Browse entries in the PDBbind-CN Database
HEADER 2YFA_COMPLEX COMPND 2YFA_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 236 GLY SER HIS MET GLY ASP ILE GLY GLN LEU ASN LYS ASP SEQRES 2 A 236 LEU THR ASP LEU ARG ILE ALA ARG LEU GLN TYR MET ILE SEQRES 3 A 236 ALA ASN GLY ASP ASP THR ALA ALA ALA ASN THR LEU ALA SEQRES 4 A 236 LYS LEU ASP ALA PHE SER LYS GLN GLN ALA TYR LEU ALA SEQRES 5 A 236 THR THR PHE LYS SER PRO GLU ASN VAL LYS LEU LEU GLY SEQRES 6 A 236 GLU LEU GLY ASP THR ILE SER ALA TYR LYS LEU SER LEU SEQRES 7 A 236 ASN LYS MET ARG GLN GLY TYR ASP ALA THR ARG ALA ALA SEQRES 8 A 236 ARG VAL SER MET ASP SER SER ALA ILE ARG ALA ASP GLN SEQRES 9 A 236 ALA MET ASP ALA LEU SER GLN GLU VAL MET ALA ARG PRO SEQRES 10 A 236 GLU ALA ASP SER VAL ARG LEU ALA GLN TYR GLN LEU ILE SEQRES 11 A 236 SER LYS ALA ARG GLN GLN LEU LEU GLN VAL ARG ILE ASP SEQRES 12 A 236 VAL ARG GLY TYR ILE ALA GLU ASN SER SER ALA ASN GLU SEQRES 13 A 236 GLN ALA ALA LEU ARG GLN LEU ASP ALA ALA LEU ALA ASP SEQRES 14 A 236 THR ASP ASN LEU LYS ARG GLN LEU PRO SER GLU ASP ALA SEQRES 15 A 236 ARG LEU GLN GLN PHE GLU ASN ALA VAL LEU ALA TYR ARG SEQRES 16 A 236 ASP ALA VAL ARG GLN PHE ARG ASP ALA VAL ALA ASN ILE SEQRES 17 A 236 THR THR SER ARG ALA GLU MET THR VAL GLN GLY ALA ASP SEQRES 18 A 236 ILE VAL LYS ARG SER ASP ALA LEU TYR GLN ILE GLN LEU SEQRES 19 A 236 GLU ARG SEQRES 1 B 235 SER HIS MET GLY ASP ILE GLY GLN LEU ASN LYS ASP LEU SEQRES 2 B 235 THR ASP LEU ARG ILE ALA ARG LEU GLN TYR MET ILE ALA SEQRES 3 B 235 ASN GLY ASP ASP THR ALA ALA ALA ASN THR LEU ALA LYS SEQRES 4 B 235 LEU ASP ALA PHE SER LYS GLN GLN ALA TYR LEU ALA THR SEQRES 5 B 235 THR PHE LYS SER PRO GLU ASN VAL LYS LEU LEU GLY GLU SEQRES 6 B 235 LEU GLY ASP THR ILE SER ALA TYR LYS LEU SER LEU ASN SEQRES 7 B 235 LYS MET ARG GLN GLY TYR ASP ALA THR ARG ALA ALA ARG SEQRES 8 B 235 VAL SER MET ASP SER SER ALA ILE ARG ALA ASP GLN ALA SEQRES 9 B 235 MET ASP ALA LEU SER GLN GLU VAL MET ALA ARG PRO GLU SEQRES 10 B 235 ALA ASP SER VAL ARG LEU ALA GLN TYR GLN LEU ILE SER SEQRES 11 B 235 LYS ALA ARG GLN GLN LEU LEU GLN VAL ARG ILE ASP VAL SEQRES 12 B 235 ARG GLY TYR ILE ALA GLU ASN SER SER ALA ASN GLU GLN SEQRES 13 B 235 ALA ALA LEU ARG GLN LEU ASP ALA ALA LEU ALA ASP THR SEQRES 14 B 235 ASP ASN LEU LYS ARG GLN LEU PRO SER GLU ASP ALA ARG SEQRES 15 B 235 LEU GLN GLN PHE GLU ASN ALA VAL LEU ALA TYR ARG ASP SEQRES 16 B 235 ALA VAL ARG GLN PHE ARG ASP ALA VAL ALA ASN ILE THR SEQRES 17 B 235 THR SER ARG ALA GLU MET THR VAL GLN GLY ALA ASP ILE SEQRES 18 B 235 VAL LYS ARG SER ASP ALA LEU TYR GLN ILE GLN LEU GLU SEQRES 19 B 235 ARG HET NA A 1 1 HET NA A 2 1 HET LMR A1007 13 ATOM 1 N GLY A 47 -91.283 31.479 4.974 1.00 33.95 N ATOM 2 CA GLY A 47 -90.201 30.875 5.730 1.00 36.89 C ATOM 3 C GLY A 47 -88.846 31.401 5.299 1.00 34.84 C ATOM 4 O GLY A 47 -87.814 30.787 5.568 1.00 32.45 O ATOM 5 HA3 GLY A 47 -90.225 29.796 5.578 1.00 0.00 H ATOM 6 HA2 GLY A 47 -90.344 31.095 6.788 1.00 0.00 H ATOM 7 HN3 GLY A 47 -91.158 31.268 3.963 1.00 0.00 H ATOM 8 HN2 GLY A 47 -91.272 32.509 5.118 1.00 0.00 H ATOM 9 HN1 GLY A 47 -92.191 31.091 5.301 1.00 0.00 H ATOM 10 N SER A 48 -88.850 32.551 4.634 1.00 35.76 N ATOM 11 CA SER A 48 -87.615 33.132 4.114 1.00 32.15 C ATOM 12 C SER A 48 -86.660 33.559 5.236 1.00 30.16 C ATOM 13 O SER A 48 -85.448 33.380 5.132 1.00 29.53 O ATOM 14 CB SER A 48 -87.929 34.307 3.184 1.00 32.41 C ATOM 15 OG SER A 48 -86.817 34.603 2.355 1.00 32.99 O ATOM 16 HA SER A 48 -87.104 32.358 3.541 1.00 0.00 H ATOM 17 HB2 SER A 48 -88.171 35.184 3.784 1.00 0.00 H ATOM 18 HB3 SER A 48 -88.783 34.050 2.558 1.00 0.00 H ATOM 19 HG SER A 48 -86.040 34.841 2.920 1.00 0.00 H ATOM 20 H SER A 48 -89.751 33.048 4.481 1.00 0.00 H ATOM 21 N HIS A 49 -87.198 34.116 6.314 1.00 30.41 N ATOM 22 CA HIS A 49 -86.352 34.503 7.438 1.00 29.00 C ATOM 23 C HIS A 49 -85.632 33.290 8.038 1.00 32.51 C ATOM 24 O HIS A 49 -84.489 33.391 8.496 1.00 30.47 O ATOM 25 CB HIS A 49 -87.165 35.240 8.503 1.00 30.96 C ATOM 26 CG HIS A 49 -87.391 36.688 8.198 1.00 30.17 C ATOM 27 ND1 HIS A 49 -88.044 37.539 9.062 1.00 29.07 N ATOM 28 CD2 HIS A 49 -87.045 37.437 7.121 1.00 32.14 C ATOM 29 CE1 HIS A 49 -88.094 38.750 8.532 1.00 29.65 C ATOM 30 NE2 HIS A 49 -87.498 38.713 7.355 1.00 30.29 N ATOM 31 HA HIS A 49 -85.590 35.185 7.061 1.00 0.00 H ATOM 32 HB2 HIS A 49 -88.136 34.752 8.593 1.00 0.00 H ATOM 33 HB3 HIS A 49 -86.634 35.168 9.452 1.00 0.00 H ATOM 34 HD2 HIS A 49 -86.509 37.092 6.237 1.00 0.00 H ATOM 35 HE1 HIS A 49 -88.550 39.628 8.989 1.00 0.00 H ATOM 36 H HIS A 49 -88.225 34.277 6.358 1.00 0.00 H ATOM 37 N MET A 50 -86.283 32.134 8.025 1.00 30.14 N ATOM 38 CA MET A 50 -85.628 30.937 8.532 1.00 31.69 C ATOM 39 C MET A 50 -84.445 30.603 7.619 1.00 32.25 C ATOM 40 O MET A 50 -83.380 30.193 8.080 1.00 29.00 O ATOM 41 CB MET A 50 -86.609 29.768 8.629 1.00 31.84 C ATOM 42 CG MET A 50 -86.094 28.615 9.477 1.00 39.34 C ATOM 43 SD MET A 50 -87.225 27.219 9.486 1.00 51.81 S ATOM 44 CE MET A 50 -86.461 26.190 10.730 1.00 47.70 C ATOM 45 HA MET A 50 -85.262 31.121 9.542 1.00 0.00 H ATOM 46 HB2 MET A 50 -87.538 30.132 9.068 1.00 0.00 H ATOM 47 HB3 MET A 50 -86.805 29.397 7.623 1.00 0.00 H ATOM 48 HG2 MET A 50 -85.960 28.965 10.501 1.00 0.00 H ATOM 49 HG3 MET A 50 -85.134 28.287 9.078 1.00 0.00 H ATOM 50 HE1 MET A 50 -85.449 25.934 10.416 1.00 0.00 H ATOM 51 HE2 MET A 50 -86.424 26.732 11.675 1.00 0.00 H ATOM 52 HE3 MET A 50 -87.046 25.279 10.855 1.00 0.00 H ATOM 53 H MET A 50 -87.254 32.083 7.655 1.00 0.00 H ATOM 54 N GLY A 51 -84.644 30.802 6.320 1.00 30.32 N ATOM 55 CA GLY A 51 -83.581 30.663 5.349 1.00 30.13 C ATOM 56 C GLY A 51 -82.438 31.621 5.647 1.00 31.42 C ATOM 57 O GLY A 51 -81.281 31.210 5.675 1.00 25.89 O ATOM 58 HA3 GLY A 51 -83.976 30.877 4.356 1.00 0.00 H ATOM 59 HA2 GLY A 51 -83.205 29.640 5.376 1.00 0.00 H ATOM 60 H GLY A 51 -85.595 31.066 5.991 1.00 0.00 H ATOM 61 N ASP A 52 -82.762 32.894 5.879 1.00 25.33 N ATOM 62 CA ASP A 52 -81.741 33.905 6.180 1.00 26.88 C ATOM 63 C ASP A 52 -80.847 33.472 7.343 1.00 26.66 C ATOM 64 O ASP A 52 -79.623 33.646 7.304 1.00 26.56 O ATOM 65 CB ASP A 52 -82.388 35.249 6.520 1.00 23.84 C ATOM 66 CG ASP A 52 -83.083 35.896 5.332 1.00 30.89 C ATOM 67 OD1 ASP A 52 -82.562 35.823 4.198 1.00 27.00 O ATOM 68 OD2 ASP A 52 -84.146 36.514 5.553 1.00 31.06 O ATOM 69 HA ASP A 52 -81.127 34.012 5.286 1.00 0.00 H ATOM 70 HB2 ASP A 52 -83.124 35.090 7.308 1.00 0.00 H ATOM 71 HB3 ASP A 52 -81.613 35.926 6.879 1.00 0.00 H ATOM 72 H ASP A 52 -83.762 33.177 5.846 1.00 0.00 H ATOM 73 N ILE A 53 -81.462 32.912 8.377 1.00 27.37 N ATOM 74 CA ILE A 53 -80.714 32.445 9.532 1.00 26.44 C ATOM 75 C ILE A 53 -79.836 31.249 9.166 1.00 28.07 C ATOM 76 O ILE A 53 -78.740 31.080 9.711 1.00 23.57 O ATOM 77 CB ILE A 53 -81.650 32.101 10.708 1.00 28.09 C ATOM 78 CG1 ILE A 53 -82.443 33.346 11.126 1.00 27.58 C ATOM 79 CG2 ILE A 53 -80.861 31.575 11.883 1.00 30.22 C ATOM 80 CD1 ILE A 53 -81.561 34.540 11.458 1.00 23.89 C ATOM 81 HA ILE A 53 -80.064 33.258 9.855 1.00 0.00 H ATOM 82 HB ILE A 53 -82.343 31.325 10.382 1.00 0.00 H ATOM 83 HG12 ILE A 53 -83.108 33.624 10.308 1.00 0.00 H ATOM 84 HG13 ILE A 53 -83.036 33.099 12.006 1.00 0.00 H ATOM 85 HD11 ILE A 53 -80.897 34.281 12.283 1.00 0.00 H ATOM 86 HD12 ILE A 53 -80.968 34.807 10.583 1.00 0.00 H ATOM 87 HD13 ILE A 53 -82.188 35.384 11.745 1.00 0.00 H ATOM 88 HG21 ILE A 53 -80.324 30.675 11.585 1.00 0.00 H ATOM 89 HG22 ILE A 53 -80.149 32.333 12.209 1.00 0.00 H ATOM 90 HG23 ILE A 53 -81.543 31.339 12.700 1.00 0.00 H ATOM 91 H ILE A 53 -82.496 32.806 8.360 1.00 0.00 H ATOM 92 N GLY A 54 -80.314 30.413 8.251 1.00 26.72 N ATOM 93 CA GLY A 54 -79.485 29.348 7.708 1.00 27.07 C ATOM 94 C GLY A 54 -78.195 29.895 7.131 1.00 25.07 C ATOM 95 O GLY A 54 -77.110 29.402 7.443 1.00 28.25 O ATOM 96 HA3 GLY A 54 -80.037 28.834 6.921 1.00 0.00 H ATOM 97 HA2 GLY A 54 -79.247 28.642 8.504 1.00 0.00 H ATOM 98 H GLY A 54 -81.293 30.521 7.919 1.00 0.00 H ATOM 99 N GLN A 55 -78.317 30.917 6.291 1.00 22.35 N ATOM 100 CA GLN A 55 -77.166 31.564 5.678 1.00 22.37 C ATOM 101 C GLN A 55 -76.207 32.101 6.738 1.00 25.86 C ATOM 102 O GLN A 55 -74.992 31.948 6.612 1.00 24.68 O ATOM 103 CB GLN A 55 -77.611 32.685 4.737 1.00 25.15 C ATOM 104 CG GLN A 55 -76.474 33.467 4.077 1.00 25.97 C ATOM 105 CD GLN A 55 -75.810 32.731 2.914 1.00 32.81 C ATOM 106 OE1 GLN A 55 -74.583 32.563 2.882 1.00 37.54 O ATOM 107 NE2 GLN A 55 -76.613 32.296 1.954 1.00 34.29 N ATOM 108 HA GLN A 55 -76.635 30.814 5.092 1.00 0.00 H ATOM 109 HB2 GLN A 55 -78.219 32.243 3.948 1.00 0.00 H ATOM 110 HB3 GLN A 55 -78.216 33.387 5.310 1.00 0.00 H ATOM 111 HG2 GLN A 55 -76.876 34.408 3.703 1.00 0.00 H ATOM 112 HG3 GLN A 55 -75.715 33.672 4.832 1.00 0.00 H ATOM 113 HE22 GLN A 55 -77.638 32.458 2.020 1.00 0.00 H ATOM 114 HE21 GLN A 55 -76.218 31.792 1.134 1.00 0.00 H ATOM 115 H GLN A 55 -79.269 31.268 6.063 1.00 0.00 H ATOM 116 N LEU A 56 -76.759 32.729 7.775 1.00 21.41 N ATOM 117 CA LEU A 56 -75.954 33.256 8.875 1.00 21.81 C ATOM 118 C LEU A 56 -75.154 32.152 9.591 1.00 24.64 C ATOM 119 O LEU A 56 -73.933 32.275 9.776 1.00 22.24 O ATOM 120 CB LEU A 56 -76.868 33.982 9.870 1.00 24.68 C ATOM 121 CG LEU A 56 -76.228 34.662 11.080 1.00 20.80 C ATOM 122 CD1 LEU A 56 -75.578 35.967 10.631 1.00 18.03 C ATOM 123 CD2 LEU A 56 -77.263 34.913 12.165 1.00 23.87 C ATOM 124 HA LEU A 56 -75.229 33.955 8.458 1.00 0.00 H ATOM 125 HB2 LEU A 56 -77.404 34.751 9.314 1.00 0.00 H ATOM 126 HB3 LEU A 56 -77.578 33.248 10.250 1.00 0.00 H ATOM 127 HG LEU A 56 -75.464 34.009 11.502 1.00 0.00 H ATOM 128 HD21 LEU A 56 -78.050 35.558 11.773 1.00 0.00 H ATOM 129 HD22 LEU A 56 -77.694 33.963 12.481 1.00 0.00 H ATOM 130 HD23 LEU A 56 -76.785 35.398 13.016 1.00 0.00 H ATOM 131 HD11 LEU A 56 -74.815 35.753 9.883 1.00 0.00 H ATOM 132 HD12 LEU A 56 -76.337 36.620 10.201 1.00 0.00 H ATOM 133 HD13 LEU A 56 -75.119 36.457 11.490 1.00 0.00 H ATOM 134 H LEU A 56 -77.792 32.848 7.803 1.00 0.00 H ATOM 135 N ASN A 57 -75.842 31.088 10.001 1.00 24.89 N ATOM 136 CA ASN A 57 -75.196 29.970 10.705 1.00 28.36 C ATOM 137 C ASN A 57 -74.118 29.268 9.877 1.00 27.16 C ATOM 138 O ASN A 57 -73.141 28.749 10.420 1.00 21.60 O ATOM 139 CB ASN A 57 -76.229 28.933 11.163 1.00 25.41 C ATOM 140 CG ASN A 57 -77.043 29.396 12.360 1.00 36.16 C ATOM 141 OD1 ASN A 57 -76.955 30.550 12.787 1.00 38.47 O ATOM 142 ND2 ASN A 57 -77.850 28.489 12.905 1.00 39.97 N ATOM 143 HA ASN A 57 -74.707 30.419 11.569 1.00 0.00 H ATOM 144 HB2 ASN A 57 -76.910 28.732 10.336 1.00 0.00 H ATOM 145 HB3 ASN A 57 -75.705 28.016 11.432 1.00 0.00 H ATOM 146 HD22 ASN A 57 -77.892 27.527 12.512 1.00 0.00 H ATOM 147 HD21 ASN A 57 -78.439 28.742 13.724 1.00 0.00 H ATOM 148 H ASN A 57 -76.865 31.047 9.818 1.00 0.00 H ATOM 149 N LYS A 58 -74.310 29.242 8.561 1.00 25.21 N ATOM 150 CA LYS A 58 -73.304 28.711 7.650 1.00 27.00 C ATOM 151 C LYS A 58 -72.101 29.632 7.608 1.00 23.80 C ATOM 152 O LYS A 58 -70.950 29.185 7.603 1.00 18.72 O ATOM 153 CB LYS A 58 -73.887 28.583 6.245 1.00 30.02 C ATOM 154 CG LYS A 58 -74.314 27.190 5.880 1.00 35.85 C ATOM 155 CD LYS A 58 -73.331 26.572 4.896 1.00 35.96 C ATOM 156 CE LYS A 58 -73.893 25.275 4.317 1.00 38.57 C ATOM 157 NZ LYS A 58 -74.171 24.268 5.386 1.00 34.74 N ATOM 158 HA LYS A 58 -72.996 27.728 8.007 1.00 0.00 H ATOM 159 HB2 LYS A 58 -74.756 29.237 6.174 1.00 0.00 H ATOM 160 HB3 LYS A 58 -73.131 28.907 5.530 1.00 0.00 H ATOM 161 HG2 LYS A 58 -74.352 26.578 6.781 1.00 0.00 H ATOM 162 HG3 LYS A 58 -75.304 27.226 5.424 1.00 0.00 H ATOM 163 HD2 LYS A 58 -73.146 27.276 4.085 1.00 0.00 H ATOM 164 HD3 LYS A 58 -72.395 26.358 5.411 1.00 0.00 H ATOM 165 HE2 LYS A 58 -73.169 24.857 3.617 1.00 0.00 H ATOM 166 HE3 LYS A 58 -74.821 25.496 3.789 1.00 0.00 H ATOM 167 HZ1 LYS A 58 -73.289 24.047 5.890 1.00 0.00 H ATOM 168 HZ2 LYS A 58 -74.866 24.657 6.055 1.00 0.00 H ATOM 169 HZ3 LYS A 58 -74.551 23.402 4.954 1.00 0.00 H ATOM 170 H LYS A 58 -75.201 29.610 8.172 1.00 0.00 H ATOM 171 N ASP A 59 -72.382 30.929 7.586 1.00 22.33 N ATOM 172 CA ASP A 59 -71.340 31.939 7.592 1.00 21.22 C ATOM 173 C ASP A 59 -70.503 31.836 8.862 1.00 17.54 C ATOM 174 O ASP A 59 -69.305 32.108 8.833 1.00 17.21 O ATOM 175 CB ASP A 59 -71.950 33.340 7.487 1.00 20.68 C ATOM 176 CG ASP A 59 -72.630 33.582 6.151 1.00 27.72 C ATOM 177 OD1 ASP A 59 -72.352 32.832 5.190 1.00 28.98 O ATOM 178 OD2 ASP A 59 -73.447 34.522 6.058 1.00 28.82 O ATOM 179 HA ASP A 59 -70.696 31.767 6.729 1.00 0.00 H ATOM 180 HB2 ASP A 59 -72.687 33.461 8.281 1.00 0.00 H ATOM 181 HB3 ASP A 59 -71.157 34.077 7.614 1.00 0.00 H ATOM 182 H ASP A 59 -73.377 31.230 7.564 1.00 0.00 H ATOM 183 N LEU A 60 -71.145 31.462 9.965 1.00 18.34 N ATOM 184 CA LEU A 60 -70.455 31.321 11.246 1.00 21.38 C ATOM 185 C LEU A 60 -69.494 30.124 11.213 1.00 18.86 C ATOM 186 O LEU A 60 -68.287 30.261 11.456 1.00 13.73 O ATOM 187 CB LEU A 60 -71.463 31.176 12.386 1.00 21.00 C ATOM 188 CG LEU A 60 -70.870 30.801 13.744 1.00 18.58 C ATOM 189 CD1 LEU A 60 -69.794 31.822 14.125 1.00 20.89 C ATOM 190 CD2 LEU A 60 -71.947 30.738 14.801 1.00 26.58 C ATOM 191 HA LEU A 60 -69.869 32.223 11.422 1.00 0.00 H ATOM 192 HB2 LEU A 60 -71.984 32.127 12.498 1.00 0.00 H ATOM 193 HB3 LEU A 60 -72.178 30.402 12.106 1.00 0.00 H ATOM 194 HG LEU A 60 -70.417 29.812 13.676 1.00 0.00 H ATOM 195 HD21 LEU A 60 -72.430 31.712 14.885 1.00 0.00 H ATOM 196 HD22 LEU A 60 -72.686 29.988 14.521 1.00 0.00 H ATOM 197 HD23 LEU A 60 -71.500 30.469 15.758 1.00 0.00 H ATOM 198 HD11 LEU A 60 -69.008 31.819 13.369 1.00 0.00 H ATOM 199 HD12 LEU A 60 -70.241 32.815 14.183 1.00 0.00 H ATOM 200 HD13 LEU A 60 -69.370 31.557 15.093 1.00 0.00 H ATOM 201 H LEU A 60 -72.165 31.265 9.915 1.00 0.00 H ATOM 202 N THR A 61 -70.031 28.949 10.905 1.00 22.00 N ATOM 203 CA THR A 61 -69.177 27.777 10.725 1.00 16.71 C ATOM 204 C THR A 61 -67.997 28.120 9.833 1.00 15.50 C ATOM 205 O THR A 61 -66.835 27.844 10.175 1.00 14.85 O ATOM 206 CB THR A 61 -69.971 26.592 10.156 1.00 20.88 C ATOM 207 OG1 THR A 61 -70.975 26.220 11.102 1.00 20.80 O ATOM 208 CG2 THR A 61 -69.060 25.387 9.898 1.00 19.52 C ATOM 209 HA THR A 61 -68.797 27.477 11.702 1.00 0.00 H ATOM 210 HB THR A 61 -70.419 26.893 9.209 1.00 0.00 H ATOM 211 HG1 THR A 61 -71.495 25.456 10.747 1.00 0.00 H ATOM 212 HG23 THR A 61 -68.291 25.663 9.177 1.00 0.00 H ATOM 213 HG21 THR A 61 -68.591 25.081 10.833 1.00 0.00 H ATOM 214 HG22 THR A 61 -69.653 24.563 9.501 1.00 0.00 H ATOM 215 H THR A 61 -71.061 28.863 10.792 1.00 0.00 H ATOM 216 N ASP A 62 -68.273 28.767 8.708 1.00 16.79 N ATOM 217 CA ASP A 62 -67.209 29.089 7.764 1.00 15.50 C ATOM 218 C ASP A 62 -66.144 29.990 8.362 1.00 17.19 C ATOM 219 O ASP A 62 -64.956 29.853 8.051 1.00 13.54 O ATOM 220 CB ASP A 62 -67.780 29.719 6.498 1.00 22.21 C ATOM 221 CG ASP A 62 -68.480 28.705 5.619 1.00 23.29 C ATOM 222 OD1 ASP A 62 -68.318 27.495 5.877 1.00 23.59 O ATOM 223 OD2 ASP A 62 -69.185 29.123 4.682 1.00 28.48 O ATOM 224 HA ASP A 62 -66.726 28.145 7.510 1.00 0.00 H ATOM 225 HB2 ASP A 62 -68.495 30.491 6.782 1.00 0.00 H ATOM 226 HB3 ASP A 62 -66.965 30.171 5.932 1.00 0.00 H ATOM 227 H ASP A 62 -69.253 29.046 8.498 1.00 0.00 H ATOM 228 N LEU A 63 -66.561 30.913 9.225 1.00 14.58 N ATOM 229 CA LEU A 63 -65.599 31.788 9.882 1.00 13.09 C ATOM 230 C LEU A 63 -64.738 30.997 10.877 1.00 9.45 C ATOM 231 O LEU A 63 -63.532 31.178 10.940 1.00 9.69 O ATOM 232 CB LEU A 63 -66.334 32.927 10.597 1.00 14.36 C ATOM 233 CG LEU A 63 -65.517 33.692 11.642 1.00 12.82 C ATOM 234 CD1 LEU A 63 -64.308 34.386 11.019 1.00 11.15 C ATOM 235 CD2 LEU A 63 -66.424 34.673 12.395 1.00 16.79 C ATOM 236 HA LEU A 63 -64.939 32.213 9.126 1.00 0.00 H ATOM 237 HB2 LEU A 63 -66.663 33.640 9.841 1.00 0.00 H ATOM 238 HB3 LEU A 63 -67.204 32.502 11.097 1.00 0.00 H ATOM 239 HG LEU A 63 -65.117 32.978 12.362 1.00 0.00 H ATOM 240 HD21 LEU A 63 -66.858 35.380 11.688 1.00 0.00 H ATOM 241 HD22 LEU A 63 -67.220 34.120 12.893 1.00 0.00 H ATOM 242 HD23 LEU A 63 -65.836 35.214 13.137 1.00 0.00 H ATOM 243 HD11 LEU A 63 -63.661 33.641 10.556 1.00 0.00 H ATOM 244 HD12 LEU A 63 -64.647 35.094 10.263 1.00 0.00 H ATOM 245 HD13 LEU A 63 -63.756 34.917 11.794 1.00 0.00 H ATOM 246 H LEU A 63 -67.576 31.010 9.431 1.00 0.00 H ATOM 247 N ARG A 64 -65.381 30.149 11.667 1.00 10.61 N ATOM 248 CA ARG A 64 -64.675 29.326 12.639 1.00 9.97 C ATOM 249 C ARG A 64 -63.667 28.420 11.944 1.00 9.49 C ATOM 250 O ARG A 64 -62.517 28.326 12.361 1.00 9.36 O ATOM 251 CB ARG A 64 -65.659 28.492 13.454 1.00 11.37 C ATOM 252 CG ARG A 64 -66.519 29.326 14.415 1.00 12.64 C ATOM 253 CD ARG A 64 -67.562 28.449 15.082 1.00 14.06 C ATOM 254 NE ARG A 64 -66.950 27.499 16.009 1.00 12.31 N ATOM 255 CZ ARG A 64 -67.567 26.434 16.504 1.00 13.16 C ATOM 256 NH1 ARG A 64 -68.816 26.160 16.145 1.00 16.69 N ATOM 257 NH2 ARG A 64 -66.927 25.635 17.349 1.00 12.96 N ATOM 258 HA ARG A 64 -64.137 29.989 13.317 1.00 0.00 H ATOM 259 HB2 ARG A 64 -66.321 27.968 12.765 1.00 0.00 H ATOM 260 HB3 ARG A 64 -65.095 27.765 14.038 1.00 0.00 H ATOM 261 HG2 ARG A 64 -65.879 29.769 15.178 1.00 0.00 H ATOM 262 HG3 ARG A 64 -67.018 30.118 13.857 1.00 0.00 H ATOM 263 HD2 ARG A 64 -68.104 27.896 14.314 1.00 0.00 H ATOM 264 HD3 ARG A 64 -68.258 29.082 15.632 1.00 0.00 H ATOM 265 HE ARG A 64 -65.966 27.669 16.300 1.00 0.00 H ATOM 266 HH12 ARG A 64 -69.298 25.325 16.534 1.00 0.00 H ATOM 267 HH11 ARG A 64 -69.312 26.781 15.474 1.00 0.00 H ATOM 268 HH22 ARG A 64 -67.407 24.799 17.739 1.00 0.00 H ATOM 269 HH21 ARG A 64 -65.945 25.845 17.621 1.00 0.00 H ATOM 270 H ARG A 64 -66.415 30.069 11.591 1.00 0.00 H ATOM 271 N ILE A 65 -64.088 27.770 10.861 1.00 9.35 N ATOM 272 CA ILE A 65 -63.140 26.951 10.095 1.00 9.77 C ATOM 273 C ILE A 65 -61.966 27.781 9.566 1.00 10.65 C ATOM 274 O ILE A 65 -60.790 27.401 9.685 1.00 9.04 O ATOM 275 CB ILE A 65 -63.863 26.230 8.902 1.00 9.56 C ATOM 276 CG1 ILE A 65 -64.904 25.237 9.405 1.00 12.03 C ATOM 277 CG2 ILE A 65 -62.843 25.579 7.970 1.00 12.57 C ATOM 278 CD1 ILE A 65 -64.349 24.098 10.228 1.00 11.02 C ATOM 279 HA ILE A 65 -62.742 26.201 10.778 1.00 0.00 H ATOM 280 HB ILE A 65 -64.402 26.979 8.322 1.00 0.00 H ATOM 281 HG12 ILE A 65 -65.622 25.780 10.019 1.00 0.00 H ATOM 282 HG13 ILE A 65 -65.414 24.813 8.540 1.00 0.00 H ATOM 283 HD11 ILE A 65 -63.638 23.531 9.628 1.00 0.00 H ATOM 284 HD12 ILE A 65 -63.846 24.499 11.108 1.00 0.00 H ATOM 285 HD13 ILE A 65 -65.165 23.446 10.540 1.00 0.00 H ATOM 286 HG21 ILE A 65 -62.178 26.344 7.570 1.00 0.00 H ATOM 287 HG22 ILE A 65 -62.261 24.845 8.527 1.00 0.00 H ATOM 288 HG23 ILE A 65 -63.365 25.085 7.150 1.00 0.00 H ATOM 289 H ILE A 65 -65.081 27.842 10.560 1.00 0.00 H ATOM 290 N ALA A 66 -62.271 28.941 8.993 1.00 8.92 N ATOM 291 CA ALA A 66 -61.233 29.824 8.469 1.00 11.00 C ATOM 292 C ALA A 66 -60.217 30.273 9.516 1.00 8.92 C ATOM 293 O ALA A 66 -58.993 30.304 9.260 1.00 9.67 O ATOM 294 CB ALA A 66 -61.892 31.057 7.789 1.00 9.72 C ATOM 295 HA ALA A 66 -60.669 29.244 7.739 1.00 0.00 H ATOM 296 HB1 ALA A 66 -62.530 30.722 6.971 1.00 0.00 H ATOM 297 HB2 ALA A 66 -62.492 31.597 8.522 1.00 0.00 H ATOM 298 HB3 ALA A 66 -61.115 31.714 7.399 1.00 0.00 H ATOM 299 H ALA A 66 -63.268 29.225 8.916 1.00 0.00 H ATOM 300 N ARG A 67 -60.701 30.666 10.694 1.00 11.13 N ATOM 301 CA ARG A 67 -59.773 31.089 11.734 1.00 9.23 C ATOM 302 C ARG A 67 -58.821 29.969 12.191 1.00 10.16 C ATOM 303 O ARG A 67 -57.680 30.241 12.502 1.00 11.24 O ATOM 304 CB ARG A 67 -60.497 31.732 12.933 1.00 12.72 C ATOM 305 CG ARG A 67 -59.595 32.683 13.749 1.00 12.83 C ATOM 306 CD ARG A 67 -59.064 32.029 15.028 1.00 13.09 C ATOM 307 NE ARG A 67 -60.145 31.702 15.945 1.00 13.14 N ATOM 308 CZ ARG A 67 -60.077 30.775 16.893 1.00 12.47 C ATOM 309 NH1 ARG A 67 -58.973 30.057 17.060 1.00 13.28 N ATOM 310 NH2 ARG A 67 -61.129 30.556 17.662 1.00 16.24 N ATOM 311 HA ARG A 67 -59.150 31.856 11.274 1.00 0.00 H ATOM 312 HB2 ARG A 67 -61.350 32.298 12.560 1.00 0.00 H ATOM 313 HB3 ARG A 67 -60.850 30.938 13.592 1.00 0.00 H ATOM 314 HG2 ARG A 67 -58.749 32.980 13.130 1.00 0.00 H ATOM 315 HG3 ARG A 67 -60.173 33.566 14.021 1.00 0.00 H ATOM 316 HD2 ARG A 67 -58.377 32.718 15.520 1.00 0.00 H ATOM 317 HD3 ARG A 67 -58.533 31.114 14.765 1.00 0.00 H ATOM 318 HE ARG A 67 -61.035 32.232 15.851 1.00 0.00 H ATOM 319 HH12 ARG A 67 -58.931 29.333 17.806 1.00 0.00 H ATOM 320 HH11 ARG A 67 -58.150 30.218 16.445 1.00 0.00 H ATOM 321 HH22 ARG A 67 -61.086 29.832 18.408 1.00 0.00 H ATOM 322 HH21 ARG A 67 -62.000 31.107 17.522 1.00 0.00 H ATOM 323 H ARG A 67 -61.726 30.671 10.868 1.00 0.00 H ATOM 324 N LEU A 68 -59.296 28.727 12.261 1.00 8.49 N ATOM 325 CA LEU A 68 -58.422 27.606 12.591 1.00 9.76 C ATOM 326 C LEU A 68 -57.425 27.340 11.462 1.00 8.83 C ATOM 327 O LEU A 68 -56.266 27.026 11.712 1.00 9.61 O ATOM 328 CB LEU A 68 -59.243 26.343 12.917 1.00 9.13 C ATOM 329 CG LEU A 68 -60.101 26.449 14.167 1.00 12.35 C ATOM 330 CD1 LEU A 68 -61.257 25.473 14.100 1.00 12.72 C ATOM 331 CD2 LEU A 68 -59.249 26.207 15.419 1.00 13.66 C ATOM 332 HA LEU A 68 -57.854 27.873 13.482 1.00 0.00 H ATOM 333 HB2 LEU A 68 -59.899 26.136 12.071 1.00 0.00 H ATOM 334 HB3 LEU A 68 -58.550 25.512 13.050 1.00 0.00 H ATOM 335 HG LEU A 68 -60.513 27.456 14.225 1.00 0.00 H ATOM 336 HD21 LEU A 68 -58.810 25.210 15.371 1.00 0.00 H ATOM 337 HD22 LEU A 68 -58.456 26.953 15.467 1.00 0.00 H ATOM 338 HD23 LEU A 68 -59.878 26.286 16.306 1.00 0.00 H ATOM 339 HD11 LEU A 68 -61.871 25.698 13.228 1.00 0.00 H ATOM 340 HD12 LEU A 68 -60.869 24.457 14.021 1.00 0.00 H ATOM 341 HD13 LEU A 68 -61.860 25.563 15.003 1.00 0.00 H ATOM 342 H LEU A 68 -60.305 28.553 12.078 1.00 0.00 H ATOM 343 N GLN A 69 -57.870 27.478 10.215 1.00 11.85 N ATOM 344 CA GLN A 69 -56.947 27.349 9.083 1.00 10.92 C ATOM 345 C GLN A 69 -55.830 28.379 9.176 1.00 13.47 C ATOM 346 O GLN A 69 -54.673 28.096 8.850 1.00 11.98 O ATOM 347 CB GLN A 69 -57.684 27.441 7.744 1.00 11.43 C ATOM 348 CG GLN A 69 -58.712 26.323 7.517 1.00 10.66 C ATOM 349 CD GLN A 69 -59.623 26.544 6.286 1.00 16.64 C ATOM 350 OE1 GLN A 69 -60.066 27.660 6.023 1.00 13.71 O ATOM 351 NE2 GLN A 69 -59.936 25.453 5.560 1.00 13.51 N ATOM 352 HA GLN A 69 -56.494 26.359 9.133 1.00 0.00 H ATOM 353 HB2 GLN A 69 -58.204 28.398 7.704 1.00 0.00 H ATOM 354 HB3 GLN A 69 -56.946 27.396 6.943 1.00 0.00 H ATOM 355 HG2 GLN A 69 -58.174 25.385 7.381 1.00 0.00 H ATOM 356 HG3 GLN A 69 -59.344 26.253 8.403 1.00 0.00 H ATOM 357 HE22 GLN A 69 -59.539 24.526 5.816 1.00 0.00 H ATOM 358 HE21 GLN A 69 -60.574 25.537 4.743 1.00 0.00 H ATOM 359 H GLN A 69 -58.876 27.678 10.043 1.00 0.00 H ATOM 360 N TYR A 70 -56.191 29.579 9.629 1.00 11.87 N ATOM 361 CA TYR A 70 -55.244 30.668 9.790 1.00 12.35 C ATOM 362 C TYR A 70 -54.127 30.264 10.745 1.00 12.46 C ATOM 363 O TYR A 70 -52.958 30.522 10.474 1.00 10.67 O ATOM 364 CB TYR A 70 -56.015 31.906 10.269 1.00 13.49 C ATOM 365 CG TYR A 70 -55.201 33.106 10.674 1.00 12.66 C ATOM 366 CD1 TYR A 70 -54.188 33.610 9.860 1.00 15.97 C ATOM 367 CD2 TYR A 70 -55.508 33.793 11.837 1.00 13.94 C ATOM 368 CE1 TYR A 70 -53.464 34.737 10.236 1.00 16.64 C ATOM 369 CE2 TYR A 70 -54.802 34.904 12.218 1.00 15.98 C ATOM 370 CZ TYR A 70 -53.781 35.379 11.422 1.00 16.68 C ATOM 371 OH TYR A 70 -53.099 36.503 11.820 1.00 20.11 O ATOM 372 HA TYR A 70 -54.761 30.907 8.842 1.00 0.00 H ATOM 373 HB3 TYR A 70 -56.613 31.608 11.131 1.00 0.00 H ATOM 374 HB2 TYR A 70 -56.676 32.215 9.459 1.00 0.00 H ATOM 375 HD2 TYR A 70 -56.329 33.442 12.463 1.00 0.00 H ATOM 376 HE2 TYR A 70 -55.048 35.412 13.150 1.00 0.00 H ATOM 377 HE1 TYR A 70 -52.657 35.110 9.605 1.00 0.00 H ATOM 378 HD1 TYR A 70 -53.960 33.115 8.916 1.00 0.00 H ATOM 379 HH TYR A 70 -52.402 36.719 11.151 1.00 0.00 H ATOM 380 H TYR A 70 -57.188 29.742 9.876 1.00 0.00 H ATOM 381 N MET A 71 -54.469 29.583 11.843 1.00 8.44 N ATOM 382 CA MET A 71 -53.453 29.172 12.805 1.00 12.23 C ATOM 383 C MET A 71 -52.590 28.048 12.250 1.00 12.51 C ATOM 384 O MET A 71 -51.368 27.988 12.474 1.00 11.88 O ATOM 385 CB MET A 71 -54.126 28.739 14.113 1.00 11.21 C ATOM 386 CG MET A 71 -54.992 29.838 14.701 1.00 13.97 C ATOM 387 SD MET A 71 -55.530 29.461 16.378 1.00 16.55 S ATOM 388 CE MET A 71 -53.983 29.585 17.212 1.00 14.05 C ATOM 389 HA MET A 71 -52.799 30.022 13.002 1.00 0.00 H ATOM 390 HB2 MET A 71 -54.750 27.867 13.916 1.00 0.00 H ATOM 391 HB3 MET A 71 -53.354 28.475 14.835 1.00 0.00 H ATOM 392 HG2 MET A 71 -55.872 29.966 14.071 1.00 0.00 H ATOM 393 HG3 MET A 71 -54.419 30.765 14.716 1.00 0.00 H ATOM 394 HE1 MET A 71 -53.286 28.860 16.792 1.00 0.00 H ATOM 395 HE2 MET A 71 -53.583 30.591 17.085 1.00 0.00 H ATOM 396 HE3 MET A 71 -54.126 29.380 18.273 1.00 0.00 H ATOM 397 H MET A 71 -55.467 29.344 12.013 1.00 0.00 H ATOM 398 N ILE A 72 -53.233 27.155 11.514 1.00 11.16 N ATOM 399 CA ILE A 72 -52.512 26.042 10.889 1.00 10.74 C ATOM 400 C ILE A 72 -51.451 26.549 9.927 1.00 14.58 C ATOM 401 O ILE A 72 -50.356 25.978 9.815 1.00 17.34 O ATOM 402 CB ILE A 72 -53.496 25.084 10.200 1.00 10.30 C ATOM 403 CG1 ILE A 72 -54.248 24.310 11.288 1.00 11.15 C ATOM 404 CG2 ILE A 72 -52.761 24.070 9.283 1.00 12.90 C ATOM 405 CD1 ILE A 72 -55.469 23.538 10.822 1.00 9.58 C ATOM 406 HA ILE A 72 -51.995 25.483 11.669 1.00 0.00 H ATOM 407 HB ILE A 72 -54.176 25.668 9.580 1.00 0.00 H ATOM 408 HG12 ILE A 72 -53.553 23.600 11.735 1.00 0.00 H ATOM 409 HG13 ILE A 72 -54.572 25.025 12.045 1.00 0.00 H ATOM 410 HD11 ILE A 72 -56.189 24.229 10.385 1.00 0.00 H ATOM 411 HD12 ILE A 72 -55.169 22.803 10.075 1.00 0.00 H ATOM 412 HD13 ILE A 72 -55.922 23.029 11.673 1.00 0.00 H ATOM 413 HG21 ILE A 72 -52.211 24.611 8.513 1.00 0.00 H ATOM 414 HG22 ILE A 72 -52.066 23.479 9.880 1.00 0.00 H ATOM 415 HG23 ILE A 72 -53.491 23.410 8.814 1.00 0.00 H ATOM 416 H ILE A 72 -54.260 27.244 11.378 1.00 0.00 H ATOM 417 N ALA A 73 -51.790 27.628 9.235 1.00 11.97 N ATOM 418 CA ALA A 73 -50.889 28.287 8.299 1.00 16.33 C ATOM 419 C ALA A 73 -49.886 29.203 9.008 1.00 18.71 C ATOM 420 O ALA A 73 -49.359 30.151 8.415 1.00 17.90 O ATOM 421 CB ALA A 73 -51.702 29.066 7.270 1.00 17.08 C ATOM 422 HA ALA A 73 -50.306 27.517 7.794 1.00 0.00 H ATOM 423 HB1 ALA A 73 -52.351 28.380 6.727 1.00 0.00 H ATOM 424 HB2 ALA A 73 -52.308 29.815 7.779 1.00 0.00 H ATOM 425 HB3 ALA A 73 -51.025 29.558 6.571 1.00 0.00 H ATOM 426 H ALA A 73 -52.743 28.022 9.367 1.00 0.00 H ATOM 427 N ASN A 74 -49.610 28.903 10.274 1.00 17.14 N ATOM 428 CA ASN A 74 -48.651 29.680 11.060 1.00 21.32 C ATOM 429 C ASN A 74 -48.939 31.180 10.981 1.00 16.71 C ATOM 430 O ASN A 74 -48.034 32.017 11.014 1.00 19.65 O ATOM 431 CB ASN A 74 -47.224 29.360 10.610 1.00 23.13 C ATOM 432 CG ASN A 74 -46.966 27.855 10.514 1.00 32.64 C ATOM 433 OD1 ASN A 74 -47.127 27.117 11.492 1.00 33.44 O ATOM 434 ND2 ASN A 74 -46.572 27.395 9.326 1.00 33.93 N ATOM 435 HA ASN A 74 -48.756 29.395 12.107 1.00 0.00 H ATOM 436 HB2 ASN A 74 -47.057 29.807 9.630 1.00 0.00 H ATOM 437 HB3 ASN A 74 -46.526 29.790 11.328 1.00 0.00 H ATOM 438 HD22 ASN A 74 -46.449 28.052 8.529 1.00 0.00 H ATOM 439 HD21 ASN A 74 -46.388 26.380 9.197 1.00 0.00 H ATOM 440 H ASN A 74 -50.089 28.094 10.718 1.00 0.00 H ATOM 441 N GLY A 75 -50.224 31.496 10.886 1.00 17.13 N ATOM 442 CA GLY A 75 -50.717 32.855 10.965 1.00 14.81 C ATOM 443 C GLY A 75 -50.272 33.683 9.771 1.00 14.57 C ATOM 444 O GLY A 75 -50.082 34.877 9.901 1.00 19.45 O ATOM 445 HA3 GLY A 75 -50.338 33.317 11.877 1.00 0.00 H ATOM 446 HA2 GLY A 75 -51.806 32.835 10.995 1.00 0.00 H ATOM 447 H GLY A 75 -50.912 30.729 10.748 1.00 0.00 H ATOM 448 N ASP A 76 -50.098 33.068 8.608 1.00 15.79 N ATOM 449 CA ASP A 76 -49.512 33.845 7.503 1.00 18.53 C ATOM 450 C ASP A 76 -50.489 34.842 6.890 1.00 18.48 C ATOM 451 O ASP A 76 -51.705 34.749 7.088 1.00 17.43 O ATOM 452 CB ASP A 76 -48.799 32.962 6.469 1.00 23.60 C ATOM 453 CG ASP A 76 -49.750 32.162 5.605 1.00 21.59 C ATOM 454 OD1 ASP A 76 -50.954 32.500 5.536 1.00 26.01 O ATOM 455 OD2 ASP A 76 -49.270 31.212 4.956 1.00 30.03 O ATOM 456 HA ASP A 76 -48.728 34.458 7.947 1.00 0.00 H ATOM 457 HB2 ASP A 76 -48.199 33.602 5.822 1.00 0.00 H ATOM 458 HB3 ASP A 76 -48.146 32.268 6.998 1.00 0.00 H ATOM 459 H ASP A 76 -50.366 32.071 8.481 1.00 0.00 H ATOM 460 N ASP A 77 -49.948 35.817 6.160 1.00 22.85 N ATOM 461 CA ASP A 77 -50.743 36.940 5.660 1.00 20.66 C ATOM 462 C ASP A 77 -51.822 36.514 4.665 1.00 17.54 C ATOM 463 O ASP A 77 -52.894 37.122 4.583 1.00 17.60 O ATOM 464 CB ASP A 77 -49.832 38.000 5.023 1.00 22.02 C ATOM 465 CG ASP A 77 -48.940 38.701 6.031 1.00 31.03 C ATOM 466 OD1 ASP A 77 -49.370 38.918 7.186 1.00 34.23 O ATOM 467 OD2 ASP A 77 -47.802 39.063 5.657 1.00 38.08 O ATOM 468 HA ASP A 77 -51.256 37.364 6.523 1.00 0.00 H ATOM 469 HB2 ASP A 77 -49.201 37.514 4.279 1.00 0.00 H ATOM 470 HB3 ASP A 77 -50.457 38.747 4.534 1.00 0.00 H ATOM 471 H ASP A 77 -48.932 35.779 5.939 1.00 0.00 H ATOM 472 N THR A 78 -51.542 35.470 3.896 1.00 18.21 N ATOM 473 CA THR A 78 -52.521 34.962 2.949 1.00 15.04 C ATOM 474 C THR A 78 -53.744 34.388 3.658 1.00 18.83 C ATOM 475 O THR A 78 -54.891 34.679 3.297 1.00 17.48 O ATOM 476 CB THR A 78 -51.891 33.912 2.028 1.00 18.69 C ATOM 477 OG1 THR A 78 -50.861 34.539 1.261 1.00 20.28 O ATOM 478 CG2 THR A 78 -52.931 33.330 1.092 1.00 20.62 C ATOM 479 HA THR A 78 -52.855 35.803 2.341 1.00 0.00 H ATOM 480 HB THR A 78 -51.479 33.104 2.632 1.00 0.00 H ATOM 481 HG1 THR A 78 -50.445 33.871 0.661 1.00 0.00 H ATOM 482 HG23 THR A 78 -53.717 32.852 1.676 1.00 0.00 H ATOM 483 HG21 THR A 78 -53.361 34.128 0.487 1.00 0.00 H ATOM 484 HG22 THR A 78 -52.460 32.593 0.441 1.00 0.00 H ATOM 485 H THR A 78 -50.612 35.010 3.971 1.00 0.00 H ATOM 486 N ALA A 79 -53.506 33.566 4.673 1.00 15.11 N ATOM 487 CA ALA A 79 -54.613 32.987 5.412 1.00 16.95 C ATOM 488 C ALA A 79 -55.348 34.066 6.204 1.00 17.46 C ATOM 489 O ALA A 79 -56.559 33.995 6.357 1.00 22.94 O ATOM 490 CB ALA A 79 -54.120 31.881 6.340 1.00 17.37 C ATOM 491 HA ALA A 79 -55.311 32.548 4.699 1.00 0.00 H ATOM 492 HB1 ALA A 79 -53.642 31.099 5.750 1.00 0.00 H ATOM 493 HB2 ALA A 79 -53.401 32.295 7.047 1.00 0.00 H ATOM 494 HB3 ALA A 79 -54.966 31.461 6.884 1.00 0.00 H ATOM 495 H ALA A 79 -52.527 33.337 4.938 1.00 0.00 H ATOM 496 N ALA A 80 -54.618 35.065 6.692 1.00 20.25 N ATOM 497 CA ALA A 80 -55.246 36.171 7.427 1.00 23.03 C ATOM 498 C ALA A 80 -56.262 36.870 6.544 1.00 22.68 C ATOM 499 O ALA A 80 -57.366 37.206 6.980 1.00 26.68 O ATOM 500 CB ALA A 80 -54.201 37.165 7.922 1.00 19.23 C ATOM 501 HA ALA A 80 -55.755 35.758 8.298 1.00 0.00 H ATOM 502 HB1 ALA A 80 -53.503 36.656 8.587 1.00 0.00 H ATOM 503 HB2 ALA A 80 -53.659 37.575 7.070 1.00 0.00 H ATOM 504 HB3 ALA A 80 -54.696 37.972 8.462 1.00 0.00 H ATOM 505 H ALA A 80 -53.588 35.063 6.551 1.00 0.00 H ATOM 506 N ALA A 81 -55.894 37.070 5.285 1.00 25.63 N ATOM 507 CA ALA A 81 -56.819 37.653 4.323 1.00 25.40 C ATOM 508 C ALA A 81 -58.108 36.823 4.221 1.00 26.70 C ATOM 509 O ALA A 81 -59.219 37.372 4.256 1.00 26.59 O ATOM 510 CB ALA A 81 -56.148 37.811 2.969 1.00 23.29 C ATOM 511 HA ALA A 81 -57.101 38.645 4.675 1.00 0.00 H ATOM 512 HB1 ALA A 81 -55.281 38.464 3.069 1.00 0.00 H ATOM 513 HB2 ALA A 81 -55.829 36.834 2.607 1.00 0.00 H ATOM 514 HB3 ALA A 81 -56.855 38.248 2.264 1.00 0.00 H ATOM 515 H ALA A 81 -54.934 36.808 4.982 1.00 0.00 H ATOM 516 N ASN A 82 -57.973 35.502 4.126 1.00 25.46 N ATOM 517 CA ASN A 82 -59.147 34.631 4.011 1.00 21.66 C ATOM 518 C ASN A 82 -60.072 34.698 5.232 1.00 20.36 C ATOM 519 O ASN A 82 -61.299 34.655 5.106 1.00 22.14 O ATOM 520 CB ASN A 82 -58.730 33.170 3.812 1.00 25.55 C ATOM 521 CG ASN A 82 -59.912 32.256 3.568 1.00 23.97 C ATOM 522 OD1 ASN A 82 -60.640 32.434 2.599 1.00 28.68 O ATOM 523 ND2 ASN A 82 -60.101 31.254 4.439 1.00 23.43 N ATOM 524 HA ASN A 82 -59.694 34.999 3.143 1.00 0.00 H ATOM 525 HB2 ASN A 82 -58.060 33.111 2.954 1.00 0.00 H ATOM 526 HB3 ASN A 82 -58.205 32.832 4.705 1.00 0.00 H ATOM 527 HD22 ASN A 82 -59.458 31.140 5.248 1.00 0.00 H ATOM 528 HD21 ASN A 82 -60.891 30.591 4.305 1.00 0.00 H ATOM 529 H ASN A 82 -57.022 35.082 4.133 1.00 0.00 H ATOM 530 N THR A 83 -59.469 34.759 6.410 1.00 19.92 N ATOM 531 CA THR A 83 -60.228 34.822 7.652 1.00 19.76 C ATOM 532 C THR A 83 -60.985 36.149 7.718 1.00 19.85 C ATOM 533 O THR A 83 -62.180 36.191 8.008 1.00 19.52 O ATOM 534 CB THR A 83 -59.284 34.667 8.868 1.00 16.28 C ATOM 535 OG1 THR A 83 -58.548 33.442 8.743 1.00 17.94 O ATOM 536 CG2 THR A 83 -60.058 34.627 10.150 1.00 13.60 C ATOM 537 HA THR A 83 -60.947 34.003 7.678 1.00 0.00 H ATOM 538 HB THR A 83 -58.610 35.524 8.887 1.00 0.00 H ATOM 539 HG1 THR A 83 -58.015 33.462 7.909 1.00 0.00 H ATOM 540 HG23 THR A 83 -60.624 35.552 10.260 1.00 0.00 H ATOM 541 HG21 THR A 83 -60.744 33.780 10.133 1.00 0.00 H ATOM 542 HG22 THR A 83 -59.368 34.520 10.987 1.00 0.00 H ATOM 543 H THR A 83 -58.430 34.762 6.449 1.00 0.00 H ATOM 544 N LEU A 84 -60.279 37.229 7.419 1.00 23.71 N ATOM 545 CA LEU A 84 -60.891 38.555 7.388 1.00 22.48 C ATOM 546 C LEU A 84 -62.097 38.558 6.466 1.00 21.75 C ATOM 547 O LEU A 84 -63.127 39.150 6.780 1.00 23.59 O ATOM 548 CB LEU A 84 -59.852 39.587 6.974 1.00 19.02 C ATOM 549 CG LEU A 84 -59.077 40.101 8.183 1.00 24.88 C ATOM 550 CD1 LEU A 84 -57.807 40.849 7.782 1.00 30.59 C ATOM 551 CD2 LEU A 84 -60.012 40.985 9.022 1.00 26.55 C ATOM 552 HA LEU A 84 -61.247 38.819 8.384 1.00 0.00 H ATOM 553 HB2 LEU A 84 -59.155 39.129 6.272 1.00 0.00 H ATOM 554 HB3 LEU A 84 -60.355 40.425 6.491 1.00 0.00 H ATOM 555 HG LEU A 84 -58.744 39.250 8.778 1.00 0.00 H ATOM 556 HD21 LEU A 84 -60.357 41.823 8.417 1.00 0.00 H ATOM 557 HD22 LEU A 84 -60.868 40.396 9.351 1.00 0.00 H ATOM 558 HD23 LEU A 84 -59.472 41.361 9.891 1.00 0.00 H ATOM 559 HD11 LEU A 84 -57.154 40.180 7.221 1.00 0.00 H ATOM 560 HD12 LEU A 84 -58.072 41.705 7.161 1.00 0.00 H ATOM 561 HD13 LEU A 84 -57.292 41.194 8.678 1.00 0.00 H ATOM 562 H LEU A 84 -59.267 37.131 7.202 1.00 0.00 H ATOM 563 N ALA A 85 -61.982 37.849 5.347 1.00 22.68 N ATOM 564 CA ALA A 85 -63.081 37.691 4.404 1.00 20.06 C ATOM 565 C ALA A 85 -64.283 36.951 4.974 1.00 22.65 C ATOM 566 O ALA A 85 -65.415 37.378 4.780 1.00 22.11 O ATOM 567 CB ALA A 85 -62.602 36.986 3.141 1.00 24.29 C ATOM 568 HA ALA A 85 -63.417 38.702 4.172 1.00 0.00 H ATOM 569 HB1 ALA A 85 -61.815 37.577 2.673 1.00 0.00 H ATOM 570 HB2 ALA A 85 -62.213 36.002 3.401 1.00 0.00 H ATOM 571 HB3 ALA A 85 -63.437 36.877 2.449 1.00 0.00 H ATOM 572 H ALA A 85 -61.073 37.390 5.137 1.00 0.00 H ATOM 573 N LYS A 86 -64.055 35.813 5.631 1.00 18.80 N ATOM 574 CA LYS A 86 -65.155 35.068 6.233 1.00 18.43 C ATOM 575 C LYS A 86 -65.825 35.868 7.360 1.00 18.56 C ATOM 576 O LYS A 86 -67.035 35.753 7.595 1.00 17.96 O ATOM 577 CB LYS A 86 -64.674 33.701 6.755 1.00 19.78 C ATOM 578 CG LYS A 86 -64.768 32.567 5.725 1.00 20.87 C ATOM 579 CD LYS A 86 -64.119 32.957 4.405 1.00 22.84 C ATOM 580 CE LYS A 86 -64.232 31.857 3.347 1.00 25.42 C ATOM 581 NZ LYS A 86 -63.165 32.000 2.310 1.00 28.32 N ATOM 582 HA LYS A 86 -65.899 34.898 5.454 1.00 0.00 H ATOM 583 HB2 LYS A 86 -63.633 33.799 7.062 1.00 0.00 H ATOM 584 HB3 LYS A 86 -65.282 33.431 7.618 1.00 0.00 H ATOM 585 HG2 LYS A 86 -64.264 31.686 6.121 1.00 0.00 H ATOM 586 HG3 LYS A 86 -65.818 32.335 5.549 1.00 0.00 H ATOM 587 HD2 LYS A 86 -64.606 33.856 4.028 1.00 0.00 H ATOM 588 HD3 LYS A 86 -63.064 33.165 4.582 1.00 0.00 H ATOM 589 HE2 LYS A 86 -65.208 31.923 2.866 1.00 0.00 H ATOM 590 HE3 LYS A 86 -64.132 30.885 3.830 1.00 0.00 H ATOM 591 HZ1 LYS A 86 -63.259 32.924 1.843 1.00 0.00 H ATOM 592 HZ2 LYS A 86 -62.231 31.933 2.763 1.00 0.00 H ATOM 593 HZ3 LYS A 86 -63.265 31.242 1.605 1.00 0.00 H ATOM 594 H LYS A 86 -63.083 35.453 5.715 1.00 0.00 H ATOM 595 N LEU A 87 -65.022 36.661 8.057 1.00 18.46 N ATOM 596 CA LEU A 87 -65.525 37.519 9.122 1.00 17.08 C ATOM 597 C LEU A 87 -66.415 38.620 8.544 1.00 19.87 C ATOM 598 O LEU A 87 -67.468 38.956 9.098 1.00 22.42 O ATOM 599 CB LEU A 87 -64.362 38.149 9.861 1.00 19.45 C ATOM 600 CG LEU A 87 -64.786 39.235 10.853 1.00 15.91 C ATOM 601 CD1 LEU A 87 -65.708 38.663 11.908 1.00 18.82 C ATOM 602 CD2 LEU A 87 -63.577 39.873 11.486 1.00 20.28 C ATOM 603 HA LEU A 87 -66.113 36.913 9.811 1.00 0.00 H ATOM 604 HB2 LEU A 87 -63.836 37.367 10.409 1.00 0.00 H ATOM 605 HB3 LEU A 87 -63.688 38.594 9.129 1.00 0.00 H ATOM 606 HG LEU A 87 -65.332 40.005 10.308 1.00 0.00 H ATOM 607 HD21 LEU A 87 -63.003 39.113 12.016 1.00 0.00 H ATOM 608 HD22 LEU A 87 -62.958 40.323 10.710 1.00 0.00 H ATOM 609 HD23 LEU A 87 -63.899 40.642 12.188 1.00 0.00 H ATOM 610 HD11 LEU A 87 -66.598 38.255 11.429 1.00 0.00 H ATOM 611 HD12 LEU A 87 -65.191 37.871 12.450 1.00 0.00 H ATOM 612 HD13 LEU A 87 -65.997 39.452 12.602 1.00 0.00 H ATOM 613 H LEU A 87 -64.006 36.671 7.837 1.00 0.00 H ATOM 614 N ASP A 88 -65.990 39.183 7.424 1.00 25.12 N ATOM 615 CA ASP A 88 -66.763 40.241 6.783 1.00 25.02 C ATOM 616 C ASP A 88 -68.072 39.712 6.222 1.00 28.21 C ATOM 617 O ASP A 88 -69.103 40.387 6.285 1.00 25.84 O ATOM 618 CB ASP A 88 -65.936 40.931 5.703 1.00 27.29 C ATOM 619 CG ASP A 88 -64.974 41.954 6.278 1.00 35.66 C ATOM 620 OD1 ASP A 88 -65.090 42.277 7.485 1.00 37.19 O ATOM 621 OD2 ASP A 88 -64.113 42.453 5.523 1.00 39.97 O ATOM 622 HA ASP A 88 -67.014 40.981 7.543 1.00 0.00 H ATOM 623 HB2 ASP A 88 -65.364 40.176 5.164 1.00 0.00 H ATOM 624 HB3 ASP A 88 -66.612 41.435 5.012 1.00 0.00 H ATOM 625 H ASP A 88 -65.096 38.868 6.997 1.00 0.00 H ATOM 626 N ALA A 89 -68.035 38.498 5.682 1.00 26.18 N ATOM 627 CA ALA A 89 -69.240 37.873 5.159 1.00 24.78 C ATOM 628 C ALA A 89 -70.237 37.664 6.281 1.00 24.92 C ATOM 629 O ALA A 89 -71.434 37.897 6.119 1.00 24.19 O ATOM 630 CB ALA A 89 -68.905 36.537 4.470 1.00 21.56 C ATOM 631 HA ALA A 89 -69.684 38.532 4.413 1.00 0.00 H ATOM 632 HB1 ALA A 89 -68.215 36.718 3.646 1.00 0.00 H ATOM 633 HB2 ALA A 89 -68.443 35.863 5.192 1.00 0.00 H ATOM 634 HB3 ALA A 89 -69.821 36.088 4.087 1.00 0.00 H ATOM 635 H ALA A 89 -67.131 37.987 5.633 1.00 0.00 H ATOM 636 N PHE A 90 -69.739 37.231 7.434 1.00 23.14 N ATOM 637 CA PHE A 90 -70.602 36.980 8.578 1.00 23.34 C ATOM 638 C PHE A 90 -71.148 38.303 9.130 1.00 22.68 C ATOM 639 O PHE A 90 -72.342 38.427 9.408 1.00 23.66 O ATOM 640 CB PHE A 90 -69.830 36.218 9.650 1.00 16.86 C ATOM 641 CG PHE A 90 -70.652 35.851 10.842 1.00 19.44 C ATOM 642 CD1 PHE A 90 -71.811 35.114 10.699 1.00 17.04 C ATOM 643 CD2 PHE A 90 -70.252 36.234 12.116 1.00 21.16 C ATOM 644 CE1 PHE A 90 -72.570 34.773 11.799 1.00 23.47 C ATOM 645 CE2 PHE A 90 -70.996 35.897 13.224 1.00 20.59 C ATOM 646 CZ PHE A 90 -72.166 35.169 13.071 1.00 23.05 C ATOM 647 HA PHE A 90 -71.449 36.370 8.263 1.00 0.00 H ATOM 648 HB2 PHE A 90 -69.440 35.302 9.207 1.00 0.00 H ATOM 649 HB3 PHE A 90 -69.000 36.841 9.984 1.00 0.00 H ATOM 650 HD2 PHE A 90 -69.335 36.810 12.240 1.00 0.00 H ATOM 651 HE2 PHE A 90 -70.667 36.201 14.218 1.00 0.00 H ATOM 652 HZ PHE A 90 -72.767 34.908 13.942 1.00 0.00 H ATOM 653 HE1 PHE A 90 -73.485 34.194 11.673 1.00 0.00 H ATOM 654 HD1 PHE A 90 -72.130 34.798 9.706 1.00 0.00 H ATOM 655 H PHE A 90 -68.715 37.069 7.520 1.00 0.00 H ATOM 656 N SER A 91 -70.270 39.290 9.267 1.00 20.65 N ATOM 657 CA SER A 91 -70.678 40.614 9.731 1.00 22.29 C ATOM 658 C SER A 91 -71.707 41.255 8.788 1.00 24.21 C ATOM 659 O SER A 91 -72.694 41.836 9.246 1.00 23.07 O ATOM 660 CB SER A 91 -69.464 41.533 9.898 1.00 24.64 C ATOM 661 OG SER A 91 -69.865 42.829 10.323 1.00 25.62 O ATOM 662 HA SER A 91 -71.153 40.483 10.703 1.00 0.00 H ATOM 663 HB2 SER A 91 -68.944 41.615 8.944 1.00 0.00 H ATOM 664 HB3 SER A 91 -68.791 41.105 10.641 1.00 0.00 H ATOM 665 HG SER A 91 -70.335 42.760 11.192 1.00 0.00 H ATOM 666 H SER A 91 -69.270 39.117 9.039 1.00 0.00 H ATOM 667 N LYS A 92 -71.475 41.151 7.479 1.00 23.77 N ATOM 668 CA LYS A 92 -72.379 41.744 6.487 1.00 23.28 C ATOM 669 C LYS A 92 -73.768 41.142 6.611 1.00 24.68 C ATOM 670 O LYS A 92 -74.776 41.841 6.502 1.00 24.62 O ATOM 671 CB LYS A 92 -71.863 41.532 5.057 1.00 27.82 C ATOM 672 CG LYS A 92 -72.302 42.615 4.067 1.00 33.16 C ATOM 673 CD LYS A 92 -72.409 42.101 2.630 1.00 30.63 C ATOM 674 CE LYS A 92 -71.127 41.447 2.150 1.00 33.37 C ATOM 675 NZ LYS A 92 -71.238 40.974 0.739 1.00 28.21 N ATOM 676 HA LYS A 92 -72.422 42.815 6.685 1.00 0.00 H ATOM 677 HB2 LYS A 92 -70.773 41.515 5.085 1.00 0.00 H ATOM 678 HB3 LYS A 92 -72.231 40.571 4.699 1.00 0.00 H ATOM 679 HG2 LYS A 92 -73.277 42.993 4.375 1.00 0.00 H ATOM 680 HG3 LYS A 92 -71.574 43.426 4.093 1.00 0.00 H ATOM 681 HD2 LYS A 92 -73.215 41.369 2.579 1.00 0.00 H ATOM 682 HD3 LYS A 92 -72.640 42.941 1.974 1.00 0.00 H ATOM 683 HE2 LYS A 92 -70.905 40.594 2.791 1.00 0.00 H ATOM 684 HE3 LYS A 92 -70.315 42.171 2.216 1.00 0.00 H ATOM 685 HZ1 LYS A 92 -72.006 40.277 0.668 1.00 0.00 H ATOM 686 HZ2 LYS A 92 -71.444 41.783 0.119 1.00 0.00 H ATOM 687 HZ3 LYS A 92 -70.341 40.534 0.451 1.00 0.00 H ATOM 688 H LYS A 92 -70.632 40.637 7.153 1.00 0.00 H ATOM 689 N GLN A 93 -73.821 39.834 6.829 1.00 22.11 N ATOM 690 CA GLN A 93 -75.101 39.146 6.962 1.00 20.77 C ATOM 691 C GLN A 93 -75.806 39.528 8.267 1.00 22.96 C ATOM 692 O GLN A 93 -77.030 39.676 8.292 1.00 24.65 O ATOM 693 CB GLN A 93 -74.910 37.629 6.851 1.00 22.10 C ATOM 694 CG GLN A 93 -76.199 36.814 6.960 1.00 20.31 C ATOM 695 CD GLN A 93 -76.989 36.758 5.653 1.00 24.57 C ATOM 696 OE1 GLN A 93 -76.661 37.442 4.670 1.00 24.14 O ATOM 697 NE2 GLN A 93 -78.028 35.935 5.635 1.00 19.87 N ATOM 698 HA GLN A 93 -75.745 39.466 6.143 1.00 0.00 H ATOM 699 HB2 GLN A 93 -74.452 37.414 5.885 1.00 0.00 H ATOM 700 HB3 GLN A 93 -74.239 37.312 7.649 1.00 0.00 H ATOM 701 HG2 GLN A 93 -75.942 35.796 7.253 1.00 0.00 H ATOM 702 HG3 GLN A 93 -76.830 37.264 7.727 1.00 0.00 H ATOM 703 HE22 GLN A 93 -78.267 35.381 6.482 1.00 0.00 H ATOM 704 HE21 GLN A 93 -78.604 35.844 4.774 1.00 0.00 H ATOM 705 H GLN A 93 -72.937 39.291 6.906 1.00 0.00 H ATOM 706 N GLN A 94 -75.046 39.700 9.345 1.00 19.80 N ATOM 707 CA GLN A 94 -75.638 40.184 10.601 1.00 23.77 C ATOM 708 C GLN A 94 -76.277 41.549 10.348 1.00 22.60 C ATOM 709 O GLN A 94 -77.424 41.792 10.714 1.00 23.73 O ATOM 710 CB GLN A 94 -74.580 40.280 11.708 1.00 18.77 C ATOM 711 CG GLN A 94 -75.095 40.784 13.085 1.00 20.57 C ATOM 712 CD GLN A 94 -75.303 42.283 13.115 1.00 23.92 C ATOM 713 OE1 GLN A 94 -74.656 43.018 12.365 1.00 22.38 O ATOM 714 NE2 GLN A 94 -76.214 42.753 13.981 1.00 21.29 N ATOM 715 HA GLN A 94 -76.397 39.478 10.937 1.00 0.00 H ATOM 716 HB2 GLN A 94 -74.153 39.287 11.852 1.00 0.00 H ATOM 717 HB3 GLN A 94 -73.801 40.964 11.370 1.00 0.00 H ATOM 718 HG2 GLN A 94 -76.044 40.295 13.303 1.00 0.00 H ATOM 719 HG3 GLN A 94 -74.366 40.517 13.850 1.00 0.00 H ATOM 720 HE22 GLN A 94 -76.736 42.095 14.594 1.00 0.00 H ATOM 721 HE21 GLN A 94 -76.398 43.775 14.039 1.00 0.00 H ATOM 722 H GLN A 94 -74.028 39.491 9.299 1.00 0.00 H ATOM 723 N ALA A 95 -75.515 42.437 9.716 1.00 23.19 N ATOM 724 CA ALA A 95 -75.985 43.792 9.426 1.00 23.06 C ATOM 725 C ALA A 95 -77.192 43.777 8.493 1.00 24.55 C ATOM 726 O ALA A 95 -78.155 44.519 8.699 1.00 31.40 O ATOM 727 CB ALA A 95 -74.859 44.627 8.833 1.00 24.98 C ATOM 728 HA ALA A 95 -76.301 44.245 10.366 1.00 0.00 H ATOM 729 HB1 ALA A 95 -74.035 44.681 9.544 1.00 0.00 H ATOM 730 HB2 ALA A 95 -74.513 44.164 7.909 1.00 0.00 H ATOM 731 HB3 ALA A 95 -75.225 45.632 8.623 1.00 0.00 H ATOM 732 H ALA A 95 -74.557 42.160 9.419 1.00 0.00 H ATOM 733 N TYR A 96 -77.147 42.926 7.476 1.00 25.65 N ATOM 734 CA TYR A 96 -78.271 42.774 6.550 1.00 23.86 C ATOM 735 C TYR A 96 -79.545 42.363 7.286 1.00 25.07 C ATOM 736 O TYR A 96 -80.585 43.014 7.145 1.00 23.83 O ATOM 737 CB TYR A 96 -77.924 41.780 5.435 1.00 23.83 C ATOM 738 CG TYR A 96 -79.075 41.429 4.520 1.00 24.13 C ATOM 739 CD1 TYR A 96 -79.620 42.376 3.659 1.00 26.18 C ATOM 740 CD2 TYR A 96 -79.615 40.143 4.508 1.00 26.62 C ATOM 741 CE1 TYR A 96 -80.673 42.050 2.818 1.00 24.17 C ATOM 742 CE2 TYR A 96 -80.665 39.809 3.669 1.00 26.55 C ATOM 743 CZ TYR A 96 -81.191 40.764 2.824 1.00 28.77 C ATOM 744 OH TYR A 96 -82.244 40.440 1.986 1.00 29.37 O ATOM 745 HA TYR A 96 -78.462 43.743 6.089 1.00 0.00 H ATOM 746 HB3 TYR A 96 -77.566 40.861 5.899 1.00 0.00 H ATOM 747 HB2 TYR A 96 -77.128 42.213 4.829 1.00 0.00 H ATOM 748 HD2 TYR A 96 -79.202 39.385 5.173 1.00 0.00 H ATOM 749 HE2 TYR A 96 -81.073 38.798 3.676 1.00 0.00 H ATOM 750 HE1 TYR A 96 -81.093 42.804 2.153 1.00 0.00 H ATOM 751 HD1 TYR A 96 -79.214 43.387 3.645 1.00 0.00 H ATOM 752 HH TYR A 96 -82.496 41.235 1.452 1.00 0.00 H ATOM 753 H TYR A 96 -76.291 42.352 7.333 1.00 0.00 H ATOM 754 N LEU A 97 -79.471 41.307 8.093 1.00 21.92 N ATOM 755 CA LEU A 97 -80.662 40.845 8.810 1.00 23.19 C ATOM 756 C LEU A 97 -81.144 41.847 9.861 1.00 22.47 C ATOM 757 O LEU A 97 -82.327 41.878 10.196 1.00 21.19 O ATOM 758 CB LEU A 97 -80.420 39.494 9.474 1.00 18.51 C ATOM 759 CG LEU A 97 -80.024 38.337 8.551 1.00 22.24 C ATOM 760 CD1 LEU A 97 -80.133 37.056 9.329 1.00 21.20 C ATOM 761 CD2 LEU A 97 -80.910 38.286 7.317 1.00 22.35 C ATOM 762 HA LEU A 97 -81.443 40.745 8.057 1.00 0.00 H ATOM 763 HB2 LEU A 97 -79.621 39.623 10.205 1.00 0.00 H ATOM 764 HB3 LEU A 97 -81.338 39.208 9.987 1.00 0.00 H ATOM 765 HG LEU A 97 -79.001 38.484 8.206 1.00 0.00 H ATOM 766 HD21 LEU A 97 -81.947 38.148 7.622 1.00 0.00 H ATOM 767 HD22 LEU A 97 -80.814 39.220 6.764 1.00 0.00 H ATOM 768 HD23 LEU A 97 -80.602 37.454 6.684 1.00 0.00 H ATOM 769 HD11 LEU A 97 -79.463 37.096 10.188 1.00 0.00 H ATOM 770 HD12 LEU A 97 -81.159 36.927 9.672 1.00 0.00 H ATOM 771 HD13 LEU A 97 -79.855 36.219 8.689 1.00 0.00 H ATOM 772 H LEU A 97 -78.566 40.809 8.215 1.00 0.00 H ATOM 773 N ALA A 98 -80.225 42.653 10.388 1.00 24.59 N ATOM 774 CA ALA A 98 -80.605 43.688 11.357 1.00 21.76 C ATOM 775 C ALA A 98 -81.549 44.703 10.731 1.00 22.83 C ATOM 776 O ALA A 98 -82.339 45.347 11.431 1.00 24.43 O ATOM 777 CB ALA A 98 -79.383 44.370 11.930 1.00 20.41 C ATOM 778 HA ALA A 98 -81.133 43.199 12.176 1.00 0.00 H ATOM 779 HB1 ALA A 98 -78.759 43.632 12.433 1.00 0.00 H ATOM 780 HB2 ALA A 98 -78.817 44.837 11.124 1.00 0.00 H ATOM 781 HB3 ALA A 98 -79.695 45.132 12.645 1.00 0.00 H ATOM 782 H ALA A 98 -79.228 42.548 10.111 1.00 0.00 H ATOM 783 N THR A 99 -81.481 44.842 9.409 1.00 23.84 N ATOM 784 CA THR A 99 -82.399 45.736 8.722 1.00 24.33 C ATOM 785 C THR A 99 -83.720 45.073 8.335 1.00 25.78 C ATOM 786 O THR A 99 -84.724 45.764 8.176 1.00 28.32 O ATOM 787 CB THR A 99 -81.791 46.379 7.447 1.00 26.17 C ATOM 788 OG1 THR A 99 -81.626 45.391 6.418 1.00 28.58 O ATOM 789 CG2 THR A 99 -80.458 47.039 7.756 1.00 25.03 C ATOM 790 HA THR A 99 -82.593 46.514 9.460 1.00 0.00 H ATOM 791 HB THR A 99 -82.480 47.146 7.093 1.00 0.00 H ATOM 792 HG1 THR A 99 -81.020 44.678 6.741 1.00 0.00 H ATOM 793 HG23 THR A 99 -80.596 47.786 8.538 1.00 0.00 H ATOM 794 HG21 THR A 99 -79.750 46.283 8.095 1.00 0.00 H ATOM 795 HG22 THR A 99 -80.075 47.520 6.856 1.00 0.00 H ATOM 796 H THR A 99 -80.770 44.310 8.867 1.00 0.00 H ATOM 797 N THR A 100 -83.725 43.749 8.176 1.00 23.34 N ATOM 798 CA THR A 100 -84.901 43.067 7.613 1.00 25.08 C ATOM 799 C THR A 100 -85.771 42.340 8.635 1.00 26.58 C ATOM 800 O THR A 100 -86.976 42.190 8.428 1.00 28.29 O ATOM 801 CB THR A 100 -84.527 42.068 6.498 1.00 26.21 C ATOM 802 OG1 THR A 100 -83.682 41.046 7.043 1.00 26.05 O ATOM 803 CG2 THR A 100 -83.815 42.776 5.347 1.00 27.81 C ATOM 804 HA THR A 100 -85.488 43.889 7.203 1.00 0.00 H ATOM 805 HB THR A 100 -85.440 41.621 6.106 1.00 0.00 H ATOM 806 HG1 THR A 100 -83.441 40.404 6.329 1.00 0.00 H ATOM 807 HG23 THR A 100 -84.466 43.550 4.940 1.00 0.00 H ATOM 808 HG21 THR A 100 -82.895 43.229 5.715 1.00 0.00 H ATOM 809 HG22 THR A 100 -83.579 42.052 4.567 1.00 0.00 H ATOM 810 H THR A 100 -82.890 43.194 8.452 1.00 0.00 H ATOM 811 N PHE A 101 -85.178 41.880 9.729 1.00 23.96 N ATOM 812 CA PHE A 101 -85.989 41.303 10.798 1.00 22.69 C ATOM 813 C PHE A 101 -86.699 42.433 11.527 1.00 26.72 C ATOM 814 O PHE A 101 -86.152 43.524 11.678 1.00 28.95 O ATOM 815 CB PHE A 101 -85.145 40.483 11.768 1.00 22.57 C ATOM 816 CG PHE A 101 -84.855 39.090 11.283 1.00 22.37 C ATOM 817 CD1 PHE A 101 -84.492 38.868 9.970 1.00 22.59 C ATOM 818 CD2 PHE A 101 -84.937 38.010 12.144 1.00 27.47 C ATOM 819 CE1 PHE A 101 -84.212 37.583 9.515 1.00 27.57 C ATOM 820 CE2 PHE A 101 -84.656 36.727 11.702 1.00 26.41 C ATOM 821 CZ PHE A 101 -84.294 36.515 10.385 1.00 25.63 C ATOM 822 HA PHE A 101 -86.719 40.620 10.362 1.00 0.00 H ATOM 823 HB2 PHE A 101 -84.197 40.999 11.922 1.00 0.00 H ATOM 824 HB3 PHE A 101 -85.678 40.414 12.716 1.00 0.00 H ATOM 825 HD2 PHE A 101 -85.226 38.170 13.183 1.00 0.00 H ATOM 826 HE2 PHE A 101 -84.720 35.886 12.392 1.00 0.00 H ATOM 827 HZ PHE A 101 -84.074 35.507 10.034 1.00 0.00 H ATOM 828 HE1 PHE A 101 -83.929 37.421 8.475 1.00 0.00 H ATOM 829 HD1 PHE A 101 -84.424 39.710 9.281 1.00 0.00 H ATOM 830 H PHE A 101 -84.144 41.930 9.825 1.00 0.00 H ATOM 831 N LYS A 102 -87.912 42.162 11.982 1.00 24.09 N ATOM 832 CA LYS A 102 -88.787 43.214 12.472 1.00 24.61 C ATOM 833 C LYS A 102 -89.172 43.047 13.943 1.00 25.48 C ATOM 834 O LYS A 102 -89.386 44.029 14.641 1.00 22.06 O ATOM 835 CB LYS A 102 -90.045 43.286 11.600 1.00 26.30 C ATOM 836 CG LYS A 102 -89.757 43.527 10.117 1.00 27.31 C ATOM 837 CD LYS A 102 -88.897 44.774 9.903 1.00 31.41 C ATOM 838 CE LYS A 102 -88.531 44.960 8.431 1.00 29.74 C ATOM 839 NZ LYS A 102 -87.826 46.243 8.169 1.00 34.79 N ATOM 840 HA LYS A 102 -88.228 44.147 12.406 1.00 0.00 H ATOM 841 HB2 LYS A 102 -90.585 42.344 11.697 1.00 0.00 H ATOM 842 HB3 LYS A 102 -90.670 44.101 11.965 1.00 0.00 H ATOM 843 HG2 LYS A 102 -89.231 42.661 9.714 1.00 0.00 H ATOM 844 HG3 LYS A 102 -90.702 43.655 9.589 1.00 0.00 H ATOM 845 HD2 LYS A 102 -89.451 45.649 10.243 1.00 0.00 H ATOM 846 HD3 LYS A 102 -87.981 44.677 10.486 1.00 0.00 H ATOM 847 HE2 LYS A 102 -89.446 44.938 7.839 1.00 0.00 H ATOM 848 HE3 LYS A 102 -87.883 44.138 8.127 1.00 0.00 H ATOM 849 HZ1 LYS A 102 -88.438 47.037 8.447 1.00 0.00 H ATOM 850 HZ2 LYS A 102 -86.945 46.272 8.722 1.00 0.00 H ATOM 851 HZ3 LYS A 102 -87.603 46.314 7.156 1.00 0.00 H ATOM 852 H LYS A 102 -88.246 41.177 11.989 1.00 0.00 H ATOM 853 N SER A 103 -89.268 41.811 14.416 1.00 24.95 N ATOM 854 CA SER A 103 -89.716 41.595 15.792 1.00 25.19 C ATOM 855 C SER A 103 -88.665 42.052 16.807 1.00 26.60 C ATOM 856 O SER A 103 -87.474 41.792 16.642 1.00 25.47 O ATOM 857 CB SER A 103 -90.089 40.130 16.030 1.00 27.65 C ATOM 858 OG SER A 103 -88.956 39.303 15.867 1.00 36.25 O ATOM 859 HA SER A 103 -90.608 42.204 15.937 1.00 0.00 H ATOM 860 HB2 SER A 103 -90.857 39.833 15.315 1.00 0.00 H ATOM 861 HB3 SER A 103 -90.474 40.017 17.043 1.00 0.00 H ATOM 862 HG SER A 103 -88.258 39.569 16.517 1.00 0.00 H ATOM 863 H SER A 103 -89.026 41.000 13.812 1.00 0.00 H ATOM 864 N PRO A 104 -89.109 42.733 17.871 1.00 25.29 N ATOM 865 CA PRO A 104 -88.161 43.272 18.848 1.00 27.25 C ATOM 866 C PRO A 104 -87.198 42.227 19.400 1.00 23.79 C ATOM 867 O PRO A 104 -86.015 42.532 19.560 1.00 25.61 O ATOM 868 CB PRO A 104 -89.071 43.814 19.953 1.00 28.50 C ATOM 869 CG PRO A 104 -90.309 44.211 19.223 1.00 30.28 C ATOM 870 CD PRO A 104 -90.493 43.139 18.167 1.00 24.54 C ATOM 871 HA PRO A 104 -87.507 44.021 18.402 1.00 0.00 H ATOM 872 HD3 PRO A 104 -91.074 42.302 18.554 1.00 0.00 H ATOM 873 HD2 PRO A 104 -90.983 43.541 17.280 1.00 0.00 H ATOM 874 HG3 PRO A 104 -90.185 45.190 18.760 1.00 0.00 H ATOM 875 HG2 PRO A 104 -91.163 44.236 19.899 1.00 0.00 H ATOM 876 HB2 PRO A 104 -89.286 43.044 20.694 1.00 0.00 H ATOM 877 HB3 PRO A 104 -88.616 44.674 20.446 1.00 0.00 H ATOM 878 N GLU A 105 -87.664 41.019 19.686 1.00 22.28 N ATOM 879 CA GLU A 105 -86.745 40.068 20.293 1.00 27.21 C ATOM 880 C GLU A 105 -85.701 39.586 19.287 1.00 23.66 C ATOM 881 O GLU A 105 -84.572 39.285 19.662 1.00 22.60 O ATOM 882 CB GLU A 105 -87.471 38.903 20.966 1.00 29.89 C ATOM 883 CG GLU A 105 -88.097 37.899 20.029 1.00 34.89 C ATOM 884 CD GLU A 105 -88.522 36.636 20.761 1.00 42.18 C ATOM 885 OE1 GLU A 105 -88.084 36.456 21.920 1.00 42.76 O ATOM 886 OE2 GLU A 105 -89.292 35.832 20.187 1.00 38.62 O ATOM 887 HA GLU A 105 -86.217 40.597 21.086 1.00 0.00 H ATOM 888 HB2 GLU A 105 -86.752 38.375 21.592 1.00 0.00 H ATOM 889 HB3 GLU A 105 -88.261 39.316 21.592 1.00 0.00 H ATOM 890 HG2 GLU A 105 -88.973 38.349 19.562 1.00 0.00 H ATOM 891 HG3 GLU A 105 -87.372 37.634 19.259 1.00 0.00 H ATOM 892 H GLU A 105 -88.651 40.761 19.484 1.00 0.00 H ATOM 893 N ASN A 106 -86.070 39.543 18.011 1.00 22.59 N ATOM 894 CA ASN A 106 -85.119 39.177 16.963 1.00 21.26 C ATOM 895 C ASN A 106 -84.113 40.291 16.690 1.00 21.01 C ATOM 896 O ASN A 106 -82.927 40.034 16.523 1.00 20.44 O ATOM 897 CB ASN A 106 -85.830 38.781 15.663 1.00 23.99 C ATOM 898 CG ASN A 106 -86.491 37.409 15.748 1.00 22.27 C ATOM 899 OD1 ASN A 106 -86.025 36.534 16.471 1.00 25.19 O ATOM 900 ND2 ASN A 106 -87.571 37.218 14.996 1.00 26.11 N ATOM 901 HA ASN A 106 -84.573 38.310 17.335 1.00 0.00 H ATOM 902 HB2 ASN A 106 -86.596 39.525 15.444 1.00 0.00 H ATOM 903 HB3 ASN A 106 -85.098 38.766 14.855 1.00 0.00 H ATOM 904 HD22 ASN A 106 -87.931 37.989 14.398 1.00 0.00 H ATOM 905 HD21 ASN A 106 -88.056 36.298 15.006 1.00 0.00 H ATOM 906 H ASN A 106 -87.051 39.773 17.754 1.00 0.00 H ATOM 907 N VAL A 107 -84.588 41.530 16.635 1.00 21.42 N ATOM 908 CA VAL A 107 -83.692 42.642 16.355 1.00 20.73 C ATOM 909 C VAL A 107 -82.674 42.763 17.490 1.00 20.08 C ATOM 910 O VAL A 107 -81.515 43.118 17.250 1.00 19.33 O ATOM 911 CB VAL A 107 -84.457 43.968 16.123 1.00 19.12 C ATOM 912 CG1 VAL A 107 -83.498 45.084 15.771 1.00 21.42 C ATOM 913 CG2 VAL A 107 -85.449 43.802 14.989 1.00 21.19 C ATOM 914 HA VAL A 107 -83.164 42.438 15.423 1.00 0.00 H ATOM 915 HB VAL A 107 -84.982 44.221 17.044 1.00 0.00 H ATOM 916 HG11 VAL A 107 -82.789 45.224 16.587 1.00 0.00 H ATOM 917 HG12 VAL A 107 -82.958 44.824 14.860 1.00 0.00 H ATOM 918 HG13 VAL A 107 -84.058 46.006 15.612 1.00 0.00 H ATOM 919 HG21 VAL A 107 -84.915 43.531 14.078 1.00 0.00 H ATOM 920 HG22 VAL A 107 -86.161 43.016 15.243 1.00 0.00 H ATOM 921 HG23 VAL A 107 -85.982 44.740 14.834 1.00 0.00 H ATOM 922 H VAL A 107 -85.601 41.706 16.792 1.00 0.00 H ATOM 923 N LYS A 108 -83.104 42.436 18.711 1.00 20.08 N ATOM 924 CA LYS A 108 -82.227 42.502 19.874 1.00 24.03 C ATOM 925 C LYS A 108 -81.184 41.403 19.855 1.00 21.47 C ATOM 926 O LYS A 108 -80.005 41.642 20.133 1.00 20.35 O ATOM 927 CB LYS A 108 -83.003 42.425 21.187 1.00 20.96 C ATOM 928 CG LYS A 108 -82.054 42.404 22.391 1.00 25.82 C ATOM 929 CD LYS A 108 -82.731 42.707 23.711 1.00 25.18 C ATOM 930 CE LYS A 108 -81.682 42.828 24.811 1.00 29.02 C ATOM 931 NZ LYS A 108 -82.298 42.991 26.145 1.00 32.88 N ATOM 932 HA LYS A 108 -81.730 43.470 19.815 1.00 0.00 H ATOM 933 HB2 LYS A 108 -83.658 43.293 21.265 1.00 0.00 H ATOM 934 HB3 LYS A 108 -83.605 41.516 21.192 1.00 0.00 H ATOM 935 HG2 LYS A 108 -81.603 41.414 22.456 1.00 0.00 H ATOM 936 HG3 LYS A 108 -81.274 43.147 22.226 1.00 0.00 H ATOM 937 HD2 LYS A 108 -83.281 43.645 23.630 1.00 0.00 H ATOM 938 HD3 LYS A 108 -83.423 41.902 23.957 1.00 0.00 H ATOM 939 HE2 LYS A 108 -81.053 43.694 24.605 1.00 0.00 H ATOM 940 HE3 LYS A 108 -81.068 41.927 24.814 1.00 0.00 H ATOM 941 HZ1 LYS A 108 -82.881 43.853 26.154 1.00 0.00 H ATOM 942 HZ2 LYS A 108 -82.895 42.165 26.353 1.00 0.00 H ATOM 943 HZ3 LYS A 108 -81.550 43.069 26.864 1.00 0.00 H ATOM 944 H LYS A 108 -84.089 42.126 18.836 1.00 0.00 H ATOM 945 N LEU A 109 -81.622 40.190 19.550 1.00 20.09 N ATOM 946 CA LEU A 109 -80.690 39.080 19.416 1.00 19.01 C ATOM 947 C LEU A 109 -79.650 39.399 18.345 1.00 19.03 C ATOM 948 O LEU A 109 -78.463 39.135 18.527 1.00 22.14 O ATOM 949 CB LEU A 109 -81.440 37.787 19.091 1.00 22.23 C ATOM 950 CG LEU A 109 -82.115 37.090 20.274 1.00 25.19 C ATOM 951 CD1 LEU A 109 -83.193 36.108 19.788 1.00 27.44 C ATOM 952 CD2 LEU A 109 -81.076 36.365 21.120 1.00 23.48 C ATOM 953 HA LEU A 109 -80.172 38.934 20.364 1.00 0.00 H ATOM 954 HB2 LEU A 109 -82.211 38.023 18.358 1.00 0.00 H ATOM 955 HB3 LEU A 109 -80.727 37.088 18.654 1.00 0.00 H ATOM 956 HG LEU A 109 -82.600 37.848 20.888 1.00 0.00 H ATOM 957 HD21 LEU A 109 -80.568 35.620 20.509 1.00 0.00 H ATOM 958 HD22 LEU A 109 -80.349 37.085 21.497 1.00 0.00 H ATOM 959 HD23 LEU A 109 -81.570 35.874 21.958 1.00 0.00 H ATOM 960 HD11 LEU A 109 -83.949 36.652 19.222 1.00 0.00 H ATOM 961 HD12 LEU A 109 -82.734 35.353 19.150 1.00 0.00 H ATOM 962 HD13 LEU A 109 -83.658 35.626 20.648 1.00 0.00 H ATOM 963 H LEU A 109 -82.639 40.030 19.405 1.00 0.00 H ATOM 964 N LEU A 110 -80.091 39.979 17.234 1.00 18.78 N ATOM 965 CA LEU A 110 -79.156 40.407 16.196 1.00 20.16 C ATOM 966 C LEU A 110 -78.208 41.495 16.686 1.00 19.57 C ATOM 967 O LEU A 110 -77.044 41.515 16.306 1.00 18.36 O ATOM 968 CB LEU A 110 -79.891 40.845 14.929 1.00 20.28 C ATOM 969 CG LEU A 110 -80.544 39.672 14.187 1.00 22.50 C ATOM 970 CD1 LEU A 110 -81.617 40.144 13.220 1.00 19.90 C ATOM 971 CD2 LEU A 110 -79.481 38.861 13.456 1.00 19.69 C ATOM 972 HA LEU A 110 -78.545 39.540 15.947 1.00 0.00 H ATOM 973 HB2 LEU A 110 -80.667 41.559 15.205 1.00 0.00 H ATOM 974 HB3 LEU A 110 -79.177 41.327 14.261 1.00 0.00 H ATOM 975 HG LEU A 110 -81.032 39.037 14.926 1.00 0.00 H ATOM 976 