.00 H ATOM 13430 HB3 SER B 345 51.621 47.786 58.443 1.00 0.00 H ATOM 13431 HG SER B 345 52.479 45.642 58.500 1.00 0.00 H ATOM 13432 H SER B 345 52.887 48.431 55.252 1.00 0.00 H ATOM 13433 N LYS B 346 49.493 49.159 55.268 1.00 43.57 N ATOM 13434 CA LYS B 346 48.201 49.804 55.175 1.00 43.70 C ATOM 13435 C LYS B 346 47.282 48.659 54.780 1.00 43.28 C ATOM 13436 O LYS B 346 47.562 47.872 53.878 1.00 44.28 O ATOM 13437 CB LYS B 346 48.255 50.923 54.145 1.00 46.35 C ATOM 13438 CG LYS B 346 49.142 52.119 54.558 1.00 45.48 C ATOM 13439 CD LYS B 346 49.115 53.122 53.379 1.00 51.12 C ATOM 13440 CE LYS B 346 50.078 54.323 53.501 1.00 53.71 C ATOM 13441 NZ LYS B 346 50.296 54.944 52.138 1.00 56.38 N ATOM 13442 HA LYS B 346 47.861 50.290 56.090 1.00 0.00 H ATOM 13443 HB2 LYS B 346 48.645 50.513 53.214 1.00 0.00 H ATOM 13444 HB3 LYS B 346 47.241 51.288 53.983 1.00 0.00 H ATOM 13445 HG2 LYS B 346 48.746 52.587 55.459 1.00 0.00 H ATOM 13446 HG3 LYS B 346 50.163 51.784 54.743 1.00 0.00 H ATOM 13447 HD2 LYS B 346 49.371 52.578 52.470 1.00 0.00 H ATOM 13448 HD3 LYS B 346 48.101 53.512 53.294 1.00 0.00 H ATOM 13449 HE2 LYS B 346 51.033 53.983 53.901 1.00 0.00 H ATOM 13450 HE3 LYS B 346 49.648 55.066 54.173 1.00 0.00 H ATOM 13451 HZ1 LYS B 346 50.708 54.236 51.497 1.00 0.00 H ATOM 13452 HZ2 LYS B 346 49.385 55.270 51.757 1.00 0.00 H ATOM 13453 HZ3 LYS B 346 50.945 55.752 52.226 1.00 0.00 H ATOM 13454 H LYS B 346 50.190 49.264 54.503 1.00 0.00 H ATOM 13455 N ILE B 347 46.168 48.552 55.479 1.00 42.91 N ATOM 13456 CA ILE B 347 45.264 47.431 55.303 1.00 42.60 C ATOM 13457 C ILE B 347 43.982 47.739 54.527 1.00 42.86 C ATOM 13458 O ILE B 347 43.205 48.627 54.866 1.00 43.20 O ATOM 13459 CB ILE B 347 44.897 46.874 56.731 1.00 41.65 C ATOM 13460 CG1 ILE B 347 46.186 46.464 57.475 1.00 40.16 C ATOM 13461 CG2 ILE B 347 43.946 45.689 56.632 1.00 42.83 C ATOM 13462 CD1 ILE B 347 47.005 45.394 56.789 1.00 37.15 C ATOM 13463 HA ILE B 347 45.791 46.700 54.690 1.00 0.00 H ATOM 13464 HB ILE B 347 44.391 47.662 57.289 1.00 0.00 H ATOM 13465 HG12 ILE B 347 46.811 47.351 57.584 1.00 0.00 H ATOM 13466 HG13 ILE B 347 45.905 46.095 58.461 1.00 0.00 H ATOM 13467 HD11 ILE B 347 46.404 44.491 56.682 1.00 0.00 H ATOM 13468 HD12 ILE B 347 47.310 45.748 55.804 1.00 0.00 H ATOM 13469 HD13 ILE B 347 47.889 45.175 57.388 1.00 0.00 H ATOM 13470 HG21 ILE B 347 43.028 46.002 56.134 1.00 0.00 H ATOM 13471 HG22 ILE B 347 44.419 44.892 56.058 1.00 0.00 H ATOM 13472 HG23 ILE B 347 43.712 45.328 57.633 1.00 0.00 H ATOM 13473 H ILE B 347 45.932 49.290 56.173 1.00 0.00 H ATOM 13474 N SER B 348 43.747 46.944 53.512 1.00 44.63 N ATOM 13475 CA SER B 348 42.563 47.109 52.696 1.00 47.25 C ATOM 13476 C SER B 348 41.348 46.707 53.534 1.00 48.09 C ATOM 13477 O SER B 348 41.474 46.033 54.566 1.00 46.71 O ATOM 13478 CB SER B 348 42.655 46.200 51.497 1.00 47.11 C ATOM 13479 OG SER B 348 42.244 44.901 51.869 1.00 50.55 O ATOM 13480 HA SER B 348 42.474 48.143 52.362 1.00 0.00 H ATOM 13481 HB2 SER B 348 43.684 46.169 51.140 1.00 0.00 H ATOM 13482 HB3 SER B 348 42.008 46.575 50.704 1.00 0.00 H ATOM 13483 HG SER B 348 42.303 44.300 51.084 1.00 0.00 H ATOM 13484 H SER B 348 44.421 46.184 53.290 1.00 0.00 H ATOM 13485 N ARG B 349 40.182 47.133 53.078 1.00 48.02 N ATOM 13486 CA ARG B 349 38.943 46.849 53.743 1.00 49.01 C ATOM 13487 C ARG B 349 38.756 45.345 53.849 1.00 49.39 C ATOM 13488 O ARG B 349 38.233 44.820 54.824 1.00 49.25 O ATOM 13489 CB ARG B 349 37.806 47.418 52.916 1.00 50.50 C ATOM 13490 CG ARG B 349 36.512 47.441 53.630 1.00 53.29 C ATOM 13491 CD ARG B 349 36.696 48.411 54.734 1.00 56.29 C ATOM 13492 NE ARG B 349 35.818 48.053 55.804 1.00 57.98 N ATOM 13493 CZ ARG B 349 36.036 48.334 57.077 1.00 57.00 C ATOM 13494 NH1 ARG B 349 35.139 47.935 57.971 1.00 58.23 N ATOM 13495 NH2 ARG B 349 37.122 49.005 57.448 1.00 56.45 N ATOM 13496 HA ARG B 349 38.953 47.291 54.739 1.00 0.00 H ATOM 13497 HB2 ARG B 349 38.062 48.439 52.633 1.00 0.00 H ATOM 13498 HB3 ARG B 349 37.694 46.810 52.018 1.00 0.00 H ATOM 13499 HG2 ARG B 349 35.713 47.766 52.964 1.00 0.00 H ATOM 13500 HG3 ARG B 349 36.275 46.453 54.024 1.00 0.00 H ATOM 13501 HD2 ARG B 349 36.459 49.416 54.384 1.00 0.00 H ATOM 13502 HD3 ARG B 349 37.729 48.382 55.081 1.00 0.00 H ATOM 13503 HE ARG B 349 34.948 47.536 55.564 1.00 0.00 H ATOM 13504 HH12 ARG B 349 35.283 48.141 58.980 1.00 0.00 H ATOM 13505 HH11 ARG B 349 34.292 47.416 57.662 1.00 0.00 H ATOM 13506 HH22 ARG B 349 37.282 49.220 58.453 1.00 0.00 H ATOM 13507 HH21 ARG B 349 37.811 49.315 56.733 1.00 0.00 H ATOM 13508 H ARG B 349 40.163 47.696 52.204 1.00 0.00 H ATOM 13509 N GLU B 350 39.175 44.654 52.811 1.00 49.28 N ATOM 13510 CA GLU B 350 39.012 43.218 52.751 1.00 50.45 C ATOM 13511 C GLU B 350 39.906 42.479 53.744 1.00 49.78 C ATOM 13512 O GLU B 350 39.458 41.527 54.415 1.00 49.88 O ATOM 13513 CB GLU B 350 39.286 42.735 51.325 1.00 50.88 C ATOM 13514 CG GLU B 350 38.920 41.296 51.107 1.00 54.36 C ATOM 13515 CD GLU B 350 39.444 40.754 49.800 1.00 56.88 C ATOM 13516 HA GLU B 350 37.984 42.992 53.032 1.00 0.00 H ATOM 13517 HB2 GLU B 350 38.707 43.348 50.634 1.00 0.00 H ATOM 13518 HB3 GLU B 350 40.349 42.858 51.116 1.00 0.00 H ATOM 13519 HG2 GLU B 350 39.335 40.703 51.922 1.00 0.00 H ATOM 13520 HG3 GLU B 350 37.834 41.208 51.111 1.00 0.00 H ATOM 13521 H GLU B 350 39.632 45.149 52.019 1.00 0.00 H ATOM 13522 N ASP B 351 41.166 42.906 53.816 1.00 48.18 N ATOM 13523 CA ASP B 351 42.120 42.293 54.733 1.00 47.65 C ATOM 13524 C ASP B 351 41.701 42.600 56.188 1.00 46.97 C ATOM 13525 O ASP B 351 41.933 41.810 57.101 1.00 46.71 O ATOM 13526 CB ASP B 351 43.543 42.778 54.408 1.00 48.09 C ATOM 13527 CG ASP B 351 44.181 41.969 53.254 1.00 48.36 C ATOM 13528 OD1 ASP B 351 43.594 40.953 52.833 1.00 49.38 O ATOM 13529 OD2 ASP B 351 45.272 42.323 52.771 1.00 48.90 O ATOM 13530 HA ASP B 351 42.120 41.209 54.615 1.00 0.00 H ATOM 13531 HB2 ASP B 351 43.500 43.828 54.120 1.00 0.00 H ATOM 13532 HB3 ASP B 351 44.163 42.672 55.298 1.00 0.00 H ATOM 13533 H ASP B 351 41.475 43.691 53.207 1.00 0.00 H ATOM 13534 N PHE B 352 41.044 43.733 56.372 1.00 44.80 N ATOM 13535 CA PHE B 352 40.555 44.124 57.678 1.00 45.82 C ATOM 13536 C PHE B 352 39.542 43.066 58.127 1.00 46.77 C ATOM 13537 O PHE B 352 39.597 42.534 59.247 1.00 46.43 O ATOM 13538 CB PHE B 352 39.847 45.474 57.574 1.00 42.46 C ATOM 13539 CG PHE B 352 39.313 45.966 58.857 1.00 42.22 C ATOM 13540 CD1 PHE B 352 40.144 46.616 59.760 1.00 38.75 C ATOM 13541 CD2 PHE B 352 37.972 45.752 59.187 1.00 39.97 C ATOM 13542 CE1 PHE B 352 39.641 47.044 60.980 1.00 40.80 C ATOM 13543 CE2 PHE B 352 37.470 46.163 60.363 1.00 40.89 C ATOM 13544 CZ PHE B 352 38.290 46.815 61.289 1.00 38.82 C ATOM 13545 HA PHE B 352 41.379 44.205 58.387 1.00 0.00 H ATOM 13546 HB2 PHE B 352 40.558 46.207 57.194 1.00 0.00 H ATOM 13547 HB3 PHE B 352 39.019 45.375 56.872 1.00 0.00 H ATOM 13548 HD2 PHE B 352 37.321 45.242 58.477 1.00 0.00 H ATOM 13549 HE2 PHE B 352 36.420 45.988 60.596 1.00 0.00 H ATOM 13550 HZ PHE B 352 37.883 47.144 62.245 1.00 0.00 H ATOM 13551 HE1 PHE B 352 40.289 47.554 61.693 1.00 0.00 H ATOM 13552 HD1 PHE B 352 41.191 46.790 59.510 1.00 0.00 H ATOM 13553 H PHE B 352 40.874 44.359 55.559 1.00 0.00 H ATOM 13554 N MET B 353 38.607 42.771 57.235 1.00 46.96 N ATOM 13555 CA MET B 353 37.566 41.828 57.568 1.00 48.11 C ATOM 13556 C MET B 353 38.091 40.423 57.792 1.00 46.07 C ATOM 13557 O MET B 353 37.580 39.706 58.637 1.00 44.81 O ATOM 13558 CB MET B 353 36.454 41.860 56.505 1.00 50.02 C ATOM 13559 CG MET B 353 35.483 43.047 56.742 1.00 53.97 C ATOM 13560 SD MET B 353 34.067 43.055 55.582 1.00 62.09 S ATOM 13561 CE MET B 353 34.961 42.980 53.939 1.00 55.69 C ATOM 13562 HA MET B 353 37.141 42.139 58.522 1.00 0.00 H ATOM 13563 HB2 MET B 353 36.907 41.963 55.519 1.00 0.00 H ATOM 13564 HB3 MET B 353 35.892 40.927 56.550 1.00 0.00 H ATOM 13565 HG2 MET B 353 36.036 43.978 56.622 1.00 0.00 H ATOM 13566 HG3 MET B 353 35.098 42.984 57.760 1.00 0.00 H ATOM 13567 HE1 MET B 353 35.612 43.849 53.841 1.00 0.00 H ATOM 13568 HE2 MET B 353 35.559 42.070 53.893 1.00 0.00 H ATOM 13569 HE3 MET B 353 34.231 42.978 53.129 1.00 0.00 H ATOM 13570 H MET B 353 38.623 43.218 56.296 1.00 0.00 H ATOM 13571 N SER B 354 39.111 40.025 57.056 1.00 45.09 N ATOM 13572 CA SER B 354 39.617 38.693 57.284 1.00 45.98 C ATOM 13573 C SER B 354 40.504 38.705 58.613 1.00 45.56 C ATOM 13574 O SER B 354 40.619 37.682 59.320 1.00 43.52 O ATOM 13575 CB SER B 354 40.328 38.212 56.007 1.00 46.04 C ATOM 13576 OG SER B 354 41.619 38.724 55.966 1.00 51.79 O ATOM 13577 HA SER B 354 38.829 37.963 57.469 1.00 0.00 H ATOM 13578 HB2 SER B 354 39.774 38.555 55.133 1.00 0.00 H ATOM 13579 HB3 SER B 354 40.370 37.123 56.004 1.00 0.00 H ATOM 13580 HG SER B 354 41.581 39.713 55.967 1.00 0.00 H ATOM 13581 H SER B 354 39.534 40.648 56.339 1.00 0.00 H ATOM 13582 N GLY B 355 41.024 39.895 58.973 1.00 43.29 N ATOM 13583 CA GLY B 355 41.789 40.075 60.197 1.00 40.10 C ATOM 13584 C GLY B 355 40.823 39.946 61.374 1.00 39.27 C ATOM 13585 O GLY B 355 41.152 39.292 62.387 1.00 35.89 O ATOM 13586 HA3 GLY B 355 42.252 41.062 60.203 1.00 0.00 H ATOM 13587 HA2 GLY B 355 42.563 39.311 60.267 1.00 0.00 H ATOM 13588 H GLY B 355 40.873 40.716 58.352 1.00 0.00 H ATOM 13589 N VAL B 356 39.621 40.533 61.266 1.00 38.01 N ATOM 13590 CA VAL B 356 38.722 40.401 62.394 1.00 39.05 C ATOM 13591 C VAL B 356 38.254 38.966 62.566 1.00 38.03 C ATOM 13592 O VAL B 356 38.131 38.507 63.687 1.00 39.28 O ATOM 13593 CB VAL B 356 37.464 41.428 62.415 1.00 41.44 C ATOM 13594 CG1 VAL B 356 37.664 42.572 61.505 1.00 38.56 C ATOM 13595 CG2 VAL B 356 36.162 40.725 62.244 1.00 40.76 C ATOM 13596 HA VAL B 356 39.329 40.692 63.251 1.00 0.00 H ATOM 13597 HB VAL B 356 37.416 41.868 63.411 1.00 0.00 H ATOM 13598 HG11 VAL B 356 38.556 43.122 61.805 1.00 0.00 H ATOM 13599 HG12 VAL B 356 37.787 42.206 60.485 1.00 0.00 H ATOM 13600 HG13 VAL B 356 36.796 43.230 61.554 1.00 0.00 H ATOM 13601 HG21 VAL B 356 36.156 40.201 61.288 1.00 0.00 H ATOM 13602 HG22 VAL B 356 36.029 40.008 63.054 1.00 0.00 H ATOM 13603 HG23 VAL B 356 35.352 41.454 62.265 1.00 0.00 H ATOM 13604 H VAL B 356 39.347 41.059 60.411 1.00 0.00 H ATOM 13605 N LYS B 357 38.023 38.254 61.477 1.00 38.68 N ATOM 13606 CA LYS B 357 37.627 36.842 61.537 1.00 39.31 C ATOM 13607 C LYS B 357 38.744 36.008 62.236 1.00 38.46 C ATOM 13608 O LYS B 357 38.471 35.117 63.052 1.00 36.83 O ATOM 13609 CB LYS B 357 37.414 36.319 60.119 1.00 40.60 C ATOM 13610 CG LYS B 357 37.176 34.799 60.048 1.00 45.22 C ATOM 13611 CD LYS B 357 35.875 34.361 60.773 1.00 45.85 C ATOM 13612 CE LYS B 357 35.490 32.873 60.458 1.00 48.59 C ATOM 13613 HA LYS B 357 36.702 36.750 62.107 1.00 0.00 H ATOM 13614 HB2 LYS B 357 36.547 36.824 59.693 1.00 0.00 H ATOM 13615 HB3 LYS B 357 38.298 36.557 59.528 1.00 0.00 H ATOM 13616 HG2 LYS B 357 37.108 34.505 59.001 1.00 0.00 H ATOM 13617 HG3 LYS B 357 38.022 34.291 60.512 1.00 0.00 H ATOM 13618 HD2 LYS B 357 36.020 34.466 61.848 1.00 0.00 H ATOM 13619 HD3 LYS B 357 35.060 35.010 60.453 1.00 0.00 H ATOM 13620 HE2 LYS B 357 35.334 32.759 59.385 1.00 0.00 H ATOM 13621 HE3 LYS B 357 36.296 32.214 60.782 1.00 0.00 H ATOM 13622 H LYS B 357 38.125 38.709 60.547 1.00 0.00 H ATOM 13623 N LEU B 358 39.995 36.326 61.920 1.00 36.46 N ATOM 13624 CA LEU B 358 41.132 35.644 62.528 1.00 37.27 C ATOM 13625 C LEU B 358 41.260 36.007 64.029 1.00 37.54 C ATOM 13626 O LEU B 358 41.672 35.171 64.843 1.00 37.07 O ATOM 13627 CB LEU B 358 42.379 36.068 61.789 1.00 38.55 C ATOM 13628 CG LEU B 358 43.228 35.139 60.915 1.00 42.74 C ATOM 13629 CD1 LEU B 358 42.480 33.925 60.362 1.00 41.18 C ATOM 13630 CD2 LEU B 358 43.905 36.026 59.831 1.00 38.94 C ATOM 13631 HA LEU B 358 40.991 34.565 62.459 1.00 0.00 H ATOM 13632 HB2 LEU B 358 42.070 36.884 61.136 1.00 0.00 H ATOM 13633 HB3 LEU B 358 43.056 36.452 62.552 1.00 0.00 H ATOM 13634 HG LEU B 358 43.991 34.659 61.527 1.00 0.00 H ATOM 13635 HD21 LEU B 358 43.137 36.520 59.236 1.00 0.00 H ATOM 13636 HD22 LEU B 358 44.529 36.777 60.316 1.00 0.00 H ATOM 13637 HD23 LEU B 358 44.521 35.401 59.185 1.00 0.00 H ATOM 13638 HD11 LEU B 358 42.103 33.324 61.190 1.00 0.00 H ATOM 13639 HD12 LEU B 358 41.646 34.263 59.747 1.00 0.00 H ATOM 13640 HD13 LEU B 358 43.160 33.326 59.756 1.00 0.00 H ATOM 13641 H LEU B 358 40.167 37.078 61.223 1.00 0.00 H ATOM 13642 N SER B 359 40.905 37.249 64.389 1.00 36.25 N ATOM 13643 CA SER B 359 41.021 37.736 65.762 1.00 36.43 C ATOM 13644 C SER B 359 39.968 37.292 66.729 1.00 37.59 C ATOM 13645 O SER B 359 40.226 37.244 67.923 1.00 40.26 O ATOM 13646 CB SER B 359 41.037 39.240 65.788 1.00 36.37 C ATOM 13647 OG SER B 359 42.014 39.702 64.911 1.00 37.25 O ATOM 13648 HA SER B 359 41.956 37.288 66.097 1.00 0.00 H ATOM 13649 HB2 SER B 359 41.260 39.585 66.798 1.00 0.00 H ATOM 13650 HB3 SER B 359 40.063 39.621 65.482 1.00 0.00 H ATOM 13651 HG SER B 359 41.809 39.387 63.995 1.00 0.00 H ATOM 13652 H SER B 359 40.532 37.892 63.662 1.00 0.00 H ATOM 13653 N VAL B 360 38.785 36.960 66.242 1.00 37.15 N ATOM 13654 CA VAL B 360 37.712 36.525 67.136 1.00 38.91 C ATOM 13655 C VAL B 360 37.203 35.231 66.531 1.00 40.75 C ATOM 13656 O VAL B 360 36.055 35.139 66.084 1.00 41.18 O ATOM 13657 CB VAL B 360 36.613 37.586 67.133 1.00 38.10 C ATOM 13658 CG1 VAL B 360 35.667 37.361 68.301 1.00 37.21 C ATOM 13659 CG2 VAL B 360 37.293 38.979 67.214 1.00 38.27 C ATOM 13660 HA VAL B 360 38.039 36.384 68.166 1.00 0.00 H ATOM 13661 HB VAL B 360 36.020 37.525 66.221 1.00 0.00 H ATOM 13662 HG11 VAL B 360 35.213 36.374 68.214 1.00 0.00 H ATOM 13663 HG12 VAL B 360 36.224 37.425 69.236 1.00 0.00 H ATOM 13664 HG13 VAL B 360 34.888 38.123 68.288 1.00 0.00 H ATOM 13665 HG21 VAL B 360 37.878 39.044 68.132 1.00 0.00 H ATOM 13666 HG22 VAL B 360 37.949 39.112 66.354 1.00 0.00 H ATOM 13667 HG23 VAL B 360 36.528 39.756 67.213 1.00 0.00 H ATOM 13668 H VAL B 360 38.616 37.008 65.217 1.00 0.00 H ATOM 13669 N PRO B 361 38.053 34.196 66.536 1.00 43.04 N ATOM 13670 CA PRO B 361 37.751 32.878 65.965 1.00 44.79 C ATOM 13671 C PRO B 361 36.497 32.205 66.421 1.00 46.34 C ATOM 13672 O PRO B 361 35.842 31.527 65.641 1.00 46.63 O ATOM 13673 CB PRO B 361 39.005 32.077 66.284 1.00 45.01 C ATOM 13674 CG PRO B 361 39.485 32.702 67.582 1.00 43.61 C ATOM 13675 CD PRO B 361 39.306 34.160 67.313 1.00 42.40 C ATOM 13676 HA PRO B 361 37.527 32.971 64.902 1.00 0.00 H ATOM 13677 HD3 PRO B 361 39.209 34.722 68.242 1.00 0.00 H ATOM 13678 HD2 PRO B 361 40.139 34.558 66.734 1.00 0.00 H ATOM 13679 HG3 PRO B 361 40.530 32.460 67.775 1.00 0.00 H ATOM 13680 HG2 PRO B 361 38.877 32.378 68.426 1.00 0.00 H ATOM 13681 HB2 PRO B 361 38.772 31.021 66.419 1.00 0.00 H ATOM 13682 HB3 PRO B 361 39.751 32.185 65.497 1.00 0.00 H ATOM 13683 N HIS B 362 36.158 32.404 67.685 1.00 48.45 N ATOM 13684 CA HIS B 362 34.979 31.801 68.277 1.00 51.41 C ATOM 13685 C HIS B 362 33.631 32.525 67.955 1.00 52.24 C ATOM 13686 O HIS B 362 32.566 32.082 68.399 1.00 52.69 O ATOM 13687 CB HIS B 362 35.204 31.757 69.796 1.00 53.53 C ATOM 13688 CG HIS B 362 35.546 33.101 70.378 1.00 56.94 C ATOM 13689 ND1 HIS B 362 36.717 33.778 70.068 1.00 56.55 N ATOM 13690 CD2 HIS B 362 34.825 33.936 71.171 1.00 57.64 C ATOM 13691 CE1 HIS B 362 36.694 34.969 70.640 1.00 57.18 C ATOM 13692 NE2 HIS B 362 35.558 35.091 71.317 1.00 58.79 N ATOM 13693 HA HIS B 362 34.866 30.809 67.840 1.00 0.00 H ATOM 13694 HB2 HIS B 362 34.293 31.393 70.272 1.00 0.00 H ATOM 13695 HB3 HIS B 362 36.022 31.068 70.007 1.00 0.00 H ATOM 13696 HD2 HIS B 362 33.849 33.729 71.609 1.00 0.00 H ATOM 13697 HE1 HIS B 362 37.476 35.725 70.568 1.00 0.00 H ATOM 13698 H HIS B 362 36.759 33.015 68.275 1.00 0.00 H ATOM 13699 N ALA B 363 33.663 33.607 67.172 1.00 50.99 N ATOM 13700 CA ALA B 363 32.438 34.356 66.897 1.00 50.12 C ATOM 13701 C ALA B 363 31.636 33.948 65.682 1.00 48.95 C ATOM 13702 O ALA B 363 32.197 33.602 64.655 1.00 50.42 O ATOM 13703 CB ALA B 363 32.765 35.855 66.767 1.00 49.51 C ATOM 13704 HA ALA B 363 31.803 34.122 67.752 1.00 0.00 H ATOM 13705 HB1 ALA B 363 33.206 36.211 67.698 1.00 0.00 H ATOM 13706 HB2 ALA B 363 33.471 36.002 65.949 1.00 0.00 H ATOM 13707 HB3 ALA B 363 31.849 36.409 66.562 1.00 0.00 H ATOM 13708 H ALA B 363 34.564 33.918 66.756 1.00 0.00 H ATOM 13709 N ASN B 364 30.314 34.031 65.791 1.00 48.21 N ATOM 13710 CA ASN B 364 29.453 33.746 64.649 1.00 47.39 C ATOM 13711 C ASN B 364 29.455 35.011 63.758 1.00 46.39 C ATOM 13712 O ASN B 364 30.135 36.002 64.071 1.00 44.69 O ATOM 13713 CB ASN B 364 28.017 33.409 65.096 1.00 48.25 C ATOM 13714 CG ASN B 364 27.379 34.498 65.942 1.00 49.68 C ATOM 13715 OD1 ASN B 364 27.803 35.659 65.927 1.00 50.86 O ATOM 13716 ND2 ASN B 364 26.343 34.126 66.678 1.00 49.59 N ATOM 13717 HA ASN B 364 29.825 32.877 64.105 1.00 0.00 H ATOM 13718 HB2 ASN B 364 27.404 33.258 64.207 1.00 0.00 H ATOM 13719 HB3 ASN B 364 28.043 32.488 65.679 1.00 0.00 H ATOM 13720 HD22 ASN B 364 26.020 33.138 66.660 1.00 0.00 H ATOM 13721 HD21 ASN B 364 25.852 34.822 67.274 1.00 0.00 H ATOM 13722 H ASN B 364 29.889 34.302 66.701 1.00 0.00 H ATOM 13723 N ASP B 365 28.706 34.983 62.664 1.00 44.49 N ATOM 13724 CA ASP B 365 28.700 36.124 61.762 1.00 44.57 C ATOM 13725 C ASP B 365 28.127 37.423 62.344 1.00 43.24 C ATOM 13726 O ASP B 365 28.612 38.497 62.037 1.00 41.74 O ATOM 13727 CB ASP B 365 28.033 35.742 60.433 1.00 46.08 C ATOM 13728 CG ASP B 365 28.940 34.856 59.555 1.00 45.54 C ATOM 13729 HA ASP B 365 29.748 36.367 61.588 1.00 0.00 H ATOM 13730 HB2 ASP B 365 27.112 35.199 60.646 1.00 0.00 H ATOM 13731 HB3 ASP B 365 27.797 36.654 59.885 1.00 0.00 H ATOM 13732 H ASP B 365 28.124 34.147 62.452 1.00 0.00 H ATOM 13733 N LEU B 366 27.125 37.326 63.200 1.00 41.79 N ATOM 13734 CA LEU B 366 26.578 38.517 63.815 1.00 42.86 C ATOM 13735 C LEU B 366 27.685 39.130 64.720 1.00 42.01 C ATOM 13736 O LEU B 366 27.873 40.361 64.804 1.00 41.04 O ATOM 13737 CB LEU B 366 25.349 38.145 64.649 1.00 42.77 C ATOM 13738 CG LEU B 366 24.710 39.372 65.288 1.00 44.63 C ATOM 13739 CD1 LEU B 366 24.121 40.250 64.180 1.00 42.15 C ATOM 13740 CD2 LEU B 366 23.644 38.964 66.302 1.00 45.75 C ATOM 13741 HA LEU B 366 26.269 39.240 63.060 1.00 0.00 H ATOM 13742 HB2 LEU B 366 24.617 37.661 64.003 1.00 0.00 H ATOM 13743 HB3 LEU B 366 25.651 37.454 65.436 1.00 0.00 H ATOM 13744 HG LEU B 366 25.465 39.940 65.832 1.00 0.00 H ATOM 13745 HD21 LEU B 366 22.869 38.386 65.799 1.00 0.00 H ATOM 13746 HD22 LEU B 366 24.101 38.358 67.084 1.00 0.00 H ATOM 13747 HD23 LEU B 366 23.203 39.858 66.744 1.00 0.00 H ATOM 13748 HD11 LEU B 366 24.916 40.557 63.500 1.00 0.00 H ATOM 13749 HD12 LEU B 366 23.369 39.684 63.630 1.00 0.00 H ATOM 13750 HD13 LEU B 366 23.660 41.132 64.624 1.00 0.00 H ATOM 13751 H LEU B 366 26.729 36.393 63.432 1.00 0.00 H ATOM 13752 N GLY B 367 28.395 38.244 65.410 1.00 41.06 N ATOM 13753 CA GLY B 367 29.488 38.653 66.271 1.00 39.59 C ATOM 13754 C GLY B 367 30.575 39.356 65.444 1.00 37.86 C ATOM 13755 O GLY B 367 31.049 40.436 65.810 1.00 36.93 O ATOM 13756 HA3 GLY B 367 29.914 37.774 66.755 1.00 0.00 H ATOM 13757 HA2 GLY B 367 29.112 39.339 67.031 1.00 0.00 H ATOM 13758 H GLY B 367 28.162 37.234 65.331 1.00 0.00 H ATOM 13759 N LEU B 368 30.962 38.776 64.322 1.00 37.34 N ATOM 13760 CA LEU B 368 31.989 39.433 63.506 1.00 39.49 C ATOM 13761 C LEU B 368 31.497 40.791 62.980 1.00 41.31 C ATOM 13762 O LEU B 368 32.294 41.745 62.834 1.00 41.19 O ATOM 13763 CB LEU B 368 32.413 38.532 62.347 1.00 38.54 C ATOM 13764 CG LEU B 368 33.061 37.211 62.814 1.00 40.25 C ATOM 13765 CD1 LEU B 368 33.216 36.304 61.587 1.00 40.11 C ATOM 13766 CD2 LEU B 368 34.410 37.468 63.531 1.00 40.01 C ATOM 13767 HA LEU B 368 32.856 39.613 64.142 1.00 0.00 H ATOM 13768 HB2 LEU B 368 31.532 38.295 61.751 1.00 0.00 H ATOM 13769 HB3 LEU B 368 33.132 39.073 61.731 1.00 0.00 H ATOM 13770 HG LEU B 368 32.426 36.716 63.549 1.00 0.00 H ATOM 13771 HD21 LEU B 368 35.095 37.967 62.846 1.00 0.00 H ATOM 13772 HD22 LEU B 368 34.242 38.100 64.403 1.00 0.00 H ATOM 13773 HD23 LEU B 368 34.839 36.517 63.847 1.00 0.00 H ATOM 13774 HD11 LEU B 368 32.235 36.111 61.153 1.00 0.00 H ATOM 13775 HD12 LEU B 368 33.850 36.797 60.850 1.00 0.00 H ATOM 13776 HD13 LEU B 368 33.673 35.361 61.889 1.00 0.00 H ATOM 13777 H LEU B 368 30.546 37.871 64.023 1.00 0.00 H ATOM 13778 N ASP B 369 30.192 40.895 62.702 1.00 41.05 N ATOM 13779 CA ASP B 369 29.646 42.169 62.252 1.00 41.56 C ATOM 13780 C ASP B 369 29.742 43.205 63.385 1.00 39.19 C ATOM 13781 O ASP B 369 30.134 44.352 63.162 1.00 39.35 O ATOM 13782 CB ASP B 369 28.179 42.037 61.817 1.00 44.54 C ATOM 13783 CG ASP B 369 28.027 41.435 60.435 1.00 47.99 C ATOM 13784 OD1 ASP B 369 28.990 41.479 59.647 1.00 49.03 O ATOM 13785 OD2 ASP B 369 26.927 40.930 60.130 1.00 51.03 O ATOM 13786 HA ASP B 369 30.231 42.493 61.391 1.00 0.00 H ATOM 13787 HB2 ASP B 369 27.659 41.401 62.533 1.00 0.00 H ATOM 13788 HB3 ASP B 369 27.725 43.028 61.817 1.00 0.00 H ATOM 13789 H ASP B 369 29.569 40.069 62.807 1.00 0.00 H ATOM 13790 N ALA B 370 29.368 42.811 64.590 1.00 37.17 N ATOM 13791 CA ALA B 370 29.440 43.746 65.713 1.00 37.10 C ATOM 13792 C ALA B 370 30.867 44.298 65.877 1.00 37.86 C ATOM 13793 O ALA B 370 31.020 45.523 66.057 1.00 39.34 O ATOM 13794 CB ALA B 370 28.970 43.071 67.015 1.00 34.61 C ATOM 13795 HA ALA B 370 28.774 44.582 65.499 1.00 0.00 H ATOM 13796 HB1 ALA B 370 27.939 42.738 66.898 1.00 0.00 H ATOM 13797 HB2 ALA B 370 29.608 42.213 67.229 1.00 0.00 H ATOM 13798 HB3 ALA B 370 29.032 43.785 67.836 1.00 0.00 H ATOM 13799 H ALA B 370 29.024 41.841 64.739 1.00 0.00 H ATOM 13800 N VAL B 371 31.905 43.445 65.800 1.00 35.33 N ATOM 13801 CA VAL B 371 33.290 43.930 65.960 1.00 35.27 C ATOM 13802 C VAL B 371 33.657 44.914 64.843 1.00 36.48 C ATOM 13803 O VAL B 371 34.187 46.018 65.101 1.00 36.37 O ATOM 13804 CB VAL B 371 34.339 42.737 65.930 1.00 34.47 C ATOM 13805 CG1 VAL B 371 35.804 43.274 66.079 1.00 33.77 C ATOM 13806 CG2 VAL B 371 33.998 41.717 67.060 1.00 34.83 C ATOM 13807 HA VAL B 371 33.334 44.426 66.930 1.00 0.00 H ATOM 13808 HB VAL B 371 34.275 42.232 64.966 1.00 0.00 H ATOM 13809 HG11 VAL B 371 36.025 43.956 65.258 1.00 0.00 H ATOM 13810 HG12 VAL B 371 35.901 43.802 67.027 1.00 0.00 H ATOM 13811 HG13 VAL B 371 36.501 42.436 66.055 1.00 0.00 H ATOM 13812 HG21 VAL B 371 34.044 42.219 68.027 1.00 0.00 H ATOM 13813 HG22 VAL B 371 32.994 41.323 66.901 1.00 0.00 H ATOM 13814 HG23 VAL B 371 34.718 40.899 67.039 1.00 0.00 H ATOM 13815 H VAL B 371 31.730 42.435 65.626 1.00 0.00 H ATOM 13816 N THR B 372 33.385 44.507 63.604 1.00 37.17 N ATOM 13817 CA THR B 372 33.663 45.322 62.440 1.00 38.89 C ATOM 13818 C THR B 372 32.976 46.687 62.531 1.00 40.98 C ATOM 13819 O THR B 372 33.587 47.713 62.278 1.00 41.24 O ATOM 13820 CB THR B 372 33.223 44.570 61.177 1.00 40.98 C ATOM 13821 OG1 THR B 372 33.964 43.346 61.121 1.00 43.57 O ATOM 13822 CG2 THR B 372 33.505 45.380 59.886 1.00 38.99 C ATOM 13823 HA THR B 372 34.736 45.509 62.393 1.00 0.00 H ATOM 13824 HB THR B 372 32.148 44.398 61.230 1.00 0.00 H ATOM 13825 HG1 THR B 372 33.771 42.807 61.929 1.00 0.00 H ATOM 13826 HG23 THR B 372 32.946 46.315 59.916 1.00 0.00 H ATOM 13827 HG21 THR B 372 34.572 45.595 59.819 1.00 0.00 H ATOM 13828 HG22 THR B 372 33.195 44.798 59.018 1.00 0.00 H ATOM 13829 H THR B 372 32.957 43.569 63.468 1.00 0.00 H ATOM 13830 N LEU B 373 31.719 46.703 62.945 1.00 41.73 N ATOM 13831 CA LEU B 373 30.988 47.959 63.089 1.00 43.18 C ATOM 13832 C LEU B 373 31.669 48.861 64.124 1.00 43.47 C ATOM 13833 O LEU B 373 31.839 50.057 63.907 1.00 42.81 O ATOM 13834 CB LEU B 373 29.567 47.669 63.586 1.00 45.20 C ATOM 13835 CG LEU B 373 28.707 48.870 63.982 1.00 46.38 C ATOM 13836 CD1 LEU B 373 27.874 49.245 62.811 1.00 49.60 C ATOM 13837 CD2 LEU B 373 27.795 48.532 65.135 1.00 49.99 C ATOM 13838 HA LEU B 373 30.969 48.455 62.119 1.00 0.00 H ATOM 13839 HB2 LEU B 373 29.043 47.138 62.791 1.00 0.00 H ATOM 13840 HB3 LEU B 373 29.650 47.023 64.460 1.00 0.00 H ATOM 13841 HG LEU B 373 29.359 49.688 64.288 1.00 0.00 H ATOM 13842 HD21 LEU B 373 27.137 47.712 64.848 1.00 0.00 H ATOM 13843 HD22 LEU B 373 28.394 48.234 65.995 1.00 0.00 H ATOM 13844 HD23 LEU B 373 27.197 49.406 65.392 1.00 0.00 H ATOM 13845 HD11 LEU B 373 28.522 49.505 61.974 1.00 0.00 H ATOM 13846 HD12 LEU B 373 27.240 48.403 62.533 1.00 0.00 H ATOM 13847 HD13 LEU B 373 27.251 50.101 63.069 1.00 0.00 H ATOM 13848 H LEU B 373 31.244 45.806 63.172 1.00 0.00 H ATOM 13849 N GLN B 374 32.023 48.261 65.262 1.00 41.80 N ATOM 13850 CA GLN B 374 32.650 48.953 66.398 1.00 42.30 C ATOM 13851 C GLN B 374 34.016 49.572 66.081 1.00 40.88 C ATOM 13852 O GLN B 374 34.385 50.621 66.608 1.00 39.64 O ATOM 13853 CB GLN B 374 32.800 47.951 67.547 1.00 44.49 C ATOM 13854 CG GLN B 374 33.048 48.521 68.874 1.00 47.26 C ATOM 13855 CD GLN B 374 31.808 49.189 69.432 1.00 51.17 C ATOM 13856 OE1 GLN B 374 31.892 49.847 70.473 1.00 51.64 O ATOM 13857 NE2 GLN B 374 30.650 49.045 68.740 1.00 50.48 N ATOM 13858 HA GLN B 374 31.999 49.786 66.663 1.00 0.00 H ATOM 13859 HB2 GLN B 374 31.881 47.367 67.602 1.00 0.00 H ATOM 13860 HB3 GLN B 374 33.634 47.292 67.307 1.00 0.00 H ATOM 13861 HG2 GLN B 374 33.356 47.724 69.550 1.00 0.00 H ATOM 13862 HG3 GLN B 374 33.846 49.260 68.799 1.00 0.00 H ATOM 13863 HE22 GLN B 374 30.633 48.479 67.867 1.00 0.00 H ATOM 13864 HE21 GLN B 374 29.780 49.500 69.082 1.00 0.00 H ATOM 13865 H GLN B 374 31.844 47.240 65.351 1.00 0.00 H ATOM 13866 N TYR B 375 34.758 48.931 65.197 1.00 38.58 N ATOM 13867 CA TYR B 375 36.084 49.425 64.881 1.00 38.80 C ATOM 13868 C TYR B 375 36.241 50.109 63.521 1.00 39.71 C ATOM 13869 O TYR B 375 37.331 50.512 63.139 1.00 40.67 O ATOM 13870 CB TYR B 375 37.088 48.249 65.061 1.00 35.96 C ATOM 13871 CG TYR B 375 37.364 47.992 66.550 1.00 33.31 C ATOM 13872 CD1 TYR B 375 38.355 48.695 67.217 1.00 33.04 C ATOM 13873 CD2 TYR B 375 36.599 47.065 67.283 1.00 32.96 C ATOM 13874 CE1 TYR B 375 38.600 48.494 68.603 1.00 34.16 C ATOM 13875 CE2 TYR B 375 36.820 46.856 68.652 1.00 32.65 C ATOM 13876 CZ TYR B 375 37.821 47.573 69.303 1.00 33.71 C ATOM 13877 OH TYR B 375 38.046 47.368 70.652 