Browse entries in the PDBbind-CN Database
HEADER 3F3C_COMPLEX COMPND 3F3C_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 128 ARG GLU HIS TRP ALA THR ARG LEU GLY LEU ILE LEU ALA SEQRES 2 A 128 MET ALA GLY ASN ALA VAL GLY LEU GLY ASN PHE LEU ARG SEQRES 3 A 128 PHE PRO VAL GLN ALA ALA GLU ASN GLY GLY GLY ALA PHE SEQRES 4 A 128 MET ILE PRO TYR ILE ILE ALA PHE LEU LEU VAL GLY ILE SEQRES 5 A 128 PRO LEU MET TRP ILE GLU TRP ALA MET GLY ARG TYR GLY SEQRES 6 A 128 GLY ALA GLN GLY HIS GLY THR THR PRO ALA ILE PHE TYR SEQRES 7 A 128 LEU LEU TRP ARG ASN ARG PHE ALA LYS ILE LEU GLY VAL SEQRES 8 A 128 PHE GLY LEU TRP ILE PRO LEU VAL VAL ALA ILE TYR TYR SEQRES 9 A 128 VAL TYR ILE GLU SER TRP THR LEU GLY PHE ALA ILE LYS SEQRES 10 A 128 PHE LEU VAL GLY LEU VAL PRO GLU PRO PRO PRO SEQRES 1 A 381 THR ASP PRO ASP SER ILE LEU ARG PRO PHE LYS GLU PHE SEQRES 2 A 381 LEU TYR SER TYR ILE GLY VAL PRO LYS GLY ASP GLU PRO SEQRES 3 A 381 ILE LEU LYS PRO SER LEU PHE ALA TYR ILE VAL PHE LEU SEQRES 4 A 381 ILE THR MET PHE ILE ASN VAL SER ILE LEU ILE ARG GLY SEQRES 5 A 381 ILE SER LYS GLY ILE GLU ARG PHE ALA LYS ILE ALA MET SEQRES 6 A 381 PRO THR LEU PHE ILE LEU ALA VAL PHE LEU VAL ILE ARG SEQRES 7 A 381 VAL PHE LEU LEU GLU THR PRO ASN GLY THR ALA ALA ASP SEQRES 8 A 381 GLY LEU ASN PHE LEU TRP THR PRO ASP PHE GLU LYS LEU SEQRES 9 A 381 LYS ASP PRO GLY VAL TRP ILE ALA ALA VAL GLY GLN ILE SEQRES 10 A 381 PHE PHE THR LEU SER LEU GLY PHE GLY ALA ILE ILE THR SEQRES 11 A 381 TYR ALA SER TYR VAL ARG LYS ASP GLN ASP ILE VAL LEU SEQRES 12 A 381 SER GLY LEU THR ALA ALA THR LEU ASN GLU LYS ALA GLU SEQRES 13 A 381 VAL ILE LEU GLY GLY SER ILE SER ILE PRO ALA ALA VAL SEQRES 14 A 381 ALA PHE PHE GLY VAL ALA ASN ALA VAL ALA ILE ALA LYS SEQRES 15 A 381 ALA GLY ALA PHE ASN LEU GLY PHE ILE THR LEU PRO ALA SEQRES 16 A 381 ILE PHE SER GLN THR ALA GLY GLY THR PHE LEU GLY PHE SEQRES 17 A 381 LEU TRP PHE PHE LEU LEU PHE PHE ALA GLY LEU THR SER SEQRES 18 A 381 SER ILE ALA ILE MET GLN PRO MET ILE ALA PHE LEU GLU SEQRES 19 A 381 ASP GLU LEU LYS LEU SER ARG LYS HIS ALA VAL LEU TRP SEQRES 20 A 381 THR ALA ALA ILE VAL PHE PHE SER ALA HIS LEU VAL MET SEQRES 21 A 381 PHE LEU ASN LYS SER LEU ASP GLU MET ASP PHE TRP ALA SEQRES 22 A 381 GLY THR ILE GLY VAL VAL PHE PHE GLY LEU THR GLU LEU SEQRES 23 A 381 ILE ILE PHE PHE TRP ILE PHE GLY ALA ASP LYS ALA TRP SEQRES 24 A 381 GLU GLU ILE ASN ARG GLY GLY ILE ILE LYS VAL PRO ARG SEQRES 25 A 381 ILE TYR TYR TYR VAL MET ARG TYR ILE THR PRO ALA PHE SEQRES 26 A 381 LEU ALA VAL LEU LEU VAL VAL TRP ALA ARG GLU TYR ILE SEQRES 27 A 381 PRO LYS ILE MET GLU GLU THR HIS TRP THR VAL TRP ILE SEQRES 28 A 381 THR ARG PHE TYR ILE ILE GLY LEU PHE LEU PHE LEU THR SEQRES 29 A 381 PHE LEU VAL PHE LEU ALA GLU ARG ARG ARG ASN HIS GLU SEQRES 30 A 381 SER ALA GLY THR SEQRES 1 B 128 ARG GLU HIS TRP ALA THR ARG LEU GLY LEU ILE LEU ALA SEQRES 2 B 128 MET ALA GLY ASN ALA VAL GLY LEU GLY ASN PHE LEU ARG SEQRES 3 B 128 PHE PRO VAL GLN ALA ALA GLU ASN GLY GLY GLY ALA PHE SEQRES 4 B 128 MET ILE PRO TYR ILE ILE ALA PHE LEU LEU VAL GLY ILE SEQRES 5 B 128 PRO LEU MET TRP ILE GLU TRP ALA MET GLY ARG TYR GLY SEQRES 6 B 128 GLY ALA GLN GLY HIS GLY THR THR PRO ALA ILE PHE TYR SEQRES 7 B 128 LEU LEU TRP ARG ASN ARG PHE ALA LYS ILE LEU GLY VAL SEQRES 8 B 128 PHE GLY LEU TRP ILE PRO LEU VAL VAL ALA ILE TYR TYR SEQRES 9 B 128 VAL TYR ILE GLU SER TRP THR LEU GLY PHE ALA ILE LYS SEQRES 10 B 128 PHE LEU VAL GLY LEU VAL PRO GLU PRO PRO PRO SEQRES 1 B 381 THR ASP PRO ASP SER ILE LEU ARG PRO PHE LYS GLU PHE SEQRES 2 B 381 LEU TYR SER TYR ILE GLY VAL PRO LYS GLY ASP GLU PRO SEQRES 3 B 381 ILE LEU LYS PRO SER LEU PHE ALA TYR ILE VAL PHE LEU SEQRES 4 B 381 ILE THR MET PHE ILE ASN VAL SER ILE LEU ILE ARG GLY SEQRES 5 B 381 ILE SER LYS GLY ILE GLU ARG PHE ALA LYS ILE ALA MET SEQRES 6 B 381 PRO THR LEU PHE ILE LEU ALA VAL PHE LEU VAL ILE ARG SEQRES 7 B 381 VAL PHE LEU LEU GLU THR PRO ASN GLY THR ALA ALA ASP SEQRES 8 B 381 GLY LEU ASN PHE LEU TRP THR PRO ASP PHE GLU LYS LEU SEQRES 9 B 381 LYS ASP PRO GLY VAL TRP ILE ALA ALA VAL GLY GLN ILE SEQRES 10 B 381 PHE PHE THR LEU SER LEU GLY PHE GLY ALA ILE ILE THR SEQRES 11 B 381 TYR ALA SER TYR VAL ARG LYS ASP GLN ASP ILE VAL LEU SEQRES 12 B 381 SER GLY LEU THR ALA ALA THR LEU ASN GLU LYS ALA GLU SEQRES 13 B 381 VAL ILE LEU GLY GLY SER ILE SER ILE PRO ALA ALA VAL SEQRES 14 B 381 ALA PHE PHE GLY VAL ALA ASN ALA VAL ALA ILE ALA LYS SEQRES 15 B 381 ALA GLY ALA PHE ASN LEU GLY PHE ILE THR LEU PRO ALA SEQRES 16 B 381 ILE PHE SER GLN THR ALA GLY GLY THR PHE LEU GLY PHE SEQRES 17 B 381 LEU TRP PHE PHE LEU LEU PHE PHE ALA GLY LEU THR SER SEQRES 18 B 381 SER ILE ALA ILE MET GLN PRO MET ILE ALA PHE LEU GLU SEQRES 19 B 381 ASP GLU LEU LYS LEU SER ARG LYS HIS ALA VAL LEU TRP SEQRES 20 B 381 THR ALA ALA ILE VAL PHE PHE SER ALA HIS LEU VAL MET SEQRES 21 B 381 PHE LEU ASN LYS SER LEU ASP GLU MET ASP PHE TRP ALA SEQRES 22 B 381 GLY THR ILE GLY VAL VAL PHE PHE GLY LEU THR GLU LEU SEQRES 23 B 381 ILE ILE PHE PHE TRP ILE PHE GLY ALA ASP LYS ALA TRP SEQRES 24 B 381 GLU GLU ILE ASN ARG GLY GLY ILE ILE LYS VAL PRO ARG SEQRES 25 B 381 ILE TYR TYR TYR VAL MET ARG TYR ILE THR PRO ALA PHE SEQRES 26 B 381 LEU ALA VAL LEU LEU VAL VAL TRP ALA ARG GLU TYR ILE SEQRES 27 B 381 PRO LYS ILE MET GLU GLU THR HIS TRP THR VAL TRP ILE SEQRES 28 B 381 THR ARG PHE TYR ILE ILE GLY LEU PHE LEU PHE LEU THR SEQRES 29 B 381 PHE LEU VAL PHE LEU ALA GLU ARG ARG ARG ASN HIS GLU SEQRES 30 B 381 SER ALA GLY THR HET PFF A1194 23 ATOM 1 N ARG A 5 33.156 57.587 22.948 1.00 46.13 N ATOM 2 CA ARG A 5 32.995 56.106 22.849 1.00 45.18 C ATOM 3 C ARG A 5 33.048 55.671 21.400 1.00 44.26 C ATOM 4 O ARG A 5 32.583 56.390 20.518 1.00 43.77 O ATOM 5 CB ARG A 5 31.661 55.674 23.461 1.00 44.99 C ATOM 6 CG ARG A 5 31.477 54.163 23.600 1.00 44.58 C ATOM 7 CD ARG A 5 30.182 53.846 24.345 1.00 44.05 C ATOM 8 NE ARG A 5 29.993 52.415 24.576 1.00 42.03 N ATOM 9 CZ ARG A 5 30.574 51.732 25.558 1.00 40.80 C ATOM 10 NH1 ARG A 5 30.339 50.436 25.692 1.00 40.08 N ATOM 11 NH2 ARG A 5 31.388 52.342 26.405 1.00 39.89 N ATOM 12 HA ARG A 5 33.810 55.634 23.398 1.00 0.00 H ATOM 13 HB2 ARG A 5 31.584 56.118 24.454 1.00 0.00 H ATOM 14 HB3 ARG A 5 30.859 56.057 22.830 1.00 0.00 H ATOM 15 HG2 ARG A 5 31.439 53.714 22.608 1.00 0.00 H ATOM 16 HG3 ARG A 5 32.320 53.748 24.153 1.00 0.00 H ATOM 17 HD2 ARG A 5 29.343 54.217 23.757 1.00 0.00 H ATOM 18 HD3 ARG A 5 30.202 54.354 25.309 1.00 0.00 H ATOM 19 HE ARG A 5 29.363 51.897 23.930 1.00 0.00 H ATOM 20 HH12 ARG A 5 30.793 49.902 26.460 1.00 0.00 H ATOM 21 HH11 ARG A 5 29.700 49.952 25.029 1.00 0.00 H ATOM 22 HH22 ARG A 5 31.840 51.803 27.171 1.00 0.00 H ATOM 23 HH21 ARG A 5 31.576 53.360 26.304 1.00 0.00 H ATOM 24 HN3 ARG A 5 32.389 58.054 22.423 1.00 0.00 H ATOM 25 HN2 ARG A 5 34.073 57.863 22.542 1.00 0.00 H ATOM 26 HN1 ARG A 5 33.118 57.873 23.947 1.00 0.00 H ATOM 27 N GLU A 6 33.617 54.492 21.159 1.00 43.56 N ATOM 28 CA GLU A 6 33.660 53.914 19.823 1.00 42.64 C ATOM 29 C GLU A 6 32.259 53.577 19.355 1.00 41.18 C ATOM 30 O GLU A 6 31.386 53.260 20.158 1.00 40.72 O ATOM 31 CB GLU A 6 34.522 52.646 19.804 1.00 43.77 C ATOM 32 CG GLU A 6 36.011 52.902 19.975 1.00 44.44 C ATOM 33 HA GLU A 6 34.102 54.650 19.151 1.00 0.00 H ATOM 34 HB2 GLU A 6 34.191 51.995 20.614 1.00 0.00 H ATOM 35 HB3 GLU A 6 34.369 52.142 18.850 1.00 0.00 H ATOM 36 HG2 GLU A 6 36.364 53.541 19.166 1.00 0.00 H ATOM 37 HG3 GLU A 6 36.186 53.394 20.932 1.00 0.00 H ATOM 38 H GLU A 6 34.044 53.968 21.949 1.00 0.00 H ATOM 39 N HIS A 7 32.050 53.654 18.048 1.00 40.96 N ATOM 40 CA HIS A 7 30.768 53.315 17.454 1.00 40.65 C ATOM 41 C HIS A 7 30.997 52.483 16.209 1.00 40.34 C ATOM 42 O HIS A 7 32.089 52.493 15.645 1.00 39.67 O ATOM 43 CB HIS A 7 29.969 54.578 17.105 1.00 41.95 C ATOM 44 CG HIS A 7 29.521 55.359 18.300 1.00 42.45 C ATOM 45 ND1 HIS A 7 30.193 56.472 18.758 1.00 43.58 N ATOM 46 CD2 HIS A 7 28.470 55.184 19.137 1.00 42.41 C ATOM 47 CE1 HIS A 7 29.573 56.952 19.823 1.00 42.81 C ATOM 48 NE2 HIS A 7 28.527 56.186 20.075 1.00 43.27 N ATOM 49 HA HIS A 7 30.188 52.742 18.178 1.00 0.00 H ATOM 50 HB2 HIS A 7 30.596 55.222 16.488 1.00 0.00 H ATOM 51 HB3 HIS A 7 29.087 54.281 16.538 1.00 0.00 H ATOM 52 HD2 HIS A 7 27.720 54.396 19.077 1.00 0.00 H ATOM 53 HE1 HIS A 7 29.874 57.830 20.395 1.00 0.00 H ATOM 54 H HIS A 7 32.826 53.966 17.430 1.00 0.00 H ATOM 55 N TRP A 8 29.971 51.749 15.795 1.00 39.56 N ATOM 56 CA TRP A 8 30.021 51.018 14.546 1.00 39.94 C ATOM 57 C TRP A 8 30.015 52.047 13.421 1.00 40.93 C ATOM 58 O TRP A 8 29.195 52.964 13.422 1.00 42.05 O ATOM 59 CB TRP A 8 28.816 50.085 14.428 1.00 39.21 C ATOM 60 CG TRP A 8 28.711 49.090 15.551 1.00 39.46 C ATOM 61 CD1 TRP A 8 27.853 49.136 16.615 1.00 39.22 C ATOM 62 CD2 TRP A 8 29.500 47.907 15.722 1.00 38.77 C ATOM 63 NE1 TRP A 8 28.058 48.052 17.435 1.00 40.04 N ATOM 64 CE2 TRP A 8 29.062 47.280 16.909 1.00 39.84 C ATOM 65 CE3 TRP A 8 30.531 47.314 14.987 1.00 38.53 C ATOM 66 CZ2 TRP A 8 29.622 46.085 17.379 1.00 39.01 C ATOM 67 CZ3 TRP A 8 31.089 46.126 15.458 1.00 39.96 C ATOM 68 CH2 TRP A 8 30.628 45.527 16.644 1.00 38.49 C ATOM 69 HA TRP A 8 30.918 50.400 14.495 1.00 0.00 H ATOM 70 HB2 TRP A 8 27.910 50.691 14.419 1.00 0.00 H ATOM 71 HB3 TRP A 8 28.895 49.538 13.489 1.00 0.00 H ATOM 72 HE1 TRP A 8 27.536 47.850 18.312 1.00 0.00 H ATOM 73 HD1 TRP A 8 27.114 49.918 16.788 1.00 0.00 H ATOM 74 HZ2 TRP A 8 29.267 45.618 18.298 1.00 0.00 H ATOM 75 HH2 TRP A 8 31.084 44.597 16.984 1.00 0.00 H ATOM 76 HZ3 TRP A 8 31.896 45.654 14.898 1.00 0.00 H ATOM 77 HE3 TRP A 8 30.891 47.771 14.065 1.00 0.00 H ATOM 78 H TRP A 8 29.113 51.698 16.380 1.00 0.00 H ATOM 79 N ALA A 9 30.923 51.898 12.466 1.00 41.12 N ATOM 80 CA ALA A 9 31.056 52.878 11.389 1.00 42.07 C ATOM 81 C ALA A 9 29.881 52.869 10.414 1.00 42.19 C ATOM 82 O ALA A 9 29.350 53.918 10.072 1.00 42.04 O ATOM 83 CB ALA A 9 32.376 52.685 10.644 1.00 42.60 C ATOM 84 HA ALA A 9 31.052 53.859 11.865 1.00 0.00 H ATOM 85 HB1 ALA A 9 33.206 52.810 11.340 1.00 0.00 H ATOM 86 HB2 ALA A 9 32.407 51.683 10.216 1.00 0.00 H ATOM 87 HB3 ALA A 9 32.454 53.425 9.847 1.00 0.00 H ATOM 88 H ALA A 9 31.552 51.070 12.483 1.00 0.00 H ATOM 89 N THR A 10 29.477 51.682 9.974 1.00 42.97 N ATOM 90 CA THR A 10 28.380 51.554 9.022 1.00 43.20 C ATOM 91 C THR A 10 27.291 50.626 9.529 1.00 44.12 C ATOM 92 O THR A 10 27.518 49.808 10.428 1.00 44.25 O ATOM 93 CB THR A 10 28.872 51.027 7.650 1.00 44.03 C ATOM 94 OG1 THR A 10 29.365 49.688 7.794 1.00 44.82 O ATOM 95 CG2 THR A 10 29.977 51.911 7.091 1.00 42.79 C ATOM 96 HA THR A 10 27.971 52.557 8.904 1.00 0.00 H ATOM 97 HB THR A 10 28.030 51.041 6.958 1.00 0.00 H ATOM 98 HG1 THR A 10 30.118 49.682 8.437 1.00 0.00 H ATOM 99 HG23 THR A 10 29.605 52.930 6.981 1.00 0.00 H ATOM 100 HG21 THR A 10 30.826 51.905 7.775 1.00 0.00 H ATOM 101 HG22 THR A 10 30.289 51.529 6.119 1.00 0.00 H ATOM 102 H THR A 10 29.955 50.824 10.317 1.00 0.00 H ATOM 103 N ARG A 11 26.104 50.753 8.946 1.00 43.87 N ATOM 104 CA ARG A 11 24.984 49.901 9.302 1.00 44.19 C ATOM 105 C ARG A 11 25.222 48.454 8.871 1.00 44.10 C ATOM 106 O ARG A 11 24.850 47.523 9.590 1.00 41.79 O ATOM 107 CB ARG A 11 23.692 50.433 8.692 1.00 46.45 C ATOM 108 CG ARG A 11 22.436 49.818 9.286 1.00 48.90 C ATOM 109 CD ARG A 11 21.221 50.659 8.953 1.00 52.81 C ATOM 110 NE ARG A 11 21.307 51.995 9.548 1.00 54.49 N ATOM 111 CZ ARG A 11 20.634 52.376 10.630 1.00 55.90 C ATOM 112 NH1 ARG A 11 19.815 51.530 11.239 1.00 57.23 N ATOM 113 NH2 ARG A 11 20.774 53.606 11.105 1.00 57.29 N ATOM 114 HA ARG A 11 24.890 49.914 10.388 1.00 0.00 H ATOM 115 HB2 ARG A 11 23.655 51.511 8.850 1.00 0.00 H ATOM 116 HB3 ARG A 11 23.705 50.224 7.622 1.00 0.00 H ATOM 117 HG2 ARG A 11 22.301 48.816 8.879 1.00 0.00 H ATOM 118 HG3 ARG A 11 22.544 49.758 10.369 1.00 0.00 H ATOM 119 HD2 ARG A 11 20.330 50.159 9.333 1.00 0.00 H ATOM 120 HD3 ARG A 11 21.146 50.758 7.870 1.00 0.00 H ATOM 121 HE ARG A 11 21.934 52.690 9.095 1.00 0.00 H ATOM 122 HH12 ARG A 11 19.291 51.832 12.085 1.00 0.00 H ATOM 123 HH11 ARG A 11 19.697 50.564 10.871 1.00 0.00 H ATOM 124 HH22 ARG A 11 20.246 53.900 11.951 1.00 0.00 H ATOM 125 HH21 ARG A 11 21.412 54.277 10.631 1.00 0.00 H ATOM 126 H ARG A 11 25.974 51.482 8.216 1.00 0.00 H ATOM 127 N LEU A 12 25.838 48.272 7.702 1.00 42.40 N ATOM 128 CA LEU A 12 26.156 46.939 7.200 1.00 43.07 C ATOM 129 C LEU A 12 27.150 46.278 8.138 1.00 42.61 C ATOM 130 O LEU A 12 26.957 45.136 8.551 1.00 43.31 O ATOM 131 CB LEU A 12 26.746 46.995 5.790 1.00 42.46 C ATOM 132 CG LEU A 12 27.273 45.659 5.246 1.00 42.57 C ATOM 133 CD1 LEU A 12 26.119 44.733 4.842 1.00 42.90 C ATOM 134 CD2 LEU A 12 28.214 45.878 4.075 1.00 41.20 C ATOM 135 HA LEU A 12 25.233 46.361 7.155 1.00 0.00 H ATOM 136 HB2 LEU A 12 25.969 47.352 5.113 1.00 0.00 H ATOM 137 HB3 LEU A 12 27.573 47.705 5.798 1.00 0.00 H ATOM 138 HG LEU A 12 27.833 45.176 6.047 1.00 0.00 H ATOM 139 HD21 LEU A 12 27.683 46.395 3.276 1.00 0.00 H ATOM 140 HD22 LEU A 12 29.062 46.481 4.400 1.00 0.00 H ATOM 141 HD23 LEU A 12 28.570 44.914 3.712 1.00 0.00 H ATOM 142 HD11 LEU A 12 25.493 44.533 5.712 1.00 0.00 H ATOM 143 HD12 LEU A 12 25.523 45.215 4.067 1.00 0.00 H ATOM 144 HD13 LEU A 12 26.524 43.795 4.461 1.00 0.00 H ATOM 145 H LEU A 12 26.099 49.102 7.133 1.00 0.00 H ATOM 146 N GLY A 13 28.213 47.004 8.467 1.00 41.04 N ATOM 147 CA GLY A 13 29.215 46.521 9.403 1.00 41.27 C ATOM 148 C GLY A 13 28.604 46.124 10.734 1.00 41.35 C ATOM 149 O GLY A 13 29.015 45.133 11.329 1.00 42.42 O ATOM 150 HA3 GLY A 13 29.948 47.310 9.573 1.00 0.00 H ATOM 151 HA2 GLY A 13 29.712 45.653 8.970 1.00 0.00 H ATOM 152 H GLY A 13 28.332 47.946 8.042 1.00 0.00 H ATOM 153 N LEU A 14 27.625 46.901 11.197 1.00 40.82 N ATOM 154 CA LEU A 14 26.900 46.599 12.426 1.00 40.29 C ATOM 155 C LEU A 14 26.179 45.262 12.304 1.00 41.01 C ATOM 156 O LEU A 14 26.302 44.403 13.183 1.00 39.65 O ATOM 157 CB LEU A 14 25.881 47.699 12.758 1.00 38.84 C ATOM 158 CG LEU A 14 24.821 47.390 13.838 1.00 38.75 C ATOM 159 CD1 LEU A 14 25.460 47.007 15.182 1.00 37.25 C ATOM 160 CD2 LEU A 14 23.825 48.542 14.027 1.00 36.96 C ATOM 161 HA LEU A 14 27.631 46.546 13.233 1.00 0.00 H ATOM 162 HB2 LEU A 14 26.441 48.573 13.091 1.00 0.00 H ATOM 163 HB3 LEU A 14 25.349 47.939 11.838 1.00 0.00 H ATOM 164 HG LEU A 14 24.264 46.528 13.471 1.00 0.00 H ATOM 165 HD21 LEU A 14 24.363 49.440 14.330 1.00 0.00 H ATOM 166 HD22 LEU A 14 23.305 48.729 13.088 1.00 0.00 H ATOM 167 HD23 LEU A 14 23.102 48.273 14.797 1.00 0.00 H ATOM 168 HD11 LEU A 14 26.079 46.120 15.049 1.00 0.00 H ATOM 169 HD12 LEU A 14 26.077 47.832 15.538 1.00 0.00 H ATOM 170 HD13 LEU A 14 24.676 46.799 15.910 1.00 0.00 H ATOM 171 H LEU A 14 27.368 47.755 10.662 1.00 0.00 H ATOM 172 N ILE A 15 25.425 45.108 11.214 1.00 41.27 N ATOM 173 CA ILE A 15 24.626 43.910 10.969 1.00 41.20 C ATOM 174 C ILE A 15 25.492 42.660 10.835 1.00 39.75 C ATOM 175 O ILE A 15 25.209 41.638 11.459 1.00 39.98 O ATOM 176 CB ILE A 15 23.760 44.044 9.701 1.00 42.11 C ATOM 177 CG1 ILE A 15 22.826 45.253 9.801 1.00 43.11 C ATOM 178 CG2 ILE A 15 22.949 42.781 9.473 1.00 41.91 C ATOM 179 CD1 ILE A 15 21.683 45.074 10.750 1.00 43.05 C ATOM 180 HA ILE A 15 23.978 43.807 11.840 1.00 0.00 H ATOM 181 HB ILE A 15 24.429 44.192 8.853 1.00 0.00 H ATOM 182 HG12 ILE A 15 23.412 46.111 10.131 1.00 0.00 H ATOM 183 HG13 ILE A 15 22.419 45.452 8.810 1.00 0.00 H ATOM 184 HD11 ILE A 15 21.075 44.228 10.430 1.00 0.00 H ATOM 185 HD12 ILE A 15 22.070 44.887 11.752 1.00 0.00 H ATOM 186 HD13 ILE A 15 21.074 45.978 10.758 1.00 0.00 H ATOM 187 HG21 ILE A 15 23.624 41.934 9.353 1.00 0.00 H ATOM 188 HG22 ILE A 15 22.298 42.609 10.330 1.00 0.00 H ATOM 189 HG23 ILE A 15 22.345 42.896 8.573 1.00 0.00 H ATOM 190 H ILE A 15 25.405 45.873 10.510 1.00 0.00 H ATOM 191 N LEU A 16 26.542 42.750 10.025 1.00 37.57 N ATOM 192 CA LEU A 16 27.440 41.621 9.799 1.00 36.38 C ATOM 193 C LEU A 16 28.234 41.248 11.056 1.00 36.20 C ATOM 194 O LEU A 16 28.550 40.075 11.270 1.00 35.55 O ATOM 195 CB LEU A 16 28.392 41.899 8.629 1.00 35.54 C ATOM 196 CG LEU A 16 27.761 42.059 7.239 1.00 36.36 C ATOM 197 CD1 LEU A 16 28.848 42.160 6.174 1.00 34.90 C ATOM 198 CD2 LEU A 16 26.794 40.917 6.911 1.00 35.40 C ATOM 199 HA LEU A 16 26.812 40.768 9.545 1.00 0.00 H ATOM 200 HB2 LEU A 16 28.930 42.820 8.854 1.00 0.00 H ATOM 201 HB3 LEU A 16 29.099 41.071 8.576 1.00 0.00 H ATOM 202 HG LEU A 16 27.181 42.982 7.247 1.00 0.00 H ATOM 203 HD21 LEU A 16 27.332 39.969 6.934 1.00 0.00 H ATOM 204 HD22 LEU A 16 25.992 40.899 7.649 1.00 0.00 H ATOM 205 HD23 LEU A 16 26.372 41.073 5.918 1.00 0.00 H ATOM 206 HD11 LEU A 16 29.479 43.024 6.381 1.00 0.00 H ATOM 207 HD12 LEU A 16 29.454 41.254 6.189 1.00 0.00 H ATOM 208 HD13 LEU A 16 28.385 42.273 5.194 1.00 0.00 H ATOM 209 H LEU A 16 26.729 43.650 9.538 1.00 0.00 H ATOM 210 N ALA A 17 28.560 42.249 11.872 1.00 34.53 N ATOM 211 CA ALA A 17 29.262 42.014 13.132 1.00 34.81 C ATOM 212 C ALA A 17 28.350 41.293 14.109 1.00 32.76 C ATOM 213 O ALA A 17 28.784 40.381 14.808 1.00 33.76 O ATOM 214 CB ALA A 17 29.747 43.316 13.733 1.00 33.78 C ATOM 215 HA ALA A 17 30.132 41.389 12.928 1.00 0.00 H ATOM 216 HB1 ALA A 17 30.430 43.804 13.037 1.00 0.00 H ATOM 217 HB2 ALA A 17 28.894 43.967 13.923 1.00 0.00 H ATOM 218 HB3 ALA A 17 30.266 43.111 14.670 1.00 0.00 H ATOM 219 H ALA A 17 28.309 43.222 11.606 1.00 0.00 H ATOM 220 N MET A 18 27.089 41.712 14.148 1.00 31.49 N ATOM 221 CA MET A 18 26.082 41.094 15.005 1.00 31.84 C ATOM 222 C MET A 18 25.679 39.714 14.484 1.00 32.78 C ATOM 223 O MET A 18 25.321 38.816 15.267 1.00 32.82 O ATOM 224 CB MET A 18 24.855 41.996 15.116 1.00 32.16 C ATOM 225 CG MET A 18 25.026 43.181 16.035 1.00 33.03 C ATOM 226 SD MET A 18 24.701 42.748 17.764 1.00 35.19 S ATOM 227 CE MET A 18 24.516 44.383 18.477 1.00 33.76 C ATOM 228 HA MET A 18 26.519 40.965 15.995 1.00 0.00 H ATOM 229 HB2 MET A 18 24.616 42.370 14.120 1.00 0.00 H ATOM 230 HB3 MET A 18 24.024 41.396 15.486 1.00 0.00 H ATOM 231 HG2 MET A 18 24.333 43.965 15.732 1.00 0.00 H ATOM 232 HG3 MET A 18 26.049 43.549 15.950 1.00 0.00 H ATOM 233 HE1 MET A 18 25.436 44.948 18.330 1.00 0.00 H ATOM 234 HE2 MET A 18 23.689 44.899 17.989 1.00 0.00 H ATOM 235 HE3 MET A 18 24.311 44.292 19.544 1.00 0.00 H ATOM 236 H MET A 18 26.809 42.511 13.544 1.00 0.00 H ATOM 237 N ALA A 19 25.729 39.547 13.163 1.00 30.43 N ATOM 238 CA ALA A 19 25.483 38.243 12.554 1.00 31.12 C ATOM 239 C ALA A 19 26.645 37.315 12.888 1.00 29.33 C ATOM 240 O ALA A 19 26.446 36.147 13.146 1.00 31.93 O ATOM 241 CB ALA A 19 25.305 38.364 11.032 1.00 28.54 C ATOM 242 HA ALA A 19 24.557 37.831 12.956 1.00 0.00 H ATOM 243 HB1 ALA A 19 24.457 39.014 10.817 1.00 0.00 H ATOM 244 HB2 ALA A 19 26.209 38.788 10.594 1.00 0.00 H ATOM 245 HB3 ALA A 19 25.123 37.376 10.609 1.00 0.00 H ATOM 246 H ALA A 19 25.947 40.361 12.554 1.00 0.00 H ATOM 247 N GLY A 20 27.858 37.854 12.885 1.00 30.24 N ATOM 248 CA GLY A 20 29.051 37.084 13.209 1.00 28.72 C ATOM 249 C GLY A 20 29.068 36.687 14.672 1.00 29.90 C ATOM 250 O GLY A 20 29.549 35.601 15.024 1.00 31.11 O ATOM 251 HA3 GLY A 20 29.933 37.687 12.994 1.00 0.00 H ATOM 252 HA2 GLY A 20 29.070 36.183 12.596 1.00 0.00 H ATOM 253 H GLY A 20 27.960 38.860 12.643 1.00 0.00 H ATOM 254 N ASN A 21 28.554 37.576 15.519 1.00 28.44 N ATOM 255 CA ASN A 21 28.373 37.297 16.934 1.00 28.63 C ATOM 256 C ASN A 21 27.522 36.027 17.052 1.00 26.24 C ATOM 257 O ASN A 21 27.941 35.047 17.641 1.00 26.17 O ATOM 258 CB ASN A 21 27.721 38.511 17.628 1.00 28.75 C ATOM 259 CG ASN A 21 27.580 38.345 19.136 1.00 31.21 C ATOM 260 OD1 ASN A 21 27.465 37.230 19.648 1.00 31.63 O ATOM 261 ND2 ASN A 21 27.577 39.470 19.857 1.00 28.91 N ATOM 262 HA ASN A 21 29.327 37.129 17.434 1.00 0.00 H ATOM 263 HB2 ASN A 21 28.334 39.391 17.433 1.00 0.00 H ATOM 264 HB3 ASN A 21 26.729 38.660 17.203 1.00 0.00 H ATOM 265 HD22 ASN A 21 27.677 40.391 19.384 1.00 0.00 H ATOM 266 HD21 ASN A 21 27.475 39.425 20.891 1.00 0.00 H ATOM 267 H ASN A 21 28.271 38.508 15.154 1.00 0.00 H ATOM 268 N ALA A 22 26.340 36.053 16.451 1.00 25.58 N ATOM 269 CA ALA A 22 25.381 34.957 16.559 1.00 25.71 C ATOM 270 C ALA A 22 25.747 33.695 15.768 1.00 26.58 C ATOM 271 O ALA A 22 25.696 32.584 16.315 1.00 25.80 O ATOM 272 CB ALA A 22 23.980 35.444 16.169 1.00 25.48 C ATOM 273 HA ALA A 22 25.404 34.653 17.605 1.00 0.00 H ATOM 274 HB1 ALA A 22 23.679 36.252 16.836 1.00 0.00 H ATOM 275 HB2 ALA A 22 23.996 35.807 15.141 1.00 0.00 H ATOM 276 HB3 ALA A 22 23.273 34.618 16.253 1.00 0.00 H ATOM 277 H ALA A 22 26.087 36.885 15.881 1.00 0.00 H ATOM 278 N VAL A 23 26.093 33.858 14.488 1.00 27.15 N ATOM 279 CA VAL A 23 26.441 32.722 13.628 1.00 27.14 C ATOM 280 C VAL A 23 27.774 32.102 14.025 1.00 26.24 C ATOM 281 O VAL A 23 28.832 32.709 13.839 1.00 27.31 O ATOM 282 CB VAL A 23 26.498 33.124 12.143 1.00 28.15 C ATOM 283 CG1 VAL A 23 26.985 31.936 11.300 1.00 27.95 C ATOM 284 CG2 VAL A 23 25.136 33.602 11.672 1.00 26.17 C ATOM 285 HA VAL A 23 25.650 31.985 13.766 1.00 0.00 H ATOM 286 HB VAL A 23 27.203 33.946 12.022 1.00 0.00 H ATOM 287 HG11 VAL A 23 27.980 31.640 11.632 1.00 0.00 H ATOM 288 HG12 VAL A 23 26.297 31.100 11.421 1.00 0.00 H ATOM 289 HG13 VAL A 23 27.023 32.228 10.251 1.00 0.00 H ATOM 290 HG21 VAL A 23 24.408 32.800 11.796 1.00 0.00 H ATOM 291 HG22 VAL A 23 24.831 34.466 12.263 1.00 0.00 H ATOM 292 HG23 VAL A 23 25.194 33.882 10.620 1.00 0.00 H ATOM 293 H VAL A 23 26.116 34.818 14.090 1.00 0.00 H ATOM 294 N GLY A 24 27.738 30.895 14.576 1.00 27.40 N ATOM 295 CA GLY A 24 28.966 30.280 15.064 1.00 26.35 C ATOM 296 C GLY A 24 28.969 28.770 15.109 1.00 27.02 C ATOM 297 O GLY A 24 28.271 28.099 14.343 1.00 27.87 O ATOM 298 HA3 GLY A 24 29.145 30.646 16.075 1.00 0.00 H ATOM 299 HA2 GLY A 24 29.781 30.598 14.414 1.00 0.00 H ATOM 300 H GLY A 24 26.834 30.388 14.660 1.00 0.00 H ATOM 301 N LEU A 25 29.774 28.234 16.015 1.00 27.86 N ATOM 302 CA LEU A 25 29.844 26.804 16.221 1.00 27.99 C ATOM 303 C LEU A 25 28.472 26.236 16.571 1.00 29.61 C ATOM 304 O LEU A 25 28.193 25.069 16.306 1.00 31.76 O ATOM 305 CB LEU A 25 30.860 26.480 17.319 1.00 28.15 C ATOM 306 CG LEU A 25 32.281 26.997 17.074 1.00 28.34 C ATOM 307 CD1 LEU A 25 33.178 26.625 18.239 1.00 26.86 C ATOM 308 CD2 LEU A 25 32.850 26.454 15.765 1.00 28.02 C ATOM 309 HA LEU A 25 30.172 26.337 15.292 1.00 0.00 H ATOM 310 HB2 LEU A 25 30.499 26.916 18.250 1.00 0.00 H ATOM 311 HB3 LEU A 25 30.910 25.396 17.422 1.00 0.00 H ATOM 312 HG LEU A 25 32.239 28.083 16.992 1.00 0.00 H ATOM 313 HD21 LEU A 25 32.878 25.365 15.807 1.00 0.00 H ATOM 314 HD22 LEU A 25 32.217 26.771 14.936 1.00 0.00 H ATOM 315 HD23 LEU A 25 33.859 26.840 15.621 1.00 0.00 H ATOM 316 HD11 LEU A 25 32.787 27.071 19.154 1.00 0.00 H ATOM 317 HD12 LEU A 25 33.204 25.540 18.344 1.00 0.00 H ATOM 318 HD13 LEU A 25 34.185 26.998 18.054 1.00 0.00 H ATOM 319 H LEU A 25 30.372 28.858 16.594 1.00 0.00 H ATOM 320 N GLY A 26 27.614 27.066 17.157 1.00 30.18 N ATOM 321 CA GLY A 26 26.261 26.644 17.517 1.00 29.26 C ATOM 322 C GLY A 26 25.403 26.289 16.318 1.00 29.58 C ATOM 323 O GLY A 26 24.541 25.403 16.395 1.00 29.25 O ATOM 324 HA3 GLY A 26 25.778 27.457 18.060 1.00 0.00 H ATOM 325 HA2 GLY A 26 26.332 25.769 18.163 1.00 0.00 H ATOM 326 H GLY A 26 27.913 28.040 17.365 1.00 0.00 H ATOM 327 N ASN A 27 25.631 26.979 15.203 1.00 29.33 N ATOM 328 CA ASN A 27 24.864 26.728 13.981 1.00 28.41 C ATOM 329 C ASN A 27 25.258 25.426 13.296 1.00 29.01 C ATOM 330 O ASN A 27 24.408 24.685 12.804 1.00 29.00 O ATOM 331 CB ASN A 27 25.036 27.882 12.983 1.00 27.28 C ATOM 332 CG ASN A 27 24.690 29.230 13.585 1.00 27.62 C ATOM 333 OD1 ASN A 27 25.282 29.647 14.583 1.00 26.98 O ATOM 334 ND2 ASN A 27 23.735 29.924 12.979 1.00 27.71 N ATOM 335 HA ASN A 27 23.822 26.649 14.290 1.00 0.00 H ATOM 336 HB2 ASN A 27 26.074 27.904 12.650 1.00 0.00 H ATOM 337 HB3 ASN A 27 24.385 27.704 12.127 1.00 0.00 H ATOM 338 HD22 ASN A 27 23.262 29.534 12.139 1.00 0.00 H ATOM 339 HD21 ASN A 27 23.460 30.858 13.344 1.00 0.00 H ATOM 340 H ASN A 27 26.369 27.712 15.199 1.00 0.00 H ATOM 341 N PHE A 28 26.558 25.156 13.273 1.00 29.08 N ATOM 342 CA PHE A 28 27.088 24.051 12.493 1.00 29.37 C ATOM 343 C PHE A 28 27.404 22.798 13.307 1.00 29.82 C ATOM 344 O PHE A 28 27.325 21.687 12.775 1.00 30.51 O ATOM 345 CB PHE A 28 28.307 24.528 11.694 1.00 28.73 C ATOM 346 CG PHE A 28 27.981 25.635 10.733 1.00 28.84 C ATOM 347 CD1 PHE A 28 27.392 25.353 9.506 1.00 28.26 C ATOM 348 CD2 PHE A 28 28.234 26.957 11.067 1.00 27.38 C ATOM 349 CE1 PHE A 28 27.073 26.381 8.618 1.00 28.82 C ATOM 350 CE2 PHE A 28 27.920 27.982 10.192 1.00 30.06 C ATOM 351 CZ PHE A 28 27.339 27.697 8.965 1.00 29.67 C ATOM 352 HA PHE A 28 26.297 23.739 11.811 1.00 0.00 H ATOM 353 HB2 PHE A 28 29.063 24.886 12.393 1.00 0.00 H ATOM 354 HB3 PHE A 28 28.705 23.684 11.130 1.00 0.00 H ATOM 355 HD2 PHE A 28 28.686 27.192 12.031 1.00 0.00 H ATOM 356 HE2 PHE A 28 28.130 29.016 10.467 1.00 0.00 H ATOM 357 HZ PHE A 28 27.092 28.505 8.276 1.00 0.00 H ATOM 358 HE1 PHE A 28 26.617 26.151 7.655 1.00 0.00 H ATOM 359 HD1 PHE A 28 27.177 24.319 9.235 1.00 0.00 H ATOM 360 H PHE A 28 27.211 25.748 13.825 1.00 0.00 H ATOM 361 N LEU A 29 27.742 22.974 14.584 1.00 28.48 N ATOM 362 CA LEU A 29 28.034 21.835 15.458 1.00 29.25 C ATOM 363 C LEU A 29 26.902 21.469 16.415 1.00 29.05 C ATOM 364 O LEU A 29 26.506 20.312 16.488 1.00 28.47 O ATOM 365 CB LEU A 29 29.303 22.078 16.273 1.00 28.07 C ATOM 366 CG LEU A 29 30.646 22.140 15.549 1.00 28.73 C ATOM 367 CD1 LEU A 29 31.751 22.473 16.561 1.00 27.20 C ATOM 368 CD2 LEU A 29 30.946 20.835 14.801 1.00 27.56 C ATOM 369 HA LEU A 29 28.167 20.994 14.778 1.00 0.00 H ATOM 370 HB2 LEU A 29 29.174 23.029 16.790 1.00 0.00 H ATOM 371 HB3 LEU A 29 29.371 21.274 17.006 1.00 0.00 H ATOM 372 HG LEU A 29 30.604 22.927 14.796 1.00 0.00 H ATOM 373 HD21 LEU A 29 30.976 20.009 15.512 1.00 0.00 H ATOM 374 HD22 LEU A 29 30.165 20.653 14.063 1.00 0.00 H ATOM 375 HD23 LEU A 29 31.910 20.919 14.299 1.00 0.00 H ATOM 376 HD11 LEU A 29 31.540 23.437 17.024 1.00 0.00 H ATOM 377 HD12 LEU A 29 31.784 21.700 17.328 1.00 0.00 H ATOM 378 HD13 LEU A 29 32.711 22.518 16.047 1.00 0.00 H ATOM 379 H LEU A 29 27.800 23.939 14.968 1.00 0.00 H ATOM 380 N ARG A 30 26.396 22.459 17.150 1.00 31.08 N ATOM 381 CA ARG A 30 25.407 22.235 18.217 1.00 30.89 C ATOM 382 C ARG A 30 23.997 21.956 17.678 1.00 30.51 C ATOM 383 O ARG A 30 23.358 20.969 18.065 1.00 29.53 O ATOM 384 CB ARG A 30 25.391 23.442 19.170 1.00 32.01 C ATOM 385 CG ARG A 30 24.867 23.166 20.588 1.00 34.65 C ATOM 386 CD ARG A 30 24.729 24.489 21.370 1.00 35.73 C ATOM 387 NE ARG A 30 24.458 24.313 22.800 1.00 36.16 N ATOM 388 CZ ARG A 30 23.248 24.123 23.331 1.00 37.60 C ATOM 389 NH1 ARG A 30 22.163 24.069 22.561 1.00 35.31 N ATOM 390 NH2 ARG A 30 23.124 23.979 24.644 1.00 37.61 N ATOM 391 HA ARG A 30 25.712 21.339 18.758 1.00 0.00 H ATOM 392 HB2 ARG A 30 26.412 23.814 19.257 1.00 0.00 H ATOM 393 HB3 ARG A 30 24.762 24.212 18.724 1.00 0.00 H ATOM 394 HG2 ARG A 30 23.893 22.681 20.525 1.00 0.00 H ATOM 395 HG3 ARG A 30 25.565 22.510 21.109 1.00 0.00 H ATOM 396 HD2 ARG A 30 23.910 25.061 20.934 1.00 0.00 H ATOM 397 HD3 ARG A 30 25.658 25.048 21.264 1.00 0.00 H ATOM 398 HE ARG A 30 25.270 24.338 23.450 1.00 0.00 H ATOM 399 HH12 ARG A 30 21.228 23.920 22.990 1.00 0.00 H ATOM 400 HH11 ARG A 30 22.251 24.175 21.530 1.00 0.00 H ATOM 401 HH22 ARG A 30 22.184 23.831 25.064 1.00 0.00 H ATOM 402 HH21 ARG A 30 23.966 24.014 25.253 1.00 0.00 H ATOM 403 H ARG A 30 26.713 23.431 16.962 1.00 0.00 H ATOM 404 N PHE A 31 23.514 22.815 16.783 1.00 28.59 N ATOM 405 CA PHE A 31 22.162 22.656 16.241 1.00 29.13 C ATOM 406 C PHE A 31 21.889 21.258 15.680 1.00 31.18 C ATOM 407 O PHE A 31 20.894 20.634 16.057 1.00 30.74 O ATOM 408 CB PHE A 31 21.835 23.722 15.183 1.00 29.21 C ATOM 409 CG PHE A 31 20.503 23.507 14.499 1.00 28.51 C ATOM 410 CD1 PHE A 31 19.317 23.853 15.128 1.00 28.82 C ATOM 411 CD2 PHE A 31 20.442 22.962 13.222 1.00 28.89 C ATOM 412 CE1 PHE A 31 18.085 23.657 14.498 1.00 29.38 C ATOM 413 CE2 PHE A 31 19.222 22.765 12.587 1.00 29.76 C ATOM 414 CZ PHE A 31 18.041 23.111 13.230 1.00 28.61 C ATOM 415 HA PHE A 31 21.499 22.795 17.095 1.00 0.00 H ATOM 416 HB2 PHE A 31 21.820 24.697 15.669 1.00 0.00 H ATOM 417 HB3 PHE A 31 22.618 23.708 14.425 1.00 0.00 H ATOM 418 HD2 PHE A 31 21.364 22.685 12.711 1.00 0.00 H ATOM 419 HE2 PHE A 31 19.192 22.339 11.584 1.00 0.00 H ATOM 420 HZ PHE A 31 17.082 22.952 12.736 1.00 0.00 H ATOM 421 HE1 PHE A 31 17.161 23.934 15.006 1.00 0.00 H ATOM 422 HD1 PHE A 31 19.346 24.284 16.129 1.00 0.00 H ATOM 423 H PHE A 31 24.104 23.610 16.464 1.00 0.00 H ATOM 424 N PRO A 32 22.764 20.752 14.785 1.00 31.76 N ATOM 425 CA PRO A 32 22.440 19.435 14.227 1.00 33.15 C ATOM 426 C PRO A 32 22.355 18.343 15.297 1.00 32.45 C ATOM 427 O PRO A 32 21.476 17.491 15.215 1.00 33.68 O ATOM 428 CB PRO A 32 23.603 19.156 13.256 1.00 32.80 C ATOM 429 CG PRO A 32 24.201 20.489 12.971 1.00 33.35 C ATOM 430 CD PRO A 32 24.031 21.274 14.248 1.00 31.95 C ATOM 431 HA PRO A 32 21.460 19.431 13.749 1.00 0.00 H ATOM 432 HD3 PRO A 32 24.856 21.088 14.936 1.00 0.00 H ATOM 433 HD2 PRO A 32 23.962 22.343 14.046 1.00 0.00 H ATOM 434 HG3 PRO A 32 23.677 20.976 12.149 1.00 0.00 H ATOM 435 HG2 PRO A 32 25.257 20.390 12.720 1.00 0.00 H ATOM 436 HB2 PRO A 32 24.338 18.498 13.719 1.00 0.00 H ATOM 437 HB3 PRO A 32 23.234 18.698 12.338 1.00 0.00 H ATOM 438 N VAL A 33 23.253 18.369 16.283 1.00 34.49 N ATOM 439 CA VAL A 33 23.227 17.383 17.376 1.00 34.39 C ATOM 440 C VAL A 33 21.936 17.490 18.189 1.00 35.16 C ATOM 441 O VAL A 33 21.280 16.484 18.458 1.00 34.67 O ATOM 442 CB VAL A 33 24.453 17.507 18.329 1.00 35.08 C ATOM 443 CG1 VAL A 33 24.300 16.576 19.529 1.00 34.27 C ATOM 444 CG2 VAL A 33 25.756 17.198 17.592 1.00 34.99 C ATOM 445 HA VAL A 33 23.274 16.405 16.897 1.00 0.00 H ATOM 446 HB VAL A 33 24.493 18.537 18.684 1.00 0.00 H ATOM 447 HG11 VAL A 33 23.397 16.840 20.079 1.00 0.00 H ATOM 448 HG12 VAL A 33 24.226 15.546 19.181 1.00 0.00 H ATOM 449 HG13 VAL A 33 25.168 16.680 20.181 1.00 0.00 H ATOM 450 HG21 VAL A 33 25.719 16.181 17.201 1.00 0.00 H ATOM 451 HG22 VAL A 33 25.881 17.901 16.768 1.00 0.00 H ATOM 452 HG23 VAL A 33 26.594 17.293 18.283 1.00 0.00 H ATOM 453 H VAL A 33 23.989 19.104 16.280 1.00 0.00 H ATOM 454 N GLN A 34 21.578 18.715 18.571 1.00 35.63 N ATOM 455 CA GLN A 34 20.356 18.971 19.332 1.00 35.39 C ATOM 456 C GLN A 34 19.111 18.528 18.563 1.00 36.93 C ATOM 457 O GLN A 34 18.244 17.859 19.119 1.00 36.52 O ATOM 458 CB GLN A 34 20.258 20.453 19.719 1.00 34.75 C ATOM 459 CG GLN A 34 21.391 20.934 20.626 1.00 34.60 C ATOM 460 CD GLN A 34 21.388 20.243 21.983 1.00 35.28 C ATOM 461 OE1 GLN A 34 20.333 19.968 22.543 1.00 35.06 O ATOM 462 NE2 GLN A 34 22.573 19.964 22.514 1.00 34.86 N ATOM 463 HA GLN A 34 20.406 18.378 20.245 1.00 0.00 H ATOM 464 HB2 GLN A 34 20.273 21.048 18.806 1.00 0.00 H ATOM 465 HB3 GLN A 34 19.312 20.610 20.238 1.00 0.00 H ATOM 466 HG2 GLN A 34 22.342 20.733 20.133 1.00 0.00 H ATOM 467 HG3 GLN A 34 21.283 22.008 20.780 1.00 0.00 H ATOM 468 HE22 GLN A 34 23.444 20.215 22.004 1.00 0.00 H ATOM 469 HE21 GLN A 34 22.630 19.494 23.440 1.00 0.00 H ATOM 470 H GLN A 34 22.189 19.518 18.319 1.00 0.00 H ATOM 471 N ALA A 35 19.022 18.891 17.287 1.00 37.66 N ATOM 472 CA ALA A 35 17.879 18.483 16.470 1.00 39.99 C ATOM 473 C ALA A 35 17.822 16.965 16.282 1.00 41.91 C ATOM 474 O ALA A 35 16.749 16.367 16.369 1.00 42.17 O ATOM 475 CB ALA A 35 17.896 19.186 15.121 1.00 39.99 C ATOM 476 HA ALA A 35 16.979 18.782 17.008 1.00 0.00 H ATOM 477 HB1 ALA A 35 17.850 20.264 15.274 1.00 0.00 H ATOM 478 HB2 ALA A 35 18.814 18.931 14.592 1.00 0.00 H ATOM 479 HB3 ALA A 35 17.036 18.864 14.534 1.00 0.00 H ATOM 480 H ALA A 35 19.774 19.472 16.865 1.00 0.00 H ATOM 481 N ALA A 36 18.972 16.346 16.034 1.00 43.15 N ATOM 482 CA ALA A 36 19.021 14.895 15.814 1.00 45.39 C ATOM 483 C ALA A 36 18.649 14.090 17.062 1.00 46.31 C ATOM 484 O ALA A 36 17.951 13.081 16.968 1.00 48.02 O ATOM 485 CB ALA A 36 20.390 14.473 15.298 1.00 44.96 C ATOM 486 HA ALA A 36 18.269 14.671 15.058 1.00 0.00 H ATOM 487 HB1 ALA A 36 20.593 14.979 14.354 1.00 0.00 H ATOM 488 HB2 ALA A 36 21.152 14.744 16.029 1.00 0.00 H ATOM 489 HB3 ALA A 36 20.402 13.394 15.143 1.00 0.00 H ATOM 490 H ALA A 36 19.852 16.899 15.995 1.00 0.00 H ATOM 491 N GLU A 37 19.118 14.534 18.224 1.00 46.87 N ATOM 492 CA GLU A 37 18.796 13.864 19.482 1.00 48.57 C ATOM 493 C GLU A 37 17.316 13.956 19.828 1.00 49.52 C ATOM 494 O GLU A 37 16.767 13.059 20.468 1.00 51.17 O ATOM 495 CB GLU A 37 19.605 14.454 20.636 1.00 48.14 C ATOM 496 CG GLU A 37 21.059 14.040 20.647 1.00 49.18 C ATOM 497 CD GLU A 37 21.833 14.650 21.804 1.00 49.28 C ATOM 498 OE1 GLU A 37 21.330 15.610 22.435 1.00 49.10 O ATOM 499 OE2 GLU A 37 22.954 14.167 22.073 1.00 49.85 O ATOM 500 HA GLU A 37 19.054 12.814 19.341 1.00 0.00 H ATOM 501 HB2 GLU A 37 19.559 15.541 20.566 1.00 0.00 H ATOM 502 HB3 GLU A 37 19.150 14.132 21.573 1.00 0.00 H ATOM 503 HG2 GLU A 37 21.112 12.954 20.725 1.00 0.00 H ATOM 504 HG3 GLU A 37 21.520 14.359 19.712 1.00 0.00 H ATOM 505 H GLU A 37 19.727 15.377 18.238 1.00 0.00 H ATOM 506 N ASN A 38 16.674 15.038 19.406 1.00 49.22 N ATOM 507 CA ASN A 38 15.292 15.296 19.789 1.00 50.36 C ATOM 508 C ASN A 38 14.279 15.059 18.667 1.00 50.36 C ATOM 509 O ASN A 38 13.284 15.771 18.555 1.00 50.60 O ATOM 510 CB ASN A 38 15.169 16.712 20.361 1.00 49.56 C ATOM 511 CG ASN A 38 16.068 16.927 21.570 1.00 50.06 C ATOM 512 OD1 ASN A 38 15.833 16.370 22.642 1.00 50.68 O ATOM 513 ND2 ASN A 38 17.103 17.736 21.400 1.00 48.99 N ATOM 514 HA ASN A 38 15.038 14.566 20.557 1.00 0.00 H ATOM 515 HB2 ASN A 38 15.445 17.428 19.587 1.00 0.00 H ATOM 516 HB3 ASN A 38 14.134 16.881 20.659 1.00 0.00 H ATOM 517 HD22 ASN A 38 17.265 18.186 20.477 1.00 0.00 H ATOM 518 HD21 ASN A 38 17.754 17.921 22.190 1.00 0.00 H ATOM 519 H ASN A 38 17.167 15.715 18.790 1.00 0.00 H ATOM 520 N GLY A 39 14.554 14.056 17.838 1.00 51.38 N ATOM 521 CA GLY A 39 13.614 13.608 16.808 1.00 52.39 C ATOM 522 C GLY A 39 13.494 14.412 15.526 1.00 52.77 C ATOM 523 O GLY A 39 12.494 14.299 14.822 1.00 54.13 O ATOM 524 HA3 GLY A 39 12.625 13.585 17.265 1.00 0.00 H ATOM 525 HA2 GLY A 39 13.906 12.597 16.526 1.00 0.00 H ATOM 526 H GLY A 39 15.470 13.572 17.924 1.00 0.00 H ATOM 527 N GLY A 40 14.502 15.221 15.215 1.00 53.19 N ATOM 528 CA GLY A 40 14.507 16.000 13.976 1.00 52.72 C ATOM 529 C GLY A 40 13.390 17.024 13.881 1.00 53.59 C ATOM 530 O GLY A 40 13.486 18.113 14.450 1.00 53.63 O ATOM 531 HA3 GLY A 40 14.411 15.310 13.138 1.00 0.00 H ATOM 532 HA2 GLY A 40 15.460 16.525 13.906 1.00 0.00 H ATOM 533 H GLY A 40 15.307 15.302 15.868 1.00 0.00 H ATOM 534 N GLY A 41 12.328 16.671 13.158 1.00 53.47 N ATOM 535 CA GLY A 41 11.175 17.555 12.980 1.00 53.83 C ATOM 536 C GLY A 41 10.396 17.781 14.261 1.00 54.06 C ATOM 537 O GLY A 41 9.680 18.778 14.398 1.00 55.05 O ATOM 538 HA3 GLY A 41 10.508 17.111 12.241 1.00 0.00 H ATOM 539 HA2 GLY A 41 11.529 18.519 12.614 1.00 0.00 H ATOM 540 H GLY A 41 12.318 15.735 12.705 1.00 0.00 H ATOM 541 N ALA A 42 10.536 16.847 15.198 1.00 53.50 N ATOM 542 CA ALA A 42 9.918 16.951 16.515 1.00 53.00 C ATOM 543 C ALA A 42 10.554 18.080 17.329 1.00 52.04 C ATOM 544 O ALA A 42 9.928 18.657 18.222 1.00 52.34 O ATOM 545 CB ALA A 42 10.050 15.632 17.256 1.00 53.29 C ATOM 546 HA ALA A 42 8.861 17.182 16.382 1.00 0.00 H ATOM 547 HB1 ALA A 42 9.553 14.846 16.687 1.00 0.00 H ATOM 548 HB2 ALA A 42 11.106 15.386 17.373 1.00 0.00 H ATOM 549 HB3 ALA A 42 9.585 15.720 18.238 1.00 0.00 H ATOM 550 H ALA A 42 11.110 16.007 14.982 1.00 0.00 H ATOM 551 N PHE A 43 11.807 18.382 17.008 1.00 50.40 N ATOM 552 CA PHE A 43 12.560 19.431 17.671 1.00 47.63 C ATOM 553 C PHE A 43 12.209 20.792 17.099 1.00 47.68 C ATOM 554 O PHE A 43 12.293 21.805 17.794 1.00 46.81 O ATOM 555 CB PHE A 43 14.053 19.164 17.481 1.00 46.47 C ATOM 556 CG PHE A 43 14.953 20.219 18.059 1.00 45.08 C ATOM 557 CD1 PHE A 43 15.227 20.248 19.420 1.00 44.39 C ATOM 558 CD2 PHE A 43 15.547 21.167 17.239 1.00 44.50 C ATOM 559 CE1 PHE A 43 16.067 21.208 19.952 1.00 43.92 C ATOM 560 CE2 PHE A 43 16.388 22.133 17.762 1.00 44.30 C ATOM 561 CZ PHE A 43 16.648 22.156 19.121 1.00 44.30 C ATOM 562 HA PHE A 43 12.309 19.432 18.732 1.00 0.00 H ATOM 563 HB2 PHE A 43 14.292 18.213 17.958 1.00 0.00 H ATOM 564 HB3 PHE A 43 14.253 19.094 16.412 1.00 0.00 H ATOM 565 HD2 PHE A 43 15.348 21.151 16.167 1.00 0.00 H ATOM 566 HE2 PHE A 43 16.844 22.874 17.106 1.00 0.00 H ATOM 567 HZ PHE A 43 17.308 22.917 19.538 1.00 0.00 H ATOM 568 HE1 PHE A 43 16.273 21.221 21.022 1.00 0.00 H ATOM 569 HD1 PHE A 43 14.774 19.505 20.076 1.00 0.00 H ATOM 570 H PHE A 43 12.269 17.843 16.248 1.00 0.00 H ATOM 571 N MET A 44 11.802 20.808 15.832 1.00 47.01 N ATOM 572 CA MET A 44 11.638 22.065 15.094 1.00 46.80 C ATOM 573 C MET A 44 10.420 22.928 15.456 1.00 46.56 C ATOM 574 O MET A 44 10.490 24.153 15.365 1.00 46.45 O ATOM 575 CB MET A 44 11.697 21.815 13.580 1.00 47.01 C ATOM 576 CG MET A 44 13.068 21.358 13.092 1.00 47.03 C ATOM 577 SD MET A 44 14.429 22.448 13.591 1.00 48.59 S ATOM 578 CE MET A 44 13.927 23.969 12.785 1.00 46.90 C ATOM 579 HA MET A 44 12.485 22.669 15.420 1.00 0.00 H ATOM 580 HB2 MET A 44 10.967 21.046 13.328 1.00 0.00 H ATOM 581 HB3 MET A 44 11.439 22.741 13.067 1.00 0.00 H ATOM 582 HG2 MET A 44 13.047 21.312 12.003 1.00 0.00 H ATOM 583 HG3 MET A 44 13.261 20.363 13.493 1.00 0.00 H ATOM 584 HE1 MET A 44 13.863 23.805 11.709 1.00 0.00 H ATOM 585 HE2 MET A 44 12.953 24.276 13.165 1.00 0.00 H ATOM 586 HE3 MET A 44 14.661 24.748 12.992 1.00 0.00 H ATOM 587 H MET A 44 11.595 19.908 15.354 1.00 0.00 H ATOM 588 N ILE A 45 9.314 22.317 15.862 1.00 45.39 N ATOM 589 CA ILE A 45 8.148 23.123 16.244 1.00 44.65 C ATOM 590 C ILE A 45 8.397 23.899 17.550 1.00 43.28 C ATOM 591 O ILE A 45 8.159 25.107 17.598 1.00 44.05 O ATOM 592 CB ILE A 45 6.835 22.304 16.302 1.00 45.34 C ATOM 593 CG1 ILE A 45 6.435 21.867 14.895 1.00 45.88 C ATOM 594 CG2 ILE A 45 5.711 23.132 16.920 1.00 45.65 C ATOM 595 CD1 ILE A 45 5.037 21.292 14.806 1.00 47.21 C ATOM 596 HA ILE A 45 8.010 23.854 15.447 1.00 0.00 H ATOM 597 HB ILE A 45 7.003 21.424 16.923 1.00 0.00 H ATOM 598 HG12 ILE A 45 6.493 22.734 14.237 1.00 0.00 H ATOM 599 HG13 ILE A 45 7.141 21.108 14.557 1.00 0.00 H ATOM 600 HD11 ILE A 45 4.964 20.416 15.450 1.00 0.00 H ATOM 601 HD12 ILE A 45 4.316 22.043 15.129 1.00 0.00 H ATOM 602 HD13 ILE A 45 4.828 21.005 13.775 1.00 0.00 H ATOM 603 HG21 ILE A 45 5.991 23.424 17.932 1.00 0.00 H ATOM 604 HG22 ILE A 45 5.545 24.024 16.316 1.00 0.00 H ATOM 605 HG23 ILE A 45 4.798 22.537 16.951 1.00 0.00 H ATOM 606 H ILE A 45 9.274 21.279 15.909 1.00 0.00 H ATOM 607 N PRO A 46 8.870 23.210 18.607 1.00 41.13 N ATOM 608 CA PRO A 46 9.291 23.905 19.818 1.00 39.97 C ATOM 609 C PRO A 46 10.376 24.943 19.536 1.00 39.38 C ATOM 610 O PRO A 46 10.348 26.021 20.124 1.00 38.97 O ATOM 611 CB PRO A 46 9.866 22.780 20.685 1.00 40.04 C ATOM 612 CG PRO A 46 9.169 21.558 20.216 1.00 40.93 C ATOM 613 CD PRO A 46 9.012 21.749 18.742 1.00 41.21 C ATOM 614 HA PRO A 46 8.470 24.453 20.281 1.00 0.00 H ATOM 615 HD3 PRO A 46 9.890 21.390 18.205 1.00 0.00 H ATOM 616 HD2 PRO A 46 8.125 21.234 18.373 1.00 0.00 H ATOM 617 HG3 PRO A 46 8.195 21.463 20.697 1.00 0.00 H ATOM 618 HG2 PRO A 46 9.766 20.671 20.427 1.00 0.00 H ATOM 619 HB2 PRO A 46 10.942 22.691 20.537 1.00 0.00 H ATOM 620 HB3 PRO A 46 9.659 22.961 21.740 1.00 0.00 H ATOM 621 N TYR A 47 11.319 24.609 18.653 1.00 37.63 N ATOM 622 CA TYR A 47 12.407 25.515 18.271 1.00 37.48 C ATOM 623 C TYR A 47 11.883 26.808 17.646 1.00 38.76 C ATOM 624 O TYR A 47 12.327 27.899 18.007 1.00 40.20 O ATOM 625 CB TYR A 47 13.364 24.814 17.300 1.00 34.19 C ATOM 626 CG TYR A 47 14.526 25.651 16.791 1.00 32.25 C ATOM 627 CD1 TYR A 47 15.737 25.684 17.471 1.00 30.77 C ATOM 628 CD2 TYR A 47 14.413 26.390 15.615 1.00 31.87 C ATOM 629 CE1 TYR A 47 16.802 26.438 17.001 1.00 30.64 C ATOM 630 CE2 TYR A 47 15.461 27.147 15.139 1.00 31.29 C ATOM 631 CZ TYR A 47 16.657 27.170 15.833 1.00 32.01 C ATOM 632 OH TYR A 47 17.706 27.924 15.349 1.00 31.90 O ATOM 633 HA TYR A 47 12.943 25.782 19.182 1.00 0.00 H ATOM 634 HB3 TYR A 47 12.784 24.488 16.437 1.00 0.00 H ATOM 635 HB2 TYR A 47 13.777 23.943 17.809 1.00 0.00 H ATOM 636 HD2 TYR A 47 13.475 26.369 15.060 1.00 0.00 H ATOM 637 HE2 TYR A 47 15.348 27.724 14.221 1.00 0.00 H ATOM 638 HE1 TYR A 47 17.746 26.455 17.546 1.00 0.00 H ATOM 639 HD1 TYR A 47 15.852 25.108 18.389 1.00 0.00 H ATOM 640 HH TYR A 47 18.483 27.834 15.956 1.00 0.00 H ATOM 641 H TYR A 47 11.281 23.666 18.217 1.00 0.00 H ATOM 642 N ILE A 48 10.946 26.675 16.710 1.00 40.08 N ATOM 643 CA ILE A 48 10.348 27.822 16.035 1.00 40.77 C ATOM 644 C ILE A 48 9.563 28.678 17.022 1.00 40.61 C ATOM 645 O ILE A 48 9.681 29.904 17.019 1.00 40.40 O ATOM 646 CB ILE A 48 9.411 27.394 14.881 1.00 41.00 C ATOM 647 CG1 ILE A 48 10.205 26.783 13.729 1.00 42.55 C ATOM 648 CG2 ILE A 48 8.608 28.588 14.367 1.00 41.63 C ATOM 649 CD1 ILE A 48 9.329 26.099 12.688 1.00 41.82 C ATOM 650 HA ILE A 48 11.170 28.401 15.614 1.00 0.00 H ATOM 651 HB ILE A 48 8.726 26.643 15.275 1.00 0.00 H ATOM 652 HG12 ILE A 48 10.770 27.576 13.239 1.00 0.00 H ATOM 653 HG13 ILE A 48 10.896 26.046 14.138 1.00 0.00 H ATOM 654 HD11 ILE A 48 8.765 25.295 13.161 1.00 0.00 H ATOM 655 HD12 ILE A 48 8.638 26.827 12.261 1.00 0.00 H ATOM 656 HD13 ILE A 48 9.958 25.688 11.899 1.00 0.00 H ATOM 657 HG21 ILE A 48 8.005 28.995 15.179 1.00 0.00 H ATOM 658 HG22 ILE A 48 9.292 29.354 14.001 1.00 0.00 H ATOM 659 HG23 ILE A 48 7.956 28.264 13.556 1.00 0.00 H ATOM 660 H ILE A 48 10.629 25.719 16.450 1.00 0.00 H ATOM 661 N ILE A 49 8.761 28.022 17.861 1.00 41.07 N ATOM 662 CA ILE A 49 7.969 28.714 18.880 1.00 40.50 C ATOM 663 C ILE A 49 8.874 29.442 19.880 1.00 39.87 C ATOM 664 O ILE A 49 8.551 30.540 20.326 1.00 39.99 O ATOM 665 CB ILE A 49 7.003 27.753 19.598 1.00 40.75 C ATOM 666 CG1 ILE A 49 5.868 27.355 18.652 1.00 40.98 C ATOM 667 CG2 ILE A 49 6.421 28.397 20.842 1.00 40.57 C ATOM 668 CD1 ILE A 49 4.960 26.282 19.191 1.00 42.52 C ATOM 669 HA ILE A 49 7.362 29.462 18.371 1.00 0.00 H ATOM 670 HB ILE A 49 7.563 26.866 19.895 1.00 0.00 H ATOM 671 HG12 ILE A 49 5.267 28.241 18.448 1.00 0.00 H ATOM 672 HG13 ILE A 49 6.309 26.995 17.722 1.00 0.00 H ATOM 673 HD11 ILE A 49 5.541 25.382 19.389 1.00 0.00 H ATOM 674 HD12 ILE A 49 4.499 26.629 20.116 1.00 0.00 H ATOM 675 HD13 ILE A 49 4.185 26.061 18.457 1.00 0.00 H ATOM 676 HG21 ILE A 49 7.228 28.658 21.526 1.00 0.00 H ATOM 677 HG22 ILE A 49 5.875 29.298 20.562 1.00 0.00 H ATOM 678 HG23 ILE A 49 5.743 27.696 21.329 1.00 0.00 H ATOM 679 H ILE A 49 8.696 26.987 17.790 1.00 0.00 H ATOM 680 N ALA A 50 10.008 28.829 20.215 1.00 38.69 N ATOM 681 CA ALA A 50 10.991 29.454 21.088 1.00 37.88 C ATOM 682 C ALA A 50 11.622 30.671 20.413 1.00 38.17 C ATOM 683 O ALA A 50 11.899 31.672 21.067 1.00 37.23 O ATOM 684 CB ALA A 50 12.058 28.458 21.494 1.00 38.66 C ATOM 685 HA ALA A 50 10.477 29.792 21.988 1.00 0.00 H ATOM 686 HB1 ALA A 50 11.594 27.626 22.024 1.00 0.00 H ATOM 687 HB2 ALA A 50 12.564 28.086 20.603 1.00 0.00 H ATOM 688 HB3 ALA A 50 12.781 28.948 22.146 1.00 0.00 H ATOM 689 H ALA A 50 10.197 27.877 19.842 1.00 0.00 H ATOM 690 N PHE A 51 11.847 30.588 19.103 1.00 37.39 N ATOM 691 CA PHE A 51 12.398 31.720 18.371 1.00 37.09 C ATOM 692 C PHE A 51 11.466 32.930 18.462 1.00 37.43 C ATOM 693 O PHE A 51 11.917 34.053 18.669 1.00 38.22 O ATOM 694 CB PHE A 51 12.672 31.353 16.910 1.00 36.95 C ATOM 695 CG PHE A 51 13.166 32.504 16.078 1.00 35.88 C ATOM 696 CD1 PHE A 51 14.419 33.061 16.311 1.00 35.14 C ATOM 697 CD2 PHE A 51 12.380 33.027 15.055 1.00 35.85 C ATOM 698 CE1 PHE A 51 14.880 34.134 15.542 1.00 36.15 C ATOM 699 CE2 PHE A 51 12.826 34.093 14.279 1.00 35.75 C ATOM 700 CZ PHE A 51 14.079 34.651 14.519 1.00 35.52 C ATOM 701 HA PHE A 51 13.349 31.986 18.832 1.00 0.00 H ATOM 702 HB2 PHE A 51 13.425 30.565 16.889 1.00 0.00 H ATOM 703 HB3 PHE A 51 11.747 30.982 16.469 1.00 0.00 H ATOM 704 HD2 PHE A 51 11.399 32.595 14.858 1.00 0.00 H ATOM 705 HE2 PHE A 51 12.195 34.491 13.484 1.00 0.00 H ATOM 706 HZ PHE A 51 14.433 35.485 13.913 1.00 0.00 H ATOM 707 HE1 PHE A 51 15.861 34.566 15.739 1.00 0.00 H ATOM 708 HD1 PHE A 51 15.049 32.656 17.103 1.00 0.00 H ATOM 709 H PHE A 51 11.627 29.706 18.598 1.00 0.00 H ATOM 710 N LEU A 52 10.167 32.688 18.318 1.00 38.28 N ATOM 711 CA LEU A 52 9.174 33.760 18.318 1.00 38.14 C ATOM 712 C LEU A 52 8.846 34.297 19.718 1.00 38.23 C ATOM 713 O LEU A 52 8.688 35.505 19.906 1.00 38.16 O ATOM 714 CB LEU A 52 7.888 33.288 17.631 1.00 38.43 C ATOM 715 CG LEU A 52 7.952 32.924 16.140 1.00 38.38 C ATOM 716 CD1 LEU A 52 6.707 32.152 15.728 1.00 38.46 C ATOM 717 CD2 LEU A 52 8.143 34.159 15.265 1.00 38.25 C ATOM 718 HA LEU A 52 9.620 34.586 17.764 1.00 0.00 H ATOM 719 HB2 LEU A 52 7.542 32.403 18.165 1.00 0.00 H ATOM 720 HB3 LEU A 52 7.153 34.086 17.738 1.00 0.00 H ATOM 721 HG LEU A 52 8.822 32.285 15.990 1.00 0.00 H ATOM 722 HD21 LEU A 52 7.308 34.843 15.416 1.00 0.00 H ATOM 723 HD22 LEU A 52 9.074 34.655 15.538 1.00 0.00 H ATOM 724 HD23 LEU A 52 8.183 33.858 14.218 1.00 0.00 H ATOM 725 HD11 LEU A 52 6.638 31.236 16.315 1.00 0.00 H ATOM 726 HD12 LEU A 52 5.824 32.766 15.906 1.00 0.00 H ATOM 727 HD13 LEU A 52 6.770 31.903 14.669 1.00 0.00 H ATOM 728 H LEU A 52 9.847 31.705 18.202 1.00 0.00 H ATOM 729 N LEU A 53 8.739 33.408 20.698 1.00 36.94 N ATOM 730 CA LEU A 53 8.349 33.830 22.045 1.00 36.38 C ATOM 731 C LEU A 53 9.530 34.193 22.942 1.00 35.91 C ATOM 732 O LEU A 53 9.344 34.835 23.974 1.00 35.87 O ATOM 733 CB LEU A 53 7.480 32.765 22.722 1.00 36.19 C ATOM 734 CG LEU A 53 6.109 32.487 22.092 1.00 36.64 C ATOM 735 CD1 LEU A 53 5.380 31.382 22.850 1.00 36.36 C ATOM 736 CD2 LEU A 53 5.265 33.752 22.046 1.00 36.43 C ATOM 737 HA LEU A 53 7.770 34.744 21.911 1.00 0.00 H ATOM 738 HB2 LEU A 53 8.041 31.830 22.718 1.00 0.00 H ATOM 739 HB3 LEU A 53 7.312 33.082 23.751 1.00 0.00 H ATOM 740 HG LEU A 53 6.271 32.151 21.068 1.00 0.00 H ATOM 741 HD21 LEU A 53 5.116 34.125 23.059 1.00 0.00 H ATOM 742 HD22 LEU A 53 5.778 34.508 21.451 1.00 0.00 H ATOM 743 HD23 LEU A 53 4.299 33.526 21.595 1.00 0.00 H ATOM 744 HD11 LEU A 53 5.974 30.469 22.819 1.00 0.00 H ATOM 745 HD12 LEU A 53 5.236 31.688 23.886 1.00 0.00 H ATOM 746 HD13 LEU A 53 4.411 31.203 22.385 1.00 0.00 H ATOM 747 H LEU A 53 8.934 32.404 20.508 1.00 0.00 H ATOM 748 N VAL A 54 10.737 33.784 22.555 1.00 35.12 N ATOM 749 CA VAL A 54 11.930 34.037 23.372 1.00 33.98 C ATOM 750 C VAL A 54 13.053 34.688 22.585 1.00 33.37 C ATOM 751 O VAL A 54 13.568 35.727 22.986 1.00 34.37 O ATOM 752 CB VAL A 54 12.483 32.736 23.996 1.00 33.64 C ATOM 753 CG1 VAL A 54 13.772 33.024 24.740 1.00 33.04 C ATOM 754 CG2 VAL A 54 11.455 32.108 24.921 1.00 34.22 C ATOM 755 HA VAL A 54 11.598 34.719 24.154 1.00 0.00 H ATOM 756 HB VAL A 54 12.695 32.026 23.197 1.00 0.00 H ATOM 757 HG11 VAL A 54 14.508 33.430 24.046 1.00 0.00 H ATOM 758 HG12 VAL A 54 13.579 33.748 25.532 1.00 0.00 H ATOM 759 HG13 VAL A 54 14.153 32.100 25.176 1.00 0.00 H ATOM 760 HG21 VAL A 54 11.212 32.808 25.720 1.00 0.00 H ATOM 761 HG22 VAL A 54 10.554 31.873 24.355 1.00 0.00 H ATOM 762 HG23 VAL A 54 11.865 31.193 25.350 1.00 0.00 H ATOM 763 H VAL A 54 10.836 33.274 21.654 1.00 0.00 H ATOM 764 N GLY A 55 13.428 34.070 21.465 1.00 33.95 N ATOM 765 CA GLY A 55 14.549 34.538 20.646 1.00 34.60 C ATOM 766 C GLY A 55 14.445 35.991 20.212 1.00 34.77 C ATOM 767 O GLY A 55 15.318 36.801 20.530 1.00 33.92 O ATOM 768 HA3 GLY A 55 14.601 33.917 19.751 1.00 0.00 H ATOM 769 HA2 GLY A 55 15.466 34.419 21.223 1.00 0.00 H ATOM 770 H GLY A 55 12.905 33.224 21.161 1.00 0.00 H ATOM 771 N ILE A 56 13.368 36.306 19.495 1.00 34.86 N ATOM 772 CA ILE A 56 13.077 37.663 19.001 1.00 35.10 C ATOM 773 C ILE A 56 12.925 38.741 20.093 1.00 33.73 C ATOM 774 O ILE A 56 13.626 39.752 20.059 1.00 34.96 O ATOM 775 CB ILE A 56 11.812 37.663 18.100 1.00 36.07 C ATOM 776 CG1 ILE A 56 12.070 36.882 16.820 1.00 36.98 C ATOM 777 CG2 ILE A 56 11.393 39.083 17.742 1.00 35.32 C ATOM 778 CD1 ILE A 56 13.173 37.487 15.985 1.00 38.66 C ATOM 779 HA ILE A 56 13.962 37.938 18.428 1.00 0.00 H ATOM 780 HB ILE A 56 11.008 37.188 18.663 1.00 0.00 H ATOM 781 HG12 ILE A 56 12.350 35.862 17.083 1.00 0.00 H ATOM 782 HG13 ILE A 56 11.154 36.865 16.230 1.00 0.00 H ATOM 783 HD11 ILE A 56 12.900 38.505 15.708 1.00 0.00 H ATOM 784 HD12 ILE A 56 14.098 37.501 16.562 1.00 0.00 H ATOM 785 HD13 ILE A 56 13.314 36.890 15.084 1.00 0.00 H ATOM 786 HG21 ILE A 56 11.171 39.636 18.655 1.00 0.00 H ATOM 787 HG22 ILE A 56 12.204 39.575 17.205 1.00 0.00 H ATOM 788 HG23 ILE A 56 10.505 39.050 17.111 1.00 0.00 H ATOM 789 H ILE A 56 12.692 35.549 19.270 1.00 0.00 H ATOM 790 N PRO A 57 12.009 38.544 21.057 1.00 33.68 N ATOM 791 CA PRO A 57 11.849 39.582 22.082 1.00 33.15 C ATOM 792 C PRO A 57 13.123 39.874 22.896 1.00 33.75 C ATOM 793 O PRO A 57 13.460 41.042 23.105 1.00 33.00 O ATOM 794 CB PRO A 57 10.729 39.031 22.976 1.00 32.79 C ATOM 795 CG PRO A 57 10.685 37.579 22.692 1.00 33.46 C ATOM 796 CD PRO A 57 11.076 37.424 21.265 1.00 33.61 C ATOM 797 HA PRO A 57 11.621 40.547 21.628 1.00 0.00 H ATOM 798 HD3 PRO A 57 11.568 36.466 21.094 1.00 0.00 H ATOM 799 HD2 PRO A 57 10.209 37.508 20.609 1.00 0.00 H ATOM 800 HG3 PRO A 57 9.679 37.192 22.853 1.00 0.00 H ATOM 801 HG2 PRO A 57 11.385 37.046 23.336 1.00 0.00 H ATOM 802 HB2 PRO A 57 10.956 39.209 24.027 1.00 0.00 H ATOM 803 HB3 PRO A 57 9.776 39.498 22.728 1.00 0.00 H ATOM 804 N LEU A 58 13.823 38.833 23.346 1.00 32.92 N ATOM 805 CA LEU A 58 15.071 39.023 24.095 1.00 31.83 C ATOM 806 C LEU A 58 16.153 39.693 23.269 1.00 31.91 C ATOM 807 O LEU A 58 16.988 40.431 23.805 1.00 31.18 O ATOM 808 CB LEU A 58 15.603 37.700 24.635 1.00 32.38 C ATOM 809 CG LEU A 58 15.089 37.216 25.981 1.00 32.52 C ATOM 810 CD1 LEU A 58 16.003 36.103 26.470 1.00 33.11 C ATOM 811 CD2 LEU A 58 15.062 38.361 26.982 1.00 32.85 C ATOM 812 HA LEU A 58 14.820 39.682 24.926 1.00 0.00 H ATOM 813 HB2 LEU A 58 15.363 36.931 23.901 1.00 0.00 H ATOM 814 HB3 LEU A 58 16.686 37.796 24.717 1.00 0.00 H ATOM 815 HG LEU A 58 14.071 36.841 25.877 1.00 0.00 H ATOM 816 HD21 LEU A 58 16.070 38.756 27.108 1.00 0.00 H ATOM 817 HD22 LEU A 58 14.405 39.149 26.613 1.00 0.00 H ATOM 818 HD23 LEU A 58 14.691 37.996 27.940 1.00 0.00 H ATOM 819 HD11 LEU A 58 15.994 35.285 25.750 1.00 0.00 H ATOM 820 HD12 LEU A 58 17.018 36.487 26.573 1.00 0.00 H ATOM 821 HD13 LEU A 58 15.650 35.742 27.436 1.00 0.00 H ATOM 822 H LEU A 58 13.479 37.869 23.163 1.00 0.00 H ATOM 823 N MET A 59 16.160 39.422 21.968 1.00 30.92 N ATOM 824 CA MET A 59 17.099 40.079 21.069 1.00 31.54 C ATOM 825 C MET A 59 16.866 41.592 21.092 1.00 31.46 C ATOM 826 O MET A 59 17.799 42.362 21.297 1.00 31.02 O ATOM 827 CB MET A 59 16.972 39.529 19.647 1.00 31.72 C ATOM 828 CG MET A 59 17.938 40.136 18.648 1.00 31.35 C ATOM 829 SD MET A 59 19.671 39.819 19.021 1.00 29.76 S ATOM 830 CE MET A 59 19.840 38.099 18.537 1.00 31.64 C ATOM 831 HA MET A 59 18.113 39.874 21.412 1.00 0.00 H ATOM 832 HB2 MET A 59 17.148 38.454 19.681 1.00 0.00 H ATOM 833 HB3 MET A 59 15.957 39.719 19.298 1.00 0.00 H ATOM 834 HG2 MET A 59 17.782 41.215 18.632 1.00 0.00 H ATOM 835 HG3 MET A 59 17.718 39.723 17.663 1.00 0.00 H ATOM 836 HE1 MET A 59 19.155 37.488 19.125 1.00 0.00 H ATOM 837 HE2 MET A 59 19.603 37.996 17.478 1.00 0.00 H ATOM 838 HE3 MET A 59 20.865 37.772 18.714 1.00 0.00 H ATOM 839 H MET A 59 15.484 38.730 21.586 1.00 0.00 H ATOM 840 N TRP A 60 15.617 42.014 20.893 1.00 31.46 N ATOM 841 CA TRP A 60 15.284 43.446 20.920 1.00 32.38 C ATOM 842 C TRP A 60 15.594 44.064 22.280 1.00 32.90 C ATOM 843 O TRP A 60 16.129 45.170 22.362 1.00 32.44 O ATOM 844 CB TRP A 60 13.814 43.699 20.581 1.00 31.46 C ATOM 845 CG TRP A 60 13.484 43.612 19.116 1.00 31.17 C ATOM 846 CD1 TRP A 60 14.241 44.058 18.074 1.00 31.25 C ATOM 847 CD2 TRP A 60 12.290 43.068 18.540 1.00 30.69 C ATOM 848 NE1 TRP A 60 13.600 43.809 16.877 1.00 31.49 N ATOM 849 CE2 TRP A 60 12.398 43.205 17.139 1.00 31.56 C ATOM 850 CE3 TRP A 60 11.141 42.474 19.072 1.00 32.04 C ATOM 851 CZ2 TRP A 60 11.402 42.769 16.265 1.00 31.87 C ATOM 852 CZ3 TRP A 60 10.145 42.044 18.198 1.00 31.26 C ATOM 853 CH2 TRP A 60 10.286 42.193 16.814 1.00 32.03 C ATOM 854 HA TRP A 60 15.905 43.918 20.158 1.00 0.00 H ATOM 855 HB2 TRP A 60 13.211 42.961 21.110 1.00 0.00 H ATOM 856 HB3 TRP A 60 13.552 44.698 20.930 1.00 0.00 H ATOM 857 HE1 TRP A 60 13.968 44.041 15.933 1.00 0.00 H ATOM 858 HD1 TRP A 60 15.213 44.542 18.172 1.00 0.00 H ATOM 859 HZ2 TRP A 60 11.507 42.882 15.186 1.00 0.00 H ATOM 860 HH2 TRP A 60 9.490 41.843 16.157 1.00 0.00 H ATOM 861 HZ3 TRP A 60 9.242 41.584 18.599 1.00 0.00 H ATOM 862 HE3 TRP A 60 11.027 42.350 20.149 1.00 0.00 H ATOM 863 H TRP A 60 14.865 41.318 20.716 1.00 0.00 H ATOM 864 N ILE A 61 15.258 43.334 23.341 1.00 32.17 N ATOM 865 CA ILE A 61 15.514 43.778 24.705 1.00 30.89 C ATOM 866 C ILE A 61 17.002 44.001 24.960 1.00 30.86 C ATOM 867 O ILE A 61 17.377 45.020 25.536 1.00 30.11 O ATOM 868 CB ILE A 61 14.926 42.783 25.721 1.00 31.80 C ATOM 869 CG1 ILE A 61 13.409 42.963 25.797 1.00 30.10 C ATOM 870 CG2 ILE A 61 15.566 42.947 27.102 1.00 31.18 C ATOM 871 CD1 ILE A 61 12.696 41.876 26.566 1.00 31.18 C ATOM 872 HA ILE A 61 15.016 44.739 24.835 1.00 0.00 H ATOM 873 HB ILE A 61 15.149 41.771 25.382 1.00 0.00 H ATOM 874 HG12 ILE A 61 13.201 43.917 26.281 1.00 0.00 H ATOM 875 HG13 ILE A 61 13.015 42.979 24.781 1.00 0.00 H ATOM 876 HD11 ILE A 61 12.882 40.914 26.089 1.00 0.00 H ATOM 877 HD12 ILE A 61 13.068 41.853 27.590 1.00 0.00 H ATOM 878 HD13 ILE A 61 11.625 42.079 26.572 1.00 0.00 H ATOM 879 HG21 ILE A 61 16.639 42.771 27.027 1.00 0.00 H ATOM 880 HG22 ILE A 61 15.387 43.959 27.466 1.00 0.00 H ATOM 881 HG23 ILE A 61 15.126 42.228 27.793 1.00 0.00 H ATOM 882 H ILE A 61 14.796 42.414 23.191 1.00 0.00 H ATOM 883 N GLU A 62 17.845 43.066 24.517 1.00 29.15 N ATOM 884 CA GLU A 62 19.302 43.177 24.723 1.00 29.02 C ATOM 885 C GLU A 62 19.952 44.286 23.875 1.00 29.48 C ATOM 886 O GLU A 62 20.877 44.963 24.323 1.00 29.52 O ATOM 887 CB GLU A 62 20.012 41.819 24.513 1.00 27.30 C ATOM 888 CG GLU A 62 19.662 40.768 25.586 1.00 26.41 C ATOM 889 CD GLU A 62 20.696 39.636 25.708 1.00 26.70 C ATOM 890 OE1 GLU A 62 21.869 39.819 25.294 1.00 27.15 O ATOM 891 OE2 GLU A 62 20.341 38.559 26.233 1.00 23.62 O ATOM 892 HA GLU A 62 19.436 43.471 25.764 1.00 0.00 H ATOM 893 HB2 GLU A 62 19.724 41.426 23.538 1.00 0.00 H ATOM 894 HB3 GLU A 62 21.089 41.986 24.532 1.00 0.00 H ATOM 895 HG2 GLU A 62 19.589 41.272 26.550 1.00 0.00 H ATOM 896 HG3 GLU A 62 18.698 40.327 25.334 1.00 0.00 H ATOM 897 H GLU A 62 17.466 42.239 24.014 1.00 0.00 H ATOM 898 N TRP A 63 19.472 44.468 22.647 1.00 30.76 N ATOM 899 CA TRP A 63 19.937 45.587 21.823 1.00 31.08 C ATOM 900 C TRP A 63 19.615 46.905 22.509 1.00 30.47 C ATOM 901 O TRP A 63 20.452 47.811 22.564 1.00 27.71 O ATOM 902 CB TRP A 63 19.267 45.576 20.456 1.00 30.10 C ATOM 903 CG TRP A 63 19.892 44.665 19.448 1.00 30.92 C ATOM 904 CD1 TRP A 63 19.898 43.300 19.460 1.00 29.95 C ATOM 905 CD2 TRP A 63 20.578 45.060 18.256 1.00 30.74 C ATOM 906 NE1 TRP A 63 20.561 42.821 18.351 1.00 29.97 N ATOM 907 CE2 TRP A 63 20.983 43.885 17.596 1.00 30.99 C ATOM 908 CE3 TRP A 63 20.894 46.298 17.684 1.00 30.58 C ATOM 909 CZ2 TRP A 63 21.688 43.913 16.393 1.00 31.27 C ATOM 910 CZ3 TRP A 63 21.593 46.322 16.493 1.00 29.78 C ATOM 911 CH2 TRP A 63 21.983 45.140 15.862 1.00 30.58 C ATOM 912 HA TRP A 63 21.014 45.480 21.695 1.00 0.00 H ATOM 913 HB2 TRP A 63 18.230 45.269 20.591 1.00 0.00 H ATOM 914 HB3 TRP A 63 19.296 46.590 20.058 1.00 0.00 H ATOM 915 HE1 TRP A 63 20.716 41.818 18.124 1.00 0.00 H ATOM 916 HD1 TRP A 63 19.445 42.680 20.233 1.00 0.00 H ATOM 917 HZ2 TRP A 63 21.993 42.993 15.894 1.00 0.00 H ATOM 918 HH2 TRP A 63 22.536 45.195 14.924 1.00 0.00 H ATOM 919 HZ3 TRP A 63 21.844 47.280 16.038 1.00 0.00 H ATOM 920 HE3 TRP A 63 20.594 47.226 18.170 1.00 0.00 H ATOM 921 H TRP A 63 18.761 43.810 22.269 1.00 0.00 H ATOM 922 N ALA A 64 18.394 46.996 23.032 1.00 30.71 N ATOM 923 CA ALA A 64 17.914 48.221 23.672 1.00 32.06 C ATOM 924 C ALA A 64 18.721 48.557 24.908 1.00 33.20 C ATOM 925 O ALA A 64 19.142 49.697 25.085 1.00 35.27 O ATOM 926 CB ALA A 64 16.437 48.098 24.021 1.00 30.53 C ATOM 927 HA ALA A 64 18.042 49.036 22.960 1.00 0.00 H ATOM 928 HB1 ALA A 64 15.863 47.926 23.111 1.00 0.00 H ATOM 929 HB2 ALA A 64 16.295 47.262 24.705 1.00 0.00 H ATOM 930 HB3 ALA A 64 16.099 49.019 24.496 1.00 0.00 H ATOM 931 H ALA A 64 17.762 46.171 22.984 1.00 0.00 H ATOM 932 N MET A 65 18.938 47.555 25.756 1.00 33.47 N ATOM 933 CA MET A 65 19.707 47.734 26.983 1.00 34.22 C ATOM 934 C MET A 65 21.133 48.181 26.695 1.00 33.59 C ATOM 935 O MET A 65 21.663 49.061 27.369 1.00 34.78 O ATOM 936 CB MET A 65 19.707 46.441 27.797 1.00 33.74 C ATOM 937 CG MET A 65 18.329 46.051 28.286 1.00 34.11 C ATOM 938 SD MET A 65 18.314 44.515 29.225 1.00 36.79 S ATOM 939 CE MET A 65 19.455 44.931 30.531 1.00 33.14 C ATOM 940 HA MET A 65 19.228 48.522 27.564 1.00 0.00 H ATOM 941 HB2 MET A 65 20.095 45.637 27.172 1.00 0.00 H ATOM 942 HB3 MET A 65 20.358 46.574 28.661 1.00 0.00 H ATOM 943 HG2 MET A 65 17.675 45.935 27.422 1.00 0.00 H ATOM 944 HG3 MET A 65 17.949 46.850 28.923 1.00 0.00 H ATOM 945 HE1 MET A 65 20.426 45.175 30.100 1.00 0.00 H ATOM 946 HE2 MET A 65 19.075 45.790 31.084 1.00 0.00 H ATOM 947 HE3 MET A 65 19.559 44.081 31.205 1.00 0.00 H ATOM 948 H MET A 65 18.548 46.616 25.538 1.00 0.00 H ATOM 949 N GLY A 66 21.752 47.573 25.690 1.00 33.80 N ATOM 950 CA GLY A 66 23.102 47.950 25.293 1.00 32.09 C ATOM 951 C GLY A 66 23.163 49.363 24.735 1.00 32.90 C ATOM 952 O GLY A 66 24.008 50.155 25.142 1.00 30.05 O ATOM 953 HA3 GLY A 66 23.450 47.255 24.529 1.00 0.00 H ATOM 954 HA2 GLY A 66 23.755 47.888 26.164 1.00 0.00 H ATOM 955 H GLY A 66 21.263 46.812 25.176 1.00 0.00 H ATOM 956 N ARG A 67 22.271 49.687 23.800 1.00 33.56 N ATOM 957 CA ARG A 67 22.243 51.040 23.229 1.00 35.21 C ATOM 958 C ARG A 67 22.023 52.065 24.346 1.00 35.97 C ATOM 959 O ARG A 67 22.753 53.047 24.437 1.00 37.54 O ATOM 960 CB ARG A 67 21.178 51.176 22.130 1.00 34.65 C ATOM 961 CG ARG A 67 21.215 52.538 21.427 1.00 35.19 C ATOM 962 CD ARG A 67 20.084 52.718 20.413 1.00 33.79 C ATOM 963 NE ARG A 67 18.755 52.576 21.006 1.00 33.36 N ATOM 964 CZ ARG A 67 17.619 52.871 20.375 1.00 34.29 C ATOM 965 NH1 ARG A 67 17.641 53.342 19.131 1.00 34.77 N ATOM 966 NH2 ARG A 67 16.456 52.708 20.984 1.00 33.26 N ATOM 967 HA ARG A 67 23.206 51.232 22.755 1.00 0.00 H ATOM 968 HB2 ARG A 67 21.344 50.396 21.387 1.00 0.00 H ATOM 969 HB3 ARG A 67 20.194 51.044 22.581 1.00 0.00 H ATOM 970 HG2 ARG A 67 21.134 53.321 22.181 1.00 0.00 H ATOM 971 HG3 ARG A 67 22.168 52.635 20.906 1.00 0.00 H ATOM 972 HD2 ARG A 67 20.197 51.968 19.630 1.00 0.00 H ATOM 973 HD3 ARG A 67 20.165 53.713 19.976 1.00 0.00 H ATOM 974 HE ARG A 67 18.692 52.222 21.982 1.00 0.00 H ATOM 975 HH12 ARG A 67 16.750 53.570 18.645 1.00 0.00 H ATOM 976 HH11 ARG A 67 18.549 53.482 18.644 1.00 0.00 H ATOM 977 HH22 ARG A 67 15.572 52.940 20.487 1.00 0.00 H ATOM 978 HH21 ARG A 67 16.426 52.348 21.959 1.00 0.00 H ATOM 979 H ARG A 67 21.588 48.975 23.471 1.00 0.00 H ATOM 980 N TYR A 68 21.028 51.811 25.196 1.00 37.25 N ATOM 981 CA TYR A 68 20.756 52.638 26.377 1.00 39.60 C ATOM 982 C TYR A 68 22.012 52.872 27.221 1.00 40.45 C ATOM 983 O TYR A 68 22.375 54.016 27.501 1.00 41.56 O ATOM 984 CB TYR A 68 19.659 51.998 27.239 1.00 40.91 C ATOM 985 CG TYR A 68 19.303 52.776 28.497 1.00 42.22 C ATOM 986 CD1 TYR A 68 18.379 53.819 28.455 1.00 42.80 C ATOM 987 CD2 TYR A 68 19.883 52.464 29.725 1.00 42.06 C ATOM 988 CE1 TYR A 68 18.046 54.532 29.602 1.00 42.99 C ATOM 989 CE2 TYR A 68 19.557 53.173 30.875 1.00 42.82 C ATOM 990 CZ TYR A 68 18.638 54.204 30.805 1.00 43.22 C ATOM 991 OH TYR A 68 18.308 54.914 31.941 1.00 43.42 O ATOM 992 HA TYR A 68 20.415 53.608 26.016 1.00 0.00 H ATOM 993 HB3 TYR A 68 19.997 51.006 27.538 1.00 0.00 H ATOM 994 HB2 TYR A 68 18.759 51.906 26.631 1.00 0.00 H ATOM 995 HD2 TYR A 68 20.605 51.650 29.785 1.00 0.00 H ATOM 996 HE2 TYR A 68 20.023 52.918 31.827 1.00 0.00 H ATOM 997 HE1 TYR A 68 17.322 55.345 29.551 1.00 0.00 H ATOM 998 HD1 TYR A 68 17.909 54.080 27.507 1.00 0.00 H ATOM 999 HH TYR A 68 17.642 55.609 31.712 1.00 0.00 H ATOM 1000 H TYR A 68 20.417 50.989 25.014 1.00 0.00 H ATOM 1001 N GLY A 69 22.676 51.789 27.619 1.00 39.29 N ATOM 1002 CA GLY A 69 23.874 51.889 28.446 1.00 37.10 C ATOM 1003 C GLY A 69 25.048 52.555 27.756 1.00 37.77 C ATOM 1004 O GLY A 69 25.785 53.330 28.375 1.00 37.34 O ATOM 1005 HA3 GLY A 69 24.174 50.883 28.738 1.00 0.00 H ATOM 1006 HA2 GLY A 69 23.628 52.466 29.337 1.00 0.00 H ATOM 1007 H GLY A 69 22.333 50.850 27.334 1.00 0.00 H ATOM 1008 N GLY A 70 25.236 52.249 26.476 1.00 37.52 N ATOM 1009 CA GLY A 70 26.319 52.836 25.689 1.00 37.76 C ATOM 1010 C GLY A 70 26.260 54.353 25.625 1.00 38.91 C ATOM 1011 O GLY A 70 27.296 55.025 25.653 1.00 37.69 O ATOM 1012 HA3 GLY A 70 26.261 52.444 24.674 1.00 0.00 H ATOM 1013 HA2 GLY A 70 27.269 52.545 26.136 1.00 0.00 H ATOM 1014 H GLY A 70 24.592 51.571 26.020 1.00 0.00 H ATOM 1015 N ALA A 71 25.042 54.891 25.545 1.00 40.20 N ATOM 1016 CA ALA A 71 24.816 56.342 25.526 1.00 41.29 C ATOM 1017 C ALA A 71 25.377 57.024 26.777 1.00 41.40 C ATOM 1018 O ALA A 71 25.734 58.205 26.750 1.00 41.45 O ATOM 1019 CB ALA A 71 23.330 56.648 25.378 1.00 40.14 C ATOM 1020 HA ALA A 71 25.350 56.744 24.665 1.00 0.00 H ATOM 1021 HB1 ALA A 71 22.963 56.219 24.445 1.00 0.00 H ATOM 1022 HB2 ALA A 71 22.786 56.215 26.217 1.00 0.00 H ATOM 1023 HB3 ALA A 71 23.182 57.728 25.366 1.00 0.00 H ATOM 1024 H ALA A 71 24.219 54.257 25.494 1.00 0.00 H ATOM 1025 N GLN A 72 25.452 56.271 27.870 1.00 41.47 N ATOM 1026 CA GLN A 72 25.986 56.786 29.123 1.00 39.90 C ATOM 1027 C GLN A 72 27.410 56.292 29.384 1.00 38.81 C ATOM 1028 O GLN A 72 27.960 56.503 30.465 1.00 39.07 O ATOM 1029 CB GLN A 72 25.062 56.413 30.283 1.00 41.42 C ATOM 1030 CG GLN A 72 23.622 56.872 30.080 1.00 43.02 C ATOM 1031 CD GLN A 72 22.772 56.700 31.318 1.00 44.59 C ATOM 1032 OE1 GLN A 72 23.213 56.994 32.430 1.00 46.99 O ATOM 1033 NE2 GLN A 72 21.540 56.229 31.135 1.00 44.52 N ATOM 1034 HA GLN A 72 26.033 57.872 29.042 1.00 0.00 H ATOM 1035 HB2 GLN A 72 25.067 55.329 30.395 1.00 0.00 H ATOM 1036 HB3 GLN A 72 25.447 56.873 31.193 1.00 0.00 H ATOM 1037 HG2 GLN A 72 23.628 57.927 29.805 1.00 0.00 H ATOM 1038 HG3 GLN A 72 23.181 56.289 29.271 1.00 0.00 H ATOM 1039 HE22 GLN A 72 21.210 55.994 30.177 1.00 0.00 H ATOM 1040 HE21 GLN A 72 20.908 56.096 31.950 1.00 0.00 H ATOM 1041 H GLN A 72 25.120 55.286 27.829 1.00 0.00 H ATOM 1042 N GLY A 73 28.010 55.642 28.394 1.00 36.65 N ATOM 1043 CA GLY A 73 29.379 55.148 28.536 1.00 35.19 C ATOM 1044 C GLY A 73 29.533 53.797 29.226 1.00 35.30 C ATOM 1045 O GLY A 73 30.578 53.507 29.809 1.00 33.65 O ATOM 1046 HA3 GLY A 73 29.941 55.883 29.112 1.00 0.00 H ATOM 1047 HA2 GLY A 73 29.809 55.064 27.538 1.00 0.00 H ATOM 1048 H GLY A 73 27.498 55.482 27.503 1.00 0.00 H ATOM 1049 N HIS A 74 28.500 52.964 29.154 1.00 34.69 N ATOM 1050 CA HIS A 74 28.534 51.642 29.780 1.00 34.79 C ATOM 1051 C HIS A 74 28.037 50.563 28.829 1.00 33.72 C ATOM 1052 O HIS A 74 26.935 50.659 28.294 1.00 34.39 O ATOM 1053 CB HIS A 74 27.714 51.646 31.071 1.00 35.10 C ATOM 1054 CG HIS A 74 28.171 52.676 32.054 1.00 35.96 C ATOM 1055 ND1 HIS A 74 29.284 52.503 32.846 1.00 36.40 N ATOM 1056 CD2 HIS A 74 27.680 53.901 32.356 1.00 36.78 C ATOM 1057 CE1 HIS A 74 29.456 53.573 33.601 1.00 37.41 C ATOM 1058 NE2 HIS A 74 28.495 54.435 33.324 1.00 37.53 N ATOM 1059 HA HIS A 74 29.571 51.411 30.024 1.00 0.00 H ATOM 1060 HB2 HIS A 74 26.672 51.844 30.820 1.00 0.00 H ATOM 1061 HB3 HIS A 74 27.794 50.663 31.536 1.00 0.00 H ATOM 1062 HD2 HIS A 74 26.803 54.374 31.914 1.00 0.00 H ATOM 1063 HE1 HIS A 74 30.255 53.719 34.328 1.00 0.00 H ATOM 1064 H HIS A 74 27.646 53.259 28.640 1.00 0.00 H ATOM 1065 N GLY A 75 28.856 49.539 28.617 1.00 32.11 N ATOM 1066 CA GLY A 75 28.502 48.462 27.703 1.00 29.43 C ATOM 1067 C GLY A 75 28.207 47.122 28.358 1.00 30.03 C ATOM 1068 O GLY A 75 27.731 46.197 27.698 1.00 28.54 O ATOM 1069 HA3 GLY A 75 29.331 48.323 27.010 1.00 0.00 H ATOM 1070 HA2 GLY A 75 27.615 48.769 27.149 1.00 0.00 H ATOM 1071 H GLY A 75 29.769 49.506 29.114 1.00 0.00 H ATOM 1072 N THR A 76 28.485 47.007 29.655 1.00 28.99 N ATOM 1073 CA THR A 76 28.268 45.737 30.356 1.00 28.48 C ATOM 1074 C THR A 76 27.236 45.829 31.477 1.00 28.99 C ATOM 1075 O THR A 76 26.887 46.925 31.925 1.00 28.33 O ATOM 1076 CB THR A 76 29.571 45.179 30.905 1.00 26.81 C ATOM 1077 OG1 THR A 76 30.168 46.152 31.757 1.00 27.13 O ATOM 1078 CG2 THR A 76 30.529 44.868 29.768 1.00 27.22 C ATOM 1079 HA THR A 76 27.868 45.057 29.604 1.00 0.00 H ATOM 1080 HB THR A 76 29.362 44.264 31.459 1.00 0.00 H ATOM 1081 HG1 THR A 76 30.348 46.976 31.239 1.00 0.00 H ATOM 1082 HG23 THR A 76 30.081 44.124 29.110 1.00 0.00 H ATOM 1083 HG21 THR A 76 30.730 45.779 29.204 1.00 0.00 H ATOM 1084 HG22 THR A 76 31.462 44.479 30.177 1.00 0.00 H ATOM 1085 H THR A 76 28.860 47.825 30.176 1.00 0.00 H ATOM 1086 N THR A 77 26.768 44.667 31.932 1.00 27.52 N ATOM 1087 CA THR A 77 25.609 44.581 32.835 1.00 28.52 C ATOM 1088 C THR A 77 25.779 45.002 34.315 1.00 29.92 C ATOM 1089 O THR A 77 24.797 45.405 34.930 1.00 30.27 O ATOM 1090 CB THR A 77 24.967 43.183 32.767 1.00 27.70 C ATOM 1091 OG1 THR A 77 25.970 42.184 32.995 1.00 25.27 O ATOM 1092 CG2 THR A 77 24.340 42.971 31.392 1.00 25.63 C ATOM 1093 HA THR A 77 24.961 45.360 32.433 1.00 0.00 H ATOM 1094 HB THR A 77 24.194 43.104 33.531 1.00 0.00 H ATOM 1095 HG1 THR A 77 26.372 42.320 33.889 1.00 0.00 H ATOM 1096 HG23 THR A 77 23.578 43.731 31.220 1.00 0.00 H ATOM 1097 HG21 THR A 77 25.112 43.049 30.626 1.00 0.00 H ATOM 1098 HG22 THR A 77 23.884 41.982 31.351 1.00 0.00 H ATOM 1099 H THR A 77 27.240 43.788 31.638 1.00 0.00 H ATOM 1100 N PRO A 78 26.997 44.913 34.897 1.00 29.22 N ATOM 1101 CA PRO A 78 27.076 45.469 36.254 1.00 30.67 C ATOM 1102 C PRO A 78 26.605 46.933 36.330 1.00 32.27 C ATOM 1103 O PRO A 78 25.855 47.289 37.237 1.00 33.45 O ATOM 1104 CB PRO A 78 28.566 45.373 36.597 1.00 30.51 C ATOM 1105 CG PRO A 78 29.089 44.260 35.727 1.00 28.94 C ATOM 1106 CD PRO A 78 28.285 44.349 34.451 1.00 29.07 C ATOM 1107 HA PRO A 78 26.427 44.929 36.943 1.00 0.00 H ATOM 1108 HD3 PRO A 78 28.770 45.006 33.729 1.00 0.00 H ATOM 1109 HD2 PRO A 78 28.147 43.363 34.007 1.00 0.00 H ATOM 1110 HG3 PRO A 78 28.938 43.294 36.209 1.00 0.00 H ATOM 1111 HG2 PRO A 78 30.150 44.400 35.522 1.00 0.00 H ATOM 1112 HB2 PRO A 78 29.074 46.310 36.369 1.00 0.00 H ATOM 1113 HB3 PRO A 78 28.703 45.134 37.652 1.00 0.00 H ATOM 1114 N ALA A 79 27.044 47.764 35.388 1.00 33.36 N ATOM 1115 CA ALA A 79 26.637 49.170 35.352 1.00 33.26 C ATOM 1116 C ALA A 79 25.254 49.375 34.739 1.00 34.07 C ATOM 1117 O ALA A 79 24.466 50.190 35.235 1.00 34.66 O ATOM 1118 CB ALA A 79 27.670 50.005 34.602 1.00 33.11 C ATOM 1119 HA ALA A 79 26.578 49.502 36.388 1.00 0.00 H ATOM 1120 HB1 ALA A 79 28.633 49.927 35.106 1.00 0.00 H ATOM 1121 HB2 ALA A 79 27.762 49.636 33.581 1.00 0.00 H ATOM 1122 HB3 ALA A 79 27.350 51.047 34.586 1.00 0.00 H ATOM 1123 H ALA A 79 27.693 47.406 34.659 1.00 0.00 H ATOM 1124 N ILE A 80 24.955 48.645 33.666 1.00 33.46 N ATOM 1125 CA ILE A 80 23.683 48.818 32.951 1.00 32.93 C ATOM 1126 C ILE A 80 22.477 48.413 33.804 1.00 33.90 C ATOM 1127 O ILE A 80 21.456 49.106 33.825 1.00 34.40 O ATOM 1128 CB ILE A 80 23.677 48.064 31.604 1.00 32.84 C ATOM 1129 CG1 ILE A 80 24.662 48.717 30.634 1.00 32.51 C ATOM 1130 CG2 ILE A 80 22.269 48.025 31.001 1.00 31.22 C ATOM 1131 CD1 ILE A 80 24.796 47.984 29.311 1.00 32.30 C ATOM 1132 HA ILE A 80 23.592 49.884 32.742 1.00 0.00 H ATOM 1133 HB ILE A 80 23.990 47.035 31.784 1.00 0.00 H ATOM 1134 HG12 ILE A 80 24.323 49.733 30.432 1.00 0.00 H ATOM 1135 HG13 ILE A 80 25.642 48.750 31.110 1.00 0.00 H ATOM 1136 HD11 ILE A 80 25.146 46.968 29.494 1.00 0.00 H ATOM 1137 HD12 ILE A 80 23.826 47.952 28.815 1.00 0.00 H ATOM 1138 HD13 ILE A 80 25.512 48.508 28.678 1.00 0.00 H ATOM 1139 HG21 ILE A 80 21.594 47.516 31.689 1.00 0.00 H ATOM 1140 HG22 ILE A 80 21.919 49.043 30.833 1.00 0.00 H ATOM 1141 HG23 ILE A 80 22.296 47.488 30.053 1.00 0.00 H ATOM 1142 H ILE A 80 25.637 47.937 33.327 1.00 0.00 H ATOM 1143 N PHE A 81 22.601 47.295 34.508 1.00 33.61 N ATOM 1144 CA PHE A 81 21.566 46.847 35.435 1.00 33.05 C ATOM 1145 C PHE A 81 21.291 47.898 36.513 1.00 33.84 C ATOM 1146 O PHE A 81 20.153 48.085 36.941 1.00 32.40 O ATOM 1147 CB PHE A 81 21.995 45.533 36.086 1.00 32.86 C ATOM 1148 CG PHE A 81 21.671 44.305 35.267 1.00 32.01 C ATOM 1149 CD1 PHE A 81 21.363 44.405 33.918 1.00 31.76 C ATOM 1150 CD2 PHE A 81 21.695 43.045 35.852 1.00 31.89 C ATOM 1151 CE1 PHE A 81 21.070 43.269 33.165 1.00 32.48 C ATOM 1152 CE2 PHE A 81 21.399 41.902 35.106 1.00 32.12 C ATOM 1153 CZ PHE A 81 21.088 42.019 33.759 1.00 31.19 C ATOM 1154 HA PHE A 81 20.645 46.695 34.872 1.00 0.00 H ATOM 1155 HB2 PHE A 81 23.073 45.565 36.244 1.00 0.00 H ATOM 1156 HB3 PHE A 81 21.490 45.446 37.048 1.00 0.00 H ATOM 1157 HD2 PHE A 81 21.948 42.947 36.908 1.00 0.00 H ATOM 1158 HE2 PHE A 81 21.412 40.921 35.581 1.00 0.00 H ATOM 1159 HZ PHE A 81 20.859 41.130 33.171 1.00 0.00 H ATOM 1160 HE1 PHE A 81 20.826 43.365 32.107 1.00 0.00 H ATOM 1161 HD1 PHE A 81 21.350 45.385 33.441 1.00 0.00 H ATOM 1162 H PHE A 81 23.461 46.721 34.396 1.00 0.00 H ATOM 1163 N TYR A 82 22.349 48.574 36.948 1.00 35.35 N ATOM 1164 CA TYR A 82 22.257 49.600 37.979 1.00 37.21 C ATOM 1165 C TYR A 82 21.583 50.867 37.457 1.00 38.44 C ATOM 1166 O TYR A 82 20.959 51.603 38.218 1.00 39.42 O ATOM 1167 CB TYR A 82 23.650 49.936 38.508 1.00 37.71 C ATOM 1168 CG TYR A 82 23.649 50.805 39.744 1.00 38.40 C ATOM 1169 CD1 TYR A 82 23.166 50.320 40.956 1.00 37.82 C ATOM 1170 CD2 TYR A 82 24.141 52.104 39.705 1.00 39.19 C ATOM 1171 CE1 TYR A 82 23.166 51.107 42.094 1.00 38.66 C ATOM 1172 CE2 TYR A 82 24.147 52.904 40.846 1.00 39.48 C ATOM 1173 CZ TYR A 82 23.657 52.398 42.033 1.00 39.01 C ATOM 1174 OH TYR A 82 23.656 53.181 43.167 1.00 40.07 O ATOM 1175 HA TYR A 82 21.643 49.202 38.787 1.00 0.00 H ATOM 1176 HB3 TYR A 82 24.198 50.458 37.723 1.00 0.00 H ATOM 1177 HB2 TYR A 82 24.160 49.003 38.746 1.00 0.00 H ATOM 1178 HD2 TYR A 82 24.528 52.503 38.768 1.00 0.00 H ATOM 1179 HE2 TYR A 82 24.536 53.921 40.801 1.00 0.00 H ATOM 1180 HE1 TYR A 82 22.781 50.711 43.034 1.00 0.00 H ATOM 1181 HD1 TYR A 82 22.781 49.302 41.010 1.00 0.00 H ATOM 1182 HH TYR A 82 23.273 52.667 43.921 1.00 0.00 H ATOM 1183 H TYR A 82 23.280 48.362 36.536 1.00 0.00 H ATOM 1184 N LEU A 83 21.720 51.116 36.157 1.00 38.52 N ATOM 1185 CA LEU A 83 21.083 52.263 35.524 1.00 38.90 C ATOM 1186 C LEU A 83 19.580 52.042 35.406 1.00 40.19 C ATOM 1187 O LEU A 83 18.797 52.993 35.445 1.00 41.86 O ATOM 1188 CB LEU A 83 21.678 52.510 34.138 1.00 38.37 C ATOM 1189 CG LEU A 83 23.109 53.034 34.025 1.00 39.53 C ATOM 1190 CD1 LEU A 83 23.496 53.205 32.562 1.00 38.80 C ATOM 1191 CD2 LEU A 83 23.276 54.352 34.782 1.00 40.75 C ATOM 1192 HA LEU A 83 21.264 53.138 36.148 1.00 0.00 H ATOM 1193 HB2 LEU A 83 21.642 51.562 33.602 1.00 0.00 H ATOM 1194 HB3 LEU A 83 21.033 53.233 33.638 1.00 0.00 H ATOM 1195 HG LEU A 83 23.775 52.301 34.480 1.00 0.00 H ATOM 1196 HD21 LEU A 83 22.598 55.097 34.366 1.00 0.00 H ATOM 1197 HD22 LEU A 83 23.044 54.196 35.836 1.00 0.00 H ATOM 1198 HD23 LEU A 83 24.305 54.699 34.683 1.00 0.00 H ATOM 1199 HD11 LEU A 83 23.428 52.243 32.055 1.00 0.00 H ATOM 1200 HD12 LEU A 83 22.818 53.915 32.089 1.00 0.00 H ATOM 1201 HD13 LEU A 83 24.518 53.579 32.499 1.00 0.00 H ATOM 1202 H LEU A 83 22.298 50.474 35.577 1.00 0.00 H ATOM 1203 N LEU A 84 19.182 50.782 35.263 1.00 40.19 N ATOM 1204 CA LEU A 84 17.776 50.425 35.116 1.00 41.22 C ATOM 1205 C LEU A 84 17.143 50.178 36.469 1.00 42.24 C ATOM 1206 O LEU A 84 15.929 50.288 36.630 1.00 43.33 O ATOM 1207 CB LEU A 84 17.634 49.169 34.255 1.00 40.03 C ATOM 1208 CG LEU A 84 18.296 49.260 32.882 1.00 40.27 C ATOM 1209 CD1 LEU A 84 18.173 47.944 32.142 1.00 39.24 C ATOM 1210 CD2 LEU A 84 17.696 50.407 32.067 1.00 39.92 C ATOM 1211 HA LEU A 84 17.266 51.257 34.631 1.00 0.00 H ATOM 1212 HB2 LEU A 84 18.083 48.335 34.794 1.00 0.00 H ATOM 1213 HB3 LEU A 84 16.571 48.976 34.108 1.00 0.00 H ATOM 1214 HG LEU A 84 19.356 49.469 33.025 1.00 0.00 H ATOM 1215 HD21 LEU A 84 16.628 50.236 31.933 1.00 0.00 H ATOM 1216 HD22 LEU A 84 17.851 51.347 32.596 1.00 0.00 H ATOM 1217 HD23 LEU A 84 18.183 50.452 31.093 1.00 0.00 H ATOM 1218 HD11 LEU A 84 18.661 47.158 32.718 1.00 0.00 H ATOM 1219 HD12 LEU A 84 17.119 47.700 32.011 1.00 0.00 H ATOM 1220 HD13 LEU A 84 18.651 48.031 31.166 1.00 0.00 H ATOM 1221 H LEU A 84 19.896 50.026 35.256 1.00 0.00 H ATOM 1222 N TRP A 85 17.981 49.839 37.440 1.00 43.17 N ATOM 1223 CA TRP A 85 17.529 49.540 38.783 1.00 44.11 C ATOM 1224 C TRP A 85 18.618 49.974 39.754 1.00 45.09 C ATOM 1225 O TRP A 85 19.649 49.319 39.883 1.00 44.25 O ATOM 1226 CB TRP A 85 17.199 48.053 38.902 1.00 44.90 C ATOM 1227 CG TRP A 85 16.740 47.606 40.258 1.00 45.31 C ATOM 1228 CD1 TRP A 85 16.075 48.351 41.195 1.00 45.47 C ATOM 1229 CD2 TRP A 85 16.883 46.294 40.816 1.00 45.42 C ATOM 1230 NE1 TRP A 85 15.816 47.587 42.305 1.00 45.61 N ATOM 1231 CE2 TRP A 85 16.300 46.321 42.099 1.00 45.42 C ATOM 1232 CE3 TRP A 85 17.457 45.101 40.358 1.00 45.31 C ATOM 1233 CZ2 TRP A 85 16.272 45.200 42.931 1.00 45.44 C ATOM 1234 CZ3 TRP A 85 17.428 43.990 41.182 1.00 45.69 C ATOM 1235 CH2 TRP A 85 16.840 44.047 42.456 1.00 45.61 C ATOM 1236 HA TRP A 85 16.614 50.083 39.021 1.00 0.00 H ATOM 1237 HB2 TRP A 85 16.409 47.824 38.186 1.00 0.00 H ATOM 1238 HB3 TRP A 85 18.095 47.487 38.646 1.00 0.00 H ATOM 1239 HE1 TRP A 85 15.331 47.915 43.164 1.00 0.00 H ATOM 1240 HD1 TRP A 85 15.793 49.397 41.077 1.00 0.00 H ATOM 1241 HZ2 TRP A 85 15.816 45.241 43.920 1.00 0.00 H ATOM 1242 HH2 TRP A 85 16.835 43.154 43.081 1.00 0.00 H ATOM 1243 HZ3 TRP A 85 17.869 43.055 40.837 1.00 0.00 H ATOM 1244 HE3 TRP A 85 17.918 45.049 39.371 1.00 0.00 H ATOM 1245 H TRP A 85 18.998 49.786 37.229 1.00 0.00 H ATOM 1246 N ARG A 86 18.377 51.100 40.420 1.00 46.17 N ATOM 1247 CA ARG A 86 19.351 51.716 41.321 1.00 48.16 C ATOM 1248 C ARG A 86 19.441 51.010 42.669 1.00 48.63 C ATOM 1249 O ARG A 86 19.042 51.552 43.703 1.00 47.32 O ATOM 1250 CB ARG A 86 19.015 53.196 41.515 1.00 49.20 C ATOM 1251 CG ARG A 86 19.381 54.061 40.330 1.00 50.87 C ATOM 1252 CD ARG A 86 20.846 54.429 40.385 1.00 53.72 C ATOM 1253 NE ARG A 86 21.287 55.132 39.185 1.00 56.51 N ATOM 1254 CZ ARG A 86 22.387 55.878 39.122 1.00 57.40 C ATOM 1255 NH1 ARG A 86 23.156 56.030 40.197 1.00 58.25 N ATOM 1256 NH2 ARG A 86 22.712 56.482 37.987 1.00 57.98 N ATOM 1257 HA ARG A 86 20.330 51.618 40.853 1.00 0.00 H ATOM 1258 HB2 ARG A 86 17.943 53.286 41.690 1.00 0.00 H ATOM 1259 HB3 ARG A 86 19.556 53.561 42.388 1.00 0.00 H ATOM 1260 HG2 ARG A 86 19.181 53.514 39.409 1.00 0.00 H ATOM 1261 HG3 ARG A 86 18.780 54.970 40.348 1.00 0.00 H ATOM 1262 HD2 ARG A 86 21.433 53.517 40.493 1.00 0.00 H ATOM 1263 HD3 ARG A 86 21.014 55.071 41.249 1.00 0.00 H ATOM 1264 HE ARG A 86 20.706 55.045 38.327 1.00 0.00 H ATOM 1265 HH12 ARG A 86 24.015 56.614 40.144 1.00 0.00 H ATOM 1266 HH11 ARG A 86 22.898 55.565 41.091 1.00 0.00 H ATOM 1267 HH22 ARG A 86 23.571 57.065 37.936 1.00 0.00 H ATOM 1268 HH21 ARG A 86 22.107 56.372 37.148 1.00 0.00 H ATOM 1269 H ARG A 86 17.454 51.563 40.294 1.00 0.00 H ATOM 1270 N ASN A 87 19.984 49.799 42.639 1.00 49.11 N ATOM 1271 CA ASN A 87 20.114 48.965 43.818 1.00 50.50 C ATOM 1272 C ASN A 87 21.422 48.179 43.737 1.00 51.04 C ATOM 1273 O ASN A 87 21.816 47.725 42.665 1.00 50.65 O ATOM 1274 CB ASN A 87 18.903 48.036 43.915 1.00 51.30 C ATOM 1275 CG ASN A 87 18.840 47.272 45.224 1.00 52.73 C ATOM 1276 OD1 ASN A 87 19.770 46.558 45.594 1.00 52.86 O ATOM 1277 ND2 ASN A 87 17.719 47.406 45.926 1.00 53.17 N ATOM 1278 HA ASN A 87 20.143 49.578 44.719 1.00 0.00 H ATOM 1279 HB2 ASN A 87 17.998 48.635 43.819 1.00 0.00 H ATOM 1280 HB3 ASN A 87 18.950 47.318 43.096 1.00 0.00 H ATOM 1281 HD22 ASN A 87 16.957 48.021 45.576 1.00 0.00 H ATOM 1282 HD21 ASN A 87 17.604 46.896 46.825 1.00 0.00 H ATOM 1283 H ASN A 87 20.331 49.432 41.730 1.00 0.00 H ATOM 1284 N ARG A 88 22.091 48.030 44.876 1.00 51.20 N ATOM 1285 CA ARG A 88 23.374 47.332 44.956 1.00 51.84 C ATOM 1286 C ARG A 88 23.272 45.892 44.447 1.00 50.35 C ATOM 1287 O ARG A 88 24.257 45.313 43.983 1.00 49.96 O ATOM 1288 CB ARG A 88 23.883 47.341 46.400 1.00 53.79 C ATOM 1289 CG ARG A 88 25.350 46.961 46.572 1.00 57.47 C ATOM 1290 CD ARG A 88 26.291 48.056 46.081 1.00 60.04 C ATOM 1291 NE ARG A 88 26.109 49.317 46.800 1.00 62.42 N ATOM 1292 CZ ARG A 88 25.540 50.407 46.286 1.00 63.57 C ATOM 1293 NH1 ARG A 88 25.092 50.407 45.035 1.00 63.68 N ATOM 1294 NH2 ARG A 88 25.423 51.505 47.027 1.00 64.43 N ATOM 1295 HA ARG A 88 24.079 47.860 44.315 1.00 0.00 H ATOM 1296 HB2 ARG A 88 23.745 48.345 46.801 1.00 0.00 H ATOM 1297 HB3 ARG A 88 23.282 46.636 46.974 1.00 0.00 H ATOM 1298 HG2 ARG A 88 25.544 46.779 47.629 1.00 0.00 H ATOM 1299 HG3 ARG A 88 25.546 46.050 46.006 1.00 0.00 H ATOM 1300 HD2 ARG A 88 26.104 48.228 45.021 1.00 0.00 H ATOM 1301 HD3 ARG A 88 27.319 47.721 46.218 1.00 0.00 H ATOM 1302 HE ARG A 88 26.448 49.366 47.782 1.00 0.00 H ATOM 1303 HH12 ARG A 88 24.649 51.262 44.641 1.00 0.00 H ATOM 1304 HH11 ARG A 88 25.184 49.552 44.450 1.00 0.00 H ATOM 1305 HH22 ARG A 88 24.979 52.357 46.628 1.00 0.00 H ATOM 1306 HH21 ARG A 88 25.775 51.512 48.006 1.00 0.00 H ATOM 1307 H ARG A 88 21.685 48.427 45.747 1.00 0.00 H ATOM 1308 N PHE A 89 22.074 45.327 44.537 1.00 47.82 N ATOM 1309 CA PHE A 89 21.814 43.975 44.069 1.00 46.99 C ATOM 1310 C PHE A 89 21.832 43.872 42.532 1.00 45.10 C ATOM 1311 O PHE A 89 22.094 42.797 41.985 1.00 44.20 O ATOM 1312 CB PHE A 89 20.484 43.472 44.634 1.00 48.52 C ATOM 1313 CG PHE A 89 20.290 41.989 44.504 1.00 50.40 C ATOM 1314 CD1 PHE A 89 21.252 41.104 44.980 1.00 51.08 C ATOM 1315 CD2 PHE A 89 19.137 41.476 43.925 1.00 51.02 C ATOM 1316 CE1 PHE A 89 21.078 39.733 44.870 1.00 51.39 C ATOM 1317 CE2 PHE A 89 18.952 40.102 43.813 1.00 51.71 C ATOM 1318 CZ PHE A 89 19.925 39.230 44.286 1.00 51.93 C ATOM 1319 HA PHE A 89 22.621 43.340 44.434 1.00 0.00 H ATOM 1320 HB2 PHE A 89 20.439 43.733 45.691 1.00 0.00 H ATOM 1321 HB3 PHE A 89 19.674 43.972 44.103 1.00 0.00 H ATOM 1322 HD2 PHE A 89 18.370 42.156 43.555 1.00 0.00 H ATOM 1323 HE2 PHE A 89 18.044 39.710 43.354 1.00 0.00 H ATOM 1324 HZ PHE A 89 19.782 38.153 44.198 1.00 0.00 H ATOM 1325 HE1 PHE A 89 21.845 39.053 45.241 1.00 0.00 H ATOM 1326 HD1 PHE A 89 22.156 41.494 45.447 1.00 0.00 H ATOM 1327 H PHE A 89 21.293 45.871 44.957 1.00 0.00 H ATOM 1328 N ALA A 90 21.560 44.984 41.849 1.00 40.76 N ATOM 1329 CA ALA A 90 21.587 45.018 40.389 1.00 38.71 C ATOM 1330 C ALA A 90 23.014 44.879 39.869 1.00 37.29 C ATOM 1331 O ALA A 90 23.248 44.226 38.855 1.00 35.30 O ATOM 1332 CB ALA A 90 20.948 46.296 39.861 1.00 38.31 C ATOM 1333 HA ALA A 90 21.005 44.171 40.024 1.00 0.00 H ATOM 1334 HB1 ALA A 90 19.911 46.346 40.193 1.00 0.00 H ATOM 1335 HB2 ALA A 90 21.495 47.158 40.242 1.00 0.00 H ATOM 1336 HB3 ALA A 90 20.982 46.294 38.772 1.00 0.00 H ATOM 1337 H ALA A 90 21.322 45.852 42.370 1.00 0.00 H ATOM 1338 N LYS A 91 23.960 45.501 40.571 1.00 36.86 N ATOM 1339 CA LYS A 91 25.379 45.369 40.256 1.00 35.82 C ATOM 1340 C LYS A 91 25.826 43.920 40.407 1.00 34.56 C ATOM 1341 O LYS A 91 26.530 43.399 39.552 1.00 31.50 O ATOM 1342 CB LYS A 91 26.228 46.240 41.176 1.00 36.66 C ATOM 1343 CG LYS A 91 26.096 47.733 40.958 1.00 39.47 C ATOM 1344 CD LYS A 91 26.957 48.479 41.954 1.00 40.26 C ATOM 1345 CE LYS A 91 26.768 49.980 41.842 1.00 42.01 C ATOM 1346 NZ LYS A 91 27.451 50.698 42.958 1.00 42.12 N ATOM 1347 HA LYS A 91 25.516 45.694 39.225 1.00 0.00 H ATOM 1348 HB2 LYS A 91 25.941 46.023 42.205 1.00 0.00 H ATOM 1349 HB3 LYS A 91 27.273 45.969 41.027 1.00 0.00 H ATOM 1350 HG2 LYS A 91 26.417 47.980 39.946 1.00 0.00 H ATOM 1351 HG3 LYS A 91 25.055 48.027 41.089 1.00 0.00 H ATOM 1352 HD2 LYS A 91 26.688 48.163 42.962 1.00 0.00 H ATOM 1353 HD3 LYS A 91 28.004 48.239 41.767 1.00 0.00 H ATOM 1354 HE2 LYS A 91 25.702 50.207 41.873 1.00 0.00 H ATOM 1355 HE3 LYS A 91 27.183 50.321 40.894 1.00 0.00 H ATOM 1356 HZ1 LYS A 91 27.055 50.381 43.866 1.00 0.00 H ATOM 1357 HZ2 LYS A 91 28.470 50.489 42.931 1.00 0.00 H ATOM 1358 HZ3 LYS A 91 27.303 51.722 42.852 1.00 0.00 H ATOM 1359 H LYS A 91 23.678 46.102 41.372 1.00 0.00 H ATOM 1360 N ILE A 92 25.415 43.287 41.505 1.00 33.92 N ATOM 1361 CA ILE A 92 25.762 41.894 41.792 1.00 34.25 C ATOM 1362 C ILE A 92 25.176 40.943 40.754 1.00 32.72 C ATOM 1363 O ILE A 92 25.869 40.064 40.255 1.00 33.79 O ATOM 1364 CB ILE A 92 25.287 41.461 43.191 1.00 34.77 C ATOM 1365 CG1 ILE A 92 26.024 42.256 44.269 1.00 36.68 C ATOM 1366 CG2 ILE A 92 25.497 39.964 43.396 1.00 36.70 C ATOM 1367 CD1 ILE A 92 27.541 42.140 44.185 1.00 37.88 C ATOM 1368 HA ILE A 92 26.850 41.839 41.755 1.00 0.00 H ATOM 1369 HB ILE A 92 24.220 41.668 43.271 1.00 0.00 H ATOM 1370 HG12 ILE A 92 25.753 43.307 44.168 1.00 0.00 H ATOM 1371 HG13 ILE A 92 25.704 41.892 45.245 1.00 0.00 H ATOM 1372 HD11 ILE A 92 27.831 41.095 44.296 1.00 0.00 H ATOM 1373 HD12 ILE A 92 27.880 42.512 43.218 1.00 0.00 H ATOM 1374 HD13 ILE A 92 27.994 42.730 44.981 1.00 0.00 H ATOM 1375 HG21 ILE A 92 24.930 39.413 42.646 1.00 0.00 H ATOM 1376 HG22 ILE A 92 26.557 39.730 43.296 1.00 0.00 H ATOM 1377 HG23 ILE A 92 25.154 39.683 44.392 1.00 0.00 H ATOM 1378 H ILE A 92 24.823 43.804 42.186 1.00 0.00 H ATOM 1379 N LEU A 93 23.900 41.123 40.437 1.00 31.77 N ATOM 1380 CA LEU A 93 23.254 40.328 39.402 1.00 31.92 C ATOM 1381 C LEU A 93 23.898 40.632 38.056 1.00 30.94 C ATOM 1382 O LEU A 93 23.937 39.779 37.170 1.00 30.85 O ATOM 1383 CB LEU A 93 21.752 40.627 39.339 1.00 32.12 C ATOM 1384 CG LEU A 93 20.853 40.093 40.460 1.00 31.76 C ATOM 1385 CD1 LEU A 93 19.428 40.616 40.283 1.00 31.92 C ATOM 1386 CD2 LEU A 93 20.865 38.569 40.513 1.00 32.71 C ATOM 1387 HA LEU A 93 23.381 39.272 39.642 1.00 0.00 H ATOM 1388 HB2 LEU A 93 21.640 41.711 39.325 1.00 0.00 H ATOM 1389 HB3 LEU A 93 21.380 40.212 38.402 1.00 0.00 H ATOM 1390 HG LEU A 93 21.248 40.454 41.410 1.00 0.00 H ATOM 1391 HD21 LEU A 93 20.505 38.171 39.564 1.00 0.00 H ATOM 1392 HD22 LEU A 93 21.882 38.221 40.692 1.00 0.00 H ATOM 1393 HD23 LEU A 93 20.216 38.230 41.320 1.00 0.00 H ATOM 1394 HD11 LEU A 93 19.435 41.705 40.317 1.00 0.00 H ATOM 1395 HD12 LEU A 93 19.037 40.284 39.321 1.00 0.00 H ATOM 1396 HD13 LEU A 93 18.799 40.230 41.085 1.00 0.00 H ATOM 1397 H LEU A 93 23.349 41.848 40.939 1.00 0.00 H ATOM 1398 N GLY A 94 24.408 41.853 37.915 1.00 29.75 N ATOM 1399 CA GLY A 94 25.059 42.283 36.681 1.00 29.12 C ATOM 1400 C GLY A 94 26.357 41.547 36.419 1.00 29.31 C ATOM 1401 O GLY A 94 26.782 41.417 35.277 1.00 28.13 O ATOM 1402 HA3 GLY A 94 25.271 43.350 36.751 1.00 0.00 H ATOM 1403 HA2 GLY A 94 24.381 42.102 35.847 1.00 0.00 H ATOM 1404 H GLY A 94 24.341 42.522 38.709 1.00 0.00 H ATOM 1405 N VAL A 95 26.984 41.061 37.487 1.00 29.43 N ATOM 1406 CA VAL A 95 28.243 40.327 37.376 1.00 28.34 C ATOM 1407 C VAL A 95 28.122 39.095 36.462 1.00 27.90 C ATOM 1408 O VAL A 95 29.090 38.692 35.830 1.00 27.96 O ATOM 1409 CB VAL A 95 28.799 39.940 38.772 1.00 27.86 C ATOM 1410 CG1 VAL A 95 29.988 39.004 38.639 1.00 25.80 C ATOM 1411 CG2 VAL A 95 29.191 41.213 39.559 1.00 26.34 C ATOM 1412 HA VAL A 95 28.959 41.001 36.906 1.00 0.00 H ATOM 1413 HB VAL A 95 28.019 39.415 39.323 1.00 0.00 H ATOM 1414 HG11 VAL A 95 29.678 38.097 38.120 1.00 0.00 H ATOM 1415 HG12 VAL A 95 30.776 39.498 38.071 1.00 0.00 H ATOM 1416 HG13 VAL A 95 30.360 38.747 39.631 1.00 0.00 H ATOM 1417 HG21 VAL A 95 29.956 41.759 39.007 1.00 0.00 H ATOM 1418 HG22 VAL A 95 28.312 41.845 39.686 1.00 0.00 H ATOM 1419 HG23 VAL A 95 29.580 40.929 40.537 1.00 0.00 H ATOM 1420 H VAL A 95 26.566 41.208 38.428 1.00 0.00 H ATOM 1421 N PHE A 96 26.932 38.510 36.387 1.00 27.51 N ATOM 1422 CA PHE A 96 26.709 37.354 35.523 1.00 28.28 C ATOM 1423 C PHE A 96 26.927 37.671 34.033 1.00 28.90 C ATOM 1424 O PHE A 96 27.295 36.793 33.260 1.00 27.68 O ATOM 1425 CB PHE A 96 25.314 36.759 35.757 1.00 29.59 C ATOM 1426 CG PHE A 96 25.223 35.878 36.984 1.00 29.41 C ATOM 1427 CD1 PHE A 96 25.629 34.551 36.931 1.00 29.30 C ATOM 1428 CD2 PHE A 96 24.734 36.381 38.189 1.00 30.43 C ATOM 1429 CE1 PHE A 96 25.549 33.727 38.065 1.00 30.59 C ATOM 1430 CE2 PHE A 96 24.647 35.570 39.329 1.00 31.13 C ATOM 1431 CZ PHE A 96 25.053 34.242 39.263 1.00 30.73 C ATOM 1432 HA PHE A 96 27.458 36.611 35.796 1.00 0.00 H ATOM 1433 HB2 PHE A 96 24.605 37.579 35.869 1.00 0.00 H ATOM 1434 HB3 PHE A 96 25.044 36.163 34.885 1.00 0.00 H ATOM 1435 HD2 PHE A 96 24.414 37.422 38.245 1.00 0.00 H ATOM 1436 HE2 PHE A 96 24.263 35.979 40.263 1.00 0.00 H ATOM 1437 HZ PHE A 96 24.984 33.605 40.145 1.00 0.00 H ATOM 1438 HE1 PHE A 96 25.873 32.688 38.010 1.00 0.00 H ATOM 1439 HD1 PHE A 96 26.015 34.144 35.997 1.00 0.00 H ATOM 1440 H PHE A 96 26.144 38.882 36.954 1.00 0.00 H ATOM 1441 N GLY A 97 26.713 38.927 33.641 1.00 26.97 N ATOM 1442 CA GLY A 97 26.927 39.346 32.256 1.00 25.80 C ATOM 1443 C GLY A 97 28.393 39.548 31.936 1.00 25.56 C ATOM 1444 O GLY A 97 28.754 39.890 30.810 1.00 26.27 O ATOM 1445 HA3 GLY A 97 26.399 40.285 32.088 1.00 0.00 H ATOM 1446 HA2 GLY A 97 26.525 38.581 31.592 1.00 0.00 H ATOM 1447 H GLY A 97 26.386 39.627 34.337 1.00 0.00 H ATOM 1448 N LEU A 98 29.242 39.359 32.939 1.00 24.99 N ATOM 1449 CA LEU A 98 30.683 39.319 32.729 1.00 25.37 C ATOM 1450 C LEU A 98 31.151 37.873 32.899 1.00 24.90 C ATOM 1451 O LEU A 98 31.977 37.391 32.128 1.00 24.48 O ATOM 1452 CB LEU A 98 31.421 40.217 33.721 1.00 26.04 C ATOM 1453 CG LEU A 98 31.326 41.742 33.616 1.00 27.47 C ATOM 1454 CD1 LEU A 98 32.195 42.360 34.695 1.00 28.16 C ATOM 1455 CD2 LEU A 98 31.779 42.212 32.252 1.00 28.38 C ATOM 1456 HA LEU A 98 30.905 39.685 31.727 1.00 0.00 H ATOM 1457 HB2 LEU A 98 31.057 39.950 34.713 1.00 0.00 H ATOM 1458 HB3 LEU A 98 32.478 39.965 33.643 1.00 0.00 H ATOM 1459 HG LEU A 98 30.289 42.050 33.752 1.00 0.00 H ATOM 1460 HD21 LEU A 98 32.814 41.911 32.090 1.00 0.00 H ATOM 1461 HD22 LEU A 98 31.145 41.765 31.486 1.00 0.00 H ATOM 1462 HD23 LEU A 98 31.703 43.298 32.200 1.00 0.00 H ATOM 1463 HD11 LEU A 98 31.844 42.033 35.674 1.00 0.00 H ATOM 1464 HD12 LEU A 98 33.228 42.043 34.554 1.00 0.00 H ATOM 1465 HD13 LEU A 98 32.135 43.446 34.630 1.00 0.00 H ATOM 1466 H LEU A 98 28.868 39.236 33.902 1.00 0.00 H ATOM 1467 N TRP A 99 30.608 37.196 33.916 1.00 23.78 N ATOM 1468 CA TRP A 99 30.990 35.818 34.256 1.00 21.70 C ATOM 1469 C TRP A 99 30.595 34.813 33.180 1.00 21.11 C ATOM 1470 O TRP A 99 31.417 34.006 32.752 1.00 21.88 O ATOM 1471 CB TRP A 99 30.398 35.422 35.619 1.00 21.57 C ATOM 1472 CG TRP A 99 30.717 34.005 36.088 1.00 20.29 C ATOM 1473 CD1 TRP A 99 31.866 33.573 36.687 1.00 20.48 C ATOM 1474 CD2 TRP A 99 29.857 32.861 36.000 1.00 21.04 C ATOM 1475 NE1 TRP A 99 31.778 32.233 36.977 1.00 19.93 N ATOM 1476 CE2 TRP A 99 30.550 31.772 36.568 1.00 22.62 C ATOM 1477 CE3 TRP A 99 28.565 32.655 35.506 1.00 22.33 C ATOM 1478 CZ2 TRP A 99 29.995 30.491 36.648 1.00 22.12 C ATOM 1479 CZ3 TRP A 99 28.013 31.383 35.588 1.00 22.07 C ATOM 1480 CH2 TRP A 99 28.729 30.318 36.149 1.00 22.77 C ATOM 1481 HA TRP A 99 32.078 35.793 34.317 1.00 0.00 H ATOM 1482 HB2 TRP A 99 30.780 36.117 36.366 1.00 0.00 H ATOM 1483 HB3 TRP A 99 29.314 35.519 35.555 1.00 0.00 H ATOM 1484 HE1 TRP A 99 32.519 31.662 37.431 1.00 0.00 H ATOM 1485 HD1 TRP A 99 32.730 34.202 36.904 1.00 0.00 H ATOM 1486 HZ2 TRP A 99 30.547 29.662 37.090 1.00 0.00 H ATOM 1487 HH2 TRP A 99 28.270 29.330 36.190 1.00 0.00 H ATOM 1488 HZ3 TRP A 99 27.006 31.211 35.209 1.00 0.00 H ATOM 1489 HE3 TRP A 99 28.002 33.477 35.065 1.00 0.00 H ATOM 1490 H TRP A 99 29.882 37.666 34.493 1.00 0.00 H ATOM 1491 N ILE A 100 29.347 34.855 32.732 1.00 21.65 N ATOM 1492 CA ILE A 100 28.897 33.915 31.693 1.00 22.07 C ATOM 1493 C ILE A 100 29.771 33.940 30.426 1.00 23.40 C ATOM 1494 O ILE A 100 30.267 32.895 30.007 1.00 23.51 O ATOM 1495 CB ILE A 100 27.411 34.115 31.326 1.00 22.04 C ATOM 1496 CG1 ILE A 100 26.506 33.796 32.516 1.00 22.03 C ATOM 1497 CG2 ILE A 100 27.025 33.236 30.152 1.00 21.79 C ATOM 1498 CD1 ILE A 100 25.033 34.129 32.251 1.00 23.32 C ATOM 1499 HA ILE A 100 29.009 32.927 32.140 1.00 0.00 H ATOM 1500 HB ILE A 100 27.279 35.161 31.050 1.00 0.00 H ATOM 1501 HG12 ILE A 100 26.588 32.732 32.740 1.00 0.00 H ATOM 1502 HG13 ILE A 100 26.844 34.374 33.376 1.00 0.00 H ATOM 1503 HD11 ILE A 100 24.936 35.193 32.035 1.00 0.00 H ATOM 1504 HD12 ILE A 100 24.678 33.550 31.399 1.00 0.00 H ATOM 1505 HD13 ILE A 100 24.441 33.881 33.132 1.00 0.00 H ATOM 1506 HG21 ILE A 100 27.639 33.494 29.289 1.00 0.00 H ATOM 1507 HG22 ILE A 100 27.186 32.190 30.414 1.00 0.00 H ATOM 1508 HG23 ILE A 100 25.974 33.394 29.912 1.00 0.00 H ATOM 1509 H ILE A 100 28.683 35.556 33.117 1.00 0.00 H ATOM 1510 N PRO A 101 29.970 35.133 29.809 1.00 24.54 N ATOM 1511 CA PRO A 101 30.805 35.161 28.596 1.00 23.08 C ATOM 1512 C PRO A 101 32.282 34.832 28.844 1.00 23.67 C ATOM 1513 O PRO A 101 32.943 34.258 27.978 1.00 23.02 O ATOM 1514 CB PRO A 101 30.643 36.606 28.090 1.00 23.69 C ATOM 1515 CG PRO A 101 30.313 37.401 29.298 1.00 23.79 C ATOM 1516 CD PRO A 101 29.449 36.474 30.143 1.00 23.83 C ATOM 1517 HA PRO A 101 30.490 34.397 27.885 1.00 0.00 H ATOM 1518 HD3 PRO A 101 29.569 36.687 31.205 1.00 0.00 H ATOM 1519 HD2 PRO A 101 28.397 36.564 29.872 1.00 0.00 H ATOM 1520 HG3 PRO A 101 29.762 38.302 29.028 1.00 0.00 H ATOM 1521 HG2 PRO A 101 31.219 37.679 29.836 1.00 0.00 H ATOM 1522 HB2 PRO A 101 31.570 36.961 27.639 1.00 0.00 H ATOM 1523 HB3 PRO A 101 29.837 36.668 27.358 1.00 0.00 H ATOM 1524 N LEU A 102 32.812 35.185 30.006 1.00 24.73 N ATOM 1525 CA LEU A 102 34.191 34.814 30.305 1.00 26.42 C ATOM 1526 C LEU A 102 34.340 33.288 30.427 1.00 27.40 C ATOM 1527 O LEU A 102 35.269 32.701 29.871 1.00 28.17 O ATOM 1528 CB LEU A 102 34.680 35.502 31.580 1.00 27.49 C ATOM 1529 CG LEU A 102 36.133 35.218 31.980 1.00 29.37 C ATOM 1530 CD1 LEU A 102 37.104 35.776 30.950 1.00 30.22 C ATOM 1531 CD2 LEU A 102 36.436 35.788 33.359 1.00 29.43 C ATOM 1532 HA LEU A 102 34.811 35.152 29.474 1.00 0.00 H ATOM 1533 HB2 LEU A 102 34.576 36.578 31.440 1.00 0.00 H ATOM 1534 HB3 LEU A 102 34.039 35.180 32.400 1.00 0.00 H ATOM 1535 HG LEU A 102 36.262 34.136 32.017 1.00 0.00 H ATOM 1536 HD21 LEU A 102 36.279 36.867 33.348 1.00 0.00 H ATOM 1537 HD22 LEU A 102 35.773 35.331 34.093 1.00 0.00 H ATOM 1538 HD23 LEU A 102 37.472 35.573 33.620 1.00 0.00 H ATOM 1539 HD11 LEU A 102 36.911 35.313 29.982 1.00 0.00 H ATOM 1540 HD12 LEU A 102 36.968 36.855 30.871 1.00 0.00 H ATOM 1541 HD13 LEU A 102 38.126 35.559 31.261 1.00 0.00 H ATOM 1542 H LEU A 102 32.251 35.721 30.698 1.00 0.00 H ATOM 1543 N VAL A 103 33.431 32.647 31.159 1.00 25.88 N ATOM 1544 CA VAL A 103 33.505 31.197 31.335 1.00 24.82 C ATOM 1545 C VAL A 103 33.304 30.489 30.000 1.00 23.80 C ATOM 1546 O VAL A 103 33.987 29.520 29.696 1.00 21.62 O ATOM 1547 CB VAL A 103 32.472 30.678 32.369 1.00 24.40 C ATOM 1548 CG1 VAL A 103 32.380 29.154 32.331 1.00 24.00 C ATOM 1549 CG2 VAL A 103 32.844 31.147 33.763 1.00 23.47 C ATOM 1550 HA VAL A 103 34.499 30.972 31.721 1.00 0.00 H ATOM 1551 HB VAL A 103 31.495 31.085 32.108 1.00 0.00 H ATOM 1552 HG11 VAL A 103 32.071 28.835 31.336 1.00 0.00 H ATOM 1553 HG12 VAL A 103 33.355 28.726 32.565 1.00 0.00 H ATOM 1554 HG13 VAL A 103 31.649 28.817 33.066 1.00 0.00 H ATOM 1555 HG21 VAL A 103 33.831 30.765 34.022 1.00 0.00 H ATOM 1556 HG22 VAL A 103 32.857 32.237 33.787 1.00 0.00 H ATOM 1557 HG23 VAL A 103 32.110 30.775 34.478 1.00 0.00 H ATOM 1558 H VAL A 103 32.662 33.182 31.610 1.00 0.00 H ATOM 1559 N VAL A 104 32.365 30.980 29.201 1.00 24.29 N ATOM 1560 CA VAL A 104 32.121 30.378 27.906 1.00 25.16 C ATOM 1561 C VAL A 104 33.347 30.561 27.006 1.00 26.00 C ATOM 1562 O VAL A 104 33.738 29.635 26.291 1.00 25.21 O ATOM 1563 CB VAL A 104 30.820 30.890 27.255 1.00 26.02 C ATOM 1564 CG1 VAL A 104 30.655 30.312 25.850 1.00 27.47 C ATOM 1565 CG2 VAL A 104 29.629 30.499 28.107 1.00 24.98 C ATOM 1566 HA VAL A 104 31.967 29.308 28.049 1.00 0.00 H ATOM 1567 HB VAL A 104 30.876 31.976 27.182 1.00 0.00 H ATOM 1568 HG11 VAL A 104 31.501 30.614 25.233 1.00 0.00 H ATOM 1569 HG12 VAL A 104 30.616 29.224 25.908 1.00 0.00 H ATOM 1570 HG13 VAL A 104 29.731 30.687 25.410 1.00 0.00 H ATOM 1571 HG21 VAL A 104 29.586 29.413 28.193 1.00 0.00 H ATOM 1572 HG22 VAL A 104 29.733 30.939 29.099 1.00 0.00 H ATOM 1573 HG23 VAL A 104 28.714 30.864 27.640 1.00 0.00 H ATOM 1574 H VAL A 104 31.802 31.800 29.506 1.00 0.00 H ATOM 1575 N ALA A 105 33.965 31.742 27.076 1.00 25.38 N ATOM 1576 CA ALA A 105 35.173 32.034 26.297 1.00 25.19 C ATOM 1577 C ALA A 105 36.241 30.987 26.551 1.00 25.88 C ATOM 1578 O ALA A 105 36.898 30.494 25.621 1.00 23.60 O ATOM 1579 CB ALA A 105 35.712 33.419 26.644 1.00 22.79 C ATOM 1580 HA ALA A 105 34.906 32.013 25.240 1.00 0.00 H ATOM 1581 HB1 ALA A 105 34.954 34.169 26.418 1.00 0.00 H ATOM 1582 HB2 ALA A 105 35.957 33.457 27.705 1.00 0.00 H ATOM 1583 HB3 ALA A 105 36.608 33.617 26.056 1.00 0.00 H ATOM 1584 H ALA A 105 33.578 32.477 27.702 1.00 0.00 H ATOM 1585 N ILE A 106 36.392 30.645 27.828 1.00 26.49 N ATOM 1586 CA ILE A 106 37.408 29.704 28.296 1.00 27.04 C ATOM 1587 C ILE A 106 37.341 28.317 27.625 1.00 28.17 C ATOM 1588 O ILE A 106 38.371 27.648 27.490 1.00 31.71 O ATOM 1589 CB ILE A 106 37.377 29.613 29.843 1.00 27.78 C ATOM 1590 CG1 ILE A 106 37.964 30.896 30.428 1.00 27.15 C ATOM 1591 CG2 ILE A 106 38.153 28.413 30.337 1.00 27.36 C ATOM 1592 CD1 ILE A 106 37.544 31.191 31.861 1.00 29.61 C ATOM 1593 HA ILE A 106 38.374 30.104 27.987 1.00 0.00 H ATOM 1594 HB ILE A 106 36.343 29.495 30.168 1.00 0.00 H ATOM 1595 HG12 ILE A 106 39.051 30.815 30.402 1.00 0.00 H ATOM 1596 HG13 ILE A 106 37.648 31.731 29.802 1.00 0.00 H ATOM 1597 HD11 ILE A 106 36.459 31.290 31.907 1.00 0.00 H ATOM 1598 HD12 ILE A 106 37.864 30.374 32.508 1.00 0.00 H ATOM 1599 HD13 ILE A 106 38.009 32.120 32.191 1.00 0.00 H ATOM 1600 HG21 ILE A 106 37.714 27.504 29.926 1.00 0.00 H ATOM 1601 HG22 ILE A 106 39.191 28.495 30.014 1.00 0.00 H ATOM 1602 HG23 ILE A 106 38.112 28.378 31.426 1.00 0.00 H ATOM 1603 H ILE A 106 35.753 31.070 28.530 1.00 0.00 H ATOM 1604 N TYR A 107 36.160 27.889 27.186 1.00 26.84 N ATOM 1605 CA TYR A 107 36.075 26.625 26.445 1.00 26.41 C ATOM 1606 C TYR A 107 35.772 26.803 24.956 1.00 26.47 C ATOM 1607 O TYR A 107 36.135 25.950 24.149 1.00 26.97 O ATOM 1608 CB TYR A 107 35.092 25.630 27.086 1.00 24.33 C ATOM 1609 CG TYR A 107 33.609 25.967 27.010 1.00 24.26 C ATOM 1610 CD1 TYR A 107 32.836 25.576 25.917 1.00 22.99 C ATOM 1611 CD2 TYR A 107 32.975 26.645 28.049 1.00 23.40 C ATOM 1612 CE1 TYR A 107 31.484 25.871 25.851 1.00 22.38 C ATOM 1613 CE2 TYR A 107 31.617 26.939 27.995 1.00 23.22 C ATOM 1614 CZ TYR A 107 30.879 26.552 26.893 1.00 24.12 C ATOM 1615 OH TYR A 107 29.529 26.847 26.839 1.00 25.48 O ATOM 1616 HA TYR A 107 37.076 26.200 26.512 1.00 0.00 H ATOM 1617 HB3 TYR A 107 35.355 25.543 28.140 1.00 0.00 H ATOM 1618 HB2 TYR A 107 35.235 24.667 26.596 1.00 0.00 H ATOM 1619 HD2 TYR A 107 33.554 26.951 28.920 1.00 0.00 H ATOM 1620 HE2 TYR A 107 31.138 27.471 28.817 1.00 0.00 H ATOM 1621 HE1 TYR A 107 30.899 25.568 24.982 1.00 0.00 H ATOM 1622 HD1 TYR A 107 33.304 25.028 25.099 1.00 0.00 H ATOM 1623 HH TYR A 107 29.151 26.504 25.991 1.00 0.00 H ATOM 1624 H TYR A 107 35.302 28.447 27.367 1.00 0.00 H ATOM 1625 N TYR A 108 35.116 27.906 24.603 1.00 24.13 N ATOM 1626 CA TYR A 108 34.735 28.156 23.217 1.00 24.56 C ATOM 1627 C TYR A 108 35.958 28.410 22.349 1.00 23.87 C ATOM 1628 O TYR A 108 36.054 27.886 21.242 1.00 23.02 O ATOM 1629 CB TYR A 108 33.805 29.357 23.144 1.00 23.00 C ATOM 1630 CG TYR A 108 33.016 29.500 21.865 1.00 24.45 C ATOM 1631 CD1 TYR A 108 31.738 28.948 21.748 1.00 23.78 C ATOM 1632 CD2 TYR A 108 33.526 30.205 20.785 1.00 23.88 C ATOM 1633 CE1 TYR A 108 31.008 29.088 20.597 1.00 23.48 C ATOM 1634 CE2 TYR A 108 32.789 30.348 19.608 1.00 24.73 C ATOM 1635 CZ TYR A 108 31.538 29.790 19.521 1.00 25.27 C ATOM 1636 OH TYR A 108 30.794 29.929 18.360 1.00 24.16 O ATOM 1637 HA TYR A 108 34.223 27.269 22.843 1.00 0.00 H ATOM 1638 HB3 TYR A 108 34.409 30.256 23.267 1.00 0.00 H ATOM 1639 HB2 TYR A 108 33.096 29.282 23.968 1.00 0.00 H ATOM 1640 HD2 TYR A 108 34.517 30.654 20.856 1.00 0.00 H ATOM 1641 HE2 TYR A 108 33.204 30.899 18.764 1.00 0.00 H ATOM 1642 HE1 TYR A 108 30.013 28.649 20.525 1.00 0.00 H ATOM 1643 HD1 TYR A 108 31.314 28.396 22.587 1.00 0.00 H ATOM 1644 HH TYR A 108 29.924 29.469 18.470 1.00 0.00 H ATOM 1645 H TYR A 108 34.869 28.606 25.332 1.00 0.00 H ATOM 1646 N VAL A 109 36.896 29.215 22.848 1.00 22.79 N ATOM 1647 CA VAL A 109 38.083 29.509 22.056 1.00 23.31 C ATOM 1648 C VAL A 109 38.906 28.241 21.842 1.00 23.72 C ATOM 1649 O VAL A 109 39.515 28.060 20.775 1.00 22.81 O ATOM 1650 CB VAL A 109 38.953 30.624 22.662 1.00 22.77 C ATOM 1651 CG1 VAL A 109 40.140 30.919 21.763 1.00 24.09 C ATOM 1652 CG2 VAL A 109 38.134 31.901 22.867 1.00 22.22 C ATOM 1653 HA VAL A 109 37.733 29.881 21.093 1.00 0.00 H ATOM 1654 HB VAL A 109 39.315 30.279 23.630 1.00 0.00 H ATOM 1655 HG11 VAL A 109 40.744 30.018 21.653 1.00 0.00 H ATOM 1656 HG12 VAL A 109 39.782 31.240 20.785 1.00 0.00 H ATOM 1657 HG13 VAL A 109 40.744 31.710 22.208 1.00 0.00 H ATOM 1658 HG21 VAL A 109 37.746 32.240 21.907 1.00 0.00 H ATOM 1659 HG22 VAL A 109 37.305 31.695 23.543 1.00 0.00 H ATOM 1660 HG23 VAL A 109 38.771 32.674 23.296 1.00 0.00 H ATOM 1661 H VAL A 109 36.781 29.630 23.795 1.00 0.00 H ATOM 1662 N TYR A 110 38.918 27.358 22.844 1.00 23.65 N ATOM 1663 CA TYR A 110 39.709 26.137 22.743 1.00 23.38 C ATOM 1664 C TYR A 110 39.126 25.247 21.662 1.00 23.30 C ATOM 1665 O TYR A 110 39.858 24.734 20.826 1.00 25.42 O ATOM 1666 CB TYR A 110 39.831 25.406 24.091 1.00 24.16 C ATOM 1667 CG TYR A 110 40.708 24.166 24.046 1.00 23.31 C ATOM 1668 CD1 TYR A 110 41.942 24.181 23.399 1.00 22.73 C ATOM 1669 CD2 TYR A 110 40.312 22.988 24.676 1.00 22.58 C ATOM 1670 CE1 TYR A 110 42.757 23.034 23.365 1.00 23.73 C ATOM 1671 CE2 TYR A 110 41.107 21.855 24.653 1.00 23.68 C ATOM 1672 CZ TYR A 110 42.330 21.882 23.998 1.00 23.41 C ATOM 1673 OH TYR A 110 43.107 20.746 23.978 1.00 24.85 O ATOM 1674 HA TYR A 110 40.727 26.407 22.463 1.00 0.00 H ATOM 1675 HB3 TYR A 110 38.833 25.108 24.411 1.00 0.00 H ATOM 1676 HB2 TYR A 110 40.253 26.098 24.819 1.00 0.00 H ATOM 1677 HD2 TYR A 110 39.356 22.958 25.198 1.00 0.00 H ATOM 1678 HE2 TYR A 110 40.773 20.943 25.148 1.00 0.00 H ATOM 1679 HE1 TYR A 110 43.715 23.054 22.845 1.00 0.00 H ATOM 1680 HD1 TYR A 110 42.281 25.095 22.912 1.00 0.00 H ATOM 1681 HH TYR A 110 43.330 20.484 24.906 1.00 0.00 H ATOM 1682 H TYR A 110 38.360 27.542 23.702 1.00 0.00 H ATOM 1683 N ILE A 111 37.809 25.089 21.654 1.00 23.10 N ATOM 1684 CA ILE A 111 37.156 24.310 20.612 1.00 24.09 C ATOM 1685 C ILE A 111 37.364 24.959 19.229 1.00 26.31 C ATOM 1686 O ILE A 111 37.516 24.271 18.208 1.00 25.64 O ATOM 1687 CB ILE A 111 35.651 24.153 20.891 1.00 24.46 C ATOM 1688 CG1 ILE A 111 35.426 23.404 22.216 1.00 25.14 C ATOM 1689 CG2 ILE A 111 34.976 23.415 19.738 1.00 23.91 C ATOM 1690 CD1 ILE A 111 33.965 23.416 22.693 1.00 25.65 C ATOM 1691 HA ILE A 111 37.613 23.321 20.612 1.00 0.00 H ATOM 1692 HB ILE A 111 35.206 25.144 20.977 1.00 0.00 H ATOM 1693 HG12 ILE A 111 35.736 22.368 22.083 1.00 0.00 H ATOM 1694 HG13 ILE A 111 36.043 23.870 22.984 1.00 0.00 H ATOM 1695 HD11 ILE A 111 33.642 24.446 22.843 1.00 0.00 H ATOM 1696 HD12 ILE A 111 33.335 22.942 21.941 1.00 0.00 H ATOM 1697 HD13 ILE A 111 33.886 22.869 23.632 1.00 0.00 H ATOM 1698 HG21 ILE A 111 35.112 23.981 18.817 1.00 0.00 H ATOM 1699 HG22 ILE A 111 35.424 22.428 19.628 1.00 0.00 H ATOM 1700 HG23 ILE A 111 33.912 23.311 19.949 1.00 0.00 H ATOM 1701 H ILE A 111 37.235 25.528 22.402 1.00 0.00 H ATOM 1702 N GLU A 112 37.359 26.288 19.202 1.00 24.68 N ATOM 1703 CA GLU A 112 37.633 27.019 17.975 1.00 25.47 C ATOM 1704 C GLU A 112 39.040 26.688 17.492 1.00 25.16 C ATOM 1705 O GLU A 112 39.260 26.490 16.297 1.00 25.34 O ATOM 1706 CB GLU A 112 37.471 28.519 18.204 1.00 25.97 C ATOM 1707 CG GLU A 112 37.931 29.405 17.050 1.00 26.27 C ATOM 1708 CD GLU A 112 37.894 30.863 17.447 1.00 27.76 C ATOM 1709 OE1 GLU A 112 36.845 31.305 17.974 1.00 27.45 O ATOM 1710 OE2 GLU A 112 38.904 31.559 17.246 1.00 26.28 O ATOM 1711 HA GLU A 112 36.920 26.720 17.207 1.00 0.00 H ATOM 1712 HB2 GLU A 112 36.415 28.721 18.385 1.00 0.00 H ATOM 1713 HB3 GLU A 112 38.048 28.790 19.088 1.00 0.00 H ATOM 1714 HG2 GLU A 112 38.951 29.135 16.775 1.00 0.00 H ATOM 1715 HG3 GLU A 112 37.273 29.250 16.195 1.00 0.00 H ATOM 1716 H GLU A 112 37.155 26.815 20.075 1.00 0.00 H ATOM 1717 N SER A 113 39.985 26.611 18.426 1.00 24.36 N ATOM 1718 CA SER A 113 41.349 26.258 18.078 1.00 24.33 C ATOM 1719 C SER A 113 41.445 24.877 17.418 1.00 25.72 C ATOM 1720 O SER A 113 42.298 24.678 16.544 1.00 26.56 O ATOM 1721 CB SER A 113 42.299 26.368 19.274 1.00 24.16 C ATOM 1722 OG SER A 113 42.165 25.278 20.163 1.00 26.08 O ATOM 1723 HA SER A 113 41.671 26.991 17.338 1.00 0.00 H ATOM 1724 HB2 SER A 113 42.080 27.290 19.813 1.00 0.00 H ATOM 1725 HB3 SER A 113 43.325 26.398 18.907 1.00 0.00 H ATOM 1726 HG SER A 113 41.237 25.247 20.508 1.00 0.00 H ATOM 1727 H SER A 113 39.743 26.806 19.418 1.00 0.00 H ATOM 1728 N TRP A 114 40.582 23.938 17.810 1.00 26.01 N ATOM 1729 CA TRP A 114 40.575 22.615 17.171 1.00 25.53 C ATOM 1730 C TRP A 114 40.204 22.688 15.696 1.00 26.89 C ATOM 1731 O TRP A 114 40.794 21.986 14.875 1.00 26.64 O ATOM 1732 CB TRP A 114 39.596 21.635 17.809 1.00 25.47 C ATOM 1733 CG TRP A 114 39.626 21.488 19.304 1.00 24.85 C ATOM 1734 CD1 TRP A 114 40.585 21.923 20.175 1.00 25.24 C ATOM 1735 CD2 TRP A 114 38.645 20.815 20.087 1.00 24.58 C ATOM 1736 NE1 TRP A 114 40.240 21.578 21.468 1.00 25.88 N ATOM 1737 CE2 TRP A 114 39.053 20.894 21.437 1.00 25.09 C ATOM 1738 CE3 TRP A 114 37.450 20.157 19.779 1.00 24.23 C ATOM 1739 CZ2 TRP A 114 38.304 20.338 22.478 1.00 25.74 C ATOM 1740 CZ3 TRP A 114 36.705 19.608 20.816 1.00 25.81 C ATOM 1741 CH2 TRP A 114 37.141 19.700 22.150 1.00 25.98 C ATOM 1742 HA TRP A 114 41.597 22.260 17.305 1.00 0.00 H ATOM 1743 HB2 TRP A 114 38.591 21.954 17.533 1.00 0.00 H ATOM 1744 HB3 TRP A 114 39.794 20.652 17.381 1.00 0.00 H ATOM 1745 HE1 TRP A 114 40.790 21.800 22.322 1.00 0.00 H ATOM 1746 HD1 TRP A 114 41.489 22.463 19.892 1.00 0.00 H ATOM 1747 HZ2 TRP A 114 38.636 20.411 23.514 1.00 0.00 H ATOM 1748 HH2 TRP A 114 36.538 19.252 22.940 1.00 0.00 H ATOM 1749 HZ3 TRP A 114 35.768 19.098 20.592 1.00 0.00 H ATOM 1750 HE3 TRP A 114 37.110 20.076 18.747 1.00 0.00 H ATOM 1751 H TRP A 114 39.908 24.144 18.575 1.00 0.00 H ATOM 1752 N THR A 115 39.212 23.514 15.366 1.00 25.50 N ATOM 1753 CA THR A 115 38.771 23.646 13.980 1.00 24.36 C ATOM 1754 C THR A 115 39.917 24.186 13.128 1.00 26.10 C ATOM 1755 O THR A 115 40.115 23.753 11.996 1.00 27.45 O ATOM 1756 CB THR A 115 37.520 24.530 13.850 1.00 22.66 C ATOM 1757 OG1 THR A 115 37.841 25.884 14.188 1.00 22.25 O ATOM 1758 CG2 THR A 115 36.391 24.008 14.772 1.00 20.63 C ATOM 1759 HA THR A 115 38.489 22.657 13.619 1.00 0.00 H ATOM 1760 HB THR A 115 37.172 24.492 12.818 1.00 0.00 H ATOM 1761 HG1 THR A 115 38.171 25.921 15.121 1.00 0.00 H ATOM 1762 HG23 THR A 115 36.154 22.978 14.507 1.00 0.00 H ATOM 1763 HG21 THR A 115 36.722 24.051 15.810 1.00 0.00 H ATOM 1764 HG22 THR A 115 35.504 24.630 14.646 1.00 0.00 H ATOM 1765 H THR A 115 38.744 24.074 16.107 1.00 0.00 H ATOM 1766 N LEU A 116 40.681 25.123 13.682 1.00 25.69 N ATOM 1767 CA LEU A 116 41.845 25.647 12.982 1.00 26.81 C ATOM 1768 C LEU A 116 42.906 24.561 12.782 1.00 27.44 C ATOM 1769 O LEU A 116 43.443 24.405 11.684 1.00 26.46 O ATOM 1770 CB LEU A 116 42.444 26.833 13.736 1.00 25.86 C ATOM 1771 CG LEU A 116 43.669 27.495 13.105 1.00 26.53 C ATOM 1772 CD1 LEU A 116 43.387 27.925 11.645 1.00 24.69 C ATOM 1773 CD2 LEU A 116 44.131 28.679 13.954 1.00 24.98 C ATOM 1774 HA LEU A 116 41.513 25.987 12.001 1.00 0.00 H ATOM 1775 HB2 LEU A 116 41.668 27.593 13.829 1.00 0.00 H ATOM 1776 HB3 LEU A 116 42.730 26.484 14.728 1.00 0.00 H ATOM 1777 HG LEU A 116 44.475 26.762 13.075 1.00 0.00 H ATOM 1778 HD21 LEU A 116 43.327 29.411 14.022 1.00 0.00 H ATOM 1779 HD22 LEU A 116 44.391 28.329 14.953 1.00 0.00 H ATOM 1780 HD23 LEU A 116 45.004 29.138 13.490 1.00 0.00 H ATOM 1781 HD11 LEU A 116 43.123 27.048 11.054 1.00 0.00 H ATOM 1782 HD12 LEU A 116 42.561 28.637 11.630 1.00 0.00 H ATOM 1783 HD13 LEU A 116 44.279 28.392 11.226 1.00 0.00 H ATOM 1784 H LEU A 116 40.444 25.486 14.627 1.00 0.00 H ATOM 1785 N GLY A 117 43.206 23.820 13.844 1.00 24.98 N ATOM 1786 CA GLY A 117 44.195 22.748 13.780 1.00 24.94 C ATOM 1787 C GLY A 117 43.786 21.681 12.779 1.00 25.70 C ATOM 1788 O GLY A 117 44.619 21.186 12.029 1.00 26.02 O ATOM 1789 HA3 GLY A 117 44.291 22.293 14.766 1.00 0.00 H ATOM 1790 HA2 GLY A 117 45.155 23.167 13.480 1.00 0.00 H ATOM 1791 H GLY A 117 42.723 24.009 14.745 1.00 0.00 H ATOM 1792 N PHE A 118 42.502 21.328 12.765 1.00 24.88 N ATOM 1793 CA PHE A 118 41.984 20.383 11.791 1.00 27.46 C ATOM 1794 C PHE A 118 42.032 20.975 10.365 1.00 28.92 C ATOM 1795 O PHE A 118 42.322 20.261 9.408 1.00 30.02 O ATOM 1796 CB PHE A 118 40.552 19.953 12.143 1.00 27.91 C ATOM 1797 CG PHE A 118 40.460 18.783 13.122 1.00 28.45 C ATOM 1798 CD1 PHE A 118 41.084 18.830 14.353 1.00 26.37 C ATOM 1799 CD2 PHE A 118 39.708 17.656 12.806 1.00 26.91 C ATOM 1800 CE1 PHE A 118 40.985 17.764 15.253 1.00 28.30 C ATOM 1801 CE2 PHE A 118 39.602 16.593 13.698 1.00 27.95 C ATOM 1802 CZ PHE A 118 40.246 16.649 14.926 1.00 27.52 C ATOM 1803 HA PHE A 118 42.622 19.500 11.818 1.00 0.00 H ATOM 1804 HB2 PHE A 118 40.039 20.807 12.585 1.00 0.00 H ATOM 1805 HB3 PHE A 118 40.047 19.665 11.221 1.00 0.00 H ATOM 1806 HD2 PHE A 118 39.194 17.605 11.846 1.00 0.00 H ATOM 1807 HE2 PHE A 118 39.013 15.716 13.432 1.00 0.00 H ATOM 1808 HZ PHE A 118 40.168 15.817 15.626 1.00 0.00 H ATOM 1809 HE1 PHE A 118 41.494 17.816 16.215 1.00 0.00 H ATOM 1810 HD1 PHE A 118 41.663 19.712 14.628 1.00 0.00 H ATOM 1811 H PHE A 118 41.855 21.739 13.468 1.00 0.00 H ATOM 1812 N ALA A 119 41.744 22.270 10.222 1.00 28.12 N ATOM 1813 CA ALA A 119 41.786 22.909 8.904 1.00 27.72 C ATOM 1814 C ALA A 119 43.191 22.802 8.330 1.00 29.06 C ATOM 1815 O ALA A 119 43.368 22.419 7.170 1.00 29.04 O ATOM 1816 CB ALA A 119 41.342 24.365 8.978 1.00 26.84 C ATOM 1817 HA ALA A 119 41.089 22.391 8.245 1.00 0.00 H ATOM 1818 HB1 ALA A 119 40.320 24.413 9.354 1.00 0.00 H ATOM 1819 HB2 ALA A 119 42.004 24.912 9.650 1.00 0.00 H ATOM 1820 HB3 ALA A 119 41.385 24.808 7.983 1.00 0.00 H ATOM 1821 H ALA A 119 41.486 22.833 11.057 1.00 0.00 H ATOM 1822 N ILE A 120 44.182 23.128 9.158 1.00 28.46 N ATOM 1823 CA ILE A 120 45.581 23.045 8.779 1.00 29.10 C ATOM 1824 C ILE A 120 45.986 21.633 8.332 1.00 31.67 C ATOM 1825 O ILE A 120 46.562 21.459 7.254 1.00 30.97 O ATOM 1826 CB ILE A 120 46.488 23.499 9.930 1.00 29.76 C ATOM 1827 CG1 ILE A 120 46.317 24.998 10.191 1.00 28.62 C ATOM 1828 CG2 ILE A 120 47.940 23.187 9.617 1.00 29.72 C ATOM 1829 CD1 ILE A 120 47.101 25.490 11.398 1.00 29.40 C ATOM 1830 HA ILE A 120 45.709 23.714 7.928 1.00 0.00 H ATOM 1831 HB ILE A 120 46.198 22.953 10.828 1.00 0.00 H ATOM 1832 HG12 ILE A 120 46.657 25.544 9.311 1.00 0.00 H ATOM 1833 HG13 ILE A 120 45.259 25.202 10.358 1.00 0.00 H ATOM 1834 HD11 ILE A 120 46.765 24.960 12.289 1.00 0.00 H ATOM 1835 HD12 ILE A 120 48.163 25.302 11.241 1.00 0.00 H ATOM 1836 HD13 ILE A 120 46.935 26.560 11.526 1.00 0.00 H ATOM 1837 HG21 ILE A 120 48.057 22.113 9.476 1.00 0.00 H ATOM 1838 HG22 ILE A 120 48.234 23.709 8.706 1.00 0.00 H ATOM 1839 HG23 ILE A 120 48.568 23.516 10.445 1.00 0.00 H ATOM 1840 H ILE A 120 43.944 23.456 10.116 1.00 0.00 H ATOM 1841 N LYS A 121 45.679 20.624 9.146 1.00 31.16 N ATOM 1842 CA LYS A 121 46.087 19.258 8.824 1.00 31.57 C ATOM 1843 C LYS A 121 45.332 18.691 7.629 1.00 31.62 C ATOM 1844 O LYS A 121 45.884 17.894 6.869 1.00 29.36 O ATOM 1845 CB LYS A 121 45.935 18.336 10.035 1.00 32.60 C ATOM 1846 CG LYS A 121 46.856 18.714 11.195 1.00 34.55 C ATOM 1847 CD LYS A 121 46.610 17.819 12.404 1.00 37.57 C ATOM 1848 CE LYS A 121 47.486 16.579 12.398 1.00 40.22 C ATOM 1849 NZ LYS A 121 48.844 16.883 12.941 1.00 41.60 N ATOM 1850 HA LYS A 121 47.141 19.307 8.550 1.00 0.00 H ATOM 1851 HB2 LYS A 121 44.903 18.385 10.381 1.00 0.00 H ATOM 1852 HB3 LYS A 121 46.166 17.316 9.726 1.00 0.00 H ATOM 1853 HG2 LYS A 121 47.893 18.606 10.877 1.00 0.00 H ATOM 1854 HG3 LYS A 121 46.669 19.751 11.475 1.00 0.00 H ATOM 1855 HD2 LYS A 121 46.817 18.389 13.309 1.00 0.00 H ATOM 1856 HD3 LYS A 121 45.565 17.509 12.403 1.00 0.00 H ATOM 1857 HE2 LYS A 121 47.584 16.216 11.375 1.00 0.00 H ATOM 1858 HE3 LYS A 121 47.020 15.809 13.013 1.00 0.00 H ATOM 1859 HZ1 LYS A 121 49.295 17.614 12.355 1.00 0.00 H ATOM 1860 HZ2 LYS A 121 48.756 17.226 13.919 1.00 0.00 H ATOM 1861 HZ3 LYS A 121 49.423 16.019 12.926 1.00 0.00 H ATOM 1862 H LYS A 121 45.144 20.810 10.018 1.00 0.00 H ATOM 1863 N PHE A 122 44.075 19.093 7.465 1.00 31.22 N ATOM 1864 CA PHE A 122 43.292 18.622 6.328 1.00 32.91 C ATOM 1865 C PHE A 122 43.770 19.262 5.019 1.00 33.53 C ATOM 1866 O PHE A 122 43.715 18.638 3.974 1.00 34.36 O ATOM 1867 CB PHE A 122 41.785 18.819 6.544 1.00 32.79 C ATOM 1868 CG PHE A 122 41.106 17.631 7.192 1.00 34.80 C ATOM 1869 CD1 PHE A 122 41.213 17.412 8.561 1.00 34.24 C ATOM 1870 CD2 PHE A 122 40.374 16.731 6.428 1.00 34.59 C ATOM 1871 CE1 PHE A 122 40.598 16.318 9.159 1.00 34.84 C ATOM 1872 CE2 PHE A 122 39.755 15.632 7.015 1.00 35.83 C ATOM 1873 CZ PHE A 122 39.868 15.426 8.389 1.00 35.86 C ATOM 1874 HA PHE A 122 43.457 17.548 6.246 1.00 0.00 H ATOM 1875 HB2 PHE A 122 41.639 19.690 7.182 1.00 0.00 H ATOM 1876 HB3 PHE A 122 41.318 18.997 5.575 1.00 0.00 H ATOM 1877 HD2 PHE A 122 40.283 16.888 5.353 1.00 0.00 H ATOM 1878 HE2 PHE A 122 39.184 14.934 6.403 1.00 0.00 H ATOM 1879 HZ PHE A 122 39.385 14.568 8.856 1.00 0.00 H ATOM 1880 HE1 PHE A 122 40.690 16.162 10.234 1.00 0.00 H ATOM 1881 HD1 PHE A 122 41.787 18.107 9.174 1.00 0.00 H ATOM 1882 H PHE A 122 43.648 19.747 8.151 1.00 0.00 H ATOM 1883 N LEU A 123 44.246 20.500 5.101 1.00 32.95 N ATOM 1884 CA LEU A 123 44.753 21.220 3.940 1.00 32.51 C ATOM 1885 C LEU A 123 46.029 20.588 3.412 1.00 33.29 C ATOM 1886 O LEU A 123 46.197 20.423 2.208 1.00 34.38 O ATOM 1887 CB LEU A 123 45.030 22.680 4.295 1.00 30.91 C ATOM 1888 CG LEU A 123 45.591 23.549 3.164 1.00 31.26 C ATOM 1889 CD1 LEU A 123 44.662 23.537 1.951 1.00 29.54 C ATOM 1890 CD2 LEU A 123 45.823 24.960 3.646 1.00 31.73 C ATOM 1891 HA LEU A 123 43.988 21.168 3.166 1.00 0.00 H ATOM 1892 HB2 LEU A 123 44.093 23.127 4.627 1.00 0.00 H ATOM 1893 HB3 LEU A 123 45.748 22.694 5.115 1.00 0.00 H ATOM 1894 HG LEU A 123 46.548 23.129 2.856 1.00 0.00 H ATOM 1895 HD21 LEU A 123 44.879 25.386 3.986 1.00 0.00 H ATOM 1896 HD22 LEU A 123 46.536 24.948 4.471 1.00 0.00 H ATOM 1897 HD23 LEU A 123 46.221 25.561 2.829 1.00 0.00 H ATOM 1898 HD11 LEU A 123 44.555 22.515 1.587 1.00 0.00 H ATOM 1899 HD12 LEU A 123 43.685 23.926 2.239 1.00 0.00 H ATOM 1900 HD13 LEU A 123 45.085 24.162 1.165 1.00 0.00 H ATOM 1901 H LEU A 123 44.257 20.972 6.028 1.00 0.00 H ATOM 1902 N VAL A 124 46.921 20.242 4.332 1.00 33.57 N ATOM 1903 CA VAL A 124 48.214 19.676 4.010 1.00 32.74 C ATOM 1904 C VAL A 124 48.148 18.154 3.842 1.00 32.41 C ATOM 1905 O VAL A 124 49.159 17.498 3.582 1.00 31.37 O ATOM 1906 CB VAL A 124 49.240 20.066 5.093 1.00 34.44 C ATOM 1907 CG1 VAL A 124 50.616 19.512 4.762 1.00 35.83 C ATOM 1908 CG2 VAL A 124 49.314 21.580 5.223 1.00 34.58 C ATOM 1909 HA VAL A 124 48.532 20.086 3.052 1.00 0.00 H ATOM 1910 HB VAL A 124 48.912 19.637 6.040 1.00 0.00 H ATOM 1911 HG11 VAL A 124 50.564 18.425 4.703 1.00 0.00 H ATOM 1912 HG12 VAL A 124 50.947 19.913 3.804 1.00 0.00 H ATOM 1913 HG13 VAL A 124 51.320 19.802 5.542 1.00 0.00 H ATOM 1914 HG21 VAL A 124 49.619 22.011 4.269 1.00 0.00 H ATOM 1915 HG22 VAL A 124 48.334 21.968 5.502 1.00 0.00 H ATOM 1916 HG23 VAL A 124 50.042 21.842 5.991 1.00 0.00 H ATOM 1917 H VAL A 124 46.679 20.385 5.333 1.00 0.00 H ATOM 1918 N GLY A 125 46.953 17.591 3.987 1.00 31.81 N ATOM 1919 CA GLY A 125 46.756 16.157 3.820 1.00 33.30 C ATOM 1920 C GLY A 125 47.364 15.283 4.901 1.00 35.59 C ATOM 1921 O GLY A 125 47.608 14.092 4.682 1.00 33.89 O ATOM 1922 HA3 GLY A 125 47.196 15.866 2.866 1.00 0.00 H ATOM 1923 HA2 GLY A 125 45.683 15.966 3.797 1.00 0.00 H ATOM 1924 H GLY A 125 46.137 18.190 4.226 1.00 0.00 H ATOM 1925 N LEU A 126 47.611 15.865 6.073 1.00 37.26 N ATOM 1926 CA LEU A 126 48.143 15.112 7.211 1.00 39.51 C ATOM 1927 C LEU A 126 46.982 14.510 8.006 1.00 41.75 C ATOM 1928 O LEU A 126 46.820 14.758 9.204 1.00 40.39 O ATOM 1929 CB LEU A 126 49.019 16.002 8.094 1.00 39.28 C ATOM 1930 CG LEU A 126 50.357 16.460 7.506 1.00 39.83 C ATOM 1931 CD1 LEU A 126 51.016 17.504 8.398 1.00 38.74 C ATOM 1932 CD2 LEU A 126 51.301 15.273 7.285 1.00 39.97 C ATOM 1933 HA LEU A 126 48.775 14.304 6.843 1.00 0.00 H ATOM 1934 HB2 LEU A 126 48.443 16.895 8.336 1.00 0.00 H ATOM 1935 HB3 LEU A 126 49.233 15.450 9.009 1.00 0.00 H ATOM 1936 HG LEU A 126 50.152 16.915 6.537 1.00 0.00 H ATOM 1937 HD21 LEU A 126 51.490 14.779 8.238 1.00 0.00 H ATOM 1938 HD22 LEU A 126 50.840 14.568 6.594 1.00 0.00 H ATOM 1939 HD23 LEU A 126 52.242 15.631 6.867 1.00 0.00 H ATOM 1940 HD11 LEU A 126 50.359 18.369 8.489 1.00 0.00 H ATOM 1941 HD12 LEU A 126 51.195 17.076 9.385 1.00 0.00 H ATOM 1942 HD13 LEU A 126 51.964 17.811 7.956 1.00 0.00 H ATOM 1943 H LEU A 126 47.421 16.882 6.183 1.00 0.00 H ATOM 1944 N VAL A 127 46.178 13.712 7.309 1.00 44.36 N ATOM 1945 CA VAL A 127 44.966 13.129 7.855 1.00 47.41 C ATOM 1946 C VAL A 127 45.078 11.609 7.883 1.00 50.33 C ATOM 1947 O VAL A 127 46.035 11.050 7.348 1.00 50.67 O ATOM 1948 CB VAL A 127 43.741 13.542 7.012 1.00 47.14 C ATOM 1949 CG1 VAL A 127 43.609 15.044 6.990 1.00 47.84 C ATOM 1950 CG2 VAL A 127 43.855 13.003 5.597 1.00 46.66 C ATOM 1951 HA VAL A 127 44.837 13.498 8.872 1.00 0.00 H ATOM 1952 HB VAL A 127 42.848 13.115 7.469 1.00 0.00 H ATOM 1953 HG11 VAL A 127 43.483 15.411 8.008 1.00 0.00 H ATOM 1954 HG12 VAL A 127 44.508 15.480 6.554 1.00 0.00 H ATOM 1955 HG13 VAL A 127 42.741 15.322 6.392 1.00 0.00 H ATOM 1956 HG21 VAL A 127 44.755 13.402 5.129 1.00 0.00 H ATOM 1957 HG22 VAL A 127 43.911 11.915 5.627 1.00 0.00 H ATOM 1958 HG23 VAL A 127 42.980 13.307 5.022 1.00 0.00 H ATOM 1959 H VAL A 127 46.430 13.495 6.324 1.00 0.00 H ATOM 1960 N PRO A 128 44.102 10.930 8.509 1.00 53.69 N ATOM 1961 CA PRO A 128 44.141 9.473 8.536 1.00 56.29 C ATOM 1962 C PRO A 128 43.766 8.856 7.193 1.00 59.19 C ATOM 1963 O PRO A 128 42.965 9.422 6.443 1.00 58.96 O ATOM 1964 CB PRO A 128 43.080 9.106 9.584 1.00 55.51 C ATOM 1965 CG PRO A 128 42.671 10.388 10.231 1.00 54.57 C ATOM 1966 CD PRO A 128 42.929 11.453 9.229 1.00 53.96 C ATOM 1967 HA PRO A 128 45.141 9.104 8.761 1.00 0.00 H ATOM 1968 HD3 PRO A 128 42.078 11.579 8.559 1.00 0.00 H ATOM 1969 HD2 PRO A 128 43.154 12.404 9.712 1.00 0.00 H ATOM 1970 HG3 PRO A 128 43.261 10.563 11.131 1.00 0.00 H ATOM 1971 HG2 PRO A 128 41.613 10.361 10.491 1.00 0.00 H ATOM 1972 HB2 PRO A 128 42.222 8.634 9.104 1.00 0.00 H ATOM 1973 HB3 PRO A 128 43.500 8.426 10.325 1.00 0.00 H ATOM 1974 N GLU A 129 44.357 7.703 6.900 1.00 63.24 N ATOM 1975 CA GLU A 129 44.031 6.939 5.706 1.00 66.83 C ATOM 1976 C GLU A 129 43.254 5.689 6.091 1.00 68.76 C ATOM 1977 O GLU A 129 43.813 4.769 6.686 1.00 69.41 O ATOM 1978 CB GLU A 129 45.300 6.552 4.942 1.00 67.98 C ATOM 1979 CG GLU A 129 45.719 7.538 3.856 1.00 69.52 C ATOM 1980 CD GLU A 129 44.882 7.416 2.584 1.00 70.50 C ATOM 1981 OE1 GLU A 129 44.009 6.519 2.508 1.00 70.93 O ATOM 1982 OE2 GLU A 129 45.100 8.220 1.653 1.00 70.85 O ATOM 1983 HA GLU A 129 43.417 7.561 5.055 1.00 0.00 H ATOM 1984 HB2 GLU A 129 46.116 6.470 5.660 1.00 0.00 H ATOM 1985 HB3 GLU A 129 45.132 5.582 4.473 1.00 0.00 H ATOM 1986 HG2 GLU A 129 45.613 8.550 4.246 1.00 0.00 H ATOM 1987 HG3 GLU A 129 46.763 7.354 3.604 1.00 0.00 H ATOM 1988 H GLU A 129 45.080 7.332 7.549 1.00 0.00 H ATOM 1989 N PRO A 130 41.954 5.655 5.760 1.00 70.66 N ATOM 1990 CA PRO A 130 41.137 4.477 6.034 1.00 72.42 C ATOM 1991 C PRO A 130 41.437 3.359 5.033 1.00 74.39 C ATOM 1992 O PRO A 130 41.851 3.645 3.905 1.00 74.54 O ATOM 1993 CB PRO A 130 39.698 4.986 5.847 1.00 71.94 C ATOM 1994 CG PRO A 130 39.804 6.475 5.615 1.00 71.77 C ATOM 1995 CD PRO A 130 41.181 6.725 5.112 1.00 70.76 C ATOM 1996 HA PRO A 130 41.322 4.058 7.023 1.00 0.00 H ATOM 1997 HD3 PRO A 130 41.226 6.642 4.026 1.00 0.00 H ATOM 1998 HD2 PRO A 130 41.539 7.709 5.415 1.00 0.00 H ATOM 1999 HG3 PRO A 130 39.639 7.015 6.548 1.00 0.00 H ATOM 2000 HG2 PRO A 130 39.069 6.795 4.877 1.00 0.00 H ATOM 2001 HB2 PRO A 130 39.234 4.502 4.988 1.00 0.00 H ATOM 2002 HB3 PRO A 130 39.106 4.784 6.740 1.00 0.00 H ATOM 2003 N PRO A 131 41.245 2.092 5.443 1.00 76.23 N ATOM 2004 CA PRO A 131 41.433 0.954 4.539 1.00 77.36 C ATOM 2005 C PRO A 131 40.505 1.015 3.322 1.00 78.17 C ATOM 2006 O PRO A 131 39.288 1.160 3.477 1.00 77.76 O ATOM 2007 CB PRO A 131 41.090 -0.261 5.416 1.00 77.42 C ATOM 2008 CG PRO A 131 40.302 0.286 6.557 1.00 77.08 C ATOM 2009 CD PRO A 131 40.851 1.657 6.794 1.00 76.85 C ATOM 2010 HA PRO A 131 42.441 0.927 4.125 1.00 0.00 H ATOM 2011 HD3 PRO A 131 40.091 2.317 7.213 1.00 0.00 H ATOM 2012 HD2 PRO A 131 41.711 1.625 7.463 1.00 0.00 H ATOM 2013 HG3 PRO A 131 40.431 -0.336 7.443 1.00 0.00 H ATOM 2014 HG2 PRO A 131 39.244 0.337 6.301 1.00 0.00 H ATOM 2015 HB2 PRO A 131 40.497 -0.983 4.854 1.00 0.00 H ATOM 2016 HB3 PRO A 131 42.000 -0.741 5.776 1.00 0.00 H ATOM 2017 N PRO A 132 41.081 0.907 2.114 1.00 79.21 N ATOM 2018 CA PRO A 132 40.316 0.951 0.873 1.00 79.64 C ATOM 2019 C PRO A 132 39.822 -0.432 0.459 1.00 79.80 C ATOM 2020 O PRO A 132 38.619 -0.696 0.509 1.00 80.30 O ATOM 2021 CB PRO A 132 41.334 1.478 -0.139 1.00 79.72 C ATOM 2022 CG PRO A 132 42.672 1.019 0.390 1.00 79.77 C ATOM 2023 CD PRO A 132 42.525 0.735 1.868 1.00 79.51 C ATOM 2024 HA PRO A 132 39.419 1.564 0.958 1.00 0.00 H ATOM 2025 HD3 PRO A 132 42.841 -0.281 2.102 1.00 0.00 H ATOM 2026 HD2 PRO A 132 43.107 1.441 2.460 1.00 0.00 H ATOM 2027 HG3 PRO A 132 43.417 1.800 0.236 1.00 0.00 H ATOM 2028 HG2 PRO A 132 42.984 0.114 -0.131 1.00 0.00 H ATOM 2029 HB2 PRO A 132 41.147 1.059 -1.127 1.00 0.00 H ATOM 2030 HB3 PRO A 132 41.294 2.566 -0.194 1.00 0.00 H TER 2031 PRO A 132 ATOM 2032 N THR A 135 34.883 -3.381 3.668 1.00 83.28 N ATOM 2033 CA THR A 135 35.258 -2.375 4.655 1.00 82.89 C ATOM 2034 C THR A 135 34.026 -1.822 5.372 1.00 82.70 C ATOM 2035 O THR A 135 33.234 -1.073 4.789 1.00 82.83 O ATOM 2036 CB THR A 135 36.058 -1.218 4.016 1.00 82.90 C ATOM 2037 OG1 THR A 135 35.296 -0.635 2.952 1.00 82.98 O ATOM 2038 CG2 THR A 135 37.385 -1.726 3.463 1.00 83.02 C ATOM 2039 HA THR A 135 35.899 -2.869 5.385 1.00 0.00 H ATOM 2040 HB THR A 135 36.257 -0.469 4.783 1.00 0.00 H ATOM 2041 HG1 THR A 135 34.443 -0.285 3.312 1.00 0.00 H ATOM 2042 HG23 THR A 135 37.967 -2.170 4.270 1.00 0.00 H ATOM 2043 HG21 THR A 135 37.194 -2.476 2.696 1.00 0.00 H ATOM 2044 HG22 