Browse entries in the PDBbind-CN Database
HEADER 2AQ7_COMPLEX COMPND 2AQ7_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 404 MET LYS ARG ALA VAL ILE THR GLY LEU GLY ILE VAL SER SEQRES 2 A 404 SER ILE GLY ASN ASN GLN GLN GLU VAL LEU ALA SER LEU SEQRES 3 A 404 ARG GLU GLY ARG SER GLY ILE THR PHE SER GLN GLU LEU SEQRES 4 A 404 LYS ASP SER GLY MET ARG SER HIS VAL TRP GLY ASN VAL SEQRES 5 A 404 LYS LEU ASP THR THR GLY LEU ILE ASP ARG LYS VAL VAL SEQRES 6 A 404 ARG PHE MET SER ASP ALA SER ILE TYR ALA PHE LEU SER SEQRES 7 A 404 MET GLU GLN ALA ILE ALA ASP ALA GLY LEU SER PRO GLU SEQRES 8 A 404 ALA TYR GLN ASN ASN PRO ARG VAL GLY LEU ILE ALA GLY SEQRES 9 A 404 SER GLY GLY GLY SER PRO ARG PHE GLN VAL PHE GLY ALA SEQRES 10 A 404 ASP ALA MET ARG GLY PRO ARG GLY LEU LYS ALA VAL GLY SEQRES 11 A 404 PRO TYR VAL VAL THR LYS ALA MET ALA SER GLY VAL SER SEQRES 12 A 404 ALA CYS LEU ALA THR PRO PHE LYS ILE HIS GLY VAL ASN SEQRES 13 A 404 TYR SER ILE SER SER ALA CYS ALA THR SER ALA HIS CYS SEQRES 14 A 404 ILE GLY ASN ALA VAL GLU GLN ILE GLN LEU GLY LYS GLN SEQRES 15 A 404 ASP ILE VAL PHE ALA GLY GLY GLY GLU GLU LEU CYS TRP SEQRES 16 A 404 GLU MET ALA CYS GLU PHE ASP ALA MET GLY ALA LEU SER SEQRES 17 A 404 THR LYS TYR ASN ASP THR PRO GLU LYS ALA SER ARG THR SEQRES 18 A 404 TYR ASP ALA HIS ARG ASP GLY PHE VAL ILE ALA GLY GLY SEQRES 19 A 404 GLY GLY MET VAL VAL VAL GLU GLU LEU GLU HIS ALA LEU SEQRES 20 A 404 ALA ARG GLY ALA HIS ILE TYR ALA GLU ILE VAL GLY TYR SEQRES 21 A 404 GLY ALA THR SER ASP GLY ALA ASP MET VAL ALA PRO SER SEQRES 22 A 404 GLY GLU GLY ALA VAL ARG CYS MET LYS MET ALA MET HIS SEQRES 23 A 404 GLY VAL ASP THR PRO ILE ASP TYR LEU ASN SER HIS GLY SEQRES 24 A 404 THR SER THR PRO VAL GLY ASP VAL LYS GLU LEU ALA ALA SEQRES 25 A 404 ILE ARG GLU VAL PHE GLY ASP LYS SER PRO ALA ILE SER SEQRES 26 A 404 ALA THR LYS ALA MET THR GLY HIS SER LEU GLY ALA ALA SEQRES 27 A 404 GLY VAL GLN GLU ALA ILE TYR SER LEU LEU MET LEU GLU SEQRES 28 A 404 HIS GLY PHE ILE ALA PRO SER ILE ASN ILE GLU GLU LEU SEQRES 29 A 404 ASP GLU GLN ALA ALA GLY LEU ASN ILE VAL THR GLU THR SEQRES 30 A 404 THR ASP ARG GLU LEU THR THR VAL MET SER ASN SER PHE SEQRES 31 A 404 GLY PHE GLY GLY THR ASN ALA THR LEU VAL MET ARG LYS SEQRES 32 A 404 LEU SEQRES 1 B 403 LYS ARG ALA VAL ILE THR GLY LEU GLY ILE VAL SER SER SEQRES 2 B 403 ILE GLY ASN ASN GLN GLN GLU VAL LEU ALA SER LEU ARG SEQRES 3 B 403 GLU GLY ARG SER GLY ILE THR PHE SER GLN GLU LEU LYS SEQRES 4 B 403 ASP SER GLY MET ARG SER HIS VAL TRP GLY ASN VAL LYS SEQRES 5 B 403 LEU ASP THR THR GLY LEU ILE ASP ARG LYS VAL VAL ARG SEQRES 6 B 403 PHE MET SER ASP ALA SER ILE TYR ALA PHE LEU SER MET SEQRES 7 B 403 GLU GLN ALA ILE ALA ASP ALA GLY LEU SER PRO GLU ALA SEQRES 8 B 403 TYR GLN ASN ASN PRO ARG VAL GLY LEU ILE ALA GLY SER SEQRES 9 B 403 GLY GLY GLY SER PRO ARG PHE GLN VAL PHE GLY ALA ASP SEQRES 10 B 403 ALA MET ARG GLY PRO ARG GLY LEU LYS ALA VAL GLY PRO SEQRES 11 B 403 TYR VAL VAL THR LYS ALA MET ALA SER GLY VAL SER ALA SEQRES 12 B 403 CYS LEU ALA THR PRO PHE LYS ILE HIS GLY VAL ASN TYR SEQRES 13 B 403 SER ILE SER SER ALA CYS ALA THR SER ALA HIS CYS ILE SEQRES 14 B 403 GLY ASN ALA VAL GLU GLN ILE GLN LEU GLY LYS GLN ASP SEQRES 15 B 403 ILE VAL PHE ALA GLY GLY GLY GLU GLU LEU CYS TRP GLU SEQRES 16 B 403 MET ALA CYS GLU PHE ASP ALA MET GLY ALA LEU SER THR SEQRES 17 B 403 LYS TYR ASN ASP THR PRO GLU LYS ALA SER ARG THR TYR SEQRES 18 B 403 ASP ALA HIS ARG ASP GLY PHE VAL ILE ALA GLY GLY GLY SEQRES 19 B 403 GLY MET VAL VAL VAL GLU GLU LEU GLU HIS ALA LEU ALA SEQRES 20 B 403 ARG GLY ALA HIS ILE TYR ALA GLU ILE VAL GLY TYR GLY SEQRES 21 B 403 ALA THR SER ASP GLY ALA ASP MET VAL ALA PRO SER GLY SEQRES 22 B 403 GLU GLY ALA VAL ARG CYS MET LYS MET ALA MET HIS GLY SEQRES 23 B 403 VAL ASP THR PRO ILE ASP TYR LEU ASN SER HIS GLY THR SEQRES 24 B 403 SER THR PRO VAL GLY ASP VAL LYS GLU LEU ALA ALA ILE SEQRES 25 B 403 ARG GLU VAL PHE GLY ASP LYS SER PRO ALA ILE SER ALA SEQRES 26 B 403 THR LYS ALA MET THR GLY HIS SER LEU GLY ALA ALA GLY SEQRES 27 B 403 VAL GLN GLU ALA ILE TYR SER LEU LEU MET LEU GLU HIS SEQRES 28 B 403 GLY PHE ILE ALA PRO SER ILE ASN ILE GLU GLU LEU ASP SEQRES 29 B 403 GLU GLN ALA ALA GLY LEU ASN ILE VAL THR GLU THR THR SEQRES 30 B 403 ASP ARG GLU LEU THR THR VAL MET SER ASN SER PHE GLY SEQRES 31 B 403 PHE GLY GLY THR ASN ALA THR LEU VAL MET ARG LYS LEU HET TL A 5 31 ATOM 1 N MET A 1 18.127 86.631 -32.395 1.00 26.25 N ATOM 2 CA MET A 1 17.889 85.983 -31.068 1.00 25.80 C ATOM 3 C MET A 1 16.406 85.687 -30.854 1.00 25.54 C ATOM 4 O MET A 1 15.535 86.461 -31.253 1.00 25.81 O ATOM 5 CB MET A 1 18.437 86.854 -29.925 1.00 26.03 C ATOM 6 HA MET A 1 18.425 85.034 -31.063 1.00 0.00 H ATOM 7 HB2 MET A 1 19.509 86.995 -30.059 1.00 0.00 H ATOM 8 HB3 MET A 1 17.938 87.823 -29.937 1.00 0.00 H ATOM 9 HN3 MET A 1 17.600 87.526 -32.442 1.00 0.00 H ATOM 10 HN2 MET A 1 17.803 85.996 -33.152 1.00 0.00 H ATOM 11 HN1 MET A 1 19.143 86.819 -32.510 1.00 0.00 H ATOM 12 N LYS A 2 16.141 84.552 -30.217 1.00 24.84 N ATOM 13 CA LYS A 2 14.789 84.128 -29.907 1.00 23.98 C ATOM 14 C LYS A 2 14.312 84.714 -28.580 1.00 23.09 C ATOM 15 O LYS A 2 15.117 85.100 -27.729 1.00 22.76 O ATOM 16 CB LYS A 2 14.730 82.602 -29.866 1.00 24.46 C ATOM 17 CG LYS A 2 15.292 81.956 -31.132 1.00 25.32 C ATOM 18 CD LYS A 2 14.309 80.990 -31.719 1.00 26.43 C ATOM 19 CE LYS A 2 14.616 80.666 -33.165 1.00 26.53 C ATOM 20 NZ LYS A 2 13.423 80.001 -33.767 1.00 26.99 N ATOM 21 HA LYS A 2 14.124 84.497 -30.688 1.00 0.00 H ATOM 22 HB2 LYS A 2 15.308 82.253 -29.010 1.00 0.00 H ATOM 23 HB3 LYS A 2 13.690 82.296 -29.750 1.00 0.00 H ATOM 24 HG2 LYS A 2 15.509 82.734 -31.864 1.00 0.00 H ATOM 25 HG3 LYS A 2 16.211 81.425 -30.884 1.00 0.00 H ATOM 26 HD2 LYS A 2 14.335 80.067 -31.139 1.00 0.00 H ATOM 27 HD3 LYS A 2 13.312 81.426 -31.661 1.00 0.00 H ATOM 28 HE2 LYS A 2 15.475 79.997 -33.218 1.00 0.00 H ATOM 29 HE3 LYS A 2 14.838 81.584 -33.708 1.00 0.00 H ATOM 30 HZ1 LYS A 2 13.214 79.127 -33.244 1.00 0.00 H ATOM 31 HZ2 LYS A 2 12.606 80.642 -33.713 1.00 0.00 H ATOM 32 HZ3 LYS A 2 13.620 79.772 -34.762 1.00 0.00 H ATOM 33 H LYS A 2 16.934 83.944 -29.929 1.00 0.00 H ATOM 34 N ARG A 3 12.995 84.771 -28.418 1.00 21.86 N ATOM 35 CA ARG A 3 12.376 85.305 -27.209 1.00 21.00 C ATOM 36 C ARG A 3 11.975 84.182 -26.256 1.00 19.97 C ATOM 37 O ARG A 3 11.573 83.104 -26.689 1.00 19.88 O ATOM 38 CB ARG A 3 11.156 86.153 -27.572 1.00 20.96 C ATOM 39 CG ARG A 3 11.504 87.393 -28.406 1.00 21.12 C ATOM 40 CD ARG A 3 10.281 87.929 -29.144 1.00 20.66 C ATOM 41 NE ARG A 3 9.353 88.606 -28.246 1.00 20.23 N ATOM 42 CZ ARG A 3 8.137 89.027 -28.579 1.00 20.67 C ATOM 43 NH1 ARG A 3 7.665 88.835 -29.806 1.00 21.18 N ATOM 44 NH2 ARG A 3 7.378 89.636 -27.675 1.00 20.33 N ATOM 45 HA ARG A 3 13.107 85.934 -26.702 1.00 0.00 H ATOM 46 HB2 ARG A 3 10.463 85.535 -28.143 1.00 0.00 H ATOM 47 HB3 ARG A 3 10.675 86.480 -26.650 1.00 0.00 H ATOM 48 HG2 ARG A 3 11.888 88.170 -27.744 1.00 0.00 H ATOM 49 HG3 ARG A 3 12.270 87.127 -29.135 1.00 0.00 H ATOM 50 HD2 ARG A 3 9.765 87.096 -29.621 1.00 0.00 H ATOM 51 HD3 ARG A 3 10.611 88.635 -29.906 1.00 0.00 H ATOM 52 HE ARG A 3 9.667 88.772 -27.269 1.00 0.00 H ATOM 53 HH12 ARG A 3 6.712 89.169 -30.055 1.00 0.00 H ATOM 54 HH11 ARG A 3 8.249 88.351 -30.518 1.00 0.00 H ATOM 55 HH22 ARG A 3 6.426 89.966 -27.933 1.00 0.00 H ATOM 56 HH21 ARG A 3 7.736 89.782 -26.709 1.00 0.00 H ATOM 57 H ARG A 3 12.381 84.422 -29.182 1.00 0.00 H ATOM 58 N ALA A 4 12.082 84.456 -24.958 1.00 18.91 N ATOM 59 CA ALA A 4 11.829 83.462 -23.919 1.00 18.28 C ATOM 60 C ALA A 4 10.685 83.903 -23.011 1.00 17.37 C ATOM 61 O ALA A 4 10.641 85.050 -22.563 1.00 17.00 O ATOM 62 CB ALA A 4 13.083 83.228 -23.103 1.00 18.15 C ATOM 63 HA ALA A 4 11.541 82.529 -24.403 1.00 0.00 H ATOM 64 HB1 ALA A 4 13.878 82.868 -23.756 1.00 0.00 H ATOM 65 HB2 ALA A 4 13.391 84.163 -22.636 1.00 0.00 H ATOM 66 HB3 ALA A 4 12.880 82.485 -22.332 1.00 0.00 H ATOM 67 H ALA A 4 12.357 85.417 -24.672 1.00 0.00 H ATOM 68 N VAL A 5 9.778 82.973 -22.733 1.00 16.62 N ATOM 69 CA VAL A 5 8.597 83.236 -21.915 1.00 16.40 C ATOM 70 C VAL A 5 8.484 82.198 -20.793 1.00 15.90 C ATOM 71 O VAL A 5 9.020 81.102 -20.918 1.00 15.85 O ATOM 72 CB VAL A 5 7.303 83.250 -22.792 1.00 16.23 C ATOM 73 CG1 VAL A 5 7.364 84.370 -23.823 1.00 16.03 C ATOM 74 CG2 VAL A 5 7.085 81.925 -23.502 1.00 15.85 C ATOM 75 HA VAL A 5 8.705 84.222 -21.463 1.00 0.00 H ATOM 76 HB VAL A 5 6.464 83.419 -22.117 1.00 0.00 H ATOM 77 HG11 VAL A 5 7.454 85.328 -23.312 1.00 0.00 H ATOM 78 HG12 VAL A 5 8.228 84.219 -24.471 1.00 0.00 H ATOM 79 HG13 VAL A 5 6.453 84.361 -24.422 1.00 0.00 H ATOM 80 HG21 VAL A 5 7.936 81.718 -24.151 1.00 0.00 H ATOM 81 HG22 VAL A 5 6.988 81.130 -22.763 1.00 0.00 H ATOM 82 HG23 VAL A 5 6.175 81.980 -24.100 1.00 0.00 H ATOM 83 H VAL A 5 9.915 82.015 -23.115 1.00 0.00 H ATOM 84 N ILE A 6 7.810 82.557 -19.696 1.00 15.64 N ATOM 85 CA ILE A 6 7.507 81.607 -18.602 1.00 15.52 C ATOM 86 C ILE A 6 6.104 81.040 -18.785 1.00 15.12 C ATOM 87 O ILE A 6 5.123 81.783 -18.732 1.00 15.35 O ATOM 88 CB ILE A 6 7.592 82.255 -17.189 1.00 15.51 C ATOM 89 CG1 ILE A 6 8.998 82.802 -16.908 1.00 16.08 C ATOM 90 CG2 ILE A 6 7.190 81.249 -16.098 1.00 15.53 C ATOM 91 CD1 ILE A 6 10.102 81.747 -16.983 1.00 16.99 C ATOM 92 HA ILE A 6 8.262 80.823 -18.657 1.00 0.00 H ATOM 93 HB ILE A 6 6.891 83.089 -17.172 1.00 0.00 H ATOM 94 HG12 ILE A 6 9.216 83.580 -17.640 1.00 0.00 H ATOM 95 HG13 ILE A 6 9.004 83.235 -15.908 1.00 0.00 H ATOM 96 HD11 ILE A 6 9.907 80.966 -16.248 1.00 0.00 H ATOM 97 HD12 ILE A 6 10.119 81.311 -17.982 1.00 0.00 H ATOM 98 HD13 ILE A 6 11.064 82.214 -16.772 1.00 0.00 H ATOM 99 HG21 ILE A 6 6.166 80.917 -16.271 1.00 0.00 H ATOM 100 HG22 ILE A 6 7.862 80.391 -16.131 1.00 0.00 H ATOM 101 HG23 ILE A 6 7.258 81.728 -15.121 1.00 0.00 H ATOM 102 H ILE A 6 7.486 83.541 -19.608 1.00 0.00 H ATOM 103 N THR A 7 6.022 79.727 -18.979 1.00 14.65 N ATOM 104 CA THR A 7 4.768 79.044 -19.303 1.00 14.53 C ATOM 105 C THR A 7 4.280 78.106 -18.197 1.00 14.48 C ATOM 106 O THR A 7 3.363 77.313 -18.411 1.00 14.40 O ATOM 107 CB THR A 7 4.936 78.215 -20.577 1.00 14.42 C ATOM 108 OG1 THR A 7 5.992 77.259 -20.387 1.00 13.46 O ATOM 109 CG2 THR A 7 5.267 79.129 -21.761 1.00 14.24 C ATOM 110 HA THR A 7 4.027 79.833 -19.430 1.00 0.00 H ATOM 111 HB THR A 7 4.005 77.691 -20.790 1.00 0.00 H ATOM 112 HG1 THR A 7 6.102 76.722 -21.211 1.00 0.00 H ATOM 113 HG23 THR A 7 4.461 79.850 -21.898 1.00 0.00 H ATOM 114 HG21 THR A 7 6.199 79.657 -21.561 1.00 0.00 H ATOM 115 HG22 THR A 7 5.375 78.528 -22.664 1.00 0.00 H ATOM 116 H THR A 7 6.889 79.159 -18.897 1.00 0.00 H ATOM 117 N GLY A 8 4.901 78.190 -17.025 1.00 14.37 N ATOM 118 CA GLY A 8 4.527 77.363 -15.895 1.00 14.35 C ATOM 119 C GLY A 8 5.421 77.642 -14.708 1.00 14.47 C ATOM 120 O GLY A 8 6.553 78.108 -14.865 1.00 14.47 O ATOM 121 HA3 GLY A 8 4.619 76.313 -16.174 1.00 0.00 H ATOM 122 HA2 GLY A 8 3.493 77.576 -15.622 1.00 0.00 H ATOM 123 H GLY A 8 5.680 78.871 -16.915 1.00 0.00 H ATOM 124 N LEU A 9 4.911 77.363 -13.516 1.00 14.54 N ATOM 125 CA LEU A 9 5.682 77.564 -12.305 1.00 14.73 C ATOM 126 C LEU A 9 5.249 76.647 -11.179 1.00 14.64 C ATOM 127 O LEU A 9 4.147 76.085 -11.181 1.00 14.40 O ATOM 128 CB LEU A 9 5.615 79.029 -11.861 1.00 15.12 C ATOM 129 CG LEU A 9 4.241 79.618 -11.524 1.00 15.24 C ATOM 130 CD1 LEU A 9 3.889 79.392 -10.071 1.00 16.18 C ATOM 131 CD2 LEU A 9 4.216 81.113 -11.825 1.00 15.04 C ATOM 132 HA LEU A 9 6.715 77.309 -12.542 1.00 0.00 H ATOM 133 HB2 LEU A 9 6.237 79.127 -10.971 1.00 0.00 H ATOM 134 HB3 LEU A 9 6.037 79.631 -12.665 1.00 0.00 H ATOM 135 HG LEU A 9 3.503 79.109 -12.144 1.00 0.00 H ATOM 136 HD21 LEU A 9 4.975 81.616 -11.226 1.00 0.00 H ATOM 137 HD22 LEU A 9 4.422 81.273 -12.883 1.00 0.00 H ATOM 138 HD23 LEU A 9 3.233 81.515 -11.580 1.00 0.00 H ATOM 139 HD11 LEU A 9 3.868 78.322 -9.866 1.00 0.00 H ATOM 140 HD12 LEU A 9 4.637 79.870 -9.439 1.00 0.00 H ATOM 141 HD13 LEU A 9 2.909 79.822 -9.865 1.00 0.00 H ATOM 142 H LEU A 9 3.941 76.994 -13.449 1.00 0.00 H ATOM 143 N GLY A 10 6.152 76.497 -10.222 1.00 14.58 N ATOM 144 CA GLY A 10 5.919 75.669 -9.052 1.00 14.46 C ATOM 145 C GLY A 10 6.800 76.125 -7.916 1.00 14.33 C ATOM 146 O GLY A 10 7.902 76.635 -8.144 1.00 14.20 O ATOM 147 HA3 GLY A 10 6.147 74.631 -9.292 1.00 0.00 H ATOM 148 HA2 GLY A 10 4.874 75.750 -8.754 1.00 0.00 H ATOM 149 H GLY A 10 7.063 76.991 -10.312 1.00 0.00 H ATOM 150 N ILE A 11 6.325 75.931 -6.693 1.00 14.20 N ATOM 151 CA ILE A 11 6.983 76.510 -5.541 1.00 14.48 C ATOM 152 C ILE A 11 6.647 75.778 -4.240 1.00 14.66 C ATOM 153 O ILE A 11 5.511 75.346 -4.027 1.00 14.69 O ATOM 154 CB ILE A 11 6.648 78.030 -5.434 1.00 14.35 C ATOM 155 CG1 ILE A 11 7.469 78.696 -4.324 1.00 13.92 C ATOM 156 CG2 ILE A 11 5.143 78.250 -5.240 1.00 14.25 C ATOM 157 CD1 ILE A 11 7.565 80.202 -4.442 1.00 13.99 C ATOM 158 HA ILE A 11 8.057 76.394 -5.690 1.00 0.00 H ATOM 159 HB ILE A 11 6.926 78.506 -6.374 1.00 0.00 H ATOM 160 HG12 ILE A 11 7.007 78.457 -3.366 1.00 0.00 H ATOM 161 HG13 ILE A 11 8.478 78.286 -4.352 1.00 0.00 H ATOM 162 HD11 ILE A 11 8.037 80.462 -5.390 1.00 0.00 H ATOM 163 HD12 ILE A 11 6.564 80.633 -4.403 1.00 0.00 H ATOM 164 HD13 ILE A 11 8.162 80.592 -3.618 1.00 0.00 H ATOM 165 HG21 ILE A 11 4.603 77.832 -6.090 1.00 0.00 H ATOM 166 HG22 ILE A 11 4.820 77.755 -4.324 1.00 0.00 H ATOM 167 HG23 ILE A 11 4.940 79.318 -5.169 1.00 0.00 H ATOM 168 H ILE A 11 5.469 75.356 -6.560 1.00 0.00 H ATOM 169 N VAL A 12 7.667 75.614 -3.401 1.00 14.85 N ATOM 170 CA VAL A 12 7.500 75.130 -2.036 1.00 15.35 C ATOM 171 C VAL A 12 8.262 76.104 -1.140 1.00 15.58 C ATOM 172 O VAL A 12 9.496 76.125 -1.147 1.00 15.53 O ATOM 173 CB VAL A 12 8.035 73.685 -1.856 1.00 15.50 C ATOM 174 CG1 VAL A 12 7.944 73.246 -0.406 1.00 15.85 C ATOM 175 CG2 VAL A 12 7.255 72.710 -2.725 1.00 16.00 C ATOM 176 HA VAL A 12 6.442 75.088 -1.778 1.00 0.00 H ATOM 177 HB VAL A 12 9.081 73.684 -2.162 1.00 0.00 H ATOM 178 HG11 VAL A 12 8.538 73.918 0.214 1.00 0.00 H ATOM 179 HG12 VAL A 12 6.903 73.276 -0.083 1.00 0.00 H ATOM 180 HG13 VAL A 12 8.326 72.230 -0.311 1.00 0.00 H ATOM 181 HG21 VAL A 12 6.203 72.734 -2.442 1.00 0.00 H ATOM 182 HG22 VAL A 12 7.357 72.996 -3.772 1.00 0.00 H ATOM 183 HG23 VAL A 12 7.648 71.703 -2.582 1.00 0.00 H ATOM 184 H VAL A 12 8.626 75.841 -3.734 1.00 0.00 H ATOM 185 N SER A 13 7.530 76.923 -0.387 1.00 15.85 N ATOM 186 CA SER A 13 8.164 77.935 0.456 1.00 16.05 C ATOM 187 C SER A 13 7.524 78.077 1.827 1.00 16.29 C ATOM 188 O SER A 13 6.505 77.437 2.140 1.00 16.46 O ATOM 189 CB SER A 13 8.196 79.294 -0.254 1.00 16.13 C ATOM 190 OG SER A 13 6.941 79.934 -0.234 1.00 16.72 O ATOM 191 HA SER A 13 9.182 77.584 0.624 1.00 0.00 H ATOM 192 HB2 SER A 13 8.496 79.142 -1.291 1.00 0.00 H ATOM 193 HB3 SER A 13 8.925 79.934 0.244 1.00 0.00 H ATOM 194 HG SER A 13 7.008 80.804 -0.702 1.00 0.00 H ATOM 195 H SER A 13 6.493 76.841 -0.399 1.00 0.00 H ATOM 196 N SER A 14 8.171 78.909 2.642 1.00 16.36 N ATOM 197 CA SER A 14 7.721 79.241 3.986 1.00 16.35 C ATOM 198 C SER A 14 6.308 79.799 4.016 1.00 16.53 C ATOM 199 O SER A 14 5.614 79.645 5.016 1.00 16.90 O ATOM 200 CB SER A 14 8.675 80.265 4.622 1.00 16.33 C ATOM 201 OG SER A 14 8.693 81.482 3.892 1.00 14.82 O ATOM 202 HA SER A 14 7.721 78.310 4.552 1.00 0.00 H ATOM 203 HB2 SER A 14 9.682 79.848 4.641 1.00 0.00 H ATOM 204 HB3 SER A 14 8.348 80.468 5.642 1.00 0.00 H ATOM 205 HG SER A 14 9.315 82.117 4.327 1.00 0.00 H ATOM 206 H SER A 14 9.049 79.347 2.298 1.00 0.00 H ATOM 207 N ILE A 15 5.890 80.460 2.939 1.00 16.78 N ATOM 208 CA ILE A 15 4.547 81.053 2.873 1.00 17.03 C ATOM 209 C ILE A 15 3.560 80.304 1.949 1.00 17.19 C ATOM 210 O ILE A 15 2.495 80.837 1.634 1.00 17.24 O ATOM 211 CB ILE A 15 4.609 82.570 2.491 1.00 16.95 C ATOM 212 CG1 ILE A 15 5.136 82.779 1.063 1.00 16.90 C ATOM 213 CG2 ILE A 15 5.459 83.331 3.494 1.00 16.93 C ATOM 214 CD1 ILE A 15 4.920 84.188 0.534 1.00 17.52 C ATOM 215 HA ILE A 15 4.148 80.951 3.882 1.00 0.00 H ATOM 216 HB ILE A 15 3.592 82.961 2.521 1.00 0.00 H ATOM 217 HG12 ILE A 15 6.205 82.568 1.056 1.00 0.00 H ATOM 218 HG13 ILE A 15 4.625 82.080 0.401 1.00 0.00 H ATOM 219 HD11 ILE A 15 3.853 84.411 0.524 1.00 0.00 H ATOM 220 HD12 ILE A 15 5.435 84.900 1.179 1.00 0.00 H ATOM 221 HD13 ILE A 15 5.317 84.259 -0.478 1.00 0.00 H ATOM 222 HG21 ILE A 15 5.023 83.231 4.488 1.00 0.00 H ATOM 223 HG22 ILE A 15 6.469 82.922 3.496 1.00 0.00 H ATOM 224 HG23 ILE A 15 5.493 84.384 3.215 1.00 0.00 H ATOM 225 H ILE A 15 6.529 80.559 2.125 1.00 0.00 H ATOM 226 N GLY A 16 3.902 79.081 1.531 1.00 17.17 N ATOM 227 CA GLY A 16 2.980 78.250 0.741 1.00 17.08 C ATOM 228 C GLY A 16 3.608 77.054 0.030 1.00 17.07 C ATOM 229 O GLY A 16 4.746 77.124 -0.443 1.00 17.13 O ATOM 230 HA3 GLY A 16 2.521 78.886 -0.016 1.00 0.00 H ATOM 231 HA2 GLY A 16 2.209 77.873 1.413 1.00 0.00 H ATOM 232 H GLY A 16 4.843 78.708 1.770 1.00 0.00 H ATOM 233 N ASN A 17 2.852 75.958 -0.060 1.00 16.91 N ATOM 234 CA ASN A 17 3.339 74.710 -0.670 1.00 16.88 C ATOM 235 C ASN A 17 2.969 74.572 -2.138 1.00 16.62 C ATOM 236 O ASN A 17 3.274 73.568 -2.768 1.00 16.44 O ATOM 237 CB ASN A 17 2.828 73.499 0.112 1.00 16.93 C ATOM 238 CG ASN A 17 3.469 73.381 1.477 1.00 16.80 C ATOM 239 OD1 ASN A 17 4.668 73.606 1.628 1.00 18.13 O ATOM 240 ND2 ASN A 17 2.677 73.020 2.475 1.00 15.45 N ATOM 241 HA ASN A 17 4.427 74.752 -0.622 1.00 0.00 H ATOM 242 HB2 ASN A 17 1.749 73.593 0.239 1.00 0.00 H ATOM 243 HB3 ASN A 17 3.048 72.596 -0.458 1.00 0.00 H ATOM 244 HD22 ASN A 17 1.668 72.840 2.299 1.00 0.00 H ATOM 245 HD21 ASN A 17 3.064 72.916 3.435 1.00 0.00 H ATOM 246 H ASN A 17 1.882 75.987 0.315 1.00 0.00 H ATOM 247 N ASN A 18 2.302 75.590 -2.666 1.00 16.63 N ATOM 248 CA ASN A 18 2.015 75.695 -4.090 1.00 16.92 C ATOM 249 C ASN A 18 1.720 77.154 -4.410 1.00 16.90 C ATOM 250 O ASN A 18 1.689 77.991 -3.516 1.00 16.65 O ATOM 251 CB ASN A 18 0.831 74.805 -4.475 1.00 16.90 C ATOM 252 CG ASN A 18 -0.411 75.083 -3.638 1.00 16.78 C ATOM 253 OD1 ASN A 18 -0.867 76.220 -3.536 1.00 16.45 O ATOM 254 ND2 ASN A 18 -0.954 74.040 -3.032 1.00 16.96 N ATOM 255 HA ASN A 18 2.875 75.355 -4.666 1.00 0.00 H ATOM 256 HB2 ASN A 18 0.591 74.978 -5.524 1.00 0.00 H ATOM 257 HB3 ASN A 18 1.119 73.763 -4.337 1.00 0.00 H ATOM 258 HD22 ASN A 18 -0.534 73.095 -3.147 1.00 0.00 H ATOM 259 HD21 ASN A 18 -1.801 74.165 -2.441 1.00 0.00 H ATOM 260 H ASN A 18 1.969 76.347 -2.035 1.00 0.00 H ATOM 261 N GLN A 19 1.482 77.463 -5.673 1.00 17.28 N ATOM 262 CA GLN A 19 1.283 78.847 -6.057 1.00 17.78 C ATOM 263 C GLN A 19 0.013 79.466 -5.470 1.00 18.28 C ATOM 264 O GLN A 19 -0.030 80.674 -5.247 1.00 18.40 O ATOM 265 CB GLN A 19 1.316 79.003 -7.574 1.00 17.75 C ATOM 266 CG GLN A 19 0.128 78.472 -8.342 1.00 17.53 C ATOM 267 CD GLN A 19 0.049 79.118 -9.697 1.00 17.95 C ATOM 268 OE1 GLN A 19 0.473 78.538 -10.698 1.00 19.54 O ATOM 269 NE2 GLN A 19 -0.441 80.357 -9.736 1.00 18.23 N ATOM 270 HA GLN A 19 2.116 79.403 -5.627 1.00 0.00 H ATOM 271 HB2 GLN A 19 1.402 80.067 -7.794 1.00 0.00 H ATOM 272 HB3 GLN A 19 2.203 78.485 -7.939 1.00 0.00 H ATOM 273 HG2 GLN A 19 0.231 77.394 -8.463 1.00 0.00 H ATOM 274 HG3 GLN A 19 -0.785 78.688 -7.787 1.00 0.00 H ATOM 275 HE22 GLN A 19 -0.788 80.807 -8.865 1.00 0.00 H ATOM 276 HE21 GLN A 19 -0.476 80.874 -10.638 1.00 0.00 H ATOM 277 H GLN A 19 1.437 76.713 -6.392 1.00 0.00 H ATOM 278 N GLN A 20 -1.005 78.647 -5.207 1.00 18.81 N ATOM 279 CA GLN A 20 -2.256 79.158 -4.647 1.00 19.26 C ATOM 280 C GLN A 20 -2.062 79.583 -3.188 1.00 19.36 C ATOM 281 O GLN A 20 -2.415 80.703 -2.827 1.00 19.35 O ATOM 282 CB GLN A 20 -3.396 78.145 -4.782 1.00 19.51 C ATOM 283 CG GLN A 20 -3.738 77.769 -6.241 1.00 20.56 C ATOM 284 CD GLN A 20 -2.991 76.529 -6.744 1.00 21.37 C ATOM 285 OE1 GLN A 20 -2.182 75.949 -6.031 1.00 21.37 O ATOM 286 NE2 GLN A 20 -3.268 76.128 -7.980 1.00 21.36 N ATOM 287 HA GLN A 20 -2.541 80.038 -5.224 1.00 0.00 H ATOM 288 HB2 GLN A 20 -3.111 77.236 -4.252 1.00 0.00 H ATOM 289 HB3 GLN A 20 -4.287 78.569 -4.320 1.00 0.00 H ATOM 290 HG2 GLN A 20 -4.809 77.577 -6.306 1.00 0.00 H ATOM 291 HG3 GLN A 20 -3.481 78.611 -6.884 1.00 0.00 H ATOM 292 HE22 GLN A 20 -3.962 76.649 -8.553 1.00 0.00 H ATOM 293 HE21 GLN A 20 -2.791 75.293 -8.375 1.00 0.00 H ATOM 294 H GLN A 20 -0.909 77.630 -5.403 1.00 0.00 H ATOM 295 N GLU A 21 -1.480 78.709 -2.369 1.00 19.42 N ATOM 296 CA GLU A 21 -1.145 79.063 -0.981 1.00 19.97 C ATOM 297 C GLU A 21 -0.248 80.302 -0.885 1.00 20.01 C ATOM 298 O GLU A 21 -0.437 81.140 -0.002 1.00 19.91 O ATOM 299 CB GLU A 21 -0.472 77.893 -0.252 1.00 19.86 C ATOM 300 CG GLU A 21 -1.403 76.707 0.000 1.00 20.60 C ATOM 301 CD GLU A 21 -0.743 75.572 0.770 1.00 21.52 C ATOM 302 OE1 GLU A 21 0.409 75.744 1.245 1.00 22.24 O ATOM 303 OE2 GLU A 21 -1.385 74.499 0.899 1.00 23.72 O ATOM 304 HA GLU A 21 -2.094 79.295 -0.498 1.00 0.00 H ATOM 305 HB2 GLU A 21 0.368 77.549 -0.855 1.00 0.00 H ATOM 306 HB3 GLU A 21 -0.104 78.252 0.709 1.00 0.00 H ATOM 307 HG2 GLU A 21 -2.263 77.058 0.571 1.00 0.00 H ATOM 308 HG3 GLU A 21 -1.740 76.322 -0.962 1.00 0.00 H ATOM 309 H GLU A 21 -1.257 77.755 -2.718 1.00 0.00 H ATOM 310 N VAL A 22 0.721 80.412 -1.795 1.00 20.16 N ATOM 311 CA VAL A 22 1.664 81.538 -1.804 1.00 20.33 C ATOM 312 C VAL A 22 0.964 82.849 -2.176 1.00 20.57 C ATOM 313 O VAL A 22 1.244 83.894 -1.586 1.00 20.21 O ATOM 314 CB VAL A 22 2.868 81.256 -2.753 1.00 20.07 C ATOM 315 CG1 VAL A 22 3.668 82.522 -3.057 1.00 20.24 C ATOM 316 CG2 VAL A 22 3.764 80.209 -2.145 1.00 19.71 C ATOM 317 HA VAL A 22 2.055 81.648 -0.792 1.00 0.00 H ATOM 318 HB VAL A 22 2.466 80.891 -3.698 1.00 0.00 H ATOM 319 HG11 VAL A 22 3.019 83.253 -3.539 1.00 0.00 H ATOM 320 HG12 VAL A 22 4.057 82.936 -2.127 1.00 0.00 H ATOM 321 HG13 VAL A 22 4.496 82.276 -3.722 1.00 0.00 H ATOM 322 HG21 VAL A 22 4.137 80.565 -1.185 1.00 0.00 H ATOM 323 HG22 VAL A 22 3.198 79.289 -1.998 1.00 0.00 H ATOM 324 HG23 VAL A 22 4.603 80.018 -2.814 1.00 0.00 H ATOM 325 H VAL A 22 0.812 79.675 -2.523 1.00 0.00 H ATOM 326 N LEU A 23 0.054 82.784 -3.147 1.00 21.13 N ATOM 327 CA LEU A 23 -0.726 83.953 -3.567 1.00 21.39 C ATOM 328 C LEU A 23 -1.488 84.548 -2.385 1.00 21.75 C ATOM 329 O LEU A 23 -1.510 85.765 -2.189 1.00 21.75 O ATOM 330 CB LEU A 23 -1.739 83.562 -4.644 1.00 21.47 C ATOM 331 CG LEU A 23 -2.142 84.562 -5.731 1.00 21.51 C ATOM 332 CD1 LEU A 23 -3.571 84.254 -6.170 1.00 22.29 C ATOM 333 CD2 LEU A 23 -2.016 86.022 -5.323 1.00 21.83 C ATOM 334 HA LEU A 23 -0.027 84.690 -3.963 1.00 0.00 H ATOM 335 HB2 LEU A 23 -1.330 82.691 -5.156 1.00 0.00 H ATOM 336 HB3 LEU A 23 -2.654 83.279 -4.124 1.00 0.00 H ATOM 337 HG LEU A 23 -1.439 84.437 -6.554 1.00 0.00 H ATOM 338 HD21 LEU A 23 -2.656 86.214 -4.462 1.00 0.00 H ATOM 339 HD22 LEU A 23 -0.980 86.237 -5.062 1.00 0.00 H ATOM 340 HD23 LEU A 23 -2.322 86.658 -6.154 1.00 0.00 H ATOM 341 HD11 LEU A 23 -3.618 83.238 -6.563 1.00 0.00 H ATOM 342 HD12 LEU A 23 -4.240 84.345 -5.314 1.00 0.00 H ATOM 343 HD13 LEU A 23 -3.872 84.959 -6.945 1.00 0.00 H ATOM 344 H LEU A 23 -0.109 81.874 -3.623 1.00 0.00 H ATOM 345 N ALA A 24 -2.121 83.661 -1.622 1.00 22.26 N ATOM 346 CA ALA A 24 -2.898 84.016 -0.432 1.00 22.58 C ATOM 347 C ALA A 24 -2.039 84.700 0.628 1.00 23.00 C ATOM 348 O ALA A 24 -2.438 85.714 1.201 1.00 23.28 O ATOM 349 CB ALA A 24 -3.535 82.764 0.154 1.00 22.58 C ATOM 350 HA ALA A 24 -3.670 84.722 -0.738 1.00 0.00 H ATOM 351 HB1 ALA A 24 -4.193 82.312 -0.588 1.00 0.00 H ATOM 352 HB2 ALA A 24 -2.754 82.055 0.429 1.00 0.00 H ATOM 353 HB3 ALA A 24 -4.112 83.032 1.039 1.00 0.00 H ATOM 354 H ALA A 24 -2.061 82.657 -1.886 1.00 0.00 H ATOM 355 N SER A 25 -0.858 84.134 0.880 1.00 23.34 N ATOM 356 CA SER A 25 0.072 84.684 1.861 1.00 23.36 C ATOM 357 C SER A 25 0.585 86.066 1.461 1.00 23.67 C ATOM 358 O SER A 25 0.681 86.954 2.303 1.00 23.39 O ATOM 359 CB SER A 25 1.248 83.735 2.065 1.00 23.12 C ATOM 360 OG SER A 25 0.822 82.511 2.636 1.00 22.72 O ATOM 361 HA SER A 25 -0.477 84.794 2.796 1.00 0.00 H ATOM 362 HB2 SER A 25 1.974 84.205 2.729 1.00 0.00 H ATOM 363 HB3 SER A 25 1.716 83.535 1.101 1.00 0.00 H ATOM 364 HG SER A 25 1.603 81.915 2.757 1.00 0.00 H ATOM 365 H SER A 25 -0.591 83.273 0.361 1.00 0.00 H ATOM 366 N LEU A 26 0.910 86.238 0.181 1.00 24.21 N ATOM 367 CA LEU A 26 1.415 87.511 -0.338 1.00 24.89 C ATOM 368 C LEU A 26 0.402 88.645 -0.234 1.00 25.58 C ATOM 369 O LEU A 26 0.760 89.768 0.126 1.00 25.49 O ATOM 370 CB LEU A 26 1.839 87.371 -1.801 1.00 24.76 C ATOM 371 CG LEU A 26 3.068 86.511 -2.108 1.00 24.60 C ATOM 372 CD1 LEU A 26 3.151 86.244 -3.596 1.00 24.06 C ATOM 373 CD2 LEU A 26 4.337 87.168 -1.598 1.00 24.26 C ATOM 374 HA LEU A 26 2.272 87.765 0.287 1.00 0.00 H ATOM 375 HB2 LEU A 26 0.997 86.942 -2.344 1.00 0.00 H ATOM 376 HB3 LEU A 26 2.040 88.373 -2.179 1.00 0.00 H ATOM 377 HG LEU A 26 2.965 85.558 -1.589 1.00 0.00 H ATOM 378 HD21 LEU A 26 4.461 88.138 -2.079 1.00 0.00 H ATOM 379 HD22 LEU A 26 4.266 87.303 -0.519 1.00 0.00 H ATOM 380 HD23 LEU A 26 5.192 86.533 -1.831 1.00 0.00 H ATOM 381 HD11 LEU A 26 2.253 85.718 -3.920 1.00 0.00 H ATOM 382 HD12 LEU A 26 3.231 87.191 -4.130 1.00 0.00 H ATOM 383 HD13 LEU A 26 4.028 85.632 -3.806 1.00 0.00 H ATOM 384 H LEU A 26 0.801 85.438 -0.475 1.00 0.00 H ATOM 385 N ARG A 27 -0.852 88.355 -0.575 1.00 26.60 N ATOM 386 CA ARG A 27 -1.918 89.357 -0.521 1.00 27.35 C ATOM 387 C ARG A 27 -2.257 89.726 0.922 1.00 27.80 C ATOM 388 O ARG A 27 -2.613 90.867 1.201 1.00 28.12 O ATOM 389 CB ARG A 27 -3.171 88.866 -1.259 1.00 27.53 C ATOM 390 CG ARG A 27 -3.040 88.891 -2.784 1.00 28.06 C ATOM 391 CD ARG A 27 -4.369 89.159 -3.495 1.00 29.14 C ATOM 392 NE ARG A 27 -4.961 87.960 -4.105 1.00 30.92 N ATOM 393 CZ ARG A 27 -5.385 87.860 -5.370 1.00 31.89 C ATOM 394 NH1 ARG A 27 -5.307 88.888 -6.218 1.00 32.56 N ATOM 395 NH2 ARG A 27 -5.911 86.715 -5.796 1.00 32.32 N ATOM 396 HA ARG A 27 -1.554 90.253 -1.023 1.00 0.00 H ATOM 397 HB2 ARG A 27 -3.374 87.841 -0.948 1.00 0.00 H ATOM 398 HB3 ARG A 27 -4.009 89.503 -0.975 1.00 0.00 H ATOM 399 HG2 ARG A 27 -2.334 89.675 -3.059 1.00 0.00 H ATOM 400 HG3 ARG A 27 -2.657 87.926 -3.116 1.00 0.00 H ATOM 401 HD2 ARG A 27 -4.198 89.897 -4.279 1.00 0.00 H ATOM 402 HD3 ARG A 27 -5.075 89.560 -2.768 1.00 0.00 H ATOM 403 HE ARG A 27 -5.059 87.118 -3.502 1.00 0.00 H ATOM 404 HH12 ARG A 27 -5.644 88.782 -7.196 1.00 0.00 H ATOM 405 HH11 ARG A 27 -4.909 89.795 -5.901 1.00 0.00 H ATOM 406 HH22 ARG A 27 -6.243 86.629 -6.778 1.00 0.00 H ATOM 407 HH21 ARG A 27 -5.990 85.906 -5.147 1.00 0.00 H ATOM 408 H ARG A 27 -1.081 87.390 -0.888 1.00 0.00 H ATOM 409 N GLU A 28 -2.121 88.759 1.828 1.00 28.41 N ATOM 410 CA GLU A 28 -2.411 88.944 3.251 1.00 28.35 C ATOM 411 C GLU A 28 -1.206 89.498 4.042 1.00 28.34 C ATOM 412 O GLU A 28 -1.355 89.928 5.185 1.00 28.21 O ATOM 413 CB GLU A 28 -2.872 87.594 3.830 1.00 28.86 C ATOM 414 CG GLU A 28 -3.126 87.520 5.350 1.00 30.01 C ATOM 415 CD GLU A 28 -4.388 88.249 5.814 1.00 33.98 C ATOM 416 OE1 GLU A 28 -4.545 88.414 7.049 1.00 36.02 O ATOM 417 OE2 GLU A 28 -5.225 88.647 4.964 1.00 35.47 O ATOM 418 HA GLU A 28 -3.198 89.691 3.348 1.00 0.00 H ATOM 419 HB2 GLU A 28 -3.802 87.325 3.330 1.00 0.00 H ATOM 420 HB3 GLU A 28 -2.105 86.857 3.591 1.00 0.00 H ATOM 421 HG2 GLU A 28 -3.215 86.471 5.631 1.00 0.00 H ATOM 422 HG3 GLU A 28 -2.270 87.960 5.861 1.00 0.00 H ATOM 423 H GLU A 28 -1.792 87.826 1.508 1.00 0.00 H ATOM 424 N GLY A 29 -0.018 89.493 3.439 1.00 28.17 N ATOM 425 CA GLY A 29 1.211 89.809 4.167 1.00 27.95 C ATOM 426 C GLY A 29 1.543 88.803 5.264 1.00 27.86 C ATOM 427 O GLY A 29 2.127 89.166 6.289 1.00 27.79 O ATOM 428 HA3 GLY A 29 1.099 90.793 4.623 1.00 0.00 H ATOM 429 HA2 GLY A 29 2.037 89.831 3.457 1.00 0.00 H ATOM 430 H GLY A 29 0.037 89.259 2.427 1.00 0.00 H ATOM 431 N ARG A 30 1.174 87.537 5.055 1.00 27.81 N ATOM 432 CA ARG A 30 1.399 86.490 6.058 1.00 27.57 C ATOM 433 C ARG A 30 2.880 86.124 6.155 1.00 26.89 C ATOM 434 O ARG A 30 3.537 85.905 5.135 1.00 27.33 O ATOM 435 CB ARG A 30 0.570 85.244 5.729 1.00 27.75 C ATOM 436 CG ARG A 30 0.855 84.042 6.636 1.00 28.70 C ATOM 437 CD ARG A 30 -0.218 82.957 6.558 1.00 30.32 C ATOM 438 NE ARG A 30 -1.560 83.497 6.791 1.00 33.26 N ATOM 439 CZ ARG A 30 -2.540 83.561 5.885 1.00 34.89 C ATOM 440 NH1 ARG A 30 -2.375 83.091 4.647 1.00 35.92 N ATOM 441 NH2 ARG A 30 -3.713 84.090 6.227 1.00 34.80 N ATOM 442 HA ARG A 30 1.081 86.882 7.024 1.00 0.00 H ATOM 443 HB2 ARG A 30 -0.485 85.501 5.823 1.00 0.00 H ATOM 444 HB3 ARG A 30 0.782 84.954 4.700 1.00 0.00 H ATOM 445 HG2 ARG A 30 1.810 83.606 6.343 1.00 0.00 H ATOM 446 HG3 ARG A 30 0.918 84.393 7.666 1.00 0.00 H ATOM 447 HD2 ARG A 30 -0.008 82.198 7.312 1.00 0.00 H ATOM 448 HD3 ARG A 30 -0.188 82.502 5.568 1.00 0.00 H ATOM 449 HE ARG A 30 -1.767 83.862 7.743 1.00 0.00 H ATOM 450 HH12 ARG A 30 -3.153 83.152 3.960 1.00 0.00 H ATOM 451 HH11 ARG A 30 -1.468 82.663 4.370 1.00 0.00 H ATOM 452 HH22 ARG A 30 -4.482 84.144 5.529 1.00 0.00 H ATOM 453 HH21 ARG A 30 -3.860 84.449 7.192 1.00 0.00 H ATOM 454 H ARG A 30 0.714 87.286 4.156 1.00 0.00 H ATOM 455 N SER A 31 3.397 86.061 7.380 1.00 26.00 N ATOM 456 CA SER A 31 4.777 85.648 7.626 1.00 25.35 C ATOM 457 C SER A 31 4.882 84.129 7.613 1.00 24.87 C ATOM 458 O SER A 31 3.973 83.435 8.079 1.00 24.62 O ATOM 459 CB SER A 31 5.263 86.170 8.982 1.00 25.34 C ATOM 460 OG SER A 31 6.552 85.664 9.309 1.00 24.45 O ATOM 461 HA SER A 31 5.400 86.066 6.835 1.00 0.00 H ATOM 462 HB2 SER A 31 4.556 85.863 9.753 1.00 0.00 H ATOM 463 HB3 SER A 31 5.309 87.258 8.946 1.00 0.00 H ATOM 464 HG SER A 31 7.201 85.944 8.616 1.00 0.00 H ATOM 465 H SER A 31 2.797 86.315 8.191 1.00 0.00 H ATOM 466 N GLY A 32 5.999 83.623 7.086 1.00 24.13 N ATOM 467 CA GLY A 32 6.303 82.191 7.128 1.00 23.68 C ATOM 468 C GLY A 32 7.328 81.830 8.195 1.00 23.07 C ATOM 469 O GLY A 32 7.807 80.699 8.244 1.00 22.81 O ATOM 470 HA3 GLY A 32 6.693 81.890 6.156 1.00 0.00 H ATOM 471 HA2 GLY A 32 5.382 81.646 7.333 1.00 0.00 H ATOM 472 H GLY A 32 6.676 84.267 6.630 1.00 0.00 H ATOM 473 N ILE A 33 7.648 82.782 9.064 1.00 22.64 N ATOM 474 CA ILE A 33 8.740 82.623 10.018 1.00 22.43 C ATOM 475 C ILE A 33 8.231 82.078 11.351 1.00 22.13 C ATOM 476 O ILE A 33 7.265 82.595 11.904 1.00 22.19 O ATOM 477 CB ILE A 33 9.491 83.966 10.220 1.00 22.53 C ATOM 478 CG1 ILE A 33 9.948 84.539 8.866 1.00 22.40 C ATOM 479 CG2 ILE A 33 10.681 83.803 11.172 1.00 22.45 C ATOM 480 CD1 ILE A 33 10.664 83.542 7.956 1.00 22.74 C ATOM 481 HA ILE A 33 9.443 81.897 9.608 1.00 0.00 H ATOM 482 HB ILE A 33 8.797 84.672 10.677 1.00 0.00 H ATOM 483 HG12 ILE A 33 9.068 84.908 8.339 1.00 0.00 H ATOM 484 HG13 ILE A 33 10.627 85.369 9.061 1.00 0.00 H ATOM 485 HD11 ILE A 33 11.557 83.171 8.458 1.00 0.00 H ATOM 486 HD12 ILE A 33 9.997 82.709 7.736 1.00 0.00 H ATOM 487 HD13 ILE A 33 10.947 84.038 7.027 1.00 0.00 H ATOM 488 HG21 ILE A 33 10.324 83.456 12.142 1.00 0.00 H ATOM 489 HG22 ILE A 33 11.378 83.075 10.758 1.00 0.00 H ATOM 490 HG23 ILE A 33 11.184 84.763 11.291 1.00 0.00 H ATOM 491 H ILE A 33 7.103 83.668 9.064 1.00 0.00 H ATOM 492 N THR A 34 8.889 81.026 11.846 1.00 21.76 N ATOM 493 CA THR A 34 8.535 80.380 13.111 1.00 21.53 C ATOM 494 C THR A 34 9.760 80.199 14.003 1.00 21.40 C ATOM 495 O THR A 34 10.897 80.233 13.527 1.00 21.23 O ATOM 496 CB THR A 34 7.913 78.979 12.888 1.00 21.64 C ATOM 497 OG1 THR A 34 8.846 78.122 12.204 1.00 21.45 O ATOM 498 CG2 THR A 34 6.637 79.082 12.082 1.00 21.71 C ATOM 499 HA THR A 34 7.809 81.037 13.589 1.00 0.00 H ATOM 500 HB THR A 34 7.680 78.553 13.864 1.00 0.00 H ATOM 501 HG1 THR A 34 9.074 78.519 11.326 1.00 0.00 H ATOM 502 HG23 THR A 34 5.932 79.731 12.601 1.00 0.00 H ATOM 503 HG21 THR A 34 6.862 79.499 11.100 1.00 0.00 H ATOM 504 HG22 THR A 34 6.201 78.090 11.966 1.00 0.00 H ATOM 505 H THR A 34 9.693 80.647 11.306 1.00 0.00 H ATOM 506 N PHE A 35 9.518 79.996 15.296 1.00 21.01 N ATOM 507 CA PHE A 35 10.579 79.617 16.218 1.00 20.83 C ATOM 508 C PHE A 35 11.095 78.220 15.867 1.00 20.71 C ATOM 509 O PHE A 35 10.316 77.326 15.508 1.00 20.55 O ATOM 510 CB PHE A 35 10.093 79.642 17.670 1.00 20.83 C ATOM 511 CG PHE A 35 11.082 79.064 18.647 1.00 20.70 C ATOM 512 CD1 PHE A 35 11.038 77.720 18.982 1.00 20.69 C ATOM 513 CD2 PHE A 35 12.066 79.862 19.212 1.00 20.15 C ATOM 514 CE1 PHE A 35 11.960 77.177 19.871 1.00 21.45 C ATOM 515 CE2 PHE A 35 12.984 79.337 20.106 1.00 20.34 C ATOM 516 CZ PHE A 35 12.939 77.989 20.434 1.00 20.95 C ATOM 517 HA PHE A 35 11.387 80.342 16.121 1.00 0.00 H ATOM 518 HB2 PHE A 35 9.896 80.677 17.950 1.00 0.00 H ATOM 519 HB3 PHE A 35 9.169 79.068 17.734 1.00 0.00 H ATOM 520 HD2 PHE A 35 12.117 80.918 18.948 1.00 0.00 H ATOM 521 HE2 PHE A 35 13.741 79.982 20.552 1.00 0.00 H ATOM 522 HZ PHE A 35 13.667 77.569 21.129 1.00 0.00 H ATOM 523 HE1 PHE A 35 11.915 76.118 20.126 1.00 0.00 H ATOM 524 HD1 PHE A 35 10.272 77.081 18.544 1.00 0.00 H ATOM 525 H PHE A 35 8.549 80.111 15.656 1.00 0.00 H ATOM 526 N SER A 36 12.410 78.045 15.985 1.00 20.49 N ATOM 527 CA SER A 36 13.069 76.792 15.657 1.00 20.40 C ATOM 528 C SER A 36 13.798 76.200 16.858 1.00 20.25 C ATOM 529 O SER A 36 14.826 76.729 17.284 1.00 20.52 O ATOM 530 CB SER A 36 14.073 77.018 14.528 1.00 20.35 C ATOM 531 OG SER A 36 14.777 75.819 14.247 1.00 20.32 O ATOM 532 HA SER A 36 12.297 76.088 15.346 1.00 0.00 H ATOM 533 HB2 SER A 36 14.782 77.790 14.826 1.00 0.00 H ATOM 534 HB3 SER A 36 13.541 77.341 13.633 1.00 0.00 H ATOM 535 HG SER A 36 15.263 75.525 15.058 1.00 0.00 H ATOM 536 H SER A 36 12.990 78.838 16.326 1.00 0.00 H ATOM 537 N GLN A 37 13.287 75.092 17.386 1.00 19.98 N ATOM 538 CA GLN A 37 13.968 74.401 18.482 1.00 19.95 C ATOM 539 C GLN A 37 15.292 73.806 18.021 1.00 19.80 C ATOM 540 O GLN A 37 16.258 73.783 18.792 1.00 19.81 O ATOM 541 CB GLN A 37 13.081 73.310 19.090 1.00 19.88 C ATOM 542 CG GLN A 37 13.640 72.670 20.382 1.00 19.94 C ATOM 543 CD GLN A 37 13.816 73.667 21.537 1.00 19.92 C ATOM 544 OE1 GLN A 37 14.847 73.670 22.214 1.00 18.61 O ATOM 545 NE2 GLN A 37 12.809 74.510 21.759 1.00 18.42 N ATOM 546 HA GLN A 37 14.174 75.144 19.253 1.00 0.00 H ATOM 547 HB2 GLN A 37 12.111 73.750 19.321 1.00 0.00 H ATOM 548 HB3 GLN A 37 12.954 72.522 18.348 1.00 0.00 H ATOM 549 HG2 GLN A 37 12.953 71.887 20.704 1.00 0.00 H ATOM 550 HG3 GLN A 37 14.611 72.229 20.156 1.00 0.00 H ATOM 551 HE22 GLN A 37 11.958 74.472 21.163 1.00 0.00 H ATOM 552 HE21 GLN A 37 12.874 75.206 22.529 1.00 0.00 H ATOM 553 H GLN A 37 12.393 74.712 17.016 1.00 0.00 H ATOM 554 N GLU A 38 15.337 73.321 16.777 1.00 19.57 N ATOM 555 CA GLU A 38 16.573 72.765 16.205 1.00 19.55 C ATOM 556 C GLU A 38 17.714 73.785 16.239 1.00 19.42 C ATOM 557 O GLU A 38 18.840 73.452 16.624 1.00 19.07 O ATOM 558 CB GLU A 38 16.354 72.290 14.763 1.00 19.54 C ATOM 559 CG GLU A 38 17.629 71.784 14.067 1.00 19.38 C ATOM 560 CD GLU A 38 17.396 71.386 12.614 1.00 19.39 C ATOM 561 OE1 GLU A 38 18.301 71.611 11.783 1.00 17.72 O ATOM 562 OE2 GLU A 38 16.309 70.850 12.305 1.00 19.82 O ATOM 563 HA GLU A 38 16.850 71.909 16.821 1.00 0.00 H ATOM 564 HB2 GLU A 38 15.626 71.479 14.777 1.00 0.00 H ATOM 565 HB3 GLU A 38 15.956 73.124 14.185 1.00 0.00 H ATOM 566 HG2 GLU A 38 18.378 72.576 14.095 1.00 0.00 H ATOM 567 HG3 GLU A 38 18.000 70.915 14.610 1.00 0.00 H ATOM 568 H GLU A 38 14.474 73.337 16.197 1.00 0.00 H ATOM 569 N LEU A 39 17.419 75.019 15.829 1.00 19.48 N ATOM 570 CA LEU A 39 18.422 76.077 15.829 1.00 19.87 C ATOM 571 C LEU A 39 18.894 76.420 17.244 1.00 20.11 C ATOM 572 O LEU A 39 20.092 76.367 17.524 1.00 20.17 O ATOM 573 CB LEU A 39 17.909 77.325 15.114 1.00 19.75 C ATOM 574 CG LEU A 39 17.594 77.185 13.617 1.00 19.88 C ATOM 575 CD1 LEU A 39 17.360 78.564 13.015 1.00 20.07 C ATOM 576 CD2 LEU A 39 18.684 76.452 12.844 1.00 19.87 C ATOM 577 HA LEU A 39 19.283 75.697 15.280 1.00 0.00 H ATOM 578 HB2 LEU A 39 16.994 77.640 15.616 1.00 0.00 H ATOM 579 HB3 LEU A 39 18.667 78.101 15.221 1.00 0.00 H ATOM 580 HG LEU A 39 16.692 76.578 13.532 1.00 0.00 H ATOM 581 HD21 LEU A 39 19.623 76.999 12.935 1.00 0.00 H ATOM 582 HD22 LEU A 39 18.805 75.449 13.252 1.00 0.00 H ATOM 583 HD23 LEU A 39 18.401 76.386 11.793 1.00 0.00 H ATOM 584 HD11 LEU A 39 16.520 79.042 13.520 1.00 0.00 H ATOM 585 HD12 LEU A 39 18.256 79.172 13.143 1.00 0.00 H ATOM 586 HD13 LEU A 39 17.137 78.462 11.953 1.00 0.00 H ATOM 587 H LEU A 39 16.454 75.231 15.503 1.00 0.00 H ATOM 588 N LYS A 40 17.957 76.757 18.127 1.00 20.45 N ATOM 589 CA LYS A 40 18.275 77.005 19.538 1.00 20.67 C ATOM 590 C LYS A 40 19.127 75.877 20.138 1.00 20.79 C ATOM 591 O LYS A 40 20.182 76.138 20.722 1.00 20.77 O ATOM 592 CB LYS A 40 16.987 77.209 20.358 1.00 20.70 C ATOM 593 CG LYS A 40 17.231 77.415 21.859 1.00 20.98 C ATOM 594 CD LYS A 40 16.249 78.392 22.475 1.00 21.53 C ATOM 595 CE LYS A 40 16.679 78.836 23.878 1.00 22.30 C ATOM 596 NZ LYS A 40 15.944 78.096 24.953 1.00 23.77 N ATOM 597 HA LYS A 40 18.866 77.920 19.584 1.00 0.00 H ATOM 598 HB2 LYS A 40 16.469 78.086 19.971 1.00 0.00 H ATOM 599 HB3 LYS A 40 16.356 76.330 20.230 1.00 0.00 H ATOM 600 HG2 LYS A 40 17.134 76.454 22.365 1.00 0.00 H ATOM 601 HG3 LYS A 40 18.242 77.798 22.000 1.00 0.00 H ATOM 602 HD2 LYS A 40 16.179 79.271 21.834 1.00 0.00 H ATOM 603 HD3 LYS A 40 15.272 77.913 22.542 1.00 0.00 H ATOM 604 HE2 LYS A 40 16.480 79.902 23.986 1.00 0.00 H ATOM 605 HE3 LYS A 40 17.747 78.653 23.993 1.00 0.00 H ATOM 606 HZ1 LYS A 40 14.923 78.270 24.856 1.00 0.00 H ATOM 607 HZ2 LYS A 40 16.133 77.077 24.863 1.00 0.00 H ATOM 608 HZ3 LYS A 40 16.267 78.429 25.884 1.00 0.00 H ATOM 609 H LYS A 40 16.971 76.847 17.808 1.00 0.00 H ATOM 610 N ASP A 41 18.681 74.633 19.969 1.00 20.83 N ATOM 611 CA ASP A 41 19.411 73.470 20.480 1.00 21.05 C ATOM 612 C ASP A 41 20.840 73.353 19.947 1.00 20.99 C ATOM 613 O ASP A 41 21.728 72.894 20.665 1.00 20.82 O ATOM 614 CB ASP A 41 18.663 72.175 20.156 1.00 21.38 C ATOM 615 CG ASP A 41 17.378 72.022 20.949 1.00 23.19 C ATOM 616 OD1 ASP A 41 16.695 70.985 20.752 1.00 24.72 O ATOM 617 OD2 ASP A 41 17.046 72.932 21.757 1.00 24.03 O ATOM 618 HA ASP A 41 19.474 73.623 21.557 1.00 0.00 H ATOM 619 HB2 ASP A 41 18.419 72.170 19.094 1.00 0.00 H ATOM 620 HB3 ASP A 41 19.314 71.331 20.382 1.00 0.00 H ATOM 621 H ASP A 41 17.787 74.483 19.459 1.00 0.00 H ATOM 622 N SER A 42 21.066 73.755 18.695 1.00 20.91 N ATOM 623 CA SER A 42 22.422 73.712 18.116 1.00 20.80 C ATOM 624 C SER A 42 23.401 74.654 18.841 1.00 20.64 C ATOM 625 O SER A 42 24.609 74.491 18.741 1.00 20.66 O ATOM 626 CB SER A 42 22.400 74.020 16.605 1.00 20.73 C ATOM 627 OG SER A 42 22.159 75.391 16.333 1.00 19.89 O ATOM 628 HA SER A 42 22.783 72.693 18.257 1.00 0.00 H ATOM 629 HB2 SER A 42 21.613 73.427 16.139 1.00 0.00 H ATOM 630 HB3 SER A 42 23.364 73.743 16.177 1.00 0.00 H ATOM 631 HG SER A 42 21.282 75.652 16.710 1.00 0.00 H ATOM 632 H SER A 42 20.274 74.104 18.118 1.00 0.00 H ATOM 633 N GLY A 43 22.873 75.622 19.580 1.00 20.69 N ATOM 634 CA GLY A 43 23.700 76.581 20.306 1.00 20.86 C ATOM 635 C GLY A 43 23.805 77.891 19.551 1.00 20.90 C ATOM 636 O GLY A 43 24.656 78.715 19.852 1.00 21.06 O ATOM 637 HA3 GLY A 43 24.698 76.164 20.437 1.00 0.00 H ATOM 638 HA2 GLY A 43 23.255 76.768 21.283 1.00 0.00 H ATOM 639 H GLY A 43 21.838 75.700 19.644 1.00 0.00 H ATOM 640 N MET A 44 22.940 78.081 18.561 1.00 20.99 N ATOM 641 CA MET A 44 22.925 79.310 17.783 1.00 21.21 C ATOM 642 C MET A 44 22.288 80.436 18.575 1.00 21.07 C ATOM 643 O MET A 44 21.632 80.199 19.589 1.00 21.10 O ATOM 644 CB MET A 44 22.159 79.109 16.469 1.00 21.22 C ATOM 645 CG MET A 44 22.995 78.476 15.368 1.00 21.35 C ATOM 646 SD MET A 44 22.016 77.946 13.955 1.00 21.66 S ATOM 647 CE MET A 44 21.343 79.503 13.390 1.00 21.29 C ATOM 648 HA MET A 44 23.957 79.575 17.555 1.00 0.00 H ATOM 649 HB2 MET A 44 21.302 78.465 16.665 1.00 0.00 H ATOM 650 HB3 MET A 44 21.810 80.081 16.121 1.00 0.00 H ATOM 651 HG2 MET A 44 23.510 77.608 15.779 1.00 0.00 H ATOM 652 HG3 MET A 44 23.730 79.205 15.027 1.00 0.00 H ATOM 653 HE1 MET A 44 20.748 79.950 14.186 1.00 0.00 H ATOM 654 HE2 MET A 44 22.159 80.175 13.124 1.00 0.00 H ATOM 655 HE3 MET A 44 20.714 79.330 12.517 1.00 0.00 H ATOM 656 H MET A 44 22.255 77.331 18.336 1.00 0.00 H ATOM 657 N ARG A 45 22.491 81.657 18.089 1.00 21.21 N ATOM 658 CA ARG A 45 21.881 82.858 18.650 1.00 21.48 C ATOM 659 C ARG A 45 20.616 83.253 17.894 1.00 21.17 C ATOM 660 O ARG A 45 19.722 83.878 18.471 1.00 21.42 O ATOM 661 CB ARG A 45 22.872 84.020 18.621 1.00 21.61 C ATOM 662 CG ARG A 45 24.163 83.766 19.402 1.00 22.54 C ATOM 663 CD ARG A 45 25.178 84.877 19.196 1.00 23.91 C ATOM 664 NE ARG A 45 25.470 85.106 17.775 1.00 26.62 N ATOM 665 CZ ARG A 45 26.410 85.931 17.306 1.00 28.13 C ATOM 666 NH1 ARG A 45 27.192 86.631 18.131 1.00 28.68 N ATOM 667 NH2 ARG A 45 26.580 86.047 15.991 1.00 27.93 N ATOM 668 HA ARG A 45 21.608 82.633 19.681 1.00 0.00 H ATOM 669 HB2 ARG A 45 23.135 84.219 17.582 1.00 0.00 H ATOM 670 HB3 ARG A 45 22.383 84.897 19.045 1.00 0.00 H ATOM 671 HG2 ARG A 45 23.925 83.698 20.464 1.00 0.00 H ATOM 672 HG3 ARG A 45 24.598 82.824 19.067 1.00 0.00 H ATOM 673 HD2 ARG A 45 26.103 84.607 19.705 1.00 0.00 H ATOM 674 HD3 ARG A 45 24.783 85.797 19.626 1.00 0.00 H ATOM 675 HE ARG A 45 24.900 84.585 17.079 1.00 0.00 H ATOM 676 HH12 ARG A 45 27.918 87.268 17.744 1.00 0.00 H ATOM 677 HH11 ARG A 45 27.075 86.540 19.160 1.00 0.00 H ATOM 678 HH22 ARG A 45 27.309 86.687 15.615 1.00 0.00 H ATOM 679 HH21 ARG A 45 25.984 85.498 15.339 1.00 0.00 H ATOM 680 H ARG A 45 23.118 81.761 17.266 1.00 0.00 H ATOM 681 N SER A 46 20.550 82.917 16.605 1.00 20.93 N ATOM 682 CA SER A 46 19.317 83.057 15.819 1.00 20.66 C ATOM 683 C SER A 46 18.450 81.826 16.042 1.00 20.53 C ATOM 684 O SER A 46 18.897 80.706 15.798 1.00 20.59 O ATOM 685 CB SER A 46 19.637 83.198 14.329 1.00 20.65 C ATOM 686 OG SER A 46 18.467 83.468 13.567 1.00 20.20 O ATOM 687 HA SER A 46 18.788 83.954 16.141 1.00 0.00 H ATOM 688 HB2 SER A 46 20.085 82.270 13.973 1.00 0.00 H ATOM 689 HB3 SER A 46 20.344 84.016 14.194 1.00 0.00 H ATOM 690 HG SER A 46 18.058 84.313 13.881 1.00 0.00 H ATOM 691 H SER A 46 21.402 82.543 16.140 1.00 0.00 H ATOM 692 N HIS A 47 17.218 82.033 16.506 1.00 20.43 N ATOM 693 CA HIS A 47 16.295 80.933 16.803 1.00 20.48 C ATOM 694 C HIS A 47 15.036 80.950 15.936 1.00 20.51 C ATOM 695 O HIS A 47 14.024 80.341 16.301 1.00 20.40 O ATOM 696 CB HIS A 47 15.864 80.977 18.267 1.00 20.67 C ATOM 697 CG HIS A 47 16.999 80.909 19.238 1.00 21.18 C ATOM 698 ND1 HIS A 47 16.884 81.338 20.542 1.00 20.51 N ATOM 699 CD2 HIS A 47 18.269 80.463 19.096 1.00 21.17 C ATOM 700 CE1 HIS A 47 18.035 81.153 21.162 1.00 21.50 C ATOM 701 NE2 HIS A 47 18.892 80.626 20.307 1.00 21.47 N ATOM 702 HA HIS A 47 16.846 80.019 16.584 1.00 0.00 H ATOM 703 HB2 HIS A 47 15.322 81.907 18.437 1.00 0.00 H ATOM 704 HB3 HIS A 47 15.201 80.132 18.455 1.00 0.00 H ATOM 705 HD2 HIS A 47 18.713 80.052 18.190 1.00 0.00 H ATOM 706 HE1 HIS A 47 18.243 81.395 22.204 1.00 0.00 H ATOM 707 H HIS A 47 16.900 83.010 16.663 1.00 0.00 H ATOM 708 N VAL A 48 15.097 81.633 14.796 1.00 20.16 N ATOM 709 CA VAL A 48 13.941 81.762 13.915 1.00 20.30 C ATOM 710 C VAL A 48 14.280 81.313 12.498 1.00 20.29 C ATOM 711 O VAL A 48 15.441 81.348 12.080 1.00 20.05 O ATOM 712 CB VAL A 48 13.385 83.210 13.895 1.00 20.10 C ATOM 713 CG1 VAL A 48 12.756 83.540 15.229 1.00 20.25 C ATOM 714 CG2 VAL A 48 14.475 84.229 13.559 1.00 20.08 C ATOM 715 HA VAL A 48 13.164 81.110 14.316 1.00 0.00 H ATOM 716 HB VAL A 48 12.628 83.267 13.113 1.00 0.00 H ATOM 717 HG11 VAL A 48 11.940 82.844 15.427 1.00 0.00 H ATOM 718 HG12 VAL A 48 13.507 83.454 16.014 1.00 0.00 H ATOM 719 HG13 VAL A 48 12.369 84.559 15.205 1.00 0.00 H ATOM 720 HG21 VAL A 48 15.265 84.174 14.308 1.00 0.00 H ATOM 721 HG22 VAL A 48 14.889 84.006 12.576 1.00 0.00 H ATOM 722 HG23 VAL A 48 14.045 85.231 13.555 1.00 0.00 H ATOM 723 H VAL A 48 15.993 82.087 14.525 1.00 0.00 H ATOM 724 N TRP A 49 13.264 80.880 11.761 1.00 20.42 N ATOM 725 CA TRP A 49 13.483 80.479 10.383 1.00 20.63 C ATOM 726 C TRP A 49 12.221 80.459 9.521 1.00 20.72 C ATOM 727 O TRP A 49 11.102 80.398 10.031 1.00 20.41 O ATOM 728 CB TRP A 49 14.217 79.127 10.324 1.00 20.95 C ATOM 729 CG TRP A 49 13.489 77.946 10.878 1.00 20.69 C ATOM 730 CD1 TRP A 49 12.188 77.877 11.265 1.00 21.09 C ATOM 731 CD2 TRP A 49 14.022 76.632 11.041 1.00 20.63 C ATOM 732 NE1 TRP A 49 11.883 76.612 11.686 1.00 21.15 N ATOM 733 CE2 TRP A 49 12.989 75.822 11.551 1.00 20.95 C ATOM 734 CE3 TRP A 49 15.278 76.063 10.815 1.00 20.67 C ATOM 735 CZ2 TRP A 49 13.172 74.468 11.846 1.00 21.17 C ATOM 736 CZ3 TRP A 49 15.463 74.719 11.109 1.00 20.84 C ATOM 737 CH2 TRP A 49 14.415 73.937 11.620 1.00 21.14 C ATOM 738 HA TRP A 49 14.113 81.254 9.946 1.00 0.00 H ATOM 739 HB2 TRP A 49 14.441 78.917 9.278 1.00 0.00 H ATOM 740 HB3 TRP A 49 15.149 79.232 10.880 1.00 0.00 H ATOM 741 HE1 TRP A 49 10.959 76.302 12.050 1.00 0.00 H ATOM 742 HD1 TRP A 49 11.487 78.711 11.243 1.00 0.00 H ATOM 743 HZ2 TRP A 49 12.359 73.859 12.240 1.00 0.00 H ATOM 744 HH2 TRP A 49 14.594 72.885 11.842 1.00 0.00 H ATOM 745 HZ3 TRP A 49 16.439 74.263 10.940 1.00 0.00 H ATOM 746 HE3 TRP A 49 16.096 76.662 10.416 1.00 0.00 H ATOM 747 H TRP A 49 12.310 80.828 12.171 1.00 0.00 H ATOM 748 N GLY A 50 12.439 80.526 8.208 1.00 20.97 N ATOM 749 CA GLY A 50 11.386 80.399 7.206 1.00 21.06 C ATOM 750 C GLY A 50 11.333 78.957 6.754 1.00 21.29 C ATOM 751 O GLY A 50 11.941 78.574 5.748 1.00 21.36 O ATOM 752 HA3 GLY A 50 11.606 81.044 6.356 1.00 0.00 H ATOM 753 HA2 GLY A 50 10.428 80.685 7.639 1.00 0.00 H ATOM 754 H GLY A 50 13.414 80.677 7.879 1.00 0.00 H ATOM 755 N ASN A 51 10.602 78.156 7.517 1.00 21.42 N ATOM 756 CA ASN A 51 10.561 76.713 7.320 1.00 21.65 C ATOM 757 C ASN A 51 9.441 76.275 6.386 1.00 21.75 C ATOM 758 O ASN A 51 8.380 76.891 6.347 1.00 21.39 O ATOM 759 CB ASN A 51 10.393 76.011 8.667 1.00 21.64 C ATOM 760 CG ASN A 51 9.160 76.483 9.429 1.00 21.84 C ATOM 761 OD1 ASN A 51 8.782 77.662 9.375 1.00 22.39 O ATOM 762 ND2 ASN A 51 8.527 75.561 10.144 1.00 21.71 N ATOM 763 HA ASN A 51 11.505 76.432 6.854 1.00 0.00 H ATOM 764 HB2 ASN A 51 10.306 74.939 8.493 1.00 0.00 H ATOM 765 HB3 ASN A 51 11.276 76.208 9.275 1.00 0.00 H ATOM 766 HD22 ASN A 51 8.880 74.583 10.160 1.00 0.00 H ATOM 767 HD21 ASN A 51 7.678 75.817 10.688 1.00 0.00 H ATOM 768 H ASN A 51 10.037 78.573 8.284 1.00 0.00 H ATOM 769 N VAL A 52 9.694 75.201 5.645 1.00 22.11 N ATOM 770 CA VAL A 52 8.682 74.579 4.804 1.00 22.86 C ATOM 771 C VAL A 52 7.780 73.734 5.697 1.00 23.31 C ATOM 772 O VAL A 52 8.275 72.944 6.505 1.00 22.99 O ATOM 773 CB VAL A 52 9.325 73.696 3.706 1.00 22.80 C ATOM 774 CG1 VAL A 52 8.266 72.898 2.948 1.00 22.52 C ATOM 775 CG2 VAL A 52 10.150 74.561 2.740 1.00 22.82 C ATOM 776 HA VAL A 52 8.105 75.354 4.299 1.00 0.00 H ATOM 777 HB VAL A 52 9.992 72.984 4.191 1.00 0.00 H ATOM 778 HG11 VAL A 52 7.731 72.253 3.645 1.00 0.00 H ATOM 779 HG12 VAL A 52 7.564 73.585 2.476 1.00 0.00 H ATOM 780 HG13 VAL A 52 8.750 72.289 2.185 1.00 0.00 H ATOM 781 HG21 VAL A 52 9.500 75.298 2.269 1.00 0.00 H ATOM 782 HG22 VAL A 52 10.938 75.071 3.294 1.00 0.00 H ATOM 783 HG23 VAL A 52 10.595 73.925 1.975 1.00 0.00 H ATOM 784 H VAL A 52 10.649 74.790 5.667 1.00 0.00 H ATOM 785 N LYS A 53 6.468 73.913 5.552 1.00 24.08 N ATOM 786 CA LYS A 53 5.484 73.222 6.393 1.00 24.93 C ATOM 787 C LYS A 53 4.792 72.171 5.534 1.00 25.58 C ATOM 788 O LYS A 53 3.651 72.358 5.108 1.00 25.74 O ATOM 789 CB LYS A 53 4.434 74.183 6.990 1.00 25.04 C ATOM 790 CG LYS A 53 4.781 75.681 7.025 1.00 25.32 C ATOM 791 CD LYS A 53 5.666 76.065 8.186 1.00 24.97 C ATOM 792 CE LYS A 53 5.640 77.591 8.401 1.00 25.42 C ATOM 793 NZ LYS A 53 6.294 78.383 7.318 1.00 24.02 N ATOM 794 HA LYS A 53 6.005 72.768 7.236 1.00 0.00 H ATOM 795 HB2 LYS A 53 3.521 74.073 6.406 1.00 0.00 H ATOM 796 HB3 LYS A 53 4.248 73.867 8.016 1.00 0.00 H ATOM 797 HG2 LYS A 53 5.295 75.939 6.099 1.00 0.00 H ATOM 798 HG3 LYS A 53 3.853 76.249 7.095 1.00 0.00 H ATOM 799 HD2 LYS A 53 5.310 75.569 9.089 1.00 0.00 H ATOM 800 HD3 LYS A 53 6.688 75.749 7.978 1.00 0.00 H ATOM 801 HE2 LYS A 53 6.150 77.811 9.339 1.00 0.00 H ATOM 802 HE3 LYS A 53 4.599 77.907 8.472 1.00 0.00 H ATOM 803 HZ1 LYS A 53 7.294 78.106 7.243 1.00 0.00 H ATOM 804 HZ2 LYS A 53 5.812 78.197 6.415 1.00 0.00 H ATOM 805 HZ3 LYS A 53 6.230 79.396 7.544 1.00 0.00 H ATOM 806 H LYS A 53 6.129 74.566 4.817 1.00 0.00 H ATOM 807 N LEU A 54 5.501 71.081 5.263 1.00 26.45 N ATOM 808 CA LEU A 54 4.993 70.010 4.413 1.00 26.93 C ATOM 809 C LEU A 54 5.575 68.688 4.872 1.00 27.63 C ATOM 810 O LEU A 54 6.780 68.585 5.103 1.00 27.98 O ATOM 811 CB LEU A 54 5.376 70.265 2.951 1.00 27.04 C ATOM 812 CG LEU A 54 4.999 69.216 1.891 1.00 26.93 C ATOM 813 CD1 LEU A 54 3.491 69.011 1.802 1.00 27.38 C ATOM 814 CD2 LEU A 54 5.543 69.625 0.539 1.00 26.89 C ATOM 815 HA LEU A 54 3.906 69.979 4.489 1.00 0.00 H ATOM 816 HB2 LEU A 54 4.905 71.203 2.655 1.00 0.00 H ATOM 817 HB3 LEU A 54 6.460 70.378 2.919 1.00 0.00 H ATOM 818 HG LEU A 54 5.445 68.269 2.195 1.00 0.00 H ATOM 819 HD21 LEU A 54 5.121 70.589 0.255 1.00 0.00 H ATOM 820 HD22 LEU A 54 6.629 69.705 0.595 1.00 0.00 H ATOM 821 HD23 LEU A 54 5.270 68.875 -0.203 1.00 0.00 H ATOM 822 HD11 LEU A 54 3.114 68.672 2.767 1.00 0.00 H ATOM 823 HD12 LEU A 54 3.013 69.953 1.535 1.00 0.00 H ATOM 824 HD13 LEU A 54 3.272 68.262 1.041 1.00 0.00 H ATOM 825 H LEU A 54 6.453 70.988 5.672 1.00 0.00 H ATOM 826 N ASP A 55 4.714 67.686 5.018 1.00 28.45 N ATOM 827 CA ASP A 55 5.153 66.315 5.235 1.00 28.61 C ATOM 828 C ASP A 55 5.436 65.716 3.864 1.00 28.85 C ATOM 829 O ASP A 55 4.509 65.404 3.113 1.00 28.97 O ATOM 830 CB ASP A 55 4.070 65.513 5.963 1.00 28.86 C ATOM 831 CG ASP A 55 4.533 64.114 6.360 1.00 29.41 C ATOM 832 OD1 ASP A 55 3.713 63.386 6.968 1.00 31.08 O ATOM 833 OD2 ASP A 55 5.701 63.743 6.079 1.00 30.84 O ATOM 834 HA ASP A 55 6.047 66.288 5.859 1.00 0.00 H ATOM 835 HB2 ASP A 55 3.783 66.054 6.865 1.00 0.00 H ATOM 836 HB3 ASP A 55 3.205 65.420 5.306 1.00 0.00 H ATOM 837 H ASP A 55 3.695 67.888 4.976 1.00 0.00 H ATOM 838 N THR A 56 6.716 65.564 3.535 1.00 29.05 N ATOM 839 CA THR A 56 7.117 65.102 2.202 1.00 29.13 C ATOM 840 C THR A 56 7.172 63.577 2.079 1.00 29.31 C ATOM 841 O THR A 56 7.542 63.050 1.022 1.00 29.47 O ATOM 842 CB THR A 56 8.479 65.690 1.807 1.00 29.20 C ATOM 843 OG1 THR A 56 9.448 65.365 2.811 1.00 28.85 O ATOM 844 CG2 THR A 56 8.377 67.209 1.655 1.00 29.21 C ATOM 845 HA THR A 56 6.343 65.457 1.522 1.00 0.00 H ATOM 846 HB THR A 56 8.788 65.264 0.852 1.00 0.00 H ATOM 847 HG1 THR A 56 9.162 65.746 3.679 1.00 0.00 H ATOM 848 HG23 THR A 56 7.638 67.448 0.890 1.00 0.00 H ATOM 849 HG21 THR A 56 8.073 67.648 2.605 1.00 0.00 H ATOM 850 HG22 THR A 56 9.348 67.610 1.362 1.00 0.00 H ATOM 851 H THR A 56 7.450 65.778 4.240 1.00 0.00 H ATOM 852 N THR A 57 6.808 62.876 3.154 1.00 29.35 N ATOM 853 CA THR A 57 6.784 61.416 3.168 1.00 29.24 C ATOM 854 C THR A 57 5.769 60.923 2.143 1.00 29.05 C ATOM 855 O THR A 57 4.620 61.351 2.150 1.00 29.34 O ATOM 856 CB THR A 57 6.397 60.869 4.577 1.00 29.57 C ATOM 857 OG1 THR A 57 7.265 61.426 5.574 1.00 30.08 O ATOM 858 CG2 THR A 57 6.495 59.343 4.632 1.00 29.68 C ATOM 859 HA THR A 57 7.782 61.054 2.922 1.00 0.00 H ATOM 860 HB THR A 57 5.365 61.160 4.771 1.00 0.00 H ATOM 861 HG1 THR A 57 7.178 62.412 5.571 1.00 0.00 H ATOM 862 HG23 THR A 57 5.838 58.911 3.877 1.00 0.00 H ATOM 863 HG21 THR A 57 7.524 59.039 4.438 1.00 0.00 H ATOM 864 HG22 THR A 57 6.193 58.996 5.620 1.00 0.00 H ATOM 865 H THR A 57 6.531 63.389 4.015 1.00 0.00 H ATOM 866 N GLY A 58 6.204 60.044 1.248 1.00 28.66 N ATOM 867 CA GLY A 58 5.303 59.420 0.280 1.00 28.34 C ATOM 868 C GLY A 58 5.135 60.159 -1.037 1.00 27.99 C ATOM 869 O GLY A 58 4.548 59.624 -1.970 1.00 27.90 O ATOM 870 HA3 GLY A 58 4.320 59.334 0.744 1.00 0.00 H ATOM 871 HA2 GLY A 58 5.687 58.424 0.059 1.00 0.00 H ATOM 872 H GLY A 58 7.213 59.792 1.235 1.00 0.00 H ATOM 873 N LEU A 59 5.654 61.382 -1.120 1.00 27.74 N ATOM 874 CA LEU A 59 5.427 62.242 -2.284 1.00 27.45 C ATOM 875 C LEU A 59 6.359 61.940 -3.463 1.00 27.24 C ATOM 876 O LEU A 59 5.996 62.190 -4.614 1.00 27.01 O ATOM 877 CB LEU A 59 5.514 63.721 -1.878 1.00 27.41 C ATOM 878 CG LEU A 59 4.209 64.384 -1.403 1.00 27.47 C ATOM 879 CD1 LEU A 59 3.312 63.446 -0.598 1.00 27.23 C ATOM 880 CD2 LEU A 59 4.500 65.647 -0.597 1.00 27.15 C ATOM 881 HA LEU A 59 4.420 62.023 -2.640 1.00 0.00 H ATOM 882 HB2 LEU A 59 6.239 63.800 -1.068 1.00 0.00 H ATOM 883 HB3 LEU A 59 5.874 64.280 -2.741 1.00 0.00 H ATOM 884 HG LEU A 59 3.662 64.648 -2.308 1.00 0.00 H ATOM 885 HD21 LEU A 59 5.100 65.389 0.276 1.00 0.00 H ATOM 886 HD22 LEU A 59 5.047 66.356 -1.219 1.00 0.00 H ATOM 887 HD23 LEU A 59 3.560 66.095 -0.274 1.00 0.00 H ATOM 888 HD11 LEU A 59 3.040 62.589 -1.213 1.00 0.00 H ATOM 889 HD12 LEU A 59 3.848 63.104 0.287 1.00 0.00 H ATOM 890 HD13 LEU A 59 2.410 63.978 -0.295 1.00 0.00 H ATOM 891 H LEU A 59 6.238 61.737 -0.336 1.00 0.00 H ATOM 892 N ILE A 60 7.545 61.411 -3.177 1.00 27.07 N ATOM 893 CA ILE A 60 8.493 61.006 -4.216 1.00 27.11 C ATOM 894 C ILE A 60 8.743 59.506 -4.092 1.00 27.27 C ATOM 895 O ILE A 60 8.890 58.985 -2.984 1.00 27.06 O ATOM 896 CB ILE A 60 9.828 61.782 -4.107 1.00 26.86 C ATOM 897 CG1 ILE A 60 9.565 63.293 -4.181 1.00 26.85 C ATOM 898 CG2 ILE A 60 10.796 61.351 -5.209 1.00 26.66 C ATOM 899 CD1 ILE A 60 10.750 64.158 -3.821 1.00 26.88 C ATOM 900 HA ILE A 60 8.065 61.238 -5.191 1.00 0.00 H ATOM 901 HB ILE A 60 10.287 61.552 -3.145 1.00 0.00 H ATOM 902 HG12 ILE A 60 9.264 63.536 -5.200 1.00 0.00 H ATOM 903 HG13 ILE A 60 8.751 63.530 -3.496 1.00 0.00 H ATOM 904 HD11 ILE A 60 11.059 63.941 -2.799 1.00 0.00 H ATOM 905 HD12 ILE A 60 11.573 63.947 -4.504 1.00 0.00 H ATOM 906 HD13 ILE A 60 10.470 65.208 -3.902 1.00 0.00 H ATOM 907 HG21 ILE A 60 11.000 60.284 -5.115 1.00 0.00 H ATOM 908 HG22 ILE A 60 10.349 61.553 -6.183 1.00 0.00 H ATOM 909 HG23 ILE A 60 11.727 61.910 -5.112 1.00 0.00 H ATOM 910 H ILE A 60 7.808 61.280 -2.179 1.00 0.00 H ATOM 911 N ASP A 61 8.787 58.816 -5.232 1.00 27.55 N ATOM 912 CA ASP A 61 8.997 57.365 -5.237 1.00 27.76 C ATOM 913 C ASP A 61 10.288 56.984 -4.510 1.00 27.61 C ATOM 914 O ASP A 61 11.315 57.649 -4.655 1.00 27.25 O ATOM 915 CB ASP A 61 9.010 56.806 -6.667 1.00 28.16 C ATOM 916 CG ASP A 61 7.619 56.748 -7.294 1.00 30.01 C ATOM 917 OD1 ASP A 61 6.630 56.435 -6.578 1.00 32.25 O ATOM 918 OD2 ASP A 61 7.518 57.005 -8.518 1.00 32.26 O ATOM 919 HA ASP A 61 8.158 56.920 -4.702 1.00 0.00 H ATOM 920 HB2 ASP A 61 9.644 57.443 -7.284 1.00 0.00 H ATOM 921 HB3 ASP A 61 9.424 55.798 -6.643 1.00 0.00 H ATOM 922 H ASP A 61 8.670 59.317 -6.136 1.00 0.00 H ATOM 923 N ARG A 62 10.192 55.908 -3.729 1.00 27.62 N ATOM 924 CA ARG A 62 11.271 55.377 -2.884 1.00 27.29 C ATOM 925 C ARG A 62 12.640 55.319 -3.571 1.00 26.80 C ATOM 926 O ARG A 62 13.635 55.763 -3.006 1.00 26.67 O ATOM 927 CB ARG A 62 10.832 54.001 -2.316 1.00 27.94 C ATOM 928 CG ARG A 62 11.865 52.870 -2.264 1.00 28.89 C ATOM 929 CD ARG A 62 12.866 53.027 -1.125 1.00 31.85 C ATOM 930 NE ARG A 62 14.078 52.235 -1.366 1.00 32.41 N ATOM 931 CZ ARG A 62 15.209 52.332 -0.663 1.00 33.98 C ATOM 932 NH1 ARG A 62 15.308 53.189 0.353 1.00 34.21 N ATOM 933 NH2 ARG A 62 16.255 51.568 -0.985 1.00 34.20 N ATOM 934 HA ARG A 62 11.425 56.079 -2.065 1.00 0.00 H ATOM 935 HB2 ARG A 62 10.486 54.169 -1.296 1.00 0.00 H ATOM 936 HB3 ARG A 62 10.000 53.650 -2.927 1.00 0.00 H ATOM 937 HG2 ARG A 62 11.338 51.924 -2.136 1.00 0.00 H ATOM 938 HG3 ARG A 62 12.411 52.855 -3.207 1.00 0.00 H ATOM 939 HD2 ARG A 62 12.403 52.694 -0.196 1.00 0.00 H ATOM 940 HD3 ARG A 62 13.140 54.078 -1.036 1.00 0.00 H ATOM 941 HE ARG A 62 14.054 51.545 -2.144 1.00 0.00 H ATOM 942 HH12 ARG A 62 16.194 53.255 0.893 1.00 0.00 H ATOM 943 HH11 ARG A 62 14.499 53.791 0.606 1.00 0.00 H ATOM 944 HH22 ARG A 62 17.138 51.640 -0.441 1.00 0.00 H ATOM 945 HH21 ARG A 62 16.187 50.901 -1.780 1.00 0.00 H ATOM 946 H ARG A 62 9.282 55.405 -3.717 1.00 0.00 H ATOM 947 N LYS A 63 12.680 54.795 -4.793 1.00 26.18 N ATOM 948 CA LYS A 63 13.938 54.631 -5.532 1.00 25.78 C ATOM 949 C LYS A 63 14.498 55.947 -6.104 1.00 24.74 C ATOM 950 O LYS A 63 15.651 55.997 -6.527 1.00 24.39 O ATOM 951 CB LYS A 63 13.762 53.604 -6.654 1.00 25.88 C ATOM 952 CG LYS A 63 13.512 52.176 -6.155 1.00 27.08 C ATOM 953 CD LYS A 63 13.378 51.192 -7.326 1.00 27.84 C ATOM 954 CE LYS A 63 14.723 50.579 -7.756 1.00 30.14 C ATOM 955 NZ LYS A 63 14.919 49.191 -7.210 1.00 31.43 N ATOM 956 HA LYS A 63 14.671 54.275 -4.808 1.00 0.00 H ATOM 957 HB2 LYS A 63 12.913 53.907 -7.267 1.00 0.00 H ATOM 958 HB3 LYS A 63 14.666 53.602 -7.263 1.00 0.00 H ATOM 959 HG2 LYS A 63 14.347 51.868 -5.526 1.00 0.00 H ATOM 960 HG3 LYS A 63 12.592 52.160 -5.570 1.00 0.00 H ATOM 961 HD2 LYS A 63 12.709 50.385 -7.027 1.00 0.00 H ATOM 962 HD3 LYS A 63 12.950 51.721 -8.177 1.00 0.00 H ATOM 963 HE2 LYS A 63 15.530 51.216 -7.394 1.00 0.00 H ATOM 964 HE3 LYS A 63 14.757 50.536 -8.845 1.00 0.00 H ATOM 965 HZ1 LYS A 63 14.896 49.222 -6.171 1.00 0.00 H ATOM 966 HZ2 LYS A 63 14.158 48.573 -7.556 1.00 0.00 H ATOM 967 HZ3 LYS A 63 15.838 48.822 -7.527 1.00 0.00 H ATOM 968 H LYS A 63 11.791 54.492 -5.240 1.00 0.00 H ATOM 969 N VAL A 64 13.683 56.999 -6.121 1.00 23.61 N ATOM 970 CA VAL A 64 14.120 58.322 -6.573 1.00 22.98 C ATOM 971 C VAL A 64 14.609 59.166 -5.388 1.00 22.21 C ATOM 972 O VAL A 64 15.673 59.787 -5.448 1.00 21.82 O ATOM 973 CB VAL A 64 12.972 59.061 -7.304 1.00 22.82 C ATOM 974 CG1 VAL A 64 13.367 60.488 -7.667 1.00 22.48 C ATOM 975 CG2 VAL A 64 12.560 58.285 -8.556 1.00 22.96 C ATOM 976 HA VAL A 64 14.946 58.180 -7.270 1.00 0.00 H ATOM 977 HB VAL A 64 12.122 59.117 -6.624 1.00 0.00 H ATOM 978 HG11 VAL A 64 13.609 61.039 -6.758 1.00 0.00 H ATOM 979 HG12 VAL A 64 14.237 60.467 -8.323 1.00 0.00 H ATOM 980 HG13 VAL A 64 12.536 60.975 -8.178 1.00 0.00 H ATOM 981 HG21 VAL A 64 13.415 58.199 -9.227 1.00 0.00 H ATOM 982 HG22 VAL A 64 12.220 57.290 -8.270 1.00 0.00 H ATOM 983 HG23 VAL A 64 11.752 58.815 -9.061 1.00 0.00 H ATOM 984 H VAL A 64 12.701 56.877 -5.802 1.00 0.00 H ATOM 985 N VAL A 65 13.829 59.165 -4.309 1.00 21.41 N ATOM 986 CA VAL A 65 14.073 60.041 -3.173 1.00 21.03 C ATOM 987 C VAL A 65 15.329 59.642 -2.386 1.00 20.65 C ATOM 988 O VAL A 65 15.913 60.466 -1.682 1.00 20.32 O ATOM 989 CB VAL A 65 12.823 60.103 -2.248 1.00 20.86 C ATOM 990 CG1 VAL A 65 12.712 58.853 -1.372 1.00 20.55 C ATOM 991 CG2 VAL A 65 12.833 61.375 -1.405 1.00 21.02 C ATOM 992 HA VAL A 65 14.258 61.039 -3.569 1.00 0.00 H ATOM 993 HB VAL A 65 11.939 60.131 -2.884 1.00 0.00 H ATOM 994 HG11 VAL A 65 12.628 57.972 -2.008 1.00 0.00 H ATOM 995 HG12 VAL A 65 13.601 58.769 -0.747 1.00 0.00 H ATOM 996 HG13 VAL A 65 11.828 58.931 -0.740 1.00 0.00 H ATOM 997 HG21 VAL A 65 13.730 61.392 -0.785 1.00 0.00 H ATOM 998 HG22 VAL A 65 12.827 62.245 -2.062 1.00 0.00 H ATOM 999 HG23 VAL A 65 11.949 61.394 -0.768 1.00 0.00 H ATOM 1000 H VAL A 65 13.017 58.516 -4.277 1.00 0.00 H ATOM 1001 N ARG A 66 15.735 58.379 -2.519 1.00 20.43 N ATOM 1002 CA ARG A 66 16.913 57.841 -1.828 1.00 20.33 C ATOM 1003 C ARG A 66 18.236 58.518 -2.203 1.00 19.90 C ATOM 1004 O ARG A 66 19.186 58.474 -1.428 1.00 19.86 O ATOM 1005 CB ARG A 66 17.032 56.338 -2.087 1.00 20.37 C ATOM 1006 CG ARG A 66 17.279 55.984 -3.543 1.00 20.96 C ATOM 1007 CD ARG A 66 17.283 54.483 -3.764 1.00 21.65 C ATOM 1008 NE ARG A 66 17.560 54.145 -5.161 1.00 22.43 N ATOM 1009 CZ ARG A 66 17.655 52.905 -5.639 1.00 23.39 C ATOM 1010 NH1 ARG A 66 17.488 51.858 -4.838 1.00 23.62 N ATOM 1011 NH2 ARG A 66 17.915 52.713 -6.928 1.00 23.63 N ATOM 1012 HA ARG A 66 16.748 58.049 -0.771 1.00 0.00 H ATOM 1013 HB2 ARG A 66 17.861 55.951 -1.494 1.00 0.00 H ATOM 1014 HB3 ARG A 66 16.105 55.860 -1.769 1.00 0.00 H ATOM 1015 HG2 ARG A 66 16.493 56.429 -4.153 1.00 0.00 H ATOM 1016 HG3 ARG A 66 18.245 56.388 -3.846 1.00 0.00 H ATOM 1017 HD2 ARG A 66 16.307 54.082 -3.489 1.00 0.00 H ATOM 1018 HD3 ARG A 66 18.050 54.034 -3.132 1.00 0.00 H ATOM 1019 HE ARG A 66 17.692 54.931 -5.830 1.00 0.00 H ATOM 1020 HH12 ARG A 66 17.564 50.894 -5.220 1.00 0.00 H ATOM 1021 HH11 ARG A 66 17.281 52.003 -3.829 1.00 0.00 H ATOM 1022 HH22 ARG A 66 17.990 51.747 -7.305 1.00 0.00 H ATOM 1023 HH21 ARG A 66 18.044 53.529 -7.560 1.00 0.00 H ATOM 1024 H ARG A 66 15.192 57.746 -3.141 1.00 0.00 H ATOM 1025 N PHE A 67 18.300 59.116 -3.391 1.00 19.36 N ATOM 1026 CA PHE A 67 19.480 59.865 -3.826 1.00 19.09 C ATOM 1027 C PHE A 67 19.452 61.333 -3.397 1.00 18.87 C ATOM 1028 O PHE A 67 20.445 62.049 -3.574 1.00 18.78 O ATOM 1029 CB PHE A 67 19.589 59.826 -5.346 1.00 18.97 C ATOM 1030 CG PHE A 67 19.837 58.460 -5.906 1.00 18.85 C ATOM 1031 CD1 PHE A 67 21.065 57.842 -5.733 1.00 18.75 C ATOM 1032 CD2 PHE A 67 18.854 57.806 -6.635 1.00 19.02 C ATOM 1033 CE1 PHE A 67 21.309 56.579 -6.268 1.00 19.39 C ATOM 1034 CE2 PHE A 67 19.089 56.549 -7.170 1.00 19.09 C ATOM 1035 CZ PHE A 67 20.319 55.935 -6.988 1.00 19.20 C ATOM 1036 HA PHE A 67 20.335 59.385 -3.350 1.00 0.00 H ATOM 1037 HB2 PHE A 67 18.657 60.205 -5.766 1.00 0.00 H ATOM 1038 HB3 PHE A 67 20.412 60.474 -5.647 1.00 0.00 H ATOM 1039 HD2 PHE A 67 17.887 58.286 -6.789 1.00 0.00 H ATOM 1040 HE2 PHE A 67 18.306 56.043 -7.734 1.00 0.00 H ATOM 1041 HZ PHE A 67 20.505 54.948 -7.411 1.00 0.00 H ATOM 1042 HE1 PHE A 67 22.277 56.100 -6.120 1.00 0.00 H ATOM 1043 HD1 PHE A 67 21.849 58.350 -5.172 1.00 0.00 H ATOM 1044 H PHE A 67 17.484 59.049 -4.032 1.00 0.00 H ATOM 1045 N MET A 68 18.322 61.770 -2.838 1.00 18.42 N ATOM 1046 CA MET A 68 18.014 63.186 -2.682 1.00 18.54 C ATOM 1047 C MET A 68 18.215 63.723 -1.271 1.00 18.32 C ATOM 1048 O MET A 68 17.865 63.077 -0.281 1.00 18.16 O ATOM 1049 CB MET A 68 16.555 63.451 -3.060 1.00 18.50 C ATOM 1050 CG MET A 68 16.157 63.033 -4.454 1.00 18.85 C ATOM 1051 SD MET A 68 14.495 63.616 -4.842 1.00 19.55 S ATOM 1052 CE MET A 68 14.528 63.735 -6.612 1.00 20.27 C ATOM 1053 HA MET A 68 18.716 63.699 -3.340 1.00 0.00 H ATOM 1054 HB2 MET A 68 15.922 62.912 -2.354 1.00 0.00 H ATOM 1055 HB3 MET A 68 16.373 64.522 -2.966 1.00 0.00 H ATOM 1056 HG2 MET A 68 16.180 61.945 -4.523 1.00 0.00 H ATOM 1057 HG3 MET A 68 16.862 63.456 -5.170 1.00 0.00 H ATOM 1058 HE1 MET A 68 15.304 64.439 -6.913 1.00 0.00 H ATOM 1059 HE2 MET A 68 14.741 62.754 -7.037 1.00 0.00 H ATOM 1060 HE3 MET A 68 13.559 64.084 -6.970 1.00 0.00 H ATOM 1061 H MET A 68 17.631 61.070 -2.499 1.00 0.00 H ATOM 1062 N SER A 69 18.771 64.928 -1.210 1.00 18.35 N ATOM 1063 CA SER A 69 18.720 65.778 -0.028 1.00 18.22 C ATOM 1064 C SER A 69 17.458 66.647 -0.106 1.00 18.18 C ATOM 1065 O SER A 69 16.739 66.618 -1.107 1.00 18.14 O ATOM 1066 CB SER A 69 19.946 66.683 -0.001 1.00 18.26 C ATOM 1067 OG SER A 69 19.888 67.631 -1.061 1.00 17.88 O ATOM 1068 HA SER A 69 18.702 65.163 0.872 1.00 0.00 H ATOM 1069 HB2 SER A 69 20.844 66.075 -0.112 1.00 0.00 H ATOM 1070 HB3 SER A 69 19.982 67.211 0.952 1.00 0.00 H ATOM 1071 HG SER A 69 19.859 67.154 -1.928 1.00 0.00 H ATOM 1072 H SER A 69 19.269 65.283 -2.051 1.00 0.00 H ATOM 1073 N ASP A 70 17.214 67.443 0.933 1.00 18.01 N ATOM 1074 CA ASP A 70 16.018 68.291 1.002 1.00 17.91 C ATOM 1075 C ASP A 70 15.927 69.324 -0.106 1.00 17.37 C ATOM 1076 O ASP A 70 14.836 69.595 -0.595 1.00 17.71 O ATOM 1077 CB ASP A 70 15.946 69.031 2.340 1.00 18.34 C ATOM 1078 CG ASP A 70 15.473 68.155 3.468 1.00 20.11 C ATOM 1079 OD1 ASP A 70 15.417 68.665 4.606 1.00 23.21 O ATOM 1080 OD2 ASP A 70 15.159 66.966 3.234 1.00 22.88 O ATOM 1081 HA ASP A 70 15.183 67.599 0.888 1.00 0.00 H ATOM 1082 HB2 ASP A 70 16.940 69.407 2.584 1.00 0.00 H ATOM 1083 HB3 ASP A 70 15.257 69.869 2.238 1.00 0.00 H ATOM 1084 H ASP A 70 17.893 67.465 1.721 1.00 0.00 H ATOM 1085 N ALA A 71 17.051 69.927 -0.479 1.00 16.70 N ATOM 1086 CA ALA A 71 17.057 70.885 -1.585 1.00 16.43 C ATOM 1087 C ALA A 71 16.536 70.248 -2.874 1.00 16.02 C ATOM 1088 O ALA A 71 15.796 70.882 -3.623 1.00 15.99 O ATOM 1089 CB ALA A 71 18.450 71.449 -1.806 1.00 16.47 C ATOM 1090 HA ALA A 71 16.389 71.702 -1.314 1.00 0.00 H ATOM 1091 HB1 ALA A 71 18.783 71.956 -0.901 1.00 0.00 H ATOM 1092 HB2 ALA A 71 19.137 70.636 -2.042 1.00 0.00 H ATOM 1093 HB3 ALA A 71 18.426 72.158 -2.633 1.00 0.00 H ATOM 1094 H ALA A 71 17.938 69.715 0.022 1.00 0.00 H ATOM 1095 N SER A 72 16.927 68.999 -3.119 1.00 15.44 N ATOM 1096 CA SER A 72 16.487 68.265 -4.299 1.00 15.47 C ATOM 1097 C SER A 72 15.005 67.929 -4.217 1.00 15.26 C ATOM 1098 O SER A 72 14.288 68.024 -5.214 1.00 15.31 O ATOM 1099 CB SER A 72 17.298 66.980 -4.469 1.00 15.34 C ATOM 1100 OG SER A 72 18.649 67.285 -4.763 1.00 16.36 O ATOM 1101 HA SER A 72 16.650 68.907 -5.165 1.00 0.00 H ATOM 1102 HB2 SER A 72 16.876 66.394 -5.285 1.00 0.00 H ATOM 1103 HB3 SER A 72 17.253 66.401 -3.546 1.00 0.00 H ATOM 1104 HG SER A 72 19.160 66.444 -4.870 1.00 0.00 H ATOM 1105 H SER A 72 17.568 68.532 -2.446 1.00 0.00 H ATOM 1106 N ILE A 73 14.564 67.524 -3.030 1.00 14.90 N ATOM 1107 CA ILE A 73 13.169 67.205 -2.773 1.00 14.65 C ATOM 1108 C ILE A 73 12.283 68.413 -3.061 1.00 14.46 C ATOM 1109 O ILE A 73 11.284 68.304 -3.781 1.00 14.25 O ATOM 1110 CB ILE A 73 12.970 66.713 -1.304 1.00 14.72 C ATOM 1111 CG1 ILE A 73 13.591 65.319 -1.137 1.00 14.79 C ATOM 1112 CG2 ILE A 73 11.487 66.643 -0.933 1.00 15.07 C ATOM 1113 CD1 ILE A 73 13.760 64.861 0.297 1.00 14.88 C ATOM 1114 HA ILE A 73 12.877 66.395 -3.442 1.00 0.00 H ATOM 1115 HB ILE A 73 13.460 67.429 -0.644 1.00 0.00 H ATOM 1116 HG12 ILE A 73 12.951 64.600 -1.649 1.00 0.00 H ATOM 1117 HG13 ILE A 73 14.574 65.328 -1.608 1.00 0.00 H ATOM 1118 HD11 ILE A 73 14.410 65.558 0.826 1.00 0.00 H ATOM 1119 HD12 ILE A 73 12.786 64.830 0.784 1.00 0.00 H ATOM 1120 HD13 ILE A 73 14.206 63.866 0.309 1.00 0.00 H ATOM 1121 HG21 ILE A 73 11.043 67.634 -1.029 1.00 0.00 H ATOM 1122 HG22 ILE A 73 10.979 65.949 -1.602 1.00 0.00 H ATOM 1123 HG23 ILE A 73 11.387 66.297 0.096 1.00 0.00 H ATOM 1124 H ILE A 73 15.247 67.431 -2.251 1.00 0.00 H ATOM 1125 N TYR A 74 12.656 69.565 -2.508 1.00 14.12 N ATOM 1126 CA TYR A 74 11.873 70.781 -2.694 1.00 13.83 C ATOM 1127 C TYR A 74 11.832 71.199 -4.153 1.00 13.24 C ATOM 1128 O TYR A 74 10.785 71.591 -4.658 1.00 12.68 O ATOM 1129 CB TYR A 74 12.431 71.933 -1.852 1.00 14.86 C ATOM 1130 CG TYR A 74 12.390 71.717 -0.353 1.00 15.67 C ATOM 1131 CD1 TYR A 74 11.396 70.940 0.246 1.00 16.59 C ATOM 1132 CD2 TYR A 74 13.329 72.327 0.472 1.00 16.85 C ATOM 1133 CE1 TYR A 74 11.363 70.753 1.613 1.00 16.58 C ATOM 1134 CE2 TYR A 74 13.299 72.152 1.844 1.00 16.97 C ATOM 1135 CZ TYR A 74 12.317 71.365 2.410 1.00 17.05 C ATOM 1136 OH TYR A 74 12.287 71.184 3.775 1.00 17.60 O ATOM 1137 HA TYR A 74 10.858 70.557 -2.365 1.00 0.00 H ATOM 1138 HB3 TYR A 74 11.852 72.828 -2.080 1.00 0.00 H ATOM 1139 HB2 TYR A 74 13.470 72.090 -2.142 1.00 0.00 H ATOM 1140 HD2 TYR A 74 14.103 72.954 0.029 1.00 0.00 H ATOM 1141 HE2 TYR A 74 14.047 72.633 2.474 1.00 0.00 H ATOM 1142 HE1 TYR A 74 10.592 70.128 2.063 1.00 0.00 H ATOM 1143 HD1 TYR A 74 10.633 70.473 -0.377 1.00 0.00 H ATOM 1144 HH TYR A 74 11.526 70.597 4.012 1.00 0.00 H ATOM 1145 H TYR A 74 13.522 69.598 -1.933 1.00 0.00 H ATOM 1146 N ALA A 75 12.984 71.124 -4.819 1.00 12.58 N ATOM 1147 CA ALA A 75 13.076 71.413 -6.244 1.00 12.19 C ATOM 1148 C ALA A 75 12.250 70.429 -7.081 1.00 11.65 C ATOM 1149 O ALA A 75 11.560 70.831 -8.020 1.00 11.29 O ATOM 1150 CB ALA A 75 14.527 71.389 -6.684 1.00 12.15 C ATOM 1151 HA ALA A 75 12.663 72.408 -6.409 1.00 0.00 H ATOM 1152 HB1 ALA A 75 15.087 72.141 -6.128 1.00 0.00 H ATOM 1153 HB2 ALA A 75 14.948 70.403 -6.489 1.00 0.00 H ATOM 1154 HB3 ALA A 75 14.586 71.606 -7.751 1.00 0.00 H ATOM 1155 H ALA A 75 13.845 70.850 -4.305 1.00 0.00 H ATOM 1156 N PHE A 76 12.331 69.148 -6.739 1.00 11.37 N ATOM 1157 CA PHE A 76 11.613 68.103 -7.465 1.00 11.66 C ATOM 1158 C PHE A 76 10.098 68.339 -7.399 1.00 11.58 C ATOM 1159 O PHE A 76 9.427 68.369 -8.426 1.00 11.62 O ATOM 1160 CB PHE A 76 11.968 66.728 -6.898 1.00 11.56 C ATOM 1161 CG PHE A 76 11.271 65.589 -7.578 1.00 11.44 C ATOM 1162 CD1 PHE A 76 9.998 65.210 -7.190 1.00 11.68 C ATOM 1163 CD2 PHE A 76 11.889 64.888 -8.602 1.00 11.94 C ATOM 1164 CE1 PHE A 76 9.350 64.151 -7.811 1.00 12.04 C ATOM 1165 CE2 PHE A 76 11.240 63.828 -9.228 1.00 12.29 C ATOM 1166 CZ PHE A 76 9.969 63.461 -8.825 1.00 11.67 C ATOM 1167 HA PHE A 76 11.916 68.138 -8.512 1.00 0.00 H ATOM 1168 HB2 PHE A 76 13.043 66.582 -7.000 1.00 0.00 H ATOM 1169 HB3 PHE A 76 11.699 66.713 -5.842 1.00 0.00 H ATOM 1170 HD2 PHE A 76 12.893 65.170 -8.920 1.00 0.00 H ATOM 1171 HE2 PHE A 76 11.733 63.287 -10.036 1.00 0.00 H ATOM 1172 HZ PHE A 76 9.460 62.628 -9.310 1.00 0.00 H ATOM 1173 HE1 PHE A 76 8.347 63.866 -7.493 1.00 0.00 H ATOM 1174 HD1 PHE A 76 9.498 65.750 -6.386 1.00 0.00 H ATOM 1175 H PHE A 76 12.925 68.880 -5.928 1.00 0.00 H ATOM 1176 N LEU A 77 9.576 68.530 -6.193 1.00 11.82 N ATOM 1177 CA LEU A 77 8.153 68.834 -6.002 1.00 12.39 C ATOM 1178 C LEU A 77 7.725 70.112 -6.725 1.00 12.77 C ATOM 1179 O LEU A 77 6.649 70.151 -7.330 1.00 12.68 O ATOM 1180 CB LEU A 77 7.812 68.943 -4.511 1.00 12.25 C ATOM 1181 CG LEU A 77 8.006 67.676 -3.668 1.00 12.56 C ATOM 1182 CD1 LEU A 77 7.766 67.986 -2.202 1.00 12.56 C ATOM 1183 CD2 LEU A 77 7.111 66.525 -4.131 1.00 12.41 C ATOM 1184 HA LEU A 77 7.599 68.004 -6.440 1.00 0.00 H ATOM 1185 HB2 LEU A 77 8.441 69.724 -4.084 1.00 0.00 H ATOM 1186 HB3 LEU A 77 6.765 69.237 -4.431 1.00 0.00 H ATOM 1187 HG LEU A 77 9.036 67.347 -3.803 1.00 0.00 H ATOM 1188 HD21 LEU A 77 6.066 66.825 -4.053 1.00 0.00 H ATOM 1189 HD22 LEU A 77 7.344 66.280 -5.167 1.00 0.00 H ATOM 1190 HD23 LEU A 77 7.288 65.653 -3.501 1.00 0.00 H ATOM 1191 HD11 LEU A 77 8.472 68.748 -1.873 1.00 0.00 H ATOM 1192 HD12 LEU A 77 6.748 68.352 -2.071 1.00 0.00 H ATOM 1193 HD13 LEU A 77 7.906 67.080 -1.613 1.00 0.00 H ATOM 1194 H LEU A 77 10.194 68.462 -5.359 1.00 0.00 H ATOM 1195 N SER A 78 8.563 71.149 -6.670 1.00 13.18 N ATOM 1196 CA SER A 78 8.298 72.382 -7.409 1.00 13.73 C ATOM 1197 C SER A 78 8.247 72.125 -8.903 1.00 14.50 C ATOM 1198 O SER A 78 7.468 72.753 -9.618 1.00 14.95 O ATOM 1199 CB SER A 78 9.359 73.441 -7.128 1.00 13.56 C ATOM 1200 OG SER A 78 9.436 73.726 -5.751 1.00 13.05 O ATOM 1201 HA SER A 78 7.329 72.748 -7.070 1.00 0.00 H ATOM 1202 HB2 SER A 78 9.104 74.353 -7.667 1.00 0.00 H ATOM 1203 HB3 SER A 78 10.327 73.076 -7.471 1.00 0.00 H ATOM 1204 HG SER A 78 9.672 72.901 -5.257 1.00 0.00 H ATOM 1205 H SER A 78 9.423 71.078 -6.089 1.00 0.00 H ATOM 1206 N MET A 79 9.087 71.205 -9.371 1.00 15.28 N ATOM 1207 CA MET A 79 9.138 70.869 -10.790 1.00 15.36 C ATOM 1208 C MET A 79 7.906 70.084 -11.246 1.00 15.29 C ATOM 1209 O MET A 79 7.427 70.313 -12.341 1.00 15.57 O ATOM 1210 CB MET A 79 10.423 70.111 -11.132 1.00 15.45 C ATOM 1211 CG MET A 79 10.618 69.900 -12.627 1.00 15.78 C ATOM 1212 SD MET A 79 12.298 69.418 -13.055 1.00 16.99 S ATOM 1213 CE MET A 79 12.047 68.824 -14.715 1.00 16.50 C ATOM 1214 HA MET A 79 9.139 71.812 -11.337 1.00 0.00 H ATOM 1215 HB2 MET A 79 11.272 70.678 -10.749 1.00 0.00 H ATOM 1216 HB3 MET A 79 10.390 69.136 -10.646 1.00 0.00 H ATOM 1217 HG2 MET A 79 10.381 70.830 -13.143 1.00 0.00 H ATOM 1218 HG3 MET A 79 9.936 69.117 -12.960 1.00 0.00 H ATOM 1219 HE1 MET A 79 11.341 67.994 -14.700 1.00 0.00 H ATOM 1220 HE2 MET A 79 11.649 69.630 -15.332 1.00 0.00 H ATOM 1221 HE3 MET A 79 12.998 68.486 -15.126 1.00 0.00 H ATOM 1222 H MET A 79 9.722 70.714 -8.710 1.00 0.00 H ATOM 1223 N GLU A 80 7.399 69.162 -10.432 1.00 15.19 N ATOM 1224 CA GLU A 80 6.128 68.493 -10.748 1.00 15.43 C ATOM 1225 C GLU A 80 5.013 69.510 -10.967 1.00 15.15 C ATOM 1226 O GLU A 80 4.281 69.454 -11.962 1.00 15.10 O ATOM 1227 CB GLU A 80 5.712 67.548 -9.625 1.00 15.62 C ATOM 1228 CG GLU A 80 6.429 66.216 -9.638 1.00 16.71 C ATOM 1229 CD GLU A 80 5.938 65.277 -8.548 1.00 17.36 C ATOM 1230 OE1 GLU A 80 5.576 65.768 -7.454 1.00 21.40 O ATOM 1231 OE2 GLU A 80 5.922 64.048 -8.781 1.00 18.97 O ATOM 1232 HA GLU A 80 6.286 67.923 -11.664 1.00 0.00 H ATOM 1233 HB2 GLU A 80 5.916 68.037 -8.673 1.00 0.00 H ATOM 1234 HB3 GLU A 80 4.642 67.361 -9.714 1.00 0.00 H ATOM 1235 HG2 GLU A 80 6.268 65.742 -10.606 1.00 0.00 H ATOM 1236 HG3 GLU A 80 7.495 66.392 -9.494 1.00 0.00 H ATOM 1237 H GLU A 80 7.908 68.911 -9.561 1.00 0.00 H ATOM 1238 N GLN A 81 4.887 70.430 -10.016 1.00 14.83 N ATOM 1239 CA GLN A 81 3.926 71.531 -10.105 1.00 14.35 C ATOM 1240 C GLN A 81 4.084 72.336 -11.382 1.00 14.31 C ATOM 1241 O GLN A 81 3.095 72.708 -12.016 1.00 13.93 O ATOM 1242 CB GLN A 81 4.113 72.495 -8.945 1.00 14.03 C ATOM 1243 CG GLN A 81 3.757 71.956 -7.588 1.00 13.36 C ATOM 1244 CD GLN A 81 4.031 72.976 -6.531 1.00 13.45 C ATOM 1245 OE1 GLN A 81 3.929 74.176 -6.786 1.00 13.34 O ATOM 1246 NE2 GLN A 81 4.396 72.523 -5.340 1.00 12.84 N ATOM 1247 HA GLN A 81 2.939 71.070 -10.086 1.00 0.00 H ATOM 1248 HB2 GLN A 81 5.161 72.794 -8.923 1.00 0.00 H ATOM 1249 HB3 GLN A 81 3.491 73.370 -9.132 1.00 0.00 H ATOM 1250 HG2 GLN A 81 2.698 71.697 -7.571 1.00 0.00 H ATOM 1251 HG3 GLN A 81 4.351 71.064 -7.389 1.00 0.00 H ATOM 1252 HE22 GLN A 81 4.468 71.499 -5.173 1.00 0.00 H ATOM 1253 HE21 GLN A 81 4.610 73.192 -4.573 1.00 0.00 H ATOM 1254 H GLN A 81 5.495 70.365 -9.175 1.00 0.00 H ATOM 1255 N ALA A 82 5.331 72.632 -11.733 1.00 14.28 N ATOM 1256 CA ALA A 82 5.628 73.456 -12.903 1.00 14.48 C ATOM 1257 C ALA A 82 5.274 72.732 -14.201 1.00 14.36 C ATOM 1258 O ALA A 82 4.790 73.352 -15.142 1.00 14.18 O ATOM 1259 CB ALA A 82 7.104 73.870 -12.907 1.00 14.36 C ATOM 1260 HA ALA A 82 5.011 74.353 -12.843 1.00 0.00 H ATOM 1261 HB1 ALA A 82 7.322 74.442 -12.005 1.00 0.00 H ATOM 1262 HB2 ALA A 82 7.730 72.978 -12.933 1.00 0.00 H ATOM 1263 HB3 ALA A 82 7.306 74.483 -13.786 1.00 0.00 H ATOM 1264 H ALA A 82 6.118 72.267 -11.159 1.00 0.00 H ATOM 1265 N ILE A 83 5.532 71.426 -14.240 1.00 14.64 N ATOM 1266 CA ILE A 83 5.227 70.594 -15.407 1.00 15.01 C ATOM 1267 C ILE A 83 3.715 70.590 -15.653 1.00 14.94 C ATOM 1268 O ILE A 83 3.259 70.812 -16.774 1.00 14.72 O ATOM 1269 CB ILE A 83 5.740 69.128 -15.222 1.00 15.35 C ATOM 1270 CG1 ILE A 83 7.224 68.975 -15.593 1.00 16.82 C ATOM 1271 CG2 ILE A 83 4.977 68.138 -16.117 1.00 14.87 C ATOM 1272 CD1 ILE A 83 8.163 69.966 -14.987 1.00 18.70 C ATOM 1273 HA ILE A 83 5.742 71.019 -16.268 1.00 0.00 H ATOM 1274 HB ILE A 83 5.582 68.911 -14.166 1.00 0.00 H ATOM 1275 HG12 ILE A 83 7.544 67.981 -15.282 1.00 0.00 H ATOM 1276 HG13 ILE A 83 7.306 69.059 -16.677 1.00 0.00 H ATOM 1277 HD11 ILE A 83 7.878 70.971 -15.297 1.00 0.00 H ATOM 1278 HD12 ILE A 83 8.116 69.892 -13.901 1.00 0.00 H ATOM 1279 HD13 ILE A 83 9.178 69.755 -15.323 1.00 0.00 H ATOM 1280 HG21 ILE A 83 3.917 68.164 -15.864 1.00 0.00 H ATOM 1281 HG22 ILE A 83 5.110 68.418 -17.162 1.00 0.00 H ATOM 1282 HG23 ILE A 83 5.365 67.132 -15.957 1.00 0.00 H ATOM 1283 H ILE A 83 5.968 70.978 -13.408 1.00 0.00 H ATOM 1284 N ALA A 84 2.956 70.341 -14.587 1.00 15.13 N ATOM 1285 CA ALA A 84 1.493 70.309 -14.630 1.00 15.23 C ATOM 1286 C ALA A 84 0.919 71.679 -14.954 1.00 15.36 C ATOM 1287 O ALA A 84 0.072 71.814 -15.839 1.00 15.59 O ATOM 1288 CB ALA A 84 0.942 69.807 -13.294 1.00 15.29 C ATOM 1289 HA ALA A 84 1.192 69.625 -15.423 1.00 0.00 H ATOM 1290 HB1 ALA A 84 1.318 68.802 -13.102 1.00 0.00 H ATOM 1291 HB2 ALA A 84 1.264 70.476 -12.496 1.00 0.00 H ATOM 1292 HB3 ALA A 84 -0.147 69.787 -13.336 1.00 0.00 H ATOM 1293 H ALA A 84 3.427 70.160 -13.678 1.00 0.00 H ATOM 1294 N ASP A 85 1.393 72.700 -14.248 1.00 15.67 N ATOM 1295 CA ASP A 85 0.964 74.077 -14.502 1.00 15.68 C ATOM 1296 C ASP A 85 1.243 74.510 -15.937 1.00 15.77 C ATOM 1297 O ASP A 85 0.537 75.363 -16.474 1.00 15.70 O ATOM 1298 CB ASP A 85 1.644 75.049 -13.538 1.00 15.86 C ATOM 1299 CG ASP A 85 1.065 76.454 -13.620 1.00 16.18 C ATOM 1300 OD1 ASP A 85 -0.179 76.595 -13.552 1.00 17.86 O ATOM 1301 OD2 ASP A 85 1.848 77.416 -13.747 1.00 14.72 O ATOM 1302 HA ASP A 85 -0.114 74.101 -14.342 1.00 0.00 H ATOM 1303 HB2 ASP A 85 1.518 74.678 -12.521 1.00 0.00 H ATOM 1304 HB3 ASP A 85 2.706 75.094 -13.778 1.00 0.00 H ATOM 1305 H ASP A 85 2.087 72.516 -13.495 1.00 0.00 H ATOM 1306 N ALA A 86 2.270 73.923 -16.551 1.00 15.69 N ATOM 1307 CA ALA A 86 2.627 74.242 -17.933 1.00 15.84 C ATOM 1308 C ALA A 86 1.810 73.475 -18.967 1.00 15.86 C ATOM 1309 O ALA A 86 1.847 73.804 -20.141 1.00 15.79 O ATOM 1310 CB ALA A 86 4.117 74.009 -18.164 1.00 15.73 C ATOM 1311 HA ALA A 86 2.390 75.297 -18.072 1.00 0.00 H ATOM 1312 HB1 ALA A 86 4.692 74.646 -17.492 1.00 0.00 H ATOM 1313 HB2 ALA A 86 4.355 72.964 -17.967 1.00 0.00 H ATOM 1314 HB3 ALA A 86 4.365 74.251 -19.197 1.00 0.00 H ATOM 1315 H ALA A 86 2.833 73.219 -16.033 1.00 0.00 H ATOM 1316 N GLY A 87 1.074 72.454 -18.538 1.00 16.25 N ATOM 1317 CA GLY A 87 0.265 71.655 -19.461 1.00 16.27 C ATOM 1318 C GLY A 87 1.118 70.682 -20.254 1.00 16.40 C ATOM 1319 O GLY A 87 0.737 70.248 -21.344 1.00 16.35 O ATOM 1320 HA3 GLY A 87 -0.246 72.324 -20.154 1.00 0.00 H ATOM 1321 HA2 GLY A 87 -0.474 71.093 -18.889 1.00 0.00 H ATOM 1322 H GLY A 87 1.073 72.218 -17.525 1.00 0.00 H ATOM 1323 N LEU A 88 2.266 70.325 -19.682 1.00 16.47 N ATOM 1324 CA LEU A 88 3.244 69.463 -20.339 1.00 16.73 C ATOM 1325 C LEU A 88 3.069 68.019 -19.873 1.00 16.75 C ATOM 1326 O LEU A 88 2.896 67.763 -18.673 1.00 16.71 O ATOM 1327 CB LEU A 88 4.667 69.946 -20.017 1.00 16.79 C ATOM 1328 CG LEU A 88 5.555 70.666 -21.047 1.00 17.21 C ATOM 1329 CD1 LEU A 88 4.862 71.062 -22.349 1.00 17.71 C ATOM 1330 CD2 LEU A 88 6.217 71.869 -20.400 1.00 17.10 C ATOM 1331 HA LEU A 88 3.086 69.508 -21.417 1.00 0.00 H ATOM 1332 HB2 LEU A 88 4.570 70.629 -19.173 1.00 0.00 H ATOM 1333 HB3 LEU A 88 5.223 69.061 -19.706 1.00 0.00 H ATOM 1334 HG LEU A 88 6.302 69.933 -21.352 1.00 0.00 H ATOM 1335 HD21 LEU A 88 5.450 72.555 -20.041 1.00 0.00 H ATOM 1336 HD22 LEU A 88 6.830 71.538 -19.562 1.00 0.00 H ATOM 1337 HD23 LEU A 88 6.845 72.375 -21.134 1.00 0.00 H ATOM 1338 HD11 LEU A 88 4.480 70.168 -22.842 1.00 0.00 H ATOM 1339 HD12 LEU A 88 4.036 71.738 -22.128 1.00 0.00 H ATOM 1340 HD13 LEU A 88 5.577 71.562 -23.002 1.00 0.00 H ATOM 1341 H LEU A 88 2.475 70.675 -18.725 1.00 0.00 H ATOM 1342 N SER A 89 3.125 67.093 -20.835 1.00 16.77 N ATOM 1343 CA SER A 89 3.035 65.654 -20.588 1.00 16.89 C ATOM 1344 C SER A 89 4.353 64.996 -21.002 1.00 16.92 C ATOM 1345 O SER A 89 5.070 65.544 -21.829 1.00 16.97 O ATOM 1346 CB SER A 89 1.877 65.048 -21.391 1.00 16.85 C ATOM 1347 OG SER A 89 0.615 65.387 -20.843 1.00 16.47 O ATOM 1348 HA SER A 89 2.850 65.479 -19.528 1.00 0.00 H ATOM 1349 HB2 SER A 89 1.980 63.963 -21.393 1.00 0.00 H ATOM 1350 HB3 SER A 89 1.927 65.418 -22.415 1.00 0.00 H ATOM 1351 HG SER A 89 0.510 66.371 -20.844 1.00 0.00 H ATOM 1352 H SER A 89 3.239 67.415 -21.817 1.00 0.00 H ATOM 1353 N PRO A 90 4.677 63.820 -20.431 1.00 17.27 N ATOM 1354 CA PRO A 90 5.948 63.128 -20.706 1.00 17.71 C ATOM 1355 C PRO A 90 6.346 63.055 -22.182 1.00 17.99 C ATOM 1356 O PRO A 90 7.485 63.358 -22.541 1.00 17.69 O ATOM 1357 CB PRO A 90 5.693 61.726 -20.147 1.00 17.45 C ATOM 1358 CG PRO A 90 4.809 61.970 -19.003 1.00 17.23 C ATOM 1359 CD PRO A 90 3.873 63.067 -19.452 1.00 17.18 C ATOM 1360 HA PRO A 90 6.784 63.665 -20.258 1.00 0.00 H ATOM 1361 HD3 PRO A 90 2.979 62.652 -19.917 1.00 0.00 H ATOM 1362 HD2 PRO A 90 3.584 63.701 -18.614 1.00 0.00 H ATOM 1363 HG3 PRO A 90 5.386 62.291 -18.135 1.00 0.00 H ATOM 1364 HG2 PRO A 90 4.250 61.069 -18.753 1.00 0.00 H ATOM 1365 HB2 PRO A 90 5.206 61.093 -20.889 1.00 0.00 H ATOM 1366 HB3 PRO A 90 6.624 61.258 -19.828 1.00 0.00 H ATOM 1367 N GLU A 91 5.404 62.667 -23.029 1.00 18.56 N ATOM 1368 CA GLU A 91 5.662 62.582 -24.469 1.00 18.88 C ATOM 1369 C GLU A 91 6.254 63.876 -25.065 1.00 18.69 C ATOM 1370 O GLU A 91 6.922 63.830 -26.095 1.00 18.59 O ATOM 1371 CB GLU A 91 4.402 62.134 -25.234 1.00 19.67 C ATOM 1372 CG GLU A 91 3.071 62.686 -24.706 1.00 22.35 C ATOM 1373 CD GLU A 91 2.363 61.782 -23.675 1.00 25.66 C ATOM 1374 OE1 GLU A 91 1.262 61.264 -24.003 1.00 27.49 O ATOM 1375 OE2 GLU A 91 2.888 61.613 -22.539 1.00 26.05 O ATOM 1376 HA GLU A 91 6.430 61.819 -24.595 1.00 0.00 H ATOM 1377 HB2 GLU A 91 4.509 62.452 -26.271 1.00 0.00 H ATOM 1378 HB3 GLU A 91 4.354 61.046 -25.192 1.00 0.00 H ATOM 1379 HG2 GLU A 91 3.265 63.650 -24.236 1.00 0.00 H ATOM 1380 HG3 GLU A 91 2.400 62.825 -25.554 1.00 0.00 H ATOM 1381 H GLU A 91 4.462 62.418 -22.665 1.00 0.00 H ATOM 1382 N ALA A 92 6.039 65.014 -24.400 1.00 18.27 N ATOM 1383 CA ALA A 92 6.517 66.315 -24.893 1.00 17.84 C ATOM 1384 C ALA A 92 7.880 66.744 -24.320 1.00 17.57 C ATOM 1385 O ALA A 92 8.667 67.385 -25.022 1.00 17.67 O ATOM 1386 CB ALA A 92 5.473 67.394 -24.604 1.00 17.82 C ATOM 1387 HA ALA A 92 6.664 66.195 -25.966 1.00 0.00 H ATOM 1388 HB1 ALA A 92 4.540 67.139 -25.106 1.00 0.00 H ATOM 1389 HB2 ALA A 92 5.304 67.455 -23.529 1.00 0.00 H ATOM 1390 HB3 ALA A 92 5.834 68.355 -24.972 1.00 0.00 H ATOM 1391 H ALA A 92 5.515 64.979 -23.502 1.00 0.00 H ATOM 1392 N TYR A 93 8.154 66.421 -23.056 1.00 16.91 N ATOM 1393 CA TYR A 93 9.374 66.915 -22.390 1.00 16.51 C ATOM 1394 C TYR A 93 10.419 65.842 -22.082 1.00 16.13 C ATOM 1395 O TYR A 93 11.603 66.160 -21.942 1.00 16.35 O ATOM 1396 CB TYR A 93 9.025 67.705 -21.113 1.00 16.34 C ATOM 1397 CG TYR A 93 8.625 66.869 -19.914 1.00 16.08 C ATOM 1398 CD1 TYR A 93 9.587 66.360 -19.043 1.00 16.14 C ATOM 1399 CD2 TYR A 93 7.287 66.605 -19.637 1.00 16.05 C ATOM 1400 CE1 TYR A 93 9.226 65.596 -17.933 1.00 16.15 C ATOM 1401 CE2 TYR A 93 6.916 65.840 -18.523 1.00 16.16 C ATOM 1402 CZ TYR A 93 7.893 65.342 -17.677 1.00 15.75 C ATOM 1403 OH TYR A 93 7.542 64.579 -16.585 1.00 15.40 O ATOM 1404 HA TYR A 93 9.841 67.576 -23.120 1.00 0.00 H ATOM 1405 HB3 TYR A 93 8.196 68.373 -21.348 1.00 0.00 H ATOM 1406 HB2 TYR A 93 9.898 68.295 -20.834 1.00 0.00 H ATOM 1407 HD2 TYR A 93 6.515 67.000 -20.297 1.00 0.00 H ATOM 1408 HE2 TYR A 93 5.864 65.638 -18.323 1.00 0.00 H ATOM 1409 HE1 TYR A 93 9.995 65.200 -17.269 1.00 0.00 H ATOM 1410 HD1 TYR A 93 10.641 66.563 -19.233 1.00 0.00 H ATOM 1411 HH TYR A 93 6.958 65.110 -15.987 1.00 0.00 H ATOM 1412 H TYR A 93 7.496 65.810 -22.530 1.00 0.00 H ATOM 1413 N GLN A 94 9.992 64.586 -21.976 1.00 15.74 N ATOM 1414 CA GLN A 94 10.896 63.475 -21.658 1.00 15.51 C ATOM 1415 C GLN A 94 11.570 62.909 -22.900 1.00 15.09 C ATOM 1416 O GLN A 94 10.937 62.766 -23.941 1.00 14.86 O ATOM 1417 CB GLN A 94 10.132 62.346 -20.970 1.00 15.50 C ATOM 1418 CG GLN A 94 9.546 62.722 -19.623 1.00 15.82 C ATOM 1419 CD GLN A 94 9.066 61.519 -18.837 1.00 15.94 C ATOM 1420 OE1 GLN A 94 9.118 60.383 -19.310 1.00 15.73 O ATOM 1421 NE2 GLN A 94 8.592 61.767 -17.626 1.00 17.65 N ATOM 1422 HA GLN A 94 11.662 63.878 -20.996 1.00 0.00 H ATOM 1423 HB2 GLN A 94 9.316 62.037 -21.624 1.00 0.00 H ATOM 1424 HB3 GLN A 94 10.816 61.510 -20.824 1.00 0.00 H ATOM 1425 HG2 GLN A 94 10.311 63.236 -19.041 1.00 0.00 H ATOM 1426 HG3 GLN A 94 8.702 63.393 -19.785 1.00 0.00 H ATOM 1427 HE22 GLN A 94 8.567 62.743 -17.267 1.00 0.00 H ATOM 1428 HE21 GLN A 94 8.245 60.986 -17.034 1.00 0.00 H ATOM 1429 H GLN A 94 8.982 64.385 -22.124 1.00 0.00 H ATOM 1430 N ASN A 95 12.847 62.553 -22.764 1.00 14.89 N ATOM 1431 CA ASN A 95 13.636 61.965 -23.852 1.00 14.82 C ATOM 1432 C ASN A 95 13.705 62.879 -25.068 1.00 14.67 C ATOM 1433 O ASN A 95 13.684 62.422 -26.207 1.00 14.91 O ATOM 1434 CB ASN A 95 13.103 60.571 -24.222 1.00 14.79 C ATOM 1435 CG ASN A 95 13.081 59.620 -23.026 1.00 15.41 C ATOM 1436 OD1 ASN A 95 13.960 59.663 -22.169 1.00 15.98 O ATOM 1437 ND2 ASN A 95 12.066 58.774 -22.961 1.00 16.35 N ATOM 1438 HA ASN A 95 14.658 61.850 -23.490 1.00 0.00 H ATOM 1439 HB2 ASN A 95 12.088 60.674 -24.606 1.00 0.00 H ATOM 1440 HB3 ASN A 95 13.742 60.146 -24.996 1.00 0.00 H ATOM 1441 HD22 ASN A 95 11.343 58.771 -23.709 1.00 0.00 H ATOM 1442 HD21 ASN A 95 11.991 58.112 -22.162 1.00 0.00 H ATOM 1443 H ASN A 95 13.306 62.699 -21.842 1.00 0.00 H ATOM 1444 N ASN A 96 13.813 64.177 -24.795 1.00 14.57 N ATOM 1445 CA ASN A 96 13.776 65.228 -25.803 1.00 14.39 C ATOM 1446 C ASN A 96 15.036 66.102 -25.722 1.00 14.53 C ATOM 1447 O ASN A 96 15.181 66.889 -24.777 1.00 14.49 O ATOM 1448 CB ASN A 96 12.545 66.088 -25.568 1.00 14.25 C ATOM 1449 CG ASN A 96 12.257 67.027 -26.715 1.00 14.05 C ATOM 1450 OD1 ASN A 96 13.151 67.393 -27.476 1.00 13.39 O ATOM 1451 ND2 ASN A 96 10.996 67.422 -26.848 1.00 12.55 N ATOM 1452 HA ASN A 96 13.736 64.773 -26.793 1.00 0.00 H ATOM 1453 HB2 ASN A 96 11.684 65.434 -25.429 1.00 0.00 H ATOM 1454 HB3 ASN A 96 12.700 66.679 -24.665 1.00 0.00 H ATOM 1455 HD22 ASN A 96 10.273 67.086 -26.180 1.00 0.00 H ATOM 1456 HD21 ASN A 96 10.732 68.067 -27.620 1.00 0.00 H ATOM 1457 H ASN A 96 13.931 64.458 -23.801 1.00 0.00 H ATOM 1458 N PRO A 97 15.954 65.961 -26.703 1.00 14.59 N ATOM 1459 CA PRO A 97 17.208 66.720 -26.753 1.00 14.75 C ATOM 1460 C PRO A 97 17.058 68.234 -26.610 1.00 14.80 C ATOM 1461 O PRO A 97 17.986 68.901 -26.148 1.00 14.69 O ATOM 1462 CB PRO A 97 17.753 66.393 -28.146 1.00 14.73 C ATOM 1463 CG PRO A 97 17.235 65.055 -28.438 1.00 15.03 C ATOM 1464 CD PRO A 97 15.858 65.023 -27.839 1.00 14.84 C ATOM 1465 HA PRO A 97 17.848 66.442 -25.915 1.00 0.00 H ATOM 1466 HD3 PRO A 97 15.112 65.358 -28.559 1.00 0.00 H ATOM 1467 HD2 PRO A 97 15.605 64.020 -27.496 1.00 0.00 H ATOM 1468 HG3 PRO A 97 17.867 64.293 -27.983 1.00 0.00 H ATOM 1469 HG2 PRO A 97 17.187 64.890 -29.514 1.00 0.00 H ATOM 1470 HB2 PRO A 97 17.393 67.114 -28.880 1.00 0.00 H ATOM 1471 HB3 PRO A 97 18.843 66.392 -28.143 1.00 0.00 H ATOM 1472 N ARG A 98 15.900 68.759 -27.006 1.00 14.70 N ATOM 1473 CA ARG A 98 15.650 70.194 -27.005 1.00 14.77 C ATOM 1474 C ARG A 98 14.946 70.695 -25.739 1.00 14.44 C ATOM 1475 O ARG A 98 14.450 71.821 -25.701 1.00 14.33 O ATOM 1476 CB ARG A 98 14.878 70.559 -28.272 1.00 14.85 C ATOM 1477 CG ARG A 98 15.721 70.272 -29.525 1.00 15.66 C ATOM 1478 CD ARG A 98 15.266 71.024 -30.752 1.00 16.25 C ATOM 1479 NE ARG A 98 15.069 72.451 -30.503 1.00 17.74 N ATOM 1480 CZ ARG A 98 16.040 73.357 -30.434 1.00 18.52 C ATOM 1481 NH1 ARG A 98 17.316 73.019 -30.601 1.00 18.96 N ATOM 1482 NH2 ARG A 98 15.724 74.624 -30.197 1.00 19.07 N ATOM 1483 HA ARG A 98 16.614 70.704 -27.000 1.00 0.00 H ATOM 1484 HB2 ARG A 98 13.962 69.970 -28.315 1.00 0.00 H ATOM 1485 HB3 ARG A 98 14.627 71.619 -28.245 1.00 0.00 H ATOM 1486 HG2 ARG A 98 16.754 70.549 -29.315 1.00 0.00 H ATOM 1487 HG3 ARG A 98 15.669 69.204 -29.737 1.00 0.00 H ATOM 1488 HD2 ARG A 98 14.323 70.596 -31.093 1.00 0.00 H ATOM 1489 HD3 ARG A 98 16.019 70.907 -31.531 1.00 0.00 H ATOM 1490 HE ARG A 98 14.093 72.784 -30.369 1.00 0.00 H ATOM 1491 HH12 ARG A 98 18.058 73.745 -30.543 1.00 0.00 H ATOM 1492 HH11 ARG A 98 17.571 72.029 -30.790 1.00 0.00 H ATOM 1493 HH22 ARG A 98 16.472 75.345 -30.140 1.00 0.00 H ATOM 1494 HH21 ARG A 98 14.729 74.896 -30.068 1.00 0.00 H ATOM 1495 H ARG A 98 15.145 68.120 -27.328 1.00 0.00 H ATOM 1496 N VAL A 99 14.941 69.857 -24.703 1.00 13.99 N ATOM 1497 CA VAL A 99 14.369 70.185 -23.405 1.00 13.88 C ATOM 1498 C VAL A 99 15.450 69.944 -22.343 1.00 13.75 C ATOM 1499 O VAL A 99 