1.00 36.51 O ATOM 13878 HA TYR B 375 36.293 50.238 65.576 1.00 0.00 H ATOM 13879 HB3 TYR B 375 38.024 48.498 64.561 1.00 0.00 H ATOM 13880 HB2 TYR B 375 36.668 47.348 64.614 1.00 0.00 H ATOM 13881 HD2 TYR B 375 35.819 46.498 66.776 1.00 0.00 H ATOM 13882 HE2 TYR B 375 36.213 46.138 69.203 1.00 0.00 H ATOM 13883 HE1 TYR B 375 39.386 49.052 69.112 1.00 0.00 H ATOM 13884 HD1 TYR B 375 38.959 49.417 66.668 1.00 0.00 H ATOM 13885 HH TYR B 375 38.786 47.952 70.955 1.00 0.00 H ATOM 13886 H TYR B 375 34.393 48.076 64.730 1.00 0.00 H ATOM 13887 N THR B 376 35.163 50.284 62.788 1.00 39.83 N ATOM 13888 CA THR B 376 35.302 50.921 61.475 1.00 38.89 C ATOM 13889 C THR B 376 34.892 52.390 61.486 1.00 39.37 C ATOM 13890 O THR B 376 33.897 52.767 62.097 1.00 36.60 O ATOM 13891 CB THR B 376 34.447 50.168 60.440 1.00 39.82 C ATOM 13892 OG1 THR B 376 34.979 48.848 60.269 1.00 38.42 O ATOM 13893 CG2 THR B 376 34.398 50.899 59.084 1.00 37.46 C ATOM 13894 HA THR B 376 36.358 50.876 61.210 1.00 0.00 H ATOM 13895 HB THR B 376 33.424 50.119 60.813 1.00 0.00 H ATOM 13896 HG1 THR B 376 34.955 48.369 61.135 1.00 0.00 H ATOM 13897 HG23 THR B 376 33.992 51.900 59.227 1.00 0.00 H ATOM 13898 HG21 THR B 376 35.405 50.969 58.674 1.00 0.00 H ATOM 13899 HG22 THR B 376 33.762 50.343 58.396 1.00 0.00 H ATOM 13900 H THR B 376 34.231 49.977 63.133 1.00 0.00 H ATOM 13901 N ASP B 377 35.697 53.244 60.869 1.00 39.89 N ATOM 13902 CA ASP B 377 35.300 54.638 60.747 1.00 40.61 C ATOM 13903 C ASP B 377 34.545 54.644 59.379 1.00 42.35 C ATOM 13904 O ASP B 377 35.190 54.668 58.314 1.00 40.36 O ATOM 13905 CB ASP B 377 36.529 55.507 60.663 1.00 41.97 C ATOM 13906 CG ASP B 377 36.208 56.937 60.281 1.00 44.10 C ATOM 13907 OD1 ASP B 377 35.040 57.231 59.902 1.00 43.89 O ATOM 13908 OD2 ASP B 377 37.146 57.764 60.341 1.00 44.85 O ATOM 13909 HA ASP B 377 34.705 55.010 61.581 1.00 0.00 H ATOM 13910 HB2 ASP B 377 37.023 55.508 61.635 1.00 0.00 H ATOM 13911 HB3 ASP B 377 37.202 55.088 59.915 1.00 0.00 H ATOM 13912 H ASP B 377 36.604 52.920 60.476 1.00 0.00 H ATOM 13913 N TRP B 378 33.204 54.597 59.405 1.00 42.68 N ATOM 13914 CA TRP B 378 32.447 54.554 58.158 1.00 44.99 C ATOM 13915 C TRP B 378 32.479 55.805 57.285 1.00 45.81 C ATOM 13916 O TRP B 378 31.957 55.779 56.172 1.00 46.68 O ATOM 13917 CB TRP B 378 30.974 54.095 58.372 1.00 44.73 C ATOM 13918 CG TRP B 378 30.882 52.715 58.962 1.00 45.44 C ATOM 13919 CD1 TRP B 378 30.599 52.413 60.258 1.00 47.25 C ATOM 13920 CD2 TRP B 378 31.188 51.467 58.317 1.00 44.81 C ATOM 13921 NE1 TRP B 378 30.711 51.059 60.467 1.00 48.48 N ATOM 13922 CE2 TRP B 378 31.073 50.453 59.294 1.00 46.57 C ATOM 13923 CE3 TRP B 378 31.552 51.113 57.017 1.00 44.48 C ATOM 13924 CZ2 TRP B 378 31.311 49.092 59.012 1.00 46.59 C ATOM 13925 CZ3 TRP B 378 31.788 49.762 56.727 1.00 46.08 C ATOM 13926 CH2 TRP B 378 31.668 48.771 57.718 1.00 46.49 C ATOM 13927 HA TRP B 378 32.996 53.803 57.590 1.00 0.00 H ATOM 13928 HB2 TRP B 378 30.483 54.797 59.046 1.00 0.00 H ATOM 13929 HB3 TRP B 378 30.463 54.099 57.409 1.00 0.00 H ATOM 13930 HE1 TRP B 378 30.547 50.573 61.372 1.00 0.00 H ATOM 13931 HD1 TRP B 378 30.323 53.141 61.021 1.00 0.00 H ATOM 13932 HZ2 TRP B 378 31.217 48.327 59.782 1.00 0.00 H ATOM 13933 HH2 TRP B 378 31.861 47.730 57.459 1.00 0.00 H ATOM 13934 HZ3 TRP B 378 32.070 49.474 55.714 1.00 0.00 H ATOM 13935 HE3 TRP B 378 31.651 51.873 56.242 1.00 0.00 H ATOM 13936 H TRP B 378 32.703 54.591 60.316 1.00 0.00 H ATOM 13937 N MET B 379 33.077 56.891 57.745 1.00 46.75 N ATOM 13938 CA MET B 379 33.185 58.029 56.833 1.00 49.40 C ATOM 13939 C MET B 379 34.471 57.834 56.065 1.00 49.93 C ATOM 13940 O MET B 379 34.747 58.584 55.136 1.00 51.46 O ATOM 13941 CB MET B 379 33.339 59.381 57.543 1.00 51.07 C ATOM 13942 CG MET B 379 32.441 59.601 58.733 1.00 55.86 C ATOM 13943 SD MET B 379 32.314 61.351 59.112 1.00 60.64 S ATOM 13944 CE MET B 379 30.929 61.732 57.937 1.00 58.98 C ATOM 13945 HA MET B 379 32.275 58.056 56.234 1.00 0.00 H ATOM 13946 HB2 MET B 379 34.371 59.466 57.882 1.00 0.00 H ATOM 13947 HB3 MET B 379 33.131 60.167 56.817 1.00 0.00 H ATOM 13948 HG2 MET B 379 32.853 59.076 59.595 1.00 0.00 H ATOM 13949 HG3 MET B 379 31.448 59.209 58.511 1.00 0.00 H ATOM 13950 HE1 MET B 379 31.242 61.496 56.920 1.00 0.00 H ATOM 13951 HE2 MET B 379 30.057 61.133 58.199 1.00 0.00 H ATOM 13952 HE3 MET B 379 30.678 62.790 58.005 1.00 0.00 H ATOM 13953 H MET B 379 33.454 56.934 58.713 1.00 0.00 H ATOM 13954 N ASP B 380 35.277 56.832 56.411 1.00 48.64 N ATOM 13955 CA ASP B 380 36.575 56.721 55.726 1.00 47.28 C ATOM 13956 C ASP B 380 37.077 55.279 55.799 1.00 47.20 C ATOM 13957 O ASP B 380 38.194 55.023 56.216 1.00 45.98 O ATOM 13958 CB ASP B 380 37.515 57.691 56.454 1.00 43.74 C ATOM 13959 CG ASP B 380 38.844 57.870 55.765 1.00 44.25 C ATOM 13960 OD1 ASP B 380 38.958 57.579 54.543 1.00 43.44 O ATOM 13961 OD2 ASP B 380 39.775 58.324 56.464 1.00 43.28 O ATOM 13962 HA ASP B 380 36.512 56.974 54.668 1.00 0.00 H ATOM 13963 HB2 ASP B 380 37.026 58.663 56.519 1.00 0.00 H ATOM 13964 HB3 ASP B 380 37.695 57.309 57.459 1.00 0.00 H ATOM 13965 H ASP B 380 34.998 56.148 57.143 1.00 0.00 H ATOM 13966 N ASP B 381 36.245 54.354 55.348 1.00 48.30 N ATOM 13967 CA ASP B 381 36.512 52.925 55.478 1.00 49.62 C ATOM 13968 C ASP B 381 37.625 52.262 54.664 1.00 50.15 C ATOM 13969 O ASP B 381 37.983 51.094 54.912 1.00 49.85 O ATOM 13970 CB ASP B 381 35.197 52.167 55.292 1.00 51.12 C ATOM 13971 CG ASP B 381 34.621 52.355 53.905 1.00 54.13 C ATOM 13972 OD1 ASP B 381 34.574 53.514 53.405 1.00 56.80 O ATOM 13973 OD2 ASP B 381 34.209 51.343 53.321 1.00 54.37 O ATOM 13974 HA ASP B 381 36.937 52.858 56.479 1.00 0.00 H ATOM 13975 HB2 ASP B 381 35.377 51.105 55.457 1.00 0.00 H ATOM 13976 HB3 ASP B 381 34.476 52.530 56.024 1.00 0.00 H ATOM 13977 H ASP B 381 35.366 54.657 54.882 1.00 0.00 H ATOM 13978 N ASN B 382 38.161 52.993 53.697 1.00 49.84 N ATOM 13979 CA ASN B 382 39.241 52.485 52.877 1.00 49.89 C ATOM 13980 C ASN B 382 40.566 53.072 53.345 1.00 49.32 C ATOM 13981 O ASN B 382 41.600 52.875 52.706 1.00 49.82 O ATOM 13982 CB ASN B 382 39.013 52.869 51.422 1.00 52.20 C ATOM 13983 CG ASN B 382 37.850 52.164 50.852 1.00 53.80 C ATOM 13984 OD1 ASN B 382 37.809 50.934 50.892 1.00 53.72 O ATOM 13985 ND2 ASN B 382 36.865 52.919 50.327 1.00 54.08 N ATOM 13986 HA ASN B 382 39.269 51.399 52.968 1.00 0.00 H ATOM 13987 HB2 ASN B 382 38.840 53.944 51.362 1.00 0.00 H ATOM 13988 HB3 ASN B 382 39.901 52.612 50.844 1.00 0.00 H ATOM 13989 HD22 ASN B 382 36.952 53.955 50.319 1.00 0.00 H ATOM 13990 HD21 ASN B 382 36.018 52.465 49.930 1.00 0.00 H ATOM 13991 H ASN B 382 37.798 53.952 53.523 1.00 0.00 H ATOM 13992 N ASN B 383 40.539 53.813 54.445 1.00 45.88 N ATOM 13993 CA ASN B 383 41.768 54.380 54.937 1.00 44.29 C ATOM 13994 C ASN B 383 42.657 53.220 55.505 1.00 44.01 C ATOM 13995 O ASN B 383 42.331 52.585 56.531 1.00 41.42 O ATOM 13996 CB ASN B 383 41.410 55.427 55.982 1.00 42.48 C ATOM 13997 CG ASN B 383 42.610 56.142 56.516 1.00 43.89 C ATOM 13998 OD1 ASN B 383 42.540 57.352 56.807 1.00 43.20 O ATOM 13999 ND2 ASN B 383 43.724 55.413 56.681 1.00 40.97 N ATOM 14000 HA ASN B 383 42.345 54.873 54.155 1.00 0.00 H ATOM 14001 HB2 ASN B 383 40.741 56.158 55.529 1.00 0.00 H ATOM 14002 HB3 ASN B 383 40.900 54.934 56.810 1.00 0.00 H ATOM 14003 HD22 ASN B 383 43.729 54.406 56.422 1.00 0.00 H ATOM 14004 HD21 ASN B 383 44.582 55.855 57.068 1.00 0.00 H ATOM 14005 H ASN B 383 39.643 53.982 54.945 1.00 0.00 H ATOM 14006 N GLY B 384 43.747 52.942 54.788 1.00 43.17 N ATOM 14007 CA GLY B 384 44.706 51.917 55.149 1.00 43.12 C ATOM 14008 C GLY B 384 45.342 52.064 56.529 1.00 43.88 C ATOM 14009 O GLY B 384 45.573 51.059 57.174 1.00 45.05 O ATOM 14010 HA3 GLY B 384 45.505 51.930 54.408 1.00 0.00 H ATOM 14011 HA2 GLY B 384 44.196 50.954 55.115 1.00 0.00 H ATOM 14012 H GLY B 384 43.918 53.491 53.922 1.00 0.00 H ATOM 14013 N ILE B 385 45.635 53.275 56.984 1.00 42.46 N ATOM 14014 CA ILE B 385 46.243 53.478 58.290 1.00 41.86 C ATOM 14015 C ILE B 385 45.197 53.144 59.390 1.00 42.66 C ATOM 14016 O ILE B 385 45.500 52.475 60.388 1.00 41.24 O ATOM 14017 CB ILE B 385 46.687 54.958 58.477 1.00 41.89 C ATOM 14018 CG1 ILE B 385 47.713 55.333 57.408 1.00 44.61 C ATOM 14019 CG2 ILE B 385 47.267 55.188 59.872 1.00 40.34 C ATOM 14020 CD1 ILE B 385 48.747 54.277 57.199 1.00 47.92 C ATOM 14021 HA ILE B 385 47.117 52.831 58.366 1.00 0.00 H ATOM 14022 HB ILE B 385 45.809 55.595 58.370 1.00 0.00 H ATOM 14023 HG12 ILE B 385 47.190 55.499 56.466 1.00 0.00 H ATOM 14024 HG13 ILE B 385 48.212 56.253 57.712 1.00 0.00 H ATOM 14025 HD11 ILE B 385 49.285 54.108 58.132 1.00 0.00 H ATOM 14026 HD12 ILE B 385 48.262 53.353 56.885 1.00 0.00 H ATOM 14027 HD13 ILE B 385 49.446 54.602 56.428 1.00 0.00 H ATOM 14028 HG21 ILE B 385 46.511 54.953 60.622 1.00 0.00 H ATOM 14029 HG22 ILE B 385 48.134 54.543 60.014 1.00 0.00 H ATOM 14030 HG23 ILE B 385 47.568 56.231 59.972 1.00 0.00 H ATOM 14031 H ILE B 385 45.424 54.103 56.390 1.00 0.00 H ATOM 14032 N LYS B 386 43.982 53.641 59.197 1.00 42.35 N ATOM 14033 CA LYS B 386 42.886 53.420 60.122 1.00 43.00 C ATOM 14034 C LYS B 386 42.507 51.955 60.241 1.00 41.35 C ATOM 14035 O LYS B 386 42.233 51.478 61.331 1.00 41.04 O ATOM 14036 CB LYS B 386 41.659 54.234 59.706 1.00 42.58 C ATOM 14037 CG LYS B 386 41.746 55.685 60.094 1.00 44.99 C ATOM 14038 CD LYS B 386 40.540 56.447 59.553 1.00 46.09 C ATOM 14039 CE LYS B 386 40.452 57.873 60.158 1.00 47.19 C ATOM 14040 NZ LYS B 386 39.358 58.744 59.581 1.00 47.85 N ATOM 14041 HA LYS B 386 43.235 53.751 61.100 1.00 0.00 H ATOM 14042 HB2 LYS B 386 41.553 54.171 58.623 1.00 0.00 H ATOM 14043 HB3 LYS B 386 40.779 53.801 60.182 1.00 0.00 H ATOM 14044 HG2 LYS B 386 41.767 55.767 61.181 1.00 0.00 H ATOM 14045 HG3 LYS B 386 42.659 56.115 59.681 1.00 0.00 H ATOM 14046 HD2 LYS B 386 40.627 56.526 58.469 1.00 0.00 H ATOM 14047 HD3 LYS B 386 39.632 55.899 59.804 1.00 0.00 H ATOM 14048 HE2 LYS B 386 41.406 58.372 59.990 1.00 0.00 H ATOM 14049 HE3 LYS B 386 40.278 57.776 61.230 1.00 0.00 H ATOM 14050 HZ1 LYS B 386 39.513 58.861 58.559 1.00 0.00 H ATOM 14051 HZ2 LYS B 386 38.435 58.293 59.743 1.00 0.00 H ATOM 14052 HZ3 LYS B 386 39.377 59.675 60.045 1.00 0.00 H ATOM 14053 H LYS B 386 43.808 54.213 58.346 1.00 0.00 H ATOM 14054 N ASN B 387 42.477 51.248 59.130 1.00 41.08 N ATOM 14055 CA ASN B 387 42.157 49.833 59.191 1.00 41.37 C ATOM 14056 C ASN B 387 43.296 49.084 59.950 1.00 40.05 C ATOM 14057 O ASN B 387 43.023 48.183 60.739 1.00 39.26 O ATOM 14058 CB ASN B 387 41.998 49.247 57.787 1.00 39.88 C ATOM 14059 CG ASN B 387 40.739 49.743 57.079 1.00 45.76 C ATOM 14060 OD1 ASN B 387 39.757 50.149 57.730 1.00 45.73 O ATOM 14061 ND2 ASN B 387 40.745 49.686 55.729 1.00 43.81 N ATOM 14062 HA ASN B 387 41.212 49.709 59.720 1.00 0.00 H ATOM 14063 HB2 ASN B 387 42.867 49.528 57.191 1.00 0.00 H ATOM 14064 HB3 ASN B 387 41.949 48.161 57.866 1.00 0.00 H ATOM 14065 HD22 ASN B 387 41.587 49.340 55.227 1.00 0.00 H ATOM 14066 HD21 ASN B 387 39.907 49.988 55.192 1.00 0.00 H ATOM 14067 H ASN B 387 42.681 51.700 58.216 1.00 0.00 H ATOM 14068 N ARG B 388 44.551 49.459 59.687 1.00 38.83 N ATOM 14069 CA ARG B 388 45.705 48.828 60.324 1.00 38.67 C ATOM 14070 C ARG B 388 45.635 49.092 61.821 1.00 38.41 C ATOM 14071 O ARG B 388 45.685 48.143 62.635 1.00 36.76 O ATOM 14072 CB ARG B 388 47.011 49.384 59.780 1.00 37.98 C ATOM 14073 CG ARG B 388 48.270 48.771 60.368 1.00 37.10 C ATOM 14074 CD ARG B 388 49.499 49.655 60.024 1.00 36.48 C ATOM 14075 NE ARG B 388 49.490 50.887 60.819 1.00 38.56 N ATOM 14076 CZ ARG B 388 50.094 52.034 60.474 1.00 39.25 C ATOM 14077 NH1 ARG B 388 50.035 53.096 61.285 1.00 37.53 N ATOM 14078 NH2 ARG B 388 50.748 52.137 59.312 1.00 39.11 N ATOM 14079 HA ARG B 388 45.679 47.759 60.115 1.00 0.00 H ATOM 14080 HB2 ARG B 388 47.026 49.218 58.703 1.00 0.00 H ATOM 14081 HB3 ARG B 388 47.032 50.455 59.981 1.00 0.00 H ATOM 14082 HG2 ARG B 388 48.167 48.701 61.451 1.00 0.00 H ATOM 14083 HG3 ARG B 388 48.414 47.774 59.953 1.00 0.00 H ATOM 14084 HD2 ARG B 388 49.470 49.912 58.965 1.00 0.00 H ATOM 14085 HD3 ARG B 388 50.412 49.098 60.237 1.00 0.00 H ATOM 14086 HE ARG B 388 48.974 50.870 61.722 1.00 0.00 H ATOM 14087 HH12 ARG B 388 50.504 53.984 61.014 1.00 0.00 H ATOM 14088 HH11 ARG B 388 49.520 53.034 62.186 1.00 0.00 H ATOM 14089 HH22 ARG B 388 51.213 53.031 59.054 1.00 0.00 H ATOM 14090 HH21 ARG B 388 50.792 51.323 58.666 1.00 0.00 H ATOM 14091 H ARG B 388 44.712 50.227 59.005 1.00 0.00 H ATOM 14092 N ASP B 389 45.492 50.360 62.204 1.00 37.56 N ATOM 14093 CA ASP B 389 45.400 50.660 63.632 1.00 37.30 C ATOM 14094 C ASP B 389 44.143 50.048 64.310 1.00 38.53 C ATOM 14095 O ASP B 389 44.188 49.643 65.498 1.00 36.29 O ATOM 14096 CB ASP B 389 45.416 52.174 63.856 1.00 38.13 C ATOM 14097 CG ASP B 389 46.754 52.823 63.462 1.00 38.82 C ATOM 14098 OD1 ASP B 389 47.787 52.109 63.329 1.00 38.36 O ATOM 14099 OD2 ASP B 389 46.738 54.055 63.290 1.00 39.22 O ATOM 14100 HA ASP B 389 46.270 50.198 64.098 1.00 0.00 H ATOM 14101 HB2 ASP B 389 44.622 52.623 63.259 1.00 0.00 H ATOM 14102 HB3 ASP B 389 45.231 52.372 64.912 1.00 0.00 H ATOM 14103 H ASP B 389 45.447 51.123 61.499 1.00 0.00 H ATOM 14104 N GLY B 390 43.035 49.990 63.566 1.00 37.03 N ATOM 14105 CA GLY B 390 41.793 49.429 64.108 1.00 38.29 C ATOM 14106 C GLY B 390 41.942 47.951 64.488 1.00 38.16 C ATOM 14107 O GLY B 390 41.418 47.503 65.502 1.00 37.63 O ATOM 14108 HA3 GLY B 390 41.009 49.521 63.357 1.00 0.00 H ATOM 14109 HA2 GLY B 390 41.511 49.994 64.997 1.00 0.00 H ATOM 14110 H GLY B 390 43.053 50.347 62.590 1.00 0.00 H ATOM 14111 N LEU B 391 42.669 47.209 63.656 1.00 37.81 N ATOM 14112 CA LEU B 391 42.957 45.796 63.867 1.00 36.61 C ATOM 14113 C LEU B 391 43.908 45.666 65.074 1.00 37.36 C ATOM 14114 O LEU B 391 43.769 44.756 65.920 1.00 34.56 O ATOM 14115 CB LEU B 391 43.602 45.246 62.600 1.00 37.17 C ATOM 14116 CG LEU B 391 42.967 44.028 61.878 1.00 39.95 C ATOM 14117 CD1 LEU B 391 41.461 43.947 62.115 1.00 41.53 C ATOM 14118 CD2 LEU B 391 43.272 44.035 60.387 1.00 37.71 C ATOM 14119 HA LEU B 391 42.049 45.230 64.075 1.00 0.00 H ATOM 14120 HB2 LEU B 391 43.628 46.063 61.879 1.00 0.00 H ATOM 14121 HB3 LEU B 391 44.621 44.962 62.862 1.00 0.00 H ATOM 14122 HG LEU B 391 43.422 43.138 62.312 1.00 0.00 H ATOM 14123 HD21 LEU B 391 42.873 44.946 59.940 1.00 0.00 H ATOM 14124 HD22 LEU B 391 44.351 43.998 60.238 1.00 0.00 H ATOM 14125 HD23 LEU B 391 42.810 43.166 59.919 1.00 0.00 H ATOM 14126 HD11 LEU B 391 41.267 43.850 63.183 1.00 0.00 H ATOM 14127 HD12 LEU B 391 40.986 44.853 61.739 1.00 0.00 H ATOM 14128 HD13 LEU B 391 41.058 43.080 61.591 1.00 0.00 H ATOM 14129 H LEU B 391 43.055 47.665 62.804 1.00 0.00 H ATOM 14130 N ASP B 392 44.855 46.599 65.207 1.00 37.45 N ATOM 14131 CA ASP B 392 45.757 46.499 66.342 1.00 38.32 C ATOM 14132 C ASP B 392 44.940 46.650 67.619 1.00 37.51 C ATOM 14133 O ASP B 392 45.155 45.935 68.600 1.00 38.17 O ATOM 14134 CB ASP B 392 46.894 47.535 66.260 1.00 39.33 C ATOM 14135 CG ASP B 392 47.653 47.692 67.589 1.00 40.02 C ATOM 14136 OD1 ASP B 392 48.235 46.733 68.126 1.00 39.63 O ATOM 14137 OD2 ASP B 392 47.652 48.814 68.108 1.00 44.77 O ATOM 14138 HA ASP B 392 46.243 45.523 66.337 1.00 0.00 H ATOM 14139 HB2 ASP B 392 47.599 47.219 65.491 1.00 0.00 H ATOM 14140 HB3 ASP B 392 46.468 48.500 65.986 1.00 0.00 H ATOM 14141 H ASP B 392 44.944 47.374 64.519 1.00 0.00 H ATOM 14142 N ASP B 393 43.986 47.567 67.617 1.00 36.79 N ATOM 14143 CA ASP B 393 43.143 47.745 68.787 1.00 35.33 C ATOM 14144 C ASP B 393 42.206 46.547 69.006 1.00 34.11 C ATOM 14145 O ASP B 393 41.941 46.154 70.126 1.00 34.02 O ATOM 14146 CB ASP B 393 42.322 48.996 68.636 1.00 36.53 C ATOM 14147 CG ASP B 393 43.129 50.232 68.894 1.00 39.60 C ATOM 14148 OD1 ASP B 393 44.000 50.233 69.811 1.00 38.50 O ATOM 14149 OD2 ASP B 393 42.866 51.214 68.192 1.00 39.44 O ATOM 14150 HA ASP B 393 43.798 47.825 69.655 1.00 0.00 H ATOM 14151 HB2 ASP B 393 41.928 49.038 67.621 1.00 0.00 H ATOM 14152 HB3 ASP B 393 41.494 48.962 69.344 1.00 0.00 H ATOM 14153 H ASP B 393 43.839 48.161 66.776 1.00 0.00 H ATOM 14154 N ILE B 394 41.686 45.972 67.930 1.00 33.10 N ATOM 14155 CA ILE B 394 40.796 44.815 68.096 1.00 31.63 C ATOM 14156 C ILE B 394 41.586 43.694 68.791 1.00 32.17 C ATOM 14157 O ILE B 394 41.150 43.135 69.807 1.00 31.82 O ATOM 14158 CB ILE B 394 40.283 44.312 66.727 1.00 30.87 C ATOM 14159 CG1 ILE B 394 39.189 45.279 66.201 1.00 28.84 C ATOM 14160 CG2 ILE B 394 39.713 42.807 66.838 1.00 30.59 C ATOM 14161 CD1 ILE B 394 38.856 44.980 64.749 1.00 30.02 C ATOM 14162 HA ILE B 394 39.933 45.107 68.694 1.00 0.00 H ATOM 14163 HB ILE B 394 41.115 44.294 66.023 1.00 0.00 H ATOM 14164 HG12 ILE B 394 38.289 45.163 66.805 1.00 0.00 H ATOM 14165 HG13 ILE B 394 39.550 46.304 66.281 1.00 0.00 H ATOM 14166 HD11 ILE B 394 39.752 45.099 64.140 1.00 0.00 H ATOM 14167 HD12 ILE B 394 38.491 43.957 64.665 1.00 0.00 H ATOM 14168 HD13 ILE B 394 38.087 45.671 64.404 1.00 0.00 H ATOM 14169 HG21 ILE B 394 40.508 42.143 67.179 1.00 0.00 H ATOM 14170 HG22 ILE B 394 38.888 42.784 67.550 1.00 0.00 H ATOM 14171 HG23 ILE B 394 39.360 42.481 65.860 1.00 0.00 H ATOM 14172 H ILE B 394 41.905 46.336 66.981 1.00 0.00 H ATOM 14173 N VAL B 395 42.761 43.395 68.262 1.00 30.94 N ATOM 14174 CA VAL B 395 43.551 42.311 68.812 1.00 33.03 C ATOM 14175 C VAL B 395 43.965 42.592 70.251 1.00 33.25 C ATOM 14176 O VAL B 395 43.741 41.746 71.138 1.00 33.95 O ATOM 14177 CB VAL B 395 44.793 42.022 67.914 1.00 32.20 C ATOM 14178 CG1 VAL B 395 45.666 40.922 68.553 1.00 31.60 C ATOM 14179 CG2 VAL B 395 44.341 41.585 66.541 1.00 30.60 C ATOM 14180 HA VAL B 395 42.926 41.418 68.825 1.00 0.00 H ATOM 14181 HB VAL B 395 45.384 42.933 67.824 1.00 0.00 H ATOM 14182 HG11 VAL B 395 46.004 41.253 69.535 1.00 0.00 H ATOM 14183 HG12 VAL B 395 45.079 40.009 68.657 1.00 0.00 H ATOM 14184 HG13 VAL B 395 46.530 40.730 67.916 1.00 0.00 H ATOM 14185 HG21 VAL B 395 43.740 40.680 66.629 1.00 0.00 H ATOM 14186 HG22 VAL B 395 43.744 42.376 66.088 1.00 0.00 H ATOM 14187 HG23 VAL B 395 45.214 41.385 65.919 1.00 0.00 H ATOM 14188 H VAL B 395 43.119 43.938 67.450 1.00 0.00 H ATOM 14189 N GLY B 396 44.562 43.776 70.461 1.00 33.41 N ATOM 14190 CA GLY B 396 44.976 44.193 71.787 1.00 31.68 C ATOM 14191 C GLY B 396 43.839 44.275 72.818 1.00 32.66 C ATOM 14192 O GLY B 396 43.977 43.783 73.962 1.00 31.35 O ATOM 14193 HA3 GLY B 396 45.433 45.179 71.706 1.00 0.00 H ATOM 14194 HA2 GLY B 396 45.715 43.480 72.152 1.00 0.00 H ATOM 14195 H GLY B 396 44.732 44.409 69.654 1.00 0.00 H ATOM 14196 N ASP B 397 42.723 44.926 72.457 1.00 31.88 N ATOM 14197 CA ASP B 397 41.587 45.053 73.365 1.00 31.79 C ATOM 14198 C ASP B 397 40.993 43.663 73.693 1.00 31.56 C ATOM 14199 O ASP B 397 40.755 43.346 74.844 1.00 28.55 O ATOM 14200 CB ASP B 397 40.445 45.908 72.770 1.00 32.29 C ATOM 14201 CG ASP B 397 40.826 47.391 72.579 1.00 34.41 C ATOM 14202 OD1 ASP B 397 41.800 47.846 73.184 1.00 32.46 O ATOM 14203 OD2 ASP B 397 40.124 48.106 71.826 1.00 34.31 O ATOM 14204 HA ASP B 397 41.975 45.540 74.260 1.00 0.00 H ATOM 14205 HB2 ASP B 397 40.172 45.493 71.800 1.00 0.00 H ATOM 14206 HB3 ASP B 397 39.587 45.855 73.441 1.00 0.00 H ATOM 14207 H ASP B 397 42.666 45.350 71.509 1.00 0.00 H ATOM 14208 N HIS B 398 40.736 42.854 72.675 1.00 31.18 N ATOM 14209 CA HIS B 398 40.130 41.541 72.943 1.00 31.60 C ATOM 14210 C HIS B 398 41.042 40.576 73.744 1.00 31.37 C ATOM 14211 O HIS B 398 40.581 39.900 74.668 1.00 31.52 O ATOM 14212 CB HIS B 398 39.729 40.875 71.627 1.00 30.28 C ATOM 14213 CG HIS B 398 39.356 39.433 71.777 1.00 31.98 C ATOM 14214 ND1 HIS B 398 38.388 38.999 72.660 1.00 31.74 N ATOM 14215 CD2 HIS B 398 39.791 38.328 71.127 1.00 33.02 C ATOM 14216 CE1 HIS B 398 38.234 37.693 72.549 1.00 30.14 C ATOM 14217 NE2 HIS B 398 39.074 37.260 71.623 1.00 34.32 N ATOM 14218 HA HIS B 398 39.257 41.737 73.566 1.00 0.00 H ATOM 14219 HB2 HIS B 398 38.875 41.412 71.215 1.00 0.00 H ATOM 14220 HB3 HIS B 398 40.568 40.944 70.935 1.00 0.00 H ATOM 14221 HD2 HIS B 398 40.562 38.290 70.357 1.00 0.00 H ATOM 14222 HE1 HIS B 398 37.537 37.079 73.120 1.00 0.00 H ATOM 14223 H HIS B 398 40.960 43.143 71.701 1.00 0.00 H ATOM 14224 N ASN B 399 42.329 40.564 73.430 1.00 30.90 N ATOM 14225 CA ASN B 399 43.237 39.632 74.061 1.00 31.18 C ATOM 14226 C ASN B 399 44.008 40.013 75.291 1.00 32.57 C ATOM 14227 O ASN B 399 44.400 39.149 76.084 1.00 33.82 O ATOM 14228 CB ASN B 399 44.220 39.149 73.012 1.00 31.66 C ATOM 14229 CG ASN B 399 43.547 38.259 71.956 1.00 33.31 C ATOM 14230 OD1 ASN B 399 43.099 37.131 72.269 1.00 32.66 O ATOM 14231 ND2 ASN B 399 43.470 38.758 70.699 1.00 30.80 N ATOM 14232 HA ASN B 399 42.549 38.885 74.458 1.00 0.00 H ATOM 14233 HB2 ASN B 399 44.658 40.015 72.515 1.00 0.00 H ATOM 14234 HB3 ASN B 399 45.007 38.577 73.504 1.00 0.00 H ATOM 14235 HD22 ASN B 399 43.857 39.700 70.489 1.00 0.00 H ATOM 14236 HD21 ASN B 399 43.024 38.199 69.944 1.00 0.00 H ATOM 14237 H ASN B 399 42.691 41.233 72.721 1.00 0.00 H ATOM 14238 N VAL B 400 44.249 41.302 75.453 1.00 32.59 N ATOM 14239 CA VAL B 400 45.051 41.761 76.555 1.00 31.29 C ATOM 14240 C VAL B 400 44.368 42.821 77.411 1.00 32.11 C ATOM 14241 O VAL B 400 44.062 42.608 78.606 1.00 32.58 O ATOM 14242 CB VAL B 400 46.343 42.387 76.032 1.00 30.36 C ATOM 14243 CG1 VAL B 400 47.086 43.018 77.198 1.00 28.67 C ATOM 14244 CG2 VAL B 400 47.224 41.269 75.246 1.00 27.30 C ATOM 14245 HA VAL B 400 45.231 40.879 77.169 1.00 0.00 H ATOM 14246 HB VAL B 400 46.129 43.174 75.309 1.00 0.00 H ATOM 14247 HG11 VAL B 400 46.460 43.785 77.653 1.00 0.00 H ATOM 14248 HG12 VAL B 400 47.318 42.251 77.937 1.00 0.00 H ATOM 14249 HG13 VAL B 400 48.011 43.468 76.837 1.00 0.00 H ATOM 14250 HG21 VAL B 400 47.470 40.456 75.929 1.00 0.00 H ATOM 14251 HG22 VAL B 400 46.648 40.879 74.407 1.00 0.00 H ATOM 14252 HG23 VAL B 400 48.143 41.725 74.877 1.00 0.00 H ATOM 14253 H VAL B 400 43.856 41.989 74.779 1.00 0.00 H ATOM 14254 N ILE B 401 44.074 43.956 76.791 1.00 32.76 N ATOM 14255 CA ILE B 401 43.504 45.071 77.557 1.00 32.53 C ATOM 14256 C ILE B 401 42.155 44.868 78.252 1.00 32.82 C ATOM 14257 O ILE B 401 42.066 45.028 79.501 1.00 33.15 O ATOM 14258 CB ILE B 401 43.477 46.346 76.713 1.00 31.58 C ATOM 14259 CG1 ILE B 401 44.909 46.605 76.229 1.00 32.72 C ATOM 14260 CG2 ILE B 401 42.989 47.550 77.553 1.00 32.23 C ATOM 14261 CD1 ILE B 401 45.068 47.792 75.315 1.00 31.73 C ATOM 14262 HA ILE B 401 44.195 45.150 78.396 1.00 0.00 H ATOM 14263 HB ILE B 401 42.792 46.224 75.874 1.00 0.00 H ATOM 14264 HG12 ILE B 401 45.538 46.765 77.104 1.00 0.00 H ATOM 14265 HG13 ILE B 401 45.251 45.719 75.695 1.00 0.00 H ATOM 14266 HD11 ILE B 401 44.458 47.647 74.423 1.00 0.00 H ATOM 14267 HD12 ILE B 401 44.745 48.695 75.834 1.00 0.00 H ATOM 14268 HD13 ILE B 401 46.115 47.891 75.028 1.00 0.00 H ATOM 14269 HG21 ILE B 401 41.983 47.350 77.922 1.00 0.00 H ATOM 14270 HG22 ILE B 401 43.663 47.700 78.396 1.00 0.00 H ATOM 14271 HG23 ILE B 401 42.978 48.445 76.931 1.00 0.00 H ATOM 14272 H ILE B 401 44.246 44.055 75.770 1.00 0.00 H ATOM 14273 N CYS B 402 41.114 44.525 77.501 1.00 32.15 N ATOM 14274 CA CYS B 402 39.812 44.361 78.166 1.00 30.94 C ATOM 14275 C CYS B 402 39.797 43.211 79.150 1.00 31.11 C ATOM 14276 O CYS B 402 39.137 43.304 80.162 1.00 31.03 O ATOM 14277 CB CYS B 402 38.706 44.293 77.119 1.00 31.63 C ATOM 14278 SG CYS B 402 38.637 45.884 76.214 1.00 34.07 S ATOM 14279 HA CYS B 402 39.623 45.238 78.785 1.00 0.00 H ATOM 14280 HB2 CYS B 402 37.750 44.110 77.609 1.00 0.00 H ATOM 14281 HB3 CYS B 402 38.915 43.484 76.419 1.00 0.00 H ATOM 14282 H CYS B 402 41.216 44.377 76.477 1.00 0.00 H ATOM 14283 N PRO B 403 40.508 42.083 78.868 1.00 31.79 N ATOM 14284 CA PRO B 403 40.475 41.023 79.913 1.00 32.86 C ATOM 14285 C PRO B 403 41.187 41.587 81.174 1.00 32.14 C ATOM 14286 O PRO B 403 40.789 41.308 82.320 1.00 32.12 O ATOM 14287 CB PRO B 403 41.327 39.866 79.332 1.00 30.95 C ATOM 14288 CG PRO B 403 41.164 40.051 77.821 1.00 32.63 C ATOM 14289 CD PRO B 403 41.090 41.597 77.602 1.00 30.42 C ATOM 14290 HA PRO B 403 39.466 40.701 80.173 1.00 0.00 H ATOM 14291 HD3 PRO B 403 42.082 42.018 77.439 1.00 0.00 H ATOM 14292 HD2 PRO B 403 40.449 41.843 76.756 1.00 0.00 H ATOM 14293 HG3 PRO B 403 40.249 39.571 77.474 1.00 0.00 H ATOM 14294 HG2 PRO B 403 42.018 39.630 77.290 1.00 0.00 H ATOM 14295 HB2 PRO B 403 42.372 39.960 79.629 1.00 0.00 H ATOM 14296 HB3 PRO B 403 40.945 38.897 79.653 1.00 0.00 H ATOM 14297 N LEU B 404 42.254 42.368 80.979 1.00 32.47 N ATOM 14298 CA LEU B 404 42.916 42.879 82.164 1.00 31.83 C ATOM 14299 C LEU B 404 42.027 43.900 82.911 1.00 32.22 C ATOM 14300 O LEU B 404 42.037 43.948 84.156 1.00 32.47 O ATOM 14301 CB LEU B 404 44.272 43.497 81.824 1.00 30.28 C ATOM 14302 CG LEU B 404 45.075 44.052 83.026 1.00 31.93 C ATOM 14303 CD1 LEU B 404 46.605 43.856 82.853 1.00 29.88 C ATOM 14304 CD2 LEU B 404 44.755 45.551 83.189 1.00 31.12 C ATOM 14305 HA LEU B 404 43.088 42.031 82.827 1.00 0.00 H ATOM 14306 HB2 LEU B 404 44.878 42.731 81.340 1.00 0.00 H ATOM 14307 HB3 LEU B 404 44.102 44.317 81.127 1.00 0.00 H ATOM 14308 HG LEU B 404 44.780 43.497 83.916 1.00 0.00 H ATOM 14309 HD21 LEU B 404 45.036 46.082 82.280 1.00 0.00 H ATOM 14310 HD22 LEU B 404 43.687 45.676 83.369 1.00 0.00 H ATOM 14311 HD23 LEU B 404 45.316 45.951 84.033 1.00 0.00 H ATOM 14312 HD11 LEU B 404 46.826 42.793 82.761 1.00 0.00 H ATOM 14313 HD12 LEU B 404 46.937 44.376 81.955 1.00 0.00 H ATOM 14314 HD13 LEU B 404 47.123 44.262 83.722 1.00 0.00 H ATOM 14315 H LEU B 404 42.593 42.598 80.023 1.00 0.00 H ATOM 14316 N MET B 405 41.281 44.717 82.174 1.00 31.16 N ATOM 14317 CA MET B 405 40.396 45.686 82.833 1.00 31.90 C ATOM 14318 C MET B 405 39.301 44.911 83.540 1.00 31.45 C ATOM 14319 O MET B 405 38.893 45.269 84.627 1.00 31.03 O ATOM 14320 CB MET B 405 39.796 46.704 81.830 1.00 31.91 C ATOM 14321 CG MET B 405 40.857 47.698 81.308 1.00 32.28 C ATOM 14322 SD MET B 405 41.880 48.442 82.633 1.00 37.23 S ATOM 14323 CE MET B 405 40.553 49.327 83.532 1.00 36.72 C ATOM 14324 HA MET B 405 40.972 46.271 83.550 1.00 0.00 H ATOM 14325 HB2 