Browse entries in the PDBbind-CN Database
HEADER 2VBA_COMPLEX COMPND 2VBA_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 404 MET LYS ARG ALA VAL ILE THR GLY LEU GLY ILE VAL SER SEQRES 2 A 404 SER ILE GLY ASN ASN GLN GLN GLU VAL LEU ALA SER LEU SEQRES 3 A 404 ARG GLU GLY ARG SER GLY ILE THR PHE SER GLN GLU LEU SEQRES 4 A 404 LYS ASP SER GLY MET ARG SER HIS VAL TRP GLY ASN VAL SEQRES 5 A 404 LYS LEU ASP THR THR GLY LEU ILE ASP ARG LYS VAL VAL SEQRES 6 A 404 ARG PHE MET SER ASP ALA SER ILE TYR ALA PHE LEU SER SEQRES 7 A 404 MET GLU GLN ALA ILE ALA ASP ALA GLY LEU SER PRO GLU SEQRES 8 A 404 ALA TYR GLN ASN ASN PRO ARG VAL GLY LEU ILE ALA GLY SEQRES 9 A 404 SER GLY GLY GLY SER PRO ARG PHE GLN VAL PHE GLY ALA SEQRES 10 A 404 ASP ALA MET ARG GLY PRO ARG GLY LEU LYS ALA VAL GLY SEQRES 11 A 404 PRO TYR VAL VAL THR LYS ALA MET ALA SER GLY VAL SER SEQRES 12 A 404 ALA CYS LEU ALA THR PRO PHE LYS ILE HIS GLY VAL ASN SEQRES 13 A 404 TYR SER ILE SER SER ALA CYS ALA THR SER ALA HIS CYS SEQRES 14 A 404 ILE GLY ASN ALA VAL GLU GLN ILE GLN LEU GLY LYS GLN SEQRES 15 A 404 ASP ILE VAL PHE ALA GLY GLY GLY GLU GLU LEU CYS TRP SEQRES 16 A 404 GLU MET ALA CYS GLU PHE ASP ALA MET GLY ALA LEU SER SEQRES 17 A 404 THR LYS TYR ASN ASP THR PRO GLU LYS ALA SER ARG THR SEQRES 18 A 404 TYR ASP ALA HIS ARG ASP GLY PHE VAL ILE ALA GLY GLY SEQRES 19 A 404 GLY GLY MET VAL VAL VAL GLU GLU LEU GLU HIS ALA LEU SEQRES 20 A 404 ALA ARG GLY ALA HIS ILE TYR ALA GLU ILE VAL GLY TYR SEQRES 21 A 404 GLY ALA THR SER ASP GLY ALA ASP MET VAL ALA PRO SER SEQRES 22 A 404 GLY GLU GLY ALA VAL ARG CYS MET LYS MET ALA MET HIS SEQRES 23 A 404 GLY VAL ASP THR PRO ILE ASP TYR LEU ASN SER HIS GLY SEQRES 24 A 404 THR SER THR PRO VAL GLY ASP VAL LYS GLU LEU ALA ALA SEQRES 25 A 404 ILE ARG GLU VAL PHE GLY ASP LYS SER PRO ALA ILE SER SEQRES 26 A 404 ALA THR LYS ALA MET THR GLY HIS SER LEU GLY ALA ALA SEQRES 27 A 404 GLY VAL GLN GLU ALA ILE TYR SER LEU LEU MET LEU GLU SEQRES 28 A 404 HIS GLY PHE ILE ALA PRO SER ILE ASN ILE GLU GLU LEU SEQRES 29 A 404 ASP GLU GLN ALA ALA GLY LEU ASN ILE VAL THR GLU THR SEQRES 30 A 404 THR ASP ARG GLU LEU THR THR VAL MET SER ASN SER PHE SEQRES 31 A 404 GLY PHE GLY GLY THR ASN ALA THR LEU VAL MET ARG LYS SEQRES 32 A 404 LEU SEQRES 1 B 404 MET LYS ARG ALA VAL ILE THR GLY LEU GLY ILE VAL SER SEQRES 2 B 404 SER ILE GLY ASN ASN GLN GLN GLU VAL LEU ALA SER LEU SEQRES 3 B 404 ARG GLU GLY ARG SER GLY ILE THR PHE SER GLN GLU LEU SEQRES 4 B 404 LYS ASP SER GLY MET ARG SER HIS VAL TRP GLY ASN VAL SEQRES 5 B 404 LYS LEU ASP THR THR GLY LEU ILE ASP ARG LYS VAL VAL SEQRES 6 B 404 ARG PHE MET SER ASP ALA SER ILE TYR ALA PHE LEU SER SEQRES 7 B 404 MET GLU GLN ALA ILE ALA ASP ALA GLY LEU SER PRO GLU SEQRES 8 B 404 ALA TYR GLN ASN ASN PRO ARG VAL GLY LEU ILE ALA GLY SEQRES 9 B 404 SER GLY GLY GLY SER PRO ARG PHE GLN VAL PHE GLY ALA SEQRES 10 B 404 ASP ALA MET ARG GLY PRO ARG GLY LEU LYS ALA VAL GLY SEQRES 11 B 404 PRO TYR VAL VAL THR LYS ALA MET ALA SER GLY VAL SER SEQRES 12 B 404 ALA CYS LEU ALA THR PRO PHE LYS ILE HIS GLY VAL ASN SEQRES 13 B 404 TYR SER ILE SER SER ALA CYS ALA THR SER ALA HIS CYS SEQRES 14 B 404 ILE GLY ASN ALA VAL GLU GLN ILE GLN LEU GLY LYS GLN SEQRES 15 B 404 ASP ILE VAL PHE ALA GLY GLY GLY GLU GLU LEU CYS TRP SEQRES 16 B 404 GLU MET ALA CYS GLU PHE ASP ALA MET GLY ALA LEU SER SEQRES 17 B 404 THR LYS TYR ASN ASP THR PRO GLU LYS ALA SER ARG THR SEQRES 18 B 404 TYR ASP ALA HIS ARG ASP GLY PHE VAL ILE ALA GLY GLY SEQRES 19 B 404 GLY GLY MET VAL VAL VAL GLU GLU LEU GLU HIS ALA LEU SEQRES 20 B 404 ALA ARG GLY ALA HIS ILE TYR ALA GLU ILE VAL GLY TYR SEQRES 21 B 404 GLY ALA THR SER ASP GLY ALA ASP MET VAL ALA PRO SER SEQRES 22 B 404 GLY GLU GLY ALA VAL ARG CYS MET LYS MET ALA MET HIS SEQRES 23 B 404 GLY VAL ASP THR PRO ILE ASP TYR LEU ASN SER HIS GLY SEQRES 24 B 404 THR SER THR PRO VAL GLY ASP VAL LYS GLU LEU ALA ALA SEQRES 25 B 404 ILE ARG GLU VAL PHE GLY ASP LYS SER PRO ALA ILE SER SEQRES 26 B 404 ALA THR LYS ALA MET THR GLY HIS SER LEU GLY ALA ALA SEQRES 27 B 404 GLY VAL GLN GLU ALA ILE TYR SER LEU LEU MET LEU GLU SEQRES 28 B 404 HIS GLY PHE ILE ALA PRO SER ILE ASN ILE GLU GLU LEU SEQRES 29 B 404 ASP GLU GLN ALA ALA GLY LEU ASN ILE VAL THR GLU THR SEQRES 30 B 404 THR ASP ARG GLU LEU THR THR VAL MET SER ASN SER PHE SEQRES 31 B 404 GLY PHE GLY GLY THR ASN ALA THR LEU VAL MET ARG LYS SEQRES 32 B 404 LEU HET P A 4T 28 ATOM 1 N MET A 1 11.962 55.576 49.133 1.00 31.38 N ATOM 2 CA MET A 1 12.981 55.341 50.217 1.00 30.15 C ATOM 3 C MET A 1 12.442 55.873 51.539 1.00 25.47 C ATOM 4 O MET A 1 11.737 56.895 51.532 1.00 26.93 O ATOM 5 CB MET A 1 14.304 56.036 49.888 1.00 31.91 C ATOM 6 CG MET A 1 15.430 55.727 50.901 1.00 31.64 C ATOM 7 SD MET A 1 17.110 56.099 50.380 1.00 34.68 S ATOM 8 CE MET A 1 16.961 57.863 50.046 1.00 33.96 C ATOM 9 HA MET A 1 13.166 54.269 50.292 1.00 0.00 H ATOM 10 HB2 MET A 1 14.629 55.710 48.900 1.00 0.00 H ATOM 11 HB3 MET A 1 14.135 57.113 49.877 1.00 0.00 H ATOM 12 HG2 MET A 1 15.384 54.663 51.132 1.00 0.00 H ATOM 13 HG3 MET A 1 15.229 56.303 51.804 1.00 0.00 H ATOM 14 HE1 MET A 1 16.213 58.023 49.269 1.00 0.00 H ATOM 15 HE2 MET A 1 16.657 58.379 50.957 1.00 0.00 H ATOM 16 HE3 MET A 1 17.923 58.251 49.711 1.00 0.00 H ATOM 17 HN3 MET A 1 11.776 56.596 49.049 1.00 0.00 H ATOM 18 HN2 MET A 1 11.080 55.081 49.375 1.00 0.00 H ATOM 19 HN1 MET A 1 12.329 55.213 48.230 1.00 0.00 H ATOM 20 N LYS A 2 12.745 55.204 52.661 1.00 21.71 N ATOM 21 CA LYS A 2 12.260 55.679 53.972 1.00 17.79 C ATOM 22 C LYS A 2 12.873 57.033 54.287 1.00 14.85 C ATOM 23 O LYS A 2 14.061 57.284 54.022 1.00 16.05 O ATOM 24 CB LYS A 2 12.594 54.696 55.112 1.00 18.03 C ATOM 25 CG LYS A 2 12.052 53.267 54.964 1.00 22.28 C ATOM 26 CD LYS A 2 10.564 53.286 54.899 1.00 25.68 C ATOM 27 CE LYS A 2 9.954 51.900 55.036 1.00 28.20 C ATOM 28 NZ LYS A 2 8.532 52.121 54.661 1.00 31.16 N ATOM 29 HA LYS A 2 11.175 55.757 53.905 1.00 0.00 H ATOM 30 HB2 LYS A 2 13.680 54.633 55.188 1.00 0.00 H ATOM 31 HB3 LYS A 2 12.190 55.110 56.036 1.00 0.00 H ATOM 32 HG2 LYS A 2 12.447 52.825 54.050 1.00 0.00 H ATOM 33 HG3 LYS A 2 12.368 52.671 55.820 1.00 0.00 H ATOM 34 HD2 LYS A 2 10.187 53.915 55.706 1.00 0.00 H ATOM 35 HD3 LYS A 2 10.262 53.707 53.940 1.00 0.00 H ATOM 36 HE2 LYS A 2 10.037 51.535 56.060 1.00 0.00 H ATOM 37 HE3 LYS A 2 10.433 51.192 54.359 1.00 0.00 H ATOM 38 HZ1 LYS A 2 8.106 52.811 55.312 1.00 0.00 H ATOM 39 HZ2 LYS A 2 8.484 52.485 53.688 1.00 0.00 H ATOM 40 HZ3 LYS A 2 8.015 51.221 54.722 1.00 0.00 H ATOM 41 H LYS A 2 13.326 54.343 52.607 1.00 0.00 H ATOM 42 N ARG A 3 12.052 57.886 54.876 1.00 12.86 N ATOM 43 CA ARG A 3 12.422 59.263 55.245 1.00 12.28 C ATOM 44 C ARG A 3 12.729 59.338 56.726 1.00 11.27 C ATOM 45 O ARG A 3 12.127 58.631 57.537 1.00 12.29 O ATOM 46 CB ARG A 3 11.281 60.210 54.880 1.00 13.01 C ATOM 47 CG ARG A 3 11.091 60.205 53.355 1.00 15.16 C ATOM 48 CD ARG A 3 9.763 60.819 52.950 1.00 15.46 C ATOM 49 NE ARG A 3 9.716 62.249 53.293 1.00 15.14 N ATOM 50 CZ ARG A 3 8.611 62.968 53.225 1.00 16.42 C ATOM 51 NH1 ARG A 3 7.490 62.391 52.815 1.00 18.20 N ATOM 52 NH2 ARG A 3 8.631 64.244 53.545 1.00 17.28 N ATOM 53 HA ARG A 3 13.316 59.561 54.696 1.00 0.00 H ATOM 54 HB2 ARG A 3 10.362 59.878 55.364 1.00 0.00 H ATOM 55 HB3 ARG A 3 11.522 61.219 55.215 1.00 0.00 H ATOM 56 HG2 ARG A 3 11.898 60.776 52.897 1.00 0.00 H ATOM 57 HG3 ARG A 3 11.128 59.176 52.998 1.00 0.00 H ATOM 58 HD2 ARG A 3 8.957 60.301 53.470 1.00 0.00 H ATOM 59 HD3 ARG A 3 9.631 60.706 51.874 1.00 0.00 H ATOM 60 HE ARG A 3 10.593 62.714 53.603 1.00 0.00 H ATOM 61 HH12 ARG A 3 6.612 62.945 52.756 1.00 0.00 H ATOM 62 HH11 ARG A 3 7.489 61.385 52.552 1.00 0.00 H ATOM 63 HH22 ARG A 3 7.759 64.808 53.490 1.00 0.00 H ATOM 64 HH21 ARG A 3 9.519 64.689 53.853 1.00 0.00 H ATOM 65 H ARG A 3 11.087 57.565 55.092 1.00 0.00 H ATOM 66 N ALA A 4 13.668 60.215 57.077 1.00 10.78 N ATOM 67 CA ALA A 4 14.161 60.355 58.455 1.00 10.50 C ATOM 68 C ALA A 4 13.890 61.762 58.964 1.00 9.62 C ATOM 69 O ALA A 4 14.161 62.759 58.265 1.00 11.23 O ATOM 70 CB ALA A 4 15.644 60.090 58.507 1.00 11.68 C ATOM 71 HA ALA A 4 13.641 59.632 59.083 1.00 0.00 H ATOM 72 HB1 ALA A 4 15.843 59.077 58.157 1.00 0.00 H ATOM 73 HB2 ALA A 4 16.162 60.805 57.868 1.00 0.00 H ATOM 74 HB3 ALA A 4 15.995 60.197 59.533 1.00 0.00 H ATOM 75 H ALA A 4 14.072 60.830 56.342 1.00 0.00 H ATOM 76 N VAL A 5 13.325 61.837 60.163 1.00 9.73 N ATOM 77 CA VAL A 5 13.031 63.116 60.792 1.00 9.95 C ATOM 78 C VAL A 5 13.681 63.190 62.172 1.00 9.18 C ATOM 79 O VAL A 5 14.046 62.172 62.766 1.00 11.27 O ATOM 80 CB VAL A 5 11.499 63.365 60.904 1.00 10.87 C ATOM 81 CG1 VAL A 5 10.851 63.480 59.491 1.00 13.42 C ATOM 82 CG2 VAL A 5 10.782 62.247 61.715 1.00 12.21 C ATOM 83 HA VAL A 5 13.448 63.899 60.158 1.00 0.00 H ATOM 84 HB VAL A 5 11.373 64.306 61.439 1.00 0.00 H ATOM 85 HG11 VAL A 5 11.304 64.312 58.952 1.00 0.00 H ATOM 86 HG12 VAL A 5 11.017 62.554 58.940 1.00 0.00 H ATOM 87 HG13 VAL A 5 9.780 63.654 59.597 1.00 0.00 H ATOM 88 HG21 VAL A 5 10.935 61.287 61.222 1.00 0.00 H ATOM 89 HG22 VAL A 5 11.195 62.209 62.723 1.00 0.00 H ATOM 90 HG23 VAL A 5 9.715 62.464 61.766 1.00 0.00 H ATOM 91 H VAL A 5 13.086 60.959 60.666 1.00 0.00 H ATOM 92 N ILE A 6 13.787 64.402 62.691 1.00 9.75 N ATOM 93 CA ILE A 6 14.278 64.617 64.054 1.00 9.51 C ATOM 94 C ILE A 6 13.098 64.923 64.957 1.00 10.38 C ATOM 95 O ILE A 6 12.347 65.876 64.708 1.00 10.27 O ATOM 96 CB ILE A 6 15.259 65.790 64.101 1.00 11.28 C ATOM 97 CG1 ILE A 6 16.425 65.528 63.171 1.00 13.31 C ATOM 98 CG2 ILE A 6 15.711 66.060 65.553 1.00 10.61 C ATOM 99 CD1 ILE A 6 17.153 64.337 63.501 1.00 15.27 C ATOM 100 HA ILE A 6 14.795 63.717 64.388 1.00 0.00 H ATOM 101 HB ILE A 6 14.761 66.694 63.752 1.00 0.00 H ATOM 102 HG12 ILE A 6 16.043 65.431 62.155 1.00 0.00 H ATOM 103 HG13 ILE A 6 17.107 66.377 63.222 1.00 0.00 H ATOM 104 HD11 ILE A 6 17.550 64.424 64.512 1.00 0.00 H ATOM 105 HD12 ILE A 6 16.485 63.477 63.444 1.00 0.00 H ATOM 106 HD13 ILE A 6 17.975 64.208 62.796 1.00 0.00 H ATOM 107 HG21 ILE A 6 14.841 66.301 66.164 1.00 0.00 H ATOM 108 HG22 ILE A 6 16.201 65.172 65.951 1.00 0.00 H ATOM 109 HG23 ILE A 6 16.408 66.898 65.565 1.00 0.00 H ATOM 110 H ILE A 6 13.514 65.224 62.116 1.00 0.00 H ATOM 111 N THR A 7 12.939 64.091 66.006 1.00 10.27 N ATOM 112 CA THR A 7 11.791 64.177 66.898 1.00 10.68 C ATOM 113 C THR A 7 12.148 64.571 68.315 1.00 10.33 C ATOM 114 O THR A 7 11.266 64.666 69.171 1.00 13.04 O ATOM 115 CB THR A 7 11.012 62.868 66.930 1.00 12.00 C ATOM 116 OG1 THR A 7 11.911 61.827 67.290 1.00 12.34 O ATOM 117 CG2 THR A 7 10.397 62.567 65.565 1.00 13.81 C ATOM 118 HA THR A 7 11.172 64.971 66.482 1.00 0.00 H ATOM 119 HB THR A 7 10.201 62.945 67.654 1.00 0.00 H ATOM 120 HG1 THR A 7 11.423 60.966 67.317 1.00 0.00 H ATOM 121 HG23 THR A 7 9.709 63.368 65.293 1.00 0.00 H ATOM 122 HG21 THR A 7 11.188 62.498 64.819 1.00 0.00 H ATOM 123 HG22 THR A 7 9.856 61.622 65.612 1.00 0.00 H ATOM 124 H THR A 7 13.660 63.363 66.184 1.00 0.00 H ATOM 125 N GLY A 8 13.431 64.803 68.592 1.00 10.07 N ATOM 126 CA GLY A 8 13.820 65.226 69.922 1.00 10.16 C ATOM 127 C GLY A 8 15.242 65.677 69.891 1.00 9.50 C ATOM 128 O GLY A 8 16.023 65.194 69.064 1.00 10.33 O ATOM 129 HA3 GLY A 8 13.716 64.392 70.616 1.00 0.00 H ATOM 130 HA2 GLY A 8 13.182 66.049 70.246 1.00 0.00 H ATOM 131 H GLY A 8 14.153 64.680 67.853 1.00 0.00 H ATOM 132 N LEU A 9 15.586 66.558 70.820 1.00 10.02 N ATOM 133 CA LEU A 9 16.961 67.008 70.913 1.00 11.13 C ATOM 134 C LEU A 9 17.354 67.297 72.346 1.00 9.91 C ATOM 135 O LEU A 9 16.492 67.501 73.206 1.00 10.29 O ATOM 136 CB LEU A 9 17.267 68.125 69.938 1.00 14.81 C ATOM 137 CG LEU A 9 16.425 69.357 70.162 1.00 13.85 C ATOM 138 CD1 LEU A 9 17.019 70.268 71.267 1.00 17.11 C ATOM 139 CD2 LEU A 9 16.291 70.220 68.904 1.00 16.09 C ATOM 140 HA LEU A 9 17.606 66.188 70.597 1.00 0.00 H ATOM 141 HB2 LEU A 9 18.317 68.399 70.043 1.00 0.00 H ATOM 142 HB3 LEU A 9 17.087 67.761 68.926 1.00 0.00 H ATOM 143 HG LEU A 9 15.448 68.974 70.456 1.00 0.00 H ATOM 144 HD21 LEU A 9 17.280 70.546 68.581 1.00 0.00 H ATOM 145 HD22 LEU A 9 15.823 69.635 68.112 1.00 0.00 H ATOM 146 HD23 LEU A 9 15.675 71.091 69.127 1.00 0.00 H ATOM 147 HD11 LEU A 9 17.071 69.714 72.204 1.00 0.00 H ATOM 148 HD12 LEU A 9 18.020 70.586 70.975 1.00 0.00 H ATOM 149 HD13 LEU A 9 16.382 71.143 71.396 1.00 0.00 H ATOM 150 H LEU A 9 14.871 66.925 71.480 1.00 0.00 H ATOM 151 N GLY A 10 18.658 67.208 72.603 1.00 8.75 N ATOM 152 CA GLY A 10 19.195 67.473 73.923 1.00 9.91 C ATOM 153 C GLY A 10 20.611 67.974 73.773 1.00 8.68 C ATOM 154 O GLY A 10 21.314 67.582 72.841 1.00 9.28 O ATOM 155 HA3 GLY A 10 19.190 66.557 74.513 1.00 0.00 H ATOM 156 HA2 GLY A 10 18.588 68.229 74.422 1.00 0.00 H ATOM 157 H GLY A 10 19.308 66.941 71.836 1.00 0.00 H ATOM 158 N ILE A 11 21.023 68.843 74.685 1.00 8.80 N ATOM 159 CA ILE A 11 22.306 69.498 74.506 1.00 9.86 C ATOM 160 C ILE A 11 22.856 69.993 75.821 1.00 8.52 C ATOM 161 O ILE A 11 22.119 70.512 76.658 1.00 10.54 O ATOM 162 CB ILE A 11 22.142 70.647 73.486 1.00 8.73 C ATOM 163 CG1 ILE A 11 23.517 71.282 73.179 1.00 10.51 C ATOM 164 CG2 ILE A 11 21.072 71.646 73.967 1.00 11.43 C ATOM 165 CD1 ILE A 11 23.536 72.155 71.901 1.00 11.39 C ATOM 166 HA ILE A 11 23.029 68.780 74.119 1.00 0.00 H ATOM 167 HB ILE A 11 21.772 70.260 72.537 1.00 0.00 H ATOM 168 HG12 ILE A 11 23.803 71.906 74.025 1.00 0.00 H ATOM 169 HG13 ILE A 11 24.246 70.480 73.058 1.00 0.00 H ATOM 170 HD11 ILE A 11 23.264 71.543 71.041 1.00 0.00 H ATOM 171 HD12 ILE A 11 22.821 72.971 72.009 1.00 0.00 H ATOM 172 HD13 ILE A 11 24.536 72.563 71.756 1.00 0.00 H ATOM 173 HG21 ILE A 11 20.118 71.130 74.077 1.00 0.00 H ATOM 174 HG22 ILE A 11 21.373 72.064 74.928 1.00 0.00 H ATOM 175 HG23 ILE A 11 20.971 72.448 73.236 1.00 0.00 H ATOM 176 H ILE A 11 20.435 69.053 75.517 1.00 0.00 H ATOM 177 N VAL A 12 24.179 69.834 75.968 1.00 9.36 N ATOM 178 CA VAL A 12 24.894 70.451 77.078 1.00 9.97 C ATOM 179 C VAL A 12 26.088 71.152 76.412 1.00 9.89 C ATOM 180 O VAL A 12 26.984 70.497 75.875 1.00 9.70 O ATOM 181 CB VAL A 12 25.381 69.385 78.079 1.00 12.09 C ATOM 182 CG1 VAL A 12 26.210 70.017 79.132 1.00 15.66 C ATOM 183 CG2 VAL A 12 24.156 68.662 78.697 1.00 14.65 C ATOM 184 HA VAL A 12 24.266 71.137 77.646 1.00 0.00 H ATOM 185 HB VAL A 12 25.997 68.650 77.561 1.00 0.00 H ATOM 186 HG11 VAL A 12 27.073 70.499 78.673 1.00 0.00 H ATOM 187 HG12 VAL A 12 25.616 70.762 79.662 1.00 0.00 H ATOM 188 HG13 VAL A 12 26.548 69.254 79.833 1.00 0.00 H ATOM 189 HG21 VAL A 12 23.529 69.389 79.214 1.00 0.00 H ATOM 190 HG22 VAL A 12 23.581 68.183 77.905 1.00 0.00 H ATOM 191 HG23 VAL A 12 24.500 67.908 79.405 1.00 0.00 H ATOM 192 H VAL A 12 24.704 69.260 75.278 1.00 0.00 H ATOM 193 N SER A 13 26.064 72.482 76.409 1.00 11.01 N ATOM 194 CA SER A 13 27.010 73.239 75.621 1.00 10.35 C ATOM 195 C SER A 13 27.596 74.379 76.407 1.00 10.50 C ATOM 196 O SER A 13 27.056 74.787 77.427 1.00 10.19 O ATOM 197 CB SER A 13 26.139 73.873 74.501 1.00 11.37 C ATOM 198 OG SER A 13 26.739 74.911 73.731 1.00 10.37 O ATOM 199 HA SER A 13 27.826 72.604 75.278 1.00 0.00 H ATOM 200 HB2 SER A 13 25.246 74.285 74.971 1.00 0.00 H ATOM 201 HB3 SER A 13 25.853 73.076 73.815 1.00 0.00 H ATOM 202 HG SER A 13 26.093 75.234 73.054 1.00 0.00 H ATOM 203 H SER A 13 25.355 72.984 76.981 1.00 0.00 H ATOM 204 N SER A 14 28.633 74.979 75.848 1.00 9.79 N ATOM 205 CA SER A 14 29.217 76.185 76.446 1.00 9.68 C ATOM 206 C SER A 14 28.212 77.339 76.520 1.00 10.20 C ATOM 207 O SER A 14 28.393 78.262 77.323 1.00 10.88 O ATOM 208 CB SER A 14 30.452 76.604 75.661 1.00 11.01 C ATOM 209 OG SER A 14 30.055 77.001 74.366 1.00 11.77 O ATOM 210 HA SER A 14 29.501 75.943 77.470 1.00 0.00 H ATOM 211 HB2 SER A 14 31.144 75.765 75.591 1.00 0.00 H ATOM 212 HB3 SER A 14 30.942 77.437 76.166 1.00 0.00 H ATOM 213 HG SER A 14 30.852 77.276 73.847 1.00 0.00 H ATOM 214 H SER A 14 29.040 74.591 74.973 1.00 0.00 H ATOM 215 N ILE A 15 27.177 77.301 75.677 1.00 9.28 N ATOM 216 CA ILE A 15 26.179 78.382 75.651 1.00 9.86 C ATOM 217 C ILE A 15 24.837 77.932 76.239 1.00 9.82 C ATOM 218 O ILE A 15 23.854 78.661 76.141 1.00 11.52 O ATOM 219 CB ILE A 15 26.023 79.015 74.224 1.00 10.04 C ATOM 220 CG1 ILE A 15 25.534 77.987 73.203 1.00 10.66 C ATOM 221 CG2 ILE A 15 27.328 79.680 73.796 1.00 11.75 C ATOM 222 CD1 ILE A 15 24.931 78.653 71.947 1.00 11.75 C ATOM 223 HA ILE A 15 26.556 79.175 76.296 1.00 0.00 H ATOM 224 HB ILE A 15 25.256 79.788 74.271 1.00 0.00 H ATOM 225 HG12 ILE A 15 26.376 77.364 72.901 1.00 0.00 H ATOM 226 HG13 ILE A 15 24.772 77.363 73.670 1.00 0.00 H ATOM 227 HD11 ILE A 15 24.082 79.272 72.238 1.00 0.00 H ATOM 228 HD12 ILE A 15 25.688 79.274 71.467 1.00 0.00 H ATOM 229 HD13 ILE A 15 24.598 77.882 71.252 1.00 0.00 H ATOM 230 HG21 ILE A 15 27.585 80.464 74.508 1.00 0.00 H ATOM 231 HG22 ILE A 15 28.123 78.935 73.771 1.00 0.00 H ATOM 232 HG23 ILE A 15 27.205 80.115 72.804 1.00 0.00 H ATOM 233 H ILE A 15 27.075 76.494 75.028 1.00 0.00 H ATOM 234 N GLY A 16 24.784 76.778 76.913 1.00 9.86 N ATOM 235 CA GLY A 16 23.575 76.473 77.648 1.00 9.67 C ATOM 236 C GLY A 16 23.474 74.989 77.958 1.00 9.96 C ATOM 237 O GLY A 16 23.970 74.129 77.208 1.00 11.08 O ATOM 238 HA3 GLY A 16 22.712 76.771 77.052 1.00 0.00 H ATOM 239 HA2 GLY A 16 23.578 77.032 78.584 1.00 0.00 H ATOM 240 H GLY A 16 25.588 76.119 76.909 1.00 0.00 H ATOM 241 N ASN A 17 22.805 74.689 79.075 1.00 10.66 N ATOM 242 CA ASN A 17 22.694 73.328 79.582 1.00 10.43 C ATOM 243 C ASN A 17 21.434 72.624 79.143 1.00 10.23 C ATOM 244 O ASN A 17 21.192 71.511 79.561 1.00 11.76 O ATOM 245 CB ASN A 17 22.760 73.394 81.114 1.00 12.15 C ATOM 246 CG ASN A 17 24.103 73.877 81.596 1.00 12.29 C ATOM 247 OD1 ASN A 17 25.143 73.512 81.027 1.00 13.60 O ATOM 248 ND2 ASN A 17 24.102 74.667 82.658 1.00 13.43 N ATOM 249 HA ASN A 17 23.516 72.742 79.170 1.00 0.00 H ATOM 250 HB2 ASN A 17 21.990 74.077 81.471 1.00 0.00 H ATOM 251 HB3 ASN A 17 22.577 72.399 81.519 1.00 0.00 H ATOM 252 HD22 ASN A 17 23.202 74.944 83.099 1.00 0.00 H ATOM 253 HD21 ASN A 17 25.001 75.010 83.052 1.00 0.00 H ATOM 254 H ASN A 17 22.345 75.458 79.603 1.00 0.00 H ATOM 255 N ASN A 18 20.641 73.266 78.285 1.00 10.65 N ATOM 256 CA ASN A 18 19.418 72.673 77.735 1.00 10.26 C ATOM 257 C ASN A 18 19.008 73.554 76.560 1.00 10.77 C ATOM 258 O ASN A 18 19.637 74.595 76.311 1.00 10.35 O ATOM 259 CB ASN A 18 18.292 72.608 78.786 1.00 11.89 C ATOM 260 CG ASN A 18 18.033 73.958 79.423 1.00 11.44 C ATOM 261 OD1 ASN A 18 17.819 74.939 78.709 1.00 12.71 O ATOM 262 ND2 ASN A 18 18.059 74.028 80.749 1.00 14.96 N ATOM 263 HA ASN A 18 19.599 71.645 77.422 1.00 0.00 H ATOM 264 HB2 ASN A 18 17.377 72.265 78.302 1.00 0.00 H ATOM 265 HB3 ASN A 18 18.577 71.900 79.564 1.00 0.00 H ATOM 266 HD22 ASN A 18 18.244 73.173 81.311 1.00 0.00 H ATOM 267 HD21 ASN A 18 17.895 74.938 81.225 1.00 0.00 H ATOM 268 H ASN A 18 20.901 74.230 77.993 1.00 0.00 H ATOM 269 N GLN A 19 17.976 73.156 75.833 1.00 10.67 N ATOM 270 CA GLN A 19 17.670 73.905 74.603 1.00 11.33 C ATOM 271 C GLN A 19 17.097 75.279 74.895 1.00 11.17 C ATOM 272 O GLN A 19 17.188 76.146 74.031 1.00 12.29 O ATOM 273 CB GLN A 19 16.746 73.130 73.674 1.00 11.65 C ATOM 274 CG GLN A 19 15.339 72.857 74.208 1.00 11.81 C ATOM 275 CD GLN A 19 14.389 72.550 73.073 1.00 13.51 C ATOM 276 OE1 GLN A 19 14.089 73.429 72.267 1.00 14.43 O ATOM 277 NE2 GLN A 19 13.976 71.271 72.954 1.00 13.11 N ATOM 278 HA GLN A 19 18.622 74.042 74.091 1.00 0.00 H ATOM 279 HB2 GLN A 19 16.648 73.698 72.749 1.00 0.00 H ATOM 280 HB3 GLN A 19 17.215 72.169 73.461 1.00 0.00 H ATOM 281 HG2 GLN A 19 15.373 72.006 74.888 1.00 0.00 H ATOM 282 HG3 GLN A 19 14.983 73.736 74.746 1.00 0.00 H ATOM 283 HE22 GLN A 19 14.258 70.565 73.664 1.00 0.00 H ATOM 284 HE21 GLN A 19 13.376 70.991 72.152 1.00 0.00 H ATOM 285 H GLN A 19 17.399 72.340 76.122 1.00 0.00 H ATOM 286 N GLN A 20 16.504 75.514 76.084 1.00 11.50 N ATOM 287 CA GLN A 20 15.999 76.851 76.401 1.00 12.16 C ATOM 288 C GLN A 20 17.161 77.826 76.571 1.00 11.73 C ATOM 289 O GLN A 20 17.158 78.921 75.996 1.00 12.94 O ATOM 290 CB GLN A 20 15.186 76.790 77.683 1.00 14.73 C ATOM 291 CG GLN A 20 13.841 76.101 77.532 1.00 18.28 C ATOM 292 CD GLN A 20 13.884 74.577 77.465 1.00 22.78 C ATOM 293 OE1 GLN A 20 13.061 73.961 76.763 1.00 27.50 O ATOM 294 NE2 GLN A 20 14.803 73.961 78.193 1.00 22.35 N ATOM 295 HA GLN A 20 15.367 77.199 75.584 1.00 0.00 H ATOM 296 HB2 GLN A 20 15.766 76.249 78.431 1.00 0.00 H ATOM 297 HB3 GLN A 20 15.012 77.809 78.027 1.00 0.00 H ATOM 298 HG2 GLN A 20 13.222 76.382 78.384 1.00 0.00 H ATOM 299 HG3 GLN A 20 13.379 76.464 76.614 1.00 0.00 H ATOM 300 HE22 GLN A 20 15.471 74.516 78.765 1.00 0.00 H ATOM 301 HE21 GLN A 20 14.857 72.922 78.192 1.00 0.00 H ATOM 302 H GLN A 20 16.406 74.744 76.776 1.00 0.00 H ATOM 303 N GLU A 21 18.187 77.418 77.320 1.00 10.79 N ATOM 304 CA GLU A 21 19.340 78.278 77.515 1.00 11.50 C ATOM 305 C GLU A 21 20.086 78.479 76.195 1.00 11.09 C ATOM 306 O GLU A 21 20.549 79.579 75.910 1.00 11.96 O ATOM 307 CB GLU A 21 20.292 77.683 78.546 1.00 12.58 C ATOM 308 CG GLU A 21 19.709 77.706 79.967 1.00 13.42 C ATOM 309 CD GLU A 21 20.668 77.185 81.023 1.00 13.58 C ATOM 310 OE1 GLU A 21 21.826 76.771 80.704 1.00 14.29 O ATOM 311 OE2 GLU A 21 20.238 77.206 82.206 1.00 15.92 O ATOM 312 HA GLU A 21 18.980 79.241 77.878 1.00 0.00 H ATOM 313 HB2 GLU A 21 20.504 76.650 78.271 1.00 0.00 H ATOM 314 HB3 GLU A 21 21.219 78.257 78.539 1.00 0.00 H ATOM 315 HG2 GLU A 21 19.446 78.734 80.216 1.00 0.00 H ATOM 316 HG3 GLU A 21 18.811 77.089 79.982 1.00 0.00 H ATOM 317 H GLU A 21 18.161 76.479 77.766 1.00 0.00 H ATOM 318 N VAL A 22 20.236 77.417 75.410 1.00 9.58 N ATOM 319 CA VAL A 22 20.930 77.547 74.139 1.00 9.64 C ATOM 320 C VAL A 22 20.182 78.515 73.221 1.00 10.69 C ATOM 321 O VAL A 22 20.792 79.412 72.611 1.00 10.89 O ATOM 322 CB VAL A 22 21.117 76.178 73.485 1.00 10.43 C ATOM 323 CG1 VAL A 22 21.517 76.334 72.005 1.00 11.13 C ATOM 324 CG2 VAL A 22 22.194 75.367 74.241 1.00 10.55 C ATOM 325 HA VAL A 22 21.922 77.961 74.320 1.00 0.00 H ATOM 326 HB VAL A 22 20.169 75.642 73.534 1.00 0.00 H ATOM 327 HG11 VAL A 22 20.735 76.876 71.474 1.00 0.00 H ATOM 328 HG12 VAL A 22 22.453 76.888 71.939 1.00 0.00 H ATOM 329 HG13 VAL A 22 21.645 75.348 71.559 1.00 0.00 H ATOM 330 HG21 VAL A 22 23.140 75.908 74.214 1.00 0.00 H ATOM 331 HG22 VAL A 22 21.883 75.229 75.276 1.00 0.00 H ATOM 332 HG23 VAL A 22 22.316 74.395 73.764 1.00 0.00 H ATOM 333 H VAL A 22 19.857 76.494 75.705 1.00 0.00 H ATOM 334 N LEU A 23 18.861 78.375 73.142 1.00 10.84 N ATOM 335 CA LEU A 23 18.078 79.304 72.309 1.00 11.74 C ATOM 336 C LEU A 23 18.289 80.759 72.738 1.00 11.37 C ATOM 337 O LEU A 23 18.481 81.650 71.884 1.00 12.55 O ATOM 338 CB LEU A 23 16.598 78.911 72.366 1.00 12.45 C ATOM 339 CG LEU A 23 15.606 79.881 71.689 1.00 12.70 C ATOM 340 CD1 LEU A 23 15.844 79.960 70.180 1.00 13.60 C ATOM 341 CD2 LEU A 23 14.177 79.396 71.952 1.00 14.37 C ATOM 342 HA LEU A 23 18.424 79.231 71.278 1.00 0.00 H ATOM 343 HB2 LEU A 23 16.493 77.939 71.884 1.00 0.00 H ATOM 344 HB3 LEU A 23 16.317 78.827 73.416 1.00 0.00 H ATOM 345 HG LEU A 23 15.756 80.876 72.108 1.00 0.00 H ATOM 346 HD21 LEU A 23 14.053 78.395 71.539 1.00 0.00 H ATOM 347 HD22 LEU A 23 13.994 79.373 73.026 1.00 0.00 H ATOM 348 HD23 LEU A 23 13.470 80.076 71.477 1.00 0.00 H ATOM 349 HD11 LEU A 23 16.858 80.314 69.991 1.00 0.00 H ATOM 350 HD12 LEU A 23 15.715 78.971 69.741 1.00 0.00 H ATOM 351 HD13 LEU A 23 15.128 80.652 69.736 1.00 0.00 H ATOM 352 H LEU A 23 18.384 77.614 73.666 1.00 0.00 H ATOM 353 N ALA A 24 18.231 81.023 74.044 1.00 11.44 N ATOM 354 CA ALA A 24 18.446 82.382 74.502 1.00 11.62 C ATOM 355 C ALA A 24 19.839 82.886 74.155 1.00 12.27 C ATOM 356 O ALA A 24 20.002 84.035 73.699 1.00 13.34 O ATOM 357 CB ALA A 24 18.227 82.463 76.022 1.00 13.72 C ATOM 358 HA ALA A 24 17.726 83.020 73.990 1.00 0.00 H ATOM 359 HB1 ALA A 24 17.207 82.161 76.257 1.00 0.00 H ATOM 360 HB2 ALA A 24 18.929 81.798 76.525 1.00 0.00 H ATOM 361 HB3 ALA A 24 18.391 83.487 76.357 1.00 0.00 H ATOM 362 H ALA A 24 18.034 80.263 74.726 1.00 0.00 H ATOM 363 N SER A 25 20.864 82.044 74.317 1.00 10.72 N ATOM 364 CA SER A 25 22.220 82.478 73.956 1.00 11.73 C ATOM 365 C SER A 25 22.324 82.794 72.484 1.00 11.17 C ATOM 366 O SER A 25 22.958 83.782 72.098 1.00 11.53 O ATOM 367 CB SER A 25 23.239 81.406 74.294 1.00 11.82 C ATOM 368 OG SER A 25 23.382 81.324 75.712 1.00 12.65 O ATOM 369 HA SER A 25 22.428 83.379 74.532 1.00 0.00 H ATOM 370 HB2 SER A 25 24.199 81.661 73.845 1.00 0.00 H ATOM 371 HB3 SER A 25 22.901 80.446 73.905 1.00 0.00 H ATOM 372 HG SER A 25 24.047 80.625 75.936 1.00 0.00 H ATOM 373 H SER A 25 20.703 81.089 74.696 1.00 0.00 H ATOM 374 N LEU A 26 21.748 81.928 71.648 1.00 11.63 N ATOM 375 CA LEU A 26 21.838 82.141 70.194 1.00 11.15 C ATOM 376 C LEU A 26 21.158 83.463 69.825 1.00 11.83 C ATOM 377 O LEU A 26 21.686 84.223 68.997 1.00 14.42 O ATOM 378 CB LEU A 26 21.176 80.988 69.447 1.00 11.70 C ATOM 379 CG LEU A 26 21.897 79.649 69.478 1.00 10.31 C ATOM 380 CD1 LEU A 26 20.978 78.582 68.848 1.00 11.16 C ATOM 381 CD2 LEU A 26 23.225 79.717 68.759 1.00 11.66 C ATOM 382 HA LEU A 26 22.889 82.183 69.907 1.00 0.00 H ATOM 383 HB2 LEU A 26 20.186 80.840 69.878 1.00 0.00 H ATOM 384 HB3 LEU A 26 21.076 81.285 68.403 1.00 0.00 H ATOM 385 HG LEU A 26 22.116 79.382 70.512 1.00 0.00 H ATOM 386 HD21 LEU A 26 23.059 79.996 67.718 1.00 0.00 H ATOM 387 HD22 LEU A 26 23.859 80.462 69.240 1.00 0.00 H ATOM 388 HD23 LEU A 26 23.711 78.742 68.802 1.00 0.00 H ATOM 389 HD11 LEU A 26 20.052 78.519 69.419 1.00 0.00 H ATOM 390 HD12 LEU A 26 20.753 78.860 67.818 1.00 0.00 H ATOM 391 HD13 LEU A 26 21.482 77.616 68.863 1.00 0.00 H ATOM 392 H LEU A 26 21.236 81.104 72.023 1.00 0.00 H ATOM 393 N ARG A 27 19.994 83.738 70.406 1.00 11.72 N ATOM 394 CA ARG A 27 19.277 85.000 70.091 1.00 12.60 C ATOM 395 C ARG A 27 20.055 86.207 70.592 1.00 13.47 C ATOM 396 O ARG A 27 20.008 87.269 69.965 1.00 15.17 O ATOM 397 CB ARG A 27 17.895 85.002 70.723 1.00 14.46 C ATOM 398 CG ARG A 27 16.918 84.126 69.965 1.00 15.76 C ATOM 399 CD ARG A 27 15.552 84.142 70.611 1.00 19.28 C ATOM 400 NE ARG A 27 14.477 83.762 69.691 1.00 22.39 N ATOM 401 CZ ARG A 27 13.359 83.142 70.062 1.00 23.67 C ATOM 402 NH1 ARG A 27 13.185 82.757 71.320 1.00 27.17 N ATOM 403 NH2 ARG A 27 12.416 82.880 69.173 1.00 24.51 N ATOM 404 HA ARG A 27 19.181 85.062 69.007 1.00 0.00 H ATOM 405 HB2 ARG A 27 17.976 84.634 71.746 1.00 0.00 H ATOM 406 HB3 ARG A 27 17.515 86.024 70.734 1.00 0.00 H ATOM 407 HG2 ARG A 27 16.832 84.492 68.942 1.00 0.00 H ATOM 408 HG3 ARG A 27 17.294 83.103 69.953 1.00 0.00 H ATOM 409 HD2 ARG A 27 15.354 85.148 70.980 1.00 0.00 H ATOM 410 HD3 ARG A 27 15.556 83.444 71.448 1.00 0.00 H ATOM 411 HE ARG A 27 14.595 83.991 68.683 1.00 0.00 H ATOM 412 HH12 ARG A 27 12.308 82.273 71.599 1.00 0.00 H ATOM 413 HH11 ARG A 27 13.926 82.939 72.027 1.00 0.00 H ATOM 414 HH22 ARG A 27 11.544 82.395 69.467 1.00 0.00 H ATOM 415 HH21 ARG A 27 12.546 83.159 68.179 1.00 0.00 H ATOM 416 H ARG A 27 19.583 83.066 71.085 1.00 0.00 H ATOM 417 N GLU A 28 20.779 86.060 71.701 1.00 13.60 N ATOM 418 CA GLU A 28 21.455 87.192 72.314 1.00 15.00 C ATOM 419 C GLU A 28 22.871 87.384 71.774 1.00 15.24 C ATOM 420 O GLU A 28 23.538 88.393 72.075 1.00 17.56 O ATOM 421 CB GLU A 28 21.428 86.981 73.831 1.00 18.54 C ATOM 422 CG GLU A 28 20.053 87.442 74.335 1.00 26.19 C ATOM 423 CD GLU A 28 19.346 86.518 75.293 1.00 30.06 C ATOM 424 OE1 GLU A 28 19.860 86.303 76.433 1.00 31.56 O ATOM 425 OE2 GLU A 28 18.243 86.032 74.891 1.00 32.73 O ATOM 426 HA GLU A 28 20.935 88.116 72.062 1.00 0.00 H ATOM 427 HB2 GLU A 28 21.576 85.926 74.063 1.00 0.00 H ATOM 428 HB3 GLU A 28 22.215 87.569 74.303 1.00 0.00 H ATOM 429 HG2 GLU A 28 20.188 88.400 74.837 1.00 0.00 H ATOM 430 HG3 GLU A 28 19.409 87.575 73.466 1.00 0.00 H ATOM 431 H GLU A 28 20.862 85.119 72.136 1.00 0.00 H ATOM 432 N GLY A 29 23.350 86.416 70.989 1.00 13.46 N ATOM 433 CA GLY A 29 24.751 86.418 70.558 1.00 13.95 C ATOM 434 C GLY A 29 25.733 86.329 71.720 1.00 13.89 C ATOM 435 O GLY A 29 26.815 86.943 71.695 1.00 16.47 O ATOM 436 HA3 GLY A 29 24.944 87.340 70.010 1.00 0.00 H ATOM 437 HA2 GLY A 29 24.913 85.564 69.900 1.00 0.00 H ATOM 438 H GLY A 29 22.720 85.649 70.679 1.00 0.00 H ATOM 439 N ARG A 30 25.367 85.532 72.723 1.00 13.58 N ATOM 440 CA ARG A 30 26.115 85.464 73.974 1.00 16.00 C ATOM 441 C ARG A 30 27.244 84.452 73.914 1.00 13.33 C ATOM 442 O ARG A 30 27.016 83.286 73.590 1.00 17.85 O ATOM 443 CB ARG A 30 25.163 85.117 75.125 1.00 18.65 C ATOM 444 CG ARG A 30 25.906 84.902 76.458 1.00 21.69 C ATOM 445 CD ARG A 30 25.082 84.731 77.734 1.00 25.06 C ATOM 446 NE ARG A 30 23.805 84.044 77.593 1.00 27.05 N ATOM 447 CZ ARG A 30 22.677 84.686 77.307 1.00 26.90 C ATOM 448 NH1 ARG A 30 22.709 86.006 77.121 1.00 29.84 N ATOM 449 NH2 ARG A 30 21.532 84.030 77.185 1.00 27.17 N ATOM 450 HA ARG A 30 26.565 86.442 74.143 1.00 0.00 H ATOM 451 HB2 ARG A 30 24.451 85.933 75.249 1.00 0.00 H ATOM 452 HB3 ARG A 30 24.626 84.203 74.872 1.00 0.00 H ATOM 453 HG2 ARG A 30 26.515 84.005 76.346 1.00 0.00 H ATOM 454 HG3 ARG A 30 26.555 85.765 76.607 1.00 0.00 H ATOM 455 HD2 ARG A 30 24.882 85.724 78.136 1.00 0.00 H ATOM 456 HD3 ARG A 30 25.685 84.167 78.446 1.00 0.00 H ATOM 457 HE ARG A 30 23.775 83.012 77.721 1.00 0.00 H ATOM 458 HH12 ARG A 30 21.834 86.521 76.897 1.00 0.00 H ATOM 459 HH11 ARG A 30 23.609 86.521 77.200 1.00 0.00 H ATOM 460 HH22 ARG A 30 20.658 84.547 76.961 1.00 0.00 H ATOM 461 HH21 ARG A 30 21.508 82.998 77.313 1.00 0.00 H ATOM 462 H ARG A 30 24.520 84.939 72.611 1.00 0.00 H ATOM 463 N SER A 31 28.460 84.920 74.172 1.00 13.15 N ATOM 464 CA SER A 31 29.634 84.050 74.171 1.00 12.83 C ATOM 465 C SER A 31 29.575 83.027 75.305 1.00 13.40 C ATOM 466 O SER A 31 29.207 83.357 76.446 1.00 14.81 O ATOM 467 CB SER A 31 30.911 84.890 74.362 1.00 14.34 C ATOM 468 OG SER A 31 32.037 84.033 74.442 1.00 12.93 O ATOM 469 HA SER A 31 29.648 83.529 73.214 1.00 0.00 H ATOM 470 HB2 SER A 31 30.830 85.470 75.282 1.00 0.00 H ATOM 471 HB3 SER A 31 31.030 85.567 73.516 1.00 0.00 H ATOM 472 HG SER A 31 32.110 83.508 73.606 1.00 0.00 H ATOM 473 H SER A 31 28.580 85.932 74.380 1.00 0.00 H ATOM 474 N GLY A 32 30.017 81.809 75.012 1.00 11.93 N ATOM 475 CA GLY A 32 30.244 80.796 76.060 1.00 12.08 C ATOM 476 C GLY A 32 31.699 80.622 76.463 1.00 10.61 C ATOM 477 O GLY A 32 32.030 79.661 77.161 1.00 11.94 O ATOM 478 HA3 GLY A 32 29.875 79.838 75.694 1.00 0.00 H ATOM 479 HA2 GLY A 32 29.678 81.088 76.945 1.00 0.00 H ATOM 480 H GLY A 32 30.208 81.564 74.020 1.00 0.00 H ATOM 481 N ILE A 33 32.570 81.532 76.029 1.00 10.86 N ATOM 482 CA ILE A 33 33.994 81.359 76.238 1.00 10.81 C ATOM 483 C ILE A 33 34.455 82.082 77.487 1.00 11.82 C ATOM 484 O ILE A 33 34.098 83.238 77.710 1.00 13.58 O ATOM 485 CB ILE A 33 34.793 81.853 75.005 1.00 11.77 C ATOM 486 CG1 ILE A 33 34.256 81.197 73.713 1.00 12.63 C ATOM 487 CG2 ILE A 33 36.313 81.687 75.223 1.00 11.70 C ATOM 488 CD1 ILE A 33 34.192 79.705 73.816 1.00 13.74 C ATOM 489 HA ILE A 33 34.183 80.294 76.372 1.00 0.00 H ATOM 490 HB ILE A 33 34.640 82.925 74.878 1.00 0.00 H ATOM 491 HG12 ILE A 33 33.254 81.578 73.517 1.00 0.00 H ATOM 492 HG13 ILE A 33 34.913 81.463 72.885 1.00 0.00 H ATOM 493 HD11 ILE A 33 35.191 79.312 74.004 1.00 0.00 H ATOM 494 HD12 ILE A 33 33.530 79.427 74.636 1.00 0.00 H ATOM 495 HD13 ILE A 33 33.808 79.294 72.882 1.00 0.00 H ATOM 496 HG21 ILE A 33 36.620 82.268 76.093 1.00 0.00 H ATOM 497 HG22 ILE A 33 36.542 80.634 75.388 1.00 0.00 H ATOM 498 HG23 ILE A 33 36.846 82.042 74.341 1.00 0.00 H ATOM 499 H ILE A 33 32.223 82.378 75.533 1.00 0.00 H ATOM 500 N THR A 34 35.257 81.387 78.287 1.00 11.56 N ATOM 501 CA THR A 34 35.802 81.938 79.520 1.00 12.10 C ATOM 502 C THR A 34 37.309 81.683 79.635 1.00 10.76 C ATOM 503 O THR A 34 37.865 80.819 78.947 1.00 11.28 O ATOM 504 CB THR A 34 35.107 81.293 80.742 1.00 13.20 C ATOM 505 OG1 THR A 34 35.337 79.879 80.730 1.00 14.90 O ATOM 506 CG2 THR A 34 33.588 81.607 80.751 1.00 14.66 C ATOM 507 HA THR A 34 35.624 83.013 79.499 1.00 0.00 H ATOM 508 HB THR A 34 35.531 81.715 81.653 1.00 0.00 H ATOM 509 HG1 THR A 34 34.967 79.493 79.897 1.00 0.00 H ATOM 510 HG23 THR A 34 33.442 82.687 80.760 1.00 0.00 H ATOM 511 HG21 THR A 34 33.126 81.184 79.859 1.00 0.00 H ATOM 512 HG22 THR A 34 33.133 81.170 81.640 1.00 0.00 H ATOM 513 H THR A 34 35.505 80.412 78.022 1.00 0.00 H ATOM 514 N PHE A 35 37.949 82.423 80.531 1.00 11.93 N ATOM 515 CA PHE A 35 39.350 82.173 80.856 1.00 11.84 C ATOM 516 C PHE A 35 39.447 80.865 81.625 1.00 12.53 C ATOM 517 O PHE A 35 38.619 80.592 82.517 1.00 13.84 O ATOM 518 CB PHE A 35 39.869 83.317 81.746 1.00 14.25 C ATOM 519 CG PHE A 35 41.215 83.055 82.350 1.00 14.59 C ATOM 520 CD1 PHE A 35 42.379 83.213 81.603 1.00 17.24 C ATOM 521 CD2 PHE A 35 41.320 82.596 83.668 1.00 16.45 C ATOM 522 CE1 PHE A 35 43.630 82.964 82.185 1.00 17.83 C ATOM 523 CE2 PHE A 35 42.557 82.322 84.225 1.00 17.37 C ATOM 524 CZ PHE A 35 43.696 82.491 83.473 1.00 17.47 C ATOM 525 HA PHE A 35 39.942 82.116 79.943 1.00 0.00 H ATOM 526 HB2 PHE A 35 39.935 84.221 81.140 1.00 0.00 H ATOM 527 HB3 PHE A 35 39.155 83.474 82.554 1.00 0.00 H ATOM 528 HD2 PHE A 35 40.418 82.453 84.262 1.00 0.00 H ATOM 529 HE2 PHE A 35 42.628 81.974 85.255 1.00 0.00 H ATOM 530 HZ PHE A 35 44.666 82.246 83.906 1.00 0.00 H ATOM 531 HE1 PHE A 35 44.544 83.145 81.619 1.00 0.00 H ATOM 532 HD1 PHE A 35 42.318 83.531 80.562 1.00 0.00 H ATOM 533 H PHE A 35 37.443 83.195 81.010 1.00 0.00 H ATOM 534 N SER A 36 40.493 80.095 81.351 1.00 12.35 N ATOM 535 CA SER A 36 40.716 78.798 82.029 1.00 12.95 C ATOM 536 C SER A 36 42.033 78.798 82.783 1.00 12.94 C ATOM 537 O SER A 36 43.112 78.781 82.169 1.00 12.76 O ATOM 538 CB SER A 36 40.779 77.674 81.007 1.00 13.03 C ATOM 539 OG SER A 36 41.174 76.476 81.679 1.00 13.03 O ATOM 540 HA SER A 36 39.887 78.648 82.721 1.00 0.00 H ATOM 541 HB2 SER A 36 41.506 77.920 80.233 1.00 0.00 H ATOM 542 HB3 SER A 36 39.799 77.535 80.551 1.00 0.00 H ATOM 543 HG SER A 36 42.064 76.609 82.093 1.00 0.00 H ATOM 544 H SER A 36 41.178 80.413 80.637 1.00 0.00 H ATOM 545 N GLN A 37 41.967 78.799 84.120 1.00 13.98 N ATOM 546 CA GLN A 37 43.180 78.660 84.892 1.00 13.48 C ATOM 547 C GLN A 37 43.817 77.290 84.654 1.00 12.62 C ATOM 548 O GLN A 37 45.044 77.159 84.713 1.00 14.27 O ATOM 549 CB GLN A 37 42.924 78.886 86.403 1.00 16.09 C ATOM 550 CG GLN A 37 44.221 78.976 87.227 1.00 18.09 C ATOM 551 CD GLN A 37 44.982 80.253 86.932 1.00 20.33 C ATOM 552 OE1 GLN A 37 44.393 81.334 86.852 1.00 22.79 O ATOM 553 NE2 GLN A 37 46.293 80.138 86.757 1.00 21.21 N ATOM 554 HA GLN A 37 43.874 79.431 84.556 1.00 0.00 H ATOM 555 HB2 GLN A 37 42.369 79.816 86.526 1.00 0.00 H ATOM 556 HB3 GLN A 37 42.328 78.056 86.782 1.00 0.00 H ATOM 557 HG2 GLN A 37 43.969 78.951 88.287 1.00 0.00 H ATOM 558 HG3 GLN A 37 44.854 78.123 86.985 1.00 0.00 H ATOM 559 HE22 GLN A 37 46.748 79.206 86.834 1.00 0.00 H ATOM 560 HE21 GLN A 37 46.865 80.980 86.543 1.00 0.00 H ATOM 561 H GLN A 37 41.049 78.899 84.599 1.00 0.00 H ATOM 562 N GLU A 38 43.007 76.263 84.392 1.00 13.36 N ATOM 563 CA GLU A 38 43.591 74.950 84.116 1.00 12.96 C ATOM 564 C GLU A 38 44.487 74.982 82.888 1.00 11.57 C ATOM 565 O GLU A 38 45.606 74.462 82.908 1.00 12.45 O ATOM 566 CB GLU A 38 42.483 73.929 83.909 1.00 13.02 C ATOM 567 CG GLU A 38 42.963 72.547 83.390 1.00 13.10 C ATOM 568 CD GLU A 38 41.864 71.525 83.180 1.00 13.09 C ATOM 569 OE1 GLU A 38 40.815 71.578 83.852 1.00 14.99 O ATOM 570 OE2 GLU A 38 42.074 70.643 82.347 1.00 12.76 O ATOM 571 HA GLU A 38 44.202 74.669 84.974 1.00 0.00 H ATOM 572 HB2 GLU A 38 41.978 73.777 84.863 1.00 0.00 H ATOM 573 HB3 GLU A 38 41.776 74.337 83.186 1.00 0.00 H ATOM 574 HG2 GLU A 38 43.469 72.701 82.437 1.00 0.00 H ATOM 575 HG3 GLU A 38 43.669 72.140 84.114 1.00 0.00 H ATOM 576 H GLU A 38 41.975 76.394 84.384 1.00 0.00 H ATOM 577 N LEU A 39 44.011 75.593 81.810 1.00 12.25 N ATOM 578 CA LEU A 39 44.847 75.627 80.614 1.00 11.82 C ATOM 579 C LEU A 39 46.109 76.431 80.893 1.00 11.70 C ATOM 580 O LEU A 39 47.195 76.016 80.518 1.00 12.45 O ATOM 581 CB LEU A 39 44.084 76.160 79.399 1.00 12.16 C ATOM 582 CG LEU A 39 42.839 75.360 78.991 1.00 10.80 C ATOM 583 CD1 LEU A 39 42.318 75.961 77.694 1.00 12.62 C ATOM 584 CD2 LEU A 39 43.166 73.893 78.814 1.00 13.40 C ATOM 585 HA LEU A 39 45.137 74.606 80.364 1.00 0.00 H ATOM 586 HB2 LEU A 39 43.769 77.179 79.622 1.00 0.00 H ATOM 587 HB3 LEU A 39 44.769 76.170 78.551 1.00 0.00 H ATOM 588 HG LEU A 39 42.080 75.419 79.771 1.00 0.00 H ATOM 589 HD21 LEU A 39 43.922 73.782 78.037 1.00 0.00 H ATOM 590 HD22 LEU A 39 43.547 73.491 79.753 1.00 0.00 H ATOM 591 HD23 LEU A 39 42.264 73.353 78.525 1.00 0.00 H ATOM 592 HD11 LEU A 39 42.063 77.008 77.857 1.00 0.00 H ATOM 593 HD12 LEU A 39 43.088 75.888 76.926 1.00 0.00 H ATOM 594 HD13 LEU A 39 41.430 75.416 77.373 1.00 0.00 H ATOM 595 H LEU A 39 43.070 76.035 81.817 1.00 0.00 H ATOM 596 N LYS A 40 45.976 77.578 81.553 1.00 12.47 N ATOM 597 CA LYS A 40 47.168 78.364 81.876 1.00 13.16 C ATOM 598 C LYS A 40 48.145 77.594 82.753 1.00 13.18 C ATOM 599 O LYS A 40 49.344 77.574 82.452 1.00 14.04 O ATOM 600 CB LYS A 40 46.780 79.692 82.540 1.00 13.72 C ATOM 601 CG LYS A 40 47.998 80.586 82.838 1.00 16.21 C ATOM 602 CD LYS A 40 47.599 81.976 83.327 1.00 17.25 C ATOM 603 CE LYS A 40 48.833 82.773 83.678 1.00 21.59 C ATOM 604 NZ LYS A 40 48.418 84.032 84.346 1.00 25.94 N ATOM 605 HA LYS A 40 47.676 78.576 80.935 1.00 0.00 H ATOM 606 HB2 LYS A 40 46.106 80.231 81.874 1.00 0.00 H ATOM 607 HB3 LYS A 40 46.267 79.477 83.478 1.00 0.00 H ATOM 608 HG2 LYS A 40 48.604 80.106 83.606 1.00 0.00 H ATOM 609 HG3 LYS A 40 48.586 80.692 81.926 1.00 0.00 H ATOM 610 HD2 LYS A 40 47.047 82.491 82.541 1.00 0.00 H ATOM 611 HD3 LYS A 40 46.967 81.881 84.210 1.00 0.00 H ATOM 612 HE2 LYS A 40 49.389 83.006 82.770 1.00 0.00 H ATOM 613 HE3 LYS A 40 49.465 82.193 84.350 1.00 0.00 H ATOM 614 HZ1 LYS A 40 47.815 84.582 83.702 1.00 0.00 H ATOM 615 HZ2 LYS A 40 47.887 83.805 85.211 1.00 0.00 H ATOM 616 HZ3 LYS A 40 49.262 84.587 84.591 1.00 0.00 H ATOM 617 H LYS A 40 45.034 77.914 81.837 1.00 0.00 H ATOM 618 N ASP A 41 47.634 76.919 83.788 1.00 13.00 N ATOM 619 CA ASP A 41 48.501 76.207 84.724 1.00 14.07 C ATOM 620 C ASP A 41 49.255 75.103 84.030 1.00 14.06 C ATOM 621 O ASP A 41 50.348 74.749 84.461 1.00 16.55 O ATOM 622 CB ASP A 41 47.700 75.587 85.852 1.00 16.20 C ATOM 623 CG ASP A 41 47.274 76.572 86.881 1.00 18.94 C ATOM 624 OD1 ASP A 41 47.771 77.716 86.867 1.00 20.76 O ATOM 625 OD2 ASP A 41 46.407 76.186 87.703 1.00 22.32 O ATOM 626 HA ASP A 41 49.199 76.942 85.125 1.00 0.00 H ATOM 627 HB2 ASP A 41 46.810 75.121 85.429 1.00 0.00 H ATOM 628 HB3 ASP A 41 48.313 74.826 86.334 1.00 0.00 H ATOM 629 H ASP A 41 46.604 76.901 83.929 1.00 0.00 H ATOM 630 N SER A 42 48.675 74.527 82.970 1.00 13.30 N ATOM 631 CA SER A 42 49.318 73.414 82.256 1.00 14.11 C ATOM 632 C SER A 42 50.507 73.855 81.415 1.00 13.77 C ATOM 633 O SER A 42 51.212 72.991 80.900 1.00 14.62 O ATOM 634 CB SER A 42 48.299 72.696 81.375 1.00 14.85 C ATOM 635 OG SER A 42 48.043 73.458 80.183 1.00 15.34 O ATOM 636 HA SER A 42 49.700 72.733 83.017 1.00 0.00 H ATOM 637 HB2 SER A 42 47.369 72.572 81.929 1.00 0.00 H ATOM 638 HB3 SER A 42 48.689 71.716 81.099 1.00 0.00 H ATOM 639 HG SER A 42 47.686 74.347 80.432 1.00 0.00 H ATOM 640 H SER A 42 47.750 74.874 82.645 1.00 0.00 H ATOM 641 N GLY A 43 50.715 75.171 81.216 1.00 13.18 N ATOM 642 CA GLY A 43 51.831 75.625 80.386 1.00 14.67 C ATOM 643 C GLY A 43 51.423 75.999 78.970 1.00 13.57 C ATOM 644 O GLY A 43 52.278 76.332 78.141 1.00 14.75 O ATOM 645 HA3 GLY A 43 52.569 74.825 80.332 1.00 0.00 H ATOM 646 HA2 GLY A 43 52.279 76.499 80.858 1.00 0.00 H ATOM 647 H GLY A 43 50.079 75.868 81.654 1.00 0.00 H ATOM 648 N MET A 44 50.122 75.963 78.687 1.00 12.05 N ATOM 649 CA MET A 44 49.630 76.291 77.350 1.00 11.48 C ATOM 650 C MET A 44 49.722 77.797 77.080 1.00 12.83 C ATOM 651 O MET A 44 49.815 78.620 78.024 1.00 14.01 O ATOM 652 CB MET A 44 48.195 75.834 77.240 1.00 12.25 C ATOM 653 CG MET A 44 48.103 74.313 77.001 1.00 12.80 C ATOM 654 SD MET A 44 46.389 73.746 77.018 1.00 13.09 S ATOM 655 CE MET A 44 45.661 74.775 75.717 1.00 13.88 C ATOM 656 HA MET A 44 50.247 75.783 76.608 1.00 0.00 H ATOM 657 HB2 MET A 44 47.673 76.080 78.165 1.00 0.00 H ATOM 658 HB3 MET A 44 47.720 76.353 76.407 1.00 0.00 H ATOM 659 HG2 MET A 44 48.656 73.796 77.786 1.00 0.00 H ATOM 660 HG3 MET A 44 48.545 74.079 76.033 1.00 0.00 H ATOM 661 HE1 MET A 44 45.772 75.826 75.982 1.00 0.00 H ATOM 662 HE2 MET A 44 46.172 74.581 74.774 1.00 0.00 H ATOM 663 HE3 MET A 44 44.603 74.534 75.615 1.00 0.00 H ATOM 664 H MET A 44 49.445 75.697 79.430 1.00 0.00 H ATOM 665 N ARG A 45 49.683 78.158 75.788 1.00 11.97 N ATOM 666 CA ARG A 45 49.613 79.543 75.371 1.00 13.21 C ATOM 667 C ARG A 45 48.172 79.991 75.215 1.00 11.95 C ATOM 668 O ARG A 45 47.891 81.192 75.345 1.00 13.60 O ATOM 669 CB ARG A 45 50.356 79.743 74.058 1.00 15.23 C ATOM 670 CG ARG A 45 51.880 79.527 74.143 1.00 17.16 C ATOM 671 CD ARG A 45 52.460 79.548 72.694 1.00 20.38 C ATOM 672 NE ARG A 45 51.789 78.533 71.827 1.00 25.14 N ATOM 673 CZ ARG A 45 52.134 78.235 70.568 1.00 26.46 C ATOM 674 NH1 ARG A 45 51.481 77.297 69.897 1.00 28.30 N ATOM 675 NH2 ARG A 45 53.123 78.885 69.951 1.00 28.29 N ATOM 676 HA ARG A 45 50.085 80.148 76.145 1.00 0.00 H ATOM 677 HB2 ARG A 45 49.953 79.040 73.329 1.00 0.00 H ATOM 678 HB3 ARG A 45 50.175 80.762 73.717 1.00 0.00 H ATOM 679 HG2 ARG A 45 52.333 80.324 74.733 1.00 0.00 H ATOM 680 HG3 ARG A 45 52.091 78.565 74.611 1.00 0.00 H ATOM 681 HD2 ARG A 45 53.527 79.331 72.735 1.00 0.00 H ATOM 682 HD3 ARG A 45 52.308 80.538 72.265 1.00 0.00 H ATOM 683 HE ARG A 45 50.986 78.014 72.236 1.00 0.00 H ATOM 684 HH12 ARG A 45 51.755 77.071 68.919 1.00 0.00 H ATOM 685 HH11 ARG A 45 50.695 76.787 70.348 1.00 0.00 H ATOM 686 HH22 ARG A 45 53.376 78.639 68.973 1.00 0.00 H ATOM 687 HH21 ARG A 45 53.641 79.638 70.448 1.00 0.00 H ATOM 688 H ARG A 45 49.704 77.416 75.060 1.00 0.00 H ATOM 689 N SER A 46 47.269 79.055 74.880 1.00 11.04 N ATOM 690 CA SER A 46 45.858 79.364 74.821 1.00 11.34 C ATOM 691 C SER A 46 45.236 79.174 76.215 1.00 11.21 C ATOM 692 O SER A 46 45.356 78.112 76.798 1.00 11.99 O ATOM 693 CB SER A 46 45.182 78.429 73.829 1.00 11.70 C ATOM 694 OG SER A 46 43.817 78.773 73.657 1.00 11.48 O ATOM 695 HA SER A 46 45.720 80.397 74.501 1.00 0.00 H ATOM 696 HB2 SER A 46 45.248 77.406 74.200 1.00 0.00 H ATOM 697 HB3 SER A 46 45.692 78.499 72.868 1.00 0.00 H ATOM 698 HG SER A 46 43.752 79.700 73.316 1.00 0.00 H ATOM 699 H SER A 46 47.590 78.091 74.659 1.00 0.00 H ATOM 700 N HIS A 47 44.594 80.214 76.752 1.00 11.00 N ATOM 701 CA HIS A 47 44.043 80.167 78.127 1.00 11.53 C ATOM 702 C HIS A 47 42.537 80.368 78.151 1.00 11.68 C ATOM 703 O HIS A 47 41.985 80.857 79.160 1.00 14.22 O ATOM 704 CB HIS A 47 44.684 81.207 79.077 1.00 13.11 C ATOM 705 CG HIS A 47 46.185 81.197 79.082 1.00 12.61 C ATOM 706 ND1 HIS A 47 46.921 82.288 79.510 1.00 14.55 N ATOM 707 CD2 HIS A 47 47.084 80.256 78.707 1.00 13.93 C ATOM 708 CE1 HIS A 47 48.214 82.013 79.398 1.00 14.48 C ATOM 709 NE2 HIS A 47 48.339 80.780 78.921 1.00 14.18 N ATOM 710 HA HIS A 47 44.288 79.167 78.484 1.00 0.00 H ATOM 711 HB2 HIS A 47 44.350 82.199 78.773 1.00 0.00 H ATOM 712 HB3 HIS A 47 44.338 81.003 80.090 1.00 0.00 H ATOM 713 HD2 HIS A 47 46.856 79.267 78.309 1.00 0.00 H ATOM 714 HE1 HIS A 47 49.034 82.684 79.654 1.00 0.00 H ATOM 715 H HIS A 47 44.477 81.081 76.190 1.00 0.00 H ATOM 716 N VAL A 48 41.882 80.002 77.042 1.00 11.57 N ATOM 717 CA VAL A 48 40.456 80.256 76.928 1.00 11.50 C ATOM 718 C VAL A 48 39.764 78.997 76.468 1.00 11.02 C ATOM 719 O VAL A 48 40.362 78.190 75.738 1.00 11.84 O ATOM 720 CB VAL A 48 40.167 81.433 75.925 1.00 14.20 C ATOM 721 CG1 VAL A 48 40.661 82.775 76.522 1.00 14.85 C ATOM 722 CG2 VAL A 48 40.840 81.205 74.575 1.00 13.91 C ATOM 723 HA VAL A 48 40.073 80.551 77.905 1.00 0.00 H ATOM 724 HB VAL A 48 39.089 81.469 75.767 1.00 0.00 H ATOM 725 HG11 VAL A 48 40.140 82.968 77.460 1.00 0.00 H ATOM 726 HG12 VAL A 48 41.734 82.716 76.706 1.00 0.00 H ATOM 727 HG13 VAL A 48 40.455 83.582 75.818 1.00 0.00 H ATOM 728 HG21 VAL A 48 41.918 81.132 74.716 1.00 0.00 H ATOM 729 HG22 VAL A 48 40.466 80.280 74.135 1.00 0.00 H ATOM 730 HG23 VAL A 48 40.615 82.041 73.912 1.00 0.00 H ATOM 731 H VAL A 48 42.393 79.537 76.264 1.00 0.00 H ATOM 732 N TRP A 49 38.500 78.811 76.874 1.00 10.18 N ATOM 733 CA TRP A 49 37.785 77.590 76.467 1.00 9.81 C ATOM 734 C TRP A 49 36.297 77.788 76.549 1.00 9.87 C ATOM 735 O TRP A 49 35.798 78.727 77.211 1.00 10.93 O ATOM 736 CB TRP A 49 38.232 76.367 77.291 1.00 11.13 C ATOM 737 CG TRP A 49 37.985 76.390 78.778 1.00 11.24 C ATOM 738 CD1 TRP A 49 37.279 77.319 79.507 1.00 11.82 C ATOM 739 CD2 TRP A 49 38.442 75.410 79.698 1.00 12.62 C ATOM 740 NE1 TRP A 49 37.293 76.956 80.849 1.00 12.56 N ATOM 741 CE2 TRP A 49 37.976 75.774 80.981 1.00 12.64 C ATOM 742 CE3 TRP A 49 39.196 74.248 79.559 1.00 13.84 C ATOM 743 CZ2 TRP A 49 38.248 75.009 82.115 1.00 13.84 C ATOM 744 CZ3 TRP A 49 39.466 73.477 80.712 1.00 13.97 C ATOM 745 CH2 TRP A 49 38.995 73.877 81.944 1.00 14.03 C ATOM 746 HA TRP A 49 38.042 77.389 75.427 1.00 0.00 H ATOM 747 HB2 TRP A 49 37.713 75.497 76.889 1.00 0.00 H ATOM 748 HB3 TRP A 49 39.305 76.249 77.142 1.00 0.00 H ATOM 749 HE1 TRP A 49 36.857 77.493 81.626 1.00 0.00 H ATOM 750 HD1 TRP A 49 36.786 78.201 79.097 1.00 0.00 H ATOM 751 HZ2 TRP A 49 37.880 75.302 83.098 1.00 0.00 H ATOM 752 HH2 TRP A 49 39.227 73.266 82.817 1.00 0.00 H ATOM 753 HZ3 TRP A 49 40.050 72.561 80.627 1.00 0.00 H ATOM 754 HE3 TRP A 49 39.570 73.940 78.583 1.00 0.00 H ATOM 755 H TRP A 49 38.029 79.522 77.470 1.00 0.00 H ATOM 756 N GLY A 50 35.587 76.924 75.831 1.00 9.98 N ATOM 757 CA GLY A 50 34.137 76.917 75.905 1.00 9.84 C ATOM 758 C GLY A 50 33.716 75.803 76.853 1.00 10.26 C ATOM 759 O GLY A 50 33.501 74.642 76.447 1.00 10.96 O ATOM 760 HA3 GLY A 50 33.717 76.738 74.915 1.00 0.00 H ATOM 761 HA2 GLY A 50 33.782 77.876 76.281 1.00 0.00 H ATOM 762 H GLY A 50 36.074 76.247 75.210 1.00 0.00 H ATOM 763 N ASN A 51 33.612 76.158 78.131 1.00 10.72 N ATOM 764 CA ASN A 51 33.345 75.155 79.160 1.00 11.79 C ATOM 765 C ASN A 51 31.865 74.918 79.413 1.00 10.51 C ATOM 766 O ASN A 51 31.028 75.826 79.244 1.00 11.79 O ATOM 767 CB ASN A 51 34.070 75.547 80.463 1.00 12.75 C ATOM 768 CG ASN A 51 33.644 76.897 81.003 1.00 15.67 C ATOM 769 OD1 ASN A 51 33.444 77.849 80.235 1.00 16.20 O ATOM 770 ND2 ASN A 51 33.524 77.013 82.346 1.00 17.80 N ATOM 771 HA ASN A 51 33.733 74.207 78.788 1.00 0.00 H ATOM 772 HB2 ASN A 51 33.859 74.790 81.218 1.00 0.00 H ATOM 773 HB3 ASN A 51 35.142 75.575 80.268 1.00 0.00 H ATOM 774 HD22 ASN A 51 33.700 76.190 82.957 1.00 0.00 H ATOM 775 HD21 ASN A 51 33.255 77.925 82.767 1.00 0.00 H ATOM 776 H ASN A 51 33.722 77.157 78.400 1.00 0.00 H ATOM 777 N VAL A 52 31.547 73.720 79.894 1.00 11.18 N ATOM 778 CA VAL A 52 30.206 73.420 80.345 1.00 12.32 C ATOM 779 C VAL A 52 30.052 73.953 81.761 1.00 13.23 C ATOM 780 O VAL A 52 30.828 73.605 82.661 1.00 15.69 O ATOM 781 CB VAL A 52 29.959 71.887 80.321 1.00 13.67 C ATOM 782 CG1 VAL A 52 28.629 71.523 81.000 1.00 15.24 C ATOM 783 CG2 VAL A 52 29.981 71.402 78.884 1.00 14.69 C ATOM 784 HA VAL A 52 29.477 73.889 79.685 1.00 0.00 H ATOM 785 HB VAL A 52 30.752 71.393 80.883 1.00 0.00 H ATOM 786 HG11 VAL A 52 28.650 71.855 82.038 1.00 0.00 H ATOM 787 HG12 VAL A 52 27.809 72.015 80.477 1.00 0.00 H ATOM 788 HG13 VAL A 52 28.488 70.443 80.965 1.00 0.00 H ATOM 789 HG21 VAL A 52 29.199 71.909 78.319 1.00 0.00 H ATOM 790 HG22 VAL A 52 30.952 71.624 78.442 1.00 0.00 H ATOM 791 HG23 VAL A 52 29.808 70.326 78.862 1.00 0.00 H ATOM 792 H VAL A 52 32.278 72.983 79.947 1.00 0.00 H ATOM 793 N LYS A 53 29.070 74.825 81.957 1.00 12.79 N ATOM 794 CA LYS A 53 28.882 75.523 83.224 1.00 13.81 C ATOM 795 C LYS A 53 27.758 74.825 83.984 1.00 13.49 C ATOM 796 O LYS A 53 26.622 75.298 84.046 1.00 14.34 O ATOM 797 CB LYS A 53 28.550 76.979 82.900 1.00 15.46 C ATOM 798 CG LYS A 53 29.705 77.654 82.077 1.00 17.67 C ATOM 799 CD LYS A 53 29.215 78.882 81.331 1.00 17.77 C ATOM 800 CE LYS A 53 30.276 79.464 80.418 1.00 17.52 C ATOM 801 NZ LYS A 53 30.469 78.607 79.213 1.00 13.19 N ATOM 802 HA LYS A 53 29.772 75.505 83.853 1.00 0.00 H ATOM 803 HB2 LYS A 53 27.630 77.013 82.316 1.00 0.00 H ATOM 804 HB3 LYS A 53 28.409 77.528 83.831 1.00 0.00 H ATOM 805 HG2 LYS A 53 30.501 77.949 82.761 1.00 0.00 H ATOM 806 HG3 LYS A 53 30.094 76.934 81.357 1.00 0.00 H ATOM 807 HD2 LYS A 53 28.349 78.605 80.730 1.00 0.00 H ATOM 808 HD3 LYS A 53 28.923 79.640 82.058 1.00 0.00 H ATOM 809 HE2 LYS A 53 31.218 79.532 80.963 1.00 0.00 H ATOM 810 HE3 LYS A 53 29.968 80.461 80.102 1.00 0.00 H ATOM 811 HZ1 LYS A 53 30.767 77.656 79.510 1.00 0.00 H ATOM 812 HZ2 LYS A 53 29.574 78.543 78.688 1.00 0.00 H ATOM 813 HZ3 LYS A 53 31.200 79.027 78.604 1.00 0.00 H ATOM 814 H LYS A 53 28.409 75.018 81.177 1.00 0.00 H ATOM 815 N LEU A 54 28.079 73.663 84.527 1.00 14.48 N ATOM 816 CA LEU A 54 27.080 72.804 85.144 1.00 14.77 C ATOM 817 C LEU A 54 27.781 71.905 86.131 1.00 14.82 C ATOM 818 O LEU A 54 28.758 71.235 85.784 1.00 16.34 O ATOM 819 CB LEU A 54 26.374 71.926 84.082 1.00 15.26 C ATOM 820 CG LEU A 54 25.297 70.968 84.591 1.00 15.64 C ATOM 821 CD1 LEU A 54 24.122 71.719 85.144 1.00 18.54 C ATOM 822 CD2 LEU A 54 24.854 70.040 83.487 1.00 17.19 C ATOM 823 HA LEU A 54 26.329 73.422 85.636 1.00 0.00 H ATOM 824 HB2 LEU A 54 25.907 72.594 83.358 1.00 0.00 H ATOM 825 HB3 LEU A 54 27.139 71.330 83.584 1.00 0.00 H ATOM 826 HG LEU A 54 25.728 70.375 85.397 1.00 0.00 H ATOM 827 HD21 LEU A 54 24.448 70.626 82.663 1.00 0.00 H ATOM 828 HD22 LEU A 54 25.708 69.461 83.136 1.00 0.00 H ATOM 829 HD23 LEU A 54 24.087 69.365 83.867 1.00 0.00 H ATOM 830 HD11 LEU A 54 24.451 72.346 85.973 1.00 0.00 H ATOM 831 HD12 LEU A 54 23.691 72.344 84.362 1.00 0.00 H ATOM 832 HD13 LEU A 54 23.373 71.010 85.498 1.00 0.00 H ATOM 833 H LEU A 54 29.072 73.355 84.513 1.00 0.00 H ATOM 834 N ASP A 55 27.264 71.847 87.347 1.00 15.82 N ATOM 835 CA ASP A 55 27.780 70.896 88.327 1.00 16.14 C ATOM 836 C ASP A 55 27.079 69.572 88.027 1.00 16.93 C ATOM 837 O ASP A 55 25.867 69.443 88.206 1.00 16.94 O ATOM 838 CB ASP A 55 27.464 71.377 89.754 1.00 19.51 C ATOM 839 CG ASP A 55 28.004 70.443 90.823 1.00 22.13 C ATOM 840 OD1 ASP A 55 28.543 69.357 90.487 1.00 22.36 O ATOM 841 OD2 ASP A 55 27.880 70.813 92.017 1.00 24.20 O ATOM 842 HA ASP A 55 28.863 70.792 88.263 1.00 0.00 H ATOM 843 HB2 ASP A 55 27.907 72.363 89.896 1.00 0.00 H ATOM 844 HB3 ASP A 55 26.382 71.447 89.867 1.00 0.00 H ATOM 845 H ASP A 55 26.484 72.484 87.607 1.00 0.00 H ATOM 846 N THR A 56 27.828 68.598 87.526 1.00 16.51 N ATOM 847 CA THR A 56 27.209 67.318 87.134 1.00 15.83 C ATOM 848 C THR A 56 27.121 66.318 88.296 1.00 16.67 C ATOM 849 O THR A 56 26.657 65.190 88.101 1.00 17.46 O ATOM 850 CB THR A 56 27.974 66.672 85.958 1.00 17.05 C ATOM 851 OG1 THR A 56 29.340 66.492 86.346 1.00 19.39 O ATOM 852 CG2 THR A 56 27.896 67.552 84.725 1.00 18.24 C ATOM 853 HA THR A 56 26.192 67.557 86.824 1.00 0.00 H ATOM 854 HB THR A 56 27.524 65.709 85.716 1.00 0.00 H ATOM 855 HG1 THR A 56 29.381 65.902 87.140 1.00 0.00 H ATOM 856 HG23 THR A 56 26.852 67.682 84.439 1.00 0.00 H ATOM 857 HG21 THR A 56 28.338 68.524 84.945 1.00 0.00 H ATOM 858 HG22 THR A 56 28.442 67.080 83.908 1.00 0.00 H ATOM 859 H THR A 56 28.852 68.737 87.410 1.00 0.00 H ATOM 860 N THR A 57 27.566 66.710 89.492 1.00 17.27 N ATOM 861 CA THR A 57 27.550 65.815 90.647 1.00 18.32 C ATOM 862 C THR A 57 26.152 65.260 90.901 1.00 18.67 C ATOM 863 O THR A 57 25.182 66.014 90.982 1.00 21.39 O ATOM 864 CB THR A 57 27.980 66.567 91.913 1.00 20.42 C ATOM 865 OG1 THR A 57 29.283 67.114 91.691 1.00 23.95 O ATOM 866 CG2 THR A 57 28.038 65.625 93.113 1.00 22.18 C ATOM 867 HA THR A 57 28.239 65.000 90.425 1.00 0.00 H ATOM 868 HB THR A 57 27.255 67.353 92.124 1.00 0.00 H ATOM 869 HG1 THR A 57 29.919 66.380 91.499 1.00 0.00 H ATOM 870 HG23 THR A 57 27.049 65.203 93.290 1.00 0.00 H ATOM 871 HG21 THR A 57 28.746 64.822 92.909 1.00 0.00 H ATOM 872 HG22 THR A 57 28.361 66.180 93.994 1.00 0.00 H ATOM 873 H THR A 57 27.933 67.676 89.605 1.00 0.00 H ATOM 874 N GLY A 58 26.048 63.936 90.988 1.00 19.43 N ATOM 875 CA GLY A 58 24.779 63.304 91.322 1.00 19.95 C ATOM 876 C GLY A 58 23.723 63.272 90.230 1.00 18.73 C ATOM 877 O GLY A 58 22.644 62.727 90.448 1.00 21.76 O ATOM 878 HA3 GLY A 58 24.358 63.839 92.173 1.00 0.00 H ATOM 879 HA2 GLY A 58 24.989 62.274 91.609 1.00 0.00 H ATOM 880 H GLY A 58 26.885 63.344 90.815 1.00 0.00 H ATOM 881 N LEU A 59 24.010 63.800 89.035 1.00 17.89 N ATOM 882 CA LEU A 59 23.029 63.770 87.951 1.00 17.16 C ATOM 883 C LEU A 59 22.878 62.397 87.314 1.00 17.53 C ATOM 884 O LEU A 59 21.878 62.127 86.642 1.00 19.22 O ATOM 885 CB LEU A 59 23.399 64.792 86.878 1.00 17.99 C ATOM 886 CG LEU A 59 23.371 66.249 87.354 1.00 17.88 C ATOM 887 CD1 LEU A 59 23.558 67.186 86.170 1.00 18.00 C ATOM 888 CD2 LEU A 59 22.081 66.616 88.071 1.00 19.74 C ATOM 889 HA LEU A 59 22.068 64.021 88.400 1.00 0.00 H ATOM 890 HB2 LEU A 59 24.406 64.567 86.526 1.00 0.00 H ATOM 891 HB3 LEU A 59 22.695 64.689 86.052 1.00 0.00 H ATOM 892 HG LEU A 59 24.188 66.357 88.067 1.00 0.00 H ATOM 893 HD21 LEU A 59 21.238 66.472 87.396 1.00 0.00 H ATOM 894 HD22 LEU A 59 21.960 65.979 88.947 1.00 0.00 H ATOM 895 HD23 LEU A 59 22.124 67.660 88.383 1.00 0.00 H ATOM 896 HD11 LEU A 59 24.517 66.981 85.694 1.00 0.00 H ATOM 897 HD12 LEU A 59 22.754 67.027 85.452 1.00 0.00 H ATOM 898 HD13 LEU A 59 23.537 68.219 86.519 1.00 0.00 H ATOM 899 H LEU A 59 24.940 64.236 88.875 1.00 0.00 H ATOM 900 N ILE A 60 23.883 61.543 87.484 1.00 16.40 N ATOM 901 CA ILE A 60 23.852 60.198 86.895 1.00 15.90 C ATOM 902 C ILE A 60 24.076 59.190 88.009 1.00 16.05 C ATOM 903 O ILE A 60 24.970 59.381 88.843 1.00 18.24 O ATOM 904 CB ILE A 60 24.919 60.052 85.766 1.00 14.81 C ATOM 905 CG1 ILE A 60 24.703 61.147 84.710 1.00 14.93 C ATOM 906 CG2 ILE A 60 24.876 58.620 85.169 1.00 16.09 C ATOM 907 CD1 ILE A 60 25.756 61.115 83.634 1.00 15.32 C ATOM 908 HA ILE A 60 22.884 60.018 86.428 1.00 0.00 H ATOM 909 HB ILE A 60 25.920 60.189 86.175 1.00 0.00 H ATOM 910 HG12 ILE A 60 23.726 61.003 84.249 1.00 0.00 H ATOM 911 HG13 ILE A 60 24.732 62.120 85.201 1.00 0.00 H ATOM 912 HD11 ILE A 60 26.738 61.266 84.083 1.00 0.00 H ATOM 913 HD12 ILE A 60 25.730 60.148 83.131 1.00 0.00 H ATOM 914 HD13 ILE A 60 25.560 61.908 82.912 1.00 0.00 H ATOM 915 HG21 ILE A 60 25.085 57.894 85.954 1.00 0.00 H ATOM 916 HG22 ILE A 60 23.887 58.431 84.752 1.00 0.00 H ATOM 917 HG23 ILE A 60 25.626 58.533 84.383 1.00 0.00 H ATOM 918 H ILE A 60 24.708 61.834 88.046 1.00 0.00 H ATOM 919 N ASP A 61 23.297 58.113 88.017 1.00 16.94 N ATOM 920 CA ASP A 61 23.420 57.121 89.086 1.00 19.60 C ATOM 921 C ASP A 61 24.849 56.603 89.204 1.00 17.64 C ATOM 922 O ASP A 61 25.519 56.385 88.186 1.00 16.60 O ATOM 923 CB ASP A 61 22.461 55.972 88.820 1.00 24.57 C ATOM 924 CG ASP A 61 21.021 56.314 89.198 1.00 30.36 C ATOM 925 OD1 ASP A 61 20.189 55.388 89.200 1.00 33.94 O ATOM 926 OD2 ASP A 61 20.723 57.496 89.503 1.00 32.56 O ATOM 927 HA ASP A 61 23.166 57.599 90.032 1.00 0.00 H ATOM 928 HB2 ASP A 61 22.495 55.726 87.759 1.00 0.00 H ATOM 929 HB3 ASP A 61 22.780 55.108 89.403 1.00 0.00 H ATOM 930 H ASP A 61 22.597 57.975 87.260 1.00 0.00 H ATOM 931 N ARG A 62 25.301 56.367 90.440 1.00 17.98 N ATOM 932 CA ARG A 62 26.660 55.928 90.671 1.00 19.35 C ATOM 933 C ARG A 62 27.068 54.707 89.827 1.00 19.11 C ATOM 934 O ARG A 62 28.163 54.689 89.249 1.00 20.03 O ATOM 935 CB ARG A 62 26.855 55.612 92.155 1.00 21.43 C ATOM 936 CG ARG A 62 28.162 54.891 92.439 1.00 24.51 C ATOM 937 HA ARG A 62 27.306 56.750 90.362 1.00 0.00 H ATOM 938 HB2 ARG A 62 26.845 56.547 92.714 1.00 0.00 H ATOM 939 HB3 ARG A 62 26.030 54.982 92.488 1.00 0.00 H ATOM 940 HG2 ARG A 62 28.181 53.948 91.893 1.00 0.00 H ATOM 941 HG3 ARG A 62 28.997 55.515 92.119 1.00 0.00 H ATOM 942 H ARG A 62 24.664 56.502 91.251 1.00 0.00 H ATOM 943 N LYS A 63 26.212 53.694 89.729 1.00 19.88 N ATOM 944 CA LYS A 63 26.636 52.482 89.021 1.00 21.82 C ATOM 945 C LYS A 63 26.716 52.659 87.497 1.00 20.50 C ATOM 946 O LYS A 63 27.266 51.810 86.778 1.00 22.79 O ATOM 947 CB LYS A 63 25.738 51.303 89.391 1.00 24.28 C ATOM 948 CG LYS A 63 25.942 50.856 90.846 1.00 27.13 C ATOM 949 HA LYS A 63 27.654 52.272 89.350 1.00 0.00 H ATOM 950 HB2 LYS A 63 24.697 51.598 89.256 1.00 0.00 H ATOM 951 HB3 LYS A 63 25.966 50.466 88.731 1.00 0.00 H ATOM 952 HG2 LYS A 63 26.979 50.552 90.989 1.00 0.00 H ATOM 953 HG3 LYS A 63 25.709 51.684 91.515 1.00 0.00 H ATOM 954 H LYS A 63 25.262 53.760 90.146 1.00 0.00 H ATOM 955 N VAL A 64 26.140 53.740 87.015 1.00 18.65 N ATOM 956 CA VAL A 64 26.179 54.088 85.606 1.00 18.35 C ATOM 957 C VAL A 64 27.396 54.985 85.330 1.00 16.03 C ATOM 958 O VAL A 64 28.192 54.727 84.412 1.00 16.13 O ATOM 959 CB VAL A 64 24.862 54.801 85.146 1.00 19.31 C ATOM 960 CG1 VAL A 64 25.020 55.317 83.703 1.00 18.86 C ATOM 961 CG2 VAL A 64 23.661 53.875 85.254 1.00 21.97 C ATOM 962 HA VAL A 64 26.266 53.166 85.032 1.00 0.00 H ATOM 963 HB VAL A 64 24.684 55.647 85.810 1.00 0.00 H ATOM 964 HG11 VAL A 64 25.847 56.026 83.661 1.00 0.00 H ATOM 965 HG12 VAL A 64 25.225 54.478 83.039 1.00 0.00 H ATOM 966 HG13 VAL A 64 24.099 55.811 83.392 1.00 0.00 H ATOM 967 HG21 VAL A 64 23.820 53.001 84.622 1.00 0.00 H ATOM 968 HG22 VAL A 64 23.539 53.559 86.290 1.00 0.00 H ATOM 969 HG23 VAL A 64 22.766 54.404 84.927 1.00 0.00 H ATOM 970 H VAL A 64 25.636 54.371 87.671 1.00 0.00 H ATOM 971 N VAL A 65 27.576 56.016 86.149 1.00 13.30 N ATOM 972 CA VAL A 65 28.590 57.021 85.880 1.00 12.87 C ATOM 973 C VAL A 65 30.000 56.492 86.187 1.00 12.82 C ATOM 974 O VAL A 65 30.968 57.029 85.671 1.00 12.58 O ATOM 975 CB VAL A 65 28.292 58.311 86.680 1.00 13.10 C ATOM 976 CG1 VAL A 65 28.725 58.168 88.154 1.00 14.62 C ATOM 977 CG2 VAL A 65 28.960 59.521 86.045 1.00 14.67 C ATOM 978 HA VAL A 65 28.558 57.259 84.817 1.00 0.00 H ATOM 979 HB VAL A 65 27.213 58.466 86.656 1.00 0.00 H ATOM 980 HG11 VAL A 65 28.182 57.341 88.612 1.00 0.00 H ATOM 981 HG12 VAL A 65 29.796 57.970 88.199 1.00 0.00 H ATOM 982 HG13 VAL A 65 28.502 59.092 88.688 1.00 0.00 H ATOM 983 HG21 VAL A 65 30.039 59.368 86.021 1.00 0.00 H ATOM 984 HG22 VAL A 65 28.587 59.648 85.029 1.00 0.00 H ATOM 985 HG23 VAL A 65 28.731 60.411 86.632 1.00 0.00 H ATOM 986 H VAL A 65 26.981 56.105 86.997 1.00 0.00 H ATOM 987 N ARG A 66 30.113 55.415 86.982 1.00 12.51 N ATOM 988 CA ARG A 66 31.430 54.887 87.302 1.00 14.01 C ATOM 989 C ARG A 66 32.191 54.456 86.044 1.00 12.99 C ATOM 990 O ARG A 66 33.418 54.367 86.077 1.00 14.73 O ATOM 991 CB ARG A 66 31.327 53.712 88.313 1.00 16.09 C ATOM 992 CG ARG A 66 30.589 52.507 87.768 1.00 19.12 C ATOM 993 CD ARG A 66 30.237 51.473 88.876 1.00 21.89 C ATOM 994 NE ARG A 66 29.366 50.459 88.278 1.00 25.20 N ATOM 995 CZ ARG A 66 29.137 49.260 88.788 1.00 29.11 C ATOM 996 NH1 ARG A 66 29.692 48.933 89.941 1.00 31.29 N ATOM 997 NH2 ARG A 66 28.340 48.408 88.148 1.00 31.15 N ATOM 998 HA ARG A 66 31.997 55.693 87.768 1.00 0.00 H ATOM 999 HB2 ARG A 66 32.336 53.404 88.588 1.00 0.00 H ATOM 1000 HB3 ARG A 66 30.802 54.066 89.201 1.00 0.00 H ATOM 1001 HG2 ARG A 66 29.665 52.845 87.299 1.00 0.00 H ATOM 1002 HG3 ARG A 66 31.217 52.020 87.022 1.00 0.00 H ATOM 1003 HD2 ARG A 66 29.720 51.970 89.697 1.00 0.00 H ATOM 1004 HD3 ARG A 66 31.148 51.006 89.251 1.00 0.00 H ATOM 1005 HE ARG A 66 28.891 50.700 87.384 1.00 0.00 H ATOM 1006 HH12 ARG A 66 29.520 47.994 90.353 1.00 0.00 H ATOM 1007 HH11 ARG A 66 30.301 49.615 90.437 1.00 0.00 H ATOM 1008 HH22 ARG A 66 28.159 47.465 88.548 1.00 0.00 H ATOM 1009 HH21 ARG A 66 27.898 48.685 87.248 1.00 0.00 H ATOM 1010 H ARG A 66 29.261 54.960 87.368 1.00 0.00 H ATOM 1011 N PHE A 67 31.475 54.140 84.959 1.00 12.70 N ATOM 1012 CA PHE A 67 32.121 53.718 83.706 1.00 12.64 C ATOM 1013 C PHE A 67 32.525 54.877 82.803 1.00 12.06 C ATOM 1014 O PHE A 67 33.186 54.640 81.785 1.00 12.32 O ATOM 1015 CB PHE A 67 31.174 52.793 82.912 1.00 13.38 C ATOM 1016 CG PHE A 67 30.923 51.516 83.594 1.00 14.23 C ATOM 1017 CD1 PHE A 67 31.904 50.526 83.640 1.00 15.66 C ATOM 1018 CD2 PHE A 67 29.707 51.300 84.221 1.00 16.10 C ATOM 1019 CE1 PHE A 67 31.668 49.307 84.284 1.00 16.51 C ATOM 1020 CE2 PHE A 67 29.456 50.100 84.868 1.00 17.47 C ATOM 1021 CZ PHE A 67 30.458 49.112 84.930 1.00 16.34 C ATOM 1022 HA PHE A 67 33.033 53.199 84.002 1.00 0.00 H ATOM 1023 HB2 PHE A 67 30.223 53.306 82.771 1.00 0.00 H ATOM 1024 HB3 PHE A 67 31.622 52.587 81.940 1.00 0.00 H ATOM 1025 HD2 PHE A 67 28.943 52.078 84.206 1.00 0.00 H ATOM 1026 HE2 PHE A 67 28.484 49.921 85.328 1.00 0.00 H ATOM 1027 HZ PHE A 67 30.281 48.192 85.487 1.00 0.00 H ATOM 1028 HE1 PHE A 67 32.425 48.522 84.278 1.00 0.00 H ATOM 1029 HD1 PHE A 67 32.870 50.705 83.167 1.00 0.00 H ATOM 1030 H PHE A 67 30.437 54.194 85.002 1.00 0.00 H ATOM 1031 N MET A 68 32.109 56.101 83.140 1.00 11.82 N ATOM 1032 CA MET A 68 32.073 57.201 82.158 1.00 12.38 C ATOM 1033 C MET A 68 33.181 58.222 82.286 1.00 11.99 C ATOM 1034 O MET A 68 33.545 58.636 83.399 1.00 13.66 O ATOM 1035 CB MET A 68 30.778 57.999 82.336 1.00 13.35 C ATOM 1036 CG MET A 68 29.575 57.262 81.962 1.00 13.17 C ATOM 1037 SD MET A 68 28.127 58.387 82.167 1.00 16.61 S ATOM 1038 CE MET A 68 26.845 57.506 81.289 1.00 15.64 C ATOM 1039 HA MET A 68 32.171 56.700 81.195 1.00 0.00 H ATOM 1040 HB2 MET A 68 30.693 58.287 83.384 1.00 0.00 H ATOM 1041 HB3 MET A 68 30.838 58.895 81.718 1.00 0.00 H ATOM 1042 HG2 MET A 68 29.460 56.390 82.606 1.00 0.00 H ATOM 1043 HG3 MET A 68 29.648 56.938 80.924 1.00 0.00 H ATOM 1044 HE1 MET A 68 27.142 57.377 80.248 1.00 0.00 H ATOM 1045 HE2 MET A 68 26.696 56.529 81.750 1.00 0.00 H ATOM 1046 HE3 MET A 68 25.917 58.076 81.335 1.00 0.00 H ATOM 1047 H MET A 68 31.803 56.282 84.117 1.00 0.00 H ATOM 1048 N SER A 69 33.677 58.678 81.136 1.00 11.53 N ATOM 1049 CA SER A 69 34.432 59.927 81.090 1.00 11.86 C ATOM 1050 C SER A 69 33.491 61.110 80.859 1.00 11.06 C ATOM 1051 O SER A 69 32.281 60.904 80.653 1.00 11.17 O ATOM 1052 CB SER A 69 35.421 59.867 79.936 1.00 14.29 C ATOM 1053 OG SER A 69 34.707 59.806 78.718 1.00 16.37 O ATOM 1054 HA SER A 69 34.953 60.058 82.039 1.00 0.00 H ATOM 1055 HB2 SER A 69 36.047 58.981 80.037 1.00 0.00 H ATOM 1056 HB3 SER A 69 36.050 60.757 79.947 1.00 0.00 H ATOM 1057 HG SER A 69 34.137 58.997 78.711 1.00 0.00 H ATOM 1058 H SER A 69 33.524 58.138 80.261 1.00 0.00 H ATOM 1059 N ASP A 70 34.023 62.338 80.829 1.00 11.95 N ATOM 1060 CA ASP A 70 33.151 63.492 80.682 1.00 11.31 C ATOM 1061 C ASP A 70 32.432 63.497 79.338 1.00 10.09 C ATOM 1062 O ASP A 70 31.288 63.956 79.284 1.00 11.26 O ATOM 1063 CB ASP A 70 33.944 64.778 80.836 1.00 11.91 C ATOM 1064 CG ASP A 70 34.292 65.083 82.270 1.00 15.81 C ATOM 1065 OD1 ASP A 70 33.798 64.401 83.188 1.00 19.60 O ATOM 1066 OD2 ASP A 70 35.071 66.038 82.483 1.00 18.07 O ATOM 1067 HA ASP A 70 32.399 63.427 81.468 1.00 0.00 H ATOM 1068 HB2 ASP A 70 34.868 64.688 80.265 1.00 0.00 H ATOM 1069 HB3 ASP A 70 33.352 65.602 80.438 1.00 0.00 H ATOM 1070 H ASP A 70 35.052 62.466 80.910 1.00 0.00 H ATOM 1071 N ALA A 71 33.050 63.012 78.256 1.00 9.95 N ATOM 1072 CA ALA A 71 32.324 63.000 76.970 1.00 9.35 C ATOM 1073 C ALA A 71 31.037 62.180 77.146 1.00 10.05 C ATOM 1074 O ALA A 71 29.986 62.544 76.627 1.00 9.73 O ATOM 1075 CB ALA A 71 33.212 62.389 75.878 1.00 9.53 C ATOM 1076 HA ALA A 71 32.068 64.016 76.669 1.00 0.00 H ATOM 1077 HB1 ALA A 71 34.120 62.984 75.775 1.00 0.00 H ATOM 1078 HB2 ALA A 71 33.474 61.368 76.154 1.00 0.00 H ATOM 1079 HB3 ALA A 71 32.670 62.383 74.932 1.00 0.00 H ATOM 1080 H ALA A 71 34.023 62.650 78.319 1.00 0.00 H ATOM 1081 N SER A 72 31.138 61.027 77.812 1.00 9.54 N ATOM 1082 CA SER A 72 29.969 60.204 78.046 1.00 9.41 C ATOM 1083 C SER A 72 28.963 60.848 78.993 1.00 10.72 C ATOM 1084 O SER A 72 27.755 60.718 78.763 1.00 11.39 O ATOM 1085 CB SER A 72 30.390 58.830 78.590 1.00 10.97 C ATOM 1086 OG SER A 72 31.070 58.140 77.569 1.00 12.13 O ATOM 1087 HA SER A 72 29.471 60.090 77.083 1.00 0.00 H ATOM 1088 HB2 SER A 72 29.507 58.266 78.891 1.00 0.00 H ATOM 1089 HB3 SER A 72 31.048 58.959 79.449 1.00 0.00 H ATOM 1090 HG SER A 72 31.349 57.251 77.903 1.00 0.00 H ATOM 1091 H SER A 72 32.065 60.717 78.166 1.00 0.00 H ATOM 1092 N ILE A 73 29.437 61.517 80.047 1.00 9.88 N ATOM 1093 CA ILE A 73 28.515 62.229 80.910 1.00 10.31 C ATOM 1094 C ILE A 73 27.713 63.258 80.107 1.00 9.51 C ATOM 1095 O ILE A 73 26.485 63.317 80.207 1.00 10.19 O ATOM 1096 CB ILE A 73 29.292 62.933 82.056 1.00 11.23 C ATOM 1097 CG1 ILE A 73 29.874 61.828 82.972 1.00 12.57 C ATOM 1098 CG2 ILE A 73 28.377 63.882 82.813 1.00 13.22 C ATOM 1099 CD1 ILE A 73 30.818 62.326 84.032 1.00 14.35 C ATOM 1100 HA ILE A 73 27.820 61.510 81.343 1.00 0.00 H ATOM 1101 HB ILE A 73 30.106 63.541 81.662 1.00 0.00 H ATOM 1102 HG12 ILE A 73 29.044 61.323 83.466 1.00 0.00 H ATOM 1103 HG13 ILE A 73 30.411 61.115 82.346 1.00 0.00 H ATOM 1104 HD11 ILE A 73 31.665 62.823 83.558 1.00 0.00 H ATOM 1105 HD12 ILE A 73 30.296 63.031 84.679 1.00 0.00 H ATOM 1106 HD13 ILE A 73 31.175 61.483 84.624 1.00 0.00 H ATOM 1107 HG21 ILE A 73 27.993 64.638 82.128 1.00 0.00 H ATOM 1108 HG22 ILE A 73 27.546 63.320 83.240 1.00 0.00 H ATOM 1109 HG23 ILE A 73 28.939 64.366 83.612 1.00 0.00 H ATOM 1110 H ILE A 73 30.458 61.527 80.247 1.00 0.00 H ATOM 1111 N TYR A 74 28.387 64.084 79.293 1.00 9.87 N ATOM 1112 CA TYR A 74 27.657 65.117 78.566 1.00 9.59 C ATOM 1113 C TYR A 74 26.698 64.508 77.540 1.00 9.12 C ATOM 1114 O TYR A 74 25.572 65.023 77.360 1.00 10.32 O ATOM 1115 CB TYR A 74 28.648 66.035 77.845 1.00 11.15 C ATOM 1116 CG TYR A 74 29.634 66.770 78.719 1.00 10.92 C ATOM 1117 CD1 TYR A 74 29.283 67.246 79.990 1.00 12.78 C ATOM 1118 CD2 TYR A 74 30.916 67.009 78.239 1.00 11.56 C ATOM 1119 CE1 TYR A 74 30.212 67.947 80.775 1.00 13.31 C ATOM 1120 CE2 TYR A 74 31.858 67.732 78.993 1.00 12.38 C ATOM 1121 CZ TYR A 74 31.499 68.176 80.243 1.00 12.52 C ATOM 1122 OH TYR A 74 32.435 68.873 80.963 1.00 14.93 O ATOM 1123 HA TYR A 74 27.072 65.686 79.288 1.00 0.00 H ATOM 1124 HB3 TYR A 74 28.072 66.779 77.295 1.00 0.00 H ATOM 1125 HB2 TYR A 74 29.216 65.425 77.143 1.00 0.00 H ATOM 1126 HD2 TYR A 74 31.198 66.628 77.257 1.00 0.00 H ATOM 1127 HE2 TYR A 74 32.852 67.936 78.594 1.00 0.00 H ATOM 1128 HE1 TYR A 74 29.946 68.305 81.770 1.00 0.00 H ATOM 1129 HD1 TYR A 74 28.278 67.070 80.373 1.00 0.00 H ATOM 1130 HH TYR A 74 32.051 69.132 81.838 1.00 0.00 H ATOM 1131 H TYR A 74 29.417 63.989 79.182 1.00 0.00 H ATOM 1132 N ALA A 75 27.137 63.449 76.857 1.00 8.80 N ATOM 1133 CA ALA A 75 26.264 62.770 75.869 1.00 8.72 C ATOM 1134 C ALA A 75 25.076 62.134 76.575 1.00 8.99 C ATOM 1135 O ALA A 75 23.958 62.189 76.075 1.00 9.80 O ATOM 1136 CB ALA A 75 27.037 61.740 75.086 1.00 10.08 C ATOM 1137 HA ALA A 75 25.894 63.514 75.163 1.00 0.00 H ATOM 1138 HB1 ALA A 75 27.855 62.227 74.555 1.00 0.00 H ATOM 1139 HB2 ALA A 75 27.440 60.993 75.770 1.00 0.00 H ATOM 1140 HB3 ALA A 75 26.373 61.257 74.369 1.00 0.00 H ATOM 1141 H ALA A 75 28.102 63.096 77.019 1.00 0.00 H ATOM 1142 N PHE A 76 25.311 61.570 77.755 1.00 9.58 N ATOM 1143 CA PHE A 76 24.222 60.908 78.518 1.00 9.69 C ATOM 1144 C PHE A 76 23.157 61.922 78.941 1.00 10.03 C ATOM 1145 O PHE A 76 21.953 61.665 78.761 1.00 10.49 O ATOM 1146 CB PHE A 76 24.810 60.206 79.739 1.00 10.40 C ATOM 1147 CG PHE A 76 23.787 59.520 80.585 1.00 11.01 C ATOM 1148 CD1 PHE A 76 23.035 60.241 81.525 1.00 13.31 C ATOM 1149 CD2 PHE A 76 23.568 58.148 80.464 1.00 13.31 C ATOM 1150 CE1 PHE A 76 22.109 59.598 82.350 1.00 15.20 C ATOM 1151 CE2 PHE A 76 22.620 57.514 81.303 1.00 16.08 C ATOM 1152 CZ PHE A 76 21.906 58.248 82.211 1.00 15.01 C ATOM 1153 HA PHE A 76 23.741 60.169 77.877 1.00 0.00 H ATOM 1154 HB2 PHE A 76 25.529 59.462 79.396 1.00 0.00 H ATOM 1155 HB3 PHE A 76 25.322 60.949 80.351 1.00 0.00 H ATOM 1156 HD2 PHE A 76 24.123 57.567 79.728 1.00 0.00 H ATOM 1157 HE2 PHE A 76 22.458 56.439 81.226 1.00 0.00 H ATOM 1158 HZ PHE A 76 21.163 57.751 82.835 1.00 0.00 H ATOM 1159 HE1 PHE A 76 21.553 60.164 83.097 1.00 0.00 H ATOM 1160 HD1 PHE A 76 23.175 61.318 81.613 1.00 0.00 H ATOM 1161 H PHE A 76 26.273 61.592 78.151 1.00 0.00 H ATOM 1162 N LEU A 77 23.596 63.062 79.493 1.00 10.16 N ATOM 1163 CA LEU A 77 22.654 64.113 79.891 1.00 10.05 C ATOM 1164 C LEU A 77 21.881 64.626 78.680 1.00 9.58 C ATOM 1165 O LEU A 77 20.655 64.853 78.750 1.00 11.44 O ATOM 1166 CB LEU A 77 23.368 65.244 80.614 1.00 10.70 C ATOM 1167 CG LEU A 77 24.035 64.842 81.934 1.00 12.67 C ATOM 1168 CD1 LEU A 77 24.895 65.980 82.435 1.00 14.44 C ATOM 1169 CD2 LEU A 77 23.003 64.455 82.989 1.00 14.79 C ATOM 1170 HA LEU A 77 21.937 63.682 80.590 1.00 0.00 H ATOM 1171 HB2 LEU A 77 24.138 65.638 79.951 1.00 0.00 H ATOM 1172 HB3 LEU A 77 22.638 66.025 80.826 1.00 0.00 H ATOM 1173 HG LEU A 77 24.658 63.967 81.748 1.00 0.00 H ATOM 1174 HD21 LEU A 77 22.345 65.303 83.179 1.00 0.00 H ATOM 1175 HD22 LEU A 77 22.416 63.611 82.628 1.00 0.00 H ATOM 1176 HD23 LEU A 77 23.514 64.176 83.910 1.00 0.00 H ATOM 1177 HD11 LEU A 77 25.663 66.207 81.695 1.00 0.00 H ATOM 1178 HD12 LEU A 77 24.273 66.860 82.596 1.00 0.00 H ATOM 1179 HD13 LEU A 77 25.368 65.691 83.374 1.00 0.00 H ATOM 1180 H LEU A 77 24.616 63.203 79.641 1.00 0.00 H ATOM 1181 N SER A 78 22.581 64.787 77.564 1.00 9.11 N ATOM 1182 CA SER A 78 21.912 65.201 76.337 1.00 9.45 C ATOM 1183 C SER A 78 20.893 64.162 75.883 1.00 9.56 C ATOM 1184 O SER A 78 19.797 64.518 75.392 1.00 10.49 O ATOM 1185 CB SER A 78 22.919 65.431 75.231 1.00 9.14 C ATOM 1186 OG SER A 78 23.813 66.465 75.588 1.00 11.15 O ATOM 1187 HA SER A 78 21.389 66.133 76.551 1.00 0.00 H ATOM 1188 HB2 SER A 78 22.393 65.710 74.318 1.00 0.00 H ATOM 1189 HB3 SER A 78 23.481 64.513 75.059 1.00 0.00 H ATOM 1190 HG SER A 78 24.294 66.213 76.416 1.00 0.00 H ATOM 1191 H SER A 78 23.607 64.618 77.565 1.00 0.00 H ATOM 1192 N MET A 79 21.228 62.873 76.005 1.00 9.68 N ATOM 1193 CA MET A 79 20.280 61.823 75.628 1.00 9.60 C ATOM 1194 C MET A 79 19.053 61.823 76.504 1.00 10.30 C ATOM 1195 O MET A 79 17.944 61.629 76.002 1.00 10.51 O ATOM 1196 CB MET A 79 20.958 60.457 75.608 1.00 10.15 C ATOM 1197 CG MET A 79 20.089 59.337 75.079 1.00 11.44 C ATOM 1198 SD MET A 79 21.044 58.039 74.358 1.00 13.02 S ATOM 1199 CE MET A 79 19.823 56.760 74.242 1.00 14.38 C ATOM 1200 HA MET A 79 19.939 62.042 74.616 1.00 0.00 H ATOM 1201 HB2 MET A 79 21.846 60.526 74.980 1.00 0.00 H ATOM 1202 HB3 MET A 79 21.254 60.208 76.627 1.00 0.00 H ATOM 1203 HG2 MET A 79 19.417 59.741 74.322 1.00 0.00 H ATOM 1204 HG3 MET A 79 19.503 58.927 75.902 1.00 0.00 H ATOM 1205 HE1 MET A 79 19.447 56.527 75.238 1.00 0.00 H ATOM 1206 HE2 MET A 79 19.001 57.101 73.613 1.00 0.00 H ATOM 1207 HE3 MET A 79 20.273 55.869 73.804 1.00 0.00 H ATOM 1208 H MET A 79 22.167 62.615 76.370 1.00 0.00 H ATOM 1209 N GLU A 80 19.221 62.019 77.809 1.00 10.16 N ATOM 1210 CA GLU A 80 18.043 62.121 78.695 1.00 10.79 C ATOM 1211 C GLU A 80 17.141 63.250 78.233 1.00 10.28 C ATOM 1212 O GLU A 80 15.919 63.078 78.139 1.00 11.52 O ATOM 1213 CB GLU A 80 18.495 62.421 80.123 1.00 12.68 C ATOM 1214 CG GLU A 80 19.159 61.274 80.830 1.00 14.97 C ATOM 1215 CD GLU A 80 19.325 61.600 82.298 1.00 16.88 C ATOM 1216 OE1 GLU A 80 19.835 62.703 82.630 1.00 19.09 O ATOM 1217 OE2 GLU A 80 18.971 60.750 83.128 1.00 18.06 O ATOM 1218 HA GLU A 80 17.502 61.175 78.662 1.00 0.00 H ATOM 1219 HB2 GLU A 80 19.200 63.251 80.088 1.00 0.00 H ATOM 1220 HB3 GLU A 80 17.619 62.714 80.701 1.00 0.00 H ATOM 1221 HG2 GLU A 80 18.544 60.380 80.725 1.00 0.00 H ATOM 1222 HG3 GLU A 80 20.138 61.094 80.387 1.00 0.00 H ATOM 1223 H GLU A 80 20.179 62.100 78.205 1.00 0.00 H ATOM 1224 N GLN A 81 17.725 64.409 77.904 1.00 10.06 N ATOM 1225 CA GLN A 81 16.938 65.538 77.421 1.00 9.74 C ATOM 1226 C GLN A 81 16.222 65.157 76.129 1.00 10.18 C ATOM 1227 O GLN A 81 15.037 65.468 75.963 1.00 11.31 O ATOM 1228 CB GLN A 81 17.826 66.719 77.134 1.00 11.63 C ATOM 1229 CG GLN A 81 18.422 67.397 78.371 1.00 11.03 C ATOM 1230 CD GLN A 81 19.357 68.516 77.925 1.00 10.85 C ATOM 1231 OE1 GLN A 81 19.125 69.171 76.879 1.00 12.43 O ATOM 1232 NE2 GLN A 81 20.431 68.713 78.669 1.00 14.08 N ATOM 1233 HA GLN A 81 16.216 65.800 78.194 1.00 0.00 H ATOM 1234 HB2 GLN A 81 18.649 66.379 76.505 1.00 0.00 H ATOM 1235 HB3 GLN A 81 17.239 67.460 76.592 1.00 0.00 H ATOM 1236 HG2 GLN A 81 17.620 67.812 78.982 1.00 0.00 H ATOM 1237 HG3 GLN A 81 18.980 66.665 78.955 1.00 0.00 H ATOM 1238 HE22 GLN A 81 20.580 68.145 79.528 1.00 0.00 H ATOM 1239 HE21 GLN A 81 21.127 69.436 78.396 1.00 0.00 H ATOM 1240 H GLN A 81 18.757 64.506 77.994 1.00 0.00 H ATOM 1241 N ALA A 82 16.919 64.486 75.226 1.00 9.86 N ATOM 1242 CA ALA A 82 16.326 64.162 73.917 1.00 10.82 C ATOM 1243 C ALA A 82 15.155 63.198 74.045 1.00 9.91 C ATOM 1244 O ALA A 82 14.149 63.322 73.342 1.00 11.48 O ATOM 1245 CB ALA A 82 17.407 63.619 72.990 1.00 11.21 C ATOM 1246 HA ALA A 82 15.919 65.076 73.484 1.00 0.00 H ATOM 1247 HB1 ALA A 82 18.185 64.372 72.861 1.00 0.00 H ATOM 1248 HB2 ALA A 82 17.840 62.719 73.426 1.00 0.00 H ATOM 1249 HB3 ALA A 82 16.967 63.380 72.022 1.00 0.00 H ATOM 1250 H ALA A 82 17.891 64.186 75.442 1.00 0.00 H ATOM 1251 N ILE A 83 15.289 62.214 74.929 1.00 10.44 N ATOM 1252 CA ILE A 83 14.228 61.252 75.178 1.00 10.99 C ATOM 1253 C ILE A 83 12.982 61.946 75.717 1.00 11.47 C ATOM 1254 O ILE A 83 11.875 61.657 75.270 1.00 13.42 O ATOM 1255 CB ILE A 83 14.748 60.207 76.169 1.00 11.36 C ATOM 1256 CG1 ILE A 83 15.667 59.234 75.423 1.00 12.09 C ATOM 1257 CG2 ILE A 83 13.586 59.428 76.845 1.00 12.64 C ATOM 1258 CD1 ILE A 83 16.530 58.366 76.326 1.00 14.59 C ATOM 1259 HA ILE A 83 13.944 60.764 74.246 1.00 0.00 H ATOM 1260 HB ILE A 83 15.299 60.719 76.958 1.00 0.00 H ATOM 1261 HG12 ILE A 83 15.046 58.579 74.812 1.00 0.00 H ATOM 1262 HG13 ILE A 83 16.326 59.814 74.777 1.00 0.00 H ATOM 1263 HD11 ILE A 83 17.170 59.003 76.937 1.00 0.00 H ATOM 1264 HD12 ILE A 83 15.889 57.766 76.972 1.00 0.00 H ATOM 1265 HD13 ILE A 83 17.148 57.709 75.714 1.00 0.00 H ATOM 1266 HG21 ILE A 83 12.948 60.127 77.386 1.00 0.00 H ATOM 1267 HG22 ILE A 83 13.001 58.916 76.081 1.00 0.00 H ATOM 1268 HG23 ILE A 83 13.997 58.696 77.541 1.00 0.00 H ATOM 1269 H ILE A 83 16.180 62.130 75.459 1.00 0.00 H ATOM 1270 N ALA A 84 13.166 62.856 76.671 1.00 11.60 N ATOM 1271 CA ALA A 84 12.043 63.568 77.230 1.00 12.99 C ATOM 1272 C ALA A 84 11.423 64.453 76.157 1.00 13.60 C ATOM 1273 O ALA A 84 10.190 64.502 75.990 1.00 14.79 O ATOM 1274 CB ALA A 84 12.465 64.396 78.436 1.00 14.43 C ATOM 1275 HA ALA A 84 11.302 62.846 77.573 1.00 0.00 H ATOM 1276 HB1 ALA A 84 12.877 63.738 79.201 1.00 0.00 H ATOM 1277 HB2 ALA A 84 13.221 65.120 78.132 1.00 0.00 H ATOM 1278 HB3 ALA A 84 11.598 64.921 78.836 1.00 0.00 H ATOM 1279 H ALA A 84 14.127 63.055 77.016 1.00 0.00 H ATOM 1280 N ASP A 85 12.261 65.144 75.387 1.00 12.79 N ATOM 1281 CA ASP A 85 11.759 66.014 74.309 1.00 12.40 C ATOM 1282 C ASP A 85 10.976 65.210 73.258 1.00 12.69 C ATOM 1283 O ASP A 85 9.995 65.710 72.699 1.00 15.76 O ATOM 1284 CB ASP A 85 12.954 66.731 73.693 1.00 13.37 C ATOM 1285 CG ASP A 85 12.568 67.853 72.764 1.00 13.25 C ATOM 1286 OD1 ASP A 85 11.644 68.636 73.125 1.00 15.95 O ATOM 1287 OD2 ASP A 85 13.242 67.996 71.712 1.00 12.20 O ATOM 1288 HA ASP A 85 11.059 66.745 74.714 1.00 0.00 H ATOM 1289 HB2 ASP A 85 13.562 67.143 74.498 1.00 0.00 H ATOM 1290 HB3 ASP A 85 13.541 66.004 73.132 1.00 0.00 H ATOM 1291 H ASP A 85 13.286 65.069 75.549 1.00 0.00 H ATOM 1292 N ALA A 86 11.415 63.978 72.966 1.00 11.98 N ATOM 1293 CA ALA A 86 10.745 63.136 71.989 1.00 12.99 C ATOM 1294 C ALA A 86 9.504 62.452 72.555 1.00 14.24 C ATOM 1295 O ALA A 86 8.766 61.794 71.792 1.00 17.02 O ATOM 1296 CB ALA A 86 11.692 62.078 71.489 1.00 13.84 C ATOM 1297 HA ALA A 86 10.429 63.790 71.176 1.00 0.00 H ATOM 1298 HB1 ALA A 86 12.554 62.555 71.023 1.00 0.00 H ATOM 1299 HB2 ALA A 86 12.024 61.464 72.326 1.00 0.00 H ATOM 1300 HB3 ALA A 86 11.182 61.452 70.757 1.00 0.00 H ATOM 1301 H ALA A 86 12.259 63.614 73.452 1.00 0.00 H ATOM 1302 N GLY A 87 9.257 62.569 73.868 1.00 13.86 N ATOM 1303 CA GLY A 87 8.050 61.949 74.431 1.00 13.83 C ATOM 1304 C GLY A 87 8.149 60.435 74.428 1.00 15.23 C ATOM 1305 O GLY A 87 7.132 59.737 74.285 1.00 17.00 O ATOM 1306 HA3 GLY A 87 7.187 62.249 73.836 1.00 0.00 H ATOM 1307 HA2 GLY A 87 7.920 62.294 75.457 1.00 0.00 H ATOM 1308 H GLY A 87 9.913 63.093 74.481 1.00 0.00 H ATOM 1309 N LEU A 88 9.360 59.900 74.591 1.00 14.71 N ATOM 1310 CA LEU A 88 9.562 58.431 74.571 1.00 14.05 C ATOM 1311 C LEU A 88 9.613 57.852 75.981 1.00 15.79 C ATOM 1312 O LEU A 88 10.503 58.175 76.756 1.00 17.42 O ATOM 1313 CB LEU A 88 10.851 58.081 73.815 1.00 15.13 C ATOM 1314 CG LEU A 88 10.854 58.349 72.299 1.00 14.42 C ATOM 1315 CD1 LEU A 88 12.277 58.253 71.769 1.00 14.46 C ATOM 1316 CD2 LEU A 88 9.969 57.342 71.564 1.00 15.99 C ATOM 1317 HA LEU A 88 8.710 57.988 74.056 1.00 0.00 H ATOM 1318 HB2 LEU A 88 11.661 58.662 74.256 1.00 0.00 H ATOM 1319 HB3 LEU A 88 11.044 57.019 73.964 1.00 0.00 H ATOM 1320 HG LEU A 88 10.458 59.350 72.125 1.00 0.00 H ATOM 1321 HD21 LEU A 88 10.343 56.334 71.743 1.00 0.00 H ATOM 1322 HD22 LEU A 88 8.946 57.422 71.932 1.00 0.00 H ATOM 1323 HD23 LEU A 88 9.989 57.554 70.495 1.00 0.00 H ATOM 1324 HD11 LEU A 88 12.901 58.993 72.270 1.00 0.00 H ATOM 1325 HD12 LEU A 88 12.669 57.254 71.963 1.00 0.00 H ATOM 1326 HD13 LEU A 88 12.277 58.443 70.696 1.00 0.00 H ATOM 1327 H LEU A 88 10.178 60.525 74.735 1.00 0.00 H ATOM 1328 N SER A 89 8.649 56.992 76.293 1.00 16.37 N ATOM 1329 CA SER A 89 8.636 56.263 77.559 1.00 16.77 C ATOM 1330 C SER A 89 9.710 55.173 77.513 1.00 16.41 C ATOM 1331 O SER A 89 10.136 54.746 76.420 1.00 16.21 O ATOM 1332 CB SER A 89 7.294 55.582 77.742 1.00 17.99 C ATOM 1333 OG SER A 89 7.169 54.558 76.776 1.00 20.42 O ATOM 1334 HA SER A 89 8.820 56.960 78.376 1.00 0.00 H ATOM 1335 HB2 SER A 89 6.493 56.309 77.612 1.00 0.00 H ATOM 1336 HB3 SER A 89 7.234 55.152 78.742 1.00 0.00 H ATOM 1337 HG SER A 89 6.295 54.106 76.887 1.00 0.00 H ATOM 1338 H SER A 89 7.878 56.833 75.613 1.00 0.00 H ATOM 1339 N PRO A 90 10.132 54.670 78.693 1.00 16.89 N ATOM 1340 CA PRO A 90 11.064 53.528 78.680 1.00 17.56 C ATOM 1341 C PRO A 90 10.564 52.394 77.812 1.00 18.22 C ATOM 1342 O PRO A 90 11.331 51.789 77.096 1.00 19.45 O ATOM 1343 CB PRO A 90 11.105 53.110 80.154 1.00 18.42 C ATOM 1344 CG PRO A 90 10.925 54.418 80.882 1.00 18.90 C ATOM 1345 CD PRO A 90 9.875 55.146 80.069 1.00 17.55 C ATOM 1346 HA PRO A 90 12.039 53.786 78.267 1.00 0.00 H ATOM 1347 HD3 PRO A 90 8.870 54.878 80.396 1.00 0.00 H ATOM 1348 HD2 PRO A 90 10.003 56.226 80.141 1.00 0.00 H ATOM 1349 HG3 PRO A 90 11.858 54.981 80.904 1.00 0.00 H ATOM 1350 HG2 PRO A 90 10.579 54.250 81.902 1.00 0.00 H ATOM 1351 HB2 PRO A 90 10.297 52.417 80.388 1.00 0.00 H ATOM 1352 HB3 PRO A 90 12.061 52.650 80.405 1.00 0.00 H ATOM 1353 N GLU A 91 9.265 52.121 77.854 1.00 18.86 N ATOM 1354 CA GLU A 91 8.685 51.018 77.097 1.00 21.08 C ATOM 1355 C GLU A 91 8.765 51.213 75.579 1.00 20.39 C ATOM 1356 O GLU A 91 8.790 50.258 74.814 1.00 22.71 O ATOM 1357 CB GLU A 91 7.231 50.816 77.548 1.00 23.96 C ATOM 1358 CG GLU A 91 7.070 50.379 79.031 1.00 28.64 C ATOM 1359 CD GLU A 91 7.248 51.498 80.098 1.00 29.66 C ATOM 1360 OE1 GLU A 91 7.264 52.731 79.808 1.00 26.79 O ATOM 1361 OE2 GLU A 91 7.362 51.108 81.287 1.00 33.41 O ATOM 1362 HA GLU A 91 9.274 50.126 77.308 1.00 0.00 H ATOM 1363 HB2 GLU A 91 6.698 51.757 77.410 1.00 0.00 H ATOM 1364 HB3 GLU A 91 6.782 50.050 76.916 1.00 0.00 H ATOM 1365 HG2 GLU A 91 6.070 49.962 79.149 1.00 0.00 H ATOM 1366 HG3 GLU A 91 7.811 49.605 79.233 1.00 0.00 H ATOM 1367 H GLU A 91 8.644 52.711 78.444 1.00 0.00 H ATOM 1368 N ALA A 92 8.832 52.460 75.149 1.00 19.13 N ATOM 1369 CA ALA A 92 8.916 52.782 73.742 1.00 20.41 C ATOM 1370 C ALA A 92 10.317 52.536 73.170 1.00 20.37 C ATOM 1371 O ALA A 92 10.428 52.131 72.022 1.00 24.27 O ATOM 1372 CB ALA A 92 8.477 54.243 73.508 1.00 20.36 C ATOM 1373 HA ALA A 92 8.239 52.114 73.210 1.00 0.00 H ATOM 1374 HB1 ALA A 92 7.448 54.370 73.845 1.00 0.00 H ATOM 1375 HB2 ALA A 92 9.130 54.912 74.069 1.00 0.00 H ATOM 1376 HB3 ALA A 92 8.544 54.475 72.445 1.00 0.00 H ATOM 1377 H ALA A 92 8.824 53.234 75.844 1.00 0.00 H ATOM 1378 N TYR A 93 11.394 52.779 73.927 1.00 16.76 N ATOM 1379 CA TYR A 93 12.723 52.714 73.301 1.00 15.54 C ATOM 1380 C TYR A 93 13.643 51.654 73.890 1.00 15.19 C ATOM 1381 O TYR A 93 14.653 51.329 73.254 1.00 16.28 O ATOM 1382 CB TYR A 93 13.429 54.105 73.316 1.00 16.35 C ATOM 1383 CG TYR A 93 13.906 54.524 74.689 1.00 15.18 C ATOM 1384 CD1 TYR A 93 15.167 54.137 75.145 1.00 15.87 C ATOM 1385 CD2 TYR A 93 13.085 55.266 75.553 1.00 15.40 C ATOM 1386 CE1 TYR A 93 15.612 54.449 76.387 1.00 15.96 C ATOM 1387 CE2 TYR A 93 13.541 55.631 76.845 1.00 14.82 C ATOM 1388 CZ TYR A 93 14.780 55.175 77.261 1.00 16.00 C ATOM 1389 OH TYR A 93 15.236 55.481 78.525 1.00 17.70 O ATOM 1390 HA TYR A 93 12.531 52.414 72.271 1.00 0.00 H ATOM 1391 HB3 TYR A 93 12.725 54.853 72.951 1.00 0.00 H ATOM 1392 HB2 TYR A 93 14.290 54.062 72.649 1.00 0.00 H ATOM 1393 HD2 TYR A 93 12.088 55.564 75.228 1.00 0.00 H ATOM 1394 HE2 TYR A 93 12.930 56.256 77.496 1.00 0.00 H ATOM 1395 HE1 TYR A 93 16.607 54.140 76.707 1.00 0.00 H ATOM 1396 HD1 TYR A 93 15.815 53.565 74.481 1.00 0.00 H ATOM 1397 HH TYR A 93 15.296 56.464 78.624 1.00 0.00 H ATOM 1398 H TYR A 93 11.293 53.009 74.936 1.00 0.00 H ATOM 1399 N GLN A 94 13.354 51.156 75.100 1.00 14.20 N ATOM 1400 CA GLN A 94 14.206 50.150 75.740 1.00 14.40 C ATOM 1401 C GLN A 94 13.918 48.754 75.229 1.00 13.68 C ATOM 1402 O GLN A 94 12.769 48.412 74.887 1.00 14.39 O ATOM 1403 CB GLN A 94 14.039 50.188 77.268 1.00 13.93 C ATOM 1404 CG GLN A 94 14.515 51.528 77.834 1.00 15.83 C ATOM 1405 CD GLN A 94 14.368 51.612 79.325 1.00 17.19 C ATOM 1406 OE1 GLN A 94 13.912 50.658 79.978 1.00 19.49 O ATOM 1407 NE2 GLN A 94 14.785 52.752 79.896 1.00 19.18 N ATOM 1408 HA GLN A 94 15.236 50.397 75.483 1.00 0.00 H ATOM 1409 HB2 GLN A 94 12.987 50.048 77.516 1.00 0.00 H ATOM 1410 HB3 GLN A 94 14.626 49.384 77.712 1.00 0.00 H ATOM 1411 HG2 GLN A 94 15.566 51.661 77.579 1.00 0.00 H ATOM 1412 HG3 GLN A 94 13.929 52.327 77.380 1.00 0.00 H ATOM 1413 HE22 GLN A 94 15.159 53.522 79.306 1.00 0.00 H ATOM 1414 HE21 GLN A 94 14.734 52.865 80.929 1.00 0.00 H ATOM 1415 H GLN A 94 12.504 51.492 75.597 1.00 0.00 H ATOM 1416 N ASN A 95 14.973 47.930 75.216 1.00 12.95 N ATOM 1417 CA ASN A 95 14.834 46.506 74.878 1.00 13.14 C ATOM 1418 C ASN A 95 14.120 46.301 73.552 1.00 13.20 C ATOM 1419 O ASN A 95 13.294 45.375 73.384 1.00 14.94 O ATOM 1420 CB ASN A 95 14.101 45.735 76.005 1.00 15.27 C ATOM 1421 CG ASN A 95 14.786 45.875 77.324 1.00 17.52 C ATOM 1422 OD1 ASN A 95 16.008 45.767 77.416 1.00 19.28 O ATOM 1423 ND2 ASN A 95 14.009 46.115 78.367 1.00 22.47 N ATOM 1424 HA ASN A 95 15.843 46.106 74.777 1.00 0.00 H ATOM 1425 HB2 ASN A 95 13.086 46.123 76.093 1.00 0.00 H ATOM 1426 HB3 ASN A 95 14.062 44.678 75.740 1.00 0.00 H ATOM 1427 HD22 ASN A 95 12.980 46.198 78.241 1.00 0.00 H ATOM 1428 HD21 ASN A 95 14.427 46.220 79.313 1.00 0.00 H ATOM 1429 H ASN A 95 15.914 48.306 75.451 1.00 0.00 H ATOM 1430 N ASN A 96 14.501 47.112 72.568 1.00 11.82 N ATOM 1431 CA ASN A 96 13.771 47.175 71.320 1.00 11.90 C ATOM 1432 C ASN A 96 14.789 47.078 70.191 1.00 11.47 C ATOM 1433 O ASN A 96 15.570 47.995 69.976 1.00 11.11 O ATOM 1434 CB ASN A 96 13.011 48.510 71.244 1.00 13.22 C ATOM 1435 CG ASN A 96 12.145 48.615 70.016 1.00 13.97 C ATOM 1436 OD1 ASN A 96 12.391 47.951 68.999 1.00 14.44 O ATOM 1437 ND2 ASN A 96 11.123 49.464 70.101 1.00 16.99 N ATOM 1438 HA ASN A 96 13.047 46.364 71.243 1.00 0.00 H ATOM 1439 HB2 ASN A 96 12.378 48.602 72.127 1.00 0.00 H ATOM 1440 HB3 ASN A 96 13.736 49.324 71.231 1.00 0.00 H ATOM 1441 HD22 ASN A 96 10.961 49.997 70.979 1.00 0.00 H ATOM 1442 HD21 ASN A 96 10.486 49.594 69.289 1.00 0.00 H ATOM 1443 H ASN A 96 15.340 47.712 72.698 1.00 0.00 H ATOM 1444 N PRO A 97 14.811 45.951 69.476 1.00 12.44 N ATOM 1445 CA PRO A 97 15.807 45.781 68.401 1.00 12.24 C ATOM 1446 C PRO A 97 15.761 46.819 67.293 1.00 11.42 C ATOM 1447 O PRO A 97 16.721 46.929 66.532 1.00 11.41 O ATOM 1448 CB PRO A 97 15.500 44.388 67.847 1.00 14.93 C ATOM 1449 CG PRO A 97 14.933 43.656 69.019 1.00 16.84 C ATOM 1450 CD PRO A 97 14.025 44.720 69.680 1.00 14.94 C ATOM 1451 HA PRO A 97 16.812 45.905 68.804 1.00 0.00 H ATOM 1452 HD3 PRO A 97 13.056 44.780 69.184 1.00 0.00 H ATOM 1453 HD2 PRO A 97 13.877 44.514 70.740 1.00 0.00 H ATOM 1454 HG3 PRO A 97 15.721 43.334 69.700 1.00 0.00 H ATOM 1455 HG2 PRO A 97 14.354 42.790 68.699 1.00 0.00 H ATOM 1456 HB2 PRO A 97 14.775 44.444 67.035 1.00 0.00 H ATOM 1457 HB3 PRO A 97 16.408 43.903 67.488 1.00 0.00 H ATOM 1458 N ARG A 98 14.659 47.567 67.215 1.00 11.69 N ATOM 1459 CA ARG A 98 14.475 48.607 66.190 1.00 11.72 C ATOM 1460 C ARG A 98 14.965 49.978 66.618 1.00 10.98 C ATOM 1461 O ARG A 98 14.813 50.926 65.866 1.00 11.08 O ATOM 1462 CB ARG A 98 12.990 48.729 65.796 1.00 14.30 C ATOM 1463 CG ARG A 98 12.293 47.452 65.357 1.00 17.95 C ATOM 1464 CD ARG A 98 12.735 47.085 63.951 1.00 18.05 C ATOM 1465 NE ARG A 98 12.419 48.117 62.944 1.00 18.34 N ATOM 1466 CZ ARG A 98 12.900 48.106 61.697 1.00 17.99 C ATOM 1467 NH1 ARG A 98 13.679 47.096 61.296 1.00 19.30 N ATOM 1468 NH2 ARG A 98 12.627 49.108 60.869 1.00 18.42 N ATOM 1469 HA ARG A 98 15.079 48.283 65.343 1.00 0.00 H ATOM 1470 HB2 ARG A 98 12.450 49.120 66.658 1.00 0.00 H ATOM 1471 HB3 ARG A 98 12.924 49.441 64.974 1.00 0.00 H ATOM 1472 HG2 ARG A 98 12.552 46.644 66.041 1.00 0.00 H ATOM 1473 HG3 ARG A 98 11.214 47.605 65.370 1.00 0.00 H ATOM 1474 HD2 ARG A 98 12.237 46.159 63.664 1.00 0.00 H ATOM 1475 HD3 ARG A 98 13.814 46.929 63.958 1.00 0.00 H ATOM 1476 HE ARG A 98 11.787 48.896 63.220 1.00 0.00 H ATOM 1477 HH12 ARG A 98 14.056 47.083 60.327 1.00 0.00 H ATOM 1478 HH11 ARG A 98 13.908 46.323 61.953 1.00 0.00 H ATOM 1479 HH22 ARG A 98 13.002 49.098 59.899 1.00 0.00 H ATOM 1480 HH21 ARG A 98 12.038 49.903 61.191 1.00 0.00 H ATOM 1481 H ARG A 98 13.899 47.409 67.907 1.00 0.00 H ATOM 1482 N VAL A 99 15.589 50.045 67.800 1.00 9.69 N ATOM 1483 CA VAL A 99 16.066 51.330 68.346 1.00 10.17 C ATOM 1484 C VAL A 99 17.576 51.207 68.602 1.00 9.98 C ATOM 1485 O VAL A 99 18.010 50.285 69.305 1.00 10.89 O ATOM 1486 CB VAL A 99 15.342 51.644 69.654 1.00 11.57 C ATOM 1487 CG1 VAL A 99 15.940 52.927 70.269 1.00 12.91 C ATOM 1488 CG2 VAL A 99 13.844 51.775 69.381 1.00 12.88 C ATOM 1489 HA VAL A 99 15.865 52.136 67.640 1.00 0.00 H ATOM 1490 HB VAL A 99 15.477 50.838 70.375 1.00 0.00 H ATOM 1491 HG11 VAL A 99 17.001 52.774 70.465 1.00 0.00 H ATOM 1492 HG12 VAL A 99 15.814 53.755 69.572 1.00 0.00 H ATOM 1493 HG13 VAL A 99 15.426 53.155 71.203 1.00 0.00 H ATOM 1494 HG21 VAL A 99 13.675 52.581 68.666 1.00 0.00 H ATOM 1495 HG22 VAL A 99 13.468 50.838 68.970 1.00 0.00 H ATOM 1496 HG23 VAL A 99 13.324 51.999 70.313 1.00 0.00 H ATOM 1497 H VAL A 99 15.741 49.173 68.345 1.00 0.00 H ATOM 1498 N GLY A 100 18.337 52.136 68.027 1.00 9.18 N ATOM 1499 CA GLY A 100 19.781 52.089 68.067 1.00 9.23 C ATOM 1500 C GLY A 100 20.419 53.366 68.597 1.00 8.92 C ATOM 1501 O GLY A 100 19.736 54.324 68.963 1.00 9.06 O ATOM 1502 HA3 GLY A 100 20.148 51.914 67.056 1.00 0.00 H ATOM 1503 HA2 GLY A 100 20.081 51.261 68.709 1.00 0.00 H ATOM 1504 H GLY A 100 17.875 52.925 67.531 1.00 0.00 H ATOM 1505 N LEU A 101 21.758 53.357 68.635 1.00 9.40 N ATOM 1506 CA LEU A 101 22.522 54.476 69.162 1.00 9.62 C ATOM 1507 C LEU A 101 23.837 54.553 68.395 1.00 8.23 C ATOM 1508 O LEU A 101 24.604 53.562 68.355 1.00 10.07 O ATOM 1509 CB LEU A 101 22.798 54.271 70.653 1.00 11.15 C ATOM 1510 CG LEU A 101 23.494 55.422 71.371 1.00 14.01 C ATOM 1511 CD1 LEU A 101 24.962 55.270 71.183 1.00 15.31 C ATOM 1512 CD2 LEU A 101 23.036 56.794 70.960 1.00 15.50 C ATOM 1513 HA LEU A 101 21.960 55.402 69.044 1.00 0.00 H ATOM 1514 HB2 LEU A 101 21.842 54.098 71.148 1.00 0.00 H ATOM 1515 HB3 LEU A 101 23.425 53.385 70.757 1.00 0.00 H ATOM 1516 HG LEU A 101 23.221 55.355 72.424 1.00 0.00 H ATOM 1517 HD21 LEU A 101 23.219 56.933 69.894 1.00 0.00 H ATOM 1518 HD22 LEU A 101 21.970 56.896 71.163 1.00 0.00 H ATOM 1519 HD23 LEU A 101 23.588 57.545 71.525 1.00 0.00 H ATOM 1520 HD11 LEU A 101 25.284 54.317 71.603 1.00 0.00 H ATOM 1521 HD12 LEU A 101 25.195 55.297 70.119 1.00 0.00 H ATOM 1522 HD13 LEU A 101 25.478 56.085 71.690 1.00 0.00 H ATOM 1523 H LEU A 101 22.267 52.524 68.276 1.00 0.00 H ATOM 1524 N ILE A 102 24.081 55.715 67.793 1.00 7.97 N ATOM 1525 CA ILE A 102 25.346 55.968 67.088 1.00 7.46 C ATOM 1526 C ILE A 102 25.868 57.305 67.581 1.00 8.24 C ATOM 1527 O ILE A 102 25.295 58.363 67.294 1.00 8.68 O ATOM 1528 CB ILE A 102 25.183 55.991 65.541 1.00 8.74 C ATOM 1529 CG1 ILE A 102 24.569 54.668 65.052 1.00 9.55 C ATOM 1530 CG2 ILE A 102 26.535 56.232 64.892 1.00 9.62 C ATOM 1531 CD1 ILE A 102 24.188 54.663 63.565 1.00 12.21 C ATOM 1532 HA ILE A 102 26.042 55.157 67.301 1.00 0.00 H ATOM 1533 HB ILE A 102 24.510 56.800 65.259 1.00 0.00 H ATOM 1534 HG12 ILE A 102 25.293 53.871 65.222 1.00 0.00 H ATOM 1535 HG13 ILE A 102 23.670 54.471 65.636 1.00 0.00 H ATOM 1536 HD11 ILE A 102 23.454 55.446 63.377 1.00 0.00 H ATOM 1537 HD12 ILE A 102 25.078 54.845 62.963 1.00 0.00 H ATOM 1538 HD13 ILE A 102 23.763 53.694 63.303 1.00 0.00 H ATOM 1539 HG21 ILE A 102 26.933 57.189 65.230 1.00 0.00 H ATOM 1540 HG22 ILE A 102 27.220 55.432 65.174 1.00 0.00 H ATOM 1541 HG23 ILE A 102 26.419 56.248 63.808 1.00 0.00 H ATOM 1542 H ILE A 102 23.359 56.463 67.822 1.00 0.00 H ATOM 1543 N ALA A 103 26.907 57.249 68.413 1.00 8.09 N ATOM 1544 CA ALA A 103 27.373 58.476 69.056 1.00 9.18 C ATOM 1545 C ALA A 103 28.828 58.344 69.363 1.00 9.38 C ATOM 1546 O ALA A 103 29.244 57.267 69.804 1.00 11.00 O ATOM 1547 CB ALA A 103 26.583 58.737 70.326 1.00 10.69 C ATOM 1548 HA ALA A 103 27.222 59.320 68.383 1.00 0.00 H ATOM 1549 HB1 ALA A 103 25.526 58.842 70.080 1.00 0.00 H ATOM 1550 HB2 ALA A 103 26.716 57.901 71.013 1.00 0.00 H ATOM 1551 HB3 ALA A 103 26.942 59.654 70.793 1.00 0.00 H ATOM 1552 H ALA A 103 27.381 56.343 68.603 1.00 0.00 H ATOM 1553 N GLY A 104 29.579 59.406 69.140 1.00 9.26 N ATOM 1554 CA GLY A 104 31.021 59.326 69.253 1.00 10.43 C ATOM 1555 C GLY A 104 31.688 60.520 69.878 1.00 10.35 C ATOM 1556 O GLY A 104 31.056 61.459 70.316 1.00 11.93 O ATOM 1557 HA3 GLY A 104 31.430 59.199 68.251 1.00 0.00 H ATOM 1558 HA2 GLY A 104 31.263 58.451 69.857 1.00 0.00 H ATOM 1559 H GLY A 104 29.132 60.308 68.881 1.00 0.00 H ATOM 1560 N SER A 105 33.012 60.449 69.947 1.00 10.87 N ATOM 1561 CA SER A 105 33.825 61.542 70.391 1.00 10.98 C ATOM 1562 C SER A 105 34.998 61.640 69.431 1.00 10.48 C ATOM 1563 O SER A 105 35.385 60.670 68.767 1.00 12.97 O ATOM 1564 CB SER A 105 34.317 61.295 71.827 1.00 12.12 C ATOM 1565 OG SER A 105 35.083 62.355 72.314 1.00 16.37 O ATOM 1566 HA SER A 105 33.257 62.472 70.400 1.00 0.00 H ATOM 1567 HB2 SER A 105 34.923 60.389 71.839 1.00 0.00 H ATOM 1568 HB3 SER A 105 33.452 61.160 72.476 1.00 0.00 H ATOM 1569 HG SER A 105 34.538 63.182 72.314 1.00 0.00 H ATOM 1570 H SER A 105 33.479 59.563 69.667 1.00 0.00 H ATOM 1571 N GLY A 106 35.605 62.811 69.380 1.00 11.09 N ATOM 1572 CA GLY A 106 36.793 62.972 68.555 1.00 12.44 C ATOM 1573 C GLY A 106 38.063 62.413 69.176 1.00 12.22 C ATOM 1574 O GLY A 106 38.963 61.963 68.447 1.00 12.76 O ATOM 1575 HA3 GLY A 106 36.941 64.036 68.372 1.00 0.00 H ATOM 1576 HA2 GLY A 106 36.623 62.462 67.607 1.00 0.00 H ATOM 1577 H GLY A 106 35.236 63.615 69.927 1.00 0.00 H ATOM 1578 N GLY A 107 38.157 62.519 70.501 1.00 16.55 N ATOM 1579 CA GLY A 107 39.377 62.168 71.211 1.00 16.71 C ATOM 1580 C GLY A 107 39.252 61.028 72.199 1.00 17.35 C ATOM 1581 O GLY A 107 40.258 60.589 72.754 1.00 18.52 O ATOM 1582 HA3 GLY A 107 39.714 63.050 71.756 1.00 0.00 H ATOM 1583 HA2 GLY A 107 40.128 61.891 70.471 1.00 0.00 H ATOM 1584 H GLY A 107 37.337 62.861 71.041 1.00 0.00 H ATOM 1585 N GLY A 108 38.037 60.548 72.440 1.00 16.73 N ATOM 1586 CA GLY A 108 37.836 59.524 73.480 1.00 18.39 C ATOM 1587 C GLY A 108 37.998 60.158 74.849 1.00 16.23 C ATOM 1588 O GLY A 108 37.245 61.076 75.201 1.00 17.50 O ATOM 1589 HA3 GLY A 108 38.573 58.730 73.357 1.00 0.00 H ATOM 1590 HA2 GLY A 108 36.834 59.105 73.389 1.00 0.00 H ATOM 1591 