HD21 LEU A 110 -78.969 39.500 12.737 1.00 0.00 H ATOM 977 HD22 LEU A 110 -78.761 38.474 14.177 1.00 0.00 H ATOM 978 HD23 LEU A 110 -79.955 38.031 12.933 1.00 0.00 H ATOM 979 HD11 LEU A 110 -82.393 40.676 13.771 1.00 0.00 H ATOM 980 HD12 LEU A 110 -81.171 40.811 12.482 1.00 0.00 H ATOM 981 HD13 LEU A 110 -82.054 39.282 12.715 1.00 0.00 H ATOM 982 H LEU A 110 -81.111 40.130 17.102 1.00 0.00 H ATOM 983 N GLY A 111 -78.712 42.394 17.528 1.00 19.30 N ATOM 984 CA GLY A 111 -77.870 43.388 18.165 1.00 16.24 C ATOM 985 C GLY A 111 -76.814 42.745 19.045 1.00 19.15 C ATOM 986 O GLY A 111 -75.643 43.139 19.019 1.00 17.36 O ATOM 987 HA3 GLY A 111 -78.493 44.039 18.778 1.00 0.00 H ATOM 988 HA2 GLY A 111 -77.376 43.980 17.394 1.00 0.00 H ATOM 989 H GLY A 111 -79.731 42.383 17.734 1.00 0.00 H ATOM 990 N GLU A 112 -77.220 41.752 19.831 1.00 17.96 N ATOM 991 CA GLU A 112 -76.272 41.038 20.680 1.00 17.42 C ATOM 992 C GLU A 112 -75.217 40.332 19.831 1.00 19.75 C ATOM 993 O GLU A 112 -74.019 40.456 20.082 1.00 17.12 O ATOM 994 CB GLU A 112 -77.015 40.073 21.606 1.00 18.38 C ATOM 995 CG GLU A 112 -77.800 40.818 22.692 1.00 22.24 C ATOM 996 CD GLU A 112 -78.796 39.938 23.420 1.00 25.19 C ATOM 997 OE1 GLU A 112 -79.216 38.906 22.858 1.00 24.21 O ATOM 998 OE2 GLU A 112 -79.159 40.282 24.557 1.00 27.70 O ATOM 999 HA GLU A 112 -75.745 41.754 21.311 1.00 0.00 H ATOM 1000 HB2 GLU A 112 -77.710 39.479 21.013 1.00 0.00 H ATOM 1001 HB3 GLU A 112 -76.291 39.413 22.084 1.00 0.00 H ATOM 1002 HG2 GLU A 112 -77.093 41.216 23.420 1.00 0.00 H ATOM 1003 HG3 GLU A 112 -78.341 41.641 22.225 1.00 0.00 H ATOM 1004 H GLU A 112 -78.224 41.481 19.841 1.00 0.00 H ATOM 1005 N LEU A 113 -75.661 39.616 18.803 1.00 19.48 N ATOM 1006 CA LEU A 113 -74.727 38.991 17.871 1.00 20.32 C ATOM 1007 C LEU A 113 -73.741 40.009 17.302 1.00 20.93 C ATOM 1008 O LEU A 113 -72.536 39.751 17.232 1.00 20.22 O ATOM 1009 CB LEU A 113 -75.497 38.309 16.734 1.00 21.50 C ATOM 1010 CG LEU A 113 -74.761 37.208 15.982 1.00 26.86 C ATOM 1011 CD1 LEU A 113 -74.721 35.948 16.819 1.00 24.08 C ATOM 1012 CD2 LEU A 113 -75.435 36.940 14.651 1.00 27.89 C ATOM 1013 HA LEU A 113 -74.155 38.242 18.419 1.00 0.00 H ATOM 1014 HB2 LEU A 113 -76.401 37.873 17.160 1.00 0.00 H ATOM 1015 HB3 LEU A 113 -75.772 39.078 16.012 1.00 0.00 H ATOM 1016 HG LEU A 113 -73.738 37.533 15.790 1.00 0.00 H ATOM 1017 HD21 LEU A 113 -76.465 36.627 14.823 1.00 0.00 H ATOM 1018 HD22 LEU A 113 -75.426 37.850 14.051 1.00 0.00 H ATOM 1019 HD23 LEU A 113 -74.897 36.151 14.125 1.00 0.00 H ATOM 1020 HD11 LEU A 113 -74.202 36.152 17.756 1.00 0.00 H ATOM 1021 HD12 LEU A 113 -75.739 35.621 17.030 1.00 0.00 H ATOM 1022 HD13 LEU A 113 -74.193 35.167 16.272 1.00 0.00 H ATOM 1023 H LEU A 113 -76.685 39.500 18.661 1.00 0.00 H ATOM 1024 N GLY A 114 -74.248 41.169 16.897 1.00 16.07 N ATOM 1025 CA GLY A 114 -73.392 42.244 16.414 1.00 17.76 C ATOM 1026 C GLY A 114 -72.347 42.686 17.432 1.00 19.02 C ATOM 1027 O GLY A 114 -71.194 42.959 17.068 1.00 17.75 O ATOM 1028 HA3 GLY A 114 -74.019 43.101 16.167 1.00 0.00 H ATOM 1029 HA2 GLY A 114 -72.878 41.900 15.517 1.00 0.00 H ATOM 1030 H GLY A 114 -75.278 41.312 16.926 1.00 0.00 H ATOM 1031 N ASP A 115 -72.735 42.765 18.704 1.00 20.44 N ATOM 1032 CA ASP A 115 -71.774 43.119 19.763 1.00 20.14 C ATOM 1033 C ASP A 115 -70.637 42.104 19.888 1.00 20.68 C ATOM 1034 O ASP A 115 -69.473 42.464 20.050 1.00 18.31 O ATOM 1035 CB ASP A 115 -72.468 43.282 21.121 1.00 20.61 C ATOM 1036 CG ASP A 115 -73.308 44.549 21.201 1.00 21.53 C ATOM 1037 OD1 ASP A 115 -73.176 45.397 20.305 1.00 19.15 O ATOM 1038 OD2 ASP A 115 -74.101 44.692 22.151 1.00 19.62 O ATOM 1039 HA ASP A 115 -71.341 44.074 19.466 1.00 0.00 H ATOM 1040 HB2 ASP A 115 -73.116 42.422 21.287 1.00 0.00 H ATOM 1041 HB3 ASP A 115 -71.707 43.318 21.900 1.00 0.00 H ATOM 1042 H ASP A 115 -73.727 42.575 18.952 1.00 0.00 H ATOM 1043 N THR A 116 -70.976 40.828 19.820 1.00 17.98 N ATOM 1044 CA THR A 116 -69.944 39.797 19.905 1.00 20.18 C ATOM 1045 C THR A 116 -69.034 39.804 18.672 1.00 20.14 C ATOM 1046 O THR A 116 -67.823 39.552 18.766 1.00 18.54 O ATOM 1047 CB THR A 116 -70.577 38.430 20.088 1.00 20.16 C ATOM 1048 OG1 THR A 116 -71.529 38.513 21.148 1.00 22.64 O ATOM 1049 CG2 THR A 116 -69.521 37.371 20.423 1.00 20.26 C ATOM 1050 HA THR A 116 -69.324 40.020 20.773 1.00 0.00 H ATOM 1051 HB THR A 116 -71.063 38.134 19.158 1.00 0.00 H ATOM 1052 HG1 THR A 116 -71.952 37.628 21.280 1.00 0.00 H ATOM 1053 HG23 THR A 116 -68.797 37.312 19.610 1.00 0.00 H ATOM 1054 HG21 THR A 116 -69.011 37.647 21.346 1.00 0.00 H ATOM 1055 HG22 THR A 116 -70.006 36.403 20.550 1.00 0.00 H ATOM 1056 H THR A 116 -71.974 40.559 19.706 1.00 0.00 H ATOM 1057 N ILE A 117 -69.621 40.087 17.517 1.00 19.24 N ATOM 1058 CA ILE A 117 -68.841 40.241 16.293 1.00 17.01 C ATOM 1059 C ILE A 117 -67.835 41.381 16.427 1.00 20.62 C ATOM 1060 O ILE A 117 -66.688 41.248 16.019 1.00 17.34 O ATOM 1061 CB ILE A 117 -69.747 40.418 15.068 1.00 20.02 C ATOM 1062 CG1 ILE A 117 -70.565 39.140 14.874 1.00 22.24 C ATOM 1063 CG2 ILE A 117 -68.930 40.750 13.821 1.00 22.84 C ATOM 1064 CD1 ILE A 117 -71.693 39.279 13.871 1.00 18.94 C ATOM 1065 HA ILE A 117 -68.275 39.322 16.138 1.00 0.00 H ATOM 1066 HB ILE A 117 -70.423 41.257 15.233 1.00 0.00 H ATOM 1067 HG12 ILE A 117 -69.895 38.352 14.530 1.00 0.00 H ATOM 1068 HG13 ILE A 117 -70.993 38.857 15.836 1.00 0.00 H ATOM 1069 HD11 ILE A 117 -72.381 40.056 14.205 1.00 0.00 H ATOM 1070 HD12 ILE A 117 -71.282 39.550 12.899 1.00 0.00 H ATOM 1071 HD13 ILE A 117 -72.225 38.331 13.790 1.00 0.00 H ATOM 1072 HG21 ILE A 117 -68.380 41.677 13.985 1.00 0.00 H ATOM 1073 HG22 ILE A 117 -68.228 39.940 13.622 1.00 0.00 H ATOM 1074 HG23 ILE A 117 -69.601 40.869 12.970 1.00 0.00 H ATOM 1075 H ILE A 117 -70.654 40.201 17.483 1.00 0.00 H ATOM 1076 N SER A 118 -68.251 42.490 17.034 1.00 18.62 N ATOM 1077 CA SER A 118 -67.313 43.566 17.340 1.00 22.46 C ATOM 1078 C SER A 118 -66.173 43.120 18.267 1.00 18.27 C ATOM 1079 O SER A 118 -65.019 43.513 18.077 1.00 21.83 O ATOM 1080 CB SER A 118 -68.039 44.770 17.946 1.00 19.70 C ATOM 1081 OG SER A 118 -68.814 45.434 16.968 1.00 20.60 O ATOM 1082 HA SER A 118 -66.863 43.856 16.390 1.00 0.00 H ATOM 1083 HB2 SER A 118 -67.303 45.465 18.351 1.00 0.00 H ATOM 1084 HB3 SER A 118 -68.693 44.427 18.748 1.00 0.00 H ATOM 1085 HG SER A 118 -68.223 45.751 16.240 1.00 0.00 H ATOM 1086 H SER A 118 -69.253 42.591 17.293 1.00 0.00 H ATOM 1087 N ALA A 119 -66.490 42.313 19.273 1.00 18.45 N ATOM 1088 CA ALA A 119 -65.468 41.825 20.198 1.00 19.23 C ATOM 1089 C ALA A 119 -64.538 40.836 19.492 1.00 19.06 C ATOM 1090 O ALA A 119 -63.319 40.861 19.661 1.00 18.94 O ATOM 1091 CB ALA A 119 -66.114 41.178 21.412 1.00 19.52 C ATOM 1092 HA ALA A 119 -64.874 42.674 20.537 1.00 0.00 H ATOM 1093 HB1 ALA A 119 -66.736 41.911 21.925 1.00 0.00 H ATOM 1094 HB2 ALA A 119 -66.731 40.339 21.090 1.00 0.00 H ATOM 1095 HB3 ALA A 119 -65.337 40.821 22.088 1.00 0.00 H ATOM 1096 H ALA A 119 -67.480 42.024 19.405 1.00 0.00 H ATOM 1097 N TYR A 120 -65.135 39.970 18.689 1.00 19.56 N ATOM 1098 CA TYR A 120 -64.369 39.012 17.905 1.00 19.59 C ATOM 1099 C TYR A 120 -63.377 39.718 16.971 1.00 17.80 C ATOM 1100 O TYR A 120 -62.224 39.304 16.872 1.00 15.84 O ATOM 1101 CB TYR A 120 -65.340 38.133 17.120 1.00 13.89 C ATOM 1102 CG TYR A 120 -64.693 36.973 16.408 1.00 16.79 C ATOM 1103 CD1 TYR A 120 -63.992 37.173 15.234 1.00 19.38 C ATOM 1104 CD2 TYR A 120 -64.788 35.680 16.911 1.00 14.45 C ATOM 1105 CE1 TYR A 120 -63.394 36.115 14.564 1.00 17.88 C ATOM 1106 CE2 TYR A 120 -64.189 34.606 16.241 1.00 13.85 C ATOM 1107 CZ TYR A 120 -63.487 34.845 15.077 1.00 16.09 C ATOM 1108 OH TYR A 120 -62.887 33.807 14.384 1.00 16.70 O ATOM 1109 HA TYR A 120 -63.777 38.389 18.576 1.00 0.00 H ATOM 1110 HB3 TYR A 120 -65.838 38.755 16.376 1.00 0.00 H ATOM 1111 HB2 TYR A 120 -66.080 37.737 17.815 1.00 0.00 H ATOM 1112 HD2 TYR A 120 -65.335 35.501 17.837 1.00 0.00 H ATOM 1113 HE2 TYR A 120 -64.276 33.593 16.634 1.00 0.00 H ATOM 1114 HE1 TYR A 120 -62.853 36.292 13.634 1.00 0.00 H ATOM 1115 HD1 TYR A 120 -63.907 38.180 14.827 1.00 0.00 H ATOM 1116 HH TYR A 120 -62.223 33.362 14.968 1.00 0.00 H ATOM 1117 H TYR A 120 -66.172 39.974 18.617 1.00 0.00 H ATOM 1118 N LYS A 121 -63.803 40.793 16.301 1.00 17.82 N ATOM 1119 CA LYS A 121 -62.891 41.524 15.412 1.00 19.04 C ATOM 1120 C LYS A 121 -61.679 42.049 16.165 1.00 20.17 C ATOM 1121 O LYS A 121 -60.576 42.083 15.631 1.00 17.25 O ATOM 1122 CB LYS A 121 -63.570 42.712 14.713 1.00 19.12 C ATOM 1123 CG LYS A 121 -64.622 42.367 13.679 1.00 26.00 C ATOM 1124 CD LYS A 121 -65.263 43.647 13.115 1.00 27.25 C ATOM 1125 CE LYS A 121 -66.324 43.325 12.069 1.00 33.20 C ATOM 1126 NZ LYS A 121 -66.840 44.557 11.389 1.00 34.74 N ATOM 1127 HA LYS A 121 -62.581 40.800 14.659 1.00 0.00 H ATOM 1128 HB2 LYS A 121 -64.045 43.323 15.481 1.00 0.00 H ATOM 1129 HB3 LYS A 121 -62.794 43.294 14.217 1.00 0.00 H ATOM 1130 HG2 LYS A 121 -64.157 41.810 12.866 1.00 0.00 H ATOM 1131 HG3 LYS A 121 -65.394 41.753 14.143 1.00 0.00 H ATOM 1132 HD2 LYS A 121 -65.726 44.201 13.931 1.00 0.00 H ATOM 1133 HD3 LYS A 121 -64.487 44.260 12.656 1.00 0.00 H ATOM 1134 HE2 LYS A 121 -67.156 42.818 12.557 1.00 0.00 H ATOM 1135 HE3 LYS A 121 -65.889 42.665 11.318 1.00 0.00 H ATOM 1136 HZ1 LYS A 121 -67.264 45.190 12.097 1.00 0.00 H ATOM 1137 HZ2 LYS A 121 -66.054 45.044 10.913 1.00 0.00 H ATOM 1138 HZ3 LYS A 121 -67.559 44.289 10.687 1.00 0.00 H ATOM 1139 H LYS A 121 -64.786 41.114 16.410 1.00 0.00 H ATOM 1140 N LEU A 122 -61.890 42.465 17.409 1.00 17.67 N ATOM 1141 CA LEU A 122 -60.792 42.973 18.232 1.00 18.26 C ATOM 1142 C LEU A 122 -59.839 41.856 18.683 1.00 15.95 C ATOM 1143 O LEU A 122 -58.610 42.027 18.715 1.00 15.26 O ATOM 1144 CB LEU A 122 -61.354 43.722 19.442 1.00 18.54 C ATOM 1145 CG LEU A 122 -61.966 45.098 19.149 1.00 24.61 C ATOM 1146 CD1 LEU A 122 -62.786 45.603 20.323 1.00 26.83 C ATOM 1147 CD2 LEU A 122 -60.875 46.112 18.798 1.00 26.79 C ATOM 1148 HA LEU A 122 -60.208 43.660 17.619 1.00 0.00 H ATOM 1149 HB2 LEU A 122 -62.128 43.100 19.891 1.00 0.00 H ATOM 1150 HB3 LEU A 122 -60.542 43.862 20.156 1.00 0.00 H ATOM 1151 HG LEU A 122 -62.632 44.984 18.294 1.00 0.00 H ATOM 1152 HD21 LEU A 122 -60.184 46.205 19.636 1.00 0.00 H ATOM 1153 HD22 LEU A 122 -60.334 45.771 17.915 1.00 0.00 H ATOM 1154 HD23 LEU A 122 -61.333 47.080 18.594 1.00 0.00 H ATOM 1155 HD11 LEU A 122 -63.595 44.901 20.528 1.00 0.00 H ATOM 1156 HD12 LEU A 122 -62.146 45.689 21.201 1.00 0.00 H ATOM 1157 HD13 LEU A 122 -63.204 46.580 20.079 1.00 0.00 H ATOM 1158 H LEU A 122 -62.851 42.429 17.804 1.00 0.00 H ATOM 1159 N SER A 123 -60.406 40.719 19.060 1.00 16.85 N ATOM 1160 CA SER A 123 -59.588 39.573 19.427 1.00 14.76 C ATOM 1161 C SER A 123 -58.797 39.068 18.222 1.00 16.10 C ATOM 1162 O SER A 123 -57.617 38.718 18.346 1.00 15.41 O ATOM 1163 CB SER A 123 -60.459 38.465 20.050 1.00 17.30 C ATOM 1164 OG SER A 123 -61.014 38.929 21.281 1.00 20.20 O ATOM 1165 HA SER A 123 -58.866 39.884 20.182 1.00 0.00 H ATOM 1166 HB2 SER A 123 -59.846 37.583 20.237 1.00 0.00 H ATOM 1167 HB3 SER A 123 -61.265 38.207 19.363 1.00 0.00 H ATOM 1168 HG SER A 123 -60.281 39.163 21.905 1.00 0.00 H ATOM 1169 H SER A 123 -61.443 40.645 19.094 1.00 0.00 H ATOM 1170 N LEU A 124 -59.435 39.055 17.056 1.00 12.26 N ATOM 1171 CA LEU A 124 -58.763 38.587 15.845 1.00 18.08 C ATOM 1172 C LEU A 124 -57.628 39.544 15.482 1.00 19.41 C ATOM 1173 O LEU A 124 -56.532 39.113 15.115 1.00 12.81 O ATOM 1174 CB LEU A 124 -59.768 38.426 14.689 1.00 16.49 C ATOM 1175 CG LEU A 124 -59.215 37.980 13.334 1.00 19.00 C ATOM 1176 CD1 LEU A 124 -58.480 36.647 13.464 1.00 15.27 C ATOM 1177 CD2 LEU A 124 -60.329 37.879 12.311 1.00 15.92 C ATOM 1178 HA LEU A 124 -58.331 37.604 16.032 1.00 0.00 H ATOM 1179 HB2 LEU A 124 -60.509 37.689 14.999 1.00 0.00 H ATOM 1180 HB3 LEU A 124 -60.256 39.390 14.542 1.00 0.00 H ATOM 1181 HG LEU A 124 -58.502 38.730 12.991 1.00 0.00 H ATOM 1182 HD21 LEU A 124 -61.066 37.151 12.649 1.00 0.00 H ATOM 1183 HD22 LEU A 124 -60.804 38.853 12.196 1.00 0.00 H ATOM 1184 HD23 LEU A 124 -59.914 37.560 11.355 1.00 0.00 H ATOM 1185 HD11 LEU A 124 -57.652 36.757 14.165 1.00 0.00 H ATOM 1186 HD12 LEU A 124 -59.170 35.887 13.831 1.00 0.00 H ATOM 1187 HD13 LEU A 124 -58.095 36.349 12.489 1.00 0.00 H ATOM 1188 H LEU A 124 -60.421 39.381 17.005 1.00 0.00 H ATOM 1189 N ASN A 125 -57.876 40.850 15.615 1.00 16.64 N ATOM 1190 CA ASN A 125 -56.798 41.824 15.443 1.00 17.31 C ATOM 1191 C ASN A 125 -55.611 41.566 16.374 1.00 15.22 C ATOM 1192 O ASN A 125 -54.461 41.736 15.990 1.00 16.06 O ATOM 1193 CB ASN A 125 -57.320 43.254 15.645 1.00 19.17 C ATOM 1194 CG ASN A 125 -56.356 44.304 15.136 1.00 22.19 C ATOM 1195 OD1 ASN A 125 -55.973 44.298 13.969 1.00 20.81 O ATOM 1196 ND2 ASN A 125 -55.957 45.219 16.013 1.00 20.82 N ATOM 1197 HA ASN A 125 -56.439 41.708 14.420 1.00 0.00 H ATOM 1198 HB2 ASN A 125 -58.265 43.359 15.112 1.00 0.00 H ATOM 1199 HB3 ASN A 125 -57.485 43.418 16.710 1.00 0.00 H ATOM 1200 HD22 ASN A 125 -56.306 45.188 16.992 1.00 0.00 H ATOM 1201 HD21 ASN A 125 -55.296 45.967 15.720 1.00 0.00 H ATOM 1202 H ASN A 125 -58.838 41.175 15.841 1.00 0.00 H ATOM 1203 N LYS A 126 -55.886 41.177 17.616 1.00 16.80 N ATOM 1204 CA LYS A 126 -54.807 40.925 18.567 1.00 17.67 C ATOM 1205 C LYS A 126 -54.015 39.696 18.156 1.00 16.28 C ATOM 1206 O LYS A 126 -52.785 39.684 18.266 1.00 14.68 O ATOM 1207 CB LYS A 126 -55.345 40.737 19.979 1.00 20.74 C ATOM 1208 CG LYS A 126 -55.599 42.038 20.733 1.00 27.14 C ATOM 1209 CD LYS A 126 -56.046 41.750 22.160 1.00 34.29 C ATOM 1210 CE LYS A 126 -56.248 43.031 22.958 1.00 38.80 C ATOM 1211 NZ LYS A 126 -56.897 42.763 24.276 1.00 42.62 N ATOM 1212 HA LYS A 126 -54.152 41.797 18.561 1.00 0.00 H ATOM 1213 HB2 LYS A 126 -56.285 40.190 19.916 1.00 0.00 H ATOM 1214 HB3 LYS A 126 -54.622 40.150 20.545 1.00 0.00 H ATOM 1215 HG2 LYS A 126 -54.681 42.625 20.756 1.00 0.00 H ATOM 1216 HG3 LYS A 126 -56.377 42.604 20.221 1.00 0.00 H ATOM 1217 HD2 LYS A 126 -56.986 41.200 22.131 1.00 0.00 H ATOM 1218 HD3 LYS A 126 -55.286 41.143 22.652 1.00 0.00 H ATOM 1219 HE2 LYS A 126 -56.879 43.709 22.384 1.00 0.00 H ATOM 1220 HE3 LYS A 126 -55.278 43.497 23.130 1.00 0.00 H ATOM 1221 HZ1 LYS A 126 -57.826 42.323 24.120 1.00 0.00 H ATOM 1222 HZ2 LYS A 126 -56.297 42.121 24.832 1.00 0.00 H ATOM 1223 HZ3 LYS A 126 -57.018 43.659 24.790 1.00 0.00 H ATOM 1224 H LYS A 126 -56.875 41.052 17.911 1.00 0.00 H ATOM 1225 N MET A 127 -54.715 38.673 17.671 1.00 14.38 N ATOM 1226 CA MET A 127 -54.023 37.474 17.184 1.00 11.05 C ATOM 1227 C MET A 127 -53.119 37.845 16.014 1.00 15.78 C ATOM 1228 O MET A 127 -51.959 37.433 15.949 1.00 13.50 O ATOM 1229 CB MET A 127 -55.000 36.383 16.758 1.00 14.91 C ATOM 1230 CG MET A 127 -54.308 35.138 16.146 1.00 11.02 C ATOM 1231 SD MET A 127 -55.483 33.802 15.867 1.00 12.24 S ATOM 1232 CE MET A 127 -55.626 33.074 17.512 1.00 11.68 C ATOM 1233 HA MET A 127 -53.427 37.077 18.006 1.00 0.00 H ATOM 1234 HB2 MET A 127 -55.568 36.067 17.633 1.00 0.00 H ATOM 1235 HB3 MET A 127 -55.681 36.800 16.016 1.00 0.00 H ATOM 1236 HG2 MET A 127 -53.533 34.791 16.829 1.00 0.00 H ATOM 1237 HG3 MET A 127 -53.855 35.416 15.195 1.00 0.00 H ATOM 1238 HE1 MET A 127 -54.648 32.721 17.838 1.00 0.00 H ATOM 1239 HE2 MET A 127 -55.993 33.826 18.210 1.00 0.00 H ATOM 1240 HE3 MET A 127 -56.323 32.237 17.478 1.00 0.00 H ATOM 1241 H MET A 127 -55.753 38.723 17.637 1.00 0.00 H ATOM 1242 N ARG A 128 -53.651 38.635 15.089 1.00 13.63 N ATOM 1243 CA ARG A 128 -52.850 39.066 13.948 1.00 16.79 C ATOM 1244 C ARG A 128 -51.622 39.849 14.366 1.00 16.40 C ATOM 1245 O ARG A 128 -50.533 39.624 13.836 1.00 13.97 O ATOM 1246 CB ARG A 128 -53.672 39.913 12.981 1.00 14.48 C ATOM 1247 CG ARG A 128 -52.861 40.403 11.798 1.00 18.61 C ATOM 1248 CD ARG A 128 -53.589 41.523 11.064 1.00 27.23 C ATOM 1249 NE ARG A 128 -53.897 42.656 11.939 1.00 24.43 N ATOM 1250 CZ ARG A 128 -53.087 43.690 12.153 1.00 26.31 C ATOM 1251 NH1 ARG A 128 -51.901 43.737 11.567 1.00 31.47 N ATOM 1252 NH2 ARG A 128 -53.462 44.680 12.965 1.00 22.41 N ATOM 1253 HA ARG A 128 -52.524 38.153 13.449 1.00 0.00 H ATOM 1254 HB2 ARG A 128 -54.502 39.312 12.610 1.00 0.00 H ATOM 1255 HB3 ARG A 128 -54.062 40.777 13.519 1.00 0.00 H ATOM 1256 HG2 ARG A 128 -51.900 40.775 12.154 1.00 0.00 H ATOM 1257 HG3 ARG A 128 -52.696 39.574 11.110 1.00 0.00 H ATOM 1258 HD2 ARG A 128 -54.521 41.129 10.660 1.00 0.00 H ATOM 1259 HD3 ARG A 128 -52.959 41.873 10.246 1.00 0.00 H ATOM 1260 HE ARG A 128 -54.815 42.652 12.428 1.00 0.00 H ATOM 1261 HH12 ARG A 128 -51.269 44.546 11.735 1.00 0.00 H ATOM 1262 HH11 ARG A 128 -51.601 42.965 10.938 1.00 0.00 H ATOM 1263 HH22 ARG A 128 -52.826 45.486 13.130 1.00 0.00 H ATOM 1264 HH21 ARG A 128 -54.390 44.645 13.433 1.00 0.00 H ATOM 1265 H ARG A 128 -54.639 38.947 15.178 1.00 0.00 H ATOM 1266 N GLN A 129 -51.786 40.805 15.282 1.00 12.12 N ATOM 1267 CA GLN A 129 -50.617 41.501 15.815 1.00 15.02 C ATOM 1268 C GLN A 129 -49.645 40.522 16.456 1.00 13.89 C ATOM 1269 O GLN A 129 -48.425 40.717 16.444 1.00 12.54 O ATOM 1270 CB GLN A 129 -51.044 42.553 16.841 1.00 14.65 C ATOM 1271 CG GLN A 129 -51.940 43.620 16.218 1.00 20.59 C ATOM 1272 CD GLN A 129 -52.345 44.699 17.196 1.00 25.75 C ATOM 1273 OE1 GLN A 129 -52.742 44.414 18.329 1.00 27.55 O ATOM 1274 NE2 GLN A 129 -52.256 45.951 16.759 1.00 32.38 N ATOM 1275 HA GLN A 129 -50.114 41.995 14.984 1.00 0.00 H ATOM 1276 HB2 GLN A 129 -51.589 42.060 17.646 1.00 0.00 H ATOM 1277 HB3 GLN A 129 -50.153 43.033 17.247 1.00 0.00 H ATOM 1278 HG2 GLN A 129 -51.403 44.085 15.391 1.00 0.00 H ATOM 1279 HG3 GLN A 129 -52.842 43.138 15.839 1.00 0.00 H ATOM 1280 HE22 GLN A 129 -51.915 46.142 15.795 1.00 0.00 H ATOM 1281 HE21 GLN A 129 -52.527 46.739 17.381 1.00 0.00 H ATOM 1282 H GLN A 129 -52.740 41.053 15.615 1.00 0.00 H ATOM 1283 N GLY A 130 -50.203 39.483 17.052 1.00 14.06 N ATOM 1284 CA GLY A 130 -49.395 38.501 17.736 1.00 15.72 C ATOM 1285 C GLY A 130 -48.535 37.808 16.713 1.00 12.34 C ATOM 1286 O GLY A 130 -47.339 37.692 16.904 1.00 12.25 O ATOM 1287 HA3 GLY A 130 -50.038 37.774 18.232 1.00 0.00 H ATOM 1288 HA2 GLY A 130 -48.765 38.992 18.477 1.00 0.00 H ATOM 1289 H GLY A 130 -51.237 39.371 17.028 1.00 0.00 H ATOM 1290 N TYR A 131 -49.144 37.356 15.616 1.00 14.42 N ATOM 1291 CA TYR A 131 -48.374 36.632 14.604 1.00 15.83 C ATOM 1292 C TYR A 131 -47.310 37.509 13.962 1.00 16.13 C ATOM 1293 O TYR A 131 -46.186 37.058 13.723 1.00 17.85 O ATOM 1294 CB TYR A 131 -49.282 35.990 13.539 1.00 13.07 C ATOM 1295 CG TYR A 131 -49.886 34.670 13.978 1.00 13.51 C ATOM 1296 CD1 TYR A 131 -49.094 33.528 14.133 1.00 16.69 C ATOM 1297 CD2 TYR A 131 -51.249 34.558 14.217 1.00 13.63 C ATOM 1298 CE1 TYR A 131 -49.643 32.324 14.523 1.00 13.64 C ATOM 1299 CE2 TYR A 131 -51.804 33.361 14.618 1.00 15.25 C ATOM 1300 CZ TYR A 131 -51.004 32.242 14.767 1.00 16.19 C ATOM 1301 OH TYR A 131 -51.582 31.047 15.172 1.00 13.38 O ATOM 1302 HA TYR A 131 -47.860 35.824 15.125 1.00 0.00 H ATOM 1303 HB3 TYR A 131 -48.691 35.818 12.639 1.00 0.00 H ATOM 1304 HB2 TYR A 131 -50.093 36.683 13.313 1.00 0.00 H ATOM 1305 HD2 TYR A 131 -51.890 35.430 14.086 1.00 0.00 H ATOM 1306 HE2 TYR A 131 -52.874 33.296 14.818 1.00 0.00 H ATOM 1307 HE1 TYR A 131 -49.010 31.444 14.638 1.00 0.00 H ATOM 1308 HD1 TYR A 131 -48.023 33.590 13.942 1.00 0.00 H ATOM 1309 HH TYR A 131 -50.884 30.347 15.231 1.00 0.00 H ATOM 1310 H TYR A 131 -50.162 37.517 15.480 1.00 0.00 H ATOM 1311 N ASP A 132 -47.656 38.762 13.675 1.00 17.44 N ATOM 1312 CA ASP A 132 -46.657 39.710 13.176 1.00 16.77 C ATOM 1313 C ASP A 132 -45.466 39.800 14.132 1.00 18.39 C ATOM 1314 O ASP A 132 -44.312 39.879 13.696 1.00 20.21 O ATOM 1315 CB ASP A 132 -47.246 41.119 13.022 1.00 19.47 C ATOM 1316 CG ASP A 132 -48.245 41.228 11.893 1.00 23.75 C ATOM 1317 OD1 ASP A 132 -48.230 40.370 10.985 1.00 22.93 O ATOM 1318 OD2 ASP A 132 -49.043 42.203 11.921 1.00 27.61 O ATOM 1319 HA ASP A 132 -46.334 39.339 12.203 1.00 0.00 H ATOM 1320 HB2 ASP A 132 -47.744 41.390 13.953 1.00 0.00 H ATOM 1321 HB3 ASP A 132 -46.430 41.817 12.832 1.00 0.00 H ATOM 1322 H ASP A 132 -48.641 39.069 13.806 1.00 0.00 H ATOM 1323 N ALA A 133 -45.739 39.799 15.432 1.00 17.26 N ATOM 1324 CA ALA A 133 -44.671 39.924 16.422 1.00 16.75 C ATOM 1325 C ALA A 133 -43.781 38.683 16.486 1.00 16.29 C ATOM 1326 O ALA A 133 -42.568 38.801 16.690 1.00 14.84 O ATOM 1327 CB ALA A 133 -45.228 40.242 17.804 1.00 16.37 C ATOM 1328 HA ALA A 133 -44.049 40.757 16.094 1.00 0.00 H ATOM 1329 HB1 ALA A 133 -45.777 41.183 17.766 1.00 0.00 H ATOM 1330 HB2 ALA A 133 -45.899 39.442 18.117 1.00 0.00 H ATOM 1331 HB3 ALA A 133 -44.406 40.328 18.515 1.00 0.00 H ATOM 1332 H ALA A 133 -46.725 39.708 15.749 1.00 0.00 H ATOM 1333 N THR A 134 -44.366 37.495 16.320 1.00 14.94 N ATOM 1334 CA THR A 134 -43.529 36.293 16.247 1.00 14.95 C ATOM 1335 C THR A 134 -42.648 36.335 14.999 1.00 16.69 C ATOM 1336 O THR A 134 -41.464 35.976 15.053 1.00 14.91 O ATOM 1337 CB THR A 134 -44.335 34.961 16.274 1.00 16.13 C ATOM 1338 OG1 THR A 134 -45.223 34.898 15.154 1.00 14.24 O ATOM 1339 CG2 THR A 134 -45.139 34.846 17.560 1.00 14.04 C ATOM 1340 HA THR A 134 -42.914 36.303 17.147 1.00 0.00 H ATOM 1341 HB THR A 134 -43.626 34.135 16.223 1.00 0.00 H ATOM 1342 HG1 THR A 134 -45.854 35.660 15.191 1.00 0.00 H ATOM 1343 HG23 THR A 134 -44.464 34.894 18.415 1.00 0.00 H ATOM 1344 HG21 THR A 134 -45.855 35.666 17.614 1.00 0.00 H ATOM 1345 HG22 THR A 134 -45.673 33.896 17.570 1.00 0.00 H ATOM 1346 H THR A 134 -45.401 37.423 16.244 1.00 0.00 H ATOM 1347 N ARG A 135 -43.218 36.772 13.876 1.00 16.51 N ATOM 1348 CA ARG A 135 -42.422 36.940 12.666 1.00 15.54 C ATOM 1349 C ARG A 135 -41.278 37.936 12.885 1.00 18.95 C ATOM 1350 O ARG A 135 -40.123 37.630 12.579 1.00 19.48 O ATOM 1351 CB ARG A 135 -43.288 37.354 11.469 1.00 18.82 C ATOM 1352 CG ARG A 135 -44.079 36.185 10.880 1.00 20.63 C ATOM 1353 CD ARG A 135 -44.807 36.553 9.596 1.00 26.31 C ATOM 1354 NE ARG A 135 -46.038 37.304 9.840 1.00 25.05 N ATOM 1355 CZ ARG A 135 -47.208 36.735 10.130 1.00 26.34 C ATOM 1356 NH1 ARG A 135 -47.299 35.411 10.233 1.00 20.30 N ATOM 1357 NH2 ARG A 135 -48.278 37.489 10.337 1.00 25.58 N ATOM 1358 HA ARG A 135 -41.983 35.970 12.434 1.00 0.00 H ATOM 1359 HB2 ARG A 135 -43.990 38.121 11.795 1.00 0.00 H ATOM 1360 HB3 ARG A 135 -42.640 37.762 10.694 1.00 0.00 H ATOM 1361 HG2 ARG A 135 -43.388 35.369 10.667 1.00 0.00 H ATOM 1362 HG3 ARG A 135 -44.813 35.856 11.615 1.00 0.00 H ATOM 1363 HD2 ARG A 135 -45.057 35.636 9.062 1.00 0.00 H ATOM 1364 HD3 ARG A 135 -44.144 37.161 8.981 1.00 0.00 H ATOM 1365 HE ARG A 135 -45.998 38.342 9.784 1.00 0.00 H ATOM 1366 HH12 ARG A 135 -48.213 34.969 10.459 1.00 0.00 H ATOM 1367 HH11 ARG A 135 -46.457 34.819 10.087 1.00 0.00 H ATOM 1368 HH22 ARG A 135 -49.191 37.045 10.563 1.00 0.00 H ATOM 1369 HH21 ARG A 135 -48.205 38.524 10.273 1.00 0.00 H ATOM 1370 H ARG A 135 -44.234 36.994 13.863 1.00 0.00 H ATOM 1371 N ALA A 136 -41.588 39.109 13.432 1.00 16.19 N ATOM 1372 CA ALA A 136 -40.554 40.115 13.699 1.00 17.37 C ATOM 1373 C ALA A 136 -39.493 39.565 14.633 1.00 17.05 C ATOM 1374 O ALA A 136 -38.302 39.803 14.441 1.00 15.38 O ATOM 1375 CB ALA A 136 -41.155 41.381 14.277 1.00 17.18 C ATOM 1376 HA ALA A 136 -40.085 40.364 12.747 1.00 0.00 H ATOM 1377 HB1 ALA A 136 -41.871 41.798 13.569 1.00 0.00 H ATOM 1378 HB2 ALA A 136 -41.662 41.147 15.213 1.00 0.00 H ATOM 1379 HB3 ALA A 136 -40.362 42.106 14.463 1.00 0.00 H ATOM 1380 H ALA A 136 -42.578 39.316 13.674 1.00 0.00 H ATOM 1381 N ALA A 137 -39.922 38.820 15.653 1.00 13.39 N ATOM 1382 CA ALA A 137 -38.970 38.249 16.592 1.00 14.92 C ATOM 1383 C ALA A 137 -38.048 37.260 15.888 1.00 14.50 C ATOM 1384 O ALA A 137 -36.843 37.246 16.131 1.00 16.81 O ATOM 1385 CB ALA A 137 -39.696 37.578 17.769 1.00 14.64 C ATOM 1386 HA ALA A 137 -38.359 39.059 16.992 1.00 0.00 H ATOM 1387 HB1 ALA A 137 -40.302 38.319 18.290 1.00 0.00 H ATOM 1388 HB2 ALA A 137 -40.338 36.782 17.392 1.00 0.00 H ATOM 1389 HB3 ALA A 137 -38.961 37.159 18.456 1.00 0.00 H ATOM 1390 H ALA A 137 -40.940 38.647 15.777 1.00 0.00 H ATOM 1391 N ARG A 138 -38.617 36.422 15.032 1.00 12.84 N ATOM 1392 CA ARG A 138 -37.816 35.433 14.312 1.00 18.70 C ATOM 1393 C ARG A 138 -36.785 36.124 13.412 1.00 18.84 C ATOM 1394 O ARG A 138 -35.604 35.759 13.405 1.00 19.14 O ATOM 1395 CB ARG A 138 -38.709 34.460 13.535 1.00 17.48 C ATOM 1396 CG ARG A 138 -39.410 33.435 14.438 1.00 19.23 C ATOM 1397 CD ARG A 138 -40.444 32.620 13.681 1.00 22.70 C ATOM 1398 NE ARG A 138 -39.894 32.177 12.407 1.00 27.46 N ATOM 1399 CZ ARG A 138 -40.439 32.433 11.222 1.00 29.90 C ATOM 1400 NH1 ARG A 138 -41.588 33.100 11.141 1.00 28.60 N ATOM 1401 NH2 ARG A 138 -39.846 32.003 10.114 1.00 31.49 N ATOM 1402 HA ARG A 138 -37.263 34.839 15.039 1.00 0.00 H ATOM 1403 HB2 ARG A 138 -39.469 35.034 13.005 1.00 0.00 H ATOM 1404 HB3 ARG A 138 -38.093 33.923 12.814 1.00 0.00 H ATOM 1405 HG2 ARG A 138 -38.661 32.758 14.849 1.00 0.00 H ATOM 1406 HG3 ARG A 138 -39.906 33.964 15.252 1.00 0.00 H ATOM 1407 HD2 ARG A 138 -41.326 33.234 13.500 1.00 0.00 H ATOM 1408 HD3 ARG A 138 -40.724 31.750 14.275 1.00 0.00 H ATOM 1409 HE ARG A 138 -39.014 31.622 12.426 1.00 0.00 H ATOM 1410 HH12 ARG A 138 -42.010 33.298 10.211 1.00 0.00 H ATOM 1411 HH11 ARG A 138 -42.064 33.424 12.007 1.00 0.00 H ATOM 1412 HH22 ARG A 138 -40.271 32.202 9.186 1.00 0.00 H ATOM 1413 HH21 ARG A 138 -38.957 31.467 10.175 1.00 0.00 H ATOM 1414 H ARG A 138 -39.643 36.469 14.871 1.00 0.00 H ATOM 1415 N VAL A 139 -37.222 37.155 12.694 1.00 15.62 N ATOM 1416 CA VAL A 139 -36.311 37.960 11.888 1.00 16.79 C ATOM 1417 C VAL A 139 -35.183 38.536 12.746 1.00 18.98 C ATOM 1418 O VAL A 139 -34.010 38.499 12.363 1.00 17.58 O ATOM 1419 CB VAL A 139 -37.056 39.110 11.177 1.00 19.18 C ATOM 1420 CG1 VAL A 139 -36.058 40.087 10.567 1.00 20.85 C ATOM 1421 CG2 VAL A 139 -37.976 38.548 10.113 1.00 23.97 C ATOM 1422 HA VAL A 139 -35.883 37.301 11.133 1.00 0.00 H ATOM 1423 HB VAL A 139 -37.659 39.650 11.907 1.00 0.00 H ATOM 1424 HG11 VAL A 139 -35.430 40.502 11.355 1.00 0.00 H ATOM 1425 HG12 VAL A 139 -35.435 39.563 9.842 1.00 0.00 H ATOM 1426 HG13 VAL A 139 -36.598 40.892 10.069 1.00 0.00 H ATOM 1427 HG21 VAL A 139 -37.388 37.994 9.382 1.00 0.00 H ATOM 1428 HG22 VAL A 139 -38.702 37.881 10.578 1.00 0.00 H ATOM 1429 HG23 VAL A 139 -38.498 39.366 9.616 1.00 0.00 H ATOM 1430 H VAL A 139 -38.235 37.392 12.708 1.00 0.00 H ATOM 1431 N SER A 140 -35.540 39.063 13.913 1.00 18.74 N ATOM 1432 CA SER A 140 -34.553 39.634 14.822 1.00 17.21 C ATOM 1433 C SER A 140 -33.588 38.575 15.373 1.00 19.13 C ATOM 1434 O SER A 140 -32.387 38.823 15.505 1.00 17.70 O ATOM 1435 CB SER A 140 -35.243 40.405 15.957 1.00 21.28 C ATOM 1436 OG SER A 140 -34.305 40.896 16.910 1.00 23.79 O ATOM 1437 HA SER A 140 -33.950 40.336 14.247 1.00 0.00 H ATOM 1438 HB2 SER A 140 -35.943 39.739 16.461 1.00 0.00 H ATOM 1439 HB3 SER A 140 -35.788 41.248 15.531 1.00 0.00 H ATOM 1440 HG SER A 140 -34.786 41.385 17.623 1.00 0.00 H ATOM 1441 H SER A 140 -36.544 39.068 14.183 1.00 0.00 H ATOM 1442 N MET A 141 -34.111 37.396 15.699 1.00 17.51 N ATOM 1443 CA MET A 141 -33.252 36.304 16.170 1.00 21.27 C ATOM 1444 C MET A 141 -32.235 35.875 15.100 1.00 18.33 C ATOM 1445 O MET A 141 -31.044 35.662 15.388 1.00 16.67 O ATOM 1446 CB MET A 141 -34.102 35.102 16.600 1.00 16.92 C ATOM 1447 CG MET A 141 -34.921 35.321 17.855 1.00 19.31 C ATOM 1448 SD MET A 141 -35.730 33.798 18.422 1.00 22.47 S ATOM 1449 CE MET A 141 -37.354 33.893 17.674 1.00 19.36 C ATOM 1450 HA MET A 141 -32.694 36.676 17.030 1.00 0.00 H ATOM 1451 HB2 MET A 141 -34.786 34.861 15.786 1.00 0.00 H ATOM 1452 HB3 MET A 141 -33.434 34.258 16.773 1.00 0.00 H ATOM 1453 HG2 MET A 141 -35.686 36.069 17.649 1.00 0.00 H ATOM 1454 HG3 MET A 141 -34.263 35.684 18.645 1.00 0.00 H ATOM 1455 HE1 MET A 141 -37.862 34.791 18.025 1.00 0.00 H ATOM 1456 HE2 MET A 141 -37.251 33.932 16.590 1.00 0.00 H ATOM 1457 HE3 MET A 141 -37.934 33.013 17.954 1.00 0.00 H ATOM 1458 H MET A 141 -35.137 37.247 15.619 1.00 0.00 H ATOM 1459 N ASP A 142 -32.694 35.751 13.860 1.00 18.58 N ATOM 1460 CA ASP A 142 -31.803 35.304 12.791 1.00 22.22 C ATOM 1461 C ASP A 142 -30.656 36.293 12.596 1.00 23.83 C ATOM 1462 O ASP A 142 -29.484 35.910 12.559 1.00 21.96 O ATOM 1463 CB ASP A 142 -32.561 35.146 11.473 1.00 21.54 C ATOM 1464 CG ASP A 142 -33.504 33.961 11.475 1.00 24.10 C ATOM 1465 OD1 ASP A 142 -33.465 33.139 12.426 1.00 20.77 O ATOM 1466 OD2 ASP A 142 -34.280 33.851 10.506 1.00 21.58 O ATOM 1467 HA ASP A 142 -31.399 34.335 13.086 1.00 0.00 H ATOM 1468 HB2 ASP A 142 -33.140 36.052 11.294 1.00 0.00 H ATOM 1469 HB3 ASP A 142 -31.837 35.014 10.669 1.00 0.00 H ATOM 1470 H ASP A 142 -33.688 35.972 13.649 1.00 0.00 H ATOM 1471 N SER A 143 -30.999 37.572 12.483 1.00 23.13 N ATOM 1472 CA SER A 143 -29.984 38.608 12.279 1.00 23.31 C ATOM 1473 C SER A 143 -29.033 38.762 13.481 1.00 24.87 C ATOM 1474 O SER A 143 -27.820 38.945 13.306 1.00 23.24 O ATOM 1475 CB SER A 143 -30.628 39.945 11.894 1.00 24.37 C ATOM 1476 OG SER A 143 -31.296 40.540 12.989 1.00 29.07 O ATOM 1477 HA SER A 143 -29.365 38.278 11.445 1.00 0.00 H ATOM 1478 HB2 SER A 143 -31.347 39.773 11.093 1.00 0.00 H ATOM 1479 HB3 SER A 143 -29.850 40.624 11.543 1.00 0.00 H ATOM 1480 HG SER A 143 -31.698 41.398 12.702 1.00 0.00 H ATOM 1481 H SER A 143 -32.002 37.841 12.540 1.00 0.00 H ATOM 1482 N SER A 144 -29.570 38.680 14.696 1.00 20.26 N ATOM 1483 CA SER A 144 -28.717 38.766 15.880 1.00 19.39 C ATOM 1484 C SER A 144 -27.749 37.586 15.975 1.00 21.82 C ATOM 1485 O SER A 144 -26.573 37.752 16.350 1.00 20.53 O ATOM 1486 CB SER A 144 -29.551 38.912 17.154 1.00 18.02 C ATOM 1487 OG SER A 144 -29.934 40.267 17.338 1.00 23.58 O ATOM 1488 HA SER A 144 -28.110 39.666 15.776 1.00 0.00 H ATOM 1489 HB2 SER A 144 -28.961 38.585 18.010 1.00 0.00 H ATOM 1490 HB3 SER A 144 -30.445 38.293 17.072 1.00 0.00 H ATOM 1491 HG SER A 144 -30.472 40.347 18.165 1.00 0.00 H ATOM 1492 H SER A 144 -30.597 38.555 14.803 1.00 0.00 H ATOM 1493 N ALA A 145 -28.226 36.403 15.600 1.00 20.65 N ATOM 1494 CA ALA A 145 -27.391 35.203 15.621 1.00 23.01 C ATOM 1495 C ALA A 145 -26.250 35.297 14.616 1.00 24.73 C ATOM 1496 O ALA A 145 -25.102 34.951 14.926 1.00 23.14 O ATOM 1497 CB ALA A 145 -28.231 33.956 15.350 1.00 23.51 C ATOM 1498 HA ALA A 145 -26.956 35.125 16.617 1.00 0.00 H ATOM 1499 HB1 ALA A 145 -29.000 33.864 16.117 1.00 0.00 H ATOM 1500 HB2 ALA A 145 -28.701 34.042 14.370 1.00 0.00 H ATOM 1501 HB3 ALA A 145 -27.589 33.075 15.370 1.00 0.00 H ATOM 1502 H ALA A 145 -29.214 36.330 15.285 1.00 0.00 H ATOM 1503 N ILE A 146 -26.576 35.752 13.410 1.00 24.13 N ATOM 1504 CA ILE A 146 -25.592 35.911 12.342 1.00 27.43 C ATOM 1505 C ILE A 146 -24.525 36.923 12.739 1.00 27.78 C ATOM 1506 O ILE A 146 -23.331 36.697 12.530 1.00 28.26 O ATOM 1507 CB ILE A 146 -26.250 36.354 11.017 1.00 27.76 C ATOM 1508 CG1 ILE A 146 -26.678 35.141 10.183 1.00 33.29 C ATOM 1509 CG2 ILE A 146 -25.280 37.186 10.191 1.00 31.51 C ATOM 1510 CD1 ILE A 146 -27.801 34.334 10.771 1.00 32.37 C ATOM 1511 HA ILE A 146 -25.130 34.936 12.187 1.00 0.00 H ATOM 1512 HB ILE A 146 -27.127 36.948 11.273 1.00 0.00 H ATOM 1513 HG12 ILE A 146 -26.994 35.498 9.203 1.00 0.00 H ATOM 1514 HG13 ILE A 146 -25.814 34.486 10.069 1.00 0.00 H ATOM 1515 HD11 ILE A 146 -27.501 33.954 11.747 1.00 0.00 H ATOM 1516 HD12 ILE A 146 -28.682 34.966 10.881 1.00 0.00 H ATOM 1517 HD13 ILE A 146 -28.032 33.499 10.110 1.00 0.00 H ATOM 1518 HG21 ILE A 146 -24.990 38.072 10.756 1.00 0.00 H ATOM 1519 HG22 ILE A 146 -24.394 36.592 9.965 1.00 0.00 H ATOM 1520 HG23 ILE A 146 -25.763 37.488 9.262 1.00 0.00 H ATOM 1521 H ILE A 146 -27.567 36.004 13.220 1.00 0.00 H ATOM 1522 N ARG A 147 -24.963 38.037 13.321 1.00 26.76 N ATOM 1523 CA ARG A 147 -24.041 39.046 13.828 1.00 27.12 C ATOM 1524 C ARG A 147 -23.114 38.459 14.896 1.00 28.24 C ATOM 1525 O ARG A 147 -21.914 38.732 14.911 1.00 25.10 O ATOM 1526 CB ARG A 147 -24.804 40.261 14.376 1.00 27.27 C ATOM 1527 CG ARG A 147 -23.893 41.380 14.844 1.00 34.51 C ATOM 1528 CD ARG A 147 -24.646 42.688 15.085 1.00 35.32 C ATOM 1529 NE ARG A 147 -23.767 43.716 15.648 1.00 41.53 N ATOM 1530 CZ ARG A 147 -23.014 44.552 14.931 1.00 44.85 C ATOM 1531 NH1 ARG A 147 -23.022 44.494 13.603 1.00 43.43 N ATOM 1532 NH2 ARG A 147 -22.251 45.451 15.544 1.00 40.72 N ATOM 1533 HA ARG A 147 -23.423 39.381 12.995 1.00 0.00 H ATOM 1534 HB2 ARG A 147 -25.451 40.648 13.589 1.00 0.00 H ATOM 1535 HB3 ARG A 147 -25.414 39.936 15.219 1.00 0.00 H ATOM 1536 HG2 ARG A 147 -23.415 41.075 15.775 1.00 0.00 H ATOM 1537 HG3 ARG A 147 -23.130 41.551 14.084 1.00 0.00 H ATOM 1538 HD2 ARG A 147 -25.466 42.503 15.779 1.00 0.00 H ATOM 1539 HD3 ARG A 147 -25.048 43.046 14.137 1.00 0.00 H ATOM 1540 HE ARG A 147 -23.727 43.800 16.684 1.00 0.00 H ATOM 1541 HH12 ARG A 147 -22.433 45.149 13.050 1.00 0.00 H ATOM 1542 HH11 ARG A 147 -23.618 43.794 13.117 1.00 0.00 H ATOM 1543 HH22 ARG A 147 -21.664 46.103 14.985 1.00 0.00 H ATOM 1544 HH21 ARG A 147 -22.241 45.503 16.583 1.00 0.00 H ATOM 1545 H ARG A 147 -25.987 38.191 13.416 1.00 0.00 H ATOM 1546 N ALA A 148 -23.669 37.643 15.785 1.00 24.76 N ATOM 1547 CA ALA A 148 -22.874 37.000 16.827 1.00 23.65 C ATOM 1548 C ALA A 148 -21.815 36.081 16.228 1.00 27.70 C ATOM 1549 O ALA A 148 -20.644 36.127 16.617 1.00 28.13 O ATOM 1550 CB ALA A 148 -23.766 36.218 17.772 1.00 22.23 C ATOM 1551 HA ALA A 148 -22.366 37.785 17.387 1.00 0.00 H ATOM 1552 HB1 ALA A 148 -24.481 36.896 18.239 1.00 0.00 H ATOM 1553 HB2 ALA A 148 -24.302 35.452 17.213 1.00 0.00 H ATOM 1554 HB3 ALA A 148 -23.154 35.747 18.541 1.00 0.00 H ATOM 1555 H ALA A 148 -24.691 37.458 15.738 1.00 0.00 H ATOM 1556 N ASP A 149 -22.228 35.243 15.283 1.00 27.96 N ATOM 1557 CA ASP A 149 -21.308 34.288 14.687 1.00 29.11 C ATOM 1558 C ASP A 149 -20.212 35.019 13.912 1.00 30.41 C ATOM 1559 O ASP A 149 -19.036 34.668 14.004 1.00 32.86 O ATOM 1560 CB ASP A 149 -22.051 33.289 13.794 1.00 27.64 C ATOM 1561 CG ASP A 149 -21.172 32.129 13.366 1.00 35.05 C ATOM 1562 OD1 ASP A 149 -20.951 31.206 14.185 1.00 33.83 O ATOM 1563 OD2 ASP A 149 -20.699 32.143 12.208 1.00 38.72 O ATOM 1564 HA ASP A 149 -20.836 33.719 15.488 1.00 0.00 H ATOM 1565 HB2 ASP A 149 -22.906 32.896 14.344 1.00 0.00 H ATOM 1566 HB3 ASP A 149 -22.402 33.810 12.903 1.00 0.00 H ATOM 1567 H ASP A 149 -23.218 35.271 14.967 1.00 0.00 H ATOM 1568 N GLN A 150 -20.596 36.048 13.165 1.00 27.87 N ATOM 1569 CA GLN A 150 -19.620 36.830 12.413 1.00 32.63 C ATOM 1570 C GLN A 150 -18.582 37.490 13.316 1.00 33.52 C ATOM 1571 O GLN A 150 -17.417 37.610 12.941 1.00 36.34 O ATOM 1572 CB GLN A 150 -20.314 37.878 11.548 1.00 31.54 C ATOM 1573 CG GLN A 150 -21.037 37.295 10.338 1.00 33.62 C ATOM 1574 CD GLN A 150 -21.813 38.346 9.568 1.00 35.99 C ATOM 1575 OE1 GLN A 150 -22.112 39.423 10.092 1.00 35.02 O ATOM 1576 NE2 GLN A 150 -22.152 38.038 8.320 1.00 38.32 N ATOM 1577 HA GLN A 150 -19.089 36.131 11.766 1.00 0.00 H ATOM 1578 HB2 GLN A 150 -21.043 38.405 12.164 1.00 0.00 H ATOM 1579 HB3 GLN A 150 -19.563 38.584 11.193 1.00 0.00 H ATOM 1580 HG2 GLN A 150 -20.300 36.846 9.672 1.00 0.00 H ATOM 1581 HG3 GLN A 150 -21.731 36.528 10.681 1.00 0.00 H ATOM 1582 HE22 GLN A 150 -21.879 37.118 7.919 1.00 0.00 H ATOM 1583 HE21 GLN A 150 -22.690 38.717 7.745 1.00 0.00 H ATOM 1584 H GLN A 150 -21.604 36.299 13.115 1.00 0.00 H ATOM 1585 N ALA A 151 -19.004 37.922 14.502 1.00 35.29 N ATOM 1586 CA ALA A 151 -18.078 38.505 15.473 1.00 33.48 C ATOM 1587 C ALA A 151 -17.047 37.478 15.940 1.00 38.44 C ATOM 1588 O ALA A 151 -15.877 37.805 16.141 1.00 38.17 O ATOM 1589 CB ALA A 151 -18.831 39.078 16.663 1.00 34.25 C ATOM 1590 HA ALA A 151 -17.547 39.317 14.976 1.00 0.00 H ATOM 1591 HB1 ALA A 151 -19.514 39.854 16.319 1.00 0.00 H ATOM 1592 HB2 ALA A 151 -19.397 38.284 17.150 1.00 0.00 H ATOM 1593 HB3 ALA A 151 -18.120 39.505 17.370 1.00 0.00 H ATOM 1594 H ALA A 151 -20.013 37.844 14.743 1.00 0.00 H ATOM 1595 N MET A 152 -17.484 36.235 16.114 1.00 35.17 N ATOM 1596 CA MET A 152 -16.576 35.166 16.513 1.00 35.08 C ATOM 1597 C MET A 152 -15.728 34.730 15.328 1.00 39.98 C ATOM 1598 O MET A 152 -14.573 34.337 15.486 1.00 40.08 O ATOM 1599 CB MET A 152 -17.354 33.964 17.046 1.00 34.45 C ATOM 1600 CG MET A 152 -18.051 34.179 18.372 1.00 35.19 C ATOM 1601 SD MET A 152 -16.905 34.381 19.749 1.00 45.15 S ATOM 1602 CE MET A 152 -16.654 36.143 19.711 1.00 32.31 C ATOM 1603 HA MET A 152 -15.931 35.548 17.304 1.00 0.00 H ATOM 1604 HB2 MET A 152 -18.110 33.698 16.307 1.00 0.00 H ATOM 1605 HB3 MET A 152 -16.655 33.136 17.163 1.00 0.00 H ATOM 1606 HG2 MET A 152 -18.687 33.317 18.573 1.00 0.00 H ATOM 1607 HG3 MET A 152 -18.667 35.075 18.299 1.00 0.00 H ATOM 1608 HE1 MET A 152 -16.235 36.428 18.746 1.00 0.00 H ATOM 1609 HE2 MET A 152 -17.609 36.648 19.857 1.00 0.00 H ATOM 1610 HE3 MET A 152 -15.965 36.428 20.506 1.00 0.00 H ATOM 1611 H MET A 152 -18.491 36.021 15.963 1.00 0.00 H ATOM 1612 N ASP A 153 -16.323 34.786 14.142 1.00 38.19 N ATOM 1613 CA ASP A 153 -15.632 34.451 12.909 1.00 40.09 C ATOM 1614 C ASP A 153 -14.459 35.404 12.700 1.00 44.65 C ATOM 1615 O ASP A 153 -13.338 34.977 12.416 1.00 44.67 O ATOM 1616 CB ASP A 153 -16.605 34.550 11.735 1.00 40.93 C ATOM 1617 CG ASP A 153 -16.016 34.038 10.438 1.00 47.97 C ATOM 1618 OD1 ASP A 153 -14.775 34.041 10.288 1.00 49.40 O ATOM 1619 OD2 ASP A 153 -16.806 33.650 9.553 1.00 52.41 O ATOM 1620 HA ASP A 153 -15.251 33.432 12.972 1.00 0.00 H ATOM 1621 HB2 ASP A 153 -17.494 33.964 11.969 1.00 0.00 H ATOM 1622 HB3 ASP A 153 -16.885 35.595 11.602 1.00 0.00 H ATOM 1623 H ASP A 153 -17.319 35.080 14.094 1.00 0.00 H ATOM 1624 N ALA A 154 -14.727 36.698 12.848 1.00 40.21 N ATOM 1625 CA ALA A 154 -13.703 37.719 12.659 1.00 45.20 C ATOM 1626 C ALA A 154 -12.618 37.588 13.718 1.00 46.44 C ATOM 1627 O ALA A 154 -11.440 37.824 13.454 1.00 47.06 O ATOM 1628 CB ALA A 154 -14.322 39.115 12.706 1.00 41.90 C ATOM 1629 HA ALA A 154 -13.251 37.573 11.678 1.00 0.00 H ATOM 1630 HB1 ALA A 154 -15.065 39.208 11.914 1.00 0.00 H ATOM 1631 HB2 ALA A 154 -14.799 39.267 13.674 1.00 0.00 H ATOM 1632 HB3 ALA A 154 -13.541 39.862 12.563 1.00 0.00 H ATOM 1633 H ALA A 154 -15.692 36.989 13.105 1.00 0.00 H ATOM 1634 N LEU A 155 -13.030 37.214 14.922 1.00 41.46 N ATOM 1635 CA LEU A 155 -12.105 37.054 16.034 1.00 43.31 C ATOM 1636 C LEU A 155 -11.177 35.856 15.836 1.00 44.94 C ATOM 1637 O LEU A 155 -9.981 35.943 16.105 1.00 45.57 O ATOM 1638 CB LEU A 155 -12.872 36.924 17.346 1.00 37.12 C ATOM 1639 CG LEU A 155 -12.012 36.657 18.578 1.00 42.30 C ATOM 1640 CD1 LEU A 155 -10.926 37.711 18.699 1.00 43.77 C ATOM 1641 CD2 LEU A 155 -12.863 36.610 19.833 1.00 35.76 C ATOM 1642 HA LEU A 155 -11.480 37.946 16.073 1.00 0.00 H ATOM 1643 HB2 LEU A 155 -13.419 37.853 17.511 1.00 0.00 H ATOM 1644 HB3 LEU A 155 -13.579 36.101 17.243 1.00 0.00 H ATOM 1645 HG LEU A 155 -11.537 35.683 18.462 1.00 0.00 H ATOM 1646 HD21 LEU A 155 -13.372 37.565 19.961 1.00 0.00 H ATOM 1647 HD22 LEU A 155 -13.601 35.813 19.741 1.00 0.00 H ATOM 1648 HD23 LEU A 155 -12.225 36.418 20.696 1.00 0.00 H ATOM 1649 HD11 LEU A 155 -10.295 37.684 17.811 1.00 0.00 H ATOM 1650 HD12 LEU A 155 -11.385 38.695 18.791 1.00 0.00 H ATOM 1651 HD13 LEU A 155 -10.321 37.507 19.582 1.00 0.00 H ATOM 1652 H LEU A 155 -14.042 37.030 15.076 1.00 0.00 H ATOM 1653 N SER A 156 -11.731 34.744 15.361 1.00 43.27 N ATOM 1654 CA SER A 156 -10.952 33.528 15.135 1.00 46.50 C ATOM 1655 C SER A 156 -9.890 33.720 14.056 1.00 51.03 C ATOM 1656 O SER A 156 -8.778 33.203 14.174 1.00 51.96 O ATOM 1657 CB SER A 156 -11.863 32.355 14.759 1.00 48.06 C ATOM 1658 OG SER A 156 -12.303 32.451 13.413 1.00 51.19 O ATOM 1659 HA SER A 156 -10.445 33.302 16.073 1.00 0.00 H ATOM 1660 HB2 SER A 156 -12.732 32.355 15.417 1.00 0.00 H ATOM 1661 HB3 SER A 156 -11.312 31.423 14.887 1.00 0.00 H ATOM 1662 HG SER A 156 -12.809 33.293 13.292 1.00 0.00 H ATOM 1663 H SER A 156 -12.748 34.740 15.144 1.00 0.00 H ATOM 1664 N GLN A 157 -10.232 34.454 13.000 1.00 48.49 N ATOM 1665 CA GLN A 157 -9.278 34.699 11.923 1.00 51.97 C ATOM 1666 C GLN A 157 -8.312 35.823 12.294 1.00 53.97 C ATOM 1667 O GLN A 157 -7.243 35.955 11.696 1.00 55.04 O ATOM 1668 CB GLN A 157 -9.993 34.999 10.605 1.00 50.63 C ATOM 1669 CG GLN A 157 -10.688 36.341 10.565 1.00 53.96 C ATOM 1670 CD GLN A 157 -11.385 36.590 9.241 1.00 57.64 C ATOM 1671 OE1 GLN A 157 -12.362 37.338 9.173 1.00 57.58 O ATOM 1672 NE2 GLN A 157 -10.889 35.959 8.181 1.00 60.25 N ATOM 1673 HA GLN A 157 -8.695 33.789 11.781 1.00 0.00 H ATOM 1674 HB2 GLN A 157 -9.256 34.972 9.803 1.00 0.00 H ATOM 1675 HB3 GLN A 157 -10.739 34.223 10.437 1.00 0.00 H ATOM 1676 HG2 GLN A 157 -11.429 36.376 11.363 1.00 0.00 H ATOM 1677 HG3 GLN A 157 -9.947 37.124 10.724 1.00 0.00 H ATOM 1678 HE22 GLN A 157 -10.062 35.337 8.286 1.00 0.00 H ATOM 1679 HE21 GLN A 157 -11.328 36.088 7.247 1.00 0.00 H ATOM 1680 H GLN A 157 -11.189 34.857 12.942 1.00 0.00 H ATOM 1681 N GLU A 158 -8.692 36.625 13.286 1.00 51.85 N ATOM 1682 CA GLU A 158 -7.792 37.620 13.857 1.00 51.67 C ATOM 1683 C GLU A 158 -6.729 36.941 14.717 1.00 56.43 C ATOM 1684 O GLU A 158 -5.624 37.461 14.877 1.00 54.39 O ATOM 1685 CB GLU A 158 -8.565 38.633 14.698 1.00 52.11 C ATOM 1686 CG GLU A 158 -7.681 39.615 15.447 1.00 54.61 C ATOM 1687 CD GLU A 158 -8.473 40.581 16.310 1.00 58.90 C ATOM 1688 OE1 GLU A 158 -9.713 40.665 16.145 1.00 54.58 O ATOM 1689 OE2 GLU A 158 -7.849 41.262 17.153 1.00 61.86 O ATOM 1690 HA GLU A 158 -7.306 38.147 13.036 1.00 0.00 H ATOM 1691 HB2 GLU A 158 -9.222 39.198 14.037 1.00 0.00 H ATOM 1692 HB3 GLU A 158 -9.166 38.088 15.426 1.00 0.00 H ATOM 1693 HG2 GLU A 158 -7.001 39.053 16.087 1.00 0.00 H ATOM 1694 HG3 GLU A 158 -7.105 40.189 14.721 1.00 0.00 H ATOM 1695 H GLU A 158 -9.657 36.540 13.664 1.00 0.00 H ATOM 1696 N VAL A 159 -7.074 35.781 15.270 1.00 52.37 N ATOM 1697 CA VAL A 159 -6.133 34.984 16.057 1.00 55.31 C ATOM 1698 C VAL A 159 -5.255 34.120 15.154 1.00 56.38 C ATOM 1699 O VAL A 159 -4.041 34.047 15.347 1.00 57.63 O ATOM 1700 CB VAL A 159 -6.859 34.087 17.089 1.00 51.56 C ATOM 1701 CG1 VAL A 159 -6.066 32.810 17.352 1.00 48.59 C ATOM 1702 CG2 VAL A 159 -7.105 34.855 18.378 1.00 50.07 C ATOM 1703 HA VAL A 159 -5.503 35.688 16.600 1.00 0.00 H ATOM 1704 HB VAL A 159 -7.825 33.798 16.676 1.00 0.00 H ATOM 1705 HG11 VAL A 159 -5.954 32.255 16.421 1.00 0.00 H ATOM 1706 HG12 VAL A 159 -5.082 33.069 17.742 1.00 0.00 H ATOM 1707 HG13 VAL A 159 -6.597 32.197 18.080 1.00 0.00 H ATOM 1708 HG21 VAL A 159 -6.151 35.177 18.795 1.00 0.00 H ATOM 1709 HG22 VAL A 159 -7.724 35.727 18.167 1.00 0.00 H ATOM 1710 HG23 VAL A 159 -7.616 34.209 19.092 1.00 0.00 H ATOM 1711 H VAL A 159 -8.044 35.430 15.138 1.00 0.00 H ATOM 1712 N MET A 160 -5.874 33.474 14.168 1.00 56.90 N ATOM 1713 CA MET A 160 -5.144 32.686 13.176 1.00 57.26 C ATOM 1714 C MET A 160 -4.139 33.550 12.422 1.00 58.08 C ATOM 1715 O MET A 160 -3.187 33.042 11.829 1.00 61.21 O ATOM 1716 CB MET A 160 -6.109 32.042 12.177 1.00 57.51 C ATOM 1717 CG MET A 160 -6.921 30.880 12.729 1.00 56.34 C ATOM 1718 SD MET A 160 -5.906 29.488 13.262 1.00 64.27 S ATOM 1719 CE MET A 160 -5.653 29.888 14.991 1.00 53.71 C ATOM 1720 HA MET A 160 -4.606 31.903 13.711 1.00 0.00 H ATOM 1721 HB2 MET A 160 -6.804 32.809 11.835 1.00 0.00 H ATOM 1722 HB3 MET A 160 -5.527 31.677 11.331 1.00 0.00 H ATOM 1723 HG2 MET A 160 -7.602 30.534 11.952 1.00 0.00 H ATOM 1724 HG3 MET A 160 -7.497 31.235 13.583 1.00 0.00 H ATOM 1725 HE1 MET A 160 -5.147 30.850 15.070 1.00 0.00 H ATOM 1726 HE2 MET A 160 -6.618 29.941 15.495 1.00 0.00 H ATOM 1727 HE3 MET A 160 -5.041 29.115 15.456 1.00 0.00 H ATOM 1728 H MET A 160 -6.910 33.532 14.101 1.00 0.00 H ATOM 1729 N ALA A 161 -4.365 34.858 12.444 1.00 56.38 N ATOM 1730 CA ALA A 161 -3.480 35.799 11.773 1.00 60.65 C ATOM 1731 C ALA A 161 -2.330 36.234 12.679 1.00 60.35 C ATOM 1732 O ALA A 161 -1.230 36.511 12.200 1.00 62.60 O ATOM 1733 CB ALA A 161 -4.266 37.010 11.284 1.00 60.83 C ATOM 1734 HA ALA A 161 -3.045 35.291 10.912 1.00 0.00 H ATOM 1735 HB1 ALA A 161 -5.035 36.684 10.584 1.00 0.00 H ATOM 1736 HB2 ALA A 161 -4.734 37.506 12.135 1.00 0.00 H ATOM 1737 HB3 ALA A 161 -3.589 37.703 10.785 1.00 0.00 H ATOM 1738 H ALA A 161 -5.196 35.220 12.954 1.00 0.00 H ATOM 1739 N ARG A 162 -2.585 36.288 13.985 1.00 57.29 N ATOM 1740 CA ARG A 162 -1.579 36.754 14.941 1.00 60.76 C ATOM 1741 C ARG A 162 -0.325 35.879 14.953 1.00 61.73 C ATOM 1742 O ARG A 162 -0.398 34.669 14.733 1.00 60.14 O ATOM 1743 CB ARG A 162 -2.166 36.880 16.352 1.00 60.91 C ATOM 1744 CG ARG A 162 -3.213 37.978 16.490 1.00 62.70 C ATOM 1745 CD ARG A 162 -2.839 39.201 15.658 1.00 64.98 C ATOM 1746 NE ARG A 162 -3.926 40.176 15.575 1.00 65.59 N ATOM 1747 CZ ARG A 162 -3.995 41.283 16.309 1.00 68.36 C ATOM 1748 NH1 ARG A 162 -3.037 41.560 17.185 1.00 71.77 N ATOM 1749 NH2 ARG A 162 -5.020 42.115 16.165 1.00 62.91 N ATOM 1750 HA ARG A 162 -1.273 37.744 14.604 1.00 0.00 H ATOM 1751 HB2 ARG A 162 -2.628 35.929 16.618 1.00 0.00 H ATOM 1752 HB3 ARG A 162 -1.352 37.093 17.045 1.00 0.00 H ATOM 1753 HG2 ARG A 162 -4.176 37.597 16.150 1.00 0.00 H ATOM 1754 HG3 ARG A 162 -3.288 38.269 17.538 1.00 0.00 H ATOM 1755 HD2 ARG A 162 -2.585 38.874 14.650 1.00 0.00 H ATOM 1756 HD3 ARG A 162 -1.972 39.681 16.112 1.00 0.00 H ATOM 1757 HE ARG A 162 -4.694 39.992 14.899 1.00 0.00 H ATOM 1758 HH12 ARG A 162 -3.091 42.426 17.759 1.00 0.00 H ATOM 1759 HH11 ARG A 162 -2.232 40.911 17.298 1.00 0.00 H ATOM 1760 HH22 ARG A 162 -5.072 42.980 16.740 1.00 0.00 H ATOM 1761 HH21 ARG A 162 -5.770 41.901 15.477 1.00 0.00 H ATOM 1762 H ARG A 162 -3.519 35.993 14.333 1.00 0.00 H ATOM 1763 N PRO A 163 0.836 36.499 15.219 1.00 67.85 N ATOM 1764 CA PRO A 163 2.144 35.839 15.139 1.00 65.27 C ATOM 1765 C PRO A 163 2.583 35.211 16.462 1.00 60.36 C ATOM 1766 O PRO A 163 3.764 34.894 16.621 1.00 59.02 O ATOM 1767 CB PRO A 163 3.076 36.996 14.775 1.00 67.47 C ATOM 1768 CG PRO A 163 2.429 38.217 15.407 1.00 67.08 C ATOM 1769 CD PRO A 163 0.959 37.912 15.623 1.00 64.59 C ATOM 1770 HA PRO A 163 2.139 35.011 14.430 1.00 0.00 H ATOM 1771 HD3 PRO A 163 0.683 38.044 16.669 1.00 0.00 H ATOM 1772 HD2 PRO A 163 0.333 38.551 15.001 1.00 0.00 H ATOM 1773 HG3 PRO A 163 2.535 39.076 14.745 1.00 0.00 H ATOM 1774 HG2 PRO A 163 2.906 38.435 16.363 1.00 0.00 H ATOM 1775 HB2 PRO A 163 4.073 36.832 15.184 1.00 0.00 H ATOM 1776 HB3 PRO A 163 3.143 37.111 13.693 1.00 0.00 H ATOM 1777 N GLU A 164 1.643 35.026 17.385 1.00 56.01 N ATOM 1778 CA GLU A 164 1.952 34.550 18.729 1.00 50.60 C ATOM 1779 C GLU A 164 2.217 33.047 18.762 1.00 45.53 C ATOM 1780 O GLU A 164 2.131 32.370 17.738 1.00 49.76 O ATOM 1781 CB GLU A 164 0.812 34.908 19.687 1.00 53.66 C ATOM 1782 CG GLU A 164 -0.517 34.261 19.325 1.00 54.03 C ATOM 1783 CD GLU A 164 -1.709 34.922 19.997 1.00 55.95 C ATOM 1784 OE1 GLU A 164 -1.528 35.542 21.069 1.00 57.83 O ATOM 1785 OE2 GLU A 164 -2.829 34.819 19.449 1.00 53.04 O ATOM 1786 HA GLU A 164 2.868 35.047 19.050 1.00 0.00 H ATOM 1787 HB2 GLU A 164 1.091 34.585 20.690 1.00 0.00 H ATOM 1788 HB3 GLU A 164 0.682 35.990 19.678 1.00 0.00 H ATOM 1789 HG2 GLU A 164 -0.650 34.323 18.245 1.00 0.00 H ATOM 1790 HG3 GLU A 164 -0.486 33.214 19.626 1.00 0.00 H ATOM 1791 H GLU A 164 0.653 35.228 17.140 1.00 0.00 H ATOM 1792 N ALA A 165 2.536 32.529 19.944 1.00 43.32 N ATOM 1793 CA ALA A 165 2.846 31.111 20.096 1.00 40.01 C ATOM 1794 C ALA A 165 1.681 30.227 19.660 1.00 45.32 C ATOM 1795 O ALA A 165 0.521 30.530 19.949 1.00 40.75 O ATOM 1796 CB ALA A 165 3.232 30.805 21.526 1.00 39.06 C ATOM 1797 HA ALA A 165 3.691 30.888 19.444 1.00 0.00 H ATOM 1798 HB1 ALA A 165 4.110 31.392 21.798 1.00 0.00 H ATOM 1799 HB2 ALA A 165 2.404 31.060 22.187 1.00 0.00 H ATOM 1800 HB3 ALA A 165 3.460 29.743 21.620 1.00 0.00 H ATOM 1801 H ALA A 165 2.565 33.148 20.779 1.00 0.00 H ATOM 1802 N ASP A 166 2.002 29.133 18.972 1.00 38.42 N ATOM 1803 CA ASP A 166 1.003 28.176 18.508 1.00 43.86 C ATOM 1804 C ASP A 166 0.177 27.598 19.651 1.00 42.92 C ATOM 1805 O ASP A 166 -1.040 27.464 19.536 1.00 40.37 O ATOM 1806 CB ASP A 166 1.667 27.037 17.733 1.00 47.70 C ATOM 1807 CG ASP A 166 2.145 27.466 16.362 1.00 52.74 C ATOM 1808 OD1 ASP A 166 1.519 28.370 15.771 1.00 52.02 O ATOM 1809 OD2 ASP A 166 3.144 26.893 15.875 1.00 56.76 O ATOM 1810 HA ASP A 166 0.328 28.724 17.851 1.00 0.00 H ATOM 1811 HB2 ASP A 166 2.523 26.678 18.305 1.00 0.00 H ATOM 1812 HB3 ASP A 166 0.946 26.228 17.614 1.00 0.00 H ATOM 1813 H ASP A 166 3.004 28.954 18.757 1.00 0.00 H ATOM 1814 N SER A 167 0.842 27.245 20.747 1.00 41.14 N ATOM 1815 CA SER A 167 0.147 26.698 21.908 1.00 39.20 C ATOM 1816 C SER A 167 -0.865 27.708 22.455 1.00 40.06 C ATOM 1817 O SER A 167 -1.938 27.333 22.929 1.00 38.87 O ATOM 1818 CB SER A 167 1.146 26.304 22.995 1.00 39.53 C ATOM 1819 OG SER A 167 1.817 27.449 23.493 1.00 39.77 O ATOM 1820 HA SER A 167 -0.392 25.805 21.594 1.00 0.00 H ATOM 1821 HB2 SER A 167 1.878 25.613 22.576 1.00 0.00 H ATOM 1822 HB3 SER A 167 0.614 25.817 23.812 1.00 0.00 H ATOM 1823 HG SER A 167 2.459 27.175 24.195 1.00 0.00 H ATOM 1824 H SER A 167 1.875 27.361 20.777 1.00 0.00 H ATOM 1825 N VAL A 168 -0.516 28.989 22.383 1.00 39.14 N ATOM 1826 CA VAL A 168 -1.416 30.056 22.802 1.00 39.55 C ATOM 1827 C VAL A 168 -2.592 30.190 21.830 1.00 41.51 C ATOM 1828 O VAL A 168 -3.748 30.275 22.256 1.00 38.22 O ATOM 1829 CB VAL A 168 -0.677 31.411 22.934 1.00 41.63 C ATOM 1830 CG1 VAL A 168 -1.664 32.574 22.924 1.00 42.70 C ATOM 1831 CG2 VAL A 168 0.176 31.435 24.204 1.00 36.93 C ATOM 1832 HA VAL A 168 -1.800 29.786 23.786 1.00 0.00 H ATOM 1833 HB VAL A 168 -0.017 31.524 22.074 1.00 0.00 H ATOM 1834 HG11 VAL A 168 -2.221 32.568 21.987 1.00 0.00 H ATOM 1835 HG12 VAL A 168 -2.356 32.469 23.760 1.00 0.00 H ATOM 1836 HG13 VAL A 168 -1.118 33.513 23.018 1.00 0.00 H ATOM 1837 HG21 VAL A 168 -0.466 31.295 25.074 1.00 0.00 H ATOM 1838 HG22 VAL A 168 0.912 30.632 24.161 1.00 0.00 H ATOM 1839 HG23 VAL A 168 0.687 32.395 24.279 1.00 0.00 H ATOM 1840 H VAL A 168 0.426 29.236 22.017 1.00 0.00 H ATOM 1841 N ARG A 169 -2.291 30.205 20.531 1.00 39.81 N ATOM 1842 CA ARG A 169 -3.326 30.294 19.499 1.00 42.97 C ATOM 1843 C ARG A 169 -4.289 29.110 19.575 1.00 42.44 C ATOM 1844 O ARG A 169 -5.498 29.270 19.382 1.00 38.98 O ATOM 1845 CB ARG A 169 -2.706 30.365 18.100 1.00 42.61 C ATOM 1846 CG ARG A 169 -1.564 31.354 17.980 1.00 48.74 C ATOM 1847 CD ARG A 169 -1.817 32.424 16.923 1.00 50.98 C ATOM 1848 NE ARG A 169 -1.706 31.972 15.533 1.00 55.53 N ATOM 1849 CZ ARG A 169 -1.017 30.915 15.104 1.00 56.52 C ATOM 1850 NH1 ARG A 169 -0.333 30.150 15.943 1.00 52.34 N ATOM 1851 NH2 ARG A 169 -1.008 30.626 13.810 1.00 62.24 N ATOM 1852 HA ARG A 169 -3.885 31.211 19.683 1.00 0.00 H ATOM 1853 HB2 ARG A 169 -2.331 29.375 17.841 1.00 0.00 H ATOM 1854 HB3 ARG A 169 -3.485 30.653 17.394 1.00 0.00 H ATOM 1855 HG2 ARG A 169 -1.424 31.843 18.944 1.00 0.00 H ATOM 1856 HG3 ARG A 169 -0.658 30.809 17.715 1.00 0.00 H ATOM 1857 HD2 ARG A 169 -1.094 33.225 17.075 1.00 0.00 H ATOM 1858 HD3 ARG A 169 -2.825 32.812 17.071 1.00 0.00 H ATOM 1859 HE ARG A 169 -2.212 32.528 14.815 1.00 0.00 H ATOM 1860 HH12 ARG A 169 0.197 29.330 15.585 1.00 0.00 H ATOM 1861 HH11 ARG A 169 -0.327 30.370 16.960 1.00 0.00 H ATOM 1862 HH22 ARG A 169 -0.474 29.803 13.465 1.00 0.00 H ATOM 1863 HH21 ARG A 169 -1.535 31.222 13.140 1.00 0.00 H ATOM 1864 H ARG A 169 -1.293 30.152 20.243 1.00 0.00 H ATOM 1865 N LEU A 170 -3.742 27.928 19.855 1.00 38.79 N ATOM 1866 CA LEU A 170 -4.535 26.708 19.963 1.00 41.03 C ATOM 1867 C LEU A 170 -5.528 26.758 21.118 1.00 42.04 C ATOM 1868 O LEU A 170 -6.688 26.353 20.978 1.00 40.23 O ATOM 1869 CB LEU A 170 -3.624 25.497 20.138 1.00 42.79 C ATOM 1870 CG LEU A 170 -4.368 24.167 20.254 1.00 46.41 C ATOM 1871 CD1 LEU A 170 -5.224 23.942 19.011 1.00 46.96 C ATOM 1872 CD2 LEU A 170 -3.395 23.016 20.463 1.00 47.78 C ATOM 1873 HA LEU A 170 -5.102 26.621 19.036 1.00 0.00 H ATOM 1874 HB2 LEU A 170 -2.958 25.443 19.277 1.00 0.00 H ATOM 1875 HB3 LEU A 170 -3.035 25.640 21.044 1.00 0.00 H ATOM 1876 HG LEU A 170 -5.022 24.206 21.125 1.00 0.00 H ATOM 1877 HD21 LEU A 170 -2.711 22.962 19.616 1.00 0.00 H ATOM 1878 HD22 LEU A 170 -2.829 23.182 21.380 1.00 0.00 H ATOM 1879 HD23 LEU A 170 -3.951 22.082 20.542 1.00 0.00 H ATOM 1880 HD11 LEU A 170 -5.947 24.753 18.918 1.00 0.00 H ATOM 1881 HD12 LEU A 170 -4.584 23.921 18.129 1.00 0.00 H ATOM 1882 HD13 LEU A 170 -5.751 22.992 19.101 1.00 0.00 H ATOM 1883 H LEU A 170 -2.714 27.873 20.002 1.00 0.00 H ATOM 1884 N ALA A 171 -5.064 27.243 22.264 1.00 37.16 N ATOM 1885 CA ALA A 171 -5.909 27.351 23.446 1.00 36.46 C ATOM 1886 C ALA A 171 -7.032 28.344 23.190 1.00 38.52 C ATOM 1887 O ALA A 171 -8.192 28.090 23.533 1.00 37.86 O ATOM 1888 CB ALA A 171 -5.085 27.782 24.651 1.00 38.74 C ATOM 1889 HA ALA A 171 -6.343 26.374 23.659 1.00 0.00 H ATOM 1890 HB1 ALA A 171 -4.305 27.045 24.838 1.00 0.00 H ATOM 1891 HB2 ALA A 171 -4.630 28.752 24.450 1.00 0.00 H ATOM 1892 HB3 ALA A 171 -5.733 27.857 25.524 1.00 0.00 H ATOM 1893 H ALA A 171 -4.073 27.553 22.319 1.00 0.00 H ATOM 1894 N GLN A 172 -6.674 29.472 22.583 1.00 33.74 N ATOM 1895 CA GLN A 172 -7.626 30.526 22.262 1.00 36.97 C ATOM 1896 C GLN A 172 -8.681 30.046 21.262 1.00 37.96 C ATOM 1897 O GLN A 172 -9.873 30.294 21.444 1.00 33.96 O ATOM 1898 CB GLN A 172 -6.900 31.752 21.699 1.00 35.55 C ATOM 1899 CG GLN A 172 -6.000 32.473 22.699 1.00 40.13 C ATOM 1900 CD GLN A 172 -5.223 33.614 22.066 1.00 42.55 C ATOM 1901 OE1 GLN A 172 -5.087 33.686 20.843 1.00 43.90 O ATOM 1902 NE2 GLN A 172 -4.710 34.514 22.898 1.00 40.55 N ATOM 1903 HA GLN A 172 -8.133 30.800 23.187 1.00 0.00 H ATOM 1904 HB2 GLN A 172 -6.285 31.427 20.860 1.00 0.00 H ATOM 1905 HB3 GLN A 172 -7.650 32.459 21.345 1.00 0.00 H ATOM 1906 HG2 GLN A 172 -6.620 32.874 23.501 1.00 0.00 H ATOM 1907 HG3 GLN A 172 -5.292 31.755 23.113 1.00 0.00 H ATOM 1908 HE22 GLN A 172 -4.850 34.413 23.924 1.00 0.00 H ATOM 1909 HE21 GLN A 172 -4.169 35.319 22.524 1.00 0.00 H ATOM 1910 H GLN A 172 -5.675 29.607 22.328 1.00 0.00 H ATOM 1911 N TYR A 173 -8.239 29.369 20.207 1.00 36.88 N ATOM 1912 CA TYR A 173 -9.150 28.904 19.165 1.00 39.85 C ATOM 1913 C TYR A 173 -10.140 27.893 19.729 1.00 37.94 C ATOM 1914 O TYR A 173 -11.312 27.876 19.351 1.00 37.33 O ATOM 1915 CB TYR A 173 -8.370 28.285 18.003 1.00 43.75 C ATOM 1916 CG TYR A 173 -9.157 28.190 16.711 1.00 45.61 C ATOM 1917 CD1 TYR A 173 -9.947 27.079 16.433 1.00 38.75 C ATOM 1918 CD2 TYR A 173 -9.104 29.211 15.768 1.00 45.46 C ATOM 1919 CE1 TYR A 173 -10.662 26.987 15.261 1.00 42.24 C ATOM 1920 CE2 TYR A 173 -9.821 29.129 14.587 1.00 49.51 C ATOM 1921 CZ TYR A 173 -10.598 28.014 14.340 1.00 46.47 C ATOM 1922 OH TYR A 173 -11.311 27.927 13.164 1.00 51.88 O ATOM 1923 HA TYR A 173 -9.705 29.765 18.792 1.00 0.00 H ATOM 1924 HB3 TYR A 173 -8.064 27.280 18.293 1.00 0.00 H ATOM 1925 HB2 TYR A 173 -7.485 28.895 17.821 1.00 0.00 H ATOM 1926 HD2 TYR A 173 -8.488 30.089 15.962 1.00 0.00 H ATOM 1927 HE2 TYR A 173 -9.773 29.938 13.858 1.00 0.00 H ATOM 1928 HE1 TYR A 173 -11.275 26.109 15.061 1.00 0.00 H ATOM 1929 HD1 TYR A 173 -10.001 26.266 17.157 1.00 0.00 H ATOM 1930 HH TYR A 173 -11.811 27.073 13.145 1.00 0.00 H ATOM 1931 H TYR A 173 -7.223 29.166 20.122 1.00 0.00 H ATOM 1932 N GLN A 174 -9.653 27.048 20.630 1.00 34.27 N ATOM 1933 CA GLN A 174 -10.482 26.046 21.281 1.00 37.07 C ATOM 1934 C GLN A 174 -11.611 26.701 22.083 1.00 38.59 C ATOM 1935 O GLN A 174 -12.767 26.265 22.018 1.00 35.79 O ATOM 1936 CB GLN A 174 -9.615 25.167 22.180 1.00 40.56 C ATOM 1937 CG GLN A 174 -10.301 23.925 22.717 1.00 46.20 C ATOM 1938 CD GLN A 174 -9.309 22.871 23.200 1.00 54.40 C ATOM 1939 OE1 GLN A 174 -9.515 22.234 24.236 1.00 60.40 O ATOM 1940 NE2 GLN A 174 -8.225 22.686 22.449 1.00 50.66 N ATOM 1941 HA GLN A 174 -10.944 25.423 20.515 1.00 0.00 H ATOM 1942 HB2 GLN A 174 -8.744 24.851 21.606 1.00 0.00 H ATOM 1943 HB3 GLN A 174 -9.290 25.768 23.029 1.00 0.00 H ATOM 1944 HG2 GLN A 174 -10.940 24.212 23.552 1.00 0.00 H ATOM 1945 HG3 GLN A 174 -10.912 23.493 21.925 1.00 0.00 H ATOM 1946 HE22 GLN A 174 -8.091 23.245 21.583 1.00 0.00 H ATOM 1947 HE21 GLN A 174 -7.512 21.982 22.729 1.00 0.00 H ATOM 1948 H GLN A 174 -8.645 27.105 20.879 1.00 0.00 H ATOM 1949 N LEU A 175 -11.268 27.747 22.834 1.00 33.78 N ATOM 1950 CA LEU A 175 -12.239 28.505 23.621 1.00 33.19 C ATOM 1951 C LEU A 175 -13.289 29.168 22.737 1.00 33.46 C ATOM 1952 O LEU A 175 -14.498 29.061 22.990 1.00 30.13 O ATOM 1953 CB LEU A 175 -11.525 29.570 24.463 1.00 33.07 C ATOM 1954 CG LEU A 175 -11.328 29.309 25.963 1.00 41.30 C ATOM 1955 CD1 LEU A 175 -11.287 27.826 26.285 1.00 36.72 C ATOM 1956 CD2 LEU A 175 -10.076 30.017 26.481 1.00 35.24 C ATOM 1957 HA LEU A 175 -12.748 27.800 24.278 1.00 0.00 H ATOM 1958 HB2 LEU A 175 -10.536 29.714 24.029 1.00 0.00 H ATOM 1959 HB3 LEU A 175 -12.099 30.492 24.369 1.00 0.00 H ATOM 1960 HG LEU A 175 -12.195 29.724 26.478 1.00 0.00 H ATOM 1961 HD21 