MET B 405 39.377 46.159 80.984 1.00 0.00 H ATOM 14326 HB3 MET B 405 39.004 47.264 82.328 1.00 0.00 H ATOM 14327 HG2 MET B 405 40.346 48.500 80.776 1.00 0.00 H ATOM 14328 HG3 MET B 405 41.516 47.169 80.620 1.00 0.00 H ATOM 14329 HE1 MET B 405 40.080 50.046 82.863 1.00 0.00 H ATOM 14330 HE2 MET B 405 39.810 48.609 83.879 1.00 0.00 H ATOM 14331 HE3 MET B 405 40.982 49.850 84.387 1.00 0.00 H ATOM 14332 H MET B 405 41.324 44.670 81.136 1.00 0.00 H ATOM 14333 N HIS B 406 38.850 43.806 82.969 1.00 31.58 N ATOM 14334 CA HIS B 406 37.826 43.048 83.688 1.00 32.10 C ATOM 14335 C HIS B 406 38.443 42.462 84.988 1.00 33.34 C ATOM 14336 O HIS B 406 37.830 42.481 86.059 1.00 33.13 O ATOM 14337 CB HIS B 406 37.281 41.917 82.789 1.00 32.23 C ATOM 14338 CG HIS B 406 36.182 41.123 83.425 1.00 36.56 C ATOM 14339 ND1 HIS B 406 34.930 41.656 83.684 1.00 37.77 N ATOM 14340 CD2 HIS B 406 36.137 39.829 83.838 1.00 35.71 C ATOM 14341 CE1 HIS B 406 34.163 40.721 84.223 1.00 36.97 C ATOM 14342 NE2 HIS B 406 34.870 39.604 84.323 1.00 36.91 N ATOM 14343 HA HIS B 406 36.998 43.706 83.952 1.00 0.00 H ATOM 14344 HB2 HIS B 406 36.898 42.361 81.870 1.00 0.00 H ATOM 14345 HB3 HIS B 406 38.102 41.240 82.550 1.00 0.00 H ATOM 14346 HD2 HIS B 406 36.951 39.106 83.793 1.00 0.00 H ATOM 14347 HE1 HIS B 406 33.126 40.848 84.532 1.00 0.00 H ATOM 14348 H HIS B 406 39.209 43.489 82.046 1.00 0.00 H ATOM 14349 N PHE B 407 39.662 41.941 84.905 1.00 32.93 N ATOM 14350 CA PHE B 407 40.287 41.387 86.100 1.00 32.52 C ATOM 14351 C PHE B 407 40.489 42.495 87.180 1.00 32.99 C ATOM 14352 O PHE B 407 40.166 42.275 88.375 1.00 31.70 O ATOM 14353 CB PHE B 407 41.644 40.770 85.732 1.00 31.18 C ATOM 14354 CG PHE B 407 42.440 40.308 86.907 1.00 30.43 C ATOM 14355 CD1 PHE B 407 42.111 39.138 87.571 1.00 30.96 C ATOM 14356 CD2 PHE B 407 43.514 41.070 87.379 1.00 31.93 C ATOM 14357 CE1 PHE B 407 42.855 38.720 88.715 1.00 31.44 C ATOM 14358 CE2 PHE B 407 44.264 40.667 88.525 1.00 28.48 C ATOM 14359 CZ PHE B 407 43.932 39.501 89.178 1.00 31.66 C ATOM 14360 HA PHE B 407 39.633 40.617 86.511 1.00 0.00 H ATOM 14361 HB2 PHE B 407 41.466 39.915 85.080 1.00 0.00 H ATOM 14362 HB3 PHE B 407 42.227 41.519 85.196 1.00 0.00 H ATOM 14363 HD2 PHE B 407 43.784 41.990 86.861 1.00 0.00 H ATOM 14364 HE2 PHE B 407 45.094 41.278 88.881 1.00 0.00 H ATOM 14365 HZ PHE B 407 44.501 39.183 90.051 1.00 0.00 H ATOM 14366 HE1 PHE B 407 42.590 37.797 89.230 1.00 0.00 H ATOM 14367 HD1 PHE B 407 41.277 38.532 87.217 1.00 0.00 H ATOM 14368 H PHE B 407 40.166 41.928 83.995 1.00 0.00 H ATOM 14369 N VAL B 408 40.996 43.673 86.778 1.00 33.53 N ATOM 14370 CA VAL B 408 41.256 44.692 87.773 1.00 35.90 C ATOM 14371 C VAL B 408 39.985 45.180 88.448 1.00 36.57 C ATOM 14372 O VAL B 408 39.975 45.402 89.663 1.00 35.57 O ATOM 14373 CB VAL B 408 42.085 45.914 87.232 1.00 38.46 C ATOM 14374 CG1 VAL B 408 41.342 46.680 86.271 1.00 38.78 C ATOM 14375 CG2 VAL B 408 42.423 46.879 88.392 1.00 40.15 C ATOM 14376 HA VAL B 408 41.876 44.192 88.517 1.00 0.00 H ATOM 14377 HB VAL B 408 42.982 45.501 86.770 1.00 0.00 H ATOM 14378 HG11 VAL B 408 41.079 46.044 85.426 1.00 0.00 H ATOM 14379 HG12 VAL B 408 40.433 47.062 86.737 1.00 0.00 H ATOM 14380 HG13 VAL B 408 41.952 47.514 85.923 1.00 0.00 H ATOM 14381 HG21 VAL B 408 41.499 47.243 88.841 1.00 0.00 H ATOM 14382 HG22 VAL B 408 43.010 46.351 89.143 1.00 0.00 H ATOM 14383 HG23 VAL B 408 42.997 47.722 88.006 1.00 0.00 H ATOM 14384 H VAL B 408 41.197 43.849 85.773 1.00 0.00 H ATOM 14385 N ASN B 409 38.897 45.302 87.688 1.00 38.89 N ATOM 14386 CA ASN B 409 37.663 45.738 88.318 1.00 39.33 C ATOM 14387 C ASN B 409 37.107 44.669 89.242 1.00 38.91 C ATOM 14388 O ASN B 409 36.642 44.992 90.325 1.00 38.83 O ATOM 14389 CB ASN B 409 36.656 46.203 87.264 1.00 41.16 C ATOM 14390 CG ASN B 409 36.938 47.649 86.841 1.00 43.07 C ATOM 14391 OD1 ASN B 409 36.760 48.583 87.646 1.00 45.45 O ATOM 14392 ND2 ASN B 409 37.405 47.841 85.612 1.00 43.70 N ATOM 14393 HA ASN B 409 37.878 46.599 88.950 1.00 0.00 H ATOM 14394 HB2 ASN B 409 36.727 45.555 86.391 1.00 0.00 H ATOM 14395 HB3 ASN B 409 35.650 46.142 87.679 1.00 0.00 H ATOM 14396 HD22 ASN B 409 37.538 47.031 84.974 1.00 0.00 H ATOM 14397 HD21 ASN B 409 37.638 48.802 85.288 1.00 0.00 H ATOM 14398 H ASN B 409 38.931 45.091 86.670 1.00 0.00 H ATOM 14399 N LYS B 410 37.172 43.399 88.863 1.00 37.39 N ATOM 14400 CA LYS B 410 36.684 42.352 89.773 1.00 38.56 C ATOM 14401 C LYS B 410 37.585 42.257 91.035 1.00 38.90 C ATOM 14402 O LYS B 410 37.112 42.156 92.189 1.00 36.96 O ATOM 14403 CB LYS B 410 36.686 40.998 89.061 1.00 39.06 C ATOM 14404 CG LYS B 410 35.588 40.886 88.015 1.00 42.23 C ATOM 14405 CD LYS B 410 34.221 41.001 88.692 1.00 44.38 C ATOM 14406 CE LYS B 410 33.113 40.761 87.721 1.00 47.08 C ATOM 14407 NZ LYS B 410 31.794 40.694 88.413 1.00 48.44 N ATOM 14408 HA LYS B 410 35.670 42.612 90.075 1.00 0.00 H ATOM 14409 HB2 LYS B 410 37.650 40.862 88.571 1.00 0.00 H ATOM 14410 HB3 LYS B 410 36.543 40.213 89.803 1.00 0.00 H ATOM 14411 HG2 LYS B 410 35.700 41.687 87.284 1.00 0.00 H ATOM 14412 HG3 LYS B 410 35.664 39.923 87.511 1.00 0.00 H ATOM 14413 HD2 LYS B 410 34.158 40.264 89.493 1.00 0.00 H ATOM 14414 HD3 LYS B 410 34.115 42.001 89.112 1.00 0.00 H ATOM 14415 HE2 LYS B 410 33.291 39.818 87.203 1.00 0.00 H ATOM 14416 HE3 LYS B 410 33.093 41.574 86.996 1.00 0.00 H ATOM 14417 HZ1 LYS B 410 31.805 39.916 89.103 1.00 0.00 H ATOM 14418 HZ2 LYS B 410 31.616 41.593 88.905 1.00 0.00 H ATOM 14419 HZ3 LYS B 410 31.044 40.526 87.712 1.00 0.00 H ATOM 14420 H LYS B 410 37.564 43.147 87.933 1.00 0.00 H ATOM 14421 N TYR B 411 38.890 42.328 90.797 1.00 38.25 N ATOM 14422 CA TYR B 411 39.870 42.213 91.868 1.00 37.34 C ATOM 14423 C TYR B 411 39.780 43.313 92.897 1.00 37.60 C ATOM 14424 O TYR B 411 39.790 43.047 94.093 1.00 36.05 O ATOM 14425 CB TYR B 411 41.307 42.200 91.315 1.00 35.96 C ATOM 14426 CG TYR B 411 42.300 41.823 92.391 1.00 34.96 C ATOM 14427 CD1 TYR B 411 42.576 40.478 92.653 1.00 33.23 C ATOM 14428 CD2 TYR B 411 42.885 42.811 93.220 1.00 33.59 C ATOM 14429 CE1 TYR B 411 43.397 40.090 93.711 1.00 31.81 C ATOM 14430 CE2 TYR B 411 43.718 42.444 94.297 1.00 33.50 C ATOM 14431 CZ TYR B 411 43.959 41.069 94.536 1.00 32.46 C ATOM 14432 OH TYR B 411 44.672 40.652 95.631 1.00 33.98 O ATOM 14433 HA TYR B 411 39.633 41.268 92.356 1.00 0.00 H ATOM 14434 HB3 TYR B 411 41.552 43.192 90.936 1.00 0.00 H ATOM 14435 HB2 TYR B 411 41.370 41.476 90.503 1.00 0.00 H ATOM 14436 HD2 TYR B 411 42.689 43.865 93.024 1.00 0.00 H ATOM 14437 HE2 TYR B 411 44.168 43.205 94.934 1.00 0.00 H ATOM 14438 HE1 TYR B 411 43.599 39.034 93.893 1.00 0.00 H ATOM 14439 HD1 TYR B 411 42.138 39.712 92.013 1.00 0.00 H ATOM 14440 HH TYR B 411 44.735 39.664 95.626 1.00 0.00 H ATOM 14441 H TYR B 411 39.220 42.469 89.821 1.00 0.00 H ATOM 14442 N THR B 412 39.703 44.543 92.405 1.00 39.16 N ATOM 14443 CA THR B 412 39.658 45.718 93.245 1.00 39.18 C ATOM 14444 C THR B 412 38.523 45.704 94.242 1.00 40.89 C ATOM 14445 O THR B 412 38.635 46.248 95.315 1.00 41.73 O ATOM 14446 CB THR B 412 39.617 46.974 92.368 1.00 38.35 C ATOM 14447 OG1 THR B 412 40.827 47.025 91.615 1.00 40.55 O ATOM 14448 CG2 THR B 412 39.541 48.243 93.196 1.00 38.14 C ATOM 14449 HA THR B 412 40.567 45.721 93.846 1.00 0.00 H ATOM 14450 HB THR B 412 38.732 46.918 91.735 1.00 0.00 H ATOM 14451 HG1 THR B 412 40.897 46.215 91.050 1.00 0.00 H ATOM 14452 HG23 THR B 412 38.624 48.236 93.786 1.00 0.00 H ATOM 14453 HG21 THR B 412 40.403 48.293 93.862 1.00 0.00 H ATOM 14454 HG22 THR B 412 39.542 49.108 92.533 1.00 0.00 H ATOM 14455 H THR B 412 39.674 44.666 91.373 1.00 0.00 H ATOM 14456 N LYS B 413 37.423 45.079 93.896 1.00 42.06 N ATOM 14457 CA LYS B 413 36.347 45.023 94.844 1.00 43.06 C ATOM 14458 C LYS B 413 36.754 44.294 96.145 1.00 43.30 C ATOM 14459 O LYS B 413 36.255 44.628 97.221 1.00 42.71 O ATOM 14460 CB LYS B 413 35.144 44.314 94.221 1.00 43.80 C ATOM 14461 CG LYS B 413 34.025 44.047 95.247 1.00 45.89 C ATOM 14462 HA LYS B 413 36.088 46.049 95.103 1.00 0.00 H ATOM 14463 HB2 LYS B 413 34.745 44.938 93.421 1.00 0.00 H ATOM 14464 HB3 LYS B 413 35.474 43.361 93.807 1.00 0.00 H ATOM 14465 HG2 LYS B 413 34.411 43.417 96.048 1.00 0.00 H ATOM 14466 HG3 LYS B 413 33.681 44.994 95.662 1.00 0.00 H ATOM 14467 H LYS B 413 37.333 44.636 92.960 1.00 0.00 H ATOM 14468 N PHE B 414 37.636 43.297 96.058 1.00 40.89 N ATOM 14469 CA PHE B 414 38.022 42.556 97.253 1.00 39.77 C ATOM 14470 C PHE B 414 39.460 42.773 97.715 1.00 38.81 C ATOM 14471 O PHE B 414 39.806 42.417 98.837 1.00 37.60 O ATOM 14472 CB PHE B 414 37.854 41.055 97.016 1.00 40.77 C ATOM 14473 CG PHE B 414 36.441 40.623 96.797 1.00 42.85 C ATOM 14474 CD1 PHE B 414 35.643 40.241 97.868 1.00 44.47 C ATOM 14475 CD2 PHE B 414 35.920 40.551 95.518 1.00 43.09 C ATOM 14476 CE1 PHE B 414 34.324 39.783 97.647 1.00 45.19 C ATOM 14477 CE2 PHE B 414 34.624 40.102 95.278 1.00 46.05 C ATOM 14478 CZ PHE B 414 33.822 39.716 96.343 1.00 45.04 C ATOM 14479 HA PHE B 414 37.364 42.940 98.032 1.00 0.00 H ATOM 14480 HB2 PHE B 414 38.436 40.781 96.136 1.00 0.00 H ATOM 14481 HB3 PHE B 414 38.242 40.526 97.886 1.00 0.00 H ATOM 14482 HD2 PHE B 414 36.541 40.854 94.675 1.00 0.00 H ATOM 14483 HE2 PHE B 414 34.241 40.054 94.259 1.00 0.00 H ATOM 14484 HZ PHE B 414 32.806 39.363 96.164 1.00 0.00 H ATOM 14485 HE1 PHE B 414 33.701 39.483 98.489 1.00 0.00 H ATOM 14486 HD1 PHE B 414 36.036 40.295 98.883 1.00 0.00 H ATOM 14487 H PHE B 414 38.049 43.048 95.137 1.00 0.00 H ATOM 14488 N GLY B 415 40.284 43.366 96.857 1.00 38.51 N ATOM 14489 CA GLY B 415 41.696 43.524 97.165 1.00 39.50 C ATOM 14490 C GLY B 415 42.103 44.551 98.185 1.00 39.79 C ATOM 14491 O GLY B 415 41.281 45.217 98.783 1.00 39.69 O ATOM 14492 HA3 GLY B 415 42.201 43.779 96.233 1.00 0.00 H ATOM 14493 HA2 GLY B 415 42.057 42.559 97.520 1.00 0.00 H ATOM 14494 H GLY B 415 39.913 43.722 95.953 1.00 0.00 H ATOM 14495 N ASN B 416 43.406 44.686 98.372 1.00 41.23 N ATOM 14496 CA ASN B 416 43.891 45.623 99.351 1.00 41.17 C ATOM 14497 C ASN B 416 44.702 46.769 98.764 1.00 40.63 C ATOM 14498 O ASN B 416 45.440 47.425 99.483 1.00 40.69 O ATOM 14499 CB ASN B 416 44.697 44.855 100.428 1.00 43.28 C ATOM 14500 CG ASN B 416 45.098 45.752 101.592 1.00 45.48 C ATOM 14501 OD1 ASN B 416 46.310 46.007 101.793 1.00 45.41 O ATOM 14502 ND2 ASN B 416 44.106 46.263 102.330 1.00 45.99 N ATOM 14503 HA ASN B 416 43.021 46.101 99.801 1.00 0.00 H ATOM 14504 HB2 ASN B 416 44.085 44.037 100.809 1.00 0.00 H ATOM 14505 HB3 ASN B 416 45.599 44.449 99.970 1.00 0.00 H ATOM 14506 HD22 ASN B 416 43.119 46.016 102.117 1.00 0.00 H ATOM 14507 HD21 ASN B 416 44.322 46.908 103.117 1.00 0.00 H ATOM 14508 H ASN B 416 44.076 44.118 97.815 1.00 0.00 H ATOM 14509 N GLY B 417 44.549 47.017 97.459 1.00 39.41 N ATOM 14510 CA GLY B 417 45.275 48.108 96.805 1.00 38.18 C ATOM 14511 C GLY B 417 45.696 47.744 95.380 1.00 36.82 C ATOM 14512 O GLY B 417 46.368 46.736 95.166 1.00 35.70 O ATOM 14513 HA3 GLY B 417 46.167 48.337 97.388 1.00 0.00 H ATOM 14514 HA2 GLY B 417 44.631 48.987 96.768 1.00 0.00 H ATOM 14515 H GLY B 417 43.903 46.425 96.899 1.00 0.00 H ATOM 14516 N THR B 418 45.276 48.573 94.427 1.00 36.53 N ATOM 14517 CA THR B 418 45.527 48.383 93.009 1.00 35.63 C ATOM 14518 C THR B 418 46.168 49.616 92.393 1.00 37.04 C ATOM 14519 O THR B 418 45.741 50.751 92.671 1.00 36.85 O ATOM 14520 CB THR B 418 44.201 48.144 92.247 1.00 36.89 C ATOM 14521 OG1 THR B 418 43.479 47.054 92.841 1.00 36.56 O ATOM 14522 CG2 THR B 418 44.476 47.831 90.746 1.00 34.91 C ATOM 14523 HA THR B 418 46.191 47.523 92.923 1.00 0.00 H ATOM 14524 HB THR B 418 43.603 49.053 92.312 1.00 0.00 H ATOM 14525 HG1 THR B 418 42.634 46.911 92.346 1.00 0.00 H ATOM 14526 HG23 THR B 418 45.024 48.660 90.298 1.00 0.00 H ATOM 14527 HG21 THR B 418 45.067 46.919 90.669 1.00 0.00 H ATOM 14528 HG22 THR B 418 43.528 47.696 90.225 1.00 0.00 H ATOM 14529 H THR B 418 44.733 49.411 94.717 1.00 0.00 H ATOM 14530 N TYR B 419 47.190 49.387 91.558 1.00 35.91 N ATOM 14531 CA TYR B 419 47.880 50.446 90.827 1.00 35.39 C ATOM 14532 C TYR B 419 47.927 50.038 89.370 1.00 34.69 C ATOM 14533 O TYR B 419 48.513 49.006 89.015 1.00 34.51 O ATOM 14534 CB TYR B 419 49.304 50.680 91.367 1.00 36.55 C ATOM 14535 CG TYR B 419 49.279 51.209 92.785 1.00 37.78 C ATOM 14536 CD1 TYR B 419 49.303 50.323 93.879 1.00 37.13 C ATOM 14537 CD2 TYR B 419 49.174 52.576 93.041 1.00 36.96 C ATOM 14538 CE1 TYR B 419 49.218 50.762 95.157 1.00 37.43 C ATOM 14539 CE2 TYR B 419 49.102 53.038 94.367 1.00 38.98 C ATOM 14540 CZ TYR B 419 49.119 52.117 95.404 1.00 39.37 C ATOM 14541 OH TYR B 419 49.011 52.518 96.724 1.00 41.60 O ATOM 14542 HA TYR B 419 47.342 51.386 90.951 1.00 0.00 H ATOM 14543 HB3 TYR B 419 49.811 51.403 90.728 1.00 0.00 H ATOM 14544 HB2 TYR B 419 49.849 49.736 91.350 1.00 0.00 H ATOM 14545 HD2 TYR B 419 49.148 53.285 92.214 1.00 0.00 H ATOM 14546 HE2 TYR B 419 49.034 54.105 94.577 1.00 0.00 H ATOM 14547 HE1 TYR B 419 49.228 50.052 95.984 1.00 0.00 H ATOM 14548 HD1 TYR B 419 49.393 49.253 93.692 1.00 0.00 H ATOM 14549 HH TYR B 419 49.043 51.723 97.313 1.00 0.00 H ATOM 14550 H TYR B 419 47.508 48.406 91.424 1.00 0.00 H ATOM 14551 N LEU B 420 47.301 50.865 88.533 1.00 34.48 N ATOM 14552 CA LEU B 420 47.180 50.618 87.132 1.00 32.05 C ATOM 14553 C LEU B 420 47.991 51.578 86.234 1.00 34.13 C ATOM 14554 O LEU B 420 47.988 52.804 86.434 1.00 34.16 O ATOM 14555 CB LEU B 420 45.691 50.654 86.794 1.00 30.46 C ATOM 14556 CG LEU B 420 45.332 50.381 85.316 1.00 33.59 C ATOM 14557 CD1 LEU B 420 45.615 48.897 85.005 1.00 31.78 C ATOM 14558 CD2 LEU B 420 43.807 50.693 85.067 1.00 31.46 C ATOM 14559 HA LEU B 420 47.616 49.642 86.919 1.00 0.00 H ATOM 14560 HB2 LEU B 420 45.191 49.903 87.405 1.00 0.00 H ATOM 14561 HB3 LEU B 420 45.312 51.643 87.054 1.00 0.00 H ATOM 14562 HG LEU B 420 45.932 51.020 84.667 1.00 0.00 H ATOM 14563 HD21 LEU B 420 43.198 50.057 85.709 1.00 0.00 H ATOM 14564 HD22 LEU B 420 43.609 51.740 85.298 1.00 0.00 H ATOM 14565 HD23 LEU B 420 43.563 50.498 84.023 1.00 0.00 H ATOM 14566 HD11 LEU B 420 46.671 48.686 85.175 1.00 0.00 H ATOM 14567 HD12 LEU B 420 45.008 48.268 85.657 1.00 0.00 H ATOM 14568 HD13 LEU B 420 45.366 48.691 83.964 1.00 0.00 H ATOM 14569 H LEU B 420 46.880 51.734 88.920 1.00 0.00 H ATOM 14570 N TYR B 421 48.681 51.032 85.230 1.00 32.95 N ATOM 14571 CA TYR B 421 49.463 51.888 84.313 1.00 34.90 C ATOM 14572 C TYR B 421 49.160 51.612 82.831 1.00 35.15 C ATOM 14573 O TYR B 421 48.608 50.561 82.484 1.00 35.49 O ATOM 14574 CB TYR B 421 50.986 51.686 84.531 1.00 33.67 C ATOM 14575 CG TYR B 421 51.508 50.354 84.031 1.00 32.17 C ATOM 14576 CD1 TYR B 421 51.685 50.117 82.673 1.00 33.11 C ATOM 14577 CD2 TYR B 421 51.787 49.313 84.926 1.00 33.77 C ATOM 14578 CE1 TYR B 421 52.142 48.832 82.204 1.00 33.95 C ATOM 14579 CE2 TYR B 421 52.229 48.041 84.489 1.00 31.81 C ATOM 14580 CZ TYR B 421 52.408 47.810 83.131 1.00 32.94 C ATOM 14581 OH TYR B 421 52.888 46.581 82.693 1.00 33.34 O ATOM 14582 HA TYR B 421 49.169 52.911 84.547 1.00 0.00 H ATOM 14583 HB3 TYR B 421 51.192 51.756 85.599 1.00 0.00 H ATOM 14584 HB2 TYR B 421 51.516 52.481 84.007 1.00 0.00 H ATOM 14585 HD2 TYR B 421 51.660 49.488 85.994 1.00 0.00 H ATOM 14586 HE2 TYR B 421 52.427 47.250 85.212 1.00 0.00 H ATOM 14587 HE1 TYR B 421 52.280 48.655 81.137 1.00 0.00 H ATOM 14588 HD1 TYR B 421 51.476 50.910 81.955 1.00 0.00 H ATOM 14589 HH TYR B 421 52.955 46.587 81.705 1.00 0.00 H ATOM 14590 H TYR B 421 48.668 50.001 85.093 1.00 0.00 H ATOM 14591 N PHE B 422 49.563 52.537 81.962 1.00 34.65 N ATOM 14592 CA PHE B 422 49.369 52.408 80.523 1.00 35.41 C ATOM 14593 C PHE B 422 50.718 52.850 79.983 1.00 36.38 C ATOM 14594 O PHE B 422 51.061 54.045 80.046 1.00 36.11 O ATOM 14595 CB PHE B 422 48.254 53.359 80.044 1.00 36.99 C ATOM 14596 CG PHE B 422 48.016 53.344 78.539 1.00 36.14 C ATOM 14597 CD1 PHE B 422 47.347 52.280 77.934 1.00 39.37 C ATOM 14598 CD2 PHE B 422 48.422 54.404 77.749 1.00 36.45 C ATOM 14599 CE1 PHE B 422 47.078 52.271 76.516 1.00 37.96 C ATOM 14600 CE2 PHE B 422 48.171 54.419 76.339 1.00 37.30 C ATOM 14601 CZ PHE B 422 47.500 53.352 75.727 1.00 37.53 C ATOM 14602 HA PHE B 422 49.070 51.410 80.202 1.00 0.00 H ATOM 14603 HB2 PHE B 422 47.326 53.073 80.539 1.00 0.00 H ATOM 14604 HB3 PHE B 422 48.522 54.374 80.337 1.00 0.00 H ATOM 14605 HD2 PHE B 422 48.943 55.244 78.208 1.00 0.00 H ATOM 14606 HE2 PHE B 422 48.504 55.266 75.738 1.00 0.00 H ATOM 14607 HZ PHE B 422 47.309 53.361 74.654 1.00 0.00 H ATOM 14608 HE1 PHE B 422 46.551 51.432 76.062 1.00 0.00 H ATOM 14609 HD1 PHE B 422 47.021 51.438 78.545 1.00 0.00 H ATOM 14610 H PHE B 422 50.037 53.388 82.326 1.00 0.00 H ATOM 14611 N PHE B 423 51.493 51.887 79.485 1.00 35.50 N ATOM 14612 CA PHE B 423 52.840 52.160 78.987 1.00 35.64 C ATOM 14613 C PHE B 423 52.755 52.517 77.512 1.00 36.58 C ATOM 14614 O PHE B 423 52.303 51.693 76.685 1.00 35.16 O ATOM 14615 CB PHE B 423 53.729 50.933 79.188 1.00 35.85 C ATOM 14616 CG PHE B 423 55.139 51.112 78.704 1.00 36.87 C ATOM 14617 CD1 PHE B 423 56.083 51.742 79.502 1.00 37.04 C ATOM 14618 CD2 PHE B 423 55.521 50.647 77.444 1.00 36.22 C ATOM 14619 CE1 PHE B 423 57.413 51.907 79.053 1.00 35.84 C ATOM 14620 CE2 PHE B 423 56.856 50.802 76.985 1.00 34.89 C ATOM 14621 CZ PHE B 423 57.788 51.431 77.796 1.00 34.28 C ATOM 14622 HA PHE B 423 53.277 52.993 79.537 1.00 0.00 H ATOM 14623 HB2 PHE B 423 53.759 50.702 80.253 1.00 0.00 H ATOM 14624 HB3 PHE B 423 53.285 50.096 78.649 1.00 0.00 H ATOM 14625 HD2 PHE B 423 54.785 50.159 76.805 1.00 0.00 H ATOM 14626 HE2 PHE B 423 57.146 50.429 76.003 1.00 0.00 H ATOM 14627 HZ PHE B 423 58.815 51.554 77.451 1.00 0.00 H ATOM 14628 HE1 PHE B 423 58.145 52.406 79.688 1.00 0.00 H ATOM 14629 HD1 PHE B 423 55.796 52.114 80.486 1.00 0.00 H ATOM 14630 H PHE B 423 51.129 50.913 79.450 1.00 0.00 H ATOM 14631 N ASN B 424 53.154 53.751 77.179 1.00 36.67 N ATOM 14632 CA ASN B 424 53.058 54.184 75.793 1.00 38.20 C ATOM 14633 C ASN B 424 54.279 54.886 75.215 1.00 39.86 C ATOM 14634 O ASN B 424 54.151 55.775 74.356 1.00 38.89 O ATOM 14635 CB ASN B 424 51.775 55.028 75.549 1.00 37.14 C ATOM 14636 CG ASN B 424 51.723 56.328 76.367 1.00 38.81 C ATOM 14637 OD1 ASN B 424 52.484 56.539 77.305 1.00 36.33 O ATOM 14638 ND2 ASN B 424 50.786 57.186 76.020 1.00 39.62 N ATOM 14639 HA ASN B 424 53.001 53.246 75.241 1.00 0.00 H ATOM 14640 HB2 ASN B 424 51.729 55.285 74.491 1.00 0.00 H ATOM 14641 HB3 ASN B 424 50.909 54.421 75.812 1.00 0.00 H ATOM 14642 HD22 ASN B 424 50.158 56.974 75.219 1.00 0.00 H ATOM 14643 HD21 ASN B 424 50.674 58.075 76.547 1.00 0.00 H ATOM 14644 H ASN B 424 53.529 54.395 77.905 1.00 0.00 H ATOM 14645 N HIS B 425 55.461 54.455 75.639 1.00 39.73 N ATOM 14646 CA HIS B 425 56.679 55.049 75.105 1.00 40.14 C ATOM 14647 C HIS B 425 57.250 54.129 74.052 1.00 41.42 C ATOM 14648 O HIS B 425 57.451 52.932 74.281 1.00 40.95 O ATOM 14649 CB HIS B 425 57.766 55.265 76.190 1.00 41.68 C ATOM 14650 CG HIS B 425 59.033 55.862 75.640 1.00 43.01 C ATOM 14651 ND1 HIS B 425 59.109 57.164 75.206 1.00 45.10 N ATOM 14652 CD2 HIS B 425 60.232 55.303 75.335 1.00 44.88 C ATOM 14653 CE1 HIS B 425 60.294 57.388 74.655 1.00 44.37 C ATOM 14654 NE2 HIS B 425 60.998 56.275 74.722 1.00 45.45 N ATOM 14655 HA HIS B 425 56.410 56.023 74.696 1.00 0.00 H ATOM 14656 HB2 HIS B 425 57.368 55.935 76.953 1.00 0.00 H ATOM 14657 HB3 HIS B 425 58.003 54.302 76.642 1.00 0.00 H ATOM 14658 HD2 HIS B 425 60.535 54.275 75.537 1.00 0.00 H ATOM 14659 HE1 HIS B 425 60.629 58.330 74.221 1.00 0.00 H ATOM 14660 H HIS B 425 55.517 53.697 76.349 1.00 0.00 H ATOM 14661 N ARG B 426 57.552 54.701 72.899 1.00 41.73 N ATOM 14662 CA ARG B 426 58.119 53.945 71.802 1.00 42.48 C ATOM 14663 C ARG B 426 59.626 54.159 71.926 1.00 41.98 C ATOM 14664 O ARG B 426 60.094 55.280 71.815 1.00 40.33 O ATOM 14665 CB ARG B 426 57.540 54.483 70.469 1.00 42.40 C ATOM 14666 CG ARG B 426 58.364 54.255 69.197 1.00 45.26 C ATOM 14667 CD ARG B 426 58.194 52.879 68.598 1.00 43.23 C ATOM 14668 NE ARG B 426 58.957 52.715 67.365 1.00 43.15 N ATOM 14669 CZ ARG B 426 58.729 51.740 66.472 1.00 45.11 C ATOM 14670 NH1 ARG B 426 59.492 51.646 65.388 1.00 42.56 N ATOM 14671 NH2 ARG B 426 57.714 50.862 66.643 1.00 41.38 N ATOM 14672 HA ARG B 426 57.885 52.881 71.824 1.00 0.00 H ATOM 14673 HB2 ARG B 426 56.570 54.009 70.319 1.00 0.00 H ATOM 14674 HB3 ARG B 426 57.404 55.559 70.582 1.00 0.00 H ATOM 14675 HG2 ARG B 426 58.061 54.993 68.454 1.00 0.00 H ATOM 14676 HG3 ARG B 426 59.417 54.397 69.440 1.00 0.00 H ATOM 14677 HD2 ARG B 426 57.138 52.718 68.381 1.00 0.00 H ATOM 14678 HD3 ARG B 426 58.532 52.137 69.321 1.00 0.00 H ATOM 14679 HE ARG B 426 59.721 53.392 67.167 1.00 0.00 H ATOM 14680 HH12 ARG B 426 59.318 50.892 64.694 1.00 0.00 H ATOM 14681 HH11 ARG B 426 60.263 52.327 65.234 1.00 0.00 H ATOM 14682 HH22 ARG B 426 57.551 50.112 65.941 1.00 0.00 H ATOM 14683 HH21 ARG B 426 57.096 50.937 67.476 1.00 0.00 H ATOM 14684 H ARG B 426 57.378 55.719 72.777 1.00 0.00 H ATOM 14685 N ALA B 427 60.365 53.081 72.188 1.00 40.71 N ATOM 14686 CA ALA B 427 61.801 53.166 72.354 1.00 41.61 C ATOM 14687 C ALA B 427 62.489 53.753 71.106 1.00 43.15 C ATOM 14688 O ALA B 427 62.196 53.378 69.956 1.00 43.98 O ATOM 14689 CB ALA B 427 62.377 51.798 72.690 1.00 40.79 C ATOM 14690 HA ALA B 427 61.998 53.846 73.183 1.00 0.00 H ATOM 14691 HB1 ALA B 427 61.932 51.436 73.617 1.00 0.00 H ATOM 14692 HB2 ALA B 427 62.153 51.102 71.882 1.00 0.00 H ATOM 14693 HB3 ALA B 427 63.457 51.880 72.811 1.00 0.00 H ATOM 14694 H ALA B 427 59.898 52.156 72.275 1.00 0.00 H ATOM 14695 N SER B 428 63.399 54.687 71.359 1.00 43.90 N ATOM 14696 CA SER B 428 64.125 55.396 70.310 1.00 45.37 C ATOM 14697 C SER B 428 64.963 54.471 69.469 1.00 46.31 C ATOM 14698 O SER B 428 65.210 54.764 68.308 1.00 46.32 O ATOM 14699 CB SER B 428 65.008 56.481 70.924 1.00 44.57 C ATOM 14700 OG SER B 428 65.926 55.884 71.842 1.00 47.18 O ATOM 14701 HA SER B 428 63.382 55.851 69.655 1.00 0.00 H ATOM 14702 HB2 SER B 428 64.384 57.203 71.451 1.00 0.00 H ATOM 14703 HB3 SER B 428 65.562 56.989 70.135 1.00 0.00 H ATOM 14704 HG SER B 428 65.422 55.423 72.558 1.00 0.00 H ATOM 14705 H SER B 428 63.604 54.924 72.351 1.00 0.00 H ATOM 14706 N ASN B 429 65.369 53.336 70.036 1.00 46.96 N ATOM 14707 CA ASN B 429 66.200 52.384 69.316 1.00 46.04 C ATOM 14708 C ASN B 429 65.445 51.128 68.902 1.00 47.01 C ATOM 14709 O ASN B 429 66.073 50.080 68.643 1.00 46.12 O ATOM 14710 CB ASN B 429 67.375 51.971 70.210 1.00 46.16 C ATOM 14711 CG ASN B 429 66.914 51.497 71.608 1.00 46.54 C ATOM 14712 OD1 ASN B 429 65.714 51.325 71.860 1.00 44.49 O ATOM 14713 ND2 ASN B 429 67.869 51.298 72.509 1.00 45.19 N ATOM 14714 HA ASN B 429 66.539 52.880 68.407 1.00 0.00 H ATOM 14715 HB2 ASN B 429 67.915 51.158 69.725 1.00 0.00 H ATOM 14716 HB3 ASN B 429 68.040 52.826 70.332 1.00 0.00 H ATOM 14717 HD22 ASN B 429 68.865 51.455 72.254 1.00 0.00 H ATOM 14718 HD21 ASN B 429 67.621 50.985 73.469 1.00 0.00 H ATOM 14719 H ASN B 429 65.086 53.126 71.014 1.00 0.00 H ATOM 14720 N LEU B 430 64.117 51.208 68.846 1.00 46.04 N ATOM 14721 CA LEU B 430 63.310 50.036 68.491 1.00 46.89 C ATOM 14722 C LEU B 430 63.694 49.540 67.082 1.00 46.25 C ATOM 14723 O LEU B 430 63.778 50.352 66.163 1.00 45.12 O ATOM 14724 CB LEU B 430 61.825 50.439 68.526 1.00 48.97 C ATOM 14725 CG LEU B 430 60.736 49.555 69.160 1.00 50.41 C ATOM 14726 CD1 LEU B 430 59.938 48.942 68.069 1.00 50.54 C ATOM 14727 CD2 LEU B 430 61.304 48.485 70.069 1.00 50.34 C ATOM 14728 HA LEU B 430 63.491 49.228 69.200 1.00 0.00 H ATOM 14729 HB2 LEU B 430 61.784 51.393 69.052 1.00 0.00 H ATOM 14730 HB3 LEU B 430 61.528 50.586 67.488 1.00 0.00 H ATOM 14731 HG LEU B 430 60.108 50.184 69.791 1.00 0.00 H ATOM 14732 HD21 LEU B 430 61.967 47.837 69.496 1.00 0.00 H ATOM 14733 HD22 LEU B 430 61.864 48.956 70.877 1.00 0.00 H ATOM 14734 HD23 LEU B 430 60.489 47.894 70.486 1.00 0.00 H ATOM 14735 HD11 LEU B 430 59.479 49.729 67.470 1.00 0.00 H ATOM 14736 HD12 LEU B 430 60.590 48.338 67.439 1.00 0.00 H ATOM 14737 HD13 LEU B 430 59.160 48.311 68.500 1.00 0.00 H ATOM 14738 H LEU B 430 63.647 52.112 69.056 1.00 0.00 H ATOM 14739 N VAL B 431 63.916 48.238 66.887 1.00 44.89 N ATOM 14740 CA VAL B 431 64.278 47.767 65.550 1.00 44.01 C ATOM 14741 C VAL B 431 63.066 47.348 64.720 1.00 43.59 C ATOM 14742 O VAL B 431 63.176 47.097 63.518 1.00 43.23 O ATOM 14743 CB VAL B 431 65.295 46.600 65.626 1.00 46.00 C ATOM 14744 CG1 VAL B 431 66.583 47.088 66.332 1.00 45.82 C ATOM 14745 CG2 VAL B 431 64.704 45.393 66.431 1.00 46.78 C ATOM 14746 HA VAL B 431 64.741 48.615 65.045 1.00 0.00 H ATOM 14747 HB VAL B 431 65.517 46.272 64.611 1.00 0.00 H ATOM 14748 HG11 VAL B 431 67.016 47.913 65.766 1.00 0.00 H ATOM 14749 HG12 VAL B 431 66.338 47.425 67.339 1.00 0.00 H ATOM 14750 HG13 VAL B 431 67.299 46.268 66.386 1.00 0.00 H ATOM 14751 HG21 VAL B 431 64.465 45.716 67.444 1.00 0.00 H ATOM 14752 HG22 VAL B 431 63.799 45.038 65.938 1.00 0.00 H ATOM 14753 HG23 VAL B 431 65.439 44.589 66.469 1.00 0.00 H ATOM 14754 H VAL B 431 63.833 47.566 67.677 1.00 0.00 H ATOM 14755 N TRP B 432 61.897 47.262 65.357 1.00 42.63 N ATOM 14756 CA TRP B 432 60.656 46.880 64.642 1.00 39.95 C ATOM 14757 C TRP B 432 60.132 48.113 63.912 1.00 39.53 C ATOM 14758 O TRP B 432 60.350 49.254 64.372 1.00 40.27 O ATOM 14759 CB TRP B 432 59.584 46.363 65.647 1.00 38.23 C ATOM 14760 CG TRP B 432 59.902 44.986 66.224 1.00 35.38 C ATOM 14761 CD1 TRP B 432 60.369 44.709 67.487 1.00 35.09 C ATOM 14762 CD2 TRP B 432 59.754 43.716 65.566 1.00 35.59 C ATOM 14763 NE1 TRP B 432 60.502 43.345 67.655 1.00 35.10 N ATOM 14764 CE2 TRP B 432 60.130 42.709 66.505 1.00 35.57 C ATOM 14765 CE3 TRP B 432 59.343 43.326 64.274 1.00 35.72 C ATOM 14766 CZ2 TRP B 432 60.098 41.317 66.200 1.00 34.35 C ATOM 14767 CZ3 TRP B 432 59.304 41.938 63.955 1.00 36.82 C ATOM 14768 CH2 TRP B 432 59.682 40.952 64.936 1.00 37.70 C ATOM 14769 HA TRP B 432 60.868 46.079 63.934 1.00 0.00 H ATOM 14770 HB2 TRP B 432 59.512 47.074 66.470 1.00 0.00 H ATOM 14771 HB3 TRP B 432 58.625 46.308 65.131 1.00 0.00 H ATOM 14772 HE1 TRP B 432 60.834 42.875 