Browse entries in the PDBbind-CN Database
HEADER 3KDT_COMPLEX COMPND 3KDT_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 59 SER GLU THR ALA ASP LEU LYS SER LEU ALA LYS ARG ILE SEQRES 2 A 59 TYR GLU ALA TYR LEU LYS ASN PHE ASN MET ASN LYS VAL SEQRES 3 A 59 LYS ALA ARG VAL ILE LEU SER GLY LYS ALA SER ASN ASN SEQRES 4 A 59 PRO PRO PHE VAL ILE HIS ASP MET GLU THR LEU CYS MET SEQRES 5 A 59 ALA GLU LYS THR LEU VAL ALA SEQRES 1 A 206 ILE GLN ASN LYS GLU ALA GLU VAL ARG ILE PHE HIS CYS SEQRES 2 A 206 CYS GLN CYS THR SER VAL GLU THR VAL THR GLU LEU THR SEQRES 3 A 206 GLU PHE ALA LYS ALA ILE PRO GLY PHE ALA ASN LEU ASP SEQRES 4 A 206 LEU ASN ASP GLN VAL THR LEU LEU LYS TYR GLY VAL TYR SEQRES 5 A 206 GLU ALA ILE PHE ALA MET LEU SER SER VAL MET ASN LYS SEQRES 6 A 206 ASP GLY MET LEU VAL ALA TYR GLY ASN GLY PHE ILE THR SEQRES 7 A 206 ARG GLU PHE LEU LYS SER LEU ARG LYS PRO PHE CYS ASP SEQRES 8 A 206 ILE MET GLU PRO LYS PHE ASP PHE ALA MET LYS PHE ASN SEQRES 9 A 206 ALA LEU GLU LEU ASP ASP SER ASP ILE SER LEU PHE VAL SEQRES 10 A 206 ALA ALA ILE ILE CYS CYS GLY ASP ARG PRO GLY LEU LEU SEQRES 11 A 206 ASN VAL GLY HIS ILE GLU LYS MET GLN GLU GLY ILE VAL SEQRES 12 A 206 HIS VAL LEU ARG LEU HIS LEU GLN SER ASN HIS PRO ASP SEQRES 13 A 206 ASP ILE PHE LEU PHE PRO LYS LEU LEU GLN LYS MET ALA SEQRES 14 A 206 ASP LEU ARG GLN LEU VAL THR GLU HIS ALA GLN LEU VAL SEQRES 15 A 206 GLN ILE ILE LYS LYS THR GLU SER ASP ALA ALA LEU HIS SEQRES 16 A 206 PRO LEU LEU GLN GLU ILE TYR ARG ASP MET TYR SEQRES 1 B 41 SER HIS MET GLU ASP SER GLU THR ALA ASP LEU LYS SER SEQRES 2 B 41 LEU ALA LYS ARG ILE TYR GLU ALA TYR LEU LYS ASN PHE SEQRES 3 B 41 ASN MET ASN LYS VAL LYS ALA ARG VAL ILE LEU SER GLY SEQRES 4 B 41 LYS ALA SEQRES 1 B 21 ASN ASN PRO PRO PHE VAL ILE HIS ASP MET GLU THR LEU SEQRES 2 B 21 CYS MET ALA GLU LYS THR LEU VAL SEQRES 1 B 210 VAL ALA ASN GLY ILE GLN ASN LYS GLU ALA GLU VAL ARG SEQRES 2 B 210 ILE PHE HIS CYS CYS GLN CYS THR SER VAL GLU THR VAL SEQRES 3 B 210 THR GLU LEU THR GLU PHE ALA LYS ALA ILE PRO GLY PHE SEQRES 4 B 210 ALA ASN LEU ASP LEU ASN ASP GLN VAL THR LEU LEU LYS SEQRES 5 B 210 TYR GLY VAL TYR GLU ALA ILE PHE ALA MET LEU SER SER SEQRES 6 B 210 VAL MET ASN LYS ASP GLY MET LEU VAL ALA TYR GLY ASN SEQRES 7 B 210 GLY PHE ILE THR ARG GLU PHE LEU LYS SER LEU ARG LYS SEQRES 8 B 210 PRO PHE CYS ASP ILE MET GLU PRO LYS PHE ASP PHE ALA SEQRES 9 B 210 MET LYS PHE ASN ALA LEU GLU LEU ASP ASP SER ASP ILE SEQRES 10 B 210 SER LEU PHE VAL ALA ALA ILE ILE CYS CYS GLY ASP ARG SEQRES 11 B 210 PRO GLY LEU LEU ASN VAL GLY HIS ILE GLU LYS MET GLN SEQRES 12 B 210 GLU GLY ILE VAL HIS VAL LEU ARG LEU HIS LEU GLN SER SEQRES 13 B 210 ASN HIS PRO ASP ASP ILE PHE LEU PHE PRO LYS LEU LEU SEQRES 14 B 210 GLN LYS MET ALA ASP LEU ARG GLN LEU VAL THR GLU HIS SEQRES 15 B 210 ALA GLN LEU VAL GLN ILE ILE LYS LYS THR GLU SER ASP SEQRES 16 B 210 ALA ALA LEU HIS PRO LEU LEU GLN GLU ILE TYR ARG ASP SEQRES 17 B 210 MET TYR HET UNN A 540 51 ATOM 1 N SER A 198 27.856 4.000 28.353 1.00 88.40 N ATOM 2 CA SER A 198 27.408 3.899 26.930 1.00 88.23 C ATOM 3 C SER A 198 27.056 2.460 26.526 1.00 88.13 C ATOM 4 O SER A 198 27.898 1.558 26.581 1.00 88.26 O ATOM 5 CB SER A 198 28.476 4.471 25.979 1.00 88.24 C ATOM 6 OG SER A 198 28.756 5.833 26.259 1.00 87.63 O ATOM 7 HA SER A 198 26.498 4.493 26.845 1.00 0.00 H ATOM 8 HB2 SER A 198 28.116 4.388 24.953 1.00 0.00 H ATOM 9 HB3 SER A 198 29.393 3.892 26.089 1.00 0.00 H ATOM 10 HG SER A 198 29.445 6.163 25.629 1.00 0.00 H ATOM 11 HN3 SER A 198 28.702 3.411 28.491 1.00 0.00 H ATOM 12 HN2 SER A 198 27.095 3.668 28.979 1.00 0.00 H ATOM 13 HN1 SER A 198 28.081 4.991 28.575 1.00 0.00 H ATOM 14 N GLU A 199 25.799 2.254 26.148 1.00 87.86 N ATOM 15 CA GLU A 199 25.387 1.066 25.403 1.00 87.49 C ATOM 16 C GLU A 199 24.673 1.591 24.160 1.00 87.14 C ATOM 17 O GLU A 199 24.637 0.937 23.110 1.00 87.00 O ATOM 18 CB GLU A 199 24.470 0.177 26.248 1.00 87.63 C ATOM 19 CG GLU A 199 24.347 -1.271 25.769 1.00 87.73 C ATOM 20 CD GLU A 199 23.314 -1.452 24.661 1.00 88.30 C ATOM 21 OE1 GLU A 199 22.444 -0.566 24.484 1.00 88.44 O ATOM 22 OE2 GLU A 199 23.370 -2.491 23.968 1.00 88.28 O ATOM 23 HA GLU A 199 26.238 0.441 25.135 1.00 0.00 H ATOM 24 HB2 GLU A 199 24.857 0.164 27.267 1.00 0.00 H ATOM 25 HB3 GLU A 199 23.474 0.620 26.245 1.00 0.00 H ATOM 26 HG2 GLU A 199 25.318 -1.596 25.394 1.00 0.00 H ATOM 27 HG3 GLU A 199 24.059 -1.893 26.616 1.00 0.00 H ATOM 28 H GLU A 199 25.081 2.965 26.392 1.00 0.00 H ATOM 29 N THR A 200 24.139 2.804 24.302 1.00 86.69 N ATOM 30 CA THR A 200 23.431 3.524 23.241 1.00 86.10 C ATOM 31 C THR A 200 24.376 4.120 22.174 1.00 85.73 C ATOM 32 O THR A 200 23.922 4.762 21.221 1.00 85.67 O ATOM 33 CB THR A 200 22.512 4.636 23.840 1.00 86.14 C ATOM 34 OG1 THR A 200 23.303 5.589 24.562 1.00 85.68 O ATOM 35 CG2 THR A 200 21.457 4.035 24.780 1.00 85.96 C ATOM 36 HA THR A 200 22.813 2.785 22.732 1.00 0.00 H ATOM 37 HB THR A 200 22.001 5.131 23.014 1.00 0.00 H ATOM 38 HG1 THR A 200 22.712 6.289 24.938 1.00 0.00 H ATOM 39 HG23 THR A 200 20.855 3.310 24.232 1.00 0.00 H ATOM 40 HG21 THR A 200 21.955 3.540 25.614 1.00 0.00 H ATOM 41 HG22 THR A 200 20.815 4.830 25.159 1.00 0.00 H ATOM 42 H THR A 200 24.231 3.270 25.227 1.00 0.00 H ATOM 43 N ALA A 201 25.683 3.905 22.338 1.00 85.19 N ATOM 44 CA ALA A 201 26.670 4.290 21.329 1.00 84.64 C ATOM 45 C ALA A 201 26.475 3.447 20.074 1.00 84.23 C ATOM 46 O ALA A 201 26.812 3.880 18.970 1.00 84.14 O ATOM 47 CB ALA A 201 28.083 4.132 21.869 1.00 84.70 C ATOM 48 HA ALA A 201 26.526 5.340 21.076 1.00 0.00 H ATOM 49 HB1 ALA A 201 28.209 4.768 22.745 1.00 0.00 H ATOM 50 HB2 ALA A 201 28.250 3.091 22.146 1.00 0.00 H ATOM 51 HB3 ALA A 201 28.799 4.424 21.101 1.00 0.00 H ATOM 52 H ALA A 201 26.011 3.448 23.213 1.00 0.00 H ATOM 53 N ASP A 202 25.932 2.241 20.266 1.00 83.82 N ATOM 54 CA ASP A 202 25.453 1.380 19.175 1.00 83.33 C ATOM 55 C ASP A 202 24.408 2.124 18.340 1.00 83.06 C ATOM 56 O ASP A 202 24.496 2.176 17.108 1.00 83.11 O ATOM 57 CB ASP A 202 24.810 0.096 19.730 1.00 83.18 C ATOM 58 CG ASP A 202 25.806 -0.826 20.415 1.00 83.05 C ATOM 59 OD1 ASP A 202 26.577 -1.505 19.704 1.00 82.68 O ATOM 60 OD2 ASP A 202 25.798 -0.895 21.664 1.00 82.29 O ATOM 61 HA ASP A 202 26.312 1.116 18.557 1.00 0.00 H ATOM 62 HB2 ASP A 202 24.044 0.377 20.453 1.00 0.00 H ATOM 63 HB3 ASP A 202 24.348 -0.445 18.904 1.00 0.00 H ATOM 64 H ASP A 202 25.843 1.892 21.242 1.00 0.00 H ATOM 65 N LEU A 203 23.436 2.710 19.043 1.00 82.47 N ATOM 66 CA LEU A 203 22.250 3.329 18.450 