15.961 68.823 -22.220 1.00 13.42 O ATOM 1500 CB VAL A 99 13.154 69.287 -23.098 1.00 13.74 C ATOM 1501 CG1 VAL A 99 12.711 69.437 -21.641 1.00 13.91 C ATOM 1502 CG2 VAL A 99 12.001 69.593 -24.055 1.00 13.71 C ATOM 1503 HA VAL A 99 14.036 71.223 -23.405 1.00 0.00 H ATOM 1504 HB VAL A 99 13.455 68.250 -23.248 1.00 0.00 H ATOM 1505 HG11 VAL A 99 13.531 69.152 -20.982 1.00 0.00 H ATOM 1506 HG12 VAL A 99 12.435 70.474 -21.451 1.00 0.00 H ATOM 1507 HG13 VAL A 99 11.853 68.791 -21.455 1.00 0.00 H ATOM 1508 HG21 VAL A 99 11.706 70.636 -23.944 1.00 0.00 H ATOM 1509 HG22 VAL A 99 12.324 69.412 -25.080 1.00 0.00 H ATOM 1510 HG23 VAL A 99 11.154 68.948 -23.820 1.00 0.00 H ATOM 1511 H VAL A 99 15.369 68.917 -24.828 1.00 0.00 H ATOM 1512 N GLY A 100 15.789 70.987 -21.587 1.00 13.55 N ATOM 1513 CA GLY A 100 16.826 70.894 -20.564 1.00 13.74 C ATOM 1514 C GLY A 100 16.398 71.334 -19.180 1.00 13.90 C ATOM 1515 O GLY A 100 15.223 71.662 -18.947 1.00 14.01 O ATOM 1516 HA3 GLY A 100 17.664 71.518 -20.874 1.00 0.00 H ATOM 1517 HA2 GLY A 100 17.151 69.855 -20.504 1.00 0.00 H ATOM 1518 H GLY A 100 15.301 71.894 -21.730 1.00 0.00 H ATOM 1519 N LEU A 101 17.371 71.339 -18.266 1.00 14.10 N ATOM 1520 CA LEU A 101 17.167 71.689 -16.856 1.00 14.20 C ATOM 1521 C LEU A 101 18.402 72.401 -16.311 1.00 14.26 C ATOM 1522 O LEU A 101 19.520 71.903 -16.440 1.00 13.87 O ATOM 1523 CB LEU A 101 16.902 70.412 -16.056 1.00 14.49 C ATOM 1524 CG LEU A 101 16.463 70.332 -14.579 1.00 15.03 C ATOM 1525 CD1 LEU A 101 17.595 69.856 -13.677 1.00 16.38 C ATOM 1526 CD2 LEU A 101 15.878 71.609 -14.046 1.00 16.35 C ATOM 1527 HA LEU A 101 16.312 72.359 -16.766 1.00 0.00 H ATOM 1528 HB2 LEU A 101 16.127 69.884 -16.612 1.00 0.00 H ATOM 1529 HB3 LEU A 101 17.833 69.847 -16.107 1.00 0.00 H ATOM 1530 HG LEU A 101 15.662 69.592 -14.566 1.00 0.00 H ATOM 1531 HD21 LEU A 101 16.619 72.405 -14.120 1.00 0.00 H ATOM 1532 HD22 LEU A 101 14.997 71.875 -14.630 1.00 0.00 H ATOM 1533 HD23 LEU A 101 15.595 71.470 -13.003 1.00 0.00 H ATOM 1534 HD11 LEU A 101 17.917 68.864 -13.993 1.00 0.00 H ATOM 1535 HD12 LEU A 101 18.432 70.551 -13.749 1.00 0.00 H ATOM 1536 HD13 LEU A 101 17.243 69.814 -12.646 1.00 0.00 H ATOM 1537 H LEU A 101 18.331 71.079 -18.572 1.00 0.00 H ATOM 1538 N ILE A 102 18.200 73.573 -15.719 1.00 14.37 N ATOM 1539 CA ILE A 102 19.283 74.309 -15.078 1.00 14.52 C ATOM 1540 C ILE A 102 18.793 74.746 -13.712 1.00 14.59 C ATOM 1541 O ILE A 102 17.974 75.658 -13.608 1.00 14.31 O ATOM 1542 CB ILE A 102 19.738 75.539 -15.903 1.00 14.48 C ATOM 1543 CG1 ILE A 102 20.337 75.100 -17.238 1.00 14.38 C ATOM 1544 CG2 ILE A 102 20.787 76.347 -15.141 1.00 14.40 C ATOM 1545 CD1 ILE A 102 20.488 76.222 -18.236 1.00 14.61 C ATOM 1546 HA ILE A 102 20.154 73.658 -14.998 1.00 0.00 H ATOM 1547 HB ILE A 102 18.858 76.158 -16.079 1.00 0.00 H ATOM 1548 HG12 ILE A 102 21.322 74.673 -17.049 1.00 0.00 H ATOM 1549 HG13 ILE A 102 19.689 74.339 -17.672 1.00 0.00 H ATOM 1550 HD11 ILE A 102 19.510 76.654 -18.446 1.00 0.00 H ATOM 1551 HD12 ILE A 102 21.144 76.988 -17.823 1.00 0.00 H ATOM 1552 HD13 ILE A 102 20.919 75.831 -19.158 1.00 0.00 H ATOM 1553 HG21 ILE A 102 20.363 76.693 -14.198 1.00 0.00 H ATOM 1554 HG22 ILE A 102 21.654 75.717 -14.941 1.00 0.00 H ATOM 1555 HG23 ILE A 102 21.090 77.205 -15.742 1.00 0.00 H ATOM 1556 H ILE A 102 17.242 73.977 -15.713 1.00 0.00 H ATOM 1557 N ALA A 103 19.295 74.089 -12.670 1.00 14.75 N ATOM 1558 CA ALA A 103 18.845 74.359 -11.313 1.00 15.35 C ATOM 1559 C ALA A 103 19.916 74.008 -10.293 1.00 15.75 C ATOM 1560 O ALA A 103 20.633 73.021 -10.461 1.00 16.01 O ATOM 1561 CB ALA A 103 17.571 73.580 -11.025 1.00 15.37 C ATOM 1562 HA ALA A 103 18.642 75.427 -11.230 1.00 0.00 H ATOM 1563 HB1 ALA A 103 16.795 73.882 -11.728 1.00 0.00 H ATOM 1564 HB2 ALA A 103 17.766 72.513 -11.134 1.00 0.00 H ATOM 1565 HB3 ALA A 103 17.242 73.788 -10.007 1.00 0.00 H ATOM 1566 H ALA A 103 20.026 73.366 -12.829 1.00 0.00 H ATOM 1567 N GLY A 104 20.014 74.810 -9.235 1.00 16.00 N ATOM 1568 CA GLY A 104 21.027 74.601 -8.214 1.00 16.50 C ATOM 1569 C GLY A 104 20.635 74.987 -6.804 1.00 16.94 C ATOM 1570 O GLY A 104 19.509 75.391 -6.541 1.00 16.82 O ATOM 1571 HA3 GLY A 104 21.904 75.186 -8.489 1.00 0.00 H ATOM 1572 HA2 GLY A 104 21.285 73.542 -8.211 1.00 0.00 H ATOM 1573 H GLY A 104 19.350 75.605 -9.137 1.00 0.00 H ATOM 1574 N SER A 105 21.592 74.830 -5.895 1.00 17.72 N ATOM 1575 CA SER A 105 21.489 75.323 -4.531 1.00 18.26 C ATOM 1576 C SER A 105 22.706 76.182 -4.208 1.00 18.79 C ATOM 1577 O SER A 105 23.716 76.143 -4.912 1.00 18.86 O ATOM 1578 CB SER A 105 21.403 74.154 -3.550 1.00 18.48 C ATOM 1579 OG SER A 105 22.482 73.258 -3.725 1.00 18.95 O ATOM 1580 HA SER A 105 20.585 75.924 -4.437 1.00 0.00 H ATOM 1581 HB2 SER A 105 20.467 73.620 -3.714 1.00 0.00 H ATOM 1582 HB3 SER A 105 21.425 74.542 -2.532 1.00 0.00 H ATOM 1583 HG SER A 105 22.399 72.513 -3.078 1.00 0.00 H ATOM 1584 H SER A 105 22.459 74.329 -6.174 1.00 0.00 H ATOM 1585 N GLY A 106 22.601 76.967 -3.144 1.00 19.42 N ATOM 1586 CA GLY A 106 23.724 77.765 -2.667 1.00 19.88 C ATOM 1587 C GLY A 106 24.747 76.954 -1.890 1.00 20.38 C ATOM 1588 O GLY A 106 25.945 77.245 -1.940 1.00 20.88 O ATOM 1589 HA3 GLY A 106 23.339 78.552 -2.018 1.00 0.00 H ATOM 1590 HA2 GLY A 106 24.219 78.215 -3.527 1.00 0.00 H ATOM 1591 H GLY A 106 21.694 77.014 -2.637 1.00 0.00 H ATOM 1592 N GLY A 107 24.282 75.939 -1.164 1.00 20.96 N ATOM 1593 CA GLY A 107 25.145 75.192 -0.244 1.00 21.17 C ATOM 1594 C GLY A 107 25.217 73.686 -0.429 1.00 21.59 C ATOM 1595 O GLY A 107 25.993 73.018 0.266 1.00 22.10 O ATOM 1596 HA3 GLY A 107 24.788 75.382 0.768 1.00 0.00 H ATOM 1597 HA2 GLY A 107 26.156 75.585 -0.351 1.00 0.00 H ATOM 1598 H GLY A 107 23.281 75.669 -1.252 1.00 0.00 H ATOM 1599 N GLY A 108 24.434 73.144 -1.360 1.00 21.73 N ATOM 1600 CA GLY A 108 24.373 71.694 -1.559 1.00 21.60 C ATOM 1601 C GLY A 108 23.595 71.057 -0.419 1.00 21.64 C ATOM 1602 O GLY A 108 22.419 71.382 -0.212 1.00 21.86 O ATOM 1603 HA3 GLY A 108 25.384 71.287 -1.581 1.00 0.00 H ATOM 1604 HA2 GLY A 108 23.875 71.478 -2.504 1.00 0.00 H ATOM 1605 H GLY A 108 23.853 73.764 -1.959 1.00 0.00 H ATOM 1606 N SER A 109 24.248 70.151 0.313 1.00 21.28 N ATOM 1607 CA SER A 109 23.689 69.592 1.547 1.00 20.89 C ATOM 1608 C SER A 109 24.748 69.446 2.640 1.00 20.49 C ATOM 1609 O SER A 109 25.355 68.390 2.785 1.00 20.62 O ATOM 1610 CB SER A 109 23.018 68.241 1.299 1.00 20.99 C ATOM 1611 OG SER A 109 22.301 67.821 2.459 1.00 21.15 O ATOM 1612 HA SER A 109 22.936 70.301 1.890 1.00 0.00 H ATOM 1613 HB2 SER A 109 23.780 67.500 1.060 1.00 0.00 H ATOM 1614 HB3 SER A 109 22.326 68.332 0.462 1.00 0.00 H ATOM 1615 HG SER A 109 21.606 68.492 2.677 1.00 0.00 H ATOM 1616 H SER A 109 25.186 69.831 -0.004 1.00 0.00 H ATOM 1617 N PRO A 110 24.973 70.515 3.414 1.00 20.11 N ATOM 1618 CA PRO A 110 25.747 70.417 4.652 1.00 19.99 C ATOM 1619 C PRO A 110 25.324 69.250 5.541 1.00 19.62 C ATOM 1620 O PRO A 110 26.178 68.579 6.103 1.00 19.68 O ATOM 1621 CB PRO A 110 25.455 71.749 5.339 1.00 19.98 C ATOM 1622 CG PRO A 110 25.255 72.695 4.200 1.00 19.85 C ATOM 1623 CD PRO A 110 24.527 71.897 3.158 1.00 19.97 C ATOM 1624 HA PRO A 110 26.803 70.232 4.455 1.00 0.00 H ATOM 1625 HD3 PRO A 110 23.448 71.988 3.280 1.00 0.00 H ATOM 1626 HD2 PRO A 110 24.806 72.218 2.154 1.00 0.00 H ATOM 1627 HG3 PRO A 110 26.214 73.042 3.817 1.00 0.00 H ATOM 1628 HG2 PRO A 110 24.659 73.552 4.513 1.00 0.00 H ATOM 1629 HB2 PRO A 110 24.556 71.682 5.952 1.00 0.00 H ATOM 1630 HB3 PRO A 110 26.295 72.059 5.960 1.00 0.00 H ATOM 1631 N ARG A 111 24.022 69.001 5.646 1.00 19.55 N ATOM 1632 CA ARG A 111 23.500 67.932 6.501 1.00 19.61 C ATOM 1633 C ARG A 111 24.055 66.550 6.159 1.00 19.40 C ATOM 1634 O ARG A 111 24.547 65.831 7.031 1.00 19.32 O ATOM 1635 CB ARG A 111 21.970 67.889 6.433 1.00 19.55 C ATOM 1636 CG ARG A 111 21.365 66.608 7.021 1.00 19.73 C ATOM 1637 CD ARG A 111 20.020 66.857 7.629 1.00 20.52 C ATOM 1638 NE ARG A 111 20.147 67.706 8.812 1.00 22.53 N ATOM 1639 CZ ARG A 111 19.141 68.324 9.425 1.00 22.46 C ATOM 1640 NH1 ARG A 111 17.894 68.201 8.983 1.00 22.42 N ATOM 1641 NH2 ARG A 111 19.388 69.079 10.488 1.00 22.61 N ATOM 1642 HA ARG A 111 23.831 68.173 7.511 1.00 0.00 H ATOM 1643 HB2 ARG A 111 21.576 68.742 6.986 1.00 0.00 H ATOM 1644 HB3 ARG A 111 21.669 67.965 5.388 1.00 0.00 H ATOM 1645 HG2 ARG A 111 21.262 65.869 6.226 1.00 0.00 H ATOM 1646 HG3 ARG A 111 22.034 66.222 7.790 1.00 0.00 H ATOM 1647 HD2 ARG A 111 19.573 65.905 7.916 1.00 0.00 H ATOM 1648 HD3 ARG A 111 19.381 67.352 6.898 1.00 0.00 H ATOM 1649 HE ARG A 111 21.100 67.838 9.206 1.00 0.00 H ATOM 1650 HH12 ARG A 111 17.118 68.690 9.473 1.00 0.00 H ATOM 1651 HH11 ARG A 111 17.694 67.615 8.147 1.00 0.00 H ATOM 1652 HH22 ARG A 111 18.607 69.566 10.973 1.00 0.00 H ATOM 1653 HH21 ARG A 111 20.362 69.184 10.836 1.00 0.00 H ATOM 1654 H ARG A 111 23.353 69.584 5.104 1.00 0.00 H ATOM 1655 N PHE A 112 23.950 66.171 4.894 1.00 19.36 N ATOM 1656 CA PHE A 112 24.405 64.858 4.470 1.00 19.24 C ATOM 1657 C PHE A 112 25.912 64.802 4.298 1.00 19.11 C ATOM 1658 O PHE A 112 26.506 63.733 4.423 1.00 18.77 O ATOM 1659 CB PHE A 112 23.639 64.388 3.237 1.00 19.10 C ATOM 1660 CG PHE A 112 22.265 63.913 3.571 1.00 19.31 C ATOM 1661 CD1 PHE A 112 21.164 64.741 3.402 1.00 19.30 C ATOM 1662 CD2 PHE A 112 22.082 62.663 4.153 1.00 18.88 C ATOM 1663 CE1 PHE A 112 19.893 64.302 3.753 1.00 19.58 C ATOM 1664 CE2 PHE A 112 20.824 62.220 4.503 1.00 18.81 C ATOM 1665 CZ PHE A 112 19.726 63.038 4.306 1.00 19.22 C ATOM 1666 HA PHE A 112 24.180 64.150 5.268 1.00 0.00 H ATOM 1667 HB2 PHE A 112 23.562 65.218 2.534 1.00 0.00 H ATOM 1668 HB3 PHE A 112 24.190 63.570 2.773 1.00 0.00 H ATOM 1669 HD2 PHE A 112 22.946 62.024 4.335 1.00 0.00 H ATOM 1670 HE2 PHE A 112 20.695 61.227 4.934 1.00 0.00 H ATOM 1671 HZ PHE A 112 18.731 62.691 4.584 1.00 0.00 H ATOM 1672 HE1 PHE A 112 19.029 64.948 3.595 1.00 0.00 H ATOM 1673 HD1 PHE A 112 21.297 65.742 2.991 1.00 0.00 H ATOM 1674 H PHE A 112 23.537 66.821 4.196 1.00 0.00 H ATOM 1675 N GLN A 113 26.530 65.953 4.051 1.00 19.15 N ATOM 1676 CA GLN A 113 27.985 66.055 4.153 1.00 19.52 C ATOM 1677 C GLN A 113 28.482 65.713 5.561 1.00 19.21 C ATOM 1678 O GLN A 113 29.411 64.923 5.718 1.00 19.00 O ATOM 1679 CB GLN A 113 28.489 67.456 3.780 1.00 20.00 C ATOM 1680 CG GLN A 113 29.149 67.529 2.422 1.00 22.17 C ATOM 1681 CD GLN A 113 30.118 66.386 2.180 1.00 24.98 C ATOM 1682 OE1 GLN A 113 30.331 65.979 1.039 1.00 27.38 O ATOM 1683 NE2 GLN A 113 30.711 65.855 3.257 1.00 26.18 N ATOM 1684 HA GLN A 113 28.385 65.330 3.444 1.00 0.00 H ATOM 1685 HB2 GLN A 113 27.640 68.139 3.786 1.00 0.00 H ATOM 1686 HB3 GLN A 113 29.213 67.772 4.531 1.00 0.00 H ATOM 1687 HG2 GLN A 113 28.375 67.498 1.655 1.00 0.00 H ATOM 1688 HG3 GLN A 113 29.694 68.470 2.349 1.00 0.00 H ATOM 1689 HE22 GLN A 113 30.502 66.230 4.204 1.00 0.00 H ATOM 1690 HE21 GLN A 113 31.381 65.067 3.146 1.00 0.00 H ATOM 1691 H GLN A 113 25.973 66.789 3.783 1.00 0.00 H ATOM 1692 N VAL A 114 27.860 66.324 6.569 1.00 18.88 N ATOM 1693 CA VAL A 114 28.202 66.071 7.972 1.00 18.65 C ATOM 1694 C VAL A 114 27.752 64.673 8.398 1.00 18.48 C ATOM 1695 O VAL A 114 28.440 64.018 9.182 1.00 18.42 O ATOM 1696 CB VAL A 114 27.596 67.143 8.917 1.00 18.46 C ATOM 1697 CG1 VAL A 114 27.901 66.834 10.376 1.00 18.17 C ATOM 1698 CG2 VAL A 114 28.140 68.517 8.579 1.00 18.78 C ATOM 1699 HA VAL A 114 29.287 66.131 8.054 1.00 0.00 H ATOM 1700 HB VAL A 114 26.516 67.128 8.773 1.00 0.00 H ATOM 1701 HG11 VAL A 114 27.478 65.864 10.637 1.00 0.00 H ATOM 1702 HG12 VAL A 114 28.981 66.813 10.524 1.00 0.00 H ATOM 1703 HG13 VAL A 114 27.462 67.605 11.009 1.00 0.00 H ATOM 1704 HG21 VAL A 114 29.224 68.515 8.693 1.00 0.00 H ATOM 1705 HG22 VAL A 114 27.882 68.765 7.549 1.00 0.00 H ATOM 1706 HG23 VAL A 114 27.704 69.255 9.252 1.00 0.00 H ATOM 1707 H VAL A 114 27.104 67.005 6.352 1.00 0.00 H ATOM 1708 N PHE A 115 26.605 64.214 7.895 1.00 18.44 N ATOM 1709 CA PHE A 115 26.169 62.848 8.180 1.00 18.48 C ATOM 1710 C PHE A 115 27.196 61.841 7.673 1.00 18.40 C ATOM 1711 O PHE A 115 27.513 60.866 8.361 1.00 18.42 O ATOM 1712 CB PHE A 115 24.806 62.520 7.558 1.00 18.69 C ATOM 1713 CG PHE A 115 24.513 61.046 7.530 1.00 18.64 C ATOM 1714 CD1 PHE A 115 23.918 60.425 8.617 1.00 18.92 C ATOM 1715 CD2 PHE A 115 24.900 60.268 6.443 1.00 19.09 C ATOM 1716 CE1 PHE A 115 23.675 59.052 8.606 1.00 19.14 C ATOM 1717 CE2 PHE A 115 24.667 58.896 6.424 1.00 18.94 C ATOM 1718 CZ PHE A 115 24.053 58.289 7.506 1.00 18.83 C ATOM 1719 HA PHE A 115 26.073 62.778 9.263 1.00 0.00 H ATOM 1720 HB2 PHE A 115 24.030 63.018 8.139 1.00 0.00 H ATOM 1721 HB3 PHE A 115 24.791 62.897 6.535 1.00 0.00 H ATOM 1722 HD2 PHE A 115 25.393 60.740 5.593 1.00 0.00 H ATOM 1723 HE2 PHE A 115 24.967 58.302 5.561 1.00 0.00 H ATOM 1724 HZ PHE A 115 23.866 57.215 7.496 1.00 0.00 H ATOM 1725 HE1 PHE A 115 23.189 58.577 9.458 1.00 0.00 H ATOM 1726 HD1 PHE A 115 23.637 61.016 9.489 1.00 0.00 H ATOM 1727 H PHE A 115 26.018 64.831 7.297 1.00 0.00 H ATOM 1728 N GLY A 116 27.690 62.072 6.457 1.00 18.39 N ATOM 1729 CA GLY A 116 28.716 61.217 5.857 1.00 18.21 C ATOM 1730 C GLY A 116 29.949 61.146 6.735 1.00 18.16 C ATOM 1731 O GLY A 116 30.391 60.058 7.106 1.00 18.08 O ATOM 1732 HA3 GLY A 116 28.994 61.623 4.884 1.00 0.00 H ATOM 1733 HA2 GLY A 116 28.312 60.213 5.728 1.00 0.00 H ATOM 1734 H GLY A 116 27.335 62.886 5.916 1.00 0.00 H ATOM 1735 N ALA A 117 30.482 62.316 7.087 1.00 17.99 N ATOM 1736 CA ALA A 117 31.658 62.420 7.964 1.00 17.88 C ATOM 1737 C ALA A 117 31.426 61.783 9.345 1.00 17.69 C ATOM 1738 O ALA A 117 32.224 60.968 9.788 1.00 17.18 O ATOM 1739 CB ALA A 117 32.072 63.879 8.115 1.00 17.86 C ATOM 1740 HA ALA A 117 32.463 61.859 7.489 1.00 0.00 H ATOM 1741 HB1 ALA A 117 32.318 64.289 7.135 1.00 0.00 H ATOM 1742 HB2 ALA A 117 31.249 64.446 8.551 1.00 0.00 H ATOM 1743 HB3 ALA A 117 32.944 63.942 8.766 1.00 0.00 H ATOM 1744 H ALA A 117 30.049 63.190 6.727 1.00 0.00 H ATOM 1745 N ASP A 118 30.329 62.148 10.010 1.00 17.59 N ATOM 1746 CA ASP A 118 29.957 61.532 11.297 1.00 17.41 C ATOM 1747 C ASP A 118 29.882 60.005 11.224 1.00 17.31 C ATOM 1748 O ASP A 118 30.442 59.302 12.071 1.00 17.08 O ATOM 1749 CB ASP A 118 28.591 62.040 11.770 1.00 17.38 C ATOM 1750 CG ASP A 118 28.617 63.493 12.225 1.00 17.46 C ATOM 1751 OD1 ASP A 118 27.523 64.034 12.445 1.00 16.92 O ATOM 1752 OD2 ASP A 118 29.699 64.101 12.355 1.00 16.86 O ATOM 1753 HA ASP A 118 30.744 61.816 11.996 1.00 0.00 H ATOM 1754 HB2 ASP A 118 27.882 61.947 10.947 1.00 0.00 H ATOM 1755 HB3 ASP A 118 28.261 61.421 12.604 1.00 0.00 H ATOM 1756 H ASP A 118 29.718 62.888 9.609 1.00 0.00 H ATOM 1757 N ALA A 119 29.159 59.508 10.223 1.00 17.14 N ATOM 1758 CA ALA A 119 28.956 58.077 10.042 1.00 17.03 C ATOM 1759 C ALA A 119 30.282 57.371 9.812 1.00 16.95 C ATOM 1760 O ALA A 119 30.549 56.324 10.406 1.00 16.84 O ATOM 1761 CB ALA A 119 28.027 57.827 8.875 1.00 17.29 C ATOM 1762 HA ALA A 119 28.504 57.676 10.949 1.00 0.00 H ATOM 1763 HB1 ALA A 119 27.066 58.303 9.069 1.00 0.00 H ATOM 1764 HB2 ALA A 119 28.465 58.244 7.968 1.00 0.00 H ATOM 1765 HB3 ALA A 119 27.883 56.754 8.750 1.00 0.00 H ATOM 1766 H ALA A 119 28.723 60.165 9.545 1.00 0.00 H ATOM 1767 N MET A 120 31.114 57.962 8.960 1.00 16.91 N ATOM 1768 CA MET A 120 32.433 57.422 8.660 1.00 17.17 C ATOM 1769 C MET A 120 33.313 57.284 9.909 1.00 17.40 C ATOM 1770 O MET A 120 34.047 56.309 10.040 1.00 17.19 O ATOM 1771 CB MET A 120 33.142 58.299 7.620 1.00 16.96 C ATOM 1772 CG MET A 120 34.408 57.681 7.040 1.00 16.80 C ATOM 1773 SD MET A 120 34.096 56.096 6.228 1.00 16.37 S ATOM 1774 CE MET A 120 35.764 55.479 6.049 1.00 16.87 C ATOM 1775 HA MET A 120 32.280 56.420 8.258 1.00 0.00 H ATOM 1776 HB2 MET A 120 32.448 58.488 6.801 1.00 0.00 H ATOM 1777 HB3 MET A 120 33.409 59.244 8.094 1.00 0.00 H ATOM 1778 HG2 MET A 120 35.123 57.525 7.848 1.00 0.00 H ATOM 1779 HG3 MET A 120 34.831 58.371 6.310 1.00 0.00 H ATOM 1780 HE1 MET A 120 36.344 56.175 5.443 1.00 0.00 H ATOM 1781 HE2 MET A 120 36.222 55.384 7.033 1.00 0.00 H ATOM 1782 HE3 MET A 120 35.739 54.504 5.562 1.00 0.00 H ATOM 1783 H MET A 120 30.813 58.840 8.492 1.00 0.00 H ATOM 1784 N ARG A 121 33.248 58.262 10.812 1.00 17.85 N ATOM 1785 CA ARG A 121 34.033 58.226 12.059 1.00 18.16 C ATOM 1786 C ARG A 121 33.461 57.306 13.119 1.00 18.45 C ATOM 1787 O ARG A 121 34.090 57.113 14.152 1.00 18.87 O ATOM 1788 CB ARG A 121 34.121 59.607 12.683 1.00 18.09 C ATOM 1789 CG ARG A 121 34.979 60.591 11.928 1.00 18.06 C ATOM 1790 CD ARG A 121 34.143 61.803 11.641 1.00 18.55 C ATOM 1791 NE ARG A 121 34.743 63.038 12.073 1.00 18.95 N ATOM 1792 CZ ARG A 121 34.100 64.196 12.118 1.00 18.29 C ATOM 1793 NH1 ARG A 121 32.820 64.295 11.775 1.00 17.57 N ATOM 1794 NH2 ARG A 121 34.745 65.266 12.525 1.00 18.78 N ATOM 1795 HA ARG A 121 35.010 57.851 11.756 1.00 0.00 H ATOM 1796 HB2 ARG A 121 33.112 60.015 12.746 1.00 0.00 H ATOM 1797 HB3 ARG A 121 34.532 59.500 13.687 1.00 0.00 H ATOM 1798 HG2 ARG A 121 35.842 60.870 12.532 1.00 0.00 H ATOM 1799 HG3 ARG A 121 35.320 60.145 10.993 1.00 0.00 H ATOM 1800 HD2 ARG A 121 33.186 61.689 12.150 1.00 0.00 H ATOM 1801 HD3 ARG A 121 33.977 61.859 10.565 1.00 0.00 H ATOM 1802 HE ARG A 121 35.740 63.021 12.367 1.00 0.00 H ATOM 1803 HH12 ARG A 121 32.339 65.216 11.820 1.00 0.00 H ATOM 1804 HH11 ARG A 121 32.299 63.451 11.462 1.00 0.00 H ATOM 1805 HH22 ARG A 121 34.256 66.183 12.567 1.00 0.00 H ATOM 1806 HH21 ARG A 121 35.744 65.196 12.805 1.00 0.00 H ATOM 1807 H ARG A 121 32.625 59.075 10.631 1.00 0.00 H ATOM 1808 N GLY A 122 32.258 56.788 12.903 1.00 18.84 N ATOM 1809 CA GLY A 122 31.683 55.799 13.804 1.00 19.11 C ATOM 1810 C GLY A 122 32.351 54.450 13.600 1.00 19.44 C ATOM 1811 O GLY A 122 33.190 54.301 12.707 1.00 19.38 O ATOM 1812 HA3 GLY A 122 30.616 55.706 13.603 1.00 0.00 H ATOM 1813 HA2 GLY A 122 31.831 56.122 14.835 1.00 0.00 H ATOM 1814 H GLY A 122 31.714 57.095 12.072 1.00 0.00 H ATOM 1815 N PRO A 123 31.977 53.451 14.417 1.00 19.97 N ATOM 1816 CA PRO A 123 32.620 52.125 14.361 1.00 20.30 C ATOM 1817 C PRO A 123 32.396 51.319 13.069 1.00 20.74 C ATOM 1818 O PRO A 123 33.179 50.412 12.789 1.00 21.16 O ATOM 1819 CB PRO A 123 32.017 51.393 15.562 1.00 20.26 C ATOM 1820 CG PRO A 123 30.707 52.081 15.803 1.00 20.57 C ATOM 1821 CD PRO A 123 30.929 53.517 15.449 1.00 19.91 C ATOM 1822 HA PRO A 123 33.704 52.239 14.379 1.00 0.00 H ATOM 1823 HD3 PRO A 123 30.019 53.968 15.054 1.00 0.00 H ATOM 1824 HD2 PRO A 123 31.268 54.085 16.315 1.00 0.00 H ATOM 1825 HG3 PRO A 123 30.416 51.988 16.849 1.00 0.00 H ATOM 1826 HG2 PRO A 123 29.930 51.650 15.172 1.00 0.00 H ATOM 1827 HB2 PRO A 123 31.862 50.339 15.333 1.00 0.00 H ATOM 1828 HB3 PRO A 123 32.666 51.483 16.433 1.00 0.00 H ATOM 1829 N ARG A 124 31.357 51.638 12.293 1.00 21.11 N ATOM 1830 CA ARG A 124 31.042 50.879 11.064 1.00 21.44 C ATOM 1831 C ARG A 124 31.504 51.553 9.762 1.00 20.92 C ATOM 1832 O ARG A 124 31.416 50.953 8.696 1.00 20.49 O ATOM 1833 CB ARG A 124 29.543 50.583 10.980 1.00 21.61 C ATOM 1834 CG ARG A 124 28.956 50.047 12.272 1.00 22.92 C ATOM 1835 CD ARG A 124 27.829 49.045 12.041 1.00 24.32 C ATOM 1836 NE ARG A 124 26.864 49.476 11.026 1.00 26.99 N ATOM 1837 CZ ARG A 124 26.573 48.814 9.901 1.00 28.50 C ATOM 1838 NH1 ARG A 124 27.160 47.649 9.606 1.00 29.41 N ATOM 1839 NH2 ARG A 124 25.669 49.315 9.062 1.00 28.26 N ATOM 1840 HA ARG A 124 31.611 49.953 11.150 1.00 0.00 H ATOM 1841 HB2 ARG A 124 29.023 51.506 10.722 1.00 0.00 H ATOM 1842 HB3 ARG A 124 29.381 49.844 10.195 1.00 0.00 H ATOM 1843 HG2 ARG A 124 29.748 49.556 12.837 1.00 0.00 H ATOM 1844 HG3 ARG A 124 28.565 50.884 12.850 1.00 0.00 H ATOM 1845 HD2 ARG A 124 27.299 48.899 12.982 1.00 0.00 H ATOM 1846 HD3 ARG A 124 28.267 48.100 11.722 1.00 0.00 H ATOM 1847 HE ARG A 124 26.363 50.372 11.195 1.00 0.00 H ATOM 1848 HH12 ARG A 124 26.917 47.153 8.725 1.00 0.00 H ATOM 1849 HH11 ARG A 124 27.859 47.239 10.258 1.00 0.00 H ATOM 1850 HH22 ARG A 124 25.436 48.807 8.185 1.00 0.00 H ATOM 1851 HH21 ARG A 124 25.196 50.214 9.284 1.00 0.00 H ATOM 1852 H ARG A 124 30.753 52.442 12.560 1.00 0.00 H ATOM 1853 N GLY A 125 31.976 52.797 9.858 1.00 20.67 N ATOM 1854 CA GLY A 125 32.617 53.496 8.738 1.00 20.32 C ATOM 1855 C GLY A 125 31.832 53.532 7.433 1.00 19.90 C ATOM 1856 O GLY A 125 30.698 54.008 7.395 1.00 19.57 O ATOM 1857 HA3 GLY A 125 33.570 53.005 8.540 1.00 0.00 H ATOM 1858 HA2 GLY A 125 32.797 54.526 9.047 1.00 0.00 H ATOM 1859 H GLY A 125 31.886 53.294 10.767 1.00 0.00 H ATOM 1860 N LEU A 126 32.458 53.030 6.370 1.00 19.51 N ATOM 1861 CA LEU A 126 31.867 52.984 5.023 1.00 19.65 C ATOM 1862 C LEU A 126 30.463 52.402 5.000 1.00 19.57 C ATOM 1863 O LEU A 126 29.586 52.904 4.289 1.00 19.35 O ATOM 1864 CB LEU A 126 32.748 52.150 4.087 1.00 19.29 C ATOM 1865 CG LEU A 126 33.651 52.812 3.044 1.00 19.66 C ATOM 1866 CD1 LEU A 126 33.855 54.311 3.236 1.00 19.69 C ATOM 1867 CD2 LEU A 126 34.983 52.081 2.997 1.00 19.56 C ATOM 1868 HA LEU A 126 31.806 54.020 4.689 1.00 0.00 H ATOM 1869 HB2 LEU A 126 33.400 51.555 4.726 1.00 0.00 H ATOM 1870 HB3 LEU A 126 32.077 51.489 3.539 1.00 0.00 H ATOM 1871 HG LEU A 126 33.134 52.726 2.088 1.00 0.00 H ATOM 1872 HD21 LEU A 126 35.458 52.131 3.977 1.00 0.00 H ATOM 1873 HD22 LEU A 126 34.815 51.039 2.726 1.00 0.00 H ATOM 1874 HD23 LEU A 126 35.628 52.551 2.255 1.00 0.00 H ATOM 1875 HD11 LEU A 126 32.891 54.817 3.185 1.00 0.00 H ATOM 1876 HD12 LEU A 126 34.311 54.493 4.209 1.00 0.00 H ATOM 1877 HD13 LEU A 126 34.508 54.691 2.450 1.00 0.00 H ATOM 1878 H LEU A 126 33.417 52.650 6.499 1.00 0.00 H ATOM 1879 N LYS A 127 30.264 51.341 5.778 1.00 19.67 N ATOM 1880 CA LYS A 127 28.981 50.649 5.838 1.00 20.02 C ATOM 1881 C LYS A 127 27.901 51.512 6.473 1.00 19.58 C ATOM 1882 O LYS A 127 26.722 51.311 6.197 1.00 19.81 O ATOM 1883 CB LYS A 127 29.117 49.324 6.594 1.00 20.30 C ATOM 1884 CG LYS A 127 30.053 48.335 5.912 1.00 21.60 C ATOM 1885 CD LYS A 127 30.104 46.989 6.638 1.00 21.94 C ATOM 1886 CE LYS A 127 30.789 45.928 5.776 1.00 23.18 C ATOM 1887 NZ LYS A 127 31.127 44.692 6.556 1.00 24.03 N ATOM 1888 HA LYS A 127 28.676 50.441 4.812 1.00 0.00 H ATOM 1889 HB2 LYS A 127 29.502 49.533 7.592 1.00 0.00 H ATOM 1890 HB3 LYS A 127 28.130 48.868 6.674 1.00 0.00 H ATOM 1891 HG2 LYS A 127 29.707 48.170 4.892 1.00 0.00 H ATOM 1892 HG3 LYS A 127 31.057 48.760 5.890 1.00 0.00 H ATOM 1893 HD2 LYS A 127 30.660 47.106 7.568 1.00 0.00 H ATOM 1894 HD3 LYS A 127 29.087 46.665 6.862 1.00 0.00 H ATOM 1895 HE2 LYS A 127 31.708 46.348 5.368 1.00 0.00 H ATOM 1896 HE3 LYS A 127 30.121 45.655 4.959 1.00 0.00 H ATOM 1897 HZ1 LYS A 127 31.770 44.940 7.334 1.00 0.00 H ATOM 1898 HZ2 LYS A 127 30.255 44.279 6.944 1.00 0.00 H ATOM 1899 HZ3 LYS A 127 31.589 44.003 5.929 1.00 0.00 H ATOM 1900 H LYS A 127 31.050 50.993 6.363 1.00 0.00 H ATOM 1901 N ALA A 128 28.301 52.460 7.321 1.00 19.09 N ATOM 1902 CA ALA A 128 27.367 53.427 7.911 1.00 18.76 C ATOM 1903 C ALA A 128 27.156 54.644 7.008 1.00 18.42 C ATOM 1904 O ALA A 128 26.137 55.321 7.102 1.00 17.97 O ATOM 1905 CB ALA A 128 27.855 53.873 9.277 1.00 18.53 C ATOM 1906 HA ALA A 128 26.407 52.923 8.019 1.00 0.00 H ATOM 1907 HB1 ALA A 128 27.931 53.007 9.935 1.00 0.00 H ATOM 1908 HB2 ALA A 128 28.834 54.342 9.176 1.00 0.00 H ATOM 1909 HB3 ALA A 128 27.149 54.589 9.697 1.00 0.00 H ATOM 1910 H ALA A 128 29.308 52.516 7.573 1.00 0.00 H ATOM 1911 N VAL A 129 28.130 54.940 6.155 1.00 18.27 N ATOM 1912 CA VAL A 129 27.968 56.012 5.176 1.00 18.39 C ATOM 1913 C VAL A 129 26.894 55.601 4.161 1.00 18.37 C ATOM 1914 O VAL A 129 25.959 56.358 3.896 1.00 18.38 O ATOM 1915 CB VAL A 129 29.309 56.357 4.469 1.00 18.18 C ATOM 1916 CG1 VAL A 129 29.094 57.387 3.367 1.00 18.43 C ATOM 1917 CG2 VAL A 129 30.324 56.896 5.473 1.00 17.74 C ATOM 1918 HA VAL A 129 27.651 56.917 5.694 1.00 0.00 H ATOM 1919 HB VAL A 129 29.694 55.439 4.026 1.00 0.00 H ATOM 1920 HG11 VAL A 129 28.400 56.987 2.628 1.00 0.00 H ATOM 1921 HG12 VAL A 129 28.681 58.298 3.799 1.00 0.00 H ATOM 1922 HG13 VAL A 129 30.048 57.610 2.889 1.00 0.00 H ATOM 1923 HG21 VAL A 129 29.928 57.798 5.939 1.00 0.00 H ATOM 1924 HG22 VAL A 129 30.512 56.143 6.238 1.00 0.00 H ATOM 1925 HG23 VAL A 129 31.255 57.131 4.956 1.00 0.00 H ATOM 1926 H VAL A 129 29.019 54.402 6.184 1.00 0.00 H ATOM 1927 N GLY A 130 27.021 54.393 3.616 1.00 18.60 N ATOM 1928 CA GLY A 130 26.106 53.906 2.583 1.00 18.81 C ATOM 1929 C GLY A 130 26.353 54.559 1.229 1.00 18.86 C ATOM 1930 O GLY A 130 27.058 55.560 1.145 1.00 18.46 O ATOM 1931 HA3 GLY A 130 25.083 54.120 2.893 1.00 0.00 H ATOM 1932 HA2 GLY A 130 26.236 52.829 2.481 1.00 0.00 H ATOM 1933 H GLY A 130 27.795 53.776 3.935 1.00 0.00 H ATOM 1934 N PRO A 131 25.732 54.020 0.159 1.00 19.28 N ATOM 1935 CA PRO A 131 26.074 54.406 -1.215 1.00 19.46 C ATOM 1936 C PRO A 131 25.351 55.628 -1.792 1.00 19.66 C ATOM 1937 O PRO A 131 25.425 55.830 -3.002 1.00 19.91 O ATOM 1938 CB PRO A 131 25.686 53.157 -2.015 1.00 19.33 C ATOM 1939 CG PRO A 131 24.521 52.593 -1.281 1.00 19.39 C ATOM 1940 CD PRO A 131 24.663 53.003 0.182 1.00 19.20 C ATOM 1941 HA PRO A 131 27.119 54.712 -1.256 1.00 0.00 H ATOM 1942 HD3 PRO A 131 23.732 53.426 0.559 1.00 0.00 H ATOM 1943 HD2 PRO A 131 24.950 52.151 0.799 1.00 0.00 H ATOM 1944 HG3 PRO A 131 24.517 51.506 -1.365 1.00 0.00 H ATOM 1945 HG2 PRO A 131 23.593 52.991 -1.692 1.00 0.00 H ATOM 1946 HB2 PRO A 131 25.408 53.423 -3.035 1.00 0.00 H ATOM 1947 HB3 PRO A 131 26.509 52.443 -2.039 1.00 0.00 H ATOM 1948 N TYR A 132 24.682 56.434 -0.963 1.00 20.13 N ATOM 1949 CA TYR A 132 23.813 57.528 -1.461 1.00 20.33 C ATOM 1950 C TYR A 132 24.225 58.946 -1.067 1.00 20.28 C ATOM 1951 O TYR A 132 23.573 59.913 -1.468 1.00 20.27 O ATOM 1952 CB TYR A 132 22.363 57.300 -1.006 1.00 21.01 C ATOM 1953 CG TYR A 132 21.804 55.993 -1.485 1.00 21.18 C ATOM 1954 CD1 TYR A 132 21.706 55.724 -2.842 1.00 21.94 C ATOM 1955 CD2 TYR A 132 21.388 55.018 -0.589 1.00 21.74 C ATOM 1956 CE1 TYR A 132 21.201 54.522 -3.300 1.00 22.22 C ATOM 1957 CE2 TYR A 132 20.884 53.809 -1.034 1.00 21.82 C ATOM 1958 CZ TYR A 132 20.793 53.564 -2.393 1.00 22.25 C ATOM 1959 OH TYR A 132 20.300 52.363 -2.849 1.00 21.85 O ATOM 1960 HA TYR A 132 23.920 57.477 -2.545 1.00 0.00 H ATOM 1961 HB3 TYR A 132 21.744 58.108 -1.396 1.00 0.00 H ATOM 1962 HB2 TYR A 132 22.333 57.314 0.083 1.00 0.00 H ATOM 1963 HD2 TYR A 132 21.460 55.208 0.482 1.00 0.00 H ATOM 1964 HE2 TYR A 132 20.560 53.053 -0.318 1.00 0.00 H ATOM 1965 HE1 TYR A 132 21.125 54.331 -4.371 1.00 0.00 H ATOM 1966 HD1 TYR A 132 22.034 56.475 -3.561 1.00 0.00 H ATOM 1967 HH TYR A 132 20.306 52.360 -3.839 1.00 0.00 H ATOM 1968 H TYR A 132 24.773 56.290 0.063 1.00 0.00 H ATOM 1969 N VAL A 133 25.306 59.086 -0.308 1.00 20.18 N ATOM 1970 CA VAL A 133 25.679 60.402 0.210 1.00 20.04 C ATOM 1971 C VAL A 133 26.205 61.324 -0.895 1.00 19.83 C ATOM 1972 O VAL A 133 25.941 62.523 -0.863 1.00 19.52 O ATOM 1973 CB VAL A 133 26.685 60.303 1.391 1.00 20.26 C ATOM 1974 CG1 VAL A 133 26.970 61.685 1.984 1.00 20.12 C ATOM 1975 CG2 VAL A 133 26.136 59.382 2.485 1.00 20.05 C ATOM 1976 HA VAL A 133 24.766 60.851 0.602 1.00 0.00 H ATOM 1977 HB VAL A 133 27.615 59.888 1.003 1.00 0.00 H ATOM 1978 HG11 VAL A 133 27.395 62.329 1.214 1.00 0.00 H ATOM 1979 HG12 VAL A 133 26.040 62.120 2.351 1.00 0.00 H ATOM 1980 HG13 VAL A 133 27.677 61.587 2.808 1.00 0.00 H ATOM 1981 HG21 VAL A 133 25.192 59.782 2.855 1.00 0.00 H ATOM 1982 HG22 VAL A 133 25.973 58.386 2.072 1.00 0.00 H ATOM 1983 HG23 VAL A 133 26.853 59.325 3.304 1.00 0.00 H ATOM 1984 H VAL A 133 25.890 58.256 -0.081 1.00 0.00 H ATOM 1985 N VAL A 134 26.914 60.782 -1.884 1.00 19.77 N ATOM 1986 CA VAL A 134 27.511 61.635 -2.927 1.00 19.83 C ATOM 1987 C VAL A 134 26.465 62.466 -3.666 1.00 19.69 C ATOM 1988 O VAL A 134 26.674 63.653 -3.909 1.00 19.62 O ATOM 1989 CB VAL A 134 28.350 60.837 -3.951 1.00 19.86 C ATOM 1990 CG1 VAL A 134 28.729 61.707 -5.145 1.00 19.96 C ATOM 1991 CG2 VAL A 134 29.608 60.308 -3.298 1.00 20.20 C ATOM 1992 HA VAL A 134 28.180 62.308 -2.391 1.00 0.00 H ATOM 1993 HB VAL A 134 27.742 60.003 -4.303 1.00 0.00 H ATOM 1994 HG11 VAL A 134 27.823 62.062 -5.636 1.00 0.00 H ATOM 1995 HG12 VAL A 134 29.315 62.559 -4.801 1.00 0.00 H ATOM 1996 HG13 VAL A 134 29.319 61.119 -5.849 1.00 0.00 H ATOM 1997 HG21 VAL A 134 30.201 61.143 -2.924 1.00 0.00 H ATOM 1998 HG22 VAL A 134 29.338 59.653 -2.470 1.00 0.00 H ATOM 1999 HG23 VAL A 134 30.189 59.748 -4.031 1.00 0.00 H ATOM 2000 H VAL A 134 27.047 59.751 -1.920 1.00 0.00 H ATOM 2001 N THR A 135 25.348 61.841 -4.022 1.00 19.73 N ATOM 2002 CA THR A 135 24.275 62.544 -4.734 1.00 19.86 C ATOM 2003 C THR A 135 23.492 63.484 -3.809 1.00 19.76 C ATOM 2004 O THR A 135 22.984 64.518 -4.241 1.00 19.58 O ATOM 2005 CB THR A 135 23.320 61.557 -5.427 1.00 19.62 C ATOM 2006 OG1 THR A 135 22.736 60.685 -4.455 1.00 19.65 O ATOM 2007 CG2 THR A 135 24.073 60.727 -6.462 1.00 19.54 C ATOM 2008 HA THR A 135 24.755 63.154 -5.500 1.00 0.00 H ATOM 2009 HB THR A 135 22.536 62.125 -5.928 1.00 0.00 H ATOM 2010 HG1 THR A 135 22.231 61.221 -3.794 1.00 0.00 H ATOM 2011 HG23 THR A 135 24.519 61.390 -7.203 1.00 0.00 H ATOM 2012 HG21 THR A 135 24.857 60.155 -5.966 1.00 0.00 H ATOM 2013 HG22 THR A 135 23.379 60.045 -6.953 1.00 0.00 H ATOM 2014 H THR A 135 25.232 60.834 -3.791 1.00 0.00 H ATOM 2015 N LYS A 136 23.395 63.122 -2.539 1.00 20.19 N ATOM 2016 CA LYS A 136 22.793 64.006 -1.550 1.00 20.59 C ATOM 2017 C LYS A 136 23.684 65.212 -1.292 1.00 20.99 C ATOM 2018 O LYS A 136 23.186 66.328 -1.145 1.00 21.17 O ATOM 2019 CB LYS A 136 22.528 63.257 -0.252 1.00 20.50 C ATOM 2020 CG LYS A 136 21.466 62.184 -0.413 1.00 20.58 C ATOM 2021 CD LYS A 136 21.306 61.369 0.840 1.00 20.63 C ATOM 2022 CE LYS A 136 20.092 60.473 0.756 1.00 20.75 C ATOM 2023 NZ LYS A 136 19.677 59.986 2.096 1.00 21.15 N ATOM 2024 HA LYS A 136 21.841 64.360 -1.946 1.00 0.00 H ATOM 2025 HB2 LYS A 136 23.455 62.787 0.077 1.00 0.00 H ATOM 2026 HB3 LYS A 136 22.195 63.970 0.503 1.00 0.00 H ATOM 2027 HG2 LYS A 136 20.515 62.661 -0.649 1.00 0.00 H ATOM 2028 HG3 LYS A 136 21.752 61.523 -1.231 1.00 0.00 H ATOM 2029 HD2 LYS A 136 22.194 60.753 0.980 1.00 0.00 H ATOM 2030 HD3 LYS A 136 21.194 62.042 1.690 1.00 0.00 H ATOM 2031 HE2 LYS A 136 20.328 59.616 0.125 1.00 0.00 H ATOM 2032 HE3 LYS A 136 19.269 61.033 0.313 1.00 0.00 H ATOM 2033 HZ1 LYS A 136 20.456 59.445 2.523 1.00 0.00 H ATOM 2034 HZ2 LYS A 136 19.444 60.799 2.702 1.00 0.00 H ATOM 2035 HZ3 LYS A 136 18.841 59.375 1.998 1.00 0.00 H ATOM 2036 H LYS A 136 23.754 62.192 -2.243 1.00 0.00 H ATOM 2037 N ALA A 137 25.000 64.992 -1.297 1.00 21.28 N ATOM 2038 CA ALA A 137 25.947 65.991 -0.821 1.00 21.49 C ATOM 2039 C ALA A 137 26.567 66.848 -1.916 1.00 21.82 C ATOM 2040 O ALA A 137 26.959 67.979 -1.643 1.00 21.86 O ATOM 2041 CB ALA A 137 27.038 65.324 -0.007 1.00 21.53 C ATOM 2042 HA ALA A 137 25.367 66.676 -0.202 1.00 0.00 H ATOM 2043 HB1 ALA A 137 26.592 64.815 0.848 1.00 0.00 H ATOM 2044 HB2 ALA A 137 27.563 64.599 -0.630 1.00 0.00 H ATOM 2045 HB3 ALA A 137 27.741 66.079 0.344 1.00 0.00 H ATOM 2046 H ALA A 137 25.359 64.082 -1.650 1.00 0.00 H ATOM 2047 N MET A 138 26.659 66.338 -3.145 1.00 22.18 N ATOM 2048 CA MET A 138 27.355 67.085 -4.202 1.00 22.30 C ATOM 2049 C MET A 138 26.630 68.388 -4.541 1.00 22.01 C ATOM 2050 O MET A 138 25.406 68.473 -4.459 1.00 22.05 O ATOM 2051 CB MET A 138 27.566 66.236 -5.465 1.00 22.52 C ATOM 2052 CG MET A 138 26.313 65.925 -6.267 1.00 23.09 C ATOM 2053 SD MET A 138 26.593 64.589 -7.461 1.00 24.16 S ATOM 2054 CE MET A 138 25.092 64.687 -8.427 1.00 23.66 C ATOM 2055 HA MET A 138 28.339 67.339 -3.808 1.00 0.00 H ATOM 2056 HB2 MET A 138 28.257 66.771 -6.117 1.00 0.00 H ATOM 2057 HB3 MET A 138 28.013 65.289 -5.162 1.00 0.00 H ATOM 2058 HG2 MET A 138 26.007 66.822 -6.806 1.00 0.00 H ATOM 2059 HG3 MET A 138 25.520 65.626 -5.582 1.00 0.00 H ATOM 2060 HE1 MET A 138 24.232 64.521 -7.778 1.00 0.00 H ATOM 2061 HE2 MET A 138 25.019 65.674 -8.884 1.00 0.00 H ATOM 2062 HE3 MET A 138 25.113 63.925 -9.206 1.00 0.00 H ATOM 2063 H MET A 138 26.238 65.411 -3.355 1.00 0.00 H ATOM 2064 N ALA A 139 27.406 69.395 -4.926 1.00 21.74 N ATOM 2065 CA ALA A 139 26.871 70.721 -5.224 1.00 21.52 C ATOM 2066 C ALA A 139 25.794 70.709 -6.312 1.00 21.25 C ATOM 2067 O ALA A 139 24.922 71.577 -6.325 1.00 21.78 O ATOM 2068 CB ALA A 139 28.009 71.667 -5.622 1.00 21.55 C ATOM 2069 HA ALA A 139 26.389 71.076 -4.313 1.00 0.00 H ATOM 2070 HB1 ALA A 139 28.721 71.743 -4.800 1.00 0.00 H ATOM 2071 HB2 ALA A 139 28.513 71.276 -6.506 1.00 0.00 H ATOM 2072 HB3 ALA A 139 27.600 72.653 -5.842 1.00 0.00 H ATOM 2073 H ALA A 139 28.429 69.234 -5.018 1.00 0.00 H ATOM 2074 N SER A 140 25.861 69.732 -7.216 1.00 20.62 N ATOM 2075 CA SER A 140 24.931 69.630 -8.341 1.00 20.14 C ATOM 2076 C SER A 140 23.771 68.672 -8.074 1.00 19.74 C ATOM 2077 O SER A 140 23.088 68.262 -9.010 1.00 19.47 O ATOM 2078 CB SER A 140 25.683 69.176 -9.595 1.00 20.10 C ATOM 2079 OG SER A 140 26.177 67.860 -9.435 1.00 19.97 O ATOM 2080 HA SER A 140 24.504 70.622 -8.486 1.00 0.00 H ATOM 2081 HB2 SER A 140 26.519 69.852 -9.776 1.00 0.00 H ATOM 2082 HB3 SER A 140 25.005 69.202 -10.448 1.00 0.00 H ATOM 2083 HG SER A 140 26.659 67.587 -10.256 1.00 0.00 H ATOM 2084 H SER A 140 26.605 69.012 -7.118 1.00 0.00 H ATOM 2085 N GLY A 141 23.552 68.315 -6.806 1.00 19.35 N ATOM 2086 CA GLY A 141 22.461 67.426 -6.426 1.00 18.86 C ATOM 2087 C GLY A 141 21.131 67.811 -7.048 1.00 18.58 C ATOM 2088 O GLY A 141 20.426 66.961 -7.588 1.00 18.67 O ATOM 2089 HA3 GLY A 141 22.356 67.450 -5.341 1.00 0.00 H ATOM 2090 HA2 GLY A 141 22.712 66.414 -6.743 1.00 0.00 H ATOM 2091 H GLY A 141 24.181 68.684 -6.064 1.00 0.00 H ATOM 2092 N VAL A 142 20.797 69.097 -6.994 1.00 18.03 N ATOM 2093 CA VAL A 142 19.506 69.579 -7.481 1.00 17.72 C ATOM 2094 C VAL A 142 19.273 69.254 -8.967 1.00 17.49 C ATOM 2095 O VAL A 142 18.212 68.740 -9.323 1.00 17.62 O ATOM 2096 CB VAL A 142 19.327 71.093 -7.218 1.00 17.67 C ATOM 2097 CG1 VAL A 142 18.083 71.626 -7.914 1.00 17.96 C ATOM 2098 CG2 VAL A 142 19.217 71.352 -5.728 1.00 17.84 C ATOM 2099 HA VAL A 142 18.748 69.041 -6.912 1.00 0.00 H ATOM 2100 HB VAL A 142 20.200 71.609 -7.618 1.00 0.00 H ATOM 2101 HG11 VAL A 142 18.173 71.466 -8.988 1.00 0.00 H ATOM 2102 HG12 VAL A 142 17.205 71.100 -7.539 1.00 0.00 H ATOM 2103 HG13 VAL A 142 17.983 72.692 -7.711 1.00 0.00 H ATOM 2104 HG21 VAL A 142 18.357 70.814 -5.330 1.00 0.00 H ATOM 2105 HG22 VAL A 142 20.124 71.006 -5.232 1.00 0.00 H ATOM 2106 HG23 VAL A 142 19.091 72.421 -5.555 1.00 0.00 H ATOM 2107 H VAL A 142 21.473 69.779 -6.594 1.00 0.00 H ATOM 2108 N SER A 143 20.251 69.539 -9.825 1.00 16.94 N ATOM 2109 CA SER A 143 20.122 69.210 -11.246 1.00 16.62 C ATOM 2110 C SER A 143 20.186 67.694 -11.482 1.00 16.37 C ATOM 2111 O SER A 143 19.365 67.137 -12.216 1.00 16.21 O ATOM 2112 CB SER A 143 21.178 69.942 -12.084 1.00 16.68 C ATOM 2113 OG SER A 143 22.496 69.602 -11.686 1.00 16.42 O ATOM 2114 HA SER A 143 19.140 69.553 -11.571 1.00 0.00 H ATOM 2115 HB2 SER A 143 21.040 71.017 -11.966 1.00 0.00 H ATOM 2116 HB3 SER A 143 21.045 69.673 -13.132 1.00 0.00 H ATOM 2117 HG SER A 143 22.627 69.849 -10.736 1.00 0.00 H ATOM 2118 H SER A 143 21.117 70.001 -9.481 1.00 0.00 H ATOM 2119 N ALA A 144 21.146 67.030 -10.846 1.00 15.95 N ATOM 2120 CA ALA A 144 21.314 65.585 -11.003 1.00 15.80 C ATOM 2121 C ALA A 144 20.037 64.844 -10.644 1.00 15.66 C ATOM 2122 O ALA A 144 19.524 64.055 -11.437 1.00 15.35 O ATOM 2123 CB ALA A 144 22.459 65.089 -10.143 1.00 15.71 C ATOM 2124 HA ALA A 144 21.544 65.387 -12.050 1.00 0.00 H ATOM 2125 HB1 ALA A 144 23.380 65.589 -10.443 1.00 0.00 H ATOM 2126 HB2 ALA A 144 22.248 65.311 -9.097 1.00 0.00 H ATOM 2127 HB3 ALA A 144 22.569 64.012 -10.273 1.00 0.00 H ATOM 2128 H ALA A 144 21.794 67.551 -10.221 1.00 0.00 H ATOM 2129 N CYS A 145 19.518 65.137 -9.453 1.00 15.81 N ATOM 2130 CA CYS A 145 18.361 64.435 -8.890 1.00 15.69 C ATOM 2131 C CYS A 145 17.033 64.670 -9.611 1.00 15.44 C ATOM 2132 O CYS A 145 16.113 63.873 -9.438 1.00 15.88 O ATOM 2133 CB CYS A 145 18.206 64.762 -7.404 1.00 16.02 C ATOM 2134 SG CYS A 145 19.446 63.960 -6.383 1.00 18.20 S ATOM 2135 HA CYS A 145 18.586 63.378 -9.035 1.00 0.00 H ATOM 2136 HB2 CYS A 145 17.219 64.435 -7.076 1.00 0.00 H ATOM 2137 HB3 CYS A 145 18.291 65.841 -7.274 1.00 0.00 H ATOM 2138 HG CYS A 145 19.242 64.301 -5.061 1.00 0.00 H ATOM 2139 H CYS A 145 19.954 65.900 -8.896 1.00 0.00 H ATOM 2140 N LEU A 146 16.927 65.750 -10.387 1.00 14.73 N ATOM 2141 CA LEU A 146 15.713 66.036 -11.156 1.00 14.54 C ATOM 2142 C LEU A 146 15.819 65.548 -12.600 1.00 14.48 C ATOM 2143 O LEU A 146 14.860 65.000 -13.135 1.00 14.59 O ATOM 2144 CB LEU A 146 15.382 67.539 -11.175 1.00 14.28 C ATOM 2145 CG LEU A 146 15.241 68.368 -9.889 1.00 13.76 C ATOM 2146 CD1 LEU A 146 14.256 69.503 -10.088 1.00 13.14 C ATOM 2147 CD2 LEU A 146 14.849 67.548 -8.686 1.00 13.86 C ATOM 2148 HA LEU A 146 14.914 65.495 -10.650 1.00 0.00 H ATOM 2149 HB2 LEU A 146 16.170 68.016 -11.758 1.00 0.00 H ATOM 2150 HB3 LEU A 146 14.433 67.634 -11.703 1.00 0.00 H ATOM 2151 HG LEU A 146 16.232 68.773 -9.683 1.00 0.00 H ATOM 2152 HD21 LEU A 146 13.889 67.068 -8.873 1.00 0.00 H ATOM 2153 HD22 LEU A 146 15.608 66.787 -8.503 1.00 0.00 H ATOM 2154 HD23 LEU A 146 14.768 68.199 -7.815 1.00 0.00 H ATOM 2155 HD11 LEU A 146 14.609 70.152 -10.889 1.00 0.00 H ATOM 2156 HD12 LEU A 146 13.281 69.094 -10.353 1.00 0.00 H ATOM 2157 HD13 LEU A 146 14.172 70.076 -9.165 1.00 0.00 H ATOM 2158 H LEU A 146 17.730 66.408 -10.448 1.00 0.00 H ATOM 2159 N ALA A 147 16.979 65.751 -13.226 1.00 14.39 N ATOM 2160 CA ALA A 147 17.177 65.419 -14.643 1.00 14.32 C ATOM 2161 C ALA A 147 17.061 63.927 -14.951 1.00 14.28 C ATOM 2162 O ALA A 147 16.598 63.552 -16.026 1.00 13.87 O ATOM 2163 CB ALA A 147 18.513 65.951 -15.129 1.00 14.34 C ATOM 2164 HA ALA A 147 16.363 65.905 -15.181 1.00 0.00 H ATOM 2165 HB1 ALA A 147 18.536 67.034 -15.011 1.00 0.00 H ATOM 2166 HB2 ALA A 147 19.316 65.503 -14.543 1.00 0.00 H ATOM 2167 HB3 ALA A 147 18.643 65.696 -16.181 1.00 0.00 H ATOM 2168 H ALA A 147 17.772 66.159 -12.691 1.00 0.00 H ATOM 2169 N THR A 148 17.472 63.087 -14.006 1.00 14.45 N ATOM 2170 CA THR A 148 17.382 61.632 -14.163 1.00 14.58 C ATOM 2171 C THR A 148 15.929 61.115 -14.135 1.00 14.83 C ATOM 2172 O THR A 148 15.497 60.499 -15.105 1.00 15.09 O ATOM 2173 CB THR A 148 18.265 60.895 -13.120 1.00 14.63 C ATOM 2174 OG1 THR A 148 19.635 61.290 -13.278 1.00 13.25 O ATOM 2175 CG2 THR A 148 18.174 59.380 -13.274 1.00 14.92 C ATOM 2176 HA THR A 148 17.770 61.405 -15.156 1.00 0.00 H ATOM 2177 HB THR A 148 17.899 61.168 -12.130 1.00 0.00 H ATOM 2178 HG1 THR A 148 19.941 61.057 -14.190 1.00 0.00 H ATOM 2179 HG23 THR A 148 17.137 59.066 -13.156 1.00 0.00 H ATOM 2180 HG21 THR A 148 18.531 59.095 -14.263 1.00 0.00 H ATOM 2181 HG22 THR A 148 18.789 58.901 -12.512 1.00 0.00 H ATOM 2182 H THR A 148 17.870 63.475 -13.127 1.00 0.00 H ATOM 2183 N PRO A 149 15.170 61.361 -13.040 1.00 15.00 N ATOM 2184 CA PRO A 149 13.782 60.856 -13.008 1.00 14.95 C ATOM 2185 C PRO A 149 12.836 61.488 -14.026 1.00 14.87 C ATOM 2186 O PRO A 149 11.919 60.823 -14.506 1.00 14.64 O ATOM 2187 CB PRO A 149 13.313 61.199 -11.588 1.00 15.23 C ATOM 2188 CG PRO A 149 14.156 62.346 -11.179 1.00 15.27 C ATOM 2189 CD PRO A 149 15.508 62.063 -11.787 1.00 15.00 C ATOM 2190 HA PRO A 149 13.767 59.797 -13.264 1.00 0.00 H ATOM 2191 HD3 PRO A 149 16.048 62.988 -11.989 1.00 0.00 H ATOM 2192 HD2 PRO A 149 16.107 61.430 -11.133 1.00 0.00 H ATOM 2193 HG3 PRO A 149 14.227 62.403 -10.093 1.00 0.00 H ATOM 2194 HG2 PRO A 149 13.748 63.280 -11.565 1.00 0.00 H ATOM 2195 HB2 PRO A 149 12.259 61.477 -11.588 1.00 0.00 H ATOM 2196 HB3 PRO A 149 13.464 60.353 -10.918 1.00 0.00 H ATOM 2197 N PHE A 150 13.048 62.763 -14.338 1.00 14.96 N ATOM 2198 CA PHE A 150 12.245 63.456 -15.346 1.00 14.92 C ATOM 2199 C PHE A 150 12.702 63.179 -16.795 1.00 14.74 C ATOM 2200 O PHE A 150 12.125 63.722 -17.731 1.00 14.44 O ATOM 2201 CB PHE A 150 12.228 64.966 -15.065 1.00 15.24 C ATOM 2202 CG PHE A 150 11.387 65.353 -13.865 1.00 15.61 C ATOM 2203 CD1 PHE A 150 10.007 65.177 -13.884 1.00 15.90 C ATOM 2204 CD2 PHE A 150 11.968 65.904 -12.731 1.00 15.45 C ATOM 2205 CE1 PHE A 150 9.228 65.526 -12.783 1.00 15.88 C ATOM 2206 CE2 PHE A 150 11.194 66.260 -11.631 1.00 16.12 C ATOM 2207 CZ PHE A 150 9.822 66.074 -11.661 1.00 15.82 C ATOM 2208 HA PHE A 150 11.234 63.056 -15.265 1.00 0.00 H ATOM 2209 HB2 PHE A 150 13.252 65.295 -14.888 1.00 0.00 H ATOM 2210 HB3 PHE A 150 11.830 65.475 -15.943 1.00 0.00 H ATOM 2211 HD2 PHE A 150 13.046 66.060 -12.702 1.00 0.00 H ATOM 2212 HE2 PHE A 150 11.667 66.685 -10.746 1.00 0.00 H ATOM 2213 HZ PHE A 150 9.213 66.359 -10.803 1.00 0.00 H ATOM 2214 HE1 PHE A 150 8.150 65.367 -12.806 1.00 0.00 H ATOM 2215 HD1 PHE A 150 9.530 64.761 -14.771 1.00 0.00 H ATOM 2216 H PHE A 150 13.806 63.283 -13.852 1.00 0.00 H ATOM 2217 N LYS A 151 13.742 62.361 -16.971 1.00 14.76 N ATOM 2218 CA LYS A 151 14.174 61.882 -18.298 1.00 14.81 C ATOM 2219 C LYS A 151 14.594 63.030 -19.225 1.00 14.68 C ATOM 2220 O LYS A 151 14.288 63.038 -20.424 1.00 14.59 O ATOM 2221 CB LYS A 151 13.076 61.045 -18.959 1.00 15.24 C ATOM 2222 CG LYS A 151 12.458 59.965 -18.075 1.00 16.27 C ATOM 2223 CD LYS A 151 13.003 58.587 -18.383 1.00 19.49 C ATOM 2224 CE LYS A 151 12.271 57.494 -17.598 1.00 20.22 C ATOM 2225 NZ LYS A 151 12.773 57.380 -16.185 1.00 22.30 N ATOM 2226 HA LYS A 151 15.051 61.255 -18.135 1.00 0.00 H ATOM 2227 HB2 LYS A 151 12.280 61.720 -19.272 1.00 0.00 H ATOM 2228 HB3 LYS A 151 13.504 60.559 -19.836 1.00 0.00 H ATOM 2229 HG2 LYS A 151 12.671 60.201 -17.032 1.00 0.00 H ATOM 2230 HG3 LYS A 151 11.379 59.958 -18.232 1.00 0.00 H ATOM 2231 HD2 LYS A 151 12.888 58.393 -19.449 1.00 0.00 H ATOM 2232 HD3 LYS A 151 14.061 58.560 -18.122 1.00 0.00 H ATOM 2233 HE2 LYS A 151 12.420 56.539 -18.102 1.00 0.00 H ATOM 2234 HE3 LYS A 151 11.207 57.730 -17.575 1.00 0.00 H ATOM 2235 HZ1 LYS A 151 13.787 57.148 -16.196 1.00 0.00 H ATOM 2236 HZ2 LYS A 151 12.629 58.285 -15.693 1.00 0.00 H ATOM 2237 HZ3 LYS A 151 12.250 56.629 -15.692 1.00 0.00 H ATOM 2238 H LYS A 151 14.273 62.047 -16.134 1.00 0.00 H ATOM 2239 N ILE A 152 15.301 63.999 -18.659 1.00 14.15 N ATOM 2240 CA ILE A 152 15.769 65.142 -19.416 1.00 14.31 C ATOM 2241 C ILE A 152 16.974 64.742 -20.256 1.00 13.90 C ATOM 2242 O ILE A 152 17.882 64.073 -19.768 1.00 13.71 O ATOM 2243 CB ILE A 152 16.112 66.314 -18.480 1.00 14.20 C ATOM 2244 CG1 ILE A 152 14.816 66.831 -17.858 1.00 14.91 C ATOM 2245 CG2 ILE A 152 16.820 67.437 -19.230 1.00 14.10 C ATOM 2246 CD1 ILE A 152 15.038 67.692 -16.677 1.00 15.57 C ATOM 2247 HA ILE A 152 14.974 65.476 -20.082 1.00 0.00 H ATOM 2248 HB ILE A 152 16.792 65.963 -17.704 1.00 0.00 H ATOM 2249 HG12 ILE A 152 14.276 67.407 -18.610 1.00 0.00 H ATOM 2250 HG13 ILE A 152 14.212 65.976 -17.555 1.00 0.00 H ATOM 2251 HD11 ILE A 152 15.568 67.126 -15.911 1.00 0.00 H ATOM 2252 HD12 ILE A 152 15.632 68.558 -16.967 1.00 0.00 H ATOM 2253 HD13 ILE A 152 14.077 68.024 -16.285 1.00 0.00 H ATOM 2254 HG21 ILE A 152 17.746 67.057 -19.662 1.00 0.00 H ATOM 2255 HG22 ILE A 152 16.172 67.807 -20.025 1.00 0.00 H ATOM 2256 HG23 ILE A 152 17.047 68.248 -18.538 1.00 0.00 H ATOM 2257 H ILE A 152 15.525 63.937 -17.645 1.00 0.00 H ATOM 2258 N HIS A 153 16.966 65.168 -21.517 1.00 13.58 N ATOM 2259 CA HIS A 153 18.029 64.848 -22.469 1.00 13.62 C ATOM 2260 C HIS A 153 18.843 66.060 -22.940 1.00 13.23 C ATOM 2261 O HIS A 153 19.924 65.886 -23.488 1.00 13.30 O ATOM 2262 CB HIS A 153 17.433 64.110 -23.675 1.00 13.61 C ATOM 2263 CG HIS A 153 17.244 62.643 -23.451 1.00 13.07 C ATOM 2264 ND1 HIS A 153 17.045 61.755 -24.486 1.00 13.83 N ATOM 2265 CD2 HIS A 153 17.234 61.904 -22.317 1.00 13.68 C ATOM 2266 CE1 HIS A 153 16.916 60.534 -23.998 1.00 14.22 C ATOM 2267 NE2 HIS A 153 17.030 60.596 -22.684 1.00 14.05 N ATOM 2268 HA HIS A 153 18.735 64.211 -21.936 1.00 0.00 H ATOM 2269 HB2 HIS A 153 16.463 64.551 -23.903 1.00 0.00 H ATOM 2270 HB3 HIS A 153 18.101 64.245 -24.526 1.00 0.00 H ATOM 2271 HD2 HIS A 153 17.364 62.277 -21.301 1.00 0.00 H ATOM 2272 HE1 HIS A 153 16.745 59.629 -24.581 1.00 0.00 H ATOM 2273 H HIS A 153 16.169 65.754 -21.839 1.00 0.00 H ATOM 2274 N GLY A 154 18.343 67.274 -22.725 1.00 13.14 N ATOM 2275 CA GLY A 154 19.075 68.483 -23.103 1.00 13.35 C ATOM 2276 C GLY A 154 20.120 68.858 -22.065 1.00 13.43 C ATOM 2277 O GLY A 154 20.722 67.990 -21.437 1.00 13.08 O ATOM 2278 HA3 GLY A 154 18.368 69.306 -23.206 1.00 0.00 H ATOM 2279 HA2 GLY A 154 19.572 68.311 -24.058 1.00 0.00 H ATOM 2280 H GLY A 154 17.409 67.366 -22.277 1.00 0.00 H ATOM 2281 N VAL A 155 20.332 70.156 -21.874 1.00 13.73 N ATOM 2282 CA VAL A 155 21.302 70.627 -20.886 1.00 14.09 C ATOM 2283 C VAL A 155 20.942 70.146 -19.481 1.00 14.22 C ATOM 2284 O VAL A 155 19.771 69.952 -19.152 1.00 14.14 O ATOM 2285 CB VAL A 155 21.468 72.177 -20.881 1.00 14.25 C ATOM 2286 CG1 VAL A 155 22.043 72.650 -22.202 1.00 15.01 C ATOM 2287 CG2 VAL A 155 20.148 72.891 -20.579 1.00 14.47 C ATOM 2288 HA VAL A 155 22.258 70.196 -21.184 1.00 0.00 H ATOM 2289 HB VAL A 155 22.164 72.432 -20.082 1.00 0.00 H ATOM 2290 HG11 VAL A 155 23.018 72.188 -22.359 1.00 0.00 H ATOM 2291 HG12 VAL A 155 21.371 72.367 -23.012 1.00 0.00 H ATOM 2292 HG13 VAL A 155 22.152 73.734 -22.182 1.00 0.00 H ATOM 2293 HG21 VAL A 155 19.412 72.628 -21.339 1.00 0.00 H ATOM 2294 HG22 VAL A 155 19.786 72.583 -19.598 1.00 0.00 H ATOM 2295 HG23 VAL A 155 20.310 73.969 -20.585 1.00 0.00 H ATOM 2296 H VAL A 155 19.799 70.849 -22.437 1.00 0.00 H ATOM 2297 N ASN A 156 21.971 69.934 -18.669 1.00 14.35 N ATOM 2298 CA ASN A 156 21.798 69.448 -17.314 1.00 14.55 C ATOM 2299 C ASN A 156 23.024 69.844 -16.521 1.00 14.95 C ATOM 2300 O ASN A 156 24.084 69.211 -16.628 1.00 15.05 O ATOM 2301 CB ASN A 156 21.589 67.927 -17.303 1.00 14.53 C ATOM 2302 CG ASN A 156 21.645 67.322 -15.901 1.00 14.26 C ATOM 2303 OD1 ASN A 156 21.391 68.000 -14.904 1.00 15.54 O ATOM 2304 ND2 ASN A 156 21.962 66.032 -15.826 1.00 10.96 N ATOM 2305 HA ASN A 156 20.909 69.889 -16.862 1.00 0.00 H ATOM 2306 HB2 ASN A 156 20.613 67.708 -17.736 1.00 0.00 H ATOM 2307 HB3 ASN A 156 22.367 67.466 -17.911 1.00 0.00 H ATOM 2308 HD22 ASN A 156 22.169 65.496 -16.693 1.00 0.00 H ATOM 2309 HD21 ASN A 156 22.002 65.559 -14.900 1.00 0.00 H ATOM 2310 H ASN A 156 22.933 70.123 -19.016 1.00 0.00 H ATOM 2311 N TYR A 157 22.878 70.931 -15.771 1.00 15.01 N ATOM 2312 CA TYR A 157 23.872 71.357 -14.801 1.00 15.25 C ATOM 2313 C TYR A 157 23.234 72.327 -13.820 1.00 15.51 C ATOM 2314 O TYR A 157 22.127 72.816 -14.047 1.00 15.35 O ATOM 2315 CB TYR A 157 25.100 71.989 -15.472 1.00 14.87 C ATOM 2316 CG TYR A 157 24.823 73.067 -16.505 1.00 15.26 C ATOM 2317 CD1 TYR A 157 24.488 74.373 -16.128 1.00 15.07 C ATOM 2318 CD2 TYR A 157 24.944 72.795 -17.865 1.00 15.43 C ATOM 2319 CE1 TYR A 157 24.250 75.359 -17.080 1.00 14.27 C ATOM 2320 CE2 TYR A 157 24.711 73.777 -18.819 1.00 14.98 C ATOM 2321 CZ TYR A 157 24.363 75.049 -18.424 1.00 15.08 C ATOM 2322 OH TYR A 157 24.136 76.006 -19.393 1.00 16.01 O ATOM 2323 HA TYR A 157 24.226 70.476 -14.266 1.00 0.00 H ATOM 2324 HB3 TYR A 157 25.656 71.192 -15.965 1.00 0.00 H ATOM 2325 HB2 TYR A 157 25.716 72.430 -14.689 1.00 0.00 H ATOM 2326 HD2 TYR A 157 25.227 71.793 -18.187 1.00 0.00 H ATOM 2327 HE2 TYR A 157 24.804 73.541 -19.879 1.00 0.00 H ATOM 2328 HE1 TYR A 157 23.977 76.368 -16.770 1.00 0.00 H ATOM 2329 HD1 TYR A 157 24.412 74.622 -15.069 1.00 0.00 H ATOM 2330 HH TYR A 157 24.956 76.126 -19.935 1.00 0.00 H ATOM 2331 H TYR A 157 22.015 71.501 -15.883 1.00 0.00 H ATOM 2332 N SER A 158 23.935 72.575 -12.723 1.00 15.89 N ATOM 2333 CA SER A 158 23.532 73.572 -11.751 1.00 16.30 C ATOM 2334 C SER A 158 24.420 74.798 -11.894 1.00 16.72 C ATOM 2335 O SER A 158 25.583 74.698 -12.278 1.00 17.02 O ATOM 2336 CB SER A 158 23.658 73.020 -10.328 1.00 16.30 C ATOM 2337 OG SER A 158 22.903 71.839 -10.149 1.00 16.11 O ATOM 2338 HA SER A 158 22.491 73.839 -11.932 1.00 0.00 H ATOM 2339 HB2 SER A 158 23.304 73.774 -9.625 1.00 0.00 H ATOM 2340 HB3 SER A 158 24.707 72.801 -10.127 1.00 0.00 H ATOM 2341 HG SER A 158 21.947 72.030 -10.323 1.00 0.00 H ATOM 2342 H SER A 158 24.807 72.034 -12.553 1.00 0.00 H ATOM 2343 N ILE A 159 23.857 75.956 -11.598 1.00 17.37 N ATOM 2344 CA ILE A 159 24.644 77.154 -11.386 1.00 17.66 C ATOM 2345 C ILE A 159 24.581 77.440 -9.901 1.00 17.88 C ATOM 2346 O ILE A 159 23.534 77.251 -9.279 1.00 17.79 O ATOM 2347 CB ILE A 159 24.095 78.349 -12.176 1.00 17.93 C ATOM 2348 CG1 ILE A 159 24.179 78.043 -13.673 1.00 18.39 C ATOM 2349 CG2 ILE A 159 24.869 79.640 -11.827 1.00 17.83 C ATOM 2350 CD1 ILE A 159 23.635 79.113 -14.557 1.00 18.27 C ATOM 2351 HA ILE A 159 25.666 77.001 -11.733 1.00 0.00 H ATOM 2352 HB ILE A 159 23.052 78.513 -11.905 1.00 0.00 H ATOM 2353 HG12 ILE A 159 25.227 77.889 -13.930 1.00 0.00 H ATOM 2354 HG13 ILE A 159 23.621 77.127 -13.865 1.00 0.00 H ATOM 2355 HD11 ILE A 159 22.582 79.273 -14.325 1.00 0.00 H ATOM 2356 HD12 ILE A 159 24.190 80.037 -14.391 1.00 0.00 H ATOM 2357 HD13 ILE A 159 23.737 78.809 -15.599 1.00 0.00 H ATOM 2358 HG21 ILE A 159 24.768 79.846 -10.761 1.00 0.00 H ATOM 2359 HG22 ILE A 159 25.922 79.509 -12.074 1.00 0.00 H ATOM 2360 HG23 ILE A 159 24.461 80.473 -12.400 1.00 0.00 H ATOM 2361 H ILE A 159 22.822 76.009 -11.515 1.00 0.00 H ATOM 2362 N SER A 160 25.710 77.874 -9.344 1.00 18.02 N ATOM 2363 CA SER A 160 25.789 78.307 -7.956 1.00 18.12 C ATOM 2364 C SER A 160 26.395 79.702 -7.890 1.00 17.91 C ATOM 2365 O SER A 160 27.443 79.959 -8.467 1.00 17.50 O ATOM 2366 CB SER A 160 26.624 77.333 -7.129 1.00 18.21 C ATOM 2367 OG SER A 160 26.514 77.640 -5.749 1.00 19.73 O ATOM 2368 HA SER A 160 24.782 78.329 -7.540 1.00 0.00 H ATOM 2369 HB2 SER A 160 27.668 77.407 -7.432 1.00 0.00 H ATOM 2370 HB3 SER A 160 26.268 76.317 -7.301 1.00 0.00 H ATOM 2371 HG SER A 160 26.839 78.561 -5.590 1.00 0.00 H ATOM 2372 H SER A 160 26.572 77.905 -9.925 1.00 0.00 H ATOM 2373 N SER A 161 25.713 80.597 -7.187 1.00 18.04 N ATOM 2374 CA SER A 161 26.193 81.957 -6.986 1.00 18.10 C ATOM 2375 C SER A 161 25.582 82.506 -5.700 1.00 18.12 C ATOM 2376 O SER A 161 25.097 83.637 -5.641 1.00 17.74 O ATOM 2377 CB SER A 161 25.837 82.810 -8.198 1.00 17.97 C ATOM 2378 OG SER A 161 24.485 82.614 -8.551 1.00 17.38 O ATOM 2379 HA SER A 161 27.278 81.973 -6.884 1.00 0.00 H ATOM 2380 HB2 SER A 161 26.473 82.528 -9.037 1.00 0.00 H ATOM 2381 HB3 SER A 161 25.998 83.861 -7.959 1.00 0.00 H ATOM 2382 HG SER A 161 24.266 83.173 -9.338 1.00 0.00 H ATOM 2383 H SER A 161 24.804 80.318 -6.765 1.00 0.00 H ATOM 2384 N ALA A 162 25.620 81.666 -4.668 1.00 18.59 N ATOM 2385 CA ALA A 162 25.124 82.001 -3.343 1.00 18.74 C ATOM 2386 C ALA A 162 23.671 82.470 -3.423 1.00 18.95 C ATOM 2387 O ALA A 162 22.810 81.739 -3.919 1.00 18.76 O ATOM 2388 CB ALA A 162 26.040 83.046 -2.677 1.00 18.85 C ATOM 2389 HA ALA A 162 25.141 81.110 -2.715 1.00 0.00 H ATOM 2390 HB1 ALA A 162 27.048 82.640 -2.588 1.00 0.00 H ATOM 2391 HB2 ALA A 162 26.063 83.949 -3.288 1.00 0.00 H ATOM 2392 HB3 ALA A 162 25.655 83.286 -1.686 1.00 0.00 H ATOM 2393 H ALA A 162 26.026 80.720 -4.817 1.00 0.00 H ATOM 2394 N CYS A 163 23.407 83.696 -2.981 1.00 18.98 N ATOM 2395 CA CYS A 163 22.052 84.200 -2.884 1.00 19.16 C ATOM 2396 C CYS A 163 21.467 84.606 -4.237 1.00 18.85 C ATOM 2397 O CYS A 163 20.295 84.970 -4.309 1.00 19.30 O ATOM 2398 CB CYS A 163 22.022 85.373 -1.909 1.00 19.53 C ATOM 2399 SG CYS A 163 22.769 84.937 -0.307 1.00 23.07 S ATOM 2400 HA CYS A 163 21.423 83.390 -2.515 1.00 0.00 H ATOM 2401 HB2 CYS A 163 20.986 85.671 -1.747 1.00 0.00 H ATOM 2402 HB3 CYS A 163 22.575 86.207 -2.342 1.00 0.00 H ATOM 2403 HG CYS A 163 22.717 86.029 0.535 1.00 0.00 H ATOM 2404 H CYS A 163 24.196 84.311 -2.697 1.00 0.00 H ATOM 2405 N ALA A 164 22.267 84.526 -5.302 1.00 18.04 N ATOM 2406 CA ALA A 164 21.798 84.836 -6.652 1.00 17.64 C ATOM 2407 C ALA A 164 21.607 83.591 -7.508 1.00 16.59 C ATOM 2408 O ALA A 164 21.357 83.688 -8.705 1.00 16.61 O ATOM 2409 CB ALA A 164 22.772 85.785 -7.326 1.00 17.47 C ATOM 2410 HA ALA A 164 20.820 85.308 -6.555 1.00 0.00 H ATOM 2411 HB1 ALA A 164 22.841 86.705 -6.746 1.00 0.00 H ATOM 2412 HB2 ALA A 164 23.754 85.316 -7.383 1.00 0.00 H ATOM 2413 HB3 ALA A 164 22.418 86.013 -8.331 1.00 0.00 H ATOM 2414 H ALA A 164 23.256 84.234 -5.168 1.00 0.00 H ATOM 2415 N THR A 165 21.675 82.425 -6.874 1.00 15.99 N ATOM 2416 CA THR A 165 21.831 81.149 -7.577 1.00 15.06 C ATOM 2417 C THR A 165 20.765 80.871 -8.627 1.00 14.81 C ATOM 2418 O THR A 165 21.069 80.747 -9.814 1.00 14.59 O ATOM 2419 CB THR A 165 21.859 79.996 -6.563 1.00 15.24 C ATOM 2420 OG1 THR A 165 23.071 80.080 -5.805 1.00 14.49 O ATOM 2421 CG2 THR A 165 21.797 78.636 -7.254 1.00 15.44 C ATOM 2422 HA THR A 165 22.775 81.224 -8.116 1.00 0.00 H ATOM 2423 HB THR A 165 20.986 80.086 -5.916 1.00 0.00 H ATOM 2424 HG1 THR A 165 23.102 80.948 -5.329 1.00 0.00 H ATOM 2425 HG23 THR A 165 20.876 78.566 -7.833 1.00 0.00 H ATOM 2426 HG21 THR A 165 22.654 78.528 -7.918 1.00 0.00 H ATOM 2427 HG22 THR A 165 21.816 77.847 -6.502 1.00 0.00 H ATOM 2428 H THR A 165 21.615 82.418 -5.836 1.00 0.00 H ATOM 2429 N SER A 166 19.519 80.755 -8.175 1.00 14.63 N ATOM 2430 CA SER A 166 18.415 80.343 -9.036 1.00 14.37 C ATOM 2431 C SER A 166 17.994 81.450 -10.012 1.00 14.37 C ATOM 2432 O SER A 166 17.320 81.174 -11.002 1.00 14.72 O ATOM 2433 CB SER A 166 17.229 79.851 -8.196 1.00 14.17 C ATOM 2434 OG SER A 166 16.857 80.783 -7.190 1.00 13.78 O ATOM 2435 HA SER A 166 18.769 79.512 -9.646 1.00 0.00 H ATOM 2436 HB2 SER A 166 17.504 78.910 -7.719 1.00 0.00 H ATOM 2437 HB3 SER A 166 16.376 79.687 -8.855 1.00 0.00 H ATOM 2438 HG SER A 166 17.623 80.933 -6.581 1.00 0.00 H ATOM 2439 H SER A 166 19.325 80.965 -7.175 1.00 0.00 H ATOM 2440 N ALA A 167 18.404 82.689 -9.737 1.00 14.06 N ATOM 2441 CA ALA A 167 18.249 83.797 -10.687 1.00 13.94 C ATOM 2442 C ALA A 167 19.208 83.676 -11.874 1.00 13.93 C ATOM 2443 O ALA A 167 18.818 83.916 -13.019 1.00 14.02 O ATOM 2444 CB ALA A 167 18.457 85.129 -9.988 1.00 14.10 C ATOM 2445 HA ALA A 167 17.232 83.746 -11.076 1.00 0.00 H ATOM 2446 HB1 ALA A 167 17.721 85.239 -9.192 1.00 0.00 H ATOM 2447 HB2 ALA A 167 19.461 85.163 -9.564 1.00 0.00 H ATOM 2448 HB3 ALA A 167 18.338 85.938 -10.708 1.00 0.00 H ATOM 2449 H ALA A 167 18.850 82.877 -8.816 1.00 0.00 H ATOM 2450 N HIS A 168 20.465 83.327 -11.607 1.00 13.60 N ATOM 2451 CA HIS A 168 21.392 83.006 -12.694 1.00 13.40 C ATOM 2452 C HIS A 168 20.935 81.763 -13.464 1.00 13.08 C ATOM 2453 O HIS A 168 21.135 81.687 -14.664 1.00 12.70 O ATOM 2454 CB HIS A 168 22.819 82.801 -12.184 1.00 13.26 C ATOM 2455 CG HIS A 168 23.502 84.067 -11.775 1.00 12.77 C ATOM 2456 ND1 HIS A 168 23.922 84.298 -10.483 1.00 12.21 N ATOM 2457 CD2 HIS A 168 23.837 85.170 -12.483 1.00 12.29 C ATOM 2458 CE1 HIS A 168 24.491 85.487 -10.416 1.00 12.71 C ATOM 2459 NE2 HIS A 168 24.455 86.036 -11.616 1.00 12.09 N ATOM 2460 HA HIS A 168 21.390 83.862 -13.369 1.00 0.00 H ATOM 2461 HB2 HIS A 168 22.784 82.135 -11.322 1.00 0.00 H ATOM 2462 HB3 HIS A 168 23.404 82.335 -12.977 1.00 0.00 H ATOM 2463 HD2 HIS A 168 23.651 85.339 -13.544 1.00 0.00 H ATOM 2464 HE1 HIS A 168 24.918 85.939 -9.521 1.00 0.00 H ATOM 2465 H HIS A 168 20.790 83.282 -10.620 1.00 0.00 H ATOM 2466 N CYS A 169 20.328 80.798 -12.773 1.00 13.15 N ATOM 2467 CA CYS A 169 19.794 79.598 -13.433 1.00 13.27 C ATOM 2468 C CYS A 169 18.760 79.957 -14.485 1.00 13.27 C ATOM 2469 O CYS A 169 18.790 79.435 -15.604 1.00 13.04 O ATOM 2470 CB CYS A 169 19.169 78.647 -12.422 1.00 13.33 C ATOM 2471 SG CYS A 169 20.362 77.713 -11.455 1.00 13.76 S ATOM 2472 HA CYS A 169 20.635 79.104 -13.918 1.00 0.00 H ATOM 2473 HB2 CYS A 169 18.538 77.941 -12.961 1.00 0.00 H ATOM 2474 HB3 CYS A 169 18.555 79.231 -11.737 1.00 0.00 H ATOM 2475 HG CYS A 169 21.164 78.586 -10.749 1.00 0.00 H ATOM 2476 H CYS A 169 20.230 80.897 -11.742 1.00 0.00 H ATOM 2477 N ILE A 170 17.858 80.863 -14.121 1.00 13.46 N ATOM 2478 CA ILE A 170 16.809 81.314 -15.031 1.00 13.67 C ATOM 2479 C ILE A 170 17.403 82.055 -16.218 1.00 13.86 C ATOM 2480 O ILE A 170 17.024 81.802 -17.352 1.00 13.87 O ATOM 2481 CB ILE A 170 15.788 82.203 -14.307 1.00 13.63 C ATOM 2482 CG1 ILE A 170 15.024 81.366 -13.283 1.00 13.69 C ATOM 2483 CG2 ILE A 170 14.813 82.851 -15.299 1.00 13.54 C ATOM 2484 CD1 ILE A 170 14.262 82.182 -12.271 1.00 13.66 C ATOM 2485 HA ILE A 170 16.290 80.429 -15.398 1.00 0.00 H ATOM 2486 HB ILE A 170 16.323 83.005 -13.798 1.00 0.00 H ATOM 2487 HG12 ILE A 170 14.315 80.733 -13.817 1.00 0.00 H ATOM 2488 HG13 ILE A 170 15.739 80.739 -12.750 1.00 0.00 H ATOM 2489 HD11 ILE A 170 14.957 82.813 -11.717 1.00 0.00 H ATOM 2490 HD12 ILE A 170 13.532 82.807 -12.785 1.00 0.00 H ATOM 2491 HD13 ILE A 170 13.747 81.514 -11.581 1.00 0.00 H ATOM 2492 HG21 ILE A 170 15.371 83.466 -16.006 1.00 0.00 H ATOM 2493 HG22 ILE A 170 14.275 82.072 -15.839 1.00 0.00 H ATOM 2494 HG23 ILE A 170 14.103 83.474 -14.755 1.00 0.00 H ATOM 2495 H ILE A 170 17.901 81.262 -13.161 1.00 0.00 H ATOM 2496 N GLY A 171 18.327 82.975 -15.954 1.00 14.24 N ATOM 2497 CA GLY A 171 18.969 83.735 -17.021 1.00 14.31 C ATOM 2498 C GLY A 171 19.764 82.847 -17.961 1.00 14.52 C ATOM 2499 O GLY A 171 19.810 83.085 -19.170 1.00 14.32 O ATOM 2500 HA3 GLY A 171 19.643 84.466 -16.575 1.00 0.00 H ATOM 2501 HA2 GLY A 171 18.200 84.254 -17.594 1.00 0.00 H ATOM 2502 H GLY A 171 18.597 83.156 -14.966 1.00 0.00 H ATOM 2503 N ASN A 172 20.393 81.816 -17.413 1.00 14.63 N ATOM 2504 CA ASN A 172 21.119 80.862 -18.248 1.00 15.17 C ATOM 2505 C ASN A 172 20.164 80.040 -19.110 1.00 14.85 C ATOM 2506 O ASN A 172 20.479 79.711 -20.247 1.00 14.73 O ATOM 2507 CB ASN A 172 21.973 79.924 -17.402 1.00 15.80 C ATOM 2508 CG ASN A 172 23.385 79.843 -17.899 1.00 18.54 C ATOM 2509 OD1 ASN A 172 24.144 80.809 -17.766 1.00 23.12 O ATOM 2510 ND2 ASN A 172 23.761 78.695 -18.469 1.00 19.74 N ATOM 2511 HA ASN A 172 21.772 81.443 -18.900 1.00 0.00 H ATOM 2512 HB2 ASN A 172 21.982 80.288 -16.374 1.00 0.00 H ATOM 2513 HB3 ASN A 172 21.533 78.927 -17.429 1.00 0.00 H ATOM 2514 HD22 ASN A 172 23.083 77.911 -18.557 1.00 0.00 H ATOM 2515 HD21 ASN A 172 24.732 78.585 -18.825 1.00 0.00 H ATOM 2516 H ASN A 172 20.369 81.686 -16.381 1.00 0.00 H ATOM 2517 N ALA A 173 19.000 79.715 -18.550 1.00 14.57 N ATOM 2518 CA ALA A 173 17.928 79.074 -19.298 1.00 14.43 C ATOM 2519 C ALA A 173 17.481 79.944 -20.468 1.00 14.36 C ATOM 2520 O ALA A 173 17.332 79.453 -21.585 1.00 14.02 O ATOM 2521 CB ALA A 173 16.757 78.763 -18.380 1.00 14.14 C ATOM 2522 HA ALA A 173 18.308 78.137 -19.705 1.00 0.00 H ATOM 2523 HB1 ALA A 173 17.087 78.093 -17.586 1.00 0.00 H ATOM 2524 HB2 ALA A 173 16.383 79.689 -17.944 1.00 0.00 H ATOM 2525 HB3 ALA A 173 15.964 78.284 -18.954 1.00 0.00 H ATOM 2526 H ALA A 173 18.852 79.927 -17.543 1.00 0.00 H ATOM 2527 N VAL A 174 17.287 81.237 -20.211 1.00 14.49 N ATOM 2528 CA VAL A 174 16.928 82.200 -21.259 1.00 14.85 C ATOM 2529 C VAL A 174 17.958 82.212 -22.383 1.00 15.06 C ATOM 2530 O VAL A 174 17.602 82.163 -23.560 1.00 14.84 O ATOM 2531 CB VAL A 174 16.782 83.631 -20.682 1.00 14.82 C ATOM 2532 CG1 VAL A 174 16.744 84.681 -21.789 1.00 14.69 C ATOM 2533 CG2 VAL A 174 15.543 83.722 -19.841 1.00 14.74 C ATOM 2534 HA VAL A 174 15.968 81.880 -21.665 1.00 0.00 H ATOM 2535 HB VAL A 174 17.655 83.833 -20.062 1.00 0.00 H ATOM 2536 HG11 VAL A 174 17.668 84.634 -22.365 1.00 0.00 H ATOM 2537 HG12 VAL A 174 15.896 84.485 -22.445 1.00 0.00 H ATOM 2538 HG13 VAL A 174 16.641 85.671 -21.345 1.00 0.00 H ATOM 2539 HG21 VAL A 174 14.672 83.491 -20.454 1.00 0.00 H ATOM 2540 HG22 VAL A 174 15.610 83.009 -19.019 1.00 0.00 H ATOM 2541 HG23 VAL A 174 15.450 84.732 -19.441 1.00 0.00 H ATOM 2542 H VAL A 174 17.394 81.576 -19.234 1.00 0.00 H ATOM 2543 N GLU A 175 19.233 82.278 -22.006 1.00 15.48 N ATOM 2544 CA GLU A 175 20.336 82.269 -22.966 1.00 16.10 C ATOM 2545 C GLU A 175 20.353 81.020 -23.853 1.00 15.84 C ATOM 2546 O GLU A 175 20.680 81.122 -25.033 1.00 15.65 O ATOM 2547 CB GLU A 175 21.684 82.414 -22.242 1.00 16.22 C ATOM 2548 CG GLU A 175 21.916 83.795 -21.632 1.00 17.51 C ATOM 2549 CD GLU A 175 23.209 83.894 -20.811 1.00 18.57 C ATOM 2550 OE1 GLU A 175 23.686 82.863 -20.280 1.00 22.28 O ATOM 2551 OE2 GLU A 175 23.750 85.017 -20.692 1.00 22.25 O ATOM 2552 HA GLU A 175 20.176 83.124 -23.622 1.00 0.00 H ATOM 2553 HB2 GLU A 175 21.725 81.674 -21.442 1.00 0.00 H ATOM 2554 HB3 GLU A 175 22.481 82.217 -22.959 1.00 0.00 H ATOM 2555 HG2 GLU A 175 21.963 84.525 -22.440 1.00 0.00 H ATOM 2556 HG3 GLU A 175 21.075 84.030 -20.980 1.00 0.00 H ATOM 2557 H GLU A 175 19.453 82.338 -20.991 1.00 0.00 H ATOM 2558 N GLN A 176 20.017 79.856 -23.292 1.00 15.78 N ATOM 2559 CA GLN A 176 19.903 78.616 -24.083 1.00 16.18 C ATOM 2560 C GLN A 176 18.837 78.735 -25.180 1.00 16.35 C ATOM 2561 O GLN A 176 19.037 78.290 -26.308 1.00 16.33 O ATOM 2562 CB GLN A 176 19.564 77.409 -23.190 1.00 16.02 C ATOM 2563 CG GLN A 176 20.674 76.967 -22.250 1.00 16.25 C ATOM 2564 CD GLN A 176 21.958 76.645 -22.982 1.00 16.36 C ATOM 2565 OE1 GLN A 176 21.976 75.836 -23.905 1.00 16.91 O ATOM 2566 NE2 GLN A 176 23.039 77.290 -22.578 1.00 17.77 N ATOM 2567 HA GLN A 176 20.876 78.460 -24.549 1.00 0.00 H ATOM 2568 HB2 GLN A 176 18.694 77.669 -22.587 1.00 0.00 H ATOM 2569 HB3 GLN A 176 19.316 76.569 -23.838 1.00 0.00 H ATOM 2570 HG2 GLN A 176 20.869 77.768 -21.537 1.00 0.00 H ATOM 2571 HG3 GLN A 176 20.345 76.077 -21.713 1.00 0.00 H ATOM 2572 HE22 GLN A 176 22.977 77.967 -21.791 1.00 0.00 H ATOM 2573 HE21 GLN A 176 23.952 77.120 -23.047 1.00 0.00 H ATOM 2574 H GLN A 176 19.831 79.823 -22.269 1.00 0.00 H ATOM 2575 N ILE A 177 17.702 79.329 -24.826 1.00 16.98 N ATOM 2576 CA ILE A 177 16.636 79.617 -25.784 1.00 17.36 C ATOM 2577 C ILE A 177 17.109 80.646 -26.820 1.00 17.58 C ATOM 2578 O ILE A 177 16.929 80.441 -28.015 1.00 17.40 O ATOM 2579 CB ILE A 177 15.342 80.099 -25.053 1.00 17.50 C ATOM 2580 CG1 ILE A 177 14.578 78.903 -24.473 1.00 18.06 C ATOM 2581 CG2 ILE A 177 14.422 80.899 -25.989 1.00 17.41 C ATOM 2582 CD1 ILE A 177 15.000 78.516 -23.108 1.00 19.23 C ATOM 2583 HA ILE A 177 16.390 78.696 -26.312 1.00 0.00 H ATOM 2584 HB ILE A 177 15.654 80.758 -24.243 1.00 0.00 H ATOM 2585 HG12 ILE A 177 13.518 79.156 -24.444 1.00 0.00 H ATOM 2586 HG13 ILE A 177 14.729 78.048 -25.133 1.00 0.00 H ATOM 2587 HD11 ILE A 177 16.056 78.247 -23.118 1.00 0.00 H ATOM 2588 HD12 ILE A 177 14.844 79.355 -22.429 1.00 0.00 H ATOM 2589 HD13 ILE A 177 14.409 77.663 -22.775 1.00 0.00 H ATOM 2590 HG21 ILE A 177 14.954 81.776 -26.357 1.00 0.00 H ATOM 2591 HG22 ILE A 177 14.127 80.271 -26.830 1.00 0.00 H ATOM 2592 HG23 ILE A 177 13.534 81.215 -25.441 1.00 0.00 H ATOM 2593 H ILE A 177 17.567 79.599 -23.831 1.00 0.00 H ATOM 2594 N GLN A 178 17.728 81.733 -26.360 1.00 17.97 N ATOM 2595 CA GLN A 178 18.252 82.769 -27.256 1.00 18.37 C ATOM 2596 C GLN A 178 19.266 82.228 -28.259 1.00 18.59 C ATOM 2597 O GLN A 178 19.327 82.706 -29.394 1.00 19.41 O ATOM 2598 CB GLN A 178 18.895 83.913 -26.459 1.00 18.59 C ATOM 2599 CG GLN A 178 17.901 84.804 -25.719 1.00 18.85 C ATOM 2600 CD GLN A 178 18.574 85.873 -24.867 1.00 19.55 C ATOM 2601 OE1 GLN A 178 19.687 85.681 -24.364 1.00 21.22 O ATOM 2602 NE2 GLN A 178 17.891 87.003 -24.688 1.00 20.38 N ATOM 2603 HA GLN A 178 17.394 83.142 -27.814 1.00 0.00 H ATOM 2604 HB2 GLN A 178 19.574 83.478 -25.726 1.00 0.00 H ATOM 2605 HB3 GLN A 178 19.461 84.536 -27.152 1.00 0.00 H ATOM 2606 HG2 GLN A 178 17.263 85.296 -26.453 1.00 0.00 H ATOM 2607 HG3 GLN A 178 17.289 84.177 -25.070 1.00 0.00 H ATOM 2608 HE22 GLN A 178 16.957 87.122 -25.130 1.00 0.00 H ATOM 2609 HE21 GLN A 178 18.292 87.766 -24.106 1.00 0.00 H ATOM 2610 H GLN A 178 17.843 81.850 -25.333 1.00 0.00 H ATOM 2611 N LEU A 179 20.059 81.239 -27.851 1.00 18.54 N ATOM 2612 CA LEU A 179 21.064 80.638 -28.739 1.00 18.28 C ATOM 2613 C LEU A 179 20.475 79.586 -29.690 1.00 18.17 C ATOM 2614 O LEU A 179 21.186 79.031 -30.525 1.00 17.86 O ATOM 2615 CB LEU A 179 22.186 80.015 -27.912 1.00 18.27 C ATOM 2616 CG LEU A 179 23.173 81.012 -27.306 1.00 18.83 C ATOM 2617 CD1 LEU A 179 23.956 80.379 -26.164 1.00 18.89 C ATOM 2618 CD2 LEU A 179 24.125 81.539 -28.371 1.00 19.29 C ATOM 2619 HA LEU A 179 21.456 81.444 -29.359 1.00 0.00 H ATOM 2620 HB2 LEU A 179 21.732 79.450 -27.097 1.00 0.00 H ATOM 2621 HB3 LEU A 179 22.744 79.336 -28.556 1.00 0.00 H ATOM 2622 HG LEU A 179 22.601 81.849 -26.905 1.00 0.00 H ATOM 2623 HD21 LEU A 179 24.682 80.707 -28.802 1.00 0.00 H ATOM 2624 HD22 LEU A 179 23.553 82.039 -29.153 1.00 0.00 H ATOM 2625 HD23 LEU A 179 24.819 82.247 -27.918 1.00 0.00 H ATOM 2626 HD11 LEU A 179 23.264 80.055 -25.387 1.00 0.00 H ATOM 2627 HD12 LEU A 179 24.512 79.520 -26.539 1.00 0.00 H ATOM 2628 HD13 LEU A 179 24.650 81.111 -25.752 1.00 0.00 H ATOM 2629 H LEU A 179 19.965 80.883 -26.879 1.00 0.00 H ATOM 2630 N GLY A 180 19.183 79.305 -29.548 1.00 18.06 N ATOM 2631 CA GLY A 180 18.504 78.325 -30.386 1.00 17.93 C ATOM 2632 C GLY A 180 18.852 76.889 -30.036 1.00 17.82 C ATOM 2633 O GLY A 180 18.546 75.978 -30.804 1.00 17.81 O ATOM 2634 HA3 GLY A 180 18.783 78.505 -31.424 1.00 0.00 H ATOM 2635 HA2 GLY A 180 17.428 78.458 -30.272 1.00 0.00 H ATOM 2636 H GLY A 180 18.639 79.801 -28.814 1.00 0.00 H ATOM 2637 N LYS A 181 19.478 76.683 -28.879 1.00 17.50 N ATOM 2638 CA LYS A 181 19.938 75.349 -28.473 1.00 17.23 C ATOM 2639 C LYS A 181 18.840 74.532 -27.794 1.00 16.74 C ATOM 2640 O LYS A 181 18.860 73.306 -27.861 1.00 16.78 O ATOM 2641 CB LYS A 181 21.139 75.452 -27.528 1.00 17.56 C ATOM 2642 CG LYS A 181 22.445 75.896 -28.162 1.00 17.85 C ATOM 2643 CD LYS A 181 23.532 75.993 -27.084 1.00 18.17 C ATOM 2644 CE LYS A 181 24.931 76.157 -27.670 1.00 18.42 C ATOM 2645 NZ LYS A 181 25.996 76.054 -26.615 1.00 18.36 N ATOM 2646 HA LYS A 181 20.227 74.834 -29.389 1.00 0.00 H ATOM 2647 HB2 LYS A 181 20.888 76.167 -26.745 1.00 0.00 H ATOM 2648 HB3 LYS A 181 21.300 74.470 -27.084 1.00 0.00 H ATOM 2649 HG2 LYS A 181 22.747 75.171 -28.918 1.00 0.00 H ATOM 2650 HG3 LYS A 181 22.309 76.871 -28.629 1.00 0.00 H ATOM 2651 HD2 LYS A 181 23.317 76.852 -26.448 1.00 0.00 H ATOM 2652 HD3 LYS A 181 23.510 75.084 -26.483 1.00 0.00 H ATOM 2653 HE2 LYS A 181 25.001 77.134 -28.148 1.00 0.00 H ATOM 2654 HE3 LYS A 181 25.095 75.378 -28.414 1.00 0.00 H ATOM 2655 HZ1 LYS A 181 25.851 76.799 -25.904 1.00 0.00 H ATOM 2656 HZ2 LYS A 181 25.941 75.121 -26.158 1.00 0.00 H ATOM 2657 HZ3 LYS A 181 26.931 76.171 -27.055 1.00 0.00 H ATOM 2658 H LYS A 181 19.646 77.490 -28.245 1.00 0.00 H ATOM 2659 N GLN A 182 17.892 75.204 -27.134 1.00 16.13 N ATOM 2660 CA GLN A 182 16.802 74.518 -26.409 1.00 15.67 C ATOM 2661 C GLN A 182 15.447 75.178 -26.662 1.00 15.38 C ATOM 2662 O GLN A 182 15.372 76.387 -26.885 1.00 15.16 O ATOM 2663 CB GLN A 182 17.078 74.510 -24.902 1.00 15.12 C ATOM 2664 CG GLN A 182 18.408 73.880 -24.483 1.00 14.29 C ATOM 2665 CD GLN A 182 18.341 72.370 -24.349 1.00 13.70 C ATOM 2666 OE1 GLN A 182 18.221 71.851 -23.246 1.00 13.60 O ATOM 2667 NE2 GLN A 182 18.414 71.662 -25.467 1.00 12.22 N ATOM 2668 HA GLN A 182 16.766 73.496 -26.785 1.00 0.00 H ATOM 2669 HB2 GLN A 182 17.069 75.542 -24.553 1.00 0.00 H ATOM 2670 HB3 GLN A 182 16.275 73.956 -24.415 1.00 0.00 H ATOM 2671 HG2 GLN A 182 19.160 74.128 -25.232 1.00 0.00 H ATOM 2672 HG3 GLN A 182 18.703 74.300 -23.521 1.00 0.00 H ATOM 2673 HE22 GLN A 182 18.516 72.145 -26.383 1.00 0.00 H ATOM 2674 HE21 GLN A 182 18.370 70.624 -25.429 1.00 0.00 H ATOM 2675 H GLN A 182 17.922 76.244 -27.130 1.00 0.00 H ATOM 2676 N ASP A 183 14.386 74.373 -26.633 1.00 15.27 N ATOM 2677 CA ASP A 183 13.004 74.869 -26.736 1.00 15.51 C ATOM 2678 C ASP A 183 12.416 75.159 -25.354 1.00 15.12 C ATOM 2679 O ASP A 183 11.730 76.163 -25.163 1.00 14.77 O ATOM 2680 CB ASP A 183 12.098 73.832 -27.417 1.00 15.99 C ATOM 2681 CG ASP A 183 12.320 73.731 -28.908 1.00 17.75 C ATOM 2682 OD1 ASP A 183 12.713 74.741 -29.534 1.00 20.68 O ATOM 2683 OD2 ASP A 183 12.073 72.632 -29.461 1.00 20.65 O ATOM 2684 HA ASP A 183 13.043 75.785 -27.326 1.00 0.00 H ATOM 2685 HB2 ASP A 183 12.292 72.857 -26.971 1.00 0.00 H ATOM 2686 HB3 ASP A 183 11.059 74.110 -27.240 1.00 0.00 H ATOM 2687 H ASP A 183 14.541 73.349 -26.533 1.00 0.00 H ATOM 2688 N ILE A 184 12.640 74.232 -24.422 1.00 14.72 N ATOM 2689 CA ILE A 184 12.224 74.386 -23.029 1.00 14.53 C ATOM 2690 C ILE A 184 13.441 74.187 -22.134 1.00 14.16 C ATOM 2691 O ILE A 184 14.240 73.278 -22.354 1.00 14.18 O ATOM 2692 CB ILE A 184 11.136 73.356 -22.600 1.00 14.56 C ATOM 2693 CG1 ILE A 184 9.811 73.604 -23.315 1.00 15.51 C ATOM 2694 CG2 ILE A 184 10.855 73.430 -21.098 1.00 14.69 C ATOM 2695 CD1 ILE A 184 9.741 73.000 -24.659 1.00 18.09 C ATOM 2696 HA ILE A 184 11.796 75.383 -22.929 1.00 0.00 H ATOM 2697 HB ILE A 184 11.533 72.377 -22.867 1.00 0.00 H ATOM 2698 HG12 ILE A 184 9.008 73.186 -22.707 1.00 0.00 H ATOM 2699 HG13 ILE A 184 9.669 74.680 -23.413 1.00 0.00 H ATOM 2700 HD11 ILE A 184 10.531 73.416 -25.284 1.00 0.00 H ATOM 2701 HD12 ILE A 184 9.870 71.921 -24.578 1.00 0.00 H ATOM 2702 HD13 ILE A 184 8.770 73.219 -25.104 1.00 0.00 H ATOM 2703 HG21 ILE A 184 11.771 73.215 -20.547 1.00 0.00 H ATOM 2704 HG22 ILE A 184 10.503 74.430 -20.844 1.00 0.00 H ATOM 2705 HG23 ILE A 184 10.091 72.698 -20.836 1.00 0.00 H ATOM 2706 H ILE A 184 13.133 73.359 -24.699 1.00 0.00 H ATOM 2707 N VAL A 185 13.581 75.048 -21.131 1.00 13.69 N ATOM 2708 CA VAL A 185 14.473 74.773 -20.014 1.00 13.40 C ATOM 2709 C VAL A 185 13.732 74.999 -18.687 1.00 12.94 C ATOM 2710 O VAL A 185 13.198 76.081 -18.433 1.00 12.25 O ATOM 2711 CB VAL A 185 15.756 75.615 -20.068 1.00 13.21 C ATOM 2712 CG1 VAL A 185 16.698 75.210 -18.937 1.00 13.82 C ATOM 2713 CG2 VAL A 185 16.459 75.447 -21.414 1.00 13.50 C ATOM 2714 HA VAL A 185 14.779 73.729 -20.086 1.00 0.00 H ATOM 2715 HB VAL A 185 15.482 76.663 -19.949 1.00 0.00 H ATOM 2716 HG11 VAL A 185 16.204 75.371 -17.979 1.00 0.00 H ATOM 2717 HG12 VAL A 185 16.957 74.156 -19.041 1.00 0.00 H ATOM 2718 HG13 VAL A 185 17.604 75.814 -18.986 1.00 0.00 H ATOM 2719 HG21 VAL A 185 16.720 74.398 -21.558 1.00 0.00 H ATOM 2720 HG22 VAL A 185 15.792 75.770 -22.214 1.00 0.00 H ATOM 2721 HG23 VAL A 185 17.365 76.053 -21.428 1.00 0.00 H ATOM 2722 H VAL A 185 13.042 75.937 -21.145 1.00 0.00 H ATOM 2723 N PHE A 186 13.697 73.956 -17.861 1.00 12.78 N ATOM 2724 CA PHE A 186 13.211 74.068 -16.498 1.00 12.91 C ATOM 2725 C PHE A 186 14.325 74.703 -15.682 1.00 12.95 C ATOM 2726 O PHE A 186 15.443 74.206 -15.669 1.00 12.90 O ATOM 2727 CB PHE A 186 12.842 72.695 -15.944 1.00 13.05 C ATOM 2728 CG PHE A 186 11.780 71.993 -16.739 1.00 13.57 C ATOM 2729 CD1 PHE A 186 12.117 71.022 -17.674 1.00 13.50 C ATOM 2730 CD2 PHE A 186 10.441 72.313 -16.568 1.00 14.42 C ATOM 2731 CE1 PHE A 186 11.138 70.381 -18.418 1.00 13.59 C ATOM 2732 CE2 PHE A 186 9.457 71.670 -17.316 1.00 13.22 C ATOM 2733 CZ PHE A 186 9.810 70.706 -18.237 1.00 13.35 C ATOM 2734 HA PHE A 186 12.309 74.679 -16.455 1.00 0.00 H ATOM 2735 HB2 PHE A 186 13.737 72.073 -15.939 1.00 0.00 H ATOM 2736 HB3 PHE A 186 12.482 72.820 -14.923 1.00 0.00 H ATOM 2737 HD2 PHE A 186 10.156 73.074 -15.842 1.00 0.00 H ATOM 2738 HE2 PHE A 186 8.408 71.929 -17.173 1.00 0.00 H ATOM 2739 HZ PHE A 186 9.040 70.202 -18.821 1.00 0.00 H ATOM 2740 HE1 PHE A 186 11.418 69.620 -19.146 1.00 0.00 H ATOM 2741 HD1 PHE A 186 13.164 70.761 -17.825 1.00 0.00 H ATOM 2742 H PHE A 186 14.028 73.031 -18.203 1.00 0.00 H ATOM 2743 N ALA A 187 14.029 75.824 -15.029 1.00 13.12 N ATOM 2744 CA ALA A 187 15.047 76.580 -14.319 1.00 12.92 C ATOM 2745 C ALA A 187 14.581 76.909 -12.917 1.00 13.18 C ATOM 2746 O ALA A 187 13.410 77.232 -12.707 1.00 13.61 O ATOM 2747 CB ALA A 187 15.367 77.840 -15.060 1.00 12.94 C ATOM 2748 HA ALA A 187 15.947 75.969 -14.254 1.00 0.00 H ATOM 2749 HB1 ALA A 187 15.736 77.591 -16.055 1.00 0.00 H ATOM 2750 HB2 ALA A 187 14.466 78.448 -15.147 1.00 0.00 H ATOM 2751 HB3 ALA A 187 16.131 78.396 -14.516 1.00 0.00 H ATOM 2752 H ALA A 187 13.047 76.167 -15.027 1.00 0.00 H ATOM 2753 N GLY A 188 15.498 76.834 -11.959 1.00 13.02 N ATOM 2754 CA GLY A 188 15.166 77.161 -10.589 1.00 13.08 C ATOM 2755 C GLY A 188 16.174 76.649 -9.592 1.00 13.17 C ATOM 2756 O GLY A 188 17.385 76.760 -9.798 1.00 12.87 O ATOM 2757 HA3 GLY A 188 14.195 76.725 -10.355 1.00 0.00 H ATOM 2758 HA2 GLY A 188 15.108 78.245 -10.496 1.00 0.00 H ATOM 2759 H GLY A 188 16.466 76.537 -12.196 1.00 0.00 H ATOM 2760 N GLY A 189 15.675 76.091 -8.498 1.00 13.44 N ATOM 2761 CA GLY A 189 16.563 75.615 -7.459 1.00 14.01 C ATOM 2762 C GLY A 189 15.887 75.279 -6.159 1.00 14.39 C ATOM 2763 O GLY A 189 14.668 75.374 -6.032 1.00 14.70 O ATOM 2764 HA3 GLY A 189 17.305 76.389 -7.266 1.00 0.00 H ATOM 2765 HA2 GLY A 189 17.063 74.718 -7.824 1.00 0.00 H ATOM 2766 H GLY A 189 14.645 75.995 -8.386 1.00 0.00 H ATOM 2767 N GLY A 190 16.702 74.870 -5.197 1.00 14.77 N ATOM 2768 CA GLY A 190 16.221 74.519 -3.880 1.00 15.64 C ATOM 2769 C GLY A 190 17.296 74.707 -2.825 1.00 16.02 C ATOM 2770 O GLY A 190 18.475 74.899 -3.139 1.00 15.79 O ATOM 2771 HA3 GLY A 190 15.907 73.475 -3.884 1.00 0.00 H ATOM 2772 HA2 GLY A 190 15.369 75.152 -3.634 1.00 0.00 H ATOM 2773 H GLY A 190 17.720 74.799 -5.396 1.00 0.00 H ATOM 2774 N GLU A 191 16.878 74.658 -1.568 1.00 16.52 N ATOM 2775 CA GLU A 191 17.788 74.870 -0.457 1.00 16.85 C ATOM 2776 C GLU A 191 17.230 74.166 0.756 1.00 17.05 C ATOM 2777 O GLU A 191 16.055 74.308 1.070 1.00 17.18 O ATOM 2778 CB GLU A 191 17.952 76.362 -0.167 1.00 16.88 C ATOM 2779 CG GLU A 191 19.205 76.710 0.625 1.00 17.33 C ATOM 2780 CD GLU A 191 20.474 76.680 -0.223 1.00 19.48 C ATOM 2781 OE1 GLU A 191 21.420 75.933 0.131 1.00 21.84 O ATOM 2782 OE2 GLU A 191 20.526 77.405 -1.246 1.00 19.11 O ATOM 2783 HA GLU A 191 18.770 74.469 -0.709 1.00 0.00 H ATOM 2784 HB2 GLU A 191 17.990 76.893 -1.118 1.00 0.00 H ATOM 2785 HB3 GLU A 191 17.084 76.698 0.401 1.00 0.00 H ATOM 2786 HG2 GLU A 191 19.087 77.711 1.039 1.00 0.00 H ATOM 2787 HG3 GLU A 191 19.313 75.992 1.438 1.00 0.00 H ATOM 2788 H GLU A 191 15.875 74.463 -1.373 1.00 0.00 H ATOM 2789 N GLU A 192 18.069 73.388 1.422 1.00 17.52 N ATOM 2790 CA GLU A 192 17.664 72.757 2.660 1.00 18.13 C ATOM 2791 C GLU A 192 17.732 73.779 3.783 1.00 18.38 C ATOM 2792 O GLU A 192 18.348 74.847 3.647 1.00 18.43 O ATOM 2793 CB GLU A 192 18.518 71.519 2.967 1.00 18.00 C ATOM 2794 CG GLU A 192 19.958 71.786 3.375 1.00 18.45 C ATOM 2795 CD GLU A 192 20.734 70.500 3.625 1.00 19.10 C ATOM 2796 OE1 GLU A 192 20.325 69.440 3.091 1.00 20.04 O ATOM 2797 OE2 GLU A 192 21.753 70.548 4.357 1.00 19.44 O ATOM 2798 HA GLU A 192 16.637 72.405 2.563 1.00 0.00 H ATOM 2799 HB2 GLU A 192 18.037 70.975 3.779 1.00 0.00 H ATOM 2800 HB3 GLU A 192 18.535 70.895 2.073 1.00 0.00 H ATOM 2801 HG2 GLU A 192 20.451 72.344 2.579 1.00 0.00 H ATOM 2802 HG3 GLU A 192 19.960 72.380 4.289 1.00 0.00 H ATOM 2803 H GLU A 192 19.028 73.229 1.052 1.00 0.00 H ATOM 2804 N LEU A 193 17.069 73.454 4.884 1.00 18.79 N ATOM 2805 CA LEU A 193 17.069 74.310 6.053 1.00 18.93 C ATOM 2806 C LEU A 193 17.534 73.465 7.226 1.00 19.18 C ATOM 2807 O LEU A 193 16.875 72.485 7.593 1.00 19.71 O ATOM 2808 CB LEU A 193 15.676 74.884 6.288 1.00 18.92 C ATOM 2809 CG LEU A 193 15.523 75.918 7.406 1.00 19.10 C ATOM 2810 CD1 LEU A 193 16.560 77.022 7.337 1.00 19.20 C ATOM 2811 CD2 LEU A 193 14.130 76.511 7.359 1.00 19.42 C ATOM 2812 HA LEU A 193 17.739 75.160 5.921 1.00 0.00 H ATOM 2813 HB2 LEU A 193 15.355 75.355 5.359 1.00 0.00 H ATOM 2814 HB3 LEU A 193 15.013 74.051 6.519 1.00 0.00 H ATOM 2815 HG LEU A 193 15.682 75.398 8.351 1.00 0.00 H ATOM 2816 HD21 LEU A 193 13.974 76.993 6.394 1.00 0.00 H ATOM 2817 HD22 LEU A 193 13.394 75.718 7.494 1.00 0.00 H ATOM 2818 HD23 LEU A 193 14.023 77.247 8.156 1.00 0.00 H ATOM 2819 HD11 LEU A 193 17.557 76.588 7.420 1.00 0.00 H ATOM 2820 HD12 LEU A 193 16.468 77.546 6.386 1.00 0.00 H ATOM 2821 HD13 LEU A 193 16.398 77.723 8.156 1.00 0.00 H ATOM 2822 H LEU A 193 16.535 72.562 4.909 1.00 0.00 H ATOM 2823 N CYS A 194 18.687 73.824 7.785 1.00 19.12 N ATOM 2824 CA CYS A 194 19.311 73.028 8.836 1.00 19.04 C ATOM 2825 C CYS A 194 20.341 73.839 9.610 1.00 18.80 C ATOM 2826 O CYS A 194 20.903 74.807 9.087 1.00 18.94 O ATOM 2827 CB CYS A 194 19.986 71.805 8.227 1.00 19.16 C ATOM 2828 SG CYS A 194 21.337 72.230 7.125 1.00 20.86 S ATOM 2829 HA CYS A 194 18.529 72.716 9.528 1.00 0.00 H ATOM 2830 HB2 CYS A 194 19.242 71.241 7.664 1.00 0.00 H ATOM 2831 HB3 CYS A 194 20.377 71.185 9.034 1.00 0.00 H ATOM 2832 HG CYS A 194 21.894 71.075 6.616 1.00 0.00 H ATOM 2833 H CYS A 194 19.156 74.695 7.464 1.00 0.00 H ATOM 2834 N TRP A 195 20.587 73.431 10.855 1.00 18.47 N ATOM 2835 CA TRP A 195 21.541 74.119 11.721 1.00 18.19 C ATOM 2836 C TRP A 195 22.956 73.993 11.149 1.00 18.27 C ATOM 2837 O TRP A 195 23.755 74.925 11.260 1.00 18.03 O ATOM 2838 CB TRP A 195 21.470 73.584 13.162 1.00 17.45 C ATOM 2839 CG TRP A 195 22.006 72.191 13.332 1.00 16.93 C ATOM 2840 CD1 TRP A 195 21.290 71.025 13.346 1.00 16.13 C ATOM 2841 CD2 TRP A 195 23.380 71.820 13.511 1.00 16.34 C ATOM 2842 NE1 TRP A 195 22.137 69.952 13.516 1.00 16.21 N ATOM 2843 CE2 TRP A 195 23.423 70.412 13.620 1.00 15.63 C ATOM 2844 CE3 TRP A 195 24.578 72.543 13.587 1.00 16.07 C ATOM 2845 CZ2 TRP A 195 24.615 69.713 13.796 1.00 16.15 C ATOM 2846 CZ3 TRP A 195 25.764 71.847 13.762 1.00 16.35 C ATOM 2847 CH2 TRP A 195 25.773 70.445 13.864 1.00 16.27 C ATOM 2848 HA TRP A 195 21.277 75.176 11.756 1.00 0.00 H ATOM 2849 HB2 TRP A 195 22.045 74.252 13.803 1.00 0.00 H ATOM 2850 HB3 TRP A 195 20.427 73.589 13.477 1.00 0.00 H ATOM 2851 HE1 TRP A 195 21.847 68.954 13.559 1.00 0.00 H ATOM 2852 HD1 TRP A 195 20.208 70.955 13.238 1.00 0.00 H ATOM 2853 HZ2 TRP A 195 24.627 68.626 13.877 1.00 0.00 H ATOM 2854 HH2 TRP A 195 26.723 69.927 14.000 1.00 0.00 H ATOM 2855 HZ3 TRP A 195 26.704 72.395 13.821 1.00 0.00 H ATOM 2856 HE3 TRP A 195 24.577 73.630 13.510 1.00 0.00 H ATOM 2857 H TRP A 195 20.084 72.597 11.221 1.00 0.00 H ATOM 2858 N GLU A 196 23.246 72.851 10.521 1.00 18.52 N ATOM 2859 CA GLU A 196 24.570 72.588 9.945 1.00 18.94 C ATOM 2860 C GLU A 196 25.020 73.723 9.041 1.00 19.39 C ATOM 2861 O GLU A 196 26.160 74.167 9.132 1.00 19.51 O ATOM 2862 CB GLU A 196 24.594 71.272 9.163 1.00 18.81 C ATOM 2863 CG GLU A 196 24.543 70.017 10.027 1.00 17.98 C ATOM 2864 CD GLU A 196 23.137 69.488 10.217 1.00 16.87 C ATOM 2865 OE1 GLU A 196 22.214 70.302 10.387 1.00 15.92 O ATOM 2866 OE2 GLU A 196 22.961 68.255 10.199 1.00 17.16 O ATOM 2867 HA GLU A 196 25.263 72.510 10.783 1.00 0.00 H ATOM 2868 HB2 GLU A 196 23.734 71.259 8.493 1.00 0.00 H ATOM 2869 HB3 GLU A 196 25.511 71.243 8.575 1.00 0.00 H ATOM 2870 HG2 GLU A 196 25.145 69.243 9.551 1.00 0.00 H ATOM 2871 HG3 GLU A 196 24.962 70.251 11.006 1.00 0.00 H ATOM 2872 H GLU A 196 22.508 72.123 10.437 1.00 0.00 H ATOM 2873 N MET A 197 24.113 74.199 8.191 1.00 20.01 N ATOM 2874 CA MET A 197 24.375 75.353 7.323 1.00 20.42 C ATOM 2875 C MET A 197 24.169 76.692 8.023 1.00 20.04 C ATOM 2876 O MET A 197 24.983 77.601 7.891 1.00 20.14 O ATOM 2877 CB MET A 197 23.439 75.324 6.116 1.00 20.61 C ATOM 2878 CG MET A 197 23.752 76.399 5.087 1.00 21.21 C ATOM 2879 SD MET A 197 23.123 75.964 3.458 1.00 23.74 S ATOM 2880 CE MET A 197 21.373 75.918 3.781 1.00 23.33 C ATOM 2881 HA MET A 197 25.421 75.271 7.029 1.00 0.00 H ATOM 2882 HB2 MET A 197 23.524 74.349 5.635 1.00 0.00 H ATOM 2883 HB3 MET A 197 22.417 75.467 6.467 1.00 0.00 H ATOM 2884 HG2 MET A 197 24.833 76.526 5.026 1.00 0.00 H ATOM 2885 HG3 MET A 197 23.294 77.336 5.404 1.00 0.00 H ATOM 2886 HE1 MET A 197 21.165 75.169 4.545 1.00 0.00 H ATOM 2887 HE2 MET A 197 21.044 76.896 4.131 1.00 0.00 H ATOM 2888 HE3 MET A 197 20.842 75.661 2.864 1.00 0.00 H ATOM 2889 H MET A 197 23.183 73.736 8.140 1.00 0.00 H ATOM 2890 N ALA A 198 23.055 76.813 8.735 1.00 19.94 N ATOM 2891 CA ALA A 198 22.650 78.072 9.364 1.00 19.90 C ATOM 2892 C ALA A 198 23.671 78.605 10.371 1.00 19.74 C ATOM 2893 O ALA A 198 23.844 79.822 10.495 1.00 19.35 O ATOM 2894 CB ALA A 198 21.294 77.900 10.034 1.00 19.86 C ATOM 2895 HA ALA A 198 22.587 78.814 8.568 1.00 0.00 H ATOM 2896 HB1 ALA A 198 20.554 77.615 9.286 1.00 0.00 H ATOM 2897 HB2 ALA A 198 21.362 77.122 10.794 1.00 0.00 H ATOM 2898 HB3 ALA A 198 20.999 78.840 10.500 1.00 0.00 H ATOM 2899 H ALA A 198 22.445 75.979 8.851 1.00 0.00 H ATOM 2900 N CYS A 199 24.348 77.700 11.080 1.00 19.83 N ATOM 2901 CA CYS A 199 25.332 78.102 12.090 1.00 20.01 C ATOM 2902 C CYS A 199 26.498 78.871 11.467 1.00 20.12 C ATOM 2903 O CYS A 199 27.065 79.765 12.107 1.00 20.22 O ATOM 2904 CB CYS A 199 25.839 76.899 12.896 1.00 19.95 C ATOM 2905 SG CYS A 199 26.942 75.760 12.022 1.00 20.80 S ATOM 2906 HA CYS A 199 24.822 78.774 12.780 1.00 0.00 H ATOM 2907 HB2 CYS A 199 24.970 76.331 13.229 1.00 0.00 H ATOM 2908 HB3 CYS A 199 26.376 77.282 13.764 1.00 0.00 H ATOM 2909 HG CYS A 199 26.286 75.237 10.927 1.00 0.00 H ATOM 2910 H CYS A 199 24.174 76.688 10.913 1.00 0.00 H ATOM 2911 N GLU A 200 26.819 78.549 10.212 1.00 19.79 N ATOM 2912 CA GLU A 200 27.861 79.255 9.457 1.00 20.04 C ATOM 2913 C GLU A 200 27.531 80.742 9.235 1.00 19.44 C ATOM 2914 O GLU A 200 28.413 81.594 9.310 1.00 19.26 O ATOM 2915 CB GLU A 200 28.092 78.574 8.100 1.00 20.12 C ATOM 2916 CG GLU A 200 28.524 77.100 8.183 1.00 21.28 C ATOM 2917 CD GLU A 200 28.502 76.386 6.833 1.00 22.18 C ATOM 2918 OE1 GLU A 200 28.272 77.043 5.785 1.00 24.57 O ATOM 2919 OE2 GLU A 200 28.718 75.152 6.824 1.00 25.45 O ATOM 2920 HA GLU A 200 28.768 79.206 10.059 1.00 0.00 H ATOM 2921 HB2 GLU A 200 27.163 78.624 7.533 1.00 0.00 H ATOM 2922 HB3 GLU A 200 28.869 79.126 7.571 1.00 0.00 H ATOM 2923 HG2 GLU A 200 29.538 77.058 8.580 1.00 0.00 H ATOM 2924 HG3 GLU A 200 27.848 76.579 8.861 1.00 0.00 H ATOM 2925 H GLU A 200 26.311 77.767 9.751 1.00 0.00 H ATOM 2926 N PHE A 201 26.268 81.044 8.947 1.00 19.20 N ATOM 2927 CA PHE A 201 25.821 82.433 8.771 1.00 19.15 C ATOM 2928 C PHE A 201 25.698 83.169 10.111 1.00 19.10 C ATOM 2929 O PHE A 201 25.857 84.391 10.176 1.00 18.80 O ATOM 2930 CB PHE A 201 24.482 82.484 8.025 1.00 18.79 C ATOM 2931 CG PHE A 201 24.575 82.058 6.588 1.00 18.47 C ATOM 2932 CD1 PHE A 201 24.380 80.734 6.232 1.00 17.83 C ATOM 2933 CD2 PHE A 201 24.876 82.985 5.594 1.00 17.90 C ATOM 2934 CE1 PHE A 201 24.473 80.337 4.901 1.00 18.61 C ATOM 2935 CE2 PHE A 201 24.976 82.601 4.266 1.00 17.81 C ATOM 2936 CZ PHE A 201 24.768 81.273 3.915 1.00 18.16 C ATOM 2937 HA PHE A 201 26.582 82.939 8.177 1.00 0.00 H ATOM 2938 HB2 PHE A 201 23.779 81.826 8.535 1.00 0.00 H ATOM 2939 HB3 PHE A 201 24.108 83.507 8.057 1.00 0.00 H ATOM 2940 HD2 PHE A 201 25.035 84.029 5.864 1.00 0.00 H ATOM 2941 HE2 PHE A 201 25.217 83.338 3.500 1.00 0.00 H ATOM 2942 HZ PHE A 201 24.836 80.966 2.871 1.00 0.00 H ATOM 2943 HE1 PHE A 201 24.315 79.293 4.631 1.00 0.00 H ATOM 2944 HD1 PHE A 201 24.152 79.996 7.001 1.00 0.00 H ATOM 2945 H PHE A 201 25.576 80.274 8.843 1.00 0.00 H ATOM 2946 N ASP A 202 25.394 82.421 11.169 1.00 19.26 N ATOM 2947 CA ASP A 202 25.297 82.988 12.510 1.00 19.39 C ATOM 2948 C ASP A 202 26.708 83.357 12.989 1.00 19.52 C ATOM 2949 O ASP A 202 26.932 84.452 13.498 1.00 19.58 O ATOM 2950 CB ASP A 202 24.628 81.990 13.464 1.00 19.26 C ATOM 2951 CG ASP A 202 23.933 82.658 14.648 1.00 19.48 C ATOM 2952 OD1 ASP A 202 24.090 83.889 14.865 1.00 18.63 O ATOM 2953 OD2 ASP A 202 23.220 81.926 15.368 1.00 18.58 O ATOM 2954 HA ASP A 202 24.679 83.886 12.493 1.00 0.00 H ATOM 2955 HB2 ASP A 202 23.887 81.420 12.904 1.00 0.00 H ATOM 2956 HB3 ASP A 202 25.391 81.313 13.848 1.00 0.00 H ATOM 2957 H ASP A 202 25.221 81.404 11.036 1.00 0.00 H ATOM 2958 N ALA A 203 27.669 82.463 12.769 1.00 19.72 N ATOM 2959 CA ALA A 203 29.063 82.730 13.134 1.00 19.96 C ATOM 2960 C ALA A 203 29.662 83.979 12.459 1.00 20.18 C ATOM 2961 O ALA A 203 30.616 84.556 12.977 1.00 20.25 O ATOM 2962 CB ALA A 203 29.919 81.514 12.860 1.00 20.00 C ATOM 2963 HA ALA A 203 29.059 82.946 14.202 1.00 0.00 H ATOM 2964 HB1 ALA A 203 29.551 80.673 13.447 1.00 0.00 H ATOM 2965 HB2 ALA A 203 29.869 81.268 11.799 1.00 0.00 H ATOM 2966 HB3 ALA A 203 30.951 81.728 13.136 1.00 0.00 H ATOM 2967 H ALA A 203 27.425 81.553 12.328 1.00 0.00 H ATOM 2968 N MET A 204 29.106 84.407 11.326 1.00 20.46 N ATOM 2969 CA MET A 204 29.545 85.656 10.698 1.00 20.69 C ATOM 2970 C MET A 204 28.651 86.857 11.021 1.00 20.43 C ATOM 2971 O MET A 204 28.851 87.935 10.467 1.00 20.75 O ATOM 2972 CB MET A 204 29.710 85.490 9.182 1.00 20.79 C ATOM 2973 CG MET A 204 28.436 85.380 8.377 1.00 21.48 C ATOM 2974 SD MET A 204 28.809 85.104 6.629 1.00 22.76 S ATOM 2975 CE MET A 204 29.227 86.758 6.101 1.00 23.72 C ATOM 2976 HA MET A 204 30.518 85.877 11.136 1.00 0.00 H ATOM 2977 HB2 MET A 204 30.264 86.353 8.812 1.00 0.00 H ATOM 2978 HB3 MET A 204 30.292 84.585 9.008 1.00 0.00 H ATOM 2979 HG2 MET A 204 27.866 86.303 8.480 1.00 0.00 H ATOM 2980 HG3 MET A 204 27.845 84.545 8.754 1.00 0.00 H ATOM 2981 HE1 MET A 204 28.374 87.417 6.265 1.00 0.00 H ATOM 2982 HE2 MET A 204 30.081 87.117 6.676 1.00 0.00 H ATOM 2983 HE3 MET A 204 29.481 86.746 5.041 1.00 0.00 H ATOM 2984 H MET A 204 28.351 83.847 10.882 1.00 0.00 H ATOM 2985 N GLY A 205 27.687 86.679 11.921 1.00 20.27 N ATOM 2986 CA GLY A 205 26.816 87.773 12.360 1.00 20.32 C ATOM 2987 C GLY A 205 25.715 88.170 11.382 1.00 20.26 C ATOM 2988 O GLY A 205 25.070 89.198 11.561 1.00 20.14 O ATOM 2989 HA3 GLY A 205 27.440 88.649 12.537 1.00 0.00 H ATOM 2990 HA2 GLY A 205 26.343 87.471 13.294 1.00 0.00 H ATOM 2991 H GLY A 205 27.547 85.732 12.327 1.00 0.00 H ATOM 2992 N ALA A 206 25.479 87.344 10.365 1.00 20.31 N ATOM 2993 CA ALA A 206 24.530 87.668 9.301 1.00 20.37 C ATOM 2994 C ALA A 206 23.053 87.447 9.677 1.00 20.40 C ATOM 2995 O ALA A 206 22.160 87.984 9.016 1.00 20.08 O ATOM 2996 CB ALA A 206 24.873 86.863 8.039 1.00 20.16 C ATOM 2997 HA ALA A 206 24.634 88.738 9.120 1.00 0.00 H ATOM 2998 HB1 ALA A 206 25.882 87.114 7.713 1.00 0.00 H ATOM 2999 HB2 ALA A 206 24.816 85.798 8.263 1.00 0.00 H ATOM 3000 HB3 ALA A 206 24.163 87.108 7.249 1.00 0.00 H ATOM 3001 H ALA A 206 25.987 86.437 10.326 1.00 0.00 H ATOM 3002 N LEU A 207 22.800 86.652 10.715 1.00 20.60 N ATOM 3003 CA LEU A 207 21.438 86.230 11.047 1.00 21.18 C ATOM 3004 C LEU A 207 20.842 87.083 12.154 1.00 21.74 C ATOM 3005 O LEU A 207 21.546 87.461 13.092 1.00 21.65 O ATOM 3006 CB LEU A 207 21.410 84.760 11.487 1.00 20.90 C ATOM 3007 CG LEU A 207 21.783 83.682 10.469 1.00 20.54 C ATOM 3008 CD1 LEU A 207 21.518 82.304 11.074 1.00 20.37 C ATOM 3009 CD2 LEU A 207 21.033 83.848 9.148 1.00 19.89 C ATOM 3010 HA LEU A 207 20.842 86.354 10.143 1.00 0.00 H ATOM 3011 HB2 LEU A 207 22.100 84.662 12.325 1.00 0.00 H ATOM 3012 HB3 LEU A 207 20.396 84.545 11.825 1.00 0.00 H ATOM 3013 HG LEU A 207 22.843 83.785 10.239 1.00 0.00 H ATOM 3014 HD21 LEU