H GLY A 108 37.224 60.896 71.892 1.00 0.00 H ATOM 1592 N SER A 109 38.936 59.662 75.659 1.00 14.67 N ATOM 1593 CA SER A 109 39.297 60.383 76.874 1.00 12.37 C ATOM 1594 C SER A 109 40.801 60.453 77.074 1.00 12.07 C ATOM 1595 O SER A 109 41.391 59.575 77.721 1.00 12.11 O ATOM 1596 CB SER A 109 38.663 59.780 78.139 1.00 12.17 C ATOM 1597 OG SER A 109 39.024 60.584 79.264 1.00 12.04 O ATOM 1598 HA SER A 109 38.902 61.388 76.729 1.00 0.00 H ATOM 1599 HB2 SER A 109 39.028 58.763 78.283 1.00 0.00 H ATOM 1600 HB3 SER A 109 37.578 59.764 78.033 1.00 0.00 H ATOM 1601 HG SER A 109 38.692 61.507 79.129 1.00 0.00 H ATOM 1602 H SER A 109 39.407 58.765 75.424 1.00 0.00 H ATOM 1603 N PRO A 110 41.441 61.498 76.532 1.00 12.23 N ATOM 1604 CA PRO A 110 42.843 61.721 76.840 1.00 12.85 C ATOM 1605 C PRO A 110 43.065 61.788 78.342 1.00 11.67 C ATOM 1606 O PRO A 110 44.053 61.253 78.843 1.00 12.62 O ATOM 1607 CB PRO A 110 43.137 63.064 76.149 1.00 14.79 C ATOM 1608 CG PRO A 110 42.174 63.067 74.968 1.00 17.03 C ATOM 1609 CD PRO A 110 40.931 62.437 75.507 1.00 14.84 C ATOM 1610 HA PRO A 110 43.500 60.922 76.497 1.00 0.00 H ATOM 1611 HD3 PRO A 110 40.276 63.185 75.954 1.00 0.00 H ATOM 1612 HD2 PRO A 110 40.391 61.905 74.724 1.00 0.00 H ATOM 1613 HG3 PRO A 110 42.576 62.483 74.140 1.00 0.00 H ATOM 1614 HG2 PRO A 110 41.977 64.085 74.632 1.00 0.00 H ATOM 1615 HB2 PRO A 110 42.937 63.900 76.819 1.00 0.00 H ATOM 1616 HB3 PRO A 110 44.172 63.111 75.810 1.00 0.00 H ATOM 1617 N ARG A 111 42.131 62.390 79.079 1.00 10.83 N ATOM 1618 CA ARG A 111 42.289 62.463 80.516 1.00 10.66 C ATOM 1619 C ARG A 111 42.418 61.098 81.144 1.00 11.20 C ATOM 1620 O ARG A 111 43.311 60.883 81.974 1.00 11.86 O ATOM 1621 CB ARG A 111 41.145 63.259 81.160 1.00 11.57 C ATOM 1622 CG ARG A 111 41.220 63.207 82.680 1.00 11.92 C ATOM 1623 CD ARG A 111 40.596 64.438 83.322 1.00 12.73 C ATOM 1624 NE ARG A 111 41.460 65.601 83.102 1.00 13.09 N ATOM 1625 CZ ARG A 111 41.087 66.872 83.233 1.00 14.07 C ATOM 1626 NH1 ARG A 111 39.853 67.194 83.605 1.00 15.64 N ATOM 1627 NH2 ARG A 111 41.970 67.819 82.979 1.00 15.11 N ATOM 1628 HA ARG A 111 43.222 62.993 80.706 1.00 0.00 H ATOM 1629 HB2 ARG A 111 41.209 64.298 80.837 1.00 0.00 H ATOM 1630 HB3 ARG A 111 40.193 62.837 80.837 1.00 0.00 H ATOM 1631 HG2 ARG A 111 40.690 62.321 83.029 1.00 0.00 H ATOM 1632 HG3 ARG A 111 42.266 63.145 82.980 1.00 0.00 H ATOM 1633 HD2 ARG A 111 40.480 64.269 84.393 1.00 0.00 H ATOM 1634 HD3 ARG A 111 39.618 64.623 82.877 1.00 0.00 H ATOM 1635 HE ARG A 111 42.444 65.418 82.821 1.00 0.00 H ATOM 1636 HH12 ARG A 111 39.583 68.194 83.701 1.00 0.00 H ATOM 1637 HH11 ARG A 111 39.157 66.446 83.800 1.00 0.00 H ATOM 1638 HH22 ARG A 111 41.702 68.819 83.074 1.00 0.00 H ATOM 1639 HH21 ARG A 111 42.934 67.565 82.683 1.00 0.00 H ATOM 1640 H ARG A 111 41.293 62.805 78.624 1.00 0.00 H ATOM 1641 N PHE A 112 41.545 60.168 80.783 1.00 11.19 N ATOM 1642 CA PHE A 112 41.625 58.832 81.401 1.00 11.76 C ATOM 1643 C PHE A 112 42.706 57.935 80.823 1.00 12.30 C ATOM 1644 O PHE A 112 43.226 57.078 81.553 1.00 13.82 O ATOM 1645 CB PHE A 112 40.241 58.186 81.479 1.00 11.77 C ATOM 1646 CG PHE A 112 39.485 58.732 82.612 1.00 12.35 C ATOM 1647 CD1 PHE A 112 39.816 58.309 83.894 1.00 14.65 C ATOM 1648 CD2 PHE A 112 38.562 59.770 82.448 1.00 14.35 C ATOM 1649 CE1 PHE A 112 39.210 58.859 85.003 1.00 16.30 C ATOM 1650 CE2 PHE A 112 37.938 60.336 83.566 1.00 16.88 C ATOM 1651 CZ PHE A 112 38.258 59.870 84.856 1.00 16.88 C ATOM 1652 HA PHE A 112 41.964 58.978 82.427 1.00 0.00 H ATOM 1653 HB2 PHE A 112 39.698 58.386 80.555 1.00 0.00 H ATOM 1654 HB3 PHE A 112 40.353 57.109 81.607 1.00 0.00 H ATOM 1655 HD2 PHE A 112 38.328 60.138 81.449 1.00 0.00 H ATOM 1656 HE2 PHE A 112 37.207 61.135 83.439 1.00 0.00 H ATOM 1657 HZ PHE A 112 37.767 60.295 85.732 1.00 0.00 H ATOM 1658 HE1 PHE A 112 39.475 58.503 85.999 1.00 0.00 H ATOM 1659 HD1 PHE A 112 40.567 57.530 84.024 1.00 0.00 H ATOM 1660 H PHE A 112 40.814 60.378 80.074 1.00 0.00 H ATOM 1661 N GLN A 113 43.096 58.155 79.560 1.00 12.78 N ATOM 1662 CA GLN A 113 44.272 57.438 79.045 1.00 13.98 C ATOM 1663 C GLN A 113 45.489 57.823 79.901 1.00 13.73 C ATOM 1664 O GLN A 113 46.286 56.969 80.339 1.00 14.06 O ATOM 1665 CB GLN A 113 44.566 57.782 77.570 1.00 15.02 C ATOM 1666 CG GLN A 113 43.551 57.378 76.446 1.00 20.26 C ATOM 1667 CD GLN A 113 43.862 58.160 75.099 1.00 21.13 C ATOM 1668 OE1 GLN A 113 43.260 59.161 74.800 1.00 27.51 O ATOM 1669 NE2 GLN A 113 44.817 57.727 74.388 1.00 23.80 N ATOM 1670 HA GLN A 113 44.069 56.368 79.099 1.00 0.00 H ATOM 1671 HB2 GLN A 113 44.678 58.865 77.517 1.00 0.00 H ATOM 1672 HB3 GLN A 113 45.515 57.307 77.321 1.00 0.00 H ATOM 1673 HG2 GLN A 113 43.627 56.306 76.263 1.00 0.00 H ATOM 1674 HG3 GLN A 113 42.540 57.618 76.774 1.00 0.00 H ATOM 1675 HE22 GLN A 113 45.321 56.861 74.666 1.00 0.00 H ATOM 1676 HE21 GLN A 113 45.097 58.237 73.526 1.00 0.00 H ATOM 1677 H GLN A 113 42.576 58.821 78.954 1.00 0.00 H ATOM 1678 N VAL A 114 45.649 59.116 80.152 1.00 12.24 N ATOM 1679 CA VAL A 114 46.771 59.623 80.948 1.00 12.14 C ATOM 1680 C VAL A 114 46.616 59.195 82.405 1.00 12.36 C ATOM 1681 O VAL A 114 47.593 58.813 83.047 1.00 14.68 O ATOM 1682 CB VAL A 114 46.831 61.153 80.792 1.00 11.72 C ATOM 1683 CG1 VAL A 114 47.867 61.757 81.766 1.00 13.28 C ATOM 1684 CG2 VAL A 114 47.211 61.495 79.349 1.00 12.13 C ATOM 1685 HA VAL A 114 47.713 59.204 80.595 1.00 0.00 H ATOM 1686 HB VAL A 114 45.854 61.575 81.026 1.00 0.00 H ATOM 1687 HG11 VAL A 114 47.584 61.516 82.791 1.00 0.00 H ATOM 1688 HG12 VAL A 114 48.851 61.340 81.552 1.00 0.00 H ATOM 1689 HG13 VAL A 114 47.894 62.839 81.640 1.00 0.00 H ATOM 1690 HG21 VAL A 114 48.185 61.064 79.119 1.00 0.00 H ATOM 1691 HG22 VAL A 114 46.462 61.086 78.671 1.00 0.00 H ATOM 1692 HG23 VAL A 114 47.255 62.578 79.233 1.00 0.00 H ATOM 1693 H VAL A 114 44.956 59.792 79.772 1.00 0.00 H ATOM 1694 N PHE A 115 45.398 59.212 82.945 1.00 13.05 N ATOM 1695 CA PHE A 115 45.185 58.763 84.307 1.00 13.28 C ATOM 1696 C PHE A 115 45.661 57.320 84.466 1.00 12.62 C ATOM 1697 O PHE A 115 46.329 57.001 85.463 1.00 13.87 O ATOM 1698 CB PHE A 115 43.694 58.836 84.672 1.00 15.15 C ATOM 1699 CG PHE A 115 43.358 58.103 85.941 1.00 15.25 C ATOM 1700 CD1 PHE A 115 43.523 58.728 87.172 1.00 17.45 C ATOM 1701 CD2 PHE A 115 42.895 56.791 85.912 1.00 15.08 C ATOM 1702 CE1 PHE A 115 43.255 58.037 88.362 1.00 19.73 C ATOM 1703 CE2 PHE A 115 42.618 56.106 87.092 1.00 16.19 C ATOM 1704 CZ PHE A 115 42.809 56.720 88.300 1.00 18.23 C ATOM 1705 HA PHE A 115 45.753 59.415 84.971 1.00 0.00 H ATOM 1706 HB2 PHE A 115 43.418 59.883 84.793 1.00 0.00 H ATOM 1707 HB3 PHE A 115 43.116 58.401 83.857 1.00 0.00 H ATOM 1708 HD2 PHE A 115 42.747 56.293 84.953 1.00 0.00 H ATOM 1709 HE2 PHE A 115 42.249 55.081 87.054 1.00 0.00 H ATOM 1710 HZ PHE A 115 42.610 56.173 89.222 1.00 0.00 H ATOM 1711 HE1 PHE A 115 43.395 58.526 89.326 1.00 0.00 H ATOM 1712 HD1 PHE A 115 43.863 59.763 87.212 1.00 0.00 H ATOM 1713 H PHE A 115 44.591 59.551 82.383 1.00 0.00 H ATOM 1714 N GLY A 116 45.318 56.453 83.515 1.00 12.93 N ATOM 1715 CA GLY A 116 45.684 55.028 83.639 1.00 12.01 C ATOM 1716 C GLY A 116 47.190 54.884 83.661 1.00 11.31 C ATOM 1717 O GLY A 116 47.761 54.139 84.470 1.00 11.33 O ATOM 1718 HA3 GLY A 116 45.280 54.475 82.791 1.00 0.00 H ATOM 1719 HA2 GLY A 116 45.269 54.627 84.563 1.00 0.00 H ATOM 1720 H GLY A 116 44.790 56.781 82.681 1.00 0.00 H ATOM 1721 N ALA A 117 47.862 55.563 82.734 1.00 11.01 N ATOM 1722 CA ALA A 117 49.330 55.465 82.637 1.00 11.23 C ATOM 1723 C ALA A 117 50.000 56.057 83.866 1.00 10.69 C ATOM 1724 O ALA A 117 51.006 55.511 84.367 1.00 11.39 O ATOM 1725 CB ALA A 117 49.859 56.171 81.366 1.00 13.55 C ATOM 1726 HA ALA A 117 49.577 54.405 82.576 1.00 0.00 H ATOM 1727 HB1 ALA A 117 49.421 55.704 80.484 1.00 0.00 H ATOM 1728 HB2 ALA A 117 49.583 57.225 81.396 1.00 0.00 H ATOM 1729 HB3 ALA A 117 50.944 56.079 81.326 1.00 0.00 H ATOM 1730 H ALA A 117 47.344 56.172 82.068 1.00 0.00 H ATOM 1731 N ASP A 118 49.465 57.159 84.381 1.00 10.69 N ATOM 1732 CA ASP A 118 50.075 57.792 85.574 1.00 11.65 C ATOM 1733 C ASP A 118 49.886 56.854 86.768 1.00 10.80 C ATOM 1734 O ASP A 118 50.830 56.629 87.537 1.00 12.20 O ATOM 1735 CB ASP A 118 49.369 59.119 85.884 1.00 11.98 C ATOM 1736 CG ASP A 118 49.793 60.264 84.974 1.00 13.19 C ATOM 1737 OD1 ASP A 118 50.712 60.103 84.123 1.00 13.23 O ATOM 1738 OD2 ASP A 118 49.174 61.360 85.108 1.00 14.18 O ATOM 1739 HA ASP A 118 51.132 57.979 85.386 1.00 0.00 H ATOM 1740 HB2 ASP A 118 48.295 58.972 85.774 1.00 0.00 H ATOM 1741 HB3 ASP A 118 49.593 59.396 86.914 1.00 0.00 H ATOM 1742 H ASP A 118 48.618 57.577 83.947 1.00 0.00 H ATOM 1743 N ALA A 119 48.685 56.300 86.923 1.00 11.11 N ATOM 1744 CA ALA A 119 48.386 55.375 88.028 1.00 11.67 C ATOM 1745 C ALA A 119 49.261 54.142 87.977 1.00 11.38 C ATOM 1746 O ALA A 119 49.769 53.682 89.008 1.00 11.49 O ATOM 1747 CB ALA A 119 46.914 54.950 87.970 1.00 12.68 C ATOM 1748 HA ALA A 119 48.589 55.901 88.961 1.00 0.00 H ATOM 1749 HB1 ALA A 119 46.279 55.832 88.057 1.00 0.00 H ATOM 1750 HB2 ALA A 119 46.718 54.452 87.021 1.00 0.00 H ATOM 1751 HB3 ALA A 119 46.702 54.266 88.791 1.00 0.00 H ATOM 1752 H ALA A 119 47.934 56.528 86.241 1.00 0.00 H ATOM 1753 N MET A 120 49.462 53.607 86.779 1.00 10.70 N ATOM 1754 CA MET A 120 50.224 52.386 86.648 1.00 11.59 C ATOM 1755 C MET A 120 51.677 52.612 87.071 1.00 12.07 C ATOM 1756 O MET A 120 52.298 51.690 87.600 1.00 14.31 O ATOM 1757 CB MET A 120 50.168 51.940 85.194 1.00 13.32 C ATOM 1758 CG MET A 120 50.769 50.568 85.000 1.00 14.12 C ATOM 1759 SD MET A 120 49.810 49.335 85.886 1.00 14.72 S ATOM 1760 CE MET A 120 50.998 48.024 86.039 1.00 19.09 C ATOM 1761 HA MET A 120 49.800 51.617 87.294 1.00 0.00 H ATOM 1762 HB2 MET A 120 49.127 51.917 84.872 1.00 0.00 H ATOM 1763 HB3 MET A 120 50.720 52.656 84.584 1.00 0.00 H ATOM 1764 HG2 MET A 120 51.792 50.567 85.377 1.00 0.00 H ATOM 1765 HG3 MET A 120 50.774 50.324 83.938 1.00 0.00 H ATOM 1766 HE1 MET A 120 51.310 47.701 85.046 1.00 0.00 H ATOM 1767 HE2 MET A 120 51.864 48.383 86.595 1.00 0.00 H ATOM 1768 HE3 MET A 120 50.546 47.186 86.570 1.00 0.00 H ATOM 1769 H MET A 120 49.070 54.067 85.933 1.00 0.00 H ATOM 1770 N ARG A 121 52.189 53.839 86.899 1.00 11.07 N ATOM 1771 CA ARG A 121 53.574 54.194 87.224 1.00 11.24 C ATOM 1772 C ARG A 121 53.769 54.596 88.684 1.00 11.37 C ATOM 1773 O ARG A 121 54.900 54.851 89.104 1.00 13.92 O ATOM 1774 CB ARG A 121 54.037 55.317 86.287 1.00 12.36 C ATOM 1775 CG ARG A 121 54.196 54.769 84.847 1.00 11.47 C ATOM 1776 CD ARG A 121 54.628 55.827 83.833 1.00 12.35 C ATOM 1777 NE ARG A 121 53.567 56.813 83.609 1.00 12.02 N ATOM 1778 CZ ARG A 121 53.664 57.809 82.725 1.00 11.59 C ATOM 1779 NH1 ARG A 121 54.759 57.917 81.989 1.00 13.94 N ATOM 1780 NH2 ARG A 121 52.676 58.671 82.572 1.00 12.80 N ATOM 1781 HA ARG A 121 54.184 53.302 87.077 1.00 0.00 H ATOM 1782 HB2 ARG A 121 53.298 56.118 86.290 1.00 0.00 H ATOM 1783 HB3 ARG A 121 54.994 55.706 86.634 1.00 0.00 H ATOM 1784 HG2 ARG A 121 54.946 53.978 84.860 1.00 0.00 H ATOM 1785 HG3 ARG A 121 53.239 54.356 84.528 1.00 0.00 H ATOM 1786 HD2 ARG A 121 54.864 55.338 82.888 1.00 0.00 H ATOM 1787 HD3 ARG A 121 55.515 56.338 84.208 1.00 0.00 H ATOM 1788 HE ARG A 121 52.693 56.733 84.167 1.00 0.00 H ATOM 1789 HH12 ARG A 121 54.846 58.688 81.297 1.00 0.00 H ATOM 1790 HH11 ARG A 121 55.532 57.230 82.103 1.00 0.00 H ATOM 1791 HH22 ARG A 121 52.762 59.443 81.881 1.00 0.00 H ATOM 1792 HH21 ARG A 121 51.812 58.578 83.143 1.00 0.00 H ATOM 1793 H ARG A 121 51.569 54.580 86.514 1.00 0.00 H ATOM 1794 N GLY A 122 52.688 54.596 89.455 1.00 9.70 N ATOM 1795 CA GLY A 122 52.713 54.965 90.862 1.00 11.27 C ATOM 1796 C GLY A 122 52.772 53.734 91.763 1.00 11.44 C ATOM 1797 O GLY A 122 52.862 52.576 91.314 1.00 13.54 O ATOM 1798 HA3 GLY A 122 51.812 55.532 91.096 1.00 0.00 H ATOM 1799 HA2 GLY A 122 53.590 55.584 91.050 1.00 0.00 H ATOM 1800 H GLY A 122 51.779 54.319 89.032 1.00 0.00 H ATOM 1801 N PRO A 123 52.695 53.963 93.080 1.00 12.11 N ATOM 1802 CA PRO A 123 52.947 52.919 94.068 1.00 12.94 C ATOM 1803 C PRO A 123 51.875 51.854 94.171 1.00 13.55 C ATOM 1804 O PRO A 123 52.113 50.802 94.806 1.00 16.10 O ATOM 1805 CB PRO A 123 53.063 53.732 95.382 1.00 13.39 C ATOM 1806 CG PRO A 123 52.172 54.907 95.159 1.00 12.67 C ATOM 1807 CD PRO A 123 52.473 55.283 93.710 1.00 12.82 C ATOM 1808 HA PRO A 123 53.828 52.332 93.807 1.00 0.00 H ATOM 1809 HD3 PRO A 123 51.630 55.802 93.253 1.00 0.00 H ATOM 1810 HD2 PRO A 123 53.363 55.908 93.641 1.00 0.00 H ATOM 1811 HG3 PRO A 123 52.420 55.723 95.837 1.00 0.00 H ATOM 1812 HG2 PRO A 123 51.124 54.636 95.286 1.00 0.00 H ATOM 1813 HB2 PRO A 123 52.722 53.143 96.234 1.00 0.00 H ATOM 1814 HB3 PRO A 123 54.091 54.052 95.551 1.00 0.00 H ATOM 1815 N ARG A 124 50.709 52.115 93.590 1.00 12.79 N ATOM 1816 CA ARG A 124 49.631 51.127 93.659 1.00 13.58 C ATOM 1817 C ARG A 124 49.401 50.395 92.355 1.00 13.58 C ATOM 1818 O ARG A 124 48.604 49.450 92.322 1.00 14.98 O ATOM 1819 CB ARG A 124 48.300 51.769 94.079 1.00 14.88 C ATOM 1820 CG ARG A 124 48.361 52.452 95.459 1.00 17.26 C ATOM 1821 CD ARG A 124 47.028 52.978 95.813 1.00 19.80 C ATOM 1822 NE ARG A 124 46.091 51.900 96.068 1.00 22.55 N ATOM 1823 CZ ARG A 124 44.789 51.994 95.843 1.00 24.77 C ATOM 1824 NH1 ARG A 124 44.277 53.103 95.300 1.00 27.36 N ATOM 1825 NH2 ARG A 124 44.007 50.974 96.138 1.00 27.49 N ATOM 1826 HA ARG A 124 49.964 50.409 94.409 1.00 0.00 H ATOM 1827 HB2 ARG A 124 48.026 52.517 93.335 1.00 0.00 H ATOM 1828 HB3 ARG A 124 47.536 50.992 94.111 1.00 0.00 H ATOM 1829 HG2 ARG A 124 48.676 51.726 96.209 1.00 0.00 H ATOM 1830 HG3 ARG A 124 49.078 53.273 95.426 1.00 0.00 H ATOM 1831 HD2 ARG A 124 46.655 53.587 94.989 1.00 0.00 H ATOM 1832 HD3 ARG A 124 47.114 53.594 96.708 1.00 0.00 H ATOM 1833 HE ARG A 124 46.461 51.006 96.448 1.00 0.00 H ATOM 1834 HH12 ARG A 124 43.254 53.172 95.125 1.00 0.00 H ATOM 1835 HH11 ARG A 124 44.902 53.897 95.052 1.00 0.00 H ATOM 1836 HH22 ARG A 124 42.983 51.037 95.966 1.00 0.00 H ATOM 1837 HH21 ARG A 124 44.414 50.107 96.543 1.00 0.00 H ATOM 1838 H ARG A 124 50.563 53.015 93.090 1.00 0.00 H ATOM 1839 N GLY A 125 50.079 50.802 91.275 1.00 12.05 N ATOM 1840 CA GLY A 125 49.995 50.027 90.028 1.00 12.21 C ATOM 1841 C GLY A 125 48.553 49.803 89.605 1.00 11.13 C ATOM 1842 O GLY A 125 47.745 50.737 89.525 1.00 12.08 O ATOM 1843 HA3 GLY A 125 50.474 49.060 90.179 1.00 0.00 H ATOM 1844 HA2 GLY A 125 50.515 50.569 89.238 1.00 0.00 H ATOM 1845 H GLY A 125 50.662 51.662 91.318 1.00 0.00 H ATOM 1846 N LEU A 126 48.228 48.545 89.309 1.00 11.59 N ATOM 1847 CA LEU A 126 46.914 48.207 88.768 1.00 11.73 C ATOM 1848 C LEU A 126 45.772 48.570 89.704 1.00 11.66 C ATOM 1849 O LEU A 126 44.662 48.800 89.245 1.00 12.02 O ATOM 1850 CB LEU A 126 46.823 46.694 88.496 1.00 12.20 C ATOM 1851 CG LEU A 126 47.740 46.160 87.385 1.00 13.40 C ATOM 1852 CD1 LEU A 126 47.657 44.614 87.375 1.00 17.22 C ATOM 1853 CD2 LEU A 126 47.399 46.714 85.994 1.00 13.97 C ATOM 1854 HA LEU A 126 46.813 48.788 87.851 1.00 0.00 H ATOM 1855 HB2 LEU A 126 47.076 46.172 89.419 1.00 0.00 H ATOM 1856 HB3 LEU A 126 45.794 46.464 88.220 1.00 0.00 H ATOM 1857 HG LEU A 126 48.753 46.497 87.605 1.00 0.00 H ATOM 1858 HD21 LEU A 126 46.376 46.439 85.736 1.00 0.00 H ATOM 1859 HD22 LEU A 126 47.493 47.800 86.004 1.00 0.00 H ATOM 1860 HD23 LEU A 126 48.086 46.295 85.259 1.00 0.00 H ATOM 1861 HD11 LEU A 126 47.981 44.228 88.341 1.00 0.00 H ATOM 1862 HD12 LEU A 126 46.628 44.308 87.186 1.00 0.00 H ATOM 1863 HD13 LEU A 126 48.304 44.222 86.590 1.00 0.00 H ATOM 1864 H LEU A 126 48.924 47.788 89.466 1.00 0.00 H ATOM 1865 N LYS A 127 46.023 48.578 91.012 1.00 11.85 N ATOM 1866 CA LYS A 127 44.971 48.932 91.957 1.00 13.69 C ATOM 1867 C LYS A 127 44.600 50.419 91.843 1.00 13.81 C ATOM 1868 O LYS A 127 43.444 50.782 92.071 1.00 16.79 O ATOM 1869 CB LYS A 127 45.361 48.560 93.388 1.00 15.46 C ATOM 1870 CG LYS A 127 45.469 47.051 93.562 1.00 18.54 C ATOM 1871 HA LYS A 127 44.085 48.352 91.700 1.00 0.00 H ATOM 1872 HB2 LYS A 127 46.324 49.014 93.622 1.00 0.00 H ATOM 1873 HB3 LYS A 127 44.604 48.943 94.073 1.00 0.00 H ATOM 1874 HG2 LYS A 127 44.507 46.591 93.335 1.00 0.00 H ATOM 1875 HG3 LYS A 127 46.229 46.662 92.884 1.00 0.00 H ATOM 1876 H LYS A 127 46.972 48.331 91.360 1.00 0.00 H ATOM 1877 N ALA A 128 45.566 51.285 91.513 1.00 12.35 N ATOM 1878 CA ALA A 128 45.261 52.697 91.289 1.00 12.62 C ATOM 1879 C ALA A 128 44.562 52.868 89.935 1.00 11.99 C ATOM 1880 O ALA A 128 43.714 53.746 89.790 1.00 13.03 O ATOM 1881 CB ALA A 128 46.536 53.534 91.321 1.00 13.67 C ATOM 1882 HA ALA A 128 44.600 53.040 92.085 1.00 0.00 H ATOM 1883 HB1 ALA A 128 47.016 53.426 92.294 1.00 0.00 H ATOM 1884 HB2 ALA A 128 47.214 53.191 90.540 1.00 0.00 H ATOM 1885 HB3 ALA A 128 46.286 54.581 91.152 1.00 0.00 H ATOM 1886 H ALA A 128 46.545 50.949 91.415 1.00 0.00 H ATOM 1887 N VAL A 129 44.910 52.057 88.928 1.00 11.26 N ATOM 1888 CA VAL A 129 44.247 52.162 87.618 1.00 10.81 C ATOM 1889 C VAL A 129 42.767 51.858 87.823 1.00 12.47 C ATOM 1890 O VAL A 129 41.895 52.615 87.370 1.00 13.29 O ATOM 1891 CB VAL A 129 44.874 51.195 86.592 1.00 11.14 C ATOM 1892 CG1 VAL A 129 44.116 51.246 85.253 1.00 11.95 C ATOM 1893 CG2 VAL A 129 46.335 51.537 86.362 1.00 12.37 C ATOM 1894 HA VAL A 129 44.375 53.167 87.215 1.00 0.00 H ATOM 1895 HB VAL A 129 44.801 50.186 86.998 1.00 0.00 H ATOM 1896 HG11 VAL A 129 43.077 50.960 85.414 1.00 0.00 H ATOM 1897 HG12 VAL A 129 44.158 52.259 84.852 1.00 0.00 H ATOM 1898 HG13 VAL A 129 44.579 50.555 84.548 1.00 0.00 H ATOM 1899 HG21 VAL A 129 46.413 52.556 85.982 1.00 0.00 H ATOM 1900 HG22 VAL A 129 46.878 51.456 87.303 1.00 0.00 H ATOM 1901 HG23 VAL A 129 46.759 50.844 85.635 1.00 0.00 H ATOM 1902 H VAL A 129 45.655 51.346 89.073 1.00 0.00 H ATOM 1903 N GLY A 130 42.479 50.762 88.525 1.00 12.32 N ATOM 1904 CA GLY A 130 41.107 50.362 88.758 1.00 13.06 C ATOM 1905 C GLY A 130 40.469 49.769 87.507 1.00 11.72 C ATOM 1906 O GLY A 130 41.074 49.693 86.447 1.00 12.34 O ATOM 1907 HA3 GLY A 130 40.532 51.235 89.067 1.00 0.00 H ATOM 1908 HA2 GLY A 130 41.087 49.616 89.552 1.00 0.00 H ATOM 1909 H GLY A 130 43.253 50.185 88.912 1.00 0.00 H ATOM 1910 N PRO A 131 39.234 49.276 87.638 1.00 13.72 N ATOM 1911 CA PRO A 131 38.600 48.478 86.583 1.00 14.69 C ATOM 1912 C PRO A 131 37.762 49.255 85.591 1.00 14.25 C ATOM 1913 O PRO A 131 37.114 48.637 84.743 1.00 15.71 O ATOM 1914 CB PRO A 131 37.726 47.529 87.390 1.00 15.62 C ATOM 1915 CG PRO A 131 37.245 48.403 88.514 1.00 17.38 C ATOM 1916 CD PRO A 131 38.438 49.291 88.881 1.00 15.44 C ATOM 1917 HA PRO A 131 39.349 48.011 85.944 1.00 0.00 H ATOM 1918 HD3 PRO A 131 38.116 50.302 89.132 1.00 0.00 H ATOM 1919 HD2 PRO A 131 39.000 48.872 89.716 1.00 0.00 H ATOM 1920 HG3 PRO A 131 36.945 47.795 89.368 1.00 0.00 H ATOM 1921 HG2 PRO A 131 36.402 49.012 88.189 1.00 0.00 H ATOM 1922 HB2 PRO A 131 36.892 47.159 86.794 1.00 0.00 H ATOM 1923 HB3 PRO A 131 38.304 46.685 87.767 1.00 0.00 H ATOM 1924 N TYR A 132 37.791 50.584 85.651 1.00 14.66 N ATOM 1925 CA TYR A 132 36.887 51.368 84.809 1.00 14.65 C ATOM 1926 C TYR A 132 37.554 52.160 83.705 1.00 14.62 C ATOM 1927 O TYR A 132 36.879 52.888 82.984 1.00 16.96 O ATOM 1928 CB TYR A 132 36.072 52.327 85.676 1.00 17.26 C ATOM 1929 CG TYR A 132 35.310 51.633 86.754 1.00 18.36 C ATOM 1930 CD1 TYR A 132 34.311 50.716 86.441 1.00 19.44 C ATOM 1931 CD2 TYR A 132 35.556 51.901 88.084 1.00 20.17 C ATOM 1932 CE1 TYR A 132 33.612 50.069 87.406 1.00 19.70 C ATOM 1933 CE2 TYR A 132 34.841 51.270 89.068 1.00 20.91 C ATOM 1934 CZ TYR A 132 33.869 50.344 88.720 1.00 20.43 C ATOM 1935 OH TYR A 132 33.141 49.683 89.692 1.00 23.33 O ATOM 1936 HA TYR A 132 36.257 50.630 84.313 1.00 0.00 H ATOM 1937 HB3 TYR A 132 35.366 52.858 85.038 1.00 0.00 H ATOM 1938 HB2 TYR A 132 36.753 53.043 86.137 1.00 0.00 H ATOM 1939 HD2 TYR A 132 36.327 52.622 88.355 1.00 0.00 H ATOM 1940 HE2 TYR A 132 35.035 51.494 90.117 1.00 0.00 H ATOM 1941 HE1 TYR A 132 32.852 49.336 87.136 1.00 0.00 H ATOM 1942 HD1 TYR A 132 34.085 50.513 85.394 1.00 0.00 H ATOM 1943 HH TYR A 132 32.648 50.344 90.240 1.00 0.00 H ATOM 1944 H TYR A 132 38.453 51.063 86.294 1.00 0.00 H ATOM 1945 N VAL A 133 38.866 52.038 83.537 1.00 14.09 N ATOM 1946 CA VAL A 133 39.544 52.910 82.585 1.00 13.68 C ATOM 1947 C VAL A 133 39.248 52.564 81.127 1.00 12.77 C ATOM 1948 O VAL A 133 39.211 53.481 80.300 1.00 14.06 O ATOM 1949 CB VAL A 133 41.084 53.006 82.852 1.00 13.16 C ATOM 1950 CG1 VAL A 133 41.789 53.932 81.852 1.00 14.27 C ATOM 1951 CG2 VAL A 133 41.323 53.527 84.264 1.00 15.85 C ATOM 1952 HA VAL A 133 39.123 53.901 82.755 1.00 0.00 H ATOM 1953 HB VAL A 133 41.500 52.005 82.734 1.00 0.00 H ATOM 1954 HG11 VAL A 133 41.643 53.551 80.841 1.00 0.00 H ATOM 1955 HG12 VAL A 133 41.368 54.935 81.928 1.00 0.00 H ATOM 1956 HG13 VAL A 133 42.855 53.965 82.079 1.00 0.00 H ATOM 1957 HG21 VAL A 133 40.873 54.515 84.366 1.00 0.00 H ATOM 1958 HG22 VAL A 133 40.871 52.844 84.983 1.00 0.00 H ATOM 1959 HG23 VAL A 133 42.395 53.593 84.449 1.00 0.00 H ATOM 1960 H VAL A 133 39.403 51.330 84.077 1.00 0.00 H ATOM 1961 N VAL A 134 39.063 51.273 80.796 1.00 13.94 N ATOM 1962 CA VAL A 134 38.782 50.947 79.384 1.00 13.83 C ATOM 1963 C VAL A 134 37.526 51.638 78.886 1.00 12.28 C ATOM 1964 O VAL A 134 37.538 52.225 77.814 1.00 13.50 O ATOM 1965 CB VAL A 134 38.701 49.428 79.118 1.00 13.98 C ATOM 1966 CG1 VAL A 134 38.477 49.186 77.616 1.00 15.67 C ATOM 1967 CG2 VAL A 134 39.979 48.757 79.581 1.00 17.04 C ATOM 1968 HA VAL A 134 39.634 51.327 78.820 1.00 0.00 H ATOM 1969 HB VAL A 134 37.866 49.001 79.674 1.00 0.00 H ATOM 1970 HG11 VAL A 134 37.546 49.661 77.308 1.00 0.00 H ATOM 1971 HG12 VAL A 134 39.307 49.612 77.053 1.00 0.00 H ATOM 1972 HG13 VAL A 134 38.420 48.114 77.427 1.00 0.00 H ATOM 1973 HG21 VAL A 134 40.825 49.175 79.035 1.00 0.00 H ATOM 1974 HG22 VAL A 134 40.112 48.930 80.649 1.00 0.00 H ATOM 1975 HG23 VAL A 134 39.915 47.686 79.390 1.00 0.00 H ATOM 1976 H VAL A 134 39.117 50.524 81.516 1.00 0.00 H ATOM 1977 N THR A 135 36.444 51.600 79.669 1.00 12.52 N ATOM 1978 CA THR A 135 35.207 52.194 79.226 1.00 14.09 C ATOM 1979 C THR A 135 35.303 53.714 79.183 1.00 13.19 C ATOM 1980 O THR A 135 34.602 54.366 78.394 1.00 13.69 O ATOM 1981 CB THR A 135 34.012 51.734 80.068 1.00 15.48 C ATOM 1982 OG1 THR A 135 34.244 52.074 81.435 1.00 16.02 O ATOM 1983 CG2 THR A 135 33.838 50.204 79.930 1.00 18.76 C ATOM 1984 HA THR A 135 35.034 51.843 78.209 1.00 0.00 H ATOM 1985 HB THR A 135 33.105 52.227 79.719 1.00 0.00 H ATOM 1986 HG1 THR A 135 34.351 53.055 81.516 1.00 0.00 H ATOM 1987 HG23 THR A 135 33.661 49.953 78.884 1.00 0.00 H ATOM 1988 HG21 THR A 135 34.742 49.704 80.278 1.00 0.00 H ATOM 1989 HG22 THR A 135 32.988 49.881 80.531 1.00 0.00 H ATOM 1990 H THR A 135 36.494 51.141 80.601 1.00 0.00 H ATOM 1991 N LYS A 136 36.175 54.283 80.004 1.00 12.99 N ATOM 1992 CA LYS A 136 36.378 55.723 79.936 1.00 12.63 C ATOM 1993 C LYS A 136 37.235 56.131 78.741 1.00 13.26 C ATOM 1994 O LYS A 136 36.927 57.144 78.105 1.00 16.32 O ATOM 1995 CB LYS A 136 36.984 56.263 81.224 1.00 12.54 C ATOM 1996 CG LYS A 136 36.104 56.033 82.433 1.00 12.93 C ATOM 1997 CD LYS A 136 36.723 56.593 83.719 1.00 15.58 C ATOM 1998 CE LYS A 136 35.818 56.277 84.897 1.00 16.09 C ATOM 1999 NZ LYS A 136 36.406 56.788 86.196 1.00 18.55 N ATOM 2000 HA LYS A 136 35.390 56.165 79.804 1.00 0.00 H ATOM 2001 HB2 LYS A 136 37.941 55.769 81.392 1.00 0.00 H ATOM 2002 HB3 LYS A 136 37.145 57.335 81.110 1.00 0.00 H ATOM 2003 HG2 LYS A 136 35.143 56.520 82.265 1.00 0.00 H ATOM 2004 HG3 LYS A 136 35.950 54.961 82.556 1.00 0.00 H ATOM 2005 HD2 LYS A 136 37.701 56.139 83.880 1.00 0.00 H ATOM 2006 HD3 LYS A 136 36.836 57.673 83.627 1.00 0.00 H ATOM 2007 HE2 LYS A 136 35.689 55.197 84.966 1.00 0.00 H ATOM 2008 HE3 LYS A 136 34.848 56.748 84.736 1.00 0.00 H ATOM 2009 HZ1 LYS A 136 37.330 56.338 86.358 1.00 0.00 H ATOM 2010 HZ2 LYS A 136 36.527 57.819 86.138 1.00 0.00 H ATOM 2011 HZ3 LYS A 136 35.764 56.556 86.981 1.00 0.00 H ATOM 2012 H LYS A 136 36.707 53.708 80.688 1.00 0.00 H ATOM 2013 N ALA A 137 38.302 55.360 78.468 1.00 13.05 N ATOM 2014 CA ALA A 137 39.364 55.735 77.542 1.00 13.92 C ATOM 2015 C ALA A 137 39.167 55.264 76.114 1.00 13.65 C ATOM 2016 O ALA A 137 39.737 55.849 75.190 1.00 15.77 O ATOM 2017 CB ALA A 137 40.686 55.206 78.033 1.00 15.44 C ATOM 2018 HA ALA A 137 39.341 56.825 77.519 1.00 0.00 H ATOM 2019 HB1 ALA A 137 40.901 55.626 79.016 1.00 0.00 H ATOM 2020 HB2 ALA A 137 40.638 54.119 78.103 1.00 0.00 H ATOM 2021 HB3 ALA A 137 41.472 55.492 77.334 1.00 0.00 H ATOM 2022 H ALA A 137 38.374 54.440 78.947 1.00 0.00 H ATOM 2023 N MET A 138 38.372 54.219 75.916 1.00 11.81 N ATOM 2024 CA MET A 138 38.299 53.591 74.583 1.00 13.22 C ATOM 2025 C MET A 138 37.549 54.532 73.633 1.00 12.43 C ATOM 2026 O MET A 138 36.704 55.342 74.062 1.00 12.74 O ATOM 2027 CB MET A 138 37.654 52.199 74.632 1.00 13.15 C ATOM 2028 CG MET A 138 36.179 52.195 74.987 1.00 14.39 C ATOM 2029 SD MET A 138 35.616 50.514 75.230 1.00 16.40 S ATOM 2030 CE MET A 138 33.850 50.771 75.497 1.00 16.08 C ATOM 2031 HA MET A 138 39.312 53.435 74.211 1.00 0.00 H ATOM 2032 HB2 MET A 138 37.769 51.737 73.652 1.00 0.00 H ATOM 2033 HB3 MET A 138 38.184 51.605 75.376 1.00 0.00 H ATOM 2034 HG2 MET A 138 35.611 52.653 74.178 1.00 0.00 H ATOM 2035 HG3 MET A 138 36.026 52.764 75.904 1.00 0.00 H ATOM 2036 HE1 MET A 138 33.705 51.408 76.370 1.00 0.00 H ATOM 2037 HE2 MET A 138 33.417 51.251 74.619 1.00 0.00 H ATOM 2038 HE3 MET A 138 33.365 49.809 75.663 1.00 0.00 H ATOM 2039 H MET A 138 37.801 53.843 76.700 1.00 0.00 H ATOM 2040 N ALA A 139 37.825 54.391 72.338 1.00 11.85 N ATOM 2041 CA ALA A 139 37.262 55.295 71.346 1.00 12.32 C ATOM 2042 C ALA A 139 35.728 55.211 71.305 1.00 11.17 C ATOM 2043 O ALA A 139 35.058 56.194 71.014 1.00 13.49 O ATOM 2044 CB ALA A 139 37.890 54.997 69.957 1.00 14.71 C ATOM 2045 HA ALA A 139 37.506 56.319 71.629 1.00 0.00 H ATOM 2046 HB1 ALA A 139 38.969 55.141 70.009 1.00 0.00 H ATOM 2047 HB2 ALA A 139 37.673 53.967 69.675 1.00 0.00 H ATOM 2048 HB3 ALA A 139 37.467 55.675 69.216 1.00 0.00 H ATOM 2049 H ALA A 139 38.454 53.622 72.030 1.00 0.00 H ATOM 2050 N SER A 140 35.181 54.046 71.641 1.00 10.35 N ATOM 2051 CA SER A 140 33.722 53.841 71.624 1.00 9.88 C ATOM 2052 C SER A 140 33.082 54.104 72.982 1.00 9.67 C ATOM 2053 O SER A 140 31.926 53.760 73.191 1.00 11.20 O ATOM 2054 CB SER A 140 33.413 52.410 71.209 1.00 11.33 C ATOM 2055 OG SER A 140 33.970 51.538 72.165 1.00 11.78 O ATOM 2056 HA SER A 140 33.306 54.553 70.911 1.00 0.00 H ATOM 2057 HB2 SER A 140 33.847 52.209 70.230 1.00 0.00 H ATOM 2058 HB3 SER A 140 32.334 52.265 71.163 1.00 0.00 H ATOM 2059 HG SER A 140 34.950 51.675 72.204 1.00 0.00 H ATOM 2060 H SER A 140 35.800 53.259 71.923 1.00 0.00 H ATOM 2061 N GLY A 141 33.791 54.765 73.904 1.00 10.55 N ATOM 2062 CA GLY A 141 33.213 54.993 75.234 1.00 11.09 C ATOM 2063 C GLY A 141 31.841 55.631 75.225 1.00 11.02 C ATOM 2064 O GLY A 141 30.973 55.237 75.994 1.00 11.87 O ATOM 2065 HA3 GLY A 141 33.887 55.644 75.791 1.00 0.00 H ATOM 2066 HA2 GLY A 141 33.137 54.031 75.741 1.00 0.00 H ATOM 2067 H GLY A 141 34.745 55.115 73.680 1.00 0.00 H ATOM 2068 N VAL A 142 31.622 56.618 74.363 1.00 10.58 N ATOM 2069 CA VAL A 142 30.343 57.336 74.393 1.00 11.04 C ATOM 2070 C VAL A 142 29.182 56.397 74.034 1.00 11.72 C ATOM 2071 O VAL A 142 28.133 56.417 74.677 1.00 14.54 O ATOM 2072 CB VAL A 142 30.350 58.573 73.460 1.00 11.42 C ATOM 2073 CG1 VAL A 142 28.931 59.121 73.266 1.00 15.88 C ATOM 2074 CG2 VAL A 142 31.234 59.642 74.058 1.00 12.97 C ATOM 2075 HA VAL A 142 30.200 57.696 75.412 1.00 0.00 H ATOM 2076 HB VAL A 142 30.736 58.275 72.485 1.00 0.00 H ATOM 2077 HG11 VAL A 142 28.303 58.350 72.821 1.00 0.00 H ATOM 2078 HG12 VAL A 142 28.520 59.413 74.233 1.00 0.00 H ATOM 2079 HG13 VAL A 142 28.965 59.989 72.607 1.00 0.00 H ATOM 2080 HG21 VAL A 142 30.848 59.924 75.038 1.00 0.00 H ATOM 2081 HG22 VAL A 142 32.248 59.256 74.163 1.00 0.00 H ATOM 2082 HG23 VAL A 142 31.241 60.514 73.404 1.00 0.00 H ATOM 2083 H VAL A 142 32.353 56.880 73.671 1.00 0.00 H ATOM 2084 N SER A 143 29.351 55.574 73.010 1.00 9.96 N ATOM 2085 CA SER A 143 28.258 54.681 72.663 1.00 10.89 C ATOM 2086 C SER A 143 28.126 53.577 73.713 1.00 10.31 C ATOM 2087 O SER A 143 27.027 53.262 74.144 1.00 12.52 O ATOM 2088 CB SER A 143 28.423 54.123 71.240 1.00 11.36 C ATOM 2089 OG SER A 143 29.657 53.400 71.088 1.00 10.59 O ATOM 2090 HA SER A 143 27.327 55.248 72.663 1.00 0.00 H ATOM 2091 HB2 SER A 143 28.410 54.952 70.532 1.00 0.00 H ATOM 2092 HB3 SER A 143 27.592 53.451 71.026 1.00 0.00 H ATOM 2093 HG SER A 143 30.418 54.005 71.275 1.00 0.00 H ATOM 2094 H SER A 143 30.240 55.567 72.470 1.00 0.00 H ATOM 2095 N ALA A 144 29.239 52.976 74.137 1.00 10.78 N ATOM 2096 CA ALA A 144 29.174 51.907 75.121 1.00 11.76 C ATOM 2097 C ALA A 144 28.503 52.350 76.421 1.00 12.74 C ATOM 2098 O ALA A 144 27.649 51.624 76.986 1.00 13.91 O ATOM 2099 CB ALA A 144 30.592 51.413 75.398 1.00 14.12 C ATOM 2100 HA ALA A 144 28.561 51.103 74.714 1.00 0.00 H ATOM 2101 HB1 ALA A 144 31.033 51.041 74.473 1.00 0.00 H ATOM 2102 HB2 ALA A 144 31.194 52.236 75.783 1.00 0.00 H ATOM 2103 HB3 ALA A 144 30.558 50.610 76.135 1.00 0.00 H ATOM 2104 H ALA A 144 30.161 53.275 73.761 1.00 0.00 H ATOM 2105 N CYS A 145 28.869 53.529 76.919 1.00 10.37 N ATOM 2106 CA CYS A 145 28.393 53.981 78.224 1.00 12.02 C ATOM 2107 C CYS A 145 26.946 54.453 78.219 1.00 12.18 C ATOM 2108 O CYS A 145 26.344 54.592 79.304 1.00 13.65 O ATOM 2109 CB CYS A 145 29.245 55.142 78.718 1.00 12.68 C ATOM 2110 SG CYS A 145 30.874 54.662 79.274 1.00 14.53 S ATOM 2111 HA CYS A 145 28.467 53.111 78.876 1.00 0.00 H ATOM 2112 HB2 CYS A 145 28.726 55.620 79.549 1.00 0.00 H ATOM 2113 HB3 CYS A 145 29.357 55.857 77.903 1.00 0.00 H ATOM 2114 HG CYS A 145 31.561 55.781 79.699 1.00 0.00 H ATOM 2115 H CYS A 145 29.506 54.140 76.369 1.00 0.00 H ATOM 2116 N LEU A 146 26.385 54.696 77.032 1.00 11.38 N ATOM 2117 CA LEU A 146 24.973 55.077 76.904 1.00 11.35 C ATOM 2118 C LEU A 146 24.095 53.886 76.511 1.00 10.93 C ATOM 2119 O LEU A 146 22.979 53.742 77.009 1.00 11.60 O ATOM 2120 CB LEU A 146 24.823 56.181 75.869 1.00 12.27 C ATOM 2121 CG LEU A 146 25.012 57.604 76.418 1.00 12.62 C ATOM 2122 CD1 LEU A 146 26.367 57.841 77.066 1.00 13.23 C ATOM 2123 CD2 LEU A 146 24.822 58.549 75.273 1.00 13.82 C ATOM 2124 HA LEU A 146 24.641 55.434 77.879 1.00 0.00 H ATOM 2125 HB2 LEU A 146 25.564 56.017 75.087 1.00 0.00 H ATOM 2126 HB3 LEU A 146 23.823 56.112 75.440 1.00 0.00 H ATOM 2127 HG LEU A 146 24.281 57.762 77.211 1.00 0.00 H ATOM 2128 HD21 LEU A 146 25.560 58.334 74.500 1.00 0.00 H ATOM 2129 HD22 LEU A 146 23.819 58.425 74.864 1.00 0.00 H ATOM 2130 HD23 LEU A 146 24.949 59.573 75.624 1.00 0.00 H ATOM 2131 HD11 LEU A 146 26.494 57.153 77.902 1.00 0.00 H ATOM 2132 HD12 LEU A 146 27.154 57.671 76.331 1.00 0.00 H ATOM 2133 HD13 LEU A 146 26.421 58.868 77.427 1.00 0.00 H ATOM 2134 H LEU A 146 26.965 54.613 76.173 1.00 0.00 H ATOM 2135 N ALA A 147 24.592 53.009 75.633 1.00 12.54 N ATOM 2136 CA ALA A 147 23.751 51.903 75.165 1.00 12.95 C ATOM 2137 C ALA A 147 23.359 50.961 76.303 1.00 13.28 C ATOM 2138 O ALA A 147 22.238 50.457 76.295 1.00 13.18 O ATOM 2139 CB ALA A 147 24.456 51.131 74.066 1.00 14.87 C ATOM 2140 HA ALA A 147 22.834 52.338 74.767 1.00 0.00 H ATOM 2141 HB1 ALA A 147 24.663 51.799 73.230 1.00 0.00 H ATOM 2142 HB2 ALA A 147 25.393 50.727 74.451 1.00 0.00 H ATOM 2143 HB3 ALA A 147 23.817 50.314 73.731 1.00 0.00 H ATOM 2144 H ALA A 147 25.567 53.110 75.285 1.00 0.00 H ATOM 2145 N THR A 148 24.242 50.727 77.283 1.00 15.95 N ATOM 2146 CA THR A 148 23.868 49.852 78.422 1.00 17.97 C ATOM 2147 C THR A 148 22.773 50.424 79.278 1.00 16.94 C ATOM 2148 O THR A 148 21.752 49.809 79.420 1.00 18.84 O ATOM 2149 CB THR A 148 25.061 49.415 79.319 1.00 22.60 C ATOM 2150 OG1 THR A 148 25.683 48.347 78.649 1.00 26.83 O ATOM 2151 CG2 THR A 148 24.604 48.866 80.698 1.00 22.78 C ATOM 2152 HA THR A 148 23.490 48.956 77.929 1.00 0.00 H ATOM 2153 HB THR A 148 25.703 50.279 79.491 1.00 0.00 H ATOM 2154 HG1 THR A 148 25.997 48.654 77.762 1.00 0.00 H ATOM 2155 HG23 THR A 148 24.113 49.661 81.259 1.00 0.00 H ATOM 2156 HG21 THR A 148 23.907 48.042 80.547 1.00 0.00 H ATOM 2157 HG22 THR A 148 25.473 48.511 81.252 1.00 0.00 H ATOM 2158 H THR A 148 25.188 51.158 77.246 1.00 0.00 H ATOM 2159 N PRO A 149 22.989 51.604 79.896 1.00 15.23 N ATOM 2160 CA PRO A 149 21.935 52.092 80.786 1.00 16.28 C ATOM 2161 C PRO A 149 20.612 52.408 80.091 1.00 13.95 C ATOM 2162 O PRO A 149 19.547 52.318 80.730 1.00 16.77 O ATOM 2163 CB PRO A 149 22.558 53.351 81.422 1.00 16.73 C ATOM 2164 CG PRO A 149 23.611 53.772 80.444 1.00 16.52 C ATOM 2165 CD PRO A 149 24.156 52.499 79.861 1.00 16.03 C ATOM 2166 HA PRO A 149 21.649 51.327 81.508 1.00 0.00 H ATOM 2167 HD3 PRO A 149 24.505 52.651 78.840 1.00 0.00 H ATOM 2168 HD2 PRO A 149 24.972 52.106 80.467 1.00 0.00 H ATOM 2169 HG3 PRO A 149 24.401 54.327 80.951 1.00 0.00 H ATOM 2170 HG2 PRO A 149 23.176 54.394 79.661 1.00 0.00 H ATOM 2171 HB2 PRO A 149 21.809 54.133 81.545 1.00 0.00 H ATOM 2172 HB3 PRO A 149 23.000 53.117 82.390 1.00 0.00 H ATOM 2173 N PHE A 150 20.651 52.798 78.808 1.00 12.24 N ATOM 2174 CA PHE A 150 19.402 53.082 78.114 1.00 11.83 C ATOM 2175 C PHE A 150 18.814 51.806 77.473 1.00 11.87 C ATOM 2176 O PHE A 150 17.797 51.889 76.775 1.00 13.18 O ATOM 2177 CB PHE A 150 19.634 54.177 77.064 1.00 12.12 C ATOM 2178 CG PHE A 150 19.780 55.571 77.660 1.00 11.39 C ATOM 2179 CD1 PHE A 150 18.694 56.198 78.271 1.00 12.89 C ATOM 2180 CD2 PHE A 150 20.998 56.248 77.636 1.00 12.77 C ATOM 2181 CE1 PHE A 150 18.825 57.499 78.814 1.00 13.09 C ATOM 2182 CE2 PHE A 150 21.110 57.528 78.177 1.00 12.43 C ATOM 2183 CZ PHE A 150 20.046 58.152 78.751 1.00 12.82 C ATOM 2184 HA PHE A 150 18.671 53.440 78.839 1.00 0.00 H ATOM 2185 HB2 PHE A 150 20.544 53.940 76.514 1.00 0.00 H ATOM 2186 HB3 PHE A 150 18.787 54.182 76.378 1.00 0.00 H ATOM 2187 HD2 PHE A 150 21.871 55.772 77.190 1.00 0.00 H ATOM 2188 HE2 PHE A 150 22.071 58.040 78.139 1.00 0.00 H ATOM 2189 HZ PHE A 150 20.153 59.157 79.158 1.00 0.00 H ATOM 2190 HE1 PHE A 150 17.968 57.986 79.280 1.00 0.00 H ATOM 2191 HD1 PHE A 150 17.736 55.682 78.331 1.00 0.00 H ATOM 2192 H PHE A 150 21.561 52.896 78.315 1.00 0.00 H ATOM 2193 N LYS A 151 19.443 50.649 77.718 1.00 11.59 N ATOM 2194 CA LYS A 151 18.902 49.358 77.304 1.00 11.59 C ATOM 2195 C LYS A 151 18.666 49.332 75.802 1.00 10.98 C ATOM 2196 O LYS A 151 17.643 48.835 75.324 1.00 12.79 O ATOM 2197 CB LYS A 151 17.594 49.019 78.059 1.00 14.08 C ATOM 2198 CG LYS A 151 17.691 49.109 79.570 1.00 16.53 C ATOM 2199 CD LYS A 151 18.788 48.391 80.203 1.00 18.43 C ATOM 2200 CE LYS A 151 18.595 48.530 81.705 1.00 20.02 C ATOM 2201 NZ LYS A 151 19.451 47.589 82.461 1.00 21.47 N ATOM 2202 HA LYS A 151 19.641 48.598 77.558 1.00 0.00 H ATOM 2203 HB2 LYS A 151 16.821 49.712 77.727 1.00 0.00 H ATOM 2204 HB3 LYS A 151 17.305 48.001 77.797 1.00 0.00 H ATOM 2205 HG2 LYS A 151 17.792 50.162 79.832 1.00 0.00 H ATOM 2206 HG3 LYS A 151 16.760 48.721 79.984 1.00 0.00 H ATOM 2207 HD2 LYS A 151 18.763 47.340 79.917 1.00 0.00 H ATOM 2208 HD3 LYS A 151 19.742 48.825 79.905 1.00 0.00 H ATOM 2209 HE2 LYS A 151 17.551 48.329 81.947 1.00 0.00 H ATOM 2210 HE3 LYS A 151 18.845 49.549 82.000 1.00 0.00 H ATOM 2211 HZ1 LYS A 151 19.214 46.613 82.191 1.00 0.00 H ATOM 2212 HZ2 LYS A 151 20.450 47.778 82.242 1.00 0.00 H ATOM 2213 HZ3 LYS A 151 19.288 47.717 83.480 1.00 0.00 H ATOM 2214 H LYS A 151 20.352 50.671 78.223 1.00 0.00 H ATOM 2215 N ILE A 152 19.637 49.810 75.032 1.00 10.17 N ATOM 2216 CA ILE A 152 19.521 49.848 73.581 1.00 10.24 C ATOM 2217 C ILE A 152 19.793 48.456 73.016 1.00 10.12 C ATOM 2218 O ILE A 152 20.788 47.821 73.405 1.00 10.66 O ATOM 2219 CB ILE A 152 20.561 50.849 73.039 1.00 10.16 C ATOM 2220 CG1 ILE A 152 20.231 52.277 73.531 1.00 12.14 C ATOM 2221 CG2 ILE A 152 20.669 50.736 71.500 1.00 11.70 C ATOM 2222 CD1 ILE A 152 18.861 52.830 73.102 1.00 14.08 C ATOM 2223 HA ILE A 152 18.519 50.158 73.286 1.00 0.00 H ATOM 2224 HB ILE A 152 21.548 50.606 73.431 1.00 0.00 H ATOM 2225 HG12 ILE A 152 20.264 52.272 74.620 1.00 0.00 H ATOM 2226 HG13 ILE A 152 20.999 52.949 73.148 1.00 0.00 H ATOM 2227 HD11 ILE A 152 18.808 52.861 72.014 1.00 0.00 H ATOM 2228 HD12 ILE A 152 18.073 52.183 73.487 1.00 0.00 H ATOM 2229 HD13 ILE A 152 18.735 53.836 73.502 1.00 0.00 H ATOM 2230 HG21 ILE A 152 20.976 49.725 71.232 1.00 0.00 H ATOM 2231 HG22 ILE A 152 19.699 50.954 71.052 1.00 0.00 H ATOM 2232 HG23 ILE A 152 21.408 51.450 71.135 1.00 0.00 H ATOM 2233 H ILE A 152 20.506 50.168 75.478 1.00 0.00 H ATOM 2234 N HIS A 153 18.933 47.984 72.103 1.00 10.29 N ATOM 2235 CA HIS A 153 19.104 46.651 71.517 1.00 10.41 C ATOM 2236 C HIS A 153 19.493 46.679 70.039 1.00 10.30 C ATOM 2237 O HIS A 153 19.889 45.645 69.506 1.00 10.40 O ATOM 2238 CB HIS A 153 17.844 45.800 71.701 1.00 11.37 C ATOM 2239 CG HIS A 153 17.786 45.160 73.044 1.00 11.73 C ATOM 2240 ND1 HIS A 153 16.917 44.131 73.337 1.00 13.56 N ATOM 2241 CD2 HIS A 153 18.528 45.362 74.162 1.00 12.82 C ATOM 2242 CE1 HIS A 153 17.097 43.749 74.589 1.00 13.78 C ATOM 2243 NE2 HIS A 153 18.066 44.477 75.116 1.00 14.40 N ATOM 2244 HA HIS A 153 19.935 46.200 72.059 1.00 0.00 H ATOM 2245 HB2 HIS A 153 16.969 46.438 71.578 1.00 0.00 H ATOM 2246 HB3 HIS A 153 17.833 45.020 70.940 1.00 0.00 H ATOM 2247 HD2 HIS A 153 19.335 46.085 74.284 1.00 0.00 H ATOM 2248 HE1 HIS A 153 16.540 42.965 75.101 1.00 0.00 H ATOM 2249 H HIS A 153 18.130 48.574 71.805 1.00 0.00 H ATOM 2250 N GLY A 154 19.335 47.827 69.379 1.00 10.09 N ATOM 2251 CA GLY A 154 19.633 47.928 67.958 1.00 9.64 C ATOM 2252 C GLY A 154 21.096 48.192 67.703 1.00 10.26 C ATOM 2253 O GLY A 154 21.971 47.638 68.387 1.00 11.10 O ATOM 2254 HA3 GLY A 154 19.049 48.744 67.533 1.00 0.00 H ATOM 2255 HA2 GLY A 154 19.354 46.993 67.473 1.00 0.00 H ATOM 2256 H GLY A 154 18.992 48.666 69.889 1.00 0.00 H ATOM 2257 N VAL A 155 21.400 48.988 66.684 1.00 11.06 N ATOM 2258 CA VAL A 155 22.792 49.276 66.407 1.00 11.37 C ATOM 2259 C VAL A 155 23.454 50.002 67.584 1.00 10.74 C ATOM 2260 O VAL A 155 22.796 50.754 68.331 1.00 12.53 O ATOM 2261 CB VAL A 155 22.939 50.075 65.081 1.00 13.36 C ATOM 2262 CG1 VAL A 155 22.469 49.278 63.952 1.00 13.05 C ATOM 2263 CG2 VAL A 155 22.182 51.420 65.129 1.00 12.58 C ATOM 2264 HA VAL A 155 23.315 48.328 66.279 1.00 0.00 H ATOM 2265 HB VAL A 155 23.999 50.296 64.952 1.00 0.00 H ATOM 2266 HG11 VAL A 155 23.059 48.364 63.884 1.00 0.00 H ATOM 2267 HG12 VAL A 155 21.419 49.024 64.100 1.00 0.00 H ATOM 2268 HG13 VAL A 155 22.579 49.853 63.032 1.00 0.00 H ATOM 2269 HG21 VAL A 155 21.122 51.233 65.299 1.00 0.00 H ATOM 2270 HG22 VAL A 155 22.579 52.030 65.940 1.00 0.00 H ATOM 2271 HG23 VAL A 155 22.313 51.943 64.182 1.00 0.00 H ATOM 2272 H VAL A 155 20.649 49.399 66.093 1.00 0.00 H ATOM 2273 N ASN A 156 24.755 49.792 67.763 1.00 10.84 N ATOM 2274 CA ASN A 156 25.459 50.436 68.866 1.00 11.42 C ATOM 2275 C ASN A 156 26.916 50.545 68.461 1.00 10.71 C ATOM 2276 O ASN A 156 27.618 49.535 68.412 1.00 13.53 O ATOM 2277 CB ASN A 156 25.255 49.570 70.154 1.00 12.62 C ATOM 2278 CG ASN A 156 26.273 49.844 71.302 1.00 14.08 C ATOM 2279 OD1 ASN A 156 26.986 50.819 71.306 1.00 17.31 O ATOM 2280 ND2 ASN A 156 26.354 48.902 72.254 1.00 15.14 N ATOM 2281 HA ASN A 156 25.082 51.435 69.083 1.00 0.00 H ATOM 2282 HB2 ASN A 156 24.253 49.764 70.537 1.00 0.00 H ATOM 2283 HB3 ASN A 156 25.338 48.520 69.872 1.00 0.00 H ATOM 2284 HD22 ASN A 156 25.725 48.074 72.221 1.00 0.00 H ATOM 2285 HD21 ASN A 156 27.046 49.000 73.025 1.00 0.00 H ATOM 2286 H ASN A 156 25.273 49.166 67.114 1.00 0.00 H ATOM 2287 N TYR A 157 27.362 51.738 68.113 1.00 10.05 N ATOM 2288 CA TYR A 157 28.762 51.971 67.847 1.00 8.77 C ATOM 2289 C TYR A 157 29.014 53.466 67.793 1.00 8.07 C ATOM 2290 O TYR A 157 28.075 54.273 67.858 1.00 9.14 O ATOM 2291 CB TYR A 157 29.292 51.270 66.575 1.00 10.28 C ATOM 2292 CG TYR A 157 28.488 51.468 65.325 1.00 10.73 C ATOM 2293 CD1 TYR A 157 28.479 52.678 64.631 1.00 12.46 C ATOM 2294 CD2 TYR A 157 27.790 50.400 64.784 1.00 12.78 C ATOM 2295 CE1 TYR A 157 27.731 52.811 63.446 1.00 12.78 C ATOM 2296 CE2 TYR A 157 27.093 50.508 63.620 1.00 14.90 C ATOM 2297 CZ TYR A 157 27.040 51.705 62.975 1.00 13.74 C ATOM 2298 OH TYR A 157 26.318 51.778 61.806 1.00 16.75 O ATOM 2299 HA TYR A 157 29.322 51.520 68.666 1.00 0.00 H ATOM 2300 HB3 TYR A 157 29.334 50.200 66.778 1.00 0.00 H ATOM 2301 HB2 TYR A 157 30.299 51.642 66.385 1.00 0.00 H ATOM 2302 HD2 TYR A 157 27.800 49.444 65.307 1.00 0.00 H ATOM 2303 HE2 TYR A 157 26.580 49.640 63.206 1.00 0.00 H ATOM 2304 HE1 TYR A 157 27.696 53.760 62.912 1.00 0.00 H ATOM 2305 HD1 TYR A 157 29.054 53.524 65.008 1.00 0.00 H ATOM 2306 HH TYR A 157 26.697 51.146 61.145 1.00 0.00 H ATOM 2307 H TYR A 157 26.690 52.527 68.029 1.00 0.00 H ATOM 2308 N SER A 158 30.287 53.821 67.691 1.00 7.72 N ATOM 2309 CA SER A 158 30.717 55.204 67.608 1.00 8.64 C ATOM 2310 C SER A 158 31.280 55.457 66.219 1.00 10.80 C ATOM 2311 O SER A 158 31.883 54.585 65.623 1.00 14.13 O ATOM 2312 CB SER A 158 31.787 55.511 68.677 1.00 9.69 C ATOM 2313 OG SER A 158 31.188 55.451 69.985 1.00 10.45 O ATOM 2314 HA SER A 158 29.864 55.858 67.790 1.00 0.00 H ATOM 2315 HB2 SER A 158 32.194 56.508 68.509 1.00 0.00 H ATOM 2316 HB3 SER A 158 32.589 54.776 68.610 1.00 0.00 H ATOM 2317 HG SER A 158 30.460 56.119 70.044 1.00 0.00 H ATOM 2318 H SER A 158 31.010 53.074 67.670 1.00 0.00 H ATOM 2319 N ILE A 159 31.088 56.633 65.671 1.00 10.62 N ATOM 2320 CA ILE A 159 31.882 57.080 64.532 1.00 10.79 C ATOM 2321 C ILE A 159 32.780 58.187 65.049 1.00 11.48 C ATOM 2322 O ILE A 159 32.380 58.961 65.937 1.00 13.90 O ATOM 2323 CB ILE A 159 30.970 57.590 63.398 1.00 12.10 C ATOM 2324 CG1 ILE A 159 30.134 56.396 62.925 1.00 14.62 C ATOM 2325 CG2 ILE A 159 31.787 58.217 62.260 1.00 15.38 C ATOM 2326 CD1 ILE A 159 29.121 56.752 61.907 1.00 16.54 C ATOM 2327 HA ILE A 159 32.470 56.263 64.114 1.00 0.00 H ATOM 2328 HB ILE A 159 30.315 58.385 63.755 1.00 0.00 H ATOM 2329 HG12 ILE A 159 30.806 55.651 62.498 1.00 0.00 H ATOM 2330 HG13 ILE A 159 29.622 55.970 63.788 1.00 0.00 H ATOM 2331 HD11 ILE A 159 28.434 57.489 62.323 1.00 0.00 H ATOM 2332 HD12 ILE A 159 29.618 57.170 61.032 1.00 0.00 H ATOM 2333 HD13 ILE A 159 28.567 55.858 61.619 1.00 0.00 H ATOM 2334 HG21 ILE A 159 32.361 59.059 62.648 1.00 0.00 H ATOM 2335 HG22 ILE A 159 32.467 57.471 61.848 1.00 0.00 H ATOM 2336 HG23 ILE A 159 31.112 58.565 61.479 1.00 0.00 H ATOM 2337 H ILE A 159 30.354 57.260 66.057 1.00 0.00 H ATOM 2338 N SER A 160 34.004 58.239 64.526 1.00 11.10 N ATOM 2339 CA SER A 160 34.884 59.371 64.804 1.00 11.30 C ATOM 2340 C SER A 160 35.442 59.873 63.505 1.00 9.33 C ATOM 2341 O SER A 160 35.786 59.101 62.606 1.00 11.25 O ATOM 2342 CB SER A 160 36.037 58.989 65.735 1.00 14.50 C ATOM 2343 OG SER A 160 36.809 60.090 66.166 1.00 14.20 O ATOM 2344 HA SER A 160 34.299 60.143 65.305 1.00 0.00 H ATOM 2345 HB2 SER A 160 36.691 58.296 65.206 1.00 0.00 H ATOM 2346 HB3 SER A 160 35.621 58.495 66.613 1.00 0.00 H ATOM 2347 HG SER A 160 37.203 60.543 65.379 1.00 0.00 H ATOM 2348 H SER A 160 34.336 57.466 63.914 1.00 0.00 H ATOM 2349 N SER A 161 35.513 61.190 63.421 1.00 9.20 N ATOM 2350 CA SER A 161 35.959 61.869 62.226 1.00 8.97 C ATOM 2351 C SER A 161 36.306 63.299 62.599 1.00 9.03 C ATOM 2352 O SER A 161 35.960 64.248 61.903 1.00 10.61 O ATOM 2353 CB SER A 161 34.921 61.806 61.113 1.00 9.74 C ATOM 2354 OG SER A 161 33.647 62.140 61.629 1.00 9.89 O ATOM 2355 HA SER A 161 36.843 61.369 61.829 1.00 0.00 H ATOM 2356 HB2 SER A 161 34.892 60.797 60.701 1.00 0.00 H ATOM 2357 HB3 SER A 161 35.190 62.511 60.326 1.00 0.00 H ATOM 2358 HG SER A 161 33.673 63.057 62.002 1.00 0.00 H ATOM 2359 H SER A 161 35.237 61.759 64.246 1.00 0.00 H ATOM 2360 N ALA A 162 37.009 63.443 63.727 1.00 10.74 N ATOM 2361 CA ALA A 162 37.455 64.777 64.180 1.00 10.73 C ATOM 2362 C ALA A 162 36.239 65.724 64.240 1.00 11.11 C ATOM 2363 O ALA A 162 35.225 65.361 64.849 1.00 11.80 O ATOM 2364 CB ALA A 162 38.615 65.326 63.335 1.00 13.04 C ATOM 2365 HA ALA A 162 37.867 64.693 65.185 1.00 0.00 H ATOM 2366 HB1 ALA A 162 39.465 64.646 63.401 1.00 0.00 H ATOM 2367 HB2 ALA A 162 38.297 65.412 62.296 1.00 0.00 H ATOM 2368 HB3 ALA A 162 38.903 66.308 63.710 1.00 0.00 H ATOM 2369 H ALA A 162 37.245 62.604 64.294 1.00 0.00 H ATOM 2370 N CYS A 163 36.310 66.918 63.643 1.00 12.52 N ATOM 2371 CA CYS A 163 35.219 67.878 63.688 1.00 13.72 C ATOM 2372 C CYS A 163 33.915 67.388 63.115 1.00 10.69 C ATOM 2373 O CYS A 163 32.853 67.986 63.398 1.00 12.82 O ATOM 2374 CB CYS A 163 35.592 69.226 62.970 1.00 15.19 C ATOM 2375 SG CYS A 163 37.318 69.631 63.005 1.00 18.61 S ATOM 2376 HA CYS A 163 35.069 68.036 64.756 1.00 0.00 H ATOM 2377 HB2 CYS A 163 35.044 70.033 63.456 1.00 0.00 H ATOM 2378 HB3 CYS A 163 35.281 69.153 61.928 1.00 0.00 H ATOM 2379 HG CYS A 163 37.522 70.827 62.348 1.00 0.00 H ATOM 2380 H CYS A 163 37.178 67.169 63.127 1.00 0.00 H ATOM 2381 N ALA A 164 33.968 66.356 62.270 1.00 9.79 N ATOM 2382 CA ALA A 164 32.753 65.883 61.633 1.00 9.28 C ATOM 2383 C ALA A 164 32.087 64.736 62.382 1.00 8.29 C ATOM 2384 O ALA A 164 31.006 64.290 62.004 1.00 9.24 O ATOM 2385 CB ALA A 164 33.101 65.434 60.216 1.00 10.60 C ATOM 2386 HA ALA A 164 32.037 66.705 61.630 1.00 0.00 H ATOM 2387 HB1 ALA A 164 33.513 66.276 59.660 1.00 0.00 H ATOM 2388 HB2 ALA A 164 33.838 64.632 60.261 1.00 0.00 H ATOM 2389 HB3 ALA A 164 32.200 65.074 59.719 1.00 0.00 H ATOM 2390 H ALA A 164 34.877 65.893 62.069 1.00 0.00 H ATOM 2391 N THR A 165 32.689 64.298 63.493 1.00 8.59 N ATOM 2392 CA THR A 165 32.282 63.091 64.215 1.00 7.27 C ATOM 2393 C THR A 165 30.768 62.974 64.351 1.00 7.76 C ATOM 2394 O THR A 165 30.147 61.977 63.895 1.00 8.13 O ATOM 2395 CB THR A 165 32.936 63.111 65.618 1.00 8.28 C ATOM 2396 OG1 THR A 165 34.339 62.893 65.451 1.00 8.95 O ATOM 2397 CG2 THR A 165 32.380 62.035 66.530 1.00 10.52 C ATOM 2398 HA THR A 165 32.615 62.225 63.643 1.00 0.00 H ATOM 2399 HB THR A 165 32.724 64.074 66.082 1.00 0.00 H ATOM 2400 HG1 THR A 165 34.718 63.611 64.885 1.00 0.00 H ATOM 2401 HG23 THR A 165 31.310 62.192 66.664 1.00 0.00 H ATOM 2402 HG21 THR A 165 32.552 61.056 66.082 1.00 0.00 H ATOM 2403 HG22 THR A 165 32.880 62.086 67.497 1.00 0.00 H ATOM 2404 H THR A 165 33.491 64.845 63.865 1.00 0.00 H ATOM 2405 N SER A 166 30.145 63.923 65.066 1.00 8.21 N ATOM 2406 CA SER A 166 28.729 63.681 65.409 1.00 8.26 C ATOM 2407 C SER A 166 27.822 64.035 64.226 1.00 8.41 C ATOM 2408 O SER A 166 26.643 63.637 64.247 1.00 9.34 O ATOM 2409 CB SER A 166 28.309 64.401 66.703 1.00 8.81 C ATOM 2410 OG SER A 166 28.778 65.735 66.684 1.00 8.76 O ATOM 2411 HA SER A 166 28.613 62.616 65.611 1.00 0.00 H ATOM 2412 HB2 SER A 166 28.734 63.880 67.561 1.00 0.00 H ATOM 2413 HB3 SER A 166 27.222 64.401 66.781 1.00 0.00 H ATOM 2414 HG SER A 166 29.766 65.735 66.615 1.00 0.00 H ATOM 2415 H SER A 166 30.637 64.789 65.365 1.00 0.00 H ATOM 2416 N ALA A 167 28.331 64.710 63.185 1.00 7.80 N ATOM 2417 CA ALA A 167 27.529 64.883 61.962 1.00 8.33 C ATOM 2418 C ALA A 167 27.492 63.569 61.191 1.00 7.58 C ATOM 2419 O ALA A 167 26.431 63.171 60.701 1.00 8.24 O ATOM 2420 CB ALA A 167 28.131 65.992 61.110 1.00 9.40 C ATOM 2421 HA ALA A 167 26.509 65.163 62.224 1.00 0.00 H ATOM 2422 HB1 ALA A 167 28.134 66.923 61.677 1.00 0.00 H ATOM 2423 HB2 ALA A 167 29.153 65.726 60.839 1.00 0.00 H ATOM 2424 HB3 ALA A 167 27.535 66.118 60.206 1.00 0.00 H ATOM 2425 H ALA A 167 29.289 65.110 63.241 1.00 0.00 H ATOM 2426 N HIS A 168 28.643 62.894 61.070 1.00 7.59 N ATOM 2427 CA HIS A 168 28.585 61.539 60.478 1.00 8.17 C ATOM 2428 C HIS A 168 27.736 60.579 61.319 1.00 7.72 C ATOM 2429 O HIS A 168 27.089 59.693 60.768 1.00 8.26 O ATOM 2430 CB HIS A 168 29.977 60.926 60.301 1.00 8.01 C ATOM 2431 CG HIS A 168 30.826 61.570 59.254 1.00 8.14 C ATOM 2432 ND1 HIS A 168 30.520 61.665 57.907 1.00 11.98 N ATOM 2433 CD2 HIS A 168 32.041 62.119 59.406 1.00 7.09 C ATOM 2434 CE1 HIS A 168 31.537 62.269 57.278 1.00 7.20 C ATOM 2435 NE2 HIS A 168 32.470 62.531 58.173 1.00 11.99 N ATOM 2436 HA HIS A 168 28.122 61.669 59.500 1.00 0.00 H ATOM 2437 HB2 HIS A 168 30.502 60.999 61.254 1.00 0.00 H ATOM 2438 HB3 HIS A 168 29.852 59.876 60.036 1.00 0.00 H ATOM 2439 HD2 HIS A 168 32.588 62.219 60.343 1.00 0.00 H ATOM 2440 HE1 HIS A 168 31.585 62.503 56.214 1.00 0.00 H ATOM 2441 H HIS A 168 29.545 63.308 61.381 1.00 0.00 H ATOM 2442 N CYS A 169 27.695 60.750 62.637 1.00 7.59 N ATOM 2443 CA CYS A 169 26.827 59.891 63.442 1.00 8.08 C ATOM 2444 C CYS A 169 25.357 60.124 63.035 1.00 8.02 C ATOM 2445 O CYS A 169 24.604 59.163 62.855 1.00 9.36 O ATOM 2446 CB CYS A 169 27.000 60.173 64.937 1.00 8.70 C ATOM 2447 SG CYS A 169 28.541 59.544 65.640 1.00 9.99 S ATOM 2448 HA CYS A 169 27.104 58.853 63.259 1.00 0.00 H ATOM 2449 HB2 CYS A 169 26.168 59.712 65.470 1.00 0.00 H ATOM 2450 HB3 CYS A 169 26.972 61.252 65.086 1.00 0.00 H ATOM 2451 HG CYS A 169 29.612 60.126 64.992 1.00 0.00 H ATOM 2452 H CYS A 169 28.273 61.486 63.090 1.00 0.00 H ATOM 2453 N ILE A 170 24.952 61.382 62.883 1.00 7.95 N ATOM 2454 CA ILE A 170 23.584 61.658 62.451 1.00 8.16 C ATOM 2455 C ILE A 170 23.340 61.114 61.047 1.00 7.93 C ATOM 2456 O ILE A 170 22.289 60.501 60.805 1.00 8.71 O ATOM 2457 CB ILE A 170 23.292 63.177 62.507 1.00 8.97 C ATOM 2458 CG1 ILE A 170 23.286 63.682 63.978 1.00 10.19 C ATOM 2459 CG2 ILE A 170 21.956 63.511 61.822 1.00 9.79 C ATOM 2460 CD1 ILE A 170 23.355 65.211 64.101 1.00 9.66 C ATOM 2461 HA ILE A 170 22.902 61.152 63.134 1.00 0.00 H ATOM 2462 HB ILE A 170 24.088 63.689 61.966 1.00 0.00 H ATOM 2463 HG12 ILE A 170 22.370 63.338 64.457 1.00 0.00 H ATOM 2464 HG13 ILE A 170 24.146 63.255 64.493 1.00 0.00 H ATOM 2465 HD11 ILE A 170 24.273 65.571 63.636 1.00 0.00 H ATOM 2466 HD12 ILE A 170 22.494 65.654 63.600 1.00 0.00 H ATOM 2467 HD13 ILE A 170 23.347 65.490 65.155 1.00 0.00 H ATOM 2468 HG21 ILE A 170 21.997 63.202 60.778 1.00 0.00 H ATOM 2469 HG22 ILE A 170 21.148 62.982 62.327 1.00 0.00 H ATOM 2470 HG23 ILE A 170 21.779 64.585 61.878 1.00 0.00 H ATOM 2471 H ILE A 170 25.608 62.167 63.071 1.00 0.00 H ATOM 2472 N GLY A 171 24.285 61.298 60.126 1.00 8.61 N ATOM 2473 CA GLY A 171 24.061 60.794 58.764 1.00 8.92 C ATOM 2474 C GLY A 171 23.955 59.285 58.749 1.00 7.66 C ATOM 2475 O GLY A 171 23.162 58.716 58.006 1.00 8.73 O ATOM 2476 HA3 GLY A 171 24.894 61.098 58.131 1.00 0.00 H ATOM 2477 HA2 GLY A 171 23.136 61.219 58.375 1.00 0.00 H ATOM 2478 H GLY A 171 25.168 61.791 60.368 1.00 0.00 H ATOM 2479 N ASN A 172 24.799 58.597 59.517 1.00 8.57 N ATOM 2480 CA ASN A 172 24.718 57.157 59.550 1.00 9.07 C ATOM 2481 C ASN A 172 23.415 56.678 60.194 1.00 8.60 C ATOM 2482 O ASN A 172 22.849 55.637 59.788 1.00 9.72 O ATOM 2483 CB ASN A 172 25.873 56.567 60.357 1.00 10.63 C ATOM 2484 CG ASN A 172 27.046 56.269 59.538 1.00 12.94 C ATOM 2485 OD1 ASN A 172 27.373 55.093 59.319 1.00 14.59 O ATOM 2486 ND2 ASN A 172 27.727 57.305 59.078 1.00 14.12 N ATOM 2487 HA ASN A 172 24.762 56.823 58.514 1.00 0.00 H ATOM 2488 HB2 ASN A 172 26.160 57.282 61.128 1.00 0.00 H ATOM 2489 HB3 ASN A 172 25.533 55.644 60.827 1.00 0.00 H ATOM 2490 HD22 ASN A 172 27.409 58.272 59.291 1.00 0.00 H ATOM 2491 HD21 ASN A 172 28.580 57.153 58.503 1.00 0.00 H ATOM 2492 H ASN A 172 25.511 59.095 60.089 1.00 0.00 H ATOM 2493 N ALA A 173 22.894 57.434 61.161 1.00 8.48 N ATOM 2494 CA ALA A 173 21.566 57.141 61.726 1.00 8.68 C ATOM 2495 C ALA A 173 20.509 57.242 60.625 1.00 9.48 C ATOM 2496 O ALA A 173 19.628 56.373 60.514 1.00 9.69 O ATOM 2497 CB ALA A 173 21.284 58.100 62.846 1.00 10.82 C ATOM 2498 HA ALA A 173 21.540 56.128 62.127 1.00 0.00 H ATOM 2499 HB1 ALA A 173 22.044 57.988 63.619 1.00 0.00 H ATOM 2500 HB2 ALA A 173 21.302 59.120 62.462 1.00 0.00 H ATOM 2501 HB3 ALA A 173 20.302 57.886 63.267 1.00 0.00 H ATOM 2502 H ALA A 173 23.435 58.245 61.523 1.00 0.00 H ATOM 2503 N VAL A 174 20.575 58.293 59.816 1.00 9.49 N ATOM 2504 CA VAL A 174 19.660 58.437 58.676 1.00 9.80 C ATOM 2505 C VAL A 174 19.785 57.222 57.766 1.00 9.57 C ATOM 2506 O VAL A 174 18.777 56.683 57.310 1.00 10.15 O ATOM 2507 CB VAL A 174 19.980 59.739 57.914 1.00 10.95 C ATOM 2508 CG1 VAL A 174 19.192 59.791 56.602 1.00 12.97 C ATOM 2509 CG2 VAL A 174 19.582 60.913 58.794 1.00 12.36 C ATOM 2510 HA VAL A 174 18.631 58.495 59.032 1.00 0.00 H ATOM 2511 HB VAL A 174 21.044 59.780 57.680 1.00 0.00 H ATOM 2512 HG11 VAL A 174 19.465 58.937 55.982 1.00 0.00 H ATOM 2513 HG12 VAL A 174 18.124 59.757 56.819 1.00 0.00 H ATOM 2514 HG13 VAL A 174 19.428 60.715 56.075 1.00 0.00 H ATOM 2515 HG21 VAL A 174 18.515 60.857 59.011 1.00 0.00 H ATOM 2516 HG22 VAL A 174 20.146 60.875 59.726 1.00 0.00 H ATOM 2517 HG23 VAL A 174 19.800 61.846 58.274 1.00 0.00 H ATOM 2518 H VAL A 174 21.289 59.029 59.993 1.00 0.00 H ATOM 2519 N GLU A 175 21.000 56.759 57.493 1.00 9.20 N ATOM 2520 CA GLU A 175 21.185 55.594 56.629 1.00 9.64 C ATOM 2521 C GLU A 175 20.549 54.340 57.214 1.00 9.38 C ATOM 2522 O GLU A 175 19.956 53.546 56.492 1.00 10.12 O ATOM 2523 CB GLU A 175 22.669 55.362 56.354 1.00 11.59 C ATOM 2524 CG GLU A 175 23.236 56.460 55.482 1.00 13.83 C ATOM 2525 CD GLU A 175 24.734 56.392 55.311 1.00 17.82 C ATOM 2526 OE1 GLU A 175 25.424 55.906 56.229 1.00 19.42 O ATOM 2527 OE2 GLU A 175 25.234 56.844 54.261 1.00 20.13 O ATOM 2528 HA GLU A 175 20.678 55.806 55.687 1.00 0.00 H ATOM 2529 HB2 GLU A 175 23.209 55.344 57.301 1.00 0.00 H ATOM 2530 HB3 GLU A 175 22.793 54.405 55.848 1.00 0.00 H ATOM 2531 HG2 GLU A 175 22.774 56.390 54.497 1.00 0.00 H ATOM 2532 HG3 GLU A 175 22.985 57.420 55.932 1.00 0.00 H ATOM 2533 H GLU A 175 21.832 57.232 57.900 1.00 0.00 H ATOM 2534 N GLN A 176 20.632 54.155 58.538 1.00 9.45 N ATOM 2535 CA GLN A 176 19.960 52.993 59.148 1.00 9.13 C ATOM 2536 C GLN A 176 18.458 53.050 58.901 1.00 10.03 C ATOM 2537 O GLN A 176 17.825 52.025 58.660 1.00 11.65 O ATOM 2538 CB GLN A 176 20.188 52.963 60.659 1.00 9.63 C ATOM 2539 CG GLN A 176 21.664 52.733 60.999 1.00 11.59 C ATOM 2540 CD GLN A 176 22.128 51.431 60.439 1.00 16.55 C ATOM 2541 OE1 GLN A 176 21.581 50.406 60.770 1.00 18.15 O ATOM 2542 NE2 GLN A 176 23.131 51.459 59.614 1.00 19.60 N ATOM 2543 HA GLN A 176 20.383 52.099 58.690 1.00 0.00 H ATOM 2544 HB2 GLN A 176 19.870 53.915 61.085 1.00 0.00 H ATOM 2545 HB3 GLN A 176 19.595 52.157 61.091 1.00 0.00 H ATOM 2546 HG2 GLN A 176 22.261 53.540 60.575 1.00 0.00 H ATOM 2547 HG3 GLN A 176 21.786 52.723 62.082 1.00 0.00 H ATOM 2548 HE22 GLN A 176 23.569 52.367 59.359 1.00 0.00 H ATOM 2549 HE21 GLN A 176 23.496 50.573 59.209 1.00 0.00 H ATOM 2550 H GLN A 176 21.165 54.824 59.130 1.00 0.00 H ATOM 2551 N ILE A 177 17.888 54.249 59.001 1.00 10.11 N ATOM 2552 CA ILE A 177 16.441 54.396 58.715 1.00 11.60 C ATOM 2553 C ILE A 177 16.179 54.102 57.237 1.00 11.35 C ATOM 2554 O ILE A 177 15.225 53.382 56.886 1.00 12.05 O ATOM 2555 CB ILE A 177 15.962 55.812 59.112 1.00 12.70 C ATOM 2556 CG1 ILE A 177 15.658 55.892 60.626 1.00 15.34 C ATOM 2557 CG2 ILE A 177 14.673 56.203 58.376 1.00 13.25 C ATOM 2558 CD1 ILE A 177 15.853 57.228 61.144 1.00 14.15 C ATOM 2559 HA ILE A 177 15.873 53.680 59.308 1.00 0.00 H ATOM 2560 HB ILE A 177 16.771 56.490 58.841 1.00 0.00 H ATOM 2561 HG12 ILE A 177 14.623 55.596 60.794 1.00 0.00 H ATOM 2562 HG13 ILE A 177 16.321 55.208 61.156 1.00 0.00 H ATOM 2563 HD11 ILE A 177 16.888 57.530 60.986 1.00 0.00 H ATOM 2564 HD12 ILE A 177 15.189 57.918 60.624 1.00 0.00 H ATOM 2565 HD13 ILE A 177 15.629 57.239 62.211 1.00 0.00 H ATOM 2566 HG21 ILE A 177 14.852 56.190 57.301 1.00 0.00 H ATOM 2567 HG22 ILE A 177 13.885 55.492 58.623 1.00 0.00 H ATOM 2568 HG23 ILE A 177 14.370 57.204 58.683 1.00 0.00 H ATOM 2569 H ILE A 177 18.454 55.077 59.278 1.00 0.00 H ATOM 2570 N GLN A 178 17.016 54.663 56.347 1.00 10.75 N ATOM 2571 CA GLN A 178 16.816 54.440 54.898 1.00 12.21 C ATOM 2572 C GLN A 178 16.913 53.003 54.477 1.00 13.02 C ATOM 2573 O GLN A 178 16.172 52.552 53.589 1.00 16.55 O ATOM 2574 CB GLN A 178 17.817 55.267 54.084 1.00 12.56 C ATOM 2575 CG GLN A 178 17.583 56.760 54.213 1.00 12.98 C ATOM 2576 CD GLN A 178 18.651 57.576 53.564 1.00 13.32 C ATOM 2577 OE1 GLN A 178 19.816 57.158 53.511 1.00 15.18 O ATOM 2578 NE2 GLN A 178 18.291 58.780 53.117 1.00 15.61 N ATOM 2579 HA GLN A 178 15.794 54.760 54.697 1.00 0.00 H ATOM 2580 HB2 GLN A 178 18.824 55.040 54.434 1.00 0.00 H ATOM 2581 HB3 GLN A 178 17.727 54.989 53.034 1.00 0.00 H ATOM 2582 HG2 GLN A 178 16.628 57.004 53.747 1.00 0.00 H ATOM 2583 HG3 GLN A 178 17.545 57.016 55.272 1.00 0.00 H ATOM 2584 HE22 GLN A 178 17.299 59.084 53.184 1.00 0.00 H ATOM 2585 HE21 GLN A 178 19.002 59.414 52.701 1.00 0.00 H ATOM 2586 H GLN A 178 17.805 55.254 56.677 1.00 0.00 H ATOM 2587 N LEU A 179 17.791 52.258 55.132 1.00 11.70 N ATOM 2588 CA LEU A 179 17.955 50.822 54.854 1.00 13.24 C ATOM 2589 C LEU A 179 16.849 49.972 55.473 1.00 12.47 C ATOM 2590 O LEU A 179 16.818 48.758 55.261 1.00 13.75 O ATOM 2591 CB LEU A 179 19.297 50.329 55.358 1.00 14.16 C ATOM 2592 CG LEU A 179 20.427 50.899 54.501 1.00 17.55 C ATOM 2593 CD1 LEU A 179 21.736 50.696 55.226 1.00 19.57 C ATOM 2594 CD2 LEU A 179 20.429 50.207 53.082 1.00 20.04 C ATOM 2595 HA LEU A 179 17.898 50.713 53.771 1.00 0.00 H ATOM 2596 HB2 LEU A 179 19.433 50.648 56.391 1.00 0.00 H ATOM 2597 HB3 LEU A 179 19.322 49.240 55.309 1.00 0.00 H ATOM 2598 HG LEU A 179 20.281 51.967 54.341 1.00 0.00 H ATOM 2599 HD21 LEU A 179 20.576 49.134 53.203 1.00 0.00 H ATOM 2600 HD22 LEU A 179 19.475 50.391 52.588 1.00 0.00 H ATOM 2601 HD23 LEU A 179 21.238 50.620 52.479 1.00 0.00 H ATOM 2602 HD11 LEU A 179 21.702 51.212 56.185 1.00 0.00 H ATOM 2603 HD12 LEU A 179 21.897 49.631 55.391 1.00 0.00 H ATOM 2604 HD13 LEU A 179 22.550 51.099 54.623 1.00 0.00 H ATOM 2605 H LEU A 179 18.382 52.701 55.864 1.00 0.00 H ATOM 2606 N GLY A 180 15.972 50.593 56.261 1.00 12.00 N ATOM 2607 CA GLY A 180 14.863 49.889 56.909 1.00 13.20 C ATOM 2608 C GLY A 180 15.316 49.101 58.123 1.00 12.17 C ATOM 2609 O GLY A 180 14.562 48.296 58.634 1.00 13.21 O ATOM 2610 HA3 GLY A 180 14.416 49.202 56.191 1.00 0.00 H ATOM 2611 HA2 GLY A 180 14.118 50.620 57.223 1.00 0.00 H ATOM 2612 H GLY A 180 16.079 51.615 56.422 1.00 0.00 H ATOM 2613 N LYS A 181 16.526 49.351 58.620 1.00 11.19 N ATOM 2614 CA LYS A 181 17.066 48.520 59.695 1.00 11.18 C ATOM 2615 C LYS A 181 16.688 48.978 61.104 1.00 11.49 C ATOM 2616 O LYS A 181 16.740 48.187 62.051 1.00 13.48 O ATOM 2617 CB LYS A 181 18.584 48.459 59.622 1.00 13.25 C ATOM 2618 CG LYS A 181 19.103 47.698 58.415 1.00 15.08 C ATOM 2619 CD LYS A 181 20.605 47.598 58.537 1.00 17.66 C ATOM 2620 CE LYS A 181 21.267 46.857 57.399 1.00 19.09 C ATOM 2621 NZ LYS A 181 22.730 46.691 57.676 1.00 18.29 N ATOM 2622 HA LYS A 181 16.615 47.541 59.532 1.00 0.00 H ATOM 2623 HB2 LYS A 181 18.969 49.478 59.579 1.00 0.00 H ATOM 2624 HB3 LYS A 181 18.954 47.970 60.523 1.00 0.00 H ATOM 2625 HG2 LYS A 181 18.666 46.700 58.391 1.00 0.00 H ATOM 2626 HG3 LYS A 181 18.840 48.230 57.501 1.00 0.00 H ATOM 2627 HD2 LYS A 181 21.014 48.608 58.573 1.00 0.00 H ATOM 2628 HD3 LYS A 181 20.840 47.079 59.466 1.00 0.00 H ATOM 2629 HE2 LYS A 181 21.136 47.422 56.476 1.00 0.00 H ATOM 2630 HE3 LYS A 181 20.806 45.875 57.291 1.00 0.00 H ATOM 2631 HZ1 LYS A 181 23.171 47.627 57.777 1.00 0.00 H ATOM 2632 HZ2 LYS A 181 22.856 46.150 58.556 1.00 0.00 H ATOM 2633 HZ3 LYS A 181 23.175 46.180 56.887 1.00 0.00 H ATOM 2634 H LYS A 181 17.089 50.140 58.242 1.00 0.00 H ATOM 2635 N GLN A 182 16.369 50.253 61.237 1.00 10.23 N ATOM 2636 CA GLN A 182 16.002 50.840 62.535 1.00 10.24 C ATOM 2637 C GLN A 182 14.831 51.768 62.341 1.00 10.29 C ATOM 2638 O GLN A 182 14.717 52.405 61.272 1.00 10.79 O ATOM 2639 CB GLN A 182 17.167 51.643 63.114 1.00 9.64 C ATOM 2640 CG GLN A 182 18.446 50.793 63.295 1.00 11.30 C ATOM 2641 CD GLN A 182 18.432 49.992 64.598 1.00 10.84 C ATOM 2642 OE1 GLN A 182 19.034 50.390 65.598 1.00 12.03 O ATOM 2643 NE2 GLN A 182 17.754 48.854 64.584 1.00 11.76 N ATOM 2644 HA GLN A 182 15.747 50.033 63.222 1.00 0.00 H ATOM 2645 HB2 GLN A 182 17.390 52.470 62.440 1.00 0.00 H ATOM 2646 HB3 GLN A 182 16.870 52.038 64.086 1.00 0.00 H ATOM 2647 HG2 GLN A 182 18.528 50.100 62.458 1.00 0.00 H ATOM 2648 HG3 GLN A 182 19.310 51.457 63.301 1.00 0.00 H ATOM 2649 HE22 GLN A 182 17.260 48.554 63.720 1.00 0.00 H ATOM 2650 HE21 GLN A 182 17.716 48.261 65.437 1.00 0.00 H ATOM 2651 H GLN A 182 16.378 50.863 60.395 1.00 0.00 H ATOM 2652 N ASP A 183 13.998 51.888 63.383 1.00 10.25 N ATOM 2653 CA ASP A 183 12.941 52.923 63.421 1.00 10.38 C ATOM 2654 C ASP A 183 13.357 54.192 64.140 1.00 10.86 C ATOM 2655 O ASP A 183 12.878 55.274 63.806 1.00 11.09 O ATOM 2656 CB ASP A 183 11.706 52.339 64.111 1.00 13.83 C ATOM 2657 CG ASP A 183 11.106 51.207 63.324 1.00 16.91 C ATOM 2658 OD1 ASP A 183 11.157 51.292 62.077 1.00 19.71 O ATOM 2659 OD2 ASP A 183 10.611 50.239 63.944 1.00 19.85 O ATOM 2660 HA ASP A 183 12.732 53.203 62.389 1.00 0.00 H ATOM 2661 HB2 ASP A 183 11.994 51.970 65.096 1.00 0.00 H ATOM 2662 HB3 ASP A 183 10.960 53.125 64.223 1.00 0.00 H ATOM 2663 H ASP A 183 14.097 51.236 64.187 1.00 0.00 H ATOM 2664 N ILE A 184 14.199 54.051 65.161 1.00 10.20 N ATOM 2665 CA ILE A 184 14.758 55.206 65.879 1.00 10.12 C ATOM 2666 C ILE A 184 16.232 54.952 66.057 1.00 9.03 C ATOM 2667 O ILE A 184 16.628 53.838 66.413 1.00 9.70 O ATOM 2668 CB ILE A 184 14.126 55.359 67.284 1.00 10.75 C ATOM 2669 CG1 ILE A 184 12.652 55.800 67.178 1.00 13.60 C ATOM 2670 CG2 ILE A 184 14.929 56.355 68.176 1.00 12.09 C ATOM 2671 CD1 ILE A 184 11.858 55.628 68.492 1.00 14.99 C ATOM 2672 HA ILE A 184 14.556 56.113 65.309 1.00 0.00 H ATOM 2673 HB ILE A 184 14.165 54.381 67.763 1.00 0.00 H ATOM 2674 HG12 ILE A 184 12.627 56.852 66.895 1.00 0.00 H ATOM 2675 HG13 ILE A 184 12.169 55.205 66.403 1.00 0.00 H ATOM 2676 HD11 ILE A 184 11.864 54.578 68.784 1.00 0.00 H ATOM 2677 HD12 ILE A 184 12.322 56.227 69.276 1.00 0.00 H ATOM 2678 HD13 ILE A 184 10.831 55.959 68.340 1.00 0.00 H ATOM 2679 HG21 ILE A 184 15.949 55.991 68.297 1.00 0.00 H ATOM 2680 HG22 ILE A 184 14.946 57.335 67.699 1.00 0.00 H ATOM 2681 HG23 ILE A 184 14.451 56.433 69.153 1.00 0.00 H ATOM 2682 H ILE A 184 14.470 53.093 65.461 1.00 0.00 H ATOM 2683 N VAL A 185 17.043 55.980 65.811 1.00 9.65 N ATOM 2684 CA VAL A 185 18.460 55.946 66.217 1.00 9.39 C ATOM 2685 C VAL A 185 18.760 57.220 66.957 1.00 9.68 C ATOM 2686 O VAL A 185 18.541 58.310 66.428 1.00 10.19 O ATOM 2687 CB VAL A 185 19.422 55.760 65.017 1.00 9.28 C ATOM 2688 CG1 VAL A 185 20.850 55.748 65.498 1.00 10.63 C ATOM 2689 CG2 VAL A 185 19.094 54.449 64.301 1.00 10.99 C ATOM 2690 HA VAL A 185 18.622 55.081 66.860 1.00 0.00 H ATOM 2691 HB VAL A 185 19.297 56.589 64.321 1.00 0.00 H ATOM 2692 HG11 VAL A 185 21.073 56.693 65.994 1.00 0.00 H ATOM 2693 HG12 VAL A 185 20.989 54.926 66.200 1.00 0.00 H ATOM 2694 HG13 VAL A 185 21.518 55.617 64.647 1.00 0.00 H ATOM 2695 HG21 VAL A 185 19.213 53.618 64.996 1.00 0.00 H ATOM 2696 HG22 VAL A 185 18.065 54.480 63.942 1.00 0.00 H ATOM 2697 HG23 VAL A 185 19.771 54.318 63.457 1.00 0.00 H ATOM 2698 H VAL A 185 16.670 56.820 65.325 1.00 0.00 H ATOM 2699 N PHE A 186 19.252 57.092 68.191 1.00 8.86 N ATOM 2700 CA PHE A 186 19.786 58.249 68.904 1.00 8.94 C ATOM 2701 C PHE A 186 21.157 58.550 68.361 1.00 8.41 C ATOM 2702 O PHE A 186 22.003 57.676 68.299 1.00 9.81 O ATOM 2703 CB PHE A 186 19.872 57.901 70.388 1.00 10.19 C ATOM 2704 CG PHE A 186 18.543 57.620 71.016 1.00 10.08 C ATOM 2705 CD1 PHE A 186 17.756 58.666 71.450 1.00 12.00 C ATOM 2706 CD2 PHE A 186 18.075 56.311 71.179 1.00 10.61 C ATOM 2707 CE1 PHE A 186 16.493 58.433 72.020 1.00 12.88 C ATOM 2708 CE2 PHE A 186 16.825 56.066 71.753 1.00 11.97 C ATOM 2709 CZ PHE A 186 16.047 57.128 72.180 1.00 12.25 C ATOM 2710 HA PHE A 186 19.146 59.122 68.773 1.00 0.00 H ATOM 2711 HB2 PHE A 186 20.500 57.017 70.499 1.00 0.00 H ATOM 2712 HB3 PHE A 186 20.331 58.739 70.913 1.00 0.00 H ATOM 2713 HD2 PHE A 186 18.693 55.473 70.855 1.00 0.00 H ATOM 2714 HE2 PHE A 186 16.464 55.043 71.864 1.00 0.00 H ATOM 2715 HZ PHE A 186 15.079 56.939 72.644 1.00 0.00 H ATOM 2716 HE1 PHE A 186 15.869 59.270 72.334 1.00 0.00 H ATOM 2717 HD1 PHE A 186 18.119 59.689 71.349 1.00 0.00 H ATOM 2718 H PHE A 186 19.255 56.159 68.650 1.00 0.00 H ATOM 2719 N ALA A 187 21.383 59.774 67.913 1.00 7.65 N ATOM 2720 CA ALA A 187 22.651 60.104 67.285 1.00 7.51 C ATOM 2721 C ALA A 187 23.252 61.363 67.881 1.00 8.39 C ATOM 2722 O ALA A 187 22.552 62.360 68.125 1.00 9.01 O ATOM 2723 CB ALA A 187 22.452 60.321 65.785 1.00 10.19 C ATOM 2724 HA ALA A 187 23.331 59.270 67.460 1.00 0.00 H ATOM 2725 HB1 ALA A 187 22.056 59.410 65.337 1.00 0.00 H ATOM 2726 HB2 ALA A 187 21.750 61.140 65.628 1.00 0.00 H ATOM 2727 HB3 ALA A 187 23.409 60.568 65.325 1.00 0.00 H ATOM 2728 H ALA A 187 20.649 60.504 68.011 1.00 0.00 H ATOM 2729 N GLY A 188 24.559 61.373 68.085 1.00 7.90 N ATOM 2730 CA GLY A 188 25.163 62.542 68.657 1.00 10.00 C ATOM 2731 C GLY A 188 26.580 62.313 69.081 1.00 8.24 C ATOM 2732 O GLY A 188 27.302 61.548 68.427 1.00 9.02 O ATOM 2733 HA3 GLY A 188 24.582 62.843 69.529 1.00 0.00 H ATOM 2734 HA2 GLY A 188 25.145 63.342 67.916 1.00 0.00 H ATOM 2735 H GLY A 188 25.139 60.547 67.835 1.00 0.00 H ATOM 2736 N GLY A 189 26.996 62.951 70.167 1.00 9.02 N ATOM 2737 CA GLY A 189 28.386 62.811 70.577 1.00 10.24 C ATOM 2738 C GLY A 189 28.682 63.625 71.814 1.00 9.10 C ATOM 2739 O GLY A 189 27.806 64.337 72.352 1.00 9.77 O ATOM 2740 HA3 GLY A 189 29.031 63.151 69.766 1.00 0.00 H ATOM 2741 HA2 GLY A 189 28.590 61.761 70.786 1.00 0.00 H ATOM 2742 H GLY A 189 26.340 63.542 70.717 1.00 0.00 H ATOM 2743 N GLY A 190 29.929 63.512 72.265 1.00 9.39 N ATOM 2744 CA GLY A 190 30.399 64.243 73.434 1.00 10.17 C ATOM 2745 C GLY A 190 31.872 64.496 73.299 1.00 9.21 C ATOM 2746 O GLY A 190 32.560 63.807 72.544 1.00 10.97 O ATOM 2747 HA3 GLY A 190 30.211 63.655 74.332 1.00 0.00 H ATOM 2748 HA2 GLY A 190 29.871 65.194 73.506 1.00 0.00 H ATOM 2749 H GLY A 190 30.589 62.881 71.767 1.00 0.00 H ATOM 2750 N GLU A 191 32.356 65.440 74.087 1.00 9.15 N ATOM 2751 CA GLU A 191 33.791 65.745 74.127 1.00 9.49 C ATOM 2752 C GLU A 191 34.121 66.293 75.495 1.00 9.27 C ATOM 2753 O GLU A 191 33.432 67.201 75.978 1.00 9.86 O ATOM 2754 CB GLU A 191 34.188 66.740 73.040 1.00 12.42 C ATOM 2755 CG GLU A 191 35.729 66.611 72.696 1.00 15.13 C ATOM 2756 CD GLU A 191 36.079 65.357 71.847 1.00 15.24 C ATOM 2757 OE1 GLU A 191 35.480 65.212 70.800 1.00 15.60 O ATOM 2758 OE2 GLU A 191 36.969 64.517 72.173 1.00 18.10 O ATOM 2759 HA GLU A 191 34.356 64.832 73.939 1.00 0.00 H ATOM 2760 HB2 GLU A 191 33.603 66.541 72.142 1.00 0.00 H ATOM 2761 HB3 GLU A 191 33.983 67.752 73.389 1.00 0.00 H ATOM 2762 HG2 GLU A 191 36.033 67.498 72.141 1.00 0.00 H ATOM 2763 HG3 GLU A 191 36.287 66.560 73.631 1.00 0.00 H ATOM 2764 H GLU A 191 31.705 65.979 74.693 1.00 0.00 H ATOM 2765 N GLU A 192 35.134 65.717 76.125 1.00 10.17 N ATOM 2766 CA GLU A 192 35.631 66.278 77.390 1.00 10.33 C ATOM 2767 C GLU A 192 36.456 67.515 77.085 1.00 10.70 C ATOM 2768 O GLU A 192 36.932 67.700 75.959 1.00 11.79 O ATOM 2769 CB GLU A 192 36.458 65.261 78.170 1.00 11.54 C ATOM 2770 CG GLU A 192 37.828 64.957 77.575 1.00 12.44 C ATOM 2771 CD GLU A 192 38.579 63.831 78.304 1.00 13.04 C ATOM 2772 OE1 GLU A 192 37.932 62.966 78.930 1.00 13.79 O ATOM 2773 OE2 GLU A 192 39.813 63.796 78.214 1.00 12.82 O ATOM 2774 HA GLU A 192 34.779 66.544 78.016 1.00 0.00 H ATOM 2775 HB2 GLU A 192 36.605 65.646 79.179 1.00 0.00 H ATOM 2776 HB3 GLU A 192 35.894 64.329 78.216 1.00 0.00 H ATOM 2777 HG2 GLU A 192 37.695 64.665 76.533 1.00 0.00 H ATOM 2778 HG3 GLU A 192 38.433 65.862 77.622 1.00 0.00 H ATOM 2779 H GLU A 192 35.579 64.867 75.724 1.00 0.00 H ATOM 2780 N LEU A 193 36.655 68.338 78.103 1.00 10.88 N ATOM 2781 CA LEU A 193 37.469 69.532 77.971 1.00 11.50 C ATOM 2782 C LEU A 193 38.569 69.418 79.009 1.00 11.92 C ATOM 2783 O LEU A 193 38.307 69.362 80.205 1.00 15.11 O ATOM 2784 CB LEU A 193 36.564 70.742 78.177 1.00 14.03 C ATOM 2785 CG LEU A 193 37.194 72.093 78.023 1.00 14.16 C ATOM 2786 CD1 LEU A 193 37.908 72.301 76.683 1.00 15.28 C ATOM 2787 CD2 LEU A 193 36.114 73.128 78.267 1.00 14.84 C ATOM 2788 HA LEU A 193 37.931 69.645 76.990 1.00 0.00 H ATOM 2789 HB2 LEU A 193 35.751 70.673 77.454 1.00 0.00 H ATOM 2790 HB3 LEU A 193 36.157 70.681 79.186 1.00 0.00 H ATOM 2791 HG LEU A 193 37.995 72.193 78.756 1.00 0.00 H ATOM 2792 HD21 LEU A 193 35.314 72.995 77.539 1.00 0.00 H ATOM 2793 HD22 LEU A 193 35.715 73.005 79.274 1.00 0.00 H ATOM 2794 HD23 LEU A 193 36.539 74.126 78.163 1.00 0.00 H ATOM 2795 HD11 LEU A 193 38.702 71.562 76.577 1.00 0.00 H ATOM 2796 HD12 LEU A 193 37.192 72.186 75.869 1.00 0.00 H ATOM 2797 HD13 LEU A 193 38.336 73.303 76.653 1.00 0.00 H ATOM 2798 H LEU A 193 36.216 68.123 79.021 1.00 0.00 H ATOM 2799 N CYS A 194 39.816 69.398 78.556 1.00 11.18 N ATOM 2800 CA CYS A 194 40.922 69.058 79.441 1.00 12.23 C ATOM 2801 C CYS A 194 42.227 69.549 78.846 1.00 11.54 C ATOM 2802 O CYS A 194 42.398 69.497 77.623 1.00 12.33 O ATOM 2803 CB CYS A 194 41.021 67.505 79.615 1.00 13.58 C ATOM 2804 SG CYS A 194 41.270 66.640 78.042 1.00 18.14 S ATOM 2805 HA CYS A 194 40.743 69.530 80.407 1.00 0.00 H ATOM 2806 HB2 CYS A 194 40.098 67.145 80.069 1.00 0.00 H ATOM 2807 HB3 CYS A 194 41.860 67.280 80.274 1.00 0.00 H ATOM 2808 HG CYS A 194 41.347 65.282 78.273 1.00 0.00 H ATOM 2809 H CYS A 194 40.006 69.627 77.559 1.00 0.00 H ATOM 2810 N TRP A 195 43.188 69.907 79.694 1.00 10.43 N ATOM 2811 CA TRP A 195 44.488 70.314 79.172 1.00 11.08 C ATOM 2812 C TRP A 195 45.183 69.138 78.457 1.00 10.98 C ATOM 2813 O TRP A 195 45.980 69.352 77.525 1.00 11.28 O ATOM 2814 CB TRP A 195 45.398 70.884 80.285 1.00 11.22 C ATOM 2815 CG TRP A 195 45.872 69.837 81.247 1.00 11.35 C ATOM 2816 CD1 TRP A 195 45.293 69.508 82.449 1.00 11.70 C ATOM 2817 CD2 TRP A 195 47.005 68.976 81.101 1.00 11.09 C ATOM 2818 NE1 TRP A 195 45.976 68.460 83.035 1.00 12.95 N ATOM 2819 CE2 TRP A 195 47.028 68.119 82.223 1.00 12.19 C ATOM 2820 CE3 TRP A 195 47.993 68.830 80.113 1.00 12.30 C ATOM 2821 CZ2 TRP A 195 48.002 67.122 82.382 1.00 13.53 C ATOM 2822 CZ3 TRP A 195 48.948 67.836 80.261 1.00 12.72 C ATOM 2823 CH2 TRP A 195 48.946 66.991 81.381 1.00 13.46 C ATOM 2824 HA TRP A 195 44.313 71.109 78.447 1.00 0.00 H ATOM 2825 HB2 TRP A 195 46.268 71.348 79.820 1.00 0.00 H ATOM 2826 HB3 TRP A 195 44.839 71.638 80.839 1.00 0.00 H ATOM 2827 HE1 TRP A 195 45.734 68.006 83.939 1.00 0.00 H ATOM 2828 HD1 TRP A 195 44.421 70.002 82.878 1.00 0.00 H ATOM 2829 HZ2 TRP A 195 48.014 66.476 83.260 1.00 0.00 H ATOM 2830 HH2 TRP A 195 49.706 66.214 81.464 1.00 0.00 H ATOM 2831 HZ3 TRP A 195 49.713 67.709 79.495 1.00 0.00 H ATOM 2832 HE3 TRP A 195 48.008 69.488 79.244 1.00 0.00 H ATOM 2833 H TRP A 195 43.014 69.897 80.719 1.00 0.00 H ATOM 2834 N GLU A 196 44.905 67.892 78.869 1.00 10.67 N ATOM 2835 CA GLU A 196 45.608 66.731 78.295 1.00 11.61 C ATOM 2836 C GLU A 196 45.424 66.685 76.805 1.00 13.63 C ATOM 2837 O GLU A 196 46.390 66.415 76.067 1.00 15.52 O ATOM 2838 CB GLU A 196 45.101 65.426 78.908 1.00 12.20 C ATOM 2839 CG GLU A 196 45.495 65.187 80.369 1.00 12.31 C ATOM 2840 CD GLU A 196 44.480 65.741 81.386 1.00 12.02 C ATOM 2841 OE1 GLU A 196 43.866 66.799 81.144 1.00 12.91 O ATOM 2842 OE2 GLU A 196 44.337 65.110 82.475 1.00 13.60 O ATOM 2843 HA GLU A 196 46.668 66.841 78.524 1.00 0.00 H ATOM 2844 HB2 GLU A 196 44.013 65.428 78.849 1.00 0.00 H ATOM 2845 HB3 GLU A 196 45.494 64.601 78.314 1.00 0.00 H ATOM 2846 HG2 GLU A 196 45.590 64.113 80.528 1.00 0.00 H ATOM 2847 HG3 GLU A 196 46.458 65.666 80.548 1.00 0.00 H ATOM 2848 H GLU A 196 44.184 67.743 79.603 1.00 0.00 H ATOM 2849 N MET A 197 44.211 66.992 76.353 1.00 12.72 N ATOM 2850 CA MET A 197 43.953 67.038 74.926 1.00 15.13 C ATOM 2851 C MET A 197 44.233 68.421 74.329 1.00 12.45 C ATOM 2852 O MET A 197 44.814 68.540 73.229 1.00 14.21 O ATOM 2853 CB MET A 197 42.514 66.664 74.656 1.00 17.74 C ATOM 2854 CG MET A 197 42.229 66.640 73.125 1.00 19.88 C ATOM 2855 SD MET A 197 40.756 65.788 72.684 1.00 24.76 S ATOM 2856 CE MET A 197 39.781 66.955 73.442 1.00 19.31 C ATOM 2857 HA MET A 197 44.629 66.326 74.452 1.00 0.00 H ATOM 2858 HB2 MET A 197 42.317 65.676 75.072 1.00 0.00 H ATOM 2859 HB3 MET A 197 41.859 67.395 75.131 1.00 0.00 H ATOM 2860 HG2 MET A 197 43.068 66.154 72.628 1.00 0.00 H ATOM 2861 HG3 MET A 197 42.148 67.669 72.775 1.00 0.00 H ATOM 2862 HE1 MET A 197 40.033 67.004 74.501 1.00 0.00 H ATOM 2863 HE2 MET A 197 39.955 67.927 72.980 1.00 0.00 H ATOM 2864 HE3 MET A 197 38.732 66.680 73.329 1.00 0.00 H ATOM 2865 H MET A 197 43.445 67.200 77.025 1.00 0.00 H ATOM 2866 N ALA A 198 43.814 69.472 75.040 1.00 11.33 N ATOM 2867 CA ALA A 198 43.972 70.820 74.487 1.00 11.65 C ATOM 2868 C ALA A 198 45.423 71.145 74.160 1.00 11.91 C ATOM 2869 O ALA A 198 45.706 71.814 73.170 1.00 11.75 O ATOM 2870 CB ALA A 198 43.390 71.845 75.421 1.00 11.84 C ATOM 2871 HA ALA A 198 43.422 70.850 73.546 1.00 0.00 H ATOM 2872 HB1 ALA A 198 42.329 71.643 75.564 1.00 0.00 H ATOM 2873 HB2 ALA A 198 43.904 71.793 76.381 1.00 0.00 H ATOM 2874 HB3 ALA A 198 43.517 72.839 74.992 1.00 0.00 H ATOM 2875 H ALA A 198 43.381 69.335 75.975 1.00 0.00 H ATOM 2876 N CYS A 199 46.357 70.675 74.978 1.00 11.55 N ATOM 2877 CA CYS A 199 47.761 71.046 74.768 1.00 11.24 C ATOM 2878 C CYS A 199 48.282 70.467 73.437 1.00 11.55 C ATOM 2879 O CYS A 199 49.194 71.035 72.834 1.00 12.80 O ATOM 2880 CB CYS A 199 48.622 70.584 75.952 1.00 12.23 C ATOM 2881 SG CYS A 199 49.007 68.836 76.033 1.00 14.43 S ATOM 2882 HA CYS A 199 47.829 72.132 74.708 1.00 0.00 H ATOM 2883 HB2 CYS A 199 48.094 70.849 76.868 1.00 0.00 H ATOM 2884 HB3 CYS A 199 49.565 71.129 75.907 1.00 0.00 H ATOM 2885 HG CYS A 199 47.835 68.112 76.115 1.00 0.00 H ATOM 2886 H CYS A 199 46.095 70.047 75.764 1.00 0.00 H ATOM 2887 N GLU A 200 47.673 69.371 72.959 1.00 11.78 N ATOM 2888 CA GLU A 200 48.124 68.811 71.685 1.00 13.60 C ATOM 2889 C GLU A 200 47.766 69.763 70.529 1.00 12.13 C ATOM 2890 O GLU A 200 48.511 69.887 69.543 1.00 12.33 O ATOM 2891 CB GLU A 200 47.450 67.471 71.409 1.00 15.39 C ATOM 2892 CG GLU A 200 47.569 66.412 72.482 1.00 21.11 C ATOM 2893 CD GLU A 200 46.671 65.188 72.202 1.00 21.47 C ATOM 2894 OE1 GLU A 200 45.924 65.145 71.173 1.00 26.11 O ATOM 2895 OE2 GLU A 200 46.746 64.230 72.989 1.00 26.25 O ATOM 2896 HA GLU A 200 49.204 68.676 71.752 1.00 0.00 H ATOM 2897 HB2 GLU A 200 46.389 67.662 71.251 1.00 0.00 H ATOM 2898 HB3 GLU A 200 47.885 67.065 70.496 1.00 0.00 H ATOM 2899 HG2 GLU A 200 48.606 66.081 72.534 1.00 0.00 H ATOM 2900 HG3 GLU A 200 47.279 66.848 73.438 1.00 0.00 H ATOM 2901 H GLU A 200 46.894 68.927 73.485 1.00 0.00 H ATOM 2902 N PHE A 201 46.592 70.383 70.619 1.00 10.51 N ATOM 2903 CA PHE A 201 46.182 71.369 69.631 1.00 10.76 C ATOM 2904 C PHE A 201 47.033 72.630 69.721 1.00 11.61 C ATOM 2905 O PHE A 201 47.414 73.201 68.701 1.00 12.26 O ATOM 2906 CB PHE A 201 44.707 71.722 69.793 1.00 12.42 C ATOM 2907 CG PHE A 201 43.777 70.598 69.381 1.00 12.15 C ATOM 2908 CD1 PHE A 201 43.458 70.399 68.037 1.00 12.84 C ATOM 2909 CD2 PHE A 201 43.256 69.715 70.315 1.00 13.64 C ATOM 2910 CE1 PHE A 201 42.608 69.371 67.656 1.00 14.06 C ATOM 2911 CE2 PHE A 201 42.423 68.676 69.924 1.00 15.02 C ATOM 2912 CZ PHE A 201 42.103 68.524 68.610 1.00 15.22 C ATOM 2913 HA PHE A 201 46.330 70.925 68.647 1.00 0.00 H ATOM 2914 HB2 PHE A 201 44.520 71.961 70.840 1.00 0.00 H ATOM 2915 HB3 PHE A 201 44.490 72.595 69.178 1.00 0.00 H ATOM 2916 HD2 PHE A 201 43.504 69.839 71.369 1.00 0.00 H ATOM 2917 HE2 PHE A 201 42.026 67.984 70.667 1.00 0.00 H ATOM 2918 HZ PHE A 201 41.435 67.716 68.311 1.00 0.00 H ATOM 2919 HE1 PHE A 201 42.343 69.237 66.607 1.00 0.00 H ATOM 2920 HD1 PHE A 201 43.881 71.058 67.279 1.00 0.00 H ATOM 2921 H PHE A 201 45.956 70.159 71.410 1.00 0.00 H ATOM 2922 N ASP A 202 47.316 73.099 70.937 1.00 11.14 N ATOM 2923 CA ASP A 202 48.149 74.293 71.081 1.00 11.76 C ATOM 2924 C ASP A 202 49.564 74.011 70.540 1.00 12.05 C ATOM 2925 O ASP A 202 50.175 74.881 69.915 1.00 13.15 O ATOM 2926 CB ASP A 202 48.161 74.652 72.567 1.00 12.22 C ATOM 2927 CG ASP A 202 48.503 76.089 72.851 1.00 13.65 C ATOM 2928 OD1 ASP A 202 48.826 76.869 71.933 1.00 16.89 O ATOM 2929 OD2 ASP A 202 48.499 76.424 74.052 1.00 14.73 O ATOM 2930 HA ASP A 202 47.757 75.133 70.507 1.00 0.00 H ATOM 2931 HB2 ASP A 202 47.171 74.448 72.976 1.00 0.00 H ATOM 2932 HB3 ASP A 202 48.896 74.020 73.066 1.00 0.00 H ATOM 2933 H ASP A 202 46.945 72.617 71.781 1.00 0.00 H ATOM 2934 N ALA A 203 50.057 72.789 70.734 1.00 11.83 N ATOM 2935 CA ALA A 203 51.405 72.423 70.267 1.00 12.63 C ATOM 2936 C ALA A 203 51.504 72.433 68.745 1.00 14.03 C ATOM 2937 O ALA A 203 52.605 72.569 68.204 1.00 15.45 O ATOM 2938 CB ALA A 203 51.821 71.081 70.805 1.00 13.49 C ATOM 2939 HA ALA A 203 52.088 73.181 70.651 1.00 0.00 H ATOM 2940 HB1 ALA A 203 51.827 71.114 71.895 1.00 0.00 H ATOM 2941 HB2 ALA A 203 51.117 70.321 70.467 1.00 0.00 H ATOM 2942 HB3 ALA A 203 52.820 70.839 70.442 1.00 0.00 H ATOM 2943 H ALA A 203 49.478 72.078 71.225 1.00 0.00 H ATOM 2944 N MET A 204 50.378 72.276 68.045 1.00 13.22 N ATOM 2945 CA MET A 204 50.428 72.412 66.595 1.00 15.54 C ATOM 2946 C MET A 204 50.014 73.815 66.124 1.00 15.78 C ATOM 2947 O MET A 204 49.933 74.057 64.916 1.00 17.51 O ATOM 2948 CB MET A 204 49.620 71.305 65.896 1.00 19.04 C ATOM 2949 CG MET A 204 48.155 71.370 66.148 1.00 18.96 C ATOM 2950 SD MET A 204 47.218 70.105 65.231 1.00 20.63 S ATOM 2951 CE MET A 204 47.529 70.678 63.563 1.00 22.51 C ATOM 2952 HA MET A 204 51.470 72.286 66.301 1.00 0.00 H ATOM 2953 HB2 MET A 204 49.787 71.386 64.822 1.00 0.00 H ATOM 2954 HB3 MET A 204 49.986 70.340 66.248 1.00 0.00 H ATOM 2955 HG2 MET A 204 47.794 72.354 65.849 1.00 0.00 H ATOM 2956 HG3 MET A 204 47.979 71.228 67.214 1.00 0.00 H ATOM 2957 HE1 MET A 204 47.146 71.692 63.451 1.00 0.00 H ATOM 2958 HE2 MET A 204 48.602 70.671 63.372 1.00 0.00 H ATOM 2959 HE3 MET A 204 47.028 70.019 62.854 1.00 0.00 H ATOM 2960 H MET A 204 49.481 72.061 68.526 1.00 0.00 H ATOM 2961 N GLY A 205 49.787 74.740 67.062 1.00 13.87 N ATOM 2962 CA GLY A 205 49.464 76.122 66.722 1.00 14.78 C ATOM 2963 C GLY A 205 48.015 76.362 66.335 1.00 14.65 C ATOM 2964 O GLY A 205 47.699 77.402 65.761 1.00 16.01 O ATOM 2965 HA3 GLY A 205 50.093 76.421 65.883 1.00 0.00 H ATOM 2966 HA2 GLY A 205 49.692 76.746 67.586 1.00 0.00 H ATOM 2967 H GLY A 205 49.842 74.467 68.064 1.00 0.00 H ATOM 2968 N ALA A 206 47.124 75.427 66.667 1.00 11.91 N ATOM 2969 CA ALA A 206 45.744 75.499 66.173 1.00 12.94 C ATOM 2970 C ALA A 206 44.850 76.393 67.000 1.00 11.31 C ATOM 2971 O ALA A 206 43.763 76.745 66.533 1.00 13.36 O ATOM 2972 CB ALA A 206 45.121 74.085 66.097 1.00 14.31 C ATOM 2973 HA ALA A 206 45.808 75.941 65.179 1.00 0.00 H ATOM 2974 HB1 ALA A 206 45.709 73.466 65.419 1.00 0.00 H ATOM 2975 HB2 ALA A 206 45.119 73.636 67.090 1.00 0.00 H ATOM 2976 HB3 ALA A 206 44.098 74.159 65.729 1.00 0.00 H ATOM 2977 H ALA A 206 47.410 74.639 67.282 1.00 0.00 H ATOM 2978 N LEU A 207 45.238 76.702 68.243 1.00 11.40 N ATOM 2979 CA LEU A 207 44.328 77.411 69.163 1.00 11.03 C ATOM 2980 C LEU A 207 44.660 78.897 69.237 1.00 11.40 C ATOM 2981 O LEU A 207 45.828 79.317 69.087 1.00 12.61 O ATOM 2982 CB LEU A 207 44.445 76.855 70.602 1.00 11.21 C ATOM 2983 CG LEU A 207 44.166 75.361 70.785 1.00 10.74 C ATOM 2984 CD1 LEU A 207 44.242 75.010 72.265 1.00 11.96 C ATOM 2985 CD2 LEU A 207 42.798 74.964 70.201 1.00 11.76 C ATOM 2986 HA LEU A 207 43.322 77.262 68.770 1.00 0.00 H ATOM 2987 HB2 LEU A 207 45.460 77.047 70.949 1.00 0.00 H ATOM 2988 HB3 LEU A 207 43.739 77.402 71.227 1.00 0.00 H ATOM 2989 HG LEU A 207 44.923 74.798 70.239 1.00 0.00 H ATOM 2990 HD21 LEU A 207 42.012 75.526 70.706 1.00 0.00 H ATOM 2991 HD22 LEU A 207 42.780 75.190 69.135 1.00 0.00 H ATOM 2992 HD23 LEU A 207 42.637 73.896 70.350 1.00 0.00 H ATOM 2993 HD11 LEU A 207 45.238 75.244 72.642 1.00 0.00 H ATOM 2994 HD12 LEU A 207 43.499 75.590 72.813 1.00 0.00 H ATOM 2995 HD13 LEU A 207 44.043 73.946 72.395 1.00 0.00 H ATOM 2996 H LEU A 207 46.192 76.439 68.564 1.00 0.00 H ATOM 2997 N SER A 208 43.640 79.686 69.546 1.00 11.05 N ATOM 2998 CA SER A 208 43.780 81.138 69.743 1.00 11.91 C ATOM 2999 C SER A 208 44.647 81.443 70.955 1.00 12.23 C ATOM 3000 O SER A 208 44.436 80.853 72.024 1.00 13.21 O ATOM 3001 CB SER A 208 42.400 81.720 69.980 1.00 11.96 C ATOM 3002 OG SER A 208 42.486 83.130 70.257 1.00 13.77 O ATOM 3003 HA SER A 208 44.249 81.571 68.860 1.00 0.00 H ATOM 3004 HB2 SER A 208 41.939 81.215 70.829 1.00 0.00 H ATOM 3005 HB3 SER A 208 41.788 81.566 69.091 1.00 0.00 H ATOM 3006 HG SER A 208 42.902 83.592 69.486 1.00 0.00 H ATOM 3007 H SER A 208 42.698 79.259 69.654 1.00 0.00 H ATOM 3008 N THR A 209 45.629 82.338 70.791 1.00 13.27 N ATOM 3009 CA THR A 209 46.503 82.680 71.908 1.00 13.58 C ATOM 3010 C THR A 209 46.610 84.167 72.201 1.00 14.94 C ATOM 3011 O THR A 209 47.167 84.535 73.227 1.00 15.88 O ATOM 3012 CB THR A 209 47.931 82.143 71.696 1.00 15.77 C ATOM 3013 OG1 THR A 209 48.516 82.824 70.592 1.00 18.89 O ATOM 3014 CG2 THR A 209 47.955 80.637 71.430 1.00 16.20 C ATOM 3015 HA THR A 209 46.023 82.204 72.763 1.00 0.00 H ATOM 3016 HB THR A 209 48.495 82.320 72.612 1.00 0.00 H ATOM 3017 HG1 THR A 209 47.972 82.663 69.781 1.00 0.00 H ATOM 3018 HG23 THR A 209 47.507 80.113 72.274 1.00 0.00 H ATOM 3019 HG21 THR A 209 47.388 80.420 70.524 1.00 0.00 H ATOM 3020 HG22 THR A 209 48.986 80.308 71.302 1.00 0.00 H ATOM 3021 H THR A 209 45.769 82.791 69.865 1.00 0.00 H ATOM 3022 N LYS A 210 46.104 85.014 71.309 1.00 15.48 N ATOM 3023 CA LYS A 210 46.353 86.470 71.426 1.00 17.55 C ATOM 3024 C LYS A 210 45.276 87.238 72.188 1.00 15.59 C ATOM 3025 O LYS A 210 45.385 88.445 72.370 1.00 18.26 O ATOM 3026 CB LYS A 210 46.516 87.107 70.029 1.00 19.61 C ATOM 3027 CG LYS A 210 47.781 86.682 69.317 1.00 23.71 C ATOM 3028 CD LYS A 210 47.859 87.218 67.898 1.00 25.75 C ATOM 3029 CE LYS A 210 49.326 87.349 67.469 1.00 30.04 C ATOM 3030 NZ LYS A 210 49.591 86.955 66.045 1.00 33.01 N ATOM 3031 HA LYS A 210 47.272 86.550 72.006 1.00 0.00 H ATOM 3032 HB2 LYS A 210 45.662 86.820 69.416 1.00 0.00 H ATOM 3033 HB3 LYS A 210 46.531 88.191 70.143 1.00 0.00 H ATOM 3034 HG2 LYS A 210 48.639 87.052 69.878 1.00 0.00 H ATOM 3035 HG3 LYS A 210 47.813 85.593 69.282 1.00 0.00 H ATOM 3036 HD2 LYS A 210 47.345 86.533 67.224 1.00 0.00 H ATOM 3037 HD3 LYS A 210 47.381 88.196 67.854 1.00 0.00 H ATOM 3038 HE2 LYS A 210 49.930 86.714 68.117 1.00 0.00 H ATOM 3039 HE3 LYS A 210 49.628 88.388 67.598 1.00 0.00 H ATOM 3040 HZ1 LYS A 210 49.320 85.961 65.906 1.00 0.00 H ATOM 3041 HZ2 LYS A 210 49.032 87.560 65.410 1.00 0.00 H ATOM 3042 HZ3 LYS A 210 50.603 87.073 65.837 1.00 0.00 H ATOM 3043 H LYS A 210 45.528 84.651 70.522 1.00 0.00 H ATOM 3044 N TYR A 211 44.228 86.539 72.622 1.00 14.55 N ATOM 3045 CA TYR A 211 43.048 87.157 73.203 1.00 14.47 C ATOM 3046 C TYR A 211 42.720 86.652 74.601 1.00 14.23 C ATOM 3047 O TYR A 211 41.573 86.749 75.046 1.00 14.98 O ATOM 3048 CB TYR A 211 41.832 86.942 72.280 1.00 17.31 C ATOM 3049 CG TYR A 211 42.047 87.563 70.915 1.00 17.11 C ATOM 3050 CD1 TYR A 211 41.961 88.940 70.744 1.00 19.65 C ATOM 3051 CD2 TYR A 211 42.386 86.774 69.804 1.00 17.15 C ATOM 3052 CE1 TYR A 211 42.182 89.512 69.484 1.00 20.77 C ATOM 3053 CE2 TYR A 211 42.623 87.326 68.551 1.00 18.18 C ATOM 3054 CZ TYR A 211 42.515 88.698 68.403 1.00 18.94 C ATOM 3055 OH TYR A 211 42.716 89.266 67.159 1.00 22.01 O ATOM 3056 HA TYR A 211 43.276 88.219 73.298 1.00 0.00 H ATOM 3057 HB3 TYR A 211 40.954 87.396 72.740 1.00 0.00 H ATOM 3058 HB2 TYR A 211 41.665 85.872 72.159 1.00 0.00 H ATOM 3059 HD2 TYR A 211 42.466 85.694 69.928 1.00 0.00 H ATOM 3060 HE2 TYR A 211 42.888 86.693 67.704 1.00 0.00 H ATOM 3061 HE1 TYR A 211 42.094 90.590 69.350 1.00 0.00 H ATOM 3062 HD1 TYR A 211 41.720 89.578 71.594 1.00 0.00 H ATOM 3063 HH TYR A 211 42.603 90.247 67.224 1.00 0.00 H ATOM 3064 H TYR A 211 44.256 85.503 72.541 1.00 0.00 H ATOM 3065 N ASN A 212 43.710 86.150 75.332 1.00 14.38 N ATOM 3066 CA ASN A 212 43.441 85.571 76.633 1.00 14.53 C ATOM 3067 C ASN A 212 42.864 86.553 77.640 1.00 16.13 C ATOM 3068 O ASN A 212 42.102 86.164 78.534 1.00 17.11 O ATOM 3069 CB ASN A 212 44.694 84.893 77.204 1.00 14.43 C ATOM 3070 CG ASN A 212 45.136 83.671 76.390 1.00 12.77 C ATOM 3071 OD1 ASN A 212 44.318 82.950 75.803 1.00 13.86 O ATOM 3072 ND2 ASN A 212 46.422 83.433 76.358 1.00 15.32 N ATOM 3073 HA ASN A 212 42.668 84.821 76.463 1.00 0.00 H ATOM 3074 HB2 ASN A 212 45.508 85.618 77.213 1.00 0.00 H ATOM 3075 HB3 ASN A 212 44.482 84.573 78.224 1.00 0.00 H ATOM 3076 HD22 ASN A 212 47.080 84.061 76.863 1.00 0.00 H ATOM 3077 HD21 ASN A 212 46.787 82.616 75.827 1.00 0.00 H ATOM 3078 H ASN A 212 44.684 86.173 74.968 1.00 0.00 H ATOM 3079 N ASP A 213 43.200 87.834 77.469 1.00 16.62 N ATOM 3080 CA ASP A 213 42.739 88.855 78.401 1.00 18.46 C ATOM 3081 C ASP A 213 41.295 89.257 78.110 1.00 18.07 C ATOM 3082 O ASP A 213 40.657 89.931 78.917 1.00 20.40 O ATOM 3083 CB ASP A 213 43.601 90.121 78.280 1.00 21.13 C ATOM 3084 CG ASP A 213 44.996 89.947 78.851 1.00 26.22 C ATOM 3085 OD1 ASP A 213 45.275 88.946 79.561 1.00 29.70 O ATOM 3086 OD2 ASP A 213 45.816 90.853 78.593 1.00 30.75 O ATOM 3087 HA ASP A 213 42.814 88.429 79.402 1.00 0.00 H ATOM 3088 HB2 ASP A 213 43.687 90.383 77.225 1.00 0.00 H ATOM 3089 HB3 ASP A 213 43.105 90.931 78.815 1.00 0.00 H ATOM 3090 H ASP A 213 43.797 88.106 76.662 1.00 0.00 H ATOM 3091 N THR A 214 40.783 88.853 76.948 1.00 17.64 N ATOM 3092 CA THR A 214 39.402 89.175 76.550 1.00 17.37 C ATOM 3093 C THR A 214 38.768 87.909 75.958 1.00 15.65 C ATOM 3094 O THR A 214 38.576 87.812 74.733 1.00 15.32 O ATOM 3095 CB THR A 214 39.341 90.300 75.503 1.00 18.03 C ATOM 3096 OG1 THR A 214 40.147 89.931 74.382 1.00 19.02 O ATOM 3097 CG2 THR A 214 39.888 91.585 76.081 1.00 18.58 C ATOM 3098 HA THR A 214 38.864 89.521 77.433 1.00 0.00 H ATOM 3099 HB THR A 214 38.304 90.450 75.204 1.00 0.00 H ATOM 3100 HG1 THR A 214 40.114 90.650 73.702 1.00 0.00 H ATOM 3101 HG23 THR A 214 39.284 91.882 76.939 1.00 0.00 H ATOM 3102 HG21 THR A 214 40.919 91.429 76.397 1.00 0.00 H ATOM 3103 HG22 THR A 214 39.853 92.367 75.322 1.00 0.00 H ATOM 3104 H THR A 214 41.376 88.293 76.303 1.00 0.00 H ATOM 3105 N PRO A 215 38.485 86.907 76.814 1.00 14.66 N ATOM 3106 CA PRO A 215 38.117 85.581 76.285 1.00 13.53 C ATOM 3107 C PRO A 215 36.966 85.573 75.326 1.00 13.63 C ATOM 3108 O PRO A 215 36.969 84.742 74.411 1.00 14.01 O ATOM 3109 CB PRO A 215 37.769 84.791 77.559 1.00 15.35 C ATOM 3110 CG PRO A 215 38.652 85.434 78.645 1.00 15.88 C ATOM 3111 CD PRO A 215 38.575 86.918 78.295 1.00 15.74 C ATOM 3112 HA PRO A 215 38.929 85.166 75.689 1.00 0.00 H ATOM 3113 HD3 PRO A 215 37.693 87.380 78.738 1.00 0.00 H ATOM 3114 HD2 PRO A 215 39.467 87.447 78.630 1.00 0.00 H ATOM 3115 HG3 PRO A 215 39.677 85.068 78.588 1.00 0.00 H ATOM 3116 HG2 PRO A 215 38.254 85.242 79.642 1.00 0.00 H ATOM 3117 HB2 PRO A 215 36.712 84.897 77.805 1.00 0.00 H ATOM 3118 HB3 PRO A 215 38.009 83.735 77.439 1.00 0.00 H ATOM 3119 N GLU A 216 35.985 86.466 75.530 1.00 13.08 N ATOM 3120 CA GLU A 216 34.815 86.456 74.683 1.00 13.99 C ATOM 3121 C GLU A 216 35.090 86.912 73.259 1.00 13.75 C ATOM 3122 O GLU A 216 34.223 86.750 72.392 1.00 15.18 O ATOM 3123 CB GLU A 216 33.688 87.282 75.293 1.00 14.95 C ATOM 3124 CG GLU A 216 33.225 86.718 76.642 1.00 18.42 C ATOM 3125 CD GLU A 216 31.923 87.287 77.129 1.00 22.88 C ATOM 3126 OE1 GLU A 216 31.446 88.275 76.527 1.00 26.71 O ATOM 3127 OE2 GLU A 216 31.389 86.758 78.142 1.00 25.08 O ATOM 3128 HA GLU A 216 34.506 85.413 74.622 1.00 0.00 H ATOM 3129 HB2 GLU A 216 34.040 88.303 75.441 1.00 0.00 H ATOM 3130 HB3 GLU A 216 32.843 87.287 74.605 1.00 0.00 H ATOM 3131 HG2 GLU A 216 33.111 85.639 76.541 1.00 0.00 H ATOM 3132 HG3 GLU A 216 33.993 86.933 77.385 1.00 0.00 H ATOM 3133 H GLU A 216 36.067 87.164 76.297 1.00 0.00 H ATOM 3134 N LYS A 217 36.269 87.487 73.033 1.00 14.61 N ATOM 3135 CA LYS A 217 36.658 87.986 71.708 1.00 14.53 C ATOM 3136 C LYS A 217 37.625 87.057 70.982 1.00 14.41 C ATOM 3137 O LYS A 217 38.010 87.333 69.850 1.00 15.35 O ATOM 3138 CB LYS A 217 37.313 89.373 71.816 1.00 17.31 C ATOM 3139 CG LYS A 217 36.528 90.357 72.606 1.00 20.06 C ATOM 3140 CD LYS A 217 35.218 90.731 71.967 1.00 23.61 C ATOM 3141 HA LYS A 217 35.735 88.041 71.131 1.00 0.00 H ATOM 3142 HB2 LYS A 217 38.288 89.255 72.288 1.00 0.00 H ATOM 3143 HB3 LYS A 217 37.444 89.769 70.809 1.00 0.00 H ATOM 3144 HG2 LYS A 217 36.324 89.928 73.587 1.00 0.00 H ATOM 3145 HG3 LYS A 217 37.126 91.261 72.723 1.00 0.00 H ATOM 3146 HD2 LYS A 217 35.406 91.172 70.988 1.00 0.00 H ATOM 3147 HD3 LYS A 217 34.603 89.838 71.853 1.00 0.00 H ATOM 3148 H LYS A 217 36.938 87.586 73.823 1.00 0.00 H ATOM 3149 N ALA A 218 38.015 85.941 71.613 1.00 13.27 N ATOM 3150 CA ALA A 218 39.047 85.084 71.023 1.00 13.26 C ATOM 3151 C ALA A 218 38.549 84.355 69.785 1.00 12.71 C ATOM 3152 O ALA A 218 39.291 84.193 68.807 1.00 14.70 O ATOM 3153 CB ALA A 218 39.573 84.079 72.068 1.00 13.91 C ATOM 3154 HA ALA A 218 39.865 85.731 70.708 1.00 0.00 H ATOM 3155 HB1 ALA A 218 40.001 84.623 72.910 1.00 0.00 H ATOM 3156 HB2 ALA A 218 38.750 83.456 72.417 1.00 0.00 H ATOM 3157 HB3 ALA A 218 40.339 83.451 71.613 1.00 0.00 H ATOM 3158 H ALA A 218 37.584 85.682 72.524 1.00 0.00 H ATOM 3159 N SER A 219 37.320 83.849 69.840 1.00 11.72 N ATOM 3160 CA SER A 219 36.760 83.069 68.735 1.00 11.64 C ATOM 3161 C SER A 219 36.030 84.064 67.848 1.00 12.19 C ATOM 3162 O SER A 219 35.109 84.749 68.317 1.00 13.77 O ATOM 3163 CB SER A 219 35.805 82.008 69.283 1.00 12.00 C ATOM 3164 OG SER A 219 35.420 81.127 68.219 1.00 11.46 O ATOM 3165 HA SER A 219 37.530 82.543 68.171 1.00 0.00 H ATOM 3166 HB2 SER A 219 34.919 82.492 69.695 1.00 0.00 H ATOM 3167 HB3 SER A 219 36.304 81.438 70.067 1.00 0.00 H ATOM 3168 HG SER A 219 34.801 80.438 68.570 1.00 0.00 H ATOM 3169 H SER A 219 36.742 84.012 70.689 1.00 0.00 H ATOM 3170 N ARG A 220 36.481 84.198 66.604 1.00 12.23 N ATOM 3171 CA ARG A 220 36.146 85.374 65.788 1.00 12.57 C ATOM 3172 C ARG A 220 36.187 84.985 64.307 1.00 12.44 C ATOM 3173 O ARG A 220 36.852 85.641 63.480 1.00 13.12 O ATOM 3174 CB ARG A 220 37.078 86.557 66.119 1.00 12.87 C ATOM 3175 CG ARG A 220 38.555 86.288 65.948 1.00 14.65 C ATOM 3176 CD ARG A 220 39.336 87.256 66.822 1.00 17.18 C ATOM 3177 NE ARG A 220 39.292 88.603 66.287 1.00 18.53 N ATOM 3178 CZ ARG A 220 39.078 89.696 67.010 1.00 20.93 C ATOM 3179 NH1 ARG A 220 38.837 89.608 68.304 1.00 22.47 N ATOM 3180 NH2 ARG A 220 39.130 90.902 66.436 1.00 22.85 N ATOM 3181 HA ARG A 220 35.136 85.711 66.020 1.00 0.00 H ATOM 3182 HB2 ARG A 220 36.810 87.389 65.467 1.00 0.00 H ATOM 3183 HB3 ARG A 220 36.906 86.840 67.157 1.00 0.00 H ATOM 3184 HG2 ARG A 220 38.778 85.264 66.247 1.00 0.00 H ATOM 3185 HG3 ARG A 220 38.835 86.430 64.904 1.00 0.00 H ATOM 3186 HD2 ARG A 220 40.374 86.928 66.875 1.00 0.00 H ATOM 3187 HD3 ARG A 220 38.905 87.257 67.823 1.00 0.00 H ATOM 3188 HE ARG A 220 39.438 88.721 65.264 1.00 0.00 H ATOM 3189 HH12 ARG A 220 38.671 90.470 68.862 1.00 0.00 H ATOM 3190 HH11 ARG A 220 38.813 88.677 68.766 1.00 0.00 H ATOM 3191 HH22 ARG A 220 38.962 91.756 67.005 1.00 0.00 H ATOM 3192 HH21 ARG A 220 39.339 90.986 65.421 1.00 0.00 H ATOM 3193 H ARG A 220 37.084 83.454 66.199 1.00 0.00 H ATOM 3194 N THR A 221 35.430 83.936 63.977 1.00 12.62 N ATOM 3195 CA THR A 221 35.383 83.404 62.632 1.00 12.65 C ATOM 3196 C THR A 221 35.146 84.544 61.622 1.00 12.92 C ATOM 3197 O THR A 221 34.252 85.374 61.800 1.00 14.60 O ATOM 3198 CB THR A 221 34.243 82.375 62.538 1.00 12.32 C ATOM 3199 OG1 THR A 221 34.375 81.462 63.644 1.00 13.63 O ATOM 3200 CG2 THR A 221 34.296 81.622 61.200 1.00 13.65 C ATOM 3201 HA THR A 221 36.332 82.922 62.398 1.00 0.00 H ATOM 3202 HB THR A 221 33.279 82.881 62.585 1.00 0.00 H ATOM 3203 HG1 THR A 221 33.650 80.789 63.603 1.00 0.00 H ATOM 3204 HG23 THR A 221 34.194 82.333 60.380 1.00 0.00 H ATOM 3205 HG21 THR A 221 35.250 81.102 61.115 1.00 0.00 H ATOM 3206 HG22 THR A 221 33.481 80.899 61.159 1.00 0.00 H ATOM 3207 H THR A 221 34.852 83.484 64.714 1.00 0.00 H ATOM 3208 N TYR A 222 35.961 84.562 60.573 1.00 13.58 N ATOM 3209 CA TYR A 222 35.889 85.552 59.478 1.00 15.57 C ATOM 3210 C TYR A 222 36.497 