LEU A 175 -9.203 29.648 25.943 1.00 0.00 H ATOM 1962 HD22 LEU A 175 -10.175 31.091 26.322 1.00 0.00 H ATOM 1963 HD23 LEU A 175 -9.960 29.815 27.546 1.00 0.00 H ATOM 1964 HD11 LEU A 175 -12.226 27.363 25.980 1.00 0.00 H ATOM 1965 HD12 LEU A 175 -10.460 27.362 25.748 1.00 0.00 H ATOM 1966 HD13 LEU A 175 -11.146 27.692 27.358 1.00 0.00 H ATOM 1967 H LEU A 175 -10.269 28.036 22.861 1.00 0.00 H ATOM 1968 N ILE A 176 -12.819 29.853 21.698 1.00 30.25 N ATOM 1969 CA ILE A 176 -13.698 30.566 20.789 1.00 30.73 C ATOM 1970 C ILE A 176 -14.662 29.611 20.090 1.00 32.67 C ATOM 1971 O ILE A 176 -15.861 29.873 20.025 1.00 31.48 O ATOM 1972 CB ILE A 176 -12.899 31.373 19.755 1.00 34.09 C ATOM 1973 CG1 ILE A 176 -12.009 32.394 20.470 1.00 34.33 C ATOM 1974 CG2 ILE A 176 -13.838 32.074 18.775 1.00 33.82 C ATOM 1975 CD1 ILE A 176 -11.164 33.237 19.544 1.00 38.74 C ATOM 1976 HA ILE A 176 -14.283 31.266 21.386 1.00 0.00 H ATOM 1977 HB ILE A 176 -12.268 30.689 19.187 1.00 0.00 H ATOM 1978 HG12 ILE A 176 -12.649 33.059 21.049 1.00 0.00 H ATOM 1979 HG13 ILE A 176 -11.343 31.855 21.144 1.00 0.00 H ATOM 1980 HD11 ILE A 176 -10.506 32.590 18.964 1.00 0.00 H ATOM 1981 HD12 ILE A 176 -11.813 33.795 18.869 1.00 0.00 H ATOM 1982 HD13 ILE A 176 -10.565 33.932 20.133 1.00 0.00 H ATOM 1983 HG21 ILE A 176 -14.439 31.329 18.254 1.00 0.00 H ATOM 1984 HG22 ILE A 176 -14.493 32.752 19.323 1.00 0.00 H ATOM 1985 HG23 ILE A 176 -13.250 32.639 18.052 1.00 0.00 H ATOM 1986 H ILE A 176 -11.793 29.878 21.532 1.00 0.00 H ATOM 1987 N SER A 177 -14.140 28.498 19.588 1.00 30.40 N ATOM 1988 CA SER A 177 -14.979 27.518 18.908 1.00 36.44 C ATOM 1989 C SER A 177 -16.028 26.927 19.854 1.00 35.30 C ATOM 1990 O SER A 177 -17.182 26.743 19.464 1.00 32.86 O ATOM 1991 CB SER A 177 -14.131 26.406 18.290 1.00 39.17 C ATOM 1992 OG SER A 177 -13.785 25.437 19.262 1.00 44.38 O ATOM 1993 HA SER A 177 -15.503 28.038 18.106 1.00 0.00 H ATOM 1994 HB2 SER A 177 -13.220 26.839 17.877 1.00 0.00 H ATOM 1995 HB3 SER A 177 -14.698 25.926 17.492 1.00 0.00 H ATOM 1996 HG SER A 177 -13.267 25.869 19.987 1.00 0.00 H ATOM 1997 H SER A 177 -13.119 28.323 19.681 1.00 0.00 H ATOM 1998 N LYS A 178 -15.620 26.620 21.086 1.00 29.84 N ATOM 1999 CA LYS A 178 -16.548 26.154 22.112 1.00 33.03 C ATOM 2000 C LYS A 178 -17.711 27.126 22.326 1.00 28.93 C ATOM 2001 O LYS A 178 -18.839 26.703 22.584 1.00 27.06 O ATOM 2002 CB LYS A 178 -15.831 25.950 23.451 1.00 35.24 C ATOM 2003 CG LYS A 178 -15.082 24.638 23.593 1.00 38.33 C ATOM 2004 CD LYS A 178 -15.065 24.195 25.057 1.00 41.28 C ATOM 2005 CE LYS A 178 -14.320 22.880 25.247 1.00 51.05 C ATOM 2006 NZ LYS A 178 -12.841 23.070 25.263 1.00 44.48 N ATOM 2007 HA LYS A 178 -16.945 25.205 21.753 1.00 0.00 H ATOM 2008 HB2 LYS A 178 -15.115 26.762 23.577 1.00 0.00 H ATOM 2009 HB3 LYS A 178 -16.577 25.999 24.244 1.00 0.00 H ATOM 2010 HG2 LYS A 178 -15.575 23.875 22.991 1.00 0.00 H ATOM 2011 HG3 LYS A 178 -14.058 24.768 23.244 1.00 0.00 H ATOM 2012 HD2 LYS A 178 -14.576 24.966 25.653 1.00 0.00 H ATOM 2013 HD3 LYS A 178 -16.092 24.070 25.399 1.00 0.00 H ATOM 2014 HE2 LYS A 178 -14.579 22.207 24.429 1.00 0.00 H ATOM 2015 HE3 LYS A 178 -14.628 22.435 26.193 1.00 0.00 H ATOM 2016 HZ1 LYS A 178 -12.537 23.488 24.361 1.00 0.00 H ATOM 2017 HZ2 LYS A 178 -12.583 23.705 26.045 1.00 0.00 H ATOM 2018 HZ3 LYS A 178 -12.376 22.149 25.395 1.00 0.00 H ATOM 2019 H LYS A 178 -14.612 26.715 21.323 1.00 0.00 H ATOM 2020 N ALA A 179 -17.427 28.423 22.236 1.00 27.31 N ATOM 2021 CA ALA A 179 -18.445 29.456 22.431 1.00 28.17 C ATOM 2022 C ALA A 179 -19.384 29.571 21.228 1.00 28.97 C ATOM 2023 O ALA A 179 -20.603 29.725 21.384 1.00 28.20 O ATOM 2024 CB ALA A 179 -17.792 30.791 22.724 1.00 30.07 C ATOM 2025 HA ALA A 179 -19.051 29.160 23.288 1.00 0.00 H ATOM 2026 HB1 ALA A 179 -17.190 30.709 23.629 1.00 0.00 H ATOM 2027 HB2 ALA A 179 -17.154 31.074 21.887 1.00 0.00 H ATOM 2028 HB3 ALA A 179 -18.563 31.548 22.866 1.00 0.00 H ATOM 2029 H ALA A 179 -16.451 28.711 22.020 1.00 0.00 H ATOM 2030 N ARG A 180 -18.814 29.504 20.029 1.00 29.03 N ATOM 2031 CA ARG A 180 -19.611 29.500 18.808 1.00 29.83 C ATOM 2032 C ARG A 180 -20.569 28.322 18.807 1.00 28.02 C ATOM 2033 O ARG A 180 -21.749 28.467 18.495 1.00 25.96 O ATOM 2034 CB ARG A 180 -18.717 29.406 17.573 1.00 32.76 C ATOM 2035 CG ARG A 180 -17.928 30.655 17.285 1.00 37.07 C ATOM 2036 CD ARG A 180 -17.001 30.455 16.096 1.00 37.32 C ATOM 2037 NE ARG A 180 -17.690 30.597 14.818 1.00 36.70 N ATOM 2038 CZ ARG A 180 -17.059 30.652 13.649 1.00 43.74 C ATOM 2039 NH1 ARG A 180 -15.734 30.577 13.616 1.00 40.67 N ATOM 2040 NH2 ARG A 180 -17.742 30.778 12.518 1.00 42.67 N ATOM 2041 HA ARG A 180 -20.172 30.434 18.776 1.00 0.00 H ATOM 2042 HB2 ARG A 180 -18.016 28.585 17.720 1.00 0.00 H ATOM 2043 HB3 ARG A 180 -19.348 29.193 16.710 1.00 0.00 H ATOM 2044 HG2 ARG A 180 -18.618 31.470 17.066 1.00 0.00 H ATOM 2045 HG3 ARG A 180 -17.333 30.911 18.162 1.00 0.00 H ATOM 2046 HD2 ARG A 180 -16.571 29.455 16.152 1.00 0.00 H ATOM 2047 HD3 ARG A 180 -16.203 31.195 16.147 1.00 0.00 H ATOM 2048 HE ARG A 180 -18.728 30.658 14.821 1.00 0.00 H ATOM 2049 HH12 ARG A 180 -15.233 30.619 12.705 1.00 0.00 H ATOM 2050 HH11 ARG A 180 -15.197 30.476 14.501 1.00 0.00 H ATOM 2051 HH22 ARG A 180 -17.239 30.820 11.609 1.00 0.00 H ATOM 2052 HH21 ARG A 180 -18.780 30.835 12.541 1.00 0.00 H ATOM 2053 H ARG A 180 -17.778 29.453 19.960 1.00 0.00 H ATOM 2054 N GLN A 181 -20.051 27.152 19.149 1.00 23.99 N ATOM 2055 CA GLN A 181 -20.847 25.936 19.102 1.00 29.10 C ATOM 2056 C GLN A 181 -21.899 25.890 20.205 1.00 26.36 C ATOM 2057 O GLN A 181 -22.982 25.344 20.016 1.00 20.41 O ATOM 2058 CB GLN A 181 -19.937 24.711 19.125 1.00 30.02 C ATOM 2059 CG GLN A 181 -19.050 24.682 17.899 1.00 33.01 C ATOM 2060 CD GLN A 181 -17.885 23.732 18.016 1.00 38.24 C ATOM 2061 OE1 GLN A 181 -17.885 22.824 18.849 1.00 41.00 O ATOM 2062 NE2 GLN A 181 -16.877 23.936 17.170 1.00 36.95 N ATOM 2063 HA GLN A 181 -21.400 25.932 18.163 1.00 0.00 H ATOM 2064 HB2 GLN A 181 -19.313 24.745 20.018 1.00 0.00 H ATOM 2065 HB3 GLN A 181 -20.550 23.810 19.145 1.00 0.00 H ATOM 2066 HG2 GLN A 181 -19.655 24.382 17.043 1.00 0.00 H ATOM 2067 HG3 GLN A 181 -18.660 25.686 17.732 1.00 0.00 H ATOM 2068 HE22 GLN A 181 -16.923 24.717 16.484 1.00 0.00 H ATOM 2069 HE21 GLN A 181 -16.043 23.315 17.195 1.00 0.00 H ATOM 2070 H GLN A 181 -19.059 27.102 19.456 1.00 0.00 H ATOM 2071 N GLN A 182 -21.600 26.495 21.345 1.00 22.38 N ATOM 2072 CA GLN A 182 -22.590 26.562 22.408 1.00 22.35 C ATOM 2073 C GLN A 182 -23.793 27.376 21.933 1.00 22.28 C ATOM 2074 O GLN A 182 -24.938 26.999 22.168 1.00 18.07 O ATOM 2075 CB GLN A 182 -21.985 27.183 23.660 1.00 23.67 C ATOM 2076 CG GLN A 182 -22.964 27.376 24.793 1.00 24.03 C ATOM 2077 CD GLN A 182 -22.340 28.126 25.963 1.00 27.27 C ATOM 2078 OE1 GLN A 182 -21.649 29.126 25.774 1.00 27.22 O ATOM 2079 NE2 GLN A 182 -22.580 27.638 27.175 1.00 32.11 N ATOM 2080 HA GLN A 182 -22.918 25.553 22.656 1.00 0.00 H ATOM 2081 HB2 GLN A 182 -21.182 26.534 24.009 1.00 0.00 H ATOM 2082 HB3 GLN A 182 -21.574 28.157 23.394 1.00 0.00 H ATOM 2083 HG2 GLN A 182 -23.820 27.943 24.427 1.00 0.00 H ATOM 2084 HG3 GLN A 182 -23.299 26.398 25.140 1.00 0.00 H ATOM 2085 HE22 GLN A 182 -23.171 26.789 27.286 1.00 0.00 H ATOM 2086 HE21 GLN A 182 -22.177 28.105 28.013 1.00 0.00 H ATOM 2087 H GLN A 182 -20.661 26.921 21.479 1.00 0.00 H ATOM 2088 N LEU A 183 -23.527 28.489 21.258 1.00 19.67 N ATOM 2089 CA LEU A 183 -24.596 29.343 20.769 1.00 21.41 C ATOM 2090 C LEU A 183 -25.395 28.651 19.661 1.00 20.54 C ATOM 2091 O LEU A 183 -26.614 28.808 19.572 1.00 16.90 O ATOM 2092 CB LEU A 183 -24.049 30.694 20.297 1.00 21.04 C ATOM 2093 CG LEU A 183 -25.086 31.661 19.725 1.00 20.94 C ATOM 2094 CD1 LEU A 183 -26.216 31.918 20.733 1.00 23.93 C ATOM 2095 CD2 LEU A 183 -24.425 32.965 19.268 1.00 25.38 C ATOM 2096 HA LEU A 183 -25.277 29.531 21.599 1.00 0.00 H ATOM 2097 HB2 LEU A 183 -23.571 31.179 21.148 1.00 0.00 H ATOM 2098 HB3 LEU A 183 -23.305 30.504 19.524 1.00 0.00 H ATOM 2099 HG LEU A 183 -25.535 31.198 18.846 1.00 0.00 H ATOM 2100 HD21 LEU A 183 -23.934 33.439 20.118 1.00 0.00 H ATOM 2101 HD22 LEU A 183 -23.687 32.746 18.497 1.00 0.00 H ATOM 2102 HD23 LEU A 183 -25.185 33.635 18.866 1.00 0.00 H ATOM 2103 HD11 LEU A 183 -26.710 30.976 20.971 1.00 0.00 H ATOM 2104 HD12 LEU A 183 -25.799 32.351 21.642 1.00 0.00 H ATOM 2105 HD13 LEU A 183 -26.938 32.609 20.299 1.00 0.00 H ATOM 2106 H LEU A 183 -22.538 28.753 21.077 1.00 0.00 H ATOM 2107 N LEU A 184 -24.719 27.881 18.817 1.00 18.57 N ATOM 2108 CA LEU A 184 -25.431 27.111 17.810 1.00 19.50 C ATOM 2109 C LEU A 184 -26.406 26.136 18.470 1.00 20.54 C ATOM 2110 O LEU A 184 -27.522 25.954 17.978 1.00 19.70 O ATOM 2111 CB LEU A 184 -24.467 26.363 16.891 1.00 22.26 C ATOM 2112 CG LEU A 184 -23.591 27.236 15.991 1.00 24.16 C ATOM 2113 CD1 LEU A 184 -22.727 26.354 15.092 1.00 24.37 C ATOM 2114 CD2 LEU A 184 -24.434 28.197 15.164 1.00 25.87 C ATOM 2115 HA LEU A 184 -25.997 27.812 17.197 1.00 0.00 H ATOM 2116 HB2 LEU A 184 -23.808 25.761 17.516 1.00 0.00 H ATOM 2117 HB3 LEU A 184 -25.057 25.708 16.250 1.00 0.00 H ATOM 2118 HG LEU A 184 -22.938 27.838 16.623 1.00 0.00 H ATOM 2119 HD21 LEU A 184 -25.120 27.628 14.536 1.00 0.00 H ATOM 2120 HD22 LEU A 184 -25.003 28.845 15.831 1.00 0.00 H ATOM 2121 HD23 LEU A 184 -23.781 28.803 14.536 1.00 0.00 H ATOM 2122 HD11 LEU A 184 -22.090 25.721 15.710 1.00 0.00 H ATOM 2123 HD12 LEU A 184 -23.370 25.729 14.472 1.00 0.00 H ATOM 2124 HD13 LEU A 184 -22.107 26.984 14.455 1.00 0.00 H ATOM 2125 H LEU A 184 -23.682 27.829 18.876 1.00 0.00 H ATOM 2126 N GLN A 185 -26.003 25.520 19.582 1.00 19.41 N ATOM 2127 CA GLN A 185 -26.892 24.579 20.289 1.00 19.59 C ATOM 2128 C GLN A 185 -28.073 25.309 20.923 1.00 19.79 C ATOM 2129 O GLN A 185 -29.191 24.784 20.983 1.00 17.88 O ATOM 2130 CB GLN A 185 -26.147 23.792 21.374 1.00 22.29 C ATOM 2131 CG GLN A 185 -25.159 22.751 20.871 1.00 24.59 C ATOM 2132 CD GLN A 185 -25.807 21.430 20.467 1.00 30.12 C ATOM 2133 OE1 GLN A 185 -27.026 21.338 20.280 1.00 24.70 O ATOM 2134 NE2 GLN A 185 -24.983 20.394 20.339 1.00 32.86 N ATOM 2135 HA GLN A 185 -27.258 23.877 19.540 1.00 0.00 H ATOM 2136 HB2 GLN A 185 -25.598 24.505 21.989 1.00 0.00 H ATOM 2137 HB3 GLN A 185 -26.889 23.281 21.987 1.00 0.00 H ATOM 2138 HG2 GLN A 185 -24.641 23.160 20.003 1.00 0.00 H ATOM 2139 HG3 GLN A 185 -24.437 22.552 21.663 1.00 0.00 H ATOM 2140 HE22 GLN A 185 -23.964 20.516 20.506 1.00 0.00 H ATOM 2141 HE21 GLN A 185 -25.358 19.461 20.072 1.00 0.00 H ATOM 2142 H GLN A 185 -25.050 25.705 19.955 1.00 0.00 H ATOM 2143 N VAL A 186 -27.825 26.524 21.399 1.00 16.57 N ATOM 2144 CA VAL A 186 -28.914 27.375 21.855 1.00 16.50 C ATOM 2145 C VAL A 186 -29.904 27.626 20.722 1.00 16.52 C ATOM 2146 O VAL A 186 -31.118 27.569 20.937 1.00 15.38 O ATOM 2147 CB VAL A 186 -28.424 28.724 22.382 1.00 17.62 C ATOM 2148 CG1 VAL A 186 -29.602 29.695 22.482 1.00 17.19 C ATOM 2149 CG2 VAL A 186 -27.743 28.540 23.724 1.00 18.25 C ATOM 2150 HA VAL A 186 -29.397 26.843 22.674 1.00 0.00 H ATOM 2151 HB VAL A 186 -27.693 29.145 21.691 1.00 0.00 H ATOM 2152 HG11 VAL A 186 -30.045 29.830 21.495 1.00 0.00 H ATOM 2153 HG12 VAL A 186 -30.349 29.289 23.164 1.00 0.00 H ATOM 2154 HG13 VAL A 186 -29.249 30.655 22.858 1.00 0.00 H ATOM 2155 HG21 VAL A 186 -28.451 28.113 24.434 1.00 0.00 H ATOM 2156 HG22 VAL A 186 -26.892 27.869 23.609 1.00 0.00 H ATOM 2157 HG23 VAL A 186 -27.398 29.507 24.090 1.00 0.00 H ATOM 2158 H VAL A 186 -26.845 26.870 21.446 1.00 0.00 H ATOM 2159 N ARG A 187 -29.402 27.900 19.514 1.00 16.91 N ATOM 2160 CA ARG A 187 -30.306 28.132 18.382 1.00 17.66 C ATOM 2161 C ARG A 187 -31.146 26.892 18.123 1.00 14.52 C ATOM 2162 O ARG A 187 -32.338 26.987 17.837 1.00 14.60 O ATOM 2163 CB ARG A 187 -29.550 28.524 17.108 1.00 15.54 C ATOM 2164 CG ARG A 187 -28.823 29.863 17.207 1.00 17.62 C ATOM 2165 CD ARG A 187 -28.425 30.386 15.816 1.00 18.52 C ATOM 2166 NE ARG A 187 -29.590 30.865 15.071 1.00 22.54 N ATOM 2167 CZ ARG A 187 -29.623 31.052 13.753 1.00 22.02 C ATOM 2168 NH1 ARG A 187 -28.555 30.788 13.015 1.00 23.85 N ATOM 2169 NH2 ARG A 187 -30.732 31.490 13.173 1.00 24.08 N ATOM 2170 HA ARG A 187 -30.953 28.967 18.650 1.00 0.00 H ATOM 2171 HB2 ARG A 187 -28.814 27.749 16.893 1.00 0.00 H ATOM 2172 HB3 ARG A 187 -30.266 28.582 16.288 1.00 0.00 H ATOM 2173 HG2 ARG A 187 -29.480 30.590 17.686 1.00 0.00 H ATOM 2174 HG3 ARG A 187 -27.924 29.736 17.810 1.00 0.00 H ATOM 2175 HD2 ARG A 187 -27.953 29.579 15.255 1.00 0.00 H ATOM 2176 HD3 ARG A 187 -27.718 31.207 15.935 1.00 0.00 H ATOM 2177 HE ARG A 187 -30.455 31.074 15.610 1.00 0.00 H ATOM 2178 HH12 ARG A 187 -28.585 30.935 11.986 1.00 0.00 H ATOM 2179 HH11 ARG A 187 -27.687 30.433 13.465 1.00 0.00 H ATOM 2180 HH22 ARG A 187 -30.758 31.636 12.144 1.00 0.00 H ATOM 2181 HH21 ARG A 187 -31.576 31.688 13.747 1.00 0.00 H ATOM 2182 H ARG A 187 -28.372 27.949 19.377 1.00 0.00 H ATOM 2183 N ILE A 188 -30.519 25.726 18.225 1.00 17.08 N ATOM 2184 CA ILE A 188 -31.249 24.463 18.047 1.00 19.70 C ATOM 2185 C ILE A 188 -32.380 24.325 19.068 1.00 15.55 C ATOM 2186 O ILE A 188 -33.510 23.921 18.727 1.00 17.39 O ATOM 2187 CB ILE A 188 -30.292 23.246 18.104 1.00 18.30 C ATOM 2188 CG1 ILE A 188 -29.255 23.345 16.984 1.00 19.25 C ATOM 2189 CG2 ILE A 188 -31.073 21.935 18.012 1.00 19.73 C ATOM 2190 CD1 ILE A 188 -28.199 22.218 16.998 1.00 20.64 C ATOM 2191 HA ILE A 188 -31.700 24.483 17.055 1.00 0.00 H ATOM 2192 HB ILE A 188 -29.772 23.254 19.062 1.00 0.00 H ATOM 2193 HG12 ILE A 188 -29.779 23.311 16.029 1.00 0.00 H ATOM 2194 HG13 ILE A 188 -28.738 24.300 17.080 1.00 0.00 H ATOM 2195 HD11 ILE A 188 -27.655 22.244 17.942 1.00 0.00 H ATOM 2196 HD12 ILE A 188 -28.697 21.254 16.890 1.00 0.00 H ATOM 2197 HD13 ILE A 188 -27.503 22.364 16.172 1.00 0.00 H ATOM 2198 HG21 ILE A 188 -31.773 21.871 18.845 1.00 0.00 H ATOM 2199 HG22 ILE A 188 -31.623 21.906 17.071 1.00 0.00 H ATOM 2200 HG23 ILE A 188 -30.378 21.096 18.054 1.00 0.00 H ATOM 2201 H ILE A 188 -29.500 25.706 18.433 1.00 0.00 H ATOM 2202 N ASP A 189 -32.094 24.677 20.317 1.00 17.58 N ATOM 2203 CA ASP A 189 -33.107 24.614 21.371 1.00 18.71 C ATOM 2204 C ASP A 189 -34.221 25.616 21.130 1.00 17.46 C ATOM 2205 O ASP A 189 -35.388 25.299 21.315 1.00 13.65 O ATOM 2206 CB ASP A 189 -32.498 24.886 22.745 1.00 18.04 C ATOM 2207 CG ASP A 189 -31.504 23.827 23.170 1.00 25.03 C ATOM 2208 OD1 ASP A 189 -31.551 22.702 22.621 1.00 26.41 O ATOM 2209 OD2 ASP A 189 -30.683 24.130 24.068 1.00 29.37 O ATOM 2210 HA ASP A 189 -33.516 23.604 21.348 1.00 0.00 H ATOM 2211 HB2 ASP A 189 -31.989 25.849 22.715 1.00 0.00 H ATOM 2212 HB3 ASP A 189 -33.302 24.924 23.480 1.00 0.00 H ATOM 2213 H ASP A 189 -31.134 25.003 20.549 1.00 0.00 H ATOM 2214 N VAL A 190 -33.858 26.837 20.730 1.00 14.03 N ATOM 2215 CA VAL A 190 -34.860 27.873 20.502 1.00 13.53 C ATOM 2216 C VAL A 190 -35.739 27.472 19.325 1.00 14.25 C ATOM 2217 O VAL A 190 -36.972 27.609 19.370 1.00 12.43 O ATOM 2218 CB VAL A 190 -34.214 29.258 20.264 1.00 14.24 C ATOM 2219 CG1 VAL A 190 -35.243 30.250 19.726 1.00 13.69 C ATOM 2220 CG2 VAL A 190 -33.614 29.787 21.573 1.00 11.77 C ATOM 2221 HA VAL A 190 -35.473 27.964 21.399 1.00 0.00 H ATOM 2222 HB VAL A 190 -33.422 29.146 19.523 1.00 0.00 H ATOM 2223 HG11 VAL A 190 -35.643 29.881 18.782 1.00 0.00 H ATOM 2224 HG12 VAL A 190 -36.053 30.358 20.447 1.00 0.00 H ATOM 2225 HG13 VAL A 190 -34.765 31.217 19.567 1.00 0.00 H ATOM 2226 HG21 VAL A 190 -34.402 29.881 22.320 1.00 0.00 H ATOM 2227 HG22 VAL A 190 -32.854 29.092 21.930 1.00 0.00 H ATOM 2228 HG23 VAL A 190 -33.161 30.763 21.396 1.00 0.00 H ATOM 2229 H VAL A 190 -32.852 27.052 20.580 1.00 0.00 H ATOM 2230 N ARG A 191 -35.124 26.951 18.272 1.00 14.01 N ATOM 2231 CA ARG A 191 -35.940 26.493 17.137 1.00 16.35 C ATOM 2232 C ARG A 191 -36.828 25.314 17.504 1.00 14.46 C ATOM 2233 O ARG A 191 -37.936 25.187 16.986 1.00 14.28 O ATOM 2234 CB ARG A 191 -35.098 26.202 15.898 1.00 15.72 C ATOM 2235 CG ARG A 191 -34.548 27.501 15.309 1.00 17.67 C ATOM 2236 CD ARG A 191 -34.008 27.333 13.931 1.00 15.27 C ATOM 2237 NE ARG A 191 -33.843 28.649 13.318 1.00 18.17 N ATOM 2238 CZ ARG A 191 -33.667 28.850 12.023 1.00 19.63 C ATOM 2239 NH1 ARG A 191 -33.625 27.815 11.192 1.00 16.22 N ATOM 2240 NH2 ARG A 191 -33.538 30.088 11.565 1.00 16.36 N ATOM 2241 HA ARG A 191 -36.601 27.321 16.883 1.00 0.00 H ATOM 2242 HB2 ARG A 191 -34.267 25.552 16.173 1.00 0.00 H ATOM 2243 HB3 ARG A 191 -35.717 25.703 15.152 1.00 0.00 H ATOM 2244 HG2 ARG A 191 -35.351 28.237 15.280 1.00 0.00 H ATOM 2245 HG3 ARG A 191 -33.748 27.864 15.954 1.00 0.00 H ATOM 2246 HD2 ARG A 191 -34.701 26.738 13.337 1.00 0.00 H ATOM 2247 HD3 ARG A 191 -33.043 26.827 13.976 1.00 0.00 H ATOM 2248 HE ARG A 191 -33.865 29.482 13.941 1.00 0.00 H ATOM 2249 HH12 ARG A 191 -33.487 27.971 10.173 1.00 0.00 H ATOM 2250 HH11 ARG A 191 -33.730 26.848 11.560 1.00 0.00 H ATOM 2251 HH22 ARG A 191 -33.399 30.254 10.548 1.00 0.00 H ATOM 2252 HH21 ARG A 191 -33.576 30.892 12.223 1.00 0.00 H ATOM 2253 H ARG A 191 -34.088 26.868 18.249 1.00 0.00 H ATOM 2254 N GLY A 192 -36.365 24.467 18.414 1.00 15.21 N ATOM 2255 CA GLY A 192 -37.238 23.426 18.946 1.00 15.09 C ATOM 2256 C GLY A 192 -38.477 24.034 19.586 1.00 13.74 C ATOM 2257 O GLY A 192 -39.592 23.541 19.412 1.00 14.87 O ATOM 2258 HA3 GLY A 192 -36.694 22.851 19.696 1.00 0.00 H ATOM 2259 HA2 GLY A 192 -37.542 22.765 18.134 1.00 0.00 H ATOM 2260 H GLY A 192 -35.383 24.545 18.747 1.00 0.00 H ATOM 2261 N TYR A 193 -38.274 25.116 20.331 1.00 13.42 N ATOM 2262 CA TYR A 193 -39.353 25.844 20.968 1.00 11.43 C ATOM 2263 C TYR A 193 -40.278 26.538 19.968 1.00 14.04 C ATOM 2264 O TYR A 193 -41.502 26.542 20.146 1.00 12.88 O ATOM 2265 CB TYR A 193 -38.802 26.822 22.017 1.00 14.21 C ATOM 2266 CG TYR A 193 -39.792 27.854 22.491 1.00 13.03 C ATOM 2267 CD1 TYR A 193 -40.962 27.482 23.135 1.00 13.38 C ATOM 2268 CD2 TYR A 193 -39.548 29.207 22.301 1.00 14.70 C ATOM 2269 CE1 TYR A 193 -41.872 28.443 23.561 1.00 14.58 C ATOM 2270 CE2 TYR A 193 -40.437 30.171 22.733 1.00 16.33 C ATOM 2271 CZ TYR A 193 -41.604 29.783 23.360 1.00 18.27 C ATOM 2272 OH TYR A 193 -42.502 30.739 23.793 1.00 21.21 O ATOM 2273 HA TYR A 193 -39.975 25.110 21.481 1.00 0.00 H ATOM 2274 HB3 TYR A 193 -37.949 27.343 21.582 1.00 0.00 H ATOM 2275 HB2 TYR A 193 -38.472 26.245 22.881 1.00 0.00 H ATOM 2276 HD2 TYR A 193 -38.632 29.516 21.798 1.00 0.00 H ATOM 2277 HE2 TYR A 193 -40.219 31.228 22.580 1.00 0.00 H ATOM 2278 HE1 TYR A 193 -42.796 28.139 24.053 1.00 0.00 H ATOM 2279 HD1 TYR A 193 -41.170 26.426 23.309 1.00 0.00 H ATOM 2280 HH TYR A 193 -43.278 30.293 24.217 1.00 0.00 H ATOM 2281 H TYR A 193 -37.299 25.454 20.462 1.00 0.00 H ATOM 2282 N ILE A 194 -39.708 27.103 18.910 1.00 11.59 N ATOM 2283 CA ILE A 194 -40.527 27.739 17.882 1.00 13.40 C ATOM 2284 C ILE A 194 -41.464 26.725 17.218 1.00 16.04 C ATOM 2285 O ILE A 194 -42.612 27.045 16.884 1.00 15.00 O ATOM 2286 CB ILE A 194 -39.656 28.440 16.814 1.00 14.36 C ATOM 2287 CG1 ILE A 194 -38.917 29.632 17.441 1.00 13.25 C ATOM 2288 CG2 ILE A 194 -40.523 28.904 15.657 1.00 16.71 C ATOM 2289 CD1 ILE A 194 -37.888 30.294 16.530 1.00 16.70 C ATOM 2290 HA ILE A 194 -41.132 28.499 18.377 1.00 0.00 H ATOM 2291 HB ILE A 194 -38.920 27.732 16.434 1.00 0.00 H ATOM 2292 HG12 ILE A 194 -39.657 30.382 17.720 1.00 0.00 H ATOM 2293 HG13 ILE A 194 -38.403 29.281 18.336 1.00 0.00 H ATOM 2294 HD11 ILE A 194 -37.129 29.563 16.250 1.00 0.00 H ATOM 2295 HD12 ILE A 194 -38.384 30.666 15.634 1.00 0.00 H ATOM 2296 HD13 ILE A 194 -37.418 31.124 17.058 1.00 0.00 H ATOM 2297 HG21 ILE A 194 -41.018 28.043 15.207 1.00 0.00 H ATOM 2298 HG22 ILE A 194 -41.273 29.605 16.025 1.00 0.00 H ATOM 2299 HG23 ILE A 194 -39.899 29.396 14.911 1.00 0.00 H ATOM 2300 H ILE A 194 -38.673 27.092 18.813 1.00 0.00 H ATOM 2301 N ALA A 195 -40.970 25.504 17.027 1.00 14.74 N ATOM 2302 CA ALA A 195 -41.774 24.446 16.399 1.00 16.77 C ATOM 2303 C ALA A 195 -42.835 23.908 17.366 1.00 18.82 C ATOM 2304 O ALA A 195 -43.969 23.607 16.971 1.00 18.79 O ATOM 2305 CB ALA A 195 -40.883 23.321 15.895 1.00 16.03 C ATOM 2306 HA ALA A 195 -42.292 24.882 15.545 1.00 0.00 H ATOM 2307 HB1 ALA A 195 -40.183 23.716 15.159 1.00 0.00 H ATOM 2308 HB2 ALA A 195 -40.330 22.894 16.732 1.00 0.00 H ATOM 2309 HB3 ALA A 195 -41.500 22.549 15.434 1.00 0.00 H ATOM 2310 H ALA A 195 -39.997 25.295 17.328 1.00 0.00 H ATOM 2311 N GLU A 196 -42.473 23.821 18.639 1.00 17.18 N ATOM 2312 CA GLU A 196 -43.377 23.276 19.662 1.00 16.63 C ATOM 2313 C GLU A 196 -43.344 24.202 20.880 1.00 17.16 C ATOM 2314 O GLU A 196 -42.409 24.137 21.672 1.00 16.30 O ATOM 2315 CB GLU A 196 -42.948 21.867 20.050 1.00 20.12 C ATOM 2316 CG GLU A 196 -43.964 21.118 20.891 1.00 24.84 C ATOM 2317 CD GLU A 196 -43.658 19.631 21.011 1.00 37.71 C ATOM 2318 OE1 GLU A 196 -43.285 19.009 19.989 1.00 36.83 O ATOM 2319 OE2 GLU A 196 -43.804 19.085 22.129 1.00 39.56 O ATOM 2320 HA GLU A 196 -44.392 23.220 19.270 1.00 0.00 H ATOM 2321 HB2 GLU A 196 -42.774 21.298 19.136 1.00 0.00 H ATOM 2322 HB3 GLU A 196 -42.019 21.936 20.616 1.00 0.00 H ATOM 2323 HG2 GLU A 196 -43.975 21.552 21.891 1.00 0.00 H ATOM 2324 HG3 GLU A 196 -44.947 21.235 20.434 1.00 0.00 H ATOM 2325 H GLU A 196 -41.526 24.146 18.920 1.00 0.00 H ATOM 2326 N ASN A 197 -44.363 25.053 21.011 1.00 15.75 N ATOM 2327 CA ASN A 197 -44.351 26.164 21.971 1.00 15.26 C ATOM 2328 C ASN A 197 -44.650 25.798 23.426 1.00 16.74 C ATOM 2329 O ASN A 197 -45.383 26.522 24.106 1.00 19.03 O ATOM 2330 CB ASN A 197 -45.362 27.238 21.577 1.00 16.57 C ATOM 2331 CG ASN A 197 -45.098 27.834 20.207 1.00 18.34 C ATOM 2332 OD1 ASN A 197 -43.972 27.812 19.688 1.00 17.90 O ATOM 2333 ND2 ASN A 197 -46.131 28.384 19.623 1.00 14.44 N ATOM 2334 HA ASN A 197 -43.319 26.512 21.924 1.00 0.00 H ATOM 2335 HB2 ASN A 197 -46.357 26.793 21.576 1.00 0.00 H ATOM 2336 HB3 ASN A 197 -45.324 28.038 22.316 1.00 0.00 H ATOM 2337 HD22 ASN A 197 -47.058 28.380 20.094 1.00 0.00 H ATOM 2338 HD21 ASN A 197 -46.025 28.825 18.687 1.00 0.00 H ATOM 2339 H ASN A 197 -45.201 24.924 20.408 1.00 0.00 H ATOM 2340 N SER A 198 -44.089 24.704 23.916 1.00 16.53 N ATOM 2341 CA SER A 198 -44.405 24.261 25.270 1.00 18.09 C ATOM 2342 C SER A 198 -43.669 25.098 26.320 1.00 15.82 C ATOM 2343 O SER A 198 -42.618 25.693 26.037 1.00 14.52 O ATOM 2344 CB SER A 198 -44.058 22.783 25.440 1.00 16.54 C ATOM 2345 OG SER A 198 -42.652 22.580 25.303 1.00 13.75 O ATOM 2346 HA SER A 198 -45.476 24.397 25.422 1.00 0.00 H ATOM 2347 HB2 SER A 198 -44.580 22.202 24.680 1.00 0.00 H ATOM 2348 HB3 SER A 198 -44.374 22.452 26.429 1.00 0.00 H ATOM 2349 HG SER A 198 -42.446 21.618 25.416 1.00 0.00 H ATOM 2350 H SER A 198 -43.421 24.159 23.334 1.00 0.00 H ATOM 2351 N SER A 199 -44.191 25.141 27.540 1.00 16.49 N ATOM 2352 CA SER A 199 -43.457 25.860 28.579 1.00 18.78 C ATOM 2353 C SER A 199 -42.132 25.133 28.846 1.00 17.38 C ATOM 2354 O SER A 199 -41.111 25.764 29.163 1.00 16.18 O ATOM 2355 CB SER A 199 -44.293 26.040 29.851 1.00 22.25 C ATOM 2356 OG SER A 199 -44.359 24.830 30.577 1.00 27.53 O ATOM 2357 HA SER A 199 -43.238 26.869 28.231 1.00 0.00 H ATOM 2358 HB2 SER A 199 -45.302 26.349 29.577 1.00 0.00 H ATOM 2359 HB3 SER A 199 -43.836 26.808 30.475 1.00 0.00 H ATOM 2360 HG SER A 199 -44.902 24.966 31.394 1.00 0.00 H ATOM 2361 H SER A 199 -45.097 24.676 27.750 1.00 0.00 H ATOM 2362 N ALA A 200 -42.128 23.813 28.667 1.00 16.57 N ATOM 2363 CA ALA A 200 -40.907 23.031 28.839 1.00 17.28 C ATOM 2364 C ALA A 200 -39.818 23.468 27.850 1.00 16.32 C ATOM 2365 O ALA A 200 -38.668 23.682 28.234 1.00 14.71 O ATOM 2366 CB ALA A 200 -41.188 21.547 28.687 1.00 21.46 C ATOM 2367 HA ALA A 200 -40.542 23.215 29.849 1.00 0.00 H ATOM 2368 HB1 ALA A 200 -41.912 21.237 29.440 1.00 0.00 H ATOM 2369 HB2 ALA A 200 -41.591 21.355 27.693 1.00 0.00 H ATOM 2370 HB3 ALA A 200 -40.262 20.988 28.820 1.00 0.00 H ATOM 2371 H ALA A 200 -43.010 23.331 28.400 1.00 0.00 H ATOM 2372 N ASN A 201 -40.173 23.555 26.573 1.00 18.24 N ATOM 2373 CA ASN A 201 -39.233 24.005 25.546 1.00 16.92 C ATOM 2374 C ASN A 201 -38.814 25.468 25.754 1.00 16.49 C ATOM 2375 O ASN A 201 -37.646 25.827 25.609 1.00 14.36 O ATOM 2376 CB ASN A 201 -39.840 23.819 24.153 1.00 16.27 C ATOM 2377 CG ASN A 201 -39.780 22.383 23.676 1.00 19.27 C ATOM 2378 OD1 ASN A 201 -39.054 21.557 24.235 1.00 19.64 O ATOM 2379 ND2 ASN A 201 -40.542 22.073 22.630 1.00 16.49 N ATOM 2380 HA ASN A 201 -38.336 23.392 25.631 1.00 0.00 H ATOM 2381 HB2 ASN A 201 -40.883 24.134 24.182 1.00 0.00 H ATOM 2382 HB3 ASN A 201 -39.293 24.444 23.448 1.00 0.00 H ATOM 2383 HD22 ASN A 201 -41.140 22.800 22.188 1.00 0.00 H ATOM 2384 HD21 ASN A 201 -40.540 21.103 22.254 1.00 0.00 H ATOM 2385 H ASN A 201 -41.142 23.297 26.297 1.00 0.00 H ATOM 2386 N GLU A 202 -39.777 26.309 26.094 1.00 13.19 N ATOM 2387 CA GLU A 202 -39.488 27.700 26.434 1.00 13.54 C ATOM 2388 C GLU A 202 -38.441 27.806 27.543 1.00 17.18 C ATOM 2389 O GLU A 202 -37.421 28.493 27.408 1.00 16.04 O ATOM 2390 CB GLU A 202 -40.774 28.385 26.883 1.00 14.54 C ATOM 2391 CG GLU A 202 -40.584 29.805 27.322 1.00 16.71 C ATOM 2392 CD GLU A 202 -41.781 30.319 28.083 1.00 18.48 C ATOM 2393 OE1 GLU A 202 -42.913 29.914 27.743 1.00 23.45 O ATOM 2394 OE2 GLU A 202 -41.595 31.117 29.011 1.00 19.38 O ATOM 2395 HA GLU A 202 -39.086 28.189 25.547 1.00 0.00 H ATOM 2396 HB2 GLU A 202 -41.478 28.374 26.051 1.00 0.00 H ATOM 2397 HB3 GLU A 202 -41.191 27.820 27.717 1.00 0.00 H ATOM 2398 HG2 GLU A 202 -39.705 29.862 27.965 1.00 0.00 H ATOM 2399 HG3 GLU A 202 -40.430 30.429 26.442 1.00 0.00 H ATOM 2400 H GLU A 202 -40.761 25.973 26.120 1.00 0.00 H ATOM 2401 N GLN A 203 -38.694 27.126 28.654 1.00 14.88 N ATOM 2402 CA GLN A 203 -37.828 27.269 29.824 1.00 15.52 C ATOM 2403 C GLN A 203 -36.446 26.674 29.612 1.00 12.83 C ATOM 2404 O GLN A 203 -35.455 27.248 30.058 1.00 15.74 O ATOM 2405 CB GLN A 203 -38.524 26.702 31.059 1.00 16.69 C ATOM 2406 CG GLN A 203 -39.752 27.545 31.419 1.00 17.70 C ATOM 2407 CD GLN A 203 -40.632 26.940 32.491 1.00 22.81 C ATOM 2408 OE1 GLN A 203 -40.272 25.952 33.137 1.00 23.13 O ATOM 2409 NE2 GLN A 203 -41.811 27.532 32.677 1.00 22.00 N ATOM 2410 HA GLN A 203 -37.657 28.333 29.985 1.00 0.00 H ATOM 2411 HB2 GLN A 203 -38.839 25.678 30.855 1.00 0.00 H ATOM 2412 HB3 GLN A 203 -37.827 26.707 31.897 1.00 0.00 H ATOM 2413 HG2 GLN A 203 -39.407 28.518 31.769 1.00 0.00 H ATOM 2414 HG3 GLN A 203 -40.352 27.676 30.519 1.00 0.00 H ATOM 2415 HE22 GLN A 203 -42.071 28.363 32.108 1.00 0.00 H ATOM 2416 HE21 GLN A 203 -42.471 27.163 33.391 1.00 0.00 H ATOM 2417 H GLN A 203 -39.514 26.487 28.693 1.00 0.00 H ATOM 2418 N ALA A 204 -36.377 25.544 28.910 1.00 13.00 N ATOM 2419 CA ALA A 204 -35.088 24.937 28.567 1.00 17.41 C ATOM 2420 C ALA A 204 -34.250 25.881 27.703 1.00 17.46 C ATOM 2421 O ALA A 204 -33.061 26.096 27.966 1.00 17.70 O ATOM 2422 CB ALA A 204 -35.295 23.605 27.850 1.00 18.81 C ATOM 2423 HA ALA A 204 -34.546 24.753 29.495 1.00 0.00 H ATOM 2424 HB1 ALA A 204 -35.844 22.925 28.501 1.00 0.00 H ATOM 2425 HB2 ALA A 204 -35.863 23.771 26.934 1.00 0.00 H ATOM 2426 HB3 ALA A 204 -34.326 23.171 27.604 1.00 0.00 H ATOM 2427 H ALA A 204 -37.256 25.083 28.599 1.00 0.00 H ATOM 2428 N ALA A 205 -34.873 26.443 26.675 1.00 16.21 N ATOM 2429 CA ALA A 205 -34.188 27.391 25.793 1.00 15.88 C ATOM 2430 C ALA A 205 -33.676 28.598 26.584 1.00 17.71 C ATOM 2431 O ALA A 205 -32.506 28.997 26.463 1.00 18.06 O ATOM 2432 CB ALA A 205 -35.126 27.843 24.692 1.00 17.66 C ATOM 2433 HA ALA A 205 -33.330 26.890 25.346 1.00 0.00 H ATOM 2434 HB1 ALA A 205 -35.446 26.978 24.111 1.00 0.00 H ATOM 2435 HB2 ALA A 205 -35.997 28.328 25.134 1.00 0.00 H ATOM 2436 HB3 ALA A 205 -34.608 28.548 24.041 1.00 0.00 H ATOM 2437 H ALA A 205 -35.869 26.205 26.492 1.00 0.00 H ATOM 2438 N LEU A 206 -34.548 29.168 27.408 1.00 14.42 N ATOM 2439 CA LEU A 206 -34.186 30.328 28.210 1.00 15.25 C ATOM 2440 C LEU A 206 -33.032 30.073 29.177 1.00 17.07 C ATOM 2441 O LEU A 206 -32.135 30.902 29.277 1.00 16.59 O ATOM 2442 CB LEU A 206 -35.411 30.893 28.932 1.00 14.76 C ATOM 2443 CG LEU A 206 -36.418 31.501 27.964 1.00 17.91 C ATOM 2444 CD1 LEU A 206 -37.659 31.996 28.692 1.00 24.08 C ATOM 2445 CD2 LEU A 206 -35.763 32.641 27.173 1.00 20.28 C ATOM 2446 HA LEU A 206 -33.816 31.078 27.511 1.00 0.00 H ATOM 2447 HB2 LEU A 206 -35.896 30.088 29.484 1.00 0.00 H ATOM 2448 HB3 LEU A 206 -35.084 31.664 29.629 1.00 0.00 H ATOM 2449 HG LEU A 206 -36.734 30.723 27.269 1.00 0.00 H ATOM 2450 HD21 LEU A 206 -35.419 33.411 27.864 1.00 0.00 H ATOM 2451 HD22 LEU A 206 -34.915 32.251 26.611 1.00 0.00 H ATOM 2452 HD23 LEU A 206 -36.491 33.069 26.484 1.00 0.00 H ATOM 2453 HD11 LEU A 206 -38.134 31.161 29.207 1.00 0.00 H ATOM 2454 HD12 LEU A 206 -37.373 32.757 29.418 1.00 0.00 H ATOM 2455 HD13 LEU A 206 -38.356 32.423 27.971 1.00 0.00 H ATOM 2456 H LEU A 206 -35.509 28.778 27.482 1.00 0.00 H ATOM 2457 N ARG A 207 -33.049 28.937 29.888 1.00 15.71 N ATOM 2458 CA ARG A 207 -31.937 28.566 30.764 1.00 17.85 C ATOM 2459 C ARG A 207 -30.634 28.388 29.976 1.00 18.95 C ATOM 2460 O ARG A 207 -29.565 28.829 30.418 1.00 17.76 O ATOM 2461 CB ARG A 207 -32.235 27.280 31.561 1.00 19.91 C ATOM 2462 CG ARG A 207 -33.135 27.458 32.798 1.00 22.07 C ATOM 2463 CD ARG A 207 -33.227 26.177 33.659 1.00 20.32 C ATOM 2464 NE ARG A 207 -33.642 25.023 32.869 1.00 22.89 N ATOM 2465 CZ ARG A 207 -34.900 24.583 32.782 1.00 20.04 C ATOM 2466 NH1 ARG A 207 -35.865 25.182 33.465 1.00 23.45 N ATOM 2467 NH2 ARG A 207 -35.183 23.531 32.020 1.00 18.02 N ATOM 2468 HA ARG A 207 -31.815 29.389 31.468 1.00 0.00 H ATOM 2469 HB2 ARG A 207 -32.723 26.574 30.889 1.00 0.00 H ATOM 2470 HB3 ARG A 207 -31.284 26.864 31.895 1.00 0.00 H ATOM 2471 HG2 ARG A 207 -32.730 28.262 33.412 1.00 0.00 H ATOM 2472 HG3 ARG A 207 -34.137 27.727 32.464 1.00 0.00 H ATOM 2473 HD2 ARG A 207 -33.952 26.339 34.456 1.00 0.00 H ATOM 2474 HD3 ARG A 207 -32.249 25.973 34.095 1.00 0.00 H ATOM 2475 HE ARG A 207 -32.910 24.509 32.339 1.00 0.00 H ATOM 2476 HH12 ARG A 207 -36.843 24.836 33.395 1.00 0.00 H ATOM 2477 HH11 ARG A 207 -35.644 25.998 34.071 1.00 0.00 H ATOM 2478 HH22 ARG A 207 -36.162 23.187 31.951 1.00 0.00 H ATOM 2479 HH21 ARG A 207 -34.425 23.052 31.493 1.00 0.00 H ATOM 2480 H ARG A 207 -33.871 28.305 29.815 1.00 0.00 H ATOM 2481 N GLN A 208 -30.707 27.734 28.817 1.00 16.22 N ATOM 2482 CA GLN A 208 -29.486 27.441 28.069 1.00 18.10 C ATOM 2483 C GLN A 208 -28.916 28.713 27.471 1.00 16.40 C ATOM 2484 O GLN A 208 -27.703 28.857 27.330 1.00 17.56 O ATOM 2485 CB GLN A 208 -29.718 26.373 26.993 1.00 18.13 C ATOM 2486 CG GLN A 208 -30.054 24.995 27.587 1.00 21.11 C ATOM 2487 CD GLN A 208 -28.986 24.515 28.568 1.00 26.33 C ATOM 2488 OE1 GLN A 208 -29.039 24.809 29.769 1.00 28.19 O ATOM 2489 NE2 GLN A 208 -28.008 23.780 28.058 1.00 29.28 N ATOM 2490 HA GLN A 208 -28.756 27.031 28.767 1.00 0.00 H ATOM 2491 HB2 GLN A 208 -30.545 26.691 26.359 1.00 0.00 H ATOM 2492 HB3 GLN A 208 -28.814 26.282 26.391 1.00 0.00 H ATOM 2493 HG2 GLN A 208 -31.008 25.061 28.110 1.00 0.00 H ATOM 2494 HG3 GLN A 208 -30.136 24.273 26.775 1.00 0.00 H ATOM 2495 HE22 GLN A 208 -28.001 23.556 27.042 1.00 0.00 H ATOM 2496 HE21 GLN A 208 -27.247 23.428 28.673 1.00 0.00 H ATOM 2497 H GLN A 208 -31.631 27.433 28.446 1.00 0.00 H ATOM 2498 N LEU A 209 -29.803 29.641 27.135 1.00 16.66 N ATOM 2499 CA LEU A 209 -29.395 30.960 26.661 1.00 17.36 C ATOM 2500 C LEU A 209 -28.712 31.767 27.764 1.00 20.45 C ATOM 2501 O LEU A 209 -27.696 32.426 27.522 1.00 19.58 O ATOM 2502 CB LEU A 209 -30.606 31.715 26.132 1.00 13.64 C ATOM 2503 CG LEU A 209 -30.394 33.079 25.474 1.00 18.10 C ATOM 2504 CD1 LEU A 209 -29.205 33.040 24.543 1.00 20.31 C ATOM 2505 CD2 LEU A 209 -31.652 33.472 24.715 1.00 20.30 C ATOM 2506 HA LEU A 209 -28.672 30.821 25.857 1.00 0.00 H ATOM 2507 HB2 LEU A 209 -31.086 31.074 25.393 1.00 0.00 H ATOM 2508 HB3 LEU A 209 -31.282 31.867 26.973 1.00 0.00 H ATOM 2509 HG LEU A 209 -30.193 33.822 26.246 1.00 0.00 H ATOM 2510 HD21 LEU A 209 -31.861 32.725 23.949 1.00 0.00 H ATOM 2511 HD22 LEU A 209 -32.491 33.527 25.409 1.00 0.00 H ATOM 2512 HD23 LEU A 209 -31.503 34.444 24.245 1.00 0.00 H ATOM 2513 HD11 LEU A 209 -28.311 32.777 25.108 1.00 0.00 H ATOM 2514 HD12 LEU A 209 -29.378 32.295 23.766 1.00 0.00 H ATOM 2515 HD13 LEU A 209 -29.071 34.020 24.085 1.00 0.00 H ATOM 2516 H LEU A 209 -30.817 29.423 27.211 1.00 0.00 H ATOM 2517 N ASP A 210 -29.267 31.727 28.972 1.00 18.16 N ATOM 2518 CA ASP A 210 -28.613 32.398 30.094 1.00 22.16 C ATOM 2519 C ASP A 210 -27.256 31.772 30.403 1.00 21.38 C ATOM 2520 O ASP A 210 -26.312 32.480 30.738 1.00 22.12 O ATOM 2521 CB ASP A 210 -29.495 32.419 31.349 1.00 21.58 C ATOM 2522 CG ASP A 210 -30.556 33.512 31.299 1.00 25.62 C ATOM 2523 OD1 ASP A 210 -30.557 34.310 30.333 1.00 21.42 O ATOM 2524 OD2 ASP A 210 -31.391 33.573 32.227 1.00 28.47 O ATOM 2525 HA ASP A 210 -28.452 33.432 29.788 1.00 0.00 H ATOM 2526 HB2 ASP A 210 -29.992 31.453 31.444 1.00 0.00 H ATOM 2527 HB3 ASP A 210 -28.861 32.587 32.219 1.00 0.00 H ATOM 2528 H ASP A 210 -30.163 31.220 29.118 1.00 0.00 H ATOM 2529 N ALA A 211 -27.152 30.453 30.278 1.00 20.80 N ATOM 2530 CA ALA A 211 -25.874 29.784 30.522 1.00 22.74 C ATOM 2531 C ALA A 211 -24.819 30.212 29.508 1.00 23.14 C ATOM 2532 O ALA A 211 -23.640 30.355 29.851 1.00 24.80 O ATOM 2533 CB ALA A 211 -26.032 28.273 30.516 1.00 21.62 C ATOM 2534 HA ALA A 211 -25.536 30.088 31.513 1.00 0.00 H ATOM 2535 HB1 ALA A 211 -26.733 27.979 31.297 1.00 0.00 H ATOM 2536 HB2 ALA A 211 -26.412 27.953 29.546 1.00 0.00 H ATOM 2537 HB3 ALA A 211 -25.064 27.807 30.700 1.00 0.00 H ATOM 2538 H ALA A 211 -27.985 29.893 30.005 1.00 0.00 H ATOM 2539 N ALA A 212 -25.233 30.401 28.255 1.00 21.00 N ATOM 2540 CA ALA A 212 -24.319 30.897 27.236 1.00 20.98 C ATOM 2541 C ALA A 212 -23.898 32.347 27.489 1.00 22.98 C ATOM 2542 O ALA A 212 -22.750 32.716 27.225 1.00 23.18 O ATOM 2543 CB ALA A 212 -24.917 30.738 25.839 1.00 20.22 C ATOM 2544 HA ALA A 212 -23.417 30.288 27.296 1.00 0.00 H ATOM 2545 HB1 ALA A 212 -25.115 29.683 25.648 1.00 0.00 H ATOM 2546 HB2 ALA A 212 -25.848 31.301 25.778 1.00 0.00 H ATOM 2547 HB3 ALA A 212 -24.213 31.117 25.098 1.00 0.00 H ATOM 2548 H ALA A 212 -26.220 30.192 28.003 1.00 0.00 H ATOM 2549 N LEU A 213 -24.815 33.169 27.992 1.00 20.18 N ATOM 2550 CA LEU A 213 -24.460 34.546 28.364 1.00 23.59 C ATOM 2551 C LEU A 213 -23.488 34.582 29.539 1.00 25.59 C ATOM 2552 O LEU A 213 -22.521 35.352 29.542 1.00 23.64 O ATOM 2553 CB LEU A 213 -25.704 35.381 28.667 1.00 20.66 C ATOM 2554 CG LEU A 213 -26.382 35.938 27.408 1.00 24.61 C ATOM 2555 CD1 LEU A 213 -27.813 36.434 27.690 1.00 22.10 C ATOM 2556 CD2 LEU A 213 -25.524 37.042 26.792 1.00 25.07 C ATOM 2557 HA LEU A 213 -23.957 34.987 27.504 1.00 0.00 H ATOM 2558 HB2 LEU A 213 -26.421 34.755 29.198 1.00 0.00 H ATOM 2559 HB3 LEU A 213 -25.413 36.217 29.303 1.00 0.00 H ATOM 2560 HG LEU A 213 -26.471 35.123 26.690 1.00 0.00 H ATOM 2561 HD21 LEU A 213 -25.396 37.847 27.515 1.00 0.00 H ATOM 2562 HD22 LEU A 213 -24.549 36.635 26.523 1.00 0.00 H ATOM 2563 HD23 LEU A 213 -26.017 37.428 25.900 1.00 0.00 H ATOM 2564 HD11 LEU A 213 -28.416 35.606 28.063 1.00 0.00 H ATOM 2565 HD12 LEU A 213 -27.781 37.227 28.437 1.00 0.00 H ATOM 2566 HD13 LEU A 213 -28.251 36.819 26.769 1.00 0.00 H ATOM 2567 H LEU A 213 -25.791 32.835 28.123 1.00 0.00 H ATOM 2568 N ALA A 214 -23.736 33.733 30.531 1.00 23.16 N ATOM 2569 CA ALA A 214 -22.841 33.650 31.682 1.00 23.76 C ATOM 2570 C ALA A 214 -21.424 33.287 31.242 1.00 27.40 C ATOM 2571 O ALA A 214 -20.446 33.941 31.627 1.00 27.50 O ATOM 2572 CB ALA A 214 -23.357 32.636 32.674 1.00 22.42 C ATOM 2573 HA ALA A 214 -22.810 34.628 32.163 1.00 0.00 H ATOM 2574 HB1 ALA A 214 -24.349 32.934 33.014 1.00 0.00 H ATOM 2575 HB2 ALA A 214 -23.414 31.658 32.196 1.00 0.00 H ATOM 2576 HB3 ALA A 214 -22.679 32.586 33.526 1.00 0.00 H ATOM 2577 H ALA A 214 -24.576 33.121 30.487 1.00 0.00 H ATOM 2578 N ASP A 215 -21.327 32.239 30.430 1.00 22.94 N ATOM 2579 CA ASP A 215 -20.047 31.755 29.922 1.00 24.19 C ATOM 2580 C ASP A 215 -19.365 32.774 29.022 1.00 28.94 C ATOM 2581 O ASP A 215 -18.150 32.739 28.849 1.00 27.88 O ATOM 2582 CB ASP A 215 -20.240 30.431 29.177 1.00 25.62 C ATOM 2583 CG ASP A 215 -20.671 29.306 30.104 1.00 29.83 C ATOM 2584 OD1 ASP A 215 -20.671 29.528 31.337 1.00 28.71 O ATOM 2585 OD2 ASP A 215 -20.999 28.207 29.607 1.00 28.68 O ATOM 2586 HA ASP A 215 -19.395 31.594 30.781 1.00 0.00 H ATOM 2587 HB2 ASP A 215 -21.004 30.567 28.411 1.00 0.00 H ATOM 2588 HB3 ASP A 215 -19.298 30.154 28.703 1.00 0.00 H ATOM 2589 H ASP A 215 -22.197 31.745 30.146 1.00 0.00 H ATOM 2590 N THR A 216 -20.153 33.678 28.447 1.00 25.77 N ATOM 2591 CA THR A 216 -19.614 34.741 27.608 1.00 29.12 C ATOM 2592 C THR A 216 -18.999 35.836 28.480 1.00 35.25 C ATOM 2593 O THR A 216 -17.964 36.411 28.128 1.00 34.42 O ATOM 2594 CB THR A 216 -20.694 35.299 26.665 1.00 29.16 C ATOM 2595 OG1 THR A 216 -21.087 34.263 25.756 1.00 28.92 O ATOM 2596 CG2 THR A 216 -20.179 36.487 25.865 1.00 25.56 C ATOM 2597 HA THR A 216 -18.825 34.329 26.980 1.00 0.00 H ATOM 2598 HB THR A 216 -21.538 35.635 27.267 1.00 0.00 H ATOM 2599 HG1 THR A 216 -21.449 33.496 26.268 1.00 0.00 H ATOM 2600 HG23 THR A 216 -19.878 37.281 26.549 1.00 0.00 H ATOM 2601 HG21 THR A 216 -19.323 36.177 25.266 1.00 0.00 H ATOM 2602 HG22 THR A 216 -20.969 36.852 25.209 1.00 0.00 H ATOM 2603 H THR A 216 -21.180 33.625 28.600 1.00 0.00 H ATOM 2604 N ASP A 217 -19.631 36.107 29.623 1.00 32.24 N ATOM 2605 CA ASP A 217 -19.039 36.970 30.648 1.00 38.22 C ATOM 2606 C ASP A 217 -17.671 36.425 31.033 1.00 37.69 C ATOM 2607 O ASP A 217 -16.669 37.144 31.044 1.00 41.25 O ATOM 2608 CB ASP A 217 -19.908 37.003 31.915 1.00 34.42 C ATOM 2609 CG ASP A 217 -21.140 37.871 31.767 1.00 42.88 C ATOM 2610 OD1 ASP A 217 -21.145 38.755 30.878 1.00 42.05 O ATOM 2611 OD2 ASP A 217 -22.097 37.672 32.557 1.00 36.00 O ATOM 2612 HA ASP A 217 -18.962 37.977 30.237 1.00 0.00 H ATOM 2613 HB2 ASP A 217 -20.225 35.986 32.145 1.00 0.00 H ATOM 2614 HB3 ASP A 217 -19.307 37.390 32.738 1.00 0.00 H ATOM 2615 H ASP A 217 -20.571 35.694 29.791 1.00 0.00 H ATOM 2616 N ASN A 218 -17.652 35.143 31.369 1.00 35.74 N ATOM 2617 CA ASN A 218 -16.444 34.475 31.823 1.00 40.25 C ATOM 2618 C ASN A 218 -15.337 34.537 30.770 1.00 42.59 C ATOM 2619 O ASN A 218 -14.168 34.763 31.089 1.00 43.88 O ATOM 2620 CB ASN A 218 -16.767 33.024 32.187 1.00 39.52 C ATOM 2621 CG ASN A 218 -15.654 32.353 32.964 1.00 47.61 C ATOM 2622 OD1 ASN A 218 -15.486 31.134 32.901 1.00 49.11 O ATOM 2623 ND2 ASN A 218 -14.885 33.146 33.704 1.00 49.21 N ATOM 2624 HA ASN A 218 -16.075 34.994 32.708 1.00 0.00 H ATOM 2625 HB2 ASN A 218 -17.673 33.010 32.793 1.00 0.00 H ATOM 2626 HB3 ASN A 218 -16.938 32.464 31.268 1.00 0.00 H ATOM 2627 HD22 ASN A 218 -15.064 34.170 33.727 1.00 0.00 H ATOM 2628 HD21 ASN A 218 -14.104 32.742 34.260 1.00 0.00 H ATOM 2629 H ASN A 218 -18.534 34.595 31.305 1.00 0.00 H ATOM 2630 N LEU A 219 -15.716 34.348 29.513 1.00 35.94 N ATOM 2631 CA LEU A 219 -14.756 34.318 28.419 1.00 39.77 C ATOM 2632 C LEU A 219 -14.078 35.678 28.259 1.00 42.46 C ATOM 2633 O LEU A 219 -12.909 35.758 27.877 1.00 40.30 O ATOM 2634 CB LEU A 219 -15.448 33.900 27.117 1.00 37.57 C ATOM 2635 CG LEU A 219 -14.565 33.496 25.937 1.00 39.88 C ATOM 2636 CD1 LEU A 219 -13.763 32.240 26.271 1.00 41.87 C ATOM 2637 CD2 LEU A 219 -15.403 33.287 24.686 1.00 37.51 C ATOM 2638 HA LEU A 219 -13.986 33.582 28.653 1.00 0.00 H ATOM 2639 HB2 LEU A 219 -16.090 33.050 27.348 1.00 0.00 H ATOM 2640 HB3 LEU A 219 -16.062 34.740 26.791 1.00 0.00 H ATOM 2641 HG LEU A 219 -13.862 34.306 25.742 1.00 0.00 H ATOM 2642 HD21 LEU A 219 -16.133 32.498 24.867 1.00 0.00 H ATOM 2643 HD22 LEU A 219 -15.921 34.213 24.438 1.00 0.00 H ATOM 2644 HD23 LEU A 219 -14.754 33.000 23.859 1.00 0.00 H ATOM 2645 HD11 LEU A 219 -13.130 32.434 27.137 1.00 0.00 H ATOM 2646 HD12 LEU A 219 -14.448 31.422 26.497 1.00 0.00 H ATOM 2647 HD13 LEU A 219 -13.141 31.970 25.417 1.00 0.00 H ATOM 2648 H LEU A 219 -16.726 34.218 29.303 1.00 0.00 H ATOM 2649 N LYS A 220 -14.821 36.744 28.553 1.00 39.58 N ATOM 2650 CA LYS A 220 -14.279 38.099 28.534 1.00 39.90 C ATOM 2651 C LYS A 220 -13.152 38.261 29.550 1.00 46.08 C ATOM 2652 O LYS A 220 -12.168 38.950 29.289 1.00 48.45 O ATOM 2653 CB LYS A 220 -15.376 39.123 28.832 1.00 42.58 C ATOM 2654 CG LYS A 220 -16.229 39.502 27.639 1.00 41.80 C ATOM 2655 CD LYS A 220 -17.485 40.236 28.086 1.00 44.04 C ATOM 2656 CE LYS A 220 -17.146 41.485 28.883 1.00 50.70 C ATOM 2657 NZ LYS A 220 -18.374 42.155 29.393 1.00 53.04 N ATOM 2658 HA LYS A 220 -13.879 38.274 27.535 1.00 0.00 H ATOM 2659 HB2 LYS A 220 -16.030 38.707 29.599 1.00 0.00 H ATOM 2660 HB3 LYS A 220 -14.902 40.028 29.212 1.00 0.00 H ATOM 2661 HG2 LYS A 220 -15.652 40.149 26.978 1.00 0.00 H ATOM 2662 HG3 LYS A 220 -16.515 38.598 27.102 1.00 0.00 H ATOM 2663 HD2 LYS A 220 -18.060 40.522 27.206 1.00 0.00 H ATOM 2664 HD3 LYS A 220 -18.083 39.570 28.708 1.00 0.00 H ATOM 2665 HE2 LYS A 220 -16.604 42.179 28.241 1.00 0.00 H ATOM 2666 HE3 LYS A 220 -16.517 41.207 29.728 1.00 0.00 H ATOM 2667 HZ1 LYS A 220 -18.977 42.429 28.591 1.00 0.00 H ATOM 2668 HZ2 LYS A 220 -18.894 41.500 30.011 1.00 0.00 H ATOM 2669 HZ3 LYS A 220 -18.106 43.003 29.932 1.00 0.00 H ATOM 2670 H LYS A 220 -15.821 36.606 28.804 1.00 0.00 H ATOM 2671 N ARG A 221 -13.304 37.635 30.712 1.00 43.30 N ATOM 2672 CA ARG A 221 -12.282 37.710 31.753 1.00 49.17 C ATOM 2673 C ARG A 221 -11.061 36.888 31.371 1.00 46.58 C ATOM 2674 O ARG A 221 -9.929 37.227 31.722 1.00 49.65 O ATOM 2675 CB ARG A 221 -12.835 37.207 33.087 1.00 50.38 C ATOM 2676 CG ARG A 221 -14.306 37.496 33.275 1.00 53.05 C ATOM 2677 CD ARG A 221 -14.649 37.759 34.729 1.00 55.06 C ATOM 2678 NE ARG A 221 -15.976 38.357 34.870 1.00 59.68 N ATOM 2679 CZ ARG A 221 -16.428 39.370 34.132 1.00 59.16 C ATOM 2680 NH1 ARG A 221 -15.662 39.913 33.192 1.00 56.52 N ATOM 2681 NH2 ARG A 221 -17.650 39.846 34.338 1.00 59.54 N ATOM 2682 HA ARG A 221 -11.989 38.755 31.857 1.00 0.00 H ATOM 2683 HB2 ARG A 221 -12.685 36.129 33.139 1.00 0.00 H ATOM 2684 HB3 ARG A 221 -12.282 37.688 33.894 1.00 0.00 H ATOM 2685 HG2 ARG A 221 -14.571 38.374 32.686 1.00 0.00 H ATOM 2686 HG3 ARG A 221 -14.881 36.638 32.926 1.00 0.00 H ATOM 2687 HD2 ARG A 221 -13.908 38.438 35.150 1.00 0.00 H ATOM 2688 HD3 ARG A 221 -14.626 36.815 35.274 1.00 0.00 H ATOM 2689 HE ARG A 221 -16.610 37.965 35.595 1.00 0.00 H ATOM 2690 HH12 ARG A 221 -16.022 40.703 32.620 1.00 0.00 H ATOM 2691 HH11 ARG A 221 -14.702 39.548 33.028 1.00 0.00 H ATOM 2692 HH22 ARG A 221 -18.004 40.637 33.763 1.00 0.00 H ATOM 2693 HH21 ARG A 221 -18.253 39.428 35.075 1.00 0.00 H ATOM 2694 H ARG A 221 -14.167 37.081 30.884 1.00 0.00 H ATOM 2695 N GLN A 222 -11.302 35.802 30.646 1.00 44.85 N ATOM 2696 CA GLN A 222 -10.248 34.859 30.296 1.00 46.92 C ATOM 2697 C GLN A 222 -9.421 35.334 29.102 1.00 48.43 C ATOM 2698 O GLN A 222 -8.239 34.999 28.976 1.00 45.86 O ATOM 2699 CB GLN A 222 -10.854 33.483 30.019 1.00 44.74 C ATOM 2700 CG GLN A 222 -11.574 32.893 31.217 1.00 46.37 C ATOM 2701 CD GLN A 222 -12.303 31.611 30.883 1.00 52.17 C ATOM 2702 OE1 GLN A 222 -12.460 31.260 29.712 1.00 50.66 O ATOM 2703 NE2 GLN A 222 -12.759 30.903 31.913 1.00 52.77 N ATOM 2704 HA GLN A 222 -9.568 34.791 31.145 1.00 0.00 H ATOM 2705 HB2 GLN A 222 -11.566 33.577 29.199 1.00 0.00 H ATOM 2706 HB3 GLN A 222 -10.053 32.804 29.727 1.00 0.00 H ATOM 2707 HG2 GLN A 222 -10.842 32.686 31.998 1.00 0.00 H ATOM 2708 HG3 GLN A 222 -12.298 33.621 31.583 1.00 0.00 H ATOM 2709 HE22 GLN A 222 -12.603 31.239 32.885 1.00 0.00 H ATOM 2710 HE21 GLN A 222 -13.272 30.014 31.746 1.00 0.00 H ATOM 2711 H GLN A 222 -12.272 35.619 30.318 1.00 0.00 H ATOM 2712 N LEU A 223 -10.046 36.120 28.231 1.00 42.01 N ATOM 2713 CA LEU A 223 -9.370 36.643 27.052 1.00 43.89 C ATOM 2714 C LEU A 223 -9.517 38.159 26.949 1.00 44.09 C ATOM 2715 O LEU A 223 -9.980 38.670 25.929 1.00 42.32 O ATOM 2716 CB LEU A 223 -9.913 35.968 25.789 1.00 38.14 C ATOM 2717 CG LEU A 223 -9.898 34.436 25.813 1.00 39.70 C ATOM 2718 CD1 LEU A 223 -10.647 33.858 24.622 1.00 41.38 C ATOM 2719 CD2 LEU A 223 -8.470 33.907 25.860 1.00 39.85 C ATOM 2720 HA LEU A 223 -8.308 36.419 27.148 1.00 0.00 H ATOM 2721 HB2 LEU A 223 -10.944 36.294 25.648 1.00 0.00 H ATOM 2722 HB3 LEU A 223 -9.310 36.299 24.943 1.00 0.00 H ATOM 2723 HG LEU A 223 -10.411 34.114 26.719 1.00 0.00 H ATOM 2724 HD21 LEU A 223 -7.928 34.250 24.979 1.00 0.00 H ATOM 2725 HD22 LEU A 223 -7.976 34.277 26.759 1.00 0.00 H ATOM 2726 HD23 LEU A 223 -8.488 32.817 25.876 1.00 0.00 H ATOM 2727 HD11 LEU A 223 -11.683 34.196 24.647 1.00 0.00 H ATOM 2728 HD12 LEU A 223 -10.176 34.196 23.699 1.00 0.00 H ATOM 2729 HD13 LEU A 223 -10.617 32.769 24.669 1.00 0.00 H ATOM 2730 H LEU A 223 -11.043 36.368 28.396 1.00 0.00 H ATOM 2731 N PRO A 224 -9.110 38.884 28.010 1.00 48.21 N ATOM 2732 CA PRO A 224 -9.210 40.349 28.081 1.00 49.39 C ATOM 2733 C PRO A 224 -8.594 41.080 26.888 1.00 48.93 C ATOM 2734 O PRO A 224 -9.036 42.183 26.559 1.00 49.94 O ATOM 2735 CB PRO A 224 -8.452 40.701 29.371 1.00 49.02 C ATOM 2736 CG PRO A 224 -7.715 39.459 29.767 1.00 48.42 C ATOM 2737 CD PRO A 224 -8.514 38.320 29.232 1.00 47.50 C ATOM 2738 HA PRO A 224 -10.254 40.662 28.070 1.00 0.00 H ATOM 2739 HD3 PRO A 224 -7.876 37.467 29.000 1.00 0.00 H ATOM 2740 HD2 PRO A 224 -9.284 38.014 29.940 1.00 0.00 H ATOM 2741 HG3 PRO A 224 -7.640 39.393 30.852 1.00 0.00 H ATOM 2742 HG2 PRO A 224 -6.715 39.457 29.334 1.00 0.00 H ATOM 2743 HB2 PRO A 224 -7.751 41.516 29.189 1.00 0.00 H ATOM 2744 HB3 PRO A 224 -9.151 40.993 30.154 1.00 0.00 H ATOM 2745 N SER A 225 -7.591 40.487 26.249 1.00 50.45 N ATOM 2746 CA SER A 225 -6.990 41.114 25.074 1.00 51.84 C ATOM 2747 C SER A 225 -8.005 41.253 23.935 1.00 52.00 C ATOM 2748 O SER A 225 -7.849 42.104 23.057 1.00 49.20 O ATOM 2749 CB SER A 225 -5.746 40.348 24.608 1.00 48.63 C ATOM 2750 OG SER A 225 -6.051 39.009 24.261 1.00 49.55 O ATOM 2751 HA SER A 225 -6.676 42.116 25.365 1.00 0.00 H ATOM 2752 HB2 SER A 225 -5.011 40.345 25.413 1.00 0.00 H ATOM 2753 HB3 SER A 225 -5.327 40.852 23.737 1.00 0.00 H ATOM 2754 HG SER A 225 -5.225 38.549 23.966 1.00 0.00 H ATOM 2755 H SER A 225 -7.232 39.571 26.587 1.00 0.00 H ATOM 2756 N GLU A 226 -9.049 40.424 23.968 1.00 50.49 N ATOM 2757 CA GLU A 226 -10.063 40.401 22.916 1.00 46.11 C ATOM 2758 C GLU A 226 -11.406 40.924 23.389 1.00 45.70 C ATOM 2759 O GLU A 226 -12.444 40.469 22.907 1.00 43.62 O ATOM 2760 CB GLU A 226 -10.263 38.974 22.398 1.00 47.38 C ATOM 2761 CG GLU A 226 -8.999 38.309 21.917 1.00 49.04 C ATOM 2762 CD GLU A 226 -8.323 39.094 20.819 1.00 51.56 C ATOM 2763 OE1 GLU A 226 -9.035 39.735 20.013 1.00 52.80 O ATOM 2764 OE2 GLU A 226 -7.077 39.067 20.761 1.00 57.10 O ATOM 2765 HA GLU A 226 -9.695 41.054 22.124 1.00 0.00 H ATOM 2766 HB2 GLU A 226 -10.680 38.372 23.205 1.00 0.00 H ATOM 2767 HB3 GLU A 226 -10.969 39.007 21.569 1.00 0.00 H ATOM 2768 HG2 GLU A 226 -8.310 38.215 22.757 1.00 0.00 H ATOM 2769 HG3 GLU A 226 -9.246 37.317 21.539 1.00 0.00 H ATOM 2770 H GLU A 226 -9.145 39.770 24.771 1.00 0.00 H ATOM 2771 N ASP A 227 -11.394 41.866 24.328 1.00 45.50 N ATOM 2772 CA ASP A 227 -12.634 42.372 24.908 1.00 47.86 C ATOM 2773 C ASP A 227 -13.526 43.054 23.874 1.00 48.82 C ATOM 2774 O ASP A 227 -14.709 42.738 23.763 1.00 47.48 O ATOM 2775 CB ASP A 227 -12.355 43.327 26.070 1.00 49.69 C ATOM 2776 CG ASP A 227 -13.626 43.773 26.764 1.00 54.88 C ATOM 2777 OD1 ASP A 227 -14.250 44.752 26.297 1.00 54.16 O ATOM 2778 OD2 ASP A 227 -14.010 43.134 27.769 1.00 55.62 O ATOM 2779 HA ASP A 227 -13.171 41.502 25.286 1.00 0.00 H ATOM 2780 HB2 ASP A 227 -11.718 42.821 26.795 1.00 0.00 H ATOM 2781 HB3 ASP A 227 -11.838 44.206 25.685 1.00 0.00 H ATOM 2782 H ASP A 227 -10.484 42.249 24.655 1.00 0.00 H ATOM 2783 N ALA A 228 -12.959 43.994 23.125 1.00 49.72 N ATOM 2784 CA ALA A 228 -13.695 44.678 22.066 1.00 47.54 C ATOM 2785 C ALA A 228 -14.541 43.703 21.237 1.00 47.10 C ATOM 2786 O ALA A 228 -15.716 43.959 20.963 1.00 44.89 O ATOM 2787 CB ALA A 228 -12.735 45.441 21.169 1.00 45.56 C ATOM 2788 HA ALA A 228 -14.379 45.382 22.540 1.00 0.00 H ATOM 2789 HB1 ALA A 228 -12.194 46.178 21.762 1.00 0.00 H ATOM 2790 HB2 ALA A 228 -12.028 44.744 20.720 1.00 0.00 H ATOM 2791 HB3 ALA A 228 -13.297 45.946 20.384 1.00 0.00 H ATOM 2792 H ALA A 228 -11.966 44.249 23.298 1.00 0.00 H ATOM 2793 N ARG A 229 -13.935 42.586 20.847 1.00 46.61 N ATOM 2794 CA ARG A 229 -14.618 41.576 20.041 1.00 46.32 C ATOM 2795 C ARG A 229 -15.666 40.806 20.844 1.00 41.72 C ATOM 2796 O ARG A 229 -16.816 40.682 20.429 1.00 40.86 O ATOM 2797 CB ARG A 229 -13.604 40.604 19.444 1.00 43.57 C ATOM 2798 CG ARG A 229 -13.095 40.998 18.075 1.00 47.00 C ATOM 2799 CD ARG A 229 -14.211 40.933 17.048 1.00 48.32 C ATOM 2800 NE ARG A 229 -13.695 41.016 15.686 1.00 51.06 N ATOM 2801 CZ ARG A 229 -13.410 42.154 15.064 1.00 51.13 C ATOM 2802 NH1 ARG A 229 -13.591 43.313 15.685 1.00 53.55 N ATOM 2803 NH2 ARG A 229 -12.943 42.133 13.822 1.00 48.25 N ATOM 2804 HA ARG A 229 -15.139 42.101 19.240 1.00 0.00 H ATOM 2805 HB2 ARG A 229 -12.752 40.541 20.120 1.00 0.00 H ATOM 2806 HB3 ARG A 229 -14.076 39.625 19.364 1.00 0.00 H ATOM 2807 HG2 ARG A 229 -12.706 42.015 18.117 1.00 0.00 H ATOM 2808 HG3 ARG A 229 -12.297 40.317 17.780 1.00 0.00 H ATOM 2809 HD2 ARG A 229 -14.897 41.763 17.218 1.00 0.00 H ATOM 2810 HD3 ARG A 229 -14.746 39.991 17.167 1.00 0.00 H ATOM 2811 HE ARG A 229 -13.540 40.127 15.169 1.00 0.00 H ATOM 2812 HH12 ARG A 229 -13.368 44.204 15.198 1.00 0.00 H ATOM 2813 HH11 ARG A 229 -13.956 43.330 16.659 1.00 0.00 H ATOM 2814 HH22 ARG A 229 -12.720 43.025 13.335 1.00 0.00 H ATOM 2815 HH21 ARG A 229 -12.800 41.225 13.335 1.00 0.00 H ATOM 2816 H ARG A 229 -12.945 42.426 21.124 1.00 0.00 H ATOM 2817 N LEU A 230 -15.257 40.280 21.989 1.00 39.72 N ATOM 2818 CA LEU A 230 -16.164 39.543 22.856 1.00 40.97 C ATOM 2819 C LEU A 230 -17.427 40.355 23.155 1.00 38.42 C ATOM 2820 O LEU A 230 -18.518 39.795 23.305 1.00 29.96 O ATOM 2821 CB LEU A 230 -15.456 39.153 24.159 1.00 37.00 C ATOM 2822 CG LEU A 230 -14.989 37.701 24.308 1.00 42.61 C ATOM 2823 CD1 LEU A 230 -15.313 36.876 23.063 1.00 35.12 C ATOM 2824 CD2 LEU A 230 -13.508 37.630 24.628 1.00 38.28 C ATOM 2825 HA LEU A 230 -16.466 38.635 22.335 1.00 0.00 H ATOM 2826 HB2 LEU A 230 -14.577 39.790 24.255 1.00 0.00 H ATOM 2827 HB3 LEU A 230 -16.144 39.360 24.978 1.00 0.00 H ATOM 2828 HG LEU A 230 -15.538 37.270 25.145 1.00 0.00 H ATOM 2829 HD21 LEU A 230 -12.941 38.097 23.823 1.00 0.00 H ATOM 2830 HD22 LEU A 230 -13.314 38.156 25.563 1.00 0.00 H ATOM 2831 HD23 LEU A 230 -13.209 36.587 24.727 1.00 0.00 H ATOM 2832 HD11 LEU A 230 -16.391 36.877 22.899 1.00 0.00 H ATOM 2833 HD12 LEU A 230 -14.812 37.313 22.199 1.00 0.00 H ATOM 2834 HD13 LEU A 230 -14.967 35.853 23.207 1.00 0.00 H ATOM 2835 H LEU A 230 -14.264 40.397 22.275 1.00 0.00 H ATOM 2836 N GLN A 231 -17.278 41.674 23.232 1.00 38.30 N ATOM 2837 CA GLN A 231 -18.408 42.542 23.544 1.00 40.41 C ATOM 2838 C GLN A 231 -19.370 42.633 22.358 1.00 37.45 C ATOM 2839 O GLN A 231 -20.591 42.692 22.540 1.00 32.42 O ATOM 2840 CB GLN A 231 -17.930 43.934 23.969 1.00 42.09 C ATOM 2841 CG GLN A 231 -18.995 44.777 24.661 1.00 42.92 C ATOM 2842 CD GLN A 231 -19.359 44.258 26.050 1.00 45.31 C ATOM 2843 OE1 GLN A 231 -18.494 43.841 26.820 1.00 48.74 O ATOM 2844 NE2 GLN A 231 -20.648 44.290 26.373 1.00 44.85 N ATOM 2845 HA GLN A 231 -18.948 42.102 24.383 1.00 0.00 H ATOM 2846 HB2 GLN A 231 -17.091 43.813 24.654 1.00 0.00 H ATOM 2847 HB3 GLN A 231 -17.596 44.468 23.079 1.00 0.00 H ATOM 2848 HG2 GLN A 231 -18.622 45.797 24.758 1.00 0.00 H ATOM 2849 HG3 GLN A 231 -19.893 44.777 24.044 1.00 0.00 H ATOM 2850 HE22 GLN A 231 -21.346 44.651 25.692 1.00 0.00 H ATOM 2851 HE21 GLN A 231 -20.958 43.954 27.307 1.00 0.00 H ATOM 2852 H GLN A 231 -16.341 42.094 23.067 1.00 0.00 H ATOM 2853 N GLN A 232 -18.818 42.651 21.146 1.00 39.23 N ATOM 2854 CA GLN A 232 -19.629 42.567 19.936 1.00 37.56 C ATOM 2855 C GLN A 232 -20.502 41.333 20.041 1.00 32.73 C ATOM 2856 O GLN A 232 -21.715 41.390 19.851 1.00 33.39 O ATOM 2857 CB GLN A 232 -18.750 42.419 18.694 1.00 39.94 C ATOM 2858 CG GLN A 232 -18.338 43.712 18.017 1.00 46.42 C ATOM 2859 CD GLN A 232 -17.543 43.456 16.742 1.00 51.71 C ATOM 2860 OE1 GLN A 232 -16.437 43.968 16.572 1.00 55.12 O ATOM 2861 NE2 GLN A 232 -18.101 42.643 15.849 1.00 51.67 N ATOM 2862 HA GLN A 232 -20.221 43.478 19.844 1.00 0.00 H ATOM 2863 HB2 GLN A 232 -17.843 41.891 18.988 1.00 0.00 H ATOM 2864 HB3 GLN A 232 -19.298 41.820 17.966 1.00 0.00 H ATOM 2865 HG2 GLN A 232 -19.234 44.280 17.766 1.00 0.00 H ATOM 2866 HG3 GLN A 232 -17.723 44.291 18.706 1.00 0.00 H ATOM 2867 HE22 GLN A 232 -19.038 42.232 16.034 1.00 0.00 H ATOM 2868 HE21 GLN A 232 -17.600 42.418 14.966 1.00 0.00 H ATOM 2869 H GLN A 232 -17.784 42.727 21.060 1.00 0.00 H ATOM 2870 N PHE A 233 -19.855 40.214 20.342 1.00 32.95 N ATOM 2871 CA PHE A 233 -20.519 38.931 20.472 1.00 30.42 C ATOM 2872 C PHE A 233 -21.611 38.984 21.531 1.00 30.01 C ATOM 2873 O PHE A 233 -22.779 38.725 21.243 1.00 26.97 O ATOM 2874 CB PHE A 233 -19.492 37.864 20.830 1.00 29.49 C ATOM 2875 CG PHE A 233 -20.065 36.485 20.937 1.00 28.39 C ATOM 2876 CD1 PHE A 233 -20.550 35.837 19.814 1.00 25.42 C ATOM 2877 CD2 PHE A 233 -20.112 35.833 22.159 1.00 28.44 C ATOM 2878 CE1 PHE A 233 -21.073 34.564 19.903 1.00 28.28 C ATOM 2879 CE2 PHE A 233 -20.635 34.558 22.257 1.00 27.86 C ATOM 2880 CZ PHE A 233 -21.112 33.920 21.127 1.00 29.51 C ATOM 2881 HA PHE A 233 -20.988 38.683 19.520 1.00 0.00 H ATOM 2882 HB2 PHE A 233 -18.721 37.857 20.060 1.00 0.00 H ATOM 2883 HB3 PHE A 233 -19.044 38.126 21.789 1.00 0.00 H ATOM 2884 HD2 PHE A 233 -19.733 36.331 23.051 1.00 0.00 H ATOM 2885 HE2 PHE A 233 -20.672 34.056 23.224 1.00 0.00 H ATOM 2886 HZ PHE A 233 -21.518 32.911 21.200 1.00 0.00 H ATOM 2887 HE1 PHE A 233 -21.455 34.066 19.011 1.00 0.00 H ATOM 2888 HD1 PHE A 233 -20.518 36.339 18.847 1.00 0.00 H ATOM 2889 H PHE A 233 -18.827 40.259 20.491 1.00 0.00 H ATOM 2890 N GLU A 234 -21.225 39.338 22.752 1.00 29.96 N ATOM 2891 CA GLU A 234 -22.156 39.376 23.874 1.00 28.96 C ATOM 2892 C GLU A 234 -23.364 40.271 23.629 1.00 25.07 C ATOM 2893 O GLU A 234 -24.489 39.913 23.991 1.00 22.56 O ATOM 2894 CB GLU A 234 -21.448 39.816 25.153 1.00 33.15 C ATOM 2895 CG GLU A 234 -22.401 40.021 26.328 1.00 33.28 C ATOM 2896 CD GLU A 234 -21.732 39.811 27.666 1.00 38.18 C ATOM 2897 OE1 GLU A 234 -20.686 40.444 27.911 1.00 43.39 O ATOM 2898 OE2 GLU A 234 -22.250 39.004 28.468 1.00 40.97 O ATOM 2899 HA GLU A 234 -22.527 38.357 23.985 1.00 0.00 H ATOM 2900 HB2 GLU A 234 -20.720 39.052 25.426 1.00 0.00 H ATOM 2901 HB3 GLU A 234 -20.931 40.756 24.958 1.00 0.00 H ATOM 2902 HG2 GLU A 234 -22.790 41.038 26.288 1.00 0.00 H ATOM 2903 HG3 GLU A 234 -23.226 39.314 26.236 1.00 0.00 H ATOM 2904 H GLU A 234 -20.230 39.595 22.912 1.00 0.00 H ATOM 2905 N ASN A 235 -23.136 41.434 23.023 1.00 25.49 N ATOM 2906 CA ASN A 235 -24.232 42.361 22.773 1.00 29.19 C ATOM 2907 C ASN A 235 -25.244 41.739 21.820 1.00 24.79 C ATOM 2908 O ASN A 235 -26.454 41.941 21.964 1.00 23.53 O ATOM 2909 CB ASN A 235 -23.721 43.697 22.228 1.00 28.78 C ATOM 2910 CG ASN A 235 -23.092 44.557 23.305 1.00 32.08 C ATOM 2911 OD1 ASN A 235 -23.281 44.312 24.498 1.00 32.33 O ATOM 2912 ND2 ASN A 235 -22.342 45.573 22.891 1.00 35.88 N ATOM 2913 HA ASN A 235 -24.726 42.563 23.723 1.00 0.00 H ATOM 2914 HB2 ASN A 235 -22.976 43.499 21.458 1.00 0.00 H ATOM 2915 HB3 ASN A 235 -24.558 44.240 21.790 1.00 0.00 H ATOM 2916 HD22 ASN A 235 -22.211 45.741 21.873 1.00 0.00 H ATOM 2917 HD21 ASN A 235 -21.886 46.200 23.585 1.00 0.00 H ATOM 2918 H ASN A 235 -22.171 41.682 22.726 1.00 0.00 H ATOM 2919 N ALA A 236 -24.738 40.975 20.857 1.00 24.38 N ATOM 2920 CA ALA A 236 -25.597 40.293 19.897 1.00 24.27 C ATOM 2921 C ALA A 236 -26.373 39.196 20.612 1.00 21.69 C ATOM 2922 O ALA A 236 -27.565 39.019 20.375 1.00 21.11 O ATOM 2923 CB ALA A 236 -24.780 39.708 18.748 1.00 24.82 C ATOM 2924 HA ALA A 236 -26.294 41.014 19.471 1.00 0.00 H ATOM 2925 HB1 ALA A 236 -24.251 40.511 18.235 1.00 0.00 H ATOM 2926 HB2 ALA A 236 -24.060 38.991 19.144 1.00 0.00 H ATOM 2927 HB3 ALA A 236 -25.448 39.206 18.048 1.00 0.00 H ATOM 2928 H ALA A 236 -23.707 40.861 20.787 1.00 0.00 H ATOM 2929 N VAL A 237 -25.707 38.460 21.494 1.00 19.83 N ATOM 2930 CA VAL A 237 -26.416 37.406 22.217 1.00 19.12 C ATOM 2931 C VAL A 237 -27.468 38.010 23.154 1.00 20.48 C ATOM 2932 O VAL A 237 -28.570 37.485 23.293 1.00 17.50 O ATOM 2933 CB VAL A 237 -25.463 36.465 22.963 1.00 20.20 C ATOM 2934 CG1 VAL A 237 -26.256 35.332 23.622 1.00 18.10 C ATOM 2935 CG2 VAL A 237 -24.447 35.890 21.991 1.00 20.16 C ATOM 2936 HA VAL A 237 -26.931 36.792 21.478 1.00 0.00 H ATOM 2937 HB VAL A 237 -24.940 37.026 23.737 1.00 0.00 H ATOM 2938 HG11 VAL A 237 -26.971 35.754 24.328 1.00 0.00 H ATOM 2939 HG12 VAL A 237 -26.789 34.770 22.855 