THR A 135 37.939 -0.893 3.029 1.00 0.00 H ATOM 2045 HN3 THR A 135 34.250 -2.953 2.962 1.00 0.00 H ATOM 2046 HN2 THR A 135 34.394 -4.166 4.143 1.00 0.00 H ATOM 2047 HN1 THR A 135 35.739 -3.739 3.197 1.00 0.00 H ATOM 2048 N ASP A 136 33.874 -2.203 6.639 1.00 81.89 N ATOM 2049 CA ASP A 136 32.756 -1.756 7.468 1.00 80.76 C ATOM 2050 C ASP A 136 32.935 -0.298 7.902 1.00 79.90 C ATOM 2051 O ASP A 136 34.032 0.253 7.785 1.00 79.34 O ATOM 2052 CB ASP A 136 32.609 -2.662 8.698 1.00 81.04 C ATOM 2053 CG ASP A 136 33.853 -2.670 9.574 1.00 81.29 C ATOM 2054 OD1 ASP A 136 34.943 -3.006 9.064 1.00 81.12 O ATOM 2055 OD2 ASP A 136 33.736 -2.347 10.777 1.00 81.38 O ATOM 2056 HA ASP A 136 31.847 -1.820 6.869 1.00 0.00 H ATOM 2057 HB2 ASP A 136 31.766 -2.309 9.292 1.00 0.00 H ATOM 2058 HB3 ASP A 136 32.413 -3.680 8.360 1.00 0.00 H ATOM 2059 H ASP A 136 34.579 -2.844 7.055 1.00 0.00 H ATOM 2060 N PRO A 137 31.855 0.331 8.402 1.00 78.73 N ATOM 2061 CA PRO A 137 31.901 1.719 8.866 1.00 77.54 C ATOM 2062 C PRO A 137 32.971 1.982 9.927 1.00 76.22 C ATOM 2063 O PRO A 137 33.614 3.030 9.900 1.00 76.25 O ATOM 2064 CB PRO A 137 30.504 1.938 9.469 1.00 77.77 C ATOM 2065 CG PRO A 137 29.936 0.570 9.663 1.00 78.52 C ATOM 2066 CD PRO A 137 30.508 -0.243 8.553 1.00 78.59 C ATOM 2067 HA PRO A 137 32.157 2.393 8.048 1.00 0.00 H ATOM 2068 HD3 PRO A 137 30.557 -1.298 8.821 1.00 0.00 H ATOM 2069 HD2 PRO A 137 29.925 -0.128 7.639 1.00 0.00 H ATOM 2070 HG3 PRO A 137 28.848 0.594 9.600 1.00 0.00 H ATOM 2071 HG2 PRO A 137 30.234 0.164 10.630 1.00 0.00 H ATOM 2072 HB2 PRO A 137 30.578 2.459 10.423 1.00 0.00 H ATOM 2073 HB3 PRO A 137 29.881 2.517 8.787 1.00 0.00 H ATOM 2074 N ASP A 138 33.161 1.040 10.848 1.00 74.42 N ATOM 2075 CA ASP A 138 34.121 1.225 11.936 1.00 72.83 C ATOM 2076 C ASP A 138 35.579 1.196 11.476 1.00 70.95 C ATOM 2077 O ASP A 138 36.450 1.747 12.145 1.00 70.37 O ATOM 2078 CB ASP A 138 33.883 0.208 13.056 1.00 73.73 C ATOM 2079 CG ASP A 138 32.641 0.524 13.872 1.00 74.76 C ATOM 2080 OD1 ASP A 138 31.895 1.455 13.492 1.00 74.97 O ATOM 2081 OD2 ASP A 138 32.411 -0.158 14.895 1.00 75.20 O ATOM 2082 HA ASP A 138 33.945 2.228 12.324 1.00 0.00 H ATOM 2083 HB2 ASP A 138 33.768 -0.781 12.612 1.00 0.00 H ATOM 2084 HB3 ASP A 138 34.748 0.209 13.720 1.00 0.00 H ATOM 2085 H ASP A 138 32.617 0.156 10.793 1.00 0.00 H ATOM 2086 N SER A 139 35.846 0.562 10.339 1.00 68.79 N ATOM 2087 CA SER A 139 37.195 0.572 9.783 1.00 66.64 C ATOM 2088 C SER A 139 37.483 1.944 9.171 1.00 64.31 C ATOM 2089 O SER A 139 38.641 2.331 9.011 1.00 63.43 O ATOM 2090 CB SER A 139 37.375 -0.537 8.743 1.00 67.44 C ATOM 2091 OG SER A 139 36.591 -0.292 7.587 1.00 68.47 O ATOM 2092 HA SER A 139 37.907 0.381 10.586 1.00 0.00 H ATOM 2093 HB2 SER A 139 37.073 -1.488 9.182 1.00 0.00 H ATOM 2094 HB3 SER A 139 38.425 -0.588 8.456 1.00 0.00 H ATOM 2095 HG SER A 139 35.635 -0.250 7.841 1.00 0.00 H ATOM 2096 H SER A 139 35.087 0.054 9.841 1.00 0.00 H ATOM 2097 N ILE A 140 36.418 2.672 8.838 1.00 61.45 N ATOM 2098 CA ILE A 140 36.532 4.024 8.292 1.00 60.06 C ATOM 2099 C ILE A 140 36.540 5.080 9.405 1.00 58.36 C ATOM 2100 O ILE A 140 37.357 6.002 9.390 1.00 58.30 O ATOM 2101 CB ILE A 140 35.380 4.346 7.300 1.00 59.97 C ATOM 2102 CG1 ILE A 140 35.275 3.274 6.209 1.00 60.39 C ATOM 2103 CG2 ILE A 140 35.570 5.723 6.678 1.00 59.97 C ATOM 2104 CD1 ILE A 140 36.509 3.155 5.334 1.00 60.31 C ATOM 2105 HA ILE A 140 37.480 4.058 7.756 1.00 0.00 H ATOM 2106 HB ILE A 140 34.447 4.349 7.863 1.00 0.00 H ATOM 2107 HG12 ILE A 140 35.103 2.311 6.690 1.00 0.00 H ATOM 2108 HG13 ILE A 140 34.425 3.517 5.571 1.00 0.00 H ATOM 2109 HD11 ILE A 140 36.691 4.106 4.833 1.00 0.00 H ATOM 2110 HD12 ILE A 140 37.369 2.899 5.953 1.00 0.00 H ATOM 2111 HD13 ILE A 140 36.351 2.375 4.589 1.00 0.00 H ATOM 2112 HG21 ILE A 140 35.578 6.478 7.465 1.00 0.00 H ATOM 2113 HG22 ILE A 140 36.517 5.749 6.138 1.00 0.00 H ATOM 2114 HG23 ILE A 140 34.751 5.925 5.988 1.00 0.00 H ATOM 2115 H ILE A 140 35.471 2.264 8.971 1.00 0.00 H ATOM 2116 N LEU A 141 35.629 4.931 10.366 1.00 56.09 N ATOM 2117 CA LEU A 141 35.464 5.893 11.463 1.00 53.30 C ATOM 2118 C LEU A 141 36.596 5.888 12.490 1.00 51.76 C ATOM 2119 O LEU A 141 36.964 6.940 13.006 1.00 51.21 O ATOM 2120 CB LEU A 141 34.132 5.656 12.179 1.00 52.72 C ATOM 2121 CG LEU A 141 32.841 5.947 11.411 1.00 53.32 C ATOM 2122 CD1 LEU A 141 31.658 5.282 12.093 1.00 53.21 C ATOM 2123 CD2 LEU A 141 32.597 7.443 11.261 1.00 52.73 C ATOM 2124 HA LEU A 141 35.485 6.874 10.989 1.00 0.00 H ATOM 2125 HB2 LEU A 141 34.104 4.607 12.474 1.00 0.00 H ATOM 2126 HB3 LEU A 141 34.127 6.283 13.071 1.00 0.00 H ATOM 2127 HG LEU A 141 32.953 5.531 10.410 1.00 0.00 H ATOM 2128 HD21 LEU A 141 32.518 7.898 12.248 1.00 0.00 H ATOM 2129 HD22 LEU A 141 33.428 7.893 10.718 1.00 0.00 H ATOM 2130 HD23 LEU A 141 31.671 7.605 10.710 1.00 0.00 H ATOM 2131 HD11 LEU A 141 31.817 4.204 12.125 1.00 0.00 H ATOM 2132 HD12 LEU A 141 31.562 5.667 13.108 1.00 0.00 H ATOM 2133 HD13 LEU A 141 30.748 5.499 11.533 1.00 0.00 H ATOM 2134 H LEU A 141 35.008 4.097 10.338 1.00 0.00 H ATOM 2135 N ARG A 142 37.144 4.709 12.782 1.00 49.94 N ATOM 2136 CA ARG A 142 38.160 4.568 13.833 1.00 48.79 C ATOM 2137 C ARG A 142 39.412 5.425 13.631 1.00 46.28 C ATOM 2138 O ARG A 142 39.861 6.072 14.576 1.00 46.22 O ATOM 2139 CB ARG A 142 38.550 3.093 14.050 1.00 50.54 C ATOM 2140 CG ARG A 142 39.393 2.849 15.310 1.00 52.41 C ATOM 2141 CD ARG A 142 39.938 1.419 15.402 1.00 54.84 C ATOM 2142 NE ARG A 142 38.887 0.408 15.291 1.00 56.54 N ATOM 2143 CZ ARG A 142 38.765 -0.443 14.273 1.00 57.75 C ATOM 2144 NH1 ARG A 142 39.638 -0.424 13.271 1.00 57.61 N ATOM 2145 NH2 ARG A 142 37.771 -1.323 14.260 1.00 57.82 N ATOM 2146 HA ARG A 142 37.678 4.951 14.732 1.00 0.00 H ATOM 2147 HB2 ARG A 142 37.636 2.505 14.129 1.00 0.00 H ATOM 2148 HB3 ARG A 142 39.122 2.758 13.184 1.00 0.00 H ATOM 2149 HG2 ARG A 142 40.235 3.542 15.304 1.00 0.00 H ATOM 2150 HG3 ARG A 142 38.772 3.041 16.185 1.00 0.00 H ATOM 2151 HD2 ARG A 142 40.440 1.297 16.362 1.00 0.00 H ATOM 2152 HD3 ARG A 142 40.656 1.266 14.596 1.00 0.00 H ATOM 2153 HE ARG A 142 38.188 0.349 16.058 1.00 0.00 H ATOM 2154 HH12 ARG A 142 39.536 -1.091 12.480 1.00 0.00 H ATOM 2155 HH11 ARG A 142 40.423 0.258 13.278 1.00 0.00 H ATOM 2156 HH22 ARG A 142 37.675 -1.988 13.466 1.00 0.00 H ATOM 2157 HH21 ARG A 142 37.088 -1.348 15.044 1.00 0.00 H ATOM 2158 H ARG A 142 36.844 3.866 12.251 1.00 0.00 H ATOM 2159 N PRO A 143 39.986 5.434 12.411 1.00 44.13 N ATOM 2160 CA PRO A 143 41.140 6.304 12.199 1.00 42.00 C ATOM 2161 C PRO A 143 40.837 7.775 12.505 1.00 38.73 C ATOM 2162 O PRO A 143 41.713 8.501 12.961 1.00 37.06 O ATOM 2163 CB PRO A 143 41.448 6.132 10.701 1.00 42.96 C ATOM 2164 CG PRO A 143 40.849 4.828 10.329 1.00 43.59 C ATOM 2165 CD PRO A 143 39.640 4.671 11.196 1.00 44.31 C ATOM 2166 HA PRO A 143 41.966 6.039 12.859 1.00 0.00 H ATOM 2167 HD3 PRO A 143 38.757 5.088 10.712 1.00 0.00 H ATOM 2168 HD2 PRO A 143 39.463 3.622 11.432 1.00 0.00 H ATOM 2169 HG3 PRO A 143 41.556 4.019 10.513 1.00 0.00 H ATOM 2170 HG2 PRO A 143 40.564 4.827 9.277 1.00 0.00 H ATOM 2171 HB2 PRO A 143 40.998 6.939 10.123 1.00 0.00 H ATOM 2172 HB3 PRO A 143 42.525 6.121 10.530 1.00 0.00 H ATOM 2173 N PHE A 144 39.609 8.208 12.251 1.00 37.40 N ATOM 2174 CA PHE A 144 39.236 9.602 12.510 1.00 38.27 C ATOM 2175 C PHE A 144 38.923 9.854 13.995 1.00 37.30 C ATOM 2176 O PHE A 144 39.167 10.946 14.511 1.00 36.99 O ATOM 2177 CB PHE A 144 38.096 10.030 11.585 1.00 38.24 C ATOM 2178 CG PHE A 144 38.529 10.172 10.147 1.00 39.76 C ATOM 2179 CD1 PHE A 144 39.004 11.388 9.669 1.00 39.22 C ATOM 2180 CD2 PHE A 144 38.490 9.085 9.284 1.00 39.42 C ATOM 2181 CE1 PHE A 144 39.417 11.524 8.348 1.00 39.27 C ATOM 2182 CE2 PHE A 144 38.904 9.214 7.956 1.00 39.96 C ATOM 2183 CZ PHE A 144 39.367 10.434 7.492 1.00 39.42 C ATOM 2184 HA PHE A 144 40.097 10.231 12.282 1.00 0.00 H ATOM 2185 HB2 PHE A 144 37.305 9.282 11.638 1.00 0.00 H ATOM 2186 HB3 PHE A 144 37.710 10.990 11.929 1.00 0.00 H ATOM 2187 HD2 PHE A 144 38.133 8.121 9.646 1.00 0.00 H ATOM 2188 HE2 PHE A 144 38.863 8.355 7.286 1.00 0.00 H ATOM 2189 HZ PHE A 144 39.691 10.537 6.457 1.00 0.00 H ATOM 2190 HE1 PHE A 144 39.780 12.486 7.986 1.00 0.00 H ATOM 2191 HD1 PHE A 144 39.053 12.247 10.339 1.00 0.00 H ATOM 2192 H PHE A 144 38.902 7.551 11.863 1.00 0.00 H ATOM 2193 N LYS A 145 38.394 8.837 14.671 1.00 37.12 N ATOM 2194 CA LYS A 145 38.187 8.907 16.118 1.00 36.95 C ATOM 2195 C LYS A 145 39.531 9.029 16.815 1.00 36.12 C ATOM 2196 O LYS A 145 39.690 9.846 17.714 1.00 35.20 O ATOM 2197 CB LYS A 145 37.433 7.681 16.641 1.00 37.72 C ATOM 2198 CG LYS A 145 37.348 7.622 18.169 1.00 40.02 C ATOM 2199 CD LYS A 145 36.434 6.504 18.648 1.00 42.57 C ATOM 2200 CE LYS A 145 34.973 6.828 18.362 1.00 44.12 C ATOM 2201 NZ LYS A 145 34.587 8.159 18.916 1.00 46.19 N ATOM 2202 HA LYS A 145 37.577 9.784 16.333 1.00 0.00 H ATOM 2203 HB2 LYS A 145 36.420 7.701 16.239 1.00 0.00 H ATOM 2204 HB3 LYS A 145 37.944 6.785 16.289 1.00 0.00 H ATOM 2205 HG2 LYS A 145 38.348 7.456 18.571 1.00 0.00 H ATOM 2206 HG3 LYS A 145 36.963 8.573 18.537 1.00 0.00 H ATOM 2207 HD2 LYS A 145 36.701 5.581 18.134 1.00 0.00 H ATOM 2208 HD3 LYS A 145 36.566 6.372 19.722 1.00 0.00 H ATOM 2209 HE2 LYS A 145 34.345 6.061 18.814 1.00 0.00 H ATOM 2210 HE3 LYS A 145 34.816 6.835 17.283 1.00 0.00 H ATOM 2211 HZ1 LYS A 145 34.728 8.158 19.946 1.00 0.00 H ATOM 2212 HZ2 LYS A 145 35.178 8.898 18.484 1.00 0.00 H ATOM 2213 HZ3 LYS A 145 33.586 8.345 18.702 1.00 0.00 H ATOM 2214 H LYS A 145 38.122 7.973 14.160 1.00 0.00 H ATOM 2215 N GLU A 146 40.500 8.220 16.390 1.00 35.66 N ATOM 2216 CA GLU A 146 41.839 8.248 16.978 1.00 35.59 C ATOM 2217 C GLU A 146 42.561 9.551 16.665 1.00 34.38 C ATOM 2218 O GLU A 146 43.392 10.021 17.448 1.00 33.61 O ATOM 2219 CB GLU A 146 42.673 7.059 16.491 1.00 38.94 C ATOM 2220 CG GLU A 146 42.156 5.705 16.959 1.00 42.30 C ATOM 2221 CD GLU A 146 42.930 4.539 16.360 1.00 45.13 C ATOM 2222 OE1 GLU A 146 43.706 4.761 15.396 1.00 46.12 O ATOM 2223 OE2 GLU A 146 42.756 3.401 16.853 1.00 44.97 O ATOM 2224 HA GLU A 146 41.718 8.177 18.059 1.00 0.00 H ATOM 2225 HB2 GLU A 146 42.677 7.066 15.401 1.00 0.00 H ATOM 2226 HB3 GLU A 146 43.692 7.182 16.857 1.00 0.00 H ATOM 2227 HG2 GLU A 146 42.238 5.657 18.045 1.00 0.00 H ATOM 2228 HG3 GLU A 146 41.109 5.613 16.671 1.00 0.00 H ATOM 2229 H GLU A 146 40.299 7.551 15.620 1.00 0.00 H ATOM 2230 N PHE A 147 42.243 10.123 15.508 1.00 32.97 N ATOM 2231 CA PHE A 147 42.812 11.391 15.084 1.00 31.70 C ATOM 2232 C PHE A 147 42.352 12.515 16.031 1.00 29.02 C ATOM 2233 O PHE A 147 43.153 13.319 16.495 1.00 27.28 O ATOM 2234 CB PHE A 147 42.387 11.676 13.643 1.00 34.95 C ATOM 2235 CG PHE A 147 43.010 12.898 13.054 1.00 37.96 C ATOM 2236 CD1 PHE A 147 44.271 12.840 12.476 1.00 39.16 C ATOM 2237 CD2 PHE A 147 42.331 14.110 13.061 1.00 38.72 C ATOM 2238 CE1 PHE A 147 44.850 13.976 11.919 1.00 40.08 C ATOM 2239 CE2 PHE A 147 42.903 15.247 12.511 1.00 40.28 C ATOM 2240 CZ PHE A 147 44.165 15.178 11.935 1.00 40.42 C ATOM 2241 HA PHE A 147 43.900 11.342 15.124 1.00 0.00 H ATOM 2242 HB2 PHE A 147 42.665 10.820 13.028 1.00 0.00 H ATOM 2243 HB3 PHE A 147 41.304 11.800 13.623 1.00 0.00 H ATOM 2244 HD2 PHE A 147 41.337 14.168 13.504 1.00 0.00 H ATOM 2245 HE2 PHE A 147 42.363 16.194 12.531 1.00 0.00 H ATOM 2246 HZ PHE A 147 44.615 16.069 11.497 1.00 0.00 H ATOM 2247 HE1 PHE A 147 45.842 13.919 11.471 1.00 0.00 H ATOM 2248 HD1 PHE A 147 44.813 11.895 12.458 1.00 0.00 H ATOM 2249 H PHE A 147 41.562 9.646 14.883 1.00 0.00 H ATOM 2250 N LEU A 148 41.059 12.565 16.316 1.00 27.06 N ATOM 2251 CA LEU A 148 40.549 13.558 17.267 1.00 28.43 C ATOM 2252 C LEU A 148 41.120 13.272 18.662 1.00 28.50 C ATOM 2253 O LEU A 148 41.631 14.173 19.333 1.00 28.41 O ATOM 2254 CB LEU A 148 39.017 13.561 17.296 1.00 26.58 C ATOM 2255 CG LEU A 148 38.353 14.476 18.333 1.00 26.80 C ATOM 2256 CD1 LEU A 148 38.714 15.945 18.094 1.00 25.72 C ATOM 2257 CD2 LEU A 148 36.831 14.279 18.352 1.00 25.19 C ATOM 2258 HA LEU A 148 40.871 14.549 16.945 1.00 0.00 H ATOM 2259 HB2 LEU A 148 38.668 13.869 16.310 1.00 0.00 H ATOM 2260 HB3 LEU A 148 38.687 12.541 17.495 1.00 0.00 H ATOM 2261 HG LEU A 148 38.739 14.196 19.313 1.00 0.00 H ATOM 2262 HD21 LEU A 148 36.423 14.513 17.369 1.00 0.00 H ATOM 2263 HD22 LEU A 148 36.603 13.243 18.604 1.00 0.00 H ATOM 2264 HD23 LEU A 148 36.389 14.941 19.097 1.00 0.00 H ATOM 2265 HD11 LEU A 148 39.795 16.068 18.164 1.00 0.00 H ATOM 2266 HD12 LEU A 148 38.377 16.244 17.102 1.00 0.00 H ATOM 2267 HD13 LEU A 148 38.227 16.565 18.847 1.00 0.00 H ATOM 2268 H LEU A 148 40.403 11.897 15.863 1.00 0.00 H ATOM 2269 N TYR A 149 41.055 12.009 19.074 1.00 29.87 N ATOM 2270 CA TYR A 149 41.527 11.581 20.400 1.00 31.58 C ATOM 2271 C TYR A 149 42.993 11.905 20.669 1.00 32.37 C ATOM 2272 O TYR A 149 43.354 12.245 21.795 1.00 32.92 O ATOM 2273 CB TYR A 149 41.268 10.082 20.590 1.00 33.56 C ATOM 2274 CG TYR A 149 39.834 9.768 20.933 1.00 33.41 C ATOM 2275 CD1 TYR A 149 38.800 10.574 20.483 1.00 34.13 C ATOM 2276 CD2 TYR A 149 39.512 8.660 21.703 1.00 35.09 C ATOM 2277 CE1 TYR A 149 37.490 10.294 20.793 1.00 35.30 C ATOM 2278 CE2 TYR A 149 38.201 8.367 22.020 1.00 35.61 C ATOM 2279 CZ TYR A 149 37.195 9.190 21.563 1.00 35.89 C ATOM 2280 OH TYR A 149 35.885 8.908 21.875 1.00 36.26 O ATOM 2281 HA TYR A 149 40.956 12.156 21.129 1.00 0.00 H ATOM 2282 HB3 TYR A 149 41.905 9.719 21.396 1.00 0.00 H ATOM 2283 HB2 TYR A 149 41.525 9.565 19.665 1.00 0.00 H ATOM 2284 HD2 TYR A 149 40.308 8.009 22.064 1.00 0.00 H ATOM 2285 HE2 TYR A 149 37.964 7.493 22.626 1.00 0.00 H ATOM 2286 HE1 TYR A 149 36.690 10.941 20.432 1.00 0.00 H ATOM 2287 HD1 TYR A 149 39.030 11.447 19.872 1.00 0.00 H ATOM 2288 HH TYR A 149 35.296 9.593 21.471 1.00 0.00 H ATOM 2289 H TYR A 149 40.654 11.295 18.433 1.00 0.00 H ATOM 2290 N SER A 150 43.837 11.818 19.647 1.00 31.08 N ATOM 2291 CA SER A 150 45.253 12.154 19.812 1.00 32.11 C ATOM 2292 C SER A 150 45.485 13.665 19.817 1.00 29.75 C ATOM 2293 O SER A 150 46.473 14.153 20.366 1.00 29.59 O ATOM 2294 CB SER A 150 46.086 11.531 18.692 1.00 34.14 C ATOM 2295 OG SER A 150 45.684 10.192 18.472 1.00 39.03 O ATOM 2296 HA SER A 150 45.562 11.751 20.777 1.00 0.00 H ATOM 2297 HB2 SER A 150 47.139 11.550 18.973 1.00 0.00 H ATOM 2298 HB3 SER A 150 45.945 12.105 17.776 1.00 0.00 H ATOM 2299 HG SER A 150 44.728 10.174 18.215 1.00 0.00 H ATOM 2300 H SER A 150 43.488 11.507 18.718 1.00 0.00 H ATOM 2301 N TYR A 151 44.580 14.397 19.183 1.00 28.72 N ATOM 2302 CA TYR A 151 44.692 15.845 19.094 1.00 28.02 C ATOM 2303 C TYR A 151 44.389 16.449 20.469 1.00 29.39 C ATOM 2304 O TYR A 151 45.226 17.149 21.050 1.00 27.45 O ATOM 2305 CB TYR A 151 43.751 16.387 18.007 1.00 27.06 C ATOM 2306 CG TYR A 151 43.891 17.878 17.733 1.00 27.28 C ATOM 2307 CD1 TYR A 151 44.781 18.353 16.767 1.00 25.19 C ATOM 2308 CD2 TYR A 151 43.128 18.816 18.442 1.00 25.61 C ATOM 2309 CE1 TYR A 151 44.909 19.723 16.522 1.00 22.96 C ATOM 2310 CE2 TYR A 151 43.252 20.179 18.193 1.00 23.39 C ATOM 2311 CZ TYR A 151 44.140 20.617 17.230 1.00 23.51 C ATOM 2312 OH TYR A 151 44.264 21.957 16.991 1.00 25.80 O ATOM 2313 HA TYR A 151 45.705 16.128 18.807 1.00 0.00 H ATOM 2314 HB3 TYR A 151 42.724 16.193 18.318 1.00 0.00 H ATOM 2315 HB2 TYR A 151 43.956 15.850 17.081 1.00 0.00 H ATOM 2316 HD2 TYR A 151 42.426 18.472 19.201 1.00 0.00 H ATOM 2317 HE2 TYR A 151 42.653 20.896 18.754 1.00 0.00 H ATOM 2318 HE1 TYR A 151 45.615 20.081 15.773 1.00 0.00 H ATOM 2319 HD1 TYR A 151 45.384 17.646 16.197 1.00 0.00 H ATOM 2320 HH TYR A 151 44.556 22.413 17.820 1.00 0.00 H ATOM 2321 H TYR A 151 43.768 13.924 18.737 1.00 0.00 H ATOM 2322 N ILE A 152 43.201 16.161 20.991 1.00 29.01 N ATOM 2323 CA ILE A 152 42.801 16.702 22.301 1.00 30.34 C ATOM 2324 C ILE A 152 43.316 15.872 23.481 1.00 31.42 C ATOM 2325 O ILE A 152 43.271 16.317 24.630 1.00 33.55 O ATOM 2326 CB ILE A 152 41.270 16.899 22.401 1.00 28.96 C ATOM 2327 CG1 ILE A 152 40.544 15.559 22.436 1.00 27.67 C ATOM 2328 CG2 ILE A 152 40.753 17.739 21.239 1.00 27.55 C ATOM 2329 CD1 ILE A 152 39.014 15.699 22.450 1.00 27.72 C ATOM 2330 HA ILE A 152 43.278 17.679 22.369 1.00 0.00 H ATOM 2331 HB ILE A 152 41.068 17.427 23.333 1.00 0.00 H ATOM 2332 HG12 ILE A 152 40.832 14.986 21.555 1.00 0.00 H ATOM 2333 HG13 ILE A 152 40.851 15.022 23.333 1.00 0.00 H ATOM 2334 HD11 ILE A 152 38.710 16.262 23.333 1.00 0.00 H ATOM 2335 HD12 ILE A 152 38.690 16.226 21.552 1.00 0.00 H ATOM 2336 HD13 ILE A 152 38.560 14.708 22.475 1.00 0.00 H ATOM 2337 HG21 ILE A 152 41.235 18.717 21.256 1.00 0.00 H ATOM 2338 HG22 ILE A 152 40.982 17.237 20.299 1.00 0.00 H ATOM 2339 HG23 ILE A 152 39.674 17.862 21.333 1.00 0.00 H ATOM 2340 H ILE A 152 42.546 15.546 20.468 1.00 0.00 H ATOM 2341 N GLY A 153 43.805 14.668 23.192 1.00 31.30 N ATOM 2342 CA GLY A 153 44.440 13.821 24.199 1.00 30.75 C ATOM 2343 C GLY A 153 43.527 13.134 25.194 1.00 31.41 C ATOM 2344 O GLY A 153 43.794 13.166 26.389 1.00 31.76 O ATOM 2345 HA3 GLY A 153 45.133 14.444 24.764 1.00 0.00 H ATOM 2346 HA2 GLY A 153 44.997 13.045 23.673 1.00 0.00 H ATOM 2347 H GLY A 153 43.732 14.318 22.215 1.00 0.00 H ATOM 2348 N VAL A 154 42.456 12.513 24.703 1.00 32.32 N ATOM 2349 CA VAL A 154 41.508 11.765 25.534 1.00 33.24 C ATOM 2350 C VAL A 154 42.228 10.748 26.439 1.00 34.89 C ATOM 2351 O VAL A 154 43.182 10.097 26.006 1.00 34.48 O ATOM 2352 CB VAL A 154 40.433 11.072 24.641 1.00 33.05 C ATOM 2353 CG1 VAL A 154 39.503 10.186 25.455 1.00 33.53 C ATOM 2354 CG2 VAL A 154 39.624 12.118 23.853 1.00 31.89 C ATOM 2355 HA VAL A 154 41.002 12.473 26.191 1.00 0.00 H ATOM 2356 HB VAL A 154 40.963 10.432 23.936 1.00 0.00 H ATOM 2357 HG11 VAL A 154 40.085 9.410 25.952 1.00 0.00 H ATOM 2358 HG12 VAL A 154 38.988 10.791 26.202 1.00 0.00 H ATOM 2359 HG13 VAL A 154 38.771 9.724 24.792 1.00 0.00 H ATOM 2360 HG21 VAL A 154 39.124 12.790 24.551 1.00 0.00 H ATOM 2361 HG22 VAL A 154 40.297 12.691 23.215 1.00 0.00 H ATOM 2362 HG23 VAL A 154 38.880 11.612 23.237 1.00 0.00 H ATOM 2363 H VAL A 154 42.284 12.561 23.679 1.00 0.00 H ATOM 2364 N PRO A 155 41.786 10.620 27.710 1.00 35.56 N ATOM 2365 CA PRO A 155 42.431 9.673 28.627 1.00 36.79 C ATOM 2366 C PRO A 155 42.403 8.237 28.110 1.00 38.23 C ATOM 2367 O PRO A 155 41.359 7.766 27.647 1.00 37.34 O ATOM 2368 CB PRO A 155 41.579 9.773 29.899 1.00 36.60 C ATOM 2369 CG PRO A 155 40.912 11.098 29.819 1.00 37.44 C ATOM 2370 CD PRO A 155 40.679 11.348 28.358 1.00 35.54 C ATOM 2371 HA PRO A 155 43.485 9.913 28.767 1.00 0.00 H ATOM 2372 HD3 PRO A 155 39.713 10.953 28.043 1.00 0.00 H ATOM 2373 HD2 PRO A 155 40.726 12.413 28.131 1.00 0.00 H ATOM 2374 HG3 PRO A 155 41.553 11.873 30.240 1.00 0.00 H ATOM 2375 HG2 PRO A 155 39.965 11.080 30.358 1.00 0.00 H ATOM 2376 HB2 PRO A 155 40.839 8.973 29.927 1.00 0.00 H ATOM 2377 HB3 PRO A 155 42.209 9.715 30.787 1.00 0.00 H ATOM 2378 N LYS A 156 43.542 7.552 28.196 1.00 40.57 N ATOM 2379 CA LYS A 156 43.639 6.155 27.762 1.00 43.84 C ATOM 2380 C LYS A 156 43.537 5.207 28.956 1.00 45.74 C ATOM 2381 O LYS A 156 43.298 4.015 28.791 1.00 46.69 O ATOM 2382 CB LYS A 156 44.926 5.914 26.963 1.00 43.89 C ATOM 2383 CG LYS A 156 44.986 6.720 25.665 1.00 45.05 C ATOM 2384 CD LYS A 156 46.194 6.382 24.789 1.00 45.72 C ATOM 2385 CE LYS A 156 47.515 6.688 25.480 1.00 47.12 C ATOM 2386 NZ LYS A 156 47.685 8.105 25.914 1.00 47.07 N ATOM 2387 HA LYS A 156 42.799 5.946 27.100 1.00 0.00 H ATOM 2388 HB2 LYS A 156 45.777 6.192 27.584 1.00 0.00 H ATOM 2389 HB3 LYS A 156 44.988 4.854 26.717 1.00 0.00 H ATOM 2390 HG2 LYS A 156 44.079 6.521 25.094 1.00 0.00 H ATOM 2391 HG3 LYS A 156 45.029 7.779 25.919 1.00 0.00 H ATOM 2392 HD2 LYS A 156 46.164 5.320 24.545 1.00 0.00 H ATOM 2393 HD3 LYS A 156 46.135 6.966 23.871 1.00 0.00 H ATOM 2394 HE2 LYS A 156 48.323 6.446 24.789 1.00 0.00 H ATOM 2395 HE3 LYS A 156 47.591 6.052 26.362 1.00 0.00 H ATOM 2396 HZ1 LYS A 156 47.630 8.729 25.084 1.00 0.00 H ATOM 2397 HZ2 LYS A 156 46.931 8.353 26.586 1.00 0.00 H ATOM 2398 HZ3 LYS A 156 48.612 8.217 26.373 1.00 0.00 H ATOM 2399 H LYS A 156 44.386 8.021 28.582 1.00 0.00 H ATOM 2400 N GLY A 157 43.716 5.752 30.156 1.00 47.17 N ATOM 2401 CA GLY A 157 43.569 4.982 31.387 1.00 48.50 C ATOM 2402 C GLY A 157 42.300 5.373 32.123 1.00 49.51 C ATOM 2403 O GLY A 157 41.268 5.644 31.503 1.00 50.58 O ATOM 2404 HA3 GLY A 157 44.428 5.171 32.031 1.00 0.00 H ATOM 2405 HA2 GLY A 157 43.527 3.921 31.142 1.00 0.00 H ATOM 2406 H GLY A 157 43.969 6.759 30.219 1.00 0.00 H ATOM 2407 N ASP A 158 42.370 5.406 33.447 1.00 49.82 N ATOM 2408 CA ASP A 158 41.205 5.755 34.253 1.00 51.11 C ATOM 2409 C ASP A 158 41.373 7.075 35.010 1.00 50.10 C ATOM 2410 O ASP A 158 40.493 7.470 35.778 1.00 50.08 O ATOM 2411 CB ASP A 158 40.838 4.608 35.202 1.00 53.85 C ATOM 2412 CG ASP A 158 42.054 3.859 35.709 1.00 56.19 C ATOM 2413 OD1 ASP A 158 43.168 4.436 35.700 1.00 58.25 O ATOM 2414 OD2 ASP A 158 41.894 2.689 36.118 1.00 56.95 O ATOM 2415 HA ASP A 158 40.378 5.910 33.560 1.00 0.00 H ATOM 2416 HB2 ASP A 158 40.300 5.020 36.056 1.00 0.00 H ATOM 2417 HB3 ASP A 158 40.193 3.908 34.671 1.00 0.00 H ATOM 2418 H ASP A 158 43.269 5.180 33.918 1.00 0.00 H ATOM 2419 N GLU A 159 42.497 7.754 34.792 1.00 46.85 N ATOM 2420 CA GLU A 159 42.686 9.085 35.343 1.00 45.53 C ATOM 2421 C GLU A 159 41.983 10.093 34.423 1.00 43.15 C ATOM 2422 O GLU A 159 42.077 9.988 33.194 1.00 40.87 O ATOM 2423 CB GLU A 159 44.169 9.410 35.499 1.00 47.25 C ATOM 2424 CG GLU A 159 44.887 8.536 36.520 1.00 50.12 C ATOM 2425 CD GLU A 159 46.374 8.829 36.591 1.00 51.82 C ATOM 2426 OE1 GLU A 159 46.903 9.478 35.662 1.00 53.85 O ATOM 2427 OE2 GLU A 159 47.021 8.411 37.575 1.00 53.53 O ATOM 2428 HA GLU A 159 42.249 9.138 36.340 1.00 0.00 H ATOM 2429 HB2 GLU A 159 44.654 9.277 34.532 1.00 0.00 H ATOM 2430 HB3 GLU A 159 44.262 10.450 35.811 1.00 0.00 H ATOM 2431 HG2 GLU A 159 44.448 8.713 37.502 1.00 0.00 H ATOM 2432 HG3 GLU A 159 44.749 7.490 36.244 1.00 0.00 H ATOM 2433 H GLU A 159 43.251 7.325 34.219 1.00 0.00 H ATOM 2434 N PRO A 160 41.273 11.071 35.015 1.00 40.70 N ATOM 2435 CA PRO A 160 40.456 12.033 34.270 1.00 39.75 C ATOM 2436 C PRO A 160 41.292 13.177 33.699 1.00 38.80 C ATOM 2437 O PRO A 160 40.910 14.340 33.804 1.00 38.95 O ATOM 2438 CB PRO A 160 39.491 12.556 35.333 1.00 39.49 C ATOM 2439 CG PRO A 160 40.258 12.462 36.606 1.00 39.96 C ATOM 2440 CD PRO A 160 41.232 11.320 36.469 1.00 40.27 C ATOM 2441 HA PRO A 160 39.965 11.582 33.408 1.00 0.00 H ATOM 2442 HD3 PRO A 160 42.216 11.600 36.844 1.00 0.00 H ATOM 2443 HD2 PRO A 160 40.878 10.440 37.005 1.00 0.00 H ATOM 2444 HG3 PRO A 160 39.578 12.273 37.437 1.00 0.00 H ATOM 2445 HG2 PRO A 160 40.798 13.392 36.784 1.00 0.00 H ATOM 2446 HB2 PRO A 160 39.211 13.589 35.126 1.00 0.00 H ATOM 2447 HB3 PRO A 160 38.593 11.939 35.377 1.00 0.00 H ATOM 2448 N ILE A 161 42.416 12.824 33.087 1.00 37.83 N ATOM 2449 CA ILE A 161 43.411 13.780 32.631 1.00 38.89 C ATOM 2450 C ILE A 161 43.580 13.748 31.115 1.00 38.66 C ATOM 2451 O ILE A 161 43.780 12.683 30.540 1.00 39.23 O ATOM 2452 CB ILE A 161 44.773 13.462 33.278 1.00 39.70 C ATOM 2453 CG1 ILE A 161 44.686 13.671 34.785 1.00 41.58 C ATOM 2454 CG2 ILE A 161 45.881 14.317 32.679 1.00 40.84 C ATOM 2455 CD1 ILE A 161 44.044 14.990 35.145 1.00 43.15 C ATOM 2456 HA ILE A 161 43.064 14.771 32.922 1.00 0.00 H ATOM 2457 HB ILE A 161 45.018 12.419 33.076 1.00 0.00 H ATOM 2458 HG12 ILE A 161 44.095 12.864 35.218 1.00 0.00 H ATOM 2459 HG13 ILE A 161 45.693 13.646 35.201 1.00 0.00 H ATOM 2460 HD11 ILE A 161 44.632 15.806 34.724 1.00 0.00 H ATOM 2461 HD12 ILE A 161 43.032 15.023 34.740 1.00 0.00 H ATOM 2462 HD13 ILE A 161 44.006 15.090 36.230 1.00 0.00 H ATOM 2463 HG21 ILE A 161 45.950 14.122 31.609 1.00 0.00 H ATOM 2464 HG22 ILE A 161 45.655 15.370 32.844 1.00 0.00 H ATOM 2465 HG23 ILE A 161 46.829 14.068 33.157 1.00 0.00 H ATOM 2466 H ILE A 161 42.593 11.812 32.926 1.00 0.00 H ATOM 2467 N LEU A 162 43.500 14.917 30.483 1.00 36.46 N ATOM 2468 CA LEU A 162 43.715 15.038 29.047 1.00 35.88 C ATOM 2469 C LEU A 162 45.162 15.400 28.755 1.00 36.97 C ATOM 2470 O LEU A 162 45.817 16.060 29.561 1.00 36.55 O ATOM 2471 CB LEU A 162 42.797 16.097 28.453 1.00 34.71 C ATOM 2472 CG LEU A 162 41.288 15.901 28.597 1.00 34.41 C ATOM 2473 CD1 LEU A 162 40.561 17.199 28.323 1.00 33.37 C ATOM 2474 CD2 LEU A 162 40.792 14.820 27.666 1.00 35.46 C ATOM 2475 HA LEU A 162 43.487 14.075 28.591 1.00 0.00 H ATOM 2476 HB2 LEU A 162 43.048 17.046 28.927 1.00 0.00 H ATOM 2477 HB3 LEU A 162 43.016 16.155 27.387 1.00 0.00 H ATOM 2478 HG LEU A 162 41.083 15.590 29.621 1.00 0.00 H ATOM 2479 HD21 LEU A 162 41.012 15.100 26.636 1.00 0.00 H ATOM 2480 HD22 LEU A 162 41.292 13.881 27.903 1.00 0.00 H ATOM 2481 HD23 LEU A 162 39.715 14.702 27.789 1.00 0.00 H ATOM 2482 HD11 LEU A 162 40.891 17.956 29.034 1.00 0.00 H ATOM 2483 HD12 LEU A 162 40.782 17.531 27.308 1.00 0.00 H ATOM 2484 HD13 LEU A 162 39.488 17.042 28.430 1.00 0.00 H ATOM 2485 H LEU A 162 43.277 15.772 31.032 1.00 0.00 H ATOM 2486 N LYS A 163 45.658 14.966 27.598 1.00 38.17 N ATOM 2487 CA LYS A 163 47.034 15.247 27.203 1.00 39.44 C ATOM 2488 C LYS A 163 47.100 15.725 25.745 1.00 38.65 C ATOM 2489 O LYS A 163 47.457 14.955 24.853 1.00 37.90 O ATOM 2490 CB LYS A 163 47.888 13.993 27.413 1.00 42.26 C ATOM 2491 CG LYS A 163 49.389 14.244 27.569 1.00 46.06 C ATOM 2492 CD LYS A 163 50.156 13.982 26.284 1.00 48.11 C ATOM 2493 CE LYS A 163 51.661 13.964 26.527 1.00 49.93 C ATOM 2494 NZ LYS A 163 52.196 15.316 26.884 1.00 51.23 N ATOM 2495 HA LYS A 163 47.428 16.051 27.825 1.00 0.00 H ATOM 2496 HB2 LYS A 163 47.535 13.491 28.314 1.00 0.00 H ATOM 2497 HB3 LYS A 163 47.743 13.338 26.554 1.00 0.00 H ATOM 2498 HG2 LYS A 163 49.542 15.282 27.863 1.00 0.00 H ATOM 2499 HG3 LYS A 163 49.775 13.587 28.348 1.00 0.00 H ATOM 2500 HD2 LYS A 163 49.850 13.017 25.879 1.00 0.00 H ATOM 2501 HD3 LYS A 163 49.922 14.767 25.565 1.00 0.00 H ATOM 2502 HE2 LYS A 163 52.158 13.618 25.621 1.00 0.00 H ATOM 2503 HE3 LYS A 163 51.876 13.275 27.344 1.00 0.00 H ATOM 2504 HZ1 LYS A 163 52.003 15.980 26.107 1.00 0.00 H ATOM 2505 HZ2 LYS A 163 51.733 15.652 27.753 1.00 0.00 H ATOM 2506 HZ3 LYS A 163 53.222 15.251 27.039 1.00 0.00 H ATOM 2507 H LYS A 163 45.050 14.413 26.961 1.00 0.00 H ATOM 2508 N PRO A 164 46.751 17.005 25.503 1.00 37.45 N ATOM 2509 CA PRO A 164 46.716 17.578 24.158 1.00 36.06 C ATOM 2510 C PRO A 164 48.052 17.474 23.441 1.00 35.44 C ATOM 2511 O PRO A 164 49.107 17.597 24.067 1.00 34.50 O ATOM 2512 CB PRO A 164 46.381 19.053 24.408 1.00 36.24 C ATOM 2513 CG PRO A 164 46.655 19.285 25.860 1.00 36.00 C ATOM 2514 CD PRO A 164 46.364 17.990 26.525 1.00 36.49 C ATOM 2515 HA PRO A 164 46.003 17.055 23.521 1.00 0.00 H ATOM 2516 HD3 PRO A 164 46.959 17.871 27.431 1.00 0.00 H ATOM 2517 HD2 PRO A 164 45.306 17.904 26.773 1.00 0.00 H ATOM 2518 HG3 PRO A 164 46.007 20.069 26.251 1.00 0.00 H ATOM 2519 HG2 PRO A 164 47.697 19.567 26.012 1.00 0.00 H ATOM 2520 HB2 PRO A 164 47.011 19.696 23.794 1.00 0.00 H ATOM 2521 HB3 PRO A 164 45.333 19.250 24.182 1.00 0.00 H ATOM 2522 N SER A 165 48.007 17.246 22.134 1.00 34.33 N ATOM 2523 CA SER A 165 49.238 17.179 21.359 1.00 33.29 C ATOM 2524 C SER A 165 49.938 18.528 21.424 1.00 31.83 C ATOM 2525 O SER A 165 49.318 19.554 21.710 1.00 30.38 O ATOM 2526 CB SER A 165 48.957 16.795 19.902 1.00 32.62 C ATOM 2527 OG SER A 165 48.231 17.809 19.219 1.00 32.39 O ATOM 2528 HA SER A 165 49.881 16.408 21.784 1.00 0.00 H ATOM 2529 HB2 SER A 165 48.376 15.873 19.886 1.00 0.00 H ATOM 2530 HB3 SER A 165 49.906 16.634 19.390 1.00 0.00 H ATOM 2531 HG SER A 165 48.070 17.525 18.284 1.00 0.00 H ATOM 2532 H SER A 165 47.090 17.115 21.662 1.00 0.00 H ATOM 2533 N LEU A 166 51.237 18.525 21.172 1.00 32.68 N ATOM 2534 CA LEU A 166 51.979 19.767 21.084 1.00 32.89 C ATOM 2535 C LEU A 166 51.348 20.644 19.994 1.00 32.24 C ATOM 2536 O LEU A 166 51.230 21.855 20.159 1.00 32.01 O ATOM 2537 CB LEU A 166 53.448 19.481 20.789 1.00 34.50 C ATOM 2538 CG LEU A 166 54.395 20.645 20.526 1.00 36.32 C ATOM 2539 CD1 LEU A 166 54.599 21.502 21.776 1.00 37.48 C ATOM 2540 CD2 LEU A 166 55.718 20.092 20.024 1.00 37.33 C ATOM 2541 HA LEU A 166 51.934 20.300 22.034 1.00 0.00 H ATOM 2542 HB2 LEU A 166 53.844 18.935 21.645 1.00 0.00 H ATOM 2543 HB3 LEU A 166 53.477 18.841 19.907 1.00 0.00 H ATOM 2544 HG LEU A 166 53.956 21.296 19.770 1.00 0.00 H ATOM 2545 HD21 LEU A 166 56.144 19.431 20.779 1.00 0.00 H ATOM 2546 HD22 LEU A 166 55.551 19.534 19.103 1.00 0.00 H ATOM 2547 HD23 LEU A 166 56.405 20.916 19.832 1.00 0.00 H ATOM 2548 HD11 LEU A 166 53.639 21.906 22.099 1.00 0.00 H ATOM 2549 HD12 LEU A 166 55.022 20.888 22.571 1.00 0.00 H ATOM 2550 HD13 LEU A 166 55.281 22.321 21.546 1.00 0.00 H ATOM 2551 H LEU A 166 51.732 17.620 21.035 1.00 0.00 H ATOM 2552 N PHE A 167 50.915 20.026 18.896 1.00 30.87 N ATOM 2553 CA PHE A 167 50.294 20.771 17.801 1.00 30.57 C ATOM 2554 C PHE A 167 49.018 21.496 18.253 1.00 29.84 C ATOM 2555 O PHE A 167 48.824 22.671 17.945 1.00 29.54 O ATOM 2556 CB PHE A 167 50.013 19.860 16.597 1.00 30.15 C ATOM 2557 CG PHE A 167 49.421 20.586 15.412 1.00 30.18 C ATOM 2558 CD1 PHE A 167 50.136 21.577 14.762 1.00 30.40 C ATOM 2559 CD2 PHE A 167 48.150 20.277 14.956 1.00 30.16 C ATOM 2560 CE1 PHE A 167 49.592 22.249 13.674 1.00 30.48 C ATOM 2561 CE2 PHE A 167 47.603 20.939 13.872 1.00 29.52 C ATOM 2562 CZ PHE A 167 48.322 21.925 13.231 1.00 29.62 C ATOM 2563 HA PHE A 167 51.007 21.534 17.488 1.00 0.00 H ATOM 2564 HB2 PHE A 167 50.951 19.401 16.286 1.00 0.00 H ATOM 2565 HB3 PHE A 167 49.315 19.083 16.909 1.00 0.00 H ATOM 2566 HD2 PHE A 167 47.573 19.501 15.459 1.00 0.00 H ATOM 2567 HE2 PHE A 167 46.603 20.681 13.524 1.00 0.00 H ATOM 2568 HZ PHE A 167 47.891 22.448 12.377 1.00 0.00 H ATOM 2569 HE1 PHE A 167 50.164 23.029 13.171 1.00 0.00 H ATOM 2570 HD1 PHE A 167 51.137 21.833 15.108 1.00 0.00 H ATOM 2571 H PHE A 167 51.021 18.994 18.816 1.00 0.00 H ATOM 2572 N ALA A 168 48.167 20.793 18.993 1.00 29.24 N ATOM 2573 CA ALA A 168 46.920 21.356 19.510 1.00 29.40 C ATOM 2574 C ALA A 168 47.160 22.557 20.421 1.00 28.85 C ATOM 2575 O ALA A 168 46.428 23.545 20.360 1.00 28.04 O ATOM 2576 CB ALA A 168 46.134 20.288 20.250 1.00 29.46 C ATOM 2577 HA ALA A 168 46.344 21.709 18.655 1.00 0.00 H ATOM 2578 HB1 ALA A 168 45.903 19.470 19.567 1.00 0.00 H ATOM 2579 HB2 ALA A 168 46.729 19.911 21.082 1.00 0.00 H ATOM 2580 HB3 ALA A 168 45.208 20.719 20.630 1.00 0.00 H ATOM 2581 H ALA A 168 48.397 19.803 19.213 1.00 0.00 H ATOM 2582 N TYR A 169 48.193 22.456 21.257 1.00 30.52 N ATOM 2583 CA TYR A 169 48.553 23.499 22.211 1.00 30.35 C ATOM 2584 C TYR A 169 49.023 24.776 21.516 1.00 31.47 C ATOM 2585 O TYR A 169 48.601 25.873 21.871 1.00 30.65 O ATOM 2586 CB TYR A 169 49.638 22.998 23.181 1.00 29.39 C ATOM 2587 CG TYR A 169 49.900 23.951 24.334 1.00 29.44 C ATOM 2588 CD1 TYR A 169 49.115 23.910 25.485 1.00 30.91 C ATOM 2589 CD2 TYR A 169 50.918 24.896 24.272 1.00 29.67 C ATOM 2590 CE1 TYR A 169 49.336 24.781 26.540 1.00 29.47 C ATOM 2591 CE2 TYR A 169 51.151 25.779 25.332 1.00 29.47 C ATOM 2592 CZ TYR A 169 50.355 25.709 26.461 1.00 29.82 C ATOM 2593 OH TYR A 169 50.566 26.568 27.514 1.00 28.45 O ATOM 2594 HA TYR A 169 47.652 23.740 22.775 1.00 0.00 H ATOM 2595 HB3 TYR A 169 50.566 22.865 22.624 1.00 0.00 H ATOM 2596 HB2 TYR A 169 49.321 22.039 23.590 1.00 0.00 H ATOM 2597 HD2 TYR A 169 51.545 24.950 23.382 1.00 0.00 H ATOM 2598 HE2 TYR A 169 51.952 26.515 25.269 1.00 0.00 H ATOM 2599 HE1 TYR A 169 48.707 24.734 27.429 1.00 0.00 H ATOM 2600 HD1 TYR A 169 48.311 23.178 25.557 1.00 0.00 H ATOM 2601 HH TYR A 169 49.910 26.377 28.230 1.00 0.00 H ATOM 2602 H TYR A 169 48.770 21.592 21.228 1.00 0.00 H ATOM 2603 N ILE A 170 49.909 24.621 20.533 1.00 31.87 N ATOM 2604 CA ILE A 170 50.457 25.749 19.791 1.00 31.44 C ATOM 2605 C ILE A 170 49.368 26.437 18.974 1.00 31.14 C ATOM 2606 O ILE A 170 49.319 27.665 18.883 1.00 33.18 O ATOM 2607 CB ILE A 170 51.622 25.287 18.886 1.00 33.14 C ATOM 2608 CG1 ILE A 170 52.792 24.819 19.757 1.00 32.87 C ATOM 2609 CG2 ILE A 170 52.050 26.404 17.931 1.00 32.79 C ATOM 2610 CD1 ILE A 170 53.899 24.121 18.995 1.00 35.56 C ATOM 2611 HA ILE A 170 50.849 26.474 20.504 1.00 0.00 H ATOM 2612 HB ILE A 170 51.287 24.451 18.273 1.00 0.00 H ATOM 2613 HG12 ILE A 170 53.217 25.691 20.254 1.00 0.00 H ATOM 2614 HG13 ILE A 170 52.405 24.128 20.506 1.00 0.00 H ATOM 2615 HD11 ILE A 170 53.496 23.237 18.500 1.00 0.00 H ATOM 2616 HD12 ILE A 170 54.309 24.801 18.249 1.00 0.00 H ATOM 2617 HD13 ILE A 170 54.685 23.824 19.689 1.00 0.00 H ATOM 2618 HG21 ILE A 170 51.206 26.684 17.300 1.00 0.00 H ATOM 2619 HG22 ILE A 170 52.377 27.269 18.509 1.00 0.00 H ATOM 2620 HG23 ILE A 170 52.871 26.052 17.306 1.00 0.00 H ATOM 2621 H ILE A 170 50.221 23.660 20.286 1.00 0.00 H ATOM 2622 N VAL A 171 48.486 25.635 18.393 1.00 30.48 N ATOM 2623 CA VAL A 171 47.356 26.149 17.632 1.00 28.92 C ATOM 2624 C VAL A 171 46.382 26.920 18.539 1.00 28.91 C ATOM 2625 O VAL A 171 45.718 27.869 18.095 1.00 28.32 O ATOM 2626 CB VAL A 171 46.642 25.009 16.876 1.00 27.77 C ATOM 2627 CG1 VAL A 171 45.384 25.506 16.204 1.00 27.42 C ATOM 2628 CG2 VAL A 171 47.580 24.403 15.833 1.00 29.48 C ATOM 2629 HA VAL A 171 47.737 26.852 16.891 1.00 0.00 H ATOM 2630 HB VAL A 171 46.365 24.245 17.602 1.00 0.00 H ATOM 2631 HG11 VAL A 171 44.704 25.905 16.957 1.00 0.00 H ATOM 2632 HG12 VAL A 171 45.640 26.291 15.492 1.00 0.00 H ATOM 2633 HG13 VAL A 171 44.903 24.680 15.680 1.00 0.00 H ATOM 2634 HG21 VAL A 171 47.877 25.174 15.122 1.00 0.00 H ATOM 2635 HG22 VAL A 171 48.465 24.005 16.330 1.00 0.00 H ATOM 2636 HG23 VAL A 171 47.065 23.600 15.306 1.00 0.00 H ATOM 2637 H VAL A 171 48.605 24.606 18.484 1.00 0.00 H ATOM 2638 N PHE A 172 46.292 26.523 19.807 1.00 28.03 N ATOM 2639 CA PHE A 172 45.469 27.287 20.749 1.00 27.96 C ATOM 2640 C PHE A 172 46.080 28.668 20.925 1.00 27.71 C ATOM 2641 O PHE A 172 45.385 29.675 20.842 1.00 29.29 O ATOM 2642 CB PHE A 172 45.292 26.579 22.109 1.00 27.62 C ATOM 2643 CG PHE A 172 44.481 27.383 23.103 1.00 26.29 C ATOM 2644 CD1 PHE A 172 43.185 27.747 22.816 1.00 25.53 C ATOM 2645 CD2 PHE A 172 45.026 27.779 24.312 1.00 27.67 C ATOM 2646 CE1 PHE A 172 42.430 28.498 23.715 1.00 27.53 C ATOM 2647 CE2 PHE A 172 44.272 28.530 25.225 1.00 27.51 C ATOM 2648 CZ PHE A 172 42.972 28.885 24.919 1.00 24.20 C ATOM 2649 HA PHE A 172 44.466 27.372 20.330 1.00 0.00 H ATOM 2650 HB2 PHE A 172 44.788 25.627 21.941 1.00 0.00 H ATOM 2651 HB3 PHE A 172 46.279 26.396 22.535 1.00 0.00 H ATOM 2652 HD2 PHE A 172 46.052 27.504 24.557 1.00 0.00 H ATOM 2653 HE2 PHE A 172 44.711 28.834 26.175 1.00 0.00 H ATOM 2654 HZ PHE A 172 42.381 29.467 25.626 1.00 0.00 H ATOM 2655 HE1 PHE A 172 41.407 28.780 23.464 1.00 0.00 H ATOM 2656 HD1 PHE A 172 42.741 27.442 21.868 1.00 0.00 H ATOM 2657 H PHE A 172 46.803 25.676 20.127 1.00 0.00 H ATOM 2658 N LEU A 173 47.386 28.704 21.161 1.00 29.95 N ATOM 2659 CA LEU A 173 48.132 29.960 21.253 1.00 32.24 C ATOM 2660 C LEU A 173 47.968 30.853 20.023 1.00 31.76 C ATOM 2661 O LEU A 173 47.821 32.064 20.152 1.00 32.70 O ATOM 2662 CB LEU A 173 49.615 29.684 21.488 1.00 34.08 C ATOM 2663 CG LEU A 173 50.063 29.703 22.945 1.00 37.55 C ATOM 2664 CD1 LEU A 173 51.391 28.970 23.120 1.00 39.17 C ATOM 2665 CD2 LEU A 173 50.166 31.153 23.426 1.00 39.12 C ATOM 2666 HA LEU A 173 47.711 30.500 22.101 1.00 0.00 H ATOM 2667 HB2 LEU A 173 49.843 28.700 21.079 1.00 0.00 H ATOM 2668 HB3 LEU A 173 50.187 30.440 20.951 1.00 0.00 H ATOM 2669 HG LEU A 173 49.323 29.180 23.551 1.00 0.00 H ATOM 2670 HD21 LEU A 173 50.893 31.687 22.814 1.00 0.00 H ATOM 2671 HD22 LEU A 173 49.192 31.634 23.338 1.00 0.00 H ATOM 2672 HD23 LEU A 173 50.486 31.167 24.468 1.00 0.00 H ATOM 2673 HD11 LEU A 173 51.277 27.933 22.803 1.00 0.00 H ATOM 2674 HD12 LEU A 173 52.155 29.455 22.513 1.00 0.00 H ATOM 2675 HD13 LEU A 173 51.686 29.000 24.169 1.00 0.00 H ATOM 2676 H LEU A 173 47.898 27.807 21.285 1.00 0.00 H ATOM 2677 N ILE A 174 47.996 30.251 18.839 1.00 31.83 N ATOM 2678 CA ILE A 174 47.817 30.985 17.589 1.00 30.71 C ATOM 2679 C ILE A 174 46.394 31.529 17.501 1.00 29.74 C ATOM 2680 O ILE A 174 46.177 32.678 17.123 1.00 29.48 O ATOM 2681 CB ILE A 174 48.136 30.081 16.371 1.00 30.41 C ATOM 2682 CG1 ILE A 174 49.628 29.745 16.351 1.00 30.82 C ATOM 2683 CG2 ILE A 174 47.719 30.748 15.069 1.00 29.20 C ATOM 2684 CD1 ILE A 174 50.000 28.624 15.400 1.00 31.20 C ATOM 2685 HA ILE A 174 48.512 31.824 17.575 1.00 0.00 H ATOM 2686 HB ILE A 174 47.565 29.157 16.467 1.00 0.00 H ATOM 2687 HG12 ILE A 174 50.176 30.640 16.056 1.00 0.00 H ATOM 2688 HG13 ILE A 174 49.926 29.453 17.358 1.00 0.00 H ATOM 2689 HD11 ILE A 174 49.471 27.715 15.687 1.00 0.00 H ATOM 2690 HD12 ILE A 174 49.721 28.903 14.384 1.00 0.00 H ATOM 2691 HD13 ILE A 174 51.075 28.450 15.448 1.00 0.00 H ATOM 2692 HG21 ILE A 174 46.646 30.942 15.089 1.00 0.00 H ATOM 2693 HG22 ILE A 174 48.257 31.689 14.956 1.00 0.00 H ATOM 2694 HG23 ILE A 174 47.955 30.090 14.233 1.00 0.00 H ATOM 2695 H ILE A 174 48.150 29.223 18.801 1.00 0.00 H ATOM 2696 N THR A 175 45.424 30.695 17.860 1.00 29.82 N ATOM 2697 CA THR A 175 44.026 31.107 17.885 1.00 27.85 C ATOM 2698 C THR A 175 43.834 32.305 18.816 1.00 28.61 C ATOM 2699 O THR A 175 43.126 33.257 18.478 1.00 26.93 O ATOM 2700 CB THR A 175 43.126 29.948 18.332 1.00 28.04 C ATOM 2701 OG1 THR A 175 43.261 28.867 17.403 1.00 28.81 O ATOM 2702 CG2 THR A 175 41.667 30.374 18.392 1.00 26.31 C ATOM 2703 HA THR A 175 43.743 31.399 16.874 1.00 0.00 H ATOM 2704 HB THR A 175 43.434 29.637 19.330 1.00 0.00 H ATOM 2705 HG1 THR A 175 44.205 28.568 17.381 1.00 0.00 H ATOM 2706 HG23 THR A 175 41.559 31.197 19.098 1.00 0.00 H ATOM 2707 HG21 THR A 175 41.343 30.697 17.403 1.00 0.00 H ATOM 2708 HG22 THR A 175 41.057 29.532 18.718 1.00 0.00 H ATOM 2709 H THR A 175 45.669 29.721 18.131 1.00 0.00 H ATOM 2710 N MET A 176 44.471 32.256 19.985 1.00 28.68 N ATOM 2711 CA MET A 176 44.387 33.359 20.931 1.00 31.48 C ATOM 2712 C MET A 176 45.004 34.596 20.284 1.00 32.18 C ATOM 2713 O MET A 176 44.447 35.685 20.362 1.00 32.87 O ATOM 2714 CB MET A 176 45.090 33.029 22.254 1.00 31.24 C ATOM 2715 CG MET A 176 44.310 32.083 23.185 1.00 32.49 C ATOM 2716 SD MET A 176 42.656 32.660 23.672 1.00 36.80 S ATOM 2717 CE MET A 176 42.989 34.292 24.322 1.00 34.34 C ATOM 2718 HA MET A 176 43.340 33.544 21.172 1.00 0.00 H ATOM 2719 HB2 MET A 176 46.047 32.562 22.022 1.00 0.00 H ATOM 2720 HB3 MET A 176 45.263 33.963 22.788 1.00 0.00 H ATOM 2721 HG2 MET A 176 44.898 31.942 24.092 1.00 0.00 H ATOM 2722 HG3 MET A 176 44.196 31.126 22.675 1.00 0.00 H ATOM 2723 HE1 MET A 176 43.675 34.213 25.166 1.00 0.00 H ATOM 2724 HE2 MET A 176 43.439 34.907 23.543 1.00 0.00 H ATOM 2725 HE3 MET A 176 42.056 34.748 24.652 1.00 0.00 H ATOM 2726 H MET A 176 45.037 31.417 20.225 1.00 0.00 H ATOM 2727 N PHE A 177 46.149 34.408 19.638 1.00 32.01 N ATOM 2728 CA PHE A 177 46.826 35.497 18.939 1.00 34.15 C ATOM 2729 C PHE A 177 45.938 36.146 17.877 1.00 32.26 C ATOM 2730 O PHE A 177 45.931 37.365 17.732 1.00 32.79 O ATOM 2731 CB PHE A 177 48.132 35.014 18.296 1.00 34.88 C ATOM 2732 CG PHE A 177 48.839 36.080 17.502 1.00 37.98 C ATOM 2733 CD1 PHE A 177 49.560 37.081 18.149 1.00 39.24 C ATOM 2734 CD2 PHE A 177 48.782 36.086 16.114 1.00 38.14 C ATOM 2735 CE1 PHE A 177 50.213 38.074 17.426 1.00 40.46 C ATOM 2736 CE2 PHE A 177 49.427 37.072 15.380 1.00 40.13 C ATOM 2737 CZ PHE A 177 50.147 38.071 16.036 1.00 40.59 C ATOM 2738 HA PHE A 177 47.055 36.251 19.692 1.00 0.00 H ATOM 2739 HB2 PHE A 177 48.800 34.671 19.086 1.00 0.00 H ATOM 2740 HB3 PHE A 177 47.902 34.182 17.630 1.00 0.00 H ATOM 2741 HD2 PHE A 177 48.224 35.307 15.595 1.00 0.00 H ATOM 2742 HE2 PHE A 177 49.371 37.066 14.291 1.00 0.00 H ATOM 2743 HZ PHE A 177 50.656 38.846 15.462 1.00 0.00 H ATOM 2744 HE1 PHE A 177 50.774 38.851 17.946 1.00 0.00 H ATOM 2745 HD1 PHE A 177 49.613 37.086 19.238 1.00 0.00 H ATOM 2746 H PHE A 177 46.575 33.459 19.630 1.00 0.00 H ATOM 2747 N ILE A 178 45.191 35.324 17.144 1.00 30.97 N ATOM 2748 CA ILE A 178 44.324 35.816 16.070 1.00 29.91 C ATOM 2749 C ILE A 178 43.137 36.581 16.632 1.00 30.40 C ATOM 2750 O ILE A 178 42.683 37.573 16.039 1.00 29.00 O ATOM 2751 CB ILE A 178 43.826 34.669 15.170 1.00 30.26 C ATOM 2752 CG1 ILE A 178 45.002 34.042 14.410 1.00 29.61 C ATOM 2753 CG2 ILE A 178 42.754 35.166 14.204 1.00 31.18 C ATOM 2754 CD1 ILE A 178 44.636 32.817 13.599 1.00 29.48 C ATOM 2755 HA ILE A 178 44.925 36.492 15.462 1.00 0.00 H ATOM 2756 HB ILE A 178 43.377 33.902 15.801 1.00 0.00 H ATOM 2757 HG12 ILE A 178 45.410 34.792 13.732 1.00 0.00 H ATOM 2758 HG13 ILE A 178 45.764 33.757 15.135 1.00 0.00 H ATOM 2759 HD11 ILE A 178 44.238 32.049 14.262 1.00 0.00 H ATOM 2760 HD12 ILE A 178 43.883 33.085 12.858 1.00 0.00 H ATOM 2761 HD13 ILE A 178 45.525 32.438 13.095 1.00 0.00 H ATOM 2762 HG21 ILE A 178 41.911 35.561 14.771 1.00 0.00 H ATOM 2763 HG22 ILE A 178 43.170 35.952 13.575 1.00 0.00 H ATOM 2764 HG23 ILE A 178 42.418 34.339 13.579 1.00 0.00 H ATOM 2765 H ILE A 178 45.224 34.303 17.339 1.00 0.00 H ATOM 2766 N ASN A 179 42.626 36.123 17.774 1.00 27.43 N ATOM 2767 CA ASN A 179 41.532 36.835 18.427 1.00 26.81 C ATOM 2768 C ASN A 179 42.006 38.193 18.921 1.00 24.92 C ATOM 2769 O ASN A 179 41.321 39.195 18.747 1.00 26.77 O ATOM 2770 CB ASN A 179 40.912 36.020 19.579 1.00 24.48 C ATOM 2771 CG ASN A 179 39.923 34.990 19.095 1.00 24.61 C ATOM 2772 OD1 ASN A 179 38.705 35.201 19.160 1.00 23.60 O ATOM 2773 ND2 ASN A 179 40.433 33.862 18.595 1.00 24.00 N ATOM 2774 HA ASN A 179 40.748 36.982 17.684 1.00 0.00 H ATOM 2775 HB2 ASN A 179 41.712 35.511 20.116 1.00 0.00 H ATOM 2776 HB3 ASN A 179 40.400 36.705 20.255 1.00 0.00 H ATOM 2777 HD22 ASN A 179 41.464 33.728 18.560 1.00 0.00 H ATOM 2778 HD21 ASN A 179 39.800 33.117 18.240 1.00 0.00 H ATOM 2779 H ASN A 179 43.008 35.255 18.202 1.00 0.00 H ATOM 2780 N VAL A 180 43.188 38.219 19.525 1.00 25.75 N ATOM 2781 CA VAL A 180 43.775 39.456 20.025 1.00 26.57 C ATOM 2782 C VAL A 180 44.023 40.465 18.889 1.00 28.04 C ATOM 2783 O VAL A 180 43.724 41.651 19.033 1.00 27.92 O ATOM 2784 CB VAL A 180 45.101 39.185 20.794 1.00 28.05 C ATOM 2785 CG1 VAL A 180 45.885 40.473 21.005 1.00 27.85 C ATOM 2786 CG2 VAL A 180 44.832 38.488 22.144 1.00 29.00 C ATOM 2787 HA VAL A 180 43.054 39.890 20.718 1.00 0.00 H ATOM 2788 HB VAL A 180 45.704 38.515 20.181 1.00 0.00 H ATOM 2789 HG11 VAL A 180 46.126 40.913 20.037 1.00 0.00 H ATOM 2790 HG12 VAL A 180 45.282 41.173 21.584 1.00 0.00 H ATOM 2791 HG13 VAL A 180 46.806 40.252 21.545 1.00 0.00 H ATOM 2792 HG21 VAL A 180 44.197 39.124 22.760 1.00 0.00 H ATOM 2793 HG22 VAL A 180 44.332 37.536 21.967 1.00 0.00 H ATOM 2794 HG23 VAL A 180 45.778 38.313 22.656 1.00 0.00 H ATOM 2795 H VAL A 180 43.712 37.329 19.645 1.00 0.00 H ATOM 2796 N SER A 181 44.554 39.983 17.765 1.00 28.56 N ATOM 2797 CA SER A 181 44.877 40.844 16.620 1.00 27.88 C ATOM 2798 C SER A 181 43.653 41.589 16.113 1.00 28.57 C ATOM 2799 O SER A 181 43.739 42.745 15.700 1.00 30.82 O ATOM 2800 CB SER A 181 45.502 40.025 15.492 1.00 25.80 C ATOM 2801 OG SER A 181 46.712 39.441 15.926 1.00 24.06 O ATOM 2802 HA SER A 181 45.599 41.585 16.963 1.00 0.00 H ATOM 2803 HB2 SER A 181 45.701 40.677 14.641 1.00 0.00 H ATOM 2804 HB3 SER A 181 44.810 39.239 15.191 1.00 0.00 H ATOM 2805 HG SER A 181 46.532 38.847 16.697 1.00 0.00 H ATOM 2806 H SER A 181 44.746 38.963 17.697 1.00 0.00 H ATOM 2807 N ILE A 182 42.507 40.928 16.143 1.00 28.55 N ATOM 2808 CA ILE A 182 41.281 41.591 15.741 1.00 28.86 C ATOM 2809 C ILE A 182 40.797 42.552 16.849 1.00 31.97 C ATOM 2810 O ILE A 182 40.566 43.738 16.597 1.00 32.34 O ATOM 2811 CB ILE A 182 40.187 40.577 15.389 1.00 29.20 C ATOM 2812 CG1 ILE A 182 40.626 39.737 14.179 1.00 29.36 C ATOM 2813 CG2 ILE A 182 38.863 41.292 15.122 1.00 29.11 C ATOM 2814 CD1 ILE A 182 39.744 38.535 13.902 1.00 30.70 C ATOM 2815 HA ILE A 182 41.494 42.173 14.844 1.00 0.00 H ATOM 2816 HB ILE A 182 40.034 39.905 16.233 1.00 0.00 H ATOM 2817 HG12 ILE A 182 40.618 40.378 13.297 1.00 0.00 H ATOM 2818 HG13 ILE A 182 41.641 39.382 14.359 1.00 0.00 H ATOM 2819 HD11 ILE A 182 39.750 37.874 14.769 1.00 0.00 H ATOM 2820 HD12 ILE A 182 38.726 38.871 13.706 1.00 0.00 H ATOM 2821 HD13 ILE A 182 40.125 37.999 13.033 1.00 0.00 H ATOM 2822 HG21 ILE A 182 38.563 41.843 16.013 1.00 0.00 H ATOM 2823 HG22 ILE A 182 38.987 41.984 14.289 1.00 0.00 H ATOM 2824 HG23 ILE A 182 38.098 40.556 14.874 1.00 0.00 H ATOM 2825 H ILE A 182 42.485 39.936 16.454 1.00 0.00 H ATOM 2826 N LEU A 183 40.663 42.038 18.074 1.00 31.16 N ATOM 2827 CA LEU A 183 40.106 42.807 19.194 1.00 30.17 C ATOM 2828 C LEU A 183 40.895 44.072 19.527 1.00 31.23 C ATOM 2829 O LEU A 183 40.312 45.103 19.882 1.00 29.85 O ATOM 2830 CB LEU A 183 40.004 41.922 20.447 1.00 29.67 C ATOM 2831 CG LEU A 183 38.931 40.833 20.421 1.00 29.24 C ATOM 2832 CD1 LEU A 183 39.129 39.830 21.546 1.00 29.24 C ATOM 2833 CD2 LEU A 183 37.534 41.459 20.482 1.00 30.76 C ATOM 2834 HA LEU A 183 39.116 43.131 18.872 1.00 0.00 H ATOM 2835 HB2 LEU A 183 40.969 41.435 20.589 1.00 0.00 H ATOM 2836 HB3 LEU A 183 39.797 42.572 21.297 1.00 0.00 H ATOM 2837 HG LEU A 183 39.025 40.289 19.481 1.00 0.00 H ATOM 2838 HD21 LEU A 183 37.435 42.034 21.403 1.00 0.00 H ATOM 2839 HD22 LEU A 183 37.394 42.117 19.624 1.00 0.00 H ATOM 2840 HD23 LEU A 183 36.782 40.670 20.463 1.00 0.00 H ATOM 2841 HD11 LEU A 183 40.105 39.356 21.441 1.00 0.00 H ATOM 2842 HD12 LEU A 183 39.075 40.346 22.505 1.00 0.00 H ATOM 2843 HD13 LEU A 183 38.348 39.071 21.496 1.00 0.00 H ATOM 2844 H LEU A 183 40.964 41.057 18.241 1.00 0.00 H ATOM 2845 N ILE A 184 42.215 43.987 19.408 1.00 31.07 N ATOM 2846 CA ILE A 184 43.088 45.072 19.809 1.00 34.25 C ATOM 2847 C ILE A 184 42.939 46.265 18.863 1.00 36.78 C ATOM 2848 O ILE A 184 43.330 47.383 19.205 1.00 37.56 O ATOM 2849 CB ILE A 184 44.565 44.597 19.896 1.00 34.88 C ATOM 2850 CG1 ILE A 184 45.334 45.389 20.961 1.00 36.17 C ATOM 2851 CG2 ILE A 184 45.239 44.648 18.516 1.00 36.67 C ATOM 2852 CD1 ILE A 184 46.755 44.900 21.191 1.00 37.52 C ATOM 2853 HA ILE A 184 42.790 45.398 20.806 1.00 0.00 H ATOM 2854 HB ILE A 184 44.578 43.554 20.213 1.00 0.00 H ATOM 2855 HG12 ILE A 184 45.377 46.432 20.648 1.00 0.00 H ATOM 2856 HG13 ILE A 184 44.790 45.316 21.902 1.00 0.00 H ATOM 2857 HD11 ILE A 184 46.732 43.860 21.517 1.00 0.00 H ATOM 2858 HD12 ILE A 184 47.320 44.978 20.262 1.00 0.00 H ATOM 2859 HD13 ILE A 184 47.229 45.512 21.958 1.00 0.00 H ATOM 2860 HG21 ILE A 184 44.701 43.998 17.826 1.00 0.00 H ATOM 2861 HG22 ILE A 184 45.221 45.672 18.142 1.00 0.00 H ATOM 2862 HG23 ILE A 184 46.272 44.311 18.605 1.00 0.00 H ATOM 2863 H ILE A 184 42.633 43.119 19.017 1.00 0.00 H ATOM 2864 N ARG A 185 42.365 46.027 17.682 1.00 36.83 N ATOM 2865 CA ARG A 185 42.123 47.105 16.727 1.00 38.23 C ATOM 2866 C ARG A 185 40.783 47.795 16.982 1.00 37.18 C ATOM 2867 O ARG A 185 40.481 48.804 16.358 1.00 38.80 O ATOM 2868 CB ARG A 185 42.195 46.601 15.280 1.00 41.52 C ATOM 2869 CG ARG A 185 43.588 46.202 14.812 1.00 44.55 C ATOM 2870 CD ARG A 185 43.531 45.706 13.369 1.00 49.22 C ATOM 2871 NE ARG A 185 44.643 44.818 13.033 1.00 53.33 N ATOM 2872 CZ ARG A 185 45.660 45.141 12.239 1.00 55.04 C ATOM 2873 NH1 ARG A 185 46.619 44.254 12.003 1.00 56.37 N ATOM 2874 NH2 ARG A 185 45.723 46.343 11.678 1.00 56.26 N ATOM 2875 HA ARG A 185 42.915 47.839 16.873 1.00 0.00 H ATOM 2876 HB2 ARG A 185 41.545 45.731 15.191 1.00 0.00 H ATOM 2877 HB3 ARG A 185 41.831 47.393 14.626 1.00 0.00 H ATOM 2878 HG2 ARG A 185 44.250 47.066 14.871 1.00 0.00 H ATOM 2879 HG3 ARG A 185 43.971 45.407 15.452 1.00 0.00 H ATOM 2880 HD2 ARG A 185 43.559 46.568 12.702 1.00 0.00 H ATOM 2881 HD3 ARG A 185 42.596 45.165 13.223 1.00 0.00 H ATOM 2882 HE ARG A 185 44.638 43.863 13.445 1.00 0.00 H ATOM 2883 HH12 ARG A 185 47.416 44.502 11.383 1.00 0.00 H ATOM 2884 HH11 ARG A 185 46.573 43.311 12.438 1.00 0.00 H ATOM 2885 HH22 ARG A 185 46.522 46.587 11.059 1.00 0.00 H ATOM 2886 HH21 ARG A 185 44.973 47.041 11.858 1.00 0.00 H ATOM 2887 H ARG A 185 42.085 45.056 17.437 1.00 0.00 H ATOM 2888 N GLY A 186 39.978 47.243 17.888 1.00 35.68 N ATOM 2889 CA GLY A 186 38.750 47.897 18.320 1.00 30.83 C ATOM 2890 C GLY A 186 37.480 47.490 17.616 1.00 32.39 C ATOM 2891 O GLY A 186 37.444 46.493 16.891 1.00 33.31 O ATOM 2892 HA3 GLY A 186 38.879 48.970 18.175 1.00 0.00 H ATOM 2893 HA2 GLY A 186 38.620 47.688 19.382 1.00 0.00 H ATOM 2894 H GLY A 186 40.232 46.322 18.298 1.00 0.00 H ATOM 2895 N ILE A 187 36.435 48.283 17.830 1.00 30.83 N ATOM 2896 CA ILE A 187 35.098 48.007 17.310 1.00 32.09 C ATOM 2897 C ILE A 187 35.004 48.172 15.791 1.00 33.71 C ATOM 2898 O ILE A 187 34.720 47.211 15.085 1.00 35.79 O ATOM 2899 CB ILE A 187 34.042 48.888 18.039 1.00 30.82 C ATOM 2900 CG1 ILE A 187 34.022 48.557 19.531 1.00 31.21 C ATOM 2901 CG2 ILE A 187 32.663 48.697 17.464 1.00 30.18 C ATOM 2902 CD1 ILE A 187 33.800 47.060 19.826 1.00 30.30 C ATOM 2903 HA ILE A 187 34.885 46.958 17.514 1.00 0.00 H ATOM 2904 HB ILE A 187 34.329 49.930 17.895 1.00 0.00 H ATOM 2905 HG12 ILE A 187 34.976 48.856 19.964 1.00 0.00 H ATOM 2906 HG13 ILE A 187 33.218 49.124 20.000 1.00 0.00 H ATOM 2907 HD11 ILE A 187 32.843 46.747 19.409 1.00 0.00 H ATOM 2908 HD12 ILE A 187 34.603 46.479 19.373 1.00 0.00 H ATOM 2909 HD13 ILE A 187 33.798 46.900 20.904 1.00 0.00 H ATOM 2910 HG21 ILE A 187 32.669 48.971 16.409 1.00 0.00 H ATOM 2911 HG22 ILE A 187 32.369 47.652 17.567 1.00 0.00 H ATOM 2912 HG23 ILE A 187 31.956 49.330 18.001 1.00 0.00 H ATOM 2913 H ILE A 187 36.576 49.144 18.396 1.00 0.00 H ATOM 2914 N SER A 188 35.254 49.381 15.288 1.00 35.96 N ATOM 2915 CA SER A 188 35.116 49.647 13.849 1.00 37.73 C ATOM 2916 C SER A 188 36.287 49.126 12.999 1.00 37.69 C ATOM 2917 O SER A 188 36.077 48.541 11.945 1.00 37.97 O ATOM 2918 CB SER A 188 34.860 51.140 13.579 1.00 38.17 C ATOM 2919 OG SER A 188 35.968 51.931 13.970 1.00 40.70 O ATOM 2920 HA SER A 188 34.243 49.076 13.531 1.00 0.00 H ATOM 2921 HB2 SER A 188 33.981 51.457 14.140 1.00 0.00 H ATOM 2922 HB3 SER A 188 34.680 51.283 12.514 1.00 0.00 H ATOM 2923 HG SER A 188 35.774 52.884 13.784 1.00 0.00 H ATOM 2924 H SER A 188 35.551 50.148 15.924 1.00 0.00 H ATOM 2925 N LYS A 189 37.514 49.338 13.455 1.00 38.48 N ATOM 2926 CA LYS A 189 38.680 48.924 12.680 1.00 39.36 C ATOM 2927 C LYS A 189 39.113 47.466 12.924 1.00 38.57 C ATOM 2928 O LYS A 189 40.011 46.960 12.250 1.00 36.67 O ATOM 2929 CB LYS A 189 39.849 49.887 12.917 1.00 42.81 C ATOM 2930 CG LYS A 189 39.609 51.288 12.337 1.00 45.86 C ATOM 2931 CD LYS A 189 40.883 52.122 12.328 1.00 48.29 C ATOM 2932 CE LYS A 189 40.740 53.346 11.414 1.00 49.46 C ATOM 2933 NZ LYS A 189 42.063 54.001 11.137 1.00 50.98 N ATOM 2934 HA LYS A 189 38.376 48.967 11.634 1.00 0.00 H ATOM 2935 HB2 LYS A 189 40.009 49.980 13.991 1.00 0.00 H ATOM 2936 HB3 LYS A 189 40.742 49.468 12.453 1.00 0.00 H ATOM 2937 HG2 LYS A 189 39.244 51.189 11.315 1.00 0.00 H ATOM 2938 HG3 LYS A 189 38.858 51.797 12.942 1.00 0.00 H ATOM 2939 HD2 LYS A 189 41.095 52.459 13.343 1.00 0.00 H ATOM 2940 HD3 LYS A 189 41.709 51.506 11.971 1.00 0.00 H ATOM 2941 HE2 LYS A 189 40.083 54.070 11.896 1.00 0.00 H ATOM 2942 HE3 LYS A 189 40.299 53.030 10.469 1.00 0.00 H ATOM 2943 HZ1 LYS A 189 42.488 54.313 12.033 1.00 0.00 H ATOM 2944 HZ2 LYS A 189 42.695 53.319 10.671 1.00 0.00 H ATOM 2945 HZ3 LYS A 189 41.918 54.823 10.516 1.00 0.00 H ATOM 2946 H LYS A 189 37.647 49.804 14.375 1.00 0.00 H ATOM 2947 N GLY A 190 38.474 46.793 13.875 1.00 36.06 N ATOM 2948 CA GLY A 190 38.815 45.403 14.173 1.00 34.42 C ATOM 2949 C GLY A 190 37.654 44.468 13.908 1.00 34.40 C ATOM 2950 O GLY A 190 37.618 43.773 12.890 1.00 33.84 O ATOM 2951 HA3 GLY A 190 39.097 45.326 15.223 1.00 0.00 H ATOM 2952 HA2 GLY A 190 39.658 45.105 13.549 1.00 0.00 H ATOM 2953 H GLY A 190 37.720 47.262 14.416 1.00 0.00 H ATOM 2954 N ILE A 191 36.695 44.455 14.829 1.00 32.96 N ATOM 2955 CA ILE A 191 35.547 43.566 14.728 1.00 31.87 C ATOM 2956 C ILE A 191 34.719 43.823 13.467 1.00 32.33 C ATOM 2957 O ILE A 191 34.478 42.905 12.691 1.00 31.23 O ATOM 2958 CB ILE A 191 34.642 43.676 15.974 1.00 32.03 C ATOM 2959 CG1 ILE A 191 35.432 43.284 17.235 1.00 30.57 C ATOM 2960 CG2 ILE A 191 33.376 42.815 15.795 1.00 31.66 C ATOM 2961 CD1 ILE A 191 34.656 43.431 18.534 1.00 31.08 C ATOM 2962 HA ILE A 191 35.950 42.555 14.666 1.00 0.00 H ATOM 2963 HB ILE A 191 34.317 44.709 16.095 1.00 0.00 H ATOM 2964 HG12 ILE A 191 35.737 42.242 17.136 1.00 0.00 H ATOM 2965 HG13 ILE A 191 36.318 43.917 17.293 1.00 0.00 H ATOM 2966 HD11 ILE A 191 34.353 44.470 18.659 1.00 0.00 H ATOM 2967 HD12 ILE A 191 33.772 42.794 18.502 1.00 0.00 H ATOM 2968 HD13 ILE A 191 35.289 43.133 19.370 1.00 0.00 H ATOM 2969 HG21 ILE A 191 32.823 43.161 14.922 1.00 0.00 H ATOM 2970 HG22 ILE A 191 33.664 41.773 15.655 1.00 0.00 H ATOM 2971 HG23 ILE A 191 32.749 42.904 16.682 1.00 0.00 H ATOM 2972 H ILE A 191 36.767 45.097 15.644 1.00 0.00 H ATOM 2973 N GLU A 192 34.289 45.067 13.273 1.00 33.80 N ATOM 2974 CA GLU A 192 33.429 45.424 12.143 1.00 35.67 C ATOM 2975 C GLU A 192 34.104 45.136 10.801 1.00 35.87 C ATOM 2976 O GLU A 192 33.497 44.561 9.897 1.00 36.50 O ATOM 2977 CB GLU A 192 33.034 46.898 12.237 1.00 36.81 C ATOM 2978 CG GLU A 192 32.117 47.396 11.138 1.00 36.49 C ATOM 2979 CD GLU A 192 31.687 48.838 11.366 1.00 37.52 C ATOM 2980 OE1 GLU A 192 32.218 49.474 12.304 1.00 37.36 O ATOM 2981 OE2 GLU A 192 30.819 49.330 10.613 1.00 37.28 O ATOM 2982 HA GLU A 192 32.533 44.805 12.194 1.00 0.00 H ATOM 2983 HB2 GLU A 192 32.530 47.051 13.191 1.00 0.00 H ATOM 2984 HB3 GLU A 192 33.947 47.494 12.210 1.00 0.00 H ATOM 2985 HG2 GLU A 192 32.642 47.331 10.185 1.00 0.00 H ATOM 2986 HG3 GLU A 192 31.229 46.764 11.106 1.00 0.00 H ATOM 2987 H GLU A 192 34.572 45.809 13.945 1.00 0.00 H ATOM 2988 N ARG A 193 35.363 45.536 10.689 1.00 36.46 N ATOM 2989 CA ARG A 193 36.150 45.307 9.484 1.00 38.98 C ATOM 2990 C ARG A 193 36.289 43.819 9.184 1.00 37.93 C ATOM 2991 O ARG A 193 36.099 43.399 8.050 1.00 37.11 O ATOM 2992 CB ARG A 193 37.526 45.964 9.628 1.00 41.59 C ATOM 2993 CG ARG A 193 38.403 45.912 8.382 1.00 45.82 C ATOM 2994 CD ARG A 193 39.515 46.955 8.459 1.00 48.43 C ATOM 2995 NE ARG A 193 38.975 48.318 8.487 1.00 51.35 N ATOM 2996 CZ ARG A 193 39.692 49.408 8.763 1.00 52.23 C ATOM 2997 NH1 ARG A 193 40.988 49.305 9.044 1.00 52.65 N ATOM 2998 NH2 ARG A 193 39.113 50.602 8.765 1.00 52.09 N ATOM 2999 HA ARG A 193 35.627 45.761 8.642 1.00 0.00 H ATOM 3000 HB2 ARG A 193 37.374 47.011 9.891 1.00 0.00 H ATOM 3001 HB3 ARG A 193 38.057 45.461 10.436 1.00 0.00 H ATOM 3002 HG2 ARG A 193 38.848 44.920 8.299 1.00 0.00 H ATOM 3003 HG3 ARG A 193 37.788 46.108 7.503 1.00 0.00 H ATOM 3004 HD2 ARG A 193 40.162 46.848 7.588 1.00 0.00 H ATOM 3005 HD3 ARG A 193 40.097 46.786 9.365 1.00 0.00 H ATOM 3006 HE ARG A 193 37.964 48.443 8.277 1.00 0.00 H ATOM 3007 HH12 ARG A 193 41.543 50.158 9.259 1.00 0.00 H ATOM 3008 HH11 ARG A 193 41.446 48.371 9.049 1.00 0.00 H ATOM 3009 HH22 ARG A 193 39.673 51.451 8.980 1.00 0.00 H ATOM 3010 HH21 ARG A 193 38.099 50.689 8.551 1.00 0.00 H ATOM 3011 H ARG A 193 35.805 46.031 11.490 1.00 0.00 H ATOM 3012 N PHE A 194 36.615 43.020 10.198 1.00 38.09 N ATOM 3013 CA PHE A 194 36.764 41.575 10.003 1.00 36.89 C ATOM 3014 C PHE A 194 35.436 40.945 9.608 1.00 35.66 C ATOM 3015 O PHE A 194 35.380 40.127 8.693 1.00 36.76 O ATOM 3016 CB PHE A 194 37.332 40.887 11.254 1.00 38.40 C ATOM 3017 CG PHE A 194 37.521 39.397 11.097 1.00 38.96 C ATOM 3018 CD1 PHE A 194 38.542 38.892 10.292 1.00 39.79 C ATOM 3019 CD2 PHE A 194 36.689 38.502 11.751 1.00 38.65 C ATOM 3020 CE1 PHE A 194 38.721 37.525 10.146 1.00 39.02 C ATOM 3021 CE2 PHE A 194 36.867 37.135 11.608 1.00 38.18 C ATOM 3022 CZ PHE A 194 37.880 36.649 10.803 1.00 38.49 C ATOM 3023 HA PHE A 194 37.477 41.428 9.192 1.00 0.00 H ATOM 3024 HB2 PHE A 194 38.299 41.334 11.483 1.00 0.00 H ATOM 3025 HB3 PHE A 194 36.647 41.061 12.084 1.00 0.00 H ATOM 3026 HD2 PHE A 194 35.886 38.877 12.385 1.00 0.00 H ATOM 3027 HE2 PHE A 194 36.207 36.442 12.131 1.00 0.00 H ATOM 3028 HZ PHE A 194 38.015 35.574 10.687 1.00 0.00 H ATOM 3029 HE1 PHE A 194 39.523 37.143 9.515 1.00 0.00 H ATOM 3030 HD1 PHE A 194 39.207 39.581 9.771 1.00 0.00 H ATOM 3031 H PHE A 194 36.766 43.427 11.143 1.00 0.00 H ATOM 3032 N ALA A 195 34.368 41.334 10.292 1.00 34.77 N ATOM 3033 CA ALA A 195 33.034 40.835 9.967 1.00 35.46 C ATOM 3034 C ALA A 195 32.655 41.038 8.494 1.00 36.83 C ATOM 3035 O ALA A 195 32.005 40.181 7.898 1.00 39.39 O ATOM 3036 CB ALA A 195 32.004 41.475 10.859 1.00 33.54 C ATOM 3037 HA ALA A 195 33.056 39.759 10.140 1.00 0.00 H ATOM 3038 HB1 ALA A 195 32.229 41.239 11.899 1.00 0.00 H ATOM 3039 HB2 ALA A 195 32.024 42.556 10.718 1.00 0.00 H ATOM 3040 HB3 ALA A 195 31.016 41.092 10.604 1.00 0.00 H ATOM 3041 H ALA A 195 34.483 42.008 11.076 1.00 0.00 H ATOM 3042 N LYS A 196 33.046 42.168 7.908 1.00 38.70 N ATOM 3043 CA LYS A 196 32.729 42.426 6.498 1.00 40.58 C ATOM 3044 C LYS A 196 33.428 41.438 5.561 1.00 39.86 C ATOM 3045 O LYS A 196 32.910 41.102 4.501 1.00 40.63 O ATOM 3046 CB LYS A 196 33.055 43.872 6.109 1.00 42.37 C ATOM 3047 CG LYS A 196 32.003 44.874 6.566 1.00 44.60 C ATOM 3048 CD LYS A 196 32.243 46.252 5.973 1.00 46.88 C ATOM 3049 CE LYS A 196 31.117 47.211 6.357 1.00 48.27 C ATOM 3050 NZ LYS A 196 31.161 48.492 5.586 1.00 49.51 N ATOM 3051 HA LYS A 196 31.655 42.278 6.383 1.00 0.00 H ATOM 3052 HB2 LYS A 196 34.010 44.144 6.559 1.00 0.00 H ATOM 3053 HB3 LYS A 196 33.137 43.928 5.024 1.00 0.00 H ATOM 3054 HG2 LYS A 196 31.020 44.521 6.254 1.00 0.00 H ATOM 3055 HG3 LYS A 196 32.033 44.947 7.653 1.00 0.00 H ATOM 3056 HD2 LYS A 196 33.189 46.643 6.348 1.00 0.00 H ATOM 3057 HD3 LYS A 196 32.289 46.171 4.887 1.00 0.00 H ATOM 3058 HE2 LYS A 196 31.201 47.440 7.419 1.00 0.00 H ATOM 3059 HE3 LYS A 196 30.162 46.722 6.166 1.00 0.00 H ATOM 3060 HZ1 LYS A 196 32.065 48.973 5.767 1.00 0.00 H ATOM 3061 HZ2 LYS A 196 31.073 48.287 4.570 1.00 0.00 H ATOM 3062 HZ3 LYS A 196 30.375 49.103 5.887 1.00 0.00 H ATOM 3063 H LYS A 196 33.580 42.874 8.454 1.00 0.00 H ATOM 3064 N ILE A 197 34.606 40.983 5.969 1.00 39.71 N ATOM 3065 CA ILE A 197 35.381 40.008 5.218 1.00 39.98 C ATOM 3066 C ILE A 197 34.955 38.573 5.548 1.00 39.51 C ATOM 3067 O ILE A 197 34.880 37.718 4.666 1.00 38.96 O ATOM 3068 CB ILE A 197 36.889 40.161 5.533 1.00 42.22 C ATOM 3069 CG1 ILE A 197 37.385 41.555 5.124 1.00 43.64 C ATOM 3070 CG2 ILE A 197 37.703 39.065 4.852 1.00 42.60 C ATOM 3071 CD1 ILE A 197 38.785 41.881 5.615 1.00 45.50 C ATOM 3072 HA ILE A 197 35.196 40.197 4.160 1.00 0.00 H ATOM 3073 HB ILE A 197 37.027 40.054 6.609 1.00 0.00 H ATOM 3074 HG12 ILE A 197 37.380 41.615 4.036 1.00 0.00 H ATOM 3075 HG13 ILE A 197 36.697 42.297 5.530 1.00 0.00 H ATOM 3076 HD11 ILE A 197 38.806 41.838 6.704 1.00 0.00 H ATOM 3077 HD12 ILE A 197 39.490 41.156 5.208 1.00 0.00 H ATOM 3078 HD13 ILE A 197 39.061 42.882 5.284 1.00 0.00 H ATOM 3079 HG21 ILE A 197 37.368 38.091 5.208 1.00 0.00 H ATOM 3080 HG22 ILE A 197 37.562 39.127 3.773 1.00 0.00 H ATOM 3081 HG23 ILE A 197 38.758 39.197 5.090 1.00 0.00 H ATOM 3082 H ILE A 197 34.992 41.340 6.866 1.00 0.00 H ATOM 3083 N ALA A 198 34.674 38.316 6.826 1.00 36.74 N ATOM 3084 CA ALA A 198 34.395 36.959 7.293 1.00 35.51 C ATOM 3085 C ALA A 198 33.016 36.417 6.944 1.00 34.43 C ATOM 3086 O ALA A 198 32.885 35.238 6.613 1.00 35.68 O ATOM 3087 CB ALA A 198 34.614 36.862 8.802 1.00 35.16 C ATOM 3088 HA ALA A 198 35.101 36.331 6.751 1.00 0.00 H ATOM 3089 HB1 ALA A 198 35.649 37.113 9.035 1.00 0.00 H ATOM 3090 HB2 ALA A 198 33.947 37.558 9.310 1.00 0.00 H ATOM 3091 HB3 ALA A 198 34.402 35.846 9.134 1.00 0.00 H ATOM 3092 H ALA A 198 34.653 39.101 7.508 1.00 0.00 H ATOM 3093 N MET A 199 31.992 37.258 7.026 1.00 33.21 N ATOM 3094 CA MET A 199 30.622 36.768 6.839 1.00 33.44 C ATOM 3095 C MET A 199 30.274 36.307 5.409 1.00 33.93 C ATOM 3096 O MET A 199 29.682 35.246 5.250 1.00 34.55 O ATOM 3097 CB MET A 199 29.593 37.761 7.394 1.00 32.49 C ATOM 3098 CG MET A 199 29.740 38.009 8.898 1.00 33.59 C ATOM 3099 SD MET A 199 29.794 36.487 9.898 1.00 34.00 S ATOM 3100 CE MET A 199 28.150 35.854 9.587 1.00 29.71 C ATOM 3101 HA MET A 199 30.572 35.852 7.427 1.00 0.00 H ATOM 3102 HB2 MET A 199 29.713 38.711 6.873 1.00 0.00 H ATOM 3103 HB3 MET A 199 28.595 37.367 7.204 1.00 0.00 H ATOM 3104 HG2 MET A 199 28.893 38.609 9.231 1.00 0.00 H ATOM 3105 HG3 MET A 199 30.664 38.563 9.066 1.00 0.00 H ATOM 3106 HE1 MET A 199 27.412 36.581 9.925 1.00 0.00 H ATOM 3107 HE2 MET A 199 28.026 35.679 8.518 1.00 0.00 H ATOM 3108 HE3 MET A 199 28.014 34.918 10.128 1.00 0.00 H ATOM 3109 H MET A 199 32.161 38.265 7.223 1.00 0.00 H ATOM 3110 N PRO A 200 30.619 37.103 4.372 1.00 34.73 N ATOM 3111 CA PRO A 200 30.422 36.621 2.990 1.00 34.67 C ATOM 3112 C PRO A 200 31.199 35.337 2.715 1.00 34.91 C ATOM 3113 O PRO A 200 30.660 34.400 2.126 1.00 36.80 O ATOM 3114 CB PRO A 200 30.974 37.771 2.128 1.00 34.60 C ATOM 3115 CG PRO A 200 30.895 38.976 3.009 1.00 34.92 C ATOM 3116 CD PRO A 200 31.167 38.470 4.401 1.00 33.86 C ATOM 3117 HA PRO A 200 29.379 36.379 2.786 1.00 0.00 H ATOM 3118 HD3 PRO A 200 32.236 38.459 4.612 1.00 0.00 H ATOM 3119 HD2 PRO A 200 30.657 39.081 5.146 1.00 0.00 H ATOM 3120 HG3 PRO A 200 29.904 39.426 2.953 1.00 0.00 H ATOM 3121 HG2 PRO A 200 31.644 39.712 2.717 1.00 0.00 H ATOM 3122 HB2 PRO A 200 32.006 37.573 1.838 1.00 0.00 H ATOM 3123 HB3 PRO A 200 30.366 37.908 1.234 1.00 0.00 H ATOM 3124 N THR A 201 32.458 35.297 3.135 1.00 36.37 N ATOM 3125 CA THR A 201 33.284 34.102 2.995 1.00 37.72 C ATOM 3126 C THR A 201 32.589 32.888 3.600 1.00 38.57 C ATOM 3127 O THR A 201 32.390 31.868 2.937 1.00 39.11 O ATOM 3128 CB THR A 201 34.630 34.279 3.711 1.00 38.14 C ATOM 3129 OG1 THR A 201 35.281 35.453 3.223 1.00 39.22 O ATOM 3130 CG2 THR A 201 35.535 33.070 3.477 1.00 38.99 C ATOM 3131 HA THR A 201 33.445 33.949 1.928 1.00 0.00 H ATOM 3132 HB THR A 201 34.440 34.373 4.780 1.00 0.00 H ATOM 3133 HG1 THR A 201 34.709 36.242 3.396 1.00 0.00 H ATOM 3134 HG23 THR A 201 35.042 32.171 3.848 1.00 0.00 H ATOM 3135 HG21 THR A 201 35.730 32.965 2.410 1.00 0.00 H ATOM 3136 HG22 THR A 201 36.476 33.215 4.007 1.00 0.00 H ATOM 3137 H THR A 201 32.868 36.144 3.578 1.00 0.00 H ATOM 3138 N LEU A 202 32.217 33.026 4.871 1.00 38.04 N ATOM 3139 CA LEU A 202 31.547 31.988 5.635 1.00 36.49 C ATOM 3140 C LEU A 202 30.272 31.506 4.932 1.00 37.17 C ATOM 3141 O LEU A 202 30.032 30.300 4.824 1.00 34.59 O ATOM 3142 CB LEU A 202 31.247 32.530 7.040 1.00 37.00 C ATOM 3143 CG LEU A 202 30.646 31.679 8.155 1.00 37.81 C ATOM 3144 CD1 LEU A 202 30.759 32.428 9.484 1.00 36.93 C ATOM 3145 CD2 LEU A 202 29.202 31.313 7.863 1.00 37.60 C ATOM 3146 HA LEU A 202 32.200 31.119 5.715 1.00 0.00 H ATOM 3147 HB2 LEU A 202 32.196 32.902 7.426 1.00 0.00 H ATOM 3148 HB3 LEU A 202 30.561 33.365 6.898 1.00 0.00 H ATOM 3149 HG LEU A 202 31.206 30.746 8.218 1.00 0.00 H ATOM 3150 HD21 LEU A 202 28.610 32.223 7.767 1.00 0.00 H ATOM 3151 HD22 LEU A 202 29.153 30.747 6.933 1.00 0.00 H ATOM 3152 HD23 LEU A 202 28.810 30.707 8.680 1.00 0.00 H ATOM 3153 HD11 LEU A 202 31.809 32.624 9.701 1.00 0.00 H ATOM 3154 HD12 LEU A 202 30.219 33.372 9.415 1.00 0.00 H ATOM 3155 HD13 LEU A 202 30.330 31.820 10.280 1.00 0.00 H ATOM 3156 H LEU A 202 32.418 33.930 5.344 1.00 0.00 H ATOM 3157 N PHE A 203 29.450 32.443 4.461 1.00 37.99 N ATOM 3158 CA PHE A 203 28.230 32.109 3.724 1.00 39.03 C ATOM 3159 C PHE A 203 28.552 31.307 2.464 1.00 40.02 C ATOM 3160 O PHE A 203 27.876 30.328 2.135 1.00 40.66 O ATOM 3161 CB PHE A 203 27.482 33.397 3.361 1.00 39.72 C ATOM 3162 CG PHE A 203 26.331 33.200 2.408 1.00 39.52 C ATOM 3163 CD1 PHE A 203 25.103 32.743 2.862 1.00 39.66 C ATOM 3164 CD2 PHE A 203 26.474 33.492 1.056 1.00 39.80 C ATOM 3165 CE1 PHE A 203 24.040 32.567 1.985 1.00 39.64 C ATOM 3166 CE2 PHE A 203 25.416 33.319 0.174 1.00 39.66 C ATOM 3167 CZ PHE A 203 24.199 32.858 0.639 1.00 39.46 C ATOM 3168 HA PHE A 203 27.597 31.490 4.359 1.00 0.00 H ATOM 3169 HB2 PHE A 203 27.093 33.836 4.280 1.00 0.00 H ATOM 3170 HB3 PHE A 203 28.191 34.086 2.902 1.00 0.00 H ATOM 3171 HD2 PHE A 203 27.429 33.862 0.684 1.00 0.00 H ATOM 3172 HE2 PHE A 203 25.545 33.547 -0.884 1.00 0.00 H ATOM 3173 HZ PHE A 203 23.366 32.724 -0.051 1.00 0.00 H ATOM 3174 HE1 PHE A 203 23.082 32.201 2.355 1.00 0.00 H ATOM 3175 HD1 PHE A 203 24.970 32.519 3.920 1.00 0.00 H ATOM 3176 H PHE A 203 29.683 33.444 4.622 1.00 0.00 H ATOM 3177 N ILE A 204 29.592 31.738 1.749 1.00 40.42 N ATOM 3178 CA ILE A 204 30.015 31.077 0.505 1.00 41.59 C ATOM 3179 C ILE A 204 30.422 29.621 0.744 1.00 40.72 C ATOM 3180 O ILE A 204 29.915 28.714 0.085 1.00 42.36 O ATOM 3181 CB ILE A 204 31.156 31.860 -0.209 1.00 41.89 C ATOM 3182 CG1 ILE A 204 30.590 33.099 -0.909 1.00 42.41 C ATOM 3183 CG2 ILE A 204 31.875 30.974 -1.226 1.00 43.26 C ATOM 3184 CD1 ILE A 204 31.650 34.139 -1.291 1.00 43.54 C ATOM 3185 HA ILE A 204 29.149 31.076 -0.157 1.00 0.00 H ATOM 3186 HB ILE A 204 31.876 32.172 0.548 1.00 0.00 H ATOM 3187 HG12 ILE A 204 30.082 32.777 -1.818 1.00 0.00 H ATOM 3188 HG13 ILE A 204 29.871 33.572 -0.240 1.00 0.00 H ATOM 3189 HD11 ILE A 204 32.161 34.482 -0.392 1.00 0.00 H ATOM 3190 HD12 ILE A 204 32.372 33.687 -1.971 1.00 0.00 H ATOM 3191 HD13 ILE A 204 31.168 34.984 -1.782 1.00 0.00 H ATOM 3192 HG21 ILE A 204 32.307 30.114 -0.715 1.00 0.00 H ATOM 3193 HG22 ILE A 204 31.162 30.632 -1.976 1.00 0.00 H ATOM 3194 HG23 ILE A 204 32.667 31.547 -1.709 1.00 0.00 H ATOM 3195 H ILE A 204 30.121 32.569 2.082 1.00 0.00 H ATOM 3196 N LEU A 205 31.332 29.408 1.690 1.00 40.17 N ATOM 3197 CA LEU A 205 31.756 28.069 2.071 1.00 39.28 C ATOM 3198 C LEU A 205 30.569 27.184 2.440 1.00 38.43 C ATOM 3199 O LEU A 205 30.479 26.038 2.003 1.00 37.77 O ATOM 3200 CB LEU A 205 32.706 28.135 3.262 1.00 38.92 C ATOM 3201 CG LEU A 205 34.106 28.707 3.086 1.00 39.34 C ATOM 3202 CD1 LEU A 205 34.675 29.086 4.442 1.00 38.66 C ATOM 3203 CD2 LEU A 205 35.012 27.716 2.379 1.00 40.09 C ATOM 3204 HA LEU A 205 32.262 27.635 1.209 1.00 0.00 H ATOM 3205 HB2 LEU A 205 32.213 28.737 4.025 1.00 0.00 H ATOM 3206 HB3 LEU A 205 32.826 27.115 3.627 1.00 0.00 H ATOM 3207 HG LEU A 205 34.046 29.600 2.464 1.00 0.00 H ATOM 3208 HD21 LEU A 205 35.078 26.802 2.969 1.00 0.00 H ATOM 3209 HD22 LEU A 205 34.601 27.487 1.396 1.00 0.00 H ATOM 3210 HD23 LEU A 205 36.005 28.150 2.266 1.00 0.00 H ATOM 3211 HD11 LEU A 205 34.033 29.834 4.908 1.00 0.00 H ATOM 3212 HD12 LEU A 205 34.722 28.200 5.075 1.00 0.00 H ATOM 3213 HD13 LEU A 205 35.677 29.495 4.313 1.00 0.00 H ATOM 3214 H LEU A 205 31.755 30.226 2.174 1.00 0.00 H ATOM 3215 N ALA A 206 29.662 27.719 3.253 1.00 38.12 N ATOM 3216 CA ALA A 206 28.525 26.945 3.734 1.00 37.55 C ATOM 3217 C ALA A 206 27.613 26.523 2.587 1.00 36.95 C ATOM 3218 O ALA A 206 27.180 25.377 2.521 1.00 37.68 O ATOM 3219 CB ALA A 206 27.752 27.728 4.787 1.00 36.80 C ATOM 3220 HA ALA A 206 28.910 26.036 4.196 1.00 0.00 H ATOM 3221 HB1 ALA A 206 28.409 27.951 5.627 1.00 0.00 H ATOM 3222 HB2 ALA A 206 27.388 28.659 4.352 1.00 0.00 H ATOM 3223 HB3 ALA A 206 26.907 27.133 5.133 1.00 0.00 H ATOM 3224 H ALA A 206 29.767 28.710 3.551 1.00 0.00 H ATOM 3225 N VAL A 207 27.327 27.449 1.682 1.00 37.99 N ATOM 3226 CA VAL A 207 26.479 27.144 0.529 1.00 37.65 C ATOM 3227 C VAL A 207 27.130 26.057 -0.331 1.00 36.54 C ATOM 3228 O VAL A 207 26.479 25.097 -0.733 1.00 36.33 O ATOM 3229 CB VAL A 207 26.170 28.408 -0.305 1.00 37.82 C ATOM 3230 CG1 VAL A 207 25.682 28.039 -1.709 1.00 37.32 C ATOM 3231 CG2 VAL A 207 25.148 29.278 0.415 1.00 37.44 C ATOM 3232 HA VAL A 207 25.525 26.769 0.900 1.00 0.00 H ATOM 3233 HB VAL A 207 27.093 28.978 -0.417 1.00 0.00 H ATOM 3234 HG11 VAL A 207 26.453 27.464 -2.221 1.00 0.00 H ATOM 3235 HG12 VAL A 207 24.773 27.442 -1.631 1.00 0.00 H ATOM 3236 HG13 VAL A 207 25.473 28.950 -2.271 1.00 0.00 H ATOM 3237 HG21 VAL A 207 24.228 28.712 0.559 1.00 0.00 H ATOM 3238 HG22 VAL A 207 25.547 29.578 1.384 1.00 0.00 H ATOM 3239 HG23 VAL A 207 24.941 30.164 -0.185 1.00 0.00 H ATOM 3240 H VAL A 207 27.712 28.409 1.794 1.00 0.00 H ATOM 3241 N PHE A 208 28.420 26.202 -0.594 1.00 36.60 N ATOM 3242 CA PHE A 208 29.133 25.201 -1.362 1.00 38.37 C ATOM 3243 C PHE A 208 29.052 23.834 -0.683 1.00 38.47 C ATOM 3244 O PHE A 208 28.832 22.819 -1.344 1.00 38.02 O ATOM 3245 CB PHE A 208 30.594 25.604 -1.563 1.00 39.94 C ATOM 3246 CG PHE A 208 31.386 24.600 -2.347 1.00 42.07 C ATOM 3247 CD1 PHE A 208 31.182 24.454 -3.717 1.00 43.20 C ATOM 3248 CD2 PHE A 208 32.328 23.799 -1.724 1.00 42.88 C ATOM 3249 CE1 PHE A 208 31.909 23.524 -4.453 1.00 44.21 C ATOM 3250 CE2 PHE A 208 33.061 22.865 -2.451 1.00 44.34 C ATOM 3251 CZ PHE A 208 32.849 22.729 -3.820 1.00 44.33 C ATOM 3252 HA PHE A 208 28.656 25.131 -2.340 1.00 0.00 H ATOM 3253 HB2 PHE A 208 30.620 26.556 -2.093 1.00 0.00 H ATOM 3254 HB3 PHE A 208 31.058 25.722 -0.584 1.00 0.00 H ATOM 3255 HD2 PHE A 208 32.498 23.901 -0.652 1.00 0.00 H ATOM 3256 HE2 PHE A 208 33.800 22.241 -1.949 1.00 0.00 H ATOM 3257 HZ PHE A 208 33.421 21.999 -4.392 1.00 0.00 H ATOM 3258 HE1 PHE A 208 31.739 23.422 -5.525 1.00 0.00 H ATOM 3259 HD1 PHE A 208 30.442 25.077 -4.220 1.00 0.00 H ATOM 3260 H PHE A 208 28.926 27.042 -0.246 1.00 0.00 H ATOM 3261 N LEU A 209 29.228 23.817 0.639 1.00 38.66 N ATOM 3262 CA LEU A 209 29.184 22.573 1.403 1.00 37.02 C ATOM 3263 C LEU A 209 27.803 21.959 1.354 1.00 36.68 C ATOM 3264 O LEU A 209 27.668 20.747 1.247 1.00 35.89 O ATOM 3265 CB LEU A 209 29.628 22.796 2.847 1.00 38.10 C ATOM 3266 CG LEU A 209 31.138 22.926 3.020 1.00 38.24 C ATOM 3267 CD1 LEU A 209 31.457 23.559 4.345 1.00 39.59 C ATOM 3268 CD2 LEU A 209 31.815 21.568 2.898 1.00 39.66 C ATOM 3269 HA LEU A 209 29.883 21.875 0.943 1.00 0.00 H ATOM 3270 HB2 LEU A 209 29.161 23.711 3.212 1.00 0.00 H ATOM 3271 HB3 LEU A 209 29.286 21.951 3.445 1.00 0.00 H ATOM 3272 HG LEU A 209 31.522 23.567 2.226 1.00 0.00 H ATOM 3273 HD21 LEU A 209 31.429 20.900 3.668 1.00 0.00 H ATOM 3274 HD22 LEU A 209 31.608 21.148 1.914 1.00 0.00 H ATOM 3275 HD23 LEU A 209 32.891 21.687 3.025 1.00 0.00 H ATOM 3276 HD11 LEU A 209 31.006 24.550 4.391 1.00 0.00 H ATOM 3277 HD12 LEU A 209 31.058 22.939 5.148 1.00 0.00 H ATOM 3278 HD13 LEU A 209 32.538 23.645 4.454 1.00 0.00 H ATOM 3279 H LEU A 209 29.401 24.713 1.139 1.00 0.00 H ATOM 3280 N VAL A 210 26.778 22.799 1.425 1.00 37.63 N ATOM 3281 CA VAL A 210 25.406 22.330 1.303 1.00 39.12 C ATOM 3282 C VAL A 210 25.187 21.685 -0.071 1.00 40.81 C ATOM 3283 O VAL A 210 24.637 20.589 -0.173 1.00 40.62 O ATOM 3284 CB VAL A 210 24.399 23.476 1.511 1.00 39.44 C ATOM 3285 CG1 VAL A 210 22.994 23.033 1.136 1.00 38.67 C ATOM 3286 CG2 VAL A 210 24.441 23.971 2.957 1.00 39.99 C ATOM 3287 HA VAL A 210 25.238 21.587 2.082 1.00 0.00 H ATOM 3288 HB VAL A 210 24.680 24.301 0.857 1.00 0.00 H ATOM 3289 HG11 VAL A 210 22.976 22.734 0.088 1.00 0.00 H ATOM 3290 HG12 VAL A 210 22.702 22.189 1.761 1.00 0.00 H ATOM 3291 HG13 VAL A 210 22.300 23.859 1.291 1.00 0.00 H ATOM 3292 HG21 VAL A 210 24.188 23.150 3.628 1.00 0.00 H ATOM 3293 HG22 VAL A 210 25.443 24.334 3.187 1.00 0.00 H ATOM 3294 HG23 VAL A 210 23.722 24.781 3.084 1.00 0.00 H ATOM 3295 H VAL A 210 26.959 23.813 1.571 1.00 0.00 H ATOM 3296 N ILE A 211 25.625 22.373 -1.121 1.00 42.05 N ATOM 3297 CA ILE A 211 25.522 21.861 -2.484 1.00 43.08 C ATOM 3298 C ILE A 211 26.256 20.528 -2.607 1.00 42.57 C ATOM 3299 O ILE A 211 25.694 19.536 -3.069 1.00 42.19 O ATOM 3300 CB ILE A 211 26.085 22.885 -3.504 1.00 43.55 C ATOM 3301 CG1 ILE A 211 25.141 24.087 -3.610 1.00 42.74 C ATOM 3302 CG2 ILE A 211 26.312 22.229 -4.875 1.00 44.51 C ATOM 3303 CD1 ILE A 211 25.714 25.267 -4.355 1.00 42.82 C ATOM 3304 HA ILE A 211 24.468 21.702 -2.710 1.00 0.00 H ATOM 3305 HB ILE A 211 27.054 23.237 -3.150 1.00 0.00 H ATOM 3306 HG12 ILE A 211 24.236 23.765 -4.125 1.00 0.00 H ATOM 3307 HG13 ILE A 211 24.887 24.411 -2.601 1.00 0.00 H ATOM 3308 HD11 ILE A 211 26.614 25.613 -3.847 1.00 0.00 H ATOM 3309 HD12 ILE A 211 25.962 24.967 -5.373 1.00 0.00 H ATOM 3310 HD13 ILE A 211 24.978 26.071 -4.381 1.00 0.00 H ATOM 3311 HG21 ILE A 211 27.024 21.410 -4.771 1.00 0.00 H ATOM 3312 HG22 ILE A 211 25.365 21.843 -5.253 1.00 0.00 H ATOM 3313 HG23 ILE A 211 26.707 22.970 -5.570 1.00 0.00 H ATOM 3314 H ILE A 211 26.055 23.307 -0.966 1.00 0.00 H ATOM 3315 N ARG A 212 27.508 20.508 -2.171 1.00 42.97 N ATOM 3316 CA ARG A 212 28.325 19.305 -2.263 1.00 43.64 C ATOM 3317 C ARG A 212 27.724 18.139 -1.476 1.00 44.47 C ATOM 3318 O ARG A 212 27.802 16.985 -1.905 1.00 44.03 O ATOM 3319 CB ARG A 212 29.759 19.596 -1.809 1.00 44.87 C ATOM 3320 CG ARG A 212 30.683 18.400 -1.893 1.00 47.62 C ATOM 3321 CD ARG A 212 30.816 17.892 -3.328 1.00 49.45 C ATOM 3322 NE ARG A 212 31.367 16.542 -3.381 1.00 49.85 N ATOM 3323 CZ ARG A 212 30.638 15.432 -3.311 1.00 50.91 C ATOM 3324 NH1 ARG A 212 29.321 15.506 -3.176 1.00 51.03 N ATOM 3325 NH2 ARG A 212 31.226 14.242 -3.370 1.00 52.32 N ATOM 3326 HA ARG A 212 28.346 19.002 -3.310 1.00 0.00 H ATOM 3327 HB2 ARG A 212 30.164 20.388 -2.438 1.00 0.00 H ATOM 3328 HB3 ARG A 212 29.729 19.935 -0.774 1.00 0.00 H ATOM 3329 HG2 ARG A 212 31.668 18.687 -1.526 1.00 0.00 H ATOM 3330 HG3 ARG A 212 30.284 17.600 -1.270 1.00 0.00 H ATOM 3331 HD2 ARG A 212 31.474 18.563 -3.880 1.00 0.00 H ATOM 3332 HD3 ARG A 212 29.830 17.889 -3.793 1.00 0.00 H ATOM 3333 HE ARG A 212 32.397 16.441 -3.480 1.00 0.00 H ATOM 3334 HH12 ARG A 212 28.754 14.636 -3.122 1.00 0.00 H ATOM 3335 HH11 ARG A 212 28.855 16.434 -3.125 1.00 0.00 H ATOM 3336 HH22 ARG A 212 30.653 13.376 -3.315 1.00 0.00 H ATOM 3337 HH21 ARG A 212 32.259 14.177 -3.471 1.00 0.00 H ATOM 3338 H ARG A 212 27.916 21.369 -1.754 1.00 0.00 H ATOM 3339 N VAL A 213 27.118 18.438 -0.329 1.00 44.27 N ATOM 3340 CA VAL A 213 26.495 17.403 0.492 1.00 43.88 C ATOM 3341 C VAL A 213 25.202 16.899 -0.143 1.00 45.00 C ATOM 3342 O VAL A 213 24.874 15.714 -0.050 1.00 44.27 O ATOM 3343 CB VAL A 213 26.236 17.895 1.942 1.00 42.78 C ATOM 3344 CG1 VAL A 213 25.154 17.061 2.622 1.00 41.23 C ATOM 3345 CG2 VAL A 213 27.533 17.874 2.747 1.00 41.72 C ATOM 3346 HA VAL A 213 27.198 16.571 0.545 1.00 0.00 H ATOM 3347 HB VAL A 213 25.876 18.923 1.896 1.00 0.00 H ATOM 3348 HG11 VAL A 213 24.226 17.141 2.056 1.00 0.00 H ATOM 3349 HG12 VAL A 213 25.470 16.018 2.659 1.00 0.00 H ATOM 3350 HG13 VAL A 213 24.996 17.430 3.635 1.00 0.00 H ATOM 3351 HG21 VAL A 213 27.922 16.856 2.780 1.00 0.00 H ATOM 3352 HG22 VAL A 213 28.264 18.529 2.273 1.00 0.00 H ATOM 3353 HG23 VAL A 213 27.335 18.221 3.761 1.00 0.00 H ATOM 3354 H VAL A 213 27.088 19.428 -0.011 1.00 0.00 H ATOM 3355 N PHE A 214 24.470 17.798 -0.793 1.00 46.57 N ATOM 3356 CA PHE A 214 23.225 17.421 -1.463 1.00 49.11 C ATOM 3357 C PHE A 214 23.484 16.416 -2.584 1.00 48.95 C ATOM 3358 O PHE A 214 22.568 15.742 -3.039 1.00 50.05 O ATOM 3359 CB PHE A 214 22.504 18.659 -2.003 1.00 51.31 C ATOM 3360 CG PHE A 214 21.668 19.382 -0.972 1.00 54.07 C ATOM 3361 CD1 PHE A 214 21.842 19.141 0.388 1.00 54.48 C ATOM 3362 CD2 PHE A 214 20.721 20.322 -1.366 1.00 54.82 C ATOM 3363 CE1 PHE A 214 21.077 19.810 1.332 1.00 55.00 C ATOM 3364 CE2 PHE A 214 19.950 21.000 -0.425 1.00 55.18 C ATOM 3365 CZ PHE A 214 20.130 20.743 0.925 1.00 55.44 C ATOM 3366 HA PHE A 214 22.581 16.942 -0.726 1.00 0.00 H ATOM 3367 HB2 PHE A 214 23.253 19.353 -2.385 1.00 0.00 H ATOM 3368 HB3 PHE A 214 21.850 18.347 -2.817 1.00 0.00 H ATOM 3369 HD2 PHE A 214 20.580 20.531 -2.427 1.00 0.00 H ATOM 3370 HE2 PHE A 214 19.208 21.730 -0.749 1.00 0.00 H ATOM 3371 HZ PHE A 214 19.530 21.271 1.666 1.00 0.00 H ATOM 3372 HE1 PHE A 214 21.218 19.604 2.393 1.00 0.00 H ATOM 3373 HD1 PHE A 214 22.589 18.418 0.715 1.00 0.00 H ATOM 3374 H PHE A 214 24.788 18.788 -0.826 1.00 0.00 H ATOM 3375 N LEU A 215 24.740 16.321 -3.014 1.00 49.95 N ATOM 3376 CA LEU A 215 25.145 15.372 -4.053 1.00 50.97 C ATOM 3377 C LEU A 215 25.545 13.999 -3.497 1.00 52.21 C ATOM 3378 O LEU A 215 25.856 13.087 -4.268 1.00 52.28 O ATOM 3379 CB LEU A 215 26.294 15.949 -4.889 1.00 49.97 C ATOM 3380 CG LEU A 215 25.953 17.178 -5.740 1.00 49.66 C ATOM 3381 CD1 LEU A 215 27.195 17.738 -6.408 1.00 48.96 C ATOM 3382 CD2 LEU A 215 24.889 16.839 -6.775 1.00 50.00 C ATOM 3383 HA LEU A 215 24.269 15.217 -4.683 1.00 0.00 H ATOM 3384 HB2 LEU A 215 27.097 16.228 -4.206 1.00 0.00 H ATOM 3385 HB3 LEU A 215 26.645 15.165 -5.560 1.00 0.00 H ATOM 3386 HG LEU A 215 25.552 17.946 -5.078 1.00 0.00 H ATOM 3387 HD21 LEU A 215 25.259 16.049 -7.429 1.00 0.00 H ATOM 3388 HD22 LEU A 215 23.986 16.500 -6.268 1.00 0.00 H ATOM 3389 HD23 LEU A 215 24.664 17.726 -7.367 1.00 0.00 H ATOM 3390 HD11 LEU A 215 27.916 18.030 -5.645 1.00 0.00 H ATOM 3391 HD12 LEU A 215 27.634 16.976 -7.053 1.00 0.00 H ATOM 3392 HD13 LEU A 215 26.924 18.609 -7.005 1.00 0.00 H ATOM 3393 H LEU A 215 25.461 16.944 -2.597 1.00 0.00 H ATOM 3394 N LEU A 216 25.536 13.853 -2.171 1.00 51.55 N ATOM 3395 CA LEU A 216 25.893 12.574 -1.539 1.00 52.56 C ATOM 3396 C LEU A 216 24.814 11.519 -1.732 1.00 53.34 C ATOM 3397 O LEU A 216 23.619 11.793 -1.581 1.00 53.07 O ATOM 3398 CB LEU A 216 26.202 12.741 -0.048 1.00 51.74 C ATOM 3399 CG LEU A 216 27.493 13.490 0.286 1.00 51.53 C ATOM 3400 CD1 LEU A 216 27.723 13.498 1.787 1.00 51.04 C ATOM 3401 CD2 LEU A 216 28.680 12.872 -0.435 1.00 51.80 C ATOM 3402 HA LEU A 216 26.797 12.230 -2.041 1.00 0.00 H ATOM 3403 HB2 LEU A 216 25.373 13.284 0.407 1.00 0.00 H ATOM 3404 HB3 LEU A 216 26.269 11.746 0.393 1.00 0.00 H ATOM 3405 HG LEU A 216 27.391 14.520 -0.056 1.00 0.00 H ATOM 3406 HD21 LEU A 216 28.788 11.832 -0.128 1.00 0.00 H ATOM 3407 HD22 LEU A 216 28.515 12.920 -1.511 1.00 0.00 H ATOM 3408 HD23 LEU A 216 29.585 13.423 -0.180 1.00 0.00 H ATOM 3409 HD11 LEU A 216 26.886 13.993 2.279 1.00 0.00 H ATOM 3410 HD12 LEU A 216 27.802 12.472 2.147 1.00 0.00 H ATOM 3411 HD13 LEU A 216 28.645 14.035 2.009 1.00 0.00 H ATOM 3412 H LEU A 216 25.271 14.661 -1.572 1.00 0.00 H ATOM 3413 N GLU A 217 25.257 10.309 -2.062 1.00 55.00 N ATOM 3414 CA GLU A 217 24.361 9.215 -2.398 1.00 56.61 C ATOM 3415 C GLU A 217 25.067 7.885 -2.150 1.00 56.35 C ATOM 3416 O GLU A 217 26.206 7.684 -2.581 1.00 55.98 O ATOM 3417 CB GLU A 217 23.949 9.332 -3.868 1.00 58.47 C ATOM 3418 CG GLU A 217 22.586 8.749 -4.227 1.00 60.36 C ATOM 3419 CD GLU A 217 22.075 9.276 -5.568 1.00 61.79 C ATOM 3420 OE1 GLU A 217 22.897 9.821 -6.342 1.00 61.99 O ATOM 3421 OE2 GLU A 217 20.858 9.154 -5.847 1.00 62.25 O ATOM 3422 HA GLU A 217 23.469 9.262 -1.774 1.00 0.00 H ATOM 3423 HB2 GLU A 217 23.939 10.390 -4.129 1.00 0.00 H ATOM 3424 HB3 GLU A 217 24.701 8.818 -4.468 1.00 0.00 H ATOM 3425 HG2 GLU A 217 22.671 7.664 -4.284 1.00 0.00 H ATOM 3426 HG3 GLU A 217 21.872 9.016 -3.448 1.00 0.00 H ATOM 3427 H GLU A 217 26.283 10.139 -2.080 1.00 0.00 H ATOM 3428 N THR A 218 24.389 6.991 -1.436 1.00 55.76 N ATOM 3429 CA THR A 218 24.898 5.653 -1.157 1.00 55.24 C ATOM 3430 C THR A 218 23.714 4.699 -1.110 1.00 54.97 C ATOM 3431 O THR A 218 22.566 5.144 -1.067 1.00 54.11 O ATOM 3432 CB THR A 218 25.623 5.570 0.204 1.00 55.12 C ATOM 3433 OG1 THR A 218 24.696 5.862 1.255 1.00 55.06 O ATOM 3434 CG2 THR A 218 26.804 6.525 0.277 1.00 55.72 C ATOM 3435 HA THR A 218 25.612 5.396 -1.940 1.00 0.00 H ATOM 3436 HB THR A 218 26.012 4.558 0.317 1.00 0.00 H ATOM 3437 HG1 THR A 218 24.332 6.774 1.129 1.00 0.00 H ATOM 3438 HG23 THR A 218 27.505 6.296 -0.526 1.00 0.00 H ATOM 3439 HG21 THR A 218 26.448 7.550 0.170 1.00 0.00 H ATOM 3440 HG22 THR A 218 27.303 6.411 1.240 1.00 0.00 H ATOM 3441 H THR A 218 23.456 7.257 -1.061 1.00 0.00 H ATOM 3442 N PRO A 219 23.982 3.380 -1.122 1.00 55.36 N ATOM 3443 CA PRO A 219 22.916 2.389 -0.961 1.00 55.80 C ATOM 3444 C PRO A 219 22.072 2.597 0.305 1.00 56.71 C ATOM 3445 O PRO A 219 20.939 2.107 0.376 1.00 57.74 O ATOM 3446 CB PRO A 219 23.683 1.067 -0.874 1.00 55.82 C ATOM 3447 CG PRO A 219 24.944 1.320 -1.621 1.00 55.51 C ATOM 3448 CD PRO A 219 25.298 2.743 -1.319 1.00 55.28 C ATOM 3449 HA PRO A 219 22.196 2.443 -1.778 1.00 0.00 H ATOM 3450 HD3 PRO A 219 25.906 2.812 -0.417 1.00 0.00 H ATOM 3451 HD2 PRO A 219 25.833 3.199 -2.152 1.00 0.00 H ATOM 3452 HG3 PRO A 219 24.789 1.183 -2.691 1.00 0.00 H ATOM 3453 HG2 PRO A 219 25.732 0.649 -1.280 1.00 0.00 H ATOM 3454 HB2 PRO A 219 23.894 0.811 0.164 1.00 0.00 H ATOM 3455 HB3 PRO A 219 23.115 0.260 -1.337 1.00 0.00 H ATOM 3456 N ASN A 220 22.616 3.320 1.284 1.00 56.77 N ATOM 3457 CA ASN A 220 21.915 3.590 2.545 1.00 56.46 C ATOM 3458 C ASN A 220 20.962 4.783 2.498 1.00 56.41 C ATOM 3459 O ASN A 220 20.152 4.970 3.404 1.00 56.09 O ATOM 3460 CB ASN A 220 22.918 3.776 3.685 1.00 56.94 C ATOM 3461 CG ASN A 220 23.605 2.483 4.070 1.00 57.19 C ATOM 3462 OD1 ASN A 220 22.970 1.433 4.161 1.00 57.29 O ATOM 3463 ND2 ASN A 220 24.909 2.553 4.305 1.00 57.29 N ATOM 3464 HA ASN A 220 21.293 2.713 2.722 1.00 0.00 H ATOM 3465 HB2 ASN A 220 23.675 4.494 3.371 1.00 0.00 H ATOM 3466 HB3 ASN A 220 22.390 4.164 4.556 1.00 0.00 H ATOM 3467 HD22 ASN A 220 25.405 3.463 4.216 1.00 0.00 H ATOM 3468 HD21 ASN A 220 25.435 1.698 4.578 1.00 0.00 H ATOM 3469 H ASN A 220 23.572 3.707 1.149 1.00 0.00 H ATOM 3470 N GLY A 221 21.063 5.592 1.449 1.00 56.54 N ATOM 3471 CA GLY A 221 20.163 6.731 1.291 1.00 56.32 C ATOM 3472 C GLY A 221 20.776 7.961 0.649 1.00 56.12 C ATOM 3473 O GLY A 221 21.926 7.945 0.203 1.00 55.80 O ATOM 3474 HA3 GLY A 221 19.800 7.013 2.279 1.00 0.00 H ATOM 3475 HA2 GLY A 221 19.323 6.413 0.674 1.00 0.00 H ATOM 3476 H GLY A 221 21.793 5.412 0.731 1.00 0.00 H ATOM 3477 N THR A 222 19.993 9.035 0.606 1.00 55.98 N ATOM 3478 CA THR A 222 20.422 10.292 0.007 1.00 56.08 C ATOM 3479 C THR A 222 20.359 11.435 1.015 1.00 55.72 C ATOM 3480 O THR A 222 19.812 11.285 2.108 1.00 55.48 O ATOM 3481 CB THR A 222 19.528 10.677 -1.192 1.00 56.10 C ATOM 3482 OG1 THR A 222 18.197 10.942 -0.730 1.00 55.42 O ATOM 3483 CG2 THR A 222 19.489 9.559 -2.229 1.00 56.91 C ATOM 3484 HA THR A 222 21.449 10.139 -0.325 1.00 0.00 H ATOM 3485 HB THR A 222 19.947 11.568 -1.660 1.00 0.00 H ATOM 3486 HG1 THR A 222 17.625 11.189 -1.499 1.00 0.00 H ATOM 3487 HG23 THR A 222 20.500 9.356 -2.581 1.00 0.00 H ATOM 3488 HG21 THR A 222 19.074 8.659 -1.776 1.00 0.00 H ATOM 3489 HG22 THR A 222 18.865 9.866 -3.069 1.00 0.00 H ATOM 3490 H THR A 222 19.039 8.975 1.015 1.00 0.00 H ATOM 3491 N ALA A 223 20.912 12.580 0.629 1.00 56.15 N ATOM 3492 CA ALA A 223 20.864 13.785 1.452 1.00 55.43 C ATOM 3493 C ALA A 223 19.423 14.210 1.708 1.00 55.10 C ATOM 3494 O ALA A 223 19.104 14.743 2.771 1.00 54.35 O ATOM 3495 CB ALA A 223 21.640 14.913 0.785 1.00 55.51 C ATOM 3496 HA ALA A 223 21.328 13.561 2.412 1.00 0.00 H ATOM 3497 HB1 ALA A 223 22.679 14.611 0.656 1.00 0.00 H ATOM 3498 HB2 ALA A 223 21.200 15.129 -0.189 1.00 0.00 H ATOM 3499 HB3 ALA A 223 21.594 15.804 1.411 1.00 0.00 H ATOM 3500 H ALA A 223 21.396 12.619 -0.291 1.00 0.00 H ATOM 3501 N ALA A 224 18.557 13.965 0.727 1.00 54.85 N ATOM 3502 CA ALA A 224 17.141 14.310 0.835 1.00 54.36 C ATOM 3503 C ALA A 224 16.458 13.594 2.000 1.00 54.39 C ATOM 3504 O ALA A 224 15.544 14.140 2.619 1.00 54.64 O ATOM 3505 CB ALA A 224 16.418 14.011 -0.473 1.00 54.54 C ATOM 3506 HA ALA A 224 17.084 15.380 1.037 1.00 0.00 H ATOM 3507 HB1 ALA A 224 16.866 14.596 -1.276 1.00 0.00 H ATOM 3508 HB2 ALA A 224 16.508 12.949 -0.702 1.00 0.00 H ATOM 3509 HB3 ALA A 224 15.365 14.274 -0.373 1.00 0.00 H ATOM 3510 H ALA A 224 18.899 13.513 -0.145 1.00 0.00 H ATOM 3511 N ASP A 225 16.903 12.372 2.295 1.00 54.38 N ATOM 3512 CA ASP A 225 16.364 11.610 3.418 1.00 54.01 C ATOM 3513 C ASP A 225 16.651 12.324 4.736 1.00 53.75 C ATOM 3514 O ASP A 225 15.824 12.315 5.647 1.00 52.48 O ATOM 3515 CB ASP A 225 16.957 10.200 3.453 1.00 54.71 C ATOM 3516 CG ASP A 225 16.636 9.395 2.203 1.00 55.43 C ATOM 3517 OD1 ASP A 225 15.579 9.641 1.584 1.00 55.17 O ATOM 3518 OD2 ASP A 225 17.445 8.515 1.840 1.00 55.42 O ATOM 3519 HA ASP A 225 15.285 11.532 3.284 1.00 0.00 H ATOM 3520 HB2 ASP A 225 18.040 10.279 3.548 1.00 0.00 H ATOM 3521 HB3 ASP A 225 16.555 9.674 4.319 1.00 0.00 H ATOM 3522 H ASP A 225 17.653 11.951 1.710 1.00 0.00 H ATOM 3523 N GLY A 226 17.832 12.935 4.826 1.00 53.57 N ATOM 3524 CA GLY A 226 18.241 13.670 6.020 1.00 53.31 C ATOM 3525 C GLY A 226 17.406 14.916 6.220 1.00 53.59 C ATOM 3526 O GLY A 226 17.092 15.291 7.350 1.00 53.86 O ATOM 3527 HA3 GLY A 226 19.287 13.958 5.918 1.00 0.00 H ATOM 3528 HA2 GLY A 226 18.127 13.024 6.890 1.00 0.00 H ATOM 3529 H GLY A 226 18.485 12.887 4.018 1.00 0.00 H ATOM 3530 N LEU A 227 17.047 15.558 5.112 1.00 53.90 N ATOM 3531 CA LEU A 227 16.211 16.752 5.142 1.00 54.35 C ATOM 3532 C LEU A 227 14.794 16.427 5.600 1.00 55.17 C ATOM 3533 O LEU A 227 14.225 17.135 6.433 1.00 54.88 O ATOM 3534 CB LEU A 227 16.186 17.417 3.765 1.00 54.09 C ATOM 3535 CG LEU A 227 17.505 18.048 3.316 1.00 53.33 C ATOM 3536 CD1 LEU A 227 17.489 18.332 1.826 1.00 53.78 C ATOM 3537 CD2 LEU A 227 17.796 19.316 4.111 1.00 52.48 C ATOM 3538 HA LEU A 227 16.644 17.446 5.863 1.00 0.00 H ATOM 3539 HB2 LEU A 227 15.908 16.661 3.031 1.00 0.00 H ATOM 3540 HB3 LEU A 227 15.428 18.200 3.783 1.00 0.00 H ATOM 3541 HG LEU A 227 18.306 17.336 3.513 1.00 0.00 H ATOM 3542 HD21 LEU A 227 16.991 20.034 3.955 1.00 0.00 H ATOM 3543 HD22 LEU A 227 17.866 19.071 5.171 1.00 0.00 H ATOM 3544 HD23 LEU A 227 18.739 19.746 3.774 1.00 0.00 H ATOM 3545 HD11 LEU A 227 17.342 17.399 1.281 1.00 0.00 H ATOM 3546 HD12 LEU A 227 16.675 19.020 1.597 1.00 0.00 H ATOM 3547 HD13 LEU A 227 18.438 18.780 1.533 1.00 0.00 H ATOM 3548 H LEU A 227 17.374 15.196 4.193 1.00 0.00 H ATOM 3549 N ASN A 228 14.230 15.351 5.060 1.00 55.72 N ATOM 3550 CA ASN A 228 12.880 14.934 5.426 1.00 56.10 C ATOM 3551 C ASN A 228 12.760 14.570 6.906 1.00 55.35 C ATOM 3552 O ASN A 228 11.739 14.833 7.529 1.00 55.23 O ATOM 3553 CB ASN A 228 12.407 13.785 4.528 1.00 57.90 C ATOM 3554 CG ASN A 228 12.135 14.239 3.098 1.00 59.55 C ATOM 3555 OD1 ASN A 228 11.426 15.224 2.870 1.00 60.07 O ATOM 3556 ND2 ASN A 228 12.697 13.521 2.130 1.00 60.03 N ATOM 3557 HA ASN A 228 12.224 15.790 5.266 1.00 0.00 H ATOM 3558 HB2 ASN A 228 13.177 13.014 4.510 1.00 0.00 H ATOM 3559 HB3 ASN A 228 11.489 13.370 4.944 1.00 0.00 H ATOM 3560 HD22 ASN A 228 13.287 12.698 2.368 1.00 0.00 H ATOM 3561 HD21 ASN A 228 12.546 13.782 1.135 1.00 0.00 H ATOM 3562 H ASN A 228 14.762 14.794 4.361 1.00 0.00 H ATOM 3563 N PHE A 229 13.811 13.974 7.462 1.00 54.61 N ATOM 3564 CA PHE A 229 13.854 13.651 8.887 1.00 54.02 C ATOM 3565 C PHE A 229 13.864 14.923 9.746 1.00 55.10 C ATOM 3566 O PHE A 229 13.251 14.967 10.811 1.00 54.64 O ATOM 3567 CB PHE A 229 15.067 12.761 9.194 1.00 52.26 C ATOM 3568 CG PHE A 229 15.533 12.821 10.628 1.00 51.53 C ATOM 3569 CD1 PHE A 229 14.830 12.171 11.634 1.00 50.91 C ATOM 3570 CD2 PHE A 229 16.688 13.520 10.966 1.00 51.21 C ATOM 3571 CE1 PHE A 229 15.259 12.226 12.950 1.00 50.17 C ATOM 3572 CE2 PHE A 229 17.125 13.578 12.284 1.00 50.41 C ATOM 3573 CZ PHE A 229 16.409 12.930 13.276 1.00 50.58 C ATOM 3574 HA PHE A 229 12.950 13.097 9.141 1.00 0.00 H ATOM 3575 HB2 PHE A 229 14.801 11.729 8.964 1.00 0.00 H ATOM 3576 HB3 PHE A 229 15.891 13.074 8.553 1.00 0.00 H ATOM 3577 HD2 PHE A 229 17.257 14.028 10.187 1.00 0.00 H ATOM 3578 HE2 PHE A 229 18.029 14.132 12.536 1.00 0.00 H ATOM 3579 HZ PHE A 229 16.748 12.973 14.311 1.00 0.00 H ATOM 3580 HE1 PHE A 229 14.693 11.716 13.729 1.00 0.00 H ATOM 3581 HD1 PHE A 229 13.929 11.610 11.385 1.00 0.00 H ATOM 3582 H PHE A 229 14.627 13.730 6.865 1.00 0.00 H ATOM 3583 N LEU A 230 14.553 15.956 9.270 1.00 56.16 N ATOM 3584 CA LEU A 230 14.667 17.206 10.012 1.00 57.67 C ATOM 3585 C LEU A 230 13.409 18.064 9.925 1.00 59.26 C ATOM 3586 O LEU A 230 13.097 18.813 10.853 1.00 59.30 O ATOM 3587 CB LEU A 230 15.875 18.013 9.518 1.00 57.43 C ATOM 3588 CG LEU A 230 16.086 19.393 10.159 1.00 57.97 C ATOM 3589 CD1 LEU A 230 16.344 19.272 11.664 1.00 57.69 C ATOM 3590 CD2 LEU A 230 17.214 20.154 9.477 1.00 56.75 C ATOM 3591 HA LEU A 230 14.803 16.934 11.059 1.00 0.00 H ATOM 3592 HB2 LEU A 230 16.770 17.420 9.707 1.00 0.00 H ATOM 3593 HB3 LEU A 230 15.758 18.161 8.444 1.00 0.00 H ATOM 3594 HG LEU A 230 15.166 19.961 10.019 1.00 0.00 H ATOM 3595 HD21 LEU A 230 18.140 19.585 9.565 1.00 0.00 H ATOM 3596 HD22 LEU A 230 16.971 20.294 8.424 1.00 0.00 H ATOM 3597 HD23 LEU A 230 17.336 21.126 9.955 1.00 0.00 H ATOM 3598 HD11 LEU A 230 15.488 18.794 12.141 1.00 0.00 H ATOM 3599 HD12 LEU A 230 17.237 18.670 11.831 1.00 0.00 H ATOM 3600 HD13 LEU A 230 16.489 20.266 12.088 1.00 0.00 H ATOM 3601 H LEU A 230 15.022 15.870 8.346 1.00 0.00 H ATOM 3602 N TRP A 231 12.685 17.953 8.817 1.00 61.39 N ATOM 3603 CA TRP A 231 11.539 18.831 8.578 1.00 63.86 C ATOM 3604 C TRP A 231 10.173 18.135 8.584 1.00 64.98 C ATOM 3605 O TRP A 231 9.174 18.728 8.175 1.00 65.18 O ATOM 3606 CB TRP A 231 11.746 19.613 7.279 1.00 64.46 C ATOM 3607 CG TRP A 231 12.937 20.526 7.333 1.00 64.94 C ATOM 3608 CD1 TRP A 231 14.160 20.320 6.760 1.00 64.93 C ATOM 3609 CD2 TRP A 231 13.019 21.788 8.006 1.00 65.18 C ATOM 3610 NE1 TRP A 231 14.996 21.377 7.029 1.00 64.36 N ATOM 3611 CE2 TRP A 231 14.321 22.291 7.793 1.00 64.90 C ATOM 3612 CE3 TRP A 231 12.118 22.543 8.767 1.00 65.32 C ATOM 3613 CZ2 TRP A 231 14.743 23.516 8.315 1.00 64.99 C ATOM 3614 CZ3 TRP A 231 12.540 23.762 9.284 1.00 65.08 C ATOM 3615 CH2 TRP A 231 13.841 24.234 9.055 1.00 64.96 C ATOM 3616 HA TRP A 231 11.505 19.510 9.430 1.00 0.00 H ATOM 3617 HB2 TRP A 231 11.887 18.903 6.464 1.00 0.00 H ATOM 3618 HB3 TRP A 231 10.856 20.212 7.087 1.00 0.00 H ATOM 3619 HE1 TRP A 231 15.980 21.468 6.705 1.00 0.00 H ATOM 3620 HD1 TRP A 231 14.433 19.443 6.173 1.00 0.00 H ATOM 3621 HZ2 TRP A 231 15.753 23.887 8.140 1.00 0.00 H ATOM 3622 HH2 TRP A 231 14.141 25.194 9.475 1.00 0.00 H ATOM 3623 HZ3 TRP A 231 11.849 24.361 9.877 1.00 0.00 H ATOM 3624 HE3 TRP A 231 11.106 22.182 8.950 1.00 0.00 H ATOM 3625 H TRP A 231 12.936 17.233 8.110 1.00 0.00 H ATOM 3626 N THR A 232 10.135 16.886 9.046 1.00 66.20 N ATOM 3627 CA THR A 232 8.873 16.160 9.200 1.00 67.14 C ATOM 3628 C THR A 232 8.427 16.235 10.655 1.00 68.55 C ATOM 3629 O THR A 232 9.056 15.637 11.533 1.00 68.33 O ATOM 3630 CB THR A 232 8.982 14.683 8.767 1.00 66.56 C ATOM 3631 OG1 THR A 232 9.339 14.613 7.382 1.00 65.87 O ATOM 3632 CG2 THR A 232 7.658 13.962 8.978 1.00 66.47 C ATOM 3633 HA THR A 232 8.139 16.633 8.547 1.00 0.00 H ATOM 3634 HB THR A 232 9.748 14.201 9.374 1.00 0.00 H ATOM 3635 HG1 THR A 232 10.211 15.062 7.244 1.00 0.00 H ATOM 3636 HG23 THR A 232 7.382 14.013 10.031 1.00 0.00 H ATOM 3637 HG21 THR A 232 6.886 14.440 8.375 1.00 0.00 H ATOM 3638 HG22 THR A 232 7.762 12.919 8.678 1.00 0.00 H ATOM 3639 H THR A 232 11.025 16.414 9.304 1.00 0.00 H ATOM 3640 N PRO A 233 7.336 16.975 10.913 1.00 69.84 N ATOM 3641 CA PRO A 233 6.832 17.207 12.263 1.00 71.10 C ATOM 3642 C PRO A 233 6.288 15.953 12.934 1.00 72.18 C ATOM 3643 O PRO A 233 5.610 15.145 12.301 1.00 72.55 O ATOM 3644 CB PRO A 233 5.693 18.218 12.052 1.00 70.84 C ATOM 3645 CG PRO A 233 5.897 18.769 10.673 1.00 70.85 C ATOM 3646 CD PRO A 233 6.506 17.646 9.900 1.00 70.23 C ATOM 3647 HA PRO A 233 7.630 17.551 12.921 1.00 0.00 H ATOM 3648 HD3 PRO A 233 5.741 16.975 9.510 1.00 0.00 H ATOM 3649 HD2 PRO A 233 7.114 18.019 9.076 1.00 0.00 H ATOM 3650 HG3 PRO A 233 6.568 19.627 10.697 1.00 0.00 H ATOM 3651 HG2 PRO A 233 4.945 19.066 10.233 1.00 0.00 H ATOM 3652 HB2 PRO A 233 4.725 17.722 12.125 1.00 0.00 H ATOM 3653 HB3 PRO A 233 5.749 19.015 12.793 1.00 0.00 H ATOM 3654 N ASP A 234 6.604 15.807 14.214 1.00 73.52 N ATOM 3655 CA ASP A 234 6.080 14.738 15.040 1.00 75.22 C ATOM 3656 C ASP A 234 5.367 15.450 16.181 1.00 76.44 C ATOM 3657 O ASP A 234 6.010 16.029 17.057 1.00 77.35 O ATOM 3658 CB ASP A 234 7.219 13.853 15.548 1.00 75.43 C ATOM 3659 CG ASP A 234 6.735 12.684 16.390 1.00 75.72 C ATOM 3660 OD1 ASP A 234 5.507 12.506 16.535 1.00 76.53 O ATOM 3661 OD2 ASP A 234 7.591 11.938 16.910 1.00 75.24 O ATOM 3662 HA ASP A 234 5.405 14.075 14.499 1.00 0.00 H ATOM 3663 HB2 ASP A 234 7.763 13.460 14.689 1.00 0.00 H ATOM 3664 HB3 ASP A 234 7.889 14.463 16.153 1.00 0.00 H ATOM 3665 H ASP A 234 7.258 16.491 14.645 1.00 0.00 H ATOM 3666 N PHE A 235 4.038 15.415 16.162 1.00 77.27 N ATOM 3667 CA PHE A 235 3.235 16.165 17.130 1.00 77.99 C ATOM 3668 C PHE A 235 3.091 15.482 18.488 1.00 78.63 C ATOM 3669 O PHE A 235 2.651 16.103 19.457 1.00 78.77 O ATOM 3670 CB PHE A 235 1.857 16.490 16.543 1.00 77.98 C ATOM 3671 CG PHE A 235 1.913 17.415 15.360 1.00 78.12 C ATOM 3672 CD1 PHE A 235 1.866 18.790 15.536 1.00 78.14 C ATOM 3673 CD2 PHE A 235 2.019 16.912 14.070 1.00 78.17 C ATOM 3674 CE1 PHE A 235 1.920 19.646 14.448 1.00 78.17 C ATOM 3675 CE2 PHE A 235 2.073 17.762 12.977 1.00 78.10 C ATOM 3676 CZ PHE A 235 2.024 19.131 13.167 1.00 78.20 C ATOM 3677 HA PHE A 235 3.784 17.087 17.321 1.00 0.00 H ATOM 3678 HB2 PHE A 235 1.386 15.558 16.231 1.00 0.00 H ATOM 3679 HB3 PHE A 235 1.253 16.959 17.320 1.00 0.00 H ATOM 3680 HD2 PHE A 235 2.060 15.834 13.915 1.00 0.00 H ATOM 3681 HE2 PHE A 235 2.154 17.353 11.970 1.00 0.00 H ATOM 3682 HZ PHE A 235 2.067 19.803 12.310 1.00 0.00 H ATOM 3683 HE1 PHE A 235 1.881 20.725 14.600 1.00 0.00 H ATOM 3684 HD1 PHE A 235 1.786 19.202 16.542 1.00 0.00 H ATOM 3685 H PHE A 235 3.556 14.840 15.441 1.00 0.00 H ATOM 3686 N GLU A 236 3.468 14.209 18.555 1.00 79.43 N ATOM 3687 CA GLU A 236 3.393 13.452 19.802 1.00 80.33 C ATOM 3688 C GLU A 236 4.633 13.698 20.670 1.00 80.12 C ATOM 3689 O GLU A 236 4.849 13.021 21.676 1.00 80.16 O ATOM 3690 CB GLU A 236 3.202 11.956 19.510 1.00 81.16 C ATOM 3691 CG GLU A 236 2.820 11.111 20.728 1.00 81.96 C ATOM 3692 CD GLU A 236 2.342 9.714 20.360 1.00 82.35 C ATOM 3693 OE1 GLU A 236 1.381 9.595 19.565 1.00 82.12 O ATOM 3694 OE2 GLU A 236 2.925 8.734 20.876 1.00 82.31 O ATOM 3695 HA GLU A 236 2.527 13.800 20.365 1.00 0.00 H ATOM 3696 HB2 GLU A 236 2.414 11.853 18.764 1.00 0.00 H ATOM 3697 HB3 GLU A 236 4.136 11.567 19.106 1.00 0.00 H ATOM 3698 HG2 GLU A 236 3.693 11.020 21.375 1.00 0.00 H ATOM 3699 HG3 GLU A 236 2.021 11.620 21.267 1.00 0.00 H ATOM 3700 H GLU A 236 3.825 13.740 17.698 1.00 0.00 H ATOM 3701 N LYS A 237 5.441 14.678 20.273 1.00 79.87 N ATOM 3702 CA LYS A 237 6.646 15.040 21.018 1.00 79.24 C ATOM 3703 C LYS A 237 6.538 16.437 21.625 1.00 78.46 C ATOM 3704 O LYS A 237 7.389 16.847 22.415 1.00 78.35 O ATOM 3705 CB LYS A 237 7.883 14.936 20.124 1.00 79.64 C ATOM 3706 CG LYS A 237 8.299 13.506 19.795 1.00 80.00 C ATOM 3707 CD LYS A 237 8.914 12.805 21.000 1.00 80.53 C ATOM 3708 CE LYS A 237 10.245 13.441 21.395 1.00 80.99 C ATOM 3709 NZ LYS A 237 10.875 12.787 22.582 1.00 80.87 N ATOM 3710 HA LYS A 237 6.748 14.332 21.841 1.00 0.00 H ATOM 3711 HB2 LYS A 237 7.674 15.455 19.189 1.00 0.00 H ATOM 3712 HB3 LYS A 237 8.714 15.426 20.632 1.00 0.00 H ATOM 3713 HG2 LYS A 237 7.420 12.948 19.472 1.00 0.00 H ATOM 3714 HG3 LYS A 237 9.031 13.528 18.988 1.00 0.00 H ATOM 3715 HD2 LYS A 237 8.224 12.874 21.841 1.00 0.00 H ATOM 3716 HD3 LYS A 237 9.081 11.756 20.754 1.00 0.00 H ATOM 3717 HE2 LYS A 237 10.073 14.492 21.628 1.00 0.00 H ATOM 3718 HE3 LYS A 237 10.931 13.365 20.551 1.00 0.00 H ATOM 3719 HZ1 LYS A 237 10.234 12.861 23.398 1.00 0.00 H ATOM 3720 HZ2 LYS A 237 11.054 11.785 22.370 1.00 0.00 H ATOM 3721 HZ3 LYS A 237 11.774 13.262 22.801 1.00 0.00 H ATOM 3722 H LYS A 237 5.208 15.203 19.406 1.00 0.00 H ATOM 3723 N LEU A 238 5.485 17.159 21.252 1.00 77.79 N ATOM 3724 CA LEU A 238 5.219 18.496 21.789 1.00 76.98 C ATOM 3725 C LEU A 238 4.850 18.457 23.270 1.00 76.19 C ATOM 3726 O LEU A 238 4.747 19.498 23.923 1.00 76.04 O ATOM 3727 CB LEU A 238 4.093 19.177 21.006 1.00 76.84 C ATOM 3728 CG LEU A 238 4.389 19.648 19.583 1.00 76.73 C ATOM 3729 CD1 LEU A 238 3.121 20.152 18.917 1.00 76.45 C ATOM 3730 CD2 LEU A 238 5.452 20.728 19.598 1.00 76.65 C ATOM 3731 HA LEU A 238 6.141 19.068 21.682 1.00 0.00 H ATOM 3732 HB2 LEU A 238 3.265 18.470 20.948 1.00 0.00 H ATOM 3733 HB3 LEU A 238 3.783 20.051 21.579 1.00 0.00 H ATOM 3734 HG LEU A 238 4.765 18.803 19.006 1.00 0.00 H ATOM 3735 HD21 LEU A 238 5.100 21.574 20.188 1.00 0.00 H ATOM 3736 HD22 LEU A 238 6.366 20.330 20.040 1.00 0.00 H ATOM 3737 HD23 LEU A 238 5.652 21.053 18.577 1.00 0.00 H ATOM 3738 HD11 LEU A 238 2.387 19.347 18.879 1.00 0.00 H ATOM 3739 HD12 LEU A 238 2.718 20.986 19.491 1.00 0.00 H ATOM 3740 HD13 LEU A 238 3.351 20.483 17.904 1.00 0.00 H ATOM 3741 H LEU A 238 4.826 16.760 20.553 1.00 0.00 H ATOM 3742 N LYS A 239 4.652 17.251 23.791 1.00 75.27 N ATOM 3743 CA LYS A 239 4.245 17.064 25.177 1.00 73.86 C ATOM 3744 C LYS A 239 5.432 16.698 26.067 1.00 72.19 C ATOM 3745 O LYS A 239 5.310 16.661 27.290 1.00 72.47 O ATOM 3746 CB LYS A 239 3.139 16.004 25.275 1.00 74.99 C ATOM 3747 CG LYS A 239 1.778 16.456 24.728 1.00 76.14 C ATOM 3748 CD LYS A 239 1.789 16.628 23.207 1.00 76.55 C ATOM 3749 CE LYS A 239 0.564 17.390 22.715 1.00 76.93 C ATOM 3750 NZ LYS A 239 0.641 17.682 21.253 1.00 76.89 N ATOM 3751 HA LYS A 239 3.848 18.013 25.538 1.00 0.00 H ATOM 3752 HB2 LYS A 239 3.458 15.125 24.714 1.00 0.00 H ATOM 3753 HB3 LYS A 239 3.014 15.738 26.324 1.00 0.00 H ATOM 3754 HG2 LYS A 239 1.029 15.709 24.991 1.00 0.00 H ATOM 3755 HG3 LYS A 239 1.515 17.409 25.187 1.00 0.00 H ATOM 3756 HD2 LYS A 239 2.686 17.178 22.920 1.00 0.00 H ATOM 3757 HD3 LYS A 239 1.803 15.643 22.740 1.00 0.00 H ATOM 3758 HE2 LYS A 239 0.492 18.331 23.260 1.00 0.00 H ATOM 3759 HE3 LYS A 239 -0.326 16.791 22.909 1.00 0.00 H ATOM 3760 HZ1 LYS A 239 1.484 18.260 21.060 1.00 0.00 H ATOM 3761 HZ2 LYS A 239 0.703 16.788 20.725 1.00 0.00 H ATOM 3762 HZ3 LYS A 239 -0.211 18.201 20.959 1.00 0.00 H ATOM 3763 H LYS A 239 4.792 16.414 23.190 1.00 0.00 H ATOM 3764 N ASP A 240 6.577 16.432 25.444 1.00 69.81 N ATOM 3765 CA ASP A 240 7.797 16.110 26.176 1.00 67.22 C ATOM 3766 C ASP A 240 8.541 17.393 26.543 1.00 65.02 C ATOM 3767 O ASP A 240 8.993 18.120 25.663 1.00 65.24 O ATOM 3768 CB ASP A 240 8.690 15.183 25.343 1.00 67.43 C ATOM 3769 CG ASP A 240 10.003 14.841 26.035 1.00 67.67 C ATOM 3770 OD1 ASP A 240 10.079 14.930 27.277 1.00 67.63 O ATOM 3771 OD2 ASP A 240 10.967 14.474 25.328 1.00 68.32 O ATOM 3772 HA ASP A 240 7.531 15.589 27.096 1.00 0.00 H ATOM 3773 HB2 ASP A 240 8.147 14.258 25.151 1.00 0.00 H ATOM 3774 HB3 ASP A 240 8.914 15.675 24.396 1.00 0.00 H ATOM 3775 H ASP A 240 6.603 16.454 24.405 1.00 0.00 H ATOM 3776 N PRO A 241 8.659 17.676 27.851 1.00 63.00 N ATOM 3777 CA PRO A 241 9.372 18.848 28.364 1.00 60.92 C ATOM 3778 C PRO A 241 10.828 18.895 27.910 1.00 58.39 C ATOM 3779 O PRO A 241 11.362 19.979 27.655 1.00 58.37 O ATOM 3780 CB PRO A 241 9.309 18.657 29.883 1.00 61.55 C ATOM 3781 CG PRO A 241 8.116 17.795 30.107 1.00 62.08 C ATOM 3782 CD PRO A 241 8.084 16.865 28.939 1.00 62.54 C ATOM 3783 HA PRO A 241 8.929 19.778 28.007 1.00 0.00 H ATOM 3784 HD3 PRO A 241 8.689 15.978 29.128 1.00 0.00 H ATOM 3785 HD2 PRO A 241 7.063 16.564 28.706 1.00 0.00 H ATOM 3786 HG3 PRO A 241 7.209 18.398 30.142 1.00 0.00 H ATOM 3787 HG2 PRO A 241 8.216 17.237 31.038 1.00 0.00 H ATOM 3788 HB2 PRO A 241 10.212 18.166 30.247 1.00 0.00 H ATOM 3789 HB3 PRO A 241 9.190 19.616 30.387 1.00 0.00 H ATOM 3790 N GLY A 242 11.455 17.725 27.815 1.00 54.98 N ATOM 3791 CA GLY A 242 12.850 17.607 27.394 1.00 50.88 C ATOM 3792 C GLY A 242 13.139 18.249 26.051 1.00 48.23 C ATOM 3793 O GLY A 242 14.192 18.848 25.859 1.00 47.62 O ATOM 3794 HA3 GLY A 242 13.102 16.548 27.331 1.00 0.00 H ATOM 3795 HA2 GLY A 242 13.478 18.085 28.146 1.00 0.00 H ATOM 3796 H GLY A 242 10.931 16.858 28.050 1.00 0.00 H ATOM 3797 N VAL A 243 12.202 18.132 25.116 1.00 46.67 N ATOM 3798 CA VAL A 243 12.381 18.713 23.791 1.00 44.93 C ATOM 3799 C VAL A 243 12.313 20.242 23.841 1.00 44.03 C ATOM 3800 O VAL A 243 13.058 20.922 23.134 1.00 43.48 O ATOM 3801 CB VAL A 243 11.351 18.159 22.780 1.00 45.26 C ATOM 3802 CG1 VAL A 243 11.570 18.766 21.406 1.00 45.27 C ATOM 3803 CG2 VAL A 243 11.455 16.645 22.700 1.00 44.98 C ATOM 3804 HA VAL A 243 13.375 18.425 23.448 1.00 0.00 H ATOM 3805 HB VAL A 243 10.353 18.429 23.125 1.00 0.00 H ATOM 3806 HG11 VAL A 243 11.459 19.849 21.467 1.00 0.00 H ATOM 3807 HG12 VAL A 243 12.574 18.522 21.058 1.00 0.00 H ATOM 3808 HG13 VAL A 243 10.834 18.362 20.710 1.00 0.00 H ATOM 3809 HG21 VAL A 243 12.458 16.368 22.376 1.00 0.00 H ATOM 3810 HG22 VAL A 243 11.257 16.216 23.682 1.00 0.00 H ATOM 3811 HG23 VAL A 243 10.724 16.269 21.984 1.00 0.00 H ATOM 3812 H VAL A 243 11.325 17.617 25.333 1.00 0.00 H ATOM 3813 N TRP A 244 11.422 20.770 24.680 1.00 42.95 N ATOM 3814 CA TRP A 244 11.255 22.216 24.839 1.00 41.19 C ATOM 3815 C TRP A 244 12.479 22.854 25.476 1.00 39.76 C ATOM 3816 O TRP A 244 12.907 23.927 25.068 1.00 39.31 O ATOM 3817 CB TRP A 244 10.011 22.529 25.672 1.00 43.68 C ATOM 3818 CG TRP A 244 8.753 22.194 24.969 1.00 44.09 C ATOM 3819 CD1 TRP A 244 8.068 21.018 25.032 1.00 44.70 C ATOM 3820 CD2 TRP A 244 8.021 23.041 24.078 1.00 44.29 C ATOM 3821 NE1 TRP A 244 6.948 21.078 24.235 1.00 44.68 N ATOM 3822 CE2 TRP A 244 6.897 22.312 23.639 1.00 44.93 C ATOM 3823 CE3 TRP A 244 8.204 24.345 23.612 1.00 45.37 C ATOM 3824 CZ2 TRP A 244 5.963 22.845 22.753 1.00 44.41 C ATOM 3825 CZ3 TRP A 244 7.274 24.874 22.732 1.00 44.56 C ATOM 3826 CH2 TRP A 244 6.170 24.125 22.314 1.00 44.94 C ATOM 3827 HA TRP A 244 11.132 22.639 23.842 1.00 0.00 H ATOM 3828 HB2 TRP A 244 10.057 21.955 26.597 1.00 0.00 H ATOM 3829 HB3 TRP A 244 10.007 23.593 25.906 1.00 0.00 H ATOM 3830 HE1 TRP A 244 6.255 20.314 24.106 1.00 0.00 H ATOM 3831 HD1 TRP A 244 8.364 20.155 25.628 1.00 0.00 H ATOM 3832 HZ2 TRP A 244 5.101 22.265 22.422 1.00 0.00 H ATOM 3833 HH2 TRP A 244 5.456 24.571 21.621 1.00 0.00 H ATOM 3834 HZ3 TRP A 244 7.405 25.890 22.360 1.00 0.00 H ATOM 3835 HE3 TRP A 244 9.062 24.935 23.935 1.00 0.00 H ATOM 3836 H TRP A 244 10.824 20.132 25.242 1.00 0.00 H ATOM 3837 N ILE A 245 13.032 22.182 26.477 1.00 37.90 N ATOM 3838 CA ILE A 245 14.232 22.641 27.157 1.00 36.80 C ATOM 3839 C ILE A 245 15.432 22.674 26.208 1.00 35.98 C ATOM 3840 O ILE A 245 16.215 23.634 26.206 1.00 34.15 O ATOM 3841 CB ILE A 245 14.545 21.749 28.379 1.00 37.39 C ATOM 3842 CG1 ILE A 245 13.500 21.978 29.477 1.00 38.51 C ATOM 3843 CG2 ILE A 245 15.960 22.001 28.897 1.00 36.69 C ATOM 3844 CD1 ILE A 245 13.826 21.281 30.780 1.00 40.52 C ATOM 3845 HA ILE A 245 14.044 23.657 27.503 1.00 0.00 H ATOM 3846 HB ILE A 245 14.496 20.705 28.070 1.00 0.00 H ATOM 3847 HG12 ILE A 245 13.429 23.049 29.667 1.00 0.00 H ATOM 3848 HG13 ILE A 245 12.538 21.609 29.120 1.00 0.00 H ATOM 3849 HD11 ILE A 245 13.889 20.206 30.610 1.00 0.00 H ATOM 3850 HD12 ILE A 245 14.781 21.647 31.158 1.00 0.00 H ATOM 3851 HD13 ILE A 245 13.042 21.489 31.508 1.00 0.00 H ATOM 3852 HG21 ILE A 245 16.679 21.778 28.109 1.00 0.00 H ATOM 3853 HG22 ILE A 245 16.056 23.045 29.194 1.00 0.00 H ATOM 3854 HG23 ILE A 245 16.151 21.359 29.757 1.00 0.00 H ATOM 3855 H ILE A 245 12.590 21.293 26.787 1.00 0.00 H ATOM 3856 N ALA A 246 15.571 21.621 25.406 1.00 34.40 N ATOM 3857 CA ALA A 246 16.643 21.545 24.426 1.00 34.54 C ATOM 3858 C ALA A 246 16.493 22.656 23.392 1.00 33.07 C ATOM 3859 O ALA A 246 17.475 23.277 22.995 1.00 33.93 O ATOM 3860 CB ALA A 246 16.655 20.179 23.751 1.00 33.39 C ATOM 3861 HA ALA A 246 17.595 21.678 24.940 1.00 0.00 H ATOM 3862 HB1 ALA A 246 16.807 19.405 24.503 1.00 0.00 H ATOM 3863 HB2 ALA A 246 15.702 20.016 23.247 1.00 0.00 H ATOM 3864 HB3 ALA A 246 17.464 20.143 23.022 1.00 0.00 H ATOM 3865 H ALA A 246 14.896 20.833 25.482 1.00 0.00 H ATOM 3866 N ALA A 247 15.255 22.902 22.976 1.00 32.72 N ATOM 3867 CA ALA A 247 14.949 23.896 21.951 1.00 32.84 C ATOM 3868 C ALA A 247 15.183 25.335 22.406 1.00 33.22 C ATOM 3869 O ALA A 247 15.658 26.163 21.631 1.00 33.54 O ATOM 3870 CB ALA A 247 13.516 23.724 21.466 1.00 31.07 C ATOM 3871 HA ALA A 247 15.645 23.717 21.131 1.00 0.00 H ATOM 3872 HB1 ALA A 247 13.394 22.726 21.045 1.00 0.00 H ATOM 3873 HB2 ALA A 247 12.832 23.852 22.305 1.00 0.00 H ATOM 3874 HB3 ALA A 247 13.300 24.471 20.702 1.00 0.00 H ATOM 3875 H ALA A 247 14.471 22.364 23.398 1.00 0.00 H ATOM 3876 N VAL A 248 14.839 25.631 23.657 1.00 33.07 N ATOM 3877 CA VAL A 248 15.013 26.969 24.202 1.00 32.02 C ATOM 3878 C VAL A 248 16.485 27.221 24.490 1.00 33.09 C ATOM 3879 O VAL A 248 16.986 28.325 24.281 1.00 33.15 O ATOM 3880 CB VAL A 248 14.176 27.174 25.483 1.00 32.42 C ATOM 3881 CG1 VAL A 248 14.521 28.498 26.143 1.00 30.86 C ATOM 3882 CG2 VAL A 248 12.688 27.101 25.160 1.00 31.39 C ATOM 3883 HA VAL A 248 14.660 27.685 23.459 1.00 0.00 H ATOM 3884 HB VAL A 248 14.415 26.375 26.185 1.00 0.00 H ATOM 3885 HG11 VAL A 248 15.578 28.506 26.407 1.00 0.00 H ATOM 3886 HG12 VAL A 248 14.312 29.313 25.450 1.00 0.00 H ATOM 3887 HG13 VAL A 248 13.919 28.621 27.044 1.00 0.00 H ATOM 3888 HG21 VAL A 248 12.435 27.880 24.440 1.00 0.00 H ATOM 3889 HG22 VAL A 248 12.457 26.124 24.736 1.00 0.00 H ATOM 3890 HG23 VAL A 248 12.112 27.247 26.073 1.00 0.00 H ATOM 3891 H VAL A 248 14.435 24.887 24.261 1.00 0.00 H ATOM 3892 N GLY A 249 17.176 26.189 24.969 1.00 32.76 N ATOM 3893 CA GLY A 249 18.610 26.293 25.217 1.00 32.23 C ATOM 3894 C GLY A 249 19.381 26.554 23.931 1.00 30.12 C ATOM 3895 O GLY A 249 20.369 27.285 23.931 1.00 30.52 O ATOM 3896 HA3 GLY A 249 18.962 25.361 25.658 1.00 0.00 H ATOM 3897 HA2 GLY A 249 18.791 27.113 25.912 1.00 0.00 H ATOM 3898 H GLY A 249 16.686 25.294 25.170 1.00 0.00 H ATOM 3899 N GLN A 250 18.935 25.944 22.835 1.00 30.25 N ATOM 3900 CA GLN A 250 19.597 26.127 21.540 1.00 29.17 C ATOM 3901 C GLN A 250 19.325 27.539 21.037 1.00 28.73 C ATOM 3902 O GLN A 250 20.241 28.227 20.571 1.00 28.09 O ATOM 3903 CB GLN A 250 19.142 25.072 20.522 1.00 29.45 C ATOM 3904 CG GLN A 250 19.735 25.253 19.114 1.00 30.90 C ATOM 3905 CD GLN A 250 21.260 25.285 19.111 1.00 31.75 C ATOM 3906 OE1 GLN A 250 21.911 24.623 19.916 1.00 31.63 O ATOM 3907 NE2 GLN A 250 21.833 26.059 18.198 1.00 32.49 N ATOM 3908 HA GLN A 250 20.671 25.994 21.667 1.00 0.00 H ATOM 3909 HB2 GLN A 250 19.436 24.090 20.893 1.00 0.00 H ATOM 3910 HB3 GLN A 250 18.056 25.119 20.444 1.00 0.00 H ATOM 3911 HG2 GLN A 250 19.403 24.425 18.488 1.00 0.00 H ATOM 3912 HG3 GLN A 250 19.366 26.191 18.699 1.00 0.00 H ATOM 3913 HE22 GLN A 250 21.245 26.603 17.535 1.00 0.00 H ATOM 3914 HE21 GLN A 250 22.870 26.121 18.146 1.00 0.00 H ATOM 3915 H GLN A 250 18.101 25.326 22.899 1.00 0.00 H ATOM 3916 N ILE A 251 18.068 27.969 21.147 1.00 26.69 N ATOM 3917 CA ILE A 251 17.691 29.338 20.785 1.00 27.20 C ATOM 3918 C ILE A 251 18.554 30.361 21.530 1.00 26.43 C ATOM 3919 O ILE A 251 19.092 31.274 20.912 1.00 25.62 O ATOM 3920 CB ILE A 251 16.193 29.610 21.021 1.00 26.95 C ATOM 3921 CG1 ILE A 251 15.349 28.952 19.923 1.00 26.51 C ATOM 3922 CG2 ILE A 251 15.923 31.115 21.073 1.00 27.51 C ATOM 3923 CD1 ILE A 251 15.619 29.496 18.520 1.00 28.00 C ATOM 3924 HA ILE A 251 17.874 29.446 19.716 1.00 0.00 H ATOM 3925 HB ILE A 251 15.911 29.176 21.980 1.00 0.00 H ATOM 3926 HG12 ILE A 251 15.560 27.883 19.923 1.00 0.00 H ATOM 3927 HG13 ILE A 251 14.297 29.113 20.157 1.00 0.00 H ATOM 3928 HD11 ILE A 251 15.401 30.564 18.497 1.00 0.00 H ATOM 3929 HD12 ILE A 251 16.666 29.332 18.263 1.00 0.00 H ATOM 3930 HD13 ILE A 251 14.982 28.979 17.802 1.00 0.00 H ATOM 3931 HG21 ILE A 251 16.496 31.558 21.887 1.00 0.00 H ATOM 3932 HG22 ILE A 251 16.221 31.569 20.128 1.00 0.00 H ATOM 3933 HG23 ILE A 251 14.860 31.287 21.240 1.00 0.00 H ATOM 3934 H ILE A 251 17.337 27.317 21.498 1.00 0.00 H ATOM 3935 N PHE A 252 18.702 30.208 22.847 1.00 25.51 N ATOM 3936 CA PHE A 252 19.585 31.109 23.592 1.00 26.72 C ATOM 3937 C PHE A 252 20.998 31.043 23.046 1.00 26.86 C ATOM 3938 O PHE A 252 21.572 32.059 22.668 1.00 28.36 O ATOM 3939 CB PHE A 252 19.627 30.761 25.090 1.00 27.07 C ATOM 3940 CG PHE A 252 18.590 31.462 25.911 1.00 27.82 C ATOM 3941 CD1 PHE A 252 18.883 32.668 26.533 1.00 28.49 C ATOM 3942 CD2 PHE A 252 17.324 30.921 26.066 1.00 27.85 C ATOM 3943 CE1 PHE A 252 17.925 33.332 27.300 1.00 28.42 C ATOM 3944 CE2 PHE A 252 16.363 31.576 26.834 1.00 29.27 C ATOM 3945 CZ PHE A 252 16.668 32.783 27.449 1.00 28.82 C ATOM 3946 HA PHE A 252 19.180 32.114 23.473 1.00 0.00 H ATOM 3947 HB2 PHE A 252 19.479 29.686 25.196 1.00 0.00 H ATOM 3948 HB3 PHE A 252 20.610 31.031 25.477 1.00 0.00 H ATOM 3949 HD2 PHE A 252 17.078 29.975 25.583 1.00 0.00 H ATOM 3950 HE2 PHE A 252 15.371 31.140 26.952 1.00 0.00 H ATOM 3951 HZ PHE A 252 15.916 33.296 28.048 1.00 0.00 H ATOM 3952 HE1 PHE A 252 18.169 34.280 27.779 1.00 0.00 H ATOM 3953 HD1 PHE A 252 19.876 33.103 26.421 1.00 0.00 H ATOM 3954 H PHE A 252 18.191 29.450 23.344 1.00 0.00 H ATOM 3955 N PHE A 253 21.563 29.838 23.017 1.00 27.09 N ATOM 3956 CA PHE A 253 22.954 29.675 22.615 1.00 27.52 C ATOM 3957 C PHE A 253 23.163 30.238 21.218 1.00 26.96 C ATOM 3958 O PHE A 253 24.149 30.933 20.966 1.00 25.97 O ATOM 3959 CB PHE A 253 23.384 28.201 22.661 1.00 27.68 C ATOM 3960 CG PHE A 253 24.876 28.006 22.572 1.00 29.11 C ATOM 3961 CD1 PHE A 253 25.639 27.877 23.724 1.00 28.01 C ATOM 3962 CD2 PHE A 253 25.518 27.957 21.331 1.00 29.12 C ATOM 3963 CE1 PHE A 253 27.014 27.709 23.649 1.00 29.85 C ATOM 3964 CE2 PHE A 253 26.885 27.784 21.245 1.00 28.61 C ATOM 3965 CZ PHE A 253 27.642 27.659 22.402 1.00 29.72 C ATOM 3966 HA PHE A 253 23.574 30.226 23.322 1.00 0.00 H ATOM 3967 HB2 PHE A 253 23.035 27.769 23.599 1.00 0.00 H ATOM 3968 HB3 PHE A 253 22.917 27.679 21.826 1.00 0.00 H ATOM 3969 HD2 PHE A 253 24.931 28.057 20.418 1.00 0.00 H ATOM 3970 HE2 PHE A 253 27.370 27.746 20.269 1.00 0.00 H ATOM 3971 HZ PHE A 253 28.722 27.522 22.338 1.00 0.00 H ATOM 3972 HE1 PHE A 253 27.603 27.616 24.561 1.00 0.00 H ATOM 3973 HD1 PHE A 253 25.152 27.908 24.699 1.00 0.00 H ATOM 3974 H PHE A 253 21.005 29.002 23.285 1.00 0.00 H ATOM 3975 N THR A 254 22.226 29.948 20.320 1.00 26.54 N ATOM 3976 CA THR A 254 22.407 30.307 18.915 1.00 27.81 C ATOM 3977 C THR A 254 22.321 31.808 18.670 1.00 27.13 C ATOM 3978 O THR A 254 23.124 32.359 17.915 1.00 27.61 O ATOM 3979 CB THR A 254 21.464 29.521 17.939 1.00 27.33 C ATOM 3980 OG1 THR A 254 21.974 29.638 16.604 1.00 30.10 O ATOM 3981 CG2 THR A 254 20.041 30.041 17.970 1.00 27.37 C ATOM 3982 HA THR A 254 23.426 29.996 18.683 1.00 0.00 H ATOM 3983 HB THR A 254 21.444 28.480 18.263 1.00 0.00 H ATOM 3984 HG1 THR A 254 21.383 29.144 15.982 1.00 0.00 H ATOM 3985 HG23 THR A 254 19.646 29.955 18.982 1.00 0.00 H ATOM 3986 HG21 THR A 254 20.031 31.087 17.662 1.00 0.00 H ATOM 3987 HG22 THR A 254 19.426 29.454 17.288 1.00 0.00 H ATOM 3988 H THR A 254 21.357 29.462 20.620 1.00 0.00 H ATOM 3989 N LEU A 255 21.370 32.473 19.312 1.00 28.14 N ATOM 3990 CA LEU A 255 21.218 33.912 19.118 1.00 26.93 C ATOM 3991 C LEU A 255 22.138 34.735 20.023 1.00 27.74 C ATOM 3992 O LEU A 255 22.028 35.959 20.062 1.00 27.90 O ATOM 3993 CB LEU A 255 19.757 34.318 19.298 1.00 25.58 C ATOM 3994 CG LEU A 255 18.823 33.786 18.214 1.00 25.23 C ATOM 3995 CD1 LEU A 255 17.395 34.068 18.559 1.00 24.83 C ATOM 3996 CD2 LEU A 255 19.178 34.404 16.862 1.00 25.18 C ATOM 3997 HA LEU A 255 21.524 34.133 18.095 1.00 0.00 H ATOM 3998 HB2 LEU A 255 19.413 33.941 20.261 1.00 0.00 H ATOM 3999 HB3 LEU A 255 19.701 35.407 19.294 1.00 0.00 H ATOM 4000 HG LEU A 255 18.950 32.705 18.150 1.00 0.00 H ATOM 4001 HD21 LEU A 255 19.076 35.488 16.921 1.00 0.00 H ATOM 4002 HD22 LEU A 255 20.206 34.148 16.606 1.00 0.00 H ATOM 4003 HD23 LEU A 255 18.504 34.016 16.098 1.00 0.00 H ATOM 4004 HD11 LEU A 255 17.149 33.585 19.504 1.00 0.00 H ATOM 4005 HD12 LEU A 255 17.251 35.144 18.651 1.00 0.00 H ATOM 4006 HD13 LEU A 255 16.749 33.680 17.772 1.00 0.00 H ATOM 4007 H LEU A 255 20.730 31.967 19.957 1.00 0.00 H ATOM 4008 N SER A 256 23.047 34.063 20.734 1.00 26.88 N ATOM 4009 CA SER A 256 23.991 34.726 21.659 1.00 27.88 C ATOM 4010 C SER A 256 23.307 35.445 22.832 1.00 27.11 C ATOM 4011 O SER A 256 23.857 36.397 23.387 1.00 28.20 O ATOM 4012 CB SER A 256 24.877 35.731 20.914 1.00 28.52 C ATOM 4013 OG SER A 256 25.691 35.102 19.933 1.00 32.62 O ATOM 4014 HA SER A 256 24.595 33.920 22.075 1.00 0.00 H ATOM 4015 HB2 SER A 256 25.521 36.234 21.635 1.00 0.00 H ATOM 4016 HB3 SER A 256 24.239 36.466 20.423 1.00 0.00 H ATOM 4017 HG SER A 256 26.245 35.785 19.478 1.00 0.00 H ATOM 4018 H SER A 256 23.093 33.029 20.633 1.00 0.00 H ATOM 4019 N LEU A 257 22.116 34.994 23.207 1.00 27.72 N ATOM 4020 CA LEU A 257 21.327 35.680 24.234 1.00 27.31 C ATOM 4021 C LEU A 257 21.583 35.158 25.643 1.00 26.72 C ATOM 4022 O LEU A 257 21.664 33.943 25.863 1.00 25.26 O ATOM 4023 CB LEU A 257 19.836 35.554 23.926 1.00 26.51 C ATOM 4024 CG LEU A 257 19.359 36.103 22.579 1.00 27.64 C ATOM 4025 CD1 LEU A 257 17.945 35.617 22.286 1.00 26.90 C ATOM 4026 CD2 LEU A 257 19.440 37.614 22.550 1.00 27.88 C ATOM 4027 HA LEU A 257 21.642 36.723 24.208 1.00 0.00 H ATOM 4028 HB2 LEU A 257 19.581 34.495 23.959 1.00 0.00 H ATOM 4029 HB3 LEU A 257 19.292 36.082 24.709 1.00 0.00 H ATOM 4030 HG LEU A 257 20.018 35.727 21.796 1.00 0.00 H ATOM 4031 HD21 LEU A 257 18.810 38.026 23.339 1.00 0.00 H ATOM 4032 HD22 LEU A 257 20.473 37.924 22.709 1.00 0.00 H ATOM 4033 HD23 LEU A 257 19.095 37.977 21.582 1.00 0.00 H ATOM 4034 HD11 LEU A 257 17.936 34.528 22.252 1.00 0.00 H ATOM 4035 HD12 LEU A 257 17.273 35.963 23.072 1.00 0.00 H ATOM 4036 HD13 LEU A 257 17.617 36.014 21.325 1.00 0.00 H ATOM 4037 H LEU A 257 21.734 34.135 22.762 1.00 0.00 H ATOM 4038 N GLY A 258 21.695 36.084 26.591 1.00 25.86 N ATOM 4039 CA GLY A 258 21.905 35.732 27.983 1.00 25.13 C ATOM 4040 C GLY A 258 23.377 35.688 28.341 1.00 26.58 C ATOM 4041 O GLY A 258 23.730 35.299 29.452 1.00 24.20 O ATOM 4042 HA3 GLY A 258 21.468 34.751 28.168 1.00 0.00 H ATOM 4043 HA2 GLY A 258 21.411 36.473 28.612 1.00 0.00 H ATOM 4044 H GLY A 258 21.630 37.088 26.327 1.00 0.00 H ATOM 4045 N PHE A 259 24.234 36.096 27.400 1.00 25.86 N ATOM 4046 CA PHE A 259 25.682 36.061 27.595 1.00 26.04 C ATOM 4047 C PHE A 259 26.238 37.463 27.844 1.00 27.48 C ATOM 4048 O PHE A 259 27.451 37.636 27.943 1.00 27.66 O ATOM 4049 CB PHE A 259 26.416 35.517 26.357 1.00 25.26 C ATOM 4050 CG PHE A 259 26.100 34.088 25.989 1.00 23.92 C ATOM 4051 CD1 PHE A 259 26.968 33.060 26.338 1.00 23.54 C ATOM 4052 CD2 PHE A 259 24.966 33.775 25.250 1.00 22.68 C ATOM 4053 CE1 PHE A 259 26.699 31.746 25.982 1.00 23.48 C ATOM 4054 CE2 PHE A 259 24.689 32.453 24.891 1.00 21.63 C ATOM 4055 CZ PHE A 259 25.550 31.441 25.254 1.00 22.19 C ATOM 4056 HA PHE A 259 25.848 35.410 28.454 1.00 0.00 H ATOM 4057 HB2 PHE A 259 26.155 36.148 25.507 1.00 0.00 H ATOM 4058 HB3 PHE A 259 27.488 35.587 26.544 1.00 0.00 H ATOM 4059 HD2 PHE A 259 24.284 34.570 24.947 1.00 0.00 H ATOM 4060 HE2 PHE A 259 23.789 32.222 24.322 1.00 0.00 H ATOM 4061 HZ PHE A 259 25.335 30.410 24.974 1.00 0.00 H ATOM 4062 HE1 PHE A 259 27.387 30.952 26.272 1.00 0.00 H ATOM 4063 HD1 PHE A 259 27.874 33.289 26.900 1.00 0.00 H ATOM 4064 H PHE A 259 23.857 36.451 26.498 1.00 0.00 H ATOM 4065 N GLY A 260 25.362 38.463 27.924 1.00 27.45 N ATOM 4066 CA GLY A 260 25.789 39.854 28.077 1.00 28.85 C ATOM 4067 C GLY A 260 26.533 40.403 26.861 1.00 28.84 C ATOM 4068 O GLY A 260 27.070 41.505 26.907 1.00 29.63 O ATOM 4069 HA3 GLY A 260 26.448 39.919 28.943 1.00 0.00 H ATOM 4070 HA2 GLY A 260 24.905 40.469 28.247 1.00 0.00 H ATOM 4071 H GLY A 260 24.345 38.249 27.876 1.00 0.00 H ATOM 4072 N ALA A 261 26.547 39.643 25.769 1.00 27.70 N ATOM 4073 CA ALA A 261 27.404 39.953 24.617 1.00 28.32 C ATOM 4074 C ALA A 261 26.703 40.715 23.494 1.00 26.66 C ATOM 4075 O ALA A 261 27.329 41.506 22.802 1.00 25.72 O ATOM 4076 CB ALA A 261 28.033 38.679 24.074 1.00 27.18 C ATOM 4077 HA ALA A 261 28.174 40.626 24.994 1.00 0.00 H ATOM 4078 HB1 ALA A 261 28.636 38.212 24.853 1.00 0.00 H ATOM 4079 HB2 ALA A 261 27.247 37.992 23.761 1.00 0.00 H ATOM 4080 HB3 ALA A 261 28.666 38.923 23.221 1.00 0.00 H ATOM 4081 H ALA A 261 25.933 38.805 25.730 1.00 0.00 H ATOM 4082 N ILE A 262 25.414 40.445 23.306 1.00 27.16 N ATOM 4083 CA ILE A 262 24.589 41.241 22.408 1.00 27.75 C ATOM 4084 C ILE A 262 24.458 42.646 23.006 1.00 27.94 C ATOM 4085 O ILE A 262 24.458 43.643 22.291 1.00 28.40 O ATOM 4086 CB ILE A 262 23.183 40.620 22.215 1.00 27.17 C ATOM 4087 CG1 ILE A 262 23.258 39.316 21.414 1.00 27.02 C ATOM 4088 CG2 ILE A 262 22.240 41.607 21.536 1.00 26.97 C ATOM 4089 CD1 ILE A 262 23.603 39.489 19.938 1.00 28.27 C ATOM 4090 HA ILE A 262 25.063 41.275 21.427 1.00 0.00 H ATOM 4091 HB ILE A 262 22.787 40.389 23.204 1.00 0.00 H ATOM 4092 HG12 ILE A 262 24.020 38.682 21.868 1.00 0.00 H ATOM 4093 HG13 ILE A 262 22.289 38.821 21.480 1.00 0.00 H ATOM 4094 HD11 ILE A 262 22.845 40.109 19.459 1.00 0.00 H ATOM 4095 HD12 ILE A 262 24.577 39.970 19.848 1.00 0.00 H ATOM 4096 HD13 ILE A 262 23.633 38.512 19.456 1.00 0.00 H ATOM 4097 HG21 ILE A 262 22.147 42.501 22.152 1.00 0.00 H ATOM 4098 HG22 ILE A 262 22.641 41.877 20.559 1.00 0.00 H ATOM 4099 HG23 ILE A 262 21.260 41.145 21.413 1.00 0.00 H ATOM 4100 H ILE A 262 24.985 39.645 23.813 1.00 0.00 H ATOM 4101 N ILE A 263 24.358 42.702 24.331 1.00 28.87 N ATOM 4102 CA ILE A 263 24.279 43.955 25.067 1.00 29.54 C ATOM 4103 C ILE A 263 25.494 44.811 24.761 1.00 29.41 C ATOM 4104 O ILE A 263 25.371 45.951 24.313 1.00 28.15 O ATOM 4105 CB ILE A 263 24.262 43.713 26.595 1.00 30.41 C ATOM 4106 CG1 ILE A 263 23.229 42.653 26.987 1.00 32.00 C ATOM 4107 CG2 ILE A 263 24.035 45.020 27.347 1.00 30.01 C ATOM 4108 CD1 ILE A 263 21.897 43.187 27.363 1.00 33.26 C ATOM 4109 HA ILE A 263 23.357 44.450 24.761 1.00 0.00 H ATOM 4110 HB ILE A 263 25.240 43.326 26.882 1.00 0.00 H ATOM 4111 HG12 ILE A 263 23.097 41.979 26.140 1.00 0.00 H ATOM 4112 HG13 ILE A 263 23.622 42.095 27.837 1.00 0.00 H ATOM 4113 HD11 ILE A 263 22.003 43.854 28.219 1.00 0.00 H ATOM 4114 HD12 ILE A 263 21.477 43.738 26.521 1.00 0.00 H ATOM 4115 HD13 ILE A 263 21.236 42.360 27.624 1.00 0.00 H ATOM 4116 HG21 ILE A 263 24.838 45.718 27.110 1.00 0.00 H ATOM 4117 HG22 ILE A 263 23.079 45.449 27.048 1.00 0.00 H ATOM 4118 HG23 ILE A 263 24.027 44.824 28.419 1.00 0.00 H ATOM 4119 H ILE A 263 24.335 41.810 24.865 1.00 0.00 H ATOM 4120 N THR A 264 26.671 44.245 25.005 1.00 28.15 N ATOM 4121 CA THR A 264 27.927 44.958 24.805 1.00 28.24 C ATOM 4122 C THR A 264 28.135 45.462 23.374 1.00 28.78 C ATOM 4123 O THR A 264 28.555 46.595 23.178 1.00 27.48 O ATOM 4124 CB THR A 264 29.126 44.090 25.234 1.00 28.74 C ATOM 4125 OG1 THR A 264 29.006 43.801 26.635 1.00 28.61 O ATOM 4126 CG2 THR A 264 30.422 44.826 24.984 1.00 27.18 C ATOM 4127 HA THR A 264 27.863 45.842 25.439 1.00 0.00 H ATOM 4128 HB THR A 264 29.130 43.166 24.655 1.00 0.00 H ATOM 4129 HG1 THR A 264 29.003 44.649 27.147 1.00 0.00 H ATOM 4130 HG23 THR A 264 30.514 45.046 23.920 1.00 0.00 H ATOM 4131 HG21 THR A 264 30.425 45.757 25.550 1.00 0.00 H ATOM 4132 HG22 THR A 264 31.259 44.204 25.301 1.00 0.00 H ATOM 4133 H THR A 264 26.697 43.264 25.349 1.00 0.00 H ATOM 4134 N TYR A 265 27.848 44.620 22.382 1.00 28.72 N ATOM 4135 CA TYR A 265 27.939 45.040 20.986 1.00 28.55 C ATOM 4136 C TYR A 265 27.013 46.214 20.730 1.00 29.69 C ATOM 4137 O TYR A 265 27.398 47.183 20.089 1.00 31.89 O ATOM 4138 CB TYR A 265 27.575 43.888 20.047 1.00 26.58 C ATOM 4139 CG TYR A 265 28.763 43.127 19.507 1.00 26.42 C ATOM 4140 CD1 TYR A 265 29.923 42.979 20.259 1.00 25.28 C ATOM 4141 CD2 TYR A 265 28.717 42.543 18.248 1.00 25.82 C ATOM 4142 CE1 TYR A 265 31.009 42.270 19.762 1.00 24.62 C ATOM 4143 CE2 TYR A 265 29.797 41.834 17.743 1.00 24.32 C ATOM 