86.893 59.774 1.00 17.03 C ATOM 3211 O TYR A 222 36.626 87.708 58.871 1.00 18.14 O ATOM 3212 CB TYR A 222 34.469 85.738 58.902 1.00 16.66 C ATOM 3213 CG TYR A 222 33.788 84.449 58.566 1.00 16.91 C ATOM 3214 CD1 TYR A 222 34.428 83.470 57.797 1.00 18.10 C ATOM 3215 CD2 TYR A 222 32.517 84.195 59.044 1.00 16.57 C ATOM 3216 CE1 TYR A 222 33.819 82.271 57.514 1.00 18.41 C ATOM 3217 CE2 TYR A 222 31.868 83.003 58.747 1.00 17.14 C ATOM 3218 CZ TYR A 222 32.526 82.033 57.996 1.00 17.92 C ATOM 3219 OH TYR A 222 31.925 80.837 57.718 1.00 18.68 O ATOM 3220 HA TYR A 222 36.517 85.089 58.717 1.00 0.00 H ATOM 3221 HB3 TYR A 222 34.540 86.338 57.995 1.00 0.00 H ATOM 3222 HB2 TYR A 222 33.864 86.266 59.639 1.00 0.00 H ATOM 3223 HD2 TYR A 222 32.016 84.940 59.663 1.00 0.00 H ATOM 3224 HE2 TYR A 222 30.851 82.829 59.099 1.00 0.00 H ATOM 3225 HE1 TYR A 222 34.336 81.515 56.922 1.00 0.00 H ATOM 3226 HD1 TYR A 222 35.430 83.663 57.415 1.00 0.00 H ATOM 3227 HH TYR A 222 32.538 80.278 57.178 1.00 0.00 H ATOM 3228 H TYR A 222 36.699 83.831 60.519 1.00 0.00 H ATOM 3229 N ASP A 223 36.885 87.136 61.019 1.00 16.53 N ATOM 3230 CA ASP A 223 37.571 88.391 61.347 1.00 17.26 C ATOM 3231 C ASP A 223 39.031 88.347 60.863 1.00 18.02 C ATOM 3232 O ASP A 223 39.687 87.289 60.963 1.00 16.69 O ATOM 3233 CB ASP A 223 37.525 88.639 62.863 1.00 18.20 C ATOM 3234 CG ASP A 223 38.278 89.889 63.266 1.00 19.65 C ATOM 3235 OD1 ASP A 223 37.717 90.980 63.085 1.00 22.14 O ATOM 3236 OD2 ASP A 223 39.444 89.775 63.694 1.00 19.66 O ATOM 3237 HA ASP A 223 37.060 89.209 60.839 1.00 0.00 H ATOM 3238 HB2 ASP A 223 36.484 88.743 63.170 1.00 0.00 H ATOM 3239 HB3 ASP A 223 37.969 87.783 63.372 1.00 0.00 H ATOM 3240 H ASP A 223 36.702 86.435 61.765 1.00 0.00 H ATOM 3241 N ALA A 224 39.541 89.496 60.381 1.00 18.01 N ATOM 3242 CA ALA A 224 40.882 89.560 59.801 1.00 18.75 C ATOM 3243 C ALA A 224 41.990 89.213 60.776 1.00 19.33 C ATOM 3244 O ALA A 224 43.090 88.847 60.346 1.00 22.87 O ATOM 3245 CB ALA A 224 41.132 90.906 59.195 1.00 19.05 C ATOM 3246 HA ALA A 224 40.905 88.795 59.025 1.00 0.00 H ATOM 3247 HB1 ALA A 224 40.399 91.092 58.410 1.00 0.00 H ATOM 3248 HB2 ALA A 224 41.043 91.672 59.965 1.00 0.00 H ATOM 3249 HB3 ALA A 224 42.135 90.931 58.770 1.00 0.00 H ATOM 3250 H ALA A 224 38.966 90.361 60.422 1.00 0.00 H ATOM 3251 N HIS A 225 41.691 89.293 62.072 1.00 20.23 N ATOM 3252 CA HIS A 225 42.699 89.055 63.089 1.00 19.86 C ATOM 3253 C HIS A 225 42.448 87.800 63.886 1.00 18.53 C ATOM 3254 O HIS A 225 42.945 87.664 65.012 1.00 19.61 O ATOM 3255 CB HIS A 225 42.865 90.268 64.003 1.00 22.61 C ATOM 3256 CG HIS A 225 43.328 91.475 63.266 1.00 24.76 C ATOM 3257 ND1 HIS A 225 42.452 92.429 62.811 1.00 26.21 N ATOM 3258 CD2 HIS A 225 44.554 91.842 62.831 1.00 26.88 C ATOM 3259 CE1 HIS A 225 43.122 93.360 62.153 1.00 26.47 C ATOM 3260 NE2 HIS A 225 44.401 93.026 62.150 1.00 28.62 N ATOM 3261 HA HIS A 225 43.638 88.898 62.557 1.00 0.00 H ATOM 3262 HB2 HIS A 225 41.905 90.489 64.469 1.00 0.00 H ATOM 3263 HB3 HIS A 225 43.596 90.027 64.775 1.00 0.00 H ATOM 3264 HD2 HIS A 225 45.487 91.301 62.990 1.00 0.00 H ATOM 3265 HE1 HIS A 225 42.693 94.250 61.692 1.00 0.00 H ATOM 3266 H HIS A 225 40.720 89.530 62.359 1.00 0.00 H ATOM 3267 N ARG A 226 41.706 86.863 63.289 1.00 17.27 N ATOM 3268 CA ARG A 226 41.529 85.554 63.937 1.00 15.44 C ATOM 3269 C ARG A 226 42.883 84.854 64.060 1.00 15.96 C ATOM 3270 O ARG A 226 43.790 85.100 63.247 1.00 16.04 O ATOM 3271 CB ARG A 226 40.562 84.731 63.135 1.00 15.37 C ATOM 3272 CG ARG A 226 41.042 84.380 61.734 1.00 15.08 C ATOM 3273 CD ARG A 226 39.837 83.881 60.918 1.00 17.13 C ATOM 3274 NE ARG A 226 40.213 83.477 59.579 1.00 17.40 N ATOM 3275 CZ ARG A 226 40.270 84.313 58.543 1.00 19.98 C ATOM 3276 NH1 ARG A 226 40.005 85.606 58.700 1.00 21.01 N ATOM 3277 NH2 ARG A 226 40.609 83.871 57.338 1.00 21.09 N ATOM 3278 HA ARG A 226 41.123 85.684 64.940 1.00 0.00 H ATOM 3279 HB2 ARG A 226 40.376 83.802 63.674 1.00 0.00 H ATOM 3280 HB3 ARG A 226 39.631 85.290 63.046 1.00 0.00 H ATOM 3281 HG2 ARG A 226 41.468 85.263 61.259 1.00 0.00 H ATOM 3282 HG3 ARG A 226 41.799 83.598 61.789 1.00 0.00 H ATOM 3283 HD2 ARG A 226 39.102 84.683 60.850 1.00 0.00 H ATOM 3284 HD3 ARG A 226 39.394 83.027 61.431 1.00 0.00 H ATOM 3285 HE ARG A 226 40.452 82.478 59.417 1.00 0.00 H ATOM 3286 HH12 ARG A 226 40.053 86.249 57.884 1.00 0.00 H ATOM 3287 HH11 ARG A 226 39.750 85.974 59.639 1.00 0.00 H ATOM 3288 HH22 ARG A 226 40.651 84.531 56.535 1.00 0.00 H ATOM 3289 HH21 ARG A 226 40.833 82.865 57.197 1.00 0.00 H ATOM 3290 H ARG A 226 41.256 87.058 62.372 1.00 0.00 H ATOM 3291 N ASP A 227 43.033 83.977 65.059 1.00 14.15 N ATOM 3292 CA ASP A 227 44.320 83.356 65.262 1.00 14.44 C ATOM 3293 C ASP A 227 44.187 81.947 65.788 1.00 14.08 C ATOM 3294 O ASP A 227 45.051 81.491 66.517 1.00 15.52 O ATOM 3295 CB ASP A 227 45.208 84.194 66.203 1.00 16.28 C ATOM 3296 CG ASP A 227 44.778 84.099 67.677 1.00 16.21 C ATOM 3297 OD1 ASP A 227 43.549 84.029 67.930 1.00 17.33 O ATOM 3298 OD2 ASP A 227 45.671 84.088 68.567 1.00 18.49 O ATOM 3299 HA ASP A 227 44.802 83.307 64.285 1.00 0.00 H ATOM 3300 HB2 ASP A 227 46.236 83.841 66.117 1.00 0.00 H ATOM 3301 HB3 ASP A 227 45.156 85.237 65.892 1.00 0.00 H ATOM 3302 H ASP A 227 42.233 83.746 65.681 1.00 0.00 H ATOM 3303 N GLY A 228 43.122 81.244 65.401 1.00 13.41 N ATOM 3304 CA GLY A 228 42.945 79.833 65.786 1.00 12.29 C ATOM 3305 C GLY A 228 41.637 79.615 66.537 1.00 11.16 C ATOM 3306 O GLY A 228 40.959 80.570 66.973 1.00 12.40 O ATOM 3307 HA3 GLY A 228 43.775 79.534 66.427 1.00 0.00 H ATOM 3308 HA2 GLY A 228 42.943 79.218 64.886 1.00 0.00 H ATOM 3309 H GLY A 228 42.398 81.703 64.812 1.00 0.00 H ATOM 3310 N PHE A 229 41.279 78.361 66.711 1.00 10.66 N ATOM 3311 CA PHE A 229 40.015 78.079 67.340 1.00 10.48 C ATOM 3312 C PHE A 229 40.120 78.099 68.861 1.00 10.43 C ATOM 3313 O PHE A 229 41.218 78.094 69.434 1.00 10.89 O ATOM 3314 CB PHE A 229 39.364 76.774 66.802 1.00 11.00 C ATOM 3315 CG PHE A 229 40.000 75.470 67.238 1.00 10.72 C ATOM 3316 CD1 PHE A 229 39.583 74.842 68.408 1.00 11.31 C ATOM 3317 CD2 PHE A 229 40.855 74.785 66.400 1.00 12.73 C ATOM 3318 CE1 PHE A 229 40.045 73.566 68.744 1.00 12.08 C ATOM 3319 CE2 PHE A 229 41.334 73.513 66.741 1.00 13.62 C ATOM 3320 CZ PHE A 229 40.931 72.924 67.914 1.00 12.78 C ATOM 3321 HA PHE A 229 39.338 78.888 67.065 1.00 0.00 H ATOM 3322 HB2 PHE A 229 38.325 76.762 67.131 1.00 0.00 H ATOM 3323 HB3 PHE A 229 39.398 76.811 65.713 1.00 0.00 H ATOM 3324 HD2 PHE A 229 41.163 75.240 65.458 1.00 0.00 H ATOM 3325 HE2 PHE A 229 42.024 72.993 66.077 1.00 0.00 H ATOM 3326 HZ PHE A 229 41.316 71.942 68.188 1.00 0.00 H ATOM 3327 HE1 PHE A 229 39.704 73.083 69.660 1.00 0.00 H ATOM 3328 HD1 PHE A 229 38.886 75.353 69.072 1.00 0.00 H ATOM 3329 H PHE A 229 41.899 77.586 66.399 1.00 0.00 H ATOM 3330 N VAL A 230 38.965 78.157 69.514 1.00 9.83 N ATOM 3331 CA VAL A 230 38.905 78.109 70.968 1.00 10.12 C ATOM 3332 C VAL A 230 38.293 76.763 71.317 1.00 10.15 C ATOM 3333 O VAL A 230 37.181 76.440 70.882 1.00 10.40 O ATOM 3334 CB VAL A 230 38.016 79.220 71.519 1.00 10.39 C ATOM 3335 CG1 VAL A 230 37.800 79.024 73.006 1.00 11.63 C ATOM 3336 CG2 VAL A 230 38.647 80.583 71.241 1.00 11.91 C ATOM 3337 HA VAL A 230 39.898 78.240 71.397 1.00 0.00 H ATOM 3338 HB VAL A 230 37.047 79.180 71.021 1.00 0.00 H ATOM 3339 HG11 VAL A 230 37.319 78.061 73.178 1.00 0.00 H ATOM 3340 HG12 VAL A 230 38.762 79.048 73.518 1.00 0.00 H ATOM 3341 HG13 VAL A 230 37.164 79.823 73.388 1.00 0.00 H ATOM 3342 HG21 VAL A 230 39.624 80.634 71.721 1.00 0.00 H ATOM 3343 HG22 VAL A 230 38.762 80.716 70.165 1.00 0.00 H ATOM 3344 HG23 VAL A 230 38.004 81.368 71.639 1.00 0.00 H ATOM 3345 H VAL A 230 38.081 78.239 68.973 1.00 0.00 H ATOM 3346 N ILE A 231 39.030 75.937 72.041 1.00 9.89 N ATOM 3347 CA ILE A 231 38.555 74.574 72.275 1.00 9.62 C ATOM 3348 C ILE A 231 37.376 74.590 73.272 1.00 9.28 C ATOM 3349 O ILE A 231 37.290 75.469 74.154 1.00 10.76 O ATOM 3350 CB ILE A 231 39.730 73.694 72.769 1.00 10.49 C ATOM 3351 CG1 ILE A 231 39.394 72.207 72.676 1.00 11.51 C ATOM 3352 CG2 ILE A 231 40.161 74.126 74.192 1.00 11.55 C ATOM 3353 CD1 ILE A 231 40.652 71.325 72.668 1.00 14.85 C ATOM 3354 HA ILE A 231 38.185 74.141 71.345 1.00 0.00 H ATOM 3355 HB ILE A 231 40.585 73.848 72.111 1.00 0.00 H ATOM 3356 HG12 ILE A 231 38.778 71.932 73.532 1.00 0.00 H ATOM 3357 HG13 ILE A 231 38.836 72.030 71.757 1.00 0.00 H ATOM 3358 HD11 ILE A 231 41.272 71.586 71.810 1.00 0.00 H ATOM 3359 HD12 ILE A 231 41.214 71.488 73.587 1.00 0.00 H ATOM 3360 HD13 ILE A 231 40.359 70.277 72.601 1.00 0.00 H ATOM 3361 HG21 ILE A 231 40.479 75.168 74.173 1.00 0.00 H ATOM 3362 HG22 ILE A 231 39.319 74.014 74.875 1.00 0.00 H ATOM 3363 HG23 ILE A 231 40.988 73.499 74.526 1.00 0.00 H ATOM 3364 H ILE A 231 39.937 76.253 72.439 1.00 0.00 H ATOM 3365 N ALA A 232 36.463 73.640 73.116 1.00 9.39 N ATOM 3366 CA ALA A 232 35.274 73.592 73.947 1.00 9.31 C ATOM 3367 C ALA A 232 34.932 72.124 74.206 1.00 9.64 C ATOM 3368 O ALA A 232 35.463 71.215 73.546 1.00 10.37 O ATOM 3369 CB ALA A 232 34.104 74.255 73.216 1.00 10.69 C ATOM 3370 HA ALA A 232 35.454 74.118 74.885 1.00 0.00 H ATOM 3371 HB1 ALA A 232 34.353 75.294 73.002 1.00 0.00 H ATOM 3372 HB2 ALA A 232 33.914 73.726 72.282 1.00 0.00 H ATOM 3373 HB3 ALA A 232 33.215 74.216 73.845 1.00 0.00 H ATOM 3374 H ALA A 232 36.602 72.915 72.383 1.00 0.00 H ATOM 3375 N GLY A 233 34.046 71.887 75.164 1.00 11.96 N ATOM 3376 CA GLY A 233 33.514 70.534 75.437 1.00 12.02 C ATOM 3377 C GLY A 233 32.025 70.574 75.535 1.00 11.10 C ATOM 3378 O GLY A 233 31.436 71.655 75.580 1.00 12.42 O ATOM 3379 HA3 GLY A 233 33.927 70.168 76.377 1.00 0.00 H ATOM 3380 HA2 GLY A 233 33.804 69.863 74.628 1.00 0.00 H ATOM 3381 H GLY A 233 33.713 72.682 75.745 1.00 0.00 H ATOM 3382 N GLY A 234 31.424 69.408 75.659 1.00 9.58 N ATOM 3383 CA GLY A 234 29.996 69.302 75.818 1.00 9.43 C ATOM 3384 C GLY A 234 29.444 68.085 75.101 1.00 9.21 C ATOM 3385 O GLY A 234 30.170 67.145 74.760 1.00 9.60 O ATOM 3386 HA3 GLY A 234 29.527 70.197 75.409 1.00 0.00 H ATOM 3387 HA2 GLY A 234 29.763 69.224 76.880 1.00 0.00 H ATOM 3388 H GLY A 234 31.996 68.540 75.642 1.00 0.00 H ATOM 3389 N GLY A 235 28.123 68.053 74.923 1.00 9.33 N ATOM 3390 CA GLY A 235 27.458 66.926 74.306 1.00 9.31 C ATOM 3391 C GLY A 235 26.226 67.357 73.543 1.00 8.36 C ATOM 3392 O GLY A 235 25.722 68.486 73.736 1.00 8.50 O ATOM 3393 HA3 GLY A 235 27.165 66.219 75.082 1.00 0.00 H ATOM 3394 HA2 GLY A 235 28.149 66.441 73.617 1.00 0.00 H ATOM 3395 H GLY A 235 27.553 68.864 75.238 1.00 0.00 H ATOM 3396 N GLY A 236 25.706 66.463 72.716 1.00 8.57 N ATOM 3397 CA GLY A 236 24.422 66.693 72.089 1.00 8.09 C ATOM 3398 C GLY A 236 23.875 65.365 71.626 1.00 7.48 C ATOM 3399 O GLY A 236 24.634 64.418 71.377 1.00 8.99 O ATOM 3400 HA3 GLY A 236 24.543 67.360 71.235 1.00 0.00 H ATOM 3401 HA2 GLY A 236 23.737 67.144 72.807 1.00 0.00 H ATOM 3402 H GLY A 236 26.226 65.585 72.515 1.00 0.00 H ATOM 3403 N MET A 237 22.545 65.298 71.483 1.00 8.88 N ATOM 3404 CA MET A 237 21.910 64.080 70.989 1.00 8.17 C ATOM 3405 C MET A 237 20.613 64.489 70.298 1.00 8.61 C ATOM 3406 O MET A 237 19.903 65.394 70.788 1.00 9.63 O ATOM 3407 CB MET A 237 21.618 63.120 72.147 1.00 9.31 C ATOM 3408 CG MET A 237 21.329 61.691 71.708 1.00 10.61 C ATOM 3409 SD MET A 237 22.793 60.810 71.086 1.00 11.62 S ATOM 3410 CE MET A 237 23.816 60.630 72.524 1.00 13.08 C ATOM 3411 HA MET A 237 22.569 63.562 70.292 1.00 0.00 H ATOM 3412 HB2 MET A 237 22.484 63.107 72.809 1.00 0.00 H ATOM 3413 HB3 MET A 237 20.751 63.493 72.692 1.00 0.00 H ATOM 3414 HG2 MET A 237 20.581 61.718 70.916 1.00 0.00 H ATOM 3415 HG3 MET A 237 20.933 61.141 72.562 1.00 0.00 H ATOM 3416 HE1 MET A 237 24.063 61.616 72.919 1.00 0.00 H ATOM 3417 HE2 MET A 237 23.279 60.058 73.281 1.00 0.00 H ATOM 3418 HE3 MET A 237 24.733 60.106 72.253 1.00 0.00 H ATOM 3419 H MET A 237 21.959 66.122 71.726 1.00 0.00 H ATOM 3420 N VAL A 238 20.336 63.850 69.162 1.00 8.36 N ATOM 3421 CA VAL A 238 19.057 64.008 68.489 1.00 8.70 C ATOM 3422 C VAL A 238 18.421 62.641 68.338 1.00 8.16 C ATOM 3423 O VAL A 238 19.110 61.619 68.210 1.00 9.79 O ATOM 3424 CB VAL A 238 19.205 64.719 67.123 1.00 9.27 C ATOM 3425 CG1 VAL A 238 19.622 66.189 67.360 1.00 10.12 C ATOM 3426 CG2 VAL A 238 20.159 63.978 66.152 1.00 9.67 C ATOM 3427 HA VAL A 238 18.412 64.648 69.092 1.00 0.00 H ATOM 3428 HB VAL A 238 18.238 64.703 66.621 1.00 0.00 H ATOM 3429 HG11 VAL A 238 18.858 66.691 67.954 1.00 0.00 H ATOM 3430 HG12 VAL A 238 20.573 66.214 67.892 1.00 0.00 H ATOM 3431 HG13 VAL A 238 19.728 66.695 66.400 1.00 0.00 H ATOM 3432 HG21 VAL A 238 21.151 63.911 66.599 1.00 0.00 H ATOM 3433 HG22 VAL A 238 19.776 62.975 65.963 1.00 0.00 H ATOM 3434 HG23 VAL A 238 20.219 64.528 65.213 1.00 0.00 H ATOM 3435 H VAL A 238 21.053 63.222 68.746 1.00 0.00 H ATOM 3436 N VAL A 239 17.094 62.641 68.257 1.00 9.18 N ATOM 3437 CA VAL A 239 16.361 61.413 68.009 1.00 9.08 C ATOM 3438 C VAL A 239 16.048 61.385 66.509 1.00 9.10 C ATOM 3439 O VAL A 239 15.255 62.213 66.039 1.00 10.58 O ATOM 3440 CB VAL A 239 15.049 61.363 68.828 1.00 9.59 C ATOM 3441 CG1 VAL A 239 14.356 59.994 68.601 1.00 11.03 C ATOM 3442 CG2 VAL A 239 15.321 61.612 70.313 1.00 11.93 C ATOM 3443 HA VAL A 239 16.954 60.550 68.311 1.00 0.00 H ATOM 3444 HB VAL A 239 14.382 62.155 68.488 1.00 0.00 H ATOM 3445 HG11 VAL A 239 14.131 59.874 67.541 1.00 0.00 H ATOM 3446 HG12 VAL A 239 15.021 59.193 68.926 1.00 0.00 H ATOM 3447 HG13 VAL A 239 13.431 59.956 69.177 1.00 0.00 H ATOM 3448 HG21 VAL A 239 15.999 60.846 70.690 1.00 0.00 H ATOM 3449 HG22 VAL A 239 15.775 62.595 70.438 1.00 0.00 H ATOM 3450 HG23 VAL A 239 14.382 61.571 70.865 1.00 0.00 H ATOM 3451 H VAL A 239 16.574 63.534 68.373 1.00 0.00 H ATOM 3452 N VAL A 240 16.710 60.478 65.773 1.00 9.00 N ATOM 3453 CA VAL A 240 16.455 60.318 64.337 1.00 9.38 C ATOM 3454 C VAL A 240 15.431 59.187 64.205 1.00 9.35 C ATOM 3455 O VAL A 240 15.626 58.098 64.749 1.00 10.99 O ATOM 3456 CB VAL A 240 17.762 59.971 63.585 1.00 9.84 C ATOM 3457 CG1 VAL A 240 17.517 59.896 62.052 1.00 12.69 C ATOM 3458 CG2 VAL A 240 18.859 60.994 63.884 1.00 10.13 C ATOM 3459 HA VAL A 240 16.077 61.241 63.898 1.00 0.00 H ATOM 3460 HB VAL A 240 18.092 58.994 63.938 1.00 0.00 H ATOM 3461 HG11 VAL A 240 16.776 59.125 61.841 1.00 0.00 H ATOM 3462 HG12 VAL A 240 17.153 60.860 61.696 1.00 0.00 H ATOM 3463 HG13 VAL A 240 18.452 59.651 61.548 1.00 0.00 H ATOM 3464 HG21 VAL A 240 18.527 61.983 63.569 1.00 0.00 H ATOM 3465 HG22 VAL A 240 19.064 61.002 64.954 1.00 0.00 H ATOM 3466 HG23 VAL A 240 19.765 60.723 63.341 1.00 0.00 H ATOM 3467 H VAL A 240 17.421 59.874 66.232 1.00 0.00 H ATOM 3468 N GLU A 241 14.337 59.447 63.495 1.00 10.32 N ATOM 3469 CA GLU A 241 13.228 58.539 63.499 1.00 9.86 C ATOM 3470 C GLU A 241 12.664 58.410 62.093 1.00 10.22 C ATOM 3471 O GLU A 241 12.598 59.386 61.326 1.00 10.57 O ATOM 3472 CB GLU A 241 12.182 59.079 64.472 1.00 11.41 C ATOM 3473 CG GLU A 241 11.036 58.150 64.714 1.00 12.63 C ATOM 3474 CD GLU A 241 10.220 58.498 65.967 1.00 13.61 C ATOM 3475 OE1 GLU A 241 10.563 59.453 66.713 1.00 14.52 O ATOM 3476 OE2 GLU A 241 9.213 57.799 66.190 1.00 15.22 O ATOM 3477 HA GLU A 241 13.539 57.545 63.819 1.00 0.00 H ATOM 3478 HB2 GLU A 241 12.671 59.276 65.426 1.00 0.00 H ATOM 3479 HB3 GLU A 241 11.788 60.012 64.068 1.00 0.00 H ATOM 3480 HG2 GLU A 241 10.373 58.186 63.849 1.00 0.00 H ATOM 3481 HG3 GLU A 241 11.429 57.139 64.827 1.00 0.00 H ATOM 3482 H GLU A 241 14.286 60.319 62.931 1.00 0.00 H ATOM 3483 N GLU A 242 12.199 57.199 61.781 1.00 10.66 N ATOM 3484 CA GLU A 242 11.556 57.009 60.493 1.00 10.46 C ATOM 3485 C GLU A 242 10.229 57.797 60.490 1.00 10.42 C ATOM 3486 O GLU A 242 9.490 57.771 61.496 1.00 11.07 O ATOM 3487 CB GLU A 242 11.341 55.515 60.240 1.00 11.94 C ATOM 3488 CG GLU A 242 10.846 55.189 58.835 1.00 12.85 C ATOM 3489 CD GLU A 242 9.312 55.269 58.721 1.00 14.84 C ATOM 3490 OE1 GLU A 242 8.633 54.873 59.685 1.00 15.75 O ATOM 3491 OE2 GLU A 242 8.781 55.724 57.675 1.00 15.80 O ATOM 3492 HA GLU A 242 12.182 57.385 59.684 1.00 0.00 H ATOM 3493 HB2 GLU A 242 12.289 55.000 60.398 1.00 0.00 H ATOM 3494 HB3 GLU A 242 10.606 55.148 60.956 1.00 0.00 H ATOM 3495 HG2 GLU A 242 11.287 55.898 58.135 1.00 0.00 H ATOM 3496 HG3 GLU A 242 11.165 54.179 58.577 1.00 0.00 H ATOM 3497 H GLU A 242 12.295 56.406 62.447 1.00 0.00 H ATOM 3498 N LEU A 243 9.901 58.446 59.364 1.00 10.72 N ATOM 3499 CA LEU A 243 8.785 59.365 59.305 1.00 12.11 C ATOM 3500 C LEU A 243 7.442 58.752 59.690 1.00 12.14 C ATOM 3501 O LEU A 243 6.706 59.313 60.503 1.00 11.96 O ATOM 3502 CB LEU A 243 8.704 59.956 57.905 1.00 13.03 C ATOM 3503 CG LEU A 243 7.502 60.853 57.635 1.00 13.88 C ATOM 3504 CD1 LEU A 243 7.457 62.077 58.561 1.00 14.69 C ATOM 3505 CD2 LEU A 243 7.535 61.259 56.183 1.00 16.39 C ATOM 3506 HA LEU A 243 8.978 60.136 60.051 1.00 0.00 H ATOM 3507 HB2 LEU A 243 9.606 60.545 57.737 1.00 0.00 H ATOM 3508 HB3 LEU A 243 8.673 59.130 57.194 1.00 0.00 H ATOM 3509 HG LEU A 243 6.590 60.295 57.848 1.00 0.00 H ATOM 3510 HD21 LEU A 243 8.460 61.799 55.979 1.00 0.00 H ATOM 3511 HD22 LEU A 243 7.487 60.368 55.557 1.00 0.00 H ATOM 3512 HD23 LEU A 243 6.682 61.903 55.968 1.00 0.00 H ATOM 3513 HD11 LEU A 243 7.401 61.745 59.598 1.00 0.00 H ATOM 3514 HD12 LEU A 243 8.358 62.673 58.418 1.00 0.00 H ATOM 3515 HD13 LEU A 243 6.580 62.679 58.323 1.00 0.00 H ATOM 3516 H LEU A 243 10.466 58.284 58.506 1.00 0.00 H ATOM 3517 N GLU A 244 7.099 57.608 59.117 1.00 12.60 N ATOM 3518 CA GLU A 244 5.772 57.065 59.392 1.00 13.85 C ATOM 3519 C GLU A 244 5.649 56.633 60.837 1.00 13.60 C ATOM 3520 O GLU A 244 4.594 56.790 61.455 1.00 14.86 O ATOM 3521 CB GLU A 244 5.463 55.922 58.431 1.00 15.56 C ATOM 3522 CG GLU A 244 5.299 56.414 56.961 1.00 16.57 C ATOM 3523 CD GLU A 244 5.299 55.310 55.881 1.00 17.46 C ATOM 3524 OE1 GLU A 244 5.360 54.110 56.233 1.00 20.74 O ATOM 3525 OE2 GLU A 244 5.257 55.655 54.665 1.00 20.64 O ATOM 3526 HA GLU A 244 5.033 57.849 59.231 1.00 0.00 H ATOM 3527 HB2 GLU A 244 6.279 55.200 58.471 1.00 0.00 H ATOM 3528 HB3 GLU A 244 4.537 55.440 58.745 1.00 0.00 H ATOM 3529 HG2 GLU A 244 4.353 56.951 56.891 1.00 0.00 H ATOM 3530 HG3 GLU A 244 6.120 57.097 56.742 1.00 0.00 H ATOM 3531 H GLU A 244 7.759 57.109 58.487 1.00 0.00 H ATOM 3532 N HIS A 245 6.745 56.119 61.393 1.00 13.00 N ATOM 3533 CA HIS A 245 6.794 55.736 62.796 1.00 12.75 C ATOM 3534 C HIS A 245 6.537 56.947 63.696 1.00 12.58 C ATOM 3535 O HIS A 245 5.780 56.870 64.666 1.00 14.09 O ATOM 3536 CB HIS A 245 8.173 55.088 63.082 1.00 13.24 C ATOM 3537 CG HIS A 245 8.315 54.488 64.447 1.00 13.89 C ATOM 3538 ND1 HIS A 245 8.637 55.241 65.560 1.00 15.06 N ATOM 3539 CD2 HIS A 245 8.210 53.205 64.869 1.00 15.04 C ATOM 3540 CE1 HIS A 245 8.681 54.449 66.620 1.00 15.26 C ATOM 3541 NE2 HIS A 245 8.425 53.207 66.226 1.00 16.58 N ATOM 3542 HA HIS A 245 6.010 55.011 63.014 1.00 0.00 H ATOM 3543 HB2 HIS A 245 8.337 54.300 62.347 1.00 0.00 H ATOM 3544 HB3 HIS A 245 8.939 55.855 62.967 1.00 0.00 H ATOM 3545 HD2 HIS A 245 7.995 52.335 64.249 1.00 0.00 H ATOM 3546 HE1 HIS A 245 8.892 54.763 67.642 1.00 0.00 H ATOM 3547 H HIS A 245 7.593 55.987 60.805 1.00 0.00 H ATOM 3548 N ALA A 246 7.177 58.067 63.359 1.00 12.65 N ATOM 3549 CA ALA A 246 7.042 59.292 64.135 1.00 12.19 C ATOM 3550 C ALA A 246 5.601 59.802 64.087 1.00 11.92 C ATOM 3551 O ALA A 246 4.995 60.111 65.128 1.00 13.19 O ATOM 3552 CB ALA A 246 8.024 60.327 63.616 1.00 12.68 C ATOM 3553 HA ALA A 246 7.276 59.091 65.180 1.00 0.00 H ATOM 3554 HB1 ALA A 246 9.040 59.943 63.713 1.00 0.00 H ATOM 3555 HB2 ALA A 246 7.811 60.534 62.567 1.00 0.00 H ATOM 3556 HB3 ALA A 246 7.924 61.244 64.196 1.00 0.00 H ATOM 3557 H ALA A 246 7.790 58.066 62.519 1.00 0.00 H ATOM 3558 N LEU A 247 5.038 59.853 62.892 1.00 12.96 N ATOM 3559 CA LEU A 247 3.664 60.336 62.750 1.00 13.72 C ATOM 3560 C LEU A 247 2.678 59.425 63.462 1.00 14.14 C ATOM 3561 O LEU A 247 1.735 59.908 64.104 1.00 16.00 O ATOM 3562 CB LEU A 247 3.310 60.438 61.281 1.00 15.68 C ATOM 3563 CG LEU A 247 4.030 61.551 60.510 1.00 16.96 C ATOM 3564 CD1 LEU A 247 3.849 61.300 59.030 1.00 18.36 C ATOM 3565 CD2 LEU A 247 3.556 62.945 60.922 1.00 19.22 C ATOM 3566 HA LEU A 247 3.600 61.321 63.212 1.00 0.00 H ATOM 3567 HB2 LEU A 247 3.555 59.487 60.808 1.00 0.00 H ATOM 3568 HB3 LEU A 247 2.237 60.614 61.204 1.00 0.00 H ATOM 3569 HG LEU A 247 5.092 61.527 60.754 1.00 0.00 H ATOM 3570 HD21 LEU A 247 2.487 63.036 60.727 1.00 0.00 H ATOM 3571 HD22 LEU A 247 3.747 63.093 61.985 1.00 0.00 H ATOM 3572 HD23 LEU A 247 4.097 63.696 60.347 1.00 0.00 H ATOM 3573 HD11 LEU A 247 4.276 60.331 58.772 1.00 0.00 H ATOM 3574 HD12 LEU A 247 2.786 61.306 58.789 1.00 0.00 H ATOM 3575 HD13 LEU A 247 4.355 62.083 58.465 1.00 0.00 H ATOM 3576 H LEU A 247 5.572 59.550 62.053 1.00 0.00 H ATOM 3577 N ALA A 248 2.901 58.115 63.395 1.00 14.57 N ATOM 3578 CA ALA A 248 1.950 57.150 63.985 1.00 15.69 C ATOM 3579 C ALA A 248 1.898 57.227 65.501 1.00 17.38 C ATOM 3580 O ALA A 248 0.864 56.908 66.106 1.00 18.87 O ATOM 3581 CB ALA A 248 2.256 55.716 63.522 1.00 16.54 C ATOM 3582 HA ALA A 248 0.961 57.430 63.621 1.00 0.00 H ATOM 3583 HB1 ALA A 248 2.179 55.662 62.436 1.00 0.00 H ATOM 3584 HB2 ALA A 248 3.265 55.444 63.830 1.00 0.00 H ATOM 3585 HB3 ALA A 248 1.540 55.029 63.973 1.00 0.00 H ATOM 3586 H ALA A 248 3.758 57.765 62.920 1.00 0.00 H ATOM 3587 N ARG A 249 3.001 57.658 66.123 1.00 16.82 N ATOM 3588 CA ARG A 249 3.000 57.836 67.584 1.00 17.23 C ATOM 3589 C ARG A 249 2.716 59.278 68.049 1.00 17.48 C ATOM 3590 O ARG A 249 2.813 59.587 69.230 1.00 18.93 O ATOM 3591 CB ARG A 249 4.291 57.308 68.198 1.00 16.81 C ATOM 3592 CG ARG A 249 5.514 58.152 67.934 1.00 16.70 C ATOM 3593 CD ARG A 249 6.723 57.610 68.689 1.00 18.31 C ATOM 3594 NE ARG A 249 7.871 58.497 68.536 1.00 16.30 N ATOM 3595 CZ ARG A 249 8.127 59.520 69.344 1.00 15.78 C ATOM 3596 NH1 ARG A 249 7.318 59.774 70.375 1.00 18.50 N ATOM 3597 NH2 ARG A 249 9.196 60.275 69.137 1.00 16.19 N ATOM 3598 HA ARG A 249 2.161 57.244 67.948 1.00 0.00 H ATOM 3599 HB2 ARG A 249 4.151 57.243 69.277 1.00 0.00 H ATOM 3600 HB3 ARG A 249 4.474 56.311 67.796 1.00 0.00 H ATOM 3601 HG2 ARG A 249 5.728 58.146 66.865 1.00 0.00 H ATOM 3602 HG3 ARG A 249 5.319 59.174 68.258 1.00 0.00 H ATOM 3603 HD2 ARG A 249 6.977 56.625 68.297 1.00 0.00 H ATOM 3604 HD3 ARG A 249 6.475 57.525 69.747 1.00 0.00 H ATOM 3605 HE ARG A 249 8.527 58.318 67.749 1.00 0.00 H ATOM 3606 HH12 ARG A 249 7.518 60.575 71.008 1.00 0.00 H ATOM 3607 HH11 ARG A 249 6.488 59.171 70.545 1.00 0.00 H ATOM 3608 HH22 ARG A 249 9.397 61.076 69.769 1.00 0.00 H ATOM 3609 HH21 ARG A 249 9.834 60.067 68.342 1.00 0.00 H ATOM 3610 H ARG A 249 3.859 57.867 65.574 1.00 0.00 H ATOM 3611 N GLY A 250 2.396 60.167 67.111 1.00 17.00 N ATOM 3612 CA GLY A 250 2.069 61.585 67.440 1.00 17.02 C ATOM 3613 C GLY A 250 3.299 62.378 67.897 1.00 16.45 C ATOM 3614 O GLY A 250 3.186 63.276 68.746 1.00 18.36 O ATOM 3615 HA3 GLY A 250 1.328 61.597 68.239 1.00 0.00 H ATOM 3616 HA2 GLY A 250 1.653 62.063 66.553 1.00 0.00 H ATOM 3617 H GLY A 250 2.373 59.863 66.117 1.00 0.00 H ATOM 3618 N ALA A 251 4.474 62.062 67.338 1.00 16.47 N ATOM 3619 CA ALA A 251 5.728 62.755 67.692 1.00 16.25 C ATOM 3620 C ALA A 251 5.675 64.209 67.293 1.00 14.96 C ATOM 3621 O ALA A 251 5.014 64.565 66.315 1.00 17.66 O ATOM 3622 CB ALA A 251 6.870 62.125 66.954 1.00 16.32 C ATOM 3623 HA ALA A 251 5.861 62.675 68.771 1.00 0.00 H ATOM 3624 HB1 ALA A 251 6.944 61.073 67.231 1.00 0.00 H ATOM 3625 HB2 ALA A 251 6.698 62.208 65.881 1.00 0.00 H ATOM 3626 HB3 ALA A 251 7.796 62.637 67.215 1.00 0.00 H ATOM 3627 H ALA A 251 4.504 61.301 66.629 1.00 0.00 H ATOM 3628 N HIS A 252 6.401 65.052 68.002 1.00 15.24 N ATOM 3629 CA HIS A 252 6.645 66.383 67.494 1.00 14.99 C ATOM 3630 C HIS A 252 7.848 66.273 66.561 1.00 14.07 C ATOM 3631 O HIS A 252 8.868 65.754 66.946 1.00 15.95 O ATOM 3632 CB HIS A 252 6.964 67.329 68.647 1.00 17.70 C ATOM 3633 CG HIS A 252 7.572 68.624 68.199 1.00 18.81 C ATOM 3634 ND1 HIS A 252 8.906 68.909 68.380 1.00 21.38 N ATOM 3635 CD2 HIS A 252 7.053 69.677 67.530 1.00 22.25 C ATOM 3636 CE1 HIS A 252 9.181 70.096 67.875 1.00 22.27 C ATOM 3637 NE2 HIS A 252 8.074 70.585 67.349 1.00 21.05 N ATOM 3638 HA HIS A 252 5.773 66.775 66.972 1.00 0.00 H ATOM 3639 HB2 HIS A 252 6.040 67.547 69.182 1.00 0.00 H ATOM 3640 HB3 HIS A 252 7.663 66.832 69.319 1.00 0.00 H ATOM 3641 HD2 HIS A 252 6.021 69.788 67.196 1.00 0.00 H ATOM 3642 HE1 HIS A 252 10.154 70.588 67.890 1.00 0.00 H ATOM 3643 H HIS A 252 6.795 64.761 68.920 1.00 0.00 H ATOM 3644 N ILE A 253 7.731 66.798 65.344 1.00 12.55 N ATOM 3645 CA ILE A 253 8.785 66.706 64.362 1.00 12.07 C ATOM 3646 C ILE A 253 9.397 68.086 64.125 1.00 12.09 C ATOM 3647 O ILE A 253 8.679 69.035 63.745 1.00 13.47 O ATOM 3648 CB ILE A 253 8.231 66.120 63.042 1.00 13.33 C ATOM 3649 CG1 ILE A 253 7.766 64.691 63.294 1.00 13.81 C ATOM 3650 CG2 ILE A 253 9.287 66.224 61.923 1.00 15.07 C ATOM 3651 CD1 ILE A 253 7.002 64.028 62.130 1.00 15.10 C ATOM 3652 HA ILE A 253 9.564 66.040 64.734 1.00 0.00 H ATOM 3653 HB ILE A 253 7.370 66.694 62.700 1.00 0.00 H ATOM 3654 HG12 ILE A 253 8.646 64.084 63.508 1.00 0.00 H ATOM 3655 HG13 ILE A 253 7.111 64.699 64.165 1.00 0.00 H ATOM 3656 HD11 ILE A 253 6.107 64.609 61.907 1.00 0.00 H ATOM 3657 HD12 ILE A 253 7.643 63.993 61.249 1.00 0.00 H ATOM 3658 HD13 ILE A 253 6.717 63.015 62.414 1.00 0.00 H ATOM 3659 HG21 ILE A 253 9.546 67.271 61.766 1.00 0.00 H ATOM 3660 HG22 ILE A 253 10.178 65.667 62.213 1.00 0.00 H ATOM 3661 HG23 ILE A 253 8.880 65.807 61.002 1.00 0.00 H ATOM 3662 H ILE A 253 6.851 67.291 65.092 1.00 0.00 H ATOM 3663 N TYR A 254 10.699 68.225 64.376 1.00 10.98 N ATOM 3664 CA TYR A 254 11.374 69.483 64.102 1.00 11.08 C ATOM 3665 C TYR A 254 11.561 69.647 62.594 1.00 11.02 C ATOM 3666 O TYR A 254 11.238 70.696 62.035 1.00 13.41 O ATOM 3667 CB TYR A 254 12.749 69.512 64.767 1.00 12.08 C ATOM 3668 CG TYR A 254 12.700 69.659 66.265 1.00 11.95 C ATOM 3669 CD1 TYR A 254 12.655 68.541 67.113 1.00 11.46 C ATOM 3670 CD2 TYR A 254 12.725 70.937 66.844 1.00 12.10 C ATOM 3671 CE1 TYR A 254 12.630 68.681 68.502 1.00 12.05 C ATOM 3672 CE2 TYR A 254 12.711 71.099 68.218 1.00 13.04 C ATOM 3673 CZ TYR A 254 12.674 69.962 69.030 1.00 11.94 C ATOM 3674 OH TYR A 254 12.657 70.163 70.400 1.00 13.46 O ATOM 3675 HA TYR A 254 10.762 70.293 64.500 1.00 0.00 H ATOM 3676 HB3 TYR A 254 13.311 70.352 64.358 1.00 0.00 H ATOM 3677 HB2 TYR A 254 13.265 68.581 64.530 1.00 0.00 H ATOM 3678 HD2 TYR A 254 12.756 71.816 66.201 1.00 0.00 H ATOM 3679 HE2 TYR A 254 12.729 72.096 68.659 1.00 0.00 H ATOM 3680 HE1 TYR A 254 12.577 67.808 69.153 1.00 0.00 H ATOM 3681 HD1 TYR A 254 12.639 67.542 66.678 1.00 0.00 H ATOM 3682 HH TYR A 254 12.631 69.287 70.861 1.00 0.00 H ATOM 3683 H TYR A 254 11.236 67.427 64.771 1.00 0.00 H ATOM 3684 N ALA A 255 12.137 68.638 61.949 1.00 10.91 N ATOM 3685 CA ALA A 255 12.534 68.749 60.557 1.00 10.65 C ATOM 3686 C ALA A 255 12.804 67.375 60.008 1.00 9.96 C ATOM 3687 O ALA A 255 13.032 66.412 60.763 1.00 11.10 O ATOM 3688 CB ALA A 255 13.796 69.626 60.417 1.00 12.09 C ATOM 3689 HA ALA A 255 11.727 69.219 59.996 1.00 0.00 H ATOM 3690 HB1 ALA A 255 13.589 70.623 60.805 1.00 0.00 H ATOM 3691 HB2 ALA A 255 14.613 69.177 60.982 1.00 0.00 H ATOM 3692 HB3 ALA A 255 14.074 69.695 59.365 1.00 0.00 H ATOM 3693 H ALA A 255 12.308 67.745 62.455 1.00 0.00 H ATOM 3694 N GLU A 256 12.789 67.288 58.680 1.00 10.01 N ATOM 3695 CA GLU A 256 13.283 66.087 57.969 1.00 10.62 C ATOM 3696 C GLU A 256 14.739 66.291 57.600 1.00 10.34 C ATOM 3697 O GLU A 256 15.138 67.393 57.218 1.00 11.07 O ATOM 3698 CB GLU A 256 12.466 65.910 56.675 1.00 12.22 C ATOM 3699 CG GLU A 256 12.863 64.687 55.866 1.00 12.04 C ATOM 3700 CD GLU A 256 12.041 64.497 54.624 1.00 14.42 C ATOM 3701 OE1 GLU A 256 11.209 65.379 54.307 1.00 16.27 O ATOM 3702 OE2 GLU A 256 12.246 63.458 53.975 1.00 16.63 O ATOM 3703 HA GLU A 256 13.181 65.209 58.607 1.00 0.00 H ATOM 3704 HB2 GLU A 256 11.413 65.820 56.942 1.00 0.00 H ATOM 3705 HB3 GLU A 256 12.608 66.795 56.054 1.00 0.00 H ATOM 3706 HG2 GLU A 256 13.909 64.790 55.576 1.00 0.00 H ATOM 3707 HG3 GLU A 256 12.747 63.804 56.495 1.00 0.00 H ATOM 3708 H GLU A 256 12.420 68.087 58.126 1.00 0.00 H ATOM 3709 N ILE A 257 15.522 65.214 57.682 1.00 10.38 N ATOM 3710 CA ILE A 257 16.887 65.273 57.159 1.00 10.08 C ATOM 3711 C ILE A 257 16.774 64.931 55.673 1.00 10.41 C ATOM 3712 O ILE A 257 16.588 63.754 55.305 1.00 12.51 O ATOM 3713 CB ILE A 257 17.844 64.289 57.840 1.00 11.12 C ATOM 3714 CG1 ILE A 257 17.867 64.590 59.362 1.00 12.22 C ATOM 3715 CG2 ILE A 257 19.271 64.479 57.238 1.00 12.85 C ATOM 3716 CD1 ILE A 257 18.611 63.633 60.203 1.00 13.65 C ATOM 3717 HA ILE A 257 17.305 66.263 57.345 1.00 0.00 H ATOM 3718 HB ILE A 257 17.517 63.262 57.678 1.00 0.00 H ATOM 3719 HG12 ILE A 257 18.316 65.574 59.500 1.00 0.00 H ATOM 3720 HG13 ILE A 257 16.835 64.610 59.713 1.00 0.00 H ATOM 3721 HD11 ILE A 257 18.172 62.641 60.098 1.00 0.00 H ATOM 3722 HD12 ILE A 257 19.653 63.606 59.885 1.00 0.00 H ATOM 3723 HD13 ILE A 257 18.556 63.948 61.245 1.00 0.00 H ATOM 3724 HG21 ILE A 257 19.241 64.284 56.166 1.00 0.00 H ATOM 3725 HG22 ILE A 257 19.605 65.502 57.413 1.00 0.00 H ATOM 3726 HG23 ILE A 257 19.961 63.783 57.716 1.00 0.00 H ATOM 3727 H ILE A 257 15.164 64.338 58.115 1.00 0.00 H ATOM 3728 N VAL A 258 16.819 65.965 54.835 1.00 9.82 N ATOM 3729 CA VAL A 258 16.608 65.791 53.403 1.00 10.22 C ATOM 3730 C VAL A 258 17.905 65.630 52.636 1.00 11.88 C ATOM 3731 O VAL A 258 17.883 65.313 51.443 1.00 13.33 O ATOM 3732 CB VAL A 258 15.752 66.932 52.790 1.00 11.36 C ATOM 3733 CG1 VAL A 258 14.351 66.841 53.362 1.00 13.18 C ATOM 3734 CG2 VAL A 258 16.394 68.297 53.022 1.00 12.41 C ATOM 3735 HA VAL A 258 16.049 64.861 53.302 1.00 0.00 H ATOM 3736 HB VAL A 258 15.696 66.816 51.708 1.00 0.00 H ATOM 3737 HG11 VAL A 258 13.919 65.873 53.109 1.00 0.00 H ATOM 3738 HG12 VAL A 258 14.395 66.948 54.446 1.00 0.00 H ATOM 3739 HG13 VAL A 258 13.736 67.636 52.941 1.00 0.00 H ATOM 3740 HG21 VAL A 258 16.491 68.474 54.093 1.00 0.00 H ATOM 3741 HG22 VAL A 258 17.380 68.317 52.558 1.00 0.00 H ATOM 3742 HG23 VAL A 258 15.768 69.072 52.580 1.00 0.00 H ATOM 3743 H VAL A 258 17.009 66.916 55.210 1.00 0.00 H ATOM 3744 N GLY A 259 19.037 65.881 53.289 1.00 10.60 N ATOM 3745 CA GLY A 259 20.321 65.660 52.609 1.00 10.80 C ATOM 3746 C GLY A 259 21.433 65.354 53.571 1.00 9.71 C ATOM 3747 O GLY A 259 21.474 65.878 54.695 1.00 10.17 O ATOM 3748 HA3 GLY A 259 20.580 66.558 52.049 1.00 0.00 H ATOM 3749 HA2 GLY A 259 20.213 64.822 51.920 1.00 0.00 H ATOM 3750 H GLY A 259 19.013 66.229 54.269 1.00 0.00 H ATOM 3751 N TYR A 260 22.341 64.502 53.130 1.00 10.29 N ATOM 3752 CA TYR A 260 23.504 64.142 53.939 1.00 9.52 C ATOM 3753 C TYR A 260 24.664 63.939 52.983 1.00 9.63 C ATOM 3754 O TYR A 260 24.618 63.058 52.131 1.00 12.40 O ATOM 3755 CB TYR A 260 23.198 62.854 54.720 1.00 9.84 C ATOM 3756 CG TYR A 260 24.430 62.150 55.299 1.00 10.10 C ATOM 3757 CD1 TYR A 260 25.467 62.851 55.949 1.00 10.39 C ATOM 3758 CD2 TYR A 260 24.527 60.758 55.237 1.00 10.57 C ATOM 3759 CE1 TYR A 260 26.593 62.161 56.485 1.00 9.41 C ATOM 3760 CE2 TYR A 260 25.630 60.083 55.746 1.00 9.71 C ATOM 3761 CZ TYR A 260 26.653 60.798 56.357 1.00 9.96 C ATOM 3762 OH TYR A 260 27.737 60.134 56.874 1.00 11.19 O ATOM 3763 HA TYR A 260 23.750 64.919 54.663 1.00 0.00 H ATOM 3764 HB3 TYR A 260 22.694 62.160 54.047 1.00 0.00 H ATOM 3765 HB2 TYR A 260 22.532 63.107 55.545 1.00 0.00 H ATOM 3766 HD2 TYR A 260 23.719 60.188 54.779 1.00 0.00 H ATOM 3767 HE2 TYR A 260 25.692 58.998 55.666 1.00 0.00 H ATOM 3768 HE1 TYR A 260 27.391 62.707 56.987 1.00 0.00 H ATOM 3769 HD1 TYR A 260 25.406 63.935 56.043 1.00 0.00 H ATOM 3770 HH TYR A 260 28.191 59.633 56.151 1.00 0.00 H ATOM 3771 H TYR A 260 22.226 64.078 52.187 1.00 0.00 H ATOM 3772 N GLY A 261 25.687 64.773 53.098 1.00 8.84 N ATOM 3773 CA GLY A 261 26.887 64.587 52.310 1.00 9.60 C ATOM 3774 C GLY A 261 28.011 64.084 53.190 1.00 8.18 C ATOM 3775 O GLY A 261 28.147 64.479 54.340 1.00 8.66 O ATOM 3776 HA3 GLY A 261 27.176 65.538 51.862 1.00 0.00 H ATOM 3777 HA2 GLY A 261 26.692 63.860 51.522 1.00 0.00 H ATOM 3778 H GLY A 261 25.627 65.571 53.762 1.00 0.00 H ATOM 3779 N ALA A 262 28.826 63.177 52.653 1.00 8.43 N ATOM 3780 CA ALA A 262 30.023 62.703 53.342 1.00 8.87 C ATOM 3781 C ALA A 262 31.066 62.481 52.275 1.00 9.19 C ATOM 3782 O ALA A 262 30.860 61.672 51.357 1.00 10.69 O ATOM 3783 CB ALA A 262 29.755 61.422 54.095 1.00 10.74 C ATOM 3784 HA ALA A 262 30.355 63.432 54.081 1.00 0.00 H ATOM 3785 HB1 ALA A 262 28.974 61.594 54.836 1.00 0.00 H ATOM 3786 HB2 ALA A 262 29.430 60.652 53.395 1.00 0.00 H ATOM 3787 HB3 ALA A 262 30.668 61.099 54.596 1.00 0.00 H ATOM 3788 H ALA A 262 28.602 62.794 51.712 1.00 0.00 H ATOM 3789 N THR A 263 32.168 63.211 52.380 1.00 8.39 N ATOM 3790 CA THR A 263 33.212 63.106 51.361 1.00 7.76 C ATOM 3791 C THR A 263 34.573 63.197 52.016 1.00 7.60 C ATOM 3792 O THR A 263 34.688 63.381 53.231 1.00 8.03 O ATOM 3793 CB THR A 263 33.101 64.250 50.285 1.00 8.67 C ATOM 3794 OG1 THR A 263 33.467 65.477 50.917 1.00 9.73 O ATOM 3795 CG2 THR A 263 31.738 64.329 49.659 1.00 10.45 C ATOM 3796 HA THR A 263 33.083 62.146 50.862 1.00 0.00 H ATOM 3797 HB THR A 263 33.778 64.034 49.458 1.00 0.00 H ATOM 3798 HG1 THR A 263 33.406 66.216 50.261 1.00 0.00 H ATOM 3799 HG23 THR A 263 31.499 63.375 49.190 1.00 0.00 H ATOM 3800 HG21 THR A 263 30.999 64.552 50.428 1.00 0.00 H ATOM 3801 HG22 THR A 263 31.730 65.118 48.906 1.00 0.00 H ATOM 3802 H THR A 263 32.290 63.857 53.186 1.00 0.00 H ATOM 3803 N SER A 264 35.596 63.112 51.173 1.00 7.55 N ATOM 3804 CA SER A 264 36.975 63.130 51.642 1.00 7.77 C ATOM 3805 C SER A 264 37.787 64.017 50.714 1.00 9.07 C ATOM 3806 O SER A 264 37.572 64.038 49.498 1.00 9.30 O ATOM 3807 CB SER A 264 37.470 61.694 51.567 1.00 10.52 C ATOM 3808 OG SER A 264 38.815 61.579 51.989 1.00 11.57 O ATOM 3809 HA SER A 264 37.065 63.515 52.658 1.00 0.00 H ATOM 3810 HB2 SER A 264 37.392 61.347 50.537 1.00 0.00 H ATOM 3811 HB3 SER A 264 36.845 61.071 52.207 1.00 0.00 H ATOM 3812 HG SER A 264 39.391 62.137 51.409 1.00 0.00 H ATOM 3813 H SER A 264 35.408 63.031 50.153 1.00 0.00 H ATOM 3814 N ASP A 265 38.735 64.749 51.289 1.00 9.65 N ATOM 3815 CA ASP A 265 39.589 65.653 50.498 1.00 10.46 C ATOM 3816 C ASP A 265 40.635 64.873 49.702 1.00 9.94 C ATOM 3817 O ASP A 265 40.907 65.213 48.553 1.00 11.44 O ATOM 3818 CB ASP A 265 40.309 66.654 51.397 1.00 10.93 C ATOM 3819 CG ASP A 265 39.395 67.719 51.970 1.00 12.73 C ATOM 3820 OD1 ASP A 265 38.191 67.773 51.627 1.00 14.87 O ATOM 3821 OD2 ASP A 265 39.925 68.509 52.775 1.00 15.52 O ATOM 3822 HA ASP A 265 38.933 66.185 49.809 1.00 0.00 H ATOM 3823 HB2 ASP A 265 40.765 66.110 52.224 1.00 0.00 H ATOM 3824 HB3 ASP A 265 41.087 67.145 50.813 1.00 0.00 H ATOM 3825 H ASP A 265 38.877 64.683 52.317 1.00 0.00 H ATOM 3826 N GLY A 266 41.275 63.880 50.347 1.00 11.09 N ATOM 3827 CA GLY A 266 42.318 63.129 49.650 1.00 12.13 C ATOM 3828 C GLY A 266 43.481 64.014 49.255 1.00 14.98 C ATOM 3829 O GLY A 266 44.074 63.800 48.211 1.00 16.66 O ATOM 3830 HA3 GLY A 266 41.892 62.684 48.751 1.00 0.00 H ATOM 3831 HA2 GLY A 266 42.683 62.339 50.307 1.00 0.00 H ATOM 3832 H GLY A 266 41.030 63.649 51.331 1.00 0.00 H ATOM 3833 N ALA A 267 43.851 64.981 50.095 1.00 17.54 N ATOM 3834 CA ALA A 267 44.824 66.030 49.657 1.00 23.51 C ATOM 3835 C ALA A 267 45.859 66.465 50.702 1.00 27.50 C ATOM 3836 O ALA A 267 46.715 65.690 51.110 1.00 30.76 O ATOM 3837 CB ALA A 267 44.073 67.242 49.082 1.00 25.64 C ATOM 3838 HA ALA A 267 45.423 65.551 48.882 1.00 0.00 H ATOM 3839 HB1 ALA A 267 43.478 66.926 48.225 1.00 0.00 H ATOM 3840 HB2 ALA A 267 43.418 67.659 49.847 1.00 0.00 H ATOM 3841 HB3 ALA A 267 44.793 67.998 48.767 1.00 0.00 H ATOM 3842 H ALA A 267 43.462 65.006 51.059 1.00 0.00 H ATOM 3843 N ASP A 268 45.862 67.730 51.079 1.00 33.03 N ATOM 3844 CA ASP A 268 46.849 68.161 52.055 1.00 34.73 C ATOM 3845 C ASP A 268 46.345 67.724 53.423 1.00 33.80 C ATOM 3846 O ASP A 268 45.275 68.135 53.842 1.00 37.01 O ATOM 3847 CB ASP A 268 47.055 69.680 52.001 1.00 37.61 C ATOM 3848 CG ASP A 268 48.228 70.145 52.868 1.00 40.38 C ATOM 3849 OD1 ASP A 268 48.253 69.830 54.083 1.00 41.49 O ATOM 3850 OD2 ASP A 268 49.133 70.835 52.337 1.00 42.67 O ATOM 3851 HA ASP A 268 47.819 67.711 51.842 1.00 0.00 H ATOM 3852 HB2 ASP A 268 47.247 69.970 50.968 1.00 0.00 H ATOM 3853 HB3 ASP A 268 46.146 70.169 52.351 1.00 0.00 H ATOM 3854 H ASP A 268 45.173 68.403 50.686 1.00 0.00 H ATOM 3855 N MET A 269 47.124 66.904 54.128 1.00 33.56 N ATOM 3856 CA MET A 269 46.689 66.382 55.431 1.00 31.84 C ATOM 3857 C MET A 269 46.132 67.402 56.413 1.00 34.15 C ATOM 3858 O MET A 269 45.142 67.135 57.100 1.00 34.62 O ATOM 3859 CB MET A 269 47.822 65.578 56.111 1.00 29.83 C ATOM 3860 CG MET A 269 47.431 64.943 57.459 1.00 25.75 C ATOM 3861 SD MET A 269 46.251 63.582 57.235 1.00 25.63 S ATOM 3862 CE MET A 269 46.403 62.838 58.852 1.00 27.29 C ATOM 3863 HA MET A 269 45.846 65.738 55.179 1.00 0.00 H ATOM 3864 HB2 MET A 269 48.128 64.780 55.434 1.00 0.00 H ATOM 3865 HB3 MET A 269 48.663 66.251 56.282 1.00 0.00 H ATOM 3866 HG2 MET A 269 46.977 65.706 58.092 1.00 0.00 H ATOM 3867 HG3 MET A 269 48.328 64.558 57.943 1.00 0.00 H ATOM 3868 HE1 MET A 269 47.435 62.525 59.011 1.00 0.00 H ATOM 3869 HE2 MET A 269 46.121 63.565 59.613 1.00 0.00 H ATOM 3870 HE3 MET A 269 45.745 61.971 58.915 1.00 0.00 H ATOM 3871 H MET A 269 48.053 66.630 53.750 1.00 0.00 H ATOM 3872 N VAL A 270 46.767 68.571 56.497 1.00 35.82 N ATOM 3873 CA VAL A 270 46.450 69.511 57.580 1.00 38.11 C ATOM 3874 C VAL A 270 45.539 70.693 57.226 1.00 38.89 C ATOM 3875 O VAL A 270 45.071 71.396 58.122 1.00 40.76 O ATOM 3876 CB VAL A 270 47.737 70.035 58.300 1.00 38.76 C ATOM 3877 CG1 VAL A 270 48.506 68.873 58.936 1.00 38.46 C ATOM 3878 CG2 VAL A 270 48.618 70.830 57.337 1.00 39.08 C ATOM 3879 HA VAL A 270 45.859 68.892 58.256 1.00 0.00 H ATOM 3880 HB VAL A 270 47.434 70.713 59.098 1.00 0.00 H ATOM 3881 HG11 VAL A 270 47.869 68.374 59.666 1.00 0.00 H ATOM 3882 HG12 VAL A 270 48.797 68.164 58.161 1.00 0.00 H ATOM 3883 HG13 VAL A 270 49.397 69.257 59.432 1.00 0.00 H ATOM 3884 HG21 VAL A 270 48.917 70.190 56.507 1.00 0.00 H ATOM 3885 HG22 VAL A 270 48.058 71.684 56.955 1.00 0.00 H ATOM 3886 HG23 VAL A 270 49.505 71.182 57.864 1.00 0.00 H ATOM 3887 H VAL A 270 47.490 68.819 55.792 1.00 0.00 H ATOM 3888 N ALA A 271 45.294 70.918 55.942 1.00 38.00 N ATOM 3889 CA ALA A 271 44.428 72.030 55.533 1.00 36.81 C ATOM 3890 C ALA A 271 43.202 71.474 54.817 1.00 35.29 C ATOM 3891 O ALA A 271 43.321 70.451 54.158 1.00 36.43 O ATOM 3892 CB ALA A 271 45.194 72.984 54.618 1.00 37.85 C ATOM 3893 HA ALA A 271 44.107 72.586 56.414 1.00 0.00 H ATOM 3894 HB1 ALA A 271 46.058 73.381 55.151 1.00 0.00 H ATOM 3895 HB2 ALA A 271 45.528 72.445 53.731 1.00 0.00 H ATOM 3896 HB3 ALA A 271 44.540 73.804 54.322 1.00 0.00 H ATOM 3897 H ALA A 271 45.719 70.302 55.220 1.00 0.00 H ATOM 3898 N PRO A 272 42.021 72.139 54.935 1.00 33.53 N ATOM 3899 CA PRO A 272 40.906 71.681 54.085 1.00 31.78 C ATOM 3900 C PRO A 272 41.220 71.988 52.631 1.00 29.94 C ATOM 3901 O PRO A 272 41.867 73.004 52.353 1.00 29.80 O ATOM 3902 CB PRO A 272 39.718 72.526 54.553 1.00 32.12 C ATOM 3903 CG PRO A 272 40.326 73.737 55.215 1.00 33.15 C ATOM 3904 CD PRO A 272 41.639 73.279 55.795 1.00 33.70 C ATOM 3905 HA PRO A 272 40.718 70.610 54.161 1.00 0.00 H ATOM 3906 HD3 PRO A 272 42.385 74.072 55.744 1.00 0.00 H ATOM 3907 HD2 PRO A 272 41.518 72.962 56.831 1.00 0.00 H ATOM 3908 HG3 PRO A 272 39.671 74.106 56.004 1.00 0.00 H ATOM 3909 HG2 PRO A 272 40.490 74.527 54.482 1.00 0.00 H ATOM 3910 HB2 PRO A 272 39.103 72.823 53.704 1.00 0.00 H ATOM 3911 HB3 PRO A 272 39.109 71.968 55.264 1.00 0.00 H ATOM 3912 N SER A 273 40.779 71.132 51.709 1.00 28.10 N ATOM 3913 CA SER A 273 41.078 71.357 50.289 1.00 27.72 C ATOM 3914 C SER A 273 40.139 72.337 49.617 1.00 27.44 C ATOM 3915 O SER A 273 40.500 72.919 48.575 1.00 32.07 O ATOM 3916 CB SER A 273 41.125 70.049 49.485 1.00 26.00 C ATOM 3917 OG SER A 273 39.830 69.509 49.310 1.00 20.61 O ATOM 3918 HA SER A 273 42.072 71.805 50.289 1.00 0.00 H ATOM 3919 HB2 SER A 273 41.743 69.326 50.018 1.00 0.00 H ATOM 3920 HB3 SER A 273 41.563 70.248 48.507 1.00 0.00 H ATOM 3921 HG SER A 273 39.892 68.669 48.790 1.00 0.00 H ATOM 3922 H SER A 273 40.222 70.302 51.996 1.00 0.00 H ATOM 3923 N GLY A 274 38.947 72.541 50.177 1.00 24.91 N ATOM 3924 CA GLY A 274 37.956 73.388 49.483 1.00 19.36 C ATOM 3925 C GLY A 274 37.111 72.517 48.553 1.00 17.05 C ATOM 3926 O GLY A 274 35.900 72.466 48.677 1.00 16.17 O ATOM 3927 HA3 GLY A 274 38.473 74.150 48.899 1.00 0.00 H ATOM 3928 HA2 GLY A 274 37.311 73.870 50.217 1.00 0.00 H ATOM 3929 H GLY A 274 38.717 72.108 51.094 1.00 0.00 H ATOM 3930 N GLU A 275 37.746 71.830 47.609 1.00 16.13 N ATOM 3931 CA GLU A 275 37.013 70.931 46.711 1.00 15.50 C ATOM 3932 C GLU A 275 36.225 69.822 47.425 1.00 13.83 C ATOM 3933 O GLU A 275 35.095 69.503 47.027 1.00 13.48 O ATOM 3934 CB GLU A 275 37.942 70.286 45.721 1.00 18.35 C ATOM 3935 CG GLU A 275 37.185 69.513 44.676 1.00 22.52 C ATOM 3936 CD GLU A 275 38.037 68.497 43.946 1.00 23.98 C ATOM 3937 OE1 GLU A 275 39.178 68.854 43.537 1.00 24.69 O ATOM 3938 OE2 GLU A 275 37.552 67.344 43.754 1.00 23.37 O ATOM 3939 HA GLU A 275 36.289 71.575 46.211 1.00 0.00 H ATOM 3940 HB2 GLU A 275 38.531 71.061 45.231 1.00 0.00 H ATOM 3941 HB3 GLU A 275 38.608 69.606 46.251 1.00 0.00 H ATOM 3942 HG2 GLU A 275 36.362 68.989 45.162 1.00 0.00 H ATOM 3943 HG3 GLU A 275 36.785 70.217 43.946 1.00 0.00 H ATOM 3944 H GLU A 275 38.776 71.931 47.506 1.00 0.00 H ATOM 3945 N GLY A 276 36.800 69.206 48.462 1.00 12.70 N ATOM 3946 CA GLY A 276 36.036 68.178 49.184 1.00 12.37 C ATOM 3947 C GLY A 276 34.771 68.772 49.807 1.00 10.74 C ATOM 3948 O GLY A 276 33.720 68.123 49.838 1.00 10.79 O ATOM 3949 HA3 GLY A 276 36.660 67.759 49.974 1.00 0.00 H ATOM 3950 HA2 GLY A 276 35.754 67.388 48.488 1.00 0.00 H ATOM 3951 H GLY A 276 37.769 69.449 48.753 1.00 0.00 H ATOM 3952 N ALA A 277 34.874 70.004 50.305 1.00 10.84 N ATOM 3953 CA ALA A 277 33.723 70.699 50.881 1.00 10.81 C ATOM 3954 C ALA A 277 32.674 71.002 49.824 1.00 10.43 C ATOM 3955 O ALA A 277 31.477 70.870 50.101 1.00 10.60 O ATOM 3956 CB ALA A 277 34.179 71.958 51.570 1.00 12.17 C ATOM 3957 HA ALA A 277 33.257 70.045 51.618 1.00 0.00 H ATOM 3958 HB1 ALA A 277 34.881 71.702 52.364 1.00 0.00 H ATOM 3959 HB2 ALA A 277 34.669 72.610 50.846 1.00 0.00 H ATOM 3960 HB3 ALA A 277 33.316 72.470 51.996 1.00 0.00 H ATOM 3961 H ALA A 277 35.797 70.484 50.284 1.00 0.00 H ATOM 3962 N VAL A 278 33.103 71.459 48.641 1.00 10.52 N ATOM 3963 CA VAL A 278 32.183 71.660 47.534 1.00 10.85 C ATOM 3964 C VAL A 278 31.432 70.373 47.212 1.00 10.49 C ATOM 3965 O VAL A 278 30.186 70.362 47.105 1.00 11.38 O ATOM 3966 CB VAL A 278 32.920 72.177 46.274 1.00 10.95 C ATOM 3967 CG1 VAL A 278 31.991 72.158 45.055 1.00 13.45 C ATOM 3968 CG2 VAL A 278 33.478 73.576 46.498 1.00 12.44 C ATOM 3969 HA VAL A 278 31.463 72.418 47.842 1.00 0.00 H ATOM 3970 HB VAL A 278 33.758 71.507 46.080 1.00 0.00 H ATOM 3971 HG11 VAL A 278 31.654 71.138 44.872 1.00 0.00 H ATOM 3972 HG12 VAL A 278 31.129 72.798 45.246 1.00 0.00 H ATOM 3973 HG13 VAL A 278 32.531 72.525 44.182 1.00 0.00 H ATOM 3974 HG21 VAL A 278 32.661 74.259 46.728 1.00 0.00 H ATOM 3975 HG22 VAL A 278 34.182 73.556 47.330 1.00 0.00 H ATOM 3976 HG23 VAL A 278 33.989 73.911 45.595 1.00 0.00 H ATOM 3977 H VAL A 278 34.112 71.674 48.512 1.00 0.00 H ATOM 3978 N ARG A 279 32.187 69.298 47.046 1.00 10.81 N ATOM 3979 CA ARG A 279 31.534 68.026 46.760 1.00 10.46 C ATOM 3980 C ARG A 279 30.561 67.598 47.859 1.00 9.70 C ATOM 3981 O ARG A 279 29.480 67.055 47.578 1.00 10.57 O ATOM 3982 CB ARG A 279 32.566 66.926 46.529 1.00 11.03 C ATOM 3983 CG ARG A 279 33.305 67.098 45.179 1.00 11.47 C ATOM 3984 CD ARG A 279 34.311 65.948 44.928 1.00 12.60 C ATOM 3985 NE ARG A 279 35.601 66.167 45.607 1.00 12.68 N ATOM 3986 CZ ARG A 279 36.062 65.451 46.652 1.00 14.89 C ATOM 3987 NH1 ARG A 279 35.313 64.519 47.181 1.00 16.01 N ATOM 3988 NH2 ARG A 279 37.261 65.706 47.185 1.00 15.99 N ATOM 3989 HA ARG A 279 30.953 68.179 45.851 1.00 0.00 H ATOM 3990 HB2 ARG A 279 33.297 66.954 47.337 1.00 0.00 H ATOM 3991 HB3 ARG A 279 32.059 65.961 46.533 1.00 0.00 H ATOM 3992 HG2 ARG A 279 32.571 67.109 44.373 1.00 0.00 H ATOM 3993 HG3 ARG A 279 33.845 68.045 45.189 1.00 0.00 H ATOM 3994 HD2 ARG A 279 34.489 65.867 43.856 1.00 0.00 H ATOM 3995 HD3 ARG A 279 33.877 65.018 45.294 1.00 0.00 H ATOM 3996 HE ARG A 279 36.204 66.936 45.251 1.00 0.00 H ATOM 3997 HH12 ARG A 279 35.665 63.964 47.987 1.00 0.00 H ATOM 3998 HH11 ARG A 279 34.365 64.332 46.795 1.00 0.00 H ATOM 3999 HH22 ARG A 279 37.602 65.144 47.991 1.00 0.00 H ATOM 4000 HH21 ARG A 279 37.853 66.466 46.794 1.00 0.00 H ATOM 4001 H ARG A 279 33.223 69.360 47.118 1.00 0.00 H ATOM 4002 N CYS A 280 30.937 67.856 49.105 1.00 9.17 N ATOM 4003 CA CYS A 280 30.081 67.464 50.226 1.00 9.13 C ATOM 4004 C CYS A 280 28.775 68.240 50.243 1.00 9.04 C ATOM 4005 O CYS A 280 27.686 67.679 50.418 1.00 9.40 O ATOM 4006 CB CYS A 280 30.860 67.641 51.526 1.00 9.42 C ATOM 4007 SG CYS A 280 30.072 66.909 52.938 1.00 10.60 S ATOM 4008 HA CYS A 280 29.805 66.416 50.112 1.00 0.00 H ATOM 4009 HB2 CYS A 280 30.979 68.708 51.713 1.00 0.00 H ATOM 4010 HB3 CYS A 280 31.842 67.183 51.404 1.00 0.00 H ATOM 4011 HG CYS A 280 28.832 67.485 53.121 1.00 0.00 H ATOM 4012 H CYS A 280 31.841 68.337 49.286 1.00 0.00 H ATOM 4013 N MET A 281 28.881 69.561 50.091 1.00 8.90 N ATOM 4014 CA MET A 281 27.674 70.386 50.071 1.00 9.41 C ATOM 4015 C MET A 281 26.790 69.994 48.905 1.00 10.48 C ATOM 4016 O MET A 281 25.576 69.925 49.063 1.00 10.48 O ATOM 4017 CB MET A 281 28.003 71.890 50.034 1.00 9.57 C ATOM 4018 CG MET A 281 28.551 72.379 51.350 1.00 9.76 C ATOM 4019 SD MET A 281 28.832 74.193 51.322 1.00 11.77 S ATOM 4020 CE MET A 281 30.514 74.237 50.724 1.00 13.45 C ATOM 4021 HA MET A 281 27.132 70.203 50.999 1.00 0.00 H ATOM 4022 HB2 MET A 281 28.744 72.070 49.255 1.00 0.00 H ATOM 4023 HB3 MET A 281 27.093 72.444 49.803 1.00 0.00 H ATOM 4024 HG2 MET A 281 29.497 71.876 51.550 1.00 0.00 H ATOM 4025 HG3 MET A 281 27.840 72.142 52.141 1.00 0.00 H ATOM 4026 HE1 MET A 281 31.159 73.699 51.418 1.00 0.00 H ATOM 4027 HE2 MET A 281 30.562 73.766 49.742 1.00 0.00 H ATOM 4028 HE3 MET A 281 30.844 75.273 50.648 1.00 0.00 H ATOM 4029 H MET A 281 29.817 70.002 49.987 1.00 0.00 H ATOM 4030 N LYS A 282 27.366 69.814 47.717 1.00 10.05 N ATOM 4031 CA LYS A 282 26.520 69.452 46.578 1.00 10.26 C ATOM 4032 C LYS A 282 25.859 68.095 46.779 1.00 11.11 C ATOM 4033 O LYS A 282 24.697 67.893 46.382 1.00 12.74 O ATOM 4034 CB LYS A 282 27.347 69.465 45.304 1.00 12.33 C ATOM 4035 CG LYS A 282 27.754 70.869 44.890 1.00 13.86 C ATOM 4036 CD LYS A 282 28.678 70.780 43.680 1.00 19.55 C ATOM 4037 CE LYS A 282 28.849 72.027 42.884 1.00 23.93 C ATOM 4038 NZ LYS A 282 29.305 71.570 41.493 1.00 25.77 N ATOM 4039 HA LYS A 282 25.721 70.189 46.495 1.00 0.00 H ATOM 4040 HB2 LYS A 282 28.248 68.873 45.465 1.00 0.00 H ATOM 4041 HB3 LYS A 282 26.760 69.020 44.501 1.00 0.00 H ATOM 4042 HG2 LYS A 282 26.866 71.446 44.631 1.00 0.00 H ATOM 4043 HG3 LYS A 282 28.275 71.357 45.714 1.00 0.00 H ATOM 4044 HD2 LYS A 282 29.662 70.476 44.036 1.00 0.00 H ATOM 4045 HD3 LYS A 282 28.281 70.013 43.015 1.00 0.00 H ATOM 4046 HE2 LYS A 282 29.603 72.669 43.340 1.00 0.00 H ATOM 4047 HE3 LYS A 282 27.905 72.568 42.817 1.00 0.00 H ATOM 4048 HZ1 LYS A 282 30.201 71.048 41.577 1.00 0.00 H ATOM 4049 HZ2 LYS A 282 28.580 70.951 41.078 1.00 0.00 H ATOM 4050 HZ3 LYS A 282 29.443 72.402 40.884 1.00 0.00 H ATOM 4051 H LYS A 282 28.393 69.928 47.601 1.00 0.00 H ATOM 4052 N MET A 283 26.575 67.152 47.394 1.00 10.13 N ATOM 4053 CA MET A 283 25.973 65.864 47.672 1.00 10.67 C ATOM 4054 C MET A 283 24.757 66.001 48.604 1.00 11.18 C ATOM 4055 O MET A 283 23.701 65.366 48.381 1.00 12.33 O ATOM 4056 CB MET A 283 27.016 64.958 48.288 1.00 11.48 C ATOM 4057 CG MET A 283 26.484 63.551 48.547 1.00 12.91 C ATOM 4058 SD MET A 283 27.775 62.499 49.252 1.00 14.74 S ATOM 4059 CE MET A 283 28.941 62.430 47.921 1.00 19.48 C ATOM 4060 HA MET A 283 25.615 65.432 46.737 1.00 0.00 H ATOM 4061 HB2 MET A 283 27.867 64.892 47.610 1.00 0.00 H ATOM 4062 HB3 MET A 283 27.340 65.390 49.235 1.00 0.00 H ATOM 4063 HG2 MET A 283 26.143 63.118 47.606 1.00 0.00 H ATOM 4064 HG3 MET A 283 25.648 63.607 49.244 1.00 0.00 H ATOM 4065 HE1 MET A 283 28.463 61.996 47.043 1.00 0.00 H ATOM 4066 HE2 MET A 283 29.285 63.438 47.688 1.00 0.00 H ATOM 4067 HE3 MET A 283 29.790 61.814 48.215 1.00 0.00 H ATOM 4068 H MET A 283 27.559 67.340 47.672 1.00 0.00 H ATOM 4069 N ALA A 284 24.886 66.841 49.632 1.00 10.23 N ATOM 4070 CA ALA A 284 23.789 67.030 50.578 1.00 9.63 C ATOM 4071 C ALA A 284 22.598 67.749 49.938 1.00 11.73 C ATOM 4072 O ALA A 284 21.463 67.617 50.385 1.00 14.43 O ATOM 4073 CB ALA A 284 24.294 67.830 51.786 1.00 11.56 C ATOM 4074 HA ALA A 284 23.444 66.046 50.896 1.00 0.00 H ATOM 4075 HB1 ALA A 284 25.104 67.283 52.269 1.00 0.00 H ATOM 4076 HB2 ALA A 284 24.659 68.801 51.450 1.00 0.00 H ATOM 4077 HB3 ALA A 284 23.477 67.972 52.493 1.00 0.00 H ATOM 4078 H ALA A 284 25.775 67.366 49.761 1.00 0.00 H ATOM 4079 N MET A 285 22.862 68.543 48.905 1.00 11.35 N ATOM 4080 CA MET A 285 21.812 69.338 48.259 1.00 13.84 C ATOM 4081 C MET A 285 21.141 68.591 47.140 1.00 13.81 C ATOM 4082 O MET A 285 20.133 69.071 46.610 1.00 15.47 O ATOM 4083 CB MET A 285 22.388 70.633 47.684 1.00 15.83 C ATOM 4084 CG MET A 285 22.792 71.598 48.753 1.00 18.62 C ATOM 4085 SD MET A 285 23.865 72.934 48.150 1.00 22.34 S ATOM 4086 CE MET A 285 22.714 73.830 47.115 1.00 21.67 C ATOM 4087 HA MET A 285 21.076 69.557 49.033 1.00 0.00 H ATOM 4088 HB2 MET A 285 23.263 70.391 47.081 1.00 0.00 H ATOM 4089 HB3 MET A 285 21.633 71.103 47.054 1.00 0.00 H ATOM 4090 HG2 MET A 285 23.325 71.050 49.530 1.00 0.00 H ATOM 4091 HG3 MET A 285 21.891 72.042 49.176 1.00 0.00 H ATOM 4092 HE1 MET A 285 22.346 73.171 46.328 1.00 0.00 H ATOM 4093 HE2 MET A 285 21.877 74.177 47.721 1.00 0.00 H ATOM 4094 HE3 MET A 285 23.220 74.686 46.668 1.00 0.00 H ATOM 4095 H MET A 285 23.836 68.602 48.546 1.00 0.00 H ATOM 4096 N HIS A 286 21.673 67.420 46.776 1.00 15.02 N ATOM 4097 CA HIS A 286 21.166 66.734 45.603 1.00 18.44 C ATOM 4098 C HIS A 286 19.702 66.340 45.810 1.00 19.29 C ATOM 4099 O HIS A 286 19.352 65.690 46.796 1.00 20.86 O ATOM 4100 CB HIS A 286 22.013 65.498 45.316 1.00 20.87 C ATOM 4101 CG HIS A 286 21.530 64.725 44.132 1.00 25.22 C ATOM 4102 ND1 HIS A 286 21.739 65.140 42.837 1.00 28.14 N ATOM 4103 CD2 HIS A 286 20.823 63.577 44.054 1.00 27.11 C ATOM 4104 CE1 HIS A 286 21.183 64.274 42.005 1.00 28.95 C ATOM 4105 NE2 HIS A 286 20.629 63.309 42.719 1.00 28.78 N ATOM 4106 HA HIS A 286 21.225 67.407 44.748 1.00 0.00 H ATOM 4107 HB2 HIS A 286 23.039 65.815 45.130 1.00 0.00 H ATOM 4108 HB3 HIS A 286 21.988 64.848 46.190 1.00 0.00 H ATOM 4109 HD2 HIS A 286 20.472 62.975 44.892 1.00 0.00 H ATOM 4110 HE1 HIS A 286 21.182 64.344 40.917 1.00 0.00 H ATOM 4111 H HIS A 286 22.447 67.003 47.331 1.00 0.00 H ATOM 4112 N GLY A 287 18.845 66.752 44.880 1.00 19.55 N ATOM 4113 CA GLY A 287 17.426 66.413 44.966 1.00 19.93 C ATOM 4114 C GLY A 287 16.599 67.285 45.880 1.00 21.02 C ATOM 4115 O GLY A 287 15.385 67.108 45.952 1.00 23.79 O ATOM 4116 HA3 GLY A 287 17.348 65.386 45.322 1.00 0.00 H ATOM 4117 HA2 GLY A 287 17.003 66.482 43.964 1.00 0.00 H ATOM 4118 H GLY A 287 19.189 67.323 44.081 1.00 0.00 H ATOM 4119 N VAL A 288 17.231 68.237 46.555 1.00 18.17 N ATOM 4120 CA VAL A 288 16.507 69.105 47.493 1.00 18.00 C ATOM 4121 C VAL A 288 15.916 70.264 46.681 1.00 19.42 C ATOM 4122 O VAL A 288 16.653 71.061 46.098 1.00 20.51 O ATOM 4123 CB VAL A 288 17.442 69.603 48.623 1.00 16.60 C ATOM 4124 CG1 VAL A 288 16.724 70.603 49.516 1.00 17.08 C ATOM 4125 CG2 VAL A 288 17.947 68.417 49.446 1.00 17.23 C ATOM 4126 HA VAL A 288 15.705 68.557 47.987 1.00 0.00 H ATOM 4127 HB VAL A 288 18.296 70.106 48.170 1.00 0.00 H ATOM 4128 HG11 VAL A 288 16.406 71.458 48.919 1.00 0.00 H ATOM 4129 HG12 VAL A 288 15.852 70.127 49.965 1.00 0.00 H ATOM 4130 HG13 VAL A 288 17.401 70.938 50.302 1.00 0.00 H ATOM 4131 HG21 VAL A 288 17.098 67.894 49.887 1.00 0.00 H ATOM 4132 HG22 VAL A 288 18.498 67.735 48.798 1.00 0.00 H ATOM 4133 HG23 VAL A 288 18.603 68.779 50.237 1.00 0.00 H ATOM 4134 H VAL A 288 18.253 68.370 46.418 1.00 0.00 H ATOM 4135 N ASP A 289 14.584 70.329 46.623 1.00 18.32 N ATOM 4136 CA ASP A 289 13.920 71.228 45.663 1.00 19.75 C ATOM 4137 C ASP A 289 13.606 72.609 46.192 1.00 18.96 C ATOM 4138 O ASP A 289 12.789 73.333 45.597 1.00 22.04 O ATOM 4139 CB ASP A 289 12.667 70.590 44.994 1.00 22.17 C ATOM 4140 CG ASP A 289 11.531 70.284 45.975 1.00 24.03 C ATOM 4141 OD1 ASP A 289 11.580 70.712 47.157 1.00 24.20 O ATOM 4142 OD2 ASP A 289 10.555 69.607 45.533 1.00 26.93 O ATOM 4143 HA ASP A 289 14.677 71.371 44.892 1.00 0.00 H ATOM 4144 HB2 ASP A 289 12.292 71.280 44.238 1.00 0.00 H ATOM 4145 HB3 ASP A 289 12.969 69.658 44.516 1.00 0.00 H ATOM 4146 H ASP A 289 14.010 69.740 47.260 1.00 0.00 H ATOM 4147 N THR A 290 14.229 72.970 47.312 1.00 17.33 N ATOM 4148 CA THR A 290 14.059 74.293 47.909 1.00 16.27 C ATOM 4149 C THR A 290 15.441 74.890 48.134 1.00 16.14 C ATOM 4150 O THR A 290 16.426 74.148 48.296 1.00 16.97 O ATOM 4151 CB THR A 290 13.324 74.179 49.258 1.00 16.08 C ATOM 4152 OG1 THR A 290 13.952 73.147 50.042 1.00 15.83 O ATOM 4153 CG2 THR A 290 11.850 73.826 49.040 1.00 18.34 C ATOM 4154 HA THR A 290 13.469 74.926 47.246 1.00 0.00 H ATOM 4155 HB THR A 290 13.378 75.136 49.777 1.00 0.00 H ATOM 4156 HG1 THR A 290 13.486 73.066 50.912 1.00 0.00 H ATOM 4157 HG23 THR A 290 11.375 74.607 48.447 1.00 0.00 H ATOM 4158 HG21 THR A 290 11.780 72.874 48.513 1.00 0.00 H ATOM 4159 HG22 THR A 290 11.350 73.746 50.005 1.00 0.00 H ATOM 4160 H THR A 290 14.859 72.286 47.778 1.00 0.00 H ATOM 4161 N PRO A 291 15.533 76.227 48.158 1.00 15.81 N ATOM 4162 CA PRO A 291 16.827 76.858 48.382 1.00 16.19 C ATOM 4163 C PRO A 291 17.282 76.676 49.827 1.00 14.14 C ATOM 4164 O PRO A 291 16.468 76.519 50.737 1.00 13.94 O ATOM 4165 CB PRO A 291 16.550 78.338 48.101 1.00 18.32 C ATOM 4166 CG PRO A 291 15.089 78.506 48.403 1.00 19.44 C ATOM 4167 CD PRO A 291 14.453 77.217 47.951 1.00 17.36 C ATOM 4168 HA PRO A 291 17.615 76.435 47.759 1.00 0.00 H ATOM 4169 HD3 PRO A 291 13.579 76.977 48.556 1.00 0.00 H ATOM 4170 HD2 PRO A 291 14.164 77.269 46.901 1.00 0.00 H ATOM 4171 HG3 PRO A 291 14.677 79.352 47.852 1.00 0.00 H ATOM 4172 HG2 PRO A 291 14.932 78.658 49.471 1.00 0.00 H ATOM 4173 HB2 PRO A 291 17.154 78.974 48.748 1.00 0.00 H ATOM 4174 HB3 PRO A 291 16.759 78.579 47.059 1.00 0.00 H ATOM 4175 N ILE A 292 18.584 76.722 50.036 1.00 13.28 N ATOM 4176 CA ILE A 292 19.111 76.774 51.388 1.00 13.01 C ATOM 4177 C ILE A 292 18.921 78.184 51.930 1.00 13.24 C ATOM 4178 O ILE A 292 19.483 79.133 51.394 1.00 15.21 O ATOM 4179 CB ILE A 292 20.616 76.391 51.398 1.00 12.70 C ATOM 4180 CG1 ILE A 292 20.851 75.012 50.751 1.00 13.23 C ATOM 4181 CG2 ILE A 292 21.198 76.475 52.816 1.00 13.48 C ATOM 4182 CD1 ILE A 292 20.080 73.854 51.415 1.00 14.96 C ATOM 4183 HA ILE A 292 18.578 76.061 52.018 1.00 0.00 H ATOM 4184 HB ILE A 292 21.152 77.118 50.788 1.00 0.00 H ATOM 4185 HG12 ILE A 292 20.546 75.070 49.706 1.00 0.00 H ATOM 4186 HG13 ILE A 292 21.916 74.787 50.805 1.00 0.00 H ATOM 4187 HD11 ILE A 292 20.381 73.770 52.459 1.00 0.00 H ATOM 4188 HD12 ILE A 292 19.010 74.053 51.359 1.00 0.00 H ATOM 4189 HD13 ILE A 292 20.306 72.923 50.895 1.00 0.00 H ATOM 4190 HG21 ILE A 292 21.094 77.493 53.190 1.00 0.00 H ATOM 4191 HG22 ILE A 292 20.659 75.790 53.470 1.00 0.00 H ATOM 4192 HG23 ILE A 292 22.253 76.201 52.791 1.00 0.00 H ATOM 4193 H ILE A 292 19.237 76.721 49.227 1.00 0.00 H ATOM 4194 N ASP A 293 18.158 78.314 53.005 1.00 12.50 N ATOM 4195 CA ASP A 293 17.875 79.623 53.563 1.00 12.99 C ATOM 4196 C ASP A 293 18.970 80.092 54.523 1.00 12.92 C ATOM 4197 O ASP A 293 19.227 81.299 54.624 1.00 14.22 O ATOM 4198 CB ASP A 293 16.533 79.613 54.286 1.00 14.04 C ATOM 4199 CG ASP A 293 15.385 79.266 53.374 1.00 14.67 C ATOM 4200 OD1 ASP A 293 15.306 79.835 52.248 1.00 16.43 O ATOM 4201 OD2 ASP A 293 14.559 78.411 53.766 1.00 14.47 O ATOM 4202 HA ASP A 293 17.840 80.324 52.729 1.00 0.00 H ATOM 4203 HB2 ASP A 293 16.575 78.878 55.090 1.00 0.00 H ATOM 4204 HB3 ASP A 293 16.357 80.602 54.709 1.00 0.00 H ATOM 4205 H ASP A 293 17.757 77.467 53.455 1.00 0.00 H ATOM 4206 N TYR A 294 19.591 79.174 55.252 1.00 11.60 N ATOM 4207 CA TYR A 294 20.557 79.492 56.280 1.00 11.23 C ATOM 4208 C TYR A 294 21.581 78.379 56.293 1.00 10.03 C ATOM 4209 O TYR A 294 21.229 77.189 56.195 1.00 10.70 O ATOM 4210 CB TYR A 294 19.872 79.625 57.663 1.00 11.75 C ATOM 4211 CG TYR A 294 20.913 79.649 58.761 1.00 11.71 C ATOM 4212 CD1 TYR A 294 21.742 80.766 58.931 1.00 12.28 C ATOM 4213 CD2 TYR A 294 21.139 78.530 59.565 1.00 12.29 C ATOM 4214 CE1 TYR A 294 22.758 80.782 59.888 1.00 11.98 C ATOM 4215 CE2 TYR A 294 22.137 78.533 60.523 1.00 11.55 C ATOM 4216 CZ TYR A 294 22.949 79.644 60.671 1.00 12.01 C ATOM 4217 OH TYR A 294 23.932 79.580 61.620 1.00 12.43 O ATOM 4218 HA TYR A 294 21.034 80.450 56.070 1.00 0.00 H ATOM 4219 HB3 TYR A 294 19.204 78.777 57.818 1.00 0.00 H ATOM 4220 HB2 TYR A 294 19.296 80.550 57.692 1.00 0.00 H ATOM 4221 HD2 TYR A 294 20.521 77.642 59.436 1.00 0.00 H ATOM 4222 HE2 TYR A 294 22.284 77.661 61.161 1.00 0.00 H ATOM 4223 HE1 TYR A 294 23.387 81.663 60.020 1.00 0.00 H ATOM 4224 HD1 TYR A 294 21.590 81.643 58.301 1.00 0.00 H ATOM 4225 HH TYR A 294 24.439 80.430 61.626 1.00 0.00 H ATOM 4226 H TYR A 294 19.372 78.173 55.075 1.00 0.00 H ATOM 4227 N LEU A 295 22.846 78.784 56.407 1.00 9.66 N ATOM 4228 CA LEU A 295 23.965 77.854 56.495 1.00 10.40 C ATOM 4229 C LEU A 295 24.749 78.126 57.765 1.00 10.17 C ATOM 4230 O LEU A 295 25.270 79.245 57.961 1.00 11.42 O ATOM 4231 CB LEU A 295 24.838 78.003 55.251 1.00 11.31 C ATOM 4232 CG LEU A 295 26.086 77.124 55.066 1.00 13.74 C ATOM 4233 CD1 LEU A 295 26.397 77.004 53.535 1.00 16.17 C ATOM 4234 CD2 LEU A 295 27.278 77.468 55.846 1.00 14.92 C ATOM 4235 HA LEU A 295 23.605 76.826 56.538 1.00 0.00 H ATOM 4236 HB2 LEU A 295 24.193 77.816 54.392 1.00 0.00 H ATOM 4237 HB3 LEU A 295 25.178 79.038 55.230 1.00 0.00 H ATOM 4238 HG LEU A 295 25.821 76.158 55.496 1.00 0.00 H ATOM 4239 HD21 LEU A 295 27.597 78.479 55.593 1.00 0.00 H ATOM 4240 HD22 LEU A 295 27.043 77.415 56.909 1.00 0.00 H ATOM 4241 HD23 LEU A 295 28.078 76.765 55.614 1.00 0.00 H ATOM 4242 HD11 LEU A 295 25.546 76.550 53.027 1.00 0.00 H ATOM 4243 HD12 LEU A 295 26.580 77.997 53.124 1.00 0.00 H ATOM 4244 HD13 LEU A 295 27.281 76.382 53.393 1.00 0.00 H ATOM 4245 H LEU A 295 23.042 79.805 56.434 1.00 0.00 H ATOM 4246 N ASN A 296 24.820 77.092 58.604 1.00 9.63 N ATOM 4247 CA ASN A 296 25.666 77.148 59.800 1.00 10.34 C ATOM 4248 C ASN A 296 27.035 76.635 59.391 1.00 9.28 C ATOM 4249 O ASN A 296 27.202 75.433 59.100 1.00 9.86 O ATOM 4250 CB ASN A 296 25.047 76.278 60.896 1.00 12.29 C ATOM 4251 CG ASN A 296 25.754 76.416 62.208 1.00 13.07 C ATOM 4252 OD1 ASN A 296 26.662 75.646 62.521 1.00 15.70 O ATOM 4253 ND2 ASN A 296 25.304 77.349 63.025 1.00 15.92 N ATOM 4254 HA ASN A 296 25.752 78.160 60.195 1.00 0.00 H ATOM 4255 HB2 ASN A 296 24.005 76.571 61.028 1.00 0.00 H ATOM 4256 HB3 ASN A 296 25.093 75.235 60.582 1.00 0.00 H ATOM 4257 HD22 ASN A 296 24.535 77.979 62.721 1.00 0.00 H ATOM 4258 HD21 ASN A 296 25.719 77.454 63.973 1.00 0.00 H ATOM 4259 H ASN A 296 24.267 76.233 58.407 1.00 0.00 H ATOM 4260 N SER A 297 28.005 77.545 59.291 1.00 11.25 N ATOM 4261 CA SER A 297 29.274 77.169 58.689 1.00 12.81 C ATOM 4262 C SER A 297 30.129 76.361 59.651 1.00 11.88 C ATOM 4263 O SER A 297 29.926 76.358 60.870 1.00 12.95 O ATOM 4264 CB SER A 297 30.022 78.396 58.163 1.00 14.98 C ATOM 4265 OG SER A 297 30.239 79.281 59.229 1.00 16.75 O ATOM 4266 HA SER A 297 29.057 76.527 57.835 1.00 0.00 H ATOM 4267 HB2 SER A 297 29.426 78.887 57.393 1.00 0.00 H ATOM 4268 HB3 SER A 297 30.979 78.089 57.740 1.00 0.00 H ATOM 4269 HG SER A 297 30.723 80.080 58.900 1.00 0.00 H ATOM 4270 H SER A 297 27.855 78.513 59.640 1.00 0.00 H ATOM 4271 N HIS A 298 31.095 75.650 59.098 1.00 10.32 N ATOM 4272 CA HIS A 298 32.086 74.979 59.922 1.00 12.08 C ATOM 4273 C HIS A 298 32.911 76.019 60.696 1.00 12.41 C ATOM 4274 O HIS A 298 33.140 75.863 61.890 1.00 15.31 O ATOM 4275 CB HIS A 298 32.920 74.106 58.987 1.00 12.85 C ATOM 4276 CG HIS A 298 34.155 73.564 59.609 1.00 14.29 C ATOM 4277 ND1 HIS A 298 34.144 72.600 60.585 1.00 16.05 N ATOM 4278 CD2 HIS A 298 35.455 73.876 59.391 1.00 17.16 C ATOM 4279 CE1 HIS A 298 35.390 72.341 60.955 1.00 15.27 C ATOM 4280 NE2 HIS A 298 36.204 73.113 60.250 1.00 17.50 N ATOM 4281 HA HIS A 298 31.635 74.341 60.682 1.00 0.00 H ATOM 4282 HB2 HIS A 298 32.304 73.268 58.660 1.00 0.00 H ATOM 4283 HB3 HIS A 298 33.206 74.705 58.122 1.00 0.00 H ATOM 4284 HD2 HIS A 298 35.835 74.598 58.668 1.00 0.00 H ATOM 4285 HE1 HIS A 298 35.693 71.616 61.711 1.00 0.00 H ATOM 4286 H HIS A 298 31.147 75.570 58.062 1.00 0.00 H ATOM 4287 N GLY A 299 33.372 77.047 59.988 1.00 12.41 N ATOM 4288 CA GLY A 299 34.063 78.231 60.487 1.00 14.70 C ATOM 4289 C GLY A 299 34.615 78.192 61.894 1.00 13.05 C ATOM 4290 O GLY A 299 33.963 78.684 62.833 1.00 14.63 O ATOM 4291 HA3 GLY A 299 33.359 79.062 60.438 1.00 0.00 H ATOM 4292 HA2 GLY A 299 34.900 78.425 59.816 1.00 0.00 H ATOM 4293 H GLY A 299 33.222 77.001 58.960 1.00 0.00 H ATOM 4294 N THR A 300 35.845 77.697 62.042 1.00 12.79 N ATOM 4295 CA THR A 300 36.422 77.529 63.374 1.00 12.40 C ATOM 4296 C THR A 300 37.228 78.705 63.921 1.00 13.16 C ATOM 4297 O THR A 300 37.615 78.651 65.085 1.00 13.33 O ATOM 4298 CB THR A 300 37.321 76.301 63.441 1.00 14.56 C ATOM 4299 OG1 THR A 300 38.435 76.521 62.575 1.00 19.31 O ATOM 4300 CG2 THR A 300 36.584 75.037 62.999 1.00 14.70 C ATOM 4301 HA THR A 300 35.534 77.432 63.999 1.00 0.00 H ATOM 4302 HB THR A 300 37.642 76.155 64.472 1.00 0.00 H ATOM 4303 HG1 THR A 300 39.034 75.733 62.603 1.00 0.00 H ATOM 4304 HG23 THR A 300 35.733 74.865 63.658 1.00 0.00 H ATOM 4305 HG21 THR A 300 36.233 75.162 61.975 1.00 0.00 H ATOM 4306 HG22 THR A 300 37.263 74.186 63.051 1.00 0.00 H ATOM 4307 H THR A 300 36.398 77.429 61.203 1.00 0.00 H ATOM 4308 N SER A 301 37.463 79.749 63.113 1.00 12.40 N ATOM 4309 CA SER A 301 38.274 80.901 63.494 1.00 12.64 C ATOM 4310 C SER A 301 39.750 80.713 63.200 1.00 13.87 C ATOM 4311 O SER A 301 40.612 81.264 63.869 1.00 14.24 O ATOM 4312 CB SER A 301 38.005 81.363 64.942 1.00 12.96 C ATOM 4313 OG SER A 301 38.346 82.751 65.060 1.00 13.63 O ATOM 4314 HA SER A 301 37.950 81.719 62.850 1.00 0.00 H ATOM 4315 HB2 SER A 301 38.613 80.777 65.632 1.00 0.00 H ATOM 4316 HB3 SER A 301 36.951 81.224 65.180 1.00 0.00 H ATOM 4317 HG SER A 301 39.304 82.874 64.842 1.00 0.00 H ATOM 4318 H SER A 301 37.044 79.737 62.161 1.00 0.00 H ATOM 4319 N THR A 302 40.035 79.893 62.204 1.00 15.83 N ATOM 4320 CA THR A 302 41.428 79.666 61.782 1.00 16.81 C ATOM 4321 C THR A 302 41.687 80.474 60.505 1.00 17.67 C ATOM 4322 O THR A 302 40.802 80.588 59.635 1.00 18.91 O ATOM 4323 CB THR A 302 41.652 78.161 61.544 1.00 18.76 C ATOM 4324 OG1 THR A 302 41.464 77.446 62.775 1.00 18.84 O ATOM 4325 CG2 THR A 302 43.013 77.860 61.006 1.00 19.77 C ATOM 4326 HA THR A 302 42.124 79.992 62.555 1.00 0.00 H ATOM 4327 HB THR A 302 40.925 77.843 60.797 1.00 0.00 H ATOM 4328 HG1 THR A 302 42.112 77.773 63.448 1.00 0.00 H ATOM 4329 HG23 THR A 302 43.161 78.401 60.071 1.00 0.00 H ATOM 4330 HG21 THR A 302 43.766 78.172 61.730 1.00 0.00 H ATOM 4331 HG22 THR A 302 43.102 76.789 60.826 1.00 0.00 H ATOM 4332 H THR A 302 39.264 79.400 61.710 1.00 0.00 H ATOM 4333 N PRO A 303 42.888 81.048 60.367 1.00 18.91 N ATOM 4334 CA PRO A 303 43.222 81.768 59.117 1.00 20.56 C ATOM 4335 C PRO A 303 42.911 81.009 57.821 1.00 20.55 C ATOM 4336 O PRO A 303 42.161 81.512 56.977 1.00 22.57 O ATOM 4337 CB PRO A 303 44.721 82.048 59.267 1.00 21.28 C ATOM 4338 CG PRO A 303 44.884 82.191 60.751 1.00 21.39 C ATOM 4339 CD PRO A 303 43.972 81.153 61.362 1.00 19.52 C ATOM 4340 HA PRO A 303 42.607 82.661 59.008 1.00 0.00 H ATOM 4341 HD3 PRO A 303 44.487 80.200 61.485 1.00 0.00 H ATOM 4342 HD2 PRO A 303 43.589 81.485 62.327 1.00 0.00 H ATOM 4343 HG3 PRO A 303 44.592 83.191 61.072 1.00 0.00 H ATOM 4344 HG2 PRO A 303 45.919 82.006 61.040 1.00 0.00 H ATOM 4345 HB2 PRO A 303 45.316 81.219 58.884 1.00 0.00 H ATOM 4346 HB3 PRO A 303 45.003 82.965 58.750 1.00 0.00 H ATOM 4347 N VAL A 304 43.433 79.803 57.667 1.00 21.44 N ATOM 4348 CA VAL A 304 43.273 79.120 56.386 1.00 23.15 C ATOM 4349 C VAL A 304 41.850 78.569 56.219 1.00 22.41 C ATOM 4350 O VAL A 304 41.193 78.798 55.184 1.00 23.64 O ATOM 4351 CB VAL A 304 44.300 77.986 56.218 1.00 23.83 C ATOM 4352 CG1 VAL A 304 43.967 77.136 54.980 1.00 25.21 C ATOM 4353 CG2 VAL A 304 45.729 78.548 56.117 1.00 26.21 C ATOM 4354 HA VAL A 304 43.450 79.862 55.607 1.00 0.00 H ATOM 4355 HB VAL A 304 44.248 77.349 57.101 1.00 0.00 H ATOM 4356 HG11 VAL A 304 42.974 76.701 55.096 1.00 0.00 H ATOM 4357 HG12 VAL A 304 43.987 77.767 54.091 1.00 0.00 H ATOM 4358 HG13 VAL A 304 44.704 76.340 54.878 1.00 0.00 H ATOM 4359 HG21 VAL A 304 45.797 79.213 55.256 1.00 0.00 H ATOM 4360 HG22 VAL A 304 45.965 79.103 57.025 1.00 0.00 H ATOM 4361 HG23 VAL A 304 46.434 77.725 55.999 1.00 0.00 H ATOM 4362 H VAL A 304 43.950 79.348 58.447 1.00 0.00 H ATOM 4363 N GLY A 305 41.361 77.872 57.249 1.00 21.58 N ATOM 4364 CA GLY A 305 40.092 77.166 57.158 1.00 21.17 C ATOM 4365 C GLY A 305 38.904 78.060 56.866 1.00 19.27 C ATOM 4366 O GLY A 305 38.041 77.692 56.050 1.00 18.85 O ATOM 4367 HA3 GLY A 305 39.914 76.659 58.106 1.00 0.00 H ATOM 4368 HA2 GLY A 305 40.168 76.427 56.361 1.00 0.00 H ATOM 4369 H GLY A 305 41.901 77.833 58.137 1.00 0.00 H ATOM 4370 N ASP A 306 38.830 79.220 57.517 1.00 17.82 N ATOM 4371 CA ASP A 306 37.624 80.033 57.369 1.00 17.07 C ATOM 4372 C ASP A 306 37.415 80.446 55.914 1.00 18.70 C ATOM 4373 O ASP A 306 36.305 80.374 55.381 1.00 19.53 O ATOM 4374 CB ASP A 306 37.694 81.298 58.221 1.00 16.70 C ATOM 4375 CG ASP A 306 37.563 81.036 59.712 1.00 16.65 C ATOM 4376 OD1 ASP A 306 37.544 79.858 60.187 1.00 16.66 O ATOM 4377 OD2 ASP A 306 37.478 82.059 60.431 1.00 16.26 O ATOM 4378 HA ASP A 306 36.790 79.416 57.703 1.00 0.00 H ATOM 4379 HB2 ASP A 306 38.653 81.784 58.039 1.00 0.00 H ATOM 4380 HB3 ASP A 306 36.887 81.964 57.916 1.00 0.00 H ATOM 4381 H ASP A 306 39.615 79.541 58.119 1.00 0.00 H ATOM 4382 N VAL A 307 38.475 80.908 55.271 1.00 20.39 N ATOM 4383 CA VAL A 307 38.252 81.434 53.923 1.00 20.88 C ATOM 4384 C VAL A 307 38.216 80.310 52.882 1.00 21.20 C ATOM 4385 O VAL A 307 37.605 80.468 51.839 1.00 21.35 O ATOM 4386 CB VAL A 307 39.181 82.610 53.557 1.00 23.71 C ATOM 4387 CG1 VAL A 307 38.831 83.848 54.425 1.00 24.43 C ATOM 4388 CG2 VAL A 307 40.650 82.210 53.738 1.00 22.45 C ATOM 4389 HA VAL A 307 37.259 81.883 53.917 1.00 0.00 H ATOM 4390 HB VAL A 307 39.032 82.868 52.509 1.00 0.00 H ATOM 4391 HG11 VAL A 307 37.796 84.136 54.244 1.00 0.00 H ATOM 4392 HG12 VAL A 307 38.961 83.600 55.478 1.00 0.00 H ATOM 4393 HG13 VAL A 307 39.491 84.674 54.161 1.00 0.00 H ATOM 4394 HG21 VAL A 307 40.824 81.931 54.777 1.00 0.00 H ATOM 4395 HG22 VAL A 307 40.877 81.363 53.090 1.00 0.00 H ATOM 4396 HG23 VAL A 307 41.290 83.052 53.475 1.00 0.00 H ATOM 4397 H VAL A 307 39.421 80.898 55.702 1.00 0.00 H ATOM 4398 N LYS A 308 38.821 79.164 53.179 1.00 19.13 N ATOM 4399 CA LYS A 308 38.650 78.009 52.291 1.00 20.24 C ATOM 4400 C LYS A 308 37.173 77.588 52.217 1.00 17.65 C ATOM 4401 O LYS A 308 36.637 77.289 51.129 1.00 16.86 O ATOM 4402 CB LYS A 308 39.502 76.846 52.773 1.00 22.18 C ATOM 4403 CG LYS A 308 39.908 75.882 51.664 1.00 25.29 C ATOM 4404 CD LYS A 308 41.125 76.390 50.860 1.00 26.91 C ATOM 4405 HA LYS A 308 38.974 78.297 51.291 1.00 0.00 H ATOM 4406 HB2 LYS A 308 40.407 77.248 53.228 1.00 0.00 H ATOM 4407 HB3 LYS A 308 38.936 76.291 53.521 1.00 0.00 H ATOM 4408 HG2 LYS A 308 40.160 74.920 52.110 1.00 0.00 H ATOM 4409 HG3 LYS A 308 39.066 75.756 50.983 1.00 0.00 H ATOM 4410 HD2 LYS A 308 40.882 77.349 50.402 1.00 0.00 H ATOM 4411 HD3 LYS A 308 41.976 76.512 51.530 1.00 0.00 H ATOM 4412 H LYS A 308 39.410 79.087 54.033 1.00 0.00 H ATOM 4413 N GLU A 309 36.505 77.573 53.370 1.00 15.52 N ATOM 4414 CA GLU A 309 35.082 77.266 53.385 1.00 14.44 C ATOM 4415 C GLU A 309 34.285 78.325 52.637 1.00 14.83 C ATOM 4416 O GLU A 309 33.387 77.993 51.901 1.00 14.50 O ATOM 4417 CB GLU A 309 34.550 77.099 54.790 1.00 14.42 C ATOM 4418 CG GLU A 309 33.038 76.804 54.786 1.00 15.22 C ATOM 4419 CD GLU A 309 32.508 76.559 56.169 1.00 15.68 C ATOM 4420 OE1 GLU A 309 33.177 76.987 57.109 1.00 18.77 O ATOM 4421 OE2 GLU A 309 31.441 75.948 56.329 1.00 13.65 O ATOM 4422 HA GLU A 309 34.960 76.312 52.872 1.00 0.00 H ATOM 4423 HB2 GLU A 309 35.072 76.272 55.271 1.00 0.00 H ATOM 4424 HB3 GLU A 309 34.731 78.017 55.350 1.00 0.00 H ATOM 4425 HG2 GLU A 309 32.514 77.657 54.354 1.00 0.00 H ATOM 4426 HG3 GLU A 309 32.854 75.919 54.177 1.00 0.00 H ATOM 4427 H GLU A 309 37.001 77.781 54.260 1.00 0.00 H ATOM 4428 N LEU A 310 34.640 79.602 52.790 1.00 14.42 N ATOM 4429 CA LEU A 310 33.908 80.651 52.073 1.00 15.42 C ATOM 4430 C LEU A 310 34.071 80.486 50.587 1.00 14.98 C ATOM 4431 O LEU A 310 33.109 80.671 49.841 1.00 16.33 O ATOM 4432 CB LEU A 310 34.378 82.034 52.492 1.00 17.04 C ATOM 4433 CG LEU A 310 33.921 82.414 53.912 1.00 17.33 C ATOM 4434 CD1 LEU A 310 34.263 83.829 54.127 1.00 18.74 C ATOM 4435 CD2 LEU A 310 32.409 82.163 54.178 1.00 18.31 C ATOM 4436 HA LEU A 310 32.853 80.553 52.330 1.00 0.00 H ATOM 4437 HB2 LEU A 310 35.467 82.057 52.458 1.00 0.00 H ATOM 4438 HB3 LEU A 310 33.979 82.766 51.790 1.00 0.00 H ATOM 4439 HG LEU A 310 34.439 81.767 54.620 1.00 0.00 H ATOM 4440 HD21 LEU A 310 31.816 82.753 53.480 1.00 0.00 H ATOM 4441 HD22 LEU A 310 32.188 81.105 54.041 1.00 0.00 H ATOM 4442 HD23 LEU A 310 32.168 82.456 55.200 1.00 0.00 H ATOM 4443 HD11 LEU A 310 35.340 83.960 54.027 1.00 0.00 H ATOM 4444 HD12 LEU A 310 33.750 84.442 53.386 1.00 0.00 H ATOM 4445 HD13 LEU A 310 33.951 84.129 55.127 1.00 0.00 H ATOM 4446 H LEU A 310 35.433 79.852 53.415 1.00 0.00 H ATOM 4447 N ALA A 311 35.290 80.181 50.145 1.00 14.53 N ATOM 4448 CA ALA A 311 35.490 79.925 48.720 1.00 15.27 C ATOM 4449 C ALA A 311 34.637 78.734 48.237 1.00 14.40 C ATOM 4450 O ALA A 311 34.078 78.776 47.121 1.00 15.10 O ATOM 4451 CB ALA A 311 36.944 79.721 48.423 1.00 16.85 C ATOM 4452 HA ALA A 311 35.154 80.801 48.166 1.00 0.00 H ATOM 4453 HB1 ALA A 311 37.500 80.615 48.704 1.00 0.00 H ATOM 4454 HB2 ALA A 311 37.314 78.868 48.992 1.00 0.00 H ATOM 4455 HB3 ALA A 311 37.073 79.532 47.357 1.00 0.00 H ATOM 4456 H ALA A 311 36.091 80.126 50.807 1.00 0.00 H ATOM 4457 N ALA A 312 34.508 77.692 49.068 1.00 12.93 N ATOM 4458 CA ALA A 312 33.670 76.548 48.678 1.00 13.34 C ATOM 4459 C ALA A 312 32.204 76.950 48.607 1.00 12.60 C ATOM 4460 O ALA A 312 31.481 76.542 47.695 1.00 13.42 O ATOM 4461 CB ALA A 312 33.822 75.391 49.679 1.00 14.77 C ATOM 4462 HA ALA A 312 34.004 76.220 47.693 1.00 0.00 H ATOM 4463 HB1 ALA A 312 34.863 75.070 49.706 1.00 0.00 H ATOM 4464 HB2 ALA A 312 33.518 75.727 50.670 1.00 0.00 H ATOM 4465 HB3 ALA A 312 33.192 74.558 49.368 1.00 0.00 H ATOM 4466 H ALA A 312 34.998 77.692 49.985 1.00 0.00 H ATOM 4467 N ILE A 313 31.763 77.753 49.577 1.00 12.96 N ATOM 4468 CA ILE A 313 30.394 78.285 49.570 1.00 13.63 C ATOM 4469 C ILE A 313 30.133 79.095 48.299 1.00 13.61 C ATOM 4470 O ILE A 313 29.087 78.925 47.648 1.00 15.05 O ATOM 4471 CB ILE A 313 30.095 79.099 50.835 1.00 14.03 C ATOM 4472 CG1 ILE A 313 30.054 78.125 52.032 1.00 15.53 C ATOM 4473 CG2 ILE A 313 28.763 79.836 50.704 1.00 16.19 C ATOM 4474 CD1 ILE A 313 30.119 78.848 53.361 1.00 17.72 C ATOM 4475 HA ILE A 313 29.707 77.439 49.572 1.00 0.00 H ATOM 4476 HB ILE A 313 30.872 79.849 50.984 1.00 0.00 H ATOM 4477 HG12 ILE A 313 29.127 77.553 51.988 1.00 0.00 H ATOM 4478 HG13 ILE A 313 30.903 77.445 51.960 1.00 0.00 H ATOM 4479 HD11 ILE A 313 31.047 79.417 53.419 1.00 0.00 H ATOM 4480 HD12 ILE A 313 29.270 79.526 53.446 1.00 0.00 H ATOM 4481 HD13 ILE A 313 30.087 78.120 54.171 1.00 0.00 H ATOM 4482 HG21 ILE A 313 28.807 80.514 49.851 1.00 0.00 H ATOM 4483 HG22 ILE A 313 27.962 79.112 50.554 1.00 0.00 H ATOM 4484 HG23 ILE A 313 28.574 80.406 51.614 1.00 0.00 H ATOM 4485 H ILE A 313 32.403 78.008 50.356 1.00 0.00 H ATOM 4486 N ARG A 314 31.094 79.935 47.920 1.00 15.87 N ATOM 4487 CA ARG A 314 30.941 80.691 46.668 1.00 17.54 C ATOM 4488 C ARG A 314 30.827 79.781 45.465 1.00 16.34 C ATOM 4489 O ARG A 314 30.061 80.052 44.548 1.00 18.40 O ATOM 4490 CB ARG A 314 32.120 81.605 46.421 1.00 20.14 C ATOM 4491 CG ARG A 314 32.060 82.792 47.227 1.00 22.93 C ATOM 4492 CD ARG A 314 32.886 83.919 46.598 1.00 24.20 C ATOM 4493 NE ARG A 314 33.200 84.857 47.683 1.00 25.02 N ATOM 4494 CZ ARG A 314 34.197 84.685 48.551 1.00 26.03 C ATOM 4495 NH1 ARG A 314 35.037 83.653 48.435 1.00 24.35 N ATOM 4496 NH2 ARG A 314 34.371 85.554 49.538 1.00 25.65 N ATOM 4497 HA ARG A 314 30.025 81.270 46.789 1.00 0.00 H ATOM 4498 HB2 ARG A 314 33.038 81.066 46.655 1.00 0.00 H ATOM 4499 HB3 ARG A 314 32.128 81.893 45.370 1.00 0.00 H ATOM 4500 HG2 ARG A 314 31.022 83.114 47.313 1.00 0.00 H ATOM 4501 HG3 ARG A 314 32.454 82.571 48.219 1.00 0.00 H ATOM 4502 HD2 ARG A 314 32.310 84.421 45.820 1.00 0.00 H ATOM 4503 HD3 ARG A 314 33.804 83.519 46.167 1.00 0.00 H ATOM 4504 HE ARG A 314 32.609 85.707 47.780 1.00 0.00 H ATOM 4505 HH12 ARG A 314 35.810 83.532 49.120 1.00 0.00 H ATOM 4506 HH11 ARG A 314 34.918 82.970 47.660 1.00 0.00 H ATOM 4507 HH22 ARG A 314 35.148 85.422 50.216 1.00 0.00 H ATOM 4508 HH21 ARG A 314 33.730 86.368 49.634 1.00 0.00 H ATOM 4509 H ARG A 314 31.946 80.055 48.505 1.00 0.00 H ATOM 4510 N GLU A 315 31.624 78.721 45.432 1.00 16.01 N ATOM 4511 CA GLU A 315 31.540 77.793 44.310 1.00 16.54 C ATOM 4512 C GLU A 315 30.186 77.107 44.233 1.00 15.78 C ATOM 4513 O GLU A 315 29.642 76.944 43.130 1.00 18.13 O ATOM 4514 CB GLU A 315 32.663 76.757 44.384 1.00 18.08 C ATOM 4515 CG GLU A 315 32.619 75.701 43.315 1.00 23.20 C ATOM 4516 CD GLU A 315 32.654 76.244 41.897 1.00 27.30 C ATOM 4517 OE1 GLU A 315 33.293 77.300 41.669 1.00 28.80 O ATOM 4518 OE2 GLU A 315 32.024 75.620 41.009 1.00 30.88 O ATOM 4519 HA GLU A 315 31.658 78.378 43.398 1.00 0.00 H ATOM 4520 HB2 GLU A 315 33.615 77.282 44.303 1.00 0.00 H ATOM 4521 HB3 GLU A 315 32.604 76.261 45.353 1.00 0.00 H ATOM 4522 HG2 GLU A 315 33.477 75.043 43.450 1.00 0.00 H ATOM 4523 HG3 GLU A 315 31.700 75.128 43.439 1.00 0.00 H ATOM 4524 H GLU A 315 32.304 78.553 46.201 1.00 0.00 H ATOM 4525 N VAL A 316 29.645 76.683 45.382 1.00 13.59 N ATOM 4526 CA VAL A 316 28.362 75.987 45.402 1.00 14.18 C ATOM 4527 C VAL A 316 27.197 76.914 45.048 1.00 15.30 C ATOM 4528 O VAL A 316 26.315 76.524 44.266 1.00 17.92 O ATOM 4529 CB VAL A 316 28.127 75.344 46.787 1.00 12.98 C ATOM 4530 CG1 VAL A 316 26.721 74.761 46.856 1.00 14.29 C ATOM 4531 CG2 VAL A 316 29.152 74.234 47.005 1.00 12.97 C ATOM 4532 HA VAL A 316 28.402 75.208 44.641 1.00 0.00 H ATOM 4533 HB VAL A 316 28.236 76.103 47.562 1.00 0.00 H ATOM 4534 HG11 VAL A 316 25.991 75.556 46.699 1.00 0.00 H ATOM 4535 HG12 VAL A 316 26.605 74.002 46.082 1.00 0.00 H ATOM 4536 HG13 VAL A 316 26.564 74.310 47.836 1.00 0.00 H ATOM 4537 HG21 VAL A 316 29.039 73.479 46.227 1.00 0.00 H ATOM 4538 HG22 VAL A 316 30.156 74.655 46.962 1.00 0.00 H ATOM 4539 HG23 VAL A 316 28.989 73.778 47.981 1.00 0.00 H ATOM 4540 H VAL A 316 30.148 76.853 46.276 1.00 0.00 H ATOM 4541 N PHE A 317 27.190 78.119 45.621 1.00 15.10 N ATOM 4542 CA PHE A 317 25.990 78.974 45.581 1.00 16.44 C ATOM 4543 C PHE A 317 26.085 80.159 44.636 1.00 17.32 C ATOM 4544 O PHE A 317 25.067 80.795 44.366 1.00 20.31 O ATOM 4545 CB PHE A 317 25.684 79.488 46.972 1.00 15.33 C ATOM 4546 CG PHE A 317 25.259 78.414 47.921 1.00 14.60 C ATOM 4547 CD1 PHE A 317 23.945 77.934 47.927 1.00 14.33 C ATOM 4548 CD2 PHE A 317 26.175 77.889 48.811 1.00 14.35 C ATOM 4549 CE1 PHE A 317 23.561 76.942 48.815 1.00 15.03 C ATOM 4550 CE2 PHE A 317 25.823 76.881 49.698 1.00 13.99 C ATOM 4551 CZ PHE A 317 24.496 76.427 49.724 1.00 13.93 C ATOM 4552 HA PHE A 317 25.193 78.336 45.199 1.00 0.00 H ATOM 4553 HB2 PHE A 317 26.580 79.966 47.369 1.00 0.00 H ATOM 4554 HB3 PHE A 317 24.883 80.223 46.901 1.00 0.00 H ATOM 4555 HD2 PHE A 317 27.195 78.274 48.817 1.00 0.00 H ATOM 4556 HE2 PHE A 317 26.568 76.448 50.366 1.00 0.00 H ATOM 4557 HZ PHE A 317 24.192 75.674 50.451 1.00 0.00 H ATOM 4558 HE1 PHE A 317 22.539 76.564 48.807 1.00 0.00 H ATOM 4559 HD1 PHE A 317 23.217 78.344 47.227 1.00 0.00 H ATOM 4560 H PHE A 317 28.045 78.461 46.104 1.00 0.00 H ATOM 4561 N GLY A 318 27.281 80.458 44.135 1.00 17.31 N ATOM 4562 CA GLY A 318 27.502 81.596 43.223 1.00 18.53 C ATOM 4563 C GLY A 318 27.078 82.891 43.907 1.00 20.77 C ATOM 4564 O GLY A 318 27.467 83.186 45.057 1.00 23.19 O ATOM 4565 HA3 GLY A 318 26.913 81.455 42.317 1.00 0.00 H ATOM 4566 HA2 GLY A 318 28.559 81.652 42.963 1.00 0.00 H ATOM 4567 H GLY A 318 28.094 79.865 44.397 1.00 0.00 H ATOM 4568 N ASP A 319 26.221 83.642 43.230 1.00 20.91 N ATOM 4569 CA ASP A 319 25.784 84.931 43.751 1.00 21.47 C ATOM 4570 C ASP A 319 24.558 84.840 44.617 1.00 20.71 C ATOM 4571 O ASP A 319 24.017 85.854 45.030 1.00 21.99 O ATOM 4572 CB ASP A 319 25.570 85.900 42.591 1.00 24.38 C ATOM 4573 CG ASP A 319 26.872 86.348 41.995 1.00 29.30 C ATOM 4574 OD1 ASP A 319 27.846 86.560 42.771 1.00 32.18 O ATOM 4575 OD2 ASP A 319 26.907 86.501 40.762 1.00 31.34 O ATOM 4576 HA ASP A 319 26.574 85.305 44.403 1.00 0.00 H ATOM 4577 HB2 ASP A 319 24.980 85.404 41.820 1.00 0.00 H ATOM 4578 HB3 ASP A 319 25.029 86.773 42.955 1.00 0.00 H ATOM 4579 H ASP A 319 25.856 83.307 42.316 1.00 0.00 H ATOM 4580 N LYS A 320 24.130 83.625 44.917 1.00 20.06 N ATOM 4581 CA LYS A 320 22.922 83.425 45.700 1.00 21.82 C ATOM 4582 C LYS A 320 23.212 82.715 47.022 1.00 19.87 C ATOM 4583 O LYS A 320 22.571 81.715 47.380 1.00 21.99 O ATOM 4584 CB LYS A 320 21.852 82.739 44.860 1.00 23.68 C ATOM 4585 CG LYS A 320 21.361 83.667 43.718 1.00 27.98 C ATOM 4586 CD LYS A 320 20.170 83.088 42.996 1.00 31.02 C ATOM 4587 CE LYS A 320 19.668 84.048 41.918 1.00 33.18 C ATOM 4588 NZ LYS A 320 20.751 84.488 40.994 1.00 36.33 N ATOM 4589 HA LYS A 320 22.523 84.399 45.982 1.00 0.00 H ATOM 4590 HB2 LYS A 320 22.268 81.829 44.427 1.00 0.00 H ATOM 4591 HB3 LYS A 320 21.007 82.482 45.499 1.00 0.00 H ATOM 4592 HG2 LYS A 320 21.082 84.631 44.143 1.00 0.00 H ATOM 4593 HG3 LYS A 320 22.172 83.807 43.004 1.00 0.00 H ATOM 4594 HD2 LYS A 320 20.458 82.146 42.530 1.00 0.00 H ATOM 4595 HD3 LYS A 320 19.370 82.907 43.714 1.00 0.00 H ATOM 4596 HE2 LYS A 320 19.244 84.927 42.403 1.00 0.00 H ATOM 4597 HE3 LYS A 320 18.894 83.547 41.336 1.00 0.00 H ATOM 4598 HZ1 LYS A 320 21.492 84.976 41.537 1.00 0.00 H ATOM 4599 HZ2 LYS A 320 21.158 83.657 40.519 1.00 0.00 H ATOM 4600 HZ3 LYS A 320 20.356 85.137 40.283 1.00 0.00 H ATOM 4601 H LYS A 320 24.667 82.798 44.587 1.00 0.00 H ATOM 4602 N SER A 321 24.168 83.295 47.755 1.00 21.52 N ATOM 4603 CA SER A 321 24.557 82.864 49.105 1.00 21.15 C ATOM 4604 C SER A 321 23.325 82.693 49.962 1.00 18.24 C ATOM 4605 O SER A 321 22.460 83.561 49.982 1.00 17.82 O ATOM 4606 CB SER A 321 25.439 84.003 49.731 1.00 22.10 C ATOM 4607 OG SER A 321 25.675 83.896 51.150 1.00 22.71 O ATOM 4608 HA SER A 321 25.098 81.919 49.056 1.00 0.00 H ATOM 4609 HB2 SER A 321 24.942 84.955 49.544 1.00 0.00 H ATOM 4610 HB3 SER A 321 26.406 83.995 49.228 1.00 0.00 H ATOM 4611 HG SER A 321 24.809 83.916 51.630 1.00 0.00 H ATOM 4612 H SER A 321 24.670 84.106 47.342 1.00 0.00 H ATOM 4613 N PRO A 322 23.265 81.613 50.754 1.00 15.93 N ATOM 4614 CA PRO A 322 22.330 81.648 51.872 1.00 15.13 C ATOM 4615 C PRO A 322 22.792 82.674 52.911 1.00 14.02 C ATOM 4616 O PRO A 322 23.916 83.153 52.869 1.00 16.14 O ATOM 4617 CB PRO A 322 22.420 80.224 52.490 1.00 16.62 C ATOM 4618 CG PRO A 322 23.523 79.551 51.811 1.00 19.14 C ATOM 4619 CD PRO A 322 24.038 80.365 50.687 1.00 16.94 C ATOM 4620 HA PRO A 322 21.321 81.920 51.561 1.00 0.00 H ATOM 4621 HD3 PRO A 322 25.103 80.563 50.810 1.00 0.00 H ATOM 4622 HD2 PRO A 322 23.872 79.859 49.736 1.00 0.00 H ATOM 4623 HG3 PRO A 322 23.172 78.594 51.425 1.00 0.00 H ATOM 4624 HG2 PRO A 322 24.329 79.380 52.525 1.00 0.00 H ATOM 4625 HB2 PRO A 322 22.618 80.288 53.560 1.00 0.00 H ATOM 4626 HB3 PRO A 322 21.489 79.682 52.326 1.00 0.00 H ATOM 4627 N ALA A 323 21.935 82.969 53.866 1.00 14.01 N ATOM 4628 CA ALA A 323 22.423 83.643 55.092 1.00 13.05 C ATOM 4629 C ALA A 323 23.386 82.679 55.793 1.00 12.96 C ATOM 4630 O ALA A 323 23.092 81.471 55.856 1.00 13.59 O ATOM 4631 CB ALA A 323 21.271 83.942 55.987 1.00 13.81 C ATOM 4632 HA ALA A 323 22.926 84.579 54.847 1.00 0.00 H ATOM 4633 HB1 ALA A 323 20.569 84.595 55.468 1.00 0.00 H ATOM 4634 HB2 ALA A 323 20.772 83.012 56.258 1.00 0.00 H ATOM 4635 HB3 ALA A 323 21.632 84.438 56.888 1.00 0.00 H ATOM 4636 H ALA A 323 20.928 82.732 53.761 1.00 0.00 H ATOM 4637 N ILE A 324 24.514 83.201 56.259 1.00 11.83 N ATOM 4638 CA ILE A 324 25.553 82.381 56.881 1.00 12.00 C ATOM 4639 C ILE A 324 25.915 82.929 58.256 1.00 10.80 C ATOM 4640 O ILE A 324 26.039 84.159 58.431 1.00 11.98 O ATOM 4641 CB ILE A 324 26.826 82.466 56.024 1.00 13.49 C ATOM 4642 CG1 ILE A 324 26.606 81.914 54.596 1.00 14.60 C ATOM 4643 CG2 ILE A 324 28.022 81.744 56.706 1.00 14.15 C ATOM 4644 CD1 ILE A 324 27.655 82.387 53.645 1.00 16.80 C ATOM 4645 HA ILE A 324 25.181 81.360 56.965 1.00 0.00 H ATOM 4646 HB ILE A 324 27.069 83.525 55.936 1.00 0.00 H ATOM 4647 HG12 ILE A 324 26.629 80.825 54.632 1.00 0.00 H ATOM 4648 HG13 ILE A 324 25.631 82.244 54.237 1.00 0.00 H ATOM 4649 HD11 ILE A 324 27.635 83.476 53.596 1.00 0.00 H ATOM 4650 HD12 ILE A 324 28.634 82.055 53.991 1.00 0.00 H ATOM 4651 HD13 ILE A 324 27.459 81.974 52.655 1.00 0.00 H ATOM 4652 HG21 ILE A 324 28.223 82.209 57.671 1.00 0.00 H ATOM 4653 HG22 ILE A 324 27.774 80.693 56.853 1.00 0.00 H ATOM 4654 HG23 ILE A 324 28.904 81.825 56.071 1.00 0.00 H ATOM 4655 H ILE A 324 24.664 84.227 56.179 1.00 0.00 H ATOM 4656 N SER A 325 26.090 82.035 59.231 1.00 10.94 N ATOM 4657 CA SER A 325 26.772 82.503 60.437 1.00 10.90 C ATOM 4658 C SER A 325 27.558 81.345 60.996 1.00 11.12 C ATOM 4659 O SER A 325 27.235 80.152 60.771 1.00 12.16 O ATOM 4660 CB SER A 325 25.837 83.119 61.490 1.00 12.20 C ATOM 4661 OG SER A 325 24.912 82.158 61.985 1.00 12.35 O ATOM 4662 HA SER A 325 27.433 83.325 60.161 1.00 0.00 H ATOM 4663 HB2 SER A 325 25.285 83.943 61.037 1.00 0.00 H ATOM 4664 HB3 SER A 325 26.435 83.496 62.319 1.00 0.00 H ATOM 4665 HG SER A 325 24.325 82.583 62.659 1.00 0.00 H ATOM 4666 H SER A 325 25.758 81.054 59.138 1.00 0.00 H ATOM 4667 N ALA A 326 28.644 81.701 61.679 1.00 11.17 N ATOM 4668 CA ALA A 326 29.538 80.732 62.304 1.00 11.35 C ATOM 4669 C ALA A 326 29.256 80.797 63.798 1.00 11.78 C ATOM 4670 O ALA A 326 29.745 81.702 64.502 1.00 12.08 O ATOM 4671 CB ALA A 326 30.975 81.117 62.026 1.00 13.57 C ATOM 4672 HA ALA A 326 29.379 79.725 61.917 1.00 0.00 H ATOM 4673 HB1 ALA A 326 31.145 81.127 60.949 1.00 0.00 H ATOM 4674 HB2 ALA A 326 31.170 82.108 62.435 1.00 0.00 H ATOM 4675 HB3 ALA A 326 31.641 80.392 62.494 1.00 0.00 H ATOM 4676 H ALA A 326 28.865 82.713 61.771 1.00 0.00 H ATOM 4677 N THR A 327 28.474 79.838 64.299 1.00 11.34 N ATOM 4678 CA THR A 327 28.149 79.865 65.726 1.00 11.90 C ATOM 4679 C THR A 327 29.368 79.539 66.595 1.00 9.98 C ATOM 4680 O THR A 327 29.318 79.818 67.810 1.00 10.35 O ATOM 4681 CB THR A 327 26.974 78.973 66.085 1.00 11.68 C ATOM 4682 OG1 THR A 327 27.151 77.689 65.481 1.00 12.75 O ATOM 4683 CG2 THR A 327 25.670 79.561 65.541 1.00 14.46 C ATOM 4684 HA THR A 327 27.844 80.889 65.940 1.00 0.00 H ATOM 4685 HB THR A 327 26.925 78.894 67.171 1.00 0.00 H ATOM 4686 HG1 THR A 327 27.990 77.282 65.814 1.00 0.00 H ATOM 4687 HG23 THR A 327 25.504 80.544 65.983 1.00 0.00 H ATOM 4688 HG21 THR A 327 25.740 79.655 64.457 1.00 0.00 H ATOM 4689 HG22 THR A 327 24.841 78.901 65.797 1.00 0.00 H ATOM 4690 H THR A 327 28.102 79.085 63.686 1.00 0.00 H ATOM 4691 N LYS A 328 30.460 79.017 66.022 1.00 10.15 N ATOM 4692 CA LYS A 328 31.654 78.781 66.848 1.00 9.86 C ATOM 4693 C LYS A 328 32.260 80.082 67.387 1.00 9.61 C ATOM 4694 O LYS A 328 32.972 80.048 68.396 1.00 10.20 O ATOM 4695 CB LYS A 328 32.722 78.010 66.127 1.00 10.37 C ATOM 4696 CG LYS A 328 32.369 76.531 65.877 1.00 11.79 C ATOM 4697 CD LYS A 328 33.535 75.819 65.258 1.00 12.51 C ATOM 4698 CE LYS A 328 33.278 74.339 65.021 1.00 13.62 C ATOM 4699 NZ LYS A 328 32.303 74.170 63.961 1.00 13.53 N ATOM 4700 HA LYS A 328 31.297 78.180 67.684 1.00 0.00 H ATOM 4701 HB2 LYS A 328 32.898 78.488 65.163 1.00 0.00 H ATOM 4702 HB3 LYS A 328 33.634 78.049 66.723 1.00 0.00 H ATOM 4703 HG2 LYS A 328 32.118 76.055 66.825 1.00 0.00 H ATOM 4704 HG3 LYS A 328 31.513 76.473 65.205 1.00 0.00 H ATOM 4705 HD2 LYS A 328 33.760 76.289 64.301 1.00 0.00 H ATOM 4706 HD3 LYS A 328 34.394 75.920 65.921 1.00 0.00 H ATOM 4707 HE2 LYS A 328 32.898 73.887 65.937 1.00 0.00 H ATOM 4708 HE3 LYS A 328 34.210 73.851 64.736 1.00 0.00 H ATOM 4709 HZ1 LYS A 328 31.413 74.634 64.233 1.00 0.00 H ATOM 4710 HZ2 LYS A 328 32.666 74.600 63.086 1.00 0.00 H ATOM 4711 HZ3 LYS A 328 32.134 73.156 63.806 1.00 0.00 H ATOM 4712 H LYS A 328 30.464 78.782 65.009 1.00 0.00 H ATOM 4713 N ALA A 329 31.935 81.234 66.799 1.00 10.77 N ATOM 4714 CA ALA A 329 32.410 82.489 67.360 1.00 11.80 C ATOM 4715 C ALA A 329 31.807 82.685 68.745 1.00 11.26 C ATOM 4716 O ALA A 329 32.425 83.329 69.588 1.00 13.50 O ATOM 4717 CB ALA A 329 32.101 83.665 66.417 1.00 12.38 C ATOM 4718 HA ALA A 329 33.494 82.454 67.465 1.00 0.00 H ATOM 4719 HB1 ALA A 329 32.594 83.500 65.459 1.00 0.00 H ATOM 4720 HB2 ALA A 329 31.024 83.734 66.265 1.00 0.00 H ATOM 4721 HB3 ALA A 329 32.467 84.591 66.861 1.00 0.00 H ATOM 4722 H ALA A 329 31.344 81.235 65.943 1.00 0.00 H ATOM 4723 N MET A 330 30.613 82.132 68.994 1.00 10.19 N ATOM 4724 CA MET A 330 30.029 82.150 70.325 1.00 11.58 C ATOM 4725 C MET A 330 30.457 80.964 71.171 1.00 11.24 C ATOM 4726 O MET A 330 30.708 81.102 72.378 1.00 12.14 O ATOM 4727 CB MET A 330 28.504 82.098 70.262 1.00 12.88 C ATOM 4728 CG MET A 330 27.842 83.371 69.799 1.00 14.23 C ATOM 4729 SD MET A 330 26.008 83.170 69.705 1.00 16.91 S ATOM 4730 CE MET A 330 25.759 82.447 68.126 1.00 17.05 C ATOM 4731 HA MET A 330 30.382 83.078 70.774 1.00 0.00 H ATOM 4732 HB2 MET A 330 28.221 81.300 69.576 1.00 0.00 H ATOM 4733 HB3 MET A 330 28.132 81.866 71.260 1.00 0.00 H ATOM 4734 HG2 MET A 330 28.223 83.632 68.812 1.00 0.00 H ATOM 4735 HG3 MET A 330 28.077 84.171 70.501 1.00 0.00 H ATOM 4736 HE1 MET A 330 26.144 83.116 67.357 1.00 0.00 H ATOM 4737 HE2 MET A 330 26.285 81.494 68.077 1.00 0.00 H ATOM 4738 HE3 MET A 330 24.693 82.284 67.967 1.00 0.00 H ATOM 4739 H MET A 330 30.091 81.679 68.217 1.00 0.00 H ATOM 4740 N THR A 331 30.468 79.777 70.564 1.00 9.87 N ATOM 4741 CA THR A 331 30.500 78.567 71.363 1.00 10.03 C ATOM 4742 C THR A 331 31.882 77.957 71.525 1.00 9.19 C ATOM 4743 O THR A 331 32.069 77.102 72.397 1.00 10.27 O ATOM 4744 CB THR A 331 29.619 77.465 70.715 1.00 9.97 C ATOM 4745 OG1 THR A 331 30.197 77.085 69.438 1.00 10.53 O ATOM 4746 CG2 THR A 331 28.171 77.921 70.467 1.00 11.50 C ATOM 4747 HA THR A 331 30.137 78.882 72.341 1.00 0.00 H ATOM 4748 HB THR A 331 29.592 76.629 71.414 1.00 0.00 H ATOM 4749 HG1 THR A 331 31.113 76.738 69.582 1.00 0.00 H ATOM 4750 HG23 THR A 331 27.716 78.212 71.414 1.00 0.00 H ATOM 4751 HG21 THR A 331 28.171 78.772 69.786 1.00 0.00 H ATOM 4752 HG22 THR A 331 27.604 77.101 70.026 1.00 0.00 H ATOM 4753 H THR A 331 30.454 79.719 69.526 1.00 0.00 H ATOM 4754 N GLY A 332 32.826 78.333 70.676 1.00 9.33 N ATOM 4755 CA GLY A 332 34.066 77.579 70.529 1.00 9.47 C ATOM 4756 C GLY A 332 33.832 76.259 69.802 1.00 9.28 C ATOM 4757 O GLY A 332 32.703 75.950 69.356 1.00 10.23 O ATOM 4758 HA3 GLY A 332 34.475 77.372 71.518 1.00 0.00 H ATOM 4759 HA2 GLY A 332 34.779 78.176 69.960 1.00 0.00 H ATOM 4760 H GLY A 332 32.680 79.187 70.100 1.00 0.00 H ATOM 4761 N HIS A 333 34.897 75.487 69.670 1.00 9.75 N ATOM 4762 CA HIS A 333 34.891 74.283 68.851 1.00 9.91 C ATOM 4763 C HIS A 333 34.879 73.053 69.752 1.00 9.68 C ATOM 4764 O HIS A 333 35.886 72.752 70.388 1.00 10.25 O ATOM 4765 CB HIS A 333 36.151 74.284 68.019 1.00 11.68 C ATOM 4766 CG HIS A 333 36.171 73.217 66.986 1.00 12.33 C ATOM 4767 ND1 HIS A 333 35.218 72.223 66.934 1.00 14.03 N ATOM 4768 CD2 HIS A 333 37.032 72.982 65.972 1.00 14.36 C ATOM 4769 CE1 HIS A 333 35.483 71.424 65.903 1.00 13.99 C ATOM 4770 NE2 HIS A 333 36.580 71.868 65.303 1.00 14.96 N ATOM 4771 HA HIS A 333 34.009 74.261 68.211 1.00 0.00 H ATOM 4772 HB2 HIS A 333 36.237 75.250 67.521 1.00 0.00 H ATOM 4773 HB3 HIS A 333 37.004 74.141 68.682 1.00 0.00 H ATOM 4774 HD2 HIS A 333 37.920 73.566 65.729 1.00 0.00 H ATOM 4775 HE1 HIS A 333 34.899 70.554 65.603 1.00 0.00 H ATOM 4776 H HIS A 333 35.771 75.749 70.169 1.00 0.00 H ATOM 4777 N SER A 334 33.722 72.392 69.861 1.00 10.42 N ATOM 4778 CA SER A 334 33.591 71.223 70.726 1.00 10.92 C ATOM 4779 C SER A 334 33.913 69.892 70.065 1.00 10.84 C ATOM 4780 O SER A 334 33.581 68.834 70.591 1.00 11.32 O ATOM 4781 CB SER A 334 32.213 71.198 71.331 1.00 11.64 C ATOM 4782 OG SER A 334 31.282 71.024 70.294 1.00 12.33 O ATOM 4783 HA SER A 334 34.351 71.336 71.499 1.00 0.00 H ATOM 4784 HB2 SER A 334 32.019 72.138 71.847 1.00 0.00 H ATOM 4785 HB3 SER A 334 32.135 70.373 72.039 1.00 0.00 H ATOM 4786 HG SER A 334 30.368 71.005 70.673 1.00 0.00 H ATOM 4787 H SER A 334 32.897 72.718 69.318 1.00 0.00 H ATOM 4788 N LEU A 335 34.638 69.961 68.945 1.00 10.50 N ATOM 4789 CA LEU A 335 35.302 68.796 68.374 1.00 11.26 C ATOM 4790 C LEU A 335 34.273 67.706 68.079 1.00 11.52 C ATOM 4791 O LEU A 335 33.393 67.929 67.236 1.00 12.69 O ATOM 4792 CB LEU A 335 36.462 68.329 69.282 1.00 13.44 C ATOM 4793 CG LEU A 335 37.464 69.430 69.688 1.00 16.57 C ATOM 4794 CD1 LEU A 335 38.541 68.833 70.545 1.00 17.94 C ATOM 4795 CD2 LEU A 335 38.091 70.101 68.485 1.00 17.89 C ATOM 4796 HA LEU A 335 35.761 69.058 67.421 1.00 0.00 H ATOM 4797 HB2 LEU A 335 36.031 67.913 70.193 1.00 0.00 H ATOM 4798 HB3 LEU A 335 37.012 67.551 68.753 1.00 0.00 H ATOM 4799 HG LEU A 335 36.914 70.191 70.242 1.00 0.00 H ATOM 4800 HD21 LEU A 335 38.624 69.357 67.893 1.00 0.00 H ATOM 4801 HD22 LEU A 335 37.310 70.559 67.878 1.00 0.00 H ATOM 4802 HD23 LEU A 335 38.789 70.868 68.821 1.00 0.00 H ATOM 4803 HD11 LEU A 335 38.093 68.400 71.439 1.00 0.00 H ATOM 4804 HD12 LEU A 335 39.061 68.056 69.984 1.00 0.00 H ATOM 4805 HD13 LEU A 335 39.249 69.611 70.832 1.00 0.00 H ATOM 4806 H LEU A 335 34.732 70.878 68.464 1.00 0.00 H ATOM 4807 N GLY A 336 34.334 66.548 68.741 1.00 11.44 N ATOM 4808 CA GLY A 336 33.367 65.470 68.492 1.00 13.18 C ATOM 4809 C GLY A 336 31.912 65.862 68.696 1.00 11.98 C ATOM 4810 O GLY A 336 31.016 65.254 68.105 1.00 11.97 O ATOM 4811 HA3 GLY A 336 33.595 64.646 69.168 1.00 0.00 H ATOM 4812 HA2 GLY A 336 33.488 65.137 67.461 1.00 0.00 H ATOM 4813 H GLY A 336 35.083 66.406 69.449 1.00 0.00 H ATOM 4814 N ALA A 337 31.657 66.843 69.564 1.00 11.50 N ATOM 4815 CA ALA A 337 30.282 67.265 69.844 1.00 9.98 C ATOM 4816 C ALA A 337 29.798 68.328 68.875 1.00 8.85 C ATOM 4817 O ALA A 337 28.619 68.656 68.889 1.00 9.85 O ATOM 4818 CB ALA A 337 30.145 67.796 71.256 1.00 11.83 C ATOM 4819 HA ALA A 337 29.665 66.375 69.724 1.00 0.00 H ATOM 4820 HB1 ALA A 337 30.419 67.015 71.965 1.00 0.00 H ATOM 4821 HB2 ALA A 337 30.805 68.654 71.386 1.00 0.00 H ATOM 4822 HB3 ALA A 337 29.113 68.100 71.430 1.00 0.00 H ATOM 4823 H ALA A 337 32.446 67.315 70.049 1.00 0.00 H ATOM 4824 N ALA A 338 30.668 68.856 68.025 1.00 8.94 N ATOM 4825 CA ALA A 338 30.313 70.048 67.253 1.00 9.74 C ATOM 4826 C ALA A 338 29.229 69.740 66.234 1.00 9.52 C ATOM 4827 O ALA A 338 28.336 70.561 66.032 1.00 10.74 O ATOM 4828 CB ALA A 338 31.551 70.655 66.555 1.00 12.34 C ATOM 4829 HA ALA A 338 29.923 70.785 67.955 1.00 0.00 H ATOM 4830 HB1 ALA A 338 32.289 70.935 67.306 1.00 0.00 H ATOM 4831 HB2 ALA A 338 31.982 69.918 65.877 1.00 0.00 H ATOM 4832 HB3 ALA A 338 31.252 