1.00 81.66 C ATOM 67 C LEU A 203 22.521 4.669 17.759 1.00 81.11 C ATOM 68 O LEU A 203 22.038 4.906 16.646 1.00 81.08 O ATOM 69 CB LEU A 203 21.155 3.494 19.518 1.00 81.75 C ATOM 70 CG LEU A 203 20.705 2.246 20.293 1.00 81.65 C ATOM 71 CD1 LEU A 203 20.039 2.638 21.600 1.00 81.21 C ATOM 72 CD2 LEU A 203 19.784 1.361 19.454 1.00 81.58 C ATOM 73 HA LEU A 203 21.916 2.651 17.664 1.00 0.00 H ATOM 74 HB2 LEU A 203 21.522 4.214 20.249 1.00 0.00 H ATOM 75 HB3 LEU A 203 20.275 3.900 19.019 1.00 0.00 H ATOM 76 HG LEU A 203 21.596 1.661 20.522 1.00 0.00 H ATOM 77 HD21 LEU A 203 18.897 1.928 19.170 1.00 0.00 H ATOM 78 HD22 LEU A 203 20.312 1.037 18.557 1.00 0.00 H ATOM 79 HD23 LEU A 203 19.488 0.490 20.038 1.00 0.00 H ATOM 80 HD11 LEU A 203 20.745 3.198 22.212 1.00 0.00 H ATOM 81 HD12 LEU A 203 19.167 3.257 21.390 1.00 0.00 H ATOM 82 HD13 LEU A 203 19.728 1.739 22.132 1.00 0.00 H ATOM 83 H LEU A 203 23.528 2.728 20.079 1.00 0.00 H ATOM 84 N LYS A 204 23.280 5.546 18.416 1.00 80.28 N ATOM 85 CA LYS A 204 23.611 6.851 17.839 1.00 79.51 C ATOM 86 C LYS A 204 24.314 6.666 16.487 1.00 78.75 C ATOM 87 O LYS A 204 24.191 7.495 15.575 1.00 78.68 O ATOM 88 CB LYS A 204 24.468 7.678 18.809 1.00 79.67 C ATOM 89 CG LYS A 204 24.651 9.128 18.374 1.00 80.00 C ATOM 90 CD LYS A 204 25.025 10.055 19.515 1.00 80.28 C ATOM 91 CE LYS A 204 24.773 11.497 19.094 1.00 80.99 C ATOM 92 NZ LYS A 204 25.417 12.485 19.995 1.00 81.38 N ATOM 93 HA LYS A 204 22.687 7.404 17.670 1.00 0.00 H ATOM 94 HB2 LYS A 204 23.988 7.669 19.788 1.00 0.00 H ATOM 95 HB3 LYS A 204 25.451 7.213 18.884 1.00 0.00 H ATOM 96 HG2 LYS A 204 25.440 9.167 17.623 1.00 0.00 H ATOM 97 HG3 LYS A 204 23.717 9.478 17.935 1.00 0.00 H ATOM 98 HD2 LYS A 204 24.419 9.819 20.390 1.00 0.00 H ATOM 99 HD3 LYS A 204 26.079 9.925 19.759 1.00 0.00 H ATOM 100 HE2 LYS A 204 23.698 11.676 19.093 1.00 0.00 H ATOM 101 HE3 LYS A 204 25.164 11.638 18.087 1.00 0.00 H ATOM 102 HZ1 LYS A 204 25.045 12.367 20.959 1.00 0.00 H ATOM 103 HZ2 LYS A 204 26.446 12.331 19.998 1.00 0.00 H ATOM 104 HZ3 LYS A 204 25.210 13.447 19.657 1.00 0.00 H ATOM 105 H LYS A 204 23.645 5.298 19.358 1.00 0.00 H ATOM 106 N SER A 205 25.038 5.557 16.378 1.00 77.60 N ATOM 107 CA SER A 205 25.682 5.149 15.148 1.00 76.44 C ATOM 108 C SER A 205 24.621 4.892 14.077 1.00 75.29 C ATOM 109 O SER A 205 24.543 5.620 13.091 1.00 75.10 O ATOM 110 CB SER A 205 26.541 3.905 15.419 1.00 76.70 C ATOM 111 OG SER A 205 26.785 3.148 14.246 1.00 77.33 O ATOM 112 HA SER A 205 26.338 5.937 14.779 1.00 0.00 H ATOM 113 HB2 SER A 205 26.024 3.274 16.142 1.00 0.00 H ATOM 114 HB3 SER A 205 27.497 4.224 15.835 1.00 0.00 H ATOM 115 HG SER A 205 27.340 2.360 14.473 1.00 0.00 H ATOM 116 H SER A 205 25.147 4.953 17.218 1.00 0.00 H ATOM 117 N LEU A 206 23.795 3.875 14.310 1.00 73.99 N ATOM 118 CA LEU A 206 22.696 3.473 13.425 1.00 72.74 C ATOM 119 C LEU A 206 21.901 4.649 12.849 1.00 72.00 C ATOM 120 O LEU A 206 21.473 4.608 11.695 1.00 71.54 O ATOM 121 CB LEU A 206 21.758 2.543 14.200 1.00 72.72 C ATOM 122 CG LEU A 206 20.547 1.916 13.520 1.00 72.90 C ATOM 123 CD1 LEU A 206 21.004 0.879 12.509 1.00 73.02 C ATOM 124 CD2 LEU A 206 19.624 1.295 14.563 1.00 72.40 C ATOM 125 HA LEU A 206 23.142 2.966 12.569 1.00 0.00 H ATOM 126 HB2 LEU A 206 22.370 1.719 14.568 1.00 0.00 H ATOM 127 HB3 LEU A 206 21.378 3.117 15.045 1.00 0.00 H ATOM 128 HG LEU A 206 19.989 2.689 12.991 1.00 0.00 H ATOM 129 HD21 LEU A 206 20.165 0.525 15.113 1.00 0.00 H ATOM 130 HD22 LEU A 206 19.287 2.068 15.254 1.00 0.00 H ATOM 131 HD23 LEU A 206 18.762 0.850 14.065 1.00 0.00 H ATOM 132 HD11 LEU A 206 21.632 1.358 11.758 1.00 0.00 H ATOM 133 HD12 LEU A 206 21.574 0.102 13.019 1.00 0.00 H ATOM 134 HD13 LEU A 206 20.133 0.435 12.027 1.00 0.00 H ATOM 135 H LEU A 206 23.939 3.326 15.182 1.00 0.00 H ATOM 136 N ALA A 207 21.722 5.684 13.674 1.00 71.20 N ATOM 137 CA ALA A 207 20.988 6.905 13.335 1.00 70.22 C ATOM 138 C ALA A 207 21.661 7.726 12.244 1.00 69.74 C ATOM 139 O ALA A 207 20.984 8.350 11.424 1.00 69.74 O ATOM 140 CB ALA A 207 20.806 7.754 14.577 1.00 70.16 C ATOM 141 HA ALA A 207 20.020 6.593 12.942 1.00 0.00 H ATOM 142 HB1 ALA A 207 20.245 7.190 15.322 1.00 0.00 H ATOM 143 HB2 ALA A 207 21.783 8.020 14.980 1.00 0.00 H ATOM 144 HB3 ALA A 207 20.259 8.661 14.319 1.00 0.00 H ATOM 145 H ALA A 207 22.134 5.618 14.627 1.00 0.00 H ATOM 146 N LYS A 208 22.992 7.742 12.255 1.00 69.21 N ATOM 147 CA LYS A 208 23.777 8.409 11.212 1.00 68.55 C ATOM 148 C LYS A 208 23.789 7.568 9.936 1.00 67.94 C ATOM 149 O LYS A 208 23.742 8.110 8.834 1.00 67.96 O ATOM 150 CB LYS A 208 25.210 8.680 11.688 1.00 68.62 C ATOM 151 HA LYS A 208 23.307 9.368 10.996 1.00 0.00 H ATOM 152 HB2 LYS A 208 25.184 9.321 12.569 1.00 0.00 H ATOM 153 HB3 LYS A 208 25.693 7.736 11.939 1.00 0.00 H ATOM 154 H LYS A 208 23.493 7.264 13.031 1.00 0.00 H ATOM 155 N ARG A 209 23.831 6.247 10.100 1.00 67.03 N ATOM 156 CA ARG A 209 23.841 5.303 8.978 1.00 66.25 C ATOM 157 C ARG A 209 22.573 5.426 8.120 1.00 65.12 C ATOM 158 O ARG A 209 22.653 5.417 6.890 1.00 65.18 O ATOM 159 CB ARG A 209 24.010 3.867 9.495 1.00 66.16 C ATOM 160 CG ARG A 209 25.128 3.083 8.824 1.00 66.66 C ATOM 161 CD ARG A 209 25.175 1.631 9.310 1.00 67.47 C ATOM 162 NE ARG A 209 25.689 1.493 10.679 1.00 69.93 N ATOM 163 CZ ARG A 209 25.621 0.376 11.410 1.00 70.51 C ATOM 164 NH1 ARG A 209 25.057 -0.729 10.926 1.00 70.86 N ATOM 165 NH2 ARG A 209 26.118 0.365 12.641 1.00 70.82 N ATOM 166 HA ARG A 209 24.689 5.551 8.340 1.00 0.00 H ATOM 167 HB2 ARG A 209 24.219 3.912 10.564 1.00 0.00 H ATOM 168 HB3 ARG A 209 23.074 3.333 9.331 1.00 0.00 H ATOM 169 HG2 ARG A 209 24.966 3.090 7.746 1.00 0.00 H ATOM 170 HG3 ARG A 209 26.081 3.562 9.050 1.00 0.00 H ATOM 171 HD2 ARG A 209 25.819 1.062 8.639 1.00 0.00 H ATOM 172 HD3 ARG A 209 24.165 1.222 9.276 1.00 0.00 H ATOM 173 HE ARG A 209 26.139 2.325 11.111 1.00 0.00 H ATOM 174 HH12 ARG A 209 25.013 -1.589 11.509 1.00 0.00 H ATOM 175 HH11 ARG A 209 24.660 -0.732 9.965 1.00 0.00 H ATOM 176 HH22 ARG A 209 26.068 -0.501 13.214 1.00 0.00 H ATOM 177 HH21 ARG A 209 26.557 1.223 13.032 1.00 0.00 H ATOM 178 H ARG A 209 23.858 5.868 11.068 1.00 0.00 H ATOM 179 N ILE A 210 21.416 5.553 8.773 1.00 63.82 N ATOM 180 CA ILE A 210 20.133 5.744 8.086 1.00 62.55 C ATOM 181 C ILE A 210 20.040 7.134 7.460 1.00 61.86 C ATOM 182 O ILE A 210 19.560 7.290 6.334 1.00 61.67 O ATOM 183 CB ILE A 210 18.921 5.508 9.036 1.00 62.58 C ATOM 184 CG1 ILE A 210 18.832 4.031 9.436 1.00 62.31 C ATOM 185 CG2 ILE A 210 17.608 5.976 