4144 CZ TYR A 265 30.934 41.703 18.502 1.00 24.03 C ATOM 4145 OH TYR A 265 31.994 40.993 17.998 1.00 23.74 O ATOM 4146 HA TYR A 265 28.968 45.341 20.790 1.00 0.00 H ATOM 4147 HB3 TYR A 265 27.019 44.297 19.203 1.00 0.00 H ATOM 4148 HB2 TYR A 265 26.941 43.189 20.593 1.00 0.00 H ATOM 4149 HD2 TYR A 265 27.815 42.644 17.645 1.00 0.00 H ATOM 4150 HE2 TYR A 265 29.744 41.384 16.751 1.00 0.00 H ATOM 4151 HE1 TYR A 265 31.914 42.161 20.360 1.00 0.00 H ATOM 4152 HD1 TYR A 265 29.981 43.425 21.252 1.00 0.00 H ATOM 4153 HH TYR A 265 31.709 40.063 17.815 1.00 0.00 H ATOM 4154 H TYR A 265 27.554 43.648 22.605 1.00 0.00 H ATOM 4155 N ALA A 266 25.793 46.121 21.249 1.00 31.58 N ATOM 4156 CA ALA A 266 24.782 47.146 21.030 1.00 33.85 C ATOM 4157 C ALA A 266 25.133 48.467 21.712 1.00 34.60 C ATOM 4158 O ALA A 266 24.619 49.518 21.340 1.00 35.87 O ATOM 4159 CB ALA A 266 23.419 46.650 21.486 1.00 34.05 C ATOM 4160 HA ALA A 266 24.749 47.343 19.959 1.00 0.00 H ATOM 4161 HB1 ALA A 266 23.150 45.758 20.920 1.00 0.00 H ATOM 4162 HB2 ALA A 266 23.458 46.410 22.548 1.00 0.00 H ATOM 4163 HB3 ALA A 266 22.675 47.428 21.315 1.00 0.00 H ATOM 4164 H ALA A 266 25.553 45.292 21.829 1.00 0.00 H ATOM 4165 N SER A 267 26.019 48.422 22.699 1.00 34.53 N ATOM 4166 CA SER A 267 26.414 49.644 23.394 1.00 34.26 C ATOM 4167 C SER A 267 27.314 50.526 22.526 1.00 34.64 C ATOM 4168 O SER A 267 27.684 51.626 22.934 1.00 33.80 O ATOM 4169 CB SER A 267 27.117 49.321 24.709 1.00 31.61 C ATOM 4170 OG SER A 267 28.444 48.902 24.465 1.00 30.81 O ATOM 4171 HA SER A 267 25.500 50.198 23.607 1.00 0.00 H ATOM 4172 HB2 SER A 267 26.576 48.524 25.220 1.00 0.00 H ATOM 4173 HB3 SER A 267 27.130 50.211 25.338 1.00 0.00 H ATOM 4174 HG SER A 267 28.434 48.092 23.896 1.00 0.00 H ATOM 4175 H SER A 267 26.435 47.511 22.979 1.00 0.00 H ATOM 4176 N TYR A 268 27.674 50.035 21.342 1.00 35.86 N ATOM 4177 CA TYR A 268 28.461 50.827 20.393 1.00 35.44 C ATOM 4178 C TYR A 268 27.573 51.342 19.261 1.00 35.43 C ATOM 4179 O TYR A 268 28.045 51.991 18.327 1.00 35.42 O ATOM 4180 CB TYR A 268 29.652 50.032 19.863 1.00 34.09 C ATOM 4181 CG TYR A 268 30.548 49.530 20.976 1.00 35.41 C ATOM 4182 CD1 TYR A 268 31.379 50.408 21.673 1.00 34.21 C ATOM 4183 CD2 TYR A 268 30.558 48.186 21.338 1.00 33.73 C ATOM 4184 CE1 TYR A 268 32.194 49.963 22.694 1.00 34.63 C ATOM 4185 CE2 TYR A 268 31.377 47.731 22.363 1.00 34.41 C ATOM 4186 CZ TYR A 268 32.191 48.621 23.035 1.00 34.52 C ATOM 4187 OH TYR A 268 33.002 48.183 24.053 1.00 33.17 O ATOM 4188 HA TYR A 268 28.865 51.692 20.919 1.00 0.00 H ATOM 4189 HB3 TYR A 268 30.237 50.674 19.204 1.00 0.00 H ATOM 4190 HB2 TYR A 268 29.280 49.177 19.299 1.00 0.00 H ATOM 4191 HD2 TYR A 268 29.915 47.482 20.810 1.00 0.00 H ATOM 4192 HE2 TYR A 268 31.377 46.676 22.636 1.00 0.00 H ATOM 4193 HE1 TYR A 268 32.836 50.663 23.228 1.00 0.00 H ATOM 4194 HD1 TYR A 268 31.385 51.465 21.406 1.00 0.00 H ATOM 4195 HH TYR A 268 33.512 48.948 24.419 1.00 0.00 H ATOM 4196 H TYR A 268 27.390 49.068 21.085 1.00 0.00 H ATOM 4197 N VAL A 269 26.285 51.037 19.356 1.00 35.34 N ATOM 4198 CA VAL A 269 25.292 51.588 18.449 1.00 37.64 C ATOM 4199 C VAL A 269 24.956 52.999 18.938 1.00 39.93 C ATOM 4200 O VAL A 269 24.755 53.213 20.139 1.00 40.65 O ATOM 4201 CB VAL A 269 24.025 50.717 18.415 1.00 36.97 C ATOM 4202 CG1 VAL A 269 22.971 51.311 17.480 1.00 37.13 C ATOM 4203 CG2 VAL A 269 24.370 49.292 17.988 1.00 35.62 C ATOM 4204 HA VAL A 269 25.689 51.614 17.434 1.00 0.00 H ATOM 4205 HB VAL A 269 23.607 50.692 19.422 1.00 0.00 H ATOM 4206 HG11 VAL A 269 22.699 52.308 17.827 1.00 0.00 H ATOM 4207 HG12 VAL A 269 23.377 51.375 16.471 1.00 0.00 H ATOM 4208 HG13 VAL A 269 22.088 50.672 17.478 1.00 0.00 H ATOM 4209 HG21 VAL A 269 24.816 49.310 16.994 1.00 0.00 H ATOM 4210 HG22 VAL A 269 25.078 48.863 18.697 1.00 0.00 H ATOM 4211 HG23 VAL A 269 23.462 48.690 17.969 1.00 0.00 H ATOM 4212 H VAL A 269 25.976 50.383 20.103 1.00 0.00 H ATOM 4213 N ARG A 270 24.910 53.960 18.019 1.00 41.73 N ATOM 4214 CA ARG A 270 24.634 55.356 18.382 1.00 44.26 C ATOM 4215 C ARG A 270 23.245 55.520 18.988 1.00 45.18 C ATOM 4216 O ARG A 270 22.290 54.868 18.565 1.00 44.23 O ATOM 4217 CB ARG A 270 24.830 56.291 17.184 1.00 44.72 C ATOM 4218 CG ARG A 270 26.276 56.409 16.763 1.00 45.66 C ATOM 4219 CD ARG A 270 26.477 57.423 15.654 1.00 47.88 C ATOM 4220 NE ARG A 270 27.894 57.557 15.309 1.00 48.68 N ATOM 4221 CZ ARG A 270 28.737 58.400 15.903 1.00 48.60 C ATOM 4222 NH1 ARG A 270 28.315 59.195 16.881 1.00 48.79 N ATOM 4223 NH2 ARG A 270 30.006 58.448 15.519 1.00 48.56 N ATOM 4224 HA ARG A 270 25.356 55.638 19.148 1.00 0.00 H ATOM 4225 HB2 ARG A 270 24.253 55.906 16.343 1.00 0.00 H ATOM 4226 HB3 ARG A 270 24.463 57.282 17.452 1.00 0.00 H ATOM 4227 HG2 ARG A 270 26.868 56.713 17.626 1.00 0.00 H ATOM 4228 HG3 ARG A 270 26.619 55.435 16.413 1.00 0.00 H ATOM 4229 HD2 ARG A 270 26.098 58.390 15.983 1.00 0.00 H ATOM 4230 HD3 ARG A 270 25.925 57.099 14.772 1.00 0.00 H ATOM 4231 HE ARG A 270 28.267 56.953 14.549 1.00 0.00 H ATOM 4232 HH12 ARG A 270 28.978 59.851 17.341 1.00 0.00 H ATOM 4233 HH11 ARG A 270 27.321 59.161 17.187 1.00 0.00 H ATOM 4234 HH22 ARG A 270 30.665 59.106 15.982 1.00 0.00 H ATOM 4235 HH21 ARG A 270 30.342 57.828 14.755 1.00 0.00 H ATOM 4236 H ARG A 270 25.073 53.717 17.021 1.00 0.00 H ATOM 4237 N LYS A 271 23.159 56.406 19.976 1.00 46.80 N ATOM 4238 CA LYS A 271 21.972 56.575 20.820 1.00 48.71 C ATOM 4239 C LYS A 271 20.613 56.541 20.112 1.00 49.93 C ATOM 4240 O LYS A 271 19.654 55.990 20.655 1.00 50.00 O ATOM 4241 CB LYS A 271 22.108 57.857 21.650 1.00 50.36 C ATOM 4242 CG LYS A 271 20.968 58.109 22.622 1.00 52.83 C ATOM 4243 CD LYS A 271 21.257 59.298 23.535 1.00 55.02 C ATOM 4244 CE LYS A 271 21.695 60.528 22.742 1.00 56.51 C ATOM 4245 NZ LYS A 271 20.666 60.968 21.755 1.00 57.63 N ATOM 4246 HA LYS A 271 21.957 55.686 21.451 1.00 0.00 H ATOM 4247 HB2 LYS A 271 23.034 57.795 22.221 1.00 0.00 H ATOM 4248 HB3 LYS A 271 22.162 58.702 20.964 1.00 0.00 H ATOM 4249 HG2 LYS A 271 20.059 58.311 22.056 1.00 0.00 H ATOM 4250 HG3 LYS A 271 20.823 57.220 23.235 1.00 0.00 H ATOM 4251 HD2 LYS A 271 20.354 59.542 24.094 1.00 0.00 H ATOM 4252 HD3 LYS A 271 22.051 59.025 24.230 1.00 0.00 H ATOM 4253 HE2 LYS A 271 22.614 60.290 22.207 1.00 0.00 H ATOM 4254 HE3 LYS A 271 21.883 61.345 23.439 1.00 0.00 H ATOM 4255 HZ1 LYS A 271 20.484 60.199 21.079 1.00 0.00 H ATOM 4256 HZ2 LYS A 271 19.786 61.206 22.256 1.00 0.00 H ATOM 4257 HZ3 LYS A 271 21.013 61.805 21.244 1.00 0.00 H ATOM 4258 H LYS A 271 23.982 57.015 20.161 1.00 0.00 H ATOM 4259 N ASP A 272 20.525 57.116 18.915 1.00 50.22 N ATOM 4260 CA ASP A 272 19.245 57.183 18.206 1.00 51.27 C ATOM 4261 C ASP A 272 19.167 56.245 17.004 1.00 49.81 C ATOM 4262 O ASP A 272 18.143 56.186 16.327 1.00 49.84 O ATOM 4263 CB ASP A 272 18.950 58.624 17.770 1.00 53.52 C ATOM 4264 CG ASP A 272 18.757 59.563 18.951 1.00 55.15 C ATOM 4265 OD1 ASP A 272 17.842 59.317 19.767 1.00 55.88 O ATOM 4266 OD2 ASP A 272 19.522 60.548 19.058 1.00 56.01 O ATOM 4267 HA ASP A 272 18.486 56.847 18.913 1.00 0.00 H ATOM 4268 HB2 ASP A 272 19.784 58.985 17.169 1.00 0.00 H ATOM 4269 HB3 ASP A 272 18.041 58.628 17.168 1.00 0.00 H ATOM 4270 H ASP A 272 21.376 57.523 18.477 1.00 0.00 H ATOM 4271 N GLN A 273 20.252 55.521 16.746 1.00 48.00 N ATOM 4272 CA GLN A 273 20.319 54.567 15.641 1.00 46.49 C ATOM 4273 C GLN A 273 19.332 53.410 15.848 1.00 45.54 C ATOM 4274 O GLN A 273 19.084 52.996 16.985 1.00 45.42 O ATOM 4275 CB GLN A 273 21.752 54.054 15.503 1.00 47.31 C ATOM 4276 CG GLN A 273 22.048 53.278 14.246 1.00 47.64 C ATOM 4277 CD GLN A 273 23.526 52.978 14.091 1.00 49.07 C ATOM 4278 OE1 GLN A 273 24.373 53.567 14.772 1.00 49.62 O ATOM 4279 NE2 GLN A 273 23.847 52.057 13.188 1.00 49.01 N ATOM 4280 HA GLN A 273 20.032 55.071 14.718 1.00 0.00 H ATOM 4281 HB2 GLN A 273 22.421 54.914 15.531 1.00 0.00 H ATOM 4282 HB3 GLN A 273 21.960 53.406 16.354 1.00 0.00 H ATOM 4283 HG2 GLN A 273 21.500 52.336 14.278 1.00 0.00 H ATOM 4284 HG3 GLN A 273 21.716 53.861 13.387 1.00 0.00 H ATOM 4285 HE22 GLN A 273 23.101 51.587 12.637 1.00 0.00 H ATOM 4286 HE21 GLN A 273 24.844 51.807 13.032 1.00 0.00 H ATOM 4287 H GLN A 273 21.087 55.638 17.355 1.00 0.00 H ATOM 4288 N ASP A 274 18.765 52.908 14.750 1.00 43.06 N ATOM 4289 CA ASP A 274 17.772 51.828 14.799 1.00 42.50 C ATOM 4290 C ASP A 274 18.318 50.542 15.411 1.00 41.75 C ATOM 4291 O ASP A 274 19.492 50.202 15.229 1.00 40.23 O ATOM 4292 CB ASP A 274 17.215 51.538 13.397 1.00 42.90 C ATOM 4293 CG ASP A 274 16.618 50.136 13.267 1.00 43.90 C ATOM 4294 OD1 ASP A 274 15.396 49.977 13.467 1.00 44.01 O ATOM 4295 OD2 ASP A 274 17.371 49.184 12.965 1.00 44.81 O ATOM 4296 HA ASP A 274 16.971 52.181 15.448 1.00 0.00 H ATOM 4297 HB2 ASP A 274 16.437 52.269 13.174 1.00 0.00 H ATOM 4298 HB3 ASP A 274 18.024 51.639 12.674 1.00 0.00 H ATOM 4299 H ASP A 274 19.037 53.296 13.824 1.00 0.00 H ATOM 4300 N ILE A 275 17.454 49.843 16.143 1.00 39.73 N ATOM 4301 CA ILE A 275 17.794 48.533 16.682 1.00 38.92 C ATOM 4302 C ILE A 275 16.680 47.528 16.406 1.00 39.11 C ATOM 4303 O ILE A 275 16.893 46.325 16.512 1.00 39.23 O ATOM 4304 CB ILE A 275 18.097 48.561 18.207 1.00 38.18 C ATOM 4305 CG1 ILE A 275 16.861 48.968 19.000 1.00 37.64 C ATOM 4306 CG2 ILE A 275 19.300 49.448 18.519 1.00 36.68 C ATOM 4307 CD1 ILE A 275 17.066 48.945 20.482 1.00 38.99 C ATOM 4308 HA ILE A 275 18.707 48.226 16.172 1.00 0.00 H ATOM 4309 HB ILE A 275 18.362 47.551 18.519 1.00 0.00 H ATOM 4310 HG12 ILE A 275 16.580 49.979 18.706 1.00 0.00 H ATOM 4311 HG13 ILE A 275 16.051 48.281 18.753 1.00 0.00 H ATOM 4312 HD11 ILE A 275 17.337 47.936 20.794 1.00 0.00 H ATOM 4313 HD12 ILE A 275 17.866 49.636 20.748 1.00 0.00 H ATOM 4314 HD13 ILE A 275 16.144 49.246 20.980 1.00 0.00 H ATOM 4315 HG21 ILE A 275 20.177 49.065 17.998 1.00 0.00 H ATOM 4316 HG22 ILE A 275 19.095 50.466 18.187 1.00 0.00 H ATOM 4317 HG23 ILE A 275 19.483 49.445 19.593 1.00 0.00 H ATOM 4318 H ILE A 275 16.513 50.242 16.335 1.00 0.00 H ATOM 4319 N VAL A 276 15.492 48.020 16.053 1.00 39.45 N ATOM 4320 CA VAL A 276 14.372 47.128 15.778 1.00 39.09 C ATOM 4321 C VAL A 276 14.622 46.315 14.503 1.00 40.40 C ATOM 4322 O VAL A 276 14.565 45.083 14.532 1.00 41.37 O ATOM 4323 CB VAL A 276 13.019 47.866 15.679 1.00 38.31 C ATOM 4324 CG1 VAL A 276 11.898 46.860 15.513 1.00 38.06 C ATOM 4325 CG2 VAL A 276 12.770 48.713 16.914 1.00 37.61 C ATOM 4326 HA VAL A 276 14.305 46.453 16.631 1.00 0.00 H ATOM 4327 HB VAL A 276 13.050 48.525 14.812 1.00 0.00 H ATOM 4328 HG11 VAL A 276 12.062 46.282 14.603 1.00 0.00 H ATOM 4329 HG12 VAL A 276 11.882 46.190 16.373 1.00 0.00 H ATOM 4330 HG13 VAL A 276 10.946 47.387 15.444 1.00 0.00 H ATOM 4331 HG21 VAL A 276 12.756 48.072 17.796 1.00 0.00 H ATOM 4332 HG22 VAL A 276 13.565 49.452 17.013 1.00 0.00 H ATOM 4333 HG23 VAL A 276 11.811 49.221 16.817 1.00 0.00 H ATOM 4334 H VAL A 276 15.363 49.049 15.973 1.00 0.00 H ATOM 4335 N LEU A 277 14.904 47.001 13.395 1.00 39.19 N ATOM 4336 CA LEU A 277 15.149 46.322 12.128 1.00 38.37 C ATOM 4337 C LEU A 277 16.510 45.645 12.118 1.00 37.97 C ATOM 4338 O LEU A 277 16.653 44.522 11.627 1.00 37.02 O ATOM 4339 CB LEU A 277 15.053 47.286 10.941 1.00 38.18 C ATOM 4340 CG LEU A 277 15.227 46.589 9.588 1.00 38.39 C ATOM 4341 CD1 LEU A 277 14.092 45.594 9.364 1.00 38.52 C ATOM 4342 CD2 LEU A 277 15.309 47.594 8.438 1.00 38.91 C ATOM 4343 HA LEU A 277 14.373 45.564 12.026 1.00 0.00 H ATOM 4344 HB2 LEU A 277 14.075 47.766 10.961 1.00 0.00 H ATOM 4345 HB3 LEU A 277 15.830 48.043 11.044 1.00 0.00 H ATOM 4346 HG LEU A 277 16.173 46.048 9.606 1.00 0.00 H ATOM 4347 HD21 LEU A 277 14.392 48.182 8.405 1.00 0.00 H ATOM 4348 HD22 LEU A 277 16.161 48.255 8.595 1.00 0.00 H ATOM 4349 HD23 LEU A 277 15.432 47.058 7.497 1.00 0.00 H ATOM 4350 HD11 LEU A 277 14.104 44.847 10.157 1.00 0.00 H ATOM 4351 HD12 LEU A 277 13.139 46.123 9.376 1.00 0.00 H ATOM 4352 HD13 LEU A 277 14.225 45.104 8.399 1.00 0.00 H ATOM 4353 H LEU A 277 14.950 48.039 13.435 1.00 0.00 H ATOM 4354 N SER A 278 17.505 46.347 12.647 1.00 38.14 N ATOM 4355 CA SER A 278 18.848 45.818 12.757 1.00 38.70 C ATOM 4356 C SER A 278 18.841 44.540 13.589 1.00 38.80 C ATOM 4357 O SER A 278 19.466 43.552 13.215 1.00 39.48 O ATOM 4358 CB SER A 278 19.788 46.856 13.378 1.00 38.94 C ATOM 4359 OG SER A 278 19.994 47.946 12.494 1.00 40.26 O ATOM 4360 HA SER A 278 19.212 45.584 11.757 1.00 0.00 H ATOM 4361 HB2 SER A 278 20.747 46.385 13.594 1.00 0.00 H ATOM 4362 HB3 SER A 278 19.349 47.226 14.305 1.00 0.00 H ATOM 4363 HG SER A 278 19.126 48.379 12.298 1.00 0.00 H ATOM 4364 H SER A 278 17.313 47.309 12.994 1.00 0.00 H ATOM 4365 N GLY A 279 18.123 44.570 14.708 1.00 38.03 N ATOM 4366 CA GLY A 279 18.044 43.419 15.597 1.00 39.67 C ATOM 4367 C GLY A 279 17.381 42.233 14.931 1.00 40.25 C ATOM 4368 O GLY A 279 17.924 41.122 14.931 1.00 40.11 O ATOM 4369 HA3 GLY A 279 17.468 43.695 16.480 1.00 0.00 H ATOM 4370 HA2 GLY A 279 19.053 43.136 15.897 1.00 0.00 H ATOM 4371 H GLY A 279 17.605 45.437 14.955 1.00 0.00 H ATOM 4372 N LEU A 280 16.204 42.472 14.362 1.00 39.97 N ATOM 4373 CA LEU A 280 15.459 41.437 13.665 1.00 41.15 C ATOM 4374 C LEU A 280 16.286 40.826 12.532 1.00 41.12 C ATOM 4375 O LEU A 280 16.289 39.608 12.345 1.00 41.43 O ATOM 4376 CB LEU A 280 14.146 42.009 13.127 1.00 42.40 C ATOM 4377 CG LEU A 280 13.221 41.086 12.331 1.00 43.37 C ATOM 4378 CD1 LEU A 280 12.856 39.851 13.132 1.00 43.27 C ATOM 4379 CD2 LEU A 280 11.962 41.840 11.906 1.00 44.40 C ATOM 4380 HA LEU A 280 15.233 40.641 14.375 1.00 0.00 H ATOM 4381 HB2 LEU A 280 13.578 42.374 13.983 1.00 0.00 H ATOM 4382 HB3 LEU A 280 14.401 42.847 12.478 1.00 0.00 H ATOM 4383 HG LEU A 280 13.754 40.759 11.438 1.00 0.00 H ATOM 4384 HD21 LEU A 280 11.436 42.195 12.792 1.00 0.00 H ATOM 4385 HD22 LEU A 280 12.242 42.690 11.283 1.00 0.00 H ATOM 4386 HD23 LEU A 280 11.313 41.171 11.341 1.00 0.00 H ATOM 4387 HD11 LEU A 280 13.763 39.302 13.384 1.00 0.00 H ATOM 4388 HD12 LEU A 280 12.345 40.151 14.047 1.00 0.00 H ATOM 4389 HD13 LEU A 280 12.198 39.216 12.539 1.00 0.00 H ATOM 4390 H LEU A 280 15.803 43.430 14.417 1.00 0.00 H ATOM 4391 N THR A 281 16.990 41.676 11.788 1.00 40.71 N ATOM 4392 CA THR A 281 17.793 41.222 10.657 1.00 40.67 C ATOM 4393 C THR A 281 18.963 40.337 11.104 1.00 40.21 C ATOM 4394 O THR A 281 19.223 39.301 10.502 1.00 40.16 O ATOM 4395 CB THR A 281 18.322 42.408 9.815 1.00 41.01 C ATOM 4396 OG1 THR A 281 17.222 43.226 9.395 1.00 40.82 O ATOM 4397 CG2 THR A 281 19.074 41.909 8.585 1.00 41.22 C ATOM 4398 HA THR A 281 17.130 40.624 10.032 1.00 0.00 H ATOM 4399 HB THR A 281 19.007 42.989 10.432 1.00 0.00 H ATOM 4400 HG1 THR A 281 16.747 43.573 10.191 1.00 0.00 H ATOM 4401 HG23 THR A 281 19.911 41.287 8.900 1.00 0.00 H ATOM 4402 HG21 THR A 281 18.399 41.323 7.961 1.00 0.00 H ATOM 4403 HG22 THR A 281 19.447 42.762 8.018 1.00 0.00 H ATOM 4404 H THR A 281 16.967 42.690 12.019 1.00 0.00 H ATOM 4405 N ALA A 282 19.667 40.745 12.157 1.00 40.05 N ATOM 4406 CA ALA A 282 20.793 39.950 12.653 1.00 39.27 C ATOM 4407 C ALA A 282 20.318 38.575 13.126 1.00 38.50 C ATOM 4408 O ALA A 282 21.008 37.571 12.924 1.00 38.43 O ATOM 4409 CB ALA A 282 21.523 40.679 13.761 1.00 39.36 C ATOM 4410 HA ALA A 282 21.492 39.803 11.830 1.00 0.00 H ATOM 4411 HB1 ALA A 282 21.903 41.627 13.381 1.00 0.00 H ATOM 4412 HB2 ALA A 282 20.835 40.866 14.586 1.00 0.00 H ATOM 4413 HB3 ALA A 282 22.354 40.067 14.111 1.00 0.00 H ATOM 4414 H ALA A 282 19.416 41.636 12.632 1.00 0.00 H ATOM 4415 N ALA A 283 19.138 38.546 13.741 1.00 36.71 N ATOM 4416 CA ALA A 283 18.539 37.313 14.250 1.00 37.08 C ATOM 4417 C ALA A 283 18.034 36.394 13.130 1.00 37.78 C ATOM 4418 O ALA A 283 18.197 35.176 13.201 1.00 37.51 O ATOM 4419 CB ALA A 283 17.415 37.637 15.215 1.00 35.28 C ATOM 4420 HA ALA A 283 19.324 36.769 14.775 1.00 0.00 H ATOM 4421 HB1 ALA A 283 17.811 38.214 16.051 1.00 0.00 H ATOM 4422 HB2 ALA A 283 16.651 38.219 14.699 1.00 0.00 H ATOM 4423 HB3 ALA A 283 16.978 36.710 15.586 1.00 0.00 H ATOM 4424 H ALA A 283 18.620 39.439 13.865 1.00 0.00 H ATOM 4425 N THR A 284 17.409 36.977 12.109 1.00 37.49 N ATOM 4426 CA THR A 284 16.957 36.204 10.950 1.00 37.60 C ATOM 4427 C THR A 284 18.159 35.669 10.169 1.00 36.08 C ATOM 4428 O THR A 284 18.145 34.537 9.709 1.00 38.55 O ATOM 4429 CB THR A 284 16.027 37.020 10.028 1.00 38.53 C ATOM 4430 OG1 THR A 284 16.626 38.290 9.760 1.00 40.76 O ATOM 4431 CG2 THR A 284 14.675 37.241 10.693 1.00 37.53 C ATOM 4432 HA THR A 284 16.373 35.364 11.326 1.00 0.00 H ATOM 4433 HB THR A 284 15.880 36.467 9.100 1.00 0.00 H ATOM 4434 HG1 THR A 284 16.760 38.777 10.612 1.00 0.00 H ATOM 4435 HG23 THR A 284 14.212 36.276 10.901 1.00 0.00 H ATOM 4436 HG21 THR A 284 14.815 37.787 11.626 1.00 0.00 H ATOM 4437 HG22 THR A 284 14.034 37.818 10.027 1.00 0.00 H ATOM 4438 H THR A 284 17.238 38.003 12.135 1.00 0.00 H ATOM 4439 N LEU A 285 19.204 36.475 10.033 1.00 33.78 N ATOM 4440 CA LEU A 285 20.423 36.008 9.395 1.00 33.45 C ATOM 4441 C LEU A 285 20.968 34.748 10.089 1.00 34.61 C ATOM 4442 O LEU A 285 21.303 33.758 9.429 1.00 32.38 O ATOM 4443 CB LEU A 285 21.488 37.101 9.391 1.00 34.37 C ATOM 4444 CG LEU A 285 21.358 38.217 8.353 1.00 34.98 C ATOM 4445 CD1 LEU A 285 22.417 39.281 8.601 1.00 34.19 C ATOM 4446 CD2 LEU A 285 21.461 37.666 6.924 1.00 35.46 C ATOM 4447 HA LEU A 285 20.175 35.754 8.364 1.00 0.00 H ATOM 4448 HB2 LEU A 285 21.478 37.569 10.375 1.00 0.00 H ATOM 4449 HB3 LEU A 285 22.451 36.617 9.230 1.00 0.00 H ATOM 4450 HG LEU A 285 20.372 38.670 8.457 1.00 0.00 H ATOM 4451 HD21 LEU A 285 22.428 37.180 6.792 1.00 0.00 H ATOM 4452 HD22 LEU A 285 20.664 36.942 6.757 1.00 0.00 H ATOM 4453 HD23 LEU A 285 21.365 38.486 6.212 1.00 0.00 H ATOM 4454 HD11 LEU A 285 22.283 39.700 9.598 1.00 0.00 H ATOM 4455 HD12 LEU A 285 23.407 38.831 8.524 1.00 0.00 H ATOM 4456 HD13 LEU A 285 22.317 40.072 7.857 1.00 0.00 H ATOM 4457 H LEU A 285 19.150 37.451 10.387 1.00 0.00 H ATOM 4458 N ASN A 286 21.054 34.790 11.416 1.00 30.90 N ATOM 4459 CA ASN A 286 21.482 33.623 12.169 1.00 30.57 C ATOM 4460 C ASN A 286 20.578 32.408 11.966 1.00 30.34 C ATOM 4461 O ASN A 286 21.056 31.279 11.811 1.00 30.34 O ATOM 4462 CB ASN A 286 21.543 33.922 13.657 1.00 29.47 C ATOM 4463 CG ASN A 286 21.920 32.705 14.453 1.00 28.64 C ATOM 4464 OD1 ASN A 286 23.097 32.349 14.536 1.00 30.14 O ATOM 4465 ND2 ASN A 286 20.929 32.048 15.032 1.00 27.69 N ATOM 4466 HA ASN A 286 22.473 33.383 11.784 1.00 0.00 H ATOM 4467 HB2 ASN A 286 22.284 34.702 13.831 1.00 0.00 H ATOM 4468 HB3 ASN A 286 20.565 34.272 13.988 1.00 0.00 H ATOM 4469 HD22 ASN A 286 19.951 32.388 14.933 1.00 0.00 H ATOM 4470 HD21 ASN A 286 21.127 31.191 15.587 1.00 0.00 H ATOM 4471 H ASN A 286 20.812 35.667 11.920 1.00 0.00 H ATOM 4472 N GLU A 287 19.272 32.633 11.974 1.00 30.29 N ATOM 4473 CA GLU A 287 18.345 31.525 11.815 1.00 32.59 C ATOM 4474 C GLU A 287 18.482 30.841 10.461 1.00 33.77 C ATOM 4475 O GLU A 287 18.309 29.628 10.360 1.00 34.22 O ATOM 4476 CB GLU A 287 16.906 31.966 12.050 1.00 32.61 C ATOM 4477 CG GLU A 287 16.643 32.322 13.495 1.00 34.79 C ATOM 4478 CD GLU A 287 17.203 31.287 14.460 1.00 34.57 C ATOM 4479 OE1 GLU A 287 16.757 30.124 14.426 1.00 34.15 O ATOM 4480 OE2 GLU A 287 18.089 31.642 15.259 1.00 36.67 O ATOM 4481 HA GLU A 287 18.609 30.791 12.576 1.00 0.00 H ATOM 4482 HB2 GLU A 287 16.701 32.839 11.431 1.00 0.00 H ATOM 4483 HB3 GLU A 287 16.239 31.154 11.762 1.00 0.00 H ATOM 4484 HG2 GLU A 287 17.106 33.286 13.708 1.00 0.00 H ATOM 4485 HG3 GLU A 287 15.566 32.396 13.647 1.00 0.00 H ATOM 4486 H GLU A 287 18.911 33.601 12.094 1.00 0.00 H ATOM 4487 N LYS A 288 18.790 31.614 9.423 1.00 34.14 N ATOM 4488 CA LYS A 288 18.976 31.053 8.088 1.00 34.55 C ATOM 4489 C LYS A 288 20.258 30.232 8.045 1.00 34.65 C ATOM 4490 O LYS A 288 20.281 29.120 7.515 1.00 36.00 O ATOM 4491 CB LYS A 288 19.007 32.160 7.027 1.00 34.65 C ATOM 4492 CG LYS A 288 17.658 32.836 6.797 1.00 35.49 C ATOM 4493 CD LYS A 288 17.758 33.953 5.761 1.00 36.11 C ATOM 4494 CE LYS A 288 16.419 34.652 5.575 1.00 36.06 C ATOM 4495 NZ LYS A 288 16.509 35.800 4.629 1.00 37.38 N ATOM 4496 HA LYS A 288 18.131 30.401 7.865 1.00 0.00 H ATOM 4497 HB2 LYS A 288 19.722 32.919 7.344 1.00 0.00 H ATOM 4498 HB3 LYS A 288 19.337 31.723 6.085 1.00 0.00 H ATOM 4499 HG2 LYS A 288 16.944 32.091 6.446 1.00 0.00 H ATOM 4500 HG3 LYS A 288 17.308 33.258 7.739 1.00 0.00 H ATOM 4501 HD2 LYS A 288 18.497 34.682 6.094 1.00 0.00 H ATOM 4502 HD3 LYS A 288 18.073 33.528 4.808 1.00 0.00 H ATOM 4503 HE2 LYS A 288 16.078 35.020 6.542 1.00 0.00 H ATOM 4504 HE3 LYS A 288 15.698 33.933 5.187 1.00 0.00 H ATOM 4505 HZ1 LYS A 288 17.189 36.496 4.995 1.00 0.00 H ATOM 4506 HZ2 LYS A 288 16.827 35.458 3.700 1.00 0.00 H ATOM 4507 HZ3 LYS A 288 15.573 36.244 4.535 1.00 0.00 H ATOM 4508 H LYS A 288 18.900 32.638 9.565 1.00 0.00 H ATOM 4509 N ALA A 289 21.325 30.789 8.607 1.00 33.13 N ATOM 4510 CA ALA A 289 22.594 30.088 8.673 1.00 33.45 C ATOM 4511 C ALA A 289 22.449 28.809 9.500 1.00 33.65 C ATOM 4512 O ALA A 289 23.165 27.830 9.276 1.00 34.99 O ATOM 4513 CB ALA A 289 23.669 30.987 9.265 1.00 33.06 C ATOM 4514 HA ALA A 289 22.894 29.816 7.661 1.00 0.00 H ATOM 4515 HB1 ALA A 289 23.785 31.873 8.640 1.00 0.00 H ATOM 4516 HB2 ALA A 289 23.377 31.287 10.271 1.00 0.00 H ATOM 4517 HB3 ALA A 289 24.613 30.444 9.306 1.00 0.00 H ATOM 4518 H ALA A 289 21.250 31.746 9.007 1.00 0.00 H ATOM 4519 N GLU A 290 21.516 28.820 10.452 1.00 32.89 N ATOM 4520 CA GLU A 290 21.298 27.665 11.319 1.00 32.10 C ATOM 4521 C GLU A 290 20.429 26.575 10.689 1.00 32.42 C ATOM 4522 O GLU A 290 20.881 25.450 10.520 1.00 31.33 O ATOM 4523 CB GLU A 290 20.715 28.099 12.672 1.00 32.36 C ATOM 4524 CG GLU A 290 20.377 26.948 13.596 1.00 31.62 C ATOM 4525 CD GLU A 290 20.778 27.222 15.039 1.00 32.45 C ATOM 4526 OE1 GLU A 290 19.896 27.170 15.924 1.00 33.10 O ATOM 4527 OE2 GLU A 290 21.976 27.490 15.289 1.00 30.31 O ATOM 4528 HA GLU A 290 22.281 27.221 11.472 1.00 0.00 H ATOM 4529 HB2 GLU A 290 21.445 28.736 13.171 1.00 0.00 H ATOM 4530 HB3 GLU A 290 19.804 28.668 12.486 1.00 0.00 H ATOM 4531 HG2 GLU A 290 19.302 26.774 13.559 1.00 0.00 H ATOM 4532 HG3 GLU A 290 20.901 26.057 13.251 1.00 0.00 H ATOM 4533 H GLU A 290 20.930 29.670 10.580 1.00 0.00 H ATOM 4534 N VAL A 291 19.188 26.897 10.345 1.00 32.50 N ATOM 4535 CA VAL A 291 18.276 25.850 9.892 1.00 36.07 C ATOM 4536 C VAL A 291 18.491 25.443 8.431 1.00 37.36 C ATOM 4537 O VAL A 291 18.263 24.288 8.069 1.00 39.36 O ATOM 4538 CB VAL A 291 16.785 26.210 10.156 1.00 36.36 C ATOM 4539 CG1 VAL A 291 16.573 26.511 11.641 1.00 36.82 C ATOM 4540 CG2 VAL A 291 16.331 27.386 9.290 1.00 36.69 C ATOM 4541 HA VAL A 291 18.523 24.978 10.498 1.00 0.00 H ATOM 4542 HB VAL A 291 16.173 25.351 9.881 1.00 0.00 H ATOM 4543 HG11 VAL A 291 16.840 25.634 12.230 1.00 0.00 H ATOM 4544 HG12 VAL A 291 17.202 27.352 11.933 1.00 0.00 H ATOM 4545 HG13 VAL A 291 15.526 26.762 11.814 1.00 0.00 H ATOM 4546 HG21 VAL A 291 16.943 28.259 9.516 1.00 0.00 H ATOM 4547 HG22 VAL A 291 16.443 27.125 8.238 1.00 0.00 H ATOM 4548 HG23 VAL A 291 15.285 27.609 9.501 1.00 0.00 H ATOM 4549 H VAL A 291 18.868 27.885 10.398 1.00 0.00 H ATOM 4550 N ILE A 292 18.940 26.381 7.601 1.00 38.29 N ATOM 4551 CA ILE A 292 19.125 26.104 6.181 1.00 38.00 C ATOM 4552 C ILE A 292 20.538 25.631 5.870 1.00 38.44 C ATOM 4553 O ILE A 292 20.724 24.649 5.155 1.00 40.00 O ATOM 4554 CB ILE A 292 18.762 27.322 5.319 1.00 38.97 C ATOM 4555 CG1 ILE A 292 17.292 27.700 5.550 1.00 39.25 C ATOM 4556 CG2 ILE A 292 19.041 27.038 3.842 1.00 38.16 C ATOM 4557 CD1 ILE A 292 16.848 28.952 4.817 1.00 41.12 C ATOM 4558 HA ILE A 292 18.443 25.292 5.930 1.00 0.00 H ATOM 4559 HB ILE A 292 19.384 28.168 5.612 1.00 0.00 H ATOM 4560 HG12 ILE A 292 16.669 26.870 5.217 1.00 0.00 H ATOM 4561 HG13 ILE A 292 17.143 27.858 6.618 1.00 0.00 H ATOM 4562 HD11 ILE A 292 17.452 29.798 5.147 1.00 0.00 H ATOM 4563 HD12 ILE A 292 16.977 28.808 3.744 1.00 0.00 H ATOM 4564 HD13 ILE A 292 15.798 29.146 5.035 1.00 0.00 H ATOM 4565 HG21 ILE A 292 20.100 26.814 3.710 1.00 0.00 H ATOM 4566 HG22 ILE A 292 18.445 26.185 3.518 1.00 0.00 H ATOM 4567 HG23 ILE A 292 18.777 27.914 3.249 1.00 0.00 H ATOM 4568 H ILE A 292 19.163 27.327 7.971 1.00 0.00 H ATOM 4569 N LEU A 293 21.532 26.325 6.408 1.00 37.16 N ATOM 4570 CA LEU A 293 22.922 25.966 6.161 1.00 36.58 C ATOM 4571 C LEU A 293 23.415 24.893 7.138 1.00 37.57 C ATOM 4572 O LEU A 293 23.785 23.792 6.721 1.00 36.86 O ATOM 4573 CB LEU A 293 23.821 27.210 6.195 1.00 34.74 C ATOM 4574 CG LEU A 293 23.493 28.302 5.170 1.00 35.47 C ATOM 4575 CD1 LEU A 293 24.487 29.460 5.265 1.00 34.30 C ATOM 4576 CD2 LEU A 293 23.449 27.742 3.742 1.00 33.93 C ATOM 4577 HA LEU A 293 22.979 25.536 5.161 1.00 0.00 H ATOM 4578 HB2 LEU A 293 23.744 27.651 7.189 1.00 0.00 H ATOM 4579 HB3 LEU A 293 24.847 26.886 6.021 1.00 0.00 H ATOM 4580 HG LEU A 293 22.500 28.682 5.408 1.00 0.00 H ATOM 4581 HD21 LEU A 293 24.419 27.314 3.491 1.00 0.00 H ATOM 4582 HD22 LEU A 293 22.683 26.969 3.680 1.00 0.00 H ATOM 4583 HD23 LEU A 293 23.214 28.546 3.045 1.00 0.00 H ATOM 4584 HD11 LEU A 293 24.443 29.893 6.264 1.00 0.00 H ATOM 4585 HD12 LEU A 293 25.494 29.090 5.072 1.00 0.00 H ATOM 4586 HD13 LEU A 293 24.230 30.219 4.527 1.00 0.00 H ATOM 4587 H LEU A 293 21.315 27.140 7.017 1.00 0.00 H ATOM 4588 N GLY A 294 23.406 25.210 8.431 1.00 36.23 N ATOM 4589 CA GLY A 294 23.866 24.268 9.445 1.00 35.06 C ATOM 4590 C GLY A 294 23.137 22.942 9.389 1.00 35.89 C ATOM 4591 O GLY A 294 23.755 21.872 9.512 1.00 34.05 O ATOM 4592 HA3 GLY A 294 23.709 24.711 10.429 1.00 0.00 H ATOM 4593 HA2 GLY A 294 24.930 24.087 9.295 1.00 0.00 H ATOM 4594 H GLY A 294 23.064 26.148 8.724 1.00 0.00 H ATOM 4595 N GLY A 295 21.820 23.012 9.199 1.00 34.98 N ATOM 4596 CA GLY A 295 20.978 21.825 9.163 1.00 35.43 C ATOM 4597 C GLY A 295 21.120 20.963 7.919 1.00 36.77 C ATOM 4598 O GLY A 295 20.850 19.757 7.967 1.00 36.59 O ATOM 4599 HA3 GLY A 295 19.939 22.147 9.233 1.00 0.00 H ATOM 4600 HA2 GLY A 295 21.225 21.210 10.029 1.00 0.00 H ATOM 4601 H GLY A 295 21.379 23.945 9.072 1.00 0.00 H ATOM 4602 N SER A 296 21.541 21.574 6.810 1.00 36.81 N ATOM 4603 CA SER A 296 21.655 20.876 5.515 1.00 37.70 C ATOM 4604 C SER A 296 23.015 20.228 5.259 1.00 38.29 C ATOM 4605 O SER A 296 23.204 19.573 4.232 1.00 40.25 O ATOM 4606 CB SER A 296 21.335 21.825 4.350 1.00 36.87 C ATOM 4607 OG SER A 296 20.004 22.299 4.422 1.00 35.92 O ATOM 4608 HA SER A 296 20.924 20.070 5.573 1.00 0.00 H ATOM 4609 HB2 SER A 296 21.471 21.291 3.409 1.00 0.00 H ATOM 4610 HB3 SER A 296 22.017 22.675 4.386 1.00 0.00 H ATOM 4611 HG SER A 296 19.875 22.789 5.272 1.00 0.00 H ATOM 4612 H SER A 296 21.799 22.580 6.860 1.00 0.00 H ATOM 4613 N ILE A 297 23.962 20.410 6.173 1.00 38.28 N ATOM 4614 CA ILE A 297 25.284 19.815 5.999 1.00 38.82 C ATOM 4615 C ILE A 297 25.450 18.473 6.730 1.00 39.90 C ATOM 4616 O ILE A 297 25.465 17.412 6.092 1.00 39.63 O ATOM 4617 CB ILE A 297 26.400 20.793 6.406 1.00 38.10 C ATOM 4618 CG1 ILE A 297 26.312 22.056 5.550 1.00 37.73 C ATOM 4619 CG2 ILE A 297 27.769 20.135 6.279 1.00 37.91 C ATOM 4620 CD1 ILE A 297 27.348 23.117 5.879 1.00 37.91 C ATOM 4621 HA ILE A 297 25.373 19.604 4.933 1.00 0.00 H ATOM 4622 HB ILE A 297 26.267 21.070 7.452 1.00 0.00 H ATOM 4623 HG12 ILE A 297 26.439 21.769 4.506 1.00 0.00 H ATOM 4624 HG13 ILE A 297 25.323 22.492 5.688 1.00 0.00 H ATOM 4625 HD11 ILE A 297 27.230 23.429 6.917 1.00 0.00 H ATOM 4626 HD12 ILE A 297 28.347 22.705 5.734 1.00 0.00 H ATOM 4627 HD13 ILE A 297 27.208 23.975 5.222 1.00 0.00 H ATOM 4628 HG21 ILE A 297 27.812 19.261 6.929 1.00 0.00 H ATOM 4629 HG22 ILE A 297 27.929 19.829 5.245 1.00 0.00 H ATOM 4630 HG23 ILE A 297 28.541 20.846 6.572 1.00 0.00 H ATOM 4631 H ILE A 297 23.760 20.981 7.019 1.00 0.00 H ATOM 4632 N SER A 298 25.562 18.530 8.056 1.00 39.49 N ATOM 4633 CA SER A 298 25.883 17.357 8.888 1.00 40.70 C ATOM 4634 C SER A 298 24.884 16.216 8.844 1.00 39.62 C ATOM 4635 O SER A 298 25.264 15.077 8.603 1.00 39.93 O ATOM 4636 CB SER A 298 26.076 17.772 10.353 1.00 41.46 C ATOM 4637 OG SER A 298 27.324 18.406 10.532 1.00 44.51 O ATOM 4638 HA SER A 298 26.802 16.972 8.446 1.00 0.00 H ATOM 4639 HB2 SER A 298 26.031 16.885 10.985 1.00 0.00 H ATOM 4640 HB3 SER A 298 25.280 18.461 10.638 1.00 0.00 H ATOM 4641 HG SER A 298 27.428 18.665 11.482 1.00 0.00 H ATOM 4642 H SER A 298 25.416 19.446 8.526 1.00 0.00 H ATOM 4643 N ILE A 299 23.617 16.522 9.100 1.00 40.18 N ATOM 4644 CA ILE A 299 22.576 15.502 9.135 1.00 40.86 C ATOM 4645 C ILE A 299 22.397 14.806 7.774 1.00 40.56 C ATOM 4646 O ILE A 299 22.534 13.584 7.698 1.00 41.43 O ATOM 4647 CB ILE A 299 21.221 16.060 9.675 1.00 41.98 C ATOM 4648 CG1 ILE A 299 21.329 16.397 11.166 1.00 42.88 C ATOM 4649 CG2 ILE A 299 20.081 15.070 9.443 1.00 41.90 C ATOM 4650 CD1 ILE A 299 21.737 15.229 12.028 1.00 44.04 C ATOM 4651 HA ILE A 299 22.915 14.743 9.841 1.00 0.00 H ATOM 4652 HB ILE A 299 20.998 16.973 9.123 1.00 0.00 H ATOM 4653 HG12 ILE A 299 22.069 17.188 11.287 1.00 0.00 H ATOM 4654 HG13 ILE A 299 20.358 16.754 11.509 1.00 0.00 H ATOM 4655 HD11 ILE A 299 21.001 14.431 11.929 1.00 0.00 H ATOM 4656 HD12 ILE A 299 22.713 14.866 11.707 1.00 0.00 H ATOM 4657 HD13 ILE A 299 21.791 15.549 13.069 1.00 0.00 H ATOM 4658 HG21 ILE A 299 19.978 14.881 8.375 1.00 0.00 H ATOM 4659 HG22 ILE A 299 20.302 14.136 9.959 1.00 0.00 H ATOM 4660 HG23 ILE A 299 19.153 15.490 9.831 1.00 0.00 H ATOM 4661 H ILE A 299 23.361 17.514 9.280 1.00 0.00 H ATOM 4662 N PRO A 300 22.111 15.573 6.698 1.00 39.24 N ATOM 4663 CA PRO A 300 21.903 14.913 5.404 1.00 38.18 C ATOM 4664 C PRO A 300 23.086 14.046 4.988 1.00 36.84 C ATOM 4665 O PRO A 300 22.888 12.979 4.419 1.00 38.65 O ATOM 4666 CB PRO A 300 21.721 16.086 4.436 1.00 37.67 C ATOM 4667 CG PRO A 300 21.205 17.188 5.299 1.00 38.36 C ATOM 4668 CD PRO A 300 21.958 17.035 6.582 1.00 38.60 C ATOM 4669 HA PRO A 300 21.056 14.227 5.428 1.00 0.00 H ATOM 4670 HD3 PRO A 300 22.928 17.529 6.530 1.00 0.00 H ATOM 4671 HD2 PRO A 300 21.391 17.439 7.421 1.00 0.00 H ATOM 4672 HG3 PRO A 300 20.133 17.080 5.465 1.00 0.00 H ATOM 4673 HG2 PRO A 300 21.405 18.159 4.847 1.00 0.00 H ATOM 4674 HB2 PRO A 300 22.671 16.363 3.979 1.00 0.00 H ATOM 4675 HB3 PRO A 300 21.003 15.836 3.655 1.00 0.00 H ATOM 4676 N ALA A 301 24.304 14.493 5.274 1.00 36.11 N ATOM 4677 CA ALA A 301 25.490 13.699 4.952 1.00 35.75 C ATOM 4678 C ALA A 301 25.536 12.402 5.760 1.00 37.16 C ATOM 4679 O ALA A 301 25.806 11.325 5.212 1.00 38.14 O ATOM 4680 CB ALA A 301 26.752 14.508 5.170 1.00 34.76 C ATOM 4681 HA ALA A 301 25.428 13.429 3.898 1.00 0.00 H ATOM 4682 HB1 ALA A 301 26.733 15.389 4.529 1.00 0.00 H ATOM 4683 HB2 ALA A 301 26.808 14.818 6.214 1.00 0.00 H ATOM 4684 HB3 ALA A 301 27.621 13.897 4.924 1.00 0.00 H ATOM 4685 H ALA A 301 24.416 15.420 5.733 1.00 0.00 H ATOM 4686 N ALA A 302 25.268 12.507 7.061 1.00 37.88 N ATOM 4687 CA ALA A 302 25.283 11.342 7.948 1.00 38.67 C ATOM 4688 C ALA A 302 24.194 10.339 7.578 1.00 38.64 C ATOM 4689 O ALA A 302 24.438 9.139 7.544 1.00 38.92 O ATOM 4690 CB ALA A 302 25.150 11.770 9.409 1.00 37.47 C ATOM 4691 HA ALA A 302 26.245 10.846 7.820 1.00 0.00 H ATOM 4692 HB1 ALA A 302 25.982 12.423 9.672 1.00 0.00 H ATOM 4693 HB2 ALA A 302 24.210 12.304 9.546 1.00 0.00 H ATOM 4694 HB3 ALA A 302 25.164 10.887 10.048 1.00 0.00 H ATOM 4695 H ALA A 302 25.042 13.442 7.457 1.00 0.00 H ATOM 4696 N VAL A 303 22.998 10.845 7.299 1.00 39.35 N ATOM 4697 CA VAL A 303 21.868 10.005 6.933 1.00 41.16 C ATOM 4698 C VAL A 303 22.061 9.357 5.554 1.00 42.25 C ATOM 4699 O VAL A 303 21.611 8.234 5.318 1.00 43.17 O ATOM 4700 CB VAL A 303 20.545 10.810 6.975 1.00 41.06 C ATOM 4701 CG1 VAL A 303 19.390 9.993 6.426 1.00 42.06 C ATOM 4702 CG2 VAL A 303 20.242 11.257 8.398 1.00 41.13 C ATOM 4703 HA VAL A 303 21.810 9.203 7.669 1.00 0.00 H ATOM 4704 HB VAL A 303 20.667 11.691 6.345 1.00 0.00 H ATOM 4705 HG11 VAL A 303 19.599 9.719 5.392 1.00 0.00 H ATOM 4706 HG12 VAL A 303 19.268 9.090 7.025 1.00 0.00 H ATOM 4707 HG13 VAL A 303 18.476 10.585 6.469 1.00 0.00 H ATOM 4708 HG21 VAL A 303 20.146 10.381 9.040 1.00 0.00 H ATOM 4709 HG22 VAL A 303 21.054 11.888 8.760 1.00 0.00 H ATOM 4710 HG23 VAL A 303 19.309 11.821 8.409 1.00 0.00 H ATOM 4711 H VAL A 303 22.865 11.875 7.344 1.00 0.00 H ATOM 4712 N ALA A 304 22.733 10.061 4.649 1.00 42.50 N ATOM 4713 CA ALA A 304 22.962 9.539 3.303 1.00 42.94 C ATOM 4714 C ALA A 304 23.890 8.335 3.341 1.00 44.35 C ATOM 4715 O ALA A 304 23.750 7.411 2.548 1.00 44.43 O ATOM 4716 CB ALA A 304 23.540 10.612 2.405 1.00 42.15 C ATOM 4717 HA ALA A 304 22.001 9.224 2.897 1.00 0.00 H ATOM 4718 HB1 ALA A 304 22.844 11.448 2.346 1.00 0.00 H ATOM 4719 HB2 ALA A 304 24.489 10.956 2.817 1.00 0.00 H ATOM 4720 HB3 ALA A 304 23.702 10.201 1.408 1.00 0.00 H ATOM 4721 H ALA A 304 23.102 10.999 4.903 1.00 0.00 H ATOM 4722 N PHE A 305 24.838 8.350 4.271 1.00 45.04 N ATOM 4723 CA PHE A 305 25.806 7.271 4.380 1.00 45.64 C ATOM 4724 C PHE A 305 25.402 6.160 5.354 1.00 46.01 C ATOM 4725 O PHE A 305 25.788 5.010 5.166 1.00 46.49 O ATOM 4726 CB PHE A 305 27.174 7.831 4.766 1.00 45.49 C ATOM 4727 CG PHE A 305 28.030 8.206 3.593 1.00 46.56 C ATOM 4728 CD1 PHE A 305 27.650 9.225 2.730 1.00 47.00 C ATOM 4729 CD2 PHE A 305 29.227 7.544 3.357 1.00 46.82 C ATOM 4730 CE1 PHE A 305 28.450 9.575 1.640 1.00 47.80 C ATOM 4731 CE2 PHE A 305 30.032 7.886 2.272 1.00 47.61 C ATOM 4732 CZ PHE A 305 29.642 8.906 1.412 1.00 47.00 C ATOM 4733 HA PHE A 305 25.847 6.807 3.395 1.00 0.00 H ATOM 4734 HB2 PHE A 305 27.021 8.720 5.378 1.00 0.00 H ATOM 4735 HB3 PHE A 305 27.702 7.077 5.349 1.00 0.00 H ATOM 4736 HD2 PHE A 305 29.542 6.746 4.029 1.00 0.00 H ATOM 4737 HE2 PHE A 305 30.967 7.354 2.098 1.00 0.00 H ATOM 4738 HZ PHE A 305 30.270 9.178 0.564 1.00 0.00 H ATOM 4739 HE1 PHE A 305 28.137 10.374 0.969 1.00 0.00 H ATOM 4740 HD1 PHE A 305 26.716 9.758 2.905 1.00 0.00 H ATOM 4741 H PHE A 305 24.889 9.149 4.934 1.00 0.00 H ATOM 4742 N PHE A 306 24.623 6.496 6.380 1.00 46.55 N ATOM 4743 CA PHE A 306 24.318 5.531 7.445 1.00 45.62 C ATOM 4744 C PHE A 306 22.834 5.217 7.670 1.00 46.15 C ATOM 4745 O PHE A 306 22.508 4.257 8.369 1.00 45.27 O ATOM 4746 CB PHE A 306 24.917 6.012 8.766 1.00 45.19 C ATOM 4747 CG PHE A 306 26.408 6.195 8.731 1.00 46.25 C ATOM 4748 CD1 PHE A 306 27.256 5.098 8.689 1.00 46.38 C ATOM 4749 CD2 PHE A 306 26.965 7.467 8.759 1.00 46.12 C ATOM 4750 CE1 PHE A 306 28.632 5.269 8.664 1.00 47.34 C ATOM 4751 CE2 PHE A 306 28.338 7.643 8.735 1.00 45.50 C ATOM 4752 CZ PHE A 306 29.171 6.545 8.687 1.00 45.97 C ATOM 4753 HA PHE A 306 24.765 4.600 7.097 1.00 0.00 H ATOM 4754 HB2 PHE A 306 24.460 6.968 9.022 1.00 0.00 H ATOM 4755 HB3 PHE A 306 24.679 5.279 9.537 1.00 0.00 H ATOM 4756 HD2 PHE A 306 26.312 8.339 8.800 1.00 0.00 H ATOM 4757 HE2 PHE A 306 28.760 8.648 8.754 1.00 0.00 H ATOM 4758 HZ PHE A 306 30.252 6.681 8.667 1.00 0.00 H ATOM 4759 HE1 PHE A 306 29.289 4.400 8.626 1.00 0.00 H ATOM 4760 HD1 PHE A 306 26.837 4.092 8.676 1.00 0.00 H ATOM 4761 H PHE A 306 24.225 7.455 6.428 1.00 0.00 H ATOM 4762 N GLY A 307 21.944 6.015 7.090 1.00 46.79 N ATOM 4763 CA GLY A 307 20.506 5.861 7.331 1.00 48.02 C ATOM 4764 C GLY A 307 20.095 6.695 8.533 1.00 49.17 C ATOM 4765 O GLY A 307 20.936 7.052 9.360 1.00 48.58 O ATOM 4766 HA3 GLY A 307 20.281 4.812 7.524 1.00 0.00 H ATOM 4767 HA2 GLY A 307 19.954 6.194 6.453 1.00 0.00 H ATOM 4768 H GLY A 307 22.275 6.766 6.451 1.00 0.00 H ATOM 4769 N VAL A 308 18.803 7.003 8.638 1.00 50.43 N ATOM 4770 CA VAL A 308 18.299 7.874 9.709 1.00 51.09 C ATOM 4771 C VAL A 308 18.643 7.395 11.126 1.00 51.67 C ATOM 4772 O VAL A 308 19.203 8.154 11.922 1.00 52.30 O ATOM 4773 CB VAL A 308 16.765 8.104 9.595 1.00 51.59 C ATOM 4774 CG1 VAL A 308 16.242 8.886 10.789 1.00 51.60 C ATOM 4775 CG2 VAL A 308 16.428 8.836 8.306 1.00 52.35 C ATOM 4776 HA VAL A 308 18.822 8.818 9.558 1.00 0.00 H ATOM 4777 HB VAL A 308 16.281 7.128 9.583 1.00 0.00 H ATOM 4778 HG11 VAL A 308 16.446 8.329 11.704 1.00 0.00 H ATOM 4779 HG12 VAL A 308 16.739 9.855 10.833 1.00 0.00 H ATOM 4780 HG13 VAL A 308 15.167 9.032 10.683 1.00 0.00 H ATOM 4781 HG21 VAL A 308 16.932 9.802 8.296 1.00 0.00 H ATOM 4782 HG22 VAL A 308 16.761 8.242 7.455 1.00 0.00 H ATOM 4783 HG23 VAL A 308 15.350 8.987 8.246 1.00 0.00 H ATOM 4784 H VAL A 308 18.133 6.616 7.943 1.00 0.00 H ATOM 4785 N ALA A 309 18.313 6.138 11.425 1.00 52.12 N ATOM 4786 CA ALA A 309 18.510 5.561 12.762 1.00 51.76 C ATOM 4787 C ALA A 309 19.963 5.569 13.242 1.00 51.47 C ATOM 4788 O ALA A 309 20.230 5.827 14.420 1.00 51.78 O ATOM 4789 CB ALA A 309 17.941 4.143 12.819 1.00 51.81 C ATOM 4790 HA ALA A 309 17.966 6.211 13.448 1.00 0.00 H ATOM 4791 HB1 ALA A 309 16.874 4.172 12.598 1.00 0.00 H ATOM 4792 HB2 ALA A 309 18.449 3.519 12.084 1.00 0.00 H ATOM 4793 HB3 ALA A 309 18.095 3.731 13.816 1.00 0.00 H ATOM 4794 H ALA A 309 17.899 5.541 10.681 1.00 0.00 H ATOM 4795 N ASN A 310 20.897 5.284 12.340 1.00 51.19 N ATOM 4796 CA ASN A 310 22.319 5.304 12.687 1.00 50.90 C ATOM 4797 C ASN A 310 22.840 6.713 12.937 1.00 50.13 C ATOM 4798 O ASN A 310 23.697 6.920 13.799 1.00 48.53 O ATOM 4799 CB ASN A 310 23.163 4.633 11.604 1.00 51.98 C ATOM 4800 CG ASN A 310 23.199 3.125 11.739 1.00 53.55 C ATOM 4801 OD1 ASN A 310 23.080 2.582 12.839 1.00 54.05 O ATOM 4802 ND2 ASN A 310 23.375 2.438 10.616 1.00 53.73 N ATOM 4803 HA ASN A 310 22.411 4.742 13.616 1.00 0.00 H ATOM 4804 HB2 ASN A 310 22.745 4.886 10.630 1.00 0.00 H ATOM 4805 HB3 ASN A 310 24.182 5.013 11.671 1.00 0.00 H ATOM 4806 HD22 ASN A 310 23.471 2.939 9.710 1.00 0.00 H ATOM 4807 HD21 ASN A 310 23.417 1.399 10.643 1.00 0.00 H ATOM 4808 H ASN A 310 20.612 5.042 11.369 1.00 0.00 H ATOM 4809 N ALA A 311 22.315 7.672 12.176 1.00 49.60 N ATOM 4810 CA ALA A 311 22.724 9.070 12.287 1.00 49.00 C ATOM 4811 C ALA A 311 22.344 9.626 13.652 1.00 48.79 C ATOM 4812 O ALA A 311 23.168 10.237 14.335 1.00 48.72 O ATOM 4813 CB ALA A 311 22.090 9.892 11.187 1.00 48.77 C ATOM 4814 HA ALA A 311 23.807 9.125 12.180 1.00 0.00 H ATOM 4815 HB1 ALA A 311 22.405 9.505 10.218 1.00 0.00 H ATOM 4816 HB2 ALA A 311 21.005 9.831 11.269 1.00 0.00 H ATOM 4817 HB3 ALA A 311 22.405 10.931 11.284 1.00 0.00 H ATOM 4818 H ALA A 311 21.588 7.416 11.478 1.00 0.00 H ATOM 4819 N VAL A 312 21.088 9.402 14.036 1.00 48.09 N ATOM 4820 CA VAL A 312 20.575 9.794 15.347 1.00 47.44 C ATOM 4821 C VAL A 312 21.439 9.226 16.475 1.00 47.11 C ATOM 4822 O VAL A 312 21.703 9.913 17.465 1.00 46.85 O ATOM 4823 CB VAL A 312 19.110 9.332 15.533 1.00 47.09 C ATOM 4824 CG1 VAL A 312 18.635 9.586 16.957 1.00 47.26 C ATOM 4825 CG2 VAL A 312 18.203 10.029 14.533 1.00 46.28 C ATOM 4826 HA VAL A 312 20.611 10.882 15.393 1.00 0.00 H ATOM 4827 HB VAL A 312 19.066 8.258 15.351 1.00 0.00 H ATOM 4828 HG11 VAL A 312 19.267 9.035 17.653 1.00 0.00 H ATOM 4829 HG12 VAL A 312 18.696 10.652 17.174 1.00 0.00 H ATOM 4830 HG13 VAL A 312 17.603 9.252 17.059 1.00 0.00 H ATOM 4831 HG21 VAL A 312 18.258 11.107 14.685 1.00 0.00 H ATOM 4832 HG22 VAL A 312 18.526 9.786 13.521 1.00 0.00 H ATOM 4833 HG23 VAL A 312 17.177 9.692 14.679 1.00 0.00 H ATOM 4834 H VAL A 312 20.443 8.927 13.373 1.00 0.00 H ATOM 4835 N ALA A 313 21.878 7.977 16.309 1.00 46.43 N ATOM 4836 CA ALA A 313 22.739 7.305 17.283 1.00 46.41 C ATOM 4837 C ALA A 313 24.113 7.961 17.354 1.00 47.67 C ATOM 4838 O ALA A 313 24.689 8.114 18.439 1.00 47.05 O ATOM 4839 CB ALA A 313 22.877 5.831 16.945 1.00 46.37 C ATOM 4840 HA ALA A 313 22.269 7.399 18.262 1.00 0.00 H ATOM 4841 HB1 ALA A 313 21.893 5.363 16.959 1.00 0.00 H ATOM 4842 HB2 ALA A 313 23.316 5.727 15.953 1.00 0.00 H ATOM 4843 HB3 ALA A 313 23.521 5.350 17.681 1.00 0.00 H ATOM 4844 H ALA A 313 21.597 7.460 15.452 1.00 0.00 H ATOM 4845 N ILE A 314 24.634 8.343 16.190 1.00 48.53 N ATOM 4846 CA ILE A 314 25.902 9.060 16.106 1.00 49.91 C ATOM 4847 C ILE A 314 25.807 10.399 16.837 1.00 49.84 C ATOM 4848 O ILE A 314 26.660 10.725 17.662 1.00 50.68 O ATOM 4849 CB ILE A 314 26.331 9.281 14.635 1.00 50.55 C ATOM 4850 CG1 ILE A 314 26.781 7.954 14.011 1.00 50.84 C ATOM 4851 CG2 ILE A 314 27.438 10.332 14.546 1.00 50.29 C ATOM 4852 CD1 ILE A 314 26.789 7.945 12.486 1.00 51.24 C ATOM 4853 HA ILE A 314 26.663 8.446 16.588 1.00 0.00 H ATOM 4854 HB ILE A 314 25.474 9.652 14.073 1.00 0.00 H ATOM 4855 HG12 ILE A 314 27.791 7.739 14.359 1.00 0.00 H ATOM 4856 HG13 ILE A 314 26.106 7.170 14.353 1.00 0.00 H ATOM 4857 HD11 ILE A 314 25.783 8.145 12.117 1.00 0.00 H ATOM 4858 HD12 ILE A 314 27.470 8.715 12.123 1.00 0.00 H ATOM 4859 HD13 ILE A 314 27.120 6.969 12.131 1.00 0.00 H ATOM 4860 HG21 ILE A 314 27.075 11.276 14.953 1.00 0.00 H ATOM 4861 HG22 ILE A 314 28.303 9.997 15.119 1.00 0.00 H ATOM 4862 HG23 ILE A 314 27.723 10.470 13.503 1.00 0.00 H ATOM 4863 H ILE A 314 24.121 8.123 15.313 1.00 0.00 H ATOM 4864 N ALA A 315 24.761 11.166 16.540 1.00 49.87 N ATOM 4865 CA ALA A 315 24.548 12.462 17.186 1.00 49.89 C ATOM 4866 C ALA A 315 24.494 12.335 18.707 1.00 50.15 C ATOM 4867 O ALA A 315 25.098 13.137 19.420 1.00 50.24 O ATOM 4868 CB ALA A 315 23.286 13.116 16.661 1.00 49.89 C ATOM 4869 HA ALA A 315 25.400 13.095 16.941 1.00 0.00 H ATOM 4870 HB1 ALA A 315 23.377 13.267 15.585 1.00 0.00 H ATOM 4871 HB2 ALA A 315 22.431 12.472 16.868 1.00 0.00 H ATOM 4872 HB3 ALA A 315 23.145 14.078 17.153 1.00 0.00 H ATOM 4873 H ALA A 315 24.077 10.836 15.830 1.00 0.00 H ATOM 4874 N LYS A 316 23.774 11.322 19.192 1.00 50.04 N ATOM 4875 CA LYS A 316 23.673 11.049 20.626 1.00 50.57 C ATOM 4876 C LYS A 316 25.013 10.650 21.250 1.00 50.68 C ATOM 4877 O LYS A 316 25.211 10.810 22.454 1.00 51.23 O ATOM 4878 CB LYS A 316 22.654 9.936 20.895 1.00 51.23 C ATOM 4879 CG LYS A 316 21.203 10.282 20.589 1.00 51.71 C ATOM 4880 CD LYS A 316 20.287 9.154 21.050 1.00 53.64 C ATOM 4881 CE LYS A 316 18.829 9.386 20.657 1.00 54.02 C ATOM 4882 NZ LYS A 316 18.260 10.623 21.256 1.00 54.65 N ATOM 4883 HA LYS A 316 23.348 11.981 21.088 1.00 0.00 H ATOM 4884 HB2 LYS A 316 22.929 9.075 20.286 1.00 0.00 H ATOM 4885 HB3 LYS A 316 22.720 9.669 21.950 1.00 0.00 H ATOM 4886 HG2 LYS A 316 20.934 11.201 21.110 1.00 0.00 H ATOM 4887 HG3 LYS A 316 21.085 10.426 19.515 1.00 0.00 H ATOM 4888 HD2 LYS A 316 20.627 8.221 20.599 1.00 0.00 H ATOM 4889 HD3 LYS A 316 20.348 9.075 22.135 1.00 0.00 H ATOM 4890 HE2 LYS A 316 18.238 8.533 20.991 1.00 0.00 H ATOM 4891 HE3 LYS A 316 18.769 9.465 19.572 1.00 0.00 H ATOM 4892 HZ1 LYS A 316 18.303 10.556 22.293 1.00 0.00 H ATOM 4893 HZ2 LYS A 316 18.810 11.446 20.937 1.00 0.00 H ATOM 4894 HZ3 LYS A 316 17.270 10.729 20.955 1.00 0.00 H ATOM 4895 H LYS A 316 23.266 10.704 18.527 1.00 0.00 H ATOM 4896 N ALA A 317 25.924 10.135 20.430 1.00 50.90 N ATOM 4897 CA ALA A 317 27.202 9.602 20.915 1.00 51.93 C ATOM 4898 C ALA A 317 28.038 10.644 21.633 1.00 52.02 C ATOM 4899 O ALA A 317 28.708 10.346 22.622 1.00 53.38 O ATOM 4900 CB ALA A 317 27.995 8.986 19.770 1.00 51.55 C ATOM 4901 HA ALA A 317 26.961 8.829 21.644 1.00 0.00 H ATOM 4902 HB1 ALA A 317 27.419 8.174 19.326 1.00 0.00 H ATOM 4903 HB2 ALA A 317 28.193 9.748 19.016 1.00 0.00 H ATOM 4904 HB3 ALA A 317 28.939 8.597 20.152 1.00 0.00 H ATOM 4905 H ALA A 317 25.724 10.109 19.410 1.00 0.00 H ATOM 4906 N GLY A 318 27.995 11.869 21.129 1.00 52.48 N ATOM 4907 CA GLY A 318 28.734 12.961 21.733 1.00 52.35 C ATOM 4908 C GLY A 318 28.421 14.260 21.031 1.00 52.27 C ATOM 4909 O GLY A 318 27.667 14.285 20.056 1.00 53.35 O ATOM 4910 HA3 GLY A 318 29.802 12.759 21.655 1.00 0.00 H ATOM 4911 HA2 GLY A 318 28.457 13.045 22.784 1.00 0.00 H ATOM 4912 H GLY A 318 27.419 12.051 20.282 1.00 0.00 H ATOM 4913 N ALA A 319 28.997 15.347 21.525 1.00 50.86 N ATOM 4914 CA ALA A 319 28.774 16.649 20.914 1.00 48.85 C ATOM 4915 C ALA A 319 29.697 16.876 19.713 1.00 46.42 C ATOM 4916 O ALA A 319 29.326 17.564 18.767 1.00 46.15 O ATOM 4917 CB ALA A 319 28.954 17.755 21.947 1.00 49.16 C ATOM 4918 HA ALA A 319 27.748 16.673 20.546 1.00 0.00 H ATOM 4919 HB1 ALA A 319 28.238 17.614 22.757 1.00 0.00 H ATOM 4920 HB2 ALA A 319 29.968 17.717 22.345 1.00 0.00 H ATOM 4921 HB3 ALA A 319 28.784 18.723 21.475 1.00 0.00 H ATOM 4922 H ALA A 319 29.615 15.269 22.358 1.00 0.00 H ATOM 4923 N PHE A 320 30.891 16.285 19.761 1.00 43.08 N ATOM 4924 CA PHE A 320 31.933 16.521 18.759 1.00 40.11 C ATOM 4925 C PHE A 320 32.093 15.391 17.745 1.00 39.35 C ATOM 4926 O PHE A 320 32.723 15.569 16.704 1.00 39.27 O ATOM 4927 CB PHE A 320 33.267 16.787 19.458 1.00 38.72 C ATOM 4928 CG PHE A 320 33.193 17.863 20.492 1.00 38.47 C ATOM 4929 CD1 PHE A 320 33.016 19.190 20.118 1.00 38.03 C ATOM 4930 CD2 PHE A 320 33.289 17.556 21.840 1.00 37.99 C ATOM 4931 CE1 PHE A 320 32.940 20.188 21.068 1.00 37.88 C ATOM 4932 CE2 PHE A 320 33.213 18.553 22.799 1.00 37.66 C ATOM 4933 CZ PHE A 320 33.038 19.871 22.411 1.00 37.77 C ATOM 4934 HA PHE A 320 31.615 17.393 18.187 1.00 0.00 H ATOM 4935 HB2 PHE A 320 33.594 15.866 19.941 1.00 0.00 H ATOM 4936 HB3 PHE A 320 33.999 17.081 18.705 1.00 0.00 H ATOM 4937 HD2 PHE A 320 33.426 16.520 22.149 1.00 0.00 H ATOM 4938 HE2 PHE A 320 33.291 18.301 23.857 1.00 0.00 H ATOM 4939 HZ PHE A 320 32.978 20.658 23.163 1.00 0.00 H ATOM 4940 HE1 PHE A 320 32.803 21.225 20.761 1.00 0.00 H ATOM 4941 HD1 PHE A 320 32.936 19.445 19.061 1.00 0.00 H ATOM 4942 H PHE A 320 31.091 15.629 20.543 1.00 0.00 H ATOM 4943 N ASN A 321 31.524 14.233 18.064 1.00 38.71 N ATOM 4944 CA ASN A 321 31.546 13.058 17.202 1.00 38.50 C ATOM 4945 C ASN A 321 31.088 13.366 15.766 1.00 36.94 C ATOM 4946 O ASN A 321 31.776 13.039 14.806 1.00 36.76 O ATOM 4947 CB ASN A 321 30.691 11.956 17.848 1.00 41.76 C ATOM 4948 CG ASN A 321 30.744 10.632 17.101 1.00 44.49 C ATOM 4949 OD1 ASN A 321 30.849 10.593 15.877 1.00 46.51 O ATOM 4950 ND2 ASN A 321 30.648 9.532 17.846 1.00 45.86 N ATOM 4951 HA ASN A 321 32.576 12.715 17.109 1.00 0.00 H ATOM 4952 HB2 ASN A 321 31.048 11.793 18.865 1.00 0.00 H ATOM 4953 HB3 ASN A 321 29.655 12.295 17.877 1.00 0.00 H ATOM 4954 HD22 ASN A 321 30.561 9.610 18.879 1.00 0.00 H ATOM 4955 HD21 ASN A 321 30.660 8.595 17.394 1.00 0.00 H ATOM 4956 H ASN A 321 31.036 14.161 18.980 1.00 0.00 H ATOM 4957 N LEU A 322 29.937 14.009 15.624 1.00 34.13 N ATOM 4958 CA LEU A 322 29.380 14.261 14.300 1.00 33.16 C ATOM 4959 C LEU A 322 30.230 15.175 13.404 1.00 33.27 C ATOM 4960 O LEU A 322 30.436 14.878 12.219 1.00 31.44 O ATOM 4961 CB LEU A 322 27.969 14.816 14.423 1.00 33.59 C ATOM 4962 CG LEU A 322 27.251 15.055 13.101 1.00 34.00 C ATOM 4963 CD1 LEU A 322 27.143 13.750 12.309 1.00 34.17 C ATOM 4964 CD2 LEU A 322 25.892 15.643 13.370 1.00 32.80 C ATOM 4965 HA LEU A 322 29.371 13.292 13.801 1.00 0.00 H ATOM 4966 HB2 LEU A 322 27.378 14.110 15.006 1.00 0.00 H ATOM 4967 HB3 LEU A 322 28.025 15.766 14.954 1.00 0.00 H ATOM 4968 HG LEU A 322 27.823 15.760 12.498 1.00 0.00 H ATOM 4969 HD21 LEU A 322 25.312 14.950 13.980 1.00 0.00 H ATOM 4970 HD22 LEU A 322 26.005 16.589 13.900 1.00 0.00 H ATOM 4971 HD23 LEU A 322 25.378 15.814 12.424 1.00 0.00 H ATOM 4972 HD11 LEU A 322 28.143 13.366 12.106 1.00 0.00 H ATOM 4973 HD12 LEU A 322 26.582 13.019 12.891 1.00 0.00 H ATOM 4974 HD13 LEU A 322 26.627 13.939 11.368 1.00 0.00 H ATOM 4975 H LEU A 322 29.425 14.338 16.467 1.00 0.00 H ATOM 4976 N GLY A 323 30.722 16.276 13.974 1.00 30.08 N ATOM 4977 CA GLY A 323 31.472 17.268 13.219 1.00 28.74 C ATOM 4978 C GLY A 323 32.965 17.038 13.118 1.00 29.50 C ATOM 4979 O GLY A 323 33.583 17.449 12.141 1.00 29.43 O ATOM 4980 HA3 GLY A 323 31.315 18.237 13.693 1.00 0.00 H ATOM 4981 HA2 GLY A 323 31.069 17.291 12.207 1.00 0.00 H ATOM 4982 H GLY A 323 30.564 16.430 14.990 1.00 0.00 H ATOM 4983 N PHE A 324 33.557 16.387 14.114 1.00 28.31 N ATOM 4984 CA PHE A 324 35.006 16.163 14.101 1.00 28.54 C ATOM 4985 C PHE A 324 35.424 14.755 13.673 1.00 29.61 C ATOM 4986 O PHE A 324 36.583 14.542 13.316 1.00 29.44 O ATOM 4987 CB PHE A 324 35.636 16.507 15.454 1.00 28.92 C ATOM 4988 CG PHE A 324 35.712 17.987 15.731 1.00 28.17 C ATOM 4989 CD1 PHE A 324 36.850 18.709 15.406 1.00 27.58 C ATOM 4990 CD2 PHE A 324 34.641 18.656 16.313 1.00 28.41 C ATOM 4991 CE1 PHE A 324 36.918 20.079 15.657 1.00 28.66 C ATOM 4992 CE2 PHE A 324 34.703 20.030 16.572 1.00 27.84 C ATOM 4993 CZ PHE A 324 35.837 20.737 16.244 1.00 27.53 C ATOM 4994 HA PHE A 324 35.385 16.841 13.336 1.00 0.00 H ATOM 4995 HB2 PHE A 324 35.041 16.040 16.239 1.00 0.00 H ATOM 4996 HB3 PHE A 324 36.647 16.101 15.476 1.00 0.00 H ATOM 4997 HD2 PHE A 324 33.739 18.102 16.572 1.00 0.00 H ATOM 4998 HE2 PHE A 324 33.856 20.538 17.032 1.00 0.00 H ATOM 4999 HZ PHE A 324 35.890 21.808 16.442 1.00 0.00 H ATOM 5000 HE1 PHE A 324 37.817 20.637 15.394 1.00 0.00 H ATOM 5001 HD1 PHE A 324 37.700 18.201 14.950 1.00 0.00 H ATOM 5002 H PHE A 324 32.988 16.033 14.909 1.00 0.00 H ATOM 5003 N ILE A 325 34.485 13.809 13.711 1.00 28.61 N ATOM 5004 CA ILE A 325 34.771 12.423 13.367 1.00 29.03 C ATOM 5005 C ILE A 325 33.935 11.942 12.188 1.00 29.65 C ATOM 5006 O ILE A 325 34.478 11.578 11.144 1.00 30.51 O ATOM 5007 CB ILE A 325 34.567 11.464 14.584 1.00 28.68 C ATOM 5008 CG1 ILE A 325 35.550 11.803 15.715 1.00 26.88 C ATOM 5009 CG2 ILE A 325 34.711 10.003 14.155 1.00 28.85 C ATOM 5010 CD1 ILE A 325 35.296 11.047 17.038 1.00 27.05 C ATOM 5011 HA ILE A 325 35.822 12.396 13.078 1.00 0.00 H ATOM 5012 HB ILE A 325 33.555 11.606 14.962 1.00 0.00 H ATOM 5013 HG12 ILE A 325 36.557 11.562 15.374 1.00 0.00 H ATOM 5014 HG13 ILE A 325 35.482 12.872 15.916 1.00 0.00 H ATOM 5015 HD11 ILE A 325 34.298 11.285 17.405 1.00 0.00 H ATOM 5016 HD12 ILE A 325 35.374 9.974 16.863 1.00 0.00 H ATOM 5017 HD13 ILE A 325 36.038 11.350 17.777 1.00 0.00 H ATOM 5018 HG21 ILE A 325 33.963 9.773 13.397 1.00 0.00 H ATOM 5019 HG22 ILE A 325 35.708 9.843 13.744 1.00 0.00 H ATOM 5020 HG23 ILE A 325 34.565 9.356 15.020 1.00 0.00 H ATOM 5021 H ILE A 325 33.519 14.069 13.995 1.00 0.00 H ATOM 5022 N THR A 326 32.618 11.954 12.349 1.00 29.80 N ATOM 5023 CA THR A 326 31.734 11.383 11.344 1.00 32.14 C ATOM 5024 C THR A 326 31.807 12.108 9.993 1.00 33.24 C ATOM 5025 O THR A 326 32.050 11.470 8.970 1.00 33.68 O ATOM 5026 CB THR A 326 30.277 11.269 11.854 1.00 32.90 C ATOM 5027 OG1 THR A 326 30.225 10.310 12.918 1.00 33.84 O ATOM 5028 CG2 THR A 326 29.344 10.807 10.747 1.00 33.01 C ATOM 5029 HA THR A 326 32.100 10.372 11.165 1.00 0.00 H ATOM 5030 HB THR A 326 29.959 12.253 12.199 1.00 0.00 H ATOM 5031 HG1 THR A 326 30.814 10.606 13.656 1.00 0.00 H ATOM 5032 HG23 THR A 326 29.371 11.525 9.928 1.00 0.00 H ATOM 5033 HG21 THR A 326 29.666 9.830 10.386 1.00 0.00 H ATOM 5034 HG22 THR A 326 28.328 10.735 11.136 1.00 0.00 H ATOM 5035 H THR A 326 32.211 12.378 13.207 1.00 0.00 H ATOM 5036 N LEU A 327 31.616 13.427 9.989 1.00 32.96 N ATOM 5037 CA LEU A 327 31.624 14.173 8.731 1.00 34.65 C ATOM 5038 C LEU A 327 32.944 14.021 7.956 1.00 35.17 C ATOM 5039 O LEU A 327 32.914 13.691 6.780 1.00 36.67 O ATOM 5040 CB LEU A 327 31.245 15.642 8.933 1.00 35.65 C ATOM 5041 CG LEU A 327 30.801 16.380 7.668 1.00 37.18 C ATOM 5042 CD1 LEU A 327 29.632 15.666 7.008 1.00 37.14 C ATOM 5043 CD2 LEU A 327 30.432 17.811 7.986 1.00 36.82 C ATOM 5044 HA LEU A 327 30.851 13.725 8.107 1.00 0.00 H ATOM 5045 HB2 LEU A 327 30.427 15.684 9.653 1.00 0.00 H ATOM 5046 HB3 LEU A 327 32.113 16.162 9.340 1.00 0.00 H ATOM 5047 HG LEU A 327 31.638 16.386 6.970 1.00 0.00 H ATOM 5048 HD21 LEU A 327 29.614 17.822 8.707 1.00 0.00 H ATOM 5049 HD22 LEU A 327 31.297 18.323 8.408 1.00 0.00 H ATOM 5050 HD23 LEU A 327 30.120 18.316 7.072 1.00 0.00 H ATOM 5051 HD11 LEU A 327 29.932 14.654 6.738 1.00 0.00 H ATOM 5052 HD12 LEU A 327 28.794 15.624 7.704 1.00 0.00 H ATOM 5053 HD13 LEU A 327 29.335 16.210 6.111 1.00 0.00 H ATOM 5054 H LEU A 327 31.460 13.929 10.886 1.00 0.00 H ATOM 5055 N PRO A 328 34.101 14.274 8.600 1.00 35.95 N ATOM 5056 CA PRO A 328 35.350 14.069 7.840 1.00 36.65 C ATOM 5057 C PRO A 328 35.588 12.621 7.378 1.00 37.67 C ATOM 5058 O PRO A 328 36.262 12.408 6.360 1.00 37.87 O ATOM 5059 CB PRO A 328 36.455 14.513 8.810 1.00 36.49 C ATOM 5060 CG PRO A 328 35.818 14.639 10.145 1.00 36.97 C ATOM 5061 CD PRO A 328 34.340 14.766 9.969 1.00 36.00 C ATOM 5062 HA PRO A 328 35.319 14.634 6.908 1.00 0.00 H ATOM 5063 HD3 PRO A 328 33.809 14.155 10.699 1.00 0.00 H ATOM 5064 HD2 PRO A 328 34.025 15.805 10.068 1.00 0.00 H ATOM 5065 HG3 PRO A 328 36.203 15.524 10.652 1.00 0.00 H ATOM 5066 HG2 PRO A 328 36.041 13.754 10.741 1.00 0.00 H ATOM 5067 HB2 PRO A 328 37.251 13.769 8.841 1.00 0.00 H ATOM 5068 HB3 PRO A 328 36.868 15.472 8.497 1.00 0.00 H ATOM 5069 N ALA A 329 35.051 11.645 8.115 1.00 35.93 N ATOM 5070 CA ALA A 329 35.165 10.242 7.728 1.00 34.81 C ATOM 5071 C ALA A 329 34.340 9.984 6.479 1.00 34.64 C ATOM 5072 O ALA A 329 34.790 9.313 5.553 1.00 35.52 O ATOM 5073 CB ALA A 329 34.715 9.331 8.853 1.00 34.74 C ATOM 5074 HA ALA A 329 36.212 10.025 7.517 1.00 0.00 H ATOM 5075 HB1 ALA A 329 35.338 9.504 9.730 1.00 0.00 H ATOM 5076 HB2 ALA A 329 33.674 9.544 9.097 1.00 0.00 H ATOM 5077 HB3 ALA A 329 34.810 8.292 8.538 1.00 0.00 H ATOM 5078 H ALA A 329 34.539 11.891 8.986 1.00 0.00 H ATOM 5079 N ILE A 330 33.125 10.519 6.466 1.00 33.65 N ATOM 5080 CA ILE A 330 32.254 10.425 5.310 1.00 33.68 C ATOM 5081 C ILE A 330 32.900 11.079 4.086 1.00 36.37 C ATOM 5082 O ILE A 330 32.947 10.485 3.003 1.00 37.81 O ATOM 5083 CB ILE A 330 30.911 11.100 5.583 1.00 32.32 C ATOM 5084 CG1 ILE A 330 30.075 10.244 6.535 1.00 31.58 C ATOM 5085 CG2 ILE A 330 30.158 11.332 4.280 1.00 31.70 C ATOM 5086 CD1 ILE A 330 28.783 10.920 6.984 1.00 32.35 C ATOM 5087 HA ILE A 330 32.091 9.366 5.110 1.00 0.00 H ATOM 5088 HB ILE A 330 31.096 12.067 6.052 1.00 0.00 H ATOM 5089 HG12 ILE A 330 29.820 9.313 6.029 1.00 0.00 H ATOM 5090 HG13 ILE A 330 30.675 10.023 7.418 1.00 0.00 H ATOM 5091 HD11 ILE A 330 29.022 11.849 7.503 1.00 0.00 H ATOM 5092 HD12 ILE A 330 28.166 11.137 6.112 1.00 0.00 H ATOM 5093 HD13 ILE A 330 28.242 10.255 7.657 1.00 0.00 H ATOM 5094 HG21 ILE A 330 30.752 11.973 3.628 1.00 0.00 H ATOM 5095 HG22 ILE A 330 29.981 10.375 3.789 1.00 0.00 H ATOM 5096 HG23 ILE A 330 29.204 11.814 4.494 1.00 0.00 H ATOM 5097 H ILE A 330 32.787 11.021 7.312 1.00 0.00 H ATOM 5098 N PHE A 331 33.401 12.299 4.266 1.00 37.25 N ATOM 5099 CA PHE A 331 34.076 13.022 3.188 1.00 38.09 C ATOM 5100 C PHE A 331 35.227 12.234 2.590 1.00 38.83 C ATOM 5101 O PHE A 331 35.448 12.287 1.378 1.00 39.34 O ATOM 5102 CB PHE A 331 34.609 14.365 3.676 1.00 36.61 C ATOM 5103 CG PHE A 331 33.546 15.394 3.884 1.00 36.87 C ATOM 5104 CD1 PHE A 331 32.271 15.198 3.386 1.00 35.25 C ATOM 5105 CD2 PHE A 331 33.830 16.573 4.553 1.00 35.92 C ATOM 5106 CE1 PHE A 331 31.296 16.143 3.572 1.00 36.50 C ATOM 5107 CE2 PHE A 331 32.858 17.527 4.738 1.00 35.72 C ATOM 5108 CZ PHE A 331 31.591 17.315 4.248 1.00 36.69 C ATOM 5109 HA PHE A 331 33.323 13.177 2.416 1.00 0.00 H ATOM 5110 HB2 PHE A 331 35.125 14.207 4.623 1.00 0.00 H ATOM 5111 HB3 PHE A 331 35.315 14.744 2.937 1.00 0.00 H ATOM 5112 HD2 PHE A 331 34.835 16.746 4.937 1.00 0.00 H ATOM 5113 HE2 PHE A 331 33.091 18.449 5.271 1.00 0.00 H ATOM 5114 HZ PHE A 331 30.818 18.070 4.392 1.00 0.00 H ATOM 5115 HE1 PHE A 331 30.290 15.972 3.188 1.00 0.00 H ATOM 5116 HD1 PHE A 331 32.039 14.283 2.840 1.00 0.00 H ATOM 5117 H PHE A 331 33.310 12.751 5.198 1.00 0.00 H ATOM 5118 N SER A 332 35.951 11.507 3.440 1.00 38.03 N ATOM 5119 CA SER A 332 37.128 10.747 3.013 1.00 39.66 C ATOM 5120 C SER A 332 36.801 9.655 1.999 1.00 40.82 C ATOM 5121 O SER A 332 37.702 9.093 1.377 1.00 41.64 O ATOM 5122 CB SER A 332 37.826 10.114 4.218 1.00 39.12 C ATOM 5123 OG SER A 332 37.087 9.005 4.715 1.00 38.89 O ATOM 5124 HA SER A 332 37.788 11.465 2.526 1.00 0.00 H ATOM 5125 HB2 SER A 332 37.922 10.860 5.007 1.00 0.00 H ATOM 5126 HB3 SER A 332 38.818 9.775 3.918 1.00 0.00 H ATOM 5127 HG SER A 332 36.187 9.308 4.994 1.00 0.00 H ATOM 5128 H SER A 332 35.671 11.478 4.441 1.00 0.00 H ATOM 5129 N GLN A 333 35.516 9.356 1.843 1.00 42.42 N ATOM 5130 CA GLN A 333 35.061 8.320 0.929 1.00 43.47 C ATOM 5131 C GLN A 333 34.576 8.944 -0.369 1.00 44.34 C ATOM 5132 O GLN A 333 33.964 8.272 -1.197 1.00 44.27 O ATOM 5133 CB GLN A 333 33.922 7.523 1.568 1.00 44.57 C ATOM 5134 CG GLN A 333 34.285 6.864 2.884 1.00 44.78 C ATOM 5135 CD GLN A 333 35.265 5.730 2.710 1.00 46.50 C ATOM 5136 OE1 GLN A 333 36.415 5.819 3.145 1.00 47.99 O ATOM 5137 NE2 GLN A 333 34.823 4.653 2.061 1.00 46.68 N ATOM 5138 HA GLN A 333 35.895 7.651 0.716 1.00 0.00 H ATOM 5139 HB2 GLN A 333 33.087 8.201 1.744 1.00 0.00 H ATOM 5140 HB3 GLN A 333 33.615 6.745 0.869 1.00 0.00 H ATOM 5141 HG2 GLN A 333 34.729 7.613 3.540 1.00 0.00 H ATOM 5142 HG3 GLN A 333 33.376 6.474 3.343 1.00 0.00 H ATOM 5143 HE22 GLN A 333 33.844 4.622 1.711 1.00 0.00 H ATOM 5144 HE21 GLN A 333 35.457 3.844 1.904 1.00 0.00 H ATOM 5145 H GLN A 333 34.809 9.882 2.395 1.00 0.00 H ATOM 5146 N THR A 334 34.847 10.236 -0.535 1.00 43.97 N ATOM 5147 CA THR A 334 34.393 10.986 -1.703 1.00 42.90 C ATOM 5148 C THR A 334 35.573 11.666 -2.399 1.00 41.16 C ATOM 5149 O THR A 334 36.541 12.047 -1.747 1.00 39.80 O ATOM 5150 CB THR A 334 33.333 12.054 -1.314 1.00 43.93 C ATOM 5151 OG1 THR A 334 33.959 13.148 -0.628 1.00 43.56 O ATOM 5152 CG2 THR A 334 32.257 11.448 -0.413 1.00 44.59 C ATOM 5153 HA THR A 334 33.932 10.274 -2.388 1.00 0.00 H ATOM 5154 HB THR A 334 32.868 12.415 -2.231 1.00 0.00 H ATOM 5155 HG1 THR A 334 34.398 12.813 0.193 1.00 0.00 H ATOM 5156 HG23 THR A 334 31.778 10.616 -0.930 1.00 0.00 H ATOM 5157 HG21 THR A 334 32.716 11.089 0.508 1.00 0.00 H ATOM 5158 HG22 THR A 334 31.512 12.208 -0.177 1.00 0.00 H ATOM 5159 H THR A 334 35.402 10.729 0.193 1.00 0.00 H ATOM 5160 N ALA A 335 35.490 11.810 -3.722 1.00 40.20 N ATOM 5161 CA ALA A 335 36.557 12.453 -4.495 1.00 38.83 C ATOM 5162 C ALA A 335 36.803 13.888 -4.030 1.00 37.21 C ATOM 5163 O ALA A 335 35.884 14.707 -3.991 1.00 37.21 O ATOM 5164 CB ALA A 335 36.242 12.417 -5.998 1.00 39.04 C ATOM 5165 HA ALA A 335 37.472 11.887 -4.321 1.00 0.00 H ATOM 5166 HB1 ALA A 335 36.148 11.381 -6.323 1.00 0.00 H ATOM 5167 HB2 ALA A 335 35.306 12.944 -6.185 1.00 0.00 H ATOM 5168 HB3 ALA A 335 37.049 12.900 -6.549 1.00 0.00 H ATOM 5169 H ALA A 335 34.647 11.457 -4.218 1.00 0.00 H ATOM 5170 N GLY A 336 38.050 14.187 -3.682 1.00 36.09 N ATOM 5171 CA GLY A 336 38.415 15.507 -3.169 1.00 34.46 C ATOM 5172 C GLY A 336 37.937 15.714 -1.738 1.00 34.65 C ATOM 5173 O GLY A 336 37.852 16.847 -1.263 1.00 34.24 O ATOM 5174 HA3 GLY A 336 37.964 16.269 -3.805 1.00 0.00 H ATOM 5175 HA2 GLY A 336 39.500 15.608 -3.196 1.00 0.00 H ATOM 5176 H GLY A 336 38.788 13.461 -3.777 1.00 0.00 H ATOM 5177 N GLY A 337 37.635 14.613 -1.051 1.00 33.71 N ATOM 5178 CA GLY A 337 37.065 14.651 0.294 1.00 33.92 C ATOM 5179 C GLY A 337 37.926 15.227 1.403 1.00 32.67 C ATOM 5180 O GLY A 337 37.402 15.753 2.383 1.00 31.94 O ATOM 5181 HA3 GLY A 337 36.815 13.627 0.572 1.00 0.00 H ATOM 5182 HA2 GLY A 337 36.153 15.246 0.246 1.00 0.00 H ATOM 5183 H GLY A 337 37.812 13.687 -1.491 1.00 0.00 H ATOM 5184 N THR A 338 39.241 15.122 1.262 1.00 31.89 N ATOM 5185 CA THR A 338 40.150 15.711 2.239 1.00 33.58 C ATOM 5186 C THR A 338 40.062 17.232 2.169 1.00 34.58 C ATOM 5187 O THR A 338 40.011 17.912 3.205 1.00 36.00 O ATOM 5188 CB THR A 338 41.599 15.247 2.021 1.00 33.24 C ATOM 5189 OG1 THR A 338 41.653 13.825 2.137 1.00 34.36 O ATOM 5190 CG2 THR A 338 42.525 15.843 3.064 1.00 33.75 C ATOM 5191 HA THR A 338 39.847 15.374 3.230 1.00 0.00 H ATOM 5192 HB THR A 338 41.919 15.574 1.032 1.00 0.00 H ATOM 5193 HG1 THR A 338 42.584 13.519 1.998 1.00 0.00 H ATOM 5194 HG23 THR A 338 42.499 16.930 2.993 1.00 0.00 H ATOM 5195 HG21 THR A 338 42.198 15.535 4.057 1.00 0.00 H ATOM 5196 HG22 THR A 338 43.542 15.491 2.889 1.00 0.00 H ATOM 5197 H THR A 338 39.629 14.612 0.443 1.00 0.00 H ATOM 5198 N PHE A 339 40.029 17.766 0.950 1.00 32.64 N ATOM 5199 CA PHE A 339 39.900 19.209 0.758 1.00 31.60 C ATOM 5200 C PHE A 339 38.547 19.724 1.240 1.00 31.24 C ATOM 5201 O PHE A 339 38.437 20.835 1.757 1.00 29.41 O ATOM 5202 CB PHE A 339 40.114 19.589 -0.710 1.00 30.24 C ATOM 5203 CG PHE A 339 40.187 21.071 -0.942 1.00 29.63 C ATOM 5204 CD1 PHE A 339 41.335 21.779 -0.616 1.00 27.68 C ATOM 5205 CD2 PHE A 339 39.110 21.757 -1.483 1.00 28.10 C ATOM 5206 CE1 PHE A 339 41.406 23.144 -0.827 1.00 27.79 C ATOM 5207 CE2 PHE A 339 39.180 23.124 -1.698 1.00 28.08 C ATOM 5208 CZ PHE A 339 40.324 23.817 -1.367 1.00 27.27 C ATOM 5209 HA PHE A 339 40.676 19.682 1.360 1.00 0.00 H ATOM 5210 HB2 PHE A 339 41.047 19.140 -1.050 1.00 0.00 H ATOM 5211 HB3 PHE A 339 39.286 19.189 -1.294 1.00 0.00 H ATOM 5212 HD2 PHE A 339 38.200 21.216 -1.742 1.00 0.00 H ATOM 5213 HE2 PHE A 339 38.329 23.652 -2.129 1.00 0.00 H ATOM 5214 HZ PHE A 339 40.377 24.893 -1.530 1.00 0.00 H ATOM 5215 HE1 PHE A 339 42.314 23.689 -0.568 1.00 0.00 H ATOM 5216 HD1 PHE A 339 42.190 21.254 -0.189 1.00 0.00 H ATOM 5217 H PHE A 339 40.096 17.145 0.119 1.00 0.00 H ATOM 5218 N LEU A 340 37.518 18.913 1.058 1.00 32.10 N ATOM 5219 CA LEU A 340 36.185 19.257 1.513 1.00 33.09 C ATOM 5220 C LEU A 340 36.158 19.276 3.052 1.00 33.34 C ATOM 5221 O LEU A 340 35.464 20.090 3.670 1.00 33.22 O ATOM 5222 CB LEU A 340 35.198 18.241 0.969 1.00 35.30 C ATOM 5223 CG LEU A 340 33.714 18.565 1.044 1.00 37.43 C ATOM 5224 CD1 LEU A 340 33.387 19.804 0.226 1.00 37.10 C ATOM 5225 CD2 LEU A 340 32.937 17.349 0.549 1.00 38.64 C ATOM 5226 HA LEU A 340 35.907 20.247 1.151 1.00 0.00 H ATOM 5227 HB2 LEU A 340 35.442 18.085 -0.082 1.00 0.00 H ATOM 5228 HB3 LEU A 340 35.354 17.313 1.519 1.00 0.00 H ATOM 5229 HG LEU A 340 33.430 18.785 2.073 1.00 0.00 H ATOM 5230 HD21 LEU A 340 33.223 17.131 -0.480 1.00 0.00 H ATOM 5231 HD22 LEU A 340 33.167 16.491 1.181 1.00 0.00 H ATOM 5232 HD23 LEU A 340 31.868 17.559 0.594 1.00 0.00 H ATOM 5233 HD11 LEU A 340 33.951 20.653 0.613 1.00 0.00 H ATOM 5234 HD12 LEU A 340 33.656 19.631 -0.816 1.00 0.00 H ATOM 5235 HD13 LEU A 340 32.320 20.013 0.297 1.00 0.00 H ATOM 5236 H LEU A 340 37.669 18.004 0.576 1.00 0.00 H ATOM 5237 N GLY A 341 36.923 18.371 3.651 1.00 31.90 N ATOM 5238 CA GLY A 341 37.113 18.338 5.090 1.00 31.61 C ATOM 5239 C GLY A 341 37.730 19.654 5.509 1.00 31.00 C ATOM 5240 O GLY A 341 37.304 20.248 6.490 1.00 29.51 O ATOM 5241 HA3 GLY A 341 37.777 17.516 5.357 1.00 0.00 H ATOM 5242 HA2 GLY A 341 36.152 18.204 5.588 1.00 0.00 H ATOM 5243 H GLY A 341 37.405 17.658 3.067 1.00 0.00 H ATOM 5244 N PHE A 342 38.725 20.116 4.749 1.00 30.50 N ATOM 5245 CA PHE A 342 39.364 21.417 5.013 1.00 28.94 C ATOM 5246 C PHE A 342 38.379 22.578 4.930 1.00 28.63 C ATOM 5247 O PHE A 342 38.353 23.428 5.815 1.00 28.71 O ATOM 5248 CB PHE A 342 40.549 21.675 4.073 1.00 29.29 C ATOM 5249 CG PHE A 342 40.897 23.141 3.915 1.00 29.71 C ATOM 5250 CD1 PHE A 342 41.621 23.811 4.892 1.00 30.21 C ATOM 5251 CD2 PHE A 342 40.502 23.846 2.779 1.00 30.12 C ATOM 5252 CE1 PHE A 342 41.941 25.154 4.748 1.00 29.76 C ATOM 5253 CE2 PHE A 342 40.821 25.194 2.628 1.00 30.42 C ATOM 5254 CZ PHE A 342 41.539 25.846 3.614 1.00 30.83 C ATOM 5255 HA PHE A 342 39.736 21.361 6.036 1.00 0.00 H ATOM 5256 HB2 PHE A 342 41.421 21.155 4.469 1.00 0.00 H ATOM 5257 HB3 PHE A 342 40.303 21.272 3.091 1.00 0.00 H ATOM 5258 HD2 PHE A 342 39.936 23.336 1.999 1.00 0.00 H ATOM 5259 HE2 PHE A 342 40.505 25.733 1.735 1.00 0.00 H ATOM 5260 HZ PHE A 342 41.789 26.901 3.501 1.00 0.00 H ATOM 5261 HE1 PHE A 342 42.508 25.665 5.526 1.00 0.00 H ATOM 5262 HD1 PHE A 342 41.943 23.275 5.785 1.00 0.00 H ATOM 5263 H PHE A 342 39.058 19.542 3.948 1.00 0.00 H ATOM 5264 N LEU A 343 37.570 22.617 3.876 1.00 25.81 N ATOM 5265 CA LEU A 343 36.575 23.683 3.737 1.00 27.22 C ATOM 5266 C LEU A 343 35.584 23.701 4.913 1.00 28.68 C ATOM 5267 O LEU A 343 35.169 24.769 5.381 1.00 29.78 O ATOM 5268 CB LEU A 343 35.820 23.554 2.416 1.00 25.77 C ATOM 5269 CG LEU A 343 36.661 23.697 1.136 1.00 26.85 C ATOM 5270 CD1 LEU A 343 35.848 23.364 -0.092 1.00 27.84 C ATOM 5271 CD2 LEU A 343 37.251 25.088 1.010 1.00 25.65 C ATOM 5272 HA LEU A 343 37.118 24.628 3.744 1.00 0.00 H ATOM 5273 HB2 LEU A 343 35.349 22.571 2.397 1.00 0.00 H ATOM 5274 HB3 LEU A 343 35.050 24.325 2.396 1.00 0.00 H ATOM 5275 HG LEU A 343 37.482 22.984 1.212 1.00 0.00 H ATOM 5276 HD21 LEU A 343 36.445 25.821 0.977 1.00 0.00 H ATOM 5277 HD22 LEU A 343 37.892 25.288 1.868 1.00 0.00 H ATOM 5278 HD23 LEU A 343 37.838 25.151 0.094 1.00 0.00 H ATOM 5279 HD11 LEU A 343 35.492 22.336 -0.023 1.00 0.00 H ATOM 5280 HD12 LEU A 343 34.997 24.042 -0.157 1.00 0.00 H ATOM 5281 HD13 LEU A 343 36.471 23.475 -0.980 1.00 0.00 H ATOM 5282 H LEU A 343 37.644 21.883 3.143 1.00 0.00 H ATOM 5283 N TRP A 344 35.204 22.513 5.369 1.00 28.94 N ATOM 5284 CA TRP A 344 34.311 22.364 6.516 1.00 27.97 C ATOM 5285 C TRP A 344 34.966 22.926 7.775 1.00 26.71 C ATOM 5286 O TRP A 344 34.368 23.726 8.482 1.00 27.33 O ATOM 5287 CB TRP A 344 33.914 20.895 6.684 1.00 27.44 C ATOM 5288 CG TRP A 344 33.315 20.513 8.036 1.00 27.55 C ATOM 5289 CD1 TRP A 344 33.893 19.723 8.987 1.00 27.32 C ATOM 5290 CD2 TRP A 344 32.031 20.889 8.555 1.00 27.50 C ATOM 5291 NE1 TRP A 344 33.052 19.583 10.069 1.00 27.46 N ATOM 5292 CE2 TRP A 344 31.903 20.292 9.830 1.00 27.94 C ATOM 5293 CE3 TRP A 344 30.976 21.672 8.067 1.00 26.95 C ATOM 5294 CZ2 TRP A 344 30.764 20.455 10.621 1.00 26.96 C ATOM 5295 CZ3 TRP A 344 29.849 21.836 8.853 1.00 26.94 C ATOM 5296 CH2 TRP A 344 29.751 21.227 10.118 1.00 27.74 C ATOM 5297 HA TRP A 344 33.399 22.935 6.341 1.00 0.00 H ATOM 5298 HB2 TRP A 344 33.179 20.658 5.915 1.00 0.00 H ATOM 5299 HB3 TRP A 344 34.807 20.289 6.531 1.00 0.00 H ATOM 5300 HE1 TRP A 344 33.255 19.030 10.926 1.00 0.00 H ATOM 5301 HD1 TRP A 344 34.880 19.268 8.902 1.00 0.00 H ATOM 5302 HZ2 TRP A 344 30.684 19.986 11.602 1.00 0.00 H ATOM 5303 HH2 TRP A 344 28.848 21.373 10.711 1.00 0.00 H ATOM 5304 HZ3 TRP A 344 29.024 22.447 8.487 1.00 0.00 H ATOM 5305 HE3 TRP A 344 31.042 22.143 7.086 1.00 0.00 H ATOM 5306 H TRP A 344 35.555 21.658 4.892 1.00 0.00 H ATOM 5307 N PHE A 345 36.201 22.531 8.050 1.00 26.86 N ATOM 5308 CA PHE A 345 36.875 23.047 9.238 1.00 27.89 C ATOM 5309 C PHE A 345 37.267 24.511 9.153 1.00 28.27 C ATOM 5310 O PHE A 345 37.297 25.208 10.172 1.00 29.21 O ATOM 5311 CB PHE A 345 38.063 22.170 9.597 1.00 28.76 C ATOM 5312 CG PHE A 345 37.653 20.831 10.109 1.00 29.63 C ATOM 5313 CD1 PHE A 345 36.936 20.731 11.294 1.00 29.44 C ATOM 5314 CD2 PHE A 345 37.965 19.677 9.413 1.00 29.26 C ATOM 5315 CE1 PHE A 345 36.541 19.505 11.773 1.00 29.56 C ATOM 5316 CE2 PHE A 345 37.579 18.445 9.889 1.00 29.47 C ATOM 5317 CZ PHE A 345 36.863 18.356 11.069 1.00 30.03 C ATOM 5318 HA PHE A 345 36.141 23.004 10.042 1.00 0.00 H ATOM 5319 HB2 PHE A 345 38.676 22.031 8.707 1.00 0.00 H ATOM 5320 HB3 PHE A 345 38.649 22.673 10.366 1.00 0.00 H ATOM 5321 HD2 PHE A 345 38.522 19.744 8.478 1.00 0.00 H ATOM 5322 HE2 PHE A 345 37.837 17.541 9.337 1.00 0.00 H ATOM 5323 HZ PHE A 345 36.552 17.381 11.445 1.00 0.00 H ATOM 5324 HE1 PHE A 345 35.977 19.437 12.703 1.00 0.00 H ATOM 5325 HD1 PHE A 345 36.684 21.634 11.850 1.00 0.00 H ATOM 5326 H PHE A 345 36.687 21.858 7.424 1.00 0.00 H ATOM 5327 N PHE A 346 37.564 24.983 7.948 1.00 28.09 N ATOM 5328 CA PHE A 346 37.828 26.397 7.737 1.00 28.37 C ATOM 5329 C PHE A 346 36.553 27.195 8.001 1.00 26.43 C ATOM 5330 O PHE A 346 36.598 28.245 8.638 1.00 25.25 O ATOM 5331 CB PHE A 346 38.327 26.642 6.320 1.00 33.94 C ATOM 5332 CG PHE A 346 38.910 28.006 6.113 1.00 37.99 C ATOM 5333 CD1 PHE A 346 40.149 28.330 6.651 1.00 40.76 C ATOM 5334 CD2 PHE A 346 38.226 28.959 5.377 1.00 40.58 C ATOM 5335 CE1 PHE A 346 40.700 29.592 6.460 1.00 42.53 C ATOM 5336 CE2 PHE A 346 38.759 30.223 5.174 1.00 42.17 C ATOM 5337 CZ PHE A 346 39.999 30.544 5.717 1.00 43.70 C ATOM 5338 HA PHE A 346 38.605 26.723 8.428 1.00 0.00 H ATOM 5339 HB2 PHE A 346 39.094 25.902 6.092 1.00 0.00 H ATOM 5340 HB3 PHE A 346 37.489 26.518 5.634 1.00 0.00 H ATOM 5341 HD2 PHE A 346 37.254 28.712 4.951 1.00 0.00 H ATOM 5342 HE2 PHE A 346 38.209 30.962 4.591 1.00 0.00 H ATOM 5343 HZ PHE A 346 40.422 31.536 5.563 1.00 0.00 H ATOM 5344 HE1 PHE A 346 41.672 29.837 6.887 1.00 0.00 H ATOM 5345 HD1 PHE A 346 40.696 27.586 7.230 1.00 0.00 H ATOM 5346 H PHE A 346 37.609 24.329 7.140 1.00 0.00 H ATOM 5347 N LEU A 347 35.423 26.687 7.518 1.00 23.57 N ATOM 5348 CA LEU A 347 34.112 27.274 7.810 1.00 25.55 C ATOM 5349 C LEU A 347 33.842 27.371 9.324 1.00 26.07 C ATOM 5350 O LEU A 347 33.418 28.411 9.823 1.00 25.75 O ATOM 5351 CB LEU A 347 33.006 26.446 7.161 1.00 24.07 C ATOM 5352 CG LEU A 347 31.558 26.720 7.582 1.00 26.63 C ATOM 5353 CD1 LEU A 347 31.093 28.086 7.109 1.00 28.68 C ATOM 5354 CD2 LEU A 347 30.624 25.650 7.035 1.00 25.78 C ATOM 5355 HA LEU A 347 34.118 28.284 7.399 1.00 0.00 H ATOM 5356 HB2 LEU A 347 33.067 26.610 6.085 1.00 0.00 H ATOM 5357 HB3 LEU A 347 33.214 25.399 7.380 1.00 0.00 H ATOM 5358 HG LEU A 347 31.529 26.700 8.671 1.00 0.00 H ATOM 5359 HD21 LEU A 347 30.679 25.644 5.946 1.00 0.00 H ATOM 5360 HD22 LEU A 347 30.924 24.676 7.421 1.00 0.00 H ATOM 5361 HD23 LEU A 347 29.603 25.867 7.347 1.00 0.00 H ATOM 5362 HD11 LEU A 347 31.732 28.856 7.542 1.00 0.00 H ATOM 5363 HD12 LEU A 347 31.153 28.132 6.022 1.00 0.00 H ATOM 5364 HD13 LEU A 347 30.062 28.247 7.425 1.00 0.00 H ATOM 5365 H LEU A 347 35.471 25.843 6.912 1.00 0.00 H ATOM 5366 N LEU A 348 34.079 26.279 10.047 1.00 25.79 N ATOM 5367 CA LEU A 348 33.849 26.277 11.487 1.00 26.83 C ATOM 5368 C LEU A 348 34.741 27.304 12.155 1.00 26.73 C ATOM 5369 O LEU A 348 34.306 28.003 13.063 1.00 30.64 O ATOM 5370 CB LEU A 348 34.105 24.896 12.083 1.00 26.94 C ATOM 5371 CG LEU A 348 33.211 23.759 11.617 1.00 26.11 C ATOM 5372 CD1 LEU A 348 33.615 22.490 12.328 1.00 26.19 C ATOM 5373 CD2 LEU A 348 31.746 24.088 11.861 1.00 26.30 C ATOM 5374 HA LEU A 348 32.805 26.535 11.665 1.00 0.00 H ATOM 5375 HB2 LEU A 348 35.133 24.622 11.846 1.00 0.00 H ATOM 5376 HB3 LEU A 348 33.992 24.980 13.164 1.00 0.00 H ATOM 5377 HG LEU A 348 33.334 23.617 10.543 1.00 0.00 H ATOM 5378 HD21 LEU A 348 31.584 24.249 12.927 1.00 0.00 H ATOM 5379 HD22 LEU A 348 31.481 24.991 11.311 1.00 0.00 H ATOM 5380 HD23 LEU A 348 31.127 23.259 11.519 1.00 0.00 H ATOM 5381 HD11 LEU A 348 34.654 22.259 12.095 1.00 0.00 H ATOM 5382 HD12 LEU A 348 33.505 22.627 13.404 1.00 0.00 H ATOM 5383 HD13 LEU A 348 32.977 21.671 11.997 1.00 0.00 H ATOM 5384 H LEU A 348 34.432 25.419 9.581 1.00 0.00 H ATOM 5385 N PHE A 349 35.984 27.413 11.696 1.00 27.49 N ATOM 5386 CA PHE A 349 36.925 28.343 12.305 1.00 28.46 C ATOM 5387 C PHE A 349 36.493 29.807 12.191 1.00 31.13 C ATOM 5388 O PHE A 349 36.621 30.561 13.159 1.00 31.37 O ATOM 5389 CB PHE A 349 38.328 28.182 11.727 1.00 28.13 C ATOM 5390 CG PHE A 349 39.299 29.191 12.256 1.00 29.25 C ATOM 5391 CD1 PHE A 349 39.660 29.181 13.601 1.00 28.29 C ATOM 5392 CD2 PHE A 349 39.838 30.167 11.426 1.00 29.53 C ATOM 5393 CE1 PHE A 349 40.547 30.114 14.098 1.00 27.25 C ATOM 5394 CE2 PHE A 349 40.722 31.105 11.924 1.00 28.34 C ATOM 5395 CZ PHE A 349 41.077 31.078 13.259 1.00 27.68 C ATOM 5396 HA PHE A 349 36.936 28.085 13.364 1.00 0.00 H ATOM 5397 HB2 PHE A 349 38.693 27.185 11.974 1.00 0.00 H ATOM 5398 HB3 PHE A 349 38.272 28.289 10.644 1.00 0.00 H ATOM 5399 HD2 PHE A 349 39.561 30.193 10.372 1.00 0.00 H ATOM 5400 HE2 PHE A 349 41.139 31.866 11.264 1.00 0.00 H ATOM 5401 HZ PHE A 349 41.775 31.817 13.652 1.00 0.00 H ATOM 5402 HE1 PHE A 349 40.830 30.091 15.150 1.00 0.00 H ATOM 5403 HD1 PHE A 349 39.238 28.429 14.268 1.00 0.00 H ATOM 5404 H PHE A 349 36.288 26.827 10.892 1.00 0.00 H ATOM 5405 N PHE A 350 36.008 30.203 11.012 1.00 29.47 N ATOM 5406 CA PHE A 350 35.514 31.562 10.798 1.00 30.85 C ATOM 5407 C PHE A 350 34.205 31.753 11.535 1.00 28.76 C ATOM 5408 O PHE A 350 33.922 32.829 12.037 1.00 28.29 O ATOM 5409 CB PHE A 350 35.355 31.875 9.302 1.00 31.20 C ATOM 5410 CG PHE A 350 36.524 32.615 8.717 1.00 33.80 C ATOM 5411 CD1 PHE A 350 37.800 32.440 9.233 1.00 34.05 C ATOM 5412 CD2 PHE A 350 36.351 33.480 7.651 1.00 34.48 C ATOM 5413 CE1 PHE A 350 38.886 33.119 8.701 1.00 35.73 C ATOM 5414 CE2 PHE A 350 37.430 34.162 7.107 1.00 35.55 C ATOM 5415 CZ PHE A 350 38.703 33.983 7.636 1.00 36.08 C ATOM 5416 HA PHE A 350 36.249 32.262 11.195 1.00 0.00 H ATOM 5417 HB2 PHE A 350 35.237 30.935 8.763 1.00 0.00 H ATOM 5418 HB3 PHE A 350 34.460 32.483 9.170 1.00 0.00 H ATOM 5419 HD2 PHE A 350 35.355 33.627 7.234 1.00 0.00 H ATOM 5420 HE2 PHE A 350 37.279 34.838 6.265 1.00 0.00 H ATOM 5421 HZ PHE A 350 39.552 34.520 7.214 1.00 0.00 H ATOM 5422 HE1 PHE A 350 39.881 32.972 9.121 1.00 0.00 H ATOM 5423 HD1 PHE A 350 37.951 31.758 10.070 1.00 0.00 H ATOM 5424 H PHE A 350 35.981 29.525 10.223 1.00 0.00 H ATOM 5425 N ALA A 351 33.406 30.699 11.599 1.00 28.52 N ATOM 5426 CA ALA A 351 32.210 30.747 12.406 1.00 28.86 C ATOM 5427 C ALA A 351 32.610 30.941 13.878 1.00 27.62 C ATOM 5428 O ALA A 351 32.039 31.776 14.559 1.00 29.08 O ATOM 5429 CB ALA A 351 31.377 29.504 12.211 1.00 27.41 C ATOM 5430 HA ALA A 351 31.592 31.589 12.096 1.00 0.00 H ATOM 5431 HB1 ALA A 351 31.090 29.422 11.163 1.00 0.00 H ATOM 5432 HB2 ALA A 351 31.959 28.629 12.499 1.00 0.00 H ATOM 5433 HB3 ALA A 351 30.482 29.567 12.831 1.00 0.00 H ATOM 5434 H ALA A 351 33.640 29.836 11.068 1.00 0.00 H ATOM 5435 N GLY A 352 33.607 30.203 14.352 1.00 28.80 N ATOM 5436 CA GLY A 352 34.065 30.343 15.741 1.00 28.07 C ATOM 5437 C GLY A 352 34.701 31.701 16.010 1.00 29.11 C ATOM 5438 O GLY A 352 34.348 32.391 16.969 1.00 28.00 O ATOM 5439 HA3 GLY A 352 34.800 29.565 15.947 1.00 0.00 H ATOM 5440 HA2 GLY A 352 33.210 30.219 16.406 1.00 0.00 H ATOM 5441 H GLY A 352 34.072 29.513 13.728 1.00 0.00 H ATOM 5442 N LEU A 353 35.642 32.092 15.157 1.00 27.08 N ATOM 5443 CA LEU A 353 36.368 33.350 15.327 1.00 25.62 C ATOM 5444 C LEU A 353 35.460 34.584 15.387 1.00 25.60 C ATOM 5445 O LEU A 353 35.614 35.414 16.269 1.00 23.78 O ATOM 5446 CB LEU A 353 37.411 33.511 14.220 1.00 27.68 C ATOM 5447 CG LEU A 353 38.319 34.740 14.234 1.00 27.77 C ATOM 5448 CD1 LEU A 353 39.049 34.868 15.565 1.00 27.19 C ATOM 5449 CD2 LEU A 353 39.297 34.608 13.091 1.00 27.32 C ATOM 5450 HA LEU A 353 36.861 33.290 16.297 1.00 0.00 H ATOM 5451 HB2 LEU A 353 38.058 32.635 14.260 1.00 0.00 H ATOM 5452 HB3 LEU A 353 36.873 33.521 13.272 1.00 0.00 H ATOM 5453 HG LEU A 353 37.723 35.644 14.114 1.00 0.00 H ATOM 5454 HD21 LEU A 353 39.887 33.701 13.222 1.00 0.00 H ATOM 5455 HD22 LEU A 353 38.749 34.554 12.150 1.00 0.00 H ATOM 5456 HD23 LEU A 353 39.958 35.474 13.078 1.00 0.00 H ATOM 5457 HD11 LEU A 353 38.320 34.963 16.370 1.00 0.00 H ATOM 5458 HD12 LEU A 353 39.660 33.981 15.730 1.00 0.00 H ATOM 5459 HD13 LEU A 353 39.687 35.751 15.544 1.00 0.00 H ATOM 5460 H LEU A 353 35.869 31.485 14.344 1.00 0.00 H ATOM 5461 N THR A 354 34.513 34.709 14.461 1.00 25.84 N ATOM 5462 CA THR A 354 33.624 35.859 14.487 1.00 27.31 C ATOM 5463 C THR A 354 32.802 35.889 15.795 1.00 28.67 C ATOM 5464 O THR A 354 32.337 36.946 16.233 1.00 28.79 O ATOM 5465 CB THR A 354 32.681 35.907 13.244 1.00 28.22 C ATOM 5466 OG1 THR A 354 31.997 34.660 13.102 1.00 26.82 O ATOM 5467 CG2 THR A 354 33.462 36.187 11.952 1.00 26.00 C ATOM 5468 HA THR A 354 34.253 36.748 14.448 1.00 0.00 H ATOM 5469 HB THR A 354 31.969 36.716 13.406 1.00 0.00 H ATOM 5470 HG1 THR A 354 32.659 33.934 12.982 1.00 0.00 H ATOM 5471 HG23 THR A 354 33.989 37.136 12.046 1.00 0.00 H ATOM 5472 HG21 THR A 354 34.181 35.386 11.783 1.00 0.00 H ATOM 5473 HG22 THR A 354 32.768 36.237 11.113 1.00 0.00 H ATOM 5474 H THR A 354 34.409 33.986 13.721 1.00 0.00 H ATOM 5475 N SER A 355 32.630 34.725 16.417 1.00 29.28 N ATOM 5476 CA SER A 355 31.862 34.621 17.658 1.00 27.33 C ATOM 5477 C SER A 355 32.691 34.824 18.901 1.00 27.24 C ATOM 5478 O SER A 355 32.205 35.393 19.871 1.00 27.24 O ATOM 5479 CB SER A 355 31.155 33.270 17.743 1.00 27.22 C ATOM 5480 OG SER A 355 30.037 33.247 16.876 1.00 26.37 O ATOM 5481 HA SER A 355 31.133 35.430 17.620 1.00 0.00 H ATOM 5482 HB2 SER A 355 30.820 33.102 18.767 1.00 0.00 H ATOM 5483 HB3 SER A 355 31.850 32.481 17.456 1.00 0.00 H ATOM 5484 HG SER A 355 29.403 33.961 17.137 1.00 0.00 H ATOM 5485 H SER A 355 33.053 33.866 16.010 1.00 0.00 H ATOM 5486 N SER A 356 33.934 34.359 18.881 1.00 27.59 N ATOM 5487 CA SER A 356 34.785 34.464 20.060 1.00 27.78 C ATOM 5488 C SER A 356 35.301 35.884 20.279 1.00 28.38 C ATOM 5489 O SER A 356 35.685 36.240 21.388 1.00 26.97 O ATOM 5490 CB SER A 356 35.939 33.454 20.019 1.00 27.01 C ATOM 5491 OG SER A 356 36.718 33.616 18.854 1.00 28.10 O ATOM 5492 HA SER A 356 34.158 34.217 20.917 1.00 0.00 H ATOM 5493 HB2 SER A 356 35.529 32.444 20.035 1.00 0.00 H ATOM 5494 HB3 SER A 356 36.572 33.602 20.894 1.00 0.00 H ATOM 5495 HG SER A 356 37.097 34.530 18.836 1.00 0.00 H ATOM 5496 H SER A 356 34.304 33.916 18.016 1.00 0.00 H ATOM 5497 N ILE A 357 35.316 36.710 19.237 1.00 27.03 N ATOM 5498 CA ILE A 357 35.686 38.113 19.465 1.00 26.48 C ATOM 5499 C ILE A 357 34.523 38.810 20.186 1.00 25.69 C ATOM 5500 O ILE A 357 34.722 39.670 21.031 1.00 26.31 O ATOM 5501 CB ILE A 357 36.108 38.849 18.161 1.00 26.26 C ATOM 5502 CG1 ILE A 357 35.036 38.717 17.079 1.00 25.83 C ATOM 5503 CG2 ILE A 357 37.437 38.297 17.648 1.00 24.65 C ATOM 5504 CD1 ILE A 357 35.462 39.291 15.722 1.00 26.13 C ATOM 5505 HA ILE A 357 36.574 38.147 20.096 1.00 0.00 H ATOM 5506 HB ILE A 357 36.226 39.907 18.397 1.00 0.00 H ATOM 5507 HG12 ILE A 357 34.805 37.660 16.949 1.00 0.00 H ATOM 5508 HG13 ILE A 357 34.142 39.245 17.412 1.00 0.00 H ATOM 5509 HD11 ILE A 357 35.686 40.352 15.832 1.00 0.00 H ATOM 5510 HD12 ILE A 357 36.349 38.765 15.369 1.00 0.00 H ATOM 5511 HD13 ILE A 357 34.652 39.162 15.004 1.00 0.00 H ATOM 5512 HG21 ILE A 357 38.207 38.444 18.406 1.00 0.00 H ATOM 5513 HG22 ILE A 357 37.330 37.233 17.438 1.00 0.00 H ATOM 5514 HG23 ILE A 357 37.719 38.822 16.735 1.00 0.00 H ATOM 5515 H ILE A 357 35.072 36.371 18.285 1.00 0.00 H ATOM 5516 N ALA A 358 33.308 38.401 19.852 1.00 24.81 N ATOM 5517 CA ALA A 358 32.099 38.874 20.517 1.00 25.67 C ATOM 5518 C ALA A 358 31.994 38.454 21.985 1.00 26.71 C ATOM 5519 O ALA A 358 31.563 39.245 22.837 1.00 28.59 O ATOM 5520 CB ALA A 358 30.880 38.370 19.768 1.00 23.77 C ATOM 5521 HA ALA A 358 32.150 39.963 20.506 1.00 0.00 H ATOM 5522 HB1 ALA A 358 30.903 38.745 18.745 1.00 0.00 H ATOM 5523 HB2 ALA A 358 30.887 37.280 19.757 1.00 0.00 H ATOM 5524 HB3 ALA A 358 29.977 38.724 20.266 1.00 0.00 H ATOM 5525 H ALA A 358 33.212 37.711 19.080 1.00 0.00 H ATOM 5526 N ILE A 359 32.397 37.222 22.288 1.00 26.65 N ATOM 5527 CA ILE A 359 32.282 36.676 23.646 1.00 27.11 C ATOM 5528 C ILE A 359 33.292 37.286 24.600 1.00 26.31 C ATOM 5529 O ILE A 359 33.065 37.335 25.809 1.00 27.40 O ATOM 5530 CB ILE A 359 32.449 35.122 23.700 1.00 27.60 C ATOM 5531 CG1 ILE A 359 33.917 34.710 23.567 1.00 28.26 C ATOM 5532 CG2 ILE A 359 31.616 34.436 22.647 1.00 27.48 C ATOM 5533 CD1 ILE A 359 34.105 33.234 23.288 1.00 29.95 C ATOM 5534 HA ILE A 359 31.271 36.937 23.957 1.00 0.00 H ATOM 5535 HB ILE A 359 32.091 34.800 24.678 1.00 0.00 H ATOM 5536 HG12 ILE A 359 34.362 35.276 22.749 1.00 0.00 H ATOM 5537 HG13 ILE A 359 34.430 34.954 24.497 1.00 0.00 H ATOM 5538 HD11 ILE A 359 33.674 32.654 24.104 1.00 0.00 H ATOM 5539 HD12 ILE A 359 33.606 32.976 22.354 1.00 0.00 H ATOM 5540 HD13 ILE A 359 35.169 33.014 23.206 1.00 0.00 H ATOM 5541 HG21 ILE A 359 30.564 34.675 22.805 1.00 0.00 H ATOM 5542 HG22 ILE A 359 31.924 34.781 21.660 1.00 0.00 H ATOM 5543 HG23 ILE A 359 31.760 33.358 22.717 1.00 0.00 H ATOM 5544 H ILE A 359 32.806 36.628 21.539 1.00 0.00 H ATOM 5545 N MET A 360 34.422 37.739 24.059 1.00 26.80 N ATOM 5546 CA MET A 360 35.467 38.324 24.897 1.00 26.10 C ATOM 5547 C MET A 360 35.357 39.842 25.069 1.00 26.08 C ATOM 5548 O MET A 360 36.013 40.427 25.947 1.00 21.88 O ATOM 5549 CB MET A 360 36.850 37.929 24.377 1.00 28.94 C ATOM 5550 CG MET A 360 37.254 36.491 24.752 1.00 27.97 C ATOM 5551 SD MET A 360 38.954 36.108 24.294 1.00 32.93 S ATOM 5552 CE MET A 360 38.764 35.889 22.527 1.00 29.96 C ATOM 5553 HA MET A 360 35.321 37.910 25.895 1.00 0.00 H ATOM 5554 HB2 MET A 360 36.849 38.016 23.291 1.00 0.00 H ATOM 5555 HB3 MET A 360 37.586 38.616 24.795 1.00 0.00 H ATOM 5556 HG2 MET A 360 36.589 35.796 24.239 1.00 0.00 H ATOM 5557 HG3 MET A 360 37.146 36.367 25.830 1.00 0.00 H ATOM 5558 HE1 MET A 360 38.061 35.078 22.336 1.00 0.00 H ATOM 5559 HE2 MET A 360 38.385 36.811 22.087 1.00 0.00 H ATOM 5560 HE3 MET A 360 39.731 35.645 22.086 1.00 0.00 H ATOM 5561 H MET A 360 34.562 37.676 23.030 1.00 0.00 H ATOM 5562 N GLN A 361 34.522 40.471 24.244 1.00 24.80 N ATOM 5563 CA GLN A 361 34.345 41.933 24.272 1.00 26.45 C ATOM 5564 C GLN A 361 33.677 42.471 25.561 1.00 25.66 C ATOM 5565 O GLN A 361 34.046 43.553 26.022 1.00 29.00 O ATOM 5566 CB GLN A 361 33.624 42.425 23.001 1.00 27.10 C ATOM 5567 CG GLN A 361 33.471 43.972 22.858 1.00 28.11 C ATOM 5568 CD GLN A 361 34.792 44.721 22.794 1.00 28.04 C ATOM 5569 OE1 GLN A 361 34.910 45.840 23.314 1.00 28.98 O ATOM 5570 NE2 GLN A 361 35.792 44.116 22.164 1.00 24.64 N ATOM 5571 HA GLN A 361 35.350 42.354 24.286 1.00 0.00 H ATOM 5572 HB2 GLN A 361 34.184 42.064 22.138 1.00 0.00 H ATOM 5573 HB3 GLN A 361 32.625 41.988 22.993 1.00 0.00 H ATOM 5574 HG2 GLN A 361 32.915 44.179 21.944 1.00 0.00 H ATOM 5575 HG3 GLN A 361 32.908 44.342 23.715 1.00 0.00 H ATOM 5576 HE22 GLN A 361 35.648 43.176 21.742 1.00 0.00 H ATOM 5577 HE21 GLN A 361 36.719 44.582 22.092 1.00 0.00 H ATOM 5578 H GLN A 361 33.977 39.912 23.557 1.00 0.00 H ATOM 5579 N PRO A 362 32.701 41.736 26.147 1.00 25.22 N ATOM 5580 CA PRO A 362 32.160 42.224 27.425 1.00 24.44 C ATOM 5581 C PRO A 362 33.235 42.446 28.474 1.00 24.99 C ATOM 5582 O PRO A 362 33.215 43.465 29.158 1.00 25.44 O ATOM 5583 CB PRO A 362 31.204 41.106 27.852 1.00 25.13 C ATOM 5584 CG PRO A 362 30.757 40.515 26.546 1.00 24.58 C ATOM 5585 CD PRO A 362 32.010 40.507 25.713 1.00 23.63 C ATOM 5586 HA PRO A 362 31.680 43.197 27.318 1.00 0.00 H ATOM 5587 HD3 PRO A 362 32.614 39.623 25.920 1.00 0.00 H ATOM 5588 HD2 PRO A 362 31.775 40.544 24.649 1.00 0.00 H ATOM 5589 HG3 PRO A 362 29.986 41.131 26.083 1.00 0.00 H ATOM 5590 HG2 PRO A 362 30.376 39.503 26.686 1.00 0.00 H ATOM 5591 HB2 PRO A 362 31.719 40.363 28.461 1.00 0.00 H ATOM 5592 HB3 PRO A 362 30.358 41.507 28.409 1.00 0.00 H ATOM 5593 N MET A 363 34.175 41.514 28.605 1.00 26.60 N ATOM 5594 CA MET A 363 35.270 41.698 29.549 1.00 25.68 C ATOM 5595 C MET A 363 36.134 42.912 29.164 1.00 26.23 C ATOM 5596 O MET A 363 36.562 43.692 30.025 1.00 24.93 O ATOM 5597 CB MET A 363 36.137 40.445 29.621 1.00 28.76 C ATOM 5598 CG MET A 363 37.168 40.485 30.721 1.00 32.26 C ATOM 5599 SD MET A 363 36.468 40.239 32.371 1.00 38.70 S ATOM 5600 CE MET A 363 37.793 40.893 33.377 1.00 36.32 C ATOM 5601 HA MET A 363 34.833 41.881 30.531 1.00 0.00 H ATOM 5602 HB2 MET A 363 35.488 39.586 29.788 1.00 0.00 H ATOM 5603 HB3 MET A 363 36.654 40.328 28.668 1.00 0.00 H ATOM 5604 HG2 MET A 363 37.662 41.456 30.696 1.00 0.00 H ATOM 5605 HG3 MET A 363 37.902 39.700 30.536 1.00 0.00 H ATOM 5606 HE1 MET A 363 38.703 40.322 33.193 1.00 0.00 H ATOM 5607 HE2 MET A 363 37.961 41.939 33.119 1.00 0.00 H ATOM 5608 HE3 MET A 363 37.520 40.816 34.430 1.00 0.00 H ATOM 5609 H MET A 363 34.128 40.649 28.030 1.00 0.00 H ATOM 5610 N ILE A 364 36.400 43.061 27.872 1.00 25.99 N ATOM 5611 CA ILE A 364 37.179 44.201 27.378 1.00 26.48 C ATOM 5612 C ILE A 364 36.427 45.508 27.643 1.00 26.46 C ATOM 5613 O ILE A 364 37.000 46.463 28.150 1.00 26.61 O ATOM 5614 CB ILE A 364 37.506 44.068 25.866 1.00 26.38 C ATOM 5615 CG1 ILE A 364 38.472 42.903 25.617 1.00 26.06 C ATOM 5616 CG2 ILE A 364 38.103 45.374 25.330 1.00 25.12 C ATOM 5617 CD1 ILE A 364 38.273 42.215 24.266 1.00 24.48 C ATOM 5618 HA ILE A 364 38.125 44.212 27.919 1.00 0.00 H ATOM 5619 HB ILE A 364 36.576 43.863 25.335 1.00 0.00 H ATOM 5620 HG12 ILE A 364 39.492 43.286 25.661 1.00 0.00 H ATOM 5621 HG13 ILE A 364 38.329 42.163 26.404 1.00 0.00 H ATOM 5622 HD11 ILE A 364 37.261 41.815 24.209 1.00 0.00 H ATOM 5623 HD12 ILE A 364 38.424 42.939 23.465 1.00 0.00 H ATOM 5624 HD13 ILE A 364 38.992 41.403 24.164 1.00 0.00 H ATOM 5625 HG21 ILE A 364 37.386 46.183 25.468 1.00 0.00 H ATOM 5626 HG22 ILE A 364 39.020 45.602 25.873 1.00 0.00 H ATOM 5627 HG23 ILE A 364 38.326 45.262 24.269 1.00 0.00 H ATOM 5628 H ILE A 364 36.048 42.354 27.195 1.00 0.00 H ATOM 5629 N ALA A 365 35.139 45.535 27.305 1.00 28.13 N ATOM 5630 CA ALA A 365 34.311 46.719 27.528 1.00 28.25 C ATOM 5631 C ALA A 365 34.270 47.100 29.002 1.00 30.70 C ATOM 5632 O ALA A 365 34.323 48.281 29.328 1.00 31.87 O ATOM 5633 CB ALA A 365 32.903 46.505 26.994 1.00 28.91 C ATOM 5634 HA ALA A 365 34.766 47.545 26.981 1.00 0.00 H ATOM 5635 HB1 ALA A 365 32.948 46.305 25.923 1.00 0.00 H ATOM 5636 HB2 ALA A 365 32.447 45.657 27.505 1.00 0.00 H ATOM 5637 HB3 ALA A 365 32.308 47.401 27.173 1.00 0.00 H ATOM 5638 H ALA A 365 34.711 44.692 26.871 1.00 0.00 H ATOM 5639 N PHE A 366 34.185 46.108 29.892 1.00 28.94 N ATOM 5640 CA PHE A 366 34.160 46.388 31.327 1.00 27.48 C ATOM 5641 C PHE A 366 35.430 47.062 31.803 1.00 28.84 C ATOM 5642 O PHE A 366 35.379 48.042 32.544 1.00 29.15 O ATOM 5643 CB PHE A 366 33.950 45.115 32.165 1.00 27.37 C ATOM 5644 CG PHE A 366 34.170 45.334 33.639 1.00 25.62 C ATOM 5645 CD1 PHE A 366 33.177 45.908 34.423 1.00 24.93 C ATOM 5646 CD2 PHE A 366 35.371 44.988 34.235 1.00 25.81 C ATOM 5647 CE1 PHE A 366 33.376 46.129 35.778 1.00 25.94 C ATOM 5648 CE2 PHE A 366 35.576 45.202 35.598 1.00 25.93 C ATOM 5649 CZ PHE A 366 34.582 45.776 36.363 1.00 25.18 C ATOM 5650 HA PHE A 366 33.315 47.062 31.471 1.00 0.00 H ATOM 5651 HB2 PHE A 366 32.929 44.765 32.015 1.00 0.00 H ATOM 5652 HB3 PHE A 366 34.648 44.353 31.819 1.00 0.00 H ATOM 5653 HD2 PHE A 366 36.164 44.544 33.633 1.00 0.00 H ATOM 5654 HE2 PHE A 366 36.522 44.916 36.059 1.00 0.00 H ATOM 5655 HZ PHE A 366 34.745 45.952 37.426 1.00 0.00 H ATOM 5656 HE1 PHE A 366 32.587 46.579 36.381 1.00 0.00 H ATOM 5657 HD1 PHE A 366 32.228 46.189 33.967 1.00 0.00 H ATOM 5658 H PHE A 366 34.136 45.124 29.560 1.00 0.00 H ATOM 5659 N LEU A 367 36.571 46.522 31.399 1.00 28.22 N ATOM 5660 CA LEU A 367 37.852 47.067 31.825 1.00 28.26 C ATOM 5661 C LEU A 367 38.079 48.476 31.257 1.00 29.33 C ATOM 5662 O LEU A 367 38.651 49.334 31.927 1.00 29.81 O ATOM 5663 CB LEU A 367 38.988 46.115 31.433 1.00 27.88 C ATOM 5664 CG LEU A 367 38.997 44.747 32.135 1.00 27.38 C ATOM 5665 CD1 LEU A 367 39.995 43.783 31.508 1.00 23.76 C ATOM 5666 CD2 LEU A 367 39.291 44.910 33.616 1.00 24.74 C ATOM 5667 HA LEU A 367 37.842 47.159 32.911 1.00 0.00 H ATOM 5668 HB2 LEU A 367 38.919 45.938 30.360 1.00 0.00 H ATOM 5669 HB3 LEU A 367 39.932 46.612 31.659 1.00 0.00 H ATOM 5670 HG LEU A 367 38.003 44.318 32.009 1.00 0.00 H ATOM 5671 HD21 LEU A 367 40.267 45.379 33.742 1.00 0.00 H ATOM 5672 HD22 LEU A 367 38.524 45.537 34.071 1.00 0.00 H ATOM 5673 HD23 LEU A 367 39.293 43.931 34.095 1.00 0.00 H ATOM 5674 HD11 LEU A 367 39.736 43.624 30.461 1.00 0.00 H ATOM 5675 HD12 LEU A 367 40.998 44.205 31.576 1.00 0.00 H ATOM 5676 HD13 LEU A 367 39.963 42.832 32.040 1.00 0.00 H ATOM 5677 H LEU A 367 36.551 45.696 30.768 1.00 0.00 H ATOM 5678 N GLU A 368 37.626 48.706 30.027 1.00 29.56 N ATOM 5679 CA GLU A 368 37.682 50.028 29.405 1.00 30.73 C ATOM 5680 C GLU A 368 36.734 51.009 30.094 1.00 31.38 C ATOM 5681 O GLU A 368 37.165 52.030 30.627 1.00 32.78 O ATOM 5682 CB GLU A 368 37.311 49.942 27.922 1.00 31.28 C ATOM 5683 CG GLU A 368 38.337 49.233 27.054 1.00 33.57 C ATOM 5684 CD GLU A 368 37.837 48.995 25.642 1.00 33.96 C ATOM 5685 OE1 GLU A 368 36.625 49.166 25.389 1.00 36.70 O ATOM 5686 OE2 GLU A 368 38.649 48.630 24.779 1.00 34.70 O ATOM 5687 HA GLU A 368 38.705 50.390 29.510 1.00 0.00 H ATOM 5688 HB2 GLU A 368 36.366 49.406 27.838 1.00 0.00 H ATOM 5689 HB3 GLU A 368 37.187 50.956 27.543 1.00 0.00 H ATOM 5690 HG2 GLU A 368 39.238 49.844 27.008 1.00 0.00 H ATOM 5691 HG3 GLU A 368 38.575 48.271 27.508 1.00 0.00 H ATOM 5692 H GLU A 368 37.217 47.916 29.488 1.00 0.00 H ATOM 5693 N ASP A 369 35.445 50.682 30.068 1.00 30.82 N ATOM 5694 CA ASP A 369 34.385 51.515 30.622 1.00 30.50 C ATOM 5695 C ASP A 369 34.529 51.806 32.112 1.00 31.18 C ATOM 5696 O ASP A 369 34.464 52.958 32.527 1.00 30.61 O ATOM 5697 CB ASP A 369 33.021 50.836 30.434 1.00 31.06 C ATOM 5698 CG ASP A 369 32.623 50.666 28.974 1.00 31.45 C ATOM 5699 OD1 ASP A 369 33.368 51.118 28.079 1.00 30.82 O ATOM 5700 OD2 ASP A 369 31.538 50.075 28.734 1.00 31.11 O ATOM 5701 HA ASP A 369 34.461 52.457 30.079 1.00 0.00 H ATOM 5702 HB2 ASP A 369 33.059 49.851 30.899 1.00 0.00 H ATOM 5703 HB3 ASP A 369 32.263 51.441 30.930 1.00 0.00 H ATOM 5704 H ASP A 369 35.178 49.779 29.627 1.00 0.00 H ATOM 5705 N GLU A 370 34.707 50.756 32.914 1.00 30.44 N ATOM 5706 CA GLU A 370 34.612 50.888 34.374 1.00 30.71 C ATOM 5707 C GLU A 370 35.946 51.015 35.092 1.00 29.53 C ATOM 5708 O GLU A 370 36.025 51.672 36.118 1.00 30.50 O ATOM 5709 CB GLU A 370 33.818 49.713 34.969 1.00 30.20 C ATOM 5710 CG GLU A 370 32.639 49.269 34.120 1.00 30.79 C ATOM 5711 CD GLU A 370 31.607 50.357 33.884 1.00 32.05 C ATOM 5712 OE1 GLU A 370 31.634 51.381 34.593 1.00 33.26 O ATOM 5713 OE2 GLU A 370 30.752 50.180 32.992 1.00 33.41 O ATOM 5714 HA GLU A 370 34.091 51.831 34.539 1.00 0.00 H ATOM 5715 HB2 GLU A 370 34.494 48.866 35.086 1.00 0.00 H ATOM 5716 HB3 GLU A 370 33.442 50.014 35.947 1.00 0.00 H ATOM 5717 HG2 GLU A 370 33.017 48.939 33.153 1.00 0.00 H ATOM 5718 HG3 GLU A 370 32.150 48.434 34.622 1.00 0.00 H ATOM 5719 H GLU A 370 34.917 49.826 32.498 1.00 0.00 H ATOM 5720 N LEU A 371 36.993 50.395 34.566 1.00 28.69 N ATOM 5721 CA LEU A 371 38.303 50.475 35.220 1.00 28.89 C ATOM 5722 C LEU A 371 39.280 51.385 34.463 1.00 30.56 C ATOM 5723 O LEU A 371 40.450 51.508 34.844 1.00 28.39 O ATOM 5724 CB LEU A 371 38.909 49.082 35.410 1.00 28.93 C ATOM 5725 CG LEU A 371 38.298 48.152 36.462 1.00 28.51 C ATOM 5726 CD1 LEU A 371 39.156 46.910 36.611 1.00 28.37 C ATOM 5727 CD2 LEU A 371 38.164 48.855 37.800 1.00 28.87 C ATOM 5728 HA LEU A 371 38.136 50.922 36.200 1.00 0.00 H ATOM 5729 HB2 LEU A 371 38.842 48.569 34.450 1.00 0.00 H ATOM 5730 HB3 LEU A 371 39.957 49.221 35.674 1.00 0.00 H ATOM 5731 HG LEU A 371 37.301 47.865 36.129 1.00 0.00 H ATOM 5732 HD21 LEU A 371 39.149 49.171 38.143 1.00 0.00 H ATOM 5733 HD22 LEU A 371 37.520 49.727 37.688 1.00 0.00 H ATOM 5734 HD23 LEU A 371 37.727 48.170 38.527 1.00 0.00 H ATOM 5735 HD11 LEU A 371 39.208 46.389 35.655 1.00 0.00 H ATOM 5736 HD12 LEU A 371 40.160 47.199 36.924 1.00 0.00 H ATOM 5737 HD13 LEU A 371 38.715 46.253 37.361 1.00 0.00 H ATOM 5738 H LEU A 371 36.885 49.850 33.687 1.00 0.00 H ATOM 5739 N LYS A 372 38.781 52.001 33.391 1.00 30.05 N ATOM 5740 CA LYS A 372 39.522 52.984 32.587 1.00 34.23 C ATOM 5741 C LYS A 372 40.838 52.465 32.008 1.00 34.10 C ATOM 5742 O LYS A 372 41.801 53.219 31.869 1.00 35.28 O ATOM 5743 CB LYS A 372 39.760 54.280 33.382 1.00 34.62 C ATOM 5744 CG LYS A 372 38.500 54.868 34.011 1.00 35.76 C ATOM 5745 CD LYS A 372 37.378 55.078 33.001 1.00 36.75 C ATOM 5746 CE LYS A 372 36.148 55.639 33.704 1.00 38.35 C ATOM 5747 NZ LYS A 372 34.981 55.808 32.792 1.00 39.02 N ATOM 5748 HA LYS A 372 38.881 53.192 31.730 1.00 0.00 H ATOM 5749 HB2 LYS A 372 40.473 54.067 34.179 1.00 0.00 H ATOM 5750 HB3 LYS A 372 40.184 55.023 32.706 1.00 0.00 H ATOM 5751 HG2 LYS A 372 38.148 54.188 34.787 1.00 0.00 H ATOM 5752 HG3 LYS A 372 38.750 55.830 34.459 1.00 0.00 H ATOM 5753 HD2 LYS A 372 37.708 55.779 32.234 1.00 0.00 H ATOM 5754 HD3 LYS A 372 37.126 54.125 32.536 1.00 0.00 H ATOM 5755 HE2 LYS A 372 36.402 56.611 34.127 1.00 0.00 H ATOM 5756 HE3 LYS A 372 35.866 54.958 34.507 1.00 0.00 H ATOM 5757 HZ1 LYS A 372 35.234 56.464 32.026 1.00 0.00 H ATOM 5758 HZ2 LYS A 372 34.721 54.885 32.389 1.00 0.00 H ATOM 5759 HZ3 LYS A 372 34.177 56.192 33.328 1.00 0.00 H ATOM 5760 H LYS A 372 37.807 51.772 33.106 1.00 0.00 H ATOM 5761 N LEU A 373 40.875 51.180 31.677 1.00 33.12 N ATOM 5762 CA LEU A 373 42.018 50.620 30.982 1.00 31.75 C ATOM 5763 C LEU A 373 41.987 51.045 29.523 1.00 31.23 C ATOM 5764 O LEU A 373 40.922 51.240 28.942 1.00 29.44 O ATOM 5765 CB LEU A 373 42.014 49.093 31.077 1.00 32.86 C ATOM 5766 CG LEU A 373 42.793 48.449 32.234 1.00 33.99 C ATOM 5767 CD1 LEU A 373 42.451 49.076 33.578 1.00 32.51 C ATOM 5768 CD2 LEU A 373 42.575 46.943 32.273 1.00 34.25 C ATOM 5769 HA LEU A 373 42.928 50.993 31.452 1.00 0.00 H ATOM 5770 HB2 LEU A 373 40.975 48.774 31.166 1.00 0.00 H ATOM 5771 HB3 LEU A 373 42.433 48.707 30.147 1.00 0.00 H ATOM 5772 HG LEU A 373 43.850 48.640 32.046 1.00 0.00 H ATOM 5773 HD21 LEU A 373 41.514 46.734 32.409 1.00 0.00 H ATOM 5774 HD22 LEU A 373 42.916 46.503 31.336 1.00 0.00 H ATOM 5775 HD23 LEU A 373 43.139 46.517 33.102 1.00 0.00 H ATOM 5776 HD11 LEU A 373 42.695 50.138 33.555 1.00 0.00 H ATOM 5777 HD12 LEU A 373 41.386 48.951 33.775 1.00 0.00 H ATOM 5778 HD13 LEU A 373 43.027 48.586 34.363 1.00 0.00 H ATOM 5779 H LEU A 373 40.072 50.565 31.920 1.00 0.00 H ATOM 5780 N SER A 374 43.156 51.201 28.925 1.00 30.76 N ATOM 5781 CA SER A 374 43.212 51.451 27.492 1.00 31.25 C ATOM 5782 C SER A 374 42.738 50.181 26.793 1.00 31.24 C ATOM 5783 O SER A 374 42.641 49.126 27.428 1.00 31.22 O ATOM 5784 CB SER A 374 44.639 51.736 27.082 1.00 30.04 C ATOM 5785 OG SER A 374 45.434 50.616 27.412 1.00 30.89 O ATOM 5786 HA SER A 374 42.590 52.305 27.225 1.00 0.00 H ATOM 5787 HB2 SER A 374 45.005 52.616 27.612 1.00 0.00 H ATOM 5788 HB3 SER A 374 44.684 51.915 26.008 1.00 0.00 H ATOM 5789 HG SER A 374 45.388 50.456 28.388 1.00 0.00 H ATOM 5790 H SER A 374 44.035 51.145 29.478 1.00 0.00 H ATOM 5791 N ARG A 375 42.449 50.281 25.497 1.00 30.21 N ATOM 5792 CA ARG A 375 42.008 49.132 24.712 1.00 32.12 C ATOM 5793 C ARG A 375 43.076 48.043 24.678 1.00 31.75 C ATOM 5794 O ARG A 375 42.783 46.873 24.908 1.00 30.91 O ATOM 5795 CB ARG A 375 41.641 49.546 23.291 1.00 33.23 C ATOM 5796 CG ARG A 375 41.100 48.405 22.429 1.00 35.69 C ATOM 5797 CD ARG A 375 40.494 48.964 21.156 1.00 37.97 C ATOM 5798 NE ARG A 375 41.518 49.631 20.359 1.00 39.85 N ATOM 5799 CZ ARG A 375 41.320 50.731 19.638 1.00 40.96 C ATOM 5800 NH1 ARG A 375 40.130 51.317 19.607 1.00 40.03 N ATOM 5801 NH2 ARG A 375 42.327 51.252 18.950 1.00 41.71 N ATOM 5802 HA ARG A 375 41.119 48.730 25.198 1.00 0.00 H ATOM 5803 HB2 ARG A 375 40.880 50.324 23.347 1.00 0.00 H ATOM 5804 HB3 ARG A 375 42.533 49.946 22.809 1.00 0.00 H ATOM 5805 HG2 ARG A 375 41.914 47.726 22.175 1.00 0.00 H ATOM 5806 HG3 ARG A 375 40.336 47.862 22.985 1.00 0.00 H ATOM 5807 HD2 ARG A 375 39.714 49.681 21.413 1.00 0.00 H ATOM 5808 HD3 ARG A 375 40.060 48.150 20.576 1.00 0.00 H ATOM 5809 HE ARG A 375 42.472 49.216 20.354 1.00 0.00 H ATOM 5810 HH12 ARG A 375 39.988 52.177 19.039 1.00 0.00 H ATOM 5811 HH11 ARG A 375 39.339 50.917 20.150 1.00 0.00 H ATOM 5812 HH22 ARG A 375 42.180 52.112 18.384 1.00 0.00 H ATOM 5813 HH21 ARG A 375 43.264 50.801 18.977 1.00 0.00 H ATOM 5814 H ARG A 375 42.540 51.206 25.030 1.00 0.00 H ATOM 5815 N LYS A 376 44.310 48.444 24.394 1.00 31.60 N ATOM 5816 CA LYS A 376 45.450 47.534 24.405 1.00 32.24 C ATOM 5817 C LYS A 376 45.488 46.689 25.684 1.00 31.94 C ATOM 5818 O LYS A 376 45.459 45.463 25.622 1.00 33.33 O ATOM 5819 CB LYS A 376 46.750 48.327 24.252 1.00 33.45 C ATOM 5820 CG LYS A 376 48.027 47.499 24.293 1.00 37.17 C ATOM 5821 CD LYS A 376 49.253 48.414 24.379 1.00 40.09 C ATOM 5822 CE LYS A 376 50.559 47.626 24.470 1.00 43.59 C ATOM 5823 NZ LYS A 376 50.749 46.935 25.793 1.00 45.66 N ATOM 5824 HA LYS A 376 45.343 46.850 23.563 1.00 0.00 H ATOM 5825 HB2 LYS A 376 46.716 48.847 23.295 1.00 0.00 H ATOM 5826 HB3 LYS A 376 46.796 49.057 25.060 1.00 0.00 H ATOM 5827 HG2 LYS A 376 48.004 46.845 25.165 1.00 0.00 H ATOM 5828 HG3 LYS A 376 48.093 46.894 23.389 1.00 0.00 H ATOM 5829 HD2 LYS A 376 49.284 49.043 23.490 1.00 0.00 H ATOM 5830 HD3 LYS A 376 49.160 49.043 25.264 1.00 0.00 H ATOM 5831 HE2 LYS A 376 51.390 48.315 24.317 1.00 0.00 H ATOM 5832 HE3 LYS A 376 50.564 46.872 23.682 1.00 0.00 H ATOM 5833 HZ1 LYS A 376 50.757 47.643 26.555 1.00 0.00 H ATOM 5834 HZ2 LYS A 376 49.968 46.266 25.948 1.00 0.00 H ATOM 5835 HZ3 LYS A 376 51.653 46.420 25.787 1.00 0.00 H ATOM 5836 H LYS A 376 44.469 49.444 24.155 1.00 0.00 H ATOM 5837 N HIS A 377 45.549 47.347 26.837 1.00 30.62 N ATOM 5838 CA HIS A 377 45.636 46.644 28.112 1.00 30.46 C ATOM 5839 C HIS A 377 44.415 45.793 28.400 1.00 28.46 C ATOM 5840 O HIS A 377 44.548 44.696 28.923 1.00 30.56 O ATOM 5841 CB HIS A 377 45.874 47.613 29.270 1.00 31.53 C ATOM 5842 CG HIS A 377 47.196 48.310 29.212 1.00 33.95 C ATOM 5843 ND1 HIS A 377 47.385 49.591 29.688 1.00 35.01 N ATOM 5844 CD2 HIS A 377 48.397 47.906 28.734 1.00 35.01 C ATOM 5845 CE1 HIS A 377 48.645 49.943 29.508 1.00 34.62 C ATOM 5846 NE2 HIS A 377 49.280 48.940 28.929 1.00 34.54 N ATOM 5847 HA HIS A 377 46.492 45.975 28.023 1.00 0.00 H ATOM 5848 HB2 HIS A 377 45.087 48.367 29.255 1.00 0.00 H ATOM 5849 HB3 HIS A 377 45.821 47.053 30.204 1.00 0.00 H ATOM 5850 HD2 HIS A 377 48.621 46.941 28.280 1.00 0.00 H ATOM 5851 HE1 HIS A 377 49.086 50.899 29.790 1.00 0.00 H ATOM 5852 H HIS A 377 45.534 48.387 26.830 1.00 0.00 H ATOM 5853 N ALA A 378 43.232 46.291 28.061 1.00 27.55 N ATOM 5854 CA ALA A 378 41.997 45.551 28.306 1.00 26.54 C ATOM 5855 C ALA A 378 41.963 44.237 27.525 1.00 27.53 C ATOM 5856 O ALA A 378 41.546 43.203 28.056 1.00 26.08 O ATOM 5857 CB ALA A 378 40.779 46.399 27.960 1.00 24.67 C ATOM 5858 HA ALA A 378 41.969 45.312 29.369 1.00 0.00 H ATOM 5859 HB1 ALA A 378 40.778 47.299 28.575 1.00 0.00 H ATOM 5860 HB2 ALA A 378 40.819 46.677 26.907 1.00 0.00 H ATOM 5861 HB3 ALA A 378 39.872 45.825 28.151 1.00 0.00 H ATOM 5862 H ALA A 378 43.184 47.228 27.612 1.00 0.00 H ATOM 5863 N VAL A 379 42.393 44.298 26.262 1.00 26.92 N ATOM 5864 CA VAL A 379 42.444 43.135 25.386 1.00 24.69 C ATOM 5865 C VAL A 379 43.476 42.123 25.861 1.00 25.73 C ATOM 5866 O VAL A 379 43.195 40.924 25.931 1.00 25.70 O ATOM 5867 CB VAL A 379 42.775 43.543 23.935 1.00 26.18 C ATOM 5868 CG1 VAL A 379 43.189 42.319 23.100 1.00 23.33 C ATOM 5869 CG2 VAL A 379 41.599 44.276 23.304 1.00 22.72 C ATOM 5870 HA VAL A 379 41.455 42.677 25.417 1.00 0.00 H ATOM 5871 HB VAL A 379 43.623 44.227 23.955 1.00 0.00 H ATOM 5872 HG11 VAL A 379 44.071 41.859 23.545 1.00 0.00 H ATOM 5873 HG12 VAL A 379 42.371 41.598 23.084 1.00 0.00 H ATOM 5874 HG13 VAL A 379 43.417 42.635 22.082 1.00 0.00 H ATOM 5875 HG21 VAL A 379 40.726 43.623 23.298 1.00 0.00 H ATOM 5876 HG22 VAL A 379 41.379 45.173 23.883 1.00 0.00 H ATOM 5877 HG23 VAL A 379 41.853 44.555 22.281 1.00 0.00 H ATOM 5878 H VAL A 379 42.705 45.216 25.887 1.00 0.00 H ATOM 5879 N LEU A 380 44.669 42.609 26.192 1.00 25.66 N ATOM 5880 CA LEU A 380 45.759 41.733 26.612 1.00 27.48 C ATOM 5881 C LEU A 380 45.474 41.030 27.936 1.00 28.03 C ATOM 5882 O LEU A 380 45.768 39.847 28.074 1.00 28.06 O ATOM 5883 CB LEU A 380 47.087 42.499 26.674 1.00 27.07 C ATOM 5884 CG LEU A 380 47.635 42.928 25.305 1.00 28.12 C ATOM 5885 CD1 LEU A 380 48.935 43.738 25.440 1.00 28.10 C ATOM 5886 CD2 LEU A 380 47.854 41.708 24.427 1.00 29.10 C ATOM 5887 HA LEU A 380 45.842 40.954 25.855 1.00 0.00 H ATOM 5888 HB2 LEU A 380 46.937 43.394 27.277 1.00 0.00 H ATOM 5889 HB3 LEU A 380 47.828 41.859 27.153 1.00 0.00 H ATOM 5890 HG LEU A 380 46.896 43.577 24.836 1.00 0.00 H ATOM 5891 HD21 LEU A 380 48.569 41.040 24.907 1.00 0.00 H ATOM 5892 HD22 LEU A 380 46.906 41.188 24.287 1.00 0.00 H ATOM 5893 HD23 LEU A 380 48.243 42.024 23.459 1.00 0.00 H ATOM 5894 HD11 LEU A 380 48.743 44.635 26.029 1.00 0.00 H ATOM 5895 HD12 LEU A 380 49.691 43.130 25.937 1.00 0.00 H ATOM 5896 HD13 LEU A 380 49.289 44.022 24.449 1.00 0.00 H ATOM 5897 H LEU A 380 44.829 43.636 26.151 1.00 0.00 H ATOM 5898 N TRP A 381 44.907 41.759 28.898 1.00 28.19 N ATOM 5899 CA TRP A 381 44.567 41.178 30.195 1.00 29.85 C ATOM 5900 C TRP A 381 43.429 40.188 30.065 1.00 29.44 C ATOM 5901 O TRP A 381 43.440 39.151 30.716 1.00 31.52 O ATOM 5902 CB TRP A 381 44.230 42.252 31.236 1.00 27.97 C ATOM 5903 CG TRP A 381 45.447 42.811 31.901 1.00 28.08 C ATOM 5904 CD1 TRP A 381 45.951 44.071 31.764 1.00 28.44 C ATOM 5905 CD2 TRP A 381 46.332 42.119 32.800 1.00 28.80 C ATOM 5906 NE1 TRP A 381 47.087 44.212 32.524 1.00 29.61 N ATOM 5907 CE2 TRP A 381 47.344 43.028 33.168 1.00 28.58 C ATOM 5908 CE3 TRP A 381 46.361 40.823 33.332 1.00 27.27 C ATOM 5909 CZ2 TRP A 381 48.371 42.687 34.039 1.00 28.82 C ATOM 5910 CZ3 TRP A 381 47.376 40.486 34.194 1.00 28.47 C ATOM 5911 CH2 TRP A 381 48.373 41.413 34.542 1.00 29.10 C ATOM 5912 HA TRP A 381 45.451 40.647 30.547 1.00 0.00 H ATOM 5913 HB2 TRP A 381 43.699 43.064 30.740 1.00 0.00 H ATOM 5914 HB3 TRP A 381 43.587 41.811 31.998 1.00 0.00 H ATOM 5915 HE1 TRP A 381 47.660 45.077 32.599 1.00 0.00 H ATOM 5916 HD1 TRP A 381 45.516 44.853 31.142 1.00 0.00 H ATOM 5917 HZ2 TRP A 381 49.145 43.405 34.311 1.00 0.00 H ATOM 5918 HH2 TRP A 381 49.165 41.112 35.227 1.00 0.00 H ATOM 5919 HZ3 TRP A 381 47.409 39.481 34.616 1.00 0.00 H ATOM 5920 HE3 TRP A 381 45.593 40.096 33.067 1.00 0.00 H ATOM 5921 H TRP A 381 44.702 42.763 28.721 1.00 0.00 H ATOM 5922 N THR A 382 42.458 40.510 29.216 1.00 30.00 N ATOM 5923 CA THR A 382 41.342 39.616 28.943 1.00 28.57 C ATOM 5924 C THR A 382 41.847 38.309 28.318 1.00 30.45 C ATOM 5925 O THR A 382 41.473 37.220 28.755 1.00 30.96 O ATOM 5926 CB THR A 382 40.283 40.298 28.060 1.00 28.26 C ATOM 5927 OG1 THR A 382 39.707 41.391 28.786 1.00 26.86 O ATOM 5928 CG2 THR A 382 39.170 39.328 27.658 1.00 25.92 C ATOM 5929 HA THR A 382 40.857 39.371 29.888 1.00 0.00 H ATOM 5930 HB THR A 382 40.773 40.648 27.151 1.00 0.00 H ATOM 5931 HG1 THR A 382 40.417 42.040 29.020 1.00 0.00 H ATOM 5932 HG23 THR A 382 39.600 38.493 27.105 1.00 0.00 H ATOM 5933 HG21 THR A 382 38.674 38.955 28.554 1.00 0.00 H ATOM 5934 HG22 THR A 382 38.446 39.848 27.030 1.00 0.00 H ATOM 5935 H THR A 382 42.497 41.429 28.732 1.00 0.00 H ATOM 5936 N ALA A 383 42.703 38.425 27.309 1.00 29.39 N ATOM 5937 CA ALA A 383 43.303 37.264 26.662 1.00 28.59 C ATOM 5938 C ALA A 383 44.136 36.433 27.647 1.00 28.78 C ATOM 5939 O ALA A 383 44.145 35.205 27.580 1.00 28.19 O ATOM 5940 CB ALA A 383 44.172 37.710 25.499 1.00 28.90 C ATOM 5941 HA ALA A 383 42.494 36.633 26.294 1.00 0.00 H ATOM 5942 HB1 ALA A 383 43.560 38.249 24.775 1.00 0.00 H ATOM 5943 HB2 ALA A 383 44.962 38.365 25.867 1.00 0.00 H ATOM 5944 HB3 ALA A 383 44.616 36.836 25.022 1.00 0.00 H ATOM 5945 H ALA A 383 42.954 39.375 26.969 1.00 0.00 H ATOM 5946 N ALA A 384 44.847 37.118 28.543 1.00 26.84 N ATOM 5947 CA ALA A 384 45.650 36.463 29.575 1.00 27.30 C ATOM 5948 C ALA A 384 44.795 35.613 30.529 1.00 27.75 C ATOM 5949 O ALA A 384 45.190 34.503 30.879 1.00 27.92 O ATOM 5950 CB ALA A 384 46.465 37.498 30.360 1.00 25.47 C ATOM 5951 HA ALA A 384 46.334 35.784 29.066 1.00 0.00 H ATOM 5952 HB1 ALA A 384 47.129 38.029 29.678 1.00 0.00 H ATOM 5953 HB2 ALA A 384 45.788 38.207 30.835 1.00 0.00 H ATOM 5954 HB3 ALA A 384 47.056 36.991 31.123 1.00 0.00 H ATOM 5955 H ALA A 384 44.830 38.157 28.507 1.00 0.00 H ATOM 5956 N ILE A 385 43.632 36.129 30.932 1.00 28.96 N ATOM 5957 CA ILE A 385 42.724 35.398 31.830 1.00 29.57 C ATOM 5958 C ILE A 385 42.100 34.204 31.117 1.00 28.84 C ATOM 5959 O ILE A 385 41.981 33.114 31.686 1.00 27.01 O ATOM 5960 CB ILE A 385 41.567 36.266 32.375 1.00 31.22 C ATOM 5961 CG1 ILE A 385 42.064 37.631 32.867 1.00 34.87 C ATOM 5962 CG2 ILE A 385 40.818 35.527 33.485 1.00 31.66 C ATOM 5963 CD1 ILE A 385 43.172 37.570 33.909 1.00 37.84 C ATOM 5964 HA ILE A 385 43.347 35.081 32.666 1.00 0.00 H ATOM 5965 HB ILE A 385 40.876 36.449 31.552 1.00 0.00 H ATOM 5966 HG12 ILE A 385 42.438 38.186 32.007 1.00 0.00 H ATOM 5967 HG13 ILE A 385 41.218 38.163 33.302 1.00 0.00 H ATOM 5968 HD11 ILE A 385 42.815 37.030 34.786 1.00 0.00 H ATOM 5969 HD12 ILE A 385 44.035 37.053 33.490 1.00 0.00 H ATOM 5970 HD13 ILE A 385 43.456 38.583 34.195 1.00 0.00 H ATOM 5971 HG21 ILE A 385 40.408 34.598 33.089 1.00 0.00 H ATOM 5972 HG22 ILE A 385 41.507 35.303 34.300 1.00 0.00 H ATOM 5973 HG23 ILE A 385 40.008 36.155 33.855 1.00 0.00 H ATOM 5974 H ILE A 385 43.359 37.077 30.601 1.00 0.00 H ATOM 5975 N VAL A 386 41.689 34.413 29.874 1.00 25.96 N ATOM 5976 CA VAL A 386 41.106 33.325 29.099 1.00 26.80 C ATOM 5977 C VAL A 386 42.140 32.233 28.808 1.00 26.63 C ATOM 5978 O VAL A 386 41.841 31.047 28.935 1.00 29.22 O ATOM 5979 CB VAL A 386 40.459 33.839 27.793 1.00 25.93 C ATOM 5980 CG1 VAL A 386 40.064 32.682 26.892 1.00 23.99 C ATOM 5981 CG2 VAL A 386 39.242 34.697 28.128 1.00 24.11 C ATOM 5982 HA VAL A 386 40.315 32.884 29.705 1.00 0.00 H ATOM 5983 HB VAL A 386 41.188 34.446 27.256 1.00 0.00 H ATOM 5984 HG11 VAL A 386 40.951 32.101 26.639 1.00 0.00 H ATOM 5985 HG12 VAL A 386 39.347 32.046 27.412 1.00 0.00 H ATOM 5986 HG13 VAL A 386 39.611 33.071 25.980 1.00 0.00 H ATOM 5987 HG21 VAL A 386 38.518 34.098 28.681 1.00 0.00 H ATOM 5988 HG22 VAL A 386 39.554 35.546 28.737 1.00 0.00 H ATOM 5989 HG23 VAL A 386 38.788 35.058 27.205 1.00 0.00 H ATOM 5990 H VAL A 386 41.783 35.358 29.450 1.00 0.00 H ATOM 5991 N PHE A 387 43.350 32.640 28.432 1.00 27.54 N ATOM 5992 CA PHE A 387 44.428 31.703 28.113 1.00 27.34 C ATOM 5993 C PHE A 387 44.835 30.885 29.336 1.00 27.35 C ATOM 5994 O PHE A 387 44.830 29.651 29.299 1.00 24.88 O ATOM 5995 CB PHE A 387 45.646 32.450 27.551 1.00 28.23 C ATOM 5996 CG PHE A 387 46.853 31.571 27.315 1.00 29.11 C ATOM 5997 CD1 PHE A 387 46.861 30.635 26.293 1.00 27.93 C ATOM 5998 CD2 PHE A 387 47.986 31.693 28.116 1.00 30.31 C ATOM 5999 CE1 PHE A 387 47.967 29.826 26.074 1.00 28.87 C ATOM 6000 CE2 PHE A 387 49.102 30.885 27.903 1.00 30.02 C ATOM 6001 CZ PHE A 387 49.089 29.951 26.879 1.00 29.60 C ATOM 6002 HA PHE A 387 44.052 31.016 27.354 1.00 0.00 H ATOM 6003 HB2 PHE A 387 45.362 32.904 26.602 1.00 0.00 H ATOM 6004 HB3 PHE A 387 45.924 33.232 28.257 1.00 0.00 H ATOM 6005 HD2 PHE A 387 48.000 32.429 28.919 1.00 0.00 H ATOM 6006 HE2 PHE A 387 49.981 30.987 28.539 1.00 0.00 H ATOM 6007 HZ PHE A 387 49.958 29.316 26.707 1.00 0.00 H ATOM 6008 HE1 PHE A 387 47.954 29.092 25.269 1.00 0.00 H ATOM 6009 HD1 PHE A 387 45.986 30.533 25.652 1.00 0.00 H ATOM 6010 H PHE A 387 43.536 33.661 28.362 1.00 0.00 H ATOM 6011 N PHE A 388 45.204 31.573 30.413 1.00 24.92 N ATOM 6012 CA PHE A 388 45.544 30.881 31.642 1.00 25.57 C ATOM 6013 C PHE A 388 44.418 29.924 32.053 1.00 25.08 C ATOM 6014 O PHE A 388 44.674 28.754 32.328 1.00 25.22 O ATOM 6015 CB PHE A 388 45.844 31.853 32.791 1.00 25.44 C ATOM 6016 CG PHE A 388 45.720 31.210 34.148 1.00 25.75 C ATOM 6017 CD1 PHE A 388 46.756 30.456 34.666 1.00 25.17 C ATOM 6018 CD2 PHE A 388 44.552 31.332 34.887 1.00 25.76 C ATOM 6019 CE1 PHE A 388 46.640 29.850 35.902 1.00 24.43 C ATOM 6020 CE2 PHE A 388 44.430 30.727 36.123 1.00 26.08 C ATOM 6021 CZ PHE A 388 45.479 29.984 36.628 1.00 25.20 C ATOM 6022 HA PHE A 388 46.451 30.310 31.443 1.00 0.00 H ATOM 6023 HB2 PHE A 388 46.861 32.227 32.674 1.00 0.00 H ATOM 6024 HB3 PHE A 388 45.143 32.686 32.735 1.00 0.00 H ATOM 6025 HD2 PHE A 388 43.720 31.912 34.487 1.00 0.00 H ATOM 6026 HE2 PHE A 388 43.510 30.836 36.697 1.00 0.00 H ATOM 6027 HZ PHE A 388 45.387 29.504 37.602 1.00 0.00 H ATOM 6028 HE1 PHE A 388 47.468 29.266 36.302 1.00 0.00 H ATOM 6029 HD1 PHE A 388 47.675 30.338 34.093 1.00 0.00 H ATOM 6030 H PHE A 388 45.249 32.611 30.374 1.00 0.00 H ATOM 6031 N SER A 389 43.180 30.423 32.076 1.00 24.22 N ATOM 6032 CA SER A 389 42.026 29.651 32.557 1.00 24.59 C ATOM 6033 C SER A 389 41.703 28.442 31.688 1.00 26.26 C ATOM 6034 O SER A 389 41.117 27.452 32.158 1.00 25.47 O ATOM 6035 CB SER A 389 40.786 30.546 32.671 1.00 24.04 C ATOM 6036 OG SER A 389 40.961 31.580 33.635 1.00 22.41 O ATOM 6037 HA SER A 389 42.307 29.274 33.540 1.00 0.00 H ATOM 6038 HB2 SER A 389 39.934 29.932 32.964 1.00 0.00 H ATOM 6039 HB3 SER A 389 40.589 31.000 31.700 1.00 0.00 H ATOM 6040 HG SER A 389 41.134 31.176 34.522 1.00 0.00 H ATOM 6041 H SER A 389 43.026 31.395 31.741 1.00 0.00 H ATOM 6042 N ALA A 390 42.089 28.524 30.416 1.00 26.64 N ATOM 6043 CA ALA A 390 41.787 27.479 29.448 1.00 24.79 C ATOM 6044 C ALA A 390 42.583 26.210 29.716 1.00 23.55 C ATOM 6045 O ALA A 390 42.216 25.132 29.264 1.00 24.29 O ATOM 6046 CB ALA A 390 42.047 27.986 28.014 1.00 23.55 C ATOM 6047 HA ALA A 390 40.731 27.230 29.552 1.00 0.00 H ATOM 6048 HB1 ALA A 390 41.413 28.850 27.815 1.00 0.00 H ATOM 6049 HB2 ALA A 390 43.094 28.272 27.915 1.00 0.00 H ATOM 6050 HB3 ALA A 390 41.817 27.193 27.302 1.00 0.00 H ATOM 6051 H ALA A 390 42.623 29.360 30.104 1.00 0.00 H ATOM 6052 N HIS A 391 43.681 26.343 30.442 1.00 25.82 N ATOM 6053 CA HIS A 391 44.468 25.181 30.830 1.00 25.93 C ATOM 6054 C HIS A 391 43.651 24.174 31.647 1.00 27.43 C ATOM 6055 O HIS A 391 43.961 22.973 31.667 1.00 26.81 O ATOM 6056 CB HIS A 391 45.735 25.609 31.564 1.00 26.66 C ATOM 6057 CG HIS A 391 46.778 26.188 30.661 1.00 28.83 C ATOM 6058 ND1 HIS A 391 46.673 27.451 30.113 1.00 29.22 N ATOM 6059 CD2 HIS A 391 47.941 25.673 30.198 1.00 28.99 C ATOM 6060 CE1 HIS A 391 47.728 27.690 29.355 1.00 29.06 C ATOM 6061 NE2 HIS A 391 48.514 26.628 29.389 1.00 31.12 N ATOM 6062 HA HIS A 391 44.765 24.666 29.916 1.00 0.00 H ATOM 6063 HB2 HIS A 391 45.467 26.359 32.308 1.00 0.00 H ATOM 6064 HB3 HIS A 391 46.156 24.737 32.064 1.00 0.00 H ATOM 6065 HD2 HIS A 391 48.348 24.687 30.423 1.00 0.00 H ATOM 6066 HE1 HIS A 391 47.918 28.607 28.797 1.00 0.00 H ATOM 6067 H HIS A 391 43.986 27.291 30.740 1.00 0.00 H ATOM 6068 N LEU A 392 42.601 24.657 32.307 1.00 26.22 N ATOM 6069 CA LEU A 392 41.731 23.764 33.053 1.00 25.91 C ATOM 6070 C LEU A 392 40.964 22.880 32.071 1.00 25.84 C ATOM 6071 O LEU A 392 40.879 21.655 32.236 1.00 25.49 O ATOM 6072 CB LEU A 392 40.776 24.566 33.944 1.00 26.08 C ATOM 6073 CG LEU A 392 39.959 23.820 35.005 1.00 27.56 C ATOM 6074 CD1 LEU A 392 40.849 22.950 35.877 1.00 27.01 C ATOM 6075 CD2 LEU A 392 39.176 24.814 35.852 1.00 26.48 C ATOM 6076 HA LEU A 392 42.329 23.129 33.706 1.00 0.00 H ATOM 6077 HB2 LEU A 392 41.374 25.313 34.466 1.00 0.00 H ATOM 6078 HB3 LEU A 392 40.066 25.067 33.285 1.00 0.00 H ATOM 6079 HG LEU A 392 39.256 23.161 34.496 1.00 0.00 H ATOM 6080 HD21 LEU A 392 39.870 25.495 36.345 1.00 0.00 H ATOM 6081 HD22 LEU A 392 38.501 25.382 35.212 1.00 0.00 H ATOM 6082 HD23 LEU A 392 38.599 24.274 36.603 1.00 0.00 H ATOM 6083 HD11 LEU A 392 41.361 22.217 35.254 1.00 0.00 H ATOM 6084 HD12 LEU A 392 41.585 23.576 36.382 1.00 0.00 H ATOM 6085 HD13 LEU A 392 40.238 22.435 36.618 1.00 0.00 H ATOM 6086 H LEU A 392 42.402 25.678 32.289 1.00 0.00 H ATOM 6087 N VAL A 393 40.405 23.513 31.045 1.00 24.39 N ATOM 6088 CA VAL A 393 39.618 22.817 30.035 1.00 24.80 C ATOM 6089 C VAL A 393 40.491 21.922 29.125 1.00 25.25 C ATOM 6090 O VAL A 393 40.038 20.887 28.634 1.00 24.10 O ATOM 6091 CB VAL A 393 38.793 23.852 29.218 1.00 26.82 C ATOM 6092 CG1 VAL A 393 38.488 23.368 27.837 1.00 26.23 C ATOM 6093 CG2 VAL A 393 37.512 24.239 29.979 1.00 26.41 C ATOM 6094 HA VAL A 393 38.929 22.140 30.540 1.00 0.00 H ATOM 6095 HB VAL A 393 39.406 24.746 29.102 1.00 0.00 H ATOM 6096 HG11 VAL A 393 39.421 23.182 27.304 1.00 0.00 H ATOM 6097 HG12 VAL A 393 37.911 22.445 27.896 1.00 0.00 H ATOM 6098 HG13 VAL A 393 37.911 24.126 27.307 1.00 0.00 H ATOM 6099 HG21 VAL A 393 36.904 23.349 30.141 1.00 0.00 H ATOM 6100 HG22 VAL A 393 37.780 24.678 30.940 1.00 0.00 H ATOM 6101 HG23 VAL A 393 36.947 24.964 29.392 1.00 0.00 H ATOM 6102 H VAL A 393 40.534 24.541 30.960 1.00 0.00 H ATOM 6103 N MET A 394 41.742 22.329 28.919 1.00 24.40 N ATOM 6104 CA MET A 394 42.684 21.585 28.086 1.00 26.55 C ATOM 6105 C MET A 394 43.197 20.300 28.750 1.00 26.82 C ATOM 6106 O MET A 394 43.469 19.314 28.056 1.00 27.72 O ATOM 6107 CB MET A 394 43.892 22.459 27.720 1.00 26.92 C ATOM 6108 CG MET A 394 43.623 23.600 26.746 1.00 30.13 C ATOM 6109 SD MET A 394 45.169 24.389 26.195 1.00 32.32 S ATOM 6110 CE MET A 394 45.381 25.703 27.373 1.00 32.70 C ATOM 6111 HA MET A 394 42.127 21.303 27.192 1.00 0.00 H ATOM 6112 HB2 MET A 394 44.282 22.892 28.641 1.00 0.00 H ATOM 6113 HB3 MET A 394 44.649 21.813 27.275 1.00 0.00 H ATOM 6114 HG2 MET A 394 43.000 24.347 27.239 1.00 0.00 H ATOM 6115 HG3 MET A 394 43.097 23.207 25.876 1.00 0.00 H ATOM 6116 HE1 MET A 394 44.524 26.375 27.324 1.00 0.00 H ATOM 6117 HE2 MET A 394 45.457 25.282 28.375 1.00 0.00 H ATOM 6118 HE3 MET A 394 46.291 26.255 27.140 1.00 0.00 H ATOM 6119 H MET A 394 42.061 23.211 29.369 1.00 0.00 H ATOM 6120 N PHE A 395 43.334 20.314 30.080 1.00 24.65 N ATOM 6121 CA PHE A 395 43.990 19.213 30.800 1.00 23.64 C ATOM 6122 C PHE A 395 43.105 18.385 31.737 1.00 24.78 C ATOM 6123 O PHE A 395 43.508 17.300 32.160 1.00 24.09 O ATOM 6124 CB PHE A 395 45.221 19.735 31.562 1.00 24.45 C ATOM 6125 CG PHE A 395 46.355 20.148 30.662 1.00 25.31 C ATOM 6126 CD1 PHE A 395 47.232 19.197 30.152 1.00 25.75 C ATOM 6127 CD2 PHE A 395 46.538 21.480 30.314 1.00 25.12 C ATOM 6128 CE1 PHE A 395 48.277 19.567 29.313 1.00 25.49 C ATOM 6129 CE2 PHE A 395 47.578 21.857 29.478 1.00 25.80 C ATOM 6130 CZ PHE A 395 48.451 20.891 28.975 1.00 25.61 C ATOM 6131 HA PHE A 395 44.276 18.515 30.013 1.00 0.00 H ATOM 6132 HB2 PHE A 395 44.919 20.598 32.155 1.00 0.00 H ATOM 6133 HB3 PHE A 395 45.576 18.946 32.225 1.00 0.00 H ATOM 6134 HD2 PHE A 395 45.857 22.237 30.702 1.00 0.00 H ATOM 6135 HE2 PHE A 395 47.714 22.906 29.214 1.00 0.00 H ATOM 6136 HZ PHE A 395 49.269 21.184 28.316 1.00 0.00 H ATOM 6137 HE1 PHE A 395 48.958 18.810 28.923 1.00 0.00 H ATOM 6138 HD1 PHE A 395 47.098 18.147 30.414 1.00 0.00 H ATOM 6139 H PHE A 395 42.967 21.124 30.619 1.00 0.00 H ATOM 6140 N LEU A 396 41.914 18.885 32.064 1.00 25.99 N ATOM 6141 CA LEU A 396 41.003 18.151 32.949 1.00 25.88 C ATOM 6142 C LEU A 396 39.783 17.648 32.193 1.00 26.79 C ATOM 6143 O LEU A 396 38.969 18.436 31.708 1.00 26.03 O ATOM 6144 CB LEU A 396 40.569 19.015 34.136 1.00 23.83 C ATOM 6145 CG LEU A 396 39.589 18.350 35.119 1.00 23.08 C ATOM 6146 CD1 LEU A 396 40.200 17.113 35.764 1.00 21.79 C ATOM 6147 CD2 LEU A 396 39.148 19.343 36.184 1.00 23.44 C ATOM 6148 HA LEU A 396 41.549 17.288 33.331 1.00 0.00 H ATOM 6149 HB2 LEU A 396 41.464 19.295 34.692 1.00 0.00 H ATOM 6150 HB3 LEU A 396 40.092 19.912 33.742 1.00 0.00 H ATOM 6151 HG LEU A 396 38.714 18.031 34.552 1.00 0.00 H ATOM 6152 HD21 LEU A 396 40.020 19.694 36.735 1.00 0.00 H ATOM 6153 HD22 LEU A 396 38.653 20.189 35.707 1.00 0.00 H ATOM 6154 HD23 LEU A 396 38.456 18.855 36.870 1.00 0.00 H ATOM 6155 HD11 LEU A 396 40.457 16.390 34.990 1.00 0.00 H ATOM 6156 HD12 LEU A 396 41.099 17.397 36.311 1.00 0.00 H ATOM 6157 HD13 LEU A 396 39.480 16.670 36.452 1.00 0.00 H ATOM 6158 H LEU A 396 41.626 19.810 31.686 1.00 0.00 H ATOM 6159 N ASN A 397 39.663 16.327 32.091 1.00 27.19 N ATOM 6160 CA ASN A 397 38.584 15.720 31.334 1.00 28.19 C ATOM 6161 C ASN A 397 37.212 16.101 31.894 1.00 28.50 C ATOM 6162 O ASN A 397 36.972 15.969 33.092 1.00 26.59 O ATOM 6163 CB ASN A 397 38.765 14.192 31.315 1.00 31.38 C ATOM 6164 CG ASN A 397 37.854 13.505 30.321 1.00 32.58 C ATOM 6165 OD1 ASN A 397 37.699 13.961 29.187 1.00 34.05 O ATOM 6166 ND2 ASN A 397 37.244 12.402 30.741 1.00 33.66 N ATOM 6167 HA ASN A 397 38.625 16.100 30.313 1.00 0.00 H ATOM 6168 HB2 ASN A 397 39.799 13.967 31.053 1.00 0.00 H ATOM 6169 HB3 ASN A 397 38.551 13.803 32.311 1.00 0.00 H ATOM 6170 HD22 ASN A 397 37.406 12.054 31.708 1.00 0.00 H ATOM 6171 HD21 ASN A 397 36.605 11.886 30.103 1.00 0.00 H ATOM 6172 H ASN A 397 40.358 15.715 32.565 1.00 0.00 H ATOM 6173 N LYS A 398 36.323 16.584 31.024 1.00 28.79 N ATOM 6174 CA LYS A 398 34.938 16.967 31.396 1.00 28.57 C ATOM 6175 C LYS A 398 34.773 18.366 32.030 1.00 26.52 C ATOM 6176 O LYS A 398 33.649 18.779 32.334 1.00 25.99 O ATOM 6177 CB LYS A 398 34.262 15.904 32.278 1.00 31.32 C ATOM 6178 CG LYS A 398 34.148 14.510 31.639 1.00 34.52 C ATOM 6179 CD LYS A 398 33.646 14.589 30.207 1.00 38.09 C ATOM 6180 CE LYS A 398 33.857 13.266 29.460 1.00 40.82 C ATOM 6181 NZ LYS A 398 33.804 13.462 27.971 1.00 42.55 N ATOM 6182 HA LYS A 398 34.430 17.024 30.433 1.00 0.00 H ATOM 6183 HB2 LYS A 398 34.840 15.809 33.197 1.00 0.00 H ATOM 6184 HB3 LYS A 398 33.257 16.251 32.516 1.00 0.00 H ATOM 6185 HG2 LYS A 398 35.130 14.037 31.644 1.00 0.00 H ATOM 6186 HG3 LYS A 398 33.453 13.908 32.225 1.00 0.00 H ATOM 6187 HD2 LYS A 398 32.582 14.824 30.218 1.00 0.00 H ATOM 6188 HD3 LYS A 398 34.186 15.380 29.686 1.00 0.00 H ATOM 6189 HE2 LYS A 398 33.076 12.564 29.754 1.00 0.00 H ATOM 6190 HE3 LYS A 398 34.831 12.858 29.730 1.00 0.00 H ATOM 6191 HZ1 LYS A 398 32.875 13.847 27.706 1.00 0.00 H ATOM 6192 HZ2 LYS A 398 34.550 14.127 27.683 1.00 0.00 H ATOM 6193 HZ3 LYS A 398 33.950 12.548 27.497 1.00 0.00 H ATOM 6194 H LYS A 398 36.616 16.698 30.033 1.00 0.00 H ATOM 6195 N SER A 399 35.873 19.086 32.224 1.00 24.89 N ATOM 6196 CA SER A 399 35.811 20.467 32.713 1.00 25.91 C ATOM 6197 C SER A 399 35.006 21.334 31.741 1.00 28.11 C ATOM 6198 O SER A 399 34.143 22.117 32.141 1.00 26.76 O ATOM 6199 CB SER A 399 37.215 21.028 32.893 1.00 26.08 C ATOM 6200 OG SER A 399 37.182 22.335 33.438 1.00 26.92 O ATOM 6201 HA SER A 399 35.311 20.475 33.682 1.00 0.00 H ATOM 6202 HB2 SER A 399 37.712 21.060 31.923 1.00 0.00 H ATOM 6203 HB3 SER A 399 37.774 20.377 33.565 1.00 0.00 H ATOM 6204 HG SER A 399 36.736 22.312 34.322 1.00 0.00 H ATOM 6205 H SER A 399 36.800 18.660 32.024 1.00 0.00 H ATOM 6206 N LEU A 400 35.294 21.174 30.453 1.00 29.65 N ATOM 6207 CA LEU A 400 34.550 21.838 29.384 1.00 30.90 C ATOM 6208 C LEU A 400 33.051 21.653 29.558 1.00 30.16 C ATOM 6209 O LEU A 400 32.274 22.619 29.463 1.00 30.32 O ATOM 6210 CB LEU A 400 35.008 21.251 28.042 1.00 34.22 C ATOM 6211 CG LEU A 400 34.436 21.624 26.679 1.00 36.77 C ATOM 6212 CD1 LEU A 400 35.477 21.255 25.620 1.00 37.70 C ATOM 6213 CD2 LEU A 400 33.101 20.931 26.399 1.00 37.09 C ATOM 6214 HA LEU A 400 34.750 22.909 29.416 1.00 0.00 H ATOM 6215 HB2 LEU A 400 36.074 21.469 27.979 1.00 0.00 H ATOM 6216 HB3 LEU A 400 34.864 20.174 28.132 1.00 0.00 H ATOM 6217 HG LEU A 400 34.228 22.694 26.657 1.00 0.00 H ATOM 6218 HD21 LEU A 400 33.242 19.850 26.422 1.00 0.00 H ATOM 6219 HD22 LEU A 400 32.376 21.220 27.160 1.00 0.00 H ATOM 6220 HD23 LEU A 400 32.737 21.230 25.416 1.00 0.00 H ATOM 6221 HD11 LEU A 400 36.397 21.807 25.809 1.00 0.00 H ATOM 6222 HD12 LEU A 400 35.678 20.185 25.667 1.00 0.00 H ATOM 6223 HD13 LEU A 400 35.095 21.511 24.632 1.00 0.00 H ATOM 6224 H LEU A 400 36.084 20.549 30.194 1.00 0.00 H ATOM 6225 N ASP A 401 32.647 20.408 29.815 1.00 28.55 N ATOM 6226 CA ASP A 401 31.237 20.058 29.988 1.00 28.58 C ATOM 6227 C ASP A 401 30.595 20.791 31.159 1.00 27.12 C ATOM 6228 O ASP A 401 29.429 21.184 31.103 1.00 26.11 O ATOM 6229 CB ASP A 401 31.073 18.554 30.235 1.00 30.30 C ATOM 6230 CG ASP A 401 31.601 17.690 29.091 1.00 32.98 C ATOM 6231 OD1 ASP A 401 32.768 17.858 28.655 1.00 32.87 O ATOM 6232 OD2 ASP A 401 30.834 16.813 28.643 1.00 35.17 O ATOM 6233 HA ASP A 401 30.741 20.355 29.064 1.00 0.00 H ATOM 6234 HB2 ASP A 401 31.614 18.292 31.144 1.00 0.00 H ATOM 6235 HB3 ASP A 401 30.013 18.339 30.370 1.00 0.00 H ATOM 6236 H ASP A 401 33.362 19.657 29.896 1.00 0.00 H ATOM 6237 N GLU A 402 31.355 20.942 32.234 1.00 26.98 N ATOM 6238 CA GLU A 402 30.849 21.558 33.460 1.00 27.81 C ATOM 6239 C GLU A 402 30.679 23.072 33.278 1.00 26.33 C ATOM 6240 O GLU A 402 29.693 23.658 33.723 1.00 26.85 O ATOM 6241 CB GLU A 402 31.786 21.215 34.627 1.00 28.61 C ATOM 6242 CG GLU A 402 31.269 