A 207 19.960 83.785 9.330 1.00 0.00 H ATOM 3015 HD22 LEU A 207 21.272 84.819 8.715 1.00 0.00 H ATOM 3016 HD23 LEU A 207 21.333 83.058 8.459 1.00 0.00 H ATOM 3017 HD11 LEU A 207 22.121 82.182 11.974 1.00 0.00 H ATOM 3018 HD12 LEU A 207 20.462 82.217 11.328 1.00 0.00 H ATOM 3019 HD13 LEU A 207 21.783 81.534 10.350 1.00 0.00 H ATOM 3020 H LEU A 207 23.590 86.322 11.305 1.00 0.00 H ATOM 3021 N SER A 208 19.544 87.374 12.045 1.00 22.41 N ATOM 3022 CA SER A 208 18.831 88.107 13.094 1.00 23.03 C ATOM 3023 C SER A 208 18.870 87.307 14.400 1.00 23.52 C ATOM 3024 O SER A 208 18.678 86.087 14.393 1.00 23.65 O ATOM 3025 CB SER A 208 17.383 88.382 12.681 1.00 22.92 C ATOM 3026 OG SER A 208 16.606 88.781 13.794 1.00 23.09 O ATOM 3027 HA SER A 208 19.325 89.067 13.246 1.00 0.00 H ATOM 3028 HB2 SER A 208 16.955 87.475 12.254 1.00 0.00 H ATOM 3029 HB3 SER A 208 17.370 89.175 11.934 1.00 0.00 H ATOM 3030 HG SER A 208 16.988 89.607 14.183 1.00 0.00 H ATOM 3031 H SER A 208 19.026 87.073 11.195 1.00 0.00 H ATOM 3032 N THR A 209 19.143 87.997 15.504 1.00 24.08 N ATOM 3033 CA THR A 209 19.276 87.353 16.819 1.00 24.70 C ATOM 3034 C THR A 209 18.458 88.016 17.945 1.00 25.17 C ATOM 3035 O THR A 209 18.318 87.432 19.026 1.00 25.09 O ATOM 3036 CB THR A 209 20.755 87.330 17.284 1.00 24.72 C ATOM 3037 OG1 THR A 209 21.196 88.668 17.553 1.00 25.11 O ATOM 3038 CG2 THR A 209 21.665 86.699 16.235 1.00 24.65 C ATOM 3039 HA THR A 209 18.884 86.348 16.659 1.00 0.00 H ATOM 3040 HB THR A 209 20.811 86.726 18.189 1.00 0.00 H ATOM 3041 HG1 THR A 209 22.140 88.650 17.850 1.00 0.00 H ATOM 3042 HG23 THR A 209 21.330 85.682 16.030 1.00 0.00 H ATOM 3043 HG21 THR A 209 21.624 87.288 15.319 1.00 0.00 H ATOM 3044 HG22 THR A 209 22.689 86.678 16.609 1.00 0.00 H ATOM 3045 H THR A 209 19.267 89.027 15.435 1.00 0.00 H ATOM 3046 N LYS A 210 17.923 89.214 17.701 1.00 25.72 N ATOM 3047 CA LYS A 210 17.266 90.001 18.754 1.00 26.42 C ATOM 3048 C LYS A 210 15.767 89.733 18.899 1.00 26.67 C ATOM 3049 O LYS A 210 15.192 90.013 19.948 1.00 27.07 O ATOM 3050 CB LYS A 210 17.499 91.503 18.520 1.00 26.56 C ATOM 3051 CG LYS A 210 18.957 91.928 18.721 1.00 27.13 C ATOM 3052 CD LYS A 210 19.113 93.441 18.900 1.00 27.75 C ATOM 3053 CE LYS A 210 18.998 94.214 17.586 1.00 29.00 C ATOM 3054 NZ LYS A 210 17.584 94.397 17.124 1.00 29.82 N ATOM 3055 HA LYS A 210 17.726 89.680 19.688 1.00 0.00 H ATOM 3056 HB2 LYS A 210 17.206 91.744 17.498 1.00 0.00 H ATOM 3057 HB3 LYS A 210 16.876 92.063 19.217 1.00 0.00 H ATOM 3058 HG2 LYS A 210 19.346 91.430 19.609 1.00 0.00 H ATOM 3059 HG3 LYS A 210 19.534 91.618 17.850 1.00 0.00 H ATOM 3060 HD2 LYS A 210 18.336 93.792 19.579 1.00 0.00 H ATOM 3061 HD3 LYS A 210 20.092 93.640 19.336 1.00 0.00 H ATOM 3062 HE2 LYS A 210 19.546 93.670 16.816 1.00 0.00 H ATOM 3063 HE3 LYS A 210 19.447 95.198 17.723 1.00 0.00 H ATOM 3064 HZ1 LYS A 210 17.145 93.466 16.978 1.00 0.00 H ATOM 3065 HZ2 LYS A 210 17.051 94.924 17.845 1.00 0.00 H ATOM 3066 HZ3 LYS A 210 17.579 94.928 16.230 1.00 0.00 H ATOM 3067 H LYS A 210 17.972 89.602 16.737 1.00 0.00 H ATOM 3068 N TYR A 211 15.145 89.176 17.862 1.00 27.02 N ATOM 3069 CA TYR A 211 13.687 89.026 17.805 1.00 27.02 C ATOM 3070 C TYR A 211 13.203 87.580 17.947 1.00 26.97 C ATOM 3071 O TYR A 211 12.157 87.224 17.421 1.00 26.75 O ATOM 3072 CB TYR A 211 13.178 89.609 16.487 1.00 27.09 C ATOM 3073 CG TYR A 211 13.502 91.072 16.305 1.00 27.13 C ATOM 3074 CD1 TYR A 211 14.639 91.474 15.612 1.00 27.32 C ATOM 3075 CD2 TYR A 211 12.670 92.057 16.829 1.00 27.74 C ATOM 3076 CE1 TYR A 211 14.943 92.827 15.442 1.00 27.02 C ATOM 3077 CE2 TYR A 211 12.963 93.412 16.666 1.00 27.48 C ATOM 3078 CZ TYR A 211 14.101 93.788 15.976 1.00 27.50 C ATOM 3079 OH TYR A 211 14.385 95.127 15.816 1.00 27.37 O ATOM 3080 HA TYR A 211 13.283 89.566 18.661 1.00 0.00 H ATOM 3081 HB3 TYR A 211 12.095 89.489 16.453 1.00 0.00 H ATOM 3082 HB2 TYR A 211 13.630 89.052 15.667 1.00 0.00 H ATOM 3083 HD2 TYR A 211 11.774 91.765 17.376 1.00 0.00 H ATOM 3084 HE2 TYR A 211 12.298 94.170 17.080 1.00 0.00 H ATOM 3085 HE1 TYR A 211 15.837 93.124 14.893 1.00 0.00 H ATOM 3086 HD1 TYR A 211 15.305 90.719 15.194 1.00 0.00 H ATOM 3087 HH TYR A 211 15.227 95.226 15.304 1.00 0.00 H ATOM 3088 H TYR A 211 15.715 88.834 17.062 1.00 0.00 H ATOM 3089 N ASN A 212 13.941 86.756 18.683 1.00 27.30 N ATOM 3090 CA ASN A 212 13.611 85.325 18.793 1.00 27.64 C ATOM 3091 C ASN A 212 12.303 85.029 19.535 1.00 28.06 C ATOM 3092 O ASN A 212 11.693 83.972 19.324 1.00 27.93 O ATOM 3093 CB ASN A 212 14.764 84.554 19.450 1.00 27.40 C ATOM 3094 CG ASN A 212 16.020 84.540 18.594 1.00 27.10 C ATOM 3095 OD1 ASN A 212 15.954 84.653 17.370 1.00 26.14 O ATOM 3096 ND2 ASN A 212 17.170 84.400 19.236 1.00 26.37 N ATOM 3097 HA ASN A 212 13.462 84.987 17.768 1.00 0.00 H ATOM 3098 HB2 ASN A 212 14.998 85.023 20.406 1.00 0.00 H ATOM 3099 HB3 ASN A 212 14.445 83.526 19.619 1.00 0.00 H ATOM 3100 HD22 ASN A 212 17.179 84.308 20.272 1.00 0.00 H ATOM 3101 HD21 ASN A 212 18.064 84.382 18.704 1.00 0.00 H ATOM 3102 H ASN A 212 14.768 87.129 19.191 1.00 0.00 H ATOM 3103 N ASP A 213 11.890 85.949 20.408 1.00 28.47 N ATOM 3104 CA ASP A 213 10.626 85.821 21.137 1.00 28.82 C ATOM 3105 C ASP A 213 9.433 86.297 20.304 1.00 28.77 C ATOM 3106 O ASP A 213 8.289 86.002 20.648 1.00 28.80 O ATOM 3107 CB ASP A 213 10.685 86.599 22.455 1.00 29.40 C ATOM 3108 CG ASP A 213 11.733 86.047 23.413 1.00 31.63 C ATOM 3109 OD1 ASP A 213 11.413 85.098 24.171 1.00 34.97 O ATOM 3110 OD2 ASP A 213 12.874 86.568 23.417 1.00 34.62 O ATOM 3111 HA ASP A 213 10.483 84.761 21.349 1.00 0.00 H ATOM 3112 HB2 ASP A 213 10.925 87.640 22.236 1.00 0.00 H ATOM 3113 HB3 ASP A 213 9.709 86.546 22.936 1.00 0.00 H ATOM 3114 H ASP A 213 12.485 86.785 20.577 1.00 0.00 H ATOM 3115 N THR A 214 9.703 87.034 19.222 1.00 28.58 N ATOM 3116 CA THR A 214 8.676 87.436 18.254 1.00 28.24 C ATOM 3117 C THR A 214 9.120 87.069 16.831 1.00 28.02 C ATOM 3118 O THR A 214 9.514 87.946 16.050 1.00 27.70 O ATOM 3119 CB THR A 214 8.394 88.953 18.320 1.00 28.36 C ATOM 3120 OG1 THR A 214 9.602 89.685 18.075 1.00 28.30 O ATOM 3121 CG2 THR A 214 7.833 89.342 19.682 1.00 28.66 C ATOM 3122 HA THR A 214 7.760 86.903 18.509 1.00 0.00 H ATOM 3123 HB THR A 214 7.656 89.196 17.556 1.00 0.00 H ATOM 3124 HG1 THR A 214 9.949 89.456 17.177 1.00 0.00 H ATOM 3125 HG23 THR A 214 6.915 88.785 19.868 1.00 0.00 H ATOM 3126 HG21 THR A 214 8.564 89.107 20.455 1.00 0.00 H ATOM 3127 HG22 THR A 214 7.620 90.411 19.694 1.00 0.00 H ATOM 3128 H THR A 214 10.685 87.336 19.059 1.00 0.00 H ATOM 3129 N PRO A 215 9.046 85.769 16.484 1.00 27.72 N ATOM 3130 CA PRO A 215 9.584 85.263 15.216 1.00 27.65 C ATOM 3131 C PRO A 215 9.076 85.970 13.957 1.00 27.54 C ATOM 3132 O PRO A 215 9.854 86.206 13.033 1.00 27.55 O ATOM 3133 CB PRO A 215 9.150 83.795 15.215 1.00 27.75 C ATOM 3134 CG PRO A 215 8.976 83.451 16.641 1.00 27.64 C ATOM 3135 CD PRO A 215 8.442 84.687 17.283 1.00 27.67 C ATOM 3136 HA PRO A 215 10.660 85.430 15.171 1.00 0.00 H ATOM 3137 HD3 PRO A 215 7.354 84.719 17.226 1.00 0.00 H ATOM 3138 HD2 PRO A 215 8.752 84.751 18.326 1.00 0.00 H ATOM 3139 HG3 PRO A 215 9.931 83.172 17.086 1.00 0.00 H ATOM 3140 HG2 PRO A 215 8.270 82.628 16.752 1.00 0.00 H ATOM 3141 HB2 PRO A 215 8.212 83.672 14.673 1.00 0.00 H ATOM 3142 HB3 PRO A 215 9.917 83.168 14.759 1.00 0.00 H ATOM 3143 N GLU A 216 7.795 86.324 13.928 1.00 27.52 N ATOM 3144 CA GLU A 216 7.199 86.942 12.738 1.00 27.50 C ATOM 3145 C GLU A 216 7.624 88.400 12.527 1.00 27.12 C ATOM 3146 O GLU A 216 7.247 89.010 11.527 1.00 26.82 O ATOM 3147 CB GLU A 216 5.669 86.817 12.776 1.00 27.43 C ATOM 3148 CG GLU A 216 5.190 85.363 12.790 1.00 27.99 C ATOM 3149 CD GLU A 216 3.689 85.206 12.546 1.00 28.54 C ATOM 3150 OE1 GLU A 216 2.905 86.061 13.016 1.00 30.79 O ATOM 3151 OE2 GLU A 216 3.291 84.214 11.895 1.00 29.15 O ATOM 3152 HA GLU A 216 7.584 86.391 11.880 1.00 0.00 H ATOM 3153 HB2 GLU A 216 5.301 87.313 13.674 1.00 0.00 H ATOM 3154 HB3 GLU A 216 5.257 87.311 11.896 1.00 0.00 H ATOM 3155 HG2 GLU A 216 5.724 84.817 12.012 1.00 0.00 H ATOM 3156 HG3 GLU A 216 5.427 84.932 13.763 1.00 0.00 H ATOM 3157 H GLU A 216 7.202 86.159 14.767 1.00 0.00 H ATOM 3158 N LYS A 217 8.413 88.946 13.454 1.00 26.99 N ATOM 3159 CA LYS A 217 8.918 90.322 13.342 1.00 27.19 C ATOM 3160 C LYS A 217 10.445 90.429 13.187 1.00 26.83 C ATOM 3161 O LYS A 217 10.974 91.530 13.075 1.00 26.66 O ATOM 3162 CB LYS A 217 8.455 91.144 14.547 1.00 27.25 C ATOM 3163 CG LYS A 217 6.939 91.203 14.670 1.00 27.92 C ATOM 3164 CD LYS A 217 6.456 92.418 15.455 1.00 28.52 C ATOM 3165 CE LYS A 217 5.262 93.074 14.768 1.00 29.81 C ATOM 3166 NZ LYS A 217 5.644 93.580 13.412 1.00 30.81 N ATOM 3167 HA LYS A 217 8.499 90.721 12.418 1.00 0.00 H ATOM 3168 HB2 LYS A 217 8.861 90.695 15.453 1.00 0.00 H ATOM 3169 HB3 LYS A 217 8.837 92.160 14.444 1.00 0.00 H ATOM 3170 HG2 LYS A 217 6.509 91.242 13.669 1.00 0.00 H ATOM 3171 HG3 LYS A 217 6.595 90.301 15.177 1.00 0.00 H ATOM 3172 HD2 LYS A 217 6.162 92.102 16.456 1.00 0.00 H ATOM 3173 HD3 LYS A 217 7.268 93.142 15.527 1.00 0.00 H ATOM 3174 HE2 LYS A 217 4.913 93.908 15.376 1.00 0.00 H ATOM 3175 HE3 LYS A 217 4.462 92.341 14.664 1.00 0.00 H ATOM 3176 HZ1 LYS A 217 6.405 94.282 13.507 1.00 0.00 H ATOM 3177 HZ2 LYS A 217 5.974 92.786 12.827 1.00 0.00 H ATOM 3178 HZ3 LYS A 217 4.817 94.022 12.963 1.00 0.00 H ATOM 3179 H LYS A 217 8.680 88.379 14.284 1.00 0.00 H ATOM 3180 N ALA A 218 11.136 89.289 13.158 1.00 26.61 N ATOM 3181 CA ALA A 218 12.596 89.248 13.038 1.00 26.44 C ATOM 3182 C ALA A 218 13.082 89.703 11.667 1.00 26.25 C ATOM 3183 O ALA A 218 14.118 90.361 11.557 1.00 26.21 O ATOM 3184 CB ALA A 218 13.101 87.840 13.326 1.00 26.59 C ATOM 3185 HA ALA A 218 13.000 89.946 13.772 1.00 0.00 H ATOM 3186 HB1 ALA A 218 12.815 87.553 14.338 1.00 0.00 H ATOM 3187 HB2 ALA A 218 12.661 87.144 12.611 1.00 0.00 H ATOM 3188 HB3 ALA A 218 14.187 87.819 13.234 1.00 0.00 H ATOM 3189 H ALA A 218 10.617 88.390 13.223 1.00 0.00 H ATOM 3190 N SER A 219 12.333 89.341 10.627 1.00 26.26 N ATOM 3191 CA SER A 219 12.644 89.736 9.256 1.00 26.07 C ATOM 3192 C SER A 219 11.898 91.038 8.949 1.00 26.10 C ATOM 3193 O SER A 219 10.677 91.049 8.808 1.00 26.19 O ATOM 3194 CB SER A 219 12.253 88.613 8.285 1.00 25.86 C ATOM 3195 OG SER A 219 12.884 88.759 7.025 1.00 25.06 O ATOM 3196 HA SER A 219 13.714 89.906 9.137 1.00 0.00 H ATOM 3197 HB2 SER A 219 11.173 88.631 8.142 1.00 0.00 H ATOM 3198 HB3 SER A 219 12.545 87.656 8.717 1.00 0.00 H ATOM 3199 HG SER A 219 12.606 88.018 6.430 1.00 0.00 H ATOM 3200 H SER A 219 11.492 88.753 10.798 1.00 0.00 H ATOM 3201 N ARG A 220 12.643 92.135 8.848 1.00 26.26 N ATOM 3202 CA ARG A 220 12.055 93.470 8.815 1.00 26.58 C ATOM 3203 C ARG A 220 12.844 94.409 7.911 1.00 26.32 C ATOM 3204 O ARG A 220 13.305 95.474 8.332 1.00 26.10 O ATOM 3205 CB ARG A 220 11.978 94.031 10.236 1.00 26.69 C ATOM 3206 CG ARG A 220 13.285 93.959 11.015 1.00 27.38 C ATOM 3207 CD ARG A 220 13.212 94.773 12.305 1.00 28.50 C ATOM 3208 NE ARG A 220 12.314 94.170 13.286 1.00 30.29 N ATOM 3209 CZ ARG A 220 11.366 94.810 13.975 1.00 31.29 C ATOM 3210 NH1 ARG A 220 11.165 96.116 13.840 1.00 32.20 N ATOM 3211 NH2 ARG A 220 10.619 94.133 14.836 1.00 31.85 N ATOM 3212 HA ARG A 220 11.050 93.391 8.401 1.00 0.00 H ATOM 3213 HB2 ARG A 220 11.676 95.076 10.174 1.00 0.00 H ATOM 3214 HB3 ARG A 220 11.223 93.468 10.784 1.00 0.00 H ATOM 3215 HG2 ARG A 220 13.493 92.918 11.264 1.00 0.00 H ATOM 3216 HG3 ARG A 220 14.090 94.351 10.394 1.00 0.00 H ATOM 3217 HD2 ARG A 220 12.853 95.775 12.069 1.00 0.00 H ATOM 3218 HD3 ARG A 220 14.211 94.839 12.736 1.00 0.00 H ATOM 3219 HE ARG A 220 12.422 93.151 13.464 1.00 0.00 H ATOM 3220 HH12 ARG A 220 10.419 96.587 14.390 1.00 0.00 H ATOM 3221 HH11 ARG A 220 11.754 96.668 13.184 1.00 0.00 H ATOM 3222 HH22 ARG A 220 9.878 94.622 15.378 1.00 0.00 H ATOM 3223 HH21 ARG A 220 10.774 93.113 14.970 1.00 0.00 H ATOM 3224 H ARG A 220 13.677 92.038 8.791 1.00 0.00 H ATOM 3225 N THR A 221 12.972 94.008 6.653 1.00 26.29 N ATOM 3226 CA THR A 221 13.697 94.786 5.654 1.00 26.38 C ATOM 3227 C THR A 221 13.284 96.262 5.687 1.00 26.54 C ATOM 3228 O THR A 221 12.095 96.579 5.758 1.00 26.41 O ATOM 3229 CB THR A 221 13.473 94.202 4.246 1.00 26.08 C ATOM 3230 OG1 THR A 221 13.652 92.781 4.288 1.00 25.97 O ATOM 3231 CG2 THR A 221 14.446 94.796 3.251 1.00 26.11 C ATOM 3232 HA THR A 221 14.758 94.727 5.896 1.00 0.00 H ATOM 3233 HB THR A 221 12.459 94.446 3.929 1.00 0.00 H ATOM 3234 HG1 THR A 221 13.508 92.405 3.384 1.00 0.00 H ATOM 3235 HG23 THR A 221 14.313 95.877 3.216 1.00 0.00 H ATOM 3236 HG21 THR A 221 15.466 94.564 3.559 1.00 0.00 H ATOM 3237 HG22 THR A 221 14.258 94.373 2.264 1.00 0.00 H ATOM 3238 H THR A 221 12.540 93.106 6.368 1.00 0.00 H ATOM 3239 N TYR A 222 14.286 97.144 5.667 1.00 26.75 N ATOM 3240 CA TYR A 222 14.105 98.609 5.659 1.00 27.00 C ATOM 3241 C TYR A 222 13.720 99.257 6.995 1.00 27.16 C ATOM 3242 O TYR A 222 13.694 100.478 7.088 1.00 27.17 O ATOM 3243 CB TYR A 222 13.116 99.041 4.566 1.00 26.76 C ATOM 3244 CG TYR A 222 13.492 98.545 3.192 1.00 26.72 C ATOM 3245 CD1 TYR A 222 12.562 97.906 2.377 1.00 26.39 C ATOM 3246 CD2 TYR A 222 14.789 98.699 2.712 1.00 26.66 C ATOM 3247 CE1 TYR A 222 12.916 97.447 1.112 1.00 26.46 C ATOM 3248 CE2 TYR A 222 15.148 98.245 1.458 1.00 26.58 C ATOM 3249 CZ TYR A 222 14.212 97.618 0.662 1.00 26.18 C ATOM 3250 OH TYR A 222 14.581 97.177 -0.581 1.00 25.83 O ATOM 3251 HA TYR A 222 15.106 98.983 5.445 1.00 0.00 H ATOM 3252 HB3 TYR A 222 13.079 100.130 4.543 1.00 0.00 H ATOM 3253 HB2 TYR A 222 12.130 98.651 4.817 1.00 0.00 H ATOM 3254 HD2 TYR A 222 15.536 99.187 3.338 1.00 0.00 H ATOM 3255 HE2 TYR A 222 16.168 98.382 1.098 1.00 0.00 H ATOM 3256 HE1 TYR A 222 12.176 96.956 0.480 1.00 0.00 H ATOM 3257 HD1 TYR A 222 11.542 97.763 2.735 1.00 0.00 H ATOM 3258 HH TYR A 222 15.313 96.516 -0.492 1.00 0.00 H ATOM 3259 H TYR A 222 15.258 96.775 5.656 1.00 0.00 H ATOM 3260 N ASP A 223 13.437 98.453 8.017 1.00 27.72 N ATOM 3261 CA ASP A 223 13.120 98.972 9.349 1.00 27.97 C ATOM 3262 C ASP A 223 14.408 99.374 10.075 1.00 28.23 C ATOM 3263 O ASP A 223 15.408 98.665 10.010 1.00 28.48 O ATOM 3264 CB ASP A 223 12.363 97.918 10.163 1.00 28.00 C ATOM 3265 CG ASP A 223 12.010 98.395 11.564 1.00 28.03 C ATOM 3266 OD1 ASP A 223 10.959 99.041 11.750 1.00 28.72 O ATOM 3267 OD2 ASP A 223 12.783 98.101 12.492 1.00 28.57 O ATOM 3268 HA ASP A 223 12.485 99.852 9.241 1.00 0.00 H ATOM 3269 HB2 ASP A 223 11.441 97.668 9.638 1.00 0.00 H ATOM 3270 HB3 ASP A 223 12.986 97.027 10.245 1.00 0.00 H ATOM 3271 H ASP A 223 13.441 97.424 7.865 1.00 0.00 H ATOM 3272 N ALA A 224 14.371 100.491 10.797 1.00 28.46 N ATOM 3273 CA ALA A 224 15.575 101.047 11.422 1.00 28.43 C ATOM 3274 C ALA A 224 16.246 100.104 12.422 1.00 28.66 C ATOM 3275 O ALA A 224 17.414 100.299 12.770 1.00 28.72 O ATOM 3276 CB ALA A 224 15.247 102.358 12.101 1.00 28.47 C ATOM 3277 HA ALA A 224 16.291 101.201 10.614 1.00 0.00 H ATOM 3278 HB1 ALA A 224 14.867 103.064 11.362 1.00 0.00 H ATOM 3279 HB2 ALA A 224 14.490 102.190 12.867 1.00 0.00 H ATOM 3280 HB3 ALA A 224 16.148 102.762 12.562 1.00 0.00 H ATOM 3281 H ALA A 224 13.463 100.983 10.921 1.00 0.00 H ATOM 3282 N HIS A 225 15.504 99.097 12.884 1.00 28.67 N ATOM 3283 CA HIS A 225 15.972 98.180 13.914 1.00 28.58 C ATOM 3284 C HIS A 225 16.154 96.751 13.414 1.00 28.21 C ATOM 3285 O HIS A 225 16.136 95.802 14.200 1.00 28.13 O ATOM 3286 CB HIS A 225 15.001 98.222 15.094 1.00 29.09 C ATOM 3287 CG HIS A 225 15.016 99.529 15.815 1.00 30.25 C ATOM 3288 ND1 HIS A 225 14.077 100.513 15.596 1.00 31.83 N ATOM 3289 CD2 HIS A 225 15.884 100.030 16.724 1.00 31.28 C ATOM 3290 CE1 HIS A 225 14.353 101.556 16.358 1.00 31.99 C ATOM 3291 NE2 HIS A 225 15.446 101.289 17.051 1.00 31.95 N ATOM 3292 HA HIS A 225 16.963 98.511 14.226 1.00 0.00 H ATOM 3293 HB2 HIS A 225 13.993 98.042 14.721 1.00 0.00 H ATOM 3294 HB3 HIS A 225 15.273 97.434 15.796 1.00 0.00 H ATOM 3295 HD2 HIS A 225 16.766 99.528 17.122 1.00 0.00 H ATOM 3296 HE1 HIS A 225 13.777 102.480 16.407 1.00 0.00 H ATOM 3297 H HIS A 225 14.550 98.961 12.492 1.00 0.00 H ATOM 3298 N ARG A 226 16.354 96.602 12.109 1.00 27.77 N ATOM 3299 CA ARG A 226 16.719 95.309 11.532 1.00 27.43 C ATOM 3300 C ARG A 226 18.094 94.870 12.056 1.00 26.68 C ATOM 3301 O ARG A 226 18.948 95.710 12.336 1.00 26.57 O ATOM 3302 CB ARG A 226 16.717 95.402 10.006 1.00 27.56 C ATOM 3303 CG ARG A 226 17.975 95.992 9.397 1.00 28.35 C ATOM 3304 CD ARG A 226 17.708 96.539 8.016 1.00 28.98 C ATOM 3305 NE ARG A 226 17.442 97.967 8.103 1.00 30.87 N ATOM 3306 CZ ARG A 226 18.191 98.932 7.576 1.00 31.41 C ATOM 3307 NH1 ARG A 226 19.271 98.674 6.854 1.00 31.62 N ATOM 3308 NH2 ARG A 226 17.836 100.187 7.760 1.00 31.72 N ATOM 3309 HA ARG A 226 15.986 94.559 11.830 1.00 0.00 H ATOM 3310 HB2 ARG A 226 16.587 94.396 9.606 1.00 0.00 H ATOM 3311 HB3 ARG A 226 15.873 96.023 9.706 1.00 0.00 H ATOM 3312 HG2 ARG A 226 18.335 96.799 10.036 1.00 0.00 H ATOM 3313 HG3 ARG A 226 18.737 95.215 9.331 1.00 0.00 H ATOM 3314 HD2 ARG A 226 16.843 96.034 7.586 1.00 0.00 H ATOM 3315 HD3 ARG A 226 18.579 96.369 7.383 1.00 0.00 H ATOM 3316 HE ARG A 226 16.590 98.259 8.624 1.00 0.00 H ATOM 3317 HH12 ARG A 226 19.831 99.456 6.459 1.00 0.00 H ATOM 3318 HH11 ARG A 226 19.559 97.689 6.683 1.00 0.00 H ATOM 3319 HH22 ARG A 226 18.410 100.954 7.355 1.00 0.00 H ATOM 3320 HH21 ARG A 226 16.982 100.411 8.310 1.00 0.00 H ATOM 3321 H ARG A 226 16.248 97.425 11.482 1.00 0.00 H ATOM 3322 N ASP A 227 18.307 93.564 12.201 1.00 25.81 N ATOM 3323 CA ASP A 227 19.568 93.069 12.760 1.00 25.17 C ATOM 3324 C ASP A 227 20.136 91.829 12.053 1.00 24.35 C ATOM 3325 O ASP A 227 20.868 91.053 12.668 1.00 24.20 O ATOM 3326 CB ASP A 227 19.397 92.794 14.257 1.00 25.12 C ATOM 3327 CG ASP A 227 18.542 91.571 14.540 1.00 25.77 C ATOM 3328 OD1 ASP A 227 17.542 91.340 13.821 1.00 27.52 O ATOM 3329 OD2 ASP A 227 18.870 90.839 15.491 1.00 26.42 O ATOM 3330 HA ASP A 227 20.301 93.859 12.595 1.00 0.00 H ATOM 3331 HB2 ASP A 227 20.382 92.639 14.697 1.00 0.00 H ATOM 3332 HB3 ASP A 227 18.926 93.662 14.719 1.00 0.00 H ATOM 3333 H ASP A 227 17.571 92.888 11.915 1.00 0.00 H ATOM 3334 N GLY A 228 19.824 91.663 10.768 1.00 23.39 N ATOM 3335 CA GLY A 228 20.286 90.502 9.995 1.00 22.76 C ATOM 3336 C GLY A 228 19.142 89.681 9.426 1.00 22.06 C ATOM 3337 O GLY A 228 17.983 89.843 9.827 1.00 21.71 O ATOM 3338 HA3 GLY A 228 20.882 89.864 10.647 1.00 0.00 H ATOM 3339 HA2 GLY A 228 20.905 90.856 9.170 1.00 0.00 H ATOM 3340 H GLY A 228 19.234 92.379 10.297 1.00 0.00 H ATOM 3341 N PHE A 229 19.458 88.795 8.484 1.00 21.34 N ATOM 3342 CA PHE A 229 18.406 88.062 7.776 1.00 20.79 C ATOM 3343 C PHE A 229 17.930 86.828 8.548 1.00 20.13 C ATOM 3344 O PHE A 229 18.615 86.339 9.447 1.00 20.13 O ATOM 3345 CB PHE A 229 18.810 87.743 6.321 1.00 20.63 C ATOM 3346 CG PHE A 229 19.795 86.608 6.161 1.00 20.55 C ATOM 3347 CD1 PHE A 229 19.355 85.289 6.108 1.00 20.41 C ATOM 3348 CD2 PHE A 229 21.151 86.863 5.985 1.00 20.37 C ATOM 3349 CE1 PHE A 229 20.254 84.238 5.931 1.00 20.37 C ATOM 3350 CE2 PHE A 229 22.063 85.811 5.808 1.00 20.46 C ATOM 3351 CZ PHE A 229 21.613 84.501 5.781 1.00 20.09 C ATOM 3352 HA PHE A 229 17.542 88.723 7.718 1.00 0.00 H ATOM 3353 HB2 PHE A 229 17.906 87.486 5.768 1.00 0.00 H ATOM 3354 HB3 PHE A 229 19.255 88.640 5.890 1.00 0.00 H ATOM 3355 HD2 PHE A 229 21.510 87.892 5.985 1.00 0.00 H ATOM 3356 HE2 PHE A 229 23.126 86.025 5.692 1.00 0.00 H ATOM 3357 HZ PHE A 229 22.318 83.681 5.643 1.00 0.00 H ATOM 3358 HE1 PHE A 229 19.893 83.210 5.910 1.00 0.00 H ATOM 3359 HD1 PHE A 229 18.291 85.074 6.206 1.00 0.00 H ATOM 3360 H PHE A 229 20.456 88.623 8.250 1.00 0.00 H ATOM 3361 N VAL A 230 16.725 86.375 8.216 1.00 19.52 N ATOM 3362 CA VAL A 230 16.163 85.137 8.756 1.00 19.07 C ATOM 3363 C VAL A 230 16.341 84.054 7.698 1.00 18.52 C ATOM 3364 O VAL A 230 15.910 84.222 6.557 1.00 18.41 O ATOM 3365 CB VAL A 230 14.659 85.307 9.123 1.00 18.95 C ATOM 3366 CG1 VAL A 230 14.016 83.970 9.507 1.00 18.83 C ATOM 3367 CG2 VAL A 230 14.505 86.311 10.261 1.00 18.78 C ATOM 3368 HA VAL A 230 16.680 84.865 9.676 1.00 0.00 H ATOM 3369 HB VAL A 230 14.142 85.682 8.240 1.00 0.00 H ATOM 3370 HG11 VAL A 230 14.089 83.279 8.668 1.00 0.00 H ATOM 3371 HG12 VAL A 230 14.536 83.553 10.370 1.00 0.00 H ATOM 3372 HG13 VAL A 230 12.967 84.131 9.756 1.00 0.00 H ATOM 3373 HG21 VAL A 230 15.048 85.953 11.136 1.00 0.00 H ATOM 3374 HG22 VAL A 230 14.908 87.275 9.951 1.00 0.00 H ATOM 3375 HG23 VAL A 230 13.449 86.420 10.507 1.00 0.00 H ATOM 3376 H VAL A 230 16.156 86.926 7.542 1.00 0.00 H ATOM 3377 N ILE A 231 16.987 82.954 8.069 1.00 17.97 N ATOM 3378 CA ILE A 231 17.315 81.918 7.104 1.00 17.81 C ATOM 3379 C ILE A 231 16.071 81.100 6.763 1.00 17.70 C ATOM 3380 O ILE A 231 15.241 80.823 7.628 1.00 17.62 O ATOM 3381 CB ILE A 231 18.489 81.012 7.588 1.00 17.68 C ATOM 3382 CG1 ILE A 231 19.047 80.193 6.413 1.00 17.74 C ATOM 3383 CG2 ILE A 231 18.062 80.115 8.756 1.00 17.54 C ATOM 3384 CD1 ILE A 231 20.431 79.612 6.664 1.00 17.66 C ATOM 3385 HA ILE A 231 17.663 82.407 6.194 1.00 0.00 H ATOM 3386 HB ILE A 231 19.287 81.653 7.962 1.00 0.00 H ATOM 3387 HG12 ILE A 231 18.361 79.370 6.212 1.00 0.00 H ATOM 3388 HG13 ILE A 231 19.101 80.841 5.538 1.00 0.00 H ATOM 3389 HD11 ILE A 231 21.135 80.422 6.855 1.00 0.00 H ATOM 3390 HD12 ILE A 231 20.394 78.950 7.529 1.00 0.00 H ATOM 3391 HD13 ILE A 231 20.752 79.049 5.787 1.00 0.00 H ATOM 3392 HG21 ILE A 231 17.739 80.737 9.591 1.00 0.00 H ATOM 3393 HG22 ILE A 231 17.239 79.474 8.439 1.00 0.00 H ATOM 3394 HG23 ILE A 231 18.906 79.498 9.066 1.00 0.00 H ATOM 3395 H ILE A 231 17.262 82.832 9.065 1.00 0.00 H ATOM 3396 N ALA A 232 15.942 80.735 5.492 1.00 17.58 N ATOM 3397 CA ALA A 232 14.802 79.949 5.030 1.00 17.51 C ATOM 3398 C ALA A 232 15.244 78.781 4.150 1.00 17.50 C ATOM 3399 O ALA A 232 16.415 78.662 3.777 1.00 17.50 O ATOM 3400 CB ALA A 232 13.819 80.836 4.286 1.00 17.32 C ATOM 3401 HA ALA A 232 14.307 79.530 5.906 1.00 0.00 H ATOM 3402 HB1 ALA A 232 13.464 81.622 4.953 1.00 0.00 H ATOM 3403 HB2 ALA A 232 14.316 81.285 3.426 1.00 0.00 H ATOM 3404 HB3 ALA A 232 12.974 80.236 3.948 1.00 0.00 H ATOM 3405 H ALA A 232 16.673 81.017 4.808 1.00 0.00 H ATOM 3406 N GLY A 233 14.286 77.916 3.844 1.00 17.34 N ATOM 3407 CA GLY A 233 14.487 76.802 2.938 1.00 17.16 C ATOM 3408 C GLY A 233 13.326 76.700 1.973 1.00 17.14 C ATOM 3409 O GLY A 233 12.303 77.359 2.148 1.00 17.41 O ATOM 3410 HA3 GLY A 233 14.561 75.879 3.512 1.00 0.00 H ATOM 3411 HA2 GLY A 233 15.409 76.955 2.378 1.00 0.00 H ATOM 3412 H GLY A 233 13.347 78.043 4.274 1.00 0.00 H ATOM 3413 N GLY A 234 13.484 75.871 0.950 1.00 16.84 N ATOM 3414 CA GLY A 234 12.410 75.627 -0.002 1.00 16.57 C ATOM 3415 C GLY A 234 12.920 75.476 -1.414 1.00 16.36 C ATOM 3416 O GLY A 234 14.124 75.316 -1.644 1.00 16.49 O ATOM 3417 HA3 GLY A 234 11.714 76.465 0.032 1.00 0.00 H ATOM 3418 HA2 GLY A 234 11.890 74.713 0.283 1.00 0.00 H ATOM 3419 H GLY A 234 14.395 75.385 0.825 1.00 0.00 H ATOM 3420 N GLY A 235 11.994 75.530 -2.361 1.00 15.93 N ATOM 3421 CA GLY A 235 12.328 75.385 -3.763 1.00 15.72 C ATOM 3422 C GLY A 235 11.458 76.223 -4.673 1.00 15.53 C ATOM 3423 O GLY A 235 10.464 76.816 -4.253 1.00 15.13 O ATOM 3424 HA3 GLY A 235 12.212 74.337 -4.040 1.00 0.00 H ATOM 3425 HA2 GLY A 235 13.367 75.684 -3.905 1.00 0.00 H ATOM 3426 H GLY A 235 11.001 75.680 -2.090 1.00 0.00 H ATOM 3427 N GLY A 236 11.864 76.276 -5.933 1.00 15.26 N ATOM 3428 CA GLY A 236 11.094 76.935 -6.968 1.00 15.31 C ATOM 3429 C GLY A 236 11.546 76.445 -8.327 1.00 15.25 C ATOM 3430 O GLY A 236 12.702 76.048 -8.499 1.00 15.23 O ATOM 3431 HA3 GLY A 236 11.245 78.013 -6.902 1.00 0.00 H ATOM 3432 HA2 GLY A 236 10.036 76.708 -6.834 1.00 0.00 H ATOM 3433 H GLY A 236 12.768 75.829 -6.188 1.00 0.00 H ATOM 3434 N MET A 237 10.634 76.467 -9.291 1.00 15.37 N ATOM 3435 CA MET A 237 10.943 76.028 -10.647 1.00 15.21 C ATOM 3436 C MET A 237 10.001 76.721 -11.600 1.00 14.88 C ATOM 3437 O MET A 237 8.791 76.758 -11.370 1.00 14.87 O ATOM 3438 CB MET A 237 10.786 74.506 -10.777 1.00 15.62 C ATOM 3439 CG MET A 237 11.539 73.880 -11.955 1.00 16.70 C ATOM 3440 SD MET A 237 13.356 73.835 -11.799 1.00 20.27 S ATOM 3441 CE MET A 237 13.580 73.120 -10.179 1.00 19.31 C ATOM 3442 HA MET A 237 11.977 76.282 -10.882 1.00 0.00 H ATOM 3443 HB2 MET A 237 11.152 74.048 -9.858 1.00 0.00 H ATOM 3444 HB3 MET A 237 9.726 74.283 -10.895 1.00 0.00 H ATOM 3445 HG2 MET A 237 11.294 74.450 -12.851 1.00 0.00 H ATOM 3446 HG3 MET A 237 11.187 72.855 -12.071 1.00 0.00 H ATOM 3447 HE1 MET A 237 13.105 73.757 -9.433 1.00 0.00 H ATOM 3448 HE2 MET A 237 13.126 72.129 -10.155 1.00 0.00 H ATOM 3449 HE3 MET A 237 14.645 73.039 -9.963 1.00 0.00 H ATOM 3450 H MET A 237 9.675 76.806 -9.074 1.00 0.00 H ATOM 3451 N VAL A 238 10.567 77.290 -12.655 1.00 14.47 N ATOM 3452 CA VAL A 238 9.778 77.867 -13.727 1.00 14.24 C ATOM 3453 C VAL A 238 10.104 77.140 -15.013 1.00 13.95 C ATOM 3454 O VAL A 238 11.197 76.577 -15.159 1.00 13.84 O ATOM 3455 CB VAL A 238 10.020 79.389 -13.902 1.00 14.09 C ATOM 3456 CG1 VAL A 238 9.522 80.130 -12.695 1.00 14.66 C ATOM 3457 CG2 VAL A 238 11.488 79.715 -14.156 1.00 14.19 C ATOM 3458 HA VAL A 238 8.725 77.749 -13.469 1.00 0.00 H ATOM 3459 HB VAL A 238 9.463 79.710 -14.782 1.00 0.00 H ATOM 3460 HG11 VAL A 238 8.454 79.948 -12.573 1.00 0.00 H ATOM 3461 HG12 VAL A 238 10.055 79.781 -11.810 1.00 0.00 H ATOM 3462 HG13 VAL A 238 9.697 81.198 -12.828 1.00 0.00 H ATOM 3463 HG21 VAL A 238 12.086 79.372 -13.312 1.00 0.00 H ATOM 3464 HG22 VAL A 238 11.818 79.213 -15.065 1.00 0.00 H ATOM 3465 HG23 VAL A 238 11.605 80.793 -14.272 1.00 0.00 H ATOM 3466 H VAL A 238 11.605 77.324 -12.716 1.00 0.00 H ATOM 3467 N VAL A 239 9.145 77.143 -15.935 1.00 13.53 N ATOM 3468 CA VAL A 239 9.354 76.577 -17.253 1.00 13.59 C ATOM 3469 C VAL A 239 9.690 77.733 -18.187 1.00 13.50 C ATOM 3470 O VAL A 239 8.834 78.554 -18.497 1.00 13.12 O ATOM 3471 CB VAL A 239 8.118 75.793 -17.761 1.00 13.20 C ATOM 3472 CG1 VAL A 239 8.435 75.076 -19.054 1.00 13.35 C ATOM 3473 CG2 VAL A 239 7.664 74.795 -16.731 1.00 12.93 C ATOM 3474 HA VAL A 239 10.167 75.852 -17.217 1.00 0.00 H ATOM 3475 HB VAL A 239 7.317 76.510 -17.940 1.00 0.00 H ATOM 3476 HG11 VAL A 239 8.726 75.805 -19.810 1.00 0.00 H ATOM 3477 HG12 VAL A 239 9.254 74.376 -18.888 1.00 0.00 H ATOM 3478 HG13 VAL A 239 7.553 74.532 -19.392 1.00 0.00 H ATOM 3479 HG21 VAL A 239 8.471 74.091 -16.529 1.00 0.00 H ATOM 3480 HG22 VAL A 239 7.398 75.318 -15.813 1.00 0.00 H ATOM 3481 HG23 VAL A 239 6.795 74.255 -17.108 1.00 0.00 H ATOM 3482 H VAL A 239 8.222 77.562 -15.704 1.00 0.00 H ATOM 3483 N VAL A 240 10.953 77.800 -18.604 1.00 13.77 N ATOM 3484 CA VAL A 240 11.397 78.792 -19.579 1.00 14.14 C ATOM 3485 C VAL A 240 11.261 78.167 -20.962 1.00 14.47 C ATOM 3486 O VAL A 240 11.731 77.042 -21.197 1.00 14.16 O ATOM 3487 CB VAL A 240 12.857 79.240 -19.356 1.00 13.92 C ATOM 3488 CG1 VAL A 240 13.165 80.465 -20.225 1.00 13.89 C ATOM 3489 CG2 VAL A 240 13.113 79.561 -17.892 1.00 13.83 C ATOM 3490 HA VAL A 240 10.780 79.684 -19.473 1.00 0.00 H ATOM 3491 HB VAL A 240 13.515 78.419 -19.643 1.00 0.00 H ATOM 3492 HG11 VAL A 240 13.023 80.209 -21.275 1.00 0.00 H ATOM 3493 HG12 VAL A 240 12.493 81.279 -19.954 1.00 0.00 H ATOM 3494 HG13 VAL A 240 14.197 80.775 -20.062 1.00 0.00 H ATOM 3495 HG21 VAL A 240 12.449 80.365 -17.576 1.00 0.00 H ATOM 3496 HG22 VAL A 240 12.924 78.673 -17.288 1.00 0.00 H ATOM 3497 HG23 VAL A 240 14.150 79.874 -17.766 1.00 0.00 H ATOM 3498 H VAL A 240 11.645 77.124 -18.223 1.00 0.00 H ATOM 3499 N GLU A 241 10.625 78.898 -21.874 1.00 14.96 N ATOM 3500 CA GLU A 241 10.214 78.332 -23.153 1.00 15.59 C ATOM 3501 C GLU A 241 10.375 79.311 -24.304 1.00 15.88 C ATOM 3502 O GLU A 241 10.135 80.502 -24.147 1.00 15.45 O ATOM 3503 CB GLU A 241 8.756 77.884 -23.049 1.00 15.65 C ATOM 3504 CG GLU A 241 8.224 77.193 -24.285 1.00 15.40 C ATOM 3505 CD GLU A 241 6.983 76.363 -24.009 1.00 16.03 C ATOM 3506 OE1 GLU A 241 6.470 75.743 -24.966 1.00 15.54 O ATOM 3507 OE2 GLU A 241 6.521 76.335 -22.843 1.00 15.97 O ATOM 3508 HA GLU A 241 10.863 77.483 -23.369 1.00 0.00 H ATOM 3509 HB2 GLU A 241 8.670 77.194 -22.209 1.00 0.00 H ATOM 3510 HB3 GLU A 241 8.142 78.764 -22.859 1.00 0.00 H ATOM 3511 HG2 GLU A 241 7.978 77.951 -25.029 1.00 0.00 H ATOM 3512 HG3 GLU A 241 9.001 76.538 -24.679 1.00 0.00 H ATOM 3513 H GLU A 241 10.416 79.896 -21.670 1.00 0.00 H ATOM 3514 N GLU A 242 10.786 78.805 -25.463 1.00 16.89 N ATOM 3515 CA GLU A 242 10.866 79.637 -26.657 1.00 17.41 C ATOM 3516 C GLU A 242 9.451 80.070 -27.071 1.00 17.98 C ATOM 3517 O GLU A 242 8.503 79.278 -27.010 1.00 17.70 O ATOM 3518 CB GLU A 242 11.575 78.896 -27.785 1.00 17.70 C ATOM 3519 CG GLU A 242 11.903 79.765 -28.992 1.00 18.06 C ATOM 3520 CD GLU A 242 10.813 79.748 -30.041 1.00 20.71 C ATOM 3521 OE1 GLU A 242 10.316 78.643 -30.360 1.00 22.97 O ATOM 3522 OE2 GLU A 242 10.456 80.834 -30.552 1.00 22.05 O ATOM 3523 HA GLU A 242 11.454 80.529 -26.438 1.00 0.00 H ATOM 3524 HB2 GLU A 242 12.507 78.488 -27.394 1.00 0.00 H ATOM 3525 HB3 GLU A 242 10.933 78.080 -28.115 1.00 0.00 H ATOM 3526 HG2 GLU A 242 12.045 80.791 -28.654 1.00 0.00 H ATOM 3527 HG3 GLU A 242 12.826 79.401 -29.443 1.00 0.00 H ATOM 3528 H GLU A 242 11.054 77.802 -25.518 1.00 0.00 H ATOM 3529 N LEU A 243 9.328 81.333 -27.477 1.00 18.55 N ATOM 3530 CA LEU A 243 8.030 81.990 -27.661 1.00 18.88 C ATOM 3531 C LEU A 243 7.128 81.301 -28.683 1.00 19.11 C ATOM 3532 O LEU A 243 5.968 81.021 -28.389 1.00 19.08 O ATOM 3533 CB LEU A 243 8.220 83.464 -28.060 1.00 18.82 C ATOM 3534 CG LEU A 243 6.947 84.233 -28.442 1.00 18.75 C ATOM 3535 CD1 LEU A 243 5.946 84.263 -27.281 1.00 18.46 C ATOM 3536 CD2 LEU A 243 7.280 85.643 -28.902 1.00 19.02 C ATOM 3537 HA LEU A 243 7.528 81.919 -26.696 1.00 0.00 H ATOM 3538 HB2 LEU A 243 8.680 83.980 -27.217 1.00 0.00 H ATOM 3539 HB3 LEU A 243 8.895 83.493 -28.915 1.00 0.00 H ATOM 3540 HG LEU A 243 6.480 83.705 -29.273 1.00 0.00 H ATOM 3541 HD21 LEU A 243 7.783 86.177 -28.096 1.00 0.00 H ATOM 3542 HD22 LEU A 243 7.935 85.595 -29.772 1.00 0.00 H ATOM 3543 HD23 LEU A 243 6.360 86.164 -29.166 1.00 0.00 H ATOM 3544 HD11 LEU A 243 5.669 83.243 -27.015 1.00 0.00 H ATOM 3545 HD12 LEU A 243 6.403 84.753 -26.421 1.00 0.00 H ATOM 3546 HD13 LEU A 243 5.056 84.815 -27.584 1.00 0.00 H ATOM 3547 H LEU A 243 10.192 81.878 -27.672 1.00 0.00 H ATOM 3548 N GLU A 244 7.655 81.057 -29.880 1.00 19.54 N ATOM 3549 CA GLU A 244 6.873 80.428 -30.949 1.00 19.98 C ATOM 3550 C GLU A 244 6.431 79.017 -30.568 1.00 19.84 C ATOM 3551 O GLU A 244 5.311 78.608 -30.873 1.00 20.12 O ATOM 3552 CB GLU A 244 7.664 80.385 -32.265 1.00 20.62 C ATOM 3553 CG GLU A 244 7.977 81.758 -32.862 1.00 22.96 C ATOM 3554 CD GLU A 244 6.737 82.613 -33.067 1.00 26.45 C ATOM 3555 OE1 GLU A 244 5.758 82.101 -33.654 1.00 28.57 O ATOM 3556 OE2 GLU A 244 6.742 83.795 -32.638 1.00 28.52 O ATOM 3557 HA GLU A 244 5.983 81.041 -31.092 1.00 0.00 H ATOM 3558 HB2 GLU A 244 8.607 79.871 -32.079 1.00 0.00 H ATOM 3559 HB3 GLU A 244 7.082 79.821 -32.994 1.00 0.00 H ATOM 3560 HG2 GLU A 244 8.654 82.284 -32.189 1.00 0.00 H ATOM 3561 HG3 GLU A 244 8.464 81.615 -33.827 1.00 0.00 H ATOM 3562 H GLU A 244 8.645 81.319 -30.062 1.00 0.00 H ATOM 3563 N HIS A 245 7.319 78.283 -29.906 1.00 19.42 N ATOM 3564 CA HIS A 245 7.004 76.962 -29.395 1.00 19.30 C ATOM 3565 C HIS A 245 5.828 77.020 -28.410 1.00 19.23 C ATOM 3566 O HIS A 245 4.930 76.171 -28.451 1.00 18.79 O ATOM 3567 CB HIS A 245 8.239 76.353 -28.725 1.00 19.24 C ATOM 3568 CG HIS A 245 8.070 74.915 -28.351 1.00 19.29 C ATOM 3569 ND1 HIS A 245 7.518 74.520 -27.150 1.00 18.62 N ATOM 3570 CD2 HIS A 245 8.363 73.778 -29.025 1.00 18.30 C ATOM 3571 CE1 HIS A 245 7.480 73.200 -27.100 1.00 18.12 C ATOM 3572 NE2 HIS A 245 7.986 72.726 -28.225 1.00 18.31 N ATOM 3573 HA HIS A 245 6.708 76.329 -30.231 1.00 0.00 H ATOM 3574 HB2 HIS A 245 9.080 76.434 -29.414 1.00 0.00 H ATOM 3575 HB3 HIS A 245 8.456 76.921 -27.821 1.00 0.00 H ATOM 3576 HD2 HIS A 245 8.813 73.710 -30.015 1.00 0.00 H ATOM 3577 HE1 HIS A 245 7.097 72.604 -26.272 1.00 0.00 H ATOM 3578 H HIS A 245 8.272 78.668 -29.749 1.00 0.00 H ATOM 3579 N ALA A 246 5.836 78.031 -27.536 1.00 19.09 N ATOM 3580 CA ALA A 246 4.764 78.219 -26.550 1.00 19.09 C ATOM 3581 C ALA A 246 3.416 78.539 -27.205 1.00 18.98 C ATOM 3582 O ALA A 246 2.393 77.962 -26.848 1.00 18.68 O ATOM 3583 CB ALA A 246 5.136 79.320 -25.561 1.00 19.05 C ATOM 3584 HA ALA A 246 4.653 77.274 -26.019 1.00 0.00 H ATOM 3585 HB1 ALA A 246 6.053 79.044 -25.040 1.00 0.00 H ATOM 3586 HB2 ALA A 246 5.290 80.254 -26.101 1.00 0.00 H ATOM 3587 HB3 ALA A 246 4.330 79.445 -24.838 1.00 0.00 H ATOM 3588 H ALA A 246 6.627 78.706 -27.555 1.00 0.00 H ATOM 3589 N LEU A 247 3.424 79.464 -28.158 1.00 18.99 N ATOM 3590 CA LEU A 247 2.196 79.868 -28.846 1.00 18.94 C ATOM 3591 C LEU A 247 1.619 78.718 -29.681 1.00 18.83 C ATOM 3592 O LEU A 247 0.411 78.475 -29.665 1.00 18.83 O ATOM 3593 CB LEU A 247 2.456 81.092 -29.731 1.00 19.07 C ATOM 3594 CG LEU A 247 2.898 82.373 -29.008 1.00 19.31 C ATOM 3595 CD1 LEU A 247 3.384 83.411 -30.004 1.00 19.70 C ATOM 3596 CD2 LEU A 247 1.771 82.946 -28.164 1.00 19.45 C ATOM 3597 HA LEU A 247 1.460 80.132 -28.087 1.00 0.00 H ATOM 3598 HB2 LEU A 247 3.236 80.827 -30.444 1.00 0.00 H ATOM 3599 HB3 LEU A 247 1.535 81.315 -30.269 1.00 0.00 H ATOM 3600 HG LEU A 247 3.722 82.110 -28.344 1.00 0.00 H ATOM 3601 HD21 LEU A 247 0.923 83.184 -28.806 1.00 0.00 H ATOM 3602 HD22 LEU A 247 1.469 82.212 -27.417 1.00 0.00 H ATOM 3603 HD23 LEU A 247 2.116 83.852 -27.666 1.00 0.00 H ATOM 3604 HD11 LEU A 247 4.231 83.010 -30.561 1.00 0.00 H ATOM 3605 HD12 LEU A 247 2.577 83.656 -30.694 1.00 0.00 H ATOM 3606 HD13 LEU A 247 3.692 84.310 -29.469 1.00 0.00 H ATOM 3607 H LEU A 247 4.324 79.912 -28.422 1.00 0.00 H ATOM 3608 N ALA A 248 2.492 78.002 -30.385 1.00 18.46 N ATOM 3609 CA ALA A 248 2.079 76.895 -31.240 1.00 18.27 C ATOM 3610 C ALA A 248 1.344 75.789 -30.479 1.00 18.26 C ATOM 3611 O ALA A 248 0.512 75.092 -31.057 1.00 18.67 O ATOM 3612 CB ALA A 248 3.286 76.320 -31.969 1.00 18.10 C ATOM 3613 HA ALA A 248 1.369 77.302 -31.961 1.00 0.00 H ATOM 3614 HB1 ALA A 248 3.742 77.097 -32.583 1.00 0.00 H ATOM 3615 HB2 ALA A 248 4.011 75.959 -31.240 1.00 0.00 H ATOM 3616 HB3 ALA A 248 2.966 75.494 -32.604 1.00 0.00 H ATOM 3617 H ALA A 248 3.503 78.240 -30.324 1.00 0.00 H ATOM 3618 N ARG A 249 1.649 75.622 -29.193 1.00 18.06 N ATOM 3619 CA ARG A 249 0.953 74.637 -28.360 1.00 17.79 C ATOM 3620 C ARG A 249 -0.133 75.245 -27.480 1.00 17.39 C ATOM 3621 O ARG A 249 -0.681 74.563 -26.626 1.00 17.51 O ATOM 3622 CB ARG A 249 1.952 73.852 -27.495 1.00 17.90 C ATOM 3623 CG ARG A 249 2.511 74.579 -26.275 1.00 17.62 C ATOM 3624 CD ARG A 249 3.512 73.665 -25.592 1.00 18.12 C ATOM 3625 NE ARG A 249 4.088 74.213 -24.366 1.00 18.02 N ATOM 3626 CZ ARG A 249 3.499 74.205 -23.172 1.00 18.83 C ATOM 3627 NH1 ARG A 249 2.285 73.699 -23.014 1.00 18.57 N ATOM 3628 NH2 ARG A 249 4.132 74.725 -22.123 1.00 19.51 N ATOM 3629 HA ARG A 249 0.454 73.959 -29.052 1.00 0.00 H ATOM 3630 HB2 ARG A 249 1.450 72.951 -27.143 1.00 0.00 H ATOM 3631 HB3 ARG A 249 2.793 73.573 -28.130 1.00 0.00 H ATOM 3632 HG2 ARG A 249 3.005 75.499 -26.588 1.00 0.00 H ATOM 3633 HG3 ARG A 249 1.701 74.820 -25.586 1.00 0.00 H ATOM 3634 HD2 ARG A 249 4.324 73.465 -26.291 1.00 0.00 H ATOM 3635 HD3 ARG A 249 3.008 72.731 -25.345 1.00 0.00 H ATOM 3636 HE ARG A 249 5.033 74.643 -24.431 1.00 0.00 H ATOM 3637 HH12 ARG A 249 1.839 73.701 -22.074 1.00 0.00 H ATOM 3638 HH11 ARG A 249 1.778 73.300 -23.830 1.00 0.00 H ATOM 3639 HH22 ARG A 249 3.678 74.722 -21.188 1.00 0.00 H ATOM 3640 HH21 ARG A 249 5.081 75.134 -22.239 1.00 0.00 H ATOM 3641 H ARG A 249 2.399 76.205 -28.770 1.00 0.00 H ATOM 3642 N GLY A 250 -0.445 76.520 -27.683 1.00 17.19 N ATOM 3643 CA GLY A 250 -1.471 77.189 -26.893 1.00 17.28 C ATOM 3644 C GLY A 250 -1.155 77.265 -25.409 1.00 17.26 C ATOM 3645 O GLY A 250 -2.060 77.224 -24.573 1.00 17.03 O ATOM 3646 HA3 GLY A 250 -2.408 76.646 -27.017 1.00 0.00 H ATOM 3647 HA2 GLY A 250 -1.588 78.204 -27.272 1.00 0.00 H ATOM 3648 H GLY A 250 0.054 77.053 -28.423 1.00 0.00 H ATOM 3649 N ALA A 251 0.131 77.390 -25.083 1.00 17.32 N ATOM 3650 CA ALA A 251 0.571 77.480 -23.699 1.00 17.45 C ATOM 3651 C ALA A 251 0.019 78.731 -23.039 1.00 17.64 C ATOM 3652 O ALA A 251 -0.222 79.735 -23.707 1.00 17.71 O ATOM 3653 CB ALA A 251 2.083 77.499 -23.639 1.00 17.46 C ATOM 3654 HA ALA A 251 0.196 76.608 -23.162 1.00 0.00 H ATOM 3655 HB1 ALA A 251 2.474 76.583 -24.082 1.00 0.00 H ATOM 3656 HB2 ALA A 251 2.457 78.361 -24.192 1.00 0.00 H ATOM 3657 HB3 ALA A 251 2.403 77.567 -22.599 1.00 0.00 H ATOM 3658 H ALA A 251 0.842 77.424 -25.841 1.00 0.00 H ATOM 3659 N HIS A 252 -0.198 78.658 -21.728 1.00 17.89 N ATOM 3660 CA HIS A 252 -0.481 79.847 -20.930 1.00 17.96 C ATOM 3661 C HIS A 252 0.840 80.542 -20.619 1.00 18.00 C ATOM 3662 O HIS A 252 1.751 79.922 -20.082 1.00 18.05 O ATOM 3663 CB HIS A 252 -1.203 79.486 -19.633 1.00 17.97 C ATOM 3664 CG HIS A 252 -1.291 80.619 -18.662 1.00 18.26 C ATOM 3665 ND1 HIS A 252 -0.603 80.628 -17.468 1.00 18.54 N ATOM 3666 CD2 HIS A 252 -1.973 81.792 -18.713 1.00 19.34 C ATOM 3667 CE1 HIS A 252 -0.862 81.752 -16.822 1.00 18.93 C ATOM 3668 NE2 HIS A 252 -1.689 82.477 -17.555 1.00 18.91 N ATOM 3669 HA HIS A 252 -1.136 80.510 -21.494 1.00 0.00 H ATOM 3670 HB2 HIS A 252 -2.215 79.164 -19.880 1.00 0.00 H ATOM 3671 HB3 HIS A 252 -0.667 78.665 -19.157 1.00 0.00 H ATOM 3672 HD2 HIS A 252 -2.624 82.128 -19.520 1.00 0.00 H ATOM 3673 HE1 HIS A 252 -0.461 82.034 -15.848 1.00 0.00 H ATOM 3674 H HIS A 252 -0.165 77.730 -21.260 1.00 0.00 H ATOM 3675 N ILE A 253 0.932 81.824 -20.961 1.00 18.06 N ATOM 3676 CA ILE A 253 2.160 82.603 -20.801 1.00 18.28 C ATOM 3677 C ILE A 253 1.987 83.650 -19.699 1.00 18.48 C ATOM 3678 O ILE A 253 1.202 84.596 -19.843 1.00 18.26 O ATOM 3679 CB ILE A 253 2.569 83.296 -22.131 1.00 18.20 C ATOM 3680 CG1 ILE A 253 2.895 82.246 -23.201 1.00 18.43 C ATOM 3681 CG2 ILE A 253 3.778 84.206 -21.924 1.00 17.99 C ATOM 3682 CD1 ILE A 253 2.930 82.781 -24.637 1.00 18.09 C ATOM 3683 HA ILE A 253 2.955 81.913 -20.519 1.00 0.00 H ATOM 3684 HB ILE A 253 1.727 83.903 -22.465 1.00 0.00 H ATOM 3685 HG12 ILE A 253 3.873 81.821 -22.973 1.00 0.00 H ATOM 3686 HG13 ILE A 253 2.139 81.462 -23.149 1.00 0.00 H ATOM 3687 HD11 ILE A 253 1.956 83.198 -24.892 1.00 0.00 H ATOM 3688 HD12 ILE A 253 3.691 83.557 -24.716 1.00 0.00 H ATOM 3689 HD13 ILE A 253 3.168 81.966 -25.321 1.00 0.00 H ATOM 3690 HG21 ILE A 253 3.532 84.974 -21.190 1.00 0.00 H ATOM 3691 HG22 ILE A 253 4.619 83.614 -21.564 1.00 0.00 H ATOM 3692 HG23 ILE A 253 4.042 84.678 -22.870 1.00 0.00 H ATOM 3693 H ILE A 253 0.094 82.293 -21.360 1.00 0.00 H ATOM 3694 N TYR A 254 2.723 83.468 -18.600 1.00 18.71 N ATOM 3695 CA TYR A 254 2.729 84.427 -17.493 1.00 18.80 C ATOM 3696 C TYR A 254 3.395 85.732 -17.914 1.00 19.08 C ATOM 3697 O TYR A 254 2.877 86.823 -17.660 1.00 19.55 O ATOM 3698 CB TYR A 254 3.486 83.863 -16.289 1.00 18.72 C ATOM 3699 CG TYR A 254 2.790 82.729 -15.573 1.00 18.71 C ATOM 3700 CD1 TYR A 254 1.952 82.980 -14.491 1.00 18.71 C ATOM 3701 CD2 TYR A 254 2.983 81.404 -15.959 1.00 18.39 C ATOM 3702 CE1 TYR A 254 1.313 81.946 -13.815 1.00 18.41 C ATOM 3703 CE2 TYR A 254 2.336 80.355 -15.290 1.00 18.59 C ATOM 3704 CZ TYR A 254 1.509 80.639 -14.216 1.00 18.56 C ATOM 3705 OH TYR A 254 0.870 79.629 -13.537 1.00 18.69 O ATOM 3706 HA TYR A 254 1.691 84.614 -17.219 1.00 0.00 H ATOM 3707 HB3 TYR A 254 3.637 84.672 -15.575 1.00 0.00 H ATOM 3708 HB2 TYR A 254 4.454 83.501 -16.637 1.00 0.00 H ATOM 3709 HD2 TYR A 254 3.647 81.180 -16.794 1.00 0.00 H ATOM 3710 HE2 TYR A 254 2.483 79.324 -15.613 1.00 0.00 H ATOM 3711 HE1 TYR A 254 0.659 82.167 -12.971 1.00 0.00 H ATOM 3712 HD1 TYR A 254 1.793 84.008 -14.166 1.00 0.00 H ATOM 3713 HH TYR A 254 1.543 79.011 -13.157 1.00 0.00 H ATOM 3714 H TYR A 254 3.313 82.615 -18.527 1.00 0.00 H ATOM 3715 N ALA A 255 4.559 85.612 -18.542 1.00 19.18 N ATOM 3716 CA ALA A 255 5.344 86.777 -18.930 1.00 19.17 C ATOM 3717 C ALA A 255 6.503 86.391 -19.837 1.00 19.15 C ATOM 3718 O ALA A 255 6.859 85.223 -19.956 1.00 19.03 O ATOM 3719 CB ALA A 255 5.884 87.490 -17.691 1.00 19.12 C ATOM 3720 HA ALA A 255 4.684 87.448 -19.480 1.00 0.00 H ATOM 3721 HB1 ALA A 255 5.051 87.814 -17.067 1.00 0.00 H ATOM 3722 HB2 ALA A 255 6.517 86.806 -17.127 1.00 0.00 H ATOM 3723 HB3 ALA A 255 6.468 88.358 -17.998 1.00 0.00 H ATOM 3724 H ALA A 255 4.920 84.662 -18.763 1.00 0.00 H ATOM 3725 N GLU A 256 7.077 87.408 -20.465 1.00 19.23 N ATOM 3726 CA GLU A 256 8.307 87.282 -21.224 1.00 19.27 C ATOM 3727 C GLU A 256 9.469 87.765 -20.365 1.00 19.20 C ATOM 3728 O GLU A 256 9.342 88.758 -19.641 1.00 18.94 O ATOM 3729 CB GLU A 256 8.237 88.136 -22.486 1.00 19.22 C ATOM 3730 CG GLU A 256 9.539 88.145 -23.273 1.00 19.51 C ATOM 3731 CD GLU A 256 9.458 88.966 -24.527 1.00 19.83 C ATOM 3732 OE1 GLU A 256 8.404 89.587 -24.761 1.00 20.80 O ATOM 3733 OE2 GLU A 256 10.458 88.999 -25.272 1.00 20.56 O ATOM 3734 HA GLU A 256 8.449 86.238 -21.505 1.00 0.00 H ATOM 3735 HB2 GLU A 256 7.447 87.745 -23.127 1.00 0.00 H ATOM 3736 HB3 GLU A 256 7.997 89.160 -22.200 1.00 0.00 H ATOM 3737 HG2 GLU A 256 10.326 88.554 -22.639 1.00 0.00 H ATOM 3738 HG3 GLU A 256 9.789 87.119 -23.544 1.00 0.00 H ATOM 3739 H GLU A 256 6.623 88.342 -20.411 1.00 0.00 H ATOM 3740 N ILE A 257 10.600 87.067 -20.455 1.00 19.16 N ATOM 3741 CA ILE A 257 11.823 87.526 -19.809 1.00 19.08 C ATOM 3742 C ILE A 257 12.481 88.463 -20.802 1.00 18.79 C ATOM 3743 O ILE A 257 13.100 88.018 -21.767 1.00 18.51 O ATOM 3744 CB ILE A 257 12.759 86.372 -19.417 1.00 19.20 C ATOM 3745 CG1 ILE A 257 11.962 85.316 -18.640 1.00 19.75 C ATOM 3746 CG2 ILE A 257 13.953 86.914 -18.599 1.00 19.29 C ATOM 3747 CD1 ILE A 257 12.787 84.232 -17.972 1.00 20.15 C ATOM 3748 HA ILE A 257 11.595 88.026 -18.867 1.00 0.00 H ATOM 3749 HB ILE A 257 13.166 85.899 -20.310 1.00 0.00 H ATOM 3750 HG12 ILE A 257 11.392 85.829 -17.866 1.00 0.00 H ATOM 3751 HG13 ILE A 257 11.276 84.834 -19.336 1.00 0.00 H ATOM 3752 HD11 ILE A 257 13.356 83.692 -18.729 1.00 0.00 H ATOM 3753 HD12 ILE A 257 13.472 84.687 -17.257 1.00 0.00 H ATOM 3754 HD13 ILE A 257 12.124 83.541 -17.452 1.00 0.00 H ATOM 3755 HG21 ILE A 257 14.506 87.636 -19.200 1.00 0.00 H ATOM 3756 HG22 ILE A 257 13.583 87.399 -17.696 1.00 0.00 H ATOM 3757 HG23 ILE A 257 14.610 86.088 -18.326 1.00 0.00 H ATOM 3758 H ILE A 257 10.610 86.179 -20.996 1.00 0.00 H ATOM 3759 N VAL A 258 12.301 89.765 -20.579 1.00 18.53 N ATOM 3760 CA VAL A 258 12.804 90.792 -21.505 1.00 18.41 C ATOM 3761 C VAL A 258 14.153 91.375 -21.088 1.00 18.04 C ATOM 3762 O VAL A 258 14.792 92.071 -21.871 1.00 18.08 O ATOM 3763 CB VAL A 258 11.780 91.943 -21.722 1.00 18.28 C ATOM 3764 CG1 VAL A 258 10.522 91.396 -22.357 1.00 18.59 C ATOM 3765 CG2 VAL A 258 11.455 92.671 -20.420 1.00 18.81 C ATOM 3766 HA VAL A 258 12.949 90.268 -22.450 1.00 0.00 H ATOM 3767 HB VAL A 258 12.233 92.674 -22.392 1.00 0.00 H ATOM 3768 HG11 VAL A 258 10.768 90.946 -23.319 1.00 0.00 H ATOM 3769 HG12 VAL A 258 10.084 90.642 -21.703 1.00 0.00 H ATOM 3770 HG13 VAL A 258 9.809 92.207 -22.506 1.00 0.00 H ATOM 3771 HG21 VAL A 258 11.029 91.965 -19.707 1.00 0.00 H ATOM 3772 HG22 VAL A 258 12.368 93.100 -20.007 1.00 0.00 H ATOM 3773 HG23 VAL A 258 10.737 93.466 -20.619 1.00 0.00 H ATOM 3774 H VAL A 258 11.789 90.064 -19.724 1.00 0.00 H ATOM 3775 N GLY A 259 14.584 91.085 -19.864 1.00 17.89 N ATOM 3776 CA GLY A 259 15.868 91.566 -19.364 1.00 17.62 C ATOM 3777 C GLY A 259 16.536 90.609 -18.397 1.00 17.34 C ATOM 3778 O GLY A 259 15.893 90.080 -17.490 1.00 16.80 O ATOM 3779 HA3 GLY A 259 15.706 92.516 -18.854 1.00 0.00 H ATOM 3780 HA2 GLY A 259 16.534 91.720 -20.213 1.00 0.00 H ATOM 3781 H GLY A 259 13.989 90.498 -19.245 1.00 0.00 H ATOM 3782 N TYR A 260 17.833 90.380 -18.605 1.00 17.11 N ATOM 3783 CA TYR A 260 18.643 89.587 -17.680 1.00 16.88 C ATOM 3784 C TYR A 260 19.972 90.300 -17.427 1.00 16.73 C ATOM 3785 O TYR A 260 20.728 90.578 -18.353 1.00 16.60 O ATOM 3786 CB TYR A 260 18.853 88.175 -18.232 1.00 16.68 C ATOM 3787 CG TYR A 260 19.930 87.359 -17.541 1.00 16.82 C ATOM 3788 CD1 TYR A 260 20.038 87.318 -16.140 1.00 16.44 C ATOM 3789 CD2 TYR A 260 20.831 86.600 -18.290 1.00 16.83 C ATOM 3790 CE1 TYR A 260 21.032 86.560 -15.517 1.00 15.90 C ATOM 3791 CE2 TYR A 260 21.818 85.840 -17.674 1.00 16.30 C ATOM 3792 CZ TYR A 260 21.915 85.823 -16.298 1.00 16.11 C ATOM 3793 OH TYR A 260 22.894 85.057 -15.722 1.00 15.84 O ATOM 3794 HA TYR A 260 18.122 89.488 -16.728 1.00 0.00 H ATOM 3795 HB3 TYR A 260 19.120 88.262 -19.285 1.00 0.00 H ATOM 3796 HB2 TYR A 260 17.911 87.635 -18.141 1.00 0.00 H ATOM 3797 HD2 TYR A 260 20.759 86.604 -19.378 1.00 0.00 H ATOM 3798 HE2 TYR A 260 22.515 85.258 -18.277 1.00 0.00 H ATOM 3799 HE1 TYR A 260 21.115 86.546 -14.430 1.00 0.00 H ATOM 3800 HD1 TYR A 260 19.335 87.886 -15.531 1.00 0.00 H ATOM 3801 HH TYR A 260 23.781 85.367 -16.035 1.00 0.00 H ATOM 3802 H TYR A 260 18.284 90.778 -19.453 1.00 0.00 H ATOM 3803 N GLY A 261 20.230 90.622 -16.168 1.00 16.53 N ATOM 3804 CA GLY A 261 21.480 91.259 -15.779 1.00 16.59 C ATOM 3805 C GLY A 261 22.315 90.267 -14.998 1.00 16.48 C ATOM 3806 O GLY A 261 21.793 89.530 -14.165 1.00 16.20 O ATOM 3807 HA3 GLY A 261 21.269 92.129 -15.158 1.00 0.00 H ATOM 3808 HA2 GLY A 261 22.023 91.573 -16.670 1.00 0.00 H ATOM 3809 H GLY A 261 19.520 90.414 -15.437 1.00 0.00 H ATOM 3810 N ALA A 262 23.609 90.230 -15.286 1.00 16.49 N ATOM 3811 CA ALA A 262 24.546 89.409 -14.526 1.00 16.55 C ATOM 3812 C ALA A 262 25.882 90.128 -14.487 1.00 16.42 C ATOM 3813 O ALA A 262 26.521 90.295 -15.521 1.00 16.29 O ATOM 3814 CB ALA A 262 24.692 88.039 -15.150 1.00 16.46 C ATOM 3815 HA ALA A 262 24.172 89.263 -13.513 1.00 0.00 H ATOM 3816 HB1 ALA A 262 23.722 87.542 -15.164 1.00 0.00 H ATOM 3817 HB2 ALA A 262 25.063 88.143 -16.169 1.00 0.00 H ATOM 3818 HB3 ALA A 262 25.396 87.447 -14.564 1.00 0.00 H ATOM 3819 H ALA A 262 23.967 90.803 -16.077 1.00 0.00 H ATOM 3820 N THR A 263 26.275 90.574 -13.295 1.00 16.56 N ATOM 3821 CA THR A 263 27.515 91.328 -13.103 1.00 16.78 C ATOM 3822 C THR A 263 28.227 90.903 -11.814 1.00 17.06 C ATOM 3823 O THR A 263 27.736 90.056 -11.068 1.00 16.67 O ATOM 3824 CB THR A 263 27.266 92.864 -13.040 1.00 16.59 C ATOM 3825 OG1 THR A 263 26.646 93.201 -11.793 1.00 16.01 O ATOM 3826 CG2 THR A 263 26.403 93.343 -14.208 1.00 15.69 C ATOM 3827 HA THR A 263 28.140 91.105 -13.968 1.00 0.00 H ATOM 3828 HB THR A 263 28.230 93.368 -13.116 1.00 0.00 H ATOM 3829 HG1 THR A 263 26.489 94.178 -11.757 1.00 0.00 H ATOM 3830 HG23 THR A 263 26.888 93.079 -15.148 1.00 0.00 H ATOM 3831 HG21 THR A 263 25.425 92.865 -14.155 1.00 0.00 H ATOM 3832 HG22 THR A 263 26.284 94.425 -14.150 1.00 0.00 H ATOM 3833 H THR A 263 25.677 90.379 -12.467 1.00 0.00 H ATOM 3834 N SER A 264 29.384 91.520 -11.577 1.00 17.59 N ATOM 3835 CA SER A 264 30.262 91.206 -10.460 1.00 18.31 C ATOM 3836 C SER A 264 30.768 92.512 -9.827 1.00 18.76 C ATOM 3837 O SER A 264 31.085 93.461 -10.536 1.00 18.48 O ATOM 3838 CB SER A 264 31.437 90.386 -10.983 1.00 18.19 C ATOM 3839 OG SER A 264 32.276 89.931 -9.941 1.00 18.70 O ATOM 3840 HA SER A 264 29.725 90.634 -9.703 1.00 0.00 H ATOM 3841 HB2 SER A 264 32.024 91.006 -11.661 1.00 0.00 H ATOM 3842 HB3 SER A 264 31.050 89.523 -11.525 1.00 0.00 H ATOM 3843 HG SER A 264 32.639 90.709 -9.447 1.00 0.00 H ATOM 3844 H SER A 264 29.678 92.273 -12.231 1.00 0.00 H ATOM 3845 N ASP A 265 30.827 92.569 -8.500 1.00 19.81 N ATOM 3846 CA ASP A 265 31.347 93.760 -7.815 1.00 20.83 C ATOM 3847 C ASP A 265 32.866 93.879 -7.987 1.00 21.58 C ATOM 3848 O ASP A 265 33.376 94.953 -8.301 1.00 21.42 O ATOM 3849 CB ASP A 265 31.028 93.731 -6.318 1.00 20.66 C ATOM 3850 CG ASP A 265 29.551 93.891 -6.016 1.00 21.64 C ATOM 3851 OD1 ASP A 265 28.734 94.048 -6.958 1.00 21.37 O ATOM 3852 OD2 ASP A 265 29.215 93.860 -4.807 1.00 21.92 O ATOM 3853 HA ASP A 265 30.857 94.620 -8.272 1.00 0.00 H ATOM 3854 HB2 ASP A 265 31.363 92.777 -5.911 1.00 0.00 H ATOM 3855 HB3 ASP A 265 31.570 94.542 -5.833 1.00 0.00 H ATOM 3856 H ASP A 265 30.500 91.757 -7.938 1.00 0.00 H ATOM 3857 N GLY A 266 33.581 92.777 -7.766 1.00 22.67 N ATOM 3858 CA GLY A 266 35.046 92.800 -7.777 1.00 23.78 C ATOM 3859 C GLY A 266 35.605 93.738 -6.714 1.00 24.72 C ATOM 3860 O GLY A 266 36.493 94.544 -6.990 1.00 24.43 O ATOM 3861 HA3 GLY A 266 35.387 93.134 -8.757 1.00 0.00 H ATOM 3862 HA2 GLY A 266 35.416 91.792 -7.589 1.00 0.00 H ATOM 3863 H GLY A 266 33.088 91.880 -7.581 1.00 0.00 H ATOM 3864 N ALA A 267 35.064 93.621 -5.500 1.00 26.07 N ATOM 3865 CA ALA A 267 35.373 94.506 -4.370 1.00 27.30 C ATOM 3866 C ALA A 267 35.751 93.753 -3.102 1.00 28.38 C ATOM 3867 O ALA A 267 36.940 93.621 -2.716 1.00 28.73 O ATOM 3868 CB ALA A 267 34.111 95.316 -4.026 1.00 27.45 C ATOM 3869 HA ALA A 267 36.217 95.122 -4.680 1.00 0.00 H ATOM 3870 HB1 ALA A 267 33.813 95.907 -4.892 1.00 0.00 H ATOM 3871 HB2 ALA A 267 33.305 94.634 -3.756 1.00 0.00 H ATOM 3872 HB3 ALA A 267 34.324 95.979 -3.188 1.00 0.00 H ATOM 3873 H ALA A 267 34.380 92.854 -5.344 1.00 0.00 H ATOM 3874 N ASP A 268 34.664 93.380 -2.409 1.00 29.57 N ATOM 3875 CA ASP A 268 34.589 92.818 -1.065 1.00 30.52 C ATOM 3876 C ASP A 268 33.832 91.492 -1.114 1.00 31.16 C ATOM 3877 O ASP A 268 32.996 91.281 -1.991 1.00 31.49 O ATOM 3878 CB ASP A 268 33.799 93.773 -0.164 1.00 30.99 C ATOM 3879 CG ASP A 268 34.691 94.713 0.617 1.00 32.73 C ATOM 3880 OD1 ASP A 268 35.429 94.228 1.511 1.00 33.73 O ATOM 3881 OD2 ASP A 268 34.640 95.937 0.344 1.00 34.32 O ATOM 3882 HA ASP A 268 35.598 92.670 -0.681 1.00 0.00 H ATOM 3883 HB2 ASP A 268 33.128 94.365 -0.787 1.00 0.00 H ATOM 3884 HB3 ASP A 268 33.213 93.183 0.540 1.00 0.00 H ATOM 3885 H ASP A 268 33.754 93.509 -2.895 1.00 0.00 H ATOM 3886 N MET A 269 34.111 90.621 -0.148 1.00 31.75 N ATOM 3887 CA MET A 269 33.535 89.269 -0.113 1.00 32.09 C ATOM 3888 C MET A 269 32.117 89.191 0.413 1.00 32.32 C ATOM 3889 O MET A 269 31.291 88.446 -0.123 1.00 32.24 O ATOM 3890 CB MET A 269 34.379 88.366 0.779 1.00 32.40 C ATOM 3891 CG MET A 269 35.524 87.749 0.078 1.00 32.99 C ATOM 3892 SD MET A 269 35.030 86.707 -1.302 1.00 34.42 S ATOM 3893 CE MET A 269 36.588 86.802 -2.153 1.00 34.51 C ATOM 3894 HA MET A 269 33.524 88.952 -1.156 1.00 0.00 H ATOM 3895 HB2 MET A 269 34.762 88.960 1.609 1.00 0.00 H ATOM 3896 HB3 MET A 269 33.742 87.571 1.167 1.00 0.00 H ATOM 3897 HG2 MET A 269 36.080 87.140 0.791 1.00 0.00 H ATOM 3898 HG3 MET A 269 36.168 88.543 -0.300 1.00 0.00 H ATOM 3899 HE1 MET A 269 36.806 87.842 -2.395 1.00 0.00 H ATOM 3900 HE2 MET A 269 37.375 86.404 -1.513 1.00 0.00 H ATOM 3901 HE3 MET A 269 36.535 86.218 -3.072 1.00 0.00 H ATOM 3902 H MET A 269 34.761 90.907 0.611 1.00 0.00 H ATOM 3903 N VAL A 270 31.856 89.926 1.488 1.00 32.54 N ATOM 3904 CA VAL A 270 30.599 89.808 2.221 1.00 32.73 C ATOM 3905 C VAL A 270 29.871 91.150 2.389 1.00 32.91 C ATOM 3906 O VAL A 270 28.920 91.245 3.170 1.00 33.10 O ATOM 3907 CB VAL A 270 30.837 89.141 3.601 1.00 32.87 C ATOM 3908 CG1 VAL A 270 31.361 87.716 3.414 1.00 32.91 C ATOM 3909 CG2 VAL A 270 31.803 89.970 4.463 1.00 32.94 C ATOM 3910 HA VAL A 270 29.946 89.174 1.621 1.00 0.00 H ATOM 3911 HB VAL A 270 29.884 89.097 4.127 1.00 0.00 H ATOM 3912 HG11 VAL A 270 30.630 87.132 2.855 1.00 0.00 H ATOM 3913 HG12 VAL A 270 32.301 87.745 2.864 1.00 0.00 H ATOM 3914 HG13 VAL A 270 31.524 87.259 4.390 1.00 0.00 H ATOM 3915 HG21 VAL A 270 32.761 90.059 3.950 1.00 0.00 H ATOM 3916 HG22 VAL A 270 31.383 90.963 4.625 1.00 0.00 H ATOM 3917 HG23 VAL A 270 31.948 89.474 5.423 1.00 0.00 H ATOM 3918 H VAL A 270 32.569 90.607 1.818 1.00 0.00 H ATOM 3919 N ALA A 271 30.307 92.171 1.645 1.00 32.86 N ATOM 3920 CA ALA A 271 29.645 93.482 1.630 1.00 32.70 C ATOM 3921 C ALA A 271 29.473 93.966 0.189 1.00 32.55 C ATOM 3922 O ALA A 271 30.431 93.932 -0.579 1.00 32.67 O ATOM 3923 CB ALA A 271 30.459 94.489 2.418 1.00 32.78 C ATOM 3924 HA ALA A 271 28.663 93.383 2.092 1.00 0.00 H ATOM 3925 HB1 ALA A 271 30.555 94.149 3.449 1.00 0.00 H ATOM 3926 HB2 ALA A 271 31.449 94.583 1.971 1.00 0.00 H ATOM 3927 HB3 ALA A 271 29.956 95.456 2.398 1.00 0.00 H ATOM 3928 H ALA A 271 31.150 92.031 1.052 1.00 0.00 H ATOM 3929 N PRO A 272 28.260 94.425 -0.179 1.00 32.30 N ATOM 3930 CA PRO A 272 27.997 94.885 -1.549 1.00 32.09 C ATOM 3931 C PRO A 272 28.663 96.225 -1.880 1.00 31.97 C ATOM 3932 O PRO A 272 28.833 97.066 -0.993 1.00 32.07 O ATOM 3933 CB PRO A 272 26.474 95.018 -1.589 1.00 32.11 C ATOM 3934 CG PRO A 272 26.071 95.238 -0.182 1.00 32.22 C ATOM 3935 CD PRO A 272 27.066 94.531 0.678 1.00 32.35 C ATOM 3936 HA PRO A 272 28.405 94.193 -2.286 1.00 0.00 H ATOM 3937 HD3 PRO A 272 27.283 95.109 1.577 1.00 0.00 H ATOM 3938 HD2 PRO A 272 26.702 93.543 0.961 1.00 0.00 H ATOM 3939 HG3 PRO A 272 25.074 94.832 -0.011 1.00 0.00 H ATOM 3940 HG2 PRO A 272 26.072 96.304 0.045 1.00 0.00 H ATOM 3941 HB2 PRO A 272 26.179 95.865 -2.209 1.00 0.00 H ATOM 3942 HB3 PRO A 272 26.020 94.107 -1.980 1.00 0.00 H ATOM 3943 N SER A 273 29.035 96.409 -3.149 1.00 31.61 N ATOM 3944 CA SER A 273 29.754 97.606 -3.597 1.00 31.23 C ATOM 3945 C SER A 273 28.809 98.700 -4.091 1.00 30.95 C ATOM 3946 O SER A 273 29.144 99.885 -4.040 1.00 31.01 O ATOM 3947 CB SER A 273 30.753 97.256 -4.712 1.00 31.35 C ATOM 3948 OG SER A 273 30.100 96.991 -5.949 1.00 31.46 O ATOM 3949 HA SER A 273 30.290 97.989 -2.729 1.00 0.00 H ATOM 3950 HB2 SER A 273 31.317 96.372 -4.415 1.00 0.00 H ATOM 3951 HB3 SER A 273 31.437 98.093 -4.847 1.00 0.00 H ATOM 3952 HG SER A 273 30.777 96.771 -6.637 1.00 0.00 H ATOM 3953 H SER A 273 28.806 95.674 -3.848 1.00 0.00 H ATOM 3954 N GLY A 274 27.642 98.305 -4.592 1.00 30.34 N ATOM 3955 CA GLY A 274 26.666 99.265 -5.094 1.00 29.64 C ATOM 3956 C GLY A 274 26.745 99.455 -6.592 1.00 29.02 C ATOM 3957 O GLY A 274 25.730 99.344 -7.277 1.00 29.26 O ATOM 3958 HA3 GLY A 274 26.843 100.226 -4.611 1.00 0.00 H ATOM 3959 HA2 GLY A 274 25.667 98.911 -4.840 1.00 0.00 H ATOM 3960 H GLY A 274 27.421 97.289 -4.626 1.00 0.00 H ATOM 3961 N GLU A 275 27.940 99.735 -7.112 1.00 28.22 N ATOM 3962 CA GLU A 275 28.088 100.004 -8.545 1.00 27.64 C ATOM 3963 C GLU A 275 27.901 98.740 -9.390 1.00 26.92 C ATOM 3964 O GLU A 275 27.547 98.827 -10.567 1.00 26.96 O ATOM 3965 CB GLU A 275 29.421 100.711 -8.859 1.00 27.83 C ATOM 3966 CG GLU A 275 30.667 99.832 -8.865 1.00 28.33 C ATOM 3967 CD GLU A 275 30.891 99.090 -10.184 1.00 28.62 C ATOM 3968 OE1 GLU A 275 31.167 97.866 -10.141 1.00 29.06 O ATOM 3969 OE2 GLU A 275 30.792 99.723 -11.258 1.00 28.06 O ATOM 3970 HA GLU A 275 27.288 100.690 -8.822 1.00 0.00 H ATOM 3971 HB2 GLU A 275 29.331 101.167 -9.845 1.00 0.00 H ATOM 3972 HB3 GLU A 275 29.568 101.491 -8.112 1.00 0.00 H ATOM 3973 HG2 GLU A 275 31.535 100.463 -8.674 1.00 0.00 H ATOM 3974 HG3 GLU A 275 30.572 99.095 -8.067 1.00 0.00 H ATOM 3975 H GLU A 275 28.776 99.763 -6.494 1.00 0.00 H ATOM 3976 N GLY A 276 28.132 97.573 -8.791 1.00 25.98 N ATOM 3977 CA GLY A 276 27.838 96.298 -9.448 1.00 25.23 C ATOM 3978 C GLY A 276 26.353 96.105 -9.700 1.00 24.37 C ATOM 3979 O GLY A 276 25.954 95.730 -10.799 1.00 23.75 O ATOM 3980 HA3 GLY A 276 28.194 95.487 -8.813 1.00 0.00 H ATOM 3981 HA2 GLY A 276 28.362 96.267 -10.403 1.00 0.00 H ATOM 3982 H GLY A 276 28.532 97.567 -7.831 1.00 0.00 H ATOM 3983 N ALA A 277 25.544 96.373 -8.672 1.00 23.70 N ATOM 3984 CA ALA A 277 24.078 96.274 -8.752 1.00 23.34 C ATOM 3985 C ALA A 277 23.482 97.287 -9.734 1.00 23.02 C ATOM 3986 O ALA A 277 22.575 96.956 -10.502 1.00 22.96 O ATOM 3987 CB ALA A 277 23.470 96.467 -7.376 1.00 23.05 C ATOM 3988 HA ALA A 277 23.838 95.278 -9.125 1.00 0.00 H ATOM 3989 HB1 ALA A 277 23.846 95.697 -6.703 1.00 0.00 H ATOM 3990 HB2 ALA A 277 23.744 97.451 -6.994 1.00 0.00 H ATOM 3991 HB3 ALA A 277 22.385 96.392 -7.446 1.00 0.00 H ATOM 3992 H ALA A 277 25.971 96.666 -7.770 1.00 0.00 H ATOM 3993 N VAL A 278 23.996 98.516 -9.692 1.00 22.67 N ATOM 3994 CA VAL A 278 23.642 99.567 -10.649 1.00 22.46 C ATOM 3995 C VAL A 278 23.824 99.097 -12.086 1.00 22.25 C ATOM 3996 O VAL A 278 22.946 99.277 -12.935 1.00 22.10 O ATOM 3997 CB VAL A 278 24.515 100.832 -10.430 1.00 22.34 C ATOM 3998 CG1 VAL A 278 24.426 101.785 -11.622 1.00 22.26 C ATOM 3999 CG2 VAL A 278 24.104 101.546 -9.147 1.00 22.47 C ATOM 4000 HA VAL A 278 22.592 99.807 -10.479 1.00 0.00 H ATOM 4001 HB VAL A 278 25.552 100.509 -10.338 1.00 0.00 H ATOM 4002 HG11 VAL A 278 24.774 101.275 -12.520 1.00 0.00 H ATOM 4003 HG12 VAL A 278 23.391 102.098 -11.759 1.00 0.00 H ATOM 4004 HG13 VAL A 278 25.049 102.659 -11.434 1.00 0.00 H ATOM 4005 HG21 VAL A 278 23.058 101.844 -9.218 1.00 0.00 H ATOM 4006 HG22 VAL A 278 24.235 100.873 -8.300 1.00 0.00 H ATOM 4007 HG23 VAL A 278 24.726 102.430 -9.009 1.00 0.00 H ATOM 4008 H VAL A 278 24.682 98.740 -8.943 1.00 0.00 H ATOM 4009 N ARG A 279 24.979 98.507 -12.357 1.00 22.20 N ATOM 4010 CA ARG A 279 25.279 98.005 -13.693 1.00 22.29 C ATOM 4011 C ARG A 279 24.371 96.833 -14.069 1.00 21.90 C ATOM 4012 O ARG A 279 23.913 96.739 -15.201 1.00 21.33 O ATOM 4013 CB ARG A 279 26.762 97.632 -13.797 1.00 22.22 C ATOM 4014 CG ARG A 279 27.667 98.852 -14.015 1.00 22.64 C ATOM 4015 CD ARG A 279 29.127 98.565 -13.713 1.00 23.16 C ATOM 4016 NE ARG A 279 29.493 97.230 -14.166 1.00 24.75 N ATOM 4017 CZ ARG A 279 29.881 96.222 -13.387 1.00 24.73 C ATOM 4018 NH1 ARG A 279 30.032 96.360 -12.076 1.00 24.88 N ATOM 4019 NH2 ARG A 279 30.149 95.059 -13.939 1.00 25.08 N ATOM 4020 HA ARG A 279 25.078 98.799 -14.412 1.00 0.00 H ATOM 4021 HB2 ARG A 279 27.062 97.135 -12.874 1.00 0.00 H ATOM 4022 HB3 ARG A 279 26.892 96.947 -14.635 1.00 0.00 H ATOM 4023 HG2 ARG A 279 27.582 99.167 -15.055 1.00 0.00 H ATOM 4024 HG3 ARG A 279 27.328 99.658 -13.364 1.00 0.00 H ATOM 4025 HD2 ARG A 279 29.291 98.636 -12.638 1.00 0.00 H ATOM 4026 HD3 ARG A 279 29.750 99.300 -14.224 1.00 0.00 H ATOM 4027 HE ARG A 279 29.447 97.048 -15.189 1.00 0.00 H ATOM 4028 HH12 ARG A 279 30.337 95.550 -11.500 1.00 0.00 H ATOM 4029 HH11 ARG A 279 29.846 97.278 -11.625 1.00 0.00 H ATOM 4030 HH22 ARG A 279 30.453 94.260 -13.347 1.00 0.00 H ATOM 4031 HH21 ARG A 279 30.057 94.938 -14.968 1.00 0.00 H ATOM 4032 H ARG A 279 25.686 98.400 -11.602 1.00 0.00 H ATOM 4033 N CYS A 280 24.100 95.963 -13.101 1.00 22.16 N ATOM 4034 CA CYS A 280 23.246 94.790 -13.305 1.00 22.49 C ATOM 4035 C CYS A 280 21.819 95.195 -13.696 1.00 22.80 C ATOM 4036 O CYS A 280 21.255 94.686 -14.669 1.00 22.40 O ATOM 4037 CB CYS A 280 23.217 93.962 -12.024 1.00 22.35 C ATOM 4038 SG CYS A 280 22.537 92.325 -12.210 1.00 21.96 S ATOM 4039 HA CYS A 280 23.660 94.200 -14.123 1.00 0.00 H ATOM 4040 HB2 CYS A 280 22.618 94.497 -11.287 1.00 0.00 H ATOM 4041 HB3 CYS A 280 24.239 93.866 -11.658 1.00 0.00 H ATOM 4042 HG CYS A 280 21.234 92.418 -12.655 1.00 0.00 H ATOM 4043 H CYS A 280 24.512 96.122 -12.159 1.00 0.00 H ATOM 4044 N MET A 281 21.248 96.122 -12.929 1.00 23.51 N ATOM 4045 CA MET A 281 19.914 96.651 -13.207 1.00 23.90 C ATOM 4046 C MET A 281 19.846 97.362 -14.558 1.00 24.35 C ATOM 4047 O MET A 281 18.902 97.154 -15.318 1.00 24.39 O ATOM 4048 CB MET A 281 19.469 97.592 -12.090 1.00 23.95 C ATOM 4049 CG MET A 281 19.028 96.863 -10.832 1.00 23.78 C ATOM 4050 SD MET A 281 18.408 97.977 -9.563 1.00 23.37 S ATOM 4051 CE MET A 281 19.928 98.541 -8.796 1.00 23.35 C ATOM 4052 HA MET A 281 19.233 95.801 -13.252 1.00 0.00 H ATOM 4053 HB2 MET A 281 20.302 98.247 -11.837 1.00 0.00 H ATOM 4054 HB3 MET A 281 18.634 98.191 -12.454 1.00 0.00 H ATOM 4055 HG2 MET A 281 19.880 96.316 -10.429 1.00 0.00 H ATOM 4056 HG3 MET A 281 18.238 96.160 -11.095 1.00 0.00 H ATOM 4057 HE1 MET A 281 20.468 97.686 -8.390 1.00 0.00 H ATOM 4058 HE2 MET A 281 20.546 99.041 -9.542 1.00 0.00 H ATOM 4059 HE3 MET A 281 19.691 99.238 -7.992 1.00 0.00 H ATOM 4060 H MET A 281 21.769 96.482 -12.104 1.00 0.00 H ATOM 4061 N LYS A 282 20.850 98.181 -14.859 1.00 24.98 N ATOM 4062 CA LYS A 282 20.910 98.886 -16.144 1.00 25.74 C ATOM 4063 C LYS A 282 20.980 97.922 -17.332 1.00 26.18 C ATOM 4064 O LYS A 282 20.386 98.170 -18.385 1.00 26.21 O ATOM 4065 CB LYS A 282 22.108 99.845 -16.183 1.00 25.89 C ATOM 4066 CG LYS A 282 21.881 101.182 -15.475 1.00 26.34 C ATOM 4067 CD LYS A 282 23.077 102.116 -15.692 1.00 26.76 C ATOM 4068 CE LYS A 282 22.732 103.598 -15.518 1.00 27.27 C ATOM 4069 NZ LYS A 282 22.865 104.075 -14.116 1.00 28.05 N ATOM 4070 HA LYS A 282 19.986 99.457 -16.232 1.00 0.00 H ATOM 4071 HB2 LYS A 282 22.955 99.349 -15.709 1.00 0.00 H ATOM 4072 HB3 LYS A 282 22.346 100.050 -17.227 1.00 0.00 H ATOM 4073 HG2 LYS A 282 20.982 101.651 -15.875 1.00 0.00 H ATOM 4074 HG3 LYS A 282 21.753 101.005 -14.407 1.00 0.00 H ATOM 4075 HD2 LYS A 282 23.854 101.855 -14.973 1.00 0.00 H ATOM 4076 HD3 LYS A 282 23.454 101.965 -16.704 1.00 0.00 H ATOM 4077 HE2 LYS A 282 21.702 103.753 -15.840 1.00 0.00 H ATOM 4078 HE3 LYS A 282 23.401 104.185 -16.148 1.00 0.00 H ATOM 4079 HZ1 LYS A 282 22.224 103.531 -13.504 1.00 0.00 H ATOM 4080 HZ2 LYS A 282 23.846 103.943 -13.798 1.00 0.00 H ATOM 4081 HZ3 LYS A 282 22.617 105.084 -14.069 1.00 0.00 H ATOM 4082 H LYS A 282 21.612 98.325 -14.166 1.00 0.00 H ATOM 4083 N MET A 283 21.708 96.824 -17.151 1.00 26.78 N ATOM 4084 CA MET A 283 21.857 95.796 -18.178 1.00 27.10 C ATOM 4085 C MET A 283 20.526 95.094 -18.430 1.00 27.48 C ATOM 4086 O MET A 283 20.161 94.807 -19.572 1.00 27.14 O ATOM 4087 CB MET A 283 22.897 94.776 -17.711 1.00 27.23 C ATOM 4088 CG MET A 283 23.336 93.768 -18.745 1.00 27.12 C ATOM 4089 SD MET A 283 24.542 92.647 -18.018 1.00 27.14 S ATOM 4090 CE MET A 283 25.050 91.731 -19.465 1.00 28.69 C ATOM 4091 HA MET A 283 22.182 96.263 -19.108 1.00 0.00 H ATOM 4092 HB2 MET A 283 23.780 95.324 -17.382 1.00 0.00 H ATOM 4093 HB3 MET A 283 22.475 94.229 -16.868 1.00 0.00 H ATOM 4094 HG2 MET A 283 23.786 94.288 -19.591 1.00 0.00 H ATOM 4095 HG3 MET A 283 22.472 93.199 -19.088 1.00 0.00 H ATOM 4096 HE1 MET A 283 24.185 91.226 -19.896 1.00 0.00 H ATOM 4097 HE2 MET A 283 25.474 92.418 -20.198 1.00 0.00 H ATOM 4098 HE3 MET A 283 25.799 90.992 -19.181 1.00 0.00 H ATOM 4099 H MET A 283 22.192 96.692 -16.240 1.00 0.00 H ATOM 4100 N ALA A 284 19.812 94.823 -17.341 1.00 28.14 N ATOM 4101 CA ALA A 284 18.506 94.172 -17.390 1.00 28.61 C ATOM 4102 C ALA A 284 17.442 95.068 -18.026 1.00 29.02 C ATOM 4103 O ALA A 284 16.516 94.570 -18.660 1.00 28.93 O ATOM 4104 CB ALA A 284 18.076 93.758 -15.984 1.00 28.53 C ATOM 4105 HA ALA A 284 18.602 93.286 -18.017 1.00 0.00 H ATOM 4106 HB1 ALA A 284 18.808 93.064 -15.571 1.00 0.00 H ATOM 4107 HB2 ALA A 284 18.013 94.642 -15.350 1.00 0.00 H ATOM 4108 HB3 ALA A 284 17.101 93.273 -16.032 1.00 0.00 H ATOM 4109 H ALA A 284 20.201 95.087 -16.413 1.00 0.00 H ATOM 4110 N MET A 285 17.583 96.383 -17.865 1.00 29.60 N ATOM 4111 CA MET A 285 16.634 97.344 -18.439 1.00 30.31 C ATOM 4112 C MET A 285 16.972 97.725 -19.877 1.00 30.72 C ATOM 4113 O MET A 285 16.237 98.485 -20.500 1.00 30.81 O ATOM 4114 CB MET A 285 16.577 98.614 -17.580 1.00 30.29 C ATOM 4115 CG MET A 285 15.920 98.393 -16.243 1.00 30.69 C ATOM 4116 SD MET A 285 16.257 99.668 -15.011 1.00 31.09 S ATOM 4117 CE MET A 285 15.529 101.110 -15.794 1.00 31.67 C ATOM 4118 HA MET A 285 15.662 96.850 -18.449 1.00 0.00 H ATOM 4119 HB2 MET A 285 17.595 98.966 -17.413 1.00 0.00 H ATOM 4120 HB3 MET A 285 16.015 99.375 -18.122 1.00 0.00 H ATOM 4121 HG2 MET A 285 16.269 97.439 -15.848 1.00 0.00 H ATOM 4122 HG3 MET A 285 14.842 98.348 -16.398 1.00 0.00 H ATOM 4123 HE1 MET A 285 16.020 101.290 -16.750 1.00 0.00 H ATOM 4124 HE2 MET A 285 14.466 100.935 -15.958 1.00 0.00 H ATOM 4125 HE3 MET A 285 15.660 101.978 -15.148 1.00 0.00 H ATOM 4126 H MET A 285 18.391 96.740 -17.315 1.00 0.00 H ATOM 4127 N HIS A 286 18.070 97.197 -20.411 1.00 31.43 N ATOM 4128 CA HIS A 286 18.547 97.640 -21.710 1.00 31.53 C ATOM 4129 C HIS A 286 17.617 97.195 -22.832 1.00 31.72 C ATOM 4130 O HIS A 286 17.373 96.002 -23.009 1.00 31.82 O ATOM 4131 CB HIS A 286 19.970 97.151 -21.974 1.00 31.97 C ATOM 4132 CG HIS A 286 20.697 97.970 -22.993 1.00 32.69 C ATOM 4133 ND1 HIS A 286 20.565 97.759 -24.350 1.00 34.68 N ATOM 4134 CD2 HIS A 286 21.541 99.022 -22.854 1.00 34.33 C ATOM 4135 CE1 HIS A 286 21.307 98.639 -25.002 1.00 35.01 C ATOM 4136 NE2 HIS A 286 21.910 99.415 -24.118 1.00 34.80 N ATOM 4137 HA HIS A 286 18.555 98.730 -21.692 1.00 0.00 H ATOM 4138 HB2 HIS A 286 20.528 97.187 -21.038 1.00 0.00 H ATOM 4139 HB3 HIS A 286 19.922 96.121 -22.327 1.00 0.00 H ATOM 4140 HD2 HIS A 286 21.866 99.472 -21.916 1.00 0.00 H ATOM 4141 HE1 HIS A 286 21.405 98.712 -26.085 1.00 0.00 H ATOM 4142 H HIS A 286 18.592 96.461 -19.894 1.00 0.00 H ATOM 4143 N GLY A 287 17.095 98.169 -23.577 1.00 31.73 N ATOM 4144 CA GLY A 287 16.186 97.905 -24.690 1.00 31.65 C ATOM 4145 C GLY A 287 14.741 97.686 -24.276 1.00 31.64 C ATOM 4146 O GLY A 287 13.883 97.460 -25.122 1.00 31.72 O ATOM 4147 HA3 GLY A 287 16.532 97.012 -25.210 1.00 0.00 H ATOM 4148 HA2 GLY A 287 16.222 98.756 -25.370 1.00 0.00 H ATOM 4149 H GLY A 287 17.344 99.155 -23.358 1.00 0.00 H ATOM 4150 N VAL A 288 14.459 97.761 -22.979 1.00 31.61 N ATOM 4151 CA VAL A 288 13.103 97.563 -22.477 1.00 31.52 C ATOM 4152 C VAL A 288 12.342 98.883 -22.604 1.00 31.46 C ATOM 4153 O VAL A 288 12.569 99.817 -21.835 1.00 31.43 O ATOM 4154 CB VAL A 288 13.126 97.042 -21.026 1.00 31.61 C ATOM 4155 CG1 VAL A 288 11.730 96.987 -20.428 1.00 31.74 C ATOM 4156 CG2 VAL A 288 13.772 95.658 -20.992 1.00 31.72 C ATOM 4157 HA VAL A 288 12.590 96.804 -23.067 1.00 0.00 H ATOM 4158 HB VAL A 288 13.712 97.736 -20.423 1.00 0.00 H ATOM 4159 HG11 VAL A 288 11.297 97.987 -20.428 1.00 0.00 H ATOM 4160 HG12 VAL A 288 11.107 96.320 -21.024 1.00 0.00 H ATOM 4161 HG13 VAL A 288 11.789 96.615 -19.405 1.00 0.00 H ATOM 4162 HG21 VAL A 288 13.196 94.974 -21.615 1.00 0.00 H ATOM 4163 HG22 VAL A 288 14.792 95.725 -21.371 1.00 0.00 H ATOM 4164 HG23 VAL A 288 13.788 95.291 -19.966 1.00 0.00 H ATOM 4165 H VAL A 288 15.224 97.966 -22.305 1.00 0.00 H ATOM 4166 N ASP A 289 11.436 98.944 -23.581 1.00 31.34 N ATOM 4167 CA ASP A 289 10.767 100.198 -23.949 1.00 31.14 C ATOM 4168 C ASP A 289 9.630 100.622 -23.014 1.00 30.83 C ATOM 4169 O ASP A 289 8.980 101.637 -23.263 1.00 31.06 O ATOM 4170 CB ASP A 289 10.267 100.140 -25.409 1.00 31.47 C ATOM 4171 CG ASP A 289 9.115 99.161 -25.616 1.00 32.04 C ATOM 4172 OD1 ASP A 289 8.612 98.586 -24.629 1.00 32.86 O ATOM 4173 OD2 ASP A 289 8.709 98.969 -26.785 1.00 33.39 O ATOM 4174 HA ASP A 289 11.531 100.968 -23.843 1.00 0.00 H ATOM 4175 HB2 ASP A 289 9.931 101.136 -25.700 1.00 0.00 H ATOM 4176 HB3 ASP A 289 11.097 99.837 -26.047 1.00 0.00 H ATOM 4177 H ASP A 289 11.196 98.075 -24.099 1.00 0.00 H ATOM 4178 N THR A 290 9.386 99.850 -21.956 1.00 30.29 N ATOM 4179 CA THR A 290 8.382 100.190 -20.949 1.00 29.83 C ATOM 4180 C THR A 290 9.046 100.444 -19.600 1.00 29.47 C ATOM 4181 O THR A 290 10.128 99.921 -19.335 1.00 29.34 O ATOM 4182 CB THR A 290 7.379 99.048 -20.753 1.00 29.76 C ATOM 4183 OG1 THR A 290 8.091 97.838 -20.468 1.00 29.62 O ATOM 4184 CG2 THR A 290 6.518 98.865 -21.990 1.00 29.59 C ATOM 4185 HA THR A 290 7.867 101.082 -21.305 1.00 0.00 H ATOM 4186 HB THR A 290 6.723 99.295 -19.918 1.00 0.00 H ATOM 4187 HG1 THR A 290 7.445 97.099 -20.341 1.00 0.00 H ATOM 4188 HG23 THR A 290 5.981 99.791 -22.198 1.00 0.00 H ATOM 4189 HG21 THR A 290 7.153 98.614 -22.839 1.00 0.00 H ATOM 4190 HG22 THR A 290 5.804 98.060 -21.818 1.00 0.00 H ATOM 4191 H THR A 290 9.931 98.971 -21.842 1.00 0.00 H ATOM 4192 N PRO A 291 8.390 101.234 -18.734 1.00 29.01 N ATOM 4193 CA PRO A 291 8.938 101.474 -17.406 1.00 28.87 C ATOM 4194 C PRO A 291 8.764 100.273 -16.480 1.00 28.54 C ATOM 4195 O PRO A 291 7.966 99.381 -16.767 1.00 28.64 O ATOM 4196 CB PRO A 291 8.109 102.656 -16.896 1.00 28.88 C ATOM 4197 CG PRO A 291 6.807 102.505 -17.574 1.00 29.10 C ATOM 4198 CD PRO A 291 7.118 101.950 -18.939 1.00 28.95 C ATOM 4199 HA PRO A 291 10.011 101.661 -17.435 1.00 0.00 H ATOM 4200 HD3 PRO A 291 6.335 101.268 -19.271 1.00 0.00 H ATOM 4201 HD2 PRO A 291 7.234 102.751 -19.669 1.00 0.00 H ATOM 4202 HG3 PRO A 291 6.309 103.471 -17.661 1.00 0.00 H ATOM 4203 HG2 PRO A 291 6.168 101.817 -17.021 1.00 0.00 H ATOM 4204 HB2 PRO A 291 7.990 102.606 -15.814 1.00 0.00 H ATOM 4205 HB3 PRO A 291 8.578 103.602 -17.165 1.00 0.00 H ATOM 4206 N ILE A 292 9.507 100.277 -15.377 1.00 27.95 N ATOM 4207 CA ILE A 292 9.429 99.236 -14.365 1.00 27.61 C ATOM 4208 C ILE A 292 8.348 99.662 -13.391 1.00 27.16 C ATOM 4209 O ILE A 292 8.486 100.679 -12.714 1.00 27.18 O ATOM 4210 CB ILE A 292 10.771 99.048 -13.608 1.00 27.80 C ATOM 4211 CG1 ILE A 292 11.840 98.469 -14.536 1.00 28.40 C ATOM 4212 CG2 ILE A 292 10.603 98.111 -12.403 1.00 27.87 C ATOM 4213 CD1 ILE A 292 12.351 99.441 -15.563 1.00 30.40 C ATOM 4214 HA ILE A 292 9.205 98.280 -14.839 1.00 0.00 H ATOM 4215 HB ILE A 292 11.083 100.032 -13.257 1.00 0.00 H ATOM 4216 HG12 ILE A 292 12.682 98.140 -13.926 1.00 0.00 H ATOM 4217 HG13 ILE A 292 11.414 97.612 -15.057 1.00 0.00 H ATOM 4218 HD11 ILE A 292 11.524 99.772 -16.191 1.00 0.00 H ATOM 4219 HD12 ILE A 292 12.793 100.301 -15.059 1.00 0.00 H ATOM 4220 HD13 ILE A 292 13.105 98.953 -16.180 1.00 0.00 H ATOM 4221 HG21 ILE A 292 9.871 98.534 -11.715 1.00 0.00 H ATOM 4222 HG22 ILE A 292 10.258 97.136 -12.748 1.00 0.00 H ATOM 4223 HG23 ILE A 292 11.561 98.000 -11.894 1.00 0.00 H ATOM 4224 H ILE A 292 10.175 101.061 -15.232 1.00 0.00 H ATOM 4225 N ASP A 293 7.282 98.871 -13.316 1.00 26.54 N ATOM 4226 CA ASP A 293 6.133 99.183 -12.475 1.00 26.18 C ATOM 4227 C ASP A 293 6.353 98.738 -11.034 1.00 25.83 C ATOM 4228 O ASP A 293 5.927 99.418 -10.096 1.00 25.89 O ATOM 4229 CB ASP A 293 4.874 98.531 -13.056 1.00 26.13 C ATOM 4230 CG ASP A 293 4.616 98.957 -14.491 1.00 26.30 C ATOM 4231 OD1 ASP A 293 4.710 100.172 -14.765 1.00 27.19 O ATOM 4232 OD2 ASP A 293 4.341 98.089 -15.347 1.00 25.58 O ATOM 4233 HA ASP A 293 6.004 100.265 -12.463 1.00 0.00 H ATOM 4234 HB2 ASP A 293 4.994 97.448 -13.027 1.00 0.00 H ATOM 4235 HB3 ASP A 293 4.017 98.816 -12.446 1.00 0.00 H ATOM 4236 H ASP A 293 7.267 97.996 -13.879 1.00 0.00 H ATOM 4237 N TYR A 294 7.013 97.595 -10.863 1.00 25.16 N ATOM 4238 CA TYR A 294 7.313 97.065 -9.537 1.00 24.83 C ATOM 4239 C TYR A 294 8.706 96.438 -9.505 1.00 24.60 C ATOM 4240 O TYR A 294 9.143 95.839 -10.482 1.00 24.51 O ATOM 4241 CB TYR A 294 6.254 96.045 -9.115 1.00 24.22 C ATOM 4242 CG TYR A 294 6.654 95.217 -7.922 1.00 24.35 C ATOM 4243 CD1 TYR A 294 6.593 95.743 -6.637 1.00 24.04 C ATOM 4244 CD2 TYR A 294 7.108 93.910 -8.077 1.00 23.82 C ATOM 4245 CE1 TYR A 294 6.970 94.986 -5.532 1.00 24.05 C ATOM 4246 CE2 TYR A 294 7.490 93.146 -6.980 1.00 23.69 C ATOM 4247 CZ TYR A 294 7.421 93.689 -5.709 1.00 23.63 C ATOM 4248 OH TYR A 294 7.784 92.937 -4.618 1.00 23.07 O ATOM 4249 HA TYR A 294 7.297 97.893 -8.828 1.00 0.00 H ATOM 4250 HB3 TYR A 294 6.068 95.374 -9.954 1.00 0.00 H ATOM 4251 HB2 TYR A 294 5.337 96.581 -8.871 1.00 0.00 H ATOM 4252 HD2 TYR A 294 7.165 93.478 -9.076 1.00 0.00 H ATOM 4253 HE2 TYR A 294 7.842 92.124 -7.120 1.00 0.00 H ATOM 4254 HE1 TYR A 294 6.910 95.413 -4.531 1.00 0.00 H ATOM 4255 HD1 TYR A 294 6.244 96.765 -6.492 1.00 0.00 H ATOM 4256 HH TYR A 294 7.674 93.477 -3.795 1.00 0.00 H ATOM 4257 H TYR A 294 7.325 97.063 -11.701 1.00 0.00 H ATOM 4258 N LEU A 295 9.387 96.600 -8.371 1.00 24.53 N ATOM 4259 CA LEU A 295 10.693 95.996 -8.122 1.00 24.32 C ATOM 4260 C LEU A 295 10.658 95.134 -6.856 1.00 24.08 C ATOM 4261 O LEU A 295 10.413 95.648 -5.759 1.00 23.82 O ATOM 4262 CB LEU A 295 11.752 97.091 -7.976 1.00 24.45 C ATOM 4263 CG LEU A 295 13.225 96.652 -8.024 1.00 24.83 C ATOM 4264 CD1 LEU A 295 14.078 97.709 -8.715 1.00 25.68 C ATOM 4265 CD2 LEU A 295 13.781 96.352 -6.645 1.00 25.12 C ATOM 4266 HA LEU A 295 10.947 95.358 -8.968 1.00 0.00 H ATOM 4267 HB2 LEU A 295 11.596 97.808 -8.782 1.00 0.00 H ATOM 4268 HB3 LEU A 295 11.587 97.582 -7.017 1.00 0.00 H ATOM 4269 HG LEU A 295 13.262 95.727 -8.600 1.00 0.00 H ATOM 4270 HD21 LEU A 295 13.714 97.246 -6.025 1.00 0.00 H ATOM 4271 HD22 LEU A 295 13.203 95.548 -6.189 1.00 0.00 H ATOM 4272 HD23 LEU A 295 14.824 96.047 -6.734 1.00 0.00 H ATOM 4273 HD11 LEU A 295 13.719 97.855 -9.734 1.00 0.00 H ATOM 4274 HD12 LEU A 295 14.007 98.648 -8.166 1.00 0.00 H ATOM 4275 HD13 LEU A 295 15.116 97.378 -8.738 1.00 0.00 H ATOM 4276 H LEU A 295 8.966 97.188 -7.624 1.00 0.00 H ATOM 4277 N ASN A 296 10.884 93.827 -7.015 1.00 23.85 N ATOM 4278 CA ASN A 296 11.087 92.927 -5.876 1.00 23.87 C ATOM 4279 C ASN A 296 12.567 92.969 -5.483 1.00 23.77 C ATOM 4280 O ASN A 296 13.426 92.412 -6.175 1.00 23.88 O ATOM 4281 CB ASN A 296 10.638 91.497 -6.216 1.00 24.09 C ATOM 4282 CG ASN A 296 10.641 90.566 -5.006 1.00 24.24 C ATOM 4283 OD1 ASN A 296 11.692 90.074 -4.586 1.00 26.01 O ATOM 4284 ND2 ASN A 296 9.460 90.302 -4.458 1.00 23.76 N ATOM 4285 HA ASN A 296 10.479 93.255 -5.033 1.00 0.00 H ATOM 4286 HB2 ASN A 296 9.627 91.537 -6.621 1.00 0.00 H ATOM 4287 HB3 ASN A 296 11.313 91.091 -6.969 1.00 0.00 H ATOM 4288 HD22 ASN A 296 8.598 90.739 -4.844 1.00 0.00 H ATOM 4289 HD21 ASN A 296 9.397 89.659 -3.643 1.00 0.00 H ATOM 4290 H ASN A 296 10.917 93.435 -7.978 1.00 0.00 H ATOM 4291 N SER A 297 12.863 93.652 -4.382 1.00 23.58 N ATOM 4292 CA SER A 297 14.250 93.904 -3.983 1.00 23.45 C ATOM 4293 C SER A 297 14.877 92.663 -3.369 1.00 23.40 C ATOM 4294 O SER A 297 14.171 91.771 -2.894 1.00 23.43 O ATOM 4295 CB SER A 297 14.321 95.061 -2.983 1.00 23.33 C ATOM 4296 OG SER A 297 13.718 94.704 -1.752 1.00 23.12 O ATOM 4297 HA SER A 297 14.808 94.170 -4.881 1.00 0.00 H ATOM 4298 HB2 SER A 297 13.801 95.924 -3.398 1.00 0.00 H ATOM 4299 HB3 SER A 297 15.366 95.318 -2.808 1.00 0.00 H ATOM 4300 HG SER A 297 13.777 95.467 -1.124 1.00 0.00 H ATOM 4301 H SER A 297 12.091 94.017 -3.789 1.00 0.00 H ATOM 4302 N HIS A 298 16.209 92.608 -3.397 1.00 23.45 N ATOM 4303 CA HIS A 298 16.946 91.562 -2.705 1.00 23.33 C ATOM 4304 C HIS A 298 16.705 91.712 -1.206 1.00 23.24 C ATOM 4305 O HIS A 298 16.395 90.732 -0.534 1.00 23.13 O ATOM 4306 CB HIS A 298 18.439 91.632 -3.031 1.00 23.54 C ATOM 4307 CG HIS A 298 19.252 90.565 -2.365 1.00 23.64 C ATOM 4308 ND1 HIS A 298 18.987 89.222 -2.525 1.00 24.35 N ATOM 4309 CD2 HIS A 298 20.328 90.641 -1.546 1.00 24.09 C ATOM 4310 CE1 HIS A 298 19.861 88.518 -1.828 1.00 24.53 C ATOM 4311 NE2 HIS A 298 20.686 89.355 -1.226 1.00 23.94 N ATOM 4312 HA HIS A 298 16.594 90.585 -3.037 1.00 0.00 H ATOM 4313 HB2 HIS A 298 18.561 91.535 -4.110 1.00 0.00 H ATOM 4314 HB3 HIS A 298 18.816 92.603 -2.710 1.00 0.00 H ATOM 4315 HD2 HIS A 298 20.818 91.553 -1.205 1.00 0.00 H ATOM 4316 HE1 HIS A 298 19.895 87.431 -1.761 1.00 0.00 H ATOM 4317 H HIS A 298 16.735 93.332 -3.927 1.00 0.00 H ATOM 4318 N GLY A 299 16.845 92.943 -0.706 1.00 23.05 N ATOM 4319 CA GLY A 299 16.388 93.336 0.636 1.00 23.06 C ATOM 4320 C GLY A 299 16.260 92.234 1.678 1.00 23.02 C ATOM 4321 O GLY A 299 15.160 91.768 1.975 1.00 22.95 O ATOM 4322 HA3 GLY A 299 15.407 93.799 0.526 1.00 0.00 H ATOM 4323 HA2 GLY A 299 17.095 94.071 1.021 1.00 0.00 H ATOM 4324 H GLY A 299 17.303 93.664 -1.299 1.00 0.00 H ATOM 4325 N THR A 300 17.394 91.848 2.253 1.00 23.07 N ATOM 4326 CA THR A 300 17.478 90.701 3.155 1.00 23.13 C ATOM 4327 C THR A 300 17.232 91.026 4.633 1.00 23.03 C ATOM 4328 O THR A 300 17.165 90.113 5.454 1.00 22.93 O ATOM 4329 CB THR A 300 18.865 90.022 3.033 1.00 23.44 C ATOM 4330 OG1 THR A 300 19.891 90.958 3.384 1.00 22.85 O ATOM 4331 CG2 THR A 300 19.102 89.520 1.599 1.00 23.41 C ATOM 4332 HA THR A 300 16.674 90.038 2.837 1.00 0.00 H ATOM 4333 HB THR A 300 18.893 89.169 3.711 1.00 0.00 H ATOM 4334 HG1 THR A 300 19.850 91.736 2.773 1.00 0.00 H ATOM 4335 HG23 THR A 300 18.322 88.808 1.331 1.00 0.00 H ATOM 4336 HG21 THR A 300 19.076 90.365 0.911 1.00 0.00 H ATOM 4337 HG22 THR A 300 20.075 89.033 1.542 1.00 0.00 H ATOM 4338 H THR A 300 18.261 92.386 2.052 1.00 0.00 H ATOM 4339 N SER A 301 17.086 92.311 4.958 1.00 23.11 N ATOM 4340 CA SER A 301 16.903 92.790 6.346 1.00 23.30 C ATOM 4341 C SER A 301 18.233 92.878 7.118 1.00 23.49 C ATOM 4342 O SER A 301 18.305 92.559 8.305 1.00 23.68 O ATOM 4343 CB SER A 301 15.831 91.977 7.108 1.00 23.17 C ATOM 4344 OG SER A 301 15.594 92.509 8.402 1.00 22.61 O ATOM 4345 HA SER A 301 16.525 93.810 6.274 1.00 0.00 H ATOM 4346 HB2 SER A 301 16.172 90.946 7.206 1.00 0.00 H ATOM 4347 HB3 SER A 301 14.901 91.998 6.540 1.00 0.00 H ATOM 4348 HG SER A 301 16.434 92.487 8.925 1.00 0.00 H ATOM 4349 H SER A 301 17.102 93.016 4.193 1.00 0.00 H ATOM 4350 N THR A 302 19.267 93.353 6.421 1.00 23.81 N ATOM 4351 CA THR A 302 20.599 93.587 6.988 1.00 24.16 C ATOM 4352 C THR A 302 20.893 95.094 6.951 1.00 24.27 C ATOM 4353 O THR A 302 20.543 95.758 5.975 1.00 23.91 O ATOM 4354 CB THR A 302 21.696 92.844 6.190 1.00 24.17 C ATOM 4355 OG1 THR A 302 21.815 93.406 4.875 1.00 24.65 O ATOM 4356 CG2 THR A 302 21.354 91.378 6.071 1.00 24.47 C ATOM 4357 HA THR A 302 20.607 93.210 8.011 1.00 0.00 H ATOM 4358 HB THR A 302 22.641 92.954 6.721 1.00 0.00 H ATOM 4359 HG1 THR A 302 22.057 94.363 4.947 1.00 0.00 H ATOM 4360 HG23 THR A 302 21.262 90.946 7.067 1.00 0.00 H ATOM 4361 HG21 THR A 302 20.410 91.269 5.538 1.00 0.00 H ATOM 4362 HG22 THR A 302 22.144 90.865 5.522 1.00 0.00 H ATOM 4363 H THR A 302 19.119 93.570 5.415 1.00 0.00 H ATOM 4364 N PRO A 303 21.520 95.637 8.016 1.00 24.76 N ATOM 4365 CA PRO A 303 21.841 97.071 8.115 1.00 25.18 C ATOM 4366 C PRO A 303 22.489 97.694 6.869 1.00 25.55 C ATOM 4367 O PRO A 303 21.888 98.567 6.251 1.00 25.84 O ATOM 4368 CB PRO A 303 22.778 97.136 9.325 1.00 25.20 C ATOM 4369 CG PRO A 303 22.327 96.014 10.184 1.00 25.16 C ATOM 4370 CD PRO A 303 21.938 94.912 9.232 1.00 24.89 C ATOM 4371 HA PRO A 303 20.929 97.659 8.214 1.00 0.00 H ATOM 4372 HD3 PRO A 303 22.786 94.259 9.024 1.00 0.00 H ATOM 4373 HD2 PRO A 303 21.116 94.321 9.635 1.00 0.00 H ATOM 4374 HG3 PRO A 303 21.472 96.316 10.788 1.00 0.00 H ATOM 4375 HG2 PRO A 303 23.135 95.686 10.838 1.00 0.00 H ATOM 4376 HB2 PRO A 303 23.816 96.999 9.021 1.00 0.00 H ATOM 4377 HB3 PRO A 303 22.676 98.089 9.845 1.00 0.00 H ATOM 4378 N VAL A 304 23.683 97.253 6.488 1.00 26.01 N ATOM 4379 CA VAL A 304 24.372 97.867 5.350 1.00 26.38 C ATOM 4380 C VAL A 304 23.728 97.462 4.026 1.00 26.69 C ATOM 4381 O VAL A 304 23.551 98.297 3.139 1.00 26.76 O ATOM 4382 CB VAL A 304 25.881 97.511 5.316 1.00 26.67 C ATOM 4383 CG1 VAL A 304 26.571 98.154 4.107 1.00 26.46 C ATOM 4384 CG2 VAL A 304 26.578 97.959 6.608 1.00 27.06 C ATOM 4385 HA VAL A 304 24.276 98.945 5.482 1.00 0.00 H ATOM 4386 HB VAL A 304 25.960 96.427 5.229 1.00 0.00 H ATOM 4387 HG11 VAL A 304 26.106 97.793 3.190 1.00 0.00 H ATOM 4388 HG12 VAL A 304 26.468 99.238 4.166 1.00 0.00 H ATOM 4389 HG13 VAL A 304 27.628 97.887 4.109 1.00 0.00 H ATOM 4390 HG21 VAL A 304 26.474 99.038 6.720 1.00 0.00 H ATOM 4391 HG22 VAL A 304 26.118 97.458 7.460 1.00 0.00 H ATOM 4392 HG23 VAL A 304 27.635 97.698 6.559 1.00 0.00 H ATOM 4393 H VAL A 304 24.131 96.467 7.001 1.00 0.00 H ATOM 4394 N GLY A 305 23.376 96.184 3.902 1.00 26.94 N ATOM 4395 CA GLY A 305 22.905 95.622 2.632 1.00 27.09 C ATOM 4396 C GLY A 305 21.629 96.231 2.075 1.00 27.23 C ATOM 4397 O GLY A 305 21.555 96.527 0.883 1.00 27.27 O ATOM 4398 HA3 GLY A 305 22.731 94.556 2.781 1.00 0.00 H ATOM 4399 HA2 GLY A 305 23.693 95.760 1.892 1.00 0.00 H ATOM 4400 H GLY A 305 23.437 95.563 4.734 1.00 0.00 H ATOM 4401 N ASP A 306 20.624 96.411 2.932 1.00 27.37 N ATOM 4402 CA ASP A 306 19.346 96.988 2.514 1.00 27.64 C ATOM 4403 C ASP A 306 19.553 98.364 1.879 1.00 27.90 C ATOM 4404 O ASP A 306 19.106 98.615 0.757 1.00 27.99 O ATOM 4405 CB ASP A 306 18.383 97.128 3.704 1.00 27.63 C ATOM 4406 CG ASP A 306 17.830 95.790 4.195 1.00 27.73 C ATOM 4407 OD1 ASP A 306 18.228 94.720 3.683 1.00 28.02 O ATOM 4408 OD2 ASP A 306 16.975 95.816 5.108 1.00 27.30 O ATOM 4409 HA ASP A 306 18.911 96.309 1.780 1.00 0.00 H ATOM 4410 HB2 ASP A 306 18.916 97.605 4.526 1.00 0.00 H ATOM 4411 HB3 ASP A 306 17.547 97.758 3.401 1.00 0.00 H ATOM 4412 H ASP A 306 20.752 96.133 3.926 1.00 0.00 H ATOM 4413 N VAL A 307 20.233 99.246 2.607 1.00 28.02 N ATOM 4414 CA VAL A 307 20.403 100.638 2.172 1.00 28.09 C ATOM 4415 C VAL A 307 21.352 100.788 0.985 1.00 28.06 C ATOM 4416 O VAL A 307 21.230 101.742 0.217 1.00 28.00 O ATOM 4417 CB VAL A 307 20.858 101.571 3.333 1.00 28.34 C ATOM 4418 CG1 VAL A 307 19.752 101.688 4.377 1.00 28.58 C ATOM 4419 CG2 VAL A 307 22.169 101.091 3.969 1.00 28.32 C ATOM 4420 HA VAL A 307 19.412 100.950 1.843 1.00 0.00 H ATOM 4421 HB VAL A 307 21.050 102.559 2.915 1.00 0.00 H ATOM 4422 HG11 VAL A 307 18.858 102.104 3.912 1.00 0.00 H ATOM 4423 HG12 VAL A 307 19.527 100.700 4.779 1.00 0.00 H ATOM 4424 HG13 VAL A 307 20.083 102.343 5.183 1.00 0.00 H ATOM 4425 HG21 VAL A 307 22.030 100.087 4.370 1.00 0.00 H ATOM 4426 HG22 VAL A 307 22.954 101.076 3.213 1.00 0.00 H ATOM 4427 HG23 VAL A 307 22.451 101.770 4.774 1.00 0.00 H ATOM 4428 H VAL A 307 20.655 98.942 3.507 1.00 0.00 H ATOM 4429 N LYS A 308 22.285 99.851 0.833 1.00 28.04 N ATOM 4430 CA LYS A 308 23.170 99.841 -0.330 1.00 27.92 C ATOM 4431 C LYS A 308 22.364 99.629 -1.616 1.00 27.76 C ATOM 4432 O LYS A 308 22.578 100.327 -2.611 1.00 27.74 O ATOM 4433 CB LYS A 308 24.253 98.760 -0.197 1.00 28.31 C ATOM 4434 CG LYS A 308 25.596 99.128 -0.832 1.00 28.62 C ATOM 4435 CD LYS A 308 26.220 100.346 -0.146 1.00 30.01 C ATOM 4436 CE LYS A 308 27.727 100.405 -0.336 1.00 30.19 C ATOM 4437 NZ LYS A 308 28.093 100.417 -1.773 1.00 30.89 N ATOM 4438 HA LYS A 308 23.665 100.811 -0.380 1.00 0.00 H ATOM 4439 HB2 LYS A 308 24.418 98.571 0.864 1.00 0.00 H ATOM 4440 HB3 LYS A 308 23.888 97.851 -0.674 1.00 0.00 H ATOM 4441 HG2 LYS A 308 26.276 98.281 -0.741 1.00 0.00 H ATOM 4442 HG3 LYS A 308 25.440 99.355 -1.887 1.00 0.00 H ATOM 4443 HD2 LYS A 308 25.778 101.250 -0.565 1.00 0.00 H ATOM 4444 HD3 LYS A 308 26.002 100.298 0.921 1.00 0.00 H ATOM 4445 HE2 LYS A 308 28.179 99.533 0.138 1.00 0.00 H ATOM 4446 HE3 LYS A 308 28.109 101.311 0.135 1.00 0.00 H ATOM 4447 HZ1 LYS A 308 27.737 99.552 -2.227 1.00 0.00 H ATOM 4448 HZ2 LYS A 308 27.670 101.250 -2.230 1.00 0.00 H ATOM 4449 HZ3 LYS A 308 29.128 100.458 -1.866 1.00 0.00 H ATOM 4450 H LYS A 308 22.386 99.111 1.557 1.00 0.00 H ATOM 4451 N GLU A 309 21.429 98.683 -1.588 1.00 27.38 N ATOM 4452 CA GLU A 309 20.588 98.407 -2.755 1.00 27.30 C ATOM 4453 C GLU A 309 19.702 99.610 -3.088 1.00 27.06 C ATOM 4454 O GLU A 309 19.578 99.987 -4.251 1.00 26.69 O ATOM 4455 CB GLU A 309 19.739 97.148 -2.538 1.00 27.19 C ATOM 4456 CG GLU A 309 18.754 96.864 -3.673 1.00 27.48 C ATOM 4457 CD GLU A 309 17.980 95.562 -3.505 1.00 27.54 C ATOM 4458 OE1 GLU A 309 17.905 95.026 -2.377 1.00 27.57 O ATOM 4459 OE2 GLU A 309 17.435 95.075 -4.517 1.00 28.61 O ATOM 4460 HA GLU A 309 21.246 98.226 -3.605 1.00 0.00 H ATOM 4461 HB2 GLU A 309 20.409 96.294 -2.442 1.00 0.00 H ATOM 4462 HB3 GLU A 309 19.173 97.270 -1.614 1.00 0.00 H ATOM 4463 HG2 GLU A 309 18.039 97.685 -3.721 1.00 0.00 H ATOM 4464 HG3 GLU A 309 19.312 96.814 -4.608 1.00 0.00 H ATOM 4465 H GLU A 309 21.292 98.128 -0.719 1.00 0.00 H ATOM 4466 N LEU A 310 19.090 100.201 -2.064 1.00 27.06 N ATOM 4467 CA LEU A 310 18.304 101.435 -2.224 1.00 27.24 C ATOM 4468 C LEU A 310 19.087 102.536 -2.938 1.00 27.24 C ATOM 4469 O LEU A 310 18.557 103.201 -3.827 1.00 27.37 O ATOM 4470 CB LEU A 310 17.816 101.941 -0.856 1.00 27.19 C ATOM 4471 CG LEU A 310 16.421 101.532 -0.356 1.00 27.20 C ATOM 4472 CD1 LEU A 310 15.849 100.303 -1.050 1.00 27.13 C ATOM 4473 CD2 LEU A 310 16.428 101.340 1.159 1.00 27.31 C ATOM 4474 HA LEU A 310 17.446 101.187 -2.849 1.00 0.00 H ATOM 4475 HB2 LEU A 310 18.535 101.594 -0.114 1.00 0.00 H ATOM 4476 HB3 LEU A 310 17.833 103.030 -0.895 1.00 0.00 H ATOM 4477 HG LEU A 310 15.758 102.357 -0.617 1.00 0.00 H ATOM 4478 HD21 LEU A 310 17.141 100.559 1.422 1.00 0.00 H ATOM 4479 HD22 LEU A 310 16.717 102.274 1.641 1.00 0.00 H ATOM 4480 HD23 LEU A 310 15.431 101.051 1.492 1.00 0.00 H ATOM 4481 HD11 LEU A 310 15.764 100.498 -2.119 1.00 0.00 H ATOM 4482 HD12 LEU A 310 16.512 99.453 -0.886 1.00 0.00 H ATOM 4483 HD13 LEU A 310 14.864 100.081 -0.640 1.00 0.00 H ATOM 4484 H LEU A 310 19.170 99.776 -1.118 1.00 0.00 H ATOM 4485 N ALA A 311 20.350 102.709 -2.555 1.00 27.51 N ATOM 4486 CA ALA A 311 21.215 103.721 -3.158 1.00 27.68 C ATOM 4487 C ALA A 311 21.508 103.406 -4.630 1.00 27.96 C ATOM 4488 O ALA A 311 21.633 104.314 -5.458 1.00 27.76 O ATOM 4489 CB ALA A 311 22.505 103.842 -2.367 1.00 27.57 C ATOM 4490 HA ALA A 311 20.691 104.676 -3.127 1.00 0.00 H ATOM 4491 HB1 ALA A 311 22.275 104.132 -1.342 1.00 0.00 H ATOM 4492 HB2 ALA A 311 23.022 102.882 -2.368 1.00 0.00 H ATOM 4493 HB3 ALA A 311 23.141 104.599 -2.826 1.00 0.00 H ATOM 4494 H ALA A 311 20.734 102.104 -1.801 1.00 0.00 H ATOM 4495 N ALA A 312 21.611 102.118 -4.950 1.00 28.32 N ATOM 4496 CA ALA A 312 21.756 101.680 -6.336 1.00 28.69 C ATOM 4497 C ALA A 312 20.474 101.944 -7.128 1.00 28.95 C ATOM 4498 O ALA A 312 20.525 102.397 -8.266 1.00 28.47 O ATOM 4499 CB ALA A 312 22.115 100.204 -6.390 1.00 28.59 C ATOM 4500 HA ALA A 312 22.563 102.254 -6.791 1.00 0.00 H ATOM 4501 HB1 ALA A 312 23.056 100.041 -5.865 1.00 0.00 H ATOM 4502 HB2 ALA A 312 21.326 99.622 -5.914 1.00 0.00 H ATOM 4503 HB3 ALA A 312 22.219 99.895 -7.430 1.00 0.00 H ATOM 4504 H ALA A 312 21.588 101.405 -4.193 1.00 0.00 H ATOM 4505 N ILE A 313 19.329 101.662 -6.513 1.00 29.80 N ATOM 4506 CA ILE A 313 18.027 101.854 -7.163 1.00 30.63 C ATOM 4507 C ILE A 313 17.831 103.333 -7.506 1.00 31.34 C ATOM 4508 O ILE A 313 17.456 103.681 -8.628 1.00 31.25 O ATOM 4509 CB ILE A 313 16.875 101.313 -6.269 1.00 30.46 C ATOM 4510 CG1 ILE A 313 16.915 99.782 -6.239 1.00 30.48 C ATOM 4511 CG2 ILE A 313 15.513 101.769 -6.771 1.00 30.30 C ATOM 4512 CD1 ILE A 313 16.176 99.157 -5.073 1.00 30.68 C ATOM 4513 HA ILE A 313 18.006 101.284 -8.092 1.00 0.00 H ATOM 4514 HB ILE A 313 17.021 101.712 -5.265 1.00 0.00 H ATOM 4515 HG12 ILE A 313 16.470 99.411 -7.162 1.00 0.00 H ATOM 4516 HG13 ILE A 313 17.958 99.469 -6.188 1.00 0.00 H ATOM 4517 HD11 ILE A 313 16.615 99.505 -4.138 1.00 0.00 H ATOM 4518 HD12 ILE A 313 15.126 99.447 -5.113 1.00 0.00 H ATOM 4519 HD13 ILE A 313 16.257 98.072 -5.133 1.00 0.00 H ATOM 4520 HG21 ILE A 313 15.471 102.858 -6.765 1.00 0.00 H ATOM 4521 HG22 ILE A 313 15.361 101.404 -7.787 1.00 0.00 H ATOM 4522 HG23 ILE A 313 14.735 101.370 -6.120 1.00 0.00 H ATOM 4523 H ILE A 313 19.357 101.294 -5.541 1.00 0.00 H ATOM 4524 N ARG A 314 18.119 104.190 -6.533 1.00 32.53 N ATOM 4525 CA ARG A 314 18.104 105.642 -6.721 1.00 33.14 C ATOM 4526 C ARG A 314 19.013 106.117 -7.860 1.00 33.47 C ATOM 4527 O ARG A 314 18.626 106.986 -8.636 1.00 33.56 O ATOM 4528 CB ARG A 314 18.502 106.318 -5.411 1.00 33.26 C ATOM 4529 CG ARG A 314 