1.00 0.00 H ATOM 2940 HG13 VAL A 237 -25.570 34.669 24.149 1.00 0.00 H ATOM 2941 HG21 VAL A 237 -24.967 35.335 21.210 1.00 0.00 H ATOM 2942 HG22 VAL A 237 -23.876 36.702 21.542 1.00 0.00 H ATOM 2943 HG23 VAL A 237 -23.772 35.222 22.526 1.00 0.00 H ATOM 2944 H VAL A 237 -24.696 38.631 21.668 1.00 0.00 H ATOM 2945 N LEU A 238 -27.148 39.142 23.766 1.00 19.37 N ATOM 2946 CA LEU A 238 -28.131 39.832 24.595 1.00 18.22 C ATOM 2947 C LEU A 238 -29.337 40.286 23.774 1.00 20.47 C ATOM 2948 O LEU A 238 -30.464 40.224 24.248 1.00 19.91 O ATOM 2949 CB LEU A 238 -27.513 41.035 25.304 1.00 21.47 C ATOM 2950 CG LEU A 238 -26.674 40.739 26.541 1.00 19.73 C ATOM 2951 CD1 LEU A 238 -25.945 41.999 27.000 1.00 22.01 C ATOM 2952 CD2 LEU A 238 -27.553 40.173 27.646 1.00 21.10 C ATOM 2953 HA LEU A 238 -28.469 39.116 25.345 1.00 0.00 H ATOM 2954 HB2 LEU A 238 -26.875 41.551 24.586 1.00 0.00 H ATOM 2955 HB3 LEU A 238 -28.326 41.696 25.605 1.00 0.00 H ATOM 2956 HG LEU A 238 -25.922 39.990 26.292 1.00 0.00 H ATOM 2957 HD21 LEU A 238 -28.325 40.899 27.902 1.00 0.00 H ATOM 2958 HD22 LEU A 238 -28.020 39.251 27.301 1.00 0.00 H ATOM 2959 HD23 LEU A 238 -26.942 39.966 28.524 1.00 0.00 H ATOM 2960 HD11 LEU A 238 -25.291 42.350 26.202 1.00 0.00 H ATOM 2961 HD12 LEU A 238 -26.675 42.772 27.241 1.00 0.00 H ATOM 2962 HD13 LEU A 238 -25.350 41.771 27.884 1.00 0.00 H ATOM 2963 H LEU A 238 -26.193 39.539 23.655 1.00 0.00 H ATOM 2964 N ALA A 239 -29.100 40.752 22.550 1.00 20.81 N ATOM 2965 CA ALA A 239 -30.196 41.148 21.676 1.00 18.99 C ATOM 2966 C ALA A 239 -30.995 39.914 21.242 1.00 20.42 C ATOM 2967 O ALA A 239 -32.226 39.952 21.143 1.00 19.48 O ATOM 2968 CB ALA A 239 -29.667 41.897 20.467 1.00 18.47 C ATOM 2969 HA ALA A 239 -30.860 41.816 22.225 1.00 0.00 H ATOM 2970 HB1 ALA A 239 -29.137 42.790 20.798 1.00 0.00 H ATOM 2971 HB2 ALA A 239 -28.985 41.253 19.912 1.00 0.00 H ATOM 2972 HB3 ALA A 239 -30.500 42.185 19.826 1.00 0.00 H ATOM 2973 H ALA A 239 -28.120 40.834 22.213 1.00 0.00 H ATOM 2974 N TYR A 240 -30.285 38.822 20.979 1.00 19.38 N ATOM 2975 CA TYR A 240 -30.933 37.557 20.639 1.00 18.90 C ATOM 2976 C TYR A 240 -31.882 37.149 21.772 1.00 17.06 C ATOM 2977 O TYR A 240 -33.042 36.792 21.541 1.00 17.24 O ATOM 2978 CB TYR A 240 -29.869 36.481 20.410 1.00 17.78 C ATOM 2979 CG TYR A 240 -30.396 35.099 20.072 1.00 14.74 C ATOM 2980 CD1 TYR A 240 -30.617 34.724 18.759 1.00 17.74 C ATOM 2981 CD2 TYR A 240 -30.623 34.157 21.071 1.00 16.45 C ATOM 2982 CE1 TYR A 240 -31.083 33.455 18.439 1.00 17.68 C ATOM 2983 CE2 TYR A 240 -31.084 32.887 20.763 1.00 16.12 C ATOM 2984 CZ TYR A 240 -31.315 32.544 19.451 1.00 13.80 C ATOM 2985 OH TYR A 240 -31.756 31.284 19.137 1.00 16.53 O ATOM 2986 HA TYR A 240 -31.512 37.672 19.723 1.00 0.00 H ATOM 2987 HB3 TYR A 240 -29.273 36.400 21.319 1.00 0.00 H ATOM 2988 HB2 TYR A 240 -29.233 36.808 19.588 1.00 0.00 H ATOM 2989 HD2 TYR A 240 -30.435 34.422 22.111 1.00 0.00 H ATOM 2990 HE2 TYR A 240 -31.263 32.162 21.557 1.00 0.00 H ATOM 2991 HE1 TYR A 240 -31.264 33.181 17.400 1.00 0.00 H ATOM 2992 HD1 TYR A 240 -30.422 35.439 17.959 1.00 0.00 H ATOM 2993 HH TYR A 240 -31.869 31.210 18.156 1.00 0.00 H ATOM 2994 H TYR A 240 -29.247 38.869 21.016 1.00 0.00 H ATOM 2995 N ARG A 241 -31.393 37.201 23.001 1.00 16.31 N ATOM 2996 CA ARG A 241 -32.261 36.940 24.145 1.00 17.22 C ATOM 2997 C ARG A 241 -33.479 37.878 24.194 1.00 18.28 C ATOM 2998 O ARG A 241 -34.588 37.449 24.519 1.00 17.44 O ATOM 2999 CB ARG A 241 -31.489 37.009 25.458 1.00 19.41 C ATOM 3000 CG ARG A 241 -32.342 36.704 26.673 1.00 18.84 C ATOM 3001 CD ARG A 241 -31.512 36.683 27.939 1.00 21.30 C ATOM 3002 NE ARG A 241 -31.139 38.033 28.344 1.00 22.18 N ATOM 3003 CZ ARG A 241 -30.519 38.329 29.484 1.00 24.46 C ATOM 3004 NH1 ARG A 241 -30.185 37.364 30.347 1.00 19.19 N ATOM 3005 NH2 ARG A 241 -30.236 39.593 29.761 1.00 23.93 N ATOM 3006 HA ARG A 241 -32.637 35.926 24.012 1.00 0.00 H ATOM 3007 HB2 ARG A 241 -30.673 36.287 25.418 1.00 0.00 H ATOM 3008 HB3 ARG A 241 -31.079 38.013 25.566 1.00 0.00 H ATOM 3009 HG2 ARG A 241 -33.113 37.469 26.767 1.00 0.00 H ATOM 3010 HG3 ARG A 241 -32.813 35.730 26.541 1.00 0.00 H ATOM 3011 HD2 ARG A 241 -30.607 36.101 27.762 1.00 0.00 H ATOM 3012 HD3 ARG A 241 -32.091 36.219 28.737 1.00 0.00 H ATOM 3013 HE ARG A 241 -31.373 38.816 27.700 1.00 0.00 H ATOM 3014 HH12 ARG A 241 -29.701 37.605 31.235 1.00 0.00 H ATOM 3015 HH11 ARG A 241 -30.409 36.372 30.130 1.00 0.00 H ATOM 3016 HH22 ARG A 241 -29.752 39.835 30.649 1.00 0.00 H ATOM 3017 HH21 ARG A 241 -30.498 40.344 29.090 1.00 0.00 H ATOM 3018 H ARG A 241 -30.389 37.428 23.152 1.00 0.00 H ATOM 3019 N ASP A 242 -33.288 39.157 23.884 1.00 21.48 N ATOM 3020 CA ASP A 242 -34.441 40.056 23.865 1.00 18.91 C ATOM 3021 C ASP A 242 -35.473 39.569 22.852 1.00 16.57 C ATOM 3022 O ASP A 242 -36.676 39.661 23.083 1.00 16.79 O ATOM 3023 CB ASP A 242 -34.036 41.499 23.537 1.00 19.65 C ATOM 3024 CG ASP A 242 -33.377 42.203 24.711 1.00 21.07 C ATOM 3025 OD1 ASP A 242 -33.632 41.827 25.886 1.00 25.16 O ATOM 3026 OD2 ASP A 242 -32.600 43.130 24.450 1.00 21.18 O ATOM 3027 HA ASP A 242 -34.876 40.048 24.864 1.00 0.00 H ATOM 3028 HB2 ASP A 242 -33.336 41.484 22.701 1.00 0.00 H ATOM 3029 HB3 ASP A 242 -34.929 42.056 23.252 1.00 0.00 H ATOM 3030 H ASP A 242 -32.336 39.511 23.659 1.00 0.00 H ATOM 3031 N ALA A 243 -35.004 39.056 21.725 1.00 16.05 N ATOM 3032 CA ALA A 243 -35.930 38.620 20.683 1.00 20.31 C ATOM 3033 C ALA A 243 -36.665 37.322 21.060 1.00 18.14 C ATOM 3034 O ALA A 243 -37.846 37.147 20.735 1.00 16.83 O ATOM 3035 CB ALA A 243 -35.218 38.487 19.341 1.00 17.71 C ATOM 3036 HA ALA A 243 -36.692 39.393 20.587 1.00 0.00 H ATOM 3037 HB1 ALA A 243 -34.799 39.452 19.056 1.00 0.00 H ATOM 3038 HB2 ALA A 243 -34.417 37.753 19.427 1.00 0.00 H ATOM 3039 HB3 ALA A 243 -35.931 38.161 18.584 1.00 0.00 H ATOM 3040 H ALA A 243 -33.978 38.964 21.582 1.00 0.00 H ATOM 3041 N VAL A 244 -35.965 36.421 21.741 1.00 15.71 N ATOM 3042 CA VAL A 244 -36.574 35.175 22.200 1.00 14.32 C ATOM 3043 C VAL A 244 -37.691 35.488 23.194 1.00 15.50 C ATOM 3044 O VAL A 244 -38.767 34.882 23.150 1.00 15.53 O ATOM 3045 CB VAL A 244 -35.530 34.235 22.828 1.00 18.27 C ATOM 3046 CG1 VAL A 244 -36.191 32.987 23.386 1.00 15.76 C ATOM 3047 CG2 VAL A 244 -34.460 33.870 21.800 1.00 17.08 C ATOM 3048 HA VAL A 244 -36.995 34.658 21.338 1.00 0.00 H ATOM 3049 HB VAL A 244 -35.050 34.757 23.656 1.00 0.00 H ATOM 3050 HG11 VAL A 244 -36.913 33.271 24.151 1.00 0.00 H ATOM 3051 HG12 VAL A 244 -36.702 32.457 22.582 1.00 0.00 H ATOM 3052 HG13 VAL A 244 -35.431 32.340 23.824 1.00 0.00 H ATOM 3053 HG21 VAL A 244 -34.928 33.368 20.953 1.00 0.00 H ATOM 3054 HG22 VAL A 244 -33.963 34.777 21.457 1.00 0.00 H ATOM 3055 HG23 VAL A 244 -33.729 33.205 22.259 1.00 0.00 H ATOM 3056 H VAL A 244 -34.964 36.607 21.951 1.00 0.00 H ATOM 3057 N ARG A 245 -37.443 36.455 24.077 1.00 16.05 N ATOM 3058 CA ARG A 245 -38.453 36.892 25.030 1.00 16.77 C ATOM 3059 C ARG A 245 -39.647 37.544 24.345 1.00 15.78 C ATOM 3060 O ARG A 245 -40.785 37.327 24.744 1.00 15.64 O ATOM 3061 CB ARG A 245 -37.845 37.851 26.060 1.00 16.89 C ATOM 3062 CG ARG A 245 -36.878 37.165 27.022 1.00 16.88 C ATOM 3063 CD ARG A 245 -36.028 38.187 27.793 1.00 20.78 C ATOM 3064 NE ARG A 245 -35.233 37.583 28.860 1.00 25.58 N ATOM 3065 CZ ARG A 245 -34.457 38.280 29.688 1.00 25.54 C ATOM 3066 NH1 ARG A 245 -34.362 39.594 29.555 1.00 23.91 N ATOM 3067 NH2 ARG A 245 -33.769 37.665 30.640 1.00 26.42 N ATOM 3068 HA ARG A 245 -38.816 36.001 25.542 1.00 0.00 H ATOM 3069 HB2 ARG A 245 -37.307 38.636 25.528 1.00 0.00 H ATOM 3070 HB3 ARG A 245 -38.654 38.296 26.640 1.00 0.00 H ATOM 3071 HG2 ARG A 245 -37.450 36.570 27.735 1.00 0.00 H ATOM 3072 HG3 ARG A 245 -36.217 36.511 26.453 1.00 0.00 H ATOM 3073 HD2 ARG A 245 -36.693 38.930 28.234 1.00 0.00 H ATOM 3074 HD3 ARG A 245 -35.353 38.677 27.091 1.00 0.00 H ATOM 3075 HE ARG A 245 -35.276 36.551 28.980 1.00 0.00 H ATOM 3076 HH12 ARG A 245 -33.756 40.140 30.201 1.00 0.00 H ATOM 3077 HH11 ARG A 245 -34.893 40.080 28.805 1.00 0.00 H ATOM 3078 HH22 ARG A 245 -33.165 38.215 31.283 1.00 0.00 H ATOM 3079 HH21 ARG A 245 -33.833 36.632 30.744 1.00 0.00 H ATOM 3080 H ARG A 245 -36.507 36.908 24.085 1.00 0.00 H ATOM 3081 N GLN A 246 -39.382 38.349 23.318 1.00 17.28 N ATOM 3082 CA GLN A 246 -40.444 38.954 22.534 1.00 16.99 C ATOM 3083 C GLN A 246 -41.273 37.886 21.816 1.00 14.29 C ATOM 3084 O GLN A 246 -42.488 38.008 21.705 1.00 14.92 O ATOM 3085 CB GLN A 246 -39.863 39.960 21.531 1.00 17.44 C ATOM 3086 CG GLN A 246 -39.305 41.210 22.215 1.00 22.81 C ATOM 3087 CD GLN A 246 -38.370 42.020 21.330 1.00 27.09 C ATOM 3088 OE1 GLN A 246 -37.944 41.569 20.261 1.00 24.68 O ATOM 3089 NE2 GLN A 246 -38.037 43.223 21.781 1.00 32.85 N ATOM 3090 HA GLN A 246 -41.107 39.489 23.214 1.00 0.00 H ATOM 3091 HB2 GLN A 246 -39.059 39.476 20.975 1.00 0.00 H ATOM 3092 HB3 GLN A 246 -40.651 40.261 20.840 1.00 0.00 H ATOM 3093 HG2 GLN A 246 -40.141 41.846 22.507 1.00 0.00 H ATOM 3094 HG3 GLN A 246 -38.757 40.901 23.105 1.00 0.00 H ATOM 3095 HE22 GLN A 246 -38.419 43.563 22.687 1.00 0.00 H ATOM 3096 HE21 GLN A 246 -37.394 43.826 21.229 1.00 0.00 H ATOM 3097 H GLN A 246 -38.392 38.549 23.072 1.00 0.00 H ATOM 3098 N PHE A 247 -40.616 36.848 21.313 1.00 14.78 N ATOM 3099 CA PHE A 247 -41.347 35.764 20.646 1.00 14.68 C ATOM 3100 C PHE A 247 -42.246 35.071 21.682 1.00 14.76 C ATOM 3101 O PHE A 247 -43.439 34.836 21.461 1.00 12.95 O ATOM 3102 CB PHE A 247 -40.358 34.781 20.009 1.00 14.63 C ATOM 3103 CG PHE A 247 -41.005 33.575 19.378 1.00 12.15 C ATOM 3104 CD1 PHE A 247 -41.304 32.462 20.142 1.00 10.87 C ATOM 3105 CD2 PHE A 247 -41.298 33.550 18.021 1.00 12.98 C ATOM 3106 CE1 PHE A 247 -41.894 31.349 19.568 1.00 14.04 C ATOM 3107 CE2 PHE A 247 -41.889 32.440 17.441 1.00 11.34 C ATOM 3108 CZ PHE A 247 -42.191 31.336 18.230 1.00 13.89 C ATOM 3109 HA PHE A 247 -41.973 36.160 19.847 1.00 0.00 H ATOM 3110 HB2 PHE A 247 -39.797 35.311 19.239 1.00 0.00 H ATOM 3111 HB3 PHE A 247 -39.672 34.436 20.783 1.00 0.00 H ATOM 3112 HD2 PHE A 247 -41.060 34.416 17.404 1.00 0.00 H ATOM 3113 HE2 PHE A 247 -42.115 32.432 16.375 1.00 0.00 H ATOM 3114 HZ PHE A 247 -42.664 30.461 17.785 1.00 0.00 H ATOM 3115 HE1 PHE A 247 -42.123 30.479 20.183 1.00 0.00 H ATOM 3116 HD1 PHE A 247 -41.073 32.461 21.207 1.00 0.00 H ATOM 3117 H PHE A 247 -39.580 36.803 21.392 1.00 0.00 H ATOM 3118 N ARG A 248 -41.681 34.805 22.847 1.00 15.65 N ATOM 3119 CA ARG A 248 -42.441 34.162 23.916 1.00 14.74 C ATOM 3120 C ARG A 248 -43.663 34.998 24.303 1.00 16.01 C ATOM 3121 O ARG A 248 -44.769 34.471 24.452 1.00 13.78 O ATOM 3122 CB ARG A 248 -41.534 33.928 25.128 1.00 17.09 C ATOM 3123 CG ARG A 248 -42.191 33.200 26.306 1.00 19.25 C ATOM 3124 CD ARG A 248 -42.852 34.172 27.274 1.00 19.92 C ATOM 3125 NE ARG A 248 -41.944 35.229 27.729 1.00 20.22 N ATOM 3126 CZ ARG A 248 -41.031 35.092 28.687 1.00 23.15 C ATOM 3127 NH1 ARG A 248 -40.866 33.925 29.307 1.00 23.97 N ATOM 3128 NH2 ARG A 248 -40.269 36.123 29.014 1.00 25.36 N ATOM 3129 HA ARG A 248 -42.803 33.199 23.555 1.00 0.00 H ATOM 3130 HB2 ARG A 248 -40.679 33.336 24.800 1.00 0.00 H ATOM 3131 HB3 ARG A 248 -41.188 34.899 25.482 1.00 0.00 H ATOM 3132 HG2 ARG A 248 -42.947 32.516 25.921 1.00 0.00 H ATOM 3133 HG3 ARG A 248 -41.429 32.633 26.840 1.00 0.00 H ATOM 3134 HD2 ARG A 248 -43.201 33.615 28.143 1.00 0.00 H ATOM 3135 HD3 ARG A 248 -43.703 34.635 26.775 1.00 0.00 H ATOM 3136 HE ARG A 248 -42.019 36.158 27.267 1.00 0.00 H ATOM 3137 HH12 ARG A 248 -40.149 33.830 30.054 1.00 0.00 H ATOM 3138 HH11 ARG A 248 -41.454 33.109 29.044 1.00 0.00 H ATOM 3139 HH22 ARG A 248 -39.553 36.024 29.762 1.00 0.00 H ATOM 3140 HH21 ARG A 248 -40.386 37.032 28.523 1.00 0.00 H ATOM 3141 H ARG A 248 -40.684 35.056 23.004 1.00 0.00 H ATOM 3142 N ASP A 249 -43.465 36.298 24.491 1.00 17.69 N ATOM 3143 CA ASP A 249 -44.576 37.185 24.832 1.00 16.91 C ATOM 3144 C ASP A 249 -45.655 37.248 23.723 1.00 19.43 C ATOM 3145 O ASP A 249 -46.853 37.368 24.014 1.00 15.87 O ATOM 3146 CB ASP A 249 -44.064 38.590 25.157 1.00 17.53 C ATOM 3147 CG ASP A 249 -43.196 38.634 26.426 1.00 22.83 C ATOM 3148 OD1 ASP A 249 -43.189 37.657 27.213 1.00 20.17 O ATOM 3149 OD2 ASP A 249 -42.518 39.666 26.643 1.00 21.55 O ATOM 3150 HA ASP A 249 -45.053 36.763 25.716 1.00 0.00 H ATOM 3151 HB2 ASP A 249 -43.469 38.946 24.316 1.00 0.00 H ATOM 3152 HB3 ASP A 249 -44.921 39.248 25.299 1.00 0.00 H ATOM 3153 H ASP A 249 -42.507 36.690 24.394 1.00 0.00 H ATOM 3154 N ALA A 250 -45.231 37.187 22.461 1.00 16.38 N ATOM 3155 CA ALA A 250 -46.177 37.197 21.342 1.00 19.55 C ATOM 3156 C ALA A 250 -47.006 35.908 21.287 1.00 17.29 C ATOM 3157 O ALA A 250 -48.204 35.953 21.006 1.00 15.78 O ATOM 3158 CB ALA A 250 -45.458 37.427 20.019 1.00 14.45 C ATOM 3159 HA ALA A 250 -46.864 38.026 21.510 1.00 0.00 H ATOM 3160 HB1 ALA A 250 -44.942 38.387 20.049 1.00 0.00 H ATOM 3161 HB2 ALA A 250 -44.734 36.629 19.857 1.00 0.00 H ATOM 3162 HB3 ALA A 250 -46.185 37.429 19.207 1.00 0.00 H ATOM 3163 H ALA A 250 -44.211 37.131 22.267 1.00 0.00 H ATOM 3164 N VAL A 251 -46.368 34.769 21.553 1.00 16.49 N ATOM 3165 CA VAL A 251 -47.090 33.501 21.643 1.00 15.08 C ATOM 3166 C VAL A 251 -48.172 33.599 22.721 1.00 18.52 C ATOM 3167 O VAL A 251 -49.314 33.171 22.528 1.00 14.31 O ATOM 3168 CB VAL A 251 -46.147 32.315 21.931 1.00 19.98 C ATOM 3169 CG1 VAL A 251 -46.935 31.041 22.304 1.00 16.54 C ATOM 3170 CG2 VAL A 251 -45.242 32.072 20.741 1.00 17.10 C ATOM 3171 HA VAL A 251 -47.555 33.312 20.675 1.00 0.00 H ATOM 3172 HB VAL A 251 -45.529 32.570 22.792 1.00 0.00 H ATOM 3173 HG11 VAL A 251 -47.531 31.232 23.196 1.00 0.00 H ATOM 3174 HG12 VAL A 251 -47.592 30.767 21.478 1.00 0.00 H ATOM 3175 HG13 VAL A 251 -46.236 30.227 22.500 1.00 0.00 H ATOM 3176 HG21 VAL A 251 -45.849 31.844 19.865 1.00 0.00 H ATOM 3177 HG22 VAL A 251 -44.648 32.965 20.550 1.00 0.00 H ATOM 3178 HG23 VAL A 251 -44.580 31.233 20.955 1.00 0.00 H ATOM 3179 H VAL A 251 -45.338 34.782 21.699 1.00 0.00 H ATOM 3180 N ALA A 252 -47.826 34.174 23.863 1.00 15.98 N ATOM 3181 CA ALA A 252 -48.831 34.355 24.903 1.00 17.70 C ATOM 3182 C ALA A 252 -50.019 35.187 24.423 1.00 16.77 C ATOM 3183 O ALA A 252 -51.170 34.830 24.680 1.00 17.59 O ATOM 3184 CB ALA A 252 -48.213 34.966 26.159 1.00 21.11 C ATOM 3185 HA ALA A 252 -49.213 33.365 25.151 1.00 0.00 H ATOM 3186 HB1 ALA A 252 -47.433 34.305 26.537 1.00 0.00 H ATOM 3187 HB2 ALA A 252 -47.782 35.937 25.915 1.00 0.00 H ATOM 3188 HB3 ALA A 252 -48.985 35.090 26.919 1.00 0.00 H ATOM 3189 H ALA A 252 -46.848 34.493 24.016 1.00 0.00 H ATOM 3190 N ASN A 253 -49.761 36.283 23.720 1.00 15.39 N ATOM 3191 CA ASN A 253 -50.857 37.097 23.220 1.00 14.61 C ATOM 3192 C ASN A 253 -51.706 36.377 22.177 1.00 13.63 C ATOM 3193 O ASN A 253 -52.920 36.560 22.099 1.00 12.74 O ATOM 3194 CB ASN A 253 -50.343 38.426 22.679 1.00 16.40 C ATOM 3195 CG ASN A 253 -49.915 39.368 23.804 1.00 28.41 C ATOM 3196 OD1 ASN A 253 -50.338 39.206 24.955 1.00 25.38 O ATOM 3197 ND2 ASN A 253 -49.063 40.331 23.484 1.00 28.52 N ATOM 3198 HA ASN A 253 -51.511 37.293 24.070 1.00 0.00 H ATOM 3199 HB2 ASN A 253 -49.487 38.237 22.032 1.00 0.00 H ATOM 3200 HB3 ASN A 253 -51.135 38.902 22.101 1.00 0.00 H ATOM 3201 HD22 ASN A 253 -48.734 40.429 22.502 1.00 0.00 H ATOM 3202 HD21 ASN A 253 -48.723 40.989 24.215 1.00 0.00 H ATOM 3203 H ASN A 253 -48.777 36.559 23.527 1.00 0.00 H ATOM 3204 N ILE A 254 -51.064 35.535 21.384 1.00 11.55 N ATOM 3205 CA ILE A 254 -51.817 34.728 20.441 1.00 12.60 C ATOM 3206 C ILE A 254 -52.742 33.764 21.183 1.00 13.44 C ATOM 3207 O ILE A 254 -53.919 33.613 20.841 1.00 9.76 O ATOM 3208 CB ILE A 254 -50.866 33.925 19.543 1.00 10.44 C ATOM 3209 CG1 ILE A 254 -50.213 34.874 18.519 1.00 9.74 C ATOM 3210 CG2 ILE A 254 -51.628 32.825 18.844 1.00 14.20 C ATOM 3211 CD1 ILE A 254 -48.940 34.300 17.864 1.00 12.62 C ATOM 3212 HA ILE A 254 -52.415 35.399 19.824 1.00 0.00 H ATOM 3213 HB ILE A 254 -50.084 33.467 20.148 1.00 0.00 H ATOM 3214 HG12 ILE A 254 -50.939 35.085 17.734 1.00 0.00 H ATOM 3215 HG13 ILE A 254 -49.950 35.801 19.028 1.00 0.00 H ATOM 3216 HD11 ILE A 254 -48.198 34.094 18.635 1.00 0.00 H ATOM 3217 HD12 ILE A 254 -49.187 33.377 17.340 1.00 0.00 H ATOM 3218 HD13 ILE A 254 -48.539 35.025 17.156 1.00 0.00 H ATOM 3219 HG21 ILE A 254 -52.069 32.161 19.588 1.00 0.00 H ATOM 3220 HG22 ILE A 254 -52.417 33.263 18.233 1.00 0.00 H ATOM 3221 HG23 ILE A 254 -50.946 32.260 18.209 1.00 0.00 H ATOM 3222 H ILE A 254 -50.029 35.452 21.436 1.00 0.00 H ATOM 3223 N THR A 255 -52.189 33.098 22.190 1.00 10.47 N ATOM 3224 CA THR A 255 -52.940 32.133 22.988 1.00 14.22 C ATOM 3225 C THR A 255 -54.108 32.814 23.706 1.00 14.92 C ATOM 3226 O THR A 255 -55.229 32.298 23.742 1.00 13.19 O ATOM 3227 CB THR A 255 -52.033 31.455 24.012 1.00 15.02 C ATOM 3228 OG1 THR A 255 -51.057 30.657 23.327 1.00 21.96 O ATOM 3229 CG2 THR A 255 -52.847 30.553 24.938 1.00 19.22 C ATOM 3230 HA THR A 255 -53.335 31.377 22.310 1.00 0.00 H ATOM 3231 HB THR A 255 -51.543 32.226 24.607 1.00 0.00 H ATOM 3232 HG1 THR A 255 -50.515 31.237 22.736 1.00 0.00 H ATOM 3233 HG23 THR A 255 -53.592 31.151 25.463 1.00 0.00 H ATOM 3234 HG21 THR A 255 -53.346 29.785 24.348 1.00 0.00 H ATOM 3235 HG22 THR A 255 -52.182 30.082 25.661 1.00 0.00 H ATOM 3236 H THR A 255 -51.189 33.269 22.418 1.00 0.00 H ATOM 3237 N THR A 256 -53.844 33.987 24.268 1.00 14.73 N ATOM 3238 CA THR A 256 -54.920 34.764 24.882 1.00 13.96 C ATOM 3239 C THR A 256 -56.043 35.119 23.889 1.00 13.30 C ATOM 3240 O THR A 256 -57.213 34.872 24.150 1.00 12.54 O ATOM 3241 CB THR A 256 -54.349 36.017 25.568 1.00 16.20 C ATOM 3242 OG1 THR A 256 -53.332 35.602 26.491 1.00 17.03 O ATOM 3243 CG2 THR A 256 -55.443 36.770 26.302 1.00 19.48 C ATOM 3244 HA THR A 256 -55.384 34.134 25.641 1.00 0.00 H ATOM 3245 HB THR A 256 -53.927 36.686 24.818 1.00 0.00 H ATOM 3246 HG1 THR A 256 -52.953 36.398 26.942 1.00 0.00 H ATOM 3247 HG23 THR A 256 -56.209 37.080 25.591 1.00 0.00 H ATOM 3248 HG21 THR A 256 -55.887 36.120 27.056 1.00 0.00 H ATOM 3249 HG22 THR A 256 -55.016 37.649 26.784 1.00 0.00 H ATOM 3250 H THR A 256 -52.871 34.354 24.272 1.00 0.00 H ATOM 3251 N SER A 257 -55.698 35.693 22.741 1.00 13.12 N ATOM 3252 CA SER A 257 -56.712 35.984 21.730 1.00 13.35 C ATOM 3253 C SER A 257 -57.506 34.754 21.322 1.00 11.08 C ATOM 3254 O SER A 257 -58.722 34.817 21.115 1.00 12.43 O ATOM 3255 CB SER A 257 -56.068 36.583 20.482 1.00 15.20 C ATOM 3256 OG SER A 257 -55.548 37.862 20.791 1.00 24.31 O ATOM 3257 HA SER A 257 -57.399 36.697 22.186 1.00 0.00 H ATOM 3258 HB2 SER A 257 -56.816 36.674 19.694 1.00 0.00 H ATOM 3259 HB3 SER A 257 -55.261 35.934 20.141 1.00 0.00 H ATOM 3260 HG SER A 257 -54.869 37.777 21.506 1.00 0.00 H ATOM 3261 H SER A 257 -54.703 35.936 22.562 1.00 0.00 H ATOM 3262 N ARG A 258 -56.811 33.643 21.137 1.00 13.90 N ATOM 3263 CA ARG A 258 -57.486 32.415 20.743 1.00 12.38 C ATOM 3264 C ARG A 258 -58.512 32.038 21.796 1.00 12.22 C ATOM 3265 O ARG A 258 -59.654 31.704 21.473 1.00 12.87 O ATOM 3266 CB ARG A 258 -56.475 31.279 20.581 1.00 12.59 C ATOM 3267 CG ARG A 258 -57.122 29.960 20.164 1.00 13.27 C ATOM 3268 CD ARG A 258 -56.155 28.791 20.287 1.00 15.72 C ATOM 3269 NE ARG A 258 -56.706 27.575 19.685 1.00 13.60 N ATOM 3270 CZ ARG A 258 -56.069 26.415 19.624 1.00 12.83 C ATOM 3271 NH1 ARG A 258 -54.841 26.280 20.124 1.00 12.43 N ATOM 3272 NH2 ARG A 258 -56.663 25.380 19.046 1.00 12.34 N ATOM 3273 HA ARG A 258 -57.985 32.579 19.788 1.00 0.00 H ATOM 3274 HB2 ARG A 258 -55.749 31.566 19.821 1.00 0.00 H ATOM 3275 HB3 ARG A 258 -55.964 31.130 21.532 1.00 0.00 H ATOM 3276 HG2 ARG A 258 -57.985 29.773 20.803 1.00 0.00 H ATOM 3277 HG3 ARG A 258 -57.449 30.040 19.127 1.00 0.00 H ATOM 3278 HD2 ARG A 258 -55.955 28.605 21.342 1.00 0.00 H ATOM 3279 HD3 ARG A 258 -55.224 29.046 19.782 1.00 0.00 H ATOM 3280 HE ARG A 258 -57.662 27.625 19.278 1.00 0.00 H ATOM 3281 HH12 ARG A 258 -54.355 25.362 20.068 1.00 0.00 H ATOM 3282 HH11 ARG A 258 -54.369 27.092 20.570 1.00 0.00 H ATOM 3283 HH22 ARG A 258 -56.174 24.464 18.991 1.00 0.00 H ATOM 3284 HH21 ARG A 258 -57.618 25.484 18.647 1.00 0.00 H ATOM 3285 H ARG A 258 -55.780 33.647 21.273 1.00 0.00 H ATOM 3286 N ALA A 259 -58.106 32.122 23.065 1.00 14.43 N ATOM 3287 CA ALA A 259 -58.991 31.778 24.182 1.00 14.24 C ATOM 3288 C ALA A 259 -60.228 32.677 24.172 1.00 14.39 C ATOM 3289 O ALA A 259 -61.332 32.257 24.517 1.00 13.60 O ATOM 3290 CB ALA A 259 -58.253 31.907 25.507 1.00 14.30 C ATOM 3291 HA ALA A 259 -59.310 30.742 24.066 1.00 0.00 H ATOM 3292 HB1 ALA A 259 -57.397 31.232 25.512 1.00 0.00 H ATOM 3293 HB2 ALA A 259 -57.908 32.934 25.631 1.00 0.00 H ATOM 3294 HB3 ALA A 259 -58.927 31.647 26.324 1.00 0.00 H ATOM 3295 H ALA A 259 -57.136 32.440 23.266 1.00 0.00 H ATOM 3296 N GLU A 260 -60.037 33.914 23.741 1.00 14.58 N ATOM 3297 CA GLU A 260 -61.125 34.881 23.683 1.00 14.96 C ATOM 3298 C GLU A 260 -62.097 34.596 22.539 1.00 16.27 C ATOM 3299 O GLU A 260 -63.317 34.626 22.726 1.00 13.80 O ATOM 3300 CB GLU A 260 -60.561 36.288 23.555 1.00 15.37 C ATOM 3301 CG GLU A 260 -59.856 36.750 24.826 1.00 14.70 C ATOM 3302 CD GLU A 260 -59.166 38.075 24.634 1.00 19.01 C ATOM 3303 OE1 GLU A 260 -59.215 38.596 23.501 1.00 17.72 O ATOM 3304 OE2 GLU A 260 -58.583 38.587 25.616 1.00 23.58 O ATOM 3305 HA GLU A 260 -61.689 34.794 24.612 1.00 0.00 H ATOM 3306 HB2 GLU A 260 -59.847 36.305 22.732 1.00 0.00 H ATOM 3307 HB3 GLU A 260 -61.379 36.975 23.339 1.00 0.00 H ATOM 3308 HG2 GLU A 260 -60.593 36.848 25.623 1.00 0.00 H ATOM 3309 HG3 GLU A 260 -59.114 36.003 25.109 1.00 0.00 H ATOM 3310 H GLU A 260 -59.086 34.203 23.436 1.00 0.00 H ATOM 3311 N MET A 261 -61.559 34.314 21.354 1.00 14.36 N ATOM 3312 CA MET A 261 -62.429 33.963 20.228 1.00 14.86 C ATOM 3313 C MET A 261 -63.178 32.639 20.449 1.00 14.76 C ATOM 3314 O MET A 261 -64.243 32.420 19.866 1.00 15.73 O ATOM 3315 CB MET A 261 -61.647 33.933 18.910 1.00 17.02 C ATOM 3316 CG MET A 261 -61.300 35.310 18.405 1.00 14.68 C ATOM 3317 SD MET A 261 -60.359 35.273 16.892 1.00 15.46 S ATOM 3318 CE MET A 261 -58.701 34.977 17.512 1.00 11.69 C ATOM 3319 HA MET A 261 -63.183 34.748 20.164 1.00 0.00 H ATOM 3320 HB2 MET A 261 -60.723 33.376 19.065 1.00 0.00 H ATOM 3321 HB3 MET A 261 -62.252 33.428 18.157 1.00 0.00 H ATOM 3322 HG2 MET A 261 -60.714 35.824 19.167 1.00 0.00 H ATOM 3323 HG3 MET A 261 -62.224 35.859 18.227 1.00 0.00 H ATOM 3324 HE1 MET A 261 -58.414 35.789 18.180 1.00 0.00 H ATOM 3325 HE2 MET A 261 -58.681 34.033 18.056 1.00 0.00 H ATOM 3326 HE3 MET A 261 -58.004 34.930 16.675 1.00 0.00 H ATOM 3327 H MET A 261 -60.527 34.343 21.228 1.00 0.00 H ATOM 3328 N THR A 262 -62.626 31.769 21.286 1.00 14.73 N ATOM 3329 CA THR A 262 -63.292 30.511 21.615 1.00 15.65 C ATOM 3330 C THR A 262 -64.585 30.821 22.355 1.00 16.16 C ATOM 3331 O THR A 262 -65.653 30.260 22.059 1.00 15.45 O ATOM 3332 CB THR A 262 -62.407 29.604 22.487 1.00 16.86 C ATOM 3333 OG1 THR A 262 -61.222 29.238 21.771 1.00 11.23 O ATOM 3334 CG2 THR A 262 -63.147 28.338 22.874 1.00 18.06 C ATOM 3335 HA THR A 262 -63.496 29.978 20.686 1.00 0.00 H ATOM 3336 HB THR A 262 -62.145 30.160 23.388 1.00 0.00 H ATOM 3337 HG1 THR A 262 -61.473 28.752 20.946 1.00 0.00 H ATOM 3338 HG23 THR A 262 -64.053 28.601 23.421 1.00 0.00 H ATOM 3339 HG21 THR A 262 -63.412 27.784 21.974 1.00 0.00 H ATOM 3340 HG22 THR A 262 -62.506 27.722 23.505 1.00 0.00 H ATOM 3341 H THR A 262 -61.704 31.987 21.715 1.00 0.00 H ATOM 3342 N VAL A 263 -64.479 31.724 23.327 1.00 14.54 N ATOM 3343 CA VAL A 263 -65.641 32.225 24.050 1.00 15.59 C ATOM 3344 C VAL A 263 -66.650 32.961 23.166 1.00 16.80 C ATOM 3345 O VAL A 263 -67.857 32.709 23.229 1.00 17.93 O ATOM 3346 CB VAL A 263 -65.206 33.155 25.215 1.00 19.10 C ATOM 3347 CG1 VAL A 263 -66.399 33.990 25.706 1.00 20.23 C ATOM 3348 CG2 VAL A 263 -64.604 32.313 26.331 1.00 16.78 C ATOM 3349 HA VAL A 263 -66.144 31.340 24.439 1.00 0.00 H ATOM 3350 HB VAL A 263 -64.446 33.855 24.867 1.00 0.00 H ATOM 3351 HG11 VAL A 263 -66.776 34.600 24.885 1.00 0.00 H ATOM 3352 HG12 VAL A 263 -67.187 33.324 26.057 1.00 0.00 H ATOM 3353 HG13 VAL A 263 -66.077 34.636 26.523 1.00 0.00 H ATOM 3354 HG21 VAL A 263 -65.348 31.601 26.689 1.00 0.00 H ATOM 3355 HG22 VAL A 263 -63.737 31.774 25.950 1.00 0.00 H ATOM 3356 HG23 VAL A 263 -64.298 32.963 27.150 1.00 0.00 H ATOM 3357 H VAL A 263 -63.536 32.084 23.579 1.00 0.00 H ATOM 3358 N GLN A 264 -66.164 33.884 22.347 1.00 13.96 N ATOM 3359 CA GLN A 264 -67.042 34.639 21.466 1.00 17.27 C ATOM 3360 C GLN A 264 -67.811 33.717 20.507 1.00 18.43 C ATOM 3361 O GLN A 264 -69.028 33.861 20.320 1.00 18.26 O ATOM 3362 CB GLN A 264 -66.214 35.674 20.707 1.00 17.25 C ATOM 3363 CG GLN A 264 -65.661 36.728 21.639 1.00 16.76 C ATOM 3364 CD GLN A 264 -64.353 37.350 21.166 1.00 23.79 C ATOM 3365 OE1 GLN A 264 -63.779 36.947 20.150 1.00 16.87 O ATOM 3366 NE2 GLN A 264 -63.872 38.337 21.920 1.00 16.93 N ATOM 3367 HA GLN A 264 -67.793 35.153 22.066 1.00 0.00 H ATOM 3368 HB2 GLN A 264 -65.385 35.170 20.209 1.00 0.00 H ATOM 3369 HB3 GLN A 264 -66.846 36.156 19.961 1.00 0.00 H ATOM 3370 HG2 GLN A 264 -66.402 37.521 21.738 1.00 0.00 H ATOM 3371 HG3 GLN A 264 -65.490 36.269 22.613 1.00 0.00 H ATOM 3372 HE22 GLN A 264 -64.390 38.644 22.768 1.00 0.00 H ATOM 3373 HE21 GLN A 264 -62.978 38.801 21.661 1.00 0.00 H ATOM 3374 H GLN A 264 -65.141 34.071 22.334 1.00 0.00 H ATOM 3375 N GLY A 265 -67.092 32.770 19.913 1.00 16.11 N ATOM 3376 CA GLY A 265 -67.697 31.760 19.063 1.00 17.65 C ATOM 3377 C GLY A 265 -68.799 30.998 19.776 1.00 20.30 C ATOM 3378 O GLY A 265 -69.907 30.842 19.247 1.00 21.32 O ATOM 3379 HA3 GLY A 265 -66.926 31.055 18.752 1.00 0.00 H ATOM 3380 HA2 GLY A 265 -68.118 32.247 18.184 1.00 0.00 H ATOM 3381 H GLY A 265 -66.063 32.752 20.062 1.00 0.00 H ATOM 3382 N ALA A 266 -68.526 30.540 20.990 1.00 15.34 N ATOM 3383 CA ALA A 266 -69.567 29.866 21.742 1.00 19.61 C ATOM 3384 C ALA A 266 -70.760 30.802 21.970 1.00 19.93 C ATOM 3385 O ALA A 266 -71.905 30.371 21.897 1.00 17.10 O ATOM 3386 CB ALA A 266 -69.041 29.308 23.050 1.00 20.68 C ATOM 3387 HA ALA A 266 -69.911 29.017 21.151 1.00 0.00 H ATOM 3388 HB1 ALA A 266 -68.246 28.591 22.844 1.00 0.00 H ATOM 3389 HB2 ALA A 266 -68.649 30.122 23.659 1.00 0.00 H ATOM 3390 HB3 ALA A 266 -69.851 28.811 23.583 1.00 0.00 H ATOM 3391 H ALA A 266 -67.577 30.663 21.398 1.00 0.00 H ATOM 3392 N ASP A 267 -70.493 32.083 22.213 1.00 20.53 N ATOM 3393 CA ASP A 267 -71.569 33.047 22.445 1.00 22.40 C ATOM 3394 C ASP A 267 -72.389 33.297 21.178 1.00 25.42 C ATOM 3395 O ASP A 267 -73.627 33.311 21.218 1.00 26.76 O ATOM 3396 CB ASP A 267 -71.011 34.365 23.001 1.00 21.63 C ATOM 3397 CG ASP A 267 -71.991 35.527 22.869 1.00 28.37 C ATOM 3398 OD1 ASP A 267 -73.219 35.307 22.943 1.00 31.16 O ATOM 3399 OD2 ASP A 267 -71.530 36.675 22.686 1.00 36.30 O ATOM 3400 HA ASP A 267 -72.239 32.615 23.189 1.00 0.00 H ATOM 3401 HB2 ASP A 267 -70.776 34.226 24.056 1.00 0.00 H ATOM 3402 HB3 ASP A 267 -70.100 34.614 22.457 1.00 0.00 H ATOM 3403 H ASP A 267 -69.504 32.404 22.238 1.00 0.00 H ATOM 3404 N ILE A 268 -71.692 33.489 20.056 1.00 24.62 N ATOM 3405 CA ILE A 268 -72.330 33.666 18.760 1.00 23.36 C ATOM 3406 C ILE A 268 -73.169 32.439 18.366 1.00 27.94 C ATOM 3407 O ILE A 268 -74.312 32.577 17.912 1.00 24.92 O ATOM 3408 CB ILE A 268 -71.290 33.972 17.660 1.00 24.55 C ATOM 3409 CG1 ILE A 268 -70.737 35.395 17.825 1.00 20.69 C ATOM 3410 CG2 ILE A 268 -71.918 33.810 16.298 1.00 23.08 C ATOM 3411 CD1 ILE A 268 -69.317 35.576 17.297 1.00 23.35 C ATOM 3412 HA ILE A 268 -73.001 34.520 18.852 1.00 0.00 H ATOM 3413 HB ILE A 268 -70.463 33.268 17.754 1.00 0.00 H ATOM 3414 HG12 ILE A 268 -71.392 36.082 17.289 1.00 0.00 H ATOM 3415 HG13 ILE A 268 -70.742 35.644 18.886 1.00 0.00 H ATOM 3416 HD11 ILE A 268 -68.644 34.905 17.831 1.00 0.00 H ATOM 3417 HD12 ILE A 268 -69.294 35.343 16.232 1.00 0.00 H ATOM 3418 HD13 ILE A 268 -69.002 36.608 17.452 1.00 0.00 H ATOM 3419 HG21 ILE A 268 -72.273 32.786 16.182 1.00 0.00 H ATOM 3420 HG22 ILE A 268 -72.757 34.500 16.202 1.00 0.00 H ATOM 3421 HG23 ILE A 268 -71.177 34.028 15.529 1.00 0.00 H ATOM 3422 H ILE A 268 -70.654 33.513 20.110 1.00 0.00 H ATOM 3423 N VAL A 269 -72.604 31.246 18.540 1.00 22.53 N ATOM 3424 CA VAL A 269 -73.353 30.012 18.306 1.00 26.95 C ATOM 3425 C VAL A 269 -74.670 30.012 19.086 1.00 27.91 C ATOM 3426 O VAL A 269 -75.739 29.782 18.517 1.00 23.39 O ATOM 3427 CB VAL A 269 -72.515 28.744 18.632 1.00 28.78 C ATOM 3428 CG1 VAL A 269 -73.413 27.534 18.850 1.00 28.88 C ATOM 3429 CG2 VAL A 269 -71.499 28.467 17.518 1.00 24.68 C ATOM 3430 HA VAL A 269 -73.584 29.978 17.241 1.00 0.00 H ATOM 3431 HB VAL A 269 -71.971 28.930 19.558 1.00 0.00 H ATOM 3432 HG11 VAL A 269 -74.088 27.730 19.683 1.00 0.00 H ATOM 3433 HG12 VAL A 269 -73.993 27.346 17.947 1.00 0.00 H ATOM 3434 HG13 VAL A 269 -72.798 26.663 19.076 1.00 0.00 H ATOM 3435 HG21 VAL A 269 -72.027 28.310 16.577 1.00 0.00 H ATOM 3436 HG22 VAL A 269 -70.827 29.320 17.421 1.00 0.00 H ATOM 3437 HG23 VAL A 269 -70.923 27.575 17.767 1.00 0.00 H ATOM 3438 H VAL A 269 -71.612 31.191 18.848 1.00 0.00 H ATOM 3439 N LYS A 270 -74.586 30.291 20.385 1.00 27.21 N ATOM 3440 CA LYS A 270 -75.763 30.382 21.247 1.00 27.15 C ATOM 3441 C LYS A 270 -76.856 31.332 20.726 1.00 28.94 C ATOM 3442 O LYS A 270 -78.018 30.946 20.611 1.00 26.06 O ATOM 3443 CB LYS A 270 -75.329 30.783 22.665 1.00 30.65 C ATOM 3444 CG LYS A 270 -76.456 31.122 23.606 1.00 34.34 C ATOM 3445 CD LYS A 270 -75.921 31.341 25.020 1.00 37.51 C ATOM 3446 CE LYS A 270 -76.250 32.745 25.534 1.00 39.68 C ATOM 3447 NZ LYS A 270 -77.718 33.010 25.538 1.00 35.39 N ATOM 3448 HA LYS A 270 -76.221 29.393 21.253 1.00 0.00 H ATOM 3449 HB2 LYS A 270 -74.768 29.953 23.094 1.00 0.00 H ATOM 3450 HB3 LYS A 270 -74.681 31.656 22.586 1.00 0.00 H ATOM 3451 HG2 LYS A 270 -76.949 32.032 23.263 1.00 0.00 H ATOM 3452 HG3 LYS A 270 -77.175 30.302 23.616 1.00 0.00 H ATOM 3453 HD2 LYS A 270 -76.370 30.605 25.687 1.00 0.00 H ATOM 3454 HD3 LYS A 270 -74.839 31.211 25.014 1.00 0.00 H ATOM 3455 HE2 LYS A 270 -75.762 33.478 24.892 1.00 0.00 H ATOM 3456 HE3 LYS A 270 -75.871 32.845 26.551 1.00 0.00 H ATOM 3457 HZ1 LYS A 270 -78.087 32.924 24.570 1.00 0.00 H ATOM 3458 HZ2 LYS A 270 -78.192 32.319 26.154 1.00 0.00 H ATOM 3459 HZ3 LYS A 270 -77.895 33.971 25.893 1.00 0.00 H ATOM 3460 H LYS A 270 -73.647 30.450 20.803 1.00 0.00 H ATOM 3461 N ARG A 271 -76.489 32.570 20.414 1.00 28.74 N ATOM 3462 CA ARG A 271 -77.468 33.566 19.958 1.00 27.64 C ATOM 3463 C ARG A 271 -78.053 33.248 18.583 1.00 27.53 C ATOM 3464 O ARG A 271 -79.240 33.488 18.320 1.00 28.84 O ATOM 3465 CB ARG A 271 -76.849 34.972 19.928 1.00 26.52 C ATOM 3466 CG ARG A 271 -77.266 35.865 21.085 1.00 30.21 C ATOM 3467 CD ARG A 271 -76.494 35.536 22.346 1.00 30.42 C ATOM 3468 NE ARG A 271 -76.975 36.310 23.489 1.00 31.74 N ATOM 3469 CZ ARG A 271 -76.192 36.803 24.439 1.00 32.75 C ATOM 3470 NH1 ARG A 271 -74.881 36.614 24.383 1.00 32.77 N ATOM 3471 NH2 ARG A 271 -76.717 37.486 25.448 1.00 34.30 N ATOM 3472 HA ARG A 271 -78.283 33.532 20.681 1.00 0.00 H ATOM 3473 HB2 ARG A 271 -75.764 34.868 19.951 1.00 0.00 H ATOM 3474 HB3 ARG A 271 -77.147 35.456 18.998 1.00 0.00 H ATOM 3475 HG2 ARG A 271 -77.079 36.905 20.816 1.00 0.00 H ATOM 3476 HG3 ARG A 271 -78.330 35.726 21.274 1.00 0.00 H ATOM 3477 HD2 ARG A 271 -75.440 35.761 22.185 1.00 0.00 H ATOM 3478 HD3 ARG A 271 -76.608 34.474 22.564 1.00 0.00 H ATOM 3479 HE ARG A 271 -77.998 36.485 23.562 1.00 0.00 H ATOM 3480 HH12 ARG A 271 -74.268 37.001 25.128 1.00 0.00 H ATOM 3481 HH11 ARG A 271 -74.466 36.079 23.594 1.00 0.00 H ATOM 3482 HH22 ARG A 271 -76.101 37.871 26.192 1.00 0.00 H ATOM 3483 HH21 ARG A 271 -77.745 37.636 25.495 1.00 0.00 H ATOM 3484 H ARG A 271 -75.488 32.840 20.494 1.00 0.00 H ATOM 3485 N SER A 272 -77.209 32.739 17.694 1.00 27.36 N ATOM 3486 CA SER A 272 -77.650 32.367 16.356 1.00 26.30 C ATOM 3487 C SER A 272 -78.584 31.164 16.404 1.00 28.38 C ATOM 3488 O SER A 272 -79.552 31.086 15.639 1.00 24.43 O ATOM 3489 CB SER A 272 -76.451 32.078 15.448 1.00 28.71 C ATOM 3490 OG SER A 272 -75.931 33.281 14.901 1.00 32.55 O ATOM 3491 HA SER A 272 -78.201 33.210 15.940 1.00 0.00 H ATOM 3492 HB2 SER A 272 -76.767 31.423 14.636 1.00 0.00 H ATOM 3493 HB3 SER A 272 -75.673 31.584 16.030 1.00 0.00 H ATOM 3494 HG SER A 272 -75.158 33.071 14.319 1.00 0.00 H ATOM 3495 H SER A 272 -76.212 32.603 17.958 1.00 0.00 H ATOM 3496 N ASP A 273 -78.292 30.232 17.307 1.00 27.55 N ATOM 3497 CA ASP A 273 -79.192 29.107 17.558 1.00 25.92 C ATOM 3498 C ASP A 273 -80.563 29.595 18.015 1.00 30.30 C ATOM 3499 O ASP A 273 -81.591 29.030 17.636 1.00 27.85 O ATOM 3500 CB ASP A 273 -78.619 28.165 18.627 1.00 28.88 C ATOM 3501 CG ASP A 273 -77.642 27.154 18.061 1.00 35.07 C ATOM 3502 OD1 ASP A 273 -77.448 27.145 16.824 1.00 35.55 O ATOM 3503 OD2 ASP A 273 -77.071 26.366 18.855 1.00 37.16 O ATOM 3504 HA ASP A 273 -79.294 28.564 16.618 1.00 0.00 H ATOM 3505 HB2 ASP A 273 -78.104 28.764 19.378 1.00 0.00 H ATOM 3506 HB3 ASP A 273 -79.444 27.628 19.095 1.00 0.00 H ATOM 3507 H ASP A 273 -77.405 30.305 17.846 1.00 0.00 H ATOM 3508 N ALA A 274 -80.574 30.627 18.855 1.00 27.80 N ATOM 3509 CA ALA A 274 -81.825 31.146 19.403 1.00 26.58 C ATOM 3510 C ALA A 274 -82.660 31.852 18.340 1.00 29.05 C ATOM 3511 O ALA A 274 -83.887 31.718 18.312 1.00 29.89 O ATOM 3512 CB ALA A 274 -81.551 32.075 20.573 1.00 33.34 C ATOM 3513 HA ALA A 274 -82.404 30.294 19.760 1.00 0.00 H ATOM 3514 HB1 ALA A 274 -81.023 31.528 21.354 1.00 0.00 H ATOM 3515 HB2 ALA A 274 -80.939 32.911 20.236 1.00 0.00 H ATOM 3516 HB3 ALA A 274 -82.496 32.450 20.966 1.00 0.00 H ATOM 3517 H ALA A 274 -79.675 31.073 19.127 1.00 0.00 H ATOM 3518 N LEU A 275 -82.007 32.615 17.467 1.00 24.74 N ATOM 3519 CA LEU A 275 -82.705 33.162 16.311 1.00 23.36 C ATOM 3520 C LEU A 275 -83.335 32.025 15.525 1.00 30.11 C ATOM 3521 O LEU A 275 -84.504 32.088 15.139 1.00 26.50 O ATOM 3522 CB LEU A 275 -81.753 33.945 15.413 1.00 27.88 C ATOM 3523 CG LEU A 275 -81.307 35.310 15.933 1.00 26.24 C ATOM 3524 CD1 LEU A 275 -80.002 35.738 15.289 1.00 26.06 C ATOM 3525 CD2 LEU A 275 -82.396 36.342 15.686 1.00 24.11 C ATOM 3526 HA LEU A 275 -83.477 33.847 16.662 1.00 0.00 H ATOM 3527 HB2 LEU A 275 -80.860 33.337 15.264 1.00 0.00 H ATOM 3528 HB3 LEU A 275 -82.250 34.100 14.455 1.00 0.00 H ATOM 3529 HG LEU A 275 -81.136 35.232 17.007 1.00 0.00 H ATOM 3530 HD21 LEU A 275 -82.593 36.412 14.616 1.00 0.00 H ATOM 3531 HD22 LEU A 275 -83.306 36.040 16.205 1.00 0.00 H ATOM 3532 HD23 LEU A 275 -82.068 37.312 16.061 1.00 0.00 H ATOM 3533 HD11 LEU A 275 -79.228 35.006 15.519 1.00 0.00 H ATOM 3534 HD12 LEU A 275 -80.135 35.801 14.209 1.00 0.00 H ATOM 3535 HD13 LEU A 275 -79.709 36.713 15.678 1.00 0.00 H ATOM 3536 H LEU A 275 -80.998 32.821 17.610 1.00 0.00 H ATOM 3537 N TYR A 276 -82.561 30.974 15.296 1.00 24.98 N ATOM 3538 CA TYR A 276 -83.077 29.858 14.514 1.00 33.83 C ATOM 3539 C TYR A 276 -84.310 29.241 15.169 1.00 32.46 C ATOM 3540 O TYR A 276 -85.295 28.945 14.494 1.00 33.44 O ATOM 3541 CB TYR A 276 -82.012 28.786 14.284 1.00 32.06 C ATOM 3542 CG TYR A 276 -82.550 27.610 13.507 1.00 37.75 C ATOM 3543 CD1 TYR A 276 -82.658 27.662 12.121 1.00 42.00 C ATOM 3544 CD2 TYR A 276 -82.979 26.459 14.160 1.00 39.77 C ATOM 3545 CE1 TYR A 276 -83.162 26.597 11.403 1.00 40.10 C ATOM 3546 CE2 TYR A 276 -83.484 25.382 13.447 1.00 44.76 C ATOM 3547 CZ TYR A 276 -83.572 25.459 12.068 1.00 44.27 C ATOM 3548 OH TYR A 276 -84.072 24.393 11.353 1.00 48.39 O ATOM 3549 HA TYR A 276 -83.366 30.262 13.544 1.00 0.00 H ATOM 3550 HB3 TYR A 276 -81.652 28.434 15.251 1.00 0.00 H ATOM 3551 HB2 TYR A 276 -81.184 29.226 13.728 1.00 0.00 H ATOM 3552 HD2 TYR A 276 -82.917 26.403 15.247 1.00 0.00 H ATOM 3553 HE2 TYR A 276 -83.809 24.482 13.969 1.00 0.00 H ATOM 3554 HE1 TYR A 276 -83.236 26.654 10.317 1.00 0.00 H ATOM 3555 HD1 TYR A 276 -82.339 28.560 11.593 1.00 0.00 H ATOM 3556 HH TYR A 276 -84.066 24.613 10.388 1.00 0.00 H ATOM 3557 H TYR A 276 -81.592 30.946 15.672 1.00 0.00 H ATOM 3558 N GLN A 277 -84.255 29.043 16.482 1.00 31.20 N ATOM 3559 CA GLN A 277 -85.370 28.423 17.188 1.00 33.77 C ATOM 3560 C GLN A 277 -86.653 29.249 17.081 1.00 34.79 C ATOM 3561 O GLN A 277 -87.741 28.697 16.909 1.00 35.74 O ATOM 3562 CB GLN A 277 -85.008 28.143 18.647 1.00 33.45 C ATOM 3563 CG GLN A 277 -84.078 26.952 18.813 1.00 37.66 C ATOM 3564 CD GLN A 277 -84.721 25.664 18.340 1.00 37.85 C ATOM 3565 OE1 GLN A 277 -85.799 25.303 18.806 1.00 46.20 O ATOM 3566 NE2 GLN A 277 -84.065 24.963 17.412 1.00 40.22 N ATOM 3567 HA GLN A 277 -85.568 27.469 16.700 1.00 0.00 H ATOM 3568 HB2 GLN A 277 -84.519 29.026 19.059 1.00 0.00 H ATOM 3569 HB3 GLN A 277 -85.926 27.946 19.201 1.00 0.00 H ATOM 3570 HG2 GLN A 277 -83.172 27.128 18.233 1.00 0.00 H ATOM 3571 HG3 GLN A 277 -83.819 26.851 19.867 1.00 0.00 H ATOM 3572 HE22 GLN A 277 -83.155 25.308 17.047 1.00 0.00 H ATOM 3573 HE21 GLN A 277 -84.465 24.072 17.055 1.00 0.00 H ATOM 3574 H GLN A 277 -83.408 29.333 17.011 1.00 0.00 H ATOM 3575 N ILE A 278 -86.524 30.571 17.177 1.00 34.54 N ATOM 3576 CA ILE A 278 -87.679 31.461 17.044 1.00 35.42 C ATOM 3577 C ILE A 278 -88.365 31.274 15.694 1.00 34.69 C ATOM 3578 O ILE A 278 -89.591 31.153 15.619 1.00 37.51 O ATOM 3579 CB ILE A 278 -87.278 32.947 17.187 1.00 32.18 C ATOM 3580 CG1 ILE A 278 -86.954 33.283 18.647 1.00 29.12 C ATOM 3581 CG2 ILE A 278 -88.389 33.854 16.651 1.00 32.78 C ATOM 3582 CD1 ILE A 278 -86.228 34.594 18.812 1.00 30.16 C ATOM 3583 HA ILE A 278 -88.365 31.196 17.848 1.00 0.00 H ATOM 3584 HB ILE A 278 -86.380 33.121 16.595 1.00 0.00 H ATOM 3585 HG12 ILE A 278 -87.888 33.332 19.206 1.00 0.00 H ATOM 3586 HG13 ILE A 278 -86.330 32.488 19.055 1.00 0.00 H ATOM 3587 HD11 ILE A 278 -85.285 34.557 18.267 1.00 0.00 H ATOM 3588 HD12 ILE A 278 -86.845 35.402 18.418 1.00 0.00 H ATOM 3589 HD13 ILE A 278 -86.031 34.768 19.870 1.00 0.00 H ATOM 3590 HG21 ILE A 278 -88.561 33.632 15.598 1.00 0.00 H ATOM 3591 HG22 ILE A 278 -89.305 33.677 17.215 1.00 0.00 H ATOM 3592 HG23 ILE A 278 -88.089 34.896 16.760 1.00 0.00 H ATOM 3593 H ILE A 278 -85.583 30.980 17.350 1.00 0.00 H ATOM 3594 N GLN A 279 -87.564 31.261 14.632 1.00 31.17 N ATOM 3595 CA GLN A 279 -88.078 31.061 13.282 1.00 36.50 C ATOM 3596 C GLN A 279 -88.747 29.694 13.132 1.00 41.50 C ATOM 3597 O GLN A 279 -89.819 29.571 12.531 1.00 36.59 O ATOM 3598 CB GLN A 279 -86.957 31.214 12.253 1.00 34.48 C ATOM 3599 CG GLN A 279 -86.426 32.637 12.139 1.00 29.85 C ATOM 3600 CD GLN A 279 -87.538 33.635 11.909 1.00 32.64 C ATOM 3601 OE1 GLN A 279 -88.419 33.417 11.078 1.00 29.47 O ATOM 3602 NE2 GLN A 279 -87.508 34.738 12.652 1.00 34.16 N ATOM 3603 HA GLN A 279 -88.833 31.826 13.102 1.00 0.00 H ATOM 3604 HB2 GLN A 279 -86.133 30.560 12.540 1.00 0.00 H ATOM 3605 HB3 GLN A 279 -87.339 30.909 11.279 1.00 0.00 H ATOM 3606 HG2 GLN A 279 -85.906 32.895 13.061 1.00 0.00 H ATOM 3607 HG3 GLN A 279 -85.728 32.687 11.303 1.00 0.00 H ATOM 3608 HE22 GLN A 279 -86.743 34.879 13.342 1.00 0.00 H ATOM 3609 HE21 GLN A 279 -88.249 35.459 12.543 1.00 0.00 H ATOM 3610 H GLN A 279 -86.542 31.397 14.768 1.00 0.00 H ATOM 3611 N LEU A 280 -88.103 28.671 13.683 1.00 38.83 N ATOM 3612 CA LEU A 280 -88.625 27.310 13.626 1.00 44.12 C ATOM 3613 C LEU A 280 -90.010 27.243 14.272 1.00 44.79 C ATOM 3614 O LEU A 280 -90.905 26.548 13.782 1.00 46.37 O ATOM 3615 CB LEU A 280 -87.655 26.351 14.320 1.00 44.10 C ATOM 3616 CG LEU A 280 -87.976 24.856 14.310 1.00 49.44 C ATOM 3617 CD1 LEU A 280 -88.040 24.327 12.884 1.00 45.04 C ATOM 3618 CD2 LEU A 280 -86.941 24.096 15.125 1.00 47.24 C ATOM 3619 HA LEU A 280 -88.723 27.011 12.583 1.00 0.00 H ATOM 3620 HB2 LEU A 280 -86.683 26.475 13.843 1.00 0.00 H ATOM 3621 HB3 LEU A 280 -87.588 26.659 15.363 1.00 0.00 H ATOM 3622 HG LEU A 280 -88.955 24.705 14.765 1.00 0.00 H ATOM 3623 HD21 LEU A 280 -85.953 24.254 14.693 1.00 0.00 H ATOM 3624 HD22 LEU A 280 -86.952 24.459 16.153 1.00 0.00 H ATOM 3625 HD23 LEU A 280 -87.179 23.032 15.111 1.00 0.00 H ATOM 3626 HD11 LEU A 280 -88.818 24.858 12.335 1.00 0.00 H ATOM 3627 HD12 LEU A 280 -87.078 24.484 12.396 1.00 0.00 H ATOM 3628 HD13 LEU A 280 -88.270 23.262 12.903 1.00 0.00 H ATOM 3629 H LEU A 280 -87.200 28.846 14.169 1.00 0.00 H ATOM 3630 N GLU A 281 -90.184 27.981 15.365 1.00 44.38 N ATOM 3631 CA GLU A 281 -91.454 28.016 16.085 1.00 47.09 C ATOM 3632 C GLU A 281 -92.603 28.605 15.269 1.00 53.22 C ATOM 3633 O GLU A 281 -93.762 28.546 15.688 1.00 53.51 O ATOM 3634 CB GLU A 281 -91.307 28.794 17.392 1.00 48.93 C ATOM 3635 CG GLU A 281 -90.619 28.027 18.502 1.00 50.25 C ATOM 3636 CD GLU A 281 -90.493 28.851 19.766 1.00 58.33 C ATOM 3637 OE1 GLU A 281 -90.409 30.095 19.653 1.00 55.10 O ATOM 3638 OE2 GLU A 281 -90.481 28.257 20.866 1.00 63.93 O ATOM 3639 HA GLU A 281 -91.709 26.976 16.290 1.00 0.00 H ATOM 3640 HB2 GLU A 281 -90.728 29.695 17.190 1.00 0.00 H ATOM 3641 HB3 GLU A 281 -92.303 29.074 17.737 1.00 0.00 H ATOM 3642 HG2 GLU A 281 -91.198 27.130 18.722 1.00 0.00 H ATOM 3643 HG3 GLU A 281 -89.622 27.741 18.167 1.00 0.00 H ATOM 3644 H GLU A 281 -89.390 28.552 15.718 1.00 0.00 H ATOM 3645 N ARG A 282 -92.286 29.177 14.111 1.00 49.84 N ATOM 3646 CA ARG A 282 -93.320 29.711 13.227 1.00 52.53 C ATOM 3647 C ARG A 282 -93.746 28.686 12.177 1.00 54.34 C ATOM 3648 O ARG A 282 -93.402 27.506 12.264 1.00 53.73 O ATOM 3649 CB ARG A 282 -92.842 31.001 12.550 1.00 50.56 C ATOM 3650 CG ARG A 282 -92.360 32.064 13.523 1.00 45.72 C ATOM 3651 CD ARG A 282 -91.893 33.317 12.794 1.00 45.49 C ATOM 3652 NE ARG A 282 -91.398 34.335 13.720 1.00 47.18 N ATOM 3653 CZ ARG A 282 -91.147 35.597 13.377 1.00 42.21 C ATOM 3654 NH1 ARG A 282 -91.352 35.996 12.128 1.00 41.67 N ATOM 3655 NH2 ARG A 282 -90.697 36.462 14.280 1.00 30.06 N ATOM 3656 HA ARG A 282 -94.190 29.940 13.842 1.00 0.00 H ATOM 3657 HB2 ARG A 282 -92.021 30.752 11.878 1.00 0.00 H ATOM 3658 HB3 ARG A 282 -93.670 31.413 11.973 1.00 0.00 H ATOM 3659 HG2 ARG A 282 -93.178 32.328 14.193 1.00 0.00 H ATOM 3660 HG3 ARG A 282 -91.530 31.662 14.105 1.00 0.00 H ATOM 3661 HD2 ARG A 282 -92.730 33.730 12.231 1.00 0.00 H ATOM 3662 HD3 ARG A 282 -91.092 33.047 12.106 1.00 0.00 H ATOM 3663 HE ARG A 282 -91.232 34.056 14.708 1.00 0.00 H ATOM 3664 HH12 ARG A 282 -91.157 36.981 11.858 1.00 0.00 H ATOM 3665 HH11 ARG A 282 -91.708 35.323 11.419 1.00 0.00 H ATOM 3666 HH22 ARG A 282 -90.503 37.446 14.006 1.00 0.00 H ATOM 3667 HH21 ARG A 282 -90.539 36.155 15.261 1.00 0.00 H ATOM 3668 H ARG A 282 -91.287 29.245 13.830 1.00 0.00 H TER 3669 ARG A 282 ATOM 3670 N SER B 48 -89.948 16.314 14.595 1.00 30.54 N ATOM 3671 CA SER B 48 -88.832 15.934 15.458 1.00 30.01 C ATOM 3672 C SER B 48 -87.605 15.513 14.645 1.00 28.01 C ATOM 3673 O SER B 48 -86.463 15.699 15.079 1.00 28.37 O ATOM 3674 CB SER B 48 -89.248 14.808 16.410 1.00 30.76 C ATOM 3675 OG SER B 48 -88.213 14.518 17.339 1.00 30.30 O ATOM 3676 HA SER B 48 -88.558 16.812 16.044 1.00 0.00 H ATOM 3677 HB2 SER B 48 -89.467 13.912 15.829 1.00 0.00 H ATOM 3678 HB3 SER B 48 -90.141 15.113 16.955 1.00 0.00 H ATOM 3679 HG SER B 48 -87.401 14.236 16.849 1.00 0.00 H ATOM 3680 HN3 SER B 48 -90.213 15.506 13.997 1.00 0.00 H ATOM 3681 HN2 SER B 48 -89.663 17.113 13.994 1.00 0.00 H ATOM 3682 HN1 SER B 48 -90.760 16.593 15.182 1.00 0.00 H ATOM 3683 N HIS B 49 -87.840 14.947 13.466 1.00 29.53 N ATOM 3684 CA HIS B 49 -86.743 14.531 12.595 1.00 27.43 C ATOM 3685 C HIS B 49 -85.900 15.722 12.157 1.00 28.06 C ATOM 3686 O HIS B 49 -84.693 15.588 11.935 1.00 27.74 O ATOM 3687 CB HIS B 49 -87.258 13.767 11.372 1.00 28.62 C ATOM 3688 CG HIS B 49 -87.528 12.318 11.637 1.00 27.96 C ATOM 3689 ND1 HIS B 49 -87.992 11.455 10.664 1.00 28.27 N ATOM 3690 CD2 HIS B 49 -87.401 11.578 12.762 1.00 29.46 C ATOM 3691 CE1 HIS B 49 -88.135 10.249 11.181 1.00 26.36 C ATOM 3692 NE2 HIS B 49 -87.787 10.296 12.455 1.00 29.51 N ATOM 3693 HA HIS B 49 -86.111 13.859 13.175 1.00 0.00 H ATOM 3694 HB2 HIS B 49 -88.185 14.235 11.039 1.00 0.00 H ATOM 3695 HB3 HIS B 49 -86.511 13.839 10.581 1.00 0.00 H ATOM 3696 HD2 HIS B 49 -87.056 11.933 13.733 1.00 0.00 H ATOM 3697 HE1 HIS B 49 -88.482 9.364 10.647 1.00 0.00 H ATOM 3698 H HIS B 49 -88.822 14.797 13.158 1.00 0.00 H ATOM 3699 N MET B 50 -86.526 16.888 12.041 1.00 27.42 N ATOM 3700 CA MET B 50 -85.775 18.088 11.686 1.00 30.21 C ATOM 3701 C MET B 50 -84.747 18.395 12.771 1.00 26.20 C ATOM 3702 O MET B 50 -83.597 18.729 12.478 1.00 29.32 O ATOM 3703 CB MET B 50 -86.701 19.283 11.473 1.00 32.22 C ATOM 3704 CG MET B 50 -85.979 20.499 10.927 1.00 38.41 C ATOM 3705 SD MET B 50 -87.112 21.761 10.330 1.00 49.67 S ATOM 3706 CE MET B 50 -85.949 22.882 9.560 1.00 43.99 C ATOM 3707 HA MET B 50 -85.258 17.901 10.745 1.00 0.00 H ATOM 3708 HB2 MET B 50 -87.482 18.997 10.769 1.00 0.00 H ATOM 3709 HB3 MET B 50 -87.154 19.547 12.429 1.00 0.00 H ATOM 3710 HG2 MET B 50 -85.339 20.185 10.103 1.00 0.00 H ATOM 3711 HG3 MET B 50 -85.365 20.927 11.720 1.00 0.00 H ATOM 3712 HE1 MET B 50 -85.241 23.239 10.308 1.00 0.00 H ATOM 3713 HE2 MET B 50 -85.411 22.359 8.769 1.00 0.00 H ATOM 3714 HE3 MET B 50 -86.489 23.728 9.135 1.00 0.00 H ATOM 3715 H MET B 50 -87.552 16.946 12.203 1.00 0.00 H ATOM 3716 N GLY B 51 -85.173 18.287 14.026 1.00 27.07 N ATOM 3717 CA GLY B 51 -84.271 18.425 15.158 1.00 27.27 C ATOM 3718 C GLY B 51 -83.154 17.397 15.162 1.00 26.65 C ATOM 3719 O GLY B 51 -82.016 17.710 15.516 1.00 25.03 O ATOM 3720 HA3 GLY B 51 -84.848 18.314 16.076 1.00 0.00 H ATOM 3721 HA2 GLY B 51 -83.826 19.420 15.128 1.00 0.00 H ATOM 3722 H GLY B 51 -86.180 18.098 14.203 1.00 0.00 H ATOM 3723 N ASP B 52 -83.474 16.162 14.784 1.00 25.53 N ATOM 3724 CA ASP B 52 -82.465 15.098 14.694 1.00 26.93 C ATOM 3725 C ASP B 52 -81.343 15.457 13.701 1.00 26.22 C ATOM 3726 O ASP B 52 -80.164 15.152 13.929 1.00 24.42 O ATOM 3727 CB ASP B 52 -83.115 13.767 14.276 1.00 25.66 C ATOM 3728 CG ASP B 52 -83.998 13.164 15.363 1.00 31.18 C ATOM 3729 OD1 ASP B 52 -83.817 13.513 16.549 1.00 31.10 O ATOM 3730 OD2 ASP B 52 -84.867 12.320 15.028 1.00 31.53 O ATOM 3731 HA ASP B 52 -82.023 14.991 15.685 1.00 0.00 H ATOM 3732 HB2 ASP B 52 -83.726 13.942 13.390 1.00 0.00 H ATOM 3733 HB3 ASP B 52 -82.325 13.055 14.036 1.00 0.00 H ATOM 3734 H ASP B 52 -84.463 15.945 14.546 1.00 0.00 H ATOM 3735 N ILE B 53 -81.714 16.088 12.596 1.00 23.69 N ATOM 3736 CA ILE B 53 -80.736 16.522 11.605 1.00 25.72 C ATOM 3737 C ILE B 53 -79.948 17.716 12.139 1.00 24.96 C ATOM 3738 O ILE B 53 -78.748 17.847 11.885 1.00 23.19 O ATOM 3739 CB ILE B 53 -81.407 16.877 10.262 1.00 25.67 C ATOM 3740 CG1 ILE B 53 -82.094 15.643 9.673 1.00 27.22 C ATOM 3741 CG2 ILE B 53 -80.387 17.428 9.276 1.00 28.25 C ATOM 3742 CD1 ILE B 53 -81.138 14.505 9.347 1.00 25.49 C ATOM 3743 HA ILE B 53 -80.052 15.693 11.421 1.00 0.00 H ATOM 3744 HB ILE B 53 -82.156 17.647 10.447 1.00 0.00 H ATOM 3745 HG12 ILE B 53 -82.827 15.281 10.394 1.00 0.00 H ATOM 3746 HG13 ILE B 53 -82.603 15.938 8.756 1.00 0.00 H ATOM 3747 HD11 ILE B 53 -80.404 14.847 8.617 1.00 0.00 H ATOM 3748 HD12 ILE B 53 -80.628 14.189 10.257 1.00 0.00 H ATOM 3749 HD13 ILE B 53 -81.700 13.667 8.934 1.00 0.00 H ATOM 3750 HG21 ILE B 53 -79.932 18.328 9.690 1.00 0.00 H ATOM 3751 HG22 ILE B 53 -79.616 16.679 9.097 1.00 0.00 H ATOM 3752 HG23 ILE B 53 -80.885 17.671 8.337 1.00 0.00 H ATOM 3753 H ILE B 53 -82.723 16.278 12.432 1.00 0.00 H ATOM 3754 N GLY B 54 -80.627 18.573 12.897 1.00 24.17 N ATOM 3755 CA GLY B 54 -79.962 19.627 13.644 1.00 21.44 C ATOM 3756 C GLY B 54 -78.800 19.088 14.451 1.00 23.96 C ATOM 3757 O GLY B 54 -77.679 19.595 14.345 1.00 23.49 O ATOM 3758 HA3 GLY B 54 -80.680 20.088 14.322 1.00 0.00 H ATOM 3759 HA2 GLY B 54 -79.591 20.376 12.945 1.00 0.00 H ATOM 3760 H GLY B 54 -81.662 18.486 12.956 1.00 0.00 H ATOM 3761 N GLN B 55 -79.062 18.050 15.247 1.00 19.85 N ATOM 3762 CA GLN B 55 -78.023 17.390 16.037 1.00 24.10 C ATOM 3763 C GLN B 55 -76.907 16.847 15.148 1.00 24.88 C ATOM 3764 O GLN B 55 -75.723 16.965 15.474 1.00 22.44 O ATOM 3765 CB GLN B 55 -78.617 16.243 16.855 1.00 20.96 C ATOM 3766 CG GLN B 55 -77.618 15.532 17.768 1.00 26.13 C ATOM 3767 CD GLN B 55 -77.216 16.372 18.978 1.00 31.03 C ATOM 3768 OE1 GLN B 55 -78.071 16.883 19.696 1.00 29.56 O ATOM 3769 NE2 GLN B 55 -75.905 16.507 19.212 1.00 30.58 N ATOM 3770 HA GLN B 55 -77.602 18.138 16.709 1.00 0.00 H ATOM 3771 HB2 GLN B 55 -79.418 16.646 17.475 1.00 0.00 H ATOM 3772 HB3 GLN B 55 -79.029 15.508 16.163 1.00 0.00 H ATOM 3773 HG2 GLN B 55 -78.069 14.605 18.122 1.00 0.00 H ATOM 3774 HG3 GLN B 55 -76.722 15.302 17.191 1.00 0.00 H ATOM 3775 HE22 GLN B 55 -75.215 16.057 18.578 1.00 0.00 H ATOM 3776 HE21 GLN B 55 -75.577 17.062 20.028 1.00 0.00 H ATOM 3777 H GLN B 55 -80.039 17.698 15.308 1.00 0.00 H ATOM 3778 N LEU B 56 -77.294 16.233 14.036 1.00 21.27 N ATOM 3779 CA LEU B 56 -76.321 15.677 13.100 1.00 23.28 C ATOM 3780 C LEU B 56 -75.395 16.778 12.584 1.00 22.78 C ATOM 3781 O LEU B 56 -74.168 16.634 12.594 1.00 20.05 O ATOM 3782 CB LEU B 56 -77.039 14.992 11.932 1.00 23.88 C ATOM 3783 CG LEU B 56 -76.155 14.245 10.940 1.00 20.80 C ATOM 3784 CD1 LEU B 56 -75.529 13.015 11.620 1.00 17.58 C ATOM 3785 CD2 LEU B 56 -76.959 13.847 9.714 1.00 23.01 C ATOM 3786 HA LEU B 56 -75.719 14.933 13.622 1.00 0.00 H ATOM 3787 HB2 LEU B 56 -77.747 14.277 12.351 1.00 0.00 H ATOM 3788 HB3 LEU B 56 -77.583 15.759 11.380 1.00 0.00 H ATOM 3789 HG LEU B 56 -75.349 14.901 10.612 1.00 0.00 H ATOM 3790 HD21 LEU B 56 -77.783 13.200 10.016 1.00 0.00 H ATOM 3791 HD22 LEU B 56 -77.355 14.742 9.235 1.00 0.00 H ATOM 3792 HD23 LEU B 56 -76.314 13.315 9.015 1.00 0.00 H ATOM 3793 HD11 LEU B 56 -74.925 13.338 12.468 1.00 0.00 H ATOM 3794 HD12 LEU B 56 -76.321 12.351 11.968 1.00 0.00 H ATOM 3795 HD13 LEU B 56 -74.899 12.487 10.904 1.00 0.00 H ATOM 3796 H LEU B 56 -78.309 16.147 13.828 1.00 0.00 H ATOM 3797 N ASN B 57 -75.986 17.882 12.149 1.00 20.52 N ATOM 3798 CA ASN B 57 -75.213 18.984 11.580 1.00 24.08 C ATOM 3799 C ASN B 57 -74.300 19.654 12.610 1.00 25.61 C ATOM 3800 O ASN B 57 -73.214 20.123 12.261 1.00 19.85 O ATOM 3801 CB ASN B 57 -76.127 20.008 10.906 1.00 23.08 C ATOM 3802 CG ASN B 57 -76.658 19.525 9.566 1.00 34.10 C ATOM 3803 OD1 ASN B 57 -76.476 18.359 9.191 1.00 36.73 O ATOM 3804 ND2 ASN B 57 -77.321 20.419 8.836 1.00 34.19 N ATOM 3805 HA ASN B 57 -74.564 18.551 10.819 1.00 0.00 H ATOM 3806 HB2 ASN B 57 -76.972 20.209 11.565 1.00 0.00 H ATOM 3807 HB3 ASN B 57 -75.564 20.928 10.748 1.00 0.00 H ATOM 3808 HD22 ASN B 57 -77.450 21.388 9.191 1.00 0.00 H ATOM 3809 HD21 ASN B 57 -77.710 20.149 7.910 1.00 0.00 H ATOM 3810 H ASN B 57 -77.021 17.966 12.214 1.00 0.00 H ATOM 3811 N LYS B 58 -74.732 19.675 13.874 1.00 22.32 N ATOM 3812 CA LYS B 58 -73.893 20.175 14.953 1.00 23.28 C ATOM 3813 C LYS B 58 -72.738 19.220 15.250 1.00 23.68 C ATOM 3814 O LYS B 58 -71.615 19.657 15.435 1.00 18.00 O ATOM 3815 CB LYS B 58 -74.713 20.480 16.215 1.00 26.58 C ATOM 3816 CG LYS B 58 -73.937 21.275 17.269 1.00 26.26 C ATOM 3817 CD LYS B 58 -74.825 21.733 18.425 1.00 39.15 C ATOM 3818 CE LYS B 58 -74.942 20.681 19.527 1.00 36.91 C ATOM 3819 NZ LYS B 58 -73.725 20.615 20.398 1.00 40.63 N ATOM 3820 HA LYS B 58 -73.459 21.117 14.617 1.00 0.00 H ATOM 3821 HB2 LYS B 58 -75.592 21.056 15.925 1.00 0.00 H ATOM 3822 HB3 LYS B 58 -75.029 19.536 16.658 1.00 0.00 H ATOM 3823 HG2 LYS B 58 -73.141 20.645 17.667 1.00 0.00 H ATOM 3824 HG3 LYS B 58 -73.500 22.153 16.794 1.00 0.00 H ATOM 3825 HD2 LYS B 58 -74.401 22.642 18.853 1.00 0.00 H ATOM 3826 HD3 LYS B 58 -75.821 21.946 18.037 1.00 0.00 H ATOM 3827 HE2 LYS B 58 -75.092 19.706 19.064 1.00 0.00 H ATOM 3828 HE3 LYS B 58 -75.804 20.923 20.150 1.00 0.00 H ATOM 3829 HZ1 LYS B 58 -72.897 20.376 19.816 1.00 0.00 H ATOM 3830 HZ2 LYS B 58 -73.576 21.538 20.854 1.00 0.00 H ATOM 3831 HZ3 LYS B 58 -73.861 19.885 21.127 1.00 0.00 H ATOM 3832 H LYS B 58 -75.688 19.327 14.091 1.00 0.00 H ATOM 3833 N ASP B 59 -73.001 17.914 15.263 1.00 20.92 N ATOM 3834 CA ASP B 59 -71.933 16.929 15.441 1.00 18.04 C ATOM 3835 C ASP B 59 -70.878 17.026 14.340 1.00 19.45 C ATOM 3836 O ASP B 59 -69.683 16.803 14.573 1.00 18.19 O ATOM 3837 CB ASP B 59 -72.511 15.518 15.444 1.00 21.79 C ATOM 3838 CG ASP B 59 -73.440 15.282 16.603 1.00 27.23 C ATOM 3839 OD1 ASP B 59 -73.529 16.180 17.468 1.00 26.99 O ATOM 3840 OD2 ASP B 59 -74.078 14.206 16.642 1.00 26.59 O ATOM 3841 HA ASP B 59 -71.457 17.144 16.398 1.00 0.00 H ATOM 3842 HB2 ASP B 59 -73.062 15.363 14.516 1.00 0.00 H ATOM 3843 HB3 ASP B 59 -71.690 14.803 15.502 1.00 0.00 H ATOM 3844 H ASP B 59 -73.982 17.589 15.145 1.00 0.00 H ATOM 3845 N LEU B 60 -71.339 17.332 13.138 1.00 18.87 N ATOM 3846 CA LEU B 60 -70.465 17.484 11.984 1.00 19.47 C ATOM 3847 C LEU B 60 -69.541 18.680 12.167 1.00 16.50 C ATOM 3848 O LEU B 60 -68.329 18.595 11.964 1.00 14.92 O ATOM 3849 CB LEU B 60 -71.306 17.683 10.737 1.00 17.56 C ATOM 3850 CG LEU B 60 -70.509 17.998 9.472 1.00 19.51 C ATOM 3851 CD1 LEU B 60 -69.361 17.005 9.294 1.00 19.47 C ATOM 3852 CD2 LEU B 60 -71.416 17.971 8.295 1.00 21.94 C ATOM 3853 HA LEU B 60 -69.858 16.584 11.883 1.00 0.00 H ATOM 3854 HB2 LEU B 60 -71.875 16.770 10.562 1.00 0.00 H ATOM 3855 HB3 LEU B 60 -71.994 18.509 10.919 1.00 0.00 H ATOM 3856 HG LEU B 60 -70.075 18.994 9.564 1.00 0.00 H ATOM 3857 HD21 LEU B 60 -71.864 16.981 8.206 1.00 0.00 H ATOM 3858 HD22 LEU B 60 -72.201 18.716 8.426 1.00 0.00 H ATOM 3859 HD23 LEU B 60 -70.846 18.196 7.393 1.00 0.00 H ATOM 3860 HD11 LEU B 60 -68.694 17.064 10.154 1.00 0.00 H ATOM 3861 HD12 LEU B 60 -69.765 15.996 9.214 1.00 0.00 H ATOM 3862 HD13 LEU B 60 -68.808 17.249 8.387 1.00 0.00 H ATOM 3863 H LEU B 60 -72.362 17.469 13.013 1.00 0.00 H ATOM 3864 N THR B 61 -70.115 19.802 12.576 1.00 20.21 N ATOM 3865 CA THR B 61 -69.303 20.988 12.799 1.00 18.30 C ATOM 3866 C THR B 61 -68.294 20.697 13.894 1.00 16.64 C ATOM 3867 O THR B 61 -67.110 21.031 13.760 1.00 14.79 O ATOM 3868 CB THR B 61 -70.173 22.227 13.124 1.00 18.41 C ATOM 3869 OG1 THR B 61 -70.910 22.591 11.958 1.00 21.39 O ATOM 3870 CG2 THR B 61 -69.305 23.428 13.548 1.00 16.72 C ATOM 3871 HA THR B 61 -68.767 21.232 11.882 1.00 0.00 H ATOM 3872 HB THR B 61 -70.839 21.971 13.948 1.00 0.00 H ATOM 3873 HG1 THR B 61 -71.470 23.383 12.157 1.00 0.00 H ATOM 3874 HG23 THR B 61 -68.735 23.166 14.439 1.00 0.00 H ATOM 3875 HG21 THR B 61 -68.621 23.684 12.739 1.00 0.00 H ATOM 3876 HG22 THR B 61 -69.948 24.281 13.765 1.00 0.00 H ATOM 3877 H THR B 61 -71.142 19.835 12.737 1.00 0.00 H ATOM 3878 N ASP B 62 -68.739 20.034 14.961 1.00 19.15 N ATOM 3879 CA ASP B 62 -67.834 19.756 16.070 1.00 16.56 C ATOM 3880 C ASP B 62 -66.668 18.891 15.634 1.00 15.75 C ATOM 3881 O ASP B 62 -65.566 19.038 16.156 1.00 14.96 O ATOM 3882 CB ASP B 62 -68.555 19.081 17.243 1.00 19.84 C ATOM 3883 CG ASP B 62 -69.506 20.023 17.968 1.00 24.21 C ATOM 3884 OD1 ASP B 62 -69.372 21.258 17.799 1.00 22.71 O ATOM 3885 OD2 ASP B 62 -70.382 19.514 18.706 1.00 26.96 O ATOM 3886 HA ASP B 62 -67.455 20.722 16.404 1.00 0.00 H ATOM 3887 HB2 ASP B 62 -69.126 18.234 16.861 1.00 0.00 H ATOM 3888 HB3 ASP B 62 -67.809 18.724 17.953 1.00 0.00 H ATOM 3889 H ASP B 62 -69.728 19.716 15.003 1.00 0.00 H ATOM 3890 N LEU B 63 -66.913 17.971 14.703 1.00 14.69 N ATOM 3891 CA LEU B 63 -65.849 17.126 14.159 1.00 14.44 C ATOM 3892 C LEU B 63 -64.857 17.921 13.292 1.00 8.40 C ATOM 3893 O LEU B 63 -63.645 17.752 13.414 1.00 11.19 O ATOM 3894 CB LEU B 63 -66.461 15.994 13.322 1.00 14.16 C ATOM 3895 CG LEU B 63 -65.511 15.215 12.415 1.00 13.90 C ATOM 3896 CD1 LEU B 63 -64.396 14.558 13.224 1.00 14.05 C ATOM 3897 CD2 LEU B 63 -66.317 14.179 11.633 1.00 15.30 C ATOM 3898 HA LEU B 63 -65.297 16.717 15.005 1.00 0.00 H ATOM 3899 HB2 LEU B 63 -66.916 15.283 14.012 1.00 0.00 H ATOM 3900 HB3 LEU B 63 -67.235 16.432 12.691 1.00 0.00 H ATOM 3901 HG LEU B 63 -65.032 15.899 11.715 1.00 0.00 H ATOM 3902 HD21 LEU B 63 -66.805 13.498 12.330 1.00 0.00 H ATOM 3903 HD22 LEU B 63 -67.071 14.686 11.031 1.00 0.00 H ATOM 3904 HD23 LEU B 63 -65.648 13.616 10.982 1.00 0.00 H ATOM 3905 HD11 LEU B 63 -63.828 15.327 13.748 1.00 0.00 H ATOM 3906 HD12 LEU B 63 -64.832 13.869 13.948 1.00 0.00 H ATOM 3907 HD13 LEU B 63 -63.735 14.011 12.552 1.00 0.00 H ATOM 3908 H LEU B 63 -67.885 17.850 14.354 1.00 0.00 H ATOM 3909 N ARG B 64 -65.374 18.754 12.401 1.00 11.52 N ATOM 3910 CA ARG B 64 -64.515 19.593 11.580 1.00 9.94 C ATOM 3911 C ARG B 64 -63.669 20.477 12.477 1.00 11.49 C ATOM 3912 O ARG B 64 -62.453 20.592 12.290 1.00 10.92 O ATOM 3913 CB ARG B 64 -65.345 20.437 10.618 1.00 10.90 C ATOM 3914 CG ARG B 64 -66.121 19.591 9.571 1.00 12.76 C ATOM 3915 CD ARG B 64 -66.989 20.469 8.665 1.00 14.78 C ATOM 3916 NE ARG B 64 -66.170 21.353 7.846 1.00 12.90 N ATOM 3917 CZ ARG B 64 -66.620 22.443 7.230 1.00 15.76 C ATOM 3918 NH1 ARG B 64 -67.898 22.806 7.350 1.00 16.91 N ATOM 3919 NH2 ARG B 64 -65.789 23.185 6.508 1.00 14.24 N ATOM 3920 HA ARG B 64 -63.860 18.958 10.984 1.00 0.00 H ATOM 3921 HB2 ARG B 64 -66.064 21.016 11.197 1.00 0.00 H ATOM 3922 HB3 ARG B 64 -64.677 21.116 10.088 1.00 0.00 H ATOM 