21.572 36.010 1.00 31.82 C ATOM 6243 CD GLU A 402 30.050 20.759 36.430 1.00 32.69 C ATOM 6244 OE1 GLU A 402 29.775 19.705 35.821 1.00 33.01 O ATOM 6245 OE2 GLU A 402 29.369 21.182 37.381 1.00 34.70 O ATOM 6246 HA GLU A 402 29.861 21.158 33.690 1.00 0.00 H ATOM 6247 HB2 GLU A 402 31.971 20.141 34.605 1.00 0.00 H ATOM 6248 HB3 GLU A 402 32.724 21.747 34.472 1.00 0.00 H ATOM 6249 HG2 GLU A 402 32.066 21.398 36.733 1.00 0.00 H ATOM 6250 HG3 GLU A 402 30.999 22.628 36.016 1.00 0.00 H ATOM 6251 H GLU A 402 32.341 20.613 32.205 1.00 0.00 H ATOM 6252 N MET A 403 31.639 23.703 32.613 1.00 25.45 N ATOM 6253 CA MET A 403 31.541 25.130 32.308 1.00 23.66 C ATOM 6254 C MET A 403 30.371 25.397 31.376 1.00 24.87 C ATOM 6255 O MET A 403 29.608 26.340 31.583 1.00 21.98 O ATOM 6256 CB MET A 403 32.836 25.639 31.674 1.00 23.90 C ATOM 6257 CG MET A 403 34.010 25.635 32.616 1.00 21.68 C ATOM 6258 SD MET A 403 35.415 26.461 31.883 1.00 26.23 S ATOM 6259 CE MET A 403 36.702 26.121 33.077 1.00 22.78 C ATOM 6260 HA MET A 403 31.377 25.664 33.244 1.00 0.00 H ATOM 6261 HB2 MET A 403 33.076 25.004 30.821 1.00 0.00 H ATOM 6262 HB3 MET A 403 32.673 26.660 31.330 1.00 0.00 H ATOM 6263 HG2 MET A 403 34.281 24.604 32.846 1.00 0.00 H ATOM 6264 HG3 MET A 403 33.732 26.150 33.536 1.00 0.00 H ATOM 6265 HE1 MET A 403 36.417 26.535 34.044 1.00 0.00 H ATOM 6266 HE2 MET A 403 36.837 25.043 33.167 1.00 0.00 H ATOM 6267 HE3 MET A 403 37.634 26.578 32.745 1.00 0.00 H ATOM 6268 H MET A 403 32.478 23.172 32.303 1.00 0.00 H ATOM 6269 N ASP A 404 30.218 24.553 30.357 1.00 24.87 N ATOM 6270 CA ASP A 404 29.132 24.712 29.386 1.00 26.20 C ATOM 6271 C ASP A 404 27.751 24.534 30.009 1.00 27.03 C ATOM 6272 O ASP A 404 26.780 25.149 29.567 1.00 28.19 O ATOM 6273 CB ASP A 404 29.285 23.741 28.213 1.00 25.70 C ATOM 6274 CG ASP A 404 28.136 23.842 27.221 1.00 27.54 C ATOM 6275 OD1 ASP A 404 28.050 24.850 26.475 1.00 28.43 O ATOM 6276 OD2 ASP A 404 27.316 22.905 27.186 1.00 27.27 O ATOM 6277 HA ASP A 404 29.209 25.737 29.023 1.00 0.00 H ATOM 6278 HB2 ASP A 404 30.217 23.964 27.693 1.00 0.00 H ATOM 6279 HB3 ASP A 404 29.322 22.724 28.603 1.00 0.00 H ATOM 6280 H ASP A 404 30.885 23.763 30.248 1.00 0.00 H ATOM 6281 N PHE A 405 27.652 23.679 31.017 1.00 27.98 N ATOM 6282 CA PHE A 405 26.381 23.523 31.710 1.00 29.54 C ATOM 6283 C PHE A 405 26.045 24.750 32.568 1.00 29.66 C ATOM 6284 O PHE A 405 24.978 25.332 32.411 1.00 32.48 O ATOM 6285 CB PHE A 405 26.350 22.252 32.561 1.00 30.45 C ATOM 6286 CG PHE A 405 25.086 22.099 33.361 1.00 32.11 C ATOM 6287 CD1 PHE A 405 23.905 21.698 32.750 1.00 33.44 C ATOM 6288 CD2 PHE A 405 25.076 22.358 34.720 1.00 32.65 C ATOM 6289 CE1 PHE A 405 22.734 21.562 33.482 1.00 34.08 C ATOM 6290 CE2 PHE A 405 23.911 22.223 35.458 1.00 34.31 C ATOM 6291 CZ PHE A 405 22.740 21.822 34.839 1.00 34.90 C ATOM 6292 HA PHE A 405 25.616 23.431 30.939 1.00 0.00 H ATOM 6293 HB2 PHE A 405 26.447 21.391 31.900 1.00 0.00 H ATOM 6294 HB3 PHE A 405 27.194 22.277 33.250 1.00 0.00 H ATOM 6295 HD2 PHE A 405 25.995 22.672 35.216 1.00 0.00 H ATOM 6296 HE2 PHE A 405 23.917 22.433 36.528 1.00 0.00 H ATOM 6297 HZ PHE A 405 21.825 21.712 35.421 1.00 0.00 H ATOM 6298 HE1 PHE A 405 21.813 21.251 32.988 1.00 0.00 H ATOM 6299 HD1 PHE A 405 23.898 21.487 31.681 1.00 0.00 H ATOM 6300 H PHE A 405 28.479 23.122 31.312 1.00 0.00 H ATOM 6301 N TRP A 406 26.945 25.151 33.464 1.00 29.24 N ATOM 6302 CA TRP A 406 26.624 26.259 34.391 1.00 30.30 C ATOM 6303 C TRP A 406 26.542 27.634 33.734 1.00 29.21 C ATOM 6304 O TRP A 406 25.658 28.421 34.062 1.00 29.83 O ATOM 6305 CB TRP A 406 27.578 26.300 35.588 1.00 30.83 C ATOM 6306 CG TRP A 406 27.419 25.119 36.490 1.00 31.94 C ATOM 6307 CD1 TRP A 406 28.290 24.086 36.646 1.00 31.52 C ATOM 6308 CD2 TRP A 406 26.307 24.846 37.356 1.00 31.81 C ATOM 6309 NE1 TRP A 406 27.795 23.184 37.561 1.00 31.04 N ATOM 6310 CE2 TRP A 406 26.578 23.627 38.009 1.00 31.90 C ATOM 6311 CE3 TRP A 406 25.109 25.515 37.639 1.00 32.92 C ATOM 6312 CZ2 TRP A 406 25.697 23.059 38.936 1.00 31.70 C ATOM 6313 CZ3 TRP A 406 24.231 24.950 38.559 1.00 33.01 C ATOM 6314 CH2 TRP A 406 24.532 23.730 39.196 1.00 32.44 C ATOM 6315 HA TRP A 406 25.618 26.030 34.743 1.00 0.00 H ATOM 6316 HB2 TRP A 406 28.603 26.321 35.217 1.00 0.00 H ATOM 6317 HB3 TRP A 406 27.381 27.206 36.161 1.00 0.00 H ATOM 6318 HE1 TRP A 406 28.268 22.308 37.863 1.00 0.00 H ATOM 6319 HD1 TRP A 406 29.241 23.987 36.123 1.00 0.00 H ATOM 6320 HZ2 TRP A 406 25.930 22.117 39.433 1.00 0.00 H ATOM 6321 HH2 TRP A 406 23.823 23.312 39.910 1.00 0.00 H ATOM 6322 HZ3 TRP A 406 23.296 25.459 38.790 1.00 0.00 H ATOM 6323 HE3 TRP A 406 24.870 26.459 37.149 1.00 0.00 H ATOM 6324 H TRP A 406 27.874 24.685 33.512 1.00 0.00 H ATOM 6325 N ALA A 407 27.453 27.924 32.812 1.00 27.06 N ATOM 6326 CA ALA A 407 27.453 29.225 32.153 1.00 27.92 C ATOM 6327 C ALA A 407 26.658 29.224 30.858 1.00 27.39 C ATOM 6328 O ALA A 407 25.752 30.032 30.679 1.00 27.35 O ATOM 6329 CB ALA A 407 28.871 29.685 31.897 1.00 27.20 C ATOM 6330 HA ALA A 407 26.961 29.924 32.829 1.00 0.00 H ATOM 6331 HB1 ALA A 407 29.402 29.766 32.845 1.00 0.00 H ATOM 6332 HB2 ALA A 407 29.376 28.962 31.257 1.00 0.00 H ATOM 6333 HB3 ALA A 407 28.853 30.657 31.405 1.00 0.00 H ATOM 6334 H ALA A 407 28.172 27.217 32.558 1.00 0.00 H ATOM 6335 N GLY A 408 26.996 28.309 29.959 1.00 28.67 N ATOM 6336 CA GLY A 408 26.393 28.291 28.631 1.00 30.51 C ATOM 6337 C GLY A 408 25.016 27.680 28.516 1.00 30.47 C ATOM 6338 O GLY A 408 24.369 27.808 27.481 1.00 30.67 O ATOM 6339 HA3 GLY A 408 27.058 27.731 27.974 1.00 0.00 H ATOM 6340 HA2 GLY A 408 26.326 29.322 28.285 1.00 0.00 H ATOM 6341 H GLY A 408 27.705 27.590 30.206 1.00 0.00 H ATOM 6342 N THR A 409 24.553 27.006 29.565 1.00 31.97 N ATOM 6343 CA THR A 409 23.235 26.367 29.499 1.00 32.36 C ATOM 6344 C THR A 409 22.261 26.933 30.536 1.00 32.93 C ATOM 6345 O THR A 409 21.294 27.596 30.180 1.00 33.45 O ATOM 6346 CB THR A 409 23.353 24.830 29.624 1.00 33.75 C ATOM 6347 OG1 THR A 409 24.285 24.348 28.651 1.00 34.26 O ATOM 6348 CG2 THR A 409 22.016 24.161 29.394 1.00 32.70 C ATOM 6349 HA THR A 409 22.821 26.597 28.517 1.00 0.00 H ATOM 6350 HB THR A 409 23.694 24.593 30.632 1.00 0.00 H ATOM 6351 HG1 THR A 409 25.170 24.763 28.809 1.00 0.00 H ATOM 6352 HG23 THR A 409 21.299 24.522 30.131 1.00 0.00 H ATOM 6353 HG21 THR A 409 21.660 24.399 28.392 1.00 0.00 H ATOM 6354 HG22 THR A 409 22.129 23.082 29.494 1.00 0.00 H ATOM 6355 H THR A 409 25.125 26.932 30.431 1.00 0.00 H ATOM 6356 N ILE A 410 22.517 26.669 31.814 1.00 31.84 N ATOM 6357 CA ILE A 410 21.675 27.183 32.887 1.00 32.16 C ATOM 6358 C ILE A 410 21.787 28.693 32.988 1.00 30.74 C ATOM 6359 O ILE A 410 20.779 29.406 33.001 1.00 30.76 O ATOM 6360 CB ILE A 410 22.071 26.569 34.254 1.00 33.65 C ATOM 6361 CG1 ILE A 410 21.800 25.074 34.258 1.00 34.88 C ATOM 6362 CG2 ILE A 410 21.319 27.235 35.393 1.00 36.29 C ATOM 6363 CD1 ILE A 410 20.335 24.724 33.973 1.00 37.82 C ATOM 6364 HA ILE A 410 20.649 26.904 32.647 1.00 0.00 H ATOM 6365 HB ILE A 410 23.137 26.740 34.402 1.00 0.00 H ATOM 6366 HG12 ILE A 410 22.423 24.607 33.495 1.00 0.00 H ATOM 6367 HG13 ILE A 410 22.067 24.676 35.237 1.00 0.00 H ATOM 6368 HD11 ILE A 410 19.700 25.176 34.735 1.00 0.00 H ATOM 6369 HD12 ILE A 410 20.056 25.107 32.991 1.00 0.00 H ATOM 6370 HD13 ILE A 410 20.211 23.641 33.991 1.00 0.00 H ATOM 6371 HG21 ILE A 410 21.553 28.299 35.408 1.00 0.00 H ATOM 6372 HG22 ILE A 410 20.247 27.100 35.247 1.00 0.00 H ATOM 6373 HG23 ILE A 410 21.619 26.782 36.338 1.00 0.00 H ATOM 6374 H ILE A 410 23.340 26.080 32.054 1.00 0.00 H ATOM 6375 N GLY A 411 23.030 29.162 33.064 1.00 30.36 N ATOM 6376 CA GLY A 411 23.348 30.569 33.200 1.00 26.33 C ATOM 6377 C GLY A 411 22.629 31.486 32.243 1.00 27.53 C ATOM 6378 O GLY A 411 22.066 32.493 32.673 1.00 27.79 O ATOM 6379 HA3 GLY A 411 24.420 30.689 33.042 1.00 0.00 H ATOM 6380 HA2 GLY A 411 23.095 30.875 34.215 1.00 0.00 H ATOM 6381 H GLY A 411 23.816 28.482 33.024 1.00 0.00 H ATOM 6382 N VAL A 412 22.631 31.159 30.949 1.00 27.52 N ATOM 6383 CA VAL A 412 22.028 32.066 29.963 1.00 26.64 C ATOM 6384 C VAL A 412 20.511 32.226 30.118 1.00 27.12 C ATOM 6385 O VAL A 412 19.984 33.323 29.923 1.00 26.50 O ATOM 6386 CB VAL A 412 22.396 31.714 28.484 1.00 26.59 C ATOM 6387 CG1 VAL A 412 23.898 31.813 28.284 1.00 26.35 C ATOM 6388 CG2 VAL A 412 21.876 30.334 28.075 1.00 23.92 C ATOM 6389 HA VAL A 412 22.478 33.032 30.190 1.00 0.00 H ATOM 6390 HB VAL A 412 21.905 32.439 27.836 1.00 0.00 H ATOM 6391 HG11 VAL A 412 24.226 32.829 28.503 1.00 0.00 H ATOM 6392 HG12 VAL A 412 24.399 31.115 28.954 1.00 0.00 H ATOM 6393 HG13 VAL A 412 24.143 31.566 27.251 1.00 0.00 H ATOM 6394 HG21 VAL A 412 22.313 29.575 28.724 1.00 0.00 H ATOM 6395 HG22 VAL A 412 20.790 30.314 28.170 1.00 0.00 H ATOM 6396 HG23 VAL A 412 22.156 30.134 27.041 1.00 0.00 H ATOM 6397 H VAL A 412 23.059 30.263 30.639 1.00 0.00 H ATOM 6398 N VAL A 413 19.821 31.143 30.472 1.00 27.30 N ATOM 6399 CA VAL A 413 18.362 31.172 30.629 1.00 28.75 C ATOM 6400 C VAL A 413 17.991 31.996 31.859 1.00 31.06 C ATOM 6401 O VAL A 413 17.082 32.837 31.809 1.00 30.65 O ATOM 6402 CB VAL A 413 17.754 29.755 30.750 1.00 29.55 C ATOM 6403 CG1 VAL A 413 16.236 29.841 30.851 1.00 31.19 C ATOM 6404 CG2 VAL A 413 18.158 28.877 29.563 1.00 29.47 C ATOM 6405 HA VAL A 413 17.948 31.630 29.731 1.00 0.00 H ATOM 6406 HB VAL A 413 18.145 29.295 31.658 1.00 0.00 H ATOM 6407 HG11 VAL A 413 15.964 30.423 31.732 1.00 0.00 H ATOM 6408 HG12 VAL A 413 15.841 30.325 29.958 1.00 0.00 H ATOM 6409 HG13 VAL A 413 15.821 28.837 30.936 1.00 0.00 H ATOM 6410 HG21 VAL A 413 17.802 29.332 28.639 1.00 0.00 H ATOM 6411 HG22 VAL A 413 19.244 28.789 29.531 1.00 0.00 H ATOM 6412 HG23 VAL A 413 17.715 27.888 29.677 1.00 0.00 H ATOM 6413 H VAL A 413 20.330 30.252 30.642 1.00 0.00 H ATOM 6414 N PHE A 414 18.706 31.745 32.953 1.00 31.01 N ATOM 6415 CA PHE A 414 18.582 32.524 34.185 1.00 33.17 C ATOM 6416 C PHE A 414 18.827 34.004 33.915 1.00 31.95 C ATOM 6417 O PHE A 414 18.059 34.851 34.367 1.00 30.99 O ATOM 6418 CB PHE A 414 19.564 32.002 35.242 1.00 36.39 C ATOM 6419 CG PHE A 414 19.787 32.943 36.411 1.00 39.63 C ATOM 6420 CD1 PHE A 414 18.795 33.142 37.367 1.00 40.77 C ATOM 6421 CD2 PHE A 414 21.005 33.610 36.564 1.00 40.98 C ATOM 6422 CE1 PHE A 414 19.007 34.008 38.454 1.00 42.92 C ATOM 6423 CE2 PHE A 414 21.227 34.474 37.643 1.00 41.96 C ATOM 6424 CZ PHE A 414 20.228 34.674 38.589 1.00 42.03 C ATOM 6425 HA PHE A 414 17.566 32.411 34.564 1.00 0.00 H ATOM 6426 HB2 PHE A 414 19.177 31.060 35.631 1.00 0.00 H ATOM 6427 HB3 PHE A 414 20.525 31.826 34.758 1.00 0.00 H ATOM 6428 HD2 PHE A 414 21.796 33.455 35.831 1.00 0.00 H ATOM 6429 HE2 PHE A 414 22.182 34.989 37.741 1.00 0.00 H ATOM 6430 HZ PHE A 414 20.396 35.346 39.431 1.00 0.00 H ATOM 6431 HE1 PHE A 414 18.219 34.160 39.192 1.00 0.00 H ATOM 6432 HD1 PHE A 414 17.843 32.620 37.272 1.00 0.00 H ATOM 6433 H PHE A 414 19.385 30.958 32.931 1.00 0.00 H ATOM 6434 N PHE A 415 19.892 34.312 33.176 1.00 30.23 N ATOM 6435 CA PHE A 415 20.224 35.705 32.885 1.00 30.61 C ATOM 6436 C PHE A 415 19.206 36.331 31.937 1.00 30.18 C ATOM 6437 O PHE A 415 18.855 37.500 32.086 1.00 30.37 O ATOM 6438 CB PHE A 415 21.641 35.829 32.323 1.00 28.68 C ATOM 6439 CG PHE A 415 22.258 37.184 32.528 1.00 29.12 C ATOM 6440 CD1 PHE A 415 22.400 37.704 33.809 1.00 28.57 C ATOM 6441 CD2 PHE A 415 22.703 37.937 31.444 1.00 28.88 C ATOM 6442 CE1 PHE A 415 22.973 38.945 34.012 1.00 28.60 C ATOM 6443 CE2 PHE A 415 23.283 39.181 31.637 1.00 29.74 C ATOM 6444 CZ PHE A 415 23.416 39.691 32.925 1.00 28.01 C ATOM 6445 HA PHE A 415 20.186 36.255 33.825 1.00 0.00 H ATOM 6446 HB2 PHE A 415 22.271 35.086 32.812 1.00 0.00 H ATOM 6447 HB3 PHE A 415 21.606 35.625 31.253 1.00 0.00 H ATOM 6448 HD2 PHE A 415 22.594 37.544 30.433 1.00 0.00 H ATOM 6449 HE2 PHE A 415 23.634 39.759 30.782 1.00 0.00 H ATOM 6450 HZ PHE A 415 23.866 40.672 33.081 1.00 0.00 H ATOM 6451 HE1 PHE A 415 23.078 39.339 35.023 1.00 0.00 H ATOM 6452 HD1 PHE A 415 22.055 37.125 34.665 1.00 0.00 H ATOM 6453 H PHE A 415 20.495 33.552 32.802 1.00 0.00 H ATOM 6454 N GLY A 416 18.731 35.553 30.968 1.00 29.93 N ATOM 6455 CA GLY A 416 17.668 36.016 30.072 1.00 30.12 C ATOM 6456 C GLY A 416 16.460 36.485 30.874 1.00 30.41 C ATOM 6457 O GLY A 416 15.949 37.577 30.660 1.00 29.66 O ATOM 6458 HA3 GLY A 416 17.368 35.198 29.417 1.00 0.00 H ATOM 6459 HA2 GLY A 416 18.042 36.844 29.469 1.00 0.00 H ATOM 6460 H GLY A 416 19.122 34.597 30.844 1.00 0.00 H ATOM 6461 N LEU A 417 16.013 35.651 31.808 1.00 30.76 N ATOM 6462 CA LEU A 417 14.879 35.975 32.660 1.00 31.77 C ATOM 6463 C LEU A 417 15.180 37.181 33.542 1.00 32.24 C ATOM 6464 O LEU A 417 14.336 38.067 33.706 1.00 33.69 O ATOM 6465 CB LEU A 417 14.507 34.775 33.531 1.00 32.32 C ATOM 6466 CG LEU A 417 13.317 35.009 34.465 1.00 34.05 C ATOM 6467 CD1 LEU A 417 12.086 35.406 33.653 1.00 34.35 C ATOM 6468 CD2 LEU A 417 13.045 33.772 35.308 1.00 33.74 C ATOM 6469 HA LEU A 417 14.037 36.223 32.014 1.00 0.00 H ATOM 6470 HB2 LEU A 417 14.265 33.940 32.874 1.00 0.00 H ATOM 6471 HB3 LEU A 417 15.372 34.516 34.141 1.00 0.00 H ATOM 6472 HG LEU A 417 13.557 35.826 35.145 1.00 0.00 H ATOM 6473 HD21 LEU A 417 12.820 32.930 34.653 1.00 0.00 H ATOM 6474 HD22 LEU A 417 13.925 33.542 35.908 1.00 0.00 H ATOM 6475 HD23 LEU A 417 12.195 33.961 35.964 1.00 0.00 H ATOM 6476 HD11 LEU A 417 12.296 36.323 33.102 1.00 0.00 H ATOM 6477 HD12 LEU A 417 11.841 34.608 32.953 1.00 0.00 H ATOM 6478 HD13 LEU A 417 11.245 35.570 34.327 1.00 0.00 H ATOM 6479 H LEU A 417 16.490 34.736 31.934 1.00 0.00 H ATOM 6480 N THR A 418 16.385 37.208 34.104 1.00 31.55 N ATOM 6481 CA THR A 418 16.819 38.302 34.960 1.00 31.50 C ATOM 6482 C THR A 418 16.798 39.631 34.219 1.00 33.03 C ATOM 6483 O THR A 418 16.230 40.610 34.703 1.00 33.66 O ATOM 6484 CB THR A 418 18.244 38.068 35.495 1.00 30.54 C ATOM 6485 OG1 THR A 418 18.259 36.895 36.313 1.00 31.18 O ATOM 6486 CG2 THR A 418 18.706 39.252 36.323 1.00 31.25 C ATOM 6487 HA THR A 418 16.117 38.337 35.793 1.00 0.00 H ATOM 6488 HB THR A 418 18.916 37.944 34.646 1.00 0.00 H ATOM 6489 HG1 THR A 418 17.976 36.114 35.774 1.00 0.00 H ATOM 6490 HG23 THR A 418 18.697 40.151 35.706 1.00 0.00 H ATOM 6491 HG21 THR A 418 18.034 39.385 37.171 1.00 0.00 H ATOM 6492 HG22 THR A 418 19.718 39.068 36.685 1.00 0.00 H ATOM 6493 H THR A 418 17.040 36.420 33.926 1.00 0.00 H ATOM 6494 N GLU A 419 17.423 39.666 33.044 1.00 31.82 N ATOM 6495 CA GLU A 419 17.556 40.915 32.315 1.00 30.21 C ATOM 6496 C GLU A 419 16.188 41.424 31.870 1.00 31.48 C ATOM 6497 O GLU A 419 15.953 42.626 31.838 1.00 31.97 O ATOM 6498 CB GLU A 419 18.534 40.774 31.140 1.00 28.13 C ATOM 6499 CG GLU A 419 17.996 39.981 29.964 1.00 27.51 C ATOM 6500 CD GLU A 419 19.069 39.598 28.969 1.00 27.91 C ATOM 6501 OE1 GLU A 419 20.218 40.086 29.085 1.00 27.88 O ATOM 6502 OE2 GLU A 419 18.756 38.798 28.067 1.00 28.57 O ATOM 6503 HA GLU A 419 17.980 41.662 32.986 1.00 0.00 H ATOM 6504 HB2 GLU A 419 18.790 41.773 30.788 1.00 0.00 H ATOM 6505 HB3 GLU A 419 19.433 40.277 31.503 1.00 0.00 H ATOM 6506 HG2 GLU A 419 17.532 39.070 30.342 1.00 0.00 H ATOM 6507 HG3 GLU A 419 17.246 40.584 29.452 1.00 0.00 H ATOM 6508 H GLU A 419 17.819 38.791 32.645 1.00 0.00 H ATOM 6509 N LEU A 420 15.281 40.509 31.551 1.00 33.44 N ATOM 6510 CA LEU A 420 13.943 40.907 31.144 1.00 36.10 C ATOM 6511 C LEU A 420 13.166 41.522 32.310 1.00 37.31 C ATOM 6512 O LEU A 420 12.558 42.591 32.164 1.00 36.76 O ATOM 6513 CB LEU A 420 13.178 39.727 30.541 1.00 37.48 C ATOM 6514 CG LEU A 420 11.780 40.055 30.017 1.00 38.06 C ATOM 6515 CD1 LEU A 420 11.408 39.139 28.868 1.00 37.00 C ATOM 6516 CD2 LEU A 420 10.741 39.993 31.138 1.00 38.54 C ATOM 6517 HA LEU A 420 14.047 41.671 30.374 1.00 0.00 H ATOM 6518 HB2 LEU A 420 13.765 39.333 29.711 1.00 0.00 H ATOM 6519 HB3 LEU A 420 13.079 38.961 31.310 1.00 0.00 H ATOM 6520 HG LEU A 420 11.792 41.077 29.639 1.00 0.00 H ATOM 6521 HD21 LEU A 420 10.727 38.990 31.564 1.00 0.00 H ATOM 6522 HD22 LEU A 420 11.001 40.714 31.913 1.00 0.00 H ATOM 6523 HD23 LEU A 420 9.757 40.231 30.733 1.00 0.00 H ATOM 6524 HD11 LEU A 420 12.126 39.264 28.058 1.00 0.00 H ATOM 6525 HD12 LEU A 420 11.422 38.104 29.211 1.00 0.00 H ATOM 6526 HD13 LEU A 420 10.409 39.392 28.512 1.00 0.00 H ATOM 6527 H LEU A 420 15.529 39.500 31.592 1.00 0.00 H ATOM 6528 N ILE A 421 13.183 40.846 33.458 1.00 36.30 N ATOM 6529 CA ILE A 421 12.510 41.357 34.654 1.00 35.98 C ATOM 6530 C ILE A 421 13.020 42.754 34.988 1.00 35.79 C ATOM 6531 O ILE A 421 12.236 43.671 35.215 1.00 36.87 O ATOM 6532 CB ILE A 421 12.663 40.394 35.852 1.00 36.03 C ATOM 6533 CG1 ILE A 421 11.764 39.172 35.646 1.00 34.77 C ATOM 6534 CG2 ILE A 421 12.326 41.096 37.168 1.00 36.09 C ATOM 6535 CD1 ILE A 421 12.072 38.006 36.557 1.00 35.45 C ATOM 6536 HA ILE A 421 11.443 41.424 34.441 1.00 0.00 H ATOM 6537 HB ILE A 421 13.702 40.068 35.909 1.00 0.00 H ATOM 6538 HG12 ILE A 421 10.731 39.476 35.819 1.00 0.00 H ATOM 6539 HG13 ILE A 421 11.875 38.837 34.615 1.00 0.00 H ATOM 6540 HD11 ILE A 421 13.098 37.677 36.390 1.00 0.00 H ATOM 6541 HD12 ILE A 421 11.953 38.316 37.595 1.00 0.00 H ATOM 6542 HD13 ILE A 421 11.387 37.187 36.341 1.00 0.00 H ATOM 6543 HG21 ILE A 421 13.000 41.941 37.310 1.00 0.00 H ATOM 6544 HG22 ILE A 421 11.296 41.452 37.135 1.00 0.00 H ATOM 6545 HG23 ILE A 421 12.443 40.394 37.993 1.00 0.00 H ATOM 6546 H ILE A 421 13.685 39.936 33.506 1.00 0.00 H ATOM 6547 N ILE A 422 14.334 42.920 34.990 1.00 34.77 N ATOM 6548 CA ILE A 422 14.932 44.214 35.289 1.00 35.46 C ATOM 6549 C ILE A 422 14.496 45.308 34.301 1.00 37.50 C ATOM 6550 O ILE A 422 14.145 46.415 34.714 1.00 38.42 O ATOM 6551 CB ILE A 422 16.480 44.116 35.351 1.00 34.24 C ATOM 6552 CG1 ILE A 422 16.907 43.295 36.571 1.00 33.16 C ATOM 6553 CG2 ILE A 422 17.116 45.492 35.386 1.00 33.88 C ATOM 6554 CD1 ILE A 422 18.398 43.311 36.842 1.00 31.85 C ATOM 6555 HA ILE A 422 14.563 44.506 36.272 1.00 0.00 H ATOM 6556 HB ILE A 422 16.826 43.613 34.448 1.00 0.00 H ATOM 6557 HG12 ILE A 422 16.396 43.694 37.447 1.00 0.00 H ATOM 6558 HG13 ILE A 422 16.600 42.261 36.412 1.00 0.00 H ATOM 6559 HD11 ILE A 422 18.927 42.903 35.981 1.00 0.00 H ATOM 6560 HD12 ILE A 422 18.723 44.337 37.017 1.00 0.00 H ATOM 6561 HD13 ILE A 422 18.612 42.705 37.722 1.00 0.00 H ATOM 6562 HG21 ILE A 422 16.838 46.042 34.487 1.00 0.00 H ATOM 6563 HG22 ILE A 422 16.766 46.031 36.267 1.00 0.00 H ATOM 6564 HG23 ILE A 422 18.200 45.389 35.429 1.00 0.00 H ATOM 6565 H ILE A 422 14.951 42.111 34.774 1.00 0.00 H ATOM 6566 N PHE A 423 14.510 44.993 33.008 1.00 36.61 N ATOM 6567 CA PHE A 423 14.194 45.970 31.965 1.00 36.93 C ATOM 6568 C PHE A 423 12.693 46.240 31.812 1.00 38.94 C ATOM 6569 O PHE A 423 12.258 47.395 31.820 1.00 39.15 O ATOM 6570 CB PHE A 423 14.787 45.511 30.632 1.00 34.77 C ATOM 6571 CG PHE A 423 14.777 46.560 29.551 1.00 34.83 C ATOM 6572 CD1 PHE A 423 15.353 47.807 29.761 1.00 35.18 C ATOM 6573 CD2 PHE A 423 14.214 46.288 28.311 1.00 34.50 C ATOM 6574 CE1 PHE A 423 15.353 48.768 28.763 1.00 35.35 C ATOM 6575 CE2 PHE A 423 14.213 47.243 27.300 1.00 34.68 C ATOM 6576 CZ PHE A 423 14.782 48.483 27.523 1.00 35.61 C ATOM 6577 HA PHE A 423 14.642 46.914 32.274 1.00 0.00 H ATOM 6578 HB2 PHE A 423 15.820 45.209 30.804 1.00 0.00 H ATOM 6579 HB3 PHE A 423 14.213 44.654 30.281 1.00 0.00 H ATOM 6580 HD2 PHE A 423 13.766 45.311 28.127 1.00 0.00 H ATOM 6581 HE2 PHE A 423 13.764 47.014 26.333 1.00 0.00 H ATOM 6582 HZ PHE A 423 14.784 49.234 26.733 1.00 0.00 H ATOM 6583 HE1 PHE A 423 15.799 49.746 28.947 1.00 0.00 H ATOM 6584 HD1 PHE A 423 15.811 48.032 30.724 1.00 0.00 H ATOM 6585 H PHE A 423 14.753 44.021 32.730 1.00 0.00 H ATOM 6586 N PHE A 424 11.912 45.172 31.673 1.00 39.75 N ATOM 6587 CA PHE A 424 10.472 45.287 31.447 1.00 41.58 C ATOM 6588 C PHE A 424 9.579 45.358 32.682 1.00 43.00 C ATOM 6589 O PHE A 424 8.405 45.715 32.562 1.00 44.77 O ATOM 6590 CB PHE A 424 9.973 44.178 30.513 1.00 40.59 C ATOM 6591 CG PHE A 424 9.472 44.694 29.203 1.00 39.81 C ATOM 6592 CD1 PHE A 424 10.356 45.014 28.182 1.00 39.24 C ATOM 6593 CD2 PHE A 424 8.111 44.875 28.996 1.00 39.80 C ATOM 6594 CE1 PHE A 424 9.891 45.502 26.975 1.00 39.05 C ATOM 6595 CE2 PHE A 424 7.636 45.363 27.790 1.00 39.69 C ATOM 6596 CZ PHE A 424 8.528 45.678 26.778 1.00 39.92 C ATOM 6597 HA PHE A 424 10.376 46.270 30.985 1.00 0.00 H ATOM 6598 HB2 PHE A 424 10.796 43.489 30.323 1.00 0.00 H ATOM 6599 HB3 PHE A 424 9.162 43.645 31.009 1.00 0.00 H ATOM 6600 HD2 PHE A 424 7.408 44.630 29.792 1.00 0.00 H ATOM 6601 HE2 PHE A 424 6.565 45.499 27.638 1.00 0.00 H ATOM 6602 HZ PHE A 424 8.160 46.064 25.827 1.00 0.00 H ATOM 6603 HE1 PHE A 424 10.594 45.748 26.179 1.00 0.00 H ATOM 6604 HD1 PHE A 424 11.427 44.879 28.333 1.00 0.00 H ATOM 6605 H PHE A 424 12.339 44.225 31.727 1.00 0.00 H ATOM 6606 N TRP A 425 10.110 45.022 33.855 1.00 44.05 N ATOM 6607 CA TRP A 425 9.307 45.073 35.081 1.00 44.02 C ATOM 6608 C TRP A 425 9.792 46.155 36.044 1.00 45.43 C ATOM 6609 O TRP A 425 9.019 47.036 36.421 1.00 46.90 O ATOM 6610 CB TRP A 425 9.287 43.713 35.781 1.00 44.04 C ATOM 6611 CG TRP A 425 8.501 42.628 35.069 1.00 44.63 C ATOM 6612 CD1 TRP A 425 7.945 42.687 33.822 1.00 44.07 C ATOM 6613 CD2 TRP A 425 8.230 41.308 35.563 1.00 44.74 C ATOM 6614 NE1 TRP A 425 7.328 41.498 33.518 1.00 43.61 N ATOM 6615 CE2 TRP A 425 7.491 40.632 34.567 1.00 44.69 C ATOM 6616 CE3 TRP A 425 8.535 40.634 36.752 1.00 44.92 C ATOM 6617 CZ2 TRP A 425 7.049 39.316 34.727 1.00 44.47 C ATOM 6618 CZ3 TRP A 425 8.094 39.322 36.909 1.00 44.45 C ATOM 6619 CH2 TRP A 425 7.361 38.681 35.901 1.00 44.67 C ATOM 6620 HA TRP A 425 8.291 45.330 34.781 1.00 0.00 H ATOM 6621 HB2 TRP A 425 10.317 43.371 35.883 1.00 0.00 H ATOM 6622 HB3 TRP A 425 8.852 43.850 36.771 1.00 0.00 H ATOM 6623 HE1 TRP A 425 6.820 41.289 32.635 1.00 0.00 H ATOM 6624 HD1 TRP A 425 7.985 43.554 33.163 1.00 0.00 H ATOM 6625 HZ2 TRP A 425 6.477 38.813 33.947 1.00 0.00 H ATOM 6626 HH2 TRP A 425 7.031 37.653 36.054 1.00 0.00 H ATOM 6627 HZ3 TRP A 425 8.323 38.786 37.830 1.00 0.00 H ATOM 6628 HE3 TRP A 425 9.106 41.126 37.539 1.00 0.00 H ATOM 6629 H TRP A 425 11.104 44.720 33.903 1.00 0.00 H ATOM 6630 N ILE A 426 11.064 46.092 36.438 1.00 45.85 N ATOM 6631 CA ILE A 426 11.625 47.054 37.395 1.00 45.43 C ATOM 6632 C ILE A 426 11.767 48.444 36.779 1.00 45.20 C ATOM 6633 O ILE A 426 11.233 49.426 37.296 1.00 46.34 O ATOM 6634 CB ILE A 426 13.019 46.630 37.926 1.00 44.91 C ATOM 6635 CG1 ILE A 426 13.016 45.190 38.465 1.00 45.53 C ATOM 6636 CG2 ILE A 426 13.508 47.628 38.968 1.00 44.64 C ATOM 6637 CD1 ILE A 426 11.968 44.892 39.513 1.00 46.46 C ATOM 6638 HA ILE A 426 10.917 47.075 38.223 1.00 0.00 H ATOM 6639 HB ILE A 426 13.719 46.640 37.091 1.00 0.00 H ATOM 6640 HG12 ILE A 426 12.852 44.516 37.624 1.00 0.00 H ATOM 6641 HG13 ILE A 426 13.995 44.992 38.902 1.00 0.00 H ATOM 6642 HD11 ILE A 426 12.121 45.544 40.373 1.00 0.00 H ATOM 6643 HD12 ILE A 426 10.977 45.067 39.094 1.00 0.00 H ATOM 6644 HD13 ILE A 426 12.053 43.851 39.825 1.00 0.00 H ATOM 6645 HG21 ILE A 426 13.583 48.617 38.515 1.00 0.00 H ATOM 6646 HG22 ILE A 426 12.803 47.659 39.798 1.00 0.00 H ATOM 6647 HG23 ILE A 426 14.488 47.319 39.333 1.00 0.00 H ATOM 6648 H ILE A 426 11.675 45.342 36.057 1.00 0.00 H ATOM 6649 N PHE A 427 12.501 48.512 35.675 1.00 43.74 N ATOM 6650 CA PHE A 427 12.731 49.758 34.959 1.00 42.26 C ATOM 6651 C PHE A 427 11.408 50.339 34.440 1.00 42.68 C ATOM 6652 O PHE A 427 11.206 51.552 34.463 1.00 42.47 O ATOM 6653 CB PHE A 427 13.729 49.511 33.828 1.00 40.30 C ATOM 6654 CG PHE A 427 14.000 50.708 32.971 1.00 39.76 C ATOM 6655 CD1 PHE A 427 14.647 51.817 33.489 1.00 38.87 C ATOM 6656 CD2 PHE A 427 13.627 50.714 31.640 1.00 38.54 C ATOM 6657 CE1 PHE A 427 14.903 52.904 32.702 1.00 38.49 C ATOM 6658 CE2 PHE A 427 13.886 51.801 30.844 1.00 37.77 C ATOM 6659 CZ PHE A 427 14.523 52.899 31.372 1.00 38.25 C ATOM 6660 HA PHE A 427 13.156 50.498 35.637 1.00 0.00 H ATOM 6661 HB2 PHE A 427 14.671 49.187 34.269 1.00 0.00 H ATOM 6662 HB3 PHE A 427 13.335 48.718 33.192 1.00 0.00 H ATOM 6663 HD2 PHE A 427 13.121 49.845 31.218 1.00 0.00 H ATOM 6664 HE2 PHE A 427 13.588 51.794 29.796 1.00 0.00 H ATOM 6665 HZ PHE A 427 14.728 53.765 30.743 1.00 0.00 H ATOM 6666 HE1 PHE A 427 15.406 53.775 33.122 1.00 0.00 H ATOM 6667 HD1 PHE A 427 14.955 51.823 34.535 1.00 0.00 H ATOM 6668 H PHE A 427 12.929 47.639 35.307 1.00 0.00 H ATOM 6669 N GLY A 428 10.509 49.466 33.990 1.00 41.55 N ATOM 6670 CA GLY A 428 9.182 49.888 33.562 1.00 40.97 C ATOM 6671 C GLY A 428 8.866 49.423 32.160 1.00 40.00 C ATOM 6672 O GLY A 428 9.628 49.689 31.241 1.00 40.56 O ATOM 6673 HA3 GLY A 428 9.132 50.976 33.592 1.00 0.00 H ATOM 6674 HA2 GLY A 428 8.442 49.472 34.246 1.00 0.00 H ATOM 6675 H GLY A 428 10.760 48.458 33.943 1.00 0.00 H ATOM 6676 N ALA A 429 7.738 48.736 31.997 1.00 41.34 N ATOM 6677 CA ALA A 429 7.350 48.176 30.702 1.00 42.37 C ATOM 6678 C ALA A 429 7.160 49.231 29.614 1.00 43.62 C ATOM 6679 O ALA A 429 7.667 49.080 28.500 1.00 43.83 O ATOM 6680 CB ALA A 429 6.100 47.326 30.844 1.00 41.82 C ATOM 6681 HA ALA A 429 8.182 47.550 30.378 1.00 0.00 H ATOM 6682 HB1 ALA A 429 6.294 46.510 31.540 1.00 0.00 H ATOM 6683 HB2 ALA A 429 5.284 47.942 31.223 1.00 0.00 H ATOM 6684 HB3 ALA A 429 5.827 46.918 29.871 1.00 0.00 H ATOM 6685 H ALA A 429 7.113 48.593 32.816 1.00 0.00 H ATOM 6686 N ASP A 430 6.436 50.299 29.934 1.00 45.28 N ATOM 6687 CA ASP A 430 6.190 51.366 28.958 1.00 46.44 C ATOM 6688 C ASP A 430 7.467 52.140 28.639 1.00 44.84 C ATOM 6689 O ASP A 430 7.683 52.547 27.498 1.00 45.61 O ATOM 6690 CB ASP A 430 5.066 52.297 29.436 1.00 48.19 C ATOM 6691 CG ASP A 430 3.738 51.575 29.579 1.00 50.47 C ATOM 6692 OD1 ASP A 430 3.401 50.755 28.692 1.00 50.52 O ATOM 6693 OD2 ASP A 430 3.029 51.826 30.580 1.00 52.37 O ATOM 6694 HA ASP A 430 5.861 50.900 28.029 1.00 0.00 H ATOM 6695 HB2 ASP A 430 5.344 52.714 30.404 1.00 0.00 H ATOM 6696 HB3 ASP A 430 4.949 53.105 28.714 1.00 0.00 H ATOM 6697 H ASP A 430 6.038 50.379 30.891 1.00 0.00 H ATOM 6698 N LYS A 431 8.309 52.334 29.649 1.00 43.73 N ATOM 6699 CA LYS A 431 9.612 52.968 29.464 1.00 43.15 C ATOM 6700 C LYS A 431 10.555 52.063 28.665 1.00 41.43 C ATOM 6701 O LYS A 431 11.389 52.540 27.892 1.00 42.03 O ATOM 6702 CB LYS A 431 10.247 53.286 30.820 1.00 44.45 C ATOM 6703 CG LYS A 431 9.387 54.149 31.734 1.00 47.16 C ATOM 6704 CD LYS A 431 9.994 54.301 33.134 1.00 48.69 C ATOM 6705 CE LYS A 431 11.095 55.355 33.184 1.00 49.31 C ATOM 6706 NZ LYS A 431 12.239 55.065 32.276 1.00 50.69 N ATOM 6707 HA LYS A 431 9.455 53.893 28.908 1.00 0.00 H ATOM 6708 HB2 LYS A 431 10.449 52.344 31.331 1.00 0.00 H ATOM 6709 HB3 LYS A 431 11.186 53.810 30.642 1.00 0.00 H ATOM 6710 HG2 LYS A 431 9.284 55.138 31.287 1.00 0.00 H ATOM 6711 HG3 LYS A 431 8.403 53.689 31.827 1.00 0.00 H ATOM 6712 HD2 LYS A 431 9.204 54.588 33.828 1.00 0.00 H ATOM 6713 HD3 LYS A 431 10.414 53.342 33.439 1.00 0.00 H ATOM 6714 HE2 LYS A 431 11.471 55.413 34.205 1.00 0.00 H ATOM 6715 HE3 LYS A 431 10.665 56.316 32.902 1.00 0.00 H ATOM 6716 HZ1 LYS A 431 12.667 54.155 32.540 1.00 0.00 H ATOM 6717 HZ2 LYS A 431 11.898 55.018 31.295 1.00 0.00 H ATOM 6718 HZ3 LYS A 431 12.948 55.821 32.362 1.00 0.00 H ATOM 6719 H LYS A 431 8.031 52.024 30.602 1.00 0.00 H ATOM 6720 N ALA A 432 10.427 50.756 28.863 1.00 39.05 N ATOM 6721 CA ALA A 432 11.252 49.799 28.133 1.00 38.17 C ATOM 6722 C ALA A 432 10.794 49.764 26.688 1.00 37.49 C ATOM 6723 O ALA A 432 11.601 49.845 25.767 1.00 37.44 O ATOM 6724 CB ALA A 432 11.158 48.414 28.766 1.00 35.32 C ATOM 6725 HA ALA A 432 12.296 50.108 28.176 1.00 0.00 H ATOM 6726 HB1 ALA A 432 11.504 48.464 29.798 1.00 0.00 H ATOM 6727 HB2 ALA A 432 10.122 48.076 28.745 1.00 0.00 H ATOM 6728 HB3 ALA A 432 11.781 47.717 28.206 1.00 0.00 H ATOM 6729 H ALA A 432 9.727 50.409 29.550 1.00 0.00 H ATOM 6730 N TRP A 433 9.481 49.653 26.508 1.00 39.13 N ATOM 6731 CA TRP A 433 8.851 49.645 25.189 1.00 41.13 C ATOM 6732 C TRP A 433 9.231 50.867 24.357 1.00 41.59 C ATOM 6733 O TRP A 433 9.477 50.754 23.157 1.00 42.27 O ATOM 6734 CB TRP A 433 7.328 49.564 25.344 1.00 42.32 C ATOM 6735 CG TRP A 433 6.599 49.394 24.062 1.00 43.06 C ATOM 6736 CD1 TRP A 433 5.800 50.314 23.440 1.00 43.62 C ATOM 6737 CD2 TRP A 433 6.593 48.229 23.228 1.00 43.28 C ATOM 6738 NE1 TRP A 433 5.300 49.792 22.272 1.00 43.10 N ATOM 6739 CE2 TRP A 433 5.769 48.515 22.119 1.00 43.83 C ATOM 6740 CE3 TRP A 433 7.206 46.973 23.311 1.00 43.53 C ATOM 6741 CZ2 TRP A 433 5.541 47.589 21.099 1.00 43.36 C ATOM 6742 CZ3 TRP A 433 6.978 46.054 22.296 1.00 43.74 C ATOM 6743 CH2 TRP A 433 6.151 46.368 21.208 1.00 43.59 C ATOM 6744 HA TRP A 433 9.216 48.768 24.655 1.00 0.00 H ATOM 6745 HB2 TRP A 433 7.093 48.716 25.987 1.00 0.00 H ATOM 6746 HB3 TRP A 433 6.982 50.483 25.816 1.00 0.00 H ATOM 6747 HE1 TRP A 433 4.668 50.287 21.611 1.00 0.00 H ATOM 6748 HD1 TRP A 433 5.591 51.315 23.816 1.00 0.00 H ATOM 6749 HZ2 TRP A 433 4.902 47.829 20.249 1.00 0.00 H ATOM 6750 HH2 TRP A 433 5.990 45.622 20.430 1.00 0.00 H ATOM 6751 HZ3 TRP A 433 7.449 45.072 22.345 1.00 0.00 H ATOM 6752 HE3 TRP A 433 7.849 46.722 24.155 1.00 0.00 H ATOM 6753 H TRP A 433 8.872 49.568 27.347 1.00 0.00 H ATOM 6754 N GLU A 434 9.282 52.033 24.996 1.00 42.17 N ATOM 6755 CA GLU A 434 9.675 53.268 24.314 1.00 43.39 C ATOM 6756 C GLU A 434 11.174 53.304 23.996 1.00 43.87 C ATOM 6757 O GLU A 434 11.585 53.853 22.976 1.00 43.74 O ATOM 6758 CB GLU A 434 9.286 54.494 25.150 1.00 42.88 C ATOM 6759 HA GLU A 434 9.137 53.292 23.366 1.00 0.00 H ATOM 6760 HB2 GLU A 434 8.207 54.502 25.301 1.00 0.00 H ATOM 6761 HB3 GLU A 434 9.789 54.448 26.116 1.00 0.00 H ATOM 6762 H GLU A 434 9.036 52.068 26.006 1.00 0.00 H ATOM 6763 N GLU A 435 11.992 52.724 24.871 1.00 45.55 N ATOM 6764 CA GLU A 435 13.438 52.682 24.639 1.00 46.34 C ATOM 6765 C GLU A 435 13.782 51.781 23.451 1.00 46.65 C ATOM 6766 O GLU A 435 14.634 52.124 22.630 1.00 47.34 O ATOM 6767 CB GLU A 435 14.183 52.231 25.901 1.00 47.73 C ATOM 6768 CG GLU A 435 15.705 52.207 25.773 1.00 48.08 C ATOM 6769 CD GLU A 435 16.317 53.588 25.588 1.00 49.37 C ATOM 6770 OE1 GLU A 435 15.698 54.582 26.021 1.00 50.11 O ATOM 6771 OE2 GLU A 435 17.425 53.681 25.013 1.00 49.50 O ATOM 6772 HA GLU A 435 13.765 53.693 24.396 1.00 0.00 H ATOM 6773 HB2 GLU A 435 13.921 52.912 26.711 1.00 0.00 H ATOM 6774 HB3 GLU A 435 13.848 51.225 26.151 1.00 0.00 H ATOM 6775 HG2 GLU A 435 16.121 51.762 26.677 1.00 0.00 H ATOM 6776 HG3 GLU A 435 15.970 51.593 24.912 1.00 0.00 H ATOM 6777 H GLU A 435 11.599 52.294 25.732 1.00 0.00 H ATOM 6778 N ILE A 436 13.116 50.633 23.357 1.00 46.45 N ATOM 6779 CA ILE A 436 13.331 49.713 22.241 1.00 45.69 C ATOM 6780 C ILE A 436 12.954 50.373 20.920 1.00 46.26 C ATOM 6781 O ILE A 436 13.722 50.355 19.962 1.00 45.41 O ATOM 6782 CB ILE A 436 12.493 48.422 22.382 1.00 44.67 C ATOM 6783 CG1 ILE A 436 12.866 47.656 23.654 1.00 44.34 C ATOM 6784 CG2 ILE A 436 12.665 47.544 21.151 1.00 43.50 C ATOM 6785 CD1 ILE A 436 11.865 46.570 24.031 1.00 43.74 C ATOM 6786 HA ILE A 436 14.390 49.456 22.255 1.00 0.00 H ATOM 6787 HB ILE A 436 11.443 48.705 22.463 1.00 0.00 H ATOM 6788 HG12 ILE A 436 13.839 47.190 23.502 1.00 0.00 H ATOM 6789 HG13 ILE A 436 12.930 48.367 24.478 1.00 0.00 H ATOM 6790 HD11 ILE A 436 10.887 47.021 24.198 1.00 0.00 H ATOM 6791 HD12 ILE A 436 11.798 45.843 23.222 1.00 0.00 H ATOM 6792 HD13 ILE A 436 12.197 46.072 24.942 1.00 0.00 H ATOM 6793 HG21 ILE A 436 12.333 48.090 20.268 1.00 0.00 H ATOM 6794 HG22 ILE A 436 13.716 47.277 21.041 1.00 0.00 H ATOM 6795 HG23 ILE A 436 12.069 46.639 21.266 1.00 0.00 H ATOM 6796 H ILE A 436 12.426 50.384 24.095 1.00 0.00 H ATOM 6797 N ASN A 437 11.765 50.965 20.885 1.00 47.71 N ATOM 6798 CA ASN A 437 11.228 51.552 19.658 1.00 49.41 C ATOM 6799 C ASN A 437 11.850 52.873 19.203 1.00 50.03 C ATOM 6800 O ASN A 437 11.728 53.237 18.032 1.00 51.21 O ATOM 6801 CB ASN A 437 9.707 51.686 19.771 1.00 49.70 C ATOM 6802 CG ASN A 437 8.997 50.359 19.596 1.00 50.11 C ATOM 6803 OD1 ASN A 437 9.017 49.772 18.513 1.00 50.54 O ATOM 6804 ND2 ASN A 437 8.359 49.881 20.659 1.00 49.92 N ATOM 6805 HA ASN A 437 11.508 50.850 18.873 1.00 0.00 H ATOM 6806 HB2 ASN A 437 9.463 52.087 20.754 1.00 0.00 H ATOM 6807 HB3 ASN A 437 9.358 52.375 19.002 1.00 0.00 H ATOM 6808 HD22 ASN A 437 8.369 50.411 21.554 1.00 0.00 H ATOM 6809 HD21 ASN A 437 7.849 48.977 20.596 1.00 0.00 H ATOM 6810 H ASN A 437 11.199 51.012 21.756 1.00 0.00 H ATOM 6811 N ARG A 438 12.512 53.593 20.105 1.00 49.84 N ATOM 6812 CA ARG A 438 13.112 54.868 19.718 1.00 50.39 C ATOM 6813 C ARG A 438 14.131 54.691 18.589 1.00 50.00 C ATOM 6814 O ARG A 438 15.044 53.862 18.681 1.00 49.98 O ATOM 6815 CB ARG A 438 13.760 55.583 20.907 1.00 51.19 C ATOM 6816 CG ARG A 438 14.115 57.031 20.583 1.00 52.85 C ATOM 6817 CD ARG A 438 15.101 57.650 21.562 1.00 54.15 C ATOM 6818 NE ARG A 438 16.387 56.955 21.577 1.00 54.74 N ATOM 6819 CZ ARG A 438 16.820 56.220 22.597 1.00 55.11 C ATOM 6820 NH1 ARG A 438 18.002 55.617 22.533 1.00 54.98 N ATOM 6821 NH2 ARG A 438 16.073 56.095 23.686 1.00 55.37 N ATOM 6822 HA ARG A 438 12.298 55.494 19.353 1.00 0.00 H ATOM 6823 HB2 ARG A 438 13.065 55.571 21.746 1.00 0.00 H ATOM 6824 HB3 ARG A 438 14.670 55.051 21.183 1.00 0.00 H ATOM 6825 HG2 ARG A 438 14.553 57.064 19.585 1.00 0.00 H ATOM 6826 HG3 ARG A 438 13.199 57.622 20.596 1.00 0.00 H ATOM 6827 HD2 ARG A 438 14.671 57.612 22.563 1.00 0.00 H ATOM 6828 HD3 ARG A 438 15.268 58.689 21.280 1.00 0.00 H ATOM 6829 HE ARG A 438 16.999 57.040 20.741 1.00 0.00 H ATOM 6830 HH12 ARG A 438 18.337 55.043 23.333 1.00 0.00 H ATOM 6831 HH11 ARG A 438 18.592 55.719 21.683 1.00 0.00 H ATOM 6832 HH22 ARG A 438 16.410 55.521 24.485 1.00 0.00 H ATOM 6833 HH21 ARG A 438 15.150 56.571 23.741 1.00 0.00 H ATOM 6834 H ARG A 438 12.602 53.249 21.082 1.00 0.00 H ATOM 6835 N GLY A 439 13.961 55.472 17.524 1.00 49.11 N ATOM 6836 CA GLY A 439 14.868 55.444 16.381 1.00 48.07 C ATOM 6837 C GLY A 439 14.610 54.304 15.413 1.00 47.51 C ATOM 6838 O GLY A 439 15.299 54.171 14.404 1.00 47.13 O ATOM 6839 HA3 GLY A 439 15.888 55.352 16.755 1.00 0.00 H ATOM 6840 HA2 GLY A 439 14.765 56.384 15.839 1.00 0.00 H ATOM 6841 H GLY A 439 13.152 56.126 17.506 1.00 0.00 H ATOM 6842 N GLY A 440 13.614 53.479 15.715 1.00 48.17 N ATOM 6843 CA GLY A 440 13.308 52.328 14.880 1.00 48.35 C ATOM 6844 C GLY A 440 12.942 52.686 13.454 1.00 48.72 C ATOM 6845 O GLY A 440 12.163 53.608 13.218 1.00 50.33 O ATOM 6846 HA3 GLY A 440 12.470 51.793 15.326 1.00 0.00 H ATOM 6847 HA2 GLY A 440 14.182 51.677 14.858 1.00 0.00 H ATOM 6848 H GLY A 440 13.042 53.659 16.565 1.00 0.00 H ATOM 6849 N ILE A 441 13.519 51.959 12.502 1.00 48.69 N ATOM 6850 CA ILE A 441 13.130 52.071 11.105 1.00 48.32 C ATOM 6851 C ILE A 441 11.724 51.482 10.986 1.00 49.21 C ATOM 6852 O ILE A 441 10.873 52.017 10.274 1.00 48.76 O ATOM 6853 CB ILE A 441 14.133 51.365 10.180 1.00 48.14 C ATOM 6854 CG1 ILE A 441 15.484 52.087 10.225 1.00 47.73 C ATOM 6855 CG2 ILE A 441 13.611 51.310 8.750 1.00 47.81 C ATOM 6856 CD1 ILE A 441 16.596 51.382 9.463 1.00 46.87 C ATOM 6857 HA ILE A 441 13.129 53.114 10.788 1.00 0.00 H ATOM 6858 HB ILE A 441 14.263 50.342 10.532 1.00 0.00 H ATOM 6859 HG12 ILE A 441 15.354 53.081 9.798 1.00 0.00 H ATOM 6860 HG13 ILE A 441 15.788 52.178 11.268 1.00 0.00 H ATOM 6861 HD11 ILE A 441 16.750 50.389 9.884 1.00 0.00 H ATOM 6862 HD12 ILE A 441 16.316 51.293 8.413 1.00 0.00 H ATOM 6863 HD13 ILE A 441 17.516 51.961 9.547 1.00 0.00 H ATOM 6864 HG21 ILE A 441 12.669 50.762 8.729 1.00 0.00 H ATOM 6865 HG22 ILE A 441 13.451 52.324 8.384 1.00 0.00 H ATOM 6866 HG23 ILE A 441 14.341 50.805 8.117 1.00 0.00 H ATOM 6867 H ILE A 441 14.271 51.290 12.764 1.00 0.00 H ATOM 6868 N ILE A 442 11.482 50.379 11.692 1.00 48.76 N ATOM 6869 CA ILE A 442 10.121 49.889 11.875 1.00 48.79 C ATOM 6870 C ILE A 442 9.836 49.815 13.375 1.00 49.11 C ATOM 6871 O ILE A 442 10.754 49.899 14.194 1.00 48.59 O ATOM 6872 CB ILE A 442 9.834 48.521 11.169 1.00 49.37 C ATOM 6873 CG1 ILE A 442 10.253 47.327 12.034 1.00 49.18 C ATOM 6874 CG2 ILE A 442 10.473 48.467 9.774 1.00 48.33 C ATOM 6875 CD1 ILE A 442 11.700 46.977 11.930 1.00 50.58 C ATOM 6876 HA ILE A 442 9.445 50.592 11.389 1.00 0.00 H ATOM 6877 HB ILE A 442 8.754 48.447 11.037 1.00 0.00 H ATOM 6878 HG12 ILE A 442 10.032 47.564 13.075 1.00 0.00 H ATOM 6879 HG13 ILE A 442 9.668 46.460 11.728 1.00 0.00 H ATOM 6880 HD11 ILE A 442 11.938 46.725 10.897 1.00 0.00 H ATOM 6881 HD12 ILE A 442 12.302 47.829 12.245 1.00 0.00 H ATOM 6882 HD13 ILE A 442 11.913 46.123 12.572 1.00 0.00 H ATOM 6883 HG21 ILE A 442 10.065 49.268 9.158 1.00 0.00 H ATOM 6884 HG22 ILE A 442 11.552 48.591 9.865 1.00 0.00 H ATOM 6885 HG23 ILE A 442 10.254 47.504 9.313 1.00 0.00 H ATOM 6886 H ILE A 442 12.275 49.860 12.119 1.00 0.00 H ATOM 6887 N LYS A 443 8.568 49.679 13.738 1.00 49.53 N ATOM 6888 CA LYS A 443 8.208 49.559 15.139 1.00 51.15 C ATOM 6889 C LYS A 443 7.958 48.093 15.466 1.00 50.49 C ATOM 6890 O LYS A 443 7.620 47.299 14.587 1.00 50.27 O ATOM 6891 CB LYS A 443 6.955 50.378 15.460 1.00 52.54 C ATOM 6892 CG LYS A 443 7.014 51.831 15.016 1.00 55.26 C ATOM 6893 CD LYS A 443 5.672 52.519 15.244 1.00 56.53 C ATOM 6894 CE LYS A 443 5.646 53.922 14.643 1.00 57.57 C ATOM 6895 NZ LYS A 443 4.430 54.674 15.068 1.00 58.19 N ATOM 6896 HA LYS A 443 9.029 49.945 15.743 1.00 0.00 H ATOM 6897 HB2 LYS A 443 6.105 49.906 14.967 1.00 0.00 H ATOM 6898 HB3 LYS A 443 6.804 50.358 16.539 1.00 0.00 H ATOM 6899 HG2 LYS A 443 7.784 52.349 15.588 1.00 0.00 H ATOM 6900 HG3 LYS A 443 7.262 51.872 13.955 1.00 0.00 H ATOM 6901 HD2 LYS A 443 4.886 51.922 14.782 1.00 0.00 H ATOM 6902 HD3 LYS A 443 5.489 52.590 16.316 1.00 0.00 H ATOM 6903 HE2 LYS A 443 5.652 53.843 13.556 1.00 0.00 H ATOM 6904 HE3 LYS A 443 6.532 54.465 14.971 1.00 0.00 H ATOM 6905 HZ1 LYS A 443 3.580 54.164 14.753 1.00 0.00 H ATOM 6906 HZ2 LYS A 443 4.421 54.758 16.105 1.00 0.00 H ATOM 6907 HZ3 LYS A 443 4.444 55.623 14.642 1.00 0.00 H ATOM 6908 H LYS A 443 7.824 49.658 13.012 1.00 0.00 H ATOM 6909 N VAL A 444 8.127 47.744 16.734 1.00 49.19 N ATOM 6910 CA VAL A 444 7.847 46.401 17.192 1.00 47.82 C ATOM 6911 C VAL A 444 6.323 46.218 17.217 1.00 47.58 C ATOM 6912 O VAL A 444 5.607 47.031 17.815 1.00 47.28 O ATOM 6913 CB VAL A 444 8.453 46.151 18.599 1.00 47.70 C ATOM 6914 CG1 VAL A 444 8.239 44.719 19.026 1.00 47.02 C ATOM 6915 CG2 VAL A 444 9.935 46.483 18.620 1.00 46.87 C ATOM 6916 HA VAL A 444 8.303 45.678 16.516 1.00 0.00 H ATOM 6917 HB VAL A 444 7.941 46.808 19.303 1.00 0.00 H ATOM 6918 HG11 VAL A 444 7.170 44.507 19.060 1.00 0.00 H ATOM 6919 HG12 VAL A 444 8.721 44.052 18.311 1.00 0.00 H ATOM 6920 HG13 VAL A 444 8.672 44.567 20.015 1.00 0.00 H ATOM 6921 HG21 VAL A 444 10.457 45.856 17.897 1.00 0.00 H ATOM 6922 HG22 VAL A 444 10.075 47.532 18.360 1.00 0.00 H ATOM 6923 HG23 VAL A 444 10.333 46.299 19.618 1.00 0.00 H ATOM 6924 H VAL A 444 8.469 48.452 17.415 1.00 0.00 H ATOM 6925 N PRO A 445 5.818 45.166 16.544 1.00 46.44 N ATOM 6926 CA PRO A 445 4.388 44.868 16.550 1.00 46.18 C ATOM 6927 C PRO A 445 3.786 44.927 17.954 1.00 47.04 C ATOM 6928 O PRO A 445 4.357 44.379 18.899 1.00 47.19 O ATOM 6929 CB PRO A 445 4.331 43.442 16.000 1.00 45.42 C ATOM 6930 CG PRO A 445 5.502 43.359 15.089 1.00 45.16 C ATOM 6931 CD PRO A 445 6.578 44.211 15.716 1.00 45.62 C ATOM 6932 HA PRO A 445 3.814 45.590 15.969 1.00 0.00 H ATOM 6933 HD3 PRO A 445 7.246 43.607 16.330 1.00 0.00 H ATOM 6934 HD2 PRO A 445 7.158 44.731 14.954 1.00 0.00 H ATOM 6935 HG3 PRO A 445 5.242 43.742 14.102 1.00 0.00 H ATOM 6936 HG2 PRO A 445 5.840 42.327 14.999 1.00 0.00 H ATOM 6937 HB2 PRO A 445 4.414 42.712 16.806 1.00 0.00 H ATOM 6938 HB3 PRO A 445 3.403 43.274 15.454 1.00 0.00 H ATOM 6939 N ARG A 446 2.639 45.591 18.076 1.00 47.66 N ATOM 6940 CA ARG A 446 1.970 45.791 19.368 1.00 48.54 C ATOM 6941 C ARG A 446 1.848 44.523 20.211 1.00 47.36 C ATOM 6942 O ARG A 446 1.971 44.576 21.431 1.00 46.21 O ATOM 6943 CB ARG A 446 0.581 46.411 19.166 1.00 50.32 C ATOM 6944 CG ARG A 446 -0.107 46.842 20.464 1.00 53.48 C ATOM 6945 CD ARG A 446 -1.441 47.523 20.189 1.00 55.71 C ATOM 6946 NE ARG A 446 -2.043 48.085 21.399 1.00 58.01 N ATOM 6947 CZ ARG A 446 -1.812 49.315 21.854 1.00 58.92 C ATOM 6948 NH1 ARG A 446 -0.985 50.127 21.206 1.00 58.75 N ATOM 6949 NH2 ARG A 446 -2.409 49.735 22.963 1.00 60.18 N ATOM 6950 HA ARG A 446 2.612 46.473 19.925 1.00 0.00 H ATOM 6951 HB2 ARG A 446 0.687 47.288 18.527 1.00 0.00 H ATOM 6952 HB3 ARG A 446 -0.053 45.676 18.670 1.00 0.00 H ATOM 6953 HG2 ARG A 446 -0.279 45.962 21.083 1.00 0.00 H ATOM 6954 HG3 ARG A 446 0.543 47.537 20.996 1.00 0.00 H ATOM 6955 HD2 ARG A 446 -2.127 46.790 19.765 1.00 0.00 H ATOM 6956 HD3 ARG A 446 -1.282 48.328 19.471 1.00 0.00 H ATOM 6957 HE ARG A 446 -2.696 47.483 21.940 1.00 0.00 H ATOM 6958 HH12 ARG A 446 -0.809 51.086 21.567 1.00 0.00 H ATOM 6959 HH11 ARG A 446 -0.513 49.804 20.337 1.00 0.00 H ATOM 6960 HH22 ARG A 446 -2.229 50.696 23.319 1.00 0.00 H ATOM 6961 HH21 ARG A 446 -3.057 49.103 23.476 1.00 0.00 H ATOM 6962 H ARG A 446 2.198 45.985 17.220 1.00 0.00 H ATOM 6963 N ILE A 447 1.606 43.389 19.556 1.00 46.46 N ATOM 6964 CA ILE A 447 1.439 42.116 20.253 1.00 46.30 C ATOM 6965 C ILE A 447 2.658 41.759 21.118 1.00 45.98 C ATOM 6966 O ILE A 447 2.514 41.157 22.185 1.00 46.87 O ATOM 6967 CB ILE A 447 1.129 40.958 19.266 1.00 46.62 C ATOM 6968 CG1 ILE A 447 0.649 39.714 20.016 1.00 47.09 C ATOM 6969 CG2 ILE A 447 2.344 40.633 18.391 1.00 46.32 C ATOM 6970 CD1 ILE A 447 -0.644 39.917 20.786 1.00 48.22 C ATOM 6971 HA ILE A 447 0.584 42.245 20.917 1.00 0.00 H ATOM 6972 HB ILE A 447 0.325 41.289 18.609 1.00 0.00 H ATOM 6973 HG12 ILE A 447 0.495 38.915 19.291 1.00 0.00 H ATOM 6974 HG13 ILE A 447 1.425 39.418 20.721 1.00 0.00 H ATOM 6975 HD11 ILE A 447 -0.505 40.705 21.526 1.00 0.00 H ATOM 6976 HD12 ILE A 447 -1.437 40.202 20.094 1.00 0.00 H ATOM 6977 HD13 ILE A 447 -0.915 38.989 21.289 1.00 0.00 H ATOM 6978 HG21 ILE A 447 2.622 41.516 17.815 1.00 0.00 H ATOM 6979 HG22 ILE A 447 3.178 40.335 19.026 1.00 0.00 H ATOM 6980 HG23 ILE A 447 2.093 39.818 17.712 1.00 0.00 H ATOM 6981 H ILE A 447 1.534 43.410 18.519 1.00 0.00 H ATOM 6982 N TYR A 448 3.846 42.148 20.660 1.00 43.73 N ATOM 6983 CA TYR A 448 5.084 41.820 21.357 1.00 42.96 C ATOM 6984 C TYR A 448 5.284 42.550 22.680 1.00 42.36 C ATOM 6985 O TYR A 448 6.175 42.193 23.451 1.00 41.63 O ATOM 6986 CB TYR A 448 6.299 42.015 20.447 1.00 43.60 C ATOM 6987 CG TYR A 448 6.731 40.747 19.744 1.00 44.41 C ATOM 6988 CD1 TYR A 448 6.704 40.643 18.352 1.00 45.33 C ATOM 6989 CD2 TYR A 448 7.168 39.646 20.478 1.00 44.27 C ATOM 6990 CE1 TYR A 448 7.108 39.467 17.712 1.00 45.36 C ATOM 6991 CE2 TYR A 448 7.566 38.479 19.855 1.00 43.87 C ATOM 6992 CZ TYR A 448 7.536 38.389 18.477 1.00 45.01 C ATOM 6993 OH TYR A 448 7.936 37.218 17.873 1.00 44.46 O ATOM 6994 HA TYR A 448 4.988 40.766 21.617 1.00 0.00 H ATOM 6995 HB3 TYR A 448 7.131 42.376 21.052 1.00 0.00 H ATOM 6996 HB2 TYR A 448 6.050 42.761 19.693 1.00 0.00 H ATOM 6997 HD2 TYR A 448 7.196 39.707 21.566 1.00 0.00 H ATOM 6998 HE2 TYR A 448 7.903 37.630 20.450 1.00 0.00 H ATOM 6999 HE1 TYR A 448 7.087 39.397 16.624 1.00 0.00 H ATOM 7000 HD1 TYR A 448 6.363 41.490 17.756 1.00 0.00 H ATOM 7001 HH TYR A 448 8.878 37.029 18.113 1.00 0.00 H ATOM 7002 H TYR A 448 3.892 42.701 19.781 1.00 0.00 H ATOM 7003 N TYR A 449 4.465 43.565 22.945 1.00 40.99 N ATOM 7004 CA TYR A 449 4.519 44.243 24.235 1.00 40.27 C ATOM 7005 C TYR A 449 4.028 43.277 25.303 1.00 40.26 C ATOM 7006 O TYR A 449 4.616 43.166 26.373 1.00 39.65 O ATOM 7007 CB TYR A 449 3.675 45.524 24.238 1.00 38.77 C ATOM 7008 CG TYR A 449 3.520 46.136 25.612 1.00 37.52 C ATOM 7009 CD1 TYR A 449 4.436 47.065 26.089 1.00 38.14 C ATOM 7010 CD2 TYR A 449 2.461 45.778 26.438 1.00 37.85 C ATOM 7011 CE1 TYR A 449 4.293 47.625 27.352 1.00 38.47 C ATOM 7012 CE2 TYR A 449 2.312 46.326 27.696 1.00 37.66 C ATOM 7013 CZ TYR A 449 3.227 47.247 28.147 1.00 37.61 C ATOM 7014 OH TYR A 449 3.074 47.789 29.400 1.00 38.97 O ATOM 7015 HA TYR A 449 5.547 44.542 24.439 1.00 0.00 H ATOM 7016 HB3 TYR A 449 2.684 45.286 23.851 1.00 0.00 H ATOM 7017 HB2 TYR A 449 4.153 46.255 23.586 1.00 0.00 H ATOM 7018 HD2 TYR A 449 1.732 45.049 26.085 1.00 0.00 H ATOM 7019 HE2 TYR A 449 1.474 46.030 28.328 1.00 0.00 H ATOM 7020 HE1 TYR A 449 5.016 48.357 27.713 1.00 0.00 H ATOM 7021 HD1 TYR A 449 5.279 47.359 25.463 1.00 0.00 H ATOM 7022 HH TYR A 449 3.809 48.430 29.573 1.00 0.00 H ATOM 7023 H TYR A 449 3.781 43.877 22.226 1.00 0.00 H ATOM 7024 N TYR A 450 2.940 42.582 24.990 1.00 41.79 N ATOM 7025 CA TYR A 450 2.336 41.615 25.896 1.00 43.06 C ATOM 7026 C TYR A 450 3.157 40.323 25.957 1.00 42.65 C ATOM 7027 O TYR A 450 3.149 39.624 26.967 1.00 42.26 O ATOM 7028 CB TYR A 450 0.876 41.368 25.491 1.00 46.45 C ATOM 7029 CG TYR A 450 0.079 42.662 25.484 1.00 48.54 C ATOM 7030 CD1 TYR A 450 -0.435 43.185 26.665 1.00 49.02 C ATOM 7031 CD2 TYR A 450 -0.131 43.374 24.304 1.00 49.23 C ATOM 7032 CE1 TYR A 450 -1.151 44.370 26.677 1.00 50.07 C ATOM 7033 CE2 TYR A 450 -0.851 44.565 24.304 1.00 50.28 C ATOM 7034 CZ TYR A 450 -1.356 45.056 25.498 1.00 50.55 C ATOM 7035 OH TYR A 450 -2.071 46.232 25.524 1.00 50.62 O ATOM 7036 HA TYR A 450 2.336 42.022 26.907 1.00 0.00 H ATOM 7037 HB3 TYR A 450 0.423 40.675 26.200 1.00 0.00 H ATOM 7038 HB2 TYR A 450 0.853 40.931 24.493 1.00 0.00 H ATOM 7039 HD2 TYR A 450 0.275 42.992 23.367 1.00 0.00 H ATOM 7040 HE2 TYR A 450 -1.016 45.107 23.373 1.00 0.00 H ATOM 7041 HE1 TYR A 450 -1.551 44.759 27.614 1.00 0.00 H ATOM 7042 HD1 TYR A 450 -0.271 42.651 27.601 1.00 0.00 H ATOM 7043 HH TYR A 450 -2.351 46.426 26.454 1.00 0.00 H ATOM 7044 H TYR A 450 2.501 42.735 24.059 1.00 0.00 H ATOM 7045 N VAL A 451 3.872 40.023 24.878 1.00 40.99 N ATOM 7046 CA VAL A 451 4.803 38.900 24.858 1.00 39.87 C ATOM 7047 C VAL A 451 5.954 39.165 25.826 1.00 40.08 C ATOM 7048 O VAL A 451 6.231 38.356 26.708 1.00 38.99 O ATOM 7049 CB VAL A 451 5.365 38.659 23.443 1.00 39.51 C ATOM 7050 CG1 VAL A 451 6.449 37.598 23.465 1.00 38.62 C ATOM 7051 CG2 VAL A 451 4.242 38.259 22.485 1.00 39.01 C ATOM 7052 HA VAL A 451 4.258 38.007 25.165 1.00 0.00 H ATOM 7053 HB VAL A 451 5.809 39.589 23.089 1.00 0.00 H ATOM 7054 HG11 VAL A 451 7.261 37.924 24.115 1.00 0.00 H ATOM 7055 HG12 VAL A 451 6.033 36.663 23.842 1.00 0.00 H ATOM 7056 HG13 VAL A 451 6.829 37.447 22.454 1.00 0.00 H ATOM 7057 HG21 VAL A 451 3.771 37.343 22.842 1.00 0.00 H ATOM 7058 HG22 VAL A 451 3.501 39.057 22.442 1.00 0.00 H ATOM 7059 HG23 VAL A 451 4.656 38.093 21.491 1.00 0.00 H ATOM 7060 H VAL A 451 3.765 40.605 24.023 1.00 0.00 H ATOM 7061 N MET A 452 6.609 40.309 25.661 1.00 39.96 N ATOM 7062 CA MET A 452 7.746 40.676 26.493 1.00 40.46 C ATOM 7063 C MET A 452 7.383 40.838 27.962 1.00 41.16 C ATOM 7064 O MET A 452 8.153 40.454 28.836 1.00 42.20 O ATOM 7065 CB MET A 452 8.371 41.973 25.994 1.00 40.90 C ATOM 7066 CG MET A 452 9.131 41.851 24.691 1.00 41.48 C ATOM 7067 SD MET A 452 9.532 43.485 24.062 1.00 41.43 S ATOM 7068 CE MET A 452 10.741 43.104 22.802 1.00 40.70 C ATOM 7069 HA MET A 452 8.457 39.853 26.416 1.00 0.00 H ATOM 7070 HB2 MET A 452 7.573 42.703 25.855 1.00 0.00 H ATOM 7071 HB3 MET A 452 9.061 42.333 26.757 1.00 0.00 H ATOM 7072 HG2 MET A 452 8.516 41.323 23.962 1.00 0.00 H ATOM 7073 HG3 MET A 452 10.052 41.292 24.860 1.00 0.00 H ATOM 7074 HE1 MET A 452 11.592 42.599 23.258 1.00 0.00 H ATOM 7075 HE2 MET A 452 10.290 42.454 22.052 1.00 0.00 H ATOM 7076 HE3 MET A 452 11.075 44.028 22.330 1.00 0.00 H ATOM 7077 H MET A 452 6.300 40.963 24.914 1.00 0.00 H ATOM 7078 N ARG A 453 6.213 41.406 28.233 1.00 41.98 N ATOM 7079 CA ARG A 453 5.816 41.675 29.611 1.00 41.90 C ATOM 7080 C ARG A 453 5.274 40.454 30.338 1.00 41.11 C ATOM 7081 O ARG A 453 5.554 40.269 31.518 1.00 39.37 O ATOM 7082 CB ARG A 453 4.788 42.818 29.677 1.00 42.64 C ATOM 7083 CG ARG A 453 4.584 43.370 31.089 1.00 44.04 C ATOM 7084 CD ARG A 453 3.621 44.556 31.122 1.00 45.54 C ATOM 7085 NE ARG A 453 3.451 45.070 32.481 1.00 45.76 N ATOM 7086 CZ ARG A 453 2.769 46.169 32.800 1.00 46.59 C ATOM 7087 NH1 ARG A 453 2.174 46.901 31.861 1.00 46.33 N ATOM 7088 NH2 ARG A 453 2.682 46.541 34.068 1.00 46.51 N ATOM 7089 HA ARG A 453 6.730 41.972 30.125 1.00 0.00 H ATOM 7090 HB2 ARG A 453 5.131 43.629 29.035 1.00 0.00 H ATOM 7091 HB3 ARG A 453 3.832 42.445 29.310 1.00 0.00 H ATOM 7092 HG2 ARG A 453 4.183 42.577 31.720 1.00 0.00 H ATOM 7093 HG3 ARG A 453 5.549 43.692 31.481 1.00 0.00 H ATOM 7094 HD2 ARG A 453 2.652 44.236 30.740 1.00 0.00 H ATOM 7095 HD3 ARG A 453 4.015 45.351 30.489 1.00 0.00 H ATOM 7096 HE ARG A 453 3.896 44.538 33.256 1.00 0.00 H ATOM 7097 HH12 ARG A 453 1.645 47.756 32.126 1.00 0.00 H ATOM 7098 HH11 ARG A 453 2.238 46.618 30.862 1.00 0.00 H ATOM 7099 HH22 ARG A 453 2.151 47.398 34.323 1.00 0.00 H ATOM 7100 HH21 ARG A 453 3.145 45.976 34.809 1.00 0.00 H ATOM 7101 H ARG A 453 5.573 41.662 27.454 1.00 0.00 H ATOM 7102 N TYR A 454 4.508 39.623 29.634 1.00 41.69 N ATOM 7103 CA TYR A 454 3.819 38.503 30.269 1.00 42.73 C ATOM 7104 C TYR A 454 4.241 37.112 29.786 1.00 43.08 C ATOM 7105 O TYR A 454 4.531 36.242 30.602 1.00 43.11 O ATOM 7106 CB TYR A 454 2.298 38.643 30.095 1.00 44.50 C ATOM 7107 CG TYR A 454 1.724 39.948 30.602 1.00 45.78 C ATOM 7108 CD1 TYR A 454 1.559 40.179 31.967 1.00 46.27 C ATOM 7109 CD2 TYR A 454 1.339 40.951 29.715 1.00 46.52 C ATOM 7110 CE1 TYR A 454 1.028 41.379 32.438 1.00 46.32 C ATOM 7111 CE2 TYR A 454 0.807 42.154 30.177 1.00 46.74 C ATOM 7112 CZ TYR A 454 0.655 42.360 31.537 1.00 46.04 C ATOM 7113 OH TYR A 454 0.127 43.550 31.992 1.00 46.22 O ATOM 7114 HA TYR A 454 4.113 38.564 31.317 1.00 0.00 H ATOM 7115 HB3 TYR A 454 1.817 37.827 30.635 1.00 0.00 H ATOM 7116 HB2 TYR A 454 2.068 38.560 29.033 1.00 0.00 H ATOM 7117 HD2 TYR A 454 1.456 40.793 28.643 1.00 0.00 H ATOM 7118 HE2 TYR A 454 0.512 42.929 29.470 1.00 0.00 H ATOM 7119 HE1 TYR A 454 0.908 41.543 33.509 1.00 0.00 H ATOM 7120 HD1 TYR A 454 1.851 39.407 32.679 1.00 0.00 H ATOM 7121 HH TYR A 454 0.087 43.535 32.981 1.00 0.00 H ATOM 7122 H TYR A 454 4.398 39.775 28.611 1.00 0.00 H ATOM 7123 N ILE A 455 4.259 36.904 28.470 1.00 41.78 N ATOM 7124 CA ILE A 455 4.480 35.568 27.901 1.00 40.64 C ATOM 7125 C ILE A 455 5.913 35.072 28.083 1.00 39.55 C ATOM 7126 O ILE A 455 6.136 33.979 28.603 1.00 39.74 O ATOM 7127 CB ILE A 455 4.103 35.501 26.392 1.00 40.84 C ATOM 7128 CG1 ILE A 455 2.693 36.054 26.145 1.00 41.35 C ATOM 7129 CG2 ILE A 455 4.238 34.078 25.862 1.00 40.85 C ATOM 7130 CD1 ILE A 455 1.595 35.378 26.933 1.00 42.53 C ATOM 7131 HA ILE A 455 3.817 34.910 28.463 1.00 0.00 H ATOM 7132 HB ILE A 455 4.803 36.132 25.844 1.00 0.00 H ATOM 7133 HG12 ILE A 455 2.694 37.112 26.405 1.00 0.00 H ATOM 7134 HG13 ILE A 455 2.467 35.942 25.085 1.00 0.00 H ATOM 7135 HD11 ILE A 455 1.565 34.319 26.677 1.00 0.00 H ATOM 7136 HD12 ILE A 455 1.793 35.490 27.999 1.00 0.00 H ATOM 7137 HD13 ILE A 455 0.638 35.839 26.689 1.00 0.00 H ATOM 7138 HG21 ILE A 455 5.268 33.743 25.982 1.00 0.00 H ATOM 7139 HG22 ILE A 455 3.573 33.419 26.420 1.00 0.00 H ATOM 7140 HG23 ILE A 455 3.969 34.058 24.806 1.00 0.00 H ATOM 7141 H ILE A 455 4.113 37.709 27.828 1.00 0.00 H ATOM 7142 N THR A 456 6.876 35.885 27.662 1.00 38.19 N ATOM 7143 CA THR A 456 8.295 35.528 27.744 1.00 38.29 C ATOM 7144 C THR A 456 8.798 35.233 29.172 1.00 39.09 C ATOM 7145 O THR A 456 9.443 34.208 29.388 1.00 39.83 O ATOM 7146 CB THR A 456 9.188 36.597 27.074 1.00 37.12 C ATOM 7147 OG1 THR A 456 8.710 36.854 25.750 1.00 35.51 O ATOM 7148 CG2 THR A 456 10.639 36.133 27.008 1.00 36.89 C ATOM 7149 HA THR A 456 8.376 34.590 27.194 1.00 0.00 H ATOM 7150 HB THR A 456 9.144 37.508 27.671 1.00 0.00 H ATOM 7151 HG1 THR A 456 8.741 36.018 25.221 1.00 0.00 H ATOM 7152 HG23 THR A 456 11.003 35.937 28.017 1.00 0.00 H ATOM 7153 HG21 THR A 456 10.701 35.221 26.415 1.00 0.00 H ATOM 7154 HG22 THR A 456 11.247 36.910 26.546 1.00 0.00 H ATOM 7155 H THR A 456 6.613 36.808 27.260 1.00 0.00 H ATOM 7156 N PRO A 457 8.514 36.119 30.150 1.00 38.61 N ATOM 7157 CA PRO A 457 9.010 35.771 31.489 1.00 39.31 C ATOM 7158 C PRO A 457 8.361 34.513 32.087 1.00 39.35 C ATOM 7159 O PRO A 457 9.036 33.756 32.783 1.00 38.44 O ATOM 7160 CB PRO A 457 8.696 37.017 32.335 1.00 38.67 C ATOM 7161 CG PRO A 457 7.654 37.755 31.586 1.00 39.14 C ATOM 7162 CD PRO A 457 7.794 37.405 30.131 1.00 38.84 C ATOM 7163 HA PRO A 457 10.070 35.520 31.458 1.00 0.00 H ATOM 7164 HD3 PRO A 457 6.817 37.297 29.661 1.00 0.00 H ATOM 7165 HD2 PRO A 457 8.369 38.165 29.601 1.00 0.00 H ATOM 7166 HG3 PRO A 457 7.789 38.828 31.724 1.00 0.00 H ATOM 7167 HG2 PRO A 457 6.666 37.465 31.943 1.00 0.00 H ATOM 7168 HB2 PRO A 457 8.325 36.726 33.318 1.00 0.00 H ATOM 7169 HB3 PRO A 457 9.588 37.632 32.453 1.00 0.00 H ATOM 7170 N ALA A 458 7.078 34.288 31.811 1.00 39.85 N ATOM 7171 CA ALA A 458 6.381 33.102 32.321 1.00 40.62 C ATOM 7172 C ALA A 458 6.890 31.820 31.655 1.00 40.93 C ATOM 7173 O ALA A 458 7.009 30.776 32.293 1.00 41.03 O ATOM 7174 CB ALA A 458 4.873 33.243 32.137 1.00 40.94 C ATOM 7175 HA ALA A 458 6.595 33.027 33.387 1.00 0.00 H ATOM 7176 HB1 ALA A 458 4.522 34.120 32.681 1.00 0.00 H ATOM 7177 HB2 ALA A 458 4.647 33.357 31.077 1.00 0.00 H ATOM 7178 HB3 ALA A 458 4.376 32.352 32.522 1.00 0.00 H ATOM 7179 H ALA A 458 6.558 34.968 31.221 1.00 0.00 H ATOM 7180 N PHE A 459 7.187 31.922 30.366 1.00 42.24 N ATOM 7181 CA PHE A 459 7.769 30.840 29.576 1.00 41.86 C ATOM 7182 C PHE A 459 9.103 30.397 30.179 1.00 40.88 C ATOM 7183 O PHE A 459 9.327 29.209 30.426 1.00 39.89 O ATOM 7184 CB PHE A 459 7.989 31.353 28.153 1.00 44.35 C ATOM 7185 CG PHE A 459 8.259 30.283 27.135 1.00 46.43 C ATOM 7186 CD1 PHE A 459 7.212 29.672 26.460 1.00 47.61 C ATOM 7187 CD2 PHE A 459 9.553 29.903 26.834 1.00 47.44 C ATOM 7188 CE1 PHE A 459 7.451 28.694 25.513 1.00 48.24 C ATOM 7189 CE2 PHE A 459 9.799 28.924 25.884 1.00 48.01 C ATOM 7190 CZ PHE A 459 8.748 28.318 25.224 1.00 48.05 C ATOM 7191 HA PHE A 459 7.096 29.983 29.571 1.00 0.00 H ATOM 7192 HB2 PHE A 459 7.096 31.897 27.846 1.00 0.00 H ATOM 7193 HB3 PHE A 459 8.841 32.033 28.165 1.00 0.00 H ATOM 7194 HD2 PHE A 459 10.388 30.378 27.349 1.00 0.00 H ATOM 7195 HE2 PHE A 459 10.824 28.632 25.657 1.00 0.00 H ATOM 7196 HZ PHE A 459 8.941 27.547 24.479 1.00 0.00 H ATOM 7197 HE1 PHE A 459 6.617 28.220 24.995 1.00 0.00 H ATOM 7198 HD1 PHE A 459 6.186 29.968 26.680 1.00 0.00 H ATOM 7199 H PHE A 459 6.994 32.826 29.890 1.00 0.00 H ATOM 7200 N LEU A 460 9.983 31.365 30.412 1.00 38.77 N ATOM 7201 CA LEU A 460 11.306 31.101 30.968 1.00 39.40 C ATOM 7202 C LEU A 460 11.247 30.612 32.412 1.00 40.64 C ATOM 7203 O LEU A 460 12.014 29.723 32.798 1.00 41.26 O ATOM 7204 CB LEU A 460 12.190 32.348 30.879 1.00 36.94 C ATOM 7205 CG LEU A 460 12.497 32.857 29.466 1.00 36.18 C ATOM 7206 CD1 LEU A 460 13.416 34.065 29.520 1.00 34.49 C ATOM 7207 CD2 LEU A 460 13.098 31.746 28.612 1.00 34.09 C ATOM 7208 HA LEU A 460 11.742 30.302 30.368 1.00 0.00 H ATOM 7209 HB2 LEU A 460 11.690 33.151 31.421 1.00 0.00 H ATOM 7210 HB3 LEU A 460 13.139 32.119 31.365 1.00 0.00 H ATOM 7211 HG LEU A 460 11.561 33.168 29.001 1.00 0.00 H ATOM 7212 HD21 LEU A 460 14.023 31.397 29.070 1.00 0.00 H ATOM 7213 HD22 LEU A 460 12.391 30.919 28.544 1.00 0.00 H ATOM 7214 HD23 LEU A 460 13.308 32.130 27.614 1.00 0.00 H ATOM 7215 HD11 LEU A 460 12.933 34.862 30.086 1.00 0.00 H ATOM 7216 HD12 LEU A 460 14.351 33.787 30.006 1.00 0.00 H ATOM 7217 HD13 LEU A 460 13.621 34.410 28.506 1.00 0.00 H ATOM 7218 H LEU A 460 9.719 32.346 30.190 1.00 0.00 H ATOM 7219 N ALA A 461 10.345 31.189 33.205 1.00 40.77 N ATOM 7220 CA ALA A 461 10.225 30.807 34.607 1.00 41.35 C ATOM 7221 C ALA A 461 9.741 29.369 34.737 1.00 42.78 C ATOM 7222 O ALA A 461 10.301 28.597 35.516 1.00 41.68 O ATOM 7223 CB ALA A 461 9.306 31.756 35.354 1.00 41.24 C ATOM 7224 HA ALA A 461 11.215 30.874 35.059 1.00 0.00 H ATOM 7225 HB1 ALA A 461 9.709 32.767 35.300 1.00 0.00 H ATOM 7226 HB2 ALA A 461 8.316 31.734 34.899 1.00 0.00 H ATOM 7227 HB3 ALA A 461 9.236 31.446 36.397 1.00 0.00 H ATOM 7228 H ALA A 461 9.717 31.923 32.818 1.00 0.00 H ATOM 7229 N VAL A 462 8.704 29.014 33.977 1.00 43.72 N ATOM 7230 CA VAL A 462 8.184 27.650 33.982 1.00 46.19 C ATOM 7231 C VAL A 462 9.266 26.672 33.524 1.00 47.65 C ATOM 7232 O VAL A 462 9.465 25.616 34.134 1.00 47.92 O ATOM 7233 CB VAL A 462 6.941 27.509 33.086 1.00 45.84 C ATOM 7234 CG1 VAL A 462 6.663 26.047 32.789 1.00 47.01 C ATOM 7235 CG2 VAL A 462 5.734 28.162 33.744 1.00 46.28 C ATOM 7236 HA VAL A 462 7.888 27.416 35.005 1.00 0.00 H ATOM 7237 HB VAL A 462 7.135 28.019 32.142 1.00 0.00 H ATOM 7238 HG11 VAL A 462 7.521 25.612 32.276 1.00 0.00 H ATOM 7239 HG12 VAL A 462 6.489 25.514 33.724 1.00 0.00 H ATOM 7240 HG13 VAL A 462 5.780 25.968 32.154 1.00 0.00 H ATOM 7241 HG21 VAL A 462 5.538 27.679 34.701 1.00 0.00 H ATOM 7242 HG22 VAL A 462 5.938 29.221 33.905 1.00 0.00 H ATOM 7243 HG23 VAL A 462 4.865 28.052 33.096 1.00 0.00 H ATOM 7244 H VAL A 462 8.255 29.726 33.366 1.00 0.00 H ATOM 7245 N LEU A 463 9.966 27.047 32.453 1.00 48.71 N ATOM 7246 CA LEU A 463 11.070 26.264 31.908 1.00 48.96 C ATOM 7247 C LEU A 463 12.117 25.956 32.965 1.00 48.79 C ATOM 7248 O LEU A 463 12.487 24.801 33.158 1.00 48.96 O ATOM 7249 CB LEU A 463 11.743 27.019 30.759 1.00 50.84 C ATOM 7250 CG LEU A 463 12.753 26.219 29.936 1.00 52.08 C ATOM 7251 CD1 LEU A 463 12.009 25.363 28.912 1.00 52.78 C ATOM 7252 CD2 LEU A 463 13.742 27.144 29.251 1.00 52.25 C ATOM 7253 HA LEU A 463 10.648 25.326 31.547 1.00 0.00 H ATOM 7254 HB2 LEU A 463 10.961 27.366 30.083 1.00 0.00 H ATOM 7255 HB3 LEU A 463 12.263 27.878 31.183 1.00 0.00 H ATOM 7256 HG LEU A 463 13.318 25.566 30.601 1.00 0.00 H ATOM 7257 HD21 LEU A 463 13.204 27.821 28.587 1.00 0.00 H ATOM 7258 HD22 LEU A 463 14.279 27.721 30.004 1.00 0.00 H ATOM 7259 HD23 LEU A 463 14.450 26.552 28.672 1.00 0.00 H ATOM 7260 HD11 LEU A 463 11.338 24.679 29.431 1.00 0.00 H ATOM 7261 HD12 LEU A 463 11.431 26.009 28.252 1.00 0.00 H ATOM 7262 HD13 LEU A 463 12.729 24.793 28.325 1.00 0.00 H ATOM 7263 H LEU A 463 9.713 27.940 31.984 1.00 0.00 H ATOM 7264 N LEU A 464 12.595 26.998 33.640 1.00 48.22 N ATOM 7265 CA LEU A 464 13.600 26.850 34.691 1.00 49.18 C ATOM 7266 C LEU A 464 13.126 25.974 35.854 1.00 50.33 C ATOM 7267 O LEU A 464 13.923 25.249 36.448 1.00 50.35 O ATOM 7268 CB LEU A 464 14.032 28.221 35.222 1.00 48.36 C ATOM 7269 CG LEU A 464 14.951 29.071 34.340 1.00 48.22 C ATOM 7270 CD1 LEU A 464 15.030 30.512 34.846 1.00 47.04 C ATOM 7271 CD2 LEU A 464 16.336 28.448 34.265 1.00 47.94 C ATOM 7272 HA LEU A 464 14.450 26.346 34.231 1.00 0.00 H ATOM 7273 HB2 LEU A 464 13.126 28.800 35.402 1.00 0.00 H ATOM 7274 HB3 LEU A 464 14.550 28.056 36.167 1.00 0.00 H ATOM 7275 HG LEU A 464 14.527 29.097 33.336 1.00 0.00 H ATOM 7276 HD21 LEU A 464 16.760 28.387 35.267 1.00 0.00 H ATOM 7277 HD22 LEU A 464 16.260 27.447 33.840 1.00 0.00 H ATOM 7278 HD23 LEU A 464 16.977 29.064 33.634 1.00 0.00 H ATOM 7279 HD11 LEU A 464 14.034 30.954 34.837 1.00 0.00 H ATOM 7280 HD12 LEU A 464 15.422 30.518 35.863 1.00 0.00 H ATOM 7281 HD13 LEU A 464 15.690 31.088 34.197 1.00 0.00 H ATOM 7282 H LEU A 464 12.242 27.949 33.412 1.00 0.00 H ATOM 7283 N VAL A 465 11.837 26.052 36.177 1.00 51.63 N ATOM 7284 CA VAL A 465 11.262 25.244 37.254 1.00 53.86 C ATOM 7285 C VAL A 465 11.255 23.764 36.865 1.00 55.39 C ATOM 7286 O VAL A 465 11.769 22.922 37.601 1.00 55.27 O ATOM 7287 CB VAL A 465 9.836 25.729 37.643 1.00 53.46 C ATOM 7288 CG1 VAL A 465 9.105 24.688 38.485 1.00 53.61 C ATOM 7289 CG2 VAL A 465 9.909 27.054 38.388 1.00 52.82 C ATOM 7290 HA VAL A 465 11.892 25.367 38.135 1.00 0.00 H ATOM 7291 HB VAL A 465 9.271 25.873 36.722 1.00 0.00 H ATOM 7292 HG11 VAL A 465 9.013 23.762 37.917 1.00 0.00 H ATOM 7293 HG12 VAL A 465 9.669 24.501 39.399 1.00 0.00 H ATOM 7294 HG13 VAL A 465 8.112 25.060 38.739 1.00 0.00 H ATOM 7295 HG21 VAL A 465 10.500 26.927 39.295 1.00 0.00 H ATOM 7296 HG22 VAL A 465 10.377 27.803 37.749 1.00 0.00 H ATOM 7297 HG23 VAL A 465 8.902 27.377 38.652 1.00 0.00 H ATOM 7298 H VAL A 465 11.222 26.704 35.650 1.00 0.00 H ATOM 7299 N VAL A 466 10.680 23.461 35.703 1.00 57.46 N ATOM 7300 CA VAL A 466 10.653 22.098 35.175 1.00 59.80 C ATOM 7301 C VAL A 466 12.073 21.545 35.044 1.00 61.66 C ATOM 7302 O VAL A 466 12.307 20.347 35.220 1.00 61.88 O ATOM 7303 CB VAL A 466 9.938 22.038 33.812 1.00 59.86 C ATOM 7304 CG1 VAL A 466 10.102 20.667 33.168 1.00 60.08 C ATOM 7305 CG2 VAL A 466 8.463 22.383 33.975 1.00 59.90 C ATOM 7306 HA VAL A 466 10.094 21.483 35.880 1.00 0.00 H ATOM 7307 HB VAL A 466 10.398 22.774 33.152 1.00 0.00 H ATOM 7308 HG11 VAL A 466 11.162 20.463 33.016 1.00 0.00 H ATOM 7309 HG12 VAL A 466 9.674 19.907 33.821 1.00 0.00 H ATOM 7310 HG13 VAL A 466 9.587 20.654 32.207 1.00 0.00 H ATOM 7311 HG21 VAL A 466 7.997 21.669 34.654 1.00 0.00 H ATOM 7312 HG22 VAL A 466 8.370 23.389 34.383 1.00 0.00 H ATOM 7313 HG23 VAL A 466 7.971 22.336 33.004 1.00 0.00 H ATOM 7314 H VAL A 466 10.234 24.221 35.151 1.00 0.00 H ATOM 7315 N TRP A 467 13.013 22.436 34.746 1.00 63.20 N ATOM 7316 CA TRP A 467 14.417 22.082 34.622 1.00 65.05 C ATOM 7317 C TRP A 467 14.989 21.663 35.967 1.00 66.07 C ATOM 7318 O TRP A 467 15.529 20.568 36.112 1.00 66.08 O ATOM 7319 CB TRP A 467 15.214 23.281 34.119 1.00 65.86 C ATOM 7320 CG TRP A 467 16.451 22.925 33.372 1.00 65.88 C ATOM 7321 CD1 TRP A 467 17.284 21.869 33.607 1.00 66.10 C ATOM 7322 CD2 TRP A 467 17.010 23.640 32.268 1.00 66.35 C ATOM 7323 NE1 TRP A 467 18.321 21.877 32.708 1.00 66.03 N ATOM 7324 CE2 TRP A 467 18.177 22.955 31.875 1.00 66.50 C ATOM 7325 CE3 TRP A 467 16.635 24.794 31.569 1.00 66.37 C ATOM 7326 CZ2 TRP A 467 18.973 23.387 30.813 1.00 66.61 C ATOM 7327 CZ3 TRP A 467 17.426 25.221 30.515 1.00 66.46 C ATOM 7328 CH2 TRP A 467 18.580 24.520 30.147 1.00 66.38 C ATOM 7329 HA TRP A 467 14.491 21.253 33.918 1.00 0.00 H ATOM 7330 HB2 TRP A 467 14.573 23.865 33.459 1.00 0.00 H ATOM 7331 HB3 TRP A 467 15.497 23.888 34.979 1.00 0.00 H ATOM 7332 HE1 TRP A 467 19.091 21.179 32.666 1.00 0.00 H ATOM 7333 HD1 TRP A 467 17.146 21.128 34.394 1.00 0.00 H ATOM 7334 HZ2 TRP A 467 19.873 22.844 30.524 1.00 0.00 H ATOM 7335 HH2 TRP A 467 19.180 24.882 29.312 1.00 0.00 H ATOM 7336 HZ3 TRP A 467 17.145 26.118 29.963 1.00 0.00 H ATOM 7337 HE3 TRP A 467 15.738 25.346 31.849 1.00 0.00 H ATOM 7338 H TRP A 467 12.733 23.426 34.596 1.00 0.00 H ATOM 7339 N ALA A 468 14.867 22.553 36.948 1.00 67.26 N ATOM 7340 CA ALA A 468 15.446 22.341 38.271 1.00 68.68 C ATOM 7341 C ALA A 468 14.756 21.245 39.089 1.00 69.93 C ATOM 7342 O ALA A 468 15.319 20.746 40.062 1.00 70.08 O ATOM 7343 CB ALA A 468 15.471 23.650 39.050 1.00 68.62 C ATOM 7344 HA ALA A 468 16.463 21.987 38.101 1.00 0.00 H ATOM 7345 HB1 ALA A 468 16.072 24.381 38.510 1.00 0.00 H ATOM 7346 HB2 ALA A 468 14.453 24.025 39.161 1.00 0.00 H ATOM 7347 HB3 ALA A 468 15.905 23.477 40.035 1.00 0.00 H ATOM 7348 H ALA A 468 14.340 23.431 36.766 1.00 0.00 H ATOM 7349 N ARG A 469 13.545 20.868 38.701 1.00 71.32 N ATOM 7350 CA ARG A 469 12.829 19.823 39.418 1.00 73.24 C ATOM 7351 C ARG A 469 13.154 18.429 38.897 1.00 74.47 C ATOM 7352 O ARG A 469 13.448 17.521 39.674 1.00 74.76 O ATOM 7353 CB ARG A 469 11.318 20.050 39.344 1.00 73.32 C ATOM 7354 CG ARG A 469 10.783 21.098 40.301 1.00 73.74 C ATOM 7355 CD ARG A 469 9.285 21.250 40.117 1.00 74.14 C ATOM 7356 NE ARG A 469 8.680 22.126 41.116 1.00 74.48 N ATOM 7357 CZ ARG A 469 7.415 22.533 41.076 1.00 74.66 C ATOM 7358 NH1 ARG A 469 6.625 22.145 40.082 1.00 74.30 N ATOM 7359 NH2 ARG A 469 6.940 23.330 42.027 1.00 74.64 N ATOM 7360 HA ARG A 469 13.161 19.880 40.455 1.00 0.00 H ATOM 7361 HB2 ARG A 469 11.071 20.360 38.329 1.00 0.00 H ATOM 7362 HB3 ARG A 469 10.822 19.105 39.564 1.00 0.00 H ATOM 7363 HG2 ARG A 469 10.992 20.792 41.326 1.00 0.00 H ATOM 7364 HG3 ARG A 469 11.270 22.052 40.101 1.00 0.00 H ATOM 7365 HD2 ARG A 469 8.823 20.266 40.190 1.00 0.00 H ATOM 7366 HD3 ARG A 469 9.095 21.666 39.128 1.00 0.00 H ATOM 7367 HE ARG A 469 9.274 22.451 41.906 1.00 0.00 H ATOM 7368 HH12 ARG A 469 5.635 22.463 40.050 1.00 0.00 H ATOM 7369 HH11 ARG A 469 6.996 21.523 39.335 1.00 0.00 H ATOM 7370 HH22 ARG A 469 5.950 23.647 41.993 1.00 0.00 H ATOM 7371 HH21 ARG A 469 7.558 23.637 42.805 1.00 0.00 H ATOM 7372 H ARG A 469 13.103 21.323 37.877 1.00 0.00 H ATOM 7373 N GLU A 470 13.110 18.264 37.580 1.00 75.93 N ATOM 7374 CA GLU A 470 13.184 16.931 36.990 1.00 78.01 C ATOM 7375 C GLU A 470 14.465 16.622 36.213 1.00 78.81 C ATOM 7376 O GLU A 470 14.534 15.598 35.530 1.00 78.84 O ATOM 7377 CB GLU A 470 11.972 16.706 36.072 1.00 78.33 C ATOM 7378 CG GLU A 470 10.624 17.117 36.674 1.00 79.09 C ATOM 7379 CD GLU A 470 10.182 16.232 37.831 1.00 79.44 C ATOM 7380 OE1 GLU A 470 10.657 15.079 37.926 1.00 79.74 O ATOM 7381 OE2 GLU A 470 9.351 16.690 38.645 1.00 79.84 O ATOM 7382 HA GLU A 470 13.186 16.247 37.839 1.00 0.00 H ATOM 7383 HB2 GLU A 470 12.126 17.282 35.160 1.00 0.00 H ATOM 7384 HB3 GLU A 470 11.925 15.645 35.827 1.00 0.00 H ATOM 7385 HG2 GLU A 470 10.705 18.142 37.035 1.00 0.00 H ATOM 7386 HG3 GLU A 470 9.867 17.067 35.892 1.00 0.00 H ATOM 7387 H GLU A 470 13.022 19.095 36.961 1.00 0.00 H ATOM 7388 N TYR A 471 15.474 17.485 36.306 1.00 79.84 N ATOM 7389 CA TYR A 471 16.687 17.275 35.507 1.00 80.93 C ATOM 7390 C TYR A 471 18.007 17.603 36.213 1.00 81.58 C ATOM 7391 O TYR A 471 19.028 16.978 35.928 1.00 81.81 O ATOM 7392 CB TYR A 471 16.599 18.035 34.170 1.00 81.17 C ATOM 7393 CG TYR A 471 15.421 17.639 33.295 1.00 81.34 C ATOM 7394 CD1 TYR A 471 15.477 16.512 32.480 1.00 81.16 C ATOM 7395 CD2 TYR A 471 14.253 18.397 33.285 1.00 81.50 C ATOM 7396 CE1 TYR A 471 14.399 16.151 31.680 1.00 81.34 C ATOM 7397 CE2 TYR A 471 13.172 18.045 32.491 1.00 81.39 C ATOM 7398 CZ TYR A 471 13.250 16.923 31.691 1.00 81.44 C ATOM 7399 OH TYR A 471 12.175 16.578 30.904 1.00 81.22 O ATOM 7400 HA TYR A 471 16.715 16.199 35.333 1.00 0.00 H ATOM 7401 HB3 TYR A 471 17.516 17.848 33.611 1.00 0.00 H ATOM 7402 HB2 TYR A 471 16.518 19.100 34.388 1.00 0.00 H ATOM 7403 HD2 TYR A 471 14.187 19.285 33.914 1.00 0.00 H ATOM 7404 HE2 TYR A 471 12.266 18.651 32.499 1.00 0.00 H ATOM 7405 HE1 TYR A 471 14.458 15.265 31.048 1.00 0.00 H ATOM 7406 HD1 TYR A 471 16.381 15.903 32.469 1.00 0.00 H ATOM 7407 HH TYR A 471 12.390 15.756 30.396 1.00 0.00 H ATOM 7408 H TYR A 471 15.403 18.305 36.942 1.00 0.00 H ATOM 7409 N ILE A 472 17.997 18.572 37.125 1.00 82.34 N ATOM 7410 CA ILE A 472 19.243 18.962 37.800 1.00 83.26 C ATOM 7411 C ILE A 472 19.647 18.111 39.017 1.00 83.86 C ATOM 7412 O ILE A 472 20.835 18.033 39.334 1.00 84.00 O ATOM 7413 CB ILE A 472 19.284 20.487 38.160 1.00 83.64 C ATOM 7414 CG1 ILE A 472 18.310 20.836 39.292 1.00 83.86 C ATOM 7415 CG2 ILE A 472 19.030 21.340 36.920 1.00 83.63 C ATOM 7416 CD1 ILE A 472 18.877 20.699 40.702 1.00 84.19 C ATOM 7417 HA ILE A 472 19.998 18.753 37.042 1.00 0.00 H ATOM 7418 HB ILE A 472 20.285 20.713 38.528 1.00 0.00 H ATOM 7419 HG12 ILE A 472 17.990 21.869 39.156 1.00 0.00 H ATOM 7420 HG13 ILE A 472 17.447 20.176 39.210 1.00 0.00 H ATOM 7421 HD11 ILE A 472 19.190 19.668 40.868 1.00 0.00 H ATOM 7422 HD12 ILE A 472 19.734 21.363 40.814 1.00 0.00 H ATOM 7423 HD13 ILE A 472 18.110 20.968 41.428 1.00 0.00 H ATOM 7424 HG21 ILE A 472 19.797 21.132 36.174 1.00 0.00 H ATOM 7425 HG22 ILE A 472 18.049 21.100 36.510 1.00 0.00 H ATOM 7426 HG23 ILE A 472 19.063 22.395 37.193 1.00 0.00 H ATOM 7427 H ILE A 472 17.106 19.054 37.361 1.00 0.00 H ATOM 7428 N PRO A 473 18.677 17.473 39.707 1.00 84.61 N ATOM 7429 CA PRO A 473 19.119 16.623 40.815 1.00 84.95 C ATOM 7430 C PRO A 473 19.857 15.373 40.322 1.00 85.38 C ATOM 7431 O PRO A 473 20.574 14.736 41.094 1.00 85.91 O ATOM 7432 CB PRO A 473 17.808 16.241 41.509 1.00 84.77 C ATOM 7433 CG PRO A 473 16.779 16.332 40.447 1.00 84.74 C ATOM 7434 CD PRO A 473 17.208 17.468 39.566 1.00 84.68 C ATOM 7435 HA PRO A 473 19.827 17.131 41.470 1.00 0.00 H ATOM 7436 HD3 PRO A 473 16.916 17.291 38.531 1.00 0.00 H ATOM 7437 HD2 PRO A 473 16.780 18.410 39.907 1.00 0.00 H ATOM 7438 HG3 PRO A 473 15.800 16.536 40.881 1.00 0.00 H ATOM 7439 HG2 PRO A 473 16.736 15.404 39.878 1.00 0.00 H ATOM 7440 HB2 PRO A 473 17.864 15.227 41.905 1.00 0.00 H ATOM 7441 HB3 PRO A 473 17.586 16.934 42.320 1.00 0.00 H ATOM 7442 N LYS A 474 19.681 15.040 39.043 1.00 85.64 N ATOM 7443 CA LYS A 474 20.352 13.896 38.423 1.00 85.84 C ATOM 7444 C LYS A 474 21.808 14.209 38.084 1.00 85.99 C ATOM 7445 O LYS A 474 22.546 13.334 37.631 1.00 86.22 O ATOM 7446 CB LYS A 474 19.620 13.468 37.146 1.00 85.79 C ATOM 7447 CG LYS A 474 18.163 13.094 37.345 1.00 86.37 C ATOM 7448 CD LYS A 474 17.479 12.827 36.015 1.00 86.37 C ATOM 7449 CE LYS A 474 15.987 12.598 36.199 1.00 86.47 C ATOM 7450 NZ LYS A 474 15.287 12.412 34.896 1.00 86.40 N ATOM 7451 HA LYS A 474 20.332 13.083 39.149 1.00 0.00 H ATOM 7452 HB2 LYS A 474 19.665 14.294 36.436 1.00 0.00 H ATOM 7453 HB3 LYS A 474 20.139 12.604 36.730 1.00 0.00 H ATOM 7454 HG2 LYS A 474 18.107 12.196 37.961 1.00 0.00 H ATOM 7455 HG3 LYS A 474 17.651 13.913 37.851 1.00 0.00 H ATOM 7456 HD2 LYS A 474 17.629 13.685 35.359 1.00 0.00 H ATOM 7457 HD3 LYS A 474 17.921 11.941 35.559 1.00 0.00 H ATOM 7458 HE2 LYS A 474 15.558 13.460 36.709 1.00 0.00 H ATOM 7459 HE3 LYS A 474 15.840 11.706 36.809 1.00 0.00 H ATOM 7460 HZ1 LYS A 474 15.416 13.261 34.310 1.00 0.00 H ATOM 7461 HZ2 LYS A 474 15.685 11.586 34.405 1.00 0.00 H ATOM 7462 HZ3 LYS A 474 14.273 12.259 35.068 1.00 0.00 H ATOM 7463 H LYS A 474 19.040 15.617 38.461 1.00 0.00 H ATOM 7464 N ILE A 475 22.214 15.459 38.295 1.00 85.94 N ATOM 7465 CA ILE A 475 23.579 15.891 37.988 1.00 85.36 C ATOM 7466 C ILE A 475 24.309 16.356 39.254 1.00 84.92 C ATOM 7467 O ILE A 475 25.541 16.422 39.285 1.00 85.25 O ATOM 7468 CB ILE A 475 23.595 17.012 36.913 1.00 85.44 C ATOM 7469 CG1 ILE A 475 22.630 16.680 35.769 1.00 85.16 C ATOM 7470 CG2 ILE A 475 25.007 17.235 36.376 1.00 85.52 C ATOM 7471 CD1 ILE A 475 22.580 17.729 34.679 1.00 84.89 C ATOM 7472 HA ILE A 475 24.106 15.028 37.582 1.00 0.00 H ATOM 7473 HB ILE A 475 23.263 17.936 37.386 1.00 0.00 H ATOM 7474 HG12 ILE A 475 22.941 15.736 35.322 1.00 0.00 H ATOM 7475 HG13 ILE A 475 21.629 16.571 36.186 1.00 0.00 H ATOM 7476 HD11 ILE A 475 22.258 18.679 35.105 1.00 0.00 H ATOM 7477 HD12 ILE A 475 23.571 17.843 34.241 1.00 0.00 H ATOM 7478 HD13 ILE A 475 21.874 17.418 33.909 1.00 0.00 H ATOM 7479 HG21 ILE A 475 25.664 17.526 37.195 1.00 0.00 H ATOM 7480 HG22 ILE A 475 25.373 16.312 35.925 1.00 0.00 H ATOM 7481 HG23 ILE A 475 24.988 18.025 35.625 1.00 0.00 H ATOM 7482 H ILE A 475 21.543 16.148 38.689 1.00 0.00 H ATOM 7483 N MET A 476 23.548 16.673 40.298 1.00 83.81 N ATOM 7484 CA MET A 476 24.139 17.101 41.565 1.00 82.76 C ATOM 7485 C MET A 476 24.588 15.911 42.415 1.00 82.17 C ATOM 7486 O MET A 476 25.315 16.077 43.397 1.00 82.04 O ATOM 7487 CB MET A 476 23.166 17.981 42.355 1.00 82.93 C ATOM 7488 CG MET A 476 22.811 19.297 41.669 1.00 82.92 C ATOM 7489 SD MET A 476 24.247 20.294 41.209 1.00 82.51 S ATOM 7490 CE MET A 476 24.916 20.735 42.815 1.00 82.32 C ATOM 7491 HA MET A 476 25.024 17.689 41.322 1.00 0.00 H ATOM 7492 HB2 MET A 476 22.246 17.418 42.511 1.00 0.00 H ATOM 7493 HB3 MET A 476 23.619 18.210 43.320 1.00 0.00 H ATOM 7494 HG2 MET A 476 22.190 19.882 42.348 1.00 0.00 H ATOM 7495 HG3 MET A 476 22.246 19.071 40.765 1.00 0.00 H ATOM 7496 HE1 MET A 476 24.168 21.293 43.378 1.00 0.00 H ATOM 7497 HE2 MET A 476 25.179 19.828 43.359 1.00 0.00 H ATOM 7498 HE3 MET A 476 25.805 21.351 42.680 1.00 0.00 H ATOM 7499 H MET A 476 22.513 16.615 40.211 1.00 0.00 H ATOM 7500 N GLU A 477 24.153 14.714 42.029 1.00 81.06 N ATOM 7501 CA GLU A 477 24.503 13.495 42.746 1.00 79.39 C ATOM 7502 C GLU A 477 25.294 12.528 41.870 1.00 78.06 C ATOM 7503 O GLU A 477 26.094 11.735 42.374 1.00 78.07 O ATOM 7504 CB GLU A 477 23.241 12.775 43.226 1.00 80.15 C ATOM 7505 CG GLU A 477 22.225 13.630 43.960 1.00 80.89 C ATOM 7506 CD GLU A 477 20.929 12.872 44.237 1.00 81.50 C ATOM 7507 OE1 GLU A 477 20.987 11.640 44.456 1.00 81.72 O ATOM 7508 OE2 GLU A 477 19.852 13.508 44.237 1.00 81.63 O ATOM 7509 HA GLU A 477 25.119 13.796 43.594 1.00 0.00 H ATOM 7510 HB2 GLU A 477 22.748 12.347 42.353 1.00 0.00 H ATOM 7511 HB3 GLU A 477 23.549 11.973 43.897 1.00 0.00 H ATOM 7512 HG2 GLU A 477 22.655 13.950 44.909 1.00 0.00 H ATOM 7513 HG3 GLU A 477 21.997 14.506 43.352 1.00 0.00 H ATOM 7514 H GLU A 477 23.544 14.647 41.189 1.00 0.00 H ATOM 7515 N GLU A 478 25.071 12.600 40.560 1.00 75.88 N ATOM 7516 CA GLU A 478 25.589 11.591 39.636 1.00 73.72 C ATOM 7517 C GLU A 478 26.840 12.026 38.863 1.00 70.85 C ATOM 7518 O GLU A 478 26.950 11.761 37.665 1.00 71.02 O ATOM 7519 CB GLU A 478 24.484 11.192 38.645 1.00 75.31 C ATOM 7520 CG GLU A 478 24.373 9.696 38.358 1.00 76.83 C ATOM 7521 CD GLU A 478 23.497 8.965 39.373 1.00 77.53 C ATOM 7522 OE1 GLU A 478 22.378 9.449 39.656 1.00 77.53 O ATOM 7523 OE2 GLU A 478 23.925 7.903 39.881 1.00 77.55 O ATOM 7524 HA GLU A 478 25.894 10.744 40.250 1.00 0.00 H ATOM 7525 HB2 GLU A 478 23.530 11.529 39.050 1.00 0.00 H ATOM 7526 HB3 GLU A 478 24.677 11.703 37.702 1.00 0.00 H ATOM 7527 HG2 GLU A 478 23.943 9.562 37.365 1.00 0.00 H ATOM 7528 HG3 GLU A 478 25.372 9.261 38.382 1.00 0.00 H ATOM 7529 H GLU A 478 24.514 13.394 40.184 1.00 0.00 H ATOM 7530 N THR A 479 27.781 12.684 39.538 1.00 66.79 N ATOM 7531 CA THR A 479 29.020 13.127 38.879 1.00 62.36 C ATOM 7532 C THR A 479 30.304 12.741 39.628 1.00 58.34 C ATOM 7533 O THR A 479 30.310 12.592 40.853 1.00 58.16 O ATOM 7534 CB THR A 479 29.037 14.662 38.636 1.00 63.28 C ATOM 7535 OG1 THR A 479 28.657 15.348 39.835 1.00 63.48 O ATOM 7536 CG2 THR A 479 28.090 15.055 37.504 1.00 63.43 C ATOM 7537 HA THR A 479 29.014 12.595 37.927 1.00 0.00 H ATOM 7538 HB THR A 479 30.050 14.946 38.351 1.00 0.00 H ATOM 7539 HG1 THR A 479 28.670 16.325 39.673 1.00 0.00 H ATOM 7540 HG23 THR A 479 28.379 14.533 36.592 1.00 0.00 H ATOM 7541 HG21 THR A 479 27.070 14.780 37.773 1.00 0.00 H ATOM 7542 HG22 THR A 479 28.147 16.131 37.342 1.00 0.00 H ATOM 7543 H THR A 479 27.638 12.888 40.548 1.00 0.00 H ATOM 7544 N HIS A 480 31.385 12.586 38.867 1.00 52.09 N ATOM 7545 CA HIS A 480 32.716 12.341 39.407 1.00 46.62 C ATOM 7546 C HIS A 480 33.143 13.547 40.249 1.00 43.15 C ATOM 7547 O HIS A 480 32.755 14.673 39.955 1.00 42.97 O ATOM 7548 CB HIS A 480 33.685 12.131 38.243 1.00 46.17 C ATOM 7549 CG HIS A 480 35.024 11.597 38.645 1.00 46.18 C ATOM 7550 ND1 HIS A 480 36.152 12.386 38.708 1.00 45.94 N ATOM 7551 CD2 HIS A 480 35.419 10.350 38.994 1.00 46.47 C ATOM 7552 CE1 HIS A 480 37.183 11.650 39.083 1.00 46.05 C ATOM 7553 NE2 HIS A 480 36.765 10.410 39.262 1.00 46.94 N ATOM 7554 HA HIS A 480 32.717 11.453 40.039 1.00 0.00 H ATOM 7555 HB2 HIS A 480 33.232 11.427 37.544 1.00 0.00 H ATOM 7556 HB3 HIS A 480 33.835 13.089 37.746 1.00 0.00 H ATOM 7557 HD2 HIS A 480 34.787 9.464 39.052 1.00 0.00 H ATOM 7558 HE1 HIS A 480 38.204 12.005 39.221 1.00 0.00 H ATOM 7559 H HIS A 480 31.274 12.643 37.834 1.00 0.00 H ATOM 7560 N TRP A 481 33.939 13.320 41.289 1.00 39.18 N ATOM 7561 CA TRP A 481 34.349 14.405 42.191 1.00 34.61 C ATOM 7562 C TRP A 481 35.091 15.554 41.489 1.00 31.98 C ATOM 7563 O TRP A 481 35.104 16.686 41.981 1.00 30.61 O ATOM 7564 CB TRP A 481 35.218 13.860 43.330 1.00 33.38 C ATOM 7565 CG TRP A 481 36.534 13.284 42.893 1.00 33.57 C ATOM 7566 CD1 TRP A 481 36.786 11.983 42.570 1.00 33.50 C ATOM 7567 CD2 TRP A 481 37.785 13.982 42.743 1.00 34.37 C ATOM 7568 NE1 TRP A 481 38.103 11.826 42.226 1.00 32.89 N ATOM 7569 CE2 TRP A 481 38.741 13.035 42.322 1.00 33.63 C ATOM 7570 CE3 TRP A 481 38.185 15.312 42.918 1.00 34.16 C ATOM 7571 CZ2 TRP A 481 40.070 13.373 42.072 1.00 33.20 C ATOM 7572 CZ3 TRP A 481 39.508 15.645 42.674 1.00 34.14 C ATOM 7573 CH2 TRP A 481 40.435 14.677 42.253 1.00 33.69 C ATOM 7574 HA TRP A 481 33.422 14.822 42.585 1.00 0.00 H ATOM 7575 HB2 TRP A 481 35.418 14.675 44.025 1.00 0.00 H ATOM 7576 HB3 TRP A 481 34.657 13.077 43.841 1.00 0.00 H ATOM 7577 HE1 TRP A 481 38.548 10.931 41.938 1.00 0.00 H ATOM 7578 HD1 TRP A 481 36.046 11.183 42.584 1.00 0.00 H ATOM 7579 HZ2 TRP A 481 40.791 12.625 41.744 1.00 0.00 H ATOM 7580 HH2 TRP A 481 41.467 14.973 42.067 1.00 0.00 H ATOM 7581 HZ3 TRP A 481 39.835 16.676 42.811 1.00 0.00 H ATOM 7582 HE3 TRP A 481 37.471 16.070 43.240 1.00 0.00 H ATOM 7583 H TRP A 481 34.279 12.354 41.468 1.00 0.00 H ATOM 7584 N THR A 482 35.714 15.261 40.353 1.00 28.07 N ATOM 7585 CA THR A 482 36.490 16.275 39.629 1.00 26.67 C ATOM 7586 C THR A 482 35.649 17.455 39.126 1.00 25.26 C ATOM 7587 O THR A 482 36.205 18.506 38.810 1.00 27.11 O ATOM 7588 CB THR A 482 37.288 15.675 38.451 1.00 26.78 C ATOM 7589 OG1 THR A 482 36.416 14.894 37.631 1.00 26.54 O ATOM 7590 CG2 THR A 482 38.406 14.805 38.957 1.00 26.64 C ATOM 7591 HA THR A 482 37.187 16.661 40.373 1.00 0.00 H ATOM 7592 HB THR A 482 37.714 16.492 37.868 1.00 0.00 H ATOM 7593 HG1 THR A 482 36.025 14.162 38.171 1.00 0.00 H ATOM 7594 HG23 THR A 482 39.072 15.399 39.583 1.00 0.00 H ATOM 7595 HG21 THR A 482 37.990 13.985 39.543 1.00 0.00 H ATOM 7596 HG22 THR A 482 38.963 14.403 38.111 1.00 0.00 H ATOM 7597 H THR A 482 35.651 14.296 39.970 1.00 0.00 H ATOM 7598 N VAL A 483 34.326 17.299 39.048 1.00 21.15 N ATOM 7599 CA VAL A 483 33.494 18.443 38.681 1.00 23.77 C ATOM 7600 C VAL A 483 33.682 19.603 39.668 1.00 23.57 C ATOM 7601 O VAL A 483 33.537 20.768 39.296 1.00 23.18 O ATOM 7602 CB VAL A 483 31.993 18.086 38.543 1.00 23.67 C ATOM 7603 CG1 VAL A 483 31.798 17.058 37.427 1.00 23.99 C ATOM 7604 CG2 VAL A 483 31.419 17.584 39.874 1.00 25.49 C ATOM 7605 HA VAL A 483 33.834 18.758 37.694 1.00 0.00 H ATOM 7606 HB VAL A 483 31.444 18.989 38.276 1.00 0.00 H ATOM 7607 HG11 VAL A 483 32.156 17.474 36.485 1.00 0.00 H ATOM 7608 HG12 VAL A 483 32.361 16.155 37.664 1.00 0.00 H ATOM 7609 HG13 VAL A 483 30.739 16.815 37.340 1.00 0.00 H ATOM 7610 HG21 VAL A 483 31.962 16.693 40.189 1.00 0.00 H ATOM 7611 HG22 VAL A 483 31.524 18.362 40.630 1.00 0.00 H ATOM 7612 HG23 VAL A 483 30.364 17.342 39.745 1.00 0.00 H ATOM 7613 H VAL A 483 33.892 16.375 39.246 1.00 0.00 H ATOM 7614 N TRP A 484 34.021 19.285 40.918 1.00 23.46 N ATOM 7615 CA TRP A 484 34.225 20.310 41.943 1.00 24.38 C ATOM 7616 C TRP A 484 35.461 21.167 41.705 1.00 25.44 C ATOM 7617 O TRP A 484 35.548 22.288 42.205 1.00 26.02 O ATOM 7618 CB TRP A 484 34.269 19.676 43.339 1.00 26.91 C ATOM 7619 CG TRP A 484 32.926 19.263 43.763 1.00 27.11 C ATOM 7620 CD1 TRP A 484 32.432 17.989 43.832 1.00 28.20 C ATOM 7621 CD2 TRP A 484 31.862 20.130 44.157 1.00 27.53 C ATOM 7622 NE1 TRP A 484 31.122 18.015 44.262 1.00 27.76 N ATOM 7623 CE2 TRP A 484 30.751 19.318 44.467 1.00 27.81 C ATOM 7624 CE3 TRP A 484 31.742 21.514 44.281 1.00 28.78 C ATOM 7625 CZ2 TRP A 484 29.534 19.848 44.894 1.00 28.88 C ATOM 7626 CZ3 TRP A 484 30.529 22.042 44.709 1.00 29.36 C ATOM 7627 CH2 TRP A 484 29.443 21.207 45.009 1.00 28.87 C ATOM 7628 HA TRP A 484 33.369 20.982 41.878 1.00 0.00 H ATOM 7629 HB2 TRP A 484 34.922 18.803 43.316 1.00 0.00 H ATOM 7630 HB3 TRP A 484 34.662 20.403 44.050 1.00 0.00 H ATOM 7631 HE1 TRP A 484 30.516 17.183 44.407 1.00 0.00 H ATOM 7632 HD1 TRP A 484 32.991 17.087 43.584 1.00 0.00 H ATOM 7633 HZ2 TRP A 484 28.687 19.203 45.127 1.00 0.00 H ATOM 7634 HH2 TRP A 484 28.505 21.652 45.341 1.00 0.00 H ATOM 7635 HZ3 TRP A 484 30.421 23.122 44.813 1.00 0.00 H ATOM 7636 HE3 TRP A 484 32.582 22.168 44.047 1.00 0.00 H ATOM 7637 H TRP A 484 34.144 18.284 41.171 1.00 0.00 H ATOM 7638 N ILE A 485 36.425 20.643 40.954 1.00 24.61 N ATOM 7639 CA ILE A 485 37.592 21.449 40.578 1.00 24.51 C ATOM 7640 C ILE A 485 37.117 22.614 39.703 1.00 24.10 C ATOM 7641 O ILE A 485 37.489 23.772 39.917 1.00 23.16 O ATOM 7642 CB ILE A 485 38.620 20.611 39.806 1.00 23.71 C ATOM 7643 CG1 ILE A 485 38.953 19.333 40.593 1.00 23.54 C ATOM 7644 CG2 ILE A 485 39.868 21.426 39.509 1.00 22.14 C ATOM 7645 CD1 ILE A 485 39.730 18.302 39.785 1.00 24.92 C ATOM 7646 HA ILE A 485 38.074 21.820 41.483 1.00 0.00 H ATOM 7647 HB ILE A 485 38.190 20.318 38.848 1.00 0.00 H ATOM 7648 HG12 ILE A 485 39.549 19.609 41.463 1.00 0.00 H ATOM 7649 HG13 ILE A 485 38.019 18.879 40.924 1.00 0.00 H ATOM 7650 HD11 ILE A 485 39.142 18.005 38.916 1.00 0.00 H ATOM 7651 HD12 ILE A 485 40.674 18.737 39.456 1.00 0.00 H ATOM 7652 HD13 ILE A 485 39.928 17.429 40.407 1.00 0.00 H ATOM 7653 HG21 ILE A 485 39.599 22.294 38.907 1.00 0.00 H ATOM 7654 HG22 ILE A 485 40.316 21.757 40.446 1.00 0.00 H ATOM 7655 HG23 ILE A 485 40.581 20.810 38.961 1.00 0.00 H ATOM 7656 H ILE A 485 36.351 19.657 40.632 1.00 0.00 H ATOM 7657 N THR A 486 36.276 22.296 38.728 1.00 22.94 N ATOM 7658 CA THR A 486 35.769 23.305 37.808 1.00 24.29 C ATOM 7659 C THR A 486 34.804 24.253 38.522 1.00 23.11 C ATOM 7660 O THR A 486 34.926 25.473 38.407 1.00 23.65 O ATOM 7661 CB THR A 486 35.117 22.655 36.575 1.00 23.83 C ATOM 7662 OG1 THR A 486 36.098 21.847 35.912 1.00 25.21 O ATOM 7663 CG2 THR A 486 34.618 23.724 35.605 1.00 21.88 C ATOM 7664 HA THR A 486 36.613 23.897 37.453 1.00 0.00 H ATOM 7665 HB THR A 486 34.270 22.049 36.896 1.00 0.00 H ATOM 7666 HG1 THR A 486 36.421 21.146 36.532 1.00 0.00 H ATOM 7667 HG23 THR A 486 33.871 24.343 36.102 1.00 0.00 H ATOM 7668 HG21 THR A 486 35.456 24.346 35.289 1.00 0.00 H ATOM 7669 HG22 THR A 486 34.172 23.243 34.734 1.00 0.00 H ATOM 7670 H THR A 486 35.973 21.307 38.618 1.00 0.00 H ATOM 7671 N ARG A 487 33.855 23.689 39.262 1.00 22.53 N ATOM 7672 CA ARG A 487 32.945 24.501 40.067 1.00 21.71 C ATOM 7673 C ARG A 487 33.731 25.446 40.977 1.00 21.58 C ATOM 7674 O ARG A 487 33.473 26.640 41.003 1.00 22.05 O ATOM 7675 CB ARG A 487 32.006 23.616 40.874 1.00 21.94 C ATOM 7676 CG ARG A 487 31.042 22.830 40.000 1.00 23.37 C ATOM 7677 CD ARG A 487 30.270 21.820 40.800 1.00 24.47 C ATOM 7678 NE ARG A 487 29.419 20.992 39.947 1.00 26.24 N ATOM 7679 CZ ARG A 487 28.670 19.991 40.397 1.00 29.58 C ATOM 7680 NH1 ARG A 487 28.663 19.692 41.693 1.00 29.45 N ATOM 7681 NH2 ARG A 487 27.923 19.288 39.555 1.00 30.72 N ATOM 7682 HA ARG A 487 32.338 25.108 39.396 1.00 0.00 H ATOM 7683 HB2 ARG A 487 32.603 22.913 41.455 1.00 0.00 H ATOM 7684 HB3 ARG A 487 31.429 24.246 41.551 1.00 0.00 H ATOM 7685 HG2 ARG A 487 30.342 23.523 39.533 1.00 0.00 H ATOM 7686 HG3 ARG A 487 31.608 22.311 39.226 1.00 0.00 H ATOM 7687 HD2 ARG A 487 29.644 22.344 41.522 1.00 0.00 H ATOM 7688 HD3 ARG A 487 30.973 21.177 41.330 1.00 0.00 H ATOM 7689 HE ARG A 487 29.399 21.199 38.928 1.00 0.00 H ATOM 7690 HH12 ARG A 487 28.076 18.908 42.043 1.00 0.00 H ATOM 7691 HH11 ARG A 487 29.245 20.242 42.357 1.00 0.00 H ATOM 7692 HH22 ARG A 487 27.337 18.505 39.909 1.00 0.00 H ATOM 7693 HH21 ARG A 487 27.923 19.520 38.541 1.00 0.00 H ATOM 7694 H ARG A 487 33.758 22.654 39.268 1.00 0.00 H ATOM 7695 N PHE A 488 34.695 24.911 41.717 1.00 22.25 N ATOM 7696 CA PHE A 488 35.557 25.744 42.552 1.00 21.70 C ATOM 7697 C PHE A 488 36.173 26.881 41.739 1.00 22.62 C ATOM 7698 O PHE A 488 36.117 28.037 42.146 1.00 23.23 O ATOM 7699 CB PHE A 488 36.672 24.914 43.181 1.00 20.51 C ATOM 7700 CG PHE A 488 37.682 25.724 43.955 1.00 21.61 C ATOM 7701 CD1 PHE A 488 37.352 26.275 45.183 1.00 21.33 C ATOM 7702 CD2 PHE A 488 38.963 25.922 43.459 1.00 21.84 C ATOM 7703 CE1 PHE A 488 38.269 27.015 45.906 1.00 21.49 C ATOM 7704 CE2 PHE A 488 39.891 26.664 44.172 1.00 22.13 C ATOM 7705 CZ PHE A 488 39.540 27.212 45.409 1.00 22.86 C ATOM 7706 HA PHE A 488 34.936 26.166 43.342 1.00 0.00 H ATOM 7707 HB2 PHE A 488 36.220 24.191 43.860 1.00 0.00 H ATOM 7708 HB3 PHE A 488 37.195 24.384 42.385 1.00 0.00 H ATOM 7709 HD2 PHE A 488 39.242 25.489 42.498 1.00 0.00 H ATOM 7710 HE2 PHE A 488 40.892 26.820 43.769 1.00 0.00 H ATOM 7711 HZ PHE A 488 40.267 27.792 45.978 1.00 0.00 H ATOM 7712 HE1 PHE A 488 37.987 27.442 46.868 1.00 0.00 H ATOM 7713 HD1 PHE A 488 36.351 26.122 45.586 1.00 0.00 H ATOM 7714 H PHE A 488 34.839 23.881 41.702 1.00 0.00 H ATOM 7715 N TYR A 489 36.768 26.559 40.591 1.00 22.65 N ATOM 7716 CA TYR A 489 37.463 27.594 39.838 1.00 23.47 C ATOM 7717 C TYR A 489 36.536 28.690 39.296 1.00 22.43 C ATOM 7718 O TYR A 489 36.870 29.863 39.395 1.00 24.36 O ATOM 7719 CB TYR A 489 38.336 27.023 38.713 1.00 24.88 C ATOM 7720 CG TYR A 489 39.110 28.102 37.991 1.00 24.02 C ATOM 7721 CD1 TYR A 489 40.183 28.735 38.607 1.00 25.27 C ATOM 7722 CD2 TYR A 489 38.766 28.498 36.703 1.00 24.22 C ATOM 7723 CE1 TYR A 489 40.896 29.735 37.964 1.00 25.77 C ATOM 7724 CE2 TYR A 489 39.479 29.501 36.047 1.00 25.65 C ATOM 7725 CZ TYR A 489 40.541 30.111 36.682 1.00 26.18 C ATOM 7726 OH TYR A 489 41.257 31.103 36.049 1.00 26.83 O ATOM 7727 HA TYR A 489 38.120 28.067 40.568 1.00 0.00 H ATOM 7728 HB3 TYR A 489 37.695 26.510 37.996 1.00 0.00 H ATOM 7729 HB2 TYR A 489 39.041 26.311 39.142 1.00 0.00 H ATOM 7730 HD2 TYR A 489 37.927 28.018 36.199 1.00 0.00 H ATOM 7731 HE2 TYR A 489 39.199 29.802 35.037 1.00 0.00 H ATOM 7732 HE1 TYR A 489 41.732 30.222 38.466 1.00 0.00 H ATOM 7733 HD1 TYR A 489 40.470 28.439 39.616 1.00 0.00 H ATOM 7734 HH TYR A 489 41.655 30.742 35.218 1.00 0.00 H ATOM 7735 H TYR A 489 36.737 25.581 40.237 1.00 0.00 H ATOM 7736 N ILE A 490 35.387 28.322 38.737 1.00 19.83 N ATOM 7737 CA ILE A 490 34.514 29.342 38.151 1.00 21.56 C ATOM 7738 C ILE A 490 33.758 30.146 39.215 1.00 21.82 C ATOM 7739 O ILE A 490 33.371 31.282 38.976 1.00 23.12 O ATOM 7740 CB ILE A 490 33.570 28.783 37.060 1.00 19.84 C ATOM 7741 CG1 ILE A 490 32.516 27.843 37.650 1.00 21.46 C ATOM 7742 CG2 ILE A 490 34.377 28.076 35.961 1.00 20.30 C ATOM 7743 CD1 ILE A 490 31.703 27.116 36.584 1.00 19.74 C ATOM 7744 HA ILE A 490 35.178 30.040 37.642 1.00 0.00 H ATOM 7745 HB ILE A 490 33.041 29.627 36.616 1.00 0.00 H ATOM 7746 HG12 ILE A 490 33.020 27.101 38.269 1.00 0.00 H ATOM 7747 HG13 ILE A 490 31.835 28.428 38.268 1.00 0.00 H ATOM 7748 HD11 ILE A 490 31.185 27.847 35.962 1.00 0.00 H ATOM 7749 HD12 ILE A 490 32.371 26.518 35.964 1.00 0.00 H ATOM 7750 HD13 ILE A 490 30.973 26.465 37.066 1.00 0.00 H ATOM 7751 HG21 ILE A 490 35.066 28.786 35.504 1.00 0.00 H ATOM 7752 HG22 ILE A 490 34.940 27.252 36.399 1.00 0.00 H ATOM 7753 HG23 ILE A 490 33.695 27.690 35.203 1.00 0.00 H ATOM 7754 H ILE A 490 35.111 27.320 38.716 1.00 0.00 H ATOM 7755 N ILE A 491 33.553 29.560 40.389 1.00 21.81 N ATOM 7756 CA ILE A 491 33.031 30.334 41.512 1.00 20.84 C ATOM 7757 C ILE A 491 34.082 31.367 41.888 1.00 20.22 C ATOM 7758 O ILE A 491 33.762 32.522 42.149 1.00 23.47 O ATOM 7759 CB ILE A 491 32.628 29.435 42.709 1.00 21.12 C ATOM 7760 CG1 ILE A 491 31.430 28.574 42.311 1.00 20.86 C ATOM 7761 CG2 ILE A 491 32.268 30.283 43.939 1.00 23.03 C ATOM 7762 CD1 ILE A 491 31.045 27.497 43.341 1.00 22.76 C ATOM 7763 HA ILE A 491 32.109 30.837 41.219 1.00 0.00 H ATOM 7764 HB ILE A 491 33.475 28.800 42.968 1.00 0.00 H ATOM 7765 HG12 ILE A 491 30.572 29.230 42.168 1.00 0.00 H ATOM 7766 HG13 ILE A 491 31.666 28.076 41.370 1.00 0.00 H ATOM 7767 HD11 ILE A 491 31.886 26.820 43.489 1.00 0.00 H ATOM 7768 HD12 ILE A 491 30.791 27.975 44.287 1.00 0.00 H ATOM 7769 HD13 ILE A 491 30.186 26.936 42.974 1.00 0.00 H ATOM 7770 HG21 ILE A 491 33.129 30.885 44.228 1.00 0.00 H ATOM 7771 HG22 ILE A 491 31.431 30.937 43.695 1.00 0.00 H ATOM 7772 HG23 ILE A 491 31.989 29.626 44.763 1.00 0.00 H ATOM 7773 H ILE A 491 33.764 28.549 40.509 1.00 0.00 H ATOM 7774 N GLY A 492 35.344 30.951 41.900 1.00 21.41 N ATOM 7775 CA GLY A 492 36.452 31.875 42.114 1.00 21.27 C ATOM 7776 C GLY A 492 36.503 32.975 41.063 1.00 22.40 C ATOM 7777 O GLY A 492 36.864 34.120 41.372 1.00 23.01 O ATOM 7778 HA3 GLY A 492 37.386 31.315 42.080 1.00 0.00 H ATOM 7779 HA2 GLY A 492 36.340 32.334 43.096 1.00 0.00 H ATOM 7780 H GLY A 492 35.547 29.942 41.753 1.00 0.00 H ATOM 7781 N LEU A 493 36.159 32.646 39.816 1.00 20.52 N ATOM 7782 CA LEU A 493 36.085 33.681 38.780 1.00 21.17 C ATOM 7783 C LEU A 493 34.953 34.685 39.077 1.00 22.62 C ATOM 7784 O LEU A 493 35.103 35.890 38.864 1.00 20.61 O ATOM 7785 CB LEU A 493 35.902 33.070 37.384 1.00 22.74 C ATOM 7786 CG LEU A 493 37.123 32.432 36.718 1.00 22.30 C ATOM 7787 CD1 LEU A 493 36.733 31.868 35.360 1.00 23.07 C ATOM 7788 CD2 LEU A 493 38.266 33.448 36.570 1.00 23.39 C ATOM 7789 HA LEU A 493 37.034 34.216 38.792 1.00 0.00 H ATOM 7790 HB2 LEU A 493 35.135 32.299 37.464 1.00 0.00 H ATOM 7791 HB3 LEU A 493 35.550 33.864 36.725 1.00 0.00 H ATOM 7792 HG LEU A 493 37.479 31.621 37.353 1.00 0.00 H ATOM 7793 HD21 LEU A 493 37.930 34.284 35.956 1.00 0.00 H ATOM 7794 HD22 LEU A 493 38.556 33.813 37.555 1.00 0.00 H ATOM 7795 HD23 LEU A 493 39.120 32.966 36.094 1.00 0.00 H ATOM 7796 HD11 LEU A 493 35.957 31.113 35.491 1.00 0.00 H ATOM 7797 HD12 LEU A 493 36.356 32.673 34.728 1.00 0.00 H ATOM 7798 HD13 LEU A 493 37.607 31.415 34.891 1.00 0.00 H ATOM 7799 H LEU A 493 35.944 31.656 39.579 1.00 0.00 H ATOM 7800 N PHE A 494 33.818 34.192 39.560 1.00 23.59 N ATOM 7801 CA PHE A 494 32.710 35.088 39.904 1.00 24.54 C ATOM 7802 C PHE A 494 33.120 36.042 41.025 1.00 24.76 C ATOM 7803 O PHE A 494 32.822 37.235 40.978 1.00 24.95 O ATOM 7804 CB PHE A 494 31.476 34.301 40.324 1.00 24.58 C ATOM 7805 CG PHE A 494 30.251 35.157 40.510 1.00 25.47 C ATOM 7806 CD1 PHE A 494 29.311 35.269 39.498 1.00 24.43 C ATOM 7807 CD2 PHE A 494 30.045 35.855 41.690 1.00 25.95 C ATOM 7808 CE1 PHE A 494 28.186 36.061 39.663 1.00 26.17 C ATOM 7809 CE2 PHE A 494 28.923 36.648 41.863 1.00 26.10 C ATOM 7810 CZ PHE A 494 27.992 36.750 40.842 1.00 24.39 C ATOM 7811 HA PHE A 494 32.464 35.667 39.014 1.00 0.00 H ATOM 7812 HB2 PHE A 494 31.264 33.557 39.557 1.00 0.00 H ATOM 7813 HB3 PHE A 494 31.692 33.798 41.267 1.00 0.00 H ATOM 7814 HD2 PHE A 494 30.777 35.778 42.494 1.00 0.00 H ATOM 7815 HE2 PHE A 494 28.773 37.189 42.797 1.00 0.00 H ATOM 7816 HZ PHE A 494 27.107 37.374 40.970 1.00 0.00 H ATOM 7817 HE1 PHE A 494 27.453 36.140 38.860 1.00 0.00 H ATOM 7818 HD1 PHE A 494 29.458 34.729 38.563 1.00 0.00 H ATOM 7819 H PHE A 494 33.715 33.166 39.695 1.00 0.00 H ATOM 7820 N LEU A 495 33.812 35.508 42.027 1.00 25.67 N ATOM 7821 CA LEU A 495 34.292 36.313 43.144 1.00 27.49 C ATOM 7822 C LEU A 495 35.296 37.363 42.659 1.00 26.68 C ATOM 7823 O LEU A 495 35.289 38.507 43.114 1.00 26.60 O ATOM 7824 CB LEU A 495 34.929 35.426 44.217 1.00 28.55 C ATOM 7825 CG LEU A 495 35.553 36.214 45.381 1.00 32.31 C ATOM 7826 CD1 LEU A 495 34.472 36.947 46.197 1.00 32.59 C ATOM 7827 CD2 LEU A 495 36.418 35.329 46.286 1.00 33.47 C ATOM 7828 HA LEU A 495 33.437 36.827 43.584 1.00 0.00 H ATOM 7829 HB2 LEU A 495 34.160 34.767 44.620 1.00 0.00 H ATOM 7830 HB3 LEU A 495 35.710 34.827 43.749 1.00 0.00 H ATOM 7831 HG LEU A 495 36.214 36.960 44.939 1.00 0.00 H ATOM 7832 HD21 LEU A 495 35.804 34.533 46.707 1.00 0.00 H ATOM 7833 HD22 LEU A 495 37.228 34.894 45.700 1.00 0.00 H ATOM 7834 HD23 LEU A 495 36.835 35.933 47.092 1.00 0.00 H ATOM 7835 HD11 LEU A 495 33.940 37.644 45.549 1.00 0.00 H ATOM 7836 HD12 LEU A 495 33.770 36.219 46.604 1.00 0.00 H ATOM 7837 HD13 LEU A 495 34.944 37.495 47.013 1.00 0.00 H ATOM 7838 H LEU A 495 34.016 34.488 42.014 1.00 0.00 H ATOM 7839 N PHE A 496 36.155 36.955 41.734 1.00 25.59 N ATOM 7840 CA PHE A 496 37.148 37.841 41.130 1.00 26.79 C ATOM 7841 C PHE A 496 36.475 39.012 40.423 1.00 25.56 C ATOM 7842 O PHE A 496 36.888 40.160 40.576 1.00 22.74 O ATOM 7843 CB PHE A 496 38.021 37.044 40.151 1.00 26.92 C ATOM 7844 CG PHE A 496 38.832 37.891 39.207 1.00 27.89 C ATOM 7845 CD1 PHE A 496 39.829 38.729 39.679 1.00 28.10 C ATOM 7846 CD2 PHE A 496 38.613 37.821 37.835 1.00 26.97 C ATOM 7847 CE1 PHE A 496 40.581 39.505 38.803 1.00 28.47 C ATOM 7848 CE2 PHE A 496 39.362 38.589 36.957 1.00 27.34 C ATOM 7849 CZ PHE A 496 40.344 39.433 37.440 1.00 27.36 C ATOM 7850 HA PHE A 496 37.780 38.250 41.918 1.00 0.00 H ATOM 7851 HB2 PHE A 496 38.708 36.427 40.731 1.00 0.00 H ATOM 7852 HB3 PHE A 496 37.369 36.402 39.559 1.00 0.00 H ATOM 7853 HD2 PHE A 496 37.843 37.154 37.446 1.00 0.00 H ATOM 7854 HE2 PHE A 496 39.176 38.527 35.885 1.00 0.00 H ATOM 7855 HZ PHE A 496 40.930 40.040 36.750 1.00 0.00 H ATOM 7856 HE1 PHE A 496 41.355 40.168 39.188 1.00 0.00 H ATOM 7857 HD1 PHE A 496 40.027 38.781 40.750 1.00 0.00 H ATOM 7858 H PHE A 496 36.120 35.962 41.426 1.00 0.00 H ATOM 7859 N LEU A 497 35.433 38.710 39.656 1.00 25.06 N ATOM 7860 CA LEU A 497 34.720 39.730 38.893 1.00 24.53 C ATOM 7861 C LEU A 497 33.907 40.632 39.817 1.00 24.90 C ATOM 7862 O LEU A 497 33.785 41.836 39.576 1.00 23.94 O ATOM 7863 CB LEU A 497 33.830 39.078 37.825 1.00 24.13 C ATOM 7864 CG LEU A 497 34.615 38.407 36.688 1.00 23.75 C ATOM 7865 CD1 LEU A 497 33.767 37.416 35.928 1.00 23.87 C ATOM 7866 CD2 LEU A 497 35.216 39.443 35.731 1.00 23.68 C ATOM 7867 HA LEU A 497 35.453 40.356 38.384 1.00 0.00 H ATOM 7868 HB2 LEU A 497 33.211 38.322 38.308 1.00 0.00 H ATOM 7869 HB3 LEU A 497 33.191 39.848 37.393 1.00 0.00 H ATOM 7870 HG LEU A 497 35.434 37.859 37.154 1.00 0.00 H ATOM 7871 HD21 LEU A 497 34.415 40.039 35.293 1.00 0.00 H ATOM 7872 HD22 LEU A 497 35.895 40.094 36.282 1.00 0.00 H ATOM 7873 HD23 LEU A 497 35.764 38.930 34.940 1.00 0.00 H ATOM 7874 HD11 LEU A 497 33.420 36.639 36.609 1.00 0.00 H ATOM 7875 HD12 LEU A 497 32.909 37.931 35.495 1.00 0.00 H ATOM 7876 HD13 LEU A 497 34.361 36.965 35.133 1.00 0.00 H ATOM 7877 H LEU A 497 35.117 37.721 39.598 1.00 0.00 H ATOM 7878 N THR A 498 33.350 40.054 40.878 1.00 25.61 N ATOM 7879 CA THR A 498 32.638 40.853 41.875 1.00 25.35 C ATOM 7880 C THR A 498 33.602 41.873 42.484 1.00 25.72 C ATOM 7881 O THR A 498 33.256 43.050 42.646 1.00 28.28 O ATOM 7882 CB THR A 498 31.984 39.974 42.959 1.00 26.42 C ATOM 7883 OG1 THR A 498 31.003 39.124 42.344 1.00 24.38 O ATOM 7884 CG2 THR A 498 31.285 40.841 44.024 1.00 25.93 C ATOM 7885 HA THR A 498 31.823 41.382 41.381 1.00 0.00 H ATOM 7886 HB THR A 498 32.763 39.382 43.440 1.00 0.00 H ATOM 7887 HG1 THR A 498 31.443 38.549 41.668 1.00 0.00 H ATOM 7888 HG23 THR A 498 32.019 41.492 44.499 1.00 0.00 H ATOM 7889 HG21 THR A 498 30.514 41.447 43.548 1.00 0.00 H ATOM 7890 HG22 THR A 498 30.830 40.195 44.775 1.00 0.00 H ATOM 7891 H THR A 498 33.422 39.024 41.000 1.00 0.00 H ATOM 7892 N PHE A 499 34.813 41.426 42.793 1.00 23.53 N ATOM 7893 CA PHE A 499 35.831 42.302 43.353 1.00 25.75 C ATOM 7894 C PHE A 499 36.187 43.459 42.413 1.00 26.50 C ATOM 7895 O PHE A 499 36.408 44.572 42.877 1.00 25.31 O ATOM 7896 CB PHE A 499 37.088 41.504 43.732 1.00 24.94 C ATOM 7897 CG PHE A 499 38.158 42.328 44.399 1.00 25.76 C ATOM 7898 CD1 PHE A 499 37.880 43.057 45.544 1.00 25.31 C ATOM 7899 CD2 PHE A 499 39.449 42.366 43.885 1.00 26.03 C ATOM 7900 CE1 PHE A 499 38.867 43.815 46.162 1.00 25.18 C ATOM 7901 CE2 PHE A 499 40.434 43.114 44.498 1.00 26.65 C ATOM 7902 CZ PHE A 499 40.142 43.846 45.643 1.00 25.46 C ATOM 7903 HA PHE A 499 35.409 42.743 44.256 1.00 0.00 H ATOM 7904 HB2 PHE A 499 36.795 40.705 44.414 1.00 0.00 H ATOM 7905 HB3 PHE A 499 37.506 41.070 42.824 1.00 0.00 H ATOM 7906 HD2 PHE A 499 39.687 41.798 42.986 1.00 0.00 H ATOM 7907 HE2 PHE A 499 41.442 43.131 44.084 1.00 0.00 H ATOM 7908 HZ PHE A 499 40.917 44.440 46.127 1.00 0.00 H ATOM 7909 HE1 PHE A 499 38.631 44.386 47.060 1.00 0.00 H ATOM 7910 HD1 PHE A 499 36.875 43.036 45.965 1.00 0.00 H ATOM 7911 H PHE A 499 35.040 40.424 42.631 1.00 0.00 H ATOM 7912 N LEU A 500 36.243 43.194 41.105 1.00 25.66 N ATOM 7913 CA LEU A 500 36.543 44.241 40.124 1.00 26.16 C ATOM 7914 C LEU A 500 35.407 45.259 40.043 1.00 26.63 C ATOM 7915 O LEU A 500 35.652 46.453 39.904 1.00 26.72 O ATOM 7916 CB LEU A 500 36.801 43.653 38.729 1.00 26.70 C ATOM 7917 CG LEU A 500 38.022 42.752 38.520 1.00 27.52 C ATOM 7918 CD1 LEU A 500 38.305 42.587 37.033 1.00 29.79 C ATOM 7919 CD2 LEU A 500 39.245 43.308 39.211 1.00 28.19 C ATOM 7920 HA LEU A 500 37.450 44.742 40.464 1.00 0.00 H ATOM 7921 HB2 LEU A 500 35.921 43.068 38.460 1.00 0.00 H ATOM 7922 HB3 LEU A 500 36.901 44.493 38.041 1.00 0.00 H ATOM 7923 HG LEU A 500 37.795 41.780 38.959 1.00 0.00 H ATOM 7924 HD21 LEU A 500 39.471 44.295 38.808 1.00 0.00 H ATOM 7925 HD22 LEU A 500 39.052 43.386 40.281 1.00 0.00 H ATOM 7926 HD23 LEU A 500 40.091 42.642 39.041 1.00 0.00 H ATOM 7927 HD11 LEU A 500 37.440 42.135 36.548 1.00 0.00 H ATOM 7928 HD12 LEU A 500 38.502 43.564 36.591 1.00 0.00 H ATOM 7929 HD13 LEU A 500 39.175 41.944 36.899 1.00 0.00 H ATOM 7930 H LEU A 500 36.070 42.223 40.775 1.00 0.00 H ATOM 7931 N VAL A 501 34.167 44.779 40.115 1.00 24.97 N ATOM 7932 CA VAL A 501 33.004 45.656 40.135 1.00 25.95 C ATOM 7933 C VAL A 501 33.088 46.552 41.375 1.00 28.63 C ATOM 7934 O VAL A 501 32.818 47.758 41.311 1.00 29.12 O ATOM 7935 CB VAL A 501 31.682 44.839 40.097 1.00 26.74 C ATOM 7936 CG1 VAL A 501 30.472 45.721 40.388 1.00 26.88 C ATOM 7937 CG2 VAL A 501 31.528 44.156 38.748 1.00 24.46 C ATOM 7938 HA VAL A 501 33.001 46.283 39.244 1.00 0.00 H ATOM 7939 HB VAL A 501 31.733 44.080 40.877 1.00 0.00 H ATOM 7940 HG11 VAL A 501 30.577 46.164 41.378 1.00 0.00 H ATOM 7941 HG12 VAL A 501 30.412 46.511 39.640 1.00 0.00 H ATOM 7942 HG13 VAL A 501 29.566 45.116 40.353 1.00 0.00 H ATOM 7943 HG21 VAL A 501 31.506 44.910 37.961 1.00 0.00 H ATOM 7944 HG22 VAL A 501 32.370 43.483 38.585 1.00 0.00 H ATOM 7945 HG23 VAL A 501 30.598 43.587 38.734 1.00 0.00 H ATOM 7946 H VAL A 501 34.025 43.750 40.158 1.00 0.00 H ATOM 7947 N PHE A 502 33.485 45.955 42.495 1.00 29.21 N ATOM 7948 CA PHE A 502 33.732 46.688 43.726 1.00 30.28 C ATOM 7949 C PHE A 502 34.843 47.731 43.555 1.00 31.03 C ATOM 7950 O PHE A 502 34.721 48.849 44.037 1.00 29.30 O ATOM 7951 CB PHE A 502 34.087 45.722 44.868 1.00 30.60 C ATOM 7952 CG PHE A 502 34.621 46.407 46.094 1.00 31.03 C ATOM 7953 CD1 PHE A 502 33.764 46.797 47.117 1.00 31.68 C ATOM 7954 CD2 PHE A 502 35.981 46.667 46.224 1.00 31.05 C ATOM 7955 CE1 PHE A 502 34.253 47.432 48.245 1.00 31.90 C ATOM 7956 CE2 PHE A 502 36.477 47.302 47.346 1.00 31.73 C ATOM 7957 CZ PHE A 502 35.618 47.687 48.360 1.00 31.61 C ATOM 7958 HA PHE A 502 32.813 47.217 43.978 1.00 0.00 H ATOM 7959 HB2 PHE A 502 33.188 45.171 45.145 1.00 0.00 H ATOM 7960 HB3 PHE A 502 34.842 45.024 44.507 1.00 0.00 H ATOM 7961 HD2 PHE A 502 36.664 46.366 45.430 1.00 0.00 H ATOM 7962 HE2 PHE A 502 37.545 47.500 47.433 1.00 0.00 H ATOM 7963 HZ PHE A 502 36.008 48.188 49.246 1.00 0.00 H ATOM 7964 HE1 PHE A 502 33.572 47.732 49.042 1.00 0.00 H ATOM 7965 HD1 PHE A 502 32.695 46.600 47.030 1.00 0.00 H ATOM 7966 H PHE A 502 33.624 44.924 42.490 1.00 0.00 H ATOM 7967 N LEU A 503 35.928 47.365 42.877 1.00 31.65 N ATOM 7968 CA LEU A 503 37.023 48.307 42.653 1.00 31.34 C ATOM 7969 C LEU A 503 36.597 49.453 41.738 1.00 32.72 C ATOM 7970 O LEU A 503 37.078 50.585 41.879 1.00 34.14 O ATOM 7971 CB LEU A 503 38.252 47.604 42.067 1.00 31.01 C ATOM 7972 CG LEU A 503 39.091 46.723 42.999 1.00 30.76 C ATOM 7973 CD1 LEU A 503 40.298 46.143 42.245 1.00 29.37 C ATOM 7974 CD2 LEU A 503 39.548 47.487 44.235 1.00 28.44 C ATOM 7975 HA LEU A 503 37.288 48.721 43.626 1.00 0.00 H ATOM 7976 HB2 LEU A 503 37.905 46.972 41.249 1.00 0.00 H ATOM 7977 HB3 LEU A 503 38.911 48.378 41.672 1.00 0.00 H ATOM 7978 HG LEU A 503 38.459 45.902 43.337 1.00 0.00 H ATOM 7979 HD21 LEU A 503 40.154 48.340 43.930 1.00 0.00 H ATOM 7980 HD22 LEU A 503 38.676 47.838 44.787 1.00 0.00 H ATOM 7981 HD23 LEU A 503 40.140 46.828 44.870 1.00 0.00 H ATOM 7982 HD11 LEU A 503 39.946 45.541 41.407 1.00 0.00 H ATOM 7983 HD12 LEU A 503 40.918 46.958 41.873 1.00 0.00 H ATOM 7984 HD13 LEU A 503 40.883 45.520 42.922 1.00 0.00 H ATOM 7985 H LEU A 503 35.998 46.397 42.502 1.00 0.00 H ATOM 7986 N ALA A 504 35.698 49.153 40.802 1.00 32.38 N ATOM 7987 CA ALA A 504 35.191 50.147 39.859 1.00 33.18 C ATOM 7988 C ALA A 504 34.261 51.164 40.528 1.00 34.34 C ATOM 7989 O ALA A 504 34.308 52.349 40.204 1.00 34.02 O ATOM 7990 CB ALA A 504 34.491 49.473 38.695 1.00 29.94 C ATOM 7991 HA ALA A 504 36.053 50.698 39.483 1.00 0.00 H ATOM 7992 HB1 ALA A 504 35.195 48.822 38.177 1.00 0.00 H ATOM 7993 HB2 ALA A 504 33.655 48.882 39.068 1.00 0.00 H ATOM 7994 HB3 ALA A 504 34.122 50.232 38.006 1.00 0.00 H ATOM 7995 H ALA A 504 35.345 48.177 40.740 1.00 0.00 H ATOM 7996 N GLU A 505 33.418 50.704 41.451 1.00 37.69 N ATOM 7997 CA GLU A 505 32.544 51.618 42.189 1.00 41.33 C ATOM 7998 C GLU A 505 33.379 52.518 43.105 1.00 42.85 C ATOM 7999 O GLU A 505 33.057 53.692 43.275 1.00 44.29 O ATOM 8000 CB GLU A 505 31.406 50.889 42.941 1.00 42.01 C ATOM 8001 CG GLU A 505 31.820 49.712 43.816 1.00 45.41 C ATOM 8002 CD GLU A 505 30.652 49.050 44.577 1.00 46.76 C ATOM 8003 OE1 GLU A 505 29.488 49.140 44.125 1.00 47.66 O ATOM 8004 OE2 GLU A 505 30.907 48.427 45.634 1.00 46.47 O ATOM 8005 HA GLU A 505 32.036 52.253 41.463 1.00 0.00 H ATOM 8006 HB2 GLU A 505 30.909 51.619 43.580 1.00 0.00 H ATOM 8007 HB3 GLU A 505 30.700 50.518 42.197 1.00 0.00 H ATOM 8008 HG2 GLU A 505 32.285 48.959 43.180 1.00 0.00 H ATOM 8009 HG3 GLU A 505 32.547 50.067 44.546 1.00 0.00 H ATOM 8010 H GLU A 505 33.380 49.684 41.650 1.00 0.00 H ATOM 8011 N ARG A 506 34.457 51.977 43.668 1.00 44.19 N ATOM 8012 CA ARG A 506 35.379 52.774 44.480 1.00 46.99 C ATOM 8013 C ARG A 506 36.095 53.836 43.639 1.00 48.39 C ATOM 8014 O ARG A 506 36.300 54.964 44.096 1.00 48.58 O ATOM 8015 CB ARG A 506 36.425 51.886 45.161 1.00 48.01 C ATOM 8016 CG ARG A 506 35.885 50.843 46.133 1.00 50.34 C ATOM 8017 CD ARG A 506 35.548 51.432 47.492 1.00 52.01 C ATOM 8018 NE ARG A 506 34.144 51.811 47.667 1.00 54.37 N ATOM 8019 CZ ARG A 506 33.095 51.119 47.224 1.00 55.73 C ATOM 8020 NH1 ARG A 506 33.259 49.980 46.568 1.00 56.49 N ATOM 8021 NH2 ARG A 506 31.867 51.567 47.448 1.00 56.67 N ATOM 8022 HA ARG A 506 34.778 53.272 45.241 1.00 0.00 H ATOM 8023 HB2 ARG A 506 36.976 51.361 44.381 1.00 0.00 H ATOM 8024 HB3 ARG A 506 37.106 52.535 45.712 1.00 0.00 H ATOM 8025 HG2 ARG A 506 34.982 50.404 45.709 1.00 0.00 H ATOM 8026 HG3 ARG A 506 36.638 50.066 46.266 1.00 0.00 H ATOM 8027 HD2 ARG A 506 36.160 52.322 47.637 1.00 0.00 H ATOM 8028 HD3 ARG A 506 35.797 50.693 48.253 1.00 0.00 H ATOM 8029 HE ARG A 506 33.950 52.694 48.180 1.00 0.00 H ATOM 8030 HH12 ARG A 506 32.430 49.451 46.229 1.00 0.00 H ATOM 8031 HH11 ARG A 506 34.217 49.614 46.392 1.00 0.00 H ATOM 8032 HH22 ARG A 506 31.046 51.029 47.103 1.00 0.00 H ATOM 8033 HH21 ARG A 506 31.725 52.456 47.968 1.00 0.00 H ATOM 8034 H ARG A 506 34.649 50.965 43.528 1.00 0.00 H ATOM 8035 N ARG A 507 36.483 53.472 42.417 1.00 49.51 N ATOM 8036 CA ARG A 507 37.187 54.397 41.532 1.00 51.59 C ATOM 8037 C ARG A 507 36.268 55.542 41.151 1.00 52.91 C ATOM 8038 O ARG A 507 36.662 56.705 41.176 1.00 52.42 O ATOM 8039 CB ARG A 507 37.670 53.694 40.262 1.00 51.80 C ATOM 8040 CG ARG A 507 38.635 54.540 39.448 1.00 53.21 C ATOM 8041 CD ARG A 507 38.725 54.114 37.986 1.00 54.27 C ATOM 8042 NE ARG A 507 39.770 54.866 37.286 1.00 55.83 N ATOM 8043 CZ ARG A 507 39.621 56.102 36.807 1.00 56.67 C ATOM 8044 NH1 ARG A 507 38.461 56.741 36.943 1.00 56.48 N ATOM 8045 NH2 ARG A 507 40.632 56.702 36.187 1.00 56.22 N ATOM 8046 HA ARG A 507 38.057 54.778 42.068 1.00 0.00 H ATOM 8047 HB2 ARG A 507 38.172 52.769 40.546 1.00 0.00 H ATOM 8048 HB3 ARG A 507 36.804 53.461 39.643 1.00 0.00 H ATOM 8049 HG2 ARG A 507 38.303 55.578 39.487 1.00 0.00 H ATOM 8050 HG3 ARG A 507 39.626 54.460 39.894 1.00 0.00 H ATOM 8051 HD2 ARG A 507 37.767 54.298 37.501 1.00 0.00 H ATOM 8052 HD3 ARG A 507 38.957 53.050 37.938 1.00 0.00 H ATOM 8053 HE ARG A 507 40.692 54.404 37.153 1.00 0.00 H ATOM 8054 HH12 ARG A 507 38.351 57.705 36.567 1.00 0.00 H ATOM 8055 HH11 ARG A 507 37.665 56.277 37.425 1.00 0.00 H ATOM 8056 HH22 ARG A 507 40.515 57.666 35.814 1.00 0.00 H ATOM 8057 HH21 ARG A 507 41.540 56.208 36.075 1.00 0.00 H ATOM 8058 H ARG A 507 36.280 52.507 42.086 1.00 0.00 H ATOM 8059 N ARG A 508 35.038 55.185 40.798 1.00 55.11 N ATOM 8060 CA ARG A 508 34.001 56.133 40.427 1.00 57.78 C ATOM 8061 C ARG A 508 33.728 57.126 41.557 1.00 59.31 C ATOM 8062 O ARG A 508 33.514 58.315 41.315 1.00 58.73 O ATOM 8063 CB ARG A 508 32.719 55.372 40.077 1.00 58.81 C ATOM 8064 CG ARG A 508 31.548 56.247 39.704 1.00 60.40 C ATOM 8065 CD ARG A 508 30.247 55.524 39.959 1.00 62.13 C ATOM 8066 NE ARG A 508 29.114 56.444 39.943 1.00 64.28 N ATOM 8067 CZ ARG A 508 27.907 56.151 40.416 1.00 65.31 C ATOM 8068 NH1 ARG A 508 27.671 54.958 40.950 1.00 65.63 N ATOM 8069 NH2 ARG A 508 26.935 57.054 40.357 1.00 66.21 N ATOM 8070 HA ARG A 508 34.343 56.699 39.560 1.00 0.00 H ATOM 8071 HB2 ARG A 508 32.934 54.714 39.235 1.00 0.00 H ATOM 8072 HB3 ARG A 508 32.433 54.772 40.941 1.00 0.00 H ATOM 8073 HG2 ARG A 508 31.576 57.158 40.301 1.00 0.00 H ATOM 8074 HG3 ARG A 508 31.615 56.505 38.647 1.00 0.00 H ATOM 8075 HD2 ARG A 508 30.296 55.038 40.934 1.00 0.00 H ATOM 8076 HD3 ARG A 508 30.103 54.770 39.185 1.00 0.00 H ATOM 8077 HE ARG A 508 29.261 57.389 39.535 1.00 0.00 H ATOM 8078 HH12 ARG A 508 26.726 54.731 41.319 1.00 0.00 H ATOM 8079 HH11 ARG A 508 28.432 54.250 40.999 1.00 0.00 H ATOM 8080 HH22 ARG A 508 25.990 56.826 40.727 1.00 0.00 H ATOM 8081 HH21 ARG A 508 27.119 57.989 39.941 1.00 0.00 H ATOM 8082 H ARG A 508 34.804 54.172 40.787 1.00 0.00 H ATOM 8083 N ASN A 509 33.741 56.629 42.790 1.00 60.51 N ATOM 8084 CA ASN A 509 33.490 57.465 43.955 1.00 62.89 C ATOM 8085 C ASN A 509 34.618 58.463 44.219 1.00 64.72 C ATOM 8086 O ASN A 509 34.361 59.617 44.560 1.00 64.36 O ATOM 8087 CB ASN A 509 33.220 56.602 45.191 1.00 63.24 C ATOM 8088 CG ASN A 509 31.869 55.893 45.130 1.00 64.24 C ATOM 8089 OD1 ASN A 509 31.029 56.194 44.277 1.00 64.60 O ATOM 8090 ND2 ASN A 509 31.655 54.948 46.039 1.00 64.49 N ATOM 8091 HA ASN A 509 32.599 58.054 43.737 1.00 0.00 H ATOM 8092 HB2 ASN A 509 34.005 55.850 45.270 1.00 0.00 H ATOM 8093 HB3 ASN A 509 33.240 57.241 46.074 1.00 0.00 H ATOM 8094 HD22 ASN A 509 32.390 54.725 46.740 1.00 0.00 H ATOM 8095 HD21 ASN A 509 30.753 54.431 46.049 1.00 0.00 H ATOM 8096 H ASN A 509 33.936 55.616 42.926 1.00 0.00 H ATOM 8097 N HIS A 510 35.862 58.020 44.050 1.00 66.89 N ATOM 8098 CA HIS A 510 37.021 58.881 44.278 1.00 69.43 C ATOM 8099 C HIS A 510 37.152 59.955 43.196 1.00 70.63 C ATOM 8100 O HIS A 510 37.652 61.052 43.454 1.00 70.27 O ATOM 8101 CB HIS A 510 38.305 58.053 44.366 1.00 70.06 C ATOM 8102 CG HIS A 510 39.492 58.833 44.838 1.00 71.50 C ATOM 8103 ND1 HIS A 510 40.387 59.427 43.973 1.00 71.80 N ATOM 8104 CD2 HIS A 510 39.929 59.122 46.088 1.00 71.93 C ATOM 8105 CE1 HIS A 510 41.325 60.045 44.670 1.00 71.88 C ATOM 8106 NE2 HIS A 510 41.071 59.875 45.955 1.00 72.03 N ATOM 8107 HA HIS A 510 36.865 59.387 45.231 1.00 0.00 H ATOM 8108 HB2 HIS A 510 38.137 57.229 45.059 1.00 0.00 H ATOM 8109 HB3 HIS A 510 38.526 57.654 43.376 1.00 0.00 H ATOM 8110 HD2 HIS A 510 39.462 58.815 47.024 1.00 0.00 H ATOM 8111 HE1 HIS A 510 42.166 60.601 44.255 1.00 0.00 H ATOM 8112 H HIS A 510 36.013 57.036 43.748 1.00 0.00 H ATOM 8113 N GLU A 511 36.703 59.631 41.987 1.00 72.51 N ATOM 8114 CA GLU A 511 36.708 60.584 40.883 1.00 74.66 C ATOM 8115 C GLU A 511 35.639 61.647 41.089 1.00 76.01 C ATOM 8116 O GLU A 511 35.850 62.817 40.771 1.00 76.25 O ATOM 8117 CB GLU A 511 36.481 59.871 39.548 1.00 75.02 C ATOM 8118 CG GLU A 511 37.642 59.004 39.112 1.00 75.92 C ATOM 8119 CD GLU A 511 38.892 59.812 38.823 1.00 76.69 C ATOM 8120 OE1 GLU A 511 38.801 60.795 38.053 1.00 76.66 O ATOM 8121 OE2 GLU A 511 39.964 59.460 39.362 1.00 76.82 O ATOM 8122 HA GLU A 511 37.686 61.065 40.860 1.00 0.00 H ATOM 8123 HB2 GLU A 511 35.597 59.240 39.641 1.00 0.00 H ATOM 8124 HB3 GLU A 511 36.308 60.625 38.780 1.00 0.00 H ATOM 8125 HG2 GLU A 511 37.863 58.290 39.905 1.00 0.00 H ATOM 8126 HG3 GLU A 511 37.357 58.465 38.208 1.00 0.00 H ATOM 8127 H GLU A 511 36.338 58.671 41.824 1.00 0.00 H ATOM 8128 N SER A 512 34.494 61.226 41.624 1.00 77.28 N ATOM 8129 CA SER A 512 33.374 62.125 41.890 1.00 79.02 C ATOM 8130 C SER A 512 33.666 63.062 43.062 1.00 80.09 C ATOM 8131 O SER A 512 33.141 64.175 43.123 1.00 80.34 O ATOM 8132 CB SER A 512 32.095 61.327 42.162 1.00 78.81 C ATOM 8133 OG SER A 512 31.708 60.572 41.025 1.00 78.93 O ATOM 8134 HA SER A 512 33.230 62.737 40.999 1.00 0.00 H ATOM 8135 HB2 SER A 512 31.293 62.018 42.420 1.00 0.00 H ATOM 8136 HB3 SER A 512 32.270 60.648 42.997 1.00 0.00 H ATOM 8137 HG SER A 512 32.431 59.939 40.789 1.00 0.00 H ATOM 8138 H SER A 512 34.394 60.218 41.861 1.00 0.00 H ATOM 8139 N ALA A 513 34.502 62.601 43.988 1.00 81.38 N ATOM 8140 CA ALA A 513 34.892 63.399 45.143 1.00 82.70 C ATOM 8141 C ALA A 513 35.876 64.498 44.744 1.00 83.73 C ATOM 8142 O ALA A 513 35.806 65.618 45.249 1.00 84.21 O ATOM 8143 CB ALA A 513 35.490 62.511 46.224 1.00 82.83 C ATOM 8144 HA ALA A 513 33.998 63.878 45.542 1.00 0.00 H ATOM 8145 HB1 ALA A 513 34.751 61.772 46.535 1.00 0.00 H ATOM 8146 HB2 ALA A 513 36.370 62.003 45.829 1.00 0.00 H ATOM 8147 HB3 ALA A 513 35.776 63.124 47.079 1.00 0.00 H ATOM 8148 H ALA A 513 34.889 61.641 43.884 1.00 0.00 H ATOM 8149 N GLY A 514 36.788 64.174 43.831 1.00 84.65 N ATOM 8150 CA GLY A 514 37.775 65.138 43.355 1.00 85.69 C ATOM 8151 C GLY A 514 37.271 66.043 42.242 1.00 86.42 C ATOM 8152 O GLY A 514 38.066 66.609 41.490 1.00 86.71 O ATOM 8153 HA3 GLY A 514 38.640 64.588 42.984 1.00 0.00 H ATOM 8154 HA2 GLY A 514 38.076 65.763 44.195 1.00 0.00 H ATOM 8155 H GLY A 514 36.798 63.208 43.446 1.00 0.00 H ATOM 8156 N THR A 515 35.951 66.178 42.131 1.00 87.01 N ATOM 8157 CA THR A 515 35.338 67.054 41.130 1.00 87.65 C ATOM 8158 C THR A 515 34.212 67.903 41.726 1.00 88.10 C ATOM 8159 O THR A 515 33.776 68.882 41.119 1.00 88.35 O ATOM 8160 CB THR A 515 34.782 66.263 39.923 1.00 87.50 C ATOM 8161 OG1 THR A 515 33.949 65.196 40.392 1.00 87.64 O ATOM 8162 CG2 THR A 515 35.914 65.689 39.076 1.00 87.59 C ATOM 8163 HA THR A 515 36.137 67.710 40.785 1.00 0.00 H ATOM 8164 HB THR A 515 34.200 66.946 39.304 1.00 0.00 H ATOM 8165 HG1 THR A 515 34.482 64.591 40.966 1.00 0.00 H ATOM 8166 HG23 THR A 515 36.547 66.501 38.720 1.00 0.00 H ATOM 8167 HG21 THR A 515 36.507 65.003 39.681 1.00 0.00 H ATOM 8168 HG22 THR A 515 35.494 65.154 38.224 1.00 0.00 H ATOM 8169 H THR A 515 35.335 65.644 42.776 1.00 0.00 H TER 8170 THR A 515 ATOM 8171 N ARG B 5 49.584 57.587 58.297 1.00 46.13 N ATOM 8172 CA ARG B 5 49.745 56.106 58.395 1.00 45.18 C ATOM 8173 C ARG B 5 49.693 55.671 59.844 1.00 44.26 C ATOM 8174 O ARG B 5 50.157 56.390 60.727 1.00 43.77 O ATOM 8175 CB ARG B 5 51.080 55.674 57.783 1.00 44.99 C ATOM 8176 CG ARG B 5 51.264 54.163 57.645 1.00 44.58 C ATOM 8177 CD ARG B 5 52.559 53.846 56.900 1.00 44.05 C ATOM 8178 NE ARG B 5 52.748 52.415 56.669 1.00 42.03 N ATOM 8179 CZ ARG B 5 52.166 51.732 55.687 1.00 40.80 C ATOM 8180 NH1 ARG B 5 52.401 50.436 55.553 1.00 40.08 N ATOM 8181 NH2 ARG B 5 51.352 52.342 54.840 1.00 39.89 N ATOM 8182 HA ARG B 5 48.930 55.634 57.846 1.00 0.00 H ATOM 8183 HB2 ARG B 5 51.157 56.117 56.790 1.00 0.00 H ATOM 8184 HB3 ARG B 5 51.882 56.057 58.414 1.00 0.00 H ATOM 8185 HG2 ARG B 5 51.302 53.714 58.638 1.00 0.00 H ATOM 8186 HG3 ARG B 5 50.421 53.748 57.092 1.00 0.00 H ATOM 8187 HD2 ARG B 5 53.398 54.217 57.488 1.00 0.00 H ATOM 8188 HD3 ARG B 5 52.539 54.354 55.936 1.00 0.00 H ATOM 8189 HE ARG B 5 53.378 51.897 57.314 1.00 0.00 H ATOM 8190 HH12 ARG B 5 51.946 49.902 54.785 1.00 0.00 H ATOM 8191 HH11 ARG B 5 53.040 49.952 56.215 1.00 0.00 H ATOM 8192 HH22 ARG B 5 50.900 51.803 54.074 1.00 0.00 H ATOM 8193 HH21 ARG B 5 51.165 53.360 54.940 1.00 0.00 H ATOM 8194 HN3 ARG B 5 50.352 58.053 58.821 1.00 0.00 H ATOM 8195 HN2 ARG B 5 48.667 57.862 58.704 1.00 0.00 H ATOM 8196 HN1 ARG B 5 49.621 57.873 57.298 1.00 0.00 H ATOM 8197 N GLU B 6 49.123 54.492 60.086 1.00 43.56 N ATOM 8198 CA GLU B 6 49.081 53.914 61.422 1.00 42.64 C ATOM 8199 C GLU B 6 50.481 53.577 61.889 1.00 41.18 C ATOM 8200 O GLU B 6 51.355 53.260 61.087 1.00 40.72 O ATOM 8201 CB GLU B 6 48.218 52.646 61.441 1.00 43.77 C ATOM 8202 CG GLU B 6 46.730 52.902 61.270 1.00 44.44 C ATOM 8203 HA GLU B 6 48.640 54.650 62.095 1.00 0.00 H ATOM 8204 HB2 GLU B 6 48.548 51.995 60.631 1.00 0.00 H ATOM 8205 HB3 GLU B 6 48.371 52.142 62.396 1.00 0.00 H ATOM 8206 HG2 GLU B 6 46.377 53.542 62.079 1.00 0.00 H ATOM 8207 HG3 GLU B 6 46.555 53.394 60.313 1.00 0.00 H ATOM 8208 H GLU B 6 48.695 53.968 59.296 1.00 0.00 H ATOM 8209 N HIS B 7 50.691 53.654 63.197 1.00 40.96 N ATOM 8210 CA HIS B 7 51.972 53.315 63.791 1.00 40.65 C ATOM 8211 C HIS B 7 51.743 52.483 65.035 1.00 40.34 C ATOM 8212 O HIS B 7 50.651 52.493 65.600 1.00 39.67 O ATOM 8213 CB HIS B 7 52.772 54.578 64.139 1.00 41.95 C ATOM 8214 CG HIS B 7 53.219 55.359 62.944 1.00 42.45 C ATOM 8215 ND1 HIS B 7 52.547 56.472 62.486 1.00 43.58 N ATOM 8216 CD2 HIS B 7 54.270 55.184 62.108 1.00 42.41 C ATOM 8217 CE1 HIS B 7 53.167 56.952 61.422 1.00 42.81 C ATOM 8218 NE2 HIS B 7 54.214 56.186 61.169 1.00 43.27 N ATOM 8219 HA HIS B 7 52.552 52.742 63.068 1.00 0.00 H ATOM 8220 HB2 HIS B 7 52.146 55.222 64.756 1.00 0.00 H ATOM 8221 HB3 HIS B 7 53.655 54.281 64.705 1.00 0.00 H ATOM 8222 HD2 HIS B 7 55.020 54.396 62.169 1.00 0.00 H ATOM 8223 HE1 HIS B 7 52.866 57.830 60.850 1.00 0.00 H ATOM 8224 H HIS B 7 49.915 53.966 63.815 1.00 0.00 H ATOM 8225 N TRP B 8 52.770 51.749 65.450 1.00 39.56 N ATOM 8226 CA TRP B 8 52.719 51.018 66.698 1.00 39.94 C ATOM 8227 C TRP B 8 52.725 52.047 67.823 1.00 40.93 C ATOM 8228 O TRP B 8 53.545 52.964 67.823 1.00 42.05 O ATOM 8229 CB TRP B 8 53.925 50.085 66.817 1.00 39.21 C ATOM 8230 CG TRP B 8 54.029 49.090 65.694 1.00 39.46 C ATOM 8231 CD1 TRP B 8 54.888 49.136 64.629 1.00 39.22 C ATOM 8232 CD2 TRP B 8 53.240 47.907 65.522 1.00 38.77 C ATOM 8233 NE1 TRP B 8 54.682 48.052 63.809 1.00 40.04 N ATOM 8234 CE2 TRP B 8 53.678 47.280 64.335 1.00 39.84 C ATOM 8235 CE3 TRP B 8 52.209 47.314 66.257 1.00 38.53 C ATOM 8236 CZ2 TRP B 8 53.118 46.085 63.865 1.00 39.01 C ATOM 8237 CZ3 TRP B 8 51.651 46.126 65.787 1.00 39.96 C ATOM 8238 CH2 TRP B 8 52.112 45.527 64.600 1.00 38.49 C ATOM 8239 HA TRP B 8 51.822 50.400 66.749 1.00 0.00 H ATOM 8240 HB2 TRP B 8 54.831 50.691 66.826 1.00 0.00 H ATOM 8241 HB3 TRP B 8 53.847 49.538 67.756 1.00 0.00 H ATOM 8242 HE1 TRP B 8 55.203 47.850 62.932 1.00 0.00 H ATOM 8243 HD1 TRP B 8 55.627 49.918 64.456 1.00 0.00 H ATOM 8244 HZ2 TRP B 8 53.473 45.618 62.946 1.00 0.00 H ATOM 8245 HH2 TRP B 8 51.656 44.597 64.260 1.00 0.00 H ATOM 8246 HZ3 TRP B 8 50.845 45.654 66.348 1.00 0.00 H ATOM 8247 HE3 TRP B 8 51.849 47.771 67.179 1.00 0.00 H ATOM 8248 H TRP B 8 53.629 51.699 64.866 1.00 0.00 H ATOM 8249 N ALA B 9 51.818 51.898 68.778 1.00 41.12 N ATOM 8250 CA ALA B 9 51.684 52.878 69.856 1.00 42.07 C ATOM 8251 C ALA B 9 52.859 52.869 70.831 1.00 42.19 C ATOM 8252 O ALA B 9 53.391 53.918 71.172 1.00 42.04 O ATOM 8253 CB ALA B 9 50.364 52.685 70.600 1.00 42.60 C ATOM 8254 HA ALA B 9 51.688 53.859 69.381 1.00 0.00 H ATOM 8255 HB1 ALA B 9 49.534 52.810 69.904 1.00 0.00 H ATOM 8256 HB2 ALA B 9 50.333 51.683 71.028 1.00 0.00 H ATOM 8257 HB3 ALA B 9 50.286 53.425 71.397 1.00 0.00 H ATOM 8258 H ALA B 9 51.190 51.069 68.761 1.00 0.00 H ATOM 8259 N THR B 10 53.264 51.682 71.270 1.00 42.97 N ATOM 8260 CA THR B 10 54.361 51.554 72.222 1.00 43.20 C ATOM 8261 C THR B 10 55.450 50.626 71.716 1.00 44.12 C ATOM 8262 O THR B 10 55.222 49.808 70.817 1.00 44.25 O ATOM 8263 CB THR B 10 53.868 51.027 73.594 1.00 44.03 C ATOM 8264 OG1 THR B 10 53.376 49.688 73.451 1.00 44.82 O ATOM 8265 CG2 THR B 10 52.764 51.911 74.153 1.00 42.79 C ATOM 8266 HA THR B 10 54.771 52.557 72.340 1.00 0.00 H ATOM 8267 HB THR B 10 54.710 51.041 74.286 1.00 0.00 H ATOM 8268 HG1 THR B 10 52.624 49.681 72.807 1.00 0.00 H ATOM 8269 HG23 THR B 10 53.136 52.930 74.262 1.00 0.00 H ATOM 8270 HG21 THR B 10 51.914 51.905 73.470 1.00 0.00 H ATOM 8271 HG22 THR B 10 52.453 51.530 75.126 1.00 0.00 H ATOM 8272 H THR B 10 52.787 50.824 70.926 1.00 0.00 H ATOM 8273 N ARG B 11 56.636 50.753 72.299 1.00 43.87 N ATOM 8274 CA ARG B 11 57.757 49.901 71.942 1.00 44.19 C ATOM 8275 C ARG B 11 57.519 48.454 72.374 1.00 44.10 C ATOM 8276 O ARG B 11 57.891 47.523 71.654 1.00 41.79 O ATOM 8277 CB ARG B 11 59.048 50.433 72.552 1.00 46.45 C ATOM 8278 CG ARG B 11 60.304 49.818 71.959 1.00 48.90 C ATOM 8279 CD ARG B 11 61.520 50.659 72.291 1.00 52.81 C ATOM 8280 NE ARG B 11 61.434 51.995 71.697 1.00 54.49 N ATOM 8281 CZ ARG B 11 62.106 52.376 70.615 1.00 55.90 C ATOM 8282 NH1 ARG B 11 62.925 51.530 70.005 1.00 57.23 N ATOM 8283 NH2 ARG B 11 61.967 53.606 70.139 1.00 57.29 N ATOM 8284 HA ARG B 11 57.851 49.914 70.856 1.00 0.00 H ATOM 8285 HB2 ARG B 11 59.085 51.511 72.394 1.00 0.00 H ATOM 8286 HB3 ARG B 11 59.035 50.224 73.622 1.00 0.00 H ATOM 8287 HG2 ARG B 11 60.439 48.816 72.367 1.00 0.00 H ATOM 8288 HG3 ARG B 11 60.196 49.757 70.876 1.00 0.00 H ATOM 8289 HD2 ARG B 11 62.410 50.159 71.909 1.00 0.00 H ATOM 8290 HD3 ARG B 11 61.596 50.758 73.374 1.00 0.00 H ATOM 8291 HE ARG B 11 60.807 52.690 72.151 1.00 0.00 H ATOM 8292 HH12 ARG B 11 63.449 51.832 69.159 1.00 0.00 H ATOM 8293 HH11 ARG B 11 63.043 50.564 70.373 1.00 0.00 H ATOM 8294 HH22 ARG B 11 62.495 53.899 69.292 1.00 0.00 H ATOM 8295 HH21 ARG B 11 61.330 54.278 70.612 1.00 0.00 H ATOM 8296 H ARG B 11 56.766 51.481 73.030 1.00 0.00 H ATOM 8297 N LEU B 12 56.903 48.272 73.543 1.00 42.40 N ATOM 8298 CA LEU B 12 56.584 46.939 74.044 1.00 43.07 C ATOM 8299 C LEU B 12 55.590 46.278 73.106 1.00 42.61 C ATOM 8300 O LEU B 12 55.783 45.136 72.694 1.00 43.31 O ATOM 8301 CB LEU B 12 55.995 46.995 75.454 1.00 42.46 C ATOM 8302 CG LEU B 12 55.468 45.659 75.999 1.00 42.57 C ATOM 8303 CD1 LEU B 12 56.621 44.733 76.403 1.00 42.90 C ATOM 8304 CD2 LEU B 12 54.526 45.878 77.169 1.00 41.20 C ATOM 8305 HA LEU B 12 57.507 46.361 74.088 1.00 0.00 H ATOM 8306 HB2 LEU B 12 56.772 47.352 76.130 1.00 0.00 H ATOM 8307 HB3 LEU B 12 55.168 47.705 75.446 1.00 0.00 H ATOM 8308 HG LEU B 12 54.909 45.176 75.198 1.00 0.00 H ATOM 8309 HD21 LEU B 12 55.056 46.396 77.968 1.00 0.00 H ATOM 8310 HD22 LEU B 12 53.678 46.481 76.843 1.00 0.00 H ATOM 8311 HD23 LEU B 12 54.170 44.914 77.533 1.00 0.00 H ATOM 8312 HD11 LEU B 12 57.246 44.532 75.533 1.00 0.00 H ATOM 8313 HD12 LEU B 12 57.218 45.215 77.178 1.00 0.00 H ATOM 8314 HD13 LEU B 12 56.216 43.796 76.785 1.00 0.00 H ATOM 8315 H LEU B 12 56.643 49.102 74.113 1.00 0.00 H ATOM 8316 N GLY B 13 54.528 47.004 72.778 1.00 41.04 N ATOM 8317 CA GLY B 13 53.526 46.521 71.841 1.00 41.27 C ATOM 8318 C GLY B 13 54.136 46.124 70.510 1.00 41.35 C ATOM 8319 O GLY B 13 53.725 45.133 69.915 1.00 42.42 O ATOM 8320 HA3 GLY B 13 52.793 47.310 71.671 1.00 0.00 H ATOM 8321 HA2 GLY B 13 53.029 45.653 72.274 1.00 0.00 H ATOM 8322 H GLY B 13 54.409 47.946 73.203 1.00 0.00 H ATOM 8323 N LEU B 14 55.115 46.901 70.047 1.00 40.82 N ATOM 8324 CA LEU B 14 55.840 46.599 68.819 1.00 40.29 C ATOM 8325 C LEU B 14 56.562 45.262 68.941 1.00 41.01 C ATOM 8326 O LEU B 14 56.438 44.403 68.061 1.00 39.65 O ATOM 8327 CB LEU B 14 56.859 47.699 68.487 1.00 38.84 C ATOM 8328 CG LEU B 14 57.919 47.390 67.406 1.00 38.75 C ATOM 8329 CD1 LEU B 14 57.281 47.007 66.062 1.00 37.25 C ATOM 8330 CD2 LEU B 14 58.916 48.542 67.218 1.00 36.96 C ATOM 8331 HA LEU B 14 55.109 46.546 68.012 1.00 0.00 H ATOM 8332 HB2 LEU B 14 56.299 48.573 68.154 1.00 0.00 H ATOM 8333 HB3 LEU B 14 57.392 47.939 69.407 1.00 0.00 H ATOM 8334 HG LEU B 14 58.475 46.527 67.772 1.00 0.00 H ATOM 8335 HD21 LEU B 14 58.378 49.441 66.916 1.00 0.00 H ATOM 8336 HD22 LEU B 14 59.437 48.727 68.158 1.00 0.00 H ATOM 8337 HD23 LEU B 14 59.639 48.273 66.448 1.00 0.00 H ATOM 