8.388 1.00 62.60 C ATOM 186 CD1 ILE A 210 17.809 3.729 10.512 1.00 62.14 C ATOM 187 HA ILE A 210 20.091 4.998 7.293 1.00 0.00 H ATOM 188 HB ILE A 210 19.078 6.102 9.937 1.00 0.00 H ATOM 189 HG12 ILE A 210 18.573 3.453 8.549 1.00 0.00 H ATOM 190 HG13 ILE A 210 19.811 3.717 9.799 1.00 0.00 H ATOM 191 HD11 ILE A 210 18.058 4.287 11.415 1.00 0.00 H ATOM 192 HD12 ILE A 210 16.819 4.023 10.163 1.00 0.00 H ATOM 193 HD13 ILE A 210 17.817 2.661 10.730 1.00 0.00 H ATOM 194 HG21 ILE A 210 17.674 7.041 8.165 1.00 0.00 H ATOM 195 HG22 ILE A 210 17.441 5.420 7.465 1.00 0.00 H ATOM 196 HG23 ILE A 210 16.781 5.798 9.076 1.00 0.00 H ATOM 197 H ILE A 210 21.424 5.515 9.812 1.00 0.00 H ATOM 198 N TYR A 211 20.504 8.136 8.200 1.00 60.96 N ATOM 199 CA TYR A 211 20.439 9.524 7.757 1.00 60.17 C ATOM 200 C TYR A 211 21.400 9.829 6.595 1.00 59.66 C ATOM 201 O TYR A 211 21.111 10.694 5.756 1.00 59.25 O ATOM 202 CB TYR A 211 20.656 10.459 8.953 1.00 60.16 C ATOM 203 CG TYR A 211 20.737 11.934 8.615 1.00 60.13 C ATOM 204 CD1 TYR A 211 19.738 12.561 7.874 1.00 60.29 C ATOM 205 CD2 TYR A 211 21.812 12.708 9.053 1.00 60.17 C ATOM 206 CE1 TYR A 211 19.812 13.915 7.565 1.00 60.26 C ATOM 207 CE2 TYR A 211 21.895 14.066 8.747 1.00 59.99 C ATOM 208 CZ TYR A 211 20.890 14.659 8.009 1.00 59.96 C ATOM 209 OH TYR A 211 20.960 15.992 7.708 1.00 60.16 O ATOM 210 HA TYR A 211 19.442 9.701 7.353 1.00 0.00 H ATOM 211 HB3 TYR A 211 21.588 10.173 9.440 1.00 0.00 H ATOM 212 HB2 TYR A 211 19.827 10.317 9.647 1.00 0.00 H ATOM 213 HD2 TYR A 211 22.601 12.243 9.645 1.00 0.00 H ATOM 214 HE2 TYR A 211 22.747 14.655 9.088 1.00 0.00 H ATOM 215 HE1 TYR A 211 19.025 14.387 6.976 1.00 0.00 H ATOM 216 HD1 TYR A 211 18.882 11.980 7.530 1.00 0.00 H ATOM 217 HH TYR A 211 20.165 16.252 7.178 1.00 0.00 H ATOM 218 H TYR A 211 20.927 7.923 9.126 1.00 0.00 H ATOM 219 N GLU A 212 22.533 9.117 6.553 1.00 59.12 N ATOM 220 CA GLU A 212 23.480 9.207 5.429 1.00 58.53 C ATOM 221 C GLU A 212 22.830 8.597 4.216 1.00 57.70 C ATOM 222 O GLU A 212 22.820 9.200 3.145 1.00 57.62 O ATOM 223 CB GLU A 212 24.788 8.474 5.723 1.00 58.68 C ATOM 224 CG GLU A 212 25.783 9.249 6.582 1.00 59.74 C ATOM 225 CD GLU A 212 26.670 8.327 7.414 1.00 61.84 C ATOM 226 OE1 GLU A 212 26.941 7.189 6.953 1.00 62.50 O ATOM 227 OE2 GLU A 212 27.087 8.736 8.530 1.00 61.50 O ATOM 228 HA GLU A 212 23.723 10.257 5.263 1.00 0.00 H ATOM 229 HB2 GLU A 212 24.547 7.545 6.240 1.00 0.00 H ATOM 230 HB3 GLU A 212 25.269 8.245 4.772 1.00 0.00 H ATOM 231 HG2 GLU A 212 26.416 9.850 5.930 1.00 0.00 H ATOM 232 HG3 GLU A 212 25.230 9.905 7.255 1.00 0.00 H ATOM 233 H GLU A 212 22.752 8.477 7.343 1.00 0.00 H ATOM 234 N ALA A 213 22.272 7.403 4.407 1.00 56.84 N ATOM 235 CA ALA A 213 21.479 6.737 3.380 1.00 56.17 C ATOM 236 C ALA A 213 20.345 7.640 2.893 1.00 55.75 C ATOM 237 O ALA A 213 20.029 7.655 1.705 1.00 55.65 O ATOM 238 CB ALA A 213 20.937 5.432 3.901 1.00 55.95 C ATOM 239 HA ALA A 213 22.127 6.527 2.529 1.00 0.00 H ATOM 240 HB1 ALA A 213 21.766 4.784 4.187 1.00 0.00 H ATOM 241 HB2 ALA A 213 20.307 5.623 4.770 1.00 0.00 H ATOM 242 HB3 ALA A 213 20.348 4.948 3.122 1.00 0.00 H ATOM 243 H ALA A 213 22.407 6.928 5.322 1.00 0.00 H ATOM 244 N TYR A 214 19.748 8.396 3.814 1.00 55.32 N ATOM 245 CA TYR A 214 18.694 9.340 3.464 1.00 54.97 C ATOM 246 C TYR A 214 19.247 10.484 2.601 1.00 54.90 C ATOM 247 O TYR A 214 18.636 10.851 1.597 1.00 54.66 O ATOM 248 CB TYR A 214 17.977 9.870 4.720 1.00 54.70 C ATOM 249 CG TYR A 214 16.875 10.888 4.446 1.00 54.23 C ATOM 250 CD1 TYR A 214 15.587 10.475 4.103 1.00 53.24 C ATOM 251 CD2 TYR A 214 17.123 12.269 4.532 1.00 53.95 C ATOM 252 CE1 TYR A 214 14.566 11.405 3.840 1.00 53.33 C ATOM 253 CE2 TYR A 214 16.105 13.215 4.276 1.00 53.78 C ATOM 254 CZ TYR A 214 14.828 12.770 3.928 1.00 54.40 C ATOM 255 OH TYR A 214 13.807 13.675 3.667 1.00 54.99 O ATOM 256 HA TYR A 214 17.950 8.809 2.870 1.00 0.00 H ATOM 257 HB3 TYR A 214 18.721 10.340 5.363 1.00 0.00 H ATOM 258 HB2 TYR A 214 17.533 9.022 5.241 1.00 0.00 H ATOM 259 HD2 TYR A 214 18.120 12.617 4.801 1.00 0.00 H ATOM 260 HE2 TYR A 214 16.315 14.282 4.349 1.00 0.00 H ATOM 261 HE1 TYR A 214 13.569 11.058 3.567 1.00 0.00 H ATOM 262 HD1 TYR A 214 15.368 9.409 4.038 1.00 0.00 H ATOM 263 HH TYR A 214 13.649 14.233 4.470 1.00 0.00 H ATOM 264 H TYR A 214 20.042 8.310 4.808 1.00 0.00 H ATOM 265 N LEU A 215 20.402 11.030 2.982 1.00 54.93 N ATOM 266 CA LEU A 215 21.006 12.139 2.230 1.00 55.14 C ATOM 267 C LEU A 215 21.529 11.699 0.869 1.00 55.25 C ATOM 268 O LEU A 215 21.459 12.459 -0.101 1.00 55.25 O ATOM 269 CB LEU A 215 22.129 12.797 3.022 1.00 55.09 C ATOM 270 CG LEU A 215 21.730 13.697 4.183 1.00 55.10 C ATOM 271 CD1 LEU A 215 22.852 13.711 5.210 1.00 55.32 C ATOM 272 CD2 LEU A 215 21.414 15.095 3.696 1.00 54.50 C ATOM 273 HA LEU A 215 20.210 12.866 2.066 1.00 0.00 H ATOM 274 HB2 LEU A 215 22.756 12.001 3.425 1.00 0.00 H ATOM 275 HB3 LEU A 215 22.712 13.400 2.325 1.00 0.00 H ATOM 276 HG LEU A 215 20.826 13.307 4.651 1.00 0.00 H ATOM 277 HD21 LEU A 215 22.294 15.517 3.210 1.00 0.00 H ATOM 278 HD22 LEU A 215 20.590 15.053 2.984 1.00 0.00 H ATOM 279 HD23 LEU A 215 21.132 15.719 4.544 1.00 0.00 H ATOM 280 HD11 LEU A 215 23.023 12.698 5.573 1.00 0.00 H ATOM 281 HD12 LEU A 215 23.762 14.091 4.747 1.00 0.00 H ATOM 282 HD13 LEU A 215 22.571 14.354 6.044 1.00 0.00 H ATOM 283 H LEU A 215 20.885 10.664 3.827 1.00 0.00 H ATOM 284 N LYS A 216 22.047 10.471 0.821 1.00 55.35 N ATOM 285 CA LYS A 216 22.563 9.845 -0.395 1.00 55.67 C ATOM 286 C LYS A 216 21.454 9.528 -1.413 1.00 55.77 C ATOM 287 O LYS A 216 21.463 10.024 -2.541 1.00 55.75 O ATOM 288 CB LYS A 216 23.324 8.566 -0.015 1.00 55.60 C ATOM 289 CG LYS A 216 23.864 7.723 -1.173 1.00 56.13 C ATOM 290 CD LYS A 216 24.712 6.542 -0.633 1.00 55.90 C ATOM 291 CE LYS A 216 25.437 5.806 -1.743 1.00 56.22 C ATOM 292 NZ LYS A 216 24.500 4.952 -2.544 1.00 57.12 N ATOM 293 HA LYS A 216 23.234 10.554 -0.880 1.00 0.00 H ATOM 294 HB2 LYS A 216 24.171 8.857 0.607 1.00 0.00 H ATOM 295 HB3 LYS A 216 22.648 7.938 0.565 1.00 0.00 H ATOM 296 HG2 LYS A 216 23.028 7.330 -1.752 1.00 0.00 H ATOM 297 HG3 LYS A 216 24.486 8.349 -1.814 1.00 0.00 H ATOM 298 HD2 LYS A 216 25.448 6.930 0.071 1.00 0.00 H ATOM 299 HD3 LYS A 216 24.053 5.842 -0.119 1.00 0.00 H ATOM 300 HE2 LYS A 216 26.206 5.171 -1.303 1.00 0.00 H ATOM 301 HE3 LYS A 216 25.904 6.535 -2.405 1.00 0.00 H ATOM 302 HZ1 LYS A 216 24.054 4.249 -1.920 1.00 0.00 H ATOM 303 HZ2 LYS A 216 23.766 5.552 -2.972 1.00 0.00 H ATOM 304 HZ3 LYS A 