18.256 107.817 -5.357 1.00 33.67 C ATOM 4530 CD ARG A 314 17.599 108.221 -4.024 1.00 34.88 C ATOM 4531 NE ARG A 314 18.158 107.477 -2.890 1.00 36.33 N ATOM 4532 CZ ARG A 314 17.506 107.175 -1.766 1.00 37.16 C ATOM 4533 NH1 ARG A 314 16.242 107.545 -1.575 1.00 37.74 N ATOM 4534 NH2 ARG A 314 18.129 106.489 -0.814 1.00 36.98 N ATOM 4535 HA ARG A 314 17.090 105.923 -7.006 1.00 0.00 H ATOM 4536 HB2 ARG A 314 17.934 105.853 -4.605 1.00 0.00 H ATOM 4537 HB3 ARG A 314 19.566 106.144 -5.251 1.00 0.00 H ATOM 4538 HG2 ARG A 314 19.208 108.339 -5.458 1.00 0.00 H ATOM 4539 HG3 ARG A 314 17.599 108.100 -6.179 1.00 0.00 H ATOM 4540 HD2 ARG A 314 16.529 108.021 -4.084 1.00 0.00 H ATOM 4541 HD3 ARG A 314 17.760 109.287 -3.860 1.00 0.00 H ATOM 4542 HE ARG A 314 19.145 107.158 -2.969 1.00 0.00 H ATOM 4543 HH12 ARG A 314 15.756 107.297 -0.690 1.00 0.00 H ATOM 4544 HH11 ARG A 314 15.740 108.082 -2.311 1.00 0.00 H ATOM 4545 HH22 ARG A 314 17.629 106.249 0.066 1.00 0.00 H ATOM 4546 HH21 ARG A 314 19.117 106.192 -0.949 1.00 0.00 H ATOM 4547 H ARG A 314 18.366 103.813 -5.596 1.00 0.00 H ATOM 4548 N GLU A 315 20.210 105.547 -7.968 1.00 34.09 N ATOM 4549 CA GLU A 315 21.124 105.897 -9.062 1.00 34.38 C ATOM 4550 C GLU A 315 20.582 105.450 -10.421 1.00 34.59 C ATOM 4551 O GLU A 315 20.733 106.155 -11.418 1.00 34.33 O ATOM 4552 CB GLU A 315 22.522 105.300 -8.832 1.00 34.62 C ATOM 4553 CG GLU A 315 23.597 105.765 -9.838 1.00 35.02 C ATOM 4554 CD GLU A 315 23.799 107.287 -9.845 1.00 37.31 C ATOM 4555 OE1 GLU A 315 23.820 107.883 -10.950 1.00 38.05 O ATOM 4556 OE2 GLU A 315 23.925 107.890 -8.749 1.00 37.68 O ATOM 4557 HA GLU A 315 21.204 106.984 -9.070 1.00 0.00 H ATOM 4558 HB2 GLU A 315 22.850 105.580 -7.831 1.00 0.00 H ATOM 4559 HB3 GLU A 315 22.443 104.215 -8.897 1.00 0.00 H ATOM 4560 HG2 GLU A 315 24.543 105.291 -9.578 1.00 0.00 H ATOM 4561 HG3 GLU A 315 23.296 105.450 -10.837 1.00 0.00 H ATOM 4562 H GLU A 315 20.504 104.840 -7.264 1.00 0.00 H ATOM 4563 N VAL A 316 19.954 104.278 -10.458 1.00 35.05 N ATOM 4564 CA VAL A 316 19.418 103.744 -11.710 1.00 35.54 C ATOM 4565 C VAL A 316 18.193 104.546 -12.165 1.00 35.89 C ATOM 4566 O VAL A 316 18.116 104.982 -13.314 1.00 35.60 O ATOM 4567 CB VAL A 316 19.065 102.238 -11.585 1.00 35.42 C ATOM 4568 CG1 VAL A 316 18.331 101.740 -12.827 1.00 35.34 C ATOM 4569 CG2 VAL A 316 20.327 101.416 -11.365 1.00 35.20 C ATOM 4570 HA VAL A 316 20.198 103.841 -12.466 1.00 0.00 H ATOM 4571 HB VAL A 316 18.405 102.119 -10.726 1.00 0.00 H ATOM 4572 HG11 VAL A 316 17.408 102.306 -12.953 1.00 0.00 H ATOM 4573 HG12 VAL A 316 18.966 101.878 -13.702 1.00 0.00 H ATOM 4574 HG13 VAL A 316 18.097 100.682 -12.709 1.00 0.00 H ATOM 4575 HG21 VAL A 316 21.002 101.555 -12.210 1.00 0.00 H ATOM 4576 HG22 VAL A 316 20.818 101.744 -10.449 1.00 0.00 H ATOM 4577 HG23 VAL A 316 20.062 100.362 -11.279 1.00 0.00 H ATOM 4578 H VAL A 316 19.842 103.731 -9.581 1.00 0.00 H ATOM 4579 N PHE A 317 17.254 104.756 -11.248 1.00 36.61 N ATOM 4580 CA PHE A 317 15.959 105.339 -11.593 1.00 37.16 C ATOM 4581 C PHE A 317 15.871 106.851 -11.395 1.00 37.69 C ATOM 4582 O PHE A 317 15.147 107.530 -12.125 1.00 37.86 O ATOM 4583 CB PHE A 317 14.859 104.644 -10.797 1.00 37.00 C ATOM 4584 CG PHE A 317 14.648 103.216 -11.200 1.00 36.81 C ATOM 4585 CD1 PHE A 317 15.140 102.176 -10.421 1.00 36.68 C ATOM 4586 CD2 PHE A 317 13.970 102.913 -12.371 1.00 36.46 C ATOM 4587 CE1 PHE A 317 14.950 100.852 -10.797 1.00 37.02 C ATOM 4588 CE2 PHE A 317 13.774 101.599 -12.756 1.00 36.65 C ATOM 4589 CZ PHE A 317 14.264 100.562 -11.971 1.00 36.81 C ATOM 4590 HA PHE A 317 15.830 105.176 -12.663 1.00 0.00 H ATOM 4591 HB2 PHE A 317 15.127 104.670 -9.741 1.00 0.00 H ATOM 4592 HB3 PHE A 317 13.926 105.188 -10.947 1.00 0.00 H ATOM 4593 HD2 PHE A 317 13.587 103.720 -12.996 1.00 0.00 H ATOM 4594 HE2 PHE A 317 13.234 101.376 -13.677 1.00 0.00 H ATOM 4595 HZ PHE A 317 14.111 99.526 -12.274 1.00 0.00 H ATOM 4596 HE1 PHE A 317 15.337 100.045 -10.175 1.00 0.00 H ATOM 4597 HD1 PHE A 317 15.682 102.402 -9.503 1.00 0.00 H ATOM 4598 H PHE A 317 17.446 104.499 -10.259 1.00 0.00 H ATOM 4599 N GLY A 318 16.600 107.371 -10.414 1.00 38.33 N ATOM 4600 CA GLY A 318 16.543 108.787 -10.088 1.00 38.66 C ATOM 4601 C GLY A 318 15.254 109.114 -9.356 1.00 39.16 C ATOM 4602 O GLY A 318 14.858 108.404 -8.432 1.00 39.19 O ATOM 4603 HA3 GLY A 318 16.591 109.369 -11.008 1.00 0.00 H ATOM 4604 HA2 GLY A 318 17.391 109.043 -9.453 1.00 0.00 H ATOM 4605 H GLY A 318 17.228 106.750 -9.865 1.00 0.00 H ATOM 4606 N ASP A 319 14.596 110.188 -9.781 1.00 39.69 N ATOM 4607 CA ASP A 319 13.366 110.647 -9.141 1.00 39.92 C ATOM 4608 C ASP A 319 12.222 109.663 -9.406 1.00 39.92 C ATOM 4609 O ASP A 319 11.464 109.314 -8.495 1.00 39.96 O ATOM 4610 CB ASP A 319 12.989 112.051 -9.654 1.00 40.50 C ATOM 4611 CG ASP A 319 12.275 112.899 -8.601 1.00 42.17 C ATOM 4612 OD1 ASP A 319 12.163 112.458 -7.431 1.00 43.94 O ATOM 4613 OD2 ASP A 319 11.833 114.024 -8.948 1.00 44.41 O ATOM 4614 HA ASP A 319 13.536 110.699 -8.066 1.00 0.00 H ATOM 4615 HB2 ASP A 319 13.900 112.567 -9.957 1.00 0.00 H ATOM 4616 HB3 ASP A 319 12.332 111.941 -10.516 1.00 0.00 H ATOM 4617 H ASP A 319 14.969 110.718 -10.595 1.00 0.00 H ATOM 4618 N LYS A 320 12.125 109.211 -10.656 1.00 39.55 N ATOM 4619 CA LYS A 320 11.032 108.340 -11.102 1.00 39.13 C ATOM 4620 C LYS A 320 11.338 106.848 -10.888 1.00 38.44 C ATOM 4621 O LYS A 320 11.522 106.082 -11.838 1.00 38.40 O ATOM 4622 CB LYS A 320 10.650 108.654 -12.562 1.00 39.40 C ATOM 4623 CG LYS A 320 11.782 108.554 -13.593 1.00 39.98 C ATOM 4624 CD LYS A 320 11.578 109.542 -14.751 1.00 40.13 C ATOM 4625 CE LYS A 320 12.717 109.470 -15.771 1.00 40.79 C ATOM 4626 NZ LYS A 320 14.041 109.842 -15.178 1.00 41.25 N ATOM 4627 HA LYS A 320 10.166 108.555 -10.475 1.00 0.00 H ATOM 4628 HB2 LYS A 320 9.866 107.957 -12.859 1.00 0.00 H ATOM 4629 HB3 LYS A 320 10.260 109.671 -12.593 1.00 0.00 H ATOM 4630 HG2 LYS A 320 12.730 108.775 -13.102 1.00 0.00 H ATOM 4631 HG3 LYS A 320 11.809 107.540 -13.993 1.00 0.00 H ATOM 4632 HD2 LYS A 320 10.640 109.307 -15.253 1.00 0.00 H ATOM 4633 HD3 LYS A 320 11.530 110.553 -14.347 1.00 0.00 H ATOM 4634 HE2 LYS A 320 12.496 110.153 -16.591 1.00 0.00 H ATOM 4635 HE3 LYS A 320 12.779 108.452 -16.155 1.00 0.00 H ATOM 4636 HZ1 LYS A 320 13.996 110.816 -14.815 1.00 0.00 H ATOM 4637 HZ2 LYS A 320 14.266 109.191 -14.399 1.00 0.00 H ATOM 4638 HZ3 LYS A 320 14.778 109.777 -15.909 1.00 0.00 H ATOM 4639 H LYS A 320 12.854 109.487 -11.344 1.00 0.00 H ATOM 4640 N SER A 321 11.367 106.453 -9.617 1.00 37.51 N ATOM 4641 CA SER A 321 11.621 105.066 -9.212 1.00 36.70 C ATOM 4642 C SER A 321 10.327 104.242 -9.175 1.00 35.75 C ATOM 4643 O SER A 321 9.234 104.805 -9.086 1.00 35.81 O ATOM 4644 CB SER A 321 12.287 105.046 -7.830 1.00 36.83 C ATOM 4645 OG SER A 321 11.332 105.247 -6.794 1.00 37.52 O ATOM 4646 HA SER A 321 12.284 104.616 -9.951 1.00 0.00 H ATOM 4647 HB2 SER A 321 13.034 105.838 -7.784 1.00 0.00 H ATOM 4648 HB3 SER A 321 12.773 104.081 -7.683 1.00 0.00 H ATOM 4649 HG SER A 321 11.790 105.229 -5.917 1.00 0.00 H ATOM 4650 H SER A 321 11.201 107.162 -8.875 1.00 0.00 H ATOM 4651 N PRO A 322 10.449 102.903 -9.225 1.00 34.48 N ATOM 4652 CA PRO A 322 9.283 102.033 -9.180 1.00 33.45 C ATOM 4653 C PRO A 322 8.828 101.750 -7.756 1.00 32.36 C ATOM 4654 O PRO A 322 9.515 102.115 -6.795 1.00 32.09 O ATOM 4655 CB PRO A 322 9.805 100.745 -9.811 1.00 33.53 C ATOM 4656 CG PRO A 322 11.206 100.681 -9.359 1.00 34.06 C ATOM 4657 CD PRO A 322 11.694 102.117 -9.332 1.00 34.53 C ATOM 4658 HA PRO A 322 8.422 102.474 -9.682 1.00 0.00 H ATOM 4659 HD3 PRO A 322 12.341 102.293 -8.473 1.00 0.00 H ATOM 4660 HD2 PRO A 322 12.233 102.363 -10.247 1.00 0.00 H ATOM 4661 HG3 PRO A 322 11.803 100.089 -10.053 1.00 0.00 H ATOM 4662 HG2 PRO A 322 11.265 100.240 -8.364 1.00 0.00 H ATOM 4663 HB2 PRO A 322 9.242 99.882 -9.457 1.00 0.00 H ATOM 4664 HB3 PRO A 322 9.748 100.793 -10.898 1.00 0.00 H ATOM 4665 N ALA A 323 7.679 101.093 -7.632 1.00 30.98 N ATOM 4666 CA ALA A 323 7.216 100.615 -6.342 1.00 30.15 C ATOM 4667 C ALA A 323 8.113 99.462 -5.893 1.00 29.09 C ATOM 4668 O ALA A 323 8.457 98.585 -6.685 1.00 28.79 O ATOM 4669 CB ALA A 323 5.770 100.167 -6.424 1.00 30.11 C ATOM 4670 HA ALA A 323 7.270 101.424 -5.613 1.00 0.00 H ATOM 4671 HB1 ALA A 323 5.148 101.007 -6.733 1.00 0.00 H ATOM 4672 HB2 ALA A 323 5.682 99.360 -7.152 1.00 0.00 H ATOM 4673 HB3 ALA A 323 5.445 99.813 -5.446 1.00 0.00 H ATOM 4674 H ALA A 323 7.099 100.918 -8.477 1.00 0.00 H ATOM 4675 N ILE A 324 8.492 99.475 -4.622 1.00 27.93 N ATOM 4676 CA ILE A 324 9.423 98.496 -4.091 1.00 27.50 C ATOM 4677 C ILE A 324 8.795 97.777 -2.915 1.00 26.24 C ATOM 4678 O ILE A 324 8.161 98.401 -2.058 1.00 26.14 O ATOM 4679 CB ILE A 324 10.749 99.162 -3.624 1.00 27.30 C ATOM 4680 CG1 ILE A 324 11.412 99.914 -4.779 1.00 27.38 C ATOM 4681 CG2 ILE A 324 11.728 98.116 -3.073 1.00 27.58 C ATOM 4682 CD1 ILE A 324 12.471 100.905 -4.339 1.00 27.47 C ATOM 4683 HA ILE A 324 9.652 97.790 -4.890 1.00 0.00 H ATOM 4684 HB ILE A 324 10.500 99.866 -2.830 1.00 0.00 H ATOM 4685 HG12 ILE A 324 11.878 99.184 -5.441 1.00 0.00 H ATOM 4686 HG13 ILE A 324 10.639 100.456 -5.324 1.00 0.00 H ATOM 4687 HD11 ILE A 324 12.020 101.651 -3.685 1.00 0.00 H ATOM 4688 HD12 ILE A 324 13.259 100.378 -3.802 1.00 0.00 H ATOM 4689 HD13 ILE A 324 12.893 101.397 -5.215 1.00 0.00 H ATOM 4690 HG21 ILE A 324 11.274 97.608 -2.222 1.00 0.00 H ATOM 4691 HG22 ILE A 324 11.958 97.389 -3.852 1.00 0.00 H ATOM 4692 HG23 ILE A 324 12.645 98.611 -2.755 1.00 0.00 H ATOM 4693 H ILE A 324 8.112 100.207 -3.988 1.00 0.00 H ATOM 4694 N SER A 325 8.964 96.461 -2.879 1.00 24.97 N ATOM 4695 CA SER A 325 8.716 95.713 -1.661 1.00 23.91 C ATOM 4696 C SER A 325 9.730 94.590 -1.522 1.00 23.47 C ATOM 4697 O SER A 325 10.193 94.022 -2.517 1.00 23.23 O ATOM 4698 CB SER A 325 7.277 95.178 -1.601 1.00 24.05 C ATOM 4699 OG SER A 325 7.090 94.046 -2.429 1.00 24.28 O ATOM 4700 HA SER A 325 8.833 96.393 -0.817 1.00 0.00 H ATOM 4701 HB2 SER A 325 6.596 95.965 -1.924 1.00 0.00 H ATOM 4702 HB3 SER A 325 7.048 94.902 -0.572 1.00 0.00 H ATOM 4703 HG SER A 325 7.288 94.289 -3.368 1.00 0.00 H ATOM 4704 H SER A 325 9.278 95.960 -3.734 1.00 0.00 H ATOM 4705 N ALA A 326 10.068 94.291 -0.270 1.00 22.85 N ATOM 4706 CA ALA A 326 10.996 93.225 0.076 1.00 22.21 C ATOM 4707 C ALA A 326 10.221 92.051 0.679 1.00 21.60 C ATOM 4708 O ALA A 326 9.912 92.047 1.872 1.00 21.50 O ATOM 4709 CB ALA A 326 12.030 93.750 1.060 1.00 22.20 C ATOM 4710 HA ALA A 326 11.513 92.879 -0.819 1.00 0.00 H ATOM 4711 HB1 ALA A 326 12.578 94.575 0.604 1.00 0.00 H ATOM 4712 HB2 ALA A 326 11.527 94.100 1.961 1.00 0.00 H ATOM 4713 HB3 ALA A 326 12.724 92.950 1.318 1.00 0.00 H ATOM 4714 H ALA A 326 9.647 94.848 0.501 1.00 0.00 H ATOM 4715 N THR A 327 9.918 91.051 -0.148 1.00 20.84 N ATOM 4716 CA THR A 327 9.123 89.899 0.293 1.00 20.29 C ATOM 4717 C THR A 327 9.832 88.988 1.314 1.00 19.62 C ATOM 4718 O THR A 327 9.182 88.176 1.972 1.00 19.46 O ATOM 4719 CB THR A 327 8.602 89.071 -0.917 1.00 20.42 C ATOM 4720 OG1 THR A 327 9.692 88.666 -1.762 1.00 20.73 O ATOM 4721 CG2 THR A 327 7.620 89.900 -1.736 1.00 20.24 C ATOM 4722 HA THR A 327 8.273 90.330 0.823 1.00 0.00 H ATOM 4723 HB THR A 327 8.101 88.184 -0.529 1.00 0.00 H ATOM 4724 HG1 THR A 327 10.323 88.109 -1.240 1.00 0.00 H ATOM 4725 HG23 THR A 327 6.790 90.211 -1.101 1.00 0.00 H ATOM 4726 HG21 THR A 327 8.129 90.781 -2.128 1.00 0.00 H ATOM 4727 HG22 THR A 327 7.241 89.300 -2.563 1.00 0.00 H ATOM 4728 H THR A 327 10.254 91.088 -1.132 1.00 0.00 H ATOM 4729 N LYS A 328 11.147 89.145 1.465 1.00 19.01 N ATOM 4730 CA LYS A 328 11.912 88.399 2.474 1.00 18.62 C ATOM 4731 C LYS A 328 11.491 88.721 3.908 1.00 18.57 C ATOM 4732 O LYS A 328 11.706 87.907 4.812 1.00 18.23 O ATOM 4733 CB LYS A 328 13.414 88.631 2.306 1.00 18.43 C ATOM 4734 CG LYS A 328 14.016 87.912 1.115 1.00 17.88 C ATOM 4735 CD LYS A 328 15.529 88.017 1.120 1.00 17.54 C ATOM 4736 CE LYS A 328 16.143 87.276 -0.061 1.00 16.70 C ATOM 4737 NZ LYS A 328 15.843 87.911 -1.357 1.00 14.62 N ATOM 4738 HA LYS A 328 11.686 87.346 2.303 1.00 0.00 H ATOM 4739 HB2 LYS A 328 13.585 89.701 2.184 1.00 0.00 H ATOM 4740 HB3 LYS A 328 13.918 88.284 3.208 1.00 0.00 H ATOM 4741 HG2 LYS A 328 13.732 86.860 1.153 1.00 0.00 H ATOM 4742 HG3 LYS A 328 13.631 88.358 0.198 1.00 0.00 H ATOM 4743 HD2 LYS A 328 15.812 89.068 1.065 1.00 0.00 H ATOM 4744 HD3 LYS A 328 15.911 87.587 2.046 1.00 0.00 H ATOM 4745 HE2 LYS A 328 15.753 86.258 -0.074 1.00 0.00 H ATOM 4746 HE3 LYS A 328 17.225 87.248 0.070 1.00 0.00 H ATOM 4747 HZ1 LYS A 328 14.813 87.936 -1.499 1.00 0.00 H ATOM 4748 HZ2 LYS A 328 16.218 88.881 -1.362 1.00 0.00 H ATOM 4749 HZ3 LYS A 328 16.287 87.363 -2.121 1.00 0.00 H ATOM 4750 H LYS A 328 11.648 89.817 0.849 1.00 0.00 H ATOM 4751 N ALA A 329 10.894 89.900 4.110 1.00 18.56 N ATOM 4752 CA ALA A 329 10.284 90.268 5.396 1.00 18.54 C ATOM 4753 C ALA A 329 9.153 89.300 5.788 1.00 18.47 C ATOM 4754 O ALA A 329 8.935 89.017 6.975 1.00 18.18 O ATOM 4755 CB ALA A 329 9.769 91.715 5.342 1.00 18.67 C ATOM 4756 HA ALA A 329 11.053 90.195 6.165 1.00 0.00 H ATOM 4757 HB1 ALA A 329 10.601 92.388 5.135 1.00 0.00 H ATOM 4758 HB2 ALA A 329 9.022 91.804 4.553 1.00 0.00 H ATOM 4759 HB3 ALA A 329 9.320 91.975 6.300 1.00 0.00 H ATOM 4760 H ALA A 329 10.860 90.583 3.327 1.00 0.00 H ATOM 4761 N MET A 330 8.436 88.797 4.786 1.00 18.47 N ATOM 4762 CA MET A 330 7.450 87.731 4.996 1.00 18.49 C ATOM 4763 C MET A 330 8.101 86.349 5.007 1.00 18.08 C ATOM 4764 O MET A 330 7.838 85.532 5.895 1.00 18.07 O ATOM 4765 CB MET A 330 6.412 87.742 3.878 1.00 18.73 C ATOM 4766 CG MET A 330 5.324 88.788 3.998 1.00 19.36 C ATOM 4767 SD MET A 330 4.230 88.662 2.570 1.00 19.62 S ATOM 4768 CE MET A 330 5.210 89.491 1.321 1.00 20.18 C ATOM 4769 HA MET A 330 6.985 87.921 5.963 1.00 0.00 H ATOM 4770 HB2 MET A 330 6.936 87.910 2.937 1.00 0.00 H ATOM 4771 HB3 MET A 330 5.934 86.763 3.856 1.00 0.00 H ATOM 4772 HG2 MET A 330 5.773 89.781 4.029 1.00 0.00 H ATOM 4773 HG3 MET A 330 4.754 88.620 4.912 1.00 0.00 H ATOM 4774 HE1 MET A 330 5.403 90.517 1.634 1.00 0.00 H ATOM 4775 HE2 MET A 330 6.156 88.964 1.194 1.00 0.00 H ATOM 4776 HE3 MET A 330 4.665 89.494 0.377 1.00 0.00 H ATOM 4777 H MET A 330 8.579 89.170 3.826 1.00 0.00 H ATOM 4778 N THR A 331 8.955 86.104 4.012 1.00 17.88 N ATOM 4779 CA THR A 331 9.394 84.746 3.661 1.00 17.55 C ATOM 4780 C THR A 331 10.671 84.261 4.337 1.00 17.50 C ATOM 4781 O THR A 331 10.840 83.057 4.552 1.00 17.73 O ATOM 4782 CB THR A 331 9.604 84.616 2.126 1.00 17.54 C ATOM 4783 OG1 THR A 331 10.645 85.505 1.689 1.00 16.25 O ATOM 4784 CG2 THR A 331 8.320 84.936 1.383 1.00 16.40 C ATOM 4785 HA THR A 331 8.583 84.118 4.028 1.00 0.00 H ATOM 4786 HB THR A 331 9.893 83.588 1.908 1.00 0.00 H ATOM 4787 HG1 THR A 331 10.768 85.412 0.711 1.00 0.00 H ATOM 4788 HG23 THR A 331 7.531 84.261 1.716 1.00 0.00 H ATOM 4789 HG21 THR A 331 8.029 85.966 1.589 1.00 0.00 H ATOM 4790 HG22 THR A 331 8.480 84.810 0.312 1.00 0.00 H ATOM 4791 H THR A 331 9.325 86.906 3.463 1.00 0.00 H ATOM 4792 N GLY A 332 11.567 85.186 4.664 1.00 17.18 N ATOM 4793 CA GLY A 332 12.935 84.832 5.029 1.00 16.96 C ATOM 4794 C GLY A 332 13.811 84.723 3.787 1.00 16.75 C ATOM 4795 O GLY A 332 13.335 84.859 2.661 1.00 16.10 O ATOM 4796 HA3 GLY A 332 12.931 83.874 5.550 1.00 0.00 H ATOM 4797 HA2 GLY A 332 13.341 85.600 5.687 1.00 0.00 H ATOM 4798 H GLY A 332 11.286 86.187 4.660 1.00 0.00 H ATOM 4799 N HIS A 333 15.099 84.475 4.000 1.00 16.85 N ATOM 4800 CA HIS A 333 16.069 84.390 2.922 1.00 16.99 C ATOM 4801 C HIS A 333 16.354 82.919 2.619 1.00 17.18 C ATOM 4802 O HIS A 333 17.098 82.263 3.362 1.00 17.31 O ATOM 4803 CB HIS A 333 17.360 85.095 3.342 1.00 17.27 C ATOM 4804 CG HIS A 333 18.321 85.336 2.221 1.00 17.32 C ATOM 4805 ND1 HIS A 333 18.086 84.913 0.932 1.00 19.06 N ATOM 4806 CD2 HIS A 333 19.537 85.930 2.205 1.00 18.76 C ATOM 4807 CE1 HIS A 333 19.106 85.253 0.165 1.00 19.53 C ATOM 4808 NE2 HIS A 333 20.001 85.871 0.914 1.00 20.05 N ATOM 4809 HA HIS A 333 15.673 84.873 2.029 1.00 0.00 H ATOM 4810 HB2 HIS A 333 17.097 86.058 3.780 1.00 0.00 H ATOM 4811 HB3 HIS A 333 17.857 84.480 4.092 1.00 0.00 H ATOM 4812 HD2 HIS A 333 20.052 86.373 3.058 1.00 0.00 H ATOM 4813 HE1 HIS A 333 19.194 85.057 -0.904 1.00 0.00 H ATOM 4814 H HIS A 333 15.426 84.336 4.978 1.00 0.00 H ATOM 4815 N SER A 334 15.769 82.403 1.536 1.00 16.99 N ATOM 4816 CA SER A 334 15.972 81.003 1.145 1.00 17.24 C ATOM 4817 C SER A 334 17.238 80.796 0.294 1.00 17.34 C ATOM 4818 O SER A 334 17.391 79.750 -0.357 1.00 17.59 O ATOM 4819 CB SER A 334 14.744 80.460 0.408 1.00 17.20 C ATOM 4820 OG SER A 334 14.530 81.159 -0.802 1.00 16.90 O ATOM 4821 HA SER A 334 16.114 80.443 2.069 1.00 0.00 H ATOM 4822 HB2 SER A 334 13.867 80.573 1.045 1.00 0.00 H ATOM 4823 HB3 SER A 334 14.898 79.404 0.187 1.00 0.00 H ATOM 4824 HG SER A 334 14.385 82.119 -0.606 1.00 0.00 H ATOM 4825 H SER A 334 15.154 83.008 0.955 1.00 0.00 H ATOM 4826 N LEU A 335 18.131 81.788 0.304 1.00 17.38 N ATOM 4827 CA LEU A 335 19.489 81.659 -0.236 1.00 17.44 C ATOM 4828 C LEU A 335 19.491 81.279 -1.716 1.00 17.36 C ATOM 4829 O LEU A 335 19.225 82.129 -2.567 1.00 17.57 O ATOM 4830 CB LEU A 335 20.313 80.676 0.617 1.00 17.56 C ATOM 4831 CG LEU A 335 20.316 80.969 2.121 1.00 17.82 C ATOM 4832 CD1 LEU A 335 20.925 79.813 2.898 1.00 18.27 C ATOM 4833 CD2 LEU A 335 21.050 82.258 2.419 1.00 18.09 C ATOM 4834 HA LEU A 335 19.966 82.637 -0.179 1.00 0.00 H ATOM 4835 HB2 LEU A 335 19.907 79.676 0.468 1.00 0.00 H ATOM 4836 HB3 LEU A 335 21.344 80.704 0.265 1.00 0.00 H ATOM 4837 HG LEU A 335 19.281 81.086 2.441 1.00 0.00 H ATOM 4838 HD21 LEU A 335 22.081 82.175 2.076 1.00 0.00 H ATOM 4839 HD22 LEU A 335 20.559 83.082 1.902 1.00 0.00 H ATOM 4840 HD23 LEU A 335 21.037 82.442 3.493 1.00 0.00 H ATOM 4841 HD11 LEU A 335 20.343 78.909 2.718 1.00 0.00 H ATOM 4842 HD12 LEU A 335 21.952 79.657 2.569 1.00 0.00 H ATOM 4843 HD13 LEU A 335 20.915 80.047 3.963 1.00 0.00 H ATOM 4844 H LEU A 335 17.849 82.700 0.716 1.00 0.00 H ATOM 4845 N GLY A 336 19.763 80.011 -2.021 1.00 17.31 N ATOM 4846 CA GLY A 336 19.847 79.553 -3.401 1.00 17.16 C ATOM 4847 C GLY A 336 18.490 79.522 -4.073 1.00 17.19 C ATOM 4848 O GLY A 336 18.380 79.796 -5.279 1.00 17.39 O ATOM 4849 HA3 GLY A 336 20.269 78.548 -3.413 1.00 0.00 H ATOM 4850 HA2 GLY A 336 20.500 80.227 -3.956 1.00 0.00 H ATOM 4851 H GLY A 336 19.920 79.329 -1.252 1.00 0.00 H ATOM 4852 N ALA A 337 17.454 79.209 -3.292 1.00 16.76 N ATOM 4853 CA ALA A 337 16.074 79.192 -3.787 1.00 16.35 C ATOM 4854 C ALA A 337 15.453 80.586 -3.932 1.00 15.96 C ATOM 4855 O ALA A 337 14.418 80.730 -4.574 1.00 15.89 O ATOM 4856 CB ALA A 337 15.210 78.344 -2.875 1.00 16.42 C ATOM 4857 HA ALA A 337 16.114 78.763 -4.788 1.00 0.00 H ATOM 4858 HB1 ALA A 337 15.598 77.325 -2.853 1.00 0.00 H ATOM 4859 HB2 ALA A 337 15.227 78.762 -1.869 1.00 0.00 H ATOM 4860 HB3 ALA A 337 14.186 78.337 -3.250 1.00 0.00 H ATOM 4861 H ALA A 337 17.632 78.968 -2.296 1.00 0.00 H ATOM 4862 N ALA A 338 16.075 81.601 -3.336 1.00 15.67 N ATOM 4863 CA ALA A 338 15.483 82.941 -3.262 1.00 15.42 C ATOM 4864 C ALA A 338 15.186 83.552 -4.623 1.00 15.29 C ATOM 4865 O ALA A 338 14.135 84.162 -4.809 1.00 15.71 O ATOM 4866 CB ALA A 338 16.370 83.870 -2.470 1.00 15.13 C ATOM 4867 HA ALA A 338 14.525 82.816 -2.756 1.00 0.00 H ATOM 4868 HB1 ALA A 338 16.491 83.480 -1.459 1.00 0.00 H ATOM 4869 HB2 ALA A 338 17.344 83.940 -2.953 1.00 0.00 H ATOM 4870 HB3 ALA A 338 15.913 84.858 -2.427 1.00 0.00 H ATOM 4871 H ALA A 338 17.010 81.439 -2.910 1.00 0.00 H ATOM 4872 N GLY A 339 16.107 83.391 -5.566 1.00 15.26 N ATOM 4873 CA GLY A 339 15.984 84.009 -6.886 1.00 15.13 C ATOM 4874 C GLY A 339 14.769 83.538 -7.657 1.00 14.96 C ATOM 4875 O GLY A 339 14.037 84.345 -8.217 1.00 14.86 O ATOM 4876 HA3 GLY A 339 16.876 83.769 -7.465 1.00 0.00 H ATOM 4877 HA2 GLY A 339 15.915 85.089 -6.758 1.00 0.00 H ATOM 4878 H GLY A 339 16.942 82.807 -5.359 1.00 0.00 H ATOM 4879 N VAL A 340 14.558 82.227 -7.699 1.00 15.02 N ATOM 4880 CA VAL A 340 13.403 81.671 -8.412 1.00 15.12 C ATOM 4881 C VAL A 340 12.102 81.893 -7.620 1.00 15.16 C ATOM 4882 O VAL A 340 11.059 82.158 -8.211 1.00 14.84 O ATOM 4883 CB VAL A 340 13.600 80.174 -8.790 1.00 14.82 C ATOM 4884 CG1 VAL A 340 13.743 79.279 -7.550 1.00 14.51 C ATOM 4885 CG2 VAL A 340 12.462 79.696 -9.691 1.00 15.06 C ATOM 4886 HA VAL A 340 13.318 82.215 -9.353 1.00 0.00 H ATOM 4887 HB VAL A 340 14.535 80.094 -9.344 1.00 0.00 H ATOM 4888 HG11 VAL A 340 14.608 79.600 -6.970 1.00 0.00 H ATOM 4889 HG12 VAL A 340 12.844 79.360 -6.939 1.00 0.00 H ATOM 4890 HG13 VAL A 340 13.878 78.244 -7.864 1.00 0.00 H ATOM 4891 HG21 VAL A 340 11.513 79.808 -9.166 1.00 0.00 H ATOM 4892 HG22 VAL A 340 12.447 80.293 -10.603 1.00 0.00 H ATOM 4893 HG23 VAL A 340 12.617 78.647 -9.945 1.00 0.00 H ATOM 4894 H VAL A 340 15.221 81.586 -7.219 1.00 0.00 H ATOM 4895 N GLN A 341 12.166 81.803 -6.292 1.00 15.61 N ATOM 4896 CA GLN A 341 10.970 82.018 -5.471 1.00 15.93 C ATOM 4897 C GLN A 341 10.497 83.456 -5.638 1.00 16.05 C ATOM 4898 O GLN A 341 9.302 83.713 -5.755 1.00 15.89 O ATOM 4899 CB GLN A 341 11.223 81.681 -4.002 1.00 15.80 C ATOM 4900 CG GLN A 341 11.254 80.181 -3.744 1.00 16.49 C ATOM 4901 CD GLN A 341 11.441 79.809 -2.279 1.00 16.68 C ATOM 4902 OE1 GLN A 341 11.082 78.708 -1.856 1.00 19.22 O ATOM 4903 NE2 GLN A 341 12.000 80.716 -1.504 1.00 17.37 N ATOM 4904 HA GLN A 341 10.185 81.343 -5.812 1.00 0.00 H ATOM 4905 HB2 GLN A 341 12.182 82.107 -3.706 1.00 0.00 H ATOM 4906 HB3 GLN A 341 10.429 82.123 -3.400 1.00 0.00 H ATOM 4907 HG2 GLN A 341 10.312 79.754 -4.089 1.00 0.00 H ATOM 4908 HG3 GLN A 341 12.077 79.751 -4.315 1.00 0.00 H ATOM 4909 HE22 GLN A 341 12.288 81.633 -1.901 1.00 0.00 H ATOM 4910 HE21 GLN A 341 12.153 80.515 -0.495 1.00 0.00 H ATOM 4911 H GLN A 341 13.072 81.578 -5.834 1.00 0.00 H ATOM 4912 N GLU A 342 11.447 84.383 -5.710 1.00 16.19 N ATOM 4913 CA GLU A 342 11.118 85.796 -5.844 1.00 16.41 C ATOM 4914 C GLU A 342 10.765 86.192 -7.267 1.00 16.24 C ATOM 4915 O GLU A 342 9.967 87.108 -7.471 1.00 16.20 O ATOM 4916 CB GLU A 342 12.229 86.655 -5.254 1.00 16.32 C ATOM 4917 CG GLU A 342 12.175 86.573 -3.737 1.00 17.33 C ATOM 4918 CD GLU A 342 13.435 87.006 -3.046 1.00 17.61 C ATOM 4919 OE1 GLU A 342 14.277 87.670 -3.685 1.00 19.26 O ATOM 4920 OE2 GLU A 342 13.572 86.680 -1.844 1.00 19.76 O ATOM 4921 HA GLU A 342 10.210 85.978 -5.269 1.00 0.00 H ATOM 4922 HB2 GLU A 342 13.195 86.292 -5.604 1.00 0.00 H ATOM 4923 HB3 GLU A 342 12.095 87.690 -5.568 1.00 0.00 H ATOM 4924 HG2 GLU A 342 11.360 87.208 -3.390 1.00 0.00 H ATOM 4925 HG3 GLU A 342 11.972 85.539 -3.458 1.00 0.00 H ATOM 4926 H GLU A 342 12.445 84.094 -5.670 1.00 0.00 H ATOM 4927 N ALA A 343 11.331 85.499 -8.249 1.00 16.15 N ATOM 4928 CA ALA A 343 10.835 85.607 -9.619 1.00 16.06 C ATOM 4929 C ALA A 343 9.368 85.180 -9.667 1.00 16.11 C ATOM 4930 O ALA A 343 8.556 85.816 -10.328 1.00 16.85 O ATOM 4931 CB ALA A 343 11.660 84.752 -10.557 1.00 16.20 C ATOM 4932 HA ALA A 343 10.920 86.644 -9.943 1.00 0.00 H ATOM 4933 HB1 ALA A 343 12.698 85.084 -10.531 1.00 0.00 H ATOM 4934 HB2 ALA A 343 11.602 83.710 -10.242 1.00 0.00 H ATOM 4935 HB3 ALA A 343 11.272 84.849 -11.571 1.00 0.00 H ATOM 4936 H ALA A 343 12.135 84.873 -8.040 1.00 0.00 H ATOM 4937 N ILE A 344 9.028 84.116 -8.948 1.00 15.65 N ATOM 4938 CA ILE A 344 7.655 83.610 -8.919 1.00 15.48 C ATOM 4939 C ILE A 344 6.693 84.571 -8.201 1.00 15.50 C ATOM 4940 O ILE A 344 5.622 84.870 -8.733 1.00 15.25 O ATOM 4941 CB ILE A 344 7.589 82.191 -8.294 1.00 15.12 C ATOM 4942 CG1 ILE A 344 8.125 81.154 -9.296 1.00 15.41 C ATOM 4943 CG2 ILE A 344 6.171 81.836 -7.903 1.00 15.16 C ATOM 4944 CD1 ILE A 344 8.394 79.764 -8.701 1.00 14.96 C ATOM 4945 HA ILE A 344 7.326 83.541 -9.956 1.00 0.00 H ATOM 4946 HB ILE A 344 8.206 82.185 -7.395 1.00 0.00 H ATOM 4947 HG12 ILE A 344 7.393 81.045 -10.096 1.00 0.00 H ATOM 4948 HG13 ILE A 344 9.060 81.533 -9.710 1.00 0.00 H ATOM 4949 HD11 ILE A 344 9.136 79.848 -7.907 1.00 0.00 H ATOM 4950 HD12 ILE A 344 7.468 79.359 -8.294 1.00 0.00 H ATOM 4951 HD13 ILE A 344 8.769 79.102 -9.482 1.00 0.00 H ATOM 4952 HG21 ILE A 344 5.805 82.558 -7.173 1.00 0.00 H ATOM 4953 HG22 ILE A 344 5.535 81.859 -8.788 1.00 0.00 H ATOM 4954 HG23 ILE A 344 6.155 80.837 -7.468 1.00 0.00 H ATOM 4955 H ILE A 344 9.758 83.629 -8.390 1.00 0.00 H ATOM 4956 N TYR A 345 7.054 85.037 -7.003 1.00 15.41 N ATOM 4957 CA TYR A 345 6.240 86.052 -6.306 1.00 15.81 C ATOM 4958 C TYR A 345 5.970 87.251 -7.218 1.00 16.08 C ATOM 4959 O TYR A 345 4.858 87.771 -7.253 1.00 16.37 O ATOM 4960 CB TYR A 345 6.899 86.563 -5.010 1.00 15.19 C ATOM 4961 CG TYR A 345 7.349 85.501 -4.029 1.00 14.92 C ATOM 4962 CD1 TYR A 345 6.638 84.313 -3.860 1.00 13.99 C ATOM 4963 CD2 TYR A 345 8.485 85.701 -3.247 1.00 14.81 C ATOM 4964 CE1 TYR A 345 7.063 83.344 -2.955 1.00 13.93 C ATOM 4965 CE2 TYR A 345 8.911 84.742 -2.335 1.00 14.84 C ATOM 4966 CZ TYR A 345 8.200 83.564 -2.195 1.00 14.40 C ATOM 4967 OH TYR A 345 8.628 82.613 -1.286 1.00 14.90 O ATOM 4968 HA TYR A 345 5.307 85.555 -6.042 1.00 0.00 H ATOM 4969 HB3 TYR A 345 6.180 87.204 -4.501 1.00 0.00 H ATOM 4970 HB2 TYR A 345 7.773 87.151 -5.290 1.00 0.00 H ATOM 4971 HD2 TYR A 345 9.050 86.627 -3.352 1.00 0.00 H ATOM 4972 HE2 TYR A 345 9.802 84.918 -1.732 1.00 0.00 H ATOM 4973 HE1 TYR A 345 6.503 82.415 -2.845 1.00 0.00 H ATOM 4974 HD1 TYR A 345 5.735 84.140 -4.446 1.00 0.00 H ATOM 4975 HH TYR A 345 9.543 82.319 -1.524 1.00 0.00 H ATOM 4976 H TYR A 345 7.921 84.680 -6.554 1.00 0.00 H ATOM 4977 N SER A 346 6.991 87.677 -7.955 1.00 16.60 N ATOM 4978 CA SER A 346 6.868 88.795 -8.887 1.00 17.22 C ATOM 4979 C SER A 346 5.921 88.481 -10.061 1.00 17.78 C ATOM 4980 O SER A 346 5.130 89.336 -10.481 1.00 17.87 O ATOM 4981 CB SER A 346 8.253 89.188 -9.421 1.00 17.48 C ATOM 4982 OG SER A 346 9.115 89.635 -8.379 1.00 17.51 O ATOM 4983 HA SER A 346 6.434 89.629 -8.336 1.00 0.00 H ATOM 4984 HB2 SER A 346 8.136 89.990 -10.150 1.00 0.00 H ATOM 4985 HB3 SER A 346 8.704 88.321 -9.905 1.00 0.00 H ATOM 4986 HG SER A 346 9.232 88.910 -7.715 1.00 0.00 H ATOM 4987 H SER A 346 7.909 87.198 -7.865 1.00 0.00 H ATOM 4988 N LEU A 347 6.014 87.264 -10.591 1.00 18.09 N ATOM 4989 CA LEU A 347 5.102 86.797 -11.640 1.00 18.33 C ATOM 4990 C LEU A 347 3.657 86.699 -11.137 1.00 18.60 C ATOM 4991 O LEU A 347 2.722 87.029 -11.874 1.00 18.41 O ATOM 4992 CB LEU A 347 5.547 85.433 -12.176 1.00 18.41 C ATOM 4993 CG LEU A 347 6.336 85.294 -13.490 1.00 18.60 C ATOM 4994 CD1 LEU A 347 6.737 86.605 -14.141 1.00 18.73 C ATOM 4995 CD2 LEU A 347 7.548 84.407 -13.263 1.00 18.68 C ATOM 4996 HA LEU A 347 5.137 87.533 -12.443 1.00 0.00 H ATOM 4997 HB2 LEU A 347 6.166 84.986 -11.398 1.00 0.00 H ATOM 4998 HB3 LEU A 347 4.639 84.842 -12.300 1.00 0.00 H ATOM 4999 HG LEU A 347 5.653 84.834 -14.204 1.00 0.00 H ATOM 5000 HD21 LEU A 347 8.186 84.854 -12.501 1.00 0.00 H ATOM 5001 HD22 LEU A 347 7.219 83.422 -12.931 1.00 0.00 H ATOM 5002 HD23 LEU A 347 8.105 84.310 -14.195 1.00 0.00 H ATOM 5003 HD11 LEU A 347 5.842 87.182 -14.374 1.00 0.00 H ATOM 5004 HD12 LEU A 347 7.368 87.171 -13.456 1.00 0.00 H ATOM 5005 HD13 LEU A 347 7.288 86.400 -15.059 1.00 0.00 H ATOM 5006 H LEU A 347 6.758 86.623 -10.250 1.00 0.00 H ATOM 5007 N LEU A 348 3.476 86.243 -9.899 1.00 18.80 N ATOM 5008 CA LEU A 348 2.139 86.160 -9.304 1.00 19.35 C ATOM 5009 C LEU A 348 1.537 87.557 -9.134 1.00 19.90 C ATOM 5010 O LEU A 348 0.343 87.761 -9.343 1.00 19.81 O ATOM 5011 CB LEU A 348 2.152 85.393 -7.969 1.00 19.05 C ATOM 5012 CG LEU A 348 2.348 83.867 -8.067 1.00 18.75 C ATOM 5013 CD1 LEU A 348 2.391 83.240 -6.688 1.00 18.24 C ATOM 5014 CD2 LEU A 348 1.266 83.188 -8.917 1.00 19.16 C ATOM 5015 HA LEU A 348 1.507 85.595 -9.990 1.00 0.00 H ATOM 5016 HB2 LEU A 348 2.963 85.795 -7.361 1.00 0.00 H ATOM 5017 HB3 LEU A 348 1.200 85.576 -7.470 1.00 0.00 H ATOM 5018 HG LEU A 348 3.304 83.708 -8.566 1.00 0.00 H ATOM 5019 HD21 LEU A 348 0.288 83.373 -8.473 1.00 0.00 H ATOM 5020 HD22 LEU A 348 1.291 83.595 -9.928 1.00 0.00 H ATOM 5021 HD23 LEU A 348 1.453 82.115 -8.952 1.00 0.00 H ATOM 5022 HD11 LEU A 348 3.220 83.666 -6.122 1.00 0.00 H ATOM 5023 HD12 LEU A 348 1.454 83.442 -6.169 1.00 0.00 H ATOM 5024 HD13 LEU A 348 2.530 82.163 -6.784 1.00 0.00 H ATOM 5025 H LEU A 348 4.301 85.939 -9.343 1.00 0.00 H ATOM 5026 N MET A 349 2.377 88.519 -8.779 1.00 20.58 N ATOM 5027 CA MET A 349 1.958 89.911 -8.710 1.00 21.16 C ATOM 5028 C MET A 349 1.643 90.477 -10.099 1.00 21.46 C ATOM 5029 O MET A 349 0.701 91.242 -10.265 1.00 21.44 O ATOM 5030 CB MET A 349 3.038 90.732 -8.012 1.00 21.15 C ATOM 5031 CG MET A 349 3.090 90.484 -6.504 1.00 21.34 C ATOM 5032 SD MET A 349 4.503 91.257 -5.678 1.00 21.88 S ATOM 5033 CE MET A 349 4.518 92.793 -6.556 1.00 22.58 C ATOM 5034 HA MET A 349 1.036 89.968 -8.131 1.00 0.00 H ATOM 5035 HB2 MET A 349 4.005 90.472 -8.441 1.00 0.00 H ATOM 5036 HB3 MET A 349 2.838 91.789 -8.184 1.00 0.00 H ATOM 5037 HG2 MET A 349 3.140 89.408 -6.335 1.00 0.00 H ATOM 5038 HG3 MET A 349 2.176 90.878 -6.060 1.00 0.00 H ATOM 5039 HE1 MET A 349 4.663 92.601 -7.619 1.00 0.00 H ATOM 5040 HE2 MET A 349 3.568 93.306 -6.405 1.00 0.00 H ATOM 5041 HE3 MET A 349 5.332 93.415 -6.183 1.00 0.00 H ATOM 5042 H MET A 349 3.360 88.273 -8.544 1.00 0.00 H ATOM 5043 N LEU A 350 2.429 90.088 -11.095 1.00 22.24 N ATOM 5044 CA LEU A 350 2.168 90.483 -12.485 1.00 22.65 C ATOM 5045 C LEU A 350 0.839 89.900 -12.967 1.00 23.26 C ATOM 5046 O LEU A 350 0.026 90.601 -13.571 1.00 23.39 O ATOM 5047 CB LEU A 350 3.279 89.970 -13.407 1.00 22.52 C ATOM 5048 CG LEU A 350 3.879 90.887 -14.470 1.00 22.96 C ATOM 5049 CD1 LEU A 350 4.410 90.045 -15.625 1.00 23.16 C ATOM 5050 CD2 LEU A 350 2.914 91.944 -14.984 1.00 23.37 C ATOM 5051 HA LEU A 350 2.131 91.572 -12.518 1.00 0.00 H ATOM 5052 HB2 LEU A 350 4.101 89.655 -12.764 1.00 0.00 H ATOM 5053 HB3 LEU A 350 2.877 89.103 -13.931 1.00 0.00 H ATOM 5054 HG LEU A 350 4.692 91.435 -13.992 1.00 0.00 H ATOM 5055 HD21 LEU A 350 2.046 91.457 -15.428 1.00 0.00 H ATOM 5056 HD22 LEU A 350 2.593 92.575 -14.155 1.00 0.00 H ATOM 5057 HD23 LEU A 350 3.413 92.555 -15.735 1.00 0.00 H ATOM 5058 HD11 LEU A 350 5.178 89.365 -15.255 1.00 0.00 H ATOM 5059 HD12 LEU A 350 3.592 89.470 -16.059 1.00 0.00 H ATOM 5060 HD13 LEU A 350 4.838 90.700 -16.384 1.00 0.00 H ATOM 5061 H LEU A 350 3.252 89.487 -10.885 1.00 0.00 H ATOM 5062 N GLU A 351 0.642 88.611 -12.688 1.00 23.81 N ATOM 5063 CA GLU A 351 -0.502 87.841 -13.182 1.00 23.97 C ATOM 5064 C GLU A 351 -1.820 88.252 -12.502 1.00 24.21 C ATOM 5065 O GLU A 351 -2.859 88.338 -13.158 1.00 23.82 O ATOM 5066 CB GLU A 351 -0.224 86.336 -12.980 1.00 24.19 C ATOM 5067 CG GLU A 351 -1.324 85.366 -13.444 1.00 24.71 C ATOM 5068 CD GLU A 351 -1.264 85.015 -14.929 1.00 26.62 C ATOM 5069 OE1 GLU A 351 -0.568 85.707 -15.709 1.00 27.77 O ATOM 5070 OE2 GLU A 351 -1.931 84.032 -15.318 1.00 27.83 O ATOM 5071 HA GLU A 351 -0.624 88.054 -14.244 1.00 0.00 H ATOM 5072 HB2 GLU A 351 0.686 86.091 -13.527 1.00 0.00 H ATOM 5073 HB3 GLU A 351 -0.062 86.169 -11.915 1.00 0.00 H ATOM 5074 HG2 GLU A 351 -1.231 84.444 -12.871 1.00 0.00 H ATOM 5075 HG3 GLU A 351 -2.292 85.823 -13.239 1.00 0.00 H ATOM 5076 H GLU A 351 1.338 88.126 -12.087 1.00 0.00 H ATOM 5077 N HIS A 352 -1.768 88.527 -11.200 1.00 24.44 N ATOM 5078 CA HIS A 352 -2.975 88.815 -10.421 1.00 24.69 C ATOM 5079 C HIS A 352 -3.193 90.304 -10.085 1.00 24.91 C ATOM 5080 O HIS A 352 -4.098 90.642 -9.326 1.00 24.86 O ATOM 5081 CB HIS A 352 -2.979 87.954 -9.161 1.00 24.60 C ATOM 5082 CG HIS A 352 -2.954 86.483 -9.449 1.00 25.19 C ATOM 5083 ND1 HIS A 352 -4.098 85.716 -9.507 1.00 25.19 N ATOM 5084 CD2 HIS A 352 -1.925 85.643 -9.717 1.00 25.01 C ATOM 5085 CE1 HIS A 352 -3.772 84.466 -9.783 1.00 25.53 C ATOM 5086 NE2 HIS A 352 -2.459 84.396 -9.917 1.00 24.72 N ATOM 5087 HA HIS A 352 -3.822 88.560 -11.058 1.00 0.00 H ATOM 5088 HB2 HIS A 352 -2.101 88.206 -8.567 1.00 0.00 H ATOM 5089 HB3 HIS A 352 -3.879 88.180 -8.590 1.00 0.00 H ATOM 5090 HD2 HIS A 352 -0.869 85.909 -9.765 1.00 0.00 H ATOM 5091 HE1 HIS A 352 -4.468 83.633 -9.883 1.00 0.00 H ATOM 5092 H HIS A 352 -0.844 88.538 -10.723 1.00 0.00 H ATOM 5093 N GLY A 353 -2.379 91.183 -10.667 1.00 25.23 N ATOM 5094 CA GLY A 353 -2.578 92.632 -10.559 1.00 25.36 C ATOM 5095 C GLY A 353 -2.513 93.236 -9.163 1.00 25.57 C ATOM 5096 O GLY A 353 -3.453 93.901 -8.721 1.00 25.57 O ATOM 5097 HA3 GLY A 353 -3.561 92.861 -10.971 1.00 0.00 H ATOM 5098 HA2 GLY A 353 -1.810 93.116 -11.163 1.00 0.00 H ATOM 5099 H GLY A 353 -1.572 90.828 -11.219 1.00 0.00 H ATOM 5100 N PHE A 354 -1.399 93.027 -8.470 1.00 25.77 N ATOM 5101 CA PHE A 354 -1.210 93.613 -7.144 1.00 25.82 C ATOM 5102 C PHE A 354 0.260 93.697 -6.755 1.00 25.96 C ATOM 5103 O PHE A 354 1.131 93.189 -7.462 1.00 25.70 O ATOM 5104 CB PHE A 354 -1.983 92.822 -6.089 1.00 25.93 C ATOM 5105 CG PHE A 354 -1.270 91.600 -5.600 1.00 25.80 C ATOM 5106 CD1 PHE A 354 -0.592 91.613 -4.384 1.00 26.40 C ATOM 5107 CD2 PHE A 354 -1.282 90.435 -6.341 1.00 26.15 C ATOM 5108 CE1 PHE A 354 0.063 90.478 -3.920 1.00 25.93 C ATOM 5109 CE2 PHE A 354 -0.631 89.295 -5.886 1.00 26.03 C ATOM 5110 CZ PHE A 354 0.041 89.317 -4.675 1.00 25.94 C ATOM 5111 HA PHE A 354 -1.599 94.630 -7.190 1.00 0.00 H ATOM 5112 HB2 PHE A 354 -2.167 93.476 -5.237 1.00 0.00 H ATOM 5113 HB3 PHE A 354 -2.935 92.514 -6.521 1.00 0.00 H ATOM 5114 HD2 PHE A 354 -1.809 90.409 -7.295 1.00 0.00 H ATOM 5115 HE2 PHE A 354 -0.649 88.383 -6.482 1.00 0.00 H ATOM 5116 HZ PHE A 354 0.551 88.423 -4.317 1.00 0.00 H ATOM 5117 HE1 PHE A 354 0.591 90.502 -2.967 1.00 0.00 H ATOM 5118 HD1 PHE A 354 -0.575 92.525 -3.788 1.00 0.00 H ATOM 5119 H PHE A 354 -0.647 92.436 -8.878 1.00 0.00 H ATOM 5120 N ILE A 355 0.513 94.379 -5.638 1.00 26.13 N ATOM 5121 CA ILE A 355 1.850 94.503 -5.068 1.00 26.19 C ATOM 5122 C ILE A 355 1.794 94.005 -3.637 1.00 26.27 C ATOM 5123 O ILE A 355 1.016 94.520 -2.839 1.00 26.30 O ATOM 5124 CB ILE A 355 2.371 95.960 -5.090 1.00 26.25 C ATOM 5125 CG1 ILE A 355 2.537 96.464 -6.522 1.00 26.56 C ATOM 5126 CG2 ILE A 355 3.716 96.064 -4.398 1.00 26.15 C ATOM 5127 CD1 ILE A 355 1.263 96.902 -7.166 1.00 27.97 C ATOM 5128 HA ILE A 355 2.540 93.912 -5.671 1.00 0.00 H ATOM 5129 HB ILE A 355 1.633 96.568 -4.567 1.00 0.00 H ATOM 5130 HG12 ILE A 355 3.223 97.311 -6.510 1.00 0.00 H ATOM 5131 HG13 ILE A 355 2.965 95.660 -7.121 1.00 0.00 H ATOM 5132 HD11 ILE A 355 0.567 96.064 -7.199 1.00 0.00 H ATOM 5133 HD12 ILE A 355 0.826 97.716 -6.588 1.00 0.00 H ATOM 5134 HD13 ILE A 355 1.469 97.245 -8.180 1.00 0.00 H ATOM 5135 HG21 ILE A 355 3.616 95.743 -3.361 1.00 0.00 H ATOM 5136 HG22 ILE A 355 4.437 95.426 -4.909 1.00 0.00 H ATOM 5137 HG23 ILE A 355 4.059 97.098 -4.428 1.00 0.00 H ATOM 5138 H ILE A 355 -0.279 94.844 -5.150 1.00 0.00 H ATOM 5139 N ALA A 356 2.602 92.993 -3.322 1.00 26.34 N ATOM 5140 CA ALA A 356 2.671 92.459 -1.964 1.00 26.64 C ATOM 5141 C ALA A 356 3.355 93.468 -1.036 1.00 26.84 C ATOM 5142 O ALA A 356 4.185 94.262 -1.483 1.00 26.89 O ATOM 5143 CB ALA A 356 3.412 91.132 -1.944 1.00 26.62 C ATOM 5144 HA ALA A 356 1.655 92.286 -1.608 1.00 0.00 H ATOM 5145 HB1 ALA A 356 2.889 90.416 -2.578 1.00 0.00 H ATOM 5146 HB2 ALA A 356 4.426 91.278 -2.317 1.00 0.00 H ATOM 5147 HB3 ALA A 356 3.450 90.754 -0.922 1.00 0.00 H ATOM 5148 H ALA A 356 3.199 92.572 -4.062 1.00 0.00 H ATOM 5149 N PRO A 357 3.011 93.439 0.261 1.00 27.14 N ATOM 5150 CA PRO A 357 3.501 94.476 1.164 1.00 27.49 C ATOM 5151 C PRO A 357 4.902 94.200 1.702 1.00 27.73 C ATOM 5152 O PRO A 357 5.263 93.046 1.939 1.00 27.70 O ATOM 5153 CB PRO A 357 2.484 94.444 2.307 1.00 27.39 C ATOM 5154 CG PRO A 357 2.003 93.022 2.346 1.00 27.10 C ATOM 5155 CD PRO A 357 2.162 92.454 0.959 1.00 27.03 C ATOM 5156 HA PRO A 357 3.588 95.437 0.657 1.00 0.00 H ATOM 5157 HD3 PRO A 357 2.648 91.479 0.993 1.00 0.00 H ATOM 5158 HD2 PRO A 357 1.194 92.359 0.466 1.00 0.00 H ATOM 5159 HG3 PRO A 357 0.955 92.991 2.644 1.00 0.00 H ATOM 5160 HG2 PRO A 357 2.598 92.446 3.055 1.00 0.00 H ATOM 5161 HB2 PRO A 357 2.956 94.717 3.251 1.00 0.00 H ATOM 5162 HB3 PRO A 357 1.657 95.125 2.106 1.00 0.00 H ATOM 5163 N SER A 358 5.678 95.264 1.886 1.00 28.35 N ATOM 5164 CA SER A 358 6.945 95.184 2.604 1.00 28.73 C ATOM 5165 C SER A 358 6.605 95.329 4.091 1.00 29.21 C ATOM 5166 O SER A 358 6.395 96.442 4.586 1.00 29.50 O ATOM 5167 CB SER A 358 7.898 96.282 2.122 1.00 28.74 C ATOM 5168 OG SER A 358 9.241 95.989 2.465 1.00 28.88 O ATOM 5169 HA SER A 358 7.456 94.238 2.425 1.00 0.00 H ATOM 5170 HB2 SER A 358 7.612 97.227 2.583 1.00 0.00 H ATOM 5171 HB3 SER A 358 7.820 96.369 1.038 1.00 0.00 H ATOM 5172 HG SER A 358 9.320 95.914 3.449 1.00 0.00 H ATOM 5173 H SER A 358 5.372 96.182 1.506 1.00 0.00 H ATOM 5174 N ILE A 359 6.516 94.198 4.789 1.00 29.58 N ATOM 5175 CA ILE A 359 5.954 94.168 6.146 1.00 30.01 C ATOM 5176 C ILE A 359 7.002 94.442 7.230 1.00 30.44 C ATOM 5177 O ILE A 359 8.191 94.572 6.938 1.00 30.26 O ATOM 5178 CB ILE A 359 5.173 92.838 6.433 1.00 29.93 C ATOM 5179 CG1 ILE A 359 6.069 91.603 6.345 1.00 30.14 C ATOM 5180 CG2 ILE A 359 4.022 92.672 5.457 1.00 29.96 C ATOM 5181 CD1 ILE A 359 6.937 91.416 7.499 1.00 30.37 C ATOM 5182 HA ILE A 359 5.236 94.987 6.188 1.00 0.00 H ATOM 5183 HB ILE A 359 4.797 92.918 7.453 1.00 0.00 H ATOM 5184 HG12 ILE A 359 5.432 90.724 6.249 1.00 0.00 H ATOM 5185 HG13 ILE A 359 6.694 91.696 5.457 1.00 0.00 H ATOM 5186 HD11 ILE A 359 7.591 92.281 7.604 1.00 0.00 H ATOM 5187 HD12 ILE A 359 6.328 91.308 8.397 1.00 0.00 H ATOM 5188 HD13 ILE A 359 7.539 90.519 7.357 1.00 0.00 H ATOM 5189 HG21 ILE A 359 3.337 93.513 5.559 1.00 0.00 H ATOM 5190 HG22 ILE A 359 4.412 92.640 4.440 1.00 0.00 H ATOM 5191 HG23 ILE A 359 3.494 91.743 5.674 1.00 0.00 H ATOM 5192 H ILE A 359 6.854 93.312 4.362 1.00 0.00 H ATOM 5193 N ASN A 360 6.535 94.541 8.477 1.00 31.13 N ATOM 5194 CA ASN A 360 7.384 94.776 9.655 1.00 31.85 C ATOM 5195 C ASN A 360 8.214 96.068 9.632 1.00 32.44 C ATOM 5196 O ASN A 360 9.236 96.160 10.310 1.00 32.44 O ATOM 5197 CB ASN A 360 8.296 93.565 9.928 1.00 31.61 C ATOM 5198 CG ASN A 360 7.527 92.344 10.393 1.00 31.22 C ATOM 5199 OD1 ASN A 360 6.440 92.455 10.958 1.00 31.14 O ATOM 5200 ND2 ASN A 360 8.093 91.163 10.154 1.00 29.43 N ATOM 5201 HA ASN A 360 6.674 94.910 10.471 1.00 0.00 H ATOM 5202 HB2 ASN A 360 8.827 93.314 9.009 1.00 0.00 H ATOM 5203 HB3 ASN A 360 9.016 93.838 10.699 1.00 0.00 H ATOM 5204 HD22 ASN A 360 9.014 91.116 9.673 1.00 0.00 H ATOM 5205 HD21 ASN A 360 7.614 90.288 10.448 1.00 0.00 H ATOM 5206 H ASN A 360 5.510 94.446 8.624 1.00 0.00 H ATOM 5207 N ILE A 361 7.765 97.069 8.880 1.00 33.49 N ATOM 5208 CA ILE A 361 8.397 98.391 8.919 1.00 34.46 C ATOM 5209 C ILE A 361 7.677 99.234 9.976 1.00 35.50 C ATOM 5210 O ILE A 361 6.703 99.930 9.682 1.00 35.51 O ATOM 5211 CB ILE A 361 8.394 99.085 7.531 1.00 34.26 C ATOM 5212 CG1 ILE A 361 9.172 98.233 6.523 1.00 34.28 C ATOM 5213 CG2 ILE A 361 9.032 100.481 7.616 1.00 33.90 C ATOM 5214 CD1 ILE A 361 9.035 98.668 5.081 1.00 34.26 C ATOM 5215 HA ILE A 361 9.447 98.280 9.188 1.00 0.00 H ATOM 5216 HB ILE A 361 7.359 99.191 7.205 1.00 0.00 H ATOM 5217 HG12 ILE A 361 10.228 98.272 6.790 1.00 0.00 H ATOM 5218 HG13 ILE A 361 8.817 97.206 6.602 1.00 0.00 H ATOM 5219 HD11 ILE A 361 7.986 98.622 4.787 1.00 0.00 H ATOM 5220 HD12 ILE A 361 9.399 99.690 4.975 1.00 0.00 H ATOM 5221 HD13 ILE A 361 9.621 98.004 4.445 1.00 0.00 H ATOM 5222 HG21 ILE A 361 8.467 101.095 8.317 1.00 0.00 H ATOM 5223 HG22 ILE A 361 10.062 100.388 7.960 1.00 0.00 H ATOM 5224 HG23 ILE A 361 9.018 100.946 6.630 1.00 0.00 H ATOM 5225 H ILE A 361 6.951 96.911 8.253 1.00 0.00 H ATOM 5226 N GLU A 362 8.149 99.123 11.216 1.00 36.80 N ATOM 5227 CA GLU A 362 7.636 99.911 12.339 1.00 37.82 C ATOM 5228 C GLU A 362 8.209 101.328 12.315 1.00 38.53 C ATOM 5229 O GLU A 362 7.614 102.261 12.852 1.00 38.65 O ATOM 5230 CB GLU A 362 7.973 99.218 13.666 1.00 37.95 C ATOM 5231 CG GLU A 362 6.992 98.101 14.031 1.00 38.90 C ATOM 5232 CD GLU A 362 7.670 96.825 14.507 1.00 39.20 C ATOM 5233 OE1 GLU A 362 8.276 96.832 15.601 1.00 40.96 O ATOM 5234 OE2 GLU A 362 7.576 95.805 13.784 1.00 41.46 O ATOM 5235 HA GLU A 362 6.552 99.983 12.245 1.00 0.00 H ATOM 5236 HB2 GLU A 362 8.972 98.790 13.589 1.00 0.00 H ATOM 5237 HB3 GLU A 362 7.959 99.965 14.460 1.00 0.00 H ATOM 5238 HG2 GLU A 362 6.339 98.462 14.826 1.00 0.00 H ATOM 5239 HG3 GLU A 362 6.394 97.866 13.150 1.00 0.00 H ATOM 5240 H GLU A 362 8.917 98.446 11.395 1.00 0.00 H ATOM 5241 N GLU A 363 9.367 101.478 11.680 1.00 39.51 N ATOM 5242 CA GLU A 363 10.056 102.757 11.600 1.00 40.05 C ATOM 5243 C GLU A 363 10.988 102.728 10.395 1.00 40.55 C ATOM 5244 O GLU A 363 12.043 102.094 10.430 1.00 40.76 O ATOM 5245 CB GLU A 363 10.837 103.003 12.894 1.00 40.10 C ATOM 5246 CG GLU A 363 11.653 104.290 12.931 1.00 40.08 C ATOM 5247 CD GLU A 363 12.548 104.374 14.161 1.00 40.68 C ATOM 5248 OE1 GLU A 363 13.628 105.002 14.070 1.00 41.79 O ATOM 5249 OE2 GLU A 363 12.175 103.805 15.214 1.00 41.59 O ATOM 5250 HA GLU A 363 9.341 103.571 11.480 1.00 0.00 H ATOM 5251 HB2 GLU A 363 10.123 103.033 13.717 1.00 0.00 H ATOM 5252 HB3 GLU A 363 11.521 102.167 13.038 1.00 0.00 H ATOM 5253 HG2 GLU A 363 12.278 104.335 12.039 1.00 0.00 H ATOM 5254 HG3 GLU A 363 10.969 105.139 12.937 1.00 0.00 H ATOM 5255 H GLU A 363 9.797 100.649 11.223 1.00 0.00 H ATOM 5256 N LEU A 364 10.581 103.405 9.327 1.00 41.31 N ATOM 5257 CA LEU A 364 11.336 103.416 8.075 1.00 41.75 C ATOM 5258 C LEU A 364 12.740 103.954 8.327 1.00 42.27 C ATOM 5259 O LEU A 364 12.910 104.943 9.041 1.00 42.40 O ATOM 5260 CB LEU A 364 10.637 104.299 7.021 1.00 41.74 C ATOM 5261 CG LEU A 364 10.537 103.837 5.557 1.00 41.64 C ATOM 5262 CD1 LEU A 364 10.575 105.048 4.628 1.00 41.65 C ATOM 5263 CD2 LEU A 364 11.613 102.830 5.151 1.00 41.78 C ATOM 5264 HA LEU A 364 11.390 102.395 7.699 1.00 0.00 H ATOM 5265 HB2 LEU A 364 9.616 104.454 7.370 1.00 0.00 H ATOM 5266 HB3 LEU A 364 11.165 105.253 7.012 1.00 0.00 H ATOM 5267 HG LEU A 364 9.584 103.315 5.464 1.00 0.00 H ATOM 5268 HD21 LEU A 364 12.597 103.279 5.282 1.00 0.00 H ATOM 5269 HD22 LEU A 364 11.532 101.941 5.777 1.00 0.00 H ATOM 5270 HD23 LEU A 364 11.474 102.554 4.106 1.00 0.00 H ATOM 5271 HD11 LEU A 364 9.737 105.706 4.857 1.00 0.00 H ATOM 5272 HD12 LEU A 364 11.512 105.586 4.773 1.00 0.00 H ATOM 5273 HD13 LEU A 364 10.504 104.713 3.593 1.00 0.00 H ATOM 5274 H LEU A 364 9.695 103.946 9.383 1.00 0.00 H ATOM 5275 N ASP A 365 13.742 103.295 7.751 1.00 42.83 N ATOM 5276 CA ASP A 365 15.112 103.790 7.809 1.00 43.22 C ATOM 5277 C ASP A 365 15.188 105.167 7.153 1.00 43.66 C ATOM 5278 O ASP A 365 14.560 105.404 6.121 1.00 43.46 O ATOM 5279 CB ASP A 365 16.065 102.831 7.095 1.00 43.22 C ATOM 5280 CG ASP A 365 17.523 103.174 7.331 1.00 42.88 C ATOM 5281 OD1 ASP A 365 18.048 102.843 8.414 1.00 42.45 O ATOM 5282 OD2 ASP A 365 18.148 103.763 6.430 1.00 43.21 O ATOM 5283 HA ASP A 365 15.410 103.863 8.855 1.00 0.00 H ATOM 5284 HB2 ASP A 365 15.881 101.820 7.459 1.00 0.00 H ATOM 5285 HB3 ASP A 365 15.865 102.873 6.024 1.00 0.00 H ATOM 5286 H ASP A 365 13.543 102.407 7.248 1.00 0.00 H ATOM 5287 N GLU A 366 15.963 106.066 7.754 1.00 44.26 N ATOM 5288 CA GLU A 366 16.101 107.428 7.237 1.00 44.75 C ATOM 5289 C GLU A 366 16.645 107.441 5.803 1.00 44.91 C ATOM 5290 O GLU A 366 16.302 108.325 5.013 1.00 44.95 O ATOM 5291 CB GLU A 366 16.987 108.268 8.163 1.00 44.87 C ATOM 5292 CG GLU A 366 18.460 107.877 8.151 1.00 45.54 C ATOM 5293 CD GLU A 366 19.182 108.214 9.449 1.00 45.74 C ATOM 5294 OE1 GLU A 366 20.121 107.470 9.810 1.00 47.00 O ATOM 5295 OE2 GLU A 366 18.813 109.213 10.108 1.00 47.06 O ATOM 5296 HA GLU A 366 15.106 107.872 7.210 1.00 0.00 H ATOM 5297 HB2 GLU A 366 16.908 109.311 7.856 1.00 0.00 H ATOM 5298 HB3 GLU A 366 16.614 108.161 9.182 1.00 0.00 H ATOM 5299 HG2 GLU A 366 18.532 106.802 7.983 1.00 0.00 H ATOM 5300 HG3 GLU A 366 18.952 108.405 7.334 1.00 0.00 H ATOM 5301 H GLU A 366 16.484 105.794 8.612 1.00 0.00 H ATOM 5302 N GLN A 367 17.464 106.446 5.462 1.00 45.07 N ATOM 5303 CA GLN A 367 18.050 106.353 4.123 1.00 45.13 C ATOM 5304 C GLN A 367 17.102 105.802 3.049 1.00 45.03 C ATOM 5305 O GLN A 367 17.492 105.711 1.890 1.00 45.11 O ATOM 5306 CB GLN A 367 19.334 105.519 4.157 1.00 45.30 C ATOM 5307 CG GLN A 367 20.322 105.954 5.241 1.00 45.73 C ATOM 5308 CD GLN A 367 21.750 105.532 4.949 1.00 45.76 C ATOM 5309 OE1 GLN A 367 22.387 104.858 5.760 1.00 46.45 O ATOM 5310 NE2 GLN A 367 22.260 105.924 3.783 1.00 46.37 N ATOM 5311 HA GLN A 367 18.269 107.381 3.833 1.00 0.00 H ATOM 5312 HB2 GLN A 367 19.064 104.478 4.335 1.00 0.00 H ATOM 5313 HB3 GLN A 367 19.826 105.605 3.188 1.00 0.00 H ATOM 5314 HG2 GLN A 367 20.291 107.040 5.323 1.00 0.00 H ATOM 5315 HG3 GLN A 367 20.016 105.510 6.188 1.00 0.00 H ATOM 5316 HE22 GLN A 367 21.685 106.492 3.129 1.00 0.00 H ATOM 5317 HE21 GLN A 367 23.233 105.662 3.527 1.00 0.00 H ATOM 5318 H GLN A 367 17.693 105.716 6.166 1.00 0.00 H ATOM 5319 N ALA A 368 15.879 105.422 3.421 1.00 44.83 N ATOM 5320 CA ALA A 368 14.854 105.036 2.439 1.00 44.72 C ATOM 5321 C ALA A 368 14.086 106.254 1.909 1.00 44.67 C ATOM 5322 O ALA A 368 13.310 106.140 0.958 1.00 44.73 O ATOM 5323 CB ALA A 368 13.888 104.042 3.047 1.00 44.74 C ATOM 5324 HA ALA A 368 15.368 104.572 1.597 1.00 0.00 H ATOM 5325 HB1 ALA A 368 14.434 103.152 3.360 1.00 0.00 H ATOM 5326 HB2 ALA A 368 13.400 104.493 3.911 1.00 0.00 H ATOM 5327 HB3 ALA A 368 13.137 103.768 2.306 1.00 0.00 H ATOM 5328 H ALA A 368 15.643 105.398 4.434 1.00 0.00 H ATOM 5329 N ALA A 369 14.299 107.402 2.551 1.00 44.41 N ATOM 5330 CA ALA A 369 13.703 108.684 2.170 1.00 44.10 C ATOM 5331 C ALA A 369 13.378 108.833 0.684 1.00 43.87 C ATOM 5332 O ALA A 369 14.268 108.771 -0.163 1.00 44.03 O ATOM 5333 CB ALA A 369 14.637 109.818 2.591 1.00 44.25 C ATOM 5334 HA ALA A 369 12.745 108.727 2.689 1.00 0.00 H ATOM 5335 HB1 ALA A 369 14.780 109.787 3.671 1.00 0.00 H ATOM 5336 HB2 ALA A 369 15.599 109.699 2.092 1.00 0.00 H ATOM 5337 HB3 ALA A 369 14.196 110.774 2.309 1.00 0.00 H ATOM 5338 H ALA A 369 14.930 107.386 3.377 1.00 0.00 H ATOM 5339 N GLY A 370 12.103 109.046 0.375 1.00 43.36 N ATOM 5340 CA GLY A 370 11.697 109.455 -0.968 1.00 42.94 C ATOM 5341 C GLY A 370 11.699 108.372 -2.030 1.00 42.58 C ATOM 5342 O GLY A 370 11.796 108.668 -3.224 1.00 42.55 O ATOM 5343 HA3 GLY A 370 12.376 110.242 -1.295 1.00 0.00 H ATOM 5344 HA2 GLY A 370 10.685 109.854 -0.902 1.00 0.00 H ATOM 5345 H GLY A 370 11.376 108.918 1.107 1.00 0.00 H ATOM 5346 N LEU A 371 11.603 107.116 -1.605 1.00 42.00 N ATOM 5347 CA LEU A 371 11.338 106.016 -2.524 1.00 41.46 C ATOM 5348 C LEU A 371 9.923 105.534 -2.246 1.00 40.95 C ATOM 5349 O LEU A 371 9.335 105.895 -1.226 1.00 41.05 O ATOM 5350 CB LEU A 371 12.351 104.886 -2.329 1.00 41.52 C ATOM 5351 CG LEU A 371 13.796 105.197 -2.736 1.00 41.58 C ATOM 5352 CD1 LEU A 371 14.747 104.182 -2.142 1.00 41.51 C ATOM 5353 CD2 LEU A 371 13.955 105.243 -4.246 1.00 41.86 C ATOM 5354 HA LEU A 371 11.433 106.347 -3.558 1.00 0.00 H ATOM 5355 HB2 LEU A 371 12.353 104.619 -1.272 1.00 0.00 H ATOM 5356 HB3 LEU A 371 12.015 104.032 -2.918 1.00 0.00 H ATOM 5357 HG LEU A 371 14.041 106.184 -2.343 1.00 0.00 H ATOM 5358 HD21 LEU A 371 13.678 104.277 -4.669 1.00 0.00 H ATOM 5359 HD22 LEU A 371 13.308 106.019 -4.655 1.00 0.00 H ATOM 5360 HD23 LEU A 371 14.993 105.466 -4.494 1.00 0.00 H ATOM 5361 HD11 LEU A 371 14.672 104.209 -1.055 1.00 0.00 H ATOM 5362 HD12 LEU A 371 14.485 103.187 -2.501 1.00 0.00 H ATOM 5363 HD13 LEU A 371 15.767 104.422 -2.443 1.00 0.00 H ATOM 5364 H LEU A 371 11.720 106.913 -0.592 1.00 0.00 H ATOM 5365 N ASN A 372 9.378 104.728 -3.150 1.00 40.27 N ATOM 5366 CA ASN A 372 8.011 104.230 -3.013 1.00 39.65 C ATOM 5367 C ASN A 372 7.996 102.803 -2.470 1.00 38.83 C ATOM 5368 O ASN A 372 7.760 101.842 -3.204 1.00 38.56 O ATOM 5369 CB ASN A 372 7.274 104.318 -4.352 1.00 39.87 C ATOM 5370 CG ASN A 372 7.428 105.676 -5.012 1.00 40.93 C ATOM 5371 OD1 ASN A 372 8.443 105.954 -5.652 1.00 42.70 O ATOM 5372 ND2 ASN A 372 6.420 106.529 -4.862 1.00 42.56 N ATOM 5373 HA ASN A 372 7.489 104.860 -2.293 1.00 0.00 H ATOM 5374 HB2 ASN A 372 7.673 103.556 -5.022 1.00 0.00 H ATOM 5375 HB3 ASN A 372 6.214 104.130 -4.181 1.00 0.00 H ATOM 5376 HD22 ASN A 372 5.581 106.252 -4.313 1.00 0.00 H ATOM 5377 HD21 ASN A 372 6.470 107.474 -5.294 1.00 0.00 H ATOM 5378 H ASN A 372 9.939 104.444 -3.978 1.00 0.00 H ATOM 5379 N ILE A 373 8.250 102.684 -1.170 1.00 37.93 N ATOM 5380 CA ILE A 373 8.275 101.393 -0.494 1.00 37.44 C ATOM 5381 C ILE A 373 6.852 101.041 -0.093 1.00 36.84 C ATOM 5382 O ILE A 373 6.281 101.650 0.816 1.00 36.85 O ATOM 5383 CB ILE A 373 9.177 101.406 0.760 1.00 37.45 C ATOM 5384 CG1 ILE A 373 10.623 101.735 0.380 1.00 37.64 C ATOM 5385 CG2 ILE A 373 9.123 100.057 1.494 1.00 37.66 C ATOM 5386 CD1 ILE A 373 10.945 103.204 0.477 1.00 38.45 C ATOM 5387 HA ILE A 373 8.688 100.652 -1.178 1.00 0.00 H ATOM 5388 HB ILE A 373 8.802 102.179 1.431 1.00 0.00 H ATOM 5389 HG12 ILE A 373 11.289 101.190 1.048 1.00 0.00 H ATOM 5390 HG13 ILE A 373 10.794 101.410 -0.646 1.00 0.00 H ATOM 5391 HD11 ILE A 373 10.293 103.763 -0.195 1.00 0.00 H ATOM 5392 HD12 ILE A 373 10.789 103.542 1.501 1.00 0.00 H ATOM 5393 HD13 ILE A 373 11.985 103.366 0.194 1.00 0.00 H ATOM 5394 HG21 ILE A 373 8.098 99.854 1.803 1.00 0.00 H ATOM 5395 HG22 ILE A 373 9.465 99.267 0.825 1.00 0.00 H ATOM 5396 HG23 ILE A 373 9.768 100.097 2.372 1.00 0.00 H ATOM 5397 H ILE A 373 8.438 103.544 -0.615 1.00 0.00 H ATOM 5398 N VAL A 374 6.287 100.050 -0.774 1.00 36.14 N ATOM 5399 CA VAL A 374 4.902 99.646 -0.558 1.00 35.63 C ATOM 5400 C VAL A 374 4.788 98.786 0.698 1.00 35.19 C ATOM 5401 O VAL A 374 5.315 97.674 0.750 1.00 35.23 O ATOM 5402 CB VAL A 374 4.360 98.899 -1.796 1.00 35.44 C ATOM 5403 CG1 VAL A 374 3.005 98.258 -1.514 1.00 35.33 C ATOM 5404 CG2 VAL A 374 4.263 99.863 -2.971 1.00 35.18 C ATOM 5405 HA VAL A 374 4.295 100.539 -0.411 1.00 0.00 H ATOM 5406 HB VAL A 374 5.053 98.095 -2.044 1.00 0.00 H ATOM 5407 HG11 VAL A 374 3.105 97.544 -0.696 1.00 0.00 H ATOM 5408 HG12 VAL A 374 2.289 99.032 -1.237 1.00 0.00 H ATOM 5409 HG13 VAL A 374 2.656 97.742 -2.408 1.00 0.00 H ATOM 5410 HG21 VAL A 374 3.588 100.679 -2.715 1.00 0.00 H ATOM 5411 HG22 VAL A 374 5.252 100.264 -3.193 1.00 0.00 H ATOM 5412 HG23 VAL A 374 3.880 99.333 -3.843 1.00 0.00 H ATOM 5413 H VAL A 374 6.852 99.545 -1.486 1.00 0.00 H ATOM 5414 N THR A 375 4.084 99.308 1.700 1.00 34.84 N ATOM 5415 CA THR A 375 3.977 98.659 3.012 1.00 34.68 C ATOM 5416 C THR A 375 2.597 98.049 3.316 1.00 34.39 C ATOM 5417 O THR A 375 2.411 97.438 4.365 1.00 33.99 O ATOM 5418 CB THR A 375 4.356 99.651 4.133 1.00 34.63 C ATOM 5419 OG1 THR A 375 3.505 100.804 4.070 1.00 34.43 O ATOM 5420 CG2 THR A 375 5.807 100.087 3.976 1.00 34.36 C ATOM 5421 HA THR A 375 4.678 97.825 2.976 1.00 0.00 H ATOM 5422 HB THR A 375 4.230 99.157 5.096 1.00 0.00 H ATOM 5423 HG1 THR A 375 2.562 100.524 4.185 1.00 0.00 H ATOM 5424 HG23 THR A 375 6.455 99.212 4.024 1.00 0.00 H ATOM 5425 HG21 THR A 375 5.934 100.583 3.014 1.00 0.00 H ATOM 5426 HG22 THR A 375 6.067 100.777 4.779 1.00 0.00 H ATOM 5427 H THR A 375 3.591 100.211 1.547 1.00 0.00 H ATOM 5428 N GLU A 376 1.637 98.227 2.412 1.00 34.32 N ATOM 5429 CA GLU A 376 0.345 97.534 2.499 1.00 34.45 C ATOM 5430 C GLU A 376 -0.027 96.980 1.128 1.00 34.09 C ATOM 5431 O GLU A 376 0.349 97.549 0.111 1.00 34.04 O ATOM 5432 CB GLU A 376 -0.781 98.440 3.045 1.00 34.82 C ATOM 5433 CG GLU A 376 -0.630 99.956 2.826 1.00 36.22 C ATOM 5434 CD GLU A 376 -0.166 100.693 4.089 1.00 38.85 C ATOM 5435 OE1 GLU A 376 1.023 100.572 4.470 1.00 39.49 O ATOM 5436 OE2 GLU A 376 -1.001 101.400 4.704 1.00 40.47 O ATOM 5437 HA GLU A 376 0.455 96.716 3.211 1.00 0.00 H ATOM 5438 HB2 GLU A 376 -1.712 98.130 2.569 1.00 0.00 H ATOM 5439 HB3 GLU A 376 -0.849 98.268 4.119 1.00 0.00 H ATOM 5440 HG2 GLU A 376 0.102 100.123 2.036 1.00 0.00 H ATOM 5441 HG3 GLU A 376 -1.594 100.362 2.519 1.00 0.00 H ATOM 5442 H GLU A 376 1.807 98.878 1.619 1.00 0.00 H ATOM 5443 N THR A 377 -0.744 95.859 1.108 1.00 33.70 N ATOM 5444 CA THR A 377 -1.154 95.231 -0.149 1.00 33.52 C ATOM 5445 C THR A 377 -1.971 96.218 -0.982 1.00 33.43 C ATOM 5446 O THR A 377 -2.968 96.761 -0.502 1.00 33.48 O ATOM 5447 CB THR A 377 -1.998 93.964 0.096 1.00 33.45 C ATOM 5448 OG1 THR A 377 -1.315 93.090 1.004 1.00 32.55 O ATOM 5449 CG2 THR A 377 -2.265 93.224 -1.218 1.00 33.76 C ATOM 5450 HA THR A 377 -0.248 94.945 -0.683 1.00 0.00 H ATOM 5451 HB THR A 377 -2.952 94.269 0.527 1.00 0.00 H ATOM 5452 HG1 THR A 377 -1.863 92.280 1.156 1.00 0.00 H ATOM 5453 HG23 THR A 377 -2.784 93.888 -1.909 1.00 0.00 H ATOM 5454 HG21 THR A 377 -1.317 92.911 -1.656 1.00 0.00 H ATOM 5455 HG22 THR A 377 -2.883 92.348 -1.021 1.00 0.00 H ATOM 5456 H THR A 377 -1.020 95.418 2.008 1.00 0.00 H ATOM 5457 N THR A 378 -1.537 96.474 -2.213 1.00 33.25 N ATOM 5458 CA THR A 378 -2.249 97.409 -3.079 1.00 33.19 C ATOM 5459 C THR A 378 -2.443 96.810 -4.467 1.00 33.10 C ATOM 5460 O THR A 378 -1.486 96.399 -5.123 1.00 32.93 O ATOM 5461 CB THR A 378 -1.559 98.815 -3.178 1.00 33.13 C ATOM 5462 OG1 THR A 378 -0.993 99.018 -4.478 1.00 33.40 O ATOM 5463 CG2 THR A 378 -0.492 99.001 -2.118 1.00 32.83 C ATOM 5464 HA THR A 378 -3.222 97.576 -2.616 1.00 0.00 H ATOM 5465 HB THR A 378 -2.337 99.559 -3.007 1.00 0.00 H ATOM 5466 HG1 THR A 378 -0.316 98.318 -4.655 1.00 0.00 H ATOM 5467 HG23 THR A 378 -0.930 98.845 -1.132 1.00 0.00 H ATOM 5468 HG21 THR A 378 0.309 98.279 -2.280 1.00 0.00 H ATOM 5469 HG22 THR A 378 -0.090 100.012 -2.183 1.00 0.00 H ATOM 5470 H THR A 378 -0.679 96.002 -2.563 1.00 0.00 H ATOM 5471 N ASP A 379 -3.701 96.766 -4.895 1.00 33.14 N ATOM 5472 CA ASP A 379 -4.060 96.303 -6.230 1.00 33.11 C ATOM 5473 C ASP A 379 -3.581 97.320 -7.264 1.00 32.94 C ATOM 5474 O ASP A 379 -3.829 98.516 -7.126 1.00 32.81 O ATOM 5475 CB ASP A 379 -5.580 96.108 -6.332 1.00 33.09 C ATOM 5476 CG ASP A 379 -6.115 95.124 -5.299 1.00 33.94 C ATOM 5477 OD1 ASP A 379 -7.239 95.328 -4.791 1.00 34.74 O ATOM 5478 OD2 ASP A 379 -5.403 94.146 -4.980 1.00 35.63 O ATOM 5479 HA ASP A 379 -3.579 95.344 -6.423 1.00 0.00 H ATOM 5480 HB2 ASP A 379 -6.067 97.072 -6.182 1.00 0.00 H ATOM 5481 HB3 ASP A 379 -5.818 95.733 -7.328 1.00 0.00 H ATOM 5482 H ASP A 379 -4.459 97.074 -4.252 1.00 0.00 H ATOM 5483 N ARG A 380 -2.873 96.837 -8.282 1.00 32.93 N ATOM 5484 CA ARG A 380 -2.429 97.673 -9.397 1.00 32.92 C ATOM 5485 C ARG A 380 -2.308 96.839 -10.669 1.00 32.95 C ATOM 5486 O ARG A 380 -2.032 95.642 -10.616 1.00 33.08 O ATOM 5487 CB ARG A 380 -1.083 98.341 -9.089 1.00 32.85 C ATOM 5488 CG ARG A 380 -0.728 99.496 -10.035 1.00 32.96 C ATOM 5489 CD ARG A 380 0.431 100.360 -9.512 1.00 32.99 C ATOM 5490 NE ARG A 380 0.100 101.017 -8.244 1.00 33.53 N ATOM 5491 CZ ARG A 380 0.972 101.628 -7.438 1.00 32.93 C ATOM 5492 NH1 ARG A 380 2.265 101.698 -7.743 1.00 32.70 N ATOM 5493 NH2 ARG A 380 0.543 102.178 -6.308 1.00 32.63 N ATOM 5494 HA ARG A 380 -3.176 98.453 -9.545 1.00 0.00 H ATOM 5495 HB2 ARG A 380 -1.118 98.730 -8.071 1.00 0.00 H ATOM 5496 HB3 ARG A 380 -0.301 97.586 -9.161 1.00 0.00 H ATOM 5497 HG2 ARG A 380 -0.444 99.080 -11.002 1.00 0.00 H ATOM 5498 HG3 ARG A 380 -1.607 100.129 -10.157 1.00 0.00 H ATOM 5499 HD2 ARG A 380 0.663 101.124 -10.254 1.00 0.00 H ATOM 5500 HD3 ARG A 380 1.304 99.724 -9.362 1.00 0.00 H ATOM 5501 HE ARG A 380 -0.897 101.006 -7.947 1.00 0.00 H ATOM 5502 HH12 ARG A 380 2.926 102.179 -7.100 1.00 0.00 H ATOM 5503 HH11 ARG A 380 2.615 101.272 -8.625 1.00 0.00 H ATOM 5504 HH22 ARG A 380 1.215 102.656 -5.674 1.00 0.00 H ATOM 5505 HH21 ARG A 380 -0.465 102.131 -6.057 1.00 0.00 H ATOM 5506 H ARG A 380 -2.626 95.827 -8.285 1.00 0.00 H ATOM 5507 N GLU A 381 -2.513 97.489 -11.808 1.00 32.95 N ATOM 5508 CA GLU A 381 -2.351 96.858 -13.108 1.00 32.67 C ATOM 5509 C GLU A 381 -0.890 97.003 -13.546 1.00 32.25 C ATOM 5510 O GLU A 381 -0.510 97.990 -14.183 1.00 32.41 O ATOM 5511 CB GLU A 381 -3.298 97.512 -14.115 1.00 32.88 C ATOM 5512 CG GLU A 381 -3.205 96.996 -15.552 1.00 33.61 C ATOM 5513 CD GLU A 381 -3.679 98.036 -16.573 1.00 34.47 C ATOM 5514 OE1 GLU A 381 -4.660 98.765 -16.287 1.00 36.57 O ATOM 5515 OE2 GLU A 381 -3.062 98.129 -17.661 1.00 37.39 O ATOM 5516 HA GLU A 381 -2.598 95.798 -13.052 1.00 0.00 H ATOM 5517 HB2 GLU A 381 -4.318 97.351 -13.767 1.00 0.00 H ATOM 5518 HB3 GLU A 381 -3.085 98.581 -14.129 1.00 0.00 H ATOM 5519 HG2 GLU A 381 -2.167 96.740 -15.767 1.00 0.00 H ATOM 5520 HG3 GLU A 381 -3.825 96.104 -15.646 1.00 0.00 H ATOM 5521 H GLU A 381 -2.800 98.488 -11.769 1.00 0.00 H ATOM 5522 N LEU A 382 -0.078 96.007 -13.195 1.00 31.40 N ATOM 5523 CA LEU A 382 1.339 95.992 -13.549 1.00 30.60 C ATOM 5524 C LEU A 382 1.553 95.411 -14.936 1.00 29.89 C ATOM 5525 O LEU A 382 0.808 94.534 -15.371 1.00 30.01 O ATOM 5526 CB LEU A 382 2.129 95.163 -12.539 1.00 30.62 C ATOM 5527 CG LEU A 382 1.941 95.531 -11.068 1.00 30.66 C ATOM 5528 CD1 LEU A 382 2.699 94.546 -10.200 1.00 30.58 C ATOM 5529 CD2 LEU A 382 2.395 96.964 -10.810 1.00 30.40 C ATOM 5530 HA LEU A 382 1.691 97.024 -13.538 1.00 0.00 H ATOM 5531 HB2 LEU A 382 1.834 94.121 -12.661 1.00 0.00 H ATOM 5532 HB3 LEU A 382 3.187 95.270 -12.776 1.00 0.00 H ATOM 5533 HG LEU A 382 0.883 95.475 -10.814 1.00 0.00 H ATOM 5534 HD21 LEU A 382 3.450 97.061 -11.067 1.00 0.00 H ATOM 5535 HD22 LEU A 382 1.806 97.646 -11.423 1.00 0.00 H ATOM 5536 HD23 LEU A 382 2.252 97.205 -9.757 1.00 0.00 H ATOM 5537 HD11 LEU A 382 2.317 93.540 -10.375 1.00 0.00 H ATOM 5538 HD12 LEU A 382 3.759 94.582 -10.452 1.00 0.00 H ATOM 5539 HD13 LEU A 382 2.564 94.809 -9.151 1.00 0.00 H ATOM 5540 H LEU A 382 -0.467 95.212 -12.649 1.00 0.00 H ATOM 5541 N THR A 383 2.590 95.899 -15.612 1.00 28.94 N ATOM 5542 CA THR A 383 2.987 95.419 -16.938 1.00 28.39 C ATOM 5543 C THR A 383 4.395 94.816 -16.915 1.00 27.62 C ATOM 5544 O THR A 383 4.631 93.751 -17.493 1.00 27.20 O ATOM 5545 CB THR A 383 2.973 96.578 -17.961 1.00 28.31 C ATOM 5546 OG1 THR A 383 1.725 97.275 -17.880 1.00 29.08 O ATOM 5547 CG2 THR A 383 3.162 96.073 -19.385 1.00 28.72 C ATOM 5548 HA THR A 383 2.270 94.651 -17.228 1.00 0.00 H ATOM 5549 HB THR A 383 3.801 97.244 -17.718 1.00 0.00 H ATOM 5550 HG1 THR A 383 1.719 98.016 -18.536 1.00 0.00 H ATOM 5551 HG23 THR A 383 4.110 95.540 -19.457 1.00 0.00 H ATOM 5552 HG21 THR A 383 2.345 95.399 -19.642 1.00 0.00 H ATOM 5553 HG22 THR A 383 3.166 96.919 -20.072 1.00 0.00 H ATOM 5554 H THR A 383 3.148 96.661 -15.176 1.00 0.00 H ATOM 5555 N THR A 384 5.320 95.516 -16.255 1.00 26.87 N ATOM 5556 CA THR A 384 6.745 95.195 -16.269 1.00 26.37 C ATOM 5557 C THR A 384 7.313 95.199 -14.848 1.00 25.86 C ATOM 5558 O THR A 384 7.283 96.225 -14.162 1.00 25.57 O ATOM 5559 CB THR A 384 7.512 96.239 -17.096 1.00 26.47 C ATOM 5560 OG1 THR A 384 6.887 96.395 -18.376 1.00 26.23 O ATOM 5561 CG2 THR A 384 8.979 95.839 -17.283 1.00 26.73 C ATOM 5562 HA THR A 384 6.861 94.204 -16.709 1.00 0.00 H ATOM 5563 HB THR A 384 7.487 97.184 -16.554 1.00 0.00 H ATOM 5564 HG1 THR A 384 7.384 97.068 -18.905 1.00 0.00 H ATOM 5565 HG23 THR A 384 9.450 95.722 -16.307 1.00 0.00 H ATOM 5566 HG21 THR A 384 9.031 94.897 -17.828 1.00 0.00 H ATOM 5567 HG22 THR A 384 9.497 96.615 -17.846 1.00 0.00 H ATOM 5568 H THR A 384 5.008 96.337 -15.699 1.00 0.00 H ATOM 5569 N VAL A 385 7.846 94.056 -14.420 1.00 25.21 N ATOM 5570 CA VAL A 385 8.395 93.909 -13.071 1.00 24.79 C ATOM 5571 C VAL A 385 9.879 93.529 -13.089 1.00 24.25 C ATOM 5572 O VAL A 385 10.379 92.970 -14.067 1.00 23.92 O ATOM 5573 CB VAL A 385 7.598 92.877 -12.226 1.00 24.72 C ATOM 5574 CG1 VAL A 385 6.149 93.305 -12.114 1.00 25.10 C ATOM 5575 CG2 VAL A 385 7.687 91.477 -12.821 1.00 24.59 C ATOM 5576 HA VAL A 385 8.298 94.888 -12.601 1.00 0.00 H ATOM 5577 HB VAL A 385 8.043 92.845 -11.232 1.00 0.00 H ATOM 5578 HG11 VAL A 385 6.096 94.281 -11.631 1.00 0.00 H ATOM 5579 HG12 VAL A 385 5.712 93.367 -13.111 1.00 0.00 H ATOM 5580 HG13 VAL A 385 5.601 92.574 -11.520 1.00 0.00 H ATOM 5581 HG21 VAL A 385 7.277 91.486 -13.831 1.00 0.00 H ATOM 5582 HG22 VAL A 385 8.730 91.163 -12.854 1.00 0.00 H ATOM 5583 HG23 VAL A 385 7.117 90.784 -12.202 1.00 0.00 H ATOM 5584 H VAL A 385 7.873 93.241 -15.065 1.00 0.00 H ATOM 5585 N MET A 386 10.565 93.844 -11.989 1.00 23.69 N ATOM 5586 CA MET A 386 11.999 93.602 -11.853 1.00 23.40 C ATOM 5587 C MET A 386 12.316 92.925 -10.521 1.00 22.86 C ATOM 5588 O MET A 386 11.739 93.256 -9.488 1.00 22.56 O ATOM 5589 CB MET A 386 12.771 94.917 -11.961 1.00 23.32 C ATOM 5590 CG MET A 386 14.267 94.782 -11.731 1.00 23.56 C ATOM 5591 SD MET A 386 15.127 96.354 -11.865 1.00 24.02 S ATOM 5592 CE MET A 386 15.475 96.382 -13.605 1.00 23.06 C ATOM 5593 HA MET A 386 12.306 92.938 -12.661 1.00 0.00 H ATOM 5594 HB2 MET A 386 12.614 95.325 -12.959 1.00 0.00 H ATOM 5595 HB3 MET A 386 12.372 95.610 -11.220 1.00 0.00 H ATOM 5596 HG2 MET A 386 14.675 94.096 -12.473 1.00 0.00 H ATOM 5597 HG3 MET A 386 14.433 94.376 -10.733 1.00 0.00 H ATOM 5598 HE1 MET A 386 16.090 95.520 -13.865 1.00 0.00 H ATOM 5599 HE2 MET A 386 14.539 96.344 -14.162 1.00 0.00 H ATOM 5600 HE3 MET A 386 16.009 97.299 -13.853 1.00 0.00 H ATOM 5601 H MET A 386 10.057 94.281 -11.194 1.00 0.00 H ATOM 5602 N SER A 387 13.254 91.983 -10.561 1.00 22.42 N ATOM 5603 CA SER A 387 13.660 91.239 -9.378 1.00 22.27 C ATOM 5604 C SER A 387 15.187 91.237 -9.271 1.00 22.07 C ATOM 5605 O SER A 387 15.880 90.947 -10.244 1.00 21.64 O ATOM 5606 CB SER A 387 13.122 89.804 -9.451 1.00 22.09 C ATOM 5607 OG SER A 387 13.035 89.223 -8.165 1.00 21.41 O ATOM 5608 HA SER A 387 13.247 91.717 -8.490 1.00 0.00 H ATOM 5609 HB2 SER A 387 13.791 89.204 -10.068 1.00 0.00 H ATOM 5610 HB3 SER A 387 12.130 89.819 -9.902 1.00 0.00 H ATOM 5611 HG SER A 387 13.934 89.202 -7.752 1.00 0.00 H ATOM 5612 H SER A 387 13.713 91.771 -11.470 1.00 0.00 H ATOM 5613 N ASN A 388 15.693 91.557 -8.082 1.00 22.18 N ATOM 5614 CA ASN A 388 17.132 91.621 -7.825 1.00 22.24 C ATOM 5615 C ASN A 388 17.573 90.501 -6.907 1.00 22.20 C ATOM 5616 O ASN A 388 16.954 90.275 -5.862 1.00 21.78 O ATOM 5617 CB ASN A 388 17.500 92.950 -7.158 1.00 22.17 C ATOM 5618 CG ASN A 388 17.444 94.133 -8.113 1.00 22.19 C ATOM 5619 OD1 ASN A 388 17.414 93.971 -9.334 1.00 22.07 O ATOM 5620 ND2 ASN A 388 17.454 95.340 -7.550 1.00 21.31 N ATOM 5621 HA ASN A 388 17.634 91.528 -8.788 1.00 0.00 H ATOM 5622 HB2 ASN A 388 16.804 93.132 -6.339 1.00 0.00 H ATOM 5623 HB3 ASN A 388 18.512 92.871 -6.762 1.00 0.00 H ATOM 5624 HD22 ASN A 388 17.480 95.430 -6.514 1.00 0.00 H ATOM 5625 HD21 ASN A 388 17.436 96.192 -8.146 1.00 0.00 H ATOM 5626 H ASN A 388 15.038 91.770 -7.303 1.00 0.00 H ATOM 5627 N SER A 389 18.646 89.812 -7.299 1.00 22.54 N ATOM 5628 CA SER A 389 19.305 88.821 -6.450 1.00 22.89 C ATOM 5629 C SER A 389 20.806 89.095 -6.410 1.00 23.19 C ATOM 5630 O SER A 389 21.480 89.028 -7.434 1.00 23.29 O ATOM 5631 CB SER A 389 19.049 87.404 -6.965 1.00 22.81 C ATOM 5632 OG SER A 389 17.671 87.183 -7.196 1.00 23.13 O ATOM 5633 HA SER A 389 18.893 88.899 -5.444 1.00 0.00 H ATOM 5634 HB2 SER A 389 19.405 86.687 -6.225 1.00 0.00 H ATOM 5635 HB3 SER A 389 19.593 87.261 -7.898 1.00 0.00 H ATOM 5636 HG SER A 389 17.343 87.828 -7.871 1.00 0.00 H ATOM 5637 H SER A 389 19.030 89.987 -8.249 1.00 0.00 H ATOM 5638 N PHE A 390 21.319 89.402 -5.222 1.00 23.62 N ATOM 5639 CA PHE A 390 22.743 89.683 -5.026 1.00 23.87 C ATOM 5640 C PHE A 390 23.309 88.680 -4.033 1.00 24.04 C ATOM 5641 O PHE A 390 22.678 88.394 -3.023 1.00 24.64 O ATOM 5642 CB PHE A 390 22.946 91.111 -4.508 1.00 24.30 C ATOM 5643 CG PHE A 390 22.230 92.165 -5.318 1.00 24.36 C ATOM 5644 CD1 PHE A 390 22.336 92.193 -6.703 1.00 25.30 C ATOM 5645 CD2 PHE A 390 21.457 93.137 -4.693 1.00 25.52 C ATOM 5646 CE1 PHE A 390 21.674 93.171 -7.460 1.00 25.27 C ATOM 5647 CE2 PHE A 390 20.794 94.122 -5.440 1.00 25.21 C ATOM 5648 CZ PHE A 390 20.908 94.138 -6.825 1.00 24.96 C ATOM 5649 HA PHE A 390 23.263 89.594 -5.980 1.00 0.00 H ATOM 5650 HB2 PHE A 390 22.580 91.159 -3.482 1.00 0.00 H ATOM 5651 HB3 PHE A 390 24.013 91.333 -4.523 1.00 0.00 H ATOM 5652 HD2 PHE A 390 21.365 93.134 -3.607 1.00 0.00 H ATOM 5653 HE2 PHE A 390 20.189 94.875 -4.934 1.00 0.00 H ATOM 5654 HZ PHE A 390 20.399 94.905 -7.409 1.00 0.00 H ATOM 5655 HE1 PHE A 390 21.761 93.171 -8.546 1.00 0.00 H ATOM 5656 HD1 PHE A 390 22.943 91.443 -7.210 1.00 0.00 H ATOM 5657 H PHE A 390 20.684 89.444 -4.400 1.00 0.00 H ATOM 5658 N GLY A 391 24.488 88.137 -4.320 1.00 23.86 N ATOM 5659 CA GLY A 391 25.080 87.110 -3.465 1.00 23.66 C ATOM 5660 C GLY A 391 26.458 87.441 -2.933 1.00 23.63 C ATOM 5661 O GLY A 391 27.139 88.338 -3.442 1.00 23.62 O ATOM 5662 HA3 GLY A 391 25.152 86.188 -4.042 1.00 0.00 H ATOM 5663 HA2 GLY A 391 24.417 86.953 -2.614 1.00 0.00 H ATOM 5664 H GLY A 391 24.999 88.449 -5.170 1.00 0.00 H ATOM 5665 N PHE A 392 26.865 86.700 -1.900 1.00 23.64 N ATOM 5666 CA PHE A 392 28.235 86.751 -1.389 1.00 23.21 C ATOM 5667 C PHE A 392 29.192 86.493 -2.530 1.00 22.74 C ATOM 5668 O PHE A 392 28.874 85.738 -3.453 1.00 22.75 O ATOM 5669 CB PHE A 392 28.475 85.688 -0.303 1.00 24.10 C ATOM 5670 CG PHE A 392 27.797 85.969 1.015 1.00 24.53 C ATOM 5671 CD1 PHE A 392 27.254 87.217 1.314 1.00 25.11 C ATOM 5672 CD2 PHE A 392 27.738 84.977 1.981 1.00 25.53 C ATOM 5673 CE1 PHE A 392 26.639 87.453 2.541 1.00 25.30 C ATOM 5674 CE2 PHE A 392 27.126 85.210 3.209 1.00 25.74 C ATOM 5675 CZ PHE A 392 26.574 86.455 3.487 1.00 25.38 C ATOM 5676 HA PHE A 392 28.397 87.736 -0.951 1.00 0.00 H ATOM 5677 HB2 PHE A 392 28.109 84.732 -0.677 1.00 0.00 H ATOM 5678 HB3 PHE A 392 29.548 85.620 -0.125 1.00 0.00 H ATOM 5679 HD2 PHE A 392 28.177 84.001 1.776 1.00 0.00 H ATOM 5680 HE2 PHE A 392 27.079 84.415 3.954 1.00 0.00 H ATOM 5681 HZ PHE A 392 26.093 86.640 4.447 1.00 0.00 H ATOM 5682 HE1 PHE A 392 26.208 88.431 2.753 1.00 0.00 H ATOM 5683 HD1 PHE A 392 27.311 88.019 0.578 1.00 0.00 H ATOM 5684 H PHE A 392 26.183 86.063 -1.441 1.00 0.00 H ATOM 5685 N GLY A 393 30.368 87.111 -2.454 1.00 21.91 N ATOM 5686 CA GLY A 393 31.337 87.064 -3.538 1.00 21.34 C ATOM 5687 C GLY A 393 31.096 88.128 -4.587 1.00 20.74 C ATOM 5688 O GLY A 393 31.755 88.135 -5.624 1.00 20.79 O ATOM 5689 HA3 GLY A 393 31.280 86.085 -4.015 1.00 0.00 H ATOM 5690 HA2 GLY A 393 32.334 87.206 -3.121 1.00 0.00 H ATOM 5691 H GLY A 393 30.602 87.644 -1.592 1.00 0.00 H ATOM 5692 N GLY A 394 30.132 89.010 -4.329 1.00 20.11 N ATOM 5693 CA GLY A 394 29.856 90.151 -5.197 1.00 19.72 C ATOM 5694 C GLY A 394 29.160 89.769 -6.488 1.00 19.27 C ATOM 5695 O GLY A 394 29.353 90.418 -7.511 1.00 19.34 O ATOM 5696 HA3 GLY A 394 30.801 90.635 -5.443 1.00 0.00 H ATOM 5697 HA2 GLY A 394 29.221 90.852 -4.656 1.00 0.00 H ATOM 5698 H GLY A 394 29.553 88.881 -3.475 1.00 0.00 H ATOM 5699 N THR A 395 28.335 88.729 -6.434 1.00 18.57 N ATOM 5700 CA THR A 395 27.674 88.209 -7.628 1.00 18.27 C ATOM 5701 C THR A 395 26.243 88.748 -7.722 1.00 17.82 C ATOM 5702 O THR A 395 25.449 88.580 -6.802 1.00 17.96 O ATOM 5703 CB THR A 395 27.707 86.652 -7.685 1.00 18.13 C ATOM 5704 OG1 THR A 395 27.050 86.205 -8.872 1.00 18.38 O ATOM 5705 CG2 THR A 395 27.042 86.007 -6.467 1.00 18.18 C ATOM 5706 HA THR A 395 28.230 88.561 -8.497 1.00 0.00 H ATOM 5707 HB THR A 395 28.754 86.349 -7.687 1.00 0.00 H ATOM 5708 HG1 THR A 395 27.515 86.575 -9.664 1.00 0.00 H ATOM 5709 HG23 THR A 395 27.542 86.346 -5.560 1.00 0.00 H ATOM 5710 HG21 THR A 395 25.991 86.294 -6.434 1.00 0.00 H ATOM 5711 HG22 THR A 395 27.121 84.923 -6.543 1.00 0.00 H ATOM 5712 H THR A 395 28.155 88.273 -5.517 1.00 0.00 H ATOM 5713 N ASN A 396 25.935 89.394 -8.845 1.00 17.43 N ATOM 5714 CA ASN A 396 24.676 90.103 -9.039 1.00 17.22 C ATOM 5715 C ASN A 396 23.840 89.540 -10.193 1.00 17.02 C ATOM 5716 O ASN A 396 24.350 89.345 -11.303 1.00 16.52 O ATOM 5717 CB ASN A 396 24.963 91.579 -9.315 1.00 17.12 C ATOM 5718 CG ASN A 396 25.902 92.200 -8.285 1.00 17.34 C ATOM 5719 OD1 ASN A 396 25.743 91.993 -7.078 1.00 17.76 O ATOM 5720 ND2 ASN A 396 26.886 92.960 -8.760 1.00 15.71 N ATOM 5721 HA ASN A 396 24.098 89.975 -8.124 1.00 0.00 H ATOM 5722 HB2 ASN A 396 25.419 91.667 -10.301 1.00 0.00 H ATOM 5723 HB3 ASN A 396 24.020 92.126 -9.302 1.00 0.00 H ATOM 5724 HD22 ASN A 396 26.981 93.107 -9.785 1.00 0.00 H ATOM 5725 HD21 ASN A 396 27.560 93.407 -8.106 1.00 0.00 H ATOM 5726 H ASN A 396 26.627 89.393 -9.622 1.00 0.00 H ATOM 5727 N ALA A 397 22.558 89.288 -9.922 1.00 16.73 N ATOM 5728 CA ALA A 397 21.588 88.944 -10.968 1.00 16.84 C ATOM 5729 C ALA A 397 20.316 89.798 -10.856 1.00 16.66 C ATOM 5730 O ALA A 397 19.845 90.092 -9.754 1.00 15.91 O ATOM 5731 CB ALA A 397 21.233 87.458 -10.910 1.00 16.93 C ATOM 5732 HA ALA A 397 22.054 89.156 -11.930 1.00 0.00 H ATOM 5733 HB1 ALA A 397 22.135 86.864 -11.057 1.00 0.00 H ATOM 5734 HB2 ALA A 397 20.799 87.227 -9.937 1.00 0.00 H ATOM 5735 HB3 ALA A 397 20.513 87.227 -11.695 1.00 0.00 H ATOM 5736 H ALA A 397 22.235 89.337 -8.935 1.00 0.00 H ATOM 5737 N THR A 398 19.787 90.202 -12.011 1.00 16.59 N ATOM 5738 CA THR A 398 18.542 90.956 -12.086 1.00 17.05 C ATOM 5739 C THR A 398 17.714 90.403 -13.235 1.00 17.10 C ATOM 5740 O THR A 398 18.240 90.192 -14.326 1.00 16.95 O ATOM 5741 CB THR A 398 18.791 92.491 -12.311 1.00 17.05 C ATOM 5742 OG1 THR A 398 19.473 93.050 -11.181 1.00 17.56 O ATOM 5743 CG2 THR A 398 17.479 93.249 -12.502 1.00 16.68 C ATOM 5744 HA THR A 398 18.018 90.849 -11.137 1.00 0.00 H ATOM 5745 HB THR A 398 19.396 92.592 -13.212 1.00 0.00 H ATOM 5746 HG1 THR A 398 18.921 92.925 -10.369 1.00 0.00 H ATOM 5747 HG23 THR A 398 16.945 92.838 -13.358 1.00 0.00 H ATOM 5748 HG21 THR A 398 16.867 93.145 -11.606 1.00 0.00 H ATOM 5749 HG22 THR A 398 17.692 94.303 -12.677 1.00 0.00 H ATOM 5750 H THR A 398 20.283 89.970 -12.895 1.00 0.00 H ATOM 5751 N LEU A 399 16.426 90.172 -12.986 1.00 17.52 N ATOM 5752 CA LEU A 399 15.493 89.736 -14.030 1.00 17.87 C ATOM 5753 C LEU A 399 14.394 90.778 -14.215 1.00 18.25 C ATOM 5754 O LEU A 399 13.862 91.313 -13.243 1.00 18.11 O ATOM 5755 CB LEU A 399 14.873 88.378 -13.687 1.00 17.60 C ATOM 5756 CG LEU A 399 15.843 87.198 -13.530 1.00 17.63 C ATOM 5757 CD1 LEU A 399 15.171 86.015 -12.842 1.00 17.39 C ATOM 5758 CD2 LEU A 399 16.411 86.777 -14.878 1.00 18.28 C ATOM 5759 HA LEU A 399 16.051 89.629 -14.960 1.00 0.00 H ATOM 5760 HB2 LEU A 399 14.332 88.489 -12.747 1.00 0.00 H ATOM 5761 HB3 LEU A 399 14.170 88.125 -14.481 1.00 0.00 H ATOM 5762 HG LEU A 399 16.666 87.532 -12.898 1.00 0.00 H ATOM 5763 HD21 LEU A 399 15.596 86.476 -15.536 1.00 0.00 H ATOM 5764 HD22 LEU A 399 16.948 87.615 -15.322 1.00 0.00 H ATOM 5765 HD23 LEU A 399 17.095 85.940 -14.737 1.00 0.00 H ATOM 5766 HD11 LEU A 399 14.830 86.318 -11.852 1.00 0.00 H ATOM 5767 HD12 LEU A 399 14.319 85.687 -13.437 1.00 0.00 H ATOM 5768 HD13 LEU A 399 15.886 85.198 -12.747 1.00 0.00 H ATOM 5769 H LEU A 399 16.070 90.305 -12.018 1.00 0.00 H ATOM 5770 N VAL A 400 14.080 91.071 -15.472 1.00 18.88 N ATOM 5771 CA VAL A 400 12.945 91.910 -15.824 1.00 19.54 C ATOM 5772 C VAL A 400 11.993 91.077 -16.670 1.00 20.09 C ATOM 5773 O VAL A 400 12.366 90.577 -17.730 1.00 20.07 O ATOM 5774 CB VAL A 400 13.376 93.192 -16.570 1.00 19.40 C ATOM 5775 CG1 VAL A 400 12.160 93.978 -17.060 1.00 19.20 C ATOM 5776 CG2 VAL A 400 14.218 94.064 -15.661 1.00 19.13 C ATOM 5777 HA VAL A 400 12.449 92.246 -14.913 1.00 0.00 H ATOM 5778 HB VAL A 400 13.966 92.896 -17.437 1.00 0.00 H ATOM 5779 HG11 VAL A 400 11.578 93.357 -17.740 1.00 0.00 H ATOM 5780 HG12 VAL A 400 11.544 94.261 -16.207 1.00 0.00 H ATOM 5781 HG13 VAL A 400 12.495 94.875 -17.581 1.00 0.00 H ATOM 5782 HG21 VAL A 400 13.635 94.339 -14.782 1.00 0.00 H ATOM 5783 HG22 VAL A 400 15.106 93.513 -15.352 1.00 0.00 H ATOM 5784 HG23 VAL A 400 14.516 94.965 -16.198 1.00 0.00 H ATOM 5785 H VAL A 400 14.670 90.685 -16.236 1.00 0.00 H ATOM 5786 N MET A 401 10.769 90.935 -16.169 1.00 21.15 N ATOM 5787 CA MET A 401 9.727 90.117 -16.780 1.00 21.98 C ATOM 5788 C MET A 401 8.530 90.994 -17.137 1.00 22.20 C ATOM 5789 O MET A 401 8.100 91.809 -16.318 1.00 21.95 O ATOM 5790 CB MET A 401 9.284 89.045 -15.792 1.00 21.95 C ATOM 5791 CG MET A 401 10.373 88.052 -15.437 1.00 22.51 C ATOM 5792 SD MET A 401 10.035 87.212 -13.886 1.00 24.47 S ATOM 5793 CE MET A 401 10.389 88.479 -12.665 1.00 24.71 C ATOM 5794 HA MET A 401 10.118 89.649 -17.683 1.00 0.00 H ATOM 5795 HB2 MET A 401 8.955 89.536 -14.876 1.00 0.00 H ATOM 5796 HB3 MET A 401 8.449 88.498 -16.230 1.00 0.00 H ATOM 5797 HG2 MET A 401 11.321 88.584 -15.351 1.00 0.00 H ATOM 5798 HG3 MET A 401 10.446 87.309 -16.232 1.00 0.00 H ATOM 5799 HE1 MET A 401 11.429 88.791 -12.758 1.00 0.00 H ATOM 5800 HE2 MET A 401 9.736 89.335 -12.832 1.00 0.00 H ATOM 5801 HE3 MET A 401 10.216 88.078 -11.666 1.00 0.00 H ATOM 5802 H MET A 401 10.541 91.438 -15.288 1.00 0.00 H ATOM 5803 N ARG A 402 7.993 90.813 -18.346 1.00 22.84 N ATOM 5804 CA ARG A 402 6.926 91.670 -18.867 1.00 23.30 C ATOM 5805 C ARG A 402 5.805 90.857 -19.498 1.00 23.75 C ATOM 5806 O ARG A 402 6.043 89.799 -20.080 1.00 23.93 O ATOM 5807 CB ARG A 402 7.487 92.651 -19.904 1.00 23.26 C ATOM 5808 CG ARG A 402 6.469 93.659 -20.443 1.00 23.39 C ATOM 5809 CD ARG A 402 7.129 94.766 -21.238 1.00 23.61 C ATOM 5810 NE ARG A 402 7.734 94.251 -22.462 1.00 24.21 N ATOM 5811 CZ ARG A 402 8.532 94.944 -23.270 1.00 24.59 C ATOM 5812 NH1 ARG A 402 8.849 96.205 -23.005 1.00 24.84 N ATOM 5813 NH2 ARG A 402 9.023 94.366 -24.356 1.00 25.16 N ATOM 5814 HA ARG A 402 6.515 92.222 -18.022 1.00 0.00 H ATOM 5815 HB2 ARG A 402 8.303 93.206 -19.441 1.00 0.00 H ATOM 5816 HB3 ARG A 402 7.873 92.074 -20.745 1.00 0.00 H ATOM 5817 HG2 ARG A 402 5.763 93.135 -21.088 1.00 0.00 H ATOM 5818 HG3 ARG A 402 5.933 94.101 -19.603 1.00 0.00 H ATOM 5819 HD2 ARG A 402 7.903 95.230 -20.627 1.00 0.00 H ATOM 5820 HD3 ARG A 402 6.379 95.512 -21.499 1.00 0.00 H ATOM 5821 HE ARG A 402 7.525 93.266 -22.723 1.00 0.00 H ATOM 5822 HH12 ARG A 402 9.474 96.730 -23.649 1.00 0.00 H ATOM 5823 HH11 ARG A 402 8.472 96.668 -22.153 1.00 0.00 H ATOM 5824 HH22 ARG A 402 9.648 94.901 -24.993 1.00 0.00 H ATOM 5825 HH21 ARG A 402 8.784 93.377 -24.572 1.00 0.00 H ATOM 5826 H ARG A 402 8.345 90.035 -18.939 1.00 0.00 H ATOM 5827 N LYS A 403 4.584 91.372 -19.387 1.00 24.37 N ATOM 5828 CA LYS A 403 3.423 90.783 -20.055 1.00 24.98 C ATOM 5829 C LYS A 403 3.558 90.858 -21.572 1.00 25.28 C ATOM 5830 O LYS A 403 4.094 91.828 -22.111 1.00 25.39 O ATOM 5831 CB LYS A 403 2.135 91.494 -19.628 1.00 24.93 C ATOM 5832 CG LYS A 403 1.601 91.050 -18.278 1.00 25.33 C ATOM 5833 CD LYS A 403 0.345 91.836 -17.889 1.00 25.90 C ATOM 5834 CE LYS A 403 -0.724 90.939 -17.262 1.00 27.13 C ATOM 5835 NZ LYS A 403 -0.404 90.509 -15.879 1.00 27.76 N ATOM 5836 HA LYS A 403 3.376 89.735 -19.758 1.00 0.00 H ATOM 5837 HB2 LYS A 403 2.334 92.565 -19.583 1.00 0.00 H ATOM 5838 HB3 LYS A 403 1.370 91.299 -20.380 1.00 0.00 H ATOM 5839 HG2 LYS A 403 1.356 89.989 -18.325 1.00 0.00 H ATOM 5840 HG3 LYS A 403 2.369 91.211 -17.522 1.00 0.00 H ATOM 5841 HD2 LYS A 403 0.622 92.608 -17.171 1.00 0.00 H ATOM 5842 HD3 LYS A 403 -0.068 92.304 -18.783 1.00 0.00 H ATOM 5843 HE2 LYS A 403 -0.835 90.050 -17.882 1.00 0.00 H ATOM 5844 HE3 LYS A 403 -1.666 91.487 -17.243 1.00 0.00 H ATOM 5845 HZ1 LYS A 403 0.488 89.974 -15.881 1.00 0.00 H ATOM 5846 HZ2 LYS A 403 -0.306 91.347 -15.271 1.00 0.00 H ATOM 5847 HZ3 LYS A 403 -1.171 89.906 -15.519 1.00 0.00 H ATOM 5848 H LYS A 403 4.450 92.223 -18.805 1.00 0.00 H ATOM 5849 N LEU A 404 3.076 89.825 -22.256 1.00 25.72 N ATOM 5850 CA LEU A 404 2.991 89.851 -23.716 1.00 26.08 C ATOM 5851 C LEU A 404 1.856 90.772 -24.165 1.00 26.38 C ATOM 5852 O LEU A 404 1.992 91.500 -25.154 1.00 27.31 O ATOM 5853 CB LEU A 404 2.766 88.444 -24.283 1.00 26.21 C ATOM 5854 CG LEU A 404 3.996 87.639 -24.690 1.00 26.47 C ATOM 5855 CD1 LEU A 404 3.556 86.249 -25.104 1.00 27.11 C ATOM 5856 CD2 LEU A 404 4.762 88.304 -25.828 1.00 26.84 C ATOM 5857 HA LEU A 404 3.939 90.231 -24.098 1.00 0.00 H ATOM 5858 HB2 LEU A 404 2.236 87.868 -23.525 1.00 0.00 H ATOM 5859 HB3 LEU A 404 2.136 88.546 -25.167 1.00 0.00 H ATOM 5860 HG LEU A 404 4.671 87.586 -23.835 1.00 0.00 H ATOM 5861 HD21 LEU A 404 4.111 88.396 -26.698 1.00 0.00 H ATOM 5862 HD22 LEU A 404 5.091 89.294 -25.513 1.00 0.00 H ATOM 5863 HD23 LEU A 404 5.629 87.696 -26.084 1.00 0.00 H ATOM 5864 HD11 LEU A 404 3.057 85.763 -24.266 1.00 0.00 H ATOM 5865 HD12 LEU A 404 2.867 86.323 -25.946 1.00 0.00 H ATOM 5866 HD13 LEU A 404 4.429 85.665 -25.397 1.00 0.00 H ATOM 5867 H LEU A 404 2.753 88.981 -21.742 1.00 0.00 H TER 5868 LEU A 404 ATOM 5869 N LYS B 2 30.062 84.775 -33.456 1.00 18.53 N ATOM 5870 CA LYS B 2 31.343 85.181 -32.782 1.00 18.65 C ATOM 5871 C LYS B 2 32.147 83.999 -32.237 1.00 18.18 C ATOM 5872 O LYS B 2 31.598 83.065 -31.644 1.00 18.06 O ATOM 5873 CB LYS B 2 31.106 86.224 -31.686 1.00 19.01 C ATOM 5874 CG LYS B 2 31.169 87.634 -32.224 1.00 20.04 C ATOM 5875 CD LYS B 2 30.726 88.656 -31.213 1.00 20.04 C ATOM 5876 CE LYS B 2 30.693 90.044 -31.843 1.00 21.23 C ATOM 5877 NZ LYS B 2 29.902 90.996 -31.009 1.00 22.71 N ATOM 5878 HA LYS B 2 31.948 85.636 -33.566 1.00 0.00 H ATOM 5879 HB2 LYS B 2 30.122 86.058 -31.248 1.00 0.00 H ATOM 5880 HB3 LYS B 2 31.869 86.106 -30.917 1.00 0.00 H ATOM 5881 HG2 LYS B 2 32.197 87.852 -32.515 1.00 0.00 H ATOM 5882 HG3 LYS B 2 30.523 87.704 -33.099 1.00 0.00 H ATOM 5883 HD2 LYS B 2 29.729 88.399 -30.855 1.00 0.00 H ATOM 5884 HD3 LYS B 2 31.422 88.658 -30.374 1.00 0.00 H ATOM 5885 HE2 LYS B 2 30.240 89.975 -32.832 1.00 0.00 H ATOM 5886 HE3 LYS B 2 31.713 90.416 -31.938 1.00 0.00 H ATOM 5887 HZ1 LYS B 2 28.926 90.648 -30.919 1.00 0.00 H ATOM 5888 HZ2 LYS B 2 30.333 91.069 -30.065 1.00 0.00 H ATOM 5889 HZ3 LYS B 2 29.898 91.932 -31.463 1.00 0.00 H ATOM 5890 HN3 LYS B 2 29.457 84.274 -32.775 1.00 0.00 H ATOM 5891 HN2 LYS B 2 30.277 84.148 -34.257 1.00 0.00 H ATOM 5892 HN1 LYS B 2 29.569 85.623 -33.801 1.00 0.00 H ATOM 5893 N ARG B 3 33.460 84.078 -32.444 1.00 17.24 N ATOM 5894 CA ARG B 3 34.356 82.954 -32.251 1.00 16.64 C ATOM 5895 C ARG B 3 35.169 83.116 -30.981 1.00 15.93 C ATOM 5896 O ARG B 3 35.573 84.224 -30.634 1.00 16.17 O ATOM 5897 CB ARG B 3 35.280 82.844 -33.457 1.00 16.69 C ATOM 5898 CG ARG B 3 34.522 82.580 -34.758 1.00 17.29 C ATOM 5899 CD ARG B 3 35.379 82.846 -35.968 1.00 17.23 C ATOM 5900 NE ARG B 3 36.425 81.839 -36.126 1.00 17.96 N ATOM 5901 CZ ARG B 3 37.471 81.953 -36.939 1.00 18.07 C ATOM 5902 NH1 ARG B 3 37.643 83.045 -37.681 1.00 18.76 N ATOM 5903 NH2 ARG B 3 38.361 80.973 -37.005 1.00 18.08 N ATOM 5904 HA ARG B 3 33.765 82.043 -32.153 1.00 0.00 H ATOM 5905 HB2 ARG B 3 35.834 83.777 -33.559 1.00 0.00 H ATOM 5906 HB3 ARG B 3 35.979 82.025 -33.288 1.00 0.00 H ATOM 5907 HG2 ARG B 3 34.201 81.539 -34.775 1.00 0.00 H ATOM 5908 HG3 ARG B 3 33.647 83.229 -34.795 1.00 0.00 H ATOM 5909 HD2 ARG B 3 35.845 83.825 -35.862 1.00 0.00 H ATOM 5910 HD3 ARG B 3 34.747 82.841 -36.856 1.00 0.00 H ATOM 5911 HE ARG B 3 36.346 80.969 -35.561 1.00 0.00 H ATOM 5912 HH12 ARG B 3 38.466 83.120 -38.312 1.00 0.00 H ATOM 5913 HH11 ARG B 3 36.954 83.823 -37.629 1.00 0.00 H ATOM 5914 HH22 ARG B 3 39.181 81.057 -37.639 1.00 0.00 H ATOM 5915 HH21 ARG B 3 38.239 80.120 -36.423 1.00 0.00 H ATOM 5916 H ARG B 3 33.860 84.985 -32.758 1.00 0.00 H ATOM 5917 N ALA B 4 35.409 82.001 -30.295 1.00 14.94 N ATOM 5918 CA ALA B 4 36.111 82.013 -29.019 1.00 14.36 C ATOM 5919 C ALA B 4 37.391 81.181 -29.070 1.00 13.57 C ATOM 5920 O ALA B 4 37.404 80.057 -29.562 1.00 12.68 O ATOM 5921 CB ALA B 4 35.197 81.515 -27.901 1.00 14.12 C ATOM 5922 HA ALA B 4 36.395 83.044 -28.811 1.00 0.00 H ATOM 5923 HB1 ALA B 4 34.324 82.163 -27.831 1.00 0.00 H ATOM 5924 HB2 ALA B 4 34.878 80.496 -28.121 1.00 0.00 H ATOM 5925 HB3 ALA B 4 35.739 81.531 -26.956 1.00 0.00 H ATOM 5926 H ALA B 4 35.085 81.092 -30.683 1.00 0.00 H ATOM 5927 N VAL B 5 38.455 81.748 -28.517 1.00 13.21 N ATOM 5928 CA VAL B 5 39.773 81.128 -28.524 1.00 12.96 C ATOM 5929 C VAL B 5 40.367 81.141 -27.117 1.00 12.69 C ATOM 5930 O VAL B 5 39.926 81.919 -26.255 1.00 12.59 O ATOM 5931 CB VAL B 5 40.732 81.853 -29.498 1.00 12.88 C ATOM 5932 CG1 VAL B 5 40.319 81.611 -30.943 1.00 12.96 C ATOM 5933 CG2 VAL B 5 40.793 83.367 -29.208 1.00 13.14 C ATOM 5934 HA VAL B 5 39.655 80.099 -28.862 1.00 0.00 H ATOM 5935 HB VAL B 5 41.728 81.439 -29.344 1.00 0.00 H ATOM 5936 HG11 VAL B 5 40.346 80.542 -31.153 1.00 0.00 H ATOM 5937 HG12 VAL B 5 39.308 81.988 -31.099 1.00 0.00 H ATOM 5938 HG13 VAL B 5 41.008 82.131 -31.608 1.00 0.00 H ATOM 5939 HG21 VAL B 5 39.798 83.797 -29.318 1.00 0.00 H ATOM 5940 HG22 VAL B 5 41.148 83.527 -28.190 1.00 0.00 H ATOM 5941 HG23 VAL B 5 41.476 83.843 -29.911 1.00 0.00 H ATOM 5942 H VAL B 5 38.343 82.675 -28.059 1.00 0.00 H ATOM 5943 N ILE B 6 41.363 80.279 -26.906 1.00 12.12 N ATOM 5944 CA ILE B 6 42.071 80.169 -25.634 1.00 11.91 C ATOM 5945 C ILE B 6 43.417 80.862 -25.771 1.00 11.68 C ATOM 5946 O ILE B 6 44.233 80.465 -26.604 1.00 11.44 O ATOM 5947 CB ILE B 6 42.307 78.699 -25.219 1.00 11.83 C ATOM 5948 CG1 ILE B 6 40.991 77.903 -25.200 1.00 11.94 C ATOM 5949 CG2 ILE B 6 43.001 78.628 -23.867 1.00 11.90 C ATOM 5950 CD1 ILE B 6 39.976 78.368 -24.189 1.00 12.40 C ATOM 5951 HA ILE B 6 41.456 80.635 -24.864 1.00 0.00 H ATOM 5952 HB ILE B 6 42.958 78.243 -25.965 1.00 0.00 H ATOM 5953 HG12 ILE B 6 40.539 77.974 -26.189 1.00 0.00 H ATOM 5954 HG13 ILE B 6 41.229 76.861 -24.985 1.00 0.00 H ATOM 5955 HD11 ILE B 6 40.401 78.291 -23.188 1.00 0.00 H ATOM 5956 HD12 ILE B 6 39.710 79.405 -24.394 1.00 0.00 H ATOM 5957 HD13 ILE B 6 39.086 77.743 -24.256 1.00 0.00 H ATOM 5958 HG21 ILE B 6 43.963 79.137 -23.927 1.00 0.00 H ATOM 5959 HG22 ILE B 6 42.378 79.112 -23.115 1.00 0.00 H ATOM 5960 HG23 ILE B 6 43.157 77.584 -23.595 1.00 0.00 H ATOM 5961 H ILE B 6 41.649 79.654 -27.687 1.00 0.00 H ATOM 5962 N THR B 7 43.637 81.886 -24.945 1.00 11.40 N ATOM 5963 CA THR B 7 44.824 82.745 -25.033 1.00 11.47 C ATOM 5964 C THR B 7 45.780 82.636 -23.837 1.00 11.43 C ATOM 5965 O THR B 7 46.877 83.178 -23.865 1.00 11.39 O ATOM 5966 CB THR B 7 44.406 84.208 -25.177 1.00 11.17 C ATOM 5967 OG1 THR B 7 43.506 84.555 -24.113 1.00 11.25 O ATOM 5968 CG2 THR B 7 43.723 84.416 -26.515 1.00 11.19 C ATOM 5969 HA THR B 7 45.365 82.390 -25.910 1.00 0.00 H ATOM 5970 HB THR B 7 45.290 84.844 -25.125 1.00 0.00 H ATOM 5971 HG1 THR B 7 43.236 85.503 -24.207 1.00 0.00 H ATOM 5972 HG23 THR B 7 44.411 84.151 -27.318 1.00 0.00 H ATOM 5973 HG21 THR B 7 42.837 83.784 -26.571 1.00 0.00 H ATOM 5974 HG22 THR B 7 43.432 85.462 -26.614 1.00 0.00 H ATOM 5975 H THR B 7 42.935 82.085 -24.204 1.00 0.00 H ATOM 5976 N GLY B 8 45.365 81.936 -22.795 1.00 11.54 N ATOM 5977 CA GLY B 8 46.233 81.665 -21.665 1.00 11.60 C ATOM 5978 C GLY B 8 45.716 80.488 -20.865 1.00 11.73 C ATOM 5979 O GLY B 8 44.513 80.226 -20.838 1.00 11.53 O ATOM 5980 HA3 GLY B 8 46.271 82.545 -21.023 1.00 0.00 H ATOM 5981 HA2 GLY B 8 47.235 81.438 -22.029 1.00 0.00 H ATOM 5982 H GLY B 8 44.391 81.570 -22.785 1.00 0.00 H ATOM 5983 N LEU B 9 46.623 79.776 -20.210 1.00 11.88 N ATOM 5984 CA LEU B 9 46.224 78.710 -19.307 1.00 12.10 C ATOM 5985 C LEU B 9 47.071 78.673 -18.042 1.00 12.02 C ATOM 5986 O LEU B 9 48.151 79.259 -17.974 1.00 12.00 O ATOM 5987 CB LEU B 9 46.242 77.356 -20.029 1.00 12.54 C ATOM 5988 CG LEU B 9 47.531 76.924 -20.734 1.00 13.18 C ATOM 5989 CD1 LEU B 9 48.428 76.162 -19.763 1.00 14.26 C ATOM 5990 CD2 LEU B 9 47.235 76.060 -21.957 1.00 12.60 C ATOM 5991 HA LEU B 9 45.202 78.920 -18.990 1.00 0.00 H ATOM 5992 HB2 LEU B 9 46.008 76.592 -19.288 1.00 0.00 H ATOM 5993 HB3 LEU B 9 45.455 77.382 -20.783 1.00 0.00 H ATOM 5994 HG LEU B 9 48.045 77.823 -21.073 1.00 0.00 H ATOM 5995 HD21 LEU B 9 46.694 75.166 -21.646 1.00 0.00 H ATOM 5996 HD22 LEU B 9 46.628 76.627 -22.663 1.00 0.00 H ATOM 5997 HD23 LEU B 9 48.173 75.772 -22.432 1.00 0.00 H ATOM 5998 HD11 LEU B 9 48.679 76.806 -18.920 1.00 0.00 H ATOM 5999 HD12 LEU B 9 47.902 75.278 -19.403 1.00 0.00 H ATOM 6000 HD13 LEU B 9 49.342 75.860 -20.275 1.00 0.00 H ATOM 6001 H LEU B 9 47.633 79.983 -20.344 1.00 0.00 H ATOM 6002 N GLY B 10 46.551 77.984 -17.035 1.00 11.83 N ATOM 6003 CA GLY B 10 47.233 77.845 -15.753 1.00 11.56 C ATOM 6004 C GLY B 10 46.732 76.594 -15.079 1.00 11.18 C ATOM 6005 O GLY B 10 45.575 76.219 -15.261 1.00 10.95 O ATOM 6006 HA3 GLY B 10 47.020 78.711 -15.127 1.00 0.00 H ATOM 6007 HA2 GLY B 10 48.308 77.771 -15.914 1.00 0.00 H ATOM 6008 H GLY B 10 45.626 77.527 -17.164 1.00 0.00 H ATOM 6009 N ILE B 11 47.594 75.943 -14.306 1.00 10.84 N ATOM 6010 CA ILE B 11 47.264 74.634 -13.755 1.00 10.81 C ATOM 6011 C ILE B 11 48.065 74.275 -12.493 1.00 10.80 C ATOM 6012 O ILE B 11 49.247 74.610 -12.367 1.00 10.22 O ATOM 6013 CB ILE B 11 47.429 73.535 -14.846 1.00 10.57 C ATOM 6014 CG1 ILE B 11 46.938 72.181 -14.341 1.00 10.77 C ATOM 6015 CG2 ILE B 11 48.869 73.439 -15.331 1.00 10.48 C ATOM 6016 CD1 ILE B 11 46.640 71.208 -15.457 1.00 10.72 C ATOM 6017 HA ILE B 11 46.222 74.685 -13.440 1.00 0.00 H ATOM 6018 HB ILE B 11 46.811 73.826 -15.696 1.00 0.00 H ATOM 6019 HG12 ILE B 11 47.706 71.750 -13.700 1.00 0.00 H ATOM 6020 HG13 ILE B 11 46.028 72.335 -13.762 1.00 0.00 H ATOM 6021 HD11 ILE B 11 45.865 71.623 -16.102 1.00 0.00 H ATOM 6022 HD12 ILE B 11 47.545 71.037 -16.039 1.00 0.00 H ATOM 6023 HD13 ILE B 11 46.295 70.265 -15.033 1.00 0.00 H ATOM 6024 HG21 ILE B 11 49.172 74.396 -15.757 1.00 0.00 H ATOM 6025 HG22 ILE B 11 49.518 73.191 -14.491 1.00 0.00 H ATOM 6026 HG23 ILE B 11 48.944 72.662 -16.091 1.00 0.00 H ATOM 6027 H ILE B 11 48.516 76.373 -14.091 1.00 0.00 H ATOM 6028 N VAL B 12 47.375 73.625 -11.557 1.00 10.76 N ATOM 6029 CA VAL B 12 47.980 72.997 -10.390 1.00 10.80 C ATOM 6030 C VAL B 12 47.388 71.595 -10.325 1.00 10.46 C ATOM 6031 O VAL B 12 46.217 71.442 -10.007 1.00 10.39 O ATOM 6032 CB VAL B 12 47.641 73.755 -9.072 1.00 11.10 C ATOM 6033 CG1 VAL B 12 48.271 73.074 -7.876 1.00 11.28 C ATOM 6034 CG2 VAL B 12 48.100 75.192 -9.136 1.00 11.94 C ATOM 6035 HA VAL B 12 49.066 73.000 -10.483 1.00 0.00 H ATOM 6036 HB VAL B 12 46.557 73.737 -8.958 1.00 0.00 H ATOM 6037 HG11 VAL B 12 47.894 72.054 -7.800 1.00 0.00 H ATOM 6038 HG12 VAL B 12 49.354 73.054 -7.999 1.00 0.00 H ATOM 6039 HG13 VAL B 12 48.017 73.625 -6.970 1.00 0.00 H ATOM 6040 HG21 VAL B 12 49.179 75.221 -9.287 1.00 0.00 H ATOM 6041 HG22 VAL B 12 47.602 75.695 -9.965 1.00 0.00 H ATOM 6042 HG23 VAL B 12 47.849 75.694 -8.202 1.00 0.00 H ATOM 6043 H VAL B 12 46.343 73.562 -11.666 1.00 0.00 H ATOM 6044 N SER B 13 48.182 70.581 -10.653 1.00 10.52 N ATOM 6045 CA SER B 13 47.692 69.205 -10.658 1.00 10.52 C ATOM 6046 C SER B 13 48.654 68.220 -10.009 1.00 10.35 C ATOM 6047 O SER B 13 49.802 68.550 -9.698 1.00 10.10 O ATOM 6048 CB SER B 13 47.399 68.750 -12.091 1.00 10.79 C ATOM 6049 OG SER B 13 48.585 68.587 -12.842 1.00 10.58 O ATOM 6050 HA SER B 13 46.779 69.207 -10.063 1.00 0.00 H ATOM 6051 HB2 SER B 13 46.773 69.497 -12.578 1.00 0.00 H ATOM 6052 HB3 SER B 13 46.868 67.799 -12.058 1.00 0.00 H ATOM 6053 HG SER B 13 49.070 69.449 -12.882 1.00 0.00 H ATOM 6054 H SER B 13 49.171 70.771 -10.911 1.00 0.00 H ATOM 6055 N SER B 14 48.167 66.992 -9.848 1.00 10.26 N ATOM 6056 CA SER B 14 48.961 65.880 -9.335 1.00 10.30 C ATOM 6057 C SER B 14 50.258 65.648 -10.113 1.00 10.32 C ATOM 6058 O SER B 14 51.215 65.098 -9.564 1.00 10.31 O ATOM 6059 CB SER B 14 48.126 64.598 -9.336 1.00 10.32 C ATOM 6060 OG SER B 14 47.768 64.218 -10.658 1.00 9.67 O ATOM 6061 HA SER B 14 49.247 66.149 -8.318 1.00 0.00 H ATOM 6062 HB2 SER B 14 47.218 64.764 -8.756 1.00 0.00 H ATOM 6063 HB3 SER B 14 48.706 63.796 -8.880 1.00 0.00 H ATOM 6064 HG SER B 14 47.230 63.388 -10.627 1.00 0.00 H ATOM 6065 H SER B 14 47.173 66.816 -10.100 1.00 0.00 H ATOM 6066 N ILE B 15 50.296 66.062 -11.381 1.00 10.51 N ATOM 6067 CA ILE B 15 51.481 65.834 -12.226 1.00 10.70 C ATOM 6068 C ILE B 15 52.285 67.110 -12.568 1.00 10.70 C ATOM 6069 O ILE B 15 53.196 67.071 -13.401 1.00 10.96 O ATOM 6070 CB ILE B 15 51.114 65.061 -13.514 1.00 10.70 C ATOM 6071 CG1 ILE B 15 50.066 65.819 -14.339 1.00 11.42 C ATOM 6072 CG2 ILE B 15 50.627 63.653 -13.159 1.00 10.28 C ATOM 6073 CD1 ILE B 15 49.979 65.352 -15.790 1.00 11.42 C ATOM 6074 HA ILE B 15 52.145 65.223 -11.615 1.00 0.00 H ATOM 6075 HB ILE B 15 52.008 64.974 -14.131 1.00 0.00 H ATOM 6076 HG12 ILE B 15 49.091 65.678 -13.872 1.00 0.00 H ATOM 6077 HG13 ILE B 15 50.321 66.879 -14.332 1.00 0.00 H ATOM 6078 HD11 ILE B 15 50.944 65.496 -16.275 1.00 0.00 H ATOM 6079 HD12 ILE B 15 49.713 64.295 -15.815 1.00 0.00 H ATOM 6080 HD13 ILE B 15 49.218 65.932 -16.312 1.00 0.00 H ATOM 6081 HG21 ILE B 15 51.418 63.119 -12.632 1.00 0.00 H ATOM 6082 HG22 ILE B 15 49.747 63.725 -12.520 1.00 0.00 H ATOM 6083 HG23 ILE B 15 50.371 63.117 -14.073 1.00 0.00 H ATOM 6084 H ILE B 15 49.472 66.556 -11.781 1.00 0.00 H ATOM 6085 N GLY B 16 51.975 68.224 -11.910 1.00 10.36 N ATOM 6086 CA GLY B 16 52.731 69.458 -12.125 1.00 10.30 C ATOM 6087 C GLY B 16 52.034 70.706 -11.619 1.00 10.03 C ATOM 6088 O GLY B 16 50.807 70.811 -11.651 1.00 9.77 O ATOM 6089 HA3 GLY B 16 52.904 69.572 -13.195 1.00 0.00 H ATOM 6090 HA2 GLY B 16 53.688 69.368 -11.611 1.00 0.00 H ATOM 6091 H GLY B 16 51.185 68.218 -11.234 1.00 0.00 H ATOM 6092 N ASN B 17 52.827 71.661 -11.156 1.00 10.13 N ATOM 6093 CA ASN B 17 52.297 72.917 -10.607 1.00 10.28 C ATOM 6094 C ASN B 17 52.328 74.077 -11.620 1.00 10.10 C ATOM 6095 O ASN B 17 52.024 75.208 -11.278 1.00 9.88 O ATOM 6096 CB ASN B 17 53.059 73.273 -9.326 1.00 10.21 C ATOM 6097 CG ASN B 17 52.950 72.178 -8.250 1.00 10.84 C ATOM 6098 OD1 ASN B 17 51.871 71.622 -8.013 1.00 11.17 O ATOM 6099 ND2 ASN B 17 54.070 71.882 -7.586 1.00 10.36 N ATOM 6100 HA ASN B 17 51.244 72.760 -10.373 1.00 0.00 H ATOM 6101 HB2 ASN B 17 54.111 73.417 -9.573 1.00 0.00 H ATOM 6102 HB3 ASN B 17 52.652 74.201 -8.923 1.00 0.00 H ATOM 6103 HD22 ASN B 17 54.957 72.374 -7.817 1.00 0.00 H ATOM 6104 HD21 ASN B 17 54.056 71.160 -6.838 1.00 0.00 H ATOM 6105 H ASN B 17 53.857 71.517 -11.182 1.00 0.00 H ATOM 6106 N ASN B 18 52.716 73.786 -12.861 1.00 10.45 N ATOM 6107 CA ASN B 18 52.549 74.718 -13.976 1.00 10.89 C ATOM 6108 C ASN B 18 52.571 73.967 -15.305 1.00 11.18 C ATOM 6109 O ASN B 18 52.816 72.757 -15.329 1.00 11.00 O ATOM 6110 CB ASN B 18 53.592 75.845 -13.945 1.00 11.04 C ATOM 6111 CG ASN B 18 55.022 75.357 -14.135 1.00 11.31 C ATOM 6112 OD1 ASN B 18 55.305 74.493 -14.964 1.00 11.80 O ATOM 6113 ND2 ASN B 18 55.940 75.948 -13.380 1.00 12.31 N ATOM 6114 HA ASN B 18 51.575 75.195 -13.870 1.00 0.00 H ATOM 6115 HB2 ASN B 18 53.360 76.552 -14.742 1.00 0.00 H ATOM 6116 HB3 ASN B 18 53.525 76.351 -12.982 1.00 0.00 H ATOM 6117 HD22 ASN B 18 55.658 76.674 -12.691 1.00 0.00 H ATOM 6118 HD21 ASN B 18 56.941 75.685 -13.478 1.00 0.00 H ATOM 6119 H ASN B 18 53.154 72.861 -13.044 1.00 0.00 H ATOM 6120 N GLN B 19 52.319 74.668 -16.407 1.00 11.42 N ATOM 6121 CA GLN B 19 52.207 73.979 -17.697 1.00 11.75 C ATOM 6122 C GLN B 19 53.503 73.286 -18.150 1.00 11.81 C ATOM 6123 O GLN B 19 53.443 72.284 -18.856 1.00 12.09 O ATOM 6124 CB GLN B 19 51.656 74.894 -18.793 1.00 11.73 C ATOM 6125 CG GLN B 19 52.487 76.106 -19.138 1.00 11.83 C ATOM 6126 CD GLN B 19 52.085 76.682 -20.482 1.00 12.30 C ATOM 6127 OE1 GLN B 19 51.545 77.789 -20.570 1.00 13.00 O ATOM 6128 NE2 GLN B 19 52.326 75.917 -21.538 1.00 11.90 N ATOM 6129 HA GLN B 19 51.484 73.181 -17.527 1.00 0.00 H ATOM 6130 HB2 GLN B 19 51.547 74.298 -19.699 1.00 0.00 H ATOM 6131 HB3 GLN B 19 50.676 75.245 -18.470 1.00 0.00 H ATOM 6132 HG2 GLN B 19 52.345 76.865 -18.369 1.00 0.00 H ATOM 6133 HG3 GLN B 19 53.538 75.819 -19.174 1.00 0.00 H ATOM 6134 HE22 GLN B 19 52.783 74.991 -21.416 1.00 0.00 H ATOM 6135 HE21 GLN B 19 52.058 76.243 -22.488 1.00 0.00 H ATOM 6136 H GLN B 19 52.202 75.700 -16.354 1.00 0.00 H ATOM 6137 N GLN B 20 54.657 73.807 -17.731 1.00 11.85 N ATOM 6138 CA GLN B 20 55.955 73.182 -18.041 1.00 11.73 C ATOM 6139 C GLN B 20 56.164 71.848 -17.306 1.00 11.34 C ATOM 6140 O GLN B 20 56.589 70.861 -17.893 1.00 11.03 O ATOM 6141 CB GLN B 20 57.107 74.131 -17.701 1.00 11.91 C ATOM 6142 CG GLN B 20 57.392 75.203 -18.748 1.00 13.63 C ATOM 6143 CD GLN B 20 56.323 76.264 -18.821 1.00 14.95 C ATOM 6144 OE1 GLN B 20 55.774 76.689 -17.801 1.00 14.95 O ATOM 6145 NE2 GLN B 20 56.017 76.703 -20.040 1.00 16.99 N ATOM 6146 HA GLN B 20 55.946 72.975 -19.111 1.00 0.00 H ATOM 6147 HB2 GLN B 20 56.868 74.630 -16.762 1.00 0.00 H ATOM 6148 HB3 GLN B 20 58.010 73.534 -17.574 1.00 0.00 H ATOM 6149 HG2 GLN B 20 58.340 75.683 -18.504 1.00 0.00 H ATOM 6150 HG3 GLN B 20 57.470 74.723 -19.723 1.00 0.00 H ATOM 6151 HE22 GLN B 20 56.507 76.314 -20.871 1.00 0.00 H ATOM 6152 HE21 GLN B 20 55.288 77.434 -20.161 1.00 0.00 H ATOM 6153 H GLN B 20 54.640 74.681 -17.168 1.00 0.00 H ATOM 6154 N GLU B 21 55.887 71.834 -16.012 1.00 11.26 N ATOM 6155 CA GLU B 21 56.022 70.622 -15.218 1.00 11.45 C ATOM 6156 C GLU B 21 55.055 69.552 -15.718 1.00 11.02 C ATOM 6157 O GLU B 21 55.412 68.374 -15.822 1.00 10.64 O ATOM 6158 CB GLU B 21 55.758 70.920 -13.741 1.00 11.33 C ATOM 6159 CG GLU B 21 56.795 71.832 -13.102 1.00 12.18 C ATOM 6160 CD GLU B 21 56.531 72.123 -11.628 1.00 13.00 C ATOM 6161 OE1 GLU B 21 55.513 71.642 -11.079 1.00 14.96 O ATOM 6162 OE2 GLU B 21 57.352 72.845 -11.016 1.00 15.52 O ATOM 6163 HA GLU B 21 57.042 70.251 -15.323 1.00 0.00 H ATOM 6164 HB2 GLU B 21 54.782 71.397 -13.656 1.00 0.00 H ATOM 6165 HB3 GLU B 21 55.748 69.976 -13.196 1.00 0.00 H ATOM 6166 HG2 GLU B 21 57.772 71.357 -13.190 1.00 0.00 H ATOM 6167 HG3 GLU B 21 56.802 72.778 -13.644 1.00 0.00 H ATOM 6168 H GLU B 21 55.565 72.709 -15.552 1.00 0.00 H ATOM 6169 N VAL B 22 53.837 69.989 -16.031 1.00 10.76 N ATOM 6170 CA VAL B 22 52.794 69.127 -16.580 1.00 10.87 C ATOM 6171 C VAL B 22 53.218 68.549 -17.932 1.00 10.86 C ATOM 6172 O VAL B 22 53.080 67.346 -18.167 1.00 10.72 O ATOM 6173 CB VAL B 22 51.464 69.911 -16.720 1.00 10.60 C ATOM 6174 CG1 VAL B 22 50.472 69.178 -17.608 1.00 10.81 C ATOM 6175 CG2 VAL B 22 50.854 70.172 -15.343 1.00 10.43 C ATOM 6176 HA VAL B 22 52.640 68.298 -15.890 1.00 0.00 H ATOM 6177 HB VAL B 22 51.690 70.865 -17.195 1.00 0.00 H ATOM 6178 HG11 VAL B 22 50.902 69.049 -18.601 1.00 0.00 H ATOM 6179 HG12 VAL B 22 50.252 68.202 -17.176 1.00 0.00 H ATOM 6180 HG13 VAL B 22 49.553 69.760 -17.681 1.00 0.00 H ATOM 6181 HG21 VAL B 22 50.657 69.221 -14.848 1.00 0.00 H ATOM 6182 HG22 VAL B 22 51.551 70.757 -14.743 1.00 0.00 H ATOM 6183 HG23 VAL B 22 49.921 70.723 -15.459 1.00 0.00 H ATOM 6184 H VAL B 22 53.618 70.994 -15.877 1.00 0.00 H ATOM 6185 N LEU B 23 53.719 69.417 -18.808 1.00 10.92 N ATOM 6186 CA LEU B 23 54.228 69.012 -20.116 1.00 11.23 C ATOM 6187 C LEU B 23 55.195 67.827 -19.978 1.00 11.30 C ATOM 6188 O LEU B 23 55.012 66.790 -20.625 1.00 11.31 O ATOM 6189 CB LEU B 23 54.934 70.189 -20.815 1.00 11.35 C ATOM 6190 CG LEU B 23 54.978 70.306 -22.357 1.00 12.08 C ATOM 6191 CD1 LEU B 23 56.303 70.957 -22.786 1.00 12.92 C ATOM 6192 CD2 LEU B 23 54.775 68.998 -23.108 1.00 12.87 C ATOM 6193 HA LEU B 23 53.379 68.702 -20.726 1.00 0.00 H ATOM 6194 HB2 LEU B 23 54.452 71.097 -20.451 1.00 0.00 H ATOM 6195 HB3 LEU B 23 55.971 70.170 -20.478 1.00 0.00 H ATOM 6196 HG LEU B 23 54.126 70.929 -22.630 1.00 0.00 H ATOM 6197 HD21 LEU B 23 55.557 68.293 -22.826 1.00 0.00 H ATOM 6198 HD22 LEU B 23 53.800 68.582 -22.854 1.00 0.00 H ATOM 6199 HD23 LEU B 23 54.823 69.185 -24.181 1.00 0.00 H ATOM 6200 HD11 LEU B 23 56.378 71.951 -22.344 1.00 0.00 H ATOM 6201 HD12 LEU B 23 57.136 70.342 -22.444 1.00 0.00 H ATOM 6202 HD13 LEU B 23 56.331 71.038 -23.873 1.00 0.00 H ATOM 6203 H LEU B 23 53.749 70.424 -18.551 1.00 0.00 H ATOM 6204 N ALA B 24 56.207 67.991 -19.125 1.00 11.00 N ATOM 6205 CA ALA B 24 57.199 66.947 -18.859 1.00 11.32 C ATOM 6206 C ALA B 24 56.557 65.642 -18.415 1.00 11.30 C ATOM 6207 O ALA B 24 56.870 64.576 -18.949 1.00 11.00 O ATOM 6208 CB ALA B 24 58.194 67.411 -17.789 1.00 11.13 C ATOM 6209 HA ALA B 24 57.722 66.764 -19.798 1.00 0.00 H ATOM 6210 HB1 ALA B 24 58.707 68.308 -18.136 1.00 0.00 H ATOM 6211 HB2 ALA B 24 57.657 67.633 -16.867 1.00 0.00 H ATOM 6212 HB3 ALA B 24 58.923 66.621 -17.606 1.00 0.00 H ATOM 6213 H ALA B 24 56.296 68.900 -18.627 1.00 0.00 H ATOM 6214 N SER B 25 55.674 65.737 -17.424 1.00 11.47 N ATOM 6215 CA SER B 25 54.995 64.567 -16.878 1.00 11.97 C ATOM 6216 C SER B 25 54.222 63.824 -17.958 1.00 12.14 C ATOM 6217 O SER B 25 54.265 62.599 -18.016 1.00 12.15 O ATOM 6218 CB SER B 25 54.035 64.966 -15.759 1.00 11.98 C ATOM 6219 OG SER B 25 54.724 65.468 -14.634 1.00 11.73 O ATOM 6220 HA SER B 25 55.764 63.908 -16.475 1.00 0.00 H ATOM 6221 HB2 SER B 25 53.459 64.091 -15.459 1.00 0.00 H ATOM 6222 HB3 SER B 25 53.358 65.735 -16.131 1.00 0.00 H ATOM 6223 HG SER B 25 54.071 65.715 -13.932 1.00 0.00 H ATOM 6224 H SER B 25 55.461 66.674 -17.027 1.00 0.00 H ATOM 6225 N LEU B 26 53.523 64.577 -18.804 1.00 12.62 N ATOM 6226 CA LEU B 26 52.722 64.004 -19.876 1.00 13.20 C ATOM 6227 C LEU B 26 53.606 63.312 -20.904 1.00 13.70 C ATOM 6228 O LEU B 26 53.344 62.168 -21.258 1.00 14.20 O ATOM 6229 CB LEU B 26 51.851 65.075 -20.552 1.00 13.27 C ATOM 6230 CG LEU B 26 50.697 65.678 -19.735 1.00 12.99 C ATOM 6231 CD1 LEU B 26 50.112 66.890 -20.448 1.00 13.33 C ATOM 6232 CD2 LEU B 26 49.610 64.659 -19.465 1.00 12.69 C ATOM 6233 HA LEU B 26 52.061 63.259 -19.432 1.00 0.00 H ATOM 6234 HB2 LEU B 26 52.509 65.895 -20.841 1.00 0.00 H ATOM 6235 HB3 LEU B 26 51.418 64.626 -21.446 1.00 0.00 H ATOM 6236 HG LEU B 26 51.107 65.993 -18.775 1.00 0.00 H ATOM 6237 HD21 LEU B 26 49.209 64.298 -20.412 1.00 0.00 H ATOM 6238 HD22 LEU B 26 50.028 63.823 -18.904 1.00 0.00 H ATOM 6239 HD23 LEU B 26 48.813 65.125 -18.885 1.00 0.00 H ATOM 6240 HD11 LEU B 26 50.888 67.645 -20.575 1.00 0.00 H ATOM 6241 HD12 LEU B 26 49.734 66.588 -21.425 1.00 0.00 H ATOM 6242 HD13 LEU B 26 49.297 67.302 -19.853 1.00 0.00 H ATOM 6243 H LEU B 26 53.550 65.611 -18.695 1.00 0.00 H ATOM 6244 N ARG B 27 54.661 63.975 -21.371 1.00 14.32 N ATOM 6245 CA ARG B 27 55.560 63.336 -22.338 1.00 15.14 C ATOM 6246 C ARG B 27 56.226 62.082 -21.787 1.00 15.32 C ATOM 6247 O ARG B 27 56.559 61.187 -22.553 1.00 15.43 O ATOM 6248 CB ARG B 27 56.641 64.287 -22.854 1.00 15.22 C ATOM 6249 CG ARG B 27 56.109 65.485 -23.607 1.00 15.93 C ATOM 6250 CD ARG B 27 56.908 65.824 -24.854 1.00 16.79 C ATOM 6251 NE ARG B 27 57.382 67.209 -24.853 1.00 18.98 N ATOM 6252 CZ ARG B 27 57.497 67.994 -25.923 1.00 19.71 C ATOM 6253 NH1 ARG B 27 57.138 67.581 -27.131 1.00 20.98 N ATOM 6254 NH2 ARG B 27 57.960 69.225 -25.778 1.00 20.44 N ATOM 6255 HA ARG B 27 54.914 63.052 -23.169 1.00 0.00 H ATOM 6256 HB2 ARG B 27 57.215 64.648 -22.000 1.00 0.00 H ATOM 6257 HB3 ARG B 27 57.297 63.728 -23.521 1.00 0.00 H ATOM 6258 HG2 ARG B 27 55.080 65.278 -23.902 1.00 0.00 H ATOM 6259 HG3 ARG B 27 56.128 66.347 -22.941 1.00 0.00 H ATOM 6260 HD2 ARG B 27 56.275 65.671 -25.728 1.00 0.00 H ATOM 6261 HD3 ARG B 27 57.770 65.159 -24.910 1.00 0.00 H ATOM 6262 HE ARG B 27 57.653 67.616 -23.935 1.00 0.00 H ATOM 6263 HH12 ARG B 27 57.239 68.216 -27.949 1.00 0.00 H ATOM 6264 HH11 ARG B 27 56.756 66.623 -27.261 1.00 0.00 H ATOM 6265 HH22 ARG B 27 58.054 69.846 -26.607 1.00 0.00 H ATOM 6266 HH21 ARG B 27 58.230 69.571 -24.835 1.00 0.00 H ATOM 6267 H ARG B 27 54.848 64.946 -21.050 1.00 0.00 H ATOM 6268 N GLU B 28 56.414 62.027 -20.468 1.00 15.75 N ATOM 6269 CA GLU B 28 57.110 60.920 -19.819 1.00 16.26 C ATOM 6270 C GLU B 28 56.199 59.814 -19.272 1.00 16.30 C ATOM 6271 O GLU B 28 56.697 58.804 -18.772 1.00 15.99 O ATOM 6272 CB GLU B 28 57.973 61.462 -18.678 1.00 16.22 C ATOM 6273 CG GLU B 28 59.102 62.349 -19.142 1.00 16.92 C ATOM 6274 CD GLU B 28 59.766 63.073 -17.994 1.00 17.56 C ATOM 6275 OE1 GLU B 28 59.961 64.307 -18.100 1.00 19.53 O ATOM 6276 OE2 GLU B 28 60.083 62.405 -16.985 1.00 19.74 O ATOM 6277 HA GLU B 28 57.712 60.455 -20.600 1.00 0.00 H ATOM 6278 HB2 GLU B 28 57.335 62.038 -18.007 1.00 0.00 H ATOM 6279 HB3 GLU B 28 58.399 60.617 -18.136 1.00 0.00 H ATOM 6280 HG2 GLU B 28 59.847 61.735 -19.648 1.00 0.00 H ATOM 6281 HG3 GLU B 28 58.706 63.086 -19.840 1.00 0.00 H ATOM 6282 H GLU B 28 56.051 62.803 -19.879 1.00 0.00 H ATOM 6283 N GLY B 29 54.882 59.994 -19.359 1.00 16.74 N ATOM 6284 CA GLY B 29 53.934 58.998 -18.832 1.00 17.16 C ATOM 6285 C GLY B 29 54.044 58.864 -17.322 1.00 17.52 C ATOM 6286 O GLY B 29 53.897 57.767 -16.764 1.00 17.42 O ATOM 6287 HA3 GLY B 29 54.145 58.031 -19.289 1.00 0.00 H ATOM 6288 HA2 GLY B 29 52.920 59.305 -19.087 1.00 0.00 H ATOM 6289 H GLY B 29 54.515 60.857 -19.809 1.00 0.00 H ATOM 6290 N ARG B 30 54.301 59.990 -16.660 1.00 17.82 N ATOM 6291 CA ARG B 30 54.645 59.982 -15.247 1.00 18.59 C ATOM 6292 C ARG B 30 53.401 60.100 -14.366 1.00 17.89 C ATOM 6293 O ARG B 30 52.578 61.001 -14.546 1.00 17.81 O ATOM 6294 CB ARG B 30 55.643 61.100 -14.936 1.00 18.96 C ATOM 6295 CG ARG B 30 56.755 60.664 -13.984 1.00 21.63 C ATOM 6296 CD ARG B 30 58.070 61.425 -14.197 1.00 23.54 C ATOM 6297 NE ARG B 30 58.182 62.590 -13.313 1.00 28.10 N ATOM 6298 CZ ARG B 30 58.287 63.863 -13.704 1.00 30.61 C ATOM 6299 NH1 ARG B 30 58.304 64.197 -14.997 1.00 32.16 N ATOM 6300 NH2 ARG B 30 58.384 64.819 -12.781 1.00 31.01 N ATOM 6301 HA ARG B 30 55.114 59.024 -15.021 1.00 0.00 H ATOM 6302 HB2 ARG B 30 56.096 61.431 -15.871 1.00 0.00 H ATOM 6303 HB3 ARG B 30 55.103 61.931 -14.482 1.00 0.00 H ATOM 6304 HG2 ARG B 30 56.420 60.832 -12.960 1.00 0.00 H ATOM 6305 HG3 ARG B 30 56.942 59.601 -14.134 1.00 0.00 H ATOM 6306 HD2 ARG B 30 58.117 61.763 -15.232 1.00 0.00 H ATOM 6307 HD3 ARG B 30 58.903 60.751 -13.998 1.00 0.00 H ATOM 6308 HE ARG B 30 58.179 62.409 -12.289 1.00 0.00 H ATOM 6309 HH12 ARG B 30 58.387 65.196 -15.275 1.00 0.00 H ATOM 6310 HH11 ARG B 30 58.235 63.458 -15.726 1.00 0.00 H ATOM 6311 HH22 ARG B 30 58.466 65.815 -13.070 1.00 0.00 H ATOM 6312 HH21 ARG B 30 58.377 64.570 -11.771 1.00 0.00 H ATOM 6313 H ARG B 30 54.255 60.898 -17.166 1.00 0.00 H ATOM 6314 N SER B 31 53.280 59.174 -13.419 1.00 17.38 N ATOM 6315 CA SER B 31 52.157 59.133 -12.496 1.00 17.08 C ATOM 6316 C SER B 31 52.288 60.196 -11.411 1.00 16.74 C ATOM 6317 O SER B 31 53.383 60.441 -10.892 1.00 16.73 O ATOM 6318 CB SER B 31 52.065 57.755 -11.842 1.00 16.92 C ATOM 6319 OG SER B 31 51.058 57.732 -10.848 1.00 16.93 O ATOM 6320 HA SER B 31 51.252 59.333 -13.069 1.00 0.00 H ATOM 6321 HB2 SER B 31 53.024 57.513 -11.384 1.00 0.00 H ATOM 6322 HB3 SER B 31 51.830 57.013 -12.605 1.00 0.00 H ATOM 6323 HG SER B 31 50.184 57.948 -11.260 1.00 0.00 H ATOM 6324 H SER B 31 54.020 58.448 -13.335 1.00 0.00 H ATOM 6325 N GLY B 32 51.164 60.819 -11.069 1.00 16.34 N ATOM 6326 CA GLY B 32 51.088 61.730 -9.923 1.00 15.99 C ATOM 6327 C GLY B 32 50.395 61.115 -8.714 1.00 15.50 C ATOM 6328 O GLY B 32 50.029 61.829 -7.784 1.00 15.13 O ATOM 6329 HA3 GLY B 32 50.536 62.620 -10.224 1.00 0.00 H ATOM 6330 HA2 GLY B 32 52.101 62.012 -9.636 1.00 0.00 H ATOM 6331 H GLY B 32 50.307 60.654 -11.635 1.00 0.00 H ATOM 6332 N ILE B 33 50.216 59.794 -8.720 1.00 15.20 N ATOM 6333 CA ILE B 33 49.482 59.114 -7.656 1.00 15.46 C ATOM 6334 C ILE B 33 50.421 58.616 -6.561 1.00 15.52 C ATOM 6335 O ILE B 33 51.462 58.024 -6.846 1.00 15.40 O ATOM 6336 CB ILE B 33 48.648 57.929 -8.201 1.00 15.27 C ATOM 6337 CG1 ILE B 33 47.714 58.396 -9.328 1.00 15.58 C ATOM 6338 CG2 ILE B 33 47.852 57.265 -7.080 1.00 14.70 C ATOM 6339 CD1 ILE B 33 46.828 59.593 -8.981 1.00 15.79 C ATOM 6340 HA ILE B 33 48.801 59.850 -7.229 1.00 0.00 H ATOM 6341 HB ILE B 33 49.336 57.190 -8.612 1.00 0.00 H ATOM 6342 HG12 ILE B 33 48.329 58.668 -10.186 1.00 0.00 H ATOM 6343 HG13 ILE B 33 47.066 57.562 -9.597 1.00 0.00 H ATOM 6344 HD11 ILE B 33 46.192 59.339 -8.133 1.00 0.00 H ATOM 6345 HD12 ILE B 33 47.456 60.446 -8.723 1.00 0.00 H ATOM 6346 HD13 ILE B 33 46.207 59.845 -9.841 1.00 0.00 H ATOM 6347 HG21 ILE B 33 48.539 56.892 -6.320 1.00 0.00 H ATOM 6348 HG22 ILE B 33 47.177 57.995 -6.634 1.00 0.00 H ATOM 6349 HG23 ILE B 33 47.274 56.436 -7.488 1.00 0.00 H ATOM 6350 H ILE B 33 50.609 59.233 -9.503 1.00 0.00 H ATOM 6351 N THR B 34 50.032 58.863 -5.309 1.00 15.89 N ATOM 6352 CA THR B 34 50.803 58.433 -4.139 1.00 16.21 C ATOM 6353 C THR B 34 49.922 57.740 -3.108 1.00 16.32 C ATOM 6354 O THR B 34 48.698 57.760 -3.196 1.00 16.09 O ATOM 6355 CB THR B 34 51.494 59.623 -3.431 1.00 16.48 C ATOM 6356 OG1 THR B 34 50.504 60.589 -3.036 1.00 17.00 O ATOM 6357 CG2 THR B 34 52.547 60.277 -4.351 1.00 16.54 C ATOM 6358 HA THR B 34 51.553 57.741 -4.522 1.00 0.00 H ATOM 6359 HB THR B 34 52.009 59.252 -2.545 1.00 0.00 H ATOM 6360 HG1 THR B 34 50.025 60.916 -3.838 1.00 0.00 H ATOM 6361 HG23 THR B 34 53.288 59.532 -4.640 1.00 0.00 H ATOM 6362 HG21 THR B 34 52.056 60.668 -5.242 1.00 0.00 H ATOM 6363 HG22 THR B 34 53.038 61.091 -3.818 1.00 0.00 H ATOM 6364 H THR B 34 49.144 59.383 -5.157 1.00 0.00 H ATOM 6365 N PHE B 35 50.581 57.124 -2.131 1.00 16.31 N ATOM 6366 CA PHE B 35 49.912 56.525 -0.993 1.00 16.02 C ATOM 6367 C PHE B 35 49.456 57.645 -0.058 1.00 15.83 C ATOM 6368 O PHE B 35 50.165 58.636 0.131 1.00 15.72 O ATOM 6369 CB PHE B 35 50.861 55.563 -0.272 1.00 16.14 C ATOM 6370 CG PHE B 35 50.358 55.108 1.051 1.00 16.17 C ATOM 6371 CD1 PHE B 35 50.772 55.742 2.219 1.00 16.37 C ATOM 6372 CD2 PHE B 35 49.453 54.062 1.139 1.00 16.05 C ATOM 6373 CE1 PHE B 35 50.294 55.332 3.460 1.00 16.72 C ATOM 6374 CE2 PHE B 35 48.971 53.642 2.378 1.00 16.57 C ATOM 6375 CZ PHE B 35 49.392 54.281 3.541 1.00 16.45 C ATOM 6376 HA PHE B 35 49.045 55.952 -1.322 1.00 0.00 H ATOM 6377 HB2 PHE B 35 51.010 54.687 -0.904 1.00 0.00 H ATOM 6378 HB3 PHE B 35 51.815 56.068 -0.123 1.00 0.00 H ATOM 6379 HD2 PHE B 35 49.115 53.563 0.231 1.00 0.00 H ATOM 6380 HE2 PHE B 35 48.265 52.814 2.436 1.00 0.00 H ATOM 6381 HZ PHE B 35 49.015 53.957 4.511 1.00 0.00 H ATOM 6382 HE1 PHE B 35 50.628 55.836 4.367 1.00 0.00 H ATOM 6383 HD1 PHE B 35 51.479 56.570 2.161 1.00 0.00 H ATOM 6384 H PHE B 35 51.618 57.070 -2.186 1.00 0.00 H ATOM 6385 N SER B 36 48.266 57.485 0.512 1.00 15.62 N ATOM 6386 CA SER B 36 47.703 58.474 1.416 1.00 15.79 C ATOM 6387 C SER B 36 47.420 57.885 2.785 1.00 15.79 C ATOM 6388 O SER B 36 46.484 57.093 2.950 1.00 15.28 O ATOM 6389 CB SER B 36 46.399 59.021 0.863 1.00 15.82 C ATOM 6390 OG SER B 36 45.869 59.997 1.742 1.00 15.13 O ATOM 6391 HA SER B 36 48.442 59.270 1.510 1.00 0.00 H ATOM 6392 HB2 SER B 36 45.683 58.206 0.755 1.00 0.00 H ATOM 6393 HB3 SER B 36 46.582 59.474 -0.111 1.00 0.00 H ATOM 6394 HG SER B 36 45.020 60.346 1.372 1.00 0.00 H ATOM 6395 H SER B 36 47.720 56.624 0.304 1.00 0.00 H ATOM 6396 N GLN B 37 48.217 58.303 3.767 1.00 16.17 N ATOM 6397 CA GLN B 37 48.005 57.908 5.159 1.00 16.45 C ATOM 6398 C GLN B 37 46.670 58.469 5.666 1.00 16.65 C ATOM 6399 O GLN B 37 45.952 57.791 6.399 1.00 16.74 O ATOM 6400 CB GLN B 37 49.182 58.373 6.034 1.00 16.38 C ATOM 6401 CG GLN B 37 49.230 57.764 7.444 1.00 16.52 C ATOM 6402 CD GLN B 37 49.330 56.246 7.441 1.00 17.72 C ATOM 6403 OE1 GLN B 37 48.475 55.560 7.995 1.00 19.61 O ATOM 6404 NE2 GLN B 37 50.366 55.716 6.807 1.00 17.70 N ATOM 6405 HA GLN B 37 47.959 56.821 5.220 1.00 0.00 H ATOM 6406 HB2 GLN B 37 50.108 58.111 5.522 1.00 0.00 H ATOM 6407 HB3 GLN B 37 49.119 59.456 6.136 1.00 0.00 H ATOM 6408 HG2 GLN B 37 50.098 58.167 7.966 1.00 0.00 H ATOM 6409 HG3 GLN B 37 48.323 58.050 7.976 1.00 0.00 H ATOM 6410 HE22 GLN B 37 51.068 56.333 6.351 1.00 0.00 H ATOM 6411 HE21 GLN B 37 50.477 54.683 6.766 1.00 0.00 H ATOM 6412 H GLN B 37 49.015 58.930 3.537 1.00 0.00 H ATOM 6413 N GLU B 38 46.332 59.690 5.242 1.00 16.97 N ATOM 6414 CA GLU B 38 45.055 60.326 5.600 1.00 17.09 C ATOM 6415 C GLU B 38 43.838 59.499 5.185 1.00 17.22 C ATOM 6416 O GLU B 38 42.883 59.374 5.953 1.00 17.65 O ATOM 6417 CB GLU B 38 44.940 61.729 4.982 1.00 17.05 C ATOM 6418 CG GLU B 38 43.562 62.381 5.196 1.00 17.36 C ATOM 6419 CD GLU B 38 43.409 63.749 4.537 1.00 17.38 C ATOM 6420 OE1 GLU B 38 44.414 64.474 4.384 1.00 16.77 O ATOM 6421 OE2 GLU B 38 42.265 64.096 4.183 1.00 17.15 O ATOM 6422 HA GLU B 38 45.058 60.398 6.688 1.00 0.00 H ATOM 6423 HB2 GLU B 38 45.699 62.369 5.433 1.00 0.00 H ATOM 6424 HB3 GLU B 38 45.123 61.651 3.910 1.00 0.00 H ATOM 6425 HG2 GLU B 38 42.802 61.717 4.786 1.00 0.00 H ATOM 6426 HG3 GLU B 38 43.401 62.497 6.268 1.00 0.00 H ATOM 6427 H GLU B 38 46.997 60.211 4.636 1.00 0.00 H ATOM 6428 N LEU B 39 43.854 58.964 3.968 1.00 17.28 N ATOM 6429 CA LEU B 39 42.748 58.136 3.506 1.00 17.33 C ATOM 6430 C LEU B 39 42.693 56.830 4.300 1.00 17.46 C ATOM 6431 O LEU B 39 41.612 56.388 4.689 1.00 17.33 O ATOM 6432 CB LEU B 39 42.844 57.856 2.002 1.00 17.23 C ATOM 6433 CG LEU B 39 42.739 59.050 1.040 1.00 17.33 C ATOM 6434 CD1 LEU B 39 42.477 58.547 -0.388 1.00 17.06 C ATOM 6435 CD2 LEU B 39 41.667 60.069 1.463 1.00 16.99 C ATOM 6436 HA LEU B 39 41.823 58.687 3.677 1.00 0.00 H ATOM 6437 HB2 LEU B 39 43.806 57.377 1.822 1.00 0.00 H ATOM 6438 HB3 LEU B 39 42.042 57.163 1.749 1.00 0.00 H ATOM 6439 HG LEU B 39 43.692 59.577 1.074 1.00 0.00 H ATOM 6440 HD21 LEU B 39 40.694 59.579 1.492 1.00 0.00 H ATOM 6441 HD22 LEU B 39 41.909 60.459 2.452 1.00 0.00 H ATOM 6442 HD23 LEU B 39 41.642 60.888 0.744 1.00 0.00 H ATOM 6443 HD11 LEU B 39 43.298 57.902 -0.701 1.00 0.00 H ATOM 6444 HD12 LEU B 39 41.544 57.984 -0.408 1.00 0.00 H ATOM 6445 HD13 LEU B 39 42.404 59.399 -1.064 1.00 0.00 H ATOM 6446 H LEU B 39 44.664 59.138 3.340 1.00 0.00 H ATOM 6447 N LYS B 40 43.856 56.229 4.553 1.00 17.73 N ATOM 6448 CA LYS B 40 43.926 54.991 5.334 1.00 17.83 C ATOM 6449 C LYS B 40 43.456 55.206 6.772 1.00 17.98 C ATOM 6450 O LYS B 40 42.695 54.397 7.314 1.00 18.06 O ATOM 6451 CB LYS B 40 45.347 54.440 5.345 1.00 17.86 C ATOM 6452 CG LYS B 40 45.473 53.107 6.061 1.00 18.16 C ATOM 6453 CD LYS B 40 46.901 52.617 6.056 1.00 18.41 C ATOM 6454 CE LYS B 40 47.030 51.274 6.748 1.00 19.11 C ATOM 6455 NZ LYS B 40 48.434 51.055 7.215 1.00 19.60 N ATOM 6456 HA LYS B 40 43.261 54.272 4.855 1.00 0.00 H ATOM 6457 HB2 LYS B 40 45.675 54.311 4.314 1.00 0.00 H ATOM 6458 HB3 LYS B 40 45.994 55.162 5.843 1.00 0.00 H ATOM 6459 HG2 LYS B 40 45.141 53.224 7.092 1.00 0.00 H ATOM 6460 HG3 LYS B 40 44.843 52.373 5.559 1.00 0.00 H ATOM 6461 HD2 LYS B 40 47.238 52.518 5.024 1.00 0.00 H ATOM 6462 HD3 LYS B 40 47.527 53.344 6.573 1.00 0.00 H ATOM 6463 HE2 LYS B 40 46.757 50.483 6.049 1.00 0.00 H ATOM 6464 HE3 LYS B 40 46.358 51.247 7.606 1.00 0.00 H ATOM 6465 HZ1 LYS B 40 49.077 51.077 6.398 1.00 0.00 H ATOM 6466 HZ2 LYS B 40 48.696 51.806 7.885 1.00 0.00 H ATOM 6467 HZ3 LYS B 40 48.501 50.130 7.686 1.00 0.00 H ATOM 6468 H LYS B 40 44.734 56.649 4.187 1.00 0.00 H ATOM 6469 N ASP B 41 43.915 56.299 7.377 1.00 17.96 N ATOM 6470 CA ASP B 41 43.576 56.628 8.760 1.00 17.91 C ATOM 6471 C ASP B 41 42.084 56.899 8.937 1.00 17.92 C ATOM 6472 O ASP B 41 41.540 56.678 10.020 1.00 18.00 O ATOM 6473 CB ASP B 41 44.399 57.836 9.243 1.00 17.94 C ATOM 6474 CG ASP B 41 45.852 57.475 9.568 1.00 18.91 C ATOM 6475 OD1 ASP B 41 46.233 56.280 9.478 1.00 21.18 O ATOM 6476 OD2 ASP B 41 46.625 58.390 9.928 1.00 20.22 O ATOM 6477 HA ASP B 41 43.824 55.759 9.369 1.00 0.00 H ATOM 6478 HB2 ASP B 41 44.395 58.595 8.461 1.00 0.00 H ATOM 6479 HB3 ASP B 41 43.931 58.239 10.141 1.00 0.00 H ATOM 6480 H ASP B 41 44.537 56.942 6.847 1.00 0.00 H ATOM 6481 N SER B 42 41.424 57.370 7.875 1.00 17.78 N ATOM 6482 CA SER B 42 39.986 57.666 7.919 1.00 17.38 C ATOM 6483 C SER B 42 39.098 56.418 7.932 1.00 17.21 C ATOM 6484 O SER B 42 37.904 56.513 8.245 1.00 16.85 O ATOM 6485 CB SER B 42 39.589 58.585 6.754 1.00 17.39 C ATOM 6486 OG SER B 42 39.786 57.958 5.502 1.00 16.85 O ATOM 6487 HA SER B 42 39.815 58.174 8.868 1.00 0.00 H ATOM 6488 HB2 SER B 42 40.195 59.490 6.795 1.00 0.00 H ATOM 6489 HB3 SER B 42 38.536 58.849 6.855 1.00 0.00 H ATOM 6490 HG SER B 42 40.742 57.720 5.400 1.00 0.00 H ATOM 6491 H SER B 42 41.945 57.532 6.989 1.00 0.00 H ATOM 6492 N GLY B 43 39.673 55.257 7.603 1.00 17.12 N ATOM 6493 CA GLY B 43 38.930 53.986 7.586 1.00 17.09 C ATOM 6494 C GLY B 43 38.440 53.578 6.201 1.00 17.10 C ATOM 6495 O GLY B 43 37.601 52.688 6.071 1.00 17.13 O ATOM 6496 HA3 GLY B 43 38.065 54.085 8.242 1.00 0.00 H ATOM 6497 HA2 GLY B 43 39.584 53.200 7.965 1.00 0.00 H ATOM 6498 H GLY B 43 40.682 55.251 7.350 1.00 0.00 H ATOM 6499 N MET B 44 38.968 54.239 5.171 1.00 17.17 N ATOM 6500 CA MET B 44 38.657 53.934 3.776 1.00 17.02 C ATOM 6501 C MET B 44 39.388 52.680 3.302 1.00 17.06 C ATOM 6502 O MET B 44 40.356 52.244 3.918 1.00 16.91 O ATOM 6503 CB MET B 44 39.045 55.123 2.881 1.00 16.73 C ATOM 6504 CG MET B 44 38.071 56.301 2.933 1.00 16.83 C ATOM 6505 SD MET B 44 38.685 57.806 2.131 1.00 16.92 S ATOM 6506 CE MET B 44 38.943 57.197 0.461 1.00 16.85 C ATOM 6507 HA MET B 44 37.585 53.752 3.705 1.00 0.00 H ATOM 6508 HB2 MET B 44 40.027 55.479 3.194 1.00 0.00 H ATOM 6509 HB3 MET B 44 39.099 54.771 1.851 1.00 0.00 H ATOM 6510 HG2 MET B 44 37.866 56.530 3.979 1.00 0.00 H ATOM 6511 HG3 MET B 44 37.146 56.003 2.439 1.00 0.00 H ATOM 6512 HE1 MET B 44 39.666 56.381 0.481 1.00 0.00 H ATOM 6513 HE2 MET B 44 37.997 56.836 0.057 1.00 0.00 H ATOM 6514 HE3 MET B 44 39.322 58.005 -0.165 1.00 0.00 H ATOM 6515 H MET B 44 39.635 55.011 5.370 1.00 0.00 H ATOM 6516 N ARG B 45 38.913 52.113 2.195 1.00 17.30 N ATOM 6517 CA ARG B 45 39.544 50.947 1.559 1.00 17.65 C ATOM 6518 C ARG B 45 40.555 51.362 0.486 1.00 16.85 C ATOM 6519 O ARG B 45 41.495 50.621 0.196 1.00 16.71 O ATOM 6520 CB ARG B 45 38.489 50.054 0.904 1.00 17.90 C ATOM 6521 CG ARG B 45 37.532 49.354 1.870 1.00 19.78 C ATOM 6522 CD ARG B 45 36.898 48.111 1.222 1.00 21.11 C ATOM 6523 NE ARG B 45 35.459 48.243 0.964 1.00 24.97 N ATOM 6524 CZ ARG B 45 34.894 48.969 -0.005 1.00 25.83 C ATOM 6525 NH1 ARG B 45 35.624 49.688 -0.845 1.00 27.01 N ATOM 6526 NH2 ARG B 45 33.569 48.984 -0.124 1.00 25.95 N ATOM 6527 HA ARG B 45 40.064 50.403 2.348 1.00 0.00 H ATOM 6528 HB2 ARG B 45 37.895 50.672 0.231 1.00 0.00 H ATOM 6529 HB3 ARG B 45 39.007 49.287 0.329 1.00 0.00 H ATOM 6530 HG2 ARG B 45 38.084 49.049 2.759 1.00 0.00 H ATOM 6531 HG3 ARG B 45 36.742 50.049 2.154 1.00 0.00 H ATOM 6532 HD2 ARG B 45 37.051 47.261 1.887 1.00 0.00 H ATOM 6533 HD3 ARG B 45 37.401 47.924 0.273 1.00 0.00 H ATOM 6534 HE ARG B 45 34.818 47.722 1.596 1.00 0.00 H ATOM 6535 HH12 ARG B 45 35.161 50.245 -1.591 1.00 0.00 H ATOM 6536 HH11 ARG B 45 36.660 49.695 -0.758 1.00 0.00 H ATOM 6537 HH22 ARG B 45 33.121 49.546 -0.875 1.00 0.00 H ATOM 6538 HH21 ARG B 45 32.982 48.433 0.534 1.00 0.00 H ATOM 6539 H ARG B 45 38.057 52.513 1.760 1.00 0.00 H ATOM 6540 N SER B 46 40.319 52.528 -0.117 1.00 16.28 N ATOM 6541 CA SER B 46 41.233 53.149 -1.077 1.00 15.93 C ATOM 6542 C SER B 46 42.195 54.061 -0.328 1.00 15.49 C ATOM 6543 O SER B 46 41.759 54.991 0.345 1.00 15.08 O ATOM 6544 CB SER B 46 40.432 53.996 -2.081 1.00 15.94 C ATOM 6545 OG SER B 46 41.271 54.629 -3.038 1.00 15.53 O ATOM 6546 HA SER B 46 41.783 52.372 -1.608 1.00 0.00 H ATOM 6547 HB2 SER B 46 39.882 54.762 -1.534 1.00 0.00 H ATOM 6548 HB3 SER B 46 39.728 53.349 -2.604 1.00 0.00 H ATOM 6549 HG SER B 46 41.770 53.940 -3.545 1.00 0.00 H ATOM 6550 H SER B 46 39.434 53.025 0.108 1.00 0.00 H ATOM 6551 N HIS B 47 43.494 53.795 -0.441 1.00 15.49 N ATOM 6552 CA HIS B 47 44.520 54.580 0.264 1.00 15.58 C ATOM 6553 C HIS B 47 45.490 55.225 -0.718 1.00 15.68 C ATOM 6554 O HIS B 47 46.673 55.399 -0.399 1.00 15.42 O ATOM 6555 CB HIS B 47 45.350 53.720 1.231 1.00 15.55 C ATOM 6556 CG HIS B 47 44.553 52.760 2.055 1.00 15.43 C ATOM 6557 ND1 HIS B 47 45.096 51.594 2.553 1.00 15.20 N ATOM 6558 CD2 HIS B 47 43.267 52.787 2.472 1.00 15.53 C ATOM 6559 CE1 HIS B 47 44.177 50.943 3.241 1.00 15.39 C ATOM 6560 NE2 HIS B 47 43.057 51.644 3.204 1.00 16.35 N ATOM 6561 HA HIS B 47 43.976 55.340 0.825 1.00 0.00 H ATOM 6562 HB2 HIS B 47 46.070 53.149 0.645 1.00 0.00 H ATOM 6563 HB3 HIS B 47 45.883 54.388 1.908 1.00 0.00 H ATOM 6564 HD2 HIS B 47 42.535 53.568 2.266 1.00 0.00 H ATOM 6565 HE1 HIS B 47 44.317 49.991 3.752 1.00 0.00 H ATOM 6566 H HIS B 47 43.794 53.006 -1.048 1.00 0.00 H ATOM 6567 N VAL B 48 44.994 55.578 -1.902 1.00 15.68 N ATOM 6568 CA VAL B 48 45.822 56.205 -2.928 1.00 15.82 C ATOM 6569 C VAL B 48 45.151 57.478 -3.434 1.00 15.84 C ATOM 6570 O VAL B 48 43.926 57.570 -3.433 1.00 15.73 O ATOM 6571 CB VAL B 48 46.109 55.227 -4.096 1.00 15.82 C ATOM 6572 CG1 VAL B 48 46.991 54.075 -3.614 1.00 16.26 C ATOM 6573 CG2 VAL B 48 44.824 54.689 -4.709 1.00 15.50 C ATOM 6574 HA VAL B 48 46.781 56.468 -2.482 1.00 0.00 H ATOM 6575 HB VAL B 48 46.636 55.782 -4.872 1.00 0.00 H ATOM 6576 HG11 VAL B 48 47.935 54.473 -3.241 1.00 0.00 H ATOM 6577 HG12 VAL B 48 46.480 53.538 -2.815 1.00 0.00 H ATOM 6578 HG13 VAL B 48 47.185 53.396 -4.444 1.00 0.00 H ATOM 6579 HG21 VAL B 48 44.255 54.157 -3.947 1.00 0.00 H ATOM 6580 HG22 VAL B 48 44.231 55.519 -5.094 1.00 0.00 H ATOM 6581 HG23 VAL B 48 45.069 54.008 -5.524 1.00 0.00 H ATOM 6582 H VAL B 48 43.989 55.402 -2.102 1.00 0.00 H ATOM 6583 N TRP B 49 45.942 58.465 -3.850 1.00 16.15 N ATOM 6584 CA TRP B 49 45.368 59.698 -4.394 1.00 16.51 C ATOM 6585 C TRP B 49 46.317 60.502 -5.273 1.00 16.55 C ATOM 6586 O TRP B 49 47.535 60.311 -5.242 1.00 16.23 O ATOM 6587 CB TRP B 49 44.776 60.597 -3.284 1.00 17.36 C ATOM 6588 CG TRP B 49 45.730 61.066 -2.198 1.00 17.76 C ATOM 6589 CD1 TRP B 49 47.090 60.969 -2.193 1.00 18.66 C ATOM 6590 CD2 TRP B 49 45.376 61.745 -0.980 1.00 18.12 C ATOM 6591 NE1 TRP B 49 47.605 61.524 -1.044 1.00 18.95 N ATOM 6592 CE2 TRP B 49 46.576 62.018 -0.288 1.00 19.04 C ATOM 6593 CE3 TRP B 49 44.165 62.142 -0.407 1.00 18.28 C ATOM 6594 CZ2 TRP B 49 46.598 62.664 0.953 1.00 19.06 C ATOM 6595 CZ3 TRP B 49 44.186 62.781 0.821 1.00 18.45 C ATOM 6596 CH2 TRP B 49 45.394 63.037 1.488 1.00 18.73 C ATOM 6597 HA TRP B 49 44.563 59.357 -5.046 1.00 0.00 H ATOM 6598 HB2 TRP B 49 44.361 61.483 -3.764 1.00 0.00 H ATOM 6599 HB3 TRP B 49 43.974 60.039 -2.800 1.00 0.00 H ATOM 6600 HE1 TRP B 49 48.613 61.562 -0.791 1.00 0.00 H ATOM 6601 HD1 TRP B 49 47.685 60.516 -2.986 1.00 0.00 H ATOM 6602 HZ2 TRP B 49 47.535 62.862 1.473 1.00 0.00 H ATOM 6603 HH2 TRP B 49 45.373 63.544 2.453 1.00 0.00 H ATOM 6604 HZ3 TRP B 49 43.247 63.091 1.278 1.00 0.00 H ATOM 6605 HE3 TRP B 49 43.221 61.952 -0.918 1.00 0.00 H ATOM 6606 H TRP B 49 46.975 58.360 -3.788 1.00 0.00 H ATOM 6607 N GLY B 50 45.721 61.395 -6.060 1.00 16.47 N ATOM 6608 CA GLY B 50 46.441 62.288 -6.946 1.00 16.63 C ATOM 6609 C GLY B 50 46.557 63.633 -6.278 1.00 16.90 C ATOM 6610 O GLY B 50 45.743 64.530 -6.508 1.00 16.39 O ATOM 6611 HA3 GLY B 50 45.899 62.390 -7.886 1.00 0.00 H ATOM 6612 HA2 GLY B 50 47.436 61.888 -7.143 1.00 0.00 H ATOM 6613 H GLY B 50 44.683 61.455 -6.038 1.00 0.00 H ATOM 6614 N ASN B 51 47.578 63.757 -5.436 1.00 17.35 N ATOM 6615 CA ASN B 51 47.751 64.923 -4.578 1.00 17.70 C ATOM 6616 C ASN B 51 48.541 66.040 -5.243 1.00 18.04 C ATOM 6617 O ASN B 51 49.443 65.793 -6.039 1.00 17.89 O ATOM 6618 CB ASN B 51 48.420 64.522 -3.249 1.00 17.73 C ATOM 6619 CG ASN B 51 49.774 63.825 -3.440 1.00 18.41 C ATOM 6620 OD1 ASN B 51 49.969 63.039 -4.375 1.00 20.11 O ATOM 6621 ND2 ASN B 51 50.709 64.103 -2.539 1.00 20.03 N ATOM 6622 HA ASN B 51 46.752 65.313 -4.383 1.00 0.00 H ATOM 6623 HB2 ASN B 51 48.574 65.422 -2.653 1.00 0.00 H ATOM 6624 HB3 ASN B 51 47.753 63.844 -2.716 1.00 0.00 H ATOM 6625 HD22 ASN B 51 50.506 64.770 -1.767 1.00 0.00 H ATOM 6626 HD21 ASN B 51 51.645 63.654 -2.605 1.00 0.00 H ATOM 6627 H ASN B 51 48.281 62.992 -5.387 1.00 0.00 H ATOM 6628 N VAL B 52 48.185 67.275 -4.909 1.00 18.64 N ATOM 6629 CA VAL B 52 48.961 68.438 -5.312 1.00 19.41 C ATOM 6630 C VAL B 52 50.218 68.495 -4.444 1.00 19.98 C ATOM 6631 O VAL B 52 50.127 68.600 -3.228 1.00 20.06 O ATOM 6632 CB VAL B 52 48.142 69.750 -5.166 1.00 19.25 C ATOM 6633 CG1 VAL B 52 49.007 70.972 -5.433 1.00 19.29 C ATOM 6634 CG2 VAL B 52 46.963 69.739 -6.111 1.00 19.40 C ATOM 6635 HA VAL B 52 49.228 68.345 -6.365 1.00 0.00 H ATOM 6636 HB VAL B 52 47.780 69.805 -4.139 1.00 0.00 H ATOM 6637 HG11 VAL B 52 49.831 70.995 -4.720 1.00 0.00 H ATOM 6638 HG12 VAL B 52 49.404 70.920 -6.447 1.00 0.00 H ATOM 6639 HG13 VAL B 52 48.404 71.873 -5.323 1.00 0.00 H ATOM 6640 HG21 VAL B 52 47.322 69.655 -7.137 1.00 0.00 H ATOM 6641 HG22 VAL B 52 46.321 68.890 -5.879 1.00 0.00 H ATOM 6642 HG23 VAL B 52 46.399 70.665 -5.997 1.00 0.00 H ATOM 6643 H VAL B 52 47.325 67.415 -4.342 1.00 0.00 H ATOM 6644 N LYS B 53 51.382 68.436 -5.084 1.00 20.99 N ATOM 6645 CA LYS B 53 52.663 68.386 -4.386 1.00 21.83 C ATOM 6646 C LYS B 53 53.132 69.836 -4.222 1.00 22.45 C ATOM 6647 O LYS B 53 54.062 70.287 -4.893 1.00 22.71 O ATOM 6648 CB LYS B 53 53.711 67.559 -5.170 1.00 21.70 C ATOM 6649 CG LYS B 53 53.181 66.402 -6.039 1.00 22.22 C ATOM 6650 CD LYS B 53 53.024 65.094 -5.279 1.00 22.12 C ATOM 6651 CE LYS B 53 52.674 63.941 -6.228 1.00 21.47 C ATOM 6652 NZ LYS B 53 51.386 64.130 -6.966 1.00 20.16 N ATOM 6653 HA LYS B 53 52.547 67.895 -3.420 1.00 0.00 H ATOM 6654 HB2 LYS B 53 54.247 68.245 -5.826 1.00 0.00 H ATOM 6655 HB3 LYS B 53 54.405 67.135 -4.445 1.00 0.00 H ATOM 6656 HG2 LYS B 53 52.208 66.688 -6.438 1.00 0.00 H ATOM 6657 HG3 LYS B 53 53.877 66.242 -6.862 1.00 0.00 H ATOM 6658 HD2 LYS B 53 53.960 64.864 -4.769 1.00 0.00 H ATOM 6659 HD3 LYS B 53 52.228 65.203 -4.543 1.00 0.00 H ATOM 6660 HE2 LYS B 53 52.603 63.024 -5.643 1.00 0.00 H ATOM 6661 HE3 LYS B 53 53.477 63.842 -6.959 1.00 0.00 H ATOM 6662 HZ1 LYS B 53 50.606 64.214 -6.283 1.00 0.00 H ATOM 6663 HZ2 LYS B 53 51.441 64.995 -7.540 1.00 0.00 H ATOM 6664 HZ3 LYS B 53 51.219 63.311 -7.585 1.00 0.00 H ATOM 6665 H LYS B 53 51.380 68.425 -6.124 1.00 0.00 H ATOM 6666 N LEU B 54 52.462 70.575 -3.353 1.00 23.25 N ATOM 6667 CA LEU B 54 52.751 71.993 -3.190 1.00 24.02 C ATOM 6668 C LEU B 54 52.184 72.497 -1.882 1.00 24.65 C ATOM 6669 O LEU B 54 50.995 72.350 -1.625 1.00 24.76 O ATOM 6670 CB LEU B 54 52.154 72.802 -4.346 1.00 24.08 C ATOM 6671 CG LEU B 54 52.358 74.322 -4.322 1.00 24.01 C ATOM 6672 CD1 LEU B 54 53.820 74.676 -4.502 1.00 24.38 C ATOM 6673 CD2 LEU B 54 51.521 75.001 -5.394 1.00 24.18 C ATOM 6674 HA LEU B 54 53.834 72.119 -3.188 1.00 0.00 H ATOM 6675 HB2 LEU B 54 52.595 72.427 -5.270 1.00 0.00 H ATOM 6676 HB3 LEU B 54 51.080 72.616 -4.355 1.00 0.00 H ATOM 6677 HG LEU B 54 52.031 74.683 -3.347 1.00 0.00 H ATOM 6678 HD21 LEU B 54 51.813 74.624 -6.374 1.00 0.00 H ATOM 6679 HD22 LEU B 54 50.467 74.786 -5.220 1.00 0.00 H ATOM 6680 HD23 LEU B 54 51.685 76.078 -5.354 1.00 0.00 H ATOM 6681 HD11 LEU B 54 54.402 74.232 -3.695 1.00 0.00 H ATOM 6682 HD12 LEU B 54 54.171 74.291 -5.459 1.00 0.00 H ATOM 6683 HD13 LEU B 54 53.935 75.760 -4.481 1.00 0.00 H ATOM 6684 H LEU B 54 51.716 70.136 -2.776 1.00 0.00 H ATOM 6685 N ASP B 55 53.041 73.089 -1.060 1.00 25.64 N ATOM 6686 CA ASP B 55 52.607 73.753 0.158 1.00 26.13 C ATOM 6687 C ASP B 55 52.176 75.162 -0.234 1.00 26.74 C ATOM 6688 O ASP B 55 53.004 75.964 -0.665 1.00 26.79 O ATOM 6689 CB ASP B 55 53.758 73.794 1.167 1.00 26.33 C ATOM 6690 CG ASP B 55 53.309 74.192 2.571 1.00 26.43 C ATOM 6691 OD1 ASP B 55 54.071 73.900 3.523 1.00 27.12 O ATOM 6692 OD2 ASP B 55 52.215 74.791 2.726 1.00 26.68 O ATOM 6693 HA ASP B 55 51.780 73.221 0.628 1.00 0.00 H ATOM 6694 HB2 ASP B 55 54.213 72.805 1.215 1.00 0.00 H ATOM 6695 HB3 ASP B 55 54.498 74.516 0.821 1.00 0.00 H ATOM 6696 H ASP B 55 54.054 73.078 -1.294 1.00 0.00 H ATOM 6697 N THR B 56 50.883 75.455 -0.100 1.00 27.38 N ATOM 6698 CA THR B 56 50.332 76.735 -0.577 1.00 27.91 C ATOM 6699 C THR B 56 50.353 77.856 0.465 1.00 28.31 C ATOM 6700 O THR B 56 49.875 78.958 0.188 1.00 28.62 O ATOM 6701 CB THR B 56 48.875 76.581 -1.070 1.00 28.02 C ATOM 6702 OG1 THR B 56 48.051 76.141 0.015 1.00 28.17 O ATOM 6703 CG2 THR B 56 48.790 75.588 -2.232 1.00 27.74 C ATOM 6704 HA THR B 56 50.994 77.017 -1.396 1.00 0.00 H ATOM 6705 HB THR B 56 48.523 77.548 -1.429 1.00 0.00 H ATOM 6706 HG1 THR B 56 47.118 76.042 -0.300 1.00 0.00 H ATOM 6707 HG23 THR B 56 49.421 75.934 -3.051 1.00 0.00 H ATOM 6708 HG21 THR B 56 49.132 74.609 -1.897 1.00 0.00 H ATOM 6709 HG22 THR B 56 47.757 75.517 -2.573 1.00 0.00 H ATOM 6710 H THR B 56 50.249 74.765 0.351 1.00 0.00 H ATOM 6711 N THR B 57 50.902 77.585 1.648 1.00 28.80 N ATOM 6712 CA THR B 57 51.026 78.604 2.695 1.00 28.73 C ATOM 6713 C THR B 57 51.813 79.823 2.212 1.00 28.75 C ATOM 6714 O THR B 57 52.913 79.683 1.686 1.00 28.84 O ATOM 6715 CB THR B 57 51.719 78.036 3.938 1.00 28.98 C ATOM 6716 OG1 THR B 57 51.065 76.822 4.338 1.00 29.08 O ATOM 6717 CG2 THR B 57 51.668 79.045 5.089 1.00 29.26 C ATOM 6718 HA THR B 57 50.011 78.913 2.946 1.00 0.00 H ATOM 6719 HB THR B 57 52.762 77.832 3.695 1.00 0.00 H ATOM 6720 HG1 THR B 57 51.116 76.163 3.601 1.00 0.00 H ATOM 6721 HG23 THR B 57 52.165 79.966 4.785 1.00 0.00 H ATOM 6722 HG21 THR B 57 50.628 79.257 5.339 1.00 0.00 H ATOM 6723 HG22 THR B 57 52.175 78.628 5.959 1.00 0.00 H ATOM 6724 H THR B 57 51.253 76.624 1.834 1.00 0.00 H ATOM 6725 N GLY B 58 51.228 81.010 2.371 1.00 28.69 N ATOM 6726 CA GLY B 58 51.889 82.272 2.016 1.00 28.60 C ATOM 6727 C GLY B 58 51.754 82.734 0.569 1.00 28.68 C ATOM 6728 O GLY B 58 52.049 83.895 0.258 1.00 28.73 O ATOM 6729 HA3 GLY B 58 52.952 82.159 2.229 1.00 0.00 H ATOM 6730 HA2 GLY B 58 51.473 83.053 2.652 1.00 0.00 H ATOM 6731 H GLY B 58 50.265 81.044 2.762 1.00 0.00 H ATOM 6732 N LEU B 59 51.299 81.853 -0.322 1.00 28.61 N ATOM 6733 CA LEU B 59 51.270 82.166 -1.756 1.00 28.42 C ATOM 6734 C LEU B 59 50.124 83.111 -2.118 1.00 28.25 C ATOM 6735 O LEU B 59 50.097 83.665 -3.222 1.00 28.24 O ATOM 6736 CB LEU B 59 51.176 80.887 -2.599 1.00 28.52 C ATOM 6737 CG LEU B 59 52.067 79.682 -2.264 1.00 28.43 C ATOM 6738 CD1 LEU B 59 51.904 78.618 -3.345 1.00 28.71 C ATOM 6739 CD2 LEU B 59 53.537 80.036 -2.105 1.00 28.60 C ATOM 6740 HA LEU B 59 52.208 82.674 -1.982 1.00 0.00 H ATOM 6741 HB2 LEU B 59 50.144 80.543 -2.536 1.00 0.00 H ATOM 6742 HB3 LEU B 59 51.401 81.170 -3.627 1.00 0.00 H ATOM 6743 HG LEU B 59 51.737 79.305 -1.296 1.00 0.00 H ATOM 6744 HD21 LEU B 59 53.908 80.467 -3.035 1.00 0.00 H ATOM 6745 HD22 LEU B 59 53.650 80.759 -1.297 1.00 0.00 H ATOM 6746 HD23 LEU B 59 54.103 79.135 -1.869 1.00 0.00 H ATOM 6747 HD11 LEU B 59 50.862 78.301 -3.387 1.00 0.00 H ATOM 6748 HD12 LEU B 59 52.198 79.033 -4.309 1.00 0.00 H ATOM 6749 HD13 LEU B 59 52.536 77.762 -3.109 1.00 0.00 H ATOM 6750 H LEU B 59 50.958 80.926 0.005 1.00 0.00 H ATOM 6751 N ILE B 60 49.178 83.281 -1.194 1.00 28.15 N ATOM 6752 CA ILE B 60 48.057 84.211 -1.360 1.00 28.20 C ATOM 6753 C ILE B 60 47.987 85.162 -0.159 1.00 28.39 C ATOM 6754 O ILE B 60 48.147 84.738 0.986 1.00 27.96 O ATOM 6755 CB ILE B 60 46.710 83.453 -1.492 1.00 27.83 C ATOM 6756 CG1 ILE B 60 46.762 82.465 -2.664 1.00 27.70 C ATOM 6757 CG2 ILE B 60 45.556 84.439 -1.673 1.00 27.73 C ATOM 6758 CD1 ILE B 60 45.612 81.481 -2.723 1.00 27.85 C ATOM 6759 HA ILE B 60 48.225 84.778 -2.275 1.00 0.00 H ATOM 6760 HB ILE B 60 46.540 82.890 -0.574 1.00 0.00 H ATOM 6761 HG12 ILE B 60 46.764 83.039 -3.591 1.00 0.00 H ATOM 6762 HG13 ILE B 60 47.689 81.897 -2.587 1.00 0.00 H ATOM 6763 HD11 ILE B 60 45.599 80.884 -1.811 1.00 0.00 H ATOM 6764 HD12 ILE B 60 44.673 82.027 -2.815 1.00 0.00 H ATOM 6765 HD13 ILE B 60 45.739 80.826 -3.585 1.00 0.00 H ATOM 6766 HG21 ILE B 60 45.507 85.101 -0.809 1.00 0.00 H ATOM 6767 HG22 ILE B 60 45.721 85.028 -2.575 1.00 0.00 H ATOM 6768 HG23 ILE B 60 44.620 83.888 -1.764 1.00 0.00 H ATOM 6769 H ILE B 60 49.238 82.728 -0.315 1.00 0.00 H ATOM 6770 N ASP B 61 47.740 86.441 -0.439 1.00 29.07 N ATOM 6771 CA ASP B 61 47.554 87.467 0.594 1.00 29.41 C ATOM 6772 C ASP B 61 46.638 86.969 1.725 1.00 29.53 C ATOM 6773 O ASP B 61 45.608 86.339 1.469 1.00 29.15 O ATOM 6774 CB ASP B 61 46.965 88.734 -0.048 1.00 29.84 C ATOM 6775 CG ASP B 61 46.948 89.934 0.894 1.00 30.57 C ATOM 6776 OD1 ASP B 61 47.360 91.029 0.446 1.00 34.18 O ATOM 6777 OD2 ASP B 61 46.518 89.805 2.067 1.00 33.56 O ATOM 6778 HA ASP B 61 48.525 87.694 1.034 1.00 0.00 H ATOM 6779 HB2 ASP B 61 47.563 88.989 -0.923 1.00 0.00 H ATOM 6780 HB3 ASP B 61 45.942 88.522 -0.358 1.00 0.00 H ATOM 6781 H ASP B 61 47.676 86.726 -1.437 1.00 0.00 H ATOM 6782 N ARG B 62 47.027 87.264 2.967 1.00 29.85 N ATOM 6783 CA ARG B 62 46.291 86.829 4.167 1.00 29.80 C ATOM 6784 C ARG B 62 44.810 87.192 4.098 1.00 29.09 C ATOM 6785 O ARG B 62 43.944 86.355 4.340 1.00 29.08 O ATOM 6786 CB ARG B 62 46.895 87.453 5.435 1.00 30.04 C ATOM 6787 CG ARG B 62 46.585 86.660 6.714 1.00 31.18 C ATOM 6788 CD ARG B 62 46.703 87.479 8.019 1.00 32.76 C ATOM 6789 NE ARG B 62 47.539 88.684 7.900 1.00 35.56 N ATOM 6790 CZ ARG B 62 47.123 89.943 8.093 1.00 36.62 C ATOM 6791 NH1 ARG B 62 45.861 90.222 8.428 1.00 36.87 N ATOM 6792 NH2 ARG B 62 47.986 90.945 7.950 1.00 36.64 N ATOM 6793 HA ARG B 62 46.381 85.743 4.207 1.00 0.00 H ATOM 6794 HB2 ARG B 62 47.977 87.504 5.314 1.00 0.00 H ATOM 6795 HB3 ARG B 62 46.496 88.461 5.548 1.00 0.00 H ATOM 6796 HG2 ARG B 62 45.566 86.280 6.641 1.00 0.00 H ATOM 6797 HG3 ARG B 62 47.280 85.823 6.773 1.00 0.00 H ATOM 6798 HD2 ARG B 62 47.134 86.838 8.788 1.00 0.00 H ATOM 6799 HD3 ARG B 62 45.702 87.785 8.323 1.00 0.00 H ATOM 6800 HE ARG B 62 48.538 88.547 7.644 1.00 0.00 H ATOM 6801 HH12 ARG B 62 45.567 91.209 8.571 1.00 0.00 H ATOM 6802 HH11 ARG B 62 45.172 89.452 8.546 1.00 0.00 H ATOM 6803 HH22 ARG B 62 47.673 91.926 8.098 1.00 0.00 H ATOM 6804 HH21 ARG B 62 48.974 90.748 7.691 1.00 0.00 H ATOM 6805 H ARG B 62 47.891 87.828 3.094 1.00 0.00 H ATOM 6806 N LYS B 63 44.538 88.446 3.755 1.00 28.31 N ATOM 6807 CA LYS B 63 43.179 88.972 3.739 1.00 27.87 C ATOM 6808 C LYS B 63 42.323 88.389 2.612 1.00 27.01 C ATOM 6809 O LYS B 63 41.099 88.510 2.636 1.00 27.05 O ATOM 6810 CB LYS B 63 43.203 90.504 3.640 1.00 28.14 C ATOM 6811 CG LYS B 63 43.653 91.191 4.935 1.00 28.73 C ATOM 6812 CD LYS B 63 43.235 92.663 4.971 1.00 29.02 C ATOM 6813 CE LYS B 63 43.489 93.287 6.344 1.00 29.96 C ATOM 6814 NZ LYS B 63 42.601 92.710 7.397 1.00 31.28 N ATOM 6815 HA LYS B 63 42.717 88.668 4.678 1.00 0.00 H ATOM 6816 HB2 LYS B 63 43.888 90.788 2.842 1.00 0.00 H ATOM 6817 HB3 LYS B 63 42.199 90.851 3.396 1.00 0.00 H ATOM 6818 HG2 LYS B 63 43.203 90.675 5.783 1.00 0.00 H ATOM 6819 HG3 LYS B 63 44.739 91.130 5.008 1.00 0.00 H ATOM 6820 HD2 LYS B 63 43.806 93.212 4.222 1.00 0.00 H ATOM 6821 HD3 LYS B 63 42.172 92.735 4.741 1.00 0.00 H ATOM 6822 HE2 LYS B 63 43.309 94.360 6.281 1.00 0.00 H ATOM 6823 HE3 LYS B 63 44.527 93.110 6.624 1.00 0.00 H ATOM 6824 HZ1 LYS B 63 41.607 92.880 7.142 1.00 0.00 H ATOM 6825 HZ2 LYS B 63 42.771 91.687 7.469 1.00 0.00 H ATOM 6826 HZ3 LYS B 63 42.809 93.163 8.310 1.00 0.00 H ATOM 6827 H LYS B 63 45.322 89.075 3.488 1.00 0.00 H ATOM 6828 N VAL B 64 42.971 87.768 1.631 1.00 25.73 N ATOM 6829 CA VAL B 64 42.281 87.111 0.528 1.00 24.78 C ATOM 6830 C VAL B 64 42.070 85.618 0.831 1.00 23.75 C ATOM 6831 O VAL B 64 40.954 85.100 0.696 1.00 23.35 O ATOM 6832 CB VAL B 64 43.076 87.304 -0.772 1.00 24.69 C ATOM 6833 CG1 VAL B 64 42.448 86.549 -1.933 1.00 24.78 C ATOM 6834 CG2 VAL B 64 43.160 88.788 -1.097 1.00 25.00 C ATOM 6835 HA VAL B 64 41.298 87.565 0.404 1.00 0.00 H ATOM 6836 HB VAL B 64 44.077 86.900 -0.622 1.00 0.00 H ATOM 6837 HG11 VAL B 64 42.422 85.484 -1.701 1.00 0.00 H ATOM 6838 HG12 VAL B 64 41.433 86.912 -2.094 1.00 0.00 H ATOM 6839 HG13 VAL B 64 43.040 86.712 -2.833 1.00 0.00 H ATOM 6840 HG21 VAL B 64 42.154 89.189 -1.222 1.00 0.00 H ATOM 6841 HG22 VAL B 64 43.662 89.309 -0.282 1.00 0.00 H ATOM 6842 HG23 VAL B 64 43.724 88.925 -2.020 1.00 0.00 H ATOM 6843 H VAL B 64 44.011 87.750 1.652 1.00 0.00 H ATOM 6844 N VAL B 65 43.136 84.945 1.261 1.00 22.47 N ATOM 6845 CA VAL B 65 43.112 83.497 1.480 1.00 22.02 C ATOM 6846 C VAL B 65 42.250 83.071 2.683 1.00 21.39 C ATOM 6847 O VAL B 65 41.814 81.925 2.761 1.00 20.90 O ATOM 6848 CB VAL B 65 44.552 82.925 1.606 1.00 21.84 C ATOM 6849 CG1 VAL B 65 45.186 83.269 2.962 1.00 21.71 C ATOM 6850 CG2 VAL B 65 44.567 81.404 1.356 1.00 22.01 C ATOM 6851 HA VAL B 65 42.637 83.070 0.596 1.00 0.00 H ATOM 6852 HB VAL B 65 45.159 83.401 0.836 1.00 0.00 H ATOM 6853 HG11 VAL B 65 45.236 84.352 3.074 1.00 0.00 H ATOM 6854 HG12 VAL B 65 44.579 82.848 3.763 1.00 0.00 H ATOM 6855 HG13 VAL B 65 46.191 82.850 3.008 1.00 0.00 H ATOM 6856 HG21 VAL B 65 43.929 80.910 2.089 1.00 0.00 H ATOM 6857 HG22 VAL B 65 44.195 81.198 0.352 1.00 0.00 H ATOM 6858 HG23 VAL B 65 45.587 81.032 1.451 1.00 0.00 H ATOM 6859 H VAL B 65 44.016 85.466 1.448 1.00 0.00 H ATOM 6860 N ARG B 66 42.001 83.994 3.607 1.00 20.87 N ATOM 6861 CA ARG B 66 41.166 83.710 4.782 1.00 21.01 C ATOM 6862 C ARG B 66 39.737 83.268 4.422 1.00 20.16 C ATOM 6863 O ARG B 66 39.120 82.509 5.165 1.00 19.72 O ATOM 6864 CB ARG B 66 41.123 84.924 5.726 1.00 21.25 C ATOM 6865 CG ARG B 66 40.591 86.193 5.086 1.00 22.18 C ATOM 6866 CD ARG B 66 40.665 87.365 6.038 1.00 22.98 C ATOM 6867 NE ARG B 66 40.124 88.583 5.437 1.00 24.06 N ATOM 6868 CZ ARG B 66 39.990 89.746 6.070 1.00 25.45 C ATOM 6869 NH1 ARG B 66 40.357 89.868 7.342 1.00 26.80 N ATOM 6870 NH2 ARG B 66 39.487 90.794 5.427 1.00 25.58 N ATOM 6871 HA ARG B 66 41.636 82.868 5.291 1.00 0.00 H ATOM 6872 HB2 ARG B 66 40.485 84.675 6.574 1.00 0.00 H ATOM 6873 HB3 ARG B 66 42.136 85.118 6.080 1.00 0.00 H ATOM 6874 HG2 ARG B 66 41.183 86.418 4.199 1.00 0.00 H ATOM 6875 HG3 ARG B 66 39.552 86.036 4.797 1.00 0.00 H ATOM 6876 HD2 ARG B 66 41.707 87.536 6.308 1.00 0.00 H ATOM 6877 HD3 ARG B 66 40.093 87.129 6.935 1.00 0.00 H ATOM 6878 HE ARG B 66 39.822 88.537 4.443 1.00 0.00 H ATOM 6879 HH12 ARG B 66 40.249 90.780 7.829 1.00 0.00 H ATOM 6880 HH11 ARG B 66 40.752 89.051 7.850 1.00 0.00 H ATOM 6881 HH22 ARG B 66 39.381 91.704 5.919 1.00 0.00 H ATOM 6882 HH21 ARG B 66 39.199 90.704 4.432 1.00 0.00 H ATOM 6883 H ARG B 66 42.409 84.944 3.495 1.00 0.00 H ATOM 6884 N PHE B 67 39.231 83.736 3.281 1.00 19.51 N ATOM 6885 CA PHE B 67 37.913 83.333 2.774 1.00 19.16 C ATOM 6886 C PHE B 67 37.898 82.007 1.989 1.00 18.64 C ATOM 6887 O PHE B 67 36.828 81.528 1.608 1.00 18.60 O ATOM 6888 CB PHE B 67 37.361 84.426 1.858 1.00 19.07 C ATOM 6889 CG PHE B 67 37.034 85.712 2.564 1.00 19.33 C ATOM 6890 CD1 PHE B 67 35.834 85.853 3.255 1.00 19.24 C ATOM 6891 CD2 PHE B 67 37.904 86.798 2.503 1.00 19.24 C ATOM 6892 CE1 PHE B 67 35.519 87.040 3.899 1.00 19.31 C ATOM 6893 CE2 PHE B 67 37.589 87.990 3.140 1.00 19.39 C ATOM 6894 CZ PHE B 67 36.396 88.109 3.842 1.00 19.03 C ATOM 6895 HA PHE B 67 37.300 83.183 3.663 1.00 0.00 H ATOM 6896 HB2 PHE B 67 38.105 84.637 1.090 1.00 0.00 H ATOM 6897 HB3 PHE B 67 36.451 84.052 1.388 1.00 0.00 H ATOM 6898 HD2 PHE B 67 38.840 86.711 1.951 1.00 0.00 H ATOM 6899 HE2 PHE B 67 38.278 88.833 3.090 1.00 0.00 H ATOM 6900 HZ PHE B 67 36.151 89.043 4.347 1.00 0.00 H ATOM 6901 HE1 PHE B 67 34.582 87.131 4.449 1.00 0.00 H ATOM 6902 HD1 PHE B 67 35.133 85.019 3.290 1.00 0.00 H ATOM 6903 H PHE B 67 39.792 84.414 2.727 1.00 0.00 H ATOM 6904 N MET B 68 39.065 81.416 1.752 1.00 18.12 N ATOM 6905 CA MET B 68 39.202 80.366 0.744 1.00 18.14 C ATOM 6906 C MET B 68 39.368 78.963 1.297 1.00 17.54 C ATOM 6907 O MET B 68 40.081 78.757 2.276 1.00 17.73 O ATOM 6908 CB MET B 68 40.421 80.642 -0.115 1.00 18.05 C ATOM 6909 CG MET B 68 40.347 81.888 -0.938 1.00 18.83 C ATOM 6910 SD MET B 68 41.820 81.945 -1.970 1.00 20.22 S ATOM 6911 CE MET B 68 41.376 83.185 -3.169 1.00 20.27 C ATOM 6912 HA MET B 68 38.266 80.394 0.187 1.00 0.00 H ATOM 6913 HB2 MET B 68 41.287 80.722 0.542 1.00 0.00 H ATOM 6914 HB3 MET B 68 40.556 79.798 -0.791 1.00 0.00 H ATOM 6915 HG2 MET B 68 40.314 82.762 -0.288 1.00 0.00 H ATOM 6916 HG3 MET B 68 39.455 81.868 -1.564 1.00 0.00 H ATOM 6917 HE1 MET B 68 40.485 82.864 -3.709 1.00 0.00 H ATOM 6918 HE2 MET B 68 41.173 84.126 -2.658 1.00 0.00 H ATOM 6919 HE3 MET B 68 42.199 83.321 -3.871 1.00 0.00 H ATOM 6920 H MET B 68 39.901 81.708 2.297 1.00 0.00 H ATOM 6921 N SER B 69 38.715 78.003 0.649 1.00 16.95 N ATOM 6922 CA SER B 69 39.044 76.585 0.813 1.00 16.70 C ATOM 6923 C SER B 69 40.123 76.218 -0.207 1.00 16.23 C ATOM 6924 O SER B 69 40.502 77.042 -1.043 1.00 15.82 O ATOM 6925 CB SER B 69 37.802 75.714 0.588 1.00 16.75 C ATOM 6926 OG SER B 69 37.315 75.834 -0.745 1.00 16.07 O ATOM 6927 HA SER B 69 39.404 76.410 1.827 1.00 0.00 H ATOM 6928 HB2 SER B 69 37.020 76.026 1.281 1.00 0.00 H ATOM 6929 HB3 SER B 69 38.060 74.672 0.779 1.00 0.00 H ATOM 6930 HG SER B 69 36.516 75.261 -0.856 1.00 0.00 H ATOM 6931 H SER B 69 37.944 78.268 0.003 1.00 0.00 H ATOM 6932 N ASP B 70 40.597 74.979 -0.148 1.00 15.94 N ATOM 6933 CA ASP B 70 41.604 74.488 -1.095 1.00 16.11 C ATOM 6934 C ASP B 70 41.176 74.577 -2.566 1.00 15.75 C ATOM 6935 O ASP B 70 41.979 74.968 -3.414 1.00 15.66 O ATOM 6936 CB ASP B 70 42.022 73.054 -0.749 1.00 16.31 C ATOM 6937 CG ASP B 70 42.925 72.989 0.485 1.00 17.58 C ATOM 6938 OD1 ASP B 70 43.246 71.868 0.935 1.00 18.44 O ATOM 6939 OD2 ASP B 70 43.314 74.058 1.010 1.00 19.28 O ATOM 6940 HA ASP B 70 42.458 75.157 -0.987 1.00 0.00 H ATOM 6941 HB2 ASP B 70 41.125 72.465 -0.558 1.00 0.00 H ATOM 6942 HB3 ASP B 70 42.559 72.631 -1.598 1.00 0.00 H ATOM 6943 H ASP B 70 40.244 74.338 0.591 1.00 0.00 H ATOM 6944 N ALA B 71 39.923 74.226 -2.866 1.00 15.47 N ATOM 6945 CA ALA B 71 39.414 74.321 -4.243 1.00 15.07 C ATOM 6946 C ALA B 71 39.669 75.724 -4.805 1.00 14.62 C ATOM 6947 O ALA B 71 40.176 75.867 -5.917 1.00 14.45 O ATOM 6948 CB ALA B 71 37.928 73.973 -4.299 1.00 14.97 C ATOM 6949 HA ALA B 71 39.948 73.599 -4.861 1.00 0.00 H ATOM 6950 HB1 ALA B 71 37.781 72.955 -3.940 1.00 0.00 H ATOM 6951 HB2 ALA B 71 37.370 74.666 -3.670 1.00 0.00 H ATOM 6952 HB3 ALA B 71 37.576 74.051 -5.328 1.00 0.00 H ATOM 6953 H ALA B 71 39.296 73.879 -2.113 1.00 0.00 H ATOM 6954 N SER B 72 39.360 76.746 -4.010 1.00 14.17 N ATOM 6955 CA SER B 72 39.570 78.146 -4.405 1.00 14.30 C ATOM 6956 C SER B 72 41.057 78.511 -4.520 1.00 14.04 C ATOM 6957 O SER B 72 41.457 79.223 -5.443 1.00 14.00 O ATOM 6958 CB SER B 72 38.867 79.097 -3.421 1.00 14.22 C ATOM 6959 OG SER B 72 37.466 78.864 -3.404 1.00 14.53 O ATOM 6960 HA SER B 72 39.132 78.261 -5.396 1.00 0.00 H ATOM 6961 HB2 SER B 72 39.054 80.127 -3.724 1.00 0.00 H ATOM 6962 HB3 SER B 72 39.268 78.936 -2.420 1.00 0.00 H ATOM 6963 HG SER B 72 37.037 79.487 -2.765 1.00 0.00 H ATOM 6964 H SER B 72 38.954 76.546 -3.073 1.00 0.00 H ATOM 6965 N ILE B 73 41.867 78.025 -3.584 1.00 13.96 N ATOM 6966 CA ILE B 73 43.313 78.254 -3.615 1.00 13.97 C ATOM 6967 C ILE B 73 43.912 77.733 -4.929 1.00 13.97 C ATOM 6968 O ILE B 73 44.628 78.452 -5.612 1.00 14.05 O ATOM 6969 CB ILE B 73 44.021 77.608 -2.380 1.00 13.97 C ATOM 6970 CG1 ILE B 73 43.628 78.354 -1.099 1.00 13.94 C ATOM 6971 CG2 ILE B 73 45.552 77.625 -2.530 1.00 13.99 C ATOM 6972 CD1 ILE B 73 44.181 77.750 0.186 1.00 13.93 C ATOM 6973 HA ILE B 73 43.484 79.329 -3.562 1.00 0.00 H ATOM 6974 HB ILE B 73 43.695 76.570 -2.320 1.00 0.00 H ATOM 6975 HG12 ILE B 73 43.992 79.378 -1.177 1.00 0.00 H ATOM 6976 HG13 ILE B 73 42.540 78.361 -1.030 1.00 0.00 H ATOM 6977 HD11 ILE B 73 43.817 76.728 0.292 1.00 0.00 H ATOM 6978 HD12 ILE B 73 45.270 77.746 0.145 1.00 0.00 H ATOM 6979 HD13 ILE B 73 43.850 78.345 1.037 1.00 0.00 H ATOM 6980 HG21 ILE B 73 45.835 77.064 -3.421 1.00 0.00 H ATOM 6981 HG22 ILE B 73 45.895 78.655 -2.623 1.00 0.00 H ATOM 6982 HG23 ILE B 73 46.007 77.167 -1.652 1.00 0.00 H ATOM 6983 H ILE B 73 41.461 77.466 -2.807 1.00 0.00 H ATOM 6984 N TYR B 74 43.606 76.488 -5.282 1.00 13.87 N ATOM 6985 CA TYR B 74 44.138 75.891 -6.506 1.00 13.83 C ATOM 6986 C TYR B 74 43.700 76.658 -7.757 1.00 13.75 C ATOM 6987 O TYR B 74 44.513 76.901 -8.650 1.00 13.55 O ATOM 6988 CB TYR B 74 43.722 74.419 -6.628 1.00 14.18 C ATOM 6989 CG TYR B 74 44.205 73.517 -5.506 1.00 14.38 C ATOM 6990 CD1 TYR B 74 45.425 73.740 -4.861 1.00 15.65 C ATOM 6991 CD2 TYR B 74 43.456 72.410 -5.117 1.00 14.70 C ATOM 6992 CE1 TYR B 74 45.866 72.893 -3.836 1.00 15.52 C ATOM 6993 CE2 TYR B 74 43.888 71.560 -4.103 1.00 14.79 C ATOM 6994 CZ TYR B 74 45.088 71.806 -3.465 1.00 15.25 C ATOM 6995 OH TYR B 74 45.508 70.960 -2.460 1.00 16.09 O ATOM 6996 HA TYR B 74 45.224 75.950 -6.436 1.00 0.00 H ATOM 6997 HB3 TYR B 74 44.119 74.033 -7.567 1.00 0.00 H ATOM 6998 HB2 TYR B 74 42.633 74.376 -6.651 1.00 0.00 H ATOM 6999 HD2 TYR B 74 42.510 72.204 -5.618 1.00 0.00 H ATOM 7000 HE2 TYR B 74 43.281 70.702 -3.813 1.00 0.00 H ATOM 7001 HE1 TYR B 74 46.814 73.087 -3.334 1.00 0.00 H ATOM 7002 HD1 TYR B 74 46.043 74.586 -5.160 1.00 0.00 H ATOM 7003 HH TYR B 74 45.606 70.044 -2.821 1.00 0.00 H ATOM 7004 H TYR B 74 42.975 75.927 -4.675 1.00 0.00 H ATOM 7005 N ALA B 75 42.423 77.034 -7.813 1.00 13.34 N ATOM 7006 CA ALA B 75 41.895 77.805 -8.931 1.00 13.23 C ATOM 7007 C ALA B 75 42.495 79.208 -8.983 1.00 12.95 C ATOM 7008 O ALA B 75 42.805 79.697 -10.061 1.00 12.69 O ATOM 7009 CB ALA B 75 40.367 77.888 -8.861 1.00 13.39 C ATOM 7010 HA ALA B 75 42.179 77.284 -9.845 1.00 0.00 H ATOM 7011 HB1 ALA B 75 39.948 76.883 -8.898 1.00 0.00 H ATOM 7012 HB2 ALA B 75 40.073 78.372 -7.930 1.00 0.00 H ATOM 7013 HB3 ALA B 75 39.997 78.468 -9.706 1.00 0.00 H ATOM 7014 H ALA B 75 41.784 76.769 -7.036 1.00 0.00 H ATOM 7015 N PHE B 76 42.645 79.848 -7.823 1.00 12.74 N ATOM 7016 CA PHE B 76 43.264 81.182 -7.734 1.00 12.55 C ATOM 7017 C PHE B 76 44.678 81.170 -8.311 1.00 12.31 C ATOM 7018 O PHE B 76 45.046 82.035 -9.114 1.00 12.09 O ATOM 7019 CB PHE B 76 43.323 81.649 -6.275 1.00 12.86 C ATOM 7020 CG PHE B 76 43.945 83.006 -6.085 1.00 12.82 C ATOM 7021 CD1 PHE B 76 45.327 83.149 -6.002 1.00 13.09 C ATOM 7022 CD2 PHE B 76 43.154 84.136 -5.963 1.00 13.38 C ATOM 7023 CE1 PHE B 76 45.909 84.399 -5.822 1.00 13.52 C ATOM 7024 CE2 PHE B 76 43.730 85.397 -5.772 1.00 13.77 C ATOM 7025 CZ PHE B 76 45.110 85.525 -5.707 1.00 13.35 C ATOM 7026 HA PHE B 76 42.649 81.870 -8.314 1.00 0.00 H ATOM 7027 HB2 PHE B 76 42.306 81.682 -5.885 1.00 0.00 H ATOM 7028 HB3 PHE B 76 43.905 80.923 -5.707 1.00 0.00 H ATOM 7029 HD2 PHE B 76 42.069 84.042 -6.016 1.00 0.00 H ATOM 7030 HE2 PHE B 76 43.095 86.278 -5.674 1.00 0.00 H ATOM 7031 HZ PHE B 76 45.563 86.506 -5.566 1.00 0.00 H ATOM 7032 HE1 PHE B 76 46.994 84.493 -5.771 1.00 0.00 H ATOM 7033 HD1 PHE B 76 45.963 82.267 -6.079 1.00 0.00 H ATOM 7034 H PHE B 76 42.313 79.389 -6.950 1.00 0.00 H ATOM 7035 N LEU B 77 45.465 80.188 -7.880 1.00 11.90 N ATOM 7036 CA LEU B 77 46.840 80.049 -8.333 1.00 11.86 C ATOM 7037 C LEU B 77 46.901 79.744 -9.827 1.00 11.82 C ATOM 7038 O LEU B 77 47.753 80.284 -10.530 1.00 11.99 O ATOM 7039 CB LEU B 77 47.560 78.965 -7.536 1.00 11.60 C ATOM 7040 CG LEU B 77 47.786 79.277 -6.056 1.00 12.06 C ATOM 7041 CD1 LEU B 77 48.223 78.025 -5.313 1.00 11.65 C ATOM 7042 CD2 LEU B 77 48.806 80.384 -5.878 1.00 12.54 C ATOM 7043 HA LEU B 77 47.346 80.999 -8.164 1.00 0.00 H ATOM 7044 HB2 LEU B 77 46.969 78.052 -7.601 1.00 0.00 H ATOM 7045 HB3 LEU B 77 48.534 78.799 -7.997 1.00 0.00 H ATOM 7046 HG LEU B 77 46.841 79.623 -5.636 1.00 0.00 H ATOM 7047 HD21 LEU B 77 49.755 80.076 -6.318 1.00 0.00 H ATOM 7048 HD22 LEU B 77 48.450 81.287 -6.374 1.00 0.00 H ATOM 7049 HD23 LEU B 77 48.944 80.582 -4.815 1.00 0.00 H ATOM 7050 HD11 LEU B 77 47.449 77.262 -5.402 1.00 0.00 H ATOM 7051 HD12 LEU B 77 49.152 77.654 -5.745 1.00 0.00 H ATOM 7052 HD13 LEU B 77 48.380 78.264 -4.261 1.00 0.00 H ATOM 7053 H LEU B 77 45.086 79.499 -7.199 1.00 0.00 H ATOM 7054 N SER B 78 46.002 78.883 -10.305 1.00 11.79 N ATOM 7055 CA SER B 78 45.870 78.614 -11.739 1.00 12.03 C ATOM 7056 C SER B 78 45.508 79.887 -12.522 1.00 12.51 C ATOM 7057 O SER B 78 46.018 80.128 -13.620 1.00 12.64 O ATOM 7058 CB SER B 78 44.824 77.521 -11.986 1.00 11.82 C ATOM 7059 OG SER B 78 45.182 76.313 -11.339 1.00 10.02 O ATOM 7060 HA SER B 78 46.838 78.265 -12.100 1.00 0.00 H ATOM 7061 HB2 SER B 78 44.745 77.340 -13.058 1.00 0.00 H ATOM 7062 HB3 SER B 78 43.861 77.858 -11.603 1.00 0.00 H ATOM 7063 HG SER B 78 45.251 76.470 -10.364 1.00 0.00 H ATOM 7064 H SER B 78 45.375 78.387 -9.639 1.00 0.00 H ATOM 7065 N MET B 79 44.647 80.713 -11.941 1.00 13.02 N ATOM 7066 CA MET B 79 44.238 81.957 -12.585 1.00 13.51 C ATOM 7067 C MET B 79 45.354 82.993 -12.676 1.00 13.67 C ATOM 7068 O MET B 79 45.416 83.753 -13.649 1.00 13.59 O ATOM 7069 CB MET B 79 43.055 82.571 -11.855 1.00 13.70 C ATOM 7070 CG MET B 79 42.506 83.785 -12.563 1.00 13.76 C ATOM 7071 SD MET B 79 40.768 83.987 -12.232 1.00 15.29 S ATOM 7072 CE MET B 79 40.551 85.692 -12.763 1.00 14.93 C ATOM 7073 HA MET B 79 43.962 81.684 -13.604 1.00 0.00 H ATOM 7074 HB2 MET B 79 42.265 81.824 -11.778 1.00 0.00 H ATOM 7075 HB3 MET B 79 43.375 82.864 -10.855 1.00 0.00 H ATOM 7076 HG2 MET B 79 42.653 83.669 -13.637 1.00 0.00 H ATOM 7077 HG3 MET B 79 43.040 84.671 -12.218 1.00 0.00 H ATOM 7078 HE1 MET B 79 41.195 86.341 -12.170 1.00 0.00 H ATOM 7079 HE2 MET B 79 40.816 85.780 -13.817 1.00 0.00 H ATOM 7080 HE3 MET B 79 39.510 85.985 -12.623 1.00 0.00 H ATOM 7081 H MET B 79 44.256 80.469 -11.009 1.00 0.00 H ATOM 7082 N GLU B 80 46.212 83.048 -11.658 1.00 13.72 N ATOM 7083 CA GLU B 80 47.406 83.893 -11.711 1.00 13.87 C ATOM 7084 C GLU B 80 48.285 83.516 -12.890 1.00 13.45 C ATOM 7085 O GLU B 80 48.744 84.384 -13.632 1.00 13.71 O ATOM 7086 CB GLU B 80 48.229 83.765 -10.432 1.00 14.06 C ATOM 7087 CG GLU B 80 47.611 84.451 -9.243 1.00 15.10 C ATOM 7088 CD GLU B 80 48.576 84.546 -8.075 1.00 15.83 C ATOM 7089 OE1 GLU B 80 49.259 83.535 -7.780 1.00 18.12 O ATOM 7090 OE2 GLU B 80 48.645 85.632 -7.455 1.00 17.56 O ATOM 7091 HA GLU B 80 47.064 84.922 -11.821 1.00 0.00 H ATOM 7092 HB2 GLU B 80 48.341 82.706 -10.199 1.00 0.00 H ATOM 7093 HB3 GLU B 80 49.212 84.202 -10.610 1.00 0.00 H ATOM 7094 HG2 GLU B 80 47.311 85.457 -9.534 1.00 0.00 H ATOM 7095 HG3 GLU B 80 46.732 83.888 -8.929 1.00 0.00 H ATOM 7096 H GLU B 80 46.029 82.478 -10.807 1.00 0.00 H ATOM 7097 N GLN B 81 48.526 82.216 -13.043 1.00 13.06 N ATOM 7098 CA GLN B 81 49.314 81.696 -14.161 1.00 12.76 C ATOM 7099 C GLN B 81 48.693 82.062 -15.520 1.00 12.79 C ATOM 7100 O GLN B 81 49.397 82.472 -16.436 1.00 12.48 O ATOM 7101 CB GLN B 81 49.440 80.169 -14.066 1.00 12.52 C ATOM 7102 CG GLN B 81 50.216 79.622 -12.863 1.00 11.72 C ATOM 7103 CD GLN B 81 50.153 78.098 -12.798 1.00 11.68 C ATOM 7104 OE1 GLN B 81 50.106 77.429 -13.831 1.00 9.47 O ATOM 7105 NE2 GLN B 81 50.145 77.548 -11.588 1.00 10.39 N ATOM 7106 HA GLN B 81 50.300 82.156 -14.095 1.00 0.00 H ATOM 7107 HB2 GLN B 81 48.433 79.755 -14.027 1.00 0.00 H ATOM 7108 HB3 GLN B 81 49.940 79.821 -14.970 1.00 0.00 H ATOM 7109 HG2 GLN B 81 51.258 79.930 -12.945 1.00 0.00 H ATOM 7110 HG3 GLN B 81 49.788 80.033 -11.949 1.00 0.00 H ATOM 7111 HE22 GLN B 81 50.186 78.152 -10.742 1.00 0.00 H ATOM 7112 HE21 GLN B 81 50.098 76.514 -11.487 1.00 0.00 H ATOM 7113 H GLN B 81 48.142 81.548 -12.345 1.00 0.00 H ATOM 7114 N ALA B 82 47.376 81.896 -15.636 1.00 12.87 N ATOM 7115 CA ALA B 82 46.651 82.164 -16.883 1.00 13.16 C ATOM 7116 C ALA B 82 46.693 83.639 -17.281 1.00 13.28 C ATOM 7117 O ALA B 82 46.889 83.967 -18.451 1.00 13.26 O ATOM 7118 CB ALA B 82 45.211 81.701 -16.759 1.00 13.12 C ATOM 7119 HA ALA B 82 47.153 81.603 -17.672 1.00 0.00 H ATOM 7120 HB1 ALA B 82 45.191 80.630 -16.556 1.00 0.00 H ATOM 7121 HB2 ALA B 82 44.728 82.236 -15.942 1.00 0.00 H ATOM 7122 HB3 ALA B 82 44.683 81.905 -17.691 1.00 0.00 H ATOM 7123 H ALA B 82 46.840 81.563 -14.809 1.00 0.00 H ATOM 7124 N ILE B 83 46.504 84.521 -16.306 1.00 13.50 N ATOM 7125 CA ILE B 83 46.584 85.956 -16.548 1.00 13.81 C ATOM 7126 C ILE B 83 47.947 86.307 -17.136 1.00 14.13 C ATOM 7127 O ILE B 83 48.033 87.019 -18.149 1.00 14.43 O ATOM 7128 CB ILE B 83 46.313 86.751 -15.255 1.00 13.80 C ATOM 7129 CG1 ILE B 83 44.824 86.659 -14.909 1.00 14.28 C ATOM 7130 CG2 ILE B 83 46.715 88.223 -15.404 1.00 13.65 C ATOM 7131 CD1 ILE B 83 44.498 87.048 -13.481 1.00 14.37 C ATOM 7132 HA ILE B 83 45.814 86.234 -17.267 1.00 0.00 H ATOM 7133 HB ILE B 83 46.915 86.318 -14.456 1.00 0.00 H ATOM 7134 HG12 ILE B 83 44.275 87.321 -15.579 1.00 0.00 H ATOM 7135 HG13 ILE B 83 44.498 85.631 -15.068 1.00 0.00 H ATOM 7136 HD11 ILE B 83 45.030 86.388 -12.796 1.00 0.00 H ATOM 7137 HD12 ILE B 83 44.806 88.079 -13.307 1.00 0.00 H ATOM 7138 HD13 ILE B 83 43.424 86.956 -13.317 1.00 0.00 H ATOM 7139 HG21 ILE B 83 47.779 88.286 -15.631 1.00 0.00 H ATOM 7140 HG22 ILE B 83 46.142 88.675 -16.213 1.00 0.00 H ATOM 7141 HG23 ILE B 83 46.509 88.751 -14.473 1.00 0.00 H ATOM 7142 H ILE B 83 46.294 84.179 -15.346 1.00 0.00 H ATOM 7143 N ALA B 84 48.999 85.782 -16.507 1.00 14.03 N ATOM 7144 CA ALA B 84 50.372 86.017 -16.938 1.00 14.21 C ATOM 7145 C ALA B 84 50.664 85.367 -18.284 1.00 14.31 C ATOM 7146 O ALA B 84 51.282 85.986 -19.145 1.00 14.50 O ATOM 7147 CB ALA B 84 51.352 85.503 -15.880 1.00 14.07 C ATOM 7148 HA ALA B 84 50.500 87.093 -17.058 1.00 0.00 H ATOM 7149 HB1 ALA B 84 51.177 86.026 -14.940 1.00 0.00 H ATOM 7150 HB2 ALA B 84 51.200 84.433 -15.735 1.00 0.00 H ATOM 7151 HB3 ALA B 84 52.374 85.685 -16.214 1.00 0.00 H ATOM 7152 H ALA B 84 48.833 85.180 -15.675 1.00 0.00 H ATOM 7153 N ASP B 85 50.218 84.127 -18.462 1.00 14.46 N ATOM 7154 CA ASP B 85 50.383 83.409 -19.726 1.00 14.80 C ATOM 7155 C ASP B 85 49.661 84.094 -20.890 1.00 15.17 C ATOM 7156 O ASP B 85 50.131 84.059 -22.029 1.00 15.17 O ATOM 7157 CB ASP B 85 49.868 81.973 -19.583 1.00 14.88 C ATOM 7158 CG ASP B 85 50.137 81.129 -20.814 1.00 14.95 C ATOM 7159 OD1 ASP B 85 51.274 81.159 -21.341 1.00 15.71 O ATOM 7160 OD2 ASP B 85 49.206 80.434 -21.258 1.00 15.33 O ATOM 7161 HA ASP B 85 51.449 83.408 -19.954 1.00 0.00 H ATOM 7162 HB2 ASP B 85 50.360 81.509 -18.728 1.00 0.00 H ATOM 7163 HB3 ASP B 85 48.792 82.004 -19.409 1.00 0.00 H ATOM 7164 H ASP B 85 49.734 83.650 -17.674 1.00 0.00 H ATOM 7165 N ALA B 86 48.514 84.701 -20.596 1.00 15.51 N ATOM 7166 CA ALA B 86 47.762 85.481 -21.573 1.00 16.03 C ATOM 7167 C ALA B 86 48.340 86.884 -21.786 1.00 16.55 C ATOM 7168 O ALA B 86 47.927 87.585 -22.704 1.00 16.40 O ATOM 7169 CB ALA B 86 46.293 85.583 -21.149 1.00 15.98 C ATOM 7170 HA ALA B 86 47.840 84.954 -22.524 1.00 0.00 H ATOM 7171 HB1 ALA B 86 45.865 84.583 -21.083 1.00 0.00 H ATOM 7172 HB2 ALA B 86 46.230 86.071 -20.176 1.00 0.00 H ATOM 7173 HB3 ALA B 86 45.743 86.167 -21.887 1.00 0.00 H ATOM 7174 H ALA B 86 48.138 84.616 -19.630 1.00 0.00 H ATOM 7175 N GLY B 87 49.278 87.300 -20.940 1.00 16.96 N ATOM 7176 CA GLY B 87 49.898 88.615 -21.075 1.00 17.39 C ATOM 7177 C GLY B 87 48.908 89.734 -20.830 1.00 17.88 C ATOM 7178 O GLY B 87 48.907 90.735 -21.536 1.00 17.94 O ATOM 7179 HA3 GLY B 87 50.299 88.714 -22.084 1.00 0.00 H ATOM 7180 HA2 GLY B 87 50.710 88.698 -20.352 1.00 0.00 H ATOM 7181 H GLY B 87 49.577 86.674 -20.165 1.00 0.00 H ATOM 7182 N LEU B 88 48.052 89.558 -19.830 1.00 18.48 N ATOM 7183 CA LEU B 88 47.037 90.553 -19.512 1.00 19.08 C ATOM 7184 C LEU B 88 47.474 91.375 -18.308 1.00 19.63 C ATOM 7185 O LEU B 88 47.641 90.840 -17.213 1.00 19.62 O ATOM 7186 CB LEU B 88 45.700 89.878 -19.213 1.00 18.98 C ATOM 7187 CG LEU B 88 44.901 89.369 -20.410 1.00 18.93 C ATOM 7188 CD1 LEU B 88 43.885 88.327 -19.957 1.00 18.86 C ATOM 7189 CD2 LEU B 88 44.210 90.523 -21.128 1.00 18.62 C ATOM 7190 HA LEU B 88 46.915 91.209 -20.374 1.00 0.00 H ATOM 7191 HB2 LEU B 88 45.899 89.026 -18.563 1.00 0.00 H ATOM 7192 HB3 LEU B 88 45.077 90.599 -18.684 1.00 0.00 H ATOM 7193 HG LEU B 88 45.589 88.900 -21.114 1.00 0.00 H ATOM 7194 HD21 LEU B 88 43.531 91.024 -20.438 1.00 0.00 H ATOM 7195 HD22 LEU B 88 44.960 91.231 -21.480 1.00 0.00 H ATOM 7196 HD23 LEU B 88 43.647 90.136 -21.977 1.00 0.00 H ATOM 7197 HD11 LEU B 88 44.407 87.490 -19.493 1.00 0.00 H ATOM 7198 HD12 LEU B 88 43.203 88.776 -19.236 1.00 0.00 H ATOM 7199 HD13 LEU B 88 43.322 87.972 -20.820 1.00 0.00 H ATOM 7200 H LEU B 88 48.108 88.689 -19.261 1.00 0.00 H ATOM 7201 N SER B 89 47.662 92.676 -18.509 1.00 20.40 N ATOM 7202 CA SER B 89 47.948 93.567 -17.389 1.00 21.00 C ATOM 7203 C SER B 89 46.659 93.787 -16.591 1.00 21.48 C ATOM 7204 O SER B 89 45.559 93.522 -17.097 1.00 21.44 O ATOM 7205 CB SER B 89 48.542 94.897 -17.873 1.00 21.09 C ATOM 7206 OG SER B 89 47.599 95.650 -18.615 1.00 21.96 O ATOM 7207 HA SER B 89 48.696 93.107 -16.743 1.00 0.00 H ATOM 7208 HB2 SER B 89 49.406 94.690 -18.505 1.00 0.00 H ATOM 7209 HB3 SER B 89 48.858 95.479 -17.008 1.00 0.00 H ATOM 7210 HG SER B 89 47.312 95.129 -19.406 1.00 0.00 H ATOM 7211 H SER B 89 47.605 93.062 -19.473 1.00 0.00 H ATOM 7212 N PRO B 90 46.786 94.244 -15.331 1.00 21.87 N ATOM 7213 CA PRO B 90 45.613 94.583 -14.535 1.00 22.23 C ATOM 7214 C PRO B 90 44.633 95.507 -15.250 1.00 22.64 C ATOM 7215 O PRO B 90 43.426 95.286 -15.180 1.00 22.96 O ATOM 7216 CB PRO B 90 46.219 95.287 -13.318 1.00 22.14 C ATOM 7217 CG PRO B 90 47.536 94.651 -13.167 1.00 22.08 C ATOM 7218 CD PRO B 90 48.029 94.450 -14.565 1.00 21.77 C ATOM 7219 HA PRO B 90 45.021 93.698 -14.301 1.00 0.00 H ATOM 7220 HD3 PRO B 90 48.567 95.329 -14.921 1.00 0.00 H ATOM 7221 HD2 PRO B 90 48.678 93.577 -14.630 1.00 0.00 H ATOM 7222 HG3 PRO B 90 47.444 93.695 -12.651 1.00 0.00 H ATOM 7223 HG2 PRO B 90 48.213 95.299 -12.611 1.00 0.00 H ATOM 7224 HB2 PRO B 90 46.322 96.357 -13.499 1.00 0.00 H ATOM 7225 HB3 PRO B 90 45.606 95.127 -12.431 1.00 0.00 H ATOM 7226 N GLU B 91 45.150 96.522 -15.938 1.00 23.06 N ATOM 7227 CA GLU B 91 44.294 97.494 -16.627 1.00 23.25 C ATOM 7228 C GLU B 91 43.516 96.872 -17.792 1.00 22.92 C ATOM 7229 O GLU B 91 42.460 97.384 -18.169 1.00 23.09 O ATOM 7230 CB GLU B 91 45.069 98.753 -17.088 1.00 24.14 C ATOM 7231 CG GLU B 91 46.565 98.581 -17.415 1.00 26.74 C ATOM 7232 CD GLU B 91 47.475 98.580 -16.171 1.00 30.68 C ATOM 7233 OE1 GLU B 91 47.259 99.414 -15.251 1.00 32.81 O ATOM 7234 OE2 GLU B 91 48.408 97.740 -16.119 1.00 32.12 O ATOM 7235 HA GLU B 91 43.565 97.817 -15.883 1.00 0.00 H ATOM 7236 HB2 GLU B 91 44.578 99.130 -17.986 1.00 0.00 H ATOM 7237 HB3 GLU B 91 44.990 99.495 -16.294 1.00 0.00 H ATOM 7238 HG2 GLU B 91 46.696 97.634 -17.939 1.00 0.00 H ATOM 7239 HG3 GLU B 91 46.872 99.400 -18.065 1.00 0.00 H ATOM 7240 H GLU B 91 46.183 96.629 -15.988 1.00 0.00 H ATOM 7241 N ALA B 92 44.023 95.772 -18.346 1.00 22.24 N ATOM 7242 CA ALA B 92 43.311 95.044 -19.401 1.00 21.79 C ATOM 7243 C ALA B 92 42.053 94.333 -18.901 1.00 21.45 C ATOM 7244 O ALA B 92 41.028 94.345 -19.586 1.00 21.85 O ATOM 7245 CB ALA B 92 44.236 94.034 -20.077 1.00 21.78 C ATOM 7246 HA ALA B 92 42.990 95.796 -20.122 1.00 0.00 H ATOM 7247 HB1 ALA B 92 45.083 94.558 -20.519 1.00 0.00 H ATOM 7248 HB2 ALA B 92 44.596 93.320 -19.336 1.00 0.00 H ATOM 7249 HB3 ALA B 92 43.687 93.505 -20.856 1.00 0.00 H ATOM 7250 H ALA B 92 44.947 95.421 -18.022 1.00 0.00 H ATOM 7251 N TYR B 93 42.127 93.714 -17.721 1.00 20.67 N ATOM 7252 CA TYR B 93 41.078 92.792 -17.276 1.00 20.07 C ATOM 7253 C TYR B 93 40.344 93.186 -15.987 1.00 19.58 C ATOM 7254 O TYR B 93 39.253 92.675 -15.734 1.00 19.40 O ATOM 7255 CB TYR B 93 41.644 91.364 -17.146 1.00 19.77 C ATOM 7256 CG TYR B 93 42.440 91.117 -15.887 1.00 19.64 C ATOM 7257 CD1 TYR B 93 41.807 90.759 -14.701 1.00 19.81 C ATOM 7258 CD2 TYR B 93 43.826 91.246 -15.877 1.00 19.44 C ATOM 7259 CE1 TYR B 93 42.532 90.544 -13.536 1.00 19.85 C ATOM 7260 CE2 TYR B 93 44.559 91.030 -14.717 1.00 19.13 C ATOM 7261 CZ TYR B 93 43.903 90.680 -13.554 1.00 18.92 C ATOM 7262 OH TYR B 93 44.603 90.463 -12.402 1.00 19.05 O ATOM 7263 HA TYR B 93 40.318 92.843 -18.056 1.00 0.00 H ATOM 7264 HB3 TYR B 93 42.293 91.176 -18.001 1.00 0.00 H ATOM 7265 HB2 TYR B 93 40.809 90.664 -17.164 1.00 0.00 H ATOM 7266 HD2 TYR B 93 44.345 91.521 -16.795 1.00 0.00 H ATOM 7267 HE2 TYR B 93 45.644 91.136 -14.725 1.00 0.00 H ATOM 7268 HE1 TYR B 93 42.020 90.270 -12.614 1.00 0.00 H ATOM 7269 HD1 TYR B 93 40.723 90.645 -14.686 1.00 0.00 H ATOM 7270 HH TYR B 93 45.095 91.286 -12.156 1.00 0.00 H ATOM 7271 H TYR B 93 42.946 93.889 -17.104 1.00 0.00 H ATOM 7272 N GLN B 94 40.931 94.066 -15.174 1.00 19.01 N ATOM 7273 CA GLN B 94 40.314 94.463 -13.905 1.00 18.95 C ATOM 7274 C GLN B 94 39.334 95.608 -14.107 1.00 18.65 C ATOM 7275 O GLN B 94 39.477 96.400 -15.039 1.00 18.36 O ATOM 7276 CB GLN B 94 41.368 94.880 -12.874 1.00 18.65 C ATOM 7277 CG GLN B 94 42.302 93.770 -12.464 1.00 18.81 C ATOM 7278 CD GLN B 94 43.250 94.168 -11.346 1.00 19.10 C ATOM 7279 OE1 GLN B 94 43.454 95.354 -11.062 1.00 18.15 O ATOM 7280 NE2 GLN B 94 43.843 93.169 -10.705 1.00 19.74 N ATOM 7281 HA GLN B 94 39.778 93.592 -13.529 1.00 0.00 H ATOM 7282 HB2 GLN B 94 41.963 95.688 -13.300 1.00 0.00 H ATOM 7283 HB3 GLN B 94 40.852 95.240 -11.984 1.00 0.00 H ATOM 7284 HG2 GLN B 94 41.706 92.922 -12.128 1.00 0.00 H ATOM 7285 HG3 GLN B 94 42.893 93.476 -13.331 1.00 0.00 H ATOM 7286 HE22 GLN B 94 43.643 92.185 -10.976 1.00 0.00 H ATOM 7287 HE21 GLN B 94 44.508 93.370 -9.931 1.00 0.00 H ATOM 7288 H GLN B 94 41.846 94.479 -15.446 1.00 0.00 H ATOM 7289 N ASN B 95 38.342 95.690 -13.226 1.00 18.32 N ATOM 7290 CA ASN B 95 37.343 96.754 -13.289 1.00 18.54 C ATOM 7291 C ASN B 95 36.768 96.893 -14.695 1.00 18.26 C ATOM 7292 O ASN B 95 36.576 98.008 -15.192 1.00 18.09 O ATOM 7293 CB ASN B 95 37.945 98.086 -12.817 1.00 18.47 C ATOM 7294 CG ASN B 95 38.582 97.978 -11.452 1.00 18.88 C ATOM 7295 OD1 ASN B 95 37.958 97.518 -10.503 1.00 20.82 O ATOM 7296 ND2 ASN B 95 39.837 98.379 -11.351 1.00 19.96 N ATOM 7297 HA ASN B 95 36.525 96.485 -12.620 1.00 0.00 H ATOM 7298 HB2 ASN B 95 38.703 98.401 -13.534 1.00 0.00 H ATOM 7299 HB3 ASN B 95 37.153 98.834 -12.776 1.00 0.00 H ATOM 7300 HD22 ASN B 95 40.329 98.763 -12.183 1.00 0.00 H ATOM 7301 HD21 ASN B 95 40.333 98.310 -10.440 1.00 0.00 H ATOM 7302 H ASN B 95 38.275 94.977 -12.471 1.00 0.00 H ATOM 7303 N ASN B 96 36.491 95.745 -15.318 1.00 17.98 N ATOM 7304 CA ASN B 96 36.052 95.695 -16.711 1.00 17.96 C ATOM 7305 C ASN B 96 34.769 94.867 -16.895 1.00 17.98 C ATOM 7306 O ASN B 96 34.802 93.640 -16.763 1.00 17.79 O ATOM 7307 CB ASN B 96 37.171 95.128 -17.587 1.00 17.62 C ATOM 7308 CG ASN B 96 36.953 95.408 -19.062 1.00 17.29 C ATOM 7309 OD1 ASN B 96 35.820 95.571 -19.520 1.00 15.46 O ATOM 7310 ND2 ASN B 96 38.040 95.473 -19.811 1.00 13.98 N ATOM 7311 HA ASN B 96 35.821 96.716 -17.016 1.00 0.00 H ATOM 7312 HB2 ASN B 96 38.116 95.577 -17.282 1.00 0.00 H ATOM 7313 HB3 ASN B 96 37.218 94.049 -17.439 1.00 0.00 H ATOM 7314 HD22 ASN B 96 38.976 95.329 -19.382 1.00 0.00 H ATOM 7315 HD21 ASN B 96 37.959 95.668 -20.829 1.00 0.00 H ATOM 7316 H ASN B 96 36.591 94.853 -14.792 1.00 0.00 H ATOM 7317 N PRO B 97 33.631 95.541 -17.187 1.00 17.94 N ATOM 7318 CA PRO B 97 32.347 94.891 -17.502 1.00 17.83 C ATOM 7319 C PRO B 97 32.388 93.786 -18.564 1.00 17.70 C ATOM 7320 O PRO B 97 31.554 92.880 -18.522 1.00 18.03 O ATOM 7321 CB PRO B 97 31.483 96.057 -17.992 1.00 18.10 C ATOM 7322 CG PRO B 97 32.000 97.221 -17.269 1.00 17.87 C ATOM 7323 CD PRO B 97 33.487 97.007 -17.166 1.00 17.91 C ATOM 7324 HA PRO B 97 31.979 94.361 -16.623 1.00 0.00 H ATOM 7325 HD3 PRO B 97 34.005 97.461 -18.011 1.00 0.00 H ATOM 7326 HD2 PRO B 97 33.876 97.423 -16.237 1.00 0.00 H ATOM 7327 HG3 PRO B 97 31.554 97.281 -16.276 1.00 0.00 H ATOM 7328 HG2 PRO B 97 31.784 98.137 -17.819 1.00 0.00 H ATOM 7329 HB2 PRO B 97 31.591 96.192 -19.068 1.00 0.00 H ATOM 7330 HB3 PRO B 97 30.433 95.888 -17.751 1.00 0.00 H ATOM 7331 N ARG B 98 33.347 93.850 -19.488 1.00 17.36 N ATOM 7332 CA ARG B 98 33.462 92.860 -20.566 1.00 17.13 C ATOM 7333 C ARG B 98 34.343 91.670 -20.191 1.00 16.70 C ATOM 7334 O ARG B 98 34.648 90.840 -21.053 1.00 16.65 O ATOM 7335 CB ARG B 98 34.046 93.501 -21.827 1.00 17.41 C ATOM 7336 CG ARG B 98 33.397 94.808 -22.269 1.00 19.05 C ATOM 7337 CD ARG B 98 32.150 94.584 -23.083 1.00 20.99 C ATOM 7338 NE ARG B 98 32.389 93.701 -24.227 1.00 21.94 N ATOM 7339 CZ ARG B 98 31.429 93.051 -24.881 1.00 21.87 C ATOM 7340 NH1 ARG B 98 30.159 93.190 -24.520 1.00 21.42 N ATOM 7341 NH2 ARG B 98 31.737 92.256 -25.898 1.00 22.22 N ATOM 7342 HA ARG B 98 32.449 92.499 -20.745 1.00 0.00 H ATOM 7343 HB2 ARG B 98 35.103 93.697 -21.644 1.00 0.00 H ATOM 7344 HB3 ARG B 98 33.947 92.785 -22.643 1.00 0.00 H ATOM 7345 HG2 ARG B 98 33.137 95.387 -21.383 1.00 0.00 H ATOM 7346 HG3 ARG B 98 34.112 95.368 -22.871 1.00 0.00 H ATOM 7347 HD2 ARG B 98 31.792 95.546 -23.450 1.00 0.00 H ATOM 7348 HD3 ARG B 98 31.389 94.134 -22.445 1.00 0.00 H ATOM 7349 HE ARG B 98 33.370 93.574 -24.548 1.00 0.00 H ATOM 7350 HH12 ARG B 98 29.413 92.680 -25.035 1.00 0.00 H ATOM 7351 HH11 ARG B 98 29.910 93.809 -23.722 1.00 0.00 H ATOM 7352 HH22 ARG B 98 30.986 91.749 -26.408 1.00 0.00 H ATOM 7353 HH21 ARG B 98 32.730 92.140 -26.185 1.00 0.00 H ATOM 7354 H ARG B 98 34.037 94.627 -19.444 1.00 0.00 H ATOM 7355 N VAL B 99 34.763 91.594 -18.924 1.00 16.14 N ATOM 7356 CA VAL B 99 35.632 90.521 -18.441 1.00 15.49 C ATOM 7357 C VAL B 99 34.962 89.800 -17.286 1.00 15.36 C ATOM 7358 O VAL B 99 34.622 90.426 -16.276 1.00 14.98 O ATOM 7359 CB VAL B 99 37.004 91.056 -17.970 1.00 15.50 C ATOM 7360 CG1 VAL B 99 37.889 89.906 -17.483 1.00 14.85 C ATOM 7361 CG2 VAL B 99 37.704 91.821 -19.096 1.00 14.74 C ATOM 7362 HA VAL B 99 35.800 89.837 -19.273 1.00 0.00 H ATOM 7363 HB VAL B 99 36.834 91.742 -17.141 1.00 0.00 H ATOM 7364 HG11 VAL B 99 37.400 89.401 -16.650 1.00 0.00 H ATOM 7365 HG12 VAL B 99 38.045 89.199 -18.298 1.00 0.00 H ATOM 7366 HG13 VAL B 99 38.850 90.302 -17.156 1.00 0.00 H ATOM 7367 HG21 VAL B 99 37.858 91.155 -19.945 1.00 0.00 H ATOM 7368 HG22 VAL B 99 37.083 92.663 -19.402 1.00 0.00 H ATOM 7369 HG23 VAL B 99 38.667 92.188 -18.741 1.00 0.00 H ATOM 7370 H VAL B 99 34.459 92.329 -18.254 1.00 0.00 H ATOM 7371 N GLY B 100 34.800 88.480 -17.430 1.00 15.12 N ATOM 7372 CA GLY B 100 34.055 87.672 -16.473 1.00 14.95 C ATOM 7373 C GLY B 100 34.792 86.443 -15.980 1.00 14.86 C ATOM 7374 O GLY B 100 35.935 86.194 -16.354 1.00 14.64 O ATOM 7375 HA3 GLY B 100 33.130 87.347 -16.949 1.00 0.00 H ATOM 7376 HA2 GLY B 100 33.819 88.296 -15.611 1.00 0.00 H ATOM 7377 H GLY B 100 35.222 88.012 -18.257 1.00 0.00 H ATOM 7378 N LEU B 101 34.109 85.671 -15.141 1.00 14.75 N ATOM 7379 CA LEU B 101 34.704 84.532 -14.458 1.00 14.86 C ATOM 7380 C LEU B 101 33.629 83.483 -14.207 1.00 14.69 C ATOM 7381 O LEU B 101 32.672 83.739 -13.477 1.00 14.63 O ATOM 7382 CB LEU B 101 35.324 84.989 -13.125 1.00 14.99 C ATOM 7383 CG LEU B 101 35.987 84.000 -12.153 1.00 15.59 C ATOM 7384 CD1 LEU B 101 35.012 83.038 -11.524 1.00 17.29 C ATOM 7385 CD2 LEU B 101 37.108 83.218 -12.803 1.00 17.31 C ATOM 7386 HA LEU B 101 35.490 84.101 -15.078 1.00 0.00 H ATOM 7387 HB2 LEU B 101 36.087 85.725 -13.380 1.00 0.00 H ATOM 7388 HB3 LEU B 101 34.524 85.475 -12.567 1.00 0.00 H ATOM 7389 HG LEU B 101 36.401 84.627 -11.363 1.00 0.00 H ATOM 7390 HD21 LEU B 101 36.712 82.650 -13.645 1.00 0.00 H ATOM 7391 HD22 LEU B 101 37.874 83.909 -13.157 1.00 0.00 H ATOM 7392 HD23 LEU B 101 37.543 82.534 -12.074 1.00 0.00 H ATOM 7393 HD11 LEU B 101 34.262 83.597 -10.964 1.00 0.00 H ATOM 7394 HD12 LEU B 101 34.524 82.455 -12.305 1.00 0.00 H ATOM 7395 HD13 LEU B 101 35.547 82.369 -10.850 1.00 0.00 H ATOM 7396 H LEU B 101 33.108 85.890 -14.965 1.00 0.00 H ATOM 7397 N ILE B 102 33.793 82.312 -14.812 1.00 14.50 N ATOM 7398 CA ILE B 102 32.907 81.175 -14.585 1.00 14.75 C ATOM 7399 C ILE B 102 33.764 79.977 -14.167 1.00 14.59 C ATOM 7400 O ILE B 102 34.524 79.430 -14.967 1.00 13.81 O ATOM 7401 CB ILE B 102 32.079 80.831 -15.852 1.00 14.61 C ATOM 7402 CG1 ILE B 102 31.200 82.014 -16.267 1.00 14.86 C ATOM 7403 CG2 ILE B 102 31.196 79.596 -15.623 1.00 14.68 C ATOM 7404 CD1 ILE B 102 30.793 81.975 -17.743 1.00 15.31 C ATOM 7405 HA ILE B 102 32.195 81.428 -13.799 1.00 0.00 H ATOM 7406 HB ILE B 102 32.787 80.613 -16.651 1.00 0.00 H ATOM 7407 HG12 ILE B 102 30.296 82.005 -15.658 1.00 0.00 H ATOM 7408 HG13 ILE B 102 31.751 82.936 -16.084 1.00 0.00 H ATOM 7409 HD11 ILE B 102 31.687 81.994 -18.366 1.00 0.00 H ATOM 7410 HD12 ILE B 102 30.231 81.062 -17.940 1.00 0.00 H ATOM 7411 HD13 ILE B 102 30.172 82.841 -17.970 1.00 0.00 H ATOM 7412 HG21 ILE B 102 31.826 78.741 -15.377 1.00 0.00 H ATOM 7413 HG22 ILE B 102 30.508 79.790 -14.800 1.00 0.00 H ATOM 7414 HG23 ILE B 102 30.630 79.383 -16.530 1.00 0.00 H ATOM 7415 H ILE B 102 34.586 82.201 -15.475 1.00 0.00 H ATOM 7416 N ALA B 103 33.642 79.581 -12.907 1.00 15.03 N ATOM 7417 CA ALA B 103 34.490 78.540 -12.354 1.00 15.66 C ATOM 7418 C ALA B 103 33.852 77.882 -11.140 1.00 16.23 C ATOM 7419 O ALA B 103 33.287 78.563 -10.283 1.00 16.47 O ATOM 7420 CB ALA B 103 35.835 79.124 -11.978 1.00 15.67 C ATOM 7421 HA ALA B 103 34.622 77.772 -13.117 1.00 0.00 H ATOM 7422 HB1 ALA B 103 36.309 79.543 -12.866 1.00 0.00 H ATOM 7423 HB2 ALA B 103 35.694 79.909 -11.235 1.00 0.00 H ATOM 7424 HB3 ALA B 103 36.468 78.339 -11.564 1.00 0.00 H ATOM 7425 H ALA B 103 32.923 80.026 -12.302 1.00 0.00 H ATOM 7426 N GLY B 104 33.971 76.562 -11.047 1.00 16.91 N ATOM 7427 CA GLY B 104 33.312 75.822 -9.981 1.00 17.47 C ATOM 7428 C GLY B 104 34.131 74.703 -9.373 1.00 18.06 C ATOM 7429 O GLY B 104 35.319 74.557 -9.642 1.00 18.11 O ATOM 7430 HA3 GLY B 104 32.397 75.389 -10.386 1.00 0.00 H ATOM 7431 HA2 GLY B 104 33.060 76.525 -9.188 1.00 0.00 H ATOM 7432 H GLY B 104 34.544 76.049 -11.747 1.00 0.00 H ATOM 7433 N SER B 105 33.471 73.943 -8.507 1.00 18.64 N ATOM 7434 CA SER B 105 33.982 72.679 -8.006 1.00 19.09 C ATOM 7435 C SER B 105 32.831 71.690 -7.999 1.00 19.37 C ATOM 7436 O SER B 105 31.662 72.083 -8.085 1.00 19.55 O ATOM 7437 CB SER B 105 34.549 72.839 -6.593 1.00 19.29 C ATOM 7438 OG SER B 105 33.627 73.497 -5.746 1.00 20.01 O ATOM 7439 HA SER B 105 34.792 72.325 -8.644 1.00 0.00 H ATOM 7440 HB2 SER B 105 35.468 73.423 -6.642 1.00 0.00 H ATOM 7441 HB3 SER B 105 34.768 71.853 -6.183 1.00 0.00 H ATOM 7442 HG SER B 105 33.428 74.395 -6.112 1.00 0.00 H ATOM 7443 H SER B 105 32.542 74.269 -8.171 1.00 0.00 H ATOM 7444 N GLY B 106 33.166 70.408 -7.922 1.00 19.84 N ATOM 7445 CA GLY B 106 32.167 69.347 -7.808 1.00 20.22 C ATOM 7446 C GLY B 106 31.525 69.305 -6.429 1.00 20.55 C ATOM 7447 O GLY B 106 30.300 69.222 -6.311 1.00 20.68 O ATOM 7448 HA3 GLY B 106 32.649 68.389 -8.000 1.00 0.00 H ATOM 7449 HA2 GLY B 106 31.389 69.516 -8.552 1.00 0.00 H ATOM 7450 H GLY B 106 34.173 70.150 -7.943 1.00 0.00 H ATOM 7451 N GLY B 107 32.355 69.382 -5.387 1.00 21.01 N ATOM 7452 CA GLY B 107 31.904 69.160 -4.006 1.00 21.06 C ATOM 7453 C GLY B 107 31.860 70.382 -3.106 1.00 21.38 C ATOM 7454 O GLY B 107 31.423 70.280 -1.956 1.00 21.87 O ATOM 7455 HA3 GLY B 107 32.578 68.435 -3.549 1.00 0.00 H ATOM 7456 HA2 GLY B 107 30.898 68.742 -4.048 1.00 0.00 H ATOM 7457 H GLY B 107 33.356 69.607 -5.558 1.00 0.00 H ATOM 7458 N GLY B 108 32.291 71.539 -3.612 1.00 21.29 N ATOM 7459 CA GLY B 108 32.477 72.719 -2.766 1.00 21.07 C ATOM 7460 C GLY B 108 33.628 72.474 -1.798 1.00 21.14 C ATOM 7461 O GLY B 108 34.776 72.307 -2.227 1.00 21.32 O ATOM 7462 HA3 GLY B 108 31.563 72.911 -2.203 1.00 0.00 H ATOM 7463 HA2 GLY B 108 32.705 73.582 -3.391 1.00 0.00 H ATOM 7464 H GLY B 108 32.499 71.604 -4.629 1.00 0.00 H ATOM 7465 N SER B 109 33.325 72.448 -0.499 1.00 20.74 N ATOM 7466 CA SER B 109 34.288 72.011 0.508 1.00 20.54 C ATOM 7467 C SER B 109 33.639 71.196 1.616 1.00 20.50 C ATOM 7468 O SER B 109 33.262 71.744 2.657 1.00 20.41 O ATOM 7469 CB SER B 109 35.021 73.189 1.137 1.00 20.77 C ATOM 7470 OG SER B 109 35.914 72.714 2.134 1.00 19.93 O ATOM 7471 HA SER B 109 35.000 71.380 -0.024 1.00 0.00 H ATOM 7472 HB2 SER B 109 34.298 73.867 1.590 1.00 0.00 H ATOM 7473 HB3 SER B 109 35.583 73.720 0.369 1.00 0.00 H ATOM 7474 HG SER B 109 36.571 72.099 1.721 1.00 0.00 H ATOM 7475 H SER B 109 32.377 72.747 -0.195 1.00 0.00 H ATOM 7476 N PRO B 110 33.518 69.876 1.406 1.00 20.35 N ATOM 7477 CA PRO B 110 33.099 68.963 2.468 1.00 20.31 C ATOM 7478 C PRO B 110 33.913 69.136 3.752 1.00 20.20 C ATOM 7479 O PRO B 110 33.360 69.021 4.842 1.00 20.27 O ATOM 7480 CB PRO B 110 33.352 67.588 1.853 1.00 20.37 C ATOM 7481 CG PRO B 110 33.136 67.816 0.393 1.00 20.60 C ATOM 7482 CD PRO B 110 33.750 69.163 0.139 1.00 20.29 C ATOM 7483 HA PRO B 110 32.066 69.134 2.772 1.00 0.00 H ATOM 7484 HD3 PRO B 110 34.816 69.075 -0.072 1.00 0.00 H ATOM 7485 HD2 PRO B 110 33.257 69.668 -0.691 1.00 0.00 H ATOM 7486 HG3 PRO B 110 32.072 67.824 0.155 1.00 0.00 H ATOM 7487 HG2 PRO B 110 33.633 67.046 -0.197 1.00 0.00 H ATOM 7488 HB2 PRO B 110 34.371 67.254 2.049 1.00 0.00 H ATOM 7489 HB3 PRO B 110 32.649 66.851 2.241 1.00 0.00 H ATOM 7490 N ARG B 111 35.207 69.421 3.622 1.00 19.98 N ATOM 7491 CA ARG B 111 36.052 69.634 4.794 1.00 20.08 C ATOM 7492 C ARG B 111 35.550 70.779 5.674 1.00 20.02 C ATOM 7493 O ARG B 111 35.448 70.628 6.888 1.00 20.12 O ATOM 7494 CB ARG B 111 37.506 69.889 4.389 1.00 19.84 C ATOM 7495 CG ARG B 111 38.391 70.355 5.551 1.00 20.07 C ATOM 7496 CD ARG B 111 39.838 70.001 5.316 1.00 20.14 C ATOM 7497 NE ARG B 111 40.050 68.561 5.435 1.00 19.72 N ATOM 7498 CZ ARG B 111 41.156 67.926 5.075 1.00 19.82 C ATOM 7499 NH1 ARG B 111 42.178 68.597 4.559 1.00 20.05 N ATOM 7500 NH2 ARG B 111 41.238 66.609 5.227 1.00 20.20 N ATOM 7501 HA ARG B 111 36.001 68.716 5.380 1.00 0.00 H ATOM 7502 HB2 ARG B 111 37.920 68.964 3.989 1.00 0.00 H ATOM 7503 HB3 ARG B 111 37.520 70.656 3.615 1.00 0.00 H ATOM 7504 HG2 ARG B 111 38.302 71.437 5.653 1.00 0.00 H ATOM 7505 HG3 ARG B 111 38.053 69.875 6.469 1.00 0.00 H ATOM 7506 HD2 ARG B 111 40.455 70.515 6.053 1.00 0.00 H ATOM 7507 HD3 ARG B 111 40.126 70.323 4.315 1.00 0.00 H ATOM 7508 HE ARG B 111 39.275 67.992 5.832 1.00 0.00 H ATOM 7509 HH12 ARG B 111 43.043 68.092 4.279 1.00 0.00 H ATOM 7510 HH11 ARG B 111 42.114 69.628 4.435 1.00 0.00 H ATOM 7511 HH22 ARG B 111 42.104 66.106 4.946 1.00 0.00 H ATOM 7512 HH21 ARG B 111 40.436 66.081 5.627 1.00 0.00 H ATOM 7513 H ARG B 111 35.622 69.493 2.671 1.00 0.00 H ATOM 7514 N PHE B 112 35.241 71.922 5.076 1.00 20.06 N ATOM 7515 CA PHE B 112 34.801 73.064 5.873 1.00 20.31 C ATOM 7516 C PHE B 112 33.331 72.985 6.303 1.00 20.45 C ATOM 7517 O PHE B 112 32.969 73.538 7.338 1.00 20.78 O ATOM 7518 CB PHE B 112 35.160 74.391 5.193 1.00 20.38 C ATOM 7519 CG PHE B 112 36.607 74.764 5.372 1.00 20.29 C ATOM 7520 CD1 PHE B 112 37.510 74.647 4.327 1.00 20.62 C ATOM 7521 CD2 PHE B 112 37.074 75.178 6.613 1.00 20.60 C ATOM 7522 CE1 PHE B 112 38.852 74.960 4.506 1.00 20.73 C ATOM 7523 CE2 PHE B 112 38.411 75.496 6.804 1.00 20.96 C ATOM 7524 CZ PHE B 112 39.305 75.387 5.743 1.00 20.85 C ATOM 7525 HA PHE B 112 35.359 73.022 6.808 1.00 0.00 H ATOM 7526 HB2 PHE B 112 34.952 74.304 4.127 1.00 0.00 H ATOM 7527 HB3 PHE B 112 34.541 75.180 5.620 1.00 0.00 H ATOM 7528 HD2 PHE B 112 36.379 75.254 7.450 1.00 0.00 H ATOM 7529 HE2 PHE B 112 38.760 75.830 7.781 1.00 0.00 H ATOM 7530 HZ PHE B 112 40.357 75.636 5.885 1.00 0.00 H ATOM 7531 HE1 PHE B 112 39.548 74.869 3.672 1.00 0.00 H ATOM 7532 HD1 PHE B 112 37.163 74.305 3.352 1.00 0.00 H ATOM 7533 H PHE B 112 35.312 72.005 4.042 1.00 0.00 H ATOM 7534 N GLN B 113 32.502 72.275 5.540 1.00 20.49 N ATOM 7535 CA GLN B 113 31.143 71.961 5.982 1.00 20.66 C ATOM 7536 C GLN B 113 31.198 71.157 7.294 1.00 20.53 C ATOM 7537 O GLN B 113 30.497 71.472 8.258 1.00 20.36 O ATOM 7538 CB GLN B 113 30.377 71.171 4.907 1.00 20.59 C ATOM 7539 CG GLN B 113 29.990 71.991 3.677 1.00 21.66 C ATOM 7540 CD GLN B 113 29.439 71.140 2.524 1.00 21.89 C ATOM 7541 OE1 GLN B 113 28.358 70.570 2.617 1.00 23.00 O ATOM 7542 NE2 GLN B 113 30.189 71.069 1.430 1.00 24.58 N ATOM 7543 HA GLN B 113 30.611 72.897 6.152 1.00 0.00 H ATOM 7544 HB2 GLN B 113 31.005 70.342 4.581 1.00 0.00 H ATOM 7545 HB3 GLN B 113 29.465 70.779 5.357 1.00 0.00 H ATOM 7546 HG2 GLN B 113 29.227 72.713 3.969 1.00 0.00 H ATOM 7547 HG3 GLN B 113 30.874 72.521 3.323 1.00 0.00 H ATOM 7548 HE22 GLN B 113 31.101 71.568 1.391 1.00 0.00 H ATOM 7549 HE21 GLN B 113 29.864 70.515 0.612 1.00 0.00 H ATOM 7550 H GLN B 113 32.827 71.937 4.612 1.00 0.00 H ATOM 7551 N VAL B 114 32.048 70.130 7.317 1.00 20.18 N ATOM 7552 CA VAL B 114 32.213 69.277 8.489 1.00 20.03 C ATOM 7553 C VAL B 114 32.865 70.030 9.656 1.00 19.85 C ATOM 7554 O VAL B 114 32.463 69.850 10.811 1.00 19.58 O ATOM 7555 CB VAL B 114 33.046 68.011 8.156 1.00 20.06 C ATOM 7556 CG1 VAL B 114 33.356 67.215 9.414 1.00 20.11 C ATOM 7557 CG2 VAL B 114 32.308 67.136 7.146 1.00 20.00 C ATOM 7558 HA VAL B 114 31.212 68.971 8.793 1.00 0.00 H ATOM 7559 HB VAL B 114 33.989 68.335 7.717 1.00 0.00 H ATOM 7560 HG11 VAL B 114 33.926 67.837 10.105 1.00 0.00 H ATOM 7561 HG12 VAL B 114 32.423 66.906 9.886 1.00 0.00 H ATOM 7562 HG13 VAL B 114 33.941 66.334 9.150 1.00 0.00 H ATOM 7563 HG21 VAL B 114 31.349 66.830 7.565 1.00 0.00 H ATOM 7564 HG22 VAL B 114 32.142 67.702 6.230 1.00 0.00 H ATOM 7565 HG23 VAL B 114 32.908 66.253 6.925 1.00 0.00 H ATOM 7566 H VAL B 114 32.614 69.930 6.468 1.00 0.00 H ATOM 7567 N PHE B 115 33.867 70.857 9.360 1.00 19.69 N ATOM 7568 CA PHE B 115 34.546 71.634 10.403 1.00 19.68 C ATOM 7569 C PHE B 115 33.558 72.560 11.122 1.00 19.61 C ATOM 7570 O PHE B 115 33.543 72.615 12.350 1.00 19.64 O ATOM 7571 CB PHE B 115 35.718 72.439 9.832 1.00 19.90 C ATOM 7572 CG PHE B 115 36.216 73.533 10.749 1.00 20.00 C ATOM 7573 CD1 PHE B 115 37.260 73.298 11.637 1.00 20.38 C ATOM 7574 CD2 PHE B 115 35.638 74.800 10.719 1.00 20.34 C ATOM 7575 CE1 PHE B 115 37.717 74.306 12.483 1.00 20.21 C ATOM 7576 CE2 PHE B 115 36.084 75.811 11.564 1.00 20.31 C ATOM 7577 CZ PHE B 115 37.126 75.566 12.447 1.00 20.37 C ATOM 7578 HA PHE B 115 34.950 70.927 11.128 1.00 0.00 H ATOM 7579 HB2 PHE B 115 36.542 71.753 9.636 1.00 0.00 H ATOM 7580 HB3 PHE B 115 35.397 72.896 8.896 1.00 0.00 H ATOM 7581 HD2 PHE B 115 34.824 75.002 10.023 1.00 0.00 H ATOM 7582 HE2 PHE B 115 35.615 76.795 11.533 1.00 0.00 H ATOM 7583 HZ PHE B 115 37.480 76.356 13.109 1.00 0.00 H ATOM 7584 HE1 PHE B 115 38.537 74.108 13.173 1.00 0.00 H ATOM 7585 HD1 PHE B 115 37.726 72.313 11.672 1.00 0.00 H ATOM 7586 H PHE B 115 34.174 70.954 8.371 1.00 0.00 H ATOM 7587 N GLY B 116 32.732 73.271 10.354 1.00 19.31 N ATOM 7588 CA GLY B 