3923 HG2 ARG B 64 -65.405 19.047 8.955 1.00 0.00 H ATOM 3924 HG3 ARG B 64 -66.761 18.881 10.094 1.00 0.00 H ATOM 3925 HD2 ARG B 64 -67.653 21.072 9.284 1.00 0.00 H ATOM 3926 HD3 ARG B 64 -67.583 19.829 8.013 1.00 0.00 H ATOM 3927 HE ARG B 64 -65.164 21.115 7.735 1.00 0.00 H ATOM 3928 HH12 ARG B 64 -68.244 23.659 6.866 1.00 0.00 H ATOM 3929 HH11 ARG B 64 -68.548 22.236 7.927 1.00 0.00 H ATOM 3930 HH22 ARG B 64 -66.139 24.037 6.026 1.00 0.00 H ATOM 3931 HH21 ARG B 64 -64.788 22.914 6.425 1.00 0.00 H ATOM 3932 H ARG B 64 -66.406 18.809 12.287 1.00 0.00 H ATOM 3933 N ILE B 65 -64.305 21.080 13.481 1.00 10.17 N ATOM 3934 CA ILE B 65 -63.542 21.906 14.417 1.00 11.87 C ATOM 3935 C ILE B 65 -62.470 21.087 15.129 1.00 11.04 C ATOM 3936 O ILE B 65 -61.309 21.489 15.205 1.00 9.22 O ATOM 3937 CB ILE B 65 -64.457 22.641 15.424 1.00 14.56 C ATOM 3938 CG1 ILE B 65 -65.344 23.651 14.707 1.00 13.58 C ATOM 3939 CG2 ILE B 65 -63.617 23.314 16.521 1.00 12.88 C ATOM 3940 CD1 ILE B 65 -64.606 24.853 14.135 1.00 15.34 C ATOM 3941 HA ILE B 65 -63.038 22.674 13.830 1.00 0.00 H ATOM 3942 HB ILE B 65 -65.108 21.909 15.902 1.00 0.00 H ATOM 3943 HG12 ILE B 65 -65.847 23.139 13.887 1.00 0.00 H ATOM 3944 HG13 ILE B 65 -66.087 24.015 15.417 1.00 0.00 H ATOM 3945 HD11 ILE B 65 -64.106 25.389 14.942 1.00 0.00 H ATOM 3946 HD12 ILE B 65 -63.866 24.512 13.411 1.00 0.00 H ATOM 3947 HD13 ILE B 65 -65.319 25.516 13.644 1.00 0.00 H ATOM 3948 HG21 ILE B 65 -63.041 22.556 17.052 1.00 0.00 H ATOM 3949 HG22 ILE B 65 -62.938 24.035 16.066 1.00 0.00 H ATOM 3950 HG23 ILE B 65 -64.278 23.826 17.220 1.00 0.00 H ATOM 3951 H ILE B 65 -65.332 20.965 13.598 1.00 0.00 H ATOM 3952 N ALA B 66 -62.845 19.913 15.648 1.00 11.90 N ATOM 3953 CA ALA B 66 -61.883 19.080 16.357 1.00 13.28 C ATOM 3954 C ALA B 66 -60.687 18.670 15.508 1.00 10.93 C ATOM 3955 O ALA B 66 -59.552 18.682 15.994 1.00 9.65 O ATOM 3956 CB ALA B 66 -62.579 17.824 16.998 1.00 11.95 C ATOM 3957 HA ALA B 66 -61.484 19.703 17.157 1.00 0.00 H ATOM 3958 HB1 ALA B 66 -63.341 18.153 17.704 1.00 0.00 H ATOM 3959 HB2 ALA B 66 -63.043 17.227 16.213 1.00 0.00 H ATOM 3960 HB3 ALA B 66 -61.833 17.224 17.519 1.00 0.00 H ATOM 3961 H ALA B 66 -63.829 19.593 15.545 1.00 0.00 H ATOM 3962 N ARG B 67 -60.918 18.322 14.241 1.00 9.65 N ATOM 3963 CA ARG B 67 -59.812 17.883 13.404 1.00 10.29 C ATOM 3964 C ARG B 67 -58.814 18.997 13.120 1.00 9.11 C ATOM 3965 O ARG B 67 -57.615 18.742 13.017 1.00 9.08 O ATOM 3966 CB ARG B 67 -60.290 17.217 12.096 1.00 12.29 C ATOM 3967 CG ARG B 67 -59.232 16.262 11.489 1.00 12.15 C ATOM 3968 CD ARG B 67 -58.444 16.920 10.340 1.00 12.20 C ATOM 3969 NE ARG B 67 -59.335 17.249 9.240 1.00 10.02 N ATOM 3970 CZ ARG B 67 -59.099 18.150 8.291 1.00 11.05 C ATOM 3971 NH1 ARG B 67 -57.982 18.865 8.283 1.00 13.29 N ATOM 3972 NH2 ARG B 67 -60.015 18.346 7.362 1.00 13.11 N ATOM 3973 HA ARG B 67 -59.289 17.122 13.983 1.00 0.00 H ATOM 3974 HB2 ARG B 67 -61.195 16.647 12.305 1.00 0.00 H ATOM 3975 HB3 ARG B 67 -60.514 17.997 11.369 1.00 0.00 H ATOM 3976 HG2 ARG B 67 -58.533 15.969 12.272 1.00 0.00 H ATOM 3977 HG3 ARG B 67 -59.738 15.376 11.106 1.00 0.00 H ATOM 3978 HD2 ARG B 67 -57.677 16.230 9.988 1.00 0.00 H ATOM 3979 HD3 ARG B 67 -57.970 17.832 10.704 1.00 0.00 H ATOM 3980 HE ARG B 67 -60.237 16.734 9.191 1.00 0.00 H ATOM 3981 HH12 ARG B 67 -57.818 19.564 7.531 1.00 0.00 H ATOM 3982 HH11 ARG B 67 -57.270 18.726 9.029 1.00 0.00 H ATOM 3983 HH22 ARG B 67 -59.852 19.046 6.610 1.00 0.00 H ATOM 3984 HH21 ARG B 67 -60.900 17.801 7.382 1.00 0.00 H ATOM 3985 H ARG B 67 -61.882 18.364 13.854 1.00 0.00 H ATOM 3986 N LEU B 68 -59.289 20.235 13.010 1.00 10.28 N ATOM 3987 CA LEU B 68 -58.369 21.351 12.823 1.00 9.41 C ATOM 3988 C LEU B 68 -57.586 21.625 14.104 1.00 7.79 C ATOM 3989 O LEU B 68 -56.398 21.963 14.053 1.00 7.40 O ATOM 3990 CB LEU B 68 -59.105 22.619 12.373 1.00 7.28 C ATOM 3991 CG LEU B 68 -59.748 22.497 10.990 1.00 10.25 C ATOM 3992 CD1 LEU B 68 -60.878 23.506 10.851 1.00 10.96 C ATOM 3993 CD2 LEU B 68 -58.689 22.699 9.898 1.00 12.60 C ATOM 3994 HA LEU B 68 -57.670 21.069 12.035 1.00 0.00 H ATOM 3995 HB2 LEU B 68 -59.888 22.839 13.099 1.00 0.00 H ATOM 3996 HB3 LEU B 68 -58.391 23.442 12.350 1.00 0.00 H ATOM 3997 HG LEU B 68 -60.168 21.498 10.875 1.00 0.00 H ATOM 3998 HD21 LEU B 68 -58.246 23.690 10.002 1.00 0.00 H ATOM 3999 HD22 LEU B 68 -57.913 21.940 10.001 1.00 0.00 H ATOM 4000 HD23 LEU B 68 -59.158 22.610 8.918 1.00 0.00 H ATOM 4001 HD11 LEU B 68 -61.631 23.314 11.615 1.00 0.00 H ATOM 4002 HD12 LEU B 68 -60.481 24.514 10.975 1.00 0.00 H ATOM 4003 HD13 LEU B 68 -61.329 23.411 9.863 1.00 0.00 H ATOM 4004 H LEU B 68 -60.314 20.406 13.057 1.00 0.00 H ATOM 4005 N GLN B 69 -58.254 21.518 15.249 1.00 8.80 N ATOM 4006 CA GLN B 69 -57.566 21.631 16.542 1.00 11.65 C ATOM 4007 C GLN B 69 -56.443 20.613 16.684 1.00 11.19 C ATOM 4008 O GLN B 69 -55.394 20.892 17.270 1.00 10.72 O ATOM 4009 CB GLN B 69 -58.554 21.493 17.693 1.00 9.78 C ATOM 4010 CG GLN B 69 -59.509 22.674 17.807 1.00 10.68 C ATOM 4011 CD GLN B 69 -60.642 22.437 18.811 1.00 15.23 C ATOM 4012 OE1 GLN B 69 -61.093 21.311 18.997 1.00 15.57 O ATOM 4013 NE2 GLN B 69 -61.115 23.514 19.450 1.00 11.47 N ATOM 4014 HA GLN B 69 -57.116 22.623 16.579 1.00 0.00 H ATOM 4015 HB2 GLN B 69 -59.140 20.587 17.541 1.00 0.00 H ATOM 4016 HB3 GLN B 69 -57.993 21.409 18.624 1.00 0.00 H ATOM 4017 HG2 GLN B 69 -58.942 23.549 18.124 1.00 0.00 H ATOM 4018 HG3 GLN B 69 -59.947 22.862 16.827 1.00 0.00 H ATOM 4019 HE22 GLN B 69 -60.705 24.451 19.264 1.00 0.00 H ATOM 4020 HE21 GLN B 69 -61.893 23.414 20.133 1.00 0.00 H ATOM 4021 H GLN B 69 -59.280 21.352 15.229 1.00 0.00 H ATOM 4022 N TYR B 70 -56.688 19.421 16.147 1.00 11.68 N ATOM 4023 CA TYR B 70 -55.714 18.336 16.135 1.00 9.52 C ATOM 4024 C TYR B 70 -54.441 18.758 15.441 1.00 13.45 C ATOM 4025 O TYR B 70 -53.338 18.512 15.922 1.00 12.21 O ATOM 4026 CB TYR B 70 -56.347 17.152 15.414 1.00 13.06 C ATOM 4027 CG TYR B 70 -55.490 15.936 15.217 1.00 12.20 C ATOM 4028 CD1 TYR B 70 -54.651 15.447 16.220 1.00 12.74 C ATOM 4029 CD2 TYR B 70 -55.587 15.212 14.039 1.00 12.83 C ATOM 4030 CE1 TYR B 70 -53.888 14.277 16.011 1.00 16.32 C ATOM 4031 CE2 TYR B 70 -54.857 14.080 13.836 1.00 15.37 C ATOM 4032 CZ TYR B 70 -54.010 13.607 14.804 1.00 16.53 C ATOM 4033 OH TYR B 70 -53.300 12.455 14.533 1.00 17.70 O ATOM 4034 HA TYR B 70 -55.448 18.063 17.156 1.00 0.00 H ATOM 4035 HB3 TYR B 70 -56.661 17.496 14.429 1.00 0.00 H ATOM 4036 HB2 TYR B 70 -57.223 16.848 15.987 1.00 0.00 H ATOM 4037 HD2 TYR B 70 -56.263 15.557 13.257 1.00 0.00 H ATOM 4038 HE2 TYR B 70 -54.948 13.543 12.892 1.00 0.00 H ATOM 4039 HE1 TYR B 70 -53.215 13.908 16.785 1.00 0.00 H ATOM 4040 HD1 TYR B 70 -54.584 15.973 17.173 1.00 0.00 H ATOM 4041 HH TYR B 70 -52.732 12.228 15.311 1.00 0.00 H ATOM 4042 H TYR B 70 -57.619 19.255 15.715 1.00 0.00 H ATOM 4043 N MET B 71 -54.584 19.427 14.305 1.00 9.13 N ATOM 4044 CA MET B 71 -53.419 19.825 13.541 1.00 8.55 C ATOM 4045 C MET B 71 -52.702 20.982 14.233 1.00 10.50 C ATOM 4046 O MET B 71 -51.473 21.074 14.238 1.00 8.82 O ATOM 4047 CB MET B 71 -53.877 20.228 12.123 1.00 7.88 C ATOM 4048 CG MET B 71 -54.541 19.085 11.362 1.00 9.84 C ATOM 4049 SD MET B 71 -54.782 19.530 9.619 1.00 13.37 S ATOM 4050 CE MET B 71 -53.100 19.375 9.076 1.00 14.70 C ATOM 4051 HA MET B 71 -52.715 18.995 13.472 1.00 0.00 H ATOM 4052 HB2 MET B 71 -54.589 21.049 12.208 1.00 0.00 H ATOM 4053 HB3 MET B 71 -53.006 20.562 11.558 1.00 0.00 H ATOM 4054 HG2 MET B 71 -55.509 18.869 11.814 1.00 0.00 H ATOM 4055 HG3 MET B 71 -53.908 18.200 11.421 1.00 0.00 H ATOM 4056 HE1 MET B 71 -52.472 20.065 9.640 1.00 0.00 H ATOM 4057 HE2 MET B 71 -52.759 18.353 9.242 1.00 0.00 H ATOM 4058 HE3 MET B 71 -53.039 19.612 8.014 1.00 0.00 H ATOM 4059 H MET B 71 -55.536 19.667 13.961 1.00 0.00 H ATOM 4060 N ILE B 72 -53.479 21.873 14.828 1.00 9.94 N ATOM 4061 CA ILE B 72 -52.897 23.003 15.550 1.00 10.71 C ATOM 4062 C ILE B 72 -52.048 22.506 16.712 1.00 14.33 C ATOM 4063 O ILE B 72 -50.994 23.067 17.023 1.00 16.71 O ATOM 4064 CB ILE B 72 -53.996 23.984 16.001 1.00 9.61 C ATOM 4065 CG1 ILE B 72 -54.604 24.653 14.770 1.00 8.88 C ATOM 4066 CG2 ILE B 72 -53.447 25.079 16.939 1.00 15.71 C ATOM 4067 CD1 ILE B 72 -55.879 25.368 15.032 1.00 10.40 C ATOM 4068 HA ILE B 72 -52.237 23.554 14.880 1.00 0.00 H ATOM 4069 HB ILE B 72 -54.746 23.413 16.549 1.00 0.00 H ATOM 4070 HG12 ILE B 72 -53.883 25.371 14.380 1.00 0.00 H ATOM 4071 HG13 ILE B 72 -54.791 23.884 14.020 1.00 0.00 H ATOM 4072 HD11 ILE B 72 -56.618 24.663 15.411 1.00 0.00 H ATOM 4073 HD12 ILE B 72 -55.710 26.151 15.771 1.00 0.00 H ATOM 4074 HD13 ILE B 72 -56.241 25.813 14.105 1.00 0.00 H ATOM 4075 HG21 ILE B 72 -53.021 24.614 17.828 1.00 0.00 H ATOM 4076 HG22 ILE B 72 -52.676 25.648 16.419 1.00 0.00 H ATOM 4077 HG23 ILE B 72 -54.258 25.746 17.230 1.00 0.00 H ATOM 4078 H ILE B 72 -54.513 21.768 14.781 1.00 0.00 H ATOM 4079 N ALA B 73 -52.531 21.450 17.353 1.00 11.03 N ATOM 4080 CA ALA B 73 -51.821 20.775 18.427 1.00 12.07 C ATOM 4081 C ALA B 73 -50.671 19.869 17.950 1.00 17.75 C ATOM 4082 O ALA B 73 -50.271 18.935 18.653 1.00 19.00 O ATOM 4083 CB ALA B 73 -52.818 19.979 19.247 1.00 16.62 C ATOM 4084 HA ALA B 73 -51.346 21.548 19.032 1.00 0.00 H ATOM 4085 HB1 ALA B 73 -53.565 20.654 19.664 1.00 0.00 H ATOM 4086 HB2 ALA B 73 -53.308 19.244 18.608 1.00 0.00 H ATOM 4087 HB3 ALA B 73 -52.296 19.468 20.056 1.00 0.00 H ATOM 4088 H ALA B 73 -53.464 21.087 17.073 1.00 0.00 H ATOM 4089 N ASN B 74 -50.139 20.151 16.767 1.00 15.65 N ATOM 4090 CA ASN B 74 -49.028 19.373 16.195 1.00 17.77 C ATOM 4091 C ASN B 74 -49.299 17.867 16.221 1.00 14.42 C ATOM 4092 O ASN B 74 -48.387 17.056 16.388 1.00 16.42 O ATOM 4093 CB ASN B 74 -47.709 19.708 16.906 1.00 20.61 C ATOM 4094 CG ASN B 74 -47.315 21.187 16.754 1.00 28.41 C ATOM 4095 OD1 ASN B 74 -47.510 21.789 15.695 1.00 33.22 O ATOM 4096 ND2 ASN B 74 -46.760 21.770 17.814 1.00 31.40 N ATOM 4097 HA ASN B 74 -48.940 19.659 15.147 1.00 0.00 H ATOM 4098 HB2 ASN B 74 -47.817 19.482 17.967 1.00 0.00 H ATOM 4099 HB3 ASN B 74 -46.917 19.090 16.483 1.00 0.00 H ATOM 4100 HD22 ASN B 74 -46.613 21.227 18.689 1.00 0.00 H ATOM 4101 HD21 ASN B 74 -46.473 22.769 17.768 1.00 0.00 H ATOM 4102 H ASN B 74 -50.521 20.951 16.224 1.00 0.00 H ATOM 4103 N GLY B 75 -50.570 17.516 16.080 1.00 13.68 N ATOM 4104 CA GLY B 75 -50.985 16.142 15.908 1.00 14.54 C ATOM 4105 C GLY B 75 -50.740 15.313 17.149 1.00 12.95 C ATOM 4106 O GLY B 75 -50.479 14.117 17.057 1.00 17.14 O ATOM 4107 HA3 GLY B 75 -50.427 15.707 15.079 1.00 0.00 H ATOM 4108 HA2 GLY B 75 -52.050 16.123 15.677 1.00 0.00 H ATOM 4109 H GLY B 75 -51.297 18.259 16.094 1.00 0.00 H ATOM 4110 N ASP B 76 -50.825 15.940 18.318 1.00 16.79 N ATOM 4111 CA ASP B 76 -50.486 15.224 19.552 1.00 17.23 C ATOM 4112 C ASP B 76 -51.572 14.216 19.959 1.00 17.55 C ATOM 4113 O ASP B 76 -52.726 14.337 19.564 1.00 15.58 O ATOM 4114 CB ASP B 76 -50.076 16.184 20.680 1.00 17.79 C ATOM 4115 CG ASP B 76 -51.247 16.889 21.334 1.00 18.71 C ATOM 4116 OD1 ASP B 76 -52.405 16.433 21.209 1.00 23.81 O ATOM 4117 OD2 ASP B 76 -50.991 17.906 22.014 1.00 28.66 O ATOM 4118 HA ASP B 76 -49.601 14.622 19.345 1.00 0.00 H ATOM 4119 HB2 ASP B 76 -49.547 15.613 21.443 1.00 0.00 H ATOM 4120 HB3 ASP B 76 -49.408 16.938 20.265 1.00 0.00 H ATOM 4121 H ASP B 76 -51.130 16.933 18.357 1.00 0.00 H ATOM 4122 N ASP B 77 -51.187 13.197 20.724 1.00 15.96 N ATOM 4123 CA ASP B 77 -52.107 12.089 21.023 1.00 16.87 C ATOM 4124 C ASP B 77 -53.369 12.508 21.789 1.00 16.23 C ATOM 4125 O ASP B 77 -54.431 11.915 21.612 1.00 16.71 O ATOM 4126 CB ASP B 77 -51.369 10.971 21.777 1.00 21.11 C ATOM 4127 CG ASP B 77 -50.337 10.257 20.917 1.00 31.52 C ATOM 4128 OD1 ASP B 77 -50.649 9.909 19.753 1.00 35.88 O ATOM 4129 OD2 ASP B 77 -49.212 10.021 21.416 1.00 38.10 O ATOM 4130 HA ASP B 77 -52.455 11.722 20.057 1.00 0.00 H ATOM 4131 HB2 ASP B 77 -50.863 11.407 22.638 1.00 0.00 H ATOM 4132 HB3 ASP B 77 -52.102 10.240 22.120 1.00 0.00 H ATOM 4133 H ASP B 77 -50.223 13.184 21.115 1.00 0.00 H ATOM 4134 N THR B 78 -53.267 13.518 22.645 1.00 15.92 N ATOM 4135 CA THR B 78 -54.444 14.017 23.334 1.00 13.84 C ATOM 4136 C THR B 78 -55.497 14.586 22.382 1.00 16.19 C ATOM 4137 O THR B 78 -56.690 14.312 22.522 1.00 15.35 O ATOM 4138 CB THR B 78 -54.074 15.080 24.380 1.00 17.05 C ATOM 4139 OG1 THR B 78 -53.289 14.469 25.412 1.00 22.89 O ATOM 4140 CG2 THR B 78 -55.328 15.667 25.001 1.00 20.46 C ATOM 4141 HA THR B 78 -54.880 13.152 23.834 1.00 0.00 H ATOM 4142 HB THR B 78 -53.509 15.875 23.893 1.00 0.00 H ATOM 4143 HG1 THR B 78 -53.048 15.150 26.089 1.00 0.00 H ATOM 4144 HG23 THR B 78 -55.932 16.134 24.224 1.00 0.00 H ATOM 4145 HG21 THR B 78 -55.901 14.873 25.480 1.00 0.00 H ATOM 4146 HG22 THR B 78 -55.049 16.414 25.744 1.00 0.00 H ATOM 4147 H THR B 78 -52.340 13.954 22.823 1.00 0.00 H ATOM 4148 N ALA B 79 -55.075 15.407 21.428 1.00 14.26 N ATOM 4149 CA ALA B 79 -56.039 15.976 20.496 1.00 13.10 C ATOM 4150 C ALA B 79 -56.524 14.901 19.498 1.00 15.20 C ATOM 4151 O ALA B 79 -57.657 14.957 19.025 1.00 19.25 O ATOM 4152 CB ALA B 79 -55.454 17.191 19.780 1.00 15.00 C ATOM 4153 HA ALA B 79 -56.906 16.321 21.059 1.00 0.00 H ATOM 4154 HB1 ALA B 79 -55.186 17.950 20.515 1.00 0.00 H ATOM 4155 HB2 ALA B 79 -54.565 16.891 19.225 1.00 0.00 H ATOM 4156 HB3 ALA B 79 -56.195 17.596 19.090 1.00 0.00 H ATOM 4157 H ALA B 79 -54.065 15.642 21.347 1.00 0.00 H ATOM 4158 N ALA B 80 -55.680 13.917 19.208 1.00 16.02 N ATOM 4159 CA ALA B 80 -56.103 12.803 18.365 1.00 18.72 C ATOM 4160 C ALA B 80 -57.281 12.108 19.036 1.00 22.51 C ATOM 4161 O ALA B 80 -58.304 11.825 18.401 1.00 22.48 O ATOM 4162 CB ALA B 80 -54.960 11.829 18.136 1.00 18.11 C ATOM 4163 HA ALA B 80 -56.406 13.179 17.388 1.00 0.00 H ATOM 4164 HB1 ALA B 80 -54.136 12.347 17.645 1.00 0.00 H ATOM 4165 HB2 ALA B 80 -54.623 11.434 19.095 1.00 0.00 H ATOM 4166 HB3 ALA B 80 -55.304 11.009 17.505 1.00 0.00 H ATOM 4167 H ALA B 80 -54.711 13.941 19.584 1.00 0.00 H ATOM 4168 N ALA B 81 -57.136 11.852 20.337 1.00 22.31 N ATOM 4169 CA ALA B 81 -58.211 11.243 21.112 1.00 25.38 C ATOM 4170 C ALA B 81 -59.496 12.062 21.027 1.00 23.46 C ATOM 4171 O ALA B 81 -60.588 11.510 20.848 1.00 21.65 O ATOM 4172 CB ALA B 81 -57.784 11.051 22.569 1.00 19.67 C ATOM 4173 HA ALA B 81 -58.417 10.263 20.681 1.00 0.00 H ATOM 4174 HB1 ALA B 81 -56.909 10.402 22.607 1.00 0.00 H ATOM 4175 HB2 ALA B 81 -57.539 12.019 23.005 1.00 0.00 H ATOM 4176 HB3 ALA B 81 -58.601 10.595 23.129 1.00 0.00 H ATOM 4177 H ALA B 81 -56.240 12.091 20.807 1.00 0.00 H ATOM 4178 N ASN B 82 -59.375 13.378 21.153 1.00 19.90 N ATOM 4179 CA ASN B 82 -60.548 14.238 21.086 1.00 20.54 C ATOM 4180 C ASN B 82 -61.216 14.188 19.713 1.00 21.04 C ATOM 4181 O ASN B 82 -62.449 14.230 19.596 1.00 22.11 O ATOM 4182 CB ASN B 82 -60.169 15.681 21.409 1.00 20.91 C ATOM 4183 CG ASN B 82 -61.362 16.603 21.398 1.00 23.65 C ATOM 4184 OD1 ASN B 82 -62.248 16.481 22.239 1.00 21.56 O ATOM 4185 ND2 ASN B 82 -61.402 17.538 20.429 1.00 20.38 N ATOM 4186 HA ASN B 82 -61.258 13.867 21.825 1.00 0.00 H ATOM 4187 HB2 ASN B 82 -59.712 15.711 22.398 1.00 0.00 H ATOM 4188 HB3 ASN B 82 -59.450 16.029 20.667 1.00 0.00 H ATOM 4189 HD22 ASN B 82 -60.628 17.604 19.738 1.00 0.00 H ATOM 4190 HD21 ASN B 82 -62.207 18.194 20.372 1.00 0.00 H ATOM 4191 H ASN B 82 -58.435 13.798 21.301 1.00 0.00 H ATOM 4192 N THR B 83 -60.400 14.130 18.668 1.00 18.01 N ATOM 4193 CA THR B 83 -60.932 14.068 17.313 1.00 17.81 C ATOM 4194 C THR B 83 -61.659 12.744 17.074 1.00 20.81 C ATOM 4195 O THR B 83 -62.775 12.719 16.552 1.00 17.07 O ATOM 4196 CB THR B 83 -59.824 14.265 16.282 1.00 19.07 C ATOM 4197 OG1 THR B 83 -59.117 15.480 16.583 1.00 13.43 O ATOM 4198 CG2 THR B 83 -60.410 14.354 14.883 1.00 12.02 C ATOM 4199 HA THR B 83 -61.651 14.879 17.198 1.00 0.00 H ATOM 4200 HB THR B 83 -59.143 13.414 16.321 1.00 0.00 H ATOM 4201 HG1 THR B 83 -58.724 15.416 17.489 1.00 0.00 H ATOM 4202 HG23 THR B 83 -60.946 13.432 14.656 1.00 0.00 H ATOM 4203 HG21 THR B 83 -61.098 15.198 14.832 1.00 0.00 H ATOM 4204 HG22 THR B 83 -59.605 14.495 14.162 1.00 0.00 H ATOM 4205 H THR B 83 -59.371 14.129 18.818 1.00 0.00 H ATOM 4206 N LEU B 84 -61.025 11.650 17.473 1.00 19.28 N ATOM 4207 CA LEU B 84 -61.667 10.339 17.396 1.00 22.19 C ATOM 4208 C LEU B 84 -63.024 10.354 18.098 1.00 23.03 C ATOM 4209 O LEU B 84 -64.003 9.794 17.594 1.00 23.21 O ATOM 4210 CB LEU B 84 -60.753 9.282 17.987 1.00 17.46 C ATOM 4211 CG LEU B 84 -59.501 9.063 17.146 1.00 23.10 C ATOM 4212 CD1 LEU B 84 -58.505 8.155 17.853 1.00 30.49 C ATOM 4213 CD2 LEU B 84 -59.881 8.512 15.766 1.00 26.30 C ATOM 4214 HA LEU B 84 -61.845 10.095 16.349 1.00 0.00 H ATOM 4215 HB2 LEU B 84 -60.453 9.597 18.987 1.00 0.00 H ATOM 4216 HB3 LEU B 84 -61.300 8.342 18.052 1.00 0.00 H ATOM 4217 HG LEU B 84 -59.009 10.026 17.008 1.00 0.00 H ATOM 4218 HD21 LEU B 84 -60.402 7.562 15.886 1.00 0.00 H ATOM 4219 HD22 LEU B 84 -60.533 9.224 15.259 1.00 0.00 H ATOM 4220 HD23 LEU B 84 -58.978 8.360 15.175 1.00 0.00 H ATOM 4221 HD11 LEU B 84 -58.210 8.608 18.799 1.00 0.00 H ATOM 4222 HD12 LEU B 84 -58.968 7.186 18.041 1.00 0.00 H ATOM 4223 HD13 LEU B 84 -57.626 8.022 17.223 1.00 0.00 H ATOM 4224 H LEU B 84 -60.057 11.726 17.846 1.00 0.00 H ATOM 4225 N ALA B 85 -63.092 11.028 19.244 1.00 21.82 N ATOM 4226 CA ALA B 85 -64.340 11.151 19.983 1.00 15.82 C ATOM 4227 C ALA B 85 -65.418 11.924 19.243 1.00 19.88 C ATOM 4228 O ALA B 85 -66.582 11.545 19.276 1.00 21.24 O ATOM 4229 CB ALA B 85 -64.089 11.774 21.356 1.00 19.85 C ATOM 4230 HA ALA B 85 -64.720 10.136 20.101 1.00 0.00 H ATOM 4231 HB1 ALA B 85 -63.403 11.142 21.920 1.00 0.00 H ATOM 4232 HB2 ALA B 85 -63.652 12.765 21.230 1.00 0.00 H ATOM 4233 HB3 ALA B 85 -65.033 11.858 21.894 1.00 0.00 H ATOM 4234 H ALA B 85 -62.233 11.477 19.620 1.00 0.00 H ATOM 4235 N LYS B 86 -65.054 13.019 18.584 1.00 19.96 N ATOM 4236 CA LYS B 86 -66.041 13.763 17.825 1.00 17.29 C ATOM 4237 C LYS B 86 -66.499 12.921 16.624 1.00 17.17 C ATOM 4238 O LYS B 86 -67.669 12.950 16.233 1.00 17.32 O ATOM 4239 CB LYS B 86 -65.473 15.108 17.350 1.00 17.18 C ATOM 4240 CG LYS B 86 -65.754 16.278 18.291 1.00 17.51 C ATOM 4241 CD LYS B 86 -65.366 15.940 19.721 1.00 18.06 C ATOM 4242 CE LYS B 86 -65.538 17.119 20.657 1.00 20.15 C ATOM 4243 NZ LYS B 86 -65.091 16.760 22.035 1.00 22.78 N ATOM 4244 HA LYS B 86 -66.895 13.973 18.469 1.00 0.00 H ATOM 4245 HB2 LYS B 86 -64.393 15.005 17.246 1.00 0.00 H ATOM 4246 HB3 LYS B 86 -65.910 15.339 16.378 1.00 0.00 H ATOM 4247 HG2 LYS B 86 -65.180 17.145 17.962 1.00 0.00 H ATOM 4248 HG3 LYS B 86 -66.818 16.514 18.257 1.00 0.00 H ATOM 4249 HD2 LYS B 86 -65.994 15.120 20.070 1.00 0.00 H ATOM 4250 HD3 LYS B 86 -64.322 15.629 19.737 1.00 0.00 H ATOM 4251 HE2 LYS B 86 -66.589 17.406 20.684 1.00 0.00 H ATOM 4252 HE3 LYS B 86 -64.943 17.957 20.293 1.00 0.00 H ATOM 4253 HZ1 LYS B 86 -65.659 15.963 22.386 1.00 0.00 H ATOM 4254 HZ2 LYS B 86 -64.087 16.488 22.013 1.00 0.00 H ATOM 4255 HZ3 LYS B 86 -65.216 17.579 22.663 1.00 0.00 H ATOM 4256 H LYS B 86 -64.066 13.341 18.612 1.00 0.00 H ATOM 4257 N LEU B 87 -65.558 12.185 16.048 1.00 17.79 N ATOM 4258 CA LEU B 87 -65.856 11.321 14.912 1.00 17.21 C ATOM 4259 C LEU B 87 -66.921 10.269 15.225 1.00 21.07 C ATOM 4260 O LEU B 87 -67.885 10.101 14.474 1.00 19.98 O ATOM 4261 CB LEU B 87 -64.585 10.642 14.420 1.00 16.03 C ATOM 4262 CG LEU B 87 -64.728 9.673 13.238 1.00 15.95 C ATOM 4263 CD1 LEU B 87 -65.468 10.315 12.078 1.00 14.27 C ATOM 4264 CD2 LEU B 87 -63.352 9.213 12.792 1.00 19.42 C ATOM 4265 HA LEU B 87 -66.262 11.962 14.129 1.00 0.00 H ATOM 4266 HB2 LEU B 87 -63.887 11.425 14.122 1.00 0.00 H ATOM 4267 HB3 LEU B 87 -64.166 10.082 15.256 1.00 0.00 H ATOM 4268 HG LEU B 87 -65.314 8.815 13.567 1.00 0.00 H ATOM 4269 HD21 LEU B 87 -62.763 10.077 12.485 1.00 0.00 H ATOM 4270 HD22 LEU B 87 -62.854 8.707 13.619 1.00 0.00 H ATOM 4271 HD23 LEU B 87 -63.455 8.525 11.953 1.00 0.00 H ATOM 4272 HD11 LEU B 87 -66.465 10.612 12.404 1.00 0.00 H ATOM 4273 HD12 LEU B 87 -64.919 11.194 11.740 1.00 0.00 H ATOM 4274 HD13 LEU B 87 -65.550 9.599 11.260 1.00 0.00 H ATOM 4275 H LEU B 87 -64.586 12.225 16.415 1.00 0.00 H ATOM 4276 N ASP B 88 -66.765 9.529 16.308 1.00 23.76 N ATOM 4277 CA ASP B 88 -67.787 8.508 16.532 1.00 27.80 C ATOM 4278 C ASP B 88 -69.098 9.053 17.117 1.00 26.48 C ATOM 4279 O ASP B 88 -70.135 8.407 17.002 1.00 24.63 O ATOM 4280 CB ASP B 88 -67.258 7.247 17.226 1.00 34.76 C ATOM 4281 CG ASP B 88 -66.658 7.524 18.564 1.00 36.21 C ATOM 4282 OD1 ASP B 88 -65.948 8.540 18.688 1.00 38.16 O ATOM 4283 OD2 ASP B 88 -66.889 6.715 19.491 1.00 44.28 O ATOM 4284 HA ASP B 88 -68.066 8.169 15.534 1.00 0.00 H ATOM 4285 HB2 ASP B 88 -68.085 6.548 17.354 1.00 0.00 H ATOM 4286 HB3 ASP B 88 -66.497 6.794 16.591 1.00 0.00 H ATOM 4287 H ASP B 88 -65.966 9.664 16.960 1.00 0.00 H ATOM 4288 N ALA B 89 -69.065 10.255 17.694 1.00 23.47 N ATOM 4289 CA ALA B 89 -70.307 10.959 18.031 1.00 20.96 C ATOM 4290 C ALA B 89 -71.110 11.195 16.765 1.00 24.95 C ATOM 4291 O ALA B 89 -72.327 10.985 16.721 1.00 23.87 O ATOM 4292 CB ALA B 89 -70.021 12.295 18.714 1.00 22.09 C ATOM 4293 HA ALA B 89 -70.875 10.340 18.725 1.00 0.00 H ATOM 4294 HB1 ALA B 89 -69.461 12.119 19.633 1.00 0.00 H ATOM 4295 HB2 ALA B 89 -69.435 12.926 18.045 1.00 0.00 H ATOM 4296 HB3 ALA B 89 -70.963 12.790 18.950 1.00 0.00 H ATOM 4297 H ALA B 89 -68.149 10.698 17.907 1.00 0.00 H ATOM 4298 N PHE B 90 -70.416 11.624 15.721 1.00 20.98 N ATOM 4299 CA PHE B 90 -71.078 11.909 14.462 1.00 19.40 C ATOM 4300 C PHE B 90 -71.491 10.592 13.798 1.00 20.62 C ATOM 4301 O PHE B 90 -72.616 10.462 13.304 1.00 21.17 O ATOM 4302 CB PHE B 90 -70.150 12.724 13.565 1.00 16.51 C ATOM 4303 CG PHE B 90 -70.737 13.074 12.251 1.00 16.89 C ATOM 4304 CD1 PHE B 90 -71.891 13.827 12.167 1.00 14.49 C ATOM 4305 CD2 PHE B 90 -70.124 12.650 11.077 1.00 22.67 C ATOM 4306 CE1 PHE B 90 -72.426 14.158 10.947 1.00 20.04 C ATOM 4307 CE2 PHE B 90 -70.655 12.977 9.856 1.00 20.52 C ATOM 4308 CZ PHE B 90 -71.808 13.726 9.783 1.00 21.65 C ATOM 4309 HA PHE B 90 -71.977 12.500 14.635 1.00 0.00 H ATOM 4310 HB2 PHE B 90 -69.895 13.648 14.084 1.00 0.00 H ATOM 4311 HB3 PHE B 90 -69.243 12.144 13.392 1.00 0.00 H ATOM 4312 HD2 PHE B 90 -69.214 12.053 11.128 1.00 0.00 H ATOM 4313 HE2 PHE B 90 -70.164 12.644 8.942 1.00 0.00 H ATOM 4314 HZ PHE B 90 -72.234 13.979 8.812 1.00 0.00 H ATOM 4315 HE1 PHE B 90 -73.334 14.759 10.893 1.00 0.00 H ATOM 4316 HD1 PHE B 90 -72.383 14.163 13.080 1.00 0.00 H ATOM 4317 H PHE B 90 -69.388 11.758 15.805 1.00 0.00 H ATOM 4318 N SER B 91 -70.583 9.623 13.809 1.00 17.84 N ATOM 4319 CA SER B 91 -70.879 8.293 13.276 1.00 23.21 C ATOM 4320 C SER B 91 -72.123 7.709 13.961 1.00 23.42 C ATOM 4321 O SER B 91 -73.042 7.218 13.297 1.00 22.05 O ATOM 4322 CB SER B 91 -69.675 7.364 13.466 1.00 25.10 C ATOM 4323 OG SER B 91 -69.862 6.124 12.790 1.00 24.17 O ATOM 4324 HA SER B 91 -71.082 8.381 12.209 1.00 0.00 H ATOM 4325 HB2 SER B 91 -69.540 7.171 14.530 1.00 0.00 H ATOM 4326 HB3 SER B 91 -68.784 7.853 13.071 1.00 0.00 H ATOM 4327 HG SER B 91 -69.980 6.292 11.821 1.00 0.00 H ATOM 4328 H SER B 91 -69.641 9.814 14.205 1.00 0.00 H ATOM 4329 N LYS B 92 -72.150 7.783 15.291 1.00 25.27 N ATOM 4330 CA LYS B 92 -73.269 7.254 16.074 1.00 25.14 C ATOM 4331 C LYS B 92 -74.597 7.873 15.653 1.00 25.33 C ATOM 4332 O LYS B 92 -75.588 7.159 15.451 1.00 23.90 O ATOM 4333 CB LYS B 92 -73.040 7.471 17.576 1.00 25.10 C ATOM 4334 CG LYS B 92 -72.383 6.302 18.280 1.00 27.94 C ATOM 4335 CD LYS B 92 -72.181 6.580 19.769 1.00 34.89 C ATOM 4336 CE LYS B 92 -73.496 6.898 20.488 1.00 26.65 C ATOM 4337 NZ LYS B 92 -73.261 7.457 21.859 1.00 30.31 N ATOM 4338 HA LYS B 92 -73.319 6.183 15.876 1.00 0.00 H ATOM 4339 HB2 LYS B 92 -72.404 8.347 17.702 1.00 0.00 H ATOM 4340 HB3 LYS B 92 -74.006 7.654 18.046 1.00 0.00 H ATOM 4341 HG2 LYS B 92 -73.015 5.421 18.167 1.00 0.00 H ATOM 4342 HG3 LYS B 92 -71.413 6.113 17.821 1.00 0.00 H ATOM 4343 HD2 LYS B 92 -71.733 5.701 20.232 1.00 0.00 H ATOM 4344 HD3 LYS B 92 -71.508 7.430 19.878 1.00 0.00 H ATOM 4345 HE2 LYS B 92 -74.081 5.982 20.576 1.00 0.00 H ATOM 4346 HE3 LYS B 92 -74.052 7.628 19.900 1.00 0.00 H ATOM 4347 HZ1 LYS B 92 -72.736 6.764 22.429 1.00 0.00 H ATOM 4348 HZ2 LYS B 92 -72.709 8.335 21.784 1.00 0.00 H ATOM 4349 HZ3 LYS B 92 -74.176 7.659 22.311 1.00 0.00 H ATOM 4350 H LYS B 92 -71.353 8.230 15.788 1.00 0.00 H ATOM 4351 N GLN B 93 -74.614 9.196 15.506 1.00 19.80 N ATOM 4352 CA GLN B 93 -75.824 9.900 15.084 1.00 22.41 C ATOM 4353 C GLN B 93 -76.267 9.481 13.680 1.00 21.49 C ATOM 4354 O GLN B 93 -77.464 9.326 13.420 1.00 22.47 O ATOM 4355 CB GLN B 93 -75.629 11.423 15.172 1.00 20.52 C ATOM 4356 CG GLN B 93 -76.882 12.247 14.870 1.00 22.53 C ATOM 4357 CD GLN B 93 -77.964 12.128 15.943 1.00 23.70 C ATOM 4358 OE1 GLN B 93 -77.789 11.442 16.951 1.00 23.69 O ATOM 4359 NE2 GLN B 93 -79.089 12.801 15.722 1.00 22.57 N ATOM 4360 HA GLN B 93 -76.623 9.618 15.770 1.00 0.00 H ATOM 4361 HB2 GLN B 93 -75.298 11.665 16.182 1.00 0.00 H ATOM 4362 HB3 GLN B 93 -74.855 11.708 14.459 1.00 0.00 H ATOM 4363 HG2 GLN B 93 -76.594 13.295 14.785 1.00 0.00 H ATOM 4364 HG3 GLN B 93 -77.298 11.908 13.921 1.00 0.00 H ATOM 4365 HE22 GLN B 93 -79.194 13.368 14.857 1.00 0.00 H ATOM 4366 HE21 GLN B 93 -79.864 12.760 16.414 1.00 0.00 H ATOM 4367 H GLN B 93 -73.748 9.740 15.695 1.00 0.00 H ATOM 4368 N GLN B 94 -75.314 9.288 12.769 1.00 17.94 N ATOM 4369 CA GLN B 94 -75.646 8.737 11.447 1.00 20.97 C ATOM 4370 C GLN B 94 -76.321 7.361 11.586 1.00 21.14 C ATOM 4371 O GLN B 94 -77.366 7.105 10.987 1.00 21.72 O ATOM 4372 CB GLN B 94 -74.391 8.627 10.572 1.00 18.65 C ATOM 4373 CG GLN B 94 -74.628 8.101 9.150 1.00 20.21 C ATOM 4374 CD GLN B 94 -74.742 6.594 9.084 1.00 20.45 C ATOM 4375 OE1 GLN B 94 -74.233 5.874 9.949 1.00 17.99 O ATOM 4376 NE2 GLN B 94 -75.419 6.100 8.046 1.00 22.90 N ATOM 4377 HA GLN B 94 -76.345 9.419 10.963 1.00 0.00 H ATOM 4378 HB2 GLN B 94 -73.946 9.619 10.495 1.00 0.00 H ATOM 4379 HB3 GLN B 94 -73.692 7.954 11.068 1.00 0.00 H ATOM 4380 HG2 GLN B 94 -75.552 8.536 8.769 1.00 0.00 H ATOM 4381 HG3 GLN B 94 -73.794 8.414 8.521 1.00 0.00 H ATOM 4382 HE22 GLN B 94 -75.831 6.743 7.341 1.00 0.00 H ATOM 4383 HE21 GLN B 94 -75.534 5.072 7.942 1.00 0.00 H ATOM 4384 H GLN B 94 -74.328 9.529 12.995 1.00 0.00 H ATOM 4385 N ALA B 95 -75.711 6.490 12.382 1.00 22.05 N ATOM 4386 CA ALA B 95 -76.214 5.127 12.604 1.00 22.50 C ATOM 4387 C ALA B 95 -77.583 5.131 13.284 1.00 24.17 C ATOM 4388 O ALA B 95 -78.472 4.341 12.935 1.00 24.46 O ATOM 4389 CB ALA B 95 -75.222 4.331 13.430 1.00 24.24 C ATOM 4390 HA ALA B 95 -76.331 4.656 11.628 1.00 0.00 H ATOM 4391 HB1 ALA B 95 -74.270 4.279 12.902 1.00 0.00 H ATOM 4392 HB2 ALA B 95 -75.078 4.820 14.393 1.00 0.00 H ATOM 4393 HB3 ALA B 95 -75.607 3.324 13.587 1.00 0.00 H ATOM 4394 H ALA B 95 -74.841 6.785 12.869 1.00 0.00 H ATOM 4395 N TYR B 96 -77.750 6.018 14.259 1.00 22.47 N ATOM 4396 CA TYR B 96 -79.031 6.171 14.941 1.00 24.37 C ATOM 4397 C TYR B 96 -80.112 6.555 13.946 1.00 20.09 C ATOM 4398 O TYR B 96 -81.147 5.879 13.845 1.00 21.05 O ATOM 4399 CB TYR B 96 -78.933 7.215 16.060 1.00 23.24 C ATOM 4400 CG TYR B 96 -80.261 7.531 16.718 1.00 23.45 C ATOM 4401 CD1 TYR B 96 -80.943 6.560 17.448 1.00 25.44 C ATOM 4402 CD2 TYR B 96 -80.837 8.795 16.603 1.00 26.64 C ATOM 4403 CE1 TYR B 96 -82.159 6.841 18.045 1.00 23.87 C ATOM 4404 CE2 TYR B 96 -82.055 9.085 17.198 1.00 24.85 C ATOM 4405 CZ TYR B 96 -82.708 8.102 17.920 1.00 24.07 C ATOM 4406 OH TYR B 96 -83.918 8.372 18.518 1.00 28.45 O ATOM 4407 HA TYR B 96 -79.296 5.216 15.394 1.00 0.00 H ATOM 4408 HB3 TYR B 96 -78.531 8.136 15.637 1.00 0.00 H ATOM 4409 HB2 TYR B 96 -78.252 6.839 16.823 1.00 0.00 H ATOM 4410 HD2 TYR B 96 -80.321 9.569 16.035 1.00 0.00 H ATOM 4411 HE2 TYR B 96 -82.494 10.078 17.098 1.00 0.00 H ATOM 4412 HE1 TYR B 96 -82.682 6.070 18.612 1.00 0.00 H ATOM 4413 HD1 TYR B 96 -80.512 5.564 17.550 1.00 0.00 H ATOM 4414 HH TYR B 96 -84.575 8.636 17.826 1.00 0.00 H ATOM 4415 H TYR B 96 -76.949 6.617 14.543 1.00 0.00 H ATOM 4416 N LEU B 97 -79.868 7.631 13.198 1.00 19.37 N ATOM 4417 CA LEU B 97 -80.860 8.142 12.253 1.00 20.87 C ATOM 4418 C LEU B 97 -81.140 7.134 11.140 1.00 20.39 C ATOM 4419 O LEU B 97 -82.247 7.075 10.618 1.00 17.82 O ATOM 4420 CB LEU B 97 -80.416 9.480 11.661 1.00 19.05 C ATOM 4421 CG LEU B 97 -80.310 10.599 12.699 1.00 21.21 C ATOM 4422 CD1 LEU B 97 -80.180 11.952 12.005 1.00 20.17 C ATOM 4423 CD2 LEU B 97 -81.502 10.584 13.653 1.00 23.17 C ATOM 4424 HA LEU B 97 -81.786 8.300 12.806 1.00 0.00 H ATOM 4425 HB2 LEU B 97 -79.439 9.345 11.197 1.00 0.00 H ATOM 4426 HB3 LEU B 97 -81.139 9.779 10.902 1.00 0.00 H ATOM 4427 HG LEU B 97 -79.413 10.429 13.295 1.00 0.00 H ATOM 4428 HD21 LEU B 97 -82.422 10.722 13.085 1.00 0.00 H ATOM 4429 HD22 LEU B 97 -81.536 9.628 14.175 1.00 0.00 H ATOM 4430 HD23 LEU B 97 -81.396 11.391 14.378 1.00 0.00 H ATOM 4431 HD11 LEU B 97 -79.285 11.956 11.383 1.00 0.00 H ATOM 4432 HD12 LEU B 97 -81.057 12.125 11.382 1.00 0.00 H ATOM 4433 HD13 LEU B 97 -80.106 12.738 12.756 1.00 0.00 H ATOM 4434 H LEU B 97 -78.953 8.117 13.288 1.00 0.00 H ATOM 4435 N ALA B 98 -80.131 6.337 10.793 1.00 19.34 N ATOM 4436 CA ALA B 98 -80.311 5.292 9.778 1.00 22.23 C ATOM 4437 C ALA B 98 -81.385 4.292 10.196 1.00 21.99 C ATOM 4438 O ALA B 98 -81.964 3.609 9.348 1.00 24.19 O ATOM 4439 CB ALA B 98 -78.996 4.577 9.509 1.00 20.14 C ATOM 4440 HA ALA B 98 -80.642 5.774 8.858 1.00 0.00 H ATOM 4441 HB1 ALA B 98 -78.260 5.296 9.150 1.00 0.00 H ATOM 4442 HB2 ALA B 98 -78.638 4.118 10.431 1.00 0.00 H ATOM 4443 HB3 ALA B 98 -79.151 3.806 8.754 1.00 0.00 H ATOM 4444 H ALA B 98 -79.203 6.457 11.247 1.00 0.00 H ATOM 4445 N THR B 99 -81.646 4.200 11.502 1.00 23.97 N ATOM 4446 CA THR B 99 -82.668 3.284 12.009 1.00 24.61 C ATOM 4447 C THR B 99 -84.048 3.911 12.182 1.00 26.26 C ATOM 4448 O THR B 99 -85.050 3.196 12.203 1.00 26.63 O ATOM 4449 CB THR B 99 -82.280 2.615 13.356 1.00 22.02 C ATOM 4450 OG1 THR B 99 -82.266 3.586 14.422 1.00 24.87 O ATOM 4451 CG2 THR B 99 -80.931 1.919 13.244 1.00 23.47 C ATOM 4452 HA THR B 99 -82.722 2.532 11.222 1.00 0.00 H ATOM 4453 HB THR B 99 -83.032 1.862 13.591 1.00 0.00 H ATOM 4454 HG1 THR B 99 -81.606 4.294 14.214 1.00 0.00 H ATOM 4455 HG23 THR B 99 -80.965 1.191 12.433 1.00 0.00 H ATOM 4456 HG21 THR B 99 -80.158 2.659 13.037 1.00 0.00 H ATOM 4457 HG22 THR B 99 -80.707 1.410 14.182 1.00 0.00 H ATOM 4458 H THR B 99 -81.113 4.791 12.172 1.00 0.00 H ATOM 4459 N THR B 100 -84.102 5.232 12.321 1.00 22.27 N ATOM 4460 CA THR B 100 -85.364 5.907 12.626 1.00 23.22 C ATOM 4461 C THR B 100 -86.001 6.602 11.421 1.00 23.33 C ATOM 4462 O THR B 100 -87.221 6.724 11.357 1.00 23.41 O ATOM 4463 CB THR B 100 -85.222 6.916 13.773 1.00 23.59 C ATOM 4464 OG1 THR B 100 -84.271 7.922 13.407 1.00 23.74 O ATOM 4465 CG2 THR B 100 -84.763 6.219 15.048 1.00 26.00 C ATOM 4466 HA THR B 100 -86.031 5.101 12.934 1.00 0.00 H ATOM 4467 HB THR B 100 -86.193 7.375 13.958 1.00 0.00 H ATOM 4468 HG1 THR B 100 -84.180 8.573 14.147 1.00 0.00 H ATOM 4469 HG23 THR B 100 -85.489 5.454 15.324 1.00 0.00 H ATOM 4470 HG21 THR B 100 -83.791 5.755 14.877 1.00 0.00 H ATOM 4471 HG22 THR B 100 -84.682 6.951 15.852 1.00 0.00 H ATOM 4472 H THR B 100 -83.234 5.794 12.211 1.00 0.00 H ATOM 4473 N PHE B 101 -85.195 7.062 10.470 1.00 22.11 N ATOM 4474 CA PHE B 101 -85.765 7.657 9.261 1.00 19.63 C ATOM 4475 C PHE B 101 -86.338 6.553 8.370 1.00 22.94 C ATOM 4476 O PHE B 101 -85.749 5.486 8.251 1.00 24.14 O ATOM 4477 CB PHE B 101 -84.718 8.477 8.501 1.00 20.37 C ATOM 4478 CG PHE B 101 -84.524 9.864 9.046 1.00 22.91 C ATOM 4479 CD1 PHE B 101 -84.301 10.063 10.396 1.00 24.11 C ATOM 4480 CD2 PHE B 101 -84.560 10.965 8.207 1.00 24.97 C ATOM 4481 CE1 PHE B 101 -84.121 11.340 10.906 1.00 27.53 C ATOM 4482 CE2 PHE B 101 -84.380 12.248 8.710 1.00 27.28 C ATOM 4483 CZ PHE B 101 -84.159 12.433 10.059 1.00 24.83 C ATOM 4484 HA PHE B 101 -86.566 8.337 9.550 1.00 0.00 H ATOM 4485 HB2 PHE B 101 -83.765 7.951 8.552 1.00 0.00 H ATOM 4486 HB3 PHE B 101 -85.032 8.557 7.460 1.00 0.00 H ATOM 4487 HD2 PHE B 101 -84.731 10.824 7.140 1.00 0.00 H ATOM 4488 HE2 PHE B 101 -84.413 13.107 8.040 1.00 0.00 H ATOM 4489 HZ PHE B 101 -84.015 13.438 10.456 1.00 0.00 H ATOM 4490 HE1 PHE B 101 -83.950 11.482 11.973 1.00 0.00 H ATOM 4491 HD1 PHE B 101 -84.266 9.205 11.068 1.00 0.00 H ATOM 4492 H PHE B 101 -84.163 6.999 10.585 1.00 0.00 H ATOM 4493 N LYS B 102 -87.484 6.809 7.749 1.00 23.60 N ATOM 4494 CA LYS B 102 -88.220 5.759 7.037 1.00 25.19 C ATOM 4495 C LYS B 102 -88.286 5.953 5.517 1.00 24.43 C ATOM 4496 O LYS B 102 -88.285 4.978 4.760 1.00 23.85 O ATOM 4497 CB LYS B 102 -89.637 5.625 7.607 1.00 24.88 C ATOM 4498 CG LYS B 102 -89.700 5.444 9.130 1.00 30.37 C ATOM 4499 CD LYS B 102 -88.937 4.211 9.598 1.00 30.06 C ATOM 4500 CE LYS B 102 -88.914 4.101 11.118 1.00 28.61 C ATOM 4501 NZ LYS B 102 -87.977 3.038 11.593 1.00 30.34 N ATOM 4502 HA LYS B 102 -87.654 4.842 7.200 1.00 0.00 H ATOM 4503 HB2 LYS B 102 -90.194 6.525 7.348 1.00 0.00 H ATOM 4504 HB3 LYS B 102 -90.110 4.760 7.142 1.00 0.00 H ATOM 4505 HG2 LYS B 102 -89.269 6.325 9.606 1.00 0.00 H ATOM 4506 HG3 LYS B 102 -90.744 5.345 9.429 1.00 0.00 H ATOM 4507 HD2 LYS B 102 -89.416 3.322 9.187 1.00 0.00 H ATOM 4508 HD3 LYS B 102 -87.912 4.271 9.233 1.00 0.00 H ATOM 4509 HE2 LYS B 102 -89.919 3.866 11.468 1.00 0.00 H ATOM 4510 HE3 LYS B 102 -88.600 5.058 11.535 1.00 0.00 H ATOM 4511 HZ1 LYS B 102 -88.273 2.119 11.206 1.00 0.00 H ATOM 4512 HZ2 LYS B 102 -87.013 3.257 11.270 1.00 0.00 H ATOM 4513 HZ3 LYS B 102 -87.995 3.000 12.632 1.00 0.00 H ATOM 4514 H LYS B 102 -87.868 7.775 7.768 1.00 0.00 H ATOM 4515 N SER B 103 -88.345 7.203 5.068 1.00 22.96 N ATOM 4516 CA SER B 103 -88.449 7.490 3.637 1.00 23.08 C ATOM 4517 C SER B 103 -87.241 6.939 2.889 1.00 23.69 C ATOM 4518 O SER B 103 -86.097 7.135 3.316 1.00 22.26 O ATOM 4519 CB SER B 103 -88.534 8.993 3.388 1.00 26.51 C ATOM 4520 OG SER B 103 -89.492 9.584 4.245 1.00 36.18 O ATOM 4521 HA SER B 103 -89.357 7.010 3.273 1.00 0.00 H ATOM 4522 HB2 SER B 103 -88.822 9.169 2.352 1.00 0.00 H ATOM 4523 HB3 SER B 103 -87.559 9.443 3.575 1.00 0.00 H ATOM 4524 HG SER B 103 -89.534 10.558 4.070 1.00 0.00 H ATOM 4525 H SER B 103 -88.317 7.991 5.746 1.00 0.00 H ATOM 4526 N PRO B 104 -87.480 6.252 1.763 1.00 24.90 N ATOM 4527 CA PRO B 104 -86.310 5.671 1.099 1.00 21.70 C ATOM 4528 C PRO B 104 -85.272 6.721 0.706 1.00 21.11 C ATOM 4529 O PRO B 104 -84.069 6.450 0.807 1.00 21.57 O ATOM 4530 CB PRO B 104 -86.915 4.989 -0.135 1.00 27.24 C ATOM 4531 CG PRO B 104 -88.291 4.594 0.322 1.00 25.07 C ATOM 4532 CD PRO B 104 -88.745 5.761 1.187 1.00 23.06 C ATOM 4533 HA PRO B 104 -85.762 4.989 1.749 1.00 0.00 H ATOM 4534 HD3 PRO B 104 -89.228 6.531 0.586 1.00 0.00 H ATOM 4535 HD2 PRO B 104 -89.429 5.429 1.968 1.00 0.00 H ATOM 4536 HG3 PRO B 104 -88.256 3.672 0.903 1.00 0.00 H ATOM 4537 HG2 PRO B 104 -88.958 4.461 -0.529 1.00 0.00 H ATOM 4538 HB2 PRO B 104 -86.967 5.680 -0.976 1.00 0.00 H ATOM 4539 HB3 PRO B 104 -86.333 4.113 -0.421 1.00 0.00 H ATOM 4540 N GLU B 105 -85.714 7.901 0.286 1.00 22.00 N ATOM 4541 CA GLU B 105 -84.765 8.916 -0.157 1.00 24.85 C ATOM 4542 C GLU B 105 -83.920 9.424 1.013 1.00 19.53 C ATOM 4543 O GLU B 105 -82.744 9.757 0.845 1.00 20.78 O ATOM 4544 CB GLU B 105 -85.465 10.066 -0.875 1.00 30.24 C ATOM 4545 CG GLU B 105 -86.094 11.103 0.033 1.00 29.86 C ATOM 4546 CD GLU B 105 -86.444 12.381 -0.717 1.00 42.40 C ATOM 4547 OE1 GLU B 105 -85.868 12.603 -1.807 1.00 38.05 O ATOM 4548 OE2 GLU B 105 -87.292 13.159 -0.218 1.00 40.20 O ATOM 4549 HA GLU B 105 -84.094 8.447 -0.877 1.00 0.00 H ATOM 4550 HB2 GLU B 105 -84.730 10.569 -1.504 1.00 0.00 H ATOM 4551 HB3 GLU B 105 -86.251 9.645 -1.502 1.00 0.00 H ATOM 4552 HG2 GLU B 105 -87.005 10.687 0.465 1.00 0.00 H ATOM 4553 HG3 GLU B 105 -85.392 11.344 0.831 1.00 0.00 H ATOM 4554 H GLU B 105 -86.735 8.101 0.273 1.00 0.00 H ATOM 4555 N ASN B 106 -84.513 9.450 2.197 1.00 20.13 N ATOM 4556 CA ASN B 106 -83.772 9.832 3.389 1.00 19.26 C ATOM 4557 C ASN B 106 -82.821 8.720 3.798 1.00 20.46 C ATOM 4558 O ASN B 106 -81.680 8.977 4.183 1.00 18.49 O ATOM 4559 CB ASN B 106 -84.711 10.177 4.539 1.00 20.61 C ATOM 4560 CG ASN B 106 -85.328 11.563 4.402 1.00 22.56 C ATOM 4561 OD1 ASN B 106 -84.756 12.459 3.774 1.00 22.13 O ATOM 4562 ND2 ASN B 106 -86.492 11.746 5.005 1.00 22.09 N ATOM 4563 HA ASN B 106 -83.192 10.724 3.152 1.00 0.00 H ATOM 4564 HB2 ASN B 106 -85.513 9.440 4.567 1.00 0.00 H ATOM 4565 HB3 ASN B 106 -84.149 10.136 5.472 1.00 0.00 H ATOM 4566 HD22 ASN B 106 -86.938 10.962 5.523 1.00 0.00 H ATOM 4567 HD21 ASN B 106 -86.961 12.673 4.961 1.00 0.00 H ATOM 4568 H ASN B 106 -85.518 9.195 2.275 1.00 0.00 H ATOM 4569 N VAL B 107 -83.277 7.476 3.681 1.00 18.54 N ATOM 4570 CA VAL B 107 -82.456 6.354 4.117 1.00 22.11 C ATOM 4571 C VAL B 107 -81.213 6.220 3.234 1.00 19.09 C ATOM 4572 O VAL B 107 -80.129 5.896 3.728 1.00 18.50 O ATOM 4573 CB VAL B 107 -83.266 5.038 4.192 1.00 19.90 C ATOM 4574 CG1 VAL B 107 -82.390 3.900 4.709 1.00 25.95 C ATOM 4575 CG2 VAL B 107 -84.460 5.225 5.106 1.00 22.64 C ATOM 4576 HA VAL B 107 -82.119 6.560 5.133 1.00 0.00 H ATOM 4577 HB VAL B 107 -83.613 4.782 3.191 1.00 0.00 H ATOM 4578 HG11 VAL B 107 -81.545 3.759 4.035 1.00 0.00 H ATOM 4579 HG12 VAL B 107 -82.024 4.149 5.705 1.00 0.00 H ATOM 4580 HG13 VAL B 107 -82.977 2.983 4.755 1.00 0.00 H ATOM 4581 HG21 VAL B 107 -84.114 5.494 6.104 1.00 0.00 H ATOM 4582 HG22 VAL B 107 -85.095 6.019 4.714 1.00 0.00 H ATOM 4583 HG23 VAL B 107 -85.027 4.296 5.155 1.00 0.00 H ATOM 4584 H VAL B 107 -84.220 7.304 3.278 1.00 0.00 H ATOM 4585 N LYS B 108 -81.374 6.496 1.936 1.00 18.42 N ATOM 4586 CA LYS B 108 -80.264 6.454 0.996 1.00 20.57 C ATOM 4587 C LYS B 108 -79.280 7.598 1.254 1.00 21.49 C ATOM 4588 O LYS B 108 -78.066 7.410 1.194 1.00 16.58 O ATOM 4589 CB LYS B 108 -80.767 6.501 -0.455 1.00 23.25 C ATOM 4590 CG LYS B 108 -79.646 6.754 -1.454 1.00 25.65 C ATOM 4591 CD LYS B 108 -79.929 6.208 -2.837 1.00 27.96 C ATOM 4592 CE LYS B 108 -78.605 6.020 -3.585 1.00 25.19 C ATOM 4593 NZ LYS B 108 -78.761 5.597 -5.005 1.00 37.31 N ATOM 4594 HA LYS B 108 -79.741 5.510 1.148 1.00 0.00 H ATOM 4595 HB2 LYS B 108 -81.239 5.547 -0.693 1.00 0.00 H ATOM 4596 HB3 LYS B 108 -81.502 7.301 -0.544 1.00 0.00 H ATOM 4597 HG2 LYS B 108 -79.492 7.830 -1.533 1.00 0.00 H ATOM 4598 HG3 LYS B 108 -78.737 6.285 -1.078 1.00 0.00 H ATOM 4599 HD2 LYS B 108 -80.440 5.249 -2.753 1.00 0.00 H ATOM 4600 HD3 LYS B 108 -80.561 6.908 -3.384 1.00 0.00 H ATOM 4601 HE2 LYS B 108 -78.022 5.260 -3.064 1.00 0.00 H ATOM 4602 HE3 LYS B 108 -78.065 6.966 -3.567 1.00 0.00 H ATOM 4603 HZ1 LYS B 108 -79.265 4.688 -5.041 1.00 0.00 H ATOM 4604 HZ2 LYS B 108 -79.305 6.317 -5.522 1.00 0.00 H ATOM 4605 HZ3 LYS B 108 -77.822 5.492 -5.439 1.00 0.00 H ATOM 4606 H LYS B 108 -82.321 6.748 1.588 1.00 0.00 H ATOM 4607 N LEU B 109 -79.804 8.787 1.539 1.00 21.28 N ATOM 4608 CA LEU B 109 -78.939 9.901 1.922 1.00 19.31 C ATOM 4609 C LEU B 109 -78.109 9.564 3.154 1.00 18.18 C ATOM 4610 O LEU B 109 -76.920 9.901 3.218 1.00 20.93 O ATOM 4611 CB LEU B 109 -79.758 11.174 2.154 1.00 20.55 C ATOM 4612 CG LEU B 109 -80.218 11.880 0.872 1.00 21.36 C ATOM 4613 CD1 LEU B 109 -81.263 12.968 1.168 1.00 21.75 C ATOM 4614 CD2 LEU B 109 -79.032 12.457 0.104 1.00 22.20 C ATOM 4615 HA LEU B 109 -78.251 10.081 1.096 1.00 0.00 H ATOM 4616 HB2 LEU B 109 -80.643 10.909 2.733 1.00 0.00 H ATOM 4617 HB3 LEU B 109 -79.147 11.872 2.726 1.00 0.00 H ATOM 4618 HG LEU B 109 -80.695 11.129 0.242 1.00 0.00 H ATOM 4619 HD21 LEU B 109 -78.511 13.180 0.732 1.00 0.00 H ATOM 4620 HD22 LEU B 109 -78.350 11.651 -0.167 1.00 0.00 H ATOM 4621 HD23 LEU B 109 -79.391 12.951 -0.799 1.00 0.00 H ATOM 4622 HD11 LEU B 109 -82.133 12.515 1.643 1.00 0.00 H ATOM 4623 HD12 LEU B 109 -80.831 13.713 1.835 1.00 0.00 H ATOM 4624 HD13 LEU B 109 -81.564 13.445 0.235 1.00 0.00 H ATOM 4625 H LEU B 109 -80.834 8.924 1.489 1.00 0.00 H ATOM 4626 N LEU B 110 -78.726 8.903 4.134 1.00 16.29 N ATOM 4627 CA LEU B 110 -78.001 8.503 5.338 1.00 19.28 C ATOM 4628 C LEU B 110 -76.956 7.430 5.035 1.00 17.61 C ATOM 4629 O LEU B 110 -75.894 7.412 5.641 1.00 18.08 O ATOM 4630 CB LEU B 110 -78.958 8.039 6.444 1.00 18.24 C ATOM 4631 CG LEU B 110 -79.786 9.176 7.064 1.00 20.26 C ATOM 4632 CD1 LEU B 110 -81.047 8.636 7.714 1.00 19.28 C ATOM 4633 CD2 LEU B 110 -78.954 9.997 8.049 1.00 20.62 C ATOM 4634 HA LEU B 110 -77.475 9.385 5.702 1.00 0.00 H ATOM 4635 HB2 LEU B 110 -79.644 7.305 6.020 1.00 0.00 H ATOM 4636 HB3 LEU B 110 -78.370 7.571 7.234 1.00 0.00 H ATOM 4637 HG LEU B 110 -80.089 9.847 6.260 1.00 0.00 H ATOM 4638 HD21 LEU B 110 -78.599 9.349 8.851 1.00 0.00 H ATOM 4639 HD22 LEU B 110 -78.102 10.433 7.528 1.00 0.00 H ATOM 4640 HD23 LEU B 110 -79.570 10.792 8.469 1.00 0.00 H ATOM 4641 HD11 LEU B 110 -81.653 8.130 6.963 1.00 0.00 H ATOM 4642 HD12 LEU B 110 -80.776 7.931 8.500 1.00 0.00 H ATOM 4643 HD13 LEU B 110 -81.614 9.461 8.145 1.00 0.00 H ATOM 4644 H LEU B 110 -79.735 8.669 4.040 1.00 0.00 H ATOM 4645 N GLY B 111 -77.270 6.531 4.104 1.00 18.34 N ATOM 4646 CA GLY B 111 -76.308 5.543 3.650 1.00 14.87 C ATOM 4647 C GLY B 111 -75.114 6.167 2.944 1.00 15.34 C ATOM 4648 O GLY B 111 -73.977 5.748 3.154 1.00 16.44 O ATOM 4649 HA3 GLY B 111 -76.806 4.863 2.959 1.00 0.00 H ATOM 4650 HA2 GLY B 111 -75.949 4.983 4.513 1.00 0.00 H ATOM 4651 H GLY B 111 -78.225 6.537 3.693 1.00 0.00 H ATOM 4652 N GLU B 112 -75.361 7.163 2.098 1.00 16.04 N ATOM 4653 CA GLU B 112 -74.271 7.904 1.468 1.00 16.13 C ATOM 4654 C GLU B 112 -73.403 8.616 2.508 1.00 17.40 C ATOM 4655 O GLU B 112 -72.174 8.600 2.432 1.00 15.94 O ATOM 4656 CB GLU B 112 -74.835 8.904 0.463 1.00 18.73 C ATOM 4657 CG GLU B 112 -75.247 8.236 -0.834 1.00 21.35 C ATOM 4658 CD GLU B 112 -76.203 9.072 -1.659 1.00 27.13 C ATOM 4659 OE1 GLU B 112 -76.851 9.983 -1.103 1.00 24.35 O ATOM 4660 OE2 GLU B 112 -76.309 8.804 -2.872 1.00 28.17 O ATOM 4661 HA GLU B 112 -73.634 7.192 0.943 1.00 0.00 H ATOM 4662 HB2 GLU B 112 -75.707 9.390 0.901 1.00 0.00 H ATOM 4663 HB3 GLU B 112 -74.073 9.653 0.247 1.00 0.00 H ATOM 4664 HG2 GLU B 112 -74.352 8.047 -1.426 1.00 0.00 H ATOM 4665 HG3 GLU B 112 -75.731 7.288 -0.597 1.00 0.00 H ATOM 4666 H GLU B 112 -76.346 7.418 1.882 1.00 0.00 H ATOM 4667 N LEU B 113 -74.053 9.222 3.490 1.00 15.46 N ATOM 4668 CA LEU B 113 -73.332 9.874 4.569 1.00 17.29 C ATOM 4669 C LEU B 113 -72.439 8.847 5.240 1.00 19.23 C ATOM 4670 O LEU B 113 -71.244 9.069 5.434 1.00 17.21 O ATOM 4671 CB LEU B 113 -74.326 10.471 5.565 1.00 21.26 C ATOM 4672 CG LEU B 113 -73.892 11.668 6.401 1.00 26.67 C ATOM 4673 CD1 LEU B 113 -73.125 12.671 5.556 1.00 22.31 C ATOM 4674 CD2 LEU B 113 -75.123 12.318 7.022 1.00 26.65 C ATOM 4675 HA LEU B 113 -72.716 10.685 4.182 1.00 0.00 H ATOM 4676 HB2 LEU B 113 -75.205 10.777 4.998 1.00 0.00 H ATOM 4677 HB3 LEU B 113 -74.601 9.677 6.259 1.00 0.00 H ATOM 4678 HG LEU B 113 -73.225 11.327 7.193 1.00 0.00 H ATOM 4679 HD21 LEU B 113 -75.796 12.648 6.231 1.00 0.00 H ATOM 4680 HD22 LEU B 113 -75.634 11.594 7.656 1.00 0.00 H ATOM 4681 HD23 LEU B 113 -74.816 13.175 7.621 1.00 0.00 H ATOM 4682 HD11 LEU B 113 -72.238 12.192 5.142 1.00 0.00 H ATOM 4683 HD12 LEU B 113 -73.762 13.023 4.744 1.00 0.00 H ATOM 4684 HD13 LEU B 113 -72.827 13.515 6.178 1.00 0.00 H ATOM 4685 H LEU B 113 -75.093 9.231 3.488 1.00 0.00 H ATOM 4686 N GLY B 114 -73.018 7.700 5.576 1.00 15.93 N ATOM 4687 CA GLY B 114 -72.262 6.641 6.212 1.00 19.09 C ATOM 4688 C GLY B 114 -71.054 6.185 5.412 1.00 17.59 C ATOM 4689 O GLY B 114 -70.017 5.856 6.001 1.00 16.98 O ATOM 4690 HA3 GLY B 114 -72.922 5.786 6.356 1.00 0.00 H ATOM 4691 HA2 GLY B 114 -71.917 6.999 7.182 1.00 0.00 H ATOM 4692 H GLY B 114 -74.030 7.560 5.379 1.00 0.00 H ATOM 4693 N ASP B 115 -71.178 6.135 4.084 1.00 20.04 N ATOM 4694 CA ASP B 115 -70.031 5.757 3.242 1.00 17.86 C ATOM 4695 C ASP B 115 -68.918 6.793 3.346 1.00 19.63 C ATOM 4696 O ASP B 115 -67.730 6.463 3.345 1.00 17.83 O ATOM 4697 CB ASP B 115 -70.431 5.600 1.767 1.00 17.67 C ATOM 4698 CG ASP B 115 -71.282 4.361 1.518 1.00 18.41 C ATOM 4699 OD1 ASP B 115 -71.240 3.439 2.354 1.00 16.97 O ATOM 4700 OD2 ASP B 115 -71.999 4.320 0.491 1.00 19.80 O ATOM 4701 HA ASP B 115 -69.675 4.795 3.611 1.00 0.00 H ATOM 4702 HB2 ASP B 115 -70.998 6.480 1.463 1.00 0.00 H ATOM 4703 HB3 ASP B 115 -69.525 5.528 1.165 1.00 0.00 H ATOM 4704 H ASP B 115 -72.091 6.365 3.641 1.00 0.00 H ATOM 4705 N THR B 116 -69.299 8.059 3.424 1.00 17.65 N ATOM 4706 CA THR B 116 -68.281 9.096 3.463 1.00 20.03 C ATOM 4707 C THR B 116 -67.596 9.099 4.821 1.00 17.15 C ATOM 4708 O THR B 116 -66.390 9.387 4.920 1.00 17.93 O ATOM 4709 CB THR B 116 -68.859 10.465 3.124 1.00 19.67 C ATOM 4710 OG1 THR B 116 -69.498 10.395 1.849 1.00 22.60 O ATOM 4711 CG2 THR B 116 -67.748 11.516 3.073 1.00 20.56 C ATOM 4712 HA THR B 116 -67.535 8.874 2.700 1.00 0.00 H ATOM 4713 HB THR B 116 -69.577 10.749 3.893 1.00 0.00 H ATOM 4714 HG1 THR B 116 -69.876 11.281 1.622 1.00 0.00 H ATOM 4715 HG23 THR B 116 -67.258 11.572 4.045 1.00 0.00 H ATOM 4716 HG21 THR B 116 -67.019 11.236 2.313 1.00 0.00 H ATOM 4717 HG22 THR B 116 -68.179 12.486 2.825 1.00 0.00 H ATOM 4718 H THR B 116 -70.309 8.307 3.457 1.00 0.00 H ATOM 4719 N ILE B 117 -68.363 8.768 5.860 1.00 18.72 N ATOM 4720 CA ILE B 117 -67.816 8.592 7.207 1.00 18.71 C ATOM 4721 C ILE B 117 -66.776 7.482 7.232 1.00 18.28 C ATOM 4722 O ILE B 117 -65.708 7.628 7.839 1.00 17.61 O ATOM 4723 CB ILE B 117 -68.921 8.305 8.249 1.00 19.47 C ATOM 4724 CG1 ILE B 117 -69.772 9.547 8.433 1.00 19.34 C ATOM 4725 CG2 ILE B 117 -68.321 7.917 9.596 1.00 20.37 C ATOM 4726 CD1 ILE B 117 -68.942 10.720 8.812 1.00 26.76 C ATOM 4727 HA ILE B 117 -67.337 9.533 7.478 1.00 0.00 H ATOM 4728 HB ILE B 117 -69.526 7.476 7.883 1.00 0.00 H ATOM 4729 HG12 ILE B 117 -70.289 9.765 7.499 1.00 0.00 H ATOM 4730 HG13 ILE B 117 -70.505 9.362 9.218 1.00 0.00 H ATOM 4731 HD11 ILE B 117 -68.426 10.511 9.749 1.00 0.00 H ATOM 4732 HD12 ILE B 117 -68.210 10.914 8.028 1.00 0.00 H ATOM 4733 HD13 ILE B 117 -69.583 11.593 8.936 1.00 0.00 H ATOM 4734 HG21 ILE B 117 -67.713 7.020 9.477 1.00 0.00 H ATOM 4735 HG22 ILE B 117 -67.699 8.733 9.964 1.00 0.00 H ATOM 4736 HG23 ILE B 117 -69.124 7.722 10.307 1.00 0.00 H ATOM 4737 H ILE B 117 -69.383 8.630 5.709 1.00 0.00 H ATOM 4738 N SER B 118 -67.078 6.367 6.571 1.00 16.99 N ATOM 4739 CA SER B 118 -66.097 5.292 6.455 1.00 20.63 C ATOM 4740 C SER B 118 -64.811 5.763 5.779 1.00 18.09 C ATOM 4741 O SER B 118 -63.718 5.390 6.202 1.00 21.51 O ATOM 4742 CB SER B 118 -66.671 4.082 5.712 1.00 22.75 C ATOM 4743 OG SER B 118 -67.557 3.354 6.546 1.00 24.99 O ATOM 4744 HA SER B 118 -65.852 4.987 7.472 1.00 0.00 H ATOM 4745 HB2 SER B 118 -65.853 3.431 5.404 1.00 0.00 H ATOM 4746 HB3 SER B 118 -67.211 4.427 4.830 1.00 0.00 H ATOM 4747 HG SER B 118 -67.069 3.036 7.346 1.00 0.00 H ATOM 4748 H SER B 118 -68.016 6.261 6.135 1.00 0.00 H ATOM 4749 N ALA B 119 -64.932 6.566 4.726 1.00 17.86 N ATOM 4750 CA ALA B 119 -63.739 7.072 4.032 1.00 18.64 C ATOM 4751 C ALA B 119 -62.972 8.057 4.922 1.00 17.37 C ATOM 4752 O ALA B 119 -61.735 8.033 5.015 1.00 17.87 O ATOM 4753 CB ALA B 119 -64.138 7.738 2.715 1.00 19.56 C ATOM 4754 HA ALA B 119 -63.082 6.230 3.813 1.00 0.00 H ATOM 4755 HB1 ALA B 119 -64.640 7.009 2.078 1.00 0.00 H ATOM 4756 HB2 ALA B 119 -64.812 8.570 2.920 1.00 0.00 H ATOM 4757 HB3 ALA B 119 -63.245 8.108 2.211 1.00 0.00 H ATOM 4758 H ALA B 119 -65.878 6.838 4.391 1.00 0.00 H ATOM 4759 N TYR B 120 -63.724 8.924 5.579 1.00 15.16 N ATOM 4760 CA TYR B 120 -63.141 9.885 6.502 1.00 17.74 C ATOM 4761 C TYR B 120 -62.324 9.201 7.595 1.00 15.59 C ATOM 4762 O TYR B 120 -61.218 9.635 7.916 1.00 15.22 O ATOM 4763 CB TYR B 120 -64.245 10.731 7.115 1.00 13.52 C ATOM 4764 CG TYR B 120 -63.743 11.905 7.930 1.00 16.14 C ATOM 4765 CD1 TYR B 120 -63.324 11.727 9.241 1.00 18.83 C ATOM 4766 CD2 TYR B 120 -63.696 13.188 7.386 1.00 15.38 C ATOM 4767 CE1 TYR B 120 -62.867 12.799 10.010 1.00 17.02 C ATOM 4768 CE2 TYR B 120 -63.246 14.271 8.148 1.00 14.54 C ATOM 4769 CZ TYR B 120 -62.831 14.060 9.456 1.00 13.93 C ATOM 4770 OH TYR B 120 -62.373 15.125 10.226 1.00 18.02 O ATOM 4771 HA TYR B 120 -62.457 10.523 5.942 1.00 0.00 H ATOM 4772 HB3 TYR B 120 -64.844 10.094 7.765 1.00 0.00 H ATOM 4773 HB2 TYR B 120 -64.870 11.116 6.309 1.00 0.00 H ATOM 4774 HD2 TYR B 120 -64.013 13.349 6.356 1.00 0.00 H ATOM 4775 HE2 TYR B 120 -63.221 15.273 7.718 1.00 0.00 H ATOM 4776 HE1 TYR B 120 -62.542 12.640 11.038 1.00 0.00 H ATOM 4777 HD1 TYR B 120 -63.352 10.729 9.679 1.00 0.00 H ATOM 4778 HH TYR B 120 -63.090 15.802 10.310 1.00 0.00 H ATOM 4779 H TYR B 120 -64.754 8.919 5.433 1.00 0.00 H ATOM 4780 N LYS B 121 -62.853 8.125 8.180 1.00 19.76 N ATOM 4781 CA LYS B 121 -62.090 7.418 9.208 1.00 16.78 C ATOM 4782 C LYS B 121 -60.755 6.915 8.673 1.00 17.64 C ATOM 4783 O LYS B 121 -59.734 6.973 9.365 1.00 17.13 O ATOM 4784 CB LYS B 121 -62.887 6.250 9.790 1.00 18.44 C ATOM 4785 CG LYS B 121 -64.129 6.661 10.531 1.00 23.60 C ATOM 4786 CD LYS B 121 -64.864 5.439 11.080 1.00 26.47 C ATOM 4787 CE LYS B 121 -66.191 5.838 11.719 1.00 25.82 C ATOM 4788 NZ LYS B 121 -66.999 4.656 12.143 1.00 32.39 N ATOM 4789 HA LYS B 121 -61.893 8.138 10.002 1.00 0.00 H ATOM 4790 HB2 LYS B 121 -63.179 5.593 8.971 1.00 0.00 H ATOM 4791 HB3 LYS B 121 -62.242 5.705 10.479 1.00 0.00 H ATOM 4792 HG2 LYS B 121 -63.852 7.313 11.359 1.00 0.00 H ATOM 4793 HG3 LYS B 121 -64.789 7.200 9.851 1.00 0.00 H ATOM 4794 HD2 LYS B 121 -65.057 4.743 10.264 1.00 0.00 H ATOM 4795 HD3 LYS B 121 -64.239 4.954 11.830 1.00 0.00 H ATOM 4796 HE2 LYS B 121 -66.768 6.415 10.996 1.00 0.00 H ATOM 4797 HE3 LYS B 121 -65.987 6.454 12.594 1.00 0.00 H ATOM 4798 HZ1 LYS B 121 -67.207 4.064 11.313 1.00 0.00 H ATOM 4799 HZ2 LYS B 121 -66.461 4.102 12.839 1.00 0.00 H ATOM 4800 HZ3 LYS B 121 -67.889 4.982 12.570 1.00 0.00 H ATOM 4801 H LYS B 121 -63.800 7.792 7.907 1.00 0.00 H ATOM 4802 N LEU B 122 -60.756 6.423 7.437 1.00 15.85 N ATOM 4803 CA LEU B 122 -59.518 5.939 6.826 1.00 16.86 C ATOM 4804 C LEU B 122 -58.519 7.066 6.580 1.00 16.58 C ATOM 4805 O LEU B 122 -57.317 6.902 6.806 1.00 17.72 O ATOM 4806 CB LEU B 122 -59.803 5.210 5.516 1.00 19.04 C ATOM 4807 CG LEU B 122 -60.350 3.780 5.628 1.00 26.64 C ATOM 4808 CD1 LEU B 122 -60.688 3.239 4.235 1.00 22.43 C ATOM 4809 CD2 LEU B 122 -59.361 2.852 6.341 1.00 22.54 C ATOM 4810 HA LEU B 122 -59.072 5.242 7.535 1.00 0.00 H ATOM 4811 HB2 LEU B 122 -60.532 5.800 4.961 1.00 0.00 H ATOM 4812 HB3 LEU B 122 -58.870 5.164 4.953 1.00 0.00 H ATOM 4813 HG LEU B 122 -61.259 3.812 6.229 1.00 0.00 H ATOM 4814 HD21 LEU B 122 -58.426 2.821 5.781 1.00 0.00 H ATOM 4815 HD22 LEU B 122 -59.172 3.228 7.346 1.00 0.00 H ATOM 4816 HD23 LEU B 122 -59.784 1.849 6.401 1.00 0.00 H ATOM 4817 HD11 LEU B 122 -61.441 3.877 3.772 1.00 0.00 H ATOM 4818 HD12 LEU B 122 -59.788 3.233 3.621 1.00 0.00 H ATOM 4819 HD13 LEU B 122 -61.075 2.224 4.325 1.00 0.00 H ATOM 4820 H LEU B 122 -61.646 6.382 6.900 1.00 0.00 H ATOM 4821 N SER B 123 -59.010 8.203 6.103 1.00 15.78 N ATOM 4822 CA SER B 123 -58.146 9.367 5.915 1.00 16.15 C ATOM 4823 C SER B 123 -57.602 9.861 7.267 1.00 14.49 C ATOM 4824 O SER B 123 -56.410 10.158 7.392 1.00 14.02 O ATOM 4825 CB SER B 123 -58.888 10.490 5.159 1.00 15.97 C ATOM 4826 OG SER B 123 -59.164 10.118 3.805 1.00 20.49 O ATOM 4827 HA SER B 123 -57.296 9.068 5.302 1.00 0.00 H ATOM 4828 HB2 SER B 123 -58.269 11.387 5.161 1.00 0.00 H ATOM 4829 HB3 SER B 123 -59.829 10.698 5.668 1.00 0.00 H ATOM 4830 HG SER B 123 -58.313 9.933 3.335 1.00 0.00 H ATOM 4831 H SER B 123 -60.019 8.266 5.861 1.00 0.00 H ATOM 4832 N LEU B 124 -58.457 9.918 8.286 1.00 15.16 N ATOM 4833 CA LEU B 124 -58.012 10.398 9.599 1.00 16.49 C ATOM 4834 C LEU B 124 -56.957 9.447 10.177 1.00 18.51 C ATOM 4835 O LEU B 124 -55.977 9.871 10.802 1.00 13.62 O ATOM 4836 CB LEU B 124 -59.204 10.566 10.553 1.00 18.17 C ATOM 4837 CG LEU B 124 -58.841 11.028 11.967 1.00 20.81 C ATOM 4838 CD1 LEU B 124 -58.155 12.391 11.905 1.00 14.21 C ATOM 4839 CD2 LEU B 124 -60.068 11.057 12.867 1.00 19.09 C ATOM 4840 HA LEU B 124 -57.554 11.380 9.478 1.00 0.00 H ATOM 4841 HB2 LEU B 124 -59.883 11.301 10.121 1.00 0.00 H ATOM 4842 HB3 LEU B 124 -59.713 9.605 10.631 1.00 0.00 H ATOM 4843 HG LEU B 124 -58.144 10.313 12.404 1.00 0.00 H ATOM 4844 HD21 LEU B 124 -60.804 11.746 12.453 1.00 0.00 H ATOM 4845 HD22 LEU B 124 -60.497 10.057 12.926 1.00 0.00 H ATOM 4846 HD23 LEU B 124 -59.778 11.389 13.864 1.00 0.00 H ATOM 4847 HD11 LEU B 124 -57.247 12.313 11.306 1.00 0.00 H ATOM 4848 HD12 LEU B 124 -58.830 13.116 11.450 1.00 0.00 H ATOM 4849 HD13 LEU B 124 -57.899 12.714 12.914 1.00 0.00 H ATOM 4850 H LEU B 124 -59.444 9.621 8.151 1.00 0.00 H ATOM 4851 N ASN B 125 -57.142 8.155 9.921 1.00 15.20 N ATOM 4852 CA ASN B 125 -56.143 7.164 10.301 1.00 17.81 C ATOM 4853 C ASN B 125 -54.803 7.417 9.599 1.00 13.41 C ATOM 4854 O ASN B 125 -53.747 7.309 10.220 1.00 16.87 O ATOM 4855 CB ASN B 125 -56.660 5.753 10.005 1.00 16.67 C ATOM 4856 CG ASN B 125 -55.872 4.686 10.717 1.00 23.76 C ATOM 4857 OD1 ASN B 125 -55.655 4.759 11.926 1.00 19.74 O ATOM 4858 ND2 ASN B 125 -55.427 3.684 9.968 1.00 23.51 N ATOM 4859 HA ASN B 125 -55.967 7.254 11.373 1.00 0.00 H ATOM 4860 HB2 ASN B 125 -57.701 5.689 10.322 1.00 0.00 H ATOM 4861 HB3 ASN B 125 -56.597 5.576 8.931 1.00 0.00 H ATOM 4862 HD22 ASN B 125 -55.635 3.664 8.949 1.00 0.00 H ATOM 4863 HD21 ASN B 125 -54.870 2.919 10.400 1.00 0.00 H ATOM 4864 H ASN B 125 -58.013 7.847 9.442 1.00 0.00 H ATOM 4865 N LYS B 126 -54.844 7.760 8.312 1.00 13.89 N ATOM 4866 CA LYS B 126 -53.631 8.081 7.556 1.00 16.13 C ATOM 4867 C LYS B 126 -52.949 9.300 8.163 1.00 14.82 C ATOM 4868 O LYS B 126 -51.733 9.311 8.342 1.00 11.84 O ATOM 4869 CB LYS B 126 -53.948 8.319 6.078 1.00 18.74 C ATOM 4870 CG LYS B 126 -52.727 8.603 5.193 1.00 17.86 C ATOM 4871 CD LYS B 126 -53.167 9.035 3.776 1.00 23.78 C ATOM 4872 CE LYS B 126 -52.060 9.815 3.040 1.00 20.41 C ATOM 4873 NZ LYS B 126 -51.242 8.914 2.179 1.00 26.57 N ATOM 4874 HA LYS B 126 -52.953 7.230 7.615 1.00 0.00 H ATOM 4875 HB2 LYS B 126 -54.448 7.431 5.691 1.00 0.00 H ATOM 4876 HB3 LYS B 126 -54.622 9.173 6.009 1.00 0.00 H ATOM 4877 HG2 LYS B 126 -52.136 9.401 5.643 1.00 0.00 H ATOM 4878 HG3 LYS B 126 -52.120 7.700 5.120 1.00 0.00 H ATOM 4879 HD2 LYS B 126 -53.415 8.145 3.198 1.00 0.00 H ATOM 4880 HD3 LYS B 126 -54.049 9.670 3.859 1.00 0.00 H ATOM 4881 HE2 LYS B 126 -51.410 10.289 3.776 1.00 0.00 H ATOM 4882 HE3 LYS B 126 -52.520 10.581 2.416 1.00 0.00 H ATOM 4883 HZ1 LYS B 126 -50.796 8.183 2.769 1.00 0.00 H ATOM 4884 HZ2 LYS B 126 -51.855 8.462 1.471 1.00 0.00 H ATOM 4885 HZ3 LYS B 126 -50.506 9.470 1.698 1.00 0.00 H ATOM 4886 H LYS B 126 -55.765 7.801 7.830 1.00 0.00 H ATOM 4887 N MET B 127 -53.735 10.314 8.513 1.00 13.76 N ATOM 4888 CA MET B 127 -53.160 11.497 9.176 1.00 10.22 C ATOM 4889 C MET B 127 -52.474 11.130 10.494 1.00 12.83 C ATOM 4890 O MET B 127 -51.330 11.544 10.767 1.00 9.21 O ATOM 4891 CB MET B 127 -54.212 12.576 9.425 1.00 11.89 C ATOM 4892 CG MET B 127 -53.593 13.822 10.075 1.00 12.25 C ATOM 4893 SD MET B 127 -54.735 15.186 10.169 1.00 11.50 S ATOM 4894 CE MET B 127 -54.556 15.894 8.525 1.00 12.80 C ATOM 4895 HA MET B 127 -52.410 11.897 8.494 1.00 0.00 H ATOM 4896 HB2 MET B 127 -54.663 12.859 8.474 1.00 0.00 H ATOM 4897 HB3 MET B 127 -54.981 12.176 10.086 1.00 0.00 H ATOM 4898 HG2 MET B 127 -52.729 14.130 9.487 1.00 0.00 H ATOM 4899 HG3 MET B 127 -53.271 13.566 11.084 1.00 0.00 H ATOM 4900 HE1 MET B 127 -53.521 16.201 8.374 1.00 0.00 H ATOM 4901 HE2 MET B 127 -54.828 15.148 7.778 1.00 0.00 H ATOM 4902 HE3 MET B 127 -55.211 16.760 8.431 1.00 0.00 H ATOM 4903 H MET B 127 -54.756 10.272 8.319 1.00 0.00 H ATOM 4904 N ARG B 128 -53.174 10.358 11.319 1.00 12.49 N ATOM 4905 CA ARG B 128 -52.581 9.890 12.567 1.00 15.12 C ATOM 4906 C ARG B 128 -51.263 9.145 12.350 1.00 14.83 C ATOM 4907 O ARG B 128 -50.276 9.378 13.056 1.00 14.32 O ATOM 4908 CB ARG B 128 -53.554 8.991 13.336 1.00 13.08 C ATOM 4909 CG ARG B 128 -52.937 8.424 14.609 1.00 17.46 C ATOM 4910 CD ARG B 128 -53.742 7.275 15.209 1.00 26.90 C ATOM 4911 NE ARG B 128 -53.932 6.152 14.287 1.00 25.93 N ATOM 4912 CZ ARG B 128 -53.027 5.210 14.029 1.00 25.77 C ATOM 4913 NH1 ARG B 128 -51.830 5.247 14.593 1.00 26.95 N ATOM 4914 NH2 ARG B 128 -53.316 4.233 13.176 1.00 24.29 N ATOM 4915 HA ARG B 128 -52.368 10.783 13.154 1.00 0.00 H ATOM 4916 HB2 ARG B 128 -54.434 9.575 13.603 1.00 0.00 H ATOM 4917 HB3 ARG B 128 -53.851 8.163 12.692 1.00 0.00 H ATOM 4918 HG2 ARG B 128 -51.936 8.061 14.377 1.00 0.00 H ATOM 4919 HG3 ARG B 128 -52.870 9.223 15.347 1.00 0.00 H ATOM 4920 HD2 ARG B 128 -54.722 7.654 15.499 1.00 0.00 H ATOM 4921 HD3 ARG B 128 -53.219 6.911 16.093 1.00 0.00 H ATOM 4922 HE ARG B 128 -54.846 6.085 13.795 1.00 0.00 H ATOM 4923 HH12 ARG B 128 -51.133 4.505 14.382 1.00 0.00 H ATOM 4924 HH11 ARG B 128 -51.587 6.018 15.247 1.00 0.00 H ATOM 4925 HH22 ARG B 128 -52.612 3.496 12.972 1.00 0.00 H ATOM 