216 25.032 4.465 -3.293 1.00 0.00 H ATOM 305 H LYS A 216 22.086 9.924 1.705 1.00 0.00 H ATOM 306 N ASN A 217 20.487 8.722 -0.998 1.00 55.85 N ATOM 307 CA ASN A 217 19.529 8.159 -1.926 1.00 56.01 C ATOM 308 C ASN A 217 18.305 9.018 -2.218 1.00 56.20 C ATOM 309 O ASN A 217 17.383 8.552 -2.878 1.00 56.21 O ATOM 310 CB ASN A 217 19.116 6.771 -1.451 1.00 56.00 C ATOM 311 CG ASN A 217 20.208 5.743 -1.655 1.00 56.05 C ATOM 312 OD1 ASN A 217 20.442 5.293 -2.777 1.00 57.22 O ATOM 313 ND2 ASN A 217 20.882 5.365 -0.574 1.00 54.32 N ATOM 314 HA ASN A 217 20.048 8.106 -2.883 1.00 0.00 H ATOM 315 HB2 ASN A 217 18.876 6.821 -0.389 1.00 0.00 H ATOM 316 HB3 ASN A 217 18.232 6.459 -2.008 1.00 0.00 H ATOM 317 HD22 ASN A 217 20.648 5.773 0.354 1.00 0.00 H ATOM 318 HD21 ASN A 217 21.643 4.661 -0.656 1.00 0.00 H ATOM 319 H ASN A 217 20.415 8.490 0.013 1.00 0.00 H ATOM 320 N PHE A 218 18.293 10.264 -1.745 1.00 56.61 N ATOM 321 CA PHE A 218 17.160 11.162 -1.989 1.00 56.99 C ATOM 322 C PHE A 218 17.609 12.512 -2.490 1.00 57.74 C ATOM 323 O PHE A 218 18.108 13.325 -1.721 1.00 57.88 O ATOM 324 CB PHE A 218 16.297 11.357 -0.731 1.00 56.76 C ATOM 325 CG PHE A 218 15.443 10.170 -0.380 1.00 55.78 C ATOM 326 CD1 PHE A 218 15.732 9.404 0.744 1.00 55.09 C ATOM 327 CD2 PHE A 218 14.352 9.815 -1.175 1.00 55.01 C ATOM 328 CE1 PHE A 218 14.948 8.294 1.074 1.00 55.85 C ATOM 329 CE2 PHE A 218 13.567 8.706 -0.859 1.00 54.66 C ATOM 330 CZ PHE A 218 13.863 7.945 0.268 1.00 55.45 C ATOM 331 HA PHE A 218 16.559 10.679 -2.759 1.00 0.00 H ATOM 332 HB2 PHE A 218 16.959 11.563 0.110 1.00 0.00 H ATOM 333 HB3 PHE A 218 15.643 12.213 -0.894 1.00 0.00 H ATOM 334 HD2 PHE A 218 14.110 10.412 -2.054 1.00 0.00 H ATOM 335 HE2 PHE A 218 12.723 8.436 -1.494 1.00 0.00 H ATOM 336 HZ PHE A 218 13.250 7.080 0.520 1.00 0.00 H ATOM 337 HE1 PHE A 218 15.184 7.703 1.959 1.00 0.00 H ATOM 338 HD1 PHE A 218 16.579 9.672 1.375 1.00 0.00 H ATOM 339 H PHE A 218 19.104 10.606 -1.191 1.00 0.00 H ATOM 340 N ASN A 219 17.408 12.752 -3.780 1.00 58.83 N ATOM 341 CA ASN A 219 17.742 14.029 -4.398 1.00 59.95 C ATOM 342 C ASN A 219 17.004 15.214 -3.772 1.00 60.54 C ATOM 343 O ASN A 219 17.519 16.334 -3.759 1.00 60.72 O ATOM 344 CB ASN A 219 17.478 13.975 -5.907 1.00 60.03 C ATOM 345 CG ASN A 219 17.845 15.273 -6.615 1.00 60.84 C ATOM 346 OD1 ASN A 219 16.980 15.952 -7.179 1.00 61.54 O ATOM 347 ND2 ASN A 219 19.129 15.637 -6.569 1.00 61.16 N ATOM 348 HA ASN A 219 18.804 14.193 -4.216 1.00 0.00 H ATOM 349 HB2 ASN A 219 18.068 13.165 -6.336 1.00 0.00 H ATOM 350 HB3 ASN A 219 16.419 13.777 -6.069 1.00 0.00 H ATOM 351 HD22 ASN A 219 19.823 15.034 -6.083 1.00 0.00 H ATOM 352 HD21 ASN A 219 19.435 16.523 -7.019 1.00 0.00 H ATOM 353 H ASN A 219 16.997 12.001 -4.371 1.00 0.00 H ATOM 354 N MET A 220 15.808 14.962 -3.247 1.00 61.36 N ATOM 355 CA MET A 220 14.995 16.017 -2.635 1.00 62.24 C ATOM 356 C MET A 220 14.821 15.840 -1.113 1.00 62.59 C ATOM 357 O MET A 220 14.294 14.813 -0.652 1.00 62.74 O ATOM 358 CB MET A 220 13.635 16.104 -3.340 1.00 62.33 C ATOM 359 CG MET A 220 12.902 17.416 -3.131 1.00 63.46 C ATOM 360 SD MET A 220 13.961 18.886 -3.123 1.00 66.43 S ATOM 361 CE MET A 220 14.493 18.960 -4.829 1.00 66.15 C ATOM 362 HA MET A 220 15.532 16.956 -2.768 1.00 0.00 H ATOM 363 HB2 MET A 220 13.796 15.970 -4.410 1.00 0.00 H ATOM 364 HB3 MET A 220 13.004 15.298 -2.965 1.00 0.00 H ATOM 365 HG2 MET A 220 12.384 17.366 -2.173 1.00 0.00 H ATOM 366 HG3 MET A 220 12.172 17.528 -3.933 1.00 0.00 H ATOM 367 HE1 MET A 220 15.029 18.045 -5.081 1.00 0.00 H ATOM 368 HE2 MET A 220 13.622 19.062 -5.476 1.00 0.00 H ATOM 369 HE3 MET A 220 15.151 19.818 -4.966 1.00 0.00 H ATOM 370 H MET A 220 15.440 13.990 -3.271 1.00 0.00 H ATOM 371 N ASN A 221 15.265 16.844 -0.347 1.00 62.68 N ATOM 372 CA ASN A 221 15.176 16.835 1.126 1.00 62.67 C ATOM 373 C ASN A 221 14.664 18.153 1.730 1.00 62.81 C ATOM 374 O ASN A 221 14.804 19.215 1.117 1.00 62.74 O ATOM 375 CB ASN A 221 16.531 16.470 1.727 1.00 62.60 C ATOM 376 CG ASN A 221 17.644 17.357 1.221 1.00 62.52 C ATOM 377 OD1 ASN A 221 17.772 18.508 1.637 1.00 62.12 O ATOM 378 ND2 ASN A 221 18.456 16.828 0.312 1.00 62.87 N ATOM 379 HA ASN A 221 14.432 16.080 1.382 1.00 0.00 H ATOM 380 HB2 ASN A 221 16.471 16.567 2.811 1.00 0.00 H ATOM 381 HB3 ASN A 221 16.762 15.437 1.469 1.00 0.00 H ATOM 382 HD22 ASN A 221 18.309 15.850 -0.010 1.00 0.00 H ATOM 383 HD21 ASN A 221 19.238 17.392 -0.077 1.00 0.00 H ATOM 384 H ASN A 221 15.693 17.670 -0.812 1.00 0.00 H ATOM 385 N LYS A 222 14.094 18.077 2.937 1.00 62.97 N ATOM 386 CA LYS A 222 13.498 19.240 3.616 1.00 63.25 C ATOM 387 C LYS A 222 14.426 20.453 3.703 1.00 63.81 C ATOM 388 O LYS A 222 14.022 21.561 3.378 1.00 63.74 O ATOM 389 CB LYS A 222 12.994 18.861 5.013 1.00 62.93 C ATOM 390 CG LYS A 222 12.079 19.901 5.669 1.00 62.23 C ATOM 391 CD LYS A 222 11.177 19.243 6.706 1.00 61.38 C ATOM 392 CE LYS A 222 10.123 20.183 7.295 1.00 60.29 C ATOM 393 NZ LYS A 222 8.973 19.410 7.877 1.00 59.06 N ATOM 394 HA LYS A 222 12.657 19.541 2.991 1.00 0.00 H ATOM 395 HB2 LYS A 222 12.441 17.925 4.932 1.00 0.00 H ATOM 396 HB3 LYS A 222 13.860 18.715 5.659 1.00 0.00 H ATOM 397 HG2 LYS A 222 12.691 20.660 6.156 1.00 0.00 H ATOM 398 HG3 LYS A 222 11.462 20.370 4.903 1.00 0.00 H ATOM 399 HD2 LYS A 222 10.665 18.405 6.234 1.00 0.00 H ATOM 400 HD3 LYS A 222 11.801 18.874 7.520 1.00 0.00 H ATOM 401 HE2 LYS A 222 9.750 20.838 6.508 1.00 0.00 H ATOM 402 HE3 LYS A 222 10.581 20.785 8.080 1.00 0.00 H ATOM 403 HZ1 LYS A 222 8.529 18.837 7.131 1.00 0.00 H ATOM 404 HZ2 LYS A 222 9.323 18.787 8.632 1.00 0.00 H ATOM 405 HZ3 LYS A 222 8.274 20.073 8.269 1.00 0.00 H ATOM 406 H LYS A 222 14.070 17.155 3.418 1.00 0.00 H ATOM 407 N VAL A 223 15.664 20.242 4.135 1.00 64.76 N ATOM 408 CA VAL A 223 16.616 21.345 4.244 1.00 65.84 C ATOM 409 C VAL A 223 16.865 22.025 2.881 1.00 66.59 C ATOM 410 O VAL A 223 16.840 23.256 2.785 1.00 66.43 O ATOM 411 CB VAL A 223 17.928 20.937 5.007 1.00 65.77 C ATOM 412 CG1 VAL A 223 18.824 19.996 4.187 1.00 65.74 C ATOM 413 CG2 VAL A 223 18.692 22.171 5.453 1.00 65.79 C ATOM 414 HA VAL A 223 16.158 22.109 4.872 1.00 0.00 H ATOM 415 HB VAL A 223 17.622 20.377 5.890 1.00 0.00 H ATOM 416 HG11 VAL A 223 18.275 19.083 3.956 1.00 0.00 H ATOM 417 HG12 VAL A 223 19.116 20.490 3.261 1.00 0.00 H ATOM 418 HG13 VAL A 223 19.714 19.749 4.765 1.00 0.00 H ATOM 419 HG21 VAL A 223 18.961 22.766 4.580 1.00 0.00 H ATOM 420 HG22 VAL A 223 18.065 22.764 6.119 1.00 0.00 H ATOM 421 HG23 VAL A 223 19.597 21.866 5.979 1.00 