8338 HD11 LEU B 14 56.662 46.119 66.195 1.00 0.00 H ATOM 8339 HD12 LEU B 14 56.664 47.832 65.706 1.00 0.00 H ATOM 8340 HD13 LEU B 14 58.066 46.799 65.335 1.00 0.00 H ATOM 8341 H LEU B 14 55.371 47.755 70.582 1.00 0.00 H ATOM 8342 N ILE B 15 57.316 45.108 70.031 1.00 41.27 N ATOM 8343 CA ILE B 15 58.114 43.910 70.275 1.00 41.20 C ATOM 8344 C ILE B 15 57.248 42.660 70.409 1.00 39.75 C ATOM 8345 O ILE B 15 57.532 41.638 69.785 1.00 39.98 O ATOM 8346 CB ILE B 15 58.980 44.044 71.543 1.00 42.11 C ATOM 8347 CG1 ILE B 15 59.914 45.253 71.444 1.00 43.11 C ATOM 8348 CG2 ILE B 15 59.791 42.781 71.772 1.00 41.91 C ATOM 8349 CD1 ILE B 15 61.057 45.074 70.495 1.00 43.05 C ATOM 8350 HA ILE B 15 58.761 43.806 69.404 1.00 0.00 H ATOM 8351 HB ILE B 15 58.310 44.192 72.390 1.00 0.00 H ATOM 8352 HG12 ILE B 15 59.328 46.111 71.115 1.00 0.00 H ATOM 8353 HG13 ILE B 15 60.321 45.452 72.435 1.00 0.00 H ATOM 8354 HD11 ILE B 15 61.664 44.227 70.815 1.00 0.00 H ATOM 8355 HD12 ILE B 15 60.670 44.887 69.493 1.00 0.00 H ATOM 8356 HD13 ILE B 15 61.666 45.978 70.488 1.00 0.00 H ATOM 8357 HG21 ILE B 15 59.116 41.934 71.893 1.00 0.00 H ATOM 8358 HG22 ILE B 15 60.442 42.609 70.915 1.00 0.00 H ATOM 8359 HG23 ILE B 15 60.395 42.897 72.672 1.00 0.00 H ATOM 8360 H ILE B 15 57.336 45.873 70.736 1.00 0.00 H ATOM 8361 N LEU B 16 56.199 42.750 71.219 1.00 37.57 N ATOM 8362 CA LEU B 16 55.300 41.621 71.445 1.00 36.38 C ATOM 8363 C LEU B 16 54.507 41.248 70.189 1.00 36.20 C ATOM 8364 O LEU B 16 54.191 40.075 69.975 1.00 35.55 O ATOM 8365 CB LEU B 16 54.349 41.899 72.615 1.00 35.54 C ATOM 8366 CG LEU B 16 54.980 42.059 74.005 1.00 36.36 C ATOM 8367 CD1 LEU B 16 53.892 42.160 75.070 1.00 34.90 C ATOM 8368 CD2 LEU B 16 55.947 40.917 74.334 1.00 35.40 C ATOM 8369 HA LEU B 16 55.928 40.767 71.699 1.00 0.00 H ATOM 8370 HB2 LEU B 16 53.811 42.820 72.390 1.00 0.00 H ATOM 8371 HB3 LEU B 16 53.642 41.071 72.668 1.00 0.00 H ATOM 8372 HG LEU B 16 55.561 42.981 73.997 1.00 0.00 H ATOM 8373 HD21 LEU B 16 55.409 39.969 74.312 1.00 0.00 H ATOM 8374 HD22 LEU B 16 56.749 40.898 73.596 1.00 0.00 H ATOM 8375 HD23 LEU B 16 56.368 41.074 75.327 1.00 0.00 H ATOM 8376 HD11 LEU B 16 53.261 43.024 74.862 1.00 0.00 H ATOM 8377 HD12 LEU B 16 53.286 41.254 75.055 1.00 0.00 H ATOM 8378 HD13 LEU B 16 54.355 42.273 76.051 1.00 0.00 H ATOM 8379 H LEU B 16 56.012 43.650 71.706 1.00 0.00 H ATOM 8380 N ALA B 17 54.181 42.249 69.373 1.00 34.53 N ATOM 8381 CA ALA B 17 53.478 42.014 68.112 1.00 34.81 C ATOM 8382 C ALA B 17 54.391 41.293 67.135 1.00 32.76 C ATOM 8383 O ALA B 17 53.956 40.381 66.436 1.00 33.76 O ATOM 8384 CB ALA B 17 52.993 43.316 67.511 1.00 33.78 C ATOM 8385 HA ALA B 17 52.608 41.390 68.315 1.00 0.00 H ATOM 8386 HB1 ALA B 17 52.311 43.804 68.207 1.00 0.00 H ATOM 8387 HB2 ALA B 17 53.846 43.967 67.320 1.00 0.00 H ATOM 8388 HB3 ALA B 17 52.474 43.111 66.575 1.00 0.00 H ATOM 8389 H ALA B 17 54.433 43.222 69.639 1.00 0.00 H ATOM 8390 N MET B 18 55.651 41.712 67.097 1.00 31.49 N ATOM 8391 CA MET B 18 56.658 41.094 66.240 1.00 31.84 C ATOM 8392 C MET B 18 57.062 39.714 66.760 1.00 32.78 C ATOM 8393 O MET B 18 57.419 38.816 65.978 1.00 32.82 O ATOM 8394 CB MET B 18 57.886 41.996 66.129 1.00 32.16 C ATOM 8395 CG MET B 18 57.715 43.181 65.210 1.00 33.03 C ATOM 8396 SD MET B 18 58.039 42.748 63.480 1.00 35.19 S ATOM 8397 CE MET B 18 58.224 44.383 62.767 1.00 33.76 C ATOM 8398 HA MET B 18 56.220 40.965 65.250 1.00 0.00 H ATOM 8399 HB2 MET B 18 58.125 42.369 67.125 1.00 0.00 H ATOM 8400 HB3 MET B 18 58.717 41.395 65.759 1.00 0.00 H ATOM 8401 HG2 MET B 18 58.409 43.965 65.513 1.00 0.00 H ATOM 8402 HG3 MET B 18 56.693 43.549 65.296 1.00 0.00 H ATOM 8403 HE1 MET B 18 57.304 44.949 62.915 1.00 0.00 H ATOM 8404 HE2 MET B 18 59.051 44.899 63.254 1.00 0.00 H ATOM 8405 HE3 MET B 18 58.429 44.292 61.700 1.00 0.00 H ATOM 8406 H MET B 18 55.931 42.511 67.701 1.00 0.00 H ATOM 8407 N ALA B 19 57.011 39.547 68.082 1.00 30.43 N ATOM 8408 CA ALA B 19 57.258 38.243 68.691 1.00 31.12 C ATOM 8409 C ALA B 19 56.096 37.315 68.356 1.00 29.33 C ATOM 8410 O ALA B 19 56.294 36.147 68.099 1.00 31.93 O ATOM 8411 CB ALA B 19 57.435 38.364 70.213 1.00 28.54 C ATOM 8412 HA ALA B 19 58.184 37.831 68.290 1.00 0.00 H ATOM 8413 HB1 ALA B 19 58.282 39.015 70.428 1.00 0.00 H ATOM 8414 HB2 ALA B 19 56.530 38.787 70.650 1.00 0.00 H ATOM 8415 HB3 ALA B 19 57.617 37.376 70.636 1.00 0.00 H ATOM 8416 H ALA B 19 56.791 40.361 68.691 1.00 0.00 H ATOM 8417 N GLY B 20 54.883 37.854 68.359 1.00 30.24 N ATOM 8418 CA GLY B 20 53.690 37.084 68.035 1.00 28.72 C ATOM 8419 C GLY B 20 53.672 36.687 66.573 1.00 29.90 C ATOM 8420 O GLY B 20 53.191 35.601 66.221 1.00 31.11 O ATOM 8421 HA3 GLY B 20 52.808 37.687 68.250 1.00 0.00 H ATOM 8422 HA2 GLY B 20 53.671 36.183 68.648 1.00 0.00 H ATOM 8423 H GLY B 20 54.781 38.860 68.601 1.00 0.00 H ATOM 8424 N ASN B 21 54.187 37.576 65.725 1.00 28.44 N ATOM 8425 CA ASN B 21 54.367 37.297 64.311 1.00 28.63 C ATOM 8426 C ASN B 21 55.218 36.027 64.192 1.00 26.24 C ATOM 8427 O ASN B 21 54.800 35.047 63.603 1.00 26.17 O ATOM 8428 CB ASN B 21 55.020 38.511 63.617 1.00 28.75 C ATOM 8429 CG ASN B 21 55.160 38.345 62.108 1.00 31.21 C ATOM 8430 OD1 ASN B 21 55.276 37.230 61.596 1.00 31.63 O ATOM 8431 ND2 ASN B 21 55.163 39.470 61.388 1.00 28.91 N ATOM 8432 HA ASN B 21 53.412 37.129 63.812 1.00 0.00 H ATOM 8433 HB2 ASN B 21 54.408 39.391 63.812 1.00 0.00 H ATOM 8434 HB3 ASN B 21 56.013 38.659 64.042 1.00 0.00 H ATOM 8435 HD22 ASN B 21 55.062 40.391 61.861 1.00 0.00 H ATOM 8436 HD21 ASN B 21 55.266 39.425 60.354 1.00 0.00 H ATOM 8437 H ASN B 21 54.472 38.507 66.090 1.00 0.00 H ATOM 8438 N ALA B 22 56.401 36.053 64.793 1.00 25.58 N ATOM 8439 CA ALA B 22 57.359 34.957 64.686 1.00 25.71 C ATOM 8440 C ALA B 22 56.993 33.695 65.477 1.00 26.58 C ATOM 8441 O ALA B 22 57.044 32.584 64.930 1.00 25.80 O ATOM 8442 CB ALA B 22 58.761 35.444 65.076 1.00 25.48 C ATOM 8443 HA ALA B 22 57.336 34.652 63.640 1.00 0.00 H ATOM 8444 HB1 ALA B 22 59.063 36.251 64.408 1.00 0.00 H ATOM 8445 HB2 ALA B 22 58.745 35.808 66.103 1.00 0.00 H ATOM 8446 HB3 ALA B 22 59.467 34.618 64.992 1.00 0.00 H ATOM 8447 H ALA B 22 56.655 36.886 65.362 1.00 0.00 H ATOM 8448 N VAL B 23 56.648 33.858 66.757 1.00 27.15 N ATOM 8449 CA VAL B 23 56.300 32.722 67.617 1.00 27.14 C ATOM 8450 C VAL B 23 54.967 32.102 67.219 1.00 26.24 C ATOM 8451 O VAL B 23 53.908 32.709 67.406 1.00 27.31 O ATOM 8452 CB VAL B 23 56.242 33.124 69.102 1.00 28.15 C ATOM 8453 CG1 VAL B 23 55.755 31.936 69.945 1.00 27.95 C ATOM 8454 CG2 VAL B 23 57.605 33.602 69.573 1.00 26.17 C ATOM 8455 HA VAL B 23 57.092 31.985 67.480 1.00 0.00 H ATOM 8456 HB VAL B 23 55.537 33.946 69.223 1.00 0.00 H ATOM 8457 HG11 VAL B 23 54.760 31.640 69.612 1.00 0.00 H ATOM 8458 HG12 VAL B 23 56.444 31.100 69.824 1.00 0.00 H ATOM 8459 HG13 VAL B 23 55.717 32.228 70.994 1.00 0.00 H ATOM 8460 HG21 VAL B 23 58.333 32.800 69.449 1.00 0.00 H ATOM 8461 HG22 VAL B 23 57.910 34.465 68.982 1.00 0.00 H ATOM 8462 HG23 VAL B 23 57.547 33.882 70.625 1.00 0.00 H ATOM 8463 H VAL B 23 56.625 34.818 67.155 1.00 0.00 H ATOM 8464 N GLY B 24 55.002 30.895 66.668 1.00 27.40 N ATOM 8465 CA GLY B 24 53.775 30.280 66.180 1.00 26.35 C ATOM 8466 C GLY B 24 53.772 28.770 66.135 1.00 27.02 C ATOM 8467 O GLY B 24 54.469 28.099 66.901 1.00 27.87 O ATOM 8468 HA3 GLY B 24 53.596 30.646 65.169 1.00 0.00 H ATOM 8469 HA2 GLY B 24 52.959 30.598 66.830 1.00 0.00 H ATOM 8470 H GLY B 24 55.906 30.388 66.585 1.00 0.00 H ATOM 8471 N LEU B 25 52.967 28.234 65.230 1.00 27.86 N ATOM 8472 CA LEU B 25 52.897 26.804 65.023 1.00 27.99 C ATOM 8473 C LEU B 25 54.269 26.236 64.674 1.00 29.61 C ATOM 8474 O LEU B 25 54.547 25.069 64.939 1.00 31.76 O ATOM 8475 CB LEU B 25 51.880 26.480 63.925 1.00 28.15 C ATOM 8476 CG LEU B 25 50.459 26.997 64.171 1.00 28.34 C ATOM 8477 CD1 LEU B 25 49.562 26.625 63.005 1.00 26.86 C ATOM 8478 CD2 LEU B 25 49.891 26.454 65.480 1.00 28.02 C ATOM 8479 HA LEU B 25 52.569 26.336 65.951 1.00 0.00 H ATOM 8480 HB2 LEU B 25 52.240 26.916 62.993 1.00 0.00 H ATOM 8481 HB3 LEU B 25 51.830 25.396 63.822 1.00 0.00 H ATOM 8482 HG LEU B 25 50.500 28.083 64.254 1.00 0.00 H ATOM 8483 HD21 LEU B 25 49.863 25.365 65.438 1.00 0.00 H ATOM 8484 HD22 LEU B 25 50.525 26.771 66.309 1.00 0.00 H ATOM 8485 HD23 LEU B 25 48.882 26.840 65.624 1.00 0.00 H ATOM 8486 HD11 LEU B 25 49.953 27.071 62.091 1.00 0.00 H ATOM 8487 HD12 LEU B 25 49.536 25.540 62.900 1.00 0.00 H ATOM 8488 HD13 LEU B 25 48.554 26.997 63.190 1.00 0.00 H ATOM 8489 H LEU B 25 52.369 28.858 64.652 1.00 0.00 H ATOM 8490 N GLY B 26 55.127 27.066 64.088 1.00 30.18 N ATOM 8491 CA GLY B 26 56.480 26.644 63.727 1.00 29.26 C ATOM 8492 C GLY B 26 57.337 26.289 64.927 1.00 29.58 C ATOM 8493 O GLY B 26 58.200 25.403 64.850 1.00 29.25 O ATOM 8494 HA3 GLY B 26 56.963 27.457 63.184 1.00 0.00 H ATOM 8495 HA2 GLY B 26 56.409 25.769 63.081 1.00 0.00 H ATOM 8496 H GLY B 26 54.828 28.040 63.881 1.00 0.00 H ATOM 8497 N ASN B 27 57.109 26.979 66.041 1.00 29.33 N ATOM 8498 CA ASN B 27 57.877 26.728 67.263 1.00 28.41 C ATOM 8499 C ASN B 27 57.483 25.426 67.948 1.00 29.01 C ATOM 8500 O ASN B 27 58.333 24.685 68.441 1.00 29.00 O ATOM 8501 CB ASN B 27 57.705 27.882 68.261 1.00 27.28 C ATOM 8502 CG ASN B 27 58.050 29.230 67.659 1.00 27.62 C ATOM 8503 OD1 ASN B 27 57.459 29.647 66.662 1.00 26.98 O ATOM 8504 ND2 ASN B 27 59.005 29.924 68.266 1.00 27.71 N ATOM 8505 HA ASN B 27 58.919 26.649 66.954 1.00 0.00 H ATOM 8506 HB2 ASN B 27 56.668 27.904 68.595 1.00 0.00 H ATOM 8507 HB3 ASN B 27 58.357 27.704 69.116 1.00 0.00 H ATOM 8508 HD22 ASN B 27 59.478 29.533 69.106 1.00 0.00 H ATOM 8509 HD21 ASN B 27 59.280 30.858 67.902 1.00 0.00 H ATOM 8510 H ASN B 27 56.371 27.711 66.045 1.00 0.00 H ATOM 8511 N PHE B 28 56.182 25.156 67.972 1.00 29.08 N ATOM 8512 CA PHE B 28 55.653 24.051 68.751 1.00 29.37 C ATOM 8513 C PHE B 28 55.337 22.798 67.938 1.00 29.82 C ATOM 8514 O PHE B 28 55.416 21.687 68.469 1.00 30.51 O ATOM 8515 CB PHE B 28 54.434 24.528 69.550 1.00 28.73 C ATOM 8516 CG PHE B 28 54.760 25.635 70.511 1.00 28.84 C ATOM 8517 CD1 PHE B 28 55.349 25.353 71.739 1.00 28.26 C ATOM 8518 CD2 PHE B 28 54.507 26.957 70.177 1.00 27.38 C ATOM 8519 CE1 PHE B 28 55.667 26.381 72.626 1.00 28.82 C ATOM 8520 CE2 PHE B 28 54.821 27.982 71.052 1.00 30.06 C ATOM 8521 CZ PHE B 28 55.401 27.697 72.279 1.00 29.67 C ATOM 8522 HA PHE B 28 56.445 23.739 69.432 1.00 0.00 H ATOM 8523 HB2 PHE B 28 53.678 24.886 68.851 1.00 0.00 H ATOM 8524 HB3 PHE B 28 54.036 23.684 70.114 1.00 0.00 H ATOM 8525 HD2 PHE B 28 54.055 27.192 69.213 1.00 0.00 H ATOM 8526 HE2 PHE B 28 54.612 29.016 70.776 1.00 0.00 H ATOM 8527 HZ PHE B 28 55.647 28.505 72.968 1.00 0.00 H ATOM 8528 HE1 PHE B 28 56.123 26.151 73.589 1.00 0.00 H ATOM 8529 HD1 PHE B 28 55.564 24.319 72.010 1.00 0.00 H ATOM 8530 H PHE B 28 55.529 25.749 67.421 1.00 0.00 H ATOM 8531 N LEU B 29 54.998 22.974 66.660 1.00 28.48 N ATOM 8532 CA LEU B 29 54.706 21.835 65.787 1.00 29.25 C ATOM 8533 C LEU B 29 55.839 21.469 64.829 1.00 29.05 C ATOM 8534 O LEU B 29 56.234 20.312 64.757 1.00 28.47 O ATOM 8535 CB LEU B 29 53.438 22.078 64.972 1.00 28.07 C ATOM 8536 CG LEU B 29 52.094 22.140 65.695 1.00 28.73 C ATOM 8537 CD1 LEU B 29 50.989 22.473 64.683 1.00 27.20 C ATOM 8538 CD2 LEU B 29 51.794 20.835 66.444 1.00 27.56 C ATOM 8539 HA LEU B 29 54.573 20.994 66.468 1.00 0.00 H ATOM 8540 HB2 LEU B 29 53.567 23.029 64.455 1.00 0.00 H ATOM 8541 HB3 LEU B 29 53.370 21.274 64.239 1.00 0.00 H ATOM 8542 HG LEU B 29 52.135 22.927 66.448 1.00 0.00 H ATOM 8543 HD21 LEU B 29 51.765 20.008 65.734 1.00 0.00 H ATOM 8544 HD22 LEU B 29 52.575 20.654 67.183 1.00 0.00 H ATOM 8545 HD23 LEU B 29 50.830 20.919 66.945 1.00 0.00 H ATOM 8546 HD11 LEU B 29 51.200 23.437 64.220 1.00 0.00 H ATOM 8547 HD12 LEU B 29 50.956 21.700 63.915 1.00 0.00 H ATOM 8548 HD13 LEU B 29 50.029 22.518 65.197 1.00 0.00 H ATOM 8549 H LEU B 29 54.940 23.939 66.276 1.00 0.00 H ATOM 8550 N ARG B 30 56.344 22.459 64.094 1.00 31.08 N ATOM 8551 CA ARG B 30 57.334 22.235 63.028 1.00 30.89 C ATOM 8552 C ARG B 30 58.743 21.956 63.566 1.00 30.51 C ATOM 8553 O ARG B 30 59.383 20.969 63.179 1.00 29.53 O ATOM 8554 CB ARG B 30 57.349 23.442 62.075 1.00 32.01 C ATOM 8555 CG ARG B 30 57.873 23.166 60.657 1.00 34.65 C ATOM 8556 CD ARG B 30 58.011 24.489 59.874 1.00 35.73 C ATOM 8557 NE ARG B 30 58.282 24.313 58.444 1.00 36.16 N ATOM 8558 CZ ARG B 30 59.492 24.123 57.913 1.00 37.60 C ATOM 8559 NH1 ARG B 30 60.578 24.069 58.684 1.00 35.31 N ATOM 8560 NH2 ARG B 30 59.617 23.979 56.600 1.00 37.61 N ATOM 8561 HA ARG B 30 57.030 21.339 62.487 1.00 0.00 H ATOM 8562 HB2 ARG B 30 56.328 23.813 61.988 1.00 0.00 H ATOM 8563 HB3 ARG B 30 57.978 24.213 62.520 1.00 0.00 H ATOM 8564 HG2 ARG B 30 58.847 22.681 60.721 1.00 0.00 H ATOM 8565 HG3 ARG B 30 57.176 22.510 60.136 1.00 0.00 H ATOM 8566 HD2 ARG B 30 58.830 25.061 60.310 1.00 0.00 H ATOM 8567 HD3 ARG B 30 57.082 25.048 59.980 1.00 0.00 H ATOM 8568 HE ARG B 30 57.470 24.338 57.794 1.00 0.00 H ATOM 8569 HH12 ARG B 30 61.514 23.920 58.255 1.00 0.00 H ATOM 8570 HH11 ARG B 30 60.490 24.176 59.715 1.00 0.00 H ATOM 8571 HH22 ARG B 30 60.557 23.831 56.180 1.00 0.00 H ATOM 8572 HH21 ARG B 30 58.775 24.014 55.990 1.00 0.00 H ATOM 8573 H ARG B 30 56.025 23.431 64.281 1.00 0.00 H ATOM 8574 N PHE B 31 59.227 22.815 64.462 1.00 28.59 N ATOM 8575 CA PHE B 31 60.578 22.656 65.004 1.00 29.13 C ATOM 8576 C PHE B 31 60.852 21.258 65.564 1.00 31.18 C ATOM 8577 O PHE B 31 61.846 20.634 65.188 1.00 30.74 O ATOM 8578 CB PHE B 31 60.906 23.722 66.061 1.00 29.21 C ATOM 8579 CG PHE B 31 62.237 23.507 66.746 1.00 28.51 C ATOM 8580 CD1 PHE B 31 63.423 23.853 66.117 1.00 28.82 C ATOM 8581 CD2 PHE B 31 62.298 22.962 68.022 1.00 28.89 C ATOM 8582 CE1 PHE B 31 64.656 23.657 66.746 1.00 29.38 C ATOM 8583 CE2 PHE B 31 63.519 22.765 68.657 1.00 29.76 C ATOM 8584 CZ PHE B 31 64.700 23.111 68.014 1.00 28.61 C ATOM 8585 HA PHE B 31 61.241 22.795 64.150 1.00 0.00 H ATOM 8586 HB2 PHE B 31 60.922 24.697 65.574 1.00 0.00 H ATOM 8587 HB3 PHE B 31 60.122 23.709 66.818 1.00 0.00 H ATOM 8588 HD2 PHE B 31 61.376 22.685 68.533 1.00 0.00 H ATOM 8589 HE2 PHE B 31 63.549 22.339 69.660 1.00 0.00 H ATOM 8590 HZ PHE B 31 65.659 22.952 68.508 1.00 0.00 H ATOM 8591 HE1 PHE B 31 65.579 23.934 66.238 1.00 0.00 H ATOM 8592 HD1 PHE B 31 63.394 24.285 65.116 1.00 0.00 H ATOM 8593 H PHE B 31 58.637 23.610 64.781 1.00 0.00 H ATOM 8594 N PRO B 32 59.977 20.752 66.460 1.00 31.76 N ATOM 8595 CA PRO B 32 60.300 19.435 67.017 1.00 33.15 C ATOM 8596 C PRO B 32 60.386 18.343 65.948 1.00 32.45 C ATOM 8597 O PRO B 32 61.264 17.491 66.029 1.00 33.68 O ATOM 8598 CB PRO B 32 59.138 19.156 67.989 1.00 32.80 C ATOM 8599 CG PRO B 32 58.539 20.489 68.273 1.00 33.35 C ATOM 8600 CD PRO B 32 58.709 21.274 66.996 1.00 31.95 C ATOM 8601 HA PRO B 32 61.280 19.431 67.494 1.00 0.00 H ATOM 8602 HD3 PRO B 32 57.885 21.088 66.307 1.00 0.00 H ATOM 8603 HD2 PRO B 32 58.778 22.343 67.198 1.00 0.00 H ATOM 8604 HG3 PRO B 32 59.062 20.977 69.095 1.00 0.00 H ATOM 8605 HG2 PRO B 32 57.483 20.389 68.524 1.00 0.00 H ATOM 8606 HB2 PRO B 32 58.403 18.497 67.527 1.00 0.00 H ATOM 8607 HB3 PRO B 32 59.508 18.699 68.907 1.00 0.00 H ATOM 8608 N VAL B 33 59.487 18.369 64.962 1.00 34.49 N ATOM 8609 CA VAL B 33 59.514 17.383 63.868 1.00 34.39 C ATOM 8610 C VAL B 33 60.804 17.490 63.056 1.00 35.16 C ATOM 8611 O VAL B 33 61.461 16.484 62.786 1.00 34.67 O ATOM 8612 CB VAL B 33 58.288 17.507 62.916 1.00 35.08 C ATOM 8613 CG1 VAL B 33 58.441 16.576 61.715 1.00 34.27 C ATOM 8614 CG2 VAL B 33 56.984 17.198 63.653 1.00 34.99 C ATOM 8615 HA VAL B 33 59.468 16.404 64.346 1.00 0.00 H ATOM 8616 HB VAL B 33 58.248 18.537 62.561 1.00 0.00 H ATOM 8617 HG11 VAL B 33 59.344 16.841 61.164 1.00 0.00 H ATOM 8618 HG12 VAL B 33 58.515 15.546 62.063 1.00 0.00 H ATOM 8619 HG13 VAL B 33 57.573 16.680 61.064 1.00 0.00 H ATOM 8620 HG21 VAL B 33 57.021 16.181 64.044 1.00 0.00 H ATOM 8621 HG22 VAL B 33 56.859 17.901 64.477 1.00 0.00 H ATOM 8622 HG23 VAL B 33 56.146 17.293 62.962 1.00 0.00 H ATOM 8623 H VAL B 33 58.750 19.103 64.966 1.00 0.00 H ATOM 8624 N GLN B 34 61.163 18.715 62.673 1.00 35.63 N ATOM 8625 CA GLN B 34 62.385 18.971 61.913 1.00 35.39 C ATOM 8626 C GLN B 34 63.630 18.528 62.681 1.00 36.93 C ATOM 8627 O GLN B 34 64.496 17.859 62.126 1.00 36.52 O ATOM 8628 CB GLN B 34 62.483 20.453 61.526 1.00 34.75 C ATOM 8629 CG GLN B 34 61.349 20.934 60.618 1.00 34.60 C ATOM 8630 CD GLN B 34 61.352 20.243 59.261 1.00 35.28 C ATOM 8631 OE1 GLN B 34 62.407 19.968 58.702 1.00 35.06 O ATOM 8632 NE2 GLN B 34 60.167 19.964 58.730 1.00 34.86 N ATOM 8633 HA GLN B 34 62.335 18.378 61.000 1.00 0.00 H ATOM 8634 HB2 GLN B 34 62.468 21.048 62.439 1.00 0.00 H ATOM 8635 HB3 GLN B 34 63.429 20.611 61.007 1.00 0.00 H ATOM 8636 HG2 GLN B 34 60.398 20.733 61.111 1.00 0.00 H ATOM 8637 HG3 GLN B 34 61.457 22.008 60.464 1.00 0.00 H ATOM 8638 HE22 GLN B 34 59.296 20.216 59.240 1.00 0.00 H ATOM 8639 HE21 GLN B 34 60.110 19.494 57.804 1.00 0.00 H ATOM 8640 H GLN B 34 60.551 19.518 62.924 1.00 0.00 H ATOM 8641 N ALA B 35 63.718 18.891 63.958 1.00 37.66 N ATOM 8642 CA ALA B 35 64.862 18.483 64.775 1.00 39.99 C ATOM 8643 C ALA B 35 64.918 16.965 64.963 1.00 41.91 C ATOM 8644 O ALA B 35 65.992 16.367 64.876 1.00 42.17 O ATOM 8645 CB ALA B 35 64.844 19.186 66.124 1.00 39.99 C ATOM 8646 HA ALA B 35 65.762 18.782 64.238 1.00 0.00 H ATOM 8647 HB1 ALA B 35 64.889 20.264 65.971 1.00 0.00 H ATOM 8648 HB2 ALA B 35 63.926 18.931 66.653 1.00 0.00 H ATOM 8649 HB3 ALA B 35 65.705 18.865 66.711 1.00 0.00 H ATOM 8650 H ALA B 35 62.965 19.471 64.381 1.00 0.00 H ATOM 8651 N ALA B 36 63.769 16.346 65.210 1.00 43.15 N ATOM 8652 CA ALA B 36 63.719 14.895 65.430 1.00 45.39 C ATOM 8653 C ALA B 36 64.091 14.090 64.183 1.00 46.31 C ATOM 8654 O ALA B 36 64.790 13.081 64.276 1.00 48.02 O ATOM 8655 CB ALA B 36 62.350 14.473 65.947 1.00 44.96 C ATOM 8656 HA ALA B 36 64.471 14.671 66.186 1.00 0.00 H ATOM 8657 HB1 ALA B 36 62.148 14.979 66.891 1.00 0.00 H ATOM 8658 HB2 ALA B 36 61.588 14.745 65.217 1.00 0.00 H ATOM 8659 HB3 ALA B 36 62.338 13.394 66.102 1.00 0.00 H ATOM 8660 H ALA B 36 62.889 16.899 65.248 1.00 0.00 H ATOM 8661 N GLU B 37 63.623 14.534 63.020 1.00 46.87 N ATOM 8662 CA GLU B 37 63.944 13.864 61.763 1.00 48.57 C ATOM 8663 C GLU B 37 65.424 13.956 61.416 1.00 49.52 C ATOM 8664 O GLU B 37 65.974 13.059 60.776 1.00 51.17 O ATOM 8665 CB GLU B 37 63.136 14.454 60.608 1.00 48.14 C ATOM 8666 CG GLU B 37 61.681 14.040 60.597 1.00 49.18 C ATOM 8667 CD GLU B 37 60.907 14.650 59.441 1.00 49.28 C ATOM 8668 OE1 GLU B 37 61.410 15.610 58.809 1.00 49.10 O ATOM 8669 OE2 GLU B 37 59.786 14.167 59.172 1.00 49.85 O ATOM 8670 HA GLU B 37 63.685 12.815 61.905 1.00 0.00 H ATOM 8671 HB2 GLU B 37 63.182 15.541 60.677 1.00 0.00 H ATOM 8672 HB3 GLU B 37 63.591 14.131 59.672 1.00 0.00 H ATOM 8673 HG2 GLU B 37 61.628 12.954 60.518 1.00 0.00 H ATOM 8674 HG3 GLU B 37 61.220 14.358 61.532 1.00 0.00 H ATOM 8675 H GLU B 37 63.015 15.377 63.006 1.00 0.00 H ATOM 8676 N ASN B 38 66.067 15.038 61.839 1.00 49.22 N ATOM 8677 CA ASN B 38 67.448 15.296 61.456 1.00 50.36 C ATOM 8678 C ASN B 38 68.462 15.059 62.578 1.00 50.36 C ATOM 8679 O ASN B 38 69.457 15.771 62.690 1.00 50.60 O ATOM 8680 CB ASN B 38 67.572 16.712 60.883 1.00 49.56 C ATOM 8681 CG ASN B 38 66.672 16.927 59.675 1.00 50.06 C ATOM 8682 OD1 ASN B 38 66.907 16.370 58.602 1.00 50.68 O ATOM 8683 ND2 ASN B 38 65.638 17.736 59.844 1.00 48.99 N ATOM 8684 HA ASN B 38 67.701 14.565 60.688 1.00 0.00 H ATOM 8685 HB2 ASN B 38 67.298 17.429 61.657 1.00 0.00 H ATOM 8686 HB3 ASN B 38 68.607 16.880 60.584 1.00 0.00 H ATOM 8687 HD22 ASN B 38 65.476 18.186 60.767 1.00 0.00 H ATOM 8688 HD21 ASN B 38 64.988 17.921 59.054 1.00 0.00 H ATOM 8689 H ASN B 38 65.574 15.715 62.456 1.00 0.00 H ATOM 8690 N GLY B 39 68.186 14.056 63.407 1.00 51.38 N ATOM 8691 CA GLY B 39 69.126 13.608 64.436 1.00 52.39 C ATOM 8692 C GLY B 39 69.246 14.412 65.719 1.00 52.77 C ATOM 8693 O GLY B 39 70.246 14.299 66.422 1.00 54.13 O ATOM 8694 HA3 GLY B 39 70.115 13.585 63.978 1.00 0.00 H ATOM 8695 HA2 GLY B 39 68.834 12.596 64.718 1.00 0.00 H ATOM 8696 H GLY B 39 67.269 13.573 63.321 1.00 0.00 H ATOM 8697 N GLY B 40 68.239 15.221 66.029 1.00 53.19 N ATOM 8698 CA GLY B 40 68.234 16.000 67.269 1.00 52.72 C ATOM 8699 C GLY B 40 69.350 17.024 67.364 1.00 53.59 C ATOM 8700 O GLY B 40 69.254 18.113 66.794 1.00 53.63 O ATOM 8701 HA3 GLY B 40 68.330 15.310 68.107 1.00 0.00 H ATOM 8702 HA2 GLY B 40 67.281 16.525 67.340 1.00 0.00 H ATOM 8703 H GLY B 40 67.434 15.303 65.375 1.00 0.00 H ATOM 8704 N GLY B 41 70.412 16.671 68.087 1.00 53.47 N ATOM 8705 CA GLY B 41 71.566 17.555 68.264 1.00 53.83 C ATOM 8706 C GLY B 41 72.344 17.781 66.984 1.00 54.06 C ATOM 8707 O GLY B 41 73.061 18.778 66.847 1.00 55.05 O ATOM 8708 HA3 GLY B 41 72.234 17.111 69.002 1.00 0.00 H ATOM 8709 HA2 GLY B 41 71.212 18.519 68.630 1.00 0.00 H ATOM 8710 H GLY B 41 70.422 15.736 68.541 1.00 0.00 H ATOM 8711 N ALA B 42 72.204 16.847 66.046 1.00 53.50 N ATOM 8712 CA ALA B 42 72.823 16.951 64.730 1.00 53.00 C ATOM 8713 C ALA B 42 72.186 18.080 63.916 1.00 52.04 C ATOM 8714 O ALA B 42 72.812 18.657 63.023 1.00 52.34 O ATOM 8715 CB ALA B 42 72.691 15.632 63.989 1.00 53.29 C ATOM 8716 HA ALA B 42 73.880 17.181 64.863 1.00 0.00 H ATOM 8717 HB1 ALA B 42 73.187 14.846 64.558 1.00 0.00 H ATOM 8718 HB2 ALA B 42 71.635 15.387 63.871 1.00 0.00 H ATOM 8719 HB3 ALA B 42 73.156 15.720 63.007 1.00 0.00 H ATOM 8720 H ALA B 42 71.629 16.008 66.261 1.00 0.00 H ATOM 8721 N PHE B 43 70.933 18.382 64.237 1.00 50.40 N ATOM 8722 CA PHE B 43 70.180 19.431 63.574 1.00 47.63 C ATOM 8723 C PHE B 43 70.531 20.792 64.145 1.00 47.68 C ATOM 8724 O PHE B 43 70.448 21.805 63.450 1.00 46.81 O ATOM 8725 CB PHE B 43 68.688 19.164 63.764 1.00 46.47 C ATOM 8726 CG PHE B 43 67.787 20.219 63.185 1.00 45.08 C ATOM 8727 CD1 PHE B 43 67.513 20.248 61.825 1.00 44.39 C ATOM 8728 CD2 PHE B 43 67.194 21.167 64.005 1.00 44.50 C ATOM 8729 CE1 PHE B 43 66.674 21.208 61.292 1.00 43.92 C ATOM 8730 CE2 PHE B 43 66.353 22.133 63.483 1.00 44.30 C ATOM 8731 CZ PHE B 43 66.093 22.156 62.123 1.00 44.30 C ATOM 8732 HA PHE B 43 70.431 19.431 62.513 1.00 0.00 H ATOM 8733 HB2 PHE B 43 68.449 18.213 63.288 1.00 0.00 H ATOM 8734 HB3 PHE B 43 68.488 19.094 64.833 1.00 0.00 H ATOM 8735 HD2 PHE B 43 67.394 21.151 65.076 1.00 0.00 H ATOM 8736 HE2 PHE B 43 65.896 22.874 64.140 1.00 0.00 H ATOM 8737 HZ PHE B 43 65.433 22.917 61.706 1.00 0.00 H ATOM 8738 HE1 PHE B 43 66.469 21.221 60.222 1.00 0.00 H ATOM 8739 HD1 PHE B 43 67.965 19.504 61.169 1.00 0.00 H ATOM 8740 H PHE B 43 70.471 17.843 64.997 1.00 0.00 H ATOM 8741 N MET B 44 70.939 20.808 65.412 1.00 47.01 N ATOM 8742 CA MET B 44 71.103 22.065 66.150 1.00 46.80 C ATOM 8743 C MET B 44 72.320 22.928 65.788 1.00 46.56 C ATOM 8744 O MET B 44 72.251 24.153 65.879 1.00 46.45 O ATOM 8745 CB MET B 44 71.043 21.815 67.665 1.00 47.01 C ATOM 8746 CG MET B 44 69.672 21.358 68.153 1.00 47.03 C ATOM 8747 SD MET B 44 68.311 22.448 67.653 1.00 48.59 S ATOM 8748 CE MET B 44 68.814 23.969 68.460 1.00 46.90 C ATOM 8749 HA MET B 44 70.256 22.669 65.824 1.00 0.00 H ATOM 8750 HB2 MET B 44 71.773 21.046 67.917 1.00 0.00 H ATOM 8751 HB3 MET B 44 71.301 22.741 68.178 1.00 0.00 H ATOM 8752 HG2 MET B 44 69.693 21.312 69.242 1.00 0.00 H ATOM 8753 HG3 MET B 44 69.479 20.363 67.753 1.00 0.00 H ATOM 8754 HE1 MET B 44 68.877 23.804 69.536 1.00 0.00 H ATOM 8755 HE2 MET B 44 69.789 24.275 68.080 1.00 0.00 H ATOM 8756 HE3 MET B 44 68.081 24.748 68.253 1.00 0.00 H ATOM 8757 H MET B 44 71.146 19.908 65.890 1.00 0.00 H ATOM 8758 N ILE B 45 73.427 22.317 65.382 1.00 45.39 N ATOM 8759 CA ILE B 45 74.593 23.123 65.001 1.00 44.65 C ATOM 8760 C ILE B 45 74.344 23.899 63.694 1.00 43.28 C ATOM 8761 O ILE B 45 74.582 25.107 63.647 1.00 44.05 O ATOM 8762 CB ILE B 45 75.906 22.304 64.942 1.00 45.34 C ATOM 8763 CG1 ILE B 45 76.305 21.867 66.350 1.00 45.88 C ATOM 8764 CG2 ILE B 45 77.029 23.132 64.325 1.00 45.65 C ATOM 8765 CD1 ILE B 45 77.704 21.292 66.439 1.00 47.21 C ATOM 8766 HA ILE B 45 74.731 23.853 65.798 1.00 0.00 H ATOM 8767 HB ILE B 45 75.739 21.425 64.320 1.00 0.00 H ATOM 8768 HG12 ILE B 45 76.247 22.734 67.008 1.00 0.00 H ATOM 8769 HG13 ILE B 45 75.599 21.108 66.687 1.00 0.00 H ATOM 8770 HD11 ILE B 45 77.777 20.416 65.795 1.00 0.00 H ATOM 8771 HD12 ILE B 45 78.425 22.043 66.116 1.00 0.00 H ATOM 8772 HD13 ILE B 45 77.913 21.005 67.470 1.00 0.00 H ATOM 8773 HG21 ILE B 45 76.749 23.425 63.313 1.00 0.00 H ATOM 8774 HG22 ILE B 45 77.195 24.024 64.929 1.00 0.00 H ATOM 8775 HG23 ILE B 45 77.942 22.537 64.293 1.00 0.00 H ATOM 8776 H ILE B 45 73.467 21.279 65.335 1.00 0.00 H ATOM 8777 N PRO B 46 73.871 23.210 62.638 1.00 41.13 N ATOM 8778 CA PRO B 46 73.450 23.905 61.426 1.00 39.97 C ATOM 8779 C PRO B 46 72.365 24.943 61.709 1.00 39.38 C ATOM 8780 O PRO B 46 72.392 26.021 61.120 1.00 38.97 O ATOM 8781 CB PRO B 46 72.874 22.780 60.559 1.00 40.04 C ATOM 8782 CG PRO B 46 73.572 21.558 61.029 1.00 40.93 C ATOM 8783 CD PRO B 46 73.728 21.749 62.502 1.00 41.21 C ATOM 8784 HA PRO B 46 74.271 24.452 60.962 1.00 0.00 H ATOM 8785 HD3 PRO B 46 72.850 21.390 63.038 1.00 0.00 H ATOM 8786 HD2 PRO B 46 74.614 21.233 62.872 1.00 0.00 H ATOM 8787 HG3 PRO B 46 74.546 21.463 60.549 1.00 0.00 H ATOM 8788 HG2 PRO B 46 72.976 20.670 60.818 1.00 0.00 H ATOM 8789 HB2 PRO B 46 71.798 22.691 60.707 1.00 0.00 H ATOM 8790 HB3 PRO B 46 73.081 22.961 59.504 1.00 0.00 H ATOM 8791 N TYR B 47 71.421 24.609 62.592 1.00 37.63 N ATOM 8792 CA TYR B 47 70.334 25.515 62.974 1.00 37.48 C ATOM 8793 C TYR B 47 70.858 26.808 63.599 1.00 38.76 C ATOM 8794 O TYR B 47 70.413 27.899 63.237 1.00 40.20 O ATOM 8795 CB TYR B 47 69.376 24.814 63.944 1.00 34.19 C ATOM 8796 CG TYR B 47 68.215 25.651 64.454 1.00 32.25 C ATOM 8797 CD1 TYR B 47 67.004 25.684 63.773 1.00 30.77 C ATOM 8798 CD2 TYR B 47 68.328 26.390 65.629 1.00 31.87 C ATOM 8799 CE1 TYR B 47 65.939 26.438 64.243 1.00 30.64 C ATOM 8800 CE2 TYR B 47 67.279 27.147 66.106 1.00 31.29 C ATOM 8801 CZ TYR B 47 66.084 27.170 65.412 1.00 32.01 C ATOM 8802 OH TYR B 47 65.034 27.924 65.895 1.00 31.90 O ATOM 8803 HA TYR B 47 69.798 25.783 62.063 1.00 0.00 H ATOM 8804 HB3 TYR B 47 69.956 24.486 64.807 1.00 0.00 H ATOM 8805 HB2 TYR B 47 68.962 23.944 63.434 1.00 0.00 H ATOM 8806 HD2 TYR B 47 69.266 26.369 66.184 1.00 0.00 H ATOM 8807 HE2 TYR B 47 67.391 27.723 67.024 1.00 0.00 H ATOM 8808 HE1 TYR B 47 64.995 26.455 63.698 1.00 0.00 H ATOM 8809 HD1 TYR B 47 66.889 25.108 62.855 1.00 0.00 H ATOM 8810 HH TYR B 47 64.258 27.834 65.287 1.00 0.00 H ATOM 8811 H TYR B 47 71.459 23.665 63.028 1.00 0.00 H ATOM 8812 N ILE B 48 71.794 26.675 64.534 1.00 40.08 N ATOM 8813 CA ILE B 48 72.392 27.822 65.210 1.00 40.77 C ATOM 8814 C ILE B 48 73.177 28.678 64.222 1.00 40.61 C ATOM 8815 O ILE B 48 73.059 29.904 64.225 1.00 40.40 O ATOM 8816 CB ILE B 48 73.329 27.394 66.364 1.00 41.00 C ATOM 8817 CG1 ILE B 48 72.535 26.783 67.516 1.00 42.55 C ATOM 8818 CG2 ILE B 48 74.132 28.588 66.877 1.00 41.63 C ATOM 8819 CD1 ILE B 48 73.412 26.099 68.556 1.00 41.82 C ATOM 8820 HA ILE B 48 71.571 28.401 65.632 1.00 0.00 H ATOM 8821 HB ILE B 48 74.014 26.643 65.971 1.00 0.00 H ATOM 8822 HG12 ILE B 48 71.971 27.576 68.007 1.00 0.00 H ATOM 8823 HG13 ILE B 48 71.844 26.046 67.107 1.00 0.00 H ATOM 8824 HD11 ILE B 48 73.976 25.295 68.082 1.00 0.00 H ATOM 8825 HD12 ILE B 48 74.103 26.827 68.982 1.00 0.00 H ATOM 8826 HD13 ILE B 48 72.783 25.687 69.345 1.00 0.00 H ATOM 8827 HG21 ILE B 48 74.735 28.995 66.065 1.00 0.00 H ATOM 8828 HG22 ILE B 48 73.448 29.354 67.243 1.00 0.00 H ATOM 8829 HG23 ILE B 48 74.784 28.264 67.688 1.00 0.00 H ATOM 8830 H ILE B 48 72.111 25.719 64.793 1.00 0.00 H ATOM 8831 N ILE B 49 73.980 28.022 63.383 1.00 41.07 N ATOM 8832 CA ILE B 49 74.772 28.714 62.364 1.00 40.50 C ATOM 8833 C ILE B 49 73.867 29.442 61.364 1.00 39.87 C ATOM 8834 O ILE B 49 74.189 30.540 60.919 1.00 39.99 O ATOM 8835 CB ILE B 49 75.737 27.753 61.647 1.00 40.75 C ATOM 8836 CG1 ILE B 49 76.873 27.355 62.593 1.00 40.98 C ATOM 8837 CG2 ILE B 49 76.320 28.397 60.403 1.00 40.57 C ATOM 8838 CD1 ILE B 49 77.781 26.282 62.053 1.00 42.52 C ATOM 8839 HA ILE B 49 75.379 29.463 62.873 1.00 0.00 H ATOM 8840 HB ILE B 49 75.176 26.867 61.351 1.00 0.00 H ATOM 8841 HG12 ILE B 49 77.474 28.241 62.797 1.00 0.00 H ATOM 8842 HG13 ILE B 49 76.433 26.994 63.523 1.00 0.00 H ATOM 8843 HD11 ILE B 49 77.200 25.382 61.855 1.00 0.00 H ATOM 8844 HD12 ILE B 49 78.242 26.629 61.128 1.00 0.00 H ATOM 8845 HD13 ILE B 49 78.557 26.061 62.786 1.00 0.00 H ATOM 8846 HG21 ILE B 49 75.513 28.659 59.719 1.00 0.00 H ATOM 8847 HG22 ILE B 49 76.866 29.298 60.684 1.00 0.00 H ATOM 8848 HG23 ILE B 49 76.998 27.696 59.916 1.00 0.00 H ATOM 8849 H ILE B 49 74.046 26.987 63.455 1.00 0.00 H ATOM 8850 N ALA B 50 72.733 28.829 61.029 1.00 38.69 N ATOM 8851 CA ALA B 50 71.749 29.454 60.157 1.00 37.88 C ATOM 8852 C ALA B 50 71.118 30.671 60.831 1.00 38.17 C ATOM 8853 O ALA B 50 70.841 31.672 60.178 1.00 37.23 O ATOM 8854 CB ALA B 50 70.683 28.458 59.751 1.00 38.66 C ATOM 8855 HA ALA B 50 72.263 29.792 59.257 1.00 0.00 H ATOM 8856 HB1 ALA B 50 71.147 27.627 59.220 1.00 0.00 H ATOM 8857 HB2 ALA B 50 70.178 28.085 60.642 1.00 0.00 H ATOM 8858 HB3 ALA B 50 69.959 28.948 59.100 1.00 0.00 H ATOM 8859 H ALA B 50 72.545 27.876 61.401 1.00 0.00 H ATOM 8860 N PHE B 51 70.894 30.588 62.142 1.00 37.39 N ATOM 8861 CA PHE B 51 70.343 31.720 62.873 1.00 37.09 C ATOM 8862 C PHE B 51 71.275 32.930 62.782 1.00 37.43 C ATOM 8863 O PHE B 51 70.823 34.053 62.575 1.00 38.22 O ATOM 8864 CB PHE B 51 70.069 31.353 64.335 1.00 36.95 C ATOM 8865 CG PHE B 51 69.575 32.504 65.166 1.00 35.88 C ATOM 8866 CD1 PHE B 51 68.322 33.061 64.933 1.00 35.14 C ATOM 8867 CD2 PHE B 51 70.361 33.027 66.189 1.00 35.85 C ATOM 8868 CE1 PHE B 51 67.861 34.134 65.703 1.00 36.15 C ATOM 8869 CE2 PHE B 51 69.915 34.093 66.966 1.00 35.75 C ATOM 8870 CZ PHE B 51 68.662 34.651 66.725 1.00 35.52 C ATOM 8871 HA PHE B 51 69.392 31.986 62.411 1.00 0.00 H ATOM 8872 HB2 PHE B 51 69.316 30.565 64.357 1.00 0.00 H ATOM 8873 HB3 PHE B 51 70.994 30.982 64.776 1.00 0.00 H ATOM 8874 HD2 PHE B 51 71.342 32.595 66.385 1.00 0.00 H ATOM 8875 HE2 PHE B 51 70.546 34.490 67.762 1.00 0.00 H ATOM 8876 HZ PHE B 51 68.308 35.486 67.330 1.00 0.00 H ATOM 8877 HE1 PHE B 51 66.880 34.566 65.506 1.00 0.00 H ATOM 8878 HD1 PHE B 51 67.692 32.657 64.141 1.00 0.00 H ATOM 8879 H PHE B 51 71.115 29.706 62.648 1.00 0.00 H ATOM 8880 N LEU B 52 72.573 32.688 62.926 1.00 38.28 N ATOM 8881 CA LEU B 52 73.567 33.760 62.926 1.00 38.14 C ATOM 8882 C LEU B 52 73.894 34.297 61.526 1.00 38.23 C ATOM 8883 O LEU B 52 74.052 35.505 61.339 1.00 38.16 O ATOM 8884 CB LEU B 52 74.853 33.288 63.614 1.00 38.43 C ATOM 8885 CG LEU B 52 74.788 32.924 65.105 1.00 38.38 C ATOM 8886 CD1 LEU B 52 76.034 32.152 65.516 1.00 38.46 C ATOM 8887 CD2 LEU B 52 74.597 34.159 65.980 1.00 38.25 C ATOM 8888 HA LEU B 52 73.122 34.587 63.480 1.00 0.00 H ATOM 8889 HB2 LEU B 52 75.199 32.403 63.080 1.00 0.00 H ATOM 8890 HB3 LEU B 52 75.588 34.086 63.508 1.00 0.00 H ATOM 8891 HG LEU B 52 73.917 32.286 65.255 1.00 0.00 H ATOM 8892 HD21 LEU B 52 75.433 34.842 65.829 1.00 0.00 H ATOM 8893 HD22 LEU B 52 73.666 34.656 65.707 1.00 0.00 H ATOM 8894 HD23 LEU B 52 74.556 33.858 67.027 1.00 0.00 H ATOM 8895 HD11 LEU B 52 76.103 31.236 64.929 1.00 0.00 H ATOM 8896 HD12 LEU B 52 76.916 32.767 65.338 1.00 0.00 H ATOM 8897 HD13 LEU B 52 75.972 31.902 66.575 1.00 0.00 H ATOM 8898 H LEU B 52 72.892 31.705 63.042 1.00 0.00 H ATOM 8899 N LEU B 53 74.001 33.408 60.547 1.00 36.94 N ATOM 8900 CA LEU B 53 74.391 33.830 59.200 1.00 36.38 C ATOM 8901 C LEU B 53 73.210 34.193 58.303 1.00 35.91 C ATOM 8902 O LEU B 53 73.397 34.835 57.270 1.00 35.87 O ATOM 8903 CB LEU B 53 75.260 32.765 58.523 1.00 36.19 C ATOM 8904 CG LEU B 53 76.632 32.487 59.153 1.00 36.64 C ATOM 8905 CD1 LEU B 53 77.361 31.382 58.395 1.00 36.36 C ATOM 8906 CD2 LEU B 53 77.475 33.752 59.199 1.00 36.43 C ATOM 8907 HA LEU B 53 74.970 34.744 59.334 1.00 0.00 H ATOM 8908 HB2 LEU B 53 74.699 31.830 58.527 1.00 0.00 H ATOM 8909 HB3 LEU B 53 75.428 33.082 57.494 1.00 0.00 H ATOM 8910 HG LEU B 53 76.470 32.150 60.177 1.00 0.00 H ATOM 8911 HD21 LEU B 53 77.623 34.125 58.186 1.00 0.00 H ATOM 8912 HD22 LEU B 53 76.962 34.507 59.794 1.00 0.00 H ATOM 8913 HD23 LEU B 53 78.442 33.527 59.650 1.00 0.00 H ATOM 8914 HD11 LEU B 53 76.767 30.469 58.427 1.00 0.00 H ATOM 8915 HD12 LEU B 53 77.505 31.688 57.359 1.00 0.00 H ATOM 8916 HD13 LEU B 53 78.330 31.203 58.860 1.00 0.00 H ATOM 8917 H LEU B 53 73.807 32.404 60.738 1.00 0.00 H ATOM 8918 N VAL B 54 72.004 33.784 58.690 1.00 35.12 N ATOM 8919 CA VAL B 54 70.811 34.037 57.873 1.00 33.98 C ATOM 8920 C VAL B 54 69.688 34.688 58.660 1.00 33.37 C ATOM 8921 O VAL B 54 69.172 35.727 58.258 1.00 34.37 O ATOM 8922 CB VAL B 54 70.257 32.736 57.248 1.00 33.64 C ATOM 8923 CG1 VAL B 54 68.969 33.024 56.505 1.00 33.04 C ATOM 8924 CG2 VAL B 54 71.285 32.108 56.324 1.00 34.22 C ATOM 8925 HA VAL B 54 71.144 34.719 57.091 1.00 0.00 H ATOM 8926 HB VAL B 54 70.044 32.026 58.047 1.00 0.00 H ATOM 8927 HG11 VAL B 54 68.233 33.430 57.199 1.00 0.00 H ATOM 8928 HG12 VAL B 54 69.162 33.748 55.714 1.00 0.00 H ATOM 8929 HG13 VAL B 54 68.588 32.100 56.069 1.00 0.00 H ATOM 8930 HG21 VAL B 54 71.530 32.808 55.525 1.00 0.00 H ATOM 8931 HG22 VAL B 54 72.186 31.873 56.891 1.00 0.00 H ATOM 8932 HG23 VAL B 54 70.875 31.194 55.895 1.00 0.00 H ATOM 8933 H VAL B 54 71.905 33.274 59.591 1.00 0.00 H ATOM 8934 N GLY B 55 69.312 34.070 59.779 1.00 33.95 N ATOM 8935 CA GLY B 55 68.192 34.538 60.599 1.00 34.60 C ATOM 8936 C GLY B 55 68.296 35.991 61.032 1.00 34.77 C ATOM 8937 O GLY B 55 67.422 36.801 60.715 1.00 33.92 O ATOM 8938 HA3 GLY B 55 68.142 33.918 61.494 1.00 0.00 H ATOM 8939 HA2 GLY B 55 67.274 34.418 60.023 1.00 0.00 H ATOM 8940 H GLY B 55 69.834 33.223 60.082 1.00 0.00 H ATOM 8941 N ILE B 56 69.373 36.306 61.749 1.00 34.86 N ATOM 8942 CA ILE B 56 69.663 37.663 62.243 1.00 35.10 C ATOM 8943 C ILE B 56 69.816 38.741 61.151 1.00 33.73 C ATOM 8944 O ILE B 56 69.115 39.752 61.185 1.00 34.96 O ATOM 8945 CB ILE B 56 70.928 37.663 63.145 1.00 36.07 C ATOM 8946 CG1 ILE B 56 70.671 36.882 64.424 1.00 36.98 C ATOM 8947 CG2 ILE B 56 71.347 39.083 63.502 1.00 35.32 C ATOM 8948 CD1 ILE B 56 69.567 37.487 65.260 1.00 38.66 C ATOM 8949 HA ILE B 56 68.777 37.938 62.815 1.00 0.00 H ATOM 8950 HB ILE B 56 71.732 37.188 62.583 1.00 0.00 H ATOM 8951 HG12 ILE B 56 70.391 35.862 64.161 1.00 0.00 H ATOM 8952 HG13 ILE B 56 71.587 36.865 65.014 1.00 0.00 H ATOM 8953 HD11 ILE B 56 69.839 38.505 65.537 1.00 0.00 H ATOM 8954 HD12 ILE B 56 68.642 37.501 64.683 1.00 0.00 H ATOM 8955 HD13 ILE B 56 69.426 36.889 66.161 1.00 0.00 H ATOM 8956 HG21 ILE B 56 71.569 39.635 62.589 1.00 0.00 H ATOM 8957 HG22 ILE B 56 70.536 39.576 64.038 1.00 0.00 H ATOM 8958 HG23 ILE B 56 72.235 39.051 64.134 1.00 0.00 H ATOM 8959 H ILE B 56 70.050 35.549 61.974 1.00 0.00 H ATOM 8960 N PRO B 57 70.731 38.544 60.188 1.00 33.68 N ATOM 8961 CA PRO B 57 70.891 39.582 59.163 1.00 33.15 C ATOM 8962 C PRO B 57 69.618 39.874 58.349 1.00 33.75 C ATOM 8963 O PRO B 57 69.281 41.042 58.139 1.00 33.00 O ATOM 8964 CB PRO B 57 72.011 39.031 58.269 1.00 32.79 C ATOM 8965 CG PRO B 57 72.055 37.579 58.553 1.00 33.46 C ATOM 8966 CD PRO B 57 71.665 37.424 59.980 1.00 33.61 C ATOM 8967 HA PRO B 57 71.118 40.546 59.617 1.00 0.00 H ATOM 8968 HD3 PRO B 57 71.174 36.466 60.151 1.00 0.00 H ATOM 8969 HD2 PRO B 57 72.532 37.509 60.635 1.00 0.00 H ATOM 8970 HG3 PRO B 57 73.061 37.192 58.392 1.00 0.00 H ATOM 8971 HG2 PRO B 57 71.355 37.046 57.909 1.00 0.00 H ATOM 8972 HB2 PRO B 57 71.784 39.209 57.218 1.00 0.00 H ATOM 8973 HB3 PRO B 57 72.964 39.498 58.517 1.00 0.00 H ATOM 8974 N LEU B 58 68.918 38.833 57.898 1.00 32.92 N ATOM 8975 CA LEU B 58 67.669 39.023 57.150 1.00 31.83 C ATOM 8976 C LEU B 58 66.588 39.693 57.975 1.00 31.91 C ATOM 8977 O LEU B 58 65.752 40.431 57.440 1.00 31.18 O ATOM 8978 CB LEU B 58 67.138 37.700 56.609 1.00 32.38 C ATOM 8979 CG LEU B 58 67.651 37.216 55.264 1.00 32.52 C ATOM 8980 CD1 LEU B 58 66.737 36.103 54.775 1.00 33.11 C ATOM 8981 CD2 LEU B 58 67.678 38.361 54.263 1.00 32.85 C ATOM 8982 HA LEU B 58 67.919 39.683 56.319 1.00 0.00 H ATOM 8983 HB2 LEU B 58 67.379 36.931 57.343 1.00 0.00 H ATOM 8984 HB3 LEU B 58 66.055 37.796 56.527 1.00 0.00 H ATOM 8985 HG LEU B 58 68.669 36.841 55.368 1.00 0.00 H ATOM 8986 HD21 LEU B 58 66.670 38.756 54.138 1.00 0.00 H ATOM 8987 HD22 LEU B 58 68.335 39.149 54.632 1.00 0.00 H ATOM 8988 HD23 LEU B 58 68.048 37.996 53.305 1.00 0.00 H ATOM 8989 HD11 LEU B 58 66.746 35.285 55.495 1.00 0.00 H ATOM 8990 HD12 LEU B 58 65.722 36.487 54.672 1.00 0.00 H ATOM 8991 HD13 LEU B 58 67.090 35.742 53.809 1.00 0.00 H ATOM 8992 H LEU B 58 69.263 37.869 58.079 1.00 0.00 H ATOM 8993 N MET B 59 66.581 39.422 59.276 1.00 30.92 N ATOM 8994 CA MET B 59 65.641 40.079 60.175 1.00 31.54 C ATOM 8995 C MET B 59 65.874 41.592 60.153 1.00 31.46 C ATOM 8996 O MET B 59 64.942 42.362 59.947 1.00 31.02 O ATOM 8997 CB MET B 59 65.769 39.529 61.597 1.00 31.72 C ATOM 8998 CG MET B 59 64.802 40.136 62.596 1.00 31.35 C ATOM 8999 SD MET B 59 63.069 39.819 62.224 1.00 29.76 S ATOM 9000 CE MET B 59 62.901 38.099 62.708 1.00 31.64 C ATOM 9001 HA MET B 59 64.627 39.874 59.832 1.00 0.00 H ATOM 9002 HB2 MET B 59 65.594 38.454 61.563 1.00 0.00 H ATOM 9003 HB3 MET B 59 66.784 39.720 61.946 1.00 0.00 H ATOM 9004 HG2 MET B 59 64.958 41.215 62.612 1.00 0.00 H ATOM 9005 HG3 MET B 59 65.022 39.724 63.581 1.00 0.00 H ATOM 9006 HE1 MET B 59 63.586 37.489 62.119 1.00 0.00 H ATOM 9007 HE2 MET B 59 63.139 37.996 63.767 1.00 0.00 H ATOM 9008 HE3 MET B 59 61.876 37.772 62.531 1.00 0.00 H ATOM 9009 H MET B 59 67.257 38.730 59.658 1.00 0.00 H ATOM 9010 N TRP B 60 67.124 42.014 60.352 1.00 31.46 N ATOM 9011 CA TRP B 60 67.457 43.446 60.325 1.00 32.38 C ATOM 9012 C TRP B 60 67.147 44.064 58.965 1.00 32.90 C ATOM 9013 O TRP B 60 66.612 45.170 58.883 1.00 32.44 O ATOM 9014 CB TRP B 60 68.927 43.699 60.663 1.00 31.46 C ATOM 9015 CG TRP B 60 69.257 43.612 62.129 1.00 31.17 C ATOM 9016 CD1 TRP B 60 68.499 44.058 63.170 1.00 31.25 C ATOM 9017 CD2 TRP B 60 70.451 43.068 62.705 1.00 30.69 C ATOM 9018 NE1 TRP B 60 69.141 43.809 64.368 1.00 31.49 N ATOM 9019 CE2 TRP B 60 70.343 43.205 64.106 1.00 31.56 C ATOM 9020 CE3 TRP B 60 71.600 42.474 62.172 1.00 32.04 C ATOM 9021 CZ2 TRP B 60 71.338 42.769 64.980 1.00 31.87 C ATOM 9022 CZ3 TRP B 60 72.596 42.044 63.047 1.00 31.26 C ATOM 9023 CH2 TRP B 60 72.454 42.193 64.430 1.00 32.03 C ATOM 9024 HA TRP B 60 66.836 43.917 61.087 1.00 0.00 H ATOM 9025 HB2 TRP B 60 69.530 42.961 60.134 1.00 0.00 H ATOM 9026 HB3 TRP B 60 69.189 44.698 60.314 1.00 0.00 H ATOM 9027 HE1 TRP B 60 68.773 44.042 65.312 1.00 0.00 H ATOM 9028 HD1 TRP B 60 67.527 44.541 63.072 1.00 0.00 H ATOM 9029 HZ2 TRP B 60 71.233 42.882 66.059 1.00 0.00 H ATOM 9030 HH2 TRP B 60 73.250 41.843 65.087 1.00 0.00 H ATOM 9031 HZ3 TRP B 60 73.500 41.584 62.647 1.00 0.00 H ATOM 9032 HE3 TRP B 60 71.714 42.350 61.095 1.00 0.00 H ATOM 9033 H TRP B 60 67.876 41.318 60.529 1.00 0.00 H ATOM 9034 N ILE B 61 67.483 43.334 57.904 1.00 32.17 N ATOM 9035 CA ILE B 61 67.227 43.778 56.539 1.00 30.89 C ATOM 9036 C ILE B 61 65.739 44.001 56.285 1.00 30.86 C ATOM 9037 O ILE B 61 65.364 45.020 55.709 1.00 30.11 O ATOM 9038 CB ILE B 61 67.814 42.783 55.523 1.00 31.80 C ATOM 9039 CG1 ILE B 61 69.332 42.963 55.447 1.00 30.10 C ATOM 9040 CG2 ILE B 61 67.174 42.947 54.142 1.00 31.18 C ATOM 9041 CD1 ILE B 61 70.044 41.876 54.678 1.00 31.18 C ATOM 9042 HA ILE B 61 67.726 44.738 56.409 1.00 0.00 H ATOM 9043 HB ILE B 61 67.591 41.771 55.861 1.00 0.00 H ATOM 9044 HG12 ILE B 61 69.540 43.917 54.963 1.00 0.00 H ATOM 9045 HG13 ILE B 61 69.726 42.978 56.463 1.00 0.00 H ATOM 9046 HD11 ILE B 61 69.858 40.914 55.155 1.00 0.00 H ATOM 9047 HD12 ILE B 61 69.671 41.853 53.654 1.00 0.00 H ATOM 9048 HD13 ILE B 61 71.115 42.079 54.672 1.00 0.00 H ATOM 9049 HG21 ILE B 61 66.101 42.771 54.217 1.00 0.00 H ATOM 9050 HG22 ILE B 61 67.353 43.959 53.778 1.00 0.00 H ATOM 9051 HG23 ILE B 61 67.614 42.228 53.451 1.00 0.00 H ATOM 9052 H ILE B 61 67.945 42.414 58.054 1.00 0.00 H ATOM 9053 N GLU B 62 64.895 43.066 56.727 1.00 29.15 N ATOM 9054 CA GLU B 62 63.438 43.177 56.522 1.00 29.02 C ATOM 9055 C GLU B 62 62.788 44.286 57.370 1.00 29.48 C ATOM 9056 O GLU B 62 61.864 44.963 56.922 1.00 29.52 O ATOM 9057 CB GLU B 62 62.728 41.819 56.731 1.00 27.30 C ATOM 9058 CG GLU B 62 63.078 40.768 55.658 1.00 26.41 C ATOM 9059 CD GLU B 62 62.044 39.636 55.536 1.00 26.70 C ATOM 9060 OE1 GLU B 62 60.871 39.819 55.950 1.00 27.15 O ATOM 9061 OE2 GLU B 62 62.400 38.559 55.011 1.00 23.62 O ATOM 9062 HA GLU B 62 63.304 43.471 55.481 1.00 0.00 H ATOM 9063 HB2 GLU B 62 63.016 41.426 57.706 1.00 0.00 H ATOM 9064 HB3 GLU B 62 61.651 41.986 56.712 1.00 0.00 H ATOM 9065 HG2 GLU B 62 63.151 41.272 54.694 1.00 0.00 H ATOM 9066 HG3 GLU B 62 64.042 40.327 55.910 1.00 0.00 H ATOM 9067 H GLU B 62 65.274 42.238 57.229 1.00 0.00 H ATOM 9068 N TRP B 63 63.269 44.468 58.597 1.00 30.76 N ATOM 9069 CA TRP B 63 62.803 45.587 59.422 1.00 31.08 C ATOM 9070 C TRP B 63 63.126 46.905 58.736 1.00 30.47 C ATOM 9071 O TRP B 63 62.288 47.811 58.681 1.00 27.71 O ATOM 9072 CB TRP B 63 63.474 45.576 60.788 1.00 30.10 C ATOM 9073 CG TRP B 63 62.849 44.665 61.797 1.00 30.92 C ATOM 9074 CD1 TRP B 63 62.843 43.300 61.785 1.00 29.95 C ATOM 9075 CD2 TRP B 63 62.163 45.060 62.989 1.00 30.74 C ATOM 9076 NE1 TRP B 63 62.179 42.821 62.894 1.00 29.97 N ATOM 9077 CE2 TRP B 63 61.758 43.885 63.648 1.00 30.99 C ATOM 9078 CE3 TRP B 63 61.846 46.298 63.560 1.00 30.58 C ATOM 9079 CZ2 TRP B 63 61.053 43.913 64.852 1.00 31.27 C ATOM 9080 CZ3 TRP B 63 61.148 46.322 64.751 1.00 29.78 C ATOM 9081 CH2 TRP B 63 60.758 45.140 65.382 1.00 30.58 C ATOM 9082 HA TRP B 63 61.726 45.480 59.551 1.00 0.00 H ATOM 9083 HB2 TRP B 63 64.511 45.269 60.652 1.00 0.00 H ATOM 9084 HB3 TRP B 63 63.446 46.590 61.186 1.00 0.00 H ATOM 9085 HE1 TRP B 63 62.023 41.818 63.121 1.00 0.00 H ATOM 9086 HD1 TRP B 63 63.297 42.680 61.012 1.00 0.00 H ATOM 9087 HZ2 TRP B 63 60.749 42.993 65.351 1.00 0.00 H ATOM 9088 HH2 TRP B 63 60.205 45.195 66.320 1.00 0.00 H ATOM 9089 HZ3 TRP B 63 60.897 47.280 65.206 1.00 0.00 H ATOM 9090 HE3 TRP B 63 62.145 47.226 63.073 1.00 0.00 H ATOM 9091 H TRP B 63 63.982 43.811 58.974 1.00 0.00 H ATOM 9092 N ALA B 64 64.347 46.996 58.212 1.00 30.71 N ATOM 9093 CA ALA B 64 64.826 48.221 57.572 1.00 32.06 C ATOM 9094 C ALA B 64 64.019 48.557 56.337 1.00 33.20 C ATOM 9095 O ALA B 64 63.599 49.697 56.160 1.00 35.27 O ATOM 9096 CB ALA B 64 66.303 48.098 57.224 1.00 30.53 C ATOM 9097 HA ALA B 64 64.698 49.037 58.284 1.00 0.00 H ATOM 9098 HB1 ALA B 64 66.876 47.926 58.135 1.00 0.00 H ATOM 9099 HB2 ALA B 64 66.445 47.261 56.540 1.00 0.00 H ATOM 9100 HB3 ALA B 64 66.641 49.019 56.749 1.00 0.00 H ATOM 9101 H ALA B 64 64.979 46.171 58.259 1.00 0.00 H ATOM 9102 N MET B 65 63.803 47.555 55.489 1.00 33.47 N ATOM 9103 CA MET B 65 63.033 47.734 54.261 1.00 34.22 C ATOM 9104 C MET B 65 61.608 48.181 54.550 1.00 33.59 C ATOM 9105 O MET B 65 61.078 49.061 53.876 1.00 34.78 O ATOM 9106 CB MET B 65 63.033 46.441 53.447 1.00 33.74 C ATOM 9107 CG MET B 65 64.412 46.051 52.959 1.00 34.11 C ATOM 9108 SD MET B 65 64.427 44.515 52.020 1.00 36.79 S ATOM 9109 CE MET B 65 63.285 44.931 50.714 1.00 33.14 C ATOM 9110 HA MET B 65 63.511 48.522 53.679 1.00 0.00 H ATOM 9111 HB2 MET B 65 62.645 45.637 54.072 1.00 0.00 H ATOM 9112 HB3 MET B 65 62.383 46.574 52.582 1.00 0.00 H ATOM 9113 HG2 MET B 65 65.065 45.935 53.824 1.00 0.00 H ATOM 9114 HG3 MET B 65 64.793 46.850 52.322 1.00 0.00 H ATOM 9115 HE1 MET B 65 62.314 45.175 51.146 1.00 0.00 H ATOM 9116 HE2 MET B 65 63.665 45.790 50.161 1.00 0.00 H ATOM 9117 HE3 MET B 65 63.181 44.081 50.040 1.00 0.00 H ATOM 9118 H MET B 65 64.194 46.616 55.707 1.00 0.00 H ATOM 9119 N GLY B 66 60.989 47.573 55.554 1.00 33.80 N ATOM 9120 CA GLY B 66 59.639 47.950 55.952 1.00 32.09 C ATOM 9121 C GLY B 66 59.578 49.363 56.510 1.00 32.90 C ATOM 9122 O GLY B 66 58.733 50.155 56.102 1.00 30.05 O ATOM 9123 HA3 GLY B 66 59.291 47.255 56.716 1.00 0.00 H ATOM 9124 HA2 GLY B 66 58.986 47.888 55.082 1.00 0.00 H ATOM 9125 H GLY B 66 61.477 46.812 56.067 1.00 0.00 H ATOM 9126 N ARG B 67 60.469 49.687 57.444 1.00 33.56 N ATOM 9127 CA ARG B 67 60.498 51.040 58.016 1.00 35.21 C ATOM 9128 C ARG B 67 60.718 52.065 56.898 1.00 35.97 C ATOM 9129 O ARG B 67 59.987 53.047 56.807 1.00 37.54 O ATOM 9130 CB ARG B 67 61.562 51.176 59.114 1.00 34.65 C ATOM 9131 CG ARG B 67 61.526 52.538 59.818 1.00 35.19 C ATOM 9132 CD ARG B 67 62.657 52.718 60.831 1.00 33.79 C ATOM 9133 NE ARG B 67 63.986 52.576 60.239 1.00 33.36 N ATOM 9134 CZ ARG B 67 65.121 52.871 60.870 1.00 34.29 C ATOM 9135 NH1 ARG B 67 65.100 53.342 62.114 1.00 34.77 N ATOM 9136 NH2 ARG B 67 66.284 52.708 60.261 1.00 33.26 N ATOM 9137 HA ARG B 67 59.536 51.233 58.491 1.00 0.00 H ATOM 9138 HB2 ARG B 67 61.396 50.396 59.857 1.00 0.00 H ATOM 9139 HB3 ARG B 67 62.546 51.044 58.663 1.00 0.00 H ATOM 9140 HG2 ARG B 67 61.607 53.321 59.064 1.00 0.00 H ATOM 9141 HG3 ARG B 67 60.574 52.634 60.340 1.00 0.00 H ATOM 9142 HD2 ARG B 67 62.544 51.968 61.614 1.00 0.00 H ATOM 9143 HD3 ARG B 67 62.576 53.713 61.268 1.00 0.00 H ATOM 9144 HE ARG B 67 64.049 52.222 59.263 1.00 0.00 H ATOM 9145 HH12 ARG B 67 65.991 53.570 62.599 1.00 0.00 H ATOM 9146 HH11 ARG B 67 64.192 53.483 62.602 1.00 0.00 H ATOM 9147 HH22 ARG B 67 67.168 52.940 60.758 1.00 0.00 H ATOM 9148 HH21 ARG B 67 66.314 52.348 59.286 1.00 0.00 H ATOM 9149 H ARG B 67 61.152 48.975 57.772 1.00 0.00 H ATOM 9150 N TYR B 68 61.712 51.811 56.048 1.00 37.25 N ATOM 9151 CA TYR B 68 61.984 52.638 54.867 1.00 39.60 C ATOM 9152 C TYR B 68 60.728 52.872 54.023 1.00 40.45 C ATOM 9153 O TYR B 68 60.365 54.016 53.743 1.00 41.56 O ATOM 9154 CB TYR B 68 63.081 51.998 54.005 1.00 40.91 C ATOM 9155 CG TYR B 68 63.438 52.776 52.748 1.00 42.22 C ATOM 9156 CD1 TYR B 68 64.362 53.819 52.789 1.00 42.80 C ATOM 9157 CD2 TYR B 68 62.858 52.464 51.520 1.00 42.06 C ATOM 9158 CE1 TYR B 68 64.695 54.532 51.642 1.00 42.99 C ATOM 9159 CE2 TYR B 68 63.184 53.173 50.370 1.00 42.82 C ATOM 9160 CZ TYR B 68 64.103 54.204 50.440 1.00 43.22 C ATOM 9161 OH TYR B 68 64.433 54.914 49.303 1.00 43.42 O ATOM 9162 HA TYR B 68 62.325 53.608 55.228 1.00 0.00 H ATOM 9163 HB3 TYR B 68 62.742 51.006 53.706 1.00 0.00 H ATOM 9164 HB2 TYR B 68 63.980 51.905 54.614 1.00 0.00 H ATOM 9165 HD2 TYR B 68 62.136 51.650 51.460 1.00 0.00 H ATOM 9166 HE2 TYR B 68 62.718 52.918 49.418 1.00 0.00 H ATOM 9167 HE1 TYR B 68 65.419 55.345 51.693 1.00 0.00 H ATOM 9168 HD1 TYR B 68 64.832 54.081 53.737 1.00 0.00 H ATOM 9169 HH TYR B 68 65.099 55.610 49.532 1.00 0.00 H ATOM 9170 H TYR B 68 62.323 50.989 56.230 1.00 0.00 H ATOM 9171 N GLY B 69 60.065 51.789 53.626 1.00 39.29 N ATOM 9172 CA GLY B 69 58.867 51.889 52.798 1.00 37.10 C ATOM 9173 C GLY B 69 57.693 52.555 53.489 1.00 37.77 C ATOM 9174 O GLY B 69 56.956 53.330 52.870 1.00 37.34 O ATOM 9175 HA3 GLY B 69 58.567 50.883 52.506 1.00 0.00 H ATOM 9176 HA2 GLY B 69 59.113 52.467 51.907 1.00 0.00 H ATOM 9177 H GLY B 69 60.408 50.850 53.912 1.00 0.00 H ATOM 9178 N GLY B 70 57.505 52.249 54.769 1.00 37.52 N ATOM 9179 CA GLY B 70 56.422 52.836 55.556 1.00 37.76 C ATOM 9180 C GLY B 70 56.480 54.353 55.620 1.00 38.91 C ATOM 9181 O GLY B 70 55.444 55.025 55.592 1.00 37.69 O ATOM 9182 HA3 GLY B 70 56.480 52.444 56.571 1.00 0.00 H ATOM 9183 HA2 GLY B 70 55.472 52.544 55.109 1.00 0.00 H ATOM 9184 H GLY B 70 58.149 51.571 55.225 1.00 0.00 H ATOM 9185 N ALA B 71 57.699 54.891 55.700 1.00 40.20 N ATOM 9186 CA ALA B 71 57.925 56.342 55.718 1.00 41.29 C ATOM 9187 C ALA B 71 57.364 57.024 54.468 1.00 41.40 C ATOM 9188 O ALA B 71 57.007 58.205 54.495 1.00 41.45 O ATOM 9189 CB ALA B 71 59.410 56.648 55.867 1.00 40.14 C ATOM 9190 HA ALA B 71 57.390 56.744 56.579 1.00 0.00 H ATOM 9191 HB1 ALA B 71 59.776 56.220 56.800 1.00 0.00 H ATOM 9192 HB2 ALA B 71 59.955 56.214 55.029 1.00 0.00 H ATOM 9193 HB3 ALA B 71 59.558 57.728 55.878 1.00 0.00 H ATOM 9194 H ALA B 71 58.522 54.257 55.752 1.00 0.00 H ATOM 9195 N GLN B 72 57.288 56.271 53.374 1.00 41.47 N ATOM 9196 CA GLN B 72 56.755 56.786 52.121 1.00 39.90 C ATOM 9197 C GLN B 72 55.331 56.292 51.861 1.00 38.81 C ATOM 9198 O GLN B 72 54.781 56.503 50.779 1.00 39.07 O ATOM 9199 CB GLN B 72 57.678 56.413 50.962 1.00 41.42 C ATOM 9200 CG GLN B 72 59.118 56.872 51.164 1.00 43.02 C ATOM 9201 CD GLN B 72 59.968 56.700 49.926 1.00 44.59 C ATOM 9202 OE1 GLN B 72 59.528 56.994 48.815 1.00 46.99 O ATOM 9203 NE2 GLN B 72 61.200 56.229 50.109 1.00 44.52 N ATOM 9204 HA GLN B 72 56.709 57.872 52.201 1.00 0.00 H ATOM 9205 HB2 GLN B 72 57.673 55.329 50.851 1.00 0.00 H ATOM 9206 HB3 GLN B 72 57.293 56.872 50.052 1.00 0.00 H ATOM 9207 HG2 GLN B 72 59.112 57.927 51.439 1.00 0.00 H ATOM 9208 HG3 GLN B 72 59.559 56.290 51.973 1.00 0.00 H ATOM 9209 HE22 GLN B 72 61.530 55.994 51.067 1.00 0.00 H ATOM 9210 HE21 GLN B 72 61.832 56.097 49.294 1.00 0.00 H ATOM 9211 H GLN B 72 57.619 55.286 53.415 1.00 0.00 H ATOM 9212 N GLY B 73 54.730 55.642 52.850 1.00 36.65 N ATOM 9213 CA GLY B 73 53.361 55.148 52.709 1.00 35.19 C ATOM 9214 C GLY B 73 53.208 53.797 52.019 1.00 35.30 C ATOM 9215 O GLY B 73 52.163 53.507 51.435 1.00 33.65 O ATOM 9216 HA3 GLY B 73 52.798 55.883 52.133 1.00 0.00 H ATOM 9217 HA2 GLY B 73 52.932 55.064 53.707 1.00 0.00 H ATOM 9218 H GLY B 73 55.242 55.481 53.741 1.00 0.00 H ATOM 9219 N HIS B 74 54.240 52.964 52.090 1.00 34.69 N ATOM 9220 CA HIS B 74 54.206 51.642 51.465 1.00 34.79 C ATOM 9221 C HIS B 74 54.703 50.563 52.416 1.00 33.72 C ATOM 9222 O HIS B 74 55.806 50.659 52.950 1.00 34.39 O ATOM 9223 CB HIS B 74 55.026 51.646 50.173 1.00 35.10 C ATOM 9224 CG HIS B 74 54.569 52.676 49.191 1.00 35.96 C ATOM 9225 ND1 HIS B 74 53.456 52.503 48.398 1.00 36.40 N ATOM 9226 CD2 HIS B 74 55.060 53.901 48.889 1.00 36.78 C ATOM 9227 CE1 HIS B 74 53.285 53.573 47.644 1.00 37.41 C ATOM 9228 NE2 HIS B 74 54.245 54.435 47.920 1.00 37.53 N ATOM 9229 HA HIS B 74 53.169 51.411 51.222 1.00 0.00 H ATOM 9230 HB2 HIS B 74 56.068 51.844 50.424 1.00 0.00 H ATOM 9231 HB3 HIS B 74 54.946 50.663 49.708 1.00 0.00 H ATOM 9232 HD2 HIS B 74 55.937 54.374 49.331 1.00 0.00 H ATOM 9233 HE1 HIS B 74 52.486 53.720 46.917 1.00 0.00 H ATOM 9234 H HIS B 74 55.095 53.259 52.603 1.00 0.00 H ATOM 9235 N GLY B 75 53.885 49.539 52.627 1.00 32.11 N ATOM 9236 CA GLY B 75 54.239 48.462 53.541 1.00 29.43 C ATOM 9237 C GLY B 75 54.533 47.122 52.886 1.00 30.03 C ATOM 9238 O GLY B 75 55.010 46.197 53.547 1.00 28.54 O ATOM 9239 HA3 GLY B 75 53.410 48.323 54.235 1.00 0.00 H ATOM 9240 HA2 GLY B 75 55.127 48.768 54.094 1.00 0.00 H ATOM 9241 H GLY B 75 52.972 49.505 52.129 1.00 0.00 H ATOM 9242 N THR B 76 54.255 47.007 51.590 1.00 28.99 N ATOM 9243 CA THR B 76 54.472 45.737 50.889 1.00 28.48 C ATOM 9244 C THR B 76 55.505 45.829 49.767 1.00 28.99 C ATOM 9245 O THR B 76 55.853 46.925 49.319 1.00 28.33 O ATOM 9246 CB THR B 76 53.169 45.179 50.340 1.00 26.81 C ATOM 9247 OG1 THR B 76 52.572 46.152 49.487 1.00 27.13 O ATOM 9248 CG2 THR B 76 52.212 44.868 51.477 1.00 27.22 C ATOM 9249 HA THR B 76 54.872 45.057 51.641 1.00 0.00 H ATOM 9250 HB THR B 76 53.377 44.264 49.786 1.00 0.00 H ATOM 9251 HG1 THR B 76 52.392 46.977 50.004 1.00 0.00 H ATOM 9252 HG23 THR B 76 52.661 44.124 52.135 1.00 0.00 H ATOM 9253 HG21 THR B 76 52.011 45.779 52.041 1.00 0.00 H ATOM 9254 HG22 THR B 76 51.279 44.478 51.069 1.00 0.00 H ATOM 9255 H THR B 76 53.880 47.825 51.069 1.00 0.00 H ATOM 9256 N THR B 77 55.972 44.667 49.312 1.00 27.52 N ATOM 9257 CA THR B 77 57.132 44.581 48.410 1.00 28.52 C ATOM 9258 C THR B 77 56.962 45.002 46.929 1.00 29.92 C ATOM 9259 O THR B 77 57.944 45.405 46.315 1.00 30.27 O ATOM 9260 CB THR B 77 57.773 43.183 48.477 1.00 27.70 C ATOM 9261 OG1 THR B 77 56.770 42.184 48.249 1.00 25.27 O ATOM 9262 CG2 THR B 77 58.401 42.971 49.852 1.00 25.63 C ATOM 9263 HA THR B 77 57.780 45.359 48.814 1.00 0.00 H ATOM 9264 HB THR B 77 58.545 43.103 47.712 1.00 0.00 H ATOM 9265 HG1 THR B 77 56.368 42.320 47.355 1.00 0.00 H ATOM 9266 HG23 THR B 77 59.163 43.731 50.023 1.00 0.00 H ATOM 9267 HG21 THR B 77 57.630 43.049 50.618 1.00 0.00 H ATOM 9268 HG22 THR B 77 58.857 41.982 49.893 1.00 0.00 H ATOM 9269 H THR B 77 55.499 43.788 49.605 1.00 0.00 H ATOM 9270 N PRO B 78 55.743 44.913 46.347 1.00 29.22 N ATOM 9271 CA PRO B 78 55.664 45.469 44.990 1.00 30.67 C ATOM 9272 C PRO B 78 56.136 46.933 44.914 1.00 32.27 C ATOM 9273 O PRO B 78 56.886 47.289 44.008 1.00 33.45 O ATOM 9274 CB PRO B 78 54.175 45.373 44.648 1.00 30.51 C ATOM 9275 CG PRO B 78 53.651 44.260 45.517 1.00 28.94 C ATOM 9276 CD PRO B 78 54.456 44.349 46.794 1.00 29.07 C ATOM 9277 HA PRO B 78 56.313 44.929 44.300 1.00 0.00 H ATOM 9278 HD3 PRO B 78 53.971 45.006 47.516 1.00 0.00 H ATOM 9279 HD2 PRO B 78 54.595 43.363 47.238 1.00 0.00 H ATOM 9280 HG3 PRO B 78 53.802 43.294 45.035 1.00 0.00 H ATOM 9281 HG2 PRO B 78 52.590 44.401 45.722 1.00 0.00 H ATOM 9282 HB2 PRO B 78 53.667 46.310 44.876 1.00 0.00 H ATOM 9283 HB3 PRO B 78 54.038 45.134 43.593 1.00 0.00 H ATOM 9284 N ALA B 79 55.697 47.764 45.856 1.00 33.36 N ATOM 9285 CA ALA B 79 56.103 49.170 45.892 1.00 33.26 C ATOM 9286 C ALA B 79 57.486 49.375 46.505 1.00 34.07 C ATOM 9287 O ALA B 79 58.275 50.190 46.010 1.00 34.66 O ATOM 9288 CB ALA B 79 55.071 50.005 46.642 1.00 33.11 C ATOM 9289 HA ALA B 79 56.161 49.502 44.855 1.00 0.00 H ATOM 9290 HB1 ALA B 79 54.107 49.927 46.139 1.00 0.00 H ATOM 9291 HB2 ALA B 79 54.980 49.636 47.664 1.00 0.00 H ATOM 9292 HB3 ALA B 79 55.391 51.047 46.658 1.00 0.00 H ATOM 9293 H ALA B 79 55.049 47.405 46.586 1.00 0.00 H ATOM 9294 N ILE B 80 57.785 48.645 47.578 1.00 33.46 N ATOM 9295 CA ILE B 80 59.057 48.818 48.294 1.00 32.93 C ATOM 9296 C ILE B 80 60.264 48.413 47.441 1.00 33.90 C ATOM 9297 O ILE B 80 61.285 49.106 47.419 1.00 34.40 O ATOM 9298 CB ILE B 80 59.063 48.064 49.641 1.00 32.84 C ATOM 9299 CG1 ILE B 80 58.078 48.717 50.611 1.00 32.51 C ATOM 9300 CG2 ILE B 80 60.471 48.025 50.243 1.00 31.22 C ATOM 9301 CD1 ILE B 80 57.944 47.984 51.934 1.00 32.30 C ATOM 9302 HA ILE B 80 59.147 49.884 48.504 1.00 0.00 H ATOM 9303 HB ILE B 80 58.750 47.035 49.462 1.00 0.00 H ATOM 9304 HG12 ILE B 80 58.417 49.733 50.813 1.00 0.00 H ATOM 9305 HG13 ILE B 80 57.098 48.750 50.135 1.00 0.00 H ATOM 9306 HD11 ILE B 80 57.594 46.968 51.751 1.00 0.00 H ATOM 9307 HD12 ILE B 80 58.914 47.952 52.430 1.00 0.00 H ATOM 9308 HD13 ILE B 80 57.228 48.508 52.567 1.00 0.00 H ATOM 9309 HG21 ILE B 80 61.145 47.516 49.554 1.00 0.00 H ATOM 9310 HG22 ILE B 80 60.821 49.043 50.411 1.00 0.00 H ATOM 9311 HG23 ILE B 80 60.445 47.488 51.191 1.00 0.00 H ATOM 9312 H ILE B 80 57.103 47.937 47.917 1.00 0.00 H ATOM 9313 N PHE B 81 60.139 47.295 46.736 1.00 33.61 N ATOM 9314 CA PHE B 81 61.175 46.847 45.809 1.00 33.05 C ATOM 9315 C PHE B 81 61.450 47.898 44.731 1.00 33.84 C ATOM 9316 O PHE B 81 62.587 48.085 44.303 1.00 32.40 O ATOM 9317 CB PHE B 81 60.745 45.533 45.158 1.00 32.86 C ATOM 9318 CG PHE B 81 61.069 44.305 45.977 1.00 32.01 C ATOM 9319 CD1 PHE B 81 61.377 44.405 47.327 1.00 31.76 C ATOM 9320 CD2 PHE B 81 61.045 43.045 45.392 1.00 31.89 C ATOM 9321 CE1 PHE B 81 61.670 43.269 48.080 1.00 32.48 C ATOM 9322 CE2 PHE B 81 61.342 41.902 46.139 1.00 32.12 C ATOM 9323 CZ PHE B 81 61.653 42.019 47.486 1.00 31.19 C ATOM 9324 HA PHE B 81 62.096 46.695 46.372 1.00 0.00 H ATOM 9325 HB2 PHE B 81 59.667 45.565 45.000 1.00 0.00 H ATOM 9326 HB3 PHE B 81 61.249 45.446 44.196 1.00 0.00 H ATOM 9327 HD2 PHE B 81 60.791 42.947 44.337 1.00 0.00 H ATOM 9328 HE2 PHE B 81 61.329 40.921 45.665 1.00 0.00 H ATOM 9329 HZ PHE B 81 61.883 41.130 48.074 1.00 0.00 H ATOM 9330 HE1 PHE B 81 61.913 43.365 49.138 1.00 0.00 H ATOM 9331 HD1 PHE B 81 61.390 45.385 47.805 1.00 0.00 H ATOM 9332 H PHE B 81 59.278 46.722 46.847 1.00 0.00 H ATOM 9333 N TYR B 82 60.392 48.574 44.297 1.00 35.35 N ATOM 9334 CA TYR B 82 60.483 49.600 43.266 1.00 37.21 C ATOM 9335 C TYR B 82 61.157 50.867 43.788 1.00 38.44 C ATOM 9336 O TYR B 82 61.782 51.603 43.026 1.00 39.42 O ATOM 9337 CB TYR B 82 59.090 49.936 42.736 1.00 37.71 C ATOM 9338 CG TYR B 82 59.092 50.805 41.501 1.00 38.40 C ATOM 9339 CD1 TYR B 82 59.575 50.320 40.288 1.00 37.82 C ATOM 9340 CD2 TYR B 82 58.599 52.104 41.539 1.00 39.19 C ATOM 9341 CE1 TYR B 82 59.575 51.107 39.151 1.00 38.66 C ATOM 9342 CE2 TYR B 82 58.593 52.904 40.398 1.00 39.48 C ATOM 9343 CZ TYR B 82 59.084 52.398 39.212 1.00 39.01 C ATOM 9344 OH TYR B 82 59.084 53.181 38.078 1.00 40.07 O ATOM 9345 HA TYR B 82 61.096 49.202 42.458 1.00 0.00 H ATOM 9346 HB3 TYR B 82 58.542 50.457 43.521 1.00 0.00 H ATOM 9347 HB2 TYR B 82 58.580 49.003 42.497 1.00 0.00 H ATOM 9348 HD2 TYR B 82 58.211 52.503 42.476 1.00 0.00 H ATOM 9349 HE2 TYR B 82 58.204 53.921 40.442 1.00 0.00 H ATOM 9350 HE1 TYR B 82 59.960 50.711 38.211 1.00 0.00 H ATOM 9351 HD1 TYR B 82 59.960 49.302 40.234 1.00 0.00 H ATOM 9352 HH TYR B 82 59.467 52.667 37.324 1.00 0.00 H ATOM 9353 H TYR B 82 59.461 48.363 44.710 1.00 0.00 H ATOM 9354 N LEU B 83 61.020 51.116 45.087 1.00 38.52 N ATOM 9355 CA LEU B 83 61.657 52.263 45.721 1.00 38.90 C ATOM 9356 C LEU B 83 63.160 52.042 45.839 1.00 40.19 C ATOM 9357 O LEU B 83 63.944 52.993 45.800 1.00 41.86 O ATOM 9358 CB LEU B 83 61.062 52.510 47.106 1.00 38.37 C ATOM 9359 CG LEU B 83 59.632 53.034 47.219 1.00 39.53 C ATOM 9360 CD1 LEU B 83 59.245 53.205 48.682 1.00 38.80 C ATOM 9361 CD2 LEU B 83 59.465 54.352 46.462 1.00 40.75 C ATOM 9362 HA LEU B 83 61.476 53.138 45.097 1.00 0.00 H ATOM 9363 HB2 LEU B 83 61.097 51.562 47.642 1.00 0.00 H ATOM 9364 HB3 LEU B 83 61.707 53.233 47.606 1.00 0.00 H ATOM 9365 HG LEU B 83 58.966 52.301 46.764 1.00 0.00 H ATOM 9366 HD21 LEU B 83 60.143 55.097 46.878 1.00 0.00 H ATOM 9367 HD22 LEU B 83 59.697 54.196 45.408 1.00 0.00 H ATOM 9368 HD23 LEU B 83 58.437 54.699 46.562 1.00 0.00 H ATOM 9369 HD11 LEU B 83 59.313 52.243 49.189 1.00 0.00 H ATOM 9370 HD12 LEU B 83 59.923 53.915 49.155 1.00 0.00 H ATOM 9371 HD13 LEU B 83 58.223 53.579 48.745 1.00 0.00 H ATOM 9372 H LEU B 83 60.442 50.474 45.667 1.00 0.00 H ATOM 9373 N LEU B 84 63.559 50.782 45.981 1.00 40.19 N ATOM 9374 CA LEU B 84 64.965 50.425 46.129 1.00 41.22 C ATOM 9375 C LEU B 84 65.597 50.178 44.776 1.00 42.24 C ATOM 9376 O LEU B 84 66.811 50.288 44.614 1.00 43.33 O ATOM 9377 CB LEU B 84 65.106 49.169 46.989 1.00 40.03 C ATOM 9378 CG LEU B 84 64.445 49.260 48.362 1.00 40.27 C ATOM 9379 CD1 LEU B 84 64.567 47.944 49.102 1.00 39.24 C ATOM 9380 CD2 LEU B 84 65.044 50.407 49.178 1.00 39.92 C ATOM 9381 HA LEU B 84 65.476 51.256 46.615 1.00 0.00 H ATOM 9382 HB2 LEU B 84 64.656 48.335 46.450 1.00 0.00 H ATOM 9383 HB3 LEU B 84 66.168 48.975 47.135 1.00 0.00 H ATOM 9384 HG LEU B 84 63.385 49.469 48.218 1.00 0.00 H ATOM 9385 HD21 LEU B 84 66.112 50.237 49.312 1.00 0.00 H ATOM 9386 HD22 LEU B 84 64.888 51.347 48.649 1.00 0.00 H ATOM 9387 HD23 LEU B 84 64.557 50.451 50.152 1.00 0.00 H ATOM 9388 HD11 LEU B 84 64.078 47.158 48.526 1.00 0.00 H ATOM 9389 HD12 LEU B 84 65.621 47.699 49.233 1.00 0.00 H ATOM 9390 HD13 LEU B 84 64.089 48.032 50.078 1.00 0.00 H ATOM 9391 H LEU B 84 62.845 50.026 45.987 1.00 0.00 H ATOM 9392 N TRP B 85 64.760 49.839 43.804 1.00 43.17 N ATOM 9393 CA TRP B 85 65.212 49.540 42.462 1.00 44.11 C ATOM 9394 C TRP B 85 64.123 49.974 41.490 1.00 45.09 C ATOM 9395 O TRP B 85 63.092 49.319 41.361 1.00 44.25 O ATOM 9396 CB TRP B 85 65.541 48.053 42.343 1.00 44.90 C ATOM 9397 CG TRP B 85 66.001 47.606 40.986 1.00 45.31 C ATOM 9398 CD1 TRP B 85 66.665 48.351 40.050 1.00 45.47 C ATOM 9399 CD2 TRP B 85 65.858 46.294 40.428 1.00 45.42 C ATOM 9400 NE1 TRP B 85 66.924 47.587 38.940 1.00 45.61 N ATOM 9401 CE2 TRP B 85 66.441 46.321 39.145 1.00 45.42 C ATOM 9402 CE3 TRP B 85 65.284 45.101 40.886 1.00 45.31 C ATOM 9403 CZ2 TRP B 85 66.469 45.200 38.313 1.00 45.44 C ATOM 9404 CZ3 TRP B 85 65.312 43.990 40.062 1.00 45.69 C ATOM 9405 CH2 TRP B 85 65.900 44.047 38.788 1.00 45.61 C ATOM 9406 HA TRP B 85 66.127 50.083 42.224 1.00 0.00 H ATOM 9407 HB2 TRP B 85 66.330 47.824 43.059 1.00 0.00 H ATOM 9408 HB3 TRP B 85 64.645 47.488 42.599 1.00 0.00 H ATOM 9409 HE1 TRP B 85 67.409 47.916 38.081 1.00 0.00 H ATOM 9410 HD1 TRP B 85 66.947 49.397 40.169 1.00 0.00 H ATOM 9411 HZ2 TRP B 85 66.926 45.240 37.324 1.00 0.00 H ATOM 9412 HH2 TRP B 85 65.904 43.154 38.163 1.00 0.00 H ATOM 9413 HZ3 TRP B 85 64.870 43.055 40.407 1.00 0.00 H ATOM 9414 HE3 TRP B 85 64.824 45.049 41.873 1.00 0.00 H ATOM 9415 H TRP B 85 63.743 49.786 44.014 1.00 0.00 H ATOM 9416 N ARG B 86 64.364 51.100 40.825 1.00 46.17 N ATOM 9417 CA ARG B 86 63.389 51.716 39.923 1.00 48.16 C ATOM 9418 C ARG B 86 63.300 51.010 38.575 1.00 48.63 C ATOM 9419 O ARG B 86 63.699 51.552 37.541 1.00 47.32 O ATOM 9420 CB ARG B 86 63.725 53.196 39.730 1.00 49.20 C ATOM 9421 CG ARG B 86 63.359 54.061 40.914 1.00 50.87 C ATOM 9422 CD ARG B 86 61.895 54.429 40.859 1.00 53.72 C ATOM 9423 NE ARG B 86 61.453 55.132 42.059 1.00 56.51 N ATOM 9424 CZ ARG B 86 60.353 55.878 42.123 1.00 57.40 C ATOM 9425 NH1 ARG B 86 59.584 56.030 41.047 1.00 58.25 N ATOM 9426 NH2 ARG B 86 60.029 56.482 43.258 1.00 57.98 N ATOM 9427 HA ARG B 86 62.409 51.617 40.390 1.00 0.00 H ATOM 9428 HB2 ARG B 86 64.797 53.286 39.556 1.00 0.00 H ATOM 9429 HB3 ARG B 86 63.185 53.561 38.857 1.00 0.00 H ATOM 9430 HG2 ARG B 86 63.559 53.514 41.835 1.00 0.00 H ATOM 9431 HG3 ARG B 86 63.960 54.970 40.895 1.00 0.00 H ATOM 9432 HD2 ARG B 86 61.308 53.517 40.751 1.00 0.00 H ATOM 9433 HD3 ARG B 86 61.727 55.072 39.995 1.00 0.00 H ATOM 9434 HE ARG B 86 62.034 55.045 42.917 1.00 0.00 H ATOM 9435 HH12 ARG B 86 58.725 56.614 41.100 1.00 0.00 H ATOM 9436 HH11 ARG B 86 59.842 55.565 40.153 1.00 0.00 H ATOM 9437 HH22 ARG B 86 59.170 57.065 43.310 1.00 0.00 H ATOM 9438 HH21 ARG B 86 60.634 56.372 44.097 1.00 0.00 H ATOM 9439 H ARG B 86 65.286 51.564 40.951 1.00 0.00 H ATOM 9440 N ASN B 87 62.757 49.799 38.605 1.00 49.11 N ATOM 9441 CA ASN B 87 62.627 48.965 37.426 1.00 50.50 C ATOM 9442 C ASN B 87 61.319 48.179 37.508 1.00 51.04 C ATOM 9443 O ASN B 87 60.925 47.725 38.580 1.00 50.65 O ATOM 9444 CB ASN B 87 63.837 48.036 37.330 1.00 51.30 C ATOM 9445 CG ASN B 87 63.901 47.272 36.020 1.00 52.73 C ATOM 9446 OD1 ASN B 87 62.971 46.558 35.651 1.00 52.86 O ATOM 9447 ND2 ASN B 87 65.022 47.406 35.319 1.00 53.17 N ATOM 9448 HA ASN B 87 62.599 49.578 36.525 1.00 0.00 H ATOM 9449 HB2 ASN B 87 64.743 48.635 37.427 1.00 0.00 H ATOM 9450 HB3 ASN B 87 63.789 47.318 38.148 1.00 0.00 H ATOM 9451 HD22 ASN B 87 65.784 48.021 35.669 1.00 0.00 H ATOM 9452 HD21 ASN B 87 65.137 46.896 34.420 1.00 0.00 H ATOM 9453 H ASN B 87 62.410 49.432 39.514 1.00 0.00 H ATOM 9454 N ARG B 88 60.650 48.030 36.368 1.00 51.20 N ATOM 9455 CA ARG B 88 59.367 47.332 36.288 1.00 51.84 C ATOM 9456 C ARG B 88 59.468 45.892 36.797 1.00 50.35 C ATOM 9457 O ARG B 88 58.483 45.313 37.261 1.00 49.96 O ATOM 9458 CB ARG B 88 58.858 47.341 34.844 1.00 53.79 C ATOM 9459 CG ARG B 88 57.391 46.961 34.672 1.00 57.47 C ATOM 9460 CD ARG B 88 56.450 48.056 35.163 1.00 60.04 C ATOM 9461 NE ARG B 88 56.632 49.317 34.444 1.00 62.42 N ATOM 9462 CZ ARG B 88 57.200 50.407 34.959 1.00 63.57 C ATOM 9463 NH1 ARG B 88 57.648 50.407 36.209 1.00 63.68 N ATOM 9464 NH2 ARG B 88 57.318 51.505 34.218 1.00 64.43 N ATOM 9465 HA ARG B 88 58.662 47.860 36.930 1.00 0.00 H ATOM 9466 HB2 ARG B 88 58.996 48.345 34.443 1.00 0.00 H ATOM 9467 HB3 ARG B 88 59.459 46.636 34.270 1.00 0.00 H ATOM 9468 HG2 ARG B 88 57.197 46.779 33.615 1.00 0.00 H ATOM 9469 HG3 ARG B 88 57.195 46.050 35.238 1.00 0.00 H ATOM 9470 HD2 ARG B 88 56.637 48.228 36.223 1.00 0.00 H ATOM 9471 HD3 ARG B 88 55.422 47.721 35.026 1.00 0.00 H ATOM 9472 HE ARG B 88 56.294 49.366 33.462 1.00 0.00 H ATOM 9473 HH12 ARG B 88 58.090 51.262 36.603 1.00 0.00 H ATOM 9474 HH11 ARG B 88 57.557 49.552 36.794 1.00 0.00 H ATOM 9475 HH22 ARG B 88 57.761 52.357 34.618 1.00 0.00 H ATOM 9476 HH21 ARG B 88 56.967 51.512 33.239 1.00 0.00 H ATOM 9477 H ARG B 88 61.056 48.427 35.497 1.00 0.00 H ATOM 9478 N PHE B 89 60.666 45.327 36.708 1.00 47.82 N ATOM 9479 CA PHE B 89 60.926 43.975 37.175 1.00 46.99 C ATOM 9480 C PHE B 89 60.908 43.872 38.712 1.00 45.10 C ATOM 9481 O PHE B 89 60.647 42.797 39.260 1.00 44.20 O ATOM 9482 CB PHE B 89 62.257 43.472 36.611 1.00 48.52 C ATOM 9483 CG PHE B 89 62.450 41.989 36.740 1.00 50.40 C ATOM 9484 CD1 PHE B 89 61.489 41.104 36.264 1.00 51.08 C ATOM 9485 CD2 PHE B 89 63.603 41.476 37.319 1.00 51.02 C ATOM 9486 CE1 PHE B 89 61.663 39.733 36.374 1.00 51.39 C ATOM 9487 CE2 PHE B 89 63.788 40.102 37.431 1.00 51.71 C ATOM 9488 CZ PHE B 89 62.816 39.230 36.959 1.00 51.93 C ATOM 9489 HA PHE B 89 60.119 43.340 36.809 1.00 0.00 H ATOM 9490 HB2 PHE B 89 62.303 43.734 35.554 1.00 0.00 H ATOM 9491 HB3 PHE B 89 63.066 43.971 37.143 1.00 0.00 H ATOM 9492 HD2 PHE B 89 64.370 42.156 37.689 1.00 0.00 H ATOM 9493 HE2 PHE B 89 64.696 39.710 37.889 1.00 0.00 H ATOM 9494 HZ PHE B 89 62.959 38.153 37.048 1.00 0.00 H ATOM 9495 HE1 PHE B 89 60.897 39.053 36.002 1.00 0.00 H ATOM 9496 HD1 PHE B 89 60.585 41.494 35.797 1.00 0.00 H ATOM 9497 H PHE B 89 61.447 45.871 36.289 1.00 0.00 H ATOM 9498 N ALA B 90 61.181 44.984 39.395 1.00 40.76 N ATOM 9499 CA ALA B 90 61.154 45.018 40.855 1.00 38.71 C ATOM 9500 C ALA B 90 59.727 44.879 41.376 1.00 37.29 C ATOM 9501 O ALA B 90 59.492 44.226 42.389 1.00 35.30 O ATOM 9502 CB ALA B 90 61.792 46.296 41.383 1.00 38.31 C ATOM 9503 HA ALA B 90 61.736 44.171 41.219 1.00 0.00 H ATOM 9504 HB1 ALA B 90 62.829 46.347 41.051 1.00 0.00 H ATOM 9505 HB2 ALA B 90 61.244 47.158 41.002 1.00 0.00 H ATOM 9506 HB3 ALA B 90 61.758 46.294 42.472 1.00 0.00 H ATOM 9507 H ALA B 90 61.420 45.852 38.874 1.00 0.00 H ATOM 9508 N LYS B 91 58.781 45.501 40.673 1.00 36.86 N ATOM 9509 CA LYS B 91 57.361 45.369 40.989 1.00 35.82 C ATOM 9510 C LYS B 91 56.914 43.920 40.837 1.00 34.56 C ATOM 9511 O LYS B 91 56.211 43.399 41.693 1.00 31.50 O ATOM 9512 CB LYS B 91 56.513 46.240 40.069 1.00 36.66 C ATOM 9513 CG LYS B 91 56.645 47.733 40.286 1.00 39.47 C ATOM 9514 CD LYS B 91 55.783 48.479 39.291 1.00 40.26 C ATOM 9515 CE LYS B 91 55.972 49.980 39.403 1.00 42.01 C ATOM 9516 NZ LYS B 91 55.289 50.698 38.286 1.00 42.12 N ATOM 9517 HA LYS B 91 57.223 45.693 42.021 1.00 0.00 H ATOM 9518 HB2 LYS B 91 56.800 46.023 39.040 1.00 0.00 H ATOM 9519 HB3 LYS B 91 55.468 45.969 40.218 1.00 0.00 H ATOM 9520 HG2 LYS B 91 56.325 47.981 41.298 1.00 0.00 H ATOM 9521 HG3 LYS B 91 57.686 48.027 40.153 1.00 0.00 H ATOM 9522 HD2 LYS B 91 56.051 48.163 38.283 1.00 0.00 H ATOM 9523 HD3 LYS B 91 54.737 48.239 39.479 1.00 0.00 H ATOM 9524 HE2 LYS B 91 57.038 50.207 39.372 1.00 0.00 H ATOM 9525 HE3 LYS B 91 55.556 50.321 40.351 1.00 0.00 H ATOM 9526 HZ1 LYS B 91 55.685 50.381 37.378 1.00 0.00 H ATOM 9527 HZ2 LYS B 91 54.270 50.489 38.313 1.00 0.00 H ATOM 9528 HZ3 LYS B 91 55.437 51.722 38.392 1.00 0.00 H ATOM 9529 H LYS B 91 59.063 46.101 39.872 1.00 0.00 H ATOM 9530 N ILE B 92 57.325 43.287 39.739 1.00 33.92 N ATOM 9531 CA ILE B 92 56.978 41.894 39.453 1.00 34.25 C ATOM 9532 C ILE B 92 57.565 40.943 40.490 1.00 32.72 C ATOM 9533 O ILE B 92 56.871 40.064 40.989 1.00 33.79 O ATOM 9534 CB ILE B 92 57.453 41.461 38.053 1.00 34.77 C ATOM 9535 CG1 ILE B 92 56.717 42.256 36.975 1.00 36.68 C ATOM 9536 CG2 ILE B 92 57.243 39.964 37.849 1.00 36.70 C ATOM 9537 CD1 ILE B 92 55.200 42.140 37.059 1.00 37.88 C ATOM 9538 HA ILE B 92 55.890 41.839 39.492 1.00 0.00 H ATOM 9539 HB ILE B 92 58.520 41.668 37.973 1.00 0.00 H ATOM 9540 HG12 ILE B 92 56.988 43.307 37.076 1.00 0.00 H ATOM 9541 HG13 ILE B 92 57.037 41.891 35.999 1.00 0.00 H ATOM 9542 HD11 ILE B 92 54.910 41.095 36.948 1.00 0.00 H ATOM 9543 HD12 ILE B 92 54.861 42.512 38.026 1.00 0.00 H ATOM 9544 HD13 ILE B 92 54.747 42.730 36.263 1.00 0.00 H ATOM 9545 HG21 ILE B 92 57.810 39.413 38.599 1.00 0.00 H ATOM 9546 HG22 ILE B 92 56.183 39.730 37.949 1.00 0.00 H ATOM 9547 HG23 ILE B 92 57.586 39.683 36.853 1.00 0.00 H ATOM 9548 H ILE B 92 57.917 43.804 39.057 1.00 0.00 H ATOM 9549 N LEU B 93 58.840 41.123 40.807 1.00 31.77 N ATOM 9550 CA LEU B 93 59.486 40.328 41.843 1.00 31.92 C ATOM 9551 C LEU B 93 58.843 40.632 43.188 1.00 30.94 C ATOM 9552 O LEU B 93 58.803 39.779 44.075 1.00 30.85 O ATOM 9553 CB LEU B 93 60.989 40.627 41.906 1.00 32.12 C ATOM 9554 CG LEU B 93 61.888 40.093 40.785 1.00 31.76 C ATOM 9555 CD1 LEU B 93 63.312 40.616 40.962 1.00 31.92 C ATOM 9556 CD2 LEU B 93 61.876 38.569 40.731 1.00 32.71 C ATOM 9557 HA LEU B 93 59.358 39.273 41.603 1.00 0.00 H ATOM 9558 HB2 LEU B 93 61.101 41.711 41.920 1.00 0.00 H ATOM 9559 HB3 LEU B 93 61.361 40.212 42.843 1.00 0.00 H ATOM 9560 HG LEU B 93 61.493 40.454 39.836 1.00 0.00 H ATOM 9561 HD21 LEU B 93 62.235 38.170 41.680 1.00 0.00 H ATOM 9562 HD22 LEU B 93 60.859 38.221 40.551 1.00 0.00 H ATOM 9563 HD23 LEU B 93 62.525 38.230 39.924 1.00 0.00 H ATOM 9564 HD11 LEU B 93 63.304 41.705 40.928 1.00 0.00 H ATOM 9565 HD12 LEU B 93 63.703 40.284 41.924 1.00 0.00 H ATOM 9566 HD13 LEU B 93 63.942 40.230 40.160 1.00 0.00 H ATOM 9567 H LEU B 93 59.391 41.848 40.305 1.00 0.00 H ATOM 9568 N GLY B 94 58.333 41.853 43.330 1.00 29.75 N ATOM 9569 CA GLY B 94 57.681 42.283 44.563 1.00 29.12 C ATOM 9570 C GLY B 94 56.383 41.547 44.825 1.00 29.31 C ATOM 9571 O GLY B 94 55.959 41.417 45.968 1.00 28.13 O ATOM 9572 HA3 GLY B 94 57.469 43.350 44.492 1.00 0.00 H ATOM 9573 HA2 GLY B 94 58.359 42.103 45.397 1.00 0.00 H ATOM 9574 H GLY B 94 58.401 42.522 42.537 1.00 0.00 H ATOM 9575 N VAL B 95 55.757 41.061 43.758 1.00 29.43 N ATOM 9576 CA VAL B 95 54.498 40.327 43.868 1.00 28.34 C ATOM 9577 C VAL B 95 54.618 39.095 44.782 1.00 27.90 C ATOM 9578 O VAL B 95 53.651 38.692 45.414 1.00 27.96 O ATOM 9579 CB VAL B 95 53.941 39.940 42.472 1.00 27.86 C ATOM 9580 CG1 VAL B 95 52.752 39.004 42.605 1.00 25.80 C ATOM 9581 CG2 VAL B 95 53.550 41.213 41.685 1.00 26.34 C ATOM 9582 HA VAL B 95 53.782 41.002 44.337 1.00 0.00 H ATOM 9583 HB VAL B 95 54.721 39.414 41.921 1.00 0.00 H ATOM 9584 HG11 VAL B 95 53.062 38.097 43.124 1.00 0.00 H ATOM 9585 HG12 VAL B 95 51.964 39.498 43.173 1.00 0.00 H ATOM 9586 HG13 VAL B 95 52.380 38.748 41.613 1.00 0.00 H ATOM 9587 HG21 VAL B 95 52.786 41.760 42.237 1.00 0.00 H ATOM 9588 HG22 VAL B 95 54.429 41.844 41.558 1.00 0.00 H ATOM 9589 HG23 VAL B 95 53.161 40.929 40.707 1.00 0.00 H ATOM 9590 H VAL B 95 56.175 41.207 42.817 1.00 0.00 H ATOM 9591 N PHE B 96 55.809 38.510 44.858 1.00 27.51 N ATOM 9592 CA PHE B 96 56.032 37.354 45.721 1.00 28.28 C ATOM 9593 C PHE B 96 55.813 37.671 47.212 1.00 28.90 C ATOM 9594 O PHE B 96 55.446 36.793 47.984 1.00 27.68 O ATOM 9595 CB PHE B 96 57.426 36.759 45.487 1.00 29.59 C ATOM 9596 CG PHE B 96 57.517 35.878 44.261 1.00 29.41 C ATOM 9597 CD1 PHE B 96 57.111 34.551 44.313 1.00 29.30 C ATOM 9598 CD2 PHE B 96 58.007 36.381 43.056 1.00 30.43 C ATOM 9599 CE1 PHE B 96 57.191 33.727 43.179 1.00 30.59 C ATOM 9600 CE2 PHE B 96 58.093 35.570 41.916 1.00 31.13 C ATOM 9601 CZ PHE B 96 57.688 34.242 41.981 1.00 30.73 C ATOM 9602 HA PHE B 96 55.283 36.610 45.447 1.00 0.00 H ATOM 9603 HB2 PHE B 96 58.135 37.579 45.374 1.00 0.00 H ATOM 9604 HB3 PHE B 96 57.696 36.164 46.359 1.00 0.00 H ATOM 9605 HD2 PHE B 96 58.328 37.421 43.000 1.00 0.00 H ATOM 9606 HE2 PHE B 96 58.476 35.980 40.981 1.00 0.00 H ATOM 9607 HZ PHE B 96 57.758 33.605 41.099 1.00 0.00 H ATOM 9608 HE1 PHE B 96 56.866 32.688 43.234 1.00 0.00 H ATOM 9609 HD1 PHE B 96 56.725 34.143 45.247 1.00 0.00 H ATOM 9610 H PHE B 96 56.597 38.883 44.292 1.00 0.00 H ATOM 9611 N GLY B 97 56.028 38.927 47.603 1.00 26.97 N ATOM 9612 CA GLY B 97 55.813 39.346 48.989 1.00 25.80 C ATOM 9613 C GLY B 97 54.347 39.548 49.309 1.00 25.56 C ATOM 9614 O GLY B 97 53.986 39.890 50.434 1.00 26.27 O ATOM 9615 HA3 GLY B 97 56.341 40.285 49.157 1.00 0.00 H ATOM 9616 HA2 GLY B 97 56.214 38.580 49.653 1.00 0.00 H ATOM 9617 H GLY B 97 56.356 39.626 46.907 1.00 0.00 H ATOM 9618 N LEU B 98 53.498 39.359 48.306 1.00 24.99 N ATOM 9619 CA LEU B 98 52.057 39.319 48.516 1.00 25.37 C ATOM 9620 C LEU B 98 51.590 37.873 48.346 1.00 24.90 C ATOM 9621 O LEU B 98 50.764 37.391 49.117 1.00 24.48 O ATOM 9622 CB LEU B 98 51.319 40.217 47.523 1.00 26.04 C ATOM 9623 CG LEU B 98 51.414 41.742 47.629 1.00 27.47 C ATOM 9624 CD1 LEU B 98 50.545 42.360 46.550 1.00 28.16 C ATOM 9625 CD2 LEU B 98 50.962 42.212 48.992 1.00 28.38 C ATOM 9626 HA LEU B 98 51.834 39.685 49.518 1.00 0.00 H ATOM 9627 HB2 LEU B 98 51.683 39.950 46.531 1.00 0.00 H ATOM 9628 HB3 LEU B 98 50.262 39.964 47.600 1.00 0.00 H ATOM 9629 HG LEU B 98 52.451 42.050 47.494 1.00 0.00 H ATOM 9630 HD21 LEU B 98 49.927 41.911 49.154 1.00 0.00 H ATOM 9631 HD22 LEU B 98 51.596 41.765 49.758 1.00 0.00 H ATOM 9632 HD23 LEU B 98 51.038 43.298 49.044 1.00 0.00 H ATOM 9633 HD11 LEU B 98 50.896 42.034 45.571 1.00 0.00 H ATOM 9634 HD12 LEU B 98 49.512 42.042 46.691 1.00 0.00 H ATOM 9635 HD13 LEU B 98 50.604 43.446 46.615 1.00 0.00 H ATOM 9636 H LEU B 98 53.872 39.236 47.343 1.00 0.00 H ATOM 9637 N TRP B 99 52.133 37.196 47.328 1.00 23.78 N ATOM 9638 CA TRP B 99 51.751 35.818 46.989 1.00 21.70 C ATOM 9639 C TRP B 99 52.145 34.813 48.065 1.00 21.11 C ATOM 9640 O TRP B 99 51.324 34.006 48.492 1.00 21.88 O ATOM 9641 CB TRP B 99 52.343 35.422 45.626 1.00 21.57 C ATOM 9642 CG TRP B 99 52.023 34.005 45.157 1.00 20.29 C ATOM 9643 CD1 TRP B 99 50.874 33.573 44.557 1.00 20.48 C ATOM 9644 CD2 TRP B 99 52.883 32.861 45.245 1.00 21.04 C ATOM 9645 NE1 TRP B 99 50.962 32.233 44.267 1.00 19.93 N ATOM 9646 CE2 TRP B 99 52.191 31.772 44.676 1.00 22.62 C ATOM 9647 CE3 TRP B 99 54.175 32.655 45.739 1.00 22.33 C ATOM 9648 CZ2 TRP B 99 52.745 30.491 44.596 1.00 22.12 C ATOM 9649 CZ3 TRP B 99 54.727 31.383 45.657 1.00 22.07 C ATOM 9650 CH2 TRP B 99 54.011 30.318 45.096 1.00 22.77 C ATOM 9651 HA TRP B 99 50.663 35.793 46.928 1.00 0.00 H ATOM 9652 HB2 TRP B 99 51.961 36.118 44.879 1.00 0.00 H ATOM 9653 HB3 TRP B 99 53.427 35.518 45.690 1.00 0.00 H ATOM 9654 HE1 TRP B 99 50.221 31.662 43.813 1.00 0.00 H ATOM 9655 HD1 TRP B 99 50.011 34.202 44.339 1.00 0.00 H ATOM 9656 HZ2 TRP B 99 52.193 29.662 44.154 1.00 0.00 H ATOM 9657 HH2 TRP B 99 54.470 29.330 45.056 1.00 0.00 H ATOM 9658 HZ3 TRP B 99 55.734 31.211 46.036 1.00 0.00 H ATOM 9659 HE3 TRP B 99 54.738 33.477 46.180 1.00 0.00 H ATOM 9660 H TRP B 99 52.859 37.666 46.750 1.00 0.00 H ATOM 9661 N ILE B 100 53.394 34.855 48.513 1.00 21.65 N ATOM 9662 CA ILE B 100 53.843 33.915 49.551 1.00 22.07 C ATOM 9663 C ILE B 100 52.969 33.940 50.819 1.00 23.40 C ATOM 9664 O ILE B 100 52.474 32.895 51.237 1.00 23.51 O ATOM 9665 CB ILE B 100 55.330 34.115 49.919 1.00 22.04 C ATOM 9666 CG1 ILE B 100 56.234 33.796 48.728 1.00 22.03 C ATOM 9667 CG2 ILE B 100 55.715 33.236 51.093 1.00 21.79 C ATOM 9668 CD1 ILE B 100 57.708 34.129 48.993 1.00 23.32 C ATOM 9669 HA ILE B 100 53.730 32.928 49.104 1.00 0.00 H ATOM 9670 HB ILE B 100 55.464 35.161 50.196 1.00 0.00 H ATOM 9671 HG12 ILE B 100 56.152 32.733 48.503 1.00 0.00 H ATOM 9672 HG13 ILE B 100 55.895 34.375 47.869 1.00 0.00 H ATOM 9673 HD11 ILE B 100 57.806 35.193 49.210 1.00 0.00 H ATOM 9674 HD12 ILE B 100 58.063 33.549 49.845 1.00 0.00 H ATOM 9675 HD13 ILE B 100 58.299 33.881 48.112 1.00 0.00 H ATOM 9676 HG21 ILE B 100 55.100 33.494 51.955 1.00 0.00 H ATOM 9677 HG22 ILE B 100 55.554 32.190 50.830 1.00 0.00 H ATOM 9678 HG23 ILE B 100 56.766 33.394 51.334 1.00 0.00 H ATOM 9679 H ILE B 100 54.058 35.556 48.128 1.00 0.00 H ATOM 9680 N PRO B 101 52.770 35.133 51.435 1.00 24.54 N ATOM 9681 CA PRO B 101 51.935 35.161 52.648 1.00 23.08 C ATOM 9682 C PRO B 101 50.459 34.832 52.401 1.00 23.67 C ATOM 9683 O PRO B 101 49.797 34.258 53.267 1.00 23.02 O ATOM 9684 CB PRO B 101 52.097 36.606 53.154 1.00 23.69 C ATOM 9685 CG PRO B 101 52.428 37.401 51.947 1.00 23.79 C ATOM 9686 CD PRO B 101 53.291 36.474 51.102 1.00 23.83 C ATOM 9687 HA PRO B 101 52.250 34.397 53.359 1.00 0.00 H ATOM 9688 HD3 PRO B 101 53.171 36.688 50.040 1.00 0.00 H ATOM 9689 HD2 PRO B 101 54.343 36.564 51.373 1.00 0.00 H ATOM 9690 HG3 PRO B 101 52.980 38.301 52.218 1.00 0.00 H ATOM 9691 HG2 PRO B 101 51.522 37.680 51.409 1.00 0.00 H ATOM 9692 HB2 PRO B 101 51.170 36.961 53.604 1.00 0.00 H ATOM 9693 HB3 PRO B 101 52.902 36.668 53.886 1.00 0.00 H ATOM 9694 N LEU B 102 49.928 35.185 51.239 1.00 24.73 N ATOM 9695 CA LEU B 102 48.550 34.814 50.940 1.00 26.42 C ATOM 9696 C LEU B 102 48.401 33.288 50.818 1.00 27.40 C ATOM 9697 O LEU B 102 47.471 32.701 51.373 1.00 28.17 O ATOM 9698 CB LEU B 102 48.060 35.502 49.664 1.00 27.49 C ATOM 9699 CG LEU B 102 46.608 35.218 49.264 1.00 29.37 C ATOM 9700 CD1 LEU B 102 45.636 35.776 50.294 1.00 30.22 C ATOM 9701 CD2 LEU B 102 46.304 35.788 47.886 1.00 29.43 C ATOM 9702 HA LEU B 102 47.931 35.152 51.771 1.00 0.00 H ATOM 9703 HB2 LEU B 102 48.164 36.578 49.804 1.00 0.00 H ATOM 9704 HB3 LEU B 102 48.701 35.180 48.844 1.00 0.00 H ATOM 9705 HG LEU B 102 46.481 34.136 49.226 1.00 0.00 H ATOM 9706 HD21 LEU B 102 46.461 36.867 47.898 1.00 0.00 H ATOM 9707 HD22 LEU B 102 46.967 35.331 47.151 1.00 0.00 H ATOM 9708 HD23 LEU B 102 45.268 35.573 47.626 1.00 0.00 H ATOM 9709 HD11 LEU B 102 45.828 35.313 51.262 1.00 0.00 H ATOM 9710 HD12 LEU B 102 45.772 36.855 50.373 1.00 0.00 H ATOM 9711 HD13 LEU B 102 44.614 35.559 49.983 1.00 0.00 H ATOM 9712 H LEU B 102 50.489 35.722 50.547 1.00 0.00 H ATOM 9713 N VAL B 103 49.309 32.647 50.086 1.00 25.88 N ATOM 9714 CA VAL B 103 49.236 31.197 49.910 1.00 24.82 C ATOM 9715 C VAL B 103 49.437 30.489 51.245 1.00 23.80 C ATOM 9716 O VAL B 103 48.754 29.520 51.548 1.00 21.62 O ATOM 9717 CB VAL B 103 50.269 30.678 48.876 1.00 24.40 C ATOM 9718 CG1 VAL B 103 50.361 29.154 48.913 1.00 24.00 C ATOM 9719 CG2 VAL B 103 49.897 31.147 47.481 1.00 23.47 C ATOM 9720 HA VAL B 103 48.242 30.971 49.524 1.00 0.00 H ATOM 9721 HB VAL B 103 51.246 31.085 49.138 1.00 0.00 H ATOM 9722 HG11 VAL B 103 50.670 28.834 49.908 1.00 0.00 H ATOM 9723 HG12 VAL B 103 49.386 28.727 48.679 1.00 0.00 H ATOM 9724 HG13 VAL B 103 51.092 28.817 48.178 1.00 0.00 H ATOM 9725 HG21 VAL B 103 48.910 30.765 47.222 1.00 0.00 H ATOM 9726 HG22 VAL B 103 49.884 32.237 47.457 1.00 0.00 H ATOM 9727 HG23 VAL B 103 50.631 30.775 46.766 1.00 0.00 H ATOM 9728 H VAL B 103 50.078 33.182 49.635 1.00 0.00 H ATOM 9729 N VAL B 104 50.376 30.980 52.044 1.00 24.29 N ATOM 9730 CA VAL B 104 50.620 30.378 53.339 1.00 25.16 C ATOM 9731 C VAL B 104 49.394 30.561 54.239 1.00 26.00 C ATOM 9732 O VAL B 104 49.002 29.635 54.953 1.00 25.21 O ATOM 9733 CB VAL B 104 51.920 30.890 53.989 1.00 26.02 C ATOM 9734 CG1 VAL B 104 52.086 30.312 55.395 1.00 27.47 C ATOM 9735 CG2 VAL B 104 53.111 30.499 53.138 1.00 24.98 C ATOM 9736 HA VAL B 104 50.774 29.308 53.197 1.00 0.00 H ATOM 9737 HB VAL B 104 51.863 31.976 54.061 1.00 0.00 H ATOM 9738 HG11 VAL B 104 51.240 30.614 56.013 1.00 0.00 H ATOM 9739 HG12 VAL B 104 52.125 29.224 55.337 1.00 0.00 H ATOM 9740 HG13 VAL B 104 53.010 30.687 55.834 1.00 0.00 H ATOM 9741 HG21 VAL B 104 53.154 29.413 53.053 1.00 0.00 H ATOM 9742 HG22 VAL B 104 53.007 30.939 52.146 1.00 0.00 H ATOM 9743 HG23 VAL B 104 54.025 30.865 53.605 1.00 0.00 H ATOM 9744 H VAL B 104 50.939 31.800 51.739 1.00 0.00 H ATOM 9745 N ALA B 105 48.776 31.742 54.169 1.00 25.38 N ATOM 9746 CA ALA B 105 47.568 32.034 54.947 1.00 25.19 C ATOM 9747 C ALA B 105 46.499 30.987 54.694 1.00 25.88 C ATOM 9748 O ALA B 105 45.843 30.494 55.623 1.00 23.60 O ATOM 9749 CB ALA B 105 47.029 33.419 54.600 1.00 22.79 C ATOM 9750 HA ALA B 105 47.835 32.013 56.004 1.00 0.00 H ATOM 9751 HB1 ALA B 105 47.786 34.169 54.827 1.00 0.00 H ATOM 9752 HB2 ALA B 105 46.784 33.457 53.538 1.00 0.00 H ATOM 9753 HB3 ALA B 105 46.133 33.616 55.188 1.00 0.00 H ATOM 9754 H ALA B 105 49.163 32.477 53.544 1.00 0.00 H ATOM 9755 N ILE B 106 46.349 30.645 53.416 1.00 26.49 N ATOM 9756 CA ILE B 106 45.333 29.704 52.949 1.00 27.04 C ATOM 9757 C ILE B 106 45.400 28.317 53.620 1.00 28.17 C ATOM 9758 O ILE B 106 44.370 27.648 53.755 1.00 31.71 O ATOM 9759 CB ILE B 106 45.364 29.613 51.401 1.00 27.78 C ATOM 9760 CG1 ILE B 106 44.776 30.896 50.816 1.00 27.15 C ATOM 9761 CG2 ILE B 106 44.587 28.413 50.907 1.00 27.36 C ATOM 9762 CD1 ILE B 106 45.197 31.191 49.383 1.00 29.61 C ATOM 9763 HA ILE B 106 44.367 30.104 53.259 1.00 0.00 H ATOM 9764 HB ILE B 106 46.398 29.495 51.076 1.00 0.00 H ATOM 9765 HG12 ILE B 106 43.689 30.815 50.841 1.00 0.00 H ATOM 9766 HG13 ILE B 106 45.091 31.731 51.442 1.00 0.00 H ATOM 9767 HD11 ILE B 106 46.281 31.290 49.337 1.00 0.00 H ATOM 9768 HD12 ILE B 106 44.878 30.373 48.736 1.00 0.00 H ATOM 9769 HD13 ILE B 106 44.731 32.120 49.053 1.00 0.00 H ATOM 9770 HG21 ILE B 106 45.025 27.504 51.318 1.00 0.00 H ATOM 9771 HG22 ILE B 106 43.549 28.496 51.230 1.00 0.00 H ATOM 9772 HG23 ILE B 106 44.628 28.378 49.818 1.00 0.00 H ATOM 9773 H ILE B 106 46.988 31.069 52.714 1.00 0.00 H ATOM 9774 N TYR B 107 46.581 27.889 54.059 1.00 26.84 N ATOM 9775 CA TYR B 107 46.666 26.625 54.800 1.00 26.41 C ATOM 9776 C TYR B 107 46.968 26.803 56.288 1.00 26.47 C ATOM 9777 O TYR B 107 46.605 25.950 57.096 1.00 26.97 O ATOM 9778 CB TYR B 107 47.648 25.630 54.158 1.00 24.33 C ATOM 9779 CG TYR B 107 49.132 25.967 54.234 1.00 24.26 C ATOM 9780 CD1 TYR B 107 49.904 25.576 55.328 1.00 22.99 C ATOM 9781 CD2 TYR B 107 49.766 26.645 53.196 1.00 23.40 C ATOM 9782 CE1 TYR B 107 51.257 25.871 55.394 1.00 22.38 C ATOM 9783 CE2 TYR B 107 51.123 26.939 53.249 1.00 23.22 C ATOM 9784 CZ TYR B 107 51.861 26.552 54.352 1.00 24.12 C ATOM 9785 OH TYR B 107 53.212 26.847 54.406 1.00 25.48 O ATOM 9786 HA TYR B 107 45.665 26.199 54.734 1.00 0.00 H ATOM 9787 HB3 TYR B 107 47.385 25.544 53.104 1.00 0.00 H ATOM 9788 HB2 TYR B 107 47.505 24.666 54.647 1.00 0.00 H ATOM 9789 HD2 TYR B 107 49.187 26.951 52.325 1.00 0.00 H ATOM 9790 HE2 TYR B 107 51.602 27.471 52.427 1.00 0.00 H ATOM 9791 HE1 TYR B 107 51.842 25.568 56.262 1.00 0.00 H ATOM 9792 HD1 TYR B 107 49.435 25.029 56.146 1.00 0.00 H ATOM 9793 HH TYR B 107 53.590 26.504 55.254 1.00 0.00 H ATOM 9794 H TYR B 107 47.439 28.447 53.878 1.00 0.00 H ATOM 9795 N TYR B 108 47.624 27.906 56.642 1.00 24.13 N ATOM 9796 CA TYR B 108 48.005 28.156 58.028 1.00 24.56 C ATOM 9797 C TYR B 108 46.782 28.410 58.895 1.00 23.87 C ATOM 9798 O TYR B 108 46.687 27.886 60.002 1.00 23.02 O ATOM 9799 CB TYR B 108 48.935 29.357 58.100 1.00 23.00 C ATOM 9800 CG TYR B 108 49.724 29.500 59.380 1.00 24.45 C ATOM 9801 CD1 TYR B 108 51.002 28.948 59.496 1.00 23.78 C ATOM 9802 CD2 TYR B 108 49.215 30.205 60.459 1.00 23.88 C ATOM 9803 CE1 TYR B 108 51.733 29.088 60.648 1.00 23.48 C ATOM 9804 CE2 TYR B 108 49.952 30.348 61.636 1.00 24.73 C ATOM 9805 CZ TYR B 108 51.203 29.790 61.724 1.00 25.27 C ATOM 9806 OH TYR B 108 51.947 29.929 62.885 1.00 24.16 O ATOM 9807 HA TYR B 108 48.517 27.270 58.403 1.00 0.00 H ATOM 9808 HB3 TYR B 108 48.331 30.256 57.976 1.00 0.00 H ATOM 9809 HB2 TYR B 108 49.644 29.281 57.276 1.00 0.00 H ATOM 9810 HD2 TYR B 108 48.225 30.655 60.388 1.00 0.00 H ATOM 9811 HE2 TYR B 108 49.537 30.899 62.480 1.00 0.00 H ATOM 9812 HE1 TYR B 108 52.728 28.649 60.720 1.00 0.00 H ATOM 9813 HD1 TYR B 108 51.426 28.397 58.657 1.00 0.00 H ATOM 9814 HH TYR B 108 52.817 29.469 62.775 1.00 0.00 H ATOM 9815 H TYR B 108 47.871 28.606 55.913 1.00 0.00 H ATOM 9816 N VAL B 109 45.844 29.215 58.397 1.00 22.79 N ATOM 9817 CA VAL B 109 44.657 29.509 59.188 1.00 23.31 C ATOM 9818 C VAL B 109 43.834 28.241 59.403 1.00 23.72 C ATOM 9819 O VAL B 109 43.225 28.060 60.469 1.00 22.81 O ATOM 9820 CB VAL B 109 43.788 30.624 58.583 1.00 22.77 C ATOM 9821 CG1 VAL B 109 42.600 30.919 59.481 1.00 24.09 C ATOM 9822 CG2 VAL B 109 44.606 31.901 58.377 1.00 22.22 C ATOM 9823 HA VAL B 109 45.007 29.881 60.151 1.00 0.00 H ATOM 9824 HB VAL B 109 43.427 30.278 57.614 1.00 0.00 H ATOM 9825 HG11 VAL B 109 41.996 30.018 59.590 1.00 0.00 H ATOM 9826 HG12 VAL B 109 42.957 31.239 60.460 1.00 0.00 H ATOM 9827 HG13 VAL B 109 41.997 31.711 59.036 1.00 0.00 H ATOM 9828 HG21 VAL B 109 44.995 32.240 59.337 1.00 0.00 H ATOM 9829 HG22 VAL B 109 45.435 31.695 57.700 1.00 0.00 H ATOM 9830 HG23 VAL B 109 43.968 32.674 57.948 1.00 0.00 H ATOM 9831 H VAL B 109 45.959 29.630 57.450 1.00 0.00 H ATOM 9832 N TYR B 110 43.822 27.358 58.401 1.00 23.65 N ATOM 9833 CA TYR B 110 43.032 26.137 58.502 1.00 23.38 C ATOM 9834 C TYR B 110 43.614 25.247 59.583 1.00 23.30 C ATOM 9835 O TYR B 110 42.883 24.734 60.419 1.00 25.42 O ATOM 9836 CB TYR B 110 42.910 25.406 57.154 1.00 24.16 C ATOM 9837 CG TYR B 110 42.032 24.166 57.199 1.00 23.31 C ATOM 9838 CD1 TYR B 110 40.798 24.181 57.846 1.00 22.73 C ATOM 9839 CD2 TYR B 110 42.428 22.988 56.569 1.00 22.58 C ATOM 9840 CE1 TYR B 110 39.983 23.034 57.880 1.00 23.73 C ATOM 9841 CE2 TYR B 110 41.633 21.855 56.592 1.00 23.68 C ATOM 9842 CZ TYR B 110 40.410 21.882 57.246 1.00 23.41 C ATOM 9843 OH TYR B 110 39.633 20.746 57.267 1.00 24.85 O ATOM 9844 HA TYR B 110 42.014 26.407 58.782 1.00 0.00 H ATOM 9845 HB3 TYR B 110 43.908 25.108 56.834 1.00 0.00 H ATOM 9846 HB2 TYR B 110 42.488 26.098 56.425 1.00 0.00 H ATOM 9847 HD2 TYR B 110 43.384 22.958 56.047 1.00 0.00 H ATOM 9848 HE2 TYR B 110 41.967 20.943 56.097 1.00 0.00 H ATOM 9849 HE1 TYR B 110 39.026 23.054 58.401 1.00 0.00 H ATOM 9850 HD1 TYR B 110 40.459 25.095 58.333 1.00 0.00 H ATOM 9851 HH TYR B 110 39.411 20.483 56.339 1.00 0.00 H ATOM 9852 H TYR B 110 44.380 27.543 57.543 1.00 0.00 H ATOM 9853 N ILE B 111 44.931 25.089 59.590 1.00 23.10 N ATOM 9854 CA ILE B 111 45.584 24.310 60.633 1.00 24.09 C ATOM 9855 C ILE B 111 45.377 24.959 62.016 1.00 26.31 C ATOM 9856 O ILE B 111 45.224 24.271 63.036 1.00 25.64 O ATOM 9857 CB ILE B 111 47.090 24.153 60.353 1.00 24.46 C ATOM 9858 CG1 ILE B 111 47.315 23.404 59.029 1.00 25.14 C ATOM 9859 CG2 ILE B 111 47.764 23.415 61.507 1.00 23.91 C ATOM 9860 CD1 ILE B 111 48.776 23.416 58.551 1.00 25.65 C ATOM 9861 HA ILE B 111 45.126 23.321 60.634 1.00 0.00 H ATOM 9862 HB ILE B 111 47.535 25.144 60.265 1.00 0.00 H ATOM 9863 HG12 ILE B 111 47.005 22.368 59.163 1.00 0.00 H ATOM 9864 HG13 ILE B 111 46.698 23.870 58.261 1.00 0.00 H ATOM 9865 HD11 ILE B 111 49.099 24.446 58.400 1.00 0.00 H ATOM 9866 HD12 ILE B 111 49.407 22.942 59.303 1.00 0.00 H ATOM 9867 HD13 ILE B 111 48.854 22.868 57.612 1.00 0.00 H ATOM 9868 HG21 ILE B 111 47.628 23.982 62.428 1.00 0.00 H ATOM 9869 HG22 ILE B 111 47.315 22.428 61.617 1.00 0.00 H ATOM 9870 HG23 ILE B 111 48.828 23.310 61.297 1.00 0.00 H ATOM 9871 H ILE B 111 45.505 25.527 58.841 1.00 0.00 H ATOM 9872 N GLU B 112 45.382 26.288 62.042 1.00 24.68 N ATOM 9873 CA GLU B 112 45.108 27.019 63.270 1.00 25.47 C ATOM 9874 C GLU B 112 43.700 26.688 63.752 1.00 25.16 C ATOM 9875 O GLU B 112 43.480 26.490 64.948 1.00 25.34 O ATOM 9876 CB GLU B 112 45.270 28.519 63.041 1.00 25.97 C ATOM 9877 CG GLU B 112 44.809 29.405 64.195 1.00 26.27 C ATOM 9878 CD GLU B 112 44.846 30.863 63.797 1.00 27.76 C ATOM 9879 OE1 GLU B 112 45.895 31.305 63.270 1.00 27.45 O ATOM 9880 OE2 GLU B 112 43.837 31.559 63.998 1.00 26.28 O ATOM 9881 HA GLU B 112 45.821 26.720 64.038 1.00 0.00 H ATOM 9882 HB2 GLU B 112 46.326 28.721 62.861 1.00 0.00 H ATOM 9883 HB3 GLU B 112 44.694 28.790 62.156 1.00 0.00 H ATOM 9884 HG2 GLU B 112 43.789 29.134 64.469 1.00 0.00 H ATOM 9885 HG3 GLU B 112 45.467 29.250 65.050 1.00 0.00 H ATOM 9886 H GLU B 112 45.585 26.815 61.169 1.00 0.00 H ATOM 9887 N SER B 113 42.755 26.611 62.819 1.00 24.36 N ATOM 9888 CA SER B 113 41.392 26.258 63.166 1.00 24.33 C ATOM 9889 C SER B 113 41.295 24.877 63.827 1.00 25.72 C ATOM 9890 O SER B 113 40.443 24.678 64.701 1.00 26.56 O ATOM 9891 CB SER B 113 40.441 26.368 61.971 1.00 24.16 C ATOM 9892 OG SER B 113 40.575 25.278 61.081 1.00 26.08 O ATOM 9893 HA SER B 113 41.071 26.992 63.905 1.00 0.00 H ATOM 9894 HB2 SER B 113 40.658 27.290 61.432 1.00 0.00 H ATOM 9895 HB3 SER B 113 39.416 26.397 62.339 1.00 0.00 H ATOM 9896 HG SER B 113 41.502 25.248 60.735 1.00 0.00 H ATOM 9897 H SER B 113 42.997 26.807 61.827 1.00 0.00 H ATOM 9898 N TRP B 114 42.158 23.938 63.434 1.00 26.01 N ATOM 9899 CA TRP B 114 42.166 22.615 64.073 1.00 25.53 C ATOM 9900 C TRP B 114 42.536 22.688 65.549 1.00 26.89 C ATOM 9901 O TRP B 114 41.947 21.986 66.370 1.00 26.64 O ATOM 9902 CB TRP B 114 43.145 21.635 63.435 1.00 25.47 C ATOM 9903 CG TRP B 114 43.114 21.488 61.941 1.00 24.85 C ATOM 9904 CD1 TRP B 114 42.156 21.923 61.069 1.00 25.24 C ATOM 9905 CD2 TRP B 114 44.096 20.815 61.157 1.00 24.58 C ATOM 9906 NE1 TRP B 114 42.501 21.578 59.776 1.00 25.88 N ATOM 9907 CE2 TRP B 114 43.688 20.894 59.807 1.00 25.09 C ATOM 9908 CE3 TRP B 114 45.291 20.157 61.465 1.00 24.23 C ATOM 9909 CZ2 TRP B 114 44.437 20.338 58.767 1.00 25.74 C ATOM 9910 CZ3 TRP B 114 46.035 19.608 60.428 1.00 25.81 C ATOM 9911 CH2 TRP B 114 45.599 19.700 59.094 1.00 25.98 C ATOM 9912 HA TRP B 114 41.144 22.260 63.939 1.00 0.00 H ATOM 9913 HB2 TRP B 114 44.150 21.954 63.710 1.00 0.00 H ATOM 9914 HB3 TRP B 114 42.947 20.652 63.863 1.00 0.00 H ATOM 9915 HE1 TRP B 114 41.951 21.800 58.922 1.00 0.00 H ATOM 9916 HD1 TRP B 114 41.252 22.463 61.352 1.00 0.00 H ATOM 9917 HZ2 TRP B 114 44.105 20.411 57.731 1.00 0.00 H ATOM 9918 HH2 TRP B 114 46.202 19.252 58.304 1.00 0.00 H ATOM 9919 HZ3 TRP B 114 46.972 19.098 60.652 1.00 0.00 H ATOM 9920 HE3 TRP B 114 45.632 20.077 62.497 1.00 0.00 H ATOM 9921 H TRP B 114 42.831 24.145 62.668 1.00 0.00 H ATOM 9922 N THR B 115 43.529 23.514 65.879 1.00 25.50 N ATOM 9923 CA THR B 115 43.969 23.646 67.264 1.00 24.36 C ATOM 9924 C THR B 115 42.824 24.186 68.117 1.00 26.10 C ATOM 9925 O THR B 115 42.626 23.753 69.249 1.00 27.45 O ATOM 9926 CB THR B 115 45.221 24.530 67.394 1.00 22.66 C ATOM 9927 OG1 THR B 115 44.900 25.884 67.056 1.00 22.25 O ATOM 9928 CG2 THR B 115 46.349 24.008 66.472 1.00 20.63 C ATOM 9929 HA THR B 115 44.250 22.657 67.625 1.00 0.00 H ATOM 9930 HB THR B 115 45.569 24.492 68.426 1.00 0.00 H ATOM 9931 HG1 THR B 115 44.569 25.921 66.124 1.00 0.00 H ATOM 9932 HG23 THR B 115 46.586 22.978 66.737 1.00 0.00 H ATOM 9933 HG21 THR B 115 46.017 24.051 65.435 1.00 0.00 H ATOM 9934 HG22 THR B 115 47.236 24.630 66.597 1.00 0.00 H ATOM 9935 H THR B 115 43.997 24.073 65.138 1.00 0.00 H ATOM 9936 N LEU B 116 42.059 25.123 67.562 1.00 25.69 N ATOM 9937 CA LEU B 116 40.895 25.647 68.263 1.00 26.81 C ATOM 9938 C LEU B 116 39.834 24.561 68.463 1.00 27.44 C ATOM 9939 O LEU B 116 39.297 24.405 69.561 1.00 26.46 O ATOM 9940 CB LEU B 116 40.297 26.833 67.508 1.00 25.86 C ATOM 9941 CG LEU B 116 39.072 27.495 68.139 1.00 26.53 C ATOM 9942 CD1 LEU B 116 39.353 27.925 69.600 1.00 24.69 C ATOM 9943 CD2 LEU B 116 38.609 28.679 67.290 1.00 24.98 C ATOM 9944 HA LEU B 116 41.226 25.987 69.244 1.00 0.00 H ATOM 9945 HB2 LEU B 116 41.073 27.592 67.415 1.00 0.00 H ATOM 9946 HB3 LEU B 116 40.011 26.484 66.516 1.00 0.00 H ATOM 9947 HG LEU B 116 38.266 26.761 68.168 1.00 0.00 H ATOM 9948 HD21 LEU B 116 39.413 29.412 67.221 1.00 0.00 H ATOM 9949 HD22 LEU B 116 38.349 28.329 66.291 1.00 0.00 H ATOM 9950 HD23 LEU B 116 37.736 29.138 67.754 1.00 0.00 H ATOM 9951 HD11 LEU B 116 39.616 27.048 70.191 1.00 0.00 H ATOM 9952 HD12 LEU B 116 40.178 28.637 69.616 1.00 0.00 H ATOM 9953 HD13 LEU B 116 38.461 28.392 70.018 1.00 0.00 H ATOM 9954 H LEU B 116 42.295 25.485 66.616 1.00 0.00 H ATOM 9955 N GLY B 117 39.535 23.820 67.400 1.00 24.98 N ATOM 9956 CA GLY B 117 38.545 22.748 67.465 1.00 24.94 C ATOM 9957 C GLY B 117 38.955 21.681 68.466 1.00 25.70 C ATOM 9958 O GLY B 117 38.121 21.186 69.216 1.00 26.02 O ATOM 9959 HA3 GLY B 117 38.448 22.293 66.479 1.00 0.00 H ATOM 9960 HA2 GLY B 117 37.585 23.168 67.766 1.00 0.00 H ATOM 9961 H GLY B 117 40.019 24.009 66.499 1.00 0.00 H ATOM 9962 N PHE B 118 40.239 21.328 68.480 1.00 24.88 N ATOM 9963 CA PHE B 118 40.757 20.383 69.454 1.00 27.46 C ATOM 9964 C PHE B 118 40.709 20.975 70.879 1.00 28.92 C ATOM 9965 O PHE B 118 40.419 20.261 71.837 1.00 30.02 O ATOM 9966 CB PHE B 118 42.188 19.953 69.102 1.00 27.91 C ATOM 9967 CG PHE B 118 42.281 18.783 68.123 1.00 28.45 C ATOM 9968 CD1 PHE B 118 41.657 18.830 66.891 1.00 26.37 C ATOM 9969 CD2 PHE B 118 43.032 17.656 68.439 1.00 26.91 C ATOM 9970 CE1 PHE B 118 41.755 17.764 65.992 1.00 28.30 C ATOM 9971 CE2 PHE B 118 43.139 16.593 67.546 1.00 27.95 C ATOM 9972 CZ PHE B 118 42.495 16.649 66.319 1.00 27.52 C ATOM 9973 HA PHE B 118 40.119 19.500 69.427 1.00 0.00 H ATOM 9974 HB2 PHE B 118 42.701 20.807 68.660 1.00 0.00 H ATOM 9975 HB3 PHE B 118 42.693 19.665 70.024 1.00 0.00 H ATOM 9976 HD2 PHE B 118 43.544 17.604 69.400 1.00 0.00 H ATOM 9977 HE2 PHE B 118 43.729 15.716 67.812 1.00 0.00 H ATOM 9978 HZ PHE B 118 42.574 15.817 65.619 1.00 0.00 H ATOM 9979 HE1 PHE B 118 41.245 17.815 65.030 1.00 0.00 H ATOM 9980 HD1 PHE B 118 41.079 19.712 66.616 1.00 0.00 H ATOM 9981 H PHE B 118 40.886 21.739 67.777 1.00 0.00 H ATOM 9982 N ALA B 119 40.996 22.270 71.022 1.00 28.12 N ATOM 9983 CA ALA B 119 40.955 22.909 72.341 1.00 27.72 C ATOM 9984 C ALA B 119 39.550 22.802 72.915 1.00 29.06 C ATOM 9985 O ALA B 119 39.373 22.419 74.075 1.00 29.04 O ATOM 9986 CB ALA B 119 41.398 24.365 72.266 1.00 26.84 C ATOM 9987 HA ALA B 119 41.652 22.391 73.000 1.00 0.00 H ATOM 9988 HB1 ALA B 119 42.419 24.414 71.888 1.00 0.00 H ATOM 9989 HB2 ALA B 119 40.735 24.911 71.595 1.00 0.00 H ATOM 9990 HB3 ALA B 119 41.356 24.808 73.261 1.00 0.00 H ATOM 9991 H ALA B 119 41.252 22.834 70.187 1.00 0.00 H ATOM 9992 N ILE B 120 38.559 23.128 72.087 1.00 28.46 N ATOM 9993 CA ILE B 120 37.160 23.045 72.466 1.00 29.10 C ATOM 9994 C ILE B 120 36.755 21.633 72.912 1.00 31.67 C ATOM 9995 O ILE B 120 36.178 21.459 73.990 1.00 30.97 O ATOM 9996 CB ILE B 120 36.252 23.499 71.314 1.00 29.76 C ATOM 9997 CG1 ILE B 120 36.423 24.998 71.053 1.00 28.62 C ATOM 9998 CG2 ILE B 120 34.800 23.187 71.627 1.00 29.72 C ATOM 9999 CD1 ILE B 120 35.639 25.490 69.847 1.00 29.40 C ATOM 10000 HA ILE B 120 37.032 23.714 73.317 1.00 0.00 H ATOM 10001 HB ILE B 120 36.542 22.953 70.416 1.00 0.00 H ATOM 10002 HG12 ILE B 120 36.084 25.544 71.933 1.00 0.00 H ATOM 10003 HG13 ILE B 120 37.481 25.202 70.886 1.00 0.00 H ATOM 10004 HD11 ILE B 120 35.975 24.960 68.956 1.00 0.00 H ATOM 10005 HD12 ILE B 120 34.577 25.302 70.004 1.00 0.00 H ATOM 10006 HD13 ILE B 120 35.805 26.560 69.719 1.00 0.00 H ATOM 10007 HG21 ILE B 120 34.683 22.113 71.769 1.00 0.00 H ATOM 10008 HG22 ILE B 120 34.506 23.709 72.537 1.00 0.00 H ATOM 10009 HG23 ILE B 120 34.172 23.516 70.799 1.00 0.00 H ATOM 10010 H ILE B 120 38.797 23.456 71.129 1.00 0.00 H ATOM 10011 N LYS B 121 37.062 20.624 72.099 1.00 31.16 N ATOM 10012 CA LYS B 121 36.654 19.258 72.421 1.00 31.57 C ATOM 10013 C LYS B 121 37.408 18.691 73.615 1.00 31.62 C ATOM 10014 O LYS B 121 36.856 17.894 74.376 1.00 29.36 O ATOM 10015 CB LYS B 121 36.806 18.336 71.210 1.00 32.60 C ATOM 10016 CG LYS B 121 35.885 18.714 70.049 1.00 34.55 C ATOM 10017 CD LYS B 121 36.130 17.819 68.841 1.00 37.57 C ATOM 10018 CE LYS B 121 35.255 16.579 68.847 1.00 40.22 C ATOM 10019 NZ LYS B 121 33.897 16.883 68.303 1.00 41.60 N ATOM 10020 HA LYS B 121 35.600 19.307 72.695 1.00 0.00 H ATOM 10021 HB2 LYS B 121 37.839 18.384 70.864 1.00 0.00 H ATOM 10022 HB3 LYS B 121 36.575 17.316 71.519 1.00 0.00 H ATOM 10023 HG2 LYS B 121 34.848 18.607 70.367 1.00 0.00 H ATOM 10024 HG3 LYS B 121 36.072 19.750 69.768 1.00 0.00 H ATOM 10025 HD2 LYS B 121 35.922 18.389 67.936 1.00 0.00 H ATOM 10026 HD3 LYS B 121 37.175 17.509 68.842 1.00 0.00 H ATOM 10027 HE2 LYS B 121 35.157 16.216 69.870 1.00 0.00 H ATOM 10028 HE3 LYS B 121 35.722 15.809 68.233 1.00 0.00 H ATOM 10029 HZ1 LYS B 121 33.446 17.614 68.889 1.00 0.00 H ATOM 10030 HZ2 LYS B 121 33.985 17.226 67.325 1.00 0.00 H ATOM 10031 HZ3 LYS B 121 33.318 16.019 68.318 1.00 0.00 H ATOM 10032 H LYS B 121 37.597 20.810 71.227 1.00 0.00 H ATOM 10033 N PHE B 122 38.666 19.093 73.779 1.00 31.22 N ATOM 10034 CA PHE B 122 39.449 18.622 74.916 1.00 32.91 C ATOM 10035 C PHE B 122 38.971 19.262 76.225 1.00 33.53 C ATOM 10036 O PHE B 122 39.026 18.638 77.270 1.00 34.36 O ATOM 10037 CB PHE B 122 40.956 18.819 74.701 1.00 32.79 C ATOM 10038 CG PHE B 122 41.635 17.631 74.052 1.00 34.80 C ATOM 10039 CD1 PHE B 122 41.528 17.412 72.683 1.00 34.24 C ATOM 10040 CD2 PHE B 122 42.367 16.731 74.817 1.00 34.59 C ATOM 10041 CE1 PHE B 122 42.142 16.318 72.085 1.00 34.84 C ATOM 10042 CE2 PHE B 122 42.986 15.632 74.230 1.00 35.83 C ATOM 10043 CZ PHE B 122 42.873 15.426 72.856 1.00 35.86 C ATOM 10044 HA PHE B 122 39.284 17.548 74.998 1.00 0.00 H ATOM 10045 HB2 PHE B 122 41.103 19.691 74.064 1.00 0.00 H ATOM 10046 HB3 PHE B 122 41.423 18.996 75.670 1.00 0.00 H ATOM 10047 HD2 PHE B 122 42.457 16.888 75.892 1.00 0.00 H ATOM 10048 HE2 PHE B 122 43.557 14.934 74.842 1.00 0.00 H ATOM 10049 HZ PHE B 122 43.357 14.568 72.389 1.00 0.00 H ATOM 10050 HE1 PHE B 122 42.049 16.161 71.010 1.00 0.00 H ATOM 10051 HD1 PHE B 122 40.955 18.108 72.070 1.00 0.00 H ATOM 10052 H PHE B 122 39.093 19.747 73.092 1.00 0.00 H ATOM 10053 N LEU B 123 38.495 20.500 76.144 1.00 32.95 N ATOM 10054 CA LEU B 123 37.987 21.220 77.305 1.00 32.51 C ATOM 10055 C LEU B 123 36.712 20.588 77.832 1.00 33.29 C ATOM 10056 O LEU B 123 36.544 20.423 79.037 1.00 34.38 O ATOM 10057 CB LEU B 123 37.711 22.680 76.950 1.00 30.91 C ATOM 10058 CG LEU B 123 37.150 23.549 78.081 1.00 31.26 C ATOM 10059 CD1 LEU B 123 38.078 23.537 79.293 1.00 29.54 C ATOM 10060 CD2 LEU B 123 36.917 24.960 77.599 1.00 31.73 C ATOM 10061 HA LEU B 123 38.752 21.169 78.080 1.00 0.00 H ATOM 10062 HB2 LEU B 123 38.649 23.127 76.619 1.00 0.00 H ATOM 10063 HB3 LEU B 123 36.993 22.695 76.130 1.00 0.00 H ATOM 10064 HG LEU B 123 36.193 23.128 78.389 1.00 0.00 H ATOM 10065 HD21 LEU B 123 37.861 25.387 77.259 1.00 0.00 H ATOM 10066 HD22 LEU B 123 36.204 24.948 76.775 1.00 0.00 H ATOM 10067 HD23 LEU B 123 36.519 25.561 78.417 1.00 0.00 H ATOM 10068 HD11 LEU B 123 38.185 22.515 79.657 1.00 0.00 H ATOM 10069 HD12 LEU B 123 39.055 23.925 79.005 1.00 0.00 H ATOM 10070 HD13 LEU B 123 37.655 24.162 80.079 1.00 0.00 H ATOM 10071 H LEU B 123 38.485 20.973 75.218 1.00 0.00 H ATOM 10072 N VAL B 124 35.819 20.242 76.912 1.00 33.57 N ATOM 10073 CA VAL B 124 34.526 19.676 77.234 1.00 32.74 C ATOM 10074 C VAL B 124 34.593 18.154 77.403 1.00 32.41 C ATOM 10075 O VAL B 124 33.581 17.498 77.662 1.00 31.37 O ATOM 10076 CB VAL B 124 33.501 20.066 76.151 1.00 34.44 C ATOM 10077 CG1 VAL B 124 32.124 19.512 76.483 1.00 35.83 C ATOM 10078 CG2 VAL B 124 33.426 21.580 76.022 1.00 34.58 C ATOM 10079 HA VAL B 124 34.206 20.086 78.192 1.00 0.00 H ATOM 10080 HB VAL B 124 33.829 19.638 75.204 1.00 0.00 H ATOM 10081 HG11 VAL B 124 32.176 18.425 76.542 1.00 0.00 H ATOM 10082 HG12 VAL B 124 31.793 19.914 77.441 1.00 0.00 H ATOM 10083 HG13 VAL B 124 31.420 19.801 75.703 1.00 0.00 H ATOM 10084 HG21 VAL B 124 33.120 22.010 76.976 1.00 0.00 H ATOM 10085 HG22 VAL B 124 34.406 21.969 75.744 1.00 0.00 H ATOM 10086 HG23 VAL B 124 32.699 21.842 75.254 1.00 0.00 H ATOM 10087 H VAL B 124 36.060 20.385 75.911 1.00 0.00 H ATOM 10088 N GLY B 125 35.788 17.591 77.257 1.00 31.81 N ATOM 10089 CA GLY B 125 35.984 16.157 77.424 1.00 33.30 C ATOM 10090 C GLY B 125 35.377 15.283 76.344 1.00 35.59 C ATOM 10091 O GLY B 125 35.133 14.092 76.562 1.00 33.89 O ATOM 10092 HA3 GLY B 125 35.543 15.867 78.378 1.00 0.00 H ATOM 10093 HA2 GLY B 125 37.057 15.965 77.447 1.00 0.00 H ATOM 10094 H GLY B 125 36.604 18.189 77.017 1.00 0.00 H ATOM 10095 N LEU B 126 35.130 15.865 75.171 1.00 37.26 N ATOM 10096 CA LEU B 126 34.597 15.112 74.034 1.00 39.51 C ATOM 10097 C LEU B 126 35.758 14.510 73.239 1.00 41.75 C ATOM 10098 O LEU B 126 35.920 14.758 72.040 1.00 40.39 O ATOM 10099 CB LEU B 126 33.721 16.002 73.150 1.00 39.28 C ATOM 10100 CG LEU B 126 32.383 16.460 73.739 1.00 39.83 C ATOM 10101 CD1 LEU B 126 31.724 17.504 72.847 1.00 38.74 C ATOM 10102 CD2 LEU B 126 31.439 15.273 73.960 1.00 39.97 C ATOM 10103 HA LEU B 126 33.965 14.304 74.403 1.00 0.00 H ATOM 10104 HB2 LEU B 126 34.297 16.895 72.907 1.00 0.00 H ATOM 10105 HB3 LEU B 126 33.507 15.449 72.235 1.00 0.00 H ATOM 10106 HG LEU B 126 32.589 16.915 74.708 1.00 0.00 H ATOM 10107 HD21 LEU B 126 31.249 14.779 73.007 1.00 0.00 H ATOM 10108 HD22 LEU B 126 31.900 14.567 74.651 1.00 0.00 H ATOM 10109 HD23 LEU B 126 30.499 15.631 74.379 1.00 0.00 H ATOM 10110 HD11 LEU B 126 32.381 18.369 72.755 1.00 0.00 H ATOM 10111 HD12 LEU B 126 31.545 17.076 71.861 1.00 0.00 H ATOM 10112 HD13 LEU B 126 30.776 17.811 73.289 1.00 0.00 H ATOM 10113 H LEU B 126 35.321 16.881 75.060 1.00 0.00 H ATOM 10114 N VAL B 127 36.562 13.712 73.936 1.00 44.36 N ATOM 10115 CA VAL B 127 37.775 13.129 73.389 1.00 47.41 C ATOM 10116 C VAL B 127 37.663 11.609 73.362 1.00 50.33 C ATOM 10117 O VAL B 127 36.706 11.050 73.897 1.00 50.67 O ATOM 10118 CB VAL B 127 38.999 13.542 74.233 1.00 47.14 C ATOM 10119 CG1 VAL B 127 39.132 15.044 74.254 1.00 47.84 C ATOM 10120 CG2 VAL B 127 38.886 13.003 75.647 1.00 46.66 C ATOM 10121 HA VAL B 127 37.904 13.498 72.371 1.00 0.00 H ATOM 10122 HB VAL B 127 39.892 13.115 73.776 1.00 0.00 H ATOM 10123 HG11 VAL B 127 39.259 15.410 73.235 1.00 0.00 H ATOM 10124 HG12 VAL B 127 38.233 15.481 74.689 1.00 0.00 H ATOM 10125 HG13 VAL B 127 39.999 15.322 74.853 1.00 0.00 H ATOM 10126 HG21 VAL B 127 37.986 13.401 76.115 1.00 0.00 H ATOM 10127 HG22 VAL B 127 38.831 11.915 75.616 1.00 0.00 H ATOM 10128 HG23 VAL B 127 39.761 13.308 76.222 1.00 0.00 H ATOM 10129 H VAL B 127 36.310 13.495 74.921 1.00 0.00 H ATOM 10130 N PRO B 128 38.639 10.930 72.736 1.00 53.69 N ATOM 10131 CA PRO B 128 38.599 9.473 72.709 1.00 56.29 C ATOM 10132 C PRO B 128 38.974 8.856 74.052 1.00 59.19 C ATOM 10133 O PRO B 128 39.776 9.422 74.802 1.00 58.96 O ATOM 10134 CB PRO B 128 39.660 9.106 71.660 1.00 55.51 C ATOM 10135 CG PRO B 128 40.069 10.388 71.013 1.00 54.57 C ATOM 10136 CD PRO B 128 39.812 11.453 72.016 1.00 53.96 C ATOM 10137 HA PRO B 128 37.598 9.104 72.484 1.00 0.00 H ATOM 10138 HD3 PRO B 128 40.663 11.579 72.686 1.00 0.00 H ATOM 10139 HD2 PRO B 128 39.588 12.404 71.533 1.00 0.00 H ATOM 10140 HG3 PRO B 128 39.479 10.564 70.114 1.00 0.00 H ATOM 10141 HG2 PRO B 128 41.127 10.360 70.752 1.00 0.00 H ATOM 10142 HB2 PRO B 128 40.518 8.634 72.139 1.00 0.00 H ATOM 10143 HB3 PRO B 128 39.240 8.426 70.919 1.00 0.00 H ATOM 10144 N GLU B 129 38.383 7.703 74.344 1.00 63.24 N ATOM 10145 CA GLU B 129 38.709 6.939 75.538 1.00 66.83 C ATOM 10146 C GLU B 129 39.486 5.689 75.153 1.00 68.76 C ATOM 10147 O GLU B 129 38.928 4.769 74.558 1.00 69.41 O ATOM 10148 CB GLU B 129 37.441 6.552 76.302 1.00 67.98 C ATOM 10149 CG GLU B 129 37.022 7.538 77.388 1.00 69.52 C ATOM 10150 CD GLU B 129 37.858 7.416 78.660 1.00 70.50 C ATOM 10151 OE1 GLU B 129 38.731 6.519 78.737 1.00 70.93 O ATOM 10152 OE2 GLU B 129 37.641 8.220 79.591 1.00 70.85 O ATOM 10153 HA GLU B 129 39.323 7.561 76.189 1.00 0.00 H ATOM 10154 HB2 GLU B 129 36.624 6.470 75.585 1.00 0.00 H ATOM 10155 HB3 GLU B 129 37.610 5.583 76.771 1.00 0.00 H ATOM 10156 HG2 GLU B 129 37.128 8.550 76.998 1.00 0.00 H ATOM 10157 HG3 GLU B 129 35.977 7.355 77.640 1.00 0.00 H ATOM 10158 H GLU B 129 37.660 7.333 73.695 1.00 0.00 H ATOM 10159 N PRO B 130 40.786 5.655 75.484 1.00 70.66 N ATOM 10160 CA PRO B 130 41.603 4.477 75.210 1.00 72.42 C ATOM 10161 C PRO B 130 41.303 3.359 76.212 1.00 74.39 C ATOM 10162 O PRO B 130 40.889 3.645 77.340 1.00 74.54 O ATOM 10163 CB PRO B 130 43.042 4.986 75.397 1.00 71.94 C ATOM 10164 CG PRO B 130 42.937 6.475 75.629 1.00 71.77 C ATOM 10165 CD PRO B 130 41.559 6.725 76.132 1.00 70.76 C ATOM 10166 HA PRO B 130 41.418 4.058 74.221 1.00 0.00 H ATOM 10167 HD3 PRO B 130 41.514 6.642 77.218 1.00 0.00 H ATOM 10168 HD2 PRO B 130 41.201 7.709 75.829 1.00 0.00 H ATOM 10169 HG3 PRO B 130 43.102 7.015 74.697 1.00 0.00 H ATOM 10170 HG2 PRO B 130 43.672 6.795 76.368 1.00 0.00 H ATOM 10171 HB2 PRO B 130 43.506 4.501 76.256 1.00 0.00 H ATOM 10172 HB3 PRO B 130 43.634 4.783 74.504 1.00 0.00 H ATOM 10173 N PRO B 131 41.495 2.092 75.802 1.00 76.23 N ATOM 10174 CA PRO B 131 41.307 0.954 76.706 1.00 77.36 C ATOM 10175 C PRO B 131 42.236 1.015 77.922 1.00 78.17 C ATOM 10176 O PRO B 131 43.453 1.160 77.767 1.00 77.76 O ATOM 10177 CB PRO B 131 41.651 -0.261 75.829 1.00 77.42 C ATOM 10178 CG PRO B 131 42.438 0.286 74.688 1.00 77.08 C ATOM 10179 CD PRO B 131 41.889 1.657 74.451 1.00 76.85 C ATOM 10180 HA PRO B 131 40.299 0.927 77.120 1.00 0.00 H ATOM 10181 HD3 PRO B 131 42.649 2.317 74.032 1.00 0.00 H ATOM 10182 HD2 PRO B 131 41.029 1.625 73.782 1.00 0.00 H ATOM 10183 HG3 PRO B 131 42.309 -0.336 73.802 1.00 0.00 H ATOM 10184 HG2 PRO B 131 43.496 0.337 74.944 1.00 0.00 H ATOM 10185 HB2 PRO B 131 42.244 -0.982 76.391 1.00 0.00 H ATOM 10186 HB3 PRO B 131 40.741 -0.742 75.470 1.00 0.00 H ATOM 10187 N PRO B 132 41.660 0.907 79.130 1.00 79.21 N ATOM 10188 CA PRO B 132 42.425 0.951 80.371 1.00 79.64 C ATOM 10189 C PRO B 132 42.919 -0.432 80.785 1.00 79.80 C ATOM 10190 O PRO B 132 44.121 -0.696 80.736 1.00 80.30 O ATOM 10191 CB PRO B 132 41.407 1.478 81.383 1.00 79.72 C ATOM 10192 CG PRO B 132 40.069 1.019 80.855 1.00 79.77 C ATOM 10193 CD PRO B 132 40.215 0.735 79.376 1.00 79.51 C ATOM 10194 HA PRO B 132 43.322 1.564 80.286 1.00 0.00 H ATOM 10195 HD3 PRO B 132 39.898 -0.281 79.142 1.00 0.00 H ATOM 10196 HD2 PRO B 132 39.632 1.441 78.784 1.00 0.00 H ATOM 10197 HG3 PRO B 132 39.324 1.800 81.009 1.00 0.00 H ATOM 10198 HG2 PRO B 132 39.758 0.113 81.376 1.00 0.00 H ATOM 10199 HB2 PRO B 132 41.595 1.059 82.372 1.00 0.00 H ATOM 10200 HB3 PRO B 132 41.446 2.566 81.438 1.00 0.00 H TER 10201 PRO B 132 ATOM 10202 N THR B 135 47.858 -3.381 77.576 1.00 83.28 N ATOM 10203 CA THR B 135 47.483 -2.375 76.590 1.00 82.89 C ATOM 10204 C THR B 135 48.715 -1.822 75.873 1.00 82.70 C ATOM 10205 O THR B 135 49.507 -1.073 76.456 1.00 82.83 O ATOM 10206 CB THR B 135 46.682 -1.218 77.228 1.00 82.90 C ATOM 10207 OG1 THR B 135 47.444 -0.635 78.293 1.00 82.98 O ATOM 10208 CG2 THR B 135 45.355 -1.726 77.781 1.00 83.02 C ATOM 10209 HA THR B 135 46.842 -2.870 75.860 1.00 0.00 H ATOM 10210 HB THR B 135 46.483 -0.470 76.461 1.00 0.00 H ATOM 10211 HG1 THR B 135 48.298 -0.286 77.934 1.00 0.00 H ATOM 10212 HG23 THR B 135 44.773 -2.170 76.974 1.00 0.00 H ATOM 10213 HG21 THR B 135 45.546 -2.476 78.548 1.00 0.00 H ATOM 10214 HG22 THR B 135 44.801 -0.894 78.215 1.00 0.00 H ATOM 10215 HN3 THR B 135 48.491 -2.954 78.282 1.00 0.00 H ATOM 10216 HN2 THR B 135 48.347 -4.166 77.100 1.00 0.00 H ATOM 10217 HN1 THR B 135 47.003 -3.739 78.047 1.00 0.00 H ATOM 10218 N ASP B 136 48.867 -2.203 74.606 1.00 81.89 N ATOM 10219 CA ASP B 136 49.984 -1.756 73.776 1.00 80.76 C ATOM 10220 C ASP B 136 49.806 -0.298 73.343 1.00 79.90 C ATOM 10221 O ASP B 136 48.709 0.253 73.460 1.00 79.34 O ATOM 10222 CB ASP B 136 50.132 -2.662 72.546 1.00 81.04 C ATOM 10223 CG ASP B 136 48.888 -2.670 71.671 1.00 81.29 C ATOM 10224 OD1 ASP B 136 47.797 -3.006 72.180 1.00 81.12 O ATOM 10225 OD2 ASP B 136 49.005 -2.347 70.468 1.00 81.38 O ATOM 10226 HA ASP B 136 50.893 -1.821 74.374 1.00 0.00 H ATOM 10227 HB2 ASP B 136 50.975 -2.309 71.952 1.00 0.00 H ATOM 10228 HB3 ASP B 136 50.328 -3.680 72.883 1.00 0.00 H ATOM 10229 H ASP B 136 48.162 -2.845 74.190 1.00 0.00 H ATOM 10230 N PRO B 137 50.886 0.331 72.843 1.00 78.73 N ATOM 10231 CA PRO B 137 50.840 1.719 72.379 1.00 77.54 C ATOM 10232 C PRO B 137 49.770 1.982 71.317 1.00 76.22 C ATOM 10233 O PRO B 137 49.127 3.030 71.344 1.00 76.25 O ATOM 10234 CB PRO B 137 52.236 1.938 71.775 1.00 77.77 C ATOM 10235 CG PRO B 137 52.804 0.570 71.582 1.00 78.52 C ATOM 10236 CD PRO B 137 52.233 -0.243 72.692 1.00 78.59 C ATOM 10237 HA PRO B 137 50.584 2.392 73.197 1.00 0.00 H ATOM 10238 HD3 PRO B 137 52.185 -1.298 72.424 1.00 0.00 H ATOM 10239 HD2 PRO B 137 52.816 -0.128 73.606 1.00 0.00 H ATOM 10240 HG3 PRO B 137 53.892 0.594 71.644 1.00 0.00 H ATOM 10241 HG2 PRO B 137 52.506 0.163 70.616 1.00 0.00 H ATOM 10242 HB2 PRO B 137 52.161 2.458 70.820 1.00 0.00 H ATOM 10243 HB3 PRO B 137 52.860 2.518 72.456 1.00 0.00 H ATOM 10244 N ASP B 138 49.580 1.040 70.397 1.00 74.42 N ATOM 10245 CA ASP B 138 48.620 1.225 69.308 1.00 72.83 C ATOM 10246 C ASP B 138 47.161 1.196 69.769 1.00 70.95 C ATOM 10247 O ASP B 138 46.291 1.747 69.100 1.00 70.37 O ATOM 10248 CB ASP B 138 48.858 0.208 68.189 1.00 73.73 C ATOM 10249 CG ASP B 138 50.099 0.524 67.373 1.00 74.76 C ATOM 10250 OD1 ASP B 138 50.846 1.455 67.752 1.00 74.97 O ATOM 10251 OD2 ASP B 138 50.330 -0.158 66.350 1.00 75.20 O ATOM 10252 HA ASP B 138 48.796 2.228 68.919 1.00 0.00 H ATOM 10253 HB2 ASP B 138 48.973 -0.781 68.633 1.00 0.00 H ATOM 10254 HB3 ASP B 138 47.993 0.208 67.526 1.00 0.00 H ATOM 10255 H ASP B 138 50.124 0.155 70.453 1.00 0.00 H ATOM 10256 N SER B 139 46.895 0.562 70.906 1.00 68.79 N ATOM 10257 CA SER B 139 45.545 0.572 71.462 1.00 66.64 C ATOM 10258 C SER B 139 45.258 1.944 72.073 1.00 64.31 C ATOM 10259 O SER B 139 44.099 2.331 72.234 1.00 63.43 O ATOM 10260 CB SER B 139 45.365 -0.537 72.501 1.00 67.44 C ATOM 10261 OG SER B 139 46.150 -0.292 73.657 1.00 68.47 O ATOM 10262 HA SER B 139 44.833 0.381 70.659 1.00 0.00 H ATOM 10263 HB2 SER B 139 45.666 -1.488 72.062 1.00 0.00 H ATOM 10264 HB3 SER B 139 44.315 -0.588 72.789 1.00 0.00 H ATOM 10265 HG SER B 139 47.106 -0.250 73.403 1.00 0.00 H ATOM 10266 H SER B 139 47.654 0.055 71.404 1.00 0.00 H ATOM 10267 N ILE B 140 46.322 2.672 72.406 1.00 61.45 N ATOM 10268 CA ILE B 140 46.209 4.024 72.953 1.00 60.06 C ATOM 10269 C ILE B 140 46.200 5.080 71.840 1.00 58.36 C ATOM 10270 O ILE B 140 45.383 6.002 71.855 1.00 58.30 O ATOM 10271 CB ILE B 140 47.361 4.346 73.945 1.00 59.97 C ATOM 10272 CG1 ILE B 140 47.465 3.274 75.035 1.00 60.39 C ATOM 10273 CG2 ILE B 140 47.170 5.723 74.567 1.00 59.97 C ATOM 10274 CD1 ILE B 140 46.231 3.155 75.910 1.00 60.31 C ATOM 10275 HA ILE B 140 45.261 4.058 73.491 1.00 0.00 H ATOM 10276 HB ILE B 140 48.295 4.349 73.382 1.00 0.00 H ATOM 10277 HG12 ILE B 140 47.637 2.312 74.553 1.00 0.00 H ATOM 10278 HG13 ILE B 140 48.315 3.516 75.673 1.00 0.00 H ATOM 10279 HD11 ILE B 140 46.050 4.106 76.412 1.00 0.00 H ATOM 10280 HD12 ILE B 140 45.371 2.900 75.291 1.00 0.00 H ATOM 10281 HD13 ILE B 140 46.389 2.374 76.654 1.00 0.00 H ATOM 10282 HG21 ILE B 140 47.162 6.478 73.780 1.00 0.00 H ATOM 10283 HG22 ILE B 140 46.223 5.748 75.107 1.00 0.00 H ATOM 10284 HG23 ILE B 140 47.989 5.925 75.257 1.00 0.00 H ATOM 10285 H ILE B 140 47.269 2.264 72.272 1.00 0.00 H ATOM 10286 N LEU B 141 47.111 4.931 70.879 1.00 56.09 N ATOM 10287 CA LEU B 141 47.276 5.893 69.781 1.00 53.30 C ATOM 10288 C LEU B 141 46.145 5.888 68.754 1.00 51.76 C ATOM 10289 O LEU B 141 45.776 6.940 68.239 1.00 51.21 O ATOM 10290 CB LEU B 141 48.608 5.656 69.066 1.00 52.72 C ATOM 10291 CG LEU B 141 49.900 5.947 69.834 1.00 53.32 C ATOM 10292 CD1 LEU B 141 51.083 5.282 69.151 1.00 53.21 C ATOM 10293 CD2 LEU B 141 50.144 7.443 69.984 1.00 52.73 C ATOM 10294 HA LEU B 141 47.254 6.875 70.254 1.00 0.00 H ATOM 10295 HB2 LEU B 141 48.635 4.607 68.771 1.00 0.00 H ATOM 10296 HB3 LEU B 141 48.613 6.283 68.174 1.00 0.00 H ATOM 10297 HG LEU B 141 49.789 5.531 70.835 1.00 0.00 H ATOM 10298 HD21 LEU B 141 50.222 7.898 68.997 1.00 0.00 H ATOM 10299 HD22 LEU B 141 49.313 7.893 70.528 1.00 0.00 H ATOM 10300 HD23 LEU B 141 51.071 7.605 70.535 1.00 0.00 H ATOM 10301 HD11 LEU B 141 50.923 4.204 69.119 1.00 0.00 H ATOM 10302 HD12 LEU B 141 51.178 5.667 68.136 1.00 0.00 H ATOM 10303 HD13 LEU B 141 51.993 5.499 69.710 1.00 0.00 H ATOM 10304 H LEU B 141 47.732 4.097 70.907 1.00 0.00 H ATOM 10305 N ARG B 142 45.596 4.709 68.463 1.00 49.94 N ATOM 10306 CA ARG B 142 44.581 4.568 67.412 1.00 48.79 C ATOM 10307 C ARG B 142 43.328 5.425 67.614 1.00 46.28 C ATOM 10308 O ARG B 142 42.880 6.072 66.668 1.00 46.22 O ATOM 10309 CB ARG B 142 44.191 3.093 67.195 1.00 50.54 C ATOM 10310 CG ARG B 142 43.347 2.849 65.934 1.00 52.41 C ATOM 10311 CD ARG B 142 42.803 1.419 65.843 1.00 54.84 C ATOM 10312 NE ARG B 142 43.853 0.408 65.954 1.00 56.54 N ATOM 10313 CZ ARG B 142 43.975 -0.443 66.972 1.00 57.75 C ATOM 10314 NH1 ARG B 142 43.102 -0.424 67.974 1.00 57.61 N ATOM 10315 NH2 ARG B 142 44.969 -1.323 66.984 1.00 57.82 N ATOM 10316 HA ARG B 142 45.064 4.951 66.513 1.00 0.00 H ATOM 10317 HB2 ARG B 142 45.105 2.505 67.115 1.00 0.00 H ATOM 10318 HB3 ARG B 142 43.619 2.758 68.061 1.00 0.00 H ATOM 10319 HG2 ARG B 142 42.505 3.541 65.940 1.00 0.00 H ATOM 10320 HG3 ARG B 142 43.967 3.041 65.058 1.00 0.00 H ATOM 10321 HD2 ARG B 142 42.301 1.297 64.883 1.00 0.00 H ATOM 10322 HD3 ARG B 142 42.085 1.267 66.649 1.00 0.00 H ATOM 10323 HE ARG B 142 44.552 0.349 65.186 1.00 0.00 H ATOM 10324 HH12 ARG B 142 43.204 -1.091 68.765 1.00 0.00 H ATOM 10325 HH11 ARG B 142 42.317 0.258 67.967 1.00 0.00 H ATOM 10326 HH22 ARG B 142 45.065 -1.988 67.778 1.00 0.00 H ATOM 10327 HH21 ARG B 142 45.651 -1.348 66.199 1.00 0.00 H ATOM 10328 H ARG B 142 45.895 3.867 68.995 1.00 0.00 H ATOM 10329 N PRO B 143 42.755 5.434 68.834 1.00 44.13 N ATOM 10330 CA PRO B 143 41.600 6.304 69.046 1.00 42.00 C ATOM 10331 C PRO B 143 41.904 7.775 68.740 1.00 38.73 C ATOM 10332 O PRO B 143 41.028 8.501 68.284 1.00 37.06 O ATOM 10333 CB PRO B 143 41.292 6.132 70.543 1.00 42.96 C ATOM 10334 CG PRO B 143 41.892 4.828 70.915 1.00 43.59 C ATOM 10335 CD PRO B 143 43.100 4.671 70.049 1.00 44.31 C ATOM 10336 HA PRO B 143 40.773 6.039 68.387 1.00 0.00 H ATOM 10337 HD3 PRO B 143 43.983 5.087 70.533 1.00 0.00 H ATOM 10338 HD2 PRO B 143 43.277 3.622 69.813 1.00 0.00 H ATOM 10339 HG3 PRO B 143 41.185 4.019 70.731 1.00 0.00 H ATOM 10340 HG2 PRO B 143 42.177 4.828 71.967 1.00 0.00 H ATOM 10341 HB2 PRO B 143 41.742 6.939 71.121 1.00 0.00 H ATOM 10342 HB3 PRO B 143 40.215 6.121 70.713 1.00 0.00 H ATOM 10343 N PHE B 144 43.132 8.208 68.993 1.00 37.40 N ATOM 10344 CA PHE B 144 43.505 9.602 68.734 1.00 38.27 C ATOM 10345 C PHE B 144 43.818 9.854 67.249 1.00 37.30 C ATOM 10346 O PHE B 144 43.574 10.946 66.734 1.00 36.99 O ATOM 10347 CB PHE B 144 44.645 10.030 69.659 1.00 38.24 C ATOM 10348 CG PHE B 144 44.212 10.172 71.097 1.00 39.76 C ATOM 10349 CD1 PHE B 144 43.736 11.388 71.576 1.00 39.22 C ATOM 10350 CD2 PHE B 144 44.251 9.085 71.960 1.00 39.42 C ATOM 10351 CE1 PHE B 144 43.324 11.524 72.897 1.00 39.27 C ATOM 10352 CE2 PHE B 144 43.837 9.214 73.288 1.00 39.96 C ATOM 10353 CZ PHE B 144 43.373 10.434 73.752 1.00 39.42 C ATOM 10354 HA PHE B 144 42.644 10.231 68.962 1.00 0.00 H ATOM 10355 HB2 PHE B 144 45.436 9.282 69.606 1.00 0.00 H ATOM 10356 HB3 PHE B 144 45.031 10.990 69.315 1.00 0.00 H ATOM 10357 HD2 PHE B 144 44.608 8.121 71.598 1.00 0.00 H ATOM 10358 HE2 PHE B 144 43.879 8.356 73.958 1.00 0.00 H ATOM 10359 HZ PHE B 144 43.047 10.537 74.787 1.00 0.00 H ATOM 10360 HE1 PHE B 144 42.963 12.486 73.260 1.00 0.00 H ATOM 10361 HD1 PHE B 144 43.685 12.246 70.906 1.00 0.00 H ATOM 10362 H PHE B 144 43.839 7.551 69.380 1.00 0.00 H ATOM 10363 N LYS B 145 44.346 8.837 66.573 1.00 37.12 N ATOM 10364 CA LYS B 145 44.553 8.907 65.126 1.00 36.95 C ATOM 10365 C LYS B 145 43.209 9.029 64.430 1.00 36.12 C ATOM 10366 O LYS B 145 43.050 9.846 63.531 1.00 35.20 O ATOM 10367 CB LYS B 145 45.307 7.681 64.603 1.00 37.72 C ATOM 10368 CG LYS B 145 45.392 7.622 63.075 1.00 40.02 C ATOM 10369 CD LYS B 145 46.306 6.504 62.596 1.00 42.57 C ATOM 10370 CE LYS B 145 47.767 6.828 62.883 1.00 44.12 C ATOM 10371 NZ LYS B 145 48.154 8.159 62.328 1.00 46.19 N ATOM 10372 HA LYS B 145 45.163 9.784 64.910 1.00 0.00 H ATOM 10373 HB2 LYS B 145 46.320 7.701 65.005 1.00 0.00 H ATOM 10374 HB3 LYS B 145 44.796 6.785 64.955 1.00 0.00 H ATOM 10375 HG2 LYS B 145 44.392 7.456 62.673 1.00 0.00 H ATOM 10376 HG3 LYS B 145 45.777 8.573 62.707 1.00 0.00 H ATOM 10377 HD2 LYS B 145 46.038 5.581 63.110 1.00 0.00 H ATOM 10378 HD3 LYS B 145 46.175 6.372 61.522 1.00 0.00 H ATOM 10379 HE2 LYS B 145 48.395 6.060 62.432 1.00 0.00 H ATOM 10380 HE3 LYS B 145 47.923 6.835 63.962 1.00 0.00 H ATOM 10381 HZ1 LYS B 145 48.014 8.158 61.298 1.00 0.00 H ATOM 10382 HZ2 LYS B 145 47.562 8.898 62.759 1.00 0.00 H ATOM 10383 HZ3 LYS B 145 49.154 8.345 62.543 1.00 0.00 H ATOM 10384 H LYS B 145 44.618 7.973 67.084 1.00 0.00 H ATOM 10385 N GLU B 146 42.240 8.220 64.855 1.00 35.66 N ATOM 10386 CA GLU B 146 40.901 8.248 64.266 1.00 35.59 C ATOM 10387 C GLU B 146 40.179 9.551 64.579 1.00 34.38 C ATOM 10388 O GLU B 146 39.349 10.021 63.797 1.00 33.61 O ATOM 10389 CB GLU B 146 40.068 7.059 64.754 1.00 38.94 C ATOM 10390 CG GLU B 146 40.584 5.705 64.285 1.00 42.30 C ATOM 10391 CD GLU B 146 39.810 4.539 64.885 1.00 45.13 C ATOM 10392 OE1 GLU B 146 39.035 4.761 65.849 1.00 46.12 O ATOM 10393 OE2 GLU B 146 39.984 3.401 64.391 1.00 44.97 O ATOM 10394 HA GLU B 146 41.021 8.177 63.185 1.00 0.00 H ATOM 10395 HB2 GLU B 146 40.066 7.066 65.844 1.00 0.00 H ATOM 10396 HB3 GLU B 146 39.048 7.182 64.389 1.00 0.00 H ATOM 10397 HG2 GLU B 146 40.500 5.657 63.199 1.00 0.00 H ATOM 10398 HG3 GLU B 146 41.631 5.613 64.572 1.00 0.00 H ATOM 10399 H GLU B 146 42.440 7.551 65.626 1.00 0.00 H ATOM 10400 N PHE B 147 40.498 10.123 65.737 1.00 32.97 N ATOM 10401 CA PHE B 147 39.928 11.391 66.160 1.00 31.70 C ATOM 10402 C PHE B 147 40.389 12.515 65.213 1.00 29.02 C ATOM 10403 O PHE B 147 39.587 13.319 64.749 1.00 27.28 O ATOM 10404 CB PHE B 147 40.353 11.676 67.602 1.00 34.95 C ATOM 10405 CG PHE B 147 39.730 12.898 68.191 1.00 37.96 C ATOM 10406 CD1 PHE B 147 38.469 12.840 68.769 1.00 39.16 C ATOM 10407 CD2 PHE B 147 40.410 14.110 68.183 1.00 38.72 C ATOM 10408 CE1 PHE B 147 37.891 13.976 69.326 1.00 40.08 C ATOM 10409 CE2 PHE B 147 39.837 15.247 68.734 1.00 40.28 C ATOM 10410 CZ PHE B 147 38.575 15.178 69.309 1.00 40.42 C ATOM 10411 HA PHE B 147 38.840 11.342 66.119 1.00 0.00 H ATOM 10412 HB2 PHE B 147 40.075 10.820 68.217 1.00 0.00 H ATOM 10413 HB3 PHE B 147 41.436 11.800 67.622 1.00 0.00 H ATOM 10414 HD2 PHE B 147 41.404 14.168 67.739 1.00 0.00 H ATOM 10415 HE2 PHE B 147 40.377 16.194 68.716 1.00 0.00 H ATOM 10416 HZ PHE B 147 38.124 16.069 69.746 1.00 0.00 H ATOM 10417 HE1 PHE B 147 36.900 13.919 69.776 1.00 0.00 H ATOM 10418 HD1 PHE B 147 37.926 11.895 68.786 1.00 0.00 H ATOM 10419 H PHE B 147 41.179 9.646 66.361 1.00 0.00 H ATOM 10420 N LEU B 148 41.681 12.565 64.928 1.00 27.06 N ATOM 10421 CA LEU B 148 42.191 13.558 63.977 1.00 28.43 C ATOM 10422 C LEU B 148 41.620 13.272 62.583 1.00 28.50 C ATOM 10423 O LEU B 148 41.109 14.173 61.911 1.00 28.41 O ATOM 10424 CB LEU B 148 43.724 13.561 63.949 1.00 26.58 C ATOM 10425 CG LEU B 148 44.388 14.476 62.911 1.00 26.80 C ATOM 10426 CD1 LEU B 148 44.026 15.945 63.151 1.00 25.72 C ATOM 10427 CD2 LEU B 148 45.910 14.279 62.892 1.00 25.19 C ATOM 10428 HA LEU B 148 41.869 14.549 64.298 1.00 0.00 H ATOM 10429 HB2 LEU B 148 44.073 13.870 64.934 1.00 0.00 H ATOM 10430 HB3 LEU B 148 44.054 12.541 63.751 1.00 0.00 H ATOM 10431 HG LEU B 148 44.002 14.196 61.931 1.00 0.00 H ATOM 10432 HD21 LEU B 148 46.318 14.514 63.875 1.00 0.00 H ATOM 10433 HD22 LEU B 148 46.138 13.243 62.640 1.00 0.00 H ATOM 10434 HD23 LEU B 148 46.351 14.941 62.147 1.00 0.00 H ATOM 10435 HD11 LEU B 148 42.945 16.068 63.081 1.00 0.00 H ATOM 10436 HD12 LEU B 148 44.363 16.244 64.144 1.00 0.00 H ATOM 10437 HD13 LEU B 148 44.513 16.565 62.398 1.00 0.00 H ATOM 10438 H LEU B 148 42.337 11.897 65.381 1.00 0.00 H ATOM 10439 N TYR B 149 41.685 12.009 62.170 1.00 29.87 N ATOM 10440 CA TYR B 149 41.214 11.581 60.844 1.00 31.58 C ATOM 10441 C TYR B 149 