71.538 65.991 1.00 0.00 H ATOM 4833 H ALA A 338 31.606 68.422 67.906 1.00 0.00 H ATOM 4834 N GLY A 339 29.278 68.594 65.569 1.00 9.28 N ATOM 4835 CA GLY A 339 28.295 68.321 64.515 1.00 9.55 C ATOM 4836 C GLY A 339 26.879 68.279 65.039 1.00 8.32 C ATOM 4837 O GLY A 339 25.952 68.883 64.438 1.00 9.25 O ATOM 4838 HA3 GLY A 339 28.528 67.358 64.060 1.00 0.00 H ATOM 4839 HA2 GLY A 339 28.365 69.104 63.760 1.00 0.00 H ATOM 4840 H GLY A 339 30.011 67.891 65.794 1.00 0.00 H ATOM 4841 N VAL A 340 26.656 67.550 66.134 1.00 7.81 N ATOM 4842 CA VAL A 340 25.307 67.464 66.663 1.00 7.61 C ATOM 4843 C VAL A 340 24.902 68.783 67.322 1.00 7.62 C ATOM 4844 O VAL A 340 23.743 69.184 67.199 1.00 9.26 O ATOM 4845 CB VAL A 340 25.142 66.254 67.617 1.00 7.79 C ATOM 4846 CG1 VAL A 340 26.135 66.344 68.811 1.00 9.57 C ATOM 4847 CG2 VAL A 340 23.700 66.135 68.081 1.00 9.39 C ATOM 4848 HA VAL A 340 24.626 67.292 65.830 1.00 0.00 H ATOM 4849 HB VAL A 340 25.386 65.344 67.070 1.00 0.00 H ATOM 4850 HG11 VAL A 340 27.157 66.354 68.432 1.00 0.00 H ATOM 4851 HG12 VAL A 340 25.945 67.259 69.371 1.00 0.00 H ATOM 4852 HG13 VAL A 340 25.996 65.482 69.463 1.00 0.00 H ATOM 4853 HG21 VAL A 340 23.413 67.045 68.609 1.00 0.00 H ATOM 4854 HG22 VAL A 340 23.052 65.996 67.216 1.00 0.00 H ATOM 4855 HG23 VAL A 340 23.604 65.280 68.750 1.00 0.00 H ATOM 4856 H VAL A 340 27.438 67.050 66.602 1.00 0.00 H ATOM 4857 N GLN A 341 25.825 69.440 68.031 1.00 8.27 N ATOM 4858 CA GLN A 341 25.432 70.710 68.648 1.00 8.02 C ATOM 4859 C GLN A 341 25.030 71.719 67.578 1.00 8.82 C ATOM 4860 O GLN A 341 24.043 72.445 67.732 1.00 9.40 O ATOM 4861 CB GLN A 341 26.532 71.267 69.530 1.00 9.07 C ATOM 4862 CG GLN A 341 26.729 70.425 70.783 1.00 10.05 C ATOM 4863 CD GLN A 341 27.838 70.994 71.630 1.00 9.98 C ATOM 4864 OE1 GLN A 341 28.768 71.605 71.105 1.00 11.96 O ATOM 4865 NE2 GLN A 341 27.757 70.784 72.948 1.00 12.33 N ATOM 4866 HA GLN A 341 24.570 70.518 69.287 1.00 0.00 H ATOM 4867 HB2 GLN A 341 27.464 71.284 68.965 1.00 0.00 H ATOM 4868 HB3 GLN A 341 26.269 72.283 69.824 1.00 0.00 H ATOM 4869 HG2 GLN A 341 25.804 70.417 71.360 1.00 0.00 H ATOM 4870 HG3 GLN A 341 26.984 69.405 70.494 1.00 0.00 H ATOM 4871 HE22 GLN A 341 26.949 70.261 73.343 1.00 0.00 H ATOM 4872 HE21 GLN A 341 28.502 71.144 73.579 1.00 0.00 H ATOM 4873 H GLN A 341 26.788 69.063 68.141 1.00 0.00 H ATOM 4874 N GLU A 342 25.788 71.771 66.477 1.00 8.40 N ATOM 4875 CA GLU A 342 25.472 72.736 65.419 1.00 9.05 C ATOM 4876 C GLU A 342 24.245 72.360 64.625 1.00 8.40 C ATOM 4877 O GLU A 342 23.499 73.230 64.168 1.00 9.17 O ATOM 4878 CB GLU A 342 26.694 72.948 64.545 1.00 9.94 C ATOM 4879 CG GLU A 342 27.753 73.742 65.355 1.00 11.99 C ATOM 4880 CD GLU A 342 29.163 73.689 64.861 1.00 13.17 C ATOM 4881 OE1 GLU A 342 29.415 73.148 63.759 1.00 13.81 O ATOM 4882 OE2 GLU A 342 30.040 74.230 65.595 1.00 14.01 O ATOM 4883 HA GLU A 342 25.215 73.685 65.890 1.00 0.00 H ATOM 4884 HB2 GLU A 342 27.106 71.983 64.249 1.00 0.00 H ATOM 4885 HB3 GLU A 342 26.415 73.511 63.654 1.00 0.00 H ATOM 4886 HG2 GLU A 342 27.446 74.788 65.363 1.00 0.00 H ATOM 4887 HG3 GLU A 342 27.746 73.355 66.374 1.00 0.00 H ATOM 4888 H GLU A 342 26.599 71.129 66.372 1.00 0.00 H ATOM 4889 N ALA A 343 23.980 71.053 64.476 1.00 8.62 N ATOM 4890 CA ALA A 343 22.697 70.621 63.923 1.00 8.99 C ATOM 4891 C ALA A 343 21.578 71.118 64.830 1.00 8.07 C ATOM 4892 O ALA A 343 20.568 71.611 64.344 1.00 9.58 O ATOM 4893 CB ALA A 343 22.631 69.095 63.754 1.00 9.80 C ATOM 4894 HA ALA A 343 22.582 71.049 62.927 1.00 0.00 H ATOM 4895 HB1 ALA A 343 23.422 68.771 63.077 1.00 0.00 H ATOM 4896 HB2 ALA A 343 22.763 68.617 64.725 1.00 0.00 H ATOM 4897 HB3 ALA A 343 21.661 68.818 63.341 1.00 0.00 H ATOM 4898 H ALA A 343 24.689 70.345 64.755 1.00 0.00 H ATOM 4899 N ILE A 344 21.762 71.003 66.147 1.00 7.91 N ATOM 4900 CA ILE A 344 20.753 71.488 67.084 1.00 8.17 C ATOM 4901 C ILE A 344 20.594 73.002 66.991 1.00 8.85 C ATOM 4902 O ILE A 344 19.440 73.500 66.965 1.00 9.72 O ATOM 4903 CB ILE A 344 21.082 71.025 68.520 1.00 8.60 C ATOM 4904 CG1 ILE A 344 20.787 69.525 68.587 1.00 10.03 C ATOM 4905 CG2 ILE A 344 20.247 71.805 69.574 1.00 10.25 C ATOM 4906 CD1 ILE A 344 21.276 68.826 69.856 1.00 9.50 C ATOM 4907 HA ILE A 344 19.791 71.054 66.811 1.00 0.00 H ATOM 4908 HB ILE A 344 22.129 71.223 68.751 1.00 0.00 H ATOM 4909 HG12 ILE A 344 19.708 69.389 68.520 1.00 0.00 H ATOM 4910 HG13 ILE A 344 21.265 69.048 67.732 1.00 0.00 H ATOM 4911 HD11 ILE A 344 22.357 68.936 69.936 1.00 0.00 H ATOM 4912 HD12 ILE A 344 20.798 69.278 70.725 1.00 0.00 H ATOM 4913 HD13 ILE A 344 21.020 67.768 69.808 1.00 0.00 H ATOM 4914 HG21 ILE A 344 20.467 72.870 69.495 1.00 0.00 H ATOM 4915 HG22 ILE A 344 19.186 71.638 69.391 1.00 0.00 H ATOM 4916 HG23 ILE A 344 20.505 71.453 70.573 1.00 0.00 H ATOM 4917 H ILE A 344 22.632 70.564 66.509 1.00 0.00 H ATOM 4918 N TYR A 345 21.692 73.772 66.908 1.00 9.06 N ATOM 4919 CA TYR A 345 21.516 75.243 66.793 1.00 8.90 C ATOM 4920 C TYR A 345 20.716 75.548 65.524 1.00 9.63 C ATOM 4921 O TYR A 345 19.841 76.414 65.516 1.00 9.74 O ATOM 4922 CB TYR A 345 22.844 75.966 66.717 1.00 10.04 C ATOM 4923 CG TYR A 345 23.812 75.684 67.836 1.00 9.51 C ATOM 4924 CD1 TYR A 345 23.381 75.425 69.135 1.00 9.82 C ATOM 4925 CD2 TYR A 345 25.184 75.686 67.578 1.00 10.06 C ATOM 4926 CE1 TYR A 345 24.312 75.162 70.165 1.00 9.13 C ATOM 4927 CE2 TYR A 345 26.125 75.383 68.586 1.00 9.57 C ATOM 4928 CZ TYR A 345 25.667 75.112 69.868 1.00 9.16 C ATOM 4929 OH TYR A 345 26.524 74.790 70.879 1.00 10.51 O ATOM 4930 HA TYR A 345 20.991 75.591 67.683 1.00 0.00 H ATOM 4931 HB3 TYR A 345 22.642 77.037 66.712 1.00 0.00 H ATOM 4932 HB2 TYR A 345 23.325 75.684 65.780 1.00 0.00 H ATOM 4933 HD2 TYR A 345 25.537 75.927 66.575 1.00 0.00 H ATOM 4934 HE2 TYR A 345 27.191 75.362 68.362 1.00 0.00 H ATOM 4935 HE1 TYR A 345 23.968 74.999 71.187 1.00 0.00 H ATOM 4936 HD1 TYR A 345 22.314 75.425 69.359 1.00 0.00 H ATOM 4937 HH TYR A 345 27.022 73.969 70.639 1.00 0.00 H ATOM 4938 H TYR A 345 22.642 73.349 66.924 1.00 0.00 H ATOM 4939 N SER A 346 21.027 74.841 64.433 1.00 9.09 N ATOM 4940 CA SER A 346 20.329 75.030 63.167 1.00 9.75 C ATOM 4941 C SER A 346 18.849 74.655 63.252 1.00 9.60 C ATOM 4942 O SER A 346 17.993 75.369 62.711 1.00 10.46 O ATOM 4943 CB SER A 346 21.004 74.201 62.065 1.00 10.00 C ATOM 4944 OG SER A 346 22.367 74.567 61.885 1.00 11.76 O ATOM 4945 HA SER A 346 20.386 76.092 62.928 1.00 0.00 H ATOM 4946 HB2 SER A 346 20.470 74.359 61.128 1.00 0.00 H ATOM 4947 HB3 SER A 346 20.955 73.147 62.337 1.00 0.00 H ATOM 4948 HG SER A 346 22.861 74.421 62.730 1.00 0.00 H ATOM 4949 H SER A 346 21.789 74.136 64.489 1.00 0.00 H ATOM 4950 N LEU A 347 18.535 73.550 63.947 1.00 9.79 N ATOM 4951 CA LEU A 347 17.154 73.165 64.188 1.00 10.36 C ATOM 4952 C LEU A 347 16.430 74.174 65.044 1.00 10.13 C ATOM 4953 O LEU A 347 15.252 74.422 64.809 1.00 11.62 O ATOM 4954 CB LEU A 347 17.074 71.786 64.840 1.00 11.72 C ATOM 4955 CG LEU A 347 17.493 70.635 63.918 1.00 11.76 C ATOM 4956 CD1 LEU A 347 17.694 69.344 64.724 1.00 15.21 C ATOM 4957 CD2 LEU A 347 16.472 70.418 62.831 1.00 13.17 C ATOM 4958 HA LEU A 347 16.664 73.129 63.215 1.00 0.00 H ATOM 4959 HB2 LEU A 347 17.726 71.781 65.713 1.00 0.00 H ATOM 4960 HB3 LEU A 347 16.045 71.615 65.156 1.00 0.00 H ATOM 4961 HG LEU A 347 18.440 70.905 63.450 1.00 0.00 H ATOM 4962 HD21 LEU A 347 15.510 70.175 63.281 1.00 0.00 H ATOM 4963 HD22 LEU A 347 16.377 71.327 62.237 1.00 0.00 H ATOM 4964 HD23 LEU A 347 16.793 69.596 62.191 1.00 0.00 H ATOM 4965 HD11 LEU A 347 18.472 69.501 65.471 1.00 0.00 H ATOM 4966 HD12 LEU A 347 16.761 69.078 65.221 1.00 0.00 H ATOM 4967 HD13 LEU A 347 17.991 68.540 64.051 1.00 0.00 H ATOM 4968 H LEU A 347 19.300 72.954 64.323 1.00 0.00 H ATOM 4969 N LEU A 348 17.119 74.793 66.013 1.00 10.46 N ATOM 4970 CA LEU A 348 16.451 75.800 66.837 1.00 11.26 C ATOM 4971 C LEU A 348 16.152 77.073 66.019 1.00 11.25 C ATOM 4972 O LEU A 348 15.087 77.685 66.166 1.00 12.44 O ATOM 4973 CB LEU A 348 17.301 76.117 68.066 1.00 11.37 C ATOM 4974 CG LEU A 348 17.361 74.994 69.102 1.00 11.45 C ATOM 4975 CD1 LEU A 348 18.389 75.364 70.191 1.00 12.79 C ATOM 4976 CD2 LEU A 348 15.979 74.715 69.729 1.00 13.24 C ATOM 4977 HA LEU A 348 15.495 75.398 67.174 1.00 0.00 H ATOM 4978 HB2 LEU A 348 18.317 76.328 67.732 1.00 0.00 H ATOM 4979 HB3 LEU A 348 16.887 77.003 68.547 1.00 0.00 H ATOM 4980 HG LEU A 348 17.671 74.078 68.600 1.00 0.00 H ATOM 4981 HD21 LEU A 348 15.617 75.617 70.223 1.00 0.00 H ATOM 4982 HD22 LEU A 348 15.279 74.421 68.947 1.00 0.00 H ATOM 4983 HD23 LEU A 348 16.068 73.910 70.459 1.00 0.00 H ATOM 4984 HD11 LEU A 348 19.370 75.494 69.734 1.00 0.00 H ATOM 4985 HD12 LEU A 348 18.086 76.293 70.674 1.00 0.00 H ATOM 4986 HD13 LEU A 348 18.435 74.566 70.932 1.00 0.00 H ATOM 4987 H LEU A 348 18.119 74.559 66.177 1.00 0.00 H ATOM 4988 N MET A 349 17.068 77.441 65.138 1.00 10.36 N ATOM 4989 CA MET A 349 16.850 78.560 64.231 1.00 10.49 C ATOM 4990 C MET A 349 15.669 78.271 63.318 1.00 10.73 C ATOM 4991 O MET A 349 14.866 79.171 63.041 1.00 11.88 O ATOM 4992 CB MET A 349 18.123 78.792 63.420 1.00 10.97 C ATOM 4993 CG MET A 349 19.178 79.538 64.280 1.00 11.64 C ATOM 4994 SD MET A 349 20.644 79.890 63.305 1.00 11.78 S ATOM 4995 CE MET A 349 21.899 78.970 64.196 1.00 11.67 C ATOM 4996 HA MET A 349 16.619 79.461 64.800 1.00 0.00 H ATOM 4997 HB2 MET A 349 18.529 77.831 63.105 1.00 0.00 H ATOM 4998 HB3 MET A 349 17.886 79.391 62.541 1.00 0.00 H ATOM 4999 HG2 MET A 349 19.453 78.915 65.131 1.00 0.00 H ATOM 5000 HG3 MET A 349 18.752 80.475 64.639 1.00 0.00 H ATOM 5001 HE1 MET A 349 21.962 79.341 65.219 1.00 0.00 H ATOM 5002 HE2 MET A 349 21.633 77.913 64.208 1.00 0.00 H ATOM 5003 HE3 MET A 349 22.862 79.098 63.701 1.00 0.00 H ATOM 5004 H MET A 349 17.966 76.918 65.092 1.00 0.00 H ATOM 5005 N LEU A 350 15.586 77.050 62.800 1.00 10.43 N ATOM 5006 CA LEU A 350 14.498 76.654 61.928 1.00 10.83 C ATOM 5007 C LEU A 350 13.173 76.636 62.664 1.00 11.40 C ATOM 5008 O LEU A 350 12.150 77.154 62.166 1.00 13.75 O ATOM 5009 CB LEU A 350 14.820 75.269 61.340 1.00 11.53 C ATOM 5010 CG LEU A 350 13.848 74.696 60.320 1.00 12.46 C ATOM 5011 CD1 LEU A 350 13.679 75.602 59.118 1.00 13.87 C ATOM 5012 CD2 LEU A 350 14.299 73.271 59.910 1.00 12.58 C ATOM 5013 HA LEU A 350 14.400 77.383 61.124 1.00 0.00 H ATOM 5014 HB2 LEU A 350 15.796 75.337 60.859 1.00 0.00 H ATOM 5015 HB3 LEU A 350 14.874 74.566 62.171 1.00 0.00 H ATOM 5016 HG LEU A 350 12.865 74.629 60.786 1.00 0.00 H ATOM 5017 HD21 LEU A 350 15.296 73.319 59.472 1.00 0.00 H ATOM 5018 HD22 LEU A 350 14.318 72.630 60.791 1.00 0.00 H ATOM 5019 HD23 LEU A 350 13.599 72.866 59.179 1.00 0.00 H ATOM 5020 HD11 LEU A 350 13.297 76.569 59.444 1.00 0.00 H ATOM 5021 HD12 LEU A 350 14.643 75.738 58.628 1.00 0.00 H ATOM 5022 HD13 LEU A 350 12.976 75.149 58.419 1.00 0.00 H ATOM 5023 H LEU A 350 16.326 76.356 63.028 1.00 0.00 H ATOM 5024 N GLU A 351 13.176 76.085 63.872 1.00 11.63 N ATOM 5025 CA GLU A 351 11.953 75.955 64.671 1.00 12.68 C ATOM 5026 C GLU A 351 11.448 77.325 65.146 1.00 13.27 C ATOM 5027 O GLU A 351 10.224 77.561 65.206 1.00 15.58 O ATOM 5028 CB GLU A 351 12.239 75.035 65.883 1.00 12.79 C ATOM 5029 CG GLU A 351 11.042 74.774 66.799 1.00 15.66 C ATOM 5030 CD GLU A 351 10.086 73.703 66.308 1.00 17.91 C ATOM 5031 OE1 GLU A 351 10.135 73.279 65.131 1.00 19.68 O ATOM 5032 OE2 GLU A 351 9.233 73.306 67.122 1.00 21.41 O ATOM 5033 HA GLU A 351 11.171 75.517 64.051 1.00 0.00 H ATOM 5034 HB2 GLU A 351 12.589 74.075 65.503 1.00 0.00 H ATOM 5035 HB3 GLU A 351 13.026 75.497 66.479 1.00 0.00 H ATOM 5036 HG2 GLU A 351 11.421 74.469 67.774 1.00 0.00 H ATOM 5037 HG3 GLU A 351 10.484 75.705 66.902 1.00 0.00 H ATOM 5038 H GLU A 351 14.073 75.735 64.264 1.00 0.00 H ATOM 5039 N HIS A 352 12.370 78.226 65.496 1.00 12.24 N ATOM 5040 CA HIS A 352 11.992 79.515 66.120 1.00 13.45 C ATOM 5041 C HIS A 352 12.089 80.698 65.179 1.00 14.01 C ATOM 5042 O HIS A 352 11.744 81.802 65.542 1.00 15.46 O ATOM 5043 CB HIS A 352 12.811 79.725 67.395 1.00 14.22 C ATOM 5044 CG HIS A 352 12.508 78.701 68.433 1.00 13.52 C ATOM 5045 ND1 HIS A 352 11.424 78.787 69.286 1.00 16.61 N ATOM 5046 CD2 HIS A 352 13.094 77.502 68.687 1.00 14.49 C ATOM 5047 CE1 HIS A 352 11.378 77.700 70.041 1.00 17.36 C ATOM 5048 NE2 HIS A 352 12.376 76.903 69.695 1.00 15.21 N ATOM 5049 HA HIS A 352 10.935 79.456 66.379 1.00 0.00 H ATOM 5050 HB2 HIS A 352 13.871 79.669 67.145 1.00 0.00 H ATOM 5051 HB3 HIS A 352 12.586 80.712 67.799 1.00 0.00 H ATOM 5052 HD2 HIS A 352 13.970 77.091 68.185 1.00 0.00 H ATOM 5053 HE1 HIS A 352 10.641 77.496 70.818 1.00 0.00 H ATOM 5054 H HIS A 352 13.375 78.018 65.327 1.00 0.00 H ATOM 5055 N GLY A 353 12.498 80.462 63.939 1.00 12.52 N ATOM 5056 CA GLY A 353 12.445 81.533 62.920 1.00 14.11 C ATOM 5057 C GLY A 353 13.415 82.682 63.143 1.00 13.57 C ATOM 5058 O GLY A 353 13.032 83.851 63.138 1.00 14.25 O ATOM 5059 HA3 GLY A 353 11.434 81.941 62.910 1.00 0.00 H ATOM 5060 HA2 GLY A 353 12.665 81.088 61.950 1.00 0.00 H ATOM 5061 H GLY A 353 12.857 79.520 63.682 1.00 0.00 H ATOM 5062 N PHE A 354 14.685 82.371 63.298 1.00 12.03 N ATOM 5063 CA PHE A 354 15.691 83.424 63.390 1.00 12.65 C ATOM 5064 C PHE A 354 17.026 82.884 62.932 1.00 10.85 C ATOM 5065 O PHE A 354 17.254 81.655 62.889 1.00 12.09 O ATOM 5066 CB PHE A 354 15.803 83.996 64.819 1.00 12.85 C ATOM 5067 CG PHE A 354 16.541 83.069 65.776 1.00 11.61 C ATOM 5068 CD1 PHE A 354 15.919 81.905 66.262 1.00 12.46 C ATOM 5069 CD2 PHE A 354 17.867 83.315 66.105 1.00 12.22 C ATOM 5070 CE1 PHE A 354 16.634 80.992 67.079 1.00 13.22 C ATOM 5071 CE2 PHE A 354 18.573 82.459 66.934 1.00 12.83 C ATOM 5072 CZ PHE A 354 17.971 81.292 67.413 1.00 12.96 C ATOM 5073 HA PHE A 354 15.382 84.244 62.742 1.00 0.00 H ATOM 5074 HB2 PHE A 354 16.338 84.945 64.773 1.00 0.00 H ATOM 5075 HB3 PHE A 354 14.798 84.165 65.205 1.00 0.00 H ATOM 5076 HD2 PHE A 354 18.362 84.199 65.703 1.00 0.00 H ATOM 5077 HE2 PHE A 354 19.600 82.696 67.213 1.00 0.00 H ATOM 5078 HZ PHE A 354 18.538 80.611 68.048 1.00 0.00 H ATOM 5079 HE1 PHE A 354 16.161 80.079 67.441 1.00 0.00 H ATOM 5080 HD1 PHE A 354 14.878 81.703 66.009 1.00 0.00 H ATOM 5081 H PHE A 354 14.972 81.373 63.355 1.00 0.00 H ATOM 5082 N ILE A 355 17.916 83.818 62.607 1.00 12.13 N ATOM 5083 CA ILE A 355 19.306 83.518 62.256 1.00 12.12 C ATOM 5084 C ILE A 355 20.161 84.061 63.376 1.00 11.09 C ATOM 5085 O ILE A 355 20.080 85.263 63.720 1.00 12.26 O ATOM 5086 CB ILE A 355 19.670 84.246 60.944 1.00 12.14 C ATOM 5087 CG1 ILE A 355 18.791 83.707 59.799 1.00 13.44 C ATOM 5088 CG2 ILE A 355 21.144 84.090 60.632 1.00 12.89 C ATOM 5089 CD1 ILE A 355 18.759 84.633 58.575 1.00 15.24 C ATOM 5090 HA ILE A 355 19.458 82.447 62.120 1.00 0.00 H ATOM 5091 HB ILE A 355 19.477 85.313 61.059 1.00 0.00 H ATOM 5092 HG12 ILE A 355 19.180 82.737 59.490 1.00 0.00 H ATOM 5093 HG13 ILE A 355 17.773 83.587 60.170 1.00 0.00 H ATOM 5094 HD11 ILE A 355 18.362 85.605 58.867 1.00 0.00 H ATOM 5095 HD12 ILE A 355 19.770 84.754 58.186 1.00 0.00 H ATOM 5096 HD13 ILE A 355 18.123 84.195 57.806 1.00 0.00 H ATOM 5097 HG21 ILE A 355 21.733 84.515 61.445 1.00 0.00 H ATOM 5098 HG22 ILE A 355 21.381 83.032 60.524 1.00 0.00 H ATOM 5099 HG23 ILE A 355 21.375 84.612 59.703 1.00 0.00 H ATOM 5100 H ILE A 355 17.609 84.812 62.602 1.00 0.00 H ATOM 5101 N ALA A 356 20.956 83.180 63.974 1.00 12.12 N ATOM 5102 CA ALA A 356 21.903 83.589 65.005 1.00 11.68 C ATOM 5103 C ALA A 356 23.058 84.371 64.386 1.00 12.58 C ATOM 5104 O ALA A 356 23.470 84.069 63.259 1.00 12.89 O ATOM 5105 CB ALA A 356 22.427 82.349 65.722 1.00 12.02 C ATOM 5106 HA ALA A 356 21.400 84.237 65.722 1.00 0.00 H ATOM 5107 HB1 ALA A 356 21.594 81.816 66.180 1.00 0.00 H ATOM 5108 HB2 ALA A 356 22.925 81.698 65.003 1.00 0.00 H ATOM 5109 HB3 ALA A 356 23.136 82.649 66.494 1.00 0.00 H ATOM 5110 H ALA A 356 20.902 82.178 63.701 1.00 0.00 H ATOM 5111 N PRO A 357 23.604 85.364 65.119 1.00 11.63 N ATOM 5112 CA PRO A 357 24.680 86.188 64.557 1.00 12.36 C ATOM 5113 C PRO A 357 26.022 85.502 64.525 1.00 11.20 C ATOM 5114 O PRO A 357 26.335 84.696 65.425 1.00 12.50 O ATOM 5115 CB PRO A 357 24.767 87.370 65.538 1.00 13.24 C ATOM 5116 CG PRO A 357 24.352 86.772 66.861 1.00 14.02 C ATOM 5117 CD PRO A 357 23.253 85.784 66.499 1.00 12.76 C ATOM 5118 HA PRO A 357 24.459 86.445 63.521 1.00 0.00 H ATOM 5119 HD3 PRO A 357 23.256 84.932 67.178 1.00 0.00 H ATOM 5120 HD2 PRO A 357 22.274 86.263 66.524 1.00 0.00 H ATOM 5121 HG3 PRO A 357 23.973 87.543 67.532 1.00 0.00 H ATOM 5122 HG2 PRO A 357 25.191 86.261 67.334 1.00 0.00 H ATOM 5123 HB2 PRO A 357 25.784 87.758 65.589 1.00 0.00 H ATOM 5124 HB3 PRO A 357 24.088 88.170 65.243 1.00 0.00 H ATOM 5125 N SER A 358 26.819 85.904 63.539 1.00 10.97 N ATOM 5126 CA SER A 358 28.235 85.573 63.463 1.00 11.52 C ATOM 5127 C SER A 358 28.973 86.686 64.195 1.00 11.14 C ATOM 5128 O SER A 358 29.078 87.786 63.680 1.00 13.83 O ATOM 5129 CB SER A 358 28.659 85.442 61.988 1.00 12.60 C ATOM 5130 OG SER A 358 29.671 84.453 61.843 1.00 12.58 O ATOM 5131 HA SER A 358 28.468 84.616 63.929 1.00 0.00 H ATOM 5132 HB2 SER A 358 29.042 86.401 61.639 1.00 0.00 H ATOM 5133 HB3 SER A 358 27.793 85.159 61.390 1.00 0.00 H ATOM 5134 HG SER A 358 30.461 84.709 62.382 1.00 0.00 H ATOM 5135 H SER A 358 26.409 86.486 62.781 1.00 0.00 H ATOM 5136 N ILE A 359 29.402 86.429 65.437 1.00 11.07 N ATOM 5137 CA ILE A 359 29.880 87.540 66.295 1.00 12.39 C ATOM 5138 C ILE A 359 31.377 87.775 66.141 1.00 12.56 C ATOM 5139 O ILE A 359 32.079 86.978 65.514 1.00 12.68 O ATOM 5140 CB ILE A 359 29.516 87.313 67.796 1.00 12.25 C ATOM 5141 CG1 ILE A 359 30.288 86.164 68.442 1.00 13.25 C ATOM 5142 CG2 ILE A 359 28.010 87.127 67.976 1.00 13.30 C ATOM 5143 CD1 ILE A 359 30.204 86.226 69.993 1.00 13.22 C ATOM 5144 HA ILE A 359 29.362 88.437 65.954 1.00 0.00 H ATOM 5145 HB ILE A 359 29.823 88.219 68.319 1.00 0.00 H ATOM 5146 HG12 ILE A 359 29.867 85.218 68.101 1.00 0.00 H ATOM 5147 HG13 ILE A 359 31.334 86.225 68.140 1.00 0.00 H ATOM 5148 HD11 ILE A 359 30.628 87.168 70.341 1.00 0.00 H ATOM 5149 HD12 ILE A 359 29.161 86.160 70.302 1.00 0.00 H ATOM 5150 HD13 ILE A 359 30.764 85.394 70.419 1.00 0.00 H ATOM 5151 HG21 ILE A 359 27.490 88.017 67.622 1.00 0.00 H ATOM 5152 HG22 ILE A 359 27.681 86.260 67.402 1.00 0.00 H ATOM 5153 HG23 ILE A 359 27.788 86.971 69.032 1.00 0.00 H ATOM 5154 H ILE A 359 29.400 85.454 65.799 1.00 0.00 H ATOM 5155 N ASN A 360 31.840 88.900 66.707 1.00 12.99 N ATOM 5156 CA ASN A 360 33.273 89.254 66.765 1.00 13.69 C ATOM 5157 C ASN A 360 33.929 89.565 65.436 1.00 14.79 C ATOM 5158 O ASN A 360 35.176 89.553 65.340 1.00 17.15 O ATOM 5159 CB ASN A 360 34.082 88.187 67.524 1.00 14.89 C ATOM 5160 CG ASN A 360 33.712 88.103 68.977 1.00 14.16 C ATOM 5161 OD1 ASN A 360 33.293 89.099 69.592 1.00 17.61 O ATOM 5162 ND2 ASN A 360 33.915 86.914 69.561 1.00 14.45 N ATOM 5163 HA ASN A 360 33.288 90.196 67.314 1.00 0.00 H ATOM 5164 HB2 ASN A 360 33.901 87.217 67.061 1.00 0.00 H ATOM 5165 HB3 ASN A 360 35.141 88.432 67.447 1.00 0.00 H ATOM 5166 HD22 ASN A 360 34.267 86.112 69.000 1.00 0.00 H ATOM 5167 HD21 ASN A 360 33.720 86.793 70.575 1.00 0.00 H ATOM 5168 H ASN A 360 31.153 89.558 67.127 1.00 0.00 H ATOM 5169 N ILE A 361 33.135 89.906 64.412 1.00 15.18 N ATOM 5170 CA ILE A 361 33.767 90.326 63.146 1.00 16.27 C ATOM 5171 C ILE A 361 33.977 91.831 63.192 1.00 18.47 C ATOM 5172 O ILE A 361 33.072 92.591 62.940 1.00 20.69 O ATOM 5173 CB ILE A 361 32.946 89.894 61.917 1.00 15.80 C ATOM 5174 CG1 ILE A 361 32.716 88.389 61.953 1.00 14.24 C ATOM 5175 CG2 ILE A 361 33.670 90.294 60.632 1.00 17.71 C ATOM 5176 CD1 ILE A 361 31.770 87.906 60.854 1.00 15.32 C ATOM 5177 HA ILE A 361 34.731 89.828 63.041 1.00 0.00 H ATOM 5178 HB ILE A 361 31.980 90.398 61.939 1.00 0.00 H ATOM 5179 HG12 ILE A 361 33.676 87.887 61.832 1.00 0.00 H ATOM 5180 HG13 ILE A 361 32.289 88.125 62.921 1.00 0.00 H ATOM 5181 HD11 ILE A 361 30.802 88.394 60.969 1.00 0.00 H ATOM 5182 HD12 ILE A 361 32.190 88.155 59.879 1.00 0.00 H ATOM 5183 HD13 ILE A 361 31.646 86.826 60.932 1.00 0.00 H ATOM 5184 HG21 ILE A 361 33.801 91.376 60.612 1.00 0.00 H ATOM 5185 HG22 ILE A 361 34.645 89.808 60.599 1.00 0.00 H ATOM 5186 HG23 ILE A 361 33.078 89.983 59.771 1.00 0.00 H ATOM 5187 H ILE A 361 32.100 89.876 64.507 1.00 0.00 H ATOM 5188 N GLU A 362 35.167 92.241 63.606 1.00 20.13 N ATOM 5189 CA GLU A 362 35.469 93.671 63.693 1.00 23.26 C ATOM 5190 C GLU A 362 36.010 94.180 62.378 1.00 24.70 C ATOM 5191 O GLU A 362 35.784 95.330 62.013 1.00 26.49 O ATOM 5192 CB GLU A 362 36.453 93.943 64.828 1.00 24.89 C ATOM 5193 CG GLU A 362 35.865 93.565 66.165 1.00 27.78 C ATOM 5194 HA GLU A 362 34.545 94.207 63.910 1.00 0.00 H ATOM 5195 HB2 GLU A 362 37.359 93.360 64.660 1.00 0.00 H ATOM 5196 HB3 GLU A 362 36.702 95.004 64.836 1.00 0.00 H ATOM 5197 HG2 GLU A 362 34.961 94.149 66.341 1.00 0.00 H ATOM 5198 HG3 GLU A 362 35.619 92.503 66.165 1.00 0.00 H ATOM 5199 H GLU A 362 35.891 91.543 63.871 1.00 0.00 H ATOM 5200 N GLU A 363 36.753 93.329 61.686 1.00 24.34 N ATOM 5201 CA GLU A 363 37.230 93.627 60.340 1.00 25.90 C ATOM 5202 C GLU A 363 36.978 92.361 59.528 1.00 23.61 C ATOM 5203 O GLU A 363 37.608 91.328 59.764 1.00 23.22 O ATOM 5204 CB GLU A 363 38.720 93.964 60.360 1.00 28.28 C ATOM 5205 CG GLU A 363 39.322 94.169 58.981 1.00 31.58 C ATOM 5206 CD GLU A 363 40.795 94.561 59.047 1.00 32.48 C ATOM 5207 OE1 GLU A 363 41.210 95.217 60.036 1.00 35.46 O ATOM 5208 OE2 GLU A 363 41.532 94.215 58.102 1.00 36.07 O ATOM 5209 HA GLU A 363 36.718 94.489 59.913 1.00 0.00 H ATOM 5210 HB2 GLU A 363 38.858 94.880 60.935 1.00 0.00 H ATOM 5211 HB3 GLU A 363 39.251 93.147 60.849 1.00 0.00 H ATOM 5212 HG2 GLU A 363 39.230 93.241 58.416 1.00 0.00 H ATOM 5213 HG3 GLU A 363 38.771 94.959 58.471 1.00 0.00 H ATOM 5214 H GLU A 363 37.005 92.417 62.117 1.00 0.00 H ATOM 5215 N LEU A 364 36.052 92.420 58.580 1.00 23.80 N ATOM 5216 CA LEU A 364 35.808 91.242 57.755 1.00 23.47 C ATOM 5217 C LEU A 364 37.038 90.907 56.894 1.00 24.76 C ATOM 5218 O LEU A 364 37.660 91.800 56.286 1.00 25.74 O ATOM 5219 CB LEU A 364 34.614 91.485 56.858 1.00 25.21 C ATOM 5220 CG LEU A 364 33.395 90.572 56.615 1.00 27.13 C ATOM 5221 CD1 LEU A 364 32.960 90.742 55.129 1.00 25.89 C ATOM 5222 CD2 LEU A 364 33.479 89.114 57.053 1.00 24.31 C ATOM 5223 HA LEU A 364 35.608 90.398 58.415 1.00 0.00 H ATOM 5224 HB2 LEU A 364 34.187 92.421 57.218 1.00 0.00 H ATOM 5225 HB3 LEU A 364 35.042 91.639 55.868 1.00 0.00 H ATOM 5226 HG LEU A 364 32.626 90.918 57.306 1.00 0.00 H ATOM 5227 HD21 LEU A 364 34.302 88.626 56.531 1.00 0.00 H ATOM 5228 HD22 LEU A 364 33.652 89.068 58.128 1.00 0.00 H ATOM 5229 HD23 LEU A 364 32.543 88.609 56.812 1.00 0.00 H ATOM 5230 HD11 LEU A 364 32.695 91.783 54.946 1.00 0.00 H ATOM 5231 HD12 LEU A 364 33.784 90.455 54.475 1.00 0.00 H ATOM 5232 HD13 LEU A 364 32.098 90.106 54.929 1.00 0.00 H ATOM 5233 H LEU A 364 35.508 93.293 58.427 1.00 0.00 H ATOM 5234 N ASP A 365 37.371 89.623 56.819 1.00 22.78 N ATOM 5235 CA ASP A 365 38.510 89.177 56.018 1.00 24.38 C ATOM 5236 C ASP A 365 38.391 89.678 54.599 1.00 25.75 C ATOM 5237 O ASP A 365 37.299 89.611 54.023 1.00 24.60 O ATOM 5238 CB ASP A 365 38.562 87.645 56.003 1.00 24.71 C ATOM 5239 CG ASP A 365 39.890 87.113 55.498 1.00 25.95 C ATOM 5240 OD1 ASP A 365 40.118 87.097 54.255 1.00 26.91 O ATOM 5241 OD2 ASP A 365 40.722 86.737 56.342 1.00 27.18 O ATOM 5242 HA ASP A 365 39.421 89.578 56.462 1.00 0.00 H ATOM 5243 HB2 ASP A 365 38.402 87.280 57.017 1.00 0.00 H ATOM 5244 HB3 ASP A 365 37.768 87.274 55.355 1.00 0.00 H ATOM 5245 H ASP A 365 36.810 88.920 57.341 1.00 0.00 H ATOM 5246 N GLU A 366 39.517 90.141 54.033 1.00 26.37 N ATOM 5247 CA GLU A 366 39.565 90.592 52.633 1.00 28.67 C ATOM 5248 C GLU A 366 39.008 89.562 51.642 1.00 28.09 C ATOM 5249 O GLU A 366 38.542 89.931 50.570 1.00 29.70 O ATOM 5250 CB GLU A 366 40.982 91.052 52.229 1.00 29.68 C ATOM 5251 CG GLU A 366 42.076 89.983 52.278 1.00 32.46 C ATOM 5252 HA GLU A 366 38.902 91.455 52.578 1.00 0.00 H ATOM 5253 HB2 GLU A 366 40.931 91.431 51.208 1.00 0.00 H ATOM 5254 HB3 GLU A 366 41.274 91.859 52.900 1.00 0.00 H ATOM 5255 HG2 GLU A 366 42.161 89.598 53.294 1.00 0.00 H ATOM 5256 HG3 GLU A 366 41.818 89.169 51.601 1.00 0.00 H ATOM 5257 H GLU A 366 40.385 90.182 54.604 1.00 0.00 H ATOM 5258 N GLN A 367 39.036 88.277 52.019 1.00 27.82 N ATOM 5259 CA GLN A 367 38.568 87.210 51.147 1.00 26.71 C ATOM 5260 C GLN A 367 37.153 86.734 51.430 1.00 25.64 C ATOM 5261 O GLN A 367 36.746 85.694 50.926 1.00 25.47 O ATOM 5262 CB GLN A 367 39.575 86.050 51.129 1.00 29.34 C ATOM 5263 CG GLN A 367 40.799 86.369 50.266 1.00 32.50 C ATOM 5264 CD GLN A 367 40.437 86.520 48.789 1.00 34.83 C ATOM 5265 OE1 GLN A 367 39.867 85.606 48.177 1.00 36.56 O ATOM 5266 NE2 GLN A 367 40.747 87.677 48.217 1.00 35.45 N ATOM 5267 HA GLN A 367 38.509 87.643 50.148 1.00 0.00 H ATOM 5268 HB2 GLN A 367 39.904 85.853 52.149 1.00 0.00 H ATOM 5269 HB3 GLN A 367 39.084 85.163 50.730 1.00 0.00 H ATOM 5270 HG2 GLN A 367 41.243 87.301 50.616 1.00 0.00 H ATOM 5271 HG3 GLN A 367 41.523 85.561 50.370 1.00 0.00 H ATOM 5272 HE22 GLN A 367 41.226 88.418 48.768 1.00 0.00 H ATOM 5273 HE21 GLN A 367 40.511 87.843 47.218 1.00 0.00 H ATOM 5274 H GLN A 367 39.403 88.035 52.962 1.00 0.00 H ATOM 5275 N ALA A 368 36.376 87.520 52.187 1.00 24.84 N ATOM 5276 CA ALA A 368 34.975 87.167 52.558 1.00 25.06 C ATOM 5277 C ALA A 368 33.898 88.089 51.935 1.00 26.09 C ATOM 5278 O ALA A 368 32.769 88.176 52.429 1.00 28.72 O ATOM 5279 CB ALA A 368 34.819 87.141 54.105 1.00 25.13 C ATOM 5280 HA ALA A 368 34.801 86.176 52.140 1.00 0.00 H ATOM 5281 HB1 ALA A 368 35.498 86.399 54.525 1.00 0.00 H ATOM 5282 HB2 ALA A 368 35.059 88.124 54.510 1.00 0.00 H ATOM 5283 HB3 ALA A 368 33.792 86.882 54.361 1.00 0.00 H ATOM 5284 H ALA A 368 36.768 88.419 52.532 1.00 0.00 H ATOM 5285 N ALA A 369 34.223 88.747 50.832 1.00 25.23 N ATOM 5286 CA ALA A 369 33.291 89.688 50.166 1.00 24.16 C ATOM 5287 C ALA A 369 32.210 88.981 49.333 1.00 23.33 C ATOM 5288 O ALA A 369 32.410 87.859 48.894 1.00 25.81 O ATOM 5289 CB ALA A 369 34.094 90.649 49.291 1.00 24.97 C ATOM 5290 HA ALA A 369 32.762 90.234 50.947 1.00 0.00 H ATOM 5291 HB1 ALA A 369 34.796 91.205 49.913 1.00 0.00 H ATOM 5292 HB2 ALA A 369 34.643 90.082 48.540 1.00 0.00 H ATOM 5293 HB3 ALA A 369 33.414 91.344 48.798 1.00 0.00 H ATOM 5294 H ALA A 369 35.166 88.598 50.419 1.00 0.00 H ATOM 5295 N GLY A 370 31.054 89.606 49.181 1.00 23.32 N ATOM 5296 CA GLY A 370 29.997 89.123 48.304 1.00 21.75 C ATOM 5297 C GLY A 370 29.137 87.991 48.825 1.00 22.42 C ATOM 5298 O GLY A 370 28.406 87.373 48.072 1.00 22.80 O ATOM 5299 HA3 GLY A 370 30.465 88.783 47.380 1.00 0.00 H ATOM 5300 HA2 GLY A 370 29.338 89.964 48.088 1.00 0.00 H ATOM 5301 H GLY A 370 30.892 90.485 49.714 1.00 0.00 H ATOM 5302 N LEU A 371 29.207 87.718 50.123 1.00 19.46 N ATOM 5303 CA LEU A 371 28.363 86.699 50.738 1.00 17.50 C ATOM 5304 C LEU A 371 27.407 87.395 51.691 1.00 17.90 C ATOM 5305 O LEU A 371 27.420 88.635 51.795 1.00 19.45 O ATOM 5306 CB LEU A 371 29.222 85.607 51.418 1.00 18.17 C ATOM 5307 CG LEU A 371 30.051 84.724 50.450 1.00 18.74 C ATOM 5308 CD1 LEU A 371 30.965 83.822 51.248 1.00 20.62 C ATOM 5309 CD2 LEU A 371 29.188 83.894 49.520 1.00 20.72 C ATOM 5310 HA LEU A 371 27.775 86.174 49.985 1.00 0.00 H ATOM 5311 HB2 LEU A 371 29.913 86.098 52.103 1.00 0.00 H ATOM 5312 HB3 LEU A 371 28.555 84.955 51.983 1.00 0.00 H ATOM 5313 HG LEU A 371 30.635 85.396 49.820 1.00 0.00 H ATOM 5314 HD21 LEU A 371 28.552 83.234 50.109 1.00 0.00 H ATOM 5315 HD22 LEU A 371 28.567 84.555 48.916 1.00 0.00 H ATOM 5316 HD23 LEU A 371 29.827 83.298 48.868 1.00 0.00 H ATOM 5317 HD11 LEU A 371 31.638 84.431 51.852 1.00 0.00 H ATOM 5318 HD12 LEU A 371 30.367 83.185 51.899 1.00 0.00 H ATOM 5319 HD13 LEU A 371 31.547 83.202 50.566 1.00 0.00 H ATOM 5320 H LEU A 371 29.880 88.244 50.716 1.00 0.00 H ATOM 5321 N ASN A 372 26.511 86.631 52.298 1.00 14.10 N ATOM 5322 CA ASN A 372 25.605 87.175 53.306 1.00 14.05 C ATOM 5323 C ASN A 372 25.927 86.630 54.691 1.00 12.72 C ATOM 5324 O ASN A 372 25.218 85.780 55.206 1.00 12.56 O ATOM 5325 CB ASN A 372 24.139 86.896 52.979 1.00 15.19 C ATOM 5326 CG ASN A 372 23.209 87.655 53.917 1.00 16.02 C ATOM 5327 OD1 ASN A 372 23.634 88.635 54.538 1.00 17.32 O ATOM 5328 ND2 ASN A 372 21.966 87.216 54.040 1.00 18.01 N ATOM 5329 HA ASN A 372 25.756 88.254 53.300 1.00 0.00 H ATOM 5330 HB2 ASN A 372 23.939 87.205 51.953 1.00 0.00 H ATOM 5331 HB3 ASN A 372 23.950 85.827 53.079 1.00 0.00 H ATOM 5332 HD22 ASN A 372 21.651 86.387 53.497 1.00 0.00 H ATOM 5333 HD21 ASN A 372 21.304 87.701 54.679 1.00 0.00 H ATOM 5334 H ASN A 372 26.452 85.622 52.051 1.00 0.00 H ATOM 5335 N ILE A 373 26.989 87.140 55.279 1.00 13.19 N ATOM 5336 CA ILE A 373 27.383 86.756 56.634 1.00 13.14 C ATOM 5337 C ILE A 373 26.603 87.659 57.598 1.00 13.52 C ATOM 5338 O ILE A 373 26.756 88.897 57.588 1.00 16.39 O ATOM 5339 CB ILE A 373 28.910 86.928 56.856 1.00 14.15 C ATOM 5340 CG1 ILE A 373 29.720 86.142 55.809 1.00 17.24 C ATOM 5341 CG2 ILE A 373 29.265 86.596 58.288 1.00 15.44 C ATOM 5342 CD1 ILE A 373 29.530 84.753 55.772 1.00 16.34 C ATOM 5343 HA ILE A 373 27.158 85.703 56.804 1.00 0.00 H ATOM 5344 HB ILE A 373 29.186 87.971 56.702 1.00 0.00 H ATOM 5345 HG12 ILE A 373 29.460 86.537 54.827 1.00 0.00 H ATOM 5346 HG13 ILE A 373 30.777 86.325 56.004 1.00 0.00 H ATOM 5347 HD11 ILE A 373 29.801 84.325 56.737 1.00 0.00 H ATOM 5348 HD12 ILE A 373 28.483 84.536 55.558 1.00 0.00 H ATOM 5349 HD13 ILE A 373 30.158 84.322 54.992 1.00 0.00 H ATOM 5350 HG21 ILE A 373 28.727 87.265 58.959 1.00 0.00 H ATOM 5351 HG22 ILE A 373 28.985 85.564 58.501 1.00 0.00 H ATOM 5352 HG23 ILE A 373 30.338 86.720 58.433 1.00 0.00 H ATOM 5353 H ILE A 373 27.565 87.837 54.765 1.00 0.00 H ATOM 5354 N VAL A 374 25.756 87.038 58.400 1.00 11.53 N ATOM 5355 CA VAL A 374 24.835 87.757 59.228 1.00 11.92 C ATOM 5356 C VAL A 374 25.447 87.979 60.585 1.00 12.17 C ATOM 5357 O VAL A 374 25.875 87.030 61.232 1.00 13.33 O ATOM 5358 CB VAL A 374 23.525 86.962 59.356 1.00 11.85 C ATOM 5359 CG1 VAL A 374 22.622 87.581 60.422 1.00 13.53 C ATOM 5360 CG2 VAL A 374 22.794 86.918 57.986 1.00 14.67 C ATOM 5361 HA VAL A 374 24.615 88.725 58.777 1.00 0.00 H ATOM 5362 HB VAL A 374 23.764 85.943 59.661 1.00 0.00 H ATOM 5363 HG11 VAL A 374 23.137 87.571 61.383 1.00 0.00 H ATOM 5364 HG12 VAL A 374 22.386 88.609 60.145 1.00 0.00 H ATOM 5365 HG13 VAL A 374 21.701 87.003 60.496 1.00 0.00 H ATOM 5366 HG21 VAL A 374 22.567 87.934 57.664 1.00 0.00 H ATOM 5367 HG22 VAL A 374 23.436 86.436 57.248 1.00 0.00 H ATOM 5368 HG23 VAL A 374 21.868 86.353 58.088 1.00 0.00 H ATOM 5369 H VAL A 374 25.758 85.998 58.431 1.00 0.00 H ATOM 5370 N THR A 375 25.515 89.247 60.993 1.00 12.23 N ATOM 5371 CA THR A 375 26.237 89.620 62.219 1.00 13.59 C ATOM 5372 C THR A 375 25.339 90.132 63.334 1.00 14.79 C ATOM 5373 O THR A 375 25.826 90.475 64.415 1.00 16.94 O ATOM 5374 CB THR A 375 27.347 90.640 61.967 1.00 14.27 C ATOM 5375 OG1 THR A 375 26.762 91.886 61.541 1.00 15.95 O ATOM 5376 CG2 THR A 375 28.330 90.120 60.898 1.00 15.35 C ATOM 5377 HA THR A 375 26.681 88.681 62.550 1.00 0.00 H ATOM 5378 HB THR A 375 27.903 90.797 62.892 1.00 0.00 H ATOM 5379 HG1 THR A 375 26.156 92.223 62.247 1.00 0.00 H ATOM 5380 HG23 THR A 375 28.764 89.178 61.233 1.00 0.00 H ATOM 5381 HG21 THR A 375 27.796 89.962 59.961 1.00 0.00 H ATOM 5382 HG22 THR A 375 29.122 90.854 60.747 1.00 0.00 H ATOM 5383 H THR A 375 25.048 89.988 60.432 1.00 0.00 H ATOM 5384 N GLU A 376 24.043 90.185 63.070 1.00 14.83 N ATOM 5385 CA GLU A 376 23.065 90.630 64.055 1.00 16.72 C ATOM 5386 C GLU A 376 21.897 89.658 64.017 1.00 15.28 C ATOM 5387 O GLU A 376 21.513 89.207 62.953 1.00 15.62 O ATOM 5388 CB GLU A 376 22.597 92.057 63.742 1.00 20.37 C ATOM 5389 CG GLU A 376 21.840 92.180 62.455 1.00 25.01 C ATOM 5390 HA GLU A 376 23.508 90.646 65.051 1.00 0.00 H ATOM 5391 HB2 GLU A 376 21.951 92.392 64.554 1.00 0.00 H ATOM 5392 HB3 GLU A 376 23.474 92.702 63.687 1.00 0.00 H ATOM 5393 HG2 GLU A 376 22.475 91.860 61.629 1.00 0.00 H ATOM 5394 HG3 GLU A 376 20.951 91.550 62.496 1.00 0.00 H ATOM 5395 H GLU A 376 23.711 89.899 62.127 1.00 0.00 H ATOM 5396 N THR A 377 21.365 89.287 65.184 1.00 15.10 N ATOM 5397 CA THR A 377 20.233 88.384 65.224 1.00 13.90 C ATOM 5398 C THR A 377 19.130 88.893 64.317 1.00 14.52 C ATOM 5399 O THR A 377 18.740 90.066 64.388 1.00 16.09 O ATOM 5400 CB THR A 377 19.737 88.220 66.659 1.00 15.45 C ATOM 5401 OG1 THR A 377 20.851 87.817 67.454 1.00 16.33 O ATOM 5402 CG2 THR A 377 18.586 87.201 66.767 1.00 16.77 C ATOM 5403 HA THR A 377 20.545 87.404 64.863 1.00 0.00 H ATOM 5404 HB THR A 377 19.331 89.167 67.013 1.00 0.00 H ATOM 5405 HG1 THR A 377 20.560 87.702 68.393 1.00 0.00 H ATOM 5406 HG23 THR A 377 17.750 87.533 66.151 1.00 0.00 H ATOM 5407 HG21 THR A 377 18.931 86.227 66.420 1.00 0.00 H ATOM 5408 HG22 THR A 377 18.266 87.125 67.806 1.00 0.00 H ATOM 5409 H THR A 377 21.767 89.649 66.072 1.00 0.00 H ATOM 5410 N THR A 378 18.625 87.998 63.460 1.00 13.79 N ATOM 5411 CA THR A 378 17.656 88.417 62.450 1.00 15.07 C ATOM 5412 C THR A 378 16.458 87.472 62.460 1.00 14.66 C ATOM 5413 O THR A 378 16.602 86.276 62.179 1.00 16.29 O ATOM 5414 CB THR A 378 18.362 88.442 61.054 1.00 14.63 C ATOM 5415 OG1 THR A 378 19.492 89.334 61.110 1.00 17.27 O ATOM 5416 CG2 THR A 378 17.416 88.840 59.915 1.00 16.63 C ATOM 5417 HA THR A 378 17.285 89.418 62.669 1.00 0.00 H ATOM 5418 HB THR A 378 18.696 87.428 60.833 1.00 0.00 H ATOM 5419 HG1 THR A 378 20.128 89.016 61.799 1.00 0.00 H ATOM 5420 HG23 THR A 378 16.570 88.153 59.891 1.00 0.00 H ATOM 5421 HG21 THR A 378 17.057 89.856 60.081 1.00 0.00 H ATOM 5422 HG22 THR A 378 17.951 88.793 58.967 1.00 0.00 H ATOM 5423 H THR A 378 18.923 87.003 63.513 1.00 0.00 H ATOM 5424 N ASP A 379 15.281 87.997 62.797 1.00 16.83 N ATOM 5425 CA ASP A 379 14.072 87.171 62.723 1.00 16.54 C ATOM 5426 C ASP A 379 13.726 86.951 61.254 1.00 16.35 C ATOM 5427 O ASP A 379 13.695 87.895 60.474 1.00 18.46 O ATOM 5428 CB ASP A 379 12.898 87.820 63.453 1.00 20.17 C ATOM 5429 CG ASP A 379 13.087 87.828 64.960 1.00 22.83 C ATOM 5430 OD1 ASP A 379 13.703 86.876 65.502 1.00 23.25 O ATOM 5431 OD2 ASP A 379 12.613 88.787 65.618 1.00 26.96 O ATOM 5432 HA ASP A 379 14.265 86.217 63.214 1.00 0.00 H ATOM 5433 HB2 ASP A 379 12.796 88.849 63.107 1.00 0.00 H ATOM 5434 HB3 ASP A 379 11.989 87.267 63.217 1.00 0.00 H ATOM 5435 H ASP A 379 15.220 88.987 63.111 1.00 0.00 H ATOM 5436 N ARG A 380 13.501 85.697 60.867 1.00 16.19 N ATOM 5437 CA ARG A 380 13.195 85.378 59.472 1.00 16.49 C ATOM 5438 C ARG A 380 12.620 83.967 59.477 1.00 15.77 C ATOM 5439 O ARG A 380 13.132 83.083 60.166 1.00 17.12 O ATOM 5440 CB ARG A 380 14.482 85.385 58.634 1.00 17.98 C ATOM 5441 CG ARG A 380 14.301 85.203 57.097 1.00 18.51 C ATOM 5442 CD ARG A 380 15.511 85.760 56.333 1.00 20.14 C ATOM 5443 NE ARG A 380 15.622 87.211 56.487 1.00 23.15 N ATOM 5444 CZ ARG A 380 16.705 87.955 56.225 1.00 24.10 C ATOM 5445 NH1 ARG A 380 17.814 87.402 55.796 1.00 23.81 N ATOM 5446 NH2 ARG A 380 16.676 89.273 56.453 1.00 26.22 N ATOM 5447 HA ARG A 380 12.503 86.105 59.047 1.00 0.00 H ATOM 5448 HB2 ARG A 380 14.982 86.339 58.800 1.00 0.00 H ATOM 5449 HB3 ARG A 380 15.118 84.575 58.993 1.00 0.00 H ATOM 5450 HG2 ARG A 380 14.195 84.142 56.873 1.00 0.00 H ATOM 5451 HG3 ARG A 380 13.403 85.732 56.778 1.00 0.00 H ATOM 5452 HD2 ARG A 380 15.401 85.523 55.275 1.00 0.00 H ATOM 5453 HD3 ARG A 380 16.418 85.293 56.716 1.00 0.00 H ATOM 5454 HE ARG A 380 14.779 87.713 56.833 1.00 0.00 H ATOM 5455 HH12 ARG A 380 18.646 87.993 55.597 1.00 0.00 H ATOM 5456 HH11 ARG A 380 17.861 86.373 55.655 1.00 0.00 H ATOM 5457 HH22 ARG A 380 17.514 89.854 56.251 1.00 0.00 H ATOM 5458 HH21 ARG A 380 15.815 89.716 56.832 1.00 0.00 H ATOM 5459 H ARG A 380 13.543 84.931 61.569 1.00 0.00 H ATOM 5460 N GLU A 381 11.591 83.762 58.669 1.00 17.09 N ATOM 5461 CA GLU A 381 11.004 82.444 58.487 1.00 17.22 C ATOM 5462 C GLU A 381 11.970 81.642 57.620 1.00 17.56 C ATOM 5463 O GLU A 381 12.303 82.038 56.499 1.00 22.17 O ATOM 5464 CB GLU A 381 9.627 82.552 57.799 1.00 19.75 C ATOM 5465 CG GLU A 381 8.923 81.222 57.616 1.00 22.90 C ATOM 5466 HA GLU A 381 10.848 81.956 59.449 1.00 0.00 H ATOM 5467 HB2 GLU A 381 8.990 83.197 58.405 1.00 0.00 H ATOM 5468 HB3 GLU A 381 9.769 83.003 56.817 1.00 0.00 H ATOM 5469 HG2 GLU A 381 9.540 80.567 57.001 1.00 0.00 H ATOM 5470 HG3 GLU A 381 8.761 80.761 58.590 1.00 0.00 H ATOM 5471 H GLU A 381 11.190 84.568 58.149 1.00 0.00 H ATOM 5472 N LEU A 382 12.474 80.555 58.169 1.00 15.31 N ATOM 5473 CA LEU A 382 13.355 79.667 57.453 1.00 14.05 C ATOM 5474 C LEU A 382 12.592 78.411 57.113 1.00 13.32 C ATOM 5475 O LEU A 382 11.685 77.992 57.855 1.00 15.02 O ATOM 5476 CB LEU A 382 14.560 79.307 58.338 1.00 14.12 C ATOM 5477 CG LEU A 382 15.391 80.478 58.909 1.00 14.03 C ATOM 5478 CD1 LEU A 382 16.444 79.938 59.857 1.00 14.91 C ATOM 5479 CD2 LEU A 382 16.054 81.339 57.810 1.00 15.80 C ATOM 5480 HA LEU A 382 13.713 80.151 56.544 1.00 0.00 H ATOM 5481 HB2 LEU A 382 14.186 78.728 59.182 1.00 0.00 H ATOM 5482 HB3 LEU A 382 15.231 78.688 57.743 1.00 0.00 H ATOM 5483 HG LEU A 382 14.703 81.132 59.444 1.00 0.00 H ATOM 5484 HD21 LEU A 382 16.723 80.716 57.216 1.00 0.00 H ATOM 5485 HD22 LEU A 382 15.282 81.762 57.167 1.00 0.00 H ATOM 5486 HD23 LEU A 382 16.623 82.144 58.275 1.00 0.00 H ATOM 5487 HD11 LEU A 382 15.957 79.406 60.674 1.00 0.00 H ATOM 5488 HD12 LEU A 382 17.101 79.255 59.318 1.00 0.00 H ATOM 5489 HD13 LEU A 382 17.029 80.766 60.258 1.00 0.00 H ATOM 5490 H LEU A 382 12.227 80.330 59.154 1.00 0.00 H ATOM 5491 N THR A 383 12.995 77.767 56.026 1.00 12.18 N ATOM 5492 CA THR A 383 12.401 76.484 55.645 1.00 13.07 C ATOM 5493 C THR A 383 13.432 75.377 55.516 1.00 12.32 C ATOM 5494 O THR A 383 13.146 74.226 55.896 1.00 11.94 O ATOM 5495 CB THR A 383 11.632 76.614 54.311 1.00 15.23 C ATOM 5496 OG1 THR A 383 10.555 77.535 54.512 1.00 18.40 O ATOM 5497 CG2 THR A 383 11.032 75.285 53.911 1.00 16.67 C ATOM 5498 HA THR A 383 11.716 76.214 56.448 1.00 0.00 H ATOM 5499 HB THR A 383 12.318 76.950 53.533 1.00 0.00 H ATOM 5500 HG1 THR A 383 10.920 78.414 54.785 1.00 0.00 H ATOM 5501 HG23 THR A 383 11.831 74.561 53.750 1.00 0.00 H ATOM 5502 HG21 THR A 383 10.373 74.932 54.704 1.00 0.00 H ATOM 5503 HG22 THR A 383 10.461 75.408 52.991 1.00 0.00 H ATOM 5504 H THR A 383 13.745 78.180 55.435 1.00 0.00 H ATOM 5505 N THR A 384 14.606 75.703 54.969 1.00 11.38 N ATOM 5506 CA THR A 384 15.652 74.695 54.716 1.00 11.23 C ATOM 5507 C THR A 384 16.955 75.261 55.219 1.00 11.12 C ATOM 5508 O THR A 384 17.312 76.385 54.884 1.00 12.33 O ATOM 5509 CB THR A 384 15.779 74.435 53.182 1.00 12.14 C ATOM 5510 OG1 THR A 384 14.480 74.218 52.620 1.00 13.28 O ATOM 5511 CG2 THR A 384 16.629 73.195 52.923 1.00 12.26 C ATOM 5512 HA THR A 384 15.404 73.759 55.216 1.00 0.00 H ATOM 5513 HB THR A 384 16.249 75.305 52.724 1.00 0.00 H ATOM 5514 HG1 THR A 384 14.566 74.054 51.648 1.00 0.00 H ATOM 5515 HG23 THR A 384 17.623 73.343 53.345 1.00 0.00 H ATOM 5516 HG21 THR A 384 16.159 72.330 53.391 1.00 0.00 H ATOM 5517 HG22 THR A 384 16.710 73.029 51.849 1.00 0.00 H ATOM 5518 H THR A 384 14.787 76.695 54.715 1.00 0.00 H ATOM 5519 N VAL A 385 17.662 74.480 56.040 1.00 11.09 N ATOM 5520 CA VAL A 385 18.932 74.900 56.603 1.00 10.96 C ATOM 5521 C VAL A 385 20.011 73.862 56.357 1.00 10.18 C ATOM 5522 O VAL A 385 19.716 72.682 56.183 1.00 11.28 O ATOM 5523 CB VAL A 385 18.806 75.216 58.136 1.00 11.74 C ATOM 5524 CG1 VAL A 385 17.748 76.311 58.373 1.00 13.29 C ATOM 5525 CG2 VAL A 385 18.480 73.966 58.967 1.00 13.88 C ATOM 5526 HA VAL A 385 19.223 75.820 56.095 1.00 0.00 H ATOM 5527 HB VAL A 385 19.778 75.578 58.470 1.00 0.00 H ATOM 5528 HG11 VAL A 385 18.042 77.219 57.846 1.00 0.00 H ATOM 5529 HG12 VAL A 385 16.783 75.969 58.000 1.00 0.00 H ATOM 5530 HG13 VAL A 385 17.674 76.518 59.441 1.00 0.00 H ATOM 5531 HG21 VAL A 385 17.533 73.545 58.631 1.00 0.00 H ATOM 5532 HG22 VAL A 385 19.273 73.229 58.839 1.00 0.00 H ATOM 5533 HG23 VAL A 385 18.404 74.240 60.019 1.00 0.00 H ATOM 5534 H VAL A 385 17.290 73.540 56.284 1.00 0.00 H ATOM 5535 N MET A 386 21.259 74.308 56.349 1.00 10.41 N ATOM 5536 CA MET A 386 22.404 73.428 56.084 1.00 10.32 C ATOM 5537 C MET A 386 23.421 73.649 57.182 1.00 9.49 C ATOM 5538 O MET A 386 23.590 74.765 57.637 1.00 10.43 O ATOM 5539 CB MET A 386 22.994 73.789 54.717 1.00 11.17 C ATOM 5540 CG MET A 386 23.970 72.715 54.287 1.00 12.92 C ATOM 5541 SD MET A 386 24.210 72.787 52.518 1.00 16.63 S ATOM 5542 CE MET A 386 25.319 74.175 52.380 1.00 16.17 C ATOM 5543 HA MET A 386 22.107 72.379 56.069 1.00 0.00 H ATOM 5544 HB2 MET A 386 22.191 73.865 53.984 1.00 0.00 H ATOM 5545 HB3 MET A 386 23.513 74.745 54.786 1.00 0.00 H ATOM 5546 HG2 MET A 386 23.574 71.736 54.559 1.00 0.00 H ATOM 5547 HG3 MET A 386 24.925 72.872 54.789 1.00 0.00 H ATOM 5548 HE1 MET A 386 24.840 75.064 52.791 1.00 0.00 H ATOM 5549 HE2 MET A 386 26.233 73.965 52.935 1.00 0.00 H ATOM 5550 HE3 MET A 386 25.560 74.343 51.330 1.00 0.00 H ATOM 5551 H MET A 386 21.433 75.316 56.537 1.00 0.00 H ATOM 5552 N SER A 387 24.126 72.601 57.565 1.00 8.94 N ATOM 5553 CA SER A 387 25.192 72.711 58.542 1.00 8.68 C ATOM 5554 C SER A 387 26.414 71.907 58.066 1.00 8.06 C ATOM 5555 O SER A 387 26.284 70.713 57.754 1.00 9.24 O ATOM 5556 CB SER A 387 24.687 72.157 59.879 1.00 10.36 C ATOM 5557 OG SER A 387 25.716 72.184 60.857 1.00 11.21 O ATOM 5558 HA SER A 387 25.485 73.754 58.662 1.00 0.00 H ATOM 5559 HB2 SER A 387 24.355 71.128 59.737 1.00 0.00 H ATOM 5560 HB3 SER A 387 23.850 72.764 60.224 1.00 0.00 H ATOM 5561 HG SER A 387 25.368 71.822 61.710 1.00 0.00 H ATOM 5562 H SER A 387 23.911 71.670 57.154 1.00 0.00 H ATOM 5563 N ASN A 388 27.590 72.548 58.045 1.00 8.49 N ATOM 5564 CA ASN A 388 28.814 71.948 57.543 1.00 8.73 C ATOM 5565 C ASN A 388 29.744 71.524 58.656 1.00 9.31 C ATOM 5566 O ASN A 388 29.913 72.286 59.625 1.00 9.59 O ATOM 5567 CB ASN A 388 29.590 72.972 56.726 1.00 10.37 C ATOM 5568 CG ASN A 388 29.004 73.221 55.360 1.00 10.56 C ATOM 5569 OD1 ASN A 388 28.230 72.429 54.852 1.00 12.38 O ATOM 5570 ND2 ASN A 388 29.388 74.335 54.752 1.00 12.26 N ATOM 5571 HA ASN A 388 28.510 71.082 56.956 1.00 0.00 H ATOM 5572 HB2 ASN A 388 29.601 73.914 57.274 1.00 0.00 H ATOM 5573 HB3 ASN A 388 30.612 72.613 56.603 1.00 0.00 H ATOM 5574 HD22 ASN A 388 30.051 74.983 55.224 1.00 0.00 H ATOM 5575 HD21 ASN A 388 29.026 74.561 53.803 1.00 0.00 H ATOM 5576 H ASN A 388 27.629 73.523 58.406 1.00 0.00 H ATOM 5577 N SER A 389 30.418 70.383 58.481 1.00 9.50 N ATOM 5578 CA SER A 389 31.423 69.939 59.439 1.00 10.61 C ATOM 5579 C SER A 389 32.599 69.402 58.625 1.00 11.83 C ATOM 5580 O SER A 389 32.501 68.335 58.020 1.00 13.59 O ATOM 5581 CB SER A 389 30.879 68.850 60.373 1.00 12.91 C ATOM 5582 OG SER A 389 29.633 69.231 60.947 1.00 13.15 O ATOM 5583 HA SER A 389 31.724 70.770 60.077 1.00 0.00 H ATOM 5584 HB2 SER A 389 31.599 68.676 61.172 1.00 0.00 H ATOM 5585 HB3 SER A 389 30.741 67.931 59.804 1.00 0.00 H ATOM 5586 HG SER A 389 29.753 70.063 61.470 1.00 0.00 H ATOM 5587 H SER A 389 30.221 69.799 57.643 1.00 0.00 H ATOM 5588 N PHE A 390 33.692 70.140 58.586 1.00 14.70 N ATOM 5589 CA PHE A 390 34.810 69.819 57.698 1.00 16.44 C ATOM 5590 C PHE A 390 35.997 69.495 58.569 1.00 18.10 C ATOM 5591 O PHE A 390 36.740 70.391 58.988 1.00 20.62 O ATOM 5592 CB PHE A 390 35.108 70.974 56.746 1.00 16.83 C ATOM 5593 CG PHE A 390 33.957 71.363 55.866 1.00 17.20 C ATOM 5594 CD1 PHE A 390 33.090 70.400 55.346 1.00 18.59 C ATOM 5595 CD2 PHE A 390 33.739 72.702 55.519 1.00 16.12 C ATOM 5596 CE1 PHE A 390 32.003 70.756 54.516 1.00 18.18 C ATOM 5597 CE2 PHE A 390 32.663 73.045 54.690 1.00 17.91 C ATOM 5598 CZ PHE A 390 31.815 72.072 54.174 1.00 16.15 C ATOM 5599 HA PHE A 390 34.564 68.964 57.068 1.00 0.00 H ATOM 5600 HB2 PHE A 390 35.392 71.842 57.341 1.00 0.00 H ATOM 5601 HB3 PHE A 390 35.943 70.684 56.108 1.00 0.00 H ATOM 5602 HD2 PHE A 390 34.407 73.478 55.894 1.00 0.00 H ATOM 5603 HE2 PHE A 390 32.488 74.093 54.445 1.00 0.00 H ATOM 5604 HZ PHE A 390 31.005 72.353 53.501 1.00 0.00 H ATOM 5605 HE1 PHE A 390 31.319 69.991 54.150 1.00 0.00 H ATOM 5606 HD1 PHE A 390 33.255 69.350 55.586 1.00 0.00 H ATOM 5607 H PHE A 390 33.761 70.974 59.204 1.00 0.00 H ATOM 5608 N GLY A 391 36.142 68.205 58.862 1.00 17.36 N ATOM 5609 CA GLY A 391 37.032 67.701 59.869 1.00 16.36 C ATOM 5610 C GLY A 391 38.494 67.574 59.496 1.00 15.48 C ATOM 5611 O GLY A 391 38.894 67.254 58.359 1.00 14.59 O ATOM 5612 HA3 GLY A 391 36.678 66.710 60.154 1.00 0.00 H ATOM 5613 HA2 GLY A 391 36.969 68.369 60.728 1.00 0.00 H ATOM 5614 H GLY A 391 35.574 67.518 58.327 1.00 0.00 H ATOM 5615 N PHE A 392 39.308 67.782 60.505 1.00 17.30 N ATOM 5616 CA PHE A 392 40.697 67.551 60.408 1.00 18.21 C ATOM 5617 C PHE A 392 41.009 66.134 59.832 1.00 17.23 C ATOM 5618 O PHE A 392 40.293 65.143 60.143 1.00 18.45 O ATOM 5619 CB PHE A 392 41.241 67.795 61.810 1.00 21.63 C ATOM 5620 CG PHE A 392 42.699 67.808 61.875 1.00 21.59 C ATOM 5621 CD1 PHE A 392 43.461 68.686 61.088 1.00 25.16 C ATOM 5622 CD2 PHE A 392 43.331 66.917 62.702 1.00 23.18 C ATOM 5623 CE1 PHE A 392 44.852 68.638 61.149 1.00 24.76 C ATOM 5624 CE2 PHE A 392 44.689 66.873 62.764 1.00 24.08 C ATOM 5625 CZ PHE A 392 45.453 67.729 61.998 1.00 24.73 C ATOM 5626 HA PHE A 392 41.186 68.219 59.699 1.00 0.00 H ATOM 5627 HB2 PHE A 392 40.871 68.758 62.161 1.00 0.00 H ATOM 5628 HB3 PHE A 392 40.873 67.005 62.465 1.00 0.00 H ATOM 5629 HD2 PHE A 392 42.740 66.237 63.316 1.00 0.00 H ATOM 5630 HE2 PHE A 392 45.177 66.156 63.424 1.00 0.00 H ATOM 5631 HZ PHE A 392 46.540 67.688 62.063 1.00 0.00 H ATOM 5632 HE1 PHE A 392 45.456 69.307 60.537 1.00 0.00 H ATOM 5633 HD1 PHE A 392 42.966 69.402 60.432 1.00 0.00 H ATOM 5634 H PHE A 392 38.917 68.128 61.404 1.00 0.00 H ATOM 5635 N GLY A 393 41.951 66.030 58.897 1.00 19.30 N ATOM 5636 CA GLY A 393 42.116 64.775 58.151 1.00 17.42 C ATOM 5637 C GLY A 393 41.314 64.706 56.843 1.00 16.49 C ATOM 5638 O GLY A 393 41.234 63.635 56.178 1.00 18.19 O ATOM 5639 HA3 GLY A 393 41.797 63.953 58.791 1.00 0.00 H ATOM 5640 HA2 GLY A 393 43.173 64.657 57.910 1.00 0.00 H ATOM 5641 H GLY A 393 42.572 66.839 58.694 1.00 0.00 H ATOM 5642 N GLY A 394 40.666 65.806 56.474 1.00 13.47 N ATOM 5643 CA GLY A 394 40.011 65.883 55.164 1.00 12.59 C ATOM 5644 C GLY A 394 38.731 65.087 55.129 1.00 10.60 C ATOM 5645 O GLY A 394 38.371 64.561 54.094 1.00 15.31 O ATOM 5646 HA3 GLY A 394 40.690 65.492 54.406 1.00 0.00 H ATOM 5647 HA2 GLY A 394 39.784 66.926 54.944 1.00 0.00 H ATOM 5648 H GLY A 394 40.623 66.620 57.120 1.00 0.00 H ATOM 5649 N THR A 395 38.017 65.043 56.233 1.00 9.92 N ATOM 5650 CA THR A 395 36.765 64.325 56.281 1.00 10.26 C ATOM 5651 C THR A 395 35.606 65.286 56.429 1.00 9.39 C ATOM 5652 O THR A 395 35.571 66.088 57.368 1.00 12.53 O ATOM 5653 CB THR A 395 36.786 63.309 57.428 1.00 10.94 C ATOM 5654 OG1 THR A 395 35.511 62.680 57.477 1.00 12.36 O ATOM 5655 CG2 THR A 395 37.132 63.936 58.802 1.00 12.49 C ATOM 5656 HA THR A 395 36.633 63.784 55.344 1.00 0.00 H ATOM 5657 HB THR A 395 37.578 62.587 57.229 1.00 0.00 H ATOM 5658 HG1 THR A 395 35.337 62.223 56.616 1.00 0.00 H ATOM 5659 HG23 THR A 395 38.111 64.413 58.746 1.00 0.00 H ATOM 5660 HG21 THR A 395 36.378 64.680 59.061 1.00 0.00 H ATOM 5661 HG22 THR A 395 37.150 63.155 59.562 1.00 0.00 H ATOM 5662 H THR A 395 38.359 65.533 57.084 1.00 0.00 H ATOM 5663 N ASN A 396 34.643 65.216 55.506 1.00 8.59 N ATOM 5664 CA ASN A 396 33.585 66.239 55.455 1.00 8.59 C ATOM 5665 C ASN A 396 32.228 65.610 55.630 1.00 7.51 C ATOM 5666 O ASN A 396 31.954 64.535 55.102 1.00 8.48 O ATOM 5667 CB ASN A 396 33.637 66.908 54.080 1.00 9.67 C ATOM 5668 CG ASN A 396 35.018 67.399 53.760 1.00 11.17 C ATOM 5669 OD1 ASN A 396 35.567 68.178 54.543 1.00 12.94 O ATOM 5670 ND2 ASN A 396 35.608 66.923 52.646 1.00 11.00 N ATOM 5671 HA ASN A 396 33.744 66.962 56.255 1.00 0.00 H ATOM 5672 HB2 ASN A 396 33.333 66.186 53.322 1.00 0.00 H ATOM 5673 HB3 ASN A 396 32.949 67.753 54.071 1.00 0.00 H ATOM 5674 HD22 ASN A 396 35.093 66.268 52.024 1.00 0.00 H ATOM 5675 HD21 ASN A 396 36.579 67.211 52.408 1.00 0.00 H ATOM 5676 H ASN A 396 34.640 64.435 54.820 1.00 0.00 H ATOM 5677 N ALA A 397 31.380 66.313 56.369 1.00 8.50 N ATOM 5678 CA ALA A 397 29.948 65.968 56.465 1.00 8.46 C ATOM 5679 C ALA A 397 29.132 67.237 56.317 1.00 8.42 C ATOM 5680 O ALA A 397 29.503 68.287 56.860 1.00 10.19 O ATOM 5681 CB ALA A 397 29.651 65.341 57.842 1.00 9.97 C ATOM 5682 HA ALA A 397 29.691 65.255 55.681 1.00 0.00 H ATOM 5683 HB1 ALA A 397 30.248 64.438 57.965 1.00 0.00 H ATOM 5684 HB2 ALA A 397 29.903 66.054 58.627 1.00 0.00 H ATOM 5685 HB3 ALA A 397 28.592 65.089 57.905 1.00 0.00 H ATOM 5686 H ALA A 397 31.736 67.134 56.898 1.00 0.00 H ATOM 5687 N THR A 398 28.011 67.142 55.613 1.00 8.20 N ATOM 5688 CA THR A 398 27.060 68.238 55.559 1.00 8.50 C ATOM 5689 C THR A 398 25.679 67.656 55.777 1.00 8.15 C ATOM 5690 O THR A 398 25.350 66.586 55.231 1.00 9.18 O ATOM 5691 CB THR A 398 27.091 68.964 54.172 1.00 9.68 C ATOM 5692 OG1 THR A 398 28.332 69.619 54.021 1.00 11.31 O ATOM 5693 CG2 THR A 398 26.004 70.000 54.061 1.00 10.52 C ATOM 5694 HA THR A 398 27.317 68.971 56.324 1.00 0.00 H ATOM 5695 HB THR A 398 26.940 68.210 53.400 1.00 0.00 H ATOM 5696 HG1 THR A 398 28.444 70.282 54.747 1.00 0.00 H ATOM 5697 HG23 THR A 398 25.032 69.519 54.174 1.00 0.00 H ATOM 5698 HG21 THR A 398 26.135 70.747 54.844 1.00 0.00 H ATOM 5699 HG22 THR A 398 26.061 70.481 53.085 1.00 0.00 H ATOM 5700 H THR A 398 27.810 66.266 55.090 1.00 0.00 H ATOM 5701 N LEU A 399 24.867 68.344 56.586 1.00 8.47 N ATOM 5702 CA LEU A 399 23.460 67.944 56.799 1.00 8.89 C ATOM 5703 C LEU A 399 22.528 69.038 56.301 1.00 8.10 C ATOM 5704 O LEU A 399 22.792 70.214 56.550 1.00 9.21 O ATOM 5705 CB LEU A 399 23.189 67.695 58.286 1.00 9.66 C ATOM 5706 CG LEU A 399 23.969 66.525 58.888 1.00 10.28 C ATOM 5707 CD1 LEU A 399 23.915 66.609 60.398 1.00 12.32 C ATOM 5708 CD2 LEU A 399 23.424 65.172 58.400 1.00 12.84 C ATOM 5709 HA LEU A 399 23.280 67.024 56.244 1.00 0.00 H ATOM 5710 HB2 LEU A 399 23.452 68.598 58.836 1.00 0.00 H ATOM 5711 HB3 LEU A 399 22.125 67.494 58.409 1.00 0.00 H ATOM 5712 HG LEU A 399 25.005 66.593 58.557 1.00 0.00 H ATOM 5713 HD21 LEU A 399 22.378 65.076 58.692 1.00 0.00 H ATOM 5714 HD22 LEU A 399 23.506 65.119 57.314 1.00 0.00 H ATOM 5715 HD23 LEU A 399 24.003 64.365 58.849 1.00 0.00 H ATOM 5716 HD11 LEU A 399 24.359 67.550 60.724 1.00 0.00 H ATOM 5717 HD12 LEU A 399 22.877 66.562 60.726 1.00 0.00 H ATOM 5718 HD13 LEU A 399 24.471 65.775 60.827 1.00 0.00 H ATOM 5719 H LEU A 399 25.235 69.183 57.079 1.00 0.00 H ATOM 5720 N VAL A 400 21.458 68.656 55.603 1.00 9.05 N ATOM 5721 CA VAL A 400 20.414 69.600 55.192 1.00 8.99 C ATOM 5722 C VAL A 400 19.121 69.150 55.850 1.00 10.27 C ATOM 5723 O VAL A 400 18.705 67.990 55.743 1.00 10.66 O ATOM 5724 CB VAL A 400 20.280 69.669 53.660 1.00 10.63 C ATOM 5725 CG1 VAL A 400 19.146 70.619 53.285 1.00 11.23 C ATOM 5726 CG2 VAL A 400 21.591 70.153 53.026 1.00 11.95 C ATOM 5727 HA VAL A 400 20.669 70.611 55.510 1.00 0.00 H ATOM 5728 HB VAL A 400 20.058 68.670 53.284 1.00 0.00 H ATOM 5729 HG11 VAL A 400 18.212 70.255 53.714 1.00 0.00 H ATOM 5730 HG12 VAL A 400 19.363 71.614 53.674 1.00 0.00 H ATOM 5731 HG13 VAL A 400 19.055 70.664 52.200 1.00 0.00 H ATOM 5732 HG21 VAL A 400 21.832 71.146 53.406 1.00 0.00 H ATOM 5733 HG22 VAL A 400 22.394 69.461 53.281 1.00 0.00 H ATOM 5734 HG23 VAL A 400 21.476 70.195 51.943 1.00 0.00 H ATOM 5735 H VAL A 400 21.361 67.654 55.341 1.00 0.00 H ATOM 5736 N MET A 401 18.500 70.096 56.538 1.00 10.03 N ATOM 5737 CA MET A 401 17.303 69.856 57.302 1.00 10.74 C ATOM 5738 C MET A 401 16.189 70.760 56.821 1.00 9.58 C ATOM 5739 O MET A 401 16.441 71.937 56.541 1.00 10.47 O ATOM 5740 CB MET A 401 17.574 70.106 58.772 1.00 12.62 C ATOM 5741 CG MET A 401 18.765 69.396 59.460 1.00 13.59 C ATOM 5742 SD MET A 401 19.667 70.356 60.720 1.00 14.55 S ATOM 5743 CE MET A 401 20.931 71.014 59.619 1.00 14.33 C ATOM 5744 HA MET A 401 16.997 68.819 57.166 1.00 0.00 H ATOM 5745 HB2 MET A 401 17.734 71.178 58.887 1.00 0.00 H ATOM 5746 HB3 MET A 401 16.675 69.814 59.314 1.00 0.00 H ATOM 5747 HG2 MET A 401 19.477 69.116 58.684 1.00 0.00 H ATOM 5748 HG3 MET A 401 18.381 68.496 59.941 1.00 0.00 H ATOM 5749 HE1 MET A 401 21.487 70.190 59.172 1.00 0.00 H ATOM 5750 HE2 MET A 401 20.456 71.602 58.833 1.00 0.00 H ATOM 5751 HE3 MET A 401 21.612 71.647 60.187 1.00 0.00 H ATOM 5752 H MET A 401 18.895 71.058 56.526 1.00 0.00 H ATOM 5753 N ARG A 402 14.973 70.224 56.730 1.00 9.97 N ATOM 5754 CA ARG A 402 13.897 71.003 56.152 1.00 10.68 C ATOM 5755 C ARG A 402 12.606 70.787 56.888 1.00 11.65 C ATOM 5756 O ARG A 402 12.296 69.659 57.299 1.00 11.66 O ATOM 5757 CB ARG A 402 13.686 70.620 54.672 1.00 11.59 C ATOM 5758 CG ARG A 402 12.634 71.466 53.973 1.00 13.11 C ATOM 5759 CD ARG A 402 12.715 71.282 52.464 1.00 14.46 C ATOM 5760 NE ARG A 402 12.314 69.953 52.040 1.00 13.28 N ATOM 5761 CZ ARG A 402 12.345 69.586 50.758 1.00 14.64 C ATOM 5762 NH1 ARG A 402 12.804 70.463 49.850 1.00 16.73 N ATOM 5763 NH2 ARG A 402 11.949 68.363 50.385 1.00 17.85 N ATOM 5764 HA ARG A 402 14.183 72.052 56.231 1.00 0.00 H ATOM 5765 HB2 ARG A 402 14.633 70.741 54.145 1.00 0.00 H ATOM 5766 HB3 ARG A 402 13.377 69.576 54.626 1.00 0.00 H ATOM 5767 HG2 ARG A 402 11.645 71.166 54.318 1.00 0.00 H ATOM 5768 HG3 ARG A 402 12.799 72.516 54.216 1.00 0.00 H ATOM 5769 HD2 ARG A 402 13.743 71.455 52.146 1.00 0.00 H ATOM 5770 HD3 ARG A 402 12.061 72.013 51.988 1.00 0.00 H ATOM 5771 HE ARG A 402 11.994 69.269 52.755 1.00 0.00 H ATOM 5772 HH12 ARG A 402 12.838 70.200 48.844 1.00 0.00 H ATOM 5773 HH11 ARG A 402 13.125 71.405 50.153 1.00 0.00 H ATOM 5774 HH22 ARG A 402 11.979 68.090 49.382 1.00 0.00 H ATOM 5775 HH21 ARG A 402 11.612 67.685 51.098 1.00 0.00 H ATOM 5776 H ARG A 402 14.798 69.257 57.070 1.00 0.00 H ATOM 5777 N LYS A 403 11.822 71.846 57.057 1.00 12.52 N ATOM 5778 CA LYS A 403 10.491 71.649 57.643 1.00 13.98 C ATOM 5779 C LYS A 403 9.657 70.654 56.858 1.00 15.21 C ATOM 5780 O LYS A 403 9.782 70.553 55.617 1.00 16.62 O ATOM 5781 CB LYS A 403 9.735 72.968 57.720 1.00 17.02 C ATOM 5782 CG LYS A 403 10.273 73.854 58.818 1.00 19.43 C ATOM 5783 CD LYS A 403 9.486 75.143 58.822 1.00 20.89 C ATOM 5784 CE LYS A 403 9.881 75.919 60.044 1.00 20.49 C ATOM 5785 NZ LYS A 403 9.404 75.297 61.352 1.00 20.55 N ATOM 5786 HA LYS A 403 10.652 71.250 58.645 1.00 0.00 H ATOM 5787 HB2 LYS A 403 9.832 73.488 56.767 1.00 0.00 H ATOM 5788 HB3 LYS A 403 8.683 72.762 57.915 1.00 0.00 H ATOM 5789 HG2 LYS A 403 10.165 73.354 59.781 1.00 0.00 H ATOM 5790 HG3 LYS A 403 11.327 74.067 58.636 1.00 0.00 H ATOM 5791 HD2 LYS A 403 9.715 75.720 57.926 1.00 0.00 H ATOM 5792 HD3 LYS A 403 8.418 74.926 58.850 1.00 0.00 H ATOM 5793 HE2 LYS A 403 9.459 76.921 59.966 1.00 0.00 H ATOM 5794 HE3 LYS A 403 10.969 75.986 60.072 1.00 0.00 H ATOM 5795 HZ1 LYS A 403 8.366 75.236 61.347 1.00 0.00 H ATOM 5796 HZ2 LYS A 403 9.808 74.343 61.448 1.00 0.00 H ATOM 5797 HZ3 LYS A 403 9.714 75.888 62.149 1.00 0.00 H ATOM 5798 H LYS A 403 12.145 72.795 56.780 1.00 0.00 H ATOM 5799 N LEU A 404 8.800 69.918 57.565 1.00 16.80 N ATOM 5800 CA LEU A 404 7.736 69.134 56.896 1.00 21.58 C ATOM 5801 C LEU A 404 6.529 69.989 56.549 1.00 25.00 C ATOM 5802 O LEU A 404 6.367 71.100 57.068 1.00 28.88 O ATOM 5803 CB LEU A 404 7.223 68.052 57.803 1.00 24.04 C ATOM 5804 CG LEU A 404 7.923 66.731 57.880 1.00 23.54 C ATOM 5805 CD1 LEU A 404 7.126 65.847 58.821 1.00 24.00 C ATOM 5806 CD2 LEU A 404 8.147 65.984 56.527 1.00 25.03 C ATOM 5807 HA LEU A 404 8.192 68.728 55.993 1.00 0.00 H ATOM 5808 HB2 LEU A 404 7.221 68.464 58.812 1.00 0.00 H ATOM 5809 HB3 LEU A 404 6.198 67.845 57.495 1.00 0.00 H ATOM 5810 HG LEU A 404 8.932 66.943 58.234 1.00 0.00 H ATOM 5811 HD21 LEU A 404 7.183 65.785 56.059 1.00 0.00 H ATOM 5812 HD22 LEU A 404 8.752 66.605 55.866 1.00 0.00 H ATOM 5813 HD23 LEU A 404 8.662 65.042 56.714 1.00 0.00 H ATOM 5814 HD11 LEU A 404 7.082 66.313 59.805 1.00 0.00 H ATOM 5815 HD12 LEU A 404 6.116 65.721 58.431 1.00 0.00 H ATOM 5816 HD13 LEU A 404 7.610 64.874 58.900 1.00 0.00 H ATOM 5817 H LEU A 404 8.879 69.894 58.602 1.00 0.00 H TER 5818 LEU A 404 ATOM 5819 N MET B 1 18.648 44.353 45.802 1.00 30.90 N ATOM 5820 CA MET B 1 19.592 45.493 46.107 1.00 29.48 C ATOM 5821 C MET B 1 21.041 45.139 45.730 1.00 24.14 C ATOM 5822 O MET B 1 21.337 43.986 45.398 1.00 26.54 O ATOM 5823 CB MET B 1 19.420 46.032 47.553 1.00 32.54 C ATOM 5824 CG MET B 1 20.500 45.695 48.602 1.00 32.11 C ATOM 5825 SD MET B 1 19.994 46.010 50.317 1.00 35.19 S ATOM 5826 CE MET B 1 20.165 44.339 50.959 1.00 34.76 C ATOM 5827 HA MET B 1 19.320 46.333 45.468 1.00 0.00 H ATOM 5828 HB2 MET B 1 19.365 47.119 47.486 1.00 0.00 H ATOM 5829 HB3 MET B 1 18.474 45.644 47.930 1.00 0.00 H ATOM 5830 HG2 MET B 1 21.383 46.297 48.390 1.00 0.00 H ATOM 5831 HG3 MET B 1 20.751 44.638 48.508 1.00 0.00 H ATOM 5832 HE1 MET B 1 19.506 43.670 50.407 1.00 0.00 H ATOM 5833 HE2 MET B 1 21.198 44.011 50.843 1.00 0.00 H ATOM 5834 HE3 MET B 1 19.895 44.327 52.015 1.00 0.00 H ATOM 5835 HN3 MET B 1 18.935 43.513 46.344 1.00 0.00 H ATOM 5836 HN2 MET B 1 18.682 44.139 44.785 1.00 0.00 H ATOM 5837 HN1 MET B 1 17.680 44.625 46.068 1.00 0.00 H ATOM 5838 N LYS B 2 21.920 46.139 45.729 1.00 20.19 N ATOM 5839 CA LYS B 2 23.314 45.946 45.292 1.00 15.29 C ATOM 5840 C LYS B 2 24.055 45.002 46.222 1.00 12.88 C ATOM 5841 O LYS B 2 23.853 45.006 47.440 1.00 14.24 O ATOM 5842 CB LYS B 2 24.065 47.281 45.192 1.00 16.59 C ATOM 5843 CG LYS B 2 23.394 48.211 44.182 1.00 20.73 C ATOM 5844 CD LYS B 2 23.882 49.597 44.159 1.00 21.12 C ATOM 5845 CE LYS B 2 22.932 50.457 43.328 1.00 23.14 C ATOM 5846 NZ LYS B 2 22.423 49.711 42.168 1.00 23.37 N ATOM 5847 HA LYS B 2 23.277 45.500 44.298 1.00 0.00 H ATOM 5848 HB2 LYS B 2 24.071 47.761 46.170 1.00 0.00 H ATOM 5849 HB3 LYS B 2 25.091 47.091 44.876 1.00 0.00 H ATOM 5850 HG2 LYS B 2 23.543 47.788 43.189 1.00 0.00 H ATOM 5851 HG3 LYS B 2 22.328 48.236 44.408 1.00 0.00 H ATOM 5852 HD2 LYS B 2 23.926 49.984 45.177 1.00 0.00 H ATOM 5853 HD3 LYS B 2 24.878 49.625 43.717 1.00 0.00 H ATOM 5854 HE2 LYS B 2 23.465 51.341 42.978 1.00 0.00 H ATOM 5855 HE3 LYS B 2 22.092 50.764 43.951 1.00 0.00 H ATOM 5856 HZ1 LYS B 2 23.221 49.419 41.568 1.00 0.00 H ATOM 5857 HZ2 LYS B 2 21.909 48.869 42.497 1.00 0.00 H ATOM 5858 HZ3 LYS B 2 21.780 50.319 41.621 1.00 0.00 H ATOM 5859 H LYS B 2 21.615 47.082 46.045 1.00 0.00 H ATOM 5860 N ARG B 3 24.879 44.170 45.609 1.00 11.57 N ATOM 5861 CA ARG B 3 25.629 43.140 46.320 1.00 11.45 C ATOM 5862 C ARG B 3 27.058 43.582 46.507 1.00 9.99 C ATOM 5863 O ARG B 3 27.612 44.288 45.653 1.00 10.89 O ATOM 5864 CB ARG B 3 25.545 41.845 45.509 1.00 11.97 C ATOM 5865 CG ARG B 3 24.106 41.305 45.453 1.00 13.04 C ATOM 5866 CD ARG B 3 23.881 40.234 44.366 1.00 13.74 C ATOM 5867 NE ARG B 3 24.660 39.041 44.634 1.00 13.87 N ATOM 5868 CZ ARG B 3 24.811 38.042 43.766 1.00 14.71 C ATOM 5869 NH1 ARG B 3 24.242 38.107 42.550 1.00 17.43 N ATOM 5870 NH2 ARG B 3 25.538 36.996 44.115 1.00 16.57 N ATOM 5871 HA ARG B 3 25.208 42.970 47.311 1.00 0.00 H ATOM 5872 HB2 ARG B 3 25.890 42.040 44.494 1.00 0.00 H ATOM 5873 HB3 ARG B 3 26.187 41.095 45.972 1.00 0.00 H ATOM 5874 HG2 ARG B 3 23.866 40.867 46.422 1.00 0.00 H ATOM 5875 HG3 ARG B 3 23.433 42.140 45.257 1.00 0.00 H ATOM 5876 HD2 ARG B 3 24.176 40.641 43.399 1.00 0.00 H ATOM 5877 HD3 ARG B 3 22.824 39.970 44.340 1.00 0.00 H ATOM 5878 HE ARG B 3 25.129 38.960 45.559 1.00 0.00 H ATOM 5879 HH12 ARG B 3 24.363 37.324 41.877 1.00 0.00 H ATOM 5880 HH11 ARG B 3 23.680 38.940 42.283 1.00 0.00 H ATOM 5881 HH22 ARG B 3 25.667 36.207 43.450 1.00 0.00 H ATOM 5882 HH21 ARG B 3 25.982 36.961 45.055 1.00 0.00 H ATOM 5883 H ARG B 3 24.997 44.253 44.579 1.00 0.00 H ATOM 5884 N ALA B 4 27.639 43.154 47.634 1.00 9.79 N ATOM 5885 CA ALA B 4 29.008 43.548 48.003 1.00 9.12 C ATOM 5886 C ALA B 4 29.905 42.321 48.051 1.00 8.74 C ATOM 5887 O ALA B 4 29.523 41.295 48.657 1.00 10.49 O ATOM 5888 CB ALA B 4 28.985 44.232 49.383 1.00 10.96 C ATOM 5889 HA ALA B 4 29.399 44.242 47.259 1.00 0.00 H ATOM 5890 HB1 ALA B 4 28.349 45.116 49.338 1.00 0.00 H ATOM 5891 HB2 ALA B 4 28.592 43.537 50.125 1.00 0.00 H ATOM 5892 HB3 ALA B 4 29.998 44.525 49.659 1.00 0.00 H ATOM 5893 H ALA B 4 27.107 42.524 48.268 1.00 0.00 H ATOM 5894 N VAL B 5 31.085 42.430 47.433 1.00 8.08 N ATOM 5895 CA VAL B 5 32.060 41.362 47.434 1.00 8.64 C ATOM 5896 C VAL B 5 33.392 41.865 47.949 1.00 8.14 C ATOM 5897 O VAL B 5 33.641 43.081 47.966 1.00 10.17 O ATOM 5898 CB VAL B 5 32.212 40.751 46.007 1.00 9.90 C ATOM 5899 CG1 VAL B 5 30.928 40.058 45.589 1.00 11.74 C ATOM 5900 CG2 VAL B 5 32.572 41.827 44.978 1.00 10.92 C ATOM 5901 HA VAL B 5 31.709 40.575 48.101 1.00 0.00 H ATOM 5902 HB VAL B 5 33.022 40.022 46.044 1.00 0.00 H ATOM 5903 HG11 VAL B 5 30.701 39.260 46.295 1.00 0.00 H ATOM 5904 HG12 VAL B 5 30.112 40.781 45.581 1.00 0.00 H ATOM 5905 HG13 VAL B 5 31.052 39.637 44.591 1.00 0.00 H ATOM 5906 HG21 VAL B 5 31.785 42.581 44.952 1.00 0.00 H ATOM 5907 HG22 VAL B 5 33.516 42.295 45.258 1.00 0.00 H ATOM 5908 HG23 VAL B 5 32.671 41.368 43.994 1.00 0.00 H ATOM 5909 H VAL B 5 31.310 43.314 46.934 1.00 0.00 H ATOM 5910 N ILE B 6 34.250 40.935 48.360 1.00 8.29 N ATOM 5911 CA ILE B 6 35.607 41.265 48.787 1.00 9.17 C ATOM 5912 C ILE B 6 36.553 40.895 47.667 1.00 8.13 C ATOM 5913 O ILE B 6 36.598 39.718 47.256 1.00 9.43 O ATOM 5914 CB ILE B 6 36.008 40.542 50.094 1.00 9.53 C ATOM 5915 CG1 ILE B 6 34.982 40.861 51.181 1.00 14.40 C ATOM 5916 CG2 ILE B 6 37.497 40.852 50.422 1.00 9.12 C ATOM 5917 CD1 ILE B 6 35.368 40.779 52.630 1.00 12.67 C ATOM 5918 HA ILE B 6 35.657 42.333 49.001 1.00 0.00 H ATOM 5919 HB ILE B 6 35.975 39.457 49.999 1.00 0.00 H ATOM 5920 HG12 ILE B 6 34.643 41.882 51.003 1.00 0.00 H ATOM 5921 HG13 ILE B 6 34.149 40.173 51.038 1.00 0.00 H ATOM 5922 HD11 ILE B 6 35.690 39.764 52.862 1.00 0.00 H ATOM 5923 HD12 ILE B 6 36.184 41.474 52.827 1.00 0.00 H ATOM 5924 HD13 ILE B 6 34.509 41.040 53.249 1.00 0.00 H ATOM 5925 HG21 ILE B 6 38.128 40.503 49.605 1.00 0.00 H ATOM 5926 HG22 ILE B 6 37.624 41.927 50.547 1.00 0.00 H ATOM 5927 HG23 ILE B 6 37.779 40.342 51.343 1.00 0.00 H ATOM 5928 H ILE B 6 33.945 39.941 48.378 1.00 0.00 H ATOM 5929 N THR B 7 37.344 41.869 47.221 1.00 7.87 N ATOM 5930 CA THR B 7 38.163 41.673 46.034 1.00 8.45 C ATOM 5931 C THR B 7 39.645 41.868 46.310 1.00 9.02 C ATOM 5932 O THR B 7 40.470 41.780 45.397 1.00 10.70 O ATOM 5933 CB THR B 7 37.744 42.612 44.916 1.00 10.26 C ATOM 5934 OG1 THR B 7 37.848 43.946 45.408 1.00 11.09 O ATOM 5935 CG2 THR B 7 36.328 42.337 44.466 1.00 12.16 C ATOM 5936 HA THR B 7 38.003 40.639 45.728 1.00 0.00 H ATOM 5937 HB THR B 7 38.392 42.463 44.053 1.00 0.00 H ATOM 5938 HG1 THR B 7 37.580 44.581 44.697 1.00 0.00 H ATOM 5939 HG23 THR B 7 36.259 41.316 44.092 1.00 0.00 H ATOM 5940 HG21 THR B 7 35.649 42.463 45.309 1.00 0.00 H ATOM 5941 HG22 THR B 7 36.058 43.035 43.673 1.00 0.00 H ATOM 5942 H THR B 7 37.377 42.778 47.725 1.00 0.00 H ATOM 5943 N GLY B 8 40.002 42.091 47.569 1.00 8.62 N ATOM 5944 CA GLY B 8 41.415 42.217 47.915 1.00 8.59 C ATOM 5945 C GLY B 8 41.535 42.239 49.418 1.00 8.06 C ATOM 5946 O GLY B 8 40.611 42.673 50.129 1.00 8.81 O ATOM 5947 HA3 GLY B 8 41.815 43.142 47.500 1.00 0.00 H ATOM 5948 HA2 GLY B 8 41.970 41.369 47.513 1.00 0.00 H ATOM 5949 H GLY B 8 39.276 42.176 48.309 1.00 0.00 H ATOM 5950 N LEU B 9 42.693 41.814 49.920 1.00 8.75 N ATOM 5951 CA LEU B 9 42.895 41.863 51.353 1.00 9.02 C ATOM 5952 C LEU B 9 44.359 42.107 51.680 1.00 8.15 C ATOM 5953 O LEU B 9 45.238 41.930 50.820 1.00 8.70 O ATOM 5954 CB LEU B 9 42.317 40.623 52.008 1.00 12.24 C ATOM 5955 CG LEU B 9 42.874 39.305 51.569 1.00 11.33 C ATOM 5956 CD1 LEU B 9 44.234 38.982 52.250 1.00 14.70 C ATOM 5957 CD2 LEU B 9 41.912 38.173 51.850 1.00 14.13 C ATOM 5958 HA LEU B 9 42.352 42.710 51.773 1.00 0.00 H ATOM 5959 HB2 LEU B 9 42.482 40.710 53.082 1.00 0.00 H ATOM 5960 HB3 LEU B 9 41.246 40.612 51.806 1.00 0.00 H ATOM 5961 HG LEU B 9 43.031 39.394 50.494 1.00 0.00 H ATOM 5962 HD21 LEU B 9 41.713 38.124 52.921 1.00 0.00 H ATOM 5963 HD22 LEU B 9 40.979 38.349 51.314 1.00 0.00 H ATOM 5964 HD23 LEU B 9 42.352 37.233 51.517 1.00 0.00 H ATOM 5965 HD11 LEU B 9 44.958 39.756 51.997 1.00 0.00 H ATOM 5966 HD12 LEU B 9 44.099 38.948 53.331 1.00 0.00 H ATOM 5967 HD13 LEU B 9 44.595 38.016 51.898 1.00 0.00 H ATOM 5968 H LEU B 9 43.440 41.453 49.293 1.00 0.00 H ATOM 5969 N GLY B 10 44.596 42.608 52.892 1.00 7.75 N ATOM 5970 CA GLY B 10 45.936 42.908 53.331 1.00 8.82 C ATOM 5971 C GLY B 10 45.947 42.823 54.836 1.00 7.16 C ATOM 5972 O GLY B 10 44.941 43.099 55.491 1.00 7.81 O ATOM 5973 HA3 GLY B 10 46.217 43.912 53.012 1.00 0.00 H ATOM 5974 HA2 GLY B 10 46.636 42.186 52.912 1.00 0.00 H ATOM 5975 H GLY B 10 43.798 42.786 53.534 1.00 0.00 H ATOM 5976 N ILE B 11 47.097 42.452 55.409 1.00 8.16 N ATOM 5977 CA ILE B 11 47.124 42.138 56.831 1.00 7.88 C ATOM 5978 C ILE B 11 48.527 42.203 57.389 1.00 8.64 C ATOM 5979 O ILE B 11 49.496 41.816 56.740 1.00 9.43 O ATOM 5980 CB ILE B 11 46.518 40.729 57.100 1.00 8.55 C ATOM 5981 CG1 ILE B 11 46.425 40.436 58.605 1.00 9.48 C ATOM 5982 CG2 ILE B 11 47.273 39.636 56.314 1.00 10.20 C ATOM 5983 CD1 ILE B 11 45.452 39.307 58.914 1.00 9.13 C ATOM 5984 HA ILE B 11 46.518 42.890 57.336 1.00 0.00 H ATOM 5985 HB ILE B 11 45.494 40.722 56.727 1.00 0.00 H ATOM 5986 HG12 ILE B 11 47.413 40.157 58.970 1.00 0.00 H ATOM 5987 HG13 ILE B 11 46.091 41.338 59.118 1.00 0.00 H ATOM 5988 HD11 ILE B 11 44.458 39.579 58.560 1.00 0.00 H ATOM 5989 HD12 ILE B 11 45.782 38.397 58.412 1.00 0.00 H ATOM 5990 HD13 ILE B 11 45.423 39.139 59.991 1.00 0.00 H ATOM 5991 HG21 ILE B 11 47.205 39.846 55.246 1.00 0.00 H ATOM 5992 HG22 ILE B 11 48.320 39.629 56.619 1.00 0.00 H ATOM 5993 HG23 ILE B 11 46.825 38.665 56.524 1.00 0.00 H ATOM 5994 H ILE B 11 47.967 42.388 54.843 1.00 0.00 H ATOM 5995 N VAL B 12 48.624 42.763 58.598 1.00 8.61 N ATOM 5996 CA VAL B 12 49.854 42.762 59.379 1.00 9.35 C ATOM 5997 C VAL B 12 49.431 42.265 60.754 1.00 8.65 C ATOM 5998 O VAL B 12 48.675 42.940 61.469 1.00 9.60 O ATOM 5999 CB VAL B 12 50.488 44.169 59.450 1.00 11.72 C ATOM 6000 CG1 VAL B 12 51.685 44.133 60.361 1.00 13.24 C ATOM 6001 CG2 VAL B 12 50.936 44.616 58.067 1.00 13.27 C ATOM 6002 HA VAL B 12 50.622 42.131 58.933 1.00 0.00 H ATOM 6003 HB VAL B 12 49.745 44.869 59.832 1.00 0.00 H ATOM 6004 HG11 VAL B 12 51.372 43.824 61.358 1.00 0.00 H ATOM 6005 HG12 VAL B 12 52.415 43.424 59.972 1.00 0.00 H ATOM 6006 HG13 VAL B 12 52.132 45.126 60.411 1.00 0.00 H ATOM 6007 HG21 VAL B 12 51.673 43.912 57.680 1.00 0.00 H ATOM 6008 HG22 VAL B 12 50.075 44.646 57.400 1.00 0.00 H ATOM 6009 HG23 VAL B 12 51.381 45.609 58.134 1.00 0.00 H ATOM 6010 H VAL B 12 47.782 43.221 59.001 1.00 0.00 H ATOM 6011 N SER B 13 49.863 41.059 61.108 1.00 9.75 N ATOM 6012 CA SER B 13 49.323 40.378 62.295 1.00 9.42 C ATOM 6013 C SER B 13 50.406 39.692 63.107 1.00 8.71 C ATOM 6014 O SER B 13 51.530 39.485 62.615 1.00 9.52 O ATOM 6015 CB SER B 13 48.293 39.348 61.834 1.00 12.22 C ATOM 6016 OG SER B 13 48.029 38.183 62.569 1.00 10.24 O ATOM 6017 HA SER B 13 48.864 41.126 62.942 1.00 0.00 H ATOM 6018 HB2 SER B 13 48.611 39.020 60.844 1.00 0.00 H ATOM 6019 HB3 SER B 13 47.345 39.879 61.752 1.00 0.00 H ATOM 6020 HG SER B 13 47.335 37.651 62.105 1.00 0.00 H ATOM 6021 H SER B 13 50.594 40.589 60.537 1.00 0.00 H ATOM 6022 N SER B 14 50.059 39.295 64.318 1.00 8.50 N ATOM 6023 CA SER B 14 50.991 38.520 65.114 1.00 8.69 C ATOM 6024 C SER B 14 51.422 37.225 64.440 1.00 9.39 C ATOM 6025 O SER B 14 52.467 36.663 64.810 1.00 10.61 O ATOM 6026 CB SER B 14 50.400 38.190 66.462 1.00 9.98 C ATOM 6027 OG SER B 14 49.248 37.383 66.319 1.00 10.79 O ATOM 6028 HA SER B 14 51.874 39.149 65.229 1.00 0.00 H ATOM 6029 HB2 SER B 14 50.128 39.115 66.970 1.00 0.00 H ATOM 6030 HB3 SER B 14 51.141 37.655 67.056 1.00 0.00 H ATOM 6031 HG SER B 14 48.877 37.178 67.214 1.00 0.00 H ATOM 6032 H SER B 14 49.122 39.537 64.699 1.00 0.00 H ATOM 6033 N ILE B 15 50.612 36.718 63.502 1.00 8.77 N ATOM 6034 CA ILE B 15 50.925 35.452 62.832 1.00 8.76 C ATOM 6035 C ILE B 15 51.384 35.628 61.375 1.00 8.76 C ATOM 6036 O ILE B 15 51.494 34.651 60.628 1.00 10.71 O ATOM 6037 CB ILE B 15 49.761 34.410 62.961 1.00 9.12 C ATOM 6038 CG1 ILE B 15 48.496 34.905 62.283 1.00 10.04 C ATOM 6039 CG2 ILE B 15 49.558 33.991 64.427 1.00 10.25 C ATOM 6040 CD1 ILE B 15 47.502 33.737 62.009 1.00 10.80 C ATOM 6041 HA ILE B 15 51.783 35.043 63.365 1.00 0.00 H ATOM 6042 HB ILE B 15 50.042 33.503 62.425 1.00 0.00 H ATOM 6043 HG12 ILE B 15 48.012 35.639 62.927 1.00 0.00 H ATOM 6044 HG13 ILE B 15 48.762 35.374 61.336 1.00 0.00 H ATOM 6045 HD11 ILE B 15 47.977 33.002 61.360 1.00 0.00 H ATOM 6046 HD12 ILE B 15 47.227 33.266 62.953 1.00 0.00 H ATOM 6047 HD13 ILE B 15 46.608 34.129 61.523 1.00 0.00 H ATOM 6048 HG21 ILE B 15 50.476 33.540 64.805 1.00 0.00 H ATOM 6049 HG22 ILE B 15 49.310 34.869 65.024 1.00 0.00 H ATOM 6050 HG23 ILE B 15 48.745 33.268 64.488 1.00 0.00 H ATOM 6051 H ILE B 15 49.745 37.232 63.244 1.00 0.00 H ATOM 6052 N GLY B 16 51.679 36.865 60.962 1.00 8.83 N ATOM 6053 CA GLY B 16 52.280 37.049 59.643 1.00 9.70 C ATOM 6054 C GLY B 16 52.092 38.450 59.143 1.00 8.81 C ATOM 6055 O GLY B 16 51.106 39.122 59.484 1.00 9.61 O ATOM 6056 HA3 GLY B 16 51.814 36.357 58.942 1.00 0.00 H ATOM 6057 HA2 GLY B 16 53.347 36.836 59.707 1.00 0.00 H ATOM 6058 H GLY B 16 51.483 37.685 61.571 1.00 0.00 H ATOM 6059 N ASN B 17 53.021 38.881 58.300 1.00 9.56 N ATOM 6060 CA ASN B 17 53.067 40.269 57.814 1.00 9.94 C ATOM 6061 C ASN B 17 52.437 40.439 56.442 1.00 10.10 C ATOM 6062 O ASN B 17 52.498 41.525 55.876 1.00 10.92 O ATOM 6063 CB ASN B 17 54.519 40.720 57.776 1.00 10.47 C ATOM 6064 CG ASN B 17 55.111 40.773 59.154 1.00 11.76 C ATOM 6065 OD1 ASN B 17 54.422 41.147 60.108 1.00 13.51 O ATOM 6066 ND2 ASN B 17 56.393 40.419 59.275 1.00 13.93 N ATOM 6067 HA ASN B 17 52.483 40.883 58.500 1.00 0.00 H ATOM 6068 HB2 ASN B 17 55.093 40.019 57.170 1.00 0.00 H ATOM 6069 HB3 ASN B 17 54.571 41.713 57.329 1.00 0.00 H ATOM 6070 HD22 ASN B 17 56.929 40.111 58.438 1.00 0.00 H ATOM 6071 HD21 ASN B 17 56.856 40.451 60.206 1.00 0.00 H ATOM 6072 H ASN B 17 53.745 38.212 57.970 1.00 0.00 H ATOM 6073 N ASN B 18 51.832 39.370 55.920 1.00 10.04 N ATOM 6074 CA ASN B 18 51.114 39.383 54.654 1.00 9.75 C ATOM 6075 C ASN B 18 50.292 38.114 54.577 1.00 9.41 C ATOM 6076 O ASN B 18 50.388 37.260 55.471 1.00 9.56 O ATOM 6077 CB ASN B 18 52.070 39.531 53.467 1.00 11.11 C ATOM 6078 CG ASN B 18 53.113 38.417 53.435 1.00 12.04 C ATOM 6079 OD1 ASN B 18 52.768 37.239 53.584 1.00 12.74 O ATOM 6080 ND2 ASN B 18 54.389 38.766 53.277 1.00 15.75 N ATOM 6081 HA ASN B 18 50.452 40.248 54.604 1.00 0.00 H ATOM 6082 HB2 ASN B 18 51.493 39.500 52.543 1.00 0.00 H ATOM 6083 HB3 ASN B 18 52.581 40.491 53.543 1.00 0.00 H ATOM 6084 HD22 ASN B 18 54.643 39.767 53.154 1.00 0.00 H ATOM 6085 HD21 ASN B 18 55.131 38.037 53.276 1.00 0.00 H ATOM 6086 H ASN B 18 51.876 38.476 56.449 1.00 0.00 H ATOM 6087 N GLN B 19 49.464 37.979 53.538 1.00 10.01 N ATOM 6088 CA GLN B 19 48.559 36.851 53.534 1.00 9.40 C ATOM 6089 C GLN B 19 49.256 35.536 53.352 1.00 9.88 C ATOM 6090 O GLN B 19 48.735 34.512 53.787 1.00 11.14 O ATOM 6091 CB GLN B 19 47.432 37.005 52.518 1.00 10.77 C ATOM 6092 CG GLN B 19 47.858 37.037 51.075 1.00 11.93 C ATOM 6093 CD GLN B 19 46.667 36.729 50.187 1.00 12.06 C ATOM 6094 OE1 GLN B 19 46.206 35.583 50.144 1.00 14.10 O ATOM 6095 NE2 GLN B 19 46.173 37.732 49.458 1.00 12.89 N ATOM 6096 HA GLN B 19 48.113 36.846 54.529 1.00 0.00 H ATOM 6097 HB2 GLN B 19 46.747 36.167 52.647 1.00 0.00 H ATOM 6098 HB3 GLN B 19 46.910 37.937 52.735 1.00 0.00 H ATOM 6099 HG2 GLN B 19 48.246 38.026 50.833 1.00 0.00 H ATOM 6100 HG3 GLN B 19 48.637 36.292 50.910 1.00 0.00 H ATOM 6101 HE22 GLN B 19 46.593 38.681 49.527 1.00 0.00 H ATOM 6102 HE21 GLN B 19 45.368 37.565 48.821 1.00 0.00 H ATOM 6103 H GLN B 19 49.470 38.664 52.756 1.00 0.00 H ATOM 6104 N GLN B 20 50.439 35.531 52.721 1.00 10.70 N ATOM 6105 CA GLN B 20 51.170 34.264 52.541 1.00 11.28 C ATOM 6106 C GLN B 20 51.650 33.753 53.911 1.00 10.69 C ATOM 6107 O GLN B 20 51.509 32.558 54.234 1.00 11.60 O ATOM 6108 CB GLN B 20 52.347 34.447 51.581 1.00 14.45 C ATOM 6109 CG GLN B 20 51.939 34.618 50.120 1.00 18.53 C ATOM 6110 CD GLN B 20 51.343 35.984 49.771 1.00 21.37 C ATOM 6111 OE1 GLN B 20 50.575 36.094 48.801 1.00 26.58 O ATOM 6112 NE2 GLN B 20 51.697 37.022 50.529 1.00 18.79 N ATOM 6113 HA GLN B 20 50.501 33.524 52.101 1.00 0.00 H ATOM 6114 HB2 GLN B 20 52.904 35.332 51.887 1.00 0.00 H ATOM 6115 HB3 GLN B 20 52.990 33.570 51.657 1.00 0.00 H ATOM 6116 HG2 GLN B 20 52.824 34.467 49.502 1.00 0.00 H ATOM 6117 HG3 GLN B 20 51.197 33.855 49.884 1.00 0.00 H ATOM 6118 HE22 GLN B 20 52.343 36.883 51.332 1.00 0.00 H ATOM 6119 HE21 GLN B 20 51.327 37.971 50.317 1.00 0.00 H ATOM 6120 H GLN B 20 50.840 36.420 52.359 1.00 0.00 H ATOM 6121 N GLU B 21 52.229 34.649 54.716 1.00 9.93 N ATOM 6122 CA GLU B 21 52.713 34.267 56.029 1.00 10.92 C ATOM 6123 C GLU B 21 51.549 33.880 56.924 1.00 9.74 C ATOM 6124 O GLU B 21 51.628 32.889 57.672 1.00 10.20 O ATOM 6125 CB GLU B 21 53.549 35.379 56.648 1.00 11.63 C ATOM 6126 CG GLU B 21 54.808 35.700 55.898 1.00 13.03 C ATOM 6127 CD GLU B 21 55.648 36.783 56.568 1.00 14.60 C ATOM 6128 OE1 GLU B 21 55.257 37.328 57.618 1.00 15.60 O ATOM 6129 OE2 GLU B 21 56.723 37.088 56.008 1.00 18.28 O ATOM 6130 HA GLU B 21 53.362 33.398 55.922 1.00 0.00 H ATOM 6131 HB2 GLU B 21 52.938 36.281 56.691 1.00 0.00 H ATOM 6132 HB3 GLU B 21 53.822 35.078 57.659 1.00 0.00 H ATOM 6133 HG2 GLU B 21 55.408 34.793 55.823 1.00 0.00 H ATOM 6134 HG3 GLU B 21 54.539 36.039 54.898 1.00 0.00 H ATOM 6135 H GLU B 21 52.334 35.633 54.397 1.00 0.00 H ATOM 6136 N VAL B 22 50.451 34.633 56.856 1.00 9.20 N ATOM 6137 CA VAL B 22 49.292 34.300 57.657 1.00 9.02 C ATOM 6138 C VAL B 22 48.736 32.906 57.287 1.00 9.42 C ATOM 6139 O VAL B 22 48.393 32.117 58.170 1.00 10.00 O ATOM 6140 CB VAL B 22 48.253 35.419 57.539 1.00 8.84 C ATOM 6141 CG1 VAL B 22 46.924 34.996 58.112 1.00 10.00 C ATOM 6142 CG2 VAL B 22 48.759 36.650 58.286 1.00 9.53 C ATOM 6143 HA VAL B 22 49.579 34.229 58.706 1.00 0.00 H ATOM 6144 HB VAL B 22 48.110 35.647 56.483 1.00 0.00 H ATOM 6145 HG11 VAL B 22 46.558 34.124 57.571 1.00 0.00 H ATOM 6146 HG12 VAL B 22 47.047 34.746 59.166 1.00 0.00 H ATOM 6147 HG13 VAL B 22 46.210 35.813 58.012 1.00 0.00 H ATOM 6148 HG21 VAL B 22 48.912 36.399 59.336 1.00 0.00 H ATOM 6149 HG22 VAL B 22 49.702 36.977 57.848 1.00 0.00 H ATOM 6150 HG23 VAL B 22 48.023 37.450 58.205 1.00 0.00 H ATOM 6151 H VAL B 22 50.427 35.461 56.227 1.00 0.00 H ATOM 6152 N LEU B 23 48.614 32.643 55.995 1.00 9.04 N ATOM 6153 CA LEU B 23 48.063 31.359 55.562 1.00 9.92 C ATOM 6154 C LEU B 23 48.936 30.232 56.126 1.00 10.45 C ATOM 6155 O LEU B 23 48.416 29.242 56.625 1.00 11.00 O ATOM 6156 CB LEU B 23 48.050 31.311 54.034 1.00 11.12 C ATOM 6157 CG LEU B 23 47.642 29.966 53.425 1.00 10.96 C ATOM 6158 CD1 LEU B 23 46.242 29.548 53.848 1.00 12.55 C ATOM 6159 CD2 LEU B 23 47.723 30.100 51.895 1.00 13.70 C ATOM 6160 HA LEU B 23 47.043 31.238 55.927 1.00 0.00 H ATOM 6161 HB2 LEU B 23 47.351 32.068 53.679 1.00 0.00 H ATOM 6162 HB3 LEU B 23 49.053 31.551 53.681 1.00 0.00 H ATOM 6163 HG LEU B 23 48.318 29.190 53.784 1.00 0.00 H ATOM 6164 HD21 LEU B 23 47.045 30.887 51.564 1.00 0.00 H ATOM 6165 HD22 LEU B 23 48.744 30.353 51.607 1.00 0.00 H ATOM 6166 HD23 LEU B 23 47.437 29.155 51.433 1.00 0.00 H ATOM 6167 HD11 LEU B 23 46.204 29.456 54.933 1.00 0.00 H ATOM 6168 HD12 LEU B 23 45.525 30.301 53.521 1.00 0.00 H ATOM 6169 HD13 LEU B 23 45.997 28.589 53.392 1.00 0.00 H ATOM 6170 H LEU B 23 48.909 33.348 55.290 1.00 0.00 H ATOM 6171 N ALA B 24 50.271 30.380 56.042 1.00 10.62 N ATOM 6172 CA ALA B 24 51.155 29.311 56.543 1.00 10.72 C ATOM 6173 C ALA B 24 50.950 29.140 58.048 1.00 10.34 C ATOM 6174 O ALA B 24 50.863 28.008 58.530 1.00 12.17 O ATOM 6175 CB ALA B 24 52.610 29.623 56.223 1.00 12.70 C ATOM 6176 HA ALA B 24 50.900 28.375 56.046 1.00 0.00 H ATOM 6177 HB1 ALA B 24 52.733 29.706 55.143 1.00 0.00 H ATOM 6178 HB2 ALA B 24 52.891 30.564 56.696 1.00 0.00 H ATOM 6179 HB3 ALA B 24 53.244 28.821 56.602 1.00 0.00 H ATOM 6180 H ALA B 24 50.677 31.243 55.626 1.00 0.00 H ATOM 6181 N SER B 25 50.831 30.239 58.790 1.00 9.74 N ATOM 6182 CA SER B 25 50.625 30.101 60.240 1.00 9.45 C ATOM 6183 C SER B 25 49.304 29.432 60.571 1.00 9.44 C ATOM 6184 O SER B 25 49.250 28.566 61.465 1.00 11.11 O ATOM 6185 CB SER B 25 50.624 31.461 60.897 1.00 10.09 C ATOM 6186 OG SER B 25 51.944 31.988 60.875 1.00 11.31 O ATOM 6187 HA SER B 25 51.442 29.483 60.612 1.00 0.00 H ATOM 6188 HB2 SER B 25 50.285 31.368 61.929 1.00 0.00 H ATOM 6189 HB3 SER B 25 49.955 32.129 60.354 1.00 0.00 H ATOM 6190 HG SER B 25 51.949 32.880 61.305 1.00 0.00 H ATOM 6191 H SER B 25 50.883 31.181 58.351 1.00 0.00 H ATOM 6192 N LEU B 26 48.226 29.815 59.871 1.00 9.59 N ATOM 6193 CA LEU B 26 46.914 29.199 60.108 1.00 10.04 C ATOM 6194 C LEU B 26 46.949 27.687 59.841 1.00 11.03 C ATOM 6195 O LEU B 26 46.387 26.898 60.595 1.00 12.53 O ATOM 6196 CB LEU B 26 45.871 29.835 59.207 1.00 10.45 C ATOM 6197 CG LEU B 26 45.479 31.285 59.536 1.00 10.01 C ATOM 6198 CD1 LEU B 26 44.551 31.814 58.441 1.00 10.95 C ATOM 6199 CD2 LEU B 26 44.844 31.419 60.930 1.00 10.76 C ATOM 6200 HA LEU B 26 46.656 29.364 61.154 1.00 0.00 H ATOM 6201 HB2 LEU B 26 46.257 29.818 58.188 1.00 0.00 H ATOM 6202 HB3 LEU B 26 44.969 29.226 59.262 1.00 0.00 H ATOM 6203 HG LEU B 26 46.386 31.890 59.564 1.00 0.00 H ATOM 6204 HD21 LEU B 26 43.943 30.807 60.978 1.00 0.00 H ATOM 6205 HD22 LEU B 26 45.554 31.082 61.685 1.00 0.00 H ATOM 6206 HD23 LEU B 26 44.586 32.462 61.112 1.00 0.00 H ATOM 6207 HD11 LEU B 26 45.068 31.782 57.482 1.00 0.00 H ATOM 6208 HD12 LEU B 26 43.656 31.193 58.394 1.00 0.00 H ATOM 6209 HD13 LEU B 26 44.270 32.842 58.670 1.00 0.00 H ATOM 6210 H LEU B 26 48.320 30.559 59.150 1.00 0.00 H ATOM 6211 N ARG B 27 47.567 27.298 58.742 1.00 10.65 N ATOM 6212 CA ARG B 27 47.666 25.867 58.427 1.00 11.74 C ATOM 6213 C ARG B 27 48.529 25.099 59.428 1.00 11.71 C ATOM 6214 O ARG B 27 48.270 23.905 59.678 1.00 13.34 O ATOM 6215 CB ARG B 27 48.212 25.623 57.023 1.00 13.28 C ATOM 6216 CG ARG B 27 47.255 25.983 55.915 1.00 15.34 C ATOM 6217 CD ARG B 27 47.883 25.604 54.574 1.00 19.78 C ATOM 6218 NE ARG B 27 46.969 25.660 53.419 1.00 21.26 N ATOM 6219 CZ ARG B 27 47.317 26.075 52.185 1.00 20.44 C ATOM 6220 NH1 ARG B 27 48.557 26.492 51.911 1.00 21.20 N ATOM 6221 NH2 ARG B 27 46.425 26.095 51.215 1.00 21.25 N ATOM 6222 HA ARG B 27 46.644 25.494 58.488 1.00 0.00 H ATOM 6223 HB2 ARG B 27 49.117 26.218 56.900 1.00 0.00 H ATOM 6224 HB3 ARG B 27 48.459 24.565 56.931 1.00 0.00 H ATOM 6225 HG2 ARG B 27 46.320 25.439 56.048 1.00 0.00 H ATOM 6226 HG3 ARG B 27 47.057 27.055 55.936 1.00 0.00 H ATOM 6227 HD2 ARG B 27 48.264 24.586 54.655 1.00 0.00 H ATOM 6228 HD3 ARG B 27 48.711 26.287 54.383 1.00 0.00 H ATOM 6229 HE ARG B 27 45.985 25.358 53.567 1.00 0.00 H ATOM 6230 HH12 ARG B 27 48.799 26.807 50.950 1.00 0.00 H ATOM 6231 HH11 ARG B 27 49.280 26.501 52.659 1.00 0.00 H ATOM 6232 HH22 ARG B 27 46.698 26.416 50.264 1.00 0.00 H ATOM 6233 HH21 ARG B 27 45.448 25.790 51.400 1.00 0.00 H ATOM 6234 H ARG B 27 47.983 28.003 58.100 1.00 0.00 H ATOM 6235 N GLU B 28 49.561 25.741 59.971 1.00 12.12 N ATOM 6236 CA GLU B 28 50.459 25.096 60.910 1.00 13.81 C ATOM 6237 C GLU B 28 49.983 25.163 62.350 1.00 13.24 C ATOM 6238 O GLU B 28 50.587 24.527 63.218 1.00 16.07 O ATOM 6239 CB GLU B 28 51.824 25.748 60.818 1.00 16.99 C ATOM 6240 CG GLU B 28 52.552 25.534 59.504 1.00 25.14 C ATOM 6241 CD GLU B 28 53.909 26.242 59.510 1.00 29.78 C ATOM 6242 OE1 GLU B 28 54.589 26.174 60.559 1.00 34.12 O ATOM 6243 OE2 GLU B 28 54.295 26.863 58.492 1.00 32.96 O ATOM 6244 HA GLU B 28 50.496 24.042 60.634 1.00 0.00 H ATOM 6245 HB2 GLU B 28 51.697 26.821 60.963 1.00 0.00 H ATOM 6246 HB3 GLU B 28 52.445 25.346 61.618 1.00 0.00 H ATOM 6247 HG2 GLU B 28 52.707 24.466 59.351 1.00 0.00 H ATOM 6248 HG3 GLU B 28 51.945 25.932 58.691 1.00 0.00 H ATOM 6249 H GLU B 28 49.728 26.735 59.714 1.00 0.00 H ATOM 6250 N GLY B 29 48.950 25.951 62.632 1.00 12.79 N ATOM 6251 CA GLY B 29 48.521 26.137 64.025 1.00 13.36 C ATOM 6252 C GLY B 29 49.560 26.888 64.846 1.00 13.29 C ATOM 6253 O GLY B 29 49.711 26.650 66.045 1.00 15.12 O ATOM 6254 HA3 GLY B 29 48.355 25.159 64.476 1.00 0.00 H ATOM 6255 HA2 GLY B 29 47.589 26.702 64.034 1.00 0.00 H ATOM 6256 H GLY B 29 48.444 26.437 61.864 1.00 0.00 H ATOM 6257 N ARG B 30 50.269 27.813 64.199 1.00 12.44 N ATOM 6258 CA ARG B 30 51.437 28.431 64.821 1.00 14.59 C ATOM 6259 C ARG B 30 51.006 29.618 65.672 1.00 13.05 C ATOM 6260 O ARG B 30 50.311 30.486 65.189 1.00 16.19 O ATOM 6261 CB ARG B 30 52.385 28.928 63.715 1.00 18.45 C ATOM 6262 CG ARG B 30 53.724 29.407 64.229 1.00 21.64 C ATOM 6263 CD ARG B 30 54.514 30.423 63.352 1.00 23.31 C ATOM 6264 NE ARG B 30 54.277 30.448 61.909 1.00 23.65 N ATOM 6265 CZ ARG B 30 54.487 29.419 61.093 1.00 23.23 C ATOM 6266 NH1 ARG B 30 54.899 28.279 61.605 1.00 24.84 N ATOM 6267 NH2 ARG B 30 54.230 29.516 59.791 1.00 21.73 N ATOM 6268 HA ARG B 30 51.940 27.699 65.452 1.00 0.00 H ATOM 6269 HB2 ARG B 30 52.558 28.109 63.016 1.00 0.00 H ATOM 6270 HB3 ARG B 30 51.902 29.754 63.193 1.00 0.00 H ATOM 6271 HG2 ARG B 30 53.552 29.877 65.197 1.00 0.00 H ATOM 6272 HG3 ARG B 30 54.356 28.529 64.360 1.00 0.00 H ATOM 6273 HD2 ARG B 30 55.574 30.215 63.498 1.00 0.00 H ATOM 6274 HD3 ARG B 30 54.284 31.419 63.731 1.00 0.00 H ATOM 6275 HE ARG B 30 53.920 31.331 61.492 1.00 0.00 H ATOM 6276 HH12 ARG B 30 55.069 27.462 60.985 1.00 0.00 H ATOM 6277 HH11 ARG B 30 55.054 28.195 62.630 1.00 0.00 H ATOM 6278 HH22 ARG B 30 54.399 28.703 59.166 1.00 0.00 H ATOM 6279 HH21 ARG B 30 53.860 30.405 59.399 1.00 0.00 H ATOM 6280 H ARG B 30 49.987 28.098 63.239 1.00 0.00 H ATOM 6281 N SER B 31 51.466 29.668 66.907 1.00 13.32 N ATOM 6282 CA SER B 31 51.191 30.786 67.790 1.00 12.53 C ATOM 6283 C SER B 31 51.956 32.030 67.390 1.00 12.46 C ATOM 6284 O SER B 31 53.149 31.944 67.015 1.00 16.19 O ATOM 6285 CB SER B 31 51.632 30.423 69.225 1.00 13.39 C ATOM 6286 OG SER B 31 51.465 31.537 70.067 1.00 13.19 O ATOM 6287 HA SER B 31 50.121 30.987 67.729 1.00 0.00 H ATOM 6288 HB2 SER B 31 52.681 30.127 69.218 1.00 0.00 H ATOM 6289 HB3 SER B 31 51.025 29.596 69.593 1.00 0.00 H ATOM 6290 HG SER B 31 50.512 31.804 70.073 1.00 0.00 H ATOM 6291 H SER B 31 52.045 28.880 67.260 1.00 0.00 H ATOM 6292 N GLY B 32 51.308 33.182 67.532 1.00 11.06 N ATOM 6293 CA GLY B 32 51.994 34.463 67.333 1.00 11.58 C ATOM 6294 C GLY B 32 52.321 35.157 68.658 1.00 10.84 C ATOM 6295 O GLY B 32 52.699 36.337 68.672 1.00 12.55 O ATOM 6296 HA3 GLY B 32 51.352 35.117 66.743 1.00 0.00 H ATOM 6297 HA2 GLY B 32 52.923 34.283 66.792 1.00 0.00 H ATOM 6298 H GLY B 32 50.300 33.175 67.788 1.00 0.00 H ATOM 6299 N ILE B 33 52.182 34.431 69.776 1.00 10.52 N ATOM 6300 CA ILE B 33 52.298 35.044 71.107 1.00 10.86 C ATOM 6301 C ILE B 33 53.704 34.885 71.659 1.00 11.00 C ATOM 6302 O ILE B 33 54.307 33.806 71.587 1.00 12.63 O ATOM 6303 CB ILE B 33 51.267 34.451 72.092 1.00 11.20 C ATOM 6304 CG1 ILE B 33 49.820 34.606 71.580 1.00 13.09 C ATOM 6305 CG2 ILE B 33 51.378 35.066 73.492 1.00 12.21 C ATOM 6306 CD1 ILE B 33 49.482 35.937 71.023 1.00 12.62 C ATOM 6307 HA ILE B 33 52.088 36.108 70.994 1.00 0.00 H ATOM 6308 HB ILE B 33 51.504 33.389 72.160 1.00 0.00 H ATOM 6309 HG12 ILE B 33 49.658 33.863 70.799 1.00 0.00 H ATOM 6310 HG13 ILE B 33 49.145 34.409 72.413 1.00 0.00 H ATOM 6311 HD11 ILE B 33 49.621 36.697 71.792 1.00 0.00 H ATOM 6312 HD12 ILE B 33 50.134 36.151 70.176 1.00 0.00 H ATOM 6313 HD13 ILE B 33 48.443 35.938 70.693 1.00 0.00 H ATOM 6314 HG21 ILE B 33 52.374 34.878 73.892 1.00 0.00 H ATOM 6315 HG22 ILE B 33 51.207 36.141 73.430 1.00 0.00 H ATOM 6316 HG23 ILE B 33 50.632 34.615 74.146 1.00 0.00 H ATOM 6317 H ILE B 33 51.988 33.412 69.700 1.00 0.00 H ATOM 6318 N THR B 34 54.224 35.966 72.218 1.00 11.08 N ATOM 6319 CA THR B 34 55.578 35.971 72.771 1.00 12.43 C ATOM 6320 C THR B 34 55.585 36.619 74.141 1.00 12.10 C ATOM 6321 O THR B 34 54.673 37.374 74.498 1.00 12.87 O ATOM 6322 CB THR B 34 56.589 36.761 71.864 1.00 13.83 C ATOM 6323 OG1 THR B 34 56.133 38.108 71.680 1.00 15.48 O ATOM 6324 CG2 THR B 34 56.740 36.110 70.486 1.00 14.87 C ATOM 6325 HA THR B 34 55.890 34.928 72.829 1.00 0.00 H ATOM 6326 HB THR B 34 57.555 36.748 72.369 1.00 0.00 H ATOM 6327 HG1 THR B 34 55.244 38.098 71.245 1.00 0.00 H ATOM 6328 HG23 THR B 34 57.087 35.084 70.606 1.00 0.00 H ATOM 6329 HG21 THR B 34 55.776 36.112 69.977 1.00 0.00 H ATOM 6330 HG22 THR B 34 57.464 36.673 69.897 1.00 0.00 H ATOM 6331 H THR B 34 53.655 36.835 72.265 1.00 0.00 H ATOM 6332 N PHE B 35 56.647 36.361 74.900 1.00 12.53 N ATOM 6333 CA PHE B 35 56.876 37.078 76.139 1.00 12.86 C ATOM 6334 C PHE B 35 57.205 38.551 75.862 1.00 13.06 C ATOM 6335 O PHE B 35 57.950 38.849 74.911 1.00 14.15 O ATOM 6336 CB PHE B 35 58.076 36.441 76.842 1.00 14.14 C ATOM 6337 CG PHE B 35 58.548 37.215 78.034 1.00 16.06 C ATOM 6338 CD1 PHE B 35 57.852 37.139 79.234 1.00 17.08 C ATOM 6339 CD2 PHE B 35 59.650 38.049 77.945 1.00 16.55 C ATOM 6340 CE1 PHE B 35 58.267 37.888 80.350 1.00 18.50 C ATOM 6341 CE2 PHE B 35 60.080 38.785 79.053 1.00 19.02 C ATOM 6342 CZ PHE B 35 59.371 38.697 80.238 1.00 17.34 C ATOM 6343 HA PHE B 35 55.978 37.026 76.754 1.00 0.00 H ATOM 6344 HB2 PHE B 35 57.794 35.440 77.169 1.00 0.00 H ATOM 6345 HB3 PHE B 35 58.897 36.370 76.129 1.00 0.00 H ATOM 6346 HD2 PHE B 35 60.188 38.132 77.001 1.00 0.00 H ATOM 6347 HE2 PHE B 35 60.963 39.420 78.984 1.00 0.00 H ATOM 6348 HZ PHE B 35 59.695 39.281 81.099 1.00 0.00 H ATOM 6349 HE1 PHE B 35 57.720 37.827 81.291 1.00 0.00 H ATOM 6350 HD1 PHE B 35 56.977 36.494 79.311 1.00 0.00 H ATOM 6351 H PHE B 35 57.325 35.632 74.599 1.00 0.00 H ATOM 6352 N SER B 36 56.654 39.465 76.673 1.00 12.63 N ATOM 6353 CA SER B 36 56.933 40.896 76.520 1.00 12.54 C ATOM 6354 C SER B 36 57.654 41.460 77.738 1.00 13.23 C ATOM 6355 O SER B 36 57.067 41.636 78.810 1.00 12.81 O ATOM 6356 CB SER B 36 55.620 41.669 76.361 1.00 13.66 C ATOM 6357 OG SER B 36 55.893 43.070 76.343 1.00 12.93 O ATOM 6358 HA SER B 36 57.565 41.008 75.639 1.00 0.00 H ATOM 6359 HB2 SER B 36 54.958 41.438 77.196 1.00 0.00 H ATOM 6360 HB3 SER B 36 55.139 41.380 75.427 1.00 0.00 H ATOM 6361 HG SER B 36 56.330 43.331 77.192 1.00 0.00 H ATOM 6362 H SER B 36 56.013 39.151 77.429 1.00 0.00 H ATOM 6363 N GLN B 37 58.912 41.830 77.558 1.00 13.51 N ATOM 6364 CA GLN B 37 59.630 42.504 78.640 1.00 13.98 C ATOM 6365 C GLN B 37 58.984 43.868 78.943 1.00 13.29 C ATOM 6366 O GLN B 37 58.995 44.325 80.094 1.00 14.37 O ATOM 6367 CB GLN B 37 61.113 42.703 78.266 1.00 17.83 C ATOM 6368 CG GLN B 37 61.999 43.180 79.430 1.00 18.66 C ATOM 6369 CD GLN B 37 62.155 42.092 80.489 1.00 20.19 C ATOM 6370 OE1 GLN B 37 62.417 40.939 80.150 1.00 22.68 O ATOM 6371 NE2 GLN B 37 61.980 42.442 81.758 1.00 22.60 N ATOM 6372 HA GLN B 37 59.572 41.876 79.529 1.00 0.00 H ATOM 6373 HB2 GLN B 37 61.505 41.752 77.905 1.00 0.00 H ATOM 6374 HB3 GLN B 37 61.168 43.444 77.468 1.00 0.00 H ATOM 6375 HG2 GLN B 37 62.983 43.443 79.043 1.00 0.00 H ATOM 6376 HG3 GLN B 37 61.543 44.058 79.887 1.00 0.00 H ATOM 6377 HE22 GLN B 37 61.760 43.429 81.999 1.00 0.00 H ATOM 6378 HE21 GLN B 37 62.063 41.729 82.510 1.00 0.00 H ATOM 6379 H GLN B 37 59.388 41.643 76.652 1.00 0.00 H ATOM 6380 N GLU B 38 58.465 44.543 77.912 1.00 13.32 N ATOM 6381 CA GLU B 38 57.779 45.840 78.117 1.00 13.10 C ATOM 6382 C GLU B 38 56.604 45.686 79.071 1.00 11.76 C ATOM 6383 O GLU B 38 56.456 46.463 80.024 1.00 12.73 O ATOM 6384 CB GLU B 38 57.311 46.425 76.783 1.00 13.25 C ATOM 6385 CG GLU B 38 56.405 47.633 76.960 1.00 13.31 C ATOM 6386 CD GLU B 38 55.915 48.200 75.645 1.00 13.41 C ATOM 6387 OE1 GLU B 38 56.611 48.080 74.602 1.00 15.74 O ATOM 6388 OE2 GLU B 38 54.840 48.792 75.657 1.00 13.19 O ATOM 6389 HA GLU B 38 58.494 46.531 78.563 1.00 0.00 H ATOM 6390 HB2 GLU B 38 58.186 46.726 76.207 1.00 0.00 H ATOM 6391 HB3 GLU B 38 56.765 45.656 76.237 1.00 0.00 H ATOM 6392 HG2 GLU B 38 55.541 47.336 77.554 1.00 0.00 H ATOM 6393 HG3 GLU B 38 56.959 48.409 77.489 1.00 0.00 H ATOM 6394 H GLU B 38 58.544 44.152 76.952 1.00 0.00 H ATOM 6395 N LEU B 39 55.750 44.688 78.843 1.00 11.79 N ATOM 6396 CA LEU B 39 54.610 44.552 79.745 1.00 11.49 C ATOM 6397 C LEU B 39 55.097 44.203 81.152 1.00 11.80 C ATOM 6398 O LEU B 39 54.601 44.758 82.138 1.00 13.72 O ATOM 6399 CB LEU B 39 53.629 43.488 79.227 1.00 11.92 C ATOM 6400 CG LEU B 39 52.970 43.788 77.867 1.00 11.58 C ATOM 6401 CD1 LEU B 39 51.878 42.741 77.607 1.00 13.48 C ATOM 6402 CD2 LEU B 39 52.397 45.177 77.777 1.00 13.14 C ATOM 6403 HA LEU B 39 54.080 45.503 79.785 1.00 0.00 H ATOM 6404 HB2 LEU B 39 54.173 42.548 79.135 1.00 0.00 H ATOM 6405 HB3 LEU B 39 52.836 43.376 79.966 1.00 0.00 H ATOM 6406 HG LEU B 39 53.746 43.734 77.104 1.00 0.00 H ATOM 6407 HD21 LEU B 39 51.636 45.305 78.547 1.00 0.00 H ATOM 6408 HD22 LEU B 39 53.193 45.907 77.925 1.00 0.00 H ATOM 6409 HD23 LEU B 39 51.949 45.321 76.794 1.00 0.00 H ATOM 6410 HD11 LEU B 39 52.326 41.747 77.591 1.00 0.00 H ATOM 6411 HD12 LEU B 39 51.132 42.792 78.400 1.00 0.00 H ATOM 6412 HD13 LEU B 39 51.404 42.943 76.646 1.00 0.00 H ATOM 6413 H LEU B 39 55.891 44.029 78.050 1.00 0.00 H ATOM 6414 N LYS B 40 56.087 43.317 81.266 1.00 12.70 N ATOM 6415 CA LYS B 40 56.603 42.964 82.594 1.00 13.53 C ATOM 6416 C LYS B 40 57.189 44.185 83.299 1.00 14.58 C ATOM 6417 O LYS B 40 56.899 44.441 84.490 1.00 14.76 O ATOM 6418 CB LYS B 40 57.655 41.877 82.493 1.00 15.76 C ATOM 6419 CG LYS B 40 58.077 41.386 83.879 1.00 18.61 C ATOM 6420 CD LYS B 40 59.063 40.240 83.782 1.00 21.29 C ATOM 6421 CE LYS B 40 59.504 39.766 85.175 1.00 23.33 C ATOM 6422 NZ LYS B 40 60.564 38.738 85.083 1.00 28.33 N ATOM 6423 HA LYS B 40 55.765 42.591 83.182 1.00 0.00 H ATOM 6424 HB2 LYS B 40 57.248 41.039 81.927 1.00 0.00 H ATOM 6425 HB3 LYS B 40 58.528 42.274 81.975 1.00 0.00 H ATOM 6426 HG2 LYS B 40 58.542 42.209 84.421 1.00 0.00 H ATOM 6427 HG3 LYS B 40 57.193 41.049 84.421 1.00 0.00 H ATOM 6428 HD2 LYS B 40 58.592 39.409 83.256 1.00 0.00 H ATOM 6429 HD3 LYS B 40 59.939 40.571 83.225 1.00 0.00 H ATOM 6430 HE2 LYS B 40 58.644 39.344 85.695 1.00 0.00 H ATOM 6431 HE3 LYS B 40 59.884 40.619 85.737 1.00 0.00 H ATOM 6432 HZ1 LYS B 40 60.205 37.919 84.552 1.00 0.00 H ATOM 6433 HZ2 LYS B 40 61.390 39.136 84.592 1.00 0.00 H ATOM 6434 HZ3 LYS B 40 60.839 38.439 86.040 1.00 0.00 H ATOM 6435 H LYS B 40 56.493 42.877 80.416 1.00 0.00 H ATOM 6436 N ASP B 41 57.974 44.973 82.566 1.00 14.30 N ATOM 6437 CA ASP B 41 58.640 46.134 83.182 1.00 15.11 C ATOM 6438 C ASP B 41 57.643 47.187 83.651 1.00 14.22 C ATOM 6439 O ASP B 41 57.935 47.935 84.575 1.00 16.88 O ATOM 6440 CB ASP B 41 59.595 46.781 82.194 1.00 17.67 C ATOM 6441 CG ASP B 41 60.877 45.980 81.979 1.00 20.89 C ATOM 6442 OD1 ASP B 41 61.111 45.002 82.708 1.00 22.85 O ATOM 6443 OD2 ASP B 41 61.620 46.327 81.023 1.00 23.75 O ATOM 6444 HA ASP B 41 59.184 45.759 84.049 1.00 0.00 H ATOM 6445 HB2 ASP B 41 59.085 46.882 81.236 1.00 0.00 H ATOM 6446 HB3 ASP B 41 59.863 47.769 82.568 1.00 0.00 H ATOM 6447 H ASP B 41 58.117 44.768 81.556 1.00 0.00 H ATOM 6448 N SER B 42 56.481 47.258 83.001 1.00 14.13 N ATOM 6449 CA SER B 42 55.468 48.235 83.388 1.00 13.49 C ATOM 6450 C SER B 42 54.805 47.924 84.711 1.00 13.44 C ATOM 6451 O SER B 42 54.118 48.775 85.255 1.00 14.66 O ATOM 6452 CB SER B 42 54.395 48.401 82.327 1.00 13.16 C ATOM 6453 OG SER B 42 53.525 47.300 82.322 1.00 14.45 O ATOM 6454 HA SER B 42 56.019 49.169 83.497 1.00 0.00 H ATOM 6455 HB2 SER B 42 54.869 48.487 81.349 1.00 0.00 H ATOM 6456 HB3 SER B 42 53.825 49.307 82.534 1.00 0.00 H ATOM 6457 HG SER B 42 54.039 46.476 82.131 1.00 0.00 H ATOM 6458 H SER B 42 56.294 46.610 82.209 1.00 0.00 H ATOM 6459 N GLY B 43 55.004 46.712 85.233 1.00 14.15 N ATOM 6460 CA GLY B 43 54.353 46.290 86.474 1.00 15.14 C ATOM 6461 C GLY B 43 53.087 45.474 86.275 1.00 13.92 C ATOM 6462 O GLY B 43 52.407 45.140 87.247 1.00 15.48 O ATOM 6463 HA3 GLY B 43 54.097 47.182 87.045 1.00 0.00 H ATOM 6464 HA2 GLY B 43 55.061 45.687 87.042 1.00 0.00 H ATOM 6465 H GLY B 43 55.639 46.049 84.744 1.00 0.00 H