0.00 H ATOM 422 H VAL A 223 15.959 19.280 4.399 1.00 0.00 H ATOM 423 N LYS A 224 17.051 21.222 1.832 1.00 67.55 N ATOM 424 CA LYS A 224 17.197 21.749 0.469 1.00 68.42 C ATOM 425 C LYS A 224 15.917 22.420 -0.007 1.00 69.20 C ATOM 426 O LYS A 224 15.965 23.485 -0.619 1.00 69.38 O ATOM 427 CB LYS A 224 17.601 20.640 -0.510 1.00 68.45 C ATOM 428 CG LYS A 224 17.933 21.109 -1.926 1.00 68.09 C ATOM 429 CD LYS A 224 18.193 19.926 -2.852 1.00 68.02 C ATOM 430 CE LYS A 224 18.229 20.361 -4.318 1.00 67.35 C ATOM 431 NZ LYS A 224 18.301 19.200 -5.256 1.00 66.56 N ATOM 432 HA LYS A 224 17.988 22.498 0.496 1.00 0.00 H ATOM 433 HB2 LYS A 224 18.480 20.138 -0.106 1.00 0.00 H ATOM 434 HB3 LYS A 224 16.776 19.930 -0.575 1.00 0.00 H ATOM 435 HG2 LYS A 224 17.095 21.688 -2.315 1.00 0.00 H ATOM 436 HG3 LYS A 224 18.823 21.738 -1.893 1.00 0.00 H ATOM 437 HD2 LYS A 224 19.151 19.476 -2.592 1.00 0.00 H ATOM 438 HD3 LYS A 224 17.399 19.191 -2.720 1.00 0.00 H ATOM 439 HE2 LYS A 224 19.104 20.992 -4.475 1.00 0.00 H ATOM 440 HE3 LYS A 224 17.326 20.932 -4.536 1.00 0.00 H ATOM 441 HZ1 LYS A 224 19.163 18.652 -5.062 1.00 0.00 H ATOM 442 HZ2 LYS A 224 17.466 18.594 -5.121 1.00 0.00 H ATOM 443 HZ3 LYS A 224 18.323 19.548 -6.236 1.00 0.00 H ATOM 444 H LYS A 224 17.094 20.194 1.984 1.00 0.00 H ATOM 445 N ALA A 225 14.779 21.791 0.277 1.00 70.32 N ATOM 446 CA ALA A 225 13.484 22.290 -0.174 1.00 71.47 C ATOM 447 C ALA A 225 13.067 23.577 0.536 1.00 72.49 C ATOM 448 O ALA A 225 12.402 24.431 -0.063 1.00 72.87 O ATOM 449 CB ALA A 225 12.422 21.224 -0.017 1.00 71.28 C ATOM 450 HA ALA A 225 13.589 22.536 -1.231 1.00 0.00 H ATOM 451 HB1 ALA A 225 12.693 20.352 -0.612 1.00 0.00 H ATOM 452 HB2 ALA A 225 12.347 20.940 1.033 1.00 0.00 H ATOM 453 HB3 ALA A 225 11.463 21.615 -0.358 1.00 0.00 H ATOM 454 H ALA A 225 14.814 20.916 0.838 1.00 0.00 H ATOM 455 N ARG A 226 13.454 23.712 1.805 1.00 73.59 N ATOM 456 CA ARG A 226 13.142 24.916 2.582 1.00 74.66 C ATOM 457 C ARG A 226 14.017 26.106 2.174 1.00 75.63 C ATOM 458 O ARG A 226 13.581 27.252 2.259 1.00 75.81 O ATOM 459 CB ARG A 226 13.218 24.658 4.103 1.00 74.43 C ATOM 460 CG ARG A 226 11.995 23.939 4.707 1.00 73.74 C ATOM 461 CD ARG A 226 10.714 24.786 4.629 1.00 72.29 C ATOM 462 NE ARG A 226 9.576 24.171 5.316 1.00 71.08 N ATOM 463 CZ ARG A 226 8.697 23.336 4.754 1.00 70.42 C ATOM 464 NH1 ARG A 226 8.802 22.987 3.479 1.00 69.21 N ATOM 465 NH2 ARG A 226 7.702 22.840 5.477 1.00 69.25 N ATOM 466 HA ARG A 226 12.110 25.178 2.348 1.00 0.00 H ATOM 467 HB2 ARG A 226 14.099 24.047 4.298 1.00 0.00 H ATOM 468 HB3 ARG A 226 13.326 25.620 4.604 1.00 0.00 H ATOM 469 HG2 ARG A 226 11.833 23.009 4.163 1.00 0.00 H ATOM 470 HG3 ARG A 226 12.203 23.715 5.753 1.00 0.00 H ATOM 471 HD2 ARG A 226 10.453 24.925 3.580 1.00 0.00 H ATOM 472 HD3 ARG A 226 10.911 25.757 5.084 1.00 0.00 H ATOM 473 HE ARG A 226 9.441 24.403 6.321 1.00 0.00 H ATOM 474 HH12 ARG A 226 8.108 22.336 3.059 1.00 0.00 H ATOM 475 HH11 ARG A 226 9.578 23.364 2.899 1.00 0.00 H ATOM 476 HH22 ARG A 226 7.017 22.190 5.042 1.00 0.00 H ATOM 477 HH21 ARG A 226 7.607 23.101 6.479 1.00 0.00 H ATOM 478 H ARG A 226 13.991 22.944 2.255 1.00 0.00 H ATOM 479 N VAL A 227 15.241 25.829 1.725 1.00 76.82 N ATOM 480 CA VAL A 227 16.141 26.880 1.222 1.00 77.92 C ATOM 481 C VAL A 227 15.671 27.436 -0.136 1.00 78.61 C ATOM 482 O VAL A 227 15.710 28.652 -0.367 1.00 78.78 O ATOM 483 CB VAL A 227 17.618 26.396 1.152 1.00 77.90 C ATOM 484 CG1 VAL A 227 18.500 27.416 0.427 1.00 78.07 C ATOM 485 CG2 VAL A 227 18.162 26.120 2.562 1.00 78.03 C ATOM 486 HA VAL A 227 16.100 27.698 1.942 1.00 0.00 H ATOM 487 HB VAL A 227 17.640 25.467 0.582 1.00 0.00 H ATOM 488 HG11 VAL A 227 18.131 27.557 -0.589 1.00 0.00 H ATOM 489 HG12 VAL A 227 18.469 28.366 0.961 1.00 0.00 H ATOM 490 HG13 VAL A 227 19.526 27.049 0.394 1.00 0.00 H ATOM 491 HG21 VAL A 227 18.116 27.035 3.153 1.00 0.00 H ATOM 492 HG22 VAL A 227 17.558 25.348 3.038 1.00 0.00 H ATOM 493 HG23 VAL A 227 19.196 25.783 2.491 1.00 0.00 H ATOM 494 H VAL A 227 15.570 24.842 1.730 1.00 0.00 H ATOM 495 N ILE A 228 15.217 26.541 -1.012 1.00 79.34 N ATOM 496 CA ILE A 228 14.687 26.920 -2.323 1.00 80.16 C ATOM 497 C ILE A 228 13.516 27.901 -2.205 1.00 80.86 C ATOM 498 O ILE A 228 13.559 28.996 -2.770 1.00 81.15 O ATOM 499 CB ILE A 228 14.301 25.659 -3.156 1.00 80.17 C ATOM 500 CG1 ILE A 228 15.570 24.993 -3.706 1.00 80.00 C ATOM 501 CG2 ILE A 228 13.321 26.003 -4.285 1.00 79.81 C ATOM 502 CD1 ILE A 228 15.433 23.517 -4.006 1.00 79.59 C ATOM 503 HA ILE A 228 15.480 27.441 -2.858 1.00 0.00 H ATOM 504 HB ILE A 228 13.790 24.956 -2.498 1.00 0.00 H ATOM 505 HG12 ILE A 228 15.848 25.502 -4.629 1.00 0.00 H ATOM 506 HG13 ILE A 228 16.365 25.117 -2.970 1.00 0.00 H ATOM 507 HD11 ILE A 228 15.169 22.985 -3.092 1.00 0.00 H ATOM 508 HD12 ILE A 228 14.652 23.370 -4.752 1.00 0.00 H ATOM 509 HD13 ILE A 228 16.380 23.136 -4.389 1.00 0.00 H ATOM 510 HG21 ILE A 228 12.411 26.425 -3.858 1.00 0.00 H ATOM 511 HG22 ILE A 228 13.781 26.730 -4.955 1.00 0.00 H ATOM 512 HG23 ILE A 228 13.077 25.098 -4.841 1.00 0.00 H ATOM 513 H ILE A 228 15.240 25.534 -0.755 1.00 0.00 H ATOM 514 N LEU A 229 12.491 27.519 -1.448 1.00 81.78 N ATOM 515 CA LEU A 229 11.269 28.320 -1.346 1.00 82.62 C ATOM 516 C LEU A 229 11.358 29.549 -0.437 1.00 83.20 C ATOM 517 O LEU A 229 10.355 30.249 -0.246 1.00 83.21 O ATOM 518 CB LEU A 229 10.075 27.446 -0.942 1.00 82.48 C ATOM 519 CG LEU A 229 9.122 27.092 -2.087 1.00 82.65 C ATOM 520 CD1 LEU A 229 8.098 26.061 -1.627 1.00 81.84 C ATOM 521 CD2 LEU A 229 8.434 28.347 -2.681 1.00 82.85 C ATOM 522 HA LEU A 229 11.124 28.720 -2.349 1.00 0.00 H ATOM 523 HB2 LEU A 229 10.461 26.517 -0.522 1.00 0.00 H ATOM 524 HB3 LEU A 229 9.507 27.979 -0.180 1.00 0.00 H ATOM 525 HG LEU A 229 9.716 26.653 -2.889 1.00 0.00 H ATOM 526 HD21 LEU A 229 7.859 28.848 -1.902 1.00 0.00 H ATOM 527 HD22 LEU A 229 9.193 29.027 -3.068 1.00 0.00 H ATOM 528 HD23 LEU A 229 7.768 28.046 -3.490 1.00 0.00 H ATOM 529 HD11 LEU A 229 8.614 25.158 -1.302 1.00 0.00 H ATOM 530 HD12 LEU A 229 7.521 26.469 -0.797 1.00 0.00 H ATOM 531 HD13 LEU A 229 7.429 25.821 -2.454 1.00 0.00 H ATOM 532 H LEU A 229 12.559 26.629 -0.915 1.00 0.00 H ATOM 533 N SER A 230 12.551 29.811 0.102 1.00 83.87 N ATOM 534 CA SER A 230 12.778 30.958 0.984 1.00 84.62 C ATOM 535 C SER A 230 12.465 32.301 0.307 1.00 85.29 C ATOM 536 O SER A 230 11.513 32.994 0.685 1.00 85.52 O ATOM 537 CB SER A 230 14.228 30.987 1.500 1.00 84.55 C ATOM 538 OG SER A 230 14.618 29.765 2.092 1.00 84.24 