4926 HH21 ARG B 128 -54.247 4.206 12.712 1.00 0.00 H ATOM 4927 H ARG B 128 -54.148 10.087 11.074 1.00 0.00 H ATOM 4928 N GLN B 129 -51.250 8.214 11.401 1.00 12.27 N ATOM 4929 CA GLN B 129 -50.011 7.507 11.069 1.00 14.52 C ATOM 4930 C GLN B 129 -48.906 8.456 10.621 1.00 13.87 C ATOM 4931 O GLN B 129 -47.730 8.243 10.929 1.00 13.61 O ATOM 4932 CB GLN B 129 -50.258 6.432 10.006 1.00 15.21 C ATOM 4933 CG GLN B 129 -50.987 5.213 10.572 1.00 19.35 C ATOM 4934 CD GLN B 129 -51.349 4.187 9.505 1.00 26.39 C ATOM 4935 OE1 GLN B 129 -51.641 4.535 8.355 1.00 24.87 O ATOM 4936 NE2 GLN B 129 -51.332 2.918 9.883 1.00 32.47 N ATOM 4937 HA GLN B 129 -49.672 7.022 11.984 1.00 0.00 H ATOM 4938 HB2 GLN B 129 -50.861 6.862 9.206 1.00 0.00 H ATOM 4939 HB3 GLN B 129 -49.298 6.110 9.602 1.00 0.00 H ATOM 4940 HG2 GLN B 129 -50.343 4.735 11.310 1.00 0.00 H ATOM 4941 HG3 GLN B 129 -51.904 5.550 11.056 1.00 0.00 H ATOM 4942 HE22 GLN B 129 -51.080 2.670 10.861 1.00 0.00 H ATOM 4943 HE21 GLN B 129 -51.570 2.169 9.202 1.00 0.00 H ATOM 4944 H GLN B 129 -52.127 7.986 10.890 1.00 0.00 H ATOM 4945 N GLY B 130 -49.276 9.518 9.917 1.00 13.53 N ATOM 4946 CA GLY B 130 -48.284 10.488 9.492 1.00 13.61 C ATOM 4947 C GLY B 130 -47.665 11.206 10.683 1.00 10.11 C ATOM 4948 O GLY B 130 -46.447 11.375 10.766 1.00 12.05 O ATOM 4949 HA3 GLY B 130 -48.761 11.223 8.843 1.00 0.00 H ATOM 4950 HA2 GLY B 130 -47.498 9.973 8.940 1.00 0.00 H ATOM 4951 H GLY B 130 -50.277 9.655 9.670 1.00 0.00 H ATOM 4952 N TYR B 131 -48.505 11.663 11.601 1.00 12.39 N ATOM 4953 CA TYR B 131 -47.980 12.368 12.768 1.00 11.95 C ATOM 4954 C TYR B 131 -47.077 11.454 13.593 1.00 13.95 C ATOM 4955 O TYR B 131 -46.045 11.898 14.103 1.00 15.28 O ATOM 4956 CB TYR B 131 -49.106 12.948 13.634 1.00 13.16 C ATOM 4957 CG TYR B 131 -49.628 14.271 13.123 1.00 11.35 C ATOM 4958 CD1 TYR B 131 -48.817 15.409 13.107 1.00 11.11 C ATOM 4959 CD2 TYR B 131 -50.933 14.384 12.652 1.00 12.09 C ATOM 4960 CE1 TYR B 131 -49.286 16.618 12.627 1.00 13.09 C ATOM 4961 CE2 TYR B 131 -51.414 15.592 12.181 1.00 15.19 C ATOM 4962 CZ TYR B 131 -50.592 16.703 12.174 1.00 14.01 C ATOM 4963 OH TYR B 131 -51.095 17.887 11.679 1.00 14.12 O ATOM 4964 HA TYR B 131 -47.383 13.204 12.404 1.00 0.00 H ATOM 4965 HB3 TYR B 131 -48.726 13.092 14.646 1.00 0.00 H ATOM 4966 HB2 TYR B 131 -49.930 12.235 13.655 1.00 0.00 H ATOM 4967 HD2 TYR B 131 -51.584 13.510 12.654 1.00 0.00 H ATOM 4968 HE2 TYR B 131 -52.438 15.668 11.816 1.00 0.00 H ATOM 4969 HE1 TYR B 131 -48.636 17.493 12.605 1.00 0.00 H ATOM 4970 HD1 TYR B 131 -47.795 15.342 13.480 1.00 0.00 H ATOM 4971 HH TYR B 131 -50.400 18.589 11.737 1.00 0.00 H ATOM 4972 H TYR B 131 -49.529 11.521 11.491 1.00 0.00 H ATOM 4973 N ASP B 132 -47.455 10.180 13.699 1.00 16.66 N ATOM 4974 CA ASP B 132 -46.616 9.186 14.376 1.00 15.37 C ATOM 4975 C ASP B 132 -45.261 9.118 13.706 1.00 16.19 C ATOM 4976 O ASP B 132 -44.226 9.054 14.369 1.00 15.87 O ATOM 4977 CB ASP B 132 -47.236 7.780 14.324 1.00 18.80 C ATOM 4978 CG ASP B 132 -48.323 7.567 15.356 1.00 20.36 C ATOM 4979 OD1 ASP B 132 -48.440 8.395 16.282 1.00 23.41 O ATOM 4980 OD2 ASP B 132 -49.072 6.562 15.223 1.00 22.76 O ATOM 4981 HA ASP B 132 -46.527 9.498 15.417 1.00 0.00 H ATOM 4982 HB2 ASP B 132 -47.664 7.627 13.333 1.00 0.00 H ATOM 4983 HB3 ASP B 132 -46.447 7.047 14.495 1.00 0.00 H ATOM 4984 H ASP B 132 -48.365 9.884 13.292 1.00 0.00 H ATOM 4985 N ALA B 133 -45.273 9.107 12.379 1.00 16.16 N ATOM 4986 CA ALA B 133 -44.043 8.998 11.618 1.00 16.30 C ATOM 4987 C ALA B 133 -43.208 10.267 11.756 1.00 14.11 C ATOM 4988 O ALA B 133 -41.989 10.187 11.895 1.00 13.28 O ATOM 4989 CB ALA B 133 -44.325 8.671 10.145 1.00 15.59 C ATOM 4990 HA ALA B 133 -43.465 8.170 12.029 1.00 0.00 H ATOM 4991 HB1 ALA B 133 -44.858 7.723 10.080 1.00 0.00 H ATOM 4992 HB2 ALA B 133 -44.934 9.463 9.709 1.00 0.00 H ATOM 4993 HB3 ALA B 133 -43.382 8.596 9.604 1.00 0.00 H ATOM 4994 H ALA B 133 -46.180 9.178 11.876 1.00 0.00 H ATOM 4995 N THR B 134 -43.839 11.444 11.741 1.00 14.87 N ATOM 4996 CA THR B 134 -43.043 12.659 11.963 1.00 13.93 C ATOM 4997 C THR B 134 -42.366 12.629 13.330 1.00 16.95 C ATOM 4998 O THR B 134 -41.201 13.043 13.478 1.00 13.06 O ATOM 4999 CB THR B 134 -43.842 13.983 11.811 1.00 17.83 C ATOM 5000 OG1 THR B 134 -44.869 14.073 12.809 1.00 14.03 O ATOM 5001 CG2 THR B 134 -44.440 14.092 10.407 1.00 12.38 C ATOM 5002 HA THR B 134 -42.294 12.652 11.171 1.00 0.00 H ATOM 5003 HB THR B 134 -43.154 14.816 11.955 1.00 0.00 H ATOM 5004 HG1 THR B 134 -44.456 14.049 13.709 1.00 0.00 H ATOM 5005 HG23 THR B 134 -43.643 14.021 9.667 1.00 0.00 H ATOM 5006 HG21 THR B 134 -45.153 13.282 10.253 1.00 0.00 H ATOM 5007 HG22 THR B 134 -44.949 15.050 10.304 1.00 0.00 H ATOM 5008 H THR B 134 -44.864 11.499 11.577 1.00 0.00 H ATOM 5009 N ARG B 135 -43.101 12.137 14.331 1.00 16.53 N ATOM 5010 CA ARG B 135 -42.562 12.043 15.681 1.00 18.78 C ATOM 5011 C ARG B 135 -41.413 11.026 15.740 1.00 18.02 C ATOM 5012 O ARG B 135 -40.383 11.291 16.362 1.00 17.29 O ATOM 5013 CB ARG B 135 -43.669 11.688 16.669 1.00 21.17 C ATOM 5014 CG ARG B 135 -43.491 12.306 18.030 1.00 31.90 C ATOM 5015 CD ARG B 135 -44.745 12.160 18.861 1.00 36.23 C ATOM 5016 NE ARG B 135 -45.798 13.071 18.423 1.00 30.79 N ATOM 5017 CZ ARG B 135 -46.866 12.691 17.732 1.00 30.02 C ATOM 5018 NH1 ARG B 135 -47.011 11.417 17.401 1.00 28.51 N ATOM 5019 NH2 ARG B 135 -47.784 13.583 17.369 1.00 22.23 N ATOM 5020 HA ARG B 135 -42.156 13.014 15.963 1.00 0.00 H ATOM 5021 HB2 ARG B 135 -44.619 12.029 16.258 1.00 0.00 H ATOM 5022 HB3 ARG B 135 -43.693 10.604 16.784 1.00 0.00 H ATOM 5023 HG2 ARG B 135 -42.665 11.811 18.541 1.00 0.00 H ATOM 5024 HG3 ARG B 135 -43.262 13.365 17.913 1.00 0.00 H ATOM 5025 HD2 ARG B 135 -44.505 12.374 19.902 1.00 0.00 H ATOM 5026 HD3 ARG B 135 -45.107 11.135 18.776 1.00 0.00 H ATOM 5027 HE ARG B 135 -45.706 14.078 18.667 1.00 0.00 H ATOM 5028 HH12 ARG B 135 -47.845 11.112 16.860 1.00 0.00 H ATOM 5029 HH11 ARG B 135 -46.291 10.721 17.682 1.00 0.00 H ATOM 5030 HH22 ARG B 135 -48.619 13.279 16.828 1.00 0.00 H ATOM 5031 HH21 ARG B 135 -47.667 14.584 17.626 1.00 0.00 H ATOM 5032 H ARG B 135 -44.072 11.816 14.144 1.00 0.00 H ATOM 5033 N ALA B 136 -41.582 9.868 15.098 1.00 16.94 N ATOM 5034 CA ALA B 136 -40.500 8.872 15.028 1.00 15.23 C ATOM 5035 C ALA B 136 -39.267 9.420 14.336 1.00 18.98 C ATOM 5036 O ALA B 136 -38.135 9.207 14.794 1.00 17.24 O ATOM 5037 CB ALA B 136 -40.962 7.594 14.329 1.00 15.54 C ATOM 5038 HA ALA B 136 -40.234 8.632 16.057 1.00 0.00 H ATOM 5039 HB1 ALA B 136 -41.796 7.161 14.881 1.00 0.00 H ATOM 5040 HB2 ALA B 136 -41.280 7.831 13.314 1.00 0.00 H ATOM 5041 HB3 ALA B 136 -40.138 6.881 14.295 1.00 0.00 H ATOM 5042 H ALA B 136 -42.493 9.666 14.640 1.00 0.00 H ATOM 5043 N ALA B 137 -39.471 10.110 13.212 1.00 12.48 N ATOM 5044 CA ALA B 137 -38.341 10.678 12.487 1.00 15.75 C ATOM 5045 C ALA B 137 -37.578 11.708 13.326 1.00 15.43 C ATOM 5046 O ALA B 137 -36.337 11.795 13.258 1.00 16.35 O ATOM 5047 CB ALA B 137 -38.809 11.292 11.176 1.00 15.39 C ATOM 5048 HA ALA B 137 -37.648 9.865 12.270 1.00 0.00 H ATOM 5049 HB1 ALA B 137 -39.276 10.522 10.562 1.00 0.00 H ATOM 5050 HB2 ALA B 137 -39.532 12.081 11.383 1.00 0.00 H ATOM 5051 HB3 ALA B 137 -37.953 11.712 10.647 1.00 0.00 H ATOM 5052 H ALA B 137 -40.438 10.243 12.853 1.00 0.00 H ATOM 5053 N ARG B 138 -38.313 12.505 14.096 1.00 13.75 N ATOM 5054 CA ARG B 138 -37.679 13.498 14.962 1.00 15.15 C ATOM 5055 C ARG B 138 -36.846 12.829 16.050 1.00 20.53 C ATOM 5056 O ARG B 138 -35.702 13.220 16.304 1.00 19.53 O ATOM 5057 CB ARG B 138 -38.708 14.473 15.543 1.00 17.11 C ATOM 5058 CG ARG B 138 -39.121 15.546 14.542 1.00 17.27 C ATOM 5059 CD ARG B 138 -40.317 16.351 15.011 1.00 22.48 C ATOM 5060 NE ARG B 138 -40.046 17.041 16.264 1.00 24.63 N ATOM 5061 CZ ARG B 138 -40.747 16.851 17.377 1.00 30.34 C ATOM 5062 NH1 ARG B 138 -41.779 16.010 17.379 1.00 30.69 N ATOM 5063 NH2 ARG B 138 -40.431 17.514 18.482 1.00 34.10 N ATOM 5064 HA ARG B 138 -36.996 14.087 14.350 1.00 0.00 H ATOM 5065 HB2 ARG B 138 -39.594 13.912 15.840 1.00 0.00 H ATOM 5066 HB3 ARG B 138 -38.276 14.958 16.418 1.00 0.00 H ATOM 5067 HG2 ARG B 138 -38.281 16.224 14.390 1.00 0.00 H ATOM 5068 HG3 ARG B 138 -39.373 15.064 13.597 1.00 0.00 H ATOM 5069 HD2 ARG B 138 -41.162 15.677 15.154 1.00 0.00 H ATOM 5070 HD3 ARG B 138 -40.567 17.089 14.249 1.00 0.00 H ATOM 5071 HE ARG B 138 -39.259 17.721 16.290 1.00 0.00 H ATOM 5072 HH12 ARG B 138 -42.327 15.862 18.250 1.00 0.00 H ATOM 5073 HH11 ARG B 138 -42.037 15.501 16.509 1.00 0.00 H ATOM 5074 HH22 ARG B 138 -40.980 17.365 19.353 1.00 0.00 H ATOM 5075 HH21 ARG B 138 -39.634 18.183 18.477 1.00 0.00 H ATOM 5076 H ARG B 138 -39.350 12.421 14.082 1.00 0.00 H ATOM 5077 N VAL B 139 -37.402 11.790 16.662 1.00 19.12 N ATOM 5078 CA VAL B 139 -36.635 10.999 17.615 1.00 20.04 C ATOM 5079 C VAL B 139 -35.359 10.452 16.971 1.00 20.62 C ATOM 5080 O VAL B 139 -34.280 10.512 17.562 1.00 21.75 O ATOM 5081 CB VAL B 139 -37.477 9.846 18.179 1.00 23.25 C ATOM 5082 CG1 VAL B 139 -36.591 8.894 18.988 1.00 28.40 C ATOM 5083 CG2 VAL B 139 -38.610 10.396 19.030 1.00 26.94 C ATOM 5084 HA VAL B 139 -36.354 11.657 18.438 1.00 0.00 H ATOM 5085 HB VAL B 139 -37.914 9.283 17.354 1.00 0.00 H ATOM 5086 HG11 VAL B 139 -35.813 8.487 18.342 1.00 0.00 H ATOM 5087 HG12 VAL B 139 -36.132 9.439 19.813 1.00 0.00 H ATOM 5088 HG13 VAL B 139 -37.200 8.081 19.383 1.00 0.00 H ATOM 5089 HG21 VAL B 139 -38.195 10.974 19.855 1.00 0.00 H ATOM 5090 HG22 VAL B 139 -39.244 11.037 18.418 1.00 0.00 H ATOM 5091 HG23 VAL B 139 -39.201 9.569 19.425 1.00 0.00 H ATOM 5092 H VAL B 139 -38.391 11.539 16.460 1.00 0.00 H ATOM 5093 N SER B 140 -35.482 9.945 15.748 1.00 16.77 N ATOM 5094 CA SER B 140 -34.340 9.404 15.017 1.00 17.34 C ATOM 5095 C SER B 140 -33.312 10.478 14.658 1.00 20.36 C ATOM 5096 O SER B 140 -32.100 10.266 14.803 1.00 19.56 O ATOM 5097 CB SER B 140 -34.804 8.659 13.767 1.00 23.13 C ATOM 5098 OG SER B 140 -33.697 8.152 13.042 1.00 27.34 O ATOM 5099 HA SER B 140 -33.841 8.699 15.682 1.00 0.00 H ATOM 5100 HB2 SER B 140 -35.365 9.343 13.131 1.00 0.00 H ATOM 5101 HB3 SER B 140 -35.447 7.830 14.063 1.00 0.00 H ATOM 5102 HG SER B 140 -34.021 7.674 12.238 1.00 0.00 H ATOM 5103 H SER B 140 -36.420 9.933 15.299 1.00 0.00 H ATOM 5104 N MET B 141 -33.787 11.639 14.212 1.00 15.11 N ATOM 5105 CA MET B 141 -32.884 12.757 13.963 1.00 18.88 C ATOM 5106 C MET B 141 -32.077 13.162 15.206 1.00 17.29 C ATOM 5107 O MET B 141 -30.862 13.371 15.115 1.00 18.90 O ATOM 5108 CB MET B 141 -33.645 13.953 13.402 1.00 15.55 C ATOM 5109 CG MET B 141 -33.990 13.796 11.947 1.00 21.02 C ATOM 5110 SD MET B 141 -34.815 15.266 11.308 1.00 23.75 S ATOM 5111 CE MET B 141 -36.397 15.211 12.124 1.00 19.30 C ATOM 5112 HA MET B 141 -32.164 12.415 13.220 1.00 0.00 H ATOM 5113 HB2 MET B 141 -34.569 14.075 13.968 1.00 0.00 H ATOM 5114 HB3 MET B 141 -33.029 14.844 13.520 1.00 0.00 H ATOM 5115 HG2 MET B 141 -34.651 12.938 11.829 1.00 0.00 H ATOM 5116 HG3 MET B 141 -33.074 13.628 11.381 1.00 0.00 H ATOM 5117 HE1 MET B 141 -36.911 14.288 11.856 1.00 0.00 H ATOM 5118 HE2 MET B 141 -36.249 15.245 13.203 1.00 0.00 H ATOM 5119 HE3 MET B 141 -36.996 16.066 11.811 1.00 0.00 H ATOM 5120 H MET B 141 -34.807 11.749 14.040 1.00 0.00 H ATOM 5121 N ASP B 142 -32.736 13.243 16.360 1.00 18.54 N ATOM 5122 CA ASP B 142 -32.055 13.662 17.585 1.00 18.67 C ATOM 5123 C ASP B 142 -30.980 12.643 17.971 1.00 22.16 C ATOM 5124 O ASP B 142 -29.839 13.000 18.266 1.00 20.92 O ATOM 5125 CB ASP B 142 -33.049 13.847 18.736 1.00 19.69 C ATOM 5126 CG ASP B 142 -33.997 15.018 18.517 1.00 25.11 C ATOM 5127 OD1 ASP B 142 -33.753 15.840 17.600 1.00 24.82 O ATOM 5128 OD2 ASP B 142 -34.990 15.117 19.267 1.00 26.10 O ATOM 5129 HA ASP B 142 -31.579 14.623 17.393 1.00 0.00 H ATOM 5130 HB2 ASP B 142 -33.639 12.936 18.837 1.00 0.00 H ATOM 5131 HB3 ASP B 142 -32.489 14.019 19.655 1.00 0.00 H ATOM 5132 H ASP B 142 -33.748 13.005 16.391 1.00 0.00 H ATOM 5133 N SER B 143 -31.340 11.369 17.943 1.00 21.29 N ATOM 5134 CA SER B 143 -30.393 10.335 18.334 1.00 25.57 C ATOM 5135 C SER B 143 -29.214 10.249 17.351 1.00 25.62 C ATOM 5136 O SER B 143 -28.060 10.111 17.762 1.00 25.44 O ATOM 5137 CB SER B 143 -31.095 8.986 18.553 1.00 25.09 C ATOM 5138 OG SER B 143 -31.498 8.382 17.338 1.00 30.38 O ATOM 5139 HA SER B 143 -29.965 10.616 19.296 1.00 0.00 H ATOM 5140 HB2 SER B 143 -31.977 9.147 19.173 1.00 0.00 H ATOM 5141 HB3 SER B 143 -30.408 8.314 19.067 1.00 0.00 H ATOM 5142 HG SER B 143 -32.129 8.982 16.866 1.00 0.00 H ATOM 5143 H SER B 143 -32.300 11.107 17.641 1.00 0.00 H ATOM 5144 N SER B 144 -29.478 10.374 16.057 1.00 22.25 N ATOM 5145 CA SER B 144 -28.375 10.324 15.099 1.00 21.13 C ATOM 5146 C SER B 144 -27.443 11.527 15.206 1.00 24.77 C ATOM 5147 O SER B 144 -26.227 11.398 15.022 1.00 25.38 O ATOM 5148 CB SER B 144 -28.877 10.137 13.677 1.00 22.34 C ATOM 5149 OG SER B 144 -29.468 8.859 13.550 1.00 30.63 O ATOM 5150 HA SER B 144 -27.782 9.448 15.362 1.00 0.00 H ATOM 5151 HB2 SER B 144 -28.041 10.222 12.982 1.00 0.00 H ATOM 5152 HB3 SER B 144 -29.617 10.904 13.449 1.00 0.00 H ATOM 5153 HG SER B 144 -28.795 8.163 13.757 1.00 0.00 H ATOM 5154 H SER B 144 -30.456 10.506 15.729 1.00 0.00 H ATOM 5155 N ALA B 145 -28.008 12.691 15.511 1.00 22.99 N ATOM 5156 CA ALA B 145 -27.211 13.900 15.690 1.00 23.58 C ATOM 5157 C ALA B 145 -26.263 13.787 16.887 1.00 29.51 C ATOM 5158 O ALA B 145 -25.080 14.151 16.799 1.00 29.87 O ATOM 5159 CB ALA B 145 -28.119 15.112 15.844 1.00 23.51 C ATOM 5160 HA ALA B 145 -26.597 14.025 14.798 1.00 0.00 H ATOM 5161 HB1 ALA B 145 -28.734 15.219 14.951 1.00 0.00 H ATOM 5162 HB2 ALA B 145 -28.761 14.975 16.714 1.00 0.00 H ATOM 5163 HB3 ALA B 145 -27.510 16.006 15.977 1.00 0.00 H ATOM 5164 H ALA B 145 -29.041 12.741 15.624 1.00 0.00 H ATOM 5165 N ILE B 146 -26.799 13.295 18.004 1.00 26.30 N ATOM 5166 CA ILE B 146 -26.022 13.040 19.211 1.00 29.54 C ATOM 5167 C ILE B 146 -24.892 12.034 18.946 1.00 30.62 C ATOM 5168 O ILE B 146 -23.750 12.258 19.342 1.00 31.97 O ATOM 5169 CB ILE B 146 -26.928 12.534 20.366 1.00 29.77 C ATOM 5170 CG1 ILE B 146 -27.554 13.710 21.128 1.00 39.37 C ATOM 5171 CG2 ILE B 146 -26.133 11.668 21.334 1.00 30.69 C ATOM 5172 CD1 ILE B 146 -28.353 14.684 20.266 1.00 32.43 C ATOM 5173 HA ILE B 146 -25.575 13.987 19.512 1.00 0.00 H ATOM 5174 HB ILE B 146 -27.725 11.936 19.923 1.00 0.00 H ATOM 5175 HG12 ILE B 146 -28.222 13.304 21.888 1.00 0.00 H ATOM 5176 HG13 ILE B 146 -26.751 14.266 21.612 1.00 0.00 H ATOM 5177 HD11 ILE B 146 -27.700 15.115 19.507 1.00 0.00 H ATOM 5178 HD12 ILE B 146 -29.173 14.152 19.783 1.00 0.00 H ATOM 5179 HD13 ILE B 146 -28.755 15.479 20.895 1.00 0.00 H ATOM 5180 HG21 ILE B 146 -25.727 10.808 20.801 1.00 0.00 H ATOM 5181 HG22 ILE B 146 -25.316 12.253 21.757 1.00 0.00 H ATOM 5182 HG23 ILE B 146 -26.788 11.325 22.135 1.00 0.00 H ATOM 5183 H ILE B 146 -27.817 13.084 18.015 1.00 0.00 H ATOM 5184 N ARG B 147 -25.210 10.933 18.270 1.00 28.82 N ATOM 5185 CA ARG B 147 -24.199 9.941 17.902 1.00 29.07 C ATOM 5186 C ARG B 147 -23.074 10.546 17.051 1.00 31.45 C ATOM 5187 O ARG B 147 -21.897 10.269 17.275 1.00 29.03 O ATOM 5188 CB ARG B 147 -24.841 8.750 17.184 1.00 34.15 C ATOM 5189 CG ARG B 147 -23.878 7.619 16.864 1.00 36.76 C ATOM 5190 CD ARG B 147 -24.614 6.348 16.437 1.00 37.26 C ATOM 5191 NE ARG B 147 -23.680 5.263 16.121 1.00 47.69 N ATOM 5192 CZ ARG B 147 -23.243 4.357 16.997 1.00 46.98 C ATOM 5193 NH1 ARG B 147 -23.657 4.387 18.258 1.00 42.79 N ATOM 5194 NH2 ARG B 147 -22.392 3.413 16.611 1.00 42.00 N ATOM 5195 HA ARG B 147 -23.746 9.587 18.828 1.00 0.00 H ATOM 5196 HB2 ARG B 147 -25.633 8.355 17.820 1.00 0.00 H ATOM 5197 HB3 ARG B 147 -25.272 9.107 16.248 1.00 0.00 H ATOM 5198 HG2 ARG B 147 -23.220 7.934 16.054 1.00 0.00 H ATOM 5199 HG3 ARG B 147 -23.283 7.401 17.751 1.00 0.00 H ATOM 5200 HD2 ARG B 147 -25.214 6.566 15.554 1.00 0.00 H ATOM 5201 HD3 ARG B 147 -25.267 6.028 17.249 1.00 0.00 H ATOM 5202 HE ARG B 147 -23.333 5.195 15.143 1.00 0.00 H ATOM 5203 HH12 ARG B 147 -23.312 3.677 18.936 1.00 0.00 H ATOM 5204 HH11 ARG B 147 -24.326 5.120 18.568 1.00 0.00 H ATOM 5205 HH22 ARG B 147 -22.052 2.708 17.296 1.00 0.00 H ATOM 5206 HH21 ARG B 147 -22.065 3.379 15.624 1.00 0.00 H ATOM 5207 H ARG B 147 -26.201 10.774 17.997 1.00 0.00 H ATOM 5208 N ALA B 148 -23.438 11.375 16.079 1.00 24.46 N ATOM 5209 CA ALA B 148 -22.455 12.062 15.245 1.00 27.74 C ATOM 5210 C ALA B 148 -21.541 12.967 16.070 1.00 32.79 C ATOM 5211 O ALA B 148 -20.320 12.976 15.883 1.00 29.48 O ATOM 5212 CB ALA B 148 -23.156 12.878 14.153 1.00 27.30 C ATOM 5213 HA ALA B 148 -21.833 11.297 14.779 1.00 0.00 H ATOM 5214 HB1 ALA B 148 -23.749 12.211 13.527 1.00 0.00 H ATOM 5215 HB2 ALA B 148 -23.808 13.618 14.617 1.00 0.00 H ATOM 5216 HB3 ALA B 148 -22.408 13.383 13.542 1.00 0.00 H ATOM 5217 H ALA B 148 -24.450 11.539 15.907 1.00 0.00 H ATOM 5218 N ASP B 149 -22.143 13.733 16.975 1.00 31.49 N ATOM 5219 CA ASP B 149 -21.403 14.654 17.827 1.00 32.09 C ATOM 5220 C ASP B 149 -20.451 13.912 18.774 1.00 36.97 C ATOM 5221 O ASP B 149 -19.328 14.354 19.008 1.00 39.30 O ATOM 5222 CB ASP B 149 -22.374 15.543 18.613 1.00 33.49 C ATOM 5223 CG ASP B 149 -21.768 16.886 18.981 1.00 41.00 C ATOM 5224 OD1 ASP B 149 -21.369 17.642 18.065 1.00 38.66 O ATOM 5225 OD2 ASP B 149 -21.696 17.187 20.190 1.00 42.62 O ATOM 5226 HA ASP B 149 -20.789 15.286 17.185 1.00 0.00 H ATOM 5227 HB2 ASP B 149 -23.261 15.715 18.004 1.00 0.00 H ATOM 5228 HB3 ASP B 149 -22.658 15.025 19.529 1.00 0.00 H ATOM 5229 H ASP B 149 -23.176 13.673 17.078 1.00 0.00 H ATOM 5230 N GLN B 150 -20.897 12.781 19.313 1.00 35.51 N ATOM 5231 CA GLN B 150 -20.052 11.971 20.186 1.00 34.97 C ATOM 5232 C GLN B 150 -18.864 11.363 19.430 1.00 39.87 C ATOM 5233 O GLN B 150 -17.758 11.287 19.962 1.00 39.78 O ATOM 5234 CB GLN B 150 -20.875 10.880 20.876 1.00 31.83 C ATOM 5235 CG GLN B 150 -21.917 11.428 21.850 1.00 38.90 C ATOM 5236 CD GLN B 150 -22.762 10.334 22.502 1.00 42.97 C ATOM 5237 OE1 GLN B 150 -22.970 9.263 21.927 1.00 36.84 O ATOM 5238 NE2 GLN B 150 -23.259 10.608 23.707 1.00 46.98 N ATOM 5239 HA GLN B 150 -19.644 12.633 20.950 1.00 0.00 H ATOM 5240 HB2 GLN B 150 -21.389 10.299 20.110 1.00 0.00 H ATOM 5241 HB3 GLN B 150 -20.195 10.231 21.427 1.00 0.00 H ATOM 5242 HG2 GLN B 150 -21.402 11.982 22.634 1.00 0.00 H ATOM 5243 HG3 GLN B 150 -22.580 12.101 21.307 1.00 0.00 H ATOM 5244 HE22 GLN B 150 -23.059 11.524 24.156 1.00 0.00 H ATOM 5245 HE21 GLN B 150 -23.847 9.906 24.199 1.00 0.00 H ATOM 5246 H GLN B 150 -21.867 12.467 19.109 1.00 0.00 H ATOM 5247 N ALA B 151 -19.096 10.932 18.193 1.00 37.26 N ATOM 5248 CA ALA B 151 -18.023 10.401 17.360 1.00 40.43 C ATOM 5249 C ALA B 151 -16.999 11.491 17.096 1.00 43.64 C ATOM 5250 O ALA B 151 -15.794 11.235 17.064 1.00 41.46 O ATOM 5251 CB ALA B 151 -18.570 9.877 16.050 1.00 34.46 C ATOM 5252 HA ALA B 151 -17.547 9.574 17.887 1.00 0.00 H ATOM 5253 HB1 ALA B 151 -19.288 9.081 16.250 1.00 0.00 H ATOM 5254 HB2 ALA B 151 -19.064 10.687 15.514 1.00 0.00 H ATOM 5255 HB3 ALA B 151 -17.751 9.486 15.446 1.00 0.00 H ATOM 5256 H ALA B 151 -20.063 10.975 17.812 1.00 0.00 H ATOM 5257 N MET B 152 -17.493 12.710 16.910 1.00 38.73 N ATOM 5258 CA MET B 152 -16.631 13.848 16.637 1.00 41.74 C ATOM 5259 C MET B 152 -15.898 14.280 17.905 1.00 43.98 C ATOM 5260 O MET B 152 -14.789 14.807 17.841 1.00 46.32 O ATOM 5261 CB MET B 152 -17.442 15.006 16.047 1.00 41.36 C ATOM 5262 CG MET B 152 -16.596 16.075 15.376 1.00 44.62 C ATOM 5263 SD MET B 152 -15.514 15.415 14.090 1.00 52.43 S ATOM 5264 CE MET B 152 -16.435 15.789 12.602 1.00 40.82 C ATOM 5265 HA MET B 152 -15.884 13.551 15.901 1.00 0.00 H ATOM 5266 HB2 MET B 152 -18.132 14.600 15.307 1.00 0.00 H ATOM 5267 HB3 MET B 152 -18.009 15.473 16.852 1.00 0.00 H ATOM 5268 HG2 MET B 152 -15.980 16.558 16.135 1.00 0.00 H ATOM 5269 HG3 MET B 152 -17.261 16.813 14.926 1.00 0.00 H ATOM 5270 HE1 MET B 152 -17.404 15.292 12.642 1.00 0.00 H ATOM 5271 HE2 MET B 152 -16.580 16.867 12.527 1.00 0.00 H ATOM 5272 HE3 MET B 152 -15.879 15.435 11.734 1.00 0.00 H ATOM 5273 H MET B 152 -18.522 12.854 16.961 1.00 0.00 H ATOM 5274 N ASP B 153 -16.516 14.052 19.058 1.00 43.61 N ATOM 5275 CA ASP B 153 -15.849 14.314 20.329 1.00 48.50 C ATOM 5276 C ASP B 153 -14.694 13.343 20.543 1.00 49.58 C ATOM 5277 O ASP B 153 -13.575 13.755 20.840 1.00 54.37 O ATOM 5278 CB ASP B 153 -16.833 14.242 21.498 1.00 47.34 C ATOM 5279 CG ASP B 153 -17.255 15.613 21.989 1.00 50.73 C ATOM 5280 OD1 ASP B 153 -16.564 16.176 22.868 1.00 55.84 O ATOM 5281 OD2 ASP B 153 -18.275 16.132 21.496 1.00 47.70 O ATOM 5282 HA ASP B 153 -15.447 15.327 20.290 1.00 0.00 H ATOM 5283 HB2 ASP B 153 -17.721 13.698 21.175 1.00 0.00 H ATOM 5284 HB3 ASP B 153 -16.360 13.706 22.321 1.00 0.00 H ATOM 5285 H ASP B 153 -17.488 13.682 19.055 1.00 0.00 H ATOM 5286 N ALA B 154 -14.971 12.053 20.383 1.00 49.00 N ATOM 5287 CA ALA B 154 -13.948 11.022 20.530 1.00 51.09 C ATOM 5288 C ALA B 154 -12.826 11.199 19.510 1.00 53.60 C ATOM 5289 O ALA B 154 -11.685 10.808 19.758 1.00 58.14 O ATOM 5290 CB ALA B 154 -14.565 9.634 20.408 1.00 48.33 C ATOM 5291 HA ALA B 154 -13.514 11.126 21.524 1.00 0.00 H ATOM 5292 HB1 ALA B 154 -15.316 9.502 21.187 1.00 0.00 H ATOM 5293 HB2 ALA B 154 -15.034 9.531 19.429 1.00 0.00 H ATOM 5294 HB3 ALA B 154 -13.786 8.880 20.521 1.00 0.00 H ATOM 5295 H ALA B 154 -15.943 11.770 20.147 1.00 0.00 H ATOM 5296 N LEU B 155 -13.157 11.786 18.364 1.00 50.08 N ATOM 5297 CA LEU B 155 -12.175 12.061 17.321 1.00 52.37 C ATOM 5298 C LEU B 155 -11.246 13.204 17.713 1.00 54.68 C ATOM 5299 O LEU B 155 -10.041 13.146 17.473 1.00 56.10 O ATOM 5300 CB LEU B 155 -12.876 12.404 16.006 1.00 49.80 C ATOM 5301 CG LEU B 155 -11.980 12.931 14.885 1.00 48.98 C ATOM 5302 CD1 LEU B 155 -10.947 11.892 14.525 1.00 53.28 C ATOM 5303 CD2 LEU B 155 -12.800 13.310 13.665 1.00 50.69 C ATOM 5304 HA LEU B 155 -11.576 11.160 17.192 1.00 0.00 H ATOM 5305 HB2 LEU B 155 -13.367 11.500 15.644 1.00 0.00 H ATOM 5306 HB3 LEU B 155 -13.628 13.164 16.217 1.00 0.00 H ATOM 5307 HG LEU B 155 -11.474 13.829 15.239 1.00 0.00 H ATOM 5308 HD21 LEU B 155 -13.335 12.433 13.302 1.00 0.00 H ATOM 5309 HD22 LEU B 155 -13.515 14.087 13.936 1.00 0.00 H ATOM 5310 HD23 LEU B 155 -12.137 13.681 12.884 1.00 0.00 H ATOM 5311 HD11 LEU B 155 -10.337 11.670 15.400 1.00 0.00 H ATOM 5312 HD12 LEU B 155 -11.448 10.984 14.190 1.00 0.00 H ATOM 5313 HD13 LEU B 155 -10.312 12.274 13.726 1.00 0.00 H ATOM 5314 H LEU B 155 -14.148 12.058 18.206 1.00 0.00 H ATOM 5315 N SER B 156 -11.815 14.242 18.316 1.00 55.30 N ATOM 5316 CA SER B 156 -11.058 15.438 18.669 1.00 55.90 C ATOM 5317 C SER B 156 -10.273 15.256 19.963 1.00 61.81 C ATOM 5318 O SER B 156 -9.454 16.102 20.325 1.00 64.29 O ATOM 5319 CB SER B 156 -11.993 16.644 18.789 1.00 54.44 C ATOM 5320 OG SER B 156 -11.265 17.843 19.001 1.00 53.09 O ATOM 5321 HA SER B 156 -10.340 15.615 17.868 1.00 0.00 H ATOM 5322 HB2 SER B 156 -12.670 16.486 19.629 1.00 0.00 H ATOM 5323 HB3 SER B 156 -12.572 16.738 17.870 1.00 0.00 H ATOM 5324 HG SER B 156 -10.741 17.766 19.837 1.00 0.00 H ATOM 5325 H SER B 156 -12.829 14.201 18.543 1.00 0.00 H ATOM 5326 N GLN B 157 -10.515 14.150 20.659 1.00 62.53 N ATOM 5327 CA GLN B 157 -9.878 13.931 21.953 1.00 64.57 C ATOM 5328 C GLN B 157 -8.859 12.792 21.952 1.00 67.67 C ATOM 5329 O GLN B 157 -8.106 12.624 22.912 1.00 72.07 O ATOM 5330 CB GLN B 157 -10.927 13.774 23.058 1.00 63.35 C ATOM 5331 CG GLN B 157 -11.637 15.090 23.366 1.00 67.24 C ATOM 5332 CD GLN B 157 -12.795 14.942 24.333 1.00 70.61 C ATOM 5333 OE1 GLN B 157 -13.257 13.834 24.607 1.00 72.57 O ATOM 5334 NE2 GLN B 157 -13.278 16.068 24.852 1.00 69.76 N ATOM 5335 HA GLN B 157 -9.294 14.826 22.166 1.00 0.00 H ATOM 5336 HB2 GLN B 157 -11.668 13.041 22.738 1.00 0.00 H ATOM 5337 HB3 GLN B 157 -10.434 13.420 23.963 1.00 0.00 H ATOM 5338 HG2 GLN B 157 -10.912 15.780 23.798 1.00 0.00 H ATOM 5339 HG3 GLN B 157 -12.018 15.503 22.432 1.00 0.00 H ATOM 5340 HE22 GLN B 157 -12.857 16.983 24.592 1.00 0.00 H ATOM 5341 HE21 GLN B 157 -14.077 16.033 25.517 1.00 0.00 H ATOM 5342 H GLN B 157 -11.165 13.433 20.277 1.00 0.00 H ATOM 5343 N GLU B 158 -8.828 12.017 20.873 1.00 63.98 N ATOM 5344 CA GLU B 158 -7.689 11.145 20.624 1.00 66.54 C ATOM 5345 C GLU B 158 -6.841 11.794 19.538 1.00 67.03 C ATOM 5346 O GLU B 158 -6.078 11.132 18.836 1.00 68.85 O ATOM 5347 CB GLU B 158 -8.115 9.724 20.246 1.00 66.05 C ATOM 5348 CG GLU B 158 -8.895 9.597 18.952 1.00 64.32 C ATOM 5349 CD GLU B 158 -9.318 8.163 18.677 1.00 67.01 C ATOM 5350 OE1 GLU B 158 -8.597 7.239 19.113 1.00 73.57 O ATOM 5351 OE2 GLU B 158 -10.366 7.956 18.027 1.00 63.33 O ATOM 5352 HA GLU B 158 -7.105 11.033 21.538 1.00 0.00 H ATOM 5353 HB2 GLU B 158 -7.215 9.116 20.156 1.00 0.00 H ATOM 5354 HB3 GLU B 158 -8.736 9.334 21.052 1.00 0.00 H ATOM 5355 HG2 GLU B 158 -9.787 10.221 19.016 1.00 0.00 H ATOM 5356 HG3 GLU B 158 -8.270 9.943 18.129 1.00 0.00 H ATOM 5357 H GLU B 158 -9.622 12.033 20.202 1.00 0.00 H ATOM 5358 N VAL B 159 -7.004 13.107 19.410 1.00 65.39 N ATOM 5359 CA VAL B 159 -6.148 13.931 18.569 1.00 66.67 C ATOM 5360 C VAL B 159 -5.138 14.636 19.459 1.00 69.81 C ATOM 5361 O VAL B 159 -4.020 14.935 19.041 1.00 70.39 O ATOM 5362 CB VAL B 159 -6.959 14.998 17.808 1.00 63.66 C ATOM 5363 CG1 VAL B 159 -6.426 16.401 18.109 1.00 62.25 C ATOM 5364 CG2 VAL B 159 -6.939 14.715 16.313 1.00 61.12 C ATOM 5365 HA VAL B 159 -5.658 13.287 17.839 1.00 0.00 H ATOM 5366 HB VAL B 159 -7.994 14.953 18.148 1.00 0.00 H ATOM 5367 HG11 VAL B 159 -6.503 16.596 19.179 1.00 0.00 H ATOM 5368 HG12 VAL B 159 -5.382 16.466 17.801 1.00 0.00 H ATOM 5369 HG13 VAL B 159 -7.014 17.137 17.561 1.00 0.00 H ATOM 5370 HG21 VAL B 159 -5.909 14.730 15.955 1.00 0.00 H ATOM 5371 HG22 VAL B 159 -7.377 13.735 16.124 1.00 0.00 H ATOM 5372 HG23 VAL B 159 -7.517 15.479 15.792 1.00 0.00 H ATOM 5373 H VAL B 159 -7.777 13.566 19.934 1.00 0.00 H ATOM 5374 N MET B 160 -5.548 14.893 20.698 1.00 71.36 N ATOM 5375 CA MET B 160 -4.716 15.587 21.671 1.00 71.15 C ATOM 5376 C MET B 160 -3.778 14.607 22.366 1.00 72.97 C ATOM 5377 O MET B 160 -2.721 14.993 22.863 1.00 74.92 O ATOM 5378 CB MET B 160 -5.598 16.275 22.714 1.00 72.60 C ATOM 5379 CG MET B 160 -6.912 16.815 22.163 1.00 72.41 C ATOM 5380 SD MET B 160 -6.807 18.501 21.525 1.00 79.61 S ATOM 5381 CE MET B 160 -6.627 19.423 23.054 1.00 73.17 C ATOM 5382 HA MET B 160 -4.121 16.335 21.146 1.00 0.00 H ATOM 5383 HB2 MET B 160 -5.827 15.553 23.498 1.00 0.00 H ATOM 5384 HB3 MET B 160 -5.038 17.107 23.140 1.00 0.00 H ATOM 5385 HG2 MET B 160 -7.652 16.797 22.963 1.00 0.00 H ATOM 5386 HG3 MET B 160 -7.238 16.162 21.353 1.00 0.00 H ATOM 5387 HE1 MET B 160 -7.497 19.247 23.687 1.00 0.00 H ATOM 5388 HE2 MET B 160 -5.726 19.093 23.572 1.00 0.00 H ATOM 5389 HE3 MET B 160 -6.549 20.487 22.828 1.00 0.00 H ATOM 5390 H MET B 160 -6.500 14.586 20.983 1.00 0.00 H ATOM 5391 N ALA B 161 -4.178 13.337 22.399 1.00 73.98 N ATOM 5392 CA ALA B 161 -3.394 12.287 23.045 1.00 75.61 C ATOM 5393 C ALA B 161 -2.222 11.831 22.181 1.00 75.43 C ATOM 5394 O ALA B 161 -1.376 11.055 22.630 1.00 76.53 O ATOM 5395 CB ALA B 161 -4.283 11.098 23.403 1.00 73.82 C ATOM 5396 HA ALA B 161 -2.980 12.711 23.960 1.00 0.00 H ATOM 5397 HB1 ALA B 161 -5.068 11.425 24.085 1.00 0.00 H ATOM 5398 HB2 ALA B 161 -4.733 10.696 22.495 1.00 0.00 H ATOM 5399 HB3 ALA B 161 -3.680 10.327 23.883 1.00 0.00 H ATOM 5400 H ALA B 161 -5.081 13.084 21.949 1.00 0.00 H ATOM 5401 N ARG B 162 -2.180 12.309 20.941 1.00 72.78 N ATOM 5402 CA ARG B 162 -1.101 11.958 20.025 1.00 74.53 C ATOM 5403 C ARG B 162 0.002 13.013 20.029 1.00 72.59 C ATOM 5404 O ARG B 162 -0.277 14.213 19.996 1.00 70.52 O ATOM 5405 CB ARG B 162 -1.638 11.753 18.607 1.00 71.89 C ATOM 5406 CG ARG B 162 -2.525 10.529 18.460 1.00 75.12 C ATOM 5407 CD ARG B 162 -1.744 9.247 18.715 1.00 78.41 C ATOM 5408 NE ARG B 162 -2.600 8.062 18.670 1.00 84.02 N ATOM 5409 CZ ARG B 162 -3.009 7.390 19.742 1.00 83.03 C ATOM 5410 NH1 ARG B 162 -2.632 7.777 20.954 1.00 81.41 N ATOM 5411 NH2 ARG B 162 -3.787 6.325 19.604 1.00 82.08 N ATOM 5412 HA ARG B 162 -0.668 11.020 20.373 1.00 0.00 H ATOM 5413 HB2 ARG B 162 -2.217 12.633 18.328 1.00 0.00 H ATOM 5414 HB3 ARG B 162 -0.790 11.647 17.930 1.00 0.00 H ATOM 5415 HG2 ARG B 162 -3.344 10.595 19.177 1.00 0.00 H ATOM 5416 HG3 ARG B 162 -2.930 10.503 17.449 1.00 0.00 H ATOM 5417 HD2 ARG B 162 -1.280 9.308 19.699 1.00 0.00 H ATOM 5418 HD3 ARG B 162 -0.969 9.150 17.954 1.00 0.00 H ATOM 5419 HE ARG B 162 -2.910 7.722 17.737 1.00 0.00 H ATOM 5420 HH12 ARG B 162 -2.953 7.250 21.791 1.00 0.00 H ATOM 5421 HH11 ARG B 162 -2.016 8.607 21.067 1.00 0.00 H ATOM 5422 HH22 ARG B 162 -4.105 5.801 20.444 1.00 0.00 H ATOM 5423 HH21 ARG B 162 -4.079 6.014 18.656 1.00 0.00 H ATOM 5424 H ARG B 162 -2.934 12.948 20.617 1.00 0.00 H ATOM 5425 N PRO B 163 1.265 12.562 20.076 1.00 70.38 N ATOM 5426 CA PRO B 163 2.421 13.464 20.074 1.00 65.21 C ATOM 5427 C PRO B 163 2.683 14.037 18.684 1.00 63.63 C ATOM 5428 O PRO B 163 2.998 13.296 17.749 1.00 65.13 O ATOM 5429 CB PRO B 163 3.571 12.551 20.499 1.00 67.03 C ATOM 5430 CG PRO B 163 3.162 11.200 20.022 1.00 71.10 C ATOM 5431 CD PRO B 163 1.664 11.145 20.152 1.00 68.60 C ATOM 5432 HA PRO B 163 2.281 14.327 20.725 1.00 0.00 H ATOM 5433 HD3 PRO B 163 1.222 10.570 19.338 1.00 0.00 H ATOM 5434 HD2 PRO B 163 1.370 10.707 21.106 1.00 0.00 H ATOM 5435 HG3 PRO B 163 3.624 10.426 20.636 1.00 0.00 H ATOM 5436 HG2 PRO B 163 3.457 11.061 18.982 1.00 0.00 H ATOM 5437 HB2 PRO B 163 4.505 12.861 20.029 1.00 0.00 H ATOM 5438 HB3 PRO B 163 3.691 12.559 21.582 1.00 0.00 H ATOM 5439 N GLU B 164 2.545 15.351 18.555 1.00 59.32 N ATOM 5440 CA GLU B 164 2.779 16.030 17.289 1.00 54.10 C ATOM 5441 C GLU B 164 2.990 17.516 17.532 1.00 49.23 C ATOM 5442 O GLU B 164 2.721 18.016 18.623 1.00 53.98 O ATOM 5443 CB GLU B 164 1.593 15.824 16.351 1.00 60.46 C ATOM 5444 CG GLU B 164 0.302 16.423 16.871 1.00 57.72 C ATOM 5445 CD GLU B 164 -0.877 16.149 15.961 1.00 60.12 C ATOM 5446 OE1 GLU B 164 -0.677 16.078 14.729 1.00 59.56 O ATOM 5447 OE2 GLU B 164 -2.006 16.011 16.479 1.00 58.43 O ATOM 5448 HA GLU B 164 3.672 15.610 16.825 1.00 0.00 H ATOM 5449 HB2 GLU B 164 1.827 16.286 15.392 1.00 0.00 H ATOM 5450 HB3 GLU B 164 1.445 14.753 16.211 1.00 0.00 H ATOM 5451 HG2 GLU B 164 0.091 15.999 17.853 1.00 0.00 H ATOM 5452 HG3 GLU B 164 0.429 17.502 16.962 1.00 0.00 H ATOM 5453 H GLU B 164 2.261 15.912 19.383 1.00 0.00 H ATOM 5454 N ALA B 165 3.471 18.217 16.512 1.00 48.83 N ATOM 5455 CA ALA B 165 3.702 19.653 16.610 1.00 53.80 C ATOM 5456 C ALA B 165 2.413 20.403 16.949 1.00 55.76 C ATOM 5457 O ALA B 165 1.312 19.921 16.678 1.00 53.19 O ATOM 5458 CB ALA B 165 4.306 20.186 15.313 1.00 51.63 C ATOM 5459 HA ALA B 165 4.409 19.823 17.422 1.00 0.00 H ATOM 5460 HB1 ALA B 165 5.256 19.686 15.123 1.00 0.00 H ATOM 5461 HB2 ALA B 165 3.621 19.992 14.488 1.00 0.00 H ATOM 5462 HB3 ALA B 165 4.471 21.259 15.405 1.00 0.00 H ATOM 5463 H ALA B 165 3.689 17.729 15.620 1.00 0.00 H ATOM 5464 N ASP B 166 2.558 21.582 17.545 1.00 55.67 N ATOM 5465 CA ASP B 166 1.406 22.401 17.906 1.00 56.14 C ATOM 5466 C ASP B 166 0.732 22.989 16.675 1.00 55.29 C ATOM 5467 O ASP B 166 -0.491 23.105 16.627 1.00 54.26 O ATOM 5468 CB ASP B 166 1.814 23.521 18.870 1.00 56.36 C ATOM 5469 CG ASP B 166 1.421 23.223 20.305 1.00 54.61 C ATOM 5470 OD1 ASP B 166 0.267 22.796 20.522 1.00 54.35 O ATOM 5471 OD2 ASP B 166 2.262 23.417 21.212 1.00 54.35 O ATOM 5472 HA ASP B 166 0.689 21.751 18.407 1.00 0.00 H ATOM 5473 HB2 ASP B 166 2.896 23.647 18.822 1.00 0.00 H ATOM 5474 HB3 ASP B 166 1.328 24.445 18.559 1.00 0.00 H ATOM 5475 H ASP B 166 3.515 21.929 17.759 1.00 0.00 H ATOM 5476 N SER B 167 1.532 23.360 15.682 1.00 55.24 N ATOM 5477 CA SER B 167 1.002 23.944 14.459 1.00 53.16 C ATOM 5478 C SER B 167 0.099 22.936 13.756 1.00 54.30 C ATOM 5479 O SER B 167 -0.915 23.297 13.153 1.00 50.51 O ATOM 5480 CB SER B 167 2.142 24.352 13.532 1.00 52.94 C ATOM 5481 OG SER B 167 2.874 23.215 13.118 1.00 51.89 O ATOM 5482 HA SER B 167 0.422 24.831 14.714 1.00 0.00 H ATOM 5483 HB2 SER B 167 2.808 25.035 14.060 1.00 0.00 H ATOM 5484 HB3 SER B 167 1.731 24.853 12.656 1.00 0.00 H ATOM 5485 HG SER B 167 3.609 23.498 12.518 1.00 0.00 H ATOM 5486 H SER B 167 2.559 23.230 15.781 1.00 0.00 H ATOM 5487 N VAL B 168 0.480 21.667 13.842 1.00 51.99 N ATOM 5488 CA VAL B 168 -0.298 20.593 13.249 1.00 50.95 C ATOM 5489 C VAL B 168 -1.559 20.352 14.065 1.00 52.10 C ATOM 5490 O VAL B 168 -2.619 20.043 13.520 1.00 51.08 O ATOM 5491 CB VAL B 168 0.513 19.296 13.188 1.00 52.47 C ATOM 5492 CG1 VAL B 168 -0.336 18.174 12.622 1.00 56.33 C ATOM 5493 CG2 VAL B 168 1.767 19.499 12.352 1.00 53.35 C ATOM 5494 HA VAL B 168 -0.563 20.892 12.235 1.00 0.00 H ATOM 5495 HB VAL B 168 0.816 19.020 14.198 1.00 0.00 H ATOM 5496 HG11 VAL B 168 -1.207 18.022 13.260 1.00 0.00 H ATOM 5497 HG12 VAL B 168 -0.663 18.439 11.616 1.00 0.00 H ATOM 5498 HG13 VAL B 168 0.253 17.258 12.584 1.00 0.00 H ATOM 5499 HG21 VAL B 168 1.485 19.792 11.341 1.00 0.00 H ATOM 5500 HG22 VAL B 168 2.378 20.282 12.801 1.00 0.00 H ATOM 5501 HG23 VAL B 168 2.334 18.569 12.317 1.00 0.00 H ATOM 5502 H VAL B 168 1.359 21.436 14.347 1.00 0.00 H ATOM 5503 N ARG B 169 -1.435 20.495 15.379 1.00 51.17 N ATOM 5504 CA ARG B 169 -2.567 20.331 16.276 1.00 51.68 C ATOM 5505 C ARG B 169 -3.585 21.446 16.033 1.00 49.70 C ATOM 5506 O ARG B 169 -4.794 21.214 16.071 1.00 47.39 O ATOM 5507 CB ARG B 169 -2.093 20.335 17.732 1.00 55.94 C ATOM 5508 CG ARG B 169 -3.070 19.703 18.705 1.00 59.17 C ATOM 5509 CD ARG B 169 -3.166 18.190 18.515 1.00 62.79 C ATOM 5510 NE ARG B 169 -2.121 17.461 19.234 1.00 66.41 N ATOM 5511 CZ ARG B 169 -1.901 17.559 20.543 1.00 68.55 C ATOM 5512 NH1 ARG B 169 -2.645 18.367 21.288 1.00 71.45 N ATOM 5513 NH2 ARG B 169 -0.929 16.855 21.109 1.00 70.37 N ATOM 5514 HA ARG B 169 -3.047 19.373 16.078 1.00 0.00 H ATOM 5515 HB2 ARG B 169 -1.152 19.787 17.787 1.00 0.00 H ATOM 5516 HB3 ARG B 169 -1.928 21.369 18.035 1.00 0.00 H ATOM 5517 HG2 ARG B 169 -2.738 19.910 19.722 1.00 0.00 H ATOM 5518 HG3 ARG B 169 -4.056 20.141 18.549 1.00 0.00 H ATOM 5519 HD2 ARG B 169 -3.079 17.966 17.452 1.00 0.00 H ATOM 5520 HD3 ARG B 169 -4.138 17.854 18.877 1.00 0.00 H ATOM 5521 HE ARG B 169 -1.509 16.824 18.686 1.00 0.00 H ATOM 5522 HH12 ARG B 169 -2.469 18.440 22.310 1.00 0.00 H ATOM 5523 HH11 ARG B 169 -3.404 18.927 20.849 1.00 0.00 H ATOM 5524 HH22 ARG B 169 -0.758 16.933 22.132 1.00 0.00 H ATOM 5525 HH21 ARG B 169 -0.338 16.225 20.530 1.00 0.00 H ATOM 5526 H ARG B 169 -0.504 20.731 15.777 1.00 0.00 H ATOM 5527 N LEU B 170 -3.082 22.650 15.771 1.00 48.11 N ATOM 5528 CA LEU B 170 -3.922 23.811 15.482 1.00 50.58 C ATOM 5529 C LEU B 170 -4.640 23.665 14.142 1.00 48.72 C ATOM 5530 O LEU B 170 -5.804 24.046 14.005 1.00 50.40 O ATOM 5531 CB LEU B 170 -3.085 25.095 15.489 1.00 50.08 C ATOM 5532 CG LEU B 170 -3.827 26.395 15.166 1.00 50.01 C ATOM 5533 CD1 LEU B 170 -4.855 26.703 16.242 1.00 48.33 C ATOM 5534 CD2 LEU B 170 -2.854 27.548 15.010 1.00 53.74 C ATOM 5535 HA LEU B 170 -4.677 23.871 16.266 1.00 0.00 H ATOM 5536 HB2 LEU B 170 -2.648 25.201 16.482 1.00 0.00 H ATOM 5537 HB3 LEU B 170 -2.289 24.976 14.754 1.00 0.00 H ATOM 5538 HG LEU B 170 -4.349 26.263 14.218 1.00 0.00 H ATOM 5539 HD21 LEU B 170 -2.299 27.682 15.939 1.00 0.00 H ATOM 5540 HD22 LEU B 170 -2.160 27.329 14.199 1.00 0.00 H ATOM 5541 HD23 LEU B 170 -3.406 28.459 14.781 1.00 0.00 H ATOM 5542 HD11 LEU B 170 -5.576 25.888 16.298 1.00 0.00 H ATOM 5543 HD12 LEU B 170 -4.352 26.811 17.203 1.00 0.00 H ATOM 5544 HD13 LEU B 170 -5.372 27.630 15.994 1.00 0.00 H ATOM 5545 H LEU B 170 -2.049 22.770 15.772 1.00 0.00 H ATOM 5546 N ALA B 171 -3.942 23.116 13.153 1.00 47.98 N ATOM 5547 CA ALA B 171 -4.537 22.878 11.844 1.00 46.15 C ATOM 5548 C ALA B 171 -5.626 21.809 11.911 1.00 46.53 C ATOM 5549 O ALA B 171 -6.658 21.920 11.244 1.00 46.04 O ATOM 5550 CB ALA B 171 -3.470 22.483 10.843 1.00 49.82 C ATOM 5551 HA ALA B 171 -5.003 23.807 11.516 1.00 0.00 H ATOM 5552 HB1 ALA B 171 -2.737 23.285 10.760 1.00 0.00 H ATOM 5553 HB2 ALA B 171 -2.977 21.572 11.180 1.00 0.00 H ATOM 5554 HB3 ALA B 171 -3.932 22.309 9.871 1.00 0.00 H ATOM 5555 H ALA B 171 -2.950 22.851 13.317 1.00 0.00 H ATOM 5556 N GLN B 172 -5.393 20.774 12.712 1.00 43.95 N ATOM 5557 CA GLN B 172 -6.359 19.686 12.839 1.00 44.19 C ATOM 5558 C GLN B 172 -7.643 20.140 13.534 1.00 47.59 C ATOM 5559 O GLN B 172 -8.747 19.834 13.078 1.00 43.07 O ATOM 5560 CB GLN B 172 -5.745 18.489 13.571 1.00 45.55 C ATOM 5561 CG GLN B 172 -4.677 17.743 12.762 1.00 51.20 C ATOM 5562 CD GLN B 172 -3.964 16.674 13.572 1.00 49.76 C ATOM 5563 OE1 GLN B 172 -3.885 16.762 14.795 1.00 47.70 O ATOM 5564 NE2 GLN B 172 -3.435 15.660 12.890 1.00 49.57 N ATOM 5565 HA GLN B 172 -6.625 19.375 11.829 1.00 0.00 H ATOM 5566 HB2 GLN B 172 -5.288 18.849 14.493 1.00 0.00 H ATOM 5567 HB3 GLN B 172 -6.544 17.788 13.812 1.00 0.00 H ATOM 5568 HG2 GLN B 172 -5.156 17.269 11.905 1.00 0.00 H ATOM 5569 HG3 GLN B 172 -3.939 18.464 12.411 1.00 0.00 H ATOM 5570 HE22 GLN B 172 -3.526 15.626 11.855 1.00 0.00 H ATOM 5571 HE21 GLN B 172 -2.931 14.902 13.393 1.00 0.00 H ATOM 5572 H GLN B 172 -4.508 20.738 13.257 1.00 0.00 H ATOM 5573 N TYR B 173 -7.500 20.869 14.639 1.00 47.38 N ATOM 5574 CA TYR B 173 -8.659 21.319 15.402 1.00 44.97 C ATOM 5575 C TYR B 173 -9.503 22.283 14.573 1.00 42.25 C ATOM 5576 O TYR B 173 -10.707 22.422 14.790 1.00 42.59 O ATOM 5577 CB TYR B 173 -8.216 21.986 16.708 1.00 46.93 C ATOM 5578 CG TYR B 173 -9.330 22.185 17.714 1.00 46.01 C ATOM 5579 CD1 TYR B 173 -10.097 23.344 17.714 1.00 43.08 C ATOM 5580 CD2 TYR B 173 -9.611 21.214 18.668 1.00 47.93 C ATOM 5581 CE1 TYR B 173 -11.120 23.527 18.633 1.00 41.40 C ATOM 5582 CE2 TYR B 173 -10.627 21.388 19.593 1.00 47.80 C ATOM 5583 CZ TYR B 173 -11.378 22.548 19.571 1.00 48.20 C ATOM 5584 OH TYR B 173 -12.389 22.722 20.492 1.00 47.12 O ATOM 5585 HA TYR B 173 -9.268 20.449 15.647 1.00 0.00 H ATOM 5586 HB3 TYR B 173 -7.794 22.962 16.468 1.00 0.00 H ATOM 5587 HB2 TYR B 173 -7.448 21.363 17.167 1.00 0.00 H ATOM 5588 HD2 TYR B 173 -9.020 20.298 18.689 1.00 0.00 H ATOM 5589 HE2 TYR B 173 -10.833 20.615 20.334 1.00 0.00 H ATOM 5590 HE1 TYR B 173 -11.717 24.439 18.614 1.00 0.00 H ATOM 5591 HD1 TYR B 173 -9.891 24.123 16.979 1.00 0.00 H ATOM 5592 HH TYR B 173 -12.825 23.598 20.340 1.00 0.00 H ATOM 5593 H TYR B 173 -6.545 21.122 14.964 1.00 0.00 H ATOM 5594 N GLN B 174 -8.866 22.947 13.619 1.00 40.07 N ATOM 5595 CA GLN B 174 -9.555 23.910 12.779 1.00 41.81 C ATOM 5596 C GLN B 174 -10.578 23.218 11.878 1.00 43.32 C ATOM 5597 O GLN B 174 -11.669 23.742 11.638 1.00 38.37 O ATOM 5598 CB GLN B 174 -8.544 24.690 11.941 1.00 47.85 C ATOM 5599 CG GLN B 174 -8.963 26.113 11.616 1.00 47.67 C ATOM 5600 CD GLN B 174 -7.805 27.084 11.703 1.00 50.64 C ATOM 5601 OE1 GLN B 174 -6.771 26.778 12.294 1.00 49.22 O ATOM 5602 NE2 GLN B 174 -7.975 28.264 11.120 1.00 55.50 N ATOM 5603 HA GLN B 174 -10.093 24.606 13.423 1.00 0.00 H ATOM 5604 HB2 GLN B 174 -7.603 24.728 12.490 1.00 0.00 H ATOM 5605 HB3 GLN B 174 -8.394 24.156 11.003 1.00 0.00 H ATOM 5606 HG2 GLN B 174 -9.367 26.138 10.604 1.00 0.00 H ATOM 5607 HG3 GLN B 174 -9.734 26.422 12.321 1.00 0.00 H ATOM 5608 HE22 GLN B 174 -8.867 28.479 10.631 1.00 0.00 H ATOM 5609 HE21 GLN B 174 -7.216 28.974 11.152 1.00 0.00 H ATOM 5610 H GLN B 174 -7.851 22.775 13.469 1.00 0.00 H ATOM 5611 N LEU B 175 -10.231 22.034 11.389 1.00 41.72 N ATOM 5612 CA LEU B 175 -11.119 21.323 10.477 1.00 41.75 C ATOM 5613 C LEU B 175 -12.126 20.440 11.213 1.00 39.39 C ATOM 5614 O LEU B 175 -13.251 20.247 10.748 1.00 34.82 O ATOM 5615 CB LEU B 175 -10.323 20.534 9.433 1.00 45.48 C ATOM 5616 CG LEU B 175 -9.155 19.671 9.900 1.00 47.20 C ATOM 5617 CD1 LEU B 175 -9.659 18.456 10.661 1.00 47.17 C ATOM 5618 CD2 LEU B 175 -8.311 19.246 8.705 1.00 49.38 C ATOM 5619 HA LEU B 175 -11.703 22.076 9.948 1.00 0.00 H ATOM 5620 HB2 LEU B 175 -11.026 19.874 8.924 1.00 0.00 H ATOM 5621 HB3 LEU B 175 -9.924 21.256 8.721 1.00 0.00 H ATOM 5622 HG LEU B 175 -8.533 20.258 10.575 1.00 0.00 H ATOM 5623 HD21 LEU B 175 -8.927 18.673 8.012 1.00 0.00 H ATOM 5624 HD22 LEU B 175 -7.924 20.132 8.201 1.00 0.00 H ATOM 5625 HD23 LEU B 175 -7.480 18.630 9.049 1.00 0.00 H ATOM 5626 HD11 LEU B 175 -10.227 18.784 11.532 1.00 0.00 H ATOM 5627 HD12 LEU B 175 -10.300 17.862 10.010 1.00 0.00 H ATOM 5628 HD13 LEU B 175 -8.810 17.854 10.985 1.00 0.00 H ATOM 5629 H LEU B 175 -9.320 21.611 11.658 1.00 0.00 H ATOM 5630 N ILE B 176 -11.730 19.905 12.361 1.00 36.66 N ATOM 5631 CA ILE B 176 -12.691 19.212 13.201 1.00 39.50 C ATOM 5632 C ILE B 176 -13.807 20.181 13.594 1.00 37.43 C ATOM 5633 O ILE B 176 -14.987 19.892 13.395 1.00 37.97 O ATOM 5634 CB ILE B 176 -12.043 18.617 14.457 1.00 42.98 C ATOM 5635 CG1 ILE B 176 -11.159 17.428 14.074 1.00 47.53 C ATOM 5636 CG2 ILE B 176 -13.115 18.178 15.442 1.00 40.37 C ATOM 5637 CD1 ILE B 176 -10.462 16.776 15.247 1.00 49.38 C ATOM 5638 HA ILE B 176 -13.099 18.380 12.628 1.00 0.00 H ATOM 5639 HB ILE B 176 -11.425 19.379 14.931 1.00 0.00 H ATOM 5640 HG12 ILE B 176 -11.784 16.679 13.587 1.00 0.00 H ATOM 5641 HG13 ILE B 176 -10.399 17.777 13.374 1.00 0.00 H ATOM 5642 HD11 ILE B 176 -9.822 17.508 15.740 1.00 0.00 H ATOM 5643 HD12 ILE B 176 -11.207 16.409 15.953 1.00 0.00 H ATOM 5644 HD13 ILE B 176 -9.856 15.943 14.891 1.00 0.00 H ATOM 5645 HG21 ILE B 176 -13.721 19.039 15.725 1.00 0.00 H ATOM 5646 HG22 ILE B 176 -13.749 17.424 14.975 1.00 0.00 H ATOM 5647 HG23 ILE B 176 -12.641 17.757 16.329 1.00 0.00 H ATOM 5648 H ILE B 176 -10.736 19.982 12.658 1.00 0.00 H ATOM 5649 N SER B 177 -13.430 21.339 14.125 1.00 32.38 N ATOM 5650 CA SER B 177 -14.415 22.329 14.547 1.00 38.87 C ATOM 5651 C SER B 177 -15.278 22.784 13.372 1.00 35.70 C ATOM 5652 O SER B 177 -16.485 22.985 13.524 1.00 35.83 O ATOM 5653 CB SER B 177 -13.742 23.528 15.229 1.00 37.83 C ATOM 5654 OG SER B 177 -13.296 24.494 14.289 1.00 41.76 O ATOM 5655 HA SER B 177 -15.068 21.852 15.278 1.00 0.00 H ATOM 5656 HB2 SER B 177 -12.885 23.172 15.802 1.00 0.00 H ATOM 5657 HB3 SER B 177 -14.458 23.997 15.903 1.00 0.00 H ATOM 5658 HG SER B 177 -12.639 24.078 13.676 1.00 0.00 H ATOM 5659 H SER B 177 -12.417 21.543 14.242 1.00 0.00 H ATOM 5660 N LYS B 178 -14.654 22.938 12.205 1.00 34.45 N ATOM 5661 CA LYS B 178 -15.359 23.324 10.982 1.00 35.40 C ATOM 5662 C LYS B 178 -16.461 22.327 10.627 1.00 33.97 C ATOM 5663 O LYS B 178 -17.543 22.716 10.178 1.00 27.79 O ATOM 5664 CB LYS B 178 -14.377 23.446 9.815 1.00 38.10 C ATOM 5665 CG LYS B 178 -14.200 24.863 9.272 1.00 43.35 C ATOM 5666 CD LYS B 178 -14.588 24.934 7.797 1.00 49.59 C ATOM 5667 CE LYS B 178 -14.428 26.345 7.228 1.00 52.32 C ATOM 5668 NZ LYS B 178 -13.002 26.786 7.162 1.00 54.45 N ATOM 5669 HA LYS B 178 -15.825 24.292 11.166 1.00 0.00 H ATOM 5670 HB2 LYS B 178 -13.404 23.087 10.151 1.00 0.00 H ATOM 5671 HB3 LYS B 178 -14.735 22.814 9.003 1.00 0.00 H ATOM 5672 HG2 LYS B 178 -14.832 25.545 9.841 1.00 0.00 H ATOM 5673 HG3 LYS B 178 -13.157 25.160 9.382 1.00 0.00 H ATOM 5674 HD2 LYS B 178 -13.951 24.253 7.232 1.00 0.00 H ATOM 5675 HD3 LYS B 178 -15.629 24.628 7.692 1.00 0.00 H ATOM 5676 HE2 LYS B 178 -14.979 27.040 7.861 1.00 0.00 H ATOM 5677 HE3 LYS B 178 -14.845 26.364 6.221 1.00 0.00 H ATOM 5678 HZ1 LYS B 178 -12.594 26.781 8.119 1.00 0.00 H ATOM 5679 HZ2 LYS B 178 -12.467 26.135 6.552 1.00 0.00 H ATOM 5680 HZ3 LYS B 178 -12.956 27.748 6.769 1.00 0.00 H ATOM 5681 H LYS B 178 -13.627 22.778 12.161 1.00 0.00 H ATOM 5682 N ALA B 179 -16.177 21.044 10.826 1.00 28.71 N ATOM 5683 CA ALA B 179 -17.151 19.986 10.573 1.00 33.67 C ATOM 5684 C ALA B 179 -18.247 19.963 11.637 1.00 31.02 C ATOM 5685 O ALA B 179 -19.427 19.814 11.322 1.00 30.86 O ATOM 5686 CB ALA B 179 -16.456 18.620 10.491 1.00 31.64 C ATOM 5687 HA ALA B 179 -17.624 20.198 9.614 1.00 0.00 H ATOM 5688 HB1 ALA B 179 -15.728 18.632 9.680 1.00 0.00 H ATOM 5689 HB2 ALA B 179 -15.948 18.415 11.433 1.00 0.00 H ATOM 5690 HB3 ALA B 179 -17.200 17.846 10.302 1.00 0.00 H ATOM 5691 H ALA B 179 -15.231 20.785 11.173 1.00 0.00 H ATOM 5692 N ARG B 180 -17.850 20.095 12.898 1.00 31.28 N ATOM 5693 CA ARG B 180 -18.811 20.174 13.990 1.00 32.84 C ATOM 5694 C ARG B 180 -19.861 21.236 13.702 1.00 31.64 C ATOM 5695 O ARG B 180 -21.065 20.959 13.700 1.00 29.28 O ATOM 5696 CB ARG B 180 -18.114 20.554 15.292 1.00 35.88 C ATOM 5697 CG ARG B 180 -17.421 19.424 16.012 1.00 39.60 C ATOM 5698 CD ARG B 180 -16.941 19.920 17.366 1.00 46.90 C ATOM 5699 NE ARG B 180 -16.210 18.904 18.111 1.00 48.56 N ATOM 5700 CZ ARG B 180 -16.785 17.901 18.762 1.00 48.78 C ATOM 5701 NH1 ARG B 180 -18.108 17.771 18.751 1.00 45.90 N ATOM 5702 NH2 ARG B 180 -16.034 17.028 19.415 1.00 49.54 N ATOM 5703 HA ARG B 180 -19.279 19.194 14.083 1.00 0.00 H ATOM 5704 HB2 ARG B 180 -17.368 21.315 15.064 1.00 0.00 H ATOM 5705 HB3 ARG B 180 -18.863 20.972 15.965 1.00 0.00 H ATOM 5706 HG2 ARG B 180 -18.118 18.597 16.151 1.00 0.00 H ATOM 5707 HG3 ARG B 180 -16.569 19.084 15.424 1.00 0.00 H ATOM 5708 HD2 ARG B 180 -17.807 20.227 17.952 1.00 0.00 H ATOM 5709 HD3 ARG B 180 -16.286 20.778 17.211 1.00 0.00 H ATOM 5710 HE ARG B 180 -15.172 18.969 18.134 1.00 0.00 H ATOM 5711 HH12 ARG B 180 -18.557 16.984 19.262 1.00 0.00 H ATOM 5712 HH11 ARG B 180 -18.694 18.456 18.232 1.00 0.00 H ATOM 5713 HH22 ARG B 180 -16.479 16.240 19.927 1.00 0.00 H ATOM 5714 HH21 ARG B 180 -14.999 17.130 19.416 1.00 0.00 H ATOM 5715 H ARG B 180 -16.833 20.143 13.110 1.00 0.00 H ATOM 5716 N GLN B 181 -19.385 22.454 13.472 1.00 29.03 N ATOM 5717 CA GLN B 181 -20.256 23.609 13.335 1.00 33.60 C ATOM 5718 C GLN B 181 -21.105 23.499 12.084 1.00 28.42 C ATOM 5719 O GLN B 181 -22.232 23.984 12.051 1.00 29.46 O ATOM 5720 CB GLN B 181 -19.433 24.898 13.314 1.00 29.50 C ATOM 5721 CG GLN B 181 -18.725 25.162 14.631 1.00 34.39 C ATOM 5722 CD GLN B 181 -17.794 26.361 14.586 1.00 41.32 C ATOM 5723 OE1 GLN B 181 -16.727 26.349 15.201 1.00 39.57 O ATOM 5724 NE2 GLN B 181 -18.192 27.404 13.859 1.00 42.25 N ATOM 5725 HA GLN B 181 -20.924 23.638 14.196 1.00 0.00 H ATOM 5726 HB2 GLN B 181 -18.685 24.822 12.525 1.00 0.00 H ATOM 5727 HB3 GLN B 181 -20.099 25.734 13.102 1.00 0.00 H ATOM 5728 HG2 GLN B 181 -19.478 25.338 15.399 1.00 0.00 H ATOM 5729 HG3 GLN B 181 -18.140 24.280 14.892 1.00 0.00 H ATOM 5730 HE22 GLN B 181 -19.102 27.370 13.356 1.00 0.00 H ATOM 5731 HE21 GLN B 181 -17.593 28.252 13.795 1.00 0.00 H ATOM 5732 H GLN B 181 -18.357 22.585 13.387 1.00 0.00 H ATOM 5733 N GLN B 182 -20.563 22.849 11.060 1.00 28.45 N ATOM 5734 CA GLN B 182 -21.296 22.672 9.819 1.00 27.02 C ATOM 5735 C GLN B 182 -22.546 21.836 10.070 1.00 23.98 C ATOM 5736 O GLN B 182 -23.630 22.178 9.598 1.00 21.38 O ATOM 5737 CB GLN B 182 -20.417 22.008 8.764 1.00 25.87 C ATOM 5738 CG GLN B 182 -21.056 21.923 7.394 1.00 27.82 C ATOM 5739 CD GLN B 182 -20.165 21.229 6.378 1.00 30.41 C ATOM 5740 OE1 GLN B 182 -19.404 20.324 6.722 1.00 28.01 O ATOM 5741 NE2 GLN B 182 -20.263 21.647 5.118 1.00 32.21 N ATOM 5742 HA GLN B 182 -21.593 23.652 9.446 1.00 0.00 H ATOM 5743 HB2 GLN B 182 -19.494 22.581 8.677 1.00 0.00 H ATOM 5744 HB3 GLN B 182 -20.185 20.997 9.098 1.00 0.00 H ATOM 5745 HG2 GLN B 182 -21.990 21.367 7.478 1.00 0.00 H ATOM 5746 HG3 GLN B 182 -21.266 22.933 7.043 1.00 0.00 H ATOM 5747 HE22 GLN B 182 -20.920 22.415 4.875 1.00 0.00 H ATOM 5748 HE21 GLN B 182 -19.682 21.205 4.377 1.00 0.00 H ATOM 5749 H GLN B 182 -19.602 22.462 11.148 1.00 0.00 H ATOM 5750 N LEU B 183 -22.390 20.741 10.811 1.00 21.79 N ATOM 5751 CA LEU B 183 -23.513 19.859 11.133 1.00 24.79 C ATOM 5752 C LEU B 183 -24.517 20.536 12.081 1.00 22.28 C ATOM 5753 O LEU B 183 -25.729 20.386 11.937 1.00 20.21 O ATOM 5754 CB LEU B 183 -23.015 18.522 11.705 1.00 23.26 C ATOM 5755 CG LEU B 183 -24.109 17.507 12.041 1.00 26.61 C ATOM 5756 CD1 LEU B 183 -25.123 17.401 10.903 1.00 29.20 C ATOM 5757 CD2 LEU B 183 -23.530 16.125 12.382 1.00 32.05 C ATOM 5758 HA LEU B 183 -24.043 19.650 10.204 1.00 0.00 H ATOM 5759 HB2 LEU B 183 -22.349 18.069 10.971 1.00 0.00 H ATOM 5760 HB3 LEU B 183 -22.458 18.732 12.618 1.00 0.00 H ATOM 5761 HG LEU B 183 -24.622 17.873 12.931 1.00 0.00 H ATOM 5762 HD21 LEU B 183 -22.967 15.748 11.529 1.00 0.00 H ATOM 5763 HD22 LEU B 183 -22.870 16.212 13.245 1.00 0.00 H ATOM 5764 HD23 LEU B 183 -24.344 15.438 12.613 1.00 0.00 H ATOM 5765 HD11 LEU B 183 -25.586 18.374 10.739 1.00 0.00 H ATOM 5766 HD12 LEU B 183 -24.615 17.081 9.994 1.00 0.00 H ATOM 5767 HD13 LEU B 183 -25.890 16.673 11.168 1.00 0.00 H ATOM 5768 H LEU B 183 -21.443 20.506 11.171 1.00 0.00 H ATOM 5769 N LEU B 184 -24.000 21.283 13.049 1.00 22.47 N ATOM 5770 CA LEU B 184 -24.848 22.110 13.895 1.00 23.60 C ATOM 5771 C LEU B 184 -25.728 23.037 13.056 1.00 20.49 C ATOM 5772 O LEU B 184 -26.927 23.143 13.315 1.00 18.28 O ATOM 5773 CB LEU B 184 -24.010 22.928 14.871 1.00 22.22 C ATOM 5774 CG LEU B 184 -23.980 22.433 16.321 1.00 28.43 C ATOM 5775 CD1 LEU B 184 -24.157 20.938 16.417 1.00 27.98 C ATOM 5776 CD2 LEU B 184 -22.703 22.880 17.012 1.00 25.10 C ATOM 5777 HA LEU B 184 -25.495 21.442 14.464 1.00 0.00 H ATOM 5778 HB2 LEU B 184 -22.984 22.937 14.502 1.00 0.00 H ATOM 5779 HB3 LEU B 184 -24.403 23.945 14.875 1.00 0.00 H ATOM 5780 HG LEU B 184 -24.828 22.884 16.837 1.00 0.00 H ATOM 5781 HD21 LEU B 184 -21.842 22.473 16.481 1.00 0.00 H ATOM 5782 HD22 LEU B 184 -22.652 23.969 17.009 1.00 0.00 H ATOM 5783 HD23 LEU B 184 -22.702 22.518 18.040 1.00 0.00 H ATOM 5784 HD11 LEU B 184 -25.117 20.658 15.983 1.00 0.00 H ATOM 5785 HD12 LEU B 184 -23.353 20.443 15.873 1.00 0.00 H ATOM 5786 HD13 LEU B 184 -24.128 20.637 17.464 1.00 0.00 H ATOM 5787 H LEU B 184 -22.972 21.277 13.206 1.00 0.00 H ATOM 5788 N GLN B 185 -25.143 23.690 12.052 1.00 21.80 N ATOM 5789 CA GLN B 185 -25.919 24.587 11.190 1.00 22.25 C ATOM 5790 C GLN B 185 -26.953 23.818 10.371 1.00 22.37 C ATOM 5791 O GLN B 185 -28.054 24.314 10.120 1.00 18.05 O ATOM 5792 CB GLN B 185 -25.024 25.422 10.264 1.00 24.41 C ATOM 5793 CG GLN B 185 -24.054 26.370 10.971 1.00 31.82 C ATOM 5794 CD GLN B 185 -24.685 27.699 11.378 1.00 32.15 C ATOM 5795 OE1 GLN B 185 -25.896 27.899 11.255 1.00 25.25 O ATOM 5796 NE2 GLN B 185 -23.857 28.615 11.863 1.00 36.26 N ATOM 5797 HA GLN B 185 -26.443 25.275 11.854 1.00 0.00 H ATOM 5798 HB2 GLN B 185 -24.438 24.735 9.653 1.00 0.00 H ATOM 5799 HB3 GLN B 185 -25.670 26.019 9.620 1.00 0.00 H ATOM 5800 HG2 GLN B 185 -23.682 25.876 11.868 1.00 0.00 H ATOM 5801 HG3 GLN B 185 -23.221 26.575 10.299 1.00 0.00 H ATOM 5802 HE22 GLN B 185 -22.842 28.405 11.950 1.00 0.00 H ATOM 5803 HE21 GLN B 185 -24.223 29.543 12.156 1.00 0.00 H ATOM 5804 H GLN B 185 -24.126 23.562 11.878 1.00 0.00 H ATOM 5805 N VAL B 186 -26.602 22.610 9.940 1.00 18.41 N ATOM 5806 CA VAL B 186 -27.583 21.763 9.262 1.00 17.40 C ATOM 5807 C VAL B 186 -28.783 21.460 10.159 1.00 19.38 C ATOM 5808 O VAL B 186 -29.934 21.500 9.704 1.00 19.07 O ATOM 5809 CB VAL B 186 -26.959 20.445 8.749 1.00 17.63 C ATOM 5810 CG1 VAL B 186 -28.051 19.490 8.259 1.00 21.05 C ATOM 5811 CG2 VAL B 186 -25.969 20.732 7.647 1.00 22.73 C ATOM 5812 HA VAL B 186 -27.931 22.330 8.398 1.00 0.00 H ATOM 5813 HB VAL B 186 -26.431 19.965 9.573 1.00 0.00 H ATOM 5814 HG11 VAL B 186 -28.730 19.265 9.081 1.00 0.00 H ATOM 5815 HG12 VAL B 186 -28.605 19.960 7.447 1.00 0.00 H ATOM 5816 HG13 VAL B 186 -27.592 18.568 7.902 1.00 0.00 H ATOM 5817 HG21 VAL B 186 -26.479 21.231 6.823 1.00 0.00 H ATOM 5818 HG22 VAL B 186 -25.178 21.377 8.030 1.00 0.00 H ATOM 5819 HG23 VAL B 186 -25.537 19.795 7.295 1.00 0.00 H ATOM 5820 H VAL B 186 -25.631 22.268 10.085 1.00 0.00 H ATOM 5821 N ARG B 187 -28.526 21.160 11.433 1.00 18.21 N ATOM 5822 CA ARG B 187 -29.607 20.925 12.387 1.00 17.07 C ATOM 5823 C ARG B 187 -30.504 22.151 12.518 1.00 16.07 C ATOM 5824 O ARG B 187 -31.719 22.026 12.643 1.00 15.47 O ATOM 5825 CB ARG B 187 -29.062 20.556 13.777 1.00 19.07 C ATOM 5826 CG ARG B 187 -28.248 19.261 13.824 1.00 21.33 C ATOM 5827 CD ARG B 187 -28.170 18.742 15.277 1.00 21.51 C ATOM 5828 NE ARG B 187 -29.476 18.254 15.714 1.00 25.96 N ATOM 5829 CZ ARG B 187 -29.831 18.055 16.983 1.00 23.04 C ATOM 5830 NH1 ARG B 187 -28.978 18.308 17.962 1.00 23.11 N ATOM 5831 NH2 ARG B 187 -31.046 17.602 17.271 1.00 24.53 N ATOM 5832 HA ARG B 187 -30.190 20.090 11.999 1.00 0.00 H ATOM 5833 HB2 ARG B 187 -28.424 21.371 14.118 1.00 0.00 H ATOM 5834 HB3 ARG B 187 -29.908 20.450 14.456 1.00 0.00 H ATOM 5835 HG2 ARG B 187 -28.727 18.509 13.197 1.00 0.00 H ATOM 5836 HG3 ARG B 187 -27.241 19.453 13.454 1.00 0.00 H ATOM 5837 HD2 ARG B 187 -27.852 19.553 15.932 1.00 0.00 H ATOM 5838 HD3 ARG B 187 -27.446 17.929 15.330 1.00 0.00 H ATOM 5839 HE ARG B 187 -30.182 18.046 14.979 1.00 0.00 H ATOM 5840 HH12 ARG B 187 -29.260 18.151 18.951 1.00 0.00 H ATOM 5841 HH11 ARG B 187 -28.026 18.664 17.743 1.00 0.00 H ATOM 5842 HH22 ARG B 187 -31.322 17.447 18.262 1.00 0.00 H ATOM 5843 HH21 ARG B 187 -31.721 17.402 16.506 1.00 0.00 H ATOM 5844 H ARG B 187 -27.539 21.092 11.753 1.00 0.00 H ATOM 5845 N ILE B 188 -29.894 23.330 12.502 1.00 17.35 N ATOM 5846 CA ILE B 188 -30.651 24.589 12.563 1.00 18.29 C ATOM 5847 C ILE B 188 -31.549 24.742 11.331 1.00 16.53 C ATOM 5848 O ILE B 188 -32.713 25.147 11.436 1.00 16.65 O ATOM 5849 CB ILE B 188 -29.704 25.802 12.726 1.00 16.90 C ATOM 5850 CG1 ILE B 188 -28.993 25.734 14.085 1.00 18.88 C ATOM 5851 CG2 ILE B 188 -30.465 27.131 12.584 1.00 18.07 C ATOM 5852 CD1 ILE B 188 -27.895 26.796 14.281 1.00 19.06 C ATOM 5853 HA ILE B 188 -31.294 24.556 13.443 1.00 0.00 H ATOM 5854 HB ILE B 188 -28.960 25.760 11.931 1.00 0.00 H ATOM 5855 HG12 ILE B 188 -29.740 25.866 14.868 1.00 0.00 H ATOM 5856 HG13 ILE B 188 -28.537 24.749 14.183 1.00 0.00 H ATOM 5857 HD11 ILE B 188 -27.130 26.672 13.514 1.00 0.00 H ATOM 5858 HD12 ILE B 188 -28.334 27.790 14.200 1.00 0.00 H ATOM 5859 HD13 ILE B 188 -27.446 26.675 15.267 1.00 0.00 H ATOM 5860 HG21 ILE B 188 -30.925 27.181 11.597 1.00 0.00 H ATOM 5861 HG22 ILE B 188 -31.238 27.189 13.350 1.00 0.00 H ATOM 5862 HG23 ILE B 188 -29.769 27.961 12.704 1.00 0.00 H ATOM 5863 H ILE B 188 -28.856 23.364 12.445 1.00 0.00 H ATOM 5864 N ASP B 189 -31.010 24.409 10.165 1.00 16.03 N ATOM 5865 CA ASP B 189 -31.796 24.426 8.938 1.00 16.89 C ATOM 5866 C ASP B 189 -32.929 23.409 9.020 1.00 16.18 C ATOM 5867 O ASP B 189 -34.059 23.709 8.669 1.00 16.12 O ATOM 5868 CB ASP B 189 -30.925 24.122 7.715 1.00 18.10 C ATOM 5869 CG ASP B 189 -29.889 25.205 7.440 1.00 22.81 C ATOM 5870 OD1 ASP B 189 -30.063 26.339 7.923 1.00 27.89 O ATOM 5871 OD2 ASP B 189 -28.906 24.923 6.721 1.00 27.62 O ATOM 5872 HA ASP B 189 -32.212 25.427 8.827 1.00 0.00 H ATOM 5873 HB2 ASP B 189 -30.406 23.179 7.883 1.00 0.00 H ATOM 5874 HB3 ASP B 189 -31.571 24.029 6.842 1.00 0.00 H ATOM 5875 H ASP B 189 -30.009 24.131 10.126 1.00 0.00 H ATOM 5876 N VAL B 190 -32.629 22.193 9.465 1.00 14.12 N ATOM 5877 CA VAL B 190 -33.671 21.153 9.558 1.00 14.49 C ATOM 5878 C VAL B 190 -34.769 21.548 10.554 1.00 13.75 C ATOM 5879 O VAL B 190 -35.958 21.327 10.310 1.00 12.54 O ATOM 5880 CB VAL B 190 -33.073 19.745 9.862 1.00 15.37 C ATOM 5881 CG1 VAL B 190 -34.171 18.727 10.158 1.00 14.13 C ATOM 5882 CG2 VAL B 190 -32.244 19.268 8.676 1.00 14.63 C ATOM 5883 HA VAL B 190 -34.141 21.078 8.577 1.00 0.00 H ATOM 5884 HB VAL B 190 -32.440 19.833 10.745 1.00 0.00 H ATOM 5885 HG11 VAL B 190 -34.745 19.055 11.025 1.00 0.00 H ATOM 5886 HG12 VAL B 190 -34.831 18.645 9.294 1.00 0.00 H ATOM 5887 HG13 VAL B 190 -33.719 17.757 10.365 1.00 0.00 H ATOM 5888 HG21 VAL B 190 -32.879 19.207 7.792 1.00 0.00 H ATOM 5889 HG22 VAL B 190 -31.433 19.973 8.495 1.00 0.00 H ATOM 5890 HG23 VAL B 190 -31.830 18.284 8.896 1.00 0.00 H ATOM 5891 H VAL B 190 -31.653 21.973 9.750 1.00 0.00 H ATOM 5892 N ARG B 191 -34.387 22.159 11.673 1.00 12.72 N ATOM 5893 CA ARG B 191 -35.413 22.593 12.624 1.00 17.87 C ATOM 5894 C ARG B 191 -36.228 23.771 12.090 1.00 14.61 C ATOM 5895 O ARG B 191 -37.404 23.960 12.456 1.00 12.81 O ATOM 5896 CB ARG B 191 -34.806 22.884 13.992 1.00 18.40 C ATOM 5897 CG ARG B 191 -34.320 21.597 14.638 1.00 20.69 C ATOM 5898 CD ARG B 191 -34.345 21.687 16.117 1.00 18.46 C ATOM 5899 NE ARG B 191 -34.176 20.380 16.730 1.00 18.18 N ATOM 5900 CZ ARG B 191 -34.230 20.187 18.036 1.00 20.07 C ATOM 5901 NH1 ARG B 191 -34.453 21.224 18.842 1.00 18.31 N ATOM 5902 NH2 ARG B 191 -34.072 18.968 18.530 1.00 16.25 N ATOM 5903 HA ARG B 191 -36.114 21.768 12.750 1.00 0.00 H ATOM 5904 HB2 ARG B 191 -33.965 23.568 13.875 1.00 0.00 H ATOM 5905 HB3 ARG B 191 -35.560 23.344 14.630 1.00 0.00 H ATOM 5906 HG2 ARG B 191 -34.965 20.777 14.322 1.00 0.00 H ATOM 5907 HG3 ARG B 191 -33.298 21.401 14.312 1.00 0.00 H ATOM 5908 HD2 ARG B 191 -35.301 22.106 16.431 1.00 0.00 H ATOM 5909 HD3 ARG B 191 -33.538 22.341 16.447 1.00 0.00 H ATOM 5910 HE ARG B 191 -34.005 19.560 16.113 1.00 0.00 H ATOM 5911 HH12 ARG B 191 -34.497 21.082 19.871 1.00 0.00 H ATOM 5912 HH11 ARG B 191 -34.583 22.175 18.442 1.00 0.00 H ATOM 5913 HH22 ARG B 191 -34.114 18.814 19.558 