39.748 11.905 60.575 1.00 32.37 C ATOM 10442 O TYR B 149 39.386 12.245 59.450 1.00 32.92 O ATOM 10443 CB TYR B 149 41.472 10.082 60.654 1.00 33.56 C ATOM 10444 CG TYR B 149 42.907 9.768 60.312 1.00 33.41 C ATOM 10445 CD1 TYR B 149 43.941 10.574 60.761 1.00 34.13 C ATOM 10446 CD2 TYR B 149 43.228 8.660 59.541 1.00 35.09 C ATOM 10447 CE1 TYR B 149 45.251 10.294 60.452 1.00 35.30 C ATOM 10448 CE2 TYR B 149 44.539 8.367 59.224 1.00 35.61 C ATOM 10449 CZ TYR B 149 45.545 9.190 59.681 1.00 35.89 C ATOM 10450 OH TYR B 149 46.855 8.908 59.370 1.00 36.26 O ATOM 10451 HA TYR B 149 41.786 12.156 60.116 1.00 0.00 H ATOM 10452 HB3 TYR B 149 40.835 9.720 59.847 1.00 0.00 H ATOM 10453 HB2 TYR B 149 41.214 9.565 61.578 1.00 0.00 H ATOM 10454 HD2 TYR B 149 42.431 8.010 59.179 1.00 0.00 H ATOM 10455 HE2 TYR B 149 44.776 7.493 58.618 1.00 0.00 H ATOM 10456 HE1 TYR B 149 46.051 10.940 60.814 1.00 0.00 H ATOM 10457 HD1 TYR B 149 43.711 11.447 61.371 1.00 0.00 H ATOM 10458 HH TYR B 149 47.444 9.594 59.774 1.00 0.00 H ATOM 10459 H TYR B 149 42.085 11.295 62.811 1.00 0.00 H ATOM 10460 N SER B 150 38.904 11.818 61.597 1.00 31.08 N ATOM 10461 CA SER B 150 37.487 12.154 61.432 1.00 32.11 C ATOM 10462 C SER B 150 37.255 13.665 61.428 1.00 29.75 C ATOM 10463 O SER B 150 36.267 14.153 60.879 1.00 29.59 O ATOM 10464 CB SER B 150 36.654 11.531 62.553 1.00 34.14 C ATOM 10465 OG SER B 150 37.056 10.192 62.773 1.00 39.03 O ATOM 10466 HA SER B 150 37.178 11.751 60.467 1.00 0.00 H ATOM 10467 HB2 SER B 150 35.601 11.550 62.273 1.00 0.00 H ATOM 10468 HB3 SER B 150 36.795 12.105 63.469 1.00 0.00 H ATOM 10469 HG SER B 150 38.012 10.174 63.030 1.00 0.00 H ATOM 10470 H SER B 150 39.253 11.507 62.526 1.00 0.00 H ATOM 10471 N TYR B 151 38.160 14.397 62.062 1.00 28.72 N ATOM 10472 CA TYR B 151 38.048 15.845 62.151 1.00 28.02 C ATOM 10473 C TYR B 151 38.352 16.449 60.776 1.00 29.39 C ATOM 10474 O TYR B 151 37.514 17.149 60.194 1.00 27.45 O ATOM 10475 CB TYR B 151 38.989 16.387 63.237 1.00 27.06 C ATOM 10476 CG TYR B 151 38.849 17.878 63.511 1.00 27.28 C ATOM 10477 CD1 TYR B 151 37.959 18.353 64.478 1.00 25.19 C ATOM 10478 CD2 TYR B 151 39.612 18.816 62.803 1.00 25.61 C ATOM 10479 CE1 TYR B 151 37.831 19.723 64.722 1.00 22.96 C ATOM 10480 CE2 TYR B 151 39.489 20.179 63.051 1.00 23.39 C ATOM 10481 CZ TYR B 151 38.600 20.617 64.014 1.00 23.51 C ATOM 10482 OH TYR B 151 38.477 21.957 64.254 1.00 25.80 O ATOM 10483 HA TYR B 151 37.035 16.128 62.438 1.00 0.00 H ATOM 10484 HB3 TYR B 151 40.015 16.193 62.925 1.00 0.00 H ATOM 10485 HB2 TYR B 151 38.784 15.850 64.163 1.00 0.00 H ATOM 10486 HD2 TYR B 151 40.315 18.471 62.044 1.00 0.00 H ATOM 10487 HE2 TYR B 151 40.089 20.896 62.490 1.00 0.00 H ATOM 10488 HE1 TYR B 151 37.124 20.082 65.470 1.00 0.00 H ATOM 10489 HD1 TYR B 151 37.357 17.646 65.049 1.00 0.00 H ATOM 10490 HH TYR B 151 38.186 22.414 63.425 1.00 0.00 H ATOM 10491 H TYR B 151 38.972 13.924 62.508 1.00 0.00 H ATOM 10492 N ILE B 152 39.539 16.161 60.254 1.00 29.01 N ATOM 10493 CA ILE B 152 39.940 16.702 58.944 1.00 30.34 C ATOM 10494 C ILE B 152 39.425 15.872 57.764 1.00 31.42 C ATOM 10495 O ILE B 152 39.469 16.317 56.614 1.00 33.55 O ATOM 10496 CB ILE B 152 41.471 16.899 58.843 1.00 28.96 C ATOM 10497 CG1 ILE B 152 42.197 15.559 58.809 1.00 27.67 C ATOM 10498 CG2 ILE B 152 41.987 17.739 60.005 1.00 27.55 C ATOM 10499 CD1 ILE B 152 43.727 15.699 58.794 1.00 27.72 C ATOM 10500 HA ILE B 152 39.463 17.680 58.877 1.00 0.00 H ATOM 10501 HB ILE B 152 41.673 17.426 57.911 1.00 0.00 H ATOM 10502 HG12 ILE B 152 41.910 14.987 59.691 1.00 0.00 H ATOM 10503 HG13 ILE B 152 41.889 15.021 57.912 1.00 0.00 H ATOM 10504 HD11 ILE B 152 44.031 16.261 57.911 1.00 0.00 H ATOM 10505 HD12 ILE B 152 44.051 16.227 59.691 1.00 0.00 H ATOM 10506 HD13 ILE B 152 44.181 14.708 58.770 1.00 0.00 H ATOM 10507 HG21 ILE B 152 41.505 18.716 59.987 1.00 0.00 H ATOM 10508 HG22 ILE B 152 41.758 17.236 60.945 1.00 0.00 H ATOM 10509 HG23 ILE B 152 43.066 17.863 59.911 1.00 0.00 H ATOM 10510 H ILE B 152 40.194 15.545 60.777 1.00 0.00 H ATOM 10511 N GLY B 153 38.935 14.668 58.053 1.00 31.30 N ATOM 10512 CA GLY B 153 38.300 13.821 57.045 1.00 30.75 C ATOM 10513 C GLY B 153 39.214 13.134 56.050 1.00 31.41 C ATOM 10514 O GLY B 153 38.947 13.166 54.855 1.00 31.76 O ATOM 10515 HA3 GLY B 153 37.607 14.445 56.480 1.00 0.00 H ATOM 10516 HA2 GLY B 153 37.743 13.045 57.570 1.00 0.00 H ATOM 10517 H GLY B 153 39.007 14.318 59.030 1.00 0.00 H ATOM 10518 N VAL B 154 40.285 12.513 56.541 1.00 32.32 N ATOM 10519 CA VAL B 154 41.233 11.765 55.711 1.00 33.24 C ATOM 10520 C VAL B 154 40.513 10.748 54.806 1.00 34.89 C ATOM 10521 O VAL B 154 39.559 10.097 55.239 1.00 34.48 O ATOM 10522 CB VAL B 154 42.307 11.072 56.603 1.00 33.05 C ATOM 10523 CG1 VAL B 154 43.237 10.186 55.789 1.00 33.53 C ATOM 10524 CG2 VAL B 154 43.117 12.118 57.392 1.00 31.89 C ATOM 10525 HA VAL B 154 41.740 12.473 55.055 1.00 0.00 H ATOM 10526 HB VAL B 154 41.776 10.432 57.308 1.00 0.00 H ATOM 10527 HG11 VAL B 154 42.655 9.411 55.291 1.00 0.00 H ATOM 10528 HG12 VAL B 154 43.752 10.791 55.043 1.00 0.00 H ATOM 10529 HG13 VAL B 154 43.969 9.724 56.452 1.00 0.00 H ATOM 10530 HG21 VAL B 154 43.618 12.790 56.695 1.00 0.00 H ATOM 10531 HG22 VAL B 154 42.444 12.691 58.030 1.00 0.00 H ATOM 10532 HG23 VAL B 154 43.860 11.611 58.007 1.00 0.00 H ATOM 10533 H VAL B 154 40.457 12.561 57.565 1.00 0.00 H ATOM 10534 N PRO B 155 40.955 10.620 53.535 1.00 35.56 N ATOM 10535 CA PRO B 155 40.309 9.673 52.617 1.00 36.79 C ATOM 10536 C PRO B 155 40.337 8.237 53.135 1.00 38.23 C ATOM 10537 O PRO B 155 41.382 7.766 53.597 1.00 37.34 O ATOM 10538 CB PRO B 155 41.161 9.773 51.346 1.00 36.60 C ATOM 10539 CG PRO B 155 41.828 11.098 51.425 1.00 37.44 C ATOM 10540 CD PRO B 155 42.062 11.348 52.886 1.00 35.54 C ATOM 10541 HA PRO B 155 39.255 9.913 52.476 1.00 0.00 H ATOM 10542 HD3 PRO B 155 43.028 10.952 53.201 1.00 0.00 H ATOM 10543 HD2 PRO B 155 42.016 12.413 53.113 1.00 0.00 H ATOM 10544 HG3 PRO B 155 41.187 11.872 51.004 1.00 0.00 H ATOM 10545 HG2 PRO B 155 42.775 11.080 50.886 1.00 0.00 H ATOM 10546 HB2 PRO B 155 41.901 8.973 51.318 1.00 0.00 H ATOM 10547 HB3 PRO B 155 40.531 9.714 50.458 1.00 0.00 H ATOM 10548 N LYS B 156 39.199 7.552 53.048 1.00 40.57 N ATOM 10549 CA LYS B 156 39.102 6.155 53.483 1.00 43.84 C ATOM 10550 C LYS B 156 39.203 5.207 52.288 1.00 45.74 C ATOM 10551 O LYS B 156 39.443 4.015 52.453 1.00 46.69 O ATOM 10552 CB LYS B 156 37.815 5.914 54.282 1.00 43.89 C ATOM 10553 CG LYS B 156 37.755 6.720 55.580 1.00 45.05 C ATOM 10554 CD LYS B 156 36.547 6.382 56.456 1.00 45.72 C ATOM 10555 CE LYS B 156 35.225 6.688 55.764 1.00 47.12 C ATOM 10556 NZ LYS B 156 35.056 8.105 55.331 1.00 47.07 N ATOM 10557 HA LYS B 156 39.942 5.946 54.146 1.00 0.00 H ATOM 10558 HB2 LYS B 156 36.964 6.192 53.661 1.00 0.00 H ATOM 10559 HB3 LYS B 156 37.753 4.854 54.528 1.00 0.00 H ATOM 10560 HG2 LYS B 156 38.662 6.521 56.151 1.00 0.00 H ATOM 10561 HG3 LYS B 156 37.712 7.779 55.326 1.00 0.00 H ATOM 10562 HD2 LYS B 156 36.577 5.320 56.700 1.00 0.00 H ATOM 10563 HD3 LYS B 156 36.605 6.966 57.374 1.00 0.00 H ATOM 10564 HE2 LYS B 156 34.417 6.446 56.455 1.00 0.00 H ATOM 10565 HE3 LYS B 156 35.149 6.053 54.882 1.00 0.00 H ATOM 10566 HZ1 LYS B 156 35.111 8.729 56.161 1.00 0.00 H ATOM 10567 HZ2 LYS B 156 35.810 8.353 54.659 1.00 0.00 H ATOM 10568 HZ3 LYS B 156 34.130 8.218 54.872 1.00 0.00 H ATOM 10569 H LYS B 156 38.355 8.021 52.661 1.00 0.00 H ATOM 10570 N GLY B 157 39.025 5.752 51.089 1.00 47.17 N ATOM 10571 CA GLY B 157 39.172 4.982 49.858 1.00 48.50 C ATOM 10572 C GLY B 157 40.441 5.373 49.121 1.00 49.51 C ATOM 10573 O GLY B 157 41.472 5.644 49.742 1.00 50.58 O ATOM 10574 HA3 GLY B 157 38.313 5.171 49.214 1.00 0.00 H ATOM 10575 HA2 GLY B 157 39.214 3.921 50.104 1.00 0.00 H ATOM 10576 H GLY B 157 38.773 6.759 51.026 1.00 0.00 H ATOM 10577 N ASP B 158 40.370 5.406 47.797 1.00 49.82 N ATOM 10578 CA ASP B 158 41.535 5.755 46.992 1.00 51.11 C ATOM 10579 C ASP B 158 41.367 7.075 46.234 1.00 50.10 C ATOM 10580 O ASP B 158 42.248 7.470 45.467 1.00 50.08 O ATOM 10581 CB ASP B 158 41.903 4.608 46.042 1.00 53.85 C ATOM 10582 CG ASP B 158 40.687 3.859 45.535 1.00 56.19 C ATOM 10583 OD1 ASP B 158 39.572 4.436 45.544 1.00 58.25 O ATOM 10584 OD2 ASP B 158 40.846 2.689 45.127 1.00 56.95 O ATOM 10585 HA ASP B 158 42.361 5.909 47.686 1.00 0.00 H ATOM 10586 HB2 ASP B 158 42.441 5.020 45.188 1.00 0.00 H ATOM 10587 HB3 ASP B 158 42.548 3.908 46.573 1.00 0.00 H ATOM 10588 H ASP B 158 39.471 5.180 47.326 1.00 0.00 H ATOM 10589 N GLU B 159 40.243 7.754 46.453 1.00 46.85 N ATOM 10590 CA GLU B 159 40.054 9.085 45.901 1.00 45.53 C ATOM 10591 C GLU B 159 40.758 10.093 46.822 1.00 43.15 C ATOM 10592 O GLU B 159 40.663 9.988 48.050 1.00 40.87 O ATOM 10593 CB GLU B 159 38.572 9.410 45.745 1.00 47.25 C ATOM 10594 CG GLU B 159 37.853 8.536 44.724 1.00 50.12 C ATOM 10595 CD GLU B 159 36.367 8.829 44.654 1.00 51.82 C ATOM 10596 OE1 GLU B 159 35.837 9.478 45.583 1.00 53.85 O ATOM 10597 OE2 GLU B 159 35.719 8.411 43.669 1.00 53.53 O ATOM 10598 HA GLU B 159 40.490 9.138 44.903 1.00 0.00 H ATOM 10599 HB2 GLU B 159 38.088 9.278 46.712 1.00 0.00 H ATOM 10600 HB3 GLU B 159 38.479 10.450 45.433 1.00 0.00 H ATOM 10601 HG2 GLU B 159 38.291 8.713 43.742 1.00 0.00 H ATOM 10602 HG3 GLU B 159 37.991 7.490 44.999 1.00 0.00 H ATOM 10603 H GLU B 159 39.489 7.326 47.027 1.00 0.00 H ATOM 10604 N PRO B 160 41.468 11.071 46.230 1.00 40.70 N ATOM 10605 CA PRO B 160 42.285 12.033 46.974 1.00 39.75 C ATOM 10606 C PRO B 160 41.449 13.177 47.545 1.00 38.80 C ATOM 10607 O PRO B 160 41.831 14.340 47.441 1.00 38.95 O ATOM 10608 CB PRO B 160 43.249 12.556 45.911 1.00 39.49 C ATOM 10609 CG PRO B 160 42.483 12.462 44.639 1.00 39.96 C ATOM 10610 CD PRO B 160 41.508 11.320 44.776 1.00 40.27 C ATOM 10611 HA PRO B 160 42.777 11.582 47.836 1.00 0.00 H ATOM 10612 HD3 PRO B 160 40.524 11.601 44.402 1.00 0.00 H ATOM 10613 HD2 PRO B 160 41.861 10.439 44.240 1.00 0.00 H ATOM 10614 HG3 PRO B 160 43.163 12.273 43.809 1.00 0.00 H ATOM 10615 HG2 PRO B 160 41.943 13.392 44.460 1.00 0.00 H ATOM 10616 HB2 PRO B 160 43.529 13.589 46.118 1.00 0.00 H ATOM 10617 HB3 PRO B 160 44.147 11.940 45.867 1.00 0.00 H ATOM 10618 N ILE B 161 40.325 12.824 48.157 1.00 37.83 N ATOM 10619 CA ILE B 161 39.330 13.780 48.614 1.00 38.89 C ATOM 10620 C ILE B 161 39.160 13.748 50.130 1.00 38.66 C ATOM 10621 O ILE B 161 38.961 12.683 50.705 1.00 39.23 O ATOM 10622 CB ILE B 161 37.968 13.462 47.967 1.00 39.70 C ATOM 10623 CG1 ILE B 161 38.054 13.671 46.459 1.00 41.58 C ATOM 10624 CG2 ILE B 161 36.859 14.317 48.566 1.00 40.84 C ATOM 10625 CD1 ILE B 161 38.697 14.990 46.099 1.00 43.15 C ATOM 10626 HA ILE B 161 39.678 14.771 48.324 1.00 0.00 H ATOM 10627 HB ILE B 161 37.724 12.419 48.170 1.00 0.00 H ATOM 10628 HG12 ILE B 161 38.644 12.863 46.026 1.00 0.00 H ATOM 10629 HG13 ILE B 161 37.047 13.647 46.043 1.00 0.00 H ATOM 10630 HD11 ILE B 161 38.110 15.806 46.521 1.00 0.00 H ATOM 10631 HD12 ILE B 161 39.709 15.022 46.503 1.00 0.00 H ATOM 10632 HD13 ILE B 161 38.734 15.090 45.014 1.00 0.00 H ATOM 10633 HG21 ILE B 161 36.790 14.122 49.636 1.00 0.00 H ATOM 10634 HG22 ILE B 161 37.085 15.371 48.401 1.00 0.00 H ATOM 10635 HG23 ILE B 161 35.912 14.068 48.088 1.00 0.00 H ATOM 10636 H ILE B 161 40.147 11.812 48.318 1.00 0.00 H ATOM 10637 N LEU B 162 39.240 14.917 50.761 1.00 36.46 N ATOM 10638 CA LEU B 162 39.026 15.038 52.197 1.00 35.88 C ATOM 10639 C LEU B 162 37.578 15.400 52.489 1.00 36.97 C ATOM 10640 O LEU B 162 36.923 16.060 51.684 1.00 36.55 O ATOM 10641 CB LEU B 162 39.944 16.097 52.791 1.00 34.71 C ATOM 10642 CG LEU B 162 41.453 15.901 52.648 1.00 34.41 C ATOM 10643 CD1 LEU B 162 42.179 17.199 52.922 1.00 33.37 C ATOM 10644 CD2 LEU B 162 41.949 14.820 53.578 1.00 35.46 C ATOM 10645 HA LEU B 162 39.255 14.075 52.654 1.00 0.00 H ATOM 10646 HB2 LEU B 162 39.694 17.046 52.317 1.00 0.00 H ATOM 10647 HB3 LEU B 162 39.724 16.156 53.857 1.00 0.00 H ATOM 10648 HG LEU B 162 41.659 15.590 51.624 1.00 0.00 H ATOM 10649 HD21 LEU B 162 41.728 15.099 54.608 1.00 0.00 H ATOM 10650 HD22 LEU B 162 41.450 13.881 53.340 1.00 0.00 H ATOM 10651 HD23 LEU B 162 43.026 14.702 53.455 1.00 0.00 H ATOM 10652 HD11 LEU B 162 41.849 17.956 52.210 1.00 0.00 H ATOM 10653 HD12 LEU B 162 41.957 17.531 53.936 1.00 0.00 H ATOM 10654 HD13 LEU B 162 43.253 17.043 52.816 1.00 0.00 H ATOM 10655 H LEU B 162 39.462 15.771 50.211 1.00 0.00 H ATOM 10656 N LYS B 163 37.083 14.966 53.647 1.00 38.17 N ATOM 10657 CA LYS B 163 35.706 15.247 54.041 1.00 39.44 C ATOM 10658 C LYS B 163 35.641 15.725 55.499 1.00 38.65 C ATOM 10659 O LYS B 163 35.283 14.955 56.392 1.00 37.90 O ATOM 10660 CB LYS B 163 34.852 13.993 53.831 1.00 42.26 C ATOM 10661 CG LYS B 163 33.352 14.244 53.675 1.00 46.06 C ATOM 10662 CD LYS B 163 32.584 13.982 54.961 1.00 48.11 C ATOM 10663 CE LYS B 163 31.079 13.964 54.718 1.00 49.93 C ATOM 10664 NZ LYS B 163 30.544 15.316 54.361 1.00 51.23 N ATOM 10665 HA LYS B 163 35.312 16.050 53.419 1.00 0.00 H ATOM 10666 HB2 LYS B 163 35.205 13.491 52.930 1.00 0.00 H ATOM 10667 HB3 LYS B 163 34.997 13.339 54.691 1.00 0.00 H ATOM 10668 HG2 LYS B 163 33.199 15.282 53.381 1.00 0.00 H ATOM 10669 HG3 LYS B 163 32.966 13.587 52.896 1.00 0.00 H ATOM 10670 HD2 LYS B 163 32.889 13.017 55.366 1.00 0.00 H ATOM 10671 HD3 LYS B 163 32.818 14.767 55.680 1.00 0.00 H ATOM 10672 HE2 LYS B 163 30.582 13.618 55.624 1.00 0.00 H ATOM 10673 HE3 LYS B 163 30.864 13.275 53.901 1.00 0.00 H ATOM 10674 HZ1 LYS B 163 30.737 15.980 55.138 1.00 0.00 H ATOM 10675 HZ2 LYS B 163 31.007 15.652 53.492 1.00 0.00 H ATOM 10676 HZ3 LYS B 163 29.518 15.251 54.206 1.00 0.00 H ATOM 10677 H LYS B 163 37.692 14.414 54.285 1.00 0.00 H ATOM 10678 N PRO B 164 35.989 17.005 55.742 1.00 37.45 N ATOM 10679 CA PRO B 164 36.025 17.578 57.087 1.00 36.06 C ATOM 10680 C PRO B 164 34.688 17.474 57.803 1.00 35.44 C ATOM 10681 O PRO B 164 33.633 17.597 57.178 1.00 34.50 O ATOM 10682 CB PRO B 164 36.359 19.053 56.837 1.00 36.24 C ATOM 10683 CG PRO B 164 36.086 19.285 55.385 1.00 36.00 C ATOM 10684 CD PRO B 164 36.377 17.990 54.719 1.00 36.49 C ATOM 10685 HA PRO B 164 36.739 17.056 57.724 1.00 0.00 H ATOM 10686 HD3 PRO B 164 35.782 17.871 53.813 1.00 0.00 H ATOM 10687 HD2 PRO B 164 37.435 17.904 54.472 1.00 0.00 H ATOM 10688 HG3 PRO B 164 36.735 20.069 54.995 1.00 0.00 H ATOM 10689 HG2 PRO B 164 35.044 19.567 55.233 1.00 0.00 H ATOM 10690 HB2 PRO B 164 35.728 19.696 57.451 1.00 0.00 H ATOM 10691 HB3 PRO B 164 37.407 19.250 57.064 1.00 0.00 H ATOM 10692 N SER B 165 34.733 17.246 59.111 1.00 34.33 N ATOM 10693 CA SER B 165 33.502 17.179 59.886 1.00 33.29 C ATOM 10694 C SER B 165 32.803 18.528 59.821 1.00 31.83 C ATOM 10695 O SER B 165 33.422 19.554 59.535 1.00 30.38 O ATOM 10696 CB SER B 165 33.783 16.795 61.343 1.00 32.62 C ATOM 10697 OG SER B 165 34.510 17.809 62.026 1.00 32.39 O ATOM 10698 HA SER B 165 32.859 16.408 59.462 1.00 0.00 H ATOM 10699 HB2 SER B 165 34.363 15.873 61.359 1.00 0.00 H ATOM 10700 HB3 SER B 165 32.834 16.635 61.855 1.00 0.00 H ATOM 10701 HG SER B 165 34.671 17.525 62.961 1.00 0.00 H ATOM 10702 H SER B 165 35.650 17.115 59.583 1.00 0.00 H ATOM 10703 N LEU B 166 31.503 18.525 60.072 1.00 32.68 N ATOM 10704 CA LEU B 166 30.762 19.767 60.160 1.00 32.89 C ATOM 10705 C LEU B 166 31.392 20.644 61.251 1.00 32.24 C ATOM 10706 O LEU B 166 31.511 21.855 61.086 1.00 32.01 O ATOM 10707 CB LEU B 166 29.293 19.481 60.456 1.00 34.50 C ATOM 10708 CG LEU B 166 28.346 20.645 60.718 1.00 36.32 C ATOM 10709 CD1 LEU B 166 28.142 21.502 59.468 1.00 37.48 C ATOM 10710 CD2 LEU B 166 27.023 20.092 61.221 1.00 37.33 C ATOM 10711 HA LEU B 166 30.808 20.300 59.210 1.00 0.00 H ATOM 10712 HB2 LEU B 166 28.896 18.934 59.601 1.00 0.00 H ATOM 10713 HB3 LEU B 166 29.265 18.842 61.339 1.00 0.00 H ATOM 10714 HG LEU B 166 28.785 21.297 61.474 1.00 0.00 H ATOM 10715 HD21 LEU B 166 26.597 19.430 60.467 1.00 0.00 H ATOM 10716 HD22 LEU B 166 27.190 19.535 62.143 1.00 0.00 H ATOM 10717 HD23 LEU B 166 26.336 20.916 61.413 1.00 0.00 H ATOM 10718 HD11 LEU B 166 29.102 21.906 59.145 1.00 0.00 H ATOM 10719 HD12 LEU B 166 27.719 20.888 58.673 1.00 0.00 H ATOM 10720 HD13 LEU B 166 27.460 22.321 59.698 1.00 0.00 H ATOM 10721 H LEU B 166 31.008 17.621 60.208 1.00 0.00 H ATOM 10722 N PHE B 167 31.826 20.026 62.349 1.00 30.87 N ATOM 10723 CA PHE B 167 32.447 20.771 63.444 1.00 30.57 C ATOM 10724 C PHE B 167 33.722 21.496 62.992 1.00 29.84 C ATOM 10725 O PHE B 167 33.916 22.671 63.300 1.00 29.54 O ATOM 10726 CB PHE B 167 32.727 19.860 64.647 1.00 30.15 C ATOM 10727 CG PHE B 167 33.319 20.586 65.832 1.00 30.18 C ATOM 10728 CD1 PHE B 167 32.605 21.577 66.483 1.00 30.40 C ATOM 10729 CD2 PHE B 167 34.590 20.277 66.288 1.00 30.16 C ATOM 10730 CE1 PHE B 167 33.148 22.249 67.570 1.00 30.48 C ATOM 10731 CE2 PHE B 167 35.138 20.939 67.373 1.00 29.52 C ATOM 10732 CZ PHE B 167 34.419 21.925 68.013 1.00 29.62 C ATOM 10733 HA PHE B 167 31.735 21.534 63.758 1.00 0.00 H ATOM 10734 HB2 PHE B 167 31.788 19.401 64.958 1.00 0.00 H ATOM 10735 HB3 PHE B 167 33.425 19.082 64.336 1.00 0.00 H ATOM 10736 HD2 PHE B 167 35.167 19.501 65.785 1.00 0.00 H ATOM 10737 HE2 PHE B 167 36.138 20.680 67.721 1.00 0.00 H ATOM 10738 HZ PHE B 167 34.850 22.449 68.866 1.00 0.00 H ATOM 10739 HE1 PHE B 167 32.576 23.029 68.073 1.00 0.00 H ATOM 10740 HD1 PHE B 167 31.603 21.833 66.138 1.00 0.00 H ATOM 10741 H PHE B 167 31.721 18.994 62.429 1.00 0.00 H ATOM 10742 N ALA B 168 34.574 20.793 62.252 1.00 29.24 N ATOM 10743 CA ALA B 168 35.821 21.356 61.734 1.00 29.40 C ATOM 10744 C ALA B 168 35.581 22.557 60.824 1.00 28.85 C ATOM 10745 O ALA B 168 36.312 23.545 60.885 1.00 28.04 O ATOM 10746 CB ALA B 168 36.606 20.288 60.995 1.00 29.46 C ATOM 10747 HA ALA B 168 36.398 21.709 62.589 1.00 0.00 H ATOM 10748 HB1 ALA B 168 36.838 19.471 61.678 1.00 0.00 H ATOM 10749 HB2 ALA B 168 36.010 19.911 60.164 1.00 0.00 H ATOM 10750 HB3 ALA B 168 37.532 20.718 60.614 1.00 0.00 H ATOM 10751 H ALA B 168 34.345 19.803 62.032 1.00 0.00 H ATOM 10752 N TYR B 169 34.547 22.456 59.987 1.00 30.52 N ATOM 10753 CA TYR B 169 34.188 23.499 59.033 1.00 30.35 C ATOM 10754 C TYR B 169 33.718 24.776 59.728 1.00 31.47 C ATOM 10755 O TYR B 169 34.139 25.873 59.373 1.00 30.65 O ATOM 10756 CB TYR B 169 33.102 22.998 58.063 1.00 29.39 C ATOM 10757 CG TYR B 169 32.840 23.951 56.910 1.00 29.44 C ATOM 10758 CD1 TYR B 169 33.626 23.910 55.760 1.00 30.91 C ATOM 10759 CD2 TYR B 169 31.823 24.896 56.972 1.00 29.67 C ATOM 10760 CE1 TYR B 169 33.404 24.781 54.705 1.00 29.47 C ATOM 10761 CE2 TYR B 169 31.590 25.779 55.913 1.00 29.47 C ATOM 10762 CZ TYR B 169 32.386 25.709 54.783 1.00 29.82 C ATOM 10763 OH TYR B 169 32.175 26.568 53.730 1.00 28.45 O ATOM 10764 HA TYR B 169 35.090 23.740 58.470 1.00 0.00 H ATOM 10765 HB3 TYR B 169 32.175 22.865 58.620 1.00 0.00 H ATOM 10766 HB2 TYR B 169 33.419 22.039 57.654 1.00 0.00 H ATOM 10767 HD2 TYR B 169 31.196 24.950 57.862 1.00 0.00 H ATOM 10768 HE2 TYR B 169 30.789 26.515 55.977 1.00 0.00 H ATOM 10769 HE1 TYR B 169 34.032 24.733 53.816 1.00 0.00 H ATOM 10770 HD1 TYR B 169 34.431 23.179 55.689 1.00 0.00 H ATOM 10771 HH TYR B 169 32.831 26.377 53.013 1.00 0.00 H ATOM 10772 H TYR B 169 33.969 21.592 60.016 1.00 0.00 H ATOM 10773 N ILE B 170 32.831 24.621 60.712 1.00 31.87 N ATOM 10774 CA ILE B 170 32.283 25.749 61.453 1.00 31.44 C ATOM 10775 C ILE B 170 33.373 26.437 62.270 1.00 31.14 C ATOM 10776 O ILE B 170 33.422 27.665 62.361 1.00 33.18 O ATOM 10777 CB ILE B 170 31.119 25.287 62.358 1.00 33.14 C ATOM 10778 CG1 ILE B 170 29.948 24.819 61.487 1.00 32.87 C ATOM 10779 CG2 ILE B 170 30.691 26.404 63.313 1.00 32.79 C ATOM 10780 CD1 ILE B 170 28.841 24.121 62.249 1.00 35.56 C ATOM 10781 HA ILE B 170 31.890 26.474 60.740 1.00 0.00 H ATOM 10782 HB ILE B 170 31.455 24.451 62.971 1.00 0.00 H ATOM 10783 HG12 ILE B 170 29.523 25.691 60.990 1.00 0.00 H ATOM 10784 HG13 ILE B 170 30.335 24.128 60.738 1.00 0.00 H ATOM 10785 HD11 ILE B 170 29.243 23.237 62.743 1.00 0.00 H ATOM 10786 HD12 ILE B 170 28.431 24.801 62.996 1.00 0.00 H ATOM 10787 HD13 ILE B 170 28.055 23.824 61.555 1.00 0.00 H ATOM 10788 HG21 ILE B 170 31.535 26.685 63.943 1.00 0.00 H ATOM 10789 HG22 ILE B 170 30.364 27.269 62.735 1.00 0.00 H ATOM 10790 HG23 ILE B 170 29.870 26.051 63.938 1.00 0.00 H ATOM 10791 H ILE B 170 32.519 23.660 60.959 1.00 0.00 H ATOM 10792 N VAL B 171 34.255 25.635 62.852 1.00 30.48 N ATOM 10793 CA VAL B 171 35.385 26.149 63.612 1.00 28.92 C ATOM 10794 C VAL B 171 36.358 26.920 62.706 1.00 28.91 C ATOM 10795 O VAL B 171 37.023 27.869 63.150 1.00 28.32 O ATOM 10796 CB VAL B 171 36.099 25.009 64.368 1.00 27.77 C ATOM 10797 CG1 VAL B 171 37.356 25.506 65.040 1.00 27.42 C ATOM 10798 CG2 VAL B 171 35.160 24.403 65.412 1.00 29.48 C ATOM 10799 HA VAL B 171 35.004 26.852 64.353 1.00 0.00 H ATOM 10800 HB VAL B 171 36.377 24.245 63.642 1.00 0.00 H ATOM 10801 HG11 VAL B 171 38.036 25.905 64.287 1.00 0.00 H ATOM 10802 HG12 VAL B 171 37.100 26.290 65.752 1.00 0.00 H ATOM 10803 HG13 VAL B 171 37.837 24.680 65.564 1.00 0.00 H ATOM 10804 HG21 VAL B 171 34.863 25.174 66.123 1.00 0.00 H ATOM 10805 HG22 VAL B 171 34.275 24.005 64.915 1.00 0.00 H ATOM 10806 HG23 VAL B 171 35.675 23.600 65.939 1.00 0.00 H ATOM 10807 H VAL B 171 34.135 24.606 62.762 1.00 0.00 H ATOM 10808 N PHE B 172 36.449 26.523 61.438 1.00 28.03 N ATOM 10809 CA PHE B 172 37.272 27.287 60.495 1.00 27.96 C ATOM 10810 C PHE B 172 36.660 28.668 60.319 1.00 27.71 C ATOM 10811 O PHE B 172 37.355 29.675 60.403 1.00 29.29 O ATOM 10812 CB PHE B 172 37.449 26.579 59.136 1.00 27.62 C ATOM 10813 CG PHE B 172 38.260 27.383 58.142 1.00 26.29 C ATOM 10814 CD1 PHE B 172 39.556 27.747 58.428 1.00 25.53 C ATOM 10815 CD2 PHE B 172 37.715 27.779 56.932 1.00 27.67 C ATOM 10816 CE1 PHE B 172 40.310 28.498 57.529 1.00 27.53 C ATOM 10817 CE2 PHE B 172 38.468 28.530 56.020 1.00 27.51 C ATOM 10818 CZ PHE B 172 39.769 28.885 56.325 1.00 24.20 C ATOM 10819 HA PHE B 172 38.275 27.372 60.913 1.00 0.00 H ATOM 10820 HB2 PHE B 172 37.953 25.627 59.305 1.00 0.00 H ATOM 10821 HB3 PHE B 172 36.463 26.396 58.710 1.00 0.00 H ATOM 10822 HD2 PHE B 172 36.689 27.503 56.687 1.00 0.00 H ATOM 10823 HE2 PHE B 172 38.028 28.834 55.070 1.00 0.00 H ATOM 10824 HZ PHE B 172 40.361 29.466 55.618 1.00 0.00 H ATOM 10825 HE1 PHE B 172 41.332 28.780 57.781 1.00 0.00 H ATOM 10826 HD1 PHE B 172 40.001 27.442 59.375 1.00 0.00 H ATOM 10827 H PHE B 172 35.939 25.675 61.118 1.00 0.00 H ATOM 10828 N LEU B 173 35.355 28.704 60.084 1.00 29.95 N ATOM 10829 CA LEU B 173 34.608 29.960 59.992 1.00 32.24 C ATOM 10830 C LEU B 173 34.773 30.853 61.221 1.00 31.76 C ATOM 10831 O LEU B 173 34.919 32.064 61.093 1.00 32.70 O ATOM 10832 CB LEU B 173 33.126 29.684 59.757 1.00 34.08 C ATOM 10833 CG LEU B 173 32.678 29.703 58.300 1.00 37.55 C ATOM 10834 CD1 LEU B 173 31.349 28.970 58.124 1.00 39.17 C ATOM 10835 CD2 LEU B 173 32.575 31.153 57.819 1.00 39.12 C ATOM 10836 HA LEU B 173 35.028 30.500 59.144 1.00 0.00 H ATOM 10837 HB2 LEU B 173 32.898 28.700 60.166 1.00 0.00 H ATOM 10838 HB3 LEU B 173 32.554 30.440 60.294 1.00 0.00 H ATOM 10839 HG LEU B 173 33.418 29.180 57.694 1.00 0.00 H ATOM 10840 HD21 LEU B 173 31.848 31.687 58.431 1.00 0.00 H ATOM 10841 HD22 LEU B 173 33.549 31.634 57.907 1.00 0.00 H ATOM 10842 HD23 LEU B 173 32.255 31.167 56.777 1.00 0.00 H ATOM 10843 HD11 LEU B 173 31.463 27.933 58.441 1.00 0.00 H ATOM 10844 HD12 LEU B 173 30.585 29.455 58.731 1.00 0.00 H ATOM 10845 HD13 LEU B 173 31.055 29.000 57.075 1.00 0.00 H ATOM 10846 H LEU B 173 34.843 27.807 59.961 1.00 0.00 H ATOM 10847 N ILE B 174 34.745 30.251 62.406 1.00 31.83 N ATOM 10848 CA ILE B 174 34.923 30.985 63.656 1.00 30.71 C ATOM 10849 C ILE B 174 36.346 31.529 63.743 1.00 29.74 C ATOM 10850 O ILE B 174 36.563 32.678 64.121 1.00 29.48 O ATOM 10851 CB ILE B 174 34.605 30.081 64.874 1.00 30.41 C ATOM 10852 CG1 ILE B 174 33.112 29.745 64.894 1.00 30.82 C ATOM 10853 CG2 ILE B 174 35.022 30.748 66.175 1.00 29.20 C ATOM 10854 CD1 ILE B 174 32.740 28.624 65.844 1.00 31.20 C ATOM 10855 HA ILE B 174 34.227 31.824 63.671 1.00 0.00 H ATOM 10856 HB ILE B 174 35.176 29.157 64.779 1.00 0.00 H ATOM 10857 HG12 ILE B 174 32.564 30.640 65.189 1.00 0.00 H ATOM 10858 HG13 ILE B 174 32.813 29.453 63.887 1.00 0.00 H ATOM 10859 HD11 ILE B 174 33.269 27.715 65.557 1.00 0.00 H ATOM 10860 HD12 ILE B 174 33.019 28.903 66.860 1.00 0.00 H ATOM 10861 HD13 ILE B 174 31.665 28.451 65.796 1.00 0.00 H ATOM 10862 HG21 ILE B 174 36.094 30.942 66.155 1.00 0.00 H ATOM 10863 HG22 ILE B 174 34.483 31.689 66.288 1.00 0.00 H ATOM 10864 HG23 ILE B 174 34.786 30.090 67.011 1.00 0.00 H ATOM 10865 H ILE B 174 34.591 29.223 62.444 1.00 0.00 H ATOM 10866 N THR B 175 37.316 30.695 63.385 1.00 29.82 N ATOM 10867 CA THR B 175 38.715 31.107 63.359 1.00 27.85 C ATOM 10868 C THR B 175 38.907 32.305 62.428 1.00 28.61 C ATOM 10869 O THR B 175 39.614 33.257 62.767 1.00 26.93 O ATOM 10870 CB THR B 175 39.614 29.948 62.913 1.00 28.04 C ATOM 10871 OG1 THR B 175 39.480 28.867 63.842 1.00 28.81 O ATOM 10872 CG2 THR B 175 41.074 30.374 62.852 1.00 26.31 C ATOM 10873 HA THR B 175 38.998 31.399 64.370 1.00 0.00 H ATOM 10874 HB THR B 175 39.304 29.637 61.915 1.00 0.00 H ATOM 10875 HG1 THR B 175 38.537 28.568 63.865 1.00 0.00 H ATOM 10876 HG23 THR B 175 41.182 31.197 62.146 1.00 0.00 H ATOM 10877 HG21 THR B 175 41.398 30.697 63.841 1.00 0.00 H ATOM 10878 HG22 THR B 175 41.684 29.531 62.526 1.00 0.00 H ATOM 10879 H THR B 175 37.071 29.721 63.116 1.00 0.00 H ATOM 10880 N MET B 176 38.270 32.256 61.260 1.00 28.68 N ATOM 10881 CA MET B 176 38.353 33.359 60.313 1.00 31.48 C ATOM 10882 C MET B 176 37.736 34.596 60.961 1.00 32.18 C ATOM 10883 O MET B 176 38.294 35.685 60.883 1.00 32.87 O ATOM 10884 CB MET B 176 37.651 33.029 58.990 1.00 31.24 C ATOM 10885 CG MET B 176 38.431 32.083 58.059 1.00 32.49 C ATOM 10886 SD MET B 176 40.084 32.660 57.572 1.00 36.80 S ATOM 10887 CE MET B 176 39.752 34.292 56.922 1.00 34.34 C ATOM 10888 HA MET B 176 39.400 33.544 60.071 1.00 0.00 H ATOM 10889 HB2 MET B 176 36.694 32.562 59.222 1.00 0.00 H ATOM 10890 HB3 MET B 176 37.479 33.963 58.456 1.00 0.00 H ATOM 10891 HG2 MET B 176 37.843 31.942 57.152 1.00 0.00 H ATOM 10892 HG3 MET B 176 38.545 31.126 58.569 1.00 0.00 H ATOM 10893 HE1 MET B 176 39.066 34.213 56.078 1.00 0.00 H ATOM 10894 HE2 MET B 176 39.302 34.907 57.701 1.00 0.00 H ATOM 10895 HE3 MET B 176 40.686 34.747 56.592 1.00 0.00 H ATOM 10896 H MET B 176 37.704 31.417 61.020 1.00 0.00 H ATOM 10897 N PHE B 177 36.592 34.408 61.606 1.00 32.01 N ATOM 10898 CA PHE B 177 35.914 35.497 62.306 1.00 34.15 C ATOM 10899 C PHE B 177 36.803 36.146 63.367 1.00 32.26 C ATOM 10900 O PHE B 177 36.809 37.365 63.513 1.00 32.79 O ATOM 10901 CB PHE B 177 34.608 35.014 62.949 1.00 34.88 C ATOM 10902 CG PHE B 177 33.901 36.080 63.742 1.00 37.98 C ATOM 10903 CD1 PHE B 177 33.181 37.081 63.096 1.00 39.24 C ATOM 10904 CD2 PHE B 177 33.959 36.086 65.130 1.00 38.14 C ATOM 10905 CE1 PHE B 177 32.528 38.074 63.819 1.00 40.46 C ATOM 10906 CE2 PHE B 177 33.313 37.072 65.865 1.00 40.13 C ATOM 10907 CZ PHE B 177 32.593 38.071 65.209 1.00 40.59 C ATOM 10908 HA PHE B 177 35.684 36.251 61.553 1.00 0.00 H ATOM 10909 HB2 PHE B 177 33.940 34.671 62.159 1.00 0.00 H ATOM 10910 HB3 PHE B 177 34.838 34.183 63.615 1.00 0.00 H ATOM 10911 HD2 PHE B 177 34.518 35.307 65.649 1.00 0.00 H ATOM 10912 HE2 PHE B 177 33.369 37.065 66.954 1.00 0.00 H ATOM 10913 HZ PHE B 177 32.084 38.845 65.783 1.00 0.00 H ATOM 10914 HE1 PHE B 177 31.968 38.851 63.299 1.00 0.00 H ATOM 10915 HD1 PHE B 177 33.128 37.087 62.007 1.00 0.00 H ATOM 10916 H PHE B 177 36.166 33.459 61.614 1.00 0.00 H ATOM 10917 N ILE B 178 37.550 35.324 64.100 1.00 30.97 N ATOM 10918 CA ILE B 178 38.416 35.816 65.174 1.00 29.91 C ATOM 10919 C ILE B 178 39.603 36.581 64.612 1.00 30.40 C ATOM 10920 O ILE B 178 40.057 37.573 65.206 1.00 29.00 O ATOM 10921 CB ILE B 178 38.914 34.669 66.075 1.00 30.26 C ATOM 10922 CG1 ILE B 178 37.739 34.042 66.835 1.00 29.61 C ATOM 10923 CG2 ILE B 178 39.986 35.166 67.040 1.00 31.18 C ATOM 10924 CD1 ILE B 178 38.105 32.817 67.645 1.00 29.48 C ATOM 10925 HA ILE B 178 37.815 36.492 65.782 1.00 0.00 H ATOM 10926 HB ILE B 178 39.363 33.902 65.444 1.00 0.00 H ATOM 10927 HG12 ILE B 178 37.332 34.792 67.514 1.00 0.00 H ATOM 10928 HG13 ILE B 178 36.976 33.757 66.110 1.00 0.00 H ATOM 10929 HD11 ILE B 178 38.503 32.049 66.981 1.00 0.00 H ATOM 10930 HD12 ILE B 178 38.859 33.085 68.386 1.00 0.00 H ATOM 10931 HD13 ILE B 178 37.216 32.438 68.150 1.00 0.00 H ATOM 10932 HG21 ILE B 178 40.829 35.560 66.473 1.00 0.00 H ATOM 10933 HG22 ILE B 178 39.570 35.953 67.669 1.00 0.00 H ATOM 10934 HG23 ILE B 178 40.322 34.339 67.665 1.00 0.00 H ATOM 10935 H ILE B 178 37.518 34.303 63.905 1.00 0.00 H ATOM 10936 N ASN B 179 40.114 36.123 63.471 1.00 27.43 N ATOM 10937 CA ASN B 179 41.209 36.835 62.818 1.00 26.81 C ATOM 10938 C ASN B 179 40.734 38.193 62.324 1.00 24.92 C ATOM 10939 O ASN B 179 41.419 39.195 62.498 1.00 26.77 O ATOM 10940 CB ASN B 179 41.828 36.020 61.666 1.00 24.48 C ATOM 10941 CG ASN B 179 42.818 34.990 62.150 1.00 24.61 C ATOM 10942 OD1 ASN B 179 44.035 35.201 62.084 1.00 23.60 O ATOM 10943 ND2 ASN B 179 42.307 33.862 62.650 1.00 24.00 N ATOM 10944 HA ASN B 179 41.993 36.982 63.560 1.00 0.00 H ATOM 10945 HB2 ASN B 179 41.028 35.510 61.129 1.00 0.00 H ATOM 10946 HB3 ASN B 179 42.339 36.705 60.989 1.00 0.00 H ATOM 10947 HD22 ASN B 179 41.276 33.729 62.685 1.00 0.00 H ATOM 10948 HD21 ASN B 179 42.940 33.117 63.004 1.00 0.00 H ATOM 10949 H ASN B 179 39.732 35.255 63.043 1.00 0.00 H ATOM 10950 N VAL B 180 39.553 38.219 61.719 1.00 25.75 N ATOM 10951 CA VAL B 180 38.965 39.456 61.219 1.00 26.57 C ATOM 10952 C VAL B 180 38.718 40.465 62.355 1.00 28.04 C ATOM 10953 O VAL B 180 39.017 41.651 62.212 1.00 27.92 O ATOM 10954 CB VAL B 180 37.639 39.185 60.450 1.00 28.05 C ATOM 10955 CG1 VAL B 180 36.855 40.473 60.239 1.00 27.85 C ATOM 10956 CG2 VAL B 180 37.908 38.488 59.100 1.00 29.00 C ATOM 10957 HA VAL B 180 39.685 39.890 60.525 1.00 0.00 H ATOM 10958 HB VAL B 180 37.036 38.515 61.063 1.00 0.00 H ATOM 10959 HG11 VAL B 180 36.614 40.913 61.207 1.00 0.00 H ATOM 10960 HG12 VAL B 180 37.458 41.173 59.660 1.00 0.00 H ATOM 10961 HG13 VAL B 180 35.934 40.252 59.699 1.00 0.00 H ATOM 10962 HG21 VAL B 180 38.543 39.124 58.484 1.00 0.00 H ATOM 10963 HG22 VAL B 180 38.408 37.536 59.277 1.00 0.00 H ATOM 10964 HG23 VAL B 180 36.962 38.313 58.588 1.00 0.00 H ATOM 10965 H VAL B 180 39.030 37.328 61.598 1.00 0.00 H ATOM 10966 N SER B 181 38.187 39.983 63.480 1.00 28.56 N ATOM 10967 CA SER B 181 37.864 40.844 64.624 1.00 27.88 C ATOM 10968 C SER B 181 39.087 41.589 65.132 1.00 28.57 C ATOM 10969 O SER B 181 39.002 42.745 65.544 1.00 30.82 O ATOM 10970 CB SER B 181 37.239 40.025 65.752 1.00 25.80 C ATOM 10971 OG SER B 181 36.029 39.441 65.319 1.00 24.06 O ATOM 10972 HA SER B 181 37.142 41.585 64.280 1.00 0.00 H ATOM 10973 HB2 SER B 181 37.040 40.677 66.603 1.00 0.00 H ATOM 10974 HB3 SER B 181 37.931 39.238 66.052 1.00 0.00 H ATOM 10975 HG SER B 181 36.208 38.847 64.548 1.00 0.00 H ATOM 10976 H SER B 181 37.996 38.963 63.549 1.00 0.00 H ATOM 10977 N ILE B 182 40.233 40.928 65.102 1.00 28.55 N ATOM 10978 CA ILE B 182 41.459 41.591 65.504 1.00 28.86 C ATOM 10979 C ILE B 182 41.944 42.552 64.395 1.00 31.97 C ATOM 10980 O ILE B 182 42.175 43.738 64.647 1.00 32.34 O ATOM 10981 CB ILE B 182 42.553 40.577 65.856 1.00 29.20 C ATOM 10982 CG1 ILE B 182 42.114 39.737 67.066 1.00 29.36 C ATOM 10983 CG2 ILE B 182 43.877 41.292 66.123 1.00 29.11 C ATOM 10984 CD1 ILE B 182 42.996 38.535 67.343 1.00 30.70 C ATOM 10985 HA ILE B 182 41.245 42.173 66.400 1.00 0.00 H ATOM 10986 HB ILE B 182 42.706 39.905 65.012 1.00 0.00 H ATOM 10987 HG12 ILE B 182 42.122 40.378 67.948 1.00 0.00 H ATOM 10988 HG13 ILE B 182 41.099 39.382 66.886 1.00 0.00 H ATOM 10989 HD11 ILE B 182 42.990 37.874 66.476 1.00 0.00 H ATOM 10990 HD12 ILE B 182 44.014 38.871 67.539 1.00 0.00 H ATOM 10991 HD13 ILE B 182 42.615 37.999 68.212 1.00 0.00 H ATOM 10992 HG21 ILE B 182 44.177 41.843 65.232 1.00 0.00 H ATOM 10993 HG22 ILE B 182 43.753 41.984 66.956 1.00 0.00 H ATOM 10994 HG23 ILE B 182 44.642 40.556 66.371 1.00 0.00 H ATOM 10995 H ILE B 182 40.255 39.936 64.791 1.00 0.00 H ATOM 10996 N LEU B 183 42.078 42.038 63.170 1.00 31.16 N ATOM 10997 CA LEU B 183 42.635 42.807 62.050 1.00 30.17 C ATOM 10998 C LEU B 183 41.846 44.072 61.718 1.00 31.23 C ATOM 10999 O LEU B 183 42.428 45.103 61.362 1.00 29.85 O ATOM 11000 CB LEU B 183 42.736 41.922 60.797 1.00 29.67 C ATOM 11001 CG LEU B 183 43.809 40.833 60.824 1.00 29.24 C ATOM 11002 CD1 LEU B 183 43.611 39.830 59.699 1.00 29.24 C ATOM 11003 CD2 LEU B 183 45.206 41.459 60.763 1.00 30.76 C ATOM 11004 HA LEU B 183 43.625 43.130 62.372 1.00 0.00 H ATOM 11005 HB2 LEU B 183 41.771 41.435 60.655 1.00 0.00 H ATOM 11006 HB3 LEU B 183 42.943 42.572 59.946 1.00 0.00 H ATOM 11007 HG LEU B 183 43.715 40.290 61.764 1.00 0.00 H ATOM 11008 HD21 LEU B 183 45.305 42.034 59.842 1.00 0.00 H ATOM 11009 HD22 LEU B 183 45.346 42.117 61.620 1.00 0.00 H ATOM 11010 HD23 LEU B 183 45.958 40.670 60.783 1.00 0.00 H ATOM 11011 HD11 LEU B 183 42.635 39.357 59.804 1.00 0.00 H ATOM 11012 HD12 LEU B 183 43.665 40.346 58.740 1.00 0.00 H ATOM 11013 HD13 LEU B 183 44.391 39.071 59.749 1.00 0.00 H ATOM 11014 H LEU B 183 41.777 41.057 63.003 1.00 0.00 H ATOM 11015 N ILE B 184 40.526 43.987 61.837 1.00 31.07 N ATOM 11016 CA ILE B 184 39.653 45.072 61.435 1.00 34.25 C ATOM 11017 C ILE B 184 39.801 46.265 62.382 1.00 36.78 C ATOM 11018 O ILE B 184 39.410 47.383 62.039 1.00 37.56 O ATOM 11019 CB ILE B 184 38.175 44.597 61.349 1.00 34.88 C ATOM 11020 CG1 ILE B 184 37.407 45.389 60.283 1.00 36.17 C ATOM 11021 CG2 ILE B 184 37.502 44.648 62.728 1.00 36.67 C ATOM 11022 CD1 ILE B 184 35.986 44.900 60.053 1.00 37.52 C ATOM 11023 HA ILE B 184 39.951 45.397 60.438 1.00 0.00 H ATOM 11024 HB ILE B 184 38.161 43.554 61.033 1.00 0.00 H ATOM 11025 HG12 ILE B 184 37.364 46.432 60.595 1.00 0.00 H ATOM 11026 HG13 ILE B 184 37.952 45.315 59.342 1.00 0.00 H ATOM 11027 HD11 ILE B 184 36.009 43.860 59.727 1.00 0.00 H ATOM 11028 HD12 ILE B 184 35.421 44.979 60.982 1.00 0.00 H ATOM 11029 HD13 ILE B 184 35.512 45.512 59.285 1.00 0.00 H ATOM 11030 HG21 ILE B 184 38.040 43.998 63.418 1.00 0.00 H ATOM 11031 HG22 ILE B 184 37.521 45.672 63.102 1.00 0.00 H ATOM 11032 HG23 ILE B 184 36.469 44.311 62.640 1.00 0.00 H ATOM 11033 H ILE B 184 40.108 43.119 62.229 1.00 0.00 H ATOM 11034 N ARG B 185 40.376 46.027 63.562 1.00 36.83 N ATOM 11035 CA ARG B 185 40.617 47.105 64.517 1.00 38.23 C ATOM 11036 C ARG B 185 41.958 47.795 64.263 1.00 37.18 C ATOM 11037 O ARG B 185 42.260 48.804 64.886 1.00 38.80 O ATOM 11038 CB ARG B 185 40.545 46.601 65.965 1.00 41.52 C ATOM 11039 CG ARG B 185 39.153 46.202 66.433 1.00 44.55 C ATOM 11040 CD ARG B 185 39.209 45.706 67.876 1.00 49.22 C ATOM 11041 NE ARG B 185 38.097 44.818 68.212 1.00 53.33 N ATOM 11042 CZ ARG B 185 37.081 45.141 69.005 1.00 55.04 C ATOM 11043 NH1 ARG B 185 36.121 44.254 69.242 1.00 56.37 N ATOM 11044 NH2 ARG B 185 37.017 46.343 69.567 1.00 56.26 N ATOM 11045 HA ARG B 185 39.824 47.839 64.370 1.00 0.00 H ATOM 11046 HB2 ARG B 185 41.196 45.731 66.054 1.00 0.00 H ATOM 11047 HB3 ARG B 185 40.909 47.394 66.619 1.00 0.00 H ATOM 11048 HG2 ARG B 185 38.491 47.066 66.373 1.00 0.00 H ATOM 11049 HG3 ARG B 185 38.771 45.407 65.792 1.00 0.00 H ATOM 11050 HD2 ARG B 185 39.181 46.568 68.543 1.00 0.00 H ATOM 11051 HD3 ARG B 185 40.144 45.165 68.023 1.00 0.00 H ATOM 11052 HE ARG B 185 38.102 43.863 67.800 1.00 0.00 H ATOM 11053 HH12 ARG B 185 35.324 44.503 69.862 1.00 0.00 H ATOM 11054 HH11 ARG B 185 36.166 43.310 68.807 1.00 0.00 H ATOM 11055 HH22 ARG B 185 36.217 46.586 70.186 1.00 0.00 H ATOM 11056 HH21 ARG B 185 37.767 47.041 69.388 1.00 0.00 H ATOM 11057 H ARG B 185 40.658 45.056 63.806 1.00 0.00 H ATOM 11058 N GLY B 186 42.763 47.243 63.356 1.00 35.68 N ATOM 11059 CA GLY B 186 43.990 47.897 62.925 1.00 30.83 C ATOM 11060 C GLY B 186 45.261 47.490 63.629 1.00 32.39 C ATOM 11061 O GLY B 186 45.297 46.493 64.353 1.00 33.31 O ATOM 11062 HA3 GLY B 186 43.861 48.970 63.070 1.00 0.00 H ATOM 11063 HA2 GLY B 186 44.120 47.689 61.863 1.00 0.00 H ATOM 11064 H GLY B 186 42.508 46.322 62.946 1.00 0.00 H ATOM 11065 N ILE B 187 46.306 48.283 63.414 1.00 30.83 N ATOM 11066 CA ILE B 187 47.642 48.007 63.934 1.00 32.09 C ATOM 11067 C ILE B 187 47.736 48.172 65.454 1.00 33.71 C ATOM 11068 O ILE B 187 48.020 47.211 66.159 1.00 35.79 O ATOM 11069 CB ILE B 187 48.699 48.888 63.206 1.00 30.82 C ATOM 11070 CG1 ILE B 187 48.718 48.557 61.714 1.00 31.21 C ATOM 11071 CG2 ILE B 187 50.078 48.697 63.781 1.00 30.18 C ATOM 11072 CD1 ILE B 187 48.941 47.060 61.419 1.00 30.30 C ATOM 11073 HA ILE B 187 47.855 46.958 63.729 1.00 0.00 H ATOM 11074 HB ILE B 187 48.414 49.930 63.351 1.00 0.00 H ATOM 11075 HG12 ILE B 187 47.763 48.856 61.282 1.00 0.00 H ATOM 11076 HG13 ILE B 187 49.521 49.125 61.244 1.00 0.00 H ATOM 11077 HD11 ILE B 187 49.899 46.748 61.835 1.00 0.00 H ATOM 11078 HD12 ILE B 187 48.139 46.478 61.873 1.00 0.00 H ATOM 11079 HD13 ILE B 187 48.943 46.900 60.341 1.00 0.00 H ATOM 11080 HG21 ILE B 187 50.071 48.971 64.836 1.00 0.00 H ATOM 11081 HG22 ILE B 187 50.372 47.653 63.677 1.00 0.00 H ATOM 11082 HG23 ILE B 187 50.785 49.330 63.244 1.00 0.00 H ATOM 11083 H ILE B 187 46.165 49.143 62.847 1.00 0.00 H ATOM 11084 N SER B 188 47.486 49.381 65.957 1.00 35.96 N ATOM 11085 CA SER B 188 47.624 49.647 67.395 1.00 37.73 C ATOM 11086 C SER B 188 46.453 49.126 68.246 1.00 37.69 C ATOM 11087 O SER B 188 46.663 48.541 69.299 1.00 37.97 O ATOM 11088 CB SER B 188 47.880 51.140 67.665 1.00 38.17 C ATOM 11089 OG SER B 188 46.773 51.931 67.275 1.00 40.70 O ATOM 11090 HA SER B 188 48.497 49.076 67.712 1.00 0.00 H ATOM 11091 HB2 SER B 188 48.759 51.457 67.103 1.00 0.00 H ATOM 11092 HB3 SER B 188 48.061 51.282 68.730 1.00 0.00 H ATOM 11093 HG SER B 188 46.968 52.884 67.461 1.00 0.00 H ATOM 11094 H SER B 188 47.188 50.148 65.321 1.00 0.00 H ATOM 11095 N LYS B 189 45.227 49.338 67.790 1.00 38.48 N ATOM 11096 CA LYS B 189 44.060 48.924 68.564 1.00 39.36 C ATOM 11097 C LYS B 189 43.627 47.466 68.320 1.00 38.57 C ATOM 11098 O LYS B 189 42.730 46.960 68.995 1.00 36.67 O ATOM 11099 CB LYS B 189 42.892 49.887 68.328 1.00 42.81 C ATOM 11100 CG LYS B 189 43.132 51.288 68.907 1.00 45.86 C ATOM 11101 CD LYS B 189 41.858 52.122 68.916 1.00 48.29 C ATOM 11102 CE LYS B 189 42.001 53.346 69.831 1.00 49.46 C ATOM 11103 NZ LYS B 189 40.678 54.001 70.108 1.00 50.98 N ATOM 11104 HA LYS B 189 44.363 48.967 69.610 1.00 0.00 H ATOM 11105 HB2 LYS B 189 42.731 49.979 67.254 1.00 0.00 H ATOM 11106 HB3 LYS B 189 41.999 49.469 68.793 1.00 0.00 H ATOM 11107 HG2 LYS B 189 43.497 51.190 69.929 1.00 0.00 H ATOM 11108 HG3 LYS B 189 43.883 51.796 68.302 1.00 0.00 H ATOM 11109 HD2 LYS B 189 41.647 52.459 67.901 1.00 0.00 H ATOM 11110 HD3 LYS B 189 41.032 51.506 69.272 1.00 0.00 H ATOM 11111 HE2 LYS B 189 42.658 54.070 69.350 1.00 0.00 H ATOM 11112 HE3 LYS B 189 42.442 53.029 70.776 1.00 0.00 H ATOM 11113 HZ1 LYS B 189 40.253 54.313 69.212 1.00 0.00 H ATOM 11114 HZ2 LYS B 189 40.046 53.319 70.574 1.00 0.00 H ATOM 11115 HZ3 LYS B 189 40.823 54.822 70.729 1.00 0.00 H ATOM 11116 H LYS B 189 45.094 49.805 66.870 1.00 0.00 H ATOM 11117 N GLY B 190 44.267 46.793 67.370 1.00 36.06 N ATOM 11118 CA GLY B 190 43.925 45.403 67.072 1.00 34.42 C ATOM 11119 C GLY B 190 45.087 44.468 67.337 1.00 34.40 C ATOM 11120 O GLY B 190 45.123 43.773 68.355 1.00 33.84 O ATOM 11121 HA3 GLY B 190 43.642 45.326 66.022 1.00 0.00 H ATOM 11122 HA2 GLY B 190 43.083 45.105 67.696 1.00 0.00 H ATOM 11123 H GLY B 190 45.022 47.262 66.830 1.00 0.00 H ATOM 11124 N ILE B 191 46.045 44.455 66.415 1.00 32.96 N ATOM 11125 CA ILE B 191 47.194 43.566 66.516 1.00 31.87 C ATOM 11126 C ILE B 191 48.022 43.823 67.778 1.00 32.33 C ATOM 11127 O ILE B 191 48.263 42.905 68.553 1.00 31.23 O ATOM 11128 CB ILE B 191 48.099 43.676 65.270 1.00 32.03 C ATOM 11129 CG1 ILE B 191 47.309 43.284 64.010 1.00 30.57 C ATOM 11130 CG2 ILE B 191 49.364 42.815 65.450 1.00 31.66 C ATOM 11131 CD1 ILE B 191 48.084 43.431 62.711 1.00 31.08 C ATOM 11132 HA ILE B 191 46.792 42.555 66.578 1.00 0.00 H ATOM 11133 HB ILE B 191 48.424 44.709 65.148 1.00 0.00 H ATOM 11134 HG12 ILE B 191 47.004 42.242 64.109 1.00 0.00 H ATOM 11135 HG13 ILE B 191 46.423 43.917 63.952 1.00 0.00 H ATOM 11136 HD11 ILE B 191 48.387 44.470 62.586 1.00 0.00 H ATOM 11137 HD12 ILE B 191 48.968 42.795 62.743 1.00 0.00 H ATOM 11138 HD13 ILE B 191 47.450 43.133 61.876 1.00 0.00 H ATOM 11139 HG21 ILE B 191 49.916 43.161 66.323 1.00 0.00 H ATOM 11140 HG22 ILE B 191 49.076 41.773 65.590 1.00 0.00 H ATOM 11141 HG23 ILE B 191 49.991 42.903 64.563 1.00 0.00 H ATOM 11142 H ILE B 191 45.972 45.097 65.600 1.00 0.00 H ATOM 11143 N GLU B 192 48.452 45.067 67.972 1.00 33.80 N ATOM 11144 CA GLU B 192 49.312 45.424 69.102 1.00 35.67 C ATOM 11145 C GLU B 192 48.636 45.136 70.444 1.00 35.87 C ATOM 11146 O GLU B 192 49.243 44.561 71.347 1.00 36.50 O ATOM 11147 CB GLU B 192 49.706 46.898 69.007 1.00 36.81 C ATOM 11148 CG GLU B 192 50.623 47.396 70.106 1.00 36.49 C ATOM 11149 CD GLU B 192 51.053 48.838 69.879 1.00 37.52 C ATOM 11150 OE1 GLU B 192 50.523 49.474 68.941 1.00 37.36 O ATOM 11151 OE2 GLU B 192 51.922 49.330 70.632 1.00 37.28 O ATOM 11152 HA GLU B 192 50.208 44.806 69.052 1.00 0.00 H ATOM 11153 HB2 GLU B 192 50.210 47.051 68.053 1.00 0.00 H ATOM 11154 HB3 GLU B 192 48.793 47.493 69.034 1.00 0.00 H ATOM 11155 HG2 GLU B 192 50.098 47.331 71.059 1.00 0.00 H ATOM 11156 HG3 GLU B 192 51.511 46.764 70.137 1.00 0.00 H ATOM 11157 H GLU B 192 48.169 45.809 67.300 1.00 0.00 H ATOM 11158 N ARG B 193 47.377 45.536 70.555 1.00 36.46 N ATOM 11159 CA ARG B 193 46.590 45.307 71.760 1.00 38.98 C ATOM 11160 C ARG B 193 46.452 43.819 72.061 1.00 37.93 C ATOM 11161 O ARG B 193 46.642 43.399 73.195 1.00 37.11 O ATOM 11162 CB ARG B 193 45.215 45.964 71.617 1.00 41.59 C ATOM 11163 CG ARG B 193 44.337 45.912 72.862 1.00 45.82 C ATOM 11164 CD ARG B 193 43.225 46.955 72.785 1.00 48.43 C ATOM 11165 NE ARG B 193 43.766 48.318 72.757 1.00 51.35 N ATOM 11166 CZ ARG B 193 43.048 49.408 72.481 1.00 52.23 C ATOM 11167 NH1 ARG B 193 41.752 49.305 72.201 1.00 52.65 N ATOM 11168 NH2 ARG B 193 43.627 50.602 72.480 1.00 52.09 N ATOM 11169 HA ARG B 193 47.113 45.761 72.602 1.00 0.00 H ATOM 11170 HB2 ARG B 193 45.367 47.011 71.355 1.00 0.00 H ATOM 11171 HB3 ARG B 193 44.684 45.462 70.808 1.00 0.00 H ATOM 11172 HG2 ARG B 193 43.892 44.920 72.945 1.00 0.00 H ATOM 11173 HG3 ARG B 193 44.951 46.108 73.741 1.00 0.00 H ATOM 11174 HD2 ARG B 193 42.578 46.848 73.656 1.00 0.00 H ATOM 11175 HD3 ARG B 193 42.643 46.786 71.879 1.00 0.00 H ATOM 11176 HE ARG B 193 44.777 48.443 72.966 1.00 0.00 H ATOM 11177 HH12 ARG B 193 41.197 50.158 71.987 1.00 0.00 H ATOM 11178 HH11 ARG B 193 41.294 48.372 72.196 1.00 0.00 H ATOM 11179 HH22 ARG B 193 43.067 51.451 72.265 1.00 0.00 H ATOM 11180 HH21 ARG B 193 44.641 50.688 72.694 1.00 0.00 H ATOM 11181 H ARG B 193 46.935 46.031 69.754 1.00 0.00 H ATOM 11182 N PHE B 194 46.126 43.020 71.046 1.00 38.09 N ATOM 11183 CA PHE B 194 45.977 41.575 71.242 1.00 36.89 C ATOM 11184 C PHE B 194 47.304 40.945 71.636 1.00 35.66 C ATOM 11185 O PHE B 194 47.361 40.127 72.552 1.00 36.76 O ATOM 11186 CB PHE B 194 45.408 40.887 69.990 1.00 38.40 C ATOM 11187 CG PHE B 194 45.219 39.397 70.147 1.00 38.96 C ATOM 11188 CD1 PHE B 194 44.199 38.892 70.953 1.00 39.79 C ATOM 11189 CD2 PHE B 194 46.051 38.502 69.493 1.00 38.65 C ATOM 11190 CE1 PHE B 194 44.020 37.525 71.099 1.00 39.02 C ATOM 11191 CE2 PHE B 194 45.873 37.135 69.636 1.00 38.18 C ATOM 11192 CZ PHE B 194 44.861 36.649 70.442 1.00 38.49 C ATOM 11193 HA PHE B 194 45.265 41.429 72.054 1.00 0.00 H ATOM 11194 HB2 PHE B 194 44.441 41.334 69.761 1.00 0.00 H ATOM 11195 HB3 PHE B 194 46.093 41.061 69.160 1.00 0.00 H ATOM 11196 HD2 PHE B 194 46.854 38.877 68.859 1.00 0.00 H ATOM 11197 HE2 PHE B 194 46.532 36.442 69.112 1.00 0.00 H ATOM 11198 HZ PHE B 194 44.727 35.574 70.559 1.00 0.00 H ATOM 11199 HE1 PHE B 194 43.218 37.143 71.730 1.00 0.00 H ATOM 11200 HD1 PHE B 194 43.534 39.581 71.475 1.00 0.00 H ATOM 11201 H PHE B 194 45.975 43.427 70.101 1.00 0.00 H ATOM 11202 N ALA B 195 48.373 41.334 70.953 1.00 34.77 N ATOM 11203 CA ALA B 195 49.706 40.835 71.278 1.00 35.46 C ATOM 11204 C ALA B 195 50.086 41.038 72.751 1.00 36.83 C ATOM 11205 O ALA B 195 50.736 40.181 73.347 1.00 39.39 O ATOM 11206 CB ALA B 195 50.736 41.475 70.385 1.00 33.54 C ATOM 11207 HA ALA B 195 49.684 39.759 71.105 1.00 0.00 H ATOM 11208 HB1 ALA B 195 50.511 41.239 69.345 1.00 0.00 H ATOM 11209 HB2 ALA B 195 50.716 42.556 70.526 1.00 0.00 H ATOM 11210 HB3 ALA B 195 51.724 41.092 70.640 1.00 0.00 H ATOM 11211 H ALA B 195 48.259 42.009 70.170 1.00 0.00 H ATOM 11212 N LYS B 196 49.694 42.168 73.337 1.00 38.70 N ATOM 11213 CA LYS B 196 50.011 42.426 74.746 1.00 40.58 C ATOM 11214 C LYS B 196 49.312 41.438 75.683 1.00 39.86 C ATOM 11215 O LYS B 196 49.831 41.102 76.743 1.00 40.63 O ATOM 11216 CB LYS B 196 49.685 43.872 75.135 1.00 42.37 C ATOM 11217 CG LYS B 196 50.737 44.874 74.678 1.00 44.60 C ATOM 11218 CD LYS B 196 50.498 46.252 75.272 1.00 46.88 C ATOM 11219 CE LYS B 196 51.623 47.211 74.888 1.00 48.27 C ATOM 11220 NZ LYS B 196 51.580 48.492 75.659 1.00 49.51 N ATOM 11221 HA LYS B 196 51.085 42.278 74.860 1.00 0.00 H ATOM 11222 HB2 LYS B 196 48.730 44.144 74.685 1.00 0.00 H ATOM 11223 HB3 LYS B 196 49.603 43.928 76.220 1.00 0.00 H ATOM 11224 HG2 LYS B 196 51.720 44.521 74.989 1.00 0.00 H ATOM 11225 HG3 LYS B 196 50.706 44.948 73.591 1.00 0.00 H ATOM 11226 HD2 LYS B 196 49.552 46.643 74.899 1.00 0.00 H ATOM 11227 HD3 LYS B 196 50.453 46.170 76.358 1.00 0.00 H ATOM 11228 HE2 LYS B 196 51.538 47.440 73.826 1.00 0.00 H ATOM 11229 HE3 LYS B 196 52.578 46.722 75.078 1.00 0.00 H ATOM 11230 HZ1 LYS B 196 50.676 48.973 75.479 1.00 0.00 H ATOM 11231 HZ2 LYS B 196 51.669 48.287 76.675 1.00 0.00 H ATOM 11232 HZ3 LYS B 196 52.365 49.103 75.357 1.00 0.00 H ATOM 11233 H LYS B 196 49.159 42.873 72.791 1.00 0.00 H ATOM 11234 N ILE B 197 48.135 40.983 75.275 1.00 39.71 N ATOM 11235 CA ILE B 197 47.359 40.008 76.026 1.00 39.98 C ATOM 11236 C ILE B 197 47.785 38.573 75.697 1.00 39.51 C ATOM 11237 O ILE B 197 47.861 37.718 76.579 1.00 38.96 O ATOM 11238 CB ILE B 197 45.852 40.161 75.712 1.00 42.22 C ATOM 11239 CG1 ILE B 197 45.355 41.555 76.121 1.00 43.64 C ATOM 11240 CG2 ILE B 197 45.038 39.065 76.392 1.00 42.60 C ATOM 11241 CD1 ILE B 197 43.956 41.881 75.629 1.00 45.50 C ATOM 11242 HA ILE B 197 47.543 40.197 77.083 1.00 0.00 H ATOM 11243 HB ILE B 197 45.715 40.055 74.636 1.00 0.00 H ATOM 11244 HG12 ILE B 197 45.358 41.615 77.209 1.00 0.00 H ATOM 11245 HG13 ILE B 197 46.043 42.297 75.715 1.00 0.00 H ATOM 11246 HD11 ILE B 197 43.936 41.838 74.540 1.00 0.00 H ATOM 11247 HD12 ILE B 197 43.251 41.156 76.035 1.00 0.00 H ATOM 11248 HD13 ILE B 197 43.680 42.882 75.960 1.00 0.00 H ATOM 11249 HG21 ILE B 197 45.373 38.091 76.035 1.00 0.00 H ATOM 11250 HG22 ILE B 197 45.179 39.126 77.471 1.00 0.00 H ATOM 11251 HG23 ILE B 197 43.983 39.197 76.154 1.00 0.00 H ATOM 11252 H ILE B 197 47.749 41.339 74.377 1.00 0.00 H ATOM 11253 N ALA B 198 48.066 38.316 74.418 1.00 36.74 N ATOM 11254 CA ALA B 198 48.346 36.959 73.951 1.00 35.51 C ATOM 11255 C ALA B 198 49.724 36.417 74.300 1.00 34.43 C ATOM 11256 O ALA B 198 49.855 35.238 74.632 1.00 35.68 O ATOM 11257 CB ALA B 198 48.127 36.862 72.442 1.00 35.16 C ATOM 11258 HA ALA B 198 47.640 36.330 74.494 1.00 0.00 H ATOM 11259 HB1 ALA B 198 47.092 37.113 72.210 1.00 0.00 H ATOM 11260 HB2 ALA B 198 48.794 37.559 71.934 1.00 0.00 H ATOM 11261 HB3 ALA B 198 48.340 35.846 72.110 1.00 0.00 H ATOM 11262 H ALA B 198 48.086 39.101 73.736 1.00 0.00 H ATOM 11263 N MET B 199 50.748 37.258 74.219 1.00 33.21 N ATOM 11264 CA MET B 199 52.118 36.768 74.406 1.00 33.44 C ATOM 11265 C MET B 199 52.467 36.307 75.835 1.00 33.93 C ATOM 11266 O MET B 199 53.059 35.246 75.995 1.00 34.55 O ATOM 11267 CB MET B 199 53.148 37.761 73.850 1.00 32.49 C ATOM 11268 CG MET B 199 53.001 38.009 72.347 1.00 33.59 C ATOM 11269 SD MET B 199 52.947 36.487 71.347 1.00 34.00 S ATOM 11270 CE MET B 199 54.590 35.854 71.657 1.00 29.71 C ATOM 11271 HA MET B 199 52.167 35.851 73.818 1.00 0.00 H ATOM 11272 HB2 MET B 199 53.029 38.711 74.371 1.00 0.00 H ATOM 11273 HB3 MET B 199 54.146 37.367 74.040 1.00 0.00 H ATOM 11274 HG2 MET B 199 53.848 38.609 72.014 1.00 0.00 H ATOM 11275 HG3 MET B 199 52.077 38.563 72.179 1.00 0.00 H ATOM 11276 HE1 MET B 199 55.328 36.581 71.318 1.00 0.00 H ATOM 11277 HE2 MET B 199 54.715 35.678 72.726 1.00 0.00 H ATOM 11278 HE3 MET B 199 54.725 34.918 71.115 1.00 0.00 H ATOM 11279 H MET B 199 50.579 38.265 74.023 1.00 0.00 H ATOM 11280 N PRO B 200 52.121 37.103 76.873 1.00 34.73 N ATOM 11281 CA PRO B 200 52.319 36.621 78.254 1.00 34.67 C ATOM 11282 C PRO B 200 51.541 35.337 78.529 1.00 34.91 C ATOM 11283 O PRO B 200 52.081 34.400 79.118 1.00 36.80 O ATOM 11284 CB PRO B 200 51.767 37.771 79.117 1.00 34.60 C ATOM 11285 CG PRO B 200 51.846 38.976 78.236 1.00 34.92 C ATOM 11286 CD PRO B 200 51.574 38.470 76.844 1.00 33.86 C ATOM 11287 HA PRO B 200 53.362 36.380 78.457 1.00 0.00 H ATOM 11288 HD3 PRO B 200 50.505 38.460 76.633 1.00 0.00 H ATOM 11289 HD2 PRO B 200 52.084 39.080 76.099 1.00 0.00 H ATOM 11290 HG3 PRO B 200 52.837 39.426 78.292 1.00 0.00 H ATOM 11291 HG2 PRO B 200 51.097 39.712 78.528 1.00 0.00 H ATOM 11292 HB2 PRO B 200 50.735 37.573 79.407 1.00 0.00 H ATOM 11293 HB3 PRO B 200 52.375 37.907 80.011 1.00 0.00 H ATOM 11294 N THR B 201 50.282 35.297 78.109 1.00 36.37 N ATOM 11295 CA THR B 201 49.456 34.102 78.249 1.00 37.72 C ATOM 11296 C THR B 201 50.151 32.888 77.644 1.00 38.57 C ATOM 11297 O THR B 201 50.350 31.868 78.308 1.00 39.11 O ATOM 11298 CB THR B 201 48.111 34.279 77.534 1.00 38.14 C ATOM 11299 OG1 THR B 201 47.459 35.453 78.022 1.00 39.22 O ATOM 11300 CG2 THR B 201 47.206 33.070 77.767 1.00 38.99 C ATOM 11301 HA THR B 201 49.295 33.949 79.316 1.00 0.00 H ATOM 11302 HB THR B 201 48.302 34.374 76.465 1.00 0.00 H ATOM 11303 HG1 THR B 201 48.030 36.243 77.849 1.00 0.00 H ATOM 11304 HG23 THR B 201 47.699 32.172 77.396 1.00 0.00 H ATOM 11305 HG21 THR B 201 47.010 32.964 78.834 1.00 0.00 H ATOM 11306 HG22 THR B 201 46.265 33.215 77.236 1.00 0.00 H ATOM 11307 H THR B 201 49.872 36.144 77.666 1.00 0.00 H ATOM 11308 N LEU B 202 50.523 33.026 76.374 1.00 38.04 N ATOM 11309 CA LEU B 202 51.194 31.988 75.609 1.00 36.49 C ATOM 11310 C LEU B 202 52.468 31.506 76.312 1.00 37.17 C ATOM 11311 O LEU B 202 52.709 30.300 76.421 1.00 34.59 O ATOM 11312 CB LEU B 202 51.493 32.530 74.204 1.00 37.00 C ATOM 11313 CG LEU B 202 52.094 31.679 73.090 1.00 37.81 C ATOM 11314 CD1 LEU B 202 51.981 32.428 71.760 1.00 36.93 C ATOM 11315 CD2 LEU B 202 53.538 31.313 73.382 1.00 37.60 C ATOM 11316 HA LEU B 202 50.542 31.118 75.528 1.00 0.00 H ATOM 11317 HB2 LEU B 202 50.544 32.901 73.818 1.00 0.00 H ATOM 11318 HB3 LEU B 202 52.178 33.366 74.345 1.00 0.00 H ATOM 11319 HG LEU B 202 51.534 30.746 73.028 1.00 0.00 H ATOM 11320 HD21 LEU B 202 54.130 32.223 73.477 1.00 0.00 H ATOM 11321 HD22 LEU B 202 53.587 30.747 74.312 1.00 0.00 H ATOM 11322 HD23 LEU B 202 53.930 30.707 72.565 1.00 0.00 H ATOM 11323 HD11 LEU B 202 50.931 32.624 71.543 1.00 0.00 H ATOM 11324 HD12 LEU B 202 52.521 33.372 71.829 1.00 0.00 H ATOM 11325 HD13 LEU B 202 52.411 31.820 70.964 1.00 0.00 H ATOM 11326 H LEU B 202 50.322 33.930 75.901 1.00 0.00 H ATOM 11327 N PHE B 203 53.291 32.443 76.784 1.00 37.99 N ATOM 11328 CA PHE B 203 54.511 32.109 77.520 1.00 39.03 C ATOM 11329 C PHE B 203 54.188 31.307 78.781 1.00 40.02 C ATOM 11330 O PHE B 203 54.864 30.328 79.109 1.00 40.66 O ATOM 11331 CB PHE B 203 55.258 33.397 77.883 1.00 39.72 C ATOM 11332 CG PHE B 203 56.410 33.200 78.837 1.00 39.52 C ATOM 11333 CD1 PHE B 203 57.638 32.743 78.382 1.00 39.66 C ATOM 11334 CD2 PHE B 203 56.267 33.492 80.189 1.00 39.80 C ATOM 11335 CE1 PHE B 203 58.700 32.567 79.260 1.00 39.64 C ATOM 11336 CE2 PHE B 203 57.325 33.319 81.070 1.00 39.66 C ATOM 11337 CZ PHE B 203 58.541 32.858 80.606 1.00 39.46 C ATOM 11338 HA PHE B 203 55.145 31.490 76.885 1.00 0.00 H ATOM 11339 HB2 PHE B 203 55.647 33.837 76.964 1.00 0.00 H ATOM 11340 HB3 PHE B 203 54.548 34.085 78.342 1.00 0.00 H ATOM 11341 HD2 PHE B 203 55.312 33.862 80.562 1.00 0.00 H ATOM 11342 HE2 PHE B 203 57.196 33.547 82.128 1.00 0.00 H ATOM 11343 HZ PHE B 203 59.374 32.723 81.296 1.00 0.00 H ATOM 11344 HE1 PHE B 203 59.658 32.200 78.891 1.00 0.00 H ATOM 11345 HD1 PHE B 203 57.771 32.519 77.324 1.00 0.00 H ATOM 11346 H PHE B 203 53.058 33.444 76.624 1.00 0.00 H ATOM 11347 N ILE B 204 53.148 31.738 79.496 1.00 40.42 N ATOM 11348 CA ILE B 204 52.725 31.077 80.740 1.00 41.59 C ATOM 11349 C ILE B 204 52.319 29.621 80.501 1.00 40.72 C ATOM 11350 O ILE B 204 52.825 28.714 81.159 1.00 42.36 O ATOM 11351 CB ILE B 204 51.584 31.860 81.454 1.00 41.89 C ATOM 11352 CG1 ILE B 204 52.151 33.099 82.153 1.00 42.41 C ATOM 11353 CG2 ILE B 204 50.865 30.974 82.471 1.00 43.26 C ATOM 11354 CD1 ILE B 204 51.090 34.139 82.535 1.00 43.54 C ATOM 11355 HA ILE B 204 53.591 31.076 81.402 1.00 0.00 H ATOM 11356 HB ILE B 204 50.863 32.172 80.698 1.00 0.00 H ATOM 11357 HG12 ILE B 204 52.660 32.778 83.062 1.00 0.00 H ATOM 11358 HG13 ILE B 204 52.870 33.572 81.484 1.00 0.00 H ATOM 11359 HD11 ILE B 204 50.579 34.482 81.636 1.00 0.00 H ATOM 11360 HD12 ILE B 204 50.368 33.687 83.215 1.00 0.00 H ATOM 11361 HD13 ILE B 204 51.572 34.985 83.025 1.00 0.00 H ATOM 11362 HG21 ILE B 204 50.433 30.114 81.960 1.00 0.00 H ATOM 11363 HG22 ILE B 204 51.578 30.632 83.221 1.00 0.00 H ATOM 11364 HG23 ILE B 204 50.073 31.547 82.954 1.00 0.00 H ATOM 11365 H ILE B 204 52.619 32.569 79.163 1.00 0.00 H ATOM 11366 N LEU B 205 51.408 29.408 79.555 1.00 40.17 N ATOM 11367 CA LEU B 205 50.984 28.069 79.174 1.00 39.28 C ATOM 11368 C LEU B 205 52.172 27.184 78.805 1.00 38.43 C ATOM 11369 O LEU B 205 52.261 26.038 79.242 1.00 37.77 O ATOM 11370 CB LEU B 205 50.035 28.135 77.983 1.00 38.92 C ATOM 11371 CG LEU B 205 48.635 28.707 78.159 1.00 39.34 C ATOM 11372 CD1 LEU B 205 48.066 29.086 76.802 1.00 38.66 C ATOM 11373 CD2 LEU B 205 47.728 27.716 78.865 1.00 40.09 C ATOM 11374 HA LEU B 205 50.478 27.634 80.036 1.00 0.00 H ATOM 11375 HB2 LEU B 205 50.528 28.737 77.220 1.00 0.00 H ATOM 11376 HB3 LEU B 205 49.915 27.115 77.618 1.00 0.00 H ATOM 11377 HG LEU B 205 48.695 29.600 78.782 1.00 0.00 H ATOM 11378 HD21 LEU B 205 47.661 26.802 78.275 1.00 0.00 H ATOM 11379 HD22 LEU B 205 48.139 27.486 79.848 1.00 0.00 H ATOM 11380 HD23 LEU B 205 46.735 28.151 78.977 1.00 0.00 H ATOM 11381 HD11 LEU B 205 48.708 29.834 76.336 1.00 0.00 H ATOM 11382 HD12 LEU B 205 48.019 28.200 76.169 1.00 0.00 H ATOM 11383 HD13 LEU B 205 47.064 29.495 76.931 1.00 0.00 H ATOM 11384 H LEU B 205 50.985 30.226 79.072 1.00 0.00 H ATOM 11385 N ALA B 206 53.078 27.719 77.992 1.00 38.12 N ATOM 11386 CA ALA B 206 54.215 26.945 77.510 1.00 37.55 C ATOM 11387 C ALA B 206 55.127 26.523 78.657 1.00 36.95 C ATOM 11388 O ALA B 206 55.560 25.377 78.724 1.00 37.68 O ATOM 11389 CB ALA B 206 54.989 27.728 76.457 1.00 36.80 C ATOM 11390 HA ALA B 206 53.830 26.037 77.047 1.00 0.00 H ATOM 11391 HB1 ALA B 206 54.332 27.952 75.617 1.00 0.00 H ATOM 11392 HB2 ALA B 206 55.354 28.658 76.893 1.00 0.00 H ATOM 11393 HB3 ALA B 206 55.833 27.132 76.111 1.00 0.00 H ATOM 11394 H ALA B 206 52.973 28.710 77.694 1.00 0.00 H ATOM 11395 N VAL B 207 55.413 27.449 79.562 1.00 37.99 N ATOM 11396 CA VAL B 207 56.261 27.144 80.716 1.00 37.65 C ATOM 11397 C VAL B 207 55.611 26.057 81.576 1.00 36.54 C ATOM 11398 O VAL B 207 56.261 25.097 81.978 1.00 36.33 O ATOM 11399 CB VAL B 207 56.571 28.408 81.549 1.00 37.82 C ATOM 11400 CG1 VAL B 207 57.059 28.039 82.954 1.00 37.32 C ATOM 11401 CG2 VAL B 207 57.593 29.278 80.829 1.00 37.44 C ATOM 11402 HA VAL B 207 57.215 26.768 80.345 1.00 0.00 H ATOM 11403 HB VAL B 207 55.649 28.978 81.660 1.00 0.00 H ATOM 11404 HG11 VAL B 207 56.287 27.465 83.466 1.00 0.00 H ATOM 11405 HG12 VAL B 207 57.967 27.441 82.876 1.00 0.00 H ATOM 11406 HG13 VAL B 207 57.269 28.950 83.515 1.00 0.00 H ATOM 11407 HG21 VAL B 207 58.513 28.712 80.685 1.00 0.00 H ATOM 11408 HG22 VAL B 207 57.194 29.579 79.860 1.00 0.00 H ATOM 11409 HG23 VAL B 207 57.801 30.164 81.429 1.00 0.00 H ATOM 11410 H VAL B 207 55.028 28.409 79.450 1.00 0.00 H ATOM 11411 N PHE B 208 54.321 26.202 81.838 1.00 36.60 N ATOM 11412 CA PHE B 208 53.608 25.201 82.606 1.00 38.37 C ATOM 11413 C PHE B 208 53.688 23.834 81.927 1.00 38.47 C ATOM 11414 O PHE B 208 53.908 22.819 82.588 1.00 38.02 O ATOM 11415 CB PHE B 208 52.147 25.604 82.808 1.00 39.94 C ATOM 11416 CG PHE B 208 51.355 24.600 83.591 1.00 42.07 C ATOM 11417 CD1 PHE B 208 51.559 24.454 84.962 1.00 43.20 C ATOM 11418 CD2 PHE B 208 50.413 23.799 82.969 1.00 42.88 C ATOM 11419 CE1 PHE B 208 50.831 23.524 85.698 1.00 44.21 C ATOM 11420 CE2 PHE B 208 49.679 22.865 83.695 1.00 44.34 C ATOM 11421 CZ PHE B 208 49.892 22.729 85.064 1.00 44.33 C ATOM 11422 HA PHE B 208 54.085 25.131 83.583 1.00 0.00 H ATOM 11423 HB2 PHE B 208 52.121 26.555 83.339 1.00 0.00 H ATOM 11424 HB3 PHE B 208 51.683 25.723 81.829 1.00 0.00 H ATOM 11425 HD2 PHE B 208 50.244 23.901 81.897 1.00 0.00 H ATOM 11426 HE2 PHE B 208 48.939 22.242 83.193 1.00 0.00 H ATOM 11427 HZ PHE B 208 49.320 21.998 85.636 1.00 0.00 H ATOM 11428 HE1 PHE B 208 51.000 23.422 86.770 1.00 0.00 H ATOM 11429 HD1 PHE B 208 52.299 25.077 85.465 1.00 0.00 H ATOM 11430 H PHE B 208 53.815 27.041 81.490 1.00 0.00 H ATOM 11431 N LEU B 209 53.513 23.817 80.606 1.00 38.66 N ATOM 11432 CA LEU B 209 53.556 22.573 79.841 1.00 37.02 C ATOM 11433 C LEU B 209 54.938 21.959 79.891 1.00 36.68 C ATOM 11434 O LEU B 209 55.072 20.747 79.998 1.00 35.89 O ATOM 11435 CB LEU B 209 53.112 22.796 78.397 1.00 38.10 C ATOM 11436 CG LEU B 209 51.602 22.926 78.225 1.00 38.24 C ATOM 11437 CD1 LEU B 209 51.283 23.559 76.900 1.00 39.59 C ATOM 11438 CD2 LEU B 209 50.925 21.568 78.347 1.00 39.66 C ATOM 11439 HA LEU B 209 52.856 21.875 80.300 1.00 0.00 H ATOM 11440 HB2 LEU B 209 53.579 23.711 78.032 1.00 0.00 H ATOM 11441 HB3 LEU B 209 53.454 21.951 77.799 1.00 0.00 H ATOM 11442 HG LEU B 209 51.218 23.567 79.019 1.00 0.00 H ATOM 11443 HD21 LEU B 209 51.311 20.901 77.576 1.00 0.00 H ATOM 11444 HD22 LEU B 209 51.132 21.147 79.331 1.00 0.00 H ATOM 11445 HD23 LEU B 209 49.849 21.687 78.221 1.00 0.00 H ATOM 11446 HD11 LEU B 209 51.734 24.550 76.854 1.00 0.00 H ATOM 11447 HD12 LEU B 209 51.682 22.939 76.097 1.00 0.00 H ATOM 11448 HD13 LEU B 209 50.202 23.645 76.791 1.00 0.00 H ATOM 11449 H LEU B 209 53.341 24.713 80.106 1.00 0.00 H ATOM 11450 N VAL B 210 55.962 22.799 79.820 1.00 37.63 N ATOM 11451 CA VAL B 210 57.334 22.330 79.942 1.00 39.12 C ATOM 11452 C VAL B 210 57.553 21.685 81.316 1.00 40.81 C ATOM 11453 O VAL B 210 58.103 20.589 81.418 1.00 40.62 O ATOM 11454 CB VAL B 210 58.342 23.476 79.734 1.00 39.44 C ATOM 11455 CG1 VAL B 210 59.746 23.033 80.109 1.00 38.67 C ATOM 11456 CG2 VAL B 210 58.300 23.971 78.287 1.00 39.99 C ATOM 11457 HA VAL B 210 57.502 21.587 79.163 1.00 0.00 H ATOM 11458 HB VAL B 210 58.061 24.302 80.388 1.00 0.00 H ATOM 11459 HG11 VAL B 210 59.764 22.734 81.157 1.00 0.00 H ATOM 11460 HG12 VAL B 210 60.038 22.189 79.484 1.00 0.00 H ATOM 11461 HG13 VAL B 210 60.440 23.859 79.954 1.00 0.00 H ATOM 11462 HG21 VAL B 210 58.553 23.150 77.616 1.00 0.00 H ATOM 11463 HG22 VAL B 210 57.298 24.334 78.057 1.00 0.00 H ATOM 11464 HG23 VAL B 210 59.019 24.780 78.160 1.00 0.00 H ATOM 11465 H VAL B 210 55.781 23.813 79.674 1.00 0.00 H ATOM 11466 N ILE B 211 57.115 22.373 82.365 1.00 42.05 N ATOM 11467 CA ILE B 211 57.218 21.861 83.728 1.00 43.08 C ATOM 11468 C ILE B 211 56.484 20.528 83.852 1.00 42.57 C ATOM 11469 O ILE B 211 57.047 19.536 84.314 1.00 42.19 O ATOM 11470 CB ILE B 211 56.656 22.885 84.749 1.00 43.55 C ATOM 11471 CG1 ILE B 211 57.599 24.087 84.855 1.00 42.74 C ATOM 11472 CG2 ILE B 211 56.428 22.229 86.120 1.00 44.51 C ATOM 11473 CD1 ILE B 211 57.026 25.267 85.600 1.00 42.82 C ATOM 11474 HA ILE B 211 58.273 21.702 83.953 1.00 0.00 H ATOM 11475 HB ILE B 211 55.687 23.238 84.395 1.00 0.00 H ATOM 11476 HG12 ILE B 211 58.504 23.766 85.370 1.00 0.00 H ATOM 11477 HG13 ILE B 211 57.852 24.411 83.846 1.00 0.00 H ATOM 11478 HD11 ILE B 211 56.126 25.613 85.092 1.00 0.00 H ATOM 11479 HD12 ILE B 211 56.778 24.967 86.618 1.00 0.00 H ATOM 11480 HD13 ILE B 211 57.762 26.071 85.626 1.00 0.00 H ATOM 11481 HG21 ILE B 211 55.715 21.411 86.016 1.00 0.00 H ATOM 11482 HG22 ILE B 211 57.374 21.842 86.498 1.00 0.00 H ATOM 11483 HG23 ILE B 211 56.034 22.970 86.815 1.00 0.00 H ATOM 11484 H ILE B 211 56.685 23.307 82.210 1.00 0.00 H ATOM 11485 N ARG B 212 55.233 20.508 83.415 1.00 42.97 N ATOM 11486 CA ARG B 212 54.416 19.305 83.507 1.00 43.64 C ATOM 11487 C ARG B 212 55.017 18.139 82.721 1.00 44.47 C ATOM 11488 O ARG B 212 54.938 16.985 83.150 1.00 44.03 O ATOM 11489 CB ARG B 212 52.981 19.596 83.053 1.00 44.87 C ATOM 11490 CG ARG B 212 52.057 18.400 83.138 1.00 47.62 C ATOM 11491 CD ARG B 212 51.925 17.892 84.573 1.00 49.45 C ATOM 11492 NE ARG B 212 51.373 16.542 84.626 1.00 49.85 N ATOM 11493 CZ ARG B 212 52.102 15.432 84.555 1.00 50.91 C ATOM 11494 NH1 ARG B 212 53.419 15.506 84.421 1.00 51.03 N ATOM 11495 NH2 ARG B 212 51.514 14.242 84.615 1.00 52.32 N ATOM 11496 HA ARG B 212 54.395 19.002 84.554 1.00 0.00 H ATOM 11497 HB2 ARG B 212 52.576 20.389 83.682 1.00 0.00 H ATOM 11498 HB3 ARG B 212 53.010 19.935 82.017 1.00 0.00 H ATOM 11499 HG2 ARG B 212 51.071 18.687 82.772 1.00 0.00 H ATOM 11500 HG3 ARG B 212 52.455 17.600 82.514 1.00 0.00 H ATOM 11501 HD2 ARG B 212 51.268 18.563 85.125 1.00 0.00 H ATOM 11502 HD3 ARG B 212 52.911 17.888 85.037 1.00 0.00 H ATOM 11503 HE ARG B 212 50.343 16.442 84.726 1.00 0.00 H ATOM 11504 HH12 ARG B 212 53.986 14.636 84.366 1.00 0.00 H ATOM 11505 HH11 ARG B 212 53.885 16.434 84.371 1.00 0.00 H ATOM 11506 HH22 ARG B 212 52.087 13.376 84.559 1.00 0.00 H ATOM 11507 HH21 ARG B 212 50.481 14.177 84.718 1.00 0.00 H ATOM 11508 H ARG B 212 54.826 21.369 82.998 1.00 0.00 H ATOM 11509 N VAL B 213 55.623 18.438 81.573 1.00 44.27 N ATOM 11510 CA VAL B 213 56.245 17.403 80.752 1.00 43.88 C ATOM 11511 C VAL B 213 57.538 16.899 81.388 1.00 45.00 C ATOM 11512 O VAL B 213 57.867 15.714 81.294 1.00 44.27 O ATOM 11513 CB VAL B 213 56.505 17.895 79.302 1.00 42.78 C ATOM 11514 CG1 VAL B 213 57.587 17.061 78.623 1.00 41.23 C ATOM 11515 CG2 VAL B 213 55.208 17.874 78.498 1.00 41.72 C ATOM 11516 HA VAL B 213 55.542 16.572 80.698 1.00 0.00 H ATOM 11517 HB VAL B 213 56.866 18.923 79.347 1.00 0.00 H ATOM 11518 HG11 VAL B 213 58.515 17.141 79.190 1.00 0.00 H ATOM 11519 HG12 VAL B 213 57.271 16.019 78.586 1.00 0.00 H ATOM 11520 HG13 VAL B 213 57.746 17.430 77.610 1.00 0.00 H ATOM 11521 HG21 VAL B 213 54.818 16.857 78.466 1.00 0.00 H ATOM 11522 HG22 VAL B 213 54.477 18.529 78.972 1.00 0.00 H ATOM 11523 HG23 VAL B 213 55.405 18.221 77.484 1.00 0.00 H ATOM 11524 H VAL B 213 55.654 19.428 81.255 1.00 0.00 H ATOM 11525 N PHE B 214 58.270 17.798 82.037 1.00 46.57 N ATOM 11526 CA PHE B 214 59.516 17.421 82.707 1.00 49.11 C ATOM 11527 C PHE B 214 59.257 16.416 83.829 1.00 48.95 C ATOM 11528 O PHE B 214 60.172 15.742 84.284 1.00 50.05 O ATOM 11529 CB PHE B 214 60.236 18.659 83.248 1.00 51.31 C ATOM 11530 CG PHE B 214 61.072 19.382 82.216 1.00 54.07 C ATOM 11531 CD1 PHE B 214 60.898 19.141 80.856 1.00 54.48 C ATOM 11532 CD2 PHE B 214 62.020 20.322 82.611 1.00 54.82 C ATOM 11533 CE1 PHE B 214 61.663 19.810 79.912 1.00 55.00 C ATOM 11534 CE2 PHE B 214 62.791 21.000 81.669 1.00 55.18 C ATOM 11535 CZ PHE B 214 62.611 20.743 80.320 1.00 55.44 C ATOM 11536 HA PHE B 214 60.160 16.943 81.969 1.00 0.00 H ATOM 11537 HB2 PHE B 214 59.487 19.352 83.630 1.00 0.00 H ATOM 11538 HB3 PHE B 214 60.890 18.347 84.063 1.00 0.00 H ATOM 11539 HD2 PHE B 214 62.161 20.530 83.672 1.00 0.00 H ATOM 11540 HE2 PHE B 214 63.533 21.730 81.993 1.00 0.00 H ATOM 11541 HZ PHE B 214 63.211 21.271 79.579 1.00 0.00 H ATOM 11542 HE1 PHE B 214 61.521 19.605 78.851 1.00 0.00 H ATOM 11543 HD1 PHE B 214 60.151 18.418 80.529 1.00 0.00 H ATOM 11544 H PHE B 214 57.952 18.788 82.070 1.00 0.00 H ATOM 11545 N LEU B 215 58.001 16.321 84.258 1.00 49.95 N ATOM 11546 CA LEU B 215 57.596 15.372 85.297 1.00 50.97 C ATOM 11547 C LEU B 215 57.196 13.999 84.742 1.00 52.21 C ATOM 11548 O LEU B 215 56.885 13.087 85.513 1.00 52.28 O ATOM 11549 CB LEU B 215 56.447 15.949 86.133 1.00 49.97 C ATOM 11550 CG LEU B 215 56.788 17.178 86.984 1.00 49.66 C ATOM 11551 CD1 LEU B 215 55.545 17.738 87.653 1.00 48.96 C ATOM 11552 CD2 LEU B 215 57.852 16.839 88.019 1.00 50.00 C ATOM 11553 HA LEU B 215 58.473 15.217 85.926 1.00 0.00 H ATOM 11554 HB2 LEU B 215 55.644 16.228 85.450 1.00 0.00 H ATOM 11555 HB3 LEU B 215 56.096 15.165 86.804 1.00 0.00 H ATOM 11556 HG LEU B 215 57.189 17.946 86.322 1.00 0.00 H ATOM 11557 HD21 LEU B 215 57.482 16.049 88.673 1.00 0.00 H ATOM 11558 HD22 LEU B 215 58.755 16.500 87.512 1.00 0.00 H ATOM 11559 HD23 LEU B 215 58.077 17.726 88.611 1.00 0.00 H ATOM 11560 HD11 LEU B 215 54.823 18.030 86.890 1.00 0.00 H ATOM 11561 HD12 LEU B 215 55.106 16.976 88.298 1.00 0.00 H ATOM 11562 HD13 LEU B 215 55.816 18.609 88.250 1.00 0.00 H ATOM 11563 H LEU B 215 57.280 16.944 83.840 1.00 0.00 H ATOM 11564 N LEU B 216 57.205 13.853 83.415 1.00 51.55 N ATOM 11565 CA LEU B 216 56.847 12.574 82.784 1.00 52.56 C ATOM 11566 C LEU B 216 57.926 11.519 82.977 1.00 53.34 C ATOM 11567 O LEU B 216 59.121 11.793 82.826 1.00 53.07 O ATOM 11568 CB LEU B 216 56.538 12.741 81.293 1.00 51.74 C ATOM 11569 CG LEU B 216 55.248 13.490 80.959 1.00 51.53 C ATOM 11570 CD1 LEU B 216 55.017 13.498 79.457 1.00 51.04 C ATOM 11571 CD2 LEU B 216 54.060 12.872 81.680 1.00 51.80 C ATOM 11572 HA LEU B 216 55.943 12.230 83.287 1.00 0.00 H ATOM 11573 HB2 LEU B 216 57.367 13.284 80.838 1.00 0.00 H ATOM 11574 HB3 LEU B 216 56.471 11.746 80.852 1.00 0.00 H ATOM 11575 HG LEU B 216 55.351 14.520 81.301 1.00 0.00 H ATOM 11576 HD21 LEU B 216 53.952 11.832 81.373 1.00 0.00 H ATOM 11577 HD22 LEU B 216 54.225 12.919 82.756 1.00 0.00 H ATOM 11578 HD23 LEU B 216 53.155 13.423 81.425 1.00 0.00 H ATOM 11579 HD11 LEU B 216 55.854 13.993 78.965 1.00 0.00 H ATOM 11580 HD12 LEU B 216 54.937 12.472 79.098 1.00 0.00 H ATOM 11581 HD13 LEU B 216 54.095 14.035 79.235 1.00 0.00 H ATOM 11582 H LEU B 216 57.471 14.660 82.815 1.00 0.00 H ATOM 11583 N GLU B 217 57.483 10.309 83.306 1.00 55.00 N ATOM 11584 CA GLU B 217 58.380 9.215 83.642 1.00 56.61 C ATOM 11585 C GLU B 217 57.673 7.885 83.394 1.00 56.35 C ATOM 11586 O GLU B 217 56.535 7.684 83.826 1.00 55.98 O ATOM 11587 CB GLU B 217 58.791 9.332 85.112 1.00 58.47 C ATOM 11588 CG GLU B 217 60.154 8.749 85.472 1.00 60.36 C ATOM 11589 CD GLU B 217 60.666 9.276 86.812 1.00 61.79 C ATOM 11590 OE1 GLU B 217 59.843 9.821 87.587 1.00 61.99 O ATOM 11591 OE2 GLU B 217 61.883 9.154 87.091 1.00 62.25 O ATOM 11592 HA GLU B 217 59.273 9.262 83.019 1.00 0.00 H ATOM 11593 HB2 GLU B 217 58.801 10.390 85.373 1.00 0.00 H ATOM 11594 HB3 GLU B 217 58.039 8.818 85.711 1.00 0.00 H ATOM 11595 HG2 GLU B 217 60.069 7.664 85.530 1.00 0.00 H ATOM 11596 HG3 GLU B 217 60.868 9.015 84.693 1.00 0.00 H ATOM 11597 H GLU B 217 56.457 10.139 83.324 1.00 0.00 H ATOM 11598 N THR B 218 58.352 6.991 82.680 1.00 55.76 N ATOM 11599 CA THR B 218 57.843 5.653 82.401 1.00 55.24 C ATOM 11600 C THR B 218 59.026 4.699 82.355 1.00 54.97 C ATOM 11601 O THR B 218 60.175 5.144 82.311 1.00 54.11 O ATOM 11602 CB THR B 218 57.117 5.570 81.040 1.00 55.12 C ATOM 11603 OG1 THR B 218 58.044 5.862 79.990 1.00 55.06 O ATOM 11604 CG2 THR B 218 55.937 6.525 80.968 1.00 55.72 C ATOM 11605 HA THR B 218 57.129 5.396 83.183 1.00 0.00 H ATOM 11606 HB THR B 218 56.727 4.558 80.926 1.00 0.00 H ATOM 11607 HG1 THR B 218 58.408 6.774 80.117 1.00 0.00 H ATOM 11608 HG23 THR B 218 55.236 6.296 81.771 1.00 0.00 H ATOM 11609 HG21 THR B 218 56.293 7.549 81.076 1.00 0.00 H ATOM 11610 HG22 THR B 218 55.438 6.412 80.005 1.00 0.00 H ATOM 11611 H THR B 218 59.285 7.257 82.305 1.00 0.00 H ATOM 11612 N PRO B 219 58.758 3.380 82.367 1.00 55.36 N ATOM 11613 CA PRO B 219 59.825 2.389 82.206 1.00 55.80 C ATOM 11614 C PRO B 219 60.669 2.597 80.939 1.00 56.71 C ATOM 11615 O PRO B 219 61.801 2.107 80.868 1.00 57.74 O ATOM 11616 CB PRO B 219 59.057 1.067 82.118 1.00 55.82 C ATOM 11617 CG PRO B 219 57.797 1.320 82.865 1.00 55.51 C ATOM 11618 CD PRO B 219 57.443 2.743 82.564 1.00 55.28 C ATOM 11619 HA PRO B 219 60.545 2.443 83.023 1.00 0.00 H ATOM 11620 HD3 PRO B 219 56.835 2.813 81.662 1.00 0.00 H ATOM 11621 HD2 PRO B 219 56.908 3.198 83.398 1.00 0.00 H ATOM 11622 HG3 PRO B 219 57.952 1.182 83.935 1.00 0.00 H ATOM 11623 HG2 PRO B 219 57.009 0.649 82.524 1.00 0.00 H ATOM 11624 HB2 PRO B 219 58.845 0.812 81.080 1.00 0.00 H ATOM 11625 HB3 PRO B 219 59.624 0.260 82.581 1.00 0.00 H ATOM 11626 N ASN B 220 60.124 3.320 79.960 1.00 56.77 N ATOM 11627 CA ASN B 220 60.825 3.590 78.700 1.00 56.46 C ATOM 11628 C ASN B 220 61.779 4.783 78.746 1.00 56.41 C ATOM 11629 O ASN B 220 62.589 4.970 77.841 1.00 56.09 O ATOM 11630 CB ASN B 220 59.822 3.776 77.559 1.00 56.94 C ATOM 11631 CG ASN B 220 59.136 2.483 77.174 1.00 57.19 C ATOM 11632 OD1 ASN B 220 59.770 1.433 77.084 1.00 57.29 O ATOM 11633 ND2 ASN B 220 57.831 2.553 76.939 1.00 57.29 N ATOM 11634 HA ASN B 220 61.447 2.712 78.525 1.00 0.00 H ATOM 11635 HB2 ASN B 220 59.064 4.494 77.873 1.00 0.00 H ATOM 11636 HB3 ASN B 220 60.350 4.164 76.688 1.00 0.00 H ATOM 11637 HD22 ASN B 220 57.335 3.463 77.027 1.00 0.00 H ATOM 11638 HD21 ASN B 220 57.305 1.698 76.667 1.00 0.00 H ATOM 11639 H ASN B 220 59.168 3.706 80.095 1.00 0.00 H ATOM 11640 N GLY B 221 61.678 5.592 79.796 1.00 56.54 N ATOM 11641 CA GLY B 221 62.578 6.731 79.954 1.00 56.32 C ATOM 11642 C GLY B 221 61.965 7.961 80.596 1.00 56.12 C ATOM 11643 O GLY B 221 60.815 7.945 81.041 1.00 55.80 O ATOM 11644 HA3 GLY B 221 62.941 7.013 78.966 1.00 0.00 H ATOM 11645 HA2 GLY B 221 63.418 6.413 80.571 1.00 0.00 H ATOM 11646 H GLY B 221 60.948 5.411 80.515 1.00 0.00 H ATOM 11647 N THR B 222 62.748 9.035 80.638 1.00 55.98 N ATOM 11648 CA THR B 222 62.319 10.292 81.237 1.00 56.08 C ATOM 11649 C THR B 222 62.382 11.435 80.230 1.00 55.72 C ATOM 11650 O THR B 222 62.928 11.285 79.136 1.00 55.48 O ATOM 11651 CB THR B 222 63.212 10.677 82.436 1.00 56.10 C ATOM 11652 OG1 THR B 222 64.543 10.942 81.975 1.00 55.42 O ATOM 11653 CG2 THR B 222 63.252 9.559 83.474 1.00 56.91 C ATOM 11654 HA THR B 222 61.292 10.139 81.568 1.00 0.00 H ATOM 11655 HB THR B 222 62.791 11.568 82.903 1.00 0.00 H ATOM 11656 HG1 THR B 222 65.115 11.189 82.745 1.00 0.00 H ATOM 11657 HG23 THR B 222 62.241 9.356 83.826 1.00 0.00 H ATOM 11658 HG21 THR B 222 63.668 8.659 83.021 1.00 0.00 H ATOM 11659 HG22 THR B 222 63.876 9.867 84.314 1.00 0.00 H ATOM 11660 H THR B 222 63.702 8.976 80.228 1.00 0.00 H ATOM 11661 N ALA B 223 61.828 12.580 80.615 1.00 56.15 N ATOM 11662 CA ALA B 223 61.877 13.785 79.793 1.00 55.43 C ATOM 11663 C ALA B 223 63.318 14.210 79.537 1.00 55.10 C ATOM 11664 O ALA B 223 63.636 14.743 78.474 1.00 54.35 O ATOM 11665 CB ALA B 223 61.100 14.913 80.460 1.00 55.51 C ATOM 11666 HA ALA B 223 61.413 13.562 78.832 1.00 0.00 H ATOM 11667 HB1 ALA B 223 60.061 14.611 80.587 1.00 0.00 H ATOM 11668 HB2 ALA B 223 61.539 15.128 81.434 1.00 0.00 H ATOM 11669 HB3 ALA B 223 61.147 15.804 79.834 1.00 0.00 H ATOM 11670 H ALA B 223 61.343 12.619 81.534 1.00 0.00 H ATOM 11671 N ALA B 224 64.183 13.965 80.517 1.00 54.85 N ATOM 11672 CA ALA B 224 65.600 14.310 80.409 1.00 54.36 C ATOM 11673 C ALA B 224 66.282 13.594 79.245 1.00 54.39 C ATOM 11674 O ALA B 224 67.197 14.140 78.626 1.00 54.64 O ATOM 11675 CB ALA B 224 66.323 14.011 81.718 1.00 54.54 C ATOM 11676 HA ALA B 224 65.657 15.380 80.207 1.00 0.00 H ATOM 11677 HB1 ALA B 224 65.875 14.597 82.521 1.00 0.00 H ATOM 11678 HB2 ALA B 224 66.233 12.949 81.947 1.00 0.00 H ATOM 11679 HB3 ALA B 224 67.376 14.274 81.618 1.00 0.00 H ATOM 11680 H ALA B 224 63.840 13.513 81.389 1.00 0.00 H ATOM 11681 N ASP B 225 65.838 12.372 78.950 1.00 54.38 N ATOM 11682 CA ASP B 225 66.376 11.610 77.826 1.00 54.01 C ATOM 11683 C ASP B 225 66.090 12.324 76.508 1.00 53.75 C ATOM 11684 O ASP B 225 66.916 12.315 75.597 1.00 52.48 O ATOM 11685 CB ASP B 225 65.784 10.200 77.791 1.00 54.71 C ATOM 11686 CG ASP B 225 66.105 9.395 79.041 1.00 55.43 C ATOM 11687 OD1 ASP B 225 67.162 9.641 79.660 1.00 55.17 O ATOM 11688 OD2 ASP B 225 65.296 8.515 79.404 1.00 55.42 O ATOM 11689 HA ASP B 225 67.455 11.532 77.960 1.00 0.00 H ATOM 11690 HB2 ASP B 225 64.701 10.279 77.696 1.00 0.00 H ATOM 11691 HB3 ASP B 225 66.186 9.674 76.925 1.00 0.00 H ATOM 11692 H ASP B 225 65.089 11.950 79.535 1.00 0.00 H ATOM 11693 N GLY B 226 64.909 12.935 76.418 1.00 53.57 N ATOM 11694 CA GLY B 226 64.499 13.670 75.225 1.00 53.31 C ATOM 11695 C GLY B 226 65.335 14.916 75.025 1.00 53.59 C ATOM 11696 O GLY B 226 65.648 15.291 73.894 1.00 53.86 O ATOM 11697 HA3 GLY B 226 63.453 13.958 75.328 1.00 0.00 H ATOM 11698 HA2 GLY B 226 64.612 13.024 74.354 1.00 0.00 H ATOM 11699 H GLY B 226 64.256 12.887 77.226 1.00 0.00 H ATOM 11700 N LEU B 227 65.694 15.558 76.132 1.00 53.90 N ATOM 11701 CA LEU B 227 66.529 16.752 76.103 1.00 54.35 C ATOM 11702 C LEU B 227 67.947 16.427 75.644 1.00 55.17 C ATOM 11703 O LEU B 227 68.516 17.135 74.811 1.00 54.88 O ATOM 11704 CB LEU B 227 66.555 17.417 77.480 1.00 54.09 C ATOM 11705 CG LEU B 227 65.236 18.048 77.928 1.00 53.33 C ATOM 11706 CD1 LEU B 227 65.251 18.332 79.418 1.00 53.78 C ATOM 11707 CD2 LEU B 227 64.945 19.316 77.133 1.00 52.48 C ATOM 11708 HA LEU B 227 66.095 17.446 75.383 1.00 0.00 H ATOM 11709 HB2 LEU B 227 66.833 16.661 78.214 1.00 0.00 H ATOM 11710 HB3 LEU B 227 67.314 18.200 77.462 1.00 0.00 H ATOM 11711 HG LEU B 227 64.435 17.335 77.731 1.00 0.00 H ATOM 11712 HD21 LEU B 227 65.750 20.034 77.290 1.00 0.00 H ATOM 11713 HD22 LEU B 227 64.876 19.071 76.073 1.00 0.00 H ATOM 11714 HD23 LEU B 227 64.002 19.746 77.470 1.00 0.00 H ATOM 11715 HD11 LEU B 227 65.397 17.399 79.963 1.00 0.00 H ATOM 11716 HD12 LEU B 227 66.065 19.020 79.647 1.00 0.00 H ATOM 11717 HD13 LEU B 227 64.302 18.780 79.711 1.00 0.00 H ATOM 11718 H LEU B 227 65.368 15.196 77.051 1.00 0.00 H ATOM 11719 N ASN B 228 68.510 15.351 76.184 1.00 55.72 N ATOM 11720 CA ASN B 228 69.861 14.934 75.819 1.00 56.10 C ATOM 11721 C ASN B 228 69.981 14.570 74.338 1.00 55.35 C ATOM 11722 O ASN B 228 71.001 14.833 73.716 1.00 55.23 O ATOM 11723 CB ASN B 228 70.334 13.785 76.716 1.00 57.90 C ATOM 11724 CG ASN B 228 70.606 14.239 78.147 1.00 59.55 C ATOM 11725 OD1 ASN B 228 71.314 15.224 78.374 1.00 60.07 O ATOM 11726 ND2 ASN B 228 70.043 13.521 79.115 1.00 60.03 N ATOM 11727 HA ASN B 228 70.517 15.790 75.981 1.00 0.00 H ATOM 11728 HB2 ASN B 228 69.564 13.014 76.733 1.00 0.00 H ATOM 11729 HB3 ASN B 228 71.252 13.370 76.299 1.00 0.00 H ATOM 11730 HD22 ASN B 228 69.454 12.698 78.876 1.00 0.00 H ATOM 11731 HD21 ASN B 228 70.192 13.783 80.110 1.00 0.00 H ATOM 11732 H ASN B 228 67.977 14.794 76.882 1.00 0.00 H ATOM 11733 N PHE B 229 68.930 13.974 73.782 1.00 54.61 N ATOM 11734 CA PHE B 229 68.886 13.651 72.358 1.00 54.02 C ATOM 11735 C PHE B 229 68.876 14.923 71.499 1.00 55.10 C ATOM 11736 O PHE B 229 69.490 14.967 70.433 1.00 54.64 O ATOM 11737 CB PHE B 229 67.674 12.761 72.050 1.00 52.26 C ATOM 11738 CG PHE B 229 67.207 12.821 70.617 1.00 51.53 C ATOM 11739 CD1 PHE B 229 67.910 12.171 69.611 1.00 50.91 C ATOM 11740 CD2 PHE B 229 66.052 13.520 70.278 1.00 51.21 C ATOM 11741 CE1 PHE B 229 67.481 12.226 68.294 1.00 50.17 C ATOM 11742 CE2 PHE B 229 65.615 13.578 68.960 1.00 50.41 C ATOM 11743 CZ PHE B 229 66.332 12.930 67.969 1.00 50.58 C ATOM 11744 HA PHE B 229 69.790 13.097 72.105 1.00 0.00 H ATOM 11745 HB2 PHE B 229 67.941 11.729 72.279 1.00 0.00 H ATOM 11746 HB3 PHE B 229 66.850 13.073 72.691 1.00 0.00 H ATOM 11747 HD2 PHE B 229 65.483 14.028 71.056 1.00 0.00 H ATOM 11748 HE2 PHE B 229 64.711 14.132 68.708 1.00 0.00 H ATOM 11749 HZ PHE B 229 65.993 12.973 66.934 1.00 0.00 H ATOM 11750 HE1 PHE B 229 68.047 11.716 67.514 1.00 0.00 H ATOM 11751 HD1 PHE B 229 68.811 11.610 69.860 1.00 0.00 H ATOM 11752 H PHE B 229 68.114 13.730 74.379 1.00 0.00 H ATOM 11753 N LEU B 230 68.188 15.956 71.975 1.00 56.16 N ATOM 11754 CA LEU B 230 68.073 17.206 71.233 1.00 57.67 C ATOM 11755 C LEU B 230 69.332 18.064 71.320 1.00 59.26 C ATOM 11756 O LEU B 230 69.644 18.813 70.391 1.00 59.30 O ATOM 11757 CB LEU B 230 66.865 18.013 71.727 1.00 57.43 C ATOM 11758 CG LEU B 230 66.654 19.393 71.085 1.00 57.97 C ATOM 11759 CD1 LEU B 230 66.397 19.272 69.581 1.00 57.69 C ATOM 11760 CD2 LEU B 230 65.526 20.154 71.767 1.00 56.75 C ATOM 11761 HA LEU B 230 67.936 16.934 70.187 1.00 0.00 H ATOM 11762 HB2 LEU B 230 65.970 17.419 71.539 1.00 0.00 H ATOM 11763 HB3 LEU B 230 66.982 18.161 72.801 1.00 0.00 H ATOM 11764 HG LEU B 230 67.574 19.962 71.224 1.00 0.00 H ATOM 11765 HD21 LEU B 230 64.600 19.585 71.679 1.00 0.00 H ATOM 11766 HD22 LEU B 230 65.769 20.295 72.820 1.00 0.00 H ATOM 11767 HD23 LEU B 230 65.404 21.126 71.288 1.00 0.00 H ATOM 11768 HD11 LEU B 230 67.253 18.794 69.105 1.00 0.00 H ATOM 11769 HD12 LEU B 230 65.504 18.670 69.414 1.00 0.00 H ATOM 11770 HD13 LEU B 230 66.252 20.266 69.157 1.00 0.00 H ATOM 11771 H LEU B 230 67.720 15.871 72.900 1.00 0.00 H ATOM 11772 N TRP B 231 70.055 17.953 72.427 1.00 61.39 N ATOM 11773 CA TRP B 231 71.201 18.831 72.666 1.00 63.86 C ATOM 11774 C TRP B 231 72.567 18.135 72.660 1.00 64.98 C ATOM 11775 O TRP B 231 73.567 18.728 73.070 1.00 65.18 O ATOM 11776 CB TRP B 231 70.995 19.613 73.966 1.00 64.46 C ATOM 11777 CG TRP B 231 69.803 20.526 73.912 1.00 64.94 C ATOM 11778 CD1 TRP B 231 68.581 20.320 74.484 1.00 64.93 C ATOM 11779 CD2 TRP B 231 69.722 21.788 73.239 1.00 65.18 C ATOM 11780 NE1 TRP B 231 67.745 21.377 74.216 1.00 64.36 N ATOM 11781 CE2 TRP B 231 68.419 22.291 73.451 1.00 64.90 C ATOM 11782 CE3 TRP B 231 70.623 22.543 72.478 1.00 65.32 C ATOM 11783 CZ2 TRP B 231 67.998 23.516 72.930 1.00 64.99 C ATOM 11784 CZ3 TRP B 231 70.201 23.762 71.960 1.00 65.08 C ATOM 11785 CH2 TRP B 231 68.900 24.234 72.189 1.00 64.96 C ATOM 11786 HA TRP B 231 71.234 19.510 71.814 1.00 0.00 H ATOM 11787 HB2 TRP B 231 70.854 18.903 74.781 1.00 0.00 H ATOM 11788 HB3 TRP B 231 71.885 20.212 74.157 1.00 0.00 H ATOM 11789 HE1 TRP B 231 66.761 21.468 74.541 1.00 0.00 H ATOM 11790 HD1 TRP B 231 68.307 19.442 75.070 1.00 0.00 H ATOM 11791 HZ2 TRP B 231 66.989 23.888 73.106 1.00 0.00 H ATOM 11792 HH2 TRP B 231 68.600 25.194 71.768 1.00 0.00 H ATOM 11793 HZ3 TRP B 231 70.892 24.361 71.366 1.00 0.00 H ATOM 11794 HE3 TRP B 231 71.635 22.182 72.295 1.00 0.00 H ATOM 11795 H TRP B 231 69.804 17.233 73.134 1.00 0.00 H ATOM 11796 N THR B 232 72.606 16.886 72.198 1.00 66.20 N ATOM 11797 CA THR B 232 73.868 16.160 72.044 1.00 67.14 C ATOM 11798 C THR B 232 74.314 16.235 70.590 1.00 68.55 C ATOM 11799 O THR B 232 73.684 15.637 69.712 1.00 68.33 O ATOM 11800 CB THR B 232 73.758 14.683 72.478 1.00 66.56 C ATOM 11801 OG1 THR B 232 73.401 14.613 73.862 1.00 65.87 O ATOM 11802 CG2 THR B 232 75.082 13.962 72.266 1.00 66.47 C ATOM 11803 HA THR B 232 74.603 16.632 72.696 1.00 0.00 H ATOM 11804 HB THR B 232 72.991 14.201 71.872 1.00 0.00 H ATOM 11805 HG1 THR B 232 72.530 15.062 74.000 1.00 0.00 H ATOM 11806 HG23 THR B 232 75.357 14.013 71.213 1.00 0.00 H ATOM 11807 HG21 THR B 232 75.855 14.439 72.869 1.00 0.00 H ATOM 11808 HG22 THR B 232 74.978 12.919 72.566 1.00 0.00 H ATOM 11809 H THR B 232 71.716 16.414 71.940 1.00 0.00 H ATOM 11810 N PRO B 233 75.404 16.975 70.332 1.00 69.84 N ATOM 11811 CA PRO B 233 75.909 17.207 68.981 1.00 71.10 C ATOM 11812 C PRO B 233 76.453 15.953 68.311 1.00 72.18 C ATOM 11813 O PRO B 233 77.130 15.145 68.944 1.00 72.55 O ATOM 11814 CB PRO B 233 77.047 18.218 69.192 1.00 70.84 C ATOM 11815 CG PRO B 233 76.844 18.769 70.572 1.00 70.85 C ATOM 11816 CD PRO B 233 76.234 17.646 71.344 1.00 70.23 C ATOM 11817 HA PRO B 233 75.112 17.551 68.322 1.00 0.00 H ATOM 11818 HD3 PRO B 233 76.999 16.975 71.734 1.00 0.00 H ATOM 11819 HD2 PRO B 233 75.626 18.019 72.168 1.00 0.00 H ATOM 11820 HG3 PRO B 233 76.174 19.628 70.548 1.00 0.00 H ATOM 11821 HG2 PRO B 233 77.796 19.065 71.012 1.00 0.00 H ATOM 11822 HB2 PRO B 233 78.015 17.723 69.118 1.00 0.00 H ATOM 11823 HB3 PRO B 233 76.991 19.015 68.451 1.00 0.00 H ATOM 11824 N ASP B 234 76.136 15.807 67.031 1.00 73.52 N ATOM 11825 CA ASP B 234 76.660 14.738 66.204 1.00 75.22 C ATOM 11826 C ASP B 234 77.374 15.450 65.064 1.00 76.44 C ATOM 11827 O ASP B 234 76.731 16.029 64.188 1.00 77.35 O ATOM 11828 CB ASP B 234 75.522 13.853 65.697 1.00 75.43 C ATOM 11829 CG ASP B 234 76.005 12.684 64.855 1.00 75.72 C ATOM 11830 OD1 ASP B 234 77.234 12.506 64.710 1.00 76.53 O ATOM 11831 OD2 ASP B 234 75.150 11.938 64.335 1.00 75.24 O ATOM 11832 HA ASP B 234 77.335 14.075 66.745 1.00 0.00 H ATOM 11833 HB2 ASP B 234 74.978 13.461 66.556 1.00 0.00 H ATOM 11834 HB3 ASP B 234 74.851 14.463 65.092 1.00 0.00 H ATOM 11835 H ASP B 234 75.481 16.491 66.601 1.00 0.00 H ATOM 11836 N PHE B 235 78.703 15.415 65.082 1.00 77.27 N ATOM 11837 CA PHE B 235 79.505 16.165 64.115 1.00 77.99 C ATOM 11838 C PHE B 235 79.650 15.482 62.757 1.00 78.63 C ATOM 11839 O PHE B 235 80.090 16.103 61.788 1.00 78.77 O ATOM 11840 CB PHE B 235 80.883 16.490 64.701 1.00 77.98 C ATOM 11841 CG PHE B 235 80.828 17.415 65.885 1.00 78.12 C ATOM 11842 CD1 PHE B 235 80.874 18.790 65.709 1.00 78.14 C ATOM 11843 CD2 PHE B 235 80.722 16.912 67.174 1.00 78.17 C ATOM 11844 CE1 PHE B 235 80.820 19.646 66.796 1.00 78.17 C ATOM 11845 CE2 PHE B 235 80.668 17.762 68.267 1.00 78.10 C ATOM 11846 CZ PHE B 235 80.716 19.131 68.078 1.00 78.20 C ATOM 11847 HA PHE B 235 78.955 17.087 63.925 1.00 0.00 H ATOM 11848 HB2 PHE B 235 81.354 15.558 65.013 1.00 0.00 H ATOM 11849 HB3 PHE B 235 81.487 16.959 63.924 1.00 0.00 H ATOM 11850 HD2 PHE B 235 80.681 15.834 67.329 1.00 0.00 H ATOM 11851 HE2 PHE B 235 80.588 17.352 69.274 1.00 0.00 H ATOM 11852 HZ PHE B 235 80.672 19.803 68.935 1.00 0.00 H ATOM 11853 HE1 PHE B 235 80.859 20.725 66.643 1.00 0.00 H ATOM 11854 HD1 PHE B 235 80.954 19.202 64.703 1.00 0.00 H ATOM 11855 H PHE B 235 79.185 14.840 65.802 1.00 0.00 H ATOM 11856 N GLU B 236 79.272 14.209 62.690 1.00 79.43 N ATOM 11857 CA GLU B 236 79.347 13.452 61.443 1.00 80.33 C ATOM 11858 C GLU B 236 78.108 13.698 60.575 1.00 80.12 C ATOM 11859 O GLU B 236 77.891 13.021 59.569 1.00 80.16 O ATOM 11860 CB GLU B 236 79.538 11.956 61.734 1.00 81.16 C ATOM 11861 CG GLU B 236 79.921 11.111 60.517 1.00 81.96 C ATOM 11862 CD GLU B 236 80.398 9.714 60.885 1.00 82.35 C ATOM 11863 OE1 GLU B 236 81.359 9.595 61.679 1.00 82.12 O ATOM 11864 OE2 GLU B 236 79.816 8.734 60.368 1.00 82.31 O ATOM 11865 HA GLU B 236 80.214 13.800 60.881 1.00 0.00 H ATOM 11866 HB2 GLU B 236 80.326 11.853 62.481 1.00 0.00 H ATOM 11867 HB3 GLU B 236 78.603 11.566 62.138 1.00 0.00 H ATOM 11868 HG2 GLU B 236 79.049 11.020 59.869 1.00 0.00 H ATOM 11869 HG3 GLU B 236 80.721 11.620 59.979 1.00 0.00 H ATOM 11870 H GLU B 236 78.914 13.741 63.547 1.00 0.00 H ATOM 11871 N LYS B 237 77.299 14.678 60.971 1.00 79.87 N ATOM 11872 CA LYS B 237 76.094 15.040 60.227 1.00 79.24 C ATOM 11873 C LYS B 237 76.203 16.437 59.620 1.00 78.46 C ATOM 11874 O LYS B 237 75.352 16.847 58.830 1.00 78.35 O ATOM 11875 CB LYS B 237 74.858 14.936 61.120 1.00 79.64 C ATOM 11876 CG LYS B 237 74.442 13.506 61.450 1.00 80.00 C ATOM 11877 CD LYS B 237 73.826 12.805 60.245 1.00 80.53 C ATOM 11878 CE LYS B 237 72.496 13.441 59.849 1.00 80.99 C ATOM 11879 NZ LYS B 237 71.865 12.787 58.663 1.00 80.87 N ATOM 11880 HA LYS B 237 75.991 14.332 59.405 1.00 0.00 H ATOM 11881 HB2 LYS B 237 75.067 15.456 62.055 1.00 0.00 H ATOM 11882 HB3 LYS B 237 74.027 15.425 60.612 1.00 0.00 H ATOM 11883 HG2 LYS B 237 75.321 12.948 61.772 1.00 0.00 H ATOM 11884 HG3 LYS B 237 73.711 13.528 62.258 1.00 0.00 H ATOM 11885 HD2 LYS B 237 74.516 12.873 59.404 1.00 0.00 H ATOM 11886 HD3 LYS B 237 73.658 11.757 60.492 1.00 0.00 H ATOM 11887 HE2 LYS B 237 72.669 14.491 59.615 1.00 0.00 H ATOM 11888 HE3 LYS B 237 71.810 13.366 60.693 1.00 0.00 H ATOM 11889 HZ1 LYS B 237 72.506 12.860 57.847 1.00 0.00 H ATOM 11890 HZ2 LYS B 237 71.685 11.785 58.876 1.00 0.00 H ATOM 11891 HZ3 LYS B 237 70.967 13.263 58.444 1.00 0.00 H ATOM 11892 H LYS B 237 77.532 15.203 61.838 1.00 0.00 H ATOM 11893 N LEU B 238 77.255 17.159 59.992 1.00 77.79 N ATOM 11894 CA LEU B 238 77.522 18.496 59.456 1.00 76.98 C ATOM 11895 C LEU B 238 77.891 18.457 57.974 1.00 76.19 C ATOM 11896 O LEU B 238 77.993 19.498 57.322 1.00 76.04 O ATOM 11897 CB LEU B 238 78.647 19.177 60.239 1.00 76.84 C ATOM 11898 CG LEU B 238 78.352 19.648 61.661 1.00 76.73 C ATOM 11899 CD1 LEU B 238 79.620 20.152 62.328 1.00 76.45 C ATOM 11900 CD2 LEU B 238 77.288 20.728 61.647 1.00 76.65 C ATOM 11901 HA LEU B 238 76.601 19.068 59.563 1.00 0.00 H ATOM 11902 HB2 LEU B 238 79.475 18.470 60.297 1.00 0.00 H ATOM 11903 HB3 LEU B 238 78.957 20.051 59.666 1.00 0.00 H ATOM 11904 HG LEU B 238 77.977 18.802 62.237 1.00 0.00 H ATOM 11905 HD21 LEU B 238 77.639 21.574 61.057 1.00 0.00 H ATOM 11906 HD22 LEU B 238 76.374 20.330 61.206 1.00 0.00 H ATOM 11907 HD23 LEU B 238 77.089 21.053 62.668 1.00 0.00 H ATOM 11908 HD11 LEU B 238 80.354 19.347 62.366 1.00 0.00 H ATOM 11909 HD12 LEU B 238 80.024 20.986 61.754 1.00 0.00 H ATOM 11910 HD13 LEU B 238 79.389 20.483 63.341 1.00 0.00 H ATOM 11911 H LEU B 238 77.914 16.759 60.690 1.00 0.00 H ATOM 11912 N LYS B 239 78.088 17.251 57.453 1.00 75.27 N ATOM 11913 CA LYS B 239 78.496 17.064 56.068 1.00 73.86 C ATOM 11914 C LYS B 239 77.308 16.698 55.178 1.00 72.19 C ATOM 11915 O LYS B 239 77.430 16.661 53.955 1.00 72.47 O ATOM 11916 CB LYS B 239 79.602 16.004 55.969 1.00 74.99 C ATOM 11917 CG LYS B 239 80.963 16.456 56.517 1.00 76.14 C ATOM 11918 CD LYS B 239 80.951 16.628 58.038 1.00 76.55 C ATOM 11919 CE LYS B 239 82.177 17.390 58.529 1.00 76.93 C ATOM 11920 NZ LYS B 239 82.100 17.682 59.992 1.00 76.89 N ATOM 11921 HA LYS B 239 78.895 18.012 55.707 1.00 0.00 H ATOM 11922 HB2 LYS B 239 79.283 15.125 56.529 1.00 0.00 H ATOM 11923 HB3 LYS B 239 79.728 15.739 54.919 1.00 0.00 H ATOM 11924 HG2 LYS B 239 81.712 15.709 56.255 1.00 0.00 H ATOM 11925 HG3 LYS B 239 81.226 17.409 56.059 1.00 0.00 H ATOM 11926 HD2 LYS B 239 80.055 17.178 58.325 1.00 0.00 H ATOM 11927 HD3 LYS B 239 80.936 15.643 58.505 1.00 0.00 H ATOM 11928 HE2 LYS B 239 82.249 18.331 57.984 1.00 0.00 H ATOM 11929 HE3 LYS B 239 83.066 16.790 58.335 1.00 0.00 H ATOM 11930 HZ1 LYS B 239 81.257 18.260 60.185 1.00 0.00 H ATOM 11931 HZ2 LYS B 239 82.038 16.788 60.520 1.00 0.00 H ATOM 11932 HZ3 LYS B 239 82.952 18.201 60.286 1.00 0.00 H ATOM 11933 H LYS B 239 77.946 16.414 58.054 1.00 0.00 H ATOM 11934 N ASP B 240 76.163 16.432 55.800 1.00 69.81 N ATOM 11935 CA ASP B 240 74.944 16.110 55.069 1.00 67.22 C ATOM 11936 C ASP B 240 74.200 17.393 54.702 1.00 65.02 C ATOM 11937 O ASP B 240 73.748 18.120 55.581 1.00 65.24 O ATOM 11938 CB ASP B 240 74.050 15.183 55.901 1.00 67.43 C ATOM 11939 CG ASP B 240 72.737 14.841 55.209 1.00 67.67 C ATOM 11940 OD1 ASP B 240 72.662 14.930 53.968 1.00 67.63 O ATOM 11941 OD2 ASP B 240 71.773 14.474 55.916 1.00 68.32 O ATOM 11942 HA ASP B 240 75.211 15.589 54.150 1.00 0.00 H ATOM 11943 HB2 ASP B 240 74.593 14.257 56.093 1.00 0.00 H ATOM 11944 HB3 ASP B 240 73.826 15.674 56.848 1.00 0.00 H ATOM 11945 H ASP B 240 76.137 16.454 56.839 1.00 0.00 H ATOM 11946 N PRO B 241 74.082 17.676 53.394 1.00 63.00 N ATOM 11947 CA PRO B 241 73.368 18.848 52.880 1.00 60.92 C ATOM 11948 C PRO B 241 71.912 18.895 53.334 1.00 58.39 C ATOM 11949 O PRO B 241 71.379 19.979 53.590 1.00 58.37 O ATOM 11950 CB PRO B 241 73.431 18.657 51.361 1.00 61.55 C ATOM 11951 CG PRO B 241 74.624 17.795 51.138 1.00 62.08 C ATOM 11952 CD PRO B 241 74.656 16.865 52.306 1.00 62.54 C ATOM 11953 HA PRO B 241 73.811 19.778 53.237 1.00 0.00 H ATOM 11954 HD3 PRO B 241 74.051 15.978 52.117 1.00 0.00 H ATOM 11955 HD2 PRO B 241 75.677 16.564 52.539 1.00 0.00 H ATOM 11956 HG3 PRO B 241 75.531 18.398 51.104 1.00 0.00 H ATOM 11957 HG2 PRO B 241 74.525 17.237 50.207 1.00 0.00 H ATOM 11958 HB2 PRO B 241 72.528 18.166 50.997 1.00 0.00 H ATOM 11959 HB3 PRO B 241 73.550 19.616 50.857 1.00 0.00 H ATOM 11960 N GLY B 242 71.285 17.725 53.429 1.00 54.98 N ATOM 11961 CA GLY B 242 69.891 17.607 53.850 1.00 50.88 C ATOM 11962 C GLY B 242 69.602 18.249 55.194 1.00 48.23 C ATOM 11963 O GLY B 242 68.549 18.848 55.386 1.00 47.62 O ATOM 11964 HA3 GLY B 242 69.639 16.548 53.913 1.00 0.00 H ATOM 11965 HA2 GLY B 242 69.263 18.085 53.098 1.00 0.00 H ATOM 11966 H GLY B 242 71.809 16.858 53.194 1.00 0.00 H ATOM 11967 N VAL B 243 70.538 18.132 56.129 1.00 46.67 N ATOM 11968 CA VAL B 243 70.359 18.713 57.453 1.00 44.93 C ATOM 11969 C VAL B 243 70.427 20.242 57.404 1.00 44.03 C ATOM 11970 O VAL B 243 69.683 20.922 58.111 1.00 43.48 O ATOM 11971 CB VAL B 243 71.389 18.159 58.465 1.00 45.26 C ATOM 11972 CG1 VAL B 243 71.171 18.766 59.839 1.00 45.27 C ATOM 11973 CG2 VAL B 243 71.285 16.645 58.544 1.00 44.98 C ATOM 11974 HA VAL B 243 69.365 18.425 57.795 1.00 0.00 H ATOM 11975 HB VAL B 243 72.387 18.430 58.121 1.00 0.00 H ATOM 11976 HG11 VAL B 243 71.283 19.849 59.778 1.00 0.00 H ATOM 11977 HG12 VAL B 243 70.167 18.522 60.188 1.00 0.00 H ATOM 11978 HG13 VAL B 243 71.907 18.362 60.534 1.00 0.00 H ATOM 11979 HG21 VAL B 243 70.282 16.367 58.867 1.00 0.00 H ATOM 11980 HG22 VAL B 243 71.483 16.217 57.561 1.00 0.00 H ATOM 11981 HG23 VAL B 243 72.016 16.269 59.260 1.00 0.00 H ATOM 11982 H VAL B 243 71.415 17.616 55.912 1.00 0.00 H ATOM 11983 N TRP B 244 71.319 20.770 56.565 1.00 42.95 N ATOM 11984 CA TRP B 244 71.486 22.216 56.406 1.00 41.19 C ATOM 11985 C TRP B 244 70.261 22.854 55.769 1.00 39.76 C ATOM 11986 O TRP B 244 69.834 23.927 56.176 1.00 39.31 O ATOM 11987 CB TRP B 244 72.730 22.529 55.572 1.00 43.68 C ATOM 11988 CG TRP B 244 73.987 22.194 56.276 1.00 44.09 C ATOM 11989 CD1 TRP B 244 74.672 21.018 56.212 1.00 44.70 C ATOM 11990 CD2 TRP B 244 74.719 23.041 57.166 1.00 44.29 C ATOM 11991 NE1 TRP B 244 75.793 21.078 57.010 1.00 44.68 N ATOM 11992 CE2 TRP B 244 75.844 22.312 57.605 1.00 44.93 C ATOM 11993 CE3 TRP B 244 74.537 24.345 57.633 1.00 45.37 C ATOM 11994 CZ2 TRP B 244 76.778 22.845 58.492 1.00 44.41 C ATOM 11995 CZ3 TRP B 244 75.466 24.874 58.513 1.00 44.56 C ATOM 11996 CH2 TRP B 244 76.570 24.125 58.931 1.00 44.94 C ATOM 11997 HA TRP B 244 71.610 22.640 57.403 1.00 0.00 H ATOM 11998 HB2 TRP B 244 72.684 21.954 54.647 1.00 0.00 H ATOM 11999 HB3 TRP B 244 72.734 23.593 55.337 1.00 0.00 H ATOM 12000 HE1 TRP B 244 76.486 20.314 57.140 1.00 0.00 H ATOM 12001 HD1 TRP B 244 74.376 20.155 55.616 1.00 0.00 H ATOM 12002 HZ2 TRP B 244 77.640 22.266 58.823 1.00 0.00 H ATOM 12003 HH2 TRP B 244 77.283 24.571 59.624 1.00 0.00 H ATOM 12004 HZ3 TRP B 244 75.335 25.890 58.886 1.00 0.00 H ATOM 12005 HE3 TRP B 244 73.679 24.935 57.311 1.00 0.00 H ATOM 12006 H TRP B 244 71.918 20.132 56.003 1.00 0.00 H ATOM 12007 N ILE B 245 69.709 22.182 54.767 1.00 37.90 N ATOM 12008 CA ILE B 245 68.508 22.641 54.087 1.00 36.80 C ATOM 12009 C ILE B 245 67.308 22.674 55.036 1.00 35.98 C ATOM 12010 O ILE B 245 66.525 23.634 55.038 1.00 34.15 O ATOM 12011 CB ILE B 245 68.195 21.749 52.865 1.00 37.39 C ATOM 12012 CG1 ILE B 245 69.240 21.978 51.767 1.00 38.51 C ATOM 12013 CG2 ILE B 245 66.781 22.001 52.347 1.00 36.69 C ATOM 12014 CD1 ILE B 245 68.915 21.281 50.465 1.00 40.52 C ATOM 12015 HA ILE B 245 68.696 23.657 53.741 1.00 0.00 H ATOM 12016 HB ILE B 245 68.244 20.705 53.175 1.00 0.00 H ATOM 12017 HG12 ILE B 245 69.311 23.049 51.576 1.00 0.00 H ATOM 12018 HG13 ILE B 245 70.202 21.610 52.124 1.00 0.00 H ATOM 12019 HD11 ILE B 245 68.852 20.206 50.636 1.00 0.00 H ATOM 12020 HD12 ILE B 245 67.960 21.647 50.087 1.00 0.00 H ATOM 12021 HD13 ILE B 245 69.699 21.489 49.737 1.00 0.00 H ATOM 12022 HG21 ILE B 245 66.062 21.778 53.135 1.00 0.00 H ATOM 12023 HG22 ILE B 245 66.685 23.045 52.050 1.00 0.00 H ATOM 12024 HG23 ILE B 245 66.591 21.359 51.487 1.00 0.00 H ATOM 12025 H ILE B 245 70.152 21.294 54.456 1.00 0.00 H ATOM 12026 N ALA B 246 67.169 21.621 55.839 1.00 34.40 N ATOM 12027 CA ALA B 246 66.097 21.545 56.819 1.00 34.54 C ATOM 12028 C ALA B 246 66.248 22.656 57.852 1.00 33.07 C ATOM 12029 O ALA B 246 65.266 23.277 58.249 1.00 33.93 O ATOM 12030 CB ALA B 246 66.085 20.179 57.493 1.00 33.39 C ATOM 12031 HA ALA B 246 65.145 21.678 56.306 1.00 0.00 H ATOM 12032 HB1 ALA B 246 65.933 19.405 56.740 1.00 0.00 H ATOM 12033 HB2 ALA B 246 67.038 20.015 57.997 1.00 0.00 H ATOM 12034 HB3 ALA B 246 65.276 20.142 58.223 1.00 0.00 H ATOM 12035 H ALA B 246 67.844 20.833 55.764 1.00 0.00 H ATOM 12036 N ALA B 247 67.486 22.902 58.269 1.00 32.72 N ATOM 12037 CA ALA B 247 67.791 23.896 59.294 1.00 32.84 C ATOM 12038 C ALA B 247 67.558 25.335 58.839 1.00 33.22 C ATOM 12039 O ALA B 247 67.082 26.163 59.614 1.00 33.54 O ATOM 12040 CB ALA B 247 69.225 23.724 59.779 1.00 31.07 C ATOM 12041 HA ALA B 247 67.094 23.717 60.113 1.00 0.00 H ATOM 12042 HB1 ALA B 247 69.348 22.726 60.200 1.00 0.00 H ATOM 12043 HB2 ALA B 247 69.909 23.853 58.940 1.00 0.00 H ATOM 12044 HB3 ALA B 247 69.441 24.471 60.543 1.00 0.00 H ATOM 12045 H ALA B 247 68.270 22.364 57.848 1.00 0.00 H ATOM 12046 N VAL B 248 67.901 25.631 57.587 1.00 33.07 N ATOM 12047 CA VAL B 248 67.728 26.969 57.042 1.00 32.02 C ATOM 12048 C VAL B 248 66.255 27.221 56.755 1.00 33.09 C ATOM 12049 O VAL B 248 65.754 28.325 56.964 1.00 33.15 O ATOM 12050 CB VAL B 248 68.564 27.174 55.761 1.00 32.42 C ATOM 12051 CG1 VAL B 248 68.219 28.498 55.102 1.00 30.86 C ATOM 12052 CG2 VAL B 248 70.052 27.101 56.084 1.00 31.39 C ATOM 12053 HA VAL B 248 68.082 27.685 57.784 1.00 0.00 H ATOM 12054 HB VAL B 248 68.325 26.376 55.059 1.00 0.00 H ATOM 12055 HG11 VAL B 248 67.161 28.507 54.839 1.00 0.00 H ATOM 12056 HG12 VAL B 248 68.429 29.313 55.795 1.00 0.00 H ATOM 12057 HG13 VAL B 248 68.820 28.622 54.201 1.00 0.00 H ATOM 12058 HG21 VAL B 248 70.305 27.880 56.804 1.00 0.00 H ATOM 12059 HG22 VAL B 248 70.283 26.124 56.508 1.00 0.00 H ATOM 12060 HG23 VAL B 248 70.628 27.247 55.171 1.00 0.00 H ATOM 12061 H VAL B 248 68.303 24.886 56.983 1.00 0.00 H ATOM 12062 N GLY B 249 65.564 26.189 56.276 1.00 32.76 N ATOM 12063 CA GLY B 249 64.130 26.293 56.028 1.00 32.23 C ATOM 12064 C GLY B 249 63.359 26.554 57.313 1.00 30.12 C ATOM 12065 O GLY B 249 62.371 27.285 57.313 1.00 30.52 O ATOM 12066 HA3 GLY B 249 63.778 25.360 55.587 1.00 0.00 H ATOM 12067 HA2 GLY B 249 63.949 27.113 55.333 1.00 0.00 H ATOM 12068 H GLY B 249 66.054 25.294 56.075 1.00 0.00 H ATOM 12069 N GLN B 250 63.806 25.944 58.410 1.00 30.25 N ATOM 12070 CA GLN B 250 63.144 26.127 59.705 1.00 29.17 C ATOM 12071 C GLN B 250 63.416 27.539 60.208 1.00 28.73 C ATOM 12072 O GLN B 250 62.499 28.227 60.673 1.00 28.09 O ATOM 12073 CB GLN B 250 63.599 25.072 60.722 1.00 29.45 C ATOM 12074 CG GLN B 250 63.005 25.253 62.130 1.00 30.90 C ATOM 12075 CD GLN B 250 61.480 25.285 62.133 1.00 31.75 C ATOM 12076 OE1 GLN B 250 60.830 24.623 61.328 1.00 31.63 O ATOM 12077 NE2 GLN B 250 60.907 26.059 63.047 1.00 32.49 N ATOM 12078 HA GLN B 250 62.070 25.994 59.578 1.00 0.00 H ATOM 12079 HB2 GLN B 250 63.305 24.090 60.351 1.00 0.00 H ATOM 12080 HB3 GLN B 250 64.685 25.119 60.801 1.00 0.00 H ATOM 12081 HG2 GLN B 250 63.337 24.425 62.757 1.00 0.00 H ATOM 12082 HG3 GLN B 250 63.373 26.191 62.545 1.00 0.00 H ATOM 12083 HE22 GLN B 250 61.495 26.603 63.710 1.00 0.00 H ATOM 12084 HE21 GLN B 250 59.870 26.121 63.100 1.00 0.00 H ATOM 12085 H GLN B 250 64.640 25.326 58.346 1.00 0.00 H ATOM 12086 N ILE B 251 64.672 27.969 60.097 1.00 26.69 N ATOM 12087 CA ILE B 251 65.049 29.338 60.459 1.00 27.20 C ATOM 12088 C ILE B 251 64.186 30.361 59.715 1.00 26.43 C ATOM 12089 O ILE B 251 63.648 31.274 60.333 1.00 25.62 O ATOM 12090 CB ILE B 251 66.547 29.610 60.224 1.00 26.95 C ATOM 12091 CG1 ILE B 251 67.391 28.952 61.322 1.00 26.51 C ATOM 12092 CG2 ILE B 251 66.817 31.115 60.172 1.00 27.51 C ATOM 12093 CD1 ILE B 251 67.121 29.496 62.724 1.00 28.00 C ATOM 12094 HA ILE B 251 64.866 29.446 61.528 1.00 0.00 H ATOM 12095 HB ILE B 251 66.829 29.176 59.265 1.00 0.00 H ATOM 12096 HG12 ILE B 251 67.180 27.883 61.322 1.00 0.00 H ATOM 12097 HG13 ILE B 251 68.443 29.113 61.088 1.00 0.00 H ATOM 12098 HD11 ILE B 251 67.339 30.564 62.746 1.00 0.00 H ATOM 12099 HD12 ILE B 251 66.074 29.332 62.981 1.00 0.00 H ATOM 12100 HD13 ILE B 251 67.758 28.979 63.442 1.00 0.00 H ATOM 12101 HG21 ILE B 251 66.244 31.558 59.357 1.00 0.00 H ATOM 12102 HG22 ILE B 251 66.518 31.569 61.117 1.00 0.00 H ATOM 12103 HG23 ILE B 251 67.880 31.287 60.005 1.00 0.00 H ATOM 12104 H ILE B 251 65.402 27.318 59.745 1.00 0.00 H ATOM 12105 N PHE B 252 64.038 30.208 58.398 1.00 25.51 N ATOM 12106 CA PHE B 252 63.156 31.109 57.653 1.00 26.72 C ATOM 12107 C PHE B 252 61.742 31.043 58.199 1.00 26.86 C ATOM 12108 O PHE B 252 61.169 32.059 58.577 1.00 28.36 O ATOM 12109 CB PHE B 252 63.114 30.761 56.154 1.00 27.07 C ATOM 12110 CG PHE B 252 64.150 31.462 55.334 1.00 27.82 C ATOM 12111 CD1 PHE B 252 63.858 32.668 54.712 1.00 28.49 C ATOM 12112 CD2 PHE B 252 65.416 30.921 55.178 1.00 27.85 C ATOM 12113 CE1 PHE B 252 64.816 33.332 53.944 1.00 28.42 C ATOM 12114 CE2 PHE B 252 66.377 31.576 54.410 1.00 29.27 C ATOM 12115 CZ PHE B 252 66.073 32.783 53.795 1.00 28.82 C ATOM 12116 HA PHE B 252 63.561 32.114 57.772 1.00 0.00 H ATOM 12117 HB2 PHE B 252 63.263 29.686 56.048 1.00 0.00 H ATOM 12118 HB3 PHE B 252 62.131 31.031 55.767 1.00 0.00 H ATOM 12119 HD2 PHE B 252 65.662 29.975 55.660 1.00 0.00 H ATOM 12120 HE2 PHE B 252 67.369 31.140 54.292 1.00 0.00 H ATOM 12121 HZ PHE B 252 66.826 33.296 53.196 1.00 0.00 H ATOM 12122 HE1 PHE B 252 64.572 34.280 53.464 1.00 0.00 H ATOM 12123 HD1 PHE B 252 62.865 33.103 54.825 1.00 0.00 H ATOM 12124 H PHE B 252 64.548 29.450 57.901 1.00 0.00 H ATOM 12125 N PHE B 253 61.178 29.838 58.227 1.00 27.09 N ATOM 12126 CA PHE B 253 59.786 29.675 58.630 1.00 27.52 C ATOM 12127 C PHE B 253 59.578 30.238 60.026 1.00 26.96 C ATOM 12128 O PHE B 253 58.592 30.933 60.279 1.00 25.97 O ATOM 12129 CB PHE B 253 59.356 28.201 58.584 1.00 27.68 C ATOM 12130 CG PHE B 253 57.864 28.006 58.672 1.00 29.11 C ATOM 12131 CD1 PHE B 253 57.102 27.877 57.520 1.00 28.01 C ATOM 12132 CD2 PHE B 253 57.222 27.957 59.913 1.00 29.12 C ATOM 12133 CE1 PHE B 253 55.727 27.709 57.596 1.00 29.85 C ATOM 12134 CE2 PHE B 253 55.855 27.784 59.999 1.00 28.61 C ATOM 12135 CZ PHE B 253 55.099 27.659 58.843 1.00 29.72 C ATOM 12136 HA PHE B 253 59.165 30.226 57.923 1.00 0.00 H ATOM 12137 HB2 PHE B 253 59.706 27.768 57.647 1.00 0.00 H ATOM 12138 HB3 PHE B 253 59.822 27.679 59.420 1.00 0.00 H ATOM 12139 HD2 PHE B 253 57.809 28.057 60.826 1.00 0.00 H ATOM 12140 HE2 PHE B 253 55.370 27.746 60.975 1.00 0.00 H ATOM 12141 HZ PHE B 253 54.020 27.522 58.907 1.00 0.00 H ATOM 12142 HE1 PHE B 253 55.137 27.616 56.684 1.00 0.00 H ATOM 12143 HD1 PHE B 253 57.589 27.908 56.545 1.00 0.00 H ATOM 12144 H PHE B 253 61.736 29.003 57.958 1.00 0.00 H ATOM 12145 N THR B 254 60.514 29.948 60.925 1.00 26.54 N ATOM 12146 CA THR B 254 60.334 30.307 62.330 1.00 27.81 C ATOM 12147 C THR B 254 60.419 31.808 62.575 1.00 27.13 C ATOM 12148 O THR B 254 59.617 32.359 63.330 1.00 27.61 O ATOM 12149 CB THR B 254 61.276 29.521 63.306 1.00 27.33 C ATOM 12150 OG1 THR B 254 60.767 29.638 64.641 1.00 30.10 O ATOM 12151 CG2 THR B 254 62.700 30.041 63.275 1.00 27.37 C ATOM 12152 HA THR B 254 59.316 29.996 62.563 1.00 0.00 H ATOM 12153 HB THR B 254 61.295 28.480 62.982 1.00 0.00 H ATOM 12154 HG1 THR B 254 61.358 29.143 65.263 1.00 0.00 H ATOM 12155 HG23 THR B 254 63.095 29.955 62.263 1.00 0.00 H ATOM 12156 HG21 THR B 254 62.710 31.086 63.583 1.00 0.00 H ATOM 12157 HG22 THR B 254 63.315 29.454 63.957 1.00 0.00 H ATOM 12158 H THR B 254 61.383 29.461 60.625 1.00 0.00 H ATOM 12159 N LEU B 255 61.370 32.473 61.932 1.00 28.14 N ATOM 12160 CA LEU B 255 61.523 33.912 62.127 1.00 26.93 C ATOM 12161 C LEU B 255 60.602 34.735 61.221 1.00 27.74 C ATOM 12162 O LEU B 255 60.712 35.959 61.182 1.00 27.90 O ATOM 12163 CB LEU B 255 62.983 34.318 61.947 1.00 25.58 C ATOM 12164 CG LEU B 255 63.917 33.786 63.031 1.00 25.23 C ATOM 12165 CD1 LEU B 255 65.346 34.068 62.685 1.00 24.83 C ATOM 12166 CD2 LEU B 255 63.562 34.404 64.382 1.00 25.18 C ATOM 12167 HA LEU B 255 61.219 34.133 63.150 1.00 0.00 H ATOM 12168 HB2 LEU B 255 63.327 33.941 60.984 1.00 0.00 H ATOM 12169 HB3 LEU B 255 63.039 35.407 61.951 1.00 0.00 H ATOM 12170 HG LEU B 255 63.790 32.705 63.096 1.00 0.00 H ATOM 12171 HD21 LEU B 255 63.664 35.488 64.322 1.00 0.00 H ATOM 12172 HD22 LEU B 255 62.534 34.148 64.638 1.00 0.00 H ATOM 12173 HD23 LEU B 255 64.236 34.016 65.146 1.00 0.00 H ATOM 12174 HD11 LEU B 255 65.592 33.584 61.740 1.00 0.00 H ATOM 12175 HD12 LEU B 255 65.490 35.144 62.592 1.00 0.00 H ATOM 12176 HD13 LEU B 255 65.992 33.680 63.472 1.00 0.00 H ATOM 12177 H LEU B 255 62.009 31.967 61.286 1.00 0.00 H ATOM 12178 N SER B 256 59.694 34.063 60.511 1.00 26.88 N ATOM 12179 CA SER B 256 58.749 34.726 59.586 1.00 27.88 C ATOM 12180 C SER B 256 59.434 35.445 58.413 1.00 27.11 C ATOM 12181 O SER B 256 58.883 36.397 57.858 1.00 28.20 O ATOM 12182 CB SER B 256 57.864 35.731 60.331 1.00 28.52 C ATOM 12183 OG SER B 256 57.050 35.102 61.312 1.00 32.62 O ATOM 12184 HA SER B 256 58.144 33.920 59.170 1.00 0.00 H ATOM 12185 HB2 SER B 256 57.220 36.235 59.610 1.00 0.00 H ATOM 12186 HB3 SER B 256 58.502 36.466 60.822 1.00 0.00 H ATOM 12187 HG SER B 256 56.497 35.785 61.767 1.00 0.00 H ATOM 12188 H SER B 256 59.649 33.029 60.612 1.00 0.00 H ATOM 12189 N LEU B 257 60.624 34.994 58.038 1.00 27.72 N ATOM 12190 CA LEU B 257 61.413 35.680 57.011 1.00 27.31 C ATOM 12191 C LEU B 257 61.157 35.158 55.602 1.00 26.72 C ATOM 12192 O LEU B 257 61.077 33.943 55.382 1.00 25.26 O ATOM 12193 CB LEU B 257 62.904 35.554 57.319 1.00 26.51 C ATOM 12194 CG LEU B 257 63.382 36.103 58.666 1.00 27.64 C ATOM 12195 CD1 LEU B 257 64.796 35.617 58.959 1.00 26.90 C ATOM 12196 CD2 LEU B 257 63.300 37.614 58.694 1.00 27.88 C ATOM 12197 HA LEU B 257 61.098 36.723 57.037 1.00 0.00 H ATOM 12198 HB2 LEU B 257 63.159 34.495 57.286 1.00 0.00 H ATOM 12199 HB3 LEU B 257 63.448 36.082 56.536 1.00 0.00 H ATOM 12200 HG LEU B 257 62.724 35.727 59.450 1.00 0.00 H ATOM 12201 HD21 LEU B 257 63.929 38.025 57.904 1.00 0.00 H ATOM 12202 HD22 LEU B 257 62.267 37.924 58.536 1.00 0.00 H ATOM 12203 HD23 LEU B 257 63.645 37.977 59.662 1.00 0.00 H ATOM 12204 HD11 LEU B 257 64.805 34.528 58.993 1.00 0.00 H ATOM 12205 HD12 LEU B 257 65.468 35.962 58.173 1.00 0.00 H ATOM 12206 HD13 LEU B 257 65.124 36.015 59.920 1.00 0.00 H ATOM 12207 H LEU B 257 61.005 34.135 58.483 1.00 0.00 H ATOM 12208 N GLY B 258 61.045 36.084 54.654 1.00 25.86 N ATOM 12209 CA GLY B 258 60.836 35.732 53.261 1.00 25.13 C ATOM 12210 C GLY B 258 59.364 35.688 52.904 1.00 26.58 C ATOM 12211 O GLY B 258 59.011 35.299 51.792 1.00 24.20 O ATOM 12212 HA3 GLY B 258 61.273 34.751 53.076 1.00 0.00 H ATOM 12213 HA2 GLY B 258 61.329 36.473 52.632 1.00 0.00 H ATOM 12214 H GLY B 258 61.109 37.088 54.918 1.00 0.00 H ATOM 12215 N PHE B 259 58.507 36.096 53.844 1.00 25.86 N ATOM 12216 CA PHE B 259 57.059 36.061 53.650 1.00 26.04 C ATOM 12217 C PHE B 259 56.502 37.463 53.401 1.00 27.48 C ATOM 12218 O PHE B 259 55.289 37.636 53.301 1.00 27.66 O ATOM 12219 CB PHE B 259 56.325 35.517 54.888 1.00 25.26 C ATOM 12220 CG PHE B 259 56.641 34.088 55.255 1.00 23.92 C ATOM 12221 CD1 PHE B 259 55.773 33.060 54.907 1.00 23.54 C ATOM 12222 CD2 PHE B 259 57.775 33.775 55.995 1.00 22.68 C ATOM 12223 CE1 PHE B 259 56.041 31.746 55.263 1.00 23.48 C ATOM 12224 CE2 PHE B 259 58.051 32.453 56.353 1.00 21.63 C ATOM 12225 CZ PHE B 259 57.191 31.441 55.990 1.00 22.19 C ATOM 12226 HA PHE B 259 56.893 35.410 52.792 1.00 0.00 H ATOM 12227 HB2 PHE B 259 56.586 36.148 55.738 1.00 0.00 H ATOM 12228 HB3 PHE B 259 55.253 35.587 54.701 1.00 0.00 H ATOM 12229 HD2 PHE B 259 58.456 34.569 56.299 1.00 0.00 H ATOM 12230 HE2 PHE B 259 58.951 32.222 56.922 1.00 0.00 H ATOM 12231 HZ PHE B 259 57.407 30.410 56.269 1.00 0.00 H ATOM 12232 HE1 PHE B 259 55.352 30.952 54.974 1.00 0.00 H ATOM 12233 HD1 PHE B 259 54.867 33.290 54.346 1.00 0.00 H ATOM 12234 H PHE B 259 58.884 36.451 54.746 1.00 0.00 H ATOM 12235 N GLY B 260 57.379 38.463 53.321 1.00 27.45 N ATOM 12236 CA GLY B 260 56.952 39.854 53.167 1.00 28.85 C ATOM 12237 C GLY B 260 56.208 40.403 54.383 1.00 28.84 C ATOM 12238 O GLY B 260 55.670 41.505 54.337 1.00 29.63 O ATOM 12239 HA3 GLY B 260 56.293 39.919 52.301 1.00 0.00 H ATOM 12240 HA2 GLY B 260 57.835 40.469 52.996 1.00 0.00 H ATOM 12241 H GLY B 260 58.396 38.249 53.369 1.00 0.00 H ATOM 12242 N ALA B 261 56.194 39.643 55.475 1.00 27.70 N ATOM 12243 CA ALA B 261 55.337 39.953 56.627 1.00 28.32 C ATOM 12244 C ALA B 261 56.038 40.715 57.751 1.00 26.66 C ATOM 12245 O ALA B 261 55.411 41.506 58.443 1.00 25.72 O ATOM 12246 CB ALA B 261 54.708 38.679 57.170 1.00 27.18 C ATOM 12247 HA ALA B 261 54.567 40.626 56.250 1.00 0.00 H ATOM 12248 HB1 ALA B 261 54.105 38.212 56.391 1.00 0.00 H ATOM 12249 HB2 ALA B 261 55.494 37.992 57.483 1.00 0.00 H ATOM 12250 HB3 ALA B 261 54.075 38.923 58.023 1.00 0.00 H ATOM 12251 H ALA B 261 56.808 38.805 55.514 1.00 0.00 H ATOM 12252 N ILE B 262 57.327 40.445 57.938 1.00 27.16 N ATOM 12253 CA ILE B 262 58.151 41.241 58.837 1.00 27.75 C ATOM 12254 C ILE B 262 58.282 42.646 58.239 1.00 27.94 C ATOM 12255 O ILE B 262 58.282 43.643 58.953 1.00 28.40 O ATOM 12256 CB ILE B 262 59.557 40.620 59.029 1.00 27.17 C ATOM 12257 CG1 ILE B 262 59.483 39.316 59.831 1.00 27.02 C ATOM 12258 CG2 ILE B 262 60.501 41.607 59.709 1.00 26.97 C ATOM 12259 CD1 ILE B 262 59.138 39.489 61.306 1.00 28.27 C ATOM 12260 HA ILE B 262 57.677 41.275 59.818 1.00 0.00 H ATOM 12261 HB ILE B 262 59.952 40.389 58.040 1.00 0.00 H ATOM 12262 HG12 ILE B 262 58.722 38.681 59.377 1.00 0.00 H ATOM 12263 HG13 ILE B 262 60.452 38.822 59.765 1.00 0.00 H ATOM 12264 HD11 ILE B 262 59.896 40.110 61.785 1.00 0.00 H ATOM 12265 HD12 ILE B 262 58.163 39.969 61.396 1.00 0.00 H ATOM 12266 HD13 ILE B 262 59.109 38.512 61.788 1.00 0.00 H ATOM 12267 HG21 ILE B 262 60.594 42.502 59.094 1.00 0.00 H ATOM 12268 HG22 ILE B 262 60.100 41.877 60.686 1.00 0.00 H ATOM 12269 HG23 ILE B 262 61.481 41.145 59.831 1.00 0.00 H ATOM 12270 H ILE B 262 57.757 39.646 57.430 1.00 0.00 H ATOM 12271 N ILE B 263 58.383 42.702 56.913 1.00 28.87 N ATOM 12272 CA ILE B 263 58.462 43.955 56.178 1.00 29.54 C ATOM 12273 C ILE B 263 57.246 44.811 56.483 1.00 29.41 C ATOM 12274 O ILE B 263 57.370 45.951 56.931 1.00 28.15 O ATOM 12275 CB ILE B 263 58.478 43.713 54.650 1.00 30.41 C ATOM 12276 CG1 ILE B 263 59.511 42.653 54.258 1.00 32.00 C ATOM 12277 CG2 ILE B 263 58.706 45.020 53.898 1.00 30.01 C ATOM 12278 CD1 ILE B 263 60.843 43.187 53.882 1.00 33.26 C ATOM 12279 HA ILE B 263 59.383 44.450 56.485 1.00 0.00 H ATOM 12280 HB ILE B 263 57.500 43.327 54.363 1.00 0.00 H ATOM 12281 HG12 ILE B 263 59.643 41.979 55.105 1.00 0.00 H ATOM 12282 HG13 ILE B 263 59.118 42.095 53.408 1.00 0.00 H ATOM 12283 HD11 ILE B 263 60.737 43.854 53.026 1.00 0.00 H ATOM 12284 HD12 ILE B 263 61.263 43.738 54.724 1.00 0.00 H ATOM 12285 HD13 ILE B 263 61.504 42.360 53.621 1.00 0.00 H ATOM 12286 HG21 ILE B 263 57.904 45.719 54.136 1.00 0.00 H ATOM 12287 HG22 ILE B 263 59.663 45.448 54.197 1.00 0.00 H ATOM 12288 HG23 ILE B 263 58.713 44.824 52.826 1.00 0.00 H ATOM 12289 H ILE B 263 58.406 41.810 56.378 1.00 0.00 H ATOM 12290 N THR B 264 56.069 44.245 56.239 1.00 28.15 N ATOM 12291 CA THR B 264 54.813 44.958 56.440 1.00 28.24 C ATOM 12292 C THR B 264 54.605 45.462 57.870 1.00 28.78 C ATOM 12293 O THR B 264 54.185 46.595 58.066 1.00 27.48 O ATOM 12294 CB THR B 264 53.614 44.090 56.011 1.00 28.74 C ATOM 12295 OG1 THR B 264 53.734 43.801 54.609 1.00 28.61 O ATOM 12296 CG2 THR B 264 52.319 44.826 56.261 1.00 27.18 C ATOM 12297 HA THR B 264 54.877 45.842 55.806 1.00 0.00 H ATOM 12298 HB THR B 264 53.609 43.166 56.590 1.00 0.00 H ATOM 12299 HG1 THR B 264 53.737 44.649 54.098 1.00 0.00 H ATOM 12300 HG23 THR B 264 52.227 45.046 57.325 1.00 0.00 H ATOM 12301 HG21 THR B 264 52.317 45.757 55.695 1.00 0.00 H ATOM 12302 HG22 THR B 264 51.482 44.204 55.943 1.00 0.00 H ATOM 12303 H THR B 264 56.043 43.264 55.894 1.00 0.00 H ATOM 12304 N TYR B 265 54.892 44.620 58.862 1.00 28.72 N ATOM 12305 CA TYR B 265 54.801 45.040 60.258 1.00 28.55 C ATOM 12306 C TYR B 265 55.727 46.214 60.514 1.00 29.69 C ATOM 12307 O TYR B 265 55.343 47.183 61.156 1.00 31.89 O ATOM 12308 CB TYR B 265 55.166 43.888 61.197 1.00 26.58 C ATOM 12309 CG TYR B 265 53.977 43.127 61.737 1.00 26.42 C ATOM 12310 CD1 TYR B 265 52.818 42.979 60.986 1.00 25.28 C ATOM 12311 CD2 TYR B 265 54.023 42.543 62.996 1.00 25.82 C ATOM 12312 CE1 TYR B 265 51.731 42.270 61.483 1.00 24.62 C ATOM 12313 CE2 TYR B 265 52.944 41.834 63.502 1.00 24.32 C ATOM 12314 CZ TYR B 265 51.806 41.703 62.742 1.00 24.03 C ATOM 12315 OH TYR B 265 50.746 40.993 63.246 1.00 23.74 O ATOM 12316 HA TYR B 265 53.772 45.341 60.454 1.00 0.00 H ATOM 12317 HB3 TYR B 265 55.722 44.297 62.041 1.00 0.00 H ATOM 12318 HB2 TYR B 265 55.800 43.189 60.651 1.00 0.00 H ATOM 12319 HD2 TYR B 265 54.926 42.644 63.599 1.00 0.00 H ATOM 12320 HE2 TYR B 265 52.998 41.385 64.494 1.00 0.00 H ATOM 12321 HE1 TYR B 265 50.826 42.162 60.885 1.00 0.00 H ATOM 12322 HD1 TYR B 265 52.760 43.425 59.993 1.00 0.00 H ATOM 12323 HH TYR B 265 51.031 40.063 63.429 1.00 0.00 H ATOM 12324 H TYR B 265 55.186 43.648 58.639 1.00 0.00 H ATOM 12325 N ALA B 266 56.947 46.121 59.995 1.00 31.58 N ATOM 12326 CA ALA B 266 57.959 47.146 60.215 1.00 33.85 C ATOM 12327 C ALA B 266 57.608 48.467 59.532 1.00 34.60 C ATOM 12328 O ALA B 266 58.121 49.518 59.904 1.00 35.87 O ATOM 12329 CB ALA B 266 59.322 46.650 59.758 1.00 34.05 C ATOM 12330 HA ALA B 266 57.992 47.343 61.287 1.00 0.00 H ATOM 12331 HB1 ALA B 266 59.591 45.757 60.323 1.00 0.00 H ATOM 12332 HB2 ALA B 266 59.283 46.411 58.695 1.00 0.00 H ATOM 12333 HB3 ALA B 266 60.066 47.428 59.929 1.00 0.00 H ATOM 12334 H ALA B 266 57.186 45.292 59.415 1.00 0.00 H ATOM 12335 N SER B 267 56.721 48.422 58.545 1.00 34.53 N ATOM 12336 CA SER B 267 56.327 49.644 57.850 1.00 34.26 C ATOM 12337 C SER B 267 55.426 50.526 58.718 1.00 34.64 C ATOM 12338 O SER B 267 55.056 51.626 58.310 1.00 33.80 O ATOM 12339 CB SER B 267 55.623 49.321 56.535 1.00 31.61 C ATOM 12340 OG SER B 267 54.297 48.902 56.779 1.00 30.81 O ATOM 12341 HA SER B 267 57.241 50.198 57.637 1.00 0.00 H ATOM 12342 HB2 SER B 267 56.164 48.525 56.023 1.00 0.00 H ATOM 12343 HB3 SER B 267 55.609 50.211 55.906 1.00 0.00 H ATOM 12344 HG SER B 267 54.308 48.092 57.348 1.00 0.00 H ATOM 12345 H SER B 267 56.304 47.511 58.265 1.00 0.00 H ATOM 12346 N TYR B 268 55.066 50.035 59.903 1.00 35.86 N ATOM 12347 CA TYR B 268 54.279 50.827 60.852 1.00 35.44 C ATOM 12348 C TYR B 268 55.167 51.342 61.983 1.00 35.43 C ATOM 12349 O TYR B 268 54.696 51.991 62.917 1.00 35.42 O ATOM 12350 CB TYR B 268 53.089 50.032 61.382 1.00 34.09 C ATOM 12351 CG TYR B 268 52.193 49.530 60.269 1.00 35.41 C ATOM 12352 CD1 TYR B 268 51.361 50.408 59.572 1.00 34.21 C ATOM 12353 CD2 TYR B 268 52.182 48.186 59.907 1.00 33.73 C ATOM 12354 CE1 TYR B 268 50.547 49.963 58.550 1.00 34.63 C ATOM 12355 CE2 TYR B 268 51.364 47.731 58.882 1.00 34.41 C ATOM 12356 CZ TYR B 268 50.550 48.621 58.209 1.00 34.52 C ATOM 12357 OH TYR B 268 49.739 48.183 57.191 1.00 33.17 O ATOM 12358 HA TYR B 268 53.874 51.692 60.326 1.00 0.00 H ATOM 12359 HB3 TYR B 268 52.504 50.673 62.041 1.00 0.00 H ATOM 12360 HB2 TYR B 268 53.461 49.177 61.946 1.00 0.00 H ATOM 12361 HD2 TYR B 268 52.824 47.481 60.435 1.00 0.00 H ATOM 12362 HE2 TYR B 268 51.364 46.676 58.609 1.00 0.00 H ATOM 12363 HE1 TYR B 268 49.906 50.664 58.015 1.00 0.00 H ATOM 12364 HD1 TYR B 268 51.354 51.465 59.840 1.00 0.00 H ATOM 12365 HH TYR B 268 49.229 48.948 56.824 1.00 0.00 H ATOM 12366 H TYR B 268 55.350 49.068 60.160 1.00 0.00 H ATOM 12367 N VAL B 269 56.456 51.037 61.889 1.00 35.34 N ATOM 12368 CA VAL B 269 57.449 51.588 62.795 1.00 37.64 C ATOM 12369 C VAL B 269 57.785 52.999 62.306 1.00 39.93 C ATOM 12370 O VAL B 269 57.986 53.213 61.105 1.00 40.65 O ATOM 12371 CB VAL B 269 58.715 50.717 62.830 1.00 36.97 C ATOM 12372 CG1 VAL B 269 59.770 51.311 63.764 1.00 37.13 C ATOM 12373 CG2 VAL B 269 58.370 49.292 63.257 1.00 35.62 C ATOM 12374 HA VAL B 269 57.052 51.615 63.810 1.00 0.00 H ATOM 12375 HB VAL B 269 59.132 50.692 61.823 1.00 0.00 H ATOM 12376 HG11 VAL B 269 60.042 52.307 63.416 1.00 0.00 H ATOM 12377 HG12 VAL B 269 59.364 51.376 64.774 1.00 0.00 H ATOM 12378 HG13 VAL B 269 60.653 50.672 63.766 1.00 0.00 H ATOM 12379 HG21 VAL B 269 57.923 49.310 64.251 1.00 0.00 H ATOM 12380 HG22 VAL B 269 57.663 48.863 62.547 1.00 0.00 H ATOM 12381 HG23 VAL B 269 59.278 48.690 63.276 1.00 0.00 H ATOM 12382 H VAL B 269 56.765 50.382 61.142 1.00 0.00 H ATOM 12383 N ARG B 270 57.831 53.960 63.225 1.00 41.73 N ATOM 12384 CA ARG B 270 58.106 55.356 62.862 1.00 44.26 C ATOM 12385 C ARG B 270 59.495 55.520 62.257 1.00 45.18 C ATOM 12386 O ARG B 270 60.450 54.868 62.679 1.00 44.23 O ATOM 12387 CB ARG B 270 57.910 56.291 64.061 1.00 44.72 C ATOM 12388 CG ARG B 270 56.465 56.409 64.481 1.00 45.66 C ATOM 12389 CD ARG B 270 56.264 57.423 65.591 1.00 47.88 C ATOM 12390 NE ARG B 270 54.846 57.557 65.936 1.00 48.68 N ATOM 12391 CZ ARG B 270 54.004 58.400 65.341 1.00 48.60 C ATOM 12392 NH1 ARG B 270 54.425 59.195 64.364 1.00 48.79 N ATOM 12393 NH2 ARG B 270 52.734 58.448 65.725 1.00 48.56 N ATOM 12394 HA ARG B 270 57.384 55.638 62.096 1.00 0.00 H ATOM 12395 HB2 ARG B 270 58.487 55.905 64.902 1.00 0.00 H ATOM 12396 HB3 ARG B 270 58.277 57.282 63.794 1.00 0.00 H ATOM 12397 HG2 ARG B 270 55.873 56.713 63.618 1.00 0.00 H ATOM 12398 HG3 ARG B 270 56.121 55.435 64.830 1.00 0.00 H ATOM 12399 HD2 ARG B 270 56.643 58.391 65.262 1.00 0.00 H ATOM 12400 HD3 ARG B 270 56.816 57.099 66.473 1.00 0.00 H ATOM 12401 HE ARG B 270 54.472 56.954 66.696 1.00 0.00 H ATOM 12402 HH12 ARG B 270 53.761 59.851 63.904 1.00 0.00 H ATOM 12403 HH11 ARG B 270 55.419 59.162 64.058 1.00 0.00 H ATOM 12404 HH22 ARG B 270 52.075 59.106 65.261 1.00 0.00 H ATOM 12405 HH21 ARG B 270 52.398 57.828 66.489 1.00 0.00 H ATOM 12406 H ARG B 270 57.669 53.717 64.223 1.00 0.00 H ATOM 12407 N LYS B 271 59.581 56.406 61.269 1.00 46.80 N ATOM 12408 CA LYS B 271 60.769 56.575 60.425 1.00 48.71 C ATOM 12409 C LYS B 271 62.127 56.541 61.133 1.00 49.93 C ATOM 12410 O LYS B 271 63.087 55.990 60.590 1.00 50.00 O ATOM 12411 CB LYS B 271 60.633 57.857 59.594 1.00 50.36 C ATOM 12412 CG LYS B 271 61.773 58.109 58.623 1.00 52.83 C ATOM 12413 CD LYS B 271 61.483 59.298 57.709 1.00 55.02 C ATOM 12414 CE LYS B 271 61.045 60.528 58.502 1.00 56.51 C ATOM 12415 NZ LYS B 271 62.075 60.968 59.489 1.00 57.63 N ATOM 12416 HA LYS B 271 60.784 55.686 59.794 1.00 0.00 H ATOM 12417 HB2 LYS B 271 59.707 57.794 59.022 1.00 0.00 H ATOM 12418 HB3 LYS B 271 60.578 58.702 60.280 1.00 0.00 H ATOM 12419 HG2 LYS B 271 62.682 58.312 59.190 1.00 0.00 H ATOM 12420 HG3 LYS B 271 61.919 57.219 58.010 1.00 0.00 H ATOM 12421 HD2 LYS B 271 62.386 59.542 57.149 1.00 0.00 H ATOM 12422 HD3 LYS B 271 60.689 59.024 57.014 1.00 0.00 H ATOM 12423 HE2 LYS B 271 60.126 60.290 59.038 1.00 0.00 H ATOM 12424 HE3 LYS B 271 60.857 61.345 57.805 1.00 0.00 H ATOM 12425 HZ1 LYS B 271 62.257 60.199 60.165 1.00 0.00 H ATOM 12426 HZ2 LYS B 271 62.955 61.206 58.988 1.00 0.00 H ATOM 12427 HZ3 LYS B 271 61.729 61.805 60.000 1.00 0.00 H ATOM 12428 H LYS B 271 58.758 57.015 61.084 1.00 0.00 H ATOM 12429 N ASP B 272 62.215 57.116 62.330 1.00 50.22 N ATOM 12430 CA ASP B 272 63.495 57.183 63.038 1.00 51.27 C ATOM 12431 C ASP B 272 63.574 56.245 64.240 1.00 49.81 C ATOM 12432 O ASP B 272 64.597 56.186 64.918 1.00 49.84 O ATOM 12433 CB ASP B 272 63.791 58.624 63.474 1.00 53.52 C ATOM 12434 CG ASP B 272 63.983 59.563 62.294 1.00 55.15 C ATOM 12435 OD1 ASP B 272 64.898 59.317 61.477 1.00 55.88 O ATOM 12436 OD2 ASP B 272 63.218 60.548 62.187 1.00 56.01 O ATOM 12437 HA ASP B 272 64.253 56.847 62.330 1.00 0.00 H ATOM 12438 HB2 ASP B 272 62.957 58.985 64.076 1.00 0.00 H ATOM 12439 HB3 ASP B 272 64.700 58.628 64.075 1.00 0.00 H ATOM 12440 H ASP B 272 61.364 57.523 62.768 1.00 0.00 H ATOM 12441 N GLN B 273 62.489 55.521 64.499 1.00 48.00 N ATOM 12442 CA GLN B 273 62.422 54.567 65.603 1.00 46.49 C ATOM 12443 C GLN B 273 63.408 53.410 65.397 1.00 45.54 C ATOM 12444 O GLN B 273 63.657 52.996 64.260 1.00 45.42 O ATOM 12445 CB GLN B 273 60.989 54.054 65.742 1.00 47.31 C ATOM 12446 CG GLN B 273 60.693 53.278 66.999 1.00 47.64 C ATOM 12447 CD GLN B 273 59.215 52.978 67.153 1.00 49.07 C ATOM 12448 OE1 GLN B 273 58.367 53.567 66.472 1.00 49.62 O ATOM 12449 NE2 GLN B 273 58.894 52.057 68.056 1.00 49.01 N ATOM 12450 HA GLN B 273 62.709 55.071 66.526 1.00 0.00 H ATOM 12451 HB2 GLN B 273 60.321 54.914 65.714 1.00 0.00 H ATOM 12452 HB3 GLN B 273 60.781 53.406 64.891 1.00 0.00 H ATOM 12453 HG2 GLN B 273 61.241 52.336 66.968 1.00 0.00 H ATOM 12454 HG3 GLN B 273 61.024 53.861 67.858 1.00 0.00 H ATOM 12455 HE22 GLN B 273 59.640 51.586 68.607 1.00 0.00 H ATOM 12456 HE21 GLN B 273 57.897 51.807 68.212 1.00 0.00 H ATOM 12457 H GLN B 273 61.654 55.639 63.890 1.00 0.00 H ATOM 12458 N ASP B 274 63.975 52.908 66.495 1.00 43.06 N ATOM 12459 CA ASP B 274 64.969 51.828 66.445 1.00 42.50 C ATOM 12460 C ASP B 274 64.422 50.542 65.834 1.00 41.75 C ATOM 12461 O ASP B 274 63.248 50.202 66.016 1.00 40.23 O ATOM 12462 CB ASP B 274 65.525 51.538 67.847 1.00 42.90 C ATOM 12463 CG ASP B 274 66.123 50.136 67.978 1.00 43.90 C ATOM 12464 OD1 ASP B 274 67.344 49.977 67.778 1.00 44.01 O ATOM 12465 OD2 ASP B 274 65.370 49.184 68.279 1.00 44.81 O ATOM 12466 HA ASP B 274 65.770 52.181 65.795 1.00 0.00 H ATOM 12467 HB2 ASP B 274 66.302 52.269 68.070 1.00 0.00 H ATOM 12468 HB3 ASP B 274 64.715 51.639 68.569 1.00 0.00 H ATOM 12469 H ASP B 274 63.703 53.296 67.421 1.00 0.00 H ATOM 12470 N ILE B 275 65.287 49.843 65.102 1.00 39.73 N ATOM 12471 CA ILE B 275 64.947 48.533 64.562 1.00 38.92 C ATOM 12472 C ILE B 275 66.061 47.528 64.838 1.00 39.11 C ATOM 12473 O ILE B 275 65.847 46.325 64.733 1.00 39.23 O ATOM 12474 CB ILE B 275 64.644 48.561 63.038 1.00 38.18 C ATOM 12475 CG1 ILE B 275 65.879 48.968 62.245 1.00 37.64 C ATOM 12476 CG2 ILE B 275 63.441 49.448 62.725 1.00 36.68 C ATOM 12477 CD1 ILE B 275 65.674 48.945 60.763 1.00 38.99 C ATOM 12478 HA ILE B 275 64.034 48.226 65.072 1.00 0.00 H ATOM 12479 HB ILE B 275 64.379 47.550 62.728 1.00 0.00 H ATOM 12480 HG12 ILE B 275 66.160 49.980 62.539 1.00 0.00 H ATOM 12481 HG13 ILE B 275 66.689 48.282 62.492 1.00 0.00 H ATOM 12482 HD11 ILE B 275 65.404 47.936 60.450 1.00 0.00 H ATOM 12483 HD12 ILE B 275 64.874 49.636 60.497 1.00 0.00 H ATOM 12484 HD13 ILE B 275 66.596 49.246 60.265 1.00 0.00 H ATOM 12485 HG21 ILE B 275 62.563 49.065 63.246 1.00 0.00 H ATOM 12486 HG22 ILE B 275 63.646 50.466 63.056 1.00 0.00 H ATOM 12487 HG23 ILE B 275 63.258 49.444 61.650 1.00 0.00 H ATOM 12488 H ILE B 275 66.228 50.242 64.911 1.00 0.00 H ATOM 12489 N VAL B 276 67.249 48.020 65.192 1.00 39.45 N ATOM 12490 CA VAL B 276 68.368 47.128 65.466 1.00 39.09 C ATOM 12491 C VAL B 