116 31.716 74.161 10.922 1.00 19.17 C ATOM 7589 C GLY B 116 30.782 73.436 11.870 1.00 18.91 C ATOM 7590 O GLY B 116 30.469 73.930 12.948 1.00 18.43 O ATOM 7591 HA3 GLY B 116 31.129 74.587 10.109 1.00 0.00 H ATOM 7592 HA2 GLY B 116 32.216 74.962 11.466 1.00 0.00 H ATOM 7593 H GLY B 116 32.811 73.191 9.320 1.00 0.00 H ATOM 7594 N ALA B 117 30.339 72.252 11.459 1.00 19.13 N ATOM 7595 CA ALA B 117 29.453 71.435 12.276 1.00 19.18 C ATOM 7596 C ALA B 117 30.185 70.901 13.497 1.00 19.10 C ATOM 7597 O ALA B 117 29.639 70.925 14.585 1.00 19.15 O ATOM 7598 CB ALA B 117 28.861 70.298 11.460 1.00 19.21 C ATOM 7599 HA ALA B 117 28.633 72.065 12.621 1.00 0.00 H ATOM 7600 HB1 ALA B 117 28.291 70.709 10.626 1.00 0.00 H ATOM 7601 HB2 ALA B 117 29.665 69.670 11.077 1.00 0.00 H ATOM 7602 HB3 ALA B 117 28.203 69.703 12.093 1.00 0.00 H ATOM 7603 H ALA B 117 30.634 71.899 10.526 1.00 0.00 H ATOM 7604 N ASP B 118 31.424 70.448 13.324 1.00 19.41 N ATOM 7605 CA ASP B 118 32.240 69.980 14.455 1.00 19.62 C ATOM 7606 C ASP B 118 32.484 71.072 15.484 1.00 19.68 C ATOM 7607 O ASP B 118 32.284 70.856 16.678 1.00 19.94 O ATOM 7608 CB ASP B 118 33.598 69.468 13.977 1.00 19.67 C ATOM 7609 CG ASP B 118 33.505 68.137 13.252 1.00 20.98 C ATOM 7610 OD1 ASP B 118 34.551 67.724 12.702 1.00 21.68 O ATOM 7611 OD2 ASP B 118 32.409 67.514 13.225 1.00 20.89 O ATOM 7612 HA ASP B 118 31.672 69.174 14.920 1.00 0.00 H ATOM 7613 HB2 ASP B 118 34.029 70.205 13.299 1.00 0.00 H ATOM 7614 HB3 ASP B 118 34.249 69.348 14.843 1.00 0.00 H ATOM 7615 H ASP B 118 31.826 70.424 12.365 1.00 0.00 H ATOM 7616 N ALA B 119 32.937 72.231 15.010 1.00 19.73 N ATOM 7617 CA ALA B 119 33.205 73.386 15.865 1.00 19.77 C ATOM 7618 C ALA B 119 31.979 73.755 16.679 1.00 19.93 C ATOM 7619 O ALA B 119 32.069 73.946 17.895 1.00 19.84 O ATOM 7620 CB ALA B 119 33.647 74.576 15.023 1.00 19.79 C ATOM 7621 HA ALA B 119 34.007 73.118 16.553 1.00 0.00 H ATOM 7622 HB1 ALA B 119 34.555 74.317 14.479 1.00 0.00 H ATOM 7623 HB2 ALA B 119 32.858 74.832 14.315 1.00 0.00 H ATOM 7624 HB3 ALA B 119 33.843 75.428 15.674 1.00 0.00 H ATOM 7625 H ALA B 119 33.107 72.318 13.988 1.00 0.00 H ATOM 7626 N MET B 120 30.835 73.844 15.998 1.00 20.09 N ATOM 7627 CA MET B 120 29.580 74.258 16.621 1.00 20.15 C ATOM 7628 C MET B 120 29.136 73.351 17.768 1.00 20.25 C ATOM 7629 O MET B 120 28.502 73.825 18.713 1.00 20.12 O ATOM 7630 CB MET B 120 28.463 74.329 15.580 1.00 20.32 C ATOM 7631 CG MET B 120 27.205 75.035 16.066 1.00 20.12 C ATOM 7632 SD MET B 120 27.469 76.802 16.294 1.00 21.92 S ATOM 7633 CE MET B 120 26.074 77.207 17.337 1.00 21.60 C ATOM 7634 HA MET B 120 29.773 75.244 17.045 1.00 0.00 H ATOM 7635 HB2 MET B 120 28.841 74.863 14.708 1.00 0.00 H ATOM 7636 HB3 MET B 120 28.196 73.312 15.294 1.00 0.00 H ATOM 7637 HG2 MET B 120 26.901 74.599 17.017 1.00 0.00 H ATOM 7638 HG3 MET B 120 26.413 74.889 15.331 1.00 0.00 H ATOM 7639 HE1 MET B 120 25.149 76.964 16.814 1.00 0.00 H ATOM 7640 HE2 MET B 120 26.133 76.631 18.260 1.00 0.00 H ATOM 7641 HE3 MET B 120 26.093 78.272 17.570 1.00 0.00 H ATOM 7642 H MET B 120 30.837 73.610 14.985 1.00 0.00 H ATOM 7643 N ARG B 121 29.450 72.058 17.674 1.00 20.42 N ATOM 7644 CA ARG B 121 29.099 71.082 18.718 1.00 20.72 C ATOM 7645 C ARG B 121 30.113 70.997 19.862 1.00 20.70 C ATOM 7646 O ARG B 121 29.928 70.221 20.796 1.00 20.62 O ATOM 7647 CB ARG B 121 28.983 69.692 18.115 1.00 20.71 C ATOM 7648 CG ARG B 121 27.875 69.517 17.102 1.00 21.47 C ATOM 7649 CD ARG B 121 28.453 68.888 15.852 1.00 22.23 C ATOM 7650 NE ARG B 121 27.827 67.637 15.503 1.00 23.05 N ATOM 7651 CZ ARG B 121 28.257 66.835 14.539 1.00 22.86 C ATOM 7652 NH1 ARG B 121 29.337 67.128 13.813 1.00 23.22 N ATOM 7653 NH2 ARG B 121 27.602 65.720 14.314 1.00 22.65 N ATOM 7654 HA ARG B 121 28.153 71.434 19.130 1.00 0.00 H ATOM 7655 HB2 ARG B 121 29.928 69.458 17.625 1.00 0.00 H ATOM 7656 HB3 ARG B 121 28.812 68.986 18.927 1.00 0.00 H ATOM 7657 HG2 ARG B 121 27.100 68.870 17.514 1.00 0.00 H ATOM 7658 HG3 ARG B 121 27.444 70.488 16.858 1.00 0.00 H ATOM 7659 HD2 ARG B 121 29.516 68.710 16.013 1.00 0.00 H ATOM 7660 HD3 ARG B 121 28.324 69.583 15.023 1.00 0.00 H ATOM 7661 HE ARG B 121 26.986 67.346 16.041 1.00 0.00 H ATOM 7662 HH12 ARG B 121 29.651 66.480 13.063 1.00 0.00 H ATOM 7663 HH11 ARG B 121 29.865 68.005 13.997 1.00 0.00 H ATOM 7664 HH22 ARG B 121 27.919 65.073 13.564 1.00 0.00 H ATOM 7665 HH21 ARG B 121 26.766 65.483 14.886 1.00 0.00 H ATOM 7666 H ARG B 121 29.962 71.727 16.831 1.00 0.00 H ATOM 7667 N GLY B 122 31.195 71.759 19.768 1.00 21.01 N ATOM 7668 CA GLY B 122 32.214 71.785 20.805 1.00 21.24 C ATOM 7669 C GLY B 122 31.867 72.765 21.907 1.00 21.50 C ATOM 7670 O GLY B 122 30.772 73.330 21.916 1.00 21.32 O ATOM 7671 HA3 GLY B 122 33.165 72.077 20.359 1.00 0.00 H ATOM 7672 HA2 GLY B 122 32.306 70.788 21.235 1.00 0.00 H ATOM 7673 H GLY B 122 31.318 72.357 18.926 1.00 0.00 H ATOM 7674 N PRO B 123 32.810 72.987 22.840 1.00 21.83 N ATOM 7675 CA PRO B 123 32.599 73.866 23.989 1.00 21.92 C ATOM 7676 C PRO B 123 32.596 75.357 23.624 1.00 22.09 C ATOM 7677 O PRO B 123 32.158 76.189 24.421 1.00 21.84 O ATOM 7678 CB PRO B 123 33.797 73.538 24.884 1.00 21.79 C ATOM 7679 CG PRO B 123 34.861 73.166 23.931 1.00 21.61 C ATOM 7680 CD PRO B 123 34.169 72.413 22.845 1.00 21.86 C ATOM 7681 HA PRO B 123 31.626 73.702 24.451 1.00 0.00 H ATOM 7682 HD3 PRO B 123 34.662 72.570 21.886 1.00 0.00 H ATOM 7683 HD2 PRO B 123 34.141 71.346 23.067 1.00 0.00 H ATOM 7684 HG3 PRO B 123 35.607 72.537 24.417 1.00 0.00 H ATOM 7685 HG2 PRO B 123 35.344 74.057 23.530 1.00 0.00 H ATOM 7686 HB2 PRO B 123 34.090 74.407 25.474 1.00 0.00 H ATOM 7687 HB3 PRO B 123 33.567 72.708 25.552 1.00 0.00 H ATOM 7688 N ARG B 124 33.080 75.681 22.430 1.00 22.36 N ATOM 7689 CA ARG B 124 33.214 77.066 21.993 1.00 22.57 C ATOM 7690 C ARG B 124 32.084 77.536 21.069 1.00 22.56 C ATOM 7691 O ARG B 124 31.897 78.737 20.889 1.00 22.70 O ATOM 7692 CB ARG B 124 34.555 77.228 21.298 1.00 22.88 C ATOM 7693 CG ARG B 124 35.744 76.933 22.205 1.00 24.18 C ATOM 7694 CD ARG B 124 36.531 78.187 22.458 1.00 25.90 C ATOM 7695 NE ARG B 124 37.226 78.586 21.238 1.00 27.07 N ATOM 7696 CZ ARG B 124 37.453 79.842 20.856 1.00 27.53 C ATOM 7697 NH1 ARG B 124 37.037 80.875 21.588 1.00 27.35 N ATOM 7698 NH2 ARG B 124 38.101 80.060 19.717 1.00 27.37 N ATOM 7699 HA ARG B 124 33.151 77.693 22.882 1.00 0.00 H ATOM 7700 HB2 ARG B 124 34.590 76.545 20.449 1.00 0.00 H ATOM 7701 HB3 ARG B 124 34.638 78.255 20.941 1.00 0.00 H ATOM 7702 HG2 ARG B 124 35.383 76.537 23.154 1.00 0.00 H ATOM 7703 HG3 ARG B 124 36.387 76.195 21.726 1.00 0.00 H ATOM 7704 HD2 ARG B 124 37.260 78.005 23.248 1.00 0.00 H ATOM 7705 HD3 ARG B 124 35.854 78.984 22.767 1.00 0.00 H ATOM 7706 HE ARG B 124 37.572 77.828 20.616 1.00 0.00 H ATOM 7707 HH12 ARG B 124 37.226 81.847 21.270 1.00 0.00 H ATOM 7708 HH11 ARG B 124 36.524 80.709 22.477 1.00 0.00 H ATOM 7709 HH22 ARG B 124 38.287 81.034 19.403 1.00 0.00 H ATOM 7710 HH21 ARG B 124 38.422 79.257 19.139 1.00 0.00 H ATOM 7711 H ARG B 124 33.374 74.920 21.784 1.00 0.00 H ATOM 7712 N GLY B 125 31.345 76.596 20.482 1.00 22.44 N ATOM 7713 CA GLY B 125 30.204 76.924 19.622 1.00 22.17 C ATOM 7714 C GLY B 125 30.573 77.847 18.475 1.00 22.00 C ATOM 7715 O GLY B 125 31.500 77.560 17.715 1.00 21.79 O ATOM 7716 HA3 GLY B 125 29.440 77.411 20.228 1.00 0.00 H ATOM 7717 HA2 GLY B 125 29.803 75.999 19.209 1.00 0.00 H ATOM 7718 H GLY B 125 31.585 75.596 20.639 1.00 0.00 H ATOM 7719 N LEU B 126 29.857 78.969 18.376 1.00 22.02 N ATOM 7720 CA LEU B 126 29.993 79.915 17.260 1.00 22.03 C ATOM 7721 C LEU B 126 31.364 80.558 17.135 1.00 21.97 C ATOM 7722 O LEU B 126 31.814 80.846 16.024 1.00 21.76 O ATOM 7723 CB LEU B 126 28.963 81.034 17.385 1.00 22.01 C ATOM 7724 CG LEU B 126 27.508 80.716 17.073 1.00 22.08 C ATOM 7725 CD1 LEU B 126 26.655 81.929 17.423 1.00 22.35 C ATOM 7726 CD2 LEU B 126 27.316 80.334 15.607 1.00 21.77 C ATOM 7727 HA LEU B 126 29.834 79.312 16.366 1.00 0.00 H ATOM 7728 HB2 LEU B 126 29.001 81.394 18.413 1.00 0.00 H ATOM 7729 HB3 LEU B 126 29.271 81.833 16.710 1.00 0.00 H ATOM 7730 HG LEU B 126 27.200 79.858 17.670 1.00 0.00 H ATOM 7731 HD21 LEU B 126 27.631 81.163 14.973 1.00 0.00 H ATOM 7732 HD22 LEU B 126 27.917 79.453 15.381 1.00 0.00 H ATOM 7733 HD23 LEU B 126 26.264 80.114 15.425 1.00 0.00 H ATOM 7734 HD11 LEU B 126 26.765 82.155 18.484 1.00 0.00 H ATOM 7735 HD12 LEU B 126 26.982 82.784 16.832 1.00 0.00 H ATOM 7736 HD13 LEU B 126 25.610 81.712 17.203 1.00 0.00 H ATOM 7737 H LEU B 126 29.169 79.184 19.126 1.00 0.00 H ATOM 7738 N LYS B 127 32.004 80.820 18.274 1.00 22.12 N ATOM 7739 CA LYS B 127 33.341 81.423 18.292 1.00 22.22 C ATOM 7740 C LYS B 127 34.416 80.498 17.718 1.00 21.79 C ATOM 7741 O LYS B 127 35.458 80.969 17.264 1.00 22.20 O ATOM 7742 CB LYS B 127 33.714 81.865 19.715 1.00 22.55 C ATOM 7743 CG LYS B 127 32.991 83.143 20.159 1.00 23.72 C ATOM 7744 CD LYS B 127 33.517 83.709 21.490 1.00 24.23 C ATOM 7745 CE LYS B 127 32.992 82.929 22.711 1.00 26.49 C ATOM 7746 NZ LYS B 127 33.769 81.670 22.980 1.00 27.05 N ATOM 7747 HA LYS B 127 33.300 82.298 17.644 1.00 0.00 H ATOM 7748 HB2 LYS B 127 33.456 81.063 20.406 1.00 0.00 H ATOM 7749 HB3 LYS B 127 34.789 82.044 19.752 1.00 0.00 H ATOM 7750 HG2 LYS B 127 33.120 83.900 19.386 1.00 0.00 H ATOM 7751 HG3 LYS B 127 31.930 82.919 20.273 1.00 0.00 H ATOM 7752 HD2 LYS B 127 34.606 83.660 21.485 1.00 0.00 H ATOM 7753 HD3 LYS B 127 33.202 84.749 21.577 1.00 0.00 H ATOM 7754 HE2 LYS B 127 31.950 82.663 22.533 1.00 0.00 H ATOM 7755 HE3 LYS B 127 33.057 83.572 23.589 1.00 0.00 H ATOM 7756 HZ1 LYS B 127 33.708 81.043 22.153 1.00 0.00 H ATOM 7757 HZ2 LYS B 127 34.764 81.910 23.161 1.00 0.00 H ATOM 7758 HZ3 LYS B 127 33.370 81.189 23.811 1.00 0.00 H ATOM 7759 H LYS B 127 31.542 80.590 19.177 1.00 0.00 H ATOM 7760 N ALA B 128 34.168 79.190 17.739 1.00 21.16 N ATOM 7761 CA ALA B 128 35.064 78.227 17.105 1.00 20.77 C ATOM 7762 C ALA B 128 34.806 78.132 15.600 1.00 20.49 C ATOM 7763 O ALA B 128 35.731 77.898 14.821 1.00 20.50 O ATOM 7764 CB ALA B 128 34.917 76.864 17.744 1.00 20.62 C ATOM 7765 HA ALA B 128 36.085 78.580 17.252 1.00 0.00 H ATOM 7766 HB1 ALA B 128 35.163 76.932 18.804 1.00 0.00 H ATOM 7767 HB2 ALA B 128 33.889 76.520 17.630 1.00 0.00 H ATOM 7768 HB3 ALA B 128 35.593 76.161 17.257 1.00 0.00 H ATOM 7769 H ALA B 128 33.313 78.845 18.220 1.00 0.00 H ATOM 7770 N VAL B 129 33.554 78.300 15.191 1.00 20.11 N ATOM 7771 CA VAL B 129 33.212 78.234 13.775 1.00 20.01 C ATOM 7772 C VAL B 129 33.940 79.359 13.037 1.00 19.88 C ATOM 7773 O VAL B 129 34.563 79.136 12.001 1.00 19.05 O ATOM 7774 CB VAL B 129 31.684 78.345 13.540 1.00 19.91 C ATOM 7775 CG1 VAL B 129 31.366 78.355 12.048 1.00 20.11 C ATOM 7776 CG2 VAL B 129 30.947 77.190 14.213 1.00 19.56 C ATOM 7777 HA VAL B 129 33.526 77.263 13.391 1.00 0.00 H ATOM 7778 HB VAL B 129 31.348 79.284 13.980 1.00 0.00 H ATOM 7779 HG11 VAL B 129 31.858 79.207 11.579 1.00 0.00 H ATOM 7780 HG12 VAL B 129 31.726 77.431 11.595 1.00 0.00 H ATOM 7781 HG13 VAL B 129 30.288 78.434 11.908 1.00 0.00 H ATOM 7782 HG21 VAL B 129 31.299 76.245 13.799 1.00 0.00 H ATOM 7783 HG22 VAL B 129 31.141 77.213 15.285 1.00 0.00 H ATOM 7784 HG23 VAL B 129 29.877 77.290 14.034 1.00 0.00 H ATOM 7785 H VAL B 129 32.806 78.481 15.891 1.00 0.00 H ATOM 7786 N GLY B 130 33.862 80.565 13.597 1.00 20.00 N ATOM 7787 CA GLY B 130 34.463 81.748 12.992 1.00 20.04 C ATOM 7788 C GLY B 130 33.628 82.274 11.834 1.00 20.20 C ATOM 7789 O GLY B 130 32.691 81.609 11.392 1.00 19.93 O ATOM 7790 HA3 GLY B 130 35.456 81.491 12.624 1.00 0.00 H ATOM 7791 HA2 GLY B 130 34.548 82.528 13.749 1.00 0.00 H ATOM 7792 H GLY B 130 33.354 80.667 14.499 1.00 0.00 H ATOM 7793 N PRO B 131 33.967 83.475 11.331 1.00 20.35 N ATOM 7794 CA PRO B 131 33.209 84.141 10.274 1.00 20.42 C ATOM 7795 C PRO B 131 33.619 83.828 8.820 1.00 20.56 C ATOM 7796 O PRO B 131 33.163 84.515 7.904 1.00 20.88 O ATOM 7797 CB PRO B 131 33.455 85.621 10.580 1.00 20.47 C ATOM 7798 CG PRO B 131 34.821 85.657 11.180 1.00 20.52 C ATOM 7799 CD PRO B 131 35.093 84.307 11.796 1.00 20.34 C ATOM 7800 HA PRO B 131 32.173 83.803 10.295 1.00 0.00 H ATOM 7801 HD3 PRO B 131 36.044 83.905 11.446 1.00 0.00 H ATOM 7802 HD2 PRO B 131 35.105 84.372 12.884 1.00 0.00 H ATOM 7803 HG3 PRO B 131 34.869 86.431 11.946 1.00 0.00 H ATOM 7804 HG2 PRO B 131 35.560 85.867 10.407 1.00 0.00 H ATOM 7805 HB2 PRO B 131 33.419 86.215 9.667 1.00 0.00 H ATOM 7806 HB3 PRO B 131 32.714 85.997 11.285 1.00 0.00 H ATOM 7807 N TYR B 132 34.436 82.803 8.593 1.00 20.65 N ATOM 7808 CA TYR B 132 34.953 82.532 7.242 1.00 20.44 C ATOM 7809 C TYR B 132 34.444 81.243 6.599 1.00 20.29 C ATOM 7810 O TYR B 132 34.753 80.976 5.438 1.00 20.56 O ATOM 7811 CB TYR B 132 36.488 82.546 7.258 1.00 20.85 C ATOM 7812 CG TYR B 132 37.055 83.883 7.695 1.00 21.09 C ATOM 7813 CD1 TYR B 132 36.769 85.041 6.979 1.00 21.22 C ATOM 7814 CD2 TYR B 132 37.866 83.993 8.825 1.00 21.19 C ATOM 7815 CE1 TYR B 132 37.267 86.271 7.368 1.00 21.63 C ATOM 7816 CE2 TYR B 132 38.377 85.225 9.222 1.00 21.08 C ATOM 7817 CZ TYR B 132 38.068 86.360 8.490 1.00 21.68 C ATOM 7818 OH TYR B 132 38.559 87.592 8.860 1.00 22.31 O ATOM 7819 HA TYR B 132 34.564 83.335 6.616 1.00 0.00 H ATOM 7820 HB3 TYR B 132 36.850 82.324 6.254 1.00 0.00 H ATOM 7821 HB2 TYR B 132 36.837 81.777 7.947 1.00 0.00 H ATOM 7822 HD2 TYR B 132 38.103 83.101 9.405 1.00 0.00 H ATOM 7823 HE2 TYR B 132 39.016 85.297 10.102 1.00 0.00 H ATOM 7824 HE1 TYR B 132 37.029 87.165 6.792 1.00 0.00 H ATOM 7825 HD1 TYR B 132 36.139 84.977 6.092 1.00 0.00 H ATOM 7826 HH TYR B 132 39.549 87.569 8.847 1.00 0.00 H ATOM 7827 H TYR B 132 34.713 82.184 9.382 1.00 0.00 H ATOM 7828 N VAL B 133 33.643 80.464 7.321 1.00 19.79 N ATOM 7829 CA VAL B 133 33.225 79.146 6.836 1.00 19.54 C ATOM 7830 C VAL B 133 32.242 79.205 5.658 1.00 19.24 C ATOM 7831 O VAL B 133 32.273 78.321 4.789 1.00 19.02 O ATOM 7832 CB VAL B 133 32.626 78.283 7.972 1.00 19.54 C ATOM 7833 CG1 VAL B 133 32.135 76.936 7.437 1.00 20.17 C ATOM 7834 CG2 VAL B 133 33.662 78.050 9.056 1.00 19.53 C ATOM 7835 HA VAL B 133 34.139 78.678 6.469 1.00 0.00 H ATOM 7836 HB VAL B 133 31.777 78.823 8.391 1.00 0.00 H ATOM 7837 HG11 VAL B 133 31.366 77.104 6.683 1.00 0.00 H ATOM 7838 HG12 VAL B 133 32.971 76.397 6.991 1.00 0.00 H ATOM 7839 HG13 VAL B 133 31.719 76.351 8.257 1.00 0.00 H ATOM 7840 HG21 VAL B 133 34.522 77.533 8.630 1.00 0.00 H ATOM 7841 HG22 VAL B 133 33.980 79.009 9.465 1.00 0.00 H ATOM 7842 HG23 VAL B 133 33.226 77.441 9.848 1.00 0.00 H ATOM 7843 H VAL B 133 33.307 80.797 8.247 1.00 0.00 H ATOM 7844 N VAL B 134 31.383 80.226 5.619 1.00 18.74 N ATOM 7845 CA VAL B 134 30.382 80.335 4.545 1.00 18.76 C ATOM 7846 C VAL B 134 31.040 80.367 3.176 1.00 18.43 C ATOM 7847 O VAL B 134 30.668 79.601 2.292 1.00 18.33 O ATOM 7848 CB VAL B 134 29.481 81.590 4.670 1.00 18.77 C ATOM 7849 CG1 VAL B 134 28.542 81.699 3.465 1.00 18.72 C ATOM 7850 CG2 VAL B 134 28.668 81.543 5.944 1.00 19.35 C ATOM 7851 HA VAL B 134 29.758 79.447 4.652 1.00 0.00 H ATOM 7852 HB VAL B 134 30.129 82.466 4.698 1.00 0.00 H ATOM 7853 HG11 VAL B 134 29.132 81.776 2.552 1.00 0.00 H ATOM 7854 HG12 VAL B 134 27.910 80.812 3.417 1.00 0.00 H ATOM 7855 HG13 VAL B 134 27.918 82.586 3.571 1.00 0.00 H ATOM 7856 HG21 VAL B 134 28.036 80.655 5.937 1.00 0.00 H ATOM 7857 HG22 VAL B 134 29.340 81.506 6.801 1.00 0.00 H ATOM 7858 HG23 VAL B 134 28.044 82.434 6.008 1.00 0.00 H ATOM 7859 H VAL B 134 31.421 80.956 6.359 1.00 0.00 H ATOM 7860 N THR B 135 32.022 81.249 3.013 1.00 18.24 N ATOM 7861 CA THR B 135 32.709 81.410 1.732 1.00 18.24 C ATOM 7862 C THR B 135 33.591 80.203 1.363 1.00 18.20 C ATOM 7863 O THR B 135 33.884 79.965 0.183 1.00 17.83 O ATOM 7864 CB THR B 135 33.558 82.697 1.716 1.00 18.25 C ATOM 7865 OG1 THR B 135 34.510 82.668 2.784 1.00 17.79 O ATOM 7866 CG2 THR B 135 32.663 83.924 1.858 1.00 18.59 C ATOM 7867 HA THR B 135 31.923 81.481 0.980 1.00 0.00 H ATOM 7868 HB THR B 135 34.087 82.754 0.764 1.00 0.00 H ATOM 7869 HG1 THR B 135 35.104 81.884 2.674 1.00 0.00 H ATOM 7870 HG23 THR B 135 31.940 83.941 1.042 1.00 0.00 H ATOM 7871 HG21 THR B 135 32.136 83.880 2.811 1.00 0.00 H ATOM 7872 HG22 THR B 135 33.275 84.825 1.822 1.00 0.00 H ATOM 7873 H THR B 135 32.309 81.841 3.819 1.00 0.00 H ATOM 7874 N LYS B 136 34.014 79.452 2.373 1.00 18.12 N ATOM 7875 CA LYS B 136 34.758 78.218 2.146 1.00 18.37 C ATOM 7876 C LYS B 136 33.839 77.067 1.771 1.00 18.37 C ATOM 7877 O LYS B 136 34.128 76.326 0.840 1.00 18.89 O ATOM 7878 CB LYS B 136 35.562 77.848 3.386 1.00 18.21 C ATOM 7879 CG LYS B 136 36.647 78.844 3.692 1.00 18.38 C ATOM 7880 CD LYS B 136 37.419 78.455 4.924 1.00 18.64 C ATOM 7881 CE LYS B 136 38.295 79.584 5.382 1.00 18.57 C ATOM 7882 NZ LYS B 136 39.103 79.172 6.547 1.00 18.52 N ATOM 7883 HA LYS B 136 35.436 78.396 1.311 1.00 0.00 H ATOM 7884 HB2 LYS B 136 34.885 77.796 4.239 1.00 0.00 H ATOM 7885 HB3 LYS B 136 36.019 76.871 3.227 1.00 0.00 H ATOM 7886 HG2 LYS B 136 37.332 78.894 2.845 1.00 0.00 H ATOM 7887 HG3 LYS B 136 36.195 79.823 3.851 1.00 0.00 H ATOM 7888 HD2 LYS B 136 36.719 78.200 5.719 1.00 0.00 H ATOM 7889 HD3 LYS B 136 38.041 77.589 4.698 1.00 0.00 H ATOM 7890 HE2 LYS B 136 37.670 80.433 5.660 1.00 0.00 H ATOM 7891 HE3 LYS B 136 38.960 79.875 4.569 1.00 0.00 H ATOM 7892 HZ1 LYS B 136 38.471 78.897 7.326 1.00 0.00 H ATOM 7893 HZ2 LYS B 136 39.702 78.364 6.283 1.00 0.00 H ATOM 7894 HZ3 LYS B 136 39.703 79.966 6.850 1.00 0.00 H ATOM 7895 H LYS B 136 33.810 79.750 3.348 1.00 0.00 H ATOM 7896 N ALA B 137 32.735 76.921 2.499 1.00 18.48 N ATOM 7897 CA ALA B 137 31.844 75.764 2.345 1.00 18.44 C ATOM 7898 C ALA B 137 30.869 75.863 1.170 1.00 18.40 C ATOM 7899 O ALA B 137 30.475 74.836 0.599 1.00 18.61 O ATOM 7900 CB ALA B 137 31.068 75.538 3.632 1.00 18.49 C ATOM 7901 HA ALA B 137 32.494 74.918 2.124 1.00 0.00 H ATOM 7902 HB1 ALA B 137 31.766 75.350 4.448 1.00 0.00 H ATOM 7903 HB2 ALA B 137 30.474 76.424 3.857 1.00 0.00 H ATOM 7904 HB3 ALA B 137 30.409 74.678 3.511 1.00 0.00 H ATOM 7905 H ALA B 137 32.495 77.650 3.200 1.00 0.00 H ATOM 7906 N MET B 138 30.464 77.082 0.825 1.00 18.37 N ATOM 7907 CA MET B 138 29.432 77.285 -0.190 1.00 18.49 C ATOM 7908 C MET B 138 29.888 76.801 -1.571 1.00 18.27 C ATOM 7909 O MET B 138 31.072 76.843 -1.901 1.00 17.97 O ATOM 7910 CB MET B 138 28.989 78.754 -0.245 1.00 18.39 C ATOM 7911 CG MET B 138 30.007 79.718 -0.823 1.00 18.67 C ATOM 7912 SD MET B 138 29.456 81.441 -0.728 1.00 19.24 S ATOM 7913 CE MET B 138 30.776 82.272 -1.607 1.00 18.87 C ATOM 7914 HA MET B 138 28.572 76.681 0.101 1.00 0.00 H ATOM 7915 HB2 MET B 138 28.087 78.811 -0.854 1.00 0.00 H ATOM 7916 HB3 MET B 138 28.760 79.075 0.771 1.00 0.00 H ATOM 7917 HG2 MET B 138 30.178 79.462 -1.869 1.00 0.00 H ATOM 7918 HG3 MET B 138 30.940 79.617 -0.268 1.00 0.00 H ATOM 7919 HE1 MET B 138 31.722 82.089 -1.097 1.00 0.00 H ATOM 7920 HE2 MET B 138 30.830 81.888 -2.626 1.00 0.00 H ATOM 7921 HE3 MET B 138 30.576 83.343 -1.631 1.00 0.00 H ATOM 7922 H MET B 138 30.891 77.909 1.288 1.00 0.00 H ATOM 7923 N ALA B 139 28.920 76.346 -2.358 1.00 18.37 N ATOM 7924 CA ALA B 139 29.170 75.704 -3.646 1.00 18.62 C ATOM 7925 C ALA B 139 29.705 76.661 -4.716 1.00 18.83 C ATOM 7926 O ALA B 139 30.222 76.213 -5.742 1.00 19.51 O ATOM 7927 CB ALA B 139 27.883 75.021 -4.143 1.00 18.79 C ATOM 7928 HA ALA B 139 29.954 74.965 -3.480 1.00 0.00 H ATOM 7929 HB1 ALA B 139 27.569 74.270 -3.419 1.00 0.00 H ATOM 7930 HB2 ALA B 139 27.098 75.768 -4.257 1.00 0.00 H ATOM 7931 HB3 ALA B 139 28.074 74.544 -5.104 1.00 0.00 H ATOM 7932 H ALA B 139 27.935 76.452 -2.042 1.00 0.00 H ATOM 7933 N SER B 140 29.567 77.965 -4.481 1.00 18.64 N ATOM 7934 CA SER B 140 30.064 78.986 -5.394 1.00 18.42 C ATOM 7935 C SER B 140 31.382 79.599 -4.909 1.00 18.30 C ATOM 7936 O SER B 140 31.814 80.627 -5.426 1.00 18.07 O ATOM 7937 CB SER B 140 29.017 80.095 -5.549 1.00 18.53 C ATOM 7938 OG SER B 140 28.951 80.915 -4.388 1.00 18.97 O ATOM 7939 HA SER B 140 30.251 78.504 -6.354 1.00 0.00 H ATOM 7940 HB2 SER B 140 28.041 79.640 -5.718 1.00 0.00 H ATOM 7941 HB3 SER B 140 29.281 80.714 -6.406 1.00 0.00 H ATOM 7942 HG SER B 140 28.267 81.619 -4.521 1.00 0.00 H ATOM 7943 H SER B 140 29.085 78.267 -3.610 1.00 0.00 H ATOM 7944 N GLY B 141 32.013 78.970 -3.917 1.00 18.21 N ATOM 7945 CA GLY B 141 33.259 79.473 -3.336 1.00 18.08 C ATOM 7946 C GLY B 141 34.345 79.760 -4.355 1.00 18.07 C ATOM 7947 O GLY B 141 34.997 80.805 -4.289 1.00 18.13 O ATOM 7948 HA3 GLY B 141 33.635 78.728 -2.635 1.00 0.00 H ATOM 7949 HA2 GLY B 141 33.039 80.396 -2.800 1.00 0.00 H ATOM 7950 H GLY B 141 31.605 78.090 -3.542 1.00 0.00 H ATOM 7951 N VAL B 142 34.530 78.851 -5.315 1.00 17.81 N ATOM 7952 CA VAL B 142 35.578 79.026 -6.322 1.00 17.65 C ATOM 7953 C VAL B 142 35.401 80.316 -7.127 1.00 17.28 C ATOM 7954 O VAL B 142 36.374 81.007 -7.369 1.00 17.25 O ATOM 7955 CB VAL B 142 35.706 77.822 -7.283 1.00 17.59 C ATOM 7956 CG1 VAL B 142 36.695 78.128 -8.406 1.00 18.19 C ATOM 7957 CG2 VAL B 142 36.189 76.592 -6.538 1.00 18.52 C ATOM 7958 HA VAL B 142 36.505 79.095 -5.753 1.00 0.00 H ATOM 7959 HB VAL B 142 34.719 77.634 -7.705 1.00 0.00 H ATOM 7960 HG11 VAL B 142 36.346 78.993 -8.970 1.00 0.00 H ATOM 7961 HG12 VAL B 142 37.674 78.342 -7.978 1.00 0.00 H ATOM 7962 HG13 VAL B 142 36.768 77.266 -9.069 1.00 0.00 H ATOM 7963 HG21 VAL B 142 37.164 76.796 -6.096 1.00 0.00 H ATOM 7964 HG22 VAL B 142 35.477 76.342 -5.751 1.00 0.00 H ATOM 7965 HG23 VAL B 142 36.272 75.757 -7.233 1.00 0.00 H ATOM 7966 H VAL B 142 33.922 78.008 -5.348 1.00 0.00 H ATOM 7967 N SER B 143 34.182 80.638 -7.551 1.00 17.06 N ATOM 7968 CA SER B 143 33.962 81.873 -8.318 1.00 16.99 C ATOM 7969 C SER B 143 34.005 83.105 -7.408 1.00 17.01 C ATOM 7970 O SER B 143 34.643 84.105 -7.732 1.00 16.78 O ATOM 7971 CB SER B 143 32.653 81.823 -9.124 1.00 16.91 C ATOM 7972 OG SER B 143 31.522 81.632 -8.300 1.00 15.91 O ATOM 7973 HA SER B 143 34.779 81.956 -9.035 1.00 0.00 H ATOM 7974 HB2 SER B 143 32.711 81.000 -9.836 1.00 0.00 H ATOM 7975 HB3 SER B 143 32.538 82.762 -9.665 1.00 0.00 H ATOM 7976 HG SER B 143 31.613 80.777 -7.809 1.00 0.00 H ATOM 7977 H SER B 143 33.379 80.012 -7.339 1.00 0.00 H ATOM 7978 N ALA B 144 33.347 83.012 -6.260 1.00 16.97 N ATOM 7979 CA ALA B 144 33.285 84.114 -5.312 1.00 17.14 C ATOM 7980 C ALA B 144 34.669 84.538 -4.833 1.00 17.30 C ATOM 7981 O ALA B 144 34.975 85.733 -4.774 1.00 17.46 O ATOM 7982 CB ALA B 144 32.426 83.721 -4.132 1.00 17.31 C ATOM 7983 HA ALA B 144 32.843 84.969 -5.824 1.00 0.00 H ATOM 7984 HB1 ALA B 144 31.420 83.484 -4.479 1.00 0.00 H ATOM 7985 HB2 ALA B 144 32.858 82.847 -3.644 1.00 0.00 H ATOM 7986 HB3 ALA B 144 32.382 84.549 -3.424 1.00 0.00 H ATOM 7987 H ALA B 144 32.860 82.123 -6.030 1.00 0.00 H ATOM 7988 N CYS B 145 35.500 83.553 -4.502 1.00 17.44 N ATOM 7989 CA CYS B 145 36.844 83.807 -3.973 1.00 17.50 C ATOM 7990 C CYS B 145 37.852 84.345 -4.989 1.00 17.59 C ATOM 7991 O CYS B 145 38.866 84.926 -4.591 1.00 18.21 O ATOM 7992 CB CYS B 145 37.404 82.548 -3.306 1.00 17.51 C ATOM 7993 SG CYS B 145 36.495 82.105 -1.797 1.00 17.38 S ATOM 7994 HA CYS B 145 36.709 84.605 -3.242 1.00 0.00 H ATOM 7995 HB2 CYS B 145 38.448 82.723 -3.048 1.00 0.00 H ATOM 7996 HB3 CYS B 145 37.339 81.719 -4.011 1.00 0.00 H ATOM 7997 HG CYS B 145 37.047 80.966 -1.247 1.00 0.00 H ATOM 7998 H CYS B 145 35.186 82.569 -4.623 1.00 0.00 H ATOM 7999 N LEU B 146 37.603 84.141 -6.282 1.00 17.61 N ATOM 8000 CA LEU B 146 38.498 84.666 -7.326 1.00 17.43 C ATOM 8001 C LEU B 146 37.989 85.986 -7.905 1.00 17.35 C ATOM 8002 O LEU B 146 38.773 86.890 -8.180 1.00 16.95 O ATOM 8003 CB LEU B 146 38.680 83.666 -8.475 1.00 17.22 C ATOM 8004 CG LEU B 146 39.054 82.202 -8.201 1.00 17.07 C ATOM 8005 CD1 LEU B 146 39.661 81.583 -9.428 1.00 15.39 C ATOM 8006 CD2 LEU B 146 39.970 82.021 -7.013 1.00 16.97 C ATOM 8007 HA LEU B 146 39.458 84.835 -6.838 1.00 0.00 H ATOM 8008 HB2 LEU B 146 37.737 83.648 -9.022 1.00 0.00 H ATOM 8009 HB3 LEU B 146 39.463 84.071 -9.117 1.00 0.00 H ATOM 8010 HG LEU B 146 38.125 81.691 -7.948 1.00 0.00 H ATOM 8011 HD21 LEU B 146 40.898 82.567 -7.185 1.00 0.00 H ATOM 8012 HD22 LEU B 146 39.482 82.405 -6.117 1.00 0.00 H ATOM 8013 HD23 LEU B 146 40.189 80.961 -6.883 1.00 0.00 H ATOM 8014 HD11 LEU B 146 38.942 81.621 -10.246 1.00 0.00 H ATOM 8015 HD12 LEU B 146 40.559 82.135 -9.706 1.00 0.00 H ATOM 8016 HD13 LEU B 146 39.921 80.545 -9.219 1.00 0.00 H ATOM 8017 H LEU B 146 36.759 83.600 -6.559 1.00 0.00 H ATOM 8018 N ALA B 147 36.678 86.081 -8.107 1.00 17.38 N ATOM 8019 CA ALA B 147 36.076 87.255 -8.737 1.00 17.72 C ATOM 8020 C ALA B 147 36.445 88.549 -8.016 1.00 17.72 C ATOM 8021 O ALA B 147 36.764 89.551 -8.643 1.00 17.62 O ATOM 8022 CB ALA B 147 34.558 87.097 -8.788 1.00 17.80 C ATOM 8023 HA ALA B 147 36.473 87.323 -9.750 1.00 0.00 H ATOM 8024 HB1 ALA B 147 34.306 86.209 -9.367 1.00 0.00 H ATOM 8025 HB2 ALA B 147 34.170 86.994 -7.774 1.00 0.00 H ATOM 8026 HB3 ALA B 147 34.118 87.976 -9.259 1.00 0.00 H ATOM 8027 H ALA B 147 36.063 85.297 -7.808 1.00 0.00 H ATOM 8028 N THR B 148 36.411 88.490 -6.691 1.00 18.06 N ATOM 8029 CA THR B 148 36.652 89.638 -5.825 1.00 18.12 C ATOM 8030 C THR B 148 38.099 90.174 -5.894 1.00 18.13 C ATOM 8031 O THR B 148 38.308 91.303 -6.325 1.00 18.45 O ATOM 8032 CB THR B 148 36.224 89.273 -4.381 1.00 18.35 C ATOM 8033 OG1 THR B 148 34.815 88.986 -4.366 1.00 19.09 O ATOM 8034 CG2 THR B 148 36.534 90.380 -3.379 1.00 18.35 C ATOM 8035 HA THR B 148 36.044 90.468 -6.185 1.00 0.00 H ATOM 8036 HB THR B 148 36.799 88.398 -4.077 1.00 0.00 H ATOM 8037 HG1 THR B 148 34.314 89.783 -4.671 1.00 0.00 H ATOM 8038 HG23 THR B 148 37.603 90.593 -3.394 1.00 0.00 H ATOM 8039 HG21 THR B 148 35.979 91.278 -3.649 1.00 0.00 H ATOM 8040 HG22 THR B 148 36.241 90.057 -2.380 1.00 0.00 H ATOM 8041 H THR B 148 36.201 87.574 -6.245 1.00 0.00 H ATOM 8042 N PRO B 149 39.103 89.379 -5.478 1.00 18.07 N ATOM 8043 CA PRO B 149 40.474 89.904 -5.525 1.00 17.92 C ATOM 8044 C PRO B 149 40.993 90.245 -6.928 1.00 17.83 C ATOM 8045 O PRO B 149 41.835 91.132 -7.068 1.00 17.60 O ATOM 8046 CB PRO B 149 41.307 88.773 -4.912 1.00 17.99 C ATOM 8047 CG PRO B 149 40.484 87.553 -5.090 1.00 18.34 C ATOM 8048 CD PRO B 149 39.069 88.005 -4.945 1.00 17.94 C ATOM 8049 HA PRO B 149 40.530 90.857 -4.999 1.00 0.00 H ATOM 8050 HD3 PRO B 149 38.395 87.376 -5.526 1.00 0.00 H ATOM 8051 HD2 PRO B 149 38.760 87.998 -3.900 1.00 0.00 H ATOM 8052 HG3 PRO B 149 40.728 86.813 -4.328 1.00 0.00 H ATOM 8053 HG2 PRO B 149 40.648 87.123 -6.078 1.00 0.00 H ATOM 8054 HB2 PRO B 149 42.260 88.673 -5.432 1.00 0.00 H ATOM 8055 HB3 PRO B 149 41.490 88.961 -3.854 1.00 0.00 H ATOM 8056 N PHE B 150 40.501 89.557 -7.955 1.00 17.69 N ATOM 8057 CA PHE B 150 40.895 89.875 -9.327 1.00 17.56 C ATOM 8058 C PHE B 150 40.070 91.032 -9.919 1.00 17.49 C ATOM 8059 O PHE B 150 40.215 91.364 -11.099 1.00 17.47 O ATOM 8060 CB PHE B 150 40.824 88.626 -10.213 1.00 17.62 C ATOM 8061 CG PHE B 150 41.897 87.601 -9.913 1.00 17.50 C ATOM 8062 CD1 PHE B 150 43.229 87.852 -10.234 1.00 18.14 C ATOM 8063 CD2 PHE B 150 41.578 86.373 -9.334 1.00 18.33 C ATOM 8064 CE1 PHE B 150 44.226 86.902 -9.971 1.00 17.42 C ATOM 8065 CE2 PHE B 150 42.572 85.418 -9.067 1.00 17.79 C ATOM 8066 CZ PHE B 150 43.892 85.688 -9.390 1.00 17.47 C ATOM 8067 HA PHE B 150 41.930 90.216 -9.297 1.00 0.00 H ATOM 8068 HB2 PHE B 150 39.851 88.157 -10.069 1.00 0.00 H ATOM 8069 HB3 PHE B 150 40.926 88.936 -11.253 1.00 0.00 H ATOM 8070 HD2 PHE B 150 40.540 86.151 -9.085 1.00 0.00 H ATOM 8071 HE2 PHE B 150 42.306 84.466 -8.607 1.00 0.00 H ATOM 8072 HZ PHE B 150 44.666 84.948 -9.188 1.00 0.00 H ATOM 8073 HE1 PHE B 150 45.264 87.118 -10.223 1.00 0.00 H ATOM 8074 HD1 PHE B 150 43.500 88.801 -10.696 1.00 0.00 H ATOM 8075 H PHE B 150 39.828 88.784 -7.780 1.00 0.00 H ATOM 8076 N LYS B 151 39.218 91.652 -9.101 1.00 17.39 N ATOM 8077 CA LYS B 151 38.462 92.836 -9.505 1.00 17.39 C ATOM 8078 C LYS B 151 37.607 92.554 -10.742 1.00 16.89 C ATOM 8079 O LYS B 151 37.523 93.380 -11.646 1.00 16.86 O ATOM 8080 CB LYS B 151 39.410 94.028 -9.757 1.00 18.22 C ATOM 8081 CG LYS B 151 39.729 94.886 -8.536 1.00 19.53 C ATOM 8082 CD LYS B 151 40.753 94.258 -7.623 1.00 21.40 C ATOM 8083 CE LYS B 151 41.206 95.250 -6.540 1.00 22.33 C ATOM 8084 NZ LYS B 151 41.969 96.421 -7.103 1.00 23.53 N ATOM 8085 HA LYS B 151 37.789 93.097 -8.688 1.00 0.00 H ATOM 8086 HB2 LYS B 151 40.349 93.634 -10.145 1.00 0.00 H ATOM 8087 HB3 LYS B 151 38.949 94.670 -10.508 1.00 0.00 H ATOM 8088 HG2 LYS B 151 40.112 95.848 -8.878 1.00 0.00 H ATOM 8089 HG3 LYS B 151 38.810 95.042 -7.971 1.00 0.00 H ATOM 8090 HD2 LYS B 151 40.315 93.382 -7.144 1.00 0.00 H ATOM 8091 HD3 LYS B 151 41.618 93.954 -8.212 1.00 0.00 H ATOM 8092 HE2 LYS B 151 41.847 94.724 -5.832 1.00 0.00 H ATOM 8093 HE3 LYS B 151 40.324 95.626 -6.021 1.00 0.00 H ATOM 8094 HZ1 LYS B 151 42.818 96.076 -7.594 1.00 0.00 H ATOM 8095 HZ2 LYS B 151 41.365 96.937 -7.774 1.00 0.00 H ATOM 8096 HZ3 LYS B 151 42.249 97.056 -6.328 1.00 0.00 H ATOM 8097 H LYS B 151 39.087 91.279 -8.139 1.00 0.00 H ATOM 8098 N ILE B 152 36.979 91.381 -10.784 1.00 16.37 N ATOM 8099 CA ILE B 152 36.177 90.996 -11.946 1.00 16.18 C ATOM 8100 C ILE B 152 34.851 91.746 -11.922 1.00 15.94 C ATOM 8101 O ILE B 152 34.167 91.785 -10.893 1.00 15.41 O ATOM 8102 CB ILE B 152 35.911 89.478 -12.001 1.00 15.99 C ATOM 8103 CG1 ILE B 152 37.221 88.694 -12.132 1.00 15.20 C ATOM 8104 CG2 ILE B 152 34.974 89.135 -13.162 1.00 16.19 C ATOM 8105 CD1 ILE B 152 38.085 89.051 -13.330 1.00 14.77 C ATOM 8106 HA ILE B 152 36.747 91.260 -12.837 1.00 0.00 H ATOM 8107 HB ILE B 152 35.430 89.190 -11.066 1.00 0.00 H ATOM 8108 HG12 ILE B 152 37.808 88.870 -11.231 1.00 0.00 H ATOM 8109 HG13 ILE B 152 36.972 87.635 -12.202 1.00 0.00 H ATOM 8110 HD11 ILE B 152 37.525 88.868 -14.247 1.00 0.00 H ATOM 8111 HD12 ILE B 152 38.362 90.104 -13.276 1.00 0.00 H ATOM 8112 HD13 ILE B 152 38.985 88.436 -13.323 1.00 0.00 H ATOM 8113 HG21 ILE B 152 34.026 89.655 -13.028 1.00 0.00 H ATOM 8114 HG22 ILE B 152 35.431 89.448 -14.101 1.00 0.00 H ATOM 8115 HG23 ILE B 152 34.800 88.059 -13.181 1.00 0.00 H ATOM 8116 H ILE B 152 37.060 90.728 -9.979 1.00 0.00 H ATOM 8117 N HIS B 153 34.506 92.355 -13.055 1.00 15.71 N ATOM 8118 CA HIS B 153 33.259 93.122 -13.167 1.00 15.72 C ATOM 8119 C HIS B 153 32.173 92.452 -14.020 1.00 15.34 C ATOM 8120 O HIS B 153 30.999 92.741 -13.833 1.00 14.78 O ATOM 8121 CB HIS B 153 33.558 94.542 -13.660 1.00 15.83 C ATOM 8122 CG HIS B 153 33.914 95.498 -12.562 1.00 15.85 C ATOM 8123 ND1 HIS B 153 33.803 96.865 -12.699 1.00 16.17 N ATOM 8124 CD2 HIS B 153 34.364 95.283 -11.303 1.00 16.42 C ATOM 8125 CE1 HIS B 153 34.173 97.451 -11.574 1.00 16.24 C ATOM 8126 NE2 HIS B 153 34.521 96.514 -10.712 1.00 16.34 N ATOM 8127 HA HIS B 153 32.837 93.163 -12.163 1.00 0.00 H ATOM 8128 HB2 HIS B 153 34.392 94.495 -14.360 1.00 0.00 H ATOM 8129 HB3 HIS B 153 32.675 94.921 -14.174 1.00 0.00 H ATOM 8130 HD2 HIS B 153 34.564 94.315 -10.844 1.00 0.00 H ATOM 8131 HE1 HIS B 153 34.188 98.525 -11.389 1.00 0.00 H ATOM 8132 H HIS B 153 35.135 92.286 -13.880 1.00 0.00 H ATOM 8133 N GLY B 154 32.547 91.539 -14.914 1.00 15.24 N ATOM 8134 CA GLY B 154 31.570 90.876 -15.794 1.00 15.29 C ATOM 8135 C GLY B 154 30.762 89.782 -15.112 1.00 15.16 C ATOM 8136 O GLY B 154 30.355 89.925 -13.961 1.00 14.78 O ATOM 8137 HA3 GLY B 154 32.109 90.433 -16.631 1.00 0.00 H ATOM 8138 HA2 GLY B 154 30.878 91.631 -16.168 1.00 0.00 H ATOM 8139 H GLY B 154 33.553 91.288 -14.993 1.00 0.00 H ATOM 8140 N VAL B 155 30.516 88.677 -15.813 1.00 15.26 N ATOM 8141 CA VAL B 155 29.823 87.553 -15.175 1.00 15.40 C ATOM 8142 C VAL B 155 30.693 86.969 -14.067 1.00 15.49 C ATOM 8143 O VAL B 155 31.923 87.037 -14.112 1.00 15.76 O ATOM 8144 CB VAL B 155 29.400 86.426 -16.151 1.00 15.40 C ATOM 8145 CG1 VAL B 155 28.464 86.968 -17.210 1.00 15.45 C ATOM 8146 CG2 VAL B 155 30.617 85.735 -16.781 1.00 15.50 C ATOM 8147 HA VAL B 155 28.899 87.965 -14.769 1.00 0.00 H ATOM 8148 HB VAL B 155 28.866 85.668 -15.578 1.00 0.00 H ATOM 8149 HG11 VAL B 155 27.574 87.377 -16.732 1.00 0.00 H ATOM 8150 HG12 VAL B 155 28.969 87.754 -17.772 1.00 0.00 H ATOM 8151 HG13 VAL B 155 28.177 86.163 -17.886 1.00 0.00 H ATOM 8152 HG21 VAL B 155 31.203 86.468 -17.335 1.00 0.00 H ATOM 8153 HG22 VAL B 155 31.232 85.296 -15.995 1.00 0.00 H ATOM 8154 HG23 VAL B 155 30.278 84.951 -17.459 1.00 0.00 H ATOM 8155 H VAL B 155 30.814 88.611 -16.807 1.00 0.00 H ATOM 8156 N ASN B 156 30.027 86.416 -13.066 1.00 15.50 N ATOM 8157 CA ASN B 156 30.686 85.843 -11.914 1.00 15.46 C ATOM 8158 C ASN B 156 29.732 84.816 -11.340 1.00 15.35 C ATOM 8159 O ASN B 156 28.775 85.178 -10.661 1.00 15.37 O ATOM 8160 CB ASN B 156 31.022 86.944 -10.896 1.00 15.54 C ATOM 8161 CG ASN B 156 31.369 86.404 -9.514 1.00 15.73 C ATOM 8162 OD1 ASN B 156 31.604 85.203 -9.328 1.00 17.70 O ATOM 8163 ND2 ASN B 156 31.403 87.297 -8.535 1.00 15.08 N ATOM 8164 HA ASN B 156 31.631 85.369 -12.180 1.00 0.00 H ATOM 8165 HB2 ASN B 156 31.874 87.512 -11.269 1.00 0.00 H ATOM 8166 HB3 ASN B 156 30.160 87.604 -10.803 1.00 0.00 H ATOM 8167 HD22 ASN B 156 31.199 88.297 -8.736 1.00 0.00 H ATOM 8168 HD21 ASN B 156 31.634 86.998 -7.566 1.00 0.00 H ATOM 8169 H ASN B 156 28.988 86.393 -13.110 1.00 0.00 H ATOM 8170 N TYR B 157 29.966 83.549 -11.665 1.00 15.24 N ATOM 8171 CA TYR B 157 29.239 82.445 -11.037 1.00 15.64 C ATOM 8172 C TYR B 157 29.921 81.113 -11.314 1.00 15.54 C ATOM 8173 O TYR B 157 30.855 81.036 -12.100 1.00 15.37 O ATOM 8174 CB TYR B 157 27.760 82.406 -11.468 1.00 15.97 C ATOM 8175 CG TYR B 157 27.491 82.419 -12.964 1.00 16.20 C ATOM 8176 CD1 TYR B 157 27.658 81.273 -13.734 1.00 16.18 C ATOM 8177 CD2 TYR B 157 27.017 83.569 -13.597 1.00 17.50 C ATOM 8178 CE1 TYR B 157 27.389 81.271 -15.098 1.00 16.49 C ATOM 8179 CE2 TYR B 157 26.742 83.579 -14.967 1.00 17.50 C ATOM 8180 CZ TYR B 157 26.933 82.424 -15.708 1.00 17.23 C ATOM 8181 OH TYR B 157 26.669 82.424 -17.058 1.00 17.90 O ATOM 8182 HA TYR B 157 29.257 82.621 -9.962 1.00 0.00 H ATOM 8183 HB3 TYR B 157 27.265 83.275 -11.034 1.00 0.00 H ATOM 8184 HB2 TYR B 157 27.319 81.497 -11.059 1.00 0.00 H ATOM 8185 HD2 TYR B 157 26.859 84.475 -13.012 1.00 0.00 H ATOM 8186 HE2 TYR B 157 26.380 84.488 -15.449 1.00 0.00 H ATOM 8187 HE1 TYR B 157 27.537 80.364 -15.684 1.00 0.00 H ATOM 8188 HD1 TYR B 157 28.007 80.357 -13.258 1.00 0.00 H ATOM 8189 HH TYR B 157 25.717 82.651 -17.207 1.00 0.00 H ATOM 8190 H TYR B 157 30.685 83.336 -12.385 1.00 0.00 H ATOM 8191 N SER B 158 29.453 80.070 -10.647 1.00 15.76 N ATOM 8192 CA SER B 158 30.009 78.741 -10.800 1.00 16.08 C ATOM 8193 C SER B 158 28.992 77.874 -11.504 1.00 16.46 C ATOM 8194 O SER B 158 27.803 77.964 -11.207 1.00 17.06 O ATOM 8195 CB SER B 158 30.326 78.153 -9.423 1.00 16.18 C ATOM 8196 OG SER B 158 31.222 78.984 -8.698 1.00 15.39 O ATOM 8197 HA SER B 158 30.929 78.785 -11.383 1.00 0.00 H ATOM 8198 HB2 SER B 158 30.779 77.170 -9.553 1.00 0.00 H ATOM 8199 HB3 SER B 158 29.399 78.053 -8.858 1.00 0.00 H ATOM 8200 HG SER B 158 32.068 79.075 -9.204 1.00 0.00 H ATOM 8201 H SER B 158 28.659 80.209 -9.990 1.00 0.00 H ATOM 8202 N ILE B 159 29.438 77.065 -12.460 1.00 16.67 N ATOM 8203 CA ILE B 159 28.644 75.928 -12.903 1.00 16.86 C ATOM 8204 C ILE B 159 29.055 74.773 -12.008 1.00 17.04 C ATOM 8205 O ILE B 159 30.196 74.716 -11.543 1.00 17.14 O ATOM 8206 CB ILE B 159 28.882 75.509 -14.381 1.00 17.05 C ATOM 8207 CG1 ILE B 159 28.801 76.700 -15.344 1.00 17.07 C ATOM 8208 CG2 ILE B 159 27.888 74.437 -14.794 1.00 16.81 C ATOM 8209 CD1 ILE B 159 27.513 77.462 -15.320 1.00 17.97 C ATOM 8210 HA ILE B 159 27.590 76.199 -12.841 1.00 0.00 H ATOM 8211 HB ILE B 159 29.894 75.109 -14.441 1.00 0.00 H ATOM 8212 HG12 ILE B 159 29.605 77.391 -15.092 1.00 0.00 H ATOM 8213 HG13 ILE B 159 28.950 76.324 -16.356 1.00 0.00 H ATOM 8214 HD11 ILE B 159 26.693 76.795 -15.585 1.00 0.00 H ATOM 8215 HD12 ILE B 159 27.348 77.863 -14.320 1.00 0.00 H ATOM 8216 HD13 ILE B 159 27.564 78.281 -16.037 1.00 0.00 H ATOM 8217 HG21 ILE B 159 28.010 73.564 -14.153 1.00 0.00 H ATOM 8218 HG22 ILE B 159 26.874 74.825 -14.693 1.00 0.00 H ATOM 8219 HG23 ILE B 159 28.069 74.156 -15.831 1.00 0.00 H ATOM 8220 H ILE B 159 30.364 77.246 -12.896 1.00 0.00 H ATOM 8221 N SER B 160 28.111 73.871 -11.752 1.00 17.26 N ATOM 8222 CA SER B 160 28.390 72.641 -11.026 1.00 17.13 C ATOM 8223 C SER B 160 27.655 71.464 -11.678 1.00 17.05 C ATOM 8224 O SER B 160 26.442 71.523 -11.929 1.00 16.71 O ATOM 8225 CB SER B 160 27.998 72.780 -9.560 1.00 17.29 C ATOM 8226 OG SER B 160 28.321 71.592 -8.855 1.00 18.82 O ATOM 8227 HA SER B 160 29.462 72.446 -11.070 1.00 0.00 H ATOM 8228 HB2 SER B 160 26.926 72.962 -9.489 1.00 0.00 H ATOM 8229 HB3 SER B 160 28.537 73.619 -9.120 1.00 0.00 H ATOM 8230 HG SER B 160 27.830 70.830 -9.253 1.00 0.00 H ATOM 8231 H SER B 160 27.141 74.051 -12.082 1.00 0.00 H ATOM 8232 N SER B 161 28.412 70.405 -11.951 1.00 16.81 N ATOM 8233 CA SER B 161 27.902 69.230 -12.634 1.00 17.03 C ATOM 8234 C SER B 161 28.808 68.016 -12.372 1.00 16.91 C ATOM 8235 O SER B 161 29.181 67.298 -13.301 1.00 16.91 O ATOM 8236 CB SER B 161 27.810 69.528 -14.132 1.00 16.80 C ATOM 8237 OG SER B 161 29.049 69.997 -14.620 1.00 17.38 O ATOM 8238 HA SER B 161 26.910 68.988 -12.253 1.00 0.00 H ATOM 8239 HB2 SER B 161 27.047 70.288 -14.301 1.00 0.00 H ATOM 8240 HB3 SER B 161 27.537 68.616 -14.663 1.00 0.00 H ATOM 8241 HG SER B 161 28.971 70.184 -15.589 1.00 0.00 H ATOM 8242 H SER B 161 29.411 70.419 -11.663 1.00 0.00 H ATOM 8243 N ALA B 162 29.163 67.806 -11.105 1.00 17.05 N ATOM 8244 CA ALA B 162 30.076 66.729 -10.704 1.00 17.26 C ATOM 8245 C ALA B 162 31.363 66.708 -11.559 1.00 17.46 C ATOM 8246 O ALA B 162 32.072 67.712 -11.627 1.00 17.31 O ATOM 8247 CB ALA B 162 29.343 65.377 -10.729 1.00 17.39 C ATOM 8248 HA ALA B 162 30.399 66.922 -9.681 1.00 0.00 H ATOM 8249 HB1 ALA B 162 28.501 65.409 -10.037 1.00 0.00 H ATOM 8250 HB2 ALA B 162 28.979 65.181 -11.738 1.00 0.00 H ATOM 8251 HB3 ALA B 162 30.031 64.586 -10.430 1.00 0.00 H ATOM 8252 H ALA B 162 28.777 68.432 -10.369 1.00 0.00 H ATOM 8253 N CYS B 163 31.650 65.595 -12.233 1.00 17.54 N ATOM 8254 CA CYS B 163 32.897 65.449 -12.990 1.00 17.76 C ATOM 8255 C CYS B 163 32.975 66.289 -14.265 1.00 17.22 C ATOM 8256 O CYS B 163 34.040 66.381 -14.876 1.00 17.60 O ATOM 8257 CB CYS B 163 33.099 63.990 -13.371 1.00 18.32 C ATOM 8258 SG CYS B 163 32.732 62.869 -12.031 1.00 23.40 S ATOM 8259 HA CYS B 163 33.679 65.813 -12.324 1.00 0.00 H ATOM 8260 HB2 CYS B 163 34.138 63.848 -13.670 1.00 0.00 H ATOM 8261 HB3 CYS B 163 32.445 63.755 -14.211 1.00 0.00 H ATOM 8262 HG CYS B 163 32.937 61.570 -12.450 1.00 0.00 H ATOM 8263 H CYS B 163 30.970 64.808 -12.222 1.00 0.00 H ATOM 8264 N ALA B 164 31.858 66.887 -14.671 1.00 16.31 N ATOM 8265 CA ALA B 164 31.809 67.716 -15.872 1.00 15.56 C ATOM 8266 C ALA B 164 31.942 69.195 -15.546 1.00 14.83 C ATOM 8267 O ALA B 164 32.000 70.030 -16.449 1.00 14.60 O ATOM 8268 CB ALA B 164 30.509 67.465 -16.615 1.00 15.55 C ATOM 8269 HA ALA B 164 32.655 67.440 -16.502 1.00 0.00 H ATOM 8270 HB1 ALA B 164 30.451 66.414 -16.898 1.00 0.00 H ATOM 8271 HB2 ALA B 164 29.668 67.715 -15.968 1.00 0.00 H ATOM 8272 HB3 ALA B 164 30.478 68.086 -17.510 1.00 0.00 H ATOM 8273 H ALA B 164 30.989 66.760 -14.113 1.00 0.00 H ATOM 8274 N THR B 165 32.001 69.503 -14.254 1.00 14.09 N ATOM 8275 CA THR B 165 31.902 70.870 -13.748 1.00 13.68 C ATOM 8276 C THR B 165 32.671 71.894 -14.593 1.00 13.11 C ATOM 8277 O THR B 165 32.069 72.773 -15.206 1.00 12.50 O ATOM 8278 CB THR B 165 32.367 70.926 -12.263 1.00 13.94 C ATOM 8279 OG1 THR B 165 31.471 70.151 -11.449 1.00 14.02 O ATOM 8280 CG2 THR B 165 32.374 72.330 -11.745 1.00 14.28 C ATOM 8281 HA THR B 165 30.851 71.151 -13.817 1.00 0.00 H ATOM 8282 HB THR B 165 33.380 70.525 -12.217 1.00 0.00 H ATOM 8283 HG1 THR B 165 31.473 69.211 -11.760 1.00 0.00 H ATOM 8284 HG23 THR B 165 33.049 72.936 -12.350 1.00 0.00 H ATOM 8285 HG21 THR B 165 31.366 72.741 -11.800 1.00 0.00 H ATOM 8286 HG22 THR B 165 32.712 72.332 -10.709 1.00 0.00 H ATOM 8287 H THR B 165 32.124 68.731 -13.568 1.00 0.00 H ATOM 8288 N SER B 166 33.998 71.765 -14.628 1.00 12.52 N ATOM 8289 CA SER B 166 34.866 72.777 -15.247 1.00 12.17 C ATOM 8290 C SER B 166 34.786 72.787 -16.774 1.00 11.61 C ATOM 8291 O SER B 166 35.122 73.785 -17.414 1.00 11.45 O ATOM 8292 CB SER B 166 36.319 72.594 -14.788 1.00 11.97 C ATOM 8293 OG SER B 166 36.742 71.250 -14.961 1.00 12.48 O ATOM 8294 HA SER B 166 34.498 73.746 -14.910 1.00 0.00 H ATOM 8295 HB2 SER B 166 36.396 72.859 -13.734 1.00 0.00 H ATOM 8296 HB3 SER B 166 36.963 73.249 -15.374 1.00 0.00 H ATOM 8297 HG SER B 166 36.162 70.651 -14.427 1.00 0.00 H ATOM 8298 H SER B 166 34.433 70.921 -14.204 1.00 0.00 H ATOM 8299 N ALA B 167 34.352 71.672 -17.348 1.00 11.10 N ATOM 8300 CA ALA B 167 34.075 71.590 -18.775 1.00 11.01 C ATOM 8301 C ALA B 167 32.875 72.462 -19.165 1.00 10.61 C ATOM 8302 O ALA B 167 32.928 73.179 -20.165 1.00 10.06 O ATOM 8303 CB ALA B 167 33.840 70.136 -19.180 1.00 10.56 C ATOM 8304 HA ALA B 167 34.944 71.971 -19.312 1.00 0.00 H ATOM 8305 HB1 ALA B 167 34.730 69.549 -18.953 1.00 0.00 H ATOM 8306 HB2 ALA B 167 32.989 69.739 -18.626 1.00 0.00 H ATOM 8307 HB3 ALA B 167 33.634 70.087 -20.249 1.00 0.00 H ATOM 8308 H ALA B 167 34.205 70.828 -16.758 1.00 0.00 H ATOM 8309 N HIS B 168 31.804 72.394 -18.374 1.00 10.72 N ATOM 8310 CA HIS B 168 30.618 73.230 -18.603 1.00 11.15 C ATOM 8311 C HIS B 168 30.947 74.697 -18.371 1.00 11.31 C ATOM 8312 O HIS B 168 30.353 75.578 -18.991 1.00 11.24 O ATOM 8313 CB HIS B 168 29.444 72.831 -17.697 1.00 11.11 C ATOM 8314 CG HIS B 168 28.740 71.582 -18.129 1.00 11.67 C ATOM 8315 ND1 HIS B 168 28.619 70.475 -17.315 1.00 11.66 N ATOM 8316 CD2 HIS B 168 28.116 71.267 -19.290 1.00 11.72 C ATOM 8317 CE1 HIS B 168 27.961 69.529 -17.961 1.00 11.47 C ATOM 8318 NE2 HIS B 168 27.644 69.984 -19.161 1.00 11.67 N ATOM 8319 HA HIS B 168 30.319 73.074 -19.639 1.00 0.00 H ATOM 8320 HB2 HIS B 168 29.826 72.678 -16.688 1.00 0.00 H ATOM 8321 HB3 HIS B 168 28.722 73.648 -17.691 1.00 0.00 H ATOM 8322 HD2 HIS B 168 28.009 71.911 -20.163 1.00 0.00 H ATOM 8323 HE1 HIS B 168 27.720 68.540 -17.571 1.00 0.00 H ATOM 8324 H HIS B 168 31.808 71.731 -17.573 1.00 0.00 H ATOM 8325 N CYS B 169 31.888 74.950 -17.465 1.00 11.50 N ATOM 8326 CA CYS B 169 32.360 76.297 -17.211 1.00 11.66 C ATOM 8327 C CYS B 169 32.984 76.884 -18.470 1.00 11.71 C ATOM 8328 O CYS B 169 32.699 78.020 -18.840 1.00 11.57 O ATOM 8329 CB CYS B 169 33.357 76.304 -16.056 1.00 11.79 C ATOM 8330 SG CYS B 169 32.579 76.160 -14.429 1.00 13.24 S ATOM 8331 HA CYS B 169 31.510 76.918 -16.929 1.00 0.00 H ATOM 8332 HB2 CYS B 169 33.917 77.238 -16.089 1.00 0.00 H ATOM 8333 HB3 CYS B 169 34.042 75.466 -16.186 1.00 0.00 H ATOM 8334 HG CYS B 169 31.875 74.975 -14.361 1.00 0.00 H ATOM 8335 H CYS B 169 32.296 74.160 -16.925 1.00 0.00 H ATOM 8336 N ILE B 170 33.819 76.095 -19.137 1.00 11.87 N ATOM 8337 CA ILE B 170 34.470 76.543 -20.359 1.00 12.24 C ATOM 8338 C ILE B 170 33.426 76.749 -21.461 1.00 12.62 C ATOM 8339 O ILE B 170 33.454 77.755 -22.171 1.00 12.66 O ATOM 8340 CB ILE B 170 35.565 75.549 -20.809 1.00 12.05 C ATOM 8341 CG1 ILE B 170 36.726 75.571 -19.806 1.00 11.78 C ATOM 8342 CG2 ILE B 170 36.062 75.890 -22.213 1.00 11.90 C ATOM 8343 CD1 ILE B 170 37.709 74.436 -19.969 1.00 11.84 C ATOM 8344 HA ILE B 170 34.961 77.496 -20.160 1.00 0.00 H ATOM 8345 HB ILE B 170 35.139 74.546 -20.838 1.00 0.00 H ATOM 8346 HG12 ILE B 170 37.265 76.510 -19.928 1.00 0.00 H ATOM 8347 HG13 ILE B 170 36.310 75.521 -18.800 1.00 0.00 H ATOM 8348 HD11 ILE B 170 37.191 73.486 -19.837 1.00 0.00 H ATOM 8349 HD12 ILE B 170 38.147 74.477 -20.966 1.00 0.00 H ATOM 8350 HD13 ILE B 170 38.496 74.529 -19.221 1.00 0.00 H ATOM 8351 HG21 ILE B 170 35.229 75.838 -22.914 1.00 0.00 H ATOM 8352 HG22 ILE B 170 36.478 76.897 -22.215 1.00 0.00 H ATOM 8353 HG23 ILE B 170 36.832 75.177 -22.508 1.00 0.00 H ATOM 8354 H ILE B 170 34.011 75.138 -18.779 1.00 0.00 H ATOM 8355 N GLY B 171 32.507 75.795 -21.590 1.00 12.89 N ATOM 8356 CA GLY B 171 31.440 75.886 -22.576 1.00 13.17 C ATOM 8357 C GLY B 171 30.564 77.110 -22.371 1.00 13.35 C ATOM 8358 O GLY B 171 30.200 77.794 -23.330 1.00 13.18 O ATOM 8359 HA3 GLY B 171 30.818 74.994 -22.502 1.00 0.00 H ATOM 8360 HA2 GLY B 171 31.885 75.936 -23.570 1.00 0.00 H ATOM 8361 H GLY B 171 32.552 74.962 -20.969 1.00 0.00 H ATOM 8362 N ASN B 172 30.223 77.383 -21.118 1.00 13.58 N ATOM 8363 CA ASN B 172 29.417 78.552 -20.792 1.00 14.02 C ATOM 8364 C ASN B 172 30.152 79.856 -21.060 1.00 13.89 C ATOM 8365 O ASN B 172 29.541 80.823 -21.501 1.00 13.72 O ATOM 8366 CB ASN B 172 28.922 78.501 -19.346 1.00 14.56 C ATOM 8367 CG ASN B 172 27.562 77.845 -19.225 1.00 16.96 C ATOM 8368 OD1 ASN B 172 26.547 78.526 -19.036 1.00 20.44 O ATOM 8369 ND2 ASN B 172 27.528 76.517 -19.350 1.00 19.32 N ATOM 8370 HA ASN B 172 28.552 78.526 -21.454 1.00 0.00 H ATOM 8371 HB2 ASN B 172 29.638 77.935 -18.750 1.00 0.00 H ATOM 8372 HB3 ASN B 172 28.856 79.519 -18.962 1.00 0.00 H ATOM 8373 HD22 ASN B 172 28.409 75.987 -19.508 1.00 0.00 H ATOM 8374 HD21 ASN B 172 26.621 76.012 -19.289 1.00 0.00 H ATOM 8375 H ASN B 172 30.537 76.751 -20.354 1.00 0.00 H ATOM 8376 N ALA B 173 31.460 79.881 -20.797 1.00 13.85 N ATOM 8377 CA ALA B 173 32.305 81.024 -21.176 1.00 13.60 C ATOM 8378 C ALA B 173 32.238 81.294 -22.678 1.00 13.54 C ATOM 8379 O ALA B 173 32.106 82.433 -23.103 1.00 13.10 O ATOM 8380 CB ALA B 173 33.741 80.781 -20.752 1.00 13.47 C ATOM 8381 HA ALA B 173 31.925 81.905 -20.659 1.00 0.00 H ATOM 8382 HB1 ALA B 173 33.782 80.651 -19.671 1.00 0.00 H ATOM 8383 HB2 ALA B 173 34.116 79.883 -21.242 1.00 0.00 H ATOM 8384 HB3 ALA B 173 34.353 81.636 -21.040 1.00 0.00 H ATOM 8385 H ALA B 173 31.894 79.070 -20.311 1.00 0.00 H ATOM 8386 N VAL B 174 32.327 80.234 -23.477 1.00 13.87 N ATOM 8387 CA VAL B 174 32.226 80.344 -24.933 1.00 14.05 C ATOM 8388 C VAL B 174 30.896 81.000 -25.328 1.00 14.31 C ATOM 8389 O VAL B 174 30.871 81.942 -26.123 1.00 14.09 O ATOM 8390 CB VAL B 174 32.387 78.951 -25.619 1.00 13.89 C ATOM 8391 CG1 VAL B 174 32.165 79.037 -27.129 1.00 14.08 C ATOM 8392 CG2 VAL B 174 33.774 78.379 -25.354 1.00 13.59 C ATOM 8393 HA VAL B 174 33.041 80.978 -25.283 1.00 0.00 H ATOM 8394 HB VAL B 174 31.629 78.295 -25.190 1.00 0.00 H ATOM 8395 HG11 VAL B 174 31.158 79.404 -27.327 1.00 0.00 H ATOM 8396 HG12 VAL B 174 32.894 79.721 -27.564 1.00 0.00 H ATOM 8397 HG13 VAL B 174 32.286 78.047 -27.570 1.00 0.00 H ATOM 8398 HG21 VAL B 174 34.528 79.058 -25.752 1.00 0.00 H ATOM 8399 HG22 VAL B 174 33.919 78.263 -24.280 1.00 0.00 H ATOM 8400 HG23 VAL B 174 33.864 77.408 -25.841 1.00 0.00 H ATOM 8401 H VAL B 174 32.473 79.296 -23.053 1.00 0.00 H ATOM 8402 N GLU B 175 29.802 80.511 -24.750 1.00 14.87 N ATOM 8403 CA GLU B 175 28.461 81.075 -24.972 1.00 15.45 C ATOM 8404 C GLU B 175 28.376 82.574 -24.658 1.00 15.57 C ATOM 8405 O GLU B 175 27.680 83.314 -25.355 1.00 15.21 O ATOM 8406 CB GLU B 175 27.413 80.314 -24.144 1.00 15.36 C ATOM 8407 CG GLU B 175 27.181 78.861 -24.594 1.00 16.40 C ATOM 8408 CD GLU B 175 26.126 78.129 -23.758 1.00 17.12 C ATOM 8409 OE1 GLU B 175 25.853 78.544 -22.609 1.00 19.76 O ATOM 8410 OE2 GLU B 175 25.567 77.125 -24.255 1.00 20.22 O ATOM 8411 HA GLU B 175 28.254 80.957 -26.036 1.00 0.00 H ATOM 8412 HB2 GLU B 175 27.743 80.301 -23.105 1.00 0.00 H ATOM 8413 HB3 GLU B 175 26.466 80.849 -24.217 1.00 0.00 H ATOM 8414 HG2 GLU B 175 26.855 78.868 -25.634 1.00 0.00 H ATOM 8415 HG3 GLU B 175 28.123 78.319 -24.514 1.00 0.00 H ATOM 8416 H GLU B 175 29.899 79.694 -24.113 1.00 0.00 H ATOM 8417 N GLN B 176 29.067 83.013 -23.606 1.00 15.91 N ATOM 8418 CA GLN B 176 29.102 84.433 -23.251 1.00 16.56 C ATOM 8419 C GLN B 176 29.775 85.268 -24.334 1.00 16.91 C ATOM 8420 O GLN B 176 29.336 86.383 -24.633 1.00 17.09 O ATOM 8421 CB GLN B 176 29.812 84.645 -21.911 1.00 16.76 C ATOM 8422 CG GLN B 176 29.026 84.120 -20.721 1.00 17.84 C ATOM 8423 CD GLN B 176 27.686 84.809 -20.581 1.00 19.28 C ATOM 8424 OE1 GLN B 176 27.616 86.040 -20.497 1.00 20.44 O ATOM 8425 NE2 GLN B 176 26.612 84.023 -20.575 1.00 18.59 N ATOM 8426 HA GLN B 176 28.068 84.766 -23.160 1.00 0.00 H ATOM 8427 HB2 GLN B 176 30.773 84.132 -21.944 1.00 0.00 H ATOM 8428 HB3 GLN B 176 29.977 85.714 -21.772 1.00 0.00 H ATOM 8429 HG2 GLN B 176 28.861 83.051 -20.852 1.00 0.00 H ATOM 8430 HG3 GLN B 176 29.606 84.289 -19.813 1.00 0.00 H ATOM 8431 HE22 GLN B 176 26.722 82.991 -20.648 1.00 0.00 H ATOM 8432 HE21 GLN B 176 25.663 84.440 -20.497 1.00 0.00 H ATOM 8433 H GLN B 176 29.594 82.331 -23.024 1.00 0.00 H ATOM 8434 N ILE B 177 30.846 84.725 -24.906 1.00 17.28 N ATOM 8435 CA ILE B 177 31.502 85.318 -26.066 1.00 17.55 C ATOM 8436 C ILE B 177 30.584 85.277 -27.298 1.00 17.71 C ATOM 8437 O ILE B 177 30.422 86.287 -27.986 1.00 17.69 O ATOM 8438 CB ILE B 177 32.851 84.605 -26.377 1.00 17.67 C ATOM 8439 CG1 ILE B 177 34.000 85.269 -25.618 1.00 18.46 C ATOM 8440 CG2 ILE B 177 33.160 84.613 -27.874 1.00 17.85 C ATOM 8441 CD1 ILE B 177 34.148 84.804 -24.221 1.00 19.29 C ATOM 8442 HA ILE B 177 31.713 86.360 -25.825 1.00 0.00 H ATOM 8443 HB ILE B 177 32.750 83.570 -26.050 1.00 0.00 H ATOM 8444 HG12 ILE B 177 34.928 85.059 -26.149 1.00 0.00 H ATOM 8445 HG13 ILE B 177 33.826 86.345 -25.605 1.00 0.00 H ATOM 8446 HD11 ILE B 177 33.232 85.017 -23.670 1.00 0.00 H ATOM 8447 HD12 ILE B 177 34.336 83.730 -24.215 1.00 0.00 H ATOM 8448 HD13 ILE B 177 34.984 85.323 -23.753 1.00 0.00 H ATOM 8449 HG21 ILE B 177 32.365 84.095 -28.411 1.00 0.00 H ATOM 8450 HG22 ILE B 177 33.226 85.643 -28.225 1.00 0.00 H ATOM 8451 HG23 ILE B 177 34.109 84.106 -28.051 1.00 0.00 H ATOM 8452 H ILE B 177 31.231 83.843 -24.511 1.00 0.00 H ATOM 8453 N GLN B 178 29.999 84.114 -27.576 1.00 17.69 N ATOM 8454 CA GLN B 178 29.118 83.962 -28.739 1.00 17.97 C ATOM 8455 C GLN B 178 27.926 84.927 -28.703 1.00 18.00 C ATOM 8456 O GLN B 178 27.489 85.412 -29.741 1.00 18.56 O ATOM 8457 CB GLN B 178 28.596 82.528 -28.842 1.00 17.96 C ATOM 8458 CG GLN B 178 29.634 81.503 -29.283 1.00 18.05 C ATOM 8459 CD GLN B 178 29.058 80.094 -29.341 1.00 18.42 C ATOM 8460 OE1 GLN B 178 28.047 79.796 -28.697 1.00 17.84 O ATOM 8461 NE2 GLN B 178 29.704 79.219 -30.106 1.00 17.74 N ATOM 8462 HA GLN B 178 29.723 84.201 -29.614 1.00 0.00 H ATOM 8463 HB2 GLN B 178 28.221 82.232 -27.862 1.00 0.00 H ATOM 8464 HB3 GLN B 178 27.778 82.515 -29.562 1.00 0.00 H ATOM 8465 HG2 GLN B 178 29.999 81.775 -30.273 1.00 0.00 H ATOM 8466 HG3 GLN B 178 30.463 81.515 -28.576 1.00 0.00 H ATOM 8467 HE22 GLN B 178 30.552 79.514 -30.631 1.00 0.00 H ATOM 8468 HE21 GLN B 178 29.361 78.240 -30.179 1.00 0.00 H ATOM 8469 H GLN B 178 30.170 83.297 -26.956 1.00 0.00 H ATOM 8470 N LEU B 179 27.410 85.196 -27.506 1.00 17.87 N ATOM 8471 CA LEU B 179 26.280 86.101 -27.322 1.00 17.78 C ATOM 8472 C LEU B 179 26.692 87.568 -27.344 1.00 17.52 C ATOM 8473 O LEU B 179 25.843 88.448 -27.219 1.00 17.45 O ATOM 8474 CB LEU B 179 25.577 85.802 -25.998 1.00 18.04 C ATOM 8475 CG LEU B 179 24.694 84.552 -25.982 1.00 19.20 C ATOM 8476 CD1 LEU B 179 24.412 84.125 -24.552 1.00 20.08 C ATOM 8477 CD2 LEU B 179 23.388 84.798 -26.741 1.00 19.94 C ATOM 8478 HA LEU B 179 25.604 85.931 -28.160 1.00 0.00 H ATOM 8479 HB2 LEU B 179 26.343 85.681 -25.232 1.00 0.00 H ATOM 8480 HB3 LEU B 179 24.950 86.658 -25.751 1.00 0.00 H ATOM 8481 HG LEU B 179 25.229 83.746 -26.485 1.00 0.00 H ATOM 8482 HD21 LEU B 179 22.845 85.618 -26.271 1.00 0.00 H ATOM 8483 HD22 LEU B 179 23.614 85.056 -27.776 1.00 0.00 H ATOM 8484 HD23 LEU B 179 22.778 83.895 -26.715 1.00 0.00 H ATOM 8485 HD11 LEU B 179 25.353 83.904 -24.048 1.00 0.00 H ATOM 8486 HD12 LEU B 179 23.899 84.931 -24.028 1.00 0.00 H ATOM 8487 HD13 LEU B 179 23.783 83.235 -24.557 1.00 0.00 H ATOM 8488 H LEU B 179 27.829 84.743 -26.669 1.00 0.00 H ATOM 8489 N GLY B 180 27.989 87.825 -27.488 1.00 17.10 N ATOM 8490 CA GLY B 180 28.525 89.182 -27.460 1.00 16.87 C ATOM 8491 C GLY B 180 28.524 89.880 -26.106 1.00 16.43 C ATOM 8492 O GLY B 180 28.715 91.089 -26.056 1.00 16.20 O ATOM 8493 HA3 GLY B 180 27.933 89.787 -28.147 1.00 0.00 H ATOM 8494 HA2 GLY B 180 29.556 89.140 -27.811 1.00 0.00 H ATOM 8495 H GLY B 180 28.645 87.030 -27.626 1.00 0.00 H ATOM 8496 N LYS B 181 28.327 89.142 -25.012 1.00 16.03 N ATOM 8497 CA LYS B 181 28.247 89.760 -23.677 1.00 16.34 C ATOM 8498 C LYS B 181 29.601 90.031 -23.003 1.00 15.93 C ATOM 8499 O LYS B 181 29.696 90.882 -22.114 1.00 15.77 O ATOM 8500 CB LYS B 181 27.400 88.901 -22.742 1.00 16.57 C ATOM 8501 CG LYS B 181 25.949 88.771 -23.163 1.00 17.22 C ATOM 8502 CD LYS B 181 25.182 87.975 -22.131 1.00 17.34 C ATOM 8503 CE LYS B 181 23.695 88.014 -22.376 1.00 17.64 C ATOM 8504 NZ LYS B 181 22.972 87.497 -21.189 1.00 18.59 N ATOM 8505 HA LYS B 181 27.788 90.733 -23.852 1.00 0.00 H ATOM 8506 HB2 LYS B 181 27.836 87.903 -22.705 1.00 0.00 H ATOM 8507 HB3 LYS B 181 27.429 89.346 -21.748 1.00 0.00 H ATOM 8508 HG2 LYS B 181 25.509 89.764 -23.254 1.00 0.00 H ATOM 8509 HG3 LYS B 181 25.896 88.262 -24.125 1.00 0.00 H ATOM 8510 HD2 LYS B 181 25.517 86.938 -22.166 1.00 0.00 H ATOM 8511 HD3 LYS B 181 25.387 88.389 -21.144 1.00 0.00 H ATOM 8512 HE2 LYS B 181 23.455 87.397 -23.242 1.00 0.00 H ATOM 8513 HE3 LYS B 181 23.387 89.042 -22.567 1.00 0.00 H ATOM 8514 HZ1 LYS B 181 23.264 86.516 -21.007 1.00 0.00 H ATOM 8515 HZ2 LYS B 181 23.199 88.086 -20.363 1.00 0.00 H ATOM 8516 HZ3 LYS B 181 21.948 87.528 -21.368 1.00 0.00 H ATOM 8517 H LYS B 181 28.228 88.111 -25.103 1.00 0.00 H ATOM 8518 N GLN B 182 30.630 89.292 -23.409 1.00 15.64 N ATOM 8519 CA GLN B 182 31.954 89.380 -22.805 1.00 15.19 C ATOM 8520 C GLN B 182 33.030 89.245 -23.887 1.00 15.11 C ATOM 8521 O GLN B 182 32.841 88.545 -24.884 1.00 15.17 O ATOM 8522 CB GLN B 182 32.133 88.273 -21.758 1.00 14.98 C ATOM 8523 CG GLN B 182 31.046 88.180 -20.671 1.00 14.06 C ATOM 8524 CD GLN B 182 31.287 89.107 -19.492 1.00 13.46 C ATOM 8525 OE1 GLN B 182 31.775 88.676 -18.445 1.00 13.00 O ATOM 8526 NE2 GLN B 182 30.968 90.388 -19.659 1.00 11.87 N ATOM 8527 HA GLN B 182 32.053 90.349 -22.317 1.00 0.00 H ATOM 8528 HB2 GLN B 182 32.159 87.319 -22.284 1.00 0.00 H ATOM 8529 HB3 GLN B 182 33.088 88.438 -21.260 1.00 0.00 H ATOM 8530 HG2 GLN B 182 30.086 88.435 -21.120 1.00 0.00 H ATOM 8531 HG3 GLN B 182 31.013 87.155 -20.303 1.00 0.00 H ATOM 8532 HE22 GLN B 182 30.558 90.709 -20.559 1.00 0.00 H ATOM 8533 HE21 GLN B 182 31.128 91.068 -18.889 1.00 0.00 H ATOM 8534 H GLN B 182 30.484 88.622 -24.191 1.00 0.00 H ATOM 8535 N ASP B 183 34.151 89.935 -23.695 1.00 15.17 N ATOM 8536 CA ASP B 183 35.332 89.779 -24.551 1.00 15.02 C ATOM 8537 C ASP B 183 36.259 88.715 -23.991 1.00 14.50 C ATOM 8538 O ASP B 183 36.939 88.023 -24.745 1.00 14.29 O ATOM 8539 CB ASP B 183 36.118 91.086 -24.635 1.00 15.54 C ATOM 8540 CG ASP B 183 35.333 92.205 -25.275 1.00 17.26 C ATOM 8541 OD1 ASP B 183 34.463 91.919 -26.122 1.00 19.42 O ATOM 8542 OD2 ASP B 183 35.593 93.381 -24.924 1.00 20.56 O ATOM 8543 HA ASP B 183 34.979 89.491 -25.541 1.00 0.00 H ATOM 8544 HB2 ASP B 183 36.397 91.390 -23.626 1.00 0.00 H ATOM 8545 HB3 ASP B 183 37.019 90.913 -25.223 1.00 0.00 H ATOM 8546 H ASP B 183 34.192 90.612 -22.907 1.00 0.00 H ATOM 8547 N ILE B 184 36.310 88.624 -22.663 1.00 14.14 N ATOM 8548 CA ILE B 184 37.132 87.640 -21.957 1.00 14.10 C ATOM 8549 C ILE B 184 36.330 87.019 -20.818 1.00 13.91 C ATOM 8550 O ILE B 184 35.646 87.727 -20.070 1.00 13.74 O ATOM 8551 CB ILE B 184 38.426 88.283 -21.372 1.00 13.99 C ATOM 8552 CG1 ILE B 184 39.399 88.660 -22.492 1.00 14.19 C ATOM 8553 CG2 ILE B 184 39.125 87.340 -20.392 1.00 14.15 C ATOM 8554 CD1 ILE B 184 40.486 89.621 -22.060 1.00 14.30 C ATOM 8555 HA ILE B 184 37.422 86.876 -22.678 1.00 0.00 H ATOM 8556 HB ILE B 184 38.124 89.183 -20.836 1.00 0.00 H ATOM 8557 HG12 ILE B 184 39.871 87.749 -22.858 1.00 0.00 H ATOM 8558 HG13 ILE B 184 38.831 89.123 -23.299 1.00 0.00 H ATOM 8559 HD11 ILE B 184 40.031 90.544 -21.701 1.00 0.00 H ATOM 8560 HD12 ILE B 184 41.072 89.169 -21.260 1.00 0.00 H ATOM 8561 HD13 ILE B 184 41.134 89.839 -22.909 1.00 0.00 H ATOM 8562 HG21 ILE B 184 38.450 87.109 -19.568 1.00 0.00 H ATOM 8563 HG22 ILE B 184 39.399 86.420 -20.908 1.00 0.00 H ATOM 8564 HG23 ILE B 184 40.023 87.821 -20.004 1.00 0.00 H ATOM 8565 H ILE B 184 35.737 89.285 -22.100 1.00 0.00 H ATOM 8566 N VAL B 185 36.417 85.693 -20.706 1.00 13.67 N ATOM 8567 CA VAL B 185 35.902 84.964 -19.552 1.00 13.54 C ATOM 8568 C VAL B 185 36.965 83.985 -19.065 1.00 13.46 C ATOM 8569 O VAL B 185 37.414 83.115 -19.816 1.00 13.73 O ATOM 8570 CB VAL B 185 34.620 84.167 -19.892 1.00 13.62 C ATOM 8571 CG1 VAL B 185 34.165 83.338 -18.692 1.00 13.78 C ATOM 8572 CG2 VAL B 185 33.502 85.104 -20.340 1.00 13.82 C ATOM 8573 HA VAL B 185 35.655 85.696 -18.783 1.00 0.00 H ATOM 8574 HB VAL B 185 34.853 83.490 -20.714 1.00 0.00 H ATOM 8575 HG11 VAL B 185 34.953 82.637 -18.416 1.00 0.00 H ATOM 8576 HG12 VAL B 185 33.956 84.001 -17.852 1.00 0.00 H ATOM 8577 HG13 VAL B 185 33.262 82.786 -18.954 1.00 0.00 H ATOM 8578 HG21 VAL B 185 33.277 85.808 -19.539 1.00 0.00 H ATOM 8579 HG22 VAL B 185 33.822 85.651 -21.227 1.00 0.00 H ATOM 8580 HG23 VAL B 185 32.612 84.520 -20.573 1.00 0.00 H ATOM 8581 H VAL B 185 36.871 85.157 -21.473 1.00 0.00 H ATOM 8582 N PHE B 186 37.368 84.138 -17.812 1.00 13.09 N ATOM 8583 CA PHE B 186 38.231 83.170 -17.165 1.00 13.09 C ATOM 8584 C PHE B 186 37.358 81.996 -16.782 1.00 12.94 C ATOM 8585 O PHE B 186 36.352 82.171 -16.090 1.00 12.95 O ATOM 8586 CB PHE B 186 38.893 83.770 -15.924 1.00 13.17 C ATOM 8587 CG PHE B 186 39.767 84.950 -16.225 1.00 12.83 C ATOM 8588 CD1 PHE B 186 39.277 86.245 -16.106 1.00 13.01 C ATOM 8589 CD2 PHE B 186 41.067 84.767 -16.652 1.00 12.82 C ATOM 8590 CE1 PHE B 186 40.082 87.336 -16.385 1.00 13.00 C ATOM 8591 CE2 PHE B 186 41.875 85.850 -16.943 1.00 13.42 C ATOM 8592 CZ PHE B 186 41.379 87.140 -16.808 1.00 13.40 C ATOM 8593 HA PHE B 186 39.033 82.862 -17.836 1.00 0.00 H ATOM 8594 HB2 PHE B 186 38.111 84.087 -15.234 1.00 0.00 H ATOM 8595 HB3 PHE B 186 39.503 83.000 -15.451 1.00 0.00 H ATOM 8596 HD2 PHE B 186 41.461 83.757 -16.761 1.00 0.00 H ATOM 8597 HE2 PHE B 186 42.900 85.692 -17.278 1.00 0.00 H ATOM 8598 HZ PHE B 186 42.014 87.996 -17.036 1.00 0.00 H ATOM 8599 HE1 PHE B 186 39.691 88.347 -16.270 1.00 0.00 H ATOM 8600 HD1 PHE B 186 38.246 86.404 -15.789 1.00 0.00 H ATOM 8601 H PHE B 186 37.057 84.975 -17.279 1.00 0.00 H ATOM 8602 N ALA B 187 37.725 80.814 -17.262 1.00 12.56 N ATOM 8603 CA ALA B 187 36.930 79.612 -17.049 1.00 12.88 C ATOM 8604 C ALA B 187 37.806 78.504 -16.507 1.00 12.91 C ATOM 8605 O ALA B 187 38.934 78.313 -16.964 1.00 13.06 O ATOM 8606 CB ALA B 187 36.285 79.168 -18.341 1.00 12.65 C ATOM 8607 HA ALA B 187 36.146 79.838 -16.326 1.00 0.00 H ATOM 8608 HB1 ALA B 187 35.636 79.961 -18.713 1.00 0.00 H ATOM 8609 HB2 ALA B 187 37.059 78.955 -19.078 1.00 0.00 H ATOM 8610 HB3 ALA B 187 35.696 78.269 -18.161 1.00 0.00 H ATOM 8611 H ALA B 187 38.608 80.744 -17.807 1.00 0.00 H ATOM 8612 N GLY B 188 37.287 77.783 -15.524 1.00 13.21 N ATOM 8613 CA GLY B 188 37.971 76.613 -14.996 1.00 13.24 C ATOM 8614 C GLY B 188 37.327 76.104 -13.724 1.00 13.33 C ATOM 8615 O GLY B 188 36.107 76.080 -13.601 1.00 13.22 O ATOM 8616 HA3 GLY B 188 39.007 76.877 -14.785 1.00 0.00 H ATOM 8617 HA2 GLY B 188 37.944 75.822 -15.745 1.00 0.00 H ATOM 8618 H GLY B 188 36.369 78.060 -15.121 1.00 0.00 H ATOM 8619 N GLY B 189 38.155 75.680 -12.780 1.00 13.41 N ATOM 8620 CA GLY B 189 37.651 75.147 -11.531 1.00 13.57 C ATOM 8621 C GLY B 189 38.747 74.670 -10.609 1.00 13.58 C ATOM 8622 O GLY B 189 39.925 74.743 -10.940 1.00 13.65 O ATOM 8623 HA3 GLY B 189 36.992 74.307 -11.752 1.00 0.00 H ATOM 8624 HA2 GLY B 189 37.085 75.928 -11.023 1.00 0.00 H ATOM 8625 H GLY B 189 39.182 75.731 -12.938 1.00 0.00 H ATOM 8626 N GLY B 190 38.342 74.193 -9.442 1.00 13.76 N ATOM 8627 CA GLY B 190 39.261 73.607 -8.477 1.00 14.01 C ATOM 8628 C GLY B 190 38.578 72.515 -7.678 1.00 14.10 C ATOM 8629 O GLY B 190 37.350 72.397 -7.689 1.00 13.49 O ATOM 8630 HA3 GLY B 190 39.608 74.384 -7.796 1.00 0.00 H ATOM 8631 HA2 GLY B 190 40.114 73.182 -9.007 1.00 0.00 H ATOM 8632 H GLY B 190 37.330 74.239 -9.206 1.00 0.00 H ATOM 8633 N GLU B 191 39.371 71.700 -6.994 1.00 14.57 N ATOM 8634 CA GLU B 191 38.809 70.679 -6.127 1.00 14.81 C ATOM 8635 C GLU B 191 39.747 70.369 -4.987 1.00 14.98 C ATOM 8636 O GLU B 191 40.942 70.135 -5.205 1.00 14.73 O ATOM 8637 CB GLU B 191 38.522 69.399 -6.909 1.00 14.99 C ATOM 8638 CG GLU B 191 37.465 68.524 -6.246 1.00 15.78 C ATOM 8639 CD GLU B 191 36.050 69.065 -6.427 1.00 17.89 C ATOM 8640 OE1 GLU B 191 35.340 69.260 -5.412 1.00 19.96 O ATOM 8641 OE2 GLU B 191 35.647 69.291 -7.586 1.00 17.25 O ATOM 8642 HA GLU B 191 37.873 71.067 -5.724 1.00 0.00 H ATOM 8643 HB2 GLU B 191 38.174 69.670 -7.906 1.00 0.00 H ATOM 8644 HB3 GLU B 191 39.446 68.827 -6.991 1.00 0.00 H ATOM 8645 HG2 GLU B 191 37.515 67.526 -6.682 1.00 0.00 H ATOM 8646 HG3 GLU B 191 37.681 68.464 -5.179 1.00 0.00 H ATOM 8647 H GLU B 191 40.403 71.793 -7.079 1.00 0.00 H ATOM 8648 N GLU B 192 39.204 70.363 -3.771 1.00 15.07 N ATOM 8649 CA GLU B 192 39.981 69.945 -2.611 1.00 15.41 C ATOM 8650 C GLU B 192 40.116 68.425 -2.587 1.00 15.45 C ATOM 8651 O GLU B 192 39.319 67.704 -3.194 1.00 15.09 O ATOM 8652 CB GLU B 192 39.383 70.474 -1.296 1.00 15.29 C ATOM 8653 CG GLU B 192 38.091 69.818 -0.829 1.00 15.72 C ATOM 8654 CD GLU B 192 37.555 70.428 0.467 1.00 15.64 C ATOM 8655 OE1 GLU B 192 37.810 71.626 0.728 1.00 15.97 O ATOM 8656 OE2 GLU B 192 36.869 69.707 1.222 1.00 15.10 O ATOM 8657 HA GLU B 192 40.976 70.381 -2.700 1.00 0.00 H ATOM 8658 HB2 GLU B 192 40.128 70.335 -0.513 1.00 0.00 H ATOM 8659 HB3 GLU B 192 39.187 71.539 -1.425 1.00 0.00 H ATOM 8660 HG2 GLU B 192 37.338 69.936 -1.608 1.00 0.00 H ATOM 8661 HG3 GLU B 192 38.278 68.757 -0.664 1.00 0.00 H ATOM 8662 H GLU B 192 38.215 70.660 -3.648 1.00 0.00 H ATOM 8663 N LEU B 193 41.148 67.965 -1.887 1.00 15.68 N ATOM 8664 CA LEU B 193 41.423 66.552 -1.713 1.00 16.05 C ATOM 8665 C LEU B 193 41.408 66.244 -0.222 1.00 16.22 C ATOM 8666 O LEU B 193 42.237 66.748 0.526 1.00 16.50 O ATOM 8667 CB LEU B 193 42.788 66.225 -2.314 1.00 16.06 C ATOM 8668 CG LEU B 193 43.270 64.776 -2.278 1.00 16.06 C ATOM 8669 CD1 LEU B 193 42.259 63.809 -2.882 1.00 16.47 C ATOM 8670 CD2 LEU B 193 44.596 64.686 -3.013 1.00 15.95 C ATOM 8671 HA LEU B 193 40.670 65.947 -2.218 1.00 0.00 H ATOM 8672 HB2 LEU B 193 42.761 66.530 -3.360 1.00 0.00 H ATOM 8673 HB3 LEU B 193 43.527 66.824 -1.781 1.00 0.00 H ATOM 8674 HG LEU B 193 43.392 64.482 -1.235 1.00 0.00 H ATOM 8675 HD21 LEU B 193 44.460 65.006 -4.046 1.00 0.00 H ATOM 8676 HD22 LEU B 193 45.325 65.332 -2.524 1.00 0.00 H ATOM 8677 HD23 LEU B 193 44.951 63.656 -2.994 1.00 0.00 H ATOM 8678 HD11 LEU B 193 41.325 63.866 -2.323 1.00 0.00 H ATOM 8679 HD12 LEU B 193 42.079 64.077 -3.923 1.00 0.00 H ATOM 8680 HD13 LEU B 193 42.653 62.794 -2.830 1.00 0.00 H ATOM 8681 H LEU B 193 41.790 68.652 -1.442 1.00 0.00 H ATOM 8682 N CYS B 194 40.463 65.416 0.208 1.00 16.53 N ATOM 8683 CA CYS B 194 40.251 65.166 1.633 1.00 16.61 C ATOM 8684 C CYS B 194 39.420 63.911 1.849 1.00 16.28 C ATOM 8685 O CYS B 194 38.613 63.550 0.994 1.00 16.23 O ATOM 8686 CB CYS B 194 39.533 66.360 2.264 1.00 16.91 C ATOM 8687 SG CYS B 194 37.880 66.638 1.583 1.00 19.85 S ATOM 8688 HA CYS B 194 41.225 65.025 2.102 1.00 0.00 H ATOM 8689 HB2 CYS B 194 40.133 67.254 2.095 1.00 0.00 H ATOM 8690 HB3 CYS B 194 39.441 66.183 3.336 1.00 0.00 H ATOM 8691 HG CYS B 194 37.306 67.728 2.204 1.00 0.00 H ATOM 8692 H CYS B 194 39.858 64.933 -0.487 1.00 0.00 H ATOM 8693 N TRP B 195 39.598 63.264 3.000 1.00 15.75 N ATOM 8694 CA TRP B 195 38.846 62.049 3.306 1.00 15.65 C ATOM 8695 C TRP B 195 37.342 62.329 3.426 1.00 15.61 C ATOM 8696 O TRP B 195 36.524 61.453 3.133 1.00 15.26 O ATOM 8697 CB TRP B 195 39.370 61.371 4.588 1.00 14.91 C ATOM 8698 CG TRP B 195 39.087 62.137 5.836 1.00 14.17 C ATOM 8699 CD1 TRP B 195 39.926 63.004 6.466 1.00 14.02 C ATOM 8700 CD2 TRP B 195 37.872 62.124 6.598 1.00 13.67 C ATOM 8701 NE1 TRP B 195 39.314 63.536 7.571 1.00 14.11 N ATOM 8702 CE2 TRP B 195 38.051 63.012 7.678 1.00 14.30 C ATOM 8703 CE3 TRP B 195 36.652 61.452 6.472 1.00 13.76 C ATOM 8704 CZ2 TRP B 195 37.054 63.243 8.633 1.00 14.30 C ATOM 8705 CZ3 TRP B 195 35.659 61.683 7.422 1.00 14.14 C ATOM 8706 CH2 TRP B 195 35.869 62.573 8.487 1.00 14.03 C ATOM 8707 HA TRP B 195 38.996 61.364 2.471 1.00 0.00 H ATOM 8708 HB2 TRP B 195 38.902 60.390 4.674 1.00 0.00 H ATOM 8709 HB3 TRP B 195 40.449 61.251 4.496 1.00 0.00 H ATOM 8710 HE1 TRP B 195 39.739 64.226 8.223 1.00 0.00 H ATOM 8711 HD1 TRP B 195 40.938 63.241 6.139 1.00 0.00 H ATOM 8712 HZ2 TRP B 195 37.215 63.931 9.463 1.00 0.00 H ATOM 8713 HH2 TRP B 195 35.072 62.734 9.213 1.00 0.00 H ATOM 8714 HZ3 TRP B 195 34.704 61.164 7.337 1.00 0.00 H ATOM 8715 HE3 TRP B 195 36.481 60.761 5.647 1.00 0.00 H ATOM 8716 H TRP B 195 40.283 63.630 3.692 1.00 0.00 H ATOM 8717 N GLU B 196 36.988 63.538 3.869 1.00 15.86 N ATOM 8718 CA GLU B 196 35.588 63.931 4.044 1.00 16.46 C ATOM 8719 C GLU B 196 34.771 63.645 2.782 1.00 16.91 C ATOM 8720 O GLU B 196 33.673 63.092 2.859 1.00 16.91 O ATOM 8721 CB GLU B 196 35.473 65.417 4.406 1.00 16.49 C ATOM 8722 CG GLU B 196 35.814 65.769 5.850 1.00 16.51 C ATOM 8723 CD GLU B 196 37.270 66.160 6.063 1.00 17.03 C ATOM 8724 OE1 GLU B 196 38.142 65.702 5.300 1.00 16.55 O ATOM 8725 OE2 GLU B 196 37.542 66.929 7.011 1.00 17.47 O ATOM 8726 HA GLU B 196 35.186 63.336 4.864 1.00 0.00 H ATOM 8727 HB2 GLU B 196 36.147 65.975 3.756 1.00 0.00 H ATOM 8728 HB3 GLU B 196 34.446 65.731 4.217 1.00 0.00 H ATOM 8729 HG2 GLU B 196 35.186 66.605 6.157 1.00 0.00 H ATOM 8730 HG3 GLU B 196 35.596 64.903 6.475 1.00 0.00 H ATOM 8731 H GLU B 196 37.734 64.226 4.098 1.00 0.00 H ATOM 8732 N MET B 197 35.325 64.006 1.627 1.00 17.62 N ATOM 8733 CA MET B 197 34.680 63.754 0.337 1.00 18.15 C ATOM 8734 C MET B 197 34.946 62.351 -0.197 1.00 17.97 C ATOM 8735 O MET B 197 34.035 61.690 -0.712 1.00 17.84 O ATOM 8736 CB MET B 197 35.170 64.756 -0.701 1.00 18.22 C ATOM 8737 CG MET B 197 34.406 64.692 -2.023 1.00 19.13 C ATOM 8738 SD MET B 197 34.657 66.167 -3.050 1.00 22.06 S ATOM 8739 CE MET B 197 36.433 66.148 -3.245 1.00 22.45 C ATOM 8740 HA MET B 197 33.609 63.858 0.509 1.00 0.00 H ATOM 8741 HB2 MET B 197 35.063 65.759 -0.289 1.00 0.00 H ATOM 8742 HB3 MET B 197 36.223 64.558 -0.901 1.00 0.00 H ATOM 8743 HG2 MET B 197 33.342 64.594 -1.807 1.00 0.00 H ATOM 8744 HG3 MET B 197 34.744 63.818 -2.579 1.00 0.00 H ATOM 8745 HE1 MET B 197 36.906 66.214 -2.265 1.00 0.00 H ATOM 8746 HE2 MET B 197 36.734 65.221 -3.733 1.00 0.00 H ATOM 8747 HE3 MET B 197 36.739 66.998 -3.855 1.00 0.00 H ATOM 8748 H MET B 197 36.249 64.484 1.641 1.00 0.00 H ATOM 8749 N ALA B 198 36.200 61.916 -0.097 1.00 17.66 N ATOM 8750 CA ALA B 198 36.639 60.665 -0.711 1.00 17.59 C ATOM 8751 C ALA B 198 35.902 59.459 -0.156 1.00 17.41 C ATOM 8752 O ALA B 198 35.606 58.523 -0.894 1.00 17.38 O ATOM 8753 CB ALA B 198 38.138 60.485 -0.532 1.00 17.62 C ATOM 8754 HA ALA B 198 36.404 60.731 -1.773 1.00 0.00 H ATOM 8755 HB1 ALA B 198 38.661 61.316 -1.004 1.00 0.00 H ATOM 8756 HB2 ALA B 198 38.375 60.462 0.532 1.00 0.00 H ATOM 8757 HB3 ALA B 198 38.448 59.548 -0.995 1.00 0.00 H ATOM 8758 H ALA B 198 36.889 62.485 0.435 1.00 0.00 H ATOM 8759 N CYS B 199 35.595 59.481 1.140 1.00 17.15 N ATOM 8760 CA CYS B 199 34.936 58.344 1.769 1.00 17.12 C ATOM 8761 C CYS B 199 33.524 58.124 1.201 1.00 16.97 C ATOM 8762 O CYS B 199 33.024 56.999 1.204 1.00 16.70 O ATOM 8763 CB CYS B 199 34.916 58.494 3.295 1.00 17.11 C ATOM 8764 SG CYS B 199 33.844 59.788 3.947 1.00 18.06 S ATOM 8765 HA CYS B 199 35.517 57.452 1.534 1.00 0.00 H ATOM 8766 HB2 CYS B 199 35.934 58.707 3.623 1.00 0.00 H ATOM 8767 HB3 CYS B 199 34.590 57.545 3.720 1.00 0.00 H ATOM 8768 HG CYS B 199 34.244 61.010 3.446 1.00 0.00 H ATOM 8769 H CYS B 199 35.828 60.319 1.709 1.00 0.00 H ATOM 8770 N GLU B 200 32.907 59.194 0.696 1.00 16.72 N ATOM 8771 CA GLU B 200 31.579 59.121 0.075 1.00 16.96 C ATOM 8772 C GLU B 200 31.602 58.320 -1.228 1.00 16.36 C ATOM 8773 O GLU B 200 30.688 57.546 -1.504 1.00 16.00 O ATOM 8774 CB GLU B 200 31.040 60.528 -0.194 1.00 16.93 C ATOM 8775 CG GLU B 200 30.826 61.354 1.072 1.00 18.17 C ATOM 8776 CD GLU B 200 30.516 62.827 0.797 1.00 18.94 C ATOM 8777 OE1 GLU B 200 30.400 63.243 -0.382 1.00 20.40 O ATOM 8778 OE2 GLU B 200 30.385 63.576 1.790 1.00 22.80 O ATOM 8779 HA GLU B 200 30.922 58.605 0.775 1.00 0.00 H ATOM 8780 HB2 GLU B 200 31.751 61.053 -0.832 1.00 0.00 H ATOM 8781 HB3 GLU B 200 30.085 60.438 -0.712 1.00 0.00 H ATOM 8782 HG2 GLU B 200 29.993 60.924 1.628 1.00 0.00 H ATOM 8783 HG3 GLU B 200 31.731 61.299 1.677 1.00 0.00 H ATOM 8784 H GLU B 200 33.386 60.116 0.744 1.00 0.00 H ATOM 8785 N PHE B 201 32.656 58.522 -2.017 1.00 16.25 N ATOM 8786 CA PHE B 201 32.889 57.754 -3.239 1.00 16.22 C ATOM 8787 C PHE B 201 33.314 56.325 -2.916 1.00 16.08 C ATOM 8788 O PHE B 201 32.915 55.385 -3.596 1.00 15.99 O ATOM 8789 CB PHE B 201 33.958 58.434 -4.084 1.00 16.13 C ATOM 8790 CG PHE B 201 33.505 59.725 -4.696 1.00 16.13 C ATOM 8791 CD1 PHE B 201 33.838 60.941 -4.118 1.00 16.34 C ATOM 8792 CD2 PHE B 201 32.728 59.722 -5.847 1.00 15.92 C ATOM 8793 CE1 PHE B 201 33.406 62.141 -4.695 1.00 16.77 C ATOM 8794 CE2 PHE B 201 32.294 60.912 -6.425 1.00 16.25 C ATOM 8795 CZ PHE B 201 32.630 62.119 -5.853 1.00 16.21 C ATOM 8796 HA PHE B 201 31.955 57.714 -3.799 1.00 0.00 H ATOM 8797 HB2 PHE B 201 34.822 58.636 -3.451 1.00 0.00 H ATOM 8798 HB3 PHE B 201 34.248 57.755 -4.886 1.00 0.00 H ATOM 8799 HD2 PHE B 201 32.453 58.772 -6.306 1.00 0.00 H ATOM 8800 HE2 PHE B 201 31.688 60.888 -7.331 1.00 0.00 H ATOM 8801 HZ PHE B 201 32.291 63.052 -6.303 1.00 0.00 H ATOM 8802 HE1 PHE B 201 33.676 63.093 -4.239 1.00 0.00 H ATOM 8803 HD1 PHE B 201 34.440 60.962 -3.209 1.00 0.00 H ATOM 8804 H PHE B 201 33.342 59.257 -1.753 1.00 0.00 H ATOM 8805 N ASP B 202 34.123 56.166 -1.874 1.00 16.31 N ATOM 8806 CA ASP B 202 34.513 54.840 -1.424 1.00 16.57 C ATOM 8807 C ASP B 202 33.293 54.056 -0.917 1.00 16.63 C ATOM 8808 O ASP B 202 33.170 52.860 -1.173 1.00 16.57 O ATOM 8809 CB ASP B 202 35.590 54.934 -0.341 1.00 16.55 C ATOM 8810 CG ASP B 202 36.412 53.653 -0.207 1.00 16.86 C ATOM 8811 OD1 ASP B 202 36.141 52.642 -0.908 1.00 17.21 O ATOM 8812 OD2 ASP B 202 37.352 53.669 0.608 1.00 17.96 O ATOM 8813 HA ASP B 202 34.931 54.300 -2.273 1.00 0.00 H ATOM 8814 HB2 ASP B 202 36.263 55.755 -0.589 1.00 0.00 H ATOM 8815 HB3 ASP B 202 35.106 55.139 0.614 1.00 0.00 H ATOM 8816 H ASP B 202 34.483 57.003 -1.373 1.00 0.00 H ATOM 8817 N ALA B 203 32.382 54.745 -0.233 1.00 16.94 N ATOM 8818 CA ALA B 203 31.178 54.121 0.315 1.00 17.41 C ATOM 8819 C ALA B 203 30.214 53.575 -0.752 1.00 17.84 C ATOM 8820 O ALA B 203 29.365 52.740 -0.445 1.00 18.07 O ATOM 8821 CB ALA B 203 30.454 55.099 1.221 1.00 17.23 C ATOM 8822 HA ALA B 203 31.517 53.256 0.884 1.00 0.00 H ATOM 8823 HB1 ALA B 203 31.112 55.390 2.039 1.00 0.00 H ATOM 8824 HB2 ALA B 203 30.172 55.983 0.648 1.00 0.00 H ATOM 8825 HB3 ALA B 203 29.559 54.625 1.624 1.00 0.00 H ATOM 8826 H ALA B 203 32.532 55.763 -0.083 1.00 0.00 H ATOM 8827 N MET B 204 30.336 54.047 -1.992 1.00 18.26 N ATOM 8828 CA MET B 204 29.537 53.512 -3.106 1.00 18.53 C ATOM 8829 C MET B 204 30.348 52.595 -4.029 1.00 17.94 C ATOM 8830 O MET B 204 29.842 52.133 -5.045 1.00 18.18 O ATOM 8831 CB MET B 204 28.901 54.651 -3.912 1.00 18.88 C ATOM 8832 CG MET B 204 29.881 55.629 -4.542 1.00 20.29 C ATOM 8833 SD MET B 204 29.034 56.919 -5.479 1.00 22.11 S ATOM 8834 CE MET B 204 28.467 55.947 -6.866 1.00 22.84 C ATOM 8835 HA MET B 204 28.750 52.903 -2.662 1.00 0.00 H ATOM 8836 HB2 MET B 204 28.307 54.207 -4.711 1.00 0.00 H ATOM 8837 HB3 MET B 204 28.247 55.212 -3.244 1.00 0.00 H ATOM 8838 HG2 MET B 204 30.543 55.082 -5.213 1.00 0.00 H ATOM 8839 HG3 MET B 204 30.471 56.095 -3.753 1.00 0.00 H ATOM 8840 HE1 MET B 204 29.325 55.512 -7.378 1.00 0.00 H ATOM 8841 HE2 MET B 204 27.814 55.151 -6.508 1.00 0.00 H ATOM 8842 HE3 MET B 204 27.917 56.587 -7.556 1.00 0.00 H ATOM 8843 H MET B 204 31.014 54.814 -2.177 1.00 0.00 H ATOM 8844 N GLY B 205 31.601 52.331 -3.668 1.00 17.16 N ATOM 8845 CA GLY B 205 32.460 51.433 -4.427 1.00 16.55 C ATOM 8846 C GLY B 205 33.071 52.004 -5.694 1.00 15.99 C ATOM 8847 O GLY B 205 33.515 51.245 -6.554 1.00 15.68 O ATOM 8848 HA3 GLY B 205 31.867 50.562 -4.706 1.00 0.00 H ATOM 8849 HA2 GLY B 205 33.276 51.122 -3.775 1.00 0.00 H ATOM 8850 H GLY B 205 31.981 52.783 -2.812 1.00 0.00 H ATOM 8851 N ALA B 206 33.134 53.332 -5.804 1.00 15.32 N ATOM 8852 CA ALA B 206 33.632 53.980 -7.022 1.00 14.79 C ATOM 8853 C ALA B 206 35.163 54.114 -7.078 1.00 14.52 C ATOM 8854 O ALA B 206 35.721 54.315 -8.164 1.00 14.17 O ATOM 8855 CB ALA B 206 32.979 55.342 -7.189 1.00 14.76 C ATOM 8856 HA ALA B 206 33.358 53.325 -7.849 1.00 0.00 H ATOM 8857 HB1 ALA B 206 31.899 55.219 -7.263 1.00 0.00 H ATOM 8858 HB2 ALA B 206 33.217 55.966 -6.327 1.00 0.00 H ATOM 8859 HB3 ALA B 206 33.355 55.815 -8.096 1.00 0.00 H ATOM 8860 H ALA B 206 32.822 53.922 -5.007 1.00 0.00 H ATOM 8861 N LEU B 207 35.836 54.006 -5.925 1.00 14.04 N ATOM 8862 CA LEU B 207 37.297 54.180 -5.847 1.00 13.96 C ATOM 8863 C LEU B 207 38.092 52.866 -5.911 1.00 14.09 C ATOM 8864 O LEU B 207 37.626 51.826 -5.446 1.00 13.97 O ATOM 8865 CB LEU B 207 37.686 54.917 -4.559 1.00 13.40 C ATOM 8866 CG LEU B 207 37.122 56.318 -4.319 1.00 12.75 C ATOM 8867 CD1 LEU B 207 37.776 56.954 -3.086 1.00 10.76 C ATOM 8868 CD2 LEU B 207 37.290 57.222 -5.547 1.00 12.04 C ATOM 8869 HA LEU B 207 37.559 54.764 -6.730 1.00 0.00 H ATOM 8870 HB2 LEU B 207 37.367 54.294 -3.723 1.00 0.00 H ATOM 8871 HB3 LEU B 207 38.773 55.002 -4.553 1.00 0.00 H ATOM 8872 HG LEU B 207 36.052 56.214 -4.137 1.00 0.00 H ATOM 8873 HD21 LEU B 207 38.350 57.317 -5.785 1.00 0.00 H ATOM 8874 HD22 LEU B 207 36.764 56.783 -6.395 1.00 0.00 H ATOM 8875 HD23 LEU B 207 36.875 58.207 -5.331 1.00 0.00 H ATOM 8876 HD11 LEU B 207 37.576 56.336 -2.211 1.00 0.00 H ATOM 8877 HD12 LEU B 207 38.852 57.026 -3.244 1.00 0.00 H ATOM 8878 HD13 LEU B 207 37.363 57.950 -2.930 1.00 0.00 H ATOM 8879 H LEU B 207 35.309 53.792 -5.054 1.00 0.00 H ATOM 8880 N SER B 208 39.308 52.943 -6.456 1.00 14.21 N ATOM 8881 CA SER B 208 40.228 51.802 -6.517 1.00 14.94 C ATOM 8882 C SER B 208 40.741 51.358 -5.133 1.00 15.52 C ATOM 8883 O SER B 208 41.184 52.191 -4.347 1.00 15.72 O ATOM 8884 CB SER B 208 41.416 52.137 -7.426 1.00 14.54 C ATOM 8885 OG SER B 208 42.459 51.193 -7.285 1.00 13.76 O ATOM 8886 HA SER B 208 39.661 50.966 -6.926 1.00 0.00 H ATOM 8887 HB2 SER B 208 41.795 53.125 -7.165 1.00 0.00 H ATOM 8888 HB3 SER B 208 41.079 52.141 -8.463 1.00 0.00 H ATOM 8889 HG SER B 208 42.774 51.188 -6.346 1.00 0.00 H ATOM 8890 H SER B 208 39.617 53.852 -6.855 1.00 0.00 H ATOM 8891 N THR B 209 40.704 50.046 -4.871 1.00 16.29 N ATOM 8892 CA THR B 209 41.119 49.465 -3.577 1.00 17.04 C ATOM 8893 C THR B 209 42.129 48.287 -3.617 1.00 17.84 C ATOM 8894 O THR B 209 42.688 47.927 -2.573 1.00 17.91 O ATOM 8895 CB THR B 209 39.902 48.934 -2.796 1.00 17.05 C ATOM 8896 OG1 THR B 209 39.403 47.763 -3.438 1.00 17.36 O ATOM 8897 CG2 THR B 209 38.793 49.969 -2.705 1.00 17.10 C ATOM 8898 HA THR B 209 41.620 50.312 -3.107 1.00 0.00 H ATOM 8899 HB THR B 209 40.229 48.703 -1.782 1.00 0.00 H ATOM 8900 HG1 THR B 209 38.621 47.421 -2.937 1.00 0.00 H ATOM 8901 HG23 THR B 209 39.173 50.865 -2.214 1.00 0.00 H ATOM 8902 HG21 THR B 209 38.450 50.221 -3.708 1.00 0.00 H ATOM 8903 HG22 THR B 209 37.964 49.561 -2.127 1.00 0.00 H ATOM 8904 H THR B 209 40.366 49.403 -5.615 1.00 0.00 H ATOM 8905 N LYS B 210 42.353 47.678 -4.786 1.00 18.52 N ATOM 8906 CA LYS B 210 43.239 46.499 -4.896 1.00 18.80 C ATOM 8907 C LYS B 210 44.729 46.834 -5.059 1.00 18.93 C ATOM 8908 O LYS B 210 45.561 45.922 -5.071 1.00 19.02 O ATOM 8909 CB LYS B 210 42.843 45.617 -6.089 1.00 19.54 C ATOM 8910 CG LYS B 210 41.376 45.240 -6.187 1.00 20.94 C ATOM 8911 CD LYS B 210 40.981 44.134 -5.221 1.00 23.11 C ATOM 8912 CE LYS B 210 39.515 43.720 -5.441 1.00 23.65 C ATOM 8913 NZ LYS B 210 39.245 43.333 -6.869 1.00 24.89 N ATOM 8914 HA LYS B 210 43.106 45.981 -3.946 1.00 0.00 H ATOM 8915 HB2 LYS B 210 43.111 46.151 -7.001 1.00 0.00 H ATOM 8916 HB3 LYS B 210 43.420 44.694 -6.027 1.00 0.00 H ATOM 8917 HG2 LYS B 210 40.775 46.123 -5.969 1.00 0.00 H ATOM 8918 HG3 LYS B 210 41.171 44.904 -7.203 1.00 0.00 H ATOM 8919 HD2 LYS B 210 41.626 43.270 -5.382 1.00 0.00 H ATOM 8920 HD3 LYS B 210 41.103 44.491 -4.198 1.00 0.00 H ATOM 8921 HE2 LYS B 210 38.869 44.557 -5.175 1.00 0.00 H ATOM 8922 HE3 LYS B 210 39.289 42.870 -4.797 1.00 0.00 H ATOM 8923 HZ1 LYS B 210 39.451 44.141 -7.491 1.00 0.00 H ATOM 8924 HZ2 LYS B 210 39.852 42.530 -7.130 1.00 0.00 H ATOM 8925 HZ3 LYS B 210 38.246 43.062 -6.970 1.00 0.00 H ATOM 8926 H LYS B 210 41.891 48.044 -5.643 1.00 0.00 H ATOM 8927 N TYR B 211 45.070 48.117 -5.200 1.00 18.64 N ATOM 8928 CA TYR B 211 46.421 48.508 -5.612 1.00 18.70 C ATOM 8929 C TYR B 211 47.129 49.478 -4.651 1.00 18.70 C ATOM 8930 O TYR B 211 48.044 50.199 -5.045 1.00 18.59 O ATOM 8931 CB TYR B 211 46.369 49.104 -7.023 1.00 18.75 C ATOM 8932 CG TYR B 211 45.837 48.150 -8.072 1.00 18.47 C ATOM 8933 CD1 TYR B 211 44.542 48.276 -8.568 1.00 18.67 C ATOM 8934 CD2 TYR B 211 46.630 47.121 -8.565 1.00 18.51 C ATOM 8935 CE1 TYR B 211 44.046 47.390 -9.535 1.00 18.87 C ATOM 8936 CE2 TYR B 211 46.147 46.234 -9.533 1.00 18.91 C ATOM 8937 CZ TYR B 211 44.858 46.375 -10.008 1.00 18.85 C ATOM 8938 OH TYR B 211 44.386 45.509 -10.959 1.00 19.01 O ATOM 8939 HA TYR B 211 47.020 47.598 -5.594 1.00 0.00 H ATOM 8940 HB3 TYR B 211 47.378 49.400 -7.308 1.00 0.00 H ATOM 8941 HB2 TYR B 211 45.726 49.984 -7.001 1.00 0.00 H ATOM 8942 HD2 TYR B 211 47.647 47.003 -8.191 1.00 0.00 H ATOM 8943 HE2 TYR B 211 46.785 45.435 -9.911 1.00 0.00 H ATOM 8944 HE1 TYR B 211 43.029 47.500 -9.911 1.00 0.00 H ATOM 8945 HD1 TYR B 211 43.903 49.077 -8.198 1.00 0.00 H ATOM 8946 HH TYR B 211 43.453 45.748 -11.187 1.00 0.00 H ATOM 8947 H TYR B 211 44.361 48.855 -5.013 1.00 0.00 H ATOM 8948 N ASN B 212 46.727 49.464 -3.386 1.00 18.90 N ATOM 8949 CA ASN B 212 47.293 50.364 -2.379 1.00 19.08 C ATOM 8950 C ASN B 212 48.793 50.184 -2.129 1.00 19.39 C ATOM 8951 O ASN B 212 49.467 51.137 -1.745 1.00 19.48 O ATOM 8952 CB ASN B 212 46.516 50.229 -1.065 1.00 18.65 C ATOM 8953 CG ASN B 212 45.087 50.726 -1.185 1.00 17.91 C ATOM 8954 OD1 ASN B 212 44.811 51.672 -1.926 1.00 15.53 O ATOM 8955 ND2 ASN B 212 44.173 50.097 -0.454 1.00 16.78 N ATOM 8956 HA ASN B 212 47.188 51.369 -2.787 1.00 0.00 H ATOM 8957 HB2 ASN B 212 46.499 49.179 -0.774 1.00 0.00 H ATOM 8958 HB3 ASN B 212 47.025 50.809 -0.295 1.00 0.00 H ATOM 8959 HD22 ASN B 212 44.452 49.303 0.157 1.00 0.00 H ATOM 8960 HD21 ASN B 212 43.178 50.398 -0.493 1.00 0.00 H ATOM 8961 H ASN B 212 45.986 48.792 -3.101 1.00 0.00 H ATOM 8962 N ASP B 213 49.304 48.970 -2.351 1.00 19.94 N ATOM 8963 CA ASP B 213 50.743 48.679 -2.237 1.00 20.30 C ATOM 8964 C ASP B 213 51.561 49.232 -3.408 1.00 20.18 C ATOM 8965 O ASP B 213 52.767 49.434 -3.281 1.00 20.26 O ATOM 8966 CB ASP B 213 50.979 47.163 -2.148 1.00 21.00 C ATOM 8967 CG ASP B 213 50.487 46.556 -0.837 1.00 23.18 C ATOM 8968 OD1 ASP B 213 50.053 47.311 0.065 1.00 25.12 O ATOM 8969 OD2 ASP B 213 50.544 45.306 -0.711 1.00 26.96 O ATOM 8970 HA ASP B 213 51.079 49.176 -1.327 1.00 0.00 H ATOM 8971 HB2 ASP B 213 50.454 46.681 -2.972 1.00 0.00 H ATOM 8972 HB3 ASP B 213 52.048 46.972 -2.239 1.00 0.00 H ATOM 8973 H ASP B 213 48.659 48.198 -2.615 1.00 0.00 H ATOM 8974 N THR B 214 50.905 49.447 -4.546 1.00 20.05 N ATOM 8975 CA THR B 214 51.536 50.004 -5.749 1.00 19.83 C ATOM 8976 C THR B 214 50.682 51.164 -6.258 1.00 19.56 C ATOM 8977 O THR B 214 49.985 51.021 -7.265 1.00 19.44 O ATOM 8978 CB THR B 214 51.660 48.942 -6.874 1.00 19.97 C ATOM 8979 OG1 THR B 214 50.397 48.287 -7.067 1.00 19.79 O ATOM 8980 CG2 THR B 214 52.723 47.898 -6.538 1.00 20.34 C ATOM 8981 HA THR B 214 52.539 50.340 -5.486 1.00 0.00 H ATOM 8982 HB THR B 214 51.957 49.456 -7.788 1.00 0.00 H ATOM 8983 HG1 THR B 214 49.715 48.957 -7.323 1.00 0.00 H ATOM 8984 HG23 THR B 214 53.683 48.393 -6.391 1.00 0.00 H ATOM 8985 HG21 THR B 214 52.440 47.374 -5.625 1.00 0.00 H ATOM 8986 HG22 THR B 214 52.802 47.185 -7.359 1.00 0.00 H ATOM 8987 H THR B 214 49.894 49.208 -4.585 1.00 0.00 H ATOM 8988 N PRO B 215 50.723 52.319 -5.554 1.00 19.43 N ATOM 8989 CA PRO B 215 49.881 53.488 -5.869 1.00 19.20 C ATOM 8990 C PRO B 215 49.874 53.946 -7.333 1.00 19.04 C ATOM 8991 O PRO B 215 48.831 54.366 -7.838 1.00 18.76 O ATOM 8992 CB PRO B 215 50.472 54.584 -4.983 1.00 19.21 C ATOM 8993 CG PRO B 215 51.035 53.856 -3.830 1.00 19.30 C ATOM 8994 CD PRO B 215 51.581 52.579 -4.381 1.00 19.14 C ATOM 8995 HA PRO B 215 48.834 53.243 -5.692 1.00 0.00 H ATOM 8996 HD3 PRO B 215 52.623 52.696 -4.678 1.00 0.00 H ATOM 8997 HD2 PRO B 215 51.500 51.773 -3.652 1.00 0.00 H ATOM 8998 HG3 PRO B 215 50.257 53.650 -3.094 1.00 0.00 H ATOM 8999 HG2 PRO B 215 51.829 54.439 -3.364 1.00 0.00 H ATOM 9000 HB2 PRO B 215 51.252 55.131 -5.513 1.00 0.00 H ATOM 9001 HB3 PRO B 215 49.697 55.280 -4.660 1.00 0.00 H ATOM 9002 N GLU B 216 51.020 53.858 -7.999 1.00 18.82 N ATOM 9003 CA GLU B 216 51.146 54.314 -9.378 1.00 18.91 C ATOM 9004 C GLU B 216 50.486 53.388 -10.405 1.00 18.55 C ATOM 9005 O GLU B 216 50.314 53.778 -11.559 1.00 18.91 O ATOM 9006 CB GLU B 216 52.623 54.486 -9.738 1.00 18.91 C ATOM 9007 CG GLU B 216 53.349 55.484 -8.864 1.00 19.69 C ATOM 9008 CD GLU B 216 54.721 55.831 -9.385 1.00 20.17 C ATOM 9009 OE1 GLU B 216 55.245 55.092 -10.242 1.00 22.80 O ATOM 9010 OE2 GLU B 216 55.285 56.845 -8.926 1.00 22.71 O ATOM 9011 HA GLU B 216 50.616 55.265 -9.426 1.00 0.00 H ATOM 9012 HB2 GLU B 216 53.116 53.519 -9.640 1.00 0.00 H ATOM 9013 HB3 GLU B 216 52.688 54.822 -10.773 1.00 0.00 H ATOM 9014 HG2 GLU B 216 52.756 56.397 -8.811 1.00 0.00 H ATOM 9015 HG3 GLU B 216 53.453 55.061 -7.865 1.00 0.00 H ATOM 9016 H GLU B 216 51.851 53.452 -7.523 1.00 0.00 H ATOM 9017 N LYS B 217 50.155 52.164 -9.997 1.00 18.16 N ATOM 9018 CA LYS B 217 49.490 51.191 -10.869 1.00 17.86 C ATOM 9019 C LYS B 217 47.977 51.127 -10.599 1.00 17.31 C ATOM 9020 O LYS B 217 47.264 50.364 -11.241 1.00 16.90 O ATOM 9021 CB LYS B 217 50.102 49.797 -10.667 1.00 18.15 C ATOM 9022 CG LYS B 217 51.618 49.679 -10.933 1.00 19.99 C ATOM 9023 CD LYS B 217 52.038 50.039 -12.369 1.00 21.50 C ATOM 9024 CE LYS B 217 51.301 49.207 -13.437 1.00 23.01 C ATOM 9025 NZ LYS B 217 51.866 49.360 -14.837 1.00 22.49 N ATOM 9026 HA LYS B 217 49.640 51.517 -11.898 1.00 0.00 H ATOM 9027 HB2 LYS B 217 49.920 49.499 -9.634 1.00 0.00 H ATOM 9028 HB3 LYS B 217 49.591 49.107 -11.338 1.00 0.00 H ATOM 9029 HG2 LYS B 217 52.138 50.347 -10.247 1.00 0.00 H ATOM 9030 HG3 LYS B 217 51.921 48.651 -10.736 1.00 0.00 H ATOM 9031 HD2 LYS B 217 51.823 51.094 -12.540 1.00 0.00 H ATOM 9032 HD3 LYS B 217 53.109 49.866 -12.472 1.00 0.00 H ATOM 9033 HE2 LYS B 217 50.256 49.517 -13.453 1.00 0.00 H ATOM 9034 HE3 LYS B 217 51.362 48.156 -13.155 1.00 0.00 H ATOM 9035 HZ1 LYS B 217 51.805 50.357 -15.127 1.00 0.00 H ATOM 9036 HZ2 LYS B 217 52.861 49.057 -14.843 1.00 0.00 H ATOM 9037 HZ3 LYS B 217 51.319 48.771 -15.497 1.00 0.00 H ATOM 9038 H LYS B 217 50.377 51.887 -9.020 1.00 0.00 H ATOM 9039 N ALA B 218 47.494 51.941 -9.658 1.00 16.71 N ATOM 9040 CA ALA B 218 46.097 51.913 -9.235 1.00 16.39 C ATOM 9041 C ALA B 218 45.137 52.408 -10.318 1.00 16.18 C ATOM 9042 O ALA B 218 44.078 51.804 -10.544 1.00 15.89 O ATOM 9043 CB ALA B 218 45.924 52.741 -7.967 1.00 16.25 C ATOM 9044 HA ALA B 218 45.843 50.871 -9.040 1.00 0.00 H ATOM 9045 HB1 ALA B 218 46.549 52.327 -7.176 1.00 0.00 H ATOM 9046 HB2 ALA B 218 46.221 53.771 -8.164 1.00 0.00 H ATOM 9047 HB3 ALA B 218 44.879 52.715 -7.658 1.00 0.00 H ATOM 9048 H ALA B 218 48.138 52.622 -9.208 1.00 0.00 H ATOM 9049 N SER B 219 45.504 53.516 -10.961 1.00 15.73 N ATOM 9050 CA SER B 219 44.700 54.112 -12.026 1.00 15.74 C ATOM 9051 C SER B 219 45.163 53.518 -13.346 1.00 15.55 C ATOM 9052 O SER B 219 46.323 53.662 -13.733 1.00 15.17 O ATOM 9053 CB SER B 219 44.864 55.637 -12.034 1.00 15.67 C ATOM 9054 OG SER B 219 43.878 56.262 -12.838 1.00 15.59 O ATOM 9055 HA SER B 219 43.643 53.897 -11.867 1.00 0.00 H ATOM 9056 HB2 SER B 219 45.850 55.885 -12.426 1.00 0.00 H ATOM 9057 HB3 SER B 219 44.776 56.008 -11.013 1.00 0.00 H ATOM 9058 HG SER B 219 44.013 57.243 -12.821 1.00 0.00 H ATOM 9059 H SER B 219 46.398 53.975 -10.694 1.00 0.00 H ATOM 9060 N ARG B 220 44.254 52.844 -14.035 1.00 15.70 N ATOM 9061 CA ARG B 220 44.636 51.976 -15.138 1.00 16.31 C ATOM 9062 C ARG B 220 43.513 51.839 -16.155 1.00 16.14 C ATOM 9063 O ARG B 220 43.079 50.739 -16.485 1.00 16.35 O ATOM 9064 CB ARG B 220 45.043 50.610 -14.587 1.00 16.17 C ATOM 9065 CG ARG B 220 44.007 49.956 -13.664 1.00 16.92 C ATOM 9066 CD ARG B 220 44.402 48.521 -13.389 1.00 18.42 C ATOM 9067 NE ARG B 220 45.742 48.469 -12.831 1.00 20.41 N ATOM 9068 CZ ARG B 220 46.665 47.538 -13.075 1.00 21.14 C ATOM 9069 NH1 ARG B 220 46.441 46.516 -13.893 1.00 21.40 N ATOM 9070 NH2 ARG B 220 47.843 47.642 -12.482 1.00 21.49 N ATOM 9071 HA ARG B 220 45.484 52.423 -15.658 1.00 0.00 H ATOM 9072 HB2 ARG B 220 45.217 49.942 -15.430 1.00 0.00 H ATOM 9073 HB3 ARG B 220 45.969 50.732 -14.025 1.00 0.00 H ATOM 9074 HG2 ARG B 220 43.961 50.506 -12.724 1.00 0.00 H ATOM 9075 HG3 ARG B 220 43.029 49.977 -14.144 1.00 0.00 H ATOM 9076 HD2 ARG B 220 44.377 47.955 -14.320 1.00 0.00 H ATOM 9077 HD3 ARG B 220 43.699 48.083 -12.680 1.00 0.00 H ATOM 9078 HE ARG B 220 46.008 49.233 -12.177 1.00 0.00 H ATOM 9079 HH12 ARG B 220 47.186 45.809 -14.058 1.00 0.00 H ATOM 9080 HH11 ARG B 220 45.521 46.422 -14.368 1.00 0.00 H ATOM 9081 HH22 ARG B 220 48.578 46.928 -12.657 1.00 0.00 H ATOM 9082 HH21 ARG B 220 48.034 48.438 -11.841 1.00 0.00 H ATOM 9083 H ARG B 220 43.249 52.937 -13.783 1.00 0.00 H ATOM 9084 N THR B 221 43.058 52.979 -16.656 1.00 16.23 N ATOM 9085 CA THR B 221 41.981 53.027 -17.637 1.00 16.44 C ATOM 9086 C THR B 221 42.208 52.019 -18.782 1.00 16.46 C ATOM 9087 O THR B 221 43.299 51.948 -19.346 1.00 16.17 O ATOM 9088 CB THR B 221 41.845 54.447 -18.205 1.00 16.32 C ATOM 9089 OG1 THR B 221 41.906 55.390 -17.128 1.00 15.82 O ATOM 9090 CG2 THR B 221 40.531 54.612 -18.952 1.00 16.16 C ATOM 9091 HA THR B 221 41.057 52.751 -17.128 1.00 0.00 H ATOM 9092 HB THR B 221 42.661 54.623 -18.906 1.00 0.00 H ATOM 9093 HG1 THR B 221 41.819 56.308 -17.489 1.00 0.00 H ATOM 9094 HG23 THR B 221 40.487 53.894 -19.771 1.00 0.00 H ATOM 9095 HG21 THR B 221 39.701 54.436 -18.268 1.00 0.00 H ATOM 9096 HG22 THR B 221 40.466 55.624 -19.351 1.00 0.00 H ATOM 9097 H THR B 221 43.485 53.872 -16.337 1.00 0.00 H ATOM 9098 N TYR B 222 41.168 51.234 -19.074 1.00 16.77 N ATOM 9099 CA TYR