68.522 1.00 0.00 H ATOM 14773 HD1 TRP B 432 60.601 45.457 68.245 1.00 0.00 H ATOM 14774 HZ2 TRP B 432 60.391 40.569 66.937 1.00 0.00 H ATOM 14775 HH2 TRP B 432 59.638 39.895 64.674 1.00 0.00 H ATOM 14776 HZ3 TRP B 432 58.986 41.620 62.962 1.00 0.00 H ATOM 14777 HE3 TRP B 432 59.060 44.074 63.533 1.00 0.00 H ATOM 14778 H TRP B 432 61.856 47.467 66.376 1.00 0.00 H ATOM 14779 N PRO B 433 59.396 47.918 62.806 1.00 39.49 N ATOM 14780 CA PRO B 433 58.909 49.111 62.116 1.00 40.07 C ATOM 14781 C PRO B 433 57.993 49.984 62.932 1.00 41.99 C ATOM 14782 O PRO B 433 57.312 49.551 63.872 1.00 42.89 O ATOM 14783 CB PRO B 433 58.210 48.547 60.900 1.00 39.81 C ATOM 14784 CG PRO B 433 57.571 47.235 61.519 1.00 39.45 C ATOM 14785 CD PRO B 433 58.760 46.691 62.259 1.00 38.59 C ATOM 14786 HA PRO B 433 59.730 49.789 61.883 1.00 0.00 H ATOM 14787 HD3 PRO B 433 58.451 46.018 63.059 1.00 0.00 H ATOM 14788 HD2 PRO B 433 59.436 46.165 61.585 1.00 0.00 H ATOM 14789 HG3 PRO B 433 57.226 46.549 60.746 1.00 0.00 H ATOM 14790 HG2 PRO B 433 56.745 47.465 62.192 1.00 0.00 H ATOM 14791 HB2 PRO B 433 57.447 49.227 60.522 1.00 0.00 H ATOM 14792 HB3 PRO B 433 58.915 48.314 60.102 1.00 0.00 H ATOM 14793 N GLU B 434 57.975 51.237 62.527 1.00 43.57 N ATOM 14794 CA GLU B 434 57.193 52.285 63.119 1.00 44.40 C ATOM 14795 C GLU B 434 55.708 51.955 63.250 1.00 41.89 C ATOM 14796 O GLU B 434 55.069 52.295 64.260 1.00 40.65 O ATOM 14797 CB GLU B 434 57.345 53.528 62.263 1.00 48.08 C ATOM 14798 CG GLU B 434 57.358 54.787 63.074 1.00 56.71 C ATOM 14799 CD GLU B 434 58.612 54.879 63.920 1.00 61.68 C ATOM 14800 OE1 GLU B 434 59.704 54.576 63.362 1.00 64.43 O ATOM 14801 OE2 GLU B 434 58.515 55.253 65.126 1.00 64.80 O ATOM 14802 HA GLU B 434 57.566 52.429 64.133 1.00 0.00 H ATOM 14803 HB2 GLU B 434 58.282 53.459 61.710 1.00 0.00 H ATOM 14804 HB3 GLU B 434 56.512 53.573 61.561 1.00 0.00 H ATOM 14805 HG2 GLU B 434 57.318 55.644 62.402 1.00 0.00 H ATOM 14806 HG3 GLU B 434 56.486 54.799 63.728 1.00 0.00 H ATOM 14807 H GLU B 434 58.574 51.487 61.715 1.00 0.00 H ATOM 14808 N TRP B 435 55.144 51.301 62.239 1.00 40.95 N ATOM 14809 CA TRP B 435 53.711 51.016 62.302 1.00 39.79 C ATOM 14810 C TRP B 435 53.306 50.133 63.510 1.00 39.88 C ATOM 14811 O TRP B 435 52.145 50.149 63.923 1.00 37.12 O ATOM 14812 CB TRP B 435 53.198 50.388 61.010 1.00 38.91 C ATOM 14813 CG TRP B 435 53.612 48.970 60.740 1.00 40.88 C ATOM 14814 CD1 TRP B 435 54.612 48.569 59.914 1.00 40.28 C ATOM 14815 CD2 TRP B 435 52.996 47.749 61.245 1.00 41.62 C ATOM 14816 NE1 TRP B 435 54.664 47.196 59.854 1.00 40.73 N ATOM 14817 CE2 TRP B 435 53.693 46.665 60.670 1.00 41.53 C ATOM 14818 CE3 TRP B 435 51.931 47.475 62.127 1.00 41.94 C ATOM 14819 CZ2 TRP B 435 53.370 45.320 60.951 1.00 40.54 C ATOM 14820 CZ3 TRP B 435 51.607 46.122 62.409 1.00 42.18 C ATOM 14821 CH2 TRP B 435 52.338 45.068 61.818 1.00 41.05 C ATOM 14822 HA TRP B 435 53.238 51.989 62.439 1.00 0.00 H ATOM 14823 HB2 TRP B 435 52.109 50.415 61.039 1.00 0.00 H ATOM 14824 HB3 TRP B 435 53.553 51.000 60.181 1.00 0.00 H ATOM 14825 HE1 TRP B 435 55.334 46.645 59.280 1.00 0.00 H ATOM 14826 HD1 TRP B 435 55.280 49.241 59.374 1.00 0.00 H ATOM 14827 HZ2 TRP B 435 53.926 44.503 60.491 1.00 0.00 H ATOM 14828 HH2 TRP B 435 52.077 44.037 62.055 1.00 0.00 H ATOM 14829 HZ3 TRP B 435 50.786 45.894 63.089 1.00 0.00 H ATOM 14830 HE3 TRP B 435 51.366 48.288 62.584 1.00 0.00 H ATOM 14831 H TRP B 435 55.710 50.999 61.421 1.00 0.00 H ATOM 14832 N MET B 436 54.256 49.386 64.073 1.00 37.62 N ATOM 14833 CA MET B 436 53.929 48.524 65.203 1.00 38.07 C ATOM 14834 C MET B 436 53.720 49.266 66.525 1.00 36.80 C ATOM 14835 O MET B 436 53.025 48.737 67.423 1.00 36.14 O ATOM 14836 CB MET B 436 54.983 47.418 65.321 1.00 37.86 C ATOM 14837 CG MET B 436 54.866 46.439 64.116 1.00 35.45 C ATOM 14838 SD MET B 436 56.158 45.190 64.124 1.00 37.79 S ATOM 14839 CE MET B 436 55.366 43.920 65.367 1.00 35.71 C ATOM 14840 HA MET B 436 52.956 48.080 64.995 1.00 0.00 H ATOM 14841 HB2 MET B 436 55.977 47.866 65.328 1.00 0.00 H ATOM 14842 HB3 MET B 436 54.827 46.868 66.249 1.00 0.00 H ATOM 14843 HG2 MET B 436 54.937 47.011 63.191 1.00 0.00 H ATOM 14844 HG3 MET B 436 53.897 45.942 64.161 1.00 0.00 H ATOM 14845 HE1 MET B 436 55.207 44.406 66.330 1.00 0.00 H ATOM 14846 HE2 MET B 436 54.411 43.574 64.972 1.00 0.00 H ATOM 14847 HE3 MET B 436 56.037 43.071 65.494 1.00 0.00 H ATOM 14848 H MET B 436 55.229 49.418 63.707 1.00 0.00 H ATOM 14849 N GLY B 437 54.274 50.489 66.630 1.00 35.23 N ATOM 14850 CA GLY B 437 54.104 51.295 67.847 1.00 33.61 C ATOM 14851 C GLY B 437 54.786 50.778 69.122 1.00 34.17 C ATOM 14852 O GLY B 437 55.976 50.421 69.116 1.00 34.46 O ATOM 14853 HA3 GLY B 437 53.035 51.365 68.050 1.00 0.00 H ATOM 14854 HA2 GLY B 437 54.499 52.290 67.642 1.00 0.00 H ATOM 14855 H GLY B 437 54.831 50.869 65.838 1.00 0.00 H ATOM 14856 N VAL B 438 54.023 50.725 70.216 1.00 33.48 N ATOM 14857 CA VAL B 438 54.498 50.287 71.518 1.00 32.88 C ATOM 14858 C VAL B 438 53.986 48.861 71.653 1.00 33.78 C ATOM 14859 O VAL B 438 52.848 48.581 72.098 1.00 34.58 O ATOM 14860 CB VAL B 438 53.921 51.184 72.581 1.00 34.45 C ATOM 14861 CG1 VAL B 438 54.475 50.786 73.966 1.00 33.05 C ATOM 14862 CG2 VAL B 438 54.252 52.672 72.209 1.00 32.50 C ATOM 14863 HA VAL B 438 55.582 50.329 71.623 1.00 0.00 H ATOM 14864 HB VAL B 438 52.838 51.076 72.633 1.00 0.00 H ATOM 14865 HG11 VAL B 438 54.203 49.753 74.182 1.00 0.00 H ATOM 14866 HG12 VAL B 438 55.561 50.884 73.964 1.00 0.00 H ATOM 14867 HG13 VAL B 438 54.051 51.441 74.727 1.00 0.00 H ATOM 14868 HG21 VAL B 438 55.333 52.801 72.159 1.00 0.00 H ATOM 14869 HG22 VAL B 438 53.811 52.910 71.241 1.00 0.00 H ATOM 14870 HG23 VAL B 438 53.841 53.335 72.970 1.00 0.00 H ATOM 14871 H VAL B 438 53.028 51.015 70.132 1.00 0.00 H ATOM 14872 N ILE B 439 54.873 47.981 71.247 1.00 32.99 N ATOM 14873 CA ILE B 439 54.649 46.553 71.129 1.00 33.97 C ATOM 14874 C ILE B 439 54.558 45.705 72.395 1.00 32.91 C ATOM 14875 O ILE B 439 55.200 45.992 73.407 1.00 34.41 O ATOM 14876 CB ILE B 439 55.742 45.994 70.221 1.00 33.04 C ATOM 14877 CG1 ILE B 439 55.742 46.814 68.901 1.00 34.65 C ATOM 14878 CG2 ILE B 439 55.543 44.501 69.936 1.00 31.68 C ATOM 14879 CD1 ILE B 439 56.994 46.555 68.002 1.00 32.03 C ATOM 14880 HA ILE B 439 53.636 46.474 70.734 1.00 0.00 H ATOM 14881 HB ILE B 439 56.705 46.085 70.723 1.00 0.00 H ATOM 14882 HG12 ILE B 439 54.849 46.552 68.333 1.00 0.00 H ATOM 14883 HG13 ILE B 439 55.712 47.874 69.154 1.00 0.00 H ATOM 14884 HD11 ILE B 439 57.896 46.823 68.552 1.00 0.00 H ATOM 14885 HD12 ILE B 439 57.033 45.500 67.730 1.00 0.00 H ATOM 14886 HD13 ILE B 439 56.923 47.162 67.099 1.00 0.00 H ATOM 14887 HG21 ILE B 439 55.563 43.947 70.875 1.00 0.00 H ATOM 14888 HG22 ILE B 439 54.582 44.351 69.445 1.00 0.00 H ATOM 14889 HG23 ILE B 439 56.343 44.147 69.287 1.00 0.00 H ATOM 14890 H ILE B 439 55.815 48.338 70.989 1.00 0.00 H ATOM 14891 N HIS B 440 53.742 44.654 72.296 1.00 31.87 N ATOM 14892 CA HIS B 440 53.579 43.680 73.353 1.00 30.26 C ATOM 14893 C HIS B 440 54.990 43.232 73.718 1.00 30.25 C ATOM 14894 O HIS B 440 55.755 42.833 72.856 1.00 31.29 O ATOM 14895 CB HIS B 440 52.794 42.498 72.805 1.00 29.86 C ATOM 14896 CG HIS B 440 52.288 41.551 73.850 1.00 29.90 C ATOM 14897 ND1 HIS B 440 51.456 41.952 74.876 1.00 27.66 N ATOM 14898 CD2 HIS B 440 52.436 40.207 73.983 1.00 29.67 C ATOM 14899 CE1 HIS B 440 51.107 40.890 75.590 1.00 29.91 C ATOM 14900 NE2 HIS B 440 51.684 39.820 75.071 1.00 29.62 N ATOM 14901 HA HIS B 440 53.050 44.083 74.216 1.00 0.00 H ATOM 14902 HB2 HIS B 440 51.938 42.884 72.252 1.00 0.00 H ATOM 14903 HB3 HIS B 440 53.442 41.943 72.127 1.00 0.00 H ATOM 14904 HD2 HIS B 440 53.037 39.556 73.348 1.00 0.00 H ATOM 14905 HE1 HIS B 440 50.452 40.898 76.461 1.00 0.00 H ATOM 14906 H HIS B 440 53.198 44.529 71.418 1.00 0.00 H ATOM 14907 N GLY B 441 55.334 43.341 74.992 1.00 31.04 N ATOM 14908 CA GLY B 441 56.637 42.888 75.449 1.00 32.89 C ATOM 14909 C GLY B 441 57.742 43.941 75.534 1.00 33.90 C ATOM 14910 O GLY B 441 58.777 43.737 76.166 1.00 32.17 O ATOM 14911 HA3 GLY B 441 56.975 42.110 74.765 1.00 0.00 H ATOM 14912 HA2 GLY B 441 56.508 42.464 76.445 1.00 0.00 H ATOM 14913 H GLY B 441 54.665 43.755 75.672 1.00 0.00 H ATOM 14914 N TYR B 442 57.497 45.104 74.958 1.00 34.33 N ATOM 14915 CA TYR B 442 58.566 46.081 74.917 1.00 34.40 C ATOM 14916 C TYR B 442 58.708 47.049 76.067 1.00 34.94 C ATOM 14917 O TYR B 442 59.562 47.980 76.018 1.00 35.56 O ATOM 14918 CB TYR B 442 58.585 46.748 73.519 1.00 33.84 C ATOM 14919 CG TYR B 442 59.146 45.764 72.527 1.00 32.77 C ATOM 14920 CD1 TYR B 442 58.362 44.698 72.023 1.00 32.53 C ATOM 14921 CD2 TYR B 442 60.520 45.741 72.268 1.00 33.89 C ATOM 14922 CE1 TYR B 442 58.952 43.636 71.309 1.00 33.15 C ATOM 14923 CE2 TYR B 442 61.114 44.688 71.563 1.00 33.07 C ATOM 14924 CZ TYR B 442 60.332 43.648 71.097 1.00 32.80 C ATOM 14925 OH TYR B 442 60.981 42.620 70.475 1.00 34.34 O ATOM 14926 HA TYR B 442 59.478 45.507 75.080 1.00 0.00 H ATOM 14927 HB3 TYR B 442 59.210 47.640 73.546 1.00 0.00 H ATOM 14928 HB2 TYR B 442 57.571 47.025 73.230 1.00 0.00 H ATOM 14929 HD2 TYR B 442 61.143 46.562 72.623 1.00 0.00 H ATOM 14930 HE2 TYR B 442 62.189 44.688 71.382 1.00 0.00 H ATOM 14931 HE1 TYR B 442 58.341 42.818 70.928 1.00 0.00 H ATOM 14932 HD1 TYR B 442 57.285 44.699 72.190 1.00 0.00 H ATOM 14933 HH TYR B 442 61.626 42.210 71.104 1.00 0.00 H ATOM 14934 H TYR B 442 56.565 45.312 74.546 1.00 0.00 H ATOM 14935 N GLU B 443 57.923 46.816 77.129 1.00 33.23 N ATOM 14936 CA GLU B 443 58.116 47.592 78.361 1.00 32.47 C ATOM 14937 C GLU B 443 59.116 46.791 79.261 1.00 33.67 C ATOM 14938 O GLU B 443 59.752 47.345 80.185 1.00 31.28 O ATOM 14939 CB GLU B 443 56.794 47.814 79.131 1.00 32.40 C ATOM 14940 CG GLU B 443 56.367 46.662 80.106 1.00 30.57 C ATOM 14941 CD GLU B 443 56.050 45.334 79.390 1.00 32.29 C ATOM 14942 OE1 GLU B 443 55.866 45.335 78.142 1.00 29.21 O ATOM 14943 OE2 GLU B 443 55.943 44.297 80.077 1.00 32.80 O ATOM 14944 HA GLU B 443 58.499 48.579 78.103 1.00 0.00 H ATOM 14945 HB2 GLU B 443 56.898 48.727 79.718 1.00 0.00 H ATOM 14946 HB3 GLU B 443 55.998 47.944 78.398 1.00 0.00 H ATOM 14947 HG2 GLU B 443 57.180 46.488 80.811 1.00 0.00 H ATOM 14948 HG3 GLU B 443 55.478 46.982 80.649 1.00 0.00 H ATOM 14949 H GLU B 443 57.181 46.089 77.080 1.00 0.00 H ATOM 14950 N ILE B 444 59.301 45.493 78.957 1.00 33.00 N ATOM 14951 CA ILE B 444 60.160 44.654 79.792 1.00 33.60 C ATOM 14952 C ILE B 444 61.580 45.275 79.962 1.00 35.78 C ATOM 14953 O ILE B 444 62.056 45.493 81.102 1.00 36.50 O ATOM 14954 CB ILE B 444 60.205 43.169 79.209 1.00 33.21 C ATOM 14955 CG1 ILE B 444 58.791 42.537 79.306 1.00 31.38 C ATOM 14956 CG2 ILE B 444 61.217 42.325 80.033 1.00 34.60 C ATOM 14957 CD1 ILE B 444 58.631 41.163 78.679 1.00 27.99 C ATOM 14958 HA ILE B 444 59.734 44.604 80.794 1.00 0.00 H ATOM 14959 HB ILE B 444 60.519 43.191 78.165 1.00 0.00 H ATOM 14960 HG12 ILE B 444 58.534 42.454 80.362 1.00 0.00 H ATOM 14961 HG13 ILE B 444 58.090 43.212 78.815 1.00 0.00 H ATOM 14962 HD11 ILE B 444 58.865 41.221 77.616 1.00 0.00 H ATOM 14963 HD12 ILE B 444 59.310 40.462 79.164 1.00 0.00 H ATOM 14964 HD13 ILE B 444 57.603 40.824 78.808 1.00 0.00 H ATOM 14965 HG21 ILE B 444 62.207 42.776 79.962 1.00 0.00 H ATOM 14966 HG22 ILE B 444 60.902 42.299 81.076 1.00 0.00 H ATOM 14967 HG23 ILE B 444 61.249 41.310 79.637 1.00 0.00 H ATOM 14968 H ILE B 444 58.831 45.085 78.124 1.00 0.00 H ATOM 14969 N GLU B 445 62.218 45.607 78.840 1.00 35.74 N ATOM 14970 CA GLU B 445 63.547 46.231 78.872 1.00 36.48 C ATOM 14971 C GLU B 445 63.608 47.449 79.801 1.00 36.58 C ATOM 14972 O GLU B 445 64.651 47.713 80.418 1.00 36.95 O ATOM 14973 CB GLU B 445 63.987 46.604 77.431 1.00 38.05 C ATOM 14974 CG GLU B 445 63.047 47.566 76.674 1.00 36.84 C ATOM 14975 CD GLU B 445 63.159 47.414 75.161 1.00 38.21 C ATOM 14976 OE1 GLU B 445 62.914 46.306 74.631 1.00 36.12 O ATOM 14977 OE2 GLU B 445 63.505 48.409 74.484 1.00 38.58 O ATOM 14978 HA GLU B 445 64.243 45.501 79.284 1.00 0.00 H ATOM 14979 HB2 GLU B 445 64.969 47.073 77.491 1.00 0.00 H ATOM 14980 HB3 GLU B 445 64.060 45.683 76.853 1.00 0.00 H ATOM 14981 HG2 GLU B 445 62.019 47.359 76.972 1.00 0.00 H ATOM 14982 HG3 GLU B 445 63.303 48.591 76.943 1.00 0.00 H ATOM 14983 H GLU B 445 61.765 45.420 77.923 1.00 0.00 H ATOM 14984 N PHE B 446 62.514 48.189 79.941 1.00 35.94 N ATOM 14985 CA PHE B 446 62.528 49.327 80.852 1.00 36.57 C ATOM 14986 C PHE B 446 62.432 48.826 82.298 1.00 38.25 C ATOM 14987 O PHE B 446 63.080 49.389 83.210 1.00 38.52 O ATOM 14988 CB PHE B 446 61.350 50.282 80.557 1.00 37.07 C ATOM 14989 CG PHE B 446 61.615 51.186 79.383 1.00 38.28 C ATOM 14990 CD1 PHE B 446 61.426 50.723 78.067 1.00 36.09 C ATOM 14991 CD2 PHE B 446 62.248 52.446 79.592 1.00 38.06 C ATOM 14992 CE1 PHE B 446 61.875 51.479 76.964 1.00 36.69 C ATOM 14993 CE2 PHE B 446 62.701 53.216 78.498 1.00 37.13 C ATOM 14994 CZ PHE B 446 62.524 52.741 77.194 1.00 38.12 C ATOM 14995 HA PHE B 446 63.460 49.873 80.710 1.00 0.00 H ATOM 14996 HB2 PHE B 446 60.462 49.686 80.345 1.00 0.00 H ATOM 14997 HB3 PHE B 446 61.171 50.898 81.438 1.00 0.00 H ATOM 14998 HD2 PHE B 446 62.384 52.819 80.607 1.00 0.00 H ATOM 14999 HE2 PHE B 446 63.187 54.177 78.669 1.00 0.00 H ATOM 15000 HZ PHE B 446 62.880 53.330 76.349 1.00 0.00 H ATOM 15001 HE1 PHE B 446 61.731 51.110 75.948 1.00 0.00 H ATOM 15002 HD1 PHE B 446 60.927 49.769 77.898 1.00 0.00 H ATOM 15003 H PHE B 446 61.653 47.958 79.405 1.00 0.00 H ATOM 15004 N VAL B 447 61.635 47.761 82.507 1.00 37.09 N ATOM 15005 CA VAL B 447 61.441 47.198 83.844 1.00 34.83 C ATOM 15006 C VAL B 447 62.764 46.578 84.316 1.00 35.59 C ATOM 15007 O VAL B 447 63.098 46.737 85.474 1.00 33.95 O ATOM 15008 CB VAL B 447 60.289 46.130 83.845 1.00 33.76 C ATOM 15009 CG1 VAL B 447 60.322 45.262 85.124 1.00 32.78 C ATOM 15010 CG2 VAL B 447 58.923 46.858 83.703 1.00 31.24 C ATOM 15011 HA VAL B 447 61.145 47.991 84.531 1.00 0.00 H ATOM 15012 HB VAL B 447 60.432 45.456 83.000 1.00 0.00 H ATOM 15013 HG11 VAL B 447 61.277 44.740 85.183 1.00 0.00 H ATOM 15014 HG12 VAL B 447 60.201 45.901 85.999 1.00 0.00 H ATOM 15015 HG13 VAL B 447 59.511 44.535 85.089 1.00 0.00 H ATOM 15016 HG21 VAL B 447 58.790 47.544 84.540 1.00 0.00 H ATOM 15017 HG22 VAL B 447 58.906 47.417 82.767 1.00 0.00 H ATOM 15018 HG23 VAL B 447 58.119 46.122 83.703 1.00 0.00 H ATOM 15019 H VAL B 447 61.145 47.328 81.698 1.00 0.00 H ATOM 15020 N PHE B 448 63.506 45.904 83.419 1.00 35.76 N ATOM 15021 CA PHE B 448 64.790 45.316 83.802 1.00 37.08 C ATOM 15022 C PHE B 448 65.996 46.306 83.693 1.00 39.10 C ATOM 15023 O PHE B 448 67.142 45.916 83.861 1.00 38.86 O ATOM 15024 CB PHE B 448 65.073 44.041 83.001 1.00 36.04 C ATOM 15025 CG PHE B 448 64.365 42.845 83.543 1.00 36.73 C ATOM 15026 CD1 PHE B 448 62.968 42.680 83.334 1.00 35.34 C ATOM 15027 CD2 PHE B 448 65.054 41.912 84.328 1.00 35.37 C ATOM 15028 CE1 PHE B 448 62.262 41.605 83.895 1.00 36.30 C ATOM 15029 CE2 PHE B 448 64.367 40.818 84.902 1.00 36.59 C ATOM 15030 CZ PHE B 448 62.958 40.664 84.685 1.00 35.91 C ATOM 15031 HA PHE B 448 64.693 45.065 84.858 1.00 0.00 H ATOM 15032 HB2 PHE B 448 64.752 44.198 81.971 1.00 0.00 H ATOM 15033 HB3 PHE B 448 66.146 43.849 83.020 1.00 0.00 H ATOM 15034 HD2 PHE B 448 66.124 42.030 84.497 1.00 0.00 H ATOM 15035 HE2 PHE B 448 64.908 40.092 85.509 1.00 0.00 H ATOM 15036 HZ PHE B 448 62.426 39.823 85.129 1.00 0.00 H ATOM 15037 HE1 PHE B 448 61.191 41.498 83.723 1.00 0.00 H ATOM 15038 HD1 PHE B 448 62.432 43.407 82.723 1.00 0.00 H ATOM 15039 H PHE B 448 63.163 45.800 82.443 1.00 0.00 H ATOM 15040 N GLY B 449 65.709 47.581 83.426 1.00 39.34 N ATOM 15041 CA GLY B 449 66.755 48.579 83.362 1.00 41.22 C ATOM 15042 C GLY B 449 67.787 48.578 82.246 1.00 42.63 C ATOM 15043 O GLY B 449 68.847 49.154 82.456 1.00 42.75 O ATOM 15044 HA3 GLY B 449 67.312 48.502 84.296 1.00 0.00 H ATOM 15045 HA2 GLY B 449 66.255 49.546 83.318 1.00 0.00 H ATOM 15046 H GLY B 449 64.721 47.861 83.262 1.00 0.00 H ATOM 15047 N LEU B 450 67.516 47.959 81.094 1.00 42.24 N ATOM 15048 CA LEU B 450 68.469 47.960 79.976 1.00 44.02 C ATOM 15049 C LEU B 450 68.868 49.409 79.554 1.00 45.07 C ATOM 15050 O LEU B 450 70.006 49.657 79.136 1.00 45.88 O ATOM 15051 CB LEU B 450 67.906 47.191 78.778 1.00 41.74 C ATOM 15052 CG LEU B 450 67.875 45.657 78.892 1.00 43.23 C ATOM 15053 CD1 LEU B 450 69.205 45.117 78.717 1.00 45.20 C ATOM 15054 CD2 LEU B 450 67.369 45.208 80.273 1.00 42.54 C ATOM 15055 HA LEU B 450 69.371 47.456 80.322 1.00 0.00 H ATOM 15056 HB2 LEU B 450 66.883 47.531 78.619 1.00 0.00 H ATOM 15057 HB3 LEU B 450 68.512 47.445 77.908 1.00 0.00 H ATOM 15058 HG LEU B 450 67.201 45.291 78.117 1.00 0.00 H ATOM 15059 HD21 LEU B 450 68.030 45.600 81.046 1.00 0.00 H ATOM 15060 HD22 LEU B 450 66.359 45.588 80.430 1.00 0.00 H ATOM 15061 HD23 LEU B 450 67.360 44.119 80.319 1.00 0.00 H ATOM 15062 HD11 LEU B 450 69.582 45.395 77.733 1.00 0.00 H ATOM 15063 HD12 LEU B 450 69.863 45.520 79.487 1.00 0.00 H ATOM 15064 HD13 LEU B 450 69.169 44.031 78.800 1.00 0.00 H ATOM 15065 H LEU B 450 66.608 47.464 80.986 1.00 0.00 H ATOM 15066 N PRO B 451 67.940 50.374 79.658 1.00 45.63 N ATOM 15067 CA PRO B 451 68.314 51.742 79.277 1.00 46.96 C ATOM 15068 C PRO B 451 69.450 52.362 80.121 1.00 48.46 C ATOM 15069 O PRO B 451 69.891 53.465 79.806 1.00 48.49 O ATOM 15070 CB PRO B 451 67.007 52.525 79.442 1.00 45.38 C ATOM 15071 CG PRO B 451 65.963 51.489 79.017 1.00 45.39 C ATOM 15072 CD PRO B 451 66.475 50.250 79.778 1.00 46.46 C ATOM 15073 HA PRO B 451 68.725 51.763 78.268 1.00 0.00 H ATOM 15074 HD3 PRO B 451 66.163 50.274 80.822 1.00 0.00 H ATOM 15075 HD2 PRO B 451 66.119 49.330 79.315 1.00 0.00 H ATOM 15076 HG3 PRO B 451 65.968 51.330 77.939 1.00 0.00 H ATOM 15077 HG2 PRO B 451 64.960 51.773 79.337 1.00 0.00 H ATOM 15078 HB2 PRO B 451 66.859 52.837 80.476 1.00 0.00 H ATOM 15079 HB3 PRO B 451 66.984 53.401 78.793 1.00 0.00 H ATOM 15080 N LEU B 452 69.891 51.702 81.199 1.00 48.57 N ATOM 15081 CA LEU B 452 70.965 52.271 82.013 1.00 49.34 C ATOM 15082 C LEU B 452 72.323 51.895 81.449 1.00 49.71 C ATOM 15083 O LEU B 452 73.317 52.424 81.914 1.00 50.76 O ATOM 15084 CB LEU B 452 70.942 51.823 83.487 1.00 46.92 C ATOM 15085 CG LEU B 452 69.675 51.782 84.355 1.00 50.68 C ATOM 15086 CD1 LEU B 452 70.115 51.694 85.845 1.00 46.75 C ATOM 15087 CD2 LEU B 452 68.719 52.954 84.093 1.00 47.22 C ATOM 15088 HA LEU B 452 70.796 53.347 81.980 1.00 0.00 H ATOM 15089 HB2 LEU B 452 71.337 50.807 83.493 1.00 0.00 H ATOM 15090 HB3 LEU B 452 71.635 52.484 84.007 1.00 0.00 H ATOM 15091 HG LEU B 452 69.092 50.900 84.088 1.00 0.00 H ATOM 15092 HD21 LEU B 452 69.231 53.893 84.304 1.00 0.00 H ATOM 15093 HD22 LEU B 452 68.403 52.937 83.050 1.00 0.00 H ATOM 15094 HD23 LEU B 452 67.847 52.861 84.740 1.00 0.00 H ATOM 15095 HD11 LEU B 452 70.704 50.790 85.996 1.00 0.00 H ATOM 15096 HD12 LEU B 452 70.716 52.567 86.097 1.00 0.00 H ATOM 15097 HD13 LEU B 452 69.231 51.664 86.482 1.00 0.00 H ATOM 15098 H LEU B 452 69.471 50.786 81.457 1.00 0.00 H ATOM 15099 N VAL B 453 72.384 50.983 80.482 1.00 50.82 N ATOM 15100 CA VAL B 453 73.676 50.642 79.920 1.00 52.60 C ATOM 15101 C VAL B 453 73.872 51.402 78.604 1.00 53.60 C ATOM 15102 O VAL B 453 73.121 51.258 77.617 1.00 53.07 O ATOM 15103 CB VAL B 453 73.887 49.086 79.754 1.00 53.36 C ATOM 15104 CG1 VAL B 453 72.735 48.309 80.397 1.00 54.23 C ATOM 15105 CG2 VAL B 453 74.104 48.714 78.317 1.00 53.25 C ATOM 15106 HA VAL B 453 74.447 50.953 80.625 1.00 0.00 H ATOM 15107 HB VAL B 453 74.796 48.804 80.285 1.00 0.00 H ATOM 15108 HG11 VAL B 453 72.687 48.546 81.460 1.00 0.00 H ATOM 15109 HG12 VAL B 453 71.797 48.590 79.918 1.00 0.00 H ATOM 15110 HG13 VAL B 453 72.904 47.240 80.269 1.00 0.00 H ATOM 15111 HG21 VAL B 453 73.234 49.010 77.731 1.00 0.00 H ATOM 15112 HG22 VAL B 453 74.989 49.226 77.940 1.00 0.00 H ATOM 15113 HG23 VAL B 453 74.246 47.636 78.239 1.00 0.00 H ATOM 15114 H VAL B 453 71.519 50.522 80.135 1.00 0.00 H ATOM 15115 N LYS B 454 74.894 52.244 78.618 1.00 54.47 N ATOM 15116 CA LYS B 454 75.229 53.098 77.474 1.00 56.24 C ATOM 15117 C LYS B 454 75.321 52.423 76.108 1.00 55.04 C ATOM 15118 O LYS B 454 74.710 52.869 75.150 1.00 54.34 O ATOM 15119 CB LYS B 454 76.527 53.864 77.788 1.00 59.46 C ATOM 15120 CG LYS B 454 76.302 55.217 78.515 1.00 63.12 C ATOM 15121 CD LYS B 454 75.419 55.154 79.809 1.00 65.22 C ATOM 15122 CE LYS B 454 75.199 56.581 80.384 1.00 66.75 C ATOM 15123 NZ LYS B 454 74.169 56.644 81.448 1.00 65.58 N ATOM 15124 HA LYS B 454 74.375 53.765 77.361 1.00 0.00 H ATOM 15125 HB2 LYS B 454 77.152 53.234 78.421 1.00 0.00 H ATOM 15126 HB3 LYS B 454 77.045 54.061 76.849 1.00 0.00 H ATOM 15127 HG2 LYS B 454 77.278 55.614 78.794 1.00 0.00 H ATOM 15128 HG3 LYS B 454 75.821 55.899 77.814 1.00 0.00 H ATOM 15129 HD2 LYS B 454 74.453 54.712 79.564 1.00 0.00 H ATOM 15130 HD3 LYS B 454 75.920 54.538 80.556 1.00 0.00 H ATOM 15131 HE2 LYS B 454 74.893 57.237 79.569 1.00 0.00 H ATOM 15132 HE3 LYS B 454 76.143 56.935 80.798 1.00 0.00 H ATOM 15133 HZ1 LYS B 454 73.258 56.320 81.066 1.00 0.00 H ATOM 15134 HZ2 LYS B 454 74.452 56.031 82.239 1.00 0.00 H ATOM 15135 HZ3 LYS B 454 74.077 57.624 81.782 1.00 0.00 H ATOM 15136 H LYS B 454 75.482 52.302 79.474 1.00 0.00 H ATOM 15137 N GLU B 455 76.071 51.344 76.009 1.00 55.09 N ATOM 15138 CA GLU B 455 76.181 50.678 74.733 1.00 56.89 C ATOM 15139 C GLU B 455 74.823 50.333 74.130 1.00 56.89 C ATOM 15140 O GLU B 455 74.736 50.066 72.939 1.00 57.69 O ATOM 15141 CB GLU B 455 76.996 49.396 74.877 1.00 59.25 C ATOM 15142 CG GLU B 455 78.223 49.548 75.757 1.00 64.77 C ATOM 15143 CD GLU B 455 77.883 49.567 77.252 1.00 67.49 C ATOM 15144 OE1 GLU B 455 77.756 48.461 77.841 1.00 68.72 O ATOM 15145 OE2 GLU B 455 77.736 50.681 77.831 1.00 68.61 O ATOM 15146 HA GLU B 455 76.680 51.376 74.060 1.00 0.00 H ATOM 15147 HB2 GLU B 455 76.355 48.627 75.309 1.00 0.00 H ATOM 15148 HB3 GLU B 455 77.320 49.081 73.885 1.00 0.00 H ATOM 15149 HG2 GLU B 455 78.897 48.713 75.563 1.00 0.00 H ATOM 15150 HG3 GLU B 455 78.722 50.483 75.501 1.00 0.00 H ATOM 15151 H GLU B 455 76.577 50.977 76.840 1.00 0.00 H ATOM 15152 N LEU B 456 73.754 50.307 74.920 1.00 56.25 N ATOM 15153 CA LEU B 456 72.475 49.931 74.325 1.00 55.92 C ATOM 15154 C LEU B 456 71.811 51.082 73.579 1.00 56.64 C ATOM 15155 O LEU B 456 70.811 50.898 72.899 1.00 57.68 O ATOM 15156 CB LEU B 456 71.540 49.316 75.376 1.00 54.67 C ATOM 15157 CG LEU B 456 71.957 47.915 75.856 1.00 53.88 C ATOM 15158 CD1 LEU B 456 70.830 47.283 76.687 1.00 53.29 C ATOM 15159 CD2 LEU B 456 72.302 47.039 74.658 1.00 50.64 C ATOM 15160 HA LEU B 456 72.685 49.169 73.575 1.00 0.00 H ATOM 15161 HB2 LEU B 456 71.515 49.979 76.240 1.00 0.00 H ATOM 15162 HB3 LEU B 456 70.541 49.246 74.945 1.00 0.00 H ATOM 15163 HG LEU B 456 72.840 48.001 76.489 1.00 0.00 H ATOM 15164 HD21 LEU B 456 71.430 46.953 74.009 1.00 0.00 H ATOM 15165 HD22 LEU B 456 73.125 47.490 74.105 1.00 0.00 H ATOM 15166 HD23 LEU B 456 72.596 46.049 75.006 1.00 0.00 H ATOM 15167 HD11 LEU B 456 70.623 47.911 77.553 1.00 0.00 H ATOM 15168 HD12 LEU B 456 69.932 47.199 76.075 1.00 0.00 H ATOM 15169 HD13 LEU B 456 71.138 46.292 77.020 1.00 0.00 H ATOM 15170 H LEU B 456 73.827 50.547 75.929 1.00 0.00 H ATOM 15171 N ASN B 457 72.364 52.278 73.721 1.00 57.15 N ATOM 15172 CA ASN B 457 71.882 53.412 72.958 1.00 57.17 C ATOM 15173 C ASN B 457 70.510 53.960 73.262 1.00 55.85 C ATOM 15174 O ASN B 457 69.760 54.211 72.309 1.00 55.93 O ATOM 15175 CB ASN B 457 71.869 53.075 71.453 1.00 59.94 C ATOM 15176 CG ASN B 457 73.258 52.805 70.865 1.00 62.04 C ATOM 15177 OD1 ASN B 457 73.379 52.207 69.778 1.00 63.19 O ATOM 15178 ND2 ASN B 457 74.301 53.249 71.559 1.00 62.92 N ATOM 15179 HA ASN B 457 72.591 54.184 73.258 1.00 0.00 H ATOM 15180 HB2 ASN B 457 71.255 52.187 71.305 1.00 0.00 H ATOM 15181 HB3 ASN B 457 71.426 53.914 70.917 1.00 0.00 H ATOM 15182 HD22 ASN B 457 74.152 53.743 72.462 1.00 0.00 H ATOM 15183 HD21 ASN B 457 75.266 53.102 71.199 1.00 0.00 H ATOM 15184 H ASN B 457 73.153 52.404 74.387 1.00 0.00 H ATOM 15185 N TYR B 458 70.133 54.122 74.521 1.00 53.10 N ATOM 15186 CA TYR B 458 68.827 54.745 74.768 1.00 50.83 C ATOM 15187 C TYR B 458 69.109 56.223 75.015 1.00 51.08 C ATOM 15188 O TYR B 458 70.257 56.617 75.217 1.00 51.94 O ATOM 15189 CB TYR B 458 68.120 54.155 76.006 1.00 48.55 C ATOM 15190 CG TYR B 458 67.617 52.734 75.802 1.00 45.30 C ATOM 15191 CD1 TYR B 458 68.479 51.632 75.950 1.00 44.86 C ATOM 15192 CD2 TYR B 458 66.283 52.490 75.484 1.00 43.77 C ATOM 15193 CE1 TYR B 458 68.021 50.295 75.787 1.00 41.22 C ATOM 15194 CE2 TYR B 458 65.796 51.167 75.330 1.00 43.68 C ATOM 15195 CZ TYR B 458 66.663 50.070 75.483 1.00 43.09 C ATOM 15196 OH TYR B 458 66.155 48.766 75.381 1.00 39.47 O ATOM 15197 HA TYR B 458 68.168 54.571 73.917 1.00 0.00 H ATOM 15198 HB3 TYR B 458 67.269 54.790 76.252 1.00 0.00 H ATOM 15199 HB2 TYR B 458 68.824 54.155 76.838 1.00 0.00 H ATOM 15200 HD2 TYR B 458 65.602 53.330 75.351 1.00 0.00 H ATOM 15201 HE2 TYR B 458 64.746 51.000 75.092 1.00 0.00 H ATOM 15202 HE1 TYR B 458 68.710 49.457 75.896 1.00 0.00 H ATOM 15203 HD1 TYR B 458 69.526 51.807 76.196 1.00 0.00 H ATOM 15204 HH TYR B 458 65.756 48.638 74.484 1.00 0.00 H ATOM 15205 H TYR B 458 70.741 53.818 75.308 1.00 0.00 H ATOM 15206 N THR B 459 68.071 57.046 75.003 1.00 50.63 N ATOM 15207 CA THR B 459 68.248 58.461 75.263 1.00 49.67 C ATOM 15208 C THR B 459 68.374 58.636 76.754 1.00 50.37 C ATOM 15209 O THR B 459 68.011 57.747 77.527 1.00 50.43 O ATOM 15210 CB THR B 459 67.044 59.255 74.830 1.00 48.73 C ATOM 15211 OG1 THR B 459 65.923 58.828 75.612 1.00 48.57 O ATOM 15212 CG2 THR B 459 66.770 59.048 73.323 1.00 47.83 C ATOM 15213 HA THR B 459 69.124 58.809 74.716 1.00 0.00 H ATOM 15214 HB THR B 459 67.222 60.319 74.987 1.00 0.00 H ATOM 15215 HG1 THR B 459 65.120 59.339 75.342 1.00 0.00 H ATOM 15216 HG23 THR B 459 67.635 59.379 72.749 1.00 0.00 H ATOM 15217 HG21 THR B 459 66.587 57.991 73.130 1.00 0.00 H ATOM 15218 HG22 THR B 459 65.895 59.628 73.031 1.00 0.00 H ATOM 15219 H THR B 459 67.120 56.673 74.805 1.00 