ATOM 6466 N MET B 44 52.777 45.129 85.021 1.00 13.81 N ATOM 6467 CA MET B 44 51.584 44.329 84.737 1.00 12.66 C ATOM 6468 C MET B 44 51.731 42.893 85.234 1.00 12.45 C ATOM 6469 O MET B 44 52.840 42.407 85.446 1.00 14.52 O ATOM 6470 CB MET B 44 51.333 44.324 83.228 1.00 13.39 C ATOM 6471 CG MET B 44 50.661 45.651 82.790 1.00 14.26 C ATOM 6472 SD MET B 44 50.528 45.733 80.995 1.00 13.85 S ATOM 6473 CE MET B 44 49.599 44.244 80.673 1.00 13.72 C ATOM 6474 HA MET B 44 50.742 44.777 85.264 1.00 0.00 H ATOM 6475 HB2 MET B 44 52.283 44.212 82.705 1.00 0.00 H ATOM 6476 HB3 MET B 44 50.680 43.489 82.975 1.00 0.00 H ATOM 6477 HG2 MET B 44 51.260 46.490 83.144 1.00 0.00 H ATOM 6478 HG3 MET B 44 49.664 45.709 83.226 1.00 0.00 H ATOM 6479 HE1 MET B 44 50.160 43.382 81.034 1.00 0.00 H ATOM 6480 HE2 MET B 44 48.640 44.297 81.189 1.00 0.00 H ATOM 6481 HE3 MET B 44 49.431 44.147 79.600 1.00 0.00 H ATOM 6482 H MET B 44 53.391 45.432 84.238 1.00 0.00 H ATOM 6483 N ARG B 45 50.608 42.192 85.361 1.00 11.87 N ATOM 6484 CA ARG B 45 50.614 40.783 85.707 1.00 12.70 C ATOM 6485 C ARG B 45 50.640 39.913 84.452 1.00 12.28 C ATOM 6486 O ARG B 45 51.060 38.759 84.519 1.00 14.43 O ATOM 6487 CB ARG B 45 49.343 40.450 86.484 1.00 13.63 C ATOM 6488 CG ARG B 45 49.202 41.164 87.815 1.00 15.30 C ATOM 6489 CD ARG B 45 47.862 40.806 88.414 1.00 17.98 C ATOM 6490 NE ARG B 45 46.716 41.302 87.620 1.00 18.27 N ATOM 6491 CZ ARG B 45 45.461 41.335 88.081 1.00 19.40 C ATOM 6492 NH1 ARG B 45 45.185 40.883 89.305 1.00 20.24 N ATOM 6493 NH2 ARG B 45 44.480 41.823 87.331 1.00 19.23 N ATOM 6494 HA ARG B 45 51.503 40.584 86.305 1.00 0.00 H ATOM 6495 HB2 ARG B 45 48.487 40.717 85.864 1.00 0.00 H ATOM 6496 HB3 ARG B 45 49.333 39.376 86.673 1.00 0.00 H ATOM 6497 HG2 ARG B 45 50.001 40.850 88.487 1.00 0.00 H ATOM 6498 HG3 ARG B 45 49.260 42.242 87.662 1.00 0.00 H ATOM 6499 HD2 ARG B 45 47.803 41.237 89.414 1.00 0.00 H ATOM 6500 HD3 ARG B 45 47.792 39.720 88.483 1.00 0.00 H ATOM 6501 HE ARG B 45 46.896 41.642 86.654 1.00 0.00 H ATOM 6502 HH12 ARG B 45 44.208 40.910 89.661 1.00 0.00 H ATOM 6503 HH11 ARG B 45 45.946 40.504 89.903 1.00 0.00 H ATOM 6504 HH22 ARG B 45 43.507 41.845 87.697 1.00 0.00 H ATOM 6505 HH21 ARG B 45 44.685 42.183 86.377 1.00 0.00 H ATOM 6506 H ARG B 45 49.697 42.669 85.207 1.00 0.00 H ATOM 6507 N SER B 46 50.157 40.454 83.334 1.00 12.34 N ATOM 6508 CA SER B 46 50.178 39.746 82.063 1.00 11.69 C ATOM 6509 C SER B 46 51.453 40.148 81.340 1.00 11.89 C ATOM 6510 O SER B 46 51.707 41.333 81.146 1.00 12.09 O ATOM 6511 CB SER B 46 48.963 40.141 81.233 1.00 11.55 C ATOM 6512 OG SER B 46 48.906 39.370 80.035 1.00 12.34 O ATOM 6513 HA SER B 46 50.149 38.668 82.220 1.00 0.00 H ATOM 6514 HB2 SER B 46 49.031 41.198 80.977 1.00 0.00 H ATOM 6515 HB3 SER B 46 48.058 39.967 81.815 1.00 0.00 H ATOM 6516 HG SER B 46 48.841 38.409 80.265 1.00 0.00 H ATOM 6517 H SER B 46 49.753 41.411 83.371 1.00 0.00 H ATOM 6518 N HIS B 47 52.280 39.162 80.983 1.00 11.43 N ATOM 6519 CA HIS B 47 53.587 39.459 80.365 1.00 11.87 C ATOM 6520 C HIS B 47 53.704 38.878 78.970 1.00 11.65 C ATOM 6521 O HIS B 47 54.823 38.583 78.512 1.00 14.07 O ATOM 6522 CB HIS B 47 54.776 38.895 81.198 1.00 13.94 C ATOM 6523 CG HIS B 47 54.752 39.276 82.637 1.00 14.62 C ATOM 6524 ND1 HIS B 47 55.503 38.603 83.582 1.00 16.30 N ATOM 6525 CD2 HIS B 47 54.079 40.244 83.303 1.00 14.90 C ATOM 6526 CE1 HIS B 47 55.286 39.140 84.770 1.00 17.95 C ATOM 6527 NE2 HIS B 47 54.438 40.145 84.631 1.00 16.03 N ATOM 6528 HA HIS B 47 53.639 40.547 80.327 1.00 0.00 H ATOM 6529 HB2 HIS B 47 54.753 37.807 81.132 1.00 0.00 H ATOM 6530 HB3 HIS B 47 55.704 39.265 80.762 1.00 0.00 H ATOM 6531 HD2 HIS B 47 53.385 40.965 82.871 1.00 0.00 H ATOM 6532 HE1 HIS B 47 55.732 38.809 85.708 1.00 0.00 H ATOM 6533 H HIS B 47 52.000 38.173 81.142 1.00 0.00 H ATOM 6534 N VAL B 48 52.565 38.674 78.321 1.00 10.99 N ATOM 6535 CA VAL B 48 52.547 38.049 77.009 1.00 11.60 C ATOM 6536 C VAL B 48 51.753 38.902 76.037 1.00 10.09 C ATOM 6537 O VAL B 48 50.796 39.576 76.446 1.00 10.68 O ATOM 6538 CB VAL B 48 51.968 36.607 77.105 1.00 12.78 C ATOM 6539 CG1 VAL B 48 52.912 35.747 77.932 1.00 15.36 C ATOM 6540 CG2 VAL B 48 50.574 36.572 77.711 1.00 13.89 C ATOM 6541 HA VAL B 48 53.568 37.973 76.634 1.00 0.00 H ATOM 6542 HB VAL B 48 51.881 36.218 76.091 1.00 0.00 H ATOM 6543 HG11 VAL B 48 53.890 35.719 77.452 1.00 0.00 H ATOM 6544 HG12 VAL B 48 53.008 36.172 78.931 1.00 0.00 H ATOM 6545 HG13 VAL B 48 52.512 34.736 78.003 1.00 0.00 H ATOM 6546 HG21 VAL B 48 50.607 36.987 78.719 1.00 0.00 H ATOM 6547 HG22 VAL B 48 49.897 37.164 77.095 1.00 0.00 H ATOM 6548 HG23 VAL B 48 50.223 35.541 77.752 1.00 0.00 H ATOM 6549 H VAL B 48 51.668 38.967 78.759 1.00 0.00 H ATOM 6550 N TRP B 49 52.085 38.835 74.747 1.00 9.84 N ATOM 6551 CA TRP B 49 51.321 39.608 73.763 1.00 9.87 C ATOM 6552 C TRP B 49 51.481 39.046 72.356 1.00 9.74 C ATOM 6553 O TRP B 49 52.402 38.267 72.089 1.00 10.97 O ATOM 6554 CB TRP B 49 51.712 41.081 73.823 1.00 11.74 C ATOM 6555 CG TRP B 49 53.154 41.449 73.490 1.00 10.96 C ATOM 6556 CD1 TRP B 49 54.164 40.629 73.004 1.00 12.36 C ATOM 6557 CD2 TRP B 49 53.725 42.755 73.620 1.00 12.58 C ATOM 6558 NE1 TRP B 49 55.329 41.371 72.828 1.00 14.26 N ATOM 6559 CE2 TRP B 49 55.074 42.677 73.181 1.00 12.67 C ATOM 6560 CE3 TRP B 49 53.222 43.991 74.061 1.00 13.35 C ATOM 6561 CZ2 TRP B 49 55.920 43.804 73.169 1.00 14.74 C ATOM 6562 CZ3 TRP B 49 54.070 45.108 74.044 1.00 13.64 C ATOM 6563 CH2 TRP B 49 55.402 44.996 73.608 1.00 14.67 C ATOM 6564 HA TRP B 49 50.265 39.525 74.018 1.00 0.00 H ATOM 6565 HB2 TRP B 49 51.070 41.617 73.124 1.00 0.00 H ATOM 6566 HB3 TRP B 49 51.513 41.429 74.837 1.00 0.00 H ATOM 6567 HE1 TRP B 49 56.239 41.001 72.487 1.00 0.00 H ATOM 6568 HD1 TRP B 49 54.060 39.565 72.792 1.00 0.00 H ATOM 6569 HZ2 TRP B 49 56.951 43.731 72.823 1.00 0.00 H ATOM 6570 HH2 TRP B 49 56.040 45.880 73.619 1.00 0.00 H ATOM 6571 HZ3 TRP B 49 53.691 46.076 74.373 1.00 0.00 H ATOM 6572 HE3 TRP B 49 52.193 44.080 74.409 1.00 0.00 H ATOM 6573 H TRP B 49 52.880 38.239 74.441 1.00 0.00 H ATOM 6574 N GLY B 50 50.537 39.385 71.491 1.00 10.17 N ATOM 6575 CA GLY B 50 50.625 39.043 70.071 1.00 9.79 C ATOM 6576 C GLY B 50 51.209 40.224 69.332 1.00 10.00 C ATOM 6577 O GLY B 50 50.476 41.102 68.837 1.00 9.99 O ATOM 6578 HA3 GLY B 50 49.631 38.821 69.683 1.00 0.00 H ATOM 6579 HA2 GLY B 50 51.268 38.172 69.941 1.00 0.00 H ATOM 6580 H GLY B 50 49.707 39.911 71.832 1.00 0.00 H ATOM 6581 N ASN B 51 52.530 40.254 69.254 1.00 11.17 N ATOM 6582 CA ASN B 51 53.231 41.381 68.677 1.00 11.79 C ATOM 6583 C ASN B 51 53.401 41.243 67.168 1.00 10.94 C ATOM 6584 O ASN B 51 53.479 40.134 66.639 1.00 11.55 O ATOM 6585 CB ASN B 51 54.590 41.575 69.362 1.00 12.84 C ATOM 6586 CG ASN B 51 55.482 40.342 69.296 1.00 16.26 C ATOM 6587 OD1 ASN B 51 55.025 39.184 69.431 1.00 17.25 O ATOM 6588 ND2 ASN B 51 56.769 40.574 69.084 1.00 18.18 N ATOM 6589 HA ASN B 51 52.619 42.267 68.849 1.00 0.00 H ATOM 6590 HB2 ASN B 51 55.107 42.402 68.876 1.00 0.00 H ATOM 6591 HB3 ASN B 51 54.417 41.821 70.410 1.00 0.00 H ATOM 6592 HD22 ASN B 51 57.111 41.550 68.977 1.00 0.00 H ATOM 6593 HD21 ASN B 51 57.438 39.780 69.025 1.00 0.00 H ATOM 6594 H ASN B 51 53.078 39.448 69.616 1.00 0.00 H ATOM 6595 N VAL B 52 53.489 42.375 66.489 1.00 11.80 N ATOM 6596 CA VAL B 52 53.815 42.395 65.072 1.00 12.40 C ATOM 6597 C VAL B 52 55.322 42.310 64.966 1.00 13.45 C ATOM 6598 O VAL B 52 56.045 43.132 65.556 1.00 16.18 O ATOM 6599 CB VAL B 52 53.286 43.700 64.392 1.00 13.01 C ATOM 6600 CG1 VAL B 52 53.900 43.873 62.987 1.00 15.74 C ATOM 6601 CG2 VAL B 52 51.762 43.710 64.388 1.00 14.56 C ATOM 6602 HA VAL B 52 53.341 41.559 64.558 1.00 0.00 H ATOM 6603 HB VAL B 52 53.605 44.567 64.971 1.00 0.00 H ATOM 6604 HG11 VAL B 52 54.985 43.935 63.071 1.00 0.00 H ATOM 6605 HG12 VAL B 52 53.630 43.018 62.366 1.00 0.00 H ATOM 6606 HG13 VAL B 52 53.517 44.788 62.534 1.00 0.00 H ATOM 6607 HG21 VAL B 52 51.396 42.845 63.835 1.00 0.00 H ATOM 6608 HG22 VAL B 52 51.397 43.668 65.414 1.00 0.00 H ATOM 6609 HG23 VAL B 52 51.407 44.624 63.912 1.00 0.00 H ATOM 6610 H VAL B 52 53.320 43.275 66.982 1.00 0.00 H ATOM 6611 N LYS B 53 55.790 41.321 64.216 1.00 13.44 N ATOM 6612 CA LYS B 53 57.229 41.052 64.095 1.00 14.33 C ATOM 6613 C LYS B 53 57.674 41.601 62.759 1.00 13.48 C ATOM 6614 O LYS B 53 57.856 40.874 61.786 1.00 14.85 O ATOM 6615 CB LYS B 53 57.475 39.555 64.204 1.00 16.35 C ATOM 6616 CG LYS B 53 56.996 38.954 65.596 1.00 20.06 C ATOM 6617 CD LYS B 53 56.317 37.571 65.454 1.00 21.02 C ATOM 6618 CE LYS B 53 55.732 37.060 66.741 1.00 19.44 C ATOM 6619 NZ LYS B 53 54.372 37.497 66.758 1.00 13.38 N ATOM 6620 HA LYS B 53 57.800 41.530 64.891 1.00 0.00 H ATOM 6621 HB2 LYS B 53 56.933 39.053 63.402 1.00 0.00 H ATOM 6622 HB3 LYS B 53 58.543 39.368 64.092 1.00 0.00 H ATOM 6623 HG2 LYS B 53 57.864 38.850 66.247 1.00 0.00 H ATOM 6624 HG3 LYS B 53 56.285 39.646 66.048 1.00 0.00 H ATOM 6625 HD2 LYS B 53 55.517 37.652 64.718 1.00 0.00 H ATOM 6626 HD3 LYS B 53 57.060 36.855 65.103 1.00 0.00 H ATOM 6627 HE2 LYS B 53 56.273 37.472 67.593 1.00 0.00 H ATOM 6628 HE3 LYS B 53 55.781 35.972 66.773 1.00 0.00 H ATOM 6629 HZ1 LYS B 53 54.342 38.536 66.718 1.00 0.00 H ATOM 6630 HZ2 LYS B 53 53.872 37.103 65.935 1.00 0.00 H ATOM 6631 HZ3 LYS B 53 53.915 37.169 67.633 1.00 0.00 H ATOM 6632 H LYS B 53 55.119 40.719 63.699 1.00 0.00 H ATOM 6633 N LEU B 54 57.796 42.919 62.704 1.00 14.42 N ATOM 6634 CA LEU B 54 58.097 43.591 61.453 1.00 15.13 C ATOM 6635 C LEU B 54 58.776 44.888 61.769 1.00 17.74 C ATOM 6636 O LEU B 54 58.276 45.650 62.591 1.00 18.85 O ATOM 6637 CB LEU B 54 56.798 43.919 60.687 1.00 14.95 C ATOM 6638 CG LEU B 54 56.925 44.660 59.338 1.00 14.81 C ATOM 6639 CD1 LEU B 54 57.720 43.838 58.317 1.00 17.04 C ATOM 6640 CD2 LEU B 54 55.544 44.970 58.820 1.00 16.61 C ATOM 6641 HA LEU B 54 58.726 42.941 60.844 1.00 0.00 H ATOM 6642 HB2 LEU B 54 56.288 42.976 60.493 1.00 0.00 H ATOM 6643 HB3 LEU B 54 56.182 44.536 61.341 1.00 0.00 H ATOM 6644 HG LEU B 54 57.475 45.588 59.494 1.00 0.00 H ATOM 6645 HD21 LEU B 54 54.993 44.040 58.680 1.00 0.00 H ATOM 6646 HD22 LEU B 54 55.020 45.600 59.539 1.00 0.00 H ATOM 6647 HD23 LEU B 54 55.624 45.494 57.867 1.00 0.00 H ATOM 6648 HD11 LEU B 54 58.722 43.651 58.704 1.00 0.00 H ATOM 6649 HD12 LEU B 54 57.213 42.889 58.143 1.00 0.00 H ATOM 6650 HD13 LEU B 54 57.788 44.392 57.381 1.00 0.00 H ATOM 6651 H LEU B 54 57.674 43.481 63.571 1.00 0.00 H ATOM 6652 N ASP B 55 59.904 45.143 61.119 1.00 18.36 N ATOM 6653 CA ASP B 55 60.552 46.444 61.254 1.00 20.06 C ATOM 6654 C ASP B 55 59.894 47.371 60.262 1.00 19.86 C ATOM 6655 O ASP B 55 60.048 47.198 59.044 1.00 19.36 O ATOM 6656 CB ASP B 55 62.046 46.367 60.961 1.00 23.16 C ATOM 6657 CG ASP B 55 62.770 47.673 61.272 1.00 27.03 C ATOM 6658 OD1 ASP B 55 62.105 48.722 61.458 1.00 28.23 O ATOM 6659 OD2 ASP B 55 64.021 47.641 61.372 1.00 30.53 O ATOM 6660 HA ASP B 55 60.443 46.800 62.278 1.00 0.00 H ATOM 6661 HB2 ASP B 55 62.481 45.573 61.568 1.00 0.00 H ATOM 6662 HB3 ASP B 55 62.184 46.133 59.905 1.00 0.00 H ATOM 6663 H ASP B 55 60.328 44.413 60.511 1.00 0.00 H ATOM 6664 N THR B 56 59.136 48.332 60.787 1.00 18.93 N ATOM 6665 CA THR B 56 58.318 49.197 59.931 1.00 18.69 C ATOM 6666 C THR B 56 59.077 50.449 59.534 1.00 18.32 C ATOM 6667 O THR B 56 58.582 51.263 58.753 1.00 17.98 O ATOM 6668 CB THR B 56 57.007 49.625 60.603 1.00 20.06 C ATOM 6669 OG1 THR B 56 57.297 50.290 61.847 1.00 22.38 O ATOM 6670 CG2 THR B 56 56.109 48.414 60.854 1.00 18.97 C ATOM 6671 HA THR B 56 58.082 48.601 59.050 1.00 0.00 H ATOM 6672 HB THR B 56 56.480 50.311 59.939 1.00 0.00 H ATOM 6673 HG1 THR B 56 56.449 50.565 62.278 1.00 0.00 H ATOM 6674 HG23 THR B 56 55.896 47.919 59.907 1.00 0.00 H ATOM 6675 HG21 THR B 56 56.617 47.719 61.523 1.00 0.00 H ATOM 6676 HG22 THR B 56 55.176 48.744 61.311 1.00 0.00 H ATOM 6677 H THR B 56 59.124 48.471 61.818 1.00 0.00 H ATOM 6678 N THR B 57 60.297 50.600 60.043 1.00 18.45 N ATOM 6679 CA THR B 57 61.067 51.812 59.772 1.00 19.73 C ATOM 6680 C THR B 57 61.292 51.973 58.262 1.00 18.88 C ATOM 6681 O THR B 57 61.729 51.075 57.580 1.00 19.39 O ATOM 6682 CB THR B 57 62.384 51.790 60.559 1.00 21.92 C ATOM 6683 OG1 THR B 57 62.081 51.695 61.958 1.00 25.59 O ATOM 6684 CG2 THR B 57 63.155 53.086 60.339 1.00 22.28 C ATOM 6685 HA THR B 57 60.504 52.683 60.108 1.00 0.00 H ATOM 6686 HB THR B 57 62.982 50.943 60.222 1.00 0.00 H ATOM 6687 HG1 THR B 57 62.924 51.680 62.477 1.00 0.00 H ATOM 6688 HG23 THR B 57 63.400 53.186 59.282 1.00 0.00 H ATOM 6689 HG21 THR B 57 62.541 53.930 60.653 1.00 0.00 H ATOM 6690 HG22 THR B 57 64.073 53.065 60.926 1.00 0.00 H ATOM 6691 H THR B 57 60.705 49.851 60.638 1.00 0.00 H ATOM 6692 N GLY B 58 60.944 53.124 57.710 1.00 18.11 N ATOM 6693 CA GLY B 58 61.213 53.346 56.282 1.00 18.31 C ATOM 6694 C GLY B 58 60.205 52.812 55.280 1.00 19.77 C ATOM 6695 O GLY B 58 60.350 53.036 54.068 1.00 21.04 O ATOM 6696 HA3 GLY B 58 62.173 52.882 56.056 1.00 0.00 H ATOM 6697 HA2 GLY B 58 61.286 54.423 56.128 1.00 0.00 H ATOM 6698 H GLY B 58 60.485 53.863 58.280 1.00 0.00 H ATOM 6699 N LEU B 59 59.191 52.086 55.747 1.00 16.28 N ATOM 6700 CA LEU B 59 58.209 51.487 54.814 1.00 16.09 C ATOM 6701 C LEU B 59 57.158 52.451 54.267 1.00 16.03 C ATOM 6702 O LEU B 59 56.402 52.109 53.334 1.00 16.82 O ATOM 6703 CB LEU B 59 57.488 50.303 55.470 1.00 15.45 C ATOM 6704 CG LEU B 59 58.359 49.135 55.895 1.00 17.17 C ATOM 6705 CD1 LEU B 59 57.475 48.022 56.429 1.00 18.05 C ATOM 6706 CD2 LEU B 59 59.217 48.628 54.717 1.00 20.13 C ATOM 6707 HA LEU B 59 58.811 51.167 53.964 1.00 0.00 H ATOM 6708 HB2 LEU B 59 56.977 50.676 56.357 1.00 0.00 H ATOM 6709 HB3 LEU B 59 56.752 49.927 54.759 1.00 0.00 H ATOM 6710 HG LEU B 59 59.039 49.466 56.679 1.00 0.00 H ATOM 6711 HD21 LEU B 59 58.564 48.302 53.908 1.00 0.00 H ATOM 6712 HD22 LEU B 59 59.860 49.434 54.364 1.00 0.00 H ATOM 6713 HD23 LEU B 59 59.831 47.791 55.050 1.00 0.00 H ATOM 6714 HD11 LEU B 59 56.909 48.388 57.286 1.00 0.00 H ATOM 6715 HD12 LEU B 59 56.786 47.700 55.648 1.00 0.00 H ATOM 6716 HD13 LEU B 59 58.097 47.181 56.735 1.00 0.00 H ATOM 6717 H LEU B 59 59.088 51.939 56.771 1.00 0.00 H ATOM 6718 N ILE B 60 57.075 53.632 54.873 1.00 13.98 N ATOM 6719 CA ILE B 60 56.065 54.618 54.515 1.00 13.33 C ATOM 6720 C ILE B 60 56.766 55.958 54.315 1.00 13.24 C ATOM 6721 O ILE B 60 57.645 56.335 55.104 1.00 15.09 O ATOM 6722 CB ILE B 60 54.988 54.684 55.640 1.00 10.42 C ATOM 6723 CG1 ILE B 60 54.366 53.289 55.878 1.00 12.20 C ATOM 6724 CG2 ILE B 60 53.929 55.724 55.324 1.00 11.43 C ATOM 6725 CD1 ILE B 60 53.353 53.305 57.017 1.00 12.46 C ATOM 6726 HA ILE B 60 55.554 54.349 53.591 1.00 0.00 H ATOM 6727 HB ILE B 60 55.476 54.993 56.565 1.00 0.00 H ATOM 6728 HG12 ILE B 60 53.865 52.966 54.965 1.00 0.00 H ATOM 6729 HG13 ILE B 60 55.161 52.585 56.123 1.00 0.00 H ATOM 6730 HD11 ILE B 60 53.847 53.621 57.936 1.00 0.00 H ATOM 6731 HD12 ILE B 60 52.549 54.001 56.777 1.00 0.00 H ATOM 6732 HD13 ILE B 60 52.941 52.305 57.149 1.00 0.00 H ATOM 6733 HG21 ILE B 60 54.399 56.703 55.233 1.00 0.00 H ATOM 6734 HG22 ILE B 60 53.438 55.467 54.386 1.00 0.00 H ATOM 6735 HG23 ILE B 60 53.192 55.746 56.127 1.00 0.00 H ATOM 6736 H ILE B 60 57.754 53.859 55.628 1.00 0.00 H ATOM 6737 N ASP B 61 56.387 56.692 53.272 1.00 14.16 N ATOM 6738 CA ASP B 61 57.040 57.995 53.000 1.00 16.64 C ATOM 6739 C ASP B 61 57.021 58.913 54.229 1.00 16.65 C ATOM 6740 O ASP B 61 56.005 58.952 54.927 1.00 14.47 O ATOM 6741 CB ASP B 61 56.297 58.697 51.871 1.00 22.04 C ATOM 6742 CG ASP B 61 56.540 58.060 50.505 1.00 28.37 C ATOM 6743 OD1 ASP B 61 57.299 57.070 50.397 1.00 31.70 O ATOM 6744 OD2 ASP B 61 55.971 58.595 49.522 1.00 32.70 O ATOM 6745 HA ASP B 61 58.078 57.796 52.732 1.00 0.00 H ATOM 6746 HB2 ASP B 61 55.229 58.663 52.085 1.00 0.00 H ATOM 6747 HB3 ASP B 61 56.625 59.736 51.833 1.00 0.00 H ATOM 6748 H ASP B 61 55.630 56.351 52.646 1.00 0.00 H ATOM 6749 N ARG B 62 58.106 59.666 54.500 1.00 18.86 N ATOM 6750 CA ARG B 62 58.112 60.529 55.718 1.00 19.27 C ATOM 6751 C ARG B 62 56.964 61.527 55.820 1.00 18.50 C ATOM 6752 O ARG B 62 56.406 61.745 56.919 1.00 19.64 O ATOM 6753 CB ARG B 62 59.462 61.244 55.955 1.00 20.71 C ATOM 6754 CG ARG B 62 59.482 62.259 57.154 1.00 21.90 C ATOM 6755 CD ARG B 62 59.055 61.635 58.527 1.00 18.95 C ATOM 6756 NE ARG B 62 59.044 62.650 59.639 1.00 23.72 N ATOM 6757 CZ ARG B 62 58.698 62.340 60.901 1.00 24.55 C ATOM 6758 NH1 ARG B 62 58.343 61.066 61.172 1.00 22.07 N ATOM 6759 NH2 ARG B 62 58.664 63.269 61.880 1.00 24.62 N ATOM 6760 HA ARG B 62 57.956 59.805 56.518 1.00 0.00 H ATOM 6761 HB2 ARG B 62 60.218 60.482 56.145 1.00 0.00 H ATOM 6762 HB3 ARG B 62 59.718 61.790 55.047 1.00 0.00 H ATOM 6763 HG2 ARG B 62 60.494 62.650 57.255 1.00 0.00 H ATOM 6764 HG3 ARG B 62 58.800 63.077 56.922 1.00 0.00 H ATOM 6765 HD2 ARG B 62 59.756 60.841 58.784 1.00 0.00 H ATOM 6766 HD3 ARG B 62 58.054 61.216 58.425 1.00 0.00 H ATOM 6767 HE ARG B 62 59.315 63.630 59.422 1.00 0.00 H ATOM 6768 HH12 ARG B 62 58.071 60.797 62.139 1.00 0.00 H ATOM 6769 HH11 ARG B 62 58.342 60.354 60.414 1.00 0.00 H ATOM 6770 HH22 ARG B 62 58.392 62.997 62.846 1.00 0.00 H ATOM 6771 HH21 ARG B 62 58.910 64.257 61.668 1.00 0.00 H ATOM 6772 H ARG B 62 58.931 59.646 53.867 1.00 0.00 H ATOM 6773 N LYS B 63 56.546 62.083 54.686 1.00 17.89 N ATOM 6774 CA LYS B 63 55.471 63.093 54.718 1.00 17.83 C ATOM 6775 C LYS B 63 54.152 62.483 55.152 1.00 16.69 C ATOM 6776 O LYS B 63 53.229 63.191 55.587 1.00 18.69 O ATOM 6777 CB LYS B 63 55.294 63.747 53.350 1.00 20.05 C ATOM 6778 HA LYS B 63 55.767 63.850 55.444 1.00 0.00 H ATOM 6779 HB2 LYS B 63 56.224 64.235 53.059 1.00 0.00 H ATOM 6780 HB3 LYS B 63 55.036 62.985 52.615 1.00 0.00 H ATOM 6781 H LYS B 63 56.976 61.807 53.780 1.00 0.00 H ATOM 6782 N VAL B 64 54.050 61.165 55.016 1.00 14.79 N ATOM 6783 CA VAL B 64 52.858 60.436 55.386 1.00 14.01 C ATOM 6784 C VAL B 64 52.999 59.892 56.824 1.00 12.65 C ATOM 6785 O VAL B 64 52.099 60.047 57.653 1.00 13.80 O ATOM 6786 CB VAL B 64 52.605 59.290 54.358 1.00 14.96 C ATOM 6787 CG1 VAL B 64 51.460 58.364 54.803 1.00 16.81 C ATOM 6788 CG2 VAL B 64 52.352 59.894 52.938 1.00 17.33 C ATOM 6789 HA VAL B 64 51.996 61.102 55.367 1.00 0.00 H ATOM 6790 HB VAL B 64 53.498 58.667 54.310 1.00 0.00 H ATOM 6791 HG11 VAL B 64 51.711 57.913 55.763 1.00 0.00 H ATOM 6792 HG12 VAL B 64 50.543 58.944 54.901 1.00 0.00 H ATOM 6793 HG13 VAL B 64 51.318 57.581 54.059 1.00 0.00 H ATOM 6794 HG21 VAL B 64 51.479 60.546 52.972 1.00 0.00 H ATOM 6795 HG22 VAL B 64 53.225 60.469 52.628 1.00 0.00 H ATOM 6796 HG23 VAL B 64 52.176 59.087 52.227 1.00 0.00 H ATOM 6797 H VAL B 64 54.859 60.638 54.629 1.00 0.00 H ATOM 6798 N VAL B 65 54.137 59.266 57.127 1.00 12.03 N ATOM 6799 CA VAL B 65 54.279 58.563 58.393 1.00 12.04 C ATOM 6800 C VAL B 65 54.408 59.532 59.560 1.00 11.18 C ATOM 6801 O VAL B 65 54.115 59.160 60.706 1.00 11.91 O ATOM 6802 CB VAL B 65 55.450 57.538 58.357 1.00 13.38 C ATOM 6803 CG1 VAL B 65 56.769 58.240 58.520 1.00 16.12 C ATOM 6804 CG2 VAL B 65 55.254 56.464 59.429 1.00 14.97 C ATOM 6805 HA VAL B 65 53.364 57.992 58.550 1.00 0.00 H ATOM 6806 HB VAL B 65 55.453 57.044 57.386 1.00 0.00 H ATOM 6807 HG11 VAL B 65 56.900 58.957 57.710 1.00 0.00 H ATOM 6808 HG12 VAL B 65 56.785 58.763 59.476 1.00 0.00 H ATOM 6809 HG13 VAL B 65 57.575 57.507 58.492 1.00 0.00 H ATOM 6810 HG21 VAL B 65 55.224 56.935 60.412 1.00 0.00 H ATOM 6811 HG22 VAL B 65 54.316 55.938 59.248 1.00 0.00 H ATOM 6812 HG23 VAL B 65 56.082 55.757 59.388 1.00 0.00 H ATOM 6813 H VAL B 65 54.929 59.280 56.453 1.00 0.00 H ATOM 6814 N ARG B 66 54.804 60.780 59.286 1.00 11.27 N ATOM 6815 CA ARG B 66 54.944 61.719 60.379 1.00 11.89 C ATOM 6816 C ARG B 66 53.653 61.980 61.159 1.00 11.52 C ATOM 6817 O ARG B 66 53.703 62.432 62.305 1.00 12.60 O ATOM 6818 CB ARG B 66 55.519 63.025 59.864 1.00 13.16 C ATOM 6819 CG ARG B 66 54.606 63.768 58.898 1.00 14.27 C ATOM 6820 CD ARG B 66 55.340 64.924 58.219 1.00 17.00 C ATOM 6821 NE ARG B 66 54.480 65.480 57.185 1.00 20.23 N ATOM 6822 CZ ARG B 66 54.659 66.652 56.612 1.00 23.49 C ATOM 6823 NH1 ARG B 66 55.708 67.382 56.947 1.00 26.03 N ATOM 6824 NH2 ARG B 66 53.813 67.061 55.677 1.00 23.57 N ATOM 6825 HA ARG B 66 55.626 61.254 61.090 1.00 0.00 H ATOM 6826 HB2 ARG B 66 55.715 63.674 60.718 1.00 0.00 H ATOM 6827 HB3 ARG B 66 56.456 62.808 59.352 1.00 0.00 H ATOM 6828 HG2 ARG B 66 54.255 63.073 58.135 1.00 0.00 H ATOM 6829 HG3 ARG B 66 53.752 64.163 59.449 1.00 0.00 H ATOM 6830 HD2 ARG B 66 56.264 64.559 57.771 1.00 0.00 H ATOM 6831 HD3 ARG B 66 55.574 65.693 58.955 1.00 0.00 H ATOM 6832 HE ARG B 66 53.666 64.911 56.877 1.00 0.00 H ATOM 6833 HH12 ARG B 66 55.860 68.309 56.501 1.00 0.00 H ATOM 6834 HH11 ARG B 66 56.382 67.029 57.656 1.00 0.00 H ATOM 6835 HH22 ARG B 66 53.949 67.986 55.221 1.00 0.00 H ATOM 6836 HH21 ARG B 66 53.013 66.457 55.400 1.00 0.00 H ATOM 6837 H ARG B 66 55.007 61.070 58.308 1.00 0.00 H ATOM 6838 N PHE B 67 52.510 61.701 60.531 1.00 10.33 N ATOM 6839 CA PHE B 67 51.227 61.898 61.192 1.00 10.30 C ATOM 6840 C PHE B 67 50.725 60.684 61.968 1.00 10.03 C ATOM 6841 O PHE B 67 49.713 60.787 62.652 1.00 11.17 O ATOM 6842 CB PHE B 67 50.168 62.268 60.138 1.00 11.69 C ATOM 6843 CG PHE B 67 50.458 63.566 59.471 1.00 11.52 C ATOM 6844 CD1 PHE B 67 50.391 64.737 60.188 1.00 13.24 C ATOM 6845 CD2 PHE B 67 50.833 63.599 58.133 1.00 12.80 C ATOM 6846 CE1 PHE B 67 50.684 65.956 59.588 1.00 15.32 C ATOM 6847 CE2 PHE B 67 51.132 64.787 57.514 1.00 14.30 C ATOM 6848 CZ PHE B 67 51.036 65.977 58.228 1.00 14.11 C ATOM 6849 HA PHE B 67 51.384 62.695 61.919 1.00 0.00 H ATOM 6850 HB2 PHE B 67 50.139 61.484 59.381 1.00 0.00 H ATOM 6851 HB3 PHE B 67 49.196 62.335 60.627 1.00 0.00 H ATOM 6852 HD2 PHE B 67 50.890 62.669 57.568 1.00 0.00 H ATOM 6853 HE2 PHE B 67 51.443 64.798 56.469 1.00 0.00 H ATOM 6854 HZ PHE B 67 51.234 66.927 57.732 1.00 0.00 H ATOM 6855 HE1 PHE B 67 50.641 66.881 60.163 1.00 0.00 H ATOM 6856 HD1 PHE B 67 50.105 64.709 61.239 1.00 0.00 H ATOM 6857 H PHE B 67 52.535 61.338 59.557 1.00 0.00 H ATOM 6858 N MET B 68 51.414 59.553 61.838 1.00 10.73 N ATOM 6859 CA MET B 68 50.851 58.261 62.197 1.00 10.55 C ATOM 6860 C MET B 68 51.294 57.691 63.521 1.00 11.10 C ATOM 6861 O MET B 68 52.467 57.770 63.889 1.00 12.74 O ATOM 6862 CB MET B 68 51.238 57.209 61.155 1.00 11.50 C ATOM 6863 CG MET B 68 50.608 57.417 59.810 1.00 11.82 C ATOM 6864 SD MET B 68 51.191 56.091 58.692 1.00 13.59 S ATOM 6865 CE MET B 68 49.957 56.200 57.417 1.00 14.27 C ATOM 6866 HA MET B 68 49.782 58.464 62.254 1.00 0.00 H ATOM 6867 HB2 MET B 68 52.321 57.230 61.033 1.00 0.00 H ATOM 6868 HB3 MET B 68 50.935 56.230 61.527 1.00 0.00 H ATOM 6869 HG2 MET B 68 50.899 58.389 59.413 1.00 0.00 H ATOM 6870 HG3 MET B 68 49.523 57.373 59.900 1.00 0.00 H ATOM 6871 HE1 MET B 68 48.973 56.016 57.849 1.00 0.00 H ATOM 6872 HE2 MET B 68 49.981 57.196 56.975 1.00 0.00 H ATOM 6873 HE3 MET B 68 50.163 55.455 56.649 1.00 0.00 H ATOM 6874 H MET B 68 52.385 59.594 61.468 1.00 0.00 H ATOM 6875 N SER B 69 50.352 57.081 64.221 1.00 10.61 N ATOM 6876 CA SER B 69 50.676 56.149 65.317 1.00 11.48 C ATOM 6877 C SER B 69 50.747 54.723 64.734 1.00 9.65 C ATOM 6878 O SER B 69 50.488 54.504 63.546 1.00 10.51 O ATOM 6879 CB SER B 69 49.576 56.207 66.369 1.00 13.61 C ATOM 6880 OG SER B 69 48.366 55.732 65.789 1.00 14.94 O ATOM 6881 HA SER B 69 51.628 56.419 65.774 1.00 0.00 H ATOM 6882 HB2 SER B 69 49.443 57.235 66.705 1.00 0.00 H ATOM 6883 HB3 SER B 69 49.847 55.580 67.219 1.00 0.00 H ATOM 6884 HG SER B 69 48.125 56.303 65.017 1.00 0.00 H ATOM 6885 H SER B 69 49.354 57.264 63.992 1.00 0.00 H ATOM 6886 N ASP B 70 51.086 53.745 65.575 1.00 10.26 N ATOM 6887 CA ASP B 70 51.260 52.374 65.073 1.00 10.49 C ATOM 6888 C ASP B 70 49.971 51.814 64.479 1.00 9.77 C ATOM 6889 O ASP B 70 50.049 51.085 63.509 1.00 10.01 O ATOM 6890 CB ASP B 70 51.766 51.449 66.172 1.00 11.93 C ATOM 6891 CG ASP B 70 53.217 51.655 66.500 1.00 14.23 C ATOM 6892 OD1 ASP B 70 53.928 52.392 65.783 1.00 17.22 O ATOM 6893 OD2 ASP B 70 53.668 51.020 67.479 1.00 15.83 O ATOM 6894 HA ASP B 70 52.004 52.424 64.278 1.00 0.00 H ATOM 6895 HB2 ASP B 70 51.179 51.628 67.073 1.00 0.00 H ATOM 6896 HB3 ASP B 70 51.627 50.418 65.848 1.00 0.00 H ATOM 6897 H ASP B 70 51.227 53.952 66.584 1.00 0.00 H ATOM 6898 N ALA B 71 48.803 52.139 65.028 1.00 8.41 N ATOM 6899 CA ALA B 71 47.563 51.626 64.445 1.00 8.17 C ATOM 6900 C ALA B 71 47.467 52.024 62.986 1.00 8.16 C ATOM 6901 O ALA B 71 47.078 51.230 62.126 1.00 8.81 O ATOM 6902 CB ALA B 71 46.374 52.114 65.220 1.00 9.58 C ATOM 6903 HA ALA B 71 47.572 50.537 64.501 1.00 0.00 H ATOM 6904 HB1 ALA B 71 46.449 51.771 66.252 1.00 0.00 H ATOM 6905 HB2 ALA B 71 46.351 53.204 65.199 1.00 0.00 H ATOM 6906 HB3 ALA B 71 45.462 51.721 64.770 1.00 0.00 H ATOM 6907 H ALA B 71 48.772 52.754 65.866 1.00 0.00 H ATOM 6908 N SER B 72 47.811 53.275 62.696 1.00 8.46 N ATOM 6909 CA SER B 72 47.735 53.788 61.321 1.00 8.05 C ATOM 6910 C SER B 72 48.821 53.196 60.443 1.00 8.63 C ATOM 6911 O SER B 72 48.569 52.920 59.259 1.00 9.21 O ATOM 6912 CB SER B 72 47.853 55.300 61.306 1.00 10.94 C ATOM 6913 OG SER B 72 46.690 55.811 61.900 1.00 12.81 O ATOM 6914 HA SER B 72 46.764 53.492 60.923 1.00 0.00 H ATOM 6915 HB2 SER B 72 47.938 55.658 60.280 1.00 0.00 H ATOM 6916 HB3 SER B 72 48.730 55.612 61.872 1.00 0.00 H ATOM 6917 HG SER B 72 46.732 56.800 61.908 1.00 0.00 H ATOM 6918 H SER B 72 48.140 53.903 63.457 1.00 0.00 H ATOM 6919 N ILE B 73 50.022 52.976 60.999 1.00 8.58 N ATOM 6920 CA ILE B 73 51.065 52.334 60.226 1.00 8.95 C ATOM 6921 C ILE B 73 50.601 50.927 59.813 1.00 8.17 C ATOM 6922 O ILE B 73 50.696 50.562 58.643 1.00 9.09 O ATOM 6923 CB ILE B 73 52.357 52.224 61.060 1.00 9.28 C ATOM 6924 CG1 ILE B 73 52.950 53.636 61.215 1.00 10.77 C ATOM 6925 CG2 ILE B 73 53.382 51.275 60.371 1.00 11.16 C ATOM 6926 CD1 ILE B 73 54.114 53.702 62.164 1.00 12.13 C ATOM 6927 HA ILE B 73 51.268 52.932 59.338 1.00 0.00 H ATOM 6928 HB ILE B 73 52.129 51.803 62.039 1.00 0.00 H ATOM 6929 HG12 ILE B 73 53.284 53.979 60.236 1.00 0.00 H ATOM 6930 HG13 ILE B 73 52.168 54.300 61.583 1.00 0.00 H ATOM 6931 HD11 ILE B 73 53.794 53.373 63.153 1.00 0.00 H ATOM 6932 HD12 ILE B 73 54.912 53.052 61.804 1.00 0.00 H ATOM 6933 HD13 ILE B 73 54.477 54.728 62.221 1.00 0.00 H ATOM 6934 HG21 ILE B 73 52.944 50.282 60.268 1.00 0.00 H ATOM 6935 HG22 ILE B 73 53.632 51.667 59.385 1.00 0.00 H ATOM 6936 HG23 ILE B 73 54.285 51.214 60.979 1.00 0.00 H ATOM 6937 H ILE B 73 50.203 53.265 61.981 1.00 0.00 H ATOM 6938 N TYR B 74 50.073 50.144 60.760 1.00 8.12 N ATOM 6939 CA TYR B 74 49.652 48.790 60.404 1.00 8.08 C ATOM 6940 C TYR B 74 48.494 48.805 59.407 1.00 8.31 C ATOM 6941 O TYR B 74 48.444 47.966 58.496 1.00 9.44 O ATOM 6942 CB TYR B 74 49.219 48.022 61.633 1.00 9.39 C ATOM 6943 CG TYR B 74 50.273 47.898 62.710 1.00 9.47 C ATOM 6944 CD1 TYR B 74 51.610 47.709 62.401 1.00 11.37 C ATOM 6945 CD2 TYR B 74 49.903 47.879 64.070 1.00 9.95 C ATOM 6946 CE1 TYR B 74 52.562 47.557 63.409 1.00 12.48 C ATOM 6947 CE2 TYR B 74 50.820 47.692 65.075 1.00 10.91 C ATOM 6948 CZ TYR B 74 52.140 47.518 64.740 1.00 11.93 C ATOM 6949 OH TYR B 74 53.056 47.355 65.760 1.00 14.72 O ATOM 6950 HA TYR B 74 50.512 48.303 59.945 1.00 0.00 H ATOM 6951 HB3 TYR B 74 48.933 47.017 61.322 1.00 0.00 H ATOM 6952 HB2 TYR B 74 48.354 48.528 62.062 1.00 0.00 H ATOM 6953 HD2 TYR B 74 48.854 48.017 64.333 1.00 0.00 H ATOM 6954 HE2 TYR B 74 50.506 47.682 66.119 1.00 0.00 H ATOM 6955 HE1 TYR B 74 53.620 47.470 63.162 1.00 0.00 H ATOM 6956 HD1 TYR B 74 51.922 47.679 61.357 1.00 0.00 H ATOM 6957 HH TYR B 74 53.961 47.241 65.374 1.00 0.00 H ATOM 6958 H TYR B 74 49.964 50.493 61.734 1.00 0.00 H ATOM 6959 N ALA B 75 47.525 49.702 59.589 1.00 8.19 N ATOM 6960 CA ALA B 75 46.398 49.777 58.651 1.00 7.86 C ATOM 6961 C ALA B 75 46.887 50.218 57.277 1.00 7.61 C ATOM 6962 O ALA B 75 46.406 49.729 56.257 1.00 8.34 O ATOM 6963 CB ALA B 75 45.329 50.729 59.193 1.00 9.16 C ATOM 6964 HA ALA B 75 45.950 48.789 58.546 1.00 0.00 H ATOM 6965 HB1 ALA B 75 44.972 50.362 60.155 1.00 0.00 H ATOM 6966 HB2 ALA B 75 45.759 51.723 59.318 1.00 0.00 H ATOM 6967 HB3 ALA B 75 44.497 50.778 58.490 1.00 0.00 H ATOM 6968 H ALA B 75 47.567 50.352 60.400 1.00 0.00 H ATOM 6969 N PHE B 76 47.828 51.159 57.243 1.00 7.74 N ATOM 6970 CA PHE B 76 48.331 51.657 55.959 1.00 8.15 C ATOM 6971 C PHE B 76 49.022 50.555 55.173 1.00 8.36 C ATOM 6972 O PHE B 76 48.779 50.368 53.975 1.00 8.81 O ATOM 6973 CB PHE B 76 49.314 52.803 56.209 1.00 9.26 C ATOM 6974 CG PHE B 76 49.940 53.347 54.961 1.00 9.41 C ATOM 6975 CD1 PHE B 76 51.047 52.742 54.393 1.00 10.22 C ATOM 6976 CD2 PHE B 76 49.420 54.489 54.360 1.00 11.24 C ATOM 6977 CE1 PHE B 76 51.645 53.255 53.235 1.00 12.17 C ATOM 6978 CE2 PHE B 76 50.019 55.028 53.171 1.00 12.85 C ATOM 6979 CZ PHE B 76 51.131 54.385 52.621 1.00 12.45 C ATOM 6980 HA PHE B 76 47.484 52.012 55.372 1.00 0.00 H ATOM 6981 HB2 PHE B 76 48.779 53.612 56.706 1.00 0.00 H ATOM 6982 HB3 PHE B 76 50.108 52.439 56.861 1.00 0.00 H ATOM 6983 HD2 PHE B 76 48.550 54.979 54.796 1.00 0.00 H ATOM 6984 HE2 PHE B 76 49.612 55.925 52.705 1.00 0.00 H ATOM 6985 HZ PHE B 76 51.592 54.771 51.712 1.00 0.00 H ATOM 6986 HE1 PHE B 76 52.521 52.761 52.814 1.00 0.00 H ATOM 6987 HD1 PHE B 76 51.463 51.847 54.856 1.00 0.00 H ATOM 6988 H PHE B 76 48.208 51.543 58.132 1.00 0.00 H ATOM 6989 N LEU B 77 49.888 49.797 55.836 1.00 8.40 N ATOM 6990 CA LEU B 77 50.580 48.692 55.147 1.00 8.80 C ATOM 6991 C LEU B 77 49.579 47.639 54.682 1.00 8.33 C ATOM 6992 O LEU B 77 49.719 47.092 53.584 1.00 9.52 O ATOM 6993 CB LEU B 77 51.601 48.065 56.083 1.00 9.46 C ATOM 6994 CG LEU B 77 52.759 49.001 56.448 1.00 10.72 C ATOM 6995 CD1 LEU B 77 53.592 48.381 57.583 1.00 12.74 C ATOM 6996 CD2 LEU B 77 53.634 49.353 55.224 1.00 12.28 C ATOM 6997 HA LEU B 77 51.091 49.090 54.271 1.00 0.00 H ATOM 6998 HB2 LEU B 77 51.092 47.772 57.001 1.00 0.00 H ATOM 6999 HB3 LEU B 77 52.013 47.179 55.599 1.00 0.00 H ATOM 7000 HG LEU B 77 52.337 49.943 56.798 1.00 0.00 H ATOM 7001 HD21 LEU B 77 54.056 48.439 54.806 1.00 0.00 H ATOM 7002 HD22 LEU B 77 53.021 49.849 54.472 1.00 0.00 H ATOM 7003 HD23 LEU B 77 54.440 50.018 55.534 1.00 0.00 H ATOM 7004 HD11 LEU B 77 52.958 48.232 58.457 1.00 0.00 H ATOM 7005 HD12 LEU B 77 53.993 47.422 57.256 1.00 0.00 H ATOM 7006 HD13 LEU B 77 54.413 49.051 57.837 1.00 0.00 H ATOM 7007 H LEU B 77 50.078 49.983 56.841 1.00 0.00 H ATOM 7008 N SER B 78 48.560 47.360 55.498 1.00 8.22 N ATOM 7009 CA SER B 78 47.495 46.438 55.101 1.00 7.83 C ATOM 7010 C SER B 78 46.759 46.977 53.878 1.00 7.99 C ATOM 7011 O SER B 78 46.405 46.199 52.981 1.00 8.95 O ATOM 7012 CB SER B 78 46.531 46.241 56.251 1.00 8.39 C ATOM 7013 OG SER B 78 47.185 45.648 57.367 1.00 9.13 O ATOM 7014 HA SER B 78 47.937 45.476 54.842 1.00 0.00 H ATOM 7015 HB2 SER B 78 45.717 45.592 55.928 1.00 0.00 H ATOM 7016 HB3 SER B 78 46.126 47.209 56.547 1.00 0.00 H ATOM 7017 HG SER B 78 47.922 46.236 57.667 1.00 0.00 H ATOM 7018 H SER B 78 48.522 47.807 56.436 1.00 0.00 H ATOM 7019 N MET B 79 46.481 48.293 53.854 1.00 8.00 N ATOM 7020 CA MET B 79 45.797 48.880 52.708 1.00 8.40 C ATOM 7021 C MET B 79 46.641 48.775 51.442 1.00 8.53 C ATOM 7022 O MET B 79 46.118 48.483 50.359 1.00 9.44 O ATOM 7023 CB MET B 79 45.372 50.314 53.014 1.00 9.25 C ATOM 7024 CG MET B 79 44.559 50.921 51.860 1.00 10.97 C ATOM 7025 SD MET B 79 43.489 52.214 52.512 1.00 11.77 S ATOM 7026 CE MET B 79 42.974 52.987 50.950 1.00 12.02 C ATOM 7027 HA MET B 79 44.889 48.309 52.517 1.00 0.00 H ATOM 7028 HB2 MET B 79 44.762 50.317 53.917 1.00 0.00 H ATOM 7029 HB3 MET B 79 46.263 50.920 53.177 1.00 0.00 H ATOM 7030 HG2 MET B 79 43.952 50.145 51.393 1.00 0.00 H ATOM 7031 HG3 MET B 79 45.237 51.346 51.119 1.00 0.00 H ATOM 7032 HE1 MET B 79 43.853 53.356 50.422 1.00 0.00 H ATOM 7033 HE2 MET B 79 42.461 52.249 50.333 1.00 0.00 H ATOM 7034 HE3 MET B 79 42.300 53.817 51.162 1.00 0.00 H ATOM 7035 H MET B 79 46.755 48.895 54.657 1.00 0.00 H ATOM 7036 N GLU B 80 47.948 49.053 51.543 1.00 8.78 N ATOM 7037 CA GLU B 80 48.801 48.883 50.364 1.00 8.79 C ATOM 7038 C GLU B 80 48.722 47.445 49.848 1.00 9.76 C ATOM 7039 O GLU B 80 48.636 47.200 48.636 1.00 10.17 O ATOM 7040 CB GLU B 80 50.259 49.154 50.723 1.00 12.09 C ATOM 7041 CG GLU B 80 50.631 50.545 50.935 1.00 14.98 C ATOM 7042 CD GLU B 80 52.162 50.680 51.004 1.00 15.71 C ATOM 7043 OE1 GLU B 80 52.849 49.883 51.736 1.00 19.28 O ATOM 7044 OE2 GLU B 80 52.704 51.565 50.316 1.00 18.08 O ATOM 7045 HA GLU B 80 48.453 49.582 49.604 1.00 0.00 H ATOM 7046 HB2 GLU B 80 50.481 48.609 51.640 1.00 0.00 H ATOM 7047 HB3 GLU B 80 50.877 48.766 49.913 1.00 0.00 H ATOM 7048 HG2 GLU B 80 50.253 51.149 50.110 1.00 0.00 H ATOM 7049 HG3 GLU B 80 50.196 50.896 51.871 1.00 0.00 H ATOM 7050 H GLU B 80 48.350 49.384 52.443 1.00 0.00 H ATOM 7051 N GLN B 81 48.772 46.479 50.760 1.00 8.71 N ATOM 7052 CA GLN B 81 48.676 45.089 50.340 1.00 8.68 C ATOM 7053 C GLN B 81 47.338 44.834 49.662 1.00 8.97 C ATOM 7054 O GLN B 81 47.283 44.120 48.654 1.00 9.39 O ATOM 7055 CB GLN B 81 48.791 44.175 51.536 1.00 8.74 C ATOM 7056 CG GLN B 81 50.162 44.080 52.151 1.00 9.57 C ATOM 7057 CD GLN B 81 50.072 43.218 53.417 1.00 8.31 C ATOM 7058 OE1 GLN B 81 49.292 42.244 53.485 1.00 9.86 O ATOM 7059 NE2 GLN B 81 50.892 43.534 54.411 1.00 12.33 N ATOM 7060 HA GLN B 81 49.488 44.888 49.641 1.00 0.00 H ATOM 7061 HB2 GLN B 81 48.104 44.535 52.301 1.00 0.00 H ATOM 7062 HB3 GLN B 81 48.493 43.174 51.224 1.00 0.00 H ATOM 7063 HG2 GLN B 81 50.852 43.621 51.442 1.00 0.00 H ATOM 7064 HG3 GLN B 81 50.519 45.077 52.410 1.00 0.00 H ATOM 7065 HE22 GLN B 81 51.528 44.352 54.320 1.00 0.00 H ATOM 7066 HE21 GLN B 81 50.899 42.964 55.281 1.00 0.00 H ATOM 7067 H GLN B 81 48.879 46.715 51.767 1.00 0.00 H ATOM 7068 N ALA B 82 46.252 45.368 50.236 1.00 8.60 N ATOM 7069 CA ALA B 82 44.912 45.113 49.696 1.00 8.00 C ATOM 7070 C ALA B 82 44.743 45.701 48.308 1.00 7.83 C ATOM 7071 O ALA B 82 44.131 45.069 47.433 1.00 9.15 O ATOM 7072 CB ALA B 82 43.853 45.662 50.649 1.00 9.30 C ATOM 7073 HA ALA B 82 44.785 44.034 49.606 1.00 0.00 H ATOM 7074 HB1 ALA B 82 43.949 45.172 51.618 1.00 0.00 H ATOM 7075 HB2 ALA B 82 43.995 46.736 50.767 1.00 0.00 H ATOM 7076 HB3 ALA B 82 42.862 45.468 50.239 1.00 0.00 H ATOM 7077 H ALA B 82 46.360 45.972 51.076 1.00 0.00 H ATOM 7078 N ILE B 83 45.292 46.889 48.080 1.00 8.61 N ATOM 7079 CA ILE B 83 45.203 47.510 46.753 1.00 9.30 C ATOM 7080 C ILE B 83 45.960 46.684 45.725 1.00 9.31 C ATOM 7081 O ILE B 83 45.466 46.466 44.602 1.00 11.10 O ATOM 7082 CB ILE B 83 45.782 48.960 46.849 1.00 9.65 C ATOM 7083 CG1 ILE B 83 44.781 49.834 47.577 1.00 10.92 C ATOM 7084 CG2 ILE B 83 46.143 49.521 45.464 1.00 11.11 C ATOM 7085 CD1 ILE B 83 45.325 51.165 48.050 1.00 13.23 C ATOM 7086 HA ILE B 83 44.163 47.554 46.429 1.00 0.00 H ATOM 7087 HB ILE B 83 46.714 48.943 47.413 1.00 0.00 H ATOM 7088 HG12 ILE B 83 43.947 50.029 46.903 1.00 0.00 H ATOM 7089 HG13 ILE B 83 44.422 49.286 48.448 1.00 0.00 H ATOM 7090 HD11 ILE B 83 46.152 50.994 48.739 1.00 0.00 H ATOM 7091 HD12 ILE B 83 45.677 51.738 47.192 1.00 0.00 H ATOM 7092 HD13 ILE B 83 44.536 51.719 48.559 1.00 0.00 H ATOM 7093 HG21 ILE B 83 46.893 48.882 44.999 1.00 0.00 H ATOM 7094 HG22 ILE B 83 45.249 49.548 44.840 1.00 0.00 H ATOM 7095 HG23 ILE B 83 46.542 50.530 45.574 1.00 0.00 H ATOM 7096 H ILE B 83 45.789 47.383 48.848 1.00 0.00 H ATOM 7097 N ALA B 84 47.149 46.191 46.101 1.00 9.51 N ATOM 7098 CA ALA B 84 47.922 45.353 45.168 1.00 10.17 C ATOM 7099 C ALA B 84 47.185 44.043 44.897 1.00 10.24 C ATOM 7100 O ALA B 84 47.116 43.567 43.759 1.00 12.01 O ATOM 7101 CB ALA B 84 49.283 45.057 45.735 1.00 11.77 C ATOM 7102 HA ALA B 84 48.037 45.899 44.232 1.00 0.00 H ATOM 7103 HB1 ALA B 84 49.818 45.992 45.900 1.00 0.00 H ATOM 7104 HB2 ALA B 84 49.174 44.528 46.682 1.00 0.00 H ATOM 7105 HB3 ALA B 84 49.841 44.437 45.033 1.00 0.00 H ATOM 7106 H ALA B 84 47.524 46.400 47.048 1.00 0.00 H ATOM 7107 N ASP B 85 46.620 43.446 45.943 1.00 9.58 N ATOM 7108 CA ASP B 85 45.925 42.177 45.792 1.00 9.46 C ATOM 7109 C ASP B 85 44.694 42.353 44.905 1.00 10.72 C ATOM 7110 O ASP B 85 44.334 41.441 44.146 1.00 13.25 O ATOM 7111 CB ASP B 85 45.537 41.699 47.181 1.00 10.53 C ATOM 7112 CG ASP B 85 44.949 40.311 47.194 1.00 11.30 C ATOM 7113 OD1 ASP B 85 45.523 39.397 46.551 1.00 13.73 O ATOM 7114 OD2 ASP B 85 43.978 40.095 47.945 1.00 10.65 O ATOM 7115 HA ASP B 85 46.566 41.438 45.312 1.00 0.00 H ATOM 7116 HB2 ASP B 85 46.428 41.703 47.809 1.00 0.00 H ATOM 7117 HB3 ASP B 85 44.801 42.390 47.592 1.00 0.00 H ATOM 7118 H ASP B 85 46.676 43.892 46.881 1.00 0.00 H ATOM 7119 N ALA B 86 44.027 43.494 45.031 1.00 10.38 N ATOM 7120 CA ALA B 86 42.823 43.765 44.250 1.00 10.18 C ATOM 7121 C ALA B 86 43.161 44.114 42.809 1.00 11.61 C ATOM 7122 O ALA B 86 42.269 44.081 41.968 1.00 14.73 O ATOM 7123 CB ALA B 86 42.022 44.895 44.846 1.00 11.08 C ATOM 7124 HA ALA B 86 42.229 42.851 44.270 1.00 0.00 H ATOM 7125 HB1 ALA B 86 41.724 44.632 45.861 1.00 0.00 H ATOM 7126 HB2 ALA B 86 42.631 45.799 44.868 1.00 0.00 H ATOM 7127 HB3 ALA B 86 41.134 45.069 44.239 1.00 0.00 H ATOM 7128 H ALA B 86 44.370 44.211 45.701 1.00 0.00 H ATOM 7129 N GLY B 87 44.419 44.447 42.519 1.00 11.96 N ATOM 7130 CA GLY B 87 44.792 44.870 41.164 1.00 13.21 C ATOM 7131 C GLY B 87 44.260 46.246 40.804 1.00 13.00 C ATOM 7132 O GLY B 87 43.996 46.510 39.635 1.00 15.73 O ATOM 7133 HA3 GLY B 87 44.394 44.147 40.452 1.00 0.00 H ATOM 7134 HA2 GLY B 87 45.880 44.888 41.093 1.00 0.00 H ATOM 7135 H GLY B 87 45.145 44.407 43.262 1.00 0.00 H ATOM 7136 N LEU B 88 44.137 47.143 41.786 1.00 11.77 N ATOM 7137 CA LEU B 88 43.593 48.477 41.528 1.00 12.60 C ATOM 7138 C LEU B 88 44.693 49.466 41.223 1.00 13.66 C ATOM 7139 O LEU B 88 45.594 49.678 42.041 1.00 15.62 O ATOM 7140 CB LEU B 88 42.794 48.968 42.739 1.00 11.83 C ATOM 7141 CG LEU B 88 41.454 48.239 42.924 1.00 12.07 C ATOM 7142 CD1 LEU B 88 40.908 48.553 44.324 1.00 14.35 C ATOM 7143 CD2 LEU B 88 40.433 48.661 41.851 1.00 13.18 C ATOM 7144 HA LEU B 88 42.937 48.405 40.660 1.00 0.00 H ATOM 7145 HB2 LEU B 88 43.396 48.817 43.635 1.00 0.00 H ATOM 7146 HB3 LEU B 88 42.594 50.032 42.613 1.00 0.00 H ATOM 7147 HG LEU B 88 41.619 47.167 42.817 1.00 0.00 H ATOM 7148 HD21 LEU B 88 40.257 49.734 41.921 1.00 0.00 H ATOM 7149 HD22 LEU B 88 40.825 48.420 40.863 1.00 0.00 H ATOM 7150 HD23 LEU B 88 39.497 48.126 42.012 1.00 0.00 H ATOM 7151 HD11 LEU B 88 41.621 48.213 45.075 1.00 0.00 H ATOM 7152 HD12 LEU B 88 40.760 49.628 44.422 1.00 0.00 H ATOM 7153 HD13 LEU B 88 39.957 48.040 44.465 1.00 0.00 H ATOM 7154 H LEU B 88 44.433 46.889 42.750 1.00 0.00 H ATOM 7155 N SER B 89 44.592 50.130 40.077 1.00 13.89 N ATOM 7156 CA SER B 89 45.580 51.171 39.751 1.00 14.08 C ATOM 7157 C SER B 89 45.154 52.502 40.385 1.00 14.87 C ATOM 7158 O SER B 89 43.982 52.706 40.649 1.00 15.71 O ATOM 7159 CB SER B 89 45.639 51.388 38.235 1.00 15.30 C ATOM 7160 OG SER B 89 44.402 51.913 37.813 1.00 12.02 O ATOM 7161 HA SER B 89 46.551 50.849 40.129 1.00 0.00 H ATOM 7162 HB2 SER B 89 45.827 50.438 37.734 1.00 0.00 H ATOM 7163 HB3 SER B 89 46.438 52.089 37.994 1.00 0.00 H ATOM 7164 HG SER B 89 43.680 51.274 38.036 1.00 0.00 H ATOM 7165 H SER B 89 43.820 49.916 39.414 1.00 0.00 H ATOM 7166 N PRO B 90 46.091 53.436 40.590 1.00 15.69 N ATOM 7167 CA PRO B 90 45.678 54.750 41.086 1.00 16.18 C ATOM 7168 C PRO B 90 44.681 55.434 40.175 1.00 15.78 C ATOM 7169 O PRO B 90 43.801 56.147 40.661 1.00 17.06 O ATOM 7170 CB PRO B 90 46.985 55.539 41.177 1.00 17.83 C ATOM 7171 CG PRO B 90 48.073 54.603 41.073 1.00 19.84 C ATOM 7172 CD PRO B 90 47.551 53.314 40.459 1.00 16.98 C ATOM 7173 HA PRO B 90 45.159 54.674 42.042 1.00 0.00 H ATOM 7174 HD3 PRO B 90 47.843 53.235 39.412 1.00 0.00 H ATOM 7175 HD2 PRO B 90 47.920 52.445 41.004 1.00 0.00 H ATOM 7176 HG3 PRO B 90 48.478 54.400 42.064 1.00 0.00 H ATOM 7177 HG2 PRO B 90 48.857 55.020 40.440 1.00 0.00 H ATOM 7178 HB2 PRO B 90 47.039 56.262 40.363 1.00 0.00 H ATOM 7179 HB3 PRO B 90 47.036 56.063 42.131 1.00 0.00 H ATOM 7180 N GLU B 91 44.781 55.213 38.866 1.00 15.46 N ATOM 7181 CA GLU B 91 43.819 55.802 37.936 1.00 16.72 C ATOM 7182 C GLU B 91 42.396 55.414 38.300 1.00 17.33 C ATOM 7183 O GLU B 91 41.477 56.230 38.186 1.00 21.24 O ATOM 7184 CB GLU B 91 44.118 55.352 36.506 1.00 19.17 C ATOM 7185 CG GLU B 91 45.341 55.970 35.889 1.00 21.22 C ATOM 7186 CD GLU B 91 46.661 55.282 36.223 1.00 21.81 C ATOM 7187 OE1 GLU B 91 46.739 54.379 37.086 1.00 20.36 O ATOM 7188 OE2 GLU B 91 47.651 55.640 35.537 1.00 25.66 O ATOM 7189 HA GLU B 91 43.913 56.886 38.004 1.00 0.00 H ATOM 7190 HB2 GLU B 91 44.252 54.270 36.512 1.00 0.00 H ATOM 7191 HB3 GLU B 91 43.260 55.607 35.884 1.00 0.00 H ATOM 7192 HG2 GLU B 91 45.217 55.953 34.806 1.00 0.00 H ATOM 7193 HG3 GLU B 91 45.404 57.003 36.230 1.00 0.00 H ATOM 7194 H GLU B 91 45.551 54.616 38.502 1.00 0.00 H ATOM 7195 N ALA B 92 42.234 54.186 38.797 1.00 16.91 N ATOM 7196 CA ALA B 92 40.945 53.636 39.149 1.00 17.34 C ATOM 7197 C ALA B 92 40.416 54.095 40.482 1.00 17.58 C ATOM 7198 O ALA B 92 39.215 54.363 40.583 1.00 21.00 O ATOM 7199 CB ALA B 92 40.982 52.093 39.106 1.00 18.31 C ATOM 7200 HA ALA B 92 40.254 54.020 38.398 1.00 0.00 H ATOM 7201 HB1 ALA B 92 41.244 51.765 38.100 1.00 0.00 H ATOM 7202 HB2 ALA B 92 41.727 51.729 39.813 1.00 0.00 H ATOM 7203 HB3 ALA B 92 40.001 51.700 39.374 1.00 0.00 H ATOM 7204 H ALA B 92 43.078 53.595 38.938 1.00 0.00 H ATOM 7205 N TYR B 93 41.266 54.157 41.509 1.00 14.68 N ATOM 7206 CA TYR B 93 40.706 54.356 42.854 1.00 13.91 C ATOM 7207 C TYR B 93 40.974 55.732 43.441 1.00 12.28 C ATOM 7208 O TYR B 93 40.268 56.124 44.382 1.00 13.60 O ATOM 7209 CB TYR B 93 41.137 53.247 43.845 1.00 15.52 C ATOM 7210 CG TYR B 93 42.539 53.413 44.354 1.00 14.65 C ATOM 7211 CD1 TYR B 93 42.805 54.219 45.453 1.00 15.66 C ATOM 7212 CD2 TYR B 93 43.623 52.730 43.743 1.00 14.60 C ATOM 7213 CE1 TYR B 93 44.079 54.416 45.906 1.00 15.39 C ATOM 7214 CE2 TYR B 93 44.908 52.908 44.209 1.00 14.09 C ATOM 7215 CZ TYR B 93 45.138 53.752 45.300 1.00 15.61 C ATOM 7216 OH TYR B 93 46.412 53.941 45.727 1.00 17.53 O ATOM 7217 HA TYR B 93 39.628 54.286 42.710 1.00 0.00 H ATOM 7218 HB3 TYR B 93 41.065 52.284 43.339 1.00 0.00 H ATOM 7219 HB2 TYR B 93 40.456 53.261 44.696 1.00 0.00 H ATOM 7220 HD2 TYR B 93 43.438 52.062 42.902 1.00 0.00 H ATOM 7221 HE2 TYR B 93 45.741 52.393 43.729 1.00 0.00 H ATOM 7222 HE1 TYR B 93 44.264 55.092 46.741 1.00 0.00 H ATOM 7223 HD1 TYR B 93 41.977 54.707 45.967 1.00 0.00 H ATOM 7224 HH TYR B 93 46.800 53.072 45.998 1.00 0.00 H ATOM 7225 H TYR B 93 42.292 54.067 41.363 1.00 0.00 H ATOM 7226 N GLN B 94 41.949 56.468 42.899 1.00 12.30 N ATOM 7227 CA GLN B 94 42.278 57.796 43.470 1.00 10.87 C ATOM 7228 C GLN B 94 41.421 58.898 42.883 1.00 10.48 C ATOM 7229 O GLN B 94 40.993 58.817 41.707 1.00 12.72 O ATOM 7230 CB GLN B 94 43.746 58.135 43.227 1.00 11.52 C ATOM 7231 CG GLN B 94 44.646 57.212 44.039 1.00 13.79 C ATOM 7232 CD GLN B 94 46.104 57.549 43.956 1.00 16.69 C ATOM 7233 OE1 GLN B 94 46.506 58.470 43.259 1.00 17.74 O ATOM 7234 NE2 GLN B 94 46.919 56.800 44.683 1.00 18.30 N ATOM 7235 HA GLN B 94 42.078 57.734 44.540 1.00 0.00 H ATOM 7236 HB2 GLN B 94 43.972 58.016 42.167 1.00 0.00 H ATOM 7237 HB3 GLN B 94 43.930 59.168 43.523 1.00 0.00 H ATOM 7238 HG2 GLN B 94 44.341 57.268 45.084 1.00 0.00 H ATOM 7239 HG3 GLN B 94 44.509 56.193 43.676 1.00 0.00 H ATOM 7240 HE22 GLN B 94 46.536 56.026 45.262 1.00 0.00 H ATOM 7241 HE21 GLN B 94 47.942 56.986 44.675 1.00 0.00 H ATOM 7242 H GLN B 94 42.476 56.109 42.077 1.00 0.00 H ATOM 7243 N ASN B 95 41.152 59.926 43.688 1.00 9.64 N ATOM 7244 CA ASN B 95 40.348 61.061 43.212 1.00 9.56 C ATOM 7245 C ASN B 95 39.036 60.611 42.599 1.00 10.87 C ATOM 7246 O ASN B 95 38.589 61.145 41.559 1.00 12.52 O ATOM 7247 CB ASN B 95 41.103 61.957 42.197 1.00 11.34 C ATOM 7248 CG ASN B 95 42.158 62.877 42.860 1.00 10.95 C ATOM 7249 OD1 ASN B 95 42.406 63.994 42.383 1.00 13.55 O ATOM 7250 ND2 ASN B 95 42.830 62.387 43.868 1.00 10.35 N ATOM 7251 HA ASN B 95 40.144 61.655 44.102 1.00 0.00 H ATOM 7252 HB2 ASN B 95 41.608 61.314 41.476 1.00 0.00 H ATOM 7253 HB3 ASN B 95 40.376 62.582 41.678 1.00 0.00 H ATOM 7254 HD22 ASN B 95 42.594 61.446 44.242 1.00 0.00 H ATOM 7255 HD21 ASN B 95 43.601 62.938 44.296 1.00 0.00 H ATOM 7256 H ASN B 95 41.515 59.925 44.663 1.00 0.00 H ATOM 7257 N ASN B 96 38.401 59.643 43.265 1.00 9.61 N ATOM 7258 CA ASN B 96 37.204 59.027 42.725 1.00 10.23 C ATOM 7259 C ASN B 96 36.141 59.129 43.804 1.00 10.16 C ATOM 7260 O ASN B 96 36.274 58.513 44.849 1.00 10.19 O ATOM 7261 CB ASN B 96 37.528 57.560 42.374 1.00 10.48 C ATOM 7262 CG ASN B 96 36.351 56.829 41.780 1.00 11.18 C ATOM 7263 OD1 ASN B 96 35.200 57.256 41.932 1.00 12.10 O ATOM 7264 ND2 ASN B 96 36.626 55.744 41.067 1.00 12.44 N ATOM 7265 HA ASN B 96 36.848 59.514 41.817 1.00 0.00 H ATOM 7266 HB2 ASN B 96 38.347 57.546 41.654 1.00 0.00 H ATOM 7267 HB3 ASN B 96 37.836 57.044 43.283 1.00 0.00 H ATOM 7268 HD22 ASN B 96 37.610 55.423 40.967 1.00 0.00 H ATOM 7269 HD21 ASN B 96 35.857 55.215 40.608 1.00 0.00 H ATOM 7270 H ASN B 96 38.770 59.326 44.184 1.00 0.00 H ATOM 7271 N PRO B 97 35.070 59.907 43.578 1.00 9.88 N ATOM 7272 CA PRO B 97 34.072 60.111 44.626 1.00 9.99 C ATOM 7273 C PRO B 97 33.337 58.855 45.006 1.00 9.59 C ATOM 7274 O PRO B 97 32.669 58.851 46.032 1.00 10.18 O ATOM 7275 CB PRO B 97 33.097 61.104 43.989 1.00 12.08 C ATOM 7276 CG PRO B 97 33.953 61.847 43.031 1.00 13.25 C ATOM 7277 CD PRO B 97 34.800 60.771 42.416 1.00 12.71 C ATOM 7278 HA PRO B 97 34.537 60.453 45.551 1.00 0.00 H ATOM 7279 HD3 PRO B 97 34.258 60.234 41.638 1.00 0.00 H ATOM 7280 HD2 PRO B 97 35.721 61.179 42.000 1.00 0.00 H ATOM 7281 HG3 PRO B 97 34.570 62.582 43.548 1.00 0.00 H ATOM 7282 HG2 PRO B 97 33.349 62.348 42.275 1.00 0.00 H ATOM 7283 HB2 PRO B 97 32.290 60.584 43.472 1.00 0.00 H ATOM 7284 HB3 PRO B 97 32.675 61.774 44.738 1.00 0.00 H ATOM 7285 N ARG B 98 33.457 57.801 44.189 1.00 9.67 N ATOM 7286 CA ARG B 98 32.757 56.549 44.499 1.00 9.40 C ATOM 7287 C ARG B 98 33.662 55.539 45.220 1.00 7.81 C ATOM 7288 O ARG B 98 33.277 54.381 45.387 1.00 8.91 O ATOM 7289 CB ARG B 98 32.171 55.955 43.233 1.00 12.69 C ATOM 7290 CG ARG B 98 30.939 56.885 42.763 1.00 15.72 C ATOM 7291 CD ARG B 98 30.077 56.377 41.706 1.00 17.20 C ATOM 7292 NE ARG B 98 29.472 55.115 42.128 1.00 15.35 N ATOM 7293 CZ ARG B 98 28.385 54.974 42.888 1.00 15.28 C ATOM 7294 NH1 ARG B 98 27.690 56.013 43.312 1.00 16.18 N ATOM 7295 NH2 ARG B 98 27.965 53.761 43.182 1.00 14.26 N ATOM 7296 HA ARG B 98 31.945 56.783 45.188 1.00 0.00 H ATOM 7297 HB2 ARG B 98 32.931 55.927 42.452 1.00 0.00 H ATOM 7298 HB3 ARG B 98 31.816 54.943 43.430 1.00 0.00 H ATOM 7299 HG2 ARG B 98 30.313 57.064 43.637 1.00 0.00 H ATOM 7300 HG3 ARG B 98 31.357 57.830 42.417 1.00 0.00 H ATOM 7301 HD2 ARG B 98 30.667 56.213 40.804 1.00 0.00 H ATOM 7302 HD3 ARG B 98 29.292 57.104 41.498 1.00 0.00 H ATOM 7303 HE ARG B 98 29.934 54.242 41.804 1.00 0.00 H ATOM 7304 HH12 ARG B 98 26.847 55.868 43.903 1.00 0.00 H ATOM 7305 HH11 ARG B 98 27.986 56.976 43.055 1.00 0.00 H ATOM 7306 HH22 ARG B 98 27.119 53.633 43.773 1.00 0.00 H ATOM 7307 HH21 ARG B 98 28.479 52.931 42.823 1.00 0.00 H ATOM 7308 H ARG B 98 34.046 57.870 43.335 1.00 0.00 H ATOM 7309 N VAL B 99 34.815 56.005 45.716 1.00 8.48 N ATOM 7310 CA VAL B 99 35.743 55.153 46.458 1.00 8.00 C ATOM 7311 C VAL B 99 35.955 55.774 47.830 1.00 8.35 C ATOM 7312 O VAL B 99 36.345 56.932 47.927 1.00 9.38 O ATOM 7313 CB VAL B 99 37.075 55.023 45.715 1.00 9.49 C ATOM 7314 CG1 VAL B 99 38.104 54.252 46.543 1.00 10.95 C ATOM 7315 CG2 VAL B 99 36.860 54.366 44.333 1.00 11.36 C ATOM 7316 HA VAL B 99 35.328 54.150 46.558 1.00 0.00 H ATOM 7317 HB VAL B 99 37.474 56.025 45.558 1.00 0.00 H ATOM 7318 HG11 VAL B 99 38.281 54.778 47.481 1.00 0.00 H ATOM 7319 HG12 VAL B 99 37.725 53.252 46.751 1.00 0.00 H ATOM 7320 HG13 VAL B 99 39.037 54.179 45.984 1.00 0.00 H ATOM 7321 HG21 VAL B 99 36.430 53.374 44.467 1.00 0.00 H ATOM 7322 HG22 VAL B 99 36.182 54.981 43.741 1.00 0.00 H ATOM 7323 HG23 VAL B 99 37.818 54.282 43.819 1.00 0.00 H ATOM 7324 H VAL B 99 35.058 57.005 45.569 1.00 0.00 H ATOM 7325 N GLY B 100 35.728 54.971 48.870 1.00 7.90 N ATOM 7326 CA GLY B 100 35.741 55.470 50.248 1.00 7.45 C ATOM 7327 C GLY B 100 36.636 54.624 51.156 1.00 7.20 C ATOM 7328 O GLY B 100 37.236 53.625 50.727 1.00 7.34 O ATOM 7329 HA3 GLY B 100 34.724 55.451 50.639 1.00 0.00 H ATOM 7330 HA2 GLY B 100 36.109 56.496 50.248 1.00 0.00 H ATOM 7331 H GLY B 100 35.537 53.963 48.699 1.00 0.00 H ATOM 7332 N LEU B 101 36.680 55.026 52.415 1.00 7.84 N ATOM 7333 CA LEU B 101 37.526 54.339 53.412 1.00 7.79 C ATOM 7334 C LEU B 101 36.823 54.433 54.759 1.00 7.49 C ATOM 7335 O LEU B 101 36.479 55.533 55.224 1.00 8.69 O ATOM 7336 CB LEU B 101 38.894 55.056 53.487 1.00 9.78 C ATOM 7337 CG LEU B 101 39.760 54.674 54.711 1.00 7.52 C ATOM 7338 CD1 LEU B 101 40.237 53.226 54.587 1.00 6.60 C ATOM 7339 CD2 LEU B 101 40.962 55.637 54.860 1.00 8.87 C ATOM 7340 HA LEU B 101 37.684 53.295 53.140 1.00 0.00 H ATOM 7341 HB2 LEU B 101 39.455 54.812 52.585 1.00 0.00 H ATOM 7342 HB3 LEU B 101 38.713 56.130 53.521 1.00 0.00 H ATOM 7343 HG LEU B 101 39.148 54.764 55.609 1.00 0.00 H ATOM 7344 HD21 LEU B 101 41.580 55.586 53.964 1.00 0.00 H ATOM 7345 HD22 LEU B 101 40.596 56.655 54.993 1.00 0.00 H ATOM 7346 HD23 LEU B 101 41.554 55.346 55.728 1.00 0.00 H ATOM 7347 HD11 LEU B 101 39.373 52.563 54.539 1.00 0.00 H ATOM 7348 HD12 LEU B 101 40.831 53.117 53.680 1.00 0.00 H ATOM 7349 HD13 LEU B 101 40.845 52.970 55.454 1.00 0.00 H ATOM 7350 H LEU B 101 36.107 55.843 52.709 1.00 0.00 H ATOM 7351 N ILE B 102 36.583 53.270 55.372 1.00 6.76 N ATOM 7352 CA ILE B 102 35.966 53.237 56.698 1.00 7.46 C ATOM 7353 C ILE B 102 36.851 52.290 57.522 1.00 6.84 C ATOM 7354 O ILE B 102 36.887 51.074 57.302 1.00 7.64 O ATOM 7355 CB ILE B 102 34.517 52.715 56.681 1.00 7.93 C ATOM 7356 CG1 ILE B 102 33.658 53.625 55.782 1.00 9.59 C ATOM 7357 CG2 ILE B 102 33.973 52.682 58.110 1.00 9.73 C ATOM 7358 CD1 ILE B 102 32.230 53.078 55.598 1.00 10.75 C ATOM 7359 HA ILE B 102 35.904 54.244 57.109 1.00 0.00 H ATOM 7360 HB ILE B 102 34.486 51.703 56.278 1.00 0.00 H ATOM 7361 HG12 ILE B 102 33.600 54.614 56.236 1.00 0.00 H ATOM 7362 HG13 ILE B 102 34.133 53.703 54.804 1.00 0.00 H ATOM 7363 HD11 ILE B 102 32.277 52.091 55.137 1.00 0.00 H ATOM 7364 HD12 ILE B 102 31.743 53.003 56.570 1.00 0.00 H ATOM 7365 HD13 ILE B 102 31.663 53.753 54.957 1.00 0.00 H ATOM 7366 HG21 ILE B 102 34.592 52.022 58.718 1.00 0.00 H ATOM 7367 HG22 ILE B 102 33.993 53.688 58.529 1.00 0.00 H ATOM 7368 HG23 ILE B 102 32.948 52.313 58.099 1.00 0.00 H ATOM 7369 H ILE B 102 36.838 52.378 54.901 1.00 0.00 H ATOM 7370 N ALA B 103 37.641 52.851 58.441 1.00 7.87 N ATOM 7371 CA ALA B 103 38.640 52.050 59.163 1.00 7.58 C ATOM 7372 C ALA B 103 38.898 52.684 60.487 1.00 7.78 C ATOM 7373 O ALA B 103 39.003 53.912 60.538 1.00 9.88 O ATOM 7374 CB ALA B 103 39.944 51.917 58.353 1.00 10.15 C ATOM 7375 HA ALA B 103 38.252 51.042 59.310 1.00 0.00 H ATOM 7376 HB1 ALA B 103 39.731 51.430 57.401 1.00 0.00 H ATOM 7377 HB2 ALA B 103 40.360 52.908 58.171 1.00 0.00 H ATOM 7378 HB3 ALA B 103 40.661 51.319 58.916 1.00 0.00 H ATOM 7379 H ALA B 103 37.548 53.866 58.648 1.00 0.00 H ATOM 7380 N GLY B 104 39.023 51.890 61.538 1.00 8.56 N ATOM 7381 CA GLY B 104 39.087 52.451 62.898 1.00 9.94 C ATOM 7382 C GLY B 104 40.051 51.718 63.796 1.00 9.05 C ATOM 7383 O GLY B 104 40.697 50.748 63.394 1.00 10.79 O ATOM 7384 HA3 GLY B 104 38.093 52.400 63.341 1.00 0.00 H ATOM 7385 HA2 GLY B 104 39.400 53.493 62.829 1.00 0.00 H ATOM 7386 H GLY B 104 39.077 50.860 61.402 1.00 0.00 H ATOM 7387 N SER B 105 40.137 52.180 65.036 1.00 10.28 N ATOM 7388 CA SER B 105 40.885 51.505 66.088 1.00 10.25 C ATOM 7389 C SER B 105 40.015 51.492 67.320 1.00 9.79 C ATOM 7390 O SER B 105 39.079 52.309 67.457 1.00 12.27 O ATOM 7391 CB SER B 105 42.191 52.226 66.382 1.00 12.50 C ATOM 7392 OG SER B 105 41.987 53.534 66.886 1.00 15.79 O ATOM 7393 HA SER B 105 41.137 50.492 65.774 1.00 0.00 H ATOM 7394 HB2 SER B 105 42.769 52.292 65.460 1.00 0.00 H ATOM 7395 HB3 SER B 105 42.750 51.650 67.119 1.00 0.00 H ATOM 7396 HG SER B 105 41.486 54.069 66.220 1.00 0.00 H ATOM 7397 H SER B 105 39.647 53.067 65.269 1.00 0.00 H ATOM 7398 N GLY B 106 40.273 50.559 68.222 1.00 11.25 N ATOM 7399 CA GLY B 106 39.524 50.541 69.470 1.00 11.49 C ATOM 7400 C GLY B 106 39.966 51.586 70.450 1.00 11.00 C ATOM 7401 O GLY B 106 39.155 52.082 71.223 1.00 12.24 O ATOM 7402 HA3 GLY B 106 39.646 49.561 69.932 1.00 0.00 H ATOM 7403 HA2 GLY B 106 38.471 50.705 69.243 1.00 0.00 H ATOM 7404 H GLY B 106 41.006 49.844 68.041 1.00 0.00 H ATOM 7405 N GLY B 107 41.252 51.927 70.429 1.00 14.33 N ATOM 7406 CA GLY B 107 41.852 52.751 71.464 1.00 15.33 C ATOM 7407 C GLY B 107 42.499 54.034 70.980 1.00 16.03 C ATOM 7408 O GLY B 107 42.886 54.840 71.807 1.00 16.13 O ATOM 7409 HA3 GLY B 107 42.616 52.157 71.966 1.00 0.00 H ATOM 7410 HA2 GLY B 107 41.072 53.016 72.178 1.00 0.00 H ATOM 7411 H GLY B 107 41.848 51.592 69.645 1.00 0.00 H ATOM 7412 N GLY B 108 42.615 54.268 69.670 1.00 14.86 N ATOM 7413 CA GLY B 108 43.358 55.451 69.194 1.00 15.93 C ATOM 7414 C GLY B 108 44.845 55.246 69.407 1.00 14.46 C ATOM 7415 O GLY B 108 45.419 54.264 68.890 1.00 16.59 O ATOM 7416 HA3 GLY B 108 43.031 56.331 69.748 1.00 0.00 H ATOM 7417 HA2 GLY B 108 43.162 55.598 68.132 1.00 0.00 H ATOM 7418 H GLY B 108 42.182 53.616 68.985 1.00 0.00 H ATOM 7419 N SER B 109 45.484 56.161 70.138 1.00 14.04 N ATOM 7420 CA SER B 109 46.862 55.918 70.535 1.00 12.10 C ATOM 7421 C SER B 109 47.100 56.352 71.962 1.00 13.09 C ATOM 7422 O SER B 109 47.557 57.468 72.211 1.00 12.92 O ATOM 7423 CB SER B 109 47.868 56.639 69.644 1.00 11.82 C ATOM 7424 OG SER B 109 49.178 56.330 70.102 1.00 11.07 O ATOM 7425 HA SER B 109 47.013 54.843 70.433 1.00 0.00 H ATOM 7426 HB2 SER B 109 47.703 57.715 69.699 1.00 0.00 H ATOM 7427 HB3 SER B 109 47.751 56.307 68.613 1.00 0.00 H ATOM 7428 HG SER B 109 49.322 55.352 70.052 1.00 0.00 H ATOM 7429 H SER B 109 45.002 57.038 70.421 1.00 0.00 H ATOM 7430 N PRO B 110 46.849 55.451 72.918 1.00 12.30 N ATOM 7431 CA PRO B 110 47.246 55.755 74.290 1.00 12.51 C ATOM 7432 C PRO B 110 48.709 56.110 74.406 1.00 12.79 C ATOM 7433 O PRO B 110 49.084 56.957 75.216 1.00 13.78 O ATOM 7434 CB PRO B 110 46.925 54.456 75.034 1.00 15.14 C ATOM 7435 CG PRO B 110 45.747 53.933 74.269 1.00 15.77 C ATOM 7436 CD PRO B 110 46.117 54.180 72.808 1.00 14.20 C ATOM 7437 HA PRO B 110 46.729 56.627 74.690 1.00 0.00 H ATOM 7438 HD3 PRO B 110 46.751 53.385 72.415 1.00 0.00 H ATOM 7439 HD2 PRO B 110 45.231 54.280 72.181 1.00 0.00 H ATOM 7440 HG3 PRO B 110 44.840 54.474 74.536 1.00 0.00 H ATOM 7441 HG2 PRO B 110 45.603 52.869 74.458 1.00 0.00 H ATOM 7442 HB2 PRO B 110 47.763 53.760 74.994 1.00 0.00 H ATOM 7443 HB3 PRO B 110 46.666 54.650 76.075 1.00 0.00 H ATOM 7444 N ARG B 111 49.548 55.471 73.601 1.00 11.00 N ATOM 7445 CA ARG B 111 50.977 55.777 73.683 1.00 11.66 C ATOM 7446 C ARG B 111 51.229 57.258 73.366 1.00 11.54 C ATOM 7447 O ARG B 111 51.961 57.933 74.107 1.00 12.44 O ATOM 7448 CB ARG B 111 51.770 54.894 72.727 1.00 12.61 C ATOM 7449 CG ARG B 111 53.210 55.395 72.590 1.00 14.19 C ATOM 7450 CD ARG B 111 54.158 54.240 72.390 1.00 15.56 C ATOM 7451 NE ARG B 111 54.247 53.411 73.596 1.00 15.28 N ATOM 7452 CZ ARG B 111 54.729 52.181 73.602 1.00 15.46 C ATOM 7453 NH1 ARG B 111 55.177 51.631 72.467 1.00 17.16 N ATOM 7454 NH2 ARG B 111 54.738 51.482 74.738 1.00 15.08 N ATOM 7455 HA ARG B 111 51.311 55.576 74.701 1.00 0.00 H ATOM 7456 HB2 ARG B 111 51.782 53.873 73.109 1.00 0.00 H ATOM 7457 HB3 ARG B 111 51.292 54.908 71.748 1.00 0.00 H ATOM 7458 HG2 ARG B 111 53.276 56.065 71.733 1.00 0.00 H ATOM 7459 HG3 ARG B 111 53.489 55.935 73.495 1.00 0.00 H ATOM 7460 HD2 ARG B 111 55.148 54.629 72.152 1.00 0.00 H ATOM 7461 HD3 ARG B 111 53.802 53.627 71.562 1.00 0.00 H ATOM 7462 HE ARG B 111 53.913 53.813 74.495 1.00 0.00 H ATOM 7463 HH12 ARG B 111 55.556 50.663 72.473 1.00 0.00 H ATOM 7464 HH11 ARG B 111 55.146 52.172 71.579 1.00 0.00 H ATOM 7465 HH22 ARG B 111 55.116 50.513 74.749 1.00 0.00 H ATOM 7466 HH21 ARG B 111 54.367 51.906 75.612 1.00 0.00 H ATOM 7467 H ARG B 111 49.196 54.765 72.923 1.00 0.00 H ATOM 7468 N PHE B 112 50.640 57.774 72.289 1.00 11.11 N ATOM 7469 CA PHE B 112 50.930 59.166 71.961 1.00 12.09 C ATOM 7470 C PHE B 112 50.175 60.154 72.829 1.00 13.34 C ATOM 7471 O PHE B 112 50.673 61.258 73.091 1.00 15.12 O ATOM 7472 CB PHE B 112 50.791 59.415 70.444 1.00 12.73 C ATOM 7473 CG PHE B 112 52.000 59.003 69.725 1.00 13.35 C ATOM 7474 CD1 PHE B 112 53.164 59.814 69.777 1.00 14.74 C ATOM 7475 CD2 PHE B 112 52.063 57.781 69.083 1.00 13.67 C ATOM 7476 CE1 PHE B 112 54.336 59.406 69.163 1.00 16.02 C ATOM 7477 CE2 PHE B 112 53.239 57.368 68.459 1.00 15.17 C ATOM 7478 CZ PHE B 112 54.374 58.181 68.504 1.00 16.54 C ATOM 7479 HA PHE B 112 51.975 59.353 72.208 1.00 0.00 H ATOM 7480 HB2 PHE B 112 49.941 58.846 70.067 1.00 0.00 H ATOM 7481 HB3 PHE B 112 50.620 60.478 70.272 1.00 0.00 H ATOM 7482 HD2 PHE B 112 51.186 57.135 69.064 1.00 0.00 H ATOM 7483 HE2 PHE B 112 53.273 56.412 67.937 1.00 0.00 H ATOM 7484 HZ PHE B 112 55.294 57.854 68.020 1.00 0.00 H ATOM 7485 HE1 PHE B 112 55.222 60.040 69.196 1.00 0.00 H ATOM 7486 HD1 PHE B 112 53.135 60.767 70.305 1.00 0.00 H ATOM 7487 H PHE B 112 49.996 57.205 71.703 1.00 0.00 H ATOM 7488 N GLN B 113 49.004 59.771 73.309 1.00 14.00 N ATOM 7489 CA GLN B 113 48.332 60.624 74.263 1.00 15.06 C ATOM 7490 C GLN B 113 49.171 60.824 75.527 1.00 14.04 C ATOM 7491 O GLN B 113 49.280 61.939 76.077 1.00 15.46 O ATOM 7492 CB GLN B 113 46.976 60.077 74.623 1.00 17.46 C ATOM 7493 CG GLN B 113 46.204 61.007 75.491 1.00 22.43 C ATOM 7494 CD GLN B 113 46.194 62.439 74.983 1.00 26.72 C ATOM 7495 OE1 GLN B 113 45.726 62.706 73.869 1.00 28.45 O ATOM 7496 NE2 GLN B 113 46.685 63.375 75.811 1.00 28.30 N ATOM 7497 HA GLN B 113 48.199 61.595 73.785 1.00 0.00 H ATOM 7498 HB2 GLN B 113 46.413 59.904 73.706 1.00 0.00 H ATOM 7499 HB3 GLN B 113 47.108 59.132 75.151 1.00 0.00 H ATOM 7500 HG2 GLN B 113 45.175 60.653 75.547 1.00 0.00 H ATOM 7501 HG3 GLN B 113 46.646 60.997 76.487 1.00 0.00 H ATOM 7502 HE22 GLN B 113 47.068 63.100 76.738 1.00 0.00 H ATOM 7503 HE21 GLN B 113 46.683 64.375 75.525 1.00 0.00 H ATOM 7504 H GLN B 113 48.575 58.873 73.006 1.00 0.00 H ATOM 7505 N VAL B 114 49.728 59.725 76.022 1.00 12.52 N ATOM 7506 CA VAL B 114 50.541 59.760 77.236 1.00 12.32 C ATOM 7507 C VAL B 114 51.862 60.468 76.954 1.00 13.48 C ATOM 7508 O VAL B 114 52.366 61.236 77.790 1.00 15.45 O ATOM 7509 CB VAL B 114 50.745 58.310 77.763 1.00 12.28 C ATOM 7510 CG1 VAL B 114 51.795 58.250 78.878 1.00 14.06 C ATOM 7511 CG2 VAL B 114 49.412 57.745 78.211 1.00 12.60 C ATOM 7512 HA VAL B 114 50.033 60.326 78.016 1.00 0.00 H ATOM 7513 HB VAL B 114 51.131 57.694 76.951 1.00 0.00 H ATOM 7514 HG11 VAL B 114 52.749 58.613 78.496 1.00 0.00 H ATOM 7515 HG12 VAL B 114 51.474 58.875 79.711 1.00 0.00 H ATOM 7516 HG13 VAL B 114 51.905 57.220 79.216 1.00 0.00 H ATOM 7517 HG21 VAL B 114 49.004 58.368 79.007 1.00 0.00 H ATOM 7518 HG22 VAL B 114 48.722 57.733 77.367 1.00 0.00 H ATOM 7519 HG23 VAL B 114 49.555 56.729 78.580 1.00 0.00 H ATOM 7520 H VAL B 114 49.582 58.818 75.534 1.00 0.00 H ATOM 7521 N PHE B 115 52.424 60.243 75.774 1.00 13.07 N ATOM 7522 CA PHE B 115 53.620 60.966 75.385 1.00 14.01 C ATOM 7523 C PHE B 115 53.349 62.470 75.423 1.00 14.51 C ATOM 7524 O PHE B 115 54.160 63.220 75.970 1.00 14.58 O ATOM 7525 CB PHE B 115 54.051 60.591 73.974 1.00 15.86 C ATOM 7526 CG PHE B 115 55.016 61.557 73.418 1.00 16.07 C ATOM 7527 CD1 PHE B 115 56.359 61.499 73.786 1.00 17.64 C ATOM 7528 CD2 PHE B 115 54.579 62.567 72.561 1.00 16.18 C ATOM 7529 CE1 PHE B 115 57.281 62.468 73.308 1.00 20.65 C ATOM 7530 CE2 PHE B 115 55.479 63.511 72.085 1.00 17.30 C ATOM 7531 CZ PHE B 115 56.825 63.458 72.456 1.00 19.59 C ATOM 7532 HA PHE B 115 54.413 60.702 76.085 1.00 0.00 H ATOM 7533 HB2 PHE B 115 54.514 59.604 73.997 1.00 0.00 H ATOM 7534 HB3 PHE B 115 53.170 60.563 73.332 1.00 0.00 H ATOM 7535 HD2 PHE B 115 53.531 62.615 72.265 1.00 0.00 H ATOM 7536 HE2 PHE B 115 55.133 64.299 71.417 1.00 0.00 H ATOM 7537 HZ PHE B 115 57.522 64.203 72.071 1.00 0.00 H ATOM 7538 HE1 PHE B 115 58.329 62.432 73.607 1.00 0.00 H ATOM 7539 HD1 PHE B 115 56.705 60.703 74.446 1.00 0.00 H ATOM 7540 H PHE B 115 52.006 59.546 75.125 1.00 0.00 H ATOM 7541 N GLY B 116 52.223 62.920 74.847 1.00 13.49 N ATOM 7542 CA GLY B 116 51.922 64.359 74.821 1.00 13.23 C ATOM 7543 C GLY B 116 51.791 64.912 76.239 1.00 11.88 C ATOM 7544 O GLY B 116 52.355 65.965 76.560 1.00 12.47 O ATOM 7545 HA3 GLY B 116 50.985 64.519 74.287 1.00 0.00 H ATOM 7546 HA2 GLY B 116 52.727 64.883 74.306 1.00 0.00 H ATOM 7547 H GLY B 116 51.559 62.246 74.416 1.00 0.00 H ATOM 7548 N ALA B 117 51.084 64.185 77.112 1.00 12.39 N ATOM 7549 CA ALA B 117 50.897 64.678 78.493 1.00 11.70 C ATOM 7550 C ALA B 117 52.190 64.663 79.279 1.00 12.16 C ATOM 7551 O ALA B 117 52.474 65.582 80.061 1.00 12.00 O ATOM 7552 CB ALA B 117 49.863 63.839 79.201 1.00 13.42 C ATOM 7553 HA ALA B 117 50.558 65.712 78.430 1.00 0.00 H ATOM 7554 HB1 ALA B 117 48.916 63.902 78.664 1.00 0.00 H ATOM 7555 HB2 ALA B 117 50.197 62.802 79.231 1.00 0.00 H ATOM 7556 HB3 ALA B 117 49.731 64.209 80.218 1.00 0.00 H ATOM 7557 H ALA B 117 50.668 63.278 76.820 1.00 0.00 H ATOM 7558 N ASP B 118 52.990 63.615 79.088 1.00 11.64 N ATOM 7559 CA ASP B 118 54.284 63.562 79.780 1.00 12.16 C ATOM 7560 C ASP B 118 55.190 64.688 79.302 1.00 12.55 C ATOM 7561 O ASP B 118 55.877 65.335 80.127 1.00 13.43 O ATOM 7562 CB ASP B 118 54.982 62.216 79.520 1.00 12.95 C ATOM 7563 CG ASP B 118 54.383 61.043 80.282 1.00 14.41 C ATOM 7564 OD1 ASP B 118 53.444 61.207 81.094 1.00 13.26 O ATOM 7565 OD2 ASP B 118 54.915 59.917 80.067 1.00 16.22 O ATOM 7566 HA ASP B 118 54.096 63.673 80.848 1.00 0.00 H ATOM 7567 HB2 ASP B 118 54.919 61.999 78.454 1.00 0.00 H ATOM 7568 HB3 ASP B 118 56.029 62.312 79.809 1.00 0.00 H ATOM 7569 H ASP B 118 52.701 62.842 78.455 1.00 0.00 H ATOM 7570 N ALA B 119 55.238 64.909 77.988 1.00 12.29 N ATOM 7571 CA ALA B 119 56.106 65.951 77.445 1.00 11.38 C ATOM 7572 C ALA B 119 55.658 67.322 77.933 1.00 10.92 C ATOM 7573 O ALA B 119 56.483 68.157 78.330 1.00 12.13 O ATOM 7574 CB ALA B 119 56.089 65.916 75.902 1.00 13.57 C ATOM 7575 HA ALA B 119 57.122 65.765 77.792 1.00 0.00 H ATOM 7576 HB1 ALA B 119 56.442 64.944 75.558 1.00 0.00 H ATOM 7577 HB2 ALA B 119 55.072 66.080 75.547 1.00 0.00 H ATOM 7578 HB3 ALA B 119 56.741 66.699 75.515 1.00 0.00 H ATOM 7579 H ALA B 119 54.654 64.336 77.346 1.00 0.00 H ATOM 7580 N MET B 120 54.352 67.567 77.931 1.00 10.85 N ATOM 7581 CA MET B 120 53.819 68.861 78.330 1.00 10.84 C ATOM 7582 C MET B 120 54.141 69.176 79.765 1.00 10.29 C ATOM 7583 O MET B 120 54.323 70.344 80.116 1.00 11.69 O ATOM 7584 CB MET B 120 52.290 68.852 78.155 1.00 11.84 C ATOM 7585 CG MET B 120 51.662 70.193 78.340 1.00 12.82 C ATOM 7586 SD MET B 120 52.182 71.338 77.044 1.00 12.99 S ATOM 7587 CE MET B 120 51.728 72.865 77.816 1.00 16.03 C ATOM 7588 HA MET B 120 54.278 69.623 77.701 1.00 0.00 H ATOM 7589 HB2 MET B 120 52.059 68.498 77.150 1.00 0.00 H ATOM 7590 HB3 MET B 120 51.863 68.167 78.887 1.00 0.00 H ATOM 7591 HG2 MET B 120 51.957 70.594 79.310 1.00 0.00 H ATOM 7592 HG3 MET B 120 50.578 70.086 78.307 1.00 0.00 H ATOM 7593 HE1 MET B 120 50.656 72.866 78.013 1.00 0.00 H ATOM 7594 HE2 MET B 120 52.272 72.972 78.755 1.00 0.00 H ATOM 7595 HE3 MET B 120 51.978 73.694 77.154 1.00 0.00 H ATOM 7596 H MET B 120 53.695 66.816 77.637 1.00 0.00 H ATOM 7597 N ARG B 121 54.202 68.138 80.590 1.00 10.52 N ATOM 7598 CA ARG B 121 54.427 68.337 82.026 1.00 11.44 C ATOM 7599 C ARG B 121 55.898 68.557 82.387 1.00 11.32 C ATOM 7600 O ARG B 121 56.181 68.857 83.540 1.00 12.98 O ATOM 7601 CB ARG B 121 53.820 67.168 82.798 1.00 11.24 C ATOM 7602 CG ARG B 121 52.301 67.288 82.858 1.00 11.45 C ATOM 7603 CD ARG B 121 51.634 66.115 83.574 1.00 11.44 C ATOM 7604 NE ARG B 121 51.807 64.834 82.865 1.00 11.58 N ATOM 7605 CZ ARG B 121 51.238 63.695 83.255 1.00 12.35 C ATOM 7606 NH1 ARG B 121 50.435 63.702 84.314 1.00 12.66 N ATOM 7607 NH2 ARG B 121 51.427 62.570 82.573 1.00 12.50 N ATOM 7608 HA ARG B 121 53.927 69.261 82.315 1.00 0.00 H ATOM 7609 HB2 ARG B 121 54.086 66.235 82.301 1.00 0.00 H ATOM 7610 HB3 ARG B 121 54.219 67.164 83.812 1.00 0.00 H ATOM 7611 HG2 ARG B 121 52.046 68.207 83.386 1.00 0.00 H ATOM 7612 HG3 ARG B 121 51.916 67.337 81.839 1.00 0.00 H ATOM 7613 HD2 ARG B 121 50.568 66.322 83.662 1.00 0.00 H ATOM 7614 HD3 ARG B 121 52.068 66.023 84.569 1.00 0.00 H ATOM 7615 HE ARG B 121 52.406 64.819 82.015 1.00 0.00 H ATOM 7616 HH12 ARG B 121 49.984 62.820 84.630 1.00 0.00 H ATOM 7617 HH11 ARG B 121 50.258 64.589 84.827 1.00 0.00 H ATOM 7618 HH22 ARG B 121 50.976 61.688 82.890 1.00 0.00 H ATOM 7619 HH21 ARG B 121 52.026 62.572 81.723 1.00 0.00 H ATOM 7620 H ARG B 121 54.089 67.175 80.215 1.00 0.00 H ATOM 7621 N GLY B 122 56.810 68.390 81.422 1.00 12.42 N ATOM 7622 CA GLY B 122 58.216 68.679 81.687 1.00 12.63 C ATOM 7623 C GLY B 122 58.520 70.137 81.403 1.00 13.89 C ATOM 7624 O GLY B 122 57.636 70.937 81.056 1.00 14.22 O ATOM 7625 HA3 GLY B 122 58.838 68.051 81.049 1.00 0.00 H ATOM 7626 HA2 GLY B 122 58.436 68.463 82.732 1.00 0.00 H ATOM 7627 H GLY B 122 56.517 68.054 80.482 1.00 0.00 H ATOM 7628 N PRO B 123 59.784 70.523 81.563 1.00 14.27 N ATOM 7629 CA PRO B 123 60.144 71.941 81.505 1.00 16.47 C ATOM 7630 C PRO B 123 59.938 72.610 80.153 1.00 17.12 C ATOM 7631 O PRO B 123 59.805 73.834 80.103 1.00 18.64 O ATOM 7632 CB PRO B 123 61.634 71.966 81.899 1.00 19.34 C ATOM 7633 CG PRO B 123 62.102 70.564 81.793 1.00 20.65 C ATOM 7634 CD PRO B 123 60.905 69.651 81.944 1.00 16.69 C ATOM 7635 HA PRO B 123 59.492 72.512 82.165 1.00 0.00 H ATOM 7636 HD3 PRO B 123 60.979 68.792 81.278 1.00 0.00 H ATOM 7637 HD2 PRO B 123 60.802 69.304 82.972 1.00 0.00 H ATOM 7638 HG3 PRO B 123 62.826 70.356 82.581 1.00 0.00 H ATOM 7639 HG2 PRO B 123 62.568 70.403 80.821 1.00 0.00 H ATOM 7640 HB2 PRO B 123 62.196 72.607 81.220 1.00 0.00 H ATOM 7641 HB3 PRO B 123 61.751 72.330 82.920 1.00 0.00 H ATOM 7642 N ARG B 124 59.891 71.834 79.072 1.00 16.14 N ATOM 7643 CA ARG B 124 59.794 72.433 77.740 1.00 18.32 C ATOM 7644 C ARG B 124 58.363 72.577 77.219 1.00 16.77 C ATOM 7645 O ARG B 124 58.132 73.184 76.164 1.00 17.90 O ATOM 7646 CB ARG B 124 60.664 71.666 76.756 1.00 19.02 C ATOM 7647 CG ARG B 124 62.157 71.857 77.034 1.00 23.54 C ATOM 7648 CD ARG B 124 63.068 71.147 76.043 1.00 26.64 C ATOM 7649 NE ARG B 124 62.853 71.481 74.629 1.00 33.08 N ATOM 7650 CZ ARG B 124 62.906 72.698 74.086 1.00 34.94 C ATOM 7651 NH1 ARG B 124 63.135 73.778 74.833 1.00 37.35 N ATOM 7652 NH2 ARG B 124 62.719 72.832 72.773 1.00 36.27 N ATOM 7653 HA ARG B 124 60.164 73.454 77.837 1.00 0.00 H ATOM 7654 HB2 ARG B 124 60.426 70.605 76.829 1.00 0.00 H ATOM 7655 HB3 ARG B 124 60.447 72.017 75.747 1.00 0.00 H ATOM 7656 HG2 ARG B 124 62.378 72.924 77.000 1.00 0.00 H ATOM 7657 HG3 ARG B 124 62.372 71.475 78.032 1.00 0.00 H ATOM 7658 HD2 ARG B 124 62.919 70.074 76.160 1.00 0.00 H ATOM 7659 HD3 ARG B 124 64.098 71.399 76.294 1.00 0.00 H ATOM 7660 HE ARG B 124 62.638 70.691 73.988 1.00 0.00 H ATOM 7661 HH12 ARG B 124 63.172 74.718 74.390 1.00 0.00 H ATOM 7662 HH11 ARG B 124 63.276 73.680 75.859 1.00 0.00 H ATOM 7663 HH22 ARG B 124 62.758 73.775 72.336 1.00 0.00 H ATOM 7664 HH21 ARG B 124 62.535 71.994 72.186 1.00 0.00 H ATOM 7665 H ARG B 124 59.923 70.800 79.174 1.00 0.00 H ATOM 7666 N GLY B 125 57.394 71.992 77.921 1.00 14.09 N ATOM 7667 CA GLY B 125 55.995 72.251 77.600 1.00 13.44 C ATOM 7668 C GLY B 125 55.653 71.948 76.137 1.00 12.89 C ATOM 7669 O GLY B 125 55.966 70.876 75.589 1.00 13.49 O ATOM 7670 HA3 GLY B 125 55.781 73.302 77.797 1.00 0.00 H ATOM 7671 HA2 GLY B 125 55.370 71.628 78.240 1.00 0.00 H ATOM 7672 H GLY B 125 57.636 71.348 78.701 1.00 0.00 H ATOM 7673 N LEU B 126 55.039 72.922 75.486 1.00 12.39 N ATOM 7674 CA LEU B 126 54.532 72.720 74.115 1.00 13.07 C ATOM 7675 C LEU B 126 55.625 72.314 73.140 1.00 13.04 C ATOM 7676 O LEU B 126 55.378 71.543 72.196 1.00 14.45 O ATOM 7677 CB LEU B 126 53.859 73.973 73.572 1.00 14.10 C ATOM 7678 CG LEU B 126 52.587 74.451 74.257 1.00 14.12 C ATOM 7679 CD1 LEU B 126 52.126 75.799 73.657 1.00 18.18 C ATOM 7680 CD2 LEU B 126 51.492 73.458 74.109 1.00 14.22 C ATOM 7681 HA LEU B 126 53.807 71.910 74.196 1.00 0.00 H ATOM 7682 HB2 LEU B 126 54.585 74.784 73.632 1.00 0.00 H ATOM 7683 HB3 LEU B 126 53.614 73.783 72.527 1.00 0.00 H ATOM 7684 HG LEU B 126 52.812 74.576 75.316 1.00 0.00 H ATOM 7685 HD21 LEU B 126 51.282 73.306 73.050 1.00 0.00 H ATOM 7686 HD22 LEU B 126 51.797 72.513 74.560 1.00 0.00 H ATOM 7687 HD23 LEU B 126 50.597 73.829 74.609 1.00 0.00 H ATOM 7688 HD11 LEU B 126 52.908 76.545 73.799 1.00 0.00 H ATOM 7689 HD12 LEU B 126 51.931 75.673 72.592 1.00 0.00 H ATOM 7690 HD13 LEU B 126 51.215 76.126 74.159 1.00 0.00 H ATOM 7691 H LEU B 126 54.911 73.845 75.948 1.00 0.00 H ATOM 7692 N LYS B 127 56.845 72.804 73.382 1.00 14.47 N ATOM 7693 CA LYS B 127 57.967 72.501 72.493 1.00 16.33 C ATOM 7694 C LYS B 127 58.351 71.034 72.535 1.00 16.32 C ATOM 7695 O LYS B 127 58.810 70.485 71.529 1.00 18.77 O ATOM 7696 CB LYS B 127 59.185 73.357 72.834 1.00 18.16 C ATOM 7697 CG LYS B 127 58.902 74.850 72.661 1.00 22.50 C ATOM 7698 CD LYS B 127 60.168 75.670 72.850 1.00 26.45 C ATOM 7699 HA LYS B 127 57.633 72.736 71.482 1.00 0.00 H ATOM 7700 HB2 LYS B 127 59.468 73.170 73.870 1.00 0.00 H ATOM 7701 HB3 LYS B 127 60.008 73.076 72.177 1.00 0.00 H ATOM 7702 HG2 LYS B 127 58.510 75.025 71.659 1.00 0.00 H ATOM 7703 HG3 LYS B 127 58.162 75.161 73.399 1.00 0.00 H ATOM 7704 HD2 LYS B 127 60.562 75.502 73.852 1.00 0.00 H ATOM 7705 HD3 LYS B 127 60.910 75.366 72.111 1.00 0.00 H ATOM 7706 H LYS B 127 56.999 73.409 74.214 1.00 0.00 H ATOM 7707 N ALA B 128 58.163 70.401 73.687 1.00 14.10 N ATOM 7708 CA ALA B 128 58.444 68.980 73.805 1.00 14.30 C ATOM 7709 C ALA B 128 57.345 68.136 73.167 1.00 14.19 C ATOM 7710 O ALA B 128 57.597 67.032 72.719 1.00 14.63 O ATOM 7711 CB ALA B 128 58.631 68.599 75.272 1.00 14.50 C ATOM 7712 HA ALA B 128 59.369 68.775 73.266 1.00 0.00 H ATOM 7713 HB1 ALA B 128 59.465 69.164 75.689 1.00 0.00 H ATOM 7714 HB2 ALA B 128 57.721 68.830 75.825 1.00 0.00 H ATOM 7715 HB3 ALA B 128 58.841 67.532 75.345 1.00 0.00 H ATOM 7716 H ALA B 128 57.811 70.927 74.512 1.00 0.00 H ATOM 7717 N VAL B 129 56.106 68.629 73.176 1.00 12.67 N ATOM 7718 CA VAL B 129 54.987 67.876 72.583 1.00 12.94 C ATOM 7719 C VAL B 129 55.131 67.766 71.056 1.00 13.35 C ATOM 7720 O VAL B 129 54.946 66.682 70.488 1.00 14.28 O ATOM 7721 CB VAL B 129 53.637 68.548 72.950 1.00 11.58 C ATOM 7722 CG1 VAL B 129 52.478 67.837 72.290 1.00 12.19 C ATOM 7723 CG2 VAL B 129 53.445 68.570 74.455 1.00 12.72 C ATOM 7724 HA VAL B 129 55.006 66.866 72.993 1.00 0.00 H ATOM 7725 HB VAL B 129 53.664 69.574 72.582 1.00 0.00 H ATOM 7726 HG11 VAL B 129 52.602 67.870 71.208 1.00 0.00 H ATOM 7727 HG12 VAL B 129 52.453 66.799 72.622 1.00 0.00 H ATOM 7728 HG13 VAL B 129 51.546 68.331 72.566 1.00 0.00 H ATOM 7729 HG21 VAL B 129 53.447 67.548 74.835 1.00 0.00 H ATOM 7730 HG22 VAL B 129 54.257 69.132 74.915 1.00 0.00 H ATOM 7731 HG23 VAL B 129 52.493 69.045 74.692 1.00 0.00 H ATOM 7732 H VAL B 129 55.927 69.558 73.608 1.00 0.00 H ATOM 7733 N GLY B 130 55.463 68.879 70.413 1.00 13.89 N ATOM 7734 CA GLY B 130 55.601 68.918 68.952 1.00 13.82 C ATOM 7735 C GLY B 130 54.251 68.938 68.275 1.00 14.58 C ATOM 7736 O GLY B 130 53.210 68.854 68.924 1.00 13.49 O ATOM 7737 HA3 GLY B 130 56.151 68.036 68.623 1.00 0.00 H ATOM 7738 HA2 GLY B 130 56.153 69.815 68.671 1.00 0.00 H ATOM 7739 H GLY B 130 55.630 69.748 70.960 1.00 0.00 H ATOM 7740 N PRO B 131 54.257 69.082 66.951 1.00 15.18 N ATOM 7741 CA PRO B 131 53.052 69.398 66.210 1.00 15.67 C ATOM 7742 C PRO B 131 52.309 68.200 65.639 1.00 16.10 C ATOM 7743 O PRO B 131 51.333 68.399 64.883 1.00 17.48 O ATOM 7744 CB PRO B 131 53.587 70.278 65.077 1.00 18.10 C ATOM 7745 CG PRO B 131 54.933 69.643 64.765 1.00 18.72 C ATOM 7746 CD PRO B 131 55.464 69.134 66.106 1.00 17.01 C ATOM 7747 HA PRO B 131 52.308 69.861 66.859 1.00 0.00 H ATOM 7748 HD3 PRO B 131 55.910 68.145 66.000 1.00 0.00 H ATOM 7749 HD2 PRO B 131 56.202 69.821 66.520 1.00 0.00 H ATOM 7750 HG3 PRO B 131 55.614 70.381 64.340 1.00 0.00 H ATOM 7751 HG2 PRO B 131 54.812 68.817 64.064 1.00 0.00 H ATOM 7752 HB2 PRO B 131 52.927 70.247 64.210 1.00 0.00 H ATOM 7753 HB3 PRO B 131 53.706 71.311 65.404 1.00 0.00 H ATOM 7754 N TYR B 132 52.697 66.969 65.984 1.00 14.75 N ATOM 7755 CA TYR B 132 52.070 65.810 65.319 1.00 15.39 C ATOM 7756 C TYR B 132 51.195 64.939 66.193 1.00 13.61 C ATOM 7757 O TYR B 132 50.731 63.867 65.754 1.00 16.63 O ATOM 7758 CB TYR B 132 53.152 64.919 64.690 1.00 17.07 C ATOM 7759 CG TYR B 132 53.917 65.623 63.615 1.00 17.08 C ATOM 7760 CD1 TYR B 132 53.283 66.004 62.421 1.00 17.05 C ATOM 7761 CD2 TYR B 132 55.267 65.864 63.749 1.00 18.93 C ATOM 7762 CE1 TYR B 132 53.983 66.630 61.410 1.00 19.17 C ATOM 7763 CE2 TYR B 132 55.968 66.485 62.749 1.00 20.08 C ATOM 7764 CZ TYR B 132 55.326 66.872 61.585 1.00 19.25 C ATOM 7765 OH TYR B 132 56.016 67.491 60.559 1.00 22.78 O ATOM 7766 HA TYR B 132 51.409 66.255 64.576 1.00 0.00 H ATOM 7767 HB3 TYR B 132 52.674 64.038 64.261 1.00 0.00 H ATOM 7768 HB2 TYR B 132 53.848 64.610 65.470 1.00 0.00 H ATOM 7769 HD2 TYR B 132 55.782 65.558 64.659 1.00 0.00 H ATOM 7770 HE2 TYR B 132 57.034 66.675 62.870 1.00 0.00 H ATOM 7771 HE1 TYR B 132 53.481 66.927 60.489 1.00 0.00 H ATOM 7772 HD1 TYR B 132 52.220 65.802 62.291 1.00 0.00 H ATOM 7773 HH TYR B 132 56.734 66.890 60.236 1.00 0.00 H ATOM 7774 H TYR B 132 53.429 66.830 66.709 1.00 0.00 H ATOM 7775 N VAL B 133 50.989 65.315 67.439 1.00 14.46 N ATOM 7776 CA VAL B 133 50.272 64.415 68.356 1.00 13.84 C ATOM 7777 C VAL B 133 48.779 64.264 68.039 1.00 15.24 C ATOM 7778 O VAL B 133 48.225 63.212 68.266 1.00 15.43 O ATOM 7779 CB VAL B 133 50.492 64.849 69.826 1.00 14.12 C ATOM 7780 CG1 VAL B 133 49.784 63.870 70.793 1.00 15.95 C ATOM 7781 CG2 VAL B 133 51.985 64.860 70.123 1.00 15.09 C ATOM 7782 HA VAL B 133 50.702 63.424 68.207 1.00 0.00 H ATOM 7783 HB VAL B 133 50.073 65.845 69.968 1.00 0.00 H ATOM 7784 HG11 VAL B 133 48.715 63.863 70.582 1.00 0.00 H ATOM 7785 HG12 VAL B 133 50.190 62.868 70.655 1.00 0.00 H ATOM 7786 HG13 VAL B 133 49.951 64.192 71.821 1.00 0.00 H ATOM 7787 HG21 VAL B 133 52.392 63.860 69.970 1.00 0.00 H ATOM 7788 HG22 VAL B 133 52.482 65.562 69.454 1.00 0.00 H ATOM 7789 HG23 VAL B 133 52.146 65.165 71.157 1.00 0.00 H ATOM 7790 H VAL B 133 51.330 66.240 67.771 1.00 0.00 H ATOM 7791 N VAL B 134 48.114 65.303 67.515 1.00 14.04 N ATOM 7792 CA VAL B 134 46.652 65.156 67.300 1.00 13.88 C ATOM 7793 C VAL B 134 46.297 64.029 66.340 1.00 14.74 C ATOM 7794 O VAL B 134 45.402 63.240 66.626 1.00 14.88 O ATOM 7795 CB VAL B 134 46.017 66.476 66.835 1.00 15.11 C ATOM 7796 CG1 VAL B 134 44.510 66.270 66.633 1.00 16.13 C ATOM 7797 CG2 VAL B 134 46.244 67.580 67.870 1.00 16.82 C ATOM 7798 HA VAL B 134 46.236 64.888 68.271 1.00 0.00 H ATOM 7799 HB VAL B 134 46.483 66.777 65.897 1.00 0.00 H ATOM 7800 HG11 VAL B 134 44.348 65.500 65.878 1.00 0.00 H ATOM 7801 HG12 VAL B 134 44.058 65.958 67.575 1.00 0.00 H ATOM 7802 HG13 VAL B 134 44.058 67.205 66.303 1.00 0.00 H ATOM 7803 HG21 VAL B 134 45.793 67.286 68.818 1.00 0.00 H ATOM 7804 HG22 VAL B 134 47.314 67.733 68.008 1.00 0.00 H ATOM 7805 HG23 VAL B 134 45.786 68.505 67.519 1.00 0.00 H ATOM 7806 H VAL B 134 48.607 66.185 67.267 1.00 0.00 H ATOM 7807 N THR B 135 46.970 63.958 65.185 1.00 12.50 N ATOM 7808 CA THR B 135 46.631 62.925 64.216 1.00 14.39 C ATOM 7809 C THR B 135 47.030 61.556 64.746 1.00 13.28 C ATOM 7810 O THR B 135 46.480 60.539 64.281 1.00 14.14 O ATOM 7811 CB THR B 135 47.321 63.180 62.866 1.00 15.03 C ATOM 7812 OG1 THR B 135 48.738 63.340 63.068 1.00 16.99 O ATOM 7813 CG2 THR B 135 46.744 64.418 62.202 1.00 17.93 C ATOM 7814 HA THR B 135 45.552 62.953 64.061 1.00 0.00 H ATOM 7815 HB THR B 135 47.147 62.325 62.213 1.00 0.00 H ATOM 7816 HG1 THR B 135 48.900 64.109 63.670 1.00 0.00 H ATOM 7817 HG23 THR B 135 45.672 64.284 62.055 1.00 0.00 H ATOM 7818 HG21 THR B 135 46.919 65.285 62.839 1.00 0.00 H ATOM 7819 HG22 THR B 135 47.228 64.570 61.237 1.00 0.00 H ATOM 7820 H THR B 135 47.731 64.637 64.981 1.00 0.00 H ATOM 7821 N LYS B 136 48.038 61.513 65.624 1.00 13.45 N ATOM 7822 CA LYS B 136 48.439 60.239 66.220 1.00 13.43 C ATOM 7823 C LYS B 136 47.416 59.771 67.240 1.00 14.42 C ATOM 7824 O LYS B 136 47.075 58.588 67.269 1.00 17.04 O ATOM 7825 CB LYS B 136 49.833 60.355 66.818 1.00 12.68 C ATOM 7826 CG LYS B 136 50.889 60.608 65.768 1.00 13.74 C ATOM 7827 CD LYS B 136 52.266 60.648 66.371 1.00 14.12 C ATOM 7828 CE LYS B 136 53.308 60.996 65.329 1.00 14.65 C ATOM 7829 NZ LYS B 136 54.677 61.119 65.978 1.00 16.40 N ATOM 7830 HA LYS B 136 48.476 59.480 65.439 1.00 0.00 H ATOM 7831 HB2 LYS B 136 49.842 61.180 67.530 1.00 0.00 H ATOM 7832 HB3 LYS B 136 50.070 59.426 67.337 1.00 0.00 H ATOM 7833 HG2 LYS B 136 50.850 59.810 65.026 1.00 0.00 H ATOM 7834 HG3 LYS B 136 50.686 61.563 65.284 1.00 0.00 H ATOM 7835 HD2 LYS B 136 52.287 61.399 67.161 1.00 0.00 H ATOM 7836 HD3 LYS B 136 52.498 59.671 66.794 1.00 0.00 H ATOM 7837 HE2 LYS B 136 53.045 61.944 64.859 1.00 0.00 H ATOM 7838 HE3 LYS B 136 53.337 60.212 64.572 1.00 0.00 H ATOM 7839 HZ1 LYS B 136 54.652 61.868 66.699 1.00 0.00 H ATOM 7840 HZ2 LYS B 136 54.930 60.215 66.425 1.00 0.00 H ATOM 7841 HZ3 LYS B 136 55.383 61.358 65.253 1.00 0.00 H ATOM 7842 H LYS B 136 48.538 62.387 65.883 1.00 0.00 H ATOM 7843 N ALA B 137 46.935 60.705 68.066 1.00 14.42 N ATOM 7844 CA ALA B 137 46.146 60.384 69.243 1.00 15.47 C ATOM 7845 C ALA B 137 44.634 60.422 68.987 1.00 14.25 C ATOM 7846 O ALA B 137 43.876 59.791 69.735 1.00 16.46 O ATOM 7847 CB ALA B 137 46.529 61.348 70.372 1.00 18.41 C ATOM 7848 HA ALA B 137 46.373 59.356 69.526 1.00 0.00 H ATOM 7849 HB1 ALA B 137 47.590 61.239 70.597 1.00 0.00 H ATOM 7850 HB2 ALA B 137 46.326 62.372 70.058 1.00 0.00 H ATOM 7851 HB3 ALA B 137 45.942 61.116 71.261 1.00 0.00 H ATOM 7852 H ALA B 137 47.134 61.704 67.857 1.00 0.00 H ATOM 7853 N MET B 138 44.177 61.109 67.939 1.00 13.20 N ATOM 7854 CA MET B 138 42.717 61.263 67.764 1.00 13.31 C ATOM 7855 C MET B 138 42.053 59.934 67.404 1.00 12.51 C ATOM 7856 O MET B 138 42.702 59.052 66.768 1.00 12.86 O ATOM 7857 CB MET B 138 42.370 62.337 66.737 1.00 14.14 C ATOM 7858 CG MET B 138 42.761 61.980 65.341 1.00 14.61 C ATOM 7859 SD MET B 138 42.546 63.452 64.298 1.00 16.60 S ATOM 7860 CE MET B 138 42.812 62.743 62.705 1.00 17.92 C ATOM 7861 HA MET B 138 42.321 61.591 68.725 1.00 0.00 H ATOM 7862 HB2 MET B 138 41.293 62.502 66.762 1.00 0.00 H ATOM 7863 HB3 MET B 138 42.884 63.258 67.014 1.00 0.00 H ATOM 7864 HG2 MET B 138 42.127 61.172 64.975 1.00 0.00 H ATOM 7865 HG3 MET B 138 43.803 61.661 65.319 1.00 0.00 H ATOM 7866 HE1 MET B 138 43.813 62.313 62.663 1.00 0.00 H ATOM 7867 HE2 MET B 138 42.072 61.963 62.528 1.00 0.00 H ATOM 7868 HE3 MET B 138 42.715 63.517 61.944 1.00 0.00 H ATOM 7869 H MET B 138 44.838 61.530 67.255 1.00 0.00 H ATOM 7870 N ALA B 139 40.772 59.774 67.745 1.00 12.10 N ATOM 7871 CA ALA B 139 40.121 58.477 67.545 1.00 12.94 C ATOM 7872 C ALA B 139 40.005 58.106 66.063 1.00 11.78 C ATOM 7873 O ALA B 139 39.970 56.914 65.735 1.00 14.43 O ATOM 7874 CB ALA B 139 38.744 58.458 68.207 1.00 15.15 C ATOM 7875 HA ALA B 139 40.755 57.727 68.018 1.00 0.00 H ATOM 7876 HB1 ALA B 139 38.854 58.637 69.277 1.00 0.00 H ATOM 7877 HB2 ALA B 139 38.121 59.238 67.769 1.00 0.00 H ATOM 7878 HB3 ALA B 139 38.278 57.486 68.046 1.00 0.00 H ATOM 7879 H ALA B 139 40.238 60.568 68.152 1.00 0.00 H ATOM 7880 N SER B 140 40.008 59.107 65.190 1.00 10.43 N ATOM 7881 CA SER B 140 39.927 58.888 63.758 1.00 9.82 C ATOM 7882 C SER B 140 41.269 58.766 63.049 1.00 10.02 C ATOM 7883 O SER B 140 41.307 58.827 61.826 1.00 11.50 O ATOM 7884 CB SER B 140 39.119 60.001 63.106 1.00 10.86 C ATOM 7885 OG SER B 140 39.766 61.235 63.345 1.00 12.14 O ATOM 7886 HA SER B 140 39.437 57.921 63.646 1.00 0.00 H ATOM 7887 HB2 SER B 140 38.116 60.024 63.533 1.00 0.00 H ATOM 7888 HB3 SER B 140 39.052 59.824 62.033 1.00 0.00 H ATOM 7889 HG SER B 140 39.826 61.391 64.321 1.00 0.00 H ATOM 7890 H SER B 140 40.071 60.082 65.545 1.00 0.00 H ATOM 7891 N GLY B 141 42.361 58.624 63.803 1.00 9.87 N ATOM 7892 CA GLY B 141 43.672 58.598 63.191 1.00 10.97 C ATOM 7893 C GLY B 141 43.795 57.603 62.054 1.00 10.23 C ATOM 7894 O GLY B 141 44.378 57.923 61.012 1.00 11.81 O ATOM 7895 HA3 GLY B 141 44.404 58.339 63.956 1.00 0.00 H ATOM 7896 HA2 GLY B 141 43.891 59.593 62.803 1.00 0.00 H ATOM 7897 H GLY B 141 42.269 58.532 64.835 1.00 0.00 H ATOM 7898 N VAL B 142 43.254 56.402 62.218 1.00 9.89 N ATOM 7899 CA VAL B 142 43.421 55.392 61.189 1.00 10.78 C ATOM 7900 C VAL B 142 42.783 55.822 59.868 1.00 10.90 C ATOM 7901 O VAL B 142 43.409 55.670 58.803 1.00 15.56 O ATOM 7902 CB VAL B 142 42.875 54.043 61.673 1.00 11.77 C ATOM 7903 CG1 VAL B 142 42.793 53.040 60.514 1.00 15.43 C ATOM 7904 CG2 VAL B 142 43.807 53.494 62.748 1.00 12.42 C ATOM 7905 HA VAL B 142 44.487 55.275 60.996 1.00 0.00 H ATOM 7906 HB VAL B 142 41.872 54.190 62.074 1.00 0.00 H ATOM 7907 HG11 VAL B 142 42.130 53.432 59.743 1.00 0.00 H ATOM 7908 HG12 VAL B 142 43.788 52.887 60.096 1.00 0.00 H ATOM 7909 HG13 VAL B 142 42.403 52.091 60.883 1.00 0.00 H ATOM 7910 HG21 VAL B 142 44.804 53.361 62.329 1.00 0.00 H ATOM 7911 HG22 VAL B 142 43.852 54.196 63.581 1.00 0.00 H ATOM 7912 HG23 VAL B 142 43.428 52.534 63.100 1.00 0.00 H ATOM 7913 H VAL B 142 42.713 56.186 63.080 1.00 0.00 H ATOM 7914 N SER B 143 41.586 56.404 59.904 1.00 9.44 N ATOM 7915 CA SER B 143 41.001 56.843 58.626 1.00 9.91 C ATOM 7916 C SER B 143 41.696 58.091 58.097 1.00 9.30 C ATOM 7917 O SER B 143 42.029 58.169 56.906 1.00 12.50 O ATOM 7918 CB SER B 143 39.495 57.032 58.742 1.00 10.05 C ATOM 7919 OG SER B 143 39.135 57.928 59.780 1.00 10.39 O ATOM 7920 HA SER B 143 41.167 56.052 57.895 1.00 0.00 H ATOM 7921 HB2 SER B 143 39.036 56.064 58.942 1.00 0.00 H ATOM 7922 HB3 SER B 143 39.118 57.423 57.797 1.00 0.00 H ATOM 7923 HG SER B 143 39.465 57.578 60.645 1.00 0.00 H ATOM 7924 H SER B 143 41.082 56.544 60.803 1.00 0.00 H ATOM 7925 N ALA B 144 41.969 59.070 58.957 1.00 9.53 N ATOM 7926 CA ALA B 144 42.568 60.317 58.478 1.00 11.82 C ATOM 7927 C ALA B 144 43.918 60.069 57.864 1.00 11.71 C ATOM 7928 O ALA B 144 44.250 60.667 56.824 1.00 14.79 O ATOM 7929 CB ALA B 144 42.692 61.278 59.634 1.00 14.13 C ATOM 7930 HA ALA B 144 41.926 60.744 57.707 1.00 0.00 H ATOM 7931 HB1 ALA B 144 41.703 61.479 60.045 1.00 0.00 H ATOM 7932 HB2 ALA B 144 43.325 60.838 60.405 1.00 0.00 H ATOM 7933 HB3 ALA B 144 43.138 62.209 59.284 1.00 0.00 H ATOM 7934 H ALA B 144 41.757 58.949 59.968 1.00 0.00 H ATOM 7935 N CYS B 145 44.737 59.240 58.507 1.00 9.37 N ATOM 7936 CA CYS B 145 46.107 59.056 58.048 1.00 10.35 C ATOM 7937 C CYS B 145 46.216 58.262 56.768 1.00 10.24 C ATOM 7938 O CYS B 145 47.303 58.230 56.154 1.00 12.08 O ATOM 7939 CB CYS B 145 46.942 58.352 59.117 1.00 11.09 C ATOM 7940 SG CYS B 145 47.356 59.414 60.519 1.00 13.59 S ATOM 7941 HA CYS B 145 46.483 60.060 57.853 1.00 0.00 H ATOM 7942 HB2 CYS B 145 47.869 58.006 58.660 1.00 0.00 H ATOM 7943 HB3 CYS B 145 46.379 57.495 59.487 1.00 0.00 H ATOM 7944 HG CYS B 145 48.107 58.699 61.430 1.00 0.00 H ATOM 7945 H CYS B 145 44.397 58.721 59.342 1.00 0.00 H ATOM 7946 N LEU B 146 45.136 57.573 56.394 1.00 9.71 N ATOM 7947 CA LEU B 146 45.117 56.792 55.157 1.00 9.00 C ATOM 7948 C LEU B 146 44.386 57.477 54.000 1.00 9.27 C ATOM 7949 O LEU B 146 44.803 57.332 52.844 1.00 9.56 O ATOM 7950 CB LEU B 146 44.486 55.421 55.393 1.00 9.90 C ATOM 7951 CG LEU B 146 45.381 54.316 55.948 1.00 9.96 C ATOM 7952 CD1 LEU B 146 46.151 54.749 57.215 1.00 10.74 C ATOM 7953 CD2 LEU B 146 44.541 53.050 56.209 1.00 9.97 C ATOM 7954 HA LEU B 146 46.163 56.692 54.866 1.00 0.00 H ATOM 7955 HB2 LEU B 146 43.663 55.557 56.094 1.00 0.00 H ATOM 7956 HB3 LEU B 146 44.094 55.074 54.437 1.00 0.00 H ATOM 7957 HG LEU B 146 46.140 54.096 55.197 1.00 0.00 H ATOM 7958 HD21 LEU B 146 43.757 53.278 56.931 1.00 0.00 H ATOM 7959 HD22 LEU B 146 44.090 52.716 55.275 1.00 0.00 H ATOM 7960 HD23 LEU B 146 45.184 52.264 56.605 1.00 0.00 H ATOM 7961 HD11 LEU B 146 46.784 55.604 56.979 1.00 0.00 H ATOM 7962 HD12 LEU B 146 45.440 55.025 57.994 1.00 0.00 H ATOM 7963 HD13 LEU B 146 46.770 53.922 57.563 1.00 0.00 H ATOM 7964 H LEU B 146 44.288 57.592 56.996 1.00 0.00 H ATOM 7965 N ALA B 147 43.318 58.213 54.309 1.00 11.13 N ATOM 7966 CA ALA B 147 42.525 58.829 53.242 1.00 11.18 C ATOM 7967 C ALA B 147 43.333 59.853 52.457 1.00 11.45 C ATOM 7968 O ALA B 147 43.156 59.968 51.237 1.00 11.59 O ATOM 7969 CB ALA B 147 41.289 59.471 53.823 1.00 13.00 C ATOM 7970 HA ALA B 147 42.231 58.042 52.548 1.00 0.00 H ATOM 7971 HB1 ALA B 147 40.689 58.712 54.325 1.00 0.00 H ATOM 7972 HB2 ALA B 147 41.582 60.237 54.541 1.00 0.00 H ATOM 7973 HB3 ALA B 147 40.707 59.926 53.022 1.00 0.00 H ATOM 7974 H ALA B 147 43.049 58.349 55.304 1.00 0.00 H ATOM 7975 N THR B 148 44.225 60.580 53.132 1.00 13.31 N ATOM 7976 CA THR B 148 45.062 61.555 52.400 1.00 15.05 C ATOM 7977 C THR B 148 46.036 60.920 51.438 1.00 14.24 C ATOM 7978 O THR B 148 46.004 61.209 50.233 1.00 14.51 O ATOM 7979 CB THR B 148 45.779 62.553 53.336 1.00 18.85 C ATOM 7980 OG1 THR B 148 44.805 63.461 53.811 1.00 22.39 O ATOM 7981 CG2 THR B 148 46.845 63.349 52.618 1.00 20.79 C ATOM 7982 HA THR B 148 44.353 62.121 51.796 1.00 0.00 H ATOM 7983 HB THR B 148 46.260 61.991 54.136 1.00 0.00 H ATOM 7984 HG1 THR B 148 44.105 62.964 54.304 1.00 0.00 H ATOM 7985 HG23 THR B 148 47.611 62.671 52.241 1.00 0.00 H ATOM 7986 HG21 THR B 148 46.394 63.889 51.786 1.00 0.00 H ATOM 7987 HG22 THR B 148 47.296 64.058 53.312 1.00 0.00 H ATOM 7988 H THR B 148 44.330 60.463 54.160 1.00 0.00 H ATOM 7989 N PRO B 149 46.932 60.043 51.934 1.00 12.82 N ATOM 7990 CA PRO B 149 47.892 59.533 50.986 1.00 13.15 C ATOM 7991 C PRO B 149 47.304 58.677 49.879 1.00 12.32 C ATOM 7992 O PRO B 149 47.863 58.625 48.788 1.00 15.19 O ATOM 7993 CB PRO B 149 48.871 58.732 51.862 1.00 14.15 C ATOM 7994 CG PRO B 149 48.066 58.374 53.056 1.00 13.13 C ATOM 7995 CD PRO B 149 47.220 59.572 53.299 1.00 13.42 C ATOM 7996 HA PRO B 149 48.357 60.348 50.431 1.00 0.00 H ATOM 7997 HD3 PRO B 149 46.303 59.307 53.826 1.00 0.00 H ATOM 7998 HD2 PRO B 149 47.761 60.327 53.870 1.00 0.00 H ATOM 7999 HG3 PRO B 149 48.711 58.176 53.912 1.00 0.00 H ATOM 8000 HG2 PRO B 149 47.448 57.498 52.858 1.00 0.00 H ATOM 8001 HB2 PRO B 149 49.215 57.838 51.343 1.00 0.00 H ATOM 8002 HB3 PRO B 149 49.731 59.341 52.141 1.00 0.00 H ATOM 8003 N PHE B 150 46.203 57.984 50.154 1.00 10.40 N ATOM 8004 CA PHE B 150 45.573 57.214 49.113 1.00 9.51 C ATOM 8005 C PHE B 150 44.607 58.017 48.244 1.00 9.51 C ATOM 8006 O PHE B 150 43.952 57.441 47.359 1.00 10.50 O ATOM 8007 CB PHE B 150 44.907 55.992 49.724 1.00 10.34 C ATOM 8008 CG PHE B 150 45.894 54.950 50.196 1.00 9.89 C ATOM 8009 CD1 PHE B 150 46.651 54.226 49.282 1.00 10.76 C ATOM 8010 CD2 PHE B 150 46.079 54.695 51.544 1.00 10.59 C ATOM 8011 CE1 PHE B 150 47.551 53.233 49.716 1.00 12.06 C ATOM 8012 CE2 PHE B 150 46.970 53.712 51.971 1.00 11.61 C ATOM 8013 CZ PHE B 150 47.715 53.010 51.060 1.00 11.50 C ATOM 8014 HA PHE B 150 46.357 56.897 48.425 1.00 0.00 H ATOM 8015 HB2 PHE B 150 44.308 56.313 50.576 1.00 0.00 H ATOM 8016 HB3 PHE B 150 44.257 55.540 48.974 1.00 0.00 H ATOM 8017 HD2 PHE B 150 45.520 55.271 52.282 1.00 0.00 H ATOM 8018 HE2 PHE B 150 47.075 53.501 53.035 1.00 0.00 H ATOM 8019 HZ PHE B 150 48.440 52.272 51.404 1.00 0.00 H ATOM 8020 HE1 PHE B 150 48.113 52.646 48.990 1.00 0.00 H ATOM 8021 HD1 PHE B 150 46.547 54.429 48.216 1.00 0.00 H ATOM 8022 H PHE B 150 45.800 57.998 51.113 1.00 0.00 H ATOM 8023 N LYS B 151 44.495 59.334 48.489 1.00 9.31 N ATOM 8024 CA LYS B 151 43.711 60.248 47.628 1.00 9.29 C ATOM 8025 C LYS B 151 42.262 59.768 47.539 1.00 8.65 C ATOM 8026 O LYS B 151 41.639 59.793 46.488 1.00 10.44 O ATOM 8027 CB LYS B 151 44.351 60.366 46.251 1.00 11.87 C ATOM 8028 CG LYS B 151 45.795 60.870 46.347 1.00 15.33 C ATOM 8029 CD LYS B 151 46.226 61.382 44.974 1.00 20.73 C ATOM 8030 CE LYS B 151 47.686 61.805 44.983 1.00 25.74 C ATOM 8031 NZ LYS B 151 47.839 62.973 45.883 1.00 28.87 N ATOM 8032 HA LYS B 151 43.708 61.244 48.072 1.00 0.00 H ATOM 8033 HB2 LYS B 151 44.348 59.386 45.773 1.00 0.00 H ATOM 8034 HB3 LYS B 151 43.771 61.065 45.648 1.00 0.00 H ATOM 8035 HG2 LYS B 151 45.854 61.678 47.076 1.00 0.00 H ATOM 8036 HG3 LYS B 151 46.449 60.055 46.657 1.00 0.00 H ATOM 8037 HD2 LYS B 151 46.089 60.589 44.239 1.00 0.00 H ATOM 8038 HD3 LYS B 151 45.608 62.238 44.703 1.00 0.00 H ATOM 8039 HE2 LYS B 151 47.995 62.077 43.974 1.00 0.00 H ATOM 8040 HE3 LYS B 151 48.304 60.982 45.342 1.00 0.00 H ATOM 8041 HZ1 LYS B 151 47.247 63.755 45.538 1.00 0.00 H ATOM 8042 HZ2 LYS B 151 47.542 62.710 46.844 1.00 0.00 H ATOM 8043 HZ3 LYS B 151 48.835 63.271 45.896 1.00 0.00 H ATOM 8044 H LYS B 151 44.981 59.728 49.320 1.00 0.00 H ATOM 8045 N ILE B 152 41.706 59.394 48.694 1.00 8.89 N ATOM 8046 CA ILE B 152 40.312 58.951 48.779 1.00 8.59 C ATOM 8047 C ILE B 152 39.386 60.172 48.702 1.00 7.98 C ATOM 8048 O ILE B 152 39.609 61.156 49.392 1.00 9.10 O ATOM 8049 CB ILE B 152 40.118 58.210 50.114 1.00 8.80 C ATOM 8050 CG1 ILE B 152 41.033 56.985 50.160 1.00 9.97 C ATOM 8051 CG2 ILE B 152 38.644 57.879 50.369 1.00 10.15 C ATOM 8052 CD1 ILE B 152 40.747 55.947 49.057 1.00 12.93 C ATOM 8053 HA ILE B 152 40.071 58.281 47.954 1.00 0.00 H ATOM 8054 HB ILE B 152 40.409 58.865 50.935 1.00 0.00 H ATOM 8055 HG12 ILE B 152 42.064 57.323 50.054 1.00 0.00 H ATOM 8056 HG13 ILE B 152 40.908 56.500 51.128 1.00 0.00 H ATOM 8057 HD11 ILE B 152 39.722 55.588 49.155 1.00 0.00 H ATOM 8058 HD12 ILE B 152 40.879 56.411 48.080 1.00 0.00 H ATOM 8059 HD13 ILE B 152 41.438 55.110 49.159 1.00 0.00 H ATOM 8060 HG21 ILE B 152 38.066 58.802 50.401 1.00 0.00 H ATOM 8061 HG22 ILE B 152 38.271 57.243 49.566 1.00 0.00 H ATOM 8062 HG23 ILE B 152 38.550 57.356 51.321 1.00 0.00 H ATOM 8063 H ILE B 152 42.281 59.418 49.561 1.00 0.00 H ATOM 8064 N HIS B 153 38.359 60.108 47.839 1.00 8.18 N ATOM 8065 CA HIS B 153 37.375 61.188 47.729 1.00 8.12 C ATOM 8066 C HIS B 153 36.008 60.860 48.280 1.00 7.78 C ATOM 8067 O HIS B 153 35.210 61.790 48.450 1.00 8.97 O ATOM 8068 CB HIS B 153 37.248 61.657 46.262 1.00 8.82 C ATOM 8069 CG HIS B 153 38.313 62.613 45.866 1.00 9.11 C ATOM 8070 ND1 HIS B 153 38.243 63.362 44.710 1.00 11.41 N ATOM 8071 CD2 HIS B 153 39.459 62.976 46.496 1.00 11.04 C ATOM 8072 CE1 HIS B 153 39.295 64.154 44.649 1.00 10.83 C ATOM 8073 NE2 HIS B 153 40.048 63.947 45.718 1.00 12.14 N ATOM 8074 HA HIS B 153 37.764 61.990 48.356 1.00 0.00 H ATOM 8075 HB2 HIS B 153 37.304 60.784 45.612 1.00 0.00 H ATOM 8076 HB3 HIS B 153 36.280 62.142 46.134 1.00 0.00 H ATOM 8077 HD2 HIS B 153 39.839 62.576 47.436 1.00 0.00 H ATOM 8078 HE1 HIS B 153 39.510 64.863 43.849 1.00 0.00 H ATOM 8079 H HIS B 153 38.259 59.269 47.232 1.00 0.00 H ATOM 8080 N GLY B 154 35.708 59.583 48.505 1.00 8.19 N ATOM 8081 CA GLY B 154 34.385 59.186 48.993 1.00 8.81 C ATOM 8082 C GLY B 154 34.287 59.283 50.505 1.00 8.68 C ATOM 8083 O GLY B 154 34.831 60.192 51.126 1.00 9.65 O ATOM 8084 HA3 GLY B 154 34.193 58.156 48.692 1.00 0.00 H ATOM 8085 HA2 GLY B 154 33.634 59.839 48.548 1.00 0.00 H ATOM 8086 H GLY B 154 36.427 58.852 48.331 1.00 0.00 H ATOM 8087 N VAL B 155 33.559 58.361 51.116 1.00 9.42 N ATOM 8088 CA VAL B 155 33.424 58.410 52.567 1.00 10.97 C ATOM 8089 C VAL B 155 34.777 58.270 53.242 1.00 10.90 C ATOM 8090 O VAL B 155 35.671 57.599 52.718 1.00 12.03 O ATOM 8091 CB VAL B 155 32.458 57.348 53.131 1.00 14.51 C ATOM 8092 CG1 VAL B 155 31.109 57.589 52.644 1.00 17.43 C ATOM 8093 CG2 VAL B 155 32.907 55.913 52.874 1.00 14.32 C ATOM 8094 HA VAL B 155 32.995 59.387 52.789 1.00 0.00 H ATOM 8095 HB VAL B 155 32.467 57.456 54.216 1.00 0.00 H ATOM 8096 HG11 VAL B 155 30.780 58.578 52.964 1.00 0.00 H ATOM 8097 HG12 VAL B 155 31.102 57.537 51.555 1.00 0.00 H ATOM 8098 HG13 VAL B 155 30.437 56.833 53.049 1.00 0.00 H ATOM 8099 HG21 VAL B 155 32.984 55.745 51.800 1.00 0.00 H ATOM 8100 HG22 VAL B 155 