B 222 41.143 50.228 -20.165 1.00 17.26 C ATOM 9100 C TYR B 222 41.862 48.908 -19.853 1.00 17.59 C ATOM 9101 O TYR B 222 41.820 47.975 -20.654 1.00 17.72 O ATOM 9102 CB TYR B 222 41.634 50.806 -21.507 1.00 16.99 C ATOM 9103 CG TYR B 222 40.990 52.123 -21.854 1.00 16.78 C ATOM 9104 CD1 TYR B 222 41.757 53.235 -22.181 1.00 16.80 C ATOM 9105 CD2 TYR B 222 39.607 52.267 -21.819 1.00 17.29 C ATOM 9106 CE1 TYR B 222 41.155 54.457 -22.482 1.00 17.07 C ATOM 9107 CE2 TYR B 222 39.002 53.471 -22.118 1.00 16.73 C ATOM 9108 CZ TYR B 222 39.776 54.566 -22.444 1.00 17.01 C ATOM 9109 OH TYR B 222 39.167 55.767 -22.738 1.00 17.12 O ATOM 9110 HA TYR B 222 40.087 49.974 -20.254 1.00 0.00 H ATOM 9111 HB3 TYR B 222 41.408 50.090 -22.297 1.00 0.00 H ATOM 9112 HB2 TYR B 222 42.713 50.952 -21.448 1.00 0.00 H ATOM 9113 HD2 TYR B 222 38.988 51.411 -21.550 1.00 0.00 H ATOM 9114 HE2 TYR B 222 37.916 53.557 -22.097 1.00 0.00 H ATOM 9115 HE1 TYR B 222 41.767 55.320 -22.745 1.00 0.00 H ATOM 9116 HD1 TYR B 222 42.844 53.151 -22.203 1.00 0.00 H ATOM 9117 HH TYR B 222 38.637 56.067 -21.957 1.00 0.00 H ATOM 9118 H TYR B 222 40.311 51.335 -18.493 1.00 0.00 H ATOM 9119 N ASP B 223 42.505 48.820 -18.695 1.00 18.16 N ATOM 9120 CA ASP B 223 43.130 47.579 -18.279 1.00 18.39 C ATOM 9121 C ASP B 223 42.064 46.611 -17.793 1.00 18.73 C ATOM 9122 O ASP B 223 41.124 47.012 -17.113 1.00 18.83 O ATOM 9123 CB ASP B 223 44.138 47.826 -17.163 1.00 18.33 C ATOM 9124 CG ASP B 223 44.805 46.549 -16.703 1.00 18.32 C ATOM 9125 OD1 ASP B 223 45.843 46.181 -17.291 1.00 17.17 O ATOM 9126 OD2 ASP B 223 44.274 45.910 -15.760 1.00 19.08 O ATOM 9127 HA ASP B 223 43.656 47.154 -19.134 1.00 0.00 H ATOM 9128 HB2 ASP B 223 44.904 48.511 -17.527 1.00 0.00 H ATOM 9129 HB3 ASP B 223 43.621 48.277 -16.316 1.00 0.00 H ATOM 9130 H ASP B 223 42.562 49.654 -18.076 1.00 0.00 H ATOM 9131 N ALA B 224 42.237 45.329 -18.110 1.00 19.34 N ATOM 9132 CA ALA B 224 41.273 44.287 -17.721 1.00 19.60 C ATOM 9133 C ALA B 224 41.043 44.148 -16.209 1.00 19.67 C ATOM 9134 O ALA B 224 40.013 43.624 -15.798 1.00 19.48 O ATOM 9135 CB ALA B 224 41.686 42.939 -18.306 1.00 19.77 C ATOM 9136 HA ALA B 224 40.319 44.614 -18.135 1.00 0.00 H ATOM 9137 HB1 ALA B 224 41.715 43.010 -19.393 1.00 0.00 H ATOM 9138 HB2 ALA B 224 42.673 42.669 -17.932 1.00 0.00 H ATOM 9139 HB3 ALA B 224 40.963 42.179 -18.009 1.00 0.00 H ATOM 9140 H ALA B 224 43.082 45.055 -18.651 1.00 0.00 H ATOM 9141 N HIS B 225 41.988 44.611 -15.390 1.00 20.11 N ATOM 9142 CA HIS B 225 41.873 44.477 -13.926 1.00 20.13 C ATOM 9143 C HIS B 225 41.727 45.806 -13.176 1.00 20.09 C ATOM 9144 O HIS B 225 42.112 45.916 -12.007 1.00 20.36 O ATOM 9145 CB HIS B 225 43.055 43.666 -13.396 1.00 20.54 C ATOM 9146 CG HIS B 225 43.110 42.280 -13.952 1.00 21.09 C ATOM 9147 ND1 HIS B 225 44.015 41.902 -14.920 1.00 22.43 N ATOM 9148 CD2 HIS B 225 42.338 41.195 -13.713 1.00 21.91 C ATOM 9149 CE1 HIS B 225 43.812 40.635 -15.236 1.00 22.49 C ATOM 9150 NE2 HIS B 225 42.794 40.185 -14.523 1.00 22.41 N ATOM 9151 HA HIS B 225 40.939 43.949 -13.732 1.00 0.00 H ATOM 9152 HB2 HIS B 225 43.977 44.183 -13.660 1.00 0.00 H ATOM 9153 HB3 HIS B 225 42.974 43.602 -12.311 1.00 0.00 H ATOM 9154 HD2 HIS B 225 41.508 41.134 -13.009 1.00 0.00 H ATOM 9155 HE1 HIS B 225 44.386 40.059 -15.961 1.00 0.00 H ATOM 9156 H HIS B 225 42.826 45.077 -15.793 1.00 0.00 H ATOM 9157 N ARG B 226 41.142 46.797 -13.845 1.00 19.56 N ATOM 9158 CA ARG B 226 40.818 48.074 -13.220 1.00 19.38 C ATOM 9159 C ARG B 226 39.700 47.882 -12.194 1.00 18.57 C ATOM 9160 O ARG B 226 38.789 47.089 -12.415 1.00 18.15 O ATOM 9161 CB ARG B 226 40.386 49.087 -14.283 1.00 19.52 C ATOM 9162 CG ARG B 226 38.966 48.901 -14.795 1.00 20.38 C ATOM 9163 CD ARG B 226 38.690 49.772 -16.002 1.00 21.41 C ATOM 9164 NE ARG B 226 38.827 48.990 -17.217 1.00 24.15 N ATOM 9165 CZ ARG B 226 37.825 48.478 -17.925 1.00 24.39 C ATOM 9166 NH1 ARG B 226 36.565 48.683 -17.606 1.00 25.67 N ATOM 9167 NH2 ARG B 226 38.095 47.766 -18.992 1.00 25.62 N ATOM 9168 HA ARG B 226 41.705 48.455 -12.713 1.00 0.00 H ATOM 9169 HB2 ARG B 226 40.465 50.086 -13.853 1.00 0.00 H ATOM 9170 HB3 ARG B 226 41.067 49.003 -15.130 1.00 0.00 H ATOM 9171 HG2 ARG B 226 38.824 47.856 -15.072 1.00 0.00 H ATOM 9172 HG3 ARG B 226 38.266 49.164 -14.002 1.00 0.00 H ATOM 9173 HD2 ARG B 226 39.400 50.599 -16.022 1.00 0.00 H ATOM 9174 HD3 ARG B 226 37.676 50.167 -15.939 1.00 0.00 H ATOM 9175 HE ARG B 226 39.792 48.815 -17.564 1.00 0.00 H ATOM 9176 HH12 ARG B 226 35.808 48.266 -18.184 1.00 0.00 H ATOM 9177 HH11 ARG B 226 36.326 49.262 -16.776 1.00 0.00 H ATOM 9178 HH22 ARG B 226 37.321 47.359 -19.555 1.00 0.00 H ATOM 9179 HH21 ARG B 226 39.083 47.608 -19.275 1.00 0.00 H ATOM 9180 H ARG B 226 40.908 46.656 -14.848 1.00 0.00 H ATOM 9181 N ASP B 227 39.760 48.618 -11.085 1.00 17.91 N ATOM 9182 CA ASP B 227 38.793 48.429 -10.004 1.00 17.45 C ATOM 9183 C ASP B 227 38.243 49.725 -9.407 1.00 16.63 C ATOM 9184 O ASP B 227 37.837 49.744 -8.246 1.00 16.44 O ATOM 9185 CB ASP B 227 39.405 47.551 -8.903 1.00 17.78 C ATOM 9186 CG ASP B 227 40.457 48.283 -8.081 1.00 18.93 C ATOM 9187 OD1 ASP B 227 41.297 48.994 -8.673 1.00 22.09 O ATOM 9188 OD2 ASP B 227 40.435 48.153 -6.843 1.00 18.93 O ATOM 9189 HA ASP B 227 37.934 47.932 -10.456 1.00 0.00 H ATOM 9190 HB2 ASP B 227 38.608 47.222 -8.236 1.00 0.00 H ATOM 9191 HB3 ASP B 227 39.869 46.681 -9.368 1.00 0.00 H ATOM 9192 H ASP B 227 40.505 49.337 -10.987 1.00 0.00 H ATOM 9193 N GLY B 228 38.192 50.790 -10.205 1.00 15.64 N ATOM 9194 CA GLY B 228 37.657 52.077 -9.739 1.00 14.82 C ATOM 9195 C GLY B 228 38.641 53.206 -9.969 1.00 13.96 C ATOM 9196 O GLY B 228 39.799 52.962 -10.327 1.00 13.07 O ATOM 9197 HA3 GLY B 228 37.442 52.006 -8.673 1.00 0.00 H ATOM 9198 HA2 GLY B 228 36.736 52.294 -10.280 1.00 0.00 H ATOM 9199 H GLY B 228 38.539 50.709 -11.182 1.00 0.00 H ATOM 9200 N PHE B 229 38.182 54.447 -9.781 1.00 13.19 N ATOM 9201 CA PHE B 229 39.040 55.613 -10.026 1.00 12.53 C ATOM 9202 C PHE B 229 39.851 55.996 -8.794 1.00 12.07 C ATOM 9203 O PHE B 229 39.565 55.548 -7.687 1.00 11.66 O ATOM 9204 CB PHE B 229 38.258 56.801 -10.628 1.00 12.09 C ATOM 9205 CG PHE B 229 37.359 57.536 -9.672 1.00 11.47 C ATOM 9206 CD1 PHE B 229 37.866 58.517 -8.832 1.00 11.37 C ATOM 9207 CD2 PHE B 229 35.992 57.303 -9.673 1.00 11.28 C ATOM 9208 CE1 PHE B 229 37.037 59.223 -7.982 1.00 11.70 C ATOM 9209 CE2 PHE B 229 35.151 57.997 -8.830 1.00 11.25 C ATOM 9210 CZ PHE B 229 35.670 58.963 -7.980 1.00 12.40 C ATOM 9211 HA PHE B 229 39.765 55.319 -10.786 1.00 0.00 H ATOM 9212 HB2 PHE B 229 38.982 57.513 -11.024 1.00 0.00 H ATOM 9213 HB3 PHE B 229 37.642 56.420 -11.443 1.00 0.00 H ATOM 9214 HD2 PHE B 229 35.576 56.559 -10.352 1.00 0.00 H ATOM 9215 HE2 PHE B 229 34.081 57.788 -8.831 1.00 0.00 H ATOM 9216 HZ PHE B 229 35.009 59.516 -7.313 1.00 0.00 H ATOM 9217 HE1 PHE B 229 37.452 59.980 -7.316 1.00 0.00 H ATOM 9218 HD1 PHE B 229 38.934 58.734 -8.843 1.00 0.00 H ATOM 9219 H PHE B 229 37.204 54.589 -9.457 1.00 0.00 H ATOM 9220 N VAL B 230 40.895 56.791 -9.018 1.00 11.87 N ATOM 9221 CA VAL B 230 41.767 57.270 -7.954 1.00 11.82 C ATOM 9222 C VAL B 230 41.478 58.749 -7.785 1.00 11.83 C ATOM 9223 O VAL B 230 41.713 59.548 -8.696 1.00 12.11 O ATOM 9224 CB VAL B 230 43.263 57.030 -8.283 1.00 11.75 C ATOM 9225 CG1 VAL B 230 44.169 57.722 -7.269 1.00 11.61 C ATOM 9226 CG2 VAL B 230 43.566 55.530 -8.320 1.00 11.43 C ATOM 9227 HA VAL B 230 41.572 56.724 -7.031 1.00 0.00 H ATOM 9228 HB VAL B 230 43.462 57.458 -9.265 1.00 0.00 H ATOM 9229 HG11 VAL B 230 43.977 58.795 -7.285 1.00 0.00 H ATOM 9230 HG12 VAL B 230 43.964 57.329 -6.273 1.00 0.00 H ATOM 9231 HG13 VAL B 230 45.211 57.535 -7.527 1.00 0.00 H ATOM 9232 HG21 VAL B 230 43.340 55.091 -7.348 1.00 0.00 H ATOM 9233 HG22 VAL B 230 42.952 55.055 -9.086 1.00 0.00 H ATOM 9234 HG23 VAL B 230 44.620 55.379 -8.552 1.00 0.00 H ATOM 9235 H VAL B 230 41.097 57.083 -9.996 1.00 0.00 H ATOM 9236 N ILE B 231 40.945 59.115 -6.628 1.00 11.62 N ATOM 9237 CA ILE B 231 40.557 60.490 -6.403 1.00 11.68 C ATOM 9238 C ILE B 231 41.786 61.410 -6.390 1.00 11.59 C ATOM 9239 O ILE B 231 42.869 61.022 -5.960 1.00 11.50 O ATOM 9240 CB ILE B 231 39.709 60.646 -5.118 1.00 11.88 C ATOM 9241 CG1 ILE B 231 38.984 61.999 -5.129 1.00 12.12 C ATOM 9242 CG2 ILE B 231 40.569 60.468 -3.866 1.00 12.02 C ATOM 9243 CD1 ILE B 231 37.840 62.086 -4.128 1.00 11.81 C ATOM 9244 HA ILE B 231 39.923 60.795 -7.235 1.00 0.00 H ATOM 9245 HB ILE B 231 38.954 59.860 -5.096 1.00 0.00 H ATOM 9246 HG12 ILE B 231 39.707 62.780 -4.895 1.00 0.00 H ATOM 9247 HG13 ILE B 231 38.582 62.166 -6.128 1.00 0.00 H ATOM 9248 HD11 ILE B 231 37.101 61.318 -4.356 1.00 0.00 H ATOM 9249 HD12 ILE B 231 38.228 61.932 -3.121 1.00 0.00 H ATOM 9250 HD13 ILE B 231 37.376 63.070 -4.193 1.00 0.00 H ATOM 9251 HG21 ILE B 231 41.015 59.473 -3.872 1.00 0.00 H ATOM 9252 HG22 ILE B 231 41.357 61.221 -3.858 1.00 0.00 H ATOM 9253 HG23 ILE B 231 39.946 60.583 -2.979 1.00 0.00 H ATOM 9254 H ILE B 231 40.805 58.409 -5.877 1.00 0.00 H ATOM 9255 N ALA B 232 41.601 62.621 -6.906 1.00 11.42 N ATOM 9256 CA ALA B 232 42.662 63.609 -6.997 1.00 11.17 C ATOM 9257 C ALA B 232 42.101 64.978 -6.693 1.00 11.09 C ATOM 9258 O ALA B 232 40.885 65.158 -6.592 1.00 11.42 O ATOM 9259 CB ALA B 232 43.272 63.597 -8.384 1.00 11.04 C ATOM 9260 HA ALA B 232 43.439 63.366 -6.273 1.00 0.00 H ATOM 9261 HB1 ALA B 232 43.685 62.609 -8.589 1.00 0.00 H ATOM 9262 HB2 ALA B 232 42.503 63.831 -9.120 1.00 0.00 H ATOM 9263 HB3 ALA B 232 44.065 64.342 -8.437 1.00 0.00 H ATOM 9264 H ALA B 232 40.656 62.872 -7.260 1.00 0.00 H ATOM 9265 N GLY B 233 42.999 65.940 -6.532 1.00 11.01 N ATOM 9266 CA GLY B 233 42.617 67.336 -6.370 1.00 11.01 C ATOM 9267 C GLY B 233 43.501 68.237 -7.210 1.00 10.95 C ATOM 9268 O GLY B 233 44.442 67.784 -7.865 1.00 11.24 O ATOM 9269 HA3 GLY B 233 42.716 67.615 -5.321 1.00 0.00 H ATOM 9270 HA2 GLY B 233 41.580 67.461 -6.681 1.00 0.00 H ATOM 9271 H GLY B 233 44.008 65.690 -6.521 1.00 0.00 H ATOM 9272 N GLY B 234 43.196 69.522 -7.183 1.00 10.82 N ATOM 9273 CA GLY B 234 43.961 70.502 -7.924 1.00 10.74 C ATOM 9274 C GLY B 234 43.035 71.518 -8.550 1.00 10.60 C ATOM 9275 O GLY B 234 41.863 71.614 -8.183 1.00 10.12 O ATOM 9276 HA3 GLY B 234 44.528 70.000 -8.708 1.00 0.00 H ATOM 9277 HA2 GLY B 234 44.649 71.009 -7.248 1.00 0.00 H ATOM 9278 H GLY B 234 42.385 69.838 -6.614 1.00 0.00 H ATOM 9279 N GLY B 235 43.567 72.264 -9.511 1.00 10.55 N ATOM 9280 CA GLY B 235 42.825 73.337 -10.142 1.00 10.58 C ATOM 9281 C GLY B 235 43.312 73.615 -11.539 1.00 10.37 C ATOM 9282 O GLY B 235 44.393 73.184 -11.927 1.00 10.23 O ATOM 9283 HA3 GLY B 235 42.936 74.241 -9.544 1.00 0.00 H ATOM 9284 HA2 GLY B 235 41.772 73.059 -10.185 1.00 0.00 H ATOM 9285 H GLY B 235 44.542 72.073 -9.819 1.00 0.00 H ATOM 9286 N GLY B 236 42.486 74.313 -12.302 1.00 10.56 N ATOM 9287 CA GLY B 236 42.868 74.778 -13.624 1.00 11.12 C ATOM 9288 C GLY B 236 42.089 76.015 -14.011 1.00 11.36 C ATOM 9289 O GLY B 236 41.017 76.279 -13.465 1.00 11.37 O ATOM 9290 HA3 GLY B 236 42.669 73.990 -14.350 1.00 0.00 H ATOM 9291 HA2 GLY B 236 43.933 75.012 -13.626 1.00 0.00 H ATOM 9292 H GLY B 236 41.535 74.535 -11.944 1.00 0.00 H ATOM 9293 N MET B 237 42.636 76.769 -14.957 1.00 11.93 N ATOM 9294 CA MET B 237 41.968 77.932 -15.506 1.00 12.04 C ATOM 9295 C MET B 237 42.499 78.190 -16.901 1.00 12.23 C ATOM 9296 O MET B 237 43.693 78.036 -17.161 1.00 11.91 O ATOM 9297 CB MET B 237 42.218 79.168 -14.637 1.00 12.62 C ATOM 9298 CG MET B 237 41.158 80.274 -14.766 1.00 13.38 C ATOM 9299 SD MET B 237 39.561 79.928 -13.957 1.00 16.54 S ATOM 9300 CE MET B 237 40.070 79.349 -12.349 1.00 16.45 C ATOM 9301 HA MET B 237 40.895 77.740 -15.534 1.00 0.00 H ATOM 9302 HB2 MET B 237 42.250 78.849 -13.595 1.00 0.00 H ATOM 9303 HB3 MET B 237 43.184 79.589 -14.917 1.00 0.00 H ATOM 9304 HG2 MET B 237 40.969 80.437 -15.827 1.00 0.00 H ATOM 9305 HG3 MET B 237 41.567 81.184 -14.327 1.00 0.00 H ATOM 9306 HE1 MET B 237 40.690 78.460 -12.464 1.00 0.00 H ATOM 9307 HE2 MET B 237 40.641 80.130 -11.847 1.00 0.00 H ATOM 9308 HE3 MET B 237 39.188 79.104 -11.757 1.00 0.00 H ATOM 9309 H MET B 237 43.578 76.516 -15.317 1.00 0.00 H ATOM 9310 N VAL B 238 41.592 78.562 -17.795 1.00 12.38 N ATOM 9311 CA VAL B 238 41.941 78.978 -19.143 1.00 12.18 C ATOM 9312 C VAL B 238 41.344 80.354 -19.379 1.00 11.98 C ATOM 9313 O VAL B 238 40.354 80.727 -18.744 1.00 11.87 O ATOM 9314 CB VAL B 238 41.440 77.982 -20.221 1.00 12.08 C ATOM 9315 CG1 VAL B 238 42.146 76.648 -20.074 1.00 12.81 C ATOM 9316 CG2 VAL B 238 39.924 77.784 -20.153 1.00 12.04 C ATOM 9317 HA VAL B 238 43.027 79.003 -19.230 1.00 0.00 H ATOM 9318 HB VAL B 238 41.675 78.409 -21.196 1.00 0.00 H ATOM 9319 HG11 VAL B 238 43.220 76.792 -20.193 1.00 0.00 H ATOM 9320 HG12 VAL B 238 41.941 76.237 -19.086 1.00 0.00 H ATOM 9321 HG13 VAL B 238 41.783 75.960 -20.838 1.00 0.00 H ATOM 9322 HG21 VAL B 238 39.654 77.392 -19.173 1.00 0.00 H ATOM 9323 HG22 VAL B 238 39.426 78.741 -20.313 1.00 0.00 H ATOM 9324 HG23 VAL B 238 39.616 77.079 -20.925 1.00 0.00 H ATOM 9325 H VAL B 238 40.589 78.556 -17.520 1.00 0.00 H ATOM 9326 N VAL B 239 41.958 81.106 -20.282 1.00 11.89 N ATOM 9327 CA VAL B 239 41.430 82.403 -20.686 1.00 12.16 C ATOM 9328 C VAL B 239 40.668 82.218 -21.991 1.00 12.29 C ATOM 9329 O VAL B 239 41.263 82.001 -23.043 1.00 12.21 O ATOM 9330 CB VAL B 239 42.544 83.460 -20.860 1.00 11.81 C ATOM 9331 CG1 VAL B 239 41.938 84.834 -21.097 1.00 11.88 C ATOM 9332 CG2 VAL B 239 43.448 83.487 -19.629 1.00 11.38 C ATOM 9333 HA VAL B 239 40.770 82.774 -19.902 1.00 0.00 H ATOM 9334 HB VAL B 239 43.145 83.190 -21.728 1.00 0.00 H ATOM 9335 HG11 VAL B 239 41.327 84.809 -21.999 1.00 0.00 H ATOM 9336 HG12 VAL B 239 41.318 85.108 -20.244 1.00 0.00 H ATOM 9337 HG13 VAL B 239 42.737 85.566 -21.217 1.00 0.00 H ATOM 9338 HG21 VAL B 239 42.855 83.737 -18.749 1.00 0.00 H ATOM 9339 HG22 VAL B 239 43.905 82.507 -19.494 1.00 0.00 H ATOM 9340 HG23 VAL B 239 44.227 84.237 -19.768 1.00 0.00 H ATOM 9341 H VAL B 239 42.839 80.761 -20.713 1.00 0.00 H ATOM 9342 N VAL B 240 39.343 82.287 -21.905 1.00 12.71 N ATOM 9343 CA VAL B 240 38.488 82.221 -23.082 1.00 13.03 C ATOM 9344 C VAL B 240 38.307 83.654 -23.550 1.00 13.61 C ATOM 9345 O VAL B 240 37.965 84.535 -22.760 1.00 14.01 O ATOM 9346 CB VAL B 240 37.127 81.566 -22.769 1.00 12.88 C ATOM 9347 CG1 VAL B 240 36.309 81.368 -24.051 1.00 12.59 C ATOM 9348 CG2 VAL B 240 37.331 80.223 -22.049 1.00 12.30 C ATOM 9349 HA VAL B 240 38.943 81.601 -23.854 1.00 0.00 H ATOM 9350 HB VAL B 240 36.571 82.233 -22.110 1.00 0.00 H ATOM 9351 HG11 VAL B 240 36.134 82.335 -24.522 1.00 0.00 H ATOM 9352 HG12 VAL B 240 36.860 80.724 -24.736 1.00 0.00 H ATOM 9353 HG13 VAL B 240 35.354 80.905 -23.803 1.00 0.00 H ATOM 9354 HG21 VAL B 240 37.909 79.554 -22.687 1.00 0.00 H ATOM 9355 HG22 VAL B 240 37.868 80.391 -21.115 1.00 0.00 H ATOM 9356 HG23 VAL B 240 36.360 79.775 -21.836 1.00 0.00 H ATOM 9357 H VAL B 240 38.904 82.391 -20.968 1.00 0.00 H ATOM 9358 N GLU B 241 38.563 83.894 -24.830 1.00 14.25 N ATOM 9359 CA GLU B 241 38.610 85.251 -25.350 1.00 14.78 C ATOM 9360 C GLU B 241 37.995 85.330 -26.741 1.00 15.00 C ATOM 9361 O GLU B 241 38.141 84.405 -27.550 1.00 14.91 O ATOM 9362 CB GLU B 241 40.060 85.744 -25.371 1.00 14.74 C ATOM 9363 CG GLU B 241 40.244 87.133 -25.947 1.00 14.97 C ATOM 9364 CD GLU B 241 41.561 87.781 -25.547 1.00 16.22 C ATOM 9365 OE1 GLU B 241 41.656 89.022 -25.689 1.00 17.33 O ATOM 9366 OE2 GLU B 241 42.495 87.066 -25.097 1.00 17.57 O ATOM 9367 HA GLU B 241 38.023 85.895 -24.695 1.00 0.00 H ATOM 9368 HB2 GLU B 241 40.433 85.748 -24.347 1.00 0.00 H ATOM 9369 HB3 GLU B 241 40.648 85.047 -25.968 1.00 0.00 H ATOM 9370 HG2 GLU B 241 40.208 87.065 -27.034 1.00 0.00 H ATOM 9371 HG3 GLU B 241 39.427 87.764 -25.597 1.00 0.00 H ATOM 9372 H GLU B 241 38.733 83.095 -25.474 1.00 0.00 H ATOM 9373 N GLU B 242 37.300 86.432 -27.009 1.00 15.50 N ATOM 9374 CA GLU B 242 36.733 86.666 -28.333 1.00 15.75 C ATOM 9375 C GLU B 242 37.876 86.828 -29.334 1.00 15.83 C ATOM 9376 O GLU B 242 38.873 87.484 -29.037 1.00 15.52 O ATOM 9377 CB GLU B 242 35.823 87.897 -28.316 1.00 15.99 C ATOM 9378 CG GLU B 242 34.971 88.068 -29.576 1.00 16.53 C ATOM 9379 CD GLU B 242 35.668 88.874 -30.663 1.00 18.53 C ATOM 9380 OE1 GLU B 242 36.471 89.772 -30.320 1.00 19.42 O ATOM 9381 OE2 GLU B 242 35.409 88.611 -31.861 1.00 19.95 O ATOM 9382 HA GLU B 242 36.119 85.817 -28.631 1.00 0.00 H ATOM 9383 HB2 GLU B 242 35.154 87.815 -27.460 1.00 0.00 H ATOM 9384 HB3 GLU B 242 36.448 88.783 -28.204 1.00 0.00 H ATOM 9385 HG2 GLU B 242 34.736 87.080 -29.973 1.00 0.00 H ATOM 9386 HG3 GLU B 242 34.047 88.578 -29.304 1.00 0.00 H ATOM 9387 H GLU B 242 37.158 87.140 -26.261 1.00 0.00 H ATOM 9388 N LEU B 243 37.738 86.208 -30.506 1.00 15.94 N ATOM 9389 CA LEU B 243 38.826 86.160 -31.489 1.00 16.15 C ATOM 9390 C LEU B 243 39.376 87.534 -31.897 1.00 16.29 C ATOM 9391 O LEU B 243 40.584 87.745 -31.859 1.00 16.34 O ATOM 9392 CB LEU B 243 38.395 85.396 -32.749 1.00 16.17 C ATOM 9393 CG LEU B 243 39.415 85.362 -33.897 1.00 15.77 C ATOM 9394 CD1 LEU B 243 40.722 84.703 -33.473 1.00 15.64 C ATOM 9395 CD2 LEU B 243 38.824 84.663 -35.117 1.00 16.12 C ATOM 9396 HA LEU B 243 39.636 85.636 -30.981 1.00 0.00 H ATOM 9397 HB2 LEU B 243 38.184 84.367 -32.459 1.00 0.00 H ATOM 9398 HB3 LEU B 243 37.484 85.860 -33.126 1.00 0.00 H ATOM 9399 HG LEU B 243 39.645 86.393 -34.165 1.00 0.00 H ATOM 9400 HD21 LEU B 243 38.553 83.641 -34.853 1.00 0.00 H ATOM 9401 HD22 LEU B 243 37.936 85.201 -35.448 1.00 0.00 H ATOM 9402 HD23 LEU B 243 39.562 84.649 -35.919 1.00 0.00 H ATOM 9403 HD11 LEU B 243 41.157 85.262 -32.644 1.00 0.00 H ATOM 9404 HD12 LEU B 243 40.525 83.678 -33.158 1.00 0.00 H ATOM 9405 HD13 LEU B 243 41.415 84.700 -34.314 1.00 0.00 H ATOM 9406 H LEU B 243 36.834 85.745 -30.730 1.00 0.00 H ATOM 9407 N GLU B 244 38.509 88.452 -32.315 1.00 16.59 N ATOM 9408 CA GLU B 244 38.984 89.762 -32.788 1.00 16.93 C ATOM 9409 C GLU B 244 39.733 90.499 -31.678 1.00 16.76 C ATOM 9410 O GLU B 244 40.746 91.144 -31.925 1.00 16.89 O ATOM 9411 CB GLU B 244 37.837 90.634 -33.324 1.00 17.31 C ATOM 9412 CG GLU B 244 37.040 90.034 -34.498 1.00 18.94 C ATOM 9413 CD GLU B 244 37.843 89.859 -35.791 1.00 20.95 C ATOM 9414 OE1 GLU B 244 37.249 89.384 -36.780 1.00 23.67 O ATOM 9415 OE2 GLU B 244 39.048 90.188 -35.842 1.00 22.50 O ATOM 9416 HA GLU B 244 39.669 89.574 -33.615 1.00 0.00 H ATOM 9417 HB2 GLU B 244 37.142 90.816 -32.504 1.00 0.00 H ATOM 9418 HB3 GLU B 244 38.262 91.581 -33.656 1.00 0.00 H ATOM 9419 HG2 GLU B 244 36.669 89.056 -34.193 1.00 0.00 H ATOM 9420 HG3 GLU B 244 36.196 90.692 -34.708 1.00 0.00 H ATOM 9421 H GLU B 244 37.490 88.243 -32.308 1.00 0.00 H ATOM 9422 N HIS B 245 39.238 90.370 -30.453 1.00 16.77 N ATOM 9423 CA HIS B 245 39.893 90.945 -29.283 1.00 16.69 C ATOM 9424 C HIS B 245 41.320 90.415 -29.086 1.00 16.49 C ATOM 9425 O HIS B 245 42.246 91.184 -28.829 1.00 16.33 O ATOM 9426 CB HIS B 245 39.056 90.672 -28.033 1.00 16.59 C ATOM 9427 CG HIS B 245 39.430 91.525 -26.866 1.00 16.95 C ATOM 9428 ND1 HIS B 245 40.328 91.117 -25.903 1.00 17.21 N ATOM 9429 CD2 HIS B 245 39.039 92.772 -26.514 1.00 17.63 C ATOM 9430 CE1 HIS B 245 40.469 92.075 -25.004 1.00 17.62 C ATOM 9431 NE2 HIS B 245 39.696 93.089 -25.350 1.00 17.38 N ATOM 9432 HA HIS B 245 39.971 92.019 -29.451 1.00 0.00 H ATOM 9433 HB2 HIS B 245 38.008 90.855 -28.272 1.00 0.00 H ATOM 9434 HB3 HIS B 245 39.186 89.627 -27.752 1.00 0.00 H ATOM 9435 HD2 HIS B 245 38.335 93.406 -27.053 1.00 0.00 H ATOM 9436 HE1 HIS B 245 41.114 92.035 -24.126 1.00 0.00 H ATOM 9437 H HIS B 245 38.352 89.841 -30.323 1.00 0.00 H ATOM 9438 N ALA B 246 41.484 89.101 -29.212 1.00 16.52 N ATOM 9439 CA ALA B 246 42.787 88.456 -29.056 1.00 16.71 C ATOM 9440 C ALA B 246 43.771 88.914 -30.134 1.00 16.74 C ATOM 9441 O ALA B 246 44.881 89.350 -29.828 1.00 16.95 O ATOM 9442 CB ALA B 246 42.630 86.939 -29.089 1.00 16.59 C ATOM 9443 HA ALA B 246 43.194 88.751 -28.089 1.00 0.00 H ATOM 9444 HB1 ALA B 246 41.976 86.625 -28.276 1.00 0.00 H ATOM 9445 HB2 ALA B 246 42.195 86.641 -30.043 1.00 0.00 H ATOM 9446 HB3 ALA B 246 43.608 86.471 -28.972 1.00 0.00 H ATOM 9447 H ALA B 246 40.656 88.511 -29.429 1.00 0.00 H ATOM 9448 N LEU B 247 43.356 88.818 -31.392 1.00 16.95 N ATOM 9449 CA LEU B 247 44.173 89.285 -32.519 1.00 17.09 C ATOM 9450 C LEU B 247 44.566 90.753 -32.373 1.00 17.32 C ATOM 9451 O LEU B 247 45.723 91.113 -32.578 1.00 17.32 O ATOM 9452 CB LEU B 247 43.409 89.123 -33.833 1.00 17.21 C ATOM 9453 CG LEU B 247 43.063 87.700 -34.250 1.00 16.67 C ATOM 9454 CD1 LEU B 247 42.156 87.718 -35.455 1.00 16.39 C ATOM 9455 CD2 LEU B 247 44.327 86.937 -34.544 1.00 16.82 C ATOM 9456 HA LEU B 247 45.077 88.677 -32.523 1.00 0.00 H ATOM 9457 HB2 LEU B 247 42.475 89.678 -33.743 1.00 0.00 H ATOM 9458 HB3 LEU B 247 44.016 89.562 -34.625 1.00 0.00 H ATOM 9459 HG LEU B 247 42.537 87.203 -33.435 1.00 0.00 H ATOM 9460 HD21 LEU B 247 44.868 87.430 -35.352 1.00 0.00 H ATOM 9461 HD22 LEU B 247 44.951 86.911 -33.650 1.00 0.00 H ATOM 9462 HD23 LEU B 247 44.075 85.919 -34.842 1.00 0.00 H ATOM 9463 HD11 LEU B 247 41.238 88.252 -35.209 1.00 0.00 H ATOM 9464 HD12 LEU B 247 42.660 88.220 -36.280 1.00 0.00 H ATOM 9465 HD13 LEU B 247 41.916 86.694 -35.743 1.00 0.00 H ATOM 9466 H LEU B 247 42.424 88.399 -31.585 1.00 0.00 H ATOM 9467 N ALA B 248 43.595 91.592 -32.019 1.00 17.53 N ATOM 9468 CA ALA B 248 43.830 93.025 -31.852 1.00 17.88 C ATOM 9469 C ALA B 248 44.979 93.335 -30.881 1.00 18.19 C ATOM 9470 O ALA B 248 45.802 94.213 -31.157 1.00 18.53 O ATOM 9471 CB ALA B 248 42.548 93.730 -31.403 1.00 17.88 C ATOM 9472 HA ALA B 248 44.131 93.407 -32.827 1.00 0.00 H ATOM 9473 HB1 ALA B 248 41.772 93.583 -32.154 1.00 0.00 H ATOM 9474 HB2 ALA B 248 42.219 93.311 -30.452 1.00 0.00 H ATOM 9475 HB3 ALA B 248 42.743 94.796 -31.284 1.00 0.00 H ATOM 9476 H ALA B 248 42.639 91.216 -31.856 1.00 0.00 H ATOM 9477 N ARG B 249 45.047 92.615 -29.760 1.00 18.21 N ATOM 9478 CA ARG B 249 46.123 92.834 -28.786 1.00 18.34 C ATOM 9479 C ARG B 249 47.348 91.930 -29.012 1.00 18.45 C ATOM 9480 O ARG B 249 48.295 91.972 -28.233 1.00 18.50 O ATOM 9481 CB ARG B 249 45.600 92.719 -27.345 1.00 18.25 C ATOM 9482 CG ARG B 249 45.257 91.314 -26.896 1.00 18.46 C ATOM 9483 CD ARG B 249 44.640 91.307 -25.514 1.00 18.29 C ATOM 9484 NE ARG B 249 44.486 89.935 -25.040 1.00 18.38 N ATOM 9485 CZ ARG B 249 45.447 89.206 -24.479 1.00 18.68 C ATOM 9486 NH1 ARG B 249 46.660 89.718 -24.284 1.00 19.08 N ATOM 9487 NH2 ARG B 249 45.183 87.959 -24.098 1.00 18.32 N ATOM 9488 HA ARG B 249 46.472 93.854 -28.946 1.00 0.00 H ATOM 9489 HB2 ARG B 249 46.366 93.110 -26.675 1.00 0.00 H ATOM 9490 HB3 ARG B 249 44.701 93.329 -27.262 1.00 0.00 H ATOM 9491 HG2 ARG B 249 44.549 90.879 -27.602 1.00 0.00 H ATOM 9492 HG3 ARG B 249 46.167 90.715 -26.881 1.00 0.00 H ATOM 9493 HD2 ARG B 249 43.662 91.787 -25.553 1.00 0.00 H ATOM 9494 HD3 ARG B 249 45.286 91.855 -24.828 1.00 0.00 H ATOM 9495 HE ARG B 249 43.551 89.492 -25.150 1.00 0.00 H ATOM 9496 HH12 ARG B 249 47.404 89.139 -23.845 1.00 0.00 H ATOM 9497 HH11 ARG B 249 46.864 90.697 -24.571 1.00 0.00 H ATOM 9498 HH22 ARG B 249 45.927 87.381 -23.658 1.00 0.00 H ATOM 9499 HH21 ARG B 249 44.232 87.562 -24.240 1.00 0.00 H ATOM 9500 H ARG B 249 44.327 91.888 -29.573 1.00 0.00 H ATOM 9501 N GLY B 250 47.340 91.138 -30.080 1.00 18.50 N ATOM 9502 CA GLY B 250 48.487 90.285 -30.411 1.00 18.61 C ATOM 9503 C GLY B 250 48.658 89.095 -29.471 1.00 18.87 C ATOM 9504 O GLY B 250 49.777 88.617 -29.258 1.00 19.03 O ATOM 9505 HA3 GLY B 250 49.392 90.892 -30.367 1.00 0.00 H ATOM 9506 HA2 GLY B 250 48.354 89.907 -31.425 1.00 0.00 H ATOM 9507 H GLY B 250 46.501 91.123 -30.695 1.00 0.00 H ATOM 9508 N ALA B 251 47.544 88.620 -28.913 1.00 18.69 N ATOM 9509 CA ALA B 251 47.541 87.475 -28.004 1.00 18.44 C ATOM 9510 C ALA B 251 48.119 86.236 -28.669 1.00 18.31 C ATOM 9511 O ALA B 251 47.991 86.054 -29.880 1.00 18.05 O ATOM 9512 CB ALA B 251 46.123 87.179 -27.556 1.00 18.57 C ATOM 9513 HA ALA B 251 48.162 87.730 -27.146 1.00 0.00 H ATOM 9514 HB1 ALA B 251 45.717 88.050 -27.041 1.00 0.00 H ATOM 9515 HB2 ALA B 251 45.508 86.950 -28.427 1.00 0.00 H ATOM 9516 HB3 ALA B 251 46.128 86.325 -26.879 1.00 0.00 H ATOM 9517 H ALA B 251 46.639 89.083 -29.134 1.00 0.00 H ATOM 9518 N HIS B 252 48.757 85.387 -27.871 1.00 18.09 N ATOM 9519 CA HIS B 252 49.146 84.065 -28.342 1.00 17.89 C ATOM 9520 C HIS B 252 47.918 83.165 -28.221 1.00 17.49 C ATOM 9521 O HIS B 252 47.364 83.034 -27.137 1.00 17.51 O ATOM 9522 CB HIS B 252 50.323 83.518 -27.530 1.00 18.08 C ATOM 9523 CG HIS B 252 50.568 82.058 -27.737 1.00 18.44 C ATOM 9524 ND1 HIS B 252 50.230 81.110 -26.798 1.00 19.29 N ATOM 9525 CD2 HIS B 252 51.099 81.380 -28.782 1.00 19.76 C ATOM 9526 CE1 HIS B 252 50.549 79.910 -27.251 1.00 20.09 C ATOM 9527 NE2 HIS B 252 51.077 80.045 -28.454 1.00 19.59 N ATOM 9528 HA HIS B 252 49.482 84.108 -29.378 1.00 0.00 H ATOM 9529 HB2 HIS B 252 51.222 84.062 -27.817 1.00 0.00 H ATOM 9530 HB3 HIS B 252 50.120 83.687 -26.472 1.00 0.00 H ATOM 9531 HD2 HIS B 252 51.474 81.812 -29.710 1.00 0.00 H ATOM 9532 HE1 HIS B 252 50.401 78.969 -26.722 1.00 0.00 H ATOM 9533 H HIS B 252 48.982 85.670 -26.896 1.00 0.00 H ATOM 9534 N ILE B 253 47.469 82.590 -29.335 1.00 17.13 N ATOM 9535 CA ILE B 253 46.300 81.707 -29.331 1.00 16.95 C ATOM 9536 C ILE B 253 46.734 80.241 -29.363 1.00 16.50 C ATOM 9537 O ILE B 253 47.523 79.828 -30.217 1.00 16.09 O ATOM 9538 CB ILE B 253 45.359 81.986 -30.528 1.00 17.33 C ATOM 9539 CG1 ILE B 253 44.678 83.354 -30.382 1.00 18.33 C ATOM 9540 CG2 ILE B 253 44.290 80.885 -30.672 1.00 17.35 C ATOM 9541 CD1 ILE B 253 45.382 84.458 -31.094 1.00 19.82 C ATOM 9542 HA ILE B 253 45.753 81.910 -28.410 1.00 0.00 H ATOM 9543 HB ILE B 253 45.974 81.990 -31.428 1.00 0.00 H ATOM 9544 HG12 ILE B 253 43.666 83.278 -30.781 1.00 0.00 H ATOM 9545 HG13 ILE B 253 44.632 83.603 -29.322 1.00 0.00 H ATOM 9546 HD11 ILE B 253 46.393 84.556 -30.699 1.00 0.00 H ATOM 9547 HD12 ILE B 253 45.427 84.231 -32.159 1.00 0.00 H ATOM 9548 HD13 ILE B 253 44.839 85.391 -30.942 1.00 0.00 H ATOM 9549 HG21 ILE B 253 44.779 79.924 -30.833 1.00 0.00 H ATOM 9550 HG22 ILE B 253 43.690 80.841 -29.763 1.00 0.00 H ATOM 9551 HG23 ILE B 253 43.647 81.113 -31.522 1.00 0.00 H ATOM 9552 H ILE B 253 47.962 82.773 -30.232 1.00 0.00 H ATOM 9553 N TYR B 254 46.208 79.462 -28.426 1.00 15.86 N ATOM 9554 CA TYR B 254 46.468 78.030 -28.383 1.00 15.70 C ATOM 9555 C TYR B 254 45.582 77.323 -29.403 1.00 15.70 C ATOM 9556 O TYR B 254 46.057 76.513 -30.214 1.00 16.01 O ATOM 9557 CB TYR B 254 46.182 77.479 -26.983 1.00 15.01 C ATOM 9558 CG TYR B 254 47.224 77.830 -25.940 1.00 14.71 C ATOM 9559 CD1 TYR B 254 48.345 77.026 -25.756 1.00 14.28 C ATOM 9560 CD2 TYR B 254 47.084 78.953 -25.128 1.00 14.36 C ATOM 9561 CE1 TYR B 254 49.300 77.334 -24.806 1.00 14.29 C ATOM 9562 CE2 TYR B 254 48.041 79.271 -24.165 1.00 13.87 C ATOM 9563 CZ TYR B 254 49.146 78.455 -24.011 1.00 14.06 C ATOM 9564 OH TYR B 254 50.099 78.739 -23.058 1.00 13.86 O ATOM 9565 HA TYR B 254 47.517 77.853 -28.622 1.00 0.00 H ATOM 9566 HB3 TYR B 254 46.122 76.393 -27.051 1.00 0.00 H ATOM 9567 HB2 TYR B 254 45.222 77.875 -26.651 1.00 0.00 H ATOM 9568 HD2 TYR B 254 46.211 79.595 -25.247 1.00 0.00 H ATOM 9569 HE2 TYR B 254 47.919 80.155 -23.539 1.00 0.00 H ATOM 9570 HE1 TYR B 254 50.174 76.694 -24.683 1.00 0.00 H ATOM 9571 HD1 TYR B 254 48.472 76.136 -26.373 1.00 0.00 H ATOM 9572 HH TYR B 254 49.679 78.737 -22.162 1.00 0.00 H ATOM 9573 H TYR B 254 45.593 79.886 -27.702 1.00 0.00 H ATOM 9574 N ALA B 255 44.290 77.637 -29.342 1.00 15.49 N ATOM 9575 CA ALA B 255 43.280 76.997 -30.164 1.00 15.42 C ATOM 9576 C ALA B 255 41.991 77.790 -30.125 1.00 15.40 C ATOM 9577 O ALA B 255 41.780 78.616 -29.242 1.00 15.34 O ATOM 9578 CB ALA B 255 43.013 75.587 -29.665 1.00 15.50 C ATOM 9579 HA ALA B 255 43.649 76.956 -31.189 1.00 0.00 H ATOM 9580 HB1 ALA B 255 43.934 75.006 -29.713 1.00 0.00 H ATOM 9581 HB2 ALA B 255 42.661 75.628 -28.634 1.00 0.00 H ATOM 9582 HB3 ALA B 255 42.253 75.119 -30.291 1.00 0.00 H ATOM 9583 H ALA B 255 43.990 78.376 -28.674 1.00 0.00 H ATOM 9584 N GLU B 256 41.128 77.512 -31.091 1.00 15.55 N ATOM 9585 CA GLU B 256 39.745 77.962 -31.051 1.00 15.37 C ATOM 9586 C GLU B 256 38.878 76.840 -30.479 1.00 14.73 C ATOM 9587 O GLU B 256 39.111 75.664 -30.757 1.00 14.36 O ATOM 9588 CB GLU B 256 39.282 78.318 -32.463 1.00 15.52 C ATOM 9589 CG GLU B 256 38.039 79.202 -32.516 1.00 16.45 C ATOM 9590 CD GLU B 256 37.343 79.148 -33.863 1.00 17.03 C ATOM 9591 OE1 GLU B 256 37.990 78.732 -34.841 1.00 19.23 O ATOM 9592 OE2 GLU B 256 36.147 79.508 -33.944 1.00 19.87 O ATOM 9593 HA GLU B 256 39.657 78.847 -30.420 1.00 0.00 H ATOM 9594 HB2 GLU B 256 40.095 78.842 -32.966 1.00 0.00 H ATOM 9595 HB3 GLU B 256 39.064 77.391 -32.994 1.00 0.00 H ATOM 9596 HG2 GLU B 256 37.341 78.870 -31.748 1.00 0.00 H ATOM 9597 HG3 GLU B 256 38.334 80.232 -32.316 1.00 0.00 H ATOM 9598 H GLU B 256 41.450 76.953 -31.906 1.00 0.00 H ATOM 9599 N ILE B 257 37.887 77.203 -29.673 1.00 14.38 N ATOM 9600 CA ILE B 257 36.839 76.261 -29.290 1.00 14.01 C ATOM 9601 C ILE B 257 35.820 76.191 -30.414 1.00 13.55 C ATOM 9602 O ILE B 257 34.950 77.058 -30.530 1.00 13.32 O ATOM 9603 CB ILE B 257 36.123 76.655 -27.986 1.00 14.35 C ATOM 9604 CG1 ILE B 257 37.132 76.861 -26.855 1.00 15.17 C ATOM 9605 CG2 ILE B 257 35.087 75.579 -27.604 1.00 14.34 C ATOM 9606 CD1 ILE B 257 38.094 75.717 -26.695 1.00 16.77 C ATOM 9607 HA ILE B 257 37.312 75.295 -29.115 1.00 0.00 H ATOM 9608 HB ILE B 257 35.601 77.598 -28.147 1.00 0.00 H ATOM 9609 HG12 ILE B 257 37.703 77.766 -27.062 1.00 0.00 H ATOM 9610 HG13 ILE B 257 36.584 76.984 -25.921 1.00 0.00 H ATOM 9611 HD11 ILE B 257 37.539 74.805 -26.476 1.00 0.00 H ATOM 9612 HD12 ILE B 257 38.659 75.587 -27.618 1.00 0.00 H ATOM 9613 HD13 ILE B 257 38.779 75.932 -25.875 1.00 0.00 H ATOM 9614 HG21 ILE B 257 34.351 75.485 -28.403 1.00 0.00 H ATOM 9615 HG22 ILE B 257 35.593 74.624 -27.461 1.00 0.00 H ATOM 9616 HG23 ILE B 257 34.587 75.869 -26.680 1.00 0.00 H ATOM 9617 H ILE B 257 37.857 78.176 -29.308 1.00 0.00 H ATOM 9618 N VAL B 258 35.928 75.146 -31.230 1.00 13.05 N ATOM 9619 CA VAL B 258 35.065 74.994 -32.396 1.00 12.74 C ATOM 9620 C VAL B 258 33.831 74.138 -32.104 1.00 12.37 C ATOM 9621 O VAL B 258 32.917 74.054 -32.928 1.00 11.97 O ATOM 9622 CB VAL B 258 35.840 74.443 -33.627 1.00 12.63 C ATOM 9623 CG1 VAL B 258 36.853 75.465 -34.104 1.00 12.56 C ATOM 9624 CG2 VAL B 258 36.515 73.105 -33.329 1.00 12.55 C ATOM 9625 HA VAL B 258 34.714 75.996 -32.642 1.00 0.00 H ATOM 9626 HB VAL B 258 35.116 74.262 -34.422 1.00 0.00 H ATOM 9627 HG11 VAL B 258 36.336 76.382 -34.387 1.00 0.00 H ATOM 9628 HG12 VAL B 258 37.559 75.677 -33.301 1.00 0.00 H ATOM 9629 HG13 VAL B 258 37.389 75.068 -34.966 1.00 0.00 H ATOM 9630 HG21 VAL B 258 37.223 73.231 -32.510 1.00 0.00 H ATOM 9631 HG22 VAL B 258 35.758 72.373 -33.048 1.00 0.00 H ATOM 9632 HG23 VAL B 258 37.043 72.760 -34.218 1.00 0.00 H ATOM 9633 H VAL B 258 36.645 74.420 -31.032 1.00 0.00 H ATOM 9634 N GLY B 259 33.799 73.514 -30.930 1.00 12.20 N ATOM 9635 CA GLY B 259 32.700 72.620 -30.580 1.00 11.82 C ATOM 9636 C GLY B 259 32.492 72.482 -29.091 1.00 11.59 C ATOM 9637 O GLY B 259 33.448 72.362 -28.331 1.00 11.20 O ATOM 9638 HA3 GLY B 259 32.911 71.634 -30.993 1.00 0.00 H ATOM 9639 HA2 GLY B 259 31.783 73.009 -31.023 1.00 0.00 H ATOM 9640 H GLY B 259 34.571 73.666 -30.249 1.00 0.00 H ATOM 9641 N TYR B 260 31.225 72.489 -28.688 1.00 11.57 N ATOM 9642 CA TYR B 260 30.833 72.341 -27.293 1.00 11.34 C ATOM 9643 C TYR B 260 29.512 71.584 -27.232 1.00 11.31 C ATOM 9644 O TYR B 260 28.489 72.058 -27.731 1.00 11.51 O ATOM 9645 CB TYR B 260 30.710 73.710 -26.625 1.00 11.39 C ATOM 9646 CG TYR B 260 29.986 73.712 -25.290 1.00 11.40 C ATOM 9647 CD1 TYR B 260 30.268 72.759 -24.311 1.00 12.18 C ATOM 9648 CD2 TYR B 260 29.036 74.683 -24.999 1.00 10.88 C ATOM 9649 CE1 TYR B 260 29.608 72.768 -23.087 1.00 11.80 C ATOM 9650 CE2 TYR B 260 28.379 74.708 -23.780 1.00 10.91 C ATOM 9651 CZ TYR B 260 28.663 73.746 -22.828 1.00 11.52 C ATOM 9652 OH TYR B 260 28.010 73.769 -21.613 1.00 11.26 O ATOM 9653 HA TYR B 260 31.595 71.779 -26.753 1.00 0.00 H ATOM 9654 HB3 TYR B 260 30.170 74.370 -27.304 1.00 0.00 H ATOM 9655 HB2 TYR B 260 31.715 74.100 -26.465 1.00 0.00 H ATOM 9656 HD2 TYR B 260 28.803 75.442 -25.746 1.00 0.00 H ATOM 9657 HE2 TYR B 260 27.641 75.483 -23.572 1.00 0.00 H ATOM 9658 HE1 TYR B 260 29.833 72.010 -22.337 1.00 0.00 H ATOM 9659 HD1 TYR B 260 31.019 71.994 -24.509 1.00 0.00 H ATOM 9660 HH TYR B 260 27.035 73.681 -21.762 1.00 0.00 H ATOM 9661 H TYR B 260 30.478 72.606 -29.403 1.00 0.00 H ATOM 9662 N GLY B 261 29.553 70.386 -26.657 1.00 11.04 N ATOM 9663 CA GLY B 261 28.358 69.590 -26.451 1.00 10.85 C ATOM 9664 C GLY B 261 27.995 69.591 -24.985 1.00 10.71 C ATOM 9665 O GLY B 261 28.867 69.472 -24.124 1.00 10.85 O ATOM 9666 HA3 GLY B 261 28.542 68.567 -26.779 1.00 0.00 H ATOM 9667 HA2 GLY B 261 27.536 70.013 -27.029 1.00 0.00 H ATOM 9668 H GLY B 261 30.470 70.008 -26.345 1.00 0.00 H ATOM 9669 N ALA B 262 26.711 69.753 -24.695 1.00 10.76 N ATOM 9670 CA ALA B 262 26.207 69.605 -23.331 1.00 10.85 C ATOM 9671 C ALA B 262 24.867 68.873 -23.375 1.00 10.93 C ATOM 9672 O ALA B 262 23.905 69.384 -23.955 1.00 11.03 O ATOM 9673 CB ALA B 262 26.063 70.951 -22.675 1.00 10.86 C ATOM 9674 HA ALA B 262 26.914 69.023 -22.739 1.00 0.00 H ATOM 9675 HB1 ALA B 262 27.035 71.444 -22.643 1.00 0.00 H ATOM 9676 HB2 ALA B 262 25.364 71.560 -23.248 1.00 0.00 H ATOM 9677 HB3 ALA B 262 25.687 70.821 -21.660 1.00 0.00 H ATOM 9678 H ALA B 262 26.046 69.991 -25.458 1.00 0.00 H ATOM 9679 N THR B 263 24.821 67.665 -22.810 1.00 10.91 N ATOM 9680 CA THR B 263 23.605 66.844 -22.838 1.00 11.28 C ATOM 9681 C THR B 263 23.327 66.187 -21.491 1.00 11.48 C ATOM 9682 O THR B 263 24.100 66.340 -20.551 1.00 11.04 O ATOM 9683 CB THR B 263 23.670 65.722 -23.909 1.00 11.16 C ATOM 9684 OG1 THR B 263 24.607 64.714 -23.504 1.00 11.07 O ATOM 9685 CG2 THR B 263 24.034 66.274 -25.273 1.00 11.00 C ATOM 9686 HA THR B 263 22.802 67.538 -23.087 1.00 0.00 H ATOM 9687 HB THR B 263 22.679 65.275 -23.993 1.00 0.00 H ATOM 9688 HG1 THR B 263 24.643 64.003 -24.192 1.00 0.00 H ATOM 9689 HG23 THR B 263 23.310 67.037 -25.560 1.00 0.00 H ATOM 9690 HG21 THR B 263 25.030 66.714 -25.231 1.00 0.00 H ATOM 9691 HG22 THR B 263 24.023 65.467 -26.005 1.00 0.00 H ATOM 9692 H THR B 263 25.670 67.295 -22.337 1.00 0.00 H ATOM 9693 N SER B 264 22.213 65.456 -21.431 1.00 12.10 N ATOM 9694 CA SER B 264 21.776 64.742 -20.235 1.00 12.82 C ATOM 9695 C SER B 264 21.378 63.291 -20.582 1.00 13.19 C ATOM 9696 O SER B 264 20.804 63.047 -21.633 1.00 12.83 O ATOM 9697 CB SER B 264 20.583 65.488 -19.627 1.00 12.86 C ATOM 9698 OG SER B 264 20.089 64.857 -18.456 1.00 13.33 O ATOM 9699 HA SER B 264 22.594 64.702 -19.516 1.00 0.00 H ATOM 9700 HB2 SER B 264 19.783 65.530 -20.366 1.00 0.00 H ATOM 9701 HB3 SER B 264 20.896 66.501 -19.374 1.00 0.00 H ATOM 9702 HG SER B 264 19.795 63.938 -18.677 1.00 0.00 H ATOM 9703 H SER B 264 21.622 65.391 -22.284 1.00 0.00 H ATOM 9704 N ASP B 265 21.667 62.338 -19.701 1.00 14.01 N ATOM 9705 CA ASP B 265 21.244 60.939 -19.914 1.00 15.20 C ATOM 9706 C ASP B 265 19.742 60.722 -19.676 1.00 15.78 C ATOM 9707 O ASP B 265 19.080 60.055 -20.466 1.00 15.62 O ATOM 9708 CB ASP B 265 22.014 59.978 -18.995 1.00 15.29 C ATOM 9709 CG ASP B 265 23.429 59.687 -19.475 1.00 16.40 C ATOM 9710 OD1 ASP B 265 23.859 60.229 -20.532 1.00 16.34 O ATOM 9711 OD2 ASP B 265 24.106 58.888 -18.779 1.00 15.59 O ATOM 9712 HA ASP B 265 21.466 60.729 -20.960 1.00 0.00 H ATOM 9713 HB2 ASP B 265 22.070 60.421 -18.001 1.00 0.00 H ATOM 9714 HB3 ASP B 265 21.466 59.037 -18.942 1.00 0.00 H ATOM 9715 H ASP B 265 22.202 62.583 -18.844 1.00 0.00 H ATOM 9716 N GLY B 266 19.222 61.266 -18.577 1.00 16.70 N ATOM 9717 CA GLY B 266 17.841 61.026 -18.166 1.00 17.67 C ATOM 9718 C GLY B 266 17.558 59.555 -17.922 1.00 18.64 C ATOM 9719 O GLY B 266 16.496 59.060 -18.290 1.00 18.45 O ATOM 9720 HA3 GLY B 266 17.174 61.386 -18.950 1.00 0.00 H ATOM 9721 HA2 GLY B 266 17.648 61.577 -17.246 1.00 0.00 H ATOM 9722 H GLY B 266 19.820 61.883 -17.991 1.00 0.00 H ATOM 9723 N ALA B 267 18.511 58.858 -17.301 1.00 19.84 N ATOM 9724 CA ALA B 267 18.450 57.398 -17.151 1.00 20.98 C ATOM 9725 C ALA B 267 18.684 56.952 -15.704 1.00 21.99 C ATOM 9726 O ALA B 267 17.732 56.730 -14.954 1.00 22.28 O ATOM 9727 CB ALA B 267 19.471 56.730 -18.088 1.00 20.91 C ATOM 9728 HA ALA B 267 17.443 57.083 -17.425 1.00 0.00 H ATOM 9729 HB1 ALA B 267 19.243 56.995 -19.120 1.00 0.00 H ATOM 9730 HB2 ALA B 267 20.474 57.076 -17.836 1.00 0.00 H ATOM 9731 HB3 ALA B 267 19.418 55.648 -17.969 1.00 0.00 H ATOM 9732 H ALA B 267 19.328 59.368 -16.908 1.00 0.00 H ATOM 9733 N ASP B 268 19.963 56.839 -15.338 1.00 23.23 N ATOM 9734 CA ASP B 268 20.422 56.371 -14.028 1.00 24.16 C ATOM 9735 C ASP B 268 21.300 57.435 -13.359 1.00 24.66 C ATOM 9736 O ASP B 268 21.871 58.289 -14.036 1.00 24.96 O ATOM 9737 CB ASP B 268 21.247 55.101 -14.197 1.00 24.83 C ATOM 9738 CG ASP B 268 20.423 53.922 -14.672 1.00 27.33 C ATOM 9739 OD1 ASP B 268 19.405 53.598 -14.012 1.00 30.11 O ATOM 9740 OD2 ASP B 268 20.810 53.303 -15.695 1.00 30.83 O ATOM 9741 HA ASP B 268 19.548 56.174 -13.407 1.00 0.00 H ATOM 9742 HB2 ASP B 268 22.034 55.292 -14.926 1.00 0.00 H ATOM 9743 HB3 ASP B 268 21.696 54.847 -13.237 1.00 0.00 H ATOM 9744 H ASP B 268 20.688 57.103 -16.035 1.00 0.00 H ATOM 9745 N MET B 269 21.435 57.353 -12.038 1.00 25.08 N ATOM 9746 CA MET B 269 22.140 58.381 -11.255 1.00 25.45 C ATOM 9747 C MET B 269 23.657 58.299 -11.284 1.00 25.64 C ATOM 9748 O MET B 269 24.341 59.325 -11.292 1.00 25.57 O ATOM 9749 CB MET B 269 21.725 58.314 -9.785 1.00 25.81 C ATOM 9750 CG MET B 269 20.570 59.183 -9.442 1.00 26.39 C ATOM 9751 SD MET B 269 20.856 60.935 -9.762 1.00 27.71 S ATOM 9752 CE MET B 269 19.152 61.357 -9.937 1.00 27.95 C ATOM 9753 HA MET B 269 21.849 59.315 -11.736 1.00 0.00 H ATOM 9754 HB2 MET B 269 21.460 57.283 -9.550 1.00 0.00 H ATOM 9755 HB3 MET B 269 22.575 58.617 -9.174 1.00 0.00 H ATOM 9756 HG2 MET B 269 20.349 59.059 -8.382 1.00 0.00 H ATOM 9757 HG3 MET B 269 19.711 58.862 -10.031 1.00 0.00 H ATOM 9758 HE1 MET B 269 18.720 60.787 -10.759 1.00 0.00 H ATOM 9759 HE2 MET B 269 18.624 61.121 -9.013 1.00 0.00 H ATOM 9760 HE3 MET B 269 19.063 62.423 -10.146 1.00 0.00 H ATOM 9761 H MET B 269 21.029 56.535 -11.542 1.00 0.00 H ATOM 9762 N VAL B 270 24.179 57.080 -11.246 1.00 25.92 N ATOM 9763 CA VAL B 270 25.617 56.868 -11.081 1.00 26.11 C ATOM 9764 C VAL B 270 26.217 55.897 -12.096 1.00 26.21 C ATOM 9765 O VAL B 270 27.418 55.621 -12.044 1.00 26.42 O ATOM 9766 CB VAL B 270 25.946 56.419 -9.631 1.00 26.15 C ATOM 9767 CG1 VAL B 270 25.724 57.583 -8.669 1.00 26.47 C ATOM 9768 CG2 VAL B 270 25.102 55.204 -9.217 1.00 25.99 C ATOM 9769 HA VAL B 270 26.085 57.833 -11.274 1.00 0.00 H ATOM 9770 HB VAL B 270 26.993 56.118 -9.592 1.00 0.00 H ATOM 9771 HG11 VAL B 270 26.375 58.412 -8.948 1.00 0.00 H ATOM 9772 HG12 VAL B 270 24.683 57.903 -8.722 1.00 0.00 H ATOM 9773 HG13 VAL B 270 25.956 57.263 -7.653 1.00 0.00 H ATOM 9774 HG21 VAL B 270 24.045 55.463 -9.269 1.00 0.00 H ATOM 9775 HG22 VAL B 270 25.307 54.374 -9.893 1.00 0.00 H ATOM 9776 HG23 VAL B 270 25.358 54.916 -8.197 1.00 0.00 H ATOM 9777 H VAL B 270 23.551 56.256 -11.336 1.00 0.00 H ATOM 9778 N ALA B 271 25.396 55.408 -13.026 1.00 26.23 N ATOM 9779 CA ALA B 271 25.869 54.576 -14.130 1.00 26.31 C ATOM 9780 C ALA B 271 25.548 55.264 -15.458 1.00 26.33 C ATOM 9781 O ALA B 271 24.411 55.697 -15.669 1.00 25.98 O ATOM 9782 CB ALA B 271 25.221 53.202 -14.075 1.00 26.33 C ATOM 9783 HA ALA B 271 26.948 54.446 -14.044 1.00 0.00 H ATOM 9784 HB1 ALA B 271 25.476 52.719 -13.132 1.00 0.00 H ATOM 9785 HB2 ALA B 271 24.139 53.309 -14.149 1.00 0.00 H ATOM 9786 HB3 ALA B 271 25.585 52.596 -14.905 1.00 0.00 H ATOM 9787 H ALA B 271 24.381 55.627 -12.963 1.00 0.00 H ATOM 9788 N PRO B 272 26.544 55.358 -16.362 1.00 26.41 N ATOM 9789 CA PRO B 272 26.343 56.084 -17.625 1.00 26.26 C ATOM 9790 C PRO B 272 25.456 55.311 -18.597 1.00 26.11 C ATOM 9791 O PRO B 272 25.453 54.082 -18.576 1.00 26.39 O ATOM 9792 CB PRO B 272 27.766 56.228 -18.181 1.00 26.43 C ATOM 9793 CG PRO B 272 28.522 55.071 -17.602 1.00 26.63 C ATOM 9794 CD PRO B 272 27.901 54.784 -16.256 1.00 26.43 C ATOM 9795 HA PRO B 272 25.835 57.037 -17.477 1.00 0.00 H ATOM 9796 HD3 PRO B 272 27.855 53.711 -16.070 1.00 0.00 H ATOM 9797 HD2 PRO B 272 28.465 55.266 -15.457 1.00 0.00 H ATOM 9798 HG3 PRO B 272 29.574 55.329 -17.484 1.00 0.00 H ATOM 9799 HG2 PRO B 272 28.434 54.200 -18.251 1.00 0.00 H ATOM 9800 HB2 PRO B 272 27.760 56.177 -19.270 1.00 0.00 H ATOM 9801 HB3 PRO B 272 28.208 57.173 -17.865 1.00 0.00 H ATOM 9802 N SER B 273 24.709 56.031 -19.432 1.00 25.85 N ATOM 9803 CA SER B 273 23.804 55.403 -20.405 1.00 25.51 C ATOM 9804 C SER B 273 24.468 55.135 -21.766 1.00 25.44 C ATOM 9805 O SER B 273 24.009 54.261 -22.514 1.00 25.76 O ATOM 9806 CB SER B 273 22.543 56.255 -20.602 1.00 25.50 C ATOM 9807 OG SER B 273 22.802 57.403 -21.393 1.00 24.94 O ATOM 9808 HA SER B 273 23.533 54.435 -19.984 1.00 0.00 H ATOM 9809 HB2 SER B 273 22.176 56.574 -19.626 1.00 0.00 H ATOM 9810 HB3 SER B 273 21.782 55.651 -21.095 1.00 0.00 H ATOM 9811 HG SER B 273 23.130 57.121 -22.284 1.00 0.00 H ATOM 9812 H SER B 273 24.768 57.069 -19.394 1.00 0.00 H ATOM 9813 N GLY B 274 25.530 55.879 -22.086 1.00 24.74 N ATOM 9814 CA GLY B 274 26.192 55.777 -23.392 1.00 24.25 C ATOM 9815 C GLY B 274 25.500 56.662 -24.412 1.00 23.85 C ATOM 9816 O GLY B 274 26.132 57.508 -25.047 1.00 23.63 O ATOM 9817 HA3 GLY B 274 26.156 54.742 -23.732 1.00 0.00 H ATOM 9818 HA2 GLY B 274 27.231 56.090 -23.292 1.00 0.00 H ATOM 9819 H GLY B 274 25.900 56.553 -21.386 1.00 0.00 H ATOM 9820 N GLU B 275 24.198 56.435 -24.584 1.00 23.26 N ATOM 9821 CA GLU B 275 23.313 57.365 -25.277 1.00 22.76 C ATOM 9822 C GLU B 275 23.459 58.688 -24.548 1.00 22.29 C ATOM 9823 O GLU B 275 23.541 58.710 -23.328 1.00 23.25 O ATOM 9824 CB GLU B 275 21.859 56.878 -25.167 1.00 22.98 C ATOM 9825 CG GLU B 275 20.895 57.427 -26.220 1.00 23.55 C ATOM 9826 CD GLU B 275 20.326 58.811 -25.907 1.00 24.59 C ATOM 9827 OE1 GLU B 275 20.401 59.265 -24.741 1.00 24.35 O ATOM 9828 OE2 GLU B 275 19.783 59.438 -26.849 1.00 24.45 O ATOM 9829 HA GLU B 275 23.563 57.450 -26.334 1.00 0.00 H ATOM 9830 HB2 GLU B 275 21.862 55.791 -25.250 1.00 0.00 H ATOM 9831 HB3 GLU B 275 21.482 57.165 -24.185 1.00 0.00 H ATOM 9832 HG2 GLU B 275 21.427 57.485 -27.170 1.00 0.00 H ATOM 9833 HG3 GLU B 275 20.062 56.730 -26.314 1.00 0.00 H ATOM 9834 H GLU B 275 23.794 55.554 -24.207 1.00 0.00 H ATOM 9835 N GLY B 276 23.504 59.804 -25.241 1.00 21.16 N ATOM 9836 CA GLY B 276 23.683 61.054 -24.491 1.00 20.09 C ATOM 9837 C GLY B 276 25.123 61.500 -24.536 1.00 18.90 C ATOM 9838 O GLY B 276 25.386 62.648 -24.871 1.00 18.49 O ATOM 9839 HA3 GLY B 276 23.390 60.894 -23.453 1.00 0.00 H ATOM 9840 HA2 GLY B 276 23.054 61.828 -24.930 1.00 0.00 H ATOM 9841 H GLY B 276 23.416 59.802 -26.277 1.00 0.00 H ATOM 9842 N ALA B 277 26.052 60.601 -24.202 1.00 17.71 N ATOM 9843 CA ALA B 277 27.475 60.817 -24.516 1.00 17.06 C ATOM 9844 C ALA B 277 27.666 60.827 -26.025 1.00 16.14 C ATOM 9845 O ALA B 277 28.391 61.664 -26.552 1.00 15.78 O ATOM 9846 CB ALA B 277 28.358 59.749 -23.878 1.00 16.89 C ATOM 9847 HA ALA B 277 27.775 61.780 -24.103 1.00 0.00 H ATOM 9848 HB1 ALA B 277 28.235 59.777 -22.795 1.00 0.00 H ATOM 9849 HB2 ALA B 277 28.067 58.768 -24.252 1.00 0.00 H ATOM 9850 HB3 ALA B 277 29.400 59.942 -24.132 1.00 0.00 H ATOM 9851 H ALA B 277 25.765 59.731 -23.710 1.00 0.00 H ATOM 9852 N VAL B 278 27.013 59.890 -26.717 1.00 15.71 N ATOM 9853 CA VAL B 278 26.958 59.895 -28.189 1.00 15.25 C ATOM 9854 C VAL B 278 26.429 61.244 -28.678 1.00 14.90 C ATOM 9855 O VAL B 278 27.047 61.898 -29.526 1.00 14.43 O ATOM 9856 CB VAL B 278 26.047 58.765 -28.742 1.00 15.27 C ATOM 9857 CG1 VAL B 278 25.798 58.930 -30.253 1.00 14.82 C ATOM 9858 CG2 VAL B 278 26.650 57.385 -28.447 1.00 15.28 C ATOM 9859 HA VAL B 278 27.970 59.724 -28.555 1.00 0.00 H ATOM 9860 HB VAL B 278 25.086 58.841 -28.233 1.00 0.00 H ATOM 9861 HG11 VAL B 278 25.311 59.888 -30.437 1.00 0.00 H ATOM 9862 HG12 VAL B 278 26.750 58.897 -30.783 1.00 0.00 H ATOM 9863 HG13 VAL B 278 25.157 58.122 -30.605 1.00 0.00 H ATOM 9864 HG21 VAL B 278 27.630 57.310 -28.919 1.00 0.00 H ATOM 9865 HG22 VAL B 278 26.753 57.258 -27.369 1.00 0.00 H ATOM 9866 HG23 VAL B 278 25.994 56.611 -28.844 1.00 0.00 H ATOM 9867 H VAL B 278 26.527 59.131 -26.199 1.00 0.00 H ATOM 9868 N ARG B 279 25.291 61.655 -28.119 1.00 14.56 N ATOM 9869 CA ARG B 279 24.650 62.917 -28.490 1.00 14.45 C ATOM 9870 C ARG B 279 25.529 64.116 -28.155 1.00 14.26 C ATOM 9871 O ARG B 279 25.598 65.068 -28.928 1.00 14.38 O ATOM 9872 CB ARG B 279 23.263 63.046 -27.838 1.00 14.26 C ATOM 9873 CG ARG B 279 22.147 62.394 -28.652 1.00 14.35 C ATOM 9874 CD ARG B 279 20.758 62.572 -28.033 1.00 14.55 C ATOM 9875 NE ARG B 279 20.691 62.064 -26.661 1.00 15.25 N ATOM 9876 CZ ARG B 279 20.645 62.826 -25.568 1.00 14.86 C ATOM 9877 NH1 ARG B 279 20.669 64.152 -25.643 1.00 15.57 N ATOM 9878 NH2 ARG B 279 20.592 62.253 -24.380 1.00 13.71 N ATOM 9879 HA ARG B 279 24.514 62.907 -29.571 1.00 0.00 H ATOM 9880 HB2 ARG B 279 23.297 62.573 -26.857 1.00 0.00 H ATOM 9881 HB3 ARG B 279 23.033 64.105 -27.722 1.00 0.00 H ATOM 9882 HG2 ARG B 279 22.141 62.837 -29.648 1.00 0.00 H ATOM 9883 HG3 ARG B 279 22.356 61.327 -28.732 1.00 0.00 H ATOM 9884 HD2 ARG B 279 20.031 62.034 -28.642 1.00 0.00 H ATOM 9885 HD3 ARG B 279 20.510 63.633 -28.026 1.00 0.00 H ATOM 9886 HE ARG B 279 20.678 61.032 -26.530 1.00 0.00 H ATOM 9887 HH12 ARG B 279 20.632 64.723 -24.774 1.00 0.00 H ATOM 9888 HH11 ARG B 279 20.725 64.619 -26.570 1.00 0.00 H ATOM 9889 HH22 ARG B 279 20.556 62.839 -23.521 1.00 0.00 H ATOM 9890 HH21 ARG B 279 20.586 61.216 -24.303 1.00 0.00 H ATOM 9891 H ARG B 279 24.843 61.058 -27.394 1.00 0.00 H ATOM 9892 N CYS B 280 26.219 64.048 -27.021 1.00 14.33 N ATOM 9893 CA CYS B 280 27.111 65.120 -26.581 1.00 14.14 C ATOM 9894 C CYS B 280 28.261 65.331 -27.566 1.00 13.88 C ATOM 9895 O CYS B 280 28.563 66.463 -27.950 1.00 13.06 O ATOM 9896 CB CYS B 280 27.677 64.807 -25.190 1.00 14.16 C ATOM 9897 SG CYS B 280 28.432 66.225 -24.359 1.00 14.99 S ATOM 9898 HA CYS B 280 26.524 66.037 -26.537 1.00 0.00 H ATOM 9899 HB2 CYS B 280 28.434 64.030 -25.296 1.00 0.00 H ATOM 9900 HB3 CYS B 280 26.864 64.438 -24.565 1.00 0.00 H ATOM 9901 HG CYS B 280 29.477 66.701 -25.124 1.00 0.00 H ATOM 9902 H CYS B 280 26.121 63.201 -26.425 1.00 0.00 H ATOM 9903 N MET B 281 28.899 64.232 -27.964 1.00 13.94 N ATOM 9904 CA MET B 281 30.010 64.282 -28.918 1.00 14.32 C ATOM 9905 C MET B 281 29.553 64.702 -30.310 1.00 14.55 C ATOM 9906 O MET B 281 30.220 65.495 -30.968 1.00 14.31 O ATOM 9907 CB MET B 281 30.722 62.929 -28.993 1.00 14.31 C ATOM 9908 CG MET B 281 31.651 62.648 -27.821 1.00 13.72 C ATOM 9909 SD MET B 281 32.461 61.040 -27.942 1.00 14.19 S ATOM 9910 CE MET B 281 31.131 59.961 -27.412 1.00 15.42 C ATOM 9911 HA MET B 281 30.706 65.037 -28.552 1.00 0.00 H ATOM 9912 HB2 MET B 281 29.965 62.145 -29.025 1.00 0.00 H ATOM 9913 HB3 MET B 281 31.310 62.902 -29.910 1.00 0.00 H ATOM 9914 HG2 MET B 281 31.069 62.677 -26.900 1.00 0.00 H ATOM 9915 HG3 MET B 281 32.417 63.423 -27.790 1.00 0.00 H ATOM 9916 HE1 MET B 281 30.832 60.226 -26.398 1.00 0.00 H ATOM 9917 HE2 MET B 281 30.281 60.076 -28.085 1.00 0.00 H ATOM 9918 HE3 MET B 281 31.474 58.927 -27.432 1.00 0.00 H ATOM 9919 H MET B 281 28.600 63.310 -27.586 1.00 0.00 H ATOM 9920 N LYS B 282 28.421 64.170 -30.763 1.00 15.19 N ATOM 9921 CA LYS B 282 27.854 64.601 -32.047 1.00 15.66 C ATOM 9922 C LYS B 282 27.569 66.101 -32.010 1.00 15.82 C ATOM 9923 O LYS B 282 27.915 66.827 -32.934 1.00 15.63 O ATOM 9924 CB LYS B 282 26.589 63.814 -32.393 1.00 15.69 C ATOM 9925 CG LYS B 282 26.863 62.386 -32.859 1.00 15.89 C ATOM 9926 CD LYS B 282 25.558 61.612 -33.043 1.00 16.40 C ATOM 9927 CE LYS B 282 25.771 60.250 -33.726 1.00 17.26 C ATOM 9928 NZ LYS B 282 24.543 59.373 -33.680 1.00 17.05 N ATOM 9929 HA LYS B 282 28.585 64.398 -32.830 1.00 0.00 H ATOM 9930 HB2 LYS B 282 25.956 63.772 -31.506 1.00 0.00 H ATOM 9931 HB3 LYS B 282 26.062 64.341 -33.189 1.00 0.00 H ATOM 9932 HG2 LYS B 282 27.397 62.417 -33.809 1.00 0.00 H ATOM 9933 HG3 LYS B 282 27.477 61.879 -32.115 1.00 0.00 H ATOM 9934 HD2 LYS B 282 25.109 61.446 -32.064 1.00 0.00 H ATOM 9935 HD3 LYS B 282 24.881 62.208 -33.655 1.00 0.00 H ATOM 9936 HE2 LYS B 282 26.588 59.732 -33.223 1.00 0.00 H ATOM 9937 HE3 LYS B 282 26.038 60.421 -34.769 1.00 0.00 H ATOM 9938 HZ1 LYS B 282 24.283 59.195 -32.689 1.00 0.00 H ATOM 9939 HZ2 LYS B 282 23.758 59.852 -34.165 1.00 0.00 H ATOM 9940 HZ3 LYS B 282 24.745 58.470 -34.155 1.00 0.00 H ATOM 9941 H LYS B 282 27.933 63.442 -30.203 1.00 0.00 H ATOM 9942 N MET B 283 26.970 66.565 -30.918 1.00 16.28 N ATOM 9943 CA MET B 283 26.696 67.989 -30.750 1.00 16.53 C ATOM 9944 C MET B 283 27.967 68.832 -30.842 1.00 16.71 C ATOM 9945 O MET B 283 27.966 69.911 -31.435 1.00 16.43 O ATOM 9946 CB MET B 283 26.009 68.246 -29.415 1.00 16.66 C ATOM 9947 CG MET B 283 25.571 69.684 -29.238 1.00 16.65 C ATOM 9948 SD MET B 283 24.674 69.945 -27.704 1.00 17.30 S ATOM 9949 CE MET B 283 23.929 71.526 -28.088 1.00 19.19 C ATOM 9950 HA MET B 283 26.035 68.285 -31.565 1.00 0.00 H ATOM 9951 HB2 MET B 283 25.130 67.605 -29.348 1.00 0.00 H ATOM 9952 HB3 MET B 283 26.703 67.994 -28.613 1.00 0.00 H ATOM 9953 HG2 MET B 283 24.925 69.958 -30.072 1.00 0.00 H ATOM 9954 HG3 MET B 283 26.455 70.322 -29.239 1.00 0.00 H ATOM 9955 HE1 MET B 283 24.713 72.258 -28.284 1.00 0.00 H ATOM 9956 HE2 MET B 283 23.297 71.424 -28.970 1.00 0.00 H ATOM 9957 HE3 MET B 283 23.325 71.856 -27.243 1.00 0.00 H ATOM 9958 H MET B 283 26.691 65.900 -30.168 1.00 0.00 H ATOM 9959 N ALA B 284 29.047 68.337 -30.246 1.00 17.05 N ATOM 9960 CA ALA B 284 30.325 69.039 -30.280 1.00 17.37 C ATOM 9961 C ALA B 284 30.954 69.041 -31.678 1.00 17.50 C ATOM 9962 O ALA B 284 31.750 69.922 -31.992 1.00 17.39 O ATOM 9963 CB ALA B 284 31.286 68.440 -29.259 1.00 17.21 C ATOM 9964 HA ALA B 284 30.129 70.079 -30.019 1.00 0.00 H ATOM 9965 HB1 ALA B 284 30.857 68.530 -28.261 1.00 0.00 H ATOM 9966 HB2 ALA B 284 31.451 67.388 -29.491 1.00 0.00 H ATOM 9967 HB3 ALA B 284 32.235 68.975 -29.297 1.00 0.00 H ATOM 9968 H ALA B 284 28.979 67.429 -29.744 1.00 0.00 H ATOM 9969 N MET B 285 30.592 68.065 -32.509 1.00 17.82 N ATOM 9970 CA MET B 285 31.136 67.944 -33.869 1.00 18.24 C ATOM 9971 C MET B 285 30.331 68.693 -34.931 1.00 18.41 C ATOM 9972 O MET B 285 30.751 68.737 -36.089 1.00 17.85 O ATOM 9973 CB MET B 285 31.228 66.466 -34.284 1.00 18.27 C ATOM 9974 CG MET B 285 32.311 65.665 -33.573 1.00 18.94 C ATOM 9975 SD MET B 285 33.944 66.420 -33.701 1.00 22.09 S ATOM 9976 CE MET B 285 34.378 66.165 -35.434 1.00 21.12 C ATOM 9977 HA MET B 285 32.124 68.403 -33.823 1.00 0.00 H ATOM 9978 HB2 MET B 285 30.267 65.995 -34.076 1.00 0.00 H ATOM 9979 HB3 MET B 285 31.426 66.427 -35.355 1.00 0.00 H ATOM 9980 HG2 MET B 285 32.353 64.669 -34.014 1.00 0.00 H ATOM 9981 HG3 MET B 285 32.047 65.583 -32.519 1.00 0.00 H ATOM 9982 HE1 MET B 285 34.393 65.097 -35.650 1.00 0.00 H ATOM 9983 HE2 MET B 285 33.639 66.655 -36.068 1.00 0.00 H ATOM 9984 HE3 MET B 285 35.363 66.590 -35.627 1.00 0.00 H ATOM 9985 H MET B 285 29.898 67.362 -32.183 1.00 0.00 H ATOM 9986 N HIS B 286 29.187 69.266 -34.551 1.00 18.86 N ATOM 9987 CA HIS B 286 28.315 69.952 -35.514 1.00 19.52 C ATOM 9988 C HIS B 286 29.080 71.102 -36.179 1.00 19.42 C ATOM 9989 O HIS B 286 29.622 71.971 -35.503 1.00 18.95 O ATOM 9990 CB HIS B 286 27.033 70.491 -34.843 1.00 20.10 C ATOM 9991 CG HIS B 286 25.962 69.458 -34.623 1.00 22.01 C ATOM 9992 ND1 HIS B 286 25.771 68.378 -35.462 1.00 24.03 N ATOM 9993 CD2 HIS B 286 24.997 69.367 -33.673 1.00 23.93 C ATOM 9994 CE1 HIS B 286 24.753 67.654 -35.024 1.00 24.50 C ATOM 9995 NE2 HIS B 286 24.266 68.231 -33.938 1.00 24.34 N ATOM 9996 HA HIS B 286 28.013 69.225 -36.268 1.00 0.00 H ATOM 9997 HB2 HIS B 286 27.306 70.910 -33.875 1.00 0.00 H ATOM 9998 HB3 HIS B 286 26.622 71.278 -35.476 1.00 0.00 H ATOM 9999 HD2 HIS B 286 24.831 70.064 -32.852 1.00 0.00 H ATOM 10000 HE1 HIS B 286 24.379 66.738 -35.481 1.00 0.00 H ATOM 10001 H HIS B 286 28.906 69.226 -33.550 1.00 0.00 H ATOM 10002 N GLY B 287 29.145 71.079 -37.505 1.00 19.55 N ATOM 10003 CA GLY B 287 29.855 72.113 -38.263 1.00 19.79 C ATOM 10004 C GLY B 287 31.377 72.025 -38.230 1.00 19.93 C ATOM 10005 O GLY B 287 32.054 72.852 -38.839 1.00 20.05 O ATOM 10006 HA3 GLY B 287 29.566 73.083 -37.859 1.00 0.00 H ATOM 10007 HA2 GLY B 287 29.537 72.044 -39.303 1.00 0.00 H ATOM 10008 H GLY B 287 28.679 70.305 -38.020 1.00 0.00 H ATOM 10009 N VAL B 288 31.925 71.032 -37.532 1.00 19.92 N ATOM 10010 CA VAL B 288 33.366 70.814 -37.521 1.00 19.96 C ATOM 10011 C VAL B 288 33.674 69.823 -38.632 1.00 20.05 C ATOM 10012 O VAL B 288 33.320 68.645 -38.537 1.00 19.82 O ATOM 10013 CB VAL B 288 33.866 70.268 -36.153 1.00 20.03 C ATOM 10014 CG1 VAL B 288 35.379 69.988 -36.184 1.00 19.73 C ATOM 10015 CG2 VAL B 288 33.517 71.245 -35.031 1.00 19.73 C ATOM 10016 HA VAL B 288 33.882 71.761 -37.678 1.00 0.00 H ATOM 10017 HB VAL B 288 33.359 69.323 -35.960 1.00 0.00 H ATOM 10018 HG11 VAL B 288 35.594 69.247 -36.954 1.00 0.00 H ATOM 10019 HG12 VAL B 288 35.914 70.911 -36.407 1.00 0.00 H ATOM 10020 HG13 VAL B 288 35.697 69.608 -35.213 1.00 0.00 H ATOM 10021 HG21 VAL B 288 33.993 72.206 -35.226 1.00 0.00 H ATOM 10022 HG22 VAL B 288 32.436 71.376 -34.988 1.00 0.00 H ATOM 10023 HG23 VAL B 288 33.874 70.848 -34.081 1.00 0.00 H ATOM 10024 H VAL B 288 31.311 70.398 -36.982 1.00 0.00 H ATOM 10025 N ASP B 289 34.335 70.309 -39.680 1.00 20.26 N ATOM 10026 CA ASP B 289 34.613 69.499 -40.865 1.00 20.18 C ATOM 10027 C ASP B 289 36.080 69.062 -40.971 1.00 20.05 C ATOM 10028 O ASP B 289 36.499 68.563 -42.014 1.00 20.44 O ATOM 10029 CB ASP B 289 34.155 70.240 -42.136 1.00 20.56 C ATOM 10030 CG ASP B 289 32.629 70.320 -42.252 1.00 21.96 C ATOM 10031 OD1 ASP B 289 31.965 69.266 -42.136 1.00 23.28 O ATOM 10032 OD2 ASP B 289 32.089 71.435 -42.456 1.00 24.04 O ATOM 10033 HA ASP B 289 34.038 68.579 -40.763 1.00 0.00 H ATOM 10034 HB2 ASP B 289 34.558 71.253 -42.115 1.00 0.00 H ATOM 10035 HB3 ASP B 289 34.545 69.714 -43.007 1.00 0.00 H ATOM 10036 H ASP B 289 34.664 71.295 -39.655 1.00 0.00 H ATOM 10037 N THR B 290 36.856 69.233 -39.898 1.00 19.43 N ATOM 10038 CA THR B 290 38.169 68.583 -39.798 1.00 18.71 C ATOM 10039 C THR B 290 38.041 67.336 -38.930 1.00 18.28 C ATOM 10040 O THR B 290 37.197 67.290 -38.035 1.00 18.01 O ATOM 10041 CB THR B 290 39.239 69.494 -39.168 1.00 18.59 C ATOM 10042 OG1 THR B 290 38.753 70.027 -37.930 1.00 17.48 O ATOM 10043 CG2 THR B 290 39.618 70.619 -40.114 1.00 18.42 C ATOM 10044 HA THR B 290 38.485 68.342 -40.813 1.00 0.00 H ATOM 10045 HB THR B 290 40.132 68.900 -38.976 1.00 0.00 H ATOM 10046 HG1 THR B 290 39.444 70.612 -37.530 1.00 0.00 H ATOM 10047 HG23 THR B 290 39.985 70.197 -41.050 1.00 0.00 H ATOM 10048 HG21 THR B 290 38.742 71.237 -40.312 1.00 0.00 H ATOM 10049 HG22 THR B 290 40.398 71.228 -39.658 1.00 0.00 H ATOM 10050 H THR B 290 36.525 69.837 -39.119 1.00 0.00 H ATOM 10051 N PRO B 291 38.891 66.326 -39.172 1.00 17.79 N ATOM 10052 CA PRO B 291 38.793 65.109 -38.369 1.00 17.65 C ATOM 10053 C PRO B 291 39.377 65.316 -36.972 1.00 17.31 C ATOM 10054 O PRO B 291 40.275 66.131 -36.794 1.00 17.07 O ATOM 10055 CB PRO B 291 39.645 64.112 -39.151 1.00 17.73 C ATOM 10056 CG PRO B 291 40.696 64.974 -39.796 1.00 17.98 C ATOM 10057 CD PRO B 291 39.983 66.251 -40.157 1.00 17.65 C ATOM 10058 HA PRO B 291 37.763 64.787 -38.218 1.00 0.00 H ATOM 10059 HD3 PRO B 291 40.650 67.109 -40.066 1.00 0.00 H ATOM 10060 HD2 PRO B 291 39.590 66.204 -41.172 1.00 0.00 H ATOM 10061 HG3 PRO B 291 41.094 64.491 -40.689 1.00 0.00 H ATOM 10062 HG2 PRO B 291 41.510 65.173 -39.099 1.00 0.00 H ATOM 10063 HB2 PRO B 291 40.098 63.379 -38.483 1.00 0.00 H ATOM 10064 HB3 PRO B 291 39.049 63.596 -39.904 1.00 0.00 H ATOM 10065 N ILE B 292 38.859 64.581 -35.994 1.00 16.96 N ATOM 10066 CA ILE B 292 39.439 64.573 -34.662 1.00 16.71 C ATOM 10067 C ILE B 292 40.719 63.755 -34.714 1.00 16.34 C ATOM 10068 O ILE B 292 40.695 62.578 -35.058 1.00 16.31 O ATOM 10069 CB ILE B 292 38.461 63.998 -33.606 1.00 16.78 C ATOM 10070 CG1 ILE B 292 37.184 64.846 -33.548 1.00 17.13 C ATOM 10071 CG2 ILE B 292 39.116 63.941 -32.227 1.00 16.70 C ATOM 10072 CD1 ILE B 292 37.423 66.354 -33.290 1.00 17.57 C ATOM 10073 HA ILE B 292 39.652 65.597 -34.356 1.00 0.00 H ATOM 10074 HB ILE B 292 38.201 62.982 -33.903 1.00 0.00 H ATOM 10075 HG12 ILE B 292 36.663 64.742 -34.500 1.00 0.00 H ATOM 10076 HG13 ILE B 292 36.555 64.459 -32.746 1.00 0.00 H ATOM 10077 HD11 ILE B 292 37.932 66.482 -32.334 1.00 0.00 H ATOM 10078 HD12 ILE B 292 38.040 66.765 -34.089 1.00 0.00 H ATOM 10079 HD13 ILE B 292 36.465 66.873 -33.265 1.00 0.00 H ATOM 10080 HG21 ILE B 292 39.998 63.303 -32.271 1.00 0.00 H ATOM 10081 HG22 ILE B 292 39.408 64.946 -31.923 1.00 0.00 H ATOM 10082 HG23 ILE B 292 38.407 63.534 -31.506 1.00 0.00 H ATOM 10083 H ILE B 292 38.019 63.998 -36.186 1.00 0.00 H ATOM 10084 N ASP B 293 41.831 64.405 -34.381 1.00 15.97 N ATOM 10085 CA ASP B 293 43.149 63.790 -34.403 1.00 15.75 C ATOM 10086 C ASP B 293 43.465 63.087 -33.081 1.00 15.64 C ATOM 10087 O ASP B 293 44.206 62.098 -33.059 1.00 16.22 O ATOM 10088 CB ASP B 293 44.210 64.854 -34.699 1.00 15.84 C ATOM 10089 CG ASP B 293 44.008 65.512 -36.051 1.00 16.70 C ATOM 10090 OD1 ASP B 293 43.752 64.777 -37.031 1.00 17.94 O ATOM 10091 OD2 ASP B 293 44.092 66.758 -36.137 1.00 17.84 O ATOM 10092 HA ASP B 293 43.157 63.035 -35.189 1.00 0.00 H ATOM 10093 HB2 ASP B 293 44.163 65.621 -33.926 1.00 0.00 H ATOM 10094 HB3 ASP B 293 45.193 64.383 -34.682 1.00 0.00 H ATOM 10095 H ASP B 293 41.754 65.401 -34.091 1.00 0.00 H ATOM 10096 N TYR B 294 42.916 63.599 -31.983 1.00 14.84 N ATOM 10097 CA TYR B 294 43.128 62.999 -30.674 1.00 14.36 C ATOM 10098 C TYR B 294 41.940 63.237 -29.749 1.00 13.81 C ATOM 10099 O TYR B 294 41.405 64.342 -29.698 1.00 13.58 O ATOM 10100 CB TYR B 294 44.411 63.546 -30.039 1.00 14.31 C ATOM 10101 CG TYR B 294 44.543 63.199 -28.575 1.00 14.12 C ATOM 10102 CD1 TYR B 294 44.845 61.906 -28.166 1.00 13.87 C ATOM 10103 CD2 TYR B 294 44.332 64.158 -27.601 1.00 14.14 C ATOM 10104 CE1 TYR B 294 44.951 61.591 -26.817 1.00 14.20 C ATOM 10105 CE2 TYR B 294 44.435 63.856 -26.262 1.00 14.61 C ATOM 10106 CZ TYR B 294 44.741 62.580 -25.870 1.00 14.00 C ATOM 10107 OH TYR B 294 44.835 62.327 -24.526 1.00 13.88 O ATOM 10108 HA TYR B 294 43.230 61.923 -30.816 1.00 0.00 H ATOM 10109 HB3 TYR B 294 44.413 64.631 -30.140 1.00 0.00 H ATOM 10110 HB2 TYR B 294 45.266 63.131 -30.572 1.00 0.00 H ATOM 10111 HD2 TYR B 294 44.079 65.175 -27.900 1.00 0.00 H ATOM 10112 HE2 TYR B 294 44.273 64.632 -25.514 1.00 0.00 H ATOM 10113 HE1 TYR B 294 45.197 60.575 -26.507 1.00 0.00 H ATOM 10114 HD1 TYR B 294 45.001 61.128 -28.914 1.00 0.00 H ATOM 10115 HH TYR B 294 45.060 61.373 -24.386 1.00 0.00 H ATOM 10116 H TYR B 294 42.321 64.448 -32.062 1.00 0.00 H ATOM 10117 N LEU B 295 41.549 62.195 -29.016 1.00 13.33 N ATOM 10118 CA LEU B 295 40.471 62.281 -28.043 1.00 13.54 C ATOM 10119 C LEU B 295 40.983 61.951 -26.638 1.00 13.37 C ATOM 10120 O LEU B 295 41.390 60.821 -26.359 1.00 12.88 O ATOM 10121 CB LEU B 295 39.323 61.335 -28.431 1.00 13.46 C ATOM 10122 CG LEU B 295 38.001 61.393 -27.647 1.00 13.45 C ATOM 10123 CD1 LEU B 295 36.906 60.658 -28.398 1.00 13.17 C ATOM 10124 CD2 LEU B 295 38.133 60.799 -26.263 1.00 13.55 C ATOM 10125 HA LEU B 295 40.093 63.304 -28.039 1.00 0.00 H ATOM 10126 HB2 LEU B 295 39.083 61.538 -29.475 1.00 0.00 H ATOM 10127 HB3 LEU B 295 39.704 60.318 -28.338 1.00 0.00 H ATOM 10128 HG LEU B 295 37.742 62.447 -27.544 1.00 0.00 H ATOM 10129 HD21 LEU B 295 38.434 59.755 -26.344 1.00 0.00 H ATOM 10130 HD22 LEU B 295 38.886 61.353 -25.702 1.00 0.00 H ATOM 10131 HD23 LEU B 295 37.174 60.863 -25.749 1.00 0.00 H ATOM 10132 HD11 LEU B 295 36.761 61.123 -29.373 1.00 0.00 H ATOM 10133 HD12 LEU B 295 37.195 59.615 -28.530 1.00 0.00 H ATOM 10134 HD13 LEU B 295 35.978 60.710 -27.828 1.00 0.00 H ATOM 10135 H LEU B 295 42.034 61.284 -29.145 1.00 0.00 H ATOM 10136 N ASN B 296 40.958 62.955 -25.767 1.00 13.81 N ATOM 10137 CA ASN B 296 41.219 62.774 -24.344 1.00 13.82 C ATOM 10138 C ASN B 296 39.931 62.292 -23.680 1.00 13.69 C ATOM 10139 O ASN B 296 38.978 63.061 -23.508 1.00 13.57 O ATOM 10140 CB ASN B 296 41.694 64.090 -23.721 1.00 14.26 C ATOM 10141 CG ASN B 296 42.361 63.896 -22.373 1.00 14.91 C ATOM 10142 OD1 ASN B 296 41.722 63.504 -21.402 1.00 19.38 O ATOM 10143 ND2 ASN B 296 43.650 64.181 -22.309 1.00 16.75 N ATOM 10144 HA ASN B 296 42.007 62.035 -24.195 1.00 0.00 H ATOM 10145 HB2 ASN B 296 42.408 64.559 -24.399 1.00 0.00 H ATOM 10146 HB3 ASN B 296 40.833 64.745 -23.592 1.00 0.00 H ATOM 10147 HD22 ASN B 296 44.152 64.511 -23.158 1.00 0.00 H ATOM 10148 HD21 ASN B 296 44.162 64.076 -21.410 1.00 0.00 H ATOM 10149 H ASN B 296 40.743 63.911 -26.116 1.00 0.00 H ATOM 10150 N SER B 297 39.893 61.007 -23.348 1.00 13.30 N ATOM 10151 CA SER B 297 38.688 60.393 -22.829 1.00 13.55 C ATOM 10152 C SER B 297 38.474 60.774 -21.367 1.00 13.68 C ATOM 10153 O SER B 297 39.411 61.140 -20.650 1.00 13.11 O ATOM 10154 CB SER B 297 38.749 58.865 -22.968 1.00 13.41 C ATOM 10155 OG SER B 297 39.857 58.321 -22.272 1.00 11.79 O ATOM 10156 HA SER B 297 37.847 60.763 -23.415 1.00 0.00 H ATOM 10157 HB2 SER B 297 38.834 58.609 -24.024 1.00 0.00 H ATOM 10158 HB3 SER B 297 37.832 58.436 -22.564 1.00 0.00 H ATOM 10159 HG SER B 297 39.864 57.337 -22.383 1.00 0.00 H ATOM 10160 H SER B 297 40.749 60.427 -23.463 1.00 0.00 H ATOM 10161 N HIS B 298 37.221 60.698 -20.945 1.00 14.16 N ATOM 10162 CA HIS B 298 36.879 60.857 -19.545 1.00 14.51 C ATOM 10163 C HIS B 298 37.546 59.726 -18.760 1.00 14.81 C ATOM 10164 O HIS B 298 38.187 59.972 -17.738 1.00 15.14 O ATOM 10165 CB HIS B 298 35.363 60.847 -19.386 1.00 14.73 C ATOM 10166 CG HIS B 298 34.902 61.060 -17.986 1.00 14.77 C ATOM 10167 ND1 HIS B 298 35.304 62.138 -17.228 1.00 17.01 N ATOM 10168 CD2 HIS B 298 34.072 60.335 -17.204 1.00 15.92 C ATOM 10169 CE1 HIS B 298 34.742 62.064 -16.036 1.00 16.70 C ATOM 10170 NE2 HIS B 298 33.986 60.982 -15.998 1.00 16.02 N ATOM 10171 HA HIS B 298 37.238 61.810 -19.157 1.00 0.00 H ATOM 10172 HB2 HIS B 298 34.947 61.639 -20.009 1.00 0.00 H ATOM 10173 HB3 HIS B 298 34.988 59.882 -19.728 1.00 0.00 H ATOM 10174 HD2 HIS B 298 33.566 59.410 -17.480 1.00 0.00 H ATOM 10175 HE1 HIS B 298 34.879 62.775 -15.221 1.00 0.00 H ATOM 10176 H HIS B 298 36.463 60.520 -21.635 1.00 0.00 H ATOM 10177 N GLY B 299 37.383 58.498 -19.257 1.00 15.08 N ATOM 10178 CA GLY B 299 38.188 57.328 -18.861 1.00 15.18 C ATOM 10179 C GLY B 299 38.756 57.309 -17.453 1.00 15.26 C ATOM 10180 O GLY B 299 39.954 57.481 -17.257 1.00 14.62 O ATOM 10181 HA3 GLY B 299 39.028 57.261 -19.553 1.00 0.00 H ATOM 10182 HA2 GLY B 299 37.557 56.446 -18.970 1.00 0.00 H ATOM 10183 H GLY B 299 36.639 58.357 -19.970 1.00 0.00 H ATOM 10184 N THR B 300 37.883 57.049 -16.483 1.00 15.74 N ATOM 10185 CA THR B 300 38.185 57.223 -15.063 1.00 16.13 C ATOM 10186 C THR B 300 38.844 56.001 -14.421 1.00 16.66 C ATOM 10187 O THR B 300 39.352 56.089 -13.301 1.00 16.57 O ATOM 10188 CB THR B 300 36.897 57.560 -14.287 1.00 16.06 C ATOM 10189 OG1 THR B 300 35.926 56.527 -14.494 1.00 15.82 O ATOM 10190 CG2 THR B 300 36.314 58.892 -14.762 1.00 16.07 C ATOM 10191 HA THR B 300 38.902 58.042 -15.007 1.00 0.00 H ATOM 10192 HB THR B 300 37.143 57.636 -13.228 1.00 0.00 H ATOM 10193 HG1 THR B 300 35.720 56.458 -15.460 1.00 0.00 H ATOM 10194 HG23 THR B 300 37.047 59.684 -14.608 1.00 0.00 H ATOM 10195 HG21 THR B 300 36.070 58.823 -15.822 1.00 0.00 H ATOM 10196 HG22 THR B 300 35.411 59.115 -14.194 1.00 0.00 H ATOM 10197 H THR B 300 36.938 56.705 -16.748 1.00 0.00 H ATOM 10198 N SER B 301 38.831 54.885 -15.153 1.00 17.11 N ATOM 10199 CA SER B 301 39.347 53.580 -14.725 1.00 17.66 C ATOM 10200 C SER B 301 38.375 52.802 -13.824 1.00 18.55 C ATOM 10201 O SER B 301 38.777 51.991 -12.968 1.00 18.92 O ATOM 10202 CB SER B 301 40.792 53.668 -14.177 1.00 17.75 C ATOM 10203 OG SER B 301 41.282 52.391 -13.813 1.00 15.81 O ATOM 10204 HA SER B 301 39.417 52.969 -15.625 1.00 0.00 H ATOM 10205 HB2 SER B 301 40.801 54.315 -13.300 1.00 0.00 H ATOM 10206 HB3 SER B 301 41.439 54.091 -14.946 1.00 0.00 H ATOM 10207 HG SER B 301 40.701 52.004 -13.111 1.00 0.00 H ATOM 10208 H SER B 301 38.421 54.946 -16.107 1.00 0.00 H ATOM 10209 N THR B 302 37.079 52.978 -14.122 1.00 19.19 N ATOM 10210 CA THR B 302 35.991 52.186 -13.552 1.00 19.55 C ATOM 10211 C THR B 302 35.617 51.067 -14.549 1.00 19.75 C ATOM 10212 O THR B 302 35.720 51.267 -15.764 1.00 19.88 O ATOM 10213 CB THR B 302 34.756 53.068 -13.288 1.00 19.71 C ATOM 10214 OG1 THR B 302 34.349 53.707 -14.503 1.00 20.97 O ATOM 10215 CG2 THR B 302 35.068 54.136 -12.264 1.00 20.13 C ATOM 10216 HA THR B 302 36.319 51.758 -12.605 1.00 0.00 H ATOM 10217 HB THR B 302 33.958 52.429 -12.910 1.00 0.00 H ATOM 10218 HG1 THR B 302 35.089 54.271 -14.842 1.00 0.00 H ATOM 10219 HG23 THR B 302 35.380 53.664 -11.332 1.00 0.00 H ATOM 10220 HG21 THR B 302 35.871 54.772 -12.637 1.00 0.00 H ATOM 10221 HG22 THR B 302 34.177 54.739 -12.087 1.00 0.00 H ATOM 10222 H THR B 302 36.833 53.726 -14.802 1.00 0.00 H ATOM 10223 N PRO B 303 35.215 49.880 -14.053 1.00 19.98 N ATOM 10224 CA PRO B 303 34.764 48.784 -14.945 1.00 19.97 C ATOM 10225 C PRO B 303 33.694 49.175 -15.990 1.00 20.04 C ATOM 10226 O PRO B 303 33.958 49.106 -17.189 1.00 20.02 O ATOM 10227 CB PRO B 303 34.237 47.731 -13.966 1.00 20.23 C ATOM 10228 CG PRO B 303 35.046 47.957 -12.727 1.00 20.10 C ATOM 10229 CD PRO B 303 35.214 49.457 -12.640 1.00 20.10 C ATOM 10230 HA PRO B 303 35.584 48.443 -15.577 1.00 0.00 H ATOM 10231 HD3 PRO B 303 34.386 49.912 -12.096 1.00 0.00 H ATOM 10232 HD2 PRO B 303 36.154 49.718 -12.153 1.00 0.00 H ATOM 10233 HG3 PRO B 303 36.016 47.466 -12.807 1.00 0.00 H ATOM 10234 HG2 PRO B 303 34.520 47.578 -11.851 1.00 0.00 H ATOM 10235 HB2 PRO B 303 33.175 47.880 -13.769 1.00 0.00 H ATOM 10236 HB3 PRO B 303 34.395 46.725 -14.355 1.00 0.00 H ATOM 10237 N VAL B 304 32.518 49.606 -15.538 1.00 19.90 N ATOM 10238 CA VAL B 304 31.412 49.939 -16.437 1.00 19.65 C ATOM 10239 C VAL B 304 31.703 51.194 -17.271 1.00 19.65 C ATOM 10240 O VAL B 304 31.502 51.197 -18.484 1.00 19.79 O ATOM 10241 CB VAL B 304 30.098 50.141 -15.648 1.00 19.93 C ATOM 10242 CG1 VAL B 304 28.982 50.671 -16.546 1.00 19.96 C ATOM 10243 CG2 VAL B 304 29.662 48.831 -14.989 1.00 20.23 C ATOM 10244 HA VAL B 304 31.300 49.095 -17.117 1.00 0.00 H ATOM 10245 HB VAL B 304 30.290 50.883 -14.873 1.00 0.00 H ATOM 10246 HG11 VAL B 304 29.282 51.630 -16.969 1.00 0.00 H ATOM 10247 HG12 VAL B 304 28.796 49.960 -17.351 1.00 0.00 H ATOM 10248 HG13 VAL B 304 28.074 50.801 -15.957 1.00 0.00 H ATOM 10249 HG21 VAL B 304 29.502 48.075 -15.758 1.00 0.00 H ATOM 10250 HG22 VAL B 304 30.439 48.494 -14.303 1.00 0.00 H ATOM 10251 HG23 VAL B 304 28.735 48.994 -14.438 1.00 0.00 H ATOM 10252 H VAL B 304 32.381 49.709 -14.512 1.00 0.00 H ATOM 10253 N GLY B 305 32.184 52.248 -16.618 1.00 19.19 N ATOM 10254 CA GLY B 305 32.351 53.553 -17.261 1.00 18.77 C ATOM 10255 C GLY B 305 33.284 53.602 -18.459 1.00 18.27 C ATOM 10256 O GLY B 305 32.968 54.234 -19.468 1.00 17.93 O ATOM 10257 HA3 GLY B 305 32.736 54.245 -16.512 1.00 0.00 H ATOM 10258 HA2 GLY B 305 31.368 53.888 -17.592 1.00 0.00 H ATOM 10259 H GLY B 305 32.450 52.142 -15.618 1.00 0.00 H ATOM 10260 N ASP B 306 34.433 52.943 -18.345 1.00 17.97 N ATOM 10261 CA ASP B 306 35.442 52.941 -19.411 1.00 18.04 C ATOM 10262 C ASP B 306 34.895 52.420 -20.743 1.00 17.77 C ATOM 10263 O ASP B 306 35.082 53.057 -21.778 1.00 17.58 O ATOM 10264 CB ASP B 306 36.660 52.101 -19.010 1.00 17.84 C ATOM 10265 CG ASP B 306 37.544 52.780 -17.963 1.00 18.01 C ATOM 10266 OD1 ASP B 306 37.150 53.809 -17.353 1.00 16.94 O ATOM 10267 OD2 ASP B 306 38.654 52.253 -17.744 1.00 18.40 O ATOM 10268 HA ASP B 306 35.735 53.982 -19.549 1.00 0.00 H ATOM 10269 HB2 ASP B 306 36.308 51.153 -18.604 1.00 0.00 H ATOM 10270 HB3 ASP B 306 37.260 51.913 -19.901 1.00 0.00 H ATOM 10271 H ASP B 306 34.623 52.411 -17.472 1.00 0.00 H ATOM 10272 N VAL B 307 34.215 51.276 -20.708 1.00 17.75 N ATOM 10273 CA VAL B 307 33.707 50.650 -21.935 1.00 18.18 C ATOM 10274 C VAL B 307 32.423 51.301 -22.463 1.00 18.03 C ATOM 10275 O VAL B 307 32.160 51.282 -23.663 1.00 17.96 O ATOM 10276 CB VAL B 307 33.532 49.105 -21.797 1.00 18.40 C ATOM 10277 CG1 VAL B 307 34.897 48.448 -21.678 1.00 18.75 C ATOM 10278 CG2 VAL B 307 32.621 48.723 -20.614 1.00 18.47 C ATOM 10279 HA VAL B 307 34.482 50.828 -22.680 1.00 0.00 H ATOM 10280 HB VAL B 307 33.035 48.738 -22.695 1.00 0.00 H ATOM 10281 HG11 VAL B 307 35.484 48.669 -22.569 1.00 0.00 H ATOM 10282 HG12 VAL B 307 35.410 48.836 -20.798 1.00 0.00 H ATOM 10283 HG13 VAL B 307 34.773 47.369 -21.582 1.00 0.00 H ATOM 10284 HG21 VAL B 307 33.055 49.098 -19.687 1.00 0.00 H ATOM 10285 HG22 VAL B 307 31.635 49.163 -20.760 1.00 0.00 H ATOM 10286 HG23 VAL B 307 32.532 47.638 -20.561 1.00 0.00 H ATOM 10287 H VAL B 307 34.040 50.816 -19.792 1.00 0.00 H ATOM 10288 N LYS B 308 31.630 51.883 -21.573 1.00 18.22 N ATOM 10289 CA LYS B 308 30.455 52.647 -21.997 1.00 18.17 C ATOM 10290 C LYS B 308 30.878 53.815 -22.884 1.00 17.81 C ATOM 10291 O LYS B 308 30.254 54.081 -23.917 1.00 17.52 O ATOM 10292 CB LYS B 308 29.684 53.177 -20.788 1.00 18.78 C ATOM 10293 CG LYS B 308 28.185 53.194 -20.978 1.00 20.48 C ATOM 10294 CD LYS B 308 27.641 51.773 -21.048 1.00 21.67 C ATOM 10295 CE LYS B 308 26.214 51.674 -20.563 1.00 22.38 C ATOM 10296 NZ LYS B 308 25.789 50.247 -20.429 1.00 23.81 N ATOM 10297 HA LYS B 308 29.804 51.979 -22.562 1.00 0.00 H ATOM 10298 HB2 LYS B 308 29.914 52.546 -19.930 1.00 0.00 H ATOM 10299 HB3 LYS B 308 30.017 54.196 -20.588 1.00 0.00 H ATOM 10300 HG2 LYS B 308 27.723 53.715 -20.140 1.00 0.00 H ATOM 10301 HG3 LYS B 308 27.946 53.716 -21.905 1.00 0.00 H ATOM 10302 HD2 LYS B 308 27.683 51.433 -22.083 1.00 0.00 H ATOM 10303 HD3 LYS B 308 28.266 51.129 -20.430 1.00 0.00 H ATOM 10304 HE2 LYS B 308 25.560 52.175 -21.276 1.00 0.00 H ATOM 10305 HE3 LYS B 308 26.133 52.163 -19.592 1.00 0.00 H ATOM 10306 HZ1 LYS B 308 25.860 49.777 -21.354 1.00 0.00 H ATOM 10307 HZ2 LYS B 308 26.407 49.765 -19.746 1.00 0.00 H ATOM 10308 HZ3 LYS B 308 24.805 50.210 -20.094 1.00 0.00 H ATOM 10309 H LYS B 308 31.846 51.795 -20.559 1.00 0.00 H ATOM 10310 N GLU B 309 31.941 54.509 -22.474 1.00 17.15 N ATOM 10311 CA GLU B 309 32.468 55.619 -23.254 1.00 16.85 C ATOM 10312 C GLU B 309 33.119 55.103 -24.527 1.00 16.32 C ATOM 10313 O GLU B 309 32.989 55.721 -25.570 1.00 15.88 O ATOM 10314 CB GLU B 309 33.468 56.448 -22.452 1.00 16.66 C ATOM 10315 CG GLU B 309 34.118 57.574 -23.257 1.00 16.78 C ATOM 10316 CD GLU B 309 35.096 58.411 -22.451 1.00 17.29 C ATOM 10317 OE1 GLU B 309 35.534 57.974 -21.357 1.00 16.94 O ATOM 10318 OE2 GLU B 309 35.431 59.521 -22.924 1.00 18.35 O ATOM 10319 HA GLU B 309 31.631 56.268 -23.514 1.00 0.00 H ATOM 10320 HB2 GLU B 309 32.947 56.889 -21.602 1.00 0.00 H ATOM 10321 HB3 GLU B 309 34.254 55.785 -22.091 1.00 0.00 H ATOM 10322 HG2 GLU B 309 34.653 57.133 -24.098 1.00 0.00 H ATOM 10323 HG3 GLU B 309 33.331 58.229 -23.632 1.00 0.00 H ATOM 10324 H GLU B 309 32.403 54.251 -21.578 1.00 0.00 H ATOM 10325 N LEU B 310 33.812 53.975 -24.452 1.00 16.07 N ATOM 10326 CA LEU B 310 34.406 53.400 -25.666 1.00 16.24 C ATOM 10327 C LEU B 310 33.348 53.063 -26.713 1.00 15.98 C ATOM 10328 O LEU B 310 33.575 53.260 -27.908 1.00 16.05 O ATOM 10329 CB LEU B 310 35.245 52.164 -25.353 1.00 16.16 C ATOM 10330 CG LEU B 310 36.591 52.410 -24.667 1.00 16.17 C ATOM 10331 CD1 LEU B 310 37.385 51.117 -24.662 1.00 16.65 C ATOM 10332 CD2 LEU B 310 37.392 53.527 -25.324 1.00 16.11 C ATOM 10333 HA LEU B 310 35.062 54.166 -26.080 1.00 0.00 H ATOM 10334 HB2 LEU B 310 34.655 51.518 -24.703 1.00 0.00 H ATOM 10335 HB3 LEU B 310 35.441 51.649 -26.294 1.00 0.00 H ATOM 10336 HG LEU B 310 36.393 52.736 -23.646 1.00 0.00 H ATOM 10337 HD21 LEU B 310 37.590 53.267 -26.364 1.00 0.00 H ATOM 10338 HD22 LEU B 310 36.821 54.455 -25.282 1.00 0.00 H ATOM 10339 HD23 LEU B 310 38.336 53.655 -24.794 1.00 0.00 H ATOM 10340 HD11 LEU B 310 36.829 50.353 -24.119 1.00 0.00 H ATOM 10341 HD12 LEU B 310 37.549 50.789 -25.688 1.00 0.00 H ATOM 10342 HD13 LEU B 310 38.346 51.284 -24.175 1.00 0.00 H ATOM 10343 H LEU B 310 33.935 53.499 -23.536 1.00 0.00 H ATOM 10344 N ALA B 311 32.199 52.572 -26.257 1.00 15.69 N ATOM 10345 CA ALA B 311 31.095 52.245 -27.150 1.00 15.74 C ATOM 10346 C ALA B 311 30.531 53.517 -27.794 1.00 15.69 C ATOM 10347 O ALA B 311 30.239 53.540 -28.990 1.00 15.44 O ATOM 10348 CB ALA B 311 30.006 51.482 -26.400 1.00 15.31 C ATOM 10349 HA ALA B 311 31.471 51.601 -27.945 1.00 0.00 H ATOM 10350 HB1 ALA B 311 30.422 50.558 -25.999 1.00 0.00 H ATOM 10351 HB2 ALA B 311 29.630 52.098 -25.583 1.00 0.00 H ATOM 10352 HB3 ALA B 311 29.191 51.248 -27.085 1.00 0.00 H ATOM 10353 H ALA B 311 32.085 52.417 -25.235 1.00 0.00 H ATOM 10354 N ALA B 312 30.398 54.578 -27.002 1.00 15.63 N ATOM 10355 CA ALA B 312 29.907 55.853 -27.510 1.00 15.91 C ATOM 10356 C ALA B 312 30.856 56.416 -28.562 1.00 16.04 C ATOM 10357 O ALA B 312 30.409 56.952 -29.579 1.00 15.83 O ATOM 10358 CB ALA B 312 29.715 56.853 -26.370 1.00 15.79 C ATOM 10359 HA ALA B 312 28.939 55.680 -27.980 1.00 0.00 H ATOM 10360 HB1 ALA B 312 28.992 56.456 -25.658 1.00 0.00 H ATOM 10361 HB2 ALA B 312 30.669 57.017 -25.868 1.00 0.00 H ATOM 10362 HB3 ALA B 312 29.348 57.797 -26.774 1.00 0.00 H ATOM 10363 H ALA B 312 30.650 54.496 -25.996 1.00 0.00 H ATOM 10364 N ILE B 313 32.162 56.277 -28.326 1.00 16.52 N ATOM 10365 CA ILE B 313 33.166 56.772 -29.268 1.00 16.83 C ATOM 10366 C ILE B 313 32.984 56.036 -30.605 1.00 16.99 C ATOM 10367 O ILE B 313 32.995 56.665 -31.665 1.00 16.38 O ATOM 10368 CB ILE B 313 34.638 56.599 -28.759 1.00 16.91 C ATOM 10369 CG1 ILE B 313 35.031 57.537 -27.594 1.00 17.75 C ATOM 10370 CG2 ILE B 313 35.640 56.930 -29.874 1.00 16.67 C ATOM 10371 CD1 ILE B 313 33.938 58.063 -26.740 1.00 19.43 C ATOM 10372 HA ILE B 313 33.010 57.845 -29.382 1.00 0.00 H ATOM 10373 HB ILE B 313 34.674 55.561 -28.428 1.00 0.00 H ATOM 10374 HG12 ILE B 313 35.715 56.987 -26.948 1.00 0.00 H ATOM 10375 HG13 ILE B 313 35.550 58.393 -28.025 1.00 0.00 H ATOM 10376 HD11 ILE B 313 33.245 58.639 -27.353 1.00 0.00 H ATOM 10377 HD12 ILE B 313 33.409 57.231 -26.275 1.00 0.00 H ATOM 10378 HD13 ILE B 313 34.360 58.705 -25.966 1.00 0.00 H ATOM 10379 HG21 ILE B 313 35.477 56.260 -30.718 1.00 0.00 H ATOM 10380 HG22 ILE B 313 35.497 57.962 -30.195 1.00 0.00 H ATOM 10381 HG23 ILE B 313 36.655 56.803 -29.498 1.00 0.00 H ATOM 10382 H ILE B 313 32.473 55.806 -27.453 1.00 0.00 H ATOM 10383 N ARG B 314 32.811 54.715 -30.535 1.00 17.54 N ATOM 10384 CA ARG B 314 32.618 53.865 -31.725 1.00 18.15 C ATOM 10385 C ARG B 314 31.401 54.282 -32.539 1.00 18.63 C ATOM 10386 O ARG B 314 31.460 54.388 -33.760 1.00 18.20 O ATOM 10387 CB ARG B 314 32.408 52.404 -31.325 1.00 17.95 C ATOM 10388 CG ARG B 314 33.613 51.657 -30.824 1.00 17.97 C ATOM 10389 CD ARG B 314 33.223 50.193 -30.558 1.00 17.99 C ATOM 10390 NE ARG B 314 34.248 49.459 -29.824 1.00 17.58 N ATOM 10391 CZ ARG B 314 35.351 48.937 -30.361 1.00 17.62 C ATOM 10392 NH1 ARG B 314 35.613 49.048 -31.658 1.00 17.41 N ATOM 10393 NH2 ARG B 314 36.213 48.300 -29.581 1.00 18.39 N ATOM 10394 HA ARG B 314 33.521 53.983 -32.323 1.00 0.00 H ATOM 10395 HB2 ARG B 314 31.656 52.383 -30.537 1.00 0.00 H ATOM 10396 HB3 ARG B 314 32.031 51.874 -32.199 1.00 0.00 H ATOM 10397 HG2 ARG B 314 34.403 51.694 -31.574 1.00 0.00 H ATOM 10398 HG3 ARG B 314 33.968 52.114 -29.900 1.00 0.00 H ATOM 10399 HD2 ARG B 314 33.057 49.697 -31.514 1.00 0.00 H ATOM 10400 HD3 ARG B 314 32.301 50.178 -29.977 1.00 0.00 H ATOM 10401 HE ARG B 314 34.107 49.333 -28.801 1.00 0.00 H ATOM 10402 HH12 ARG B 314 36.481 48.631 -32.051 1.00 0.00 H ATOM 10403 HH11 ARG B 314 34.950 49.552 -32.281 1.00 0.00 H ATOM 10404 HH22 ARG B 314 37.077 47.889 -29.988 1.00 0.00 H ATOM 10405 HH21 ARG B 314 36.025 48.212 -28.562 1.00 0.00 H ATOM 10406 H ARG B 314 32.812 54.264 -29.598 1.00 0.00 H ATOM 10407 N GLU B 315 30.290 54.494 -31.846 1.00 19.80 N ATOM 10408 CA GLU B 315 29.036 54.843 -32.489 1.00 20.40 C ATOM 10409 C GLU B 315 29.149 56.207 -33.180 1.00 20.96 C ATOM 10410 O GLU B 315 28.674 56.384 -34.306 1.00 20.71 O ATOM 10411 CB GLU B 315 27.901 54.830 -31.456 1.00 20.72 C ATOM 10412 CG GLU B 315 26.490 54.917 -32.034 1.00 21.75 C ATOM 10413 CD GLU B 315 26.145 53.786 -33.012 1.00 24.81 C ATOM 10414 OE1 GLU B 315 26.798 52.711 -32.986 1.00 24.91 O ATOM 10415 OE2 GLU B 315 25.202 53.983 -33.816 1.00 27.03 O ATOM 10416 HA GLU B 315 28.808 54.104 -33.257 1.00 0.00 H ATOM 10417 HB2 GLU B 315 27.975 53.904 -30.886 1.00 0.00 H ATOM 10418 HB3 GLU B 315 28.044 55.679 -30.788 1.00 0.00 H ATOM 10419 HG2 GLU B 315 25.779 54.886 -31.209 1.00 0.00 H ATOM 10420 HG3 GLU B 315 26.393 55.867 -32.560 1.00 0.00 H ATOM 10421 H GLU B 315 30.318 54.408 -30.810 1.00 0.00 H ATOM 10422 N VAL B 316 29.802 57.155 -32.513 1.00 21.43 N ATOM 10423 CA VAL B 316 30.050 58.476 -33.091 1.00 21.94 C ATOM 10424 C VAL B 316 31.024 58.446 -34.280 1.00 22.32 C ATOM 10425 O VAL B 316 30.800 59.133 -35.280 1.00 21.97 O ATOM 10426 CB VAL B 316 30.589 59.453 -32.016 1.00 21.93 C ATOM 10427 CG1 VAL B 316 31.148 60.722 -32.645 1.00 21.77 C ATOM 10428 CG2 VAL B 316 29.485 59.794 -31.015 1.00 22.23 C ATOM 10429 HA VAL B 316 29.087 58.822 -33.465 1.00 0.00 H ATOM 10430 HB VAL B 316 31.406 58.958 -31.491 1.00 0.00 H ATOM 10431 HG11 VAL B 316 31.966 60.463 -33.318 1.00 0.00 H ATOM 10432 HG12 VAL B 316 30.360 61.225 -33.206 1.00 0.00 H ATOM 10433 HG13 VAL B 316 31.517 61.383 -31.861 1.00 0.00 H ATOM 10434 HG21 VAL B 316 28.652 60.263 -31.540 1.00 0.00 H ATOM 10435 HG22 VAL B 316 29.142 58.881 -30.529 1.00 0.00 H ATOM 10436 HG23 VAL B 316 29.876 60.481 -30.265 1.00 0.00 H ATOM 10437 H VAL B 316 30.146 56.951 -31.553 1.00 0.00 H ATOM 10438 N PHE B 317 32.103 57.672 -34.164 1.00 22.91 N ATOM 10439 CA PHE B 317 33.193 57.723 -35.147 1.00 23.77 C ATOM 10440 C PHE B 317 33.258 56.523 -36.097 1.00 24.55 C ATOM 10441 O PHE B 317 33.898 56.601 -37.137 1.00 24.80 O ATOM 10442 CB PHE B 317 34.546 57.891 -34.444 1.00 23.28 C ATOM 10443 CG PHE B 317 34.749 59.249 -33.827 1.00 22.88 C ATOM 10444 CD1 PHE B 317 34.592 59.439 -32.463 1.00 22.74 C ATOM 10445 CD2 PHE B 317 35.091 60.343 -34.614 1.00 22.73 C ATOM 10446 CE1 PHE B 317 34.773 60.697 -31.889 1.00 22.84 C ATOM 10447 CE2 PHE B 317 35.276 61.600 -34.049 1.00 22.27 C ATOM 10448 CZ PHE B 317 35.116 61.777 -32.686 1.00 22.58 C ATOM 10449 HA PHE B 317 32.970 58.590 -35.768 1.00 0.00 H ATOM 10450 HB2 PHE B 317 34.619 57.141 -33.656 1.00 0.00 H ATOM 10451 HB3 PHE B 317 35.336 57.725 -35.176 1.00 0.00 H ATOM 10452 HD2 PHE B 317 35.216 60.213 -35.689 1.00 0.00 H ATOM 10453 HE2 PHE B 317 35.547 62.446 -34.680 1.00 0.00 H ATOM 10454 HZ PHE B 317 35.259 62.762 -32.241 1.00 0.00 H ATOM 10455 HE1 PHE B 317 34.645 60.830 -30.815 1.00 0.00 H ATOM 10456 HD1 PHE B 317 34.323 58.593 -31.830 1.00 0.00 H ATOM 10457 H PHE B 317 32.175 57.017 -33.359 1.00 0.00 H ATOM 10458 N GLY B 318 32.609 55.419 -35.744 1.00 25.70 N ATOM 10459 CA GLY B 318 32.635 54.214 -36.572 1.00 26.32 C ATOM 10460 C GLY B 318 34.043 53.736 -36.883 1.00 27.18 C ATOM 10461 O GLY B 318 34.832 53.462 -35.974 1.00 27.59 O ATOM 10462 HA3 GLY B 318 32.125 54.427 -37.511 1.00 0.00 H ATOM 10463 HA2 GLY B 318 32.107 53.419 -36.045 1.00 0.00 H ATOM 10464 H GLY B 318 32.068 55.411 -34.856 1.00 0.00 H ATOM 10465 N ASP B 319 34.358 53.654 -38.173 1.00 27.87 N ATOM 10466 CA ASP B 319 35.653 53.165 -38.634 1.00 28.21 C ATOM 10467 C ASP B 319 36.659 54.293 -38.880 1.00 28.44 C ATOM 10468 O ASP B 319 37.743 54.042 -39.402 1.00 28.85 O ATOM 10469 CB ASP B 319 35.477 52.318 -39.907 1.00 28.83 C ATOM 10470 CG ASP B 319 34.786 50.964 -39.639 1.00 30.09 C ATOM 10471 OD1 ASP B 319 33.959 50.548 -40.481 1.00 31.80 O ATOM 10472 OD2 ASP B 319 35.075 50.313 -38.604 1.00 32.05 O ATOM 10473 HA ASP B 319 36.063 52.546 -37.836 1.00 0.00 H ATOM 10474 HB2 ASP B 319 34.874 52.881 -40.619 1.00 0.00 H ATOM 10475 HB3 ASP B 319 36.460 52.128 -40.337 1.00 0.00 H ATOM 10476 H ASP B 319 33.654 53.950 -38.880 1.00 0.00 H ATOM 10477 N LYS B 320 36.315 55.525 -38.502 1.00 28.41 N ATOM 10478 CA LYS B 320 37.286 56.631 -38.516 1.00 28.14 C ATOM 10479 C LYS B 320 37.586 57.142 -37.101 1.00 27.59 C ATOM 10480 O LYS B 320 37.737 58.345 -36.886 1.00 28.03 O ATOM 10481 CB LYS B 320 36.823 57.772 -39.444 1.00 29.15 C ATOM 10482 CG LYS B 320 35.475 58.434 -39.085 1.00 30.62 C ATOM 10483 CD LYS B 320 35.623 59.875 -38.577 1.00 31.93 C ATOM 10484 CE LYS B 320 34.257 60.525 -38.348 1.00 32.12 C ATOM 10485 NZ LYS B 320 33.485 60.689 -39.615 1.00 33.19 N ATOM 10486 HA LYS B 320 38.219 56.238 -38.919 1.00 0.00 H ATOM 10487 HB2 LYS B 320 37.590 58.547 -39.428 1.00 0.00 H ATOM 10488 HB3 LYS B 320 36.738 57.368 -40.453 1.00 0.00 H ATOM 10489 HG2 LYS B 320 34.846 58.443 -39.975 1.00 0.00 H ATOM 10490 HG3 LYS B 320 34.994 57.840 -38.308 1.00 0.00 H ATOM 10491 HD2 LYS B 320 36.175 59.866 -37.637 1.00 0.00 H ATOM 10492 HD3 LYS B 320 36.175 60.457 -39.315 1.00 0.00 H ATOM 10493 HE2 LYS B 320 34.407 61.507 -37.900 1.00 0.00 H ATOM 10494 HE3 LYS B 320 33.681 59.900 -37.666 1.00 0.00 H ATOM 10495 HZ1 LYS B 320 34.022 61.291 -40.271 1.00 0.00 H ATOM 10496 HZ2 LYS B 320 33.329 59.756 -40.048 1.00 0.00 H ATOM 10497 HZ3 LYS B 320 32.568 61.133 -39.406 1.00 0.00 H ATOM 10498 H LYS B 320 35.340 55.708 -38.191 1.00 0.00 H ATOM 10499 N SER B 321 37.714 56.220 -36.146 1.00 26.37 N ATOM 10500 CA SER B 321 37.937 56.593 -34.745 1.00 25.44 C ATOM 10501 C SER B 321 39.348 57.134 -34.522 1.00 24.33 C ATOM 10502 O SER B 321 40.311 56.627 -35.093 1.00 24.46 O ATOM 10503 CB SER B 321 37.680 55.410 -33.805 1.00 25.63 C ATOM 10504 OG SER B 321 38.667 54.407 -33.971 1.00 26.21 O ATOM 10505 HA SER B 321 37.225 57.385 -34.514 1.00 0.00 H ATOM 10506 HB2 SER B 321 36.700 54.986 -34.024 1.00 0.00 H ATOM 10507 HB3 SER B 321 37.699 55.763 -32.774 1.00 0.00 H ATOM 10508 HG SER B 321 39.559 54.786 -33.769 1.00 0.00 H ATOM 10509 H SER B 321 37.654 55.213 -36.400 1.00 0.00 H ATOM 10510 N PRO B 322 39.476 58.154 -33.666 1.00 22.82 N ATOM 10511 CA PRO B 322 40.746 58.828 -33.548 1.00 21.91 C ATOM 10512 C PRO B 322 41.684 58.152 -32.550 1.00 20.77 C ATOM 10513 O PRO B 322 41.301 57.187 -31.882 1.00 20.29 O ATOM 10514 CB PRO B 322 40.337 60.216 -33.058 1.00 21.93 C ATOM 10515 CG PRO B 322 39.129 59.977 -32.229 1.00 22.50 C ATOM 10516 CD PRO B 322 38.472 58.721 -32.745 1.00 22.80 C ATOM 10517 HA PRO B 322 41.306 58.829 -34.483 1.00 0.00 H ATOM 10518 HD3 PRO B 322 38.258 58.030 -31.929 1.00 0.00 H ATOM 10519 HD2 PRO B 322 37.548 58.954 -33.273 1.00 0.00 H ATOM 10520 HG3 PRO B 322 38.443 60.820 -32.316 1.00 0.00 H ATOM 10521 HG2 PRO B 322 39.413 59.848 -31.184 1.00 0.00 H ATOM 10522 HB2 PRO B 322 41.132 60.664 -32.461 1.00 0.00 H ATOM 10523 HB3 PRO B 322 40.104 60.869 -33.899 1.00 0.00 H ATOM 10524 N ALA B 323 42.914 58.653 -32.474 1.00 19.82 N ATOM 10525 CA ALA B 323 43.843 58.247 -31.421 1.00 19.13 C ATOM 10526 C ALA B 323 43.234 58.608 -30.055 1.00 18.11 C ATOM 10527 O ALA B 323 42.766 59.722 -29.864 1.00 17.60 O ATOM 10528 CB ALA B 323 45.190 58.928 -31.616 1.00 19.10 C ATOM 10529 HA ALA B 323 44.007 57.170 -31.465 1.00 0.00 H ATOM 10530 HB1 ALA B 323 45.602 58.645 -32.585 1.00 0.00 H ATOM 10531 HB2 ALA B 323 45.058 60.009 -31.578 1.00 0.00 H ATOM 10532 HB3 ALA B 323 45.871 58.616 -30.824 1.00 0.00 H ATOM 10533 H ALA B 323 43.222 59.351 -33.181 1.00 0.00 H ATOM 10534 N ILE B 324 43.192 57.644 -29.138 1.00 17.45 N ATOM 10535 CA ILE B 324 42.601 57.842 -27.804 1.00 17.04 C ATOM 10536 C ILE B 324 43.656 57.638 -26.719 1.00 16.34 C ATOM 10537 O ILE B 324 44.450 56.699 -26.803 1.00 16.19 O ATOM 10538 CB ILE B 324 41.477 56.797 -27.483 1.00 17.06 C ATOM 10539 CG1 ILE B 324 40.328 56.779 -28.514 1.00 17.72 C ATOM 10540 CG2 ILE B 324 40.925 56.992 -26.059 1.00 17.14 C ATOM 10541 CD1 ILE B 324 40.043 58.067 -29.174 1.00 19.57 C ATOM 10542 HA ILE B 324 42.195 58.853 -27.814 1.00 0.00 H ATOM 10543 HB ILE B 324 41.959 55.821 -27.548 1.00 0.00 H ATOM 10544 HG12 ILE B 324 40.583 56.055 -29.288 1.00 0.00 H ATOM 10545 HG13 ILE B 324 39.422 56.457 -28.001 1.00 0.00 H ATOM 10546 HD11 ILE B 324 39.769 58.806 -28.422 1.00 0.00 H ATOM 10547 HD12 ILE B 324 40.931 58.404 -29.710 1.00 0.00 H ATOM 10548 HD13 ILE B 324 39.220 57.939 -29.877 1.00 0.00 H ATOM 10549 HG21 ILE B 324 41.732 56.868 -25.337 1.00 0.00 H ATOM 10550 HG22 ILE B 324 40.505 57.994 -25.967 1.00 0.00 H ATOM 10551 HG23 ILE B 324 40.148 56.252 -25.868 1.00 0.00 H ATOM 10552 H ILE B 324 43.593 56.714 -29.373 1.00 0.00 H ATOM 10553 N SER B 325 43.646 58.490 -25.693 1.00 15.54 N ATOM 10554 CA SER B 325 44.295 58.153 -24.420 1.00 15.27 C ATOM 10555 C SER B 325 43.562 58.743 -23.207 1.00 14.90 C ATOM 10556 O SER B 325 42.948 59.810 -23.289 1.00 14.74 O ATOM 10557 CB SER B 325 45.776 58.555 -24.409 1.00 15.15 C ATOM 10558 OG SER B 325 45.947 59.949 -24.271 1.00 14.95 O ATOM 10559 HA SER B 325 44.239 57.068 -24.334 1.00 0.00 H ATOM 10560 HB2 SER B 325 46.234 58.235 -25.345 1.00 0.00 H ATOM 10561 HB3 SER B 325 46.270 58.056 -23.575 1.00 0.00 H ATOM 10562 HG SER B 325 46.914 60.163 -24.269 1.00 0.00 H ATOM 10563 H SER B 325 43.170 59.409 -25.797 1.00 0.00 H ATOM 10564 N ALA B 326 43.630 58.015 -22.092 1.00 14.39 N ATOM 10565 CA ALA B 326 43.040 58.432 -20.827 1.00 14.06 C ATOM 10566 C ALA B 326 44.138 58.907 -19.890 1.00 13.88 C ATOM 10567 O ALA B 326 44.834 58.091 -19.274 1.00 13.82 O ATOM 10568 CB ALA B 326 42.299 57.289 -20.200 1.00 14.02 C ATOM 10569 HA ALA B 326 42.339 59.246 -21.011 1.00 0.00 H ATOM 10570 HB1 ALA B 326 41.507 56.959 -20.872 1.00 0.00 H ATOM 10571 HB2 ALA B 326 42.990 56.466 -20.018 1.00 0.00 H ATOM 10572 HB3 ALA B 326 41.863 57.615 -19.255 1.00 0.00 H ATOM 10573 H ALA B 326 44.129 57.103 -22.127 1.00 0.00 H ATOM 10574 N THR B 327 44.280 60.226 -19.769 1.00 13.27 N ATOM 10575 CA THR B 327 45.330 60.801 -18.935 1.00 13.14 C ATOM 10576 C THR B 327 45.101 60.618 -17.429 1.00 12.83 C ATOM 10577 O THR B 327 46.035 60.770 -16.653 1.00 12.52 O ATOM 10578 CB THR B 327 45.567 62.290 -19.259 1.00 12.87 C ATOM 10579 OG1 THR B 327 44.338 63.016 -19.181 1.00 11.80 O ATOM 10580 CG2 THR B 327 46.154 62.425 -20.652 1.00 13.54 C ATOM 10581 HA THR B 327 46.227 60.234 -19.186 1.00 0.00 H ATOM 10582 HB THR B 