O ATOM 539 HA SER A 230 12.090 30.828 1.819 1.00 0.00 H ATOM 540 HB2 SER A 230 14.319 31.780 2.243 1.00 0.00 H ATOM 541 HB3 SER A 230 14.893 31.197 0.662 1.00 0.00 H ATOM 542 HG SER A 230 14.547 29.038 1.423 1.00 0.00 H ATOM 543 H SER A 230 13.348 29.178 -0.112 1.00 0.00 H ATOM 544 N GLY A 231 13.255 32.638 -0.712 1.00 85.82 N ATOM 545 CA GLY A 231 13.429 34.024 -1.148 1.00 86.36 C ATOM 546 C GLY A 231 14.888 34.360 -0.892 1.00 86.65 C ATOM 547 O GLY A 231 15.394 35.407 -1.317 1.00 86.67 O ATOM 548 HA3 GLY A 231 12.781 34.687 -0.575 1.00 0.00 H ATOM 549 HA2 GLY A 231 13.198 34.120 -2.209 1.00 0.00 H ATOM 550 H GLY A 231 13.768 31.887 -1.217 1.00 0.00 H ATOM 551 N LYS A 232 15.541 33.454 -0.155 1.00 86.99 N ATOM 552 CA LYS A 232 16.999 33.327 -0.100 1.00 87.16 C ATOM 553 C LYS A 232 17.394 32.276 -1.150 1.00 87.18 C ATOM 554 O LYS A 232 18.285 31.450 -0.920 1.00 87.25 O ATOM 555 CB LYS A 232 17.460 32.894 1.303 1.00 87.09 C ATOM 556 CG LYS A 232 16.886 33.716 2.457 1.00 86.97 C ATOM 557 HA LYS A 232 17.477 34.284 -0.308 1.00 0.00 H ATOM 558 HB2 LYS A 232 17.166 31.855 1.449 1.00 0.00 H ATOM 559 HB3 LYS A 232 18.547 32.972 1.341 1.00 0.00 H ATOM 560 HG2 LYS A 232 17.180 34.759 2.340 1.00 0.00 H ATOM 561 HG3 LYS A 232 15.799 33.641 2.449 1.00 0.00 H ATOM 562 H LYS A 232 14.975 32.796 0.417 1.00 0.00 H ATOM 563 N ALA A 233 16.722 32.350 -2.307 1.00 87.38 N ATOM 564 CA ALA A 233 16.711 31.323 -3.370 1.00 87.38 C ATOM 565 C ALA A 233 18.073 30.752 -3.760 1.00 87.47 C ATOM 566 O ALA A 233 18.155 29.609 -4.228 1.00 87.51 O ATOM 567 CB ALA A 233 15.982 31.850 -4.611 1.00 87.14 C ATOM 568 HA ALA A 233 16.175 30.481 -2.932 1.00 0.00 H ATOM 569 HB1 ALA A 233 14.955 32.102 -4.348 1.00 0.00 H ATOM 570 HB2 ALA A 233 16.492 32.740 -4.980 1.00 0.00 H ATOM 571 HB3 ALA A 233 15.983 31.082 -5.385 1.00 0.00 H ATOM 572 H ALA A 233 16.157 33.208 -2.472 1.00 0.00 H ATOM 573 N SER A 234 19.121 31.558 -3.551 1.00 87.54 N ATOM 574 CA SER A 234 20.518 31.233 -3.896 1.00 87.38 C ATOM 575 C SER A 234 20.681 30.883 -5.381 1.00 87.38 C ATOM 576 O SER A 234 20.822 29.699 -5.749 1.00 87.34 O ATOM 577 CB SER A 234 21.113 30.162 -2.955 1.00 87.33 C ATOM 578 OG SER A 234 20.570 28.874 -3.177 1.00 87.14 O ATOM 579 HA SER A 234 21.105 32.137 -3.735 1.00 0.00 H ATOM 580 HB2 SER A 234 20.911 30.453 -1.924 1.00 0.00 H ATOM 581 HB3 SER A 234 22.190 30.118 -3.114 1.00 0.00 H ATOM 582 HG SER A 234 20.755 28.595 -4.109 1.00 0.00 H ATOM 583 H SER A 234 18.937 32.483 -3.112 1.00 0.00 H ATOM 584 N ASN A 235 20.664 31.937 -6.213 1.00 87.15 N ATOM 585 CA ASN A 235 20.617 31.836 -7.681 1.00 86.93 C ATOM 586 C ASN A 235 19.233 32.281 -8.194 1.00 86.63 C ATOM 587 O ASN A 235 18.756 33.366 -7.841 1.00 86.42 O ATOM 588 CB ASN A 235 20.988 30.410 -8.142 1.00 87.08 C ATOM 589 CG ASN A 235 20.869 30.210 -9.647 1.00 87.47 C ATOM 590 OD1 ASN A 235 21.144 31.113 -10.442 1.00 88.03 O ATOM 591 ND2 ASN A 235 20.457 29.008 -10.042 1.00 87.72 N ATOM 592 HA ASN A 235 21.358 32.507 -8.115 1.00 0.00 H ATOM 593 HB2 ASN A 235 22.018 30.208 -7.847 1.00 0.00 H ATOM 594 HB3 ASN A 235 20.324 29.702 -7.646 1.00 0.00 H ATOM 595 HD22 ASN A 235 20.236 28.276 -9.337 1.00 0.00 H ATOM 596 HD21 ASN A 235 20.356 28.800 -11.056 1.00 0.00 H ATOM 597 H ASN A 235 20.685 32.888 -5.792 1.00 0.00 H ATOM 598 N ASN A 236 18.605 31.455 -9.030 1.00 86.31 N ATOM 599 CA ASN A 236 17.228 31.669 -9.452 1.00 86.07 C ATOM 600 C ASN A 236 16.264 30.953 -8.524 1.00 85.72 C ATOM 601 O ASN A 236 16.565 29.860 -8.041 1.00 85.76 O ATOM 602 CB ASN A 236 17.001 31.176 -10.882 1.00 86.07 C ATOM 603 CG ASN A 236 17.361 32.216 -11.930 1.00 86.52 C ATOM 604 OD1 ASN A 236 17.954 33.255 -11.625 1.00 86.68 O ATOM 605 ND2 ASN A 236 17.000 31.937 -13.180 1.00 86.75 N ATOM 606 HA ASN A 236 17.043 32.743 -9.414 1.00 0.00 H ATOM 607 HB2 ASN A 236 17.614 30.290 -11.046 1.00 0.00 H ATOM 608 HB3 ASN A 236 15.949 30.915 -10.997 1.00 0.00 H ATOM 609 HD22 ASN A 236 16.502 31.049 -13.391 1.00 0.00 H ATOM 610 HD21 ASN A 236 17.216 32.607 -13.946 1.00 0.00 H ATOM 611 H ASN A 236 19.117 30.627 -9.395 1.00 0.00 H ATOM 612 N PRO A 237 15.108 31.582 -8.255 1.00 85.35 N ATOM 613 CA PRO A 237 13.974 30.922 -7.611 1.00 85.00 C ATOM 614 C PRO A 237 13.270 29.910 -8.546 1.00 84.50 C ATOM 615 O PRO A 237 13.592 29.856 -9.736 1.00 84.35 O ATOM 616 CB PRO A 237 13.045 32.095 -7.266 1.00 85.11 C ATOM 617 CG PRO A 237 13.385 33.152 -8.241 1.00 85.36 C ATOM 618 CD PRO A 237 14.844 33.010 -8.524 1.00 85.32 C ATOM 619 HA PRO A 237 14.274 30.330 -6.746 1.00 0.00 H ATOM 620 HD3 PRO A 237 15.066 33.259 -9.562 1.00 0.00 H ATOM 621 HD2 PRO A 237 15.433 33.647 -7.864 1.00 0.00 H ATOM 622 HG3 PRO A 237 13.176 34.135 -7.820 1.00 0.00 H ATOM 623 HG2 PRO A 237 12.808 33.021 -9.157 1.00 0.00 H ATOM 624 HB2 PRO A 237 12.001 31.800 -7.369 1.00 0.00 H ATOM 625 HB3 PRO A 237 13.225 32.440 -6.248 1.00 0.00 H ATOM 626 N PRO A 238 12.344 29.085 -8.002 1.00 84.10 N ATOM 627 CA PRO A 238 11.454 28.223 -8.796 1.00 83.77 C ATOM 628 C PRO A 238 10.649 28.955 -9.872 1.00 83.41 C ATOM 629 O PRO A 238 10.729 30.172 -9.991 1.00 83.38 O ATOM 630 CB PRO A 238 10.489 27.665 -7.746 1.00 83.66 C ATOM 631 CG PRO A 238 11.263 27.663 -6.502 1.00 83.85 C ATOM 632 CD PRO A 238 12.133 28.879 -6.555 1.00 84.00 C ATOM 633 HA PRO A 238 12.036 27.484 -9.347 1.00 0.00 H ATOM 634 HD3 PRO A 238 11.632 29.737 -6.107 1.00 0.00 H ATOM 635 HD2 PRO A 238 13.079 28.705 -6.043 1.00 0.00 H ATOM 636 HG3 PRO A 238 11.874 26.763 -6.437 1.00 0.00 H ATOM 637 HG2 PRO A 238 10.596 27.711 -5.641 1.00 0.00 H ATOM 638 HB2 PRO A 238 9.610 28.303 -7.652 1.00 0.00 H ATOM 639 HB3 PRO A 238 10.177 26.654 -8.008 1.00 0.00 H ATOM 640 N PHE A 239 9.880 28.197 -10.646 1.00 83.13 N ATOM 641 CA PHE A 239 8.954 28.759 -11.617 1.00 83.00 C ATOM 642 C PHE A 239 7.536 28.374 -11.222 1.00 82.87 C ATOM 643 O PHE A 239 7.219 27.193 -11.115 1.00 83.00 O ATOM 644 CB PHE A 239 9.283 28.255 -13.028 1.00 83.10 C ATOM 645 CG PHE A 239 8.250 28.615 -14.064 1.00 83.23 C ATOM 646 CD1 PHE A 239 8.258 29.872 -14.673 1.00 83.32 C ATOM 647 CD2 PHE A 239 7.274 27.690 -14.444 1.00 83.45 C ATOM 648 CE1 PHE A 239 7.302 30.213 -15.635 1.00 83.32 C ATOM 649 CE2 PHE A 239 6.313 28.016 -15.406 1.00 83.73 C ATOM 650 CZ PHE A 239 6.328 29.284 -16.004 1.00 83.65 C ATOM 651 HA PHE A 239 9.045 29.845 -11.625 1.00 0.00 H ATOM 652 HB2 PHE A 239 10.238 28.685 -13.332 1.00 0.00 H ATOM 653 HB3 PHE A 239 9.370 27.169 -12.993 1.00 0.00 H ATOM 654 HD2 PHE A 239 7.262 26.702 -13.985 1.00 0.00 H ATOM 655 HE2 