1.00 0.00 H ATOM 5914 HH21 ARG B 191 -33.906 18.165 17.890 1.00 0.00 H ATOM 5915 H ARG B 191 -33.379 22.325 11.868 1.00 0.00 H ATOM 5916 N GLY B 192 -35.605 24.553 11.215 1.00 17.38 N ATOM 5917 CA GLY B 192 -36.317 25.609 10.521 1.00 15.44 C ATOM 5918 C GLY B 192 -37.424 24.964 9.701 1.00 15.88 C ATOM 5919 O GLY B 192 -38.572 25.406 9.725 1.00 14.25 O ATOM 5920 HA3 GLY B 192 -35.634 26.147 9.864 1.00 0.00 H ATOM 5921 HA2 GLY B 192 -36.747 26.303 11.243 1.00 0.00 H ATOM 5922 H GLY B 192 -34.593 24.406 11.025 1.00 0.00 H ATOM 5923 N TYR B 193 -37.068 23.903 8.979 1.00 14.52 N ATOM 5924 CA TYR B 193 -38.018 23.146 8.169 1.00 13.76 C ATOM 5925 C TYR B 193 -39.129 22.497 9.011 1.00 15.12 C ATOM 5926 O TYR B 193 -40.301 22.508 8.631 1.00 14.11 O ATOM 5927 CB TYR B 193 -37.262 22.110 7.300 1.00 14.41 C ATOM 5928 CG TYR B 193 -38.137 21.084 6.628 1.00 15.78 C ATOM 5929 CD1 TYR B 193 -39.272 21.460 5.936 1.00 16.53 C ATOM 5930 CD2 TYR B 193 -37.829 19.719 6.694 1.00 16.92 C ATOM 5931 CE1 TYR B 193 -40.084 20.516 5.330 1.00 17.40 C ATOM 5932 CE2 TYR B 193 -38.630 18.772 6.090 1.00 18.46 C ATOM 5933 CZ TYR B 193 -39.766 19.176 5.407 1.00 19.84 C ATOM 5934 OH TYR B 193 -40.589 18.240 4.800 1.00 20.38 O ATOM 5935 HA TYR B 193 -38.527 23.846 7.507 1.00 0.00 H ATOM 5936 HB3 TYR B 193 -36.554 21.584 7.940 1.00 0.00 H ATOM 5937 HB2 TYR B 193 -36.718 22.650 6.525 1.00 0.00 H ATOM 5938 HD2 TYR B 193 -36.938 19.398 7.234 1.00 0.00 H ATOM 5939 HE2 TYR B 193 -38.371 17.715 6.150 1.00 0.00 H ATOM 5940 HE1 TYR B 193 -40.977 20.833 4.791 1.00 0.00 H ATOM 5941 HD1 TYR B 193 -39.532 22.516 5.866 1.00 0.00 H ATOM 5942 HH TYR B 193 -41.347 18.703 4.362 1.00 0.00 H ATOM 5943 H TYR B 193 -36.073 23.601 8.993 1.00 0.00 H ATOM 5944 N ILE B 194 -38.772 21.959 10.169 1.00 13.42 N ATOM 5945 CA ILE B 194 -39.762 21.329 11.035 1.00 14.61 C ATOM 5946 C ILE B 194 -40.808 22.351 11.505 1.00 17.47 C ATOM 5947 O ILE B 194 -42.007 22.053 11.594 1.00 16.09 O ATOM 5948 CB ILE B 194 -39.081 20.624 12.239 1.00 15.36 C ATOM 5949 CG1 ILE B 194 -38.209 19.462 11.735 1.00 14.40 C ATOM 5950 CG2 ILE B 194 -40.125 20.136 13.229 1.00 16.47 C ATOM 5951 CD1 ILE B 194 -37.303 18.825 12.801 1.00 18.02 C ATOM 5952 HA ILE B 194 -40.280 20.565 10.456 1.00 0.00 H ATOM 5953 HB ILE B 194 -38.440 21.338 12.757 1.00 0.00 H ATOM 5954 HG12 ILE B 194 -38.869 18.688 11.344 1.00 0.00 H ATOM 5955 HG13 ILE B 194 -37.575 19.837 10.932 1.00 0.00 H ATOM 5956 HD11 ILE B 194 -36.623 19.580 13.196 1.00 0.00 H ATOM 5957 HD12 ILE B 194 -37.918 18.429 13.609 1.00 0.00 H ATOM 5958 HD13 ILE B 194 -36.728 18.016 12.351 1.00 0.00 H ATOM 5959 HG21 ILE B 194 -40.702 20.985 13.595 1.00 0.00 H ATOM 5960 HG22 ILE B 194 -40.791 19.429 12.734 1.00 0.00 H ATOM 5961 HG23 ILE B 194 -39.629 19.645 14.066 1.00 0.00 H ATOM 5962 H ILE B 194 -37.775 21.987 10.463 1.00 0.00 H ATOM 5963 N ALA B 195 -40.349 23.557 11.806 1.00 14.38 N ATOM 5964 CA ALA B 195 -41.260 24.626 12.209 1.00 15.01 C ATOM 5965 C ALA B 195 -42.123 25.124 11.038 1.00 18.46 C ATOM 5966 O ALA B 195 -43.315 25.397 11.206 1.00 18.93 O ATOM 5967 CB ALA B 195 -40.482 25.773 12.851 1.00 17.38 C ATOM 5968 HA ALA B 195 -41.946 24.214 12.949 1.00 0.00 H ATOM 5969 HB1 ALA B 195 -39.954 25.405 13.731 1.00 0.00 H ATOM 5970 HB2 ALA B 195 -39.763 26.169 12.134 1.00 0.00 H ATOM 5971 HB3 ALA B 195 -41.175 26.561 13.145 1.00 0.00 H ATOM 5972 H ALA B 195 -39.327 23.745 11.755 1.00 0.00 H ATOM 5973 N GLU B 196 -41.527 25.201 9.850 1.00 15.66 N ATOM 5974 CA GLU B 196 -42.204 25.729 8.659 1.00 19.80 C ATOM 5975 C GLU B 196 -41.925 24.818 7.461 1.00 17.34 C ATOM 5976 O GLU B 196 -40.902 24.954 6.798 1.00 17.36 O ATOM 5977 CB GLU B 196 -41.731 27.153 8.368 1.00 17.79 C ATOM 5978 CG GLU B 196 -42.312 27.768 7.116 1.00 27.85 C ATOM 5979 CD GLU B 196 -43.826 27.840 7.158 1.00 33.90 C ATOM 5980 OE1 GLU B 196 -44.368 28.449 8.110 1.00 37.31 O ATOM 5981 OE2 GLU B 196 -44.471 27.284 6.240 1.00 33.82 O ATOM 5982 HA GLU B 196 -43.278 25.755 8.841 1.00 0.00 H ATOM 5983 HB2 GLU B 196 -42.006 27.782 9.215 1.00 0.00 H ATOM 5984 HB3 GLU B 196 -40.646 27.137 8.266 1.00 0.00 H ATOM 5985 HG2 GLU B 196 -41.916 28.777 7.005 1.00 0.00 H ATOM 5986 HG3 GLU B 196 -42.013 27.165 6.258 1.00 0.00 H ATOM 5987 H GLU B 196 -40.544 24.874 9.762 1.00 0.00 H ATOM 5988 N ASN B 197 -42.845 23.890 7.206 1.00 16.05 N ATOM 5989 CA ASN B 197 -42.648 22.796 6.244 1.00 17.21 C ATOM 5990 C ASN B 197 -42.676 23.165 4.759 1.00 18.18 C ATOM 5991 O ASN B 197 -43.278 22.453 3.964 1.00 18.38 O ATOM 5992 CB ASN B 197 -43.728 21.730 6.433 1.00 19.51 C ATOM 5993 CG ASN B 197 -43.799 21.196 7.841 1.00 20.52 C ATOM 5994 OD1 ASN B 197 -42.871 21.358 8.648 1.00 22.55 O ATOM 5995 ND2 ASN B 197 -44.905 20.553 8.149 1.00 20.30 N ATOM 5996 HA ASN B 197 -41.637 22.457 6.470 1.00 0.00 H ATOM 5997 HB2 ASN B 197 -44.694 22.167 6.179 1.00 0.00 H ATOM 5998 HB3 ASN B 197 -43.517 20.900 5.758 1.00 0.00 H ATOM 5999 HD22 ASN B 197 -45.657 20.442 7.439 1.00 0.00 H ATOM 6000 HD21 ASN B 197 -45.027 20.156 9.102 1.00 0.00 H ATOM 6001 H ASN B 197 -43.751 23.942 7.714 1.00 0.00 H ATOM 6002 N SER B 198 -42.032 24.248 4.370 1.00 15.49 N ATOM 6003 CA SER B 198 -42.067 24.649 2.970 1.00 16.06 C ATOM 6004 C SER B 198 -41.112 23.833 2.086 1.00 16.64 C ATOM 6005 O SER B 198 -40.116 23.249 2.557 1.00 14.81 O ATOM 6006 CB SER B 198 -41.723 26.123 2.861 1.00 16.56 C ATOM 6007 OG SER B 198 -40.402 26.332 3.357 1.00 14.84 O ATOM 6008 HA SER B 198 -43.077 24.458 2.607 1.00 0.00 H ATOM 6009 HB2 SER B 198 -42.431 26.708 3.449 1.00 0.00 H ATOM 6010 HB3 SER B 198 -41.775 26.434 1.818 1.00 0.00 H ATOM 6011 HG SER B 198 -40.173 27.293 3.288 1.00 0.00 H ATOM 6012 H SER B 198 -41.500 24.815 5.061 1.00 0.00 H ATOM 6013 N SER B 199 -41.414 23.805 0.796 1.00 17.89 N ATOM 6014 CA SER B 199 -40.522 23.195 -0.184 1.00 18.42 C ATOM 6015 C SER B 199 -39.160 23.882 -0.104 1.00 17.40 C ATOM 6016 O SER B 199 -38.106 23.224 -0.135 1.00 14.36 O ATOM 6017 CB SER B 199 -41.129 23.318 -1.592 1.00 24.23 C ATOM 6018 OG SER B 199 -40.181 23.010 -2.594 1.00 28.26 O ATOM 6019 HA SER B 199 -40.394 22.134 0.030 1.00 0.00 H ATOM 6020 HB2 SER B 199 -41.480 24.339 -1.738 1.00 0.00 H ATOM 6021 HB3 SER B 199 -41.970 22.630 -1.677 1.00 0.00 H ATOM 6022 HG SER B 199 -40.604 23.099 -3.485 1.00 0.00 H ATOM 6023 H SER B 199 -42.308 24.228 0.475 1.00 0.00 H ATOM 6024 N ALA B 200 -39.164 25.203 0.057 1.00 17.09 N ATOM 6025 CA ALA B 200 -37.900 25.935 0.102 1.00 12.36 C ATOM 6026 C ALA B 200 -37.054 25.533 1.301 1.00 14.93 C ATOM 6027 O ALA B 200 -35.847 25.326 1.165 1.00 14.23 O ATOM 6028 CB ALA B 200 -38.119 27.451 0.082 1.00 16.70 C ATOM 6029 HA ALA B 200 -37.352 25.663 -0.800 1.00 0.00 H ATOM 6030 HB1 ALA B 200 -38.644 27.729 -0.832 1.00 0.00 H ATOM 6031 HB2 ALA B 200 -38.715 27.742 0.947 1.00 0.00 H ATOM 6032 HB3 ALA B 200 -37.154 27.957 0.117 1.00 0.00 H ATOM 6033 H ALA B 200 -40.065 25.714 0.151 1.00 0.00 H ATOM 6034 N ASN B 201 -37.671 25.478 2.474 1.00 16.29 N ATOM 6035 CA ASN B 201 -36.984 25.005 3.678 1.00 20.25 C ATOM 6036 C ASN B 201 -36.536 23.539 3.568 1.00 16.38 C ATOM 6037 O ASN B 201 -35.423 23.168 3.970 1.00 15.46 O ATOM 6038 CB ASN B 201 -37.884 25.194 4.895 1.00 15.45 C ATOM 6039 CG ASN B 201 -37.899 26.632 5.389 1.00 18.86 C ATOM 6040 OD1 ASN B 201 -37.062 27.439 4.991 1.00 19.80 O ATOM 6041 ND2 ASN B 201 -38.851 26.955 6.270 1.00 17.58 N ATOM 6042 HA ASN B 201 -36.079 25.603 3.791 1.00 0.00 H ATOM 6043 HB2 ASN B 201 -38.900 24.905 4.627 1.00 0.00 H ATOM 6044 HB3 ASN B 201 -37.525 24.551 5.699 1.00 0.00 H ATOM 6045 HD22 ASN B 201 -39.539 26.238 6.579 1.00 0.00 H ATOM 6046 HD21 ASN B 201 -38.904 27.923 6.647 1.00 0.00 H ATOM 6047 H ASN B 201 -38.665 25.777 2.540 1.00 0.00 H ATOM 6048 N GLU B 202 -37.408 22.705 3.023 1.00 14.82 N ATOM 6049 CA GLU B 202 -37.058 21.309 2.793 1.00 16.16 C ATOM 6050 C GLU B 202 -35.801 21.198 1.951 1.00 18.05 C ATOM 6051 O GLU B 202 -34.834 20.546 2.342 1.00 15.50 O ATOM 6052 CB GLU B 202 -38.210 20.579 2.112 1.00 18.32 C ATOM 6053 CG GLU B 202 -37.926 19.148 1.710 1.00 16.04 C ATOM 6054 CD GLU B 202 -39.003 18.625 0.758 1.00 22.75 C ATOM 6055 OE1 GLU B 202 -40.164 19.047 0.905 1.00 21.09 O ATOM 6056 OE2 GLU B 202 -38.695 17.809 -0.130 1.00 25.66 O ATOM 6057 HA GLU B 202 -36.866 20.844 3.760 1.00 0.00 H ATOM 6058 HB2 GLU B 202 -39.057 20.574 2.798 1.00 0.00 H ATOM 6059 HB3 GLU B 202 -38.476 21.135 1.213 1.00 0.00 H ATOM 6060 HG2 GLU B 202 -36.957 19.102 1.213 1.00 0.00 H ATOM 6061 HG3 GLU B 202 -37.905 18.524 2.603 1.00 0.00 H ATOM 6062 H GLU B 202 -38.352 23.050 2.756 1.00 0.00 H ATOM 6063 N GLN B 203 -35.808 21.845 0.789 1.00 16.04 N ATOM 6064 CA GLN B 203 -34.726 21.665 -0.170 1.00 17.58 C ATOM 6065 C GLN B 203 -33.419 22.274 0.322 1.00 18.11 C ATOM 6066 O GLN B 203 -32.342 21.712 0.102 1.00 18.38 O ATOM 6067 CB GLN B 203 -35.147 22.200 -1.544 1.00 19.65 C ATOM 6068 CG GLN B 203 -36.315 21.381 -2.117 1.00 21.33 C ATOM 6069 CD GLN B 203 -36.874 21.920 -3.423 1.00 23.31 C ATOM 6070 OE1 GLN B 203 -36.503 23.001 -3.882 1.00 22.98 O ATOM 6071 NE2 GLN B 203 -37.780 21.165 -4.022 1.00 24.44 N ATOM 6072 HA GLN B 203 -34.531 20.598 -0.274 1.00 0.00 H ATOM 6073 HB2 GLN B 203 -35.456 23.240 -1.443 1.00 0.00 H ATOM 6074 HB3 GLN B 203 -34.299 22.139 -2.226 1.00 0.00 H ATOM 6075 HG2 GLN B 203 -35.967 20.363 -2.289 1.00 0.00 H ATOM 6076 HG3 GLN B 203 -37.118 21.369 -1.380 1.00 0.00 H ATOM 6077 HE22 GLN B 203 -38.064 20.259 -3.598 1.00 0.00 H ATOM 6078 HE21 GLN B 203 -38.208 21.478 -4.917 1.00 0.00 H ATOM 6079 H GLN B 203 -36.595 22.487 0.562 1.00 0.00 H ATOM 6080 N ALA B 204 -33.512 23.404 1.017 1.00 15.36 N ATOM 6081 CA ALA B 204 -32.315 24.045 1.555 1.00 15.65 C ATOM 6082 C ALA B 204 -31.641 23.138 2.574 1.00 16.80 C ATOM 6083 O ALA B 204 -30.412 22.995 2.587 1.00 16.73 O ATOM 6084 CB ALA B 204 -32.667 25.376 2.188 1.00 18.90 C ATOM 6085 HA ALA B 204 -31.620 24.224 0.734 1.00 0.00 H ATOM 6086 HB1 ALA B 204 -33.112 26.028 1.436 1.00 0.00 H ATOM 6087 HB2 ALA B 204 -33.378 25.215 2.998 1.00 0.00 H ATOM 6088 HB3 ALA B 204 -31.763 25.839 2.583 1.00 0.00 H ATOM 6089 H ALA B 204 -34.445 23.835 1.179 1.00 0.00 H ATOM 6090 N ALA B 205 -32.449 22.528 3.428 1.00 16.65 N ATOM 6091 CA ALA B 205 -31.924 21.613 4.437 1.00 17.13 C ATOM 6092 C ALA B 205 -31.267 20.414 3.763 1.00 18.30 C ATOM 6093 O ALA B 205 -30.127 20.051 4.085 1.00 18.51 O ATOM 6094 CB ALA B 205 -33.040 21.162 5.375 1.00 15.60 C ATOM 6095 HA ALA B 205 -31.171 22.133 5.029 1.00 0.00 H ATOM 6096 HB1 ALA B 205 -33.469 22.032 5.872 1.00 0.00 H ATOM 6097 HB2 ALA B 205 -33.813 20.653 4.800 1.00 0.00 H ATOM 6098 HB3 ALA B 205 -32.632 20.480 6.121 1.00 0.00 H ATOM 6099 H ALA B 205 -33.473 22.704 3.379 1.00 0.00 H ATOM 6100 N LEU B 206 -31.966 19.813 2.804 1.00 14.17 N ATOM 6101 CA LEU B 206 -31.407 18.662 2.092 1.00 15.23 C ATOM 6102 C LEU B 206 -30.090 18.956 1.368 1.00 18.04 C ATOM 6103 O LEU B 206 -29.177 18.137 1.402 1.00 17.90 O ATOM 6104 CB LEU B 206 -32.427 18.076 1.116 1.00 17.76 C ATOM 6105 CG LEU B 206 -33.634 17.427 1.777 1.00 17.73 C ATOM 6106 CD1 LEU B 206 -34.638 16.995 0.729 1.00 22.54 C ATOM 6107 CD2 LEU B 206 -33.208 16.248 2.657 1.00 21.56 C ATOM 6108 HA LEU B 206 -31.174 17.928 2.863 1.00 0.00 H ATOM 6109 HB2 LEU B 206 -32.783 18.880 0.472 1.00 0.00 H ATOM 6110 HB3 LEU B 206 -31.924 17.322 0.510 1.00 0.00 H ATOM 6111 HG LEU B 206 -34.112 18.163 2.423 1.00 0.00 H ATOM 6112 HD21 LEU B 206 -32.701 15.503 2.044 1.00 0.00 H ATOM 6113 HD22 LEU B 206 -32.531 16.602 3.434 1.00 0.00 H ATOM 6114 HD23 LEU B 206 -34.090 15.803 3.117 1.00 0.00 H ATOM 6115 HD11 LEU B 206 -34.967 17.866 0.162 1.00 0.00 H ATOM 6116 HD12 LEU B 206 -34.171 16.277 0.055 1.00 0.00 H ATOM 6117 HD13 LEU B 206 -35.495 16.533 1.218 1.00 0.00 H ATOM 6118 H LEU B 206 -32.914 20.162 2.559 1.00 0.00 H ATOM 6119 N ARG B 207 -30.000 20.103 0.684 1.00 17.44 N ATOM 6120 CA ARG B 207 -28.749 20.500 0.033 1.00 17.14 C ATOM 6121 C ARG B 207 -27.622 20.678 1.046 1.00 18.05 C ATOM 6122 O ARG B 207 -26.491 20.222 0.826 1.00 19.42 O ATOM 6123 CB ARG B 207 -28.915 21.808 -0.766 1.00 20.42 C ATOM 6124 CG ARG B 207 -29.532 21.655 -2.149 1.00 23.58 C ATOM 6125 CD ARG B 207 -29.445 22.968 -2.962 1.00 22.20 C ATOM 6126 NE ARG B 207 -29.991 24.115 -2.234 1.00 21.67 N ATOM 6127 CZ ARG B 207 -31.249 24.541 -2.333 1.00 20.38 C ATOM 6128 NH1 ARG B 207 -32.105 23.920 -3.134 1.00 20.53 N ATOM 6129 NH2 ARG B 207 -31.651 25.587 -1.626 1.00 19.08 N ATOM 6130 HA ARG B 207 -28.490 19.693 -0.653 1.00 0.00 H ATOM 6131 HB2 ARG B 207 -29.550 22.478 -0.186 1.00 0.00 H ATOM 6132 HB3 ARG B 207 -27.929 22.257 -0.885 1.00 0.00 H ATOM 6133 HG2 ARG B 207 -29.002 20.870 -2.688 1.00 0.00 H ATOM 6134 HG3 ARG B 207 -30.580 21.375 -2.040 1.00 0.00 H ATOM 6135 HD2 ARG B 207 -30.005 22.843 -3.889 1.00 0.00 H ATOM 6136 HD3 ARG B 207 -28.399 23.167 -3.195 1.00 0.00 H ATOM 6137 HE ARG B 207 -29.353 24.632 -1.596 1.00 0.00 H ATOM 6138 HH12 ARG B 207 -33.086 24.257 -3.208 1.00 0.00 H ATOM 6139 HH11 ARG B 207 -31.795 23.096 -3.688 1.00 0.00 H ATOM 6140 HH22 ARG B 207 -32.633 25.920 -1.703 1.00 0.00 H ATOM 6141 HH21 ARG B 207 -30.984 26.075 -0.994 1.00 0.00 H ATOM 6142 H ARG B 207 -30.832 20.723 0.613 1.00 0.00 H ATOM 6143 N GLN B 208 -27.911 21.361 2.150 1.00 18.15 N ATOM 6144 CA GLN B 208 -26.863 21.652 3.126 1.00 18.29 C ATOM 6145 C GLN B 208 -26.371 20.375 3.773 1.00 20.22 C ATOM 6146 O GLN B 208 -25.182 20.241 4.081 1.00 19.78 O ATOM 6147 CB GLN B 208 -27.342 22.649 4.186 1.00 22.23 C ATOM 6148 CG GLN B 208 -27.555 24.064 3.647 1.00 24.34 C ATOM 6149 CD GLN B 208 -26.304 24.646 3.002 1.00 24.64 C ATOM 6150 OE1 GLN B 208 -25.576 25.414 3.623 1.00 32.10 O ATOM 6151 NE2 GLN B 208 -26.059 24.290 1.742 1.00 27.97 N ATOM 6152 HA GLN B 208 -26.032 22.114 2.594 1.00 0.00 H ATOM 6153 HB2 GLN B 208 -28.287 22.290 4.594 1.00 0.00 H ATOM 6154 HB3 GLN B 208 -26.597 22.692 4.980 1.00 0.00 H ATOM 6155 HG2 GLN B 208 -28.350 24.037 2.902 1.00 0.00 H ATOM 6156 HG3 GLN B 208 -27.854 24.710 4.473 1.00 0.00 H ATOM 6157 HE22 GLN B 208 -26.702 23.636 1.252 1.00 0.00 H ATOM 6158 HE21 GLN B 208 -25.224 24.666 1.248 1.00 0.00 H ATOM 6159 H GLN B 208 -28.884 21.688 2.319 1.00 0.00 H ATOM 6160 N LEU B 209 -27.290 19.432 3.962 1.00 18.49 N ATOM 6161 CA LEU B 209 -26.964 18.123 4.527 1.00 20.53 C ATOM 6162 C LEU B 209 -26.071 17.321 3.564 1.00 18.94 C ATOM 6163 O LEU B 209 -25.079 16.713 3.974 1.00 20.24 O ATOM 6164 CB LEU B 209 -28.258 17.374 4.854 1.00 16.92 C ATOM 6165 CG LEU B 209 -28.198 15.970 5.449 1.00 19.13 C ATOM 6166 CD1 LEU B 209 -27.239 15.937 6.633 1.00 19.64 C ATOM 6167 CD2 LEU B 209 -29.579 15.526 5.869 1.00 20.26 C ATOM 6168 HA LEU B 209 -26.400 18.257 5.450 1.00 0.00 H ATOM 6169 HB2 LEU B 209 -28.810 17.993 5.562 1.00 0.00 H ATOM 6170 HB3 LEU B 209 -28.821 17.298 3.924 1.00 0.00 H ATOM 6171 HG LEU B 209 -27.828 15.281 4.690 1.00 0.00 H ATOM 6172 HD21 LEU B 209 -29.969 16.216 6.617 1.00 0.00 H ATOM 6173 HD22 LEU B 209 -30.237 15.520 5.000 1.00 0.00 H ATOM 6174 HD23 LEU B 209 -29.524 14.523 6.292 1.00 0.00 H ATOM 6175 HD11 LEU B 209 -26.242 16.225 6.300 1.00 0.00 H ATOM 6176 HD12 LEU B 209 -27.584 16.633 7.397 1.00 0.00 H ATOM 6177 HD13 LEU B 209 -27.208 14.929 7.046 1.00 0.00 H ATOM 6178 H LEU B 209 -28.276 19.633 3.698 1.00 0.00 H ATOM 6179 N ASP B 210 -26.396 17.356 2.275 1.00 18.90 N ATOM 6180 CA ASP B 210 -25.555 16.718 1.265 1.00 20.28 C ATOM 6181 C ASP B 210 -24.158 17.342 1.163 1.00 22.96 C ATOM 6182 O ASP B 210 -23.186 16.651 0.860 1.00 25.14 O ATOM 6183 CB ASP B 210 -26.247 16.723 -0.102 1.00 23.09 C ATOM 6184 CG ASP B 210 -27.236 15.578 -0.257 1.00 22.06 C ATOM 6185 OD1 ASP B 210 -27.360 14.752 0.683 1.00 19.69 O ATOM 6186 OD2 ASP B 210 -27.887 15.497 -1.321 1.00 26.55 O ATOM 6187 HA ASP B 210 -25.414 15.687 1.590 1.00 0.00 H ATOM 6188 HB2 ASP B 210 -26.781 17.666 -0.220 1.00 0.00 H ATOM 6189 HB3 ASP B 210 -25.488 16.637 -0.879 1.00 0.00 H ATOM 6190 H ASP B 210 -27.265 17.846 1.981 1.00 0.00 H ATOM 6191 N ALA B 211 -24.058 18.646 1.405 1.00 20.94 N ATOM 6192 CA ALA B 211 -22.752 19.305 1.411 1.00 23.34 C ATOM 6193 C ALA B 211 -21.930 18.852 2.612 1.00 25.57 C ATOM 6194 O ALA B 211 -20.710 18.704 2.517 1.00 25.26 O ATOM 6195 CB ALA B 211 -22.910 20.815 1.411 1.00 25.74 C ATOM 6196 HA ALA B 211 -22.222 19.019 0.503 1.00 0.00 H ATOM 6197 HB1 ALA B 211 -23.455 21.122 0.518 1.00 0.00 H ATOM 6198 HB2 ALA B 211 -23.463 21.121 2.299 1.00 0.00 H ATOM 6199 HB3 ALA B 211 -21.925 21.282 1.416 1.00 0.00 H ATOM 6200 H ALA B 211 -24.917 19.202 1.592 1.00 0.00 H ATOM 6201 N ALA B 212 -22.603 18.635 3.741 1.00 23.26 N ATOM 6202 CA ALA B 212 -21.936 18.101 4.922 1.00 25.73 C ATOM 6203 C ALA B 212 -21.388 16.695 4.667 1.00 27.90 C ATOM 6204 O ALA B 212 -20.241 16.405 5.011 1.00 26.95 O ATOM 6205 CB ALA B 212 -22.862 18.111 6.125 1.00 24.54 C ATOM 6206 HA ALA B 212 -21.090 18.752 5.142 1.00 0.00 H ATOM 6207 HB1 ALA B 212 -23.174 19.134 6.333 1.00 0.00 H ATOM 6208 HB2 ALA B 212 -23.738 17.499 5.912 1.00 0.00 H ATOM 6209 HB3 ALA B 212 -22.336 17.707 6.990 1.00 0.00 H ATOM 6210 H ALA B 212 -23.620 18.850 3.780 1.00 0.00 H ATOM 6211 N LEU B 213 -22.193 15.827 4.058 1.00 24.33 N ATOM 6212 CA LEU B 213 -21.735 14.466 3.754 1.00 29.63 C ATOM 6213 C LEU B 213 -20.581 14.462 2.759 1.00 33.03 C ATOM 6214 O LEU B 213 -19.675 13.626 2.851 1.00 32.36 O ATOM 6215 CB LEU B 213 -22.879 13.574 3.257 1.00 26.29 C ATOM 6216 CG LEU B 213 -23.796 13.014 4.345 1.00 26.80 C ATOM 6217 CD1 LEU B 213 -25.071 12.427 3.742 1.00 21.92 C ATOM 6218 CD2 LEU B 213 -23.079 11.976 5.199 1.00 24.90 C ATOM 6219 HA LEU B 213 -21.369 14.048 4.692 1.00 0.00 H ATOM 6220 HB2 LEU B 213 -23.490 14.161 2.572 1.00 0.00 H ATOM 6221 HB3 LEU B 213 -22.441 12.732 2.721 1.00 0.00 H ATOM 6222 HG LEU B 213 -24.076 13.845 4.993 1.00 0.00 H ATOM 6223 HD21 LEU B 213 -22.750 11.152 4.566 1.00 0.00 H ATOM 6224 HD22 LEU B 213 -22.215 12.436 5.678 1.00 0.00 H ATOM 6225 HD23 LEU B 213 -23.762 11.600 5.961 1.00 0.00 H ATOM 6226 HD11 LEU B 213 -25.607 13.206 3.200 1.00 0.00 H ATOM 6227 HD12 LEU B 213 -24.810 11.621 3.057 1.00 0.00 H ATOM 6228 HD13 LEU B 213 -25.703 12.037 4.540 1.00 0.00 H ATOM 6229 H LEU B 213 -23.157 16.116 3.795 1.00 0.00 H ATOM 6230 N ALA B 214 -20.610 15.403 1.820 1.00 23.11 N ATOM 6231 CA ALA B 214 -19.532 15.541 0.853 1.00 28.74 C ATOM 6232 C ALA B 214 -18.227 15.935 1.549 1.00 34.51 C ATOM 6233 O ALA B 214 -17.172 15.349 1.295 1.00 33.42 O ATOM 6234 CB ALA B 214 -19.904 16.569 -0.224 1.00 25.23 C ATOM 6235 HA ALA B 214 -19.380 14.576 0.369 1.00 0.00 H ATOM 6236 HB1 ALA B 214 -20.805 16.241 -0.742 1.00 0.00 H ATOM 6237 HB2 ALA B 214 -20.085 17.536 0.246 1.00 0.00 H ATOM 6238 HB3 ALA B 214 -19.085 16.658 -0.938 1.00 0.00 H ATOM 6239 H ALA B 214 -21.420 16.054 1.776 1.00 0.00 H ATOM 6240 N ASP B 215 -18.308 16.926 2.433 1.00 30.77 N ATOM 6241 CA ASP B 215 -17.138 17.401 3.166 1.00 31.55 C ATOM 6242 C ASP B 215 -16.626 16.376 4.183 1.00 36.09 C ATOM 6243 O ASP B 215 -15.462 16.412 4.580 1.00 37.11 O ATOM 6244 CB ASP B 215 -17.435 18.742 3.854 1.00 31.32 C ATOM 6245 CG ASP B 215 -17.704 19.869 2.859 1.00 37.76 C ATOM 6246 OD1 ASP B 215 -17.560 19.640 1.633 1.00 36.42 O ATOM 6247 OD2 ASP B 215 -18.057 20.989 3.304 1.00 33.38 O ATOM 6248 HA ASP B 215 -16.344 17.547 2.433 1.00 0.00 H ATOM 6249 HB2 ASP B 215 -18.312 18.621 4.490 1.00 0.00 H ATOM 6250 HB3 ASP B 215 -16.577 19.016 4.468 1.00 0.00 H ATOM 6251 H ASP B 215 -19.230 17.375 2.607 1.00 0.00 H ATOM 6252 N THR B 216 -17.494 15.463 4.605 1.00 33.07 N ATOM 6253 CA THR B 216 -17.088 14.430 5.553 1.00 36.42 C ATOM 6254 C THR B 216 -16.247 13.373 4.850 1.00 41.84 C ATOM 6255 O THR B 216 -15.422 12.703 5.470 1.00 44.58 O ATOM 6256 CB THR B 216 -18.296 13.769 6.216 1.00 34.81 C ATOM 6257 OG1 THR B 216 -19.015 14.755 6.965 1.00 33.72 O ATOM 6258 CG2 THR B 216 -17.853 12.644 7.153 1.00 37.31 C ATOM 6259 HA THR B 216 -16.495 14.911 6.331 1.00 0.00 H ATOM 6260 HB THR B 216 -18.934 13.343 5.441 1.00 0.00 H ATOM 6261 HG1 THR B 216 -19.320 15.473 6.356 1.00 0.00 H ATOM 6262 HG23 THR B 216 -17.306 11.893 6.584 1.00 0.00 H ATOM 6263 HG21 THR B 216 -17.208 13.053 7.931 1.00 0.00 H ATOM 6264 HG22 THR B 216 -18.731 12.187 7.610 1.00 0.00 H ATOM 6265 H THR B 216 -18.473 15.485 4.256 1.00 0.00 H ATOM 6266 N ASP B 217 -16.464 13.235 3.547 1.00 41.27 N ATOM 6267 CA ASP B 217 -15.658 12.348 2.726 1.00 44.54 C ATOM 6268 C ASP B 217 -14.293 12.984 2.500 1.00 45.97 C ATOM 6269 O ASP B 217 -13.264 12.307 2.515 1.00 45.28 O ATOM 6270 CB ASP B 217 -16.355 12.077 1.390 1.00 40.60 C ATOM 6271 CG ASP B 217 -17.161 10.789 1.399 1.00 49.74 C ATOM 6272 OD1 ASP B 217 -16.694 9.797 2.007 1.00 50.54 O ATOM 6273 OD2 ASP B 217 -18.255 10.764 0.788 1.00 48.76 O ATOM 6274 HA ASP B 217 -15.531 11.394 3.237 1.00 0.00 H ATOM 6275 HB2 ASP B 217 -17.027 12.907 1.172 1.00 0.00 H ATOM 6276 HB3 ASP B 217 -15.598 12.009 0.609 1.00 0.00 H ATOM 6277 H ASP B 217 -17.232 13.777 3.102 1.00 0.00 H ATOM 6278 N ASN B 218 -14.302 14.296 2.297 1.00 45.97 N ATOM 6279 CA ASN B 218 -13.084 15.072 2.105 1.00 45.76 C ATOM 6280 C ASN B 218 -12.222 15.082 3.366 1.00 48.10 C ATOM 6281 O ASN B 218 -10.996 15.029 3.294 1.00 51.33 O ATOM 6282 CB ASN B 218 -13.452 16.500 1.703 1.00 47.54 C ATOM 6283 CG ASN B 218 -12.256 17.315 1.261 1.00 52.21 C ATOM 6284 OD1 ASN B 218 -11.106 16.923 1.461 1.00 58.09 O ATOM 6285 ND2 ASN B 218 -12.523 18.463 0.654 1.00 53.34 N ATOM 6286 HA ASN B 218 -12.499 14.606 1.312 1.00 0.00 H ATOM 6287 HB2 ASN B 218 -14.167 16.457 0.881 1.00 0.00 H ATOM 6288 HB3 ASN B 218 -13.913 16.994 2.558 1.00 0.00 H ATOM 6289 HD22 ASN B 218 -13.510 18.756 0.506 1.00 0.00 H ATOM 6290 HD21 ASN B 218 -11.746 19.071 0.326 1.00 0.00 H ATOM 6291 H ASN B 218 -15.217 14.790 2.274 1.00 0.00 H ATOM 6292 N LEU B 219 -12.877 15.141 4.519 1.00 43.80 N ATOM 6293 CA LEU B 219 -12.195 15.172 5.810 1.00 46.19 C ATOM 6294 C LEU B 219 -11.403 13.887 6.057 1.00 47.10 C ATOM 6295 O LEU B 219 -10.387 13.899 6.744 1.00 47.62 O ATOM 6296 CB LEU B 219 -13.211 15.402 6.936 1.00 42.79 C ATOM 6297 CG LEU B 219 -12.676 15.674 8.341 1.00 43.80 C ATOM 6298 CD1 LEU B 219 -11.646 16.795 8.307 1.00 43.68 C ATOM 6299 CD2 LEU B 219 -13.819 16.022 9.281 1.00 37.56 C ATOM 6300 HA LEU B 219 -11.485 15.999 5.797 1.00 0.00 H ATOM 6301 HB2 LEU B 219 -13.823 16.258 6.651 1.00 0.00 H ATOM 6302 HB3 LEU B 219 -13.838 14.512 6.994 1.00 0.00 H ATOM 6303 HG LEU B 219 -12.188 14.772 8.712 1.00 0.00 H ATOM 6304 HD21 LEU B 219 -14.330 16.912 8.915 1.00 0.00 H ATOM 6305 HD22 LEU B 219 -14.521 15.189 9.321 1.00 0.00 H ATOM 6306 HD23 LEU B 219 -13.422 16.213 10.278 1.00 0.00 H ATOM 6307 HD11 LEU B 219 -10.818 16.506 7.660 1.00 0.00 H ATOM 6308 HD12 LEU B 219 -12.111 17.702 7.921 1.00 0.00 H ATOM 6309 HD13 LEU B 219 -11.275 16.976 9.316 1.00 0.00 H ATOM 6310 H LEU B 219 -13.917 15.166 4.502 1.00 0.00 H ATOM 6311 N LYS B 220 -11.876 12.780 5.496 1.00 48.42 N ATOM 6312 CA LYS B 220 -11.165 11.513 5.606 1.00 47.08 C ATOM 6313 C LYS B 220 -9.889 11.548 4.769 1.00 53.24 C ATOM 6314 O LYS B 220 -8.896 10.905 5.101 1.00 52.68 O ATOM 6315 CB LYS B 220 -12.063 10.352 5.179 1.00 51.16 C ATOM 6316 CG LYS B 220 -13.347 10.248 5.990 1.00 48.06 C ATOM 6317 CD LYS B 220 -13.942 8.848 5.958 1.00 48.19 C ATOM 6318 CE LYS B 220 -14.569 8.529 4.614 1.00 48.34 C ATOM 6319 NZ LYS B 220 -15.346 7.259 4.672 1.00 48.90 N ATOM 6320 HA LYS B 220 -10.888 11.359 6.649 1.00 0.00 H ATOM 6321 HB2 LYS B 220 -12.327 10.487 4.130 1.00 0.00 H ATOM 6322 HB3 LYS B 220 -11.505 9.423 5.295 1.00 0.00 H ATOM 6323 HG2 LYS B 220 -13.130 10.513 7.025 1.00 0.00 H ATOM 6324 HG3 LYS B 220 -14.076 10.948 5.582 1.00 0.00 H ATOM 6325 HD2 LYS B 220 -13.152 8.125 6.159 1.00 0.00 H ATOM 6326 HD3 LYS B 220 -14.707 8.772 6.731 1.00 0.00 H ATOM 6327 HE2 LYS B 220 -13.781 8.431 3.868 1.00 0.00 H ATOM 6328 HE3 LYS B 220 -15.237 9.342 4.330 1.00 0.00 H ATOM 6329 HZ1 LYS B 220 -14.712 6.478 4.938 1.00 0.00 H ATOM 6330 HZ2 LYS B 220 -16.103 7.349 5.380 1.00 0.00 H ATOM 6331 HZ3 LYS B 220 -15.763 7.066 3.739 1.00 0.00 H ATOM 6332 H LYS B 220 -12.771 12.818 4.968 1.00 0.00 H ATOM 6333 N ARG B 221 -9.929 12.313 3.683 1.00 52.52 N ATOM 6334 CA ARG B 221 -8.769 12.510 2.823 1.00 55.25 C ATOM 6335 C ARG B 221 -7.707 13.344 3.543 1.00 54.41 C ATOM 6336 O ARG B 221 -6.505 13.132 3.372 1.00 54.10 O ATOM 6337 CB ARG B 221 -9.209 13.203 1.529 1.00 52.89 C ATOM 6338 CG ARG B 221 -8.100 13.509 0.545 1.00 56.98 C ATOM 6339 CD ARG B 221 -7.591 12.248 -0.122 1.00 62.18 C ATOM 6340 NE ARG B 221 -6.712 12.552 -1.247 1.00 65.19 N ATOM 6341 CZ ARG B 221 -5.419 12.836 -1.129 1.00 67.01 C ATOM 6342 NH1 ARG B 221 -4.851 12.861 0.070 1.00 60.06 N ATOM 6343 NH2 ARG B 221 -4.696 13.099 -2.211 1.00 68.03 N ATOM 6344 HA ARG B 221 -8.332 11.541 2.580 1.00 0.00 H ATOM 6345 HB2 ARG B 221 -9.932 12.557 1.031 1.00 0.00 H ATOM 6346 HB3 ARG B 221 -9.689 14.144 1.798 1.00 0.00 H ATOM 6347 HG2 ARG B 221 -8.480 14.186 -0.220 1.00 0.00 H ATOM 6348 HG3 ARG B 221 -7.277 13.987 1.075 1.00 0.00 H ATOM 6349 HD2 ARG B 221 -8.442 11.671 -0.484 1.00 0.00 H ATOM 6350 HD3 ARG B 221 -7.038 11.659 0.610 1.00 0.00 H ATOM 6351 HE ARG B 221 -7.124 12.546 -2.202 1.00 0.00 H ATOM 6352 HH12 ARG B 221 -3.839 13.083 0.162 1.00 0.00 H ATOM 6353 HH11 ARG B 221 -5.418 12.658 0.918 1.00 0.00 H ATOM 6354 HH22 ARG B 221 -3.684 13.321 -2.119 1.00 0.00 H ATOM 6355 HH21 ARG B 221 -5.141 13.083 -3.151 1.00 0.00 H ATOM 6356 H ARG B 221 -10.821 12.789 3.438 1.00 0.00 H ATOM 6357 N GLN B 222 -8.166 14.284 4.361 1.00 52.75 N ATOM 6358 CA GLN B 222 -7.283 15.210 5.058 1.00 52.84 C ATOM 6359 C GLN B 222 -6.815 14.639 6.401 1.00 54.18 C ATOM 6360 O GLN B 222 -5.768 15.030 6.916 1.00 53.62 O ATOM 6361 CB GLN B 222 -7.990 16.556 5.263 1.00 54.86 C ATOM 6362 CG GLN B 222 -8.838 17.004 4.070 1.00 53.42 C ATOM 6363 CD GLN B 222 -9.635 18.274 4.347 1.00 55.31 C ATOM 6364 OE1 GLN B 222 -10.864 18.289 4.240 1.00 52.70 O ATOM 6365 NE2 GLN B 222 -8.935 19.345 4.707 1.00 55.56 N ATOM 6366 HA GLN B 222 -6.398 15.362 4.440 1.00 0.00 H ATOM 6367 HB2 GLN B 222 -8.640 16.472 6.134 1.00 0.00 H ATOM 6368 HB3 GLN B 222 -7.232 17.317 5.449 1.00 0.00 H ATOM 6369 HG2 GLN B 222 -8.177 17.187 3.223 1.00 0.00 H ATOM 6370 HG3 GLN B 222 -9.535 16.204 3.819 1.00 0.00 H ATOM 6371 HE22 GLN B 222 -7.900 19.287 4.785 1.00 0.00 H ATOM 6372 HE21 GLN B 222 -9.423 20.241 4.911 1.00 0.00 H ATOM 6373 H GLN B 222 -9.192 14.362 4.509 1.00 0.00 H ATOM 6374 N LEU B 223 -7.593 13.716 6.963 1.00 53.45 N ATOM 6375 CA LEU B 223 -7.211 13.033 8.197 1.00 50.65 C ATOM 6376 C LEU B 223 -7.204 11.523 8.014 1.00 53.95 C ATOM 6377 O LEU B 223 -7.937 10.812 8.706 1.00 51.48 O ATOM 6378 CB LEU B 223 -8.166 13.384 9.337 1.00 54.62 C ATOM 6379 CG LEU B 223 -8.129 14.784 9.945 1.00 53.13 C ATOM 6380 CD1 LEU B 223 -9.118 14.856 11.096 1.00 53.80 C ATOM 6381 CD2 LEU B 223 -6.729 15.137 10.417 1.00 53.16 C ATOM 6382 HA LEU B 223 -6.205 13.370 8.447 1.00 0.00 H ATOM 6383 HB2 LEU B 223 -9.178 13.227 8.963 1.00 0.00 H ATOM 6384 HB3 LEU B 223 -7.966 12.681 10.146 1.00 0.00 H ATOM 6385 HG LEU B 223 -8.410 15.510 9.182 1.00 0.00 H ATOM 6386 HD21 LEU B 223 -6.410 14.419 11.173 1.00 0.00 H ATOM 6387 HD22 LEU B 223 -6.043 15.105 9.571 1.00 0.00 H ATOM 6388 HD23 LEU B 223 -6.733 16.139 10.845 1.00 0.00 H ATOM 6389 HD11 LEU B 223 -10.121 14.644 10.725 1.00 0.00 H ATOM 6390 HD12 LEU B 223 -8.846 14.121 11.853 1.00 0.00 H ATOM 6391 HD13 LEU B 223 -9.094 15.855 11.532 1.00 0.00 H ATOM 6392 H LEU B 223 -8.498 13.474 6.511 1.00 0.00 H ATOM 6393 N PRO B 224 -6.362 11.026 7.093 1.00 57.17 N ATOM 6394 CA PRO B 224 -6.307 9.597 6.759 1.00 55.04 C ATOM 6395 C PRO B 224 -6.060 8.702 7.972 1.00 55.14 C ATOM 6396 O PRO B 224 -6.388 7.517 7.928 1.00 55.09 O ATOM 6397 CB PRO B 224 -5.124 9.506 5.784 1.00 54.51 C ATOM 6398 CG PRO B 224 -4.329 10.755 6.015 1.00 54.63 C ATOM 6399 CD PRO B 224 -5.337 11.797 6.369 1.00 55.34 C ATOM 6400 HA PRO B 224 -7.255 9.249 6.349 1.00 0.00 H ATOM 6401 HD3 PRO B 224 -4.900 12.566 7.006 1.00 0.00 H ATOM 6402 HD2 PRO B 224 -5.753 12.261 5.475 1.00 0.00 H ATOM 6403 HG3 PRO B 224 -3.788 11.037 5.112 1.00 0.00 H ATOM 6404 HG2 PRO B 224 -3.622 10.613 6.832 1.00 0.00 H ATOM 6405 HB2 PRO B 224 -4.520 8.623 5.996 1.00 0.00 H ATOM 6406 HB3 PRO B 224 -5.479 9.463 4.754 1.00 0.00 H ATOM 6407 N SER B 225 -5.491 9.258 9.037 1.00 53.15 N ATOM 6408 CA SER B 225 -5.214 8.472 10.235 1.00 54.10 C ATOM 6409 C SER B 225 -6.493 8.094 10.984 1.00 56.13 C ATOM 6410 O SER B 225 -6.531 7.090 11.700 1.00 52.29 O ATOM 6411 CB SER B 225 -4.244 9.215 11.163 1.00 55.82 C ATOM 6412 OG SER B 225 -4.706 10.522 11.468 1.00 56.23 O ATOM 6413 HA SER B 225 -4.743 7.545 9.908 1.00 0.00 H ATOM 6414 HB2 SER B 225 -3.273 9.289 10.673 1.00 0.00 H ATOM 6415 HB3 SER B 225 -4.140 8.651 12.090 1.00 0.00 H ATOM 6416 HG SER B 225 -4.056 10.969 12.067 1.00 0.00 H ATOM 6417 H SER B 225 -5.240 10.267 9.016 1.00 0.00 H ATOM 6418 N GLU B 226 -7.543 8.891 10.800 1.00 56.53 N ATOM 6419 CA GLU B 226 -8.768 8.740 11.586 1.00 53.46 C ATOM 6420 C GLU B 226 -9.956 8.222 10.780 1.00 51.58 C ATOM 6421 O GLU B 226 -11.105 8.514 11.107 1.00 51.19 O ATOM 6422 CB GLU B 226 -9.133 10.072 12.241 1.00 51.70 C ATOM 6423 CG GLU B 226 -8.113 10.560 13.253 1.00 56.02 C ATOM 6424 CD GLU B 226 -8.069 9.690 14.494 1.00 60.73 C ATOM 6425 OE1 GLU B 226 -9.044 9.719 15.276 1.00 60.36 O ATOM 6426 OE2 GLU B 226 -7.062 8.976 14.689 1.00 63.35 O ATOM 6427 HA GLU B 226 -8.554 7.985 12.343 1.00 0.00 H ATOM 6428 HB2 GLU B 226 -9.228 10.825 11.459 1.00 0.00 H ATOM 6429 HB3 GLU B 226 -10.091 9.954 12.748 1.00 0.00 H ATOM 6430 HG2 GLU B 226 -7.128 10.556 12.787 1.00 0.00 H ATOM 6431 HG3 GLU B 226 -8.370 11.577 13.547 1.00 0.00 H ATOM 6432 H GLU B 226 -7.492 9.640 10.080 1.00 0.00 H ATOM 6433 N ASP B 227 -9.680 7.440 9.744 1.00 47.60 N ATOM 6434 CA ASP B 227 -10.724 6.966 8.845 1.00 49.94 C ATOM 6435 C ASP B 227 -11.834 6.180 9.550 1.00 51.40 C ATOM 6436 O ASP B 227 -13.010 6.323 9.212 1.00 49.21 O ATOM 6437 CB ASP B 227 -10.122 6.132 7.717 1.00 51.33 C ATOM 6438 CG ASP B 227 -11.165 5.654 6.729 1.00 54.88 C ATOM 6439 OD1 ASP B 227 -11.949 4.745 7.085 1.00 55.06 O ATOM 6440 OD2 ASP B 227 -11.199 6.189 5.597 1.00 54.52 O ATOM 6441 HA ASP B 227 -11.194 7.859 8.433 1.00 0.00 H ATOM 6442 HB2 ASP B 227 -9.389 6.739 7.186 1.00 0.00 H ATOM 6443 HB3 ASP B 227 -9.626 5.263 8.150 1.00 0.00 H ATOM 6444 H ASP B 227 -8.694 7.159 9.569 1.00 0.00 H ATOM 6445 N ALA B 228 -11.466 5.347 10.517 1.00 50.40 N ATOM 6446 CA ALA B 228 -12.460 4.575 11.256 1.00 47.67 C ATOM 6447 C ALA B 228 -13.470 5.492 11.947 1.00 47.13 C ATOM 6448 O ALA B 228 -14.683 5.293 11.845 1.00 41.71 O ATOM 6449 CB ALA B 228 -11.784 3.673 12.271 1.00 49.33 C ATOM 6450 HA ALA B 228 -13.002 3.955 10.542 1.00 0.00 H ATOM 6451 HB1 ALA B 228 -11.113 2.986 11.755 1.00 0.00 H ATOM 6452 HB2 ALA B 228 -11.214 4.281 12.973 1.00 0.00 H ATOM 6453 HB3 ALA B 228 -12.541 3.106 12.812 1.00 0.00 H ATOM 6454 H ALA B 228 -10.458 5.244 10.750 1.00 0.00 H ATOM 6455 N ARG B 229 -12.960 6.503 12.642 1.00 45.72 N ATOM 6456 CA ARG B 229 -13.802 7.398 13.426 1.00 47.91 C ATOM 6457 C ARG B 229 -14.656 8.316 12.545 1.00 43.53 C ATOM 6458 O ARG B 229 -15.786 8.654 12.899 1.00 43.44 O ATOM 6459 CB ARG B 229 -12.943 8.232 14.374 1.00 48.91 C ATOM 6460 CG ARG B 229 -13.725 8.899 15.488 1.00 49.94 C ATOM 6461 CD ARG B 229 -14.275 7.873 16.464 1.00 52.60 C ATOM 6462 NE ARG B 229 -13.216 7.068 17.064 1.00 51.77 N ATOM 6463 CZ ARG B 229 -13.421 6.136 17.989 1.00 55.68 C ATOM 6464 NH1 ARG B 229 -14.648 5.889 18.429 1.00 55.20 N ATOM 6465 NH2 ARG B 229 -12.396 5.452 18.479 1.00 61.72 N ATOM 6466 HA ARG B 229 -14.486 6.775 14.003 1.00 0.00 H ATOM 6467 HB2 ARG B 229 -12.195 7.579 14.823 1.00 0.00 H ATOM 6468 HB3 ARG B 229 -12.444 9.008 13.793 1.00 0.00 H ATOM 6469 HG2 ARG B 229 -13.067 9.583 16.024 1.00 0.00 H ATOM 6470 HG3 ARG B 229 -14.554 9.458 15.055 1.00 0.00 H ATOM 6471 HD2 ARG B 229 -14.961 7.213 15.933 1.00 0.00 H ATOM 6472 HD3 ARG B 229 -14.814 8.393 17.256 1.00 0.00 H ATOM 6473 HE ARG B 229 -12.239 7.234 16.748 1.00 0.00 H ATOM 6474 HH12 ARG B 229 -14.804 5.159 19.153 1.00 0.00 H ATOM 6475 HH11 ARG B 229 -15.454 6.426 18.050 1.00 0.00 H ATOM 6476 HH22 ARG B 229 -12.556 4.723 19.203 1.00 0.00 H ATOM 6477 HH21 ARG B 229 -11.432 5.645 18.139 1.00 0.00 H ATOM 6478 H ARG B 229 -11.932 6.660 12.626 1.00 0.00 H ATOM 6479 N LEU B 230 -14.108 8.720 11.404 1.00 43.49 N ATOM 6480 CA LEU B 230 -14.843 9.553 10.461 1.00 39.33 C ATOM 6481 C LEU B 230 -15.971 8.765 9.800 1.00 43.13 C ATOM 6482 O LEU B 230 -17.032 9.316 9.507 1.00 36.09 O ATOM 6483 CB LEU B 230 -13.904 10.137 9.406 1.00 39.94 C ATOM 6484 CG LEU B 230 -12.975 11.237 9.917 1.00 43.95 C ATOM 6485 CD1 LEU B 230 -11.904 11.555 8.896 1.00 45.49 C ATOM 6486 CD2 LEU B 230 -13.769 12.486 10.276 1.00 40.13 C ATOM 6487 HA LEU B 230 -15.287 10.378 11.018 1.00 0.00 H ATOM 6488 HB2 LEU B 230 -13.289 9.328 9.013 1.00 0.00 H ATOM 6489 HB3 LEU B 230 -14.512 10.552 8.602 1.00 0.00 H ATOM 6490 HG LEU B 230 -12.483 10.875 10.820 1.00 0.00 H ATOM 6491 HD21 LEU B 230 -14.293 12.848 9.392 1.00 0.00 H ATOM 6492 HD22 LEU B 230 -14.492 12.244 11.055 1.00 0.00 H ATOM 6493 HD23 LEU B 230 -13.088 13.256 10.638 1.00 0.00 H ATOM 6494 HD11 LEU B 230 -11.314 10.660 8.699 1.00 0.00 H ATOM 6495 HD12 LEU B 230 -12.373 11.892 7.972 1.00 0.00 H ATOM 6496 HD13 LEU B 230 -11.256 12.341 9.284 1.00 0.00 H ATOM 6497 H LEU B 230 -13.133 8.436 11.179 1.00 0.00 H ATOM 6498 N GLN B 231 -15.734 7.476 9.570 1.00 40.73 N ATOM 6499 CA GLN B 231 -16.760 6.592 9.025 1.00 42.87 C ATOM 6500 C GLN B 231 -17.925 6.456 10.004 1.00 40.79 C ATOM 6501 O GLN B 231 -19.091 6.399 9.607 1.00 38.62 O ATOM 6502 CB GLN B 231 -16.179 5.209 8.739 1.00 43.26 C ATOM 6503 CG GLN B 231 -17.192 4.253 8.154 1.00 44.84 C ATOM 6504 CD GLN B 231 -17.707 4.737 6.819 1.00 45.16 C ATOM 6505 OE1 GLN B 231 -16.928 5.144 5.957 1.00 46.22 O ATOM 6506 NE2 GLN B 231 -19.022 4.700 6.638 1.00 45.19 N ATOM 6507 HA GLN B 231 -17.121 7.030 8.094 1.00 0.00 H ATOM 6508 HB2 GLN B 231 -15.355 5.317 8.034 1.00 0.00 H ATOM 6509 HB3 GLN B 231 -15.804 4.790 9.673 1.00 0.00 H ATOM 6510 HG2 GLN B 231 -16.723 3.278 8.020 1.00 0.00 H ATOM 6511 HG3 GLN B 231 -18.030 4.160 8.844 1.00 0.00 H ATOM 6512 HE22 GLN B 231 -19.641 4.348 7.395 1.00 0.00 H ATOM 6513 HE21 GLN B 231 -19.432 5.023 5.739 1.00 0.00 H ATOM 6514 H GLN B 231 -14.793 7.088 9.784 1.00 0.00 H ATOM 6515 N GLN B 232 -17.589 6.381 11.283 1.00 37.83 N ATOM 6516 CA GLN B 232 -18.568 6.329 12.359 1.00 39.35 C ATOM 6517 C GLN B 232 -19.402 7.604 12.331 1.00 38.44 C ATOM 6518 O GLN B 232 -20.627 7.573 12.427 1.00 36.78 O ATOM 6519 CB GLN B 232 -17.826 6.215 13.688 1.00 42.19 C ATOM 6520 CG GLN B 232 -18.680 6.169 14.941 1.00 45.68 C ATOM 6521 CD GLN B 232 -17.821 6.110 16.197 1.00 51.64 C ATOM 6522 OE1 GLN B 232 -16.695 5.610 16.165 1.00 51.24 O ATOM 6523 NE2 GLN B 232 -18.345 6.628 17.305 1.00 54.08 N ATOM 6524 HA GLN B 232 -19.227 5.469 12.237 1.00 0.00 H ATOM 6525 HB2 GLN B 232 -17.232 5.301 13.658 1.00 0.00 H ATOM 6526 HB3 GLN B 232 -17.162 7.076 13.771 1.00 0.00 H ATOM 6527 HG2 GLN B 232 -19.303 7.062 14.979 1.00 0.00 H ATOM 6528 HG3 GLN B 232 -19.317 5.285 14.904 1.00 0.00 H ATOM 6529 HE22 GLN B 232 -19.300 7.040 17.285 1.00 0.00 H ATOM 6530 HE21 GLN B 232 -17.800 6.621 18.191 1.00 0.00 H ATOM 6531 H GLN B 232 -16.579 6.358 11.530 1.00 0.00 H ATOM 6532 N PHE B 233 -18.710 8.729 12.204 1.00 39.25 N ATOM 6533 CA PHE B 233 -19.347 10.024 12.080 1.00 34.02 C ATOM 6534 C PHE B 233 -20.234 10.054 10.838 1.00 33.30 C ATOM 6535 O PHE B 233 -21.395 10.461 10.907 1.00 31.83 O ATOM 6536 CB PHE B 233 -18.273 11.105 12.008 1.00 34.88 C ATOM 6537 CG PHE B 233 -18.808 12.487 11.815 1.00 32.93 C ATOM 6538 CD1 PHE B 233 -19.359 13.185 12.876 1.00 33.50 C ATOM 6539 CD2 PHE B 233 -18.742 13.097 10.575 1.00 29.64 C ATOM 6540 CE1 PHE B 233 -19.845 14.464 12.698 1.00 35.79 C ATOM 6541 CE2 PHE B 233 -19.224 14.373 10.393 1.00 32.41 C ATOM 6542 CZ PHE B 233 -19.776 15.059 11.455 1.00 32.70 C ATOM 6543 HA PHE B 233 -19.978 10.210 12.949 1.00 0.00 H ATOM 6544 HB2 PHE B 233 -17.704 11.085 12.938 1.00 0.00 H ATOM 6545 HB3 PHE B 233 -17.611 10.875 11.173 1.00 0.00 H ATOM 6546 HD2 PHE B 233 -18.304 12.561 9.733 1.00 0.00 H ATOM 6547 HE2 PHE B 233 -19.170 14.841 9.410 1.00 0.00 H ATOM 6548 HZ PHE B 233 -20.157 16.070 11.312 1.00 0.00 H ATOM 6549 HE1 PHE B 233 -20.283 15.003 13.538 1.00 0.00 H ATOM 6550 HD1 PHE B 233 -19.409 12.720 13.861 1.00 0.00 H ATOM 6551 H PHE B 233 -17.671 8.679 12.193 1.00 0.00 H ATOM 6552 N GLU B 234 -19.694 9.590 9.711 1.00 32.11 N ATOM 6553 CA GLU B 234 -20.414 9.614 8.440 1.00 31.05 C ATOM 6554 C GLU B 234 -21.659 8.732 8.437 1.00 30.42 C ATOM 6555 O GLU B 234 -22.705 9.115 7.896 1.00 26.01 O ATOM 6556 CB GLU B 234 -19.498 9.219 7.284 1.00 36.89 C ATOM 6557 CG GLU B 234 -20.214 9.192 5.937 1.00 37.10 C ATOM 6558 CD GLU B 234 -19.299 9.525 4.782 1.00 43.01 C ATOM 6559 OE1 GLU B 234 -18.259 8.847 4.639 1.00 47.80 O ATOM 6560 OE2 GLU B 234 -19.621 10.466 4.019 1.00 44.02 O ATOM 6561 HA GLU B 234 -20.748 10.643 8.306 1.00 0.00 H ATOM 6562 HB2 GLU B 234 -18.680 9.937 7.228 1.00 0.00 H ATOM 6563 HB3 GLU B 234 -19.095 8.226 7.483 1.00 0.00 H ATOM 6564 HG2 GLU B 234 -20.625 8.195 5.780 1.00 0.00 H ATOM 6565 HG3 GLU B 234 -21.026 9.919 5.959 1.00 0.00 H ATOM 6566 H GLU B 234 -18.731 9.199 9.737 1.00 0.00 H ATOM 6567 N ASN B 235 -21.547 7.551 9.040 1.00 30.03 N ATOM 6568 CA ASN B 235 -22.695 6.668 9.180 1.00 30.87 C ATOM 6569 C ASN B 235 -23.848 7.368 9.889 1.00 28.77 C ATOM 6570 O ASN B 235 -25.007 7.247 9.480 1.00 25.92 O ATOM 6571 CB ASN B 235 -22.307 5.380 9.918 1.00 32.91 C ATOM 6572 CG ASN B 235 -21.487 4.441 9.050 1.00 38.55 C ATOM 6573 OD1 ASN B 235 -21.551 4.510 7.819 1.00 35.58 O ATOM 6574 ND2 ASN B 235 -20.707 3.564 9.685 1.00 35.91 N ATOM 6575 HA ASN B 235 -23.031 6.401 8.178 1.00 0.00 H ATOM 6576 HB2 ASN B 235 -21.722 5.644 10.799 1.00 0.00 H ATOM 6577 HB3 ASN B 235 -23.217 4.866 10.228 1.00 0.00 H ATOM 6578 HD22 ASN B 235 -20.687 3.544 10.725 1.00 0.00 H ATOM 6579 HD21 ASN B 235 -20.120 2.901 9.140 1.00 0.00 H ATOM 6580 H ASN B 235 -20.624 7.254 9.417 1.00 0.00 H ATOM 6581 N ALA B 236 -23.515 8.097 10.950 1.00 25.94 N ATOM 6582 CA ALA B 236 -24.514 8.781 11.756 1.00 27.23 C ATOM 6583 C ALA B 236 -25.181 9.905 10.968 1.00 22.54 C ATOM 6584 O ALA B 236 -26.378 10.148 11.122 1.00 20.65 O ATOM 6585 CB ALA B 236 -23.891 9.321 13.033 1.00 28.86 C ATOM 6586 HA ALA B 236 -25.283 8.057 12.025 1.00 0.00 H ATOM 6587 HB1 ALA B 236 -23.475 8.495 13.610 1.00 0.00 H ATOM 6588 HB2 ALA B 236 -23.098 10.025 12.780 1.00 0.00 H ATOM 6589 HB3 ALA B 236 -24.655 9.829 13.622 1.00 0.00 H ATOM 6590 H ALA B 236 -22.512 8.180 11.211 1.00 0.00 H ATOM 6591 N VAL B 237 -24.411 10.592 10.132 1.00 21.96 N ATOM 6592 CA VAL B 237 -24.983 11.663 9.320 1.00 20.90 C ATOM 6593 C VAL B 237 -25.854 11.109 8.194 1.00 23.43 C ATOM 6594 O VAL B 237 -26.885 11.691 7.851 1.00 21.72 O ATOM 6595 CB VAL B 237 -23.919 12.612 8.757 1.00 19.34 C ATOM 6596 CG1 VAL B 237 -24.574 13.697 7.916 1.00 19.15 C ATOM 6597 CG2 VAL B 237 -23.113 13.250 9.904 1.00 23.65 C ATOM 6598 HA VAL B 237 -25.614 12.246 9.991 1.00 0.00 H ATOM 6599 HB VAL B 237 -23.240 12.038 8.126 1.00 0.00 H ATOM 6600 HG11 VAL B 237 -25.116 13.237 7.089 1.00 0.00 H ATOM 6601 HG12 VAL B 237 -25.268 14.265 8.535 1.00 0.00 H ATOM 6602 HG13 VAL B 237 -23.806 14.363 7.523 1.00 0.00 H ATOM 6603 HG21 VAL B 237 -23.787 13.812 10.551 1.00 0.00 H ATOM 6604 HG22 VAL B 237 -22.623 12.466 10.482 1.00 0.00 H ATOM 6605 HG23 VAL B 237 -22.361 13.921 9.489 1.00 0.00 H ATOM 6606 H VAL B 237 -23.399 10.367 10.055 1.00 0.00 H ATOM 6607 N LEU B 238 -25.450 9.978 7.627 1.00 20.41 N ATOM 6608 CA LEU B 238 -26.291 9.305 6.646 1.00 22.53 C ATOM 6609 C LEU B 238 -27.620 8.869 7.258 1.00 21.23 C ATOM 6610 O LEU B 238 -28.666 9.006 6.630 1.00 21.64 O ATOM 6611 CB LEU B 238 -25.565 8.107 6.036 1.00 25.71 C ATOM 6612 CG LEU B 238 -24.416 8.457 5.093 1.00 23.94 C ATOM 6613 CD1 LEU B 238 -23.575 7.217 4.795 1.00 28.24 C ATOM 6614 CD2 LEU B 238 -24.942 9.072 3.807 1.00 23.61 C ATOM 6615 HA LEU B 238 -26.505 10.020 5.852 1.00 0.00 H ATOM 6616 HB2 LEU B 238 -25.162 7.505 6.851 1.00 0.00 H ATOM 6617 HB3 LEU B 238 -26.293 7.519 5.478 1.00 0.00 H ATOM 6618 HG LEU B 238 -23.781 9.194 5.584 1.00 0.00 H ATOM 6619 HD21 LEU B 238 -25.602 8.361 3.309 1.00 0.00 H ATOM 6620 HD22 LEU B 238 -25.495 9.982 4.041 1.00 0.00 H ATOM 6621 HD23 LEU B 238 -24.105 9.313 3.152 1.00 0.00 H ATOM 6622 HD11 LEU B 238 -23.164 6.826 5.726 1.00 0.00 H ATOM 6623 HD12 LEU B 238 -24.202 6.459 4.326 1.00 0.00 H ATOM 6624 HD13 LEU B 238 -22.761 7.485 4.122 1.00 0.00 H ATOM 6625 H LEU B 238 -24.528 9.571 7.885 1.00 0.00 H ATOM 6626 N ALA B 239 -27.581 8.358 8.487 1.00 21.27 N ATOM 6627 CA ALA B 239 -28.804 7.935 9.171 1.00 22.44 C ATOM 6628 C ALA B 239 -29.693 9.144 9.450 1.00 20.12 C ATOM 6629 O ALA B 239 -30.929 9.071 9.349 1.00 18.27 O ATOM 6630 CB ALA B 239 -28.472 7.224 10.468 1.00 22.00 C ATOM 6631 HA ALA B 239 -29.339 7.241 8.523 1.00 0.00 H ATOM 6632 HB1 ALA B 239 -27.865 6.345 10.254 1.00 0.00 H ATOM 6633 HB2 ALA B 239 -27.918 7.900 11.120 1.00 0.00 H ATOM 6634 HB3 ALA B 239 -29.395 6.918 10.960 1.00 0.00 H ATOM 6635 H ALA B 239 -26.665 8.258 8.970 1.00 0.00 H ATOM 6636 N TYR B 240 -29.052 10.249 9.814 1.00 17.71 N ATOM 6637 CA TYR B 240 -29.749 11.518 10.012 1.00 16.64 C ATOM 6638 C TYR B 240 -30.486 11.946 8.737 1.00 16.35 C ATOM 6639 O TYR B 240 -31.659 12.351 8.778 1.00 15.47 O ATOM 6640 CB TYR B 240 -28.742 12.585 10.450 1.00 15.55 C ATOM 6641 CG TYR B 240 -29.335 13.946 10.760 1.00 16.68 C ATOM 6642 CD1 TYR B 240 -29.467 14.899 9.770 1.00 15.61 C ATOM 6643 CD2 TYR B 240 -29.725 14.287 12.059 1.00 16.79 C ATOM 6644 CE1 TYR B 240 -29.994 16.149 10.049 1.00 13.66 C ATOM 6645 CE2 TYR B 240 -30.259 15.542 12.345 1.00 15.01 C ATOM 6646 CZ TYR B 240 -30.389 16.466 11.323 1.00 13.32 C ATOM 6647 OH TYR B 240 -30.911 17.717 11.580 1.00 18.48 O ATOM 6648 HA TYR B 240 -30.499 11.395 10.793 1.00 0.00 H ATOM 6649 HB3 TYR B 240 -28.013 12.709 9.649 1.00 0.00 H ATOM 6650 HB2 TYR B 240 -28.238 12.225 11.347 1.00 0.00 H ATOM 6651 HD2 TYR B 240 -29.609 13.559 12.862 1.00 0.00 H ATOM 6652 HE2 TYR B 240 -30.570 15.792 13.359 1.00 0.00 H ATOM 6653 HE1 TYR B 240 -30.095 16.885 9.251 1.00 0.00 H ATOM 6654 HD1 TYR B 240 -29.152 14.664 8.753 1.00 0.00 H ATOM 6655 HH TYR B 240 -30.931 18.243 10.742 1.00 0.00 H ATOM 6656 H TYR B 240 -28.023 10.210 9.963 1.00 0.00 H ATOM 6657 N ARG B 241 -29.809 11.836 7.599 1.00 15.24 N ATOM 6658 CA ARG B 241 -30.438 12.147 6.316 1.00 18.83 C ATOM 6659 C ARG B 241 -31.635 11.227 6.051 1.00 19.08 C ATOM 6660 O ARG B 241 -32.694 11.678 5.624 1.00 18.97 O ATOM 6661 CB ARG B 241 -29.419 12.070 5.174 1.00 20.43 C ATOM 6662 CG ARG B 241 -29.963 12.494 3.824 1.00 20.18 C ATOM 6663 CD ARG B 241 -28.896 12.458 2.739 1.00 23.48 C ATOM 6664 NE ARG B 241 -28.421 11.095 2.485 1.00 23.12 N ATOM 6665 CZ ARG B 241 -27.657 10.754 1.451 1.00 28.37 C ATOM 6666 NH1 ARG B 241 -27.279 11.676 0.570 1.00 23.12 N ATOM 6667 NH2 ARG B 241 -27.268 9.492 1.297 1.00 24.11 N ATOM 6668 HA ARG B 241 -30.810 13.170 6.364 1.00 0.00 H ATOM 6669 HB2 ARG B 241 -28.578 12.717 5.422 1.00 0.00 H ATOM 6670 HB3 ARG B 241 -29.072 11.040 5.094 1.00 0.00 H ATOM 6671 HG2 ARG B 241 -30.772 11.820 3.544 1.00 0.00 H ATOM 6672 HG3 ARG B 241 -30.349 13.510 3.904 1.00 0.00 H ATOM 6673 HD2 ARG B 241 -28.052 13.073 3.053 1.00 0.00 H ATOM 6674 HD3 ARG B 241 -29.316 12.863 1.818 1.00 0.00 H ATOM 6675 HE ARG B 241 -28.698 10.349 3.154 1.00 0.00 H ATOM 6676 HH12 ARG B 241 -26.682 11.409 -0.238 1.00 0.00 H ATOM 6677 HH11 ARG B 241 -27.581 12.664 0.689 1.00 0.00 H ATOM 6678 HH22 ARG B 241 -26.671 9.227 0.488 1.00 0.00 H ATOM 6679 HH21 ARG B 241 -27.561 8.770 1.986 1.00 0.00 H ATOM 6680 H ARG B 241 -28.817 11.524 7.621 1.00 0.00 H ATOM 6681 N ASP B 242 -31.467 9.933 6.297 1.00 23.14 N ATOM 6682 CA ASP B 242 -32.582 9.002 6.159 1.00 24.37 C ATOM 6683 C ASP B 242 -33.788 9.478 6.968 1.00 21.86 C ATOM 6684 O ASP B 242 -34.938 9.393 6.514 1.00 19.44 O ATOM 6685 CB ASP B 242 -32.176 7.600 6.616 1.00 27.86 C ATOM 6686 CG ASP B 242 -31.282 6.898 5.613 1.00 29.88 C ATOM 6687 OD1 ASP B 242 -31.267 7.307 4.428 1.00 27.54 O ATOM 6688 OD2 ASP B 242 -30.599 5.938 6.011 1.00 29.13 O ATOM 6689 HA ASP B 242 -32.857 8.964 5.105 1.00 0.00 H ATOM 6690 HB2 ASP B 242 -31.642 7.682 7.563 1.00 0.00 H ATOM 6691 HB3 ASP B 242 -33.077 7.004 6.758 1.00 0.00 H ATOM 6692 H ASP B 242 -30.534 9.580 6.590 1.00 0.00 H ATOM 6693 N ALA B 243 -33.520 9.981 8.165 1.00 17.70 N ATOM 6694 CA ALA B 243 -34.586 10.447 9.038 1.00 22.51 C ATOM 6695 C ALA B 243 -35.227 11.745 8.538 1.00 16.55 C ATOM 6696 O ALA B 243 -36.434 11.914 8.645 1.00 15.19 O ATOM 6697 CB ALA B 243 -34.091 10.596 10.473 1.00 20.65 C ATOM 6698 HA ALA B 243 -35.365 9.685 9.021 1.00 0.00 H ATOM 6699 HB1 ALA B 243 -33.738 9.631 10.836 1.00 0.00 H ATOM 6700 HB2 ALA B 243 -33.274 11.318 10.501 1.00 0.00 H ATOM 6701 HB3 ALA B 243 -34.908 10.946 11.104 1.00 0.00 H ATOM 6702 H ALA B 243 -32.532 10.043 8.485 1.00 0.00 H ATOM 6703 N VAL B 244 -34.434 12.647 7.974 1.00 17.79 N ATOM 6704 CA VAL B 244 -35.006 13.890 7.449 1.00 16.13 C ATOM 6705 C VAL B 244 -35.940 13.550 6.291 1.00 18.40 C ATOM 6706 O VAL B 244 -37.047 14.068 6.206 1.00 16.77 O ATOM 6707 CB VAL B 244 -33.918 14.873 7.000 1.00 17.51 C ATOM 6708 CG1 VAL B 244 -34.526 16.155 6.461 1.00 15.04 C ATOM 6709 CG2 VAL B 244 -32.984 15.161 8.155 1.00 15.38 C ATOM 6710 HA VAL B 244 -35.565 14.383 8.244 1.00 0.00 H ATOM 6711 HB VAL B 244 -33.348 14.418 6.190 1.00 0.00 H ATOM 6712 HG11 VAL B 244 -35.161 15.923 5.606 1.00 0.00 H ATOM 6713 HG12 VAL B 244 -35.123 16.628 7.240 1.00 0.00 H ATOM 6714 HG13 VAL B 244 -33.729 16.831 6.151 1.00 0.00 H ATOM 6715 HG21 VAL B 244 -33.550 15.598 8.978 1.00 0.00 H ATOM 6716 HG22 VAL B 244 -32.519 14.232 8.485 1.00 0.00 H ATOM 6717 HG23 VAL B 244 -32.213 15.860 7.831 1.00 0.00 H ATOM 6718 H VAL B 244 -33.411 12.473 7.905 1.00 0.00 H ATOM 6719 N ARG B 245 -35.502 12.638 5.425 1.00 17.56 N ATOM 6720 CA ARG B 245 -36.340 12.165 4.330 1.00 18.90 C ATOM 6721 C ARG B 245 -37.628 11.479 4.797 1.00 16.60 C ATOM 6722 O ARG B 245 -38.698 11.677 4.204 1.00 16.51 O ATOM 6723 CB ARG B 245 -35.536 11.226 3.426 1.00 19.03 C ATOM 6724 CG ARG B 245 -34.366 11.903 2.713 1.00 19.00 C ATOM 6725 CD ARG B 245 -33.424 10.851 2.107 1.00 22.44 C ATOM 6726 NE ARG B 245 -32.458 11.432 1.176 1.00 24.74 N ATOM 6727 CZ ARG B 245 -31.517 10.728 0.550 1.00 27.51 C ATOM 6728 NH1 ARG B 245 -31.414 9.429 0.778 1.00 20.82 N ATOM 6729 NH2 ARG B 245 -30.677 11.320 -0.293 1.00 25.52 N ATOM 6730 HA ARG B 245 -36.651 13.048 3.772 1.00 0.00 H ATOM 6731 HB2 ARG B 245 -35.142 10.414 4.038 1.00 0.00 H ATOM 6732 HB3 ARG B 245 -36.208 10.817 2.671 1.00 0.00 H ATOM 6733 HG2 ARG B 245 -34.751 12.541 1.918 1.00 0.00 H ATOM 6734 HG3 ARG B 245 -33.812 12.511 3.429 1.00 0.00 H ATOM 6735 HD2 ARG B 245 -34.022 10.112 1.574 1.00 0.00 H ATOM 6736 HD3 ARG B 245 -32.880 10.362 2.915 1.00 0.00 H ATOM 6737 HE ARG B 245 -32.509 12.454 0.992 1.00 0.00 H ATOM 6738 HH12 ARG B 245 -30.682 8.872 0.293 1.00 0.00 H ATOM 6739 HH11 ARG B 245 -32.065 8.964 1.442 1.00 0.00 H ATOM 6740 HH22 ARG B 245 -29.946 10.761 -0.777 1.00 0.00 H ATOM 6741 HH21 ARG B 245 -30.751 12.342 -0.469 1.00 0.00 H ATOM 6742 H ARG B 245 -34.541 12.255 5.532 1.00 0.00 H ATOM 6743 N GLN B 246 -37.524 10.647 5.831 1.00 16.43 N ATOM 6744 CA GLN B 246 -38.695 10.044 6.454 1.00 17.32 C ATOM 6745 C GLN B 246 -39.650 11.095 7.018 1.00 14.08 C ATOM 6746 O GLN B 246 -40.859 10.926 6.965 1.00 15.30 O ATOM 6747 CB GLN B 246 -38.283 9.080 7.577 1.00 17.98 C ATOM 6748 CG GLN B 246 -37.815 7.721 7.065 1.00 21.82 C ATOM 6749 CD GLN B 246 -36.789 7.065 7.967 1.00 29.31 C ATOM 6750 OE1 GLN B 246 -36.661 7.402 9.150 1.00 28.08 O ATOM 6751 NE2 GLN B 246 -36.043 6.118 7.407 1.00 31.20 N ATOM 6752 HA GLN B 246 -39.215 9.492 5.671 1.00 0.00 H ATOM 6753 HB2 GLN B 246 -37.470 9.535 8.143 1.00 0.00 H ATOM 6754 HB3 GLN B 246 -39.140 8.926 8.233 1.00 0.00 H ATOM 6755 HG2 GLN B 246 -38.680 7.063 6.988 1.00 0.00 H ATOM 6756 HG3 GLN B 246 -37.373 7.856 6.078 1.00 0.00 H ATOM 6757 HE22 GLN B 246 -36.185 5.867 6.408 1.00 0.00 H ATOM 6758 HE21 GLN B 246 -35.317 5.628 7.968 1.00 0.00 H ATOM 6759 H GLN B 246 -36.580 10.421 6.205 1.00 0.00 H ATOM 6760 N PHE B 247 -39.111 12.154 7.600 1.00 14.40 N ATOM 6761 CA PHE B 247 -39.967 13.235 8.094 1.00 13.43 C ATOM 6762 C PHE B 247 -40.688 13.909 6.927 1.00 13.20 C ATOM 6763 O PHE B 247 -41.913 14.144 6.961 1.00 12.31 O ATOM 6764 CB PHE B 247 -39.126 14.244 8.872 1.00 13.13 C ATOM 6765 CG PHE B 247 -39.913 15.395 9.422 1.00 11.96 C ATOM 6766 CD1 PHE B 247 -40.136 16.527 8.646 1.00 14.72 C ATOM 6767 CD2 PHE B 247 -40.403 15.365 10.716 1.00 15.66 C ATOM 6768 CE1 PHE B 247 -40.859 17.609 9.160 1.00 15.55 C ATOM 6769 CE2 PHE B 247 -41.114 16.451 11.239 1.00 18.06 C ATOM 6770 CZ PHE B 247 -41.338 17.566 10.457 1.00 17.23 C ATOM 6771 HA PHE B 247 -40.720 12.822 8.765 1.00 0.00 H ATOM 6772 HB2 PHE B 247 -38.649 13.725 9.704 1.00 0.00 H ATOM 6773 HB3 PHE B 247 -38.360 14.639 8.205 1.00 0.00 H ATOM 6774 HD2 PHE B 247 -40.233 14.484 11.336 1.00 0.00 H ATOM 6775 HE2 PHE B 247 -41.490 16.416 12.262 1.00 0.00 H ATOM 6776 HZ PHE B 247 -41.892 18.413 10.861 1.00 0.00 H ATOM 6777 HE1 PHE B 247 -41.045 18.485 8.539 1.00 0.00 H ATOM 6778 HD1 PHE B 247 -39.745 16.572 7.630 1.00 0.00 H ATOM 6779 H PHE B 247 -38.079 12.219 7.707 1.00 0.00 H ATOM 6780 N ARG B 248 -39.919 14.195 5.890 1.00 15.74 N ATOM 6781 CA ARG B 248 -40.433 14.821 4.676 1.00 14.93 C ATOM 6782 C ARG B 248 -41.573 13.998 4.052 1.00 16.98 C ATOM 6783 O ARG B 248 -42.632 14.532 3.718 1.00 16.21 O ATOM 6784 CB ARG B 248 -39.257 15.030 3.706 1.00 18.64 C ATOM 6785 CG ARG B 248 -39.510 15.919 2.516 1.00 20.61 C ATOM 6786 CD ARG B 248 -40.012 15.122 1.332 1.00 20.87 C ATOM 6787 NE ARG B 248 -39.152 13.987 0.983 1.00 21.45 N ATOM 6788 CZ ARG B 248 -38.083 14.067 0.196 1.00 26.27 C ATOM 6789 NH1 ARG B 248 -37.717 15.238 -0.319 1.00 23.45 N ATOM 6790 NH2 ARG B 248 -37.365 12.977 -0.070 1.00 24.11 N ATOM 6791 HA ARG B 248 -40.872 15.790 4.915 1.00 0.00 H ATOM 6792 HB2 ARG B 248 -38.434 15.464 4.273 1.00 0.00 H ATOM 6793 HB3 ARG B 248 -38.961 14.051 3.330 1.00 0.00 H ATOM 6794 HG2 ARG B 248 -40.257 16.667 2.783 1.00 0.00 H ATOM 6795 HG3 ARG B 248 -38.581 16.417 2.241 1.00 0.00 H ATOM 6796 HD2 ARG B 248 -40.074 15.786 0.470 1.00 0.00 H ATOM 6797 HD3 ARG B 248 -41.006 14.742 1.568 1.00 0.00 H ATOM 6798 HE ARG B 248 -39.394 13.056 1.378 1.00 0.00 H ATOM 6799 HH12 ARG B 248 -36.880 15.297 -0.934 1.00 0.00 H ATOM 6800 HH11 ARG B 248 -38.267 16.094 -0.106 1.00 0.00 H ATOM 6801 HH22 ARG B 248 -36.529 13.042 -0.686 1.00 0.00 H ATOM 6802 HH21 ARG B 248 -37.640 12.061 0.338 1.00 0.00 H ATOM 6803 H ARG B 248 -38.906 13.964 5.942 1.00 0.00 H ATOM 6804 N ASP B 249 -41.359 12.695 3.890 1.00 16.91 N ATOM 6805 CA ASP B 249 -42.402 11.817 3.361 1.00 17.01 C ATOM 6806 C ASP B 249 -43.666 11.783 4.237 1.00 20.21 C ATOM 6807 O ASP B 249 -44.790 11.728 3.713 1.00 17.04 O ATOM 6808 CB ASP B 249 -41.862 10.400 3.159 1.00 20.98 C ATOM 6809 CG ASP B 249 -40.720 10.336 2.145 1.00 24.05 C ATOM 6810 OD1 ASP B 249 -40.497 11.314 1.393 1.00 21.74 O ATOM 6811 OD2 ASP B 249 -40.045 9.284 2.093 1.00 22.78 O ATOM 6812 HA ASP B 249 -42.696 12.236 2.399 1.00 0.00 H ATOM 6813 HB2 ASP B 249 -41.498 10.027 4.116 1.00 0.00 H ATOM 6814 HB3 ASP B 249 -42.675 9.765 2.808 1.00 0.00 H ATOM 6815 H ASP B 249 -40.434 12.294 4.144 1.00 0.00 H ATOM 6816 N ALA B 250 -43.499 11.809 5.559 1.00 15.61 N ATOM 6817 CA ALA B 250 -44.656 11.792 6.460 1.00 17.28 C ATOM 6818 C ALA B 250 -45.456 13.092 6.379 1.00 16.18 C ATOM 6819 O ALA B 250 -46.677 13.065 6.434 1.00 14.01 O ATOM 6820 CB ALA B 250 -44.234 11.500 7.913 1.00 16.89 C ATOM 6821 HA ALA B 250 -45.306 10.982 6.128 1.00 0.00 H ATOM 6822 HB1 ALA B 250 -43.745 10.527 7.959 1.00 0.00 H ATOM 6823 HB2 ALA B 250 -43.543 12.272 8.251 1.00 0.00 H ATOM 6824 HB3 ALA B 250 -45.117 11.495 8.552 1.00 0.00 H ATOM 6825 H ALA B 250 -42.538 11.842 5.956 1.00 0.00 H ATOM 6826 N VAL B 251 -44.768 14.223 6.242 1.00 14.32 N ATOM 6827 CA VAL B 251 -45.449 15.502 6.043 1.00 14.83 C ATOM 6828 C VAL B 251 -46.326 15.405 4.790 1.00 17.83 C ATOM 6829 O VAL B 251 -47.496 15.808 4.787 1.00 13.55 O ATOM 6830 CB VAL B 251 -44.430 16.667 5.930 1.00 19.34 C ATOM 6831 CG1 VAL B 251 -45.096 17.956 5.433 1.00 16.99 C ATOM 6832 CG2 VAL B 251 -43.734 16.890 7.274 1.00 16.30 C ATOM 6833 HA VAL B 251 -46.079 15.716 6.907 1.00 0.00 H ATOM 6834 HB VAL B 251 -43.680 16.389 5.190 1.00 0.00 H ATOM 6835 HG11 VAL B 251 -45.531 17.783 4.449 1.00 0.00 H ATOM 6836 HG12 VAL B 251 -45.880 18.251 6.131 1.00 0.00 H ATOM 6837 HG13 VAL B 251 -44.349 18.747 5.368 1.00 0.00 H ATOM 6838 HG21 VAL B 251 -44.479 17.138 8.031 1.00 0.00 H ATOM 6839 HG22 VAL B 251 -43.208 15.981 7.564 1.00 0.00 H ATOM 6840 HG23 VAL B 251 -43.022 17.710 7.181 1.00 0.00 H ATOM 6841 H VAL B 251 -43.729 14.197 6.277 1.00 0.00 H ATOM 6842 N ALA B 252 -45.771 14.823 3.733 1.00 14.29 N ATOM 6843 CA ALA B 252 -46.532 14.627 2.510 1.00 17.58 C ATOM 6844 C ALA B 252 -47.814 13.855 2.766 1.00 15.66 C ATOM 6845 O ALA B 252 -48.883 14.250 2.300 1.00 18.01 O ATOM 6846 CB ALA B 252 -45.682 13.922 1.447 1.00 18.41 C ATOM 6847 HA ALA B 252 -46.808 15.613 2.136 1.00 0.00 H ATOM 6848 HB1 ALA B 252 -44.806 14.530 1.223 1.00 0.00 H ATOM 6849 HB2 ALA B 252 -45.365 12.950 1.824 1.00 0.00 H ATOM 6850 HB3 ALA B 252 -46.274 13.787 0.542 1.00 0.00 H ATOM 6851 H ALA B 252 -44.782 14.504 3.781 1.00 0.00 H ATOM 6852 N ASN B 253 -47.719 12.776 3.537 1.00 14.04 N ATOM 6853 CA ASN B 253 -48.885 11.954 3.831 1.00 14.98 C ATOM 6854 C ASN B 253 -49.936 12.652 4.697 1.00 14.59 C ATOM 6855 O ASN B 253 -51.130 12.440 4.537 1.00 11.90 O ATOM 6856 CB ASN B 253 -48.463 10.626 4.453 1.00 17.40 C ATOM 6857 CG ASN B 253 -47.766 9.711 3.440 1.00 26.20 C ATOM 6858 OD1 ASN B 253 -48.001 9.815 2.227 1.00 26.36 O ATOM 6859 ND2 ASN B 253 -46.900 8.832 3.929 1.00 22.92 N ATOM 6860 HA ASN B 253 -49.370 11.767 2.873 1.00 0.00 H ATOM 6861 HB2 ASN B 253 -47.778 10.825 5.277 1.00 0.00 H ATOM 6862 HB3 ASN B 253 -49.349 10.119 4.834 1.00 0.00 H ATOM 6863 HD22 ASN B 253 -46.735 8.780 4.954 1.00 0.00 H ATOM 6864 HD21 ASN B 253 -46.387 8.195 3.287 1.00 0.00 H ATOM 6865 H ASN B 253 -46.796 12.514 3.937 1.00 0.00 H ATOM 6866 N ILE B 254 -49.480 13.488 5.616 1.00 12.38 N ATOM 6867 CA ILE B 254 -50.393 14.326 6.376 1.00 9.12 C ATOM 6868 C ILE B 254 -51.132 15.291 5.455 1.00 13.76 C ATOM 6869 O ILE B 254 -52.338 15.472 5.559 1.00 11.26 O ATOM 6870 CB ILE B 254 -49.621 15.125 7.444 1.00 12.84 C ATOM 6871 CG1 ILE B 254 -49.161 14.176 8.555 1.00 8.19 C ATOM 6872 CG2 ILE B 254 -50.494 16.199 8.056 1.00 13.15 C ATOM 6873 CD1 ILE B 254 -48.073 14.794 9.461 1.00 11.05 C ATOM 6874 HA ILE B 254 -51.120 13.678 6.865 1.00 0.00 H ATOM 6875 HB ILE B 254 -48.764 15.597 6.963 1.00 0.00 H ATOM 6876 HG12 ILE B 254 -50.022 13.918 9.171 1.00 0.00 H ATOM 6877 HG13 ILE B 254 -48.760 13.272 8.097 1.00 0.00 H ATOM 6878 HD11 ILE B 254 -47.201 15.048 8.858 1.00 0.00 H ATOM 6879 HD12 ILE B 254 -48.464 15.695 9.934 1.00 0.00 H ATOM 6880 HD13 ILE B 254 -47.789 14.074 10.228 1.00 0.00 H ATOM 6881 HG21 ILE B 254 -50.824 16.885 7.276 1.00 0.00 H ATOM 6882 HG22 ILE B 254 -51.362 15.736 8.525 1.00 0.00 H ATOM 6883 HG23 ILE B 254 -49.923 16.746 8.806 1.00 0.00 H ATOM 6884 H ILE B 254 -48.457 13.546 5.796 1.00 0.00 H ATOM 6885 N THR B 255 -50.393 15.908 4.555 1.00 12.95 N ATOM 6886 CA THR B 255 -50.983 16.867 3.623 1.00 13.88 C ATOM 6887 C THR B 255 -51.999 16.178 2.713 1.00 15.95 C ATOM 6888 O THR B 255 -53.094 16.690 2.451 1.00 14.26 O ATOM 6889 CB THR B 255 -49.881 17.559 2.820 1.00 16.77 C ATOM 6890 OG1 THR B 255 -49.027 18.277 3.720 1.00 21.35 O ATOM 6891 CG2 THR B 255 -50.467 18.529 1.824 1.00 22.12 C ATOM 6892 HA THR B 255 -51.519 17.631 4.187 1.00 0.00 H ATOM 6893 HB THR B 255 -49.317 16.800 2.279 1.00 0.00 H ATOM 6894 HG1 THR B 255 -48.623 17.644 4.365 1.00 0.00 H ATOM 6895 HG23 THR B 255 -51.118 17.991 1.135 1.00 0.00 H ATOM 6896 HG21 THR B 255 -51.043 19.288 2.353 1.00 0.00 H ATOM 6897 HG22 THR B 255 -49.661 19.006 1.266 1.00 0.00 H ATOM 6898 H THR B 255 -49.373 15.709 4.507 1.00 0.00 H ATOM 6899 N THR B 256 -51.648 14.986 2.251 1.00 15.04 N ATOM 6900 CA THR B 256 -52.567 14.219 1.428 1.00 14.17 C ATOM 6901 C THR B 256 -53.872 13.875 2.150 1.00 15.69 C ATOM 6902 O THR B 256 -54.953 14.128 1.623 1.00 11.64 O ATOM 6903 CB THR B 256 -51.893 12.949 0.900 1.00 15.96 C ATOM 6904 OG1 THR B 256 -50.820 13.341 0.043 1.00 18.80 O ATOM 6905 CG2 THR B 256 -52.906 12.093 0.128 1.00 14.68 C ATOM 6906 HA THR B 256 -52.834 14.858 0.586 1.00 0.00 H ATOM 6907 HB THR B 256 -51.512 12.352 1.729 1.00 0.00 H ATOM 6908 HG1 THR B 256 -50.369 12.533 -0.310 1.00 0.00 H ATOM 6909 HG23 THR B 256 -53.717 11.802 0.795 1.00 0.00 H ATOM 6910 HG21 THR