276 68.118 46.315 66.742 1.00 40.40 C ATOM 12492 O VAL B 276 68.175 45.083 66.713 1.00 41.37 O ATOM 12493 CB VAL B 276 69.722 47.866 65.566 1.00 38.31 C ATOM 12494 CG1 VAL B 276 70.843 46.860 65.731 1.00 38.06 C ATOM 12495 CG2 VAL B 276 69.971 48.713 64.331 1.00 37.61 C ATOM 12496 HA VAL B 276 68.434 46.454 64.612 1.00 0.00 H ATOM 12497 HB VAL B 276 69.691 48.524 66.434 1.00 0.00 H ATOM 12498 HG11 VAL B 276 70.679 46.281 66.640 1.00 0.00 H ATOM 12499 HG12 VAL B 276 70.859 46.191 64.871 1.00 0.00 H ATOM 12500 HG13 VAL B 276 71.795 47.387 65.801 1.00 0.00 H ATOM 12501 HG21 VAL B 276 69.985 48.072 63.449 1.00 0.00 H ATOM 12502 HG22 VAL B 276 69.176 49.452 64.232 1.00 0.00 H ATOM 12503 HG23 VAL B 276 70.930 49.221 64.428 1.00 0.00 H ATOM 12504 H VAL B 276 67.378 49.049 65.273 1.00 0.00 H ATOM 12505 N LEU B 277 67.837 47.001 67.850 1.00 39.19 N ATOM 12506 CA LEU B 277 67.591 46.322 69.117 1.00 38.37 C ATOM 12507 C LEU B 277 66.231 45.645 69.126 1.00 37.97 C ATOM 12508 O LEU B 277 66.088 44.522 69.618 1.00 37.02 O ATOM 12509 CB LEU B 277 67.688 47.286 70.303 1.00 38.18 C ATOM 12510 CG LEU B 277 67.513 46.589 71.656 1.00 38.39 C ATOM 12511 CD1 LEU B 277 68.648 45.594 71.880 1.00 38.52 C ATOM 12512 CD2 LEU B 277 67.431 47.594 72.806 1.00 38.91 C ATOM 12513 HA LEU B 277 68.366 45.563 69.220 1.00 0.00 H ATOM 12514 HB2 LEU B 277 68.667 47.765 70.283 1.00 0.00 H ATOM 12515 HB3 LEU B 277 66.912 48.044 70.199 1.00 0.00 H ATOM 12516 HG LEU B 277 66.567 46.048 71.638 1.00 0.00 H ATOM 12517 HD21 LEU B 277 68.348 48.182 72.839 1.00 0.00 H ATOM 12518 HD22 LEU B 277 66.579 48.256 72.648 1.00 0.00 H ATOM 12519 HD23 LEU B 277 67.307 47.058 73.747 1.00 0.00 H ATOM 12520 HD11 LEU B 277 68.636 44.847 71.086 1.00 0.00 H ATOM 12521 HD12 LEU B 277 69.601 46.123 71.869 1.00 0.00 H ATOM 12522 HD13 LEU B 277 68.515 45.104 72.844 1.00 0.00 H ATOM 12523 H LEU B 277 67.792 48.039 67.810 1.00 0.00 H ATOM 12524 N SER B 278 65.236 46.347 68.597 1.00 38.14 N ATOM 12525 CA SER B 278 63.892 45.818 68.487 1.00 38.70 C ATOM 12526 C SER B 278 63.900 44.540 67.656 1.00 38.80 C ATOM 12527 O SER B 278 63.275 43.552 68.029 1.00 39.48 O ATOM 12528 CB SER B 278 62.953 46.856 67.867 1.00 38.94 C ATOM 12529 OG SER B 278 62.746 47.946 68.751 1.00 40.26 O ATOM 12530 HA SER B 278 63.526 45.584 69.487 1.00 0.00 H ATOM 12531 HB2 SER B 278 61.994 46.385 67.650 1.00 0.00 H ATOM 12532 HB3 SER B 278 63.392 47.226 66.941 1.00 0.00 H ATOM 12533 HG SER B 278 63.614 48.379 68.948 1.00 0.00 H ATOM 12534 H SER B 278 65.428 47.308 68.250 1.00 0.00 H ATOM 12535 N GLY B 279 64.618 44.570 66.537 1.00 38.03 N ATOM 12536 CA GLY B 279 64.697 43.419 65.647 1.00 39.67 C ATOM 12537 C GLY B 279 65.359 42.233 66.314 1.00 40.25 C ATOM 12538 O GLY B 279 64.817 41.122 66.314 1.00 40.11 O ATOM 12539 HA3 GLY B 279 65.274 43.695 64.765 1.00 0.00 H ATOM 12540 HA2 GLY B 279 63.688 43.136 65.346 1.00 0.00 H ATOM 12541 H GLY B 279 65.136 45.437 66.291 1.00 0.00 H ATOM 12542 N LEU B 280 66.537 42.472 66.882 1.00 39.97 N ATOM 12543 CA LEU B 280 67.281 41.437 67.579 1.00 41.15 C ATOM 12544 C LEU B 280 66.454 40.826 68.713 1.00 41.12 C ATOM 12545 O LEU B 280 66.451 39.608 68.900 1.00 41.43 O ATOM 12546 CB LEU B 280 68.594 42.009 68.118 1.00 42.40 C ATOM 12547 CG LEU B 280 69.519 41.086 68.913 1.00 43.37 C ATOM 12548 CD1 LEU B 280 69.885 39.851 68.112 1.00 43.27 C ATOM 12549 CD2 LEU B 280 70.778 41.840 69.338 1.00 44.40 C ATOM 12550 HA LEU B 280 67.506 40.641 66.869 1.00 0.00 H ATOM 12551 HB2 LEU B 280 69.162 42.375 67.262 1.00 0.00 H ATOM 12552 HB3 LEU B 280 68.338 42.846 68.767 1.00 0.00 H ATOM 12553 HG LEU B 280 68.985 40.758 69.805 1.00 0.00 H ATOM 12554 HD21 LEU B 280 71.303 42.196 68.452 1.00 0.00 H ATOM 12555 HD22 LEU B 280 70.498 42.689 69.961 1.00 0.00 H ATOM 12556 HD23 LEU B 280 71.427 41.171 69.903 1.00 0.00 H ATOM 12557 HD11 LEU B 280 68.978 39.301 67.860 1.00 0.00 H ATOM 12558 HD12 LEU B 280 70.396 40.151 67.197 1.00 0.00 H ATOM 12559 HD13 LEU B 280 70.543 39.216 68.706 1.00 0.00 H ATOM 12560 H LEU B 280 66.938 43.430 66.826 1.00 0.00 H ATOM 12561 N THR B 281 65.751 41.676 69.457 1.00 40.71 N ATOM 12562 CA THR B 281 64.948 41.222 70.588 1.00 40.67 C ATOM 12563 C THR B 281 63.778 40.337 70.141 1.00 40.21 C ATOM 12564 O THR B 281 63.517 39.301 70.743 1.00 40.16 O ATOM 12565 CB THR B 281 64.418 42.408 71.430 1.00 41.01 C ATOM 12566 OG1 THR B 281 65.519 43.226 71.850 1.00 40.82 O ATOM 12567 CG2 THR B 281 63.666 41.909 72.659 1.00 41.22 C ATOM 12568 HA THR B 281 65.612 40.624 71.213 1.00 0.00 H ATOM 12569 HB THR B 281 63.733 42.989 70.813 1.00 0.00 H ATOM 12570 HG1 THR B 281 65.994 43.572 71.053 1.00 0.00 H ATOM 12571 HG23 THR B 281 62.829 41.287 72.343 1.00 0.00 H ATOM 12572 HG21 THR B 281 64.341 41.323 73.283 1.00 0.00 H ATOM 12573 HG22 THR B 281 63.293 42.762 73.226 1.00 0.00 H ATOM 12574 H THR B 281 65.774 42.690 69.227 1.00 0.00 H ATOM 12575 N ALA B 282 63.074 40.745 69.088 1.00 40.05 N ATOM 12576 CA ALA B 282 61.947 39.950 68.591 1.00 39.27 C ATOM 12577 C ALA B 282 62.422 38.575 68.118 1.00 38.50 C ATOM 12578 O ALA B 282 61.733 37.571 68.320 1.00 38.43 O ATOM 12579 CB ALA B 282 61.218 40.679 67.484 1.00 39.36 C ATOM 12580 HA ALA B 282 61.247 39.803 69.414 1.00 0.00 H ATOM 12581 HB1 ALA B 282 60.838 41.627 67.864 1.00 0.00 H ATOM 12582 HB2 ALA B 282 61.906 40.866 66.659 1.00 0.00 H ATOM 12583 HB3 ALA B 282 60.387 40.067 67.134 1.00 0.00 H ATOM 12584 H ALA B 282 63.326 41.636 68.613 1.00 0.00 H ATOM 12585 N ALA B 283 63.602 38.546 67.504 1.00 36.71 N ATOM 12586 CA ALA B 283 64.201 37.313 66.995 1.00 37.08 C ATOM 12587 C ALA B 283 64.707 36.394 68.115 1.00 37.78 C ATOM 12588 O ALA B 283 64.543 35.176 68.043 1.00 37.51 O ATOM 12589 CB ALA B 283 65.326 37.637 66.029 1.00 35.28 C ATOM 12590 HA ALA B 283 63.415 36.769 66.471 1.00 0.00 H ATOM 12591 HB1 ALA B 283 64.931 38.214 65.193 1.00 0.00 H ATOM 12592 HB2 ALA B 283 66.090 38.219 66.545 1.00 0.00 H ATOM 12593 HB3 ALA B 283 65.763 36.710 65.658 1.00 0.00 H ATOM 12594 H ALA B 283 64.121 39.439 67.381 1.00 0.00 H ATOM 12595 N THR B 284 65.332 36.977 69.135 1.00 37.49 N ATOM 12596 CA THR B 284 65.784 36.204 70.294 1.00 37.60 C ATOM 12597 C THR B 284 64.582 35.669 71.076 1.00 36.08 C ATOM 12598 O THR B 284 64.596 34.537 71.535 1.00 38.55 O ATOM 12599 CB THR B 284 66.713 37.020 71.216 1.00 38.53 C ATOM 12600 OG1 THR B 284 66.115 38.290 71.484 1.00 40.76 O ATOM 12601 CG2 THR B 284 68.066 37.241 70.552 1.00 37.53 C ATOM 12602 HA THR B 284 66.368 35.364 69.917 1.00 0.00 H ATOM 12603 HB THR B 284 66.858 36.467 72.144 1.00 0.00 H ATOM 12604 HG1 THR B 284 65.981 38.777 70.632 1.00 0.00 H ATOM 12605 HG23 THR B 284 68.529 36.276 70.344 1.00 0.00 H ATOM 12606 HG21 THR B 284 67.927 37.787 69.619 1.00 0.00 H ATOM 12607 HG22 THR B 284 68.707 37.817 71.219 1.00 0.00 H ATOM 12608 H THR B 284 65.503 38.003 69.109 1.00 0.00 H ATOM 12609 N LEU B 285 63.536 36.475 71.212 1.00 33.78 N ATOM 12610 CA LEU B 285 62.318 36.008 71.850 1.00 33.45 C ATOM 12611 C LEU B 285 61.773 34.748 71.156 1.00 34.61 C ATOM 12612 O LEU B 285 61.438 33.758 71.816 1.00 32.38 O ATOM 12613 CB LEU B 285 61.252 37.101 71.853 1.00 34.37 C ATOM 12614 CG LEU B 285 61.383 38.217 72.891 1.00 34.98 C ATOM 12615 CD1 LEU B 285 60.324 39.281 72.644 1.00 34.19 C ATOM 12616 CD2 LEU B 285 61.279 37.666 74.320 1.00 35.46 C ATOM 12617 HA LEU B 285 62.566 35.755 72.881 1.00 0.00 H ATOM 12618 HB2 LEU B 285 61.262 37.569 70.868 1.00 0.00 H ATOM 12619 HB3 LEU B 285 60.289 36.617 72.015 1.00 0.00 H ATOM 12620 HG LEU B 285 62.369 38.669 72.786 1.00 0.00 H ATOM 12621 HD21 LEU B 285 60.312 37.181 74.452 1.00 0.00 H ATOM 12622 HD22 LEU B 285 62.076 36.941 74.487 1.00 0.00 H ATOM 12623 HD23 LEU B 285 61.376 38.486 75.032 1.00 0.00 H ATOM 12624 HD11 LEU B 285 60.457 39.700 71.646 1.00 0.00 H ATOM 12625 HD12 LEU B 285 59.334 38.831 72.722 1.00 0.00 H ATOM 12626 HD13 LEU B 285 60.425 40.072 73.388 1.00 0.00 H ATOM 12627 H LEU B 285 63.589 37.451 70.858 1.00 0.00 H ATOM 12628 N ASN B 286 61.687 34.790 69.829 1.00 30.90 N ATOM 12629 CA ASN B 286 61.258 33.623 69.076 1.00 30.57 C ATOM 12630 C ASN B 286 62.163 32.408 69.278 1.00 30.34 C ATOM 12631 O ASN B 286 61.684 31.279 69.433 1.00 30.34 O ATOM 12632 CB ASN B 286 61.197 33.922 67.588 1.00 29.47 C ATOM 12633 CG ASN B 286 60.821 32.705 66.791 1.00 28.64 C ATOM 12634 OD1 ASN B 286 59.644 32.349 66.709 1.00 30.14 O ATOM 12635 ND2 ASN B 286 61.812 32.048 66.213 1.00 27.69 N ATOM 12636 HA ASN B 286 60.267 33.383 69.461 1.00 0.00 H ATOM 12637 HB2 ASN B 286 60.455 34.701 67.414 1.00 0.00 H ATOM 12638 HB3 ASN B 286 62.175 34.273 67.258 1.00 0.00 H ATOM 12639 HD22 ASN B 286 62.789 32.389 66.312 1.00 0.00 H ATOM 12640 HD21 ASN B 286 61.614 31.190 65.659 1.00 0.00 H ATOM 12641 H ASN B 286 61.929 35.667 69.325 1.00 0.00 H ATOM 12642 N GLU B 287 63.468 32.633 69.270 1.00 30.29 N ATOM 12643 CA GLU B 287 64.395 31.525 69.430 1.00 32.59 C ATOM 12644 C GLU B 287 64.258 30.841 70.784 1.00 33.77 C ATOM 12645 O GLU B 287 64.431 29.628 70.885 1.00 34.22 O ATOM 12646 CB GLU B 287 65.835 31.966 69.195 1.00 32.61 C ATOM 12647 CG GLU B 287 66.097 32.322 67.749 1.00 34.79 C ATOM 12648 CD GLU B 287 65.537 31.287 66.784 1.00 34.57 C ATOM 12649 OE1 GLU B 287 65.984 30.124 66.819 1.00 34.15 O ATOM 12650 OE2 GLU B 287 64.651 31.642 65.986 1.00 36.67 O ATOM 12651 HA GLU B 287 64.131 30.791 68.669 1.00 0.00 H ATOM 12652 HB2 GLU B 287 66.040 32.839 69.814 1.00 0.00 H ATOM 12653 HB3 GLU B 287 66.502 31.154 69.483 1.00 0.00 H ATOM 12654 HG2 GLU B 287 65.634 33.286 67.536 1.00 0.00 H ATOM 12655 HG3 GLU B 287 67.174 32.396 67.596 1.00 0.00 H ATOM 12656 H GLU B 287 63.829 33.601 69.149 1.00 0.00 H ATOM 12657 N LYS B 288 63.950 31.614 71.822 1.00 34.14 N ATOM 12658 CA LYS B 288 63.764 31.053 73.156 1.00 34.55 C ATOM 12659 C LYS B 288 62.483 30.232 73.200 1.00 34.65 C ATOM 12660 O LYS B 288 62.459 29.120 73.730 1.00 36.00 O ATOM 12661 CB LYS B 288 63.733 32.160 74.218 1.00 34.65 C ATOM 12662 CG LYS B 288 65.082 32.836 74.448 1.00 35.49 C ATOM 12663 CD LYS B 288 64.983 33.953 75.484 1.00 36.11 C ATOM 12664 CE LYS B 288 66.322 34.652 75.669 1.00 36.06 C ATOM 12665 NZ LYS B 288 66.231 35.800 76.615 1.00 37.38 N ATOM 12666 HA LYS B 288 64.609 30.401 73.378 1.00 0.00 H ATOM 12667 HB2 LYS B 288 63.018 32.919 73.901 1.00 0.00 H ATOM 12668 HB3 LYS B 288 63.403 31.723 75.160 1.00 0.00 H ATOM 12669 HG2 LYS B 288 65.796 32.091 74.798 1.00 0.00 H ATOM 12670 HG3 LYS B 288 65.432 33.257 73.506 1.00 0.00 H ATOM 12671 HD2 LYS B 288 64.244 34.682 75.152 1.00 0.00 H ATOM 12672 HD3 LYS B 288 64.669 33.528 76.437 1.00 0.00 H ATOM 12673 HE2 LYS B 288 66.663 35.020 74.701 1.00 0.00 H ATOM 12674 HE3 LYS B 288 67.043 33.933 76.057 1.00 0.00 H ATOM 12675 HZ1 LYS B 288 65.550 36.496 76.249 1.00 0.00 H ATOM 12676 HZ2 LYS B 288 65.913 35.458 77.544 1.00 0.00 H ATOM 12677 HZ3 LYS B 288 67.166 36.245 76.709 1.00 0.00 H ATOM 12678 H LYS B 288 63.840 32.638 71.680 1.00 0.00 H ATOM 12679 N ALA B 289 61.416 30.789 72.638 1.00 33.13 N ATOM 12680 CA ALA B 289 60.147 30.088 72.572 1.00 33.45 C ATOM 12681 C ALA B 289 60.291 28.809 71.745 1.00 33.65 C ATOM 12682 O ALA B 289 59.575 27.830 71.969 1.00 34.99 O ATOM 12683 CB ALA B 289 59.072 30.987 71.980 1.00 33.06 C ATOM 12684 HA ALA B 289 59.847 29.816 73.584 1.00 0.00 H ATOM 12685 HB1 ALA B 289 58.956 31.873 72.605 1.00 0.00 H ATOM 12686 HB2 ALA B 289 59.364 31.287 70.974 1.00 0.00 H ATOM 12687 HB3 ALA B 289 58.128 30.444 71.939 1.00 0.00 H ATOM 12688 H ALA B 289 61.491 31.746 72.238 1.00 0.00 H ATOM 12689 N GLU B 290 61.224 28.820 70.793 1.00 32.89 N ATOM 12690 CA GLU B 290 61.443 27.665 69.925 1.00 32.10 C ATOM 12691 C GLU B 290 62.312 26.575 70.555 1.00 32.42 C ATOM 12692 O GLU B 290 61.859 25.450 70.725 1.00 31.33 O ATOM 12693 CB GLU B 290 62.026 28.099 68.573 1.00 32.36 C ATOM 12694 CG GLU B 290 62.364 26.948 67.648 1.00 31.62 C ATOM 12695 CD GLU B 290 61.962 27.222 66.206 1.00 32.45 C ATOM 12696 OE1 GLU B 290 62.844 27.170 65.320 1.00 33.10 O ATOM 12697 OE2 GLU B 290 60.764 27.490 65.956 1.00 30.31 O ATOM 12698 HA GLU B 290 60.460 27.221 69.771 1.00 0.00 H ATOM 12699 HB2 GLU B 290 61.296 28.737 68.074 1.00 0.00 H ATOM 12700 HB3 GLU B 290 62.937 28.668 68.759 1.00 0.00 H ATOM 12701 HG2 GLU B 290 63.439 26.774 67.684 1.00 0.00 H ATOM 12702 HG3 GLU B 290 61.841 26.056 67.994 1.00 0.00 H ATOM 12703 H GLU B 290 61.809 29.670 70.665 1.00 0.00 H ATOM 12704 N VAL B 291 63.553 26.897 70.900 1.00 32.50 N ATOM 12705 CA VAL B 291 64.465 25.850 71.353 1.00 36.07 C ATOM 12706 C VAL B 291 64.249 25.443 72.814 1.00 37.36 C ATOM 12707 O VAL B 291 64.478 24.288 73.175 1.00 39.36 O ATOM 12708 CB VAL B 291 65.956 26.210 71.088 1.00 36.36 C ATOM 12709 CG1 VAL B 291 66.168 26.511 69.603 1.00 36.82 C ATOM 12710 CG2 VAL B 291 66.409 27.386 71.954 1.00 36.69 C ATOM 12711 HA VAL B 291 64.219 24.977 70.748 1.00 0.00 H ATOM 12712 HB VAL B 291 66.568 25.351 71.362 1.00 0.00 H ATOM 12713 HG11 VAL B 291 65.901 25.634 69.014 1.00 0.00 H ATOM 12714 HG12 VAL B 291 65.539 27.352 69.311 1.00 0.00 H ATOM 12715 HG13 VAL B 291 67.215 26.761 69.430 1.00 0.00 H ATOM 12716 HG21 VAL B 291 65.797 28.259 71.728 1.00 0.00 H ATOM 12717 HG22 VAL B 291 66.298 27.125 73.006 1.00 0.00 H ATOM 12718 HG23 VAL B 291 67.455 27.610 71.743 1.00 0.00 H ATOM 12719 H VAL B 291 63.873 27.885 70.848 1.00 0.00 H ATOM 12720 N ILE B 292 63.800 26.381 73.644 1.00 38.29 N ATOM 12721 CA ILE B 292 63.615 26.104 75.064 1.00 38.00 C ATOM 12722 C ILE B 292 62.203 25.631 75.374 1.00 38.44 C ATOM 12723 O ILE B 292 62.017 24.649 76.090 1.00 40.00 O ATOM 12724 CB ILE B 292 63.978 27.322 75.925 1.00 38.97 C ATOM 12725 CG1 ILE B 292 65.448 27.700 75.695 1.00 39.25 C ATOM 12726 CG2 ILE B 292 63.700 27.038 77.403 1.00 38.16 C ATOM 12727 CD1 ILE B 292 65.892 28.952 76.427 1.00 41.12 C ATOM 12728 HA ILE B 292 64.297 25.292 75.316 1.00 0.00 H ATOM 12729 HB ILE B 292 63.356 28.167 75.631 1.00 0.00 H ATOM 12730 HG12 ILE B 292 66.071 26.870 76.029 1.00 0.00 H ATOM 12731 HG13 ILE B 292 65.597 27.858 74.627 1.00 0.00 H ATOM 12732 HD11 ILE B 292 65.289 29.798 76.096 1.00 0.00 H ATOM 12733 HD12 ILE B 292 65.763 28.809 77.500 1.00 0.00 H ATOM 12734 HD13 ILE B 292 66.942 29.146 76.209 1.00 0.00 H ATOM 12735 HG21 ILE B 292 62.642 26.813 77.536 1.00 0.00 H ATOM 12736 HG22 ILE B 292 64.297 26.185 77.726 1.00 0.00 H ATOM 12737 HG23 ILE B 292 63.964 27.914 77.996 1.00 0.00 H ATOM 12738 H ILE B 292 63.577 27.327 73.274 1.00 0.00 H ATOM 12739 N LEU B 293 61.209 26.325 74.837 1.00 37.16 N ATOM 12740 CA LEU B 293 59.819 25.966 75.084 1.00 36.58 C ATOM 12741 C LEU B 293 59.325 24.893 74.106 1.00 37.57 C ATOM 12742 O LEU B 293 58.956 23.792 74.523 1.00 36.86 O ATOM 12743 CB LEU B 293 58.919 27.210 75.049 1.00 34.74 C ATOM 12744 CG LEU B 293 59.248 28.302 76.075 1.00 35.47 C ATOM 12745 CD1 LEU B 293 58.254 29.460 75.980 1.00 34.30 C ATOM 12746 CD2 LEU B 293 59.291 27.742 77.502 1.00 33.93 C ATOM 12747 HA LEU B 293 59.763 25.536 76.084 1.00 0.00 H ATOM 12748 HB2 LEU B 293 58.996 27.651 74.055 1.00 0.00 H ATOM 12749 HB3 LEU B 293 57.893 26.886 75.223 1.00 0.00 H ATOM 12750 HG LEU B 293 60.242 28.682 75.838 1.00 0.00 H ATOM 12751 HD21 LEU B 293 58.320 27.315 77.753 1.00 0.00 H ATOM 12752 HD22 LEU B 293 60.057 26.969 77.565 1.00 0.00 H ATOM 12753 HD23 LEU B 293 59.527 28.546 78.199 1.00 0.00 H ATOM 12754 HD11 LEU B 293 58.298 29.894 74.981 1.00 0.00 H ATOM 12755 HD12 LEU B 293 57.247 29.090 76.173 1.00 0.00 H ATOM 12756 HD13 LEU B 293 58.511 30.219 76.718 1.00 0.00 H ATOM 12757 H LEU B 293 61.426 27.140 74.229 1.00 0.00 H ATOM 12758 N GLY B 294 59.334 25.210 72.814 1.00 36.23 N ATOM 12759 CA GLY B 294 58.874 24.268 71.799 1.00 35.06 C ATOM 12760 C GLY B 294 59.603 22.942 71.856 1.00 35.89 C ATOM 12761 O GLY B 294 58.986 21.872 71.733 1.00 34.05 O ATOM 12762 HA3 GLY B 294 59.032 24.711 70.816 1.00 0.00 H ATOM 12763 HA2 GLY B 294 57.809 24.087 71.948 1.00 0.00 H ATOM 12764 H GLY B 294 59.676 26.148 72.522 1.00 0.00 H ATOM 12765 N GLY B 295 60.920 23.012 72.046 1.00 34.98 N ATOM 12766 CA GLY B 295 61.763 21.825 72.082 1.00 35.43 C ATOM 12767 C GLY B 295 61.620 20.963 73.326 1.00 36.77 C ATOM 12768 O GLY B 295 61.891 19.757 73.278 1.00 36.59 O ATOM 12769 HA3 GLY B 295 62.802 22.147 72.013 1.00 0.00 H ATOM 12770 HA2 GLY B 295 61.517 21.210 71.216 1.00 0.00 H ATOM 12771 H GLY B 295 61.361 23.945 72.173 1.00 0.00 H ATOM 12772 N SER B 296 61.200 21.574 74.434 1.00 36.81 N ATOM 12773 CA SER B 296 61.086 20.876 75.730 1.00 37.70 C ATOM 12774 C SER B 296 59.725 20.228 75.986 1.00 38.29 C ATOM 12775 O SER B 296 59.536 19.573 77.013 1.00 40.25 O ATOM 12776 CB SER B 296 61.406 21.825 76.894 1.00 36.87 C ATOM 12777 OG SER B 296 62.736 22.299 76.823 1.00 35.92 O ATOM 12778 HA SER B 296 61.817 20.070 75.672 1.00 0.00 H ATOM 12779 HB2 SER B 296 61.269 21.292 77.835 1.00 0.00 H ATOM 12780 HB3 SER B 296 60.724 22.675 76.857 1.00 0.00 H ATOM 12781 HG SER B 296 62.865 22.789 75.973 1.00 0.00 H ATOM 12782 H SER B 296 60.943 22.580 74.384 1.00 0.00 H ATOM 12783 N ILE B 297 58.779 20.410 75.072 1.00 38.28 N ATOM 12784 CA ILE B 297 57.456 19.815 75.246 1.00 38.82 C ATOM 12785 C ILE B 297 57.291 18.473 74.514 1.00 39.90 C ATOM 12786 O ILE B 297 57.276 17.412 75.153 1.00 39.63 O ATOM 12787 CB ILE B 297 56.340 20.793 74.838 1.00 38.10 C ATOM 12788 CG1 ILE B 297 56.428 22.056 75.695 1.00 37.73 C ATOM 12789 CG2 ILE B 297 54.971 20.135 74.966 1.00 37.91 C ATOM 12790 CD1 ILE B 297 55.392 23.117 75.365 1.00 37.91 C ATOM 12791 HA ILE B 297 57.366 19.605 76.312 1.00 0.00 H ATOM 12792 HB ILE B 297 56.473 21.070 73.792 1.00 0.00 H ATOM 12793 HG12 ILE B 297 56.300 21.769 76.739 1.00 0.00 H ATOM 12794 HG13 ILE B 297 57.417 22.492 75.558 1.00 0.00 H ATOM 12795 HD11 ILE B 297 55.511 23.429 74.327 1.00 0.00 H ATOM 12796 HD12 ILE B 297 54.393 22.705 75.509 1.00 0.00 H ATOM 12797 HD13 ILE B 297 55.531 23.975 76.022 1.00 0.00 H ATOM 12798 HG21 ILE B 297 54.928 19.260 74.317 1.00 0.00 H ATOM 12799 HG22 ILE B 297 54.811 19.830 76.000 1.00 0.00 H ATOM 12800 HG23 ILE B 297 54.199 20.846 74.672 1.00 0.00 H ATOM 12801 H ILE B 297 58.981 20.980 74.226 1.00 0.00 H ATOM 12802 N SER B 298 57.178 18.530 73.189 1.00 39.49 N ATOM 12803 CA SER B 298 56.858 17.357 72.356 1.00 40.70 C ATOM 12804 C SER B 298 57.856 16.216 72.400 1.00 39.62 C ATOM 12805 O SER B 298 57.477 15.077 72.641 1.00 39.93 O ATOM 12806 CB SER B 298 56.664 17.772 70.891 1.00 41.46 C ATOM 12807 OG SER B 298 55.416 18.406 70.713 1.00 44.51 O ATOM 12808 HA SER B 298 55.939 16.972 72.798 1.00 0.00 H ATOM 12809 HB2 SER B 298 56.709 16.885 70.259 1.00 0.00 H ATOM 12810 HB3 SER B 298 57.459 18.461 70.606 1.00 0.00 H ATOM 12811 HG SER B 298 55.311 18.665 69.763 1.00 0.00 H ATOM 12812 H SER B 298 57.322 19.446 72.719 1.00 0.00 H ATOM 12813 N ILE B 299 59.123 16.522 72.144 1.00 40.18 N ATOM 12814 CA ILE B 299 60.164 15.502 72.109 1.00 40.86 C ATOM 12815 C ILE B 299 60.343 14.806 73.471 1.00 40.56 C ATOM 12816 O ILE B 299 60.206 13.584 73.546 1.00 41.43 O ATOM 12817 CB ILE B 299 61.520 16.060 71.570 1.00 41.98 C ATOM 12818 CG1 ILE B 299 61.411 16.397 70.079 1.00 42.88 C ATOM 12819 CG2 ILE B 299 62.660 15.070 71.802 1.00 41.90 C ATOM 12820 CD1 ILE B 299 61.004 15.229 69.216 1.00 44.04 C ATOM 12821 HA ILE B 299 59.825 14.744 71.403 1.00 0.00 H ATOM 12822 HB ILE B 299 61.744 16.972 72.123 1.00 0.00 H ATOM 12823 HG12 ILE B 299 60.670 17.187 69.959 1.00 0.00 H ATOM 12824 HG13 ILE B 299 62.382 16.756 69.736 1.00 0.00 H ATOM 12825 HD11 ILE B 299 61.741 14.432 69.314 1.00 0.00 H ATOM 12826 HD12 ILE B 299 60.028 14.864 69.537 1.00 0.00 H ATOM 12827 HD13 ILE B 299 60.949 15.549 68.176 1.00 0.00 H ATOM 12828 HG21 ILE B 299 62.763 14.880 72.870 1.00 0.00 H ATOM 12829 HG22 ILE B 299 62.439 14.136 71.285 1.00 0.00 H ATOM 12830 HG23 ILE B 299 63.589 15.490 71.415 1.00 0.00 H ATOM 12831 H ILE B 299 59.379 17.514 71.964 1.00 0.00 H ATOM 12832 N PRO B 300 60.630 15.573 74.546 1.00 39.24 N ATOM 12833 CA PRO B 300 60.837 14.913 75.841 1.00 38.18 C ATOM 12834 C PRO B 300 59.654 14.046 76.257 1.00 36.84 C ATOM 12835 O PRO B 300 59.852 12.979 76.826 1.00 38.65 O ATOM 12836 CB PRO B 300 61.020 16.086 76.808 1.00 37.67 C ATOM 12837 CG PRO B 300 61.535 17.188 75.945 1.00 38.36 C ATOM 12838 CD PRO B 300 60.782 17.035 74.662 1.00 38.60 C ATOM 12839 HA PRO B 300 61.683 14.226 75.817 1.00 0.00 H ATOM 12840 HD3 PRO B 300 59.811 17.528 74.715 1.00 0.00 H ATOM 12841 HD2 PRO B 300 61.349 17.439 73.823 1.00 0.00 H ATOM 12842 HG3 PRO B 300 62.607 17.080 75.779 1.00 0.00 H ATOM 12843 HG2 PRO B 300 61.334 18.159 76.397 1.00 0.00 H ATOM 12844 HB2 PRO B 300 60.070 16.363 77.265 1.00 0.00 H ATOM 12845 HB3 PRO B 300 61.739 15.837 77.589 1.00 0.00 H ATOM 12846 N ALA B 301 58.437 14.493 75.971 1.00 36.11 N ATOM 12847 CA ALA B 301 57.251 13.699 76.293 1.00 35.75 C ATOM 12848 C ALA B 301 57.205 12.402 75.484 1.00 37.16 C ATOM 12849 O ALA B 301 56.934 11.325 76.032 1.00 38.14 O ATOM 12850 CB ALA B 301 55.989 14.508 76.075 1.00 34.76 C ATOM 12851 HA ALA B 301 57.313 13.429 77.347 1.00 0.00 H ATOM 12852 HB1 ALA B 301 56.008 15.389 76.716 1.00 0.00 H ATOM 12853 HB2 ALA B 301 55.933 14.818 75.031 1.00 0.00 H ATOM 12854 HB3 ALA B 301 55.120 13.897 76.321 1.00 0.00 H ATOM 12855 H ALA B 301 58.325 15.420 75.512 1.00 0.00 H ATOM 12856 N ALA B 302 57.472 12.507 74.183 1.00 37.88 N ATOM 12857 CA ALA B 302 57.458 11.342 73.296 1.00 38.67 C ATOM 12858 C ALA B 302 58.547 10.339 73.666 1.00 38.64 C ATOM 12859 O ALA B 302 58.303 9.139 73.701 1.00 38.92 O ATOM 12860 CB ALA B 302 57.590 11.770 71.835 1.00 37.47 C ATOM 12861 HA ALA B 302 56.496 10.845 73.424 1.00 0.00 H ATOM 12862 HB1 ALA B 302 56.757 12.422 71.572 1.00 0.00 H ATOM 12863 HB2 ALA B 302 58.530 12.305 71.698 1.00 0.00 H ATOM 12864 HB3 ALA B 302 57.577 10.887 71.196 1.00 0.00 H ATOM 12865 H ALA B 302 57.696 13.442 73.787 1.00 0.00 H ATOM 12866 N VAL B 303 59.742 10.845 73.945 1.00 39.35 N ATOM 12867 CA VAL B 303 60.873 10.005 74.311 1.00 41.16 C ATOM 12868 C VAL B 303 60.679 9.357 75.691 1.00 42.25 C ATOM 12869 O VAL B 303 61.130 8.234 75.927 1.00 43.17 O ATOM 12870 CB VAL B 303 62.196 10.810 74.269 1.00 41.06 C ATOM 12871 CG1 VAL B 303 63.350 9.993 74.819 1.00 42.06 C ATOM 12872 CG2 VAL B 303 62.498 11.257 72.847 1.00 41.13 C ATOM 12873 HA VAL B 303 60.932 9.203 73.575 1.00 0.00 H ATOM 12874 HB VAL B 303 62.075 11.692 74.898 1.00 0.00 H ATOM 12875 HG11 VAL B 303 63.140 9.720 75.853 1.00 0.00 H ATOM 12876 HG12 VAL B 303 63.472 9.090 74.221 1.00 0.00 H ATOM 12877 HG13 VAL B 303 64.265 10.584 74.777 1.00 0.00 H ATOM 12878 HG21 VAL B 303 62.593 10.381 72.205 1.00 0.00 H ATOM 12879 HG22 VAL B 303 61.686 11.888 72.486 1.00 0.00 H ATOM 12880 HG23 VAL B 303 63.431 11.821 72.835 1.00 0.00 H ATOM 12881 H VAL B 303 59.875 11.876 73.901 1.00 0.00 H ATOM 12882 N ALA B 304 60.008 10.061 76.596 1.00 42.50 N ATOM 12883 CA ALA B 304 59.779 9.539 77.942 1.00 42.94 C ATOM 12884 C ALA B 304 58.850 8.335 77.903 1.00 44.35 C ATOM 12885 O ALA B 304 58.990 7.411 78.697 1.00 44.43 O ATOM 12886 CB ALA B 304 59.200 10.612 78.840 1.00 42.15 C ATOM 12887 HA ALA B 304 60.740 9.224 78.348 1.00 0.00 H ATOM 12888 HB1 ALA B 304 59.896 11.449 78.899 1.00 0.00 H ATOM 12889 HB2 ALA B 304 58.251 10.956 78.428 1.00 0.00 H ATOM 12890 HB3 ALA B 304 59.038 10.201 79.837 1.00 0.00 H ATOM 12891 H ALA B 304 59.639 11.000 76.342 1.00 0.00 H ATOM 12892 N PHE B 305 57.903 8.350 76.974 1.00 45.04 N ATOM 12893 CA PHE B 305 56.934 7.271 76.865 1.00 45.64 C ATOM 12894 C PHE B 305 57.339 6.160 75.891 1.00 46.01 C ATOM 12895 O PHE B 305 56.953 5.010 76.079 1.00 46.49 O ATOM 12896 CB PHE B 305 55.566 7.831 76.478 1.00 45.49 C ATOM 12897 CG PHE B 305 54.711 8.206 77.651 1.00 46.56 C ATOM 12898 CD1 PHE B 305 55.090 9.225 78.514 1.00 47.00 C ATOM 12899 CD2 PHE B 305 53.514 7.544 77.888 1.00 46.82 C ATOM 12900 CE1 PHE B 305 54.291 9.575 79.605 1.00 47.80 C ATOM 12901 CE2 PHE B 305 52.709 7.886 78.972 1.00 47.61 C ATOM 12902 CZ PHE B 305 53.099 8.906 79.832 1.00 47.00 C ATOM 12903 HA PHE B 305 56.891 6.807 77.850 1.00 0.00 H ATOM 12904 HB2 PHE B 305 55.719 8.720 75.866 1.00 0.00 H ATOM 12905 HB3 PHE B 305 55.038 7.076 75.895 1.00 0.00 H ATOM 12906 HD2 PHE B 305 53.200 6.745 77.216 1.00 0.00 H ATOM 12907 HE2 PHE B 305 51.774 7.354 79.146 1.00 0.00 H ATOM 12908 HZ PHE B 305 52.471 9.178 80.680 1.00 0.00 H ATOM 12909 HE1 PHE B 305 54.605 10.374 80.277 1.00 0.00 H ATOM 12910 HD1 PHE B 305 56.024 9.759 78.338 1.00 0.00 H ATOM 12911 H PHE B 305 57.853 9.149 76.310 1.00 0.00 H ATOM 12912 N PHE B 306 58.117 6.496 74.865 1.00 46.55 N ATOM 12913 CA PHE B 306 58.422 5.531 73.799 1.00 45.62 C ATOM 12914 C PHE B 306 59.907 5.217 73.575 1.00 46.15 C ATOM 12915 O PHE B 306 60.233 4.257 72.876 1.00 45.27 O ATOM 12916 CB PHE B 306 57.824 6.012 72.478 1.00 45.19 C ATOM 12917 CG PHE B 306 56.333 6.195 72.513 1.00 46.25 C ATOM 12918 CD1 PHE B 306 55.484 5.098 72.555 1.00 46.38 C ATOM 12919 CD2 PHE B 306 55.776 7.467 72.486 1.00 46.12 C ATOM 12920 CE1 PHE B 306 54.108 5.269 72.581 1.00 47.34 C ATOM 12921 CE2 PHE B 306 54.403 7.643 72.510 1.00 45.50 C ATOM 12922 CZ PHE B 306 53.569 6.545 72.558 1.00 45.97 C ATOM 12923 HA PHE B 306 57.974 4.600 74.146 1.00 0.00 H ATOM 12924 HB2 PHE B 306 58.281 6.968 72.222 1.00 0.00 H ATOM 12925 HB3 PHE B 306 58.062 5.279 71.707 1.00 0.00 H ATOM 12926 HD2 PHE B 306 56.429 8.339 72.445 1.00 0.00 H ATOM 12927 HE2 PHE B 306 53.981 8.648 72.491 1.00 0.00 H ATOM 12928 HZ PHE B 306 52.488 6.681 72.578 1.00 0.00 H ATOM 12929 HE1 PHE B 306 53.451 4.400 72.620 1.00 0.00 H ATOM 12930 HD1 PHE B 306 55.903 4.092 72.568 1.00 0.00 H ATOM 12931 H PHE B 306 58.515 7.456 74.817 1.00 0.00 H ATOM 12932 N GLY B 307 60.797 6.015 74.154 1.00 46.79 N ATOM 12933 CA GLY B 307 62.234 5.861 73.913 1.00 48.02 C ATOM 12934 C GLY B 307 62.645 6.695 72.712 1.00 49.17 C ATOM 12935 O GLY B 307 61.804 7.052 71.885 1.00 48.58 O ATOM 12936 HA3 GLY B 307 62.459 4.812 73.720 1.00 0.00 H ATOM 12937 HA2 GLY B 307 62.787 6.194 74.792 1.00 0.00 H ATOM 12938 H GLY B 307 60.466 6.766 74.793 1.00 0.00 H ATOM 12939 N VAL B 308 63.938 7.003 72.606 1.00 50.43 N ATOM 12940 CA VAL B 308 64.442 7.874 71.535 1.00 51.09 C ATOM 12941 C VAL B 308 64.097 7.395 70.118 1.00 51.67 C ATOM 12942 O VAL B 308 63.538 8.154 69.323 1.00 52.30 O ATOM 12943 CB VAL B 308 65.975 8.104 71.650 1.00 51.59 C ATOM 12944 CG1 VAL B 308 66.499 8.886 70.456 1.00 51.60 C ATOM 12945 CG2 VAL B 308 66.312 8.836 72.939 1.00 52.35 C ATOM 12946 HA VAL B 308 63.920 8.819 71.685 1.00 0.00 H ATOM 12947 HB VAL B 308 66.459 7.127 71.663 1.00 0.00 H ATOM 12948 HG11 VAL B 308 66.296 8.329 69.541 1.00 0.00 H ATOM 12949 HG12 VAL B 308 66.002 9.855 70.411 1.00 0.00 H ATOM 12950 HG13 VAL B 308 67.574 9.032 70.563 1.00 0.00 H ATOM 12951 HG21 VAL B 308 65.808 9.802 72.949 1.00 0.00 H ATOM 12952 HG22 VAL B 308 65.979 8.242 73.790 1.00 0.00 H ATOM 12953 HG23 VAL B 308 67.390 8.986 72.999 1.00 0.00 H ATOM 12954 H VAL B 308 64.608 6.616 73.301 1.00 0.00 H ATOM 12955 N ALA B 309 64.427 6.138 69.820 1.00 52.12 N ATOM 12956 CA ALA B 309 64.231 5.561 68.483 1.00 51.76 C ATOM 12957 C ALA B 309 62.778 5.569 68.002 1.00 51.47 C ATOM 12958 O ALA B 309 62.511 5.827 66.825 1.00 51.78 O ATOM 12959 CB ALA B 309 64.799 4.143 68.425 1.00 51.81 C ATOM 12960 HA ALA B 309 64.776 6.211 67.799 1.00 0.00 H ATOM 12961 HB1 ALA B 309 65.866 4.171 68.647 1.00 0.00 H ATOM 12962 HB2 ALA B 309 64.290 3.519 69.159 1.00 0.00 H ATOM 12963 HB3 ALA B 309 64.645 3.732 67.427 1.00 0.00 H ATOM 12964 H ALA B 309 64.840 5.541 70.565 1.00 0.00 H ATOM 12965 N ASN B 310 61.843 5.284 68.904 1.00 51.19 N ATOM 12966 CA ASN B 310 60.422 5.304 68.558 1.00 50.90 C ATOM 12967 C ASN B 310 59.901 6.713 68.308 1.00 50.13 C ATOM 12968 O ASN B 310 59.044 6.920 67.445 1.00 48.53 O ATOM 12969 CB ASN B 310 59.578 4.633 69.641 1.00 51.98 C ATOM 12970 CG ASN B 310 59.541 3.125 69.505 1.00 53.55 C ATOM 12971 OD1 ASN B 310 59.660 2.582 68.406 1.00 54.05 O ATOM 12972 ND2 ASN B 310 59.365 2.438 70.629 1.00 53.73 N ATOM 12973 HA ASN B 310 60.330 4.742 67.629 1.00 0.00 H ATOM 12974 HB2 ASN B 310 59.997 4.885 70.615 1.00 0.00 H ATOM 12975 HB3 ASN B 310 58.559 5.014 69.575 1.00 0.00 H ATOM 12976 HD22 ASN B 310 59.269 2.939 71.535 1.00 0.00 H ATOM 12977 HD21 ASN B 310 59.323 1.399 70.602 1.00 0.00 H ATOM 12978 H ASN B 310 62.128 5.042 69.875 1.00 0.00 H ATOM 12979 N ALA B 311 60.425 7.672 69.069 1.00 49.60 N ATOM 12980 CA ALA B 311 60.017 9.070 68.957 1.00 49.00 C ATOM 12981 C ALA B 311 60.397 9.626 67.593 1.00 48.79 C ATOM 12982 O ALA B 311 59.572 10.237 66.909 1.00 48.72 O ATOM 12983 CB ALA B 311 60.651 9.892 70.058 1.00 48.77 C ATOM 12984 HA ALA B 311 58.934 9.125 69.063 1.00 0.00 H ATOM 12985 HB1 ALA B 311 60.335 9.505 71.027 1.00 0.00 H ATOM 12986 HB2 ALA B 311 61.736 9.830 69.977 1.00 0.00 H ATOM 12987 HB3 ALA B 311 60.337 10.931 69.961 1.00 0.00 H ATOM 12988 H ALA B 311 61.151 7.416 69.768 1.00 0.00 H ATOM 12989 N VAL B 312 61.653 9.402 67.209 1.00 48.09 N ATOM 12990 CA VAL B 312 62.166 9.794 65.897 1.00 47.44 C ATOM 12991 C VAL B 312 61.301 9.226 64.769 1.00 47.11 C ATOM 12992 O VAL B 312 61.038 9.913 63.779 1.00 46.85 O ATOM 12993 CB VAL B 312 63.630 9.332 65.712 1.00 47.09 C ATOM 12994 CG1 VAL B 312 64.106 9.586 64.287 1.00 47.26 C ATOM 12995 CG2 VAL B 312 64.537 10.029 66.712 1.00 46.28 C ATOM 12996 HA VAL B 312 62.130 10.882 65.850 1.00 0.00 H ATOM 12997 HB VAL B 312 63.673 8.258 65.895 1.00 0.00 H ATOM 12998 HG11 VAL B 312 63.474 9.035 63.591 1.00 0.00 H ATOM 12999 HG12 VAL B 312 64.045 10.652 64.070 1.00 0.00 H ATOM 13000 HG13 VAL B 312 65.138 9.252 64.185 1.00 0.00 H ATOM 13001 HG21 VAL B 312 64.483 11.107 66.560 1.00 0.00 H ATOM 13002 HG22 VAL B 312 64.213 9.787 67.724 1.00 0.00 H ATOM 13003 HG23 VAL B 312 65.563 9.691 66.567 1.00 0.00 H ATOM 13004 H VAL B 312 62.298 8.927 67.872 1.00 0.00 H ATOM 13005 N ALA B 313 60.862 7.977 64.936 1.00 46.43 N ATOM 13006 CA ALA B 313 60.002 7.305 63.962 1.00 46.41 C ATOM 13007 C ALA B 313 58.627 7.961 63.891 1.00 47.67 C ATOM 13008 O ALA B 313 58.051 8.114 62.806 1.00 47.05 O ATOM 13009 CB ALA B 313 59.864 5.831 64.299 1.00 46.37 C ATOM 13010 HA ALA B 313 60.473 7.400 62.983 1.00 0.00 H ATOM 13011 HB1 ALA B 313 60.848 5.363 64.285 1.00 0.00 H ATOM 13012 HB2 ALA B 313 59.425 5.726 65.291 1.00 0.00 H ATOM 13013 HB3 ALA B 313 59.221 5.350 63.562 1.00 0.00 H ATOM 13014 H ALA B 313 61.143 7.460 65.794 1.00 0.00 H ATOM 13015 N ILE B 314 58.106 8.343 65.055 1.00 48.53 N ATOM 13016 CA ILE B 314 56.839 9.060 65.138 1.00 49.91 C ATOM 13017 C ILE B 314 56.934 10.399 64.407 1.00 49.84 C ATOM 13018 O ILE B 314 56.081 10.725 63.583 1.00 50.68 O ATOM 13019 CB ILE B 314 56.410 9.281 66.609 1.00 50.55 C ATOM 13020 CG1 ILE B 314 55.959 7.954 67.234 1.00 50.84 C ATOM 13021 CG2 ILE B 314 55.303 10.332 66.698 1.00 50.29 C ATOM 13022 CD1 ILE B 314 55.952 7.945 68.758 1.00 51.24 C ATOM 13023 HA ILE B 314 56.078 8.447 64.655 1.00 0.00 H ATOM 13024 HB ILE B 314 57.268 9.652 67.170 1.00 0.00 H ATOM 13025 HG12 ILE B 314 54.948 7.740 66.887 1.00 0.00 H ATOM 13026 HG13 ILE B 314 56.633 7.169 66.891 1.00 0.00 H ATOM 13027 HD11 ILE B 314 56.959 8.144 69.126 1.00 0.00 H ATOM 13028 HD12 ILE B 314 55.272 8.715 69.121 1.00 0.00 H ATOM 13029 HD13 ILE B 314 55.621 6.969 69.113 1.00 0.00 H ATOM 13030 HG21 ILE B 314 55.666 11.276 66.291 1.00 0.00 H ATOM 13031 HG22 ILE B 314 54.438 9.997 66.125 1.00 0.00 H ATOM 13032 HG23 ILE B 314 55.018 10.470 67.741 1.00 0.00 H ATOM 13033 H ILE B 314 58.619 8.123 65.933 1.00 0.00 H ATOM 13034 N ALA B 315 57.980 11.166 64.704 1.00 49.87 N ATOM 13035 CA ALA B 315 58.193 12.462 64.058 1.00 49.89 C ATOM 13036 C ALA B 315 58.246 12.335 62.538 1.00 50.15 C ATOM 13037 O ALA B 315 57.642 13.137 61.825 1.00 50.24 O ATOM 13038 CB ALA B 315 59.455 13.116 64.584 1.00 49.89 C ATOM 13039 HA ALA B 315 57.341 13.096 64.303 1.00 0.00 H ATOM 13040 HB1 ALA B 315 59.363 13.267 65.660 1.00 0.00 H ATOM 13041 HB2 ALA B 315 60.310 12.472 64.377 1.00 0.00 H ATOM 13042 HB3 ALA B 315 59.596 14.078 64.092 1.00 0.00 H ATOM 13043 H ALA B 315 58.664 10.836 65.414 1.00 0.00 H ATOM 13044 N LYS B 316 58.967 11.322 62.053 1.00 50.04 N ATOM 13045 CA LYS B 316 59.068 11.049 60.618 1.00 50.57 C ATOM 13046 C LYS B 316 57.727 10.650 59.995 1.00 50.68 C ATOM 13047 O LYS B 316 57.529 10.810 58.791 1.00 51.23 O ATOM 13048 CB LYS B 316 60.087 9.936 60.349 1.00 51.23 C ATOM 13049 CG LYS B 316 61.538 10.282 60.656 1.00 51.71 C ATOM 13050 CD LYS B 316 62.453 9.154 60.194 1.00 53.64 C ATOM 13051 CE LYS B 316 63.911 9.386 60.587 1.00 54.02 C ATOM 13052 NZ LYS B 316 64.481 10.623 59.989 1.00 54.65 N ATOM 13053 HA LYS B 316 59.394 11.980 60.155 1.00 0.00 H ATOM 13054 HB2 LYS B 316 59.812 9.075 60.958 1.00 0.00 H ATOM 13055 HB3 LYS B 316 60.022 9.669 59.294 1.00 0.00 H ATOM 13056 HG2 LYS B 316 61.808 11.201 60.136 1.00 0.00 H ATOM 13057 HG3 LYS B 316 61.656 10.425 61.730 1.00 0.00 H ATOM 13058 HD2 LYS B 316 62.113 8.221 60.644 1.00 0.00 H ATOM 13059 HD3 LYS B 316 62.391 9.076 59.109 1.00 0.00 H ATOM 13060 HE2 LYS B 316 64.502 8.533 60.252 1.00 0.00 H ATOM 13061 HE3 LYS B 316 63.971 9.464 61.673 1.00 0.00 H ATOM 13062 HZ1 LYS B 316 64.438 10.557 58.952 1.00 0.00 H ATOM 13063 HZ2 LYS B 316 63.931 11.446 60.308 1.00 0.00 H ATOM 13064 HZ3 LYS B 316 65.471 10.728 60.290 1.00 0.00 H ATOM 13065 H LYS B 316 59.475 10.705 62.718 1.00 0.00 H ATOM 13066 N ALA B 317 56.816 10.135 60.815 1.00 50.90 N ATOM 13067 CA ALA B 317 55.538 9.602 60.330 1.00 51.93 C ATOM 13068 C ALA B 317 54.703 10.644 59.611 1.00 52.02 C ATOM 13069 O ALA B 317 54.032 10.346 58.623 1.00 53.38 O ATOM 13070 CB ALA B 317 54.745 8.986 61.474 1.00 51.55 C ATOM 13071 HA ALA B 317 55.778 8.828 59.601 1.00 0.00 H ATOM 13072 HB1 ALA B 317 55.321 8.174 61.918 1.00 0.00 H ATOM 13073 HB2 ALA B 317 54.547 9.747 62.228 1.00 0.00 H ATOM 13074 HB3 ALA B 317 53.801 8.597 61.092 1.00 0.00 H ATOM 13075 H ALA B 317 57.016 10.109 61.835 1.00 0.00 H ATOM 13076 N GLY B 318 54.745 11.869 60.115 1.00 52.48 N ATOM 13077 CA GLY B 318 54.007 12.961 59.511 1.00 52.35 C ATOM 13078 C GLY B 318 54.319 14.260 60.214 1.00 52.27 C ATOM 13079 O GLY B 318 55.074 14.285 61.188 1.00 53.35 O ATOM 13080 HA3 GLY B 318 52.939 12.759 59.588 1.00 0.00 H ATOM 13081 HA2 GLY B 318 54.285 13.045 58.460 1.00 0.00 H ATOM 13082 H GLY B 318 55.320 12.051 60.962 1.00 0.00 H ATOM 13083 N ALA B 319 53.743 15.347 59.719 1.00 50.86 N ATOM 13084 CA ALA B 319 53.967 16.649 60.331 1.00 48.85 C ATOM 13085 C ALA B 319 53.044 16.876 61.532 1.00 46.42 C ATOM 13086 O ALA B 319 53.414 17.564 62.477 1.00 46.15 O ATOM 13087 CB ALA B 319 53.786 17.755 59.297 1.00 49.16 C ATOM 13088 HA ALA B 319 54.993 16.673 60.699 1.00 0.00 H ATOM 13089 HB1 ALA B 319 54.501 17.613 58.486 1.00 0.00 H ATOM 13090 HB2 ALA B 319 52.772 17.717 58.900 1.00 0.00 H ATOM 13091 HB3 ALA B 319 53.956 18.723 59.768 1.00 0.00 H ATOM 13092 H ALA B 319 53.125 15.269 58.886 1.00 0.00 H ATOM 13093 N PHE B 320 51.849 16.285 61.483 1.00 43.08 N ATOM 13094 CA PHE B 320 50.807 16.521 62.486 1.00 40.11 C ATOM 13095 C PHE B 320 50.648 15.391 63.499 1.00 39.35 C ATOM 13096 O PHE B 320 50.017 15.569 64.540 1.00 39.27 O ATOM 13097 CB PHE B 320 49.474 16.787 61.786 1.00 38.72 C ATOM 13098 CG PHE B 320 49.547 17.863 60.752 1.00 38.47 C ATOM 13099 CD1 PHE B 320 49.724 19.190 61.127 1.00 38.03 C ATOM 13100 CD2 PHE B 320 49.452 17.556 59.404 1.00 37.99 C ATOM 13101 CE1 PHE B 320 49.800 20.188 60.176 1.00 37.88 C ATOM 13102 CE2 PHE B 320 49.528 18.553 58.446 1.00 37.66 C ATOM 13103 CZ PHE B 320 49.703 19.871 58.834 1.00 37.77 C ATOM 13104 HA PHE B 320 51.124 17.392 63.059 1.00 0.00 H ATOM 13105 HB2 PHE B 320 49.148 15.866 61.303 1.00 0.00 H ATOM 13106 HB3 PHE B 320 48.742 17.080 62.538 1.00 0.00 H ATOM 13107 HD2 PHE B 320 49.316 16.520 59.095 1.00 0.00 H ATOM 13108 HE2 PHE B 320 49.450 18.301 57.388 1.00 0.00 H ATOM 13109 HZ PHE B 320 49.764 20.658 58.082 1.00 0.00 H ATOM 13110 HE1 PHE B 320 49.936 21.225 60.483 1.00 0.00 H ATOM 13111 HD1 PHE B 320 49.804 19.445 62.184 1.00 0.00 H ATOM 13112 H PHE B 320 51.649 15.630 60.701 1.00 0.00 H ATOM 13113 N ASN B 321 51.217 14.233 63.181 1.00 38.71 N ATOM 13114 CA ASN B 321 51.194 13.058 64.043 1.00 38.50 C ATOM 13115 C ASN B 321 51.653 13.366 65.478 1.00 36.94 C ATOM 13116 O ASN B 321 50.965 13.039 66.439 1.00 36.76 O ATOM 13117 CB ASN B 321 52.050 11.956 63.397 1.00 41.76 C ATOM 13118 CG ASN B 321 51.996 10.632 64.144 1.00 44.49 C ATOM 13119 OD1 ASN B 321 51.892 10.593 65.368 1.00 46.51 O ATOM 13120 ND2 ASN B 321 52.093 9.532 63.398 1.00 45.86 N ATOM 13121 HA ASN B 321 50.164 12.715 64.136 1.00 0.00 H ATOM 13122 HB2 ASN B 321 51.694 11.794 62.380 1.00 0.00 H ATOM 13123 HB3 ASN B 321 53.086 12.295 63.369 1.00 0.00 H ATOM 13124 HD22 ASN B 321 52.179 9.610 62.365 1.00 0.00 H ATOM 13125 HD21 ASN B 321 52.082 8.595 63.849 1.00 0.00 H ATOM 13126 H ASN B 321 51.706 14.161 62.266 1.00 0.00 H ATOM 13127 N LEU B 322 52.803 14.009 65.621 1.00 34.13 N ATOM 13128 CA LEU B 322 53.361 14.261 66.945 1.00 33.16 C ATOM 13129 C LEU B 322 52.511 15.175 67.841 1.00 33.27 C ATOM 13130 O LEU B 322 52.304 14.878 69.025 1.00 31.44 O ATOM 13131 CB LEU B 322 54.772 14.816 66.822 1.00 33.59 C ATOM 13132 CG LEU B 322 55.489 15.055 68.144 1.00 34.00 C ATOM 13133 CD1 LEU B 322 55.597 13.750 68.936 1.00 34.17 C ATOM 13134 CD2 LEU B 322 56.849 15.643 67.874 1.00 32.80 C ATOM 13135 HA LEU B 322 53.371 13.292 67.444 1.00 0.00 H ATOM 13136 HB2 LEU B 322 55.364 14.110 66.239 1.00 0.00 H ATOM 13137 HB3 LEU B 322 54.716 15.766 66.291 1.00 0.00 H ATOM 13138 HG LEU B 322 54.917 15.760 68.747 1.00 0.00 H ATOM 13139 HD21 LEU B 322 57.429 14.950 67.264 1.00 0.00 H ATOM 13140 HD22 LEU B 322 56.736 16.589 67.344 1.00 0.00 H ATOM 13141 HD23 LEU B 322 57.363 15.815 68.820 1.00 0.00 H ATOM 13142 HD11 LEU B 322 54.597 13.365 69.138 1.00 0.00 H ATOM 13143 HD12 LEU B 322 56.158 13.019 68.354 1.00 0.00 H ATOM 13144 HD13 LEU B 322 56.112 13.940 69.878 1.00 0.00 H ATOM 13145 H LEU B 322 53.315 14.338 64.778 1.00 0.00 H ATOM 13146 N GLY B 323 52.019 16.276 67.270 1.00 30.08 N ATOM 13147 CA GLY B 323 51.269 17.268 68.025 1.00 28.74 C ATOM 13148 C GLY B 323 49.776 17.038 68.126 1.00 29.50 C ATOM 13149 O GLY B 323 49.157 17.449 69.103 1.00 29.43 O ATOM 13150 HA3 GLY B 323 51.426 18.237 67.551 1.00 0.00 H ATOM 13151 HA2 GLY B 323 51.672 17.291 69.037 1.00 0.00 H ATOM 13152 H GLY B 323 52.177 16.430 66.254 1.00 0.00 H ATOM 13153 N PHE B 324 49.184 16.387 67.130 1.00 28.31 N ATOM 13154 CA PHE B 324 47.734 16.163 67.144 1.00 28.54 C ATOM 13155 C PHE B 324 47.316 14.755 67.572 1.00 29.61 C ATOM 13156 O PHE B 324 46.157 14.542 67.928 1.00 29.44 O ATOM 13157 CB PHE B 324 47.105 16.507 65.790 1.00 28.92 C ATOM 13158 CG PHE B 324 47.029 17.987 65.513 1.00 28.17 C ATOM 13159 CD1 PHE B 324 45.891 18.709 65.838 1.00 27.58 C ATOM 13160 CD2 PHE B 324 48.099 18.656 64.931 1.00 28.41 C ATOM 13161 CE1 PHE B 324 45.822 20.079 65.588 1.00 28.66 C ATOM 13162 CE2 PHE B 324 48.038 20.030 64.672 1.00 27.84 C ATOM 13163 CZ PHE B 324 46.904 20.737 65.001 1.00 27.53 C ATOM 13164 HA PHE B 324 47.354 16.840 67.909 1.00 0.00 H ATOM 13165 HB2 PHE B 324 47.701 16.040 65.005 1.00 0.00 H ATOM 13166 HB3 PHE B 324 46.094 16.100 65.767 1.00 0.00 H ATOM 13167 HD2 PHE B 324 49.001 18.101 64.672 1.00 0.00 H ATOM 13168 HE2 PHE B 324 48.885 20.538 64.212 1.00 0.00 H ATOM 13169 HZ PHE B 324 46.851 21.808 64.804 1.00 0.00 H ATOM 13170 HE1 PHE B 324 44.923 20.636 65.851 1.00 0.00 H ATOM 13171 HD1 PHE B 324 45.041 18.200 66.294 1.00 0.00 H ATOM 13172 H PHE B 324 49.753 16.034 66.334 1.00 0.00 H ATOM 13173 N ILE B 325 48.255 13.809 67.534 1.00 28.61 N ATOM 13174 CA ILE B 325 47.969 12.423 67.877 1.00 29.03 C ATOM 13175 C ILE B 325 48.806 11.942 69.056 1.00 29.65 C ATOM 13176 O ILE B 325 48.263 11.578 70.100 1.00 30.51 O ATOM 13177 CB ILE B 325 48.173 11.464 66.660 1.00 28.68 C ATOM 13178 CG1 ILE B 325 47.191 11.803 65.529 1.00 26.88 C ATOM 13179 CG2 ILE B 325 48.029 10.003 67.090 1.00 28.85 C ATOM 13180 CD1 ILE B 325 47.444 11.047 64.207 1.00 27.05 C ATOM 13181 HA ILE B 325 46.918 12.396 68.165 1.00 0.00 H ATOM 13182 HB ILE B 325 49.185 11.605 66.281 1.00 0.00 H ATOM 13183 HG12 ILE B 325 46.184 11.563 65.870 1.00 0.00 H ATOM 13184 HG13 ILE B 325 47.260 12.872 65.328 1.00 0.00 H ATOM 13185 HD11 ILE B 325 48.443 11.284 63.840 1.00 0.00 H ATOM 13186 HD12 ILE B 325 47.365 9.974 64.383 1.00 0.00 H ATOM 13187 HD13 ILE B 325 46.702 11.351 63.468 1.00 0.00 H ATOM 13188 HG21 ILE B 325 48.777 9.773 67.849 1.00 0.00 H ATOM 13189 HG22 ILE B 325 47.032 9.843 67.501 1.00 0.00 H ATOM 13190 HG23 ILE B 325 48.175 9.355 66.226 1.00 0.00 H ATOM 13191 H ILE B 325 49.221 14.069 67.251 1.00 0.00 H ATOM 13192 N THR B 326 50.123 11.954 68.895 1.00 29.80 N ATOM 13193 CA THR B 326 51.007 11.383 69.900 1.00 32.14 C ATOM 13194 C THR B 326 50.934 12.108 71.251 1.00 33.24 C ATOM 13195 O THR B 326 50.691 11.470 72.275 1.00 33.68 O ATOM 13196 CB THR B 326 52.464 11.269 69.391 1.00 32.90 C ATOM 13197 OG1 THR B 326 52.516 10.310 68.326 1.00 33.84 O ATOM 13198 CG2 THR B 326 53.397 10.807 70.498 1.00 33.01 C ATOM 13199 HA THR B 326 50.641 10.372 70.078 1.00 0.00 H ATOM 13200 HB THR B 326 52.783 12.253 69.047 1.00 0.00 H ATOM 13201 HG1 THR B 326 51.927 10.606 67.587 1.00 0.00 H ATOM 13202 HG23 THR B 326 53.370 11.525 71.317 1.00 0.00 H ATOM 13203 HG21 THR B 326 53.075 9.830 70.859 1.00 0.00 H ATOM 13204 HG22 THR B 326 54.413 10.735 70.109 1.00 0.00 H ATOM 13205 H THR B 326 50.530 12.378 68.037 1.00 0.00 H ATOM 13206 N LEU B 327 51.124 13.427 71.255 1.00 32.96 N ATOM 13207 CA LEU B 327 51.117 14.173 72.513 1.00 34.65 C ATOM 13208 C LEU B 327 49.797 14.021 73.288 1.00 35.17 C ATOM 13209 O LEU B 327 49.827 13.691 74.465 1.00 36.67 O ATOM 13210 CB LEU B 327 51.495 15.642 72.311 1.00 35.65 C ATOM 13211 CG LEU B 327 51.940 16.380 73.576 1.00 37.18 C ATOM 13212 CD1 LEU B 327 53.108 15.666 74.237 1.00 37.14 C ATOM 13213 CD2 LEU B 327 52.309 17.811 73.258 1.00 36.82 C ATOM 13214 HA LEU B 327 51.891 13.725 73.136 1.00 0.00 H ATOM 13215 HB2 LEU B 327 52.312 15.684 71.590 1.00 0.00 H ATOM 13216 HB3 LEU B 327 50.627 16.161 71.905 1.00 0.00 H ATOM 13217 HG LEU B 327 51.103 16.386 74.274 1.00 0.00 H ATOM 13218 HD21 LEU B 327 53.126 17.822 72.537 1.00 0.00 H ATOM 13219 HD22 LEU B 327 51.444 18.323 72.837 1.00 0.00 H ATOM 13220 HD23 LEU B 327 52.622 18.316 74.172 1.00 0.00 H ATOM 13221 HD11 LEU B 327 52.807 14.654 74.508 1.00 0.00 H ATOM 13222 HD12 LEU B 327 53.946 15.623 73.542 1.00 0.00 H ATOM 13223 HD13 LEU B 327 53.405 16.211 75.133 1.00 0.00 H ATOM 13224 H LEU B 327 51.278 13.929 70.358 1.00 0.00 H ATOM 13225 N PRO B 328 48.639 14.274 72.644 1.00 35.95 N ATOM 13226 CA PRO B 328 47.391 14.069 73.404 1.00 36.65 C ATOM 13227 C PRO B 328 47.153 12.621 73.867 1.00 37.67 C ATOM 13228 O PRO B 328 46.478 12.408 74.885 1.00 37.87 O ATOM 13229 CB PRO B 328 46.285 14.513 72.434 1.00 36.49 C ATOM 13230 CG PRO B 328 46.922 14.639 71.100 1.00 36.97 C ATOM 13231 CD PRO B 328 48.401 14.766 71.275 1.00 36.00 C ATOM 13232 HA PRO B 328 47.423 14.634 74.335 1.00 0.00 H ATOM 13233 HD3 PRO B 328 48.932 14.155 70.545 1.00 0.00 H ATOM 13234 HD2 PRO B 328 48.716 15.805 71.176 1.00 0.00 H ATOM 13235 HG3 PRO B 328 46.537 15.524 70.593 1.00 0.00 H ATOM 13236 HG2 PRO B 328 46.699 13.754 70.504 1.00 0.00 H ATOM 13237 HB2 PRO B 328 45.489 13.769 72.403 1.00 0.00 H ATOM 13238 HB3 PRO B 328 45.872 15.472 72.747 1.00 0.00 H ATOM 13239 N ALA B 329 47.690 11.645 73.129 1.00 35.93 N ATOM 13240 CA ALA B 329 47.575 10.242 73.516 1.00 34.81 C ATOM 13241 C ALA B 329 48.401 9.984 74.766 1.00 34.64 C ATOM 13242 O ALA B 329 47.950 9.313 75.692 1.00 35.52 O ATOM 13243 CB ALA B 329 48.026 9.331 72.391 1.00 34.74 C ATOM 13244 HA ALA B 329 46.528 10.025 73.727 1.00 0.00 H ATOM 13245 HB1 ALA B 329 47.404 9.505 71.513 1.00 0.00 H ATOM 13246 HB2 ALA B 329 49.067 9.544 72.148 1.00 0.00 H ATOM 13247 HB3 ALA B 329 47.930 8.292 72.706 1.00 0.00 H ATOM 13248 H ALA B 329 48.202 11.891 72.258 1.00 0.00 H ATOM 13249 N ILE B 330 49.615 10.519 74.778 1.00 33.65 N ATOM 13250 CA ILE B 330 50.486 10.425 75.934 1.00 33.68 C ATOM 13251 C ILE B 330 49.840 11.079 77.159 1.00 36.37 C ATOM 13252 O ILE B 330 49.794 10.485 78.242 1.00 37.81 O ATOM 13253 CB ILE B 330 51.830 11.100 75.662 1.00 32.32 C ATOM 13254 CG1 ILE B 330 52.666 10.244 74.710 1.00 31.58 C ATOM 13255 CG2 ILE B 330 52.583 11.332 76.965 1.00 31.70 C ATOM 13256 CD1 ILE B 330 53.958 10.920 74.260 1.00 32.35 C ATOM 13257 HA ILE B 330 50.648 9.366 76.133 1.00 0.00 H ATOM 13258 HB ILE B 330 51.646 12.067 75.194 1.00 0.00 H ATOM 13259 HG12 ILE B 330 52.921 9.313 75.216 1.00 0.00 H ATOM 13260 HG13 ILE B 330 52.066 10.023 73.827 1.00 0.00 H ATOM 13261 HD11 ILE B 330 53.719 11.848 73.741 1.00 0.00 H ATOM 13262 HD12 ILE B 330 54.575 11.138 75.132 1.00 0.00 H ATOM 13263 HD13 ILE B 330 54.499 10.255 73.587 1.00 0.00 H ATOM 13264 HG21 ILE B 330 51.989 11.973 77.617 1.00 0.00 H ATOM 13265 HG22 ILE B 330 52.759 10.375 77.457 1.00 0.00 H ATOM 13266 HG23 ILE B 330 53.537 11.813 76.751 1.00 0.00 H ATOM 13267 H ILE B 330 49.953 11.021 73.932 1.00 0.00 H ATOM 13268 N PHE B 331 49.340 12.299 76.978 1.00 37.25 N ATOM 13269 CA PHE B 331 48.664 13.022 78.056 1.00 38.09 C ATOM 13270 C PHE B 331 47.514 12.234 78.654 1.00 38.83 C ATOM 13271 O PHE B 331 47.292 12.287 79.867 1.00 39.34 O ATOM 13272 CB PHE B 331 48.132 14.365 77.569 1.00 36.61 C ATOM 13273 CG PHE B 331 49.194 15.394 77.361 1.00 36.87 C ATOM 13274 CD1 PHE B 331 50.469 15.198 77.859 1.00 35.25 C ATOM 13275 CD2 PHE B 331 48.910 16.573 76.692 1.00 35.92 C ATOM 13276 CE1 PHE B 331 51.444 16.143 77.672 1.00 36.50 C ATOM 13277 CE2 PHE B 331 49.883 17.527 76.507 1.00 35.72 C ATOM 13278 CZ PHE B 331 51.150 17.315 76.996 1.00 36.69 C ATOM 13279 HA PHE B 331 49.417 13.177 78.829 1.00 0.00 H ATOM 13280 HB2 PHE B 331 47.615 14.208 76.622 1.00 0.00 H ATOM 13281 HB3 PHE B 331 47.426 14.744 78.308 1.00 0.00 H ATOM 13282 HD2 PHE B 331 47.905 16.747 76.308 1.00 0.00 H ATOM 13283 HE2 PHE B 331 49.650 18.449 75.974 1.00 0.00 H ATOM 13284 HZ PHE B 331 51.923 18.070 76.852 1.00 0.00 H ATOM 13285 HE1 PHE B 331 52.450 15.972 78.055 1.00 0.00 H ATOM 13286 HD1 PHE B 331 50.701 14.284 78.405 1.00 0.00 H ATOM 13287 H PHE B 331 49.432 12.751 76.046 1.00 0.00 H ATOM 13288 N SER B 332 46.789 11.507 77.805 1.00 38.03 N ATOM 13289 CA SER B 332 45.612 10.747 78.231 1.00 39.66 C ATOM 13290 C SER B 332 45.940 9.655 79.246 1.00 40.82 C ATOM 13291 O SER B 332 45.038 9.093 79.868 1.00 41.64 O ATOM 13292 CB SER B 332 44.914 10.114 77.026 1.00 39.12 C ATOM 13293 OG SER B 332 45.654 9.005 76.529 1.00 38.89 O ATOM 13294 HA SER B 332 44.951 11.464 78.717 1.00 0.00 H ATOM 13295 HB2 SER B 332 44.818 10.860 76.237 1.00 0.00 H ATOM 13296 HB3 SER B 332 43.923 9.775 77.326 1.00 0.00 H ATOM 13297 HG SER B 332 46.554 9.309 76.251 1.00 0.00 H ATOM 13298 H SER B 332 47.069 11.478 76.804 1.00 0.00 H ATOM 13299 N GLN B 333 47.224 9.356 79.401 1.00 42.42 N ATOM 13300 CA GLN B 333 47.679 8.320 80.316 1.00 43.47 C ATOM 13301 C GLN B 333 48.164 8.944 81.614 1.00 44.34 C ATOM 13302 O GLN B 333 48.776 8.272 82.442 1.00 44.27 O ATOM 13303 CB GLN B 333 48.819 7.523 79.677 1.00 44.57 C ATOM 13304 CG GLN B 333 48.456 6.864 78.361 1.00 44.78 C ATOM 13305 CD GLN B 333 47.475 5.730 78.534 1.00 46.50 C ATOM 13306 OE1 GLN B 333 46.325 5.819 78.100 1.00 47.99 O ATOM 13307 NE2 GLN B 333 47.917 4.653 79.183 1.00 46.68 N ATOM 13308 HA GLN B 333 46.845 7.652 80.529 1.00 0.00 H ATOM 13309 HB2 GLN B 333 49.654 8.201 79.501 1.00 0.00 H ATOM 13310 HB3 GLN B 333 49.126 6.745 80.376 1.00 0.00 H ATOM 13311 HG2 GLN B 333 48.013 7.613 77.705 1.00 0.00 H ATOM 13312 HG3 GLN B 333 49.365 6.474 77.903 1.00 0.00 H ATOM 13313 HE22 GLN B 333 48.896 4.622 79.532 1.00 0.00 H ATOM 13314 HE21 GLN B 333 47.283 3.844 79.340 1.00 0.00 H ATOM 13315 H GLN B 333 47.931 9.882 78.848 1.00 0.00 H ATOM 13316 N THR B 334 47.894 10.236 81.779 1.00 43.97 N ATOM 13317 CA THR B 334 48.347 10.986 82.948 1.00 42.90 C ATOM 13318 C THR B 334 47.167 11.666 83.644 1.00 41.16 C ATOM 13319 O THR B 334 46.200 12.047 82.992 1.00 39.80 O ATOM 13320 CB THR B 334 49.407 12.054 82.558 1.00 43.93 C ATOM 13321 OG1 THR B 334 48.782 13.148 81.873 1.00 43.56 O ATOM 13322 CG2 THR B 334 50.483 11.448 81.657 1.00 44.59 C ATOM 13323 HA THR B 334 48.807 10.275 83.634 1.00 0.00 H ATOM 13324 HB THR B 334 49.872 12.414 83.475 1.00 0.00 H ATOM 13325 HG1 THR B 334 48.342 12.813 81.052 1.00 0.00 H ATOM 13326 HG23 THR B 334 50.961 10.616 82.174 1.00 0.00 H ATOM 13327 HG21 THR B 334 50.024 11.090 80.735 1.00 0.00 H ATOM 13328 HG22 THR B 334 51.228 12.208 81.422 1.00 0.00 H ATOM 13329 H THR B 334 47.341 10.730 81.050 1.00 0.00 H ATOM 13330 N ALA B 335 47.251 11.810 84.966 1.00 40.20 N ATOM 13331 CA ALA B 335 46.184 12.453 85.740 1.00 38.83 C ATOM 13332 C ALA B 335 45.938 13.888 85.275 1.00 37.21 C ATOM 13333 O ALA B 335 46.856 14.707 85.236 1.00 37.21 O ATOM 13334 CB ALA B 335 46.498 12.417 87.243 1.00 39.04 C ATOM 13335 HA ALA B 335 45.269 11.887 85.566 1.00 0.00 H ATOM 13336 HB1 ALA B 335 46.592 11.381 87.569 1.00 0.00 H ATOM 13337 HB2 ALA B 335 47.433 12.944 87.430 1.00 0.00 H ATOM 13338 HB3 ALA B 335 45.691 12.900 87.793 1.00 0.00 H ATOM 13339 H ALA B 335 48.095 11.457 85.462 1.00 0.00 H ATOM 13340 N GLY B 336 44.691 14.187 84.927 1.00 36.09 N ATOM 13341 CA GLY B 336 44.325 15.507 84.413 1.00 34.46 C ATOM 13342 C GLY B 336 44.803 15.714 82.983 1.00 34.65 C ATOM 13343 O GLY B 336 44.889 16.847 82.507 1.00 34.24 O ATOM 13344 HA3 GLY B 336 44.775 16.270 85.049 1.00 0.00 H ATOM 13345 HA2 GLY B 336 43.240 15.607 84.440 1.00 0.00 H ATOM 13346 H GLY B 336 43.953 13.461 85.023 1.00 0.00 H ATOM 13347 N GLY B 337 45.105 14.613 82.296 1.00 33.71 N ATOM 13348 CA GLY B 337 45.675 14.651 80.951 1.00 33.92 C ATOM 13349 C GLY B 337 44.815 15.227 79.841 1.00 32.67 C ATOM 13350 O GLY B 337 45.339 15.753 78.862 1.00 31.94 O ATOM 13351 HA3 GLY B 337 45.925 13.627 80.673 1.00 0.00 H ATOM 13352 HA2 GLY B 337 46.587 15.246 80.999 1.00 0.00 H ATOM 13353 H GLY B 337 44.928 13.687 82.736 1.00 0.00 H ATOM 13354 N THR B 338 43.499 15.122 79.983 1.00 31.89 N ATOM 13355 CA THR B 338 42.590 15.711 79.005 1.00 33.58 C ATOM 13356 C THR B 338 42.678 17.232 79.076 1.00 34.58 C ATOM 13357 O THR B 338 42.730 17.912 78.040 1.00 36.00 O ATOM 13358 CB THR B 338 41.142 15.247 79.224 1.00 33.24 C ATOM 13359 OG1 THR B 338 41.087 13.825 79.108 1.00 34.36 O ATOM 13360 CG2 THR B 338 40.215 15.843 78.180 1.00 33.75 C ATOM 13361 HA THR B 338 42.892 15.374 78.013 1.00 0.00 H ATOM 13362 HB THR B 338 40.823 15.574 80.214 1.00 0.00 H ATOM 13363 HG1 THR B 338 40.156 13.519 79.248 1.00 0.00 H ATOM 13364 HG23 THR B 338 40.241 16.930 78.251 1.00 0.00 H ATOM 13365 HG21 THR B 338 40.542 15.534 77.187 1.00 0.00 H ATOM 13366 HG22 THR B 338 39.198 15.491 78.355 1.00 0.00 H ATOM 13367 H THR B 338 43.111 14.613 80.803 1.00 0.00 H ATOM 13368 N PHE B 339 42.712 17.766 80.294 1.00 32.64 N ATOM 13369 CA PHE B 339 42.840 19.209 80.487 1.00 31.60 C ATOM 13370 C PHE B 339 44.194 19.724 80.004 1.00 31.24 C ATOM 13371 O PHE B 339 44.303 20.835 79.487 1.00 29.41 O ATOM 13372 CB PHE B 339 42.627 19.589 81.954 1.00 30.24 C ATOM 13373 CG PHE B 339 42.553 21.071 82.186 1.00 29.63 C ATOM 13374 CD1 PHE B 339 41.406 21.779 81.861 1.00 27.68 C ATOM 13375 CD2 PHE B 339 43.630 21.757 82.728 1.00 28.10 C ATOM 13376 CE1 PHE B 339 41.334 23.144 82.072 1.00 27.79 C ATOM 13377 CE2 PHE B 339 43.560 23.124 82.942 1.00 28.08 C ATOM 13378 CZ PHE B 339 42.416 23.817 82.612 1.00 27.27 C ATOM 13379 HA PHE B 339 42.063 19.682 79.886 1.00 0.00 H ATOM 13380 HB2 PHE B 339 41.694 19.139 82.295 1.00 0.00 H ATOM 13381 HB3 PHE B 339 43.456 19.189 82.538 1.00 0.00 H ATOM 13382 HD2 PHE B 339 44.540 21.216 82.988 1.00 0.00 H ATOM 13383 HE2 PHE B 339 44.411 23.652 83.372 1.00 0.00 H ATOM 13384 HZ PHE B 339 42.363 24.893 82.776 1.00 0.00 H ATOM 13385 HE1 PHE B 339 40.426 23.689 81.813 1.00 0.00 H ATOM 13386 HD1 PHE B 339 40.551 21.254 81.434 1.00 0.00 H ATOM 13387 H PHE B 339 42.646 17.144 81.125 1.00 0.00 H ATOM 13388 N LEU B 340 45.222 18.913 80.186 1.00 32.10 N ATOM 13389 CA LEU B 340 46.556 19.257 79.731 1.00 33.09 C ATOM 13390 C LEU B 340 46.583 19.276 78.192 1.00 33.34 C ATOM 13391 O LEU B 340 47.276 20.090 77.575 1.00 33.22 O ATOM 13392 CB LEU B 340 47.542 18.241 80.275 1.00 35.30 C ATOM 13393 CG LEU B 340 49.026 18.565 80.201 1.00 37.43 C ATOM 13394 CD1 LEU B 340 49.353 19.804 81.019 1.00 37.10 C ATOM 13395 CD2 LEU B 340 49.803 17.349 80.695 1.00 38.64 C ATOM 13396 HA LEU B 340 46.835 20.247 80.093 1.00 0.00 H ATOM 13397 HB2 LEU B 340 47.298 18.084 81.326 1.00 0.00 H ATOM 13398 HB3 LEU B 340 47.386 17.313 79.725 1.00 0.00 H ATOM 13399 HG LEU B 340 49.310 18.786 79.172 1.00 0.00 H ATOM 13400 HD21 LEU B 340 49.517 17.130 81.724 1.00 0.00 H ATOM 13401 HD22 LEU B 340 49.574 16.491 80.063 1.00 0.00 H ATOM 13402 HD23 LEU B 340 50.872 17.560 80.650 1.00 0.00 H ATOM 13403 HD11 LEU B 340 48.789 20.653 80.632 1.00 0.00 H ATOM 13404 HD12 LEU B 340 49.083 19.632 82.061 1.00 0.00 H ATOM 13405 HD13 LEU B 340 50.420 20.013 80.949 1.00 0.00 H ATOM 13406 H LEU B 340 45.070 18.004 80.668 1.00 0.00 H ATOM 13407 N GLY B 341 45.818 18.371 77.594 1.00 31.90 N ATOM 13408 CA GLY B 341 45.627 18.338 76.154 1.00 31.61 C ATOM 13409 C GLY B 341 45.011 19.654 75.736 1.00 31.00 C ATOM 13410 O GLY B 341 45.437 20.248 74.754 1.00 29.51 O ATOM 13411 HA3 GLY B 341 44.962 17.516 75.887 1.00 0.00 H ATOM 13412 HA2 GLY B 341 46.587 18.203 75.656 1.00 0.00 H ATOM 13413 H GLY B 341 45.337 17.658 78.179 1.00 0.00 H ATOM 13414 N PHE B 342 44.016 20.116 76.496 1.00 30.50 N ATOM 13415 CA PHE B 342 43.377 21.417 76.231 1.00 28.94 C ATOM 13416 C PHE B 342 44.361 22.578 76.314 1.00 28.63 C ATOM 13417 O PHE B 342 44.388 23.428 75.430 1.00 28.71 O ATOM 13418 CB PHE B 342 42.191 21.675 77.171 1.00 29.29 C ATOM 13419 CG PHE B 342 41.843 23.141 77.329 1.00 29.71 C ATOM 13420 CD1 PHE B 342 41.120 23.811 76.353 1.00 30.21 C ATOM 13421 CD2 PHE B 342 42.239 23.846 78.466 1.00 30.12 C ATOM 13422 CE1 PHE B 342 40.800 25.154 76.496 1.00 29.76 C ATOM 13423 CE2 PHE B 342 41.919 25.194 78.617 1.00 30.42 C ATOM 13424 CZ PHE B 342 41.202 25.846 77.630 1.00 30.83 C ATOM 13425 HA PHE B 342 43.006 21.360 75.208 1.00 0.00 H ATOM 13426 HB2 PHE B 342 41.319 21.155 76.775 1.00 0.00 H ATOM 13427 HB3 PHE B 342 42.437 21.272 78.153 1.00 0.00 H ATOM 13428 HD2 PHE B 342 42.805 23.336 79.245 1.00 0.00 H ATOM 13429 HE2 PHE B 342 42.233 25.733 79.511 1.00 0.00 H ATOM 13430 HZ PHE B 342 40.953 26.901 77.743 1.00 0.00 H ATOM 13431 HE1 PHE B 342 40.233 25.665 75.718 1.00 0.00 H ATOM 13432 HD1 PHE B 342 40.798 23.275 75.460 1.00 0.00 H ATOM 13433 H PHE B 342 43.683 19.542 77.297 1.00 0.00 H ATOM 13434 N LEU B 343 45.170 22.617 77.368 1.00 25.81 N ATOM 13435 CA LEU B 343 46.166 23.683 77.507 1.00 27.22 C ATOM 13436 C LEU B 343 47.157 23.701 76.332 1.00 28.68 C ATOM 13437 O LEU B 343 47.572 24.769 75.864 1.00 29.78 O ATOM 13438 CB LEU B 343 46.920 23.554 78.829 1.00 25.77 C ATOM 13439 CG LEU B 343 46.080 23.697 80.109 1.00 26.85 C ATOM 13440 CD1 LEU B 343 46.892 23.364 81.337 1.00 27.84 C ATOM 13441 CD2 LEU B 343 45.489 25.088 80.234 1.00 25.65 C ATOM 13442 HA LEU B 343 45.624 24.629 77.500 1.00 0.00 H ATOM 13443 HB2 LEU B 343 47.391 22.571 78.849 1.00 0.00 H ATOM 13444 HB3 LEU B 343 47.690 24.325 78.849 1.00 0.00 H ATOM 13445 HG LEU B 343 45.259 22.984 80.034 1.00 0.00 H ATOM 13446 HD21 LEU B 343 46.294 25.822 80.265 1.00 0.00 H ATOM 13447 HD22 LEU B 343 44.847 25.287 79.376 1.00 0.00 H ATOM 13448 HD23 LEU B 343 44.902 25.151 81.150 1.00 0.00 H ATOM 13449 HD11 LEU B 343 47.248 22.336 81.268 1.00 0.00 H ATOM 13450 HD12 LEU B 343 47.744 24.041 81.403 1.00 0.00 H ATOM 13451 HD13 LEU B 343 46.269 23.475 82.224 1.00 0.00 H ATOM 13452 H LEU B 343 45.095 21.884 78.102 1.00 0.00 H ATOM 13453 N TRP B 344 47.536 22.513 75.876 1.00 28.94 N ATOM 13454 CA TRP B 344 48.429 22.364 74.728 1.00 27.97 C ATOM 13455 C TRP B 344 47.775 22.926 73.469 1.00 26.71 C ATOM 13456 O TRP B 344 48.373 23.726 72.763 1.00 27.33 O ATOM 13457 CB TRP B 344 48.827 20.895 74.561 1.00 27.44 C ATOM 13458 CG TRP B 344 49.425 20.513 73.209 1.00 27.55 C ATOM 13459 CD1 TRP B 344 48.847 19.723 72.257 1.00 27.32 C ATOM 13460 CD2 TRP B 344 50.709 20.889 72.689 1.00 27.50 C ATOM 13461 NE1 TRP B 344 49.688 19.583 71.175 1.00 27.46 N ATOM 13462 CE2 TRP B 344 50.837 20.292 71.415 1.00 27.94 C ATOM 13463 CE3 TRP B 344 51.764 21.672 73.177 1.00 26.95 C ATOM 13464 CZ2 TRP B 344 51.977 20.455 70.624 1.00 26.96 C ATOM 13465 CZ3 TRP B 344 52.892 21.836 72.391 1.00 26.94 C ATOM 13466 CH2 TRP B 344 52.989 21.227 71.126 1.00 27.74 C ATOM 13467 HA TRP B 344 49.340 22.936 74.902 1.00 0.00 H ATOM 13468 HB2 TRP B 344 49.563 20.659 75.330 1.00 0.00 H ATOM 13469 HB3 TRP B 344 47.935 20.288 74.715 1.00 0.00 H ATOM 13470 HE1 TRP B 344 49.485 19.031 70.317 1.00 0.00 H ATOM 13471 HD1 TRP B 344 47.860 19.268 72.341 1.00 0.00 H ATOM 13472 HZ2 TRP B 344 52.057 19.985 69.644 1.00 0.00 H ATOM 13473 HH2 TRP B 344 53.891 21.374 70.532 1.00 0.00 H ATOM 13474 HZ3 TRP B 344 53.717 22.446 72.758 1.00 0.00 H ATOM 13475 HE3 TRP B 344 51.698 22.143 74.158 1.00 0.00 H ATOM 13476 H TRP B 344 47.185 21.658 76.353 1.00 0.00 H ATOM 13477 N PHE B 345 46.539 22.531 73.195 1.00 26.86 N ATOM 13478 CA PHE B 345 45.865 23.047 72.007 1.00 27.89 C ATOM 13479 C PHE B 345 45.474 24.511 72.091 1.00 28.27 C ATOM 13480 O PHE B 345 45.444 25.208 71.073 1.00 29.21 O ATOM 13481 CB PHE B 345 44.678 22.170 71.647 1.00 28.76 C ATOM 13482 CG PHE B 345 45.087 20.831 71.135 1.00 29.63 C ATOM 13483 CD1 PHE B 345 45.804 20.731 69.951 1.00 29.44 C ATOM 13484 CD2 PHE B 345 44.776 19.677 71.832 1.00 29.26 C ATOM 13485 CE1 PHE B 345 46.200 19.505 69.472 1.00 29.56 C ATOM 13486 CE2 PHE B 345 45.161 18.445 71.356 1.00 29.47 C ATOM 13487 CZ PHE B 345 45.877 18.356 70.175 1.00 30.03 C ATOM 13488 HA PHE B 345 46.600 23.004 71.203 1.00 0.00 H ATOM 13489 HB2 PHE B 345 44.064 22.031 72.537 1.00 0.00 H ATOM 13490 HB3 PHE B 345 44.092 22.674 70.878 1.00 0.00 H ATOM 13491 HD2 PHE B 345 44.221 19.745 72.767 1.00 0.00 H ATOM 13492 HE2 PHE B 345 44.903 17.541 71.908 1.00 0.00 H ATOM 13493 HZ PHE B 345 46.187 17.381 69.798 1.00 0.00 H ATOM 13494 HE1 PHE B 345 46.766 19.437 68.543 1.00 0.00 H ATOM 13495 HD1 PHE B 345 46.056 21.634 69.395 1.00 0.00 H ATOM 13496 H PHE B 345 46.053 21.858 73.822 1.00 0.00 H ATOM 13497 N PHE B 346 45.176 24.983 73.296 1.00 28.09 N ATOM 13498 CA PHE B 346 44.913 26.397 73.507 1.00 28.37 C ATOM 13499 C PHE B 346 46.188 27.195 73.243 1.00 26.43 C ATOM 13500 O PHE B 346 46.142 28.245 72.606 1.00 25.25 O ATOM 13501 CB PHE B 346 44.413 26.642 74.924 1.00 33.94 C ATOM 13502 CG PHE B 346 43.831 28.006 75.132 1.00 37.99 C ATOM 13503 CD1 PHE B 346 42.592 28.330 74.594 1.00 40.76 C ATOM 13504 CD2 PHE B 346 44.514 28.959 75.868 1.00 40.58 C ATOM 13505 CE1 PHE B 346 42.041 29.592 74.784 1.00 42.53 C ATOM 13506 CE2 PHE B 346 43.981 30.223 76.070 1.00 42.17 C ATOM 13507 CZ PHE B 346 42.742 30.544 75.528 1.00 43.70 C ATOM 13508 HA PHE B 346 44.137 26.724 72.815 1.00 0.00 H ATOM 13509 HB2 PHE B 346 43.645 25.902 75.151 1.00 0.00 H ATOM 13510 HB3 PHE B 346 45.250 26.517 75.611 1.00 0.00 H ATOM 13511 HD2 PHE B 346 45.486 28.712 76.295 1.00 0.00 H ATOM 13512 HE2 PHE B 346 44.532 30.962 76.652 1.00 0.00 H ATOM 13513 HZ PHE B 346 42.318 31.536 75.683 1.00 0.00 H ATOM 13514 HE1 PHE B 346 41.069 29.837 74.356 1.00 0.00 H ATOM 13515 HD1 PHE B 346 42.045 27.585 74.016 1.00 0.00 H ATOM 13516 H PHE B 346 45.130 24.329 74.103 1.00 0.00 H ATOM 13517 N LEU B 347 47.318 26.687 73.727 1.00 23.57 N ATOM 13518 CA LEU B 347 48.629 27.274 73.434 1.00 25.55 C ATOM 13519 C LEU B 347 48.898 27.371 71.921 1.00 26.07 C ATOM 13520 O LEU B 347 49.322 28.411 71.421 1.00 25.75 O ATOM 13521 CB LEU B 347 49.734 26.446 74.084 1.00 24.07 C ATOM 13522 CG LEU B 347 51.182 26.720 73.662 1.00 26.63 C ATOM 13523 CD1 LEU B 347 51.648 28.086 74.135 1.00 28.68 C ATOM 13524 CD2 LEU B 347 52.117 25.650 74.210 1.00 25.78 C ATOM 13525 HA LEU B 347 48.624 28.284 73.844 1.00 0.00 H ATOM 13526 HB2 LEU B 347 49.673 26.611 75.160 1.00 0.00 H ATOM 13527 HB3 LEU B 347 49.525 25.399 73.866 1.00 0.00 H ATOM 13528 HG LEU B 347 51.209 26.699 72.573 1.00 0.00 H ATOM 13529 HD21 LEU B 347 52.063 25.645 75.299 1.00 0.00 H ATOM 13530 HD22 LEU B 347 51.817 24.675 73.825 1.00 0.00 H ATOM 13531 HD23 LEU B 347 53.138 25.867 73.897 1.00 0.00 H ATOM 13532 HD11 LEU B 347 51.009 28.856 73.703 1.00 0.00 H ATOM 13533 HD12 LEU B 347 51.589 28.132 75.222 1.00 0.00 H ATOM 13534 HD13 LEU B 347 52.679 28.247 73.818 1.00 0.00 H ATOM 13535 H LEU B 347 47.270 25.844 74.334 1.00 0.00 H ATOM 13536 N LEU B 348 48.661 26.279 71.198 1.00 25.79 N ATOM 13537 CA LEU B 348 48.892 26.277 69.757 1.00 26.83 C ATOM 13538 C LEU B 348 47.999 27.304 69.090 1.00 26.73 C ATOM 13539 O LEU B 348 48.434 28.003 68.181 1.00 30.64 O ATOM 13540 CB LEU B 348 48.636 24.896 69.162 1.00 26.94 C ATOM 13541 CG LEU B 348 49.529 23.759 69.627 1.00 26.11 C ATOM 13542 CD1 LEU B 348 49.126 22.490 68.916 1.00 26.19 C ATOM 13543 CD2 LEU B 348 50.995 24.088 69.383 1.00 26.30 C ATOM 13544 HA LEU B 348 49.936 26.535 69.578 1.00 0.00 H ATOM 13545 HB2 LEU B 348 47.608 24.623 69.399 1.00 0.00 H ATOM 13546 HB3 LEU B 348 48.748 24.979 68.081 1.00 0.00 H ATOM 13547 HG LEU B 348 49.405 23.617 70.701 1.00 0.00 H ATOM 13548 HD21 LEU B 348 51.157 24.250 68.317 1.00 0.00 H ATOM 13549 HD22 LEU B 348 51.260 24.991 69.933 1.00 0.00 H ATOM 13550 HD23 LEU B 348 51.614 23.258 69.724 1.00 0.00 H ATOM 13551 HD11 LEU B 348 48.087 22.259 69.149 1.00 0.00 H ATOM 13552 HD12 LEU B 348 49.237 22.627 67.840 1.00 0.00 H ATOM 13553 HD13 LEU B 348 49.765 21.671 69.247 1.00 0.00 H ATOM 13554 H LEU B 348 48.308 25.419 71.664 1.00 0.00 H ATOM 13555 N PHE B 349 46.757 27.413 69.549 1.00 27.49 N ATOM 13556 CA PHE B 349 45.816 28.343 68.939 1.00 28.46 C ATOM 13557 C PHE B 349 46.248 29.807 69.053 1.00 31.13 C ATOM 13558 O PHE B 349 46.120 30.561 68.085 1.00 31.37 O ATOM 13559 CB PHE B 349 44.413 28.182 69.517 1.00 28.13 C ATOM 13560 CG PHE B 349 43.441 29.191 68.989 1.00 29.25 C ATOM 13561 CD1 PHE B 349 43.081 29.181 67.644 1.00 28.29 C ATOM 13562 CD2 PHE B 349 42.903 30.167 69.819 1.00 29.53 C ATOM 13563 CE1 PHE B 349 42.194 30.114 67.147 1.00 27.25 C ATOM 13564 CE2 PHE B 349 42.019 31.105 69.320 1.00 28.34 C ATOM 13565 CZ PHE B 349 41.663 31.078 67.986 1.00 27.68 C ATOM 13566 HA PHE B 349 45.805 28.085 67.880 1.00 0.00 H ATOM 13567 HB2 PHE B 349 44.048 27.185 69.269 1.00 0.00 H ATOM 13568 HB3 PHE B 349 44.469 28.288 70.600 1.00 0.00 H ATOM 13569 HD2 PHE B 349 43.181 30.193 70.873 1.00 0.00 H ATOM 13570 HE2 PHE B 349 41.603 31.866 69.980 1.00 0.00 H ATOM 13571 HZ PHE B 349 40.964 31.816 67.594 1.00 0.00 H ATOM 13572 HE1 PHE B 349 41.912 30.092 66.094 1.00 0.00 H ATOM 13573 HD1 PHE B 349 43.504 28.429 66.977 1.00 0.00 H ATOM 13574 H PHE B 349 46.453 26.828 70.353 1.00 0.00 H ATOM 13575 N PHE B 350 46.733 30.203 70.233 1.00 29.47 N ATOM 13576 CA PHE B 350 47.227 31.562 70.447 1.00 30.85 C ATOM 13577 C PHE B 350 48.535 31.753 69.710 1.00 28.76 C ATOM 13578 O PHE B 350 48.819 32.829 69.207 1.00 28.29 O ATOM 13579 CB PHE B 350 47.386 31.875 71.942 1.00 31.20 C ATOM 13580 CG PHE B 350 46.217 32.615 72.528 1.00 33.80 C ATOM 13581 CD1 PHE B 350 44.941 32.440 72.011 1.00 34.05 C ATOM 13582 CD2 PHE B 350 46.389 33.480 73.594 1.00 34.48 C ATOM 13583 CE1 PHE B 350 43.855 33.119 72.543 1.00 35.73 C ATOM 13584 CE2 PHE B 350 45.310 34.162 74.138 1.00 35.55 C ATOM 13585 CZ PHE B 350 44.038 33.983 73.609 1.00 36.08 C ATOM 13586 HA PHE B 350 46.492 32.262 70.050 1.00 0.00 H ATOM 13587 HB2 PHE B 350 47.505 30.935 72.481 1.00 0.00 H ATOM 13588 HB3 PHE B 350 48.281 32.483 72.074 1.00 0.00 H ATOM 13589 HD2 PHE B 350 47.385 33.628 74.012 1.00 0.00 H ATOM 13590 HE2 PHE B 350 45.460 34.838 74.980 1.00 0.00 H ATOM 13591 HZ PHE B 350 43.189 34.520 74.031 1.00 0.00 H ATOM 13592 HE1 PHE B 350 42.860 32.973 72.123 1.00 0.00 H ATOM 13593 HD1 PHE B 350 44.790 31.758 71.174 1.00 0.00 H ATOM 13594 H PHE B 350 46.760 29.525 71.022 1.00 0.00 H ATOM 13595 N ALA B 351 49.334 30.699 69.645 1.00 28.52 N ATOM 13596 CA ALA B 351 50.531 30.747 68.838 1.00 28.86 C ATOM 13597 C ALA B 351 50.130 30.941 67.367 1.00 27.62 C ATOM 13598 O ALA B 351 50.702 31.776 66.686 1.00 29.08 O ATOM 13599 CB ALA B 351 51.364 29.504 69.034 1.00 27.41 C ATOM 13600 HA ALA B 351 51.150 31.589 69.147 1.00 0.00 H ATOM 13601 HB1 ALA B 351 51.651 29.422 70.082 1.00 0.00 H ATOM 13602 HB2 ALA B 351 50.782 28.629 68.746 1.00 0.00 H ATOM 13603 HB3 ALA B 351 52.259 29.567 68.415 1.00 0.00 H ATOM 13604 H ALA B 351 49.099 29.836 70.176 1.00 0.00 H ATOM 13605 N GLY B 352 49.133 30.203 66.892 1.00 28.80 N ATOM 13606 CA GLY B 352 48.675 30.343 65.504 1.00 28.07 C ATOM 13607 C GLY B 352 48.039 31.701 65.234 1.00 29.11 C ATOM 13608 O GLY B 352 48.392 32.391 64.275 1.00 28.00 O ATOM 13609 HA3 GLY B 352 47.940 29.565 65.298 1.00 0.00 H ATOM 13610 HA2 GLY B 352 49.530 30.219 64.839 1.00 0.00 H ATOM 13611 H GLY B 352 48.668 29.513 67.515 1.00 0.00 H ATOM 13612 N LEU B 353 47.099 32.092 66.088 1.00 27.08 N ATOM 13613 CA LEU B 353 46.373 33.350 65.918 1.00 25.62 C ATOM 13614 C LEU B 353 47.281 34.584 65.858 1.00 25.60 C ATOM 13615 O LEU B 353 47.127 35.414 64.975 1.00 23.78 O ATOM 13616 CB LEU B 353 45.330 33.511 67.025 1.00 27.68 C ATOM 13617 CG LEU B 353 44.422 34.740 67.010 1.00 27.77 C ATOM 13618 CD1 LEU B 353 43.691 34.868 65.680 1.00 27.19 C ATOM 13619 CD2 LEU B 353 43.444 34.608 68.153 1.00 27.32 C ATOM 13620 HA LEU B 353 45.880 33.290 64.948 1.00 0.00 H ATOM 13621 HB2 LEU B 353 44.683 32.634 66.986 1.00 0.00 H ATOM 13622 HB3 LEU B 353 45.868 33.522 67.973 1.00 0.00 H ATOM 13623 HG LEU B 353 45.019 35.644 67.129 1.00 0.00 H ATOM 13624 HD21 LEU B 353 42.854 33.701 68.022 1.00 0.00 H ATOM 13625 HD22 LEU B 353 43.992 34.554 69.094 1.00 0.00 H ATOM 13626 HD23 LEU B 353 42.782 35.474 68.165 1.00 0.00 H ATOM 13627 HD11 LEU B 353 44.419 34.963 64.874 1.00 0.00 H ATOM 13628 HD12 LEU B 353 43.079 33.981 65.516 1.00 0.00 H ATOM 13629 HD13 LEU B 353 43.053 35.752 65.701 1.00 0.00 H ATOM 13630 H LEU B 353 46.873 31.485 66.902 1.00 0.00 H ATOM 13631 N THR B 354 48.227 34.709 66.784 1.00 25.84 N ATOM 13632 CA THR B 354 49.117 35.859 66.757 1.00 27.31 C ATOM 13633 C THR B 354 49.938 35.889 65.450 1.00 28.67 C ATOM 13634 O THR B 354 50.404 36.946 65.011 1.00 28.79 O ATOM 13635 CB THR B 354 50.059 35.907 68.001 1.00 28.22 C ATOM 13636 OG1 THR B 354 50.743 34.660 68.142 1.00 26.82 O ATOM 13637 CG2 THR B 354 49.279 36.187 69.293 1.00 26.00 C ATOM 13638 HA THR B 354 48.488 36.749 66.795 1.00 0.00 H ATOM 13639 HB THR B 354 50.770 36.717 67.840 1.00 0.00 H ATOM 13640 HG1 THR B 354 50.081 33.933 68.261 1.00 0.00 H ATOM 13641 HG23 THR B 354 48.752 37.136 69.199 1.00 0.00 H ATOM 13642 HG21 THR B 354 48.560 35.386 69.463 1.00 0.00 H ATOM 13643 HG22 THR B 354 49.974 36.237 70.132 1.00 0.00 H ATOM 13644 H THR B 354 48.330 33.987 67.525 1.00 0.00 H ATOM 13645 N SER B 355 50.111 34.725 64.828 1.00 29.28 N ATOM 13646 CA SER B 355 50.879 34.621 63.587 1.00 27.33 C ATOM 13647 C SER B 355 50.050 34.824 62.343 1.00 27.24 C ATOM 13648 O SER B 355 50.535 35.393 61.373 1.00 27.24 O ATOM 13649 CB SER B 355 51.586 33.270 63.502 1.00 27.22 C ATOM 13650 OG SER B 355 52.703 33.247 64.368 1.00 26.37 O ATOM 13651 HA SER B 355 51.608 35.430 63.625 1.00 0.00 H ATOM 13652 HB2 SER B 355 51.920 33.102 62.478 1.00 0.00 H ATOM 13653 HB3 SER B 355 50.891 32.481 63.790 1.00 0.00 H ATOM 13654 HG SER B 355 53.336 33.961 64.107 1.00 0.00 H ATOM 13655 H SER B 355 49.689 33.866 65.235 1.00 0.00 H ATOM 13656 N SER B 356 48.806 34.359 62.364 1.00 27.59 N ATOM 13657 CA SER B 356 47.956 34.464 61.184 1.00 27.78 C ATOM 13658 C SER B 356 47.440 35.884 60.965 1.00 28.38 C ATOM 13659 O SER B 356 47.056 36.240 59.856 1.00 26.97 O ATOM 13660 CB SER B 356 46.801 33.454 61.225 1.00 27.01 C ATOM 13661 OG SER B 356 46.023 33.616 62.391 1.00 28.10 O ATOM 13662 HA SER B 356 48.583 34.217 60.328 1.00 0.00 H ATOM 13663 HB2 SER B 356 47.211 32.444 61.208 1.00 0.00 H ATOM 13664 HB3 SER B 356 46.167 33.602 60.351 1.00 0.00 H ATOM 13665 HG SER B 356 45.644 34.531 62.409 1.00 0.00 H ATOM 13666 H SER B 356 48.435 33.916 63.229 1.00 0.00 H ATOM 13667 N ILE B 357 47.425 36.710 62.008 1.00 27.03 N ATOM 13668 CA ILE B 357 47.054 38.113 61.779 1.00 26.48 C ATOM 13669 C ILE B 357 48.218 38.810 61.059 1.00 25.69 C ATOM 13670 O ILE B 357 48.019 39.670 60.214 1.00 26.31 O ATOM 13671 CB ILE B 357 46.633 38.849 63.084 1.00 26.26 C ATOM 13672 CG1 ILE B 357 47.705 38.717 64.165 1.00 25.83 C ATOM 13673 CG2 ILE B 357 45.303 38.297 63.596 1.00 24.65 C ATOM 13674 CD1 ILE B 357 47.279 39.291 65.522 1.00 26.13 C ATOM 13675 HA ILE B 357 46.166 38.147 61.148 1.00 0.00 H ATOM 13676 HB ILE B 357 46.516 39.907 62.850 1.00 0.00 H ATOM 13677 HG12 ILE B 357 47.937 37.660 64.295 1.00 0.00 H ATOM 13678 HG13 ILE B 357 48.598 39.245 63.832 1.00 0.00 H ATOM 13679 HD11 ILE B 357 47.054 40.352 65.412 1.00 0.00 H ATOM 13680 HD12 ILE B 357 46.392 38.765 65.875 1.00 0.00 H ATOM 13681 HD13 ILE B 357 48.089 39.162 66.240 1.00 0.00 H ATOM 13682 HG21 ILE B 357 44.534 38.445 62.838 1.00 0.00 H ATOM 13683 HG22 ILE B 357 45.409 37.232 63.805 1.00 0.00 H ATOM 13684 HG23 ILE B 357 45.021 38.821 64.509 1.00 0.00 H ATOM 13685 H ILE B 357 47.670 36.371 62.960 1.00 0.00 H ATOM 13686 N ALA B 358 49.432 38.401 61.392 1.00 24.81 N ATOM 13687 CA ALA B 358 50.642 38.874 60.727 1.00 25.67 C ATOM 13688 C ALA B 358 50.746 38.454 59.260 1.00 26.71 C ATOM 13689 O ALA B 358 51.178 39.245 58.407 1.00 28.59 O ATOM 13690 CB ALA B 358 51.861 38.370 61.477 1.00 23.77 C ATOM 13691 HA ALA B 358 50.593 39.963 60.738 1.00 0.00 H ATOM 13692 HB1 ALA B 358 51.837 38.745 62.500 1.00 0.00 H ATOM 13693 HB2 ALA B 358 51.854 37.280 61.488 1.00 0.00 H ATOM 13694 HB3 ALA B 358 52.764 38.724 60.980 1.00 0.00 H ATOM 13695 H ALA B 358 49.528 37.710 62.164 1.00 0.00 H ATOM 13696 N ILE B 359 50.343 37.222 58.956 1.00 26.65 N ATOM 13697 CA ILE B 359 50.459 36.676 57.599 1.00 27.11 C ATOM 13698 C ILE B 359 49.449 37.286 56.645 1.00 26.31 C ATOM 13699 O ILE B 359 49.675 37.335 55.435 1.00 27.40 O ATOM 13700 CB ILE B 359 50.291 35.122 57.544 1.00 27.60 C ATOM 13701 CG1 ILE B 359 48.824 34.710 57.678 1.00 28.26 C ATOM 13702 CG2 ILE B 359 51.124 34.436 58.597 1.00 27.48 C ATOM 13703 CD1 ILE B 359 48.636 33.234 57.956 1.00 29.95 C ATOM 13704 HA ILE B 359 51.471 36.937 57.289 1.00 0.00 H ATOM 13705 HB ILE B 359 50.648 34.801 56.565 1.00 0.00 H ATOM 13706 HG12 ILE B 359 48.380 35.275 58.497 1.00 0.00 H ATOM 13707 HG13 ILE B 359 48.310 34.955 56.749 1.00 0.00 H ATOM 13708 HD11 ILE B 359 49.066 32.654 57.139 1.00 0.00 H ATOM 13709 HD12 ILE B 359 49.136 32.975 58.889 1.00 0.00 H ATOM 13710 HD13 ILE B 359 47.572 33.014 58.039 1.00 0.00 H ATOM 13711 HG21 ILE B 359 52.176 34.675 58.439 1.00 0.00 H ATOM 13712 HG22 ILE B 359 50.816 34.781 59.584 1.00 0.00 H ATOM 13713 HG23 ILE B 359 50.980 33.358 58.527 1.00 0.00 H ATOM 13714 H ILE B 359 49.933 36.628 59.704 1.00 0.00 H ATOM 13715 N MET B 360 48.319 37.739 57.185 1.00 26.80 N ATOM 13716 CA MET B 360 47.273 38.324 56.347 1.00 26.10 C ATOM 13717 C MET B 360 47.383 39.842 56.175 1.00 26.08 C ATOM 13718 O MET B 360 46.727 40.427 55.297 1.00 21.88 O ATOM 13719 CB MET B 360 45.891 37.929 56.867 1.00 28.94 C ATOM 13720 CG MET B 360 45.486 36.491 56.492 1.00 27.97 C ATOM 13721 SD MET B 360 43.786 36.108 56.950 1.00 32.93 S ATOM 13722 CE MET B 360 43.977 35.889 58.718 1.00 29.96 C ATOM 13723 HA MET B 360 47.419 37.910 55.349 1.00 0.00 H ATOM 13724 HB2 MET B 360 45.892 38.016 57.954 1.00 0.00 H ATOM 13725 HB3 MET B 360 45.155 38.616 56.450 1.00 0.00 H ATOM 13726 HG2 MET B 360 46.151 35.796 57.004 1.00 0.00 H ATOM 13727 HG3 MET B 360 45.594 36.367 55.414 1.00 0.00 H ATOM 13728 HE1 MET B 360 44.680 35.078 58.909 1.00 0.00 H ATOM 13729 HE2 MET B 360 44.357 36.811 59.158 1.00 0.00 H ATOM 13730 HE3 MET B 360 43.011 35.645 59.159 1.00 0.00 H ATOM 13731 H MET B 360 48.179 37.676 58.214 1.00 0.00 H ATOM 13732 N GLN B 361 48.218 40.471 57.001 1.00 24.80 N ATOM 13733 CA GLN B 361 48.395 41.933 56.972 1.00 26.45 C ATOM 13734 C GLN B 361 49.063 42.471 55.684 1.00 25.66 C ATOM 13735 O GLN B 361 48.694 43.553 55.222 1.00 29.00 O ATOM 13736 CB GLN B 361 49.117 42.425 58.243 1.00 27.10 C ATOM 13737 CG GLN B 361 49.270 43.972 58.386 1.00 28.11 C ATOM 13738 CD GLN B 361 47.949 44.721 58.450 1.00 28.04 C ATOM 13739 OE1 GLN B 361 47.831 45.840 57.931 1.00 28.98 O ATOM 13740 NE2 GLN B 361 46.949 44.116 59.081 1.00 24.64 N ATOM 13741 HA GLN B 361 47.389 42.353 56.957 1.00 0.00 H ATOM 13742 HB2 GLN B 361 48.558 42.063 59.106 1.00 0.00 H ATOM 13743 HB3 GLN B 361 50.116 41.988 58.250 1.00 0.00 H ATOM 13744 HG2 GLN B 361 49.826 44.179 59.300 1.00 0.00 H ATOM 13745 HG3 GLN B 361 49.833 44.342 57.529 1.00 0.00 H ATOM 13746 HE22 GLN B 361 47.093 43.176 59.502 1.00 0.00 H ATOM 13747 HE21 GLN B 361 46.022 44.582 59.154 1.00 0.00 H ATOM 13748 H GLN B 361 48.762 39.912 57.688 1.00 0.00 H ATOM 13749 N PRO B 362 50.039 41.736 55.097 1.00 25.22 N ATOM 13750 CA PRO B 362 50.581 42.224 53.819 1.00 24.44 C ATOM 13751 C PRO B 362 49.505 42.446 52.770 1.00 24.99 C ATOM 13752 O PRO B 362 49.526 43.465 52.087 1.00 25.44 O ATOM 13753 CB PRO B 362 51.536 41.106 53.392 1.00 25.13 C ATOM 13754 CG PRO B 362 51.983 40.515 54.699 1.00 24.58 C ATOM 13755 CD PRO B 362 50.730 40.507 55.532 1.00 23.63 C ATOM 13756 HA PRO B 362 51.062 43.196 53.926 1.00 0.00 H ATOM 13757 HD3 PRO B 362 50.127 39.623 55.325 1.00 0.00 H ATOM 13758 HD2 PRO B 362 50.965 40.544 56.596 1.00 0.00 H ATOM 13759 HG3 PRO B 362 52.754 41.131 55.161 1.00 0.00 H ATOM 13760 HG2 PRO B 362 52.364 39.503 54.559 1.00 0.00 H ATOM 13761 HB2 PRO B 362 51.021 40.363 52.783 1.00 0.00 H ATOM 13762 HB3 PRO B 362 52.383 41.507 52.835 1.00 0.00 H ATOM 13763 N MET B 363 48.566 41.514 52.639 1.00 26.60 N ATOM 13764 CA MET B 363 47.471 41.698 51.696 1.00 25.68 C ATOM 13765 C MET B 363 46.606 42.912 52.081 1.00 26.23 C ATOM 13766 O MET B 363 46.178 43.692 51.219 1.00 24.93 O ATOM 13767 CB MET B 363 46.603 40.445 51.623 1.00 28.76 C ATOM 13768 CG MET B 363 45.572 40.485 50.523 1.00 32.26 C ATOM 13769 SD MET B 363 46.273 40.239 48.873 1.00 38.70 S ATOM 13770 CE MET B 363 44.947 40.893 47.867 1.00 36.32 C ATOM 13771 HA MET B 363 47.909 41.881 50.715 1.00 0.00 H ATOM 13772 HB2 MET B 363 47.252 39.586 51.456 1.00 0.00 H ATOM 13773 HB3 MET B 363 46.086 40.328 52.575 1.00 0.00 H ATOM 13774 HG2 MET B 363 45.077 41.456 50.548 1.00 0.00 H ATOM 13775 HG3 MET B 363 44.838 39.700 50.708 1.00 0.00 H ATOM 13776 HE1 MET B 363 44.037 40.321 48.051 1.00 0.00 H ATOM 13777 HE2 MET B 363 44.779 41.939 48.125 1.00 0.00 H ATOM 13778 HE3 MET B 363 45.219 40.816 46.814 1.00 0.00 H ATOM 13779 H MET B 363 48.613 40.648 53.213 1.00 0.00 H ATOM 13780 N ILE B 364 46.340 43.061 53.373 1.00 25.99 N ATOM 13781 CA ILE B 364 45.562 44.201 53.867 1.00 26.48 C ATOM 13782 C ILE B 364 46.313 45.508 53.602 1.00 26.46 C ATOM 13783 O ILE B 364 45.740 46.463 53.094 1.00 26.61 O ATOM 13784 CB ILE B 364 45.234 44.068 55.379 1.00 26.38 C ATOM 13785 CG1 ILE B 364 44.269 42.903 55.627 1.00 26.06 C ATOM 13786 CG2 ILE B 364 44.638 45.374 55.914 1.00 25.12 C ATOM 13787 CD1 ILE B 364 44.468 42.215 56.978 1.00 24.48 C ATOM 13788 HA ILE B 364 44.616 44.212 53.326 1.00 0.00 H ATOM 13789 HB ILE B 364 46.163 43.863 55.911 1.00 0.00 H ATOM 13790 HG12 ILE B 364 43.249 43.285 55.582 1.00 0.00 H ATOM 13791 HG13 ILE B 364 44.413 42.163 54.840 1.00 0.00 H ATOM 13792 HD11 ILE B 364 45.481 41.816 57.035 1.00 0.00 H ATOM 13793 HD12 ILE B 364 44.316 42.939 57.779 1.00 0.00 H ATOM 13794 HD13 ILE B 364 43.749 41.402 57.080 1.00 0.00 H ATOM 13795 HG21 ILE B 364 45.356 46.183 55.776 1.00 0.00 H ATOM 13796 HG22 ILE B 364 43.721 45.603 55.370 1.00 0.00 H ATOM 13797 HG23 ILE B 364 44.414 45.262 56.975 1.00 0.00 H ATOM 13798 H ILE B 364 46.691 42.353 54.050 1.00 0.00 H ATOM 13799 N ALA B 365 47.602 45.535 53.940 1.00 28.13 N ATOM 13800 CA ALA B 365 48.429 46.719 53.717 1.00 28.25 C ATOM 13801 C ALA B 365 48.471 47.100 52.242 1.00 30.70 C ATOM 13802 O ALA B 365 48.417 48.281 51.916 1.00 31.87 O ATOM 13803 CB ALA B 365 49.837 46.505 54.251 1.00 28.91 C ATOM 13804 HA ALA B 365 47.973 47.544 54.264 1.00 0.00 H ATOM 13805 HB1 ALA B 365 49.792 46.305 55.321 1.00 0.00 H ATOM 13806 HB2 ALA B 365 50.293 45.657 53.740 1.00 0.00 H ATOM 13807 HB3 ALA B 365 50.432 47.401 54.073 1.00 0.00 H ATOM 13808 H ALA B 365 48.030 44.692 54.373 1.00 0.00 H ATOM 13809 N PHE B 366 48.556 46.108 51.352 1.00 28.94 N ATOM 13810 CA PHE B 366 48.581 46.388 49.917 1.00 27.48 C ATOM 13811 C PHE B 366 47.310 47.062 49.441 1.00 28.84 C ATOM 13812 O PHE B 366 47.361 48.042 48.700 1.00 29.15 O ATOM 13813 CB PHE B 366 48.791 45.115 49.080 1.00 27.37 C ATOM 13814 CG PHE B 366 48.571 45.334 47.605 1.00 25.62 C ATOM 13815 CD1 PHE B 366 49.563 45.908 46.822 1.00 24.93 C ATOM 13816 CD2 PHE B 366 47.370 44.988 47.010 1.00 25.81 C ATOM 13817 CE1 PHE B 366 49.364 46.129 45.467 1.00 25.94 C ATOM 13818 CE2 PHE B 366 47.164 45.202 45.647 1.00 25.93 C ATOM 13819 CZ PHE B 366 48.158 45.776 44.882 1.00 25.18 C ATOM 13820 HA PHE B 366 49.425 47.062 49.773 1.00 0.00 H ATOM 13821 HB2 PHE B 366 49.812 44.765 49.231 1.00 0.00 H ATOM 13822 HB3 PHE B 366 48.093 44.353 49.426 1.00 0.00 H ATOM 13823 HD2 PHE B 366 46.577 44.544 47.612 1.00 0.00 H ATOM 13824 HE2 PHE B 366 46.218 44.916 45.187 1.00 0.00 H ATOM 13825 HZ PHE B 366 47.995 45.952 43.819 1.00 0.00 H ATOM 13826 HE1 PHE B 366 50.153 46.579 44.864 1.00 0.00 H ATOM 13827 HD1 PHE B 366 50.512 46.189 47.278 1.00 0.00 H ATOM 13828 H PHE B 366 48.605 45.124 51.684 1.00 0.00 H ATOM 13829 N LEU B 367 46.169 46.522 49.846 1.00 28.22 N ATOM 13830 CA LEU B 367 44.889 47.067 49.419 1.00 28.26 C ATOM 13831 C LEU B 367 44.661 48.476 49.987 1.00 29.33 C ATOM 13832 O LEU B 367 44.090 49.334 49.318 1.00 29.81 O ATOM 13833 CB LEU B 367 43.752 46.115 49.812 1.00 27.88 C ATOM 13834 CG LEU B 367 43.743 44.747 49.109 1.00 27.38 C ATOM 13835 CD1 LEU B 367 42.745 43.783 49.736 1.00 23.76 C ATOM 13836 CD2 LEU B 367 43.450 44.910 47.629 1.00 24.74 C ATOM 13837 HA LEU B 367 44.901 47.159 48.333 1.00 0.00 H ATOM 13838 HB2 LEU B 367 43.821 45.938 50.885 1.00 0.00 H ATOM 13839 HB3 LEU B 367 42.808 46.612 49.587 1.00 0.00 H ATOM 13840 HG LEU B 367 44.737 44.318 49.235 1.00 0.00 H ATOM 13841 HD21 LEU B 367 42.474 45.379 47.503 1.00 0.00 H ATOM 13842 HD22 LEU B 367 44.218 45.536 47.175 1.00 0.00 H ATOM 13843 HD23 LEU B 367 43.448 43.931 47.150 1.00 0.00 H ATOM 13844 HD11 LEU B 367 43.004 43.624 50.783 1.00 0.00 H ATOM 13845 HD12 LEU B 367 41.742 44.205 49.668 1.00 0.00 H ATOM 13846 HD13 LEU B 367 42.777 42.832 49.204 1.00 0.00 H ATOM 13847 H LEU B 367 46.189 45.697 50.478 1.00 0.00 H ATOM 13848 N GLU B 368 45.114 48.706 51.218 1.00 29.56 N ATOM 13849 CA GLU B 368 45.059 50.028 51.840 1.00 30.73 C ATOM 13850 C GLU B 368 46.007 51.009 51.151 1.00 31.38 C ATOM 13851 O GLU B 368 45.575 52.030 50.617 1.00 32.78 O ATOM 13852 CB GLU B 368 45.429 49.942 53.322 1.00 31.28 C ATOM 13853 CG GLU B 368 44.404 49.233 54.191 1.00 33.57 C ATOM 13854 CD GLU B 368 44.904 48.995 55.602 1.00 33.96 C ATOM 13855 OE1 GLU B 368 46.115 49.166 55.855 1.00 36.70 O ATOM 13856 OE2 GLU B 368 44.092 48.630 56.465 1.00 34.70 O ATOM 13857 HA GLU B 368 44.036 50.390 51.735 1.00 0.00 H ATOM 13858 HB2 GLU B 368 46.375 49.406 53.406 1.00 0.00 H ATOM 13859 HB3 GLU B 368 45.553 50.956 53.701 1.00 0.00 H ATOM 13860 HG2 GLU B 368 43.503 49.844 54.238 1.00 0.00 H ATOM 13861 HG3 GLU B 368 44.166 48.271 53.737 1.00 0.00 H ATOM 13862 H GLU B 368 45.522 47.916 51.757 1.00 0.00 H ATOM 13863 N ASP B 369 47.295 50.682 51.176 1.00 30.82 N ATOM 13864 CA ASP B 369 48.355 51.515 50.623 1.00 30.50 C ATOM 13865 C ASP B 369 48.212 51.806 49.133 1.00 31.18 C ATOM 13866 O ASP B 369 48.276 52.958 48.718 1.00 30.61 O ATOM 13867 CB ASP B 369 49.719 50.836 50.810 1.00 31.06 C ATOM 13868 CG ASP B 369 50.117 50.666 52.270 1.00 31.45 C ATOM 13869 OD1 ASP B 369 49.373 51.118 53.166 1.00 30.82 O ATOM 13870 OD2 ASP B 369 51.203 50.075 52.511 1.00 31.11 O ATOM 13871 HA ASP B 369 48.278 52.456 51.167 1.00 0.00 H ATOM 13872 HB2 ASP B 369 49.681 49.851 50.345 1.00 0.00 H ATOM 13873 HB3 ASP B 369 50.477 51.441 50.313 1.00 0.00 H ATOM 13874 H ASP B 369 47.562 49.778 51.616 1.00 0.00 H ATOM 13875 N GLU B 370 48.033 50.756 48.331 1.00 30.44 N ATOM 13876 CA GLU B 370 48.129 50.888 46.870 1.00 30.71 C ATOM 13877 C GLU B 370 46.794 51.015 46.153 1.00 29.53 C ATOM 13878 O GLU B 370 46.715 51.672 45.127 1.00 30.50 O ATOM 13879 CB GLU B 370 48.922 49.713 46.276 1.00 30.20 C ATOM 13880 CG GLU B 370 50.102 49.269 47.124 1.00 30.79 C ATOM 13881 CD GLU B 370 51.133 50.357 47.361 1.00 32.05 C ATOM 13882 OE1 GLU B 370 51.106 51.381 46.651 1.00 33.26 O ATOM 13883 OE2 GLU B 370 51.989 50.180 48.252 1.00 33.41 O ATOM 13884 HA GLU B 370 48.651 51.830 46.704 1.00 0.00 H ATOM 13885 HB2 GLU B 370 48.245 48.866 46.161 1.00 0.00 H ATOM 13886 HB3 GLU B 370 49.297 50.013 45.297 1.00 0.00 H ATOM 13887 HG2 GLU B 370 49.724 48.937 48.091 1.00 0.00 H ATOM 13888 HG3 GLU B 370 50.592 48.435 46.621 1.00 0.00 H ATOM 13889 H GLU B 370 47.822 49.826 48.747 1.00 0.00 H ATOM 13890 N LEU B 371 45.748 50.395 46.678 1.00 28.69 N ATOM 13891 CA LEU B 371 44.438 50.475 46.025 1.00 28.89 C ATOM 13892 C LEU B 371 43.461 51.385 46.782 1.00 30.56 C ATOM 13893 O LEU B 371 42.291 51.508 46.401 1.00 28.39 O ATOM 13894 CB LEU B 371 43.831 49.082 45.834 1.00 28.93 C ATOM 13895 CG LEU B 371 44.443 48.152 44.782 1.00 28.51 C ATOM 13896 CD1 LEU B 371 43.584 46.910 44.633 1.00 28.37 C ATOM 13897 CD2 LEU B 371 44.577 48.855 43.444 1.00 28.87 C ATOM 13898 HA LEU B 371 44.606 50.922 45.045 1.00 0.00 H ATOM 13899 HB2 LEU B 371 43.896 48.569 46.793 1.00 0.00 H ATOM 13900 HB3 LEU B 371 42.783 49.222 45.569 1.00 0.00 H ATOM 13901 HG LEU B 371 45.440 47.866 45.115 1.00 0.00 H ATOM 13902 HD21 LEU B 371 43.592 49.171 43.101 1.00 0.00 H ATOM 13903 HD22 LEU B 371 45.221 49.727 43.556 1.00 0.00 H ATOM 13904 HD23 LEU B 371 45.014 48.170 42.717 1.00 0.00 H ATOM 13905 HD11 LEU B 371 43.532 46.389 45.589 1.00 0.00 H ATOM 13906 HD12 LEU B 371 42.581 47.199 44.320 1.00 0.00 H ATOM 13907 HD13 LEU B 371 44.025 46.253 43.883 1.00 0.00 H ATOM 13908 H LEU B 371 45.856 49.849 47.557 1.00 0.00 H ATOM 13909 N LYS B 372 43.959 52.001 47.853 1.00 30.05 N ATOM 13910 CA LYS B 372 43.218 52.984 48.657 1.00 34.23 C ATOM 13911 C LYS B 372 41.903 52.465 49.236 1.00 34.10 C ATOM 13912 O LYS B 372 40.940 53.219 49.376 1.00 35.28 O ATOM 13913 CB LYS B 372 42.980 54.280 47.862 1.00 34.62 C ATOM 13914 CG LYS B 372 44.240 54.868 47.233 1.00 35.76 C ATOM 13915 CD LYS B 372 45.362 55.078 48.243 1.00 36.75 C ATOM 13916 CE LYS B 372 46.593 55.639 47.541 1.00 38.35 C ATOM 13917 NZ LYS B 372 47.760 55.808 48.453 1.00 39.02 N ATOM 13918 HA LYS B 372 43.858 53.192 49.514 1.00 0.00 H ATOM 13919 HB2 LYS B 372 42.267 54.067 47.065 1.00 0.00 H ATOM 13920 HB3 LYS B 372 42.556 55.023 48.538 1.00 0.00 H ATOM 13921 HG2 LYS B 372 44.592 54.188 46.457 1.00 0.00 H ATOM 13922 HG3 LYS B 372 43.990 55.830 46.785 1.00 0.00 H ATOM 13923 HD2 LYS B 372 45.032 55.779 49.010 1.00 0.00 H ATOM 13924 HD3 LYS B 372 45.614 54.125 48.708 1.00 0.00 H ATOM 13925 HE2 LYS B 372 46.339 56.611 47.118 1.00 0.00 H ATOM 13926 HE3 LYS B 372 46.875 54.958 46.738 1.00 0.00 H ATOM 13927 HZ1 LYS B 372 47.507 56.464 49.219 1.00 0.00 H ATOM 13928 HZ2 LYS B 372 48.020 54.885 48.856 1.00 0.00 H ATOM 13929 HZ3 LYS B 372 48.564 56.192 47.917 1.00 0.00 H ATOM 13930 H LYS B 372 44.933 51.772 48.138 1.00 0.00 H ATOM 13931 N LEU B 373 41.865 51.180 49.568 1.00 33.12 N ATOM 13932 CA LEU B 373 40.722 50.620 50.263 1.00 31.75 C ATOM 13933 C LEU B 373 40.754 51.045 51.721 1.00 31.23 C ATOM 13934 O LEU B 373 41.819 51.240 52.303 1.00 29.44 O ATOM 13935 CB LEU B 373 40.727 49.093 50.167 1.00 32.86 C ATOM 13936 CG LEU B 373 39.947 48.449 49.011 1.00 33.99 C ATOM 13937 CD1 LEU B 373 40.289 49.076 47.666 1.00 32.51 C ATOM 13938 CD2 LEU B 373 40.166 46.943 48.971 1.00 34.25 C ATOM 13939 HA LEU B 373 39.811 50.992 49.794 1.00 0.00 H ATOM 13940 HB2 LEU B 373 41.766 48.775 50.076 1.00 0.00 H ATOM 13941 HB3 LEU B 373 40.310 48.706 51.097 1.00 0.00 H ATOM 13942 HG LEU B 373 38.891 48.640 49.200 1.00 0.00 H ATOM 13943 HD21 LEU B 373 41.227 46.735 48.834 1.00 0.00 H ATOM 13944 HD22 LEU B 373 39.826 46.503 49.908 1.00 0.00 H ATOM 13945 HD23 LEU B 373 39.601 46.517 48.142 1.00 0.00 H ATOM 13946 HD11 LEU B 373 40.045 50.138 47.689 1.00 0.00 H ATOM 13947 HD12 LEU B 373 41.354 48.950 47.468 1.00 0.00 H ATOM 13948 HD13 LEU B 373 39.712 48.587 46.881 1.00 0.00 H ATOM 13949 H LEU B 373 42.668 50.565 49.326 1.00 0.00 H ATOM 13950 N SER B 374 39.584 51.201 52.319 1.00 30.76 N ATOM 13951 CA SER B 374 39.529 51.451 53.752 1.00 31.25 C ATOM 13952 C SER B 374 40.002 50.181 54.452 1.00 31.24 C ATOM 13953 O SER B 374 40.099 49.126 53.816 1.00 31.22 O ATOM 13954 CB SER B 374 38.102 51.736 54.163 1.00 30.04 C ATOM 13955 OG SER B 374 37.306 50.616 53.833 1.00 30.89 O ATOM 13956 HA SER B 374 40.152 52.305 54.017 1.00 0.00 H ATOM 13957 HB2 SER B 374 37.736 52.616 53.634 1.00 0.00 H ATOM 13958 HB3 SER B 374 38.058 51.915 55.237 1.00 0.00 H ATOM 13959 HG SER B 374 37.351 50.457 52.857 1.00 0.00 H ATOM 13960 H SER B 374 38.705 51.145 51.766 1.00 0.00 H ATOM 13961 N ARG B 375 40.291 50.281 55.748 1.00 30.21 N ATOM 13962 CA ARG B 375 40.733 49.132 56.532 1.00 32.12 C ATOM 13963 C ARG B 375 39.664 48.043 56.566 1.00 31.75 C ATOM 13964 O ARG B 375 39.958 46.873 56.337 1.00 30.91 O ATOM 13965 CB ARG B 375 41.099 49.546 57.953 1.00 33.23 C ATOM 13966 CG ARG B 375 41.641 48.405 58.816 1.00 35.69 C ATOM 13967 CD ARG B 375 42.246 48.964 60.089 1.00 37.97 C ATOM 13968 NE ARG B 375 41.222 49.631 60.886 1.00 39.85 N ATOM 13969 CZ ARG B 375 41.420 50.731 61.606 1.00 40.96 C ATOM 13970 NH1 ARG B 375 42.611 51.317 61.638 1.00 40.03 N ATOM 13971 NH2 ARG B 375 40.413 51.252 62.294 1.00 41.71 N ATOM 13972 HA ARG B 375 41.622 48.730 56.046 1.00 0.00 H ATOM 13973 HB2 ARG B 375 41.860 50.325 57.898 1.00 0.00 H ATOM 13974 HB3 ARG B 375 40.206 49.945 58.434 1.00 0.00 H ATOM 13975 HG2 ARG B 375 40.827 47.726 59.070 1.00 0.00 H ATOM 13976 HG3 ARG B 375 42.406 47.862 58.260 1.00 0.00 H ATOM 13977 HD2 ARG B 375 43.026 49.681 59.832 1.00 0.00 H ATOM 13978 HD3 ARG B 375 42.680 48.150 60.669 1.00 0.00 H ATOM 13979 HE ARG B 375 40.268 49.216 60.891 1.00 0.00 H ATOM 13980 HH12 ARG B 375 42.752 52.177 62.205 1.00 0.00 H ATOM 13981 HH11 ARG B 375 43.403 50.916 61.096 1.00 0.00 H ATOM 13982 HH22 ARG B 375 40.560 52.112 62.860 1.00 0.00 H ATOM 13983 HH21 ARG B 375 39.477 50.800 62.268 1.00 0.00 H ATOM 13984 H ARG B 375 40.199 51.205 56.216 1.00 0.00 H ATOM 13985 N LYS B 376 38.431 48.444 56.850 1.00 31.60 N ATOM 13986 CA LYS B 376 37.291 47.534 56.840 1.00 32.24 C ATOM 13987 C LYS B 376 37.252 46.689 55.560 1.00 31.94 C ATOM 13988 O LYS B 376 37.282 45.463 55.623 1.00 33.33 O ATOM 13989 CB LYS B 376 35.990 48.327 56.992 1.00 33.45 C ATOM 13990 CG LYS B 376 34.714 47.499 56.952 1.00 37.17 C ATOM 13991 CD LYS B 376 33.487 48.414 56.865 1.00 40.09 C ATOM 13992 CE LYS B 376 32.181 47.626 56.775 1.00 43.59 C ATOM 13993 NZ LYS B 376 31.991 46.935 55.452 1.00 45.66 N ATOM 13994 HA LYS B 376 37.399 46.850 57.682 1.00 0.00 H ATOM 13995 HB2 LYS B 376 36.023 48.849 57.949 1.00 0.00 H ATOM 13996 HB3 LYS B 376 35.944 49.056 56.183 1.00 0.00 H ATOM 13997 HG2 LYS B 376 34.737 46.845 56.081 1.00 0.00 H ATOM 13998 HG3 LYS B 376 34.649 46.895 57.857 1.00 0.00 H ATOM 13999 HD2 LYS B 376 33.456 49.044 57.754 1.00 0.00 H ATOM 14000 HD3 LYS B 376 33.580 49.042 55.979 1.00 0.00 H ATOM 14001 HE2 LYS B 376 31.350 48.315 56.928 1.00 0.00 H ATOM 14002 HE3 LYS B 376 32.177 46.873 57.563 1.00 0.00 H ATOM 14003 HZ1 LYS B 376 31.983 47.643 54.690 1.00 0.00 H ATOM 14004 HZ2 LYS B 376 32.772 46.266 55.296 1.00 0.00 H ATOM 14005 HZ3 LYS B 376 31.088 46.420 55.458 1.00 0.00 H ATOM 14006 H LYS B 376 38.272 49.444 57.088 1.00 0.00 H ATOM 14007 N HIS B 377 37.191 47.347 54.407 1.00 30.62 N ATOM 14008 CA HIS B 377 37.105 46.644 53.133 1.00 30.46 C ATOM 14009 C HIS B 377 38.325 45.793 52.844 1.00 28.46 C ATOM 14010 O HIS B 377 38.193 44.696 52.322 1.00 30.56 O ATOM 14011 CB HIS B 377 36.867 47.613 51.974 1.00 31.53 C ATOM 14012 CG HIS B 377 35.544 48.310 52.032 1.00 33.95 C ATOM 14013 ND1 HIS B 377 35.355 49.591 51.556 1.00 35.01 N ATOM 14014 CD2 HIS B 377 34.343 47.906 52.511 1.00 35.01 C ATOM 14015 CE1 HIS B 377 34.096 49.943 51.736 1.00 34.62 C ATOM 14016 NE2 HIS B 377 33.461 48.940 52.316 1.00 34.54 N ATOM 14017 HA HIS B 377 36.249 45.975 53.223 1.00 0.00 H ATOM 14018 HB2 HIS B 377 37.654 48.367 51.989 1.00 0.00 H ATOM 14019 HB3 HIS B 377 36.920 47.053 51.041 1.00 0.00 H ATOM 14020 HD2 HIS B 377 34.119 46.941 52.966 1.00 0.00 H ATOM 14021 HE1 HIS B 377 33.655 50.899 51.454 1.00 0.00 H ATOM 14022 H HIS B 377 37.205 48.387 54.414 1.00 0.00 H ATOM 14023 N ALA B 378 39.508 46.291 53.184 1.00 27.55 N ATOM 14024 CA ALA B 378 40.743 45.551 52.938 1.00 26.54 C ATOM 14025 C ALA B 378 40.778 44.237 53.719 1.00 27.53 C ATOM 14026 O ALA B 378 41.194 43.203 53.188 1.00 26.08 O ATOM 14027 CB ALA B 378 41.962 46.399 53.285 1.00 24.67 C ATOM 14028 HA ALA B 378 40.770 45.313 51.875 1.00 0.00 H ATOM 14029 HB1 ALA B 378 41.963 47.299 52.671 1.00 0.00 H ATOM 14030 HB2 ALA B 378 41.922 46.676 54.338 1.00 0.00 H ATOM 14031 HB3 ALA B 378 42.869 45.825 53.093 1.00 0.00 H ATOM 14032 H ALA B 378 39.556 47.227 53.635 1.00 0.00 H ATOM 14033 N VAL B 379 40.347 44.298 54.983 1.00 26.92 N ATOM 14034 CA VAL B 379 40.297 43.135 55.858 1.00 24.69 C ATOM 14035 C VAL B 379 39.264 42.123 55.383 1.00 25.73 C ATOM 14036 O VAL B 379 39.545 40.924 55.313 1.00 25.70 O ATOM 14037 CB VAL B 379 39.965 43.543 57.309 1.00 26.18 C ATOM 14038 CG1 VAL B 379 39.551 42.319 58.145 1.00 23.33 C ATOM 14039 CG2 VAL B 379 41.142 44.276 57.941 1.00 22.72 C ATOM 14040 HA VAL B 379 41.286 42.677 55.827 1.00 0.00 H ATOM 14041 HB VAL B 379 39.116 44.227 57.288 1.00 0.00 H ATOM 14042 HG11 VAL B 379 38.669 41.858 57.700 1.00 0.00 H ATOM 14043 HG12 VAL B 379 40.369 41.599 58.162 1.00 0.00 H ATOM 14044 HG13 VAL B 379 39.323 42.636 59.163 1.00 0.00 H ATOM 14045 HG21 VAL B 379 42.014 43.622 57.947 1.00 0.00 H ATOM 14046 HG22 VAL B 379 41.363 45.173 57.362 1.00 0.00 H ATOM 14047 HG23 VAL B 379 40.888 44.555 58.964 1.00 0.00 H ATOM 14048 H VAL B 379 40.034 45.216 55.358 1.00 0.00 H ATOM 14049 N LEU B 380 38.072 42.609 55.053 1.00 25.66 N ATOM 14050 CA LEU B 380 36.981 41.733 54.633 1.00 27.48 C ATOM 14051 C LEU B 380 37.267 41.030 53.309 1.00 28.03 C ATOM 14052 O LEU B 380 36.972 39.847 53.170 1.00 28.06 O ATOM 14053 CB LEU B 380 35.654 42.499 54.571 1.00 27.07 C ATOM 14054 CG LEU B 380 35.105 42.928 55.940 1.00 28.12 C ATOM 14055 CD1 LEU B 380 33.806 43.738 55.804 1.00 28.10 C ATOM 14056 CD2 LEU B 380 34.886 41.708 56.818 1.00 29.10 C ATOM 14057 HA LEU B 380 36.897 40.954 55.390 1.00 0.00 H ATOM 14058 HB2 LEU B 380 35.805 43.394 53.968 1.00 0.00 H ATOM 14059 HB3 LEU B 380 34.913 41.860 54.091 1.00 0.00 H ATOM 14060 HG LEU B 380 35.844 43.577 56.410 1.00 0.00 H ATOM 14061 HD21 LEU B 380 34.171 41.040 56.338 1.00 0.00 H ATOM 14062 HD22 LEU B 380 35.834 41.188 56.958 1.00 0.00 H ATOM 14063 HD23 LEU B 380 34.497 42.024 57.786 1.00 0.00 H ATOM 14064 HD11 LEU B 380 33.998 44.635 55.215 1.00 0.00 H ATOM 14065 HD12 LEU B 380 33.051 43.130 55.306 1.00 0.00 H ATOM 14066 HD13 LEU B 380 33.451 44.022 56.795 1.00 0.00 H ATOM 14067 H LEU B 380 37.912 43.636 55.095 1.00 0.00 H ATOM 14068 N TRP B 381 37.834 41.759 52.346 1.00 28.19 N ATOM 14069 CA TRP B 381 38.173 41.178 51.050 1.00 29.85 C ATOM 14070 C TRP B 381 39.312 40.188 51.179 1.00 29.44 C ATOM 14071 O TRP B 381 39.300 39.151 50.529 1.00 31.52 O ATOM 14072 CB TRP B 381 38.511 42.252 50.008 1.00 27.97 C ATOM 14073 CG TRP B 381 37.294 42.811 49.343 1.00 28.08 C ATOM 14074 CD1 TRP B 381 36.789 44.071 49.480 1.00 28.44 C ATOM 14075 CD2 TRP B 381 36.408 42.119 48.444 1.00 28.80 C ATOM 14076 NE1 TRP B 381 35.654 44.212 48.721 1.00 29.61 N ATOM 14077 CE2 TRP B 381 35.397 43.028 48.077 1.00 28.58 C ATOM 14078 CE3 TRP B 381 36.380 40.823 47.913 1.00 27.27 C ATOM 14079 CZ2 TRP B 381 34.370 42.687 47.206 1.00 28.82 C ATOM 14080 CZ3 TRP B 381 35.364 40.486 47.050 1.00 28.47 C ATOM 14081 CH2 TRP B 381 34.367 41.413 46.703 1.00 29.10 C ATOM 14082 HA TRP B 381 37.288 40.647 50.699 1.00 0.00 H ATOM 14083 HB2 TRP B 381 39.043 43.064 50.503 1.00 0.00 H ATOM 14084 HB3 TRP B 381 39.153 41.810 49.246 1.00 0.00 H ATOM 14085 HE1 TRP B 381 35.081 45.077 48.646 1.00 0.00 H ATOM 14086 HD1 TRP B 381 37.224 44.853 50.102 1.00 0.00 H ATOM 14087 HZ2 TRP B 381 33.597 43.405 46.933 1.00 0.00 H ATOM 14088 HH2 TRP B 381 33.574 41.112 46.019 1.00 0.00 H ATOM 14089 HZ3 TRP B 381 35.332 39.482 46.628 1.00 0.00 H ATOM 14090 HE3 TRP B 381 37.148 40.097 48.179 1.00 0.00 H ATOM 14091 H TRP B 381 38.039 42.763 52.522 1.00 0.00 H ATOM 14092 N THR B 382 40.282 40.510 52.029 1.00 30.00 N ATOM 14093 CA THR B 382 41.398 39.616 52.301 1.00 28.57 C ATOM 14094 C THR B 382 40.894 38.309 52.926 1.00 30.45 C ATOM 14095 O THR B 382 41.267 37.220 52.489 1.00 30.96 O ATOM 14096 CB THR B 382 42.458 40.298 53.184 1.00 28.26 C ATOM 14097 OG1 THR B 382 43.033 41.391 52.459 1.00 26.86 O ATOM 14098 CG2 THR B 382 43.571 39.328 53.587 1.00 25.92 C ATOM 14099 HA THR B 382 41.882 39.372 51.355 1.00 0.00 H ATOM 14100 HB THR B 382 41.968 40.647 54.093 1.00 0.00 H ATOM 14101 HG1 THR B 382 42.323 42.040 52.226 1.00 0.00 H ATOM 14102 HG23 THR B 382 43.141 38.493 54.140 1.00 0.00 H ATOM 14103 HG21 THR B 382 44.068 38.955 52.691 1.00 0.00 H ATOM 14104 HG22 THR B 382 44.294 39.848 54.216 1.00 0.00 H ATOM 14105 H THR B 382 40.242 41.429 52.515 1.00 0.00 H ATOM 14106 N ALA B 383 40.038 38.425 53.935 1.00 29.39 N ATOM 14107 CA ALA B 383 39.438 37.264 54.583 1.00 28.59 C ATOM 14108 C ALA B 383 38.605 36.433 53.597 1.00 28.78 C ATOM 14109 O ALA B 383 38.596 35.205 53.664 1.00 28.19 O ATOM 14110 CB ALA B 383 38.569 37.710 55.745 1.00 28.90 C ATOM 14111 HA ALA B 383 40.247 36.634 54.952 1.00 0.00 H ATOM 14112 HB1 ALA B 383 39.181 38.249 56.468 1.00 0.00 H ATOM 14113 HB2 ALA B 383 37.779 38.364 55.376 1.00 0.00 H ATOM 14114 HB3 ALA B 383 38.126 36.836 56.222 1.00 0.00 H ATOM 14115 H ALA B 383 39.787 39.375 54.274 1.00 0.00 H ATOM 14116 N ALA B 384 37.894 37.118 52.702 1.00 26.84 N ATOM 14117 CA ALA B 384 37.090 36.463 51.669 1.00 27.30 C ATOM 14118 C ALA B 384 37.946 35.613 50.715 1.00 27.75 C ATOM 14119 O ALA B 384 37.550 34.503 50.365 1.00 27.92 O ATOM 14120 CB ALA B 384 36.276 37.498 50.885 1.00 25.47 C ATOM 14121 HA ALA B 384 36.405 35.784 52.177 1.00 0.00 H ATOM 14122 HB1 ALA B 384 35.612 38.029 51.567 1.00 0.00 H ATOM 14123 HB2 ALA B 384 36.954 38.207 50.410 1.00 0.00 H ATOM 14124 HB3 ALA B 384 35.685 36.991 50.122 1.00 0.00 H ATOM 14125 H ALA B 384 37.911 38.157 52.739 1.00 0.00 H ATOM 14126 N ILE B 385 39.108 36.129 50.312 1.00 28.96 N ATOM 14127 CA ILE B 385 40.017 35.398 49.414 1.00 29.57 C ATOM 14128 C ILE B 385 40.641 34.204 50.127 1.00 28.84 C ATOM 14129 O ILE B 385 40.760 33.114 49.559 1.00 27.01 O ATOM 14130 CB ILE B 385 41.173 36.266 48.870 1.00 31.22 C ATOM 14131 CG1 ILE B 385 40.676 37.631 48.377 1.00 34.87 C ATOM 14132 CG2 ILE B 385 41.922 35.527 47.760 1.00 31.66 C ATOM 14133 CD1 ILE B 385 39.569 37.570 47.336 1.00 37.84 C ATOM 14134 HA ILE B 385 39.394 35.081 48.578 1.00 0.00 H ATOM 14135 HB ILE B 385 41.863 36.450 49.693 1.00 0.00 H ATOM 14136 HG12 ILE B 385 40.303 38.187 49.237 1.00 0.00 H ATOM 14137 HG13 ILE B 385 41.522 38.163 47.942 1.00 0.00 H ATOM 14138 HD11 ILE B 385 39.926 37.030 46.459 1.00 0.00 H ATOM 14139 HD12 ILE B 385 38.706 37.054 47.756 1.00 0.00 H ATOM 14140 HD13 ILE B 385 39.285 38.583 47.050 1.00 0.00 H ATOM 14141 HG21 ILE B 385 42.332 34.598 48.156 1.00 0.00 H ATOM 14142 HG22 ILE B 385 41.233 35.303 46.945 1.00 0.00 H ATOM 14143 HG23 ILE B 385 42.732 36.155 47.390 1.00 0.00 H ATOM 14144 H ILE B 385 39.380 37.077 50.642 1.00 0.00 H ATOM 14145 N VAL B 386 41.051 34.413 51.370 1.00 25.96 N ATOM 14146 CA VAL B 386 41.635 33.325 52.145 1.00 26.80 C ATOM 14147 C VAL B 386 40.600 32.233 52.437 1.00 26.63 C ATOM 14148 O VAL B 386 40.900 31.047 52.309 1.00 29.22 O ATOM 14149 CB VAL B 386 42.282 33.839 53.452 1.00 25.93 C ATOM 14150 CG1 VAL B 386 42.676 32.682 54.352 1.00 23.99 C ATOM 14151 CG2 VAL B 386 43.498 34.697 53.117 1.00 24.11 C ATOM 14152 HA VAL B 386 42.426 32.884 51.538 1.00 0.00 H ATOM 14153 HB VAL B 386 41.554 34.446 53.990 1.00 0.00 H ATOM 14154 HG11 VAL B 386 41.789 32.101 54.604 1.00 0.00 H ATOM 14155 HG12 VAL B 386 43.392 32.046 53.832 1.00 0.00 H ATOM 14156 HG13 VAL B 386 43.129 33.071 55.264 1.00 0.00 H ATOM 14157 HG21 VAL B 386 44.222 34.099 52.564 1.00 0.00 H ATOM 14158 HG22 VAL B 386 43.186 35.546 52.508 1.00 0.00 H ATOM 14159 HG23 VAL B 386 43.952 35.058 54.040 1.00 0.00 H ATOM 14160 H VAL B 386 40.956 35.358 51.794 1.00 0.00 H ATOM 14161 N PHE B 387 39.391 32.640 52.812 1.00 27.54 N ATOM 14162 CA PHE B 387 38.312 31.703 53.132 1.00 27.34 C ATOM 14163 C PHE B 387 37.906 30.885 51.908 1.00 27.35 C ATOM 14164 O PHE B 387 37.910 29.651 51.946 1.00 24.88 O ATOM 14165 CB PHE B 387 37.094 32.450 53.694 1.00 28.23 C ATOM 14166 CG PHE B 387 35.888 31.571 53.929 1.00 29.11 C ATOM 14167 CD1 PHE B 387 35.880 30.635 54.952 1.00 27.93 C ATOM 14168 CD2 PHE B 387 34.755 31.693 53.129 1.00 30.31 C ATOM 14169 CE1 PHE B 387 34.773 29.826 55.170 1.00 28.87 C ATOM 14170 CE2 PHE B 387 33.639 30.885 53.342 1.00 30.02 C ATOM 14171 CZ PHE B 387 33.651 29.951 54.365 1.00 29.60 C ATOM 14172 HA PHE B 387 38.686 31.017 53.892 1.00 0.00 H ATOM 14173 HB2 PHE B 387 37.378 32.904 54.644 1.00 0.00 H ATOM 14174 HB3 PHE B 387 36.816 33.232 52.988 1.00 0.00 H ATOM 14175 HD2 PHE B 387 34.740 32.430 52.326 1.00 0.00 H ATOM 14176 HE2 PHE B 387 32.760 30.988 52.706 1.00 0.00 H ATOM 14177 HZ PHE B 387 32.781 29.317 54.537 1.00 0.00 H ATOM 14178 HE1 PHE B 387 34.786 29.091 55.975 1.00 0.00 H ATOM 14179 HD1 PHE B 387 36.755 30.533 55.594 1.00 0.00 H ATOM 14180 H PHE B 387 39.205 33.661 52.881 1.00 0.00 H ATOM 14181 N PHE B 388 37.536 31.573 50.831 1.00 24.92 N ATOM 14182 CA PHE B 388 37.197 30.881 49.602 1.00 25.57 C ATOM 14183 C PHE B 388 38.322 29.924 49.191 1.00 25.08 C ATOM 14184 O PHE B 388 38.066 28.754 48.916 1.00 25.22 O ATOM 14185 CB PHE B 388 36.897 31.853 48.453 1.00 25.44 C ATOM 14186 CG PHE B 388 37.020 31.210 47.096 1.00 25.75 C ATOM 14187 CD1 PHE B 388 35.984 30.456 46.578 1.00 25.17 C ATOM 14188 CD2 PHE B 388 38.188 31.332 46.358 1.00 25.76 C ATOM 14189 CE1 PHE B 388 36.100 29.850 45.343 1.00 24.43 C ATOM 14190 CE2 PHE B 388 38.310 30.727 45.121 1.00 26.08 C ATOM 14191 CZ PHE B 388 37.261 29.984 44.617 1.00 25.20 C ATOM 14192 HA PHE B 388 36.290 30.310 49.801 1.00 0.00 H ATOM 14193 HB2 PHE B 388 35.880 32.228 48.570 1.00 0.00 H ATOM 14194 HB3 PHE B 388 37.598 32.686 48.509 1.00 0.00 H ATOM 14195 HD2 PHE B 388 39.020 31.912 46.758 1.00 0.00 H ATOM 14196 HE2 PHE B 388 39.230 30.836 44.546 1.00 0.00 H ATOM 14197 HZ PHE B 388 37.353 29.503 43.643 1.00 0.00 H ATOM 14198 HE1 PHE B 388 35.272 29.265 44.943 1.00 0.00 H ATOM 14199 HD1 PHE B 388 35.064 30.338 47.151 1.00 0.00 H ATOM 14200 H PHE B 388 37.490 32.611 50.870 1.00 0.00 H ATOM 14201 N SER B 389 39.560 30.423 49.169 1.00 24.22 N ATOM 14202 CA SER B 389 40.715 29.651 48.688 1.00 24.59 C ATOM 14203 C SER B 389 41.038 28.442 49.556 1.00 26.26 C ATOM 14204 O SER B 389 41.623 27.452 49.087 1.00 25.47 O ATOM 14205 CB SER B 389 41.955 30.546 48.574 1.00 24.04 C ATOM 14206 OG SER B 389 41.779 31.580 47.609 1.00 22.41 O ATOM 14207 HA SER B 389 40.434 29.275 47.704 1.00 0.00 H ATOM 14208 HB2 SER B 389 42.807 29.932 48.281 1.00 0.00 H ATOM 14209 HB3 SER B 389 42.152 31.000 49.545 1.00 0.00 H ATOM 14210 HG SER B 389 41.606 31.176 46.722 1.00 0.00 H ATOM 14211 H SER B 389 39.713 31.395 49.505 1.00 0.00 H ATOM 14212 N ALA B 390 40.651 28.524 50.828 1.00 26.64 N ATOM 14213 CA ALA B 390 40.953 27.479 51.797 1.00 24.79 C ATOM 14214 C ALA B 390 40.157 26.210 51.529 1.00 23.55 C ATOM 14215 O ALA B 390 40.525 25.132 51.980 1.00 24.29 O ATOM 14216 CB ALA B 390 40.694 27.986 53.230 1.00 23.55 C ATOM 14217 HA ALA B 390 42.009 27.230 51.693 1.00 0.00 H ATOM 14218 HB1 ALA B 390 41.328 28.850 53.429 1.00 0.00 H ATOM 14219 HB2 ALA B 390 39.647 28.272 53.329 1.00 0.00 H ATOM 14220 HB3 ALA B 390 40.924 27.193 53.942 1.00 0.00 H ATOM 14221 H ALA B 390 40.117 29.360 51.139 1.00 0.00 H ATOM 14222 N HIS B 391 39.059 26.343 50.803 1.00 25.82 N ATOM 14223 CA HIS B 391 38.273 25.181 50.414 1.00 25.93 C ATOM 14224 C HIS B 391 39.090 24.174 49.597 1.00 27.43 C ATOM 14225 O HIS B 391 38.779 22.973 49.578 1.00 26.81 O ATOM 14226 CB HIS B 391 37.005 25.609 49.681 1.00 26.66 C ATOM 14227 CG HIS B 391 35.962 26.188 50.584 1.00 28.83 C ATOM 14228 ND1 HIS B 391 36.068 27.451 51.132 1.00 29.22 N ATOM 14229 CD2 HIS B 391 34.800 25.673 51.047 1.00 28.99 C ATOM 14230 CE1 HIS B 391 35.013 27.690 51.889 1.00 29.06 C ATOM 14231 NE2 HIS B 391 34.227 26.628 51.855 1.00 31.12 N ATOM 14232 HA HIS B 391 37.977 24.665 51.327 1.00 0.00 H ATOM 14233 HB2 HIS B 391 37.273 26.359 48.937 1.00 0.00 H ATOM 14234 HB3 HIS B 391 36.584 24.737 49.181 1.00 0.00 H ATOM 14235 HD2 HIS B 391 34.394 24.687 50.822 1.00 0.00 H ATOM 14236 HE1 HIS B 391 34.823 28.607 52.447 1.00 0.00 H ATOM 14237 H HIS B 391 38.753 27.291 50.506 1.00 0.00 H ATOM 14238 N LEU B 392 40.139 24.657 48.938 1.00 26.22 N ATOM 14239 CA LEU B 392 41.010 23.764 48.191 1.00 25.91 C ATOM 14240 C LEU B 392 41.776 22.880 49.173 1.00 25.84 C ATOM 14241 O LEU B 392 41.861 21.655 49.008 1.00 25.49 O ATOM 14242 CB LEU B 392 41.965 24.566 47.300 1.00 26.08 C ATOM 14243 CG LEU B 392 42.782 23.820 46.239 1.00 27.56 C ATOM 14244 CD1 LEU B 392 41.892 22.950 45.367 1.00 27.01 C ATOM 14245 CD2 LEU B 392 43.565 24.814 45.392 1.00 26.48 C ATOM 14246 HA LEU B 392 40.413 23.129 47.537 1.00 0.00 H ATOM 14247 HB2 LEU B 392 41.367 25.313 46.778 1.00 0.00 H ATOM 14248 HB3 LEU B 392 42.675 25.067 47.959 1.00 0.00 H ATOM 14249 HG LEU B 392 43.485 23.161 46.748 1.00 0.00 H ATOM 14250 HD21 LEU B 392 42.871 25.495 44.899 1.00 0.00 H ATOM 14251 HD22 LEU B 392 44.240 25.382 46.032 1.00 0.00 H ATOM 14252 HD23 LEU B 392 44.142 24.274 44.641 1.00 0.00 H ATOM 14253 HD11 LEU B 392 41.380 22.217 45.990 1.00 0.00 H ATOM 14254 HD12 LEU B 392 41.156 23.576 44.862 1.00 0.00 H ATOM 14255 HD13 LEU B 392 42.503 22.435 44.626 1.00 0.00 H ATOM 14256 H LEU B 392 40.337 25.678 48.957 1.00 0.00 H ATOM 14257 N VAL B 393 42.336 23.513 50.200 1.00 24.39 N ATOM 14258 CA VAL B 393 43.123 22.817 51.209 1.00 24.80 C ATOM 14259 C VAL B 393 42.249 21.922 52.120 1.00 25.25 C ATOM 14260 O VAL B 393 42.703 20.887 52.611 1.00 24.10 O ATOM 14261 CB VAL B 393 43.947 23.852 52.026 1.00 26.82 C ATOM 14262 CG1 VAL B 393 44.252 23.368 53.407 1.00 26.23 C ATOM 14263 CG2 VAL B 393 45.228 24.239 51.266 1.00 26.41 C ATOM 14264 HA VAL B 393 43.812 22.140 50.704 1.00 0.00 H ATOM 14265 HB VAL B 393 43.334 24.746 52.142 1.00 0.00 H ATOM 14266 HG11 VAL B 393 43.319 23.181 53.939 1.00 0.00 H ATOM 14267 HG12 VAL B 393 44.830 22.445 53.348 1.00 0.00 H ATOM 14268 HG13 VAL B 393 44.829 24.126 53.937 1.00 0.00 H ATOM 14269 HG21 VAL B 393 45.836 23.349 51.104 1.00 0.00 H ATOM 14270 HG22 VAL B 393 44.960 24.677 50.305 1.00 0.00 H ATOM 14271 HG23 VAL B 393 45.792 24.964 51.853 1.00 0.00 H ATOM 14272 H VAL B 393 42.207 24.541 50.286 1.00 0.00 H ATOM 14273 N MET B 394 40.998 22.329 52.325 1.00 24.40 N ATOM 14274 CA MET B 394 40.056 21.585 53.158 1.00 26.55 C ATOM 14275 C MET B 394 39.544 20.300 52.495 1.00 26.82 C ATOM 14276 O MET B 394 39.272 19.314 53.188 1.00 27.72 O ATOM 14277 CB MET B 394 38.849 22.459 53.525 1.00 26.92 C ATOM 14278 CG MET B 394 39.117 23.600 54.498 1.00 30.13 C ATOM 14279 SD MET B 394 37.572 24.389 55.050 1.00 32.32 S ATOM 14280 CE MET B 394 37.359 25.703 53.871 1.00 32.70 C ATOM 14281 HA MET B 394 40.613 21.303 54.052 1.00 0.00 H ATOM 14282 HB2 MET B 394 38.459 22.892 52.604 1.00 0.00 H ATOM 14283 HB3 MET B 394 38.093 21.812 53.970 1.00 0.00 H ATOM 14284 HG2 MET B 394 39.739 24.347 54.005 1.00 0.00 H ATOM 14285 HG3 MET B 394 39.644 23.207 55.368 1.00 0.00 H ATOM 14286 HE1 MET B 394 38.216 26.375 53.919 1.00 0.00 H ATOM 14287 HE2 MET B 394 37.282 25.281 52.869 1.00 0.00 H ATOM 14288 HE3 MET B 394 36.449 26.255 54.105 1.00 0.00 H ATOM 14289 H MET B 394 40.679 23.211 51.875 1.00 0.00 H ATOM 14290 N PHE B 395 39.407 20.314 51.164 1.00 24.65 N ATOM 14291 CA PHE B 395 38.751 19.213 50.444 1.00 23.64 C ATOM 14292 C PHE B 395 39.636 18.385 49.508 1.00 24.78 C ATOM 14293 O PHE B 395 39.233 17.300 49.084 1.00 24.09 O ATOM 14294 CB PHE B 395 37.520 19.735 49.682 1.00 24.45 C ATOM 14295 CG PHE B 395 36.386 20.148 50.583 1.00 25.31 C ATOM 14296 CD1 PHE B 395 35.508 19.197 51.093 1.00 25.75 C ATOM 14297 CD2 PHE B 395 36.203 21.480 50.931 1.00 25.12 C ATOM 14298 CE1 PHE B 395 34.464 19.567 51.931 1.00 25.49 C ATOM 14299 CE2 PHE B 395 35.163 21.857 51.767 1.00 25.80 C ATOM 14300 CZ PHE B 395 34.289 20.891 52.270 1.00 25.61 C ATOM 14301 HA PHE B 395 38.465 18.515 51.231 1.00 0.00 H ATOM 14302 HB2 PHE B 395 37.822 20.598 49.089 1.00 0.00 H ATOM 14303 HB3 PHE B 395 37.164 18.946 49.019 1.00 0.00 H ATOM 14304 HD2 PHE B 395 36.884 22.237 50.543 1.00 0.00 H ATOM 14305 HE2 PHE B 395 35.028 22.906 52.031 1.00 0.00 H ATOM 14306 HZ PHE B 395 33.471 21.183 52.929 1.00 0.00 H ATOM 14307 HE1 PHE B 395 33.783 18.810 52.320 1.00 0.00 H ATOM 14308 HD1 PHE B 395 35.641 18.147 50.831 1.00 0.00 H ATOM 14309 H PHE B 395 39.774 21.124 50.625 1.00 0.00 H ATOM 14310 N LEU B 396 40.827 18.885 49.181 1.00 25.99 N ATOM 14311 CA LEU B 396 41.737 18.151 48.295 1.00 25.88 C ATOM 14312 C LEU B 396 42.958 17.648 49.051 1.00 26.79 C ATOM 14313 O LEU B 396 43.772 18.436 49.536 1.00 26.03 O ATOM 14314 CB LEU B 396 42.172 19.015 47.108 1.00 23.83 C ATOM 14315 CG LEU B 396 43.151 18.350 46.126 1.00 23.08 C ATOM 14316 CD1 LEU B 396 42.541 17.113 45.480 1.00 21.79 C ATOM 14317 CD2 LEU B 396 43.593 19.343 45.060 1.00 23.44 C ATOM 14318 HA LEU B 396 41.190 17.289 47.913 1.00 0.00 H ATOM 14319 HB2 LEU B 396 41.278 19.296 46.552 1.00 0.00 H ATOM 14320 HB3 LEU B 396 42.650 19.912 47.503 1.00 0.00 H ATOM 14321 HG LEU B 396 44.025 18.031 46.694 1.00 0.00 H ATOM 14322 HD21 LEU B 396 42.721 19.694 44.508 1.00 0.00 H ATOM 14323 HD22 LEU B 396 44.088 20.189 45.536 1.00 0.00 H ATOM 14324 HD23 LEU B 396 44.285 18.854 44.375 1.00 0.00 H ATOM 14325 HD11 LEU B 396 42.284 16.390 46.254 1.00 0.00 H ATOM 14326 HD12 LEU B 396 41.642 17.396 44.933 1.00 0.00 H ATOM 14327 HD13 LEU B 396 43.262 16.671 44.793 1.00 0.00 H ATOM 14328 H LEU B 396 41.116 19.810 49.560 1.00 0.00 H ATOM 14329 N ASN B 397 43.078 16.327 49.154 1.00 27.19 N ATOM 14330 CA ASN B 397 44.157 15.720 49.910 1.00 28.19 C ATOM 14331 C ASN B 397 45.529 16.101 49.350 1.00 28.50 C ATOM 14332 O ASN B 397 45.769 15.969 48.153 1.00 26.59 O ATOM 14333 CB ASN B 397 43.975 14.192 49.929 1.00 31.38 C ATOM 14334 CG ASN B 397 44.886 13.505 50.923 1.00 32.58 C ATOM 14335 OD1 ASN B 397 45.041 13.961 52.057 1.00 34.05 O ATOM 14336 ND2 ASN B 397 45.496 12.402 50.504 1.00 33.66 N ATOM 14337 HA ASN B 397 44.117 16.100 50.931 1.00 0.00 H ATOM 14338 HB2 ASN B 397 42.941 13.967 50.191 1.00 0.00 H ATOM 14339 HB3 ASN B 397 44.189 13.803 48.933 1.00 0.00 H ATOM 14340 HD22 ASN B 397 45.335 12.054 49.537 1.00 0.00 H ATOM 14341 HD21 ASN B 397 46.135 11.886 51.143 1.00 0.00 H ATOM 14342 H ASN B 397 42.382 15.715 48.682 1.00 0.00 H ATOM 14343 N LYS B 398 46.417 16.584 50.221 1.00 28.79 N ATOM 14344 CA LYS B 398 47.803 16.967 49.849 1.00 28.57 C ATOM 14345 C LYS B 398 47.968 18.366 49.215 1.00 26.52 C ATOM 14346 O LYS B 398 49.092 18.779 48.910 1.00 25.99 O ATOM 14347 CB LYS B 398 48.478 15.904 48.967 1.00 31.32 C ATOM 14348 CG LYS B 398 48.593 14.510 49.605 1.00 34.52 C ATOM 14349 CD LYS B 398 49.094 14.589 51.038 1.00 38.09 C ATOM 14350 CE LYS B 398 48.883 13.266 51.785 1.00 40.82 C ATOM 14351 NZ LYS B 398 48.937 13.462 53.273 1.00 42.55 N ATOM 14352 HA LYS B 398 48.311 17.024 50.812 1.00 0.00 H ATOM 14353 HB2 LYS B 398 47.899 15.809 48.048 1.00 0.00 H ATOM 14354 HB3 LYS B 398 49.483 16.251 48.728 1.00 0.00 H ATOM 14355 HG2 LYS B 398 47.611 14.036 49.599 1.00 0.00 H ATOM 14356 HG3 LYS B 398 49.289 13.909 49.019 1.00 0.00 H ATOM 14357 HD2 LYS B 398 50.158 14.824 51.028 1.00 0.00 H ATOM 14358 HD3 LYS B 398 48.553 15.379 51.559 1.00 0.00 H ATOM 14359 HE2 LYS B 398 49.663 12.564 51.491 1.00 0.00 H ATOM 14360 HE3 LYS B 398 47.909 12.858 51.516 1.00 0.00 H ATOM 14361 HZ1 LYS B 398 49.867 13.846 53.537 1.00 0.00 H ATOM 14362 HZ2 LYS B 398 48.191 14.127 53.561 1.00 0.00 H ATOM 14363 HZ3 LYS B 398 48.791 12.548 53.747 1.00 0.00 H ATOM 14364 H LYS B 398 46.123 16.698 51.212 1.00 0.00 H ATOM 14365 N SER B 399 46.867 19.086 49.020 1.00 24.89 N ATOM 14366 CA SER B 399 46.929 20.467 48.532 1.00 25.91 C ATOM 14367 C SER B 399 47.734 21.334 49.504 1.00 28.11 C ATOM 14368 O SER B 399 48.597 22.117 49.103 1.00 26.76 O ATOM 14369 CB SER B 399 45.526 21.028 48.352 1.00 26.08 C ATOM 14370 OG SER B 399 45.559 22.335 47.806 1.00 26.92 O ATOM 14371 HA SER B 399 47.429 20.475 47.564 1.00 0.00 H ATOM 14372 HB2 SER B 399 45.029 21.061 49.322 1.00 0.00 H ATOM 14373 HB3 SER B 399 44.967 20.377 47.681 1.00 0.00 H ATOM 14374 HG SER B 399 46.005 22.311 46.922 1.00 0.00 H ATOM 14375 H SER B 399 45.940 18.659 49.218 1.00 0.00 H ATOM 14376 N LEU B 400 47.447 21.174 50.791 1.00 29.65 N ATOM 14377 CA LEU B 400 48.191 21.838 51.861 1.00 30.90 C ATOM 14378 C LEU B 400 49.690 21.653 51.687 1.00 30.16 C ATOM 14379 O LEU B 400 50.467 22.619 51.782 1.00 30.32 O ATOM 14380 CB LEU B 400 47.733 21.251 53.203 1.00 34.22 C ATOM 14381 CG LEU B 400 48.304 21.624 54.566 1.00 36.77 C ATOM 14382 CD1 LEU B 400 47.264 21.255 55.624 1.00 37.70 C ATOM 14383 CD2 LEU B 400 49.639 20.931 54.846 1.00 37.09 C ATOM 14384 HA LEU B 400 47.991 22.909 51.829 1.00 0.00 H ATOM 14385 HB2 LEU B 400 46.667 21.469 53.266 1.00 0.00 H ATOM 14386 HB3 LEU B 400 47.878 20.174 53.113 1.00 0.00 H ATOM 14387 HG LEU B 400 48.512 22.694 54.588 1.00 0.00 H ATOM 14388 HD21 LEU B 400 49.498 19.850 54.823 1.00 0.00 H ATOM 14389 HD22 LEU B 400 50.364 21.220 54.085 1.00 0.00 H ATOM 14390 HD23 LEU B 400 50.003 21.230 55.829 1.00 0.00 H ATOM 14391 HD11 LEU B 400 46.343 21.807 55.435 1.00 0.00 H ATOM 14392 HD12 LEU B 400 47.064 20.185 55.577 1.00 0.00 H ATOM 14393 HD13 LEU B 400 47.646 21.511 56.612 1.00 0.00 H ATOM 14394 H LEU B 400 46.658 20.548 51.050 1.00 0.00 H ATOM 14395 N ASP B 401 50.093 20.408 51.429 1.00 28.55 N ATOM 14396 CA ASP B 401 51.504 20.058 51.257 1.00 28.58 C ATOM 14397 C ASP B 401 52.145 20.791 50.086 1.00 27.12 C ATOM 14398 O ASP B 401 53.312 21.184 50.142 1.00 26.11 O ATOM 14399 CB ASP B 401 51.667 18.554 51.010 1.00 30.30 C ATOM 14400 CG ASP B 401 51.139 17.690 52.154 1.00 32.98 C ATOM 14401 OD1 ASP B 401 49.972 17.858 52.590 1.00 32.87 O ATOM 14402 OD2 ASP B 401 51.907 16.813 52.602 1.00 35.17 O ATOM 14403 HA ASP B 401 52.000 20.355 52.181 1.00 0.00 H ATOM 14404 HB2 ASP B 401 51.126 18.292 50.101 1.00 0.00 H ATOM 14405 HB3 ASP B 401 52.727 18.339 50.875 1.00 0.00 H ATOM 14406 H ASP B 401 49.378 19.657 51.347 1.00 0.00 H ATOM 14407 N GLU B 402 51.386 20.942 49.011 1.00 26.98 N ATOM 14408 CA GLU B 402 51.892 21.558 47.785 1.00 27.81 C ATOM 14409 C GLU B 402 52.062 23.072 47.967 1.00 26.33 C ATOM 14410 O GLU B 402 53.047 23.658 47.522 1.00 26.85 O ATOM 14411 CB GLU B 402 50.955 21.215 46.617 1.00 28.61 C ATOM 14412 CG GLU B 402 51.471 21.572 45.234 1.00 31.82 C ATOM 14413 CD GLU B 402 52.691 20.759 44.815 1.00 32.69 C ATOM 14414 OE1 GLU B 402 52.965 19.705 45.423 1.00 33.01 O ATOM 14415 OE2 GLU B 402 53.371 21.182 43.864 1.00 34.70 O ATOM 14416 HA GLU B 402 52.880 21.158 47.555 1.00 0.00 H ATOM 14417 HB2 GLU B 402 50.770 20.141 46.639 1.00 0.00 H ATOM 14418 HB3 GLU B 402 50.016 21.747 46.773 1.00 0.00 H ATOM 14419 HG2 GLU B 402 50.674 21.397 44.512 1.00 0.00 H ATOM 14420 HG3 GLU B 402 51.740 22.628 45.227 1.00 0.00 H ATOM 14421 H GLU B 402 50.400 20.612 49.040 1.00 0.00 H ATOM 14422 N MET B 403 51.102 23.703 48.632 1.00 25.45 N ATOM 14423 CA MET B 403 51.200 25.130 48.937 1.00 23.66 C ATOM 14424 C MET B 403 52.370 25.397 49.868 1.00 24.87 C ATOM 14425 O MET B 403 53.133 26.340 49.661 1.00 21.98 O ATOM 14426 CB MET B 403 49.904 25.639 49.571 1.00 23.90 C ATOM 14427 CG MET B 403 48.730 25.635 48.629 1.00 21.68 C ATOM 14428 SD MET B 403 47.325 26.461 49.361 1.00 26.23 S ATOM 14429 CE MET B 403 46.038 26.121 48.167 1.00 22.78 C ATOM 14430 HA MET B 403 51.364 25.664 48.001 1.00 0.00 H ATOM 14431 HB2 MET B 403 49.664 25.003 50.423 1.00 0.00 H ATOM 14432 HB3 MET B 403 50.066 26.660 49.915 1.00 0.00 H ATOM 14433 HG2 MET B 403 48.459 24.604 48.400 1.00 0.00 H ATOM 14434 HG3 MET B 403 49.008 26.150 47.709 1.00 0.00 H ATOM 14435 HE1 MET B 403 46.323 26.535 47.200 1.00 0.00 H ATOM 14436 HE2 MET B 403 45.903 25.043 48.077 1.00 0.00 H ATOM 14437 HE3 MET B 403 45.106 26.579 48.499 1.00 0.00 H ATOM 14438 H MET B 403 50.263 23.172 48.942 1.00 0.00 H ATOM 14439 N ASP B 404 52.523 24.553 50.888 1.00 24.87 N ATOM 14440 CA ASP B 404 53.608 24.712 51.858 1.00 26.20 C ATOM 14441 C ASP B 404 54.989 24.534 51.236 1.00 27.03 C ATOM 14442 O ASP B 404 55.961 25.149 51.678 1.00 28.19 O ATOM 14443 CB ASP B 404 53.456 23.741 53.032 1.00 25.70 C ATOM 14444 CG ASP B 404 54.605 23.842 54.023 1.00 27.54 C ATOM 14445 OD1 ASP B 404 54.691 24.850 54.770 1.00 28.43 O ATOM 14446 OD2 ASP B 404 55.425 22.905 54.059 1.00 27.27 O ATOM 14447 HA ASP B 404 53.530 25.737 52.220 1.00 0.00 H ATOM 14448 HB2 ASP B 404 52.524 23.964 53.552 1.00 0.00 H ATOM 14449 HB3 ASP B 404 53.418 22.724 52.642 1.00 0.00 H ATOM 14450 H ASP B 404 51.856 23.763 50.998 1.00 0.00 H ATOM 14451 N PHE B 405 55.089 23.679 50.227 1.00 27.98 N ATOM 14452 CA PHE B 405 56.359 23.523 49.535 1.00 29.54 C ATOM 14453 C PHE B 405 56.696 24.750 48.676 1.00 29.66 C ATOM 14454 O PHE B 405 57.763 25.332 48.834 1.00 32.48 O ATOM 14455 CB PHE B 405 56.391 22.252 48.684 1.00 30.45 C ATOM 14456 CG PHE B 405 57.654 22.099 47.883 1.00 32.11 C ATOM 14457 CD1 PHE B 405 58.836 21.698 48.495 1.00 33.44 C ATOM 14458 CD2 PHE B 405 57.664 22.358 46.525 1.00 32.65 C ATOM 14459 CE1 PHE B 405 60.007 21.562 47.763 1.00 34.08 C ATOM 14460 CE2 PHE B 405 58.830 22.223 45.786 1.00 34.31 C ATOM 14461 CZ PHE B 405 60.001 21.822 46.406 1.00 34.90 C ATOM 14462 HA PHE B 405 57.123 23.432 50.308 1.00 0.00 H ATOM 14463 HB2 PHE B 405 56.295 21.391 49.345 1.00 0.00 H ATOM 14464 HB3 PHE B 405 55.546 22.276 47.996 1.00 0.00 H ATOM 14465 HD2 PHE B 405 56.745 22.672 46.029 1.00 0.00 H ATOM 14466 HE2 PHE B 405 58.824 22.433 44.716 1.00 0.00 H ATOM 14467 HZ PHE B 405 60.916 21.712 45.825 1.00 0.00 H ATOM 14468 HE1 PHE B 405 60.928 21.251 48.257 1.00 0.00 H ATOM 14469 HD1 PHE B 405 58.843 21.488 49.564 1.00 0.00 H ATOM 14470 H PHE B 405 54.262 23.122 49.931 1.00 0.00 H ATOM 14471 N TRP B 406 55.795 25.151 47.781 1.00 29.24 N ATOM 14472 CA TRP B 406 56.117 26.259 46.853 1.00 30.30 C ATOM 14473 C TRP B 406 56.199 27.634 47.511 1.00 29.21 C ATOM 14474 O TRP B 406 57.083 28.421 47.182 1.00 29.83 O ATOM 14475 CB TRP B 406 55.163 26.300 45.657 1.00 30.83 C ATOM 14476 CG TRP B 406 55.322 25.119 44.755 1.00 31.94 C ATOM 14477 CD1 TRP B 406 54.450 24.086 44.599 1.00 31.52 C ATOM 14478 CD2 TRP B 406 56.434 24.846 43.889 1.00 31.81 C ATOM 14479 NE1 TRP B 406 54.946 23.184 43.684 1.00 31.04 N ATOM 14480 CE2 TRP B 406 56.163 23.627 43.236 1.00 31.90 C ATOM 14481 CE3 TRP B 406 57.632 25.515 43.605 1.00 32.92 C ATOM 14482 CZ2 TRP B 406 57.044 23.059 42.309 1.00 31.70 C ATOM 14483 CZ3 TRP B 406 58.510 24.950 42.685 1.00 33.01 C ATOM 14484 CH2 TRP B 406 58.209 23.730 42.048 1.00 32.44 C ATOM 14485 HA TRP B 406 57.123 26.030 46.500 1.00 0.00 H ATOM 14486 HB2 TRP B 406 54.138 26.321 46.028 1.00 0.00 H ATOM 14487 HB3 TRP B 406 55.359 27.206 45.084 1.00 0.00 H ATOM 14488 HE1 TRP B 406 54.473 22.308 43.382 1.00 0.00 H ATOM 14489 HD1 TRP B 406 53.499 23.987 45.122 1.00 0.00 H ATOM 14490 HZ2 TRP B 406 56.811 22.117 41.813 1.00 0.00 H ATOM 14491 HH2 TRP B 406 58.918 23.312 41.333 1.00 0.00 H ATOM 14492 HZ3 TRP B 406 59.445 25.459 42.454 1.00 0.00 H ATOM 14493 HE3 TRP B 406 57.871 26.459 44.095 1.00 0.00 H ATOM 14494 H TRP B 406 54.866 24.686 47.734 1.00 0.00 H ATOM 14495 N ALA B 407 55.288 27.924 48.432 1.00 27.06 N ATOM 14496 CA ALA B 407 55.288 29.225 49.092 1.00 27.92 C ATOM 14497 C ALA B 407 56.083 29.224 50.386 1.00 27.39 C ATOM 14498 O ALA B 407 56.989 30.032 50.566 1.00 27.35 O ATOM 14499 CB ALA B 407 53.870 29.685 49.347 1.00 27.20 C ATOM 14500 HA ALA B 407 55.780 29.924 48.416 1.00 0.00 H ATOM 14501 HB1 ALA B 407 53.340 29.767 48.398 1.00 0.00 H ATOM 14502 HB2 ALA B 407 53.364 28.961 49.986 1.00 0.00 H ATOM 14503 HB3 ALA B 407 53.888 30.657 49.840 1.00 0.00 H ATOM 14504 H ALA B 407 54.568 27.218 48.685 1.00 0.00 H ATOM 14505 N GLY B 408 55.745 28.309 51.285 1.00 28.67 N ATOM 14506 CA GLY B 408 56.347 28.291 52.614 1.00 30.51 C ATOM 14507 C GLY B 408 57.724 27.680 52.728 1.00 30.47 C ATOM 14508 O GLY B 408 58.371 27.808 53.764 1.00 30.67 O ATOM 14509 HA3 GLY B 408 55.681 27.731 53.271 1.00 0.00 H ATOM 14510 HA2 GLY B 408 56.413 29.322 52.961 1.00 0.00 H ATOM 14511 H GLY B 408 55.036 27.589 51.037 1.00 0.00 H ATOM 14512 N THR B 409 58.188 27.006 51.679 1.00 31.97 N ATOM 14513 CA THR B 409 59.505 26.367 51.745 1.00 32.36 C ATOM 14514 C THR B 409 60.480 26.933 50.709 1.00 32.93 C ATOM 14515 O THR B 409 61.447 27.596 51.065 1.00 33.45 O ATOM 14516 CB THR B 409 59.388 24.830 51.620 1.00 33.75 C ATOM 14517 OG1 THR B 409 58.456 24.348 52.593 1.00 34.26 O ATOM 14518 CG2 THR B 409 60.724 24.161 51.850 1.00 32.70 C ATOM 14519 HA THR B 409 59.918 26.597 52.727 1.00 0.00 H ATOM 14520 HB THR B 409 59.048 24.593 50.612 1.00 0.00 H ATOM 14521 HG1 THR B 409 57.571 24.763 52.435 1.00 0.00 H ATOM 14522 HG23 THR B 409 61.441 24.522 51.113 1.00 0.00 H ATOM 14523 HG21 THR B 409 61.080 24.399 52.852 1.00 0.00 H ATOM 14524 HG22 THR B 409 60.610 23.082 51.750 1.00 0.00 H ATOM 14525 H THR B 409 57.617 26.933 50.813 1.00 0.00 H ATOM 14526 N ILE B 410 60.224 26.669 49.431 1.00 31.84 N ATOM 14527 CA ILE B 410 61.066 27.183 48.358 1.00 32.16 C ATOM 14528 C ILE B 410 60.953 28.693 48.257 1.00 30.74 C ATOM 14529 O ILE B 410 61.962 29.406 48.243 1.00 30.76 O ATOM 14530 CB ILE B 410 60.669 26.569 46.990 1.00 33.65 C ATOM 14531 CG1 ILE B 410 60.941 25.074 46.986 1.00 34.88 C ATOM 14532 CG2 ILE B 410 61.422 27.235 45.852 1.00 36.29 C ATOM 14533 CD1 ILE B 410 62.406 24.724 47.272 1.00 37.82 C ATOM 14534 HA ILE B 410 62.092 26.904 48.598 1.00 0.00 H ATOM 14535 HB ILE B 410 59.603 26.740 46.841 1.00 0.00 H ATOM 14536 HG12 ILE B 410 60.318 24.607 47.749 1.00 0.00 H ATOM 14537 HG13 ILE B 410 60.675 24.676 46.007 1.00 0.00 H ATOM 14538 HD11 ILE B 410 63.042 25.176 46.511 1.00 0.00 H ATOM 14539 HD12 ILE B 410 62.685 25.107 48.254 1.00 0.00 H ATOM 14540 HD13 ILE B 410 62.530 23.641 47.254 1.00 0.00 H ATOM 14541 HG21 ILE B 410 61.189 28.300 45.838 1.00 0.00 H ATOM 14542 HG22 ILE B 410 62.494 27.099 45.998 1.00 0.00 H ATOM 14543 HG23 ILE B 410 61.122 26.783 