0.00 H ATOM 15220 N ALA B 460 68.848 59.797 77.177 1.00 49.87 N ATOM 15221 CA ALA B 460 68.994 60.028 78.599 1.00 49.18 C ATOM 15222 C ALA B 460 67.627 60.007 79.245 1.00 48.84 C ATOM 15223 O ALA B 460 67.505 59.635 80.420 1.00 49.29 O ATOM 15224 CB ALA B 460 69.666 61.362 78.862 1.00 48.94 C ATOM 15225 HA ALA B 460 69.619 59.242 79.023 1.00 0.00 H ATOM 15226 HB1 ALA B 460 70.654 61.367 78.401 1.00 0.00 H ATOM 15227 HB2 ALA B 460 69.061 62.162 78.436 1.00 0.00 H ATOM 15228 HB3 ALA B 460 69.764 61.512 79.937 1.00 0.00 H ATOM 15229 H ALA B 460 69.113 60.536 76.495 1.00 0.00 H ATOM 15230 N GLU B 461 66.594 60.415 78.509 1.00 48.30 N ATOM 15231 CA GLU B 461 65.257 60.416 79.093 1.00 49.27 C ATOM 15232 C GLU B 461 64.697 58.991 79.222 1.00 47.31 C ATOM 15233 O GLU B 461 63.914 58.719 80.112 1.00 47.41 O ATOM 15234 CB GLU B 461 64.309 61.312 78.297 1.00 52.13 C ATOM 15235 CG GLU B 461 64.720 61.527 76.860 1.00 58.85 C ATOM 15236 CD GLU B 461 65.902 62.477 76.714 1.00 59.81 C ATOM 15237 OE1 GLU B 461 65.806 63.612 77.223 1.00 62.49 O ATOM 15238 OE2 GLU B 461 66.919 62.084 76.095 1.00 62.07 O ATOM 15239 HA GLU B 461 65.339 60.827 80.099 1.00 0.00 H ATOM 15240 HB2 GLU B 461 63.319 60.855 78.305 1.00 0.00 H ATOM 15241 HB3 GLU B 461 64.263 62.284 78.789 1.00 0.00 H ATOM 15242 HG2 GLU B 461 64.993 60.564 76.429 1.00 0.00 H ATOM 15243 HG3 GLU B 461 63.872 61.941 76.314 1.00 0.00 H ATOM 15244 H GLU B 461 66.739 60.729 77.528 1.00 0.00 H ATOM 15245 N GLU B 462 65.100 58.100 78.327 1.00 46.04 N ATOM 15246 CA GLU B 462 64.688 56.705 78.428 1.00 46.00 C ATOM 15247 C GLU B 462 65.370 56.071 79.660 1.00 46.21 C ATOM 15248 O GLU B 462 64.758 55.264 80.369 1.00 45.50 O ATOM 15249 CB GLU B 462 65.020 55.953 77.136 1.00 44.68 C ATOM 15250 CG GLU B 462 64.106 56.438 76.003 1.00 44.63 C ATOM 15251 CD GLU B 462 64.364 55.816 74.631 1.00 45.46 C ATOM 15252 OE1 GLU B 462 65.533 55.535 74.294 1.00 44.46 O ATOM 15253 OE2 GLU B 462 63.375 55.635 73.866 1.00 45.57 O ATOM 15254 HA GLU B 462 63.608 56.642 78.560 1.00 0.00 H ATOM 15255 HB2 GLU B 462 66.060 56.137 76.867 1.00 0.00 H ATOM 15256 HB3 GLU B 462 64.870 54.884 77.290 1.00 0.00 H ATOM 15257 HG2 GLU B 462 63.077 56.215 76.284 1.00 0.00 H ATOM 15258 HG3 GLU B 462 64.230 57.517 75.911 1.00 0.00 H ATOM 15259 H GLU B 462 65.716 58.399 77.545 1.00 0.00 H ATOM 15260 N GLU B 463 66.615 56.462 79.946 1.00 45.89 N ATOM 15261 CA GLU B 463 67.303 55.940 81.119 1.00 45.87 C ATOM 15262 C GLU B 463 66.532 56.406 82.333 1.00 45.66 C ATOM 15263 O GLU B 463 66.288 55.616 83.275 1.00 44.97 O ATOM 15264 CB GLU B 463 68.750 56.445 81.223 1.00 48.02 C ATOM 15265 CG GLU B 463 69.254 56.493 82.668 1.00 50.77 C ATOM 15266 CD GLU B 463 70.764 56.650 82.790 1.00 51.61 C ATOM 15267 OE1 GLU B 463 71.395 57.202 81.869 1.00 56.03 O ATOM 15268 OE2 GLU B 463 71.321 56.240 83.825 1.00 53.54 O ATOM 15269 HA GLU B 463 67.347 54.853 81.048 1.00 0.00 H ATOM 15270 HB2 GLU B 463 69.395 55.779 80.650 1.00 0.00 H ATOM 15271 HB3 GLU B 463 68.801 57.449 80.802 1.00 0.00 H ATOM 15272 HG2 GLU B 463 68.779 57.336 83.170 1.00 0.00 H ATOM 15273 HG3 GLU B 463 68.964 55.567 83.164 1.00 0.00 H ATOM 15274 H GLU B 463 67.097 57.144 79.326 1.00 0.00 H ATOM 15275 N ALA B 464 66.122 57.676 82.318 1.00 42.90 N ATOM 15276 CA ALA B 464 65.381 58.178 83.458 1.00 41.92 C ATOM 15277 C ALA B 464 64.006 57.472 83.626 1.00 41.30 C ATOM 15278 O ALA B 464 63.567 57.221 84.756 1.00 39.21 O ATOM 15279 CB ALA B 464 65.219 59.722 83.355 1.00 41.66 C ATOM 15280 HA ALA B 464 65.956 57.947 84.355 1.00 0.00 H ATOM 15281 HB1 ALA B 464 66.204 60.189 83.335 1.00 0.00 H ATOM 15282 HB2 ALA B 464 64.679 59.969 82.441 1.00 0.00 H ATOM 15283 HB3 ALA B 464 64.661 60.086 84.218 1.00 0.00 H ATOM 15284 H ALA B 464 66.330 58.292 81.506 1.00 0.00 H ATOM 15285 N LEU B 465 63.316 57.172 82.520 1.00 40.72 N ATOM 15286 CA LEU B 465 62.020 56.456 82.611 1.00 39.82 C ATOM 15287 C LEU B 465 62.259 55.050 83.226 1.00 38.10 C ATOM 15288 O LEU B 465 61.545 54.610 84.134 1.00 38.43 O ATOM 15289 CB LEU B 465 61.409 56.325 81.208 1.00 40.60 C ATOM 15290 CG LEU B 465 60.175 55.452 81.002 1.00 37.45 C ATOM 15291 CD1 LEU B 465 59.040 55.932 81.906 1.00 38.75 C ATOM 15292 CD2 LEU B 465 59.796 55.520 79.526 1.00 38.97 C ATOM 15293 HA LEU B 465 61.330 57.013 83.245 1.00 0.00 H ATOM 15294 HB2 LEU B 465 61.143 57.331 80.883 1.00 0.00 H ATOM 15295 HB3 LEU B 465 62.189 55.929 80.558 1.00 0.00 H ATOM 15296 HG LEU B 465 60.378 54.415 81.271 1.00 0.00 H ATOM 15297 HD21 LEU B 465 59.578 56.553 79.255 1.00 0.00 H ATOM 15298 HD22 LEU B 465 60.625 55.152 78.922 1.00 0.00 H ATOM 15299 HD23 LEU B 465 58.915 54.903 79.350 1.00 0.00 H ATOM 15300 HD11 LEU B 465 59.355 55.869 82.947 1.00 0.00 H ATOM 15301 HD12 LEU B 465 58.795 56.965 81.661 1.00 0.00 H ATOM 15302 HD13 LEU B 465 58.163 55.303 81.752 1.00 0.00 H ATOM 15303 H LEU B 465 63.691 57.443 81.589 1.00 0.00 H ATOM 15304 N SER B 466 63.293 54.366 82.748 1.00 37.40 N ATOM 15305 CA SER B 466 63.633 53.051 83.276 1.00 38.59 C ATOM 15306 C SER B 466 63.877 53.157 84.778 1.00 39.69 C ATOM 15307 O SER B 466 63.305 52.403 85.582 1.00 39.95 O ATOM 15308 CB SER B 466 64.863 52.491 82.552 1.00 37.50 C ATOM 15309 OG SER B 466 65.255 51.208 83.049 1.00 36.14 O ATOM 15310 HA SER B 466 62.805 52.362 83.106 1.00 0.00 H ATOM 15311 HB2 SER B 466 65.693 53.186 82.684 1.00 0.00 H ATOM 15312 HB3 SER B 466 64.632 52.399 81.491 1.00 0.00 H ATOM 15313 HG SER B 466 64.511 50.567 82.927 1.00 0.00 H ATOM 15314 H SER B 466 63.869 54.776 81.985 1.00 0.00 H ATOM 15315 N ARG B 467 64.673 54.132 85.198 1.00 40.93 N ATOM 15316 CA ARG B 467 64.917 54.238 86.634 1.00 41.68 C ATOM 15317 C ARG B 467 63.648 54.493 87.427 1.00 41.76 C ATOM 15318 O ARG B 467 63.502 53.939 88.534 1.00 39.76 O ATOM 15319 CB ARG B 467 65.978 55.302 86.966 1.00 43.02 C ATOM 15320 CG ARG B 467 67.435 54.878 86.641 1.00 44.98 C ATOM 15321 CD ARG B 467 68.429 56.084 86.838 1.00 44.90 C ATOM 15322 NE ARG B 467 69.791 55.720 86.438 1.00 43.16 N ATOM 15323 CZ ARG B 467 70.602 54.930 87.139 1.00 43.95 C ATOM 15324 NH1 ARG B 467 70.214 54.423 88.305 1.00 41.19 N ATOM 15325 NH2 ARG B 467 71.784 54.586 86.630 1.00 45.00 N ATOM 15326 HA ARG B 467 65.305 53.265 86.937 1.00 0.00 H ATOM 15327 HB2 ARG B 467 65.749 56.202 86.395 1.00 0.00 H ATOM 15328 HB3 ARG B 467 65.917 55.524 88.031 1.00 0.00 H ATOM 15329 HG2 ARG B 467 67.726 54.063 87.304 1.00 0.00 H ATOM 15330 HG3 ARG B 467 67.486 54.539 85.606 1.00 0.00 H ATOM 15331 HD2 ARG B 467 68.432 56.374 87.889 1.00 0.00 H ATOM 15332 HD3 ARG B 467 68.093 56.925 86.231 1.00 0.00 H ATOM 15333 HE ARG B 467 70.150 56.107 85.542 1.00 0.00 H ATOM 15334 HH12 ARG B 467 70.856 53.807 88.844 1.00 0.00 H ATOM 15335 HH11 ARG B 467 69.268 54.642 88.679 1.00 0.00 H ATOM 15336 HH22 ARG B 467 72.423 53.969 87.171 1.00 0.00 H ATOM 15337 HH21 ARG B 467 72.067 54.934 85.692 1.00 0.00 H ATOM 15338 H ARG B 467 65.108 54.798 84.528 1.00 0.00 H ATOM 15339 N ARG B 468 62.717 55.309 86.923 1.00 40.98 N ATOM 15340 CA ARG B 468 61.515 55.456 87.739 1.00 43.02 C ATOM 15341 C ARG B 468 60.627 54.205 87.718 1.00 40.29 C ATOM 15342 O ARG B 468 59.969 53.939 88.695 1.00 39.32 O ATOM 15343 CB ARG B 468 60.643 56.654 87.361 1.00 45.75 C ATOM 15344 CG ARG B 468 61.071 57.411 86.210 1.00 50.47 C ATOM 15345 CD ARG B 468 60.332 58.763 86.331 1.00 55.03 C ATOM 15346 NE ARG B 468 58.892 58.590 86.530 1.00 55.83 N ATOM 15347 CZ ARG B 468 58.000 58.570 85.537 1.00 55.57 C ATOM 15348 NH1 ARG B 468 58.415 58.703 84.285 1.00 55.47 N ATOM 15349 NH2 ARG B 468 56.684 58.468 85.798 1.00 54.40 N ATOM 15350 HA ARG B 468 61.913 55.618 88.741 1.00 0.00 H ATOM 15351 HB2 ARG B 468 59.637 56.285 87.162 1.00 0.00 H ATOM 15352 HB3 ARG B 468 60.618 57.331 88.215 1.00 0.00 H ATOM 15353 HG2 ARG B 468 62.151 57.560 86.228 1.00 0.00 H ATOM 15354 HG3 ARG B 468 60.791 56.901 85.288 1.00 0.00 H ATOM 15355 HD2 ARG B 468 60.494 59.335 85.418 1.00 0.00 H ATOM 15356 HD3 ARG B 468 60.741 59.312 87.179 1.00 0.00 H ATOM 15357 HE ARG B 468 58.543 58.476 87.503 1.00 0.00 H ATOM 15358 HH12 ARG B 468 57.727 58.689 83.505 1.00 0.00 H ATOM 15359 HH11 ARG B 468 59.428 58.822 84.083 1.00 0.00 H ATOM 15360 HH22 ARG B 468 55.998 58.453 85.016 1.00 0.00 H ATOM 15361 HH21 ARG B 468 56.352 58.404 86.782 1.00 0.00 H ATOM 15362 H ARG B 468 62.840 55.803 86.016 1.00 0.00 H ATOM 15363 N ILE B 469 60.603 53.464 86.605 1.00 39.81 N ATOM 15364 CA ILE B 469 59.788 52.255 86.553 1.00 38.13 C ATOM 15365 C ILE B 469 60.394 51.231 87.520 1.00 38.03 C ATOM 15366 O ILE B 469 59.690 50.632 88.366 1.00 38.68 O ATOM 15367 CB ILE B 469 59.682 51.725 85.052 1.00 37.01 C ATOM 15368 CG1 ILE B 469 58.701 52.629 84.271 1.00 33.64 C ATOM 15369 CG2 ILE B 469 59.214 50.257 85.009 1.00 34.54 C ATOM 15370 CD1 ILE B 469 58.686 52.339 82.799 1.00 31.91 C ATOM 15371 HA ILE B 469 58.764 52.453 86.870 1.00 0.00 H ATOM 15372 HB ILE B 469 60.669 51.765 84.591 1.00 0.00 H ATOM 15373 HG12 ILE B 469 57.697 52.476 84.666 1.00 0.00 H ATOM 15374 HG13 ILE B 469 58.993 53.669 84.418 1.00 0.00 H ATOM 15375 HD11 ILE B 469 59.683 52.498 82.389 1.00 0.00 H ATOM 15376 HD12 ILE B 469 58.385 51.304 82.637 1.00 0.00 H ATOM 15377 HD13 ILE B 469 57.978 53.006 82.306 1.00 0.00 H ATOM 15378 HG21 ILE B 469 59.927 49.634 85.548 1.00 0.00 H ATOM 15379 HG22 ILE B 469 58.233 50.176 85.476 1.00 0.00 H ATOM 15380 HG23 ILE B 469 59.152 49.927 83.972 1.00 0.00 H ATOM 15381 H ILE B 469 61.165 53.749 85.777 1.00 0.00 H ATOM 15382 N MET B 470 61.704 51.062 87.461 1.00 38.22 N ATOM 15383 CA MET B 470 62.335 50.131 88.391 1.00 39.21 C ATOM 15384 C MET B 470 62.056 50.503 89.858 1.00 38.54 C ATOM 15385 O MET B 470 61.767 49.611 90.704 1.00 36.92 O ATOM 15386 CB MET B 470 63.853 50.051 88.170 1.00 39.65 C ATOM 15387 CG MET B 470 64.271 49.422 86.839 1.00 40.36 C ATOM 15388 SD MET B 470 66.027 48.938 86.946 1.00 43.55 S ATOM 15389 CE MET B 470 66.770 50.578 86.518 1.00 40.13 C ATOM 15390 HA MET B 470 61.893 49.155 88.188 1.00 0.00 H ATOM 15391 HB2 MET B 470 64.256 51.063 88.210 1.00 0.00 H ATOM 15392 HB3 MET B 470 64.283 49.458 88.977 1.00 0.00 H ATOM 15393 HG2 MET B 470 64.138 50.144 86.034 1.00 0.00 H ATOM 15394 HG3 MET B 470 63.659 48.542 86.641 1.00 0.00 H ATOM 15395 HE1 MET B 470 66.436 50.879 85.525 1.00 0.00 H ATOM 15396 HE2 MET B 470 66.453 51.321 87.250 1.00 0.00 H ATOM 15397 HE3 MET B 470 67.857 50.497 86.528 1.00 0.00 H ATOM 15398 H MET B 470 62.274 51.583 86.765 1.00 0.00 H ATOM 15399 N HIS B 471 62.101 51.804 90.160 1.00 38.58 N ATOM 15400 CA HIS B 471 61.882 52.226 91.527 1.00 39.09 C ATOM 15401 C HIS B 471 60.412 52.070 91.881 1.00 39.35 C ATOM 15402 O HIS B 471 60.082 51.733 93.028 1.00 39.88 O ATOM 15403 CB HIS B 471 62.376 53.670 91.777 1.00 40.55 C ATOM 15404 CG HIS B 471 62.519 54.007 93.237 1.00 41.33 C ATOM 15405 ND1 HIS B 471 63.321 53.275 94.097 1.00 43.05 N ATOM 15406 CD2 HIS B 471 61.894 54.934 94.011 1.00 41.74 C ATOM 15407 CE1 HIS B 471 63.179 53.729 95.334 1.00 41.45 C ATOM 15408 NE2 HIS B 471 62.319 54.734 95.309 1.00 42.37 N ATOM 15409 HA HIS B 471 62.472 51.584 92.181 1.00 0.00 H ATOM 15410 HB2 HIS B 471 63.347 53.792 91.297 1.00 0.00 H ATOM 15411 HB3 HIS B 471 61.662 54.362 91.330 1.00 0.00 H ATOM 15412 HD2 HIS B 471 61.189 55.693 93.670 1.00 0.00 H ATOM 15413 HE1 HIS B 471 63.684 53.341 96.219 1.00 0.00 H ATOM 15414 H HIS B 471 62.292 52.508 89.419 1.00 0.00 H ATOM 15415 N TYR B 472 59.513 52.328 90.928 1.00 39.56 N ATOM 15416 CA TYR B 472 58.080 52.117 91.229 1.00 39.14 C ATOM 15417 C TYR B 472 57.876 50.604 91.523 1.00 37.18 C ATOM 15418 O TYR B 472 57.246 50.226 92.506 1.00 37.49 O ATOM 15419 CB TYR B 472 57.191 52.418 90.022 1.00 39.87 C ATOM 15420 CG TYR B 472 56.898 53.856 89.689 1.00 40.53 C ATOM 15421 CD1 TYR B 472 56.646 54.812 90.695 1.00 42.64 C ATOM 15422 CD2 TYR B 472 56.763 54.243 88.345 1.00 41.55 C ATOM 15423 CE1 TYR B 472 56.260 56.129 90.348 1.00 42.83 C ATOM 15424 CE2 TYR B 472 56.383 55.515 87.989 1.00 42.58 C ATOM 15425 CZ TYR B 472 56.133 56.460 88.983 1.00 45.00 C ATOM 15426 OH TYR B 472 55.799 57.739 88.572 1.00 48.03 O ATOM 15427 HA TYR B 472 57.816 52.772 92.059 1.00 0.00 H ATOM 15428 HB3 TYR B 472 56.234 51.926 90.196 1.00 0.00 H ATOM 15429 HB2 TYR B 472 57.672 51.977 89.149 1.00 0.00 H ATOM 15430 HD2 TYR B 472 56.966 53.513 87.562 1.00 0.00 H ATOM 15431 HE2 TYR B 472 56.278 55.783 86.938 1.00 0.00 H ATOM 15432 HE1 TYR B 472 56.065 56.873 91.121 1.00 0.00 H ATOM 15433 HD1 TYR B 472 56.749 54.535 91.744 1.00 0.00 H ATOM 15434 HH TYR B 472 55.647 58.310 89.366 1.00 0.00 H ATOM 15435 H TYR B 472 59.814 52.670 89.993 1.00 0.00 H ATOM 15436 N TRP B 473 58.383 49.743 90.637 1.00 36.50 N ATOM 15437 CA TRP B 473 58.189 48.300 90.834 1.00 35.01 C ATOM 15438 C TRP B 473 58.783 47.804 92.167 1.00 35.59 C ATOM 15439 O TRP B 473 58.151 47.027 92.880 1.00 36.09 O ATOM 15440 CB TRP B 473 58.831 47.477 89.695 1.00 32.66 C ATOM 15441 CG TRP B 473 57.915 47.063 88.485 1.00 32.74 C ATOM 15442 CD1 TRP B 473 57.908 45.853 87.840 1.00 29.65 C ATOM 15443 CD2 TRP B 473 57.050 47.928 87.720 1.00 31.42 C ATOM 15444 NE1 TRP B 473 57.097 45.910 86.695 1.00 30.65 N ATOM 15445 CE2 TRP B 473 56.566 47.174 86.608 1.00 32.39 C ATOM 15446 CE3 TRP B 473 56.641 49.272 87.864 1.00 30.59 C ATOM 15447 CZ2 TRP B 473 55.689 47.732 85.633 1.00 31.64 C ATOM 15448 CZ3 TRP B 473 55.759 49.825 86.899 1.00 31.87 C ATOM 15449 CH2 TRP B 473 55.298 49.044 85.791 1.00 30.87 C ATOM 15450 HA TRP B 473 57.109 48.152 90.842 1.00 0.00 H ATOM 15451 HB2 TRP B 473 59.656 48.066 89.293 1.00 0.00 H ATOM 15452 HB3 TRP B 473 59.222 46.560 90.136 1.00 0.00 H ATOM 15453 HE1 TRP B 473 56.928 45.130 86.028 1.00 0.00 H ATOM 15454 HD1 TRP B 473 58.456 44.970 88.170 1.00 0.00 H ATOM 15455 HZ2 TRP B 473 55.338 47.139 84.788 1.00 0.00 H ATOM 15456 HH2 TRP B 473 54.627 49.495 85.060 1.00 0.00 H ATOM 15457 HZ3 TRP B 473 55.428 50.858 87.003 1.00 0.00 H ATOM 15458 HE3 TRP B 473 56.996 49.874 88.701 1.00 0.00 H ATOM 15459 H TRP B 473 58.912 50.092 89.812 1.00 0.00 H ATOM 15460 N ALA B 474 60.007 48.224 92.501 1.00 35.77 N ATOM 15461 CA ALA B 474 60.659 47.729 93.732 1.00 35.06 C ATOM 15462 C ALA B 474 60.072 48.332 94.962 1.00 34.37 C ATOM 15463 O ALA B 474 59.989 47.677 95.985 1.00 35.12 O ATOM 15464 CB ALA B 474 62.173 47.969 93.690 1.00 35.18 C ATOM 15465 HA ALA B 474 60.476 46.655 93.774 1.00 0.00 H ATOM 15466 HB1 ALA B 474 62.599 47.445 92.834 1.00 0.00 H ATOM 15467 HB2 ALA B 474 62.368 49.037 93.597 1.00 0.00 H ATOM 15468 HB3 ALA B 474 62.625 47.595 94.609 1.00 0.00 H ATOM 15469 H ALA B 474 60.504 48.904 91.891 1.00 0.00 H ATOM 15470 N THR B 475 59.628 49.576 94.876 1.00 35.50 N ATOM 15471 CA THR B 475 59.024 50.181 96.048 1.00 36.14 C ATOM 15472 C THR B 475 57.665 49.501 96.283 1.00 36.76 C ATOM 15473 O THR B 475 57.246 49.308 97.439 1.00 35.35 O ATOM 15474 CB THR B 475 58.757 51.694 95.854 1.00 36.63 C ATOM 15475 OG1 THR B 475 60.008 52.375 95.605 1.00 37.36 O ATOM 15476 CG2 THR B 475 58.057 52.253 97.099 1.00 33.32 C ATOM 15477 HA THR B 475 59.710 50.055 96.885 1.00 0.00 H ATOM 15478 HB THR B 475 58.105 51.853 94.995 1.00 0.00 H ATOM 15479 HG1 THR B 475 60.427 52.005 94.788 1.00 0.00 H ATOM 15480 HG23 THR B 475 57.120 51.719 97.258 1.00 0.00 H ATOM 15481 HG21 THR B 475 58.703 52.122 97.967 1.00 0.00 H ATOM 15482 HG22 THR B 475 57.852 53.314 96.954 1.00 0.00 H ATOM 15483 H THR B 475 59.710 50.109 93.987 1.00 0.00 H ATOM 15484 N PHE B 476 56.962 49.172 95.192 1.00 36.08 N ATOM 15485 CA PHE B 476 55.687 48.494 95.377 1.00 36.23 C ATOM 15486 C PHE B 476 55.971 47.098 95.996 1.00 36.24 C ATOM 15487 O PHE B 476 55.260 46.647 96.919 1.00 35.43 O ATOM 15488 CB PHE B 476 54.950 48.299 94.026 1.00 35.38 C ATOM 15489 CG PHE B 476 53.778 47.362 94.120 1.00 35.61 C ATOM 15490 CD1 PHE B 476 52.565 47.805 94.616 1.00 34.55 C ATOM 15491 CD2 PHE B 476 53.902 46.019 93.732 1.00 36.68 C ATOM 15492 CE1 PHE B 476 51.453 46.925 94.725 1.00 35.09 C ATOM 15493 CE2 PHE B 476 52.811 45.126 93.837 1.00 34.68 C ATOM 15494 CZ PHE B 476 51.582 45.584 94.332 1.00 35.55 C ATOM 15495 HA PHE B 476 55.055 49.099 96.027 1.00 0.00 H ATOM 15496 HB2 PHE B 476 54.591 49.270 93.684 1.00 0.00 H ATOM 15497 HB3 PHE B 476 55.657 47.898 93.300 1.00 0.00 H ATOM 15498 HD2 PHE B 476 54.855 45.659 93.344 1.00 0.00 H ATOM 15499 HE2 PHE B 476 52.925 44.085 93.534 1.00 0.00 H ATOM 15500 HZ PHE B 476 50.734 44.904 94.411 1.00 0.00 H ATOM 15501 HE1 PHE B 476 50.503 47.291 95.113 1.00 0.00 H ATOM 15502 HD1 PHE B 476 52.460 48.844 94.928 1.00 0.00 H ATOM 15503 H PHE B 476 57.317 49.394 94.240 1.00 0.00 H ATOM 15504 N ALA B 477 57.010 46.416 95.503 1.00 35.03 N ATOM 15505 CA ALA B 477 57.303 45.073 96.013 1.00 35.30 C ATOM 15506 C ALA B 477 57.586 45.154 97.491 1.00 37.71 C ATOM 15507 O ALA B 477 57.128 44.309 98.298 1.00 37.82 O ATOM 15508 CB ALA B 477 58.488 44.479 95.295 1.00 32.43 C ATOM 15509 HA ALA B 477 56.440 44.431 95.838 1.00 0.00 H ATOM 15510 HB1 ALA B 477 58.269 44.413 94.229 1.00 0.00 H ATOM 15511 HB2 ALA B 477 59.360 45.114 95.449 1.00 0.00 H ATOM 15512 HB3 ALA B 477 58.688 43.483 95.689 1.00 0.00 H ATOM 15513 H ALA B 477 57.607 46.836 94.762 1.00 0.00 H ATOM 15514 N LYS B 478 58.308 46.208 97.866 1.00 38.63 N ATOM 15515 CA LYS B 478 58.681 46.358 99.252 1.00 40.14 C ATOM 15516 C LYS B 478 57.556 46.741 100.183 1.00 40.42 C ATOM 15517 O LYS B 478 57.430 46.182 101.285 1.00 41.70 O ATOM 15518 CB LYS B 478 59.806 47.391 99.397 1.00 42.39 C ATOM 15519 CG LYS B 478 60.174 47.631 100.896 1.00 46.00 C ATOM 15520 CD LYS B 478 61.613 48.121 101.046 1.00 49.61 C ATOM 15521 CE LYS B 478 61.742 49.621 100.841 1.00 52.49 C ATOM 15522 NZ LYS B 478 62.635 50.173 101.935 1.00 57.02 N ATOM 15523 HA LYS B 478 59.008 45.363 99.553 1.00 0.00 H ATOM 15524 HB2 LYS B 478 60.689 47.030 98.869 1.00 0.00 H ATOM 15525 HB3 LYS B 478 59.481 48.334 98.957 1.00 0.00 H ATOM 15526 HG2 LYS B 478 59.499 48.379 101.312 1.00 0.00 H ATOM 15527 HG3 LYS B 478 60.059 46.696 101.444 1.00 0.00 H ATOM 15528 HD2 LYS B 478 61.964 47.873 102.048 1.00 0.00 H ATOM 15529 HD3 LYS B 478 62.234 47.613 100.309 1.00 0.00 H ATOM 15530 HE2 LYS B 478 60.758 50.087 100.897 1.00 0.00 H ATOM 15531 HE3 LYS B 478 62.184 49.824 99.866 1.00 0.00 H ATOM 15532 HZ1 LYS B 478 62.209 49.974 102.862 1.00 0.00 H ATOM 15533 HZ2 LYS B 478 63.570 49.722 101.878 1.00 0.00 H ATOM 15534 HZ3 LYS B 478 62.736 51.201 101.812 1.00 0.00 H ATOM 15535 H LYS B 478 58.601 46.918 97.165 1.00 0.00 H ATOM 15536 N THR B 479 56.744 47.689 99.729 1.00 39.27 N ATOM 15537 CA THR B 479 55.690 48.248 100.531 1.00 39.05 C ATOM 15538 C THR B 479 54.260 48.035 100.145 1.00 40.04 C ATOM 15539 O THR B 479 53.407 48.280 100.979 1.00 40.76 O ATOM 15540 CB THR B 479 55.855 49.798 100.653 1.00 39.70 C ATOM 15541 OG1 THR B 479 55.508 50.421 99.405 1.00 37.49 O ATOM 15542 CG2 THR B 479 57.347 50.166 100.989 1.00 38.43 C ATOM 15543 HA THR B 479 55.835 47.676 101.448 1.00 0.00 H ATOM 15544 HB THR B 479 55.201 50.150 101.450 1.00 0.00 H ATOM 15545 HG1 THR B 479 55.614 51.402 99.487 1.00 0.00 H ATOM 15546 HG23 THR B 479 57.630 49.702 101.934 1.00 0.00 H ATOM 15547 HG21 THR B 479 57.998 49.801 100.194 1.00 0.00 H ATOM 15548 HG22 THR B 479 57.443 51.249 101.071 1.00 0.00 H ATOM 15549 H THR B 479 56.875 48.039 98.759 1.00 0.00 H ATOM 15550 N GLY B 480 53.969 47.623 98.906 1.00 39.33 N ATOM 15551 CA GLY B 480 52.577 47.470 98.495 1.00 37.56 C ATOM 15552 C GLY B 480 52.067 48.785 97.912 1.00 38.46 C ATOM 15553 O GLY B 480 50.863 48.945 97.680 1.00 37.51 O ATOM 15554 HA3 GLY B 480 51.971 47.197 99.359 1.00 0.00 H ATOM 15555 HA2 GLY B 480 52.505 46.687 97.741 1.00 0.00 H ATOM 15556 H GLY B 480 54.735 47.412 98.235 1.00 0.00 H ATOM 15557 N ASN B 481 52.987 49.730 97.672 1.00 38.10 N ATOM 15558 CA ASN B 481 52.657 51.053 97.121 1.00 39.33 C ATOM 15559 C ASN B 481 53.892 51.525 96.338 1.00 40.53 C ATOM 15560 O ASN B 481 54.986 51.638 96.906 1.00 41.55 O ATOM 15561 CB ASN B 481 52.359 52.008 98.294 1.00 40.52 C ATOM 15562 CG ASN B 481 52.009 53.441 97.852 1.00 39.44 C ATOM 15563 OD1 ASN B 481 52.345 53.881 96.762 1.00 40.61 O ATOM 15564 ND2 ASN B 481 51.364 54.179 98.742 1.00 39.51 N ATOM 15565 HA ASN B 481 51.785 51.025 96.467 1.00 0.00 H ATOM 15566 HB2 ASN B 481 51.518 51.607 98.860 1.00 0.00 H ATOM 15567 HB3 ASN B 481 53.239 52.051 98.935 1.00 0.00 H ATOM 15568 HD22 ASN B 481 51.094 53.770 99.659 1.00 0.00 H ATOM 15569 HD21 ASN B 481 51.127 55.168 98.524 1.00 0.00 H ATOM 15570 H ASN B 481 53.982 49.517 97.886 1.00 0.00 H ATOM 15571 N PRO B 482 53.739 51.812 95.030 1.00 40.27 N ATOM 15572 CA PRO B 482 54.874 52.255 94.216 1.00 41.11 C ATOM 15573 C PRO B 482 55.449 53.630 94.612 1.00 43.15 C ATOM 15574 O PRO B 482 56.567 53.960 94.241 1.00 41.43 O ATOM 15575 CB PRO B 482 54.289 52.291 92.805 1.00 41.15 C ATOM 15576 CG PRO B 482 52.871 52.793 93.073 1.00 39.29 C ATOM 15577 CD PRO B 482 52.462 51.974 94.298 1.00 40.46 C ATOM 15578 HA PRO B 482 55.728 51.588 94.337 1.00 0.00 H ATOM 15579 HD3 PRO B 482 51.729 52.510 94.901 1.00 0.00 H ATOM 15580 HD2 PRO B 482 52.052 51.007 94.005 1.00 0.00 H ATOM 15581 HG3 PRO B 482 52.214 52.593 92.226 1.00 0.00 H ATOM 15582 HG2 PRO B 482 52.865 53.861 93.291 1.00 0.00 H ATOM 15583 HB2 PRO B 482 54.840 52.978 92.163 1.00 0.00 H ATOM 15584 HB3 PRO B 482 54.281 51.300 92.352 1.00 0.00 H ATOM 15585 N ASN B 483 54.664 54.414 95.344 1.00 44.35 N ATOM 15586 CA ASN B 483 55.073 55.754 95.727 1.00 48.14 C ATOM 15587 C ASN B 483 56.021 55.833 96.900 1.00 51.03 C ATOM 15588 O ASN B 483 55.870 55.161 97.903 1.00 49.83 O ATOM 15589 CB ASN B 483 53.844 56.597 96.020 1.00 45.97 C ATOM 15590 CG ASN B 483 52.936 56.692 94.820 1.00 45.41 C ATOM 15591 OD1 ASN B 483 53.328 57.245 93.794 1.00 44.64 O ATOM 15592 ND2 ASN B 483 51.729 56.128 94.927 1.00 42.70 N ATOM 15593 HA ASN B 483 55.633 56.135 94.873 1.00 0.00 H ATOM 15594 HB2 ASN B 483 53.294 56.145 96.845 1.00 0.00 H ATOM 15595 HB3 ASN B 483 54.162 57.600 96.303 1.00 0.00 H ATOM 15596 HD22 ASN B 483 51.445 55.672 95.818 1.00 0.00 H ATOM 15597 HD21 ASN B 483 51.074 56.145 94.120 1.00 0.00 H ATOM 15598 H ASN B 483 53.735 54.060 95.650 1.00 0.00 H ATOM 15599 N GLU B 484 56.995 56.699 96.745 1.00 55.89 N ATOM 15600 CA GLU B 484 58.008 56.924 97.749 1.00 61.47 C ATOM 15601 C GLU B 484 57.346 57.922 98.729 1.00 63.89 C ATOM 15602 O GLU B 484 56.920 59.015 98.331 1.00 64.34 O ATOM 15603 CB GLU B 484 59.220 57.511 97.003 1.00 63.27 C ATOM 15604 CG GLU B 484 60.417 57.790 97.816 1.00 66.48 C ATOM 15605 CD GLU B 484 61.066 56.545 98.304 1.00 66.86 C ATOM 15606 OE1 GLU B 484 61.874 55.974 97.555 1.00 67.25 O ATOM 15607 OE2 GLU B 484 60.749 56.138 99.437 1.00 70.23 O ATOM 15608 HA GLU B 484 58.352 56.048 98.299 1.00 0.00 H ATOM 15609 HB2 GLU B 484 59.505 56.804 96.224 1.00 0.00 H ATOM 15610 HB3 GLU B 484 58.905 58.448 96.543 1.00 0.00 H ATOM 15611 HG2 GLU B 484 61.133 58.345 97.209 1.00 0.00 H ATOM 15612 HG3 GLU B 484 60.125 58.394 98.675 1.00 0.00 H ATOM 15613 H GLU B 484 57.039 57.246 95.862 1.00 0.00 H ATOM 15614 N PRO B 485 57.199 57.542 100.014 1.00 66.54 N ATOM 15615 CA PRO B 485 56.578 58.453 100.997 1.00 68.33 C ATOM 15616 C PRO B 485 57.284 59.824 101.149 1.00 69.05 C ATOM 15617 O PRO B 485 56.573 60.825 101.433 1.00 69.75 O ATOM 15618 CB PRO B 485 56.621 57.641 102.296 1.00 68.53 C ATOM 15619 CG PRO B 485 57.861 56.785 102.120 1.00 67.82 C ATOM 15620 CD PRO B 485 57.718 56.326 100.678 1.00 67.31 C ATOM 15621 HA PRO B 485 55.575 58.744 100.686 1.00 0.00 H ATOM 15622 HD3 PRO B 485 58.680 56.027 100.261 1.00 0.00 H ATOM 15623 HD2 PRO B 485 57.014 55.498 100.594 1.00 0.00 H ATOM 15624 HG3 PRO B 485 57.861 55.940 102.808 1.00 0.00 H ATOM 15625 HG2 PRO B 485 58.770 57.369 102.263 1.00 0.00 H ATOM 15626 HB2 PRO B 485 56.715 58.294 103.164 1.00 0.00 H ATOM 15627 HB3 PRO B 485 55.729 57.023 102.402 1.00 0.00 H TER 15628 PRO B 485 ATOM 15629 N SER B 490 55.621 63.410 92.866 1.00 57.64 N ATOM 15630 CA SER B 490 54.396 63.301 91.952 1.00 59.07 C ATOM 15631 C SER B 490 53.754 61.884 92.072 1.00 56.35 C ATOM 15632 O SER B 490 54.336 60.903 91.611 1.00 54.93 O ATOM 15633 CB SER B 490 54.814 63.567 90.498 1.00 61.06 C ATOM 15634 OG SER B 490 53.659 63.794 89.696 1.00 64.25 O ATOM 15635 HA SER B 490 53.658 64.043 92.257 1.00 0.00 H ATOM 15636 HB2 SER B 490 55.357 62.704 90.114 1.00 0.00 H ATOM 15637 HB3 SER B 490 55.458 64.446 90.462 1.00 0.00 H ATOM 15638 HG SER B 490 53.936 63.965 88.761 1.00 0.00 H ATOM 15639 HN3 SER B 490 56.323 62.694 92.589 1.00 0.00 H ATOM 15640 HN2 SER B 490 55.332 63.251 93.852 1.00 0.00 H ATOM 15641 HN1 SER B 490 56.037 64.359 92.775 1.00 0.00 H ATOM 15642 N LYS B 491 52.559 61.807 92.667 1.00 54.37 N ATOM 15643 CA LYS B 491 51.909 60.532 92.951 1.00 54.05 C ATOM 15644 C LYS B 491 51.110 59.691 91.923 1.00 52.24 C ATOM 15645 O LYS B 491 50.265 60.210 91.184 1.00 52.01 O ATOM 15646 CB LYS B 491 51.013 60.691 94.178 1.00 55.97 C ATOM 15647 CG LYS B 491 51.675 61.310 95.417 1.00 60.13 C ATOM 15648 CD LYS B 491 52.848 60.485 95.969 1.00 62.58 C ATOM 15649 CE LYS B 491 54.217 61.048 95.527 1.00 64.45 C ATOM 15650 NZ LYS B 491 55.345 60.206 96.048 1.00 66.12 N ATOM 15651 HA LYS B 491 52.815 59.931 93.026 1.00 0.00 H ATOM 15652 HB2 LYS B 491 50.171 61.324 93.897 1.00 0.00 H ATOM 15653 HB3 LYS B 491 50.646 59.702 94.454 1.00 0.00 H ATOM 15654 HG2 LYS B 491 52.046 62.300 95.151 1.00 0.00 H ATOM 15655 HG3 LYS B 491 50.922 61.404 96.199 1.00 0.00 H ATOM 15656 HD2 LYS B 491 52.800 60.492 97.058 1.00 0.00 H ATOM 15657 HD3 LYS B 491 52.757 59.460 95.609 1.00 0.00 H ATOM 15658 HE2 LYS B 491 54.325 62.063 95.910 1.00 0.00 H ATOM 15659 HE3 LYS B 491 54.260 61.065 94.438 1.00 0.00 H ATOM 15660 HZ1 LYS B 491 55.313 60.190 97.087 1.00 0.00 H ATOM 15661 HZ2 LYS B 491 55.251 59.237 95.682 1.00 0.00 H ATOM 15662 HZ3 LYS B 491 56.251 60.610 95.734 1.00 0.00 H ATOM 15663 H LYS B 491 52.076 62.687 92.937 1.00 0.00 H ATOM 15664 N TRP B 492 51.395 58.383 91.912 1.00 47.64 N ATOM 15665 CA TRP B 492 50.680 57.416 91.095 1.00 43.64 C ATOM 15666 C TRP B 492 49.490 57.130 92.000 1.00 42.93 C ATOM 15667 O TRP B 492 49.648 56.534 93.059 1.00 