327 46.266 62.701 -18.531 1.00 0.00 H ATOM 10583 HG1 THR B 327 43.968 62.939 -18.266 1.00 0.00 H ATOM 10584 HG23 THR B 327 47.090 61.870 -20.706 1.00 0.00 H ATOM 10585 HG21 THR B 327 45.450 62.025 -21.382 1.00 0.00 H ATOM 10586 HG22 THR B 327 46.341 63.477 -20.866 1.00 0.00 H ATOM 10587 H THR B 327 43.630 60.858 -20.279 1.00 0.00 H ATOM 10588 N LYS B 328 43.875 60.280 -17.027 1.00 12.75 N ATOM 10589 CA LYS B 328 43.589 59.922 -15.636 1.00 12.77 C ATOM 10590 C LYS B 328 44.373 58.705 -15.140 1.00 12.81 C ATOM 10591 O LYS B 328 44.529 58.527 -13.932 1.00 12.94 O ATOM 10592 CB LYS B 328 42.091 59.687 -15.424 1.00 12.77 C ATOM 10593 CG LYS B 328 41.262 60.955 -15.492 1.00 12.49 C ATOM 10594 CD LYS B 328 39.842 60.707 -15.024 1.00 12.43 C ATOM 10595 CE LYS B 328 38.981 61.969 -15.131 1.00 12.60 C ATOM 10596 NZ LYS B 328 38.758 62.388 -16.544 1.00 10.53 N ATOM 10597 HA LYS B 328 43.918 60.777 -15.045 1.00 0.00 H ATOM 10598 HB2 LYS B 328 41.737 59.002 -16.194 1.00 0.00 H ATOM 10599 HB3 LYS B 328 41.948 59.234 -14.443 1.00 0.00 H ATOM 10600 HG2 LYS B 328 41.719 61.713 -14.856 1.00 0.00 H ATOM 10601 HG3 LYS B 328 41.240 61.311 -16.522 1.00 0.00 H ATOM 10602 HD2 LYS B 328 39.399 59.924 -15.639 1.00 0.00 H ATOM 10603 HD3 LYS B 328 39.864 60.382 -13.984 1.00 0.00 H ATOM 10604 HE2 LYS B 328 39.480 62.780 -14.600 1.00 0.00 H ATOM 10605 HE3 LYS B 328 38.014 61.774 -14.667 1.00 0.00 H ATOM 10606 HZ1 LYS B 328 39.674 62.585 -16.995 1.00 0.00 H ATOM 10607 HZ2 LYS B 328 38.274 61.624 -17.059 1.00 0.00 H ATOM 10608 HZ3 LYS B 328 38.170 63.246 -16.561 1.00 0.00 H ATOM 10609 H LYS B 328 43.100 60.270 -17.721 1.00 0.00 H ATOM 10610 N ALA B 329 44.860 57.865 -16.051 1.00 12.98 N ATOM 10611 CA ALA B 329 45.752 56.764 -15.661 1.00 13.27 C ATOM 10612 C ALA B 329 47.046 57.300 -15.033 1.00 13.25 C ATOM 10613 O ALA B 329 47.658 56.628 -14.207 1.00 12.64 O ATOM 10614 CB ALA B 329 46.067 55.862 -16.857 1.00 13.35 C ATOM 10615 HA ALA B 329 45.233 56.166 -14.912 1.00 0.00 H ATOM 10616 HB1 ALA B 329 45.140 55.440 -17.246 1.00 0.00 H ATOM 10617 HB2 ALA B 329 46.555 56.449 -17.635 1.00 0.00 H ATOM 10618 HB3 ALA B 329 46.729 55.056 -16.539 1.00 0.00 H ATOM 10619 H ALA B 329 44.606 57.990 -17.052 1.00 0.00 H ATOM 10620 N MET B 330 47.448 58.506 -15.439 1.00 13.52 N ATOM 10621 CA MET B 330 48.559 59.235 -14.813 1.00 14.03 C ATOM 10622 C MET B 330 48.126 60.105 -13.627 1.00 13.68 C ATOM 10623 O MET B 330 48.777 60.095 -12.584 1.00 13.62 O ATOM 10624 CB MET B 330 49.234 60.165 -15.829 1.00 14.14 C ATOM 10625 CG MET B 330 50.136 59.490 -16.836 1.00 15.10 C ATOM 10626 SD MET B 330 50.814 60.717 -17.978 1.00 16.65 S ATOM 10627 CE MET B 330 49.489 60.804 -19.173 1.00 17.01 C ATOM 10628 HA MET B 330 49.241 58.464 -14.454 1.00 0.00 H ATOM 10629 HB2 MET B 330 48.450 60.687 -16.378 1.00 0.00 H ATOM 10630 HB3 MET B 330 49.832 60.889 -15.275 1.00 0.00 H ATOM 10631 HG2 MET B 330 49.563 58.752 -17.397 1.00 0.00 H ATOM 10632 HG3 MET B 330 50.953 58.993 -16.313 1.00 0.00 H ATOM 10633 HE1 MET B 330 49.339 59.821 -19.619 1.00 0.00 H ATOM 10634 HE2 MET B 330 48.573 61.122 -18.675 1.00 0.00 H ATOM 10635 HE3 MET B 330 49.750 61.522 -19.951 1.00 0.00 H ATOM 10636 H MET B 330 46.951 58.951 -16.237 1.00 0.00 H ATOM 10637 N THR B 331 47.053 60.879 -13.809 1.00 13.43 N ATOM 10638 CA THR B 331 46.738 61.996 -12.913 1.00 13.29 C ATOM 10639 C THR B 331 45.778 61.662 -11.782 1.00 13.24 C ATOM 10640 O THR B 331 45.736 62.370 -10.786 1.00 13.54 O ATOM 10641 CB THR B 331 46.096 63.193 -13.677 1.00 13.27 C ATOM 10642 OG1 THR B 331 44.787 62.835 -14.146 1.00 12.13 O ATOM 10643 CG2 THR B 331 46.961 63.633 -14.852 1.00 13.08 C ATOM 10644 HA THR B 331 47.712 62.247 -12.493 1.00 0.00 H ATOM 10645 HB THR B 331 46.018 64.028 -12.981 1.00 0.00 H ATOM 10646 HG1 THR B 331 44.215 62.597 -13.374 1.00 0.00 H ATOM 10647 HG23 THR B 331 47.953 63.903 -14.490 1.00 0.00 H ATOM 10648 HG21 THR B 331 47.044 62.814 -15.567 1.00 0.00 H ATOM 10649 HG22 THR B 331 46.502 64.495 -15.337 1.00 0.00 H ATOM 10650 H THR B 331 46.421 60.683 -14.611 1.00 0.00 H ATOM 10651 N GLY B 332 44.998 60.601 -11.935 1.00 13.22 N ATOM 10652 CA GLY B 332 43.841 60.402 -11.080 1.00 13.21 C ATOM 10653 C GLY B 332 42.712 61.307 -11.545 1.00 13.25 C ATOM 10654 O GLY B 332 42.841 62.032 -12.540 1.00 13.08 O ATOM 10655 HA3 GLY B 332 44.103 60.645 -10.050 1.00 0.00 H ATOM 10656 HA2 GLY B 332 43.521 59.362 -11.136 1.00 0.00 H ATOM 10657 H GLY B 332 45.217 59.904 -12.675 1.00 0.00 H ATOM 10658 N HIS B 333 41.605 61.253 -10.812 1.00 13.32 N ATOM 10659 CA HIS B 333 40.352 61.916 -11.172 1.00 13.29 C ATOM 10660 C HIS B 333 40.126 63.111 -10.256 1.00 13.19 C ATOM 10661 O HIS B 333 39.767 62.931 -9.092 1.00 12.81 O ATOM 10662 CB HIS B 333 39.200 60.914 -11.003 1.00 13.33 C ATOM 10663 CG HIS B 333 37.893 61.375 -11.570 1.00 13.34 C ATOM 10664 ND1 HIS B 333 37.664 62.675 -11.966 1.00 13.77 N ATOM 10665 CD2 HIS B 333 36.737 60.706 -11.791 1.00 13.11 C ATOM 10666 CE1 HIS B 333 36.428 62.784 -12.418 1.00 13.60 C ATOM 10667 NE2 HIS B 333 35.843 61.605 -12.320 1.00 13.33 N ATOM 10668 HA HIS B 333 40.397 62.262 -12.205 1.00 0.00 H ATOM 10669 HB2 HIS B 333 39.479 59.985 -11.500 1.00 0.00 H ATOM 10670 HB3 HIS B 333 39.063 60.727 -9.938 1.00 0.00 H ATOM 10671 HD2 HIS B 333 36.551 59.652 -11.587 1.00 0.00 H ATOM 10672 HE1 HIS B 333 35.969 63.693 -12.806 1.00 0.00 H ATOM 10673 H HIS B 333 41.631 60.706 -9.928 1.00 0.00 H ATOM 10674 N SER B 334 40.322 64.322 -10.778 1.00 13.38 N ATOM 10675 CA SER B 334 40.175 65.552 -9.977 1.00 13.76 C ATOM 10676 C SER B 334 38.749 66.131 -9.976 1.00 13.93 C ATOM 10677 O SER B 334 38.538 67.272 -9.564 1.00 13.68 O ATOM 10678 CB SER B 334 41.181 66.616 -10.427 1.00 13.73 C ATOM 10679 OG SER B 334 41.033 66.935 -11.801 1.00 14.03 O ATOM 10680 HA SER B 334 40.384 65.260 -8.948 1.00 0.00 H ATOM 10681 HB2 SER B 334 42.190 66.241 -10.259 1.00 0.00 H ATOM 10682 HB3 SER B 334 41.027 67.519 -9.836 1.00 0.00 H ATOM 10683 HG SER B 334 41.178 66.121 -12.345 1.00 0.00 H ATOM 10684 H SER B 334 40.587 64.402 -11.781 1.00 0.00 H ATOM 10685 N LEU B 335 37.786 65.333 -10.431 1.00 14.32 N ATOM 10686 CA LEU B 335 36.357 65.640 -10.311 1.00 14.61 C ATOM 10687 C LEU B 335 36.017 66.975 -10.989 1.00 14.90 C ATOM 10688 O LEU B 335 36.181 67.102 -12.209 1.00 15.66 O ATOM 10689 CB LEU B 335 35.926 65.581 -8.836 1.00 14.83 C ATOM 10690 CG LEU B 335 36.351 64.298 -8.106 1.00 15.97 C ATOM 10691 CD1 LEU B 335 36.206 64.449 -6.606 1.00 16.36 C ATOM 10692 CD2 LEU B 335 35.581 63.075 -8.599 1.00 16.70 C ATOM 10693 HA LEU B 335 35.781 64.882 -10.842 1.00 0.00 H ATOM 10694 HB2 LEU B 335 36.367 66.432 -8.317 1.00 0.00 H ATOM 10695 HB3 LEU B 335 34.839 65.654 -8.794 1.00 0.00 H ATOM 10696 HG LEU B 335 37.404 64.137 -8.337 1.00 0.00 H ATOM 10697 HD21 LEU B 335 34.515 63.226 -8.429 1.00 0.00 H ATOM 10698 HD22 LEU B 335 35.765 62.937 -9.665 1.00 0.00 H ATOM 10699 HD23 LEU B 335 35.916 62.192 -8.054 1.00 0.00 H ATOM 10700 HD11 LEU B 335 36.835 65.270 -6.262 1.00 0.00 H ATOM 10701 HD12 LEU B 335 35.165 64.660 -6.362 1.00 0.00 H ATOM 10702 HD13 LEU B 335 36.514 63.525 -6.118 1.00 0.00 H ATOM 10703 H LEU B 335 38.061 64.445 -10.896 1.00 0.00 H ATOM 10704 N GLY B 336 35.565 67.968 -10.226 1.00 14.64 N ATOM 10705 CA GLY B 336 35.223 69.263 -10.789 1.00 14.46 C ATOM 10706 C GLY B 336 36.324 69.917 -11.613 1.00 14.59 C ATOM 10707 O GLY B 336 36.029 70.635 -12.573 1.00 14.96 O ATOM 10708 HA3 GLY B 336 34.971 69.934 -9.967 1.00 0.00 H ATOM 10709 HA2 GLY B 336 34.351 69.134 -11.431 1.00 0.00 H ATOM 10710 H GLY B 336 35.454 67.813 -9.204 1.00 0.00 H ATOM 10711 N ALA B 337 37.584 69.668 -11.244 1.00 14.06 N ATOM 10712 CA ALA B 337 38.738 70.280 -11.902 1.00 13.66 C ATOM 10713 C ALA B 337 39.203 69.519 -13.143 1.00 13.55 C ATOM 10714 O ALA B 337 40.018 70.032 -13.911 1.00 13.77 O ATOM 10715 CB ALA B 337 39.888 70.406 -10.921 1.00 13.78 C ATOM 10716 HA ALA B 337 38.415 71.265 -12.238 1.00 0.00 H ATOM 10717 HB1 ALA B 337 39.581 71.029 -10.081 1.00 0.00 H ATOM 10718 HB2 ALA B 337 40.165 69.416 -10.558 1.00 0.00 H ATOM 10719 HB3 ALA B 337 40.742 70.863 -11.421 1.00 0.00 H ATOM 10720 H ALA B 337 37.751 69.011 -10.455 1.00 0.00 H ATOM 10721 N ALA B 338 38.677 68.310 -13.337 1.00 13.29 N ATOM 10722 CA ALA B 338 39.099 67.421 -14.420 1.00 12.83 C ATOM 10723 C ALA B 338 38.903 68.016 -15.814 1.00 12.64 C ATOM 10724 O ALA B 338 39.783 67.904 -16.662 1.00 12.63 O ATOM 10725 CB ALA B 338 38.357 66.102 -14.315 1.00 12.98 C ATOM 10726 HA ALA B 338 40.172 67.270 -14.298 1.00 0.00 H ATOM 10727 HB1 ALA B 338 38.581 65.636 -13.355 1.00 0.00 H ATOM 10728 HB2 ALA B 338 37.285 66.283 -14.391 1.00 0.00 H ATOM 10729 HB3 ALA B 338 38.674 65.443 -15.123 1.00 0.00 H ATOM 10730 H ALA B 338 37.932 67.983 -12.689 1.00 0.00 H ATOM 10731 N GLY B 339 37.750 68.641 -16.049 1.00 12.23 N ATOM 10732 CA GLY B 339 37.437 69.231 -17.351 1.00 11.83 C ATOM 10733 C GLY B 339 38.442 70.275 -17.826 1.00 11.45 C ATOM 10734 O GLY B 339 38.904 70.243 -18.970 1.00 11.39 O ATOM 10735 HA3 GLY B 339 36.458 69.705 -17.285 1.00 0.00 H ATOM 10736 HA2 GLY B 339 37.402 68.430 -18.089 1.00 0.00 H ATOM 10737 H GLY B 339 37.050 68.712 -15.283 1.00 0.00 H ATOM 10738 N VAL B 340 38.783 71.211 -16.954 1.00 10.75 N ATOM 10739 CA VAL B 340 39.737 72.255 -17.326 1.00 10.37 C ATOM 10740 C VAL B 340 41.173 71.709 -17.395 1.00 9.94 C ATOM 10741 O VAL B 340 41.939 72.078 -18.293 1.00 9.39 O ATOM 10742 CB VAL B 340 39.631 73.506 -16.420 1.00 10.08 C ATOM 10743 CG1 VAL B 340 39.932 73.188 -14.946 1.00 9.60 C ATOM 10744 CG2 VAL B 340 40.532 74.615 -16.953 1.00 10.40 C ATOM 10745 HA VAL B 340 39.468 72.585 -18.330 1.00 0.00 H ATOM 10746 HB VAL B 340 38.598 73.853 -16.449 1.00 0.00 H ATOM 10747 HG11 VAL B 340 39.220 72.447 -14.583 1.00 0.00 H ATOM 10748 HG12 VAL B 340 40.945 72.794 -14.860 1.00 0.00 H ATOM 10749 HG13 VAL B 340 39.844 74.099 -14.354 1.00 0.00 H ATOM 10750 HG21 VAL B 340 41.565 74.268 -16.966 1.00 0.00 H ATOM 10751 HG22 VAL B 340 40.223 74.877 -17.965 1.00 0.00 H ATOM 10752 HG23 VAL B 340 40.449 75.490 -16.308 1.00 0.00 H ATOM 10753 H VAL B 340 38.370 71.204 -15.999 1.00 0.00 H ATOM 10754 N GLN B 341 41.524 70.820 -16.469 1.00 9.75 N ATOM 10755 CA GLN B 341 42.851 70.201 -16.484 1.00 9.91 C ATOM 10756 C GLN B 341 43.068 69.376 -17.744 1.00 9.68 C ATOM 10757 O GLN B 341 44.144 69.417 -18.350 1.00 9.17 O ATOM 10758 CB GLN B 341 43.075 69.342 -15.237 1.00 9.82 C ATOM 10759 CG GLN B 341 43.196 70.180 -13.976 1.00 10.00 C ATOM 10760 CD GLN B 341 43.578 69.393 -12.735 1.00 9.90 C ATOM 10761 OE1 GLN B 341 44.201 69.944 -11.826 1.00 13.74 O ATOM 10762 NE2 GLN B 341 43.211 68.124 -12.680 1.00 7.61 N ATOM 10763 HA GLN B 341 43.583 71.008 -16.480 1.00 0.00 H ATOM 10764 HB2 GLN B 341 42.233 68.659 -15.125 1.00 0.00 H ATOM 10765 HB3 GLN B 341 43.992 68.768 -15.366 1.00 0.00 H ATOM 10766 HG2 GLN B 341 43.957 70.942 -14.144 1.00 0.00 H ATOM 10767 HG3 GLN B 341 42.235 70.661 -13.793 1.00 0.00 H ATOM 10768 HE22 GLN B 341 42.686 67.700 -13.471 1.00 0.00 H ATOM 10769 HE21 GLN B 341 43.447 67.550 -11.846 1.00 0.00 H ATOM 10770 H GLN B 341 40.846 70.561 -15.724 1.00 0.00 H ATOM 10771 N GLU B 342 42.043 68.634 -18.145 1.00 9.78 N ATOM 10772 CA GLU B 342 42.159 67.782 -19.324 1.00 10.33 C ATOM 10773 C GLU B 342 42.083 68.563 -20.630 1.00 10.02 C ATOM 10774 O GLU B 342 42.753 68.213 -21.599 1.00 10.10 O ATOM 10775 CB GLU B 342 41.144 66.652 -19.259 1.00 10.51 C ATOM 10776 CG GLU B 342 41.596 65.599 -18.264 1.00 11.66 C ATOM 10777 CD GLU B 342 40.481 64.731 -17.757 1.00 12.40 C ATOM 10778 OE1 GLU B 342 39.404 64.683 -18.400 1.00 14.08 O ATOM 10779 OE2 GLU B 342 40.699 64.092 -16.702 1.00 15.95 O ATOM 10780 HA GLU B 342 43.156 67.340 -19.316 1.00 0.00 H ATOM 10781 HB2 GLU B 342 40.179 67.052 -18.947 1.00 0.00 H ATOM 10782 HB3 GLU B 342 41.046 66.198 -20.245 1.00 0.00 H ATOM 10783 HG2 GLU B 342 42.336 64.962 -18.749 1.00 0.00 H ATOM 10784 HG3 GLU B 342 42.054 66.103 -17.413 1.00 0.00 H ATOM 10785 H GLU B 342 41.149 68.660 -17.614 1.00 0.00 H ATOM 10786 N ALA B 343 41.292 69.631 -20.652 1.00 9.87 N ATOM 10787 CA ALA B 343 41.369 70.600 -21.748 1.00 9.77 C ATOM 10788 C ALA B 343 42.789 71.140 -21.871 1.00 9.62 C ATOM 10789 O ALA B 343 43.337 71.210 -22.970 1.00 9.59 O ATOM 10790 CB ALA B 343 40.399 71.747 -21.529 1.00 9.74 C ATOM 10791 HA ALA B 343 41.096 70.090 -22.672 1.00 0.00 H ATOM 10792 HB1 ALA B 343 39.383 71.357 -21.477 1.00 0.00 H ATOM 10793 HB2 ALA B 343 40.643 72.254 -20.595 1.00 0.00 H ATOM 10794 HB3 ALA B 343 40.478 72.451 -22.358 1.00 0.00 H ATOM 10795 H ALA B 343 40.610 69.781 -19.881 1.00 0.00 H ATOM 10796 N ILE B 344 43.392 71.496 -20.737 1.00 9.72 N ATOM 10797 CA ILE B 344 44.773 71.986 -20.721 1.00 9.53 C ATOM 10798 C ILE B 344 45.771 70.930 -21.216 1.00 9.48 C ATOM 10799 O ILE B 344 46.638 71.237 -22.031 1.00 9.67 O ATOM 10800 CB ILE B 344 45.153 72.559 -19.336 1.00 9.64 C ATOM 10801 CG1 ILE B 344 44.494 73.937 -19.166 1.00 9.50 C ATOM 10802 CG2 ILE B 344 46.683 72.707 -19.179 1.00 9.54 C ATOM 10803 CD1 ILE B 344 44.569 74.527 -17.744 1.00 9.37 C ATOM 10804 HA ILE B 344 44.832 72.810 -21.432 1.00 0.00 H ATOM 10805 HB ILE B 344 44.801 71.865 -18.573 1.00 0.00 H ATOM 10806 HG12 ILE B 344 44.985 74.633 -19.847 1.00 0.00 H ATOM 10807 HG13 ILE B 344 43.443 73.845 -19.439 1.00 0.00 H ATOM 10808 HD11 ILE B 344 44.070 73.855 -17.046 1.00 0.00 H ATOM 10809 HD12 ILE B 344 45.614 74.643 -17.455 1.00 0.00 H ATOM 10810 HD13 ILE B 344 44.076 75.499 -17.729 1.00 0.00 H ATOM 10811 HG21 ILE B 344 47.154 71.730 -19.288 1.00 0.00 H ATOM 10812 HG22 ILE B 344 47.062 73.382 -19.946 1.00 0.00 H ATOM 10813 HG23 ILE B 344 46.908 73.113 -18.193 1.00 0.00 H ATOM 10814 H ILE B 344 42.869 71.424 -19.841 1.00 0.00 H ATOM 10815 N TYR B 345 45.634 69.690 -20.762 1.00 9.51 N ATOM 10816 CA TYR B 345 46.493 68.620 -21.248 1.00 9.61 C ATOM 10817 C TYR B 345 46.365 68.494 -22.762 1.00 9.92 C ATOM 10818 O TYR B 345 47.361 68.324 -23.465 1.00 9.68 O ATOM 10819 CB TYR B 345 46.152 67.263 -20.619 1.00 9.25 C ATOM 10820 CG TYR B 345 46.163 67.191 -19.107 1.00 9.46 C ATOM 10821 CD1 TYR B 345 47.064 67.939 -18.341 1.00 9.97 C ATOM 10822 CD2 TYR B 345 45.288 66.342 -18.439 1.00 8.32 C ATOM 10823 CE1 TYR B 345 47.064 67.854 -16.952 1.00 8.55 C ATOM 10824 CE2 TYR B 345 45.284 66.258 -17.064 1.00 8.51 C ATOM 10825 CZ TYR B 345 46.174 67.008 -16.330 1.00 8.39 C ATOM 10826 OH TYR B 345 46.155 66.909 -14.967 1.00 9.95 O ATOM 10827 HA TYR B 345 47.512 68.884 -20.965 1.00 0.00 H ATOM 10828 HB3 TYR B 345 46.875 66.536 -20.990 1.00 0.00 H ATOM 10829 HB2 TYR B 345 45.153 66.984 -20.956 1.00 0.00 H ATOM 10830 HD2 TYR B 345 44.592 65.731 -19.014 1.00 0.00 H ATOM 10831 HE2 TYR B 345 44.578 65.599 -16.559 1.00 0.00 H ATOM 10832 HE1 TYR B 345 47.761 68.451 -16.363 1.00 0.00 H ATOM 10833 HD1 TYR B 345 47.776 68.597 -18.839 1.00 0.00 H ATOM 10834 HH TYR B 345 45.264 67.179 -14.630 1.00 0.00 H ATOM 10835 H TYR B 345 44.905 69.481 -20.051 1.00 0.00 H ATOM 10836 N SER B 346 45.131 68.559 -23.254 1.00 10.16 N ATOM 10837 CA SER B 346 44.864 68.419 -24.687 1.00 10.60 C ATOM 10838 C SER B 346 45.400 69.616 -25.468 1.00 11.05 C ATOM 10839 O SER B 346 45.892 69.463 -26.583 1.00 10.77 O ATOM 10840 CB SER B 346 43.360 68.268 -24.929 1.00 10.65 C ATOM 10841 OG SER B 346 42.858 67.109 -24.288 1.00 10.30 O ATOM 10842 HA SER B 346 45.378 67.525 -25.040 1.00 0.00 H ATOM 10843 HB2 SER B 346 43.177 68.191 -26.001 1.00 0.00 H ATOM 10844 HB3 SER B 346 42.845 69.145 -24.536 1.00 0.00 H ATOM 10845 HG SER B 346 43.019 67.177 -23.313 1.00 0.00 H ATOM 10846 H SER B 346 44.334 68.713 -22.604 1.00 0.00 H ATOM 10847 N LEU B 347 45.288 70.804 -24.876 1.00 11.67 N ATOM 10848 CA LEU B 347 45.861 72.025 -25.439 1.00 12.30 C ATOM 10849 C LEU B 347 47.386 71.934 -25.531 1.00 12.71 C ATOM 10850 O LEU B 347 47.982 72.449 -26.480 1.00 13.17 O ATOM 10851 CB LEU B 347 45.482 73.247 -24.584 1.00 12.67 C ATOM 10852 CG LEU B 347 44.419 74.281 -25.005 1.00 13.33 C ATOM 10853 CD1 LEU B 347 43.733 73.994 -26.342 1.00 14.02 C ATOM 10854 CD2 LEU B 347 43.389 74.464 -23.892 1.00 13.10 C ATOM 10855 HA LEU B 347 45.453 72.140 -26.443 1.00 0.00 H ATOM 10856 HB2 LEU B 347 45.148 72.849 -23.626 1.00 0.00 H ATOM 10857 HB3 LEU B 347 46.405 73.809 -24.441 1.00 0.00 H ATOM 10858 HG LEU B 347 44.964 75.211 -25.166 1.00 0.00 H ATOM 10859 HD21 LEU B 347 42.900 73.511 -23.691 1.00 0.00 H ATOM 10860 HD22 LEU B 347 43.890 74.814 -22.989 1.00 0.00 H ATOM 10861 HD23 LEU B 347 42.645 75.197 -24.204 1.00 0.00 H ATOM 10862 HD11 LEU B 347 44.480 73.972 -27.135 1.00 0.00 H ATOM 10863 HD12 LEU B 347 43.228 73.029 -26.290 1.00 0.00 H ATOM 10864 HD13 LEU B 347 43.003 74.777 -26.550 1.00 0.00 H ATOM 10865 H LEU B 347 44.771 70.865 -23.976 1.00 0.00 H ATOM 10866 N LEU B 348 48.012 71.286 -24.550 1.00 12.98 N ATOM 10867 CA LEU B 348 49.478 71.112 -24.547 1.00 13.00 C ATOM 10868 C LEU B 348 49.935 70.141 -25.626 1.00 13.22 C ATOM 10869 O LEU B 348 50.944 70.373 -26.301 1.00 12.98 O ATOM 10870 CB LEU B 348 49.979 70.652 -23.170 1.00 12.63 C ATOM 10871 CG LEU B 348 49.974 71.755 -22.105 1.00 12.33 C ATOM 10872 CD1 LEU B 348 50.296 71.167 -20.750 1.00 12.10 C ATOM 10873 CD2 LEU B 348 50.962 72.868 -22.455 1.00 12.13 C ATOM 10874 HA LEU B 348 49.914 72.086 -24.768 1.00 0.00 H ATOM 10875 HB2 LEU B 348 49.339 69.840 -22.826 1.00 0.00 H ATOM 10876 HB3 LEU B 348 51.000 70.287 -23.281 1.00 0.00 H ATOM 10877 HG LEU B 348 48.977 72.195 -22.074 1.00 0.00 H ATOM 10878 HD21 LEU B 348 51.967 72.452 -22.520 1.00 0.00 H ATOM 10879 HD22 LEU B 348 50.687 73.308 -23.413 1.00 0.00 H ATOM 10880 HD23 LEU B 348 50.934 73.634 -21.680 1.00 0.00 H ATOM 10881 HD11 LEU B 348 49.548 70.417 -20.494 1.00 0.00 H ATOM 10882 HD12 LEU B 348 51.282 70.703 -20.782 1.00 0.00 H ATOM 10883 HD13 LEU B 348 50.290 71.959 -20.001 1.00 0.00 H ATOM 10884 H LEU B 348 47.454 70.892 -23.766 1.00 0.00 H ATOM 10885 N MET B 349 49.184 69.056 -25.782 1.00 13.37 N ATOM 10886 CA MET B 349 49.404 68.112 -26.875 1.00 13.77 C ATOM 10887 C MET B 349 49.265 68.779 -28.239 1.00 14.10 C ATOM 10888 O MET B 349 50.050 68.516 -29.147 1.00 14.41 O ATOM 10889 CB MET B 349 48.427 66.952 -26.749 1.00 13.70 C ATOM 10890 CG MET B 349 48.785 66.048 -25.600 1.00 13.41 C ATOM 10891 SD MET B 349 47.647 64.691 -25.436 1.00 13.75 S ATOM 10892 CE MET B 349 47.233 64.838 -23.693 1.00 13.84 C ATOM 10893 HA MET B 349 50.426 67.740 -26.801 1.00 0.00 H ATOM 10894 HB2 MET B 349 47.425 67.349 -26.588 1.00 0.00 H ATOM 10895 HB3 MET B 349 48.443 66.374 -27.673 1.00 0.00 H ATOM 10896 HG2 MET B 349 48.774 66.630 -24.678 1.00 0.00 H ATOM 10897 HG3 MET B 349 49.786 65.650 -25.765 1.00 0.00 H ATOM 10898 HE1 MET B 349 48.138 64.732 -23.096 1.00 0.00 H ATOM 10899 HE2 MET B 349 46.787 65.815 -23.508 1.00 0.00 H ATOM 10900 HE3 MET B 349 46.523 64.056 -23.422 1.00 0.00 H ATOM 10901 H MET B 349 48.416 68.873 -25.105 1.00 0.00 H ATOM 10902 N LEU B 350 48.280 69.661 -28.361 1.00 14.56 N ATOM 10903 CA LEU B 350 48.040 70.401 -29.598 1.00 14.75 C ATOM 10904 C LEU B 350 49.207 71.338 -29.885 1.00 15.00 C ATOM 10905 O LEU B 350 49.759 71.341 -30.985 1.00 15.18 O ATOM 10906 CB LEU B 350 46.763 71.238 -29.481 1.00 14.60 C ATOM 10907 CG LEU B 350 45.670 71.139 -30.543 1.00 15.53 C ATOM 10908 CD1 LEU B 350 44.834 72.430 -30.521 1.00 15.83 C ATOM 10909 CD2 LEU B 350 46.194 70.857 -31.942 1.00 15.40 C ATOM 10910 HA LEU B 350 47.934 69.679 -30.408 1.00 0.00 H ATOM 10911 HB2 LEU B 350 46.300 70.971 -28.531 1.00 0.00 H ATOM 10912 HB3 LEU B 350 47.075 72.282 -29.451 1.00 0.00 H ATOM 10913 HG LEU B 350 45.051 70.278 -30.291 1.00 0.00 H ATOM 10914 HD21 LEU B 350 46.867 71.659 -32.245 1.00 0.00 H ATOM 10915 HD22 LEU B 350 46.732 69.909 -31.943 1.00 0.00 H ATOM 10916 HD23 LEU B 350 45.357 70.801 -32.638 1.00 0.00 H ATOM 10917 HD11 LEU B 350 44.382 72.552 -29.537 1.00 0.00 H ATOM 10918 HD12 LEU B 350 45.479 73.283 -30.734 1.00 0.00 H ATOM 10919 HD13 LEU B 350 44.051 72.367 -31.277 1.00 0.00 H ATOM 10920 H LEU B 350 47.656 69.831 -27.546 1.00 0.00 H ATOM 10921 N GLU B 351 49.561 72.136 -28.880 1.00 15.37 N ATOM 10922 CA GLU B 351 50.667 73.090 -28.971 1.00 15.14 C ATOM 10923 C GLU B 351 52.021 72.442 -29.287 1.00 14.99 C ATOM 10924 O GLU B 351 52.751 72.955 -30.126 1.00 15.43 O ATOM 10925 CB GLU B 351 50.782 73.882 -27.669 1.00 15.33 C ATOM 10926 CG GLU B 351 51.779 75.044 -27.712 1.00 16.63 C ATOM 10927 CD GLU B 351 51.313 76.225 -28.564 1.00 19.78 C ATOM 10928 OE1 GLU B 351 50.189 76.186 -29.111 1.00 21.47 O ATOM 10929 OE2 GLU B 351 52.080 77.205 -28.689 1.00 22.31 O ATOM 10930 HA GLU B 351 50.428 73.747 -29.807 1.00 0.00 H ATOM 10931 HB2 GLU B 351 49.799 74.287 -27.430 1.00 0.00 H ATOM 10932 HB3 GLU B 351 51.093 73.196 -26.881 1.00 0.00 H ATOM 10933 HG2 GLU B 351 51.940 75.397 -26.693 1.00 0.00 H ATOM 10934 HG3 GLU B 351 52.720 74.675 -28.120 1.00 0.00 H ATOM 10935 H GLU B 351 49.027 72.079 -27.989 1.00 0.00 H ATOM 10936 N HIS B 352 52.348 71.331 -28.630 1.00 14.56 N ATOM 10937 CA HIS B 352 53.699 70.737 -28.723 1.00 14.55 C ATOM 10938 C HIS B 352 53.803 69.500 -29.606 1.00 14.42 C ATOM 10939 O HIS B 352 54.871 68.905 -29.717 1.00 14.29 O ATOM 10940 CB HIS B 352 54.235 70.450 -27.321 1.00 14.53 C ATOM 10941 CG HIS B 352 54.313 71.677 -26.473 1.00 14.17 C ATOM 10942 ND1 HIS B 352 55.350 72.580 -26.571 1.00 14.06 N ATOM 10943 CD2 HIS B 352 53.450 72.190 -25.567 1.00 13.22 C ATOM 10944 CE1 HIS B 352 55.136 73.581 -25.737 1.00 14.41 C ATOM 10945 NE2 HIS B 352 53.991 73.367 -25.114 1.00 13.97 N ATOM 10946 HA HIS B 352 54.316 71.483 -29.223 1.00 0.00 H ATOM 10947 HB2 HIS B 352 53.575 69.731 -26.835 1.00 0.00 H ATOM 10948 HB3 HIS B 352 55.234 70.023 -27.410 1.00 0.00 H ATOM 10949 HD2 HIS B 352 52.502 71.751 -25.255 1.00 0.00 H ATOM 10950 HE1 HIS B 352 55.793 74.438 -25.588 1.00 0.00 H ATOM 10951 H HIS B 352 51.633 70.868 -28.034 1.00 0.00 H ATOM 10952 N GLY B 353 52.697 69.132 -30.249 1.00 14.56 N ATOM 10953 CA GLY B 353 52.696 68.069 -31.252 1.00 14.37 C ATOM 10954 C GLY B 353 53.040 66.690 -30.716 1.00 14.25 C ATOM 10955 O GLY B 353 53.970 66.053 -31.194 1.00 13.83 O ATOM 10956 HA3 GLY B 353 53.425 68.326 -32.021 1.00 0.00 H ATOM 10957 HA2 GLY B 353 51.702 68.022 -31.697 1.00 0.00 H ATOM 10958 H GLY B 353 51.804 69.617 -30.030 1.00 0.00 H ATOM 10959 N PHE B 354 52.282 66.228 -29.725 1.00 14.16 N ATOM 10960 CA PHE B 354 52.427 64.863 -29.237 1.00 13.94 C ATOM 10961 C PHE B 354 51.131 64.353 -28.636 1.00 13.86 C ATOM 10962 O PHE B 354 50.238 65.125 -28.333 1.00 13.87 O ATOM 10963 CB PHE B 354 53.549 64.766 -28.197 1.00 13.69 C ATOM 10964 CG PHE B 354 53.145 65.229 -26.833 1.00 13.40 C ATOM 10965 CD1 PHE B 354 52.845 64.309 -25.830 1.00 12.58 C ATOM 10966 CD2 PHE B 354 53.028 66.586 -26.560 1.00 12.66 C ATOM 10967 CE1 PHE B 354 52.452 64.739 -24.581 1.00 13.22 C ATOM 10968 CE2 PHE B 354 52.637 67.023 -25.314 1.00 12.89 C ATOM 10969 CZ PHE B 354 52.351 66.102 -24.319 1.00 13.26 C ATOM 10970 HA PHE B 354 52.684 64.240 -30.094 1.00 0.00 H ATOM 10971 HB2 PHE B 354 53.866 63.725 -28.128 1.00 0.00 H ATOM 10972 HB3 PHE B 354 54.386 65.378 -28.535 1.00 0.00 H ATOM 10973 HD2 PHE B 354 53.248 67.313 -27.341 1.00 0.00 H ATOM 10974 HE2 PHE B 354 52.553 68.091 -25.111 1.00 0.00 H ATOM 10975 HZ PHE B 354 52.047 66.445 -23.330 1.00 0.00 H ATOM 10976 HE1 PHE B 354 52.221 64.014 -23.801 1.00 0.00 H ATOM 10977 HD1 PHE B 354 52.922 63.241 -26.035 1.00 0.00 H ATOM 10978 H PHE B 354 51.573 66.853 -29.291 1.00 0.00 H ATOM 10979 N ILE B 355 51.057 63.038 -28.471 1.00 14.10 N ATOM 10980 CA ILE B 355 49.936 62.379 -27.835 1.00 14.16 C ATOM 10981 C ILE B 355 50.472 61.739 -26.566 1.00 14.14 C ATOM 10982 O ILE B 355 51.425 60.956 -26.620 1.00 13.76 O ATOM 10983 CB ILE B 355 49.326 61.299 -28.758 1.00 14.29 C ATOM 10984 CG1 ILE B 355 48.580 61.963 -29.917 1.00 14.54 C ATOM 10985 CG2 ILE B 355 48.377 60.372 -27.976 1.00 14.27 C ATOM 10986 CD1 ILE B 355 48.154 61.002 -31.016 1.00 14.65 C ATOM 10987 HA ILE B 355 49.145 63.097 -27.618 1.00 0.00 H ATOM 10988 HB ILE B 355 50.139 60.691 -29.156 1.00 0.00 H ATOM 10989 HG12 ILE B 355 47.687 62.444 -29.518 1.00 0.00 H ATOM 10990 HG13 ILE B 355 49.232 62.718 -30.356 1.00 0.00 H ATOM 10991 HD11 ILE B 355 49.036 60.520 -31.437 1.00 0.00 H ATOM 10992 HD12 ILE B 355 47.489 60.246 -30.598 1.00 0.00 H ATOM 10993 HD13 ILE B 355 47.632 61.554 -31.798 1.00 0.00 H ATOM 10994 HG21 ILE B 355 48.931 59.877 -27.178 1.00 0.00 H ATOM 10995 HG22 ILE B 355 47.567 60.962 -27.546 1.00 0.00 H ATOM 10996 HG23 ILE B 355 47.964 59.623 -28.652 1.00 0.00 H ATOM 10997 H ILE B 355 51.844 62.452 -28.816 1.00 0.00 H ATOM 10998 N ALA B 356 49.870 62.089 -25.431 1.00 13.98 N ATOM 10999 CA ALA B 356 50.263 61.542 -24.135 1.00 14.16 C ATOM 11000 C ALA B 356 49.799 60.092 -24.016 1.00 14.24 C ATOM 11001 O ALA B 356 48.738 59.738 -24.532 1.00 14.33 O ATOM 11002 CB ALA B 356 49.665 62.374 -23.015 1.00 14.23 C ATOM 11003 HA ALA B 356 51.350 61.572 -24.055 1.00 0.00 H ATOM 11004 HB1 ALA B 356 50.024 63.400 -23.095 1.00 0.00 H ATOM 11005 HB2 ALA B 356 48.578 62.361 -23.095 1.00 0.00 H ATOM 11006 HB3 ALA B 356 49.965 61.956 -22.054 1.00 0.00 H ATOM 11007 H ALA B 356 49.091 62.777 -25.469 1.00 0.00 H ATOM 11008 N PRO B 357 50.588 59.246 -23.335 1.00 14.43 N ATOM 11009 CA PRO B 357 50.255 57.827 -23.250 1.00 14.59 C ATOM 11010 C PRO B 357 49.130 57.502 -22.273 1.00 14.69 C ATOM 11011 O PRO B 357 49.065 58.072 -21.186 1.00 14.84 O ATOM 11012 CB PRO B 357 51.560 57.198 -22.755 1.00 14.57 C ATOM 11013 CG PRO B 357 52.185 58.263 -21.936 1.00 14.61 C ATOM 11014 CD PRO B 357 51.839 59.558 -22.620 1.00 14.40 C ATOM 11015 HA PRO B 357 49.892 57.458 -24.209 1.00 0.00 H ATOM 11016 HD3 PRO B 357 51.684 60.354 -21.892 1.00 0.00 H ATOM 11017 HD2 PRO B 357 52.623 59.853 -23.317 1.00 0.00 H ATOM 11018 HG3 PRO B 357 53.266 58.129 -21.899 1.00 0.00 H ATOM 11019 HG2 PRO B 357 51.783 58.249 -20.923 1.00 0.00 H ATOM 11020 HB2 PRO B 357 51.359 56.313 -22.152 1.00 0.00 H ATOM 11021 HB3 PRO B 357 52.202 56.927 -23.593 1.00 0.00 H ATOM 11022 N SER B 358 48.267 56.575 -22.677 1.00 14.97 N ATOM 11023 CA SER B 358 47.314 55.927 -21.788 1.00 15.16 C ATOM 11024 C SER B 358 48.101 54.824 -21.065 1.00 15.58 C ATOM 11025 O SER B 358 48.354 53.764 -21.633 1.00 15.64 O ATOM 11026 CB SER B 358 46.158 55.334 -22.612 1.00 15.22 C ATOM 11027 OG SER B 358 44.967 55.195 -21.864 1.00 15.22 O ATOM 11028 HA SER B 358 46.874 56.623 -21.074 1.00 0.00 H ATOM 11029 HB2 SER B 358 46.458 54.351 -22.976 1.00 0.00 H ATOM 11030 HB3 SER B 358 45.962 55.990 -23.460 1.00 0.00 H ATOM 11031 HG SER B 358 45.130 54.594 -21.095 1.00 0.00 H ATOM 11032 H SER B 358 48.273 56.299 -23.680 1.00 0.00 H ATOM 11033 N ILE B 359 48.521 55.086 -19.831 1.00 15.83 N ATOM 11034 CA ILE B 359 49.427 54.171 -19.118 1.00 16.04 C ATOM 11035 C ILE B 359 48.708 53.073 -18.314 1.00 16.55 C ATOM 11036 O ILE B 359 47.498 53.126 -18.104 1.00 16.31 O ATOM 11037 CB ILE B 359 50.408 54.937 -18.183 1.00 15.79 C ATOM 11038 CG1 ILE B 359 49.692 55.524 -16.957 1.00 15.42 C ATOM 11039 CG2 ILE B 359 51.123 56.031 -18.954 1.00 15.65 C ATOM 11040 CD1 ILE B 359 50.656 55.984 -15.851 1.00 15.38 C ATOM 11041 HA ILE B 359 49.988 53.675 -19.910 1.00 0.00 H ATOM 11042 HB ILE B 359 51.142 54.219 -17.818 1.00 0.00 H ATOM 11043 HG12 ILE B 359 49.101 56.381 -17.279 1.00 0.00 H ATOM 11044 HG13 ILE B 359 49.031 54.762 -16.545 1.00 0.00 H ATOM 11045 HD11 ILE B 359 51.248 55.135 -15.510 1.00 0.00 H ATOM 11046 HD12 ILE B 359 51.318 56.755 -16.245 1.00 0.00 H ATOM 11047 HD13 ILE B 359 50.083 56.387 -15.016 1.00 0.00 H ATOM 11048 HG21 ILE B 359 51.686 55.587 -19.775 1.00 0.00 H ATOM 11049 HG22 ILE B 359 50.389 56.732 -19.352 1.00 0.00 H ATOM 11050 HG23 ILE B 359 51.805 56.558 -18.287 1.00 0.00 H ATOM 11051 H ILE B 359 48.202 55.956 -19.359 1.00 0.00 H ATOM 11052 N ASN B 360 49.495 52.087 -17.878 1.00 17.31 N ATOM 11053 CA ASN B 360 49.061 51.000 -16.998 1.00 18.10 C ATOM 11054 C ASN B 360 48.112 49.983 -17.625 1.00 18.85 C ATOM 11055 O ASN B 360 47.399 49.287 -16.901 1.00 18.65 O ATOM 11056 CB ASN B 360 48.461 51.545 -15.683 1.00 17.98 C ATOM 11057 CG ASN B 360 49.485 52.247 -14.811 1.00 17.72 C ATOM 11058 OD1 ASN B 360 50.678 51.962 -14.872 1.00 17.25 O ATOM 11059 ND2 ASN B 360 49.013 53.162 -13.975 1.00 18.50 N ATOM 11060 HA ASN B 360 49.979 50.449 -16.792 1.00 0.00 H ATOM 11061 HB2 ASN B 360 47.670 52.253 -15.929 1.00 0.00 H ATOM 11062 HB3 ASN B 360 48.039 50.711 -15.122 1.00 0.00 H ATOM 11063 HD22 ASN B 360 47.995 53.373 -13.956 1.00 0.00 H ATOM 11064 HD21 ASN B 360 49.661 53.669 -13.339 1.00 0.00 H ATOM 11065 H ASN B 360 50.488 52.091 -18.186 1.00 0.00 H ATOM 11066 N ILE B 361 48.117 49.866 -18.953 1.00 20.21 N ATOM 11067 CA ILE B 361 47.344 48.809 -19.619 1.00 21.10 C ATOM 11068 C ILE B 361 48.245 47.587 -19.770 1.00 21.98 C ATOM 11069 O ILE B 361 49.014 47.481 -20.730 1.00 21.58 O ATOM 11070 CB ILE B 361 46.780 49.214 -21.010 1.00 21.20 C ATOM 11071 CG1 ILE B 361 45.813 50.388 -20.907 1.00 21.76 C ATOM 11072 CG2 ILE B 361 46.009 48.052 -21.639 1.00 20.75 C ATOM 11073 CD1 ILE B 361 46.457 51.688 -21.060 1.00 23.52 C ATOM 11074 HA ILE B 361 46.474 48.602 -18.996 1.00 0.00 H ATOM 11075 HB ILE B 361 47.639 49.491 -21.621 1.00 0.00 H ATOM 11076 HG12 ILE B 361 45.058 50.283 -21.686 1.00 0.00 H ATOM 11077 HG13 ILE B 361 45.332 50.354 -19.930 1.00 0.00 H ATOM 11078 HD11 ILE B 361 47.208 51.814 -20.280 1.00 0.00 H ATOM 11079 HD12 ILE B 361 46.934 51.743 -22.038 1.00 0.00 H ATOM 11080 HD13 ILE B 361 45.708 52.475 -20.975 1.00 0.00 H ATOM 11081 HG21 ILE B 361 46.677 47.199 -21.763 1.00 0.00 H ATOM 11082 HG22 ILE B 361 45.180 47.774 -20.989 1.00 0.00 H ATOM 11083 HG23 ILE B 361 45.623 48.358 -22.612 1.00 0.00 H ATOM 11084 H ILE B 361 48.675 50.532 -19.525 1.00 0.00 H ATOM 11085 N GLU B 362 48.140 46.676 -18.805 1.00 23.26 N ATOM 11086 CA GLU B 362 48.884 45.413 -18.817 1.00 24.38 C ATOM 11087 C GLU B 362 48.144 44.369 -19.654 1.00 25.07 C ATOM 11088 O GLU B 362 48.765 43.566 -20.349 1.00 25.32 O ATOM 11089 CB GLU B 362 49.096 44.914 -17.389 1.00 24.33 C ATOM 11090 CG GLU B 362 50.131 45.730 -16.632 1.00 25.63 C ATOM 11091 CD GLU B 362 50.020 45.594 -15.117 1.00 26.39 C ATOM 11092 OE1 GLU B 362 49.991 44.451 -14.602 1.00 29.24 O ATOM 11093 OE2 GLU B 362 49.981 46.642 -14.440 1.00 28.70 O ATOM 11094 HA GLU B 362 49.861 45.582 -19.270 1.00 0.00 H ATOM 11095 HB2 GLU B 362 48.148 44.971 -16.855 1.00 0.00 H ATOM 11096 HB3 GLU B 362 49.429 43.877 -17.427 1.00 0.00 H ATOM 11097 HG2 GLU B 362 51.123 45.398 -16.937 1.00 0.00 H ATOM 11098 HG3 GLU B 362 50.003 46.780 -16.895 1.00 0.00 H ATOM 11099 H GLU B 362 47.502 46.869 -18.007 1.00 0.00 H ATOM 11100 N GLU B 363 46.816 44.399 -19.579 1.00 25.77 N ATOM 11101 CA GLU B 363 45.958 43.544 -20.379 1.00 26.08 C ATOM 11102 C GLU B 363 44.784 44.388 -20.880 1.00 26.20 C ATOM 11103 O GLU B 363 43.924 44.804 -20.105 1.00 25.87 O ATOM 11104 CB GLU B 363 45.466 42.367 -19.536 1.00 26.40 C ATOM 11105 CG GLU B 363 44.746 41.259 -20.310 1.00 26.65 C ATOM 11106 CD GLU B 363 44.009 40.295 -19.385 1.00 27.54 C ATOM 11107 OE1 GLU B 363 44.474 40.098 -18.239 1.00 29.16 O ATOM 11108 OE2 GLU B 363 42.961 39.742 -19.797 1.00 29.52 O ATOM 11109 HA GLU B 363 46.505 43.137 -21.230 1.00 0.00 H ATOM 11110 HB2 GLU B 363 46.330 41.924 -19.040 1.00 0.00 H ATOM 11111 HB3 GLU B 363 44.777 42.755 -18.786 1.00 0.00 H ATOM 11112 HG2 GLU B 363 44.025 41.716 -20.988 1.00 0.00 H ATOM 11113 HG3 GLU B 363 45.482 40.699 -20.887 1.00 0.00 H ATOM 11114 H GLU B 363 46.372 45.066 -18.916 1.00 0.00 H ATOM 11115 N LEU B 364 44.769 44.651 -22.181 1.00 26.53 N ATOM 11116 CA LEU B 364 43.770 45.519 -22.785 1.00 26.72 C ATOM 11117 C LEU B 364 42.409 44.838 -22.697 1.00 26.95 C ATOM 11118 O LEU B 364 42.281 43.650 -22.992 1.00 27.07 O ATOM 11119 CB LEU B 364 44.154 45.829 -24.244 1.00 26.77 C ATOM 11120 CG LEU B 364 43.644 47.086 -24.981 1.00 26.52 C ATOM 11121 CD1 LEU B 364 42.652 46.726 -26.077 1.00 26.40 C ATOM 11122 CD2 LEU B 364 43.066 48.148 -24.047 1.00 26.21 C ATOM 11123 HA LEU B 364 43.721 46.468 -22.251 1.00 0.00 H ATOM 11124 HB2 LEU B 364 45.242 45.884 -24.267 1.00 0.00 H ATOM 11125 HB3 LEU B 364 43.822 44.975 -24.834 1.00 0.00 H ATOM 11126 HG LEU B 364 44.524 47.533 -25.444 1.00 0.00 H ATOM 11127 HD21 LEU B 364 42.224 47.727 -23.497 1.00 0.00 H ATOM 11128 HD22 LEU B 364 43.835 48.470 -23.345 1.00 0.00 H ATOM 11129 HD23 LEU B 364 42.728 49.002 -24.635 1.00 0.00 H ATOM 11130 HD11 LEU B 364 43.136 46.072 -26.803 1.00 0.00 H ATOM 11131 HD12 LEU B 364 41.797 46.213 -25.637 1.00 0.00 H ATOM 11132 HD13 LEU B 364 42.315 47.636 -26.574 1.00 0.00 H ATOM 11133 H LEU B 364 45.496 44.222 -22.789 1.00 0.00 H ATOM 11134 N ASP B 365 41.406 45.585 -22.251 1.00 27.31 N ATOM 11135 CA ASP B 365 40.052 45.066 -22.156 1.00 27.53 C ATOM 11136 C ASP B 365 39.556 44.691 -23.545 1.00 27.67 C ATOM 11137 O ASP B 365 39.699 45.468 -24.486 1.00 27.41 O ATOM 11138 CB ASP B 365 39.127 46.110 -21.544 1.00 27.70 C ATOM 11139 CG ASP B 365 37.881 45.503 -20.946 1.00 27.84 C ATOM 11140 OD1 ASP B 365 37.937 45.088 -19.767 1.00 28.47 O ATOM 11141 OD2 ASP B 365 36.844 45.465 -21.640 1.00 29.41 O ATOM 11142 HA ASP B 365 40.054 44.183 -21.517 1.00 0.00 H ATOM 11143 HB2 ASP B 365 39.668 46.640 -20.760 1.00 0.00 H ATOM 11144 HB3 ASP B 365 38.833 46.815 -22.321 1.00 0.00 H ATOM 11145 H ASP B 365 41.594 46.566 -21.962 1.00 0.00 H ATOM 11146 N GLU B 366 38.975 43.502 -23.667 1.00 27.93 N ATOM 11147 CA GLU B 366 38.556 42.978 -24.975 1.00 28.26 C ATOM 11148 C GLU B 366 37.468 43.809 -25.661 1.00 27.96 C ATOM 11149 O GLU B 366 37.348 43.767 -26.884 1.00 28.01 O ATOM 11150 CB GLU B 366 38.124 41.512 -24.867 1.00 28.37 C ATOM 11151 CG GLU B 366 36.899 41.236 -23.994 1.00 29.26 C ATOM 11152 CD GLU B 366 36.647 39.736 -23.825 1.00 30.13 C ATOM 11153 OE1 GLU B 366 35.472 39.337 -23.642 1.00 32.65 O ATOM 11154 OE2 GLU B 366 37.626 38.956 -23.888 1.00 32.23 O ATOM 11155 HA GLU B 366 39.437 43.050 -25.613 1.00 0.00 H ATOM 11156 HB2 GLU B 366 37.904 41.154 -25.873 1.00 0.00 H ATOM 11157 HB3 GLU B 366 38.961 40.947 -24.456 1.00 0.00 H ATOM 11158 HG2 GLU B 366 37.058 41.680 -23.011 1.00 0.00 H ATOM 11159 HG3 GLU B 366 36.024 41.691 -24.459 1.00 0.00 H ATOM 11160 H GLU B 366 38.813 42.928 -22.815 1.00 0.00 H ATOM 11161 N GLN B 367 36.685 44.558 -24.883 1.00 27.78 N ATOM 11162 CA GLN B 367 35.736 45.523 -25.451 1.00 27.70 C ATOM 11163 C GLN B 367 36.447 46.718 -26.102 1.00 27.28 C ATOM 11164 O GLN B 367 35.820 47.478 -26.829 1.00 27.48 O ATOM 11165 CB GLN B 367 34.752 46.036 -24.392 1.00 27.84 C ATOM 11166 CG GLN B 367 33.591 45.096 -24.056 1.00 28.13 C ATOM 11167 CD GLN B 367 32.335 45.852 -23.595 1.00 28.57 C ATOM 11168 OE1 GLN B 367 31.864 46.774 -24.268 1.00 30.36 O ATOM 11169 NE2 GLN B 367 31.785 45.451 -22.455 1.00 29.79 N ATOM 11170 HA GLN B 367 35.184 44.986 -26.222 1.00 0.00 H ATOM 11171 HB2 GLN B 367 35.312 46.219 -23.475 1.00 0.00 H ATOM 11172 HB3 GLN B 367 34.330 46.974 -24.752 1.00 0.00 H ATOM 11173 HG2 GLN B 367 33.343 44.515 -24.944 1.00 0.00 H ATOM 11174 HG3 GLN B 367 33.906 44.422 -23.259 1.00 0.00 H ATOM 11175 HE22 GLN B 367 32.213 44.670 -21.918 1.00 0.00 H ATOM 11176 HE21 GLN B 367 30.926 45.918 -22.099 1.00 0.00 H ATOM 11177 H GLN B 367 36.748 44.456 -23.850 1.00 0.00 H ATOM 11178 N ALA B 368 37.743 46.885 -25.833 1.00 26.81 N ATOM 11179 CA ALA B 368 38.546 47.952 -26.446 1.00 26.51 C ATOM 11180 C ALA B 368 39.315 47.481 -27.677 1.00 26.15 C ATOM 11181 O ALA B 368 40.156 48.214 -28.200 1.00 26.08 O ATOM 11182 CB ALA B 368 39.516 48.534 -25.425 1.00 26.33 C ATOM 11183 HA ALA B 368 37.847 48.720 -26.776 1.00 0.00 H ATOM 11184 HB1 ALA B 368 38.955 48.946 -24.586 1.00 0.00 H ATOM 11185 HB2 ALA B 368 40.180 47.747 -25.068 1.00 0.00 H ATOM 11186 HB3 ALA B 368 40.104 49.323 -25.893 1.00 0.00 H ATOM 11187 H ALA B 368 38.203 46.235 -25.164 1.00 0.00 H ATOM 11188 N ALA B 369 39.030 46.269 -28.145 1.00 25.95 N ATOM 11189 CA ALA B 369 39.746 45.707 -29.287 1.00 25.90 C ATOM 11190 C ALA B 369 39.449 46.520 -30.545 1.00 25.65 C ATOM 11191 O ALA B 369 38.339 46.998 -30.730 1.00 25.65 O ATOM 11192 CB ALA B 369 39.368 44.241 -29.488 1.00 25.87 C ATOM 11193 HA ALA B 369 40.817 45.756 -29.088 1.00 0.00 H ATOM 11194 HB1 ALA B 369 39.627 43.674 -28.594 1.00 0.00 H ATOM 11195 HB2 ALA B 369 38.296 44.165 -29.670 1.00 0.00 H ATOM 11196 HB3 ALA B 369 39.912 43.841 -30.344 1.00 0.00 H ATOM 11197 H ALA B 369 38.282 45.710 -27.688 1.00 0.00 H ATOM 11198 N GLY B 370 40.455 46.691 -31.394 1.00 25.46 N ATOM 11199 CA GLY B 370 40.301 47.462 -32.620 1.00 25.37 C ATOM 11200 C GLY B 370 40.713 48.920 -32.513 1.00 25.32 C ATOM 11201 O GLY B 370 41.323 49.454 -33.436 1.00 25.83 O ATOM 11202 HA3 GLY B 370 39.252 47.427 -32.913 1.00 0.00 H ATOM 11203 HA2 GLY B 370 40.909 46.994 -33.394 1.00 0.00 H ATOM 11204 H GLY B 370 41.378 46.263 -31.178 1.00 0.00 H ATOM 11205 N LEU B 371 40.388 49.567 -31.395 1.00 24.95 N ATOM 11206 CA LEU B 371 40.528 51.022 -31.264 1.00 24.63 C ATOM 11207 C LEU B 371 41.994 51.473 -31.231 1.00 24.31 C ATOM 11208 O LEU B 371 42.884 50.679 -30.957 1.00 24.78 O ATOM 11209 CB LEU B 371 39.800 51.516 -30.005 1.00 24.65 C ATOM 11210 CG LEU B 371 38.313 51.169 -29.857 1.00 24.59 C ATOM 11211 CD1 LEU B 371 37.810 51.581 -28.493 1.00 24.78 C ATOM 11212 CD2 LEU B 371 37.473 51.827 -30.934 1.00 24.85 C ATOM 11213 HA LEU B 371 40.073 51.465 -32.150 1.00 0.00 H ATOM 11214 HB2 LEU B 371 40.319 51.097 -29.143 1.00 0.00 H ATOM 11215 HB3 LEU B 371 39.884 52.603 -29.985 1.00 0.00 H ATOM 11216 HG LEU B 371 38.218 50.089 -29.968 1.00 0.00 H ATOM 11217 HD21 LEU B 371 37.581 52.910 -30.867 1.00 0.00 H ATOM 11218 HD22 LEU B 371 37.809 51.487 -31.914 1.00 0.00 H ATOM 11219 HD23 LEU B 371 36.427 51.556 -30.793 1.00 0.00 H ATOM 11220 HD11 LEU B 371 38.376 51.055 -27.724 1.00 0.00 H ATOM 11221 HD12 LEU B 371 37.939 52.656 -28.369 1.00 0.00 H ATOM 11222 HD13 LEU B 371 36.754 51.328 -28.405 1.00 0.00 H ATOM 11223 H LEU B 371 40.023 49.023 -30.588 1.00 0.00 H ATOM 11224 N ASN B 372 42.236 52.751 -31.509 1.00 23.77 N ATOM 11225 CA ASN B 372 43.594 53.300 -31.517 1.00 23.22 C ATOM 11226 C ASN B 372 43.943 53.966 -30.182 1.00 22.63 C ATOM 11227 O ASN B 372 44.158 55.182 -30.101 1.00 22.28 O ATOM 11228 CB ASN B 372 43.771 54.275 -32.685 1.00 23.22 C ATOM 11229 CG ASN B 372 45.194 54.836 -32.790 1.00 23.95 C ATOM 11230 OD1 ASN B 372 45.415 55.842 -33.467 1.00 25.53 O ATOM 11231 ND2 ASN B 372 46.156 54.195 -32.116 1.00 24.17 N ATOM 11232 HA ASN B 372 44.289 52.471 -31.653 1.00 0.00 H ATOM 11233 HB2 ASN B 372 43.534 53.753 -33.612 1.00 0.00 H ATOM 11234 HB3 ASN B 372 43.079 55.106 -32.551 1.00 0.00 H ATOM 11235 HD22 ASN B 372 45.924 53.349 -31.557 1.00 0.00 H ATOM 11236 HD21 ASN B 372 47.136 54.543 -32.151 1.00 0.00 H ATOM 11237 H ASN B 372 41.437 53.380 -31.727 1.00 0.00 H ATOM 11238 N ILE B 373 44.010 53.149 -29.137 1.00 22.00 N ATOM 11239 CA ILE B 373 44.395 53.624 -27.819 1.00 21.84 C ATOM 11240 C ILE B 373 45.923 53.662 -27.741 1.00 21.45 C ATOM 11241 O ILE B 373 46.586 52.626 -27.841 1.00 20.70 O ATOM 11242 CB ILE B 373 43.759 52.770 -26.700 1.00 21.79 C ATOM 11243 CG1 ILE B 373 42.255 53.058 -26.651 1.00 21.86 C ATOM 11244 CG2 ILE B 373 44.376 53.100 -25.341 1.00 22.09 C ATOM 11245 CD1 ILE B 373 41.442 52.024 -25.947 1.00 22.23 C ATOM 11246 HA ILE B 373 44.015 54.634 -27.663 1.00 0.00 H ATOM 11247 HB ILE B 373 43.942 51.717 -26.916 1.00 0.00 H ATOM 11248 HG12 ILE B 373 42.108 54.010 -26.141 1.00 0.00 H ATOM 11249 HG13 ILE B 373 41.891 53.136 -27.675 1.00 0.00 H ATOM 11250 HD11 ILE B 373 41.562 51.065 -26.450 1.00 0.00 H ATOM 11251 HD12 ILE B 373 41.780 51.939 -24.914 1.00 0.00 H ATOM 11252 HD13 ILE B 373 40.392 52.316 -25.964 1.00 0.00 H ATOM 11253 HG21 ILE B 373 45.447 52.897 -25.371 1.00 0.00 H ATOM 11254 HG22 ILE B 373 44.211 54.153 -25.114 1.00 0.00 H ATOM 11255 HG23 ILE B 373 43.909 52.484 -24.572 1.00 0.00 H ATOM 11256 H ILE B 373 43.781 52.143 -29.266 1.00 0.00 H ATOM 11257 N VAL B 374 46.478 54.867 -27.580 1.00 21.18 N ATOM 11258 CA VAL B 374 47.931 55.029 -27.608 1.00 21.33 C ATOM 11259 C VAL B 374 48.506 54.881 -26.196 1.00 21.25 C ATOM 11260 O VAL B 374 48.094 55.566 -25.256 1.00 21.46 O ATOM 11261 CB VAL B 374 48.433 56.304 -28.408 1.00 21.37 C ATOM 11262 CG1 VAL B 374 47.290 57.189 -28.875 1.00 21.59 C ATOM 11263 CG2 VAL B 374 49.492 57.093 -27.648 1.00 21.10 C ATOM 11264 HA VAL B 374 48.343 54.215 -28.204 1.00 0.00 H ATOM 11265 HB VAL B 374 48.916 55.920 -29.307 1.00 0.00 H ATOM 11266 HG11 VAL B 374 46.635 56.617 -29.533 1.00 0.00 H ATOM 11267 HG12 VAL B 374 46.725 57.537 -28.010 1.00 0.00 H ATOM 11268 HG13 VAL B 374 47.693 58.045 -29.416 1.00 0.00 H ATOM 11269 HG21 VAL B 374 49.078 57.434 -26.699 1.00 0.00 H ATOM 11270 HG22 VAL B 374 50.355 56.454 -27.460 1.00 0.00 H ATOM 11271 HG23 VAL B 374 49.798 57.954 -28.243 1.00 0.00 H ATOM 11272 H VAL B 374 45.870 55.698 -27.433 1.00 0.00 H ATOM 11273 N THR B 375 49.439 53.939 -26.078 1.00 21.07 N ATOM 11274 CA THR B 375 50.043 53.550 -24.811 1.00 21.05 C ATOM 11275 C THR B 375 51.487 54.031 -24.707 1.00 21.11 C ATOM 11276 O THR B 375 52.184 53.707 -23.750 1.00 20.97 O ATOM 11277 CB THR B 375 50.017 52.019 -24.660 1.00 20.89 C ATOM 11278 OG1 THR B 375 50.667 51.415 -25.784 1.00 19.61 O ATOM 11279 CG2 THR B 375 48.583 51.520 -24.590 1.00 20.95 C ATOM 11280 HA THR B 375 49.461 54.016 -24.016 1.00 0.00 H ATOM 11281 HB THR B 375 50.536 51.750 -23.740 1.00 0.00 H ATOM 11282 HG1 THR B 375 50.649 50.430 -25.684 1.00 0.00 H ATOM 11283 HG23 THR B 375 48.082 51.976 -23.736 1.00 0.00 H ATOM 11284 HG21 THR B 375 48.060 51.791 -25.507 1.00 0.00 H ATOM 11285 HG22 THR B 375 48.582 50.436 -24.477 1.00 0.00 H ATOM 11286 H THR B 375 49.755 53.452 -26.941 1.00 0.00 H ATOM 11287 N GLU B 376 51.922 54.814 -25.690 1.00 21.42 N ATOM 11288 CA GLU B 376 53.303 55.270 -25.776 1.00 21.76 C ATOM 11289 C GLU B 376 53.327 56.707 -26.261 1.00 21.54 C ATOM 11290 O GLU B 376 52.602 57.051 -27.191 1.00 21.74 O ATOM 11291 CB GLU B 376 54.067 54.402 -26.781 1.00 22.45 C ATOM 11292 CG GLU B 376 55.463 54.049 -26.346 1.00 24.44 C ATOM 11293 CD GLU B 376 55.479 52.837 -25.437 1.00 27.91 C ATOM 11294 OE1 GLU B 376 55.214 51.725 -25.953 1.00 30.78 O ATOM 11295 OE2 GLU B 376 55.752 52.992 -24.221 1.00 29.16 O ATOM 11296 HA GLU B 376 53.768 55.197 -24.793 1.00 0.00 H ATOM 11297 HB2 GLU B 376 53.510 53.477 -26.929 1.00 0.00 H ATOM 11298 HB3 GLU B 376 54.128 54.943 -27.725 1.00 0.00 H ATOM 11299 HG2 GLU B 376 56.065 53.836 -27.229 1.00 0.00 H ATOM 11300 HG3 GLU B 376 55.892 54.897 -25.812 1.00 0.00 H ATOM 11301 H GLU B 376 51.250 55.112 -26.426 1.00 0.00 H ATOM 11302 N THR B 377 54.163 57.547 -25.661 1.00 21.17 N ATOM 11303 CA THR B 377 54.265 58.921 -26.127 1.00 21.16 C ATOM 11304 C THR B 377 54.613 58.910 -27.621 1.00 21.15 C ATOM 11305 O THR B 377 55.558 58.247 -28.056 1.00 20.77 O ATOM 11306 CB THR B 377 55.297 59.747 -25.330 1.00 21.04 C ATOM 11307 OG1 THR B 377 54.947 59.731 -23.946 1.00 20.49 O ATOM 11308 CG2 THR B 377 55.330 61.193 -25.814 1.00 20.83 C ATOM 11309 HA THR B 377 53.303 59.407 -25.967 1.00 0.00 H ATOM 11310 HB THR B 377 56.281 59.304 -25.480 1.00 0.00 H ATOM 11311 HG1 THR B 377 55.608 60.260 -23.433 1.00 0.00 H ATOM 11312 HG23 THR B 377 55.597 61.215 -26.871 1.00 0.00 H ATOM 11313 HG21 THR B 377 54.347 61.643 -25.676 1.00 0.00 H ATOM 11314 HG22 THR B 377 56.070 61.750 -25.240 1.00 0.00 H ATOM 11315 H THR B 377 54.743 57.223 -24.861 1.00 0.00 H ATOM 11316 N THR B 378 53.817 59.634 -28.396 1.00 21.26 N ATOM 11317 CA THR B 378 53.921 59.632 -29.841 1.00 21.47 C ATOM 11318 C THR B 378 53.960 61.071 -30.318 1.00 21.54 C ATOM 11319 O THR B 378 53.070 61.852 -29.996 1.00 21.47 O ATOM 11320 CB THR B 378 52.708 58.903 -30.465 1.00 21.48 C ATOM 11321 OG1 THR B 378 52.504 57.656 -29.791 1.00 21.58 O ATOM 11322 CG2 THR B 378 52.921 58.635 -31.947 1.00 21.43 C ATOM 11323 HA THR B 378 54.827 59.109 -30.146 1.00 0.00 H ATOM 11324 HB THR B 378 51.835 59.546 -30.353 1.00 0.00 H ATOM 11325 HG1 THR B 378 52.331 57.826 -28.831 1.00 0.00 H ATOM 11326 HG23 THR B 378 53.077 59.580 -32.467 1.00 0.00 H ATOM 11327 HG21 THR B 378 53.796 57.998 -32.078 1.00 0.00 H ATOM 11328 HG22 THR B 378 52.042 58.135 -32.355 1.00 0.00 H ATOM 11329 H THR B 378 53.089 60.227 -27.949 1.00 0.00 H ATOM 11330 N ASP B 379 55.002 61.424 -31.066 1.00 21.84 N ATOM 11331 CA ASP B 379 55.066 62.733 -31.707 1.00 22.15 C ATOM 11332 C ASP B 379 54.160 62.714 -32.922 1.00 22.36 C ATOM 11333 O ASP B 379 54.198 61.780 -33.731 1.00 22.39 O ATOM 11334 CB ASP B 379 56.496 63.096 -32.118 1.00 22.21 C ATOM 11335 CG ASP B 379 57.366 63.475 -30.933 1.00 23.14 C ATOM 11336 OD1 ASP B 379 56.817 63.829 -29.868 1.00 22.47 O ATOM 11337 OD2 ASP B 379 58.609 63.423 -31.064 1.00 25.42 O ATOM 11338 HA ASP B 379 54.737 63.491 -30.996 1.00 0.00 H ATOM 11339 HB2 ASP B 379 56.944 62.238 -32.620 1.00 0.00 H ATOM 11340 HB3 ASP B 379 56.458 63.939 -32.807 1.00 0.00 H ATOM 11341 H ASP B 379 55.786 60.754 -31.196 1.00 0.00 H ATOM 11342 N ARG B 380 53.334 63.747 -33.028 1.00 22.51 N ATOM 11343 CA ARG B 380 52.370 63.859 -34.106 1.00 22.47 C ATOM 11344 C ARG B 380 51.914 65.306 -34.236 1.00 22.32 C ATOM 11345 O ARG B 380 51.732 66.001 -33.239 1.00 22.21 O ATOM 11346 CB ARG B 380 51.165 62.949 -33.844 1.00 22.45 C ATOM 11347 CG ARG B 380 50.195 62.858 -35.026 1.00 23.03 C ATOM 11348 CD ARG B 380 49.299 61.620 -34.959 1.00 23.43 C ATOM 11349 NE ARG B 380 50.068 60.375 -34.968 1.00 23.92 N ATOM 11350 CZ ARG B 380 49.574 59.163 -34.706 1.00 24.78 C ATOM 11351 NH1 ARG B 380 48.289 58.985 -34.401 1.00 25.80 N ATOM 11352 NH2 ARG B 380 50.374 58.107 -34.746 1.00 25.52 N ATOM 11353 HA ARG B 380 52.843 63.545 -35.037 1.00 0.00 H ATOM 11354 HB2 ARG B 380 51.532 61.947 -33.621 1.00 0.00 H ATOM 11355 HB3 ARG B 380 50.622 63.336 -32.982 1.00 0.00 H ATOM 11356 HG2 ARG B 380 49.563 63.746 -35.029 1.00 0.00 H ATOM 11357 HG3 ARG B 380 50.773 62.822 -35.950 1.00 0.00 H ATOM 11358 HD2 ARG B 380 48.630 61.625 -35.819 1.00 0.00 H ATOM 11359 HD3 ARG B 380 48.711 61.662 -34.042 1.00 0.00 H ATOM 11360 HE ARG B 380 51.080 60.440 -35.197 1.00 0.00 H ATOM 11361 HH12 ARG B 380 47.929 58.030 -34.201 1.00 0.00 H ATOM 11362 HH11 ARG B 380 47.646 59.801 -34.363 1.00 0.00 H ATOM 11363 HH22 ARG B 380 49.995 57.160 -34.543 1.00 0.00 H ATOM 11364 HH21 ARG B 380 51.380 58.226 -34.980 1.00 0.00 H ATOM 11365 H ARG B 380 53.379 64.502 -32.314 1.00 0.00 H ATOM 11366 N GLU B 381 51.755 65.756 -35.474 1.00 22.41 N ATOM 11367 CA GLU B 381 51.142 67.041 -35.745 1.00 21.90 C ATOM 11368 C GLU B 381 49.646 66.834 -35.543 1.00 21.37 C ATOM 11369 O GLU B 381 49.022 66.049 -36.251 1.00 21.67 O ATOM 11370 CB GLU B 381 51.445 67.502 -37.175 1.00 22.40 C ATOM 11371 CG GLU B 381 50.467 68.558 -37.740 1.00 24.06 C ATOM 11372 CD GLU B 381 51.096 69.929 -37.966 1.00 27.90 C ATOM 11373 OE1 GLU B 381 51.798 70.426 -37.054 1.00 30.17 O ATOM 11374 OE2 GLU B 381 50.876 70.507 -39.060 1.00 29.40 O ATOM 11375 HA GLU B 381 51.530 67.817 -35.085 1.00 0.00 H ATOM 11376 HB2 GLU B 381 52.448 67.928 -37.188 1.00 0.00 H ATOM 11377 HB3 GLU B 381 51.414 66.629 -37.826 1.00 0.00 H ATOM 11378 HG2 GLU B 381 50.084 68.195 -38.694 1.00 0.00 H ATOM 11379 HG3 GLU B 381 49.641 68.671 -37.038 1.00 0.00 H ATOM 11380 H GLU B 381 52.079 65.171 -36.271 1.00 0.00 H ATOM 11381 N LEU B 382 49.087 67.511 -34.551 1.00 20.35 N ATOM 11382 CA LEU B 382 47.657 67.469 -34.297 1.00 19.46 C ATOM 11383 C LEU B 382 47.078 68.819 -34.692 1.00 18.74 C ATOM 11384 O LEU B 382 47.735 69.855 -34.556 1.00 18.38 O ATOM 11385 CB LEU B 382 47.377 67.185 -32.822 1.00 19.40 C ATOM 11386 CG LEU B 382 48.064 65.958 -32.217 1.00 19.17 C ATOM 11387 CD1 LEU B 382 47.875 65.951 -30.714 1.00 19.36 C ATOM 11388 CD2 LEU B 382 47.544 64.664 -32.831 1.00 19.35 C ATOM 11389 HA LEU B 382 47.197 66.670 -34.878 1.00 0.00 H ATOM 11390 HB2 LEU B 382 47.695 68.057 -32.251 1.00 0.00 H ATOM 11391 HB3 LEU B 382 46.301 67.051 -32.709 1.00 0.00 H ATOM 11392 HG LEU B 382 49.129 66.019 -32.443 1.00 0.00 H ATOM 11393 HD21 LEU B 382 46.472 64.583 -32.651 1.00 0.00 H ATOM 11394 HD22 LEU B 382 47.734 64.671 -33.904 1.00 0.00 H ATOM 11395 HD23 LEU B 382 48.056 63.816 -32.376 1.00 0.00 H ATOM 11396 HD11 LEU B 382 48.312 66.855 -30.290 1.00 0.00 H ATOM 11397 HD12 LEU B 382 46.810 65.918 -30.483 1.00 0.00 H ATOM 11398 HD13 LEU B 382 48.367 65.075 -30.291 1.00 0.00 H ATOM 11399 H LEU B 382 49.691 68.091 -33.934 1.00 0.00 H ATOM 11400 N THR B 383 45.853 68.795 -35.195 1.00 17.90 N ATOM 11401 CA THR B 383 45.151 70.004 -35.591 1.00 17.58 C ATOM 11402 C THR B 383 43.873 70.163 -34.783 1.00 16.86 C ATOM 11403 O THR B 383 43.572 71.261 -34.335 1.00 16.94 O ATOM 11404 CB THR B 383 44.813 69.977 -37.098 1.00 17.64 C ATOM 11405 OG1 THR B 383 46.027 69.863 -37.846 1.00 18.80 O ATOM 11406 CG2 THR B 383 44.079 71.253 -37.529 1.00 17.94 C ATOM 11407 HA THR B 383 45.807 70.852 -35.396 1.00 0.00 H ATOM 11408 HB THR B 383 44.161 69.125 -37.288 1.00 0.00 H ATOM 11409 HG1 THR B 383 45.817 69.845 -38.813 1.00 0.00 H ATOM 11410 HG23 THR B 383 43.152 71.346 -36.963 1.00 0.00 H ATOM 11411 HG21 THR B 383 44.713 72.118 -37.336 1.00 0.00 H ATOM 11412 HG22 THR B 383 43.852 71.198 -38.594 1.00 0.00 H ATOM 11413 H THR B 383 45.376 67.878 -35.311 1.00 0.00 H ATOM 11414 N THR B 384 43.128 69.073 -34.602 1.00 16.03 N ATOM 11415 CA THR B 384 41.845 69.120 -33.905 1.00 15.75 C ATOM 11416 C THR B 384 41.786 68.051 -32.821 1.00 15.25 C ATOM 11417 O THR B 384 42.096 66.881 -33.069 1.00 14.96 O ATOM 11418 CB THR B 384 40.663 68.915 -34.885 1.00 15.55 C ATOM 11419 OG1 THR B 384 40.817 69.778 -36.014 1.00 14.82 O ATOM 11420 CG2 THR B 384 39.328 69.211 -34.211 1.00 15.54 C ATOM 11421 HA THR B 384 41.758 70.107 -33.451 1.00 0.00 H ATOM 11422 HB THR B 384 40.668 67.873 -35.204 1.00 0.00 H ATOM 11423 HG1 THR B 384 40.059 69.643 -36.637 1.00 0.00 H ATOM 11424 HG23 THR B 384 39.205 68.556 -33.349 1.00 0.00 H ATOM 11425 HG21 THR B 384 39.310 70.251 -33.884 1.00 0.00 H ATOM 11426 HG22 THR B 384 38.518 69.037 -34.920 1.00 0.00 H ATOM 11427 H THR B 384 43.470 68.162 -34.968 1.00 0.00 H ATOM 11428 N VAL B 385 41.371 68.460 -31.623 1.00 15.04 N ATOM 11429 CA VAL B 385 41.300 67.548 -30.475 1.00 14.87 C ATOM 11430 C VAL B 385 39.966 67.652 -29.726 1.00 14.51 C ATOM 11431 O VAL B 385 39.332 68.707 -29.705 1.00 13.77 O ATOM 11432 CB VAL B 385 42.476 67.775 -29.483 1.00 14.65 C ATOM 11433 CG1 VAL B 385 43.791 67.472 -30.156 1.00 14.97 C ATOM 11434 CG2 VAL B 385 42.479 69.196 -28.938 1.00 14.90 C ATOM 11435 HA VAL B 385 41.379 66.543 -30.889 1.00 0.00 H ATOM 11436 HB VAL B 385 42.340 67.095 -28.642 1.00 0.00 H ATOM 11437 HG11 VAL B 385 43.798 66.433 -30.487 1.00 0.00 H ATOM 11438 HG12 VAL B 385 43.917 68.129 -31.016 1.00 0.00 H ATOM 11439 HG13 VAL B 385 44.605 67.635 -29.450 1.00 0.00 H ATOM 11440 HG21 VAL B 385 42.582 69.900 -29.764 1.00 0.00 H ATOM 11441 HG22 VAL B 385 41.543 69.384 -28.413 1.00 0.00 H ATOM 11442 HG23 VAL B 385 43.314 69.318 -28.248 1.00 0.00 H ATOM 11443 H VAL B 385 41.089 69.453 -31.498 1.00 0.00 H ATOM 11444 N MET B 386 39.583 66.539 -29.104 1.00 14.59 N ATOM 11445 CA MET B 386 38.331 66.403 -28.372 1.00 14.67 C ATOM 11446 C MET B 386 38.621 65.906 -26.956 1.00 14.31 C ATOM 11447 O MET B 386 39.548 65.116 -26.746 1.00 14.45 O ATOM 11448 CB MET B 386 37.398 65.432 -29.103 1.00 14.38 C ATOM 11449 CG MET B 386 36.074 65.164 -28.390 1.00 15.17 C ATOM 11450 SD MET B 386 35.001 63.979 -29.237 1.00 16.99 S ATOM 11451 CE MET B 386 34.306 65.031 -30.510 1.00 16.81 C ATOM 11452 HA MET B 386 37.838 67.373 -28.312 1.00 0.00 H ATOM 11453 HB2 MET B 386 37.177 65.848 -30.086 1.00 0.00 H ATOM 11454 HB3 MET B 386 37.920 64.482 -29.220 1.00 0.00 H ATOM 11455 HG2 MET B 386 35.537 66.108 -28.300 1.00 0.00 H ATOM 11456 HG3 MET B 386 36.294 64.776 -27.395 1.00 0.00 H ATOM 11457 HE1 MET B 386 33.769 65.857 -30.044 1.00 0.00 H ATOM 11458 HE2 MET B 386 35.109 65.423 -31.134 1.00 0.00 H ATOM 11459 HE3 MET B 386 33.618 64.450 -31.124 1.00 0.00 H ATOM 11460 H MET B 386 40.217 65.716 -29.143 1.00 0.00 H ATOM 11461 N SER B 387 37.836 66.389 -25.995 1.00 14.03 N ATOM 11462 CA SER B 387 37.960 66.011 -24.586 1.00 14.18 C ATOM 11463 C SER B 387 36.572 65.813 -23.979 1.00 14.08 C ATOM 11464 O SER B 387 35.739 66.710 -24.052 1.00 14.22 O ATOM 11465 CB SER B 387 38.717 67.088 -23.795 1.00 14.26 C ATOM 11466 OG SER B 387 38.788 66.771 -22.407 1.00 13.34 O ATOM 11467 HA SER B 387 38.522 65.079 -24.530 1.00 0.00 H ATOM 11468 HB2 SER B 387 38.202 68.041 -23.914 1.00 0.00 H ATOM 11469 HB3 SER B 387 39.729 67.171 -24.191 1.00 0.00 H ATOM 11470 HG SER B 387 39.281 67.485 -21.931 1.00 0.00 H ATOM 11471 H SER B 387 37.096 67.070 -26.259 1.00 0.00 H ATOM 11472 N ASN B 388 36.345 64.644 -23.382 1.00 14.18 N ATOM 11473 CA ASN B 388 35.046 64.268 -22.801 1.00 14.24 C ATOM 11474 C ASN B 388 35.010 64.390 -21.275 1.00 14.35 C ATOM 11475 O ASN B 388 35.947 63.979 -20.586 1.00 13.57 O ATOM 11476 CB ASN B 388 34.712 62.815 -23.153 1.00 13.93 C ATOM 11477 CG ASN B 388 34.317 62.629 -24.604 1.00 14.12 C ATOM 11478 OD1 ASN B 388 33.962 63.579 -25.294 1.00 14.33 O ATOM 11479 ND2 ASN B 388 34.365 61.385 -25.070 1.00 13.75 N ATOM 11480 HA ASN B 388 34.320 64.963 -23.222 1.00 0.00 H ATOM 11481 HB2 ASN B 388 35.588 62.199 -22.950 1.00 0.00 H ATOM 11482 HB3 ASN B 388 33.885 62.487 -22.523 1.00 0.00 H ATOM 11483 HD22 ASN B 388 34.672 60.609 -24.450 1.00 0.00 H ATOM 11484 HD21 ASN B 388 34.095 61.188 -26.055 1.00 0.00 H ATOM 11485 H ASN B 388 37.127 63.961 -23.323 1.00 0.00 H ATOM 11486 N SER B 389 33.904 64.921 -20.762 1.00 14.81 N ATOM 11487 CA SER B 389 33.669 65.017 -19.325 1.00 15.35 C ATOM 11488 C SER B 389 32.239 64.572 -19.011 1.00 16.08 C ATOM 11489 O SER B 389 31.276 65.203 -19.458 1.00 16.10 O ATOM 11490 CB SER B 389 33.907 66.452 -18.838 1.00 15.22 C ATOM 11491 OG SER B 389 35.272 66.819 -18.958 1.00 14.37 O ATOM 11492 HA SER B 389 34.368 64.363 -18.803 1.00 0.00 H ATOM 11493 HB2 SER B 389 33.610 66.526 -17.792 1.00 0.00 H ATOM 11494 HB3 SER B 389 33.302 67.134 -19.435 1.00 0.00 H ATOM 11495 HG SER B 389 35.827 66.206 -18.414 1.00 0.00 H ATOM 11496 H SER B 389 33.177 65.283 -21.412 1.00 0.00 H ATOM 11497 N PHE B 390 32.115 63.469 -18.271 1.00 16.88 N ATOM 11498 CA PHE B 390 30.826 62.931 -17.847 1.00 17.52 C ATOM 11499 C PHE B 390 30.812 62.838 -16.330 1.00 18.37 C ATOM 11500 O PHE B 390 31.792 62.381 -15.741 1.00 19.10 O ATOM 11501 CB PHE B 390 30.612 61.533 -18.414 1.00 18.00 C ATOM 11502 CG PHE B 390 30.977 61.401 -19.853 1.00 18.18 C ATOM 11503 CD1 PHE B 390 30.474 62.288 -20.797 1.00 19.15 C ATOM 11504 CD2 PHE B 390 31.812 60.380 -20.275 1.00 18.71 C ATOM 11505 CE1 PHE B 390 30.811 62.172 -22.137 1.00 18.72 C ATOM 11506 CE2 PHE B 390 32.147 60.253 -21.611 1.00 19.10 C ATOM 11507 CZ PHE B 390 31.647 61.151 -22.545 1.00 18.76 C ATOM 11508 HA PHE B 390 30.036 63.589 -18.209 1.00 0.00 H ATOM 11509 HB2 PHE B 390 31.220 60.833 -17.840 1.00 0.00 H ATOM 11510 HB3 PHE B 390 29.559 61.275 -18.302 1.00 0.00 H ATOM 11511 HD2 PHE B 390 32.208 59.671 -19.548 1.00 0.00 H ATOM 11512 HE2 PHE B 390 32.805 59.446 -21.932 1.00 0.00 H ATOM 11513 HZ PHE B 390 31.914 61.050 -23.597 1.00 0.00 H ATOM 11514 HE1 PHE B 390 30.418 62.883 -22.864 1.00 0.00 H ATOM 11515 HD1 PHE B 390 29.804 63.087 -20.479 1.00 0.00 H ATOM 11516 H PHE B 390 32.979 62.968 -17.982 1.00 0.00 H ATOM 11517 N GLY B 391 29.717 63.255 -15.696 1.00 18.65 N ATOM 11518 CA GLY B 391 29.606 63.185 -14.236 1.00 18.74 C ATOM 11519 C GLY B 391 28.391 62.405 -13.765 1.00 19.03 C ATOM 11520 O GLY B 391 27.531 62.037 -14.572 1.00 19.27 O ATOM 11521 HA3 GLY B 391 29.540 64.200 -13.844 1.00 0.00 H ATOM 11522 HA2 GLY B 391 30.501 62.703 -13.843 1.00 0.00 H ATOM 11523 H GLY B 391 28.924 63.638 -16.249 1.00 0.00 H ATOM 11524 N PHE B 392 28.307 62.166 -12.454 1.00 19.11 N ATOM 11525 CA PHE B 392 27.097 61.588 -11.865 1.00 19.02 C ATOM 11526 C PHE B 392 25.902 62.505 -12.121 1.00 18.76 C ATOM 11527 O PHE B 392 26.053 63.719 -12.290 1.00 18.63 O ATOM 11528 CB PHE B 392 27.231 61.367 -10.348 1.00 20.22 C ATOM 11529 CG PHE B 392 28.283 60.362 -9.943 1.00 20.89 C ATOM 11530 CD1 PHE B 392 28.877 59.500 -10.861 1.00 22.30 C ATOM 11531 CD2 PHE B 392 28.657 60.259 -8.607 1.00 22.74 C ATOM 11532 CE1 PHE B 392 29.850 58.577 -10.449 1.00 22.34 C ATOM 11533 CE2 PHE B 392 29.622 59.336 -8.199 1.00 22.23 C ATOM 11534 CZ PHE B 392 30.214 58.497 -9.123 1.00 21.72 C ATOM 11535 HA PHE B 392 26.948 60.618 -12.339 1.00 0.00 H ATOM 11536 HB2 PHE B 392 27.480 62.323 -9.887 1.00 0.00 H ATOM 11537 HB3 PHE B 392 26.269 61.022 -9.969 1.00 0.00 H ATOM 11538 HD2 PHE B 392 28.189 60.909 -7.867 1.00 0.00 H ATOM 11539 HE2 PHE B 392 29.909 59.277 -7.149 1.00 0.00 H ATOM 11540 HZ PHE B 392 30.966 57.775 -8.804 1.00 0.00 H ATOM 11541 HE1 PHE B 392 30.320 57.920 -11.181 1.00 0.00 H ATOM 11542 HD1 PHE B 392 28.583 59.543 -11.910 1.00 0.00 H ATOM 11543 H PHE B 392 29.115 62.394 -11.840 1.00 0.00 H ATOM 11544 N GLY B 393 24.713 61.912 -12.144 1.00 18.02 N ATOM 11545 CA GLY B 393 23.498 62.642 -12.472 1.00 17.36 C ATOM 11546 C GLY B 393 23.209 62.661 -13.963 1.00 16.80 C ATOM 11547 O GLY B 393 22.218 63.249 -14.394 1.00 16.84 O ATOM 11548 HA3 GLY B 393 23.604 63.670 -12.124 1.00 0.00 H ATOM 11549 HA2 GLY B 393 22.659 62.171 -11.960 1.00 0.00 H ATOM 11550 H GLY B 393 24.649 60.898 -11.921 1.00 0.00 H ATOM 11551 N GLY B 394 24.085 62.036 -14.747 1.00 16.04 N ATOM 11552 CA GLY B 394 23.880 61.867 -16.176 1.00 15.60 C ATOM 11553 C GLY B 394 24.196 63.112 -16.971 1.00 15.00 C ATOM 11554 O GLY B 394 23.585 63.360 -18.000 1.00 15.08 O ATOM 11555 HA3 GLY B 394 22.837 61.600 -16.348 1.00 0.00 H ATOM 11556 HA2 GLY B 394 24.523 61.059 -16.526 1.00 0.00 H ATOM 11557 H GLY B 394 24.952 61.653 -14.319 1.00 0.00 H ATOM 11558 N THR B 395 25.176 63.879 -16.507 1.00 14.64 N ATOM 11559 CA THR B 395 25.502 65.174 -17.096 1.00 14.32 C ATOM 11560 C THR B 395 26.764 65.073 -17.951 1.00 13.92 C ATOM 11561 O THR B 395 27.810 64.634 -17.472 1.00 13.92 O ATOM 11562 CB THR B 395 25.643 66.279 -16.017 1.00 14.23 C ATOM 11563 OG1 THR B 395 25.999 67.515 -16.646 1.00 15.36 O ATOM 11564 CG2 THR B 395 26.694 65.941 -14.965 1.00 14.55 C ATOM 11565 HA THR B 395 24.672 65.462 -17.741 1.00 0.00 H ATOM 11566 HB THR B 395 24.681 66.360 -15.511 1.00 0.00 H ATOM 11567 HG1 THR B 395 25.293 67.771 -17.292 1.00 0.00 H ATOM 11568 HG23 THR B 395 26.432 65.001 -14.480 1.00 0.00 H ATOM 11569 HG21 THR B 395 27.668 65.845 -15.444 1.00 0.00 H ATOM 11570 HG22 THR B 395 26.731 66.737 -14.221 1.00 0.00 H ATOM 11571 H THR B 395 25.732 63.544 -15.694 1.00 0.00 H ATOM 11572 N ASN B 396 26.652 65.493 -19.212 1.00 13.42 N ATOM 11573 CA ASN B 396 27.703 65.287 -20.213 1.00 13.12 C ATOM 11574 C ASN B 396 28.214 66.578 -20.826 1.00 12.94 C ATOM 11575 O ASN B 396 27.426 67.479 -21.127 1.00 12.88 O ATOM 11576 CB ASN B 396 27.170 64.414 -21.342 1.00 12.96 C ATOM 11577 CG ASN B 396 26.569 63.137 -20.838 1.00 12.20 C ATOM 11578 OD1 ASN B 396 27.217 62.388 -20.115 1.00 12.34 O ATOM 11579 ND2 ASN B 396 25.316 62.890 -21.189 1.00 11.61 N ATOM 11580 HA ASN B 396 28.532 64.812 -19.688 1.00 0.00 H ATOM 11581 HB2 ASN B 396 26.406 64.971 -21.885 1.00 0.00 H ATOM 11582 HB3 ASN B 396 27.991 64.173 -22.017 1.00 0.00 H ATOM 11583 HD22 ASN B 396 24.808 63.556 -21.805 1.00 0.00 H ATOM 11584 HD21 ASN B 396 24.841 62.030 -20.849 1.00 0.00 H ATOM 11585 H ASN B 396 25.783 65.987 -19.497 1.00 0.00 H ATOM 11586 N ALA B 397 29.531 66.652 -21.018 1.00 12.50 N ATOM 11587 CA ALA B 397 30.159 67.779 -21.702 1.00 12.57 C ATOM 11588 C ALA B 397 31.302 67.299 -22.590 1.00 12.49 C ATOM 11589 O ALA B 397 32.055 66.405 -22.208 1.00 12.56 O ATOM 11590 CB ALA B 397 30.676 68.796 -20.694 1.00 12.44 C ATOM 11591 HA ALA B 397 29.406 68.257 -22.328 1.00 0.00 H ATOM 11592 HB1 ALA B 397 29.845 69.165 -20.093 1.00 0.00 H ATOM 11593 HB2 ALA B 397 31.412 68.321 -20.045 1.00 0.00 H ATOM 11594 HB3 ALA B 397 31.140 69.628 -21.224 1.00 0.00 H ATOM 11595 H ALA B 397 30.133 65.879 -20.668 1.00 0.00 H ATOM 11596 N THR B 398 31.419 67.898 -23.775 1.00 12.55 N ATOM 11597 CA THR B 398 32.550 67.652 -24.681 1.00 12.48 C ATOM 11598 C THR B 398 33.045 68.975 -25.261 1.00 12.54 C ATOM 11599 O THR B 398 32.244 69.812 -25.671 1.00 12.58 O ATOM 11600 CB THR B 398 32.166 66.719 -25.851 1.00 12.34 C ATOM 11601 OG1 THR B 398 31.650 65.484 -25.342 1.00 11.71 O ATOM 11602 CG2 THR B 398 33.368 66.423 -26.737 1.00 12.38 C ATOM 11603 HA THR B 398 33.331 67.168 -24.095 1.00 0.00 H ATOM 11604 HB THR B 398 31.407 67.227 -26.446 1.00 0.00 H ATOM 11605 HG1 THR B 398 32.340 65.043 -24.786 1.00 0.00 H ATOM 11606 HG23 THR B 398 33.768 67.358 -27.129 1.00 0.00 H ATOM 11607 HG21 THR B 398 34.134 65.917 -26.150 1.00 0.00 H ATOM 11608 HG22 THR B 398 33.060 65.783 -27.564 1.00 0.00 H ATOM 11609 H THR B 398 30.680 68.567 -24.071 1.00 0.00 H ATOM 11610 N LEU B 399 34.363 69.155 -25.284 1.00 12.56 N ATOM 11611 CA LEU B 399 34.974 70.303 -25.933 1.00 12.63 C ATOM 11612 C LEU B 399 35.821 69.855 -27.112 1.00 12.65 C ATOM 11613 O LEU B 399 36.550 68.859 -27.033 1.00 12.05 O ATOM 11614 CB LEU B 399 35.834 71.080 -24.947 1.00 12.60 C ATOM 11615 CG LEU B 399 35.103 71.607 -23.714 1.00 13.02 C ATOM 11616 CD1 LEU B 399 36.109 71.981 -22.637 1.00 14.04 C ATOM 11617 CD2 LEU B 399 34.217 72.788 -24.060 1.00 13.57 C ATOM 11618 HA LEU B 399 34.178 70.954 -26.294 1.00 0.00 H ATOM 11619 HB2 LEU B 399 36.635 70.423 -24.608 1.00 0.00 H ATOM 11620 HB3 LEU B 399 36.263 71.932 -25.474 1.00 0.00 H ATOM 11621 HG LEU B 399 34.456 70.816 -23.333 1.00 0.00 H ATOM 11622 HD21 LEU B 399 34.829 73.591 -24.470 1.00 0.00 H ATOM 11623 HD22 LEU B 399 33.476 72.481 -24.798 1.00 0.00 H ATOM 11624 HD23 LEU B 399 33.712 73.138 -23.160 1.00 0.00 H ATOM 11625 HD11 LEU B 399 36.690 71.100 -22.363 1.00 0.00 H ATOM 11626 HD12 LEU B 399 36.777 72.754 -23.018 1.00 0.00 H ATOM 11627 HD13 LEU B 399 35.579 72.356 -21.761 1.00 0.00 H ATOM 11628 H LEU B 399 34.975 68.452 -24.823 1.00 0.00 H ATOM 11629 N VAL B 400 35.712 70.596 -28.211 1.00 12.96 N ATOM 11630 CA VAL B 400 36.495 70.324 -29.408 1.00 13.59 C ATOM 11631 C VAL B 400 37.297 71.569 -29.704 1.00 14.08 C ATOM 11632 O VAL B 400 36.738 72.666 -29.837 1.00 14.12 O ATOM 11633 CB VAL B 400 35.605 69.939 -30.618 1.00 13.43 C ATOM 11634 CG1 VAL B 400 36.439 69.780 -31.879 1.00 13.39 C ATOM 11635 CG2 VAL B 400 34.869 68.645 -30.329 1.00 13.05 C ATOM 11636 HA VAL B 400 37.147 69.468 -29.235 1.00 0.00 H ATOM 11637 HB VAL B 400 34.885 70.741 -30.778 1.00 0.00 H ATOM 11638 HG11 VAL B 400 36.943 70.721 -32.101 1.00 0.00 H ATOM 11639 HG12 VAL B 400 37.181 68.996 -31.726 1.00 0.00 H ATOM 11640 HG13 VAL B 400 35.789 69.510 -32.711 1.00 0.00 H ATOM 11641 HG21 VAL B 400 35.592 67.850 -30.147 1.00 0.00 H ATOM 11642 HG22 VAL B 400 34.241 68.775 -29.448 1.00 0.00 H ATOM 11643 HG23 VAL B 400 34.247 68.383 -31.185 1.00 0.00 H ATOM 11644 H VAL B 400 35.046 71.395 -28.216 1.00 0.00 H ATOM 11645 N MET B 401 38.611 71.387 -29.791 1.00 14.87 N ATOM 11646 CA MET B 401 39.549 72.488 -29.912 1.00 15.75 C ATOM 11647 C MET B 401 40.385 72.306 -31.172 1.00 15.68 C ATOM 11648 O MET B 401 40.815 71.196 -31.478 1.00 15.06 O ATOM 11649 CB MET B 401 40.444 72.533 -28.673 1.00 15.83 C ATOM 11650 CG MET B 401 39.687 72.859 -27.381 1.00 16.85 C ATOM 11651 SD MET B 401 40.523 72.303 -25.882 1.00 19.38 S ATOM 11652 CE MET B 401 40.271 70.523 -25.950 1.00 19.14 C ATOM 11653 HA MET B 401 39.007 73.431 -29.986 1.00 0.00 H ATOM 11654 HB2 MET B 401 40.921 71.560 -28.557 1.00 0.00 H ATOM 11655 HB3 MET B 401 41.208 73.295 -28.827 1.00 0.00 H ATOM 11656 HG2 MET B 401 38.709 72.380 -27.426 1.00 0.00 H ATOM 11657 HG3 MET B 401 39.559 73.940 -27.322 1.00 0.00 H ATOM 11658 HE1 MET B 401 39.202 70.308 -25.948 1.00 0.00 H ATOM 11659 HE2 MET B 401 40.720 70.128 -26.861 1.00 0.00 H ATOM 11660 HE3 MET B 401 40.738 70.058 -25.082 1.00 0.00 H ATOM 11661 H MET B 401 38.982 70.416 -29.772 1.00 0.00 H ATOM 11662 N ARG B 402 40.603 73.397 -31.902 1.00 16.17 N ATOM 11663 CA ARG B 402 41.354 73.335 -33.150 1.00 16.81 C ATOM 11664 C ARG B 402 42.383 74.450 -33.292 1.00 17.31 C ATOM 11665 O ARG B 402 42.097 75.617 -33.011 1.00 16.88 O ATOM 11666 CB ARG B 402 40.409 73.363 -34.346 1.00 16.54 C ATOM 11667 CG ARG B 402 41.089 73.040 -35.666 1.00 16.24 C ATOM 11668 CD ARG B 402 40.060 72.749 -36.726 1.00 16.37 C ATOM 11669 NE ARG B 402 39.168 73.887 -36.917 1.00 15.85 N ATOM 11670 CZ ARG B 402 37.969 73.832 -37.491 1.00 15.92 C ATOM 11671 NH1 ARG B 402 37.481 72.687 -37.946 1.00 15.11 N ATOM 11672 NH2 ARG B 402 37.247 74.940 -37.611 1.00 16.43 N ATOM 11673 HA ARG B 402 41.901 72.392 -33.124 1.00 0.00 H ATOM 11674 HB2 ARG B 402 39.618 72.632 -34.178 1.00 0.00 H ATOM 11675 HB3 ARG B 402 39.973 74.359 -34.418 1.00 0.00 H ATOM 11676 HG2 ARG B 402 41.695 73.891 -35.977 1.00 0.00 H ATOM 11677 HG3 ARG B 402 41.730 72.168 -35.537 1.00 0.00 H ATOM 11678 HD2 ARG B 402 39.472 71.882 -36.424 1.00 0.00 H ATOM 11679 HD3 ARG B 402 40.568 72.532 -37.666 1.00 0.00 H ATOM 11680 HE ARG B 402 39.495 74.814 -36.578 1.00 0.00 H ATOM 11681 HH12 ARG B 402 36.542 72.663 -38.392 1.00 0.00 H ATOM 11682 HH11 ARG B 402 38.037 71.813 -37.857 1.00 0.00 H ATOM 11683 HH22 ARG B 402 36.309 74.904 -38.059 1.00 0.00 H ATOM 11684 HH21 ARG B 402 37.620 75.844 -37.257 1.00 0.00 H ATOM 11685 H ARG B 402 40.230 74.312 -31.576 1.00 0.00 H ATOM 11686 N LYS B 403 43.578 74.064 -33.733 1.00 18.34 N ATOM 11687 CA LYS B 403 44.635 75.010 -34.100 1.00 19.50 C ATOM 11688 C LYS B 403 44.169 76.020 -35.130 1.00 20.29 C ATOM 11689 O LYS B 403 43.412 75.684 -36.036 1.00 20.90 O ATOM 11690 CB LYS B 403 45.828 74.277 -34.713 1.00 19.86 C ATOM 11691 CG LYS B 403 46.936 73.990 -33.750 1.00 20.10 C ATOM 11692 CD LYS B 403 48.132 73.412 -34.478 1.00 19.75 C ATOM 11693 CE LYS B 403 49.276 73.190 -33.518 1.00 20.13 C ATOM 11694 NZ LYS B 403 49.744 74.455 -32.877 1.00 20.56 N ATOM 11695 HA LYS B 403 44.911 75.520 -33.177 1.00 0.00 H ATOM 11696 HB2 LYS B 403 45.475 73.329 -35.119 1.00 0.00 H ATOM 11697 HB3 LYS B 403 46.228 74.891 -35.520 1.00 0.00 H ATOM 11698 HG2 LYS B 403 47.230 74.915 -33.254 1.00 0.00 H ATOM 11699 HG3 LYS B 403 46.588 73.274 -33.005 1.00 0.00 H ATOM 11700 HD2 LYS B 403 47.852 72.460 -34.930 1.00 0.00 H ATOM 11701 HD3 LYS B 403 48.447 74.105 -35.258 1.00 0.00 H ATOM 11702 HE2 LYS B 403 50.109 72.747 -34.064 1.00 0.00 H ATOM 11703 HE3 LYS B 403 48.948 72.504 -32.737 1.00 0.00 H ATOM 11704 HZ1 LYS B 403 50.068 75.116 -33.612 1.00 0.00 H ATOM 11705 HZ2 LYS B 403 48.960 74.884 -32.345 1.00 0.00 H ATOM 11706 HZ3 LYS B 403 50.529 74.244 -32.229 1.00 0.00 H ATOM 11707 H LYS B 403 43.770 73.046 -33.821 1.00 0.00 H ATOM 11708 N LEU B 404 44.648 77.250 -35.002 1.00 20.99 N ATOM 11709 CA LEU B 404 44.381 78.286 -35.990 1.00 21.31 C ATOM 11710 C LEU B 404 45.610 78.501 -36.873 1.00 21.52 C ATOM 11711 O LEU B 404 46.737 78.555 -36.373 1.00 22.00 O ATOM 11712 CB LEU B 404 43.964 79.587 -35.293 1.00 21.51 C ATOM 11713 CG LEU B 404 42.493 80.006 -35.413 1.00 22.45 C ATOM 11714 CD1 LEU B 404 41.516 78.845 -35.320 1.00 23.52 C ATOM 11715 CD2 LEU B 404 42.156 81.054 -34.364 1.00 22.28 C ATOM 11716 HA LEU B 404 43.558 77.967 -36.629 1.00 0.00 H ATOM 11717 HB2 LEU B 404 44.189 79.478 -34.232 1.00 0.00 H ATOM 11718 HB3 LEU B 404 44.570 80.392 -35.710 1.00 0.00 H ATOM 11719 HG LEU B 404 42.379 80.425 -36.413 1.00 0.00 H ATOM 11720 HD21 LEU B 404 42.329 80.641 -33.370 1.00 0.00 H ATOM 11721 HD22 LEU B 404 42.789 81.929 -34.510 1.00 0.00 H ATOM 11722 HD23 LEU B 404 41.109 81.341 -34.462 1.00 0.00 H ATOM 11723 HD11 LEU B 404 41.718 78.136 -36.123 1.00 0.00 H ATOM 11724 HD12 LEU B 404 41.635 78.348 -34.357 1.00 0.00 H ATOM 11725 HD13 LEU B 404 40.497 79.221 -35.413 1.00 0.00 H ATOM 11726 H LEU B 404 45.231 77.481 -34.172 1.00 0.00 H TER 11727 LEU B 404 HETATM11728 O HOH 1 18.751 77.384 4.495 1.00 11.31 O HETATM11729 O HOH 2 14.141 65.720 -22.356 1.00 5.04 O HETATM11730 O HOH 3 11.227 86.691 -0.499 1.00 19.24 O HETATM11731 O HOH 4 32.992 91.517 -4.702 1.00 17.15 O HETATM11732 O HOH 5 19.078 82.631 -5.432 1.00 12.72 O HETATM11733 O HOH 6 15.275 71.235 4.810 1.00 16.95 O HETATM11734 O HOH 7 26.865 96.148 -5.832 1.00 22.70 O HETATM11735 O HOH 8 10.086 95.024 4.649 1.00 23.72 O HETATM11736 O HOH 9 38.917 93.273 -4.411 1.00 19.85 O HETATM11737 O HOH 10 11.185 83.076 -0.508 1.00 15.42 O HETATM11738 O HOH 11 16.464 91.802 10.873 1.00 12.34 O HETATM11739 O HOH 12 7.171 91.709 3.026 1.00 20.68 O HETATM11740 O HOH 13 5.163 85.571 16.233 1.00 29.20 O HETATM11741 O HOH 14 15.350 87.970 6.044 1.00 21.31 O HETATM11742 O HOH 15 8.652 65.283 6.109 1.00 28.36 O HETATM11743 O HOH 16 23.835 86.214 13.652 1.00 13.79 O HETATM11744 O HOH 17 6.803 91.463 -23.550 1.00 14.95 O HETATM11745 O HOH 18 -0.098 67.829 -22.068 1.00 10.15 O HETATM11746 O HOH 19 4.043 69.834 -4.316 1.00 12.68 O HETATM11747 O HOH 20 23.973 56.250 2.025 1.00 15.75 O HETATM11748 O HOH 21 28.293 95.297 -16.466 1.00 27.77 O HETATM11749 O HOH 22 15.701 87.107 15.978 1.00 22.13 O HETATM11750 O HOH 23 15.247 78.372 -28.741 1.00 16.63 O HETATM11751 O HOH 24 23.868 67.882 -13.013 1.00 11.94 O HETATM11752 O HOH 25 19.878 76.453 6.612 1.00 20.98 O HETATM11753 O HOH 26 -5.555 98.693 -3.176 1.00 32.72 O HETATM11754 O HOH 27 13.909 84.501 -0.105 1.00 17.62 O HETATM11755 O HOH 28 10.198 87.441 10.767 1.00 22.99 O HETATM11756 O HOH 29 36.459 58.141 14.433 1.00 20.31 O HETATM11757 O HOH 30 7.864 76.812 16.449 1.00 24.77 O HETATM11758 O HOH 31 27.294 87.595 -12.150 1.00 6.15 O HETATM11759 O HOH 32 29.680 53.904 12.082 1.00 21.30 O HETATM11760 O HOH 33 23.976 65.702 9.686 1.00 14.07 O HETATM11761 O HOH 34 10.885 79.283 1.422 1.00 20.88 O HETATM11762 O HOH 35 16.218 87.316 20.880 1.00 24.00 O HETATM11763 O HOH 36 21.793 108.995 7.784 1.00 34.14 O HETATM11764 O HOH 37 1.701 75.811 -10.139 1.00 16.64 O HETATM11765 O HOH 38 17.360 61.553 -27.240 1.00 22.97 O HETATM11766 O HOH 39 18.710 67.396 3.338 1.00 23.04 O HETATM11767 O HOH 40 5.160 87.967 16.319 1.00 34.22 O HETATM11768 O HOH 41 5.052 73.781 -29.516 1.00 23.52 O HETATM11769 O HOH 42 25.376 54.721 -5.388 1.00 34.09 O HETATM11770 O HOH 43 16.778 87.911 -9.545 1.00 14.85 O HETATM11771 O HOH 44 11.176 96.633 -25.673 1.00 27.44 O HETATM11772 O HOH 45 20.614 65.838 -3.651 1.00 16.95 O HETATM11773 O HOH 46 4.402 64.348 -5.517 1.00 24.38 O HETATM11774 O HOH 47 12.898 67.387 -30.425 1.00 26.62 O HETATM11775 O HOH 48 5.045 64.253 -15.881 1.00 19.27 O HETATM11776 O HOH 49 25.025 97.940 -17.172 1.00 26.49 O HETATM11777 O HOH 50 12.560 72.528 15.203 1.00 26.60 O HETATM11778 O HOH 51 32.061 97.233 -7.741 1.00 18.01 O HETATM11779 O HOH 52 26.597 79.155 -3.596 1.00 22.57 O HETATM11780 O HOH 53 28.685 73.399 8.373 1.00 26.84 O HETATM11781 O HOH 54 21.128 78.464 21.603 1.00 20.00 O HETATM11782 O HOH 55 19.850 93.408 1.977 1.00 18.27 O HETATM11783 O HOH 56 25.218 94.540 7.322 1.00 36.56 O HETATM11784 O HOH 57 13.906 101.178 -24.697 1.00 38.96 O HETATM11785 O HOH 58 13.148 90.850 -0.086 1.00 27.74 O HETATM11786 O HOH 59 20.128 70.000 0.364 1.00 13.03 O HETATM11787 O HOH 60 2.317 67.609 -23.585 1.00 14.85 O HETATM11788 O HOH 61 20.871 73.316 0.509 1.00 18.22 O HETATM11789 O HOH 62 26.920 92.037 -4.686 1.00 26.85 O HETATM11790 O HOH 63 1.525 76.703 -20.382 1.00 9.38 O HETATM11791 O HOH 64 6.371 61.846 -7.450 1.00 17.28 O HETATM11792 O HOH 65 3.278 66.903 -12.667 1.00 12.96 O HETATM11793 O HOH 66 6.182 63.401 -11.221 1.00 17.87 O HETATM11794 O HOH 67 -1.995 81.532 -7.625 1.00 22.52 O HETATM11795 O HOH 68 11.146 83.436 -30.463 1.00 22.80 O HETATM11796 O HOH 69 20.096 93.627 -0.576 1.00 37.71 O HETATM11797 O HOH 70 23.023 89.809 7.566 1.00 38.06 O HETATM11798 O HOH 71 31.350 93.941 -2.916 1.00 35.57 O HETATM11799 O HOH 72 25.663 66.387 -11.691 1.00 14.58 O HETATM11800 O HOH 73 1.814 75.605 -7.572 1.00 14.12 O HETATM11801 O HOH 74 9.563 75.766 13.313 1.00 17.72 O HETATM11802 O HOH 75 0.838 87.781 -16.276 1.00 25.93 O HETATM11803 O HOH 76 5.581 98.834 -17.619 1.00 23.45 O HETATM11804 O HOH 77 14.356 86.811 -9.122 1.00 20.46 O HETATM11805 O HOH 78 19.103 92.051 -20.832 1.00 18.89 O HETATM11806 O HOH 79 20.488 86.699 -21.976 1.00 26.46 O HETATM11807 O HOH 80 25.015 64.388 11.502 1.00 17.90 O HETATM11808 O HOH 81 8.480 61.743 -12.731 1.00 33.56 O HETATM11809 O HOH 82 15.934 70.467 9.693 1.00 19.68 O HETATM11810 O HOH 83 14.226 89.707 -5.456 1.00 15.53 O HETATM11811 O HOH 84 0.302 63.589 -24.803 1.00 34.10 O HETATM11812 O HOH 85 17.085 96.680 -0.514 1.00 27.33 O HETATM11813 O HOH 86 13.561 70.848 13.080 1.00 25.28 O HETATM11814 O HOH 87 13.161 88.248 21.231 1.00 24.53 O HETATM11815 O HOH 88 37.660 64.204 12.518 1.00 23.68 O HETATM11816 O HOH 89 8.331 60.291 -7.839 1.00 18.10 O HETATM11817 O HOH 90 -3.297 74.231 -1.665 1.00 26.05 O HETATM11818 O HOH 91 33.034 89.999 -7.196 1.00 23.42 O HETATM11819 O HOH 92 16.716 61.560 -7.925 1.00 31.42 O HETATM11820 O HOH 93 16.923 89.862 -23.240 1.00 33.49 O HETATM11821 O HOH 94 16.901 85.019 22.404 1.00 21.90 O HETATM11822 O HOH 95 -1.215 82.373 -11.427 1.00 25.95 O HETATM11823 O HOH 96 -6.979 87.030 -1.585 1.00 30.31 O HETATM11824 O HOH 97 8.013 87.718 9.205 1.00 21.88 O HETATM11825 O HOH 98 14.728 81.604 22.350 1.00 33.76 O HETATM11826 O HOH 99 20.464 68.410 -26.715 1.00 18.95 O HETATM11827 O HOH 100 20.772 60.417 -15.763 1.00 24.70 O HETATM11828 O HOH 101 17.350 48.941 -6.653 1.00 33.12 O HETATM11829 O HOH 102 17.403 78.155 27.221 1.00 36.20 O HETATM11830 O HOH 103 2.299 65.561 -25.143 1.00 24.23 O HETATM11831 O HOH 104 28.181 77.008 -27.940 1.00 25.51 O HETATM11832 O HOH 105 -1.437 94.245 3.791 1.00 33.90 O HETATM11833 O HOH 106 6.591 79.810 16.112 1.00 23.31 O HETATM11834 O HOH 107 24.294 74.445 -6.966 1.00 31.50 O HETATM11835 O HOH 108 6.488 73.404 -31.835 1.00 33.46 O HETATM11836 O HOH 109 10.091 69.763 4.828 1.00 35.80 O HETATM11837 O HOH 110 17.396 82.822 11.023 1.00 9.46 O HETATM11838 O HOH 111 33.470 92.156 2.562 1.00 44.08 O HETATM11839 O HOH 112 8.367 70.056 -26.058 1.00 26.51 O HETATM11840 O HOH 113 21.934 72.872 -25.389 1.00 37.95 O HETATM11841 O HOH 114 5.484 97.262 7.140 1.00 19.09 O HETATM11842 O HOH 115 -1.054 80.626 -28.524 1.00 26.57 O HETATM11843 O HOH 116 24.926 52.247 10.476 1.00 26.95 O HETATM11844 O HOH 117 -2.673 81.901 -13.467 1.00 30.27 O HETATM11845 O HOH 118 5.436 75.358 3.511 1.00 17.89 O HETATM11846 O HOH 119 16.190 58.446 -21.174 1.00 23.46 O HETATM11847 O HOH 120 -1.027 85.337 -18.537 1.00 34.67 O HETATM11848 O HOH 121 -5.646 91.921 -3.745 1.00 33.87 O HETATM11849 O HOH 122 21.078 81.531 22.100 1.00 24.87 O HETATM11850 O HOH 123 15.082 57.980 -15.157 1.00 21.76 O HETATM11851 O HOH 124 37.453 73.261 -1.294 1.00 24.97 O HETATM11852 O HOH 125 33.714 74.418 19.982 1.00 17.98 O HETATM11853 O HOH 126 36.884 92.995 -14.780 1.00 7.13 O HETATM11854 O HOH 127 37.220 65.548 -17.807 1.00 20.24 O HETATM11855 O HOH 128 43.454 63.480 -16.682 1.00 20.12 O HETATM11856 O HOH 129 29.054 83.529 -5.029 1.00 13.68 O HETATM11857 O HOH 130 47.554 55.409 -10.267 1.00 15.30 O HETATM11858 O HOH 131 38.078 68.974 -21.255 1.00 13.49 O HETATM11859 O HOH 132 53.770 52.678 -7.028 1.00 14.89 O HETATM11860 O HOH 133 41.268 57.097 -4.536 1.00 9.43 O HETATM11861 O HOH 134 53.399 56.735 -2.544 1.00 12.35 O HETATM11862 O HOH 135 36.607 68.962 8.439 1.00 7.25 O HETATM11863 O HOH 136 48.394 61.845 4.013 1.00 12.60 O HETATM11864 O HOH 137 21.211 66.038 -27.803 1.00 19.18 O HETATM11865 O HOH 138 50.131 69.753 -33.097 1.00 11.34 O HETATM11866 O HOH 139 28.637 51.685 1.831 1.00 21.37 O HETATM11867 O HOH 140 61.857 65.700 -16.886 1.00 14.56 O HETATM11868 O HOH 141 28.798 69.018 -8.422 1.00 18.88 O HETATM11869 O HOH 142 42.110 67.770 -37.766 1.00 14.65 O HETATM11870 O HOH 143 44.006 65.971 -13.913 1.00 7.85 O HETATM11871 O HOH 144 47.687 80.099 -38.946 1.00 24.17 O HETATM11872 O HOH 145 41.383 51.986 6.559 1.00 11.24 O HETATM11873 O HOH 146 28.962 93.065 -17.742 1.00 21.96 O HETATM11874 O HOH 147 45.360 47.254 -2.088 1.00 17.26 O HETATM11875 O HOH 148 31.855 88.457 -27.481 1.00 16.06 O HETATM11876 O HOH 149 36.857 62.492 -36.924 1.00 21.12 O HETATM11877 O HOH 150 20.361 63.179 -16.518 1.00 19.32 O HETATM11878 O HOH 151 47.156 49.701 2.463 1.00 25.44 O HETATM11879 O HOH 152 57.455 59.133 -31.082 1.00 27.91 O HETATM11880 O HOH 153 51.998 81.318 -16.726 1.00 23.81 O HETATM11881 O HOH 154 59.837 72.822 -10.929 1.00 16.45 O HETATM11882 O HOH 155 50.517 81.438 -9.409 1.00 17.83 O HETATM11883 O HOH 156 51.251 83.901 -6.043 1.00 23.98 O HETATM11884 O HOH 157 25.376 86.616 -18.802 1.00 18.45 O HETATM11885 O HOH 158 51.369 77.225 -16.047 1.00 16.69 O HETATM11886 O HOH 159 47.999 85.530 -24.988 1.00 18.14 O HETATM11887 O HOH 160 25.987 75.232 -21.588 1.00 11.60 O HETATM11888 O HOH 161 39.866 72.824 1.799 1.00 18.54 O HETATM11889 O HOH 162 47.753 46.548 -3.139 1.00 26.82 O HETATM11890 O HOH 163 35.729 80.792 10.093 1.00 20.67 O HETATM11891 O HOH 164 53.728 63.437 -2.567 1.00 17.58 O HETATM11892 O HOH 165 50.643 61.474 -0.380 1.00 17.33 O HETATM11893 O HOH 166 52.982 59.812 -35.781 1.00 33.74 O HETATM11894 O HOH 167 30.625 74.868 -8.135 1.00 19.82 O HETATM11895 O HOH 168 45.280 53.988 -19.459 1.00 10.36 O HETATM11896 O HOH 169 37.196 78.846 8.889 1.00 18.42 O HETATM11897 O HOH 170 34.937 90.693 -37.237 1.00 16.13 O HETATM11898 O HOH 171 43.982 50.799 -4.914 1.00 15.20 O HETATM11899 O HOH 172 38.601 64.248 -2.015 1.00 15.78 O HETATM11900 O HOH 173 28.056 57.504 -0.689 1.00 12.12 O HETATM11901 O HOH 174 35.486 72.552 -40.314 1.00 24.66 O HETATM11902 O HOH 175 56.474 66.270 -29.515 1.00 11.34 O HETATM11903 O HOH 176 37.189 98.728 -18.956 1.00 37.23 O HETATM11904 O HOH 177 26.242 73.335 -26.996 1.00 30.80 O HETATM11905 O HOH 178 36.778 55.575 -21.570 1.00 26.94 O HETATM11906 O HOH 179 36.331 70.566 -3.551 1.00 16.27 O HETATM11907 O HOH 180 38.407 42.045 -20.473 1.00 28.34 O HETATM11908 O HOH 181 51.734 68.927 -7.729 1.00 14.07 O HETATM11909 O HOH 182 31.214 81.489 9.042 1.00 13.72 O HETATM11910 O HOH 183 41.451 64.535 -13.796 1.00 18.18 O HETATM11911 O HOH 184 52.624 56.426 6.268 1.00 26.17 O HETATM11912 O HOH 185 24.809 84.292 -17.760 1.00 12.96 O HETATM11913 O HOH 186 40.282 54.600 -32.083 1.00 21.80 O HETATM11914 O HOH 187 24.592 68.966 -19.700 1.00 5.76 O HETATM11915 O HOH 188 49.570 51.558 -21.063 1.00 13.98 O HETATM11916 O HOH 189 41.213 60.241 -18.725 1.00 25.71 O HETATM11917 O HOH 190 25.969 58.605 -21.707 1.00 22.30 O HETATM11918 O HOH 191 39.082 65.208 -4.482 1.00 15.01 O HETATM11919 O HOH 192 38.763 64.478 -20.938 1.00 19.99 O HETATM11920 O HOH 193 45.277 67.041 -10.183 1.00 10.56 O HETATM11921 O HOH 194 48.258 74.921 -30.544 1.00 15.24 O HETATM11922 O HOH 195 39.250 85.335 -1.615 1.00 25.03 O HETATM11923 O HOH 196 48.935 82.798 -31.673 1.00 21.44 O HETATM11924 O HOH 197 24.807 66.108 15.667 1.00 19.84 O HETATM11925 O HOH 198 50.789 79.062 -18.320 1.00 19.40 O HETATM11926 O HOH 199 34.516 79.616 -31.528 1.00 17.49 O HETATM11927 O HOH 200 57.100 64.272 -27.429 1.00 23.34 O HETATM11928 O HOH 201 35.449 55.875 -17.088 1.00 16.15 O HETATM11929 O HOH 202 22.651 57.294 -17.213 1.00 28.53 O HETATM11930 O HOH 203 41.368 57.361 -11.791 1.00 11.09 O HETATM11931 O HOH 204 43.124 55.175 12.112 1.00 22.22 O HETATM11932 O HOH 205 60.320 66.688 -14.586 1.00 21.11 O HETATM11933 O HOH 206 26.456 60.067 -18.563 1.00 28.75 O HETATM11934 O HOH 207 50.732 53.118 -28.820 1.00 18.42 O HETATM11935 O HOH 208 41.559 51.188 -11.299 1.00 14.52 O HETATM11936 O HOH 209 52.567 75.534 -24.216 1.00 20.69 O HETATM11937 O HOH 210 43.888 66.580 3.067 1.00 25.40 O HETATM11938 O HOH 211 23.479 89.044 -18.978 1.00 36.27 O HETATM11939 O HOH 212 50.066 49.257 -22.506 1.00 18.96 O HETATM11940 O HOH 213 25.111 70.736 -37.282 1.00 31.96 O HETATM11941 O HOH 214 29.092 72.669 -30.842 1.00 11.07 O HETATM11942 O HOH 215 42.580 61.130 8.611 1.00 22.34 O HETATM11943 O HOH 216 49.399 86.790 -12.852 1.00 13.92 O HETATM11944 O HOH 217 49.164 56.388 -12.028 1.00 11.27 O HETATM11945 O HOH 218 39.322 77.762 9.885 1.00 28.99 O HETATM11946 O HOH 219 27.974 59.468 -20.405 1.00 20.86 O HETATM11947 O HOH 220 53.228 63.891 -37.765 1.00 16.24 O HETATM11948 O HOH 221 29.552 75.778 -30.309 1.00 18.87 O HETATM11949 O HOH 222 40.094 81.654 7.466 1.00 23.91 O HETATM11950 O HOH 223 43.213 69.951 -0.855 1.00 23.55 O HETATM11951 O HOH 224 27.679 86.347 -32.108 1.00 29.19 O HETATM11952 O HOH 225 41.578 87.926 10.120 1.00 29.45 O HETATM11953 O HOH 226 49.141 51.429 9.978 1.00 26.82 O HETATM11954 O HOH 227 39.587 66.049 9.004 1.00 19.77 O HETATM11955 O HOH 228 33.299 76.082 -5.049 1.00 27.65 O HETATM11956 O HOH 229 35.230 68.703 -14.363 1.00 18.40 O HETATM11957 O HOH 230 47.299 90.752 -12.503 1.00 20.62 O HETATM11958 O HOH 231 35.622 51.910 -3.508 1.00 20.50 O HETATM11959 O HOH 232 39.413 76.816 -36.090 1.00 26.29 O HETATM11960 O HOH 233 57.781 75.621 -10.728 1.00 24.57 O HETATM11961 O HOH 234 46.055 61.355 -34.788 1.00 24.62 O HETATM11962 O HOH 235 48.546 90.995 -14.763 1.00 14.03 O HETATM11963 O HOH 236 45.561 68.286 -2.852 1.00 42.56 O HETATM11964 O HOH 237 57.695 67.368 -14.316 1.00 28.26 O HETATM11965 O HOH 238 34.994 86.583 -33.340 1.00 19.69 O HETATM11966 O HOH 239 47.728 87.312 -3.067 1.00 21.73 O HETATM11967 O HOH 240 34.176 90.700 -32.754 1.00 25.05 O HETATM11968 O HOH 241 54.225 50.585 -8.224 1.00 33.69 O HETATM11969 O HOH 242 47.120 64.195 4.289 1.00 27.70 O HETATM11970 O HOH 243 23.039 54.797 -11.636 1.00 39.90 O HETATM11971 O HOH 244 24.783 74.391 -23.789 1.00 26.55 O HETATM11972 O HOH 245 36.164 78.951 -1.034 1.00 9.80 O HETATM11973 O HOH 246 30.550 57.838 -38.348 1.00 29.73 O HETATM11974 O HOH 247 44.184 65.073 -11.354 1.00 15.18 O HETATM11975 O HOH 248 47.694 93.544 -21.405 1.00 25.10 O HETATM11976 O HOH 249 21.870 70.216 -25.030 1.00 25.82 O HETATM11977 O HOH 250 31.754 76.193 -30.307 1.00 25.77 O HETATM11978 O HOH 251 55.689 56.424 -22.814 1.00 22.77 O HETATM11979 O HOH 252 51.158 79.095 -9.371 1.00 28.58 O HETATM11980 O HOH 253 37.932 89.294 -39.181 1.00 26.91 O HETATM11981 O HOH 254 34.650 51.112 -34.321 1.00 31.46 O HETATM11982 O HOH 255 23.400 65.787 -30.567 1.00 27.68 O HETATM11983 O HOH 256 45.034 43.600 -3.991 1.00 32.05 O HETATM11984 O HOH 257 34.120 74.271 -38.309 1.00 22.57 O HETATM11985 O HOH 258 45.318 47.496 1.353 1.00 26.85 O HETATM11986 O HOH 259 35.140 51.672 6.719 1.00 20.20 O HETATM11987 O HOH 260 30.155 83.676 -7.432 1.00 17.55 O HETATM11988 O HOH 261 46.940 67.310 -0.938 1.00 25.21 O HETATM11989 O HOH 262 49.093 85.762 -4.840 1.00 24.94 O HETATM11990 O HOH 263 56.997 73.049 -8.472 1.00 32.67 O HETATM11991 O HOH 264 47.729 88.088 -11.312 1.00 16.84 O HETATM11992 O HOH 265 30.589 53.739 -14.157 1.00 31.08 O HETATM11993 O HOH 266 34.083 49.403 -26.762 1.00 36.34 O HETATM11994 O1 TL A 5 22.148 87.694 0.915 1.00 -0.36 O HETATM11995 C1 TL A 5 22.920 88.624 1.087 1.00 0.19 C HETATM11996 C2 TL A 5 23.254 89.080 2.290 1.00 0.06 C HETATM11997 C9 TL A 5 22.634 88.562 3.555 1.00 -0.01 C HETATM11998 H1 TL A 5 21.906 87.775 3.311 1.00 0.05 H HETATM11999 H2 TL A 5 22.123 89.385 4.077 1.00 0.05 H HETATM12000 H3 TL A 5 23.419 88.147 4.205 1.00 0.05 H HETATM12001 C3 TL A 5 24.171 90.036 2.257 1.00 0.03 C HETATM12002 C4 TL A 5 24.469 90.537 0.868 1.00 -0.01 C HETATM12003 S1 TL A 5 23.625 89.411 -0.200 1.00 -0.15 S HETATM12004 C10 TL A 5 23.929 91.958 0.729 1.00 -0.11 C HETATM12005 H5 TL A 5 24.478 92.627 1.408 1.00 0.00 H HETATM12006 H6 TL A 5 22.860 91.971 0.987 1.00 0.00 H HETATM12007 H7 TL A 5 24.060 92.300 -0.308 1.00 0.00 H HETATM12008 C5 TL A 5 25.964 90.488 0.603 1.00 -0.13 C HETATM12009 C6 TL A 5 26.552 90.777 -0.579 1.00 -0.03 C HETATM12010 C11 TL A 5 25.818 91.211 -1.824 1.00 -0.01 C HETATM12011 H9 TL A 5 26.541 91.379 -2.636 1.00 0.05 H HETATM12012 H10 TL A 5 25.271 92.144 -1.621 1.00 0.05 H HETATM12013 H11 TL A 5 25.107 90.427 -2.123 1.00 0.05 H HETATM12014 C7 TL A 5 28.025 90.692 -0.622 1.00 -0.01 C HETATM12015 C8 TL A 5 28.721 91.036 -1.704 1.00 -0.03 C HETATM12016 C12 TL A 5 30.219 90.957 -1.672 1.00 -0.00 C HETATM12017 H14 TL A 5 30.624 91.276 -2.644 1.00 0.06 H HETATM12018 H15 TL A 5 30.527 89.921 -1.469 1.00 0.06 H HETATM12019 H16 TL A 5 30.604 91.616 -0.880 1.00 0.06 H HETATM12020 H13 TL A 5 28.208 91.372 -2.604 1.00 0.12 H HETATM12021 H12 TL A 5 28.559 90.337 0.258 1.00 0.06 H HETATM12022 H8 TL A 5 26.612 90.198 1.429 1.00 0.03 H HETATM12023 O2 TL A 5 24.780 90.504 3.346 1.00 -0.35 O HETATM12024 H4 TL A 5 24.445 90.054 4.113 1.00 0.25 H CONECT 1 2 9 10 11 CONECT 9 1 CONECT 10 1 CONECT 11 1 CONECT 5869 5870 5890 5891 5892 CONECT 5890 5869 CONECT 5891 5869 CONECT 5892 5869 CONECT1199411995 CONECT11995119941199612003 CONECT11996119951199712001 CONECT1199711996119981199912000 CONECT1199811997 CONECT1199911997 CONECT1200011997 CONECT12001119961200212023 CONECT1200212001120031200412008 CONECT120031199512002 CONECT1200412002120051200612007 CONECT1200512004 CONECT1200612004 CONECT1200712004 CONECT12008120021200912022 CONECT12009120081201012014 CONECT1201012009120111201212013 CONECT1201112010 CONECT1201212010 CONECT1201312010 CONECT12014120091201512021 CONECT12015120141201612020 CONECT1201612015120171201812019 CONECT1201712016 CONECT1201812016 CONECT1201912016 CONECT1202012015 CONECT1202112014 CONECT1202212008 CONECT120231200112024 CONECT1202412023 MASTER 0 0 0 0 0 0 0 012022 2 39 63 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 2aq7
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
1fj4
RCSB PDB
PDBbind
406aa, >1FJ4_1|Chains... at 100%
2aqb
RCSB PDB
PDBbind
406aa, >2AQB_1|Chains... at 100%
2vb8
RCSB PDB
PDBbind
406aa, >2VB8_1|Chains... at 100%
2vba
RCSB PDB
PDBbind
406aa, >2VBA_1|Chains... at 100%
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
No complexes with the same small molecule ligand are found!
Entry Information
PDB ID
2aq7
Complex Type
Protein-Ligand
PDBbind Subset
general set
Protein Name
3-oxoacyl-[acyl-carrier-protein] synthase i
Ligand Name
TL5
EC.Number
E.C.2.3.1.41
Resolution
2.3(Å)
Affinity (Kd/Ki/IC50)
IC50=500uM
Release Year
2006
Protein/NA Sequence
Check fasta file
Primary Reference
J.Med.Chem. v49 pp. 159-71, 2006
Ligand Properties
Formula
C
1
2
H
1
6
O
2
S
Molecular Weight
224.319
Exact Mass
224.087
No. of atoms
31
No. of bonds
31
Polar Surface Area
62.6
LOGP Value
3.03 (
Computed with XLOGP3
)
3.37 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 1
No. of Hydrogen Bond Acceptors: 2
No. of Rotatable Bonds: 3
No. of Nitrogen and Oxygen Atoms: 2
No. of Rings: 1
Canonical SMILES
C/C=C/C(=C/[C@@]1(C)SC(=O)C(=C1O)C)/C
InChI String
InChI=1S/C12H16O2S/c1-5-6-8(2)7-12(4)10(13)9(3)11(14)15-12/h5-7,13H,1-4H3/b6-5+,8-7+/t12-/m1/s1
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
P0A953
Entrez Gene ID
NCBI Entrez Gene ID:
61754615
946799
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com