33.879 55.749 53.340 1.00 0.00 H ATOM 8101 HG23 VAL B 155 32.178 55.224 53.300 1.00 0.00 H ATOM 8102 H VAL B 155 33.090 57.612 50.568 1.00 0.00 H ATOM 8103 N ASN B 156 34.926 58.877 54.417 1.00 11.20 N ATOM 8104 CA ASN B 156 36.177 58.778 55.143 1.00 11.54 C ATOM 8105 C ASN B 156 35.823 58.974 56.593 1.00 11.11 C ATOM 8106 O ASN B 156 35.526 60.102 56.999 1.00 14.37 O ATOM 8107 CB ASN B 156 37.123 59.898 54.606 1.00 13.48 C ATOM 8108 CG ASN B 156 38.338 60.265 55.544 1.00 14.18 C ATOM 8109 OD1 ASN B 156 38.685 59.570 56.475 1.00 15.95 O ATOM 8110 ND2 ASN B 156 38.950 61.403 55.265 1.00 15.41 N ATOM 8111 HA ASN B 156 36.690 57.824 55.020 1.00 0.00 H ATOM 8112 HB2 ASN B 156 37.525 59.568 53.648 1.00 0.00 H ATOM 8113 HB3 ASN B 156 36.528 60.799 54.458 1.00 0.00 H ATOM 8114 HD22 ASN B 156 38.632 61.981 54.461 1.00 0.00 H ATOM 8115 HD21 ASN B 156 39.749 61.721 55.850 1.00 0.00 H ATOM 8116 H ASN B 156 34.139 59.427 54.817 1.00 0.00 H ATOM 8117 N TYR B 157 35.796 57.904 57.368 1.00 8.02 N ATOM 8118 CA TYR B 157 35.621 58.038 58.809 1.00 8.34 C ATOM 8119 C TYR B 157 36.024 56.745 59.488 1.00 7.85 C ATOM 8120 O TYR B 157 36.280 55.754 58.803 1.00 8.37 O ATOM 8121 CB TYR B 157 34.214 58.524 59.231 1.00 9.35 C ATOM 8122 CG TYR B 157 33.061 57.798 58.640 1.00 10.30 C ATOM 8123 CD1 TYR B 157 32.770 56.476 58.994 1.00 11.97 C ATOM 8124 CD2 TYR B 157 32.247 58.431 57.710 1.00 12.49 C ATOM 8125 CE1 TYR B 157 31.664 55.791 58.438 1.00 13.20 C ATOM 8126 CE2 TYR B 157 31.170 57.788 57.163 1.00 15.52 C ATOM 8127 CZ TYR B 157 30.896 56.475 57.494 1.00 13.76 C ATOM 8128 OH TYR B 157 29.788 55.876 56.918 1.00 18.24 O ATOM 8129 HA TYR B 157 36.282 58.836 59.147 1.00 0.00 H ATOM 8130 HB3 TYR B 157 34.126 59.573 58.948 1.00 0.00 H ATOM 8131 HB2 TYR B 157 34.143 58.434 60.315 1.00 0.00 H ATOM 8132 HD2 TYR B 157 32.469 59.455 57.411 1.00 0.00 H ATOM 8133 HE2 TYR B 157 30.524 58.315 56.461 1.00 0.00 H ATOM 8134 HE1 TYR B 157 31.421 54.771 58.735 1.00 0.00 H ATOM 8135 HD1 TYR B 157 33.409 55.963 59.713 1.00 0.00 H ATOM 8136 HH TYR B 157 28.974 56.380 57.169 1.00 0.00 H ATOM 8137 H TYR B 157 35.900 56.959 56.947 1.00 0.00 H ATOM 8138 N SER B 158 36.043 56.777 60.830 1.00 8.04 N ATOM 8139 CA SER B 158 36.384 55.597 61.601 1.00 8.24 C ATOM 8140 C SER B 158 35.153 55.151 62.362 1.00 8.88 C ATOM 8141 O SER B 158 34.432 55.960 62.885 1.00 16.04 O ATOM 8142 CB SER B 158 37.505 55.954 62.593 1.00 9.65 C ATOM 8143 OG SER B 158 38.729 56.215 61.896 1.00 9.89 O ATOM 8144 HA SER B 158 36.725 54.796 60.945 1.00 0.00 H ATOM 8145 HB2 SER B 158 37.654 55.122 63.281 1.00 0.00 H ATOM 8146 HB3 SER B 158 37.217 56.842 63.156 1.00 0.00 H ATOM 8147 HG SER B 158 38.995 55.409 61.386 1.00 0.00 H ATOM 8148 H SER B 158 35.810 57.662 61.324 1.00 0.00 H ATOM 8149 N ILE B 159 34.858 53.884 62.405 1.00 10.24 N ATOM 8150 CA ILE B 159 33.924 53.385 63.413 1.00 10.56 C ATOM 8151 C ILE B 159 34.728 52.791 64.532 1.00 10.87 C ATOM 8152 O ILE B 159 35.790 52.201 64.278 1.00 12.87 O ATOM 8153 CB ILE B 159 32.989 52.348 62.781 1.00 13.29 C ATOM 8154 CG1 ILE B 159 32.189 53.116 61.728 1.00 15.49 C ATOM 8155 CG2 ILE B 159 32.027 51.729 63.813 1.00 15.18 C ATOM 8156 CD1 ILE B 159 31.304 52.285 60.932 1.00 17.85 C ATOM 8157 HA ILE B 159 33.302 54.190 63.805 1.00 0.00 H ATOM 8158 HB ILE B 159 33.561 51.521 62.362 1.00 0.00 H ATOM 8159 HG12 ILE B 159 31.586 53.868 62.237 1.00 0.00 H ATOM 8160 HG13 ILE B 159 32.892 53.609 61.056 1.00 0.00 H ATOM 8161 HD11 ILE B 159 31.891 51.533 60.404 1.00 0.00 H ATOM 8162 HD12 ILE B 159 30.584 51.793 61.586 1.00 0.00 H ATOM 8163 HD13 ILE B 159 30.775 52.907 60.210 1.00 0.00 H ATOM 8164 HG21 ILE B 159 32.604 51.235 64.595 1.00 0.00 H ATOM 8165 HG22 ILE B 159 31.414 52.515 64.254 1.00 0.00 H ATOM 8166 HG23 ILE B 159 31.385 51.001 63.318 1.00 0.00 H ATOM 8167 H ILE B 159 35.287 53.227 61.722 1.00 0.00 H ATOM 8168 N SER B 160 34.230 52.892 65.762 1.00 10.99 N ATOM 8169 CA SER B 160 34.852 52.170 66.898 1.00 12.20 C ATOM 8170 C SER B 160 33.754 51.512 67.701 1.00 10.08 C ATOM 8171 O SER B 160 32.644 52.079 67.888 1.00 11.26 O ATOM 8172 CB SER B 160 35.664 53.076 67.833 1.00 14.77 C ATOM 8173 OG SER B 160 36.385 52.397 68.860 1.00 14.87 O ATOM 8174 HA SER B 160 35.548 51.446 66.475 1.00 0.00 H ATOM 8175 HB2 SER B 160 34.975 53.774 68.309 1.00 0.00 H ATOM 8176 HB3 SER B 160 36.381 53.631 67.227 1.00 0.00 H ATOM 8177 HG SER B 160 35.750 51.897 69.432 1.00 0.00 H ATOM 8178 H SER B 160 33.393 53.486 65.929 1.00 0.00 H ATOM 8179 N SER B 161 34.079 50.327 68.180 1.00 9.96 N ATOM 8180 CA SER B 161 33.112 49.519 68.917 1.00 9.59 C ATOM 8181 C SER B 161 33.914 48.438 69.595 1.00 8.90 C ATOM 8182 O SER B 161 33.551 47.261 69.595 1.00 10.70 O ATOM 8183 CB SER B 161 32.025 48.955 68.014 1.00 9.97 C ATOM 8184 OG SER B 161 32.621 48.434 66.838 1.00 10.77 O ATOM 8185 HA SER B 161 32.571 50.121 69.647 1.00 0.00 H ATOM 8186 HB2 SER B 161 31.324 49.746 67.748 1.00 0.00 H ATOM 8187 HB3 SER B 161 31.493 48.160 68.536 1.00 0.00 H ATOM 8188 HG SER B 161 33.257 47.716 67.082 1.00 0.00 H ATOM 8189 H SER B 161 35.041 49.962 68.030 1.00 0.00 H ATOM 8190 N ALA B 162 35.043 48.840 70.184 1.00 10.36 N ATOM 8191 CA ALA B 162 35.892 47.921 70.950 1.00 11.49 C ATOM 8192 C ALA B 162 36.230 46.719 70.060 1.00 11.38 C ATOM 8193 O ALA B 162 36.687 46.902 68.923 1.00 11.55 O ATOM 8194 CB ALA B 162 35.220 47.540 72.296 1.00 12.98 C ATOM 8195 HA ALA B 162 36.831 48.399 71.229 1.00 0.00 H ATOM 8196 HB1 ALA B 162 35.056 48.441 72.886 1.00 0.00 H ATOM 8197 HB2 ALA B 162 34.264 47.054 72.099 1.00 0.00 H ATOM 8198 HB3 ALA B 162 35.870 46.858 72.845 1.00 0.00 H ATOM 8199 H ALA B 162 35.329 49.836 70.097 1.00 0.00 H ATOM 8200 N CYS B 163 36.011 45.496 70.531 1.00 12.39 N ATOM 8201 CA CYS B 163 36.391 44.308 69.773 1.00 12.73 C ATOM 8202 C CYS B 163 35.646 44.142 68.454 1.00 12.54 C ATOM 8203 O CYS B 163 36.063 43.344 67.602 1.00 14.48 O ATOM 8204 CB CYS B 163 36.134 43.003 70.606 1.00 16.75 C ATOM 8205 SG CYS B 163 36.331 43.168 72.365 1.00 21.58 S ATOM 8206 HA CYS B 163 37.450 44.455 69.559 1.00 0.00 H ATOM 8207 HB2 CYS B 163 36.831 42.240 70.260 1.00 0.00 H ATOM 8208 HB3 CYS B 163 35.113 42.675 70.411 1.00 0.00 H ATOM 8209 HG CYS B 163 36.077 41.954 72.971 1.00 0.00 H ATOM 8210 H CYS B 163 35.559 45.383 71.461 1.00 0.00 H ATOM 8211 N ALA B 164 34.545 44.861 68.274 1.00 10.95 N ATOM 8212 CA ALA B 164 33.752 44.770 67.047 1.00 10.33 C ATOM 8213 C ALA B 164 34.156 45.817 66.019 1.00 9.15 C ATOM 8214 O ALA B 164 33.627 45.823 64.911 1.00 10.06 O ATOM 8215 CB ALA B 164 32.261 44.889 67.378 1.00 12.51 C ATOM 8216 HA ALA B 164 33.948 43.795 66.601 1.00 0.00 H ATOM 8217 HB1 ALA B 164 31.974 44.082 68.052 1.00 0.00 H ATOM 8218 HB2 ALA B 164 32.072 45.849 67.858 1.00 0.00 H ATOM 8219 HB3 ALA B 164 31.679 44.820 66.459 1.00 0.00 H ATOM 8220 H ALA B 164 34.236 45.508 69.027 1.00 0.00 H ATOM 8221 N THR B 165 35.085 46.693 66.379 1.00 8.90 N ATOM 8222 CA THR B 165 35.405 47.881 65.554 1.00 8.41 C ATOM 8223 C THR B 165 35.488 47.603 64.071 1.00 7.38 C ATOM 8224 O THR B 165 34.757 48.199 63.269 1.00 8.07 O ATOM 8225 CB THR B 165 36.740 48.496 66.051 1.00 8.51 C ATOM 8226 OG1 THR B 165 36.506 49.066 67.335 1.00 9.44 O ATOM 8227 CG2 THR B 165 37.301 49.572 65.100 1.00 9.57 C ATOM 8228 HA THR B 165 34.577 48.579 65.677 1.00 0.00 H ATOM 8229 HB THR B 165 37.487 47.703 66.091 1.00 0.00 H ATOM 8230 HG1 THR B 165 36.200 48.360 67.958 1.00 0.00 H ATOM 8231 HG23 THR B 165 37.478 49.131 64.119 1.00 0.00 H ATOM 8232 HG21 THR B 165 36.582 50.386 65.009 1.00 0.00 H ATOM 8233 HG22 THR B 165 38.238 49.957 65.502 1.00 0.00 H ATOM 8234 H THR B 165 35.604 46.541 67.267 1.00 0.00 H ATOM 8235 N SER B 166 36.392 46.737 63.666 1.00 8.04 N ATOM 8236 CA SER B 166 36.647 46.646 62.235 1.00 7.74 C ATOM 8237 C SER B 166 35.642 45.723 61.533 1.00 8.08 C ATOM 8238 O SER B 166 35.537 45.756 60.301 1.00 9.17 O ATOM 8239 CB SER B 166 38.098 46.228 61.960 1.00 7.77 C ATOM 8240 OG SER B 166 38.492 45.094 62.712 1.00 8.46 O ATOM 8241 HA SER B 166 36.506 47.640 61.811 1.00 0.00 H ATOM 8242 HB2 SER B 166 38.755 47.060 62.213 1.00 0.00 H ATOM 8243 HB3 SER B 166 38.199 45.996 60.900 1.00 0.00 H ATOM 8244 HG SER B 166 38.412 45.296 63.678 1.00 0.00 H ATOM 8245 H SER B 166 36.906 46.139 64.344 1.00 0.00 H ATOM 8246 N ALA B 167 34.889 44.923 62.310 1.00 8.09 N ATOM 8247 CA ALA B 167 33.728 44.205 61.739 1.00 8.54 C ATOM 8248 C ALA B 167 32.609 45.209 61.409 1.00 7.41 C ATOM 8249 O ALA B 167 32.005 45.127 60.325 1.00 8.34 O ATOM 8250 CB ALA B 167 33.248 43.153 62.723 1.00 9.70 C ATOM 8251 HA ALA B 167 34.019 43.704 60.816 1.00 0.00 H ATOM 8252 HB1 ALA B 167 34.054 42.445 62.918 1.00 0.00 H ATOM 8253 HB2 ALA B 167 32.954 43.636 63.655 1.00 0.00 H ATOM 8254 HB3 ALA B 167 32.393 42.625 62.300 1.00 0.00 H ATOM 8255 H ALA B 167 35.124 44.809 63.317 1.00 0.00 H ATOM 8256 N HIS B 168 32.323 46.175 62.309 1.00 7.46 N ATOM 8257 CA HIS B 168 31.334 47.201 61.949 1.00 6.80 C ATOM 8258 C HIS B 168 31.853 48.065 60.788 1.00 7.09 C ATOM 8259 O HIS B 168 31.061 48.535 59.987 1.00 8.50 O ATOM 8260 CB HIS B 168 31.004 48.106 63.131 1.00 7.97 C ATOM 8261 CG HIS B 168 30.202 47.459 64.204 1.00 8.78 C ATOM 8262 ND1 HIS B 168 28.932 46.941 64.042 1.00 11.85 N ATOM 8263 CD2 HIS B 168 30.505 47.318 65.503 1.00 7.32 C ATOM 8264 CE1 HIS B 168 28.498 46.500 65.219 1.00 8.30 C ATOM 8265 NE2 HIS B 168 29.433 46.728 66.114 1.00 13.55 N ATOM 8266 HA HIS B 168 30.427 46.678 61.646 1.00 0.00 H ATOM 8267 HB2 HIS B 168 31.942 48.450 63.568 1.00 0.00 H ATOM 8268 HB3 HIS B 168 30.443 48.963 62.757 1.00 0.00 H ATOM 8269 HD2 HIS B 168 31.436 47.619 65.984 1.00 0.00 H ATOM 8270 HE1 HIS B 168 27.533 46.030 65.409 1.00 0.00 H ATOM 8271 H HIS B 168 32.793 46.192 63.237 1.00 0.00 H ATOM 8272 N CYS B 169 33.170 48.277 60.691 1.00 7.29 N ATOM 8273 CA CYS B 169 33.681 49.018 59.538 1.00 7.41 C ATOM 8274 C CYS B 169 33.338 48.285 58.241 1.00 7.22 C ATOM 8275 O CYS B 169 32.878 48.893 57.277 1.00 8.11 O ATOM 8276 CB CYS B 169 35.187 49.233 59.623 1.00 8.34 C ATOM 8277 SG CYS B 169 35.699 50.442 60.888 1.00 9.29 S ATOM 8278 HA CYS B 169 33.201 49.996 59.543 1.00 0.00 H ATOM 8279 HB2 CYS B 169 35.538 49.584 58.653 1.00 0.00 H ATOM 8280 HB3 CYS B 169 35.657 48.277 59.854 1.00 0.00 H ATOM 8281 HG CYS B 169 35.280 50.011 62.130 1.00 0.00 H ATOM 8282 H CYS B 169 33.819 47.922 61.422 1.00 0.00 H ATOM 8283 N ILE B 170 33.557 46.959 58.218 1.00 7.37 N ATOM 8284 CA ILE B 170 33.240 46.186 57.029 1.00 7.59 C ATOM 8285 C ILE B 170 31.713 46.228 56.749 1.00 7.58 C ATOM 8286 O ILE B 170 31.290 46.405 55.600 1.00 7.82 O ATOM 8287 CB ILE B 170 33.747 44.751 57.157 1.00 8.22 C ATOM 8288 CG1 ILE B 170 35.284 44.725 57.135 1.00 8.80 C ATOM 8289 CG2 ILE B 170 33.126 43.868 56.043 1.00 9.24 C ATOM 8290 CD1 ILE B 170 35.862 43.353 57.603 1.00 10.50 C ATOM 8291 HA ILE B 170 33.751 46.635 56.177 1.00 0.00 H ATOM 8292 HB ILE B 170 33.433 44.336 58.115 1.00 0.00 H ATOM 8293 HG12 ILE B 170 35.623 44.919 56.118 1.00 0.00 H ATOM 8294 HG13 ILE B 170 35.657 45.507 57.797 1.00 0.00 H ATOM 8295 HD11 ILE B 170 35.536 43.152 58.623 1.00 0.00 H ATOM 8296 HD12 ILE B 170 35.502 42.564 56.943 1.00 0.00 H ATOM 8297 HD13 ILE B 170 36.951 43.388 57.569 1.00 0.00 H ATOM 8298 HG21 ILE B 170 32.040 43.875 56.138 1.00 0.00 H ATOM 8299 HG22 ILE B 170 33.409 44.264 55.068 1.00 0.00 H ATOM 8300 HG23 ILE B 170 33.494 42.847 56.143 1.00 0.00 H ATOM 8301 H ILE B 170 33.955 46.485 59.054 1.00 0.00 H ATOM 8302 N GLY B 171 30.905 46.038 57.775 1.00 8.02 N ATOM 8303 CA GLY B 171 29.451 46.075 57.553 1.00 8.85 C ATOM 8304 C GLY B 171 28.986 47.441 57.064 1.00 8.37 C ATOM 8305 O GLY B 171 28.120 47.525 56.173 1.00 8.98 O ATOM 8306 HA3 GLY B 171 28.945 45.845 58.491 1.00 0.00 H ATOM 8307 HA2 GLY B 171 29.189 45.325 56.807 1.00 0.00 H ATOM 8308 H GLY B 171 31.290 45.865 58.725 1.00 0.00 H ATOM 8309 N ASN B 172 29.560 48.532 57.593 1.00 8.13 N ATOM 8310 CA ASN B 172 29.187 49.848 57.107 1.00 9.17 C ATOM 8311 C ASN B 172 29.636 50.049 55.654 1.00 8.55 C ATOM 8312 O ASN B 172 28.930 50.725 54.882 1.00 9.29 O ATOM 8313 CB ASN B 172 29.771 50.941 57.994 1.00 10.78 C ATOM 8314 CG ASN B 172 28.876 51.296 59.119 1.00 11.41 C ATOM 8315 OD1 ASN B 172 28.289 52.376 59.125 1.00 12.96 O ATOM 8316 ND2 ASN B 172 28.747 50.404 60.078 1.00 11.67 N ATOM 8317 HA ASN B 172 28.100 49.916 57.142 1.00 0.00 H ATOM 8318 HB2 ASN B 172 30.721 50.593 58.399 1.00 0.00 H ATOM 8319 HB3 ASN B 172 29.940 51.831 57.387 1.00 0.00 H ATOM 8320 HD22 ASN B 172 29.266 49.505 60.025 1.00 0.00 H ATOM 8321 HD21 ASN B 172 28.126 50.599 60.889 1.00 0.00 H ATOM 8322 H ASN B 172 30.269 48.435 58.348 1.00 0.00 H ATOM 8323 N ALA B 173 30.782 49.489 55.278 1.00 8.37 N ATOM 8324 CA ALA B 173 31.203 49.505 53.878 1.00 8.74 C ATOM 8325 C ALA B 173 30.157 48.790 52.991 1.00 8.13 C ATOM 8326 O ALA B 173 29.779 49.309 51.929 1.00 9.30 O ATOM 8327 CB ALA B 173 32.569 48.836 53.742 1.00 9.86 C ATOM 8328 HA ALA B 173 31.282 50.539 53.543 1.00 0.00 H ATOM 8329 HB1 ALA B 173 33.299 49.377 54.345 1.00 0.00 H ATOM 8330 HB2 ALA B 173 32.503 47.804 54.088 1.00 0.00 H ATOM 8331 HB3 ALA B 173 32.877 48.851 52.697 1.00 0.00 H ATOM 8332 H ALA B 173 31.388 49.033 55.990 1.00 0.00 H ATOM 8333 N VAL B 174 29.674 47.622 53.436 1.00 8.25 N ATOM 8334 CA VAL B 174 28.602 46.945 52.727 1.00 8.99 C ATOM 8335 C VAL B 174 27.390 47.856 52.590 1.00 8.17 C ATOM 8336 O VAL B 174 26.798 47.940 51.500 1.00 9.63 O ATOM 8337 CB VAL B 174 28.245 45.649 53.441 1.00 9.93 C ATOM 8338 CG1 VAL B 174 26.984 44.996 52.864 1.00 12.07 C ATOM 8339 CG2 VAL B 174 29.411 44.665 53.322 1.00 12.00 C ATOM 8340 HA VAL B 174 28.942 46.698 51.721 1.00 0.00 H ATOM 8341 HB VAL B 174 28.049 45.895 54.485 1.00 0.00 H ATOM 8342 HG11 VAL B 174 26.142 45.681 52.966 1.00 0.00 H ATOM 8343 HG12 VAL B 174 27.144 44.769 51.810 1.00 0.00 H ATOM 8344 HG13 VAL B 174 26.772 44.075 53.407 1.00 0.00 H ATOM 8345 HG21 VAL B 174 29.605 44.460 52.269 1.00 0.00 H ATOM 8346 HG22 VAL B 174 30.300 45.100 53.779 1.00 0.00 H ATOM 8347 HG23 VAL B 174 29.155 43.737 53.833 1.00 0.00 H ATOM 8348 H VAL B 174 30.071 47.196 54.298 1.00 0.00 H ATOM 8349 N GLU B 175 27.001 48.556 53.666 1.00 8.90 N ATOM 8350 CA GLU B 175 25.870 49.466 53.574 1.00 9.14 C ATOM 8351 C GLU B 175 26.059 50.554 52.544 1.00 8.31 C ATOM 8352 O GLU B 175 25.105 50.912 51.856 1.00 9.49 O ATOM 8353 CB GLU B 175 25.618 50.086 54.930 1.00 11.03 C ATOM 8354 CG GLU B 175 25.095 49.050 55.929 1.00 14.08 C ATOM 8355 CD GLU B 175 24.913 49.628 57.327 1.00 19.82 C ATOM 8356 OE1 GLU B 175 25.536 50.688 57.632 1.00 22.68 O ATOM 8357 OE2 GLU B 175 24.127 49.055 58.097 1.00 21.62 O ATOM 8358 HA GLU B 175 25.012 48.877 53.250 1.00 0.00 H ATOM 8359 HB2 GLU B 175 26.551 50.504 55.308 1.00 0.00 H ATOM 8360 HB3 GLU B 175 24.881 50.882 54.825 1.00 0.00 H ATOM 8361 HG2 GLU B 175 24.133 48.678 55.576 1.00 0.00 H ATOM 8362 HG3 GLU B 175 25.805 48.225 55.981 1.00 0.00 H ATOM 8363 H GLU B 175 27.509 48.448 54.567 1.00 0.00 H ATOM 8364 N GLN B 176 27.270 51.111 52.436 1.00 8.30 N ATOM 8365 CA GLN B 176 27.509 52.139 51.417 1.00 9.07 C ATOM 8366 C GLN B 176 27.298 51.596 50.015 1.00 9.24 C ATOM 8367 O GLN B 176 26.794 52.288 49.137 1.00 10.10 O ATOM 8368 CB GLN B 176 28.927 52.655 51.526 1.00 10.19 C ATOM 8369 CG GLN B 176 29.197 53.401 52.850 1.00 10.90 C ATOM 8370 CD GLN B 176 28.315 54.649 52.907 1.00 14.46 C ATOM 8371 OE1 GLN B 176 28.344 55.458 51.996 1.00 17.37 O ATOM 8372 NE2 GLN B 176 27.486 54.749 53.901 1.00 18.07 N ATOM 8373 HA GLN B 176 26.796 52.944 51.593 1.00 0.00 H ATOM 8374 HB2 GLN B 176 29.611 51.809 51.458 1.00 0.00 H ATOM 8375 HB3 GLN B 176 29.113 53.339 50.698 1.00 0.00 H ATOM 8376 HG2 GLN B 176 28.963 52.749 53.692 1.00 0.00 H ATOM 8377 HG3 GLN B 176 30.246 53.692 52.898 1.00 0.00 H ATOM 8378 HE22 GLN B 176 27.494 54.037 54.659 1.00 0.00 H ATOM 8379 HE21 GLN B 176 26.814 55.542 53.940 1.00 0.00 H ATOM 8380 H GLN B 176 28.039 50.817 53.072 1.00 0.00 H ATOM 8381 N ILE B 177 27.707 50.347 49.786 1.00 9.04 N ATOM 8382 CA ILE B 177 27.449 49.701 48.492 1.00 10.08 C ATOM 8383 C ILE B 177 25.940 49.512 48.306 1.00 10.01 C ATOM 8384 O ILE B 177 25.407 49.812 47.222 1.00 10.47 O ATOM 8385 CB ILE B 177 28.230 48.370 48.410 1.00 10.93 C ATOM 8386 CG1 ILE B 177 29.702 48.632 48.024 1.00 14.22 C ATOM 8387 CG2 ILE B 177 27.605 47.441 47.355 1.00 12.28 C ATOM 8388 CD1 ILE B 177 30.473 49.624 48.744 1.00 13.84 C ATOM 8389 HA ILE B 177 27.801 50.331 47.675 1.00 0.00 H ATOM 8390 HB ILE B 177 28.184 47.896 49.390 1.00 0.00 H ATOM 8391 HG12 ILE B 177 30.229 47.684 48.131 1.00 0.00 H ATOM 8392 HG13 ILE B 177 29.704 48.931 46.976 1.00 0.00 H ATOM 8393 HD11 ILE B 177 29.995 50.598 48.641 1.00 0.00 H ATOM 8394 HD12 ILE B 177 30.521 49.350 49.798 1.00 0.00 H ATOM 8395 HD13 ILE B 177 31.481 49.667 48.333 1.00 0.00 H ATOM 8396 HG21 ILE B 177 26.571 47.229 47.627 1.00 0.00 H ATOM 8397 HG22 ILE B 177 27.633 47.929 46.381 1.00 0.00 H ATOM 8398 HG23 ILE B 177 28.169 46.510 47.313 1.00 0.00 H ATOM 8399 H ILE B 177 28.213 49.826 50.530 1.00 0.00 H ATOM 8400 N GLN B 178 25.256 49.000 49.347 1.00 10.09 N ATOM 8401 CA GLN B 178 23.806 48.768 49.250 1.00 11.22 C ATOM 8402 C GLN B 178 22.981 50.015 48.995 1.00 12.10 C ATOM 8403 O GLN B 178 21.967 49.989 48.273 1.00 14.25 O ATOM 8404 CB GLN B 178 23.315 48.084 50.523 1.00 11.56 C ATOM 8405 CG GLN B 178 23.843 46.664 50.667 1.00 11.86 C ATOM 8406 CD GLN B 178 23.454 46.032 51.981 1.00 12.49 C ATOM 8407 OE1 GLN B 178 23.255 46.733 52.973 1.00 14.29 O ATOM 8408 NE2 GLN B 178 23.364 44.713 52.012 1.00 14.71 N ATOM 8409 HA GLN B 178 23.663 48.133 48.376 1.00 0.00 H ATOM 8410 HB2 GLN B 178 23.645 48.668 51.382 1.00 0.00 H ATOM 8411 HB3 GLN B 178 22.226 48.051 50.504 1.00 0.00 H ATOM 8412 HG2 GLN B 178 23.442 46.058 49.855 1.00 0.00 H ATOM 8413 HG3 GLN B 178 24.931 46.687 50.598 1.00 0.00 H ATOM 8414 HE22 GLN B 178 23.541 44.159 51.150 1.00 0.00 H ATOM 8415 HE21 GLN B 178 23.117 44.229 52.899 1.00 0.00 H ATOM 8416 H GLN B 178 25.757 48.766 50.228 1.00 0.00 H ATOM 8417 N LEU B 179 23.427 51.121 49.559 1.00 10.54 N ATOM 8418 CA LEU B 179 22.769 52.413 49.341 1.00 11.73 C ATOM 8419 C LEU B 179 23.077 53.002 47.986 1.00 11.93 C ATOM 8420 O LEU B 179 22.531 54.055 47.630 1.00 13.31 O ATOM 8421 CB LEU B 179 23.236 53.406 50.416 1.00 14.18 C ATOM 8422 CG LEU B 179 22.691 53.146 51.812 1.00 16.36 C ATOM 8423 CD1 LEU B 179 23.568 53.834 52.866 1.00 19.20 C ATOM 8424 CD2 LEU B 179 21.225 53.519 51.887 1.00 20.22 C ATOM 8425 HA LEU B 179 21.695 52.238 49.396 1.00 0.00 H ATOM 8426 HB2 LEU B 179 24.324 53.365 50.465 1.00 0.00 H ATOM 8427 HB3 LEU B 179 22.924 54.405 50.112 1.00 0.00 H ATOM 8428 HG LEU B 179 22.738 52.080 52.035 1.00 0.00 H ATOM 8429 HD21 LEU B 179 21.108 54.577 51.652 1.00 0.00 H ATOM 8430 HD22 LEU B 179 20.662 52.922 51.170 1.00 0.00 H ATOM 8431 HD23 LEU B 179 20.853 53.326 52.893 1.00 0.00 H ATOM 8432 HD11 LEU B 179 24.584 53.444 52.803 1.00 0.00 H ATOM 8433 HD12 LEU B 179 23.578 54.908 52.683 1.00 0.00 H ATOM 8434 HD13 LEU B 179 23.163 53.637 53.859 1.00 0.00 H ATOM 8435 H LEU B 179 24.265 51.075 50.173 1.00 0.00 H ATOM 8436 N GLY B 180 23.972 52.369 47.233 1.00 10.60 N ATOM 8437 CA GLY B 180 24.369 52.858 45.914 1.00 11.47 C ATOM 8438 C GLY B 180 25.350 54.042 45.952 1.00 10.30 C ATOM 8439 O GLY B 180 25.615 54.683 44.929 1.00 12.38 O ATOM 8440 HA3 GLY B 180 23.472 53.173 45.381 1.00 0.00 H ATOM 8441 HA2 GLY B 180 24.842 52.038 45.373 1.00 0.00 H ATOM 8442 H GLY B 180 24.405 51.495 47.595 1.00 0.00 H ATOM 8443 N LYS B 181 25.894 54.343 47.124 1.00 9.74 N ATOM 8444 CA LYS B 181 26.709 55.553 47.304 1.00 10.09 C ATOM 8445 C LYS B 181 28.172 55.373 46.901 1.00 9.50 C ATOM 8446 O LYS B 181 28.832 56.351 46.553 1.00 11.04 O ATOM 8447 CB LYS B 181 26.647 56.017 48.760 1.00 11.58 C ATOM 8448 CG LYS B 181 25.273 56.555 49.159 1.00 13.00 C ATOM 8449 CD LYS B 181 25.390 57.099 50.601 1.00 15.60 C ATOM 8450 CE LYS B 181 24.073 57.658 51.061 1.00 16.48 C ATOM 8451 NZ LYS B 181 24.257 58.370 52.377 1.00 17.35 N ATOM 8452 HA LYS B 181 26.283 56.303 46.638 1.00 0.00 H ATOM 8453 HB2 LYS B 181 26.890 55.172 49.404 1.00 0.00 H ATOM 8454 HB3 LYS B 181 27.385 56.806 48.905 1.00 0.00 H ATOM 8455 HG2 LYS B 181 24.975 57.355 48.482 1.00 0.00 H ATOM 8456 HG3 LYS B 181 24.534 55.755 49.121 1.00 0.00 H ATOM 8457 HD2 LYS B 181 25.689 56.289 51.267 1.00 0.00 H ATOM 8458 HD3 LYS B 181 26.143 57.886 50.628 1.00 0.00 H ATOM 8459 HE2 LYS B 181 23.357 56.845 51.185 1.00 0.00 H ATOM 8460 HE3 LYS B 181 23.697 58.361 50.317 1.00 0.00 H ATOM 8461 HZ1 LYS B 181 24.614 57.698 53.086 1.00 0.00 H ATOM 8462 HZ2 LYS B 181 24.939 59.146 52.258 1.00 0.00 H ATOM 8463 HZ3 LYS B 181 23.344 58.755 52.692 1.00 0.00 H ATOM 8464 H LYS B 181 25.740 53.709 47.934 1.00 0.00 H ATOM 8465 N GLN B 182 28.672 54.148 46.992 1.00 9.15 N ATOM 8466 CA GLN B 182 30.068 53.860 46.706 1.00 8.21 C ATOM 8467 C GLN B 182 30.175 52.606 45.887 1.00 8.24 C ATOM 8468 O GLN B 182 29.332 51.710 46.035 1.00 9.55 O ATOM 8469 CB GLN B 182 30.868 53.623 48.017 1.00 8.88 C ATOM 8470 CG GLN B 182 30.792 54.794 49.018 1.00 9.11 C ATOM 8471 CD GLN B 182 31.753 55.943 48.690 1.00 9.86 C ATOM 8472 OE1 GLN B 182 32.813 56.065 49.310 1.00 10.86 O ATOM 8473 NE2 GLN B 182 31.388 56.798 47.742 1.00 10.97 N ATOM 8474 HA GLN B 182 30.474 54.717 46.169 1.00 0.00 H ATOM 8475 HB2 GLN B 182 30.474 52.730 48.503 1.00 0.00 H ATOM 8476 HB3 GLN B 182 31.914 53.462 47.756 1.00 0.00 H ATOM 8477 HG2 GLN B 182 29.774 55.184 49.016 1.00 0.00 H ATOM 8478 HG3 GLN B 182 31.033 54.415 50.011 1.00 0.00 H ATOM 8479 HE22 GLN B 182 30.487 56.664 47.240 1.00 0.00 H ATOM 8480 HE21 GLN B 182 32.003 57.602 47.502 1.00 0.00 H ATOM 8481 H GLN B 182 28.045 53.368 47.277 1.00 0.00 H ATOM 8482 N ASP B 183 31.200 52.572 45.025 1.00 8.02 N ATOM 8483 CA ASP B 183 31.570 51.337 44.300 1.00 8.83 C ATOM 8484 C ASP B 183 32.611 50.514 45.027 1.00 8.43 C ATOM 8485 O ASP B 183 32.617 49.297 44.899 1.00 9.24 O ATOM 8486 CB ASP B 183 32.161 51.689 42.920 1.00 11.84 C ATOM 8487 CG ASP B 183 31.156 52.308 42.003 1.00 14.13 C ATOM 8488 OD1 ASP B 183 29.963 51.942 42.108 1.00 15.53 O ATOM 8489 OD2 ASP B 183 31.555 53.160 41.170 1.00 16.55 O ATOM 8490 HA ASP B 183 30.652 50.756 44.215 1.00 0.00 H ATOM 8491 HB2 ASP B 183 32.983 52.390 43.061 1.00 0.00 H ATOM 8492 HB3 ASP B 183 32.539 50.776 42.459 1.00 0.00 H ATOM 8493 H ASP B 183 31.751 53.439 44.861 1.00 0.00 H ATOM 8494 N ILE B 184 33.508 51.183 45.747 1.00 7.84 N ATOM 8495 CA ILE B 184 34.553 50.493 46.521 1.00 7.98 C ATOM 8496 C ILE B 184 34.667 51.229 47.849 1.00 7.27 C ATOM 8497 O ILE B 184 34.696 52.461 47.870 1.00 8.34 O ATOM 8498 CB ILE B 184 35.937 50.582 45.829 1.00 9.23 C ATOM 8499 CG1 ILE B 184 35.951 49.712 44.559 1.00 11.27 C ATOM 8500 CG2 ILE B 184 37.079 50.159 46.789 1.00 9.96 C ATOM 8501 CD1 ILE B 184 37.168 49.933 43.697 1.00 13.29 C ATOM 8502 HA ILE B 184 34.284 49.442 46.625 1.00 0.00 H ATOM 8503 HB ILE B 184 36.108 51.622 45.550 1.00 0.00 H ATOM 8504 HG12 ILE B 184 35.924 48.664 44.857 1.00 0.00 H ATOM 8505 HG13 ILE B 184 35.063 49.944 43.971 1.00 0.00 H ATOM 8506 HD11 ILE B 184 37.204 50.976 43.381 1.00 0.00 H ATOM 8507 HD12 ILE B 184 38.065 49.694 44.269 1.00 0.00 H ATOM 8508 HD13 ILE B 184 37.112 49.288 42.820 1.00 0.00 H ATOM 8509 HG21 ILE B 184 37.084 50.817 47.658 1.00 0.00 H ATOM 8510 HG22 ILE B 184 36.919 49.130 47.111 1.00 0.00 H ATOM 8511 HG23 ILE B 184 38.035 50.234 46.270 1.00 0.00 H ATOM 8512 H ILE B 184 33.470 52.222 45.763 1.00 0.00 H ATOM 8513 N VAL B 185 34.738 50.463 48.949 1.00 7.76 N ATOM 8514 CA VAL B 185 35.112 51.045 50.235 1.00 7.47 C ATOM 8515 C VAL B 185 36.198 50.151 50.824 1.00 8.02 C ATOM 8516 O VAL B 185 36.004 48.933 50.947 1.00 8.43 O ATOM 8517 CB VAL B 185 33.930 51.124 51.203 1.00 8.39 C ATOM 8518 CG1 VAL B 185 34.371 51.673 52.575 1.00 8.66 C ATOM 8519 CG2 VAL B 185 32.823 51.995 50.606 1.00 10.28 C ATOM 8520 HA VAL B 185 35.459 52.067 50.083 1.00 0.00 H ATOM 8521 HB VAL B 185 33.544 50.116 51.357 1.00 0.00 H ATOM 8522 HG11 VAL B 185 35.128 51.015 53.002 1.00 0.00 H ATOM 8523 HG12 VAL B 185 34.786 52.673 52.448 1.00 0.00 H ATOM 8524 HG13 VAL B 185 33.509 51.717 53.241 1.00 0.00 H ATOM 8525 HG21 VAL B 185 33.209 52.999 50.427 1.00 0.00 H ATOM 8526 HG22 VAL B 185 32.488 51.560 49.664 1.00 0.00 H ATOM 8527 HG23 VAL B 185 31.986 52.045 51.303 1.00 0.00 H ATOM 8528 H VAL B 185 34.525 49.447 48.885 1.00 0.00 H ATOM 8529 N PHE B 186 37.348 50.753 51.126 1.00 7.36 N ATOM 8530 CA PHE B 186 38.394 50.043 51.855 1.00 7.16 C ATOM 8531 C PHE B 186 37.961 50.014 53.303 1.00 7.36 C ATOM 8532 O PHE B 186 37.641 51.069 53.872 1.00 8.96 O ATOM 8533 CB PHE B 186 39.718 50.776 51.700 1.00 7.96 C ATOM 8534 CG PHE B 186 40.189 50.834 50.288 1.00 8.21 C ATOM 8535 CD1 PHE B 186 40.865 49.752 49.748 1.00 10.20 C ATOM 8536 CD2 PHE B 186 39.968 51.954 49.494 1.00 9.20 C ATOM 8537 CE1 PHE B 186 41.324 49.777 48.444 1.00 11.85 C ATOM 8538 CE2 PHE B 186 40.437 51.999 48.179 1.00 9.66 C ATOM 8539 CZ PHE B 186 41.091 50.917 47.660 1.00 10.45 C ATOM 8540 HA PHE B 186 38.536 49.031 51.475 1.00 0.00 H ATOM 8541 HB2 PHE B 186 39.597 51.795 52.068 1.00 0.00 H ATOM 8542 HB3 PHE B 186 40.472 50.263 52.297 1.00 0.00 H ATOM 8543 HD2 PHE B 186 39.423 52.805 49.902 1.00 0.00 H ATOM 8544 HE2 PHE B 186 40.283 52.891 47.571 1.00 0.00 H ATOM 8545 HZ PHE B 186 41.435 50.940 46.626 1.00 0.00 H ATOM 8546 HE1 PHE B 186 41.860 48.922 48.031 1.00 0.00 H ATOM 8547 HD1 PHE B 186 41.038 48.867 50.361 1.00 0.00 H ATOM 8548 H PHE B 186 37.502 51.741 50.839 1.00 0.00 H ATOM 8549 N ALA B 187 37.922 48.823 53.889 1.00 7.03 N ATOM 8550 CA ALA B 187 37.407 48.689 55.252 1.00 6.82 C ATOM 8551 C ALA B 187 38.342 47.883 56.125 1.00 6.27 C ATOM 8552 O ALA B 187 38.872 46.849 55.700 1.00 8.01 O ATOM 8553 CB ALA B 187 36.041 48.041 55.245 1.00 8.59 C ATOM 8554 HA ALA B 187 37.330 49.694 55.666 1.00 0.00 H ATOM 8555 HB1 ALA B 187 35.352 48.655 54.666 1.00 0.00 H ATOM 8556 HB2 ALA B 187 36.112 47.051 54.795 1.00 0.00 H ATOM 8557 HB3 ALA B 187 35.678 47.951 56.269 1.00 0.00 H ATOM 8558 H ALA B 187 38.259 47.983 53.377 1.00 0.00 H ATOM 8559 N GLY B 188 38.547 48.333 57.358 1.00 7.13 N ATOM 8560 CA GLY B 188 39.453 47.610 58.208 1.00 8.07 C ATOM 8561 C GLY B 188 39.789 48.337 59.469 1.00 7.09 C ATOM 8562 O GLY B 188 38.932 49.031 60.019 1.00 8.13 O ATOM 8563 HA3 GLY B 188 40.376 47.429 57.656 1.00 0.00 H ATOM 8564 HA2 GLY B 188 38.995 46.656 58.470 1.00 0.00 H ATOM 8565 H GLY B 188 38.064 49.188 57.700 1.00 0.00 H ATOM 8566 N GLY B 189 41.040 48.205 59.924 1.00 7.91 N ATOM 8567 CA GLY B 189 41.392 48.828 61.194 1.00 9.13 C ATOM 8568 C GLY B 189 42.803 48.525 61.596 1.00 8.04 C ATOM 8569 O GLY B 189 43.517 47.762 60.909 1.00 8.90 O ATOM 8570 HA3 GLY B 189 40.718 48.457 61.967 1.00 0.00 H ATOM 8571 HA2 GLY B 189 41.277 49.908 61.100 1.00 0.00 H ATOM 8572 H GLY B 189 41.747 47.669 59.382 1.00 0.00 H ATOM 8573 N GLY B 190 43.199 49.119 62.709 1.00 8.68 N ATOM 8574 CA GLY B 190 44.531 48.920 63.236 1.00 8.56 C ATOM 8575 C GLY B 190 44.492 49.082 64.740 1.00 8.99 C ATOM 8576 O GLY B 190 43.564 49.677 65.295 1.00 10.59 O ATOM 8577 HA3 GLY B 190 45.209 49.657 62.806 1.00 0.00 H ATOM 8578 HA2 GLY B 190 44.878 47.918 62.984 1.00 0.00 H ATOM 8579 H GLY B 190 42.539 49.742 63.216 1.00 0.00 H ATOM 8580 N GLU B 191 45.516 48.558 65.416 1.00 8.60 N ATOM 8581 CA GLU B 191 45.628 48.700 66.860 1.00 8.18 C ATOM 8582 C GLU B 191 47.087 48.676 67.232 1.00 8.80 C ATOM 8583 O GLU B 191 47.824 47.773 66.804 1.00 9.78 O ATOM 8584 CB GLU B 191 44.882 47.580 67.567 1.00 11.40 C ATOM 8585 CG GLU B 191 44.496 47.988 69.045 1.00 14.81 C ATOM 8586 CD GLU B 191 43.337 49.017 69.132 1.00 14.19 C ATOM 8587 OE1 GLU B 191 42.269 48.714 68.600 1.00 14.93 O ATOM 8588 OE2 GLU B 191 43.432 50.132 69.735 1.00 17.29 O ATOM 8589 HA GLU B 191 45.182 49.645 67.171 1.00 0.00 H ATOM 8590 HB2 GLU B 191 43.972 47.354 67.012 1.00 0.00 H ATOM 8591 HB3 GLU B 191 45.517 46.694 67.597 1.00 0.00 H ATOM 8592 HG2 GLU B 191 44.197 47.088 69.583 1.00 0.00 H ATOM 8593 HG3 GLU B 191 45.375 48.420 69.523 1.00 0.00 H ATOM 8594 H GLU B 191 46.252 48.036 64.899 1.00 0.00 H ATOM 8595 N GLU B 192 47.530 49.651 68.025 1.00 8.72 N ATOM 8596 CA GLU B 192 48.900 49.624 68.540 1.00 9.51 C ATOM 8597 C GLU B 192 48.980 48.646 69.699 1.00 9.81 C ATOM 8598 O GLU B 192 47.963 48.291 70.290 1.00 11.23 O ATOM 8599 CB GLU B 192 49.372 51.013 68.962 1.00 10.30 C ATOM 8600 CG GLU B 192 48.701 51.539 70.240 1.00 11.79 C ATOM 8601 CD GLU B 192 49.114 52.949 70.589 1.00 12.07 C ATOM 8602 OE1 GLU B 192 49.481 53.739 69.667 1.00 12.45 O ATOM 8603 OE2 GLU B 192 49.018 53.276 71.784 1.00 12.59 O ATOM 8604 HA GLU B 192 49.566 49.294 67.742 1.00 0.00 H ATOM 8605 HB2 GLU B 192 50.448 50.973 69.131 1.00 0.00 H ATOM 8606 HB3 GLU B 192 49.158 51.709 68.151 1.00 0.00 H ATOM 8607 HG2 GLU B 192 47.620 51.519 70.098 1.00 0.00 H ATOM 8608 HG3 GLU B 192 48.970 50.883 71.068 1.00 0.00 H ATOM 8609 H GLU B 192 46.898 50.437 68.280 1.00 0.00 H ATOM 8610 N LEU B 193 50.187 48.255 70.061 1.00 10.27 N ATOM 8611 CA LEU B 193 50.398 47.358 71.186 1.00 10.81 C ATOM 8612 C LEU B 193 51.345 48.073 72.135 1.00 11.49 C ATOM 8613 O LEU B 193 52.450 48.447 71.738 1.00 13.95 O ATOM 8614 CB LEU B 193 50.979 46.059 70.637 1.00 14.63 C ATOM 8615 CG LEU B 193 51.204 44.953 71.658 1.00 14.43 C ATOM 8616 CD1 LEU B 193 49.965 44.553 72.460 1.00 15.30 C ATOM 8617 CD2 LEU B 193 51.724 43.739 70.877 1.00 15.32 C ATOM 8618 HA LEU B 193 49.485 47.108 71.727 1.00 0.00 H ATOM 8619 HB2 LEU B 193 50.295 45.680 69.878 1.00 0.00 H ATOM 8620 HB3 LEU B 193 51.939 46.290 70.176 1.00 0.00 H ATOM 8621 HG LEU B 193 51.908 45.324 72.403 1.00 0.00 H ATOM 8622 HD21 LEU B 193 50.983 43.441 70.136 1.00 0.00 H ATOM 8623 HD22 LEU B 193 52.655 44.003 70.376 1.00 0.00 H ATOM 8624 HD23 LEU B 193 51.902 42.914 71.567 1.00 0.00 H ATOM 8625 HD11 LEU B 193 49.596 45.418 73.011 1.00 0.00 H ATOM 8626 HD12 LEU B 193 49.192 44.198 71.779 1.00 0.00 H ATOM 8627 HD13 LEU B 193 50.227 43.759 73.160 1.00 0.00 H ATOM 8628 H LEU B 193 51.011 48.598 69.527 1.00 0.00 H ATOM 8629 N CYS B 194 50.910 48.294 73.376 1.00 9.71 N ATOM 8630 CA CYS B 194 51.676 49.146 74.301 1.00 10.64 C ATOM 8631 C CYS B 194 51.201 48.895 75.726 1.00 10.70 C ATOM 8632 O CYS B 194 50.021 48.654 75.971 1.00 11.48 O ATOM 8633 CB CYS B 194 51.431 50.652 73.963 1.00 12.76 C ATOM 8634 SG CYS B 194 49.681 51.100 74.047 1.00 17.04 S ATOM 8635 HA CYS B 194 52.736 48.910 74.203 1.00 0.00 H ATOM 8636 HB2 CYS B 194 51.795 50.849 72.955 1.00 0.00 H ATOM 8637 HB3 CYS B 194 51.984 51.265 74.674 1.00 0.00 H ATOM 8638 HG CYS B 194 49.535 52.437 73.739 1.00 0.00 H ATOM 8639 H CYS B 194 50.020 47.860 73.694 1.00 0.00 H ATOM 8640 N TRP B 195 52.104 49.018 76.684 1.00 10.22 N ATOM 8641 CA TRP B 195 51.688 48.883 78.087 1.00 10.02 C ATOM 8642 C TRP B 195 50.652 49.939 78.474 1.00 9.93 C ATOM 8643 O TRP B 195 49.795 49.687 79.329 1.00 11.30 O ATOM 8644 CB TRP B 195 52.891 48.909 79.043 1.00 11.99 C ATOM 8645 CG TRP B 195 53.546 50.274 79.143 1.00 11.75 C ATOM 8646 CD1 TRP B 195 54.590 50.729 78.394 1.00 12.01 C ATOM 8647 CD2 TRP B 195 53.151 51.355 80.002 1.00 11.85 C ATOM 8648 NE1 TRP B 195 54.884 52.044 78.747 1.00 12.60 N ATOM 8649 CE2 TRP B 195 54.017 52.439 79.731 1.00 12.08 C ATOM 8650 CE3 TRP B 195 52.155 51.506 80.981 1.00 13.27 C ATOM 8651 CZ2 TRP B 195 53.900 53.684 80.402 1.00 13.54 C ATOM 8652 CZ3 TRP B 195 52.037 52.730 81.638 1.00 13.01 C ATOM 8653 CH2 TRP B 195 52.900 53.789 81.338 1.00 13.85 C ATOM 8654 HA TRP B 195 51.214 47.906 78.184 1.00 0.00 H ATOM 8655 HB2 TRP B 195 52.551 48.614 80.036 1.00 0.00 H ATOM 8656 HB3 TRP B 195 53.632 48.194 78.687 1.00 0.00 H ATOM 8657 HE1 TRP B 195 55.637 52.629 78.332 1.00 0.00 H ATOM 8658 HD1 TRP B 195 55.115 50.151 77.634 1.00 0.00 H ATOM 8659 HZ2 TRP B 195 54.570 54.516 80.185 1.00 0.00 H ATOM 8660 HH2 TRP B 195 52.774 54.734 81.867 1.00 0.00 H ATOM 8661 HZ3 TRP B 195 51.263 52.863 82.394 1.00 0.00 H ATOM 8662 HE3 TRP B 195 51.486 50.680 81.223 1.00 0.00 H ATOM 8663 H TRP B 195 53.099 49.208 76.447 1.00 0.00 H ATOM 8664 N GLU B 196 50.727 51.136 77.866 1.00 10.46 N ATOM 8665 CA GLU B 196 49.845 52.245 78.254 1.00 11.99 C ATOM 8666 C GLU B 196 48.390 51.820 78.133 1.00 13.04 C ATOM 8667 O GLU B 196 47.574 52.173 78.989 1.00 15.87 O ATOM 8668 CB GLU B 196 50.084 53.486 77.386 1.00 12.55 C ATOM 8669 CG GLU B 196 51.438 54.183 77.608 1.00 12.97 C ATOM 8670 CD GLU B 196 52.564 53.668 76.711 1.00 13.59 C ATOM 8671 OE1 GLU B 196 52.638 52.462 76.413 1.00 13.32 O ATOM 8672 OE2 GLU B 196 53.444 54.479 76.321 1.00 14.89 O ATOM 8673 HA GLU B 196 50.073 52.501 79.289 1.00 0.00 H ATOM 8674 HB2 GLU B 196 50.026 53.184 76.340 1.00 0.00 H ATOM 8675 HB3 GLU B 196 49.294 54.206 77.599 1.00 0.00 H ATOM 8676 HG2 GLU B 196 51.309 55.248 77.418 1.00 0.00 H ATOM 8677 HG3 GLU B 196 51.733 54.034 78.647 1.00 0.00 H ATOM 8678 H GLU B 196 51.423 51.280 77.106 1.00 0.00 H ATOM 8679 N MET B 197 48.050 51.101 77.061 1.00 12.62 N ATOM 8680 CA MET B 197 46.700 50.590 76.902 1.00 14.52 C ATOM 8681 C MET B 197 46.500 49.232 77.569 1.00 12.52 C ATOM 8682 O MET B 197 45.470 48.995 78.204 1.00 13.74 O ATOM 8683 CB MET B 197 46.408 50.458 75.419 1.00 15.81 C ATOM 8684 CG MET B 197 44.948 50.027 75.164 1.00 18.12 C ATOM 8685 SD MET B 197 44.361 50.272 73.494 1.00 22.31 S ATOM 8686 CE MET B 197 45.652 49.371 72.682 1.00 21.40 C ATOM 8687 HA MET B 197 46.020 51.291 77.386 1.00 0.00 H ATOM 8688 HB2 MET B 197 46.583 51.420 74.937 1.00 0.00 H ATOM 8689 HB3 MET B 197 47.077 49.712 74.991 1.00 0.00 H ATOM 8690 HG2 MET B 197 44.306 50.598 75.834 1.00 0.00 H ATOM 8691 HG3 MET B 197 44.864 48.966 75.399 1.00 0.00 H ATOM 8692 HE1 MET B 197 46.614 49.830 72.911 1.00 0.00 H ATOM 8693 HE2 MET B 197 45.648 48.339 73.032 1.00 0.00 H ATOM 8694 HE3 MET B 197 45.486 49.392 71.605 1.00 0.00 H ATOM 8695 H MET B 197 48.762 50.904 76.329 1.00 0.00 H ATOM 8696 N ALA B 198 47.490 48.344 77.443 1.00 11.11 N ATOM 8697 CA ALA B 198 47.334 46.996 77.977 1.00 10.97 C ATOM 8698 C ALA B 198 47.073 46.990 79.472 1.00 10.62 C ATOM 8699 O ALA B 198 46.309 46.161 79.972 1.00 11.81 O ATOM 8700 CB ALA B 198 48.537 46.150 77.639 1.00 11.11 C ATOM 8701 HA ALA B 198 46.453 46.563 77.502 1.00 0.00 H ATOM 8702 HB1 ALA B 198 48.646 46.092 76.556 1.00 0.00 H ATOM 8703 HB2 ALA B 198 49.430 46.601 78.071 1.00 0.00 H ATOM 8704 HB3 ALA B 198 48.401 45.148 78.046 1.00 0.00 H ATOM 8705 H ALA B 198 48.373 48.614 76.964 1.00 0.00 H ATOM 8706 N CYS B 199 47.701 47.924 80.198 1.00 10.94 N ATOM 8707 CA CYS B 199 47.530 47.904 81.647 1.00 12.02 C ATOM 8708 C CYS B 199 46.069 48.198 82.032 1.00 11.12 C ATOM 8709 O CYS B 199 45.627 47.796 83.112 1.00 12.46 O ATOM 8710 CB CYS B 199 48.480 48.897 82.341 1.00 12.29 C ATOM 8711 SG CYS B 199 48.077 50.655 82.172 1.00 14.30 S ATOM 8712 HA CYS B 199 47.784 46.901 81.992 1.00 0.00 H ATOM 8713 HB2 CYS B 199 49.477 48.745 81.929 1.00 0.00 H ATOM 8714 HB3 CYS B 199 48.488 48.660 83.405 1.00 0.00 H ATOM 8715 HG CYS B 199 48.081 51.000 80.836 1.00 0.00 H ATOM 8716 H CYS B 199 48.295 48.645 79.741 1.00 0.00 H ATOM 8717 N GLU B 200 45.315 48.892 81.174 1.00 11.22 N ATOM 8718 CA GLU B 200 43.905 49.157 81.470 1.00 12.35 C ATOM 8719 C GLU B 200 43.089 47.854 81.464 1.00 10.59 C ATOM 8720 O GLU B 200 42.179 47.665 82.278 1.00 11.75 O ATOM 8721 CB GLU B 200 43.283 50.126 80.454 1.00 13.30 C ATOM 8722 CG GLU B 200 44.048 51.408 80.183 1.00 17.00 C ATOM 8723 CD GLU B 200 43.442 52.199 78.997 1.00 16.56 C ATOM 8724 OE1 GLU B 200 42.438 51.782 78.396 1.00 19.99 O ATOM 8725 OE2 GLU B 200 43.929 53.331 78.691 1.00 20.38 O ATOM 8726 HA GLU B 200 43.874 49.611 82.461 1.00 0.00 H ATOM 8727 HB2 GLU B 200 43.182 49.594 79.508 1.00 0.00 H ATOM 8728 HB3 GLU B 200 42.295 50.402 80.821 1.00 0.00 H ATOM 8729 HG2 GLU B 200 44.018 52.032 81.076 1.00 0.00 H ATOM 8730 HG3 GLU B 200 45.083 51.159 79.949 1.00 0.00 H ATOM 8731 H GLU B 200 45.732 49.246 80.290 1.00 0.00 H ATOM 8732 N PHE B 201 43.437 46.953 80.550 1.00 11.20 N ATOM 8733 CA PHE B 201 42.787 45.645 80.506 1.00 11.50 C ATOM 8734 C PHE B 201 43.221 44.751 81.651 1.00 11.05 C ATOM 8735 O PHE B 201 42.405 44.010 82.231 1.00 12.03 O ATOM 8736 CB PHE B 201 43.064 44.987 79.149 1.00 11.59 C ATOM 8737 CG PHE B 201 42.353 45.676 78.003 1.00 11.01 C ATOM 8738 CD1 PHE B 201 41.030 45.362 77.706 1.00 13.48 C ATOM 8739 CD2 PHE B 201 42.974 46.672 77.268 1.00 12.97 C ATOM 8740 CE1 PHE B 201 40.337 46.013 76.665 1.00 12.50 C ATOM 8741 CE2 PHE B 201 42.271 47.333 76.221 1.00 14.57 C ATOM 8742 CZ PHE B 201 40.967 46.983 75.924 1.00 14.26 C ATOM 8743 HA PHE B 201 41.713 45.791 80.623 1.00 0.00 H ATOM 8744 HB2 PHE B 201 44.137 45.016 78.961 1.00 0.00 H ATOM 8745 HB3 PHE B 201 42.732 43.950 79.191 1.00 0.00 H ATOM 8746 HD2 PHE B 201 44.004 46.951 77.492 1.00 0.00 H ATOM 8747 HE2 PHE B 201 42.764 48.120 75.650 1.00 0.00 H ATOM 8748 HZ PHE B 201 40.441 47.475 75.106 1.00 0.00 H ATOM 8749 HE1 PHE B 201 39.302 45.747 76.448 1.00 0.00 H ATOM 8750 HD1 PHE B 201 40.519 44.597 78.290 1.00 0.00 H ATOM 8751 H PHE B 201 44.180 47.182 79.859 1.00 0.00 H ATOM 8752 N ASP B 202 44.502 44.820 82.009 1.00 10.40 N ATOM 8753 CA ASP B 202 44.975 43.982 83.112 1.00 10.59 C ATOM 8754 C ASP B 202 44.281 44.472 84.403 1.00 11.41 C ATOM 8755 O ASP B 202 43.909 43.651 85.274 1.00 12.81 O ATOM 8756 CB ASP B 202 46.493 44.127 83.216 1.00 12.00 C ATOM 8757 CG ASP B 202 47.178 43.013 84.018 1.00 13.50 C ATOM 8758 OD1 ASP B 202 46.529 42.163 84.682 1.00 14.73 O ATOM 8759 OD2 ASP B 202 48.427 43.043 83.974 1.00 14.68 O ATOM 8760 HA ASP B 202 44.739 42.930 82.952 1.00 0.00 H ATOM 8761 HB2 ASP B 202 46.907 44.126 82.208 1.00 0.00 H ATOM 8762 HB3 ASP B 202 46.713 45.080 83.697 1.00 0.00 H ATOM 8763 H ASP B 202 45.156 45.459 81.513 1.00 0.00 H ATOM 8764 N ALA B 203 44.097 45.792 84.528 1.00 10.82 N ATOM 8765 CA ALA B 203 43.477 46.346 85.732 1.00 12.17 C ATOM 8766 C ALA B 203 42.025 45.901 85.886 1.00 12.03 C ATOM 8767 O ALA B 203 41.481 45.971 86.995 1.00 13.91 O ATOM 8768 CB ALA B 203 43.592 47.858 85.705 1.00 11.78 C ATOM 8769 HA ALA B 203 44.008 45.961 86.602 1.00 0.00 H ATOM 8770 HB1 ALA B 203 44.644 48.141 85.673 1.00 0.00 H ATOM 8771 HB2 ALA B 203 43.084 48.244 84.821 1.00 0.00 H ATOM 8772 HB3 ALA B 203 43.131 48.272 86.601 1.00 0.00 H ATOM 8773 H ALA B 203 44.397 46.429 83.763 1.00 0.00 H ATOM 8774 N MET B 204 41.376 45.504 84.790 1.00 12.84 N ATOM 8775 CA MET B 204 40.025 44.989 84.894 1.00 16.30 C ATOM 8776 C MET B 204 40.005 43.445 85.019 1.00 16.09 C ATOM 8777 O MET B 204 38.933 42.825 85.076 1.00 18.11 O ATOM 8778 CB MET B 204 39.095 45.580 83.802 1.00 20.15 C ATOM 8779 CG MET B 204 39.504 45.385 82.425 1.00 23.65 C ATOM 8780 SD MET B 204 38.245 46.040 81.304 1.00 23.86 S ATOM 8781 CE MET B 204 36.897 44.935 81.665 1.00 27.00 C ATOM 8782 HA MET B 204 39.594 45.340 85.831 1.00 0.00 H ATOM 8783 HB2 MET B 204 38.112 45.125 83.923 1.00 0.00 H ATOM 8784 HB3 MET B 204 39.021 46.653 83.976 1.00 0.00 H ATOM 8785 HG2 MET B 204 39.637 44.320 82.235 1.00 0.00 H ATOM 8786 HG3 MET B 204 40.447 45.904 82.252 1.00 0.00 H ATOM 8787 HE1 MET B 204 37.198 43.911 81.442 1.00 0.00 H ATOM 8788 HE2 MET B 204 36.635 45.016 82.720 1.00 0.00 H ATOM 8789 HE3 MET B 204 36.035 45.203 81.054 1.00 0.00 H ATOM 8790 H MET B 204 41.839 45.564 83.861 1.00 0.00 H ATOM 8791 N GLY B 205 41.201 42.843 85.094 1.00 14.82 N ATOM 8792 CA GLY B 205 41.355 41.390 85.219 1.00 15.73 C ATOM 8793 C GLY B 205 41.090 40.598 83.940 1.00 16.32 C ATOM 8794 O GLY B 205 40.820 39.386 83.999 1.00 18.16 O ATOM 8795 HA3 GLY B 205 40.660 41.041 85.983 1.00 0.00 H ATOM 8796 HA2 GLY B 205 42.377 41.185 85.538 1.00 0.00 H ATOM 8797 H GLY B 205 42.057 43.433 85.062 1.00 0.00 H ATOM 8798 N ALA B 206 41.164 41.272 82.788 1.00 13.32 N ATOM 8799 CA ALA B 206 40.758 40.677 81.512 1.00 13.30 C ATOM 8800 C ALA B 206 41.849 39.852 80.840 1.00 11.94 C ATOM 8801 O ALA B 206 41.549 39.051 79.947 1.00 14.00 O ATOM 8802 CB ALA B 206 40.235 41.783 80.524 1.00 14.42 C ATOM 8803 HA ALA B 206 39.952 39.984 81.754 1.00 0.00 H ATOM 8804 HB1 ALA B 206 39.376 42.288 80.967 1.00 0.00 H ATOM 8805 HB2 ALA B 206 41.028 42.507 80.339 1.00 0.00 H ATOM 8806 HB3 ALA B 206 39.939 41.318 79.584 1.00 0.00 H ATOM 8807 H ALA B 206 41.521 42.249 82.798 1.00 0.00 H ATOM 8808 N LEU B 207 43.108 40.094 81.222 1.00 11.70 N ATOM 8809 CA LEU B 207 44.235 39.460 80.531 1.00 11.02 C ATOM 8810 C LEU B 207 44.728 38.189 81.225 1.00 11.28 C ATOM 8811 O LEU B 207 44.692 38.066 82.460 1.00 12.97 O ATOM 8812 CB LEU B 207 45.443 40.417 80.392 1.00 10.75 C ATOM 8813 CG LEU B 207 45.136 41.744 79.694 1.00 10.95 C ATOM 8814 CD1 LEU B 207 46.388 42.559 79.556 1.00 12.60 C ATOM 8815 CD2 LEU B 207 44.462 41.504 78.326 1.00 11.20 C ATOM 8816 HA LEU B 207 43.842 39.201 79.548 1.00 0.00 H ATOM 8817 HB2 LEU B 207 45.817 40.638 81.392 1.00 0.00 H ATOM 8818 HB3 LEU B 207 46.217 39.905 79.821 1.00 0.00 H ATOM 8819 HG LEU B 207 44.433 42.307 80.307 1.00 0.00 H ATOM 8820 HD21 LEU B 207 45.128 40.920 77.692 1.00 0.00 H ATOM 8821 HD22 LEU B 207 43.529 40.960 78.473 1.00 0.00 H ATOM 8822 HD23 LEU B 207 44.255 42.463 77.851 1.00 0.00 H ATOM 8823 HD11 LEU B 207 46.799 42.762 80.545 1.00 0.00 H ATOM 8824 HD12 LEU B 207 47.117 42.005 78.965 1.00 0.00 H ATOM 8825 HD13 LEU B 207 46.154 43.500 79.058 1.00 0.00 H ATOM 8826 H LEU B 207 43.289 40.739 82.018 1.00 0.00 H ATOM 8827 N SER B 208 45.280 37.293 80.412 1.00 10.99 N ATOM 8828 CA SER B 208 45.905 36.081 80.925 1.00 11.42 C ATOM 8829 C SER B 208 47.144 36.400 81.778 1.00 12.29 C ATOM 8830 O SER B 208 47.982 37.194 81.362 1.00 13.43 O ATOM 8831 CB SER B 208 46.334 35.211 79.727 1.00 12.14 C ATOM 8832 OG SER B 208 47.028 34.070 80.224 1.00 13.89 O ATOM 8833 HA SER B 208 45.185 35.559 81.556 1.00 0.00 H ATOM 8834 HB2 SER B 208 46.990 35.784 79.072 1.00 0.00 H ATOM 8835 HB3 SER B 208 45.453 34.892 79.169 1.00 0.00 H ATOM 8836 HG SER B 208 46.429 33.554 80.820 1.00 0.00 H ATOM 8837 H SER B 208 45.265 37.461 79.386 1.00 0.00 H ATOM 8838 N THR B 209 47.259 35.770 82.943 1.00 12.87 N ATOM 8839 CA THR B 209 48.398 36.039 83.819 1.00 13.85 C ATOM 8840 C THR B 209 49.130 34.781 84.307 1.00 15.86 C ATOM 8841 O THR B 209 50.199 34.923 84.915 1.00 16.82 O ATOM 8842 CB THR B 209 47.974 36.834 85.084 1.00 15.69 C ATOM 8843 OG1 THR B 209 47.113 36.020 85.885 1.00 17.59 O ATOM 8844 CG2 THR B 209 47.252 38.132 84.720 1.00 15.19 C ATOM 8845 HA THR B 209 49.075 36.618 83.191 1.00 0.00 H ATOM 8846 HB THR B 209 48.875 37.095 85.638 1.00 0.00 H ATOM 8847 HG1 THR B 209 46.309 35.776 85.361 1.00 0.00 H ATOM 8848 HG23 THR B 209 47.908 38.752 84.110 1.00 0.00 H ATOM 8849 HG21 THR B 209 46.347 37.898 84.160 1.00 0.00 H ATOM 8850 HG22 THR B 209 46.988 38.668 85.632 1.00 0.00 H ATOM 8851 H THR B 209 46.535 35.082 83.233 1.00 0.00 H ATOM 8852 N LYS B 210 48.566 33.587 84.078 1.00 15.38 N ATOM 8853 CA LYS B 210 49.101 32.358 84.702 1.00 17.22 C ATOM 8854 C LYS B 210 50.088 31.608 83.810 1.00 16.71 C ATOM 8855 O LYS B 210 50.673 30.596 84.220 1.00 18.09 O ATOM 8856 CB LYS B 210 47.967 31.398 85.106 1.00 20.50 C ATOM 8857 CG LYS B 210 47.056 31.954 86.182 1.00 24.19 C ATOM 8858 CD LYS B 210 45.832 31.069 86.352 1.00 27.45 C ATOM 8859 HA LYS B 210 49.639 32.695 85.588 1.00 0.00 H ATOM 8860 HB2 LYS B 210 47.366 31.183 84.222 1.00 0.00 H ATOM 8861 HB3 LYS B 210 48.412 30.474 85.475 1.00 0.00 H ATOM 8862 HG2 LYS B 210 47.600 31.999 87.125 1.00 0.00 H ATOM 8863 HG3 LYS B 210 46.737 32.957 85.899 1.00 0.00 H ATOM 8864 HD2 LYS B 210 45.284 31.025 85.411 1.00 0.00 H ATOM 8865 HD3 LYS B 210 46.148 30.066 86.638 1.00 0.00 H ATOM 8866 H LYS B 210 47.739 33.524 83.451 1.00 0.00 H ATOM 8867 N TYR B 211 50.269 32.088 82.579 1.00 14.70 N ATOM 8868 CA TYR B 211 51.051 31.330 81.601 1.00 15.64 C ATOM 8869 C TYR B 211 52.232 32.134 81.056 1.00 15.60 C ATOM 8870 O TYR B 211 52.699 31.888 79.937 1.00 15.38 O ATOM 8871 CB TYR B 211 50.139 30.875 80.451 1.00 16.60 C ATOM 8872 CG TYR B 211 49.011 29.982 80.905 1.00 16.81 C ATOM 8873 CD1 TYR B 211 49.251 28.608 81.132 1.00 19.21 C ATOM 8874 CD2 TYR B 211 47.707 30.485 81.117 1.00 16.00 C ATOM 8875 CE1 TYR B 211 48.248 27.786 81.556 1.00 20.47 C ATOM 8876 CE2 TYR B 211 46.668 29.629 81.551 1.00 17.42 C ATOM 8877 CZ TYR B 211 46.965 28.286 81.759 1.00 18.98 C ATOM 8878 OH TYR B 211 45.983 27.418 82.186 1.00 21.01 O ATOM 8879 HA TYR B 211 51.465 30.459 82.110 1.00 0.00 H ATOM 8880 HB3 TYR B 211 50.742 30.330 79.725 1.00 0.00 H ATOM 8881 HB2 TYR B 211 49.712 31.759 79.976 1.00 0.00 H ATOM 8882 HD2 TYR B 211 47.501 31.541 80.945 1.00 0.00 H ATOM 8883 HE2 TYR B 211 45.661 30.012 81.718 1.00 0.00 H ATOM 8884 HE1 TYR B 211 48.453 26.731 81.737 1.00 0.00 H ATOM 8885 HD1 TYR B 211 50.248 28.200 80.967 1.00 0.00 H ATOM 8886 HH TYR B 211 46.366 26.510 82.281 1.00 0.00 H ATOM 8887 H TYR B 211 49.853 33.004 82.313 1.00 0.00 H ATOM 8888 N ASN B 212 52.746 33.082 81.844 1.00 14.88 N ATOM 8889 CA ASN B 212 53.787 33.942 81.325 1.00 14.91 C ATOM 8890 C ASN B 212 55.055 33.177 80.981 1.00 16.24 C ATOM 8891 O ASN B 212 55.798 33.612 80.095 1.00 17.40 O ATOM 8892 CB ASN B 212 54.112 35.085 82.282 1.00 14.06 C ATOM 8893 CG ASN B 212 52.949 36.048 82.460 1.00 13.85 C ATOM 8894 OD1 ASN B 212 52.204 36.312 81.501 1.00 13.83 O ATOM 8895 ND2 ASN B 212 52.792 36.591 83.664 1.00 14.40 N ATOM 8896 HA ASN B 212 53.389 34.365 80.403 1.00 0.00 H ATOM 8897 HB2 ASN B 212 54.369 34.664 83.254 1.00 0.00 H ATOM 8898 HB3 ASN B 212 54.966 35.637 81.889 1.00 0.00 H ATOM 8899 HD22 ASN B 212 53.441 36.339 84.437 1.00 0.00 H ATOM 8900 HD21 ASN B 212 52.020 37.267 83.833 1.00 0.00 H ATOM 8901 H ASN B 212 52.402 33.200 82.818 1.00 0.00 H ATOM 8902 N ASP B 213 55.314 32.057 81.678 1.00 17.08 N ATOM 8903 CA ASP B 213 56.515 31.263 81.416 1.00 19.51 C ATOM 8904 C ASP B 213 56.379 30.417 80.139 1.00 17.29 C ATOM 8905 O ASP B 213 57.380 29.876 79.652 1.00 19.20 O ATOM 8906 CB ASP B 213 56.788 30.306 82.585 1.00 21.12 C ATOM 8907 CG ASP B 213 57.115 31.026 83.876 1.00 27.99 C ATOM 8908 OD1 ASP B 213 57.555 32.195 83.812 1.00 29.36 O ATOM 8909 OD2 ASP B 213 56.979 30.391 84.954 1.00 33.17 O ATOM 8910 HA ASP B 213 57.335 31.970 81.293 1.00 0.00 H ATOM 8911 HB2 ASP B 213 55.902 29.691 82.745 1.00 0.00 H ATOM 8912 HB3 ASP B 213 57.630 29.666 82.321 1.00 0.00 H ATOM 8913 H ASP B 213 54.649 31.749 82.416 1.00 0.00 H ATOM 8914 N THR B 214 55.156 30.284 79.610 1.00 16.80 N ATOM 8915 CA THR B 214 54.928 29.508 78.392 1.00 15.81 C ATOM 8916 C THR B 214 54.001 30.338 77.502 1.00 15.05 C ATOM 8917 O THR B 214 52.809 30.023 77.388 1.00 14.71 O ATOM 8918 CB THR B 214 54.265 28.123 78.692 1.00 17.32 C ATOM 8919 OG1 THR B 214 53.028 28.299 79.399 1.00 18.64 O ATOM 8920 CG2 THR B 214 55.169 27.232 79.546 1.00 19.11 C ATOM 8921 HA THR B 214 55.883 29.303 77.908 1.00 0.00 H ATOM 8922 HB THR B 214 54.093 27.645 77.727 1.00 0.00 H ATOM 8923 HG1 THR B 214 52.624 27.414 79.580 1.00 0.00 H ATOM 8924 HG23 THR B 214 56.118 27.081 79.032 1.00 0.00 H ATOM 8925 HG21 THR B 214 55.347 27.713 80.508 1.00 0.00 H ATOM 8926 HG22 THR B 214 54.683 26.269 79.705 1.00 0.00 H ATOM 8927 H THR B 214 54.349 30.744 80.077 1.00 0.00 H ATOM 8928 N PRO B 215 54.529 31.407 76.875 1.00 14.37 N ATOM 8929 CA PRO B 215 53.657 32.374 76.200 1.00 13.83 C ATOM 8930 C PRO B 215 52.765 31.780 75.132 1.00 12.80 C ATOM 8931 O PRO B 215 51.626 32.217 74.999 1.00 13.47 O ATOM 8932 CB PRO B 215 54.644 33.385 75.611 1.00 14.19 C ATOM 8933 CG PRO B 215 55.834 33.309 76.483 1.00 15.90 C ATOM 8934 CD PRO B 215 55.940 31.853 76.829 1.00 16.14 C ATOM 8935 HA PRO B 215 52.939 32.807 76.897 1.00 0.00 H ATOM 8936 HD3 PRO B 215 56.496 31.310 76.065 1.00 0.00 H ATOM 8937 HD2 PRO B 215 56.424 31.716 77.796 1.00 0.00 H ATOM 8938 HG3 PRO B 215 55.696 33.912 77.381 1.00 0.00 H ATOM 8939 HG2 PRO B 215 56.725 33.647 75.954 1.00 0.00 H ATOM 8940 HB2 PRO B 215 54.902 33.117 74.586 1.00 0.00 H ATOM 8941 HB3 PRO B 215 54.220 34.389 75.627 1.00 0.00 H ATOM 8942 N GLU B 216 53.231 30.738 74.442 1.00 13.45 N ATOM 8943 CA GLU B 216 52.412 30.187 73.346 1.00 13.30 C ATOM 8944 C GLU B 216 51.189 29.413 73.842 1.00 13.61 C ATOM 8945 O GLU B 216 50.313 29.064 73.036 1.00 14.21 O ATOM 8946 CB GLU B 216 53.257 29.315 72.440 1.00 15.25 C ATOM 8947 CG GLU B 216 54.324 30.110 71.736 1.00 18.23 C ATOM 8948 CD GLU B 216 55.036 29.350 70.655 1.00 22.00 C ATOM 8949 OE1 GLU B 216 54.754 28.151 70.448 1.00 24.51 O ATOM 8950 OE2 GLU B 216 55.895 29.968 70.007 1.00 25.32 O ATOM 8951 HA GLU B 216 52.034 31.039 72.781 1.00 0.00 H ATOM 8952 HB2 GLU B 216 53.733 28.539 73.040 1.00 0.00 H ATOM 8953 HB3 GLU B 216 52.612 28.851 71.694 1.00 0.00 H ATOM 8954 HG2 GLU B 216 53.859 30.988 71.289 1.00 0.00 H ATOM 8955 HG3 GLU B 216 55.060 30.427 72.475 1.00 0.00 H ATOM 8956 H GLU B 216 54.156 30.321 74.673 1.00 0.00 H ATOM 8957 N LYS B 217 51.125 29.153 75.150 1.00 13.48 N ATOM 8958 CA LYS B 217 50.019 28.401 75.737 1.00 13.92 C ATOM 8959 C LYS B 217 49.017 29.283 76.463 1.00 13.84 C ATOM 8960 O LYS B 217 48.024 28.781 76.988 1.00 15.20 O ATOM 8961 CB LYS B 217 50.566 27.371 76.745 1.00 16.01 C ATOM 8962 CG LYS B 217 51.631 26.495 76.170 1.00 20.12 C ATOM 8963 CD LYS B 217 51.072 25.659 75.067 1.00 23.87 C ATOM 8964 HA LYS B 217 49.505 27.916 74.908 1.00 0.00 H ATOM 8965 HB2 LYS B 217 50.981 27.907 77.598 1.00 0.00 H ATOM 8966 HB3 LYS B 217 49.742 26.741 77.079 1.00 0.00 H ATOM 8967 HG2 LYS B 217 52.436 27.117 75.778 1.00 0.00 H ATOM 8968 HG3 LYS B 217 52.023 25.845 76.952 1.00 0.00 H ATOM 8969 HD2 LYS B 217 50.268 25.035 75.458 1.00 0.00 H ATOM 8970 HD3 LYS B 217 50.682 26.308 74.283 1.00 0.00 H ATOM 8971 H LYS B 217 51.886 29.496 75.770 1.00 0.00 H ATOM 8972 N ALA B 218 49.277 30.586 76.516 1.00 11.84 N ATOM 8973 CA ALA B 218 48.443 31.475 77.326 1.00 12.24 C ATOM 8974 C ALA B 218 47.062 31.686 76.733 1.00 12.36 C ATOM 8975 O ALA B 218 46.076 31.729 77.468 1.00 13.68 O ATOM 8976 CB ALA B 218 49.136 32.810 77.500 1.00 12.95 C ATOM 8977 HA ALA B 218 48.306 30.993 78.294 1.00 0.00 H ATOM 8978 HB1 ALA B 218 50.093 32.659 77.999 1.00 0.00 H ATOM 8979 HB2 ALA B 218 49.302 33.262 76.522 1.00 0.00 H ATOM 8980 HB3 ALA B 218 48.510 33.467 78.104 1.00 0.00 H ATOM 8981 H ALA B 218 50.078 30.976 75.979 1.00 0.00 H ATOM 8982 N SER B 219 46.986 31.856 75.407 1.00 11.56 N ATOM 8983 CA SER B 219 45.690 32.052 74.743 1.00 9.95 C ATOM 8984 C SER B 219 45.164 30.668 74.403 1.00 10.47 C ATOM 8985 O SER B 219 45.815 29.935 73.656 1.00 12.40 O ATOM 8986 CB SER B 219 45.874 32.912 73.483 1.00 11.61 C ATOM 8987 OG SER B 219 44.616 33.315 73.017 1.00 11.09 O ATOM 8988 HA SER B 219 44.981 32.576 75.383 1.00 0.00 H ATOM 8989 HB2 SER B 219 46.379 32.329 72.713 1.00 0.00 H ATOM 8990 HB3 SER B 219 46.473 33.790 73.724 1.00 0.00 H ATOM 8991 HG SER B 219 44.728 33.870 72.205 1.00 0.00 H ATOM 8992 H SER B 219 47.857 31.849 74.839 1.00 0.00 H ATOM 8993 N ARG B 220 44.017 30.300 74.972 1.00 10.57 N ATOM 8994 CA ARG B 220 43.588 28.888 74.984 1.00 11.31 C ATOM 8995 C ARG B 220 42.068 28.792 75.041 1.00 10.50 C ATOM 8996 O ARG B 220 41.493 28.132 75.904 1.00 11.33 O ATOM 8997 CB ARG B 220 44.281 28.127 76.130 1.00 12.00 C ATOM 8998 CG ARG B 220 44.046 28.748 77.511 1.00 13.03 C ATOM 8999 CD ARG B 220 45.110 28.302 78.494 1.00 13.52 C ATOM 9000 NE ARG B 220 45.033 26.900 78.831 1.00 15.62 N ATOM 9001 CZ ARG B 220 46.070 26.061 78.860 1.00 18.01 C ATOM 9002 NH1 ARG B 220 47.290 26.445 78.464 1.00 19.53 N ATOM 9003 NH2 ARG B 220 45.887 24.825 79.311 1.00 19.75 N ATOM 9004 HA ARG B 220 43.896 28.408 74.055 1.00 0.00 H ATOM 9005 HB2 ARG B 220 43.903 27.105 76.143 1.00 0.00 H ATOM 9006 HB3 ARG B 220 45.354 28.114 75.936 1.00 0.00 H ATOM 9007 HG2 ARG B 220 44.074 29.834 77.423 1.00 0.00 H ATOM 9008 HG3 ARG B 220 43.068 28.439 77.879 1.00 0.00 H ATOM 9009 HD2 ARG B 220 45.000 28.883 79.409 1.00 0.00 H ATOM 9010 HD3 ARG B 220 46.089 28.498 78.056 1.00 0.00 H ATOM 9011 HE ARG B 220 44.097 26.514 79.070 1.00 0.00 H ATOM 9012 HH12 ARG B 220 48.083 25.773 78.496 1.00 0.00 H ATOM 9013 HH11 ARG B 220 47.445 27.416 78.124 1.00 0.00 H ATOM 9014 HH22 ARG B 220 46.685 24.159 79.340 1.00 0.00 H ATOM 9015 HH21 ARG B 220 44.946 24.524 79.635 1.00 0.00 H ATOM 9016 H ARG B 220 43.413 31.021 75.416 1.00 0.00 H ATOM 9017 N THR B 221 41.421 29.423 74.060 1.00 10.64 N ATOM 9018 CA THR B 221 39.982 29.479 74.018 1.00 10.14 C ATOM 9019 C THR B 221 39.403 28.079 74.149 1.00 10.72 C ATOM 9020 O THR B 221 39.851 27.154 73.490 1.00 11.42 O ATOM 9021 CB THR B 221 39.577 30.109 72.682 1.00 10.50 C ATOM 9022 OG1 THR B 221 40.374 31.302 72.500 1.00 12.65 O ATOM 9023 CG2 THR B 221 38.118 30.468 72.684 1.00 12.06 C ATOM 9024 HA THR B 221 39.596 30.077 74.844 1.00 0.00 H ATOM 9025 HB THR B 221 39.746 29.401 71.871 1.00 0.00 H ATOM 9026 HG1 THR B 221 40.132 31.731 71.641 1.00 0.00 H ATOM 9027 HG23 THR B 221 37.523 29.565 72.821 1.00 0.00 H ATOM 9028 HG21 THR B 221 37.918 31.164 73.498 1.00 0.00 H ATOM 9029 HG22 THR B 221 37.859 30.934 71.734 1.00 0.00 H ATOM 9030 H THR B 221 41.969 29.886 73.307 1.00 0.00 H ATOM 9031 N TYR B 222 38.400 27.971 75.011 1.00 10.84 N ATOM 9032 CA TYR B 222 37.644 26.727 75.277 1.00 11.61 C ATOM 9033 C TYR B 222 38.373 25.746 76.179 1.00 12.55 C ATOM 9034 O TYR B 222 37.771 24.756 76.579 1.00 14.54 O ATOM 9035 CB TYR B 222 37.195 25.969 73.998 1.00 12.95 C ATOM 9036 CG TYR B 222 36.453 26.882 73.036 1.00 12.07 C ATOM 9037 CD1 TYR B 222 35.390 27.669 73.471 1.00 11.71 C ATOM 9038 CD2 TYR B 222 36.858 27.013 71.726 1.00 11.77 C ATOM 9039 CE1 TYR B 222 34.739 28.531 72.631 1.00 12.42 C ATOM 9040 CE2 TYR B 222 36.214 27.866 70.848 1.00 11.54 C ATOM 9041 CZ TYR B 222 35.161 28.636 71.321 1.00 12.10 C ATOM 9042 OH TYR B 222 34.532 29.503 70.471 1.00 13.85 O ATOM 9043 HA TYR B 222 36.758 27.097 75.794 1.00 0.00 H ATOM 9044 HB3 TYR B 222 36.537 25.149 74.286 1.00 0.00 H ATOM 9045 HB2 TYR B 222 38.076 25.568 73.497 1.00 0.00 H ATOM 9046 HD2 TYR B 222 37.708 26.429 71.372 1.00 0.00 H ATOM 9047 HE2 TYR B 222 36.527 27.932 69.806 1.00 0.00 H ATOM 9048 HE1 TYR B 222 33.900 29.126 72.991 1.00 0.00 H ATOM 9049 HD1 TYR B 222 35.067 27.596 74.510 1.00 0.00 H ATOM 9050 HH TYR B 222 33.809 29.974 70.957 1.00 0.00 H ATOM 9051 H TYR B 222 38.125 28.824 75.539 1.00 0.00 H ATOM 9052 N ASP B 223 39.649 25.977 76.493 1.00 12.51 N ATOM 9053 CA ASP B 223 40.331 25.107 77.440 1.00 12.88 C ATOM 9054 C ASP B 223 39.791 25.371 78.846 1.00 13.44 C ATOM 9055 O ASP B 223 39.555 26.531 79.233 1.00 13.87 O ATOM 9056 CB ASP B 223 41.834 25.352 77.394 1.00 13.48 C ATOM 9057 CG ASP B 223 42.575 24.509 78.402 1.00 14.34 C ATOM 9058 OD1 ASP B 223 42.751 23.297 78.138 1.00 15.38 O ATOM 9059 OD2 ASP B 223 42.966 25.049 79.463 1.00 15.28 O ATOM 9060 HA ASP B 223 40.147 24.066 77.173 1.00 0.00 H ATOM 9061 HB2 ASP B 223 42.200 25.111 76.396 1.00 0.00 H ATOM 9062 HB3 ASP B 223 42.026 26.404 77.605 1.00 0.00 H ATOM 9063 H ASP B 223 40.155 26.777 76.062 1.00 0.00 H ATOM 9064 N ALA B 224 39.697 24.311 79.647 1.00 14.41 N ATOM 9065 CA ALA B 224 39.148 24.439 80.992 1.00 15.31 C ATOM 9066 C ALA B 224 39.898 25.393 81.906 1.00 16.42 C ATOM 9067 O ALA B 224 39.335 25.881 82.889 1.00 19.73 O ATOM 9068 CB ALA B 224 39.065 23.059 81.651 1.00 16.49 C ATOM 9069 HA ALA B 224 38.159 24.877 80.859 1.00 0.00 H ATOM 9070 HB1 ALA B 224 38.419 22.412 81.057 1.00 0.00 H ATOM 9071 HB2 ALA B 224 40.063 22.624 81.708 1.00 0.00 H ATOM 9072 HB3 ALA B 224 38.654 23.162 82.655 1.00 0.00 H ATOM 9073 H ALA B 224 40.019 23.381 79.309 1.00 0.00 H ATOM 9074 N HIS B 225 41.168 25.632 81.597 1.00 15.54 N ATOM 9075 CA HIS B 225 42.042 26.444 82.453 1.00 16.99 C ATOM 9076 C HIS B 225 42.438 27.745 81.796 1.00 17.23 C ATOM 9077 O HIS B 225 43.425 28.373 82.206 1.00 18.66 O ATOM 9078 CB HIS B 225 43.254 25.629 82.882 1.00 19.62 C ATOM 9079 CG HIS B 225 42.875 24.402 83.636 1.00 22.13 C ATOM 9080 ND1 HIS B 225 42.760 23.169 83.032 1.00 22.81 N ATOM 9081 CD2 HIS B 225 42.500 24.234 84.923 1.00 24.66 C ATOM 9082 CE1 HIS B 225 42.375 22.277 83.929 1.00 24.75 C ATOM 9083 NE2 HIS B 225 42.213 22.898 85.088 1.00 25.79 N ATOM 9084 HA HIS B 225 41.480 26.719 83.346 1.00 0.00 H ATOM 9085 HB2 HIS B 225 43.811 25.335 81.993 1.00 0.00 H ATOM 9086 HB3 HIS B 225 43.886 26.249 83.517 1.00 0.00 H ATOM 9087 HD2 HIS B 225 42.437 25.010 85.686 1.00 0.00 H ATOM 9088 HE1 HIS B 225 42.218 21.214 83.746 1.00 0.00 H ATOM 9089 H HIS B 225 41.556 25.231 80.720 1.00 0.00 H ATOM 9090 N ARG B 226 41.636 28.200 80.845 1.00 14.90 N ATOM 9091 CA ARG B 226 41.813 29.558 80.321 1.00 14.96 C ATOM 9092 C ARG B 226 41.670 30.603 81.449 1.00 14.91 C ATOM 9093 O ARG B 226 40.951 30.382 82.441 1.00 16.32 O ATOM 9094 CB ARG B 226 40.788 29.794 79.219 1.00 14.50 C ATOM 9095 CG ARG B 226 39.366 29.828 79.704 1.00 13.97 C ATOM 9096 CD ARG B 226 38.428 29.713 78.518 1.00 15.75 C ATOM 9097 NE ARG B 226 37.032 29.788 78.923 1.00 16.26 N ATOM 9098 CZ ARG B 226 36.310 28.751 79.335 1.00 17.14 C ATOM 9099 NH1 ARG B 226 36.849 27.530 79.465 1.00 18.01 N ATOM 9100 NH2 ARG B 226 35.053 28.941 79.680 1.00 19.72 N ATOM 9101 HA ARG B 226 42.816 29.665 79.908 1.00 0.00 H ATOM 9102 HB2 ARG B 226 41.011 30.748 78.742 1.00 0.00 H ATOM 9103 HB3 ARG B 226 40.881 28.993 78.486 1.00 0.00 H ATOM 9104 HG2 ARG B 226 39.194 28.996 80.387 1.00 0.00 H ATOM 9105 HG3 ARG B 226 39.181 30.768 80.225 1.00 0.00 H ATOM 9106 HD2 ARG B 226 38.601 28.758 78.022 1.00 0.00 H ATOM 9107 HD3 ARG B 226 38.638 30.525 77.822 1.00 0.00 H ATOM 9108 HE ARG B 226 36.567 30.718 78.888 1.00 0.00 H ATOM 9109 HH12 ARG B 226 36.263 26.735 79.789 1.00 0.00 H ATOM 9110 HH11 ARG B 226 37.853 27.378 79.241 1.00 0.00 H ATOM 9111 HH22 ARG B 226 34.476 28.139 80.004 1.00 0.00 H ATOM 9112 HH21 ARG B 226 34.638 29.893 79.628 1.00 0.00 H ATOM 9113 H ARG B 226 40.880 27.593 80.469 1.00 0.00 H ATOM 9114 N ASP B 227 42.335 31.745 81.283 1.00 13.83 N ATOM 9115 CA ASP B 227 42.344 32.755 82.351 1.00 13.58 C ATOM 9116 C ASP B 227 42.395 34.180 81.814 1.00 13.04 C ATOM 9117 O ASP B 227 42.927 35.069 82.476 1.00 15.86 O ATOM 9118 CB ASP B 227 43.509 32.522 83.354 1.00 15.79 C ATOM 9119 CG ASP B 227 44.870 32.951 82.801 1.00 16.80 C ATOM 9120 OD1 ASP B 227 45.096 32.788 81.579 1.00 16.78 O ATOM 9121 OD2 ASP B 227 45.716 33.474 83.596 1.00 16.86 O ATOM 9122 HA ASP B 227 41.398 32.635 82.879 1.00 0.00 H ATOM 9123 HB2 ASP B 227 43.307 33.093 84.260 1.00 0.00 H ATOM 9124 HB3 ASP B 227 43.552 31.460 83.597 1.00 0.00 H ATOM 9125 H ASP B 227 42.849 31.922 80.396 1.00 0.00 H ATOM 9126 N GLY B 228 41.851 34.404 80.631 1.00 12.50 N ATOM 9127 CA GLY B 228 41.801 35.759 80.058 1.00 11.67 C ATOM 9128 C GLY B 228 42.475 35.840 78.714 1.00 11.48 C ATOM 9129 O GLY B 228 43.215 34.922 78.288 1.00 11.71 O ATOM 9130 HA3 GLY B 228 42.299 36.447 80.741 1.00 0.00 H ATOM 9131 HA2 GLY B 228 40.758 36.053 79.945 1.00 0.00 H ATOM 9132 H GLY B 228 41.451 33.608 80.095 1.00 0.00 H ATOM 9133 N PHE B 229 42.251 36.951 78.031 1.00 10.84 N ATOM 9134 CA PHE B 229 42.791 37.080 76.701 1.00 10.14 C ATOM 9135 C PHE B 229 44.242 37.526 76.692 1.00 9.60 C ATOM 9136 O PHE B 229 44.772 38.037 77.706 1.00 10.05 O ATOM 9137 CB PHE B 229 41.861 37.916 75.792 1.00 11.16 C ATOM 9138 CG PHE B 229 41.873 39.434 75.994 1.00 11.63 C ATOM 9139 CD1 PHE B 229 42.811 40.221 75.348 1.00 11.35 C ATOM 9140 CD2 PHE B 229 40.835 40.058 76.666 1.00 14.40 C ATOM 9141 CE1 PHE B 229 42.748 41.620 75.412 1.00 12.75 C ATOM 9142 CE2 PHE B 229 40.782 41.454 76.756 1.00 15.36 C ATOM 9143 CZ PHE B 229 41.742 42.230 76.132 1.00 14.20 C ATOM 9144 HA PHE B 229 42.818 36.083 76.261 1.00 0.00 H ATOM 9145 HB2 PHE B 229 42.147 37.719 74.759 1.00 0.00 H ATOM 9146 HB3 PHE B 229 40.841 37.570 75.958 1.00 0.00 H ATOM 9147 HD2 PHE B 229 40.052 39.457 77.129 1.00 0.00 H ATOM 9148 HE2 PHE B 229 39.981 41.931 77.320 1.00 0.00 H ATOM 9149 HZ PHE B 229 41.704 43.317 76.209 1.00 0.00 H ATOM 9150 HE1 PHE B 229 43.492 42.224 74.894 1.00 0.00 H ATOM 9151 HD1 PHE B 229 43.611 39.745 74.781 1.00 0.00 H ATOM 9152 H PHE B 229 41.692 37.722 78.449 1.00 0.00 H ATOM 9153 N VAL B 230 44.888 37.368 75.535 1.00 9.96 N ATOM 9154 CA VAL B 230 46.250 37.843 75.329 1.00 9.99 C ATOM 9155 C VAL B 230 46.153 39.008 74.359 1.00 9.27 C ATOM 9156 O VAL B 230 45.666 38.858 73.246 1.00 10.58 O ATOM 9157 CB VAL B 230 47.155 36.738 74.778 1.00 9.79 C ATOM 9158 CG1 VAL B 230 48.521 37.288 74.401 1.00 11.64 C ATOM 9159 CG2 VAL B 230 47.268 35.593 75.778 1.00 11.65 C ATOM 9160 HA VAL B 230 46.699 38.152 76.273 1.00 0.00 H ATOM 9161 HB VAL B 230 46.703 36.344 73.868 1.00 0.00 H ATOM 9162 HG11 VAL B 230 48.404 38.057 73.637 1.00 0.00 H ATOM 9163 HG12 VAL B 230 48.994 37.720 75.283 1.00 0.00 H ATOM 9164 HG13 VAL B 230 49.142 36.481 74.013 1.00 0.00 H ATOM 9165 HG21 VAL B 230 47.692 35.967 76.710 1.00 0.00 H ATOM 9166 HG22 VAL B 230 46.278 35.179 75.968 1.00 0.00 H ATOM 9167 HG23 VAL B 230 47.915 34.817 75.369 1.00 0.00 H ATOM 9168 H VAL B 230 44.401 36.888 74.751 1.00 0.00 H ATOM 9169 N ILE B 231 46.569 40.190 74.788 1.00 9.61 N ATOM 9170 CA ILE B 231 46.418 41.360 73.962 1.00 9.27 C ATOM 9171 C ILE B 231 47.366 41.321 72.764 1.00 9.37 C ATOM 9172 O ILE B 231 48.460 40.758 72.843 1.00 10.55 O ATOM 9173 CB ILE B 231 46.628 42.638 74.823 1.00 10.65 C ATOM 9174 CG1 ILE B 231 46.040 43.891 74.140 1.00 11.56 C ATOM 9175 CG2 ILE B 231 48.098 42.824 75.259 1.00 12.13 C ATOM 9176 CD1 ILE B 231 45.757 44.999 75.131 1.00 13.82 C ATOM 9177 HA ILE B 231 45.406 41.379 73.558 1.00 0.00 H ATOM 9178 HB ILE B 231 46.065 42.495 75.745 1.00 0.00 H ATOM 9179 HG12 ILE B 231 46.752 44.255 73.399 1.00 0.00 H ATOM 9180 HG13 ILE B 231 45.109 43.617 73.643 1.00 0.00 H ATOM 9181 HD11 ILE B 231 45.039 44.647 75.872 1.00 0.00 H ATOM 9182 HD12 ILE B 231 46.684 45.286 75.628 1.00 0.00 H ATOM 9183 HD13 ILE B 231 45.345 45.859 74.604 1.00 0.00 H ATOM 9184 HG21 ILE B 231 48.411 41.965 75.852 1.00 0.00 H ATOM 9185 HG22 ILE B 231 48.730 42.907 74.375 1.00 0.00 H ATOM 9186 HG23 ILE B 231 48.186 43.731 75.857 1.00 0.00 H ATOM 9187 H ILE B 231 47.007 40.274 75.727 1.00 0.00 H ATOM 9188 N ALA B 232 46.943 41.922 71.656 1.00 9.66 N ATOM 9189 CA ALA B 232 47.747 41.879 70.429 1.00 9.62 C ATOM 9190 C ALA B 232 47.574 43.180 69.681 1.00 10.15 C ATOM 9191 O ALA B 232 46.681 43.973 70.005 1.00 9.71 O ATOM 9192 CB ALA B 232 47.312 40.681 69.536 1.00 11.15 C ATOM 9193 HA ALA B 232 48.797 41.744 70.689 1.00 0.00 H ATOM 9194 HB1 ALA B 232 47.452 39.750 70.085 1.00 0.00 H ATOM 9195 HB2 ALA B 232 46.261 40.792 69.268 1.00 0.00 H ATOM 9196 HB3 ALA B 232 47.919 40.665 68.631 1.00 0.00 H ATOM 9197 H ALA B 232 46.034 42.427 71.659 1.00 0.00 H ATOM 9198 N GLY B 233 48.442 43.401 68.692 1.00 10.86 N ATOM 9199 CA GLY B 233 48.320 44.597 67.836 1.00 11.29 C ATOM 9200 C GLY B 233 48.393 44.168 66.385 1.00 9.57 C ATOM 9201 O GLY B 233 48.709 43.016 66.087 1.00 12.52 O ATOM 9202 HA3 GLY B 233 49.133 45.289 68.055 1.00 0.00 H ATOM 9203 HA2 GLY B 233 47.365 45.088 68.026 1.00 0.00 H ATOM 9204 H GLY B 233 49.213 42.723 68.523 1.00 0.00 H ATOM 9205 N GLY B 234 48.132 45.108 65.485 1.00 9.03 N ATOM 9206 CA GLY B 234 48.249 44.824 64.066 1.00 9.55 C ATOM 9207 C GLY B 234 47.222 45.578 63.253 1.00 7.96 C ATOM 9208 O GLY B 234 46.620 46.555 63.739 1.00 8.97 O ATOM 9209 HA3 GLY B 234 48.108 43.755 63.908 1.00 0.00 H ATOM 9210 HA2 GLY B 234 49.245 45.112 63.730 1.00 0.00 H ATOM 9211 H GLY B 234 47.841 46.056 65.799 1.00 0.00 H ATOM 9212 N GLY B 235 47.063 45.172 62.000 1.00 8.50 N ATOM 9213 CA GLY B 235 46.087 45.851 61.150 1.00 8.77 C ATOM 9214 C GLY B 235 45.542 44.903 60.113 1.00 7.47 C ATOM 9215 O GLY B 235 46.057 43.776 59.913 1.00 7.83 O ATOM 9216 HA3 GLY B 235 46.569 46.691 60.650 1.00 0.00 H ATOM 9217 HA2 GLY B 235 45.267 46.218 61.767 1.00 0.00 H ATOM 9218 H GLY B 235 47.626 44.381 61.627 1.00 0.00 H ATOM 9219 N GLY B 236 44.500 45.335 59.438 1.00 7.28 N ATOM 9220 CA GLY B 236 43.999 44.594 58.279 1.00 8.04 C ATOM 9221 C GLY B 236 43.133 45.499 57.444 1.00 7.44 C ATOM 9222 O GLY B 236 42.607 46.506 57.968 1.00 7.95 O ATOM 9223 HA3 GLY B 236 43.412 43.740 58.618 1.00 0.00 H ATOM 9224 HA2 GLY B 236 44.839 44.241 57.681 1.00 0.00 H ATOM 9225 H GLY B 236 44.026 46.213 59.731 1.00 0.00 H ATOM 9226 N MET B 237 42.971 45.135 56.176 1.00 6.93 N ATOM 9227 CA MET B 237 42.131 45.921 55.282 1.00 6.97 C ATOM 9228 C MET B 237 41.570 45.000 54.233 1.00 7.24 C ATOM 9229 O MET B 237 42.306 44.136 53.745 1.00 8.41 O ATOM 9230 CB MET B 237 42.933 47.038 54.592 1.00 8.31 C ATOM 9231 CG MET B 237 42.054 48.181 54.002 1.00 11.49 C ATOM 9232 SD MET B 237 41.194 49.225 55.230 1.00 12.41 S ATOM 9233 CE MET B 237 42.421 49.697 56.219 1.00 13.45 C ATOM 9234 HA MET B 237 41.337 46.387 55.865 1.00 0.00 H ATOM 9235 HB2 MET B 237 43.614 47.473 55.324 1.00 0.00 H ATOM 9236 HB3 MET B 237 43.509 46.595 53.780 1.00 0.00 H ATOM 9237 HG2 MET B 237 41.300 47.727 53.359 1.00 0.00 H ATOM 9238 HG3 MET B 237 42.698 48.826 53.405 1.00 0.00 H ATOM 9239 HE1 MET B 237 42.887 48.817 56.663 1.00 0.00 H ATOM 9240 HE2 MET B 237 43.162 50.248 55.639 1.00 0.00 H ATOM 9241 HE3 MET B 237 42.025 50.337 57.007 1.00 0.00 H ATOM 9242 H MET B 237 43.448 44.282 55.819 1.00 0.00 H ATOM 9243 N VAL B 238 40.296 45.176 53.908 1.00 6.84 N ATOM 9244 CA VAL B 238 39.690 44.448 52.798 1.00 8.17 C ATOM 9245 C VAL B 238 39.112 45.474 51.816 1.00 7.71 C ATOM 9246 O VAL B 238 38.715 46.592 52.184 1.00 8.05 O ATOM 9247 CB VAL B 238 38.610 43.430 53.257 1.00 8.16 C ATOM 9248 CG1 VAL B 238 39.258 42.303 54.025 1.00 8.37 C ATOM 9249 CG2 VAL B 238 37.484 44.088 54.068 1.00 8.63 C ATOM 9250 HA VAL B 238 40.459 43.848 52.311 1.00 0.00 H ATOM 9251 HB VAL B 238 38.138 43.023 52.363 1.00 0.00 H ATOM 9252 HG11 VAL B 238 39.980 41.797 53.385 1.00 0.00 H ATOM 9253 HG12 VAL B 238 39.767 42.707 54.900 1.00 0.00 H ATOM 9254 HG13 VAL B 238 38.493 41.594 54.343 1.00 0.00 H ATOM 9255 HG21 VAL B 238 37.905 44.555 54.959 1.00 0.00 H ATOM 9256 HG22 VAL B 238 36.993 44.845 53.457 1.00 0.00 H ATOM 9257 HG23 VAL B 238 36.759 43.329 54.362 1.00 0.00 H ATOM 9258 H VAL B 238 39.718 45.846 54.455 1.00 0.00 H ATOM 9259 N VAL B 239 39.061 45.063 50.554 1.00 7.64 N ATOM 9260 CA VAL B 239 38.424 45.906 49.522 1.00 7.60 C ATOM 9261 C VAL B 239 36.985 45.413 49.347 1.00 7.76 C ATOM 9262 O VAL B 239 36.782 44.284 48.867 1.00 9.21 O ATOM 9263 CB VAL B 239 39.176 45.756 48.189 1.00 7.61 C ATOM 9264 CG1 VAL B 239 38.560 46.706 47.163 1.00 9.95 C ATOM 9265 CG2 VAL B 239 40.677 46.042 48.388 1.00 9.63 C ATOM 9266 HA VAL B 239 38.445 46.954 49.821 1.00 0.00 H ATOM 9267 HB VAL B 239 39.083 44.734 47.822 1.00 0.00 H ATOM 9268 HG11 VAL B 239 37.508 46.456 47.023 1.00 0.00 H ATOM 9269 HG12 VAL B 239 38.646 47.732 47.522 1.00 0.00 H ATOM 9270 HG13 VAL B 239 39.088 46.606 46.214 1.00 0.00 H ATOM 9271 HG21 VAL B 239 40.806 47.059 48.758 1.00 0.00 H ATOM 9272 HG22 VAL B 239 41.087 45.337 49.111 1.00 0.00 H ATOM 9273 HG23 VAL B 239 41.196 45.932 47.436 1.00 0.00 H ATOM 9274 H VAL B 239 39.471 44.144 50.292 1.00 0.00 H ATOM 9275 N VAL B 240 36.029 46.224 49.801 1.00 7.64 N ATOM 9276 CA VAL B 240 34.602 45.904 49.671 1.00 7.42 C ATOM 9277 C VAL B 240 34.116 46.588 48.393 1.00 7.90 C ATOM 9278 O VAL B 240 34.319 47.780 48.214 1.00 9.52 O ATOM 9279 CB VAL B 240 33.797 46.360 50.886 1.00 8.90 C ATOM 9280 CG1 VAL B 240 32.334 45.950 50.766 1.00 11.94 C ATOM 9281 CG2 VAL B 240 34.407 45.798 52.181 1.00 10.46 C ATOM 9282 HA VAL B 240 34.460 44.825 49.617 1.00 0.00 H ATOM 9283 HB VAL B 240 33.839 47.449 50.924 1.00 0.00 H ATOM 9284 HG11 VAL B 240 31.903 46.403 49.873 1.00 0.00 H ATOM 9285 HG12 VAL B 240 32.267 44.865 50.692 1.00 0.00 H ATOM 9286 HG13 VAL B 240 31.789 46.290 51.647 1.00 0.00 H ATOM 9287 HG21 VAL B 240 34.401 44.709 52.141 1.00 0.00 H ATOM 9288 HG22 VAL B 240 35.432 46.153 52.282 1.00 0.00 H ATOM 9289 HG23 VAL B 240 33.818 46.135 53.034 1.00 0.00 H ATOM 9290 H VAL B 240 36.304 47.114 50.263 1.00 0.00 H ATOM 9291 N GLU B 241 33.531 45.817 47.494 1.00 8.34 N ATOM 9292 CA GLU B 241 33.247 46.334 46.160 1.00 8.67 C ATOM 9293 C GLU B 241 31.858 45.938 45.681 1.00 7.83 C ATOM 9294 O GLU B 241 31.405 44.812 45.930 1.00 9.08 O ATOM 9295 CB GLU B 241 34.332 45.841 45.218 1.00 9.18 C ATOM 9296 CG GLU B 241 34.293 46.400 43.826 1.00 10.51 C ATOM 9297 CD GLU B 241 35.550 46.136 43.026 1.00 11.48 C ATOM 9298 OE1 GLU B 241 36.515 45.525 43.565 1.00 13.16 O ATOM 9299 OE2 GLU B 241 35.589 46.563 41.840 1.00 12.42 O ATOM 9300 HA GLU B 241 33.251 47.424 46.184 1.00 0.00 H ATOM 9301 HB2 GLU B 241 35.297 46.098 45.655 1.00 0.00 H ATOM 9302 HB3 GLU B 241 34.245 44.757 45.146 1.00 0.00 H ATOM 9303 HG2 GLU B 241 33.450 45.953 43.299 1.00 0.00 H ATOM 9304 HG3 GLU B 241 34.148 47.478 43.892 1.00 0.00 H ATOM 9305 H GLU B 241 33.272 44.840 47.738 1.00 0.00 H ATOM 9306 N GLU B 242 31.195 46.823 44.950 1.00 8.67 N ATOM 9307 CA GLU B 242 29.911 46.463 44.389 1.00 9.06 C ATOM 9308 C GLU B 242 30.133 45.384 43.319 1.00 8.95 C ATOM 9309 O GLU B 242 31.087 45.440 42.532 1.00 9.61 O ATOM 9310 CB GLU B 242 29.238 47.720 43.829 1.00 9.29 C ATOM 9311 CG GLU B 242 27.819 47.472 43.379 1.00 11.46 C ATOM 9312 CD GLU B 242 27.736 47.007 41.937 1.00 13.11 C ATOM 9313 OE1 GLU B 242 28.565 47.433 41.101 1.00 14.98 O ATOM 9314 OE2 GLU B 242 26.814 46.208 41.635 1.00 14.63 O ATOM 9315 HA GLU B 242 29.245 46.051 45.147 1.00 0.00 H ATOM 9316 HB2 GLU B 242 29.229 48.486 44.605 1.00 0.00 H ATOM 9317 HB3 GLU B 242 29.817 48.075 42.977 1.00 0.00 H ATOM 9318 HG2 GLU B 242 27.378 46.707 44.019 1.00 0.00 H ATOM 9319 HG3 GLU B 242 27.254 48.398 43.480 1.00 0.00 H ATOM 9320 H GLU B 242 31.595 47.768 44.781 1.00 0.00 H ATOM 9321 N LEU B 243 29.225 44.397 43.269 1.00 8.96 N ATOM 9322 CA LEU B 243 29.459 43.220 42.447 1.00 10.20 C ATOM 9323 C LEU B 243 29.618 43.524 40.960 1.00 11.01 C ATOM 9324 O LEU B 243 30.541 43.010 40.318 1.00 10.70 O ATOM 9325 CB LEU B 243 28.284 42.252 42.629 1.00 11.50 C ATOM 9326 CG LEU B 243 28.339 40.978 41.766 1.00 11.83 C ATOM 9327 CD1 LEU B 243 29.619 40.159 41.930 1.00 12.72 C ATOM 9328 CD2 LEU B 243 27.087 40.137 41.982 1.00 14.99 C ATOM 9329 HA LEU B 243 30.403 42.788 42.780 1.00 0.00 H ATOM 9330 HB2 LEU B 243 28.257 41.949 43.676 1.00 0.00 H ATOM 9331 HB3 LEU B 243 27.366 42.786 42.383 1.00 0.00 H ATOM 9332 HG LEU B 243 28.365 41.312 40.729 1.00 0.00 H ATOM 9333 HD21 LEU B 243 27.018 39.853 43.032 1.00 0.00 H ATOM 9334 HD22 LEU B 243 26.208 40.718 41.703 1.00 0.00 H ATOM 9335 HD23 LEU B 243 27.142 39.240 41.365 1.00 0.00 H ATOM 9336 HD11 LEU B 243 30.478 40.770 41.651 1.00 0.00 H ATOM 9337 HD12 LEU B 243 29.717 39.844 42.969 1.00 0.00 H ATOM 9338 HD13 LEU B 243 29.572 39.281 41.286 1.00 0.00 H ATOM 9339 H LEU B 243 28.348 44.474 43.822 1.00 0.00 H ATOM 9340 N GLU B 244 28.727 44.322 40.393 1.00 11.26 N ATOM 9341 CA GLU B 244 28.865 44.570 38.959 1.00 12.80 C ATOM 9342 C GLU B 244 30.152 45.314 38.620 1.00 11.40 C ATOM 9343 O GLU B 244 30.786 45.037 37.588 1.00 12.62 O ATOM 9344 CB GLU B 244 27.640 45.291 38.428 1.00 15.29 C ATOM 9345 CG GLU B 244 26.354 44.429 38.550 1.00 19.35 C ATOM 9346 CD GLU B 244 26.471 43.027 37.909 1.00 23.77 C ATOM 9347 OE1 GLU B 244 27.101 42.884 36.819 1.00 26.42 O ATOM 9348 OE2 GLU B 244 25.899 42.067 38.495 1.00 27.24 O ATOM 9349 HA GLU B 244 28.935 43.603 38.461 1.00 0.00 H ATOM 9350 HB2 GLU B 244 27.501 46.212 38.995 1.00 0.00 H ATOM 9351 HB3 GLU B 244 27.802 45.533 37.378 1.00 0.00 H ATOM 9352 HG2 GLU B 244 26.124 44.304 39.608 1.00 0.00 H ATOM 9353 HG3 GLU B 244 25.537 44.961 38.063 1.00 0.00 H ATOM 9354 H GLU B 244 27.960 44.755 40.945 1.00 0.00 H ATOM 9355 N HIS B 245 30.562 46.232 39.489 1.00 10.98 N ATOM 9356 CA HIS B 245 31.805 46.944 39.304 1.00 10.70 C ATOM 9357 C HIS B 245 32.993 45.964 39.343 1.00 9.60 C ATOM 9358 O HIS B 245 33.914 46.046 38.542 1.00 11.35 O ATOM 9359 CB HIS B 245 31.913 48.016 40.412 1.00 11.74 C ATOM 9360 CG HIS B 245 33.074 48.941 40.236 1.00 11.70 C ATOM 9361 ND1 HIS B 245 34.355 48.641 40.667 1.00 12.54 N ATOM 9362 CD2 HIS B 245 33.151 50.160 39.646 1.00 13.52 C ATOM 9363 CE1 HIS B 245 35.165 49.641 40.356 1.00 13.50 C ATOM 9364 NE2 HIS B 245 34.458 50.576 39.744 1.00 13.76 N ATOM 9365 HA HIS B 245 31.827 47.432 38.329 1.00 0.00 H ATOM 9366 HB2 HIS B 245 30.997 48.607 40.411 1.00 0.00 H ATOM 9367 HB3 HIS B 245 32.017 47.511 41.372 1.00 0.00 H ATOM 9368 HD2 HIS B 245 32.331 50.707 39.181 1.00 0.00 H ATOM 9369 HE1 HIS B 245 36.233 49.686 40.568 1.00 0.00 H ATOM 9370 H HIS B 245 29.975 46.443 40.321 1.00 0.00 H ATOM 9371 N ALA B 246 32.967 45.017 40.273 1.00 9.93 N ATOM 9372 CA ALA B 246 34.033 44.018 40.385 1.00 10.19 C ATOM 9373 C ALA B 246 34.084 43.158 39.125 1.00 10.30 C ATOM 9374 O ALA B 246 35.162 42.919 38.553 1.00 11.94 O ATOM 9375 CB ALA B 246 33.806 43.152 41.613 1.00 10.24 C ATOM 9376 HA ALA B 246 34.989 44.530 40.491 1.00 0.00 H ATOM 9377 HB1 ALA B 246 33.807 43.780 42.504 1.00 0.00 H ATOM 9378 HB2 ALA B 246 32.845 42.644 41.525 1.00 0.00 H ATOM 9379 HB3 ALA B 246 34.604 42.413 41.687 1.00 0.00 H ATOM 9380 H ALA B 246 32.169 44.983 40.939 1.00 0.00 H ATOM 9381 N LEU B 247 32.922 42.690 38.683 1.00 10.40 N ATOM 9382 CA LEU B 247 32.880 41.801 37.514 1.00 11.76 C ATOM 9383 C LEU B 247 33.369 42.541 36.279 1.00 13.37 C ATOM 9384 O LEU B 247 34.081 41.981 35.441 1.00 14.80 O ATOM 9385 CB LEU B 247 31.451 41.287 37.253 1.00 13.09 C ATOM 9386 CG LEU B 247 30.939 40.307 38.309 1.00 13.49 C ATOM 9387 CD1 LEU B 247 29.470 39.988 38.056 1.00 15.02 C ATOM 9388 CD2 LEU B 247 31.772 39.007 38.351 1.00 14.71 C ATOM 9389 HA LEU B 247 33.528 40.950 37.723 1.00 0.00 H ATOM 9390 HB2 LEU B 247 30.778 42.144 37.226 1.00 0.00 H ATOM 9391 HB3 LEU B 247 31.438 40.786 36.285 1.00 0.00 H ATOM 9392 HG LEU B 247 31.044 40.788 39.282 1.00 0.00 H ATOM 9393 HD21 LEU B 247 31.724 38.515 37.380 1.00 0.00 H ATOM 9394 HD22 LEU B 247 32.808 39.249 38.587 1.00 0.00 H ATOM 9395 HD23 LEU B 247 31.369 38.344 39.116 1.00 0.00 H ATOM 9396 HD11 LEU B 247 28.886 40.907 38.106 1.00 0.00 H ATOM 9397 HD12 LEU B 247 29.362 39.540 37.068 1.00 0.00 H ATOM 9398 HD13 LEU B 247 29.116 39.289 38.814 1.00 0.00 H ATOM 9399 H LEU B 247 32.039 42.954 39.166 1.00 0.00 H ATOM 9400 N ALA B 248 33.023 43.819 36.175 1.00 13.60 N ATOM 9401 CA ALA B 248 33.360 44.583 34.968 1.00 15.34 C ATOM 9402 C ALA B 248 34.860 44.795 34.814 1.00 15.17 C ATOM 9403 O ALA B 248 35.370 44.922 33.685 1.00 18.24 O ATOM 9404 CB ALA B 248 32.612 45.890 34.974 1.00 15.21 C ATOM 9405 HA ALA B 248 33.050 44.001 34.100 1.00 0.00 H ATOM 9406 HB1 ALA B 248 31.540 45.694 34.992 1.00 0.00 H ATOM 9407 HB2 ALA B 248 32.893 46.464 35.857 1.00 0.00 H ATOM 9408 HB3 ALA B 248 32.864 46.455 34.077 1.00 0.00 H ATOM 9409 H ALA B 248 32.510 44.281 36.953 1.00 0.00 H ATOM 9410 N ARG B 249 35.580 44.828 35.927 1.00 13.44 N ATOM 9411 CA ARG B 249 37.050 45.003 35.862 1.00 14.92 C ATOM 9412 C ARG B 249 37.800 43.683 35.970 1.00 15.46 C ATOM 9413 O ARG B 249 39.034 43.688 36.052 1.00 17.69 O ATOM 9414 CB ARG B 249 37.550 46.006 36.891 1.00 15.58 C ATOM 9415 CG ARG B 249 37.486 45.468 38.331 1.00 13.71 C ATOM 9416 CD ARG B 249 37.982 46.532 39.291 1.00 14.20 C ATOM 9417 NE ARG B 249 38.042 46.041 40.658 1.00 12.90 N ATOM 9418 CZ ARG B 249 39.074 45.351 41.150 1.00 12.18 C ATOM 9419 NH1 ARG B 249 40.134 45.068 40.387 1.00 13.20 N ATOM 9420 NH2 ARG B 249 39.041 44.942 42.403 1.00 13.66 N ATOM 9421 HA ARG B 249 37.263 45.410 34.874 1.00 0.00 H ATOM 9422 HB2 ARG B 249 38.585 46.257 36.659 1.00 0.00 H ATOM 9423 HB3 ARG B 249 36.937 46.905 36.828 1.00 0.00 H ATOM 9424 HG2 ARG B 249 36.456 45.208 38.577 1.00 0.00 H ATOM 9425 HG3 ARG B 249 38.113 44.581 38.416 1.00 0.00 H ATOM 9426 HD2 ARG B 249 37.305 47.386 39.252 1.00 0.00 H ATOM 9427 HD3 ARG B 249 38.980 46.846 38.985 1.00 0.00 H ATOM 9428 HE ARG B 249 37.237 46.238 41.287 1.00 0.00 H ATOM 9429 HH12 ARG B 249 40.931 44.530 40.783 1.00 0.00 H ATOM 9430 HH11 ARG B 249 40.162 45.386 39.397 1.00 0.00 H ATOM 9431 HH22 ARG B 249 39.840 44.404 42.796 1.00 0.00 H ATOM 9432 HH21 ARG B 249 38.216 45.157 42.999 1.00 0.00 H ATOM 9433 H ARG B 249 35.111 44.731 36.850 1.00 0.00 H ATOM 9434 N GLY B 250 37.083 42.553 35.932 1.00 14.77 N ATOM 9435 CA GLY B 250 37.776 41.261 36.011 1.00 15.01 C ATOM 9436 C GLY B 250 38.430 41.061 37.375 1.00 14.11 C ATOM 9437 O GLY B 250 39.505 40.478 37.473 1.00 17.41 O ATOM 9438 HA3 GLY B 250 38.545 41.223 35.240 1.00 0.00 H ATOM 9439 HA2 GLY B 250 37.055 40.461 35.843 1.00 0.00 H ATOM 9440 H GLY B 250 36.047 42.590 35.847 1.00 0.00 H ATOM 9441 N ALA B 251 37.776 41.525 38.434 1.00 12.53 N ATOM 9442 CA ALA B 251 38.321 41.374 39.773 1.00 13.00 C ATOM 9443 C ALA B 251 38.436 39.906 40.157 1.00 12.92 C ATOM 9444 O ALA B 251 37.653 39.068 39.733 1.00 14.35 O ATOM 9445 CB ALA B 251 37.416 42.063 40.777 1.00 12.68 C ATOM 9446 HA ALA B 251 39.314 41.825 39.781 1.00 0.00 H ATOM 9447 HB1 ALA B 251 37.346 43.123 40.533 1.00 0.00 H ATOM 9448 HB2 ALA B 251 36.424 41.613 40.738 1.00 0.00 H ATOM 9449 HB3 ALA B 251 37.831 41.946 41.778 1.00 0.00 H ATOM 9450 H ALA B 251 36.862 42.003 38.303 1.00 0.00 H ATOM 9451 N HIS B 252 39.377 39.633 41.038 1.00 12.63 N ATOM 9452 CA HIS B 252 39.393 38.358 41.744 1.00 12.84 C ATOM 9453 C HIS B 252 38.487 38.531 42.958 1.00 12.79 C ATOM 9454 O HIS B 252 38.734 39.410 43.800 1.00 15.01 O ATOM 9455 CB HIS B 252 40.796 38.009 42.199 1.00 14.93 C ATOM 9456 CG HIS B 252 40.827 36.884 43.183 1.00 15.45 C ATOM 9457 ND1 HIS B 252 41.134 37.087 44.510 1.00 18.79 N ATOM 9458 CD2 HIS B 252 40.503 35.574 43.070 1.00 19.02 C ATOM 9459 CE1 HIS B 252 41.058 35.942 45.166 1.00 19.98 C ATOM 9460 NE2 HIS B 252 40.695 35.001 44.313 1.00 18.03 N ATOM 9461 HA HIS B 252 39.052 37.552 41.094 1.00 0.00 H ATOM 9462 HB2 HIS B 252 41.384 37.724 41.326 1.00 0.00 H ATOM 9463 HB3 HIS B 252 41.240 38.889 42.663 1.00 0.00 H ATOM 9464 HD2 HIS B 252 40.156 35.067 42.169 1.00 0.00 H ATOM 9465 HE1 HIS B 252 41.260 35.799 46.228 1.00 0.00 H ATOM 9466 H HIS B 252 40.118 40.336 41.232 1.00 0.00 H ATOM 9467 N ILE B 253 37.439 37.718 43.039 1.00 12.04 N ATOM 9468 CA ILE B 253 36.461 37.837 44.103 1.00 11.14 C ATOM 9469 C ILE B 253 36.662 36.697 45.096 1.00 11.17 C ATOM 9470 O ILE B 253 36.524 35.500 44.748 1.00 13.23 O ATOM 9471 CB ILE B 253 35.042 37.800 43.526 1.00 11.52 C ATOM 9472 CG1 ILE B 253 34.838 39.066 42.667 1.00 12.58 C ATOM 9473 CG2 ILE B 253 34.027 37.716 44.658 1.00 13.99 C ATOM 9474 CD1 ILE B 253 33.520 39.056 41.843 1.00 14.17 C ATOM 9475 HA ILE B 253 36.595 38.790 44.615 1.00 0.00 H ATOM 9476 HB ILE B 253 34.900 36.920 42.898 1.00 0.00 H ATOM 9477 HG12 ILE B 253 34.824 39.932 43.328 1.00 0.00 H ATOM 9478 HG13 ILE B 253 35.676 39.152 41.975 1.00 0.00 H ATOM 9479 HD11 ILE B 253 33.522 38.201 41.167 1.00 0.00 H ATOM 9480 HD12 ILE B 253 32.670 38.982 42.521 1.00 0.00 H ATOM 9481 HD13 ILE B 253 33.447 39.977 41.265 1.00 0.00 H ATOM 9482 HG21 ILE B 253 34.205 36.810 45.237 1.00 0.00 H ATOM 9483 HG22 ILE B 253 34.132 38.588 45.304 1.00 0.00 H ATOM 9484 HG23 ILE B 253 33.020 37.690 44.241 1.00 0.00 H ATOM 9485 H ILE B 253 37.317 36.977 42.320 1.00 0.00 H ATOM 9486 N TYR B 254 36.988 37.049 46.336 1.00 9.80 N ATOM 9487 CA TYR B 254 37.115 36.016 47.363 1.00 9.62 C ATOM 9488 C TYR B 254 35.727 35.496 47.727 1.00 10.16 C ATOM 9489 O TYR B 254 35.493 34.283 47.819 1.00 12.62 O ATOM 9490 CB TYR B 254 37.793 36.592 48.615 1.00 9.88 C ATOM 9491 CG TYR B 254 39.266 36.831 48.463 1.00 10.41 C ATOM 9492 CD1 TYR B 254 39.745 38.062 48.020 1.00 10.39 C ATOM 9493 CD2 TYR B 254 40.197 35.859 48.833 1.00 11.10 C ATOM 9494 CE1 TYR B 254 41.125 38.304 47.904 1.00 11.20 C ATOM 9495 CE2 TYR B 254 41.559 36.091 48.723 1.00 12.03 C ATOM 9496 CZ TYR B 254 42.013 37.324 48.255 1.00 10.94 C ATOM 9497 OH TYR B 254 43.373 37.580 48.160 1.00 12.32 O ATOM 9498 HA TYR B 254 37.726 35.200 46.976 1.00 0.00 H ATOM 9499 HB3 TYR B 254 37.643 35.892 49.437 1.00 0.00 H ATOM 9500 HB2 TYR B 254 37.316 37.542 48.856 1.00 0.00 H ATOM 9501 HD2 TYR B 254 39.847 34.900 49.215 1.00 0.00 H ATOM 9502 HE2 TYR B 254 42.271 35.314 49.001 1.00 0.00 H ATOM 9503 HE1 TYR B 254 41.485 39.265 47.537 1.00 0.00 H ATOM 9504 HD1 TYR B 254 39.039 38.850 47.759 1.00 0.00 H ATOM 9505 HH TYR B 254 43.512 38.496 47.812 1.00 0.00 H ATOM 9506 H TYR B 254 37.151 38.048 46.573 1.00 0.00 H ATOM 9507 N ALA B 255 34.822 36.406 48.035 1.00 9.44 N ATOM 9508 CA ALA B 255 33.522 36.033 48.572 1.00 9.63 C ATOM 9509 C ALA B 255 32.590 37.209 48.473 1.00 9.10 C ATOM 9510 O ALA B 255 33.029 38.361 48.397 1.00 9.83 O ATOM 9511 CB ALA B 255 33.670 35.604 50.028 1.00 11.35 C ATOM 9512 HA ALA B 255 33.114 35.200 48.000 1.00 0.00 H ATOM 9513 HB1 ALA B 255 34.344 34.750 50.087 1.00 0.00 H ATOM 9514 HB2 ALA B 255 34.078 36.431 50.609 1.00 0.00 H ATOM 9515 HB3 ALA B 255 32.694 35.326 50.425 1.00 0.00 H ATOM 9516 H ALA B 255 35.043 37.412 47.891 1.00 0.00 H ATOM 9517 N GLU B 256 31.301 36.894 48.534 1.00 9.14 N ATOM 9518 CA GLU B 256 30.268 37.877 48.722 1.00 9.36 C ATOM 9519 C GLU B 256 29.974 38.036 50.211 1.00 9.38 C ATOM 9520 O GLU B 256 29.898 37.033 50.944 1.00 9.87 O ATOM 9521 CB GLU B 256 28.992 37.457 47.995 1.00 10.64 C ATOM 9522 CG GLU B 256 27.886 38.472 48.087 1.00 11.48 C ATOM 9523 CD GLU B 256 26.615 38.043 47.383 1.00 14.11 C ATOM 9524 OE1 GLU B 256 26.554 36.908 46.851 1.00 15.30 O ATOM 9525 OE2 GLU B 256 25.651 38.870 47.381 1.00 15.22 O ATOM 9526 HA GLU B 256 30.612 38.826 48.312 1.00 0.00 H ATOM 9527 HB2 GLU B 256 29.230 37.300 46.943 1.00 0.00 H ATOM 9528 HB3 GLU B 256 28.639 36.522 48.430 1.00 0.00 H ATOM 9529 HG2 GLU B 256 27.658 38.641 49.140 1.00 0.00 H ATOM 9530 HG3 GLU B 256 28.233 39.403 47.638 1.00 0.00 H ATOM 9531 H GLU B 256 31.027 35.895 48.442 1.00 0.00 H ATOM 9532 N ILE B 257 29.750 39.273 50.668 1.00 9.22 N ATOM 9533 CA ILE B 257 29.268 39.483 52.036 1.00 10.09 C ATOM 9534 C ILE B 257 27.762 39.351 51.993 1.00 10.49 C ATOM 9535 O ILE B 257 27.069 40.275 51.523 1.00 11.87 O ATOM 9536 CB ILE B 257 29.691 40.848 52.644 1.00 9.91 C ATOM 9537 CG1 ILE B 257 31.219 40.989 52.588 1.00 11.00 C ATOM 9538 CG2 ILE B 257 29.134 40.892 54.079 1.00 11.47 C ATOM 9539 CD1 ILE B 257 31.771 42.298 52.905 1.00 10.08 C ATOM 9540 HA ILE B 257 29.721 38.739 52.691 1.00 0.00 H ATOM 9541 HB ILE B 257 29.289 41.692 52.083 1.00 0.00 H ATOM 9542 HG12 ILE B 257 31.642 40.273 53.293 1.00 0.00 H ATOM 9543 HG13 ILE B 257 31.537 40.733 51.577 1.00 0.00 H ATOM 9544 HD11 ILE B 257 31.381 43.035 52.203 1.00 0.00 H ATOM 9545 HD12 ILE B 257 31.486 42.575 53.920 1.00 0.00 H ATOM 9546 HD13 ILE B 257 32.858 42.261 52.828 1.00 0.00 H ATOM 9547 HG21 ILE B 257 28.048 40.803 54.049 1.00 0.00 H ATOM 9548 HG22 ILE B 257 29.552 40.066 54.655 1.00 0.00 H ATOM 9549 HG23 ILE B 257 29.409 41.838 54.545 1.00 0.00 H ATOM 9550 H ILE B 257 29.919 40.091 50.049 1.00 0.00 H ATOM 9551 N VAL B 258 27.268 38.180 52.379 1.00 9.56 N ATOM 9552 CA VAL B 258 25.848 37.909 52.229 1.00 10.49 C ATOM 9553 C VAL B 258 25.065 38.183 53.513 1.00 10.16 C ATOM 9554 O VAL B 258 23.833 38.131 53.519 1.00 12.19 O ATOM 9555 CB VAL B 258 25.600 36.464 51.765 1.00 10.75 C ATOM 9556 CG1 VAL B 258 26.099 36.272 50.352 1.00 12.23 C ATOM 9557 CG2 VAL B 258 26.214 35.412 52.749 1.00 11.94 C ATOM 9558 HA VAL B 258 25.485 38.594 51.463 1.00 0.00 H ATOM 9559 HB VAL B 258 24.524 36.293 51.771 1.00 0.00 H ATOM 9560 HG11 VAL B 258 25.572 36.955 49.686 1.00 0.00 H ATOM 9561 HG12 VAL B 258 27.168 36.479 50.314 1.00 0.00 H ATOM 9562 HG13 VAL B 258 25.916 35.244 50.040 1.00 0.00 H ATOM 9563 HG21 VAL B 258 27.291 35.566 52.818 1.00 0.00 H ATOM 9564 HG22 VAL B 258 25.765 35.533 53.735 1.00 0.00 H ATOM 9565 HG23 VAL B 258 26.012 34.407 52.377 1.00 0.00 H ATOM 9566 H VAL B 258 27.896 37.459 52.788 1.00 0.00 H ATOM 9567 N GLY B 259 25.765 38.489 54.609 1.00 9.84 N ATOM 9568 CA GLY B 259 25.069 38.857 55.836 1.00 11.29 C ATOM 9569 C GLY B 259 25.912 39.729 56.733 1.00 8.97 C ATOM 9570 O GLY B 259 27.143 39.540 56.810 1.00 10.02 O ATOM 9571 HA3 GLY B 259 24.807 37.948 56.377 1.00 0.00 H ATOM 9572 HA2 GLY B 259 24.160 39.398 55.575 1.00 0.00 H ATOM 9573 H GLY B 259 26.804 38.465 54.587 1.00 0.00 H ATOM 9574 N TYR B 260 25.233 40.662 57.399 1.00 9.89 N ATOM 9575 CA TYR B 260 25.873 41.549 58.344 1.00 9.60 C ATOM 9576 C TYR B 260 24.886 41.803 59.463 1.00 11.06 C ATOM 9577 O TYR B 260 23.834 42.388 59.257 1.00 13.05 O ATOM 9578 CB TYR B 260 26.272 42.864 57.647 1.00 10.17 C ATOM 9579 CG TYR B 260 26.607 44.006 58.569 1.00 9.57 C ATOM 9580 CD1 TYR B 260 27.388 43.832 59.715 1.00 9.25 C ATOM 9581 CD2 TYR B 260 26.102 45.273 58.307 1.00 10.39 C ATOM 9582 CE1 TYR B 260 27.672 44.913 60.543 1.00 9.49 C ATOM 9583 CE2 TYR B 260 26.383 46.367 59.127 1.00 10.21 C ATOM 9584 CZ TYR B 260 27.149 46.163 60.264 1.00 9.14 C ATOM 9585 OH TYR B 260 27.467 47.236 61.084 1.00 10.61 O ATOM 9586 HA TYR B 260 26.784 41.105 58.744 1.00 0.00 H ATOM 9587 HB3 TYR B 260 25.441 43.175 57.014 1.00 0.00 H ATOM 9588 HB2 TYR B 260 27.146 42.665 57.026 1.00 0.00 H ATOM 9589 HD2 TYR B 260 25.466 45.418 57.434 1.00 0.00 H ATOM 9590 HE2 TYR B 260 26.008 47.360 58.879 1.00 0.00 H ATOM 9591 HE1 TYR B 260 28.310 44.775 61.416 1.00 0.00 H ATOM 9592 HD1 TYR B 260 27.777 42.844 59.961 1.00 0.00 H ATOM 9593 HH TYR B 260 26.634 47.648 61.425 1.00 0.00 H ATOM 9594 H TYR B 260 24.210 40.755 57.234 1.00 0.00 H ATOM 9595 N GLY B 261 25.226 41.341 60.645 1.00 10.05 N ATOM 9596 CA GLY B 261 24.424 41.587 61.844 1.00 9.50 C ATOM 9597 C GLY B 261 25.111 42.645 62.695 1.00 9.73 C ATOM 9598 O GLY B 261 26.341 42.659 62.826 1.00 9.48 O ATOM 9599 HA3 GLY B 261 24.329 40.664 62.416 1.00 0.00 H ATOM 9600 HA2 GLY B 261 23.433 41.938 61.555 1.00 0.00 H ATOM 9601 H GLY B 261 26.097 40.780 60.732 1.00 0.00 H ATOM 9602 N ALA B 262 24.323 43.522 63.311 1.00 9.30 N ATOM 9603 CA ALA B 262 24.866 44.518 64.250 1.00 9.58 C ATOM 9604 C ALA B 262 23.779 44.736 65.279 1.00 9.64 C ATOM 9605 O ALA B 262 22.660 45.135 64.925 1.00 11.58 O ATOM 9606 CB ALA B 262 25.214 45.817 63.523 1.00 11.07 C ATOM 9607 HA ALA B 262 25.791 44.177 64.716 1.00 0.00 H ATOM 9608 HB1 ALA B 262 25.961 45.613 62.755 1.00 0.00 H ATOM 9609 HB2 ALA B 262 24.316 46.224 63.059 1.00 0.00 H ATOM 9610 HB3 ALA B 262 25.613 46.536 64.238 1.00 0.00 H ATOM 9611 H ALA B 262 23.300 43.504 63.125 1.00 0.00 H ATOM 9612 N THR B 263 24.067 44.416 66.538 1.00 9.51 N ATOM 9613 CA THR B 263 23.073 44.546 67.591 1.00 8.68 C ATOM 9614 C THR B 263 23.742 45.047 68.867 1.00 8.99 C ATOM 9615 O THR B 263 24.976 45.277 68.914 1.00 9.69 O ATOM 9616 CB THR B 263 22.364 43.206 67.914 1.00 9.66 C ATOM 9617 OG1 THR B 263 23.340 42.358 68.523 1.00 10.98 O ATOM 9618 CG2 THR B 263 21.742 42.551 66.680 1.00 11.79 C ATOM 9619 HA THR B 263 22.324 45.251 67.230 1.00 0.00 H ATOM 9620 HB THR B 263 21.526 43.386 68.587 1.00 0.00 H ATOM 9621 HG1 THR B 263 22.926 41.487 68.746 1.00 0.00 H ATOM 9622 HG23 THR B 263 21.005 43.226 66.245 1.00 0.00 H ATOM 9623 HG21 THR B 263 22.523 42.343 65.948 1.00 0.00 H ATOM 9624 HG22 THR B 263 21.257 41.619 66.971 1.00 0.00 H ATOM 9625 H THR B 263 25.018 44.067 66.773 1.00 0.00 H ATOM 9626 N SER B 264 22.928 45.221 69.899 1.00 9.26 N ATOM 9627 CA SER B 264 23.392 45.747 71.176 1.00 9.50 C ATOM 9628 C SER B 264 22.745 44.936 72.290 1.00 10.90 C ATOM 9629 O SER B 264 21.564 44.563 72.210 1.00 10.86 O ATOM 9630 CB SER B 264 22.958 47.209 71.250 1.00 10.79 C ATOM 9631 OG SER B 264 23.331 47.842 72.447 1.00 12.55 O ATOM 9632 HA SER B 264 24.475 45.680 71.277 1.00 0.00 H ATOM 9633 HB2 SER B 264 21.873 47.252 71.160 1.00 0.00 H ATOM 9634 HB3 SER B 264 23.412 47.747 70.418 1.00 0.00 H ATOM 9635 HG SER B 264 22.917 47.369 73.212 1.00 0.00 H ATOM 9636 H SER B 264 21.923 44.973 69.793 1.00 0.00 H ATOM 9637 N ASP B 265 23.502 44.674 73.339 1.00 11.20 N ATOM 9638 CA ASP B 265 22.961 43.907 74.484 1.00 11.87 C ATOM 9639 C ASP B 265 22.084 44.758 75.382 1.00 11.14 C ATOM 9640 O ASP B 265 21.080 44.267 75.931 1.00 12.79 O ATOM 9641 CB ASP B 265 24.097 43.349 75.346 1.00 12.66 C ATOM 9642 CG ASP B 265 24.891 42.239 74.694 1.00 14.58 C ATOM 9643 OD1 ASP B 265 24.560 41.769 73.592 1.00 14.92 O ATOM 9644 OD2 ASP B 265 25.863 41.811 75.360 1.00 18.34 O ATOM 9645 HA ASP B 265 22.365 43.102 74.054 1.00 0.00 H ATOM 9646 HB2 ASP B 265 24.781 44.165 75.579 1.00 0.00 H ATOM 9647 HB3 ASP B 265 23.666 42.963 76.270 1.00 0.00 H ATOM 9648 H ASP B 265 24.486 45.009 73.361 1.00 0.00 H ATOM 9649 N GLY B 266 22.469 46.002 75.597 1.00 11.79 N ATOM 9650 CA GLY B 266 21.708 46.845 76.513 1.00 12.81 C ATOM 9651 C GLY B 266 21.619 46.280 77.915 1.00 14.35 C ATOM 9652 O GLY B 266 20.560 46.381 78.550 1.00 16.79 O ATOM 9653 HA3 GLY B 266 20.697 46.958 76.121 1.00 0.00 H ATOM 9654 HA2 GLY B 266 22.188 47.822 76.564 1.00 0.00 H ATOM 9655 H GLY B 266 23.310 46.379 75.116 1.00 0.00 H ATOM 9656 N ALA B 267 22.725 45.718 78.397 1.00 16.16 N ATOM 9657 CA ALA B 267 22.747 44.883 79.617 1.00 20.37 C ATOM 9658 C ALA B 267 23.999 45.198 80.441 1.00 21.45 C ATOM 9659 O ALA B 267 23.915 46.017 81.356 1.00 25.52 O ATOM 9660 CB ALA B 267 22.690 43.392 79.231 1.00 21.56 C ATOM 9661 HA ALA B 267 21.874 45.108 80.230 1.00 0.00 H ATOM 9662 HB1 ALA B 267 21.772 43.196 78.676 1.00 0.00 H ATOM 9663 HB2 ALA B 267 23.551 43.146 78.610 1.00 0.00 H ATOM 9664 HB3 ALA B 267 22.707 42.783 80.135 1.00 0.00 H ATOM 9665 H ALA B 267 23.619 45.874 77.890 1.00 0.00 H ATOM 9666 N ASP B 268 25.155 44.600 80.123 1.00 24.86 N ATOM 9667 CA ASP B 268 26.386 44.763 80.952 1.00 25.28 C ATOM 9668 C ASP B 268 27.482 45.426 80.156 1.00 26.71 C ATOM 9669 O ASP B 268 27.640 45.143 78.962 1.00 26.96 O ATOM 9670 CB ASP B 268 26.911 43.429 81.487 1.00 26.66 C ATOM 9671 CG ASP B 268 27.979 43.609 82.578 1.00 25.90 C ATOM 9672 OD1 ASP B 268 29.199 43.643 82.271 1.00 25.88 O ATOM 9673 OD2 ASP B 268 27.594 43.752 83.750 1.00 25.42 O ATOM 9674 HA ASP B 268 26.103 45.388 81.799 1.00 0.00 H ATOM 9675 HB2 ASP B 268 26.076 42.867 81.905 1.00 0.00 H ATOM 9676 HB3 ASP B 268 27.347 42.868 80.660 1.00 0.00 H ATOM 9677 H ASP B 268 25.196 44.004 79.272 1.00 0.00 H ATOM 9678 N MET B 269 28.261 46.273 80.828 1.00 27.08 N ATOM 9679 CA MET B 269 29.372 46.991 80.198 1.00 29.44 C ATOM 9680 C MET B 269 30.491 46.139 79.634 1.00 31.11 C ATOM 9681 O MET B 269 31.120 46.516 78.639 1.00 31.96 O ATOM 9682 CB MET B 269 29.998 47.966 81.199 1.00 28.48 C ATOM 9683 CG MET B 269 29.277 49.254 81.263 1.00 25.04 C ATOM 9684 SD MET B 269 28.881 49.884 79.625 1.00 26.67 S ATOM 9685 CE MET B 269 30.342 50.868 79.328 1.00 26.98 C ATOM 9686 HA MET B 269 28.907 47.488 79.347 1.00 0.00 H ATOM 9687 HB2 MET B 269 29.984 47.508 82.188 1.00 0.00 H ATOM 9688 HB3 MET B 269 31.029 48.157 80.903 1.00 0.00 H ATOM 9689 HG2 MET B 269 29.902 49.983 81.779 1.00 0.00 H ATOM 9690 HG3 MET B 269 28.351 49.112 81.820 1.00 0.00 H ATOM 9691 HE1 MET B 269 30.423 51.637 80.096 1.00 0.00 H ATOM 9692 HE2 MET B 269 31.223 50.227 79.360 1.00 0.00 H ATOM 9693 HE3 MET B 269 30.269 51.338 78.347 1.00 0.00 H ATOM 9694 H MET B 269 28.073 46.430 81.839 1.00 0.00 H ATOM 9695 N VAL B 270 30.790 45.019 80.283 1.00 32.53 N ATOM 9696 CA VAL B 270 32.022 44.305 79.949 1.00 34.50 C ATOM 9697 C VAL B 270 31.801 42.809 79.673 1.00 35.58 C ATOM 9698 O VAL B 270 32.648 42.137 79.065 1.00 38.27 O ATOM 9699 CB VAL B 270 33.149 44.605 80.999 1.00 35.48 C ATOM 9700 CG1 VAL B 270 33.696 46.023 80.786 1.00 36.11 C ATOM 9701 CG2 VAL B 270 32.630 44.445 82.428 1.00 35.49 C ATOM 9702 HA VAL B 270 32.378 44.695 78.995 1.00 0.00 H ATOM 9703 HB VAL B 270 33.954 43.884 80.853 1.00 0.00 H ATOM 9704 HG11 VAL B 270 34.109 46.104 79.781 1.00 0.00 H ATOM 9705 HG12 VAL B 270 32.888 46.745 80.908 1.00 0.00 H ATOM 9706 HG13 VAL B 270 34.478 46.223 81.519 1.00 0.00 H ATOM 9707 HG21 VAL B 270 31.806 45.139 82.594 1.00 0.00 H ATOM 9708 HG22 VAL B 270 32.281 43.423 82.574 1.00 0.00 H ATOM 9709 HG23 VAL B 270 33.434 44.660 83.132 1.00 0.00 H ATOM 9710 H VAL B 270 30.155 44.654 81.021 1.00 0.00 H ATOM 9711 N ALA B 271 30.642 42.303 80.075 1.00 34.91 N ATOM 9712 CA ALA B 271 30.296 40.905 79.832 1.00 33.50 C ATOM 9713 C ALA B 271 29.197 40.806 78.776 1.00 32.13 C ATOM 9714 O ALA B 271 28.305 41.642 78.765 1.00 31.83 O ATOM 9715 CB ALA B 271 29.845 40.243 81.132 1.00 34.90 C ATOM 9716 HA ALA B 271 31.179 40.384 79.462 1.00 0.00 H ATOM 9717 HB1 ALA B 271 30.653 40.291 81.862 1.00 0.00 H ATOM 9718 HB2 ALA B 271 28.971 40.766 81.521 1.00 0.00 H ATOM 9719 HB3 ALA B 271 29.590 39.201 80.938 1.00 0.00 H ATOM 9720 H ALA B 271 29.965 42.915 80.574 1.00 0.00 H ATOM 9721 N PRO B 272 29.260 39.798 77.880 1.00 