44.906 1.00 0.00 H ATOM 14544 H ILE B 410 59.401 26.080 49.191 1.00 0.00 H ATOM 14545 N GLY B 411 59.711 29.162 48.181 1.00 30.36 N ATOM 14546 CA GLY B 411 59.392 30.569 48.044 1.00 26.33 C ATOM 14547 C GLY B 411 60.111 31.486 49.002 1.00 27.53 C ATOM 14548 O GLY B 411 60.675 32.493 48.572 1.00 27.79 O ATOM 14549 HA3 GLY B 411 58.320 30.689 48.202 1.00 0.00 H ATOM 14550 HA2 GLY B 411 59.645 30.875 47.029 1.00 0.00 H ATOM 14551 H GLY B 411 58.925 28.482 48.222 1.00 0.00 H ATOM 14552 N VAL B 412 60.109 31.159 50.295 1.00 27.52 N ATOM 14553 CA VAL B 412 60.712 32.066 51.282 1.00 26.64 C ATOM 14554 C VAL B 412 62.230 32.226 51.127 1.00 27.12 C ATOM 14555 O VAL B 412 62.757 33.323 51.322 1.00 26.50 O ATOM 14556 CB VAL B 412 60.344 31.714 52.761 1.00 26.59 C ATOM 14557 CG1 VAL B 412 58.843 31.813 52.961 1.00 26.35 C ATOM 14558 CG2 VAL B 412 60.864 30.334 53.169 1.00 23.92 C ATOM 14559 HA VAL B 412 60.262 33.032 51.055 1.00 0.00 H ATOM 14560 HB VAL B 412 60.835 32.439 53.410 1.00 0.00 H ATOM 14561 HG11 VAL B 412 58.515 32.829 52.742 1.00 0.00 H ATOM 14562 HG12 VAL B 412 58.342 31.115 52.291 1.00 0.00 H ATOM 14563 HG13 VAL B 412 58.598 31.566 53.994 1.00 0.00 H ATOM 14564 HG21 VAL B 412 60.427 29.576 52.519 1.00 0.00 H ATOM 14565 HG22 VAL B 412 61.950 30.314 53.074 1.00 0.00 H ATOM 14566 HG23 VAL B 412 60.585 30.133 54.203 1.00 0.00 H ATOM 14567 H VAL B 412 59.681 30.263 50.605 1.00 0.00 H ATOM 14568 N VAL B 413 62.919 31.143 50.773 1.00 27.30 N ATOM 14569 CA VAL B 413 64.379 31.172 50.615 1.00 28.75 C ATOM 14570 C VAL B 413 64.749 31.996 49.386 1.00 31.06 C ATOM 14571 O VAL B 413 65.659 32.837 49.435 1.00 30.65 O ATOM 14572 CB VAL B 413 64.987 29.755 50.495 1.00 29.55 C ATOM 14573 CG1 VAL B 413 66.504 29.841 50.394 1.00 31.19 C ATOM 14574 CG2 VAL B 413 64.582 28.877 51.681 1.00 29.47 C ATOM 14575 HA VAL B 413 64.794 31.630 51.513 1.00 0.00 H ATOM 14576 HB VAL B 413 64.596 29.295 49.587 1.00 0.00 H ATOM 14577 HG11 VAL B 413 66.776 30.423 49.513 1.00 0.00 H ATOM 14578 HG12 VAL B 413 66.899 30.325 51.287 1.00 0.00 H ATOM 14579 HG13 VAL B 413 66.919 28.837 50.310 1.00 0.00 H ATOM 14580 HG21 VAL B 413 64.937 29.331 52.606 1.00 0.00 H ATOM 14581 HG22 VAL B 413 63.496 28.789 51.712 1.00 0.00 H ATOM 14582 HG23 VAL B 413 65.025 27.888 51.567 1.00 0.00 H ATOM 14583 H VAL B 413 62.410 30.252 50.604 1.00 0.00 H ATOM 14584 N PHE B 414 64.034 31.745 48.291 1.00 31.01 N ATOM 14585 CA PHE B 414 64.159 32.524 47.059 1.00 33.17 C ATOM 14586 C PHE B 414 63.913 34.004 47.330 1.00 31.95 C ATOM 14587 O PHE B 414 64.681 34.851 46.877 1.00 30.99 O ATOM 14588 CB PHE B 414 63.176 32.002 46.002 1.00 36.39 C ATOM 14589 CG PHE B 414 62.953 32.943 44.834 1.00 39.63 C ATOM 14590 CD1 PHE B 414 63.946 33.142 43.877 1.00 40.77 C ATOM 14591 CD2 PHE B 414 61.736 33.610 44.681 1.00 40.98 C ATOM 14592 CE1 PHE B 414 63.733 34.008 42.791 1.00 42.92 C ATOM 14593 CE2 PHE B 414 61.514 34.474 43.602 1.00 41.96 C ATOM 14594 CZ PHE B 414 62.513 34.674 42.656 1.00 42.03 C ATOM 14595 HA PHE B 414 65.175 32.412 46.680 1.00 0.00 H ATOM 14596 HB2 PHE B 414 63.563 31.060 45.612 1.00 0.00 H ATOM 14597 HB3 PHE B 414 62.216 31.826 46.487 1.00 0.00 H ATOM 14598 HD2 PHE B 414 60.945 33.455 45.415 1.00 0.00 H ATOM 14599 HE2 PHE B 414 60.559 34.989 43.504 1.00 0.00 H ATOM 14600 HZ PHE B 414 62.345 35.346 41.815 1.00 0.00 H ATOM 14601 HE1 PHE B 414 64.521 34.160 42.053 1.00 0.00 H ATOM 14602 HD1 PHE B 414 64.898 32.620 43.972 1.00 0.00 H ATOM 14603 H PHE B 414 63.355 30.958 48.313 1.00 0.00 H ATOM 14604 N PHE B 415 62.849 34.312 48.069 1.00 30.23 N ATOM 14605 CA PHE B 415 62.517 35.705 48.359 1.00 30.61 C ATOM 14606 C PHE B 415 63.535 36.331 49.307 1.00 30.18 C ATOM 14607 O PHE B 415 63.886 37.500 49.158 1.00 30.37 O ATOM 14608 CB PHE B 415 61.099 35.829 48.922 1.00 28.68 C ATOM 14609 CG PHE B 415 60.483 37.184 48.717 1.00 29.12 C ATOM 14610 CD1 PHE B 415 60.340 37.704 47.435 1.00 28.57 C ATOM 14611 CD2 PHE B 415 60.038 37.937 49.800 1.00 28.88 C ATOM 14612 CE1 PHE B 415 59.767 38.945 47.233 1.00 28.60 C ATOM 14613 CE2 PHE B 415 59.458 39.181 49.608 1.00 29.74 C ATOM 14614 CZ PHE B 415 59.325 39.691 48.319 1.00 28.01 C ATOM 14615 HA PHE B 415 62.555 36.255 47.418 1.00 0.00 H ATOM 14616 HB2 PHE B 415 60.468 35.087 48.433 1.00 0.00 H ATOM 14617 HB3 PHE B 415 61.135 35.625 49.992 1.00 0.00 H ATOM 14618 HD2 PHE B 415 60.147 37.544 50.811 1.00 0.00 H ATOM 14619 HE2 PHE B 415 59.107 39.758 50.463 1.00 0.00 H ATOM 14620 HZ PHE B 415 58.876 40.672 48.162 1.00 0.00 H ATOM 14621 HE1 PHE B 415 59.662 39.339 46.222 1.00 0.00 H ATOM 14622 HD1 PHE B 415 60.685 37.125 46.578 1.00 0.00 H ATOM 14623 H PHE B 415 62.247 33.552 48.444 1.00 0.00 H ATOM 14624 N GLY B 416 64.010 35.553 50.276 1.00 29.93 N ATOM 14625 CA GLY B 416 65.073 36.016 51.172 1.00 30.12 C ATOM 14626 C GLY B 416 66.281 36.485 50.370 1.00 30.41 C ATOM 14627 O GLY B 416 66.791 37.577 50.584 1.00 29.66 O ATOM 14628 HA3 GLY B 416 65.373 35.198 51.827 1.00 0.00 H ATOM 14629 HA2 GLY B 416 64.699 36.844 51.775 1.00 0.00 H ATOM 14630 H GLY B 416 63.619 34.597 50.400 1.00 0.00 H ATOM 14631 N LEU B 417 66.728 35.651 49.437 1.00 30.76 N ATOM 14632 CA LEU B 417 67.862 35.975 48.584 1.00 31.77 C ATOM 14633 C LEU B 417 67.561 37.181 47.703 1.00 32.24 C ATOM 14634 O LEU B 417 68.404 38.067 47.538 1.00 33.69 O ATOM 14635 CB LEU B 417 68.234 34.775 47.714 1.00 32.32 C ATOM 14636 CG LEU B 417 69.424 35.009 46.779 1.00 34.05 C ATOM 14637 CD1 LEU B 417 70.654 35.406 47.592 1.00 34.35 C ATOM 14638 CD2 LEU B 417 69.695 33.772 45.937 1.00 33.74 C ATOM 14639 HA LEU B 417 68.705 36.224 49.229 1.00 0.00 H ATOM 14640 HB2 LEU B 417 68.477 33.940 48.372 1.00 0.00 H ATOM 14641 HB3 LEU B 417 67.368 34.515 47.104 1.00 0.00 H ATOM 14642 HG LEU B 417 69.185 35.826 46.098 1.00 0.00 H ATOM 14643 HD21 LEU B 417 69.920 32.930 46.592 1.00 0.00 H ATOM 14644 HD22 LEU B 417 68.814 33.542 45.338 1.00 0.00 H ATOM 14645 HD23 LEU B 417 70.544 33.960 45.280 1.00 0.00 H ATOM 14646 HD11 LEU B 417 70.443 36.323 48.143 1.00 0.00 H ATOM 14647 HD12 LEU B 417 70.898 34.607 48.293 1.00 0.00 H ATOM 14648 HD13 LEU B 417 71.495 35.570 46.919 1.00 0.00 H ATOM 14649 H LEU B 417 66.251 34.735 49.312 1.00 0.00 H ATOM 14650 N THR B 418 66.356 37.208 47.141 1.00 31.55 N ATOM 14651 CA THR B 418 65.921 38.302 46.285 1.00 31.50 C ATOM 14652 C THR B 418 65.942 39.631 47.026 1.00 33.03 C ATOM 14653 O THR B 418 66.510 40.610 46.541 1.00 33.66 O ATOM 14654 CB THR B 418 64.496 38.068 45.749 1.00 30.54 C ATOM 14655 OG1 THR B 418 64.481 36.895 44.931 1.00 31.18 O ATOM 14656 CG2 THR B 418 64.034 39.252 44.922 1.00 31.25 C ATOM 14657 HA THR B 418 66.623 38.337 45.452 1.00 0.00 H ATOM 14658 HB THR B 418 63.823 37.944 46.598 1.00 0.00 H ATOM 14659 HG1 THR B 418 64.764 36.114 45.470 1.00 0.00 H ATOM 14660 HG23 THR B 418 64.043 40.150 45.539 1.00 0.00 H ATOM 14661 HG21 THR B 418 64.706 39.386 44.074 1.00 0.00 H ATOM 14662 HG22 THR B 418 63.022 39.068 44.560 1.00 0.00 H ATOM 14663 H THR B 418 65.701 36.420 47.319 1.00 0.00 H ATOM 14664 N GLU B 419 65.317 39.666 48.200 1.00 31.82 N ATOM 14665 CA GLU B 419 65.184 40.915 48.929 1.00 30.21 C ATOM 14666 C GLU B 419 66.552 41.424 49.374 1.00 31.48 C ATOM 14667 O GLU B 419 66.787 42.626 49.407 1.00 31.97 O ATOM 14668 CB GLU B 419 64.207 40.774 50.105 1.00 28.13 C ATOM 14669 CG GLU B 419 64.745 39.981 51.281 1.00 27.51 C ATOM 14670 CD GLU B 419 63.672 39.598 52.276 1.00 27.91 C ATOM 14671 OE1 GLU B 419 62.523 40.086 52.160 1.00 27.88 O ATOM 14672 OE2 GLU B 419 63.984 38.798 53.178 1.00 28.57 O ATOM 14673 HA GLU B 419 64.759 41.662 48.258 1.00 0.00 H ATOM 14674 HB2 GLU B 419 63.951 41.773 50.457 1.00 0.00 H ATOM 14675 HB3 GLU B 419 63.307 40.277 49.742 1.00 0.00 H ATOM 14676 HG2 GLU B 419 65.209 39.070 50.903 1.00 0.00 H ATOM 14677 HG3 GLU B 419 65.495 40.584 51.793 1.00 0.00 H ATOM 14678 H GLU B 419 64.920 38.791 48.599 1.00 0.00 H ATOM 14679 N LEU B 420 67.460 40.509 49.694 1.00 33.44 N ATOM 14680 CA LEU B 420 68.797 40.907 50.100 1.00 36.10 C ATOM 14681 C LEU B 420 69.575 41.522 48.934 1.00 37.31 C ATOM 14682 O LEU B 420 70.183 42.591 49.081 1.00 36.76 O ATOM 14683 CB LEU B 420 69.562 39.727 50.703 1.00 37.48 C ATOM 14684 CG LEU B 420 70.960 40.055 51.227 1.00 38.06 C ATOM 14685 CD1 LEU B 420 71.332 39.139 52.377 1.00 37.00 C ATOM 14686 CD2 LEU B 420 71.999 39.993 50.106 1.00 38.54 C ATOM 14687 HA LEU B 420 68.692 41.672 50.869 1.00 0.00 H ATOM 14688 HB2 LEU B 420 68.975 39.333 51.533 1.00 0.00 H ATOM 14689 HB3 LEU B 420 69.661 38.961 49.934 1.00 0.00 H ATOM 14690 HG LEU B 420 70.948 41.077 51.605 1.00 0.00 H ATOM 14691 HD21 LEU B 420 72.013 38.990 49.680 1.00 0.00 H ATOM 14692 HD22 LEU B 420 71.739 40.714 49.331 1.00 0.00 H ATOM 14693 HD23 LEU B 420 72.983 40.231 50.511 1.00 0.00 H ATOM 14694 HD11 LEU B 420 70.614 39.265 53.187 1.00 0.00 H ATOM 14695 HD12 LEU B 420 71.318 38.104 52.035 1.00 0.00 H ATOM 14696 HD13 LEU B 420 72.331 39.392 52.733 1.00 0.00 H ATOM 14697 H LEU B 420 67.212 39.500 49.654 1.00 0.00 H ATOM 14698 N ILE B 421 69.558 40.846 47.786 1.00 36.30 N ATOM 14699 CA ILE B 421 70.231 41.357 46.590 1.00 35.98 C ATOM 14700 C ILE B 421 69.721 42.754 46.257 1.00 35.79 C ATOM 14701 O ILE B 421 70.504 43.671 46.029 1.00 36.87 O ATOM 14702 CB ILE B 421 70.078 40.394 45.392 1.00 36.03 C ATOM 14703 CG1 ILE B 421 70.977 39.172 45.599 1.00 34.77 C ATOM 14704 CG2 ILE B 421 70.415 41.096 44.077 1.00 36.09 C ATOM 14705 CD1 ILE B 421 70.668 38.006 44.688 1.00 35.45 C ATOM 14706 HA ILE B 421 71.298 41.424 46.802 1.00 0.00 H ATOM 14707 HB ILE B 421 69.040 40.068 45.334 1.00 0.00 H ATOM 14708 HG12 ILE B 421 72.010 39.475 45.426 1.00 0.00 H ATOM 14709 HG13 ILE B 421 70.866 38.838 46.630 1.00 0.00 H ATOM 14710 HD11 ILE B 421 69.642 37.678 44.855 1.00 0.00 H ATOM 14711 HD12 ILE B 421 70.787 38.316 43.650 1.00 0.00 H ATOM 14712 HD13 ILE B 421 71.353 37.186 44.904 1.00 0.00 H ATOM 14713 HG21 ILE B 421 69.741 41.941 43.935 1.00 0.00 H ATOM 14714 HG22 ILE B 421 71.445 41.452 44.110 1.00 0.00 H ATOM 14715 HG23 ILE B 421 70.298 40.394 43.252 1.00 0.00 H ATOM 14716 H ILE B 421 69.056 39.936 47.738 1.00 0.00 H ATOM 14717 N ILE B 422 68.406 42.920 46.255 1.00 34.77 N ATOM 14718 CA ILE B 422 67.808 44.214 45.956 1.00 35.46 C ATOM 14719 C ILE B 422 68.245 45.308 46.944 1.00 37.50 C ATOM 14720 O ILE B 422 68.596 46.415 46.531 1.00 38.42 O ATOM 14721 CB ILE B 422 66.260 44.116 45.894 1.00 34.24 C ATOM 14722 CG1 ILE B 422 65.834 43.295 44.673 1.00 33.16 C ATOM 14723 CG2 ILE B 422 65.624 45.492 45.858 1.00 33.88 C ATOM 14724 CD1 ILE B 422 64.343 43.311 44.403 1.00 31.85 C ATOM 14725 HA ILE B 422 68.176 44.506 44.973 1.00 0.00 H ATOM 14726 HB ILE B 422 65.913 43.613 46.797 1.00 0.00 H ATOM 14727 HG12 ILE B 422 66.345 43.695 43.797 1.00 0.00 H ATOM 14728 HG13 ILE B 422 66.142 42.261 44.831 1.00 0.00 H ATOM 14729 HD11 ILE B 422 63.815 42.902 45.264 1.00 0.00 H ATOM 14730 HD12 ILE B 422 64.018 44.337 44.229 1.00 0.00 H ATOM 14731 HD13 ILE B 422 64.128 42.706 43.522 1.00 0.00 H ATOM 14732 HG21 ILE B 422 65.902 46.043 46.756 1.00 0.00 H ATOM 14733 HG22 ILE B 422 65.974 46.030 44.977 1.00 0.00 H ATOM 14734 HG23 ILE B 422 64.540 45.389 45.815 1.00 0.00 H ATOM 14735 H ILE B 422 67.789 42.111 46.471 1.00 0.00 H ATOM 14736 N PHE B 423 68.231 44.993 48.236 1.00 36.61 N ATOM 14737 CA PHE B 423 68.546 45.970 49.279 1.00 36.93 C ATOM 14738 C PHE B 423 70.047 46.240 49.432 1.00 38.94 C ATOM 14739 O PHE B 423 70.483 47.395 49.425 1.00 39.15 O ATOM 14740 CB PHE B 423 67.954 45.511 50.612 1.00 34.77 C ATOM 14741 CG PHE B 423 67.963 46.560 51.694 1.00 34.83 C ATOM 14742 CD1 PHE B 423 67.388 47.807 51.483 1.00 35.18 C ATOM 14743 CD2 PHE B 423 68.526 46.288 52.934 1.00 34.50 C ATOM 14744 CE1 PHE B 423 67.388 48.768 52.481 1.00 35.35 C ATOM 14745 CE2 PHE B 423 68.528 47.243 53.944 1.00 34.68 C ATOM 14746 CZ PHE B 423 67.959 48.483 53.721 1.00 35.61 C ATOM 14747 HA PHE B 423 68.097 46.914 48.970 1.00 0.00 H ATOM 14748 HB2 PHE B 423 66.921 45.208 50.440 1.00 0.00 H ATOM 14749 HB3 PHE B 423 68.529 44.654 50.963 1.00 0.00 H ATOM 14750 HD2 PHE B 423 68.973 45.311 53.118 1.00 0.00 H ATOM 14751 HE2 PHE B 423 68.978 47.015 54.910 1.00 0.00 H ATOM 14752 HZ PHE B 423 67.957 49.234 54.511 1.00 0.00 H ATOM 14753 HE1 PHE B 423 66.942 49.746 52.297 1.00 0.00 H ATOM 14754 HD1 PHE B 423 66.931 48.032 50.520 1.00 0.00 H ATOM 14755 H PHE B 423 67.988 44.021 48.514 1.00 0.00 H ATOM 14756 N PHE B 424 70.829 45.172 49.572 1.00 39.75 N ATOM 14757 CA PHE B 424 72.269 45.287 49.797 1.00 41.58 C ATOM 14758 C PHE B 424 73.162 45.358 48.562 1.00 43.00 C ATOM 14759 O PHE B 424 74.335 45.715 48.682 1.00 44.77 O ATOM 14760 CB PHE B 424 72.767 44.178 50.731 1.00 40.59 C ATOM 14761 CG PHE B 424 73.269 44.694 52.041 1.00 39.81 C ATOM 14762 CD1 PHE B 424 72.385 45.014 53.062 1.00 39.24 C ATOM 14763 CD2 PHE B 424 74.629 44.875 52.248 1.00 39.80 C ATOM 14764 CE1 PHE B 424 72.850 45.502 54.270 1.00 39.05 C ATOM 14765 CE2 PHE B 424 75.105 45.363 53.455 1.00 39.69 C ATOM 14766 CZ PHE B 424 74.213 45.678 54.467 1.00 39.92 C ATOM 14767 HA PHE B 424 72.366 46.270 50.258 1.00 0.00 H ATOM 14768 HB2 PHE B 424 71.944 43.489 50.922 1.00 0.00 H ATOM 14769 HB3 PHE B 424 73.578 43.644 50.235 1.00 0.00 H ATOM 14770 HD2 PHE B 424 75.332 44.630 51.452 1.00 0.00 H ATOM 14771 HE2 PHE B 424 76.176 45.498 53.607 1.00 0.00 H ATOM 14772 HZ PHE B 424 74.581 46.064 55.418 1.00 0.00 H ATOM 14773 HE1 PHE B 424 72.147 45.748 55.066 1.00 0.00 H ATOM 14774 HD1 PHE B 424 71.314 44.879 52.911 1.00 0.00 H ATOM 14775 H PHE B 424 70.402 44.225 49.520 1.00 0.00 H ATOM 14776 N TRP B 425 72.630 45.022 47.389 1.00 44.05 N ATOM 14777 CA TRP B 425 73.433 45.073 46.163 1.00 44.02 C ATOM 14778 C TRP B 425 72.948 46.155 45.200 1.00 45.43 C ATOM 14779 O TRP B 425 73.722 47.036 44.824 1.00 46.90 O ATOM 14780 CB TRP B 425 73.454 43.713 45.464 1.00 44.04 C ATOM 14781 CG TRP B 425 74.240 42.628 46.175 1.00 44.63 C ATOM 14782 CD1 TRP B 425 74.796 42.687 47.422 1.00 44.07 C ATOM 14783 CD2 TRP B 425 74.510 41.308 45.681 1.00 44.74 C ATOM 14784 NE1 TRP B 425 75.412 41.498 47.727 1.00 43.61 N ATOM 14785 CE2 TRP B 425 75.249 40.632 46.678 1.00 44.69 C ATOM 14786 CE3 TRP B 425 74.206 40.634 44.492 1.00 44.92 C ATOM 14787 CZ2 TRP B 425 75.692 39.316 46.517 1.00 44.47 C ATOM 14788 CZ3 TRP B 425 74.647 39.322 44.336 1.00 44.45 C ATOM 14789 CH2 TRP B 425 75.379 38.681 45.343 1.00 44.67 C ATOM 14790 HA TRP B 425 74.449 45.330 46.463 1.00 0.00 H ATOM 14791 HB2 TRP B 425 72.424 43.371 45.362 1.00 0.00 H ATOM 14792 HB3 TRP B 425 73.889 43.850 44.474 1.00 0.00 H ATOM 14793 HE1 TRP B 425 75.920 41.289 48.610 1.00 0.00 H ATOM 14794 HD1 TRP B 425 74.756 43.554 48.081 1.00 0.00 H ATOM 14795 HZ2 TRP B 425 76.265 38.813 47.296 1.00 0.00 H ATOM 14796 HH2 TRP B 425 75.708 37.653 45.190 1.00 0.00 H ATOM 14797 HZ3 TRP B 425 74.419 38.786 43.415 1.00 0.00 H ATOM 14798 HE3 TRP B 425 73.636 41.126 43.704 1.00 0.00 H ATOM 14799 H TRP B 425 71.636 44.721 47.342 1.00 0.00 H ATOM 14800 N ILE B 426 71.677 46.092 44.806 1.00 45.85 N ATOM 14801 CA ILE B 426 71.115 47.054 43.849 1.00 45.43 C ATOM 14802 C ILE B 426 70.974 48.444 44.465 1.00 45.20 C ATOM 14803 O ILE B 426 71.507 49.426 43.949 1.00 46.34 O ATOM 14804 CB ILE B 426 69.722 46.630 43.319 1.00 44.91 C ATOM 14805 CG1 ILE B 426 69.725 45.190 42.779 1.00 45.53 C ATOM 14806 CG2 ILE B 426 69.233 47.628 42.276 1.00 44.64 C ATOM 14807 CD1 ILE B 426 70.772 44.892 41.731 1.00 46.46 C ATOM 14808 HA ILE B 426 71.823 47.075 43.020 1.00 0.00 H ATOM 14809 HB ILE B 426 69.023 46.640 44.155 1.00 0.00 H ATOM 14810 HG12 ILE B 426 69.889 44.516 43.620 1.00 0.00 H ATOM 14811 HG13 ILE B 426 68.746 44.992 42.342 1.00 0.00 H ATOM 14812 HD11 ILE B 426 70.619 45.544 40.871 1.00 0.00 H ATOM 14813 HD12 ILE B 426 71.763 45.067 42.149 1.00 0.00 H ATOM 14814 HD13 ILE B 426 70.686 43.851 41.419 1.00 0.00 H ATOM 14815 HG21 ILE B 426 69.159 48.617 42.728 1.00 0.00 H ATOM 14816 HG22 ILE B 426 69.938 47.659 41.446 1.00 0.00 H ATOM 14817 HG23 ILE B 426 68.253 47.319 41.911 1.00 0.00 H ATOM 14818 H ILE B 426 71.066 45.341 45.186 1.00 0.00 H ATOM 14819 N PHE B 427 70.240 48.512 45.569 1.00 43.74 N ATOM 14820 CA PHE B 427 70.010 49.758 46.285 1.00 42.26 C ATOM 14821 C PHE B 427 71.332 50.339 46.804 1.00 42.68 C ATOM 14822 O PHE B 427 71.534 51.552 46.782 1.00 42.47 O ATOM 14823 CB PHE B 427 69.011 49.511 47.416 1.00 40.30 C ATOM 14824 CG PHE B 427 68.740 50.708 48.273 1.00 39.76 C ATOM 14825 CD1 PHE B 427 68.094 51.817 47.755 1.00 38.87 C ATOM 14826 CD2 PHE B 427 69.114 50.714 49.605 1.00 38.54 C ATOM 14827 CE1 PHE B 427 67.838 52.904 48.542 1.00 38.49 C ATOM 14828 CE2 PHE B 427 68.855 51.801 50.401 1.00 37.77 C ATOM 14829 CZ PHE B 427 68.218 52.899 49.873 1.00 38.25 C ATOM 14830 HA PHE B 427 69.586 50.498 45.606 1.00 0.00 H ATOM 14831 HB2 PHE B 427 68.069 49.187 46.974 1.00 0.00 H ATOM 14832 HB3 PHE B 427 69.404 48.718 48.052 1.00 0.00 H ATOM 14833 HD2 PHE B 427 69.620 49.846 50.027 1.00 0.00 H ATOM 14834 HE2 PHE B 427 69.153 51.794 51.449 1.00 0.00 H ATOM 14835 HZ PHE B 427 68.012 53.765 50.502 1.00 0.00 H ATOM 14836 HE1 PHE B 427 67.335 53.775 48.122 1.00 0.00 H ATOM 14837 HD1 PHE B 427 67.787 51.823 46.709 1.00 0.00 H ATOM 14838 H PHE B 427 69.812 47.639 45.937 1.00 0.00 H ATOM 14839 N GLY B 428 72.231 49.466 47.255 1.00 41.55 N ATOM 14840 CA GLY B 428 73.558 49.888 47.682 1.00 40.97 C ATOM 14841 C GLY B 428 73.874 49.423 49.084 1.00 40.00 C ATOM 14842 O GLY B 428 73.112 49.689 50.004 1.00 40.56 O ATOM 14843 HA3 GLY B 428 73.609 50.976 47.652 1.00 0.00 H ATOM 14844 HA2 GLY B 428 74.297 49.472 46.998 1.00 0.00 H ATOM 14845 H GLY B 428 71.979 48.458 47.303 1.00 0.00 H ATOM 14846 N ALA B 429 75.002 48.736 49.248 1.00 41.34 N ATOM 14847 CA ALA B 429 75.391 48.176 50.542 1.00 42.37 C ATOM 14848 C ALA B 429 75.581 49.231 51.630 1.00 43.62 C ATOM 14849 O ALA B 429 75.073 49.080 52.745 1.00 43.83 O ATOM 14850 CB ALA B 429 76.641 47.326 50.401 1.00 41.82 C ATOM 14851 HA ALA B 429 74.560 47.550 50.865 1.00 0.00 H ATOM 14852 HB1 ALA B 429 76.447 46.509 49.706 1.00 0.00 H ATOM 14853 HB2 ALA B 429 77.457 47.942 50.022 1.00 0.00 H ATOM 14854 HB3 ALA B 429 76.914 46.919 51.375 1.00 0.00 H ATOM 14855 H ALA B 429 75.627 48.593 48.429 1.00 0.00 H ATOM 14856 N ASP B 430 76.305 50.299 51.310 1.00 45.28 N ATOM 14857 CA ASP B 430 76.550 51.366 52.286 1.00 46.44 C ATOM 14858 C ASP B 430 75.273 52.140 52.605 1.00 44.84 C ATOM 14859 O ASP B 430 75.058 52.547 53.746 1.00 45.61 O ATOM 14860 CB ASP B 430 77.674 52.297 51.809 1.00 48.19 C ATOM 14861 CG ASP B 430 79.002 51.575 51.666 1.00 50.47 C ATOM 14862 OD1 ASP B 430 79.340 50.755 52.553 1.00 50.52 O ATOM 14863 OD2 ASP B 430 79.712 51.826 50.664 1.00 52.37 O ATOM 14864 HA ASP B 430 76.878 50.899 53.215 1.00 0.00 H ATOM 14865 HB2 ASP B 430 77.396 52.714 50.841 1.00 0.00 H ATOM 14866 HB3 ASP B 430 77.790 53.105 52.532 1.00 0.00 H ATOM 14867 H ASP B 430 76.704 50.379 50.353 1.00 0.00 H ATOM 14868 N LYS B 431 74.431 52.334 51.596 1.00 43.73 N ATOM 14869 CA LYS B 431 73.129 52.968 51.781 1.00 43.15 C ATOM 14870 C LYS B 431 72.186 52.063 52.580 1.00 41.43 C ATOM 14871 O LYS B 431 71.352 52.540 53.352 1.00 42.03 O ATOM 14872 CB LYS B 431 72.493 53.286 50.425 1.00 44.45 C ATOM 14873 CG LYS B 431 73.353 54.149 49.511 1.00 47.16 C ATOM 14874 CD LYS B 431 72.746 54.301 48.111 1.00 48.69 C ATOM 14875 CE LYS B 431 71.645 55.355 48.060 1.00 49.31 C ATOM 14876 NZ LYS B 431 70.501 55.065 48.968 1.00 50.69 N ATOM 14877 HA LYS B 431 73.286 53.893 52.336 1.00 0.00 H ATOM 14878 HB2 LYS B 431 72.291 52.345 49.914 1.00 0.00 H ATOM 14879 HB3 LYS B 431 71.554 53.810 50.604 1.00 0.00 H ATOM 14880 HG2 LYS B 431 73.456 55.138 49.958 1.00 0.00 H ATOM 14881 HG3 LYS B 431 74.337 53.689 49.418 1.00 0.00 H ATOM 14882 HD2 LYS B 431 73.536 54.587 47.417 1.00 0.00 H ATOM 14883 HD3 LYS B 431 72.326 53.342 47.806 1.00 0.00 H ATOM 14884 HE2 LYS B 431 71.269 55.412 47.039 1.00 0.00 H ATOM 14885 HE3 LYS B 431 72.074 56.316 48.342 1.00 0.00 H ATOM 14886 HZ1 LYS B 431 70.073 54.154 48.705 1.00 0.00 H ATOM 14887 HZ2 LYS B 431 70.842 55.018 49.949 1.00 0.00 H ATOM 14888 HZ3 LYS B 431 69.792 55.821 48.882 1.00 0.00 H ATOM 14889 H LYS B 431 74.708 52.024 50.643 1.00 0.00 H ATOM 14890 N ALA B 432 72.314 50.756 52.382 1.00 39.05 N ATOM 14891 CA ALA B 432 71.489 49.799 53.111 1.00 38.17 C ATOM 14892 C ALA B 432 71.947 49.764 54.556 1.00 37.49 C ATOM 14893 O ALA B 432 71.139 49.845 55.477 1.00 37.44 O ATOM 14894 CB ALA B 432 71.582 48.414 52.478 1.00 35.32 C ATOM 14895 HA ALA B 432 70.445 50.108 53.068 1.00 0.00 H ATOM 14896 HB1 ALA B 432 71.236 48.464 51.446 1.00 0.00 H ATOM 14897 HB2 ALA B 432 72.618 48.075 52.499 1.00 0.00 H ATOM 14898 HB3 ALA B 432 70.959 47.717 53.038 1.00 0.00 H ATOM 14899 H ALA B 432 73.014 50.409 51.696 1.00 0.00 H ATOM 14900 N TRP B 433 73.260 49.653 54.736 1.00 39.13 N ATOM 14901 CA TRP B 433 73.889 49.645 56.056 1.00 41.13 C ATOM 14902 C TRP B 433 73.510 50.867 56.888 1.00 41.59 C ATOM 14903 O TRP B 433 73.263 50.754 58.087 1.00 42.27 O ATOM 14904 CB TRP B 433 75.412 49.564 55.901 1.00 42.32 C ATOM 14905 CG TRP B 433 76.141 49.394 57.182 1.00 43.06 C ATOM 14906 CD1 TRP B 433 76.941 50.314 57.804 1.00 43.62 C ATOM 14907 CD2 TRP B 433 76.147 48.229 58.017 1.00 43.28 C ATOM 14908 NE1 TRP B 433 77.441 49.792 58.972 1.00 43.10 N ATOM 14909 CE2 TRP B 433 76.972 48.515 59.126 1.00 43.83 C ATOM 14910 CE3 TRP B 433 75.534 46.973 57.934 1.00 43.53 C ATOM 14911 CZ2 TRP B 433 77.200 47.589 60.145 1.00 43.36 C ATOM 14912 CZ3 TRP B 433 75.763 46.054 58.949 1.00 43.74 C ATOM 14913 CH2 TRP B 433 76.590 46.368 60.036 1.00 43.59 C ATOM 14914 HA TRP B 433 73.522 48.768 56.590 1.00 0.00 H ATOM 14915 HB2 TRP B 433 75.647 48.716 55.258 1.00 0.00 H ATOM 14916 HB3 TRP B 433 75.758 50.483 55.429 1.00 0.00 H ATOM 14917 HE1 TRP B 433 78.074 50.287 59.633 1.00 0.00 H ATOM 14918 HD1 TRP B 433 77.151 51.315 57.427 1.00 0.00 H ATOM 14919 HZ2 TRP B 433 77.839 47.829 60.995 1.00 0.00 H ATOM 14920 HH2 TRP B 433 76.752 45.622 60.814 1.00 0.00 H ATOM 14921 HZ3 TRP B 433 75.292 45.072 58.900 1.00 0.00 H ATOM 14922 HE3 TRP B 433 74.891 46.722 57.091 1.00 0.00 H ATOM 14923 H TRP B 433 73.869 49.568 53.897 1.00 0.00 H ATOM 14924 N GLU B 434 73.459 52.033 56.248 1.00 42.17 N ATOM 14925 CA GLU B 434 73.066 53.268 56.931 1.00 43.39 C ATOM 14926 C GLU B 434 71.567 53.304 57.248 1.00 43.87 C ATOM 14927 O GLU B 434 71.156 53.853 58.269 1.00 43.74 O ATOM 14928 CB GLU B 434 73.454 54.494 56.094 1.00 42.88 C ATOM 14929 HA GLU B 434 73.604 53.292 57.879 1.00 0.00 H ATOM 14930 HB2 GLU B 434 74.533 54.502 55.942 1.00 0.00 H ATOM 14931 HB3 GLU B 434 72.950 54.448 55.129 1.00 0.00 H ATOM 14932 H GLU B 434 73.704 52.068 55.238 1.00 0.00 H ATOM 14933 N GLU B 435 70.749 52.724 56.373 1.00 45.55 N ATOM 14934 CA GLU B 435 69.302 52.682 56.605 1.00 46.34 C ATOM 14935 C GLU B 435 68.959 51.781 57.794 1.00 46.65 C ATOM 14936 O GLU B 435 68.106 52.124 58.614 1.00 47.34 O ATOM 14937 CB GLU B 435 68.558 52.231 55.343 1.00 47.73 C ATOM 14938 CG GLU B 435 67.035 52.207 55.471 1.00 48.08 C ATOM 14939 CD GLU B 435 66.424 53.588 55.657 1.00 49.37 C ATOM 14940 OE1 GLU B 435 67.043 54.582 55.224 1.00 50.11 O ATOM 14941 OE2 GLU B 435 65.316 53.681 56.231 1.00 49.50 O ATOM 14942 HA GLU B 435 68.974 53.693 56.847 1.00 0.00 H ATOM 14943 HB2 GLU B 435 68.820 52.912 54.533 1.00 0.00 H ATOM 14944 HB3 GLU B 435 68.893 51.225 55.093 1.00 0.00 H ATOM 14945 HG2 GLU B 435 66.619 51.763 54.567 1.00 0.00 H ATOM 14946 HG3 GLU B 435 66.770 51.592 56.331 1.00 0.00 H ATOM 14947 H GLU B 435 71.142 52.294 55.512 1.00 0.00 H ATOM 14948 N ILE B 436 69.624 50.633 57.888 1.00 46.45 N ATOM 14949 CA ILE B 436 69.409 49.713 59.004 1.00 45.69 C ATOM 14950 C ILE B 436 69.787 50.373 60.325 1.00 46.26 C ATOM 14951 O ILE B 436 69.019 50.355 61.282 1.00 45.41 O ATOM 14952 CB ILE B 436 70.248 48.422 58.862 1.00 44.67 C ATOM 14953 CG1 ILE B 436 69.874 47.656 57.590 1.00 44.34 C ATOM 14954 CG2 ILE B 436 70.076 47.544 60.093 1.00 43.50 C ATOM 14955 CD1 ILE B 436 70.876 46.570 57.214 1.00 43.74 C ATOM 14956 HA ILE B 436 68.350 49.456 58.991 1.00 0.00 H ATOM 14957 HB ILE B 436 71.298 48.705 58.780 1.00 0.00 H ATOM 14958 HG12 ILE B 436 68.901 47.189 57.742 1.00 0.00 H ATOM 14959 HG13 ILE B 436 69.810 48.366 56.766 1.00 0.00 H ATOM 14960 HD11 ILE B 436 71.854 47.022 57.047 1.00 0.00 H ATOM 14961 HD12 ILE B 436 70.944 45.844 58.024 1.00 0.00 H ATOM 14962 HD13 ILE B 436 70.544 46.071 56.303 1.00 0.00 H ATOM 14963 HG21 ILE B 436 70.408 48.090 60.976 1.00 0.00 H ATOM 14964 HG22 ILE B 436 69.025 47.276 60.203 1.00 0.00 H ATOM 14965 HG23 ILE B 436 70.673 46.639 59.978 1.00 0.00 H ATOM 14966 H ILE B 436 70.313 50.384 57.150 1.00 0.00 H ATOM 14967 N ASN B 437 70.975 50.965 60.359 1.00 47.71 N ATOM 14968 CA ASN B 437 71.513 51.552 61.587 1.00 49.41 C ATOM 14969 C ASN B 437 70.891 52.873 62.041 1.00 50.03 C ATOM 14970 O ASN B 437 71.013 53.237 63.212 1.00 51.21 O ATOM 14971 CB ASN B 437 73.034 51.686 61.474 1.00 49.70 C ATOM 14972 CG ASN B 437 73.743 50.359 61.648 1.00 50.11 C ATOM 14973 OD1 ASN B 437 73.724 49.772 62.731 1.00 50.54 O ATOM 14974 ND2 ASN B 437 74.382 49.881 60.586 1.00 49.92 N ATOM 14975 HA ASN B 437 71.234 50.850 62.373 1.00 0.00 H ATOM 14976 HB2 ASN B 437 73.279 52.088 60.491 1.00 0.00 H ATOM 14977 HB3 ASN B 437 73.384 52.374 62.244 1.00 0.00 H ATOM 14978 HD22 ASN B 437 74.372 50.411 59.691 1.00 0.00 H ATOM 14979 HD21 ASN B 437 74.893 48.977 60.650 1.00 0.00 H ATOM 14980 H ASN B 437 71.540 51.013 59.487 1.00 0.00 H ATOM 14981 N ARG B 438 70.228 53.593 61.139 1.00 49.84 N ATOM 14982 CA ARG B 438 69.629 54.868 61.526 1.00 50.39 C ATOM 14983 C ARG B 438 68.609 54.691 62.656 1.00 50.00 C ATOM 14984 O ARG B 438 67.697 53.862 62.563 1.00 49.98 O ATOM 14985 CB ARG B 438 68.981 55.583 60.337 1.00 51.19 C ATOM 14986 CG ARG B 438 68.626 57.031 60.661 1.00 52.85 C ATOM 14987 CD ARG B 438 67.639 57.650 59.682 1.00 54.15 C ATOM 14988 NE ARG B 438 66.353 56.955 59.667 1.00 54.74 N ATOM 14989 CZ ARG B 438 65.921 56.220 58.648 1.00 55.11 C ATOM 14990 NH1 ARG B 438 64.739 55.617 58.712 1.00 54.98 N ATOM 14991 NH2 ARG B 438 66.668 56.095 57.559 1.00 55.37 N ATOM 14992 HA ARG B 438 70.444 55.494 61.891 1.00 0.00 H ATOM 14993 HB2 ARG B 438 69.676 55.571 59.498 1.00 0.00 H ATOM 14994 HB3 ARG B 438 68.071 55.051 60.061 1.00 0.00 H ATOM 14995 HG2 ARG B 438 68.189 57.064 61.659 1.00 0.00 H ATOM 14996 HG3 ARG B 438 69.542 57.622 60.647 1.00 0.00 H ATOM 14997 HD2 ARG B 438 68.069 57.612 58.681 1.00 0.00 H ATOM 14998 HD3 ARG B 438 67.471 58.689 59.965 1.00 0.00 H ATOM 14999 HE ARG B 438 65.740 57.041 60.503 1.00 0.00 H ATOM 15000 HH12 ARG B 438 64.404 55.043 57.912 1.00 0.00 H ATOM 15001 HH11 ARG B 438 64.148 55.719 59.562 1.00 0.00 H ATOM 15002 HH22 ARG B 438 66.331 55.520 56.761 1.00 0.00 H ATOM 15003 HH21 ARG B 438 67.590 56.572 57.504 1.00 0.00 H ATOM 15004 H ARG B 438 70.137 53.249 60.162 1.00 0.00 H ATOM 15005 N GLY B 439 68.779 55.472 63.721 1.00 49.11 N ATOM 15006 CA GLY B 439 67.873 55.444 64.864 1.00 48.07 C ATOM 15007 C GLY B 439 68.130 54.304 65.832 1.00 47.51 C ATOM 15008 O GLY B 439 67.442 54.171 66.841 1.00 47.13 O ATOM 15009 HA3 GLY B 439 66.853 55.353 64.490 1.00 0.00 H ATOM 15010 HA2 GLY B 439 67.977 56.384 65.406 1.00 0.00 H ATOM 15011 H GLY B 439 69.587 56.126 63.739 1.00 0.00 H ATOM 15012 N GLY B 440 69.126 53.479 65.529 1.00 48.17 N ATOM 15013 CA GLY B 440 69.433 52.328 66.365 1.00 48.35 C ATOM 15014 C GLY B 440 69.799 52.686 67.790 1.00 48.72 C ATOM 15015 O GLY B 440 70.578 53.608 68.026 1.00 50.33 O ATOM 15016 HA3 GLY B 440 70.271 51.793 65.919 1.00 0.00 H ATOM 15017 HA2 GLY B 440 68.559 51.677 66.388 1.00 0.00 H ATOM 15018 H GLY B 440 69.697 53.659 64.679 1.00 0.00 H ATOM 15019 N ILE B 441 69.222 51.959 68.743 1.00 48.69 N ATOM 15020 CA ILE B 441 69.611 52.071 70.139 1.00 48.32 C ATOM 15021 C ILE B 441 71.016 51.482 70.258 1.00 49.21 C ATOM 15022 O ILE B 441 71.868 52.017 70.971 1.00 48.76 O ATOM 15023 CB ILE B 441 68.608 51.365 71.064 1.00 48.14 C ATOM 15024 CG1 ILE B 441 67.257 52.087 71.019 1.00 47.73 C ATOM 15025 CG2 ILE B 441 69.129 51.310 72.495 1.00 47.81 C ATOM 15026 CD1 ILE B 441 66.144 51.382 71.781 1.00 46.87 C ATOM 15027 HA ILE B 441 69.612 53.114 70.456 1.00 0.00 H ATOM 15028 HB ILE B 441 68.478 50.342 70.712 1.00 0.00 H ATOM 15029 HG12 ILE B 441 67.387 53.081 71.446 1.00 0.00 H ATOM 15030 HG13 ILE B 441 66.953 52.178 69.976 1.00 0.00 H ATOM 15031 HD11 ILE B 441 65.990 50.389 71.360 1.00 0.00 H ATOM 15032 HD12 ILE B 441 66.424 51.293 72.831 1.00 0.00 H ATOM 15033 HD13 ILE B 441 65.224 51.961 71.697 1.00 0.00 H ATOM 15034 HG21 ILE B 441 70.071 50.762 72.517 1.00 0.00 H ATOM 15035 HG22 ILE B 441 69.289 52.324 72.861 1.00 0.00 H ATOM 15036 HG23 ILE B 441 68.399 50.805 73.127 1.00 0.00 H ATOM 15037 H ILE B 441 68.470 51.290 68.481 1.00 0.00 H ATOM 15038 N ILE B 442 71.258 50.379 69.552 1.00 48.76 N ATOM 15039 CA ILE B 442 72.620 49.889 69.370 1.00 48.79 C ATOM 15040 C ILE B 442 72.904 49.815 67.870 1.00 49.11 C ATOM 15041 O ILE B 442 71.987 49.899 67.050 1.00 48.59 O ATOM 15042 CB ILE B 442 72.906 48.521 70.076 1.00 49.37 C ATOM 15043 CG1 ILE B 442 72.487 47.327 69.210 1.00 49.18 C ATOM 15044 CG2 ILE B 442 72.267 48.467 71.471 1.00 48.33 C ATOM 15045 CD1 ILE B 442 71.040 46.977 69.314 1.00 50.58 C ATOM 15046 HA ILE B 442 73.297 50.591 69.856 1.00 0.00 H ATOM 15047 HB ILE B 442 73.985 48.447 70.209 1.00 0.00 H ATOM 15048 HG12 ILE B 442 72.708 47.564 68.169 1.00 0.00 H ATOM 15049 HG13 ILE B 442 73.072 46.460 69.516 1.00 0.00 H ATOM 15050 HD11 ILE B 442 70.802 46.724 70.347 1.00 0.00 H ATOM 15051 HD12 ILE B 442 70.438 47.829 68.999 1.00 0.00 H ATOM 15052 HD13 ILE B 442 70.827 46.123 68.671 1.00 0.00 H ATOM 15053 HG21 ILE B 442 72.676 49.268 72.088 1.00 0.00 H ATOM 15054 HG22 ILE B 442 71.188 48.591 71.380 1.00 0.00 H ATOM 15055 HG23 ILE B 442 72.485 47.504 71.932 1.00 0.00 H ATOM 15056 H ILE B 442 70.465 49.860 69.124 1.00 0.00 H ATOM 15057 N LYS B 443 74.172 49.679 67.507 1.00 49.53 N ATOM 15058 CA LYS B 443 74.532 49.559 66.106 1.00 51.15 C ATOM 15059 C LYS B 443 74.782 48.093 65.778 1.00 50.49 C ATOM 15060 O LYS B 443 75.121 47.299 66.657 1.00 50.27 O ATOM 15061 CB LYS B 443 75.785 50.378 65.784 1.00 52.54 C ATOM 15062 CG LYS B 443 75.727 51.831 66.228 1.00 55.26 C ATOM 15063 CD LYS B 443 77.069 52.519 66.001 1.00 56.53 C ATOM 15064 CE LYS B 443 77.094 53.922 66.602 1.00 57.57 C ATOM 15065 NZ LYS B 443 78.311 54.674 66.177 1.00 58.19 N ATOM 15066 HA LYS B 443 73.710 49.945 65.503 1.00 0.00 H ATOM 15067 HB2 LYS B 443 76.635 49.906 66.277 1.00 0.00 H ATOM 15068 HB3 LYS B 443 75.935 50.358 64.705 1.00 0.00 H ATOM 15069 HG2 LYS B 443 74.958 52.350 65.656 1.00 0.00 H ATOM 15070 HG3 LYS B 443 75.479 51.872 67.289 1.00 0.00 H ATOM 15071 HD2 LYS B 443 77.855 51.922 66.464 1.00 0.00 H ATOM 15072 HD3 LYS B 443 77.253 52.590 64.929 1.00 0.00 H ATOM 15073 HE2 LYS B 443 77.087 53.843 67.689 1.00 0.00 H ATOM 15074 HE3 LYS B 443 76.208 54.465 66.273 1.00 0.00 H ATOM 15075 HZ1 LYS B 443 79.160 54.164 66.493 1.00 0.00 H ATOM 15076 HZ2 LYS B 443 78.321 54.758 65.140 1.00 0.00 H ATOM 15077 HZ3 LYS B 443 78.297 55.623 66.603 1.00 0.00 H ATOM 15078 H LYS B 443 74.916 49.658 68.233 1.00 0.00 H ATOM 15079 N VAL B 444 74.614 47.744 64.510 1.00 49.19 N ATOM 15080 CA VAL B 444 74.894 46.401 64.052 1.00 47.82 C ATOM 15081 C VAL B 444 76.418 46.218 64.028 1.00 47.58 C ATOM 15082 O VAL B 444 77.133 47.031 63.429 1.00 47.28 O ATOM 15083 CB VAL B 444 74.287 46.151 62.645 1.00 47.70 C ATOM 15084 CG1 VAL B 444 74.501 44.719 62.218 1.00 47.02 C ATOM 15085 CG2 VAL B 444 72.805 46.483 62.624 1.00 46.87 C ATOM 15086 HA VAL B 444 74.438 45.677 64.728 1.00 0.00 H ATOM 15087 HB VAL B 444 74.798 46.808 61.941 1.00 0.00 H ATOM 15088 HG11 VAL B 444 75.570 44.507 62.184 1.00 0.00 H ATOM 15089 HG12 VAL B 444 74.020 44.052 62.933 1.00 0.00 H ATOM 15090 HG13 VAL B 444 74.068 44.567 61.229 1.00 0.00 H ATOM 15091 HG21 VAL B 444 72.283 45.856 63.347 1.00 0.00 H ATOM 15092 HG22 VAL B 444 72.665 47.532 62.884 1.00 0.00 H ATOM 15093 HG23 VAL B 444 72.407 46.298 61.626 1.00 0.00 H ATOM 15094 H VAL B 444 74.273 48.452 63.829 1.00 0.00 H ATOM 15095 N PRO B 445 76.922 45.166 64.701 1.00 46.44 N ATOM 15096 CA PRO B 445 78.353 44.868 64.695 1.00 46.18 C ATOM 15097 C PRO B 445 78.954 44.927 63.291 1.00 47.04 C ATOM 15098 O PRO B 445 78.383 44.379 62.346 1.00 47.19 O ATOM 15099 CB PRO B 445 78.409 43.442 65.245 1.00 45.42 C ATOM 15100 CG PRO B 445 77.239 43.359 66.156 1.00 45.16 C ATOM 15101 CD PRO B 445 76.162 44.211 65.528 1.00 45.62 C ATOM 15102 HA PRO B 445 78.928 45.590 65.276 1.00 0.00 H ATOM 15103 HD3 PRO B 445 75.495 43.607 64.913 1.00 0.00 H ATOM 15104 HD2 PRO B 445 75.581 44.730 66.290 1.00 0.00 H ATOM 15105 HG3 PRO B 445 77.499 43.743 67.143 1.00 0.00 H ATOM 15106 HG2 PRO B 445 76.901 42.327 66.246 1.00 0.00 H ATOM 15107 HB2 PRO B 445 78.325 42.713 64.439 1.00 0.00 H ATOM 15108 HB3 PRO B 445 79.337 43.274 65.791 1.00 0.00 H ATOM 15109 N ARG B 446 80.102 45.591 63.169 1.00 47.66 N ATOM 15110 CA ARG B 446 80.770 45.791 61.877 1.00 48.54 C ATOM 15111 C ARG B 446 80.892 44.523 61.033 1.00 47.36 C ATOM 15112 O ARG B 446 80.769 44.576 59.813 1.00 46.21 O ATOM 15113 CB ARG B 446 82.159 46.411 62.078 1.00 50.32 C ATOM 15114 CG ARG B 446 82.847 46.842 60.781 1.00 53.48 C ATOM 15115 CD ARG B 446 84.181 47.523 61.056 1.00 55.71 C ATOM 15116 NE ARG B 446 84.784 48.085 59.846 1.00 58.01 N ATOM 15117 CZ ARG B 446 84.552 49.315 59.391 1.00 58.92 C ATOM 15118 NH1 ARG B 446 83.725 50.127 60.038 1.00 58.75 N ATOM 15119 NH2 ARG B 446 85.150 49.735 58.282 1.00 60.18 N ATOM 15120 HA ARG B 446 80.127 46.473 61.321 1.00 0.00 H ATOM 15121 HB2 ARG B 446 82.053 47.288 62.717 1.00 0.00 H ATOM 15122 HB3 ARG B 446 82.793 45.676 62.574 1.00 0.00 H ATOM 15123 HG2 ARG B 446 83.019 45.962 60.162 1.00 0.00 H ATOM 15124 HG3 ARG B 446 82.197 47.537 60.249 1.00 0.00 H ATOM 15125 HD2 ARG B 446 84.867 46.790 61.481 1.00 0.00 H ATOM 15126 HD3 ARG B 446 84.021 48.328 61.774 1.00 0.00 H ATOM 15127 HE ARG B 446 85.438 47.483 59.305 1.00 0.00 H ATOM 15128 HH12 ARG B 446 83.549 51.086 59.676 1.00 0.00 H ATOM 15129 HH11 ARG B 446 83.253 49.804 60.907 1.00 0.00 H ATOM 15130 HH22 ARG B 446 84.970 50.695 57.926 1.00 0.00 H ATOM 15131 HH21 ARG B 446 85.799 49.104 57.770 1.00 0.00 H ATOM 15132 H ARG B 446 80.544 45.984 64.025 1.00 0.00 H ATOM 15133 N ILE B 447 81.135 43.389 61.688 1.00 46.46 N ATOM 15134 CA ILE B 447 81.302 42.116 60.992 1.00 46.30 C ATOM 15135 C ILE B 447 80.082 41.759 60.127 1.00 45.98 C ATOM 15136 O ILE B 447 80.227 41.157 59.059 1.00 46.87 O ATOM 15137 CB ILE B 447 81.612 40.958 61.978 1.00 46.62 C ATOM 15138 CG1 ILE B 447 82.091 39.714 61.228 1.00 47.09 C ATOM 15139 CG2 ILE B 447 80.397 40.633 62.853 1.00 46.32 C ATOM 15140 CD1 ILE B 447 83.385 39.917 60.459 1.00 48.22 C ATOM 15141 HA ILE B 447 82.157 42.245 60.329 1.00 0.00 H ATOM 15142 HB ILE B 447 82.417 41.289 62.635 1.00 0.00 H ATOM 15143 HG12 ILE B 447 82.244 38.914 61.953 1.00 0.00 H ATOM 15144 HG13 ILE B 447 81.315 39.419 60.522 1.00 0.00 H ATOM 15145 HD11 ILE B 447 83.247 40.706 59.720 1.00 0.00 H ATOM 15146 HD12 ILE B 447 84.177 40.201 61.152 1.00 0.00 H ATOM 15147 HD13 ILE B 447 83.656 38.989 59.955 1.00 0.00 H ATOM 15148 HG21 ILE B 447 80.119 41.516 63.429 1.00 0.00 H ATOM 15149 HG22 ILE B 447 79.563 40.335 62.218 1.00 0.00 H ATOM 15150 HG23 ILE B 447 80.647 39.818 63.532 1.00 0.00 H ATOM 15151 H ILE B 447 81.208 43.411 62.725 1.00 0.00 H ATOM 15152 N TYR B 448 78.894 42.148 60.584 1.00 43.73 N ATOM 15153 CA TYR B 448 77.656 41.820 59.888 1.00 42.96 C ATOM 15154 C TYR B 448 77.457 42.550 58.565 1.00 42.36 C ATOM 15155 O TYR B 448 76.566 42.193 57.794 1.00 41.63 O ATOM 15156 CB TYR B 448 76.442 42.015 60.797 1.00 43.60 C ATOM 15157 CG TYR B 448 76.010 40.747 61.501 1.00 44.41 C ATOM 15158 CD1 TYR B 448 76.037 40.643 62.892 1.00 45.33 C ATOM 15159 CD2 TYR B 448 75.573 39.646 60.767 1.00 44.27 C ATOM 15160 CE1 TYR B 448 75.632 39.467 63.532 1.00 45.36 C ATOM 15161 CE2 TYR B 448 75.174 38.479 61.389 1.00 43.87 C ATOM 15162 CZ TYR B 448 75.204 38.389 62.767 1.00 45.01 C ATOM 15163 OH TYR B 448 74.805 37.218 63.371 1.00 44.46 O ATOM 15164 HA TYR B 448 77.751 40.765 59.629 1.00 0.00 H ATOM 15165 HB3 TYR B 448 75.610 42.375 60.191 1.00 0.00 H ATOM 15166 HB2 TYR B 448 76.691 42.762 61.551 1.00 0.00 H ATOM 15167 HD2 TYR B 448 75.545 39.707 59.679 1.00 0.00 H ATOM 15168 HE2 TYR B 448 74.836 37.631 60.794 1.00 0.00 H ATOM 15169 HE1 TYR B 448 75.652 39.397 64.620 1.00 0.00 H ATOM 15170 HD1 TYR B 448 76.378 41.489 63.488 1.00 0.00 H ATOM 15171 HH TYR B 448 73.864 37.028 63.131 1.00 0.00 H ATOM 15172 H TYR B 448 78.848 42.702 61.463 1.00 0.00 H ATOM 15173 N TYR B 449 78.275 43.565 58.300 1.00 40.99 N ATOM 15174 CA TYR B 449 78.222 44.243 57.010 1.00 40.27 C ATOM 15175 C TYR B 449 78.713 43.277 55.941 1.00 40.26 C ATOM 15176 O TYR B 449 78.124 43.166 54.871 1.00 39.65 O ATOM 15177 CB TYR B 449 79.066 45.524 57.007 1.00 38.77 C ATOM 15178 CG TYR B 449 79.221 46.136 55.633 1.00 37.52 C ATOM 15179 CD1 TYR B 449 78.305 47.065 55.156 1.00 38.14 C ATOM 15180 CD2 TYR B 449 80.279 45.778 54.806 1.00 37.85 C ATOM 15181 CE1 TYR B 449 78.448 47.625 53.892 1.00 38.47 C ATOM 15182 CE2 TYR B 449 80.428 46.326 53.548 1.00 37.66 C ATOM 15183 CZ TYR B 449 79.513 47.247 53.097 1.00 37.61 C ATOM 15184 OH TYR B 449 79.666 47.789 51.844 1.00 38.97 O ATOM 15185 HA TYR B 449 77.194 44.542 56.806 1.00 0.00 H ATOM 15186 HB3 TYR B 449 80.057 45.286 57.394 1.00 0.00 H ATOM 15187 HB2 TYR B 449 78.588 46.255 57.659 1.00 0.00 H ATOM 15188 HD2 TYR B 449 81.008 45.048 55.159 1.00 0.00 H ATOM 15189 HE2 TYR B 449 81.266 46.030 52.916 1.00 0.00 H ATOM 15190 HE1 TYR B 449 77.726 48.357 53.531 1.00 0.00 H ATOM 15191 HD1 TYR B 449 77.462 47.359 55.782 1.00 0.00 H ATOM 15192 HH TYR B 449 78.931 48.430 51.671 1.00 0.00 H ATOM 15193 H TYR B 449 78.958 43.878 59.019 1.00 0.00 H ATOM 15194 N TYR B 450 79.800 42.582 56.255 1.00 41.79 N ATOM 15195 CA TYR B 450 80.404 41.615 55.349 1.00 43.06 C ATOM 15196 C TYR B 450 79.584 40.323 55.288 1.00 42.65 C ATOM 15197 O TYR B 450 79.591 39.624 54.278 1.00 42.26 O ATOM 15198 CB TYR B 450 81.865 41.368 55.754 1.00 46.45 C ATOM 15199 CG TYR B 450 82.662 42.662 55.761 1.00 48.54 C ATOM 15200 CD1 TYR B 450 83.175 43.185 54.580 1.00 49.02 C ATOM 15201 CD2 TYR B 450 82.871 43.374 56.941 1.00 49.23 C ATOM 15202 CE1 TYR B 450 83.891 44.370 54.568 1.00 50.07 C ATOM 15203 CE2 TYR B 450 83.591 44.565 56.941 1.00 50.28 C ATOM 15204 CZ TYR B 450 84.097 45.056 55.746 1.00 50.55 C ATOM 15205 OH TYR B 450 84.811 46.232 55.721 1.00 50.62 O ATOM 15206 HA TYR B 450 80.403 42.022 54.338 1.00 0.00 H ATOM 15207 HB3 TYR B 450 82.318 40.675 55.045 1.00 0.00 H ATOM 15208 HB2 TYR B 450 81.888 40.931 56.752 1.00 0.00 H ATOM 15209 HD2 TYR B 450 82.465 42.992 57.878 1.00 0.00 H ATOM 15210 HE2 TYR B 450 83.756 45.107 57.872 1.00 0.00 H ATOM 15211 HE1 TYR B 450 84.290 44.759 53.631 1.00 0.00 H ATOM 15212 HD1 TYR B 450 83.010 42.651 53.644 1.00 0.00 H ATOM 15213 HH TYR B 450 85.092 46.427 54.792 1.00 0.00 H ATOM 15214 H TYR B 450 80.238 42.734 57.186 1.00 0.00 H ATOM 15215 N VAL B 451 78.868 40.023 56.367 1.00 40.99 N ATOM 15216 CA VAL B 451 77.938 38.900 56.386 1.00 39.87 C ATOM 15217 C VAL B 451 76.787 39.165 55.419 1.00 40.08 C ATOM 15218 O VAL B 451 76.510 38.356 54.536 1.00 38.99 O ATOM 15219 CB VAL B 451 77.376 38.659 57.801 1.00 39.51 C ATOM 15220 CG1 VAL B 451 76.291 37.598 57.779 1.00 38.62 C ATOM 15221 CG2 VAL B 451 78.499 38.259 58.760 1.00 39.01 C ATOM 15222 HA VAL B 451 78.483 38.008 56.078 1.00 0.00 H ATOM 15223 HB VAL B 451 76.932 39.590 58.155 1.00 0.00 H ATOM 15224 HG11 VAL B 451 75.479 37.924 57.129 1.00 0.00 H ATOM 15225 HG12 VAL B 451 76.706 36.663 57.402 1.00 0.00 H ATOM 15226 HG13 VAL B 451 75.912 37.447 58.790 1.00 0.00 H ATOM 15227 HG21 VAL B 451 78.970 37.343 58.404 1.00 0.00 H ATOM 15228 HG22 VAL B 451 79.240 39.057 58.803 1.00 0.00 H ATOM 15229 HG23 VAL B 451 78.084 38.093 59.754 1.00 0.00 H ATOM 15230 H VAL B 451 78.974 40.606 57.222 1.00 0.00 H ATOM 15231 N MET B 452 76.132 40.309 55.584 1.00 39.96 N ATOM 15232 CA MET B 452 74.995 40.676 54.752 1.00 40.46 C ATOM 15233 C MET B 452 75.358 40.838 53.282 1.00 41.16 C ATOM 15234 O MET B 452 74.588 40.454 52.408 1.00 42.20 O ATOM 15235 CB MET B 452 74.370 41.973 55.251 1.00 40.90 C ATOM 15236 CG MET B 452 73.609 41.851 56.553 1.00 41.48 C ATOM 15237 SD MET B 452 73.209 43.485 57.182 1.00 41.43 S ATOM 15238 CE MET B 452 71.999 43.104 58.443 1.00 40.70 C ATOM 15239 HA MET B 452 74.284 39.853 54.829 1.00 0.00 H ATOM 15240 HB2 MET B 452 75.168 42.702 55.391 1.00 0.00 H ATOM 15241 HB3 MET B 452 73.681 42.333 54.487 1.00 0.00 H ATOM 15242 HG2 MET B 452 74.223 41.323 57.283 1.00 0.00 H ATOM 15243 HG3 MET B 452 72.688 41.293 56.383 1.00 0.00 H ATOM 15244 HE1 MET B 452 71.147 42.599 57.987 1.00 0.00 H ATOM 15245 HE2 MET B 452 72.450 42.454 59.193 1.00 0.00 H ATOM 15246 HE3 MET B 452 71.665 44.028 58.915 1.00 0.00 H ATOM 15247 H MET B 452 76.441 40.963 56.331 1.00 0.00 H ATOM 15248 N ARG B 453 76.528 41.406 53.011 1.00 41.98 N ATOM 15249 CA ARG B 453 76.924 41.675 51.633 1.00 41.90 C ATOM 15250 C ARG B 453 77.466 40.454 50.907 1.00 41.11 C ATOM 15251 O ARG B 453 77.186 40.269 49.727 1.00 39.37 O ATOM 15252 CB ARG B 453 77.953 42.818 51.568 1.00 42.64 C ATOM 15253 CG ARG B 453 78.156 43.370 50.156 1.00 44.04 C ATOM 15254 CD ARG B 453 79.120 44.556 50.123 1.00 45.54 C ATOM 15255 NE ARG B 453 79.290 45.070 48.764 1.00 45.76 N ATOM 15256 CZ ARG B 453 79.972 46.169 48.444 1.00 46.59 C ATOM 15257 NH1 ARG B 453 80.567 46.901 49.383 1.00 46.33 N ATOM 15258 NH2 ARG B 453 80.058 46.541 47.176 1.00 46.51 N ATOM 15259 HA ARG B 453 76.010 41.972 51.118 1.00 0.00 H ATOM 15260 HB2 ARG B 453 77.611 43.629 52.211 1.00 0.00 H ATOM 15261 HB3 ARG B 453 78.909 42.444 51.934 1.00 0.00 H ATOM 15262 HG2 ARG B 453 78.556 42.577 49.525 1.00 0.00 H ATOM 15263 HG3 ARG B 453 77.191 43.693 49.765 1.00 0.00 H ATOM 15264 HD2 ARG B 453 80.089 44.236 50.505 1.00 0.00 H ATOM 15265 HD3 ARG B 453 78.726 45.351 50.756 1.00 0.00 H ATOM 15266 HE ARG B 453 78.845 44.538 47.989 1.00 0.00 H ATOM 15267 HH12 ARG B 453 81.096 47.756 49.118 1.00 0.00 H ATOM 15268 HH11 ARG B 453 80.503 46.618 50.382 1.00 0.00 H ATOM 15269 HH22 ARG B 453 80.589 47.398 46.920 1.00 0.00 H ATOM 15270 HH21 ARG B 453 79.595 45.976 46.436 1.00 0.00 H ATOM 15271 H ARG B 453 77.168 41.662 53.790 1.00 0.00 H ATOM 15272 N TYR B 454 78.233 39.623 51.611 1.00 41.69 N ATOM 15273 CA TYR B 454 78.921 38.503 50.975 1.00 42.73 C ATOM 15274 C TYR B 454 78.499 37.112 51.459 1.00 43.08 C ATOM 15275 O TYR B 454 78.210 36.242 50.642 1.00 43.11 O ATOM 15276 CB TYR B 454 80.442 38.643 51.150 1.00 44.50 C ATOM 15277 CG TYR B 454 81.016 39.948 50.642 1.00 45.78 C ATOM 15278 CD1 TYR B 454 81.181 40.179 49.278 1.00 46.27 C ATOM 15279 CD2 TYR B 454 81.401 40.951 51.529 1.00 46.52 C ATOM 15280 CE1 TYR B 454 81.713 41.379 48.806 1.00 46.32 C ATOM 15281 CE2 TYR B 454 81.933 42.154 51.068 1.00 46.74 C ATOM 15282 CZ TYR B 454 82.085 42.360 49.708 1.00 46.04 C ATOM 15283 OH TYR B 454 82.614 43.550 49.252 1.00 46.22 O ATOM 15284 HA TYR B 454 78.627 38.563 49.927 1.00 0.00 H ATOM 15285 HB3 TYR B 454 80.923 37.827 50.611 1.00 0.00 H ATOM 15286 HB2 TYR B 454 80.672 38.561 52.212 1.00 0.00 H ATOM 15287 HD2 TYR B 454 81.284 40.792 52.601 1.00 0.00 H ATOM 15288 HE2 TYR B 454 82.228 42.929 51.775 1.00 0.00 H ATOM 15289 HE1 TYR B 454 81.835 41.543 47.735 1.00 0.00 H ATOM 15290 HD1 TYR B 454 80.889 39.407 48.566 1.00 0.00 H ATOM 15291 HH TYR B 454 82.654 43.534 48.263 1.00 0.00 H ATOM 15292 H TYR B 454 78.344 39.775 52.634 1.00 0.00 H ATOM 15293 N ILE B 455 78.481 36.904 52.775 1.00 41.78 N ATOM 15294 CA ILE B 455 78.260 35.568 53.343 1.00 40.64 C ATOM 15295 C ILE B 455 76.828 35.072 53.161 1.00 39.55 C ATOM 15296 O ILE B 455 76.605 33.979 52.642 1.00 39.74 O ATOM 15297 CB ILE B 455 78.638 35.501 54.852 1.00 40.84 C ATOM 15298 CG1 ILE B 455 80.047 36.054 55.099 1.00 41.35 C ATOM 15299 CG2 ILE B 455 78.502 34.078 55.383 1.00 40.85 C ATOM 15300 CD1 ILE B 455 81.145 35.378 54.312 1.00 42.53 C ATOM 15301 HA ILE B 455 78.922 34.910 52.780 1.00 0.00 H ATOM 15302 HB ILE B 455 77.939 36.132 55.400 1.00 0.00 H ATOM 15303 HG12 ILE B 455 80.046 37.112 54.838 1.00 0.00 H ATOM 15304 HG13 ILE B 455 80.273 35.943 56.159 1.00 0.00 H ATOM 15305 HD11 ILE B 455 81.175 34.319 54.569 1.00 0.00 H ATOM 15306 HD12 ILE B 455 80.948 35.489 53.246 1.00 0.00 H ATOM 15307 HD13 ILE B 455 82.102 35.839 54.556 1.00 0.00 H ATOM 15308 HG21 ILE B 455 77.471 33.744 55.264 1.00 0.00 H ATOM 15309 HG22 ILE B 455 79.166 33.418 54.825 1.00 0.00 H ATOM 15310 HG23 ILE B 455 78.772 34.058 56.439 1.00 0.00 H ATOM 15311 H ILE B 455 78.627 37.709 53.417 1.00 0.00 H ATOM 15312 N THR B 456 75.865 35.885 53.583 1.00 38.19 N ATOM 15313 CA THR B 456 74.445 35.528 53.501 1.00 38.29 C ATOM 15314 C THR B 456 73.942 35.233 52.072 1.00 39.09 C ATOM 15315 O THR B 456 73.297 34.208 51.856 1.00 39.83 O ATOM 15316 CB THR B 456 73.552 36.597 54.170 1.00 37.12 C ATOM 15317 OG1 THR B 456 74.031 36.854 55.495 1.00 35.51 O ATOM 15318 CG2 THR B 456 72.102 36.133 54.236 1.00 36.89 C ATOM 15319 HA THR B 456 74.364 34.591 54.051 1.00 0.00 H ATOM 15320 HB THR B 456 73.596 37.508 53.573 1.00 0.00 H ATOM 15321 HG1 THR B 456 74.000 36.018 56.024 1.00 0.00 H ATOM 15322 HG23 THR B 456 71.738 35.938 53.227 1.00 0.00 H ATOM 15323 HG21 THR B 456 72.040 35.220 54.829 1.00 0.00 H ATOM 15324 HG22 THR B 456 71.494 36.910 54.699 1.00 0.00 H ATOM 15325 H THR B 456 76.128 36.807 53.986 1.00 0.00 H ATOM 15326 N PRO B 457 74.227 36.119 51.094 1.00 38.61 N ATOM 15327 CA PRO B 457 73.731 35.771 49.755 1.00 39.31 C ATOM 15328 C PRO B 457 74.379 34.513 49.157 1.00 39.35 C ATOM 15329 O PRO B 457 73.704 33.756 48.462 1.00 38.44 O ATOM 15330 CB PRO B 457 74.044 37.017 48.910 1.00 38.67 C ATOM 15331 CG PRO B 457 75.087 37.755 49.658 1.00 39.14 C ATOM 15332 CD PRO B 457 74.947 37.405 51.114 1.00 38.84 C ATOM 15333 HA PRO B 457 72.671 35.520 49.786 1.00 0.00 H ATOM 15334 HD3 PRO B 457 75.924 37.297 51.584 1.00 0.00 H ATOM 15335 HD2 PRO B 457 74.372 38.165 51.644 1.00 0.00 H ATOM 15336 HG3 PRO B 457 74.953 38.828 49.520 1.00 0.00 H ATOM 15337 HG2 PRO B 457 76.075 37.465 49.300 1.00 0.00 H ATOM 15338 HB2 PRO B 457 74.414 36.727 47.927 1.00 0.00 H ATOM 15339 HB3 PRO B 457 73.152 37.632 48.794 1.00 0.00 H ATOM 15340 N ALA B 458 75.662 34.288 49.434 1.00 39.85 N ATOM 15341 CA ALA B 458 76.359 33.102 48.923 1.00 40.62 C ATOM 15342 C ALA B 458 75.850 31.820 49.590 1.00 40.93 C ATOM 15343 O ALA B 458 75.731 30.776 48.952 1.00 41.03 O ATOM 15344 CB ALA B 458 77.868 33.243 49.108 1.00 40.94 C ATOM 15345 HA ALA B 458 76.146 33.027 47.857 1.00 0.00 H ATOM 15346 HB1 ALA B 458 78.219 34.120 48.565 1.00 0.00 H ATOM 15347 HB2 ALA B 458 78.094 33.356 50.168 1.00 0.00 H ATOM 15348 HB3 ALA B 458 78.365 32.353 48.722 1.00 0.00 H ATOM 15349 H ALA B 458 76.181 34.968 50.025 1.00 0.00 H ATOM 15350 N PHE B 459 75.553 31.922 50.879 1.00 42.24 N ATOM 15351 CA PHE B 459 74.972 30.840 51.669 1.00 41.86 C ATOM 15352 C PHE B 459 73.638 30.397 51.066 1.00 40.88 C ATOM 15353 O PHE B 459 73.413 29.209 50.819 1.00 39.89 O ATOM 15354 CB PHE B 459 74.751 31.353 53.092 1.00 44.35 C ATOM 15355 CG PHE B 459 74.481 30.283 54.109 1.00 46.43 C ATOM 15356 CD1 PHE B 459 75.528 29.672 54.785 1.00 47.61 C ATOM 15357 CD2 PHE B 459 73.188 29.903 54.410 1.00 47.44 C ATOM 15358 CE1 PHE B 459 75.290 28.694 55.731 1.00 48.24 C ATOM 15359 CE2 PHE B 459 72.942 28.924 55.361 1.00 48.01 C ATOM 15360 CZ PHE B 459 73.993 28.318 56.020 1.00 48.05 C ATOM 15361 HA PHE B 459 75.646 29.983 51.674 1.00 0.00 H ATOM 15362 HB2 PHE B 459 75.644 31.897 53.400 1.00 0.00 H ATOM 15363 HB3 PHE B 459 73.899 32.033 53.080 1.00 0.00 H ATOM 15364 HD2 PHE B 459 72.352 30.377 53.895 1.00 0.00 H ATOM 15365 HE2 PHE B 459 71.917 28.632 55.589 1.00 0.00 H ATOM 15366 HZ PHE B 459 73.800 27.546 56.765 1.00 0.00 H ATOM 15367 HE1 PHE B 459 76.124 28.220 56.248 1.00 0.00 H ATOM 15368 HD1 PHE B 459 76.554 29.968 54.566 1.00 0.00 H ATOM 15369 H PHE B 459 75.745 32.826 51.355 1.00 0.00 H ATOM 15370 N LEU B 460 72.757 31.365 50.833 1.00 38.77 N ATOM 15371 CA LEU B 460 71.434 31.101 50.276 1.00 39.40 C ATOM 15372 C LEU B 460 71.493 30.612 48.833 1.00 40.64 C ATOM 15373 O LEU B 460 70.727 29.723 48.447 1.00 41.26 O ATOM 15374 CB LEU B 460 70.550 32.348 50.365 1.00 36.94 C ATOM 15375 CG LEU B 460 70.243 32.857 51.779 1.00 36.18 C ATOM 15376 CD1 LEU B 460 69.325 34.065 51.724 1.00 34.49 C ATOM 15377 CD2 LEU B 460 69.642 31.746 52.633 1.00 34.09 C ATOM 15378 HA LEU B 460 70.998 30.302 50.876 1.00 0.00 H ATOM 15379 HB2 LEU B 460 71.050 33.151 49.823 1.00 0.00 H ATOM 15380 HB3 LEU B 460 69.601 32.120 49.880 1.00 0.00 H ATOM 15381 HG LEU B 460 71.178 33.167 52.245 1.00 0.00 H ATOM 15382 HD21 LEU B 460 68.716 31.397 52.175 1.00 0.00 H ATOM 15383 HD22 LEU B 460 70.349 30.919 52.701 1.00 0.00 H ATOM 15384 HD23 LEU B 460 69.432 32.130 53.631 1.00 0.00 H ATOM 15385 HD11 LEU B 460 69.808 34.862 51.158 1.00 0.00 H ATOM 15386 HD12 LEU B 460 68.390 33.787 51.237 1.00 0.00 H ATOM 15387 HD13 LEU B 460 69.120 34.410 52.737 1.00 0.00 H ATOM 15388 H LEU B 460 73.020 32.346 51.056 1.00 0.00 H ATOM 15389 N ALA B 461 72.395 31.189 48.039 1.00 40.77 N ATOM 15390 CA ALA B 461 72.516 30.807 46.638 1.00 41.35 C ATOM 15391 C ALA B 461 72.999 29.369 46.508 1.00 42.78 C ATOM 15392 O ALA B 461 72.439 28.597 45.728 1.00 41.68 O ATOM 15393 CB ALA B 461 73.434 31.756 45.891 1.00 41.24 C ATOM 15394 HA ALA B 461 71.527 30.874 46.186 1.00 0.00 H ATOM 15395 HB1 ALA B 461 73.030 32.767 45.944 1.00 0.00 H ATOM 15396 HB2 ALA B 461 74.424 31.735 46.346 1.00 0.00 H ATOM 15397 HB3 ALA B 461 73.505 31.446 44.848 1.00 0.00 H ATOM 15398 H ALA B 461 73.022 31.923 48.425 1.00 0.00 H ATOM 15399 N VAL B 462 74.037 29.014 47.267 1.00 43.72 N ATOM 15400 CA VAL B 462 74.556 27.650 47.263 1.00 46.19 C ATOM 15401 C VAL B 462 73.475 26.672 47.721 1.00 47.65 C ATOM 15402 O VAL B 462 73.275 25.616 47.111 1.00 47.92 O ATOM 15403 CB VAL B 462 75.799 27.509 48.158 1.00 45.84 C ATOM 15404 CG1 VAL B 462 76.078 26.047 48.456 1.00 47.01 C ATOM 15405 CG2 VAL B 462 77.007 28.162 47.501 1.00 46.28 C ATOM 15406 HA VAL B 462 74.851 27.415 46.240 1.00 0.00 H ATOM 15407 HB VAL B 462 75.604 28.020 49.101 1.00 0.00 H ATOM 15408 HG11 VAL B 462 75.221 25.612 48.970 1.00 0.00 H ATOM 15409 HG12 VAL B 462 76.252 25.514 47.521 1.00 0.00 H ATOM 15410 HG13 VAL B 462 76.961 25.969 49.090 1.00 0.00 H ATOM 15411 HG21 VAL B 462 77.203 27.680 46.543 1.00 0.00 H ATOM 15412 HG22 VAL B 462 76.804 29.221 47.341 1.00 0.00 H ATOM 15413 HG23 VAL B 462 77.876 28.051 48.150 1.00 0.00 H ATOM 15414 H VAL B 462 74.487 29.726 47.876 1.00 0.00 H ATOM 15415 N LEU B 463 72.775 27.047 48.791 1.00 48.71 N ATOM 15416 CA LEU B 463 71.671 26.264 49.337 1.00 48.96 C ATOM 15417 C LEU B 463 70.624 25.956 48.279 1.00 48.79 C ATOM 15418 O LEU B 463 70.254 24.801 48.087 1.00 48.96 O ATOM 15419 CB LEU B 463 70.998 27.019 50.486 1.00 50.84 C ATOM 15420 CG LEU B 463 69.987 26.219 51.309 1.00 52.08 C ATOM 15421 CD1 LEU B 463 70.731 25.363 52.333 1.00 52.78 C ATOM 15422 CD2 LEU B 463 68.999 27.144 51.993 1.00 52.25 C ATOM 15423 HA LEU B 463 72.093 25.326 49.699 1.00 0.00 H ATOM 15424 HB2 LEU B 463 71.780 27.365 51.162 1.00 0.00 H ATOM 15425 HB3 LEU B 463 70.479 27.879 50.062 1.00 0.00 H ATOM 15426 HG LEU B 463 69.421 25.566 50.644 1.00 0.00 H ATOM 15427 HD21 LEU B 463 69.537 27.821 52.657 1.00 0.00 H ATOM 15428 HD22 LEU B 463 68.462 27.721 51.240 1.00 0.00 H ATOM 15429 HD23 LEU B 463 68.290 26.552 52.572 1.00 0.00 H ATOM 15430 HD11 LEU B 463 71.402 24.679 51.814 1.00 0.00 H ATOM 15431 HD12 LEU B 463 71.309 26.009 52.993 1.00 0.00 H ATOM 15432 HD13 LEU B 463 70.011 24.793 52.920 1.00 0.00 H ATOM 15433 H LEU B 463 73.027 27.941 49.260 1.00 0.00 H ATOM 15434 N LEU B 464 70.145 26.998 47.605 1.00 48.22 N ATOM 15435 CA LEU B 464 69.141 26.850 46.553 1.00 49.18 C ATOM 15436 C LEU B 464 69.615 25.974 45.391 1.00 50.33 C ATOM 15437 O LEU B 464 68.817 25.249 44.797 1.00 50.35 O ATOM 15438 CB LEU B 464 68.709 28.221 46.023 1.00 48.36 C ATOM 15439 CG LEU B 464 67.790 29.071 46.904 1.00 48.22 C ATOM 15440 CD1 LEU B 464 67.710 30.512 46.398 1.00 47.04 C ATOM 15441 CD2 LEU B 464 66.404 28.448 46.980 1.00 47.94 C ATOM 15442 HA LEU B 464 68.291 26.346 47.012 1.00 0.00 H ATOM 15443 HB2 LEU B 464 69.615 28.800 45.844 1.00 0.00 H ATOM 15444 HB3 LEU B 464 68.192 28.056 45.078 1.00 0.00 H ATOM 15445 HG LEU B 464 68.215 29.097 47.907 1.00 0.00 H ATOM 15446 HD21 LEU B 464 65.979 28.387 45.978 1.00 0.00 H ATOM 15447 HD22 LEU B 464 66.480 27.448 47.406 1.00 0.00 H ATOM 15448 HD23 LEU B 464 65.764 29.065 47.610 1.00 0.00 H ATOM 15449 HD11 LEU B 464 68.706 30.955 46.407 1.00 0.00 H ATOM 15450 HD12 LEU B 464 67.318 30.517 45.381 1.00 0.00 H ATOM 15451 HD13 LEU B 464 67.049 31.087 47.047 1.00 0.00 H ATOM 15452 H LEU B 464 70.497 27.950 47.834 1.00 0.00 H ATOM 15453 N VAL B 465 70.903 26.052 45.068 1.00 51.63 N ATOM 15454 CA VAL B 465 71.478 25.244 43.990 1.00 53.86 C ATOM 15455 C VAL B 465 71.486 23.764 44.380 1.00 55.39 C ATOM 15456 O VAL B 465 70.972 22.922 43.644 1.00 55.27 O ATOM 15457 CB VAL B 465 72.904 25.729 43.602 1.00 53.46 C ATOM 15458 CG1 VAL B 465 73.635 24.688 42.760 1.00 53.61 C ATOM 15459 CG2 VAL B 465 72.832 27.054 42.856 1.00 52.82 C ATOM 15460 HA VAL B 465 70.849 25.367 43.109 1.00 0.00 H ATOM 15461 HB VAL B 465 73.468 25.873 44.524 1.00 0.00 H ATOM 15462 HG11 VAL B 465 73.726 23.762 43.328 1.00 0.00 H ATOM 15463 HG12 VAL B 465 73.071 24.501 41.846 1.00 0.00 H ATOM 15464 HG13 VAL B 465 74.628 25.060 42.507 1.00 0.00 H ATOM 15465 HG21 VAL B 465 72.241 26.927 41.949 1.00 0.00 H ATOM 15466 HG22 VAL B 465 72.364 27.804 43.494 1.00 0.00 H ATOM 15467 HG23 VAL B 465 73.839 27.377 42.593 1.00 0.00 H ATOM 15468 H VAL B 465 71.518 26.704 45.595 1.00 0.00 H ATOM 15469 N VAL B 466 72.061 23.461 45.541 1.00 57.46 N ATOM 15470 CA VAL B 466 72.088 22.098 46.069 1.00 59.80 C ATOM 15471 C VAL B 466 70.668 21.545 46.200 1.00 61.66 C ATOM 15472 O VAL B 466 70.433 20.347 46.025 1.00 61.88 O ATOM 15473 CB VAL B 466 72.802 22.038 47.432 1.00 59.86 C ATOM 15474 CG1 VAL B 466 72.638 20.667 48.077 1.00 60.08 C ATOM 15475 CG2 VAL B 466 74.278 22.383 47.270 1.00 59.90 C ATOM 15476 HA VAL B 466 72.647 21.483 45.364 1.00 0.00 H ATOM 15477 HB VAL B 466 72.341 22.774 48.091 1.00 0.00 H ATOM 15478 HG11 VAL B 466 71.578 20.463 48.229 1.00 0.00 H ATOM 15479 HG12 VAL B 466 73.066 19.906 47.424 1.00 0.00 H ATOM 15480 HG13 VAL B 466 73.153 20.655 49.038 1.00 0.00 H ATOM 15481 HG21 VAL B 466 74.744 21.669 46.591 1.00 0.00 H ATOM 15482 HG22 VAL B 466 74.372 23.389 46.862 1.00 0.00 H ATOM 15483 HG23 VAL B 466 74.769 22.336 48.242 1.00 0.00 H ATOM 15484 H VAL B 466 72.507 24.221 46.093 1.00 0.00 H ATOM 15485 N TRP B 467 69.728 22.436 46.498 1.00 63.20 N ATOM 15486 CA TRP B 467 68.323 22.082 46.623 1.00 65.05 C ATOM 15487 C TRP B 467 67.751 21.663 45.278 1.00 66.07 C ATOM 15488 O TRP B 467 67.212 20.568 45.133 1.00 66.08 O ATOM 15489 CB TRP B 467 67.526 23.281 47.126 1.00 65.86 C ATOM 15490 CG TRP B 467 66.290 22.925 47.873 1.00 65.88 C ATOM 15491 CD1 TRP B 467 65.457 21.869 47.638 1.00 66.10 C ATOM 15492 CD2 TRP B 467 65.731 23.640 48.977 1.00 66.35 C ATOM 15493 NE1 TRP B 467 64.419 21.877 48.536 1.00 66.03 N ATOM 15494 CE2 TRP B 467 64.564 22.955 49.370 1.00 66.50 C ATOM 15495 CE3 TRP B 467 66.106 24.794 49.675 1.00 66.37 C ATOM 15496 CZ2 TRP B 467 63.767 23.387 50.431 1.00 66.61 C ATOM 15497 CZ3 TRP B 467 65.314 25.221 50.730 1.00 66.46 C ATOM 15498 CH2 TRP B 467 64.160 24.520 51.097 1.00 66.38 C ATOM 15499 HA TRP B 467 68.249 21.253 47.327 1.00 0.00 H ATOM 15500 HB2 TRP B 467 68.168 23.865 47.786 1.00 0.00 H ATOM 15501 HB3 TRP B 467 67.243 23.888 46.266 1.00 0.00 H ATOM 15502 HE1 TRP B 467 63.649 21.179 48.577 1.00 0.00 H ATOM 15503 HD1 TRP B 467 65.596 21.127 46.851 1.00 0.00 H ATOM 15504 HZ2 TRP B 467 62.867 22.845 50.720 1.00 0.00 H ATOM 15505 HH2 TRP B 467 63.559 24.883 51.931 1.00 0.00 H ATOM 15506 HZ3 TRP B 467 65.595 26.118 51.283 1.00 0.00 H ATOM 15507 HE3 TRP B 467 67.003 25.346 49.395 1.00 0.00 H ATOM 15508 H TRP B 467 70.008 23.426 46.648 1.00 0.00 H ATOM 15509 N ALA B 468 67.874 22.553 44.297 1.00 67.26 N ATOM 15510 CA ALA B 468 67.294 22.341 42.974 1.00 68.68 C ATOM 15511 C ALA B 468 67.984 21.245 42.156 1.00 69.93 C ATOM 15512 O ALA B 468 67.421 20.746 41.182 1.00 70.08 O ATOM 15513 CB ALA B 468 67.269 23.650 42.194 1.00 68.62 C ATOM 15514 HA ALA B 468 66.277 21.988 43.145 1.00 0.00 H ATOM 15515 HB1 ALA B 468 66.669 24.382 42.734 1.00 0.00 H ATOM 15516 HB2 ALA B 468 68.287 24.024 42.082 1.00 0.00 H ATOM 15517 HB3 ALA B 468 66.834 23.477 41.210 1.00 0.00 H ATOM 15518 H ALA B 468 68.402 23.431 44.479 1.00 0.00 H ATOM 15519 N ARG B 469 69.195 20.868 42.544 1.00 71.32 N ATOM 15520 CA ARG B 469 69.912 19.823 41.827 1.00 73.24 C ATOM 15521 C ARG B 469 69.587 18.429 42.347 1.00 74.47 C ATOM 15522 O ARG B 469 69.293 17.521 41.571 1.00 74.76 O ATOM 15523 CB ARG B 469 71.422 20.050 41.901 1.00 73.32 C ATOM 15524 CG ARG B 469 71.957 21.098 40.944 1.00 73.74 C ATOM 15525 CD ARG B 469 73.456 21.250 41.127 1.00 74.14 C ATOM 15526 NE ARG B 469 74.061 22.126 40.129 1.00 74.48 N ATOM 15527 CZ ARG B 469 75.326 22.533 40.169 1.00 74.66 C ATOM 15528 NH1 ARG B 469 76.115 22.145 41.163 1.00 74.30 N ATOM 15529 NH2 ARG B 469 75.800 23.330 39.218 1.00 74.64 N ATOM 15530 HA ARG B 469 69.581 19.881 40.790 1.00 0.00 H ATOM 15531 HB2 ARG B 469 71.669 20.360 42.916 1.00 0.00 H ATOM 15532 HB3 ARG B 469 71.918 19.105 41.681 1.00 0.00 H ATOM 15533 HG2 ARG B 469 71.747 20.792 39.919 1.00 0.00 H ATOM 15534 HG3 ARG B 469 71.470 22.052 41.144 1.00 0.00 H ATOM 15535 HD2 ARG B 469 73.918 20.266 41.053 1.00 0.00 H ATOM 15536 HD3 ARG B 469 73.646 21.665 42.117 1.00 0.00 H ATOM 15537 HE ARG B 469 73.467 22.451 39.339 1.00 0.00 H ATOM 15538 HH12 ARG B 469 77.105 22.463 41.196 1.00 0.00 H ATOM 15539 HH11 ARG B 469 75.744 21.523 41.909 1.00 0.00 H ATOM 15540 HH22 ARG B 469 76.790 23.647 39.251 1.00 0.00 H ATOM 15541 HH21 ARG B 469 75.181 23.637 38.440 1.00 0.00 H ATOM 15542 H ARG B 469 69.637 21.323 43.368 1.00 0.00 H ATOM 15543 N GLU B 470 69.630 18.264 43.664 1.00 75.93 N ATOM 15544 CA GLU B 470 69.556 16.931 44.255 1.00 78.01 C ATOM 15545 C GLU B 470 68.275 16.622 45.032 1.00 78.81 C ATOM 15546 O GLU B 470 68.207 15.598 45.715 1.00 78.84 O ATOM 15547 CB GLU B 470 70.769 16.706 45.172 1.00 78.33 C ATOM 15548 CG GLU B 470 72.117 17.117 44.571 1.00 79.09 C ATOM 15549 CD GLU B 470 72.558 16.232 43.413 1.00 79.44 C ATOM 15550 OE1 GLU B 470 72.084 15.079 43.319 1.00 79.74 O ATOM 15551 OE2 GLU B 470 73.389 16.690 42.599 1.00 79.84 O ATOM 15552 HA GLU B 470 69.553 16.246 43.407 1.00 0.00 H ATOM 15553 HB2 GLU B 470 70.615 17.282 46.085 1.00 0.00 H ATOM 15554 HB3 GLU B 470 70.817 15.645 45.417 1.00 0.00 H ATOM 15555 HG2 GLU B 470 72.037 18.143 44.211 1.00 0.00 H ATOM 15556 HG3 GLU B 470 72.874 17.066 45.353 1.00 0.00 H ATOM 15557 H GLU B 470 69.718 19.095 44.283 1.00 0.00 H ATOM 15558 N TYR B 471 67.266 17.485 44.938 1.00 79.84 N ATOM 15559 CA TYR B 471 66.053 17.275 45.737 1.00 80.93 C ATOM 15560 C TYR B 471 64.734 17.603 45.032 1.00 81.58 C ATOM 15561 O TYR B 471 63.712 16.978 45.316 1.00 81.81 O ATOM 15562 CB TYR B 471 66.141 18.035 47.075 1.00 81.17 C ATOM 15563 CG TYR B 471 67.320 17.639 47.950 1.00 81.34 C ATOM 15564 CD1 TYR B 471 67.263 16.512 48.764 1.00 81.16 C ATOM 15565 CD2 TYR B 471 68.487 18.397 47.959 1.00 81.50 C ATOM 15566 CE1 TYR B 471 68.341 16.151 49.565 1.00 81.34 C ATOM 15567 CE2 TYR B 471 69.569 18.045 48.754 1.00 81.39 C ATOM 15568 CZ TYR B 471 69.490 16.923 49.553 1.00 81.44 C ATOM 15569 OH TYR B 471 70.566 16.578 50.340 1.00 81.22 O ATOM 15570 HA TYR B 471 66.025 16.199 45.910 1.00 0.00 H ATOM 15571 HB3 TYR B 471 65.224 17.848 47.634 1.00 0.00 H ATOM 15572 HB2 TYR B 471 66.221 19.100 46.857 1.00 0.00 H ATOM 15573 HD2 TYR B 471 68.553 19.284 47.329 1.00 0.00 H ATOM 15574 HE2 TYR B 471 70.475 18.651 48.747 1.00 0.00 H ATOM 15575 HE1 TYR B 471 68.282 15.266 50.198 1.00 0.00 H ATOM 15576 HD1 TYR B 471 66.359 15.903 48.774 1.00 0.00 H ATOM 15577 HH TYR B 471 70.351 15.756 50.848 1.00 0.00 H ATOM 15578 H TYR B 471 67.337 18.304 44.301 1.00 0.00 H ATOM 15579 N ILE B 472 64.743 18.572 44.120 1.00 82.34 N ATOM 15580 CA ILE B 472 63.498 18.962 43.444 1.00 83.26 C ATOM 15581 C ILE B 472 63.093 18.111 42.227 1.00 83.86 C ATOM 15582 O ILE B 472 61.906 18.033 41.910 1.00 84.00 O ATOM 15583 CB ILE B 472 63.456 20.487 43.084 1.00 83.64 C ATOM 15584 CG1 ILE B 472 64.430 20.836 41.953 1.00 83.86 C ATOM 15585 CG2 ILE B 472 63.711 21.340 44.325 1.00 83.63 C ATOM 15586 CD1 ILE B 472 63.864 20.699 40.542 1.00 84.19 C ATOM 15587 HA ILE B 472 62.744 18.753 44.202 1.00 0.00 H ATOM 15588 HB ILE B 472 62.455 20.712 42.717 1.00 0.00 H ATOM 15589 HG12 ILE B 472 64.749 21.869 42.090 1.00 0.00 H ATOM 15590 HG13 ILE B 472 65.294 20.176 42.036 1.00 0.00 H ATOM 15591 HD11 ILE B 472 63.551 19.668 40.376 1.00 0.00 H ATOM 15592 HD12 ILE B 472 63.007 21.363 40.430 1.00 0.00 H ATOM 15593 HD13 ILE B 472 64.631 20.969 39.816 1.00 0.00 H ATOM 15594 HG21 ILE B 472 62.944 21.132 45.071 1.00 0.00 H ATOM 15595 HG22 ILE B 472 64.693 21.100 44.734 1.00 0.00 H ATOM 15596 HG23 ILE B 472 63.677 22.395 44.052 1.00 0.00 H ATOM 15597 H ILE B 472 65.634 19.055 43.885 1.00 0.00 H ATOM 15598 N PRO B 473 64.064 17.473 41.538 1.00 84.61 N ATOM 15599 CA PRO B 473 63.621 16.623 40.429 1.00 84.95 C ATOM 15600 C PRO B 473 62.883 15.373 40.922 1.00 85.38 C ATOM 15601 O PRO B 473 62.166 14.736 40.151 1.00 85.91 O ATOM 15602 CB PRO B 473 64.933 16.241 39.736 1.00 84.77 C ATOM 15603 CG PRO B 473 65.962 16.332 40.797 1.00 84.74 C ATOM 15604 CD PRO B 473 65.532 17.468 41.678 1.00 84.68 C ATOM 15605 HA PRO B 473 62.913 17.130 39.774 1.00 0.00 H ATOM 15606 HD3 PRO B 473 65.825 17.292 42.713 1.00 0.00 H ATOM 15607 HD2 PRO B 473 65.960 18.410 41.336 1.00 0.00 H ATOM 15608 HG3 PRO B 473 66.940 16.536 40.362 1.00 0.00 H ATOM 15609 HG2 PRO B 473 66.005 15.404 41.366 1.00 0.00 H ATOM 15610 HB2 PRO B 473 64.878 15.227 39.340 1.00 0.00 H ATOM 15611 HB3 PRO B 473 65.155 16.934 38.925 1.00 0.00 H ATOM 15612 N LYS B 474 63.059 15.040 42.202 1.00 85.64 N ATOM 15613 CA LYS B 474 62.389 13.896 42.822 1.00 85.84 C ATOM 15614 C LYS B 474 60.932 14.209 43.160 1.00 85.99 C ATOM 15615 O LYS B 474 60.194 13.334 43.614 1.00 86.22 O ATOM 15616 CB LYS B 474 63.120 13.468 44.099 1.00 85.79 C ATOM 15617 CG LYS B 474 64.578 13.094 43.900 1.00 86.37 C ATOM 15618 CD LYS B 474 65.261 12.827 45.230 1.00 86.37 C ATOM 15619 CE LYS B 474 66.754 12.598 45.045 1.00 86.47 C ATOM 15620 NZ LYS B 474 67.454 12.412 46.349 1.00 86.40 N ATOM 15621 HA LYS B 474 62.410 13.083 42.097 1.00 0.00 H ATOM 15622 HB2 LYS B 474 63.075 14.293 44.809 1.00 0.00 H ATOM 15623 HB3 LYS B 474 62.601 12.604 44.514 1.00 0.00 H ATOM 15624 HG2 LYS B 474 64.635 12.197 43.284 1.00 0.00 H ATOM 15625 HG3 LYS B 474 65.090 13.913 43.395 1.00 0.00 H ATOM 15626 HD2 LYS B 474 65.111 13.685 45.886 1.00 0.00 H ATOM 15627 HD3 LYS B 474 64.819 11.941 45.686 1.00 0.00 H ATOM 15628 HE2 LYS B 474 67.183 13.460 44.535 1.00 0.00 H ATOM 15629 HE3 LYS B 474 66.901 11.706 44.435 1.00 0.00 H ATOM 15630 HZ1 LYS B 474 67.324 13.261 46.935 1.00 0.00 H ATOM 15631 HZ2 LYS B 474 67.056 11.586 46.840 1.00 0.00 H ATOM 15632 HZ3 LYS B 474 68.468 12.259 46.178 1.00 0.00 H ATOM 15633 H LYS B 474 63.699 15.618 42.784 1.00 0.00 H ATOM 15634 N ILE B 475 60.526 15.459 42.950 1.00 85.94 N ATOM 15635 CA ILE B 475 59.161 15.891 43.257 1.00 85.36 C ATOM 15636 C ILE B 475 58.431 16.356 41.990 1.00 84.92 C ATOM 15637 O ILE B 475 57.200 16.422 41.959 1.00 85.25 O ATOM 15638 CB ILE B 475 59.145 17.012 44.331 1.00 85.44 C ATOM 15639 CG1 ILE B 475 60.111 16.680 45.475 1.00 85.16 C ATOM 15640 CG2 ILE B 475 57.733 17.235 44.868 1.00 85.52 C ATOM 15641 CD1 ILE B 475 60.160 17.729 46.566 1.00 84.89 C ATOM 15642 HA ILE B 475 58.634 15.028 43.663 1.00 0.00 H ATOM 15643 HB ILE B 475 59.477 17.936 43.858 1.00 0.00 H ATOM 15644 HG12 ILE B 475 59.801 15.735 45.922 1.00 0.00 H ATOM 15645 HG13 ILE B 475 61.112 16.572 45.058 1.00 0.00 H ATOM 15646 HD11 ILE B 475 60.480 18.680 46.140 1.00 0.00 H ATOM 15647 HD12 ILE B 475 59.169 17.842 47.005 1.00 0.00 H ATOM 15648 HD13 ILE B 475 60.866 17.418 47.336 1.00 0.00 H ATOM 15649 HG21 ILE B 475 57.076 17.526 44.049 1.00 0.00 H ATOM 15650 HG22 ILE B 475 57.367 16.313 45.319 1.00 0.00 H ATOM 15651 HG23 ILE B 475 57.752 18.025 45.618 1.00 0.00 H ATOM 15652 H ILE B 475 61.198 16.149 42.557 1.00 0.00 H ATOM 15653 N MET B 476 59.193 16.673 40.947 1.00 83.81 N ATOM 15654 CA MET B 476 58.602 17.101 39.679 1.00 82.76 C ATOM 15655 C MET B 476 58.153 15.911 38.830 1.00 82.17 C ATOM 15656 O MET B 476 57.425 16.077 37.847 1.00 82.04 O ATOM 15657 CB MET B 476 59.575 17.981 38.889 1.00 82.93 C ATOM 15658 CG MET B 476 59.929 19.297 39.575 1.00 82.92 C ATOM 15659 SD MET B 476 58.493 20.294 40.035 1.00 82.51 S ATOM 15660 CE MET B 476 57.825 20.735 38.429 1.00 82.32 C ATOM 15661 HA MET B 476 57.717 17.690 39.921 1.00 0.00 H ATOM 15662 HB2 MET B 476 60.495 17.418 38.733 1.00 0.00 H ATOM 15663 HB3 MET B 476 59.123 18.209 37.924 1.00 0.00 H ATOM 15664 HG2 MET B 476 60.550 19.882 38.896 1.00 0.00 H ATOM 15665 HG3 MET B 476 60.494 19.072 40.479 1.00 0.00 H ATOM 15666 HE1 MET B 476 58.573 21.293 37.867 1.00 0.00 H ATOM 15667 HE2 MET B 476 57.562 19.828 37.885 1.00 0.00 H ATOM 15668 HE3 MET B 476 56.936 21.351 38.563 1.00 0.00 H ATOM 15669 H MET B 476 60.228 16.616 41.034 1.00 0.00 H ATOM 15670 N GLU B 477 58.587 14.714 39.215 1.00 81.06 N ATOM 15671 CA GLU B 477 58.237 13.495 38.498 1.00 79.39 C ATOM 15672 C GLU B 477 57.447 12.528 39.374 1.00 78.06 C ATOM 15673 O GLU B 477 56.647 11.735 38.870 1.00 78.07 O ATOM 15674 CB GLU B 477 59.499 12.775 38.019 1.00 80.15 C ATOM 15675 CG GLU B 477 60.516 13.630 37.285 1.00 80.89 C ATOM 15676 CD GLU B 477 61.812 12.872 37.008 1.00 81.50 C ATOM 15677 OE1 GLU B 477 61.754 11.640 36.788 1.00 81.72 O ATOM 15678 OE2 GLU B 477 62.889 13.508 37.008 1.00 81.63 O ATOM 15679 HA GLU B 477 57.621 13.796 37.650 1.00 0.00 H ATOM 15680 HB2 GLU B 477 59.991 12.347 38.893 1.00 0.00 H ATOM 15681 HB3 GLU B 477 59.191 11.973 37.348 1.00 0.00 H ATOM 15682 HG2 GLU B 477 60.086 13.950 36.336 1.00 0.00 H ATOM 15683 HG3 GLU B 477 60.744 14.505 37.893 1.00 0.00 H ATOM 15684 H GLU B 477 59.196 14.646 40.055 1.00 0.00 H ATOM 15685 N GLU B 478 57.669 12.600 40.684 1.00 75.88 N ATOM 15686 CA GLU B 478 57.151 11.591 41.608 1.00 73.72 C ATOM 15687 C GLU B 478 55.901 12.026 42.382 1.00 70.85 C ATOM 15688 O GLU B 478 55.791 11.761 43.580 1.00 71.02 O ATOM 15689 CB GLU B 478 58.257 11.192 42.599 1.00 75.31 C ATOM 15690 CG GLU B 478 58.367 9.696 42.886 1.00 76.83 C ATOM 15691 CD GLU B 478 59.243 8.965 41.871 1.00 77.53 C ATOM 15692 OE1 GLU B 478 60.362 9.449 41.589 1.00 77.53 O ATOM 15693 OE2 GLU B 478 58.816 7.903 41.364 1.00 77.55 O ATOM 15694 HA GLU B 478 56.845 10.744 40.994 1.00 0.00 H ATOM 15695 HB2 GLU B 478 59.211 11.528 42.193 1.00 0.00 H ATOM 15696 HB3 GLU B 478 58.065 11.703 43.542 1.00 0.00 H ATOM 15697 HG2 GLU B 478 58.796 9.562 43.879 1.00 0.00 H ATOM 15698 HG3 GLU B 478 57.368 9.261 42.862 1.00 0.00 H ATOM 15699 H GLU B 478 58.225 13.394 41.061 1.00 0.00 H ATOM 15700 N THR B 479 54.959 12.684 41.706 1.00 66.79 N ATOM 15701 CA THR B 479 53.721 13.127 42.365 1.00 62.36 C ATOM 15702 C THR B 479 52.437 12.741 41.617 1.00 58.34 C ATOM 15703 O THR B 479 52.431 12.592 40.392 1.00 58.16 O ATOM 15704 CB THR B 479 53.703 14.662 42.608 1.00 63.28 C ATOM 15705 OG1 THR B 479 54.084 15.348 41.410 1.00 63.48 O ATOM 15706 CG2 THR B 479 54.651 15.055 43.740 1.00 63.43 C ATOM 15707 HA THR B 479 53.729 12.596 43.317 1.00 0.00 H ATOM 15708 HB THR B 479 52.690 14.946 42.892 1.00 0.00 H ATOM 15709 HG1 THR B 479 54.070 16.325 41.572 1.00 0.00 H ATOM 15710 HG23 THR B 479 54.362 14.533 44.652 1.00 0.00 H ATOM 15711 HG21 THR B 479 55.671 14.780 43.470 1.00 0.00 H ATOM 15712 HG22 THR B 479 54.595 16.131 43.902 1.00 0.00 H ATOM 15713 H THR B 479 55.102 12.887 40.696 1.00 0.00 H ATOM 15714 N HIS B 480 51.355 12.586 42.377 1.00 52.09 N ATOM 15715 CA HIS B 480 50.025 12.341 41.837 1.00 46.62 C ATOM 15716 C HIS B 480 49.597 13.547 40.995 1.00 43.15 C ATOM 15717 O HIS B 480 49.986 14.673 41.289 1.00 42.97 O ATOM 15718 CB HIS B 480 49.056 12.131 43.002 1.00 46.17 C ATOM 15719 CG HIS B 480 47.717 11.597 42.599 1.00 46.18 C ATOM 15720 ND1 HIS B 480 46.589 12.386 42.536 1.00 45.94 N ATOM 15721 CD2 HIS B 480 47.322 10.350 42.251 1.00 46.47 C ATOM 15722 CE1 HIS B 480 45.557 11.650 42.161 1.00 46.05 C ATOM 15723 NE2 HIS B 480 45.975 10.410 41.983 1.00 46.94 N ATOM 15724 HA HIS B 480 50.024 11.453 41.205 1.00 0.00 H ATOM 15725 HB2 HIS B 480 49.509 11.427 43.701 1.00 0.00 H ATOM 15726 HB3 HIS B 480 48.906 13.089 43.499 1.00 0.00 H ATOM 15727 HD2 HIS B 480 47.954 9.464 42.194 1.00 0.00 H ATOM 15728 HE1 HIS B 480 44.536 12.006 42.022 1.00 0.00 H ATOM 15729 H HIS B 480 51.465 12.643 43.410 1.00 0.00 H ATOM 15730 N TRP B 481 48.801 13.320 39.956 1.00 39.18 N ATOM 15731 CA TRP B 481 48.392 14.405 39.053 1.00 34.61 C ATOM 15732 C TRP B 481 47.650 15.554 39.755 1.00 31.98 C ATOM 15733 O TRP B 481 47.636 16.686 39.264 1.00 30.61 O ATOM 15734 CB TRP B 481 47.523 13.860 37.914 1.00 33.38 C ATOM 15735 CG TRP B 481 46.206 13.284 38.352 1.00 33.57 C ATOM 15736 CD1 TRP B 481 45.955 11.983 38.675 1.00 33.50 C ATOM 15737 CD2 TRP B 481 44.956 13.982 38.502 1.00 34.37 C ATOM 15738 NE1 TRP B 481 44.638 11.826 39.019 1.00 32.89 N ATOM 15739 CE2 TRP B 481 43.999 13.035 38.922 1.00 33.63 C ATOM 15740 CE3 TRP B 481 44.556 15.312 38.327 1.00 34.16 C ATOM 15741 CZ2 TRP B 481 42.670 13.373 39.172 1.00 33.20 C ATOM 15742 CZ3 TRP B 481 43.233 15.645 38.571 1.00 34.14 C ATOM 15743 CH2 TRP B 481 42.306 14.677 38.992 1.00 33.69 C ATOM 15744 HA TRP B 481 49.319 14.821 38.659 1.00 0.00 H ATOM 15745 HB2 TRP B 481 47.323 14.675 37.218 1.00 0.00 H ATOM 15746 HB3 TRP B 481 48.084 13.077 37.403 1.00 0.00 H ATOM 15747 HE1 TRP B 481 44.193 10.931 39.308 1.00 0.00 H ATOM 15748 HD1 TRP B 481 46.695 11.183 38.661 1.00 0.00 H ATOM 15749 HZ2 TRP B 481 41.948 12.625 39.499 1.00 0.00 H ATOM 15750 HH2 TRP B 481 41.274 14.973 39.179 1.00 0.00 H ATOM 15751 HZ3 TRP B 481 42.906 16.676 38.434 1.00 0.00 H ATOM 15752 HE3 TRP B 481 45.270 16.070 38.005 1.00 0.00 H ATOM 15753 H TRP B 481 48.460 12.354 39.778 1.00 0.00 H ATOM 15754 N THR B 482 47.026 15.261 40.892 1.00 28.07 N ATOM 15755 CA THR B 482 46.251 16.275 41.615 1.00 26.67 C ATOM 15756 C THR B 482 47.092 17.455 42.118 1.00 25.26 C ATOM 15757 O THR B 482 46.535 18.506 42.434 1.00 27.11 O ATOM 15758 CB THR B 482 45.453 15.675 42.794 1.00 26.78 C ATOM 15759 OG1 THR B 482 46.325 14.894 43.614 1.00 26.54 O ATOM 15760 CG2 THR B 482 44.334 14.805 42.288 1.00 26.64 C ATOM 15761 HA THR B 482 45.554 16.661 40.871 1.00 0.00 H ATOM 15762 HB THR B 482 45.028 16.492 43.377 1.00 0.00 H ATOM 15763 HG1 THR B 482 46.716 14.162 43.074 1.00 0.00 H ATOM 15764 HG23 THR B 482 43.668 15.399 41.662 1.00 0.00 H ATOM 15765 HG21 THR B 482 44.749 13.985 41.702 1.00 0.00 H ATOM 15766 HG22 THR B 482 43.777 14.403 43.134 1.00 0.00 H ATOM 15767 H THR B 482 47.089 14.296 41.275 1.00 0.00 H ATOM 15768 N VAL B 483 48.414 17.299 42.197 1.00 21.15 N ATOM 15769 CA VAL B 483 49.246 18.443 42.563 1.00 23.77 C ATOM 15770 C VAL B 483 49.059 19.603 41.577 1.00 23.57 C ATOM 15771 O VAL B 483 49.203 20.768 41.949 1.00 23.18 O ATOM 15772 CB VAL B 483 50.748 18.086 42.702 1.00 23.67 C ATOM 15773 CG1 VAL B 483 50.943 17.058 43.818 1.00 23.99 C ATOM 15774 CG2 VAL B 483 51.322 17.584 41.370 1.00 25.49 C ATOM 15775 HA VAL B 483 48.905 18.758 43.549 1.00 0.00 H ATOM 15776 HB VAL B 483 51.297 18.989 42.970 1.00 0.00 H ATOM 15777 HG11 VAL B 483 50.585 17.474 44.760 1.00 0.00 H ATOM 15778 HG12 VAL B 483 50.381 16.155 43.581 1.00 0.00 H ATOM 15779 HG13 VAL B 483 52.002 16.815 43.906 1.00 0.00 H ATOM 15780 HG21 VAL B 483 50.779 16.693 41.055 1.00 0.00 H ATOM 15781 HG22 VAL B 483 51.216 18.362 40.614 1.00 0.00 H ATOM 15782 HG23 VAL B 483 52.377 17.341 41.499 1.00 0.00 H ATOM 15783 H VAL B 483 48.848 16.374 42.000 1.00 0.00 H ATOM 15784 N TRP B 484 48.719 19.285 40.327 1.00 23.46 N ATOM 15785 CA TRP B 484 48.516 20.310 39.301 1.00 24.38 C ATOM 15786 C TRP B 484 47.279 21.167 39.539 1.00 25.44 C ATOM 15787 O TRP B 484 47.193 22.288 39.039 1.00 26.02 O ATOM 15788 CB TRP B 484 48.471 19.676 37.906 1.00 26.91 C ATOM 15789 CG TRP B 484 49.815 19.263 37.481 1.00 27.11 C ATOM 15790 CD1 TRP B 484 50.309 17.989 37.413 1.00 28.20 C ATOM 15791 CD2 TRP B 484 50.879 20.130 37.087 1.00 27.53 C ATOM 15792 NE1 TRP B 484 51.618 18.015 36.983 1.00 27.76 N ATOM 15793 CE2 TRP B 484 51.989 19.318 36.778 1.00 27.81 C ATOM 15794 CE3 TRP B 484 50.998 21.514 36.964 1.00 28.78 C ATOM 15795 CZ2 TRP B 484 53.206 19.848 36.350 1.00 28.88 C ATOM 15796 CZ3 TRP B 484 52.212 22.042 36.535 1.00 29.36 C ATOM 15797 CH2 TRP B 484 53.297 21.207 36.236 1.00 28.87 C ATOM 15798 HA TRP B 484 49.372 20.981 39.366 1.00 0.00 H ATOM 15799 HB2 TRP B 484 47.819 18.803 37.930 1.00 0.00 H ATOM 15800 HB3 TRP B 484 48.078 20.402 37.195 1.00 0.00 H ATOM 15801 HE1 TRP B 484 52.224 17.183 36.838 1.00 0.00 H ATOM 15802 HD1 TRP B 484 49.750 17.087 37.662 1.00 0.00 H ATOM 15803 HZ2 TRP B 484 54.053 19.203 36.115 1.00 0.00 H ATOM 15804 HH2 TRP B 484 54.235 21.652 35.905 1.00 0.00 H ATOM 15805 HZ3 TRP B 484 52.321 23.121 36.430 1.00 0.00 H ATOM 15806 HE3 TRP B 484 50.158 22.168 37.199 1.00 0.00 H ATOM 15807 H TRP B 484 48.595 18.284 40.075 1.00 0.00 H ATOM 15808 N ILE B 485 46.316 20.643 40.291 1.00 24.61 N ATOM 15809 CA ILE B 485 45.148 21.449 40.666 1.00 24.51 C ATOM 15810 C ILE B 485 45.623 22.614 41.541 1.00 24.10 C ATOM 15811 O ILE B 485 45.252 23.772 41.328 1.00 23.16 O ATOM 15812 CB ILE B 485 44.120 20.611 41.438 1.00 23.71 C ATOM 15813 CG1 ILE B 485 43.788 19.333 40.651 1.00 23.54 C ATOM 15814 CG2 ILE B 485 42.873 21.426 41.736 1.00 22.14 C ATOM 15815 CD1 ILE B 485 43.011 18.302 41.459 1.00 24.92 C ATOM 15816 HA ILE B 485 44.666 21.819 39.761 1.00 0.00 H ATOM 15817 HB ILE B 485 44.549 20.317 42.396 1.00 0.00 H ATOM 15818 HG12 ILE B 485 43.192 19.609 39.781 1.00 0.00 H ATOM 15819 HG13 ILE B 485 44.722 18.879 40.321 1.00 0.00 H ATOM 15820 HD11 ILE B 485 43.598 18.006 42.328 1.00 0.00 H ATOM 15821 HD12 ILE B 485 42.067 18.736 41.788 1.00 0.00 H ATOM 15822 HD13 ILE B 485 42.814 17.429 40.837 1.00 0.00 H ATOM 15823 HG21 ILE B 485 43.143 22.294 42.338 1.00 0.00 H ATOM 15824 HG22 ILE B 485 42.425 21.757 40.799 1.00 0.00 H ATOM 15825 HG23 ILE B 485 42.160 20.810 42.284 1.00 0.00 H ATOM 15826 H ILE B 485 46.391 19.658 40.615 1.00 0.00 H ATOM 15827 N THR B 486 46.465 22.296 42.517 1.00 22.94 N ATOM 15828 CA THR B 486 46.971 23.305 43.437 1.00 24.29 C ATOM 15829 C THR B 486 47.937 24.253 42.722 1.00 23.11 C ATOM 15830 O THR B 486 47.815 25.473 42.837 1.00 23.65 O ATOM 15831 CB THR B 486 47.623 22.655 44.669 1.00 23.83 C ATOM 15832 OG1 THR B 486 46.642 21.847 45.333 1.00 25.21 O ATOM 15833 CG2 THR B 486 48.123 23.724 45.639 1.00 21.88 C ATOM 15834 HA THR B 486 46.127 23.897 43.792 1.00 0.00 H ATOM 15835 HB THR B 486 48.470 22.049 44.347 1.00 0.00 H ATOM 15836 HG1 THR B 486 46.319 21.146 44.713 1.00 0.00 H ATOM 15837 HG23 THR B 486 48.870 24.343 45.142 1.00 0.00 H ATOM 15838 HG21 THR B 486 47.286 24.346 45.955 1.00 0.00 H ATOM 15839 HG22 THR B 486 48.569 23.243 46.509 1.00 0.00 H ATOM 15840 H THR B 486 46.769 21.307 42.627 1.00 0.00 H ATOM 15841 N ARG B 487 48.886 23.689 41.983 1.00 22.53 N ATOM 15842 CA ARG B 487 49.795 24.501 41.178 1.00 21.71 C ATOM 15843 C ARG B 487 49.010 25.446 40.267 1.00 21.58 C ATOM 15844 O ARG B 487 49.267 26.640 40.242 1.00 22.05 O ATOM 15845 CB ARG B 487 50.734 23.616 40.370 1.00 21.94 C ATOM 15846 CG ARG B 487 51.699 22.830 41.245 1.00 23.37 C ATOM 15847 CD ARG B 487 52.471 21.820 40.444 1.00 24.47 C ATOM 15848 NE ARG B 487 53.322 20.992 41.297 1.00 26.24 N ATOM 15849 CZ ARG B 487 54.071 19.991 40.847 1.00 29.58 C ATOM 15850 NH1 ARG B 487 54.078 19.692 39.551 1.00 29.45 N ATOM 15851 NH2 ARG B 487 54.818 19.288 41.690 1.00 30.72 N ATOM 15852 HA ARG B 487 50.401 25.108 41.850 1.00 0.00 H ATOM 15853 HB2 ARG B 487 50.137 22.912 39.790 1.00 0.00 H ATOM 15854 HB3 ARG B 487 51.311 24.246 39.693 1.00 0.00 H ATOM 15855 HG2 ARG B 487 52.399 23.523 41.711 1.00 0.00 H ATOM 15856 HG3 ARG B 487 51.133 22.311 42.019 1.00 0.00 H ATOM 15857 HD2 ARG B 487 53.097 22.345 39.722 1.00 0.00 H ATOM 15858 HD3 ARG B 487 51.768 21.177 39.914 1.00 0.00 H ATOM 15859 HE ARG B 487 53.342 21.199 42.316 1.00 0.00 H ATOM 15860 HH12 ARG B 487 54.665 18.908 39.201 1.00 0.00 H ATOM 15861 HH11 ARG B 487 53.496 20.242 38.887 1.00 0.00 H ATOM 15862 HH22 ARG B 487 55.404 18.505 41.337 1.00 0.00 H ATOM 15863 HH21 ARG B 487 54.817 19.521 42.704 1.00 0.00 H ATOM 15864 H ARG B 487 48.983 22.654 41.978 1.00 0.00 H ATOM 15865 N PHE B 488 48.045 24.911 39.528 1.00 22.25 N ATOM 15866 CA PHE B 488 47.184 25.744 38.693 1.00 21.70 C ATOM 15867 C PHE B 488 46.568 26.881 39.505 1.00 22.62 C ATOM 15868 O PHE B 488 46.623 28.037 39.099 1.00 23.23 O ATOM 15869 CB PHE B 488 46.069 24.914 38.063 1.00 20.51 C ATOM 15870 CG PHE B 488 45.059 25.724 37.289 1.00 21.61 C ATOM 15871 CD1 PHE B 488 45.389 26.275 36.062 1.00 21.33 C ATOM 15872 CD2 PHE B 488 43.778 25.922 37.785 1.00 21.84 C ATOM 15873 CE1 PHE B 488 44.471 27.015 35.339 1.00 21.49 C ATOM 15874 CE2 PHE B 488 42.849 26.664 37.072 1.00 22.13 C ATOM 15875 CZ PHE B 488 43.200 27.212 35.836 1.00 22.86 C ATOM 15876 HA PHE B 488 47.806 26.166 37.904 1.00 0.00 H ATOM 15877 HB2 PHE B 488 46.522 24.192 37.384 1.00 0.00 H ATOM 15878 HB3 PHE B 488 45.545 24.384 38.859 1.00 0.00 H ATOM 15879 HD2 PHE B 488 43.499 25.489 38.746 1.00 0.00 H ATOM 15880 HE2 PHE B 488 41.848 26.819 37.475 1.00 0.00 H ATOM 15881 HZ PHE B 488 42.473 27.792 35.268 1.00 0.00 H ATOM 15882 HE1 PHE B 488 44.752 27.442 34.377 1.00 0.00 H ATOM 15883 HD1 PHE B 488 46.390 26.123 35.659 1.00 0.00 H ATOM 15884 H PHE B 488 47.900 23.881 39.544 1.00 0.00 H ATOM 15885 N TYR B 489 45.972 26.559 40.654 1.00 22.65 N ATOM 15886 CA TYR B 489 45.278 27.594 41.407 1.00 23.47 C ATOM 15887 C TYR B 489 46.205 28.690 41.949 1.00 22.43 C ATOM 15888 O TYR B 489 45.870 29.863 41.849 1.00 24.36 O ATOM 15889 CB TYR B 489 44.404 27.023 42.532 1.00 24.88 C ATOM 15890 CG TYR B 489 43.630 28.102 43.254 1.00 24.02 C ATOM 15891 CD1 TYR B 489 42.557 28.735 42.638 1.00 25.27 C ATOM 15892 CD2 TYR B 489 43.974 28.498 44.541 1.00 24.22 C ATOM 15893 CE1 TYR B 489 41.844 29.735 43.281 1.00 25.77 C ATOM 15894 CE2 TYR B 489 43.261 29.501 45.197 1.00 25.65 C ATOM 15895 CZ TYR B 489 42.200 30.111 44.562 1.00 26.18 C ATOM 15896 OH TYR B 489 41.483 31.103 45.196 1.00 26.83 O ATOM 15897 HA TYR B 489 44.622 28.067 40.677 1.00 0.00 H ATOM 15898 HB3 TYR B 489 45.045 26.510 43.249 1.00 0.00 H ATOM 15899 HB2 TYR B 489 43.699 26.311 42.103 1.00 0.00 H ATOM 15900 HD2 TYR B 489 44.813 28.018 45.045 1.00 0.00 H ATOM 15901 HE2 TYR B 489 43.541 29.801 46.207 1.00 0.00 H ATOM 15902 HE1 TYR B 489 41.008 30.222 42.779 1.00 0.00 H ATOM 15903 HD1 TYR B 489 42.270 28.439 41.629 1.00 0.00 H ATOM 15904 HH TYR B 489 41.084 30.741 46.027 1.00 0.00 H ATOM 15905 H TYR B 489 46.003 25.581 41.007 1.00 0.00 H ATOM 15906 N ILE B 490 47.353 28.322 42.508 1.00 19.83 N ATOM 15907 CA ILE B 490 48.227 29.342 43.093 1.00 21.56 C ATOM 15908 C ILE B 490 48.983 30.146 42.029 1.00 21.82 C ATOM 15909 O ILE B 490 49.370 31.282 42.269 1.00 23.12 O ATOM 15910 CB ILE B 490 49.170 28.783 44.184 1.00 19.84 C ATOM 15911 CG1 ILE B 490 50.224 27.843 43.594 1.00 21.46 C ATOM 15912 CG2 ILE B 490 48.364 28.076 45.283 1.00 20.30 C ATOM 15913 CD1 ILE B 490 51.038 27.116 44.660 1.00 19.74 C ATOM 15914 HA ILE B 490 47.563 30.041 43.602 1.00 0.00 H ATOM 15915 HB ILE B 490 49.698 29.627 44.628 1.00 0.00 H ATOM 15916 HG12 ILE B 490 49.720 27.101 42.975 1.00 0.00 H ATOM 15917 HG13 ILE B 490 50.905 28.428 42.976 1.00 0.00 H ATOM 15918 HD11 ILE B 490 51.556 27.847 45.281 1.00 0.00 H ATOM 15919 HD12 ILE B 490 50.370 26.518 45.280 1.00 0.00 H ATOM 15920 HD13 ILE B 490 51.767 26.465 44.177 1.00 0.00 H ATOM 15921 HG21 ILE B 490 47.675 28.786 45.740 1.00 0.00 H ATOM 15922 HG22 ILE B 490 47.801 27.252 44.845 1.00 0.00 H ATOM 15923 HG23 ILE B 490 49.046 27.690 46.041 1.00 0.00 H ATOM 15924 H ILE B 490 47.628 27.319 42.530 1.00 0.00 H ATOM 15925 N ILE B 491 49.188 29.560 40.855 1.00 21.81 N ATOM 15926 CA ILE B 491 49.709 30.334 39.733 1.00 20.84 C ATOM 15927 C ILE B 491 48.658 31.367 39.356 1.00 20.22 C ATOM 15928 O ILE B 491 48.978 32.522 39.096 1.00 23.47 O ATOM 15929 CB ILE B 491 50.112 29.435 38.535 1.00 21.12 C ATOM 15930 CG1 ILE B 491 51.310 28.574 38.934 1.00 20.86 C ATOM 15931 CG2 ILE B 491 50.472 30.283 37.306 1.00 23.03 C ATOM 15932 CD1 ILE B 491 51.696 27.497 37.904 1.00 22.76 C ATOM 15933 HA ILE B 491 50.630 30.838 40.027 1.00 0.00 H ATOM 15934 HB ILE B 491 49.265 28.800 38.274 1.00 0.00 H ATOM 15935 HG12 ILE B 491 52.168 29.231 39.078 1.00 0.00 H ATOM 15936 HG13 ILE B 491 51.073 28.076 39.874 1.00 0.00 H ATOM 15937 HD11 ILE B 491 50.855 26.820 37.755 1.00 0.00 H ATOM 15938 HD12 ILE B 491 51.951 27.975 36.958 1.00 0.00 H ATOM 15939 HD13 ILE B 491 52.555 26.936 38.272 1.00 0.00 H ATOM 15940 HG21 ILE B 491 49.611 30.886 37.017 1.00 0.00 H ATOM 15941 HG22 ILE B 491 51.309 30.937 37.550 1.00 0.00 H ATOM 15942 HG23 ILE B 491 50.750 29.626 36.482 1.00 0.00 H ATOM 15943 H ILE B 491 48.977 28.549 40.735 1.00 0.00 H ATOM 15944 N GLY B 492 47.397 30.951 39.344 1.00 21.41 N ATOM 15945 CA GLY B 492 46.288 31.875 39.130 1.00 21.27 C ATOM 15946 C GLY B 492 46.237 32.975 40.181 1.00 22.40 C ATOM 15947 O GLY B 492 45.877 34.120 39.873 1.00 23.01 O ATOM 15948 HA3 GLY B 492 45.354 31.315 39.164 1.00 0.00 H ATOM 15949 HA2 GLY B 492 46.399 32.334 38.148 1.00 0.00 H ATOM 15950 H GLY B 492 47.195 29.941 39.491 1.00 0.00 H ATOM 15951 N LEU B 493 46.581 32.646 41.428 1.00 20.52 N ATOM 15952 CA LEU B 493 46.656 33.681 42.465 1.00 21.17 C ATOM 15953 C LEU B 493 47.788 34.685 42.167 1.00 22.62 C ATOM 15954 O LEU B 493 47.638 35.890 42.380 1.00 20.61 O ATOM 15955 CB LEU B 493 46.839 33.070 43.861 1.00 22.74 C ATOM 15956 CG LEU B 493 45.617 32.432 44.526 1.00 22.30 C ATOM 15957 CD1 LEU B 493 46.008 31.868 45.885 1.00 23.07 C ATOM 15958 CD2 LEU B 493 44.474 33.448 44.675 1.00 23.39 C ATOM 15959 HA LEU B 493 45.707 34.217 42.454 1.00 0.00 H ATOM 15960 HB2 LEU B 493 47.606 32.299 43.781 1.00 0.00 H ATOM 15961 HB3 LEU B 493 47.191 33.864 44.520 1.00 0.00 H ATOM 15962 HG LEU B 493 45.260 31.622 43.890 1.00 0.00 H ATOM 15963 HD21 LEU B 493 44.810 34.283 45.290 1.00 0.00 H ATOM 15964 HD22 LEU B 493 44.184 33.814 43.690 1.00 0.00 H ATOM 15965 HD23 LEU B 493 43.620 32.965 45.150 1.00 0.00 H ATOM 15966 HD11 LEU B 493 46.784 31.114 45.754 1.00 0.00 H ATOM 15967 HD12 LEU B 493 46.385 32.673 46.516 1.00 0.00 H ATOM 15968 HD13 LEU B 493 45.134 31.415 46.354 1.00 0.00 H ATOM 15969 H LEU B 493 46.796 31.656 41.664 1.00 0.00 H ATOM 15970 N PHE B 494 48.922 34.192 41.684 1.00 23.59 N ATOM 15971 CA PHE B 494 50.031 35.088 41.340 1.00 24.54 C ATOM 15972 C PHE B 494 49.620 36.042 40.219 1.00 24.76 C ATOM 15973 O PHE B 494 49.919 37.235 40.267 1.00 24.95 O ATOM 15974 CB PHE B 494 51.264 34.301 40.920 1.00 24.58 C ATOM 15975 CG PHE B 494 52.489 35.157 40.734 1.00 25.47 C ATOM 15976 CD1 PHE B 494 53.429 35.269 41.746 1.00 24.43 C ATOM 15977 CD2 PHE B 494 52.696 35.855 39.554 1.00 25.95 C ATOM 15978 CE1 PHE B 494 54.554 36.061 41.581 1.00 26.17 C ATOM 15979 CE2 PHE B 494 53.818 36.648 39.382 1.00 26.10 C ATOM 15980 CZ PHE B 494 54.748 36.750 40.403 1.00 24.39 C ATOM 15981 HA PHE B 494 50.278 35.667 42.230 1.00 0.00 H ATOM 15982 HB2 PHE B 494 51.476 33.557 41.687 1.00 0.00 H ATOM 15983 HB3 PHE B 494 51.048 33.798 39.977 1.00 0.00 H ATOM 15984 HD2 PHE B 494 51.964 35.778 38.750 1.00 0.00 H ATOM 15985 HE2 PHE B 494 53.968 37.189 38.448 1.00 0.00 H ATOM 15986 HZ PHE B 494 55.632 37.374 40.275 1.00 0.00 H ATOM 15987 HE1 PHE B 494 55.287 36.139 42.384 1.00 0.00 H ATOM 15988 HD1 PHE B 494 53.282 34.729 42.681 1.00 0.00 H ATOM 15989 H PHE B 494 49.024 33.166 41.549 1.00 0.00 H ATOM 15990 N LEU B 495 48.928 35.508 39.218 1.00 25.67 N ATOM 15991 CA LEU B 495 48.449 36.313 38.100 1.00 27.49 C ATOM 15992 C LEU B 495 47.444 37.363 38.586 1.00 26.68 C ATOM 15993 O LEU B 495 47.452 38.507 38.130 1.00 26.60 O ATOM 15994 CB LEU B 495 47.812 35.426 37.028 1.00 28.55 C ATOM 15995 CG LEU B 495 47.188 36.214 35.864 1.00 32.31 C ATOM 15996 CD1 LEU B 495 48.269 36.947 35.047 1.00 32.59 C ATOM 15997 CD2 LEU B 495 46.322 35.329 34.959 1.00 33.47 C ATOM 15998 HA LEU B 495 49.304 36.826 37.660 1.00 0.00 H ATOM 15999 HB2 LEU B 495 48.581 34.767 36.625 1.00 0.00 H ATOM 16000 HB3 LEU B 495 47.031 34.827 37.496 1.00 0.00 H ATOM 16001 HG LEU B 495 46.528 36.960 36.306 1.00 0.00 H ATOM 16002 HD21 LEU B 495 46.935 34.533 34.537 1.00 0.00 H ATOM 16003 HD22 LEU B 495 45.512 34.894 35.545 1.00 0.00 H ATOM 16004 HD23 LEU B 495 45.905 35.933 34.153 1.00 0.00 H ATOM 16005 HD11 LEU B 495 48.802 37.644 35.694 1.00 0.00 H ATOM 16006 HD12 LEU B 495 48.970 36.219 34.639 1.00 0.00 H ATOM 16007 HD13 LEU B 495 47.797 37.495 34.231 1.00 0.00 H ATOM 16008 H LEU B 495 48.722 34.489 39.232 1.00 0.00 H ATOM 16009 N PHE B 496 46.586 36.955 39.511 1.00 25.59 N ATOM 16010 CA PHE B 496 45.593 37.841 40.114 1.00 26.79 C ATOM 16011 C PHE B 496 46.266 39.012 40.822 1.00 25.56 C ATOM 16012 O PHE B 496 45.852 40.160 40.669 1.00 22.74 O ATOM 16013 CB PHE B 496 44.719 37.044 41.093 1.00 26.92 C ATOM 16014 CG PHE B 496 43.908 37.891 42.038 1.00 27.89 C ATOM 16015 CD1 PHE B 496 42.911 38.729 41.566 1.00 28.10 C ATOM 16016 CD2 PHE B 496 44.127 37.821 43.410 1.00 26.97 C ATOM 16017 CE1 PHE B 496 42.160 39.505 42.441 1.00 28.47 C ATOM 16018 CE2 PHE B 496 43.379 38.589 44.288 1.00 27.34 C ATOM 16019 CZ PHE B 496 42.397 39.433 43.804 1.00 27.36 C ATOM 16020 HA PHE B 496 44.962 38.250 39.325 1.00 0.00 H ATOM 16021 HB2 PHE B 496 44.032 36.428 40.513 1.00 0.00 H ATOM 16022 HB3 PHE B 496 45.370 36.401 41.685 1.00 0.00 H ATOM 16023 HD2 PHE B 496 44.896 37.154 43.799 1.00 0.00 H ATOM 16024 HE2 PHE B 496 43.565 38.528 45.360 1.00 0.00 H ATOM 16025 HZ PHE B 496 41.810 40.040 44.493 1.00 0.00 H ATOM 16026 HE1 PHE B 496 41.386 40.169 42.056 1.00 0.00 H ATOM 16027 HD1 PHE B 496 42.713 38.780 40.495 1.00 0.00 H ATOM 16028 H PHE B 496 46.621 35.963 39.820 1.00 0.00 H ATOM 16029 N LEU B 497 47.307 38.710 41.589 1.00 25.06 N ATOM 16030 CA LEU B 497 48.020 39.730 42.352 1.00 24.53 C ATOM 16031 C LEU B 497 48.834 40.632 41.428 1.00 24.90 C ATOM 16032 O LEU B 497 48.956 41.836 41.669 1.00 23.94 O ATOM 16033 CB LEU B 497 48.910 39.078 43.419 1.00 24.13 C ATOM 16034 CG LEU B 497 48.126 38.407 44.556 1.00 23.75 C ATOM 16035 CD1 LEU B 497 48.974 37.416 45.316 1.00 23.87 C ATOM 16036 CD2 LEU B 497 47.525 39.443 45.514 1.00 23.68 C ATOM 16037 HA LEU B 497 47.286 40.356 42.860 1.00 0.00 H ATOM 16038 HB2 LEU B 497 49.529 38.322 42.935 1.00 0.00 H ATOM 16039 HB3 LEU B 497 49.550 39.848 43.850 1.00 0.00 H ATOM 16040 HG LEU B 497 47.308 37.859 44.090 1.00 0.00 H ATOM 16041 HD21 LEU B 497 48.326 40.039 45.952 1.00 0.00 H ATOM 16042 HD22 LEU B 497 46.846 40.094 44.964 1.00 0.00 H ATOM 16043 HD23 LEU B 497 46.978 38.930 46.305 1.00 0.00 H ATOM 16044 HD11 LEU B 497 49.321 36.639 44.635 1.00 0.00 H ATOM 16045 HD12 LEU B 497 49.832 37.931 45.749 1.00 0.00 H ATOM 16046 HD13 LEU B 497 48.380 36.965 46.111 1.00 0.00 H ATOM 16047 H LEU B 497 47.623 37.721 41.648 1.00 0.00 H ATOM 16048 N THR B 498 49.391 40.054 40.367 1.00 25.61 N ATOM 16049 CA THR B 498 50.102 40.853 39.370 1.00 25.35 C ATOM 16050 C THR B 498 49.139 41.873 38.761 1.00 25.72 C ATOM 16051 O THR B 498 49.484 43.050 38.599 1.00 28.28 O ATOM 16052 CB THR B 498 50.757 39.974 38.285 1.00 26.42 C ATOM 16053 OG1 THR B 498 51.737 39.124 38.901 1.00 24.38 O ATOM 16054 CG2 THR B 498 51.456 40.841 37.221 1.00 25.93 C ATOM 16055 HA THR B 498 50.916 41.382 39.865 1.00 0.00 H ATOM 16056 HB THR B 498 49.979 39.383 37.802 1.00 0.00 H ATOM 16057 HG1 THR B 498 51.296 38.549 39.576 1.00 0.00 H ATOM 16058 HG23 THR B 498 50.722 41.492 36.745 1.00 0.00 H ATOM 16059 HG21 THR B 498 52.227 41.447 37.697 1.00 0.00 H ATOM 16060 HG22 THR B 498 51.912 40.195 36.470 1.00 0.00 H ATOM 16061 H THR B 498 49.320 39.024 40.246 1.00 0.00 H ATOM 16062 N PHE B 499 47.928 41.426 38.452 1.00 23.53 N ATOM 16063 CA PHE B 499 46.910 42.302 37.892 1.00 25.75 C ATOM 16064 C PHE B 499 46.553 43.459 38.831 1.00 26.50 C ATOM 16065 O PHE B 499 46.333 44.572 38.367 1.00 25.31 O ATOM 16066 CB PHE B 499 45.653 41.504 37.513 1.00 24.94 C ATOM 16067 CG PHE B 499 44.583 42.328 36.846 1.00 25.76 C ATOM 16068 CD1 PHE B 499 44.861 43.057 35.700 1.00 25.31 C ATOM 16069 CD2 PHE B 499 43.291 42.366 37.359 1.00 26.03 C ATOM 16070 CE1 PHE B 499 43.873 43.815 35.083 1.00 25.18 C ATOM 16071 CE2 PHE B 499 42.306 43.114 36.746 1.00 26.65 C ATOM 16072 CZ PHE B 499 42.599 43.846 35.602 1.00 25.46 C ATOM 16073 HA PHE B 499 47.333 42.742 36.989 1.00 0.00 H ATOM 16074 HB2 PHE B 499 45.946 40.705 36.831 1.00 0.00 H ATOM 16075 HB3 PHE B 499 45.235 41.070 38.421 1.00 0.00 H ATOM 16076 HD2 PHE B 499 43.053 41.797 38.258 1.00 0.00 H ATOM 16077 HE2 PHE B 499 41.298 43.130 37.160 1.00 0.00 H ATOM 16078 HZ PHE B 499 41.824 44.441 35.119 1.00 0.00 H ATOM 16079 HE1 PHE B 499 44.108 44.387 34.185 1.00 0.00 H ATOM 16080 HD1 PHE B 499 45.866 43.035 35.278 1.00 0.00 H ATOM 16081 H PHE B 499 47.701 40.424 38.614 1.00 0.00 H ATOM 16082 N LEU B 500 46.498 43.194 40.139 1.00 25.66 N ATOM 16083 CA LEU B 500 46.197 44.241 41.120 1.00 26.16 C ATOM 16084 C LEU B 500 47.334 45.259 41.202 1.00 26.63 C ATOM 16085 O LEU B 500 47.089 46.453 41.340 1.00 26.72 O ATOM 16086 CB LEU B 500 45.940 43.653 42.516 1.00 26.70 C ATOM 16087 CG LEU B 500 44.718 42.752 42.724 1.00 27.52 C ATOM 16088 CD1 LEU B 500 44.435 42.587 44.212 1.00 29.79 C ATOM 16089 CD2 LEU B 500 43.495 43.308 42.033 1.00 28.19 C ATOM 16090 HA LEU B 500 45.290 44.741 40.780 1.00 0.00 H ATOM 16091 HB2 LEU B 500 46.819 43.068 42.784 1.00 0.00 H ATOM 16092 HB3 LEU B 500 45.840 44.492 43.204 1.00 0.00 H ATOM 16093 HG LEU B 500 44.945 41.781 42.285 1.00 0.00 H ATOM 16094 HD21 LEU B 500 43.269 44.295 42.436 1.00 0.00 H ATOM 16095 HD22 LEU B 500 43.688 43.387 40.963 1.00 0.00 H ATOM 16096 HD23 LEU B 500 42.649 42.642 42.203 1.00 0.00 H ATOM 16097 HD11 LEU B 500 45.300 42.135 44.697 1.00 0.00 H ATOM 16098 HD12 LEU B 500 44.239 43.564 44.654 1.00 0.00 H ATOM 16099 HD13 LEU B 500 43.565 41.945 44.346 1.00 0.00 H ATOM 16100 H LEU B 500 46.673 42.223 40.469 1.00 0.00 H ATOM 16101 N VAL B 501 48.574 44.779 41.130 1.00 24.97 N ATOM 16102 CA VAL B 501 49.736 45.656 41.109 1.00 25.95 C ATOM 16103 C VAL B 501 49.653 46.552 39.870 1.00 28.63 C ATOM 16104 O VAL B 501 49.922 47.758 39.934 1.00 29.12 O ATOM 16105 CB VAL B 501 51.059 44.839 41.148 1.00 26.74 C ATOM 16106 CG1 VAL B 501 52.269 45.721 40.856 1.00 26.88 C ATOM 16107 CG2 VAL B 501 51.212 44.156 42.496 1.00 24.46 C ATOM 16108 HA VAL B 501 49.738 46.284 42.000 1.00 0.00 H ATOM 16109 HB VAL B 501 51.009 44.079 40.368 1.00 0.00 H ATOM 16110 HG11 VAL B 501 52.164 46.163 39.865 1.00 0.00 H ATOM 16111 HG12 VAL B 501 52.329 46.512 41.603 1.00 0.00 H ATOM 16112 HG13 VAL B 501 53.175 45.116 40.892 1.00 0.00 H ATOM 16113 HG21 VAL B 501 51.233 44.909 43.283 1.00 0.00 H ATOM 16114 HG22 VAL B 501 50.370 43.483 42.658 1.00 0.00 H ATOM 16115 HG23 VAL B 501 52.142 43.587 42.510 1.00 0.00 H ATOM 16116 H VAL B 501 48.716 43.750 41.088 1.00 0.00 H ATOM 16117 N PHE B 502 49.255 45.955 38.749 1.00 29.21 N ATOM 16118 CA PHE B 502 49.008 46.688 37.519 1.00 30.28 C ATOM 16119 C PHE B 502 47.898 47.731 37.690 1.00 31.03 C ATOM 16120 O PHE B 502 48.020 48.849 37.208 1.00 29.30 O ATOM 16121 CB PHE B 502 48.654 45.722 36.377 1.00 30.60 C ATOM 16122 CG PHE B 502 48.120 46.407 35.151 1.00 31.03 C ATOM 16123 CD1 PHE B 502 48.977 46.797 34.127 1.00 31.68 C ATOM 16124 CD2 PHE B 502 46.760 46.667 35.020 1.00 31.05 C ATOM 16125 CE1 PHE B 502 48.487 47.432 32.999 1.00 31.90 C ATOM 16126 CE2 PHE B 502 46.264 47.302 33.898 1.00 31.73 C ATOM 16127 CZ PHE B 502 47.123 47.687 32.885 1.00 31.61 C ATOM 16128 HA PHE B 502 49.927 47.218 37.267 1.00 0.00 H ATOM 16129 HB2 PHE B 502 49.553 45.172 36.100 1.00 0.00 H ATOM 16130 HB3 PHE B 502 47.899 45.024 36.738 1.00 0.00 H ATOM 16131 HD2 PHE B 502 46.076 46.366 35.814 1.00 0.00 H ATOM 16132 HE2 PHE B 502 45.196 47.500 33.811 1.00 0.00 H ATOM 16133 HZ PHE B 502 46.733 48.189 31.999 1.00 0.00 H ATOM 16134 HE1 PHE B 502 49.167 47.732 32.202 1.00 0.00 H ATOM 16135 HD1 PHE B 502 50.046 46.600 34.214 1.00 0.00 H ATOM 16136 H PHE B 502 49.115 44.924 38.754 1.00 0.00 H ATOM 16137 N LEU B 503 46.812 47.365 38.367 1.00 31.65 N ATOM 16138 CA LEU B 503 45.718 48.307 38.592 1.00 31.34 C ATOM 16139 C LEU B 503 46.144 49.453 39.507 1.00 32.72 C ATOM 16140 O LEU B 503 45.663 50.585 39.365 1.00 34.14 O ATOM 16141 CB LEU B 503 44.489 47.604 39.178 1.00 31.01 C ATOM 16142 CG LEU B 503 43.650 46.723 38.245 1.00 30.76 C ATOM 16143 CD1 LEU B 503 42.443 46.143 38.999 1.00 29.37 C ATOM 16144 CD2 LEU B 503 43.193 47.487 37.010 1.00 28.44 C ATOM 16145 HA LEU B 503 45.453 48.722 37.620 1.00 0.00 H ATOM 16146 HB2 LEU B 503 44.836 46.972 39.996 1.00 0.00 H ATOM 16147 HB3 LEU B 503 43.830 48.378 39.573 1.00 0.00 H ATOM 16148 HG LEU B 503 44.282 45.902 37.907 1.00 0.00 H ATOM 16149 HD21 LEU B 503 42.586 48.340 37.316 1.00 0.00 H ATOM 16150 HD22 LEU B 503 44.065 47.839 36.459 1.00 0.00 H ATOM 16151 HD23 LEU B 503 42.602 46.828 36.375 1.00 0.00 H ATOM 16152 HD11 LEU B 503 42.795 45.540 39.836 1.00 0.00 H ATOM 16153 HD12 LEU B 503 41.823 46.958 39.372 1.00 0.00 H ATOM 16154 HD13 LEU B 503 41.858 45.520 38.322 1.00 0.00 H ATOM 16155 H LEU B 503 46.741 46.397 38.740 1.00 0.00 H ATOM 16156 N ALA B 504 47.042 49.153 40.443 1.00 32.38 N ATOM 16157 CA ALA B 504 47.550 50.147 41.386 1.00 33.18 C ATOM 16158 C ALA B 504 48.480 51.164 40.717 1.00 34.34 C ATOM 16159 O ALA B 504 48.432 52.349 41.041 1.00 34.02 O ATOM 16160 CB ALA B 504 48.249 49.473 42.550 1.00 29.94 C ATOM 16161 HA ALA B 504 46.688 50.698 41.762 1.00 0.00 H ATOM 16162 HB1 ALA B 504 47.544 48.823 43.068 1.00 0.00 H ATOM 16163 HB2 ALA B 504 49.085 48.881 42.177 1.00 0.00 H ATOM 16164 HB3 ALA B 504 48.619 50.232 43.239 1.00 0.00 H ATOM 16165 H ALA B 504 47.394 48.177 40.505 1.00 0.00 H ATOM 16166 N GLU B 505 49.322 50.704 39.794 1.00 37.69 N ATOM 16167 CA GLU B 505 50.197 51.618 39.056 1.00 41.33 C ATOM 16168 C GLU B 505 49.361 52.518 38.139 1.00 42.85 C ATOM 16169 O GLU B 505 49.684 53.692 37.969 1.00 44.29 O ATOM 16170 CB GLU B 505 51.334 50.889 38.303 1.00 42.01 C ATOM 16171 CG GLU B 505 50.920 49.712 37.428 1.00 45.41 C ATOM 16172 CD GLU B 505 52.089 49.050 36.667 1.00 46.76 C ATOM 16173 OE1 GLU B 505 53.252 49.140 37.120 1.00 47.66 O ATOM 16174 OE2 GLU B 505 51.834 48.427 35.611 1.00 46.47 O ATOM 16175 HA GLU B 505 50.706 52.253 39.782 1.00 0.00 H ATOM 16176 HB2 GLU B 505 51.831 51.619 37.664 1.00 0.00 H ATOM 16177 HB3 GLU B 505 52.040 50.518 39.046 1.00 0.00 H ATOM 16178 HG2 GLU B 505 50.455 48.959 38.064 1.00 0.00 H ATOM 16179 HG3 GLU B 505 50.193 50.067 36.697 1.00 0.00 H ATOM 16180 H GLU B 505 49.359 49.684 39.595 1.00 0.00 H ATOM 16181 N ARG B 506 48.283 51.977 37.577 1.00 44.19 N ATOM 16182 CA ARG B 506 47.361 52.774 36.764 1.00 46.99 C ATOM 16183 C ARG B 506 46.645 53.836 37.605 1.00 48.39 C ATOM 16184 O ARG B 506 46.441 54.964 37.148 1.00 48.58 O ATOM 16185 CB ARG B 506 46.316 51.886 36.084 1.00 48.01 C ATOM 16186 CG ARG B 506 46.855 50.843 35.111 1.00 50.34 C ATOM 16187 CD ARG B 506 47.193 51.432 33.752 1.00 52.01 C ATOM 16188 NE ARG B 506 48.596 51.811 33.578 1.00 54.37 N ATOM 16189 CZ ARG B 506 49.645 51.119 34.020 1.00 55.73 C ATOM 16190 NH1 ARG B 506 49.481 49.980 34.676 1.00 56.49 N ATOM 16191 NH2 ARG B 506 50.873 51.567 33.797 1.00 56.67 N ATOM 16192 HA ARG B 506 47.962 53.272 36.003 1.00 0.00 H ATOM 16193 HB2 ARG B 506 45.766 51.361 36.865 1.00 0.00 H ATOM 16194 HB3 ARG B 506 45.634 52.535 35.534 1.00 0.00 H ATOM 16195 HG2 ARG B 506 47.757 50.403 35.535 1.00 0.00 H ATOM 16196 HG3 ARG B 506 46.101 50.067 34.978 1.00 0.00 H ATOM 16197 HD2 ARG B 506 46.581 52.322 33.606 1.00 0.00 H ATOM 16198 HD3 ARG B 506 46.944 50.693 32.991 1.00 0.00 H ATOM 16199 HE ARG B 506 48.790 52.695 33.066 1.00 0.00 H ATOM 16200 HH12 ARG B 506 50.310 49.451 35.015 1.00 0.00 H ATOM 16201 HH11 ARG B 506 48.523 49.615 34.852 1.00 0.00 H ATOM 16202 HH22 ARG B 506 51.693 51.028 34.141 1.00 0.00 H ATOM 16203 HH21 ARG B 506 51.016 52.457 33.278 1.00 0.00 H ATOM 16204 H ARG B 506 48.090 50.965 37.718 1.00 0.00 H ATOM 16205 N ARG B 507 46.258 53.472 38.828 1.00 49.51 N ATOM 16206 CA ARG B 507 45.553 54.397 39.712 1.00 51.59 C ATOM 16207 C ARG B 507 46.472 55.542 40.093 1.00 52.91 C ATOM 16208 O ARG B 507 46.078 56.705 40.069 1.00 52.42 O ATOM 16209 CB ARG B 507 45.071 53.694 40.983 1.00 51.80 C ATOM 16210 CG ARG B 507 44.105 54.540 41.797 1.00 53.21 C ATOM 16211 CD ARG B 507 44.016 54.114 43.258 1.00 54.27 C ATOM 16212 NE ARG B 507 42.971 54.866 43.959 1.00 55.83 N ATOM 16213 CZ ARG B 507 43.120 56.102 44.438 1.00 56.67 C ATOM 16214 NH1 ARG B 507 44.279 56.741 44.301 1.00 56.48 N ATOM 16215 NH2 ARG B 507 42.108 56.702 45.057 1.00 56.22 N ATOM 16216 HA ARG B 507 44.683 54.777 39.176 1.00 0.00 H ATOM 16217 HB2 ARG B 507 44.570 52.768 40.700 1.00 0.00 H ATOM 16218 HB3 ARG B 507 45.937 53.462 41.602 1.00 0.00 H ATOM 16219 HG2 ARG B 507 44.436 55.578 41.758 1.00 0.00 H ATOM 16220 HG3 ARG B 507 43.113 54.459 41.351 1.00 0.00 H ATOM 16221 HD2 ARG B 507 44.975 54.298 43.743 1.00 0.00 H ATOM 16222 HD3 ARG B 507 43.784 53.050 43.306 1.00 0.00 H ATOM 16223 HE ARG B 507 42.049 54.404 44.092 1.00 0.00 H ATOM 16224 HH12 ARG B 507 44.389 57.705 44.677 1.00 0.00 H ATOM 16225 HH11 ARG B 507 45.075 56.277 43.818 1.00 0.00 H ATOM 16226 HH22 ARG B 507 42.225 57.666 45.430 1.00 0.00 H ATOM 16227 HH21 ARG B 507 41.200 56.208 45.168 1.00 0.00 H ATOM 16228 H ARG B 507 46.463 52.508 39.160 1.00 0.00 H ATOM 16229 N ARG B 508 47.703 55.185 40.447 1.00 55.11 N ATOM 16230 CA ARG B 508 48.739 56.133 40.818 1.00 57.78 C ATOM 16231 C ARG B 508 49.013 57.126 39.688 1.00 59.31 C ATOM 16232 O ARG B 508 49.227 58.315 39.929 1.00 58.73 O ATOM 16233 CB ARG B 508 50.022 55.372 41.167 1.00 58.81 C ATOM 16234 CG ARG B 508 51.193 56.247 41.541 1.00 60.40 C ATOM 16235 CD ARG B 508 52.493 55.524 41.285 1.00 62.13 C ATOM 16236 NE ARG B 508 53.627 56.444 41.301 1.00 64.28 N ATOM 16237 CZ ARG B 508 54.834 56.151 40.828 1.00 65.31 C ATOM 16238 NH1 ARG B 508 55.069 54.958 40.294 1.00 65.63 N ATOM 16239 NH2 ARG B 508 55.806 57.054 40.888 1.00 66.21 N ATOM 16240 HA ARG B 508 48.396 56.698 41.685 1.00 0.00 H ATOM 16241 HB2 ARG B 508 49.808 54.713 42.008 1.00 0.00 H ATOM 16242 HB3 ARG B 508 50.308 54.773 40.302 1.00 0.00 H ATOM 16243 HG2 ARG B 508 51.165 57.159 40.945 1.00 0.00 H ATOM 16244 HG3 ARG B 508 51.127 56.504 42.598 1.00 0.00 H ATOM 16245 HD2 ARG B 508 52.443 55.039 40.310 1.00 0.00 H ATOM 16246 HD3 ARG B 508 52.637 54.769 42.058 1.00 0.00 H ATOM 16247 HE ARG B 508 53.481 57.389 41.709 1.00 0.00 H ATOM 16248 HH12 ARG B 508 56.014 54.731 39.924 1.00 0.00 H ATOM 16249 HH11 ARG B 508 54.308 54.251 40.245 1.00 0.00 H ATOM 16250 HH22 ARG B 508 56.751 56.826 40.518 1.00 0.00 H ATOM 16251 HH21 ARG B 508 55.622 57.989 41.305 1.00 0.00 H ATOM 16252 H ARG B 508 47.937 54.172 40.459 1.00 0.00 H ATOM 16253 N ASN B 509 48.999 56.629 38.455 1.00 60.51 N ATOM 16254 CA ASN B 509 49.251 57.465 37.289 1.00 62.89 C ATOM 16255 C ASN B 509 48.123 58.463 37.026 1.00 64.72 C ATOM 16256 O ASN B 509 48.380 59.617 36.684 1.00 64.36 O ATOM 16257 CB ASN B 509 49.520 56.602 36.053 1.00 63.24 C ATOM 16258 CG ASN B 509 50.871 55.893 36.114 1.00 64.24 C ATOM 16259 OD1 ASN B 509 51.712 56.194 36.968 1.00 64.60 O ATOM 16260 ND2 ASN B 509 51.086 54.948 35.206 1.00 64.49 N ATOM 16261 HA ASN B 509 50.143 58.053 37.506 1.00 0.00 H ATOM 16262 HB2 ASN B 509 48.734 55.851 35.974 1.00 0.00 H ATOM 16263 HB3 ASN B 509 49.500 57.241 35.170 1.00 0.00 H ATOM 16264 HD22 ASN B 509 50.352 54.725 34.504 1.00 0.00 H ATOM 16265 HD21 ASN B 509 51.988 54.431 35.197 1.00 0.00 H ATOM 16266 H ASN B 509 48.803 55.617 38.319 1.00 0.00 H ATOM 16267 N HIS B 510 46.879 58.020 37.194 1.00 66.89 N ATOM 16268 CA HIS B 510 45.719 58.881 36.967 1.00 69.43 C ATOM 16269 C HIS B 510 45.589 59.955 38.048 1.00 70.63 C ATOM 16270 O HIS B 510 45.089 61.052 37.791 1.00 70.27 O ATOM 16271 CB HIS B 510 44.435 58.053 36.879 1.00 70.06 C ATOM 16272 CG HIS B 510 43.248 58.833 36.407 1.00 71.50 C ATOM 16273 ND1 HIS B 510 42.353 59.427 37.272 1.00 71.80 N ATOM 16274 CD2 HIS B 510 42.812 59.122 35.157 1.00 71.93 C ATOM 16275 CE1 HIS B 510 41.416 60.045 36.575 1.00 71.88 C ATOM 16276 NE2 HIS B 510 41.669 59.875 35.289 1.00 72.03 N ATOM 16277 HA HIS B 510 45.874 59.387 36.014 1.00 0.00 H ATOM 16278 HB2 HIS B 510 44.603 57.229 36.186 1.00 0.00 H ATOM 16279 HB3 HIS B 510 44.214 57.654 37.869 1.00 0.00 H ATOM 16280 HD2 HIS B 510 43.280 58.815 34.222 1.00 0.00 H ATOM 16281 HE1 HIS B 510 40.576 60.601 36.991 1.00 0.00 H ATOM 16282 H HIS B 510 46.728 57.036 37.495 1.00 0.00 H ATOM 16283 N GLU B 511 46.038 59.631 39.258 1.00 72.51 N ATOM 16284 CA GLU B 511 46.032 60.584 40.361 1.00 74.66 C ATOM 16285 C GLU B 511 47.102 61.647 40.156 1.00 76.01 C ATOM 16286 O GLU B 511 46.891 62.817 40.474 1.00 76.25 O ATOM 16287 CB GLU B 511 46.260 59.871 41.697 1.00 75.02 C ATOM 16288 CG GLU B 511 45.099 59.004 42.133 1.00 75.92 C ATOM 16289 CD GLU B 511 43.849 59.812 42.422 1.00 76.69 C ATOM 16290 OE1 GLU B 511 43.940 60.795 43.191 1.00 76.66 O ATOM 16291 OE2 GLU B 511 42.776 59.460 41.883 1.00 76.82 O ATOM 16292 HA GLU B 511 45.054 61.065 40.383 1.00 0.00 H ATOM 16293 HB2 GLU B 511 47.144 59.240 41.604 1.00 0.00 H ATOM 16294 HB3 GLU B 511 46.433 60.626 42.464 1.00 0.00 H ATOM 16295 HG2 GLU B 511 44.878 58.290 41.340 1.00 0.00 H ATOM 16296 HG3 GLU B 511 45.384 58.465 43.037 1.00 0.00 H ATOM 16297 H GLU B 511 46.403 58.671 39.421 1.00 0.00 H ATOM 16298 N SER B 512 48.246 61.226 39.620 1.00 77.28 N ATOM 16299 CA SER B 512 49.367 62.125 39.355 1.00 79.02 C ATOM 16300 C SER B 512 49.075 63.062 38.182 1.00 80.09 C ATOM 16301 O SER B 512 49.599 64.175 38.121 1.00 80.34 O ATOM 16302 CB SER B 512 50.645 61.327 39.083 1.00 78.81 C ATOM 16303 OG SER B 512 51.032 60.572 40.219 1.00 78.93 O ATOM 16304 HA SER B 512 49.511 62.736 40.246 1.00 0.00 H ATOM 16305 HB2 SER B 512 51.448 62.018 38.825 1.00 0.00 H ATOM 16306 HB3 SER B 512 50.469 60.648 38.248 1.00 0.00 H ATOM 16307 HG SER B 512 50.309 59.939 40.455 1.00 0.00 H ATOM 16308 H SER B 512 48.345 60.219 39.381 1.00 0.00 H ATOM 16309 N ALA B 513 48.239 62.601 37.257 1.00 81.38 N ATOM 16310 CA ALA B 513 47.849 63.399 36.102 1.00 82.70 C ATOM 16311 C ALA B 513 46.864 64.498 36.501 1.00 83.73 C ATOM 16312 O ALA B 513 46.934 65.618 35.995 1.00 84.21 O ATOM 16313 CB ALA B 513 47.251 62.511 35.020 1.00 82.83 C ATOM 16314 HA ALA B 513 48.743 63.878 35.704 1.00 0.00 H ATOM 16315 HB1 ALA B 513 47.990 61.772 34.709 1.00 0.00 H ATOM 16316 HB2 ALA B 513 46.371 62.003 35.414 1.00 0.00 H ATOM 16317 HB3 ALA B 513 46.966 63.124 34.165 1.00 0.00 H ATOM 16318 H ALA B 513 47.852 61.641 37.361 1.00 0.00 H ATOM 16319 N GLY B 514 45.953 64.174 37.413 1.00 84.65 N ATOM 16320 CA GLY B 514 44.965 65.138 37.889 1.00 85.69 C ATOM 16321 C GLY B 514 45.469 66.043 39.002 1.00 86.42 C ATOM 16322 O GLY B 514 44.675 66.609 39.755 1.00 86.71 O ATOM 16323 HA3 GLY B 514 44.100 64.588 38.260 1.00 0.00 H ATOM 16324 HA2 GLY B 514 44.664 65.763 37.049 1.00 0.00 H ATOM 16325 H GLY B 514 45.944 63.208 37.798 1.00 0.00 H ATOM 16326 N THR B 515 46.789 66.178 39.114 1.00 87.01 N ATOM 16327 CA THR B 515 47.403 67.054 40.114 1.00 87.65 C ATOM 16328 C THR B 515 48.529 67.903 39.519 1.00 88.10 C ATOM 16329 O THR B 515 48.965 68.882 40.126 1.00 88.35 O ATOM 16330 CB THR B 515 47.959 66.263 41.322 1.00 87.50 C ATOM 16331 OG1 THR B 515 48.791 65.196 40.852 1.00 87.64 O ATOM 16332 CG2 THR B 515 46.827 65.689 42.169 1.00 87.59 C ATOM 16333 HA THR B 515 46.604 67.710 40.458 1.00 0.00 H ATOM 16334 HB THR B 515 48.541 66.945 41.941 1.00 0.00 H ATOM 16335 HG1 THR B 515 48.257 64.591 40.278 1.00 0.00 H ATOM 16336 HG23 THR B 515 46.194 66.501 42.526 1.00 0.00 H ATOM 16337 HG21 THR B 515 46.233 65.004 41.564 1.00 0.00 H ATOM 16338 HG22 THR B 515 47.247 65.153 43.020 1.00 0.00 H ATOM 16339 H THR B 515 47.405 65.643 38.469 1.00 0.00 H TER 16340 THR B 515 HETATM16341 O HOH 1 31.405 39.590 15.535 1.00 27.81 O HETATM16342 O HOH 2 37.834 19.762 29.387 1.00 22.94 O HETATM16343 O HOH 3 45.784 51.075 30.910 1.00 27.14 O HETATM16344 O HOH 4 44.008 23.314 19.415 1.00 22.29 O HETATM16345 O HOH 5 24.164 54.533 22.278 1.00 33.14 O HETATM16346 O HOH 6 29.916 41.583 22.929 1.00 32.43 O HETATM16347 O HOH 7 37.761 13.992 4.748 1.00 35.07 O HETATM16348 O HOH 8 22.699 39.024 28.024 1.00 28.26 O HETATM16349 O HOH 9 38.754 13.228 12.860 1.00 27.05 O HETATM16350 O HOH 10 24.198 38.310 25.257 1.00 23.63 O HETATM16351 O HOH 11 49.239 16.032 1.460 1.00 33.78 O HETATM16352 O HOH 12 43.767 8.087 31.910 1.00 34.03 O HETATM16353 O HOH 13 42.511 18.757 25.474 1.00 24.74 O HETATM16354 O HOH 14 15.156 51.366 17.426 1.00 36.50 O HETATM16355 O HOH 15 27.637 42.630 29.883 1.00 30.82 O HETATM16356 O HOH 16 34.107 50.046 25.660 1.00 34.60 O HETATM16357 O HOH 17 35.631 19.354 36.189 1.00 35.98 O HETATM16358 O HOH 18 47.930 16.605 16.568 1.00 31.20 O HETATM16359 O HOH 19 34.066 38.380 28.295 1.00 26.82 O HETATM16360 O HOH 20 30.865 48.498 30.974 1.00 27.96 O HETATM16361 O HOH 21 6.197 47.582 34.820 1.00 48.27 O HETATM16362 O HOH 22 27.895 18.283 15.223 1.00 25.84 O HETATM16363 O HOH 23 18.193 51.736 23.557 1.00 39.81 O HETATM16364 O HOH 24 44.903 51.151 23.458 1.00 40.09 O HETATM16365 O HOH 25 26.265 21.288 10.001 1.00 38.64 O HETATM16366 O HOH 26 25.498 19.781 21.920 1.00 40.78 O HETATM16367 O HOH 27 48.304 15.814 30.744 1.00 43.36 O HETATM16368 O HOH 28 51.900 17.263 17.954 1.00 37.71 O HETATM16369 O HOH 29 29.776 47.464 34.049 1.00 39.96 O HETATM16370 O HOH 30 37.432 47.778 22.781 1.00 33.97 O HETATM16371 O HOH 31 22.711 19.014 9.976 1.00 34.38 O HETATM16372 O HOH 32 37.870 45.621 21.018 1.00 29.73 O HETATM16373 O HOH 33 31.537 13.933 21.000 1.00 37.46 O HETATM16374 O HOH 34 27.656 14.146 17.713 1.00 36.65 O HETATM16375 O HOH 35 21.974 27.052 26.177 1.00 46.10 O HETATM16376 O HOH 36 34.995 52.180 23.550 1.00 42.47 O HETATM16377 O HOH 37 19.837 22.478 23.750 1.00 43.64 O HETATM16378 O HOH 38 17.721 21.903 6.380 1.00 42.27 O HETATM16379 O HOH 39 39.968 12.818 -4.180 1.00 39.83 O HETATM16380 O HOH 40 32.515 55.416 26.569 1.00 38.82 O HETATM16381 O HOH 41 27.525 20.716 28.957 1.00 39.04 O HETATM16382 O HOH 42 25.016 6.649 20.873 1.00 47.28 O HETATM16383 O HOH 43 28.070 19.006 12.740 1.00 29.40 O HETATM16384 O HOH 44 36.988 50.259 21.230 1.00 45.69 O HETATM16385 O HOH 45 19.084 17.618 23.437 1.00 46.45 O HETATM16386 O HOH 46 52.468 16.014 20.874 1.00 35.29 O HETATM16387 O HOH 47 42.577 52.911 24.408 1.00 37.14 O HETATM16388 O HOH 48 26.335 51.605 12.797 1.00 48.22 O HETATM16389 O HOH 49 45.653 13.774 15.778 1.00 35.08 O HETATM16390 O HOH 50 29.714 17.314 16.504 1.00 40.39 O HETATM16391 O HOH 51 39.882 52.943 26.533 1.00 47.03 O HETATM16392 O HOH 52 44.044 8.213 13.072 1.00 44.09 O HETATM16393 O HOH 53 30.789 42.861 3.171 1.00 44.68 O HETATM16394 O HOH 54 35.848 16.445 35.541 1.00 42.15 O HETATM16395 O HOH 55 19.169 7.271 -5.506 1.00 47.20 O HETATM16396 O HOH 56 27.269 53.905 21.659 1.00 45.60 O HETATM16397 O HOH 57 27.544 48.710 1.567 1.00 43.97 O HETATM16398 O HOH 58 36.739 17.511 28.247 1.00 32.95 O HETATM16399 O HOH 59 39.111 28.686 25.503 1.00 38.37 O HETATM16400 O HOH 60 26.832 24.075 23.935 1.00 34.79 O HETATM16401 O HOH 61 0.645 43.245 16.764 1.00 44.84 O HETATM16402 O HOH 62 47.875 13.600 22.618 1.00 43.76 O HETATM16403 O HOH 63 21.127 56.248 27.990 1.00 42.84 O HETATM16404 O HOH 64 35.856 55.635 37.265 1.00 42.84 O HETATM16405 O HOH 65 28.451 31.443 40.389 1.00 42.31 O HETATM16406 O HOH 66 6.869 52.122 32.420 1.00 45.64 O HETATM16407 O HOH 67 49.761 34.290 31.078 1.00 46.23 O HETATM16408 O HOH 68 27.420 18.174 32.771 1.00 48.59 O HETATM16409 O HOH 69 41.364 56.197 40.624 1.00 50.86 O HETATM16410 O HOH 70 39.588 33.569 1.631 1.00 50.88 O HETATM16411 O HOH 71 52.081 16.888 24.197 1.00 40.44 O HETATM16412 O HOH 72 34.384 53.163 37.683 1.00 51.79 O HETATM16413 O HOH 73 40.722 33.828 41.890 1.00 47.99 O HETATM16414 O HOH 74 28.632 26.308 40.330 1.00 46.36 O HETATM16415 O HOH 75 42.950 35.274 37.536 1.00 47.76 O HETATM16416 O HOH 76 30.044 43.585 46.733 1.00 50.82 O HETATM16417 O HOH 77 49.462 41.659 30.158 1.00 46.47 O HETATM16418 O HOH 78 24.702 29.720 37.588 1.00 53.99 O HETATM16419 O HOH 79 20.484 3.526 10.136 1.00 47.34 O HETATM16420 O HOH 80 30.472 48.656 37.641 1.00 43.91 O HETATM16421 O HOH 81 42.025 51.209 39.600 1.00 50.16 O HETATM16422 O HOH 82 35.603 53.494 27.665 1.00 49.47 O HETATM16423 O HOH 83 43.521 9.280 23.310 1.00 51.49 O HETATM16424 O HOH 84 50.487 40.794 20.631 1.00 56.03 O HETATM16425 O HOH 85 10.018 54.861 15.920 1.00 55.54 O HETATM16426 O HOH 86 14.017 49.303 5.747 1.00 57.92 O HETATM16427 O HOH 87 3.765 31.528 18.404 1.00 51.78 O HETATM16428 O HOH 88 42.064 51.939 37.424 1.00 60.48 O HETATM16429 O HOH 89 51.336 39.590 65.710 1.00 27.81 O HETATM16430 O HOH 90 44.907 19.762 51.858 1.00 22.94 O HETATM16431 O HOH 91 36.956 51.075 50.334 1.00 27.14 O HETATM16432 O HOH 92 38.733 23.314 61.830 1.00 22.29 O HETATM16433 O HOH 93 58.577 54.533 58.967 1.00 33.14 O HETATM16434 O HOH 94 52.825 41.583 58.316 1.00 32.43 O HETATM16435 O HOH 95 44.980 13.992 76.496 1.00 35.07 O HETATM16436 O HOH 96 60.041 39.024 53.221 1.00 28.26 O HETATM16437 O HOH 97 43.986 13.228 68.385 1.00 27.05 O HETATM16438 O HOH 98 58.542 38.310 55.987 1.00 23.63 O HETATM16439 O HOH 99 33.502 16.032 79.784 1.00 33.78 O HETATM16440 O HOH 100 38.974 8.087 49.334 1.00 34.03 O HETATM16441 O HOH 101 40.230 18.757 55.770 1.00 24.74 O HETATM16442 O HOH 102 67.585 51.366 63.819 1.00 36.50 O HETATM16443 O HOH 103 55.103 42.630 51.361 1.00 30.82 O HETATM16444 O HOH 104 48.633 50.046 55.584 1.00 34.60 O HETATM16445 O HOH 105 47.109 19.354 45.056 1.00 35.98 O HETATM16446 O HOH 106 34.810 16.605 64.677 1.00 31.20 O HETATM16447 O HOH 107 48.675 38.380 52.950 1.00 26.82 O HETATM16448 O HOH 108 51.876 48.498 50.270 1.00 27.96 O HETATM16449 O HOH 109 76.543 47.582 46.425 1.00 48.27 O HETATM16450 O HOH 110 54.846 18.283 66.022 1.00 25.84 O HETATM16451 O HOH 111 64.547 51.736 57.688 1.00 39.81 O HETATM16452 O HOH 112 37.837 51.151 57.786 1.00 40.09 O HETATM16453 O HOH 113 56.475 21.288 71.243 1.00 38.64 O HETATM16454 O HOH 114 57.242 19.781 59.325 1.00 40.78 O HETATM16455 O HOH 115 34.437 15.814 50.501 1.00 43.36 O HETATM16456 O HOH 116 30.840 17.263 63.291 1.00 37.71 O HETATM16457 O HOH 117 52.965 47.464 47.196 1.00 39.96 O HETATM16458 O HOH 118 45.309 47.778 58.464 1.00 33.97 O HETATM16459 O HOH 119 60.029 19.014 71.269 1.00 34.38 O HETATM16460 O HOH 120 44.870 45.621 60.227 1.00 29.73 O HETATM16461 O HOH 121 51.203 13.933 60.245 1.00 37.46 O HETATM16462 O HOH 122 55.084 14.146 63.532 1.00 36.65 O HETATM16463 O HOH 123 60.767 27.052 55.068 1.00 46.10 O HETATM16464 O HOH 124 47.745 52.180 57.694 1.00 42.47 O HETATM16465 O HOH 125 62.904 22.478 57.495 1.00 43.64 O HETATM16466 O HOH 126 65.019 21.903 74.865 1.00 42.27 O HETATM16467 O HOH 127 42.773 12.818 85.424 1.00 39.83 O HETATM16468 O HOH 128 50.225 55.416 54.675 1.00 38.82 O HETATM16469 O HOH 129 55.215 20.716 52.288 1.00 39.04 O HETATM16470 O HOH 130 57.724 6.649 60.371 1.00 47.28 O HETATM16471 O HOH 131 54.670 19.006 68.504 1.00 29.40 O HETATM16472 O HOH 132 45.752 50.259 60.014 1.00 45.69 O HETATM16473 O HOH 133 63.657 17.618 57.807 1.00 46.45 O HETATM16474 O HOH 134 30.273 16.014 60.370 1.00 35.29 O HETATM16475 O HOH 135 40.163 52.911 56.837 1.00 37.14 O HETATM16476 O HOH 136 56.406 51.605 68.448 1.00 48.22 O HETATM16477 O HOH 137 37.087 13.774 65.466 1.00 35.08 O HETATM16478 O HOH 138 53.026 17.314 64.740 1.00 40.39 O HETATM16479 O HOH 139 42.858 52.943 54.712 1.00 47.03 O HETATM16480 O HOH 140 38.697 8.213 68.172 1.00 44.09 O HETATM16481 O HOH 141 51.952 42.861 78.073 1.00 44.68 O HETATM16482 O HOH 142 46.892 16.445 45.703 1.00 42.15 O HETATM16483 O HOH 143 63.572 7.271 86.751 1.00 47.20 O HETATM16484 O HOH 144 55.471 53.905 59.586 1.00 45.60 O HETATM16485 O HOH 145 55.197 48.710 79.677 1.00 43.97 O HETATM16486 O HOH 146 46.002 17.511 52.998 1.00 32.95 O HETATM16487 O HOH 147 43.630 28.686 55.742 1.00 38.37 O HETATM16488 O HOH 148 55.908 24.075 57.309 1.00 34.79 O HETATM16489 O HOH 149 82.096 43.245 64.481 1.00 44.84 O HETATM16490 O HOH 150 34.865 13.600 58.627 1.00 43.76 O HETATM16491 O HOH 151 61.614 56.248 53.255 1.00 42.84 O HETATM16492 O HOH 152 46.885 55.635 43.980 1.00 42.84 O HETATM16493 O HOH 153 54.289 31.443 40.855 1.00 42.31 O HETATM16494 O HOH 154 75.871 52.122 48.825 1.00 45.64 O HETATM16495 O HOH 155 32.980 34.290 50.166 1.00 46.23 O HETATM16496 O HOH 156 55.321 18.174 48.474 1.00 48.59 O HETATM16497 O HOH 157 43.153 33.569 79.614 1.00 50.88 O HETATM16498 O HOH 158 30.660 16.888 57.047 1.00 40.44 O HETATM16499 O HOH 159 48.356 53.163 43.562 1.00 51.79 O HETATM16500 O HOH 160 42.019 33.828 39.355 1.00 47.99 O HETATM16501 O HOH 161 54.108 26.308 40.914 1.00 46.36 O HETATM16502 O HOH 162 39.791 35.274 43.709 1.00 47.76 O HETATM16503 O HOH 163 52.697 43.585 34.511 1.00 50.82 O HETATM16504 O HOH 164 33.279 41.659 51.087 1.00 46.47 O HETATM16505 O HOH 165 58.038 29.720 43.657 1.00 53.99 O HETATM16506 O HOH 166 62.257 3.526 71.109 1.00 47.34 O HETATM16507 O HOH 167 52.269 48.656 43.603 1.00 43.91 O HETATM16508 O HOH 168 40.715 51.209 41.645 1.00 50.16 O HETATM16509 O HOH 169 47.138 53.494 53.580 1.00 49.47 O HETATM16510 O HOH 170 39.219 9.280 57.934 1.00 51.49 O HETATM16511 O HOH 171 32.254 40.794 60.614 1.00 56.03 O HETATM16512 O HOH 172 72.722 54.861 65.325 1.00 55.54 O HETATM16513 O HOH 173 68.724 49.303 75.498 1.00 57.92 O HETATM16514 O HOH 174 78.975 31.528 62.840 1.00 51.78 O HETATM16515 O HOH 175 40.676 51.939 43.821 1.00 60.48 O HETATM16516 N PFF A 176 25.952 32.270 19.162 1.00 0.23 N HETATM16517 CA PFF A 176 27.254 31.626 19.126 1.00 0.04 C HETATM16518 C PFF A 176 27.200 30.318 18.388 1.00 0.09 C HETATM16519 O PFF A 176 28.274 29.691 18.195 1.00 -0.56 O HETATM16520 OXT PFF A 176 26.089 29.905 18.006 1.00 -0.56 O HETATM16521 CB PFF A 176 27.724 31.357 20.552 1.00 0.03 C HETATM16522 CG PFF A 176 28.024 32.686 21.195 1.00 -0.04 C HETATM16523 CD1 PFF A 176 28.655 33.663 20.438 1.00 -0.06 C HETATM16524 CE1 PFF A 176 28.937 34.897 20.998 1.00 -0.03 C HETATM16525 CZ PFF A 176 28.580 35.150 22.319 1.00 0.12 C HETATM16526 CE2 PFF A 176 27.947 34.179 23.087 1.00 -0.03 C HETATM16527 CD2 PFF A 176 27.666 32.936 22.520 1.00 -0.06 C HETATM16528 H8 PFF A 176 27.172 32.169 23.105 1.00 0.05 H HETATM16529 H10 PFF A 176 27.675 34.386 24.116 1.00 0.06 H HETATM16530 F PFF A 176 28.864 36.349 22.845 1.00 -0.19 F HETATM16531 H9 PFF A 176 29.433 35.662 20.411 1.00 0.06 H HETATM16532 H7 PFF A 176 28.927 33.460 19.409 1.00 0.05 H HETATM16533 H5 PFF A 176 28.631 30.735 20.536 1.00 0.05 H HETATM16534 H6 PFF A 176 26.934 30.838 21.115 1.00 0.05 H HETATM16535 H4 PFF A 176 27.969 32.294 18.623 1.00 0.10 H HETATM16536 H1 PFF A 176 26.022 33.142 19.663 1.00 0.20 H HETATM16537 H2 PFF A 176 25.292 31.667 19.628 1.00 0.20 H HETATM16538 H3 PFF A 176 25.639 32.447 18.221 1.00 0.20 H CONECT 1 2 24 25 26 CONECT 24 1 CONECT 25 1 CONECT 26 1 CONECT 2032 2033 2045 2046 2047 CONECT 2045 2032 CONECT 2046 2032 CONECT 2047 2032 CONECT 8171 8172 8194 8195 8196 CONECT 8194 8171 CONECT 8195 8171 CONECT 8196 8171 CONECT1020210203102151021610217 CONECT1021510202 CONECT1021610202 CONECT1021710202 CONECT1651616517165361653716538 CONECT1651716516165181652116535 CONECT16518165171651916520 CONECT1651916518 CONECT1652016518 CONECT1652116517165221653316534 CONECT16522165211652316527 CONECT16523165221652416532 CONECT16524165231652516531 CONECT16525165241652616530 CONECT16526165251652716529 CONECT16527165221652616528 CONECT1652816527 CONECT1652916526 CONECT1653016525 CONECT1653116524 CONECT1653216523 CONECT1653316521 CONECT1653416521 CONECT1653516517 CONECT1653616516 CONECT1653716516 CONECT1653816516 MASTER 0 0 0 0 0 0 0 016534 4 39 80 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 3f3c
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
2q6h
RCSB PDB
PDBbind
519aa, >2Q6H_1|Chain... *
2q72
RCSB PDB
PDBbind
519aa, >2Q72_1|Chain... at 100%
2qju
RCSB PDB
PDBbind
511aa, >2QJU_1|Chain... at 100%
3f3a
RCSB PDB
PDBbind
519aa, >3F3A_1|Chain... at 100%
3f3d
RCSB PDB
PDBbind
519aa, >3F3D_1|Chain... at 100%
3f3e
RCSB PDB
PDBbind
519aa, >3F3E_1|Chain... at 100%
3f48
RCSB PDB
PDBbind
519aa, >3F48_1|Chain... at 100%
3gjd
RCSB PDB
PDBbind
515aa, >3GJD_1|Chain... at 100%
3gwu
RCSB PDB
PDBbind
515aa, >3GWU_1|Chain... at 100%
3gwv
RCSB PDB
PDBbind
515aa, >3GWV_1|Chain... at 100%
3gww
RCSB PDB
PDBbind
515aa, >3GWW_1|Chain... at 100%
3qs4
RCSB PDB
PDBbind
519aa, >3QS4_1|Chain... at 99%
3qs5
RCSB PDB
PDBbind
519aa, >3QS5_1|Chain... at 99%
3qs6
RCSB PDB
PDBbind
519aa, >3QS6_1|Chain... at 99%
4fxz
RCSB PDB
PDBbind
513aa, >4FXZ_1|Chain... at 99%
4hmk
RCSB PDB
PDBbind
513aa, >4HMK_1|Chains... at 99%
4hod
RCSB PDB
PDBbind
515aa, >4HOD_1|Chain... at 99%
4mm4
RCSB PDB
PDBbind
519aa, >4MM4_1|Chains... at 97%
4mm5
RCSB PDB
PDBbind
519aa, >4MM5_1|Chain... at 97%
4mm6
RCSB PDB
PDBbind
519aa, >4MM6_1|Chain... at 97%
4mm7
RCSB PDB
PDBbind
519aa, >4MM7_1|Chain... at 97%
4mm8
RCSB PDB
PDBbind
519aa, >4MM8_1|Chain... at 97%
4mm9
RCSB PDB
PDBbind
519aa, >4MM9_1|Chain... at 97%
4mma
RCSB PDB
PDBbind
519aa, >4MMA_1|Chain... at 97%
4mme
RCSB PDB
PDBbind
519aa, >4MME_1|Chains... at 98%
4mmf
RCSB PDB
PDBbind
518aa, >4MMF_1|Chains... at 99%
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
No complexes with the same small molecule ligand are found!
Entry Information
PDB ID
3f3c
Complex Type
Protein-Ligand
PDBbind Subset
refined set
Protein Name
Transporter LeuT
Ligand Name
PFF
EC.Number
E.C.-.-.-.-
Resolution
2.1(Å)
Affinity (Kd/Ki/IC50)
Ki=950nM
Release Year
2008
Protein/NA Sequence
Check fasta file
Primary Reference
(2008) Science Vol. 322: pp. 1655-1661
Ligand Properties
Formula
C
9
H
1
1
FNO
2
Molecular Weight
184.188
Exact Mass
184.077
No. of atoms
24
No. of bonds
24
Polar Surface Area
64.94
LOGP Value
-0.42 (
Computed with XLOGP3
)
0.06 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 1
No. of Hydrogen Bond Acceptors: 2
No. of Rotatable Bonds: 2
No. of Nitrogen and Oxygen Atoms: 3
No. of Rings: 1
Canonical SMILES
[NH3+][C@H](C(=O)O)Cc1ccc(cc1)F
InChI String
InChI=1S/C9H10FNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/p+1/t8-/m0/s1
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
O67854
Entrez Gene ID
No matched NCBI Entrez Gene ID found!
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com