42.89 O ATOM 15668 CB TRP B 492 51.521 56.153 90.958 1.00 42.46 C ATOM 15669 CG TRP B 492 50.931 55.052 90.120 1.00 41.22 C ATOM 15670 CD1 TRP B 492 49.604 54.838 89.836 1.00 39.47 C ATOM 15671 CD2 TRP B 492 51.651 53.983 89.502 1.00 39.90 C ATOM 15672 NE1 TRP B 492 49.461 53.699 89.078 1.00 40.21 N ATOM 15673 CE2 TRP B 492 50.700 53.155 88.854 1.00 38.95 C ATOM 15674 CE3 TRP B 492 53.011 53.646 89.432 1.00 38.94 C ATOM 15675 CZ2 TRP B 492 51.055 52.012 88.138 1.00 37.10 C ATOM 15676 CZ3 TRP B 492 53.373 52.495 88.712 1.00 40.56 C ATOM 15677 CH2 TRP B 492 52.380 51.690 88.070 1.00 38.40 C ATOM 15678 HA TRP B 492 50.432 57.748 90.087 1.00 0.00 H ATOM 15679 HB2 TRP B 492 52.476 56.435 90.514 1.00 0.00 H ATOM 15680 HB3 TRP B 492 51.691 55.756 91.959 1.00 0.00 H ATOM 15681 HE1 TRP B 492 48.560 53.313 88.731 1.00 0.00 H ATOM 15682 HD1 TRP B 492 48.784 55.477 90.163 1.00 0.00 H ATOM 15683 HZ2 TRP B 492 50.300 51.396 87.649 1.00 0.00 H ATOM 15684 HH2 TRP B 492 52.687 50.803 87.516 1.00 0.00 H ATOM 15685 HZ3 TRP B 492 54.423 52.212 88.642 1.00 0.00 H ATOM 15686 HE3 TRP B 492 53.766 54.260 89.923 1.00 0.00 H ATOM 15687 H TRP B 492 52.167 58.041 92.519 1.00 0.00 H ATOM 15688 N PRO B 493 48.283 57.569 91.630 1.00 42.51 N ATOM 15689 CA PRO B 493 47.144 57.290 92.520 1.00 42.00 C ATOM 15690 C PRO B 493 46.657 55.849 92.565 1.00 42.91 C ATOM 15691 O PRO B 493 46.832 55.084 91.633 1.00 43.58 O ATOM 15692 CB PRO B 493 46.037 58.208 91.971 1.00 42.17 C ATOM 15693 CG PRO B 493 46.343 58.249 90.548 1.00 41.71 C ATOM 15694 CD PRO B 493 47.858 58.389 90.489 1.00 41.10 C ATOM 15695 HA PRO B 493 47.439 57.469 93.554 1.00 0.00 H ATOM 15696 HD3 PRO B 493 48.256 58.001 89.551 1.00 0.00 H ATOM 15697 HD2 PRO B 493 48.165 59.428 90.611 1.00 0.00 H ATOM 15698 HG3 PRO B 493 45.858 59.102 90.073 1.00 0.00 H ATOM 15699 HG2 PRO B 493 46.021 57.330 90.057 1.00 0.00 H ATOM 15700 HB2 PRO B 493 45.048 57.785 92.150 1.00 0.00 H ATOM 15701 HB3 PRO B 493 46.092 59.202 92.415 1.00 0.00 H ATOM 15702 N LEU B 494 46.032 55.495 93.667 1.00 41.58 N ATOM 15703 CA LEU B 494 45.455 54.195 93.833 1.00 41.52 C ATOM 15704 C LEU B 494 44.288 54.070 92.825 1.00 42.37 C ATOM 15705 O LEU B 494 43.578 55.054 92.564 1.00 41.27 O ATOM 15706 CB LEU B 494 44.921 54.137 95.237 1.00 42.11 C ATOM 15707 CG LEU B 494 44.531 52.873 95.937 1.00 45.12 C ATOM 15708 CD1 LEU B 494 45.779 51.988 96.202 1.00 43.64 C ATOM 15709 CD2 LEU B 494 43.836 53.278 97.259 1.00 44.21 C ATOM 15710 HA LEU B 494 46.174 53.393 93.664 1.00 0.00 H ATOM 15711 HB2 LEU B 494 45.686 54.596 95.863 1.00 0.00 H ATOM 15712 HB3 LEU B 494 44.028 54.762 95.239 1.00 0.00 H ATOM 15713 HG LEU B 494 43.852 52.281 95.322 1.00 0.00 H ATOM 15714 HD21 LEU B 494 44.529 53.857 97.870 1.00 0.00 H ATOM 15715 HD22 LEU B 494 42.956 53.881 97.035 1.00 0.00 H ATOM 15716 HD23 LEU B 494 43.536 52.381 97.800 1.00 0.00 H ATOM 15717 HD11 LEU B 494 46.252 51.735 95.253 1.00 0.00 H ATOM 15718 HD12 LEU B 494 46.485 52.535 96.827 1.00 0.00 H ATOM 15719 HD13 LEU B 494 45.473 51.074 96.712 1.00 0.00 H ATOM 15720 H LEU B 494 45.954 56.182 94.444 1.00 0.00 H ATOM 15721 N PHE B 495 44.117 52.886 92.231 1.00 39.74 N ATOM 15722 CA PHE B 495 42.998 52.655 91.327 1.00 38.50 C ATOM 15723 C PHE B 495 41.860 52.219 92.281 1.00 39.17 C ATOM 15724 O PHE B 495 42.045 51.335 93.120 1.00 38.98 O ATOM 15725 CB PHE B 495 43.340 51.521 90.289 1.00 37.46 C ATOM 15726 CG PHE B 495 42.122 50.967 89.525 1.00 36.26 C ATOM 15727 CD1 PHE B 495 41.231 50.073 90.141 1.00 34.80 C ATOM 15728 CD2 PHE B 495 41.866 51.362 88.187 1.00 34.74 C ATOM 15729 CE1 PHE B 495 40.113 49.578 89.437 1.00 35.13 C ATOM 15730 CE2 PHE B 495 40.763 50.881 87.489 1.00 34.75 C ATOM 15731 CZ PHE B 495 39.879 49.982 88.110 1.00 34.10 C ATOM 15732 HA PHE B 495 42.739 53.528 90.728 1.00 0.00 H ATOM 15733 HB2 PHE B 495 44.044 51.926 89.561 1.00 0.00 H ATOM 15734 HB3 PHE B 495 43.809 50.697 90.827 1.00 0.00 H ATOM 15735 HD2 PHE B 495 42.547 52.057 87.696 1.00 0.00 H ATOM 15736 HE2 PHE B 495 40.585 51.201 86.462 1.00 0.00 H ATOM 15737 HZ PHE B 495 39.016 49.599 87.566 1.00 0.00 H ATOM 15738 HE1 PHE B 495 39.429 48.881 89.922 1.00 0.00 H ATOM 15739 HD1 PHE B 495 41.404 49.759 91.170 1.00 0.00 H ATOM 15740 H PHE B 495 44.793 52.117 92.417 1.00 0.00 H ATOM 15741 N THR B 496 40.703 52.870 92.186 1.00 40.95 N ATOM 15742 CA THR B 496 39.546 52.528 93.025 1.00 42.43 C ATOM 15743 C THR B 496 38.340 52.182 92.164 1.00 44.18 C ATOM 15744 O THR B 496 38.245 52.595 90.990 1.00 44.01 O ATOM 15745 CB THR B 496 39.126 53.692 93.979 1.00 41.11 C ATOM 15746 OG1 THR B 496 38.759 54.842 93.211 1.00 43.29 O ATOM 15747 CG2 THR B 496 40.267 54.056 94.907 1.00 41.05 C ATOM 15748 HA THR B 496 39.858 51.673 93.625 1.00 0.00 H ATOM 15749 HB THR B 496 38.275 53.360 94.574 1.00 0.00 H ATOM 15750 HG1 THR B 496 38.494 55.575 93.822 1.00 0.00 H ATOM 15751 HG23 THR B 496 40.549 53.182 95.494 1.00 0.00 H ATOM 15752 HG21 THR B 496 41.121 54.391 94.317 1.00 0.00 H ATOM 15753 HG22 THR B 496 39.949 54.857 95.575 1.00 0.00 H ATOM 15754 H THR B 496 40.615 53.644 91.497 1.00 0.00 H ATOM 15755 N THR B 497 37.416 51.429 92.747 1.00 46.80 N ATOM 15756 CA THR B 497 36.217 51.024 92.024 1.00 48.75 C ATOM 15757 C THR B 497 35.486 52.253 91.507 1.00 49.17 C ATOM 15758 O THR B 497 35.045 52.283 90.352 1.00 48.60 O ATOM 15759 CB THR B 497 35.217 50.247 92.936 1.00 50.47 C ATOM 15760 OG1 THR B 497 35.857 49.100 93.500 1.00 52.15 O ATOM 15761 CG2 THR B 497 34.028 49.777 92.118 1.00 50.38 C ATOM 15762 HA THR B 497 36.545 50.377 91.210 1.00 0.00 H ATOM 15763 HB THR B 497 34.885 50.916 93.730 1.00 0.00 H ATOM 15764 HG1 THR B 497 36.634 49.390 94.041 1.00 0.00 H ATOM 15765 HG23 THR B 497 33.527 50.640 91.679 1.00 0.00 H ATOM 15766 HG21 THR B 497 34.374 49.114 91.325 1.00 0.00 H ATOM 15767 HG22 THR B 497 33.333 49.241 92.764 1.00 0.00 H ATOM 15768 H THR B 497 37.549 51.124 93.732 1.00 0.00 H ATOM 15769 N LYS B 498 35.373 53.270 92.370 1.00 49.31 N ATOM 15770 CA LYS B 498 34.671 54.507 92.025 1.00 49.47 C ATOM 15771 C LYS B 498 35.361 55.372 90.974 1.00 49.03 C ATOM 15772 O LYS B 498 34.747 55.754 89.964 1.00 49.15 O ATOM 15773 CB LYS B 498 34.450 55.368 93.277 1.00 48.65 C ATOM 15774 HA LYS B 498 33.729 54.170 91.592 1.00 0.00 H ATOM 15775 HB2 LYS B 498 33.853 54.811 93.999 1.00 0.00 H ATOM 15776 HB3 LYS B 498 35.414 55.619 93.719 1.00 0.00 H ATOM 15777 H LYS B 498 35.797 53.178 93.315 1.00 0.00 H ATOM 15778 N GLU B 499 36.633 55.676 91.221 1.00 48.00 N ATOM 15779 CA GLU B 499 37.399 56.553 90.353 1.00 47.53 C ATOM 15780 C GLU B 499 38.107 55.948 89.147 1.00 45.49 C ATOM 15781 O GLU B 499 38.254 56.605 88.120 1.00 43.16 O ATOM 15782 CB GLU B 499 38.434 57.255 91.199 1.00 51.88 C ATOM 15783 CG GLU B 499 38.245 58.724 91.335 1.00 57.89 C ATOM 15784 CD GLU B 499 36.961 59.038 92.016 1.00 60.75 C ATOM 15785 OE1 GLU B 499 36.793 58.547 93.149 1.00 63.80 O ATOM 15786 OE2 GLU B 499 36.126 59.762 91.421 1.00 63.82 O ATOM 15787 HA GLU B 499 36.645 57.202 89.909 1.00 0.00 H ATOM 15788 HB2 GLU B 499 38.409 56.817 92.197 1.00 0.00 H ATOM 15789 HB3 GLU B 499 39.412 57.080 90.751 1.00 0.00 H ATOM 15790 HG2 GLU B 499 39.068 59.137 91.919 1.00 0.00 H ATOM 15791 HG3 GLU B 499 38.242 59.176 90.343 1.00 0.00 H ATOM 15792 H GLU B 499 37.093 55.273 92.062 1.00 0.00 H ATOM 15793 N GLN B 500 38.623 54.730 89.314 1.00 45.08 N ATOM 15794 CA GLN B 500 39.328 54.011 88.238 1.00 43.38 C ATOM 15795 C GLN B 500 40.504 54.737 87.598 1.00 41.37 C ATOM 15796 O GLN B 500 40.694 54.714 86.385 1.00 39.97 O ATOM 15797 CB GLN B 500 38.295 53.620 87.205 1.00 44.59 C ATOM 15798 CG GLN B 500 37.346 52.621 87.862 1.00 48.18 C ATOM 15799 CD GLN B 500 36.136 52.304 87.035 1.00 48.89 C ATOM 15800 OE1 GLN B 500 36.250 52.029 85.856 1.00 46.16 O ATOM 15801 NE2 GLN B 500 34.955 52.330 87.667 1.00 51.25 N ATOM 15802 HA GLN B 500 39.806 53.145 88.696 1.00 0.00 H ATOM 15803 HB2 GLN B 500 37.742 54.501 86.879 1.00 0.00 H ATOM 15804 HB3 GLN B 500 38.783 53.161 86.345 1.00 0.00 H ATOM 15805 HG2 GLN B 500 37.892 51.695 88.042 1.00 0.00 H ATOM 15806 HG3 GLN B 500 37.014 53.036 88.813 1.00 0.00 H ATOM 15807 HE22 GLN B 500 34.911 52.572 88.678 1.00 0.00 H ATOM 15808 HE21 GLN B 500 34.082 52.109 87.147 1.00 0.00 H ATOM 15809 H GLN B 500 38.524 54.269 90.241 1.00 0.00 H ATOM 15810 N LYS B 501 41.297 55.385 88.429 1.00 40.71 N ATOM 15811 CA LYS B 501 42.448 56.130 87.934 1.00 40.93 C ATOM 15812 C LYS B 501 43.639 55.238 87.561 1.00 40.69 C ATOM 15813 O LYS B 501 43.846 54.142 88.140 1.00 39.79 O ATOM 15814 CB LYS B 501 42.922 57.122 89.002 1.00 40.67 C ATOM 15815 CG LYS B 501 41.861 58.115 89.422 1.00 44.92 C ATOM 15816 CD LYS B 501 42.394 59.135 90.453 1.00 47.56 C ATOM 15817 CE LYS B 501 41.307 60.201 90.716 1.00 49.33 C ATOM 15818 NZ LYS B 501 41.699 61.102 91.804 1.00 51.90 N ATOM 15819 HA LYS B 501 42.111 56.637 87.030 1.00 0.00 H ATOM 15820 HB2 LYS B 501 43.234 56.559 89.881 1.00 0.00 H ATOM 15821 HB3 LYS B 501 43.774 57.675 88.605 1.00 0.00 H ATOM 15822 HG2 LYS B 501 41.515 58.654 88.540 1.00 0.00 H ATOM 15823 HG3 LYS B 501 41.026 57.572 89.864 1.00 0.00 H ATOM 15824 HD2 LYS B 501 42.635 58.622 91.384 1.00 0.00 H ATOM 15825 HD3 LYS B 501 43.290 59.616 90.062 1.00 0.00 H ATOM 15826 HE2 LYS B 501 40.377 59.701 90.986 1.00 0.00 H ATOM 15827 HE3 LYS B 501 41.154 60.785 89.808 1.00 0.00 H ATOM 15828 HZ1 LYS B 501 41.841 60.551 92.675 1.00 0.00 H ATOM 15829 HZ2 LYS B 501 42.584 61.586 91.550 1.00 0.00 H ATOM 15830 HZ3 LYS B 501 40.949 61.806 91.957 1.00 0.00 H ATOM 15831 H LYS B 501 41.099 55.364 89.450 1.00 0.00 H ATOM 15832 N PHE B 502 44.428 55.739 86.621 1.00 38.80 N ATOM 15833 CA PHE B 502 45.638 55.062 86.197 1.00 38.57 C ATOM 15834 C PHE B 502 46.569 56.160 85.675 1.00 38.77 C ATOM 15835 O PHE B 502 46.132 57.304 85.451 1.00 39.65 O ATOM 15836 CB PHE B 502 45.312 54.042 85.099 1.00 36.55 C ATOM 15837 CG PHE B 502 44.853 54.650 83.797 1.00 34.46 C ATOM 15838 CD1 PHE B 502 45.767 54.916 82.775 1.00 33.14 C ATOM 15839 CD2 PHE B 502 43.498 54.845 83.553 1.00 34.62 C ATOM 15840 CE1 PHE B 502 45.344 55.346 81.513 1.00 35.31 C ATOM 15841 CE2 PHE B 502 43.051 55.277 82.309 1.00 34.66 C ATOM 15842 CZ PHE B 502 43.973 55.528 81.265 1.00 34.45 C ATOM 15843 HA PHE B 502 46.106 54.509 87.011 1.00 0.00 H ATOM 15844 HB2 PHE B 502 46.209 53.454 84.903 1.00 0.00 H ATOM 15845 HB3 PHE B 502 44.522 53.387 85.466 1.00 0.00 H ATOM 15846 HD2 PHE B 502 42.776 54.657 84.348 1.00 0.00 H ATOM 15847 HE2 PHE B 502 41.985 55.423 82.137 1.00 0.00 H ATOM 15848 HZ PHE B 502 43.626 55.857 80.286 1.00 0.00 H ATOM 15849 HE1 PHE B 502 46.074 55.539 80.727 1.00 0.00 H ATOM 15850 HD1 PHE B 502 46.832 54.786 82.965 1.00 0.00 H ATOM 15851 H PHE B 502 44.172 56.643 86.175 1.00 0.00 H ATOM 15852 N ILE B 503 47.844 55.832 85.499 1.00 38.76 N ATOM 15853 CA ILE B 503 48.799 56.810 84.980 1.00 38.02 C ATOM 15854 C ILE B 503 49.424 56.307 83.679 1.00 39.06 C ATOM 15855 O ILE B 503 49.410 55.106 83.393 1.00 38.02 O ATOM 15856 CB ILE B 503 49.965 57.066 85.977 1.00 39.27 C ATOM 15857 CG1 ILE B 503 50.714 55.748 86.218 1.00 39.36 C ATOM 15858 CG2 ILE B 503 49.447 57.651 87.295 1.00 37.54 C ATOM 15859 CD1 ILE B 503 52.137 55.924 86.689 1.00 43.39 C ATOM 15860 HA ILE B 503 48.240 57.732 84.820 1.00 0.00 H ATOM 15861 HB ILE B 503 50.649 57.798 85.548 1.00 0.00 H ATOM 15862 HG12 ILE B 503 50.171 55.179 86.973 1.00 0.00 H ATOM 15863 HG13 ILE B 503 50.730 55.187 85.283 1.00 0.00 H ATOM 15864 HD11 ILE B 503 52.700 56.481 85.940 1.00 0.00 H ATOM 15865 HD12 ILE B 503 52.141 56.473 87.631 1.00 0.00 H ATOM 15866 HD13 ILE B 503 52.594 54.945 86.835 1.00 0.00 H ATOM 15867 HG21 ILE B 503 48.943 58.597 87.098 1.00 0.00 H ATOM 15868 HG22 ILE B 503 48.746 56.952 87.751 1.00 0.00 H ATOM 15869 HG23 ILE B 503 50.285 57.819 87.971 1.00 0.00 H ATOM 15870 H ILE B 503 48.166 54.871 85.732 1.00 0.00 H ATOM 15871 N ASP B 504 49.954 57.229 82.884 1.00 38.96 N ATOM 15872 CA ASP B 504 50.628 56.856 81.667 1.00 41.43 C ATOM 15873 C ASP B 504 52.034 56.650 82.164 1.00 41.17 C ATOM 15874 O ASP B 504 52.449 57.263 83.153 1.00 40.93 O ATOM 15875 CB ASP B 504 50.712 57.984 80.626 1.00 44.35 C ATOM 15876 CG ASP B 504 49.371 58.410 80.092 1.00 48.52 C ATOM 15877 OD1 ASP B 504 48.496 57.536 79.900 1.00 48.24 O ATOM 15878 OD2 ASP B 504 49.205 59.634 79.852 1.00 50.83 O ATOM 15879 HA ASP B 504 50.121 56.022 81.182 1.00 0.00 H ATOM 15880 HB2 ASP B 504 51.189 58.847 81.090 1.00 0.00 H ATOM 15881 HB3 ASP B 504 51.322 57.639 79.791 1.00 0.00 H ATOM 15882 H ASP B 504 49.882 58.234 83.143 1.00 0.00 H ATOM 15883 N LEU B 505 52.771 55.812 81.464 1.00 40.30 N ATOM 15884 CA LEU B 505 54.140 55.567 81.832 1.00 42.85 C ATOM 15885 C LEU B 505 54.978 55.911 80.585 1.00 43.13 C ATOM 15886 O LEU B 505 55.014 55.133 79.598 1.00 42.92 O ATOM 15887 CB LEU B 505 54.275 54.104 82.226 1.00 42.40 C ATOM 15888 CG LEU B 505 54.994 53.616 83.467 1.00 44.47 C ATOM 15889 CD1 LEU B 505 55.028 54.657 84.609 1.00 41.60 C ATOM 15890 CD2 LEU B 505 54.304 52.314 83.855 1.00 40.79 C ATOM 15891 HA LEU B 505 54.476 56.165 82.679 1.00 0.00 H ATOM 15892 HB2 LEU B 505 53.256 53.727 82.309 1.00 0.00 H ATOM 15893 HB3 LEU B 505 54.774 53.618 81.387 1.00 0.00 H ATOM 15894 HG LEU B 505 56.052 53.451 83.263 1.00 0.00 H ATOM 15895 HD21 LEU B 505 53.251 52.509 84.056 1.00 0.00 H ATOM 15896 HD22 LEU B 505 54.393 51.599 83.037 1.00 0.00 H ATOM 15897 HD23 LEU B 505 54.777 51.906 84.748 1.00 0.00 H ATOM 15898 HD11 LEU B 505 55.542 55.555 84.265 1.00 0.00 H ATOM 15899 HD12 LEU B 505 54.008 54.909 84.900 1.00 0.00 H ATOM 15900 HD13 LEU B 505 55.558 54.239 85.465 1.00 0.00 H ATOM 15901 H LEU B 505 52.361 55.325 80.641 1.00 0.00 H ATOM 15902 N ASN B 506 55.625 57.083 80.607 1.00 43.38 N ATOM 15903 CA ASN B 506 56.452 57.502 79.467 1.00 44.91 C ATOM 15904 C ASN B 506 57.453 58.595 79.868 1.00 46.31 C ATOM 15905 O ASN B 506 57.607 58.892 81.056 1.00 46.81 O ATOM 15906 CB ASN B 506 55.561 57.978 78.321 1.00 44.33 C ATOM 15907 CG ASN B 506 54.705 59.157 78.717 1.00 44.24 C ATOM 15908 OD1 ASN B 506 55.187 60.092 79.334 1.00 44.71 O ATOM 15909 ND2 ASN B 506 53.437 59.117 78.363 1.00 42.97 N ATOM 15910 HA ASN B 506 57.029 56.640 79.132 1.00 0.00 H ATOM 15911 HB2 ASN B 506 56.193 58.269 77.482 1.00 0.00 H ATOM 15912 HB3 ASN B 506 54.911 57.158 78.017 1.00 0.00 H ATOM 15913 HD22 ASN B 506 53.069 58.298 77.837 1.00 0.00 H ATOM 15914 HD21 ASN B 506 52.803 59.904 78.609 1.00 0.00 H ATOM 15915 H ASN B 506 55.541 57.702 81.438 1.00 0.00 H ATOM 15916 N THR B 507 58.139 59.195 78.908 1.00 47.19 N ATOM 15917 CA THR B 507 59.139 60.218 79.261 1.00 49.74 C ATOM 15918 C THR B 507 58.593 61.641 79.564 1.00 51.30 C ATOM 15919 O THR B 507 59.344 62.536 79.958 1.00 52.79 O ATOM 15920 CB THR B 507 60.234 60.277 78.168 1.00 48.36 C ATOM 15921 OG1 THR B 507 59.628 60.526 76.902 1.00 49.59 O ATOM 15922 CG2 THR B 507 60.956 58.930 78.045 1.00 47.94 C ATOM 15923 HA THR B 507 59.549 59.888 80.215 1.00 0.00 H ATOM 15924 HB THR B 507 60.935 61.064 78.446 1.00 0.00 H ATOM 15925 HG1 THR B 507 58.991 59.797 76.693 1.00 0.00 H ATOM 15926 HG23 THR B 507 61.440 58.691 78.992 1.00 0.00 H ATOM 15927 HG21 THR B 507 60.233 58.153 77.798 1.00 0.00 H ATOM 15928 HG22 THR B 507 61.707 58.992 77.258 1.00 0.00 H ATOM 15929 H THR B 507 57.973 58.946 77.912 1.00 0.00 H ATOM 15930 N GLU B 508 57.284 61.827 79.415 1.00 52.43 N ATOM 15931 CA GLU B 508 56.625 63.115 79.654 1.00 52.80 C ATOM 15932 C GLU B 508 56.182 63.166 81.102 1.00 54.44 C ATOM 15933 O GLU B 508 56.146 62.142 81.774 1.00 54.36 O ATOM 15934 CB GLU B 508 55.391 63.277 78.740 1.00 51.62 C ATOM 15935 CG GLU B 508 55.679 63.202 77.233 1.00 51.66 C ATOM 15936 HA GLU B 508 57.325 63.921 79.435 1.00 0.00 H ATOM 15937 HB2 GLU B 508 54.682 62.487 78.988 1.00 0.00 H ATOM 15938 HB3 GLU B 508 54.941 64.247 78.950 1.00 0.00 H ATOM 15939 HG2 GLU B 508 56.376 63.994 76.958 1.00 0.00 H ATOM 15940 HG3 GLU B 508 56.117 62.232 76.996 1.00 0.00 H ATOM 15941 H GLU B 508 56.700 61.020 79.115 1.00 0.00 H ATOM 15942 N PRO B 509 55.851 64.365 81.620 1.00 55.57 N ATOM 15943 CA PRO B 509 55.414 64.451 83.017 1.00 56.32 C ATOM 15944 C PRO B 509 54.154 63.614 83.203 1.00 56.83 C ATOM 15945 O PRO B 509 53.234 63.685 82.402 1.00 57.07 O ATOM 15946 CB PRO B 509 55.129 65.934 83.212 1.00 55.31 C ATOM 15947 CG PRO B 509 56.052 66.585 82.228 1.00 56.14 C ATOM 15948 CD PRO B 509 55.941 65.702 81.012 1.00 56.05 C ATOM 15949 HA PRO B 509 56.145 64.077 83.734 1.00 0.00 H ATOM 15950 HD3 PRO B 509 55.049 65.936 80.431 1.00 0.00 H ATOM 15951 HD2 PRO B 509 56.821 65.790 80.375 1.00 0.00 H ATOM 15952 HG3 PRO B 509 57.075 66.604 82.605 1.00 0.00 H ATOM 15953 HG2 PRO B 509 55.730 67.602 82.003 1.00 0.00 H ATOM 15954 HB2 PRO B 509 54.088 66.166 82.987 1.00 0.00 H ATOM 15955 HB3 PRO B 509 55.358 66.247 84.231 1.00 0.00 H ATOM 15956 N MET B 510 54.120 62.844 84.280 1.00 57.33 N ATOM 15957 CA MET B 510 53.011 61.965 84.592 1.00 57.06 C ATOM 15958 C MET B 510 51.632 62.586 84.453 1.00 56.72 C ATOM 15959 O MET B 510 51.394 63.692 84.923 1.00 57.98 O ATOM 15960 CB MET B 510 53.174 61.459 86.017 1.00 58.65 C ATOM 15961 CG MET B 510 52.049 60.543 86.500 1.00 59.82 C ATOM 15962 SD MET B 510 52.120 60.249 88.286 1.00 61.87 S ATOM 15963 CE MET B 510 53.480 59.120 88.353 1.00 61.23 C ATOM 15964 HA MET B 510 53.053 61.165 83.853 1.00 0.00 H ATOM 15965 HB2 MET B 510 54.112 60.907 86.077 1.00 0.00 H ATOM 15966 HB3 MET B 510 53.219 62.322 86.681 1.00 0.00 H ATOM 15967 HG2 MET B 510 52.129 59.586 85.984 1.00 0.00 H ATOM 15968 HG3 MET B 510 51.092 61.006 86.258 1.00 0.00 H ATOM 15969 HE1 MET B 510 53.243 58.233 87.766 1.00 0.00 H ATOM 15970 HE2 MET B 510 54.370 59.600 87.946 1.00 0.00 H ATOM 15971 HE3 MET B 510 53.662 58.833 89.389 1.00 0.00 H ATOM 15972 H MET B 510 54.929 62.872 84.934 1.00 0.00 H ATOM 15973 N LYS B 511 50.724 61.875 83.795 1.00 55.23 N ATOM 15974 CA LYS B 511 49.331 62.321 83.662 1.00 53.94 C ATOM 15975 C LYS B 511 48.479 61.179 84.213 1.00 52.67 C ATOM 15976 O LYS B 511 48.808 59.986 84.038 1.00 52.66 O ATOM 15977 CB LYS B 511 48.924 62.571 82.214 1.00 55.15 C ATOM 15978 CG LYS B 511 49.534 63.798 81.604 1.00 58.89 C ATOM 15979 CD LYS B 511 48.899 64.102 80.226 1.00 62.25 C ATOM 15980 CE LYS B 511 49.632 65.252 79.488 1.00 63.42 C ATOM 15981 NZ LYS B 511 49.251 65.352 78.022 1.00 64.81 N ATOM 15982 HA LYS B 511 49.199 63.264 84.192 1.00 0.00 H ATOM 15983 HB2 LYS B 511 49.226 61.708 81.620 1.00 0.00 H ATOM 15984 HB3 LYS B 511 47.840 62.674 82.177 1.00 0.00 H ATOM 15985 HG2 LYS B 511 49.370 64.647 82.268 1.00 0.00 H ATOM 15986 HG3 LYS B 511 50.605 63.639 81.477 1.00 0.00 H ATOM 15987 HD2 LYS B 511 48.945 63.203 79.611 1.00 0.00 H ATOM 15988 HD3 LYS B 511 47.857 64.386 80.374 1.00 0.00 H ATOM 15989 HE2 LYS B 511 50.706 65.081 79.557 1.00 0.00 H ATOM 15990 HE3 LYS B 511 49.383 66.194 79.977 1.00 0.00 H ATOM 15991 HZ1 LYS B 511 49.492 64.462 77.541 1.00 0.00 H ATOM 15992 HZ2 LYS B 511 48.229 65.525 77.942 1.00 0.00 H ATOM 15993 HZ3 LYS B 511 49.772 66.137 77.582 1.00 0.00 H ATOM 15994 H LYS B 511 51.008 60.974 83.360 1.00 0.00 H ATOM 15995 N VAL B 512 47.412 61.558 84.902 1.00 49.47 N ATOM 15996 CA VAL B 512 46.480 60.626 85.483 1.00 48.16 C ATOM 15997 C VAL B 512 45.248 60.677 84.605 1.00 47.80 C ATOM 15998 O VAL B 512 44.840 61.760 84.165 1.00 47.71 O ATOM 15999 CB VAL B 512 46.091 61.046 86.906 1.00 47.12 C ATOM 16000 CG1 VAL B 512 44.968 60.147 87.435 1.00 47.71 C ATOM 16001 CG2 VAL B 512 47.327 60.988 87.827 1.00 46.49 C ATOM 16002 HA VAL B 512 46.919 59.630 85.541 1.00 0.00 H ATOM 16003 HB VAL B 512 45.723 62.072 86.889 1.00 0.00 H ATOM 16004 HG11 VAL B 512 44.097 60.236 86.786 1.00 0.00 H ATOM 16005 HG12 VAL B 512 45.309 59.112 87.449 1.00 0.00 H ATOM 16006 HG13 VAL B 512 44.702 60.457 88.446 1.00 0.00 H ATOM 16007 HG21 VAL B 512 47.717 59.970 87.846 1.00 0.00 H ATOM 16008 HG22 VAL B 512 48.093 61.665 87.448 1.00 0.00 H ATOM 16009 HG23 VAL B 512 47.042 61.288 88.835 1.00 0.00 H ATOM 16010 H VAL B 512 47.240 62.576 85.029 1.00 0.00 H ATOM 16011 N HIS B 513 44.669 59.514 84.322 1.00 46.50 N ATOM 16012 CA HIS B 513 43.444 59.455 83.506 1.00 45.50 C ATOM 16013 C HIS B 513 42.479 58.522 84.229 1.00 44.79 C ATOM 16014 O HIS B 513 42.815 57.961 85.285 1.00 45.91 O ATOM 16015 CB HIS B 513 43.720 58.850 82.128 1.00 45.68 C ATOM 16016 CG HIS B 513 44.868 59.467 81.400 1.00 46.61 C ATOM 16017 ND1 HIS B 513 44.773 60.686 80.758 1.00 48.56 N ATOM 16018 CD2 HIS B 513 46.103 58.989 81.123 1.00 47.53 C ATOM 16019 CE1 HIS B 513 45.901 60.921 80.106 1.00 48.02 C ATOM 16020 NE2 HIS B 513 46.723 59.907 80.310 1.00 47.44 N ATOM 16021 HA HIS B 513 43.049 60.462 83.373 1.00 0.00 H ATOM 16022 HB2 HIS B 513 43.930 57.788 82.258 1.00 0.00 H ATOM 16023 HB3 HIS B 513 42.825 58.970 81.518 1.00 0.00 H ATOM 16024 HD2 HIS B 513 46.527 58.050 81.479 1.00 0.00 H ATOM 16025 HE1 HIS B 513 46.115 61.803 79.502 1.00 0.00 H ATOM 16026 H HIS B 513 45.087 58.633 84.682 1.00 0.00 H ATOM 16027 N GLN B 514 41.304 58.316 83.650 1.00 43.42 N ATOM 16028 CA GLN B 514 40.309 57.430 84.249 1.00 42.82 C ATOM 16029 C GLN B 514 39.632 56.498 83.253 1.00 40.24 C ATOM 16030 O GLN B 514 39.501 56.816 82.092 1.00 37.62 O ATOM 16031 CB GLN B 514 39.234 58.255 84.947 1.00 44.76 C ATOM 16032 CG GLN B 514 39.766 58.974 86.149 1.00 48.75 C ATOM 16033 CD GLN B 514 38.737 59.887 86.770 1.00 51.07 C ATOM 16034 OE1 GLN B 514 38.590 61.038 86.371 1.00 53.70 O ATOM 16035 NE2 GLN B 514 38.007 59.370 87.742 1.00 52.40 N ATOM 16036 HA GLN B 514 40.855 56.805 84.956 1.00 0.00 H ATOM 16037 HB2 GLN B 514 38.842 58.989 84.243 1.00 0.00 H ATOM 16038 HB3 GLN B 514 38.430 57.590 85.262 1.00 0.00 H ATOM 16039 HG2 GLN B 514 40.075 58.237 86.891 1.00 0.00 H ATOM 16040 HG3 GLN B 514 40.628 59.569 85.849 1.00 0.00 H ATOM 16041 HE22 GLN B 514 38.167 58.389 88.047 1.00 0.00 H ATOM 16042 HE21 GLN B 514 37.272 59.944 88.202 1.00 0.00 H ATOM 16043 H GLN B 514 41.087 58.794 82.752 1.00 0.00 H ATOM 16044 N ARG B 515 39.198 55.343 83.747 1.00 40.59 N ATOM 16045 CA ARG B 515 38.473 54.363 82.940 1.00 40.23 C ATOM 16046 C ARG B 515 39.148 53.992 81.608 1.00 39.30 C ATOM 16047 O ARG B 515 38.652 54.305 80.507 1.00 35.77 O ATOM 16048 CB ARG B 515 37.068 54.908 82.695 1.00 40.49 C ATOM 16049 CG ARG B 515 36.271 55.126 84.002 1.00 42.12 C ATOM 16050 CD ARG B 515 34.823 55.613 83.721 1.00 43.30 C ATOM 16051 NE ARG B 515 33.986 55.677 84.921 1.00 44.31 N ATOM 16052 HA ARG B 515 38.456 53.430 83.503 1.00 0.00 H ATOM 16053 HB2 ARG B 515 37.151 55.862 82.174 1.00 0.00 H ATOM 16054 HB3 ARG B 515 36.524 54.200 82.070 1.00 0.00 H ATOM 16055 HG2 ARG B 515 36.227 54.185 84.550 1.00 0.00 H ATOM 16056 HG3 ARG B 515 36.784 55.873 84.608 1.00 0.00 H ATOM 16057 HD2 ARG B 515 34.359 54.927 83.012 1.00 0.00 H ATOM 16058 HD3 ARG B 515 34.873 56.609 83.281 1.00 0.00 H ATOM 16059 HE ARG B 515 34.381 55.409 85.845 1.00 0.00 H ATOM 16060 H ARG B 515 39.382 55.128 84.748 1.00 0.00 H ATOM 16061 N LEU B 516 40.291 53.328 81.753 1.00 39.11 N ATOM 16062 CA LEU B 516 41.134 52.871 80.638 1.00 40.14 C ATOM 16063 C LEU B 516 40.307 52.089 79.609 1.00 39.35 C ATOM 16064 O LEU B 516 39.785 51.026 79.909 1.00 38.00 O ATOM 16065 CB LEU B 516 42.301 52.000 81.201 1.00 40.07 C ATOM 16066 CG LEU B 516 43.283 51.319 80.254 1.00 41.47 C ATOM 16067 CD1 LEU B 516 43.650 52.265 79.169 1.00 42.99 C ATOM 16068 CD2 LEU B 516 44.542 50.920 81.028 1.00 41.40 C ATOM 16069 HA LEU B 516 41.552 53.737 80.125 1.00 0.00 H ATOM 16070 HB2 LEU B 516 42.890 52.648 81.850 1.00 0.00 H ATOM 16071 HB3 LEU B 516 41.843 51.211 81.797 1.00 0.00 H ATOM 16072 HG LEU B 516 42.823 50.429 79.825 1.00 0.00 H ATOM 16073 HD21 LEU B 516 45.004 51.811 81.453 1.00 0.00 H ATOM 16074 HD22 LEU B 516 44.272 50.232 81.829 1.00 0.00 H ATOM 16075 HD23 LEU B 516 45.244 50.433 80.351 1.00 0.00 H ATOM 16076 HD11 LEU B 516 42.753 52.554 78.621 1.00 0.00 H ATOM 16077 HD12 LEU B 516 44.113 53.151 79.603 1.00 0.00 H ATOM 16078 HD13 LEU B 516 44.352 51.782 78.490 1.00 0.00 H ATOM 16079 H LEU B 516 40.610 53.118 82.720 1.00 0.00 H ATOM 16080 N ARG B 517 40.225 52.650 78.399 1.00 39.68 N ATOM 16081 CA ARG B 517 39.471 52.116 77.265 1.00 39.15 C ATOM 16082 C ARG B 517 38.087 51.564 77.643 1.00 37.60 C ATOM 16083 O ARG B 517 37.654 50.522 77.118 1.00 36.22 O ATOM 16084 CB ARG B 517 40.349 51.070 76.522 1.00 39.37 C ATOM 16085 CG ARG B 517 41.484 51.792 75.729 1.00 41.14 C ATOM 16086 CD ARG B 517 42.325 50.872 74.865 1.00 40.83 C ATOM 16087 NE ARG B 517 41.634 50.449 73.643 1.00 41.27 N ATOM 16088 CZ ARG B 517 41.362 51.245 72.610 1.00 39.54 C ATOM 16089 NH1 ARG B 517 41.730 52.522 72.675 1.00 40.77 N ATOM 16090 NH2 ARG B 517 40.744 50.778 71.514 1.00 33.50 N ATOM 16091 HA ARG B 517 39.248 52.943 76.591 1.00 0.00 H ATOM 16092 HB2 ARG B 517 40.793 50.389 77.249 1.00 0.00 H ATOM 16093 HB3 ARG B 517 39.727 50.504 75.828 1.00 0.00 H ATOM 16094 HG2 ARG B 517 41.026 52.542 75.084 1.00 0.00 H ATOM 16095 HG3 ARG B 517 42.142 52.284 76.446 1.00 0.00 H ATOM 16096 HD2 ARG B 517 42.580 49.985 75.446 1.00 0.00 H ATOM 16097 HD3 ARG B 517 43.239 51.396 74.585 1.00 0.00 H ATOM 16098 HE ARG B 517 41.334 49.455 73.578 1.00 0.00 H ATOM 16099 HH12 ARG B 517 41.528 53.162 71.881 1.00 0.00 H ATOM 16100 HH11 ARG B 517 42.219 52.880 73.520 1.00 0.00 H ATOM 16101 HH22 ARG B 517 40.541 51.417 70.719 1.00 0.00 H ATOM 16102 HH21 ARG B 517 40.468 49.777 71.460 1.00 0.00 H ATOM 16103 H ARG B 517 40.741 53.541 78.251 1.00 0.00 H ATOM 16104 N VAL B 518 37.382 52.263 78.538 1.00 36.54 N ATOM 16105 CA VAL B 518 36.054 51.775 78.951 1.00 37.34 C ATOM 16106 C VAL B 518 35.097 51.472 77.803 1.00 37.41 C ATOM 16107 O VAL B 518 34.376 50.486 77.841 1.00 36.36 O ATOM 16108 CB VAL B 518 35.162 52.755 79.688 1.00 36.98 C ATOM 16109 CG1 VAL B 518 34.783 52.185 80.992 1.00 35.97 C ATOM 16110 CG2 VAL B 518 35.703 54.152 79.622 1.00 35.80 C ATOM 16111 HA VAL B 518 36.396 50.928 79.546 1.00 0.00 H ATOM 16112 HB VAL B 518 34.201 52.896 79.194 1.00 0.00 H ATOM 16113 HG11 VAL B 518 34.246 51.249 80.836 1.00 0.00 H ATOM 16114 HG12 VAL B 518 35.681 51.996 81.580 1.00 0.00 H ATOM 16115 HG13 VAL