30.90 N ATOM 9722 CA PRO B 272 28.186 39.648 76.892 1.00 29.62 C ATOM 9723 C PRO B 272 26.924 39.047 77.496 1.00 28.40 C ATOM 9724 O PRO B 272 27.011 38.257 78.436 1.00 28.67 O ATOM 9725 CB PRO B 272 28.791 38.691 75.863 1.00 30.68 C ATOM 9726 CG PRO B 272 29.703 37.809 76.686 1.00 31.31 C ATOM 9727 CD PRO B 272 30.297 38.756 77.725 1.00 31.41 C ATOM 9728 HA PRO B 272 27.874 40.606 76.477 1.00 0.00 H ATOM 9729 HD3 PRO B 272 30.473 38.238 78.668 1.00 0.00 H ATOM 9730 HD2 PRO B 272 31.232 39.188 77.369 1.00 0.00 H ATOM 9731 HG3 PRO B 272 30.486 37.375 76.065 1.00 0.00 H ATOM 9732 HG2 PRO B 272 29.139 37.010 77.167 1.00 0.00 H ATOM 9733 HB2 PRO B 272 28.014 38.101 75.377 1.00 0.00 H ATOM 9734 HB3 PRO B 272 29.356 39.238 75.108 1.00 0.00 H ATOM 9735 N SER B 273 25.762 39.421 76.954 1.00 26.47 N ATOM 9736 CA SER B 273 24.467 38.887 77.415 1.00 26.08 C ATOM 9737 C SER B 273 24.058 37.555 76.779 1.00 25.97 C ATOM 9738 O SER B 273 23.277 36.802 77.377 1.00 28.94 O ATOM 9739 CB SER B 273 23.334 39.908 77.191 1.00 26.02 C ATOM 9740 OG SER B 273 23.011 40.035 75.789 1.00 23.95 O ATOM 9741 HA SER B 273 24.618 38.699 78.478 1.00 0.00 H ATOM 9742 HB2 SER B 273 23.650 40.879 77.572 1.00 0.00 H ATOM 9743 HB3 SER B 273 22.447 39.578 77.732 1.00 0.00 H ATOM 9744 HG SER B 273 22.282 40.696 75.678 1.00 0.00 H ATOM 9745 H SER B 273 25.771 40.114 76.179 1.00 0.00 H ATOM 9746 N GLY B 274 24.569 37.222 75.599 1.00 26.15 N ATOM 9747 CA GLY B 274 24.027 36.039 74.893 1.00 23.62 C ATOM 9748 C GLY B 274 22.837 36.370 73.986 1.00 23.84 C ATOM 9749 O GLY B 274 22.867 36.093 72.798 1.00 20.45 O ATOM 9750 HA3 GLY B 274 23.704 35.310 75.636 1.00 0.00 H ATOM 9751 HA2 GLY B 274 24.819 35.607 74.282 1.00 0.00 H ATOM 9752 H GLY B 274 25.337 37.783 75.178 1.00 0.00 H ATOM 9753 N GLU B 275 21.784 36.955 74.550 1.00 20.49 N ATOM 9754 CA GLU B 275 20.605 37.379 73.812 1.00 20.99 C ATOM 9755 C GLU B 275 20.947 38.303 72.615 1.00 18.49 C ATOM 9756 O GLU B 275 20.408 38.147 71.512 1.00 18.03 O ATOM 9757 CB GLU B 275 19.665 38.095 74.792 1.00 23.81 C ATOM 9758 CG GLU B 275 18.306 38.512 74.258 1.00 26.35 C ATOM 9759 CD GLU B 275 18.272 39.833 73.452 1.00 25.14 C ATOM 9760 OE1 GLU B 275 19.076 40.812 73.634 1.00 24.43 O ATOM 9761 OE2 GLU B 275 17.358 39.920 72.625 1.00 26.04 O ATOM 9762 HA GLU B 275 20.126 36.498 73.385 1.00 0.00 H ATOM 9763 HB2 GLU B 275 19.497 37.426 75.636 1.00 0.00 H ATOM 9764 HB3 GLU B 275 20.173 38.995 75.139 1.00 0.00 H ATOM 9765 HG2 GLU B 275 17.943 37.715 73.609 1.00 0.00 H ATOM 9766 HG3 GLU B 275 17.632 38.622 75.108 1.00 0.00 H ATOM 9767 H GLU B 275 21.805 37.118 75.577 1.00 0.00 H ATOM 9768 N GLY B 276 21.818 39.275 72.851 1.00 16.69 N ATOM 9769 CA GLY B 276 22.237 40.149 71.758 1.00 14.98 C ATOM 9770 C GLY B 276 23.007 39.404 70.675 1.00 13.19 C ATOM 9771 O GLY B 276 22.857 39.685 69.473 1.00 12.49 O ATOM 9772 HA3 GLY B 276 22.875 40.934 72.163 1.00 0.00 H ATOM 9773 HA2 GLY B 276 21.351 40.598 71.310 1.00 0.00 H ATOM 9774 H GLY B 276 22.200 39.414 73.808 1.00 0.00 H ATOM 9775 N ALA B 277 23.841 38.450 71.089 1.00 12.88 N ATOM 9776 CA ALA B 277 24.625 37.641 70.146 1.00 12.45 C ATOM 9777 C ALA B 277 23.722 36.746 69.302 1.00 12.79 C ATOM 9778 O ALA B 277 23.949 36.583 68.095 1.00 11.55 O ATOM 9779 CB ALA B 277 25.664 36.789 70.874 1.00 14.47 C ATOM 9780 HA ALA B 277 25.146 38.334 69.486 1.00 0.00 H ATOM 9781 HB1 ALA B 277 26.345 37.439 71.423 1.00 0.00 H ATOM 9782 HB2 ALA B 277 25.159 36.119 71.570 1.00 0.00 H ATOM 9783 HB3 ALA B 277 26.226 36.203 70.147 1.00 0.00 H ATOM 9784 H ALA B 277 23.940 38.273 72.109 1.00 0.00 H ATOM 9785 N VAL B 278 22.705 36.149 69.934 1.00 12.96 N ATOM 9786 CA VAL B 278 21.741 35.344 69.166 1.00 12.43 C ATOM 9787 C VAL B 278 21.072 36.214 68.095 1.00 12.02 C ATOM 9788 O VAL B 278 21.008 35.820 66.923 1.00 12.36 O ATOM 9789 CB VAL B 278 20.696 34.715 70.089 1.00 13.37 C ATOM 9790 CG1 VAL B 278 19.582 34.054 69.280 1.00 15.83 C ATOM 9791 CG2 VAL B 278 21.353 33.707 71.008 1.00 15.17 C ATOM 9792 HA VAL B 278 22.277 34.533 68.674 1.00 0.00 H ATOM 9793 HB VAL B 278 20.250 35.505 70.694 1.00 0.00 H ATOM 9794 HG11 VAL B 278 19.094 34.803 68.656 1.00 0.00 H ATOM 9795 HG12 VAL B 278 20.007 33.274 68.648 1.00 0.00 H ATOM 9796 HG13 VAL B 278 18.852 33.615 69.960 1.00 0.00 H ATOM 9797 HG21 VAL B 278 21.821 32.924 70.411 1.00 0.00 H ATOM 9798 HG22 VAL B 278 22.110 34.207 71.612 1.00 0.00 H ATOM 9799 HG23 VAL B 278 20.599 33.266 71.660 1.00 0.00 H ATOM 9800 H VAL B 278 22.596 36.253 70.963 1.00 0.00 H ATOM 9801 N ARG B 279 20.617 37.415 68.468 1.00 12.61 N ATOM 9802 CA ARG B 279 19.953 38.262 67.486 1.00 12.97 C ATOM 9803 C ARG B 279 20.933 38.672 66.382 1.00 12.07 C ATOM 9804 O ARG B 279 20.553 38.775 65.214 1.00 12.84 O ATOM 9805 CB ARG B 279 19.388 39.498 68.164 1.00 13.88 C ATOM 9806 CG ARG B 279 18.015 39.276 68.826 1.00 15.56 C ATOM 9807 CD ARG B 279 17.432 40.567 69.303 1.00 17.02 C ATOM 9808 NE ARG B 279 18.219 41.149 70.373 1.00 17.21 N ATOM 9809 CZ ARG B 279 18.885 42.303 70.287 1.00 16.09 C ATOM 9810 NH1 ARG B 279 18.948 43.018 69.147 1.00 16.84 N ATOM 9811 NH2 ARG B 279 19.505 42.704 71.362 1.00 16.91 N ATOM 9812 HA ARG B 279 19.137 37.698 67.035 1.00 0.00 H ATOM 9813 HB2 ARG B 279 20.091 39.820 68.932 1.00 0.00 H ATOM 9814 HB3 ARG B 279 19.285 40.283 67.415 1.00 0.00 H ATOM 9815 HG2 ARG B 279 17.338 38.826 68.100 1.00 0.00 H ATOM 9816 HG3 ARG B 279 18.134 38.603 69.675 1.00 0.00 H ATOM 9817 HD2 ARG B 279 16.421 40.385 69.667 1.00 0.00 H ATOM 9818 HD3 ARG B 279 17.396 41.268 68.469 1.00 0.00 H ATOM 9819 HE ARG B 279 18.268 40.630 71.273 1.00 0.00 H ATOM 9820 HH12 ARG B 279 19.478 43.913 69.123 1.00 0.00 H ATOM 9821 HH11 ARG B 279 18.467 42.675 68.291 1.00 0.00 H ATOM 9822 HH22 ARG B 279 20.040 43.596 71.352 1.00 0.00 H ATOM 9823 HH21 ARG B 279 19.465 42.132 72.229 1.00 0.00 H ATOM 9824 H ARG B 279 20.736 37.741 69.448 1.00 0.00 H ATOM 9825 N CYS B 280 22.193 38.899 66.747 1.00 11.31 N ATOM 9826 CA CYS B 280 23.190 39.349 65.773 1.00 10.97 C ATOM 9827 C CYS B 280 23.464 38.253 64.744 1.00 9.86 C ATOM 9828 O CYS B 280 23.469 38.501 63.520 1.00 10.13 O ATOM 9829 CB CYS B 280 24.448 39.751 66.504 1.00 11.64 C ATOM 9830 SG CYS B 280 25.643 40.583 65.466 1.00 11.37 S ATOM 9831 HA CYS B 280 22.811 40.215 65.230 1.00 0.00 H ATOM 9832 HB2 CYS B 280 24.912 38.853 66.912 1.00 0.00 H ATOM 9833 HB3 CYS B 280 24.174 40.420 67.320 1.00 0.00 H ATOM 9834 HG CYS B 280 26.014 39.746 64.433 1.00 0.00 H ATOM 9835 H CYS B 280 22.473 38.755 67.738 1.00 0.00 H ATOM 9836 N MET B 281 23.675 37.026 65.229 1.00 10.38 N ATOM 9837 CA MET B 281 23.893 35.921 64.292 1.00 10.67 C ATOM 9838 C MET B 281 22.674 35.675 63.420 1.00 10.92 C ATOM 9839 O MET B 281 22.818 35.479 62.210 1.00 11.73 O ATOM 9840 CB MET B 281 24.325 34.634 65.014 1.00 11.52 C ATOM 9841 CG MET B 281 25.753 34.719 65.565 1.00 11.27 C ATOM 9842 SD MET B 281 26.254 33.175 66.369 1.00 12.06 S ATOM 9843 CE MET B 281 25.641 33.514 68.039 1.00 14.47 C ATOM 9844 HA MET B 281 24.712 36.220 63.638 1.00 0.00 H ATOM 9845 HB2 MET B 281 23.641 34.452 65.843 1.00 0.00 H ATOM 9846 HB3 MET B 281 24.271 33.803 64.310 1.00 0.00 H ATOM 9847 HG2 MET B 281 25.804 35.529 66.293 1.00 0.00 H ATOM 9848 HG3 MET B 281 26.437 34.928 64.743 1.00 0.00 H ATOM 9849 HE1 MET B 281 26.130 34.406 68.430 1.00 0.00 H ATOM 9850 HE2 MET B 281 24.564 33.675 68.003 1.00 0.00 H ATOM 9851 HE3 MET B 281 25.861 32.664 68.685 1.00 0.00 H ATOM 9852 H MET B 281 23.684 36.858 66.255 1.00 0.00 H ATOM 9853 N LYS B 282 21.477 35.711 64.020 1.00 11.71 N ATOM 9854 CA LYS B 282 20.270 35.480 63.223 1.00 12.01 C ATOM 9855 C LYS B 282 20.105 36.581 62.158 1.00 11.76 C ATOM 9856 O LYS B 282 19.704 36.308 61.019 1.00 12.95 O ATOM 9857 CB LYS B 282 19.036 35.394 64.101 1.00 14.14 C ATOM 9858 CG LYS B 282 18.954 34.117 64.898 1.00 14.72 C ATOM 9859 CD LYS B 282 17.701 34.143 65.769 1.00 19.79 C ATOM 9860 CE LYS B 282 17.552 32.916 66.659 1.00 22.19 C ATOM 9861 NZ LYS B 282 16.334 33.113 67.525 1.00 27.53 N ATOM 9862 HA LYS B 282 20.383 34.522 62.716 1.00 0.00 H ATOM 9863 HB2 LYS B 282 19.047 36.234 64.795 1.00 0.00 H ATOM 9864 HB3 LYS B 282 18.154 35.461 63.464 1.00 0.00 H ATOM 9865 HG2 LYS B 282 18.907 33.266 64.218 1.00 0.00 H ATOM 9866 HG3 LYS B 282 19.836 34.026 65.532 1.00 0.00 H ATOM 9867 HD2 LYS B 282 17.741 35.027 66.405 1.00 0.00 H ATOM 9868 HD3 LYS B 282 16.829 34.205 65.118 1.00 0.00 H ATOM 9869 HE2 LYS B 282 18.437 32.803 67.285 1.00 0.00 H ATOM 9870 HE3 LYS B 282 17.428 32.025 66.043 1.00 0.00 H ATOM 9871 HZ1 LYS B 282 16.458 33.966 68.107 1.00 0.00 H ATOM 9872 HZ2 LYS B 282 15.495 33.223 66.921 1.00 0.00 H ATOM 9873 HZ3 LYS B 282 16.212 32.285 68.143 1.00 0.00 H ATOM 9874 H LYS B 282 21.405 35.901 65.040 1.00 0.00 H ATOM 9875 N MET B 283 20.451 37.826 62.509 1.00 11.78 N ATOM 9876 CA MET B 283 20.354 38.923 61.550 1.00 12.24 C ATOM 9877 C MET B 283 21.292 38.685 60.367 1.00 12.02 C ATOM 9878 O MET B 283 20.920 38.900 59.215 1.00 13.24 O ATOM 9879 CB MET B 283 20.725 40.211 62.246 1.00 12.37 C ATOM 9880 CG MET B 283 20.528 41.428 61.341 1.00 13.77 C ATOM 9881 SD MET B 283 20.943 42.962 62.137 1.00 14.18 S ATOM 9882 CE MET B 283 19.786 42.960 63.467 1.00 16.28 C ATOM 9883 HA MET B 283 19.334 38.983 61.171 1.00 0.00 H ATOM 9884 HB2 MET B 283 20.100 40.326 63.132 1.00 0.00 H ATOM 9885 HB3 MET B 283 21.772 40.161 62.546 1.00 0.00 H ATOM 9886 HG2 MET B 283 19.483 41.467 61.034 1.00 0.00 H ATOM 9887 HG3 MET B 283 21.159 41.312 60.460 1.00 0.00 H ATOM 9888 HE1 MET B 283 18.773 42.934 63.066 1.00 0.00 H ATOM 9889 HE2 MET B 283 19.953 42.082 64.091 1.00 0.00 H ATOM 9890 HE3 MET B 283 19.919 43.863 64.064 1.00 0.00 H ATOM 9891 H MET B 283 20.792 38.013 63.473 1.00 0.00 H ATOM 9892 N ALA B 284 22.517 38.222 60.653 1.00 11.38 N ATOM 9893 CA ALA B 284 23.482 37.994 59.576 1.00 11.21 C ATOM 9894 C ALA B 284 23.094 36.803 58.704 1.00 12.07 C ATOM 9895 O ALA B 284 23.541 36.721 57.560 1.00 14.46 O ATOM 9896 CB ALA B 284 24.873 37.815 60.144 1.00 11.65 C ATOM 9897 HA ALA B 284 23.475 38.876 58.935 1.00 0.00 H ATOM 9898 HB1 ALA B 284 25.158 38.712 60.693 1.00 0.00 H ATOM 9899 HB2 ALA B 284 24.882 36.958 60.817 1.00 0.00 H ATOM 9900 HB3 ALA B 284 25.578 37.647 59.330 1.00 0.00 H ATOM 9901 H ALA B 284 22.782 38.025 61.639 1.00 0.00 H ATOM 9902 N MET B 285 22.281 35.896 59.242 1.00 12.76 N ATOM 9903 CA MET B 285 21.861 34.698 58.499 1.00 13.84 C ATOM 9904 C MET B 285 20.548 34.862 57.786 1.00 14.92 C ATOM 9905 O MET B 285 20.153 33.995 56.998 1.00 15.95 O ATOM 9906 CB MET B 285 21.713 33.511 59.476 1.00 14.57 C ATOM 9907 CG MET B 285 23.056 33.027 59.957 1.00 15.68 C ATOM 9908 SD MET B 285 23.948 32.428 58.479 1.00 17.58 S ATOM 9909 CE MET B 285 23.066 30.932 58.044 1.00 16.66 C ATOM 9910 HA MET B 285 22.633 34.523 57.750 1.00 0.00 H ATOM 9911 HB2 MET B 285 21.122 33.829 60.335 1.00 0.00 H ATOM 9912 HB3 MET B 285 21.202 32.694 58.967 1.00 0.00 H ATOM 9913 HG2 MET B 285 22.930 32.217 60.676 1.00 0.00 H ATOM 9914 HG3 MET B 285 23.606 33.844 60.425 1.00 0.00 H ATOM 9915 HE1 MET B 285 23.115 30.228 58.875 1.00 0.00 H ATOM 9916 HE2 MET B 285 22.024 31.174 57.833 1.00 0.00 H ATOM 9917 HE3 MET B 285 23.523 30.486 57.161 1.00 0.00 H ATOM 9918 H MET B 285 21.934 36.038 60.212 1.00 0.00 H ATOM 9919 N HIS B 286 19.845 35.952 58.052 1.00 16.10 N ATOM 9920 CA HIS B 286 18.528 36.098 57.473 1.00 19.75 C ATOM 9921 C HIS B 286 18.592 36.154 55.931 1.00 20.08 C ATOM 9922 O HIS B 286 19.362 36.914 55.345 1.00 21.77 O ATOM 9923 CB HIS B 286 17.846 37.327 58.070 1.00 23.11 C ATOM 9924 CG HIS B 286 16.416 37.470 57.665 1.00 27.24 C ATOM 9925 ND1 HIS B 286 15.421 36.661 58.170 1.00 30.09 N ATOM 9926 CD2 HIS B 286 15.821 38.299 56.778 1.00 29.33 C ATOM 9927 CE1 HIS B 286 14.267 36.995 57.619 1.00 30.17 C ATOM 9928 NE2 HIS B 286 14.482 37.988 56.773 1.00 30.81 N ATOM 9929 HA HIS B 286 17.929 35.221 57.718 1.00 0.00 H ATOM 9930 HB2 HIS B 286 17.892 37.254 59.157 1.00 0.00 H ATOM 9931 HB3 HIS B 286 18.388 38.215 57.744 1.00 0.00 H ATOM 9932 HD2 HIS B 286 16.310 39.068 56.180 1.00 0.00 H ATOM 9933 HE1 HIS B 286 13.303 36.531 57.827 1.00 0.00 H ATOM 9934 H HIS B 286 20.235 36.693 58.669 1.00 0.00 H ATOM 9935 N GLY B 287 17.820 35.287 55.272 1.00 19.87 N ATOM 9936 CA GLY B 287 17.848 35.243 53.822 1.00 21.88 C ATOM 9937 C GLY B 287 19.036 34.477 53.227 1.00 21.48 C ATOM 9938 O GLY B 287 19.121 34.331 52.003 1.00 23.52 O ATOM 9939 HA3 GLY B 287 17.884 36.267 53.452 1.00 0.00 H ATOM 9940 HA2 GLY B 287 16.930 34.766 53.479 1.00 0.00 H ATOM 9941 H GLY B 287 17.197 34.642 55.799 1.00 0.00 H ATOM 9942 N VAL B 288 19.979 34.031 54.064 1.00 18.39 N ATOM 9943 CA VAL B 288 21.145 33.311 53.555 1.00 17.63 C ATOM 9944 C VAL B 288 20.715 31.862 53.409 1.00 19.65 C ATOM 9945 O VAL B 288 20.365 31.222 54.405 1.00 22.04 O ATOM 9946 CB VAL B 288 22.370 33.424 54.517 1.00 16.32 C ATOM 9947 CG1 VAL B 288 23.500 32.536 54.067 1.00 16.38 C ATOM 9948 CG2 VAL B 288 22.841 34.851 54.593 1.00 17.36 C ATOM 9949 HA VAL B 288 21.469 33.737 52.605 1.00 0.00 H ATOM 9950 HB VAL B 288 22.051 33.096 55.506 1.00 0.00 H ATOM 9951 HG11 VAL B 288 23.163 31.500 54.053 1.00 0.00 H ATOM 9952 HG12 VAL B 288 23.815 32.830 53.066 1.00 0.00 H ATOM 9953 HG13 VAL B 288 24.337 32.638 54.757 1.00 0.00 H ATOM 9954 HG21 VAL B 288 23.135 35.189 53.599 1.00 0.00 H ATOM 9955 HG22 VAL B 288 22.033 35.479 54.968 1.00 0.00 H ATOM 9956 HG23 VAL B 288 23.695 34.915 55.267 1.00 0.00 H ATOM 9957 H VAL B 288 19.882 34.198 55.086 1.00 0.00 H ATOM 9958 N ASP B 289 20.704 31.351 52.172 1.00 20.51 N ATOM 9959 CA ASP B 289 20.026 30.085 51.887 1.00 21.66 C ATOM 9960 C ASP B 289 20.946 28.882 51.922 1.00 21.24 C ATOM 9961 O ASP B 289 20.605 27.841 51.415 1.00 23.35 O ATOM 9962 CB ASP B 289 19.206 30.176 50.587 1.00 24.38 C ATOM 9963 CG ASP B 289 20.057 30.377 49.327 1.00 26.00 C ATOM 9964 OD1 ASP B 289 21.307 30.380 49.385 1.00 28.11 O ATOM 9965 OD2 ASP B 289 19.445 30.524 48.234 1.00 30.13 O ATOM 9966 HA ASP B 289 19.325 29.916 52.704 1.00 0.00 H ATOM 9967 HB2 ASP B 289 18.638 29.253 50.474 1.00 0.00 H ATOM 9968 HB3 ASP B 289 18.517 31.016 50.674 1.00 0.00 H ATOM 9969 H ASP B 289 21.184 31.860 51.403 1.00 0.00 H ATOM 9970 N THR B 290 22.121 29.040 52.508 1.00 17.70 N ATOM 9971 CA THR B 290 23.100 27.957 52.620 1.00 16.52 C ATOM 9972 C THR B 290 23.551 27.844 54.078 1.00 15.96 C ATOM 9973 O THR B 290 23.492 28.812 54.821 1.00 16.50 O ATOM 9974 CB THR B 290 24.368 28.243 51.769 1.00 15.18 C ATOM 9975 OG1 THR B 290 24.862 29.550 52.083 1.00 14.74 O ATOM 9976 CG2 THR B 290 24.067 28.174 50.268 1.00 17.73 C ATOM 9977 HA THR B 290 22.624 27.042 52.266 1.00 0.00 H ATOM 9978 HB THR B 290 25.111 27.482 52.006 1.00 0.00 H ATOM 9979 HG1 THR B 290 25.670 29.735 51.542 1.00 0.00 H ATOM 9980 HG23 THR B 290 23.690 27.182 50.020 1.00 0.00 H ATOM 9981 HG21 THR B 290 23.317 28.923 50.014 1.00 0.00 H ATOM 9982 HG22 THR B 290 24.981 28.368 49.706 1.00 0.00 H ATOM 9983 H THR B 290 22.359 29.971 52.905 1.00 0.00 H ATOM 9984 N PRO B 291 23.965 26.645 54.501 1.00 15.81 N ATOM 9985 CA PRO B 291 24.390 26.513 55.912 1.00 15.47 C ATOM 9986 C PRO B 291 25.758 27.110 56.167 1.00 13.61 C ATOM 9987 O PRO B 291 26.557 27.257 55.240 1.00 13.76 O ATOM 9988 CB PRO B 291 24.436 25.004 56.105 1.00 17.22 C ATOM 9989 CG PRO B 291 24.742 24.481 54.763 1.00 18.67 C ATOM 9990 CD PRO B 291 24.062 25.374 53.759 1.00 16.65 C ATOM 9991 HA PRO B 291 23.721 27.039 56.593 1.00 0.00 H ATOM 9992 HD3 PRO B 291 24.663 25.486 52.856 1.00 0.00 H ATOM 9993 HD2 PRO B 291 23.076 24.993 53.493 1.00 0.00 H ATOM 9994 HG3 PRO B 291 24.368 23.462 54.667 1.00 0.00 H ATOM 9995 HG2 PRO B 291 25.819 24.489 54.598 1.00 0.00 H ATOM 9996 HB2 PRO B 291 25.215 24.728 56.816 1.00 0.00 H ATOM 9997 HB3 PRO B 291 23.475 24.629 56.457 1.00 0.00 H ATOM 9998 N ILE B 292 26.034 27.427 57.427 1.00 13.34 N ATOM 9999 CA ILE B 292 27.354 27.915 57.793 1.00 12.28 C ATOM 10000 C ILE B 292 28.266 26.693 57.886 1.00 11.88 C ATOM 10001 O ILE B 292 27.997 25.772 58.666 1.00 14.20 O ATOM 10002 CB ILE B 292 27.309 28.643 59.146 1.00 12.41 C ATOM 10003 CG1 ILE B 292 26.370 29.854 59.058 1.00 13.45 C ATOM 10004 CG2 ILE B 292 28.730 29.046 59.588 1.00 12.81 C ATOM 10005 CD1 ILE B 292 26.725 30.862 57.921 1.00 15.22 C ATOM 10006 HA ILE B 292 27.719 28.626 57.052 1.00 0.00 H ATOM 10007 HB ILE B 292 26.913 27.970 59.906 1.00 0.00 H ATOM 10008 HG12 ILE B 292 25.357 29.489 58.887 1.00 0.00 H ATOM 10009 HG13 ILE B 292 26.408 30.385 60.009 1.00 0.00 H ATOM 10010 HD11 ILE B 292 27.731 31.249 58.082 1.00 0.00 H ATOM 10011 HD12 ILE B 292 26.680 30.353 56.958 1.00 0.00 H ATOM 10012 HD13 ILE B 292 26.011 31.686 57.931 1.00 0.00 H ATOM 10013 HG21 ILE B 292 29.346 28.152 59.686 1.00 0.00 H ATOM 10014 HG22 ILE B 292 29.167 29.710 58.842 1.00 0.00 H ATOM 10015 HG23 ILE B 292 28.678 29.560 60.548 1.00 0.00 H ATOM 10016 H ILE B 292 25.301 27.325 58.157 1.00 0.00 H ATOM 10017 N ASP B 293 29.331 26.671 57.092 1.00 10.59 N ATOM 10018 CA ASP B 293 30.264 25.550 57.079 1.00 11.09 C ATOM 10019 C ASP B 293 31.370 25.716 58.133 1.00 11.34 C ATOM 10020 O ASP B 293 32.003 24.744 58.525 1.00 14.33 O ATOM 10021 CB ASP B 293 30.902 25.461 55.708 1.00 11.23 C ATOM 10022 CG ASP B 293 29.887 25.196 54.628 1.00 12.72 C ATOM 10023 OD1 ASP B 293 29.034 24.293 54.814 1.00 14.45 O ATOM 10024 OD2 ASP B 293 29.952 25.864 53.573 1.00 12.01 O ATOM 10025 HA ASP B 293 29.708 24.642 57.312 1.00 0.00 H ATOM 10026 HB2 ASP B 293 31.407 26.403 55.493 1.00 0.00 H ATOM 10027 HB3 ASP B 293 31.632 24.651 55.711 1.00 0.00 H ATOM 10028 H ASP B 293 29.505 27.478 56.460 1.00 0.00 H ATOM 10029 N TYR B 294 31.667 26.953 58.506 1.00 9.57 N ATOM 10030 CA TYR B 294 32.731 27.234 59.446 1.00 9.00 C ATOM 10031 C TYR B 294 32.420 28.557 60.119 1.00 9.05 C ATOM 10032 O TYR B 294 32.003 29.515 59.474 1.00 9.41 O ATOM 10033 CB TYR B 294 34.096 27.281 58.733 1.00 10.49 C ATOM 10034 CG TYR B 294 35.147 27.894 59.633 1.00 9.80 C ATOM 10035 CD1 TYR B 294 35.608 27.207 60.742 1.00 10.59 C ATOM 10036 CD2 TYR B 294 35.614 29.196 59.412 1.00 9.87 C ATOM 10037 CE1 TYR B 294 36.517 27.772 61.629 1.00 10.66 C ATOM 10038 CE2 TYR B 294 36.519 29.775 60.276 1.00 10.39 C ATOM 10039 CZ TYR B 294 36.965 29.055 61.374 1.00 10.46 C ATOM 10040 OH TYR B 294 37.860 29.673 62.236 1.00 10.65 O ATOM 10041 HA TYR B 294 32.792 26.442 60.193 1.00 0.00 H ATOM 10042 HB3 TYR B 294 34.007 27.880 57.827 1.00 0.00 H ATOM 10043 HB2 TYR B 294 34.397 26.267 58.469 1.00 0.00 H ATOM 10044 HD2 TYR B 294 35.258 29.757 58.548 1.00 0.00 H ATOM 10045 HE2 TYR B 294 36.880 30.788 60.098 1.00 0.00 H ATOM 10046 HE1 TYR B 294 36.867 27.219 62.501 1.00 0.00 H ATOM 10047 HD1 TYR B 294 35.248 26.194 60.925 1.00 0.00 H ATOM 10048 HH TYR B 294 38.093 29.051 62.970 1.00 0.00 H ATOM 10049 H TYR B 294 31.120 27.744 58.112 1.00 0.00 H ATOM 10050 N LEU B 295 32.608 28.573 61.433 1.00 8.22 N ATOM 10051 CA LEU B 295 32.370 29.768 62.237 1.00 8.55 C ATOM 10052 C LEU B 295 33.660 30.097 62.997 1.00 8.76 C ATOM 10053 O LEU B 295 34.182 29.291 63.772 1.00 9.09 O ATOM 10054 CB LEU B 295 31.228 29.490 63.204 1.00 10.75 C ATOM 10055 CG LEU B 295 30.694 30.648 64.051 1.00 12.69 C ATOM 10056 CD1 LEU B 295 29.299 30.330 64.625 1.00 14.73 C ATOM 10057 CD2 LEU B 295 31.591 31.023 65.156 1.00 14.75 C ATOM 10058 HA LEU B 295 32.096 30.617 61.611 1.00 0.00 H ATOM 10059 HB2 LEU B 295 30.393 29.108 62.616 1.00 0.00 H ATOM 10060 HB3 LEU B 295 31.569 28.717 63.893 1.00 0.00 H ATOM 10061 HG LEU B 295 30.630 31.496 63.369 1.00 0.00 H ATOM 10062 HD21 LEU B 295 31.728 30.168 65.817 1.00 0.00 H ATOM 10063 HD22 LEU B 295 32.556 31.329 64.751 1.00 0.00 H ATOM 10064 HD23 LEU B 295 31.151 31.849 65.715 1.00 0.00 H ATOM 10065 HD11 LEU B 295 28.603 30.151 63.806 1.00 0.00 H ATOM 10066 HD12 LEU B 295 29.360 29.441 65.253 1.00 0.00 H ATOM 10067 HD13 LEU B 295 28.952 31.174 65.221 1.00 0.00 H ATOM 10068 H LEU B 295 32.935 27.706 61.905 1.00 0.00 H ATOM 10069 N ASN B 296 34.175 31.305 62.723 1.00 8.85 N ATOM 10070 CA ASN B 296 35.337 31.826 63.413 1.00 8.19 C ATOM 10071 C ASN B 296 34.787 32.591 64.590 1.00 8.84 C ATOM 10072 O ASN B 296 34.172 33.664 64.450 1.00 8.87 O ATOM 10073 CB ASN B 296 36.107 32.763 62.464 1.00 10.62 C ATOM 10074 CG ASN B 296 37.411 33.242 63.050 1.00 11.47 C ATOM 10075 OD1 ASN B 296 37.459 34.308 63.673 1.00 15.16 O ATOM 10076 ND2 ASN B 296 38.488 32.537 62.787 1.00 14.20 N ATOM 10077 HA ASN B 296 36.026 31.045 63.735 1.00 0.00 H ATOM 10078 HB2 ASN B 296 36.316 32.227 61.538 1.00 0.00 H ATOM 10079 HB3 ASN B 296 35.483 33.630 62.247 1.00 0.00 H ATOM 10080 HD22 ASN B 296 38.409 31.644 62.260 1.00 0.00 H ATOM 10081 HD21 ASN B 296 39.419 32.872 63.106 1.00 0.00 H ATOM 10082 H ASN B 296 33.724 31.888 61.989 1.00 0.00 H ATOM 10083 N SER B 297 34.937 32.011 65.777 1.00 9.40 N ATOM 10084 CA SER B 297 34.237 32.571 66.914 1.00 10.27 C ATOM 10085 C SER B 297 34.946 33.836 67.432 1.00 10.45 C ATOM 10086 O SER B 297 36.128 34.089 67.169 1.00 11.86 O ATOM 10087 CB SER B 297 34.146 31.542 68.025 1.00 12.49 C ATOM 10088 OG SER B 297 35.446 31.143 68.397 1.00 12.95 O ATOM 10089 HA SER B 297 33.233 32.848 66.592 1.00 0.00 H ATOM 10090 HB2 SER B 297 33.585 30.676 67.674 1.00 0.00 H ATOM 10091 HB3 SER B 297 33.638 31.978 68.885 1.00 0.00 H ATOM 10092 HG SER B 297 35.389 30.471 69.122 1.00 0.00 H ATOM 10093 H SER B 297 35.544 31.173 65.886 1.00 0.00 H ATOM 10094 N HIS B 298 34.227 34.612 68.226 1.00 9.78 N ATOM 10095 CA HIS B 298 34.858 35.732 68.927 1.00 10.99 C ATOM 10096 C HIS B 298 35.909 35.178 69.921 1.00 10.95 C ATOM 10097 O HIS B 298 37.049 35.647 69.961 1.00 12.85 O ATOM 10098 CB HIS B 298 33.747 36.554 69.581 1.00 12.69 C ATOM 10099 CG HIS B 298 34.232 37.572 70.551 1.00 14.86 C ATOM 10100 ND1 HIS B 298 34.891 38.717 70.165 1.00 16.18 N ATOM 10101 CD2 HIS B 298 34.113 37.630 71.899 1.00 16.49 C ATOM 10102 CE1 HIS B 298 35.185 39.430 71.242 1.00 15.11 C ATOM 10103 NE2 HIS B 298 34.707 38.795 72.304 1.00 18.22 N ATOM 10104 HA HIS B 298 35.402 36.397 68.256 1.00 0.00 H ATOM 10105 HB2 HIS B 298 33.193 37.067 68.795 1.00 0.00 H ATOM 10106 HB3 HIS B 298 33.080 35.871 70.107 1.00 0.00 H ATOM 10107 HD2 HIS B 298 33.635 36.889 72.540 1.00 0.00 H ATOM 10108 HE1 HIS B 298 35.727 40.376 71.254 1.00 0.00 H ATOM 10109 H HIS B 298 33.212 34.426 68.353 1.00 0.00 H ATOM 10110 N GLY B 299 35.494 34.166 70.686 1.00 11.22 N ATOM 10111 CA GLY B 299 36.379 33.291 71.477 1.00 12.80 C ATOM 10112 C GLY B 299 37.699 33.877 71.945 1.00 11.05 C ATOM 10113 O GLY B 299 38.769 33.533 71.409 1.00 12.22 O ATOM 10114 HA3 GLY B 299 36.606 32.417 70.867 1.00 0.00 H ATOM 10115 HA2 GLY B 299 35.826 32.980 72.363 1.00 0.00 H ATOM 10116 H GLY B 299 34.471 33.981 70.727 1.00 0.00 H ATOM 10117 N THR B 300 37.659 34.723 72.978 1.00 10.84 N ATOM 10118 CA THR B 300 38.884 35.433 73.387 1.00 10.66 C ATOM 10119 C THR B 300 39.761 34.719 74.426 1.00 10.98 C ATOM 10120 O THR B 300 40.846 35.212 74.730 1.00 11.99 O ATOM 10121 CB THR B 300 38.577 36.826 73.914 1.00 13.60 C ATOM 10122 OG1 THR B 300 37.863 36.661 75.125 1.00 16.20 O ATOM 10123 CG2 THR B 300 37.731 37.618 72.927 1.00 14.85 C ATOM 10124 HA THR B 300 39.458 35.471 72.461 1.00 0.00 H ATOM 10125 HB THR B 300 39.504 37.379 74.065 1.00 0.00 H ATOM 10126 HG1 THR B 300 37.644 37.550 75.501 1.00 0.00 H ATOM 10127 HG23 THR B 300 38.283 37.743 71.996 1.00 0.00 H ATOM 10128 HG21 THR B 300 36.804 37.079 72.731 1.00 0.00 H ATOM 10129 HG22 THR B 300 37.502 38.596 73.350 1.00 0.00 H ATOM 10130 H THR B 300 36.768 34.880 73.491 1.00 0.00 H ATOM 10131 N SER B 301 39.281 33.594 74.970 1.00 11.81 N ATOM 10132 CA SER B 301 39.989 32.848 76.034 1.00 10.99 C ATOM 10133 C SER B 301 39.634 33.360 77.421 1.00 12.30 C ATOM 10134 O SER B 301 40.424 33.295 78.344 1.00 13.16 O ATOM 10135 CB SER B 301 41.518 32.795 75.835 1.00 11.97 C ATOM 10136 OG SER B 301 42.057 31.640 76.489 1.00 12.09 O ATOM 10137 HA SER B 301 39.633 31.821 75.952 1.00 0.00 H ATOM 10138 HB2 SER B 301 41.969 33.693 76.258 1.00 0.00 H ATOM 10139 HB3 SER B 301 41.742 32.745 74.770 1.00 0.00 H ATOM 10140 HG SER B 301 41.855 31.686 77.457 1.00 0.00 H ATOM 10141 H SER B 301 38.369 33.228 74.629 1.00 0.00 H ATOM 10142 N THR B 302 38.406 33.839 77.568 1.00 15.33 N ATOM 10143 CA THR B 302 37.908 34.316 78.862 1.00 15.99 C ATOM 10144 C THR B 302 36.947 33.260 79.421 1.00 16.45 C ATOM 10145 O THR B 302 36.173 32.626 78.664 1.00 16.98 O ATOM 10146 CB THR B 302 37.240 35.684 78.695 1.00 17.43 C ATOM 10147 OG1 THR B 302 38.211 36.631 78.222 1.00 19.21 O ATOM 10148 CG2 THR B 302 36.666 36.205 79.981 1.00 19.01 C ATOM 10149 HA THR B 302 38.725 34.452 79.570 1.00 0.00 H ATOM 10150 HB THR B 302 36.424 35.558 77.984 1.00 0.00 H ATOM 10151 HG1 THR B 302 38.950 36.700 78.877 1.00 0.00 H ATOM 10152 HG23 THR B 302 35.925 35.500 80.359 1.00 0.00 H ATOM 10153 HG21 THR B 302 37.465 36.321 80.713 1.00 0.00 H ATOM 10154 HG22 THR B 302 36.193 37.170 79.801 1.00 0.00 H ATOM 10155 H THR B 302 37.777 33.877 76.740 1.00 0.00 H ATOM 10156 N PRO B 303 36.994 33.027 80.746 1.00 18.52 N ATOM 10157 CA PRO B 303 36.064 32.085 81.385 1.00 19.45 C ATOM 10158 C PRO B 303 34.588 32.300 81.001 1.00 19.65 C ATOM 10159 O PRO B 303 33.938 31.374 80.520 1.00 21.05 O ATOM 10160 CB PRO B 303 36.301 32.336 82.881 1.00 20.16 C ATOM 10161 CG PRO B 303 37.769 32.668 82.929 1.00 20.03 C ATOM 10162 CD PRO B 303 37.968 33.562 81.711 1.00 19.51 C ATOM 10163 HA PRO B 303 36.250 31.058 81.069 1.00 0.00 H ATOM 10164 HD3 PRO B 303 37.752 34.604 81.949 1.00 0.00 H ATOM 10165 HD2 PRO B 303 38.985 33.482 81.327 1.00 0.00 H ATOM 10166 HG3 PRO B 303 38.376 31.766 82.855 1.00 0.00 H ATOM 10167 HG2 PRO B 303 38.020 33.198 83.848 1.00 0.00 H ATOM 10168 HB2 PRO B 303 35.697 33.169 83.241 1.00 0.00 H ATOM 10169 HB3 PRO B 303 36.079 31.446 83.470 1.00 0.00 H ATOM 10170 N VAL B 304 34.050 33.497 81.197 1.00 20.47 N ATOM 10171 CA VAL B 304 32.621 33.721 80.943 1.00 21.38 C ATOM 10172 C VAL B 304 32.310 33.862 79.449 1.00 18.86 C ATOM 10173 O VAL B 304 31.384 33.227 78.926 1.00 19.83 O ATOM 10174 CB VAL B 304 32.114 34.976 81.701 1.00 23.27 C ATOM 10175 CG1 VAL B 304 30.679 35.317 81.319 1.00 25.56 C ATOM 10176 CG2 VAL B 304 32.236 34.783 83.224 1.00 25.54 C ATOM 10177 HA VAL B 304 32.098 32.839 81.312 1.00 0.00 H ATOM 10178 HB VAL B 304 32.746 35.814 81.407 1.00 0.00 H ATOM 10179 HG11 VAL B 304 30.627 35.515 80.248 1.00 0.00 H ATOM 10180 HG12 VAL B 304 30.029 34.478 81.567 1.00 0.00 H ATOM 10181 HG13 VAL B 304 30.358 36.201 81.870 1.00 0.00 H ATOM 10182 HG21 VAL B 304 31.639 33.923 83.529 1.00 0.00 H ATOM 10183 HG22 VAL B 304 33.281 34.613 83.485 1.00 0.00 H ATOM 10184 HG23 VAL B 304 31.874 35.677 83.732 1.00 0.00 H ATOM 10185 H VAL B 304 34.644 34.282 81.533 1.00 0.00 H ATOM 10186 N GLY B 305 33.102 34.675 78.757 1.00 18.17 N ATOM 10187 CA GLY B 305 32.799 35.018 77.385 1.00 17.44 C ATOM 10188 C GLY B 305 32.772 33.826 76.456 1.00 14.91 C ATOM 10189 O GLY B 305 31.893 33.720 75.598 1.00 15.51 O ATOM 10190 HA3 GLY B 305 33.556 35.716 77.029 1.00 0.00 H ATOM 10191 HA2 GLY B 305 31.821 35.499 77.357 1.00 0.00 H ATOM 10192 H GLY B 305 33.952 35.070 79.209 1.00 0.00 H ATOM 10193 N ASP B 306 33.745 32.918 76.591 1.00 14.67 N ATOM 10194 CA ASP B 306 33.871 31.835 75.591 1.00 14.69 C ATOM 10195 C ASP B 306 32.587 31.011 75.586 1.00 15.06 C ATOM 10196 O ASP B 306 32.063 30.660 74.516 1.00 15.77 O ATOM 10197 CB ASP B 306 35.033 30.889 75.932 1.00 14.18 C ATOM 10198 CG ASP B 306 36.430 31.508 75.680 1.00 14.45 C ATOM 10199 OD1 ASP B 306 36.578 32.703 75.323 1.00 14.63 O ATOM 10200 OD2 ASP B 306 37.414 30.735 75.854 1.00 14.83 O ATOM 10201 HA ASP B 306 34.056 32.295 74.620 1.00 0.00 H ATOM 10202 HB2 ASP B 306 34.960 30.619 76.986 1.00 0.00 H ATOM 10203 HB3 ASP B 306 34.938 29.992 75.321 1.00 0.00 H ATOM 10204 H ASP B 306 34.407 32.973 77.391 1.00 0.00 H ATOM 10205 N VAL B 307 32.082 30.698 76.787 1.00 15.25 N ATOM 10206 CA VAL B 307 30.919 29.801 76.874 1.00 16.82 C ATOM 10207 C VAL B 307 29.596 30.539 76.660 1.00 17.93 C ATOM 10208 O VAL B 307 28.634 29.940 76.175 1.00 17.70 O ATOM 10209 CB VAL B 307 30.941 28.909 78.123 1.00 19.43 C ATOM 10210 CG1 VAL B 307 32.162 27.970 78.043 1.00 20.84 C ATOM 10211 CG2 VAL B 307 30.966 29.717 79.382 1.00 21.03 C ATOM 10212 HA VAL B 307 31.001 29.106 76.038 1.00 0.00 H ATOM 10213 HB VAL B 307 30.025 28.318 78.151 1.00 0.00 H ATOM 10214 HG11 VAL B 307 32.085 27.352 77.149 1.00 0.00 H ATOM 10215 HG12 VAL B 307 33.074 28.565 77.998 1.00 0.00 H ATOM 10216 HG13 VAL B 307 32.186 27.332 78.926 1.00 0.00 H ATOM 10217 HG21 VAL B 307 31.858 30.344 79.392 1.00 0.00 H ATOM 10218 HG22 VAL B 307 30.077 30.347 79.426 1.00 0.00 H ATOM 10219 HG23 VAL B 307 30.981 29.047 80.242 1.00 0.00 H ATOM 10220 H VAL B 307 32.509 31.087 77.652 1.00 0.00 H ATOM 10221 N LYS B 308 29.553 31.842 76.947 1.00 16.94 N ATOM 10222 CA LYS B 308 28.360 32.624 76.591 1.00 17.12 C ATOM 10223 C LYS B 308 28.129 32.578 75.074 1.00 15.24 C ATOM 10224 O LYS B 308 27.002 32.391 74.592 1.00 14.95 O ATOM 10225 CB LYS B 308 28.491 34.082 77.053 1.00 20.64 C ATOM 10226 CG LYS B 308 28.156 34.370 78.531 1.00 22.69 C ATOM 10227 CD LYS B 308 26.757 33.883 78.968 1.00 23.81 C ATOM 10228 CE LYS B 308 25.660 34.929 78.748 1.00 25.66 C ATOM 10229 NZ LYS B 308 24.460 34.669 79.595 1.00 26.97 N ATOM 10230 HA LYS B 308 27.505 32.180 77.101 1.00 0.00 H ATOM 10231 HB2 LYS B 308 29.521 34.393 76.880 1.00 0.00 H ATOM 10232 HB3 LYS B 308 27.823 34.685 76.438 1.00 0.00 H ATOM 10233 HG2 LYS B 308 28.901 33.875 79.154 1.00 0.00 H ATOM 10234 HG3 LYS B 308 28.209 35.447 78.691 1.00 0.00 H ATOM 10235 HD2 LYS B 308 26.506 32.991 78.395 1.00 0.00 H ATOM 10236 HD3 LYS B 308 26.792 33.634 80.029 1.00 0.00 H ATOM 10237 HE2 LYS B 308 25.362 34.911 77.700 1.00 0.00 H ATOM 10238 HE3 LYS B 308 26.058 35.913 78.994 1.00 0.00 H ATOM 10239 HZ1 LYS B 308 24.069 33.734 79.362 1.00 0.00 H ATOM 10240 HZ2 LYS B 308 24.734 34.691 80.598 1.00 0.00 H ATOM 10241 HZ3 LYS B 308 23.744 35.401 79.413 1.00 0.00 H ATOM 10242 H LYS B 308 30.358 32.301 77.419 1.00 0.00 H ATOM 10243 N GLU B 309 29.203 32.723 74.314 1.00 14.49 N ATOM 10244 CA GLU B 309 29.079 32.663 72.863 1.00 13.32 C ATOM 10245 C GLU B 309 28.671 31.257 72.424 1.00 12.86 C ATOM 10246 O GLU B 309 27.843 31.096 71.515 1.00 13.44 O ATOM 10247 CB GLU B 309 30.369 33.067 72.199 1.00 12.95 C ATOM 10248 CG GLU B 309 30.326 32.963 70.652 1.00 14.06 C ATOM 10249 CD GLU B 309 31.603 33.427 69.997 1.00 12.21 C ATOM 10250 OE1 GLU B 309 32.642 33.460 70.691 1.00 12.90 O ATOM 10251 OE2 GLU B 309 31.573 33.725 68.789 1.00 12.45 O ATOM 10252 HA GLU B 309 28.304 33.365 72.556 1.00 0.00 H ATOM 10253 HB2 GLU B 309 30.588 34.100 72.470 1.00 0.00 H ATOM 10254 HB3 GLU B 309 31.165 32.419 72.567 1.00 0.00 H ATOM 10255 HG2 GLU B 309 30.152 31.922 70.378 1.00 0.00 H ATOM 10256 HG3 GLU B 309 29.503 33.577 70.285 1.00 0.00 H ATOM 10257 H GLU B 309 30.134 32.879 74.751 1.00 0.00 H ATOM 10258 N LEU B 310 29.231 30.232 73.050 1.00 13.55 N ATOM 10259 CA LEU B 310 28.828 28.874 72.625 1.00 13.32 C ATOM 10260 C LEU B 310 27.364 28.577 72.903 1.00 14.01 C ATOM 10261 O LEU B 310 26.695 27.949 72.067 1.00 14.79 O ATOM 10262 CB LEU B 310 29.695 27.782 73.269 1.00 15.36 C ATOM 10263 CG LEU B 310 31.182 27.738 72.873 1.00 15.53 C ATOM 10264 CD1 LEU B 310 31.853 26.528 73.517 1.00 16.58 C ATOM 10265 CD2 LEU B 310 31.427 27.686 71.370 1.00 17.05 C ATOM 10266 HA LEU B 310 28.981 28.860 71.546 1.00 0.00 H ATOM 10267 HB2 LEU B 310 29.647 27.920 74.349 1.00 0.00 H ATOM 10268 HB3 LEU B 310 29.257 26.819 73.007 1.00 0.00 H ATOM 10269 HG LEU B 310 31.610 28.674 73.233 1.00 0.00 H ATOM 10270 HD21 LEU B 310 30.959 26.792 70.958 1.00 0.00 H ATOM 10271 HD22 LEU B 310 30.997 28.572 70.902 1.00 0.00 H ATOM 10272 HD23 LEU B 310 32.500 27.657 71.179 1.00 0.00 H ATOM 10273 HD11 LEU B 310 31.770 26.603 74.601 1.00 0.00 H ATOM 10274 HD12 LEU B 310 31.361 25.617 73.176 1.00 0.00 H ATOM 10275 HD13 LEU B 310 32.905 26.503 73.232 1.00 0.00 H ATOM 10276 H LEU B 310 29.926 30.377 73.810 1.00 0.00 H ATOM 10277 N ALA B 311 26.837 29.089 74.018 1.00 14.31 N ATOM 10278 CA ALA B 311 25.421 28.898 74.306 1.00 14.24 C ATOM 10279 C ALA B 311 24.576 29.624 73.249 1.00 13.53 C ATOM 10280 O ALA B 311 23.548 29.122 72.815 1.00 15.12 O ATOM 10281 CB ALA B 311 25.088 29.388 75.678 1.00 16.45 C ATOM 10282 HA ALA B 311 25.194 27.833 74.269 1.00 0.00 H ATOM 10283 HB1 ALA B 311 25.674 28.835 76.412 1.00 0.00 H ATOM 10284 HB2 ALA B 311 25.322 30.450 75.750 1.00 0.00 H ATOM 10285 HB3 ALA B 311 24.026 29.235 75.869 1.00 0.00 H ATOM 10286 H ALA B 311 27.436 29.623 74.680 1.00 0.00 H ATOM 10287 N ALA B 312 25.031 30.806 72.816 1.00 13.32 N ATOM 10288 CA ALA B 312 24.315 31.530 71.766 1.00 12.42 C ATOM 10289 C ALA B 312 24.359 30.737 70.445 1.00 11.97 C ATOM 10290 O ALA B 312 23.365 30.657 69.704 1.00 13.59 O ATOM 10291 CB ALA B 312 24.942 32.907 71.574 1.00 13.75 C ATOM 10292 HA ALA B 312 23.273 31.650 72.063 1.00 0.00 H ATOM 10293 HB1 ALA B 312 24.880 33.467 72.507 1.00 0.00 H ATOM 10294 HB2 ALA B 312 25.987 32.792 71.287 1.00 0.00 H ATOM 10295 HB3 ALA B 312 24.406 33.443 70.791 1.00 0.00 H ATOM 10296 H ALA B 312 25.896 31.211 73.227 1.00 0.00 H ATOM 10297 N ILE B 313 25.523 30.197 70.110 1.00 13.02 N ATOM 10298 CA ILE B 313 25.644 29.391 68.900 1.00 13.81 C ATOM 10299 C ILE B 313 24.692 28.179 68.946 1.00 13.81 C ATOM 10300 O ILE B 313 24.001 27.873 67.966 1.00 13.58 O ATOM 10301 CB ILE B 313 27.107 28.956 68.699 1.00 14.80 C ATOM 10302 CG1 ILE B 313 27.976 30.152 68.286 1.00 13.57 C ATOM 10303 CG2 ILE B 313 27.207 27.806 67.649 1.00 16.14 C ATOM 10304 CD1 ILE B 313 29.475 29.895 68.468 1.00 14.43 C ATOM 10305 HA ILE B 313 25.350 29.998 68.043 1.00 0.00 H ATOM 10306 HB ILE B 313 27.482 28.576 69.649 1.00 0.00 H ATOM 10307 HG12 ILE B 313 27.786 30.373 67.236 1.00 0.00 H ATOM 10308 HG13 ILE B 313 27.695 31.012 68.894 1.00 0.00 H ATOM 10309 HD11 ILE B 313 29.681 29.682 69.517 1.00 0.00 H ATOM 10310 HD12 ILE B 313 29.773 29.042 67.858 1.00 0.00 H ATOM 10311 HD13 ILE B 313 30.034 30.778 68.158 1.00 0.00 H ATOM 10312 HG21 ILE B 313 26.630 26.948 67.995 1.00 0.00 H ATOM 10313 HG22 ILE B 313 26.809 28.151 66.695 1.00 0.00 H ATOM 10314 HG23 ILE B 313 28.251 27.518 67.526 1.00 0.00 H ATOM 10315 H ILE B 313 26.356 30.349 70.714 1.00 0.00 H ATOM 10316 N ARG B 314 24.608 27.511 70.088 1.00 14.41 N ATOM 10317 CA ARG B 314 23.703 26.371 70.159 1.00 15.47 C ATOM 10318 C ARG B 314 22.263 26.824 69.937 1.00 14.79 C ATOM 10319 O ARG B 314 21.462 26.130 69.293 1.00 16.65 O ATOM 10320 CB ARG B 314 23.789 25.703 71.519 1.00 15.72 C ATOM 10321 CG ARG B 314 25.113 25.007 71.816 1.00 16.07 C ATOM 10322 CD ARG B 314 24.998 24.298 73.152 1.00 18.28 C ATOM 10323 NE ARG B 314 26.286 23.897 73.726 1.00 18.14 N ATOM 10324 CZ ARG B 314 26.882 22.735 73.481 1.00 18.29 C ATOM 10325 NH1 ARG B 314 26.351 21.886 72.615 1.00 18.59 N ATOM 10326 NH2 ARG B 314 28.018 22.450 74.079 1.00 19.48 N ATOM 10327 HA ARG B 314 23.997 25.664 69.383 1.00 0.00 H ATOM 10328 HB2 ARG B 314 23.630 26.466 72.281 1.00 0.00 H ATOM 10329 HB3 ARG B 314 22.995 24.959 71.581 1.00 0.00 H ATOM 10330 HG2 ARG B 314 25.331 24.281 71.032 1.00 0.00 H ATOM 10331 HG3 ARG B 314 25.914 25.745 71.859 1.00 0.00 H ATOM 10332 HD2 ARG B 314 24.390 23.404 73.015 1.00 0.00 H ATOM 10333 HD3 ARG B 314 24.503 24.968 73.855 1.00 0.00 H ATOM 10334 HE ARG B 314 26.763 24.564 74.365 1.00 0.00 H ATOM 10335 HH12 ARG B 314 26.819 20.977 72.424 1.00 0.00 H ATOM 10336 HH11 ARG B 314 25.466 22.128 72.125 1.00 0.00 H ATOM 10337 HH22 ARG B 314 28.491 21.543 73.892 1.00 0.00 H ATOM 10338 HH21 ARG B 314 28.444 23.132 74.739 1.00 0.00 H ATOM 10339 H ARG B 314 25.174 27.794 70.913 1.00 0.00 H ATOM 10340 N GLU B 315 21.915 27.982 70.481 1.00 15.16 N ATOM 10341 CA GLU B 315 20.545 28.467 70.304 1.00 15.83 C ATOM 10342 C GLU B 315 20.236 28.805 68.841 1.00 15.19 C ATOM 10343 O GLU B 315 19.150 28.507 68.329 1.00 17.44 O ATOM 10344 CB GLU B 315 20.317 29.677 71.201 1.00 17.89 C ATOM 10345 CG GLU B 315 18.933 30.247 71.077 1.00 21.63 C ATOM 10346 CD GLU B 315 18.607 31.253 72.143 1.00 25.53 C ATOM 10347 OE1 GLU B 315 19.343 31.316 73.159 1.00 28.78 O ATOM 10348 OE2 GLU B 315 17.605 31.973 71.949 1.00 29.09 O ATOM 10349 HA GLU B 315 19.861 27.668 70.590 1.00 0.00 H ATOM 10350 HB2 GLU B 315 20.478 29.377 72.237 1.00 0.00 H ATOM 10351 HB3 GLU B 315 21.037 30.450 70.932 1.00 0.00 H ATOM 10352 HG2 GLU B 315 18.844 30.732 70.105 1.00 0.00 H ATOM 10353 HG3 GLU B 315 18.215 29.430 71.141 1.00 0.00 H ATOM 10354 H GLU B 315 22.605 28.538 71.026 1.00 0.00 H ATOM 10355 N VAL B 316 21.181 29.450 68.168 1.00 14.01 N ATOM 10356 CA VAL B 316 21.004 29.827 66.765 1.00 14.47 C ATOM 10357 C VAL B 316 20.910 28.601 65.875 1.00 14.55 C ATOM 10358 O VAL B 316 20.026 28.530 65.000 1.00 16.98 O ATOM 10359 CB VAL B 316 22.174 30.729 66.301 1.00 13.93 C ATOM 10360 CG1 VAL B 316 22.118 30.942 64.786 1.00 14.73 C ATOM 10361 CG2 VAL B 316 22.119 32.065 67.043 1.00 14.63 C ATOM 10362 HA VAL B 316 20.069 30.381 66.682 1.00 0.00 H ATOM 10363 HB VAL B 316 23.119 30.238 66.535 1.00 0.00 H ATOM 10364 HG11 VAL B 316 22.191 29.978 64.282 1.00 0.00 H ATOM 10365 HG12 VAL B 316 21.175 31.421 64.522 1.00 0.00 H ATOM 10366 HG13 VAL B 316 22.948 31.578 64.479 1.00 0.00 H ATOM 10367 HG21 VAL B 316 21.172 32.560 66.827 1.00 0.00 H ATOM 10368 HG22 VAL B 316 22.202 31.887 68.115 1.00 0.00 H ATOM 10369 HG23 VAL B 316 22.944 32.696 66.713 1.00 0.00 H ATOM 10370 H VAL B 316 22.070 29.694 68.650 1.00 0.00 H ATOM 10371 N PHE B 317 21.794 27.637 66.090 1.00 14.76 N ATOM 10372 CA PHE B 317 21.962 26.560 65.106 1.00 14.71 C ATOM 10373 C PHE B 317 21.208 25.281 65.447 1.00 17.24 C ATOM 10374 O PHE B 317 21.110 24.380 64.609 1.00 18.61 O ATOM 10375 CB PHE B 317 23.441 26.258 64.850 1.00 14.44 C ATOM 10376 CG PHE B 317 24.139 27.352 64.140 1.00 14.37 C ATOM 10377 CD1 PHE B 317 24.075 27.457 62.758 1.00 14.60 C ATOM 10378 CD2 PHE B 317 24.825 28.308 64.859 1.00 14.39 C ATOM 10379 CE1 PHE B 317 24.721 28.466 62.105 1.00 14.96 C ATOM 10380 CE2 PHE B 317 25.482 29.354 64.196 1.00 14.69 C ATOM 10381 CZ PHE B 317 25.412 29.430 62.827 1.00 14.25 C ATOM 10382 HA PHE B 317 21.512 26.943 64.190 1.00 0.00 H ATOM 10383 HB2 PHE B 317 23.934 26.095 65.809 1.00 0.00 H ATOM 10384 HB3 PHE B 317 23.512 25.352 64.248 1.00 0.00 H ATOM 10385 HD2 PHE B 317 24.857 28.250 65.947 1.00 0.00 H ATOM 10386 HE2 PHE B 317 26.042 30.099 64.761 1.00 0.00 H ATOM 10387 HZ PHE B 317 25.902 30.252 62.304 1.00 0.00 H ATOM 10388 HE1 PHE B 317 24.695 28.515 61.016 1.00 0.00 H ATOM 10389 HD1 PHE B 317 23.502 26.726 62.188 1.00 0.00 H ATOM 10390 H PHE B 317 22.369 27.643 66.956 1.00 0.00 H ATOM 10391 N GLY B 318 20.682 25.192 66.667 1.00 19.08 N ATOM 10392 CA GLY B 318 19.866 24.036 67.049 1.00 21.46 C ATOM 10393 C GLY B 318 20.700 22.788 66.903 1.00 24.12 C ATOM 10394 O GLY B 318 21.810 22.731 67.415 1.00 26.35 O ATOM 10395 HA3 GLY B 318 18.993 23.972 66.400 1.00 0.00 H ATOM 10396 HA2 GLY B 318 19.541 24.142 68.084 1.00 0.00 H ATOM 10397 H GLY B 318 20.852 25.952 67.357 1.00 0.00 H ATOM 10398 N ASP B 319 20.179 21.792 66.179 1.00 26.67 N ATOM 10399 CA ASP B 319 20.894 20.521 66.005 1.00 27.73 C ATOM 10400 C ASP B 319 21.791 20.429 64.774 1.00 26.26 C ATOM 10401 O ASP B 319 22.156 19.322 64.354 1.00 27.02 O ATOM 10402 CB ASP B 319 19.923 19.325 66.029 1.00 31.46 C ATOM 10403 CG ASP B 319 18.886 19.366 64.899 1.00 34.85 C ATOM 10404 OD1 ASP B 319 19.116 20.024 63.856 1.00 37.40 O ATOM 10405 OD2 ASP B 319 17.826 18.705 65.049 1.00 38.36 O ATOM 10406 HA ASP B 319 21.568 20.484 66.861 1.00 0.00 H ATOM 10407 HB2 ASP B 319 20.502 18.406 65.935 1.00 0.00 H ATOM 10408 HB3 ASP B 319 19.396 19.325 66.983 1.00 0.00 H ATOM 10409 H ASP B 319 19.249 21.920 65.730 1.00 0.00 H ATOM 10410 N LYS B 320 22.156 21.576 64.201 1.00 23.38 N ATOM 10411 CA LYS B 320 23.085 21.589 63.075 1.00 23.97 C ATOM 10412 C LYS B 320 24.105 22.737 63.233 1.00 22.68 C ATOM 10413 O LYS B 320 24.207 23.614 62.398 1.00 23.02 O ATOM 10414 CB LYS B 320 22.350 21.692 61.724 1.00 25.69 C ATOM 10415 CG LYS B 320 21.296 20.625 61.460 1.00 28.82 C ATOM 10416 HA LYS B 320 23.621 20.640 63.078 1.00 0.00 H ATOM 10417 HB2 LYS B 320 21.859 22.664 61.683 1.00 0.00 H ATOM 10418 HB3 LYS B 320 23.096 21.629 60.932 1.00 0.00 H ATOM 10419 HG2 LYS B 320 21.764 19.641 61.478 1.00 0.00 H ATOM 10420 HG3 LYS B 320 20.527 20.677 62.231 1.00 0.00 H ATOM 10421 H LYS B 320 21.774 22.474 64.561 1.00 0.00 H ATOM 10422 N SER B 321 24.902 22.693 64.290 1.00 21.53 N ATOM 10423 CA SER B 321 25.948 23.693 64.486 1.00 19.92 C ATOM 10424 C SER B 321 27.118 23.452 63.541 1.00 17.71 C ATOM 10425 O SER B 321 27.417 22.313 63.128 1.00 17.17 O ATOM 10426 CB SER B 321 26.442 23.676 65.919 1.00 22.74 C ATOM 10427 OG SER B 321 26.833 22.348 66.200 1.00 26.82 O ATOM 10428 HA SER B 321 25.516 24.670 64.268 1.00 0.00 H ATOM 10429 HB2 SER B 321 25.644 23.984 66.595 1.00 0.00 H ATOM 10430 HB3 SER B 321 27.292 24.349 66.031 1.00 0.00 H ATOM 10431 HG SER B 321 27.553 22.078 65.576 1.00 0.00 H ATOM 10432 H SER B 321 24.781 21.935 64.991 1.00 0.00 H ATOM 10433 N PRO B 322 27.780 24.536 63.176 1.00 15.17 N ATOM 10434 CA PRO B 322 28.902 24.485 62.253 1.00 13.55 C ATOM 10435 C PRO B 322 30.205 24.047 62.921 1.00 10.99 C ATOM 10436 O PRO B 322 30.340 24.072 64.159 1.00 13.18 O ATOM 10437 CB PRO B 322 29.031 25.959 61.838 1.00 14.61 C ATOM 10438 CG PRO B 322 28.597 26.705 63.091 1.00 16.73 C ATOM 10439 CD PRO B 322 27.450 25.923 63.573 1.00 17.33 C ATOM 10440 HA PRO B 322 28.736 23.772 61.445 1.00 0.00 H ATOM 10441 HD3 PRO B 322 27.351 26.005 64.655 1.00 0.00 H ATOM 10442 HD2 PRO B 322 26.526 26.254 63.099 1.00 0.00 H ATOM 10443 HG3 PRO B 322 28.301 27.727 62.854 1.00 0.00 H ATOM 10444 HG2 PRO B 322 29.397 26.722 63.832 1.00 0.00 H ATOM 10445 HB2 PRO B 322 30.060 26.203 61.572 1.00 0.00 H ATOM 10446 HB3 PRO B 322 28.376 26.189 60.998 1.00 0.00 H ATOM 10447 N ALA B 323 31.183 23.703 62.096 1.00 10.58 N ATOM 10448 CA ALA B 323 32.561 23.605 62.578 1.00 10.01 C ATOM 10449 C ALA B 323 32.969 24.961 63.144 1.00 8.69 C ATOM 10450 O ALA B 323 32.644 25.998 62.563 1.00 10.44 O ATOM 10451 CB ALA B 323 33.477 23.249 61.415 1.00 10.61 C ATOM 10452 HA ALA B 323 32.638 22.836 63.347 1.00 0.00 H ATOM 10453 HB1 ALA B 323 33.169 22.293 60.991 1.00 0.00 H ATOM 10454 HB2 ALA B 323 33.411 24.024 60.652 1.00 0.00 H ATOM 10455 HB3 ALA B 323 34.504 23.176 61.772 1.00 0.00 H ATOM 10456 H ALA B 323 30.970 23.501 61.098 1.00 0.00 H ATOM 10457 N ILE B 324 33.729 24.958 64.239 1.00 9.27 N ATOM 10458 CA ILE B 324 34.113 26.188 64.936 1.00 9.16 C ATOM 10459 C ILE B 324 35.594 26.145 65.236 1.00 8.75 C ATOM 10460 O ILE B 324 36.131 25.100 65.655 1.00 10.09 O ATOM 10461 CB ILE B 324 33.360 26.271 66.280 1.00 9.64 C ATOM 10462 CG1 ILE B 324 31.858 26.450 66.058 1.00 11.09 C ATOM 10463 CG2 ILE B 324 33.918 27.413 67.167 1.00 12.42 C ATOM 10464 CD1 ILE B 324 31.001 25.988 67.255 1.00 13.90 C ATOM 10465 HA ILE B 324 33.871 27.047 64.310 1.00 0.00 H ATOM 10466 HB ILE B 324 33.518 25.328 66.803 1.00 0.00 H ATOM 10467 HG12 ILE B 324 31.659 27.506 65.878 1.00 0.00 H ATOM 10468 HG13 ILE B 324 31.567 25.872 65.181 1.00 0.00 H ATOM 10469 HD11 ILE B 324 31.181 24.929 67.442 1.00 0.00 H ATOM 10470 HD12 ILE B 324 31.273 26.565 68.139 1.00 0.00 H ATOM 10471 HD13 ILE B 324 29.947 26.144 67.027 1.00 0.00 H ATOM 10472 HG21 ILE B 324 34.973 27.231 67.370 1.00 0.00 H ATOM 10473 HG22 ILE B 324 33.806 28.364 66.646 1.00 0.00 H ATOM 10474 HG23 ILE B 324 33.366 27.445 68.106 1.00 0.00 H ATOM 10475 H ILE B 324 34.062 24.047 64.613 1.00 0.00 H ATOM 10476 N SER B 325 36.276 27.292 65.066 1.00 9.08 N ATOM 10477 CA SER B 325 37.559 27.412 65.747 1.00 9.51 C ATOM 10478 C SER B 325 37.750 28.836 66.185 1.00 9.91 C ATOM 10479 O SER B 325 37.181 29.761 65.569 1.00 11.20 O ATOM 10480 CB SER B 325 38.754 26.897 64.934 1.00 10.76 C ATOM 10481 OG SER B 325 38.978 27.686 63.770 1.00 11.23 O ATOM 10482 HA SER B 325 37.527 26.758 66.618 1.00 0.00 H ATOM 10483 HB2 SER B 325 38.559 25.868 64.632 1.00 0.00 H ATOM 10484 HB3 SER B 325 39.646 26.928 65.559 1.00 0.00 H ATOM 10485 HG SER B 325 39.754 27.325 63.272 1.00 0.00 H ATOM 10486 H SER B 325 35.903 28.061 64.473 1.00 0.00 H ATOM 10487 N ALA B 326 38.557 28.993 67.228 1.00 9.76 N ATOM 10488 CA ALA B 326 38.897 30.322 67.755 1.00 10.09 C ATOM 10489 C ALA B 326 40.327 30.648 67.389 1.00 10.69 C ATOM 10490 O ALA B 326 41.273 30.134 68.015 1.00 11.15 O ATOM 10491 CB ALA B 326 38.728 30.331 69.267 1.00 12.02 C ATOM 10492 HA ALA B 326 38.234 31.072 67.323 1.00 0.00 H ATOM 10493 HB1 ALA B 326 37.694 30.096 69.517 1.00 0.00 H ATOM 10494 HB2 ALA B 326 39.389 29.586 69.710 1.00 0.00 H ATOM 10495 HB3 ALA B 326 38.981 31.318 69.654 1.00 0.00 H ATOM 10496 H ALA B 326 38.960 28.150 67.685 1.00 0.00 H ATOM 10497 N THR B 327 40.508 31.463 66.346 1.00 9.93 N ATOM 10498 CA THR B 327 41.857 31.773 65.920 1.00 9.97 C ATOM 10499 C THR B 327 42.598 32.647 66.924 1.00 8.85 C ATOM 10500 O THR B 327 43.821 32.708 66.853 1.00 9.47 O ATOM 10501 CB THR B 327 41.890 32.367 64.512 1.00 11.02 C ATOM 10502 OG1 THR B 327 40.965 33.456 64.435 1.00 11.37 O ATOM 10503 CG2 THR B 327 41.507 31.291 63.476 1.00 12.61 C ATOM 10504 HA THR B 327 42.394 30.825 65.879 1.00 0.00 H ATOM 10505 HB THR B 327 42.897 32.725 64.297 1.00 0.00 H ATOM 10506 HG1 THR B 327 41.219 34.150 65.094 1.00 0.00 H ATOM 10507 HG23 THR B 327 42.213 30.463 63.537 1.00 0.00 H ATOM 10508 HG21 THR B 327 40.501 30.929 63.686 1.00 0.00 H ATOM 10509 HG22 THR B 327 41.538 31.724 62.476 1.00 0.00 H ATOM 10510 H THR B 327 39.691 31.869 65.847 1.00 0.00 H ATOM 10511 N LYS B 328 41.894 33.246 67.898 1.00 9.33 N ATOM 10512 CA LYS B 328 42.611 34.009 68.907 1.00 9.11 C ATOM 10513 C LYS B 328 43.521 33.142 69.765 1.00 9.43 C ATOM 10514 O LYS B 328 44.468 33.670 70.346 1.00 10.03 O ATOM 10515 CB LYS B 328 41.660 34.810 69.796 1.00 11.19 C ATOM 10516 CG LYS B 328 41.011 36.025 69.080 1.00 9.96 C ATOM 10517 CD LYS B 328 40.186 36.842 70.071 1.00 12.18 C ATOM 10518 CE LYS B 328 39.539 38.080 69.474 1.00 12.75 C ATOM 10519 NZ LYS B 328 38.459 37.639 68.541 1.00 14.12 N ATOM 10520 HA LYS B 328 43.243 34.706 68.356 1.00 0.00 H ATOM 10521 HB2 LYS B 328 40.865 34.146 70.136 1.00 0.00 H ATOM 10522 HB3 LYS B 328 42.219 35.176 70.657 1.00 0.00 H ATOM 10523 HG2 LYS B 328 41.794 36.655 68.658 1.00 0.00 H ATOM 10524 HG3 LYS B 328 40.363 35.668 68.280 1.00 0.00 H ATOM 10525 HD2 LYS B 328 39.398 36.202 70.469 1.00 0.00 H ATOM 10526 HD3 LYS B 328 40.841 37.157 70.883 1.00 0.00 H ATOM 10527 HE2 LYS B 328 40.284 38.659 68.929 1.00 0.00 H ATOM 10528 HE3 LYS B 328 39.113 38.693 70.268 1.00 0.00 H ATOM 10529 HZ1 LYS B 328 38.871 37.052 67.788 1.00 0.00 H ATOM 10530 HZ2 LYS B 328 37.753 37.085 69.067 1.00 0.00 H ATOM 10531 HZ3 LYS B 328 38.003 38.474 68.121 1.00 0.00 H ATOM 10532 H LYS B 328 40.858 33.166 67.930 1.00 0.00 H ATOM 10533 N ALA B 329 43.275 31.828 69.823 1.00 9.85 N ATOM 10534 CA ALA B 329 44.201 30.971 70.549 1.00 11.10 C ATOM 10535 C ALA B 329 45.606 31.024 69.917 1.00 10.64 C ATOM 10536 O ALA B 329 46.611 30.860 70.622 1.00 11.63 O ATOM 10537 CB ALA B 329 43.636 29.511 70.636 1.00 12.42 C ATOM 10538 HA ALA B 329 44.303 31.340 71.570 1.00 0.00 H ATOM 10539 HB1 ALA B 329 42.679 29.524 71.157 1.00 0.00 H ATOM 10540 HB2 ALA B 329 43.498 29.116 69.630 1.00 0.00 H ATOM 10541 HB3 ALA B 329 44.340 28.882 71.182 1.00 0.00 H ATOM 10542 H ALA B 329 42.437 31.426 69.357 1.00 0.00 H ATOM 10543 N MET B 330 45.691 31.260 68.597 1.00 10.48 N ATOM 10544 CA MET B 330 46.981 31.457 67.926 1.00 10.06 C ATOM 10545 C MET B 330 47.407 32.940 67.965 1.00 9.67 C ATOM 10546 O MET B 330 48.588 33.252 68.164 1.00 11.58 O ATOM 10547 CB MET B 330 46.870 31.095 66.426 1.00 11.07 C ATOM 10548 CG MET B 330 46.885 29.633 66.169 1.00 13.05 C ATOM 10549 SD MET B 330 46.702 29.299 64.380 1.00 14.79 S ATOM 10550 CE MET B 330 44.948 29.435 64.226 1.00 15.91 C ATOM 10551 HA MET B 330 47.701 30.825 68.446 1.00 0.00 H ATOM 10552 HB2 MET B 330 45.937 31.504 66.040 1.00 0.00 H ATOM 10553 HB3 MET B 330 47.710 31.547 65.898 1.00 0.00 H ATOM 10554 HG2 MET B 330 46.062 29.165 66.708 1.00 0.00 H ATOM 10555 HG3 MET B 330 47.830 29.216 66.518 1.00 0.00 H ATOM 10556 HE1 MET B 330 44.470 28.695 64.868 1.00 0.00 H ATOM 10557 HE2 MET B 330 44.635 30.435 64.526 1.00 0.00 H ATOM 10558 HE3 MET B 330 44.661 29.259 63.189 1.00 0.00 H ATOM 10559 H MET B 330 44.817 31.304 68.035 1.00 0.00 H ATOM 10560 N THR B 331 46.480 33.875 67.720 1.00 8.87 N ATOM 10561 CA THR B 331 46.877 35.259 67.359 1.00 8.56 C ATOM 10562 C THR B 331 46.841 36.237 68.518 1.00 9.23 C ATOM 10563 O THR B 331 47.399 37.333 68.395 1.00 10.23 O ATOM 10564 CB THR B 331 45.915 35.809 66.282 1.00 9.33 C ATOM 10565 OG1 THR B 331 44.583 35.926 66.812 1.00 9.12 O ATOM 10566 CG2 THR B 331 45.850 34.909 65.055 1.00 9.92 C ATOM 10567 HA THR B 331 47.907 35.182 67.009 1.00 0.00 H ATOM 10568 HB THR B 331 46.305 36.784 65.989 1.00 0.00 H ATOM 10569 HG1 THR B 331 44.590 36.544 67.585 1.00 0.00 H ATOM 10570 HG23 THR B 331 46.848 34.802 64.631 1.00 0.00 H ATOM 10571 HG21 THR B 331 45.470 33.929 65.344 1.00 0.00 H ATOM 10572 HG22 THR B 331 45.185 35.354 64.315 1.00 0.00 H ATOM 10573 H THR B 331 45.472 33.629 67.783 1.00 0.00 H ATOM 10574 N GLY B 332 46.114 35.888 69.575 1.00 9.04 N ATOM 10575 CA GLY B 332 45.740 36.911 70.571 1.00 9.15 C ATOM 10576 C GLY B 332 44.615 37.797 70.059 1.00 8.68 C ATOM 10577 O GLY B 332 44.095 37.625 68.933 1.00 9.45 O ATOM 10578 HA3 GLY B 332 46.610 37.531 70.787 1.00 0.00 H ATOM 10579 HA2 GLY B 332 45.413 36.414 71.485 1.00 0.00 H ATOM 10580 H GLY B 332 45.811 34.901 69.699 1.00 0.00 H ATOM 10581 N HIS B 333 44.280 38.805 70.873 1.00 9.86 N ATOM 10582 CA HIS B 333 43.145 39.667 70.640 1.00 10.35 C ATOM 10583 C HIS B 333 43.624 41.054 70.243 1.00 9.89 C ATOM 10584 O HIS B 333 44.132 41.793 71.096 1.00 10.72 O ATOM 10585 CB HIS B 333 42.312 39.720 71.925 1.00 12.51 C ATOM 10586 CG HIS B 333 41.012 40.436 71.758 1.00 12.49 C ATOM 10587 ND1 HIS B 333 40.667 41.102 70.589 1.00 13.86 N ATOM 10588 CD2 HIS B 333 39.970 40.597 72.610 1.00 14.93 C ATOM 10589 CE1 HIS B 333 39.450 41.601 70.722 1.00 15.03 C ATOM 10590 NE2 HIS B 333 39.020 41.339 71.946 1.00 15.58 N ATOM 10591 HA HIS B 333 42.531 39.281 69.826 1.00 0.00 H ATOM 10592 HB2 HIS B 333 42.106 38.699 72.246 1.00 0.00 H ATOM 10593 HB3 HIS B 333 42.893 40.231 72.693 1.00 0.00 H ATOM 10594 HD2 HIS B 333 39.898 40.212 73.627 1.00 0.00 H ATOM 10595 HE1 HIS B 333 38.894 42.138 69.953 1.00 0.00 H ATOM 10596 H HIS B 333 44.866 38.976 71.715 1.00 0.00 H ATOM 10597 N SER B 334 43.452 41.405 68.954 1.00 10.37 N ATOM 10598 CA SER B 334 43.973 42.680 68.453 1.00 10.26 C ATOM 10599 C SER B 334 42.939 43.774 68.460 1.00 9.48 C ATOM 10600 O SER B 334 43.137 44.823 67.839 1.00 10.84 O ATOM 10601 CB SER B 334 44.554 42.505 67.055 1.00 11.55 C ATOM 10602 OG SER B 334 43.527 42.052 66.210 1.00 11.85 O ATOM 10603 HA SER B 334 44.764 42.989 69.136 1.00 0.00 H ATOM 10604 HB2 SER B 334 45.362 41.774 67.079 1.00 0.00 H ATOM 10605 HB3 SER B 334 44.938 43.458 66.692 1.00 0.00 H ATOM 10606 HG SER B 334 43.884 41.931 65.294 1.00 0.00 H ATOM 10607 H SER B 334 42.945 40.766 68.309 1.00 0.00 H ATOM 10608 N LEU B 335 41.895 43.570 69.253 1.00 10.98 N ATOM 10609 CA LEU B 335 41.011 44.675 69.640 1.00 12.39 C ATOM 10610 C LEU B 335 40.378 45.309 68.379 1.00 11.64 C ATOM 10611 O LEU B 335 39.651 44.607 67.654 1.00 13.07 O ATOM 10612 CB LEU B 335 41.728 45.709 70.532 1.00 14.11 C ATOM 10613 CG LEU B 335 42.328 45.127 71.823 1.00 17.80 C ATOM 10614 CD1 LEU B 335 43.005 46.185 72.636 1.00 18.74 C ATOM 10615 CD2 LEU B 335 41.272 44.419 72.661 1.00 20.60 C ATOM 10616 HA LEU B 335 40.204 44.274 70.254 1.00 0.00 H ATOM 10617 HB2 LEU B 335 42.535 46.158 69.953 1.00 0.00 H ATOM 10618 HB3 LEU B 335 41.008 46.480 70.808 1.00 0.00 H ATOM 10619 HG LEU B 335 43.075 44.393 71.522 1.00 0.00 H ATOM 10620 HD21 LEU B 335 40.490 45.128 72.933 1.00 0.00 H ATOM 10621 HD22 LEU B 335 40.839 43.603 72.083 1.00 0.00 H ATOM 10622 HD23 LEU B 335 41.734 44.021 73.565 1.00 0.00 H ATOM 10623 HD11 LEU B 335 43.809 46.632 72.051 1.00 0.00 H ATOM 10624 HD12 LEU B 335 42.280 46.953 72.906 1.00 0.00 H ATOM 10625 HD13 LEU B 335 43.417 45.738 73.541 1.00 0.00 H ATOM 10626 H LEU B 335 41.700 42.611 69.606 1.00 0.00 H ATOM 10627 N GLY B 336 40.684 46.571 68.065 1.00 12.10 N ATOM 10628 CA GLY B 336 40.116 47.223 66.856 1.00 13.45 C ATOM 10629 C GLY B 336 40.461 46.540 65.553 1.00 11.94 C ATOM 10630 O GLY B 336 39.700 46.639 64.581 1.00 12.89 O ATOM 10631 HA3 GLY B 336 40.490 48.246 66.814 1.00 0.00 H ATOM 10632 HA2 GLY B 336 39.031 47.238 66.956 1.00 0.00 H ATOM 10633 H GLY B 336 41.331 47.107 68.678 1.00 0.00 H ATOM 10634 N ALA B 337 41.570 45.809 65.514 1.00 10.43 N ATOM 10635 CA ALA B 337 41.950 45.083 64.299 1.00 9.70 C ATOM 10636 C ALA B 337 41.352 43.678 64.213 1.00 8.96 C ATOM 10637 O ALA B 337 41.447 43.051 63.163 1.00 9.91 O ATOM 10638 CB ALA B 337 43.474 45.011 64.192 1.00 12.27 C ATOM 10639 HA ALA B 337 41.537 45.644 63.461 1.00 0.00 H ATOM 10640 HB1 ALA B 337 43.882 46.021 64.151 1.00 0.00 H ATOM 10641 HB2 ALA B 337 43.874 44.491 65.063 1.00 0.00 H ATOM 10642 HB3 ALA B 337 43.748 44.470 63.286 1.00 0.00 H ATOM 10643 H ALA B 337 42.176 45.751 66.357 1.00 0.00 H ATOM 10644 N ALA B 338 40.712 43.203 65.273 1.00 8.92 N ATOM 10645 CA ALA B 338 40.320 41.780 65.302 1.00 9.08 C ATOM 10646 C ALA B 338 39.283 41.443 64.234 1.00 8.70 C ATOM 10647 O ALA B 338 39.349 40.377 63.614 1.00 9.27 O ATOM 10648 CB ALA B 338 39.788 41.392 66.680 1.00 10.27 C ATOM 10649 HA ALA B 338 41.219 41.203 65.086 1.00 0.00 H ATOM 10650 HB1 ALA B 338 40.563 41.559 67.428 1.00 0.00 H ATOM 10651 HB2 ALA B 338 38.916 42.002 66.917 1.00 0.00 H ATOM 10652 HB3 ALA B 338 39.506 40.339 66.676 1.00 0.00 H ATOM 10653 H ALA B 338 40.489 43.826 66.075 1.00 0.00 H ATOM 10654 N GLY B 339 38.273 42.303 64.055 1.00 8.50 N ATOM 10655 CA GLY B 339 37.175 41.978 63.132 1.00 8.74 C ATOM 10656 C GLY B 339 37.664 41.774 61.717 1.00 8.88 C ATOM 10657 O GLY B 339 37.300 40.799 61.046 1.00 8.90 O ATOM 10658 HA3 GLY B 339 36.454 42.796 63.141 1.00 0.00 H ATOM 10659 HA2 GLY B 339 36.689 41.063 63.472 1.00 0.00 H ATOM 10660 H GLY B 339 38.265 43.206 64.571 1.00 0.00 H ATOM 10661 N VAL B 340 38.511 42.677 61.230 1.00 7.80 N ATOM 10662 CA VAL B 340 39.019 42.562 59.875 1.00 7.60 C ATOM 10663 C VAL B 340 40.044 41.447 59.767 1.00 7.46 C ATOM 10664 O VAL B 340 40.045 40.688 58.774 1.00 7.96 O ATOM 10665 CB VAL B 340 39.545 43.901 59.294 1.00 7.25 C ATOM 10666 CG1 VAL B 340 40.693 44.462 60.117 1.00 8.36 C ATOM 10667 CG2 VAL B 340 39.940 43.707 57.831 1.00 8.25 C ATOM 10668 HA VAL B 340 38.167 42.295 59.249 1.00 0.00 H ATOM 10669 HB VAL B 340 38.744 44.638 59.343 1.00 0.00 H ATOM 10670 HG11 VAL B 340 40.353 44.641 61.137 1.00 0.00 H ATOM 10671 HG12 VAL B 340 41.515 43.746 60.127 1.00 0.00 H ATOM 10672 HG13 VAL B 340 41.031 45.399 59.675 1.00 0.00 H ATOM 10673 HG21 VAL B 340 40.722 42.951 57.764 1.00 0.00 H ATOM 10674 HG22 VAL B 340 39.070 43.382 57.261 1.00 0.00 H ATOM 10675 HG23 VAL B 340 40.309 44.650 57.427 1.00 0.00 H ATOM 10676 H VAL B 340 38.812 43.474 61.826 1.00 0.00 H ATOM 10677 N GLN B 341 40.917 41.310 60.762 1.00 7.69 N ATOM 10678 CA GLN B 341 41.888 40.222 60.659 1.00 7.57 C ATOM 10679 C GLN B 341 41.175 38.874 60.648 1.00 7.86 C ATOM 10680 O GLN B 341 41.542 37.971 59.883 1.00 8.73 O ATOM 10681 CB GLN B 341 42.884 40.273 61.794 1.00 8.38 C ATOM 10682 CG GLN B 341 43.809 41.472 61.665 1.00 8.87 C ATOM 10683 CD GLN B 341 44.792 41.478 62.800 1.00 9.63 C ATOM 10684 OE1 GLN B 341 44.480 41.034 63.914 1.00 10.88 O ATOM 10685 NE2 GLN B 341 46.001 41.985 62.545 1.00 11.54 N ATOM 10686 HA GLN B 341 42.432 40.344 59.722 1.00 0.00 H ATOM 10687 HB2 GLN B 341 42.343 40.341 62.738 1.00 0.00 H ATOM 10688 HB3 GLN B 341 43.481 39.361 61.784 1.00 0.00 H ATOM 10689 HG2 GLN B 341 44.348 41.414 60.719 1.00 0.00 H ATOM 10690 HG3 GLN B 341 43.220 42.389 61.691 1.00 0.00 H ATOM 10691 HE22 GLN B 341 46.223 42.348 61.596 1.00 0.00 H ATOM 10692 HE21 GLN B 341 46.720 42.017 63.295 1.00 0.00 H ATOM 10693 H GLN B 341 40.909 41.952 61.580 1.00 0.00 H ATOM 10694 N GLU B 342 40.144 38.705 61.479 1.00 7.83 N ATOM 10695 CA GLU B 342 39.412 37.417 61.527 1.00 7.94 C ATOM 10696 C GLU B 342 38.553 37.208 60.299 1.00 7.99 C ATOM 10697 O GLU B 342 38.400 36.064 59.844 1.00 9.13 O ATOM 10698 CB GLU B 342 38.649 37.349 62.829 1.00 9.10 C ATOM 10699 CG GLU B 342 39.654 37.158 63.960 1.00 10.21 C ATOM 10700 CD GLU B 342 39.165 37.427 65.348 1.00 11.70 C ATOM 10701 OE1 GLU B 342 37.953 37.614 65.550 1.00 12.84 O ATOM 10702 OE2 GLU B 342 40.013 37.424 66.283 1.00 12.52 O ATOM 10703 HA GLU B 342 40.115 36.584 61.505 1.00 0.00 H ATOM 10704 HB2 GLU B 342 38.094 38.275 62.981 1.00 0.00 H ATOM 10705 HB3 GLU B 342 37.954 36.510 62.807 1.00 0.00 H ATOM 10706 HG2 GLU B 342 39.998 36.124 63.925 1.00 0.00 H ATOM 10707 HG3 GLU B 342 40.495 37.825 63.771 1.00 0.00 H ATOM 10708 H GLU B 342 39.851 39.486 62.100 1.00 0.00 H ATOM 10709 N ALA B 343 38.002 38.285 59.742 1.00 7.85 N ATOM 10710 CA ALA B 343 37.357 38.163 58.423 1.00 7.86 C ATOM 10711 C ALA B 343 38.376 37.640 57.395 1.00 8.16 C ATOM 10712 O ALA B 343 38.063 36.738 56.596 1.00 9.07 O ATOM 10713 CB ALA B 343 36.760 39.491 57.998 1.00 8.80 C ATOM 10714 HA ALA B 343 36.538 37.446 58.484 1.00 0.00 H ATOM 10715 HB1 ALA B 343 36.015 39.804 58.729 1.00 0.00 H ATOM 10716 HB2 ALA B 343 37.549 40.240 57.939 1.00 0.00 H ATOM 10717 HB3 ALA B 343 36.288 39.380 57.022 1.00 0.00 H ATOM 10718 H ALA B 343 38.027 39.202 60.233 1.00 0.00 H ATOM 10719 N ILE B 344 39.605 38.186 57.427 1.00 7.59 N ATOM 10720 CA ILE B 344 40.644 37.737 56.513 1.00 7.55 C ATOM 10721 C ILE B 344 41.011 36.271 56.773 1.00 7.92 C ATOM 10722 O ILE B 344 41.151 35.505 55.810 1.00 8.69 O ATOM 10723 CB ILE B 344 41.850 38.677 56.587 1.00 7.90 C ATOM 10724 CG1 ILE B 344 41.462 40.012 55.914 1.00 8.62 C ATOM 10725 CG2 ILE B 344 43.098 38.057 55.954 1.00 8.78 C ATOM 10726 CD1 ILE B 344 42.495 41.118 56.105 1.00 9.74 C ATOM 10727 HA ILE B 344 40.266 37.777 55.491 1.00 0.00 H ATOM 10728 HB ILE B 344 42.110 38.857 57.630 1.00 0.00 H ATOM 10729 HG12 ILE B 344 41.339 39.836 54.845 1.00 0.00 H ATOM 10730 HG13 ILE B 344 40.515 40.348 56.337 1.00 0.00 H ATOM 10731 HD11 ILE B 344 42.622 41.315 57.169 1.00 0.00 H ATOM 10732 HD12 ILE B 344 43.447 40.803 55.677 1.00 0.00 H ATOM 10733 HD13 ILE B 344 42.152 42.024 55.605 1.00 0.00 H ATOM 10734 HG21 ILE B 344 43.350 37.136 56.479 1.00 0.00 H ATOM 10735 HG22 ILE B 344 42.900 37.837 54.905 1.00 0.00 H ATOM 10736 HG23 ILE B 344 43.929 38.759 56.029 1.00 0.00 H ATOM 10737 H ILE B 344 39.815 38.938 58.114 1.00 0.00 H ATOM 10738 N TYR B 345 41.169 35.861 58.036 1.00 7.85 N ATOM 10739 CA TYR B 345 41.501 34.448 58.262 1.00 7.96 C ATOM 10740 C TYR B 345 40.389 33.562 57.681 1.00 7.89 C ATOM 10741 O TYR B 345 40.651 32.526 57.082 1.00 8.90 O ATOM 10742 CB TYR B 345 41.642 34.146 59.765 1.00 8.32 C ATOM 10743 CG TYR B 345 42.655 34.976 60.514 1.00 7.94 C ATOM 10744 CD1 TYR B 345 43.798 35.470 59.898 1.00 8.44 C ATOM 10745 CD2 TYR B 345 42.429 35.292 61.850 1.00 9.09 C ATOM 10746 CE1 TYR B 345 44.701 36.270 60.603 1.00 9.35 C ATOM 10747 CE2 TYR B 345 43.309 36.128 62.558 1.00 8.91 C ATOM 10748 CZ TYR B 345 44.420 36.600 61.912 1.00 9.15 C ATOM 10749 OH TYR B 345 45.295 37.430 62.577 1.00 9.94 O ATOM 10750 HA TYR B 345 42.451 34.239 57.770 1.00 0.00 H ATOM 10751 HB3 TYR B 345 41.925 33.099 59.870 1.00 0.00 H ATOM 10752 HB2 TYR B 345 40.669 34.306 60.230 1.00 0.00 H ATOM 10753 HD2 TYR B 345 41.554 34.884 62.356 1.00 0.00 H ATOM 10754 HE2 TYR B 345 43.112 36.394 63.596 1.00 0.00 H ATOM 10755 HE1 TYR B 345 45.613 36.628 60.126 1.00 0.00 H ATOM 10756 HD1 TYR B 345 43.993 35.231 58.853 1.00 0.00 H ATOM 10757 HH TYR B 345 44.817 38.247 62.867 1.00 0.00 H ATOM 10758 H TYR B 345 41.060 36.521 58.832 1.00 0.00 H ATOM 10759 N SER B 346 39.142 33.977 57.894 1.00 7.92 N ATOM 10760 CA SER B 346 37.979 33.238 57.399 1.00 8.12 C ATOM 10761 C SER B 346 37.957 33.181 55.858 1.00 8.37 C ATOM 10762 O SER B 346 37.646 32.142 55.275 1.00 9.55 O ATOM 10763 CB SER B 346 36.684 33.857 57.923 1.00 10.27 C ATOM 10764 OG SER B 346 36.660 33.848 59.338 1.00 10.80 O ATOM 10765 HA SER B 346 38.058 32.217 57.771 1.00 0.00 H ATOM 10766 HB2 SER B 346 35.836 33.284 57.547 1.00 0.00 H ATOM 10767 HB3 SER B 346 36.611 34.886 57.570 1.00 0.00 H ATOM 10768 HG SER B 346 37.427 34.370 59.683 1.00 0.00 H ATOM 10769 H SER B 346 38.989 34.855 58.430 1.00 0.00 H ATOM 10770 N LEU B 347 38.290 34.292 55.214 1.00 8.84 N ATOM 10771 CA LEU B 347 38.373 34.343 53.760 1.00 9.40 C ATOM 10772 C LEU B 347 39.511 33.472 53.251 1.00 8.90 C ATOM 10773 O LEU B 347 39.386 32.854 52.185 1.00 10.35 O ATOM 10774 CB LEU B 347 38.567 35.803 53.280 1.00 10.83 C ATOM 10775 CG LEU B 347 37.359 36.720 53.453 1.00 10.69 C ATOM 10776 CD1 LEU B 347 37.804 38.168 53.237 1.00 13.87 C ATOM 10777 CD2 LEU B 347 36.251 36.310 52.482 1.00 12.93 C ATOM 10778 HA LEU B 347 37.437 33.959 53.355 1.00 0.00 H ATOM 10779 HB2 LEU B 347 39.398 36.233 53.840 1.00 0.00 H ATOM 10780 HB3 LEU B 347 38.820 35.777 52.220 1.00 0.00 H ATOM 10781 HG LEU B 347 36.954 36.632 54.461 1.00 0.00 H ATOM 10782 HD21 LEU B 347 36.619 36.388 51.459 1.00 0.00 H ATOM 10783 HD22 LEU B 347 35.954 35.281 52.685 1.00 0.00 H ATOM 10784 HD23 LEU B 347 35.393 36.970 52.612 1.00 0.00 H ATOM 10785 HD11 LEU B 347 38.571 38.424 53.968 1.00 0.00 H ATOM 10786 HD12 LEU B 347 38.209 38.276 52.231 1.00 0.00 H ATOM 10787 HD13 LEU B 347 36.948 38.832 53.358 1.00 0.00 H ATOM 10788 H LEU B 347 38.498 35.151 55.762 1.00 0.00 H ATOM 10789 N LEU B 348 40.634 33.409 53.973 1.00 9.19 N ATOM 10790 CA LEU B 348 41.714 32.516 53.544 1.00 8.69 C ATOM 10791 C LEU B 348 41.309 31.041 53.675 1.00 9.36 C ATOM 10792 O LEU B 348 41.649 30.225 52.809 1.00 9.86 O ATOM 10793 CB LEU B 348 42.998 32.772 54.346 1.00 9.16 C ATOM 10794 CG LEU B 348 43.641 34.132 54.030 1.00 9.34 C ATOM 10795 CD1 LEU B 348 44.771 34.418 54.984 1.00 10.90 C ATOM 10796 CD2 LEU B 348 44.124 34.184 52.580 1.00 12.60 C ATOM 10797 HA LEU B 348 41.906 32.732 52.493 1.00 0.00 H ATOM 10798 HB2 LEU B 348 42.757 32.740 55.408 1.00 0.00 H ATOM 10799 HB3 LEU B 348 43.716 31.985 54.114 1.00 0.00 H ATOM 10800 HG LEU B 348 42.883 34.905 54.158 1.00 0.00 H ATOM 10801 HD21 LEU B 348 44.863 33.400 52.416 1.00 0.00 H ATOM 10802 HD22 LEU B 348 43.277 34.032 51.911 1.00 0.00 H ATOM 10803 HD23 LEU B 348 44.575 35.157 52.383 1.00 0.00 H ATOM 10804 HD11 LEU B 348 44.388 34.436 56.004 1.00 0.00 H ATOM 10805 HD12 LEU B 348 45.528 33.639 54.893 1.00 0.00 H ATOM 10806 HD13 LEU B 348 45.212 35.385 54.743 1.00 0.00 H ATOM 10807 H LEU B 348 40.740 33.988 54.830 1.00 0.00 H ATOM 10808 N MET B 349 40.577 30.725 54.741 1.00 9.07 N ATOM 10809 CA MET B 349 40.046 29.369 54.899 1.00 8.74 C ATOM 10810 C MET B 349 39.084 29.024 53.763 1.00 9.78 C ATOM 10811 O MET B 349 39.137 27.928 53.195 1.00 10.06 O ATOM 10812 CB MET B 349 39.373 29.222 56.251 1.00 9.27 C ATOM 10813 CG MET B 349 40.389 29.115 57.384 1.00 9.73 C ATOM 10814 SD MET B 349 39.584 28.958 58.976 1.00 10.22 S ATOM 10815 CE MET B 349 40.134 30.423 59.865 1.00 11.02 C ATOM 10816 HA MET B 349 40.876 28.664 54.853 1.00 0.00 H ATOM 10817 HB2 MET B 349 38.740 30.092 56.426 1.00 0.00 H ATOM 10818 HB3 MET B 349 38.758 28.322 56.243 1.00 0.00 H ATOM 10819 HG2 MET B 349 41.011 30.010 57.388 1.00 0.00 H ATOM 10820 HG3 MET B 349 41.016 28.239 57.216 1.00 0.00 H ATOM 10821 HE1 MET B 349 41.221 30.411 59.945 1.00 0.00 H ATOM 10822 HE2 MET B 349 39.818 31.315 59.324 1.00 0.00 H ATOM 10823 HE3 MET B 349 39.695 30.427 60.863 1.00 0.00 H ATOM 10824 H MET B 349 40.381 31.445 55.466 1.00 0.00 H ATOM 10825 N LEU B 350 38.223 29.968 53.414 1.00 9.82 N ATOM 10826 CA LEU B 350 37.284 29.759 52.317 1.00 10.16 C ATOM 10827 C LEU B 350 38.000 29.611 50.974 1.00 10.24 C ATOM 10828 O LEU B 350 37.685 28.740 50.161 1.00 12.37 O ATOM 10829 CB LEU B 350 36.312 30.965 52.298 1.00 11.33 C ATOM 10830 CG LEU B 350 35.163 30.909 51.301 1.00 11.60 C ATOM 10831 CD1 LEU B 350 34.281 29.700 51.566 1.00 12.94 C ATOM 10832 CD2 LEU B 350 34.370 32.190 51.470 1.00 13.41 C ATOM 10833 HA LEU B 350 36.738 28.829 52.473 1.00 0.00 H ATOM 10834 HB2 LEU B 350 35.879 31.055 53.294 1.00 0.00 H ATOM 10835 HB3 LEU B 350 36.898 31.857 52.076 1.00 0.00 H ATOM 10836 HG LEU B 350 35.540 30.816 50.283 1.00 0.00 H ATOM 10837 HD21 LEU B 350 33.993 32.251 52.491 1.00 0.00 H ATOM 10838 HD22 LEU B 350 35.016 33.045 51.268 1.00 0.00 H ATOM 10839 HD23 LEU B 350 33.533 32.192 50.772 1.00 0.00 H ATOM 10840 HD11 LEU B 350 34.875 28.791 51.472 1.00 0.00 H ATOM 10841 HD12 LEU B 350 33.871 29.765 52.574 1.00 0.00 H ATOM 10842 HD13 LEU B 350 33.467 29.680 50.842 1.00 0.00 H ATOM 10843 H LEU B 350 38.216 30.871 53.929 1.00 0.00 H ATOM 10844 N GLU B 351 38.974 30.485 50.724 1.00 10.58 N ATOM 10845 CA GLU B 351 39.702 30.488 49.447 1.00 10.11 C ATOM 10846 C GLU B 351 40.561 29.234 49.268 1.00 11.37 C ATOM 10847 O GLU B 351 40.690 28.735 48.153 1.00 13.66 O ATOM 10848 CB GLU B 351 40.551 31.761 49.359 1.00 11.72 C ATOM 10849 CG GLU B 351 41.398 31.966 48.094 1.00 13.31 C ATOM 10850 CD GLU B 351 40.602 32.487 46.909 1.00 15.74 C ATOM 10851 OE1 GLU B 351 39.358 32.604 46.970 1.00 15.78 O ATOM 10852 OE2 GLU B 351 41.240 32.752 45.872 1.00 19.64 O ATOM 10853 HA GLU B 351 38.976 30.477 48.634 1.00 0.00 H ATOM 10854 HB2 GLU B 351 39.874 32.611 49.439 1.00 0.00 H ATOM 10855 HB3 GLU B 351 41.232 31.759 50.210 1.00 0.00 H ATOM 10856 HG2 GLU B 351 42.189 32.681 48.320 1.00 0.00 H ATOM 10857 HG3 GLU B 351 41.843 31.010 47.818 1.00 0.00 H ATOM 10858 H GLU B 351 39.226 31.184 51.452 1.00 0.00 H ATOM 10859 N HIS B 352 41.187 28.771 50.351 1.00 10.60 N ATOM 10860 CA HIS B 352 42.141 27.673 50.259 1.00 10.25 C ATOM 10861 C HIS B 352 41.580 26.358 50.733 1.00 11.31 C ATOM 10862 O HIS B 352 42.251 25.335 50.629 1.00 13.26 O ATOM 10863 CB HIS B 352 43.415 28.048 51.013 1.00 11.98 C ATOM 10864 CG HIS B 352 44.109 29.212 50.388 1.00 11.46 C ATOM 10865 ND1 HIS B 352 44.951 29.074 49.308 1.00 14.29 N ATOM 10866 CD2 HIS B 352 43.999 30.536 50.618 1.00 11.73 C ATOM 10867 CE1 HIS B 352 45.353 30.274 48.926 1.00 14.41 C ATOM 10868 NE2 HIS B 352 44.789 31.181 49.705 1.00 12.81 N ATOM 10869 HA HIS B 352 42.374 27.521 49.205 1.00 0.00 H ATOM 10870 HB2 HIS B 352 43.155 28.303 52.040 1.00 0.00 H ATOM 10871 HB3 HIS B 352 44.090 27.192 51.012 1.00 0.00 H ATOM 10872 HD2 HIS B 352 43.391 31.007 51.391 1.00 0.00 H ATOM 10873 HE1 HIS B 352 46.037 30.482 48.103 1.00 0.00 H ATOM 10874 H HIS B 352 40.991 29.201 51.277 1.00 0.00 H ATOM 10875 N GLY B 353 40.346 26.350 51.213 1.00 10.04 N ATOM 10876 CA GLY B 353 39.635 25.101 51.525 1.00 11.24 C ATOM 10877 C GLY B 353 40.198 24.371 52.732 1.00 10.31 C ATOM 10878 O GLY B 353 40.540 23.180 52.675 1.00 10.18 O ATOM 10879 HA3 GLY B 353 39.700 24.441 50.660 1.00 0.00 H ATOM 10880 HA2 GLY B 353 38.589 25.338 51.721 1.00 0.00 H ATOM 10881 H GLY B 353 39.864 27.257 51.375 1.00 0.00 H ATOM 10882 N PHE B 354 40.278 25.069 53.850 1.00 9.90 N ATOM 10883 CA PHE B 354 40.719 24.397 55.089 1.00 9.65 C ATOM 10884 C PHE B 354 40.110 25.106 56.283 1.00 8.54 C ATOM 10885 O PHE B 354 39.717 26.278 56.195 1.00 10.09 O ATOM 10886 CB PHE B 354 42.262 24.330 55.209 1.00 10.39 C ATOM 10887 CG PHE B 354 42.881 25.646 55.632 1.00 10.17 C ATOM 10888 CD1 PHE B 354 43.011 26.666 54.704 1.00 10.96 C ATOM 10889 CD2 PHE B 354 43.304 25.870 56.949 1.00 9.74 C ATOM 10890 CE1 PHE B 354 43.543 27.909 55.082 1.00 12.03 C ATOM 10891 CE2 PHE B 354 43.810 27.083 57.344 1.00 10.85 C ATOM 10892 CZ PHE B 354 43.920 28.122 56.414 1.00 11.89 C ATOM 10893 HA PHE B 354 40.372 23.364 55.058 1.00 0.00 H ATOM 10894 HB2 PHE B 354 42.521 23.571 55.947 1.00 0.00 H ATOM 10895 HB3 PHE B 354 42.674 24.048 54.240 1.00 0.00 H ATOM 10896 HD2 PHE B 354 43.229 25.062 57.677 1.00 0.00 H ATOM 10897 HE2 PHE B 354 44.124 27.236 58.376 1.00 0.00 H ATOM 10898 HZ PHE B 354 44.298 29.096 56.725 1.00 0.00 H ATOM 10899 HE1 PHE B 354 43.662 28.703 54.344 1.00 0.00 H ATOM 10900 HD1 PHE B 354 42.698 26.502 53.673 1.00 0.00 H ATOM 10901 H PHE B 354 40.033 26.080 53.858 1.00 0.00 H ATOM 10902 N ILE B 355 40.079 24.412 57.422 1.00 9.48 N ATOM 10903 CA ILE B 355 39.726 25.011 58.695 1.00 9.36 C ATOM 10904 C ILE B 355 40.948 25.050 59.571 1.00 9.68 C ATOM 10905 O ILE B 355 41.611 24.026 59.784 1.00 10.41 O ATOM 10906 CB ILE B 355 38.617 24.180 59.383 1.00 10.14 C ATOM 10907 CG1 ILE B 355 37.326 24.214 58.534 1.00 11.63 C ATOM 10908 CG2 ILE B 355 38.356 24.683 60.821 1.00 10.72 C ATOM 10909 CD1 ILE B 355 36.319 23.148 58.946 1.00 13.64 C ATOM 10910 HA ILE B 355 39.355 26.023 58.531 1.00 0.00 H ATOM 10911 HB ILE B 355 38.953 23.146 59.457 1.00 0.00 H ATOM 10912 HG12 ILE B 355 36.861 25.194 58.646 1.00 0.00 H ATOM 10913 HG13 ILE B 355 37.592 24.056 57.489 1.00 0.00 H ATOM 10914 HD11 ILE B 355 36.768 22.162 58.830 1.00 0.00 H ATOM 10915 HD12 ILE B 355 36.037 23.300 59.988 1.00 0.00 H ATOM 10916 HD13 ILE B 355 35.434 23.222 58.314 1.00 0.00 H ATOM 10917 HG21 ILE B 355 39.271 24.597 61.407 1.00 0.00 H ATOM 10918 HG22 ILE B 355 38.041 25.726 60.788 1.00 0.00 H ATOM 10919 HG23 ILE B 355 37.572 24.080 61.279 1.00 0.00 H ATOM 10920 H ILE B 355 40.318 23.400 57.396 1.00 0.00 H ATOM 10921 N ALA B 356 41.277 26.245 60.071 1.00 9.26 N ATOM 10922 CA ALA B 356 42.399 26.434 60.973 1.00 10.19 C ATOM 10923 C ALA B 356 42.045 25.851 62.339 1.00 10.13 C ATOM 10924 O ALA B 356 40.897 25.948 62.780 1.00 11.83 O ATOM 10925 CB ALA B 356 42.719 27.937 61.109 1.00 11.44 C ATOM 10926 HA ALA B 356 43.277 25.925 60.575 1.00 0.00 H ATOM 10927 HB1 ALA B 356 42.973 28.343 60.130 1.00 0.00 H ATOM 10928 HB2 ALA B 356 41.848 28.458 61.505 1.00 0.00 H ATOM 10929 HB3 ALA B 356 43.562 28.068 61.788 1.00 0.00 H ATOM 10930 H ALA B 356 40.707 27.072 59.803 1.00 0.00 H ATOM 10931 N PRO B 357 43.026 25.319 63.063 1.00 10.48 N ATOM 10932 CA PRO B 357 42.734 24.679 64.347 1.00 10.86 C ATOM 10933 C PRO B 357 42.527 25.676 65.484 1.00 10.37 C ATOM 10934 O PRO B 357 43.102 26.778 65.469 1.00 11.55 O ATOM 10935 CB PRO B 357 44.014 23.879 64.614 1.00 11.75 C ATOM 10936 CG PRO B 357 45.080 24.652 63.923 1.00 11.83 C ATOM 10937 CD PRO B 357 44.443 25.182 62.678 1.00 10.81 C ATOM 10938 HA PRO B 357 41.813 24.097 64.304 1.00 0.00 H ATOM 10939 HD3 PRO B 357 44.869 26.146 62.400 1.00 0.00 H ATOM 10940 HD2 PRO B 357 44.559 24.483 61.850 1.00 0.00 H ATOM 10941 HG3 PRO B 357 45.921 24.005 63.675 1.00 0.00 H ATOM 10942 HG2 PRO B 357 45.427 25.471 64.553 1.00 0.00 H ATOM 10943 HB2 PRO B 357 44.214 23.815 65.684 1.00 0.00 H ATOM 10944 HB3 PRO B 357 43.935 22.874 64.200 1.00 0.00 H ATOM 10945 N SER B 358 41.697 25.265 66.431 1.00 10.31 N ATOM 10946 CA SER B 358 41.534 25.922 67.707 1.00 10.57 C ATOM 10947 C SER B 358 42.572 25.294 68.626 1.00 9.95 C ATOM 10948 O SER B 358 42.403 24.149 69.071 1.00 11.13 O ATOM 10949 CB SER B 358 40.120 25.688 68.244 1.00 10.69 C ATOM 10950 OG SER B 358 39.621 26.855 68.922 1.00 11.32 O ATOM 10951 HA SER B 358 41.670 27.001 67.632 1.00 0.00 H ATOM 10952 HB2 SER B 358 40.139 24.851 68.942 1.00 0.00 H ATOM 10953 HB3 SER B 358 39.458 25.450 67.411 1.00 0.00 H ATOM 10954 HG SER B 358 40.216 27.073 69.682 1.00 0.00 H ATOM 10955 H SER B 358 41.127 24.416 66.244 1.00 0.00 H ATOM 10956 N ILE B 359 43.684 26.022 68.856 1.00 10.14 N ATOM 10957 CA ILE B 359 44.844 25.407 69.526 1.00 10.85 C ATOM 10958 C ILE B 359 44.772 25.539 71.050 1.00 10.73 C ATOM 10959 O ILE B 359 43.923 26.254 71.590 1.00 11.12 O ATOM 10960 CB ILE B 359 46.218 25.933 69.006 1.00 11.43 C ATOM 10961 CG1 ILE B 359 46.481 27.396 69.401 1.00 11.35 C ATOM 10962 CG2 ILE B 359 46.324 25.767 67.467 1.00 12.25 C ATOM 10963 CD1 ILE B 359 47.956 27.775 69.259 1.00 12.98 C ATOM 10964 HA ILE B 359 44.785 24.350 69.265 1.00 0.00 H ATOM 10965 HB ILE B 359 46.985 25.326 69.487 1.00 0.00 H ATOM 10966 HG12 ILE B 359 45.887 28.046 68.758 1.00 0.00 H ATOM 10967 HG13 ILE B 359 46.179 27.540 70.439 1.00 0.00 H ATOM 10968 HD11 ILE B 359 48.558 27.135 69.904 1.00 0.00 H ATOM 10969 HD12 ILE B 359 48.266 27.642 68.222 1.00 0.00 H ATOM 10970 HD13 ILE B 359 48.092 28.817 69.549 1.00 0.00 H ATOM 10971 HG21 ILE B 359 46.230 24.712 67.209 1.00 0.00 H ATOM 10972 HG22 ILE B 359 45.526 26.332 66.986 1.00 0.00 H ATOM 10973 HG23 ILE B 359 47.290 26.141 67.128 1.00 0.00 H ATOM 10974 H ILE B 359 43.723 27.018 68.560 1.00 0.00 H ATOM 10975 N ASN B 360 45.628 24.761 71.724 1.00 11.66 N ATOM 10976 CA ASN B 360 45.832 24.837 73.175 1.00 12.01 C ATOM 10977 C ASN B 360 44.657 24.323 74.005 1.00 13.36 C ATOM 10978 O ASN B 360 44.560 24.653 75.201 1.00 14.95 O ATOM 10979 CB ASN B 360 46.201 26.246 73.643 1.00 13.28 C ATOM 10980 CG ASN B 360 47.552 26.684 73.144 1.00 14.44 C ATOM 10981 OD1 ASN B 360 48.459 25.855 72.936 1.00 16.85 O ATOM 10982 ND2 ASN B 360 47.707 27.984 72.940 1.00 13.40 N ATOM 10983 HA ASN B 360 46.673 24.166 73.351 1.00 0.00 H ATOM 10984 HB2 ASN B 360 45.449 26.945 73.276 1.00 0.00 H ATOM 10985 HB3 ASN B 360 46.209 26.262 74.733 1.00 0.00 H ATOM 10986 HD22 ASN B 360 46.920 28.637 73.128 1.00 0.00 H ATOM 10987 HD21 ASN B 360 48.616 28.351 72.592 1.00 0.00 H ATOM 10988 H ASN B 360 46.181 24.062 71.188 1.00 0.00 H ATOM 10989 N ILE B 361 43.819 23.467 73.408 1.00 13.19 N ATOM 10990 CA ILE B 361 42.756 22.848 74.181 1.00 13.49 C ATOM 10991 C ILE B 361 43.286 21.554 74.767 1.00 15.20 C ATOM 10992 O ILE B 361 43.317 20.527 74.108 1.00 16.94 O ATOM 10993 CB ILE B 361 41.462 22.667 73.371 1.00 13.38 C ATOM 10994 CG1 ILE B 361 41.006 24.023 72.811 1.00 13.87 C ATOM 10995 CG2 ILE B 361 40.372 22.033 74.267 1.00 16.44 C ATOM 10996 CD1 ILE B 361 39.846 23.881 71.840 1.00 13.94 C ATOM 10997 HA ILE B 361 42.465 23.510 74.997 1.00 0.00 H ATOM 10998 HB ILE B 361 41.643 21.997 72.530 1.00 0.00 H ATOM 10999 HG12 ILE B 361 40.695 24.659 73.640 1.00 0.00 H ATOM 11000 HG13 ILE B 361 41.844 24.489 72.292 1.00 0.00 H ATOM 11001 HD11 ILE B 361 40.150 23.253 71.003 1.00 0.00 H ATOM 11002 HD12 ILE B 361 39.000 23.423 72.352 1.00 0.00 H ATOM 11003 HD13 ILE B 361 39.560 24.866 71.471 1.00 0.00 H ATOM 11004 HG21 ILE B 361 40.716 21.062 74.623 1.00 0.00 H ATOM 11005 HG22 ILE B 361 40.178 22.686 75.118 1.00 0.00 H ATOM 11006 HG23 ILE B 361 39.457 21.906 73.689 1.00 0.00 H ATOM 11007 H ILE B 361 43.928 23.246 72.398 1.00 0.00 H ATOM 11008 N GLU B 362 43.750 21.627 76.000 1.00 16.43 N ATOM 11009 CA GLU B 362 44.260 20.445 76.670 1.00 17.20 C ATOM 11010 C GLU B 362 43.142 19.680 77.343 1.00 18.83 C ATOM 11011 O GLU B 362 43.207 18.459 77.454 1.00 19.46 O ATOM 11012 CB GLU B 362 45.305 20.873 77.690 1.00 20.69 C ATOM 11013 CG GLU B 362 46.626 21.261 77.055 1.00 27.77 C ATOM 11014 CD GLU B 362 47.695 21.586 78.094 1.00 31.85 C ATOM 11015 OE1 GLU B 362 47.662 22.710 78.643 1.00 31.66 O ATOM 11016 OE2 GLU B 362 48.577 20.735 78.358 1.00 36.02 O ATOM 11017 HA GLU B 362 44.714 19.781 75.935 1.00 0.00 H ATOM 11018 HB2 GLU B 362 44.920 21.729 78.244 1.00 0.00 H ATOM 11019 HB3 GLU B 362 45.479 20.046 78.378 1.00 0.00 H ATOM 11020 HG2 GLU B 362 46.976 20.433 76.439 1.00 0.00 H ATOM 11021 HG3 GLU B 362 46.469 22.138 76.427 1.00 0.00 H ATOM 11022 H GLU B 362 43.750 22.541 76.497 1.00 0.00 H ATOM 11023 N GLU B 363 42.115 20.396 77.784 1.00 17.29 N ATOM 11024 CA GLU B 363 40.933 19.806 78.379 1.00 17.31 C ATOM 11025 C GLU B 363 39.782 20.697 77.936 1.00 16.04 C ATOM 11026 O GLU B 363 39.711 21.877 78.311 1.00 16.57 O ATOM 11027 CB GLU B 363 41.041 19.801 79.910 1.00 20.10 C ATOM 11028 CG GLU B 363 39.756 19.312 80.560 1.00 23.53 C ATOM 11029 CD GLU B 363 39.742 19.401 82.095 1.00 25.00 C ATOM 11030 OE1 GLU B 363 40.820 19.358 82.738 1.00 29.42 O ATOM 11031 OE2 GLU B 363 38.635 19.542 82.656 1.00 30.57 O ATOM 11032 HA GLU B 363 40.797 18.770 78.069 1.00 0.00 H ATOM 11033 HB2 GLU B 363 41.859 19.144 80.205 1.00 0.00 H ATOM 11034 HB3 GLU B 363 41.248 20.814 80.254 1.00 0.00 H ATOM 11035 HG2 GLU B 363 38.931 19.912 80.177 1.00 0.00 H ATOM 11036 HG3 GLU B 363 39.607 18.270 80.278 1.00 0.00 H ATOM 11037 H GLU B 363 42.161 21.431 77.698 1.00 0.00 H ATOM 11038 N LEU B 364 38.880 20.164 77.125 1.00 15.96 N ATOM 11039 CA LEU B 364 37.792 20.986 76.631 1.00 15.83 C ATOM 11040 C LEU B 364 36.820 21.353 77.735 1.00 15.70 C ATOM 11041 O LEU B 364 36.441 20.490 78.537 1.00 18.28 O ATOM 11042 CB LEU B 364 37.051 20.238 75.496 1.00 16.74 C ATOM 11043 CG LEU B 364 36.011 21.047 74.714 1.00 17.36 C ATOM 11044 CD1 LEU B 364 36.645 22.192 73.912 1.00 18.02 C ATOM 11045 CD2 LEU B 364 35.196 20.125 73.786 1.00 18.42 C ATOM 11046 HA LEU B 364 38.216 21.913 76.246 1.00 0.00 H ATOM 11047 HB2 LEU B 364 37.800 19.886 74.786 1.00 0.00 H ATOM 11048 HB3 LEU B 364 36.541 19.383 75.939 1.00 0.00 H ATOM 11049 HG LEU B 364 35.341 21.500 75.445 1.00 0.00 H ATOM 11050 HD21 LEU B 364 35.868 19.636 73.081 1.00 0.00 H ATOM 11051 HD22 LEU B 364 34.683 19.372 74.384 1.00 0.00 H ATOM 11052 HD23 LEU B 364 34.463 20.718 73.239 1.00 0.00 H ATOM 11053 HD11 LEU B 364 37.158 22.871 74.593 1.00 0.00 H ATOM 11054 HD12 LEU B 364 37.360 21.782 73.199 1.00 0.00 H ATOM 11055 HD13 LEU B 364 35.866 22.734 73.376 1.00 0.00 H ATOM 11056 H LEU B 364 38.952 19.165 76.845 1.00 0.00 H ATOM 11057 N ASP B 365 36.404 22.620 77.775 1.00 14.90 N ATOM 11058 CA ASP B 365 35.406 23.053 78.753 1.00 16.13 C ATOM 11059 C ASP B 365 34.145 22.194 78.631 1.00 16.62 C ATOM 11060 O ASP B 365 33.718 21.883 77.534 1.00 17.35 O ATOM 11061 CB ASP B 365 35.046 24.529 78.518 1.00 17.59 C ATOM 11062 CG ASP B 365 34.290 25.150 79.685 1.00 20.07 C ATOM 11063 OD1 ASP B 365 33.085 24.876 79.865 1.00 20.04 O ATOM 11064 OD2 ASP B 365 34.896 25.919 80.443 1.00 22.28 O ATOM 11065 HA ASP B 365 35.823 22.939 79.753 1.00 0.00 H ATOM 11066 HB2 ASP B 365 35.967 25.091 78.362 1.00 0.00 H ATOM 11067 HB3 ASP B 365 34.424 24.597 77.625 1.00 0.00 H ATOM 11068 H ASP B 365 36.795 23.309 77.101 1.00 0.00 H ATOM 11069 N GLU B 366 33.529 21.855 79.760 1.00 17.66 N ATOM 11070 CA GLU B 366 32.313 21.037 79.739 1.00 20.21 C ATOM 11071 C GLU B 366 31.206 21.674 78.877 1.00 18.70 C ATOM 11072 O GLU B 366 30.411 20.962 78.232 1.00 18.79 O ATOM 11073 CB GLU B 366 31.838 20.736 81.185 1.00 23.80 C ATOM 11074 CG GLU B 366 30.787 21.684 81.734 1.00 26.01 C ATOM 11075 CD GLU B 366 30.513 21.468 83.210 1.00 25.36 C ATOM 11076 OE1 GLU B 366 29.375 21.758 83.633 1.00 27.72 O ATOM 11077 OE2 GLU B 366 31.435 21.017 83.942 1.00 26.11 O ATOM 11078 HA GLU B 366 32.552 20.085 79.265 1.00 0.00 H ATOM 11079 HB2 GLU B 366 31.424 19.728 81.200 1.00 0.00 H ATOM 11080 HB3 GLU B 366 32.707 20.780 81.841 1.00 0.00 H ATOM 11081 HG2 GLU B 366 31.132 22.708 81.590 1.00 0.00 H ATOM 11082 HG3 GLU B 366 29.859 21.533 81.182 1.00 0.00 H ATOM 11083 H GLU B 366 33.916 22.175 80.671 1.00 0.00 H ATOM 11084 N GLN B 367 31.170 23.008 78.834 1.00 17.19 N ATOM 11085 CA GLN B 367 30.125 23.724 78.104 1.00 18.43 C ATOM 11086 C GLN B 367 30.369 23.771 76.597 1.00 18.79 C ATOM 11087 O GLN B 367 29.525 24.245 75.840 1.00 20.70 O ATOM 11088 CB GLN B 367 29.902 25.117 78.669 1.00 20.20 C ATOM 11089 CG GLN B 367 29.253 25.073 80.061 1.00 24.70 C ATOM 11090 CD GLN B 367 28.802 26.430 80.519 1.00 27.39 C ATOM 11091 OE1 GLN B 367 27.905 27.032 79.919 1.00 31.67 O ATOM 11092 NE2 GLN B 367 29.438 26.945 81.563 1.00 27.98 N ATOM 11093 HA GLN B 367 29.211 23.149 78.249 1.00 0.00 H ATOM 11094 HB2 GLN B 367 30.863 25.625 78.744 1.00 0.00 H ATOM 11095 HB3 GLN B 367 29.251 25.672 77.993 1.00 0.00 H ATOM 11096 HG2 GLN B 367 28.389 24.409 80.025 1.00 0.00 H ATOM 11097 HG3 GLN B 367 29.979 24.684 80.775 1.00 0.00 H ATOM 11098 HE22 GLN B 367 30.187 26.400 82.036 1.00 0.00 H ATOM 11099 HE21 GLN B 367 29.188 27.894 81.908 1.00 0.00 H ATOM 11100 H GLN B 367 31.904 23.551 79.332 1.00 0.00 H ATOM 11101 N ALA B 368 31.487 23.226 76.154 1.00 15.95 N ATOM 11102 CA ALA B 368 31.738 23.112 74.716 1.00 15.57 C ATOM 11103 C ALA B 368 31.487 21.707 74.193 1.00 14.75 C ATOM 11104 O ALA B 368 31.663 21.448 73.022 1.00 16.12 O ATOM 11105 CB ALA B 368 33.149 23.546 74.398 1.00 17.85 C ATOM 11106 HA ALA B 368 31.032 23.772 74.211 1.00 0.00 H ATOM 11107 HB1 ALA B 368 33.286 24.583 74.704 1.00 0.00 H ATOM 11108 HB2 ALA B 368 33.853 22.911 74.936 1.00 0.00 H ATOM 11109 HB3 ALA B 368 33.322 23.456 73.326 1.00 0.00 H ATOM 11110 H ALA B 368 32.194 22.875 76.831 1.00 0.00 H ATOM 11111 N ALA B 369 31.042 20.802 75.053 1.00 14.31 N ATOM 11112 CA ALA B 369 30.845 19.412 74.644 1.00 16.21 C ATOM 11113 C ALA B 369 29.820 19.285 73.521 1.00 17.12 C ATOM 11114 O ALA B 369 28.799 19.984 73.495 1.00 19.09 O ATOM 11115 CB ALA B 369 30.417 18.574 75.848 1.00 17.07 C ATOM 11116 HA ALA B 369 31.795 19.041 74.259 1.00 0.00 H ATOM 11117 HB1 ALA B 369 31.191 18.619 76.614 1.00 0.00 H ATOM 11118 HB2 ALA B 369 29.483 18.968 76.250 1.00 0.00 H ATOM 11119 HB3 ALA B 369 30.272 17.540 75.536 1.00 0.00 H ATOM 11120 H ALA B 369 30.830 21.084 76.031 1.00 0.00 H ATOM 11121 N GLY B 370 30.095 18.382 72.590 1.00 17.16 N ATOM 11122 CA GLY B 370 29.137 18.082 71.521 1.00 17.86 C ATOM 11123 C GLY B 370 29.260 19.019 70.330 1.00 18.03 C ATOM 11124 O GLY B 370 28.531 18.850 69.330 1.00 22.04 O ATOM 11125 HA3 GLY B 370 28.128 18.165 71.925 1.00 0.00 H ATOM 11126 HA2 GLY B 370 29.307 17.061 71.179 1.00 0.00 H ATOM 11127 H GLY B 370 31.005 17.878 72.618 1.00 0.00 H ATOM 11128 N LEU B 371 30.134 20.015 70.404 1.00 15.78 N ATOM 11129 CA LEU B 371 30.316 20.919 69.262 1.00 15.07 C ATOM 11130 C LEU B 371 31.556 20.514 68.521 1.00 14.26 C ATOM 11131 O LEU B 371 32.538 20.041 69.137 1.00 15.70 O ATOM 11132 CB LEU B 371 30.486 22.359 69.743 1.00 14.66 C ATOM 11133 CG LEU B 371 29.244 22.920 70.407 1.00 15.41 C ATOM 11134 CD1 LEU B 371 29.583 24.254 70.995 1.00 17.37 C ATOM 11135 CD2 LEU B 371 28.057 22.990 69.425 1.00 18.04 C ATOM 11136 HA LEU B 371 29.440 20.858 68.617 1.00 0.00 H ATOM 11137 HB2 LEU B 371 31.306 22.390 70.460 1.00 0.00 H ATOM 11138 HB3 LEU B 371 30.732 22.984 68.885 1.00 0.00 H ATOM 11139 HG LEU B 371 28.920 22.255 71.207 1.00 0.00 H ATOM 11140 HD21 LEU B 371 28.319 23.634 68.585 1.00 0.00 H ATOM 11141 HD22 LEU B 371 27.830 21.988 69.060 1.00 0.00 H ATOM 11142 HD23 LEU B 371 27.186 23.397 69.938 1.00 0.00 H ATOM 11143 HD11 LEU B 371 30.378 24.134 71.731 1.00 0.00 H ATOM 11144 HD12 LEU B 371 29.918 24.924 70.203 1.00 0.00 H ATOM 11145 HD13 LEU B 371 28.699 24.672 71.477 1.00 0.00 H ATOM 11146 H LEU B 371 30.690 20.155 71.272 1.00 0.00 H ATOM 11147 N ASN B 372 31.576 20.766 67.212 1.00 12.81 N ATOM 11148 CA ASN B 372 32.740 20.415 66.415 1.00 12.62 C ATOM 11149 C ASN B 372 33.743 21.579 66.473 1.00 12.30 C ATOM 11150 O ASN B 372 33.865 22.359 65.521 1.00 12.21 O ATOM 11151 CB ASN B 372 32.364 20.148 64.958 1.00 14.96 C ATOM 11152 CG ASN B 372 33.559 19.693 64.138 1.00 15.92 C ATOM 11153 OD1 ASN B 372 34.582 19.285 64.699 1.00 18.98 O ATOM 11154 ND2 ASN B 372 33.456 19.788 62.823 1.00 19.09 N ATOM 11155 HA ASN B 372 33.177 19.503 66.822 1.00 0.00 H ATOM 11156 HB2 ASN B 372 31.600 19.372 64.928 1.00 0.00 H ATOM 11157 HB3 ASN B 372 31.966 21.065 64.523 1.00 0.00 H ATOM 11158 HD22 ASN B 372 32.575 20.137 62.394 1.00 0.00 H ATOM 11159 HD21 ASN B 372 34.256 19.514 62.218 1.00 0.00 H ATOM 11160 H ASN B 372 30.755 21.216 66.759 1.00 0.00 H ATOM 11161 N ILE B 373 34.416 21.699 67.619 1.00 12.07 N ATOM 11162 CA ILE B 373 35.520 22.605 67.790 1.00 11.83 C ATOM 11163 C ILE B 373 36.716 21.927 67.193 1.00 11.08 C ATOM 11164 O ILE B 373 37.185 20.894 67.703 1.00 13.40 O ATOM 11165 CB ILE B 373 35.687 23.014 69.243 1.00 14.10 C ATOM 11166 CG1 ILE B 373 34.390 23.782 69.678 1.00 16.70 C ATOM 11167 CG2 ILE B 373 36.951 23.865 69.391 1.00 14.87 C ATOM 11168 CD1 ILE B 373 34.398 25.220 69.464 1.00 19.26 C ATOM 11169 HA ILE B 373 35.356 23.553 67.277 1.00 0.00 H ATOM 11170 HB ILE B 373 35.811 22.148 69.893 1.00 0.00 H ATOM 11171 HG12 ILE B 373 33.552 23.366 69.118 1.00 0.00 H ATOM 11172 HG13 ILE B 373 34.238 23.604 70.743 1.00 0.00 H ATOM 11173 HD11 ILE B 373 35.217 25.665 70.028 1.00 0.00 H ATOM 11174 HD12 ILE B 373 34.531 25.427 68.402 1.00 0.00 H ATOM 11175 HD13 ILE B 373 33.451 25.642 69.802 1.00 0.00 H ATOM 11176 HG21 ILE B 373 37.817 23.284 69.074 1.00 0.00 H ATOM 11177 HG22 ILE B 373 36.862 24.756 68.770 1.00 0.00 H ATOM 11178 HG23 ILE B 373 37.070 24.158 70.434 1.00 0.00 H ATOM 11179 H ILE B 373 34.129 21.110 68.426 1.00 0.00 H ATOM 11180 N VAL B 374 37.167 22.460 66.061 1.00 9.90 N ATOM 11181 CA VAL B 374 38.196 21.802 65.264 1.00 10.37 C ATOM 11182 C VAL B 374 39.560 22.083 65.862 1.00 10.24 C ATOM 11183 O VAL B 374 39.903 23.238 66.070 1.00 11.33 O ATOM 11184 CB VAL B 374 38.126 22.288 63.796 1.00 10.76 C ATOM 11185 CG1 VAL B 374 39.340 21.798 62.974 1.00 12.42 C ATOM 11186 CG2 VAL B 374 36.798 21.865 63.192 1.00 13.13 C ATOM 11187 HA VAL B 374 38.027 20.725 65.272 1.00 0.00 H ATOM 11188 HB VAL B 374 38.178 23.377 63.773 1.00 0.00 H ATOM 11189 HG11 VAL B 374 40.258 22.181 63.420 1.00 0.00 H ATOM 11190 HG12 VAL B 374 39.362 20.708 62.975 1.00 0.00 H ATOM 11191 HG13 VAL B 374 39.253 22.160 61.950 1.00 0.00 H ATOM 11192 HG21 VAL B 374 36.716 20.779 63.222 1.00 0.00 H ATOM 11193 HG22 VAL B 374 35.983 22.308 63.764 1.00 0.00 H ATOM 11194 HG23 VAL B 374 36.746 22.206 62.158 1.00 0.00 H ATOM 11195 H VAL B 374 36.777 23.368 65.736 1.00 0.00 H ATOM 11196 N THR B 375 40.310 21.018 66.187 1.00 11.33 N ATOM 11197 CA THR B 375 41.576 21.167 66.884 1.00 11.01 C ATOM 11198 C THR B 375 42.777 20.734 66.071 1.00 12.71 C ATOM 11199 O THR B 375 43.909 20.847 66.547 1.00 14.60 O ATOM 11200 CB THR B 375 41.574 20.432 68.233 1.00 12.92 C ATOM 11201 OG1 THR B 375 41.218 19.069 67.992 1.00 15.00 O ATOM 11202 CG2 THR B 375 40.502 21.033 69.185 1.00 14.92 C ATOM 11203 HA THR B 375 41.674 22.239 67.056 1.00 0.00 H ATOM 11204 HB THR B 375 42.559 20.525 68.690 1.00 0.00 H ATOM 11205 HG1 THR B 375 41.880 18.660 67.380 1.00 0.00 H ATOM 11206 HG23 THR B 375 40.744 22.076 69.390 1.00 0.00 H ATOM 11207 HG21 THR B 375 39.522 20.972 68.711 1.00 0.00 H ATOM 11208 HG22 THR B 375 40.491 20.471 70.119 1.00 0.00 H ATOM 11209 H THR B 375 39.977 20.066 65.934 1.00 0.00 H ATOM 11210 N GLU B 376 42.559 20.282 64.846 1.00 13.23 N ATOM 11211 CA GLU B 376 43.649 19.967 63.934 1.00 14.41 C ATOM 11212 C GLU B 376 43.302 20.581 62.604 1.00 12.39 C ATOM 11213 O GLU B 376 42.130 20.569 62.207 1.00 13.57 O ATOM 11214 CB GLU B 376 43.808 18.453 63.726 1.00 18.82 C ATOM 11215 CG GLU B 376 44.188 17.653 64.950 1.00 24.94 C ATOM 11216 CD GLU B 376 43.007 17.335 65.884 1.00 28.45 C ATOM 11217 OE1 GLU B 376 41.950 16.844 65.403 1.00 30.86 O ATOM 11218 OE2 GLU B 376 43.151 17.552 67.114 1.00 29.46 O ATOM 11219 HA GLU B 376 44.580 20.351 64.351 1.00 0.00 H ATOM 11220 HB2 GLU B 376 42.859 18.065 63.355 1.00 0.00 H ATOM 11221 HB3 GLU B 376 44.581 18.299 62.973 1.00 0.00 H ATOM 11222 HG2 GLU B 376 44.628 16.712 64.621 1.00 0.00 H ATOM 11223 HG3 GLU B 376 44.928 18.221 65.514 1.00 0.00 H ATOM 11224 H GLU B 376 41.579 20.148 64.525 1.00 0.00 H ATOM 11225 N THR B 377 44.300 21.097 61.894 1.00 11.60 N ATOM 11226 CA THR B 377 44.041 21.661 60.559 1.00 11.91 C ATOM 11227 C THR B 377 43.332 20.626 59.697 1.00 12.00 C ATOM 11228 O THR B 377 43.755 19.461 59.645 1.00 13.39 O ATOM 11229 CB THR B 377 45.380 22.041 59.917 1.00 12.65 C ATOM 11230 OG1 THR B 377 46.026 22.963 60.812 1.00 13.76 O ATOM 11231 CG2 THR B 377 45.148 22.739 58.586 1.00 13.24 C ATOM 11232 HA THR B 377 43.408 22.545 60.644 1.00 0.00 H ATOM 11233 HB THR B 377 45.983 21.150 59.744 1.00 0.00 H ATOM 11234 HG1 THR B 377 46.899 23.234 60.431 1.00 0.00 H ATOM 11235 HG23 THR B 377 44.658 22.051 57.897 1.00 0.00 H ATOM 11236 HG21 THR B 377 44.515 23.612 58.741 1.00 0.00 H ATOM 11237 HG22 THR B 377 46.105 23.052 58.170 1.00 0.00 H ATOM 11238 H THR B 377 45.265 21.102 62.282 1.00 0.00 H ATOM 11239 N THR B 378 42.254 21.040 59.033 1.00 11.44 N ATOM 11240 CA THR B 378 41.395 20.105 58.312 1.00 11.79 C ATOM 11241 C THR B 378 41.123 20.642 56.923 1.00 11.55 C ATOM 11242 O THR B 378 40.559 21.711 56.799 1.00 12.01 O ATOM 11243 CB THR B 378 40.059 19.949 59.096 1.00 13.40 C ATOM 11244 OG1 THR B 378 40.365 19.423 60.404 1.00 14.92 O ATOM 11245 CG2 THR B 378 39.060 19.012 58.382 1.00 15.58 C ATOM 11246 HA THR B 378 41.883 19.134 58.225 1.00 0.00 H ATOM 11247 HB THR B 378 39.583 20.927 59.162 1.00 0.00 H ATOM 11248 HG1 THR B 378 40.968 20.050 60.878 1.00 0.00 H ATOM 11249 HG23 THR B 378 38.831 19.412 57.394 1.00 0.00 H ATOM 11250 HG21 THR B 378 39.502 18.021 58.280 1.00 0.00 H ATOM 11251 HG22 THR B 378 38.144 18.944 58.969 1.00 0.00 H ATOM 11252 H THR B 378 42.019 22.053 59.028 1.00 0.00 H ATOM 11253 N ASP B 379 41.483 19.898 55.875 1.00 11.63 N ATOM 11254 CA ASP B 379 41.066 20.292 54.528 1.00 12.84 C ATOM 11255 C ASP B 379 39.582 20.043 54.333 1.00 11.43 C ATOM 11256 O ASP B 379 39.079 18.943 54.613 1.00 13.73 O ATOM 11257 CB ASP B 379 41.852 19.528 53.455 1.00 15.26 C ATOM 11258 CG ASP B 379 43.313 19.924 53.402 1.00 18.88 C ATOM 11259 OD1 ASP B 379 43.627 21.136 53.557 1.00 20.47 O ATOM 11260 OD2 ASP B 379 44.151 19.016 53.198 1.00 22.89 O ATOM 11261 HA ASP B 379 41.273 21.357 54.423 1.00 0.00 H ATOM 11262 HB2 ASP B 379 41.788 18.461 53.670 1.00 0.00 H ATOM 11263 HB3 ASP B 379 41.401 19.730 52.483 1.00 0.00 H ATOM 11264 H ASP B 379 42.057 19.042 56.015 1.00 0.00 H ATOM 11265 N ARG B 380 38.887 21.066 53.860 1.00 10.49 N ATOM 11266 CA ARG B 380 37.437 20.968 53.681 1.00 10.76 C ATOM 11267 C ARG B 380 37.047 22.005 52.663 1.00 10.35 C ATOM 11268 O ARG B 380 37.457 23.163 52.772 1.00 10.81 O ATOM 11269 CB ARG B 380 36.669 21.175 54.991 1.00 12.30 C ATOM 11270 CG ARG B 380 35.158 20.927 54.794 1.00 12.63 C ATOM 11271 CD ARG B 380 34.445 20.785 56.122 1.00 14.24 C ATOM 11272 NE ARG B 380 34.873 19.557 56.814 1.00 14.94 N ATOM 11273 CZ ARG B 380 34.402 19.159 57.988 1.00 15.50 C ATOM 11274 NH1 ARG B 380 33.495 19.906 58.617 1.00 18.03 N ATOM 11275 NH2 ARG B 380 34.823 17.985 58.511 1.00 18.53 N ATOM 11276 HA ARG B 380 37.178 19.965 53.343 1.00 0.00 H ATOM 11277 HB2 ARG B 380 37.049 20.481 55.741 1.00 0.00 H ATOM 11278 HB3 ARG B 380 36.820 22.198 55.335 1.00 0.00 H ATOM 11279 HG2 ARG B 380 34.728 21.767 54.248 1.00 0.00 H ATOM 11280 HG3 ARG B 380 35.020 20.012 54.217 1.00 0.00 H ATOM 11281 HD2 ARG B 380 33.370 20.742 55.948 1.00 0.00 H ATOM 11282 HD3 ARG B 380 34.677 21.648 56.747 1.00 0.00 H ATOM 11283 HE ARG B 380 35.591 18.964 56.352 1.00 0.00 H ATOM 11284 HH12 ARG B 380 33.120 19.602 59.538 1.00 0.00 H ATOM 11285 HH11 ARG B 380 33.163 20.793 58.187 1.00 0.00 H ATOM 11286 HH22 ARG B 380 34.459 17.665 59.431 1.00 0.00 H ATOM 11287 HH21 ARG B 380 35.511 17.402 57.993 1.00 0.00 H ATOM 11288 H ARG B 380 39.377 21.950 53.613 1.00 0.00 H ATOM 11289 N GLU B 381 36.226 21.609 51.688 1.00 11.36 N ATOM 11290 CA GLU B 381 35.687 22.558 50.709 1.00 12.26 C ATOM 11291 C GLU B 381 34.559 23.383 51.319 1.00 13.66 C ATOM 11292 O GLU B 381 33.409 22.944 51.392 1.00 22.04 O ATOM 11293 CB GLU B 381 35.239 21.823 49.441 1.00 13.63 C ATOM 11294 CG GLU B 381 34.989 22.778 48.306 1.00 16.85 C ATOM 11295 CD GLU B 381 34.483 22.047 47.100 1.00 17.85 C ATOM 11296 OE1 GLU B 381 35.271 21.314 46.470 1.00 19.92 O ATOM 11297 OE2 GLU B 381 33.295 22.271 46.798 1.00 23.58 O ATOM 11298 HA GLU B 381 36.476 23.254 50.424 1.00 0.00 H ATOM 11299 HB2 GLU B 381 36.017 21.119 49.146 1.00 0.00 H ATOM 11300 HB3 GLU B 381 34.319 21.278 49.654 1.00 0.00 H ATOM 11301 HG2 GLU B 381 34.248 23.515 48.615 1.00 0.00 H ATOM 11302 HG3 GLU B 381 35.920 23.285 48.053 1.00 0.00 H ATOM 11303 H GLU B 381 35.963 20.605 51.621 1.00 0.00 H ATOM 11304 N LEU B 382 34.878 24.530 51.854 1.00 11.93 N ATOM 11305 CA LEU B 382 33.898 25.403 52.468 1.00 10.59 C ATOM 11306 C LEU B 382 33.189 26.245 51.415 1.00 10.95 C ATOM 11307 O LEU B 382 33.783 26.606 50.379 1.00 12.32 O ATOM 11308 CB LEU B 382 34.638 26.329 53.451 1.00 10.10 C ATOM 11309 CG LEU B 382 35.525 25.667 54.510 1.00 10.39 C ATOM 11310 CD1 LEU B 382 36.238 26.762 55.304 1.00 11.49 C ATOM 11311 CD2 LEU B 382 34.641 24.787 55.430 1.00 12.33 C ATOM 11312 HA LEU B 382 33.148 24.805 52.985 1.00 0.00 H ATOM 11313 HB2 LEU B 382 35.271 26.993 52.862 1.00 0.00 H ATOM 11314 HB3 LEU B 382 33.886 26.918 53.976 1.00 0.00 H ATOM 11315 HG LEU B 382 36.277 25.028 54.046 1.00 0.00 H ATOM 11316 HD21 LEU B 382 33.891 25.411 55.916 1.00 0.00 H ATOM 11317 HD22 LEU B 382 