PHE A 239 5.555 27.287 -15.690 1.00 0.00 H ATOM 656 HZ PHE A 239 5.581 29.543 -16.755 1.00 0.00 H ATOM 657 HE1 PHE A 239 7.317 31.201 -16.095 1.00 0.00 H ATOM 658 HD1 PHE A 239 9.021 30.598 -14.394 1.00 0.00 H ATOM 659 H PHE A 239 9.942 27.163 -10.554 1.00 0.00 H ATOM 660 N VAL A 240 6.690 29.378 -11.020 1.00 82.74 N ATOM 661 CA VAL A 240 5.325 29.179 -10.531 1.00 82.50 C ATOM 662 C VAL A 240 4.341 28.799 -11.633 1.00 82.54 C ATOM 663 O VAL A 240 4.307 29.419 -12.692 1.00 82.52 O ATOM 664 CB VAL A 240 4.806 30.439 -9.778 1.00 82.54 C ATOM 665 CG1 VAL A 240 3.300 30.346 -9.489 1.00 82.04 C ATOM 666 CG2 VAL A 240 5.604 30.664 -8.489 1.00 82.03 C ATOM 667 HA VAL A 240 5.380 28.338 -9.839 1.00 0.00 H ATOM 668 HB VAL A 240 4.956 31.301 -10.428 1.00 0.00 H ATOM 669 HG11 VAL A 240 2.756 30.258 -10.429 1.00 0.00 H ATOM 670 HG12 VAL A 240 3.103 29.470 -8.871 1.00 0.00 H ATOM 671 HG13 VAL A 240 2.976 31.244 -8.963 1.00 0.00 H ATOM 672 HG21 VAL A 240 5.496 29.795 -7.840 1.00 0.00 H ATOM 673 HG22 VAL A 240 6.656 30.807 -8.735 1.00 0.00 H ATOM 674 HG23 VAL A 240 5.225 31.549 -7.978 1.00 0.00 H ATOM 675 H VAL A 240 7.011 30.347 -11.218 1.00 0.00 H ATOM 676 N ILE A 241 3.554 27.763 -11.359 1.00 82.75 N ATOM 677 CA ILE A 241 2.376 27.416 -12.145 1.00 83.03 C ATOM 678 C ILE A 241 1.155 27.845 -11.349 1.00 83.41 C ATOM 679 O ILE A 241 0.994 27.431 -10.206 1.00 83.46 O ATOM 680 CB ILE A 241 2.280 25.887 -12.381 1.00 82.96 C ATOM 681 CG1 ILE A 241 3.493 25.382 -13.164 1.00 82.95 C ATOM 682 CG2 ILE A 241 0.967 25.511 -13.082 1.00 82.58 C ATOM 683 CD1 ILE A 241 3.660 23.880 -13.123 1.00 82.72 C ATOM 684 HA ILE A 241 2.437 27.912 -13.114 1.00 0.00 H ATOM 685 HB ILE A 241 2.280 25.397 -11.408 1.00 0.00 H ATOM 686 HG12 ILE A 241 3.383 25.688 -14.204 1.00 0.00 H ATOM 687 HG13 ILE A 241 4.389 25.840 -12.744 1.00 0.00 H ATOM 688 HD11 ILE A 241 3.783 23.557 -12.089 1.00 0.00 H ATOM 689 HD12 ILE A 241 2.777 23.406 -13.550 1.00 0.00 H ATOM 690 HD13 ILE A 241 4.541 23.598 -13.700 1.00 0.00 H ATOM 691 HG21 ILE A 241 0.125 25.820 -12.463 1.00 0.00 H ATOM 692 HG22 ILE A 241 0.915 26.015 -14.047 1.00 0.00 H ATOM 693 HG23 ILE A 241 0.933 24.432 -13.232 1.00 0.00 H ATOM 694 H ILE A 241 3.791 27.168 -10.540 1.00 0.00 H ATOM 695 N HIS A 242 0.308 28.684 -11.939 1.00 84.04 N ATOM 696 CA HIS A 242 -0.968 29.056 -11.314 1.00 84.59 C ATOM 697 C HIS A 242 -2.168 28.738 -12.208 1.00 84.91 C ATOM 698 O HIS A 242 -3.299 28.642 -11.718 1.00 84.71 O ATOM 699 CB HIS A 242 -0.978 30.526 -10.873 1.00 84.62 C ATOM 700 CG HIS A 242 -0.572 31.483 -11.948 1.00 85.21 C ATOM 701 ND1 HIS A 242 -1.430 31.885 -12.950 1.00 85.34 N ATOM 702 CD2 HIS A 242 0.602 32.117 -12.180 1.00 85.58 C ATOM 703 CE1 HIS A 242 -0.801 32.724 -13.753 1.00 85.70 C ATOM 704 NE2 HIS A 242 0.433 32.882 -13.308 1.00 85.82 N ATOM 705 HA HIS A 242 -1.064 28.441 -10.419 1.00 0.00 H ATOM 706 HB2 HIS A 242 -1.987 30.781 -10.549 1.00 0.00 H ATOM 707 HB3 HIS A 242 -0.290 30.638 -10.035 1.00 0.00 H ATOM 708 HD2 HIS A 242 1.511 32.035 -11.583 1.00 0.00 H ATOM 709 HE1 HIS A 242 -1.228 33.205 -14.633 1.00 0.00 H ATOM 710 H HIS A 242 0.555 29.086 -12.866 1.00 0.00 H ATOM 711 N ASP A 243 -1.903 28.584 -13.511 1.00 85.38 N ATOM 712 CA ASP A 243 -2.886 28.083 -14.488 1.00 85.96 C ATOM 713 C ASP A 243 -2.248 27.689 -15.834 1.00 86.36 C ATOM 714 O ASP A 243 -1.026 27.741 -16.000 1.00 86.27 O ATOM 715 CB ASP A 243 -4.044 29.081 -14.714 1.00 85.84 C ATOM 716 CG ASP A 243 -3.722 30.135 -15.768 1.00 85.78 C ATOM 717 OD1 ASP A 243 -2.730 30.878 -15.590 1.00 86.07 O ATOM 718 OD2 ASP A 243 -4.461 30.215 -16.775 1.00 85.34 O ATOM 719 HA ASP A 243 -3.298 27.176 -14.045 1.00 0.00 H ATOM 720 HB2 ASP A 243 -4.925 28.525 -15.035 1.00 0.00 H ATOM 721 HB3 ASP A 243 -4.258 29.585 -13.772 1.00 0.00 H ATOM 722 H ASP A 243 -0.952 28.831 -13.852 1.00 0.00 H ATOM 723 N MET A 244 -3.118 27.302 -16.768 1.00 86.92 N ATOM 724 CA MET A 244 -2.805 26.932 -18.155 1.00 87.48 C ATOM 725 C MET A 244 -1.527 27.508 -18.743 1.00 87.89 C ATOM 726 O MET A 244 -0.571 26.780 -19.009 1.00 87.91 O ATOM 727 CB MET A 244 -3.972 27.350 -19.052 1.00 87.36 C ATOM 728 CG MET A 244 -5.330 27.024 -18.478 1.00 87.61 C ATOM 729 SD MET A 244 -5.417 25.289 -18.014 1.00 87.82 S ATOM 730 CE MET A 244 -5.430 24.499 -19.628 1.00 88.44 C ATOM 731 HA MET A 244 -2.644 25.854 -18.120 1.00 0.00 H ATOM 732 HB2 MET A 244 -3.915 28.427 -19.210 1.00 0.00 H ATOM 733 HB3 MET A 244 -3.871 26.837 -20.009 1.00 0.00 H ATOM 734 HG2 MET A 244 -6.096 27.235 -19.225 1.00 0.00 H ATOM 735 HG3 MET A 244 -5.505 27.641 -17.596 1.00 0.00 H ATOM 736 HE1 MET A 244 -6.297 24.842 -20.192 1.00 0.00 H ATOM 737 HE2 MET A 244 -4.519 24.760 -20.166 1.00 0.00 H ATOM 738 HE3 MET A 244 -5.482 23.418 -19.501 1.00 0.00 H ATOM 739 H MET A 244 -4.118 27.258 -16.486 1.00 0.00 H ATOM 740 N GLU A 245 -1.546 28.820 -18.965 1.00 88.51 N ATOM 741 CA GLU A 245 -0.464 29.560 -19.611 1.00 89.14 C ATOM 742 C GLU A 245 0.898 29.178 -19.031 1.00 89.39 C ATOM 743 O GLU A 245 1.821 28.784 -19.759 1.00 89.26 O ATOM 744 CB GLU A 245 -0.732 31.066 -19.449 1.00 89.13 C ATOM 745 CG GLU A 245 0.348 31.995 -19.998 1.00 89.45 C ATOM 746 CD GLU A 245 0.076 33.466 -19.693 1.00 89.40 C ATOM 747 OE1 GLU A 245 -1.092 33.838 -19.435 1.00 89.72 O ATOM 748 OE2 GLU A 245 1.041 34.254 -19.717 1.00 89.67 O ATOM 749 HA GLU A 245 -0.437 29.305 -20.670 1.00 0.00 H ATOM 750 HB2 GLU A 245 -1.665 31.297 -19.962 1.00 0.00 H ATOM 751 HB3 GLU A 245 -0.843 31.274 -18.385 1.00 0.00 H ATOM 752 HG2 GLU A 245 1.304 31.718 -19.554 1.00 0.00 H ATOM 753 HG3 GLU A 245 0.401 31.867 -21.079 1.00 0.00 H ATOM 754 H GLU A 245 -2.385 29.353 -18.659 1.00 0.00 H ATOM 755 N THR A 246 0.988 29.281 -17.708 1.00 89.82 N ATOM 756 CA THR A 246 2.198 28.987 -16.945 1.00 90.23 C ATOM 757 C THR A 246 2.506 27.482 -16.878 1.00 90.40 C ATOM 758 O THR A 246 3.672 27.074 -16.836 1.00 90.28 O ATOM 759 CB THR A 246 2.080 29.583 -15.526 1.00 90.32 C ATOM 760 OG1 THR A 246 0.692 29.800 -15.220 1.00 90.32 O ATOM 761 CG2 THR A 246 2.821 30.920 -15.444 1.00 90.25 C ATOM 762 HA THR A 246 3.034 29.451 -17.468 1.00 0.00 H ATOM 763 HB THR A 246 2.522 28.886 -14.813 1.00 0.00 H ATOM 764 HG1 THR A 246 0.208 28.938 -15.261 1.00 0.00 H ATOM 765 HG23 THR A 246 3.875 30.765 -15.675 1.00 0.00 H ATOM 766 HG21 THR A 246 2.390 31.618 -16.162 1.00 0.00 H ATOM 767 HG22 THR A 246 2.724 31.326 -14.437 1.00 0.00 H ATOM 768 H THR A 246 0.144 29.590 -17.184 1.00 0.00 H ATOM 769 N LEU A 247 1.447 26.674 -16.866 1.00 90.66 N ATOM 770 CA LEU A 247 