B 518 34.142 52.889 81.522 1.00 0.00 H ATOM 16116 HG21 VAL B 518 36.693 54.179 80.077 1.00 0.00 H ATOM 16117 HG22 VAL B 518 35.771 54.465 78.580 1.00 0.00 H ATOM 16118 HG23 VAL B 518 35.036 54.824 80.162 1.00 0.00 H ATOM 16119 H VAL B 518 37.767 53.142 78.939 1.00 0.00 H ATOM 16120 N GLN B 519 35.050 52.384 76.839 1.00 38.32 N ATOM 16121 CA GLN B 519 34.113 52.284 75.711 1.00 41.01 C ATOM 16122 C GLN B 519 34.260 50.944 74.995 1.00 39.86 C ATOM 16123 O GLN B 519 33.304 50.209 74.836 1.00 39.68 O ATOM 16124 CB GLN B 519 34.340 53.476 74.750 1.00 42.34 C ATOM 16125 CG GLN B 519 33.189 53.769 73.787 1.00 45.76 C ATOM 16126 CD GLN B 519 31.927 54.275 74.495 1.00 47.66 C ATOM 16127 OE1 GLN B 519 31.997 55.052 75.461 1.00 48.82 O ATOM 16128 NE2 GLN B 519 30.765 53.832 74.017 1.00 48.82 N ATOM 16129 HA GLN B 519 33.090 52.330 76.086 1.00 0.00 H ATOM 16130 HB2 GLN B 519 34.509 54.368 75.354 1.00 0.00 H ATOM 16131 HB3 GLN B 519 35.230 53.266 74.157 1.00 0.00 H ATOM 16132 HG2 GLN B 519 33.516 54.527 73.076 1.00 0.00 H ATOM 16133 HG3 GLN B 519 32.943 52.852 73.251 1.00 0.00 H ATOM 16134 HE22 GLN B 519 30.751 53.182 73.206 1.00 0.00 H ATOM 16135 HE21 GLN B 519 29.872 54.137 74.455 1.00 0.00 H ATOM 16136 H GLN B 519 35.698 53.196 76.884 1.00 0.00 H ATOM 16137 N MET B 520 35.473 50.626 74.586 1.00 39.35 N ATOM 16138 CA MET B 520 35.727 49.367 73.921 1.00 40.10 C ATOM 16139 C MET B 520 35.586 48.184 74.885 1.00 39.92 C ATOM 16140 O MET B 520 35.029 47.161 74.520 1.00 40.73 O ATOM 16141 CB MET B 520 37.129 49.392 73.279 1.00 42.27 C ATOM 16142 CG MET B 520 37.254 50.362 72.099 1.00 45.15 C ATOM 16143 SD MET B 520 35.954 50.002 70.756 1.00 53.36 S ATOM 16144 CE MET B 520 34.764 51.232 71.123 1.00 49.27 C ATOM 16145 HA MET B 520 34.980 49.233 73.138 1.00 0.00 H ATOM 16146 HB2 MET B 520 37.851 49.684 74.042 1.00 0.00 H ATOM 16147 HB3 MET B 520 37.363 48.388 72.925 1.00 0.00 H ATOM 16148 HG2 MET B 520 38.249 50.264 71.664 1.00 0.00 H ATOM 16149 HG3 MET B 520 37.116 51.381 72.462 1.00 0.00 H ATOM 16150 HE1 MET B 520 34.397 51.089 72.139 1.00 0.00 H ATOM 16151 HE2 MET B 520 35.223 52.217 71.037 1.00 0.00 H ATOM 16152 HE3 MET B 520 33.934 51.154 70.421 1.00 0.00 H ATOM 16153 H MET B 520 36.258 51.290 74.744 1.00 0.00 H ATOM 16154 N CYS B 521 36.074 48.298 76.124 1.00 38.78 N ATOM 16155 CA CYS B 521 35.947 47.160 77.005 1.00 37.59 C ATOM 16156 C CYS B 521 34.512 46.843 77.409 1.00 37.53 C ATOM 16157 O CYS B 521 34.198 45.695 77.707 1.00 36.01 O ATOM 16158 CB CYS B 521 36.852 47.331 78.208 1.00 38.09 C ATOM 16159 SG CYS B 521 38.608 47.286 77.685 1.00 37.09 S ATOM 16160 HA CYS B 521 36.270 46.287 76.438 1.00 0.00 H ATOM 16161 HB2 CYS B 521 36.666 46.525 78.917 1.00 0.00 H ATOM 16162 HB3 CYS B 521 36.642 48.288 78.685 1.00 0.00 H ATOM 16163 H CYS B 521 36.530 49.177 76.443 1.00 0.00 H ATOM 16164 N VAL B 522 33.607 47.825 77.401 1.00 37.97 N ATOM 16165 CA VAL B 522 32.203 47.460 77.695 1.00 37.42 C ATOM 16166 C VAL B 522 31.713 46.550 76.520 1.00 36.80 C ATOM 16167 O VAL B 522 30.916 45.611 76.709 1.00 37.04 O ATOM 16168 CB VAL B 522 31.293 48.699 77.791 1.00 38.86 C ATOM 16169 CG1 VAL B 522 29.788 48.264 77.780 1.00 37.79 C ATOM 16170 CG2 VAL B 522 31.585 49.446 79.107 1.00 37.15 C ATOM 16171 HA VAL B 522 32.155 46.951 78.657 1.00 0.00 H ATOM 16172 HB VAL B 522 31.489 49.349 76.938 1.00 0.00 H ATOM 16173 HG11 VAL B 522 29.572 47.732 76.854 1.00 0.00 H ATOM 16174 HG12 VAL B 522 29.594 47.610 78.630 1.00 0.00 H ATOM 16175 HG13 VAL B 522 29.155 49.149 77.848 1.00 0.00 H ATOM 16176 HG21 VAL B 522 31.390 48.784 79.950 1.00 0.00 H ATOM 16177 HG22 VAL B 522 32.629 49.758 79.122 1.00 0.00 H ATOM 16178 HG23 VAL B 522 30.941 50.323 79.176 1.00 0.00 H ATOM 16179 H VAL B 522 33.878 48.808 77.196 1.00 0.00 H ATOM 16180 N PHE B 523 32.190 46.820 75.308 1.00 34.97 N ATOM 16181 CA PHE B 523 31.834 45.980 74.156 1.00 34.02 C ATOM 16182 C PHE B 523 32.391 44.547 74.310 1.00 34.65 C ATOM 16183 O PHE B 523 31.657 43.562 74.183 1.00 33.74 O ATOM 16184 CB PHE B 523 32.371 46.586 72.857 1.00 32.12 C ATOM 16185 CG PHE B 523 32.276 45.670 71.684 1.00 34.76 C ATOM 16186 CD1 PHE B 523 31.106 45.612 70.913 1.00 36.07 C ATOM 16187 CD2 PHE B 523 33.364 44.865 71.324 1.00 34.93 C ATOM 16188 CE1 PHE B 523 31.029 44.762 69.773 1.00 34.87 C ATOM 16189 CE2 PHE B 523 33.307 44.022 70.219 1.00 34.43 C ATOM 16190 CZ PHE B 523 32.126 43.977 69.430 1.00 37.15 C ATOM 16191 HA PHE B 523 30.746 45.934 74.116 1.00 0.00 H ATOM 16192 HB2 PHE B 523 31.801 47.488 72.636 1.00 0.00 H ATOM 16193 HB3 PHE B 523 33.419 46.847 73.006 1.00 0.00 H ATOM 16194 HD2 PHE B 523 34.275 44.900 71.922 1.00 0.00 H ATOM 16195 HE2 PHE B 523 34.163 43.399 69.960 1.00 0.00 H ATOM 16196 HZ PHE B 523 32.079 43.328 68.556 1.00 0.00 H ATOM 16197 HE1 PHE B 523 30.119 44.726 69.174 1.00 0.00 H ATOM 16198 HD1 PHE B 523 30.247 46.224 71.189 1.00 0.00 H ATOM 16199 H PHE B 523 32.822 47.635 75.174 1.00 0.00 H ATOM 16200 N TRP B 524 33.687 44.436 74.581 1.00 33.59 N ATOM 16201 CA TRP B 524 34.310 43.114 74.748 1.00 34.12 C ATOM 16202 C TRP B 524 33.904 42.328 76.003 1.00 34.27 C ATOM 16203 O TRP B 524 33.786 41.119 75.937 1.00 34.47 O ATOM 16204 CB TRP B 524 35.850 43.226 74.742 1.00 31.49 C ATOM 16205 CG TRP B 524 36.367 43.604 73.356 1.00 31.69 C ATOM 16206 CD1 TRP B 524 36.830 44.837 72.965 1.00 28.64 C ATOM 16207 CD2 TRP B 524 36.415 42.765 72.195 1.00 29.02 C ATOM 16208 NE1 TRP B 524 37.163 44.811 71.649 1.00 31.05 N ATOM 16209 CE2 TRP B 524 36.918 43.550 71.142 1.00 30.10 C ATOM 16210 CE3 TRP B 524 36.094 41.432 71.950 1.00 29.94 C ATOM 16211 CZ2 TRP B 524 37.105 43.046 69.844 1.00 29.50 C ATOM 16212 CZ3 TRP B 524 36.286 40.918 70.654 1.00 29.04 C ATOM 16213 CH2 TRP B 524 36.786 41.726 69.617 1.00 30.02 C ATOM 16214 HA TRP B 524 33.932 42.553 73.893 1.00 0.00 H ATOM 16215 HB2 TRP B 524 36.155 43.990 75.457 1.00 0.00 H ATOM 16216 HB3 TRP B 524 36.278 42.267 75.033 1.00 0.00 H ATOM 16217 HE1 TRP B 524 37.543 45.614 71.108 1.00 0.00 H ATOM 16218 HD1 TRP B 524 36.917 45.707 73.615 1.00 0.00 H ATOM 16219 HZ2 TRP B 524 37.490 43.678 69.044 1.00 0.00 H ATOM 16220 HH2 TRP B 524 36.923 41.302 68.622 1.00 0.00 H ATOM 16221 HZ3 TRP B 524 36.043 39.875 70.450 1.00 0.00 H ATOM 16222 HE3 TRP B 524 35.702 40.799 72.746 1.00 0.00 H ATOM 16223 H TRP B 524 34.268 45.294 74.676 1.00 0.00 H ATOM 16224 N ASN B 525 33.685 43.010 77.124 1.00 35.37 N ATOM 16225 CA ASN B 525 33.364 42.323 78.376 1.00 37.82 C ATOM 16226 C ASN B 525 31.901 42.150 78.681 1.00 38.34 C ATOM 16227 O ASN B 525 31.561 41.269 79.421 1.00 38.10 O ATOM 16228 CB ASN B 525 34.027 43.019 79.575 1.00 36.04 C ATOM 16229 CG ASN B 525 35.557 43.067 79.432 1.00 39.95 C ATOM 16230 OD1 ASN B 525 36.124 42.240 78.729 1.00 40.90 O ATOM 16231 ND2 ASN B 525 36.213 44.035 80.078 1.00 35.97 N ATOM 16232 HA ASN B 525 33.763 41.321 78.218 1.00 0.00 H ATOM 16233 HB2 ASN B 525 33.647 44.038 79.646 1.00 0.00 H ATOM 16234 HB3 ASN B 525 33.774 42.474 80.484 1.00 0.00 H ATOM 16235 HD22 ASN B 525 35.690 44.716 80.664 1.00 0.00 H ATOM 16236 HD21 ASN B 525 37.247 44.108 79.994 1.00 0.00 H ATOM 16237 H ASN B 525 33.743 44.048 77.111 1.00 0.00 H ATOM 16238 N GLN B 526 31.038 42.975 78.113 1.00 37.80 N ATOM 16239 CA GLN B 526 29.629 42.847 78.441 1.00 39.04 C ATOM 16240 C GLN B 526 28.778 42.593 77.221 1.00 39.32 C ATOM 16241 O GLN B 526 28.026 41.614 77.183 1.00 40.58 O ATOM 16242 CB GLN B 526 29.131 44.113 79.183 1.00 39.23 C ATOM 16243 CG GLN B 526 29.927 44.417 80.486 1.00 44.32 C ATOM 16244 CD GLN B 526 29.491 45.734 81.194 1.00 43.98 C ATOM 16245 HA GLN B 526 29.529 41.980 79.094 1.00 0.00 H ATOM 16246 HB2 GLN B 526 29.226 44.967 78.512 1.00 0.00 H ATOM 16247 HB3 GLN B 526 28.082 43.972 79.443 1.00 0.00 H ATOM 16248 HG2 GLN B 526 29.781 43.589 81.180 1.00 0.00 H ATOM 16249 HG3 GLN B 526 30.984 44.496 80.233 1.00 0.00 H ATOM 16250 H GLN B 526 31.362 43.702 77.444 1.00 0.00 H ATOM 16251 N PHE B 527 28.876 43.455 76.206 1.00 38.93 N ATOM 16252 CA PHE B 527 28.042 43.249 75.037 1.00 37.96 C ATOM 16253 C PHE B 527 28.269 42.004 74.156 1.00 37.60 C ATOM 16254 O PHE B 527 27.347 41.202 73.945 1.00 35.96 O ATOM 16255 CB PHE B 527 28.077 44.476 74.127 1.00 36.17 C ATOM 16256 CG PHE B 527 27.116 44.362 72.965 1.00 36.82 C ATOM 16257 CD1 PHE B 527 25.736 44.403 73.190 1.00 35.72 C ATOM 16258 CD2 PHE B 527 27.582 44.147 71.671 1.00 35.71 C ATOM 16259 CE1 PHE B 527 24.848 44.227 72.141 1.00 38.09 C ATOM 16260 CE2 PHE B 527 26.694 43.971 70.599 1.00 37.76 C ATOM 16261 CZ PHE B 527 25.335 44.010 70.833 1.00 38.01 C ATOM 16262 HA PHE B 527 27.074 43.070 75.506 1.00 0.00 H ATOM 16263 HB2 PHE B 527 27.813 45.355 74.715 1.00 0.00 H ATOM 16264 HB3 PHE B 527 29.087 44.593 73.735 1.00 0.00 H ATOM 16265 HD2 PHE B 527 28.656 44.115 71.487 1.00 0.00 H ATOM 16266 HE2 PHE B 527 27.074 43.805 69.591 1.00 0.00 H ATOM 16267 HZ PHE B 527 24.636 43.873 70.008 1.00 0.00 H ATOM 16268 HE1 PHE B 527 23.774 44.256 72.325 1.00 0.00 H ATOM 16269 HD1 PHE B 527 25.357 44.575 74.197 1.00 0.00 H ATOM 16270 H PHE B 527 29.536 44.257 76.253 1.00 0.00 H ATOM 16271 N LEU B 528 29.476 41.851 73.627 1.00 37.58 N ATOM 16272 CA LEU B 528 29.749 40.743 72.730 1.00 38.93 C ATOM 16273 C LEU B 528 29.476 39.350 73.352 1.00 41.02 C ATOM 16274 O LEU B 528 28.926 38.461 72.681 1.00 41.28 O ATOM 16275 CB LEU B 528 31.179 40.863 72.160 1.00 36.48 C ATOM 16276 CG LEU B 528 31.516 39.782 71.105 1.00 38.40 C ATOM 16277 CD1 LEU B 528 30.538 39.874 69.872 1.00 36.22 C ATOM 16278 CD2 LEU B 528 32.944 39.928 70.640 1.00 35.53 C ATOM 16279 HA LEU B 528 29.038 40.816 71.907 1.00 0.00 H ATOM 16280 HB2 LEU B 528 31.284 41.843 71.696 1.00 0.00 H ATOM 16281 HB3 LEU B 528 31.888 40.774 72.984 1.00 0.00 H ATOM 16282 HG LEU B 528 31.392 38.805 71.573 1.00 0.00 H ATOM 16283 HD21 LEU B 528 33.081 40.914 70.195 1.00 0.00 H ATOM 16284 HD22 LEU B 528 33.615 39.816 71.491 1.00 0.00 H ATOM 16285 HD23 LEU B 528 33.164 39.160 69.899 1.00 0.00 H ATOM 16286 HD11 LEU B 528 29.513 39.726 70.211 1.00 0.00 H ATOM 16287 HD12 LEU B 528 30.630 40.857 69.409 1.00 0.00 H ATOM 16288 HD13 LEU B 528 30.797 39.103 69.146 1.00 0.00 H ATOM 16289 H LEU B 528 30.231 42.529 73.856 1.00 0.00 H ATOM 16290 N PRO B 529 29.895 39.119 74.611 1.00 42.53 N ATOM 16291 CA PRO B 529 29.602 37.794 75.187 1.00 44.56 C ATOM 16292 C PRO B 529 28.071 37.595 75.279 1.00 44.84 C ATOM 16293 O PRO B 529 27.533 36.513 75.013 1.00 43.70 O ATOM 16294 CB PRO B 529 30.265 37.850 76.577 1.00 44.16 C ATOM 16295 CG PRO B 529 31.421 38.812 76.380 1.00 43.77 C ATOM 16296 CD PRO B 529 30.870 39.872 75.434 1.00 42.59 C ATOM 16297 HA PRO B 529 29.976 36.958 74.596 1.00 0.00 H ATOM 16298 HD3 PRO B 529 30.379 40.673 75.987 1.00 0.00 H ATOM 16299 HD2 PRO B 529 31.662 40.293 74.815 1.00 0.00 H ATOM 16300 HG3 PRO B 529 32.276 38.303 75.935 1.00 0.00 H ATOM 16301 HG2 PRO B 529 31.719 39.258 77.329 1.00 0.00 H ATOM 16302 HB2 PRO B 529 29.568 38.226 77.326 1.00 0.00 H ATOM 16303 HB3 PRO B 529 30.624 36.866 76.878 1.00 0.00 H ATOM 16304 N LYS B 530 27.348 38.638 75.641 1.00 46.61 N ATOM 16305 CA LYS B 530 25.889 38.485 75.688 1.00 48.23 C ATOM 16306 C LYS B 530 25.351 38.145 74.274 1.00 48.68 C ATOM 16307 O LYS B 530 24.546 37.224 74.099 1.00 48.90 O ATOM 16308 CB LYS B 530 25.250 39.748 76.249 1.00 50.20 C ATOM 16309 CG LYS B 530 23.753 39.601 76.462 1.00 55.76 C ATOM 16310 CD LYS B 530 23.157 40.575 77.519 1.00 58.53 C ATOM 16311 CE LYS B 530 21.593 40.659 77.356 1.00 61.10 C ATOM 16312 NZ LYS B 530 20.862 41.642 78.253 1.00 61.42 N ATOM 16313 HA LYS B 530 25.627 37.661 76.352 1.00 0.00 H ATOM 16314 HB2 LYS B 530 25.718 39.981 77.206 1.00 0.00 H ATOM 16315 HB3 LYS B 530 25.425 40.567 75.552 1.00 0.00 H ATOM 16316 HG2 LYS B 530 23.253 39.782 75.510 1.00 0.00 H ATOM 16317 HG3 LYS B 530 23.553 38.580 76.787 1.00 0.00 H ATOM 16318 HD2 LYS B 530 23.397 40.213 78.519 1.00 0.00 H ATOM 16319 HD3 LYS B 530 23.588 41.566 77.380 1.00 0.00 H ATOM 16320 HE2 LYS B 530 21.187 39.667 77.554 1.00 0.00 H ATOM 16321 HE3 LYS B 530 21.383 40.936 76.323 1.00 0.00 H ATOM 16322 HZ1 LYS B 530 21.028 41.391 79.248 1.00 0.00 H ATOM 16323 HZ2 LYS B 530 21.216 42.603 78.073 1.00 0.00 H ATOM 16324 HZ3 LYS B 530 19.843 41.603 78.050 1.00 0.00 H ATOM 16325 H LYS B 530 27.799 39.542 75.886 1.00 0.00 H ATOM 16326 N LEU B 531 25.825 38.855 73.257 1.00 47.30 N ATOM 16327 CA LEU B 531 25.415 38.612 71.878 1.00 47.31 C ATOM 16328 C LEU B 531 25.676 37.163 71.407 1.00 48.10 C ATOM 16329 O LEU B 531 24.787 36.509 70.851 1.00 47.11 O ATOM 16330 CB LEU B 531 26.151 39.625 70.983 1.00 46.22 C ATOM 16331 CG LEU B 531 26.462 39.650 69.478 1.00 48.23 C ATOM 16332 CD1 LEU B 531 26.155 38.358 68.805 1.00 48.79 C ATOM 16333 CD2 LEU B 531 25.746 40.811 68.823 1.00 48.28 C ATOM 16334 HA LEU B 531 24.335 38.743 71.809 1.00 0.00 H ATOM 16335 HB2 LEU B 531 25.600 40.552 71.143 1.00 0.00 H ATOM 16336 HB3 LEU B 531 27.135 39.704 71.446 1.00 0.00 H ATOM 16337 HG LEU B 531 27.537 39.792 69.363 1.00 0.00 H ATOM 16338 HD21 LEU B 531 24.671 40.701 68.967 1.00 0.00 H ATOM 16339 HD22 LEU B 531 26.081 41.745 69.275 1.00 0.00 H ATOM 16340 HD23 LEU B 531 25.972 40.821 67.757 1.00 0.00 H ATOM 16341 HD11 LEU B 531 26.751 37.564 69.256 1.00 0.00 H ATOM 16342 HD12 LEU B 531 25.096 38.131 68.923 1.00 0.00 H ATOM 16343 HD13 LEU B 531 26.395 38.436 67.745 1.00 0.00 H ATOM 16344 H LEU B 531 26.513 39.611 73.450 1.00 0.00 H ATOM 16345 N LEU B 532 26.898 36.679 71.608 1.00 48.23 N ATOM 16346 CA LEU B 532 27.267 35.331 71.184 1.00 50.74 C ATOM 16347 C LEU B 532 26.454 34.283 71.949 1.00 52.49 C ATOM 16348 O LEU B 532 26.148 33.232 71.410 1.00 53.16 O ATOM 16349 CB LEU B 532 28.781 35.083 71.379 1.00 48.34 C ATOM 16350 CG LEU B 532 29.758 35.909 70.534 1.00 46.70 C ATOM 16351 CD1 LEU B 532 31.187 35.696 71.013 1.00 47.59 C ATOM 16352 CD2 LEU B 532 29.619 35.529 69.088 1.00 45.59 C ATOM 16353 HA LEU B 532 27.040 35.240 70.122 1.00 0.00 H ATOM 16354 HB2 LEU B 532 29.010 35.280 72.426 1.00 0.00 H ATOM 16355 HB3 LEU B 532 28.969 34.032 71.159 1.00 0.00 H ATOM 16356 HG LEU B 532 29.521 36.967 70.644 1.00 0.00 H ATOM 16357 HD21 LEU B 532 29.843 34.469 68.969 1.00 0.00 H ATOM 16358 HD22 LEU B 532 28.599 35.725 68.759 1.00 0.00 H ATOM 16359 HD23 LEU B 532 30.315 36.118 68.490 1.00 0.00 H ATOM 16360 HD11 LEU B 532 31.269 36.005 72.055 1.00 0.00 H ATOM 16361 HD12 LEU B 532 31.445 34.641 70.924 1.00 0.00 H ATOM 16362 HD13 LEU B 532 31.866 36.290 70.402 1.00 0.00 H ATOM 16363 H LEU B 532 27.609 37.275 72.079 1.00 0.00 H ATOM 16364 N ASN B 533 26.098 34.589 73.189 1.00 55.49 N ATOM 16365 CA ASN B 533 25.295 33.698 74.023 1.00 59.47 C ATOM 16366 C ASN B 533 23.832 33.602 73.556 1.00 61.12 C ATOM 16367 O ASN B 533 23.204 32.564 73.693 1.00 61.12 O ATOM 16368 CB ASN B 533 25.274 34.185 75.473 1.00 61.02 C ATOM 16369 CG ASN B 533 24.657 33.166 76.407 1.00 64.07 C ATOM 16370 OD1 ASN B 533 25.245 32.112 76.636 1.00 66.98 O ATOM 16371 ND2 ASN B 533 23.460 33.455 76.940 1.00 64.37 N ATOM 16372 HA ASN B 533 25.765 32.718 73.940 1.00 0.00 H ATOM 16373 HB2 ASN B 533 26.297 34.381 75.793 1.00 0.00 H ATOM 16374 HB3 ASN B 533 24.695 35.107 75.526 1.00 0.00 H ATOM 16375 HD22 ASN B 533 22.997 34.360 76.719 1.00 0.00 H ATOM 16376 HD21 ASN B 533 22.995 32.774 77.574 1.00 0.00 H ATOM 16377 H ASN B 533 26.403 35.501 73.584 1.00 0.00 H ATOM 16378 N ALA B 534 23.293 34.701 73.041 1.00 62.38 N ATOM 16379 CA ALA B 534 21.922 34.723 72.594 1.00 64.89 C ATOM 16380 C ALA B 534 21.780 34.165 71.192 1.00 67.14 C ATOM 16381 O ALA B 534 20.691 33.780 70.797 1.00 68.33 O ATOM 16382 CB ALA B 534 21.373 36.145 72.641 1.00 63.90 C ATOM 16383 HA ALA B 534 21.348 34.089 73.269 1.00 0.00 H ATOM 16384 HB1 ALA B 534 21.420 36.518 73.664 1.00 0.00 H ATOM 16385 HB2 ALA B 534 21.970 36.785 71.992 1.00 0.00 H ATOM 16386 HB3 ALA B 534 20.337 36.145 72.301 1.00 0.00 H ATOM 16387 H ALA B 534 23.870 35.562 72.958 1.00 0.00 H ATOM 16388 N THR B 535 22.881 34.116 70.443 1.00 69.21 N ATOM 16389 CA THR B 535 22.862 33.621 69.065 1.00 69.87 C ATOM 16390 C THR B 535 23.696 32.349 68.900 1.00 71.08 C ATOM 16391 O THR B 535 23.572 31.455 69.779 1.00 72.04 O ATOM 16392 CB THR B 535 23.399 34.708 68.090 1.00 70.41 C ATOM 16393 OG1 THR B 535 24.717 35.097 68.487 1.00 70.18 O ATOM 16394 CG2 THR B 535 22.508 35.948 68.115 1.00 70.52 C ATOM 16395 HA THR B 535 21.825 33.385 68.828 1.00 0.00 H ATOM 16396 HB THR B 535 23.407 34.287 67.085 1.00 0.00 H ATOM 16397 HG1 THR B 535 24.689 35.463 69.406 1.00 0.00 H ATOM 16398 HG23 THR B 535 21.497 35.673 67.815 1.00 0.00 H ATOM 16399 HG21 THR B 535 22.490 36.360 69.124 1.00 0.00 H ATOM 16400 HG22 THR B 535 22.904 36.692 67.424 1.00 0.00 H ATOM 16401 H THR B 535 23.782 34.439 70.850 1.00 0.00 H TER 16402 THR B 535 HETATM16403 MG MG A 1 20.342 66.689 69.030 1.00 48.34 MG HETATM16404 MG MG A 2 47.583 50.961 68.143 1.00 48.34 MG HETATM16405 O HOH 3 -6.244 83.858 38.985 1.00 37.32 O HETATM16406 O HOH 4 -10.382 76.459 66.483 1.00 58.57 O HETATM16407 O HOH 5 6.232 92.813 48.108 1.00 56.29 O HETATM16408 O HOH 6 -19.155 77.170 49.778 1.00 59.28 O HETATM16409 O HOH 7 -4.277 85.451 39.607 1.00 41.64 O HETATM16410 O HOH 8 -12.615 64.871 41.870 1.00 44.92 O HETATM16411 O HOH 9 -15.286 67.634 49.410 1.00 33.71 O HETATM16412 O HOH 10 -15.724 60.361 49.004 1.00 37.42 O HETATM16413 O HOH 11 -8.054 78.414 66.352 1.00 58.70 O HETATM16414 O HOH 12 -10.415 72.315 67.368 1.00 57.22 O HETATM16415 O HOH 13 -21.347 62.057 50.388 1.00 51.49 O HETATM16416 O HOH 14 -14.764 60.067 57.141 1.00 32.79 O HETATM16417 O HOH 15 -20.152 59.631 59.197 1.00 42.96 O HETATM16418 O HOH 16 -5.583 83.155 54.229 1.00 57.17 O HETATM16419 O HOH 17 -13.905 51.514 49.533 1.00 55.76 O HETATM16420 O HOH 18 -7.004 50.342 49.603 1.00 55.34 O HETATM16421 O HOH 19 -10.031 56.194 45.068 1.00 49.06 O HETATM16422 O HOH 20 0.035 61.428 72.230 1.00 60.75 O HETATM16423 O HOH 21 -17.936 68.700 48.997 1.00 38.61 O HETATM16424 O HOH 22 -20.102 75.177 37.552 1.00 44.17 O HETATM16425 O HOH 23 -20.170 77.244 47.531 1.00 57.73 O HETATM16426 O HOH 24 -10.425 81.595 55.481 1.00 43.52 O HETATM16427 O HOH 25 -9.580 70.258 54.666 1.00 34.81 O HETATM16428 O HOH 26 -7.931 59.485 42.078 1.00 40.07 O HETATM16429 O HOH 27 -9.728 62.284 59.783 1.00 33.75 O HETATM16430 O HOH 28 -8.796 61.068 63.634 1.00 34.66 O HETATM16431 O HOH 29 -12.312 63.152 59.291 1.00 37.85 O HETATM16432 O HOH 30 -2.749 66.379 67.956 1.00 36.40 O HETATM16433 O HOH 31 -4.689 68.029 65.970 1.00 44.85 O HETATM16434 O HOH 32 -3.332 65.979 74.226 1.00 53.19 O HETATM16435 O HOH 33 -6.735 65.662 74.725 1.00 56.59 O HETATM16436 O HOH 34 -9.078 65.313 70.505 1.00 40.48 O HETATM16437 O HOH 35 -0.613 65.579 72.166 1.00 46.64 O HETATM16438 O HOH 36 -4.884 80.571 31.948 1.00 55.09 O HETATM16439 O HOH 37 3.905 65.146 79.817 1.00 56.71 O HETATM16440 O HOH 38 2.386 63.739 76.867 1.00 54.74 O HETATM16441 O HOH 39 -0.063 70.440 68.390 1.00 35.25 O HETATM16442 O HOH 40 -1.445 72.005 73.429 1.00 43.09 O HETATM16443 O HOH 41 -3.202 76.200 64.515 1.00 38.58 O HETATM16444 O HOH 42 -7.005 74.418 70.154 1.00 55.71 O HETATM16445 O HOH 43 0.555 77.318 62.206 1.00 33.87 O HETATM16446 O HOH 44 -0.553 69.457 62.441 1.00 34.33 O HETATM16447 O HOH 45 -1.884 68.740 66.823 1.00 34.44 O HETATM16448 O HOH 46 -7.621 73.185 67.704 1.00 47.21 O HETATM16449 O HOH 47 -5.562 76.895 66.400 1.00 54.05 O HETATM16450 O HOH 48 -4.747 80.325 62.722 1.00 50.45 O HETATM16451 O HOH 49 -11.912 72.379 65.451 1.00 49.69 O HETATM16452 O HOH 50 4.832 47.808 63.051 1.00 47.73 O HETATM16453 O HOH 51 -14.329 71.664 65.663 1.00 47.41 O HETATM16454 O HOH 52 -4.328 39.412 58.075 1.00 52.66 O HETATM16455 O HOH 53 3.499 44.623 65.986 1.00 61.50 O HETATM16456 O HOH 54 4.658 49.683 66.966 1.00 36.14 O HETATM16457 O HOH 55 -13.542 62.424 56.933 1.00 34.61 O HETATM16458 O HOH 56 -17.967 65.546 61.402 1.00 37.22 O HETATM16459 O HOH 57 -19.318 63.229 61.035 1.00 47.78 O HETATM16460 O HOH 58 -15.422 66.466 51.867 1.00 33.72 O HETATM16461 O HOH 59 -4.099 82.992 52.275 1.00 40.69 O HETATM16462 O HOH 60 -4.981 87.851 35.226 1.00 54.32 O HETATM16463 O HOH 61 3.458 81.700 32.453 1.00 39.86 O HETATM16464 O HOH 62 -2.705 77.323 31.167 1.00 51.79 O HETATM16465 O HOH 63 4.054 43.760 55.678 1.00 43.18 O HETATM16466 O HOH 64 5.999 44.314 54.125 1.00 40.29 O HETATM16467 O HOH 65 -0.982 64.977 69.362 1.00 44.83 O HETATM16468 O HOH 66 2.639 62.316 70.404 1.00 61.60 O HETATM16469 O HOH 67 -0.530 67.801 64.589 1.00 30.63 O HETATM16470 O HOH 68 -0.725 63.276 59.023 1.00 28.26 O HETATM16471 O HOH 69 23.641 65.946 64.365 1.00 52.11 O HETATM16472 O HOH 70 -7.143 68.163 57.847 1.00 32.72 O HETATM16473 O HOH 71 -4.209 70.133 62.455 1.00 30.07 O HETATM16474 O HOH 72 -8.163 71.488 52.701 1.00 36.62 O HETATM16475 O HOH 73 -7.527 70.386 56.472 1.00 36.10 O HETATM16476 O HOH 74 -4.042 80.338 58.604 1.00 52.80 O HETATM16477 O HOH 75 0.579 83.026 57.955 1.00 49.95 O HETATM16478 O HOH 76 -2.356 77.902 62.451 1.00 40.13 O HETATM16479 O HOH 77 3.796 69.085 57.779 1.00 26.80 O HETATM16480 O HOH 78 0.055 69.463 59.637 1.00 31.77 O HETATM16481 O HOH 79 4.178 80.585 51.467 1.00 35.37 O HETATM16482 O HOH 80 14.707 45.959 62.575 1.00 55.79 O HETATM16483 O HOH 81 13.407 84.649 43.617 1.00 52.83 O HETATM16484 O HOH 82 13.022 83.479 47.477 1.00 50.72 O HETATM16485 O HOH 83 4.546 84.594 38.320 1.00 59.44 O HETATM16486 O HOH 84 -1.812 75.304 52.816 1.00 37.54 O HETATM16487 O HOH 85 20.853 70.673 71.343 1.00 51.91 O HETATM16488 O HOH 86 -1.573 69.741 52.626 1.00 28.75 O HETATM16489 O HOH 87 -9.027 58.488 64.529 1.00 34.73 O HETATM16490 O HOH 88 -13.398 57.928 56.492 1.00 35.55 O HETATM16491 O HOH 89 -3.768 50.981 59.772 1.00 33.66 O HETATM16492 O HOH 90 -4.331 51.967 56.284 1.00 29.17 O HETATM16493 O HOH 91 -5.738 45.014 57.535 1.00 40.48 O HETATM16494 O HOH 92 -6.565 46.328 51.714 1.00 49.83 O HETATM16495 O HOH 93 -9.429 45.015 51.199 1.00 49.05 O HETATM16496 O HOH 94 -10.010 51.949 54.870 1.00 35.08 O HETATM16497 O HOH 95 -7.907 58.099 44.547 1.00 37.31 O HETATM16498 O HOH 96 -3.635 51.530 44.034 1.00 42.42 O HETATM16499 O HOH 97 -6.105 58.668 40.007 1.00 46.06 O HETATM16500 O HOH 98 -5.377 57.998 36.646 1.00 58.34 O HETATM16501 O HOH 99 0.002 66.563 36.645 1.00 53.86 O HETATM16502 O HOH 100 -10.115 65.198 38.437 1.00 37.63 O HETATM16503 O HOH 101 -11.919 67.315 37.271 1.00 45.97 O HETATM16504 O HOH 102 24.377 60.326 39.876 1.00 45.50 O HETATM16505 O HOH 103 -4.213 70.748 34.028 1.00 36.53 O HETATM16506 O HOH 104 -7.702 79.888 32.273 1.00 58.37 O HETATM16507 O HOH 105 6.315 74.975 33.009 1.00 57.86 O HETATM16508 O HOH 106 3.621 66.902 36.650 1.00 42.54 O HETATM16509 O HOH 107 7.393 70.736 39.345 1.00 48.99 O HETATM16510 O HOH 108 10.828 68.509 59.706 1.00 32.94 O HETATM16511 O HOH 109 4.184 64.270 60.846 1.00 27.82 O HETATM16512 O HOH 110 -1.453 51.441 42.561 1.00 43.87 O HETATM16513 O HOH 111 -4.532 56.209 39.335 1.00 54.61 O HETATM16514 O HOH 112 2.684 54.190 36.689 1.00 35.75 O HETATM16515 O HOH 113 5.571 57.832 35.852 1.00 47.09 O HETATM16516 O HOH 114 0.025 56.749 38.091 1.00 46.08 O HETATM16517 O HOH 115 -1.536 57.827 33.533 1.00 49.27 O HETATM16518 O HOH 116 -0.770 66.420 40.066 1.00 42.12 O HETATM16519 O HOH 117 11.376 64.349 35.447 1.00 52.14 O HETATM16520 O HOH 118 13.040 65.680 33.718 1.00 45.76 O HETATM16521 O HOH 119 13.520 68.684 57.177 1.00 34.57 O HETATM16522 O HOH 120 14.083 51.168 56.136 1.00 44.79 O HETATM16523 O HOH 121 7.095 52.387 56.525 1.00 31.35 O HETATM16524 O HOH 122 4.803 50.560 62.231 1.00 32.84 O HETATM16525 O HOH 123 3.009 54.077 63.632 1.00 32.26 O HETATM16526 O HOH 124 6.391 48.320 55.878 1.00 35.04 O HETATM16527 O HOH 125 3.331 45.870 61.174 1.00 37.49 O HETATM16528 O HOH 126 -4.552 40.208 63.033 1.00 47.71 O HETATM16529 O HOH 127 0.376 40.599 57.440 1.00 39.43 O HETATM16530 O HOH 128 0.110 41.719 64.324 1.00 49.62 O HETATM16531 O HOH 129 -6.466 49.494 61.183 1.00 33.82 O HETATM16532 O HOH 130 -5.836 40.735 57.057 1.00 45.76 O HETATM16533 O HOH 131 -5.228 42.673 70.130 1.00 46.11 O HETATM16534 O HOH 132 3.399 51.320 64.439 1.00 35.23 O HETATM16535 O HOH 133 3.625 47.442 65.411 1.00 39.09 O HETATM16536 O HOH 134 -9.217 43.097 70.254 1.00 60.61 O HETATM16537 O HOH 135 -21.948 46.456 67.335 1.00 47.20 O HETATM16538 O HOH 136 -20.182 57.093 59.655 1.00 42.93 O HETATM16539 O HOH 137 -17.488 64.067 67.302 1.00 48.08 O HETATM16540 O HOH 138 -14.556 65.244 67.152 1.00 50.95 O HETATM16541 O HOH 139 -10.884 65.752 68.694 1.00 50.09 O HETATM16542 O HOH 140 -15.531 56.855 72.670 1.00 46.23 O HETATM16543 O HOH 141 -6.789 61.513 65.280 1.00 30.68 O HETATM16544 O HOH 142 -2.384 57.700 66.828 1.00 37.32 O HETATM16545 O HOH 143 -6.968 48.790 74.140 1.00 43.13 O HETATM16546 O HOH 144 3.535 50.432 69.661 1.00 32.95 O HETATM16547 O HOH 145 5.468 47.713 75.707 1.00 45.44 O HETATM16548 O HOH 146 4.939 53.738 80.649 1.00 48.63 O HETATM16549 O HOH 147 4.234 55.687 78.353 1.00 43.14 O HETATM16550 O HOH 148 8.674 49.794 74.714 1.00 43.95 O HETATM16551 O HOH 149 2.767 54.122 74.450 1.00 48.55 O HETATM16552 O HOH 150 5.082 59.845 70.095 1.00 39.07 O HETATM16553 O HOH 151 3.963 56.483 70.379 1.00 45.94 O HETATM16554 O HOH 152 7.276 49.217 66.382 1.00 49.11 O HETATM16555 O HOH 153 -3.908 50.122 62.195 1.00 40.41 O HETATM16556 O HOH 154 -1.658 57.646 62.704 1.00 30.13 O HETATM16557 O HOH 155 -3.985 57.115 63.952 1.00 34.31 O HETATM16558 O HOH 156 1.253 43.467 54.984 1.00 44.97 O HETATM16559 O HOH 157 -5.926 47.913 49.793 1.00 60.98 O HETATM16560 O HOH 158 -5.235 51.011 45.969 1.00 57.83 O HETATM16561 O HOH 159 8.665 45.106 43.869 1.00 52.37 O HETATM16562 O HOH 160 7.195 46.805 53.830 1.00 33.10 O HETATM16563 O HOH 161 9.651 46.569 53.644 1.00 37.96 O HETATM16564 O HOH 162 17.758 50.492 44.965 1.00 39.34 O HETATM16565 O HOH 163 6.640 62.610 35.316 1.00 37.22 O HETATM16566 O HOH 164 9.564 56.196 36.116 1.00 38.34 O HETATM16567 O HOH 165 9.431 50.901 37.012 1.00 56.47 O HETATM16568 O HOH 166 20.750 65.934 67.182 1.00 43.66 O HETATM16569 O HOH 167 21.315 64.996 63.803 1.00 33.81 O HETATM16570 O HOH 168 12.158 67.097 67.351 1.00 