34.147 24.021 54.832 1.00 0.00 H ATOM 11318 HD23 LEU B 382 35.266 24.312 56.187 1.00 0.00 H ATOM 11319 HD11 LEU B 382 36.850 27.360 54.628 1.00 0.00 H ATOM 11320 HD12 LEU B 382 35.497 27.400 55.786 1.00 0.00 H ATOM 11321 HD13 LEU B 382 36.873 26.304 56.062 1.00 0.00 H ATOM 11322 H LEU B 382 35.874 24.829 51.839 1.00 0.00 H ATOM 11323 N THR B 383 31.957 26.613 51.717 1.00 10.69 N ATOM 11324 CA THR B 383 31.192 27.535 50.840 1.00 11.61 C ATOM 11325 C THR B 383 30.765 28.812 51.563 1.00 9.85 C ATOM 11326 O THR B 383 30.801 29.896 50.952 1.00 10.15 O ATOM 11327 CB THR B 383 29.942 26.827 50.295 1.00 13.30 C ATOM 11328 OG1 THR B 383 30.368 25.680 49.557 1.00 16.30 O ATOM 11329 CG2 THR B 383 29.141 27.695 49.334 1.00 14.98 C ATOM 11330 HA THR B 383 31.857 27.818 50.024 1.00 0.00 H ATOM 11331 HB THR B 383 29.311 26.581 51.149 1.00 0.00 H ATOM 11332 HG1 THR B 383 30.871 25.072 50.155 1.00 0.00 H ATOM 11333 HG23 THR B 383 28.793 28.587 49.856 1.00 0.00 H ATOM 11334 HG21 THR B 383 29.774 27.986 48.496 1.00 0.00 H ATOM 11335 HG22 THR B 383 28.284 27.131 48.965 1.00 0.00 H ATOM 11336 H THR B 383 31.514 26.250 52.585 1.00 0.00 H ATOM 11337 N THR B 384 30.335 28.686 52.827 1.00 9.72 N ATOM 11338 CA THR B 384 29.807 29.826 53.592 1.00 10.09 C ATOM 11339 C THR B 384 30.469 29.821 54.949 1.00 9.91 C ATOM 11340 O THR B 384 30.477 28.798 55.631 1.00 10.75 O ATOM 11341 CB THR B 384 28.239 29.717 53.766 1.00 10.81 C ATOM 11342 OG1 THR B 384 27.635 29.391 52.519 1.00 11.95 O ATOM 11343 CG2 THR B 384 27.603 31.000 54.260 1.00 11.37 C ATOM 11344 HA THR B 384 30.019 30.752 53.058 1.00 0.00 H ATOM 11345 HB THR B 384 28.072 28.940 54.512 1.00 0.00 H ATOM 11346 HG1 THR B 384 26.654 29.325 52.636 1.00 0.00 H ATOM 11347 HG23 THR B 384 28.045 31.278 55.217 1.00 0.00 H ATOM 11348 HG21 THR B 384 27.777 31.794 53.533 1.00 0.00 H ATOM 11349 HG22 THR B 384 26.531 30.848 54.384 1.00 0.00 H ATOM 11350 H THR B 384 30.376 27.751 53.281 1.00 0.00 H ATOM 11351 N VAL B 385 30.968 30.987 55.340 1.00 9.57 N ATOM 11352 CA VAL B 385 31.625 31.131 56.644 1.00 10.00 C ATOM 11353 C VAL B 385 31.060 32.306 57.427 1.00 8.49 C ATOM 11354 O VAL B 385 30.514 33.247 56.831 1.00 10.41 O ATOM 11355 CB VAL B 385 33.187 31.259 56.512 1.00 10.24 C ATOM 11356 CG1 VAL B 385 33.741 30.035 55.779 1.00 13.23 C ATOM 11357 CG2 VAL B 385 33.579 32.548 55.796 1.00 11.56 C ATOM 11358 HA VAL B 385 31.415 30.216 57.198 1.00 0.00 H ATOM 11359 HB VAL B 385 33.620 31.301 57.512 1.00 0.00 H ATOM 11360 HG11 VAL B 385 33.497 29.134 56.342 1.00 0.00 H ATOM 11361 HG12 VAL B 385 33.296 29.976 54.786 1.00 0.00 H ATOM 11362 HG13 VAL B 385 34.823 30.126 55.689 1.00 0.00 H ATOM 11363 HG21 VAL B 385 33.144 32.554 54.796 1.00 0.00 H ATOM 11364 HG22 VAL B 385 33.207 33.403 56.360 1.00 0.00 H ATOM 11365 HG23 VAL B 385 34.665 32.605 55.722 1.00 0.00 H ATOM 11366 H VAL B 385 30.892 31.812 54.712 1.00 0.00 H ATOM 11367 N MET B 386 31.188 32.226 58.747 1.00 9.67 N ATOM 11368 CA MET B 386 30.669 33.264 59.633 1.00 9.76 C ATOM 11369 C MET B 386 31.770 33.671 60.584 1.00 9.31 C ATOM 11370 O MET B 386 32.544 32.844 61.045 1.00 10.53 O ATOM 11371 CB MET B 386 29.472 32.707 60.437 1.00 9.78 C ATOM 11372 CG MET B 386 28.928 33.659 61.530 1.00 11.55 C ATOM 11373 SD MET B 386 27.511 32.963 62.485 1.00 15.41 S ATOM 11374 CE MET B 386 26.347 33.390 61.347 1.00 14.06 C ATOM 11375 HA MET B 386 30.337 34.124 59.051 1.00 0.00 H ATOM 11376 HB2 MET B 386 28.663 32.494 59.738 1.00 0.00 H ATOM 11377 HB3 MET B 386 29.787 31.781 60.919 1.00 0.00 H ATOM 11378 HG2 MET B 386 28.600 34.581 61.051 1.00 0.00 H ATOM 11379 HG3 MET B 386 29.737 33.881 62.227 1.00 0.00 H ATOM 11380 HE1 MET B 386 26.352 34.472 61.213 1.00 0.00 H ATOM 11381 HE2 MET B 386 26.573 32.904 60.398 1.00 0.00 H ATOM 11382 HE3 MET B 386 25.365 33.070 61.696 1.00 0.00 H ATOM 11383 H MET B 386 31.671 31.402 59.160 1.00 0.00 H ATOM 11384 N SER B 387 31.813 34.969 60.913 1.00 8.82 N ATOM 11385 CA SER B 387 32.785 35.466 61.878 1.00 8.43 C ATOM 11386 C SER B 387 32.115 36.412 62.863 1.00 7.97 C ATOM 11387 O SER B 387 31.434 37.360 62.445 1.00 8.59 O ATOM 11388 CB SER B 387 33.919 36.164 61.128 1.00 10.08 C ATOM 11389 OG SER B 387 34.873 36.683 62.017 1.00 10.89 O ATOM 11390 HA SER B 387 33.197 34.634 62.448 1.00 0.00 H ATOM 11391 HB2 SER B 387 33.504 36.979 60.535 1.00 0.00 H ATOM 11392 HB3 SER B 387 34.403 35.445 60.467 1.00 0.00 H ATOM 11393 HG SER B 387 35.593 37.128 61.504 1.00 0.00 H ATOM 11394 H SER B 387 31.143 35.632 60.473 1.00 0.00 H ATOM 11395 N ASN B 388 32.264 36.124 64.166 1.00 7.66 N ATOM 11396 CA ASN B 388 31.630 36.903 65.225 1.00 8.22 C ATOM 11397 C ASN B 388 32.587 37.871 65.906 1.00 9.02 C ATOM 11398 O ASN B 388 33.728 37.496 66.211 1.00 9.63 O ATOM 11399 CB ASN B 388 31.105 35.985 66.325 1.00 10.41 C ATOM 11400 CG ASN B 388 29.863 35.225 65.936 1.00 10.55 C ATOM 11401 OD1 ASN B 388 29.103 35.648 65.058 1.00 11.87 O ATOM 11402 ND2 ASN B 388 29.614 34.138 66.643 1.00 11.82 N ATOM 11403 HA ASN B 388 30.831 37.458 64.733 1.00 0.00 H ATOM 11404 HB2 ASN B 388 31.885 35.266 66.575 1.00 0.00 H ATOM 11405 HB3 ASN B 388 30.877 36.592 67.201 1.00 0.00 H ATOM 11406 HD22 ASN B 388 30.288 33.825 67.371 1.00 0.00 H ATOM 11407 HD21 ASN B 388 28.744 33.594 66.472 1.00 0.00 H ATOM 11408 H ASN B 388 32.856 35.311 64.432 1.00 0.00 H ATOM 11409 N SER B 389 32.100 39.076 66.234 1.00 9.61 N ATOM 11410 CA SER B 389 32.890 40.047 67.003 1.00 10.24 C ATOM 11411 C SER B 389 31.984 40.673 68.046 1.00 12.02 C ATOM 11412 O SER B 389 31.070 41.414 67.711 1.00 13.35 O ATOM 11413 CB SER B 389 33.432 41.144 66.071 1.00 12.90 C ATOM 11414 OG SER B 389 34.141 40.553 64.987 1.00 13.32 O ATOM 11415 HA SER B 389 33.733 39.546 67.479 1.00 0.00 H ATOM 11416 HB2 SER B 389 34.104 41.795 66.631 1.00 0.00 H ATOM 11417 HB3 SER B 389 32.600 41.731 65.682 1.00 0.00 H ATOM 11418 HG SER B 389 34.897 40.021 65.340 1.00 0.00 H ATOM 11419 H SER B 389 31.137 39.330 65.936 1.00 0.00 H ATOM 11420 N PHE B 390 32.217 40.374 69.314 1.00 15.28 N ATOM 11421 CA PHE B 390 31.280 40.792 70.350 1.00 18.67 C ATOM 11422 C PHE B 390 32.046 41.649 71.341 1.00 19.79 C ATOM 11423 O PHE B 390 32.709 41.103 72.216 1.00 22.91 O ATOM 11424 CB PHE B 390 30.644 39.577 71.051 1.00 18.66 C ATOM 11425 CG PHE B 390 29.885 38.638 70.132 1.00 19.11 C ATOM 11426 CD1 PHE B 390 29.078 39.121 69.115 1.00 20.19 C ATOM 11427 CD2 PHE B 390 29.954 37.244 70.307 1.00 17.76 C ATOM 11428 CE1 PHE B 390 28.371 38.244 68.265 1.00 19.82 C ATOM 11429 CE2 PHE B 390 29.230 36.394 69.482 1.00 19.17 C ATOM 11430 CZ PHE B 390 28.432 36.899 68.473 1.00 18.88 C ATOM 11431 HA PHE B 390 30.462 41.361 69.907 1.00 0.00 H ATOM 11432 HB2 PHE B 390 31.439 39.010 71.535 1.00 0.00 H ATOM 11433 HB3 PHE B 390 29.951 39.946 71.807 1.00 0.00 H ATOM 11434 HD2 PHE B 390 30.580 36.828 71.096 1.00 0.00 H ATOM 11435 HE2 PHE B 390 29.292 35.316 69.632 1.00 0.00 H ATOM 11436 HZ PHE B 390 27.853 36.222 67.845 1.00 0.00 H ATOM 11437 HE1 PHE B 390 27.777 38.642 67.443 1.00 0.00 H ATOM 11438 HD1 PHE B 390 28.987 40.197 68.969 1.00 0.00 H ATOM 11439 H PHE B 390 33.071 39.839 69.572 1.00 0.00 H ATOM 11440 N GLY B 391 31.945 42.977 71.199 1.00 17.73 N ATOM 11441 CA GLY B 391 32.753 43.947 71.916 1.00 17.11 C ATOM 11442 C GLY B 391 32.274 44.406 73.283 1.00 15.41 C ATOM 11443 O GLY B 391 31.060 44.403 73.559 1.00 14.45 O ATOM 11444 HA3 GLY B 391 32.831 44.833 71.286 1.00 0.00 H ATOM 11445 HA2 GLY B 391 33.742 43.509 72.049 1.00 0.00 H ATOM 11446 H GLY B 391 31.238 43.339 70.528 1.00 0.00 H ATOM 11447 N PHE B 392 33.212 44.868 74.106 1.00 17.41 N ATOM 11448 CA PHE B 392 32.863 45.578 75.356 1.00 19.80 C ATOM 11449 C PHE B 392 31.865 46.662 75.091 1.00 18.35 C ATOM 11450 O PHE B 392 31.935 47.342 74.059 1.00 18.95 O ATOM 11451 CB PHE B 392 34.016 46.356 75.978 1.00 25.44 C ATOM 11452 CG PHE B 392 34.974 45.558 76.783 1.00 26.83 C ATOM 11453 CD1 PHE B 392 36.115 46.187 77.276 1.00 30.14 C ATOM 11454 CD2 PHE B 392 34.793 44.203 77.038 1.00 29.59 C ATOM 11455 CE1 PHE B 392 37.045 45.487 78.008 1.00 30.70 C ATOM 11456 CE2 PHE B 392 35.729 43.492 77.777 1.00 29.99 C ATOM 11457 CZ PHE B 392 36.853 44.128 78.256 1.00 30.65 C ATOM 11458 HA PHE B 392 32.517 44.776 76.008 1.00 0.00 H ATOM 11459 HB2 PHE B 392 34.572 46.832 75.171 1.00 0.00 H ATOM 11460 HB3 PHE B 392 33.591 47.123 76.626 1.00 0.00 H ATOM 11461 HD2 PHE B 392 33.908 43.695 76.654 1.00 0.00 H ATOM 11462 HE2 PHE B 392 35.575 42.432 77.978 1.00 0.00 H ATOM 11463 HZ PHE B 392 37.593 43.569 78.829 1.00 0.00 H ATOM 11464 HE1 PHE B 392 37.930 45.993 78.394 1.00 0.00 H ATOM 11465 HD1 PHE B 392 36.273 47.247 77.079 1.00 0.00 H ATOM 11466 H PHE B 392 34.214 44.727 73.865 1.00 0.00 H ATOM 11467 N GLY B 393 30.948 46.867 76.032 1.00 18.86 N ATOM 11468 CA GLY B 393 29.872 47.798 75.842 1.00 17.67 C ATOM 11469 C GLY B 393 28.657 47.134 75.226 1.00 16.84 C ATOM 11470 O GLY B 393 27.696 47.808 74.853 1.00 18.62 O ATOM 11471 HA3 GLY B 393 30.209 48.598 75.183 1.00 0.00 H ATOM 11472 HA2 GLY B 393 29.593 48.218 76.808 1.00 0.00 H ATOM 11473 H GLY B 393 31.012 46.340 76.927 1.00 0.00 H ATOM 11474 N GLY B 394 28.690 45.803 75.076 1.00 13.93 N ATOM 11475 CA GLY B 394 27.539 45.076 74.585 1.00 13.37 C ATOM 11476 C GLY B 394 27.285 45.360 73.127 1.00 12.70 C ATOM 11477 O GLY B 394 26.149 45.402 72.707 1.00 17.65 O ATOM 11478 HA3 GLY B 394 26.662 45.370 75.161 1.00 0.00 H ATOM 11479 HA2 GLY B 394 27.714 44.008 74.712 1.00 0.00 H ATOM 11480 H GLY B 394 29.558 45.283 75.317 1.00 0.00 H ATOM 11481 N THR B 395 28.334 45.542 72.330 1.00 10.00 N ATOM 11482 CA THR B 395 28.148 45.813 70.911 1.00 10.23 C ATOM 11483 C THR B 395 28.558 44.608 70.078 1.00 9.91 C ATOM 11484 O THR B 395 29.667 44.085 70.229 1.00 13.17 O ATOM 11485 CB THR B 395 28.914 47.068 70.524 1.00 11.26 C ATOM 11486 OG1 THR B 395 28.745 47.272 69.127 1.00 13.25 O ATOM 11487 CG2 THR B 395 30.418 47.004 70.854 1.00 13.44 C ATOM 11488 HA THR B 395 27.092 45.992 70.709 1.00 0.00 H ATOM 11489 HB THR B 395 28.511 47.894 71.110 1.00 0.00 H ATOM 11490 HG1 THR B 395 27.782 47.382 68.925 1.00 0.00 H ATOM 11491 HG23 THR B 395 30.547 46.848 71.925 1.00 0.00 H ATOM 11492 HG21 THR B 395 30.874 46.179 70.307 1.00 0.00 H ATOM 11493 HG22 THR B 395 30.893 47.941 70.562 1.00 0.00 H ATOM 11494 H THR B 395 29.295 45.490 72.723 1.00 0.00 H ATOM 11495 N ASN B 396 27.682 44.163 69.183 1.00 9.25 N ATOM 11496 CA ASN B 396 27.907 42.916 68.474 1.00 9.29 C ATOM 11497 C ASN B 396 27.901 43.113 66.989 1.00 8.32 C ATOM 11498 O ASN B 396 27.070 43.877 66.461 1.00 9.31 O ATOM 11499 CB ASN B 396 26.752 41.976 68.791 1.00 10.94 C ATOM 11500 CG ASN B 396 26.567 41.820 70.291 1.00 12.55 C ATOM 11501 OD1 ASN B 396 27.530 41.458 70.980 1.00 13.81 O ATOM 11502 ND2 ASN B 396 25.363 42.046 70.796 1.00 12.12 N ATOM 11503 HA ASN B 396 28.875 42.523 68.785 1.00 0.00 H ATOM 11504 HB2 ASN B 396 25.836 42.379 68.359 1.00 0.00 H ATOM 11505 HB3 ASN B 396 26.958 40.999 68.354 1.00 0.00 H ATOM 11506 HD22 ASN B 396 24.587 42.349 70.174 1.00 0.00 H ATOM 11507 HD21 ASN B 396 25.194 41.920 71.815 1.00 0.00 H ATOM 11508 H ASN B 396 26.823 44.716 68.988 1.00 0.00 H ATOM 11509 N ALA B 397 28.795 42.392 66.321 1.00 8.71 N ATOM 11510 CA ALA B 397 28.805 42.339 64.845 1.00 9.26 C ATOM 11511 C ALA B 397 29.029 40.918 64.402 1.00 8.35 C ATOM 11512 O ALA B 397 29.830 40.191 65.019 1.00 10.31 O ATOM 11513 CB ALA B 397 29.929 43.250 64.252 1.00 10.38 C ATOM 11514 HA ALA B 397 27.844 42.702 64.481 1.00 0.00 H ATOM 11515 HB1 ALA B 397 29.760 44.281 64.562 1.00 0.00 H ATOM 11516 HB2 ALA B 397 30.899 42.913 64.618 1.00 0.00 H ATOM 11517 HB3 ALA B 397 29.909 43.188 63.164 1.00 0.00 H ATOM 11518 H ALA B 397 29.507 41.850 66.852 1.00 0.00 H ATOM 11519 N THR B 398 28.346 40.521 63.344 1.00 9.01 N ATOM 11520 CA THR B 398 28.610 39.204 62.725 1.00 8.76 C ATOM 11521 C THR B 398 28.678 39.452 61.214 1.00 8.85 C ATOM 11522 O THR B 398 27.851 40.190 60.658 1.00 9.42 O ATOM 11523 CB THR B 398 27.453 38.199 63.021 1.00 10.70 C ATOM 11524 OG1 THR B 398 27.407 37.924 64.427 1.00 11.00 O ATOM 11525 CG2 THR B 398 27.638 36.876 62.292 1.00 11.72 C ATOM 11526 HA THR B 398 29.530 38.775 63.122 1.00 0.00 H ATOM 11527 HB THR B 398 26.530 38.663 62.674 1.00 0.00 H ATOM 11528 HG1 THR B 398 28.269 37.530 64.713 1.00 0.00 H ATOM 11529 HG23 THR B 398 27.676 37.057 61.218 1.00 0.00 H ATOM 11530 HG21 THR B 398 28.569 36.411 62.617 1.00 0.00 H ATOM 11531 HG22 THR B 398 26.801 36.216 62.521 1.00 0.00 H ATOM 11532 H THR B 398 27.614 41.141 62.942 1.00 0.00 H ATOM 11533 N LEU B 399 29.621 38.780 60.549 1.00 8.04 N ATOM 11534 CA LEU B 399 29.710 38.794 59.085 1.00 7.97 C ATOM 11535 C LEU B 399 29.537 37.393 58.555 1.00 7.52 C ATOM 11536 O LEU B 399 30.111 36.473 59.122 1.00 8.54 O ATOM 11537 CB LEU B 399 31.067 39.375 58.665 1.00 9.29 C ATOM 11538 CG LEU B 399 31.295 40.846 59.020 1.00 9.41 C ATOM 11539 CD1 LEU B 399 32.767 41.218 58.849 1.00 11.84 C ATOM 11540 CD2 LEU B 399 30.389 41.749 58.162 1.00 12.11 C ATOM 11541 HA LEU B 399 28.920 39.419 58.669 1.00 0.00 H ATOM 11542 HB2 LEU B 399 31.848 38.788 59.149 1.00 0.00 H ATOM 11543 HB3 LEU B 399 31.155 39.273 57.583 1.00 0.00 H ATOM 11544 HG LEU B 399 31.032 40.999 60.067 1.00 0.00 H ATOM 11545 HD21 LEU B 399 30.620 41.597 57.108 1.00 0.00 H ATOM 11546 HD22 LEU B 399 29.345 41.495 58.347 1.00 0.00 H ATOM 11547 HD23 LEU B 399 30.563 42.792 58.426 1.00 0.00 H ATOM 11548 HD11 LEU B 399 33.376 40.597 59.506 1.00 0.00 H ATOM 11549 HD12 LEU B 399 33.064 41.054 57.813 1.00 0.00 H ATOM 11550 HD13 LEU B 399 32.907 42.268 59.106 1.00 0.00 H ATOM 11551 H LEU B 399 30.317 38.227 61.088 1.00 0.00 H ATOM 11552 N VAL B 400 28.792 37.280 57.461 1.00 8.26 N ATOM 11553 CA VAL B 400 28.684 35.993 56.762 1.00 8.08 C ATOM 11554 C VAL B 400 29.183 36.204 55.344 1.00 8.80 C ATOM 11555 O VAL B 400 28.727 37.125 54.656 1.00 9.63 O ATOM 11556 CB VAL B 400 27.243 35.427 56.795 1.00 9.71 C ATOM 11557 CG1 VAL B 400 27.132 34.102 56.023 1.00 10.13 C ATOM 11558 CG2 VAL B 400 26.830 35.197 58.255 1.00 11.02 C ATOM 11559 HA VAL B 400 29.294 35.243 57.266 1.00 0.00 H ATOM 11560 HB VAL B 400 26.583 36.150 56.316 1.00 0.00 H ATOM 11561 HG11 VAL B 400 27.413 34.265 54.982 1.00 0.00 H ATOM 11562 HG12 VAL B 400 27.800 33.366 56.470 1.00 0.00 H ATOM 11563 HG13 VAL B 400 26.105 33.740 56.071 1.00 0.00 H ATOM 11564 HG21 VAL B 400 27.515 34.487 58.718 1.00 0.00 H ATOM 11565 HG22 VAL B 400 26.866 36.143 58.795 1.00 0.00 H ATOM 11566 HG23 VAL B 400 25.816 34.798 58.286 1.00 0.00 H ATOM 11567 H VAL B 400 28.281 38.109 57.097 1.00 0.00 H ATOM 11568 N MET B 401 30.093 35.324 54.917 1.00 8.73 N ATOM 11569 CA MET B 401 30.753 35.463 53.639 1.00 10.36 C ATOM 11570 C MET B 401 30.615 34.168 52.869 1.00 9.51 C ATOM 11571 O MET B 401 30.728 33.091 53.464 1.00 10.20 O ATOM 11572 CB MET B 401 32.226 35.797 53.851 1.00 12.33 C ATOM 11573 CG MET B 401 32.266 37.211 54.492 1.00 12.51 C ATOM 11574 SD MET B 401 33.871 37.828 54.943 1.00 11.31 S ATOM 11575 CE MET B 401 34.518 36.599 56.086 1.00 12.69 C ATOM 11576 HA MET B 401 30.292 36.272 53.072 1.00 0.00 H ATOM 11577 HB2 MET B 401 32.686 35.067 54.517 1.00 0.00 H ATOM 11578 HB3 MET B 401 32.754 35.800 52.897 1.00 0.00 H ATOM 11579 HG2 MET B 401 31.655 37.184 55.394 1.00 0.00 H ATOM 11580 HG3 MET B 401 31.829 37.911 53.780 1.00 0.00 H ATOM 11581 HE1 MET B 401 33.854 36.521 56.947 1.00 0.00 H ATOM 11582 HE2 MET B 401 34.579 35.634 55.583 1.00 0.00 H ATOM 11583 HE3 MET B 401 35.512 36.901 56.418 1.00 0.00 H ATOM 11584 H MET B 401 30.334 34.514 55.523 1.00 0.00 H ATOM 11585 N ARG B 402 30.338 34.273 51.565 1.00 8.68 N ATOM 11586 CA ARG B 402 30.017 33.087 50.801 1.00 9.57 C ATOM 11587 C ARG B 402 30.676 33.132 49.432 1.00 10.16 C ATOM 11588 O ARG B 402 30.710 34.202 48.811 1.00 10.87 O ATOM 11589 CB ARG B 402 28.491 32.994 50.635 1.00 11.94 C ATOM 11590 CG ARG B 402 28.046 31.693 49.907 1.00 12.67 C ATOM 11591 CD ARG B 402 26.565 31.487 50.054 1.00 13.53 C ATOM 11592 NE ARG B 402 25.756 32.477 49.360 1.00 14.20 N ATOM 11593 CZ ARG B 402 24.429 32.525 49.506 1.00 15.41 C ATOM 11594 NH1 ARG B 402 23.830 31.669 50.340 1.00 16.47 N ATOM 11595 NH2 ARG B 402 23.708 33.387 48.805 1.00 17.02 N ATOM 11596 HA ARG B 402 30.390 32.212 51.334 1.00 0.00 H ATOM 11597 HB2 ARG B 402 28.030 33.017 51.623 1.00 0.00 H ATOM 11598 HB3 ARG B 402 28.150 33.852 50.056 1.00 0.00 H ATOM 11599 HG2 ARG B 402 28.294 31.771 48.849 1.00 0.00 H ATOM 11600 HG3 ARG B 402 28.571 30.842 50.340 1.00 0.00 H ATOM 11601 HD2 ARG B 402 26.317 31.525 51.115 1.00 0.00 H ATOM 11602 HD3 ARG B 402 26.315 30.502 49.659 1.00 0.00 H ATOM 11603 HE ARG B 402 26.222 33.165 48.735 1.00 0.00 H ATOM 11604 HH12 ARG B 402 22.797 31.698 50.461 1.00 0.00 H ATOM 11605 HH11 ARG B 402 24.397 30.974 50.868 1.00 0.00 H ATOM 11606 HH22 ARG B 402 22.675 33.419 48.924 1.00 0.00 H ATOM 11607 HH21 ARG B 402 24.175 34.032 48.136 1.00 0.00 H ATOM 11608 H ARG B 402 30.353 35.204 51.102 1.00 0.00 H ATOM 11609 N LYS B 403 31.123 31.986 48.938 1.00 11.31 N ATOM 11610 CA LYS B 403 31.642 31.955 47.570 1.00 12.72 C ATOM 11611 C LYS B 403 30.583 32.441 46.577 1.00 15.05 C ATOM 11612 O LYS B 403 29.367 32.263 46.766 1.00 16.96 O ATOM 11613 CB LYS B 403 32.063 30.545 47.181 1.00 16.55 C ATOM 11614 CG LYS B 403 33.413 30.211 47.735 1.00 18.08 C ATOM 11615 CD LYS B 403 33.858 28.823 47.357 1.00 20.46 C ATOM 11616 CE LYS B 403 35.229 28.638 47.872 1.00 19.94 C ATOM 11617 NZ LYS B 403 36.273 29.487 47.194 1.00 20.78 N ATOM 11618 HA LYS B 403 32.508 32.616 47.536 1.00 0.00 H ATOM 11619 HB2 LYS B 403 31.333 29.835 47.570 1.00 0.00 H ATOM 11620 HB3 LYS B 403 32.096 30.471 46.094 1.00 0.00 H ATOM 11621 HG2 LYS B 403 34.138 30.929 47.350 1.00 0.00 H ATOM 11622 HG3 LYS B 403 33.374 30.283 48.822 1.00 0.00 H ATOM 11623 HD2 LYS B 403 33.191 28.084 47.802 1.00 0.00 H ATOM 11624 HD3 LYS B 403 33.850 28.712 46.273 1.00 0.00 H ATOM 11625 HE2 LYS B 403 35.504 27.591 47.741 1.00 0.00 H ATOM 11626 HE3 LYS B 403 35.229 28.882 48.934 1.00 0.00 H ATOM 11627 HZ1 LYS B 403 36.298 29.259 46.180 1.00 0.00 H ATOM 11628 HZ2 LYS B 403 36.036 30.492 47.319 1.00 0.00 H ATOM 11629 HZ3 LYS B 403 37.203 29.294 47.617 1.00 0.00 H ATOM 11630 H LYS B 403 31.105 31.121 49.515 1.00 0.00 H ATOM 11631 N LEU B 404 31.058 33.072 45.526 1.00 17.14 N ATOM 11632 CA LEU B 404 30.207 33.428 44.391 1.00 21.11 C ATOM 11633 C LEU B 404 30.332 32.338 43.301 1.00 24.56 C ATOM 11634 O LEU B 404 30.666 31.159 43.563 1.00 28.05 O ATOM 11635 CB LEU B 404 30.723 34.751 43.854 1.00 23.34 C ATOM 11636 CG LEU B 404 29.919 35.690 42.986 1.00 25.20 C ATOM 11637 CD1 LEU B 404 28.833 36.373 43.809 1.00 26.72 C ATOM 11638 CD2 LEU B 404 30.897 36.709 42.456 1.00 24.53 C ATOM 11639 HA LEU B 404 29.161 33.508 44.686 1.00 0.00 H ATOM 11640 HB2 LEU B 404 31.009 35.333 44.730 1.00 0.00 H ATOM 11641 HB3 LEU B 404 31.614 34.506 43.276 1.00 0.00 H ATOM 11642 HG LEU B 404 29.422 35.157 42.175 1.00 0.00 H ATOM 11643 HD21 LEU B 404 31.355 37.239 43.291 1.00 0.00 H ATOM 11644 HD22 LEU B 404 31.670 36.203 41.878 1.00 0.00 H ATOM 11645 HD23 LEU B 404 30.370 37.419 41.818 1.00 0.00 H ATOM 11646 HD11 LEU B 404 28.168 35.618 44.228 1.00 0.00 H ATOM 11647 HD12 LEU B 404 29.294 36.941 44.617 1.00 0.00 H ATOM 11648 HD13 LEU B 404 28.263 37.046 43.169 1.00 0.00 H ATOM 11649 H LEU B 404 32.066 33.325 45.501 1.00 0.00 H TER 11650 LEU B 404 HETATM11651 O HOH 1 9.088 57.293 51.869 1.00 45.67 O HETATM11652 O HOH 2 10.461 53.979 50.164 1.00 42.07 O HETATM11653 O HOH 3 14.572 60.407 51.031 1.00 38.03 O HETATM11654 O HOH 4 15.421 59.549 53.285 1.00 17.39 O HETATM11655 O HOH 5 6.523 59.748 52.364 1.00 33.72 O HETATM11656 O HOH 6 6.147 66.334 52.970 1.00 42.93 O HETATM11657 O HOH 7 5.203 64.390 53.587 1.00 36.22 O HETATM11658 O HOH 8 12.682 79.204 78.808 1.00 40.55 O HETATM11659 O HOH 9 26.904 93.382 69.203 1.00 59.89 O HETATM11660 O HOH 10 41.106 85.382 86.368 1.00 58.45 O HETATM11661 O HOH 11 10.152 67.028 70.140 1.00 22.75 O HETATM11662 O HOH 12 12.270 77.016 74.110 1.00 29.71 O HETATM11663 O HOH 13 20.322 71.296 83.905 1.00 32.82 O HETATM11664 O HOH 14 48.532 73.778 91.152 1.00 45.13 O HETATM11665 O HOH 15 23.157 80.663 81.798 1.00 33.65 O HETATM11666 O HOH 16 12.538 79.223 75.479 1.00 28.29 O HETATM11667 O HOH 17 15.102 81.695 78.028 1.00 30.23 O HETATM11668 O HOH 18 20.562 80.976 81.791 1.00 42.32 O HETATM11669 O HOH 19 21.941 79.769 84.847 1.00 59.86 O HETATM11670 O HOH 20 23.084 77.170 85.842 1.00 22.95 O HETATM11671 O HOH 21 15.110 69.277 74.753 1.00 13.08 O HETATM11672 O HOH 22 37.346 56.735 91.268 1.00 48.46 O HETATM11673 O HOH 23 10.388 79.015 72.951 1.00 48.04 O HETATM11674 O HOH 24 39.219 63.930 87.704 1.00 48.19 O HETATM11675 O HOH 25 29.499 90.538 70.465 1.00 28.96 O HETATM11676 O HOH 26 27.772 90.852 68.761 1.00 45.21 O HETATM11677 O HOH 27 16.176 84.577 78.094 1.00 42.16 O HETATM11678 O HOH 28 10.347 62.896 81.066 1.00 32.28 O HETATM11679 O HOH 29 12.302 64.444 82.366 1.00 36.08 O HETATM11680 O HOH 30 20.423 69.505 85.877 1.00 37.08 O HETATM11681 O HOH 31 12.357 66.899 81.213 1.00 40.84 O HETATM11682 O HOH 32 26.985 75.310 80.071 1.00 13.90 O HETATM11683 O HOH 33 30.238 83.131 81.017 1.00 42.08 O HETATM11684 O HOH 34 19.128 81.576 79.630 1.00 27.54 O HETATM11685 O HOH 35 10.419 56.715 83.304 1.00 46.89 O HETATM11686 O HOH 36 8.922 60.848 82.386 1.00 40.98 O HETATM11687 O HOH 37 26.298 80.071 78.793 1.00 34.19 O HETATM11688 O HOH 38 34.770 83.812 83.770 1.00 41.87 O HETATM11689 O HOH 39 38.410 86.671 82.115 1.00 32.07 O HETATM11690 O HOH 40 41.497 75.919 87.850 1.00 42.85 O HETATM11691 O HOH 41 36.888 69.997 84.649 1.00 41.57 O HETATM11692 O HOH 42 36.819 73.144 85.331 1.00 46.62 O HETATM11693 O HOH 43 48.418 71.107 84.831 1.00 42.12 O HETATM11694 O HOH 44 38.322 69.229 86.759 1.00 46.83 O HETATM11695 O HOH 45 43.462 85.712 85.180 1.00 48.07 O HETATM11696 O HOH 46 25.838 77.815 80.019 1.00 23.05 O HETATM11697 O HOH 47 21.471 69.923 81.899 1.00 31.97 O HETATM11698 O HOH 48 54.891 79.569 75.938 1.00 42.95 O HETATM11699 O HOH 49 49.591 69.693 83.320 1.00 33.43 O HETATM11700 O HOH 50 52.225 70.970 84.468 1.00 28.10 O HETATM11701 O HOH 51 55.726 77.153 74.963 1.00 35.28 O HETATM11702 O HOH 52 43.008 72.705 87.843 1.00 55.52 O HETATM11703 O HOH 53 52.873 73.174 87.642 1.00 31.78 O HETATM11704 O HOH 54 48.756 76.504 91.291 1.00 32.34 O HETATM11705 O HOH 55 45.421 80.154 90.653 1.00 46.38 O HETATM11706 O HOH 56 43.998 61.782 89.678 1.00 46.70 O HETATM11707 O HOH 57 46.184 65.319 89.015 1.00 35.49 O HETATM11708 O HOH 58 59.580 56.447 77.758 1.00 38.78 O HETATM11709 O HOH 59 53.389 64.224 86.722 1.00 46.74 O HETATM11710 O HOH 60 60.536 53.147 86.995 1.00 46.19 O HETATM11711 O HOH 61 61.224 54.470 89.214 1.00 37.80 O HETATM11712 O HOH 62 60.430 59.610 88.085 1.00 58.46 O HETATM11713 O HOH 63 17.962 71.495 82.403 1.00 33.73 O HETATM11714 O HOH 64 51.747 78.882 66.204 1.00 43.34 O HETATM11715 O HOH 65 50.755 84.063 80.486 1.00 52.54 O HETATM11716 O HOH 66 51.594 83.268 73.488 1.00 37.43 O HETATM11717 O HOH 67 40.736 60.913 87.777 1.00 48.92 O HETATM11718 O HOH 68 14.469 76.063 72.787 1.00 19.36 O HETATM11719 O HOH 69 12.447 74.142 70.216 1.00 15.75 O HETATM11720 O HOH 70 30.802 81.703 83.057 1.00 34.01 O HETATM11721 O HOH 71 34.706 81.276 84.709 1.00 45.49 O HETATM11722 O HOH 72 31.687 77.575 85.891 1.00 58.91 O HETATM11723 O HOH 73 35.405 72.336 82.074 1.00 36.47 O HETATM11724 O HOH 74 14.926 80.583 75.603 1.00 17.21 O HETATM11725 O HOH 75 12.595 71.018 77.114 1.00 36.00 O HETATM11726 O HOH 76 11.090 74.733 75.249 1.00 41.16 O HETATM11727 O HOH 77 14.930 71.326 78.190 1.00 33.09 O HETATM11728 O HOH 78 23.555 72.745 91.378 1.00 51.28 O HETATM11729 O HOH 79 23.030 75.243 87.767 1.00 24.84 O HETATM11730 O HOH 80 25.891 74.419 90.864 1.00 36.02 O HETATM11731 O HOH 81 21.304 70.888 87.815 1.00 30.77 O HETATM11732 O HOH 82 26.638 80.191 84.331 1.00 33.74 O HETATM11733 O HOH 83 14.238 40.042 67.691 1.00 39.11 O HETATM11734 O HOH 84 15.298 41.979 77.029 1.00 47.70 O HETATM11735 O HOH 85 21.685 75.748 83.868 1.00 16.36 O HETATM11736 O HOH 86 23.889 78.128 81.866 1.00 19.47 O HETATM11737 O HOH 87 17.705 76.625 82.384 1.00 17.14 O HETATM11738 O HOH 88 19.629 80.010 83.457 1.00 39.12 O HETATM11739 O HOH 89 29.428 62.195 88.417 1.00 29.53 O HETATM11740 O HOH 90 23.520 49.402 87.422 1.00 48.26 O HETATM11741 O HOH 91 36.386 54.568 90.242 1.00 30.14 O HETATM11742 O HOH 92 33.256 57.457 89.203 1.00 32.12 O HETATM11743 O HOH 93 31.736 61.044 87.994 1.00 32.18 O HETATM11744 O HOH 94 26.188 81.838 76.347 1.00 24.63 O HETATM11745 O HOH 95 35.849 62.056 86.113 1.00 37.13 O HETATM11746 O HOH 96 42.322 62.906 86.475 1.00 40.02 O HETATM11747 O HOH 97 37.892 63.330 84.935 1.00 50.75 O HETATM11748 O HOH 98 35.484 66.274 86.783 1.00 44.17 O HETATM11749 O HOH 99 32.598 63.597 87.483 1.00 37.08 O HETATM11750 O HOH 100 55.574 77.217 72.307 1.00 29.09 O HETATM11751 O HOH 101 14.826 82.791 73.800 1.00 21.29 O HETATM11752 O HOH 102 10.022 81.380 70.226 1.00 39.03 O HETATM11753 O HOH 103 15.888 85.132 74.549 1.00 39.61 O HETATM11754 O HOH 104 11.901 61.075 79.747 1.00 18.91 O HETATM11755 O HOH 105 15.791 59.076 80.379 1.00 16.74 O HETATM11756 O HOH 106 14.753 63.406 81.931 1.00 24.78 O HETATM11757 O HOH 107 20.070 66.634 84.710 1.00 36.05 O HETATM11758 O HOH 108 15.557 57.331 84.279 1.00 39.76 O HETATM11759 O HOH 109 12.736 60.073 83.342 1.00 47.60 O HETATM11760 O HOH 110 27.184 89.451 70.856 1.00 28.96 O HETATM11761 O HOH 111 15.877 69.740 79.069 1.00 34.85 O HETATM11762 O HOH 112 14.906 67.449 79.980 1.00 32.04 O HETATM11763 O HOH 113 21.265 81.348 78.029 1.00 22.51 O HETATM11764 O HOH 114 23.648 81.124 79.204 1.00 34.80 O HETATM11765 O HOH 115 10.418 72.539 73.897 1.00 46.66 O HETATM11766 O HOH 116 10.020 67.089 79.682 1.00 39.92 O HETATM11767 O HOH 117 6.630 68.618 71.937 1.00 47.38 O HETATM11768 O HOH 118 7.390 60.139 78.089 1.00 28.37 O HETATM11769 O HOH 119 2.317 61.603 74.454 1.00 53.49 O HETATM11770 O HOH 120 28.592 87.608 75.384 1.00 32.54 O HETATM11771 O HOH 121 30.890 83.058 78.795 1.00 37.30 O HETATM11772 O HOH 122 27.780 81.783 78.566 1.00 37.74 O HETATM11773 O HOH 123 29.446 87.693 73.222 1.00 38.75 O HETATM11774 O HOH 124 9.388 58.378 81.302 1.00 32.26 O HETATM11775 O HOH 125 5.748 56.449 71.989 1.00 38.56 O HETATM11776 O HOH 126 4.144 56.512 75.750 1.00 42.31 O HETATM11777 O HOH 127 4.080 66.681 60.147 1.00 35.09 O HETATM11778 O HOH 128 10.027 46.530 72.114 1.00 40.70 O HETATM11779 O HOH 129 7.252 54.543 69.942 1.00 40.94 O HETATM11780 O HOH 130 6.862 57.469 80.446 1.00 41.06 O HETATM11781 O HOH 131 34.715 85.539 79.674 1.00 33.26 O HETATM11782 O HOH 132 13.571 56.202 82.629 1.00 28.70 O HETATM11783 O HOH 133 11.766 52.029 83.612 1.00 38.66 O HETATM11784 O HOH 134 10.452 44.563 70.770 1.00 50.32 O HETATM11785 O HOH 135 37.034 81.936 84.340 1.00 35.11 O HETATM11786 O HOH 136 36.636 78.686 83.100 1.00 21.95 O HETATM11787 O HOH 137 36.407 84.573 81.764 1.00 20.57 O HETATM11788 O HOH 138 13.047 43.529 64.845 1.00 34.58 O HETATM11789 O HOH 139 16.503 42.098 61.814 1.00 31.66 O HETATM11790 O HOH 140 42.107 81.873 88.397 1.00 36.52 O HETATM11791 O HOH 141 45.239 83.808 86.305 1.00 37.11 O HETATM11792 O HOH 142 48.700 82.494 87.416 1.00 37.42 O HETATM11793 O HOH 143 39.446 78.943 85.452 1.00 34.33 O HETATM11794 O HOH 144 9.175 75.611 50.660 1.00 42.75 O HETATM11795 O HOH 145 10.973 77.775 47.714 1.00 37.83 O HETATM11796 O HOH 146 41.725 69.550 86.268 1.00 44.56 O HETATM11797 O HOH 147 38.948 69.825 82.912 1.00 17.66 O HETATM11798 O HOH 148 40.123 76.095 84.759 1.00 23.90 O HETATM11799 O HOH 149 39.413 73.337 85.395 1.00 22.45 O HETATM11800 O HOH 150 46.246 72.353 84.823 1.00 27.47 O HETATM11801 O HOH 151 50.888 78.812 80.594 1.00 16.33 O HETATM11802 O HOH 152 51.344 85.241 83.837 1.00 49.06 O HETATM11803 O HOH 153 46.018 57.488 90.646 1.00 29.67 O HETATM11804 O HOH 154 48.678 59.683 89.532 1.00 36.06 O HETATM11805 O HOH 155 44.026 75.142 87.653 1.00 40.07 O HETATM11806 O HOH 156 52.650 73.459 85.244 1.00 30.68 O HETATM11807 O HOH 157 46.384 77.756 89.862 1.00 39.18 O HETATM11808 O HOH 158 52.130 75.271 86.138 1.00 41.48 O HETATM11809 O HOH 159 45.745 61.128 87.887 1.00 26.76 O HETATM11810 O HOH 160 46.721 64.896 86.320 1.00 18.57 O HETATM11811 O HOH 161 51.976 62.894 88.302 1.00 55.48 O HETATM11812 O HOH 162 50.083 64.557 88.874 1.00 43.37 O HETATM11813 O HOH 163 48.472 56.659 91.707 1.00 25.18 O HETATM11814 O HOH 164 51.159 70.403 82.016 1.00 25.78 O HETATM11815 O HOH 165 56.905 56.305 78.565 1.00 21.00 O HETATM11816 O HOH 166 58.966 58.259 81.633 1.00 44.40 O HETATM11817 O HOH 167 57.355 53.442 82.238 1.00 43.71 O HETATM11818 O HOH 168 58.388 54.897 84.073 1.00 45.69 O HETATM11819 O HOH 169 54.290 48.503 89.716 1.00 37.97 O HETATM11820 O HOH 170 57.669 54.043 86.531 1.00 36.92 O HETATM11821 O HOH 171 57.490 57.368 85.740 1.00 46.79 O HETATM11822 O HOH 172 59.306 57.045 89.469 1.00 25.76 O HETATM11823 O HOH 173 54.694 75.443 77.054 1.00 17.58 O HETATM11824 O HOH 174 53.068 79.144 77.704 1.00 28.84 O HETATM11825 O HOH 175 42.721 47.862 97.887 1.00 68.15 O HETATM11826 O HOH 176 49.956 79.536 68.277 1.00 29.31 O HETATM11827 O HOH 177 49.914 83.082 75.703 1.00 29.69 O HETATM11828 O HOH 178 54.971 81.069 71.167 1.00 44.21 O HETATM11829 O HOH 179 52.877 76.734 67.182 1.00 39.14 O HETATM11830 O HOH 180 38.569 52.982 89.898 1.00 20.06 O HETATM11831 O HOH 181 33.400 46.196 86.865 1.00 44.97 O HETATM11832 O HOH 182 41.767 57.457 92.055 1.00 40.03 O HETATM11833 O HOH 183 40.887 47.120 91.293 1.00 29.35 O HETATM11834 O HOH 184 38.620 50.978 91.815 1.00 34.23 O HETATM11835 O HOH 185 39.923 56.538 90.618 1.00 39.08 O HETATM11836 O HOH 186 43.825 44.505 90.219 1.00 41.17 O HETATM11837 O HOH 187 36.764 49.179 92.205 1.00 44.91 O HETATM11838 O HOH 188 51.264 81.503 80.427 1.00 33.99 O HETATM11839 O HOH 189 51.366 81.682 77.851 1.00 28.71 O HETATM11840 O HOH 190 46.420 84.799 80.582 1.00 27.07 O HETATM11841 O HOH 191 39.378 57.469 88.524 1.00 42.08 O HETATM11842 O HOH 192 41.322 77.309 73.290 1.00 11.55 O HETATM11843 O HOH 193 26.664 51.178 81.924 1.00 26.37 O HETATM11844 O HOH 194 32.487 79.584 83.806 1.00 26.51 O HETATM11845 O HOH 195 16.702 51.103 84.039 1.00 41.58 O HETATM11846 O HOH 196 21.204 51.333 84.830 1.00 52.13 O HETATM11847 O HOH 197 32.821 74.685 84.103 1.00 37.83 O HETATM11848 O HOH 198 30.968 73.617 85.761 1.00 47.75 O HETATM11849 O HOH 199 33.478 71.693 80.313 1.00 24.42 O HETATM11850 O HOH 200 25.255 77.700 84.187 1.00 22.73 O HETATM11851 O HOH 201 27.829 76.545 87.174 1.00 51.40 O HETATM11852 O HOH 202 13.182 41.371 70.836 1.00 42.14 O HETATM11853 O HOH 203 14.125 41.809 74.788 1.00 48.19 O HETATM11854 O HOH 204 30.679 71.009 83.936 1.00 31.49 O HETATM11855 O HOH 205 25.176 73.700 88.333 1.00 24.54 O HETATM11856 O HOH 206 23.623 70.678 88.714 1.00 34.85 O HETATM11857 O HOH 207 26.550 72.913 92.687 1.00 37.41 O HETATM11858 O HOH 208 26.793 62.417 87.563 1.00 29.08 O HETATM11859 O HOH 209 30.286 64.644 88.124 1.00 31.43 O HETATM11860 O HOH 210 31.242 66.375 84.424 1.00 24.47 O HETATM11861 O HOH 211 31.005 68.536 88.302 1.00 32.84 O HETATM11862 O HOH 212 24.542 68.501 90.752 1.00 35.18 O HETATM11863 O HOH 213 31.039 65.562 90.765 1.00 36.79 O HETATM11864 O HOH 214 28.131 62.044 90.878 1.00 26.79 O HETATM11865 O HOH 215 22.418 61.244 92.623 1.00 44.12 O HETATM11866 O HOH 216 26.522 59.673 91.109 1.00 28.71 O HETATM11867 O HOH 217 20.194 60.286 89.167 1.00 49.10 O HETATM11868 O HOH 218 21.353 57.737 85.999 1.00 24.21 O HETATM11869 O HOH 219 29.349 58.716 91.547 1.00 34.39 O HETATM11870 O HOH 220 31.537 54.546 91.943 1.00 39.73 O HETATM11871 O HOH 221 23.766 57.136 92.725 1.00 35.93 O HETATM11872 O HOH 222 30.638 56.370 90.496 1.00 32.03 O HETATM11873 O HOH 223 27.947 52.286 94.411 1.00 56.00 O HETATM11874 O HOH 224 30.305 52.379 93.011 1.00 43.52 O HETATM11875 O HOH 225 28.711 57.904 94.451 1.00 43.99 O HETATM11876 O HOH 226 20.956 59.471 49.708 1.00 48.94 O HETATM11877 O HOH 227 18.133 44.391 56.218 1.00 34.87 O HETATM11878 O HOH 228 17.755 44.271 60.550 1.00 22.55 O HETATM11879 O HOH 229 13.482 48.118 53.708 1.00 53.34 O HETATM11880 O HOH 230 25.971 50.163 83.831 1.00 41.71 O HETATM11881 O HOH 231 26.052 49.494 86.215 1.00 39.65 O HETATM11882 O HOH 232 23.733 53.444 91.290 1.00 31.45 O HETATM11883 O HOH 233 32.781 58.720 86.854 1.00 25.06 O HETATM11884 O HOH 234 34.848 55.485 88.105 1.00 19.52 O HETATM11885 O HOH 235 34.918 59.619 85.627 1.00 31.11 O HETATM11886 O HOH 236 42.404 65.705 86.642 1.00 44.07 O HETATM11887 O HOH 237 35.835 61.883 77.575 1.00 15.09 O HETATM11888 O HOH 238 34.695 68.237 84.477 1.00 36.20 O HETATM11889 O HOH 239 37.950 66.127 81.244 1.00 38.54 O HETATM11890 O HOH 240 37.375 65.305 83.553 1.00 32.22 O HETATM11891 O HOH 241 35.185 67.945 80.565 1.00 15.27 O HETATM11892 O HOH 242 33.670 64.985 85.682 1.00 38.48 O HETATM11893 O HOH 243 54.899 75.592 70.324 1.00 39.79 O HETATM11894 O HOH 244 57.254 72.700 68.095 1.00 37.15 O HETATM11895 O HOH 245 48.215 72.988 61.115 1.00 49.38 O HETATM11896 O HOH 246 54.240 73.211 62.965 1.00 50.54 O HETATM11897 O HOH 247 56.013 73.324 65.454 1.00 44.43 O HETATM11898 O HOH 248 45.390 75.660 62.547 1.00 47.40 O HETATM11899 O HOH 249 33.382 57.030 78.558 1.00 14.88 O HETATM11900 O HOH 250 49.711 87.412 72.860 1.00 45.27 O HETATM11901 O HOH 251 32.232 68.840 83.567 1.00 21.21 O HETATM11902 O HOH 252 42.451 92.462 71.690 1.00 42.47 O HETATM11903 O HOH 253 43.155 93.196 75.641 1.00 42.16 O HETATM11904 O HOH 254 36.861 88.901 81.439 1.00 38.55 O HETATM11905 O HOH 255 34.952 88.282 79.645 1.00 39.46 O HETATM11906 O HOH 256 15.904 62.119 84.210 1.00 44.42 O HETATM11907 O HOH 257 20.170 60.264 85.537 1.00 23.60 O HETATM11908 O HOH 258 14.598 61.530 80.010 1.00 14.67 O HETATM11909 O HOH 259 17.318 58.742 82.562 1.00 29.59 O HETATM11910 O HOH 260 20.118 63.616 85.114 1.00 23.13 O HETATM11911 O HOH 261 19.221 65.344 81.800 1.00 27.87 O HETATM11912 O HOH 262 16.400 65.554 81.020 1.00 28.02 O HETATM11913 O HOH 263 20.437 67.518 81.352 1.00 27.21 O HETATM11914 O HOH 264 14.024 67.821 77.161 1.00 19.67 O HETATM11915 O HOH 265 16.908 70.549 76.355 1.00 14.20 O HETATM11916 O HOH 266 8.270 63.688 77.853 1.00 36.08 O HETATM11917 O HOH 267 11.231 67.798 77.432 1.00 28.67 O HETATM11918 O HOH 268 7.148 65.021 71.440 1.00 42.91 O HETATM11919 O HOH 269 10.849 69.663 75.362 1.00 35.63 O HETATM11920 O HOH 270 8.379 67.852 73.869 1.00 46.55 O HETATM11921 O HOH 271 9.170 68.209 71.367 1.00 43.06 O HETATM11922 O HOH 272 6.944 51.660 62.182 1.00 35.11 O HETATM11923 O HOH 273 5.390 63.081 71.878 1.00 54.12 O HETATM11924 O HOH 274 8.819 51.197 58.367 1.00 37.74 O HETATM11925 O HOH 275 5.286 53.608 68.222 1.00 32.05 O HETATM11926 O HOH 276 4.088 63.381 55.915 1.00 42.64 O HETATM11927 O HOH 277 4.791 60.801 73.202 1.00 29.78 O HETATM11928 O HOH 278 5.575 59.579 77.456 1.00 48.07 O HETATM11929 O HOH 279 11.420 58.292 79.323 1.00 17.14 O HETATM11930 O HOH 280 -0.073 53.026 65.206 1.00 44.50 O HETATM11931 O HOH 281 -0.164 58.728 72.331 1.00 50.23 O HETATM11932 O HOH 282 -1.306 60.031 70.672 1.00 29.98 O HETATM11933 O HOH 283 4.710 53.774 76.218 1.00 42.93 O HETATM11934 O HOH 284 6.363 56.914 74.500 1.00 23.09 O HETATM11935 O HOH 285 3.656 66.175 62.769 1.00 24.57 O HETATM11936 O HOH 286 3.658 68.770 66.980 1.00 47.53 O HETATM11937 O HOH 287 9.869 49.955 81.778 1.00 43.75 O HETATM11938 O HOH 288 10.535 49.095 73.372 1.00 36.29 O HETATM11939 O HOH 289 6.694 54.712 81.770 1.00 43.55 O HETATM11940 O HOH 290 8.092 68.268 53.140 1.00 40.70 O HETATM11941 O HOH 291 11.037 61.934 49.744 1.00 44.93 O HETATM11942 O HOH 292 9.234 52.868 69.765 1.00 46.95 O HETATM11943 O HOH 293 24.245 60.558 48.340 1.00 33.27 O HETATM11944 O HOH 294 13.797 57.139 80.072 1.00 17.94 O HETATM11945 O HOH 295 16.349 49.349 72.494 1.00 12.71 O HETATM11946 O HOH 296 14.054 53.375 82.794 1.00 27.04 O HETATM11947 O HOH 297 17.141 54.845 81.379 1.00 39.05 O HETATM11948 O HOH 298 14.441 49.905 82.506 1.00 37.17 O HETATM11949 O HOH 299 11.457 49.323 79.740 1.00 32.15 O HETATM11950 O HOH 300 18.400 44.727 77.978 1.00 21.39 O HETATM11951 O HOH 301 11.173 47.595 77.815 1.00 32.94 O HETATM11952 O HOH 302 10.545 46.274 67.910 1.00 36.44 O HETATM11953 O HOH 303 34.413 64.266 41.125 1.00 22.08 O HETATM11954 O HOH 304 42.812 67.639 40.978 1.00 32.66 O HETATM11955 O HOH 305 17.904 45.022 65.123 1.00 24.25 O HETATM11956 O HOH 306 14.320 44.654 62.447 1.00 43.85 O HETATM11957 O HOH 307 11.413 50.713 58.208 1.00 26.58 O HETATM11958 O HOH 308 24.269 72.202 44.608 1.00 39.10 O HETATM11959 O HOH 309 30.971 64.218 44.393 1.00 25.08 O HETATM11960 O HOH 310 26.444 65.169 44.260 1.00 34.60 O HETATM11961 O HOH 311 24.745 63.393 44.576 1.00 40.40 O HETATM11962 O HOH 312 17.328 76.769 44.815 1.00 46.47 O HETATM11963 O HOH 313 11.551 77.486 50.399 1.00 29.57 O HETATM11964 O HOH 314 19.768 75.666 45.852 1.00 37.43 O HETATM11965 O HOH 315 15.016 82.411 48.384 1.00 41.63 O HETATM11966 O HOH 316 41.108 64.675 69.321 1.00 35.77 O HETATM11967 O HOH 317 42.657 61.520 71.725 1.00 31.30 O HETATM11968 O HOH 318 47.813 79.861 58.704 1.00 50.23 O HETATM11969 O HOH 319 47.379 81.997 56.673 1.00 41.04 O HETATM11970 O HOH 320 39.449 79.386 45.709 1.00 38.77 O HETATM11971 O HOH 321 37.093 78.185 44.618 1.00 37.47 O HETATM11972 O HOH 322 38.949 82.118 46.124 1.00 37.58 O HETATM11973 O HOH 323 40.950 58.102 74.747 1.00 28.43 O HETATM11974 O HOH 324 19.930 84.983 46.751 1.00 34.04 O HETATM11975 O HOH 325 46.465 58.578 88.118 1.00 21.74 O HETATM11976 O HOH 326 50.467 57.666 90.056 1.00 20.73 O HETATM11977 O HOH 327 49.545 62.055 88.174 1.00 35.45 O HETATM11978 O HOH 328 46.615 62.121 85.517 1.00 17.60 O HETATM11979 O HOH 329 49.734 54.090 91.798 1.00 14.02 O HETATM11980 O HOH 330 54.037 50.982 89.334 1.00 32.50 O HETATM11981 O HOH 331 56.925 56.125 81.350 1.00 20.69 O HETATM11982 O HOH 332 57.169 56.031 87.927 1.00 26.30 O HETATM11983 O HOH 333 53.512 50.024 91.668 1.00 27.17 O HETATM11984 O HOH 334 51.843 48.000 92.946 1.00 36.21 O HETATM11985 O HOH 335 54.048 50.579 96.719 1.00 27.92 O HETATM11986 O HOH 336 48.898 47.630 94.671 1.00 32.72 O HETATM11987 O HOH 337 47.686 49.005 96.578 1.00 41.26 O HETATM11988 O HOH 338 45.466 55.400 94.133 1.00 43.80 O HETATM11989 O HOH 339 41.662 49.344 96.004 1.00 43.29 O HETATM11990 O HOH 340 8.009 77.080 68.220 1.00 56.77 O HETATM11991 O HOH 341 9.992 86.800 60.750 1.00 34.17 O HETATM11992 O HOH 342 50.149 46.536 90.153 1.00 25.08 O HETATM11993 O HOH 343 46.427 43.880 91.128 1.00 37.97 O HETATM11994 O HOH 344 41.162 49.465 92.521 1.00 29.91 O HETATM11995 O HOH 345 41.890 52.941 92.818 1.00 40.32 O HETATM11996 O HOH 346 41.000 54.163 90.388 1.00 26.12 O HETATM11997 O HOH 347 43.869 55.948 91.619 1.00 26.68 O HETATM11998 O HOH 348 39.170 52.687 87.192 1.00 14.52 O HETATM11999 O HOH 349 40.573 49.575 83.733 1.00 14.21 O HETATM12000 O HOH 350 35.022 46.621 84.791 1.00 30.30 O HETATM12001 O HOH 351 37.337 49.225 82.045 1.00 21.87 O HETATM12002 O HOH 352 42.867 84.334 51.737 1.00 51.44 O HETATM12003 O HOH 353 31.633 50.881 92.470 1.00 34.88 O HETATM12004 O HOH 354 33.978 50.365 92.405 1.00 45.32 O HETATM12005 O HOH 355 30.929 91.865 58.640 1.00 28.64 O HETATM12006 O HOH 356 24.859 93.955 65.169 1.00 54.10 O HETATM12007 O HOH 357 38.863 55.488 86.454 1.00 18.86 O HETATM12008 O HOH 358 17.085 92.616 58.971 1.00 39.40 O HETATM12009 O HOH 359 11.940 88.151 56.212 1.00 47.05 O HETATM12010 O HOH 360 36.059 57.490 75.519 1.00 25.48 O HETATM12011 O HOH 361 33.832 57.907 72.831 1.00 35.01 O HETATM12012 O HOH 362 7.245 74.993 55.646 1.00 47.59 O HETATM12013 O HOH 363 32.107 49.640 72.459 1.00 14.39 O HETATM12014 O HOH 364 40.390 71.026 59.095 1.00 44.62 O HETATM12015 O HOH 365 29.850 50.685 71.375 1.00 17.70 O HETATM12016 O HOH 366 27.656 53.705 81.640 1.00 19.39 O HETATM12017 O HOH 367 25.451 45.998 77.285 1.00 19.00 O HETATM12018 O HOH 368 26.708 49.117 77.038 1.00 30.15 O HETATM12019 O HOH 369 3.406 67.606 56.247 1.00 37.25 O HETATM12020 O HOH 370 19.017 55.598 81.867 1.00 24.07 O HETATM12021 O HOH 371 19.091 51.151 83.094 1.00 32.87 O HETATM12022 O HOH 372 19.748 45.614 81.835 1.00 44.88 O HETATM12023 O HOH 373 21.719 48.040 81.436 1.00 39.25 O HETATM12024 O HOH 374 15.447 42.151 72.201 1.00 22.77 O HETATM12025 O HOH 375 38.588 62.021 65.695 1.00 16.71 O HETATM12026 O HOH 376 34.328 57.964 68.985 1.00 19.12 O HETATM12027 O HOH 377 31.511 66.740 65.491 1.00 11.05 O HETATM12028 O HOH 378 23.290 48.163 60.899 1.00 21.54 O HETATM12029 O HOH 379 20.677 57.048 50.685 1.00 28.28 O HETATM12030 O HOH 380 14.203 53.041 52.124 1.00 35.28 O HETATM12031 O HOH 381 14.353 50.493 53.019 1.00 40.88 O HETATM12032 O HOH 382 20.070 61.449 52.340 1.00 31.58 O HETATM12033 O HOH 383 18.117 47.357 53.283 1.00 23.41 O HETATM12034 O HOH 384 16.117 46.243 56.510 1.00 22.00 O HETATM12035 O HOH 385 12.150 47.336 57.453 1.00 37.81 O HETATM12036 O HOH 386 15.432 45.357 59.244 1.00 24.04 O HETATM12037 O HOH 387 18.844 46.096 62.442 1.00 23.04 O HETATM12038 O HOH 388 23.834 45.656 55.475 1.00 20.88 O HETATM12039 O HOH 389 16.683 45.552 62.295 1.00 38.87 O HETATM12040 O HOH 390 13.389 52.454 58.824 1.00 15.02 O HETATM12041 O HOH 391 9.656 50.014 66.242 1.00 40.33 O HETATM12042 O HOH 392 36.570 63.658 74.656 1.00 16.27 O HETATM12043 O HOH 393 37.768 69.555 74.112 1.00 14.05 O HETATM12044 O HOH 394 36.728 62.874 81.401 1.00 16.13 O HETATM12045 O HOH 395 36.591 69.877 82.529 1.00 33.86 O HETATM12046 O HOH 396 40.101 69.712 75.612 1.00 18.05 O HETATM12047 O HOH 397 44.833 62.639 83.517 1.00 14.11 O HETATM12048 O HOH 398 44.904 66.363 84.827 1.00 18.06 O HETATM12049 O HOH 399 43.544 64.112 69.938 1.00 38.31 O HETATM12050 O HOH 400 47.896 77.445 69.376 1.00 14.44 O HETATM12051 O HOH 401 55.037 72.392 69.511 1.00 24.26 O HETATM12052 O HOH 402 53.474 74.254 65.990 1.00 37.50 O HETATM12053 O HOH 403 51.110 72.596 62.842 1.00 37.58 O HETATM12054 O HOH 404 47.678 74.793 63.106 1.00 38.16 O HETATM12055 O HOH 405 49.586 78.694 64.034 1.00 45.08 O HETATM12056 O HOH 406 45.405 78.628 63.757 1.00 41.37 O HETATM12057 O HOH 407 46.650 86.589 74.951 1.00 17.82 O HETATM12058 O HOH 408 51.230 81.720 69.934 1.00 47.26 O HETATM12059 O HOH 409 50.051 85.057 71.327 1.00 39.15 O HETATM12060 O HOH 410 48.008 89.380 72.907 1.00 39.17 O HETATM12061 O HOH 411 42.736 92.287 67.070 1.00 40.68 O HETATM12062 O HOH 412 43.329 83.879 73.010 1.00 15.40 O HETATM12063 O HOH 413 41.004 86.739 81.034 1.00 26.03 O HETATM12064 O HOH 414 48.273 85.494 77.456 1.00 31.56 O HETATM12065 O HOH 415 38.148 90.702 79.910 1.00 48.55 O HETATM12066 O HOH 416 44.986 89.179 75.449 1.00 26.52 O HETATM12067 O HOH 417 41.371 89.801 81.845 1.00 45.14 O HETATM12068 O HOH 418 47.096 87.024 79.402 1.00 46.71 O HETATM12069 O HOH 419 40.063 91.943 72.499 1.00 34.00 O HETATM12070 O HOH 420 42.919 90.648 74.396 1.00 30.13 O HETATM12071 O HOH 421 35.784 83.694 72.156 1.00 15.50 O HETATM12072 O HOH 422 28.938 85.734 77.737 1.00 34.01 O HETATM12073 O HOH 423 32.491 84.745 79.345 1.00 32.58 O HETATM12074 O HOH 424 36.080 89.043 77.084 1.00 21.86 O HETATM12075 O HOH 425 32.173 90.204 74.394 1.00 40.56 O HETATM12076 O HOH 426 35.009 91.006 75.698 1.00 39.39 O HETATM12077 O HOH 427 36.640 78.636 67.747 1.00 12.23 O HETATM12078 O HOH 428 39.276 92.053 69.963 1.00 32.33 O HETATM12079 O HOH 429 38.125 93.296 67.520 1.00 42.61 O HETATM12080 O HOH 430 39.864 92.833 63.556 1.00 35.25 O HETATM12081 O HOH 431 43.168 85.920 58.798 1.00 38.48 O HETATM12082 O HOH 432 44.192 86.243 60.783 1.00 29.18 O HETATM12083 O HOH 433 46.430 85.566 63.235 1.00 41.67 O HETATM12084 O HOH 434 46.521 80.817 63.629 1.00 43.30 O HETATM12085 O HOH 435 47.821 82.855 68.046 1.00 35.13 O HETATM12086 O HOH 436 47.530 80.354 66.976 1.00 34.02 O HETATM12087 O HOH 437 40.648 83.260 66.529 1.00 13.24 O HETATM12088 O HOH 438 29.818 73.123 73.995 1.00 14.17 O HETATM12089 O HOH 439 8.920 52.287 60.713 1.00 26.32 O HETATM12090 O HOH 440 9.391 57.094 55.405 1.00 18.47 O HETATM12091 O HOH 441 1.944 58.758 57.721 1.00 40.98 O HETATM12092 O HOH 442 3.744 60.505 55.562 1.00 30.44 O HETATM12093 O HOH 443 7.585 53.373 56.684 1.00 37.08 O HETATM12094 O HOH 444 5.221 52.464 54.321 1.00 53.85 O HETATM12095 O HOH 445 7.113 57.559 54.031 1.00 40.33 O HETATM12096 O HOH 446 2.222 57.246 59.945 1.00 20.31 O HETATM12097 O HOH 447 1.293 56.989 55.547 1.00 28.70 O HETATM12098 O HOH 448 4.971 54.474 65.812 1.00 21.57 O HETATM12099 O HOH 449 -1.146 59.907 64.156 1.00 24.89 O HETATM12100 O HOH 450 1.151 62.648 64.363 1.00 20.25 O HETATM12101 O HOH 451 -1.255 55.557 65.028 1.00 27.66 O HETATM12102 O HOH 452 2.197 53.706 66.468 1.00 42.97 O HETATM12103 O HOH 453 -0.783 57.899 68.359 1.00 32.90 O HETATM12104 O HOH 454 0.940 60.932 71.465 1.00 41.48 O HETATM12105 O HOH 455 4.701 59.086 71.117 1.00 26.50 O HETATM12106 O HOH 456 3.838 65.329 70.534 1.00 44.01 O HETATM12107 O HOH 457 0.565 63.737 69.952 1.00 35.90 O HETATM12108 O HOH 458 3.599 63.790 64.209 1.00 25.11 O HETATM12109 O HOH 459 8.508 63.756 69.477 1.00 21.50 O HETATM12110 O HOH 460 6.479 69.221 61.666 1.00 29.54 O HETATM12111 O HOH 461 5.242 68.023 64.445 1.00 23.90 O HETATM12112 O HOH 462 9.965 70.628 71.487 1.00 39.17 O HETATM12113 O HOH 463 10.929 68.237 54.018 1.00 18.12 O HETATM12114 O HOH 464 10.998 65.958 51.558 1.00 23.83 O HETATM12115 O HOH 465 13.260 63.166 51.404 1.00 38.79 O HETATM12116 O HOH 466 18.171 62.310 53.317 1.00 27.43 O HETATM12117 O HOH 467 14.570 61.852 54.790 1.00 16.32 O HETATM12118 O HOH 468 23.313 61.131 50.653 1.00 34.36 O HETATM12119 O HOH 469 27.893 57.628 55.898 1.00 18.87 O HETATM12120 O HOH 470 21.854 63.544 50.456 1.00 24.71 O HETATM12121 O HOH 471 25.778 60.613 51.681 1.00 28.05 O HETATM12122 O HOH 472 28.434 59.899 51.179 1.00 25.21 O HETATM12123 O HOH 473 30.860 59.797 49.478 1.00 20.61 O HETATM12124 O HOH 474 33.522 61.465 55.042 1.00 10.34 O HETATM12125 O HOH 475 39.984 67.411 47.294 1.00 22.82 O HETATM12126 O HOH 476 41.192 62.938 52.991 1.00 16.09 O HETATM12127 O HOH 477 50.063 68.543 55.562 1.00 48.25 O HETATM12128 O HOH 478 43.725 69.528 51.432 1.00 50.76 O HETATM12129 O HOH 479 42.526 68.199 57.042 1.00 33.26 O HETATM12130 O HOH 480 49.572 66.034 53.734 1.00 41.52 O HETATM12131 O HOH 481 42.817 71.356 58.989 1.00 42.98 O HETATM12132 O HOH 482 42.461 68.298 53.461 1.00 32.02 O HETATM12133 O HOH 483 37.611 70.660 51.208 1.00 23.33 O HETATM12134 O HOH 484 36.760 73.928 45.033 1.00 37.80 O HETATM12135 O HOH 485 37.502 65.954 41.632 1.00 23.88 O HETATM12136 O HOH 486 40.848 67.002 42.938 1.00 34.95 O HETATM12137 O HOH 487 39.886 71.431 43.078 1.00 40.91 O HETATM12138 O HOH 488 32.812 63.400 46.483 1.00 25.35 O HETATM12139 O HOH 489 29.111 66.006 45.001 1.00 17.54 O HETATM12140 O HOH 490 29.403 74.348 41.509 1.00 36.22 O HETATM12141 O HOH 491 23.706 69.381 44.276 1.00 24.78 O HETATM12142 O HOH 492 23.332 62.947 47.122 1.00 28.65 O HETATM12143 O HOH 493 23.758 61.482 42.352 1.00 50.55 O HETATM12144 O HOH 494 19.645 64.688 49.300 1.00 23.71 O HETATM12145 O HOH 495 14.017 67.015 43.401 1.00 50.86 O HETATM12146 O HOH 496 19.467 68.359 42.612 1.00 34.10 O HETATM12147 O HOH 497 19.316 71.655 45.898 1.00 26.15 O HETATM12148 O HOH 498 15.545 75.187 44.770 1.00 42.20 O HETATM12149 O HOH 499 9.467 70.831 48.674 1.00 34.46 O HETATM12150 O HOH 500 19.003 73.602 47.651 1.00 28.41 O HETATM12151 O HOH 501 13.948 76.717 51.594 1.00 15.63 O HETATM12152 O HOH 502 18.875 81.466 50.098 1.00 31.76 O HETATM12153 O HOH 503 20.276 77.334 47.783 1.00 24.05 O HETATM12154 O HOH 504 12.748 80.324 51.525 1.00 35.25 O HETATM12155 O HOH 505 16.296 81.743 50.739 1.00 30.47 O HETATM12156 O HOH 506 17.132 83.237 54.836 1.00 29.79 O HETATM12157 O HOH 507 28.750 77.372 63.057 1.00 23.36 O HETATM12158 O HOH 508 32.819 71.507 62.815 1.00 21.91 O HETATM12159 O HOH 509 38.788 71.699 60.869 1.00 28.26 O HETATM12160 O HOH 510 38.447 73.546 58.123 1.00 43.85 O HETATM12161 O HOH 511 31.140 78.130 63.319 1.00 16.67 O HETATM12162 O HOH 512 39.263 75.240 59.958 1.00 40.89 O HETATM12163 O HOH 513 43.468 76.278 63.905 1.00 32.22 O HETATM12164 O HOH 514 44.750 82.430 55.431 1.00 40.64 O HETATM12165 O HOH 515 45.338 78.561 59.604 1.00 29.59 O HETATM12166 O HOH 516 37.220 74.840 56.055 1.00 30.81 O HETATM12167 O HOH 517 42.767 75.588 58.561 1.00 37.03 O HETATM12168 O HOH 518 37.349 77.181 59.620 1.00 24.08 O HETATM12169 O HOH 519 40.046 78.342 48.207 1.00 35.88 O HETATM12170 O HOH 520 42.617 79.548 52.629 1.00 37.80 O HETATM12171 O HOH 521 37.930 76.433 48.823 1.00 25.03 O HETATM12172 O HOH 522 33.850 79.379 57.030 1.00 24.51 O HETATM12173 O HOH 523 36.336 74.054 53.593 1.00 30.80 O HETATM12174 O HOH 524 35.870 76.284 57.612 1.00 40.41 O HETATM12175 O HOH 525 35.199 80.076 44.990 1.00 23.57 O HETATM12176 O HOH 526 36.391 76.130 46.526 1.00 29.92 O HETATM12177 O HOH 527 30.995 86.333 46.431 1.00 31.16 O HETATM12178 O HOH 528 36.207 82.497 45.881 1.00 29.20 O HETATM12179 O HOH 529 29.395 79.128 41.349 1.00 35.74 O HETATM12180 O HOH 530 26.120 73.986 43.294 1.00 38.31 O HETATM12181 O HOH 531 23.179 76.661 44.409 1.00 52.77 O HETATM12182 O HOH 532 22.431 78.969 44.190 1.00 40.49 O HETATM12183 O HOH 533 30.065 84.877 44.687 1.00 39.24 O HETATM12184 O HOH 534 26.589 84.931 47.006 1.00 25.09 O HETATM12185 O HOH 535 22.850 87.989 44.169 1.00 30.37 O HETATM12186 O HOH 536 24.886 86.078 39.248 1.00 51.82 O HETATM12187 O HOH 537 25.058 82.656 40.802 1.00 39.15 O HETATM12188 O HOH 538 27.535 83.495 40.345 1.00 48.33 O HETATM12189 O HOH 539 20.159 80.511 48.174 1.00 43.49 O HETATM12190 O HOH 540 20.063 84.312 51.055 1.00 31.75 O HETATM12191 O HOH 541 21.971 85.763 48.408 1.00 18.42 O HETATM12192 O HOH 542 28.939 76.337 67.034 1.00 11.68 O HETATM12193 O HOH 543 33.110 84.243 71.987 1.00 14.34 O HETATM12194 O HOH 544 31.045 74.365 71.899 1.00 14.50 O HETATM12195 O HOH 545 31.228 73.724 68.225 1.00 14.59 O HETATM12196 O HOH 546 29.002 74.089 70.093 1.00 13.52 O HETATM12197 O HOH 547 30.272 70.718 63.069 1.00 19.40 O HETATM12198 O HOH 548 28.165 73.614 61.339 1.00 15.03 O HETATM12199 O HOH 549 13.732 72.440 63.384 1.00 19.19 O HETATM12200 O HOH 550 11.516 79.225 60.548 1.00 15.97 O HETATM12201 O HOH 551 9.948 73.076 69.892 1.00 32.04 O HETATM12202 O HOH 552 8.785 80.240 64.644 1.00 45.31 O HETATM12203 O HOH 553 11.083 73.355 62.639 1.00 16.57 O HETATM12204 O HOH 554 8.151 71.742 64.115 1.00 24.99 O HETATM12205 O HOH 555 12.288 84.446 66.230 1.00 26.43 O HETATM12206 O HOH 556 9.068 80.143 68.646 1.00 39.33 O HETATM12207 O HOH 557 9.996 82.475 67.573 1.00 36.46 O HETATM12208 O HOH 558 10.480 84.646 62.584 1.00 27.66 O HETATM12209 O HOH 559 28.723 83.615 66.284 1.00 12.88 O HETATM12210 O HOH 560 31.865 85.161 63.326 1.00 13.37 O HETATM12211 O HOH 561 30.199 90.259 64.141 1.00 17.07 O HETATM12212 O HOH 562 33.861 91.846 69.313 1.00 36.33 O HETATM12213 O HOH 563 31.792 89.471 71.905 1.00 32.98 O HETATM12214 O HOH 564 30.123 90.903 67.830 1.00 25.47 O HETATM12215 O HOH 565 30.327 92.581 62.697 1.00 30.59 O HETATM12216 O HOH 566 31.895 92.935 67.593 1.00 41.08 O HETATM12217 O HOH 567 36.641 97.204 59.212 1.00 41.48 O HETATM12218 O HOH 568 40.817 92.723 55.950 1.00 47.10 O HETATM12219 O HOH 569 35.948 94.365 55.369 1.00 45.94 O HETATM12220 O HOH 570 35.315 95.079 57.903 1.00 35.27 O HETATM12221 O HOH 571 36.113 91.904 52.941 1.00 33.83 O HETATM12222 O HOH 572 42.294 85.959 53.565 1.00 36.77 O HETATM12223 O HOH 573 42.085 90.235 55.615 1.00 31.33 O HETATM12224 O HOH 574 37.825 90.087 47.679 1.00 48.41 O HETATM12225 O HOH 575 37.263 92.432 50.550 1.00 30.51 O HETATM12226 O HOH 576 37.219 86.334 47.173 1.00 38.23 O HETATM12227 O HOH 577 39.458 83.017 48.749 1.00 43.65 O HETATM12228 O HOH 578 37.264 83.085 50.274 1.00 27.05 O HETATM12229 O HOH 579 30.498 89.930 52.480 1.00 24.31 O HETATM12230 O HOH 580 36.450 88.277 49.041 1.00 35.71 O HETATM12231 O HOH 581 32.570 88.824 45.383 1.00 38.28 O HETATM12232 O HOH 582 27.019 87.750 45.694 1.00 23.84 O HETATM12233 O HOH 583 28.217 91.152 50.642 1.00 18.74 O HETATM12234 O HOH 584 19.770 86.083 52.869 1.00 30.45 O HETATM12235 O HOH 585 28.777 89.567 54.520 1.00 29.74 O HETATM12236 O HOH 586 27.952 91.283 57.229 1.00 39.17 O HETATM12237 O HOH 587 27.682 90.758 66.095 1.00 39.16 O HETATM12238 O HOH 588 25.255 90.236 67.947 1.00 43.96 O HETATM12239 O HOH 589 27.022 93.936 62.930 1.00 43.98 O HETATM12240 O HOH 590 18.634 92.250 61.671 1.00 43.01 O HETATM12241 O HOH 591 19.185 92.074 66.152 1.00 31.32 O HETATM12242 O HOH 592 22.813 90.471 67.683 1.00 35.04 O HETATM12243 O HOH 593 15.954 90.515 65.958 1.00 45.73 O HETATM12244 O HOH 594 20.954 90.230 58.768 1.00 23.81 O HETATM12245 O HOH 595 15.018 90.775 63.123 1.00 33.78 O HETATM12246 O HOH 596 10.823 90.382 64.580 1.00 46.83 O HETATM12247 O HOH 597 14.827 86.129 67.840 1.00 27.71 O HETATM12248 O HOH 598 13.814 90.680 60.587 1.00 38.06 O HETATM12249 O HOH 599 17.885 85.630 54.282 1.00 39.96 O HETATM12250 O HOH 600 20.265 89.119 55.969 1.00 22.20 O HETATM12251 O HOH 601 13.856 88.499 57.804 1.00 29.58 O HETATM12252 O HOH 602 10.526 85.912 56.999 1.00 31.28 O HETATM12253 O HOH 603 8.726 82.679 61.770 1.00 46.36 O HETATM12254 O HOH 604 11.593 84.092 54.791 1.00 41.46 O HETATM12255 O HOH 605 7.267 78.382 59.091 1.00 49.84 O HETATM12256 O HOH 606 9.159 80.057 61.539 1.00 30.21 O HETATM12257 O HOH 607 14.549 82.463 54.646 1.00 30.98 O HETATM12258 O HOH 608 11.268 80.120 54.206 1.00 29.57 O HETATM12259 O HOH 609 8.716 77.905 56.870 1.00 31.19 O HETATM12260 O HOH 610 25.713 69.720 61.788 1.00 13.49 O HETATM12261 O HOH 611 27.259 68.785 59.666 1.00 13.17 O HETATM12262 O HOH 612 39.455 69.487 56.687 1.00 31.91 O HETATM12263 O HOH 613 37.900 69.438 54.480 1.00 25.55 O HETATM12264 O HOH 614 36.709 71.286 53.771 1.00 35.06 O HETATM12265 O HOH 615 13.116 68.032 47.734 1.00 23.33 O HETATM12266 O HOH 616 9.507 71.806 51.198 1.00 37.36 O HETATM12267 O HOH 617 8.956 72.285 53.504 1.00 40.24 O HETATM12268 O HOH 618 8.533 77.243 63.058 1.00 30.95 O HETATM12269 O HOH 619 7.490 73.063 61.347 1.00 31.98 O HETATM12270 O HOH 620 8.793 70.321 60.430 1.00 22.78 O HETATM12271 O HOH 621 4.968 70.000 54.027 1.00 72.70 O HETATM12272 O HOH 622 3.395 70.171 56.792 1.00 59.38 O HETATM12273 O HOH 623 39.918 74.169 62.501 1.00 25.73 O HETATM12274 O HOH 624 18.988 45.768 43.671 1.00 41.49 O HETATM12275 O HOH 625 20.466 41.482 46.136 1.00 43.13 O HETATM12276 O HOH 626 21.825 41.400 48.908 1.00 39.05 O HETATM12277 O HOH 627 25.959 50.389 40.377 1.00 38.65 O HETATM12278 O HOH 628 23.811 43.200 49.497 1.00 17.63 O HETATM12279 O HOH 629 25.983 51.344 42.634 1.00 24.70 O HETATM12280 O HOH 630 25.727 34.422 42.290 1.00 41.62 O HETATM12281 O HOH 631 22.802 40.285 41.099 1.00 28.50 O HETATM12282 O HOH 632 56.470 29.131 56.285 1.00 38.46 O HETATM12283 O HOH 633 50.142 28.322 48.975 1.00 43.67 O HETATM12284 O HOH 634 53.197 31.432 48.334 1.00 47.58 O HETATM12285 O HOH 635 55.154 27.819 53.619 1.00 42.47 O HETATM12286 O HOH 636 57.520 40.195 89.734 1.00 46.99 O HETATM12287 O HOH 637 64.036 43.751 76.112 1.00 43.88 O HETATM12288 O HOH 638 42.175 39.642 44.996 1.00 18.71 O HETATM12289 O HOH 639 40.396 41.914 42.538 1.00 14.58 O HETATM12290 O HOH 640 55.230 37.262 61.927 1.00 24.70 O HETATM12291 O HOH 641 48.972 32.406 49.239 1.00 31.29 O HETATM12292 O HOH 642 60.703 49.679 90.332 1.00 34.99 O HETATM12293 O HOH 643 57.224 41.568 54.947 1.00 36.22 O HETATM12294 O HOH 644 57.688 34.481 59.617 1.00 36.77 O HETATM12295 O HOH 645 55.869 31.826 56.477 1.00 23.80 O HETATM12296 O HOH 646 56.387 34.295 52.640 1.00 35.36 O HETATM12297 O HOH 647 52.517 41.649 50.313 1.00 37.01 O HETATM12298 O HOH 648 51.003 30.837 49.904 1.00 25.33 O HETATM12299 O HOH 649 54.289 30.145 52.545 1.00 29.85 O HETATM12300 O HOH 650 52.425 38.405 46.279 1.00 52.90 O HETATM12301 O HOH 651 58.033 33.248 57.252 1.00 37.18 O HETATM12302 O HOH 652 47.320 40.356 49.865 1.00 11.62 O HETATM12303 O HOH 653 52.293 26.235 54.463 1.00 35.46 O HETATM12304 O HOH 654 49.750 23.749 69.811 1.00 35.07 O HETATM12305 O HOH 655 51.298 46.764 42.980 1.00 29.47 O HETATM12306 O HOH 656 53.033 46.159 45.072 1.00 29.55 O HETATM12307 O HOH 657 52.767 43.463 46.016 1.00 32.29 O HETATM12308 O HOH 658 51.687 47.884 40.541 1.00 52.62 O HETATM12309 O HOH 659 52.389 44.051 39.422 1.00 58.46 O HETATM12310 O HOH 660 54.419 35.023 62.781 1.00 32.30 O HETATM12311 O HOH 661 59.513 33.093 76.269 1.00 30.69 O HETATM12312 O HOH 662 59.736 42.487 73.422 1.00 46.26 O HETATM12313 O HOH 663 61.580 45.838 76.135 1.00 39.15 O HETATM12314 O HOH 664 62.512 39.282 75.852 1.00 49.39 O HETATM12315 O HOH 665 57.113 48.998 70.177 1.00 43.63 O HETATM12316 O HOH 666 58.206 45.740 70.996 1.00 37.06 O HETATM12317 O HOH 667 57.786 50.559 82.021 1.00 38.76 O HETATM12318 O HOH 668 29.429 37.654 84.211 1.00 50.81 O HETATM12319 O HOH 669 55.474 43.669 89.277 1.00 50.85 O HETATM12320 O HOH 670 56.838 41.018 87.432 1.00 37.74 O HETATM12321 O HOH 671 59.399 42.930 87.373 1.00 45.47 O HETATM12322 O HOH 672 56.526 48.236 88.732 1.00 38.58 O HETATM12323 O HOH 673 54.674 42.570 54.541 1.00 34.85 O HETATM12324 O HOH 674 54.228 39.810 62.434 1.00 13.75 O HETATM12325 O HOH 675 50.906 42.558 90.851 1.00 37.58 O HETATM12326 O HOH 676 55.526 51.930 82.717 1.00 30.20 O HETATM12327 O HOH 677 56.495 51.724 86.635 1.00 32.13 O HETATM12328 O HOH 678 60.102 50.205 87.620 1.00 40.36 O HETATM12329 O HOH 679 61.127 61.851 78.888 1.00 58.24 O HETATM12330 O HOH 680 64.741 70.883 79.596 1.00 39.42 O HETATM12331 O HOH 681 55.182 41.398 52.666 1.00 38.75 O HETATM12332 O HOH 682 41.567 39.281 88.117 1.00 39.16 O HETATM12333 O HOH 683 56.591 38.153 87.699 1.00 52.15 O HETATM12334 O HOH 684 49.516 37.473 88.741 1.00 39.28 O HETATM12335 O HOH 685 58.662 67.556 65.456 1.00 48.28 O HETATM12336 O HOH 686 47.577 33.456 51.186 1.00 19.49 O HETATM12337 O HOH 687 44.425 33.867 48.971 1.00 15.86 O HETATM12338 O HOH 688 58.986 35.878 67.569 1.00 36.94 O HETATM12339 O HOH 689 60.435 37.978 71.142 1.00 48.63 O HETATM12340 O HOH 690 55.035 44.818 68.872 1.00 32.39 O HETATM12341 O HOH 691 51.065 39.641 50.015 1.00 25.18 O HETATM12342 O HOH 692 51.601 30.385 52.523 1.00 17.26 O HETATM12343 O HOH 693 55.018 32.447 53.986 1.00 26.73 O HETATM12344 O HOH 694 50.085 38.587 47.653 1.00 38.55 O HETATM12345 O HOH 695 54.317 37.141 49.959 1.00 43.19 O HETATM12346 O HOH 696 61.718 42.073 62.697 1.00 45.48 O HETATM12347 O HOH 697 58.414 44.334 54.753 1.00 34.15 O HETATM12348 O HOH 698 37.822 44.165 75.036 1.00 45.79 O HETATM12349 O HOH 699 58.699 35.267 55.605 1.00 37.54 O HETATM12350 O HOH 700 56.908 37.131 59.741 1.00 22.39 O HETATM12351 O HOH 701 57.738 39.524 56.851 1.00 21.79 O HETATM12352 O HOH 702 54.157 32.120 58.517 1.00 17.40 O HETATM12353 O HOH 703 56.716 36.926 53.242 1.00 26.19 O HETATM12354 O HOH 704 57.855 54.346 61.197 1.00 20.88 O HETATM12355 O HOH 705 52.193 56.974 50.303 1.00 33.20 O HETATM12356 O HOH 706 59.894 66.936 63.090 1.00 42.13 O HETATM12357 O HOH 707 62.282 65.273 57.974 1.00 29.73 O HETATM12358 O HOH 708 60.257 64.228 54.295 1.00 37.66 O HETATM12359 O HOH 709 57.408 56.476 62.522 1.00 24.39 O HETATM12360 O HOH 710 52.525 32.409 63.782 1.00 22.91 O HETATM12361 O HOH 711 56.000 58.136 71.946 1.00 27.67 O HETATM12362 O HOH 712 57.997 51.787 69.150 1.00 41.17 O HETATM12363 O HOH 713 56.440 55.970 70.070 1.00 35.64 O HETATM12364 O HOH 714 47.802 21.845 55.836 1.00 36.07 O HETATM12365 O HOH 715 45.761 22.371 49.729 1.00 42.81 O HETATM12366 O HOH 716 49.004 21.616 58.225 1.00 32.43 O HETATM12367 O HOH 717 50.589 27.811 53.217 1.00 21.52 O HETATM12368 O HOH 718 45.818 22.676 54.480 1.00 27.62 O HETATM12369 O HOH 719 46.600 26.805 48.641 1.00 46.17 O HETATM12370 O HOH 720 50.081 24.145 51.026 1.00 46.27 O HETATM12371 O HOH 721 59.510 30.373 75.682 1.00 40.03 O HETATM12372 O HOH 722 52.109 26.055 56.964 1.00 35.03 O HETATM12373 O HOH 723 49.494 51.484 47.090 1.00 16.27 O HETATM12374 O HOH 724 49.416 48.393 44.043 1.00 16.92 O HETATM12375 O HOH 725 52.310 47.684 47.175 1.00 22.23 O HETATM12376 O HOH 726 56.054 47.241 52.535 1.00 35.96 O HETATM12377 O HOH 727 51.449 26.949 68.452 1.00 32.59 O HETATM12378 O HOH 728 49.688 24.171 67.198 1.00 30.49 O HETATM12379 O HOH 729 54.004 43.053 51.846 1.00 36.96 O HETATM12380 O HOH 730 51.722 43.368 48.555 1.00 25.76 O HETATM12381 O HOH 731 55.273 33.340 60.710 1.00 27.38 O HETATM12382 O HOH 732 50.981 44.404 42.009 1.00 38.22 O HETATM12383 O HOH 733 51.326 42.178 43.959 1.00 39.85 O HETATM12384 O HOH 734 29.844 35.635 39.281 1.00 43.48 O HETATM12385 O HOH 735 54.789 33.562 65.000 1.00 30.77 O HETATM12386 O HOH 736 53.551 27.657 67.649 1.00 32.98 O HETATM12387 O HOH 737 49.886 50.628 40.593 1.00 32.50 O HETATM12388 O HOH 738 55.292 32.936 69.141 1.00 28.88 O HETATM12389 O HOH 739 56.886 32.478 72.738 1.00 33.74 O HETATM12390 O HOH 740 50.455 54.144 43.681 1.00 32.84 O HETATM12391 O HOH 741 29.350 61.184 44.672 1.00 46.69 O HETATM12392 O HOH 742 31.335 59.432 40.106 1.00 37.83 O HETATM12393 O HOH 743 35.429 60.139 38.636 1.00 43.89 O HETATM12394 O HOH 744 58.552 34.399 73.891 1.00 20.07 O HETATM12395 O HOH 745 57.977 40.262 72.460 1.00 24.89 O HETATM12396 O HOH 746 60.102 37.751 73.696 1.00 38.07 O HETATM12397 O HOH 747 25.597 57.584 40.424 1.00 56.35 O HETATM12398 O HOH 748 29.833 60.405 42.026 1.00 42.48 O HETATM12399 O HOH 749 14.281 35.938 65.006 1.00 40.88 O HETATM12400 O HOH 750 63.927 40.387 77.919 1.00 38.61 O HETATM12401 O HOH 751 62.637 38.739 81.814 1.00 41.33 O HETATM12402 O HOH 752 60.364 41.116 75.263 1.00 29.71 O HETATM12403 O HOH 753 62.929 41.302 84.593 1.00 53.90 O HETATM12404 O HOH 754 38.833 48.732 72.767 1.00 31.24 O HETATM12405 O HOH 755 55.235 48.817 72.385 1.00 19.55 O HETATM12406 O HOH 756 57.725 49.025 80.048 1.00 25.74 O HETATM12407 O HOH 757 58.907 44.029 75.059 1.00 24.76 O HETATM12408 O HOH 758 58.580 46.482 73.562 1.00 22.50 O HETATM12409 O HOH 759 31.806 38.770 83.667 1.00 55.77 O HETATM12410 O HOH 760 58.162 45.334 87.232 1.00 45.57 O HETATM12411 O HOH 761 60.393 36.748 83.026 1.00 40.86 O HETATM12412 O HOH 762 55.433 43.061 86.318 1.00 17.22 O HETATM12413 O HOH 763 60.366 37.675 87.744 1.00 49.10 O HETATM12414 O HOH 764 59.344 64.243 76.043 1.00 34.70 O HETATM12415 O HOH 765 61.084 43.814 85.044 1.00 38.79 O HETATM12416 O HOH 766 57.508 49.465 86.879 1.00 33.37 O HETATM12417 O HOH 767 61.261 47.028 78.403 1.00 39.35 O HETATM12418 O HOH 768 61.070 48.784 85.226 1.00 50.96 O HETATM12419 O HOH 769 57.582 59.860 76.609 1.00 30.36 O HETATM12420 O HOH 770 58.919 62.477 80.373 1.00 38.27 O HETATM12421 O HOH 771 61.440 67.736 77.615 1.00 34.99 O HETATM12422 O HOH 772 60.249 65.511 78.194 1.00 41.76 O HETATM12423 O HOH 773 60.293 66.047 82.706 1.00 37.37 O HETATM12424 O HOH 774 54.496 51.317 84.828 1.00 33.09 O HETATM12425 O HOH 775 49.690 68.451 85.678 1.00 39.62 O HETATM12426 O HOH 776 52.986 67.306 86.632 1.00 30.92 O HETATM12427 O HOH 777 52.645 46.455 89.539 1.00 33.97 O HETATM12428 O HOH 778 52.568 42.641 88.752 1.00 26.50 O HETATM12429 O HOH 779 63.564 68.602 78.922 1.00 40.67 O HETATM12430 O HOH 780 63.300 69.327 70.155 1.00 52.39 O HETATM12431 O HOH 781 41.835 41.763 88.773 1.00 35.70 O HETATM12432 O HOH 782 46.922 39.662 91.380 1.00 33.20 O HETATM12433 O HOH 783 43.786 38.779 86.324 1.00 25.27 O HETATM12434 O HOH 784 52.007 37.851 86.996 1.00 29.79 O HETATM12435 O HOH 785 57.319 65.841 67.004 1.00 24.89 O HETATM12436 O HOH 786 52.584 69.492 59.969 1.00 46.02 O HETATM12437 O HOH 787 62.043 67.471 74.964 1.00 46.56 O HETATM12438 O HOH 788 53.758 40.138 87.677 1.00 29.16 O HETATM12439 O HOH 789 57.359 36.559 83.670 1.00 25.53 O HETATM12440 O HOH 790 57.278 62.313 68.786 1.00 29.01 O HETATM12441 O HOH 791 48.188 39.917 77.288 1.00 11.43 O HETATM12442 O HOH 792 48.599 62.144 55.521 1.00 17.79 O HETATM12443 O HOH 793 59.052 38.457 68.680 1.00 26.92 O HETATM12444 O HOH 794 49.961 62.321 51.616 1.00 32.20 O HETATM12445 O HOH 795 50.559 59.543 45.029 1.00 56.09 O HETATM12446 O HOH 796 51.525 60.242 49.647 1.00 41.04 O HETATM12447 O HOH 797 58.063 42.926 67.480 1.00 41.20 O HETATM12448 O HOH 798 52.856 44.893 67.572 1.00 28.01 O HETATM12449 O HOH 799 55.605 34.731 67.248 1.00 31.46 O HETATM12450 O HOH 800 58.962 38.602 60.896 1.00 27.99 O HETATM12451 O HOH 801 59.292 43.938 65.051 1.00 44.92 O HETATM12452 O HOH 802 60.178 46.500 65.100 1.00 55.01 O HETATM12453 O HOH 803 61.181 43.021 59.517 1.00 31.48 O HETATM12454 O HOH 804 60.733 45.399 56.974 1.00 43.76 O HETATM12455 O HOH 805 59.314 48.610 63.839 1.00 39.59 O HETATM12456 O HOH 806 55.281 50.446 63.740 1.00 27.24 O HETATM12457 O HOH 807 59.104 52.439 62.556 1.00 32.62 O HETATM12458 O HOH 808 56.591 53.116 59.057 1.00 20.21 O HETATM12459 O HOH 809 37.880 46.766 74.429 1.00 39.59 O HETATM12460 O HOH 810 62.165 48.322 57.604 1.00 36.41 O HETATM12461 O HOH 811 63.820 52.524 63.900 1.00 27.27 O HETATM12462 O HOH 812 59.816 55.065 59.454 1.00 20.18 O HETATM12463 O HOH 813 58.113 54.830 57.404 1.00 19.75 O HETATM12464 O HOH 814 54.392 55.763 51.505 1.00 19.39 O HETATM12465 O HOH 815 60.336 59.572 52.891 1.00 38.88 O HETATM12466 O HOH 816 58.837 65.590 60.799 1.00 38.23 O HETATM12467 O HOH 817 59.116 58.497 61.347 1.00 24.84 O HETATM12468 O HOH 818 59.865 64.692 58.475 1.00 40.42 O HETATM12469 O HOH 819 20.339 44.115 55.150 1.00 34.82 O HETATM12470 O HOH 820 22.510 58.755 47.604 1.00 41.58 O HETATM12471 O HOH 821 25.979 59.774 46.683 1.00 41.51 O HETATM12472 O HOH 822 26.766 62.147 44.784 1.00 47.58 O HETATM12473 O HOH 823 21.206 53.452 44.223 1.00 48.50 O HETATM12474 O HOH 824 58.052 62.173 52.362 1.00 41.06 O HETATM12475 O HOH 825 55.291 69.674 54.244 1.00 47.88 O HETATM12476 O HOH 826 50.479 63.188 54.106 1.00 25.15 O HETATM12477 O HOH 827 55.538 58.582 62.875 1.00 25.57 O HETATM12478 O HOH 828 58.720 65.578 56.299 1.00 45.99 O HETATM12479 O HOH 829 56.031 62.331 63.801 1.00 18.87 O HETATM12480 O HOH 830 54.725 57.723 65.267 1.00 34.29 O HETATM12481 O HOH 831 56.295 57.325 74.387 1.00 27.50 O HETATM12482 O HOH 832 57.545 54.869 74.300 1.00 37.76 O HETATM12483 O HOH 833 47.869 53.762 67.511 1.00 13.03 O HETATM12484 O HOH 834 55.044 52.243 69.553 1.00 39.44 O HETATM12485 O HOH 835 55.990 49.591 67.795 1.00 41.05 O HETATM12486 O HOH 836 54.585 54.288 68.751 1.00 28.30 O HETATM12487 O HOH 837 52.410 48.756 68.262 1.00 17.21 O HETATM12488 O HOH 838 52.746 51.390 70.427 1.00 34.14 O HETATM12489 O HOH 839 55.111 54.977 66.158 1.00 36.17 O HETATM12490 O HOH 840 38.802 45.551 90.779 1.00 47.29 O HETATM12491 O HOH 841 47.376 57.745 63.755 1.00 14.75 O HETATM12492 O HOH 842 50.455 32.888 88.299 1.00 46.88 O HETATM12493 O HOH 843 55.461 47.988 65.440 1.00 28.21 O HETATM12494 O HOH 844 51.391 25.923 82.824 1.00 42.17 O HETATM12495 O HOH 845 57.744 29.984 73.768 1.00 36.63 O HETATM12496 O HOH 846 44.436 19.694 80.922 1.00 39.77 O HETATM12497 O HOH 847 41.756 27.457 85.900 1.00 44.26 O HETATM12498 O HOH 848 52.724 47.128 51.964 1.00 25.08 O HETATM12499 O HOH 849 54.741 53.054 51.195 1.00 19.88 O HETATM12500 O HOH 850 51.319 53.040 48.492 1.00 25.14 O HETATM12501 O HOH 851 49.824 48.796 46.756 1.00 13.06 O HETATM12502 O HOH 852 54.018 49.865 47.789 1.00 52.30 O HETATM12503 O HOH 853 55.517 49.814 52.080 1.00 23.21 O HETATM12504 O HOH 854 40.257 33.630 85.478 1.00 40.24 O HETATM12505 O HOH 855 49.125 40.199 51.784 1.00 14.54 O HETATM12506 O HOH 856 52.035 45.897 49.340 1.00 22.20 O HETATM12507 O HOH 857 49.111 42.069 48.260 1.00 15.53 O HETATM12508 O HOH 858 53.080 45.371 53.945 1.00 21.80 O HETATM12509 O HOH 859 47.068 40.923 42.460 1.00 45.74 O HETATM12510 O HOH 860 48.520 44.665 41.704 1.00 30.74 O HETATM12511 O HOH 861 48.009 39.051 45.800 1.00 30.84 O HETATM12512 O HOH 862 49.415 41.288 45.621 1.00 26.56 O HETATM12513 O HOH 863 43.000 41.244 40.443 1.00 49.42 O HETATM12514 O HOH 864 27.646 37.094 39.768 1.00 36.46 O HETATM12515 O HOH 865 28.928 46.336 34.222 1.00 35.02 O HETATM12516 O HOH 866 47.173 47.353 38.958 1.00 46.60 O HETATM12517 O HOH 867 32.876 37.591 34.876 1.00 35.66 O HETATM12518 O HOH 868 36.586 38.129 34.061 1.00 43.81 O HETATM12519 O HOH 869 48.121 50.511 42.780 1.00 15.55 O HETATM12520 O HOH 870 47.906 47.260 41.395 1.00 42.26 O HETATM12521 O HOH 871 30.369 39.553 33.877 1.00 45.33 O HETATM12522 O HOH 872 31.673 44.434 31.469 1.00 45.40 O HETATM12523 O HOH 873 36.457 41.667 32.386 1.00 48.91 O HETATM12524 O HOH 874 41.891 42.584 33.889 1.00 41.41 O HETATM12525 O HOH 875 40.303 41.942 29.922 1.00 35.27 O HETATM12526 O HOH 876 44.547 47.917 36.608 1.00 36.61 O HETATM12527 O HOH 877 48.964 50.541 38.097 1.00 37.68 O HETATM12528 O HOH 878 43.018 49.553 37.881 1.00 16.70 O HETATM12529 O HOH 879 34.777 36.442 39.124 1.00 25.96 O HETATM12530 O HOH 880 38.180 32.953 42.098 1.00 40.53 O HETATM12531 O HOH 881 39.991 35.397 39.666 1.00 46.96 O HETATM12532 O HOH 882 47.601 54.336 32.982 1.00 36.55 O HETATM12533 O HOH 883 39.363 57.426 39.308 1.00 24.79 O HETATM12534 O HOH 884 48.721 52.803 36.741 1.00 38.48 O HETATM12535 O HOH 885 37.235 52.364 40.308 1.00 29.47 O HETATM12536 O HOH 886 19.232 43.321 58.527 1.00 25.04 O HETATM12537 O HOH 887 39.142 58.265 45.665 1.00 11.04 O HETATM12538 O HOH 888 48.434 52.609 44.658 1.00 17.65 O HETATM12539 O HOH 889 50.097 56.828 43.730 1.00 40.41 O HETATM12540 O HOH 890 42.361 59.028 39.080 1.00 21.36 O HETATM12541 O HOH 891 48.835 59.439 42.663 1.00 38.84 O HETATM12542 O HOH 892 44.658 65.787 43.209 1.00 38.91 O HETATM12543 O HOH 893 43.038 64.452 45.846 1.00 22.62 O HETATM12544 O HOH 894 38.182 59.874 39.347 1.00 37.85 O HETATM12545 O HOH 895 40.408 65.021 40.231 1.00 32.82 O HETATM12546 O HOH 896 40.238 60.855 38.583 1.00 30.17 O HETATM12547 O HOH 897 33.607 57.780 39.708 1.00 29.02 O HETATM12548 O HOH 898 31.382 60.852 47.106 1.00 30.76 O HETATM12549 O HOH 899 27.918 58.823 42.821 1.00 32.08 O HETATM12550 O HOH 900 19.428 31.800 61.883 1.00 35.74 O HETATM12551 O HOH 901 15.423 35.588 62.203 1.00 47.92 O HETATM12552 O HOH 902 16.093 37.374 66.191 1.00 28.91 O HETATM12553 O HOH 903 16.586 41.133 64.982 1.00 37.21 O HETATM12554 O HOH 904 16.763 40.105 60.208 1.00 30.12 O HETATM12555 O HOH 905 14.464 41.970 56.389 1.00 56.14 O HETATM12556 O HOH 906 26.421 24.655 51.070 1.00 21.69 O HETATM12557 O HOH 907 21.735 27.751 58.733 1.00 37.74 O HETATM12558 O HOH 908 44.677 55.186 65.652 1.00 40.10 O HETATM12559 O HOH 909 40.901 50.263 73.874 1.00 32.29 O HETATM12560 O HOH 910 42.118 54.493 74.363 1.00 24.64 O HETATM12561 O HOH 911 41.041 57.414 71.655 1.00 42.36 O HETATM12562 O HOH 912 37.232 39.313 81.551 1.00 37.41 O HETATM12563 O HOH 913 37.291 40.418 78.504 1.00 34.60 O HETATM12564 O HOH 914 34.491 38.285 81.889 1.00 46.65 O HETATM12565 O HOH 915 20.032 26.015 72.980 1.00 36.89 O HETATM12566 O HOH 916 14.358 27.775 67.284 1.00 52.59 O HETATM12567 O HOH 917 22.042 22.963 58.318 1.00 35.96 O HETATM12568 O HOH 918 57.183 62.501 76.768 1.00 25.31 O HETATM12569 O HOH 919 57.784 60.109 80.253 1.00 31.14 O HETATM12570 O HOH 920 58.567 65.237 80.558 1.00 23.26 O HETATM12571 O HOH 921 55.460 58.618 77.727 1.00 17.19 O HETATM12572 O HOH 922 59.151 69.042 78.660 1.00 19.18 O HETATM12573 O HOH 923 49.258 65.755 85.974 1.00 20.59 O HETATM12574 O HOH 924 54.295 69.335 85.472 1.00 17.59 O HETATM12575 O HOH 925 59.671 75.559 75.895 1.00 45.66 O HETATM12576 O HOH 926 62.171 69.658 73.396 1.00 38.86 O HETATM12577 O HOH 927 61.022 69.177 78.763 1.00 33.68 O HETATM12578 O HOH 928 37.901 25.144 48.118 1.00 23.33 O HETATM12579 O HOH 929 45.712 31.310 45.459 1.00 43.09 O HETATM12580 O HOH 930 39.315 22.824 48.248 1.00 22.96 O HETATM12581 O HOH 931 59.447 68.592 69.838 1.00 38.48 O HETATM12582 O HOH 932 59.203 71.299 69.027 1.00 39.64 O HETATM12583 O HOH 933 59.763 65.512 73.447 1.00 28.83 O HETATM12584 O HOH 934 57.964 65.943 69.840 1.00 32.00 O HETATM12585 O HOH 935 54.648 65.825 67.816 1.00 14.82 O HETATM12586 O HOH 936 40.871 18.310 72.010 1.00 40.56 O HETATM12587 O HOH 937 47.156 21.170 72.929 1.00 44.83 O HETATM12588 O HOH 938 50.561 68.160 68.535 1.00 14.82 O HETATM12589 O HOH 939 50.874 69.534 62.255 1.00 37.98 O HETATM12590 O HOH 940 48.841 67.270 65.497 1.00 26.69 O HETATM12591 O HOH 941 37.105 16.864 74.145 1.00 30.90 O HETATM12592 O HOH 942 41.230 17.467 74.328 1.00 44.21 O HETATM12593 O HOH 943 33.422 17.190 79.167 1.00 38.37 O HETATM12594 O HOH 944 58.875 66.633 58.989 1.00 33.73 O HETATM12595 O HOH 945 35.439 15.976 70.803 1.00 44.42 O HETATM12596 O HOH 946 49.105 66.012 63.457 1.00 31.92 O HETATM12597 O HOH 947 38.504 18.917 72.038 1.00 35.61 O HETATM12598 O HOH 948 54.644 62.953 68.133 1.00 17.25 O HETATM12599 O HOH 949 57.416 60.173 66.800 1.00 30.21 O HETATM12600 O HOH 950 48.810 19.138 59.377 1.00 46.91 O HETATM12601 O HOH 951 44.231 58.060 71.729 1.00 22.28 O HETATM12602 O HOH 952 44.710 57.186 66.653 1.00 25.64 O HETATM12603 O HOH 953 42.232 55.494 64.884 1.00 26.45 O HETATM12604 O HOH 954 35.421 25.505 46.148 1.00 46.79 O HETATM12605 O HOH 955 25.914 25.715 47.837 1.00 44.97 O HETATM12606 O HOH 956 39.485 62.541 60.995 1.00 14.68 O HETATM12607 O HOH 957 38.675 60.622 59.246 1.00 15.33 O HETATM12608 O HOH 958 49.260 60.139 57.084 1.00 14.89 O HETATM12609 O HOH 959 47.356 63.451 49.357 1.00 38.61 O HETATM12610 O HOH 960 43.301 62.438 55.194 1.00 26.53 O HETATM12611 O HOH 961 43.064 65.309 52.891 1.00 21.76 O HETATM12612 O HOH 962 29.370 28.080 45.522 1.00 42.80 O HETATM12613 O HOH 963 25.739 29.278 47.456 1.00 35.19 O HETATM12614 O HOH 964 28.986 33.221 40.247 1.00 41.19 O HETATM12615 O HOH 965 49.742 60.140 47.642 1.00 36.78 O HETATM12616 O HOH 966 49.256 56.155 47.177 1.00 39.49 O HETATM12617 O HOH 967 49.988 55.764 49.259 1.00 28.39 O HETATM12618 O HOH 968 36.718 63.711 42.494 1.00 23.18 O HETATM12619 O HOH 969 35.650 55.854 66.406 1.00 32.21 O HETATM12620 O HOH 970 38.493 54.576 65.752 1.00 17.50 O HETATM12621 O HOH 971 36.536 51.196 71.206 1.00 16.77 O HETATM12622 O HOH 972 37.646 44.638 65.682 1.00 11.77 O HETATM12623 O HOH 973 38.737 46.241 72.067 1.00 50.90 O HETATM12624 O HOH 974 26.494 53.267 56.017 1.00 36.54 O HETATM12625 O HOH 975 27.787 58.150 53.196 1.00 21.31 O HETATM12626 O HOH 976 28.851 57.916 50.520 1.00 31.13 O HETATM12627 O HOH 977 20.608 46.481 54.134 1.00 24.95 O HETATM12628 O HOH 978 19.006 50.599 49.263 1.00 45.85 O HETATM12629 O HOH 979 20.854 48.564 46.398 1.00 30.44 O HETATM12630 O HOH 980 20.245 51.688 46.576 1.00 43.83 O HETATM12631 O HOH 981 23.751 43.055 54.669 1.00 26.93 O HETATM12632 O HOH 982 20.259 55.294 48.718 1.00 25.54 O HETATM12633 O HOH 983 22.791 56.517 46.221 1.00 33.80 O HETATM12634 O HOH 984 22.818 56.100 43.655 1.00 56.33 O HETATM12635 O HOH 985 25.193 57.822 44.991 1.00 36.88 O HETATM12636 O HOH 986 28.682 58.988 48.063 1.00 37.09 O HETATM12637 O HOH 987 28.016 58.866 45.608 1.00 37.66 O HETATM12638 O HOH 988 21.839 59.049 53.458 1.00 18.75 O HETATM12639 O HOH 989 26.955 50.691 45.055 1.00 13.66 O HETATM12640 O HOH 990 34.224 53.651 40.591 1.00 21.12 O HETATM12641 O HOH 991 30.319 53.203 38.753 1.00 32.13 O HETATM12642 O HOH 992 28.663 50.099 40.605 1.00 23.25 O HETATM12643 O HOH 993 45.537 51.526 68.929 1.00 14.67 O HETATM12644 O HOH 994 46.725 46.275 71.767 1.00 14.23 O HETATM12645 O HOH 995 51.805 54.184 68.300 1.00 15.20 O HETATM12646 O HOH 996 48.209 47.212 73.897 1.00 17.47 O HETATM12647 O HOH 997 57.685 51.869 76.636 1.00 48.23 O HETATM12648 O HOH 998 53.810 57.147 76.057 1.00 14.44 O HETATM12649 O HOH 999 47.706 54.763 79.510 1.00 37.49 O HETATM12650 O HOH 1000 56.045 54.145 77.100 1.00 19.75 O HETATM12651 O HOH 1001 41.500 52.022 75.646 1.00 30.90 O HETATM12652 O HOH 1002 44.210 54.735 77.268 1.00 37.56 O HETATM12653 O HOH 1003 45.897 54.161 80.111 1.00 19.69 O HETATM12654 O HOH 1004 44.354 40.508 83.942 1.00 13.95 O HETATM12655 O HOH 1005 42.529 46.943 89.335 1.00 22.14 O HETATM12656 O HOH 1006 39.684 44.024 88.317 1.00 32.36 O HETATM12657 O HOH 1007 37.567 41.009 83.424 1.00 40.02 O HETATM12658 O HOH 1008 37.092 44.050 87.489 1.00 41.76 O HETATM12659 O HOH 1009 36.083 43.937 85.354 1.00 41.92 O HETATM12660 O HOH 1010 39.729 38.107 86.281 1.00 41.06 O HETATM12661 O HOH 1011 39.358 37.108 82.007 1.00 38.53 O HETATM12662 O HOH 1012 52.437 33.405 84.805 1.00 19.64 O HETATM12663 O HOH 1013 44.797 35.008 85.538 1.00 30.53 O HETATM12664 O HOH 1014 45.988 37.596 87.963 1.00 38.07 O HETATM12665 O HOH 1015 48.738 34.863 87.914 1.00 39.96 O HETATM12666 O HOH 1016 42.551 31.279 86.763 1.00 45.49 O HETATM12667 O HOH 1017 51.310 30.622 87.017 1.00 35.83 O HETATM12668 O HOH 1018 50.599 27.834 84.675 1.00 41.02 O HETATM12669 O HOH 1019 49.799 34.371 81.019 1.00 15.92 O HETATM12670 O HOH 1020 46.583 24.838 83.081 1.00 35.11 O HETATM12671 O HOH 1021 54.444 35.543 85.896 1.00 32.11 O HETATM12672 O HOH 1022 58.455 33.490 78.977 1.00 27.12 O HETATM12673 O HOH 1023 53.702 30.711 83.791 1.00 25.47 O HETATM12674 O HOH 1024 56.920 34.345 84.834 1.00 44.31 O HETATM12675 O HOH 1025 51.839 25.846 80.132 1.00 31.45 O HETATM12676 O HOH 1026 53.127 28.344 82.333 1.00 31.61 O HETATM12677 O HOH 1027 53.394 25.790 72.022 1.00 36.12 O HETATM12678 O HOH 1028 55.101 30.059 67.399 1.00 33.88 O HETATM12679 O HOH 1029 58.287 28.683 69.090 1.00 57.19 O HETATM12680 O HOH 1030 55.505 28.899 75.059 1.00 20.48 O HETATM12681 O HOH 1031 54.752 26.477 74.787 1.00 38.57 O HETATM12682 O HOH 1032 49.141 32.249 73.834 1.00 15.32 O HETATM12683 O HOH 1033 43.381 35.767 73.564 1.00 11.91 O HETATM12684 O HOH 1034 46.223 22.505 81.550 1.00 42.74 O HETATM12685 O HOH 1035 37.450 25.023 84.761 1.00 44.04 O HETATM12686 O HOH 1036 43.742 28.961 85.140 1.00 47.76 O HETATM12687 O HOH 1037 43.717 22.262 80.658 1.00 22.46 O HETATM12688 O HOH 1038 39.073 28.648 83.373 1.00 27.52 O HETATM12689 O HOH 1039 33.398 28.155 82.433 1.00 52.17 O HETATM12690 O HOH 1040 43.116 36.844 84.537 1.00 33.88 O HETATM12691 O HOH 1041 40.294 35.832 83.908 1.00 43.97 O HETATM12692 O HOH 1042 43.598 32.273 78.679 1.00 12.95 O HETATM12693 O HOH 1043 47.715 40.692 65.056 1.00 14.09 O HETATM12694 O HOH 1044 25.102 44.385 42.780 1.00 16.28 O HETATM12695 O HOH 1045 25.022 47.366 39.944 1.00 26.26 O HETATM12696 O HOH 1046 29.358 43.881 35.454 1.00 21.60 O HETATM12697 O HOH 1047 25.967 39.226 38.470 1.00 38.58 O HETATM12698 O HOH 1048 26.813 40.517 35.385 1.00 39.86 O HETATM12699 O HOH 1049 24.378 42.656 40.744 1.00 31.98 O HETATM12700 O HOH 1050 34.820 39.334 35.677 1.00 20.90 O HETATM12701 O HOH 1051 33.835 41.285 32.323 1.00 52.80 O HETATM12702 O HOH 1052 34.024 46.010 31.600 1.00 27.22 O HETATM12703 O HOH 1053 38.534 44.811 32.711 1.00 34.99 O HETATM12704 O HOH 1054 30.748 42.298 33.748 1.00 30.07 O HETATM12705 O HOH 1055 39.690 42.369 32.723 1.00 38.32 O HETATM12706 O HOH 1056 41.055 46.056 37.912 1.00 28.50 O HETATM12707 O HOH 1057 42.078 39.783 38.641 1.00 43.88 O HETATM12708 O HOH 1058 42.399 42.425 38.202 1.00 59.37 O HETATM12709 O HOH 1059 41.359 40.510 35.409 1.00 42.41 O HETATM12710 O HOH 1060 38.824 37.007 37.931 1.00 45.30 O HETATM12711 O HOH 1061 35.313 38.960 38.362 1.00 20.11 O HETATM12712 O HOH 1062 34.700 34.211 42.734 1.00 29.84 O HETATM12713 O HOH 1063 36.966 35.583 41.083 1.00 23.24 O HETATM12714 O HOH 1064 36.966 32.035 48.154 1.00 15.92 O HETATM12715 O HOH 1065 44.391 36.852 45.435 1.00 30.99 O HETATM12716 O HOH 1066 22.941 38.640 48.505 1.00 38.68 O HETATM12717 O HOH 1067 27.108 34.169 47.386 1.00 17.91 O HETATM12718 O HOH 1068 24.110 35.643 47.119 1.00 23.82 O HETATM12719 O HOH 1069 25.977 41.223 49.062 1.00 14.73 O HETATM12720 O HOH 1070 24.803 41.517 52.864 1.00 25.18 O HETATM12721 O HOH 1071 22.026 37.701 51.496 1.00 34.31 O HETATM12722 O HOH 1072 22.461 41.089 51.997 1.00 42.92 O HETATM12723 O HOH 1073 21.735 43.391 57.766 1.00 28.99 O HETATM12724 O HOH 1074 25.692 49.320 60.631 1.00 16.37 O HETATM12725 O HOH 1075 22.412 40.731 56.748 1.00 26.11 O HETATM12726 O HOH 1076 22.770 44.921 59.863 1.00 26.10 O HETATM12727 O HOH 1077 21.774 46.183 62.349 1.00 22.15 O HETATM12728 O HOH 1078 20.369 46.405 64.790 1.00 29.02 O HETATM12729 O HOH 1079 26.101 47.224 67.083 1.00 10.87 O HETATM12730 O HOH 1080 24.717 47.625 74.915 1.00 16.88 O HETATM12731 O HOH 1081 20.523 41.676 75.811 1.00 23.48 O HETATM12732 O HOH 1082 28.928 45.626 85.140 1.00 47.37 O HETATM12733 O HOH 1083 30.009 44.191 77.205 1.00 30.20 O HETATM12734 O HOH 1084 27.369 47.274 83.586 1.00 34.50 O HETATM12735 O HOH 1085 26.072 42.880 77.933 1.00 34.25 O HETATM12736 O HOH 1086 24.977 38.953 73.720 1.00 23.86 O HETATM12737 O HOH 1087 17.779 36.520 71.130 1.00 25.22 O HETATM12738 O HOH 1088 15.735 37.999 72.033 1.00 34.59 O HETATM12739 O HOH 1089 17.748 38.783 64.645 1.00 21.94 O HETATM12740 O HOH 1090 18.144 42.674 66.374 1.00 20.82 O HETATM12741 O HOH 1091 18.136 34.090 60.602 1.00 23.89 O HETATM12742 O HOH 1092 16.842 38.086 61.967 1.00 30.92 O HETATM12743 O HOH 1093 16.510 36.017 68.711 1.00 29.59 O HETATM12744 O HOH 1094 16.101 31.728 69.717 1.00 43.02 O HETATM12745 O HOH 1095 18.800 40.623 58.344 1.00 24.83 O HETATM12746 O HOH 1096 17.274 32.677 58.625 1.00 42.23 O HETATM12747 O HOH 1097 14.307 40.526 58.658 1.00 55.19 O HETATM12748 O HOH 1098 19.556 37.688 52.318 1.00 46.33 O HETATM12749 O HOH 1099 21.558 38.565 55.215 1.00 26.70 O HETATM12750 O HOH 1100 21.032 33.345 50.013 1.00 24.33 O HETATM12751 O HOH 1101 16.223 33.311 56.253 1.00 40.22 O HETATM12752 O HOH 1102 19.970 31.278 57.043 1.00 38.94 O HETATM12753 O HOH 1103 20.455 26.707 49.161 1.00 45.97 O HETATM12754 O HOH 1104 22.848 29.919 47.121 1.00 31.99 O HETATM12755 O HOH 1105 20.215 26.987 54.947 1.00 54.87 O HETATM12756 O HOH 1106 20.183 24.870 53.136 1.00 52.78 O HETATM12757 O HOH 1107 20.140 33.014 47.430 1.00 59.10 O HETATM12758 O HOH 1108 27.403 26.603 52.789 1.00 13.75 O HETATM12759 O HOH 1109 26.674 23.552 58.947 1.00 28.14 O HETATM12760 O HOH 1110 23.937 26.877 59.309 1.00 23.88 O HETATM12761 O HOH 1111 27.957 22.580 56.450 1.00 23.85 O HETATM12762 O HOH 1112 28.178 22.938 52.645 1.00 21.26 O HETATM12763 O HOH 1113 31.769 22.134 57.872 1.00 15.45 O HETATM12764 O HOH 1114 38.499 33.392 66.115 1.00 23.23 O HETATM12765 O HOH 1115 35.065 40.876 74.320 1.00 33.71 O HETATM12766 O HOH 1116 36.625 40.044 68.390 1.00 22.03 O HETATM12767 O HOH 1117 39.076 33.420 68.591 1.00 15.95 O HETATM12768 O HOH 1118 36.979 39.200 76.070 1.00 23.88 O HETATM12769 O HOH 1119 38.971 38.541 79.737 1.00 33.23 O HETATM12770 O HOH 1120 34.982 37.407 75.985 1.00 32.20 O HETATM12771 O HOH 1121 29.395 32.271 80.547 1.00 39.30 O HETATM12772 O HOH 1122 35.498 35.797 82.507 1.00 31.81 O HETATM12773 O HOH 1123 31.056 36.074 74.242 1.00 28.06 O HETATM12774 O HOH 1124 33.476 37.870 79.412 1.00 33.52 O HETATM12775 O HOH 1125 35.234 34.949 74.521 1.00 18.53 O HETATM12776 O HOH 1126 27.827 27.443 76.811 1.00 37.40 O HETATM12777 O HOH 1127 27.142 30.685 79.322 1.00 43.71 O HETATM12778 O HOH 1128 23.984 32.043 78.125 1.00 44.68 O HETATM12779 O HOH 1129 24.503 32.914 75.722 1.00 24.21 O HETATM12780 O HOH 1130 33.313 31.281 72.020 1.00 17.43 O HETATM12781 O HOH 1131 28.408 36.109 73.337 1.00 30.44 O HETATM12782 O HOH 1132 32.936 35.154 73.006 1.00 26.49 O HETATM12783 O HOH 1133 21.992 27.428 74.313 1.00 22.86 O HETATM12784 O HOH 1134 20.867 23.599 70.728 1.00 34.32 O HETATM12785 O HOH 1135 27.032 25.752 75.449 1.00 35.03 O HETATM12786 O HOH 1136 24.454 21.785 70.583 1.00 33.16 O HETATM12787 O HOH 1137 17.726 26.277 69.182 1.00 32.50 O HETATM12788 O HOH 1138 16.628 30.071 67.958 1.00 34.92 O HETATM12789 O HOH 1139 22.002 32.027 74.356 1.00 32.34 O HETATM12790 O HOH 1140 17.931 34.410 72.871 1.00 29.56 O HETATM12791 O HOH 1141 20.016 33.652 74.442 1.00 43.62 O HETATM12792 O HOH 1142 18.308 30.631 64.065 1.00 29.54 O HETATM12793 O HOH 1143 17.899 26.361 64.635 1.00 45.72 O HETATM12794 O HOH 1144 21.043 24.718 61.971 1.00 52.27 O HETATM12795 O HOH 1145 24.177 23.007 68.456 1.00 42.83 O HETATM12796 O HOH 1146 17.427 22.105 65.184 1.00 57.81 O HETATM12797 O HOH 1147 24.018 24.152 59.878 1.00 29.98 O HETATM12798 O HOH 1148 29.480 22.248 66.029 1.00 20.38 O HETATM12799 O HOH 1149 28.791 19.692 64.068 1.00 36.53 O HETATM12800 O HOH 1150 27.451 21.544 60.365 1.00 27.17 O HETATM12801 O HOH 1151 29.998 22.065 59.932 1.00 19.11 O HETATM12802 O HOH 1152 42.060 35.587 65.621 1.00 11.42 O HETATM12803 O HOH 1153 49.160 30.962 71.332 1.00 13.44 O HETATM12804 O HOH 1154 46.109 39.412 66.748 1.00 14.17 O HETATM12805 O HOH 1155 42.399 38.903 67.061 1.00 13.42 O HETATM12806 O HOH 1156 44.296 38.578 64.883 1.00 12.80 O HETATM12807 O HOH 1157 35.760 36.233 64.753 1.00 14.93 O HETATM12808 O HOH 1158 37.377 33.763 50.348 1.00 21.64 O HETATM12809 O HOH 1159 36.671 26.208 50.221 1.00 13.50 O HETATM12810 O HOH 1160 43.348 28.953 45.923 1.00 57.58 O HETATM12811 O HOH 1161 37.861 33.072 44.740 1.00 19.71 O HETATM12812 O HOH 1162 43.993 34.124 46.328 1.00 30.44 O HETATM12813 O HOH 1163 38.530 27.738 46.828 1.00 26.37 O HETATM12814 O HOH 1164 44.140 24.756 48.884 1.00 41.91 O HETATM12815 O HOH 1165 40.069 21.523 50.507 1.00 17.85 O HETATM12816 O HOH 1166 43.607 28.641 67.389 1.00 11.30 O HETATM12817 O HOH 1167 43.679 22.326 70.697 1.00 14.03 O HETATM12818 O HOH 1168 41.274 27.171 71.062 1.00 11.62 O HETATM12819 O HOH 1169 50.732 25.908 71.300 1.00 33.01 O HETATM12820 O HOH 1170 49.093 23.467 74.320 1.00 34.25 O HETATM12821 O HOH 1171 47.425 22.846 70.543 1.00 29.48 O HETATM12822 O HOH 1172 42.950 19.816 71.516 1.00 23.42 O HETATM12823 O HOH 1173 47.325 23.963 76.215 1.00 37.98 O HETATM12824 O HOH 1174 42.675 16.442 79.128 1.00 39.33 O HETATM12825 O HOH 1175 45.727 17.685 79.902 1.00 52.44 O HETATM12826 O HOH 1176 49.518 24.759 79.367 1.00 28.24 O HETATM12827 O HOH 1177 36.385 20.327 81.385 1.00 28.66 O HETATM12828 O HOH 1178 38.536 21.160 85.055 1.00 47.79 O HETATM12829 O HOH 1179 40.517 19.108 85.175 1.00 49.02 O HETATM12830 O HOH 1180 39.156 17.499 76.247 1.00 32.00 O HETATM12831 O HOH 1181 31.868 25.815 82.082 1.00 34.93 O HETATM12832 O HOH 1182 33.700 19.034 77.124 1.00 34.78 O HETATM12833 O HOH 1183 29.815 20.029 86.237 1.00 29.13 O HETATM12834 O HOH 1184 27.569 20.746 78.114 1.00 26.82 O HETATM12835 O HOH 1185 34.734 22.249 82.292 1.00 30.69 O HETATM12836 O HOH 1186 26.337 25.969 77.968 1.00 37.69 O HETATM12837 O HOH 1187 32.738 17.139 72.718 1.00 23.03 O HETATM12838 O HOH 1188 29.150 18.091 66.538 1.00 34.53 O HETATM12839 O HOH 1189 31.874 16.650 69.726 1.00 33.90 O HETATM12840 O HOH 1190 34.376 17.648 69.286 1.00 34.85 O HETATM12841 O HOH 1191 37.009 18.033 64.128 1.00 35.36 O HETATM12842 O HOH 1192 30.697 20.269 61.911 1.00 30.75 O HETATM12843 O HOH 1193 35.636 18.523 66.997 1.00 40.94 O HETATM12844 O HOH 1194 36.807 19.474 70.080 1.00 38.53 O HETATM12845 O HOH 1195 47.148 22.018 65.780 1.00 43.15 O HETATM12846 O HOH 1196 45.457 21.725 68.552 1.00 29.84 O HETATM12847 O HOH 1197 39.597 18.452 65.116 1.00 23.88 O HETATM12848 O HOH 1198 46.172 18.284 60.468 1.00 30.02 O HETATM12849 O HOH 1199 47.649 21.773 63.360 1.00 39.96 O HETATM12850 O HOH 1200 42.514 16.849 60.221 1.00 42.37 O HETATM12851 O HOH 1201 38.790 17.975 62.085 1.00 32.28 O HETATM12852 O HOH 1202 43.492 23.040 51.708 1.00 21.92 O HETATM12853 O HOH 1203 43.470 16.452 53.592 1.00 35.61 O HETATM12854 O HOH 1204 46.146 19.904 51.883 1.00 41.42 O HETATM12855 O HOH 1205 36.806 17.852 55.706 1.00 15.34 O HETATM12856 O HOH 1206 42.390 17.227 56.292 1.00 27.90 O HETATM12857 O HOH 1207 45.709 18.903 56.401 1.00 46.41 O HETATM12858 O HOH 1208 40.145 16.557 55.534 1.00 41.60 O HETATM12859 O HOH 1209 32.238 20.588 51.511 1.00 29.97 O HETATM12860 O HOH 1210 31.907 22.891 53.563 1.00 25.21 O HETATM12861 O HOH 1211 32.771 25.568 47.711 1.00 26.68 O HETATM12862 O HOH 1212 30.450 23.419 51.071 1.00 21.28 O HETATM12863 O HOH 1213 27.708 24.526 48.820 1.00 34.49 O HETATM12864 O HOH 1214 35.014 39.280 61.245 1.00 12.99 O HETATM12865 O HOH 1215 32.757 39.914 62.704 1.00 12.12 O HETATM12866 O HOH 1216 36.522 39.961 65.718 1.00 19.73 O HETATM12867 O HOH 1217 32.610 41.044 75.415 1.00 35.64 O HETATM12868 O HOH 1218 30.137 42.076 74.812 1.00 28.96 O HETATM12869 O HOH 1219 27.872 41.138 73.588 1.00 22.32 O HETATM12870 O HOH 1220 27.776 38.829 72.732 1.00 26.70 O HETATM12871 O HOH 1221 22.317 35.924 49.946 1.00 48.42 O HETATM12872 O HOH 1222 28.052 29.865 46.432 1.00 32.89 O HETATM12873 O HOH 1223 35.762 30.989 44.667 1.00 35.20 O HETATM12874 O HOH 1224 33.837 33.586 45.392 1.00 19.14 O HETATM12875 O HOH 1225 32.873 28.414 43.754 1.00 43.40 O HETATM12876 O HOH 1226 28.478 31.191 42.440 1.00 46.25 O HETATM12877 O HOH 1227 33.142 30.804 43.469 1.00 45.48 O HETATM12878 O HOH 1228 30.030 31.109 40.306 1.00 49.71 O HETATM12879 N7 P A 4 41.896 69.686 64.712 1.00 -0.29 N HETATM12880 C8 P A 4 40.573 69.904 64.597 1.00 0.20 C HETATM12881 N9 P A 4 39.592 69.051 65.034 1.00 -0.23 N HETATM12882 C10 P A 4 39.659 67.823 65.705 1.00 0.07 C HETATM12883 C16 P A 4 38.505 67.376 66.372 1.00 -0.04 C HETATM12884 C15 P A 4 38.507 66.155 67.075 1.00 -0.07 C HETATM12885 C14 P A 4 39.659 65.373 67.082 1.00 -0.07 C HETATM12886 C13 P A 4 40.794 65.816 66.403 1.00 -0.07 C HETATM12887 C12 P A 4 40.807 67.034 65.709 1.00 -0.04 C HETATM12888 H9 P A 4 41.698 67.357 65.183 1.00 0.05 H HETATM12889 H8 P A 4 41.688 65.203 66.412 1.00 0.06 H HETATM12890 H7 P A 4 39.674 64.427 67.611 1.00 0.05 H HETATM12891 H6 P A 4 37.620 65.828 67.605 1.00 0.06 H HETATM12892 H5 P A 4 37.604 67.978 66.345 1.00 0.05 H HETATM12893 H1 P A 4 38.634 69.371 64.833 1.00 0.22 H HETATM12894 S4 P A 4 40.045 71.336 63.775 1.00 0.02 S HETATM12895 C4 P A 4 41.721 71.727 63.590 1.00 0.08 C HETATM12896 C5 P A 4 42.629 70.701 64.177 1.00 0.00 C HETATM12897 C6 P A 4 44.127 70.742 64.183 1.00 -0.03 C HETATM12898 H2 P A 4 44.471 71.664 63.691 1.00 0.04 H HETATM12899 H3 P A 4 44.520 69.869 63.641 1.00 0.04 H HETATM12900 H4 P A 4 44.490 70.723 65.221 1.00 0.04 H HETATM12901 C3 P A 4 42.022 73.031 62.898 1.00 0.11 C HETATM12902 C2 P A 4 43.448 73.444 62.732 1.00 0.00 C HETATM12903 H10 P A 4 43.491 74.412 62.211 1.00 0.04 H HETATM12904 H11 P A 4 43.983 72.686 62.141 1.00 0.04 H HETATM12905 H12 P A 4 43.920 73.539 63.721 1.00 0.04 H HETATM12906 O8 P A 4 41.107 73.735 62.468 1.00 -0.40 O CONECT 1 2 17 18 19 CONECT 17 1 CONECT 18 1 CONECT 19 1 CONECT 5819 5820 5835 5836 5837 CONECT 5835 5819 CONECT 5836 5819 CONECT 5837 5819 CONECT128791288012896 CONECT12880128791288112894 CONECT12881128801288212893 CONECT12882128811288312887 CONECT12883128821288412892 CONECT12884128831288512891 CONECT12885128841288612890 CONECT12886128851288712889 CONECT12887128821288612888 CONECT1288812887 CONECT1288912886 CONECT1289012885 CONECT1289112884 CONECT1289212883 CONECT1289312881 CONECT128941288012895 CONECT12895128941289612901 CONECT12896128791289512897 CONECT1289712896128981289912900 CONECT1289812897 CONECT1289912897 CONECT1290012897 CONECT12901128951290212906 CONECT1290212901129031290412905 CONECT1290312902 CONECT1290412902 CONECT1290512902 CONECT1290612901 MASTER 0 0 0 0 0 0 0 012904 2 36 64 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 2vba
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
1fj4
RCSB PDB
PDBbind
406aa, >1FJ4_1|Chains... at 100%
2aq7
RCSB PDB
PDBbind
406aa, >2AQ7_1|Chains... at 100%
2aqb
RCSB PDB
PDBbind
406aa, >2AQB_1|Chains... at 100%
2vb8
RCSB PDB
PDBbind
406aa, >2VB8_1|Chains... at 100%
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
No complexes with the same small molecule ligand are found!
Entry Information
PDB ID
2vba
Complex Type
Protein-Ligand
PDBbind Subset
refined set
Protein Name
3-OXOACYL-[ACYL-CARRIER-PROTEIN] SYNTHASE 1
Ligand Name
P4T
EC.Number
E.C.2.3.1.41
Resolution
1.36(Å)
Affinity (Kd/Ki/IC50)
Kd=25uM
Release Year
2007
Protein/NA Sequence
Check fasta file
Primary Reference
Acta Crystallogr.,Sect.D 63: 1208
Ligand Properties
Formula
C
1
2
H
1
2
N
2
OS
Molecular Weight
232.301
Exact Mass
232.067
No. of atoms
28
No. of bonds
29
Polar Surface Area
70.23
LOGP Value
3.25 (
Computed with XLOGP3
)
3.47 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 1
No. of Hydrogen Bond Acceptors: 2
No. of Rotatable Bonds: 3
No. of Nitrogen and Oxygen Atoms: 3
No. of Rings: 2
Canonical SMILES
CC(=O)c1sc(nc1C)Nc1ccccc1
InChI String
InChI=1S/C12H12N2OS/c1-8-11(9(2)15)16-12(13-8)14-10-6-4-3-5-7-10/h3-7H,1-2H3,(H,13,14)
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
P0A953
Entrez Gene ID
NCBI Entrez Gene ID:
61754615
946799
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com