1.541 25.218 -16.912 1.00 90.90 C ATOM 771 C LEU A 247 2.193 24.760 -18.215 1.00 91.27 C ATOM 772 O LEU A 247 3.091 23.917 -18.217 1.00 91.10 O ATOM 773 CB LEU A 247 0.134 24.620 -16.778 1.00 90.68 C ATOM 774 CG LEU A 247 -0.174 23.239 -17.352 1.00 90.19 C ATOM 775 CD1 LEU A 247 0.012 22.163 -16.300 1.00 89.54 C ATOM 776 CD2 LEU A 247 -1.587 23.228 -17.892 1.00 89.86 C ATOM 777 HA LEU A 247 2.164 24.872 -16.087 1.00 0.00 H ATOM 778 HB2 LEU A 247 -0.086 24.572 -15.712 1.00 0.00 H ATOM 779 HB3 LEU A 247 -0.551 25.319 -17.258 1.00 0.00 H ATOM 780 HG LEU A 247 0.521 23.025 -18.164 1.00 0.00 H ATOM 781 HD21 LEU A 247 -2.285 23.453 -17.085 1.00 0.00 H ATOM 782 HD22 LEU A 247 -1.681 23.980 -18.676 1.00 0.00 H ATOM 783 HD23 LEU A 247 -1.810 22.243 -18.303 1.00 0.00 H ATOM 784 HD11 LEU A 247 1.044 22.175 -15.948 1.00 0.00 H ATOM 785 HD12 LEU A 247 -0.661 22.354 -15.464 1.00 0.00 H ATOM 786 HD13 LEU A 247 -0.214 21.189 -16.734 1.00 0.00 H ATOM 787 H LEU A 247 0.501 27.104 -16.821 1.00 0.00 H ATOM 788 N CYS A 248 1.731 25.333 -19.321 1.00 91.82 N ATOM 789 CA CYS A 248 2.190 24.940 -20.640 1.00 92.40 C ATOM 790 C CYS A 248 3.503 25.599 -20.988 1.00 92.60 C ATOM 791 O CYS A 248 4.194 25.155 -21.899 1.00 92.88 O ATOM 792 CB CYS A 248 1.126 25.236 -21.686 1.00 92.34 C ATOM 793 SG CYS A 248 -0.408 24.373 -21.339 1.00 93.53 S ATOM 794 HA CYS A 248 2.364 23.864 -20.629 1.00 0.00 H ATOM 795 HB2 CYS A 248 1.494 24.923 -22.663 1.00 0.00 H ATOM 796 HB3 CYS A 248 0.933 26.309 -21.699 1.00 0.00 H ATOM 797 HG CYS A 248 -0.888 24.769 -20.107 1.00 0.00 H ATOM 798 H CYS A 248 1.019 26.086 -19.239 1.00 0.00 H ATOM 799 N MET A 249 3.841 26.663 -20.268 1.00 92.86 N ATOM 800 CA MET A 249 5.194 27.200 -20.308 1.00 93.27 C ATOM 801 C MET A 249 6.134 26.297 -19.519 1.00 93.37 C ATOM 802 O MET A 249 7.327 26.208 -19.826 1.00 93.45 O ATOM 803 CB MET A 249 5.239 28.606 -19.735 1.00 93.23 C ATOM 804 CG MET A 249 5.083 29.695 -20.767 1.00 93.53 C ATOM 805 SD MET A 249 6.020 31.155 -20.279 1.00 93.74 S ATOM 806 CE MET A 249 7.710 30.592 -20.550 1.00 93.38 C ATOM 807 HA MET A 249 5.513 27.240 -21.349 1.00 0.00 H ATOM 808 HB2 MET A 249 4.434 28.706 -19.007 1.00 0.00 H ATOM 809 HB3 MET A 249 6.198 28.742 -19.235 1.00 0.00 H ATOM 810 HG2 MET A 249 4.029 29.957 -20.858 1.00 0.00 H ATOM 811 HG3 MET A 249 5.451 29.336 -21.728 1.00 0.00 H ATOM 812 HE1 MET A 249 7.906 29.721 -19.925 1.00 0.00 H ATOM 813 HE2 MET A 249 7.839 30.324 -21.599 1.00 0.00 H ATOM 814 HE3 MET A 249 8.404 31.391 -20.290 1.00 0.00 H ATOM 815 H MET A 249 3.127 27.120 -19.666 1.00 0.00 H ATOM 816 N ALA A 250 5.584 25.637 -18.497 1.00 93.57 N ATOM 817 CA ALA A 250 6.330 24.676 -17.685 1.00 93.56 C ATOM 818 C ALA A 250 6.514 23.352 -18.427 1.00 93.53 C ATOM 819 O ALA A 250 7.617 22.805 -18.459 1.00 93.53 O ATOM 820 CB ALA A 250 5.639 24.456 -16.345 1.00 93.57 C ATOM 821 HA ALA A 250 7.320 25.091 -17.496 1.00 0.00 H ATOM 822 HB1 ALA A 250 5.580 25.403 -15.808 1.00 0.00 H ATOM 823 HB2 ALA A 250 4.634 24.071 -16.515 1.00 0.00 H ATOM 824 HB3 ALA A 250 6.210 23.738 -15.757 1.00 0.00 H ATOM 825 H ALA A 250 4.585 25.813 -18.269 1.00 0.00 H ATOM 826 N GLU A 251 5.434 22.852 -19.030 1.00 93.44 N ATOM 827 CA GLU A 251 5.481 21.645 -19.864 1.00 93.31 C ATOM 828 C GLU A 251 6.443 21.783 -21.038 1.00 93.34 C ATOM 829 O GLU A 251 6.936 20.785 -21.565 1.00 93.39 O ATOM 830 CB GLU A 251 4.089 21.287 -20.361 1.00 93.23 C ATOM 831 CG GLU A 251 3.273 20.588 -19.311 1.00 92.96 C ATOM 832 CD GLU A 251 1.834 21.013 -19.313 1.00 93.15 C ATOM 833 OE1 GLU A 251 1.502 22.034 -19.944 1.00 93.54 O ATOM 834 OE2 GLU A 251 1.024 20.319 -18.673 1.00 93.62 O ATOM 835 HA GLU A 251 5.857 20.839 -19.234 1.00 0.00 H ATOM 836 HB2 GLU A 251 3.575 22.202 -20.654 1.00 0.00 H ATOM 837 HB3 GLU A 251 4.183 20.631 -21.227 1.00 0.00 H ATOM 838 HG2 GLU A 251 3.319 19.514 -19.492 1.00 0.00 H ATOM 839 HG3 GLU A 251 3.700 20.810 -18.333 1.00 0.00 H ATOM 840 H GLU A 251 4.523 23.337 -18.904 1.00 0.00 H ATOM 841 N LYS A 252 6.687 23.028 -21.442 1.00 93.29 N ATOM 842 CA LYS A 252 7.775 23.361 -22.346 1.00 93.31 C ATOM 843 C LYS A 252 9.101 23.061 -21.654 1.00 93.39 C ATOM 844 O LYS A 252 9.695 22.009 -21.879 1.00 93.48 O ATOM 845 CB LYS A 252 7.715 24.844 -22.753 1.00 93.28 C ATOM 846 CG LYS A 252 6.705 25.174 -23.843 1.00 93.01 C ATOM 847 CD LYS A 252 7.380 25.422 -25.188 1.00 92.57 C ATOM 848 CE LYS A 252 6.451 25.092 -26.356 1.00 92.31 C ATOM 849 NZ LYS A 252 5.064 25.622 -26.177 1.00 92.15 N ATOM 850 HA LYS A 252 7.684 22.761 -23.251 1.00 0.00 H ATOM 851 HB2 LYS A 252 7.460 25.427 -21.868 1.00 0.00 H ATOM 852 HB3 LYS A 252 8.703 25.137 -23.108 1.00 0.00 H ATOM 853 HG2 LYS A 252 6.011 24.340 -23.945 1.00 0.00 H ATOM 854 HG3 LYS A 252 6.154 26.069 -23.554 1.00 0.00 H ATOM 855 HD2 LYS A 252 7.668 26.471 -25.251 1.00 0.00 H ATOM 856 HD3 LYS A 252 8.271 24.797 -25.257 1.00 0.00 H ATOM 857 HE2 LYS A 252 6.397 24.008 -26.460 1.00 0.00 H ATOM 858 HE3 LYS A 252 6.871 25.522 -27.265 1.00 0.00 H ATOM 859 HZ1 LYS A 252 4.646 25.212 -25.318 1.00 0.00 H ATOM 860 HZ2 LYS A 252 5.099 26.657 -26.087 1.00 0.00 H ATOM 861 HZ3 LYS A 252 4.486 25.364 -27.002 1.00 0.00 H ATOM 862 H LYS A 252 6.074 23.794 -21.096 1.00 0.00 H ATOM 863 N THR A 253 9.523 23.968 -20.774 1.00 93.50 N ATOM 864 CA THR A 253 10.893 23.994 -20.243 1.00 93.60 C ATOM 865 C THR A 253 11.262 22.928 -19.197 1.00 93.75 C ATOM 866 O THR A 253 12.447 22.637 -19.015 1.00 93.66 O ATOM 867 CB THR A 253 11.261 25.406 -19.690 1.00 93.54 C ATOM 868 OG1 THR A 253 10.125 25.988 -19.037 1.00 93.48 O ATOM 869 CG2 THR A 253 11.703 26.329 -20.814 1.00 93.53 C ATOM 870 HA THR A 253 11.488 23.741 -21.120 1.00 0.00 H ATOM 871 HB THR A 253 12.080 25.286 -18.981 1.00 0.00 H ATOM 872 HG1 THR A 253 9.382 26.075 -19.685 1.00 0.00 H ATOM 873 HG23 THR A 253 12.567 25.897 -21.319 1.00 0.00 H ATOM 874 HG21 THR A 253 10.887 26.449 -21.526 1.00 0.00 H ATOM 875 HG22 THR A 253 11.971 27.301 -20.400 1.00 0.00 H ATOM 876 H THR A 253 8.851 24.692 -20.448 1.00 0.00 H ATOM 877 N LEU A 254 10.266 22.335 -18.536 1.00 94.02 N ATOM 878 CA LEU A 254 10.519 21.493 -17.344 1.00 94.17 C ATOM 879 C LEU A 254 10.338 19.965 -17.473 1.00 94.21 C ATOM 880 O LEU A 254 10.748 19.227 -16.566 1.00 94.23 O ATOM 881 CB LEU A 254 9.730 22.021 -16.129 1.00 94.15 C ATOM 882 CG LEU A 254 10.017 23.432 -15.590 1.00 94.02 C ATOM 883 CD1 LEU A 254 8.953 23.839 -14.592 1.00 94.07 C ATOM 884 CD2 LEU A 254 11.399 23.551 -14.951 1.00 94.01 C ATOM 885 HA LEU A 254 11.595 21.599 -17.209 1.00 0.00 H ATOM