28.92 O HETATM16571 O HOH 169 22.146 67.702 69.412 1.00 47.07 O HETATM16572 O HOH 170 17.732 63.661 65.906 1.00 35.33 O HETATM16573 O HOH 171 5.984 61.187 72.166 1.00 47.22 O HETATM16574 O HOH 172 7.739 63.445 78.873 1.00 30.25 O HETATM16575 O HOH 173 13.533 59.183 78.948 1.00 39.01 O HETATM16576 O HOH 174 7.556 64.922 80.875 1.00 43.28 O HETATM16577 O HOH 175 12.195 67.361 83.416 1.00 49.11 O HETATM16578 O HOH 176 7.736 66.124 82.665 1.00 49.58 O HETATM16579 O HOH 177 8.376 76.642 76.163 1.00 46.73 O HETATM16580 O HOH 178 5.269 77.964 81.505 1.00 54.22 O HETATM16581 O HOH 179 11.156 77.255 83.985 1.00 54.58 O HETATM16582 O HOH 180 15.275 64.807 84.110 1.00 43.17 O HETATM16583 O HOH 181 16.300 62.222 84.309 1.00 50.52 O HETATM16584 O HOH 182 23.219 52.238 81.003 1.00 49.51 O HETATM16585 O HOH 183 10.591 55.495 68.564 1.00 30.21 O HETATM16586 O HOH 184 8.402 47.218 74.022 1.00 56.44 O HETATM16587 O HOH 185 14.794 48.259 63.764 1.00 44.44 O HETATM16588 O HOH 186 11.693 46.760 73.811 1.00 55.00 O HETATM16589 O HOH 187 17.675 39.490 74.216 1.00 44.49 O HETATM16590 O HOH 188 34.141 61.808 77.617 1.00 53.55 O HETATM16591 O HOH 189 29.198 60.857 84.329 1.00 51.80 O HETATM16592 O HOH 190 22.708 59.422 86.270 1.00 50.29 O HETATM16593 O HOH 191 24.600 66.231 84.529 1.00 50.74 O HETATM16594 O HOH 192 21.480 65.124 70.014 1.00 39.19 O HETATM16595 O HOH 193 25.841 66.022 74.362 1.00 44.13 O HETATM16596 O HOH 194 20.132 67.525 71.048 1.00 47.55 O HETATM16597 O HOH 195 20.168 62.814 65.091 1.00 31.94 O HETATM16598 O HOH 196 24.340 61.284 70.316 1.00 56.18 O HETATM16599 O HOH 197 24.453 64.653 67.442 1.00 57.35 O HETATM16600 O HOH 198 15.644 52.635 61.621 1.00 44.85 O HETATM16601 O HOH 199 21.306 52.144 53.901 1.00 31.77 O HETATM16602 O HOH 200 20.561 59.357 40.926 1.00 46.13 O HETATM16603 O HOH 201 16.547 57.442 36.186 1.00 44.55 O HETATM16604 O HOH 202 19.067 65.612 36.952 1.00 55.17 O HETATM16605 O HOH 203 18.336 59.955 41.885 1.00 37.97 O HETATM16606 O HOH 204 19.535 67.711 38.619 1.00 49.25 O HETATM16607 O HOH 205 25.075 70.728 63.236 1.00 50.17 O HETATM16608 O HOH 206 22.335 79.318 61.340 1.00 45.09 O HETATM16609 O HOH 207 16.111 80.108 69.861 1.00 51.26 O HETATM16610 O HOH 208 21.496 77.993 64.686 1.00 52.34 O HETATM16611 O HOH 209 14.479 76.511 63.986 1.00 43.66 O HETATM16612 O HOH 210 13.040 80.099 74.871 1.00 60.66 O HETATM16613 O HOH 211 8.249 79.181 67.562 1.00 43.07 O HETATM16614 O HOH 212 16.630 74.320 77.707 1.00 41.53 O HETATM16615 O HOH 213 17.661 67.600 72.123 1.00 50.52 O HETATM16616 O HOH 214 13.636 74.377 66.185 1.00 41.01 O HETATM16617 O HOH 215 12.315 77.447 62.926 1.00 37.45 O HETATM16618 O HOH 216 10.160 80.256 65.102 1.00 39.83 O HETATM16619 O HOH 217 8.095 75.630 60.909 1.00 31.84 O HETATM16620 O HOH 218 10.506 88.646 60.153 1.00 52.28 O HETATM16621 O HOH 219 12.945 91.133 58.598 1.00 62.72 O HETATM16622 O HOH 220 19.673 84.581 62.737 1.00 39.72 O HETATM16623 O HOH 221 18.387 91.374 62.110 1.00 50.45 O HETATM16624 O HOH 222 20.997 84.157 55.908 1.00 47.72 O HETATM16625 O HOH 223 13.527 86.232 47.316 1.00 43.92 O HETATM16626 O HOH 224 9.197 88.410 48.311 1.00 52.32 O HETATM16627 O HOH 225 9.144 91.031 49.240 1.00 53.32 O HETATM16628 O HOH 226 21.325 82.483 53.511 1.00 52.60 O HETATM16629 O HOH 227 18.449 79.782 46.426 1.00 51.02 O HETATM16630 O HOH 228 11.197 70.374 34.128 1.00 48.90 O HETATM16631 O HOH 229 24.475 73.304 38.961 1.00 46.63 O HETATM16632 O HOH 230 18.136 74.895 37.553 1.00 48.79 O HETATM16633 O HOH 231 23.173 66.864 47.683 1.00 34.55 O HETATM16634 O HOH 232 27.576 63.407 45.897 1.00 40.49 O HETATM16635 O HOH 233 26.864 68.376 41.184 1.00 52.29 O HETATM16636 O HOH 234 27.977 65.636 42.845 1.00 50.54 O HETATM16637 O HOH 235 22.043 61.702 41.865 1.00 45.83 O HETATM16638 O HOH 236 24.844 58.153 41.439 1.00 49.13 O HETATM16639 O HOH 237 30.305 61.316 42.409 1.00 55.65 O HETATM16640 O HOH 238 25.167 58.725 52.311 1.00 43.68 O HETATM16641 O HOH 239 34.977 65.236 45.629 1.00 53.66 O HETATM16642 O HOH 240 23.456 77.233 54.224 1.00 57.51 O HETATM16643 O HOH 241 31.028 58.386 50.012 1.00 50.47 O HETATM16644 O HOH 242 25.151 61.462 52.782 1.00 37.81 O HETATM16645 O HOH 243 24.980 58.253 55.445 1.00 46.42 O HETATM16646 O HOH 244 27.200 63.379 59.392 1.00 38.70 O HETATM16647 O HOH 245 25.343 60.350 67.940 1.00 55.95 O HETATM16648 O HOH 246 28.886 59.263 61.184 1.00 44.79 O HETATM16649 O HOH 247 26.515 59.054 63.043 1.00 34.99 O HETATM16650 O HOH 248 16.040 50.037 62.683 1.00 52.42 O HETATM16651 O HOH 249 75.745 36.522 98.188 1.00 37.32 O HETATM16652 O HOH 250 71.406 29.238 70.690 1.00 58.57 O HETATM16653 O HOH 251 77.262 51.804 89.065 1.00 56.29 O HETATM16654 O HOH 252 76.409 21.996 87.395 1.00 59.28 O HETATM16655 O HOH 253 76.141 39.022 97.566 1.00 41.64 O HETATM16656 O HOH 254 62.487 21.511 95.303 1.00 44.92 O HETATM16657 O HOH 255 66.216 20.579 87.763 1.00 33.71 O HETATM16658 O HOH 256 60.136 16.563 88.169 1.00 37.42 O HETATM16659 O HOH 257 71.936 32.232 70.821 1.00 58.70 O HETATM16660 O HOH 258 67.834 27.138 69.805 1.00 57.22 O HETATM16661 O HOH 259 64.416 12.541 86.785 1.00 51.49 O HETATM16662 O HOH 260 59.401 17.247 80.032 1.00 32.79 O HETATM16663 O HOH 261 61.718 12.363 77.976 1.00 42.96 O HETATM16664 O HOH 262 74.806 36.742 82.944 1.00 57.17 O HETATM16665 O HOH 263 51.565 13.715 87.640 1.00 55.76 O HETATM16666 O HOH 264 47.099 19.105 87.570 1.00 55.34 O HETATM16667 O HOH 265 53.681 19.410 92.105 1.00 49.06 O HETATM16668 O HOH 266 53.181 30.744 64.943 1.00 60.75 O HETATM16669 O HOH 267 68.464 18.817 88.176 1.00 38.61 O HETATM16670 O HOH 268 75.156 20.180 99.621 1.00 44.17 O HETATM16671 O HOH 269 76.980 21.154 89.642 1.00 57.73 O HETATM16672 O HOH 270 75.876 31.769 81.692 1.00 43.52 O HETATM16673 O HOH 271 65.635 26.832 82.507 1.00 34.81 O HETATM16674 O HOH 272 55.481 22.874 95.095 1.00 40.07 O HETATM16675 O HOH 273 58.803 22.717 77.390 1.00 33.75 O HETATM16676 O HOH 274 57.284 22.916 73.539 1.00 34.66 O HETATM16677 O HOH 275 60.847 20.913 77.882 1.00 37.85 O HETATM16678 O HOH 276 58.860 30.809 69.217 1.00 36.40 O HETATM16679 O HOH 277 61.259 29.954 71.203 1.00 44.85 O HETATM16680 O HOH 278 58.806 30.104 62.947 1.00 53.19 O HETATM16681 O HOH 279 60.233 26.998 62.448 1.00 56.59 O HETATM16682 O HOH 280 61.102 24.795 66.668 1.00 40.48 O HETATM16683 O HOH 281 57.100 32.259 65.007 1.00 46.64 O HETATM16684 O HOH 282 72.219 36.056 105.225 1.00 55.09 O HETATM16685 O HOH 283 54.466 35.955 57.356 1.00 56.71 O HETATM16686 O HOH 284 54.007 33.936 60.306 1.00 54.74 O HETATM16687 O HOH 285 61.034 35.165 68.783 1.00 35.25 O HETATM16688 O HOH 286 63.081 34.751 63.744 1.00 43.09 O HETATM16689 O HOH 287 67.592 35.327 72.658 1.00 38.58 O HETATM16690 O HOH 288 67.950 31.142 67.019 1.00 55.71 O HETATM16691 O HOH 289 66.682 39.140 74.967 1.00 33.87 O HETATM16692 O HOH 290 60.428 34.250 74.732 1.00 34.33 O HETATM16693 O HOH 291 60.473 32.738 70.350 1.00 34.44 O HETATM16694 O HOH 292 67.191 29.992 69.469 1.00 47.21 O HETATM16695 O HOH 293 69.374 33.631 70.773 1.00 54.05 O HETATM16696 O HOH 294 71.937 36.051 74.451 1.00 50.45 O HETATM16697 O HOH 295 68.638 25.873 71.722 1.00 49.69 O HETATM16698 O HOH 296 38.987 28.089 74.122 1.00 47.73 O HETATM16699 O HOH 297 69.227 23.423 71.510 1.00 47.41 O HETATM16700 O HOH 298 36.296 15.958 79.098 1.00 52.66 O HETATM16701 O HOH 299 36.895 25.342 71.187 1.00 61.50 O HETATM16702 O HOH 300 40.698 28.875 70.207 1.00 36.14 O HETATM16703 O HOH 301 60.832 19.484 80.240 1.00 34.61 O HETATM16704 O HOH 302 65.748 17.213 75.771 1.00 37.22 O HETATM16705 O HOH 303 64.417 14.885 76.138 1.00 47.78 O HETATM16706 O HOH 304 65.272 19.877 85.306 1.00 33.72 O HETATM16707 O HOH 305 73.923 37.946 84.898 1.00 40.69 O HETATM16708 O HOH 306 78.572 39.612 101.947 1.00 54.32 O HETATM16709 O HOH 307 69.025 43.845 104.720 1.00 39.86 O HETATM16710 O HOH 308 68.316 36.319 106.006 1.00 51.79 O HETATM16711 O HOH 309 35.870 25.391 81.495 1.00 43.18 O HETATM16712 O HOH 310 35.377 27.352 83.048 1.00 40.29 O HETATM16713 O HOH 311 56.763 31.638 67.811 1.00 44.83 O HETATM16714 O HOH 312 52.648 33.443 66.769 1.00 61.60 O HETATM16715 O HOH 313 58.982 33.441 72.584 1.00 30.63 O HETATM16716 O HOH 314 55.161 31.010 78.150 1.00 28.26 O HETATM16717 O HOH 315 45.290 53.447 72.808 1.00 52.11 O HETATM16718 O HOH 316 62.602 27.895 79.326 1.00 32.72 O HETATM16719 O HOH 317 62.842 31.421 74.718 1.00 30.07 O HETATM16720 O HOH 318 65.992 28.675 84.472 1.00 36.62 O HETATM16721 O HOH 319 64.720 28.674 80.701 1.00 36.10 O HETATM16722 O HOH 320 71.596 36.669 78.569 1.00 52.80 O HETATM16723 O HOH 321 71.613 42.014 79.218 1.00 49.95 O HETATM16724 O HOH 322 68.643 36.911 74.722 1.00 40.13 O HETATM16725 O HOH 323 57.931 37.830 79.394 1.00 26.80 O HETATM16726 O HOH 324 60.129 34.779 77.536 1.00 31.77 O HETATM16727 O HOH 325 67.700 43.911 85.706 1.00 35.37 O HETATM16728 O HOH 326 32.448 35.716 74.598 1.00 55.79 O HETATM16729 O HOH 327 66.605 53.935 93.556 1.00 52.83 O HETATM16730 O HOH 328 65.784 53.017 89.696 1.00 50.72 O HETATM16731 O HOH 329 70.988 46.234 98.853 1.00 59.44 O HETATM16732 O HOH 330 66.121 36.083 84.357 1.00 37.54 O HETATM16733 O HOH 331 50.778 53.396 65.830 1.00 51.91 O HETATM16734 O HOH 332 61.184 33.508 84.547 1.00 28.75 O HETATM16735 O HOH 333 55.166 21.426 72.644 1.00 34.73 O HETATM16736 O HOH 334 56.866 17.361 80.681 1.00 35.55 O HETATM16737 O HOH 335 46.035 22.227 77.401 1.00 33.66 O HETATM16738 O HOH 336 47.170 22.233 80.889 1.00 29.17 O HETATM16739 O HOH 337 41.852 17.538 79.638 1.00 40.48 O HETATM16740 O HOH 338 43.404 17.479 85.459 1.00 49.83 O HETATM16741 O HOH 339 43.699 14.342 85.974 1.00 49.05 O HETATM16742 O HOH 340 49.994 17.306 82.303 1.00 35.08 O HETATM16743 O HOH 341 54.269 22.202 92.626 1.00 37.31 O HETATM16744 O HOH 342 46.444 22.617 93.139 1.00 42.42 O HETATM16745 O HOH 343 53.861 24.047 97.166 1.00 46.06 O HETATM16746 O HOH 344 52.916 24.342 100.527 1.00 58.34 O HETATM16747 O HOH 345 57.644 33.283 100.528 1.00 53.86 O HETATM16748 O HOH 346 61.521 23.839 98.736 1.00 37.63 O HETATM16749 O HOH 347 64.256 23.335 99.902 1.00 45.97 O HETATM16750 O HOH 348 40.055 51.274 97.297 1.00 45.50 O HETATM16751 O HOH 349 63.376 31.725 103.145 1.00 36.53 O HETATM16752 O HOH 350 73.036 33.274 104.900 1.00 58.37 O HETATM16753 O HOH 351 61.773 42.956 104.164 1.00 57.86 O HETATM16754 O HOH 352 56.128 36.587 100.523 1.00 42.54 O HETATM16755 O HOH 353 57.563 41.770 97.828 1.00 48.99 O HETATM16756 O HOH 354 53.916 43.632 77.467 1.00 32.94 O HETATM16757 O HOH 355 53.568 35.758 76.327 1.00 27.82 O HETATM16758 O HOH 356 45.276 24.462 94.612 1.00 43.87 O HETATM16759 O HOH 357 50.944 24.180 97.838 1.00 54.61 O HETATM16760 O HOH 358 45.588 29.419 100.484 1.00 35.75 O HETATM16761 O HOH 359 47.298 33.741 101.321 1.00 47.09 O HETATM16762 O HOH 360 49.134 28.396 99.082 1.00 46.08 O HETATM16763 O HOH 361 50.848 27.583 103.640 1.00 49.27 O HETATM16764 O HOH 362 57.906 32.543 97.107 1.00 42.12 O HETATM16765 O HOH 363 50.040 42.026 101.726 1.00 52.14 O HETATM16766 O HOH 364 50.361 44.133 103.455 1.00 45.76 O HETATM16767 O HOH 365 52.722 46.051 79.996 1.00 34.57 O HETATM16768 O HOH 366 37.271 37.780 81.037 1.00 44.79 O HETATM16769 O HOH 367 41.821 32.338 80.648 1.00 31.35 O HETATM16770 O HOH 368 41.385 29.439 74.942 1.00 32.84 O HETATM16771 O HOH 369 45.328 29.644 73.541 1.00 32.26 O HETATM16772 O HOH 370 38.651 29.695 81.295 1.00 35.04 O HETATM16773 O HOH 371 38.059 25.820 75.999 1.00 37.49 O HETATM16774 O HOH 372 37.097 16.162 74.140 1.00 47.71 O HETATM16775 O HOH 373 34.972 20.625 79.733 1.00 39.43 O HETATM16776 O HOH 374 36.075 20.955 72.849 1.00 49.62 O HETATM16777 O HOH 375 46.096 19.147 75.990 1.00 33.82 O HETATM16778 O HOH 376 38.196 15.313 80.116 1.00 45.76 O HETATM16779 O HOH 377 39.570 16.809 67.043 1.00 46.11 O HETATM16780 O HOH 378 42.745 28.604 72.734 1.00 35.23 O HETATM16781 O HOH 379 39.273 26.860 71.762 1.00 39.09 O HETATM16782 O HOH 380 41.932 13.566 66.919 1.00 60.61 O HETATM16783 O HOH 381 51.206 4.221 69.838 1.00 47.20 O HETATM16784 O HOH 382 59.535 11.068 77.518 1.00 42.93 O HETATM16785 O HOH 383 64.228 16.888 69.871 1.00 48.08 O HETATM16786 O HOH 384 63.781 20.016 70.021 1.00 50.95 O HETATM16787 O HOH 385 62.385 23.450 68.479 1.00 50.09 O HETATM16788 O HOH 386 57.003 14.977 64.503 1.00 46.23 O HETATM16789 O HOH 387 56.666 24.877 71.893 1.00 30.68 O HETATM16790 O HOH 388 51.162 26.785 70.345 1.00 37.32 O HETATM16791 O HOH 389 45.737 18.360 63.033 1.00 43.13 O HETATM16792 O HOH 390 41.908 28.277 67.512 1.00 32.95 O HETATM16793 O HOH 391 38.587 28.592 61.466 1.00 45.44 O HETATM16794 O HOH 392 44.069 31.146 56.524 1.00 48.63 O HETATM16795 O HOH 393 46.109 31.510 58.820 1.00 43.14 O HETATM16796 O HOH 394 38.786 32.409 62.459 1.00 43.95 O HETATM16797 O HOH 395 45.487 29.457 62.723 1.00 48.55 O HETATM16798 O HOH 396 49.286 34.324 67.078 1.00 39.07 O HETATM16799 O HOH 397 46.934 31.674 66.794 1.00 45.94 O HETATM16800 O HOH 398 38.985 30.910 70.791 1.00 49.11 O HETATM16801 O HOH 399 45.361 21.677 74.978 1.00 40.41 O HETATM16802 O HOH 400 50.752 27.387 74.469 1.00 30.13 O HETATM16803 O HOH 401 51.456 25.106 73.221 1.00 34.31 O HETATM16804 O HOH 402 37.017 22.819 82.189 1.00 44.97 O HETATM16805 O HOH 403 44.457 18.824 87.380 1.00 60.98 O HETATM16806 O HOH 404 46.794 20.972 91.204 1.00 57.83 O HETATM16807 O HOH 405 34.730 30.057 93.304 1.00 52.37 O HETATM16808 O HOH 406 36.937 29.634 83.343 1.00 33.10 O HETATM16809 O HOH 407 35.504 31.642 83.529 1.00 37.96 O HETATM16810 O HOH 408 34.848 40.625 92.208 1.00 39.34 O HETATM16811 O HOH 409 50.902 37.055 101.857 1.00 37.22 O HETATM16812 O HOH 410 43.885 36.381 101.057 1.00 38.34 O HETATM16813 O HOH 411 39.366 33.618 100.161 1.00 56.47 O HETATM16814 O HOH 412 46.725 50.937 69.991 1.00 43.66 O HETATM16815 O HOH 413 45.631 50.957 73.370 1.00 33.81 O HETATM16816 O HOH 414 52.029 44.078 69.822 1.00 28.92 O HETATM16817 O HOH 415 47.559 53.030 67.761 1.00 47.07 O HETATM16818 O HOH 416 46.266 47.187 71.267 1.00 35.33 O HETATM16819 O HOH 417 49.998 35.776 65.007 1.00 47.22 O HETATM16820 O HOH 418 51.075 38.425 58.300 1.00 30.25 O HETATM16821 O HOH 419 44.487 41.311 58.225 1.00 39.01 O HETATM16822 O HOH 420 52.446 39.005 56.298 1.00 43.28 O HETATM16823 O HOH 421 52.239 44.242 53.757 1.00 49.11 O HETATM16824 O HOH 422 53.397 39.762 54.508 1.00 49.58 O HETATM16825 O HOH 423 62.186 45.575 61.010 1.00 46.73 O HETATM16826 O HOH 424 64.884 43.545 55.668 1.00 54.22 O HETATM16827 O HOH 425 61.327 48.289 53.188 1.00 54.58 O HETATM16828 O HOH 426 48.487 45.632 53.063 1.00 43.17 O HETATM16829 O HOH 427 45.736 45.227 52.864 1.00 50.52 O HETATM16830 O HOH 428 33.630 46.227 56.170 1.00 49.51 O HETATM16831 O HOH 429 42.765 36.920 68.609 1.00 30.21 O HETATM16832 O HOH 430 36.691 30.885 63.151 1.00 56.44 O HETATM16833 O HOH 431 34.397 36.941 73.409 1.00 44.44 O HETATM16834 O HOH 432 34.649 33.506 63.362 1.00 55.00 O HETATM16835 O HOH 433 25.362 35.052 62.957 1.00 44.49 O HETATM16836 O HOH 434 36.457 60.471 59.556 1.00 53.55 O HETATM16837 O HOH 435 38.105 55.715 52.844 1.00 51.80 O HETATM16838 O HOH 436 40.107 49.377 50.903 1.00 50.29 O HETATM16839 O HOH 437 45.058 54.420 52.644 1.00 50.74 O HETATM16840 O HOH 438 45.659 51.164 67.159 1.00 39.19 O HETATM16841 O HOH 439 44.256 55.390 62.811 1.00 44.13 O HETATM16842 O HOH 440 48.412 51.197 66.125 1.00 47.55 O HETATM16843 O HOH 441 44.315 48.873 72.082 1.00 31.94 O HETATM16844 O HOH 442 40.904 51.721 66.857 1.00 56.18 O HETATM16845 O HOH 443 43.765 53.503 69.731 1.00 57.35 O HETATM16846 O HOH 444 37.761 39.866 75.552 1.00 44.85 O HETATM16847 O HOH 445 34.505 44.523 83.272 1.00 31.77 O HETATM16848 O HOH 446 41.124 47.485 96.247 1.00 46.13 O HETATM16849 O HOH 447 41.473 43.051 100.987 1.00 44.55 O HETATM16850 O HOH 448 47.288 49.319 100.221 1.00 55.17 O HETATM16851 O HOH 449 42.755 45.857 95.288 1.00 37.97 O HETATM16852 O HOH 450 48.872 50.773 98.554 1.00 49.25 O HETATM16853 O HOH 451 48.715 57.080 73.937 1.00 50.17 O HETATM16854 O HOH 452 57.524 59.002 75.833 1.00 45.09 O HETATM16855 O HOH 453 61.320 54.007 67.312 1.00 51.26 O HETATM16856 O HOH 454 56.796 57.613 72.487 1.00 52.34 O HETATM16857 O HOH 455 59.021 50.795 73.187 1.00 43.66 O HETATM16858 O HOH 456 62.848 51.343 62.302 1.00 60.66 O HETATM16859 O HOH 457 64.448 46.734 69.611 1.00 43.07 O HETATM16860 O HOH 458 56.048 51.562 59.466 1.00 41.53 O HETATM16861 O HOH 459 49.713 49.095 65.050 1.00 50.52 O HETATM16862 O HOH 460 57.594 48.998 70.988 1.00 41.01 O HETATM16863 O HOH 461 60.914 49.389 74.247 1.00 37.45 O HETATM16864 O HOH 462 64.424 48.927 72.071 1.00 39.83 O HETATM16865 O HOH 463 61.450 44.825 76.264 1.00 31.84 O HETATM16866 O HOH 464 71.517 53.422 77.020 1.00 52.28 O HETATM16867 O HOH 465 72.451 56.777 78.575 1.00 62.72 O HETATM16868 O HOH 466 63.413 59.328 74.436 1.00 39.72 O HETATM16869 O HOH 467 69.939 61.611 75.063 1.00 50.45 O HETATM16870 O HOH 468 62.384 60.262 81.265 1.00 47.72 O HETATM16871 O HOH 469 67.916 54.831 89.857 1.00 43.92 O HETATM16872 O HOH 470 71.967 52.170 88.862 1.00 52.32 O HETATM16873 O HOH 471 74.263 53.434 87.933 1.00 53.32 O HETATM16874 O HOH 472 60.770 59.709 83.662 1.00 52.60 O HETATM16875 O HOH 473 59.869 55.868 90.747 1.00 51.02 O HETATM16876 O HOH 474 55.347 44.884 103.045 1.00 48.90 O HETATM16877 O HOH 475 51.246 57.848 98.212 1.00 46.63 O HETATM16878 O HOH 476 55.793 53.154 99.620 1.00 48.79 O HETATM16879 O HOH 477 46.319 53.500 89.490 1.00 34.55 O HETATM16880 O HOH 478 41.124 55.585 91.276 1.00 40.49 O HETATM16881 O HOH 479 45.783 57.453 95.989 1.00 52.29 O HETATM16882 O HOH 480 42.854 57.047 94.328 1.00 50.54 O HETATM16883 O HOH 481 42.414 49.941 95.308 1.00 45.83 O HETATM16884 O HOH 482 37.940 50.592 95.734 1.00 49.13 O HETATM16885 O HOH 483 37.949 56.903 94.764 1.00 55.65 O HETATM16886 O HOH 484 38.274 51.158 84.862 1.00 43.68 O HETATM16887 O HOH 485 39.008 62.909 91.544 1.00 53.66 O HETATM16888 O HOH 486 55.158 58.930 82.949 1.00 57.51 O HETATM16889 O HOH 487 35.050 56.064 87.161 1.00 50.47 O HETATM16890 O HOH 488 40.652 52.512 84.391 1.00 37.81 O HETATM16891 O HOH 489 37.959 50.760 81.728 1.00 46.42 O HETATM16892 O HOH 490 41.288 55.245 77.781 1.00 38.70 O HETATM16893 O HOH 491 39.593 52.123 69.233 1.00 55.95 O HETATM16894 O HOH 492 36.880 54.648 75.989 1.00 44.79 O HETATM16895 O HOH 493 37.885 52.490 74.130 1.00 34.99 O HETATM16896 O HOH 494 35.313 38.910 74.490 1.00 52.42 O HETATM16897 C1 GNT A 495 2.650 67.661 63.432 1.00 -0.11 C HETATM16898 C2 GNT A 495 2.799 68.172 62.198 1.00 -0.01 C HETATM16899 C3 GNT A 495 4.193 68.408 61.585 1.00 0.12 C HETATM16900 C4 GNT A 495 5.369 68.459 62.734 1.00 0.02 C HETATM16901 C41 GNT A 495 5.153 67.227 63.664 1.00 0.07 C HETATM16902 C42 GNT A 495 3.846 67.351 64.430 1.00 -0.02 C HETATM16903 C12 GNT A 495 3.809 68.424 65.599 1.00 -0.08 C HETATM16904 C11 GNT A 495 2.453 68.431 66.337 1.00 0.00 C HETATM16905 N10 GNT A 495 1.994 67.220 67.067 1.00 -0.36 N HETATM16906 C9 GNT A 495 2.229 65.965 66.810 1.00 0.06 C HETATM16907 C15 GNT A 495 3.029 65.288 65.780 1.00 0.07 C HETATM16908 C8 GNT A 495 3.076 63.847 65.821 1.00 0.03 C HETATM16909 C7 GNT A 495 3.827 63.105 64.912 1.00 0.07 C HETATM16910 C6 GNT A 495 4.589 63.766 63.911 1.00 0.26 C HETATM16911 C13 GNT A 495 4.519 65.185 63.876 1.00 0.24 C HETATM16912 O5 GNT A 495 5.190 65.991 62.958 1.00 -0.26 O HETATM16913 C14 GNT A 495 3.752 65.924 64.785 1.00 0.02 C HETATM16914 O17 GNT A 495 5.487 63.133 63.006 1.00 -0.24 O HETATM16915 C16 GNT A 495 5.824 61.785 63.306 1.00 0.09 C HETATM16916 H14 GNT A 495 6.519 61.403 62.544 1.00 0.06 H HETATM16917 H15 GNT A 495 4.911 61.171 63.311 1.00 0.06 H HETATM16918 H16 GNT A 495 6.303 61.738 64.295 1.00 0.06 H HETATM16919 H7 GNT A 495 3.830 62.023 64.968 1.00 0.09 H HETATM16920 H8 GNT A 495 2.509 63.325 66.583 1.00 0.11 H HETATM16921 H9 GNT A 495 1.733 65.280 67.496 1.00 0.13 H HETATM16922 C19 GNT A 495 1.212 67.431 68.271 1.00 0.01 C HETATM16923 H18 GNT A 495 0.941 66.458 68.707 1.00 0.04 H HETATM16924 H19 GNT A 495 0.297 67.989 68.021 1.00 0.04 H HETATM16925 H20 GNT A 495 1.805 68.006 68.998 1.00 0.04 H HETATM16926 H10 GNT A 495 2.497 69.247 67.073 1.00 0.05 H HETATM16927 H11 GNT A 495 1.684 68.658 65.584 1.00 0.05 H HETATM16928 H12 GNT A 495 3.985 69.422 65.171 1.00 0.01 H HETATM16929 H13 GNT A 495 4.605 68.189 66.321 1.00 0.01 H HETATM16930 H6 GNT A 495 5.975 67.217 64.395 1.00 0.05 H HETATM16931 H4 GNT A 495 5.289 69.389 63.315 1.00 0.04 H HETATM16932 H5 GNT A 495 6.361 68.406 62.262 1.00 0.04 H HETATM16933 O18 GNT A 495 4.318 67.249 60.690 1.00 -0.36 O HETATM16934 H17 GNT A 495 4.261 66.449 61.199 1.00 0.22 H HETATM16935 H3 GNT A 495 4.218 69.347 61.013 1.00 0.10 H HETATM16936 H2 GNT A 495 1.913 68.425 61.617 1.00 0.14 H HETATM16937 H1 GNT A 495 1.638 67.444 63.772 1.00 0.04 H CONECT 1 2 11 12 13 CONECT 11 1 CONECT 12 1 CONECT 13 1 CONECT 980 979 1387 CONECT 1387 980 1386 CONECT 3802 3801 3959 CONECT 3959 3802 3958 CONECT 4954 495316403 CONECT 5936 593416403 CONECT 6077 6076 7958 CONECT 7428 7429 7438 7439 7440 CONECT 7438 7428 CONECT 7439 7428 CONECT 7440 7428 CONECT 7958 6077 7957 CONECT 8202 8203 8212 8213 8214 CONECT 8212 8202 CONECT 8213 8202 CONECT 8214 8202 CONECT 9181 9180 9588 CONECT 9588 9181 9587 CONECT120031200212160 CONECT121601200312159 CONECT131551315416404 CONECT141371413516404 CONECT142781427716159 CONECT1562915630156391564015641 CONECT1563915629 CONECT1564015629 CONECT1564115629 CONECT161591427816158 CONECT16403 4954 5936 CONECT164041315514137 CONECT16897168981690216937 CONECT16898168971689916936 CONECT1689916898169001693316935 CONECT1690016899169011693116932 CONECT1690116900169021691216930 CONECT1690216897169011690316913 CONECT1690316902169041692816929 CONECT1690416903169051692616927 CONECT16905169041690616922 CONECT16906169051690716921 CONECT16907169061690816913 CONECT16908169071690916920 CONECT16909169081691016919 CONECT16910169091691116914 CONECT16911169101691216913 CONECT169121690116911 CONECT16913169021690716911 CONECT169141691016915 CONECT1691516914169161691716918 CONECT1691616915 CONECT1691716915 CONECT1691816915 CONECT1691916909 CONECT1692016908 CONECT1692116906 CONECT1692216905169231692416925 CONECT1692316922 CONECT1692416922 CONECT1692516922 CONECT1692616904 CONECT1692716904 CONECT1692816903 CONECT1692916903 CONECT1693016901 CONECT1693116900 CONECT1693216900 CONECT169331689916934 CONECT1693416933 CONECT1693516899 CONECT1693616898 CONECT1693716897 MASTER 0 0 0 0 0 0 0 016933 4 75 84 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 1w6r
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
1acj
RCSB PDB
PDBbind
537aa, >1ACJ_1|Chain... at 99%
1amn
RCSB PDB
PDBbind
537aa, >1AMN_1|Chain... at 100%
1dx6
RCSB PDB
PDBbind
543aa, >1DX6_1|Chain... at 100%
1e66
RCSB PDB
PDBbind
543aa, >1E66_1|Chain... at 100%
1eve
RCSB PDB
PDBbind
543aa, >1EVE_1|Chain... at 100%
1gpk
RCSB PDB
PDBbind
537aa, >1GPK_1|Chain... at 100%
1gpn
RCSB PDB
PDBbind
537aa, >1GPN_1|Chain... at 100%
1gqs
RCSB PDB
PDBbind
532aa, >1GQS_1|Chain... at 100%
1h22
RCSB PDB
PDBbind
543aa, >1H22_1|Chain... at 100%
1h23
RCSB PDB
PDBbind
543aa, >1H23_1|Chain... at 100%
1hbj
RCSB PDB
PDBbind
543aa, >1HBJ_1|Chain... at 100%
1qti
RCSB PDB
PDBbind
537aa, >1QTI_1|Chain... at 100%
1u65
RCSB PDB
PDBbind
543aa, >1U65_1|Chain... at 100%
1vot
RCSB PDB
PDBbind
537aa, >1VOT_1|Chain... at 100%
1w4l
RCSB PDB
PDBbind
543aa, >1W4L_1|Chain... at 100%
1w76
RCSB PDB
PDBbind
543aa, >1W76_1|Chains... at 100%
1zgb
RCSB PDB
PDBbind
543aa, >1ZGB_1|Chain... at 100%
2ckm
RCSB PDB
PDBbind
543aa, >2CKM_1|Chain... at 100%
2cmf
RCSB PDB
PDBbind
543aa, >2CMF_1|Chain... at 100%
2j3q
RCSB PDB
PDBbind
543aa, >2J3Q_1|Chain... at 100%
2v96
RCSB PDB
PDBbind
537aa, >2V96_1|Chains... at 100%
2w6c
RCSB PDB
PDBbind
586aa, >2W6C_1|Chain... *
3i6m
RCSB PDB
PDBbind
534aa, >3I6M_1|Chain... at 100%
3i6z
RCSB PDB
PDBbind
534aa, >3I6Z_1|Chain... at 100%
3zv7
RCSB PDB
PDBbind
543aa, >3ZV7_1|Chain... at 100%
5bwb
RCSB PDB
PDBbind
537aa, >5BWB_1|Chain... at 100%
5bwc
RCSB PDB
PDBbind
537aa, >5BWC_1|Chain... at 100%
5nap
RCSB PDB
PDBbind
543aa, >5NAP_1|Chain... at 100%
5nau
RCSB PDB
PDBbind
543aa, >5NAU_1|Chain... at 100%
6ezg
RCSB PDB
PDBbind
537aa, >6EZG_1|Chains... at 100%
6ezh
RCSB PDB
PDBbind
537aa, >6EZH_1|Chains... at 100%
6g1u
RCSB PDB
PDBbind
565aa, >6G1U_1|Chains... at 100%
6g1v
RCSB PDB
PDBbind
565aa, >6G1V_1|Chains... at 100%
6g1w
RCSB PDB
PDBbind
565aa, >6G1W_1|Chains... at 100%
6g4m
RCSB PDB
PDBbind
537aa, >6G4M_1|Chains... at 100%
6g4n
RCSB PDB
PDBbind
537aa, >6G4N_1|Chains... at 100%
6h13
RCSB PDB
PDBbind
565aa, >6H13_1|Chains... at 100%
6h14
RCSB PDB
PDBbind
565aa, >6H14_1|Chains... at 100%
6h12
RCSB PDB
PDBbind
565aa, >6H12_1|Chains... at 100%
6ewk
RCSB PDB
PDBbind
532aa, >6EWK_1|Chain... at 100%
6euc
RCSB PDB
PDBbind
572aa, >6EUC_1|Chain... at 93%
5nuu
RCSB PDB
PDBbind
543aa, >5NUU_1|Chain... at 100%
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
1dx6
RCSB PDB
PDBbind
GNT
1qti
RCSB PDB
PDBbind
GNT
1w76
RCSB PDB
PDBbind
GNT
2ph9
RCSB PDB
PDBbind
GNT
Entry Information
PDB ID
1w6r
Complex Type
Protein-Ligand
PDBbind Subset
general set
Protein Name
acetylcholinesterase
Ligand Name
GNT
EC.Number
E.C.3.1.1.7
Resolution
2.05(Å)
Affinity (Kd/Ki/IC50)
IC50=702nM
Release Year
2004
Protein/NA Sequence
Check fasta file
Primary Reference
J.Am.Chem.Soc.v126;pp.15405
Ligand Properties
Formula
C
1
7
H
2
0
NO
3
Molecular Weight
286.346
Exact Mass
286.144
No. of atoms
41
No. of bonds
44
Polar Surface Area
51.05
LOGP Value
1.29 (
Computed with XLOGP3
)
1.44 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 1
No. of Hydrogen Bond Acceptors: 1
No. of Rotatable Bonds: 2
No. of Nitrogen and Oxygen Atoms: 4
No. of Rings: 4
Canonical SMILES
COc1ccc2c3c1O[C@@H]1[C@]3(C=C[C@@H](C1)O)CC[N](=C2)C
InChI String
InChI=1S/C17H20NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-6,10,12,14,19H,7-9H2,1-2H3/t12-,14-,17-/m0/s1
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
P04058
Entrez Gene ID
No matched NCBI Entrez Gene ID found!
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com