B 256 -53.308 12.670 -0.705 1.00 0.00 H ATOM 6911 HG22 THR B 256 -52.410 11.200 -0.253 1.00 0.00 H ATOM 6912 H THR B 256 -50.710 14.598 2.479 1.00 0.00 H ATOM 6913 N SER B 257 -53.776 13.319 3.362 1.00 10.82 N ATOM 6914 CA SER B 257 -54.963 13.000 4.145 1.00 15.17 C ATOM 6915 C SER B 257 -55.782 14.236 4.468 1.00 11.32 C ATOM 6916 O SER B 257 -57.001 14.168 4.514 1.00 11.23 O ATOM 6917 CB SER B 257 -54.615 12.271 5.452 1.00 15.16 C ATOM 6918 OG SER B 257 -53.810 13.077 6.306 1.00 16.73 O ATOM 6919 HA SER B 257 -55.559 12.335 3.519 1.00 0.00 H ATOM 6920 HB2 SER B 257 -54.072 11.357 5.213 1.00 0.00 H ATOM 6921 HB3 SER B 257 -55.539 12.018 5.972 1.00 0.00 H ATOM 6922 HG SER B 257 -52.966 13.306 5.842 1.00 0.00 H ATOM 6923 H SER B 257 -52.836 13.110 3.754 1.00 0.00 H ATOM 6924 N ARG B 258 -55.106 15.356 4.695 1.00 12.18 N ATOM 6925 CA ARG B 258 -55.820 16.603 4.943 1.00 13.22 C ATOM 6926 C ARG B 258 -56.672 16.961 3.735 1.00 14.74 C ATOM 6927 O ARG B 258 -57.815 17.335 3.888 1.00 13.10 O ATOM 6928 CB ARG B 258 -54.863 17.753 5.213 1.00 10.53 C ATOM 6929 CG ARG B 258 -55.593 19.048 5.582 1.00 13.53 C ATOM 6930 CD ARG B 258 -54.644 20.223 5.693 1.00 15.87 C ATOM 6931 NE ARG B 258 -55.349 21.413 6.175 1.00 13.73 N ATOM 6932 CZ ARG B 258 -54.780 22.598 6.317 1.00 12.53 C ATOM 6933 NH1 ARG B 258 -53.499 22.760 6.015 1.00 13.86 N ATOM 6934 NH2 ARG B 258 -55.492 23.616 6.776 1.00 10.93 N ATOM 6935 HA ARG B 258 -56.445 16.450 5.823 1.00 0.00 H ATOM 6936 HB2 ARG B 258 -54.205 17.475 6.037 1.00 0.00 H ATOM 6937 HB3 ARG B 258 -54.267 17.930 4.318 1.00 0.00 H ATOM 6938 HG2 ARG B 258 -56.334 19.266 4.813 1.00 0.00 H ATOM 6939 HG3 ARG B 258 -56.095 18.909 6.540 1.00 0.00 H ATOM 6940 HD2 ARG B 258 -54.217 20.432 4.712 1.00 0.00 H ATOM 6941 HD3 ARG B 258 -53.844 19.973 6.390 1.00 0.00 H ATOM 6942 HE ARG B 258 -56.356 21.320 6.420 1.00 0.00 H ATOM 6943 HH12 ARG B 258 -53.052 23.692 6.127 1.00 0.00 H ATOM 6944 HH11 ARG B 258 -52.941 21.955 5.666 1.00 0.00 H ATOM 6945 HH22 ARG B 258 -55.050 24.550 6.890 1.00 0.00 H ATOM 6946 HH21 ARG B 258 -56.493 23.481 7.023 1.00 0.00 H ATOM 6947 H ARG B 258 -54.066 15.344 4.696 1.00 0.00 H ATOM 6948 N ALA B 259 -56.086 16.858 2.543 1.00 15.42 N ATOM 6949 CA ALA B 259 -56.782 17.205 1.294 1.00 14.19 C ATOM 6950 C ALA B 259 -57.999 16.301 1.078 1.00 15.57 C ATOM 6951 O ALA B 259 -59.053 16.737 0.587 1.00 14.22 O ATOM 6952 CB ALA B 259 -55.822 17.104 0.103 1.00 14.33 C ATOM 6953 HA ALA B 259 -57.133 18.234 1.374 1.00 0.00 H ATOM 6954 HB1 ALA B 259 -54.989 17.792 0.250 1.00 0.00 H ATOM 6955 HB2 ALA B 259 -55.444 16.085 0.028 1.00 0.00 H ATOM 6956 HB3 ALA B 259 -56.353 17.364 -0.813 1.00 0.00 H ATOM 6957 H ALA B 259 -55.103 16.521 2.494 1.00 0.00 H ATOM 6958 N GLU B 260 -57.855 15.040 1.472 1.00 16.63 N ATOM 6959 CA GLU B 260 -58.947 14.075 1.379 1.00 16.70 C ATOM 6960 C GLU B 260 -60.086 14.385 2.348 1.00 15.47 C ATOM 6961 O GLU B 260 -61.254 14.339 1.986 1.00 14.98 O ATOM 6962 CB GLU B 260 -58.425 12.663 1.612 1.00 17.45 C ATOM 6963 CG GLU B 260 -57.459 12.191 0.538 1.00 16.62 C ATOM 6964 CD GLU B 260 -56.796 10.877 0.886 1.00 23.54 C ATOM 6965 OE1 GLU B 260 -57.025 10.366 2.008 1.00 20.69 O ATOM 6966 OE2 GLU B 260 -56.033 10.367 0.036 1.00 25.95 O ATOM 6967 HA GLU B 260 -59.355 14.150 0.371 1.00 0.00 H ATOM 6968 HB2 GLU B 260 -57.912 12.638 2.573 1.00 0.00 H ATOM 6969 HB3 GLU B 260 -59.274 11.980 1.637 1.00 0.00 H ATOM 6970 HG2 GLU B 260 -58.008 12.068 -0.396 1.00 0.00 H ATOM 6971 HG3 GLU B 260 -56.686 12.948 0.407 1.00 0.00 H ATOM 6972 H GLU B 260 -56.939 14.732 1.857 1.00 0.00 H ATOM 6973 N MET B 261 -59.752 14.696 3.594 1.00 15.10 N ATOM 6974 CA MET B 261 -60.796 15.043 4.554 1.00 14.54 C ATOM 6975 C MET B 261 -61.496 16.359 4.188 1.00 12.43 C ATOM 6976 O MET B 261 -62.647 16.582 4.575 1.00 14.44 O ATOM 6977 CB MET B 261 -60.235 15.088 5.977 1.00 16.18 C ATOM 6978 CG MET B 261 -60.071 13.704 6.587 1.00 14.94 C ATOM 6979 SD MET B 261 -59.386 13.703 8.245 1.00 14.29 S ATOM 6980 CE MET B 261 -57.661 14.070 7.886 1.00 10.58 C ATOM 6981 HA MET B 261 -61.552 14.259 4.513 1.00 0.00 H ATOM 6982 HB2 MET B 261 -59.261 15.577 5.953 1.00 0.00 H ATOM 6983 HB3 MET B 261 -60.915 15.667 6.602 1.00 0.00 H ATOM 6984 HG2 MET B 261 -59.409 13.124 5.944 1.00 0.00 H ATOM 6985 HG3 MET B 261 -61.051 13.228 6.622 1.00 0.00 H ATOM 6986 HE1 MET B 261 -57.252 13.292 7.241 1.00 0.00 H ATOM 6987 HE2 MET B 261 -57.593 15.034 7.383 1.00 0.00 H ATOM 6988 HE3 MET B 261 -57.097 14.105 8.818 1.00 0.00 H ATOM 6989 H MET B 261 -58.753 14.693 3.885 1.00 0.00 H ATOM 6990 N THR B 262 -60.813 17.218 3.444 1.00 13.42 N ATOM 6991 CA THR B 262 -61.426 18.473 3.008 1.00 12.30 C ATOM 6992 C THR B 262 -62.580 18.133 2.067 1.00 15.15 C ATOM 6993 O THR B 262 -63.704 18.645 2.206 1.00 13.57 O ATOM 6994 CB THR B 262 -60.409 19.406 2.308 1.00 17.94 C ATOM 6995 OG1 THR B 262 -59.350 19.735 3.217 1.00 11.82 O ATOM 6996 CG2 THR B 262 -61.082 20.694 1.874 1.00 17.86 C ATOM 6997 HA THR B 262 -61.789 19.014 3.882 1.00 0.00 H ATOM 6998 HB THR B 262 -60.014 18.887 1.435 1.00 0.00 H ATOM 6999 HG1 THR B 262 -58.892 18.905 3.503 1.00 0.00 H ATOM 7000 HG23 THR B 262 -61.891 20.464 1.181 1.00 0.00 H ATOM 7001 HG21 THR B 262 -61.485 21.205 2.749 1.00 0.00 H ATOM 7002 HG22 THR B 262 -60.352 21.336 1.381 1.00 0.00 H ATOM 7003 H THR B 262 -59.835 16.998 3.168 1.00 0.00 H ATOM 7004 N VAL B 263 -62.283 17.238 1.125 1.00 15.42 N ATOM 7005 CA VAL B 263 -63.263 16.745 0.163 1.00 16.45 C ATOM 7006 C VAL B 263 -64.390 15.976 0.822 1.00 15.80 C ATOM 7007 O VAL B 263 -65.564 16.226 0.567 1.00 16.43 O ATOM 7008 CB VAL B 263 -62.604 15.790 -0.838 1.00 18.52 C ATOM 7009 CG1 VAL B 263 -63.689 15.000 -1.568 1.00 19.84 C ATOM 7010 CG2 VAL B 263 -61.724 16.577 -1.789 1.00 17.87 C ATOM 7011 HA VAL B 263 -63.663 17.631 -0.330 1.00 0.00 H ATOM 7012 HB VAL B 263 -61.964 15.075 -0.321 1.00 0.00 H ATOM 7013 HG11 VAL B 263 -64.270 14.428 -0.844 1.00 0.00 H ATOM 7014 HG12 VAL B 263 -64.345 15.691 -2.098 1.00 0.00 H ATOM 7015 HG13 VAL B 263 -63.224 14.319 -2.281 1.00 0.00 H ATOM 7016 HG21 VAL B 263 -62.332 17.304 -2.328 1.00 0.00 H ATOM 7017 HG22 VAL B 263 -60.952 17.097 -1.222 1.00 0.00 H ATOM 7018 HG23 VAL B 263 -61.257 15.894 -2.499 1.00 0.00 H ATOM 7019 H VAL B 263 -61.310 16.875 1.073 1.00 0.00 H ATOM 7020 N GLN B 264 -64.035 15.026 1.674 1.00 11.99 N ATOM 7021 CA GLN B 264 -65.053 14.304 2.420 1.00 15.33 C ATOM 7022 C GLN B 264 -65.961 15.234 3.231 1.00 19.01 C ATOM 7023 O GLN B 264 -67.180 15.037 3.282 1.00 18.74 O ATOM 7024 CB GLN B 264 -64.392 13.270 3.318 1.00 16.80 C ATOM 7025 CG GLN B 264 -63.688 12.179 2.519 1.00 16.59 C ATOM 7026 CD GLN B 264 -62.535 11.560 3.286 1.00 23.21 C ATOM 7027 OE1 GLN B 264 -62.235 11.968 4.401 1.00 14.97 O ATOM 7028 NE2 GLN B 264 -61.868 10.590 2.675 1.00 15.38 N ATOM 7029 HA GLN B 264 -65.697 13.801 1.699 1.00 0.00 H ATOM 7030 HB2 GLN B 264 -63.659 13.771 3.950 1.00 0.00 H ATOM 7031 HB3 GLN B 264 -65.156 12.809 3.945 1.00 0.00 H ATOM 7032 HG2 GLN B 264 -64.410 11.398 2.279 1.00 0.00 H ATOM 7033 HG3 GLN B 264 -63.303 12.612 1.596 1.00 0.00 H ATOM 7034 HE22 GLN B 264 -62.159 10.276 1.727 1.00 0.00 H ATOM 7035 HE21 GLN B 264 -61.054 10.144 3.144 1.00 0.00 H ATOM 7036 H GLN B 264 -63.030 14.797 1.809 1.00 0.00 H ATOM 7037 N GLY B 265 -65.368 16.243 3.866 1.00 15.60 N ATOM 7038 CA GLY B 265 -66.141 17.180 4.661 1.00 17.49 C ATOM 7039 C GLY B 265 -67.173 17.896 3.804 1.00 16.76 C ATOM 7040 O GLY B 265 -68.351 17.993 4.163 1.00 19.09 O ATOM 7041 HA3 GLY B 265 -65.468 17.917 5.100 1.00 0.00 H ATOM 7042 HA2 GLY B 265 -66.652 16.637 5.456 1.00 0.00 H ATOM 7043 H GLY B 265 -64.337 16.361 3.791 1.00 0.00 H ATOM 7044 N ALA B 266 -66.742 18.403 2.658 1.00 15.76 N ATOM 7045 CA ALA B 266 -67.671 19.097 1.774 1.00 18.41 C ATOM 7046 C ALA B 266 -68.768 18.155 1.252 1.00 19.60 C ATOM 7047 O ALA B 266 -69.896 18.573 1.026 1.00 19.04 O ATOM 7048 CB ALA B 266 -66.938 19.775 0.635 1.00 17.42 C ATOM 7049 HA ALA B 266 -68.164 19.872 2.361 1.00 0.00 H ATOM 7050 HB1 ALA B 266 -66.233 20.501 1.040 1.00 0.00 H ATOM 7051 HB2 ALA B 266 -66.398 19.026 0.055 1.00 0.00 H ATOM 7052 HB3 ALA B 266 -67.657 20.284 -0.007 1.00 0.00 H ATOM 7053 H ALA B 266 -65.742 18.306 2.389 1.00 0.00 H ATOM 7054 N ASP B 267 -68.437 16.883 1.085 1.00 18.11 N ATOM 7055 CA ASP B 267 -69.418 15.886 0.657 1.00 20.49 C ATOM 7056 C ASP B 267 -70.433 15.624 1.773 1.00 22.39 C ATOM 7057 O ASP B 267 -71.642 15.605 1.536 1.00 23.12 O ATOM 7058 CB ASP B 267 -68.685 14.600 0.221 1.00 20.89 C ATOM 7059 CG ASP B 267 -69.625 13.418 -0.029 1.00 28.43 C ATOM 7060 OD1 ASP B 267 -70.645 13.575 -0.734 1.00 28.95 O ATOM 7061 OD2 ASP B 267 -69.310 12.306 0.450 1.00 32.06 O ATOM 7062 HA ASP B 267 -69.978 16.260 -0.200 1.00 0.00 H ATOM 7063 HB2 ASP B 267 -68.139 14.808 -0.699 1.00 0.00 H ATOM 7064 HB3 ASP B 267 -67.980 14.321 1.004 1.00 0.00 H ATOM 7065 H ASP B 267 -67.456 16.586 1.262 1.00 0.00 H ATOM 7066 N ILE B 268 -69.941 15.454 2.999 1.00 21.03 N ATOM 7067 CA ILE B 268 -70.805 15.261 4.161 1.00 19.94 C ATOM 7068 C ILE B 268 -71.720 16.466 4.401 1.00 23.07 C ATOM 7069 O ILE B 268 -72.914 16.310 4.677 1.00 20.51 O ATOM 7070 CB ILE B 268 -69.970 14.979 5.423 1.00 23.90 C ATOM 7071 CG1 ILE B 268 -69.322 13.592 5.332 1.00 20.39 C ATOM 7072 CG2 ILE B 268 -70.827 15.085 6.664 1.00 25.92 C ATOM 7073 CD1 ILE B 268 -68.034 13.448 6.170 1.00 19.23 C ATOM 7074 HA ILE B 268 -71.435 14.397 3.948 1.00 0.00 H ATOM 7075 HB ILE B 268 -69.180 15.728 5.490 1.00 0.00 H ATOM 7076 HG12 ILE B 268 -70.043 12.852 5.680 1.00 0.00 H ATOM 7077 HG13 ILE B 268 -69.077 13.395 4.288 1.00 0.00 H ATOM 7078 HD11 ILE B 268 -67.296 14.173 5.827 1.00 0.00 H ATOM 7079 HD12 ILE B 268 -68.263 13.630 7.220 1.00 0.00 H ATOM 7080 HD13 ILE B 268 -67.637 12.440 6.053 1.00 0.00 H ATOM 7081 HG21 ILE B 268 -71.242 16.090 6.732 1.00 0.00 H ATOM 7082 HG22 ILE B 268 -71.638 14.359 6.607 1.00 0.00 H ATOM 7083 HG23 ILE B 268 -70.217 14.882 7.544 1.00 0.00 H ATOM 7084 H ILE B 268 -68.910 15.459 3.133 1.00 0.00 H ATOM 7085 N VAL B 269 -71.163 17.668 4.286 1.00 21.60 N ATOM 7086 CA VAL B 269 -71.960 18.885 4.437 1.00 25.71 C ATOM 7087 C VAL B 269 -73.086 18.901 3.408 1.00 23.44 C ATOM 7088 O VAL B 269 -74.233 19.177 3.742 1.00 22.57 O ATOM 7089 CB VAL B 269 -71.099 20.175 4.324 1.00 22.68 C ATOM 7090 CG1 VAL B 269 -71.975 21.407 4.198 1.00 25.93 C ATOM 7091 CG2 VAL B 269 -70.205 20.311 5.529 1.00 18.32 C ATOM 7092 HA VAL B 269 -72.385 18.876 5.441 1.00 0.00 H ATOM 7093 HB VAL B 269 -70.487 20.092 3.426 1.00 0.00 H ATOM 7094 HG11 VAL B 269 -72.594 21.321 3.305 1.00 0.00 H ATOM 7095 HG12 VAL B 269 -72.613 21.489 5.078 1.00 0.00 H ATOM 7096 HG13 VAL B 269 -71.345 22.293 4.121 1.00 0.00 H ATOM 7097 HG21 VAL B 269 -70.817 20.367 6.429 1.00 0.00 H ATOM 7098 HG22 VAL B 269 -69.545 19.445 5.590 1.00 0.00 H ATOM 7099 HG23 VAL B 269 -69.608 21.218 5.436 1.00 0.00 H ATOM 7100 H VAL B 269 -70.145 17.744 4.086 1.00 0.00 H ATOM 7101 N LYS B 270 -72.753 18.583 2.161 1.00 23.89 N ATOM 7102 CA LYS B 270 -73.743 18.552 1.079 1.00 25.65 C ATOM 7103 C LYS B 270 -74.910 17.606 1.385 1.00 24.07 C ATOM 7104 O LYS B 270 -76.080 17.989 1.293 1.00 27.14 O ATOM 7105 CB LYS B 270 -73.067 18.148 -0.235 1.00 28.94 C ATOM 7106 CG LYS B 270 -73.755 18.644 -1.486 1.00 33.68 C ATOM 7107 CD LYS B 270 -73.021 18.177 -2.752 1.00 35.35 C ATOM 7108 CE LYS B 270 -73.119 16.654 -2.956 1.00 37.89 C ATOM 7109 NZ LYS B 270 -71.907 15.899 -2.469 1.00 33.46 N ATOM 7110 HA LYS B 270 -74.158 19.556 0.986 1.00 0.00 H ATOM 7111 HB2 LYS B 270 -72.051 18.543 -0.228 1.00 0.00 H ATOM 7112 HB3 LYS B 270 -73.032 17.059 -0.277 1.00 0.00 H ATOM 7113 HG2 LYS B 270 -74.775 18.261 -1.506 1.00 0.00 H ATOM 7114 HG3 LYS B 270 -73.778 19.734 -1.470 1.00 0.00 H ATOM 7115 HD2 LYS B 270 -73.460 18.676 -3.616 1.00 0.00 H ATOM 7116 HD3 LYS B 270 -71.970 18.453 -2.670 1.00 0.00 H ATOM 7117 HE2 LYS B 270 -73.244 16.456 -4.021 1.00 0.00 H ATOM 7118 HE3 LYS B 270 -73.992 16.289 -2.415 1.00 0.00 H ATOM 7119 HZ1 LYS B 270 -71.065 16.228 -2.984 1.00 0.00 H ATOM 7120 HZ2 LYS B 270 -71.780 16.069 -1.451 1.00 0.00 H ATOM 7121 HZ3 LYS B 270 -72.043 14.882 -2.638 1.00 0.00 H ATOM 7122 H LYS B 270 -71.763 18.350 1.946 1.00 0.00 H ATOM 7123 N ARG B 271 -74.597 16.369 1.742 1.00 24.30 N ATOM 7124 CA ARG B 271 -75.633 15.373 2.031 1.00 27.15 C ATOM 7125 C ARG B 271 -76.473 15.750 3.256 1.00 23.41 C ATOM 7126 O ARG B 271 -77.694 15.565 3.275 1.00 23.07 O ATOM 7127 CB ARG B 271 -75.009 13.986 2.242 1.00 23.21 C ATOM 7128 CG ARG B 271 -75.050 13.074 1.023 1.00 26.04 C ATOM 7129 CD ARG B 271 -74.278 13.651 -0.150 1.00 31.51 C ATOM 7130 NE ARG B 271 -74.456 12.846 -1.361 1.00 34.63 N ATOM 7131 CZ ARG B 271 -73.545 12.010 -1.853 1.00 35.63 C ATOM 7132 NH1 ARG B 271 -72.371 11.867 -1.251 1.00 34.34 N ATOM 7133 NH2 ARG B 271 -73.804 11.324 -2.963 1.00 37.33 N ATOM 7134 HA ARG B 271 -76.294 15.347 1.165 1.00 0.00 H ATOM 7135 HB2 ARG B 271 -73.966 14.123 2.528 1.00 0.00 H ATOM 7136 HB3 ARG B 271 -75.545 13.493 3.053 1.00 0.00 H ATOM 7137 HG2 ARG B 271 -74.616 12.111 1.290 1.00 0.00 H ATOM 7138 HG3 ARG B 271 -76.089 12.933 0.725 1.00 0.00 H ATOM 7139 HD2 ARG B 271 -73.218 13.680 0.103 1.00 0.00 H ATOM 7140 HD3 ARG B 271 -74.632 14.664 -0.343 1.00 0.00 H ATOM 7141 HE ARG B 271 -75.358 12.934 -1.872 1.00 0.00 H ATOM 7142 HH12 ARG B 271 -71.663 11.212 -1.640 1.00 0.00 H ATOM 7143 HH11 ARG B 271 -72.159 12.410 -0.390 1.00 0.00 H ATOM 7144 HH22 ARG B 271 -73.093 10.670 -3.348 1.00 0.00 H ATOM 7145 HH21 ARG B 271 -74.718 11.441 -3.445 1.00 0.00 H ATOM 7146 H ARG B 271 -73.596 16.099 1.819 1.00 0.00 H ATOM 7147 N SER B 272 -75.807 16.261 4.286 1.00 22.32 N ATOM 7148 CA SER B 272 -76.493 16.689 5.500 1.00 24.89 C ATOM 7149 C SER B 272 -77.439 17.842 5.203 1.00 25.88 C ATOM 7150 O SER B 272 -78.586 17.852 5.657 1.00 26.29 O ATOM 7151 CB SER B 272 -75.483 17.095 6.574 1.00 24.09 C ATOM 7152 OG SER B 272 -74.842 15.950 7.107 1.00 30.34 O ATOM 7153 HA SER B 272 -77.078 15.849 5.874 1.00 0.00 H ATOM 7154 HB2 SER B 272 -76.002 17.622 7.375 1.00 0.00 H ATOM 7155 HB3 SER B 272 -74.735 17.753 6.133 1.00 0.00 H ATOM 7156 HG SER B 272 -74.368 15.471 6.382 1.00 0.00 H ATOM 7157 H SER B 272 -74.773 16.358 4.225 1.00 0.00 H ATOM 7158 N ASP B 273 -76.965 18.810 4.428 1.00 24.82 N ATOM 7159 CA ASP B 273 -77.827 19.915 3.999 1.00 22.89 C ATOM 7160 C ASP B 273 -79.056 19.400 3.256 1.00 27.66 C ATOM 7161 O ASP B 273 -80.159 19.906 3.455 1.00 26.69 O ATOM 7162 CB ASP B 273 -77.059 20.902 3.119 1.00 26.47 C ATOM 7163 CG ASP B 273 -76.123 21.794 3.919 1.00 31.55 C ATOM 7164 OD1 ASP B 273 -76.210 21.783 5.165 1.00 34.04 O ATOM 7165 OD2 ASP B 273 -75.297 22.503 3.304 1.00 35.81 O ATOM 7166 HA ASP B 273 -78.159 20.435 4.897 1.00 0.00 H ATOM 7167 HB2 ASP B 273 -76.471 20.339 2.394 1.00 0.00 H ATOM 7168 HB3 ASP B 273 -77.776 21.532 2.592 1.00 0.00 H ATOM 7169 H ASP B 273 -75.971 18.784 4.122 1.00 0.00 H ATOM 7170 N ALA B 274 -78.864 18.397 2.400 1.00 24.68 N ATOM 7171 CA ALA B 274 -79.974 17.805 1.643 1.00 24.78 C ATOM 7172 C ALA B 274 -81.008 17.114 2.536 1.00 27.14 C ATOM 7173 O ALA B 274 -82.224 17.200 2.289 1.00 26.85 O ATOM 7174 CB ALA B 274 -79.447 16.836 0.599 1.00 27.92 C ATOM 7175 HA ALA B 274 -80.488 18.629 1.149 1.00 0.00 H ATOM 7176 HB1 ALA B 274 -78.791 17.368 -0.090 1.00 0.00 H ATOM 7177 HB2 ALA B 274 -78.889 16.040 1.093 1.00 0.00 H ATOM 7178 HB3 ALA B 274 -80.284 16.407 0.048 1.00 0.00 H ATOM 7179 H ALA B 274 -77.903 18.024 2.265 1.00 0.00 H ATOM 7180 N LEU B 275 -80.536 16.416 3.568 1.00 22.87 N ATOM 7181 CA LEU B 275 -81.449 15.822 4.536 1.00 22.10 C ATOM 7182 C LEU B 275 -82.233 16.946 5.194 1.00 28.75 C ATOM 7183 O LEU B 275 -83.444 16.845 5.400 1.00 26.28 O ATOM 7184 CB LEU B 275 -80.695 15.017 5.601 1.00 25.13 C ATOM 7185 CG LEU B 275 -80.270 13.570 5.294 1.00 28.45 C ATOM 7186 CD1 LEU B 275 -79.223 13.061 6.289 1.00 20.43 C ATOM 7187 CD2 LEU B 275 -81.477 12.639 5.290 1.00 21.91 C ATOM 7188 HA LEU B 275 -82.118 15.132 4.022 1.00 0.00 H ATOM 7189 HB2 LEU B 275 -79.787 15.572 5.835 1.00 0.00 H ATOM 7190 HB3 LEU B 275 -81.334 14.980 6.483 1.00 0.00 H ATOM 7191 HG LEU B 275 -79.819 13.573 4.301 1.00 0.00 H ATOM 7192 HD21 LEU B 275 -81.957 12.664 6.268 1.00 0.00 H ATOM 7193 HD22 LEU B 275 -82.184 12.967 4.528 1.00 0.00 H ATOM 7194 HD23 LEU B 275 -81.150 11.623 5.071 1.00 0.00 H ATOM 7195 HD11 LEU B 275 -78.338 13.696 6.240 1.00 0.00 H ATOM 7196 HD12 LEU B 275 -79.637 13.090 7.297 1.00 0.00 H ATOM 7197 HD13 LEU B 275 -78.951 12.036 6.036 1.00 0.00 H ATOM 7198 H LEU B 275 -79.510 16.294 3.683 1.00 0.00 H ATOM 7199 N TYR B 276 -81.530 18.024 5.519 1.00 25.27 N ATOM 7200 CA TYR B 276 -82.153 19.123 6.254 1.00 30.26 C ATOM 7201 C TYR B 276 -83.250 19.789 5.438 1.00 29.20 C ATOM 7202 O TYR B 276 -84.291 20.160 5.974 1.00 31.52 O ATOM 7203 CB TYR B 276 -81.108 20.150 6.693 1.00 28.51 C ATOM 7204 CG TYR B 276 -81.704 21.420 7.261 1.00 38.93 C ATOM 7205 CD1 TYR B 276 -82.090 21.500 8.597 1.00 40.90 C ATOM 7206 CD2 TYR B 276 -81.879 22.544 6.458 1.00 40.30 C ATOM 7207 CE1 TYR B 276 -82.637 22.668 9.116 1.00 39.20 C ATOM 7208 CE2 TYR B 276 -82.420 23.713 6.968 1.00 41.92 C ATOM 7209 CZ TYR B 276 -82.796 23.770 8.293 1.00 42.99 C ATOM 7210 OH TYR B 276 -83.333 24.938 8.789 1.00 52.63 O ATOM 7211 HA TYR B 276 -82.613 18.699 7.146 1.00 0.00 H ATOM 7212 HB3 TYR B 276 -80.498 20.412 5.828 1.00 0.00 H ATOM 7213 HB2 TYR B 276 -80.477 19.695 7.456 1.00 0.00 H ATOM 7214 HD2 TYR B 276 -81.585 22.503 5.409 1.00 0.00 H ATOM 7215 HE2 TYR B 276 -82.548 24.584 6.325 1.00 0.00 H ATOM 7216 HE1 TYR B 276 -82.938 22.716 10.162 1.00 0.00 H ATOM 7217 HD1 TYR B 276 -81.961 20.633 9.246 1.00 0.00 H ATOM 7218 HH TYR B 276 -83.550 24.819 9.748 1.00 0.00 H ATOM 7219 H TYR B 276 -80.528 18.087 5.248 1.00 0.00 H ATOM 7220 N GLN B 277 -83.018 19.922 4.137 1.00 29.79 N ATOM 7221 CA GLN B 277 -83.982 20.559 3.256 1.00 34.61 C ATOM 7222 C GLN B 277 -85.244 19.717 3.067 1.00 33.61 C ATOM 7223 O GLN B 277 -86.343 20.252 2.929 1.00 38.03 O ATOM 7224 CB GLN B 277 -83.333 20.893 1.911 1.00 32.39 C ATOM 7225 CG GLN B 277 -82.363 22.058 1.977 1.00 39.68 C ATOM 7226 CD GLN B 277 -83.069 23.372 2.266 1.00 40.90 C ATOM 7227 OE1 GLN B 277 -84.095 23.684 1.657 1.00 46.32 O ATOM 7228 NE2 GLN B 277 -82.528 24.146 3.204 1.00 40.00 N ATOM 7229 HA GLN B 277 -84.297 21.487 3.733 1.00 0.00 H ATOM 7230 HB2 GLN B 277 -82.792 20.014 1.561 1.00 0.00 H ATOM 7231 HB3 GLN B 277 -84.121 21.140 1.200 1.00 0.00 H ATOM 7232 HG2 GLN B 277 -81.637 21.867 2.767 1.00 0.00 H ATOM 7233 HG3 GLN B 277 -81.845 22.139 1.021 1.00 0.00 H ATOM 7234 HE22 GLN B 277 -81.661 23.843 3.692 1.00 0.00 H ATOM 7235 HE21 GLN B 277 -82.972 25.054 3.449 1.00 0.00 H ATOM 7236 H GLN B 277 -82.127 19.562 3.740 1.00 0.00 H ATOM 7237 N ILE B 278 -85.088 18.399 3.064 1.00 31.82 N ATOM 7238 CA ILE B 278 -86.228 17.498 2.928 1.00 32.13 C ATOM 7239 C ILE B 278 -87.173 17.627 4.120 1.00 34.32 C ATOM 7240 O ILE B 278 -88.391 17.644 3.963 1.00 37.89 O ATOM 7241 CB ILE B 278 -85.775 16.029 2.774 1.00 29.89 C ATOM 7242 CG1 ILE B 278 -85.232 15.787 1.359 1.00 27.71 C ATOM 7243 CG2 ILE B 278 -86.923 15.080 3.084 1.00 30.56 C ATOM 7244 CD1 ILE B 278 -84.502 14.470 1.191 1.00 30.16 C ATOM 7245 HA ILE B 278 -86.760 17.789 2.023 1.00 0.00 H ATOM 7246 HB ILE B 278 -84.974 15.834 3.487 1.00 0.00 H ATOM 7247 HG12 ILE B 278 -86.071 15.805 0.663 1.00 0.00 H ATOM 7248 HG13 ILE B 278 -84.542 16.594 1.115 1.00 0.00 H ATOM 7249 HD11 ILE B 278 -83.651 14.439 1.871 1.00 0.00 H ATOM 7250 HD12 ILE B 278 -85.181 13.648 1.419 1.00 0.00 H ATOM 7251 HD13 ILE B 278 -84.151 14.379 0.163 1.00 0.00 H ATOM 7252 HG21 ILE B 278 -87.259 15.241 4.108 1.00 0.00 H ATOM 7253 HG22 ILE B 278 -87.746 15.271 2.396 1.00 0.00 H ATOM 7254 HG23 ILE B 278 -86.583 14.051 2.970 1.00 0.00 H ATOM 7255 H ILE B 278 -84.133 18.000 3.161 1.00 0.00 H ATOM 7256 N GLN B 279 -86.602 17.727 5.313 1.00 31.53 N ATOM 7257 CA GLN B 279 -87.391 17.923 6.516 1.00 35.48 C ATOM 7258 C GLN B 279 -88.061 19.295 6.531 1.00 39.20 C ATOM 7259 O GLN B 279 -89.193 19.443 6.996 1.00 41.14 O ATOM 7260 CB GLN B 279 -86.510 17.741 7.749 1.00 33.59 C ATOM 7261 CG GLN B 279 -85.994 16.321 7.894 1.00 30.46 C ATOM 7262 CD GLN B 279 -87.123 15.313 7.933 1.00 32.06 C ATOM 7263 OE1 GLN B 279 -88.163 15.553 8.550 1.00 30.83 O ATOM 7264 NE2 GLN B 279 -86.929 14.180 7.271 1.00 30.01 N ATOM 7265 HA GLN B 279 -88.183 17.174 6.529 1.00 0.00 H ATOM 7266 HB2 GLN B 279 -85.658 18.416 7.672 1.00 0.00 H ATOM 7267 HB3 GLN B 279 -87.093 17.993 8.635 1.00 0.00 H ATOM 7268 HG2 GLN B 279 -85.346 16.093 7.048 1.00 0.00 H ATOM 7269 HG3 GLN B 279 -85.422 16.246 8.819 1.00 0.00 H ATOM 7270 HE22 GLN B 279 -86.035 14.020 6.764 1.00 0.00 H ATOM 7271 HE21 GLN B 279 -87.671 13.451 7.259 1.00 0.00 H ATOM 7272 H GLN B 279 -85.567 17.664 5.388 1.00 0.00 H ATOM 7273 N LEU B 280 -87.358 20.294 6.012 1.00 38.34 N ATOM 7274 CA LEU B 280 -87.852 21.665 6.015 1.00 43.17 C ATOM 7275 C LEU B 280 -89.032 21.804 5.058 1.00 44.48 C ATOM 7276 O LEU B 280 -90.020 22.472 5.361 1.00 46.64 O ATOM 7277 CB LEU B 280 -86.726 22.626 5.629 1.00 41.65 C ATOM 7278 CG LEU B 280 -87.000 24.129 5.666 1.00 45.79 C ATOM 7279 CD1 LEU B 280 -87.232 24.589 7.087 1.00 47.89 C ATOM 7280 CD2 LEU B 280 -85.840 24.892 5.050 1.00 46.54 C ATOM 7281 HA LEU B 280 -88.195 21.917 7.018 1.00 0.00 H ATOM 7282 HB2 LEU B 280 -85.894 22.434 6.306 1.00 0.00 H ATOM 7283 HB3 LEU B 280 -86.428 22.379 4.610 1.00 0.00 H ATOM 7284 HG LEU B 280 -87.900 24.331 5.084 1.00 0.00 H ATOM 7285 HD21 LEU B 280 -84.930 24.682 5.611 1.00 0.00 H ATOM 7286 HD22 LEU B 280 -85.710 24.579 4.014 1.00 0.00 H ATOM 7287 HD23 LEU B 280 -86.051 25.961 5.084 1.00 0.00 H ATOM 7288 HD11 LEU B 280 -88.090 24.061 7.503 1.00 0.00 H ATOM 7289 HD12 LEU B 280 -86.347 24.375 7.686 1.00 0.00 H ATOM 7290 HD13 LEU B 280 -87.425 25.662 7.093 1.00 0.00 H ATOM 7291 H LEU B 280 -86.428 20.093 5.591 1.00 0.00 H ATOM 7292 N GLU B 281 -88.928 21.156 3.903 1.00 43.81 N ATOM 7293 CA GLU B 281 -89.998 21.175 2.917 1.00 43.03 C ATOM 7294 C GLU B 281 -91.082 20.158 3.258 1.00 50.47 C ATOM 7295 O GLU B 281 -91.933 19.835 2.426 1.00 53.16 O ATOM 7296 CB GLU B 281 -89.433 20.888 1.531 1.00 49.55 C ATOM 7297 CG GLU B 281 -88.304 21.816 1.133 1.00 50.22 C ATOM 7298 CD GLU B 281 -87.732 21.476 -0.227 1.00 58.79 C ATOM 7299 OE1 GLU B 281 -88.399 20.731 -0.983 1.00 60.83 O ATOM 7300 OE2 GLU B 281 -86.618 21.953 -0.538 1.00 55.86 O ATOM 7301 HA GLU B 281 -90.450 22.167 2.926 1.00 0.00 H ATOM 7302 HB2 GLU B 281 -89.060 19.864 1.516 1.00 0.00 H ATOM 7303 HB3 GLU B 281 -90.237 20.991 0.802 1.00 0.00 H ATOM 7304 HG2 GLU B 281 -88.682 22.838 1.109 1.00 0.00 H ATOM 7305 HG3 GLU B 281 -87.510 21.741 1.876 1.00 0.00 H ATOM 7306 H GLU B 281 -88.060 20.621 3.698 1.00 0.00 H ATOM 7307 N ARG B 282 -91.048 19.659 4.489 1.00 48.13 N ATOM 7308 CA ARG B 282 -92.015 18.665 4.935 1.00 49.72 C ATOM 7309 C ARG B 282 -92.873 19.204 6.077 1.00 50.31 C ATOM 7310 O ARG B 282 -93.549 20.223 5.931 1.00 50.26 O ATOM 7311 CB ARG B 282 -91.293 17.391 5.374 1.00 45.31 C ATOM 7312 CG ARG B 282 -92.211 16.267 5.806 1.00 48.51 C ATOM 7313 CD ARG B 282 -91.408 15.011 6.092 1.00 46.82 C ATOM 7314 NE ARG B 282 -90.617 14.596 4.936 1.00 46.87 N ATOM 7315 CZ ARG B 282 -89.909 13.471 4.884 1.00 41.63 C ATOM 7316 NH1 ARG B 282 -89.891 12.654 5.923 1.00 40.73 N ATOM 7317 NH2 ARG B 282 -89.219 13.162 3.796 1.00 39.87 N ATOM 7318 HA ARG B 282 -92.674 18.433 4.098 1.00 0.00 H ATOM 7319 HB2 ARG B 282 -90.689 17.036 4.539 1.00 0.00 H ATOM 7320 HB3 ARG B 282 -90.641 17.640 6.212 1.00 0.00 H ATOM 7321 HG2 ARG B 282 -92.746 16.565 6.708 1.00 0.00 H ATOM 7322 HG3 ARG B 282 -92.928 16.062 5.011 1.00 0.00 H ATOM 7323 HD2 ARG B 282 -92.094 14.206 6.357 1.00 0.00 H ATOM 7324 HD3 ARG B 282 -90.736 15.205 6.928 1.00 0.00 H ATOM 7325 HE ARG B 282 -90.607 15.218 4.103 1.00 0.00 H ATOM 7326 HH12 ARG B 282 -89.338 11.774 5.883 1.00 0.00 H ATOM 7327 HH11 ARG B 282 -90.430 12.891 6.780 1.00 0.00 H ATOM 7328 HH22 ARG B 282 -88.668 12.281 3.763 1.00 0.00 H ATOM 7329 HH21 ARG B 282 -89.229 13.801 2.975 1.00 0.00 H ATOM 7330 H ARG B 282 -90.314 19.986 5.149 1.00 0.00 H TER 7331 ARG B 282 HETATM 7332 NA NA A 1 -21.252 2.122 13.267 1.00 47.47 NA HETATM 7333 NA NA A 2 -22.011 0.868 19.418 1.00 47.33 NA HETATM 7334 O HOH 3 -93.139 32.568 3.792 1.00 39.78 O HETATM 7335 O HOH 4 -85.821 36.593 3.586 1.00 28.54 O HETATM 7336 O HOH 5 -90.988 34.341 3.432 1.00 38.24 O HETATM 7337 O HOH 6 -89.932 34.457 7.085 1.00 33.00 O HETATM 7338 O HOH 7 -79.910 35.490 3.494 1.00 29.59 O HETATM 7339 O HOH 8 -76.720 26.011 7.861 1.00 41.73 O HETATM 7340 O HOH 9 -75.975 33.081 -0.711 1.00 31.63 O HETATM 7341 O HOH 10 -79.274 33.613 1.568 1.00 34.05 O HETATM 7342 O HOH 11 -72.991 31.062 0.783 1.00 36.03 O HETATM 7343 O HOH 12 -71.713 24.052 7.238 1.00 31.76 O HETATM 7344 O HOH 13 -73.700 35.636 3.386 1.00 27.63 O HETATM 7345 O HOH 14 -68.482 33.571 6.649 1.00 21.26 O HETATM 7346 O HOH 15 -70.519 27.100 13.839 1.00 16.63 O HETATM 7347 O HOH 16 -72.752 24.968 9.777 1.00 28.44 O HETATM 7348 O HOH 17 -64.347 28.336 5.875 1.00 17.77 O HETATM 7349 O HOH 18 -66.121 25.977 5.852 1.00 18.61 O HETATM 7350 O HOH 19 -71.497 30.447 4.198 1.00 28.55 O HETATM 7351 O HOH 20 -91.632 34.635 0.651 1.00 41.69 O HETATM 7352 O HOH 21 -92.100 36.857 2.882 1.00 31.32 O HETATM 7353 O HOH 22 -70.579 24.025 17.200 1.00 26.27 O HETATM 7354 O HOH 23 -58.095 31.136 6.717 1.00 16.41 O HETATM 7355 O HOH 24 -72.540 21.431 8.270 1.00 26.05 O HETATM 7356 O HOH 25 -72.964 27.420 14.289 1.00 33.01 O HETATM 7357 O HOH 26 -65.435 25.096 3.375 1.00 27.28 O HETATM 7358 O HOH 27 -72.714 24.693 15.539 1.00 29.50 O HETATM 7359 O HOH 28 -71.392 24.124 19.589 1.00 30.87 O HETATM 7360 O HOH 29 -61.781 28.943 4.366 1.00 19.31 O HETATM 7361 O HOH 30 -54.351 26.318 6.806 1.00 11.59 O HETATM 7362 O HOH 31 -61.031 25.414 2.468 1.00 39.00 O HETATM 7363 O HOH 32 -54.990 27.695 4.765 1.00 28.40 O HETATM 7364 O HOH 33 -54.767 43.820 5.320 1.00 31.49 O HETATM 7365 O HOH 34 -58.275 43.740 1.813 1.00 21.97 O HETATM 7366 O HOH 35 -59.271 45.778 3.279 1.00 36.65 O HETATM 7367 O HOH 36 -49.361 25.379 6.844 1.00 34.90 O HETATM 7368 O HOH 37 -46.961 35.592 2.879 1.00 36.71 O HETATM 7369 O HOH 38 -50.454 30.465 0.966 1.00 30.67 O HETATM 7370 O HOH 39 -55.462 41.312 3.835 1.00 34.07 O HETATM 7371 O HOH 40 -53.584 40.625 7.892 1.00 30.07 O HETATM 7372 O HOH 41 -47.969 28.284 13.939 1.00 31.98 O HETATM 7373 O HOH 42 -45.561 31.422 11.754 1.00 33.03 O HETATM 7374 O HOH 43 -61.308 40.652 1.266 1.00 33.04 O HETATM 7375 O HOH 44 -57.917 41.782 3.696 1.00 31.39 O HETATM 7376 O HOH 45 -58.148 28.813 2.515 1.00 36.01 O HETATM 7377 O HOH 46 -51.416 30.070 3.615 1.00 32.75 O HETATM 7378 O HOH 47 -47.633 32.157 3.023 1.00 35.42 O HETATM 7379 O HOH 48 -62.799 44.531 25.156 1.00 39.56 O HETATM 7380 O HOH 49 -46.437 37.899 3.785 1.00 33.39 O HETATM 7381 O HOH 50 -53.361 39.775 4.965 1.00 23.63 O HETATM 7382 O HOH 51 -47.084 36.146 6.173 1.00 27.66 O HETATM 7383 O HOH 52 -50.971 39.330 8.866 1.00 26.19 O HETATM 7384 O HOH 53 -44.473 43.937 19.165 1.00 38.50 O HETATM 7385 O HOH 54 -48.998 34.147 3.684 1.00 29.63 O HETATM 7386 O HOH 55 -49.925 32.683 -0.319 1.00 26.77 O HETATM 7387 O HOH 56 -75.262 47.382 10.719 1.00 36.84 O HETATM 7388 O HOH 57 -41.389 44.815 12.191 1.00 33.42 O HETATM 7389 O HOH 58 -40.831 44.564 15.375 1.00 25.82 O HETATM 7390 O HOH 59 -59.487 39.889 3.115 1.00 27.60 O HETATM 7391 O HOH 60 -56.979 29.539 4.905 1.00 20.90 O HETATM 7392 O HOH 61 -66.099 37.754 1.874 1.00 24.20 O HETATM 7393 O HOH 62 -70.039 40.855 23.927 1.00 36.72 O HETATM 7394 O HOH 63 -71.705 42.785 24.753 1.00 30.60 O HETATM 7395 O HOH 64 -63.954 29.720 0.752 1.00 37.11 O HETATM 7396 O HOH 65 -73.083 46.106 15.299 1.00 34.55 O HETATM 7397 O HOH 66 -68.305 48.609 20.582 1.00 34.00 O HETATM 7398 O HOH 67 -68.235 42.836 6.260 1.00 38.16 O HETATM 7399 O HOH 68 -61.648 42.818 6.103 1.00 38.63 O HETATM 7400 O HOH 69 -62.224 41.338 4.031 1.00 28.58 O HETATM 7401 O HOH 70 -64.265 43.219 23.634 1.00 26.51 O HETATM 7402 O HOH 71 -58.302 47.264 12.950 1.00 38.00 O HETATM 7403 O HOH 72 -69.453 47.724 12.009 1.00 37.59 O HETATM 7404 O HOH 73 -72.608 38.135 3.603 1.00 28.11 O HETATM 7405 O HOH 74 -71.582 42.721 12.477 1.00 28.59 O HETATM 7406 O HOH 75 -49.471 43.827 20.789 1.00 40.44 O HETATM 7407 O HOH 76 -70.436 38.329 1.266 1.00 28.86 O HETATM 7408 O HOH 77 -47.162 43.408 18.591 1.00 34.89 O HETATM 7409 O HOH 78 -55.269 51.671 17.875 1.00 35.19 O HETATM 7410 O HOH 79 -49.745 29.185 18.049 1.00 32.46 O HETATM 7411 O HOH 80 -75.064 39.056 3.785 1.00 27.51 O HETATM 7412 O HOH 81 -77.545 37.769 2.175 1.00 33.47 O HETATM 7413 O HOH 82 -43.938 43.725 12.659 1.00 31.70 O HETATM 7414 O HOH 83 -42.610 43.332 16.672 1.00 24.98 O HETATM 7415 O HOH 84 -42.623 42.012 19.994 1.00 27.99 O HETATM 7416 O HOH 85 -57.740 28.172 27.681 1.00 22.02 O HETATM 7417 O HOH 86 -77.539 45.477 14.673 1.00 27.38 O HETATM 7418 O HOH 87 -39.391 42.620 11.180 1.00 25.37 O HETATM 7419 O HOH 88 -38.193 43.428 15.991 1.00 22.80 O HETATM 7420 O HOH 89 -35.111 42.591 13.027 1.00 34.56 O HETATM 7421 O HOH 90 -40.931 39.197 8.207 1.00 38.13 O HETATM 7422 O HOH 91 -30.771 36.974 8.808 1.00 25.56 O HETATM 7423 O HOH 92 -74.383 27.084 26.798 1.00 38.96 O HETATM 7424 O HOH 93 -77.541 47.090 9.297 1.00 32.65 O HETATM 7425 O HOH 94 -36.126 30.191 8.664 1.00 39.85 O HETATM 7426 O HOH 95 -28.507 38.916 8.902 1.00 36.95 O HETATM 7427 O HOH 96 -28.224 42.960 14.765 1.00 34.53 O HETATM 7428 O HOH 97 -85.252 47.809 5.957 1.00 30.36 O HETATM 7429 O HOH 98 -88.090 41.503 6.008 1.00 31.80 O HETATM 7430 O HOH 99 -84.378 39.133 5.431 1.00 25.75 O HETATM 7431 O HOH 100 -85.137 45.798 11.717 1.00 23.76 O HETATM 7432 O HOH 101 -86.344 47.476 9.954 1.00 27.91 O HETATM 7433 O HOH 102 -86.981 44.993 4.993 1.00 30.07 O HETATM 7434 O HOH 103 -85.495 45.220 20.158 1.00 21.51 O HETATM 7435 O HOH 104 -85.661 36.598 23.258 1.00 41.35 O HETATM 7436 O HOH 105 -84.558 38.785 22.260 1.00 36.43 O HETATM 7437 O HOH 106 -79.946 45.201 15.861 1.00 22.81 O HETATM 7438 O HOH 107 -82.403 39.999 26.151 1.00 33.91 O HETATM 7439 O HOH 108 -81.804 44.168 29.139 1.00 34.45 O HETATM 7440 O HOH 109 -81.988 38.759 23.952 1.00 32.06 O HETATM 7441 O HOH 110 -78.212 41.934 26.146 1.00 23.92 O HETATM 7442 O HOH 111 -73.370 40.143 23.056 1.00 24.92 O HETATM 7443 O HOH 112 -32.082 21.618 28.066 1.00 31.69 O HETATM 7444 O HOH 113 -70.731 44.366 14.632 1.00 26.46 O HETATM 7445 O HOH 114 -74.202 42.634 23.872 1.00 21.12 O HETATM 7446 O HOH 115 -70.025 46.596 20.883 1.00 27.12 O HETATM 7447 O HOH 116 -68.504 44.302 21.682 1.00 25.16 O HETATM 7448 O HOH 117 -71.147 46.438 18.540 1.00 24.69 O HETATM 7449 O HOH 118 -37.898 20.742 16.571 1.00 24.08 O HETATM 7450 O HOH 119 -73.670 36.885 20.535 1.00 23.87 O HETATM 7451 O HOH 120 -48.711 25.014 21.486 1.00 33.31 O HETATM 7452 O HOH 121 -68.517 48.664 16.001 1.00 41.86 O HETATM 7453 O HOH 122 -66.522 46.701 15.206 1.00 35.48 O HETATM 7454 O HOH 123 -64.453 45.979 16.668 1.00 23.92 O HETATM 7455 O HOH 124 -37.135 18.609 21.159 1.00 39.37 O HETATM 7456 O HOH 125 -62.559 41.385 22.440 1.00 20.82 O HETATM 7457 O HOH 126 -65.788 44.959 21.669 1.00 27.54 O HETATM 7458 O HOH 127 -63.213 31.544 15.533 1.00 16.09 O HETATM 7459 O HOH 128 -27.831 26.419 33.210 1.00 29.80 O HETATM 7460 O HOH 129 -30.576 29.253 34.822 1.00 31.17 O HETATM 7461 O HOH 130 -60.102 45.482 16.153 1.00 31.18 O HETATM 7462 O HOH 131 -59.803 45.027 13.726 1.00 34.00 O HETATM 7463 O HOH 132 -60.180 41.963 12.821 1.00 19.61 O HETATM 7464 O HOH 133 -68.731 45.595 13.282 1.00 37.41 O HETATM 7465 O HOH 134 -57.681 44.491 18.620 1.00 27.65 O HETATM 7466 O HOH 135 -54.502 47.576 15.204 1.00 28.99 O HETATM 7467 O HOH 136 -51.147 40.949 20.141 1.00 24.47 O HETATM 7468 O HOH 137 -52.946 49.091 18.053 1.00 39.95 O HETATM 7469 O HOH 138 -48.010 40.655 19.944 1.00 25.19 O HETATM 7470 O HOH 139 -53.698 47.179 19.886 1.00 36.71 O HETATM 7471 O HOH 140 -55.218 45.226 18.801 1.00 31.20 O HETATM 7472 O HOH 141 -47.320 43.251 16.005 1.00 21.85 O HETATM 7473 O HOH 142 -52.108 43.485 20.642 1.00 32.53 O HETATM 7474 O HOH 143 -50.336 28.790 14.902 1.00 27.69 O HETATM 7475 O HOH 144 -43.775 41.283 11.364 1.00 21.28 O HETATM 7476 O HOH 145 -50.546 41.915 9.611 1.00 31.29 O HETATM 7477 O HOH 146 -44.806 43.027 15.281 1.00 26.06 O HETATM 7478 O HOH 147 -41.725 40.982 17.960 1.00 19.24 O HETATM 7479 O HOH 148 -43.874 33.137 13.238 1.00 21.59 O HETATM 7480 O HOH 149 -48.293 31.236 26.116 1.00 30.15 O HETATM 7481 O HOH 150 -49.950 36.720 28.819 1.00 29.78 O HETATM 7482 O HOH 151 -47.086 40.367 27.561 1.00 40.01 O HETATM 7483 O HOH 152 -45.241 39.942 9.396 1.00 29.35 O HETATM 7484 O HOH 153 -40.068 35.617 10.366 1.00 23.64 O HETATM 7485 O HOH 154 -50.908 37.371 10.520 1.00 17.36 O HETATM 7486 O HOH 155 -55.544 29.095 26.632 1.00 23.84 O HETATM 7487 O HOH 156 -41.188 40.656 10.243 1.00 29.30 O HETATM 7488 O HOH 157 -37.710 42.182 13.440 1.00 22.67 O HETATM 7489 O HOH 158 -54.962 31.690 27.574 1.00 30.17 O HETATM 7490 O HOH 159 -63.740 28.247 26.610 1.00 26.05 O HETATM 7491 O HOH 160 -59.788 28.160 25.568 1.00 19.07 O HETATM 7492 O HOH 161 -37.247 30.833 12.690 1.00 24.77 O HETATM 7493 O HOH 162 -60.723 42.737 25.886 1.00 35.13 O HETATM 7494 O HOH 163 -66.453 26.647 23.609 1.00 23.86 O HETATM 7495 O HOH 164 -33.409 38.216 9.594 1.00 25.03 O HETATM 7496 O HOH 165 -72.316 28.343 25.547 1.00 34.57 O HETATM 7497 O HOH 166 -35.610 42.253 18.884 1.00 22.92 O HETATM 7498 O HOH 167 -71.842 30.972 25.896 1.00 34.02 O HETATM 7499 O HOH 168 -37.402 34.730 9.597 1.00 33.33 O HETATM 7500 O HOH 169 -35.658 32.763 14.061 1.00 22.91 O HETATM 7501 O HOH 170 -36.341 32.068 10.488 1.00 28.54 O HETATM 7502 O HOH 171 -84.379 33.145 22.480 1.00 33.73 O HETATM 7503 O HOH 172 -26.989 40.017 10.985 1.00 31.35 O HETATM 7504 O HOH 173 -32.966 42.191 11.358 1.00 31.25 O HETATM 7505 O HOH 174 -27.955 42.141 17.211 1.00 26.13 O HETATM 7506 O HOH 175 -31.464 41.944 16.013 1.00 29.08 O HETATM 7507 O HOH 176 -20.646 33.600 9.568 1.00 38.10 O HETATM 7508 O HOH 177 -21.532 41.436 11.640 1.00 35.66 O HETATM 7509 O HOH 178 -24.926 41.301 9.877 1.00 31.49 O HETATM 7510 O HOH 179 -0.863 37.985 19.304 1.00 56.28 O HETATM 7511 O HOH 180 -2.604 24.874 24.121 1.00 33.45 O HETATM 7512 O HOH 181 -8.617 26.161 25.205 1.00 39.97 O HETATM 7513 O HOH 182 -5.162 34.847 25.738 1.00 39.81 O HETATM 7514 O HOH 183 -19.529 23.856 23.359 1.00 37.05 O HETATM 7515 O HOH 184 -21.790 30.994 23.624 1.00 26.51 O HETATM 7516 O HOH 185 -16.815 22.414 21.209 1.00 42.76 O HETATM 7517 O HOH 186 -19.530 31.420 25.748 1.00 36.60 O HETATM 7518 O HOH 187 -25.977 25.561 24.657 1.00 22.52 O HETATM 7519 O HOH 188 -30.616 32.309 10.339 1.00 32.66 O HETATM 7520 O HOH 189 -25.879 31.189 13.289 1.00 31.90 O HETATM 7521 O HOH 190 -28.172 23.797 24.853 1.00 28.46 O HETATM 7522 O HOH 191 -32.974 22.443 25.521 1.00 32.47 O HETATM 7523 O HOH 192 -32.985 31.089 8.854 1.00 35.81 O HETATM 7524 O HOH 193 -37.979 26.202 14.300 1.00 23.65 O HETATM 7525 O HOH 194 -37.411 28.234 12.732 1.00 27.91 O HETATM 7526 O HOH 195 -39.783 20.920 18.622 1.00 23.27 O HETATM 7527 O HOH 196 -44.468 29.608 25.088 1.00 19.83 O HETATM 7528 O HOH 197 -46.505 24.891 19.457 1.00 18.15 O HETATM 7529 O HOH 198 -48.358 28.029 23.283 1.00 34.52 O HETATM 7530 O HOH 199 -48.615 28.141 20.923 1.00 18.61 O HETATM 7531 O HOH 200 -47.795 30.468 17.323 1.00 30.48 O HETATM 7532 O HOH 201 -46.116 28.028 26.050 1.00 35.95 O HETATM 7533 O HOH 202 -42.504 19.993 24.944 1.00 21.13 O HETATM 7534 O HOH 203 -43.048 23.197 32.458 1.00 28.36 O HETATM 7535 O HOH 204 -46.728 24.069 27.879 1.00 25.55 O HETATM 7536 O HOH 205 -46.303 25.936 32.453 1.00 25.82 O HETATM 7537 O HOH 206 -37.818 22.704 30.761 1.00 20.85 O HETATM 7538 O HOH 207 -40.197 19.493 21.270 1.00 31.23 O HETATM 7539 O HOH 208 -36.109 24.030 23.958 1.00 22.03 O HETATM 7540 O HOH 209 -41.201 30.194 31.644 1.00 25.79 O HETATM 7541 O HOH 210 -43.878 25.764 33.683 1.00 31.82 O HETATM 7542 O HOH 211 -38.647 23.957 33.081 1.00 24.24 O HETATM 7543 O HOH 212 -30.770 24.090 32.488 1.00 30.90 O HETATM 7544 O HOH 213 -28.614 28.767 32.954 1.00 27.41 O HETATM 7545 O HOH 214 -25.736 26.927 26.762 1.00 20.69 O HETATM 7546 O HOH 215 -32.625 33.675 28.732 1.00 18.79 O HETATM 7547 O HOH 216 -34.013 34.047 32.139 1.00 28.25 O HETATM 7548 O HOH 217 -26.594 34.991 32.723 1.00 36.15 O HETATM 7549 O HOH 218 -25.186 37.342 32.903 1.00 38.72 O HETATM 7550 O HOH 219 -66.852 23.855 20.607 1.00 26.32 O HETATM 7551 O HOH 220 -57.184 23.622 22.951 1.00 32.64 O HETATM 7552 O HOH 221 -4.036 38.704 21.954 1.00 51.83 O HETATM 7553 O HOH 222 -4.959 37.488 19.527 1.00 49.13 O HETATM 7554 O HOH 223 -12.953 46.644 24.875 1.00 53.04 O HETATM 7555 O HOH 224 -22.886 43.313 18.766 1.00 27.74 O HETATM 7556 O HOH 225 -25.875 43.630 19.303 1.00 31.04 O HETATM 7557 O HOH 226 -27.922 43.988 23.244 1.00 29.48 O HETATM 7558 O HOH 227 -31.251 40.429 26.790 1.00 23.12 O HETATM 7559 O HOH 228 -33.315 42.399 19.909 1.00 22.73 O HETATM 7560 O HOH 229 -37.552 41.410 25.336 1.00 30.79 O HETATM 7561 O HOH 230 -35.640 41.428 27.765 1.00 26.73 O HETATM 7562 O HOH 231 -32.455 44.353 22.067 1.00 26.56 O HETATM 7563 O HOH 232 -34.834 34.790 29.730 1.00 25.54 O HETATM 7564 O HOH 233 -39.034 41.254 17.715 1.00 21.05 O HETATM 7565 O HOH 234 -43.836 40.373 21.546 1.00 23.03 O HETATM 7566 O HOH 235 -45.791 32.198 25.858 1.00 22.67 O HETATM 7567 O HOH 236 -37.233 35.023 30.666 1.00 33.76 O HETATM 7568 O HOH 237 -47.336 37.835 27.120 1.00 25.97 O HETATM 7569 O HOH 238 -45.867 36.100 28.567 1.00 32.48 O HETATM 7570 O HOH 239 -44.031 37.689 29.887 1.00 29.31 O HETATM 7571 O HOH 240 -40.557 39.101 28.486 1.00 24.51 O HETATM 7572 O HOH 241 -42.820 41.350 24.985 1.00 23.28 O HETATM 7573 O HOH 242 -43.223 41.408 28.565 1.00 37.94 O HETATM 7574 O HOH 243 -53.799 39.257 23.697 1.00 32.70 O HETATM 7575 O HOH 244 -46.417 40.592 22.171 1.00 31.33 O HETATM 7576 O HOH 245 -52.617 39.469 26.091 1.00 31.52 O HETATM 7577 O HOH 246 -50.071 30.332 20.745 1.00 31.42 O HETATM 7578 O HOH 247 -55.804 29.337 23.998 1.00 22.53 O HETATM 7579 O HOH 248 -52.354 29.026 20.508 1.00 34.42 O HETATM 7580 O HOH 249 -48.981 29.076 25.416 1.00 32.88 O HETATM 7581 O HOH 250 -51.938 37.698 27.502 1.00 26.46 O HETATM 7582 O HOH 251 -52.683 32.838 27.297 1.00 25.70 O HETATM 7583 O HOH 252 -53.181 23.737 20.449 1.00 18.08 O HETATM 7584 O HOH 253 -53.968 27.797 22.765 1.00 34.36 O HETATM 7585 O HOH 254 -61.548 30.127 26.254 1.00 20.45 O HETATM 7586 O HOH 255 -59.391 40.800 26.676 1.00 34.16 O HETATM 7587 O HOH 256 -64.775 30.699 17.721 1.00 16.42 O HETATM 7588 O HOH 257 -66.120 28.641 25.124 1.00 30.74 O HETATM 7589 O HOH 258 -58.453 28.519 23.293 1.00 20.86 O HETATM 7590 O HOH 259 -72.308 27.503 22.529 1.00 25.95 O HETATM 7591 O HOH 260 -73.628 33.916 25.048 1.00 35.15 O HETATM 7592 O HOH 261 -79.678 33.789 23.430 1.00 41.15 O HETATM 7593 O HOH 262 -79.034 28.955 22.171 1.00 33.56 O HETATM 7594 O HOH 263 -80.002 30.488 24.291 1.00 39.47 O HETATM 7595 O HOH 264 -78.938 37.991 26.693 1.00 34.00 O HETATM 7596 O HOH 265 -72.500 37.430 25.813 1.00 34.85 O HETATM 7597 O HOH 266 -74.141 24.485 19.983 1.00 40.22 O HETATM 7598 O HOH 267 -75.189 24.670 17.174 1.00 36.37 O HETATM 7599 O HOH 268 -75.298 28.605 15.593 1.00 27.96 O HETATM 7600 O HOH 269 -84.711 30.815 20.763 1.00 34.55 O HETATM 7601 O HOH 270 -85.323 25.991 21.340 1.00 44.42 O HETATM 7602 O HOH 271 -85.372 34.721 14.408 1.00 23.59 O HETATM 7603 O HOH 272 -90.244 29.682 9.862 1.00 40.34 O HETATM 7604 O HOH 273 -89.190 32.139 8.692 1.00 30.20 O HETATM 7605 O HOH 274 -62.404 29.002 15.107 1.00 10.95 O HETATM 7606 O HOH 275 -64.330 24.847 20.460 1.00 22.89 O HETATM 7607 O HOH 276 -59.118 25.546 22.060 1.00 28.77 O HETATM 7608 O HOH 277 -66.047 28.343 19.927 1.00 20.01 O HETATM 7609 O HOH 278 -91.301 39.658 8.925 1.00 39.77 O HETATM 7610 O HOH 279 -92.107 14.695 15.235 1.00 31.44 O HETATM 7611 O HOH 280 -92.630 17.739 14.825 1.00 37.11 O HETATM 7612 O HOH 281 -88.650 18.279 13.828 1.00 32.05 O HETATM 7613 O HOH 282 -87.290 12.196 16.476 1.00 25.77 O HETATM 7614 O HOH 283 -90.342 14.384 12.305 1.00 31.09 O HETATM 7615 O HOH 284 -88.980 7.827 13.420 1.00 29.80 O HETATM 7616 O HOH 285 -88.919 16.884 10.977 1.00 31.42 O HETATM 7617 O HOH 286 -84.967 15.661 17.633 1.00 33.52 O HETATM 7618 O HOH 287 -85.388 9.945 14.605 1.00 28.94 O HETATM 7619 O HOH 288 -81.282 13.503 17.662 1.00 26.35 O HETATM 7620 O HOH 289 -77.180 22.516 14.269 1.00 28.67 O HETATM 7621 O HOH 290 -80.618 15.512 19.425 1.00 36.34 O HETATM 7622 O HOH 291 -73.622 22.000 10.653 1.00 29.92 O HETATM 7623 O HOH 292 -69.330 15.314 16.887 1.00 19.34 O HETATM 7624 O HOH 293 -75.184 13.355 18.687 1.00 27.16 O HETATM 7625 O HOH 294 -70.009 21.729 9.230 1.00 18.03 O HETATM 7626 O HOH 295 -73.212 23.838 12.680 1.00 29.80 O HETATM 7627 O HOH 296 -70.272 21.767 20.626 1.00 34.31 O HETATM 7628 O HOH 297 -72.816 18.601 18.872 1.00 32.53 O HETATM 7629 O HOH 298 -65.413 20.486 18.498 1.00 17.78 O HETATM 7630 O HOH 299 -67.162 22.855 18.265 1.00 23.90 O HETATM 7631 O HOH 300 -90.313 11.069 16.079 1.00 39.73 O HETATM 7632 O HOH 301 -69.556 24.748 5.933 1.00 26.18 O HETATM 7633 O HOH 302 -58.938 17.878 18.629 1.00 12.85 O HETATM 7634 O HOH 303 -69.852 24.994 3.236 1.00 31.76 O HETATM 7635 O HOH 304 -55.501 22.715 19.324 1.00 12.50 O HETATM 7636 O HOH 305 -63.125 20.045 20.207 1.00 17.09 O HETATM 7637 O HOH 306 -58.209 19.374 20.727 1.00 24.14 O HETATM 7638 O HOH 307 -56.796 21.471 21.218 1.00 20.06 O HETATM 7639 O HOH 308 -72.266 24.475 1.894 1.00 31.58 O HETATM 7640 O HOH 309 -54.874 20.610 22.710 1.00 31.99 O HETATM 7641 O HOH 310 -49.438 24.627 15.126 1.00 30.82 O HETATM 7642 O HOH 311 -57.403 7.509 21.768 1.00 26.59 O HETATM 7643 O HOH 312 -52.483 18.663 25.790 1.00 36.68 O HETATM 7644 O HOH 313 -45.983 17.493 15.868 1.00 33.62 O HETATM 7645 O HOH 314 -59.869 7.142 21.462 1.00 30.87 O HETATM 7646 O HOH 315 -51.281 11.570 16.252 1.00 18.46 O HETATM 7647 O HOH 316 -48.404 13.060 21.575 1.00 28.89 O HETATM 7648 O HOH 317 -55.025 9.151 21.007 1.00 22.99 O HETATM 7649 O HOH 318 -71.979 2.758 11.850 1.00 38.74 O HETATM 7650 O HOH 319 -72.875 2.962 15.383 1.00 40.14 O HETATM 7651 O HOH 320 -59.658 4.690 16.427 1.00 35.99 O HETATM 7652 O HOH 321 -47.757 3.923 6.886 1.00 37.30 O HETATM 7653 O HOH 322 -52.593 16.429 27.052 1.00 26.27 O HETATM 7654 O HOH 323 -50.713 14.446 23.967 1.00 24.18 O HETATM 7655 O HOH 324 -72.363 3.083 7.159 1.00 30.66 O HETATM 7656 O HOH 325 -72.300 0.353 10.777 1.00 29.54 O HETATM 7657 O HOH 326 -41.568 4.253 16.346 1.00 32.83 O HETATM 7658 O HOH 327 -40.601 4.305 13.272 1.00 29.32 O HETATM 7659 O HOH 328 -38.464 3.310 9.956 1.00 38.12 O HETATM 7660 O HOH 329 -61.291 9.221 21.931 1.00 23.01 O HETATM 7661 O HOH 330 -85.455 17.852 -1.805 1.00 42.01 O HETATM 7662 O HOH 331 -82.114 15.947 -2.032 1.00 34.17 O HETATM 7663 O HOH 332 -83.263 9.040 -3.764 1.00 33.90 O HETATM 7664 O HOH 333 -63.628 7.586 15.832 1.00 26.86 O HETATM 7665 O HOH 334 -67.953 11.192 21.747 1.00 24.31 O HETATM 7666 O HOH 335 -20.901 26.271 9.333 1.00 31.55 O HETATM 7667 O HOH 336 -64.891 19.510 23.107 1.00 34.91 O HETATM 7668 O HOH 337 -66.428 5.907 -0.237 1.00 35.61 O HETATM 7669 O HOH 338 -69.160 5.962 -1.476 1.00 31.21 O HETATM 7670 O HOH 339 -65.834 9.502 0.032 1.00 28.78 O HETATM 7671 O HOH 340 -69.123 7.278 20.137 1.00 30.34 O HETATM 7672 O HOH 341 -62.015 5.753 0.901 1.00 30.27 O HETATM 7673 O HOH 342 -70.439 9.698 20.962 1.00 34.31 O HETATM 7674 O HOH 343 -73.961 10.853 19.015 1.00 25.55 O HETATM 7675 O HOH 344 -56.387 9.698 15.601 1.00 32.30 O HETATM 7676 O HOH 345 -57.006 5.385 16.137 1.00 30.93 O HETATM 7677 O HOH 346 -70.925 4.278 14.467 1.00 34.97 O HETATM 7678 O HOH 347 -71.262 6.206 10.390 1.00 22.74 O HETATM 7679 O HOH 348 -72.682 10.628 21.444 1.00 28.26 O HETATM 7680 O HOH 349 -46.068 5.545 8.701 1.00 34.44 O HETATM 7681 O HOH 350 -79.006 10.499 19.264 1.00 30.63 O HETATM 7682 O HOH 351 -76.325 9.867 18.525 1.00 24.39 O HETATM 7683 O HOH 352 -44.121 5.349 15.323 1.00 28.43 O HETATM 7684 O HOH 353 -42.085 5.589 11.481 1.00 22.40 O HETATM 7685 O HOH 354 -41.428 6.975 8.321 1.00 29.30 O HETATM 7686 O HOH 355 -47.959 20.631 -0.155 1.00 30.46 O HETATM 7687 O HOH 356 -76.795 3.450 7.258 1.00 27.17 O HETATM 7688 O HOH 357 -73.855 3.320 9.307 1.00 35.87 O HETATM 7689 O HOH 358 -37.822 5.521 13.165 1.00 27.52 O HETATM 7690 O HOH 359 -39.815 6.059 17.418 1.00 32.42 O HETATM 7691 O HOH 360 -35.065 6.027 16.303 1.00 29.10 O HETATM 7692 O HOH 361 -77.499 1.703 12.071 1.00 31.45 O HETATM 7693 O HOH 362 -86.279 8.388 17.231 1.00 22.67 O HETATM 7694 O HOH 363 -29.996 9.507 22.193 1.00 41.34 O HETATM 7695 O HOH 364 -86.025 1.446 14.542 1.00 28.74 O HETATM 7696 O HOH 365 -84.718 3.188 8.532 1.00 23.19 O HETATM 7697 O HOH 366 -86.870 3.007 3.564 1.00 28.70 O HETATM 7698 O HOH 367 -87.867 3.928 14.514 1.00 25.73 O HETATM 7699 O HOH 368 -81.687 9.939 -1.851 1.00 24.78 O HETATM 7700 O HOH 369 -83.034 13.140 -2.916 1.00 41.73 O HETATM 7701 O HOH 370 -86.400 15.067 -2.387 1.00 43.76 O HETATM 7702 O HOH 371 -88.468 8.361 -0.596 1.00 29.56 O HETATM 7703 O HOH 372 -89.171 15.336 -0.476 1.00 48.58 O HETATM 7704 O HOH 373 -78.880 3.710 5.571 1.00 23.06 O HETATM 7705 O HOH 374 -80.177 7.801 -5.764 1.00 45.97 O HETATM 7706 O HOH 375 -73.849 3.095 4.273 1.00 28.27 O HETATM 7707 O HOH 376 -22.320 25.556 7.008 1.00 33.99 O HETATM 7708 O HOH 377 -71.289 8.636 -0.006 1.00 28.51 O HETATM 7709 O HOH 378 -75.094 7.151 -4.323 1.00 23.48 O HETATM 7710 O HOH 379 -29.459 27.456 2.748 1.00 33.37 O HETATM 7711 O HOH 380 -69.962 4.460 8.578 1.00 21.88 O HETATM 7712 O HOH 381 -71.930 6.336 -1.165 1.00 19.69 O HETATM 7713 O HOH 382 -66.550 4.724 1.807 1.00 21.66 O HETATM 7714 O HOH 383 -70.189 2.564 4.644 1.00 28.33 O HETATM 7715 O HOH 384 -68.403 2.129 2.739 1.00 24.38 O HETATM 7716 O HOH 385 -45.199 18.771 11.908 1.00 30.62 O HETATM 7717 O HOH 386 -71.899 11.975 2.292 1.00 27.92 O HETATM 7718 O HOH 387 -67.888 8.006 -0.119 1.00 30.04 O HETATM 7719 O HOH 388 -44.057 21.135 -0.110 1.00 27.98 O HETATM 7720 O HOH 389 -65.767 2.183 8.908 1.00 33.58 O HETATM 7721 O HOH 390 -63.458 3.074 7.807 1.00 24.13 O HETATM 7722 O HOH 391 -68.074 0.539 7.954 1.00 42.52 O HETATM 7723 O HOH 392 -63.932 4.079 2.358 1.00 30.12 O HETATM 7724 O HOH 393 -60.495 7.478 2.350 1.00 21.09 O HETATM 7725 O HOH 394 -62.463 17.375 8.990 1.00 16.48 O HETATM 7726 O HOH 395 -26.394 19.299 -3.720 1.00 33.69 O HETATM 7727 O HOH 396 -24.325 22.679 -1.585 1.00 29.69 O HETATM 7728 O HOH 397 -59.688 7.022 12.168 1.00 20.53 O HETATM 7729 O HOH 398 -56.026 4.295 6.914 1.00 30.31 O HETATM 7730 O HOH 399 -57.239 8.432 13.624 1.00 26.42 O HETATM 7731 O HOH 400 -55.615 1.747 12.918 1.00 34.12 O HETATM 7732 O HOH 401 -53.785 1.493 10.659 1.00 31.91 O HETATM 7733 O HOH 402 -57.321 6.022 13.812 1.00 35.70 O HETATM 7734 O HOH 403 -49.680 8.074 6.600 1.00 20.16 O HETATM 7735 O HOH 404 -46.738 5.779 11.481 1.00 21.05 O HETATM 7736 O HOH 405 -25.947 3.460 11.152 1.00 44.15 O HETATM 7737 O HOH 406 -44.076 7.868 16.786 1.00 21.36 O HETATM 7738 O HOH 407 -48.378 4.753 13.604 1.00 35.39 O HETATM 7739 O HOH 408 -51.238 7.212 17.369 1.00 30.58 O HETATM 7740 O HOH 409 -40.776 7.858 10.541 1.00 17.51 O HETATM 7741 O HOH 410 -44.390 5.683 12.622 1.00 22.66 O HETATM 7742 O HOH 411 -35.713 4.494 12.409 1.00 31.85 O HETATM 7743 O HOH 412 -43.985 15.707 14.775 1.00 25.60 O HETATM 7744 O HOH 413 -44.086 8.683 0.265 1.00 33.07 O HETATM 7745 O HOH 414 -39.187 4.815 3.876 1.00 38.87 O HETATM 7746 O HOH 415 -47.770 17.826 -0.383 1.00 37.15 O HETATM 7747 O HOH 416 -52.924 19.753 -0.402 1.00 24.71 O HETATM 7748 O HOH 417 -41.689 8.368 18.329 1.00 23.33 O HETATM 7749 O HOH 418 -37.702 6.746 15.737 1.00 21.42 O HETATM 7750 O HOH 419 -57.003 20.900 -0.230 1.00 22.28 O HETATM 7751 O HOH 420 -60.907 20.355 -2.042 1.00 33.25 O HETATM 7752 O HOH 421 -37.268 17.852 16.660 1.00 24.46 O HETATM 7753 O HOH 422 -58.158 6.764 -0.960 1.00 36.82 O HETATM 7754 O HOH 423 -64.953 18.673 -2.802 1.00 35.73 O HETATM 7755 O HOH 424 -64.347 22.501 0.349 1.00 31.07 O HETATM 7756 O HOH 425 -33.933 10.988 20.541 1.00 25.19 O HETATM 7757 O HOH 426 -69.549 20.780 -2.459 1.00 38.36 O HETATM 7758 O HOH 427 -68.388 22.872 1.873 1.00 29.21 O HETATM 7759 O HOH 428 -72.548 22.275 0.406 1.00 31.90 O HETATM 7760 O HOH 429 -31.323 5.457 12.902 1.00 40.31 O HETATM 7761 O HOH 430 -77.240 18.148 -2.639 1.00 34.76 O HETATM 7762 O HOH 431 -35.567 16.265 15.491 1.00 21.50 O HETATM 7763 O HOH 432 -37.031 16.918 19.133 1.00 28.20 O HETATM 7764 O HOH 433 -36.030 13.004 20.772 1.00 33.62 O HETATM 7765 O HOH 434 -81.297 19.214 -1.623 1.00 37.73 O HETATM 7766 O HOH 435 -31.609 11.725 21.379 1.00 27.63 O HETATM 7767 O HOH 436 -27.710 9.143 20.249 1.00 32.41 O HETATM 7768 O HOH 437 -27.665 6.839 14.693 1.00 36.29 O HETATM 7769 O HOH 438 -22.020 18.759 15.451 1.00 32.54 O HETATM 7770 O HOH 439 -10.899 24.859 5.968 1.00 43.22 O HETATM 7771 O HOH 440 -18.265 19.339 21.158 1.00 49.54 O HETATM 7772 O HOH 441 -16.914 27.367 11.553 1.00 44.35 O HETATM 7773 O HOH 442 -14.512 27.865 15.249 1.00 41.14 O HETATM 7774 O HOH 443 -16.412 20.660 7.006 1.00 37.30 O HETATM 7775 O HOH 444 -24.195 23.573 7.256 1.00 27.14 O HETATM 7776 O HOH 445 -20.091 18.433 8.794 1.00 29.72 O HETATM 7777 O HOH 446 -20.269 24.703 5.685 1.00 41.06 O HETATM 7778 O HOH 447 -26.449 25.091 6.776 1.00 25.80 O HETATM 7779 O HOH 448 -27.908 27.176 5.904 1.00 38.30 O HETATM 7780 O HOH 449 -31.029 26.776 4.992 1.00 33.37 O HETATM 7781 O HOH 450 -31.051 29.411 9.055 1.00 42.40 O HETATM 7782 O HOH 451 -34.369 24.943 6.205 1.00 19.41 O HETATM 7783 O HOH 452 -37.887 22.960 15.103 1.00 26.70 O HETATM 7784 O HOH 453 -38.738 28.023 10.296 1.00 22.66 O HETATM 7785 O HOH 454 -42.169 19.194 3.024 1.00 24.23 O HETATM 7786 O HOH 455 -43.105 20.715 13.797 1.00 29.36 O HETATM 7787 O HOH 456 -45.472 24.717 5.498 1.00 34.20 O HETATM 7788 O HOH 457 -46.715 18.589 9.847 1.00 30.00 O HETATM 7789 O HOH 458 -45.274 24.134 8.567 1.00 19.83 O HETATM 7790 O HOH 459 -47.186 20.724 6.377 1.00 23.64 O HETATM 7791 O HOH 460 -43.883 20.874 2.240 1.00 28.88 O HETATM 7792 O HOH 461 -43.556 19.963 10.734 1.00 33.87 O HETATM 7793 O HOH 462 -46.266 20.928 3.985 1.00 33.94 O HETATM 7794 O HOH 463 -46.044 21.729 10.856 1.00 33.04 O HETATM 7795 O HOH 464 -40.448 28.991 3.805 1.00 18.58 O HETATM 7796 O HOH 465 -43.865 24.852 0.010 1.00 20.45 O HETATM 7797 O HOH 466 -34.555 26.328 -0.937 1.00 18.15 O HETATM 7798 O HOH 467 -39.164 29.508 7.630 1.00 24.80 O HETATM 7799 O HOH 468 -37.395 18.457 -2.462 1.00 31.87 O HETATM 7800 O HOH 469 -34.718 25.056 -3.498 1.00 20.90 O HETATM 7801 O HOH 470 -29.660 15.563 2.145 1.00 24.39 O HETATM 7802 O HOH 471 -29.735 26.728 -0.005 1.00 22.44 O HETATM 7803 O HOH 472 -27.665 25.069 -0.676 1.00 24.98 O HETATM 7804 O HOH 473 -25.040 20.374 -1.507 1.00 26.37 O HETATM 7805 O HOH 474 -23.522 22.087 5.071 1.00 29.34 O HETATM 7806 O HOH 475 -30.109 14.503 -1.705 1.00 31.59 O HETATM 7807 O HOH 476 -28.132 17.713 -2.701 1.00 22.36 O HETATM 7808 O HOH 477 -14.092 18.975 4.263 1.00 39.11 O HETATM 7809 O HOH 478 -17.746 17.159 7.923 1.00 30.75 O HETATM 7810 O HOH 479 -55.785 25.373 3.108 1.00 33.29 O HETATM 7811 O HOH 480 -54.060 23.715 1.951 1.00 30.65 O HETATM 7812 O HOH 481 -65.948 22.592 2.594 1.00 29.26 O HETATM 7813 O HOH 482 -7.474 5.106 8.376 1.00 47.06 O HETATM 7814 O HOH 483 -10.702 2.690 8.090 1.00 51.50 O HETATM 7815 O HOH 484 -16.532 4.434 3.136 1.00 40.94 O HETATM 7816 O HOH 485 -22.221 5.501 13.578 1.00 33.49 O HETATM 7817 O HOH 486 -25.764 5.046 8.083 1.00 33.88 O HETATM 7818 O HOH 487 -18.979 1.439 8.664 1.00 37.95 O HETATM 7819 O HOH 488 -25.135 5.456 12.745 1.00 32.74 O HETATM 7820 O HOH 489 -32.141 6.612 10.278 1.00 26.71 O HETATM 7821 O HOH 490 -29.026 8.822 3.903 1.00 26.89 O HETATM 7822 O HOH 491 -24.973 8.634 -0.355 1.00 37.59 O HETATM 7823 O HOH 492 -32.952 7.667 2.462 1.00 26.68 O HETATM 7824 O HOH 493 -35.317 7.785 4.379 1.00 24.07 O HETATM 7825 O HOH 494 -31.150 4.804 8.937 1.00 26.95 O HETATM 7826 O HOH 495 -28.129 4.941 6.018 1.00 35.85 O HETATM 7827 O HOH 496 -31.712 13.832 0.578 1.00 31.10 O HETATM 7828 O HOH 497 -29.108 10.146 -2.424 1.00 28.33 O HETATM 7829 O HOH 498 -33.712 14.200 -0.677 1.00 32.58 O HETATM 7830 O HOH 499 -42.116 8.636 6.564 1.00 24.79 O HETATM 7831 O HOH 500 -38.299 7.639 11.345 1.00 20.58 O HETATM 7832 O HOH 501 -34.640 6.490 10.762 1.00 26.07 O HETATM 7833 O HOH 502 -35.864 2.828 9.036 1.00 40.18 O HETATM 7834 O HOH 503 -43.413 16.789 2.088 1.00 18.40 O HETATM 7835 O HOH 504 -40.531 7.538 3.837 1.00 29.08 O HETATM 7836 O HOH 505 -42.428 12.719 -0.197 1.00 29.25 O HETATM 7837 O HOH 506 -45.033 10.736 1.132 1.00 28.72 O HETATM 7838 O HOH 507 -37.395 8.070 2.519 1.00 35.17 O HETATM 7839 O HOH 508 -45.663 17.143 1.029 1.00 31.44 O HETATM 7840 O HOH 509 -46.717 8.338 7.386 1.00 21.65 O HETATM 7841 O HOH 510 -53.650 19.492 2.016 1.00 20.20 O HETATM 7842 O HOH 511 -48.502 18.243 6.579 1.00 23.58 O HETATM 7843 O HOH 512 -49.813 16.052 -0.363 1.00 24.41 O HETATM 7844 O HOH 513 -49.153 11.193 -0.230 1.00 29.00 O HETATM 7845 O HOH 514 -51.955 25.276 5.867 1.00 18.42 O HETATM 7846 O HOH 515 -58.857 18.951 -1.083 1.00 18.80 O HETATM 7847 O HOH 516 -57.992 7.247 1.936 1.00 23.89 O HETATM 7848 O HOH 517 -56.554 10.213 -2.248 1.00 32.03 O HETATM 7849 O HOH 518 -63.677 18.054 6.674 1.00 17.48 O HETATM 7850 O HOH 519 -56.462 20.389 2.111 1.00 22.22 O HETATM 7851 O HOH 520 -63.476 20.507 -0.875 1.00 29.56 O HETATM 7852 O HOH 521 -66.553 16.769 -2.059 1.00 25.68 O HETATM 7853 O HOH 522 -70.241 21.182 0.509 1.00 24.78 O HETATM 7854 O HOH 523 -66.463 12.422 -0.308 1.00 29.02 O HETATM 7855 O HOH 524 -77.170 19.876 -0.346 1.00 32.10 O HETATM 7856 O HOH 525 -69.287 17.635 -2.200 1.00 31.83 O HETATM 7857 O HOH 526 -76.635 15.341 -1.716 1.00 36.29 O HETATM 7858 O HOH 527 -78.376 22.496 6.972 1.00 37.02 O HETATM 7859 O HOH 528 -74.347 20.243 7.060 1.00 29.69 O HETATM 7860 O HOH 529 -82.822 17.627 -0.221 1.00 34.67 O HETATM 7861 O HOH 530 -84.448 14.381 5.760 1.00 25.24 O HETATM 7862 O HOH 531 -88.771 11.602 1.743 1.00 37.07 O HETATM 7863 O HOH 532 -64.579 20.584 4.180 1.00 20.36 O HETATM 7864 O HOH 533 -62.496 24.055 3.965 1.00 24.17 O HETATM 7865 O HOH 534 -57.250 22.966 3.280 1.00 23.69 O HETATM 7866 O HOH 535 -61.820 19.971 9.565 1.00 13.26 O HETATM 7867 C1 LMR A 536 -60.161 27.027 18.984 1.00 0.07 C HETATM 7868 O1A LMR A 536 -59.413 28.013 18.757 1.00 -0.57 O HETATM 7869 O1B LMR A 536 -59.691 25.887 19.248 1.00 -0.57 O HETATM 7870 C2 LMR A 536 -61.638 27.225 18.980 1.00 0.12 C HETATM 7871 O2 LMR A 536 -61.878 28.570 19.334 1.00 -0.38 O HETATM 7872 H2 LMR A 536 -61.520 28.738 20.198 1.00 0.21 H HETATM 7873 C3 LMR A 536 -62.205 26.916 17.599 1.00 0.04 C HETATM 7874 C4 LMR A 536 -63.690 27.177 17.590 1.00 0.04 C HETATM 7875 O4A LMR A 536 -64.208 27.876 16.690 1.00 -0.57 O HETATM 7876 O4B LMR A 536 -64.424 26.699 18.484 1.00 -0.57 O HETATM 7877 H3 LMR A 536 -62.018 25.860 17.355 1.00 0.05 H HETATM 7878 H4 LMR A 536 -61.716 27.558 16.851 1.00 0.05 H HETATM 7879 H1 LMR A 536 -62.106 26.558 19.719 1.00 0.08 H CONECT 1 2 7 8 9 CONECT 7 1 CONECT 8 1 CONECT 9 1 CONECT 3670 3671 3680 3681 3682 CONECT 3680 3670 CONECT 3681 3670 CONECT 3682 3670 CONECT 7867 7868 7869 7870 CONECT 7868 7867 CONECT 7869 7867 CONECT 7870 7867 7871 7873 7879 CONECT 7871 7870 7872 CONECT 7872 7871 CONECT 7873 7870 7874 7877 7878 CONECT 7874 7873 7875 7876 CONECT 7875 7874 CONECT 7876 7874 CONECT 7877 7873 CONECT 7878 7873 CONECT 7879 7870 MASTER 0 0 0 0 0 0 0 0 7877 2 21 38 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 2yfa
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
No similar entries are found!
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
4ipi
RCSB PDB
PDBbind
LMR
4ipj
RCSB PDB
PDBbind
LMR
Entry Information
PDB ID
2yfa
Complex Type
Protein-Ligand
PDBbind Subset
refined set
Protein Name
METHYL-ACCEPTING CHEMOTAXIS TRANSDUCER
Ligand Name
LMR
EC.Number
E.C.-.-.-.-
Resolution
1.8(Å)
Affinity (Kd/Ki/IC50)
Kd=8.5uM
Release Year
2012
Protein/NA Sequence
Check fasta file
Primary Reference
(2012) Proc.Natl.Acad.Sci.USA Vol. 109: pp. 18926
Ligand Properties
Formula
C
4
H
6
O
5
Molecular Weight
134.087
Exact Mass
134.022
No. of atoms
15
No. of bonds
14
Polar Surface Area
94.83
LOGP Value
1.00 (
Computed with XLOGP3
)
-1.09 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 1
No. of Hydrogen Bond Acceptors: 5
No. of Rotatable Bonds: 2
No. of Nitrogen and Oxygen Atoms: 5
No. of Rings: 0
Canonical SMILES
OC(=O)C[C@@H](C(=O)O)O
InChI String
InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/t2-/m0/s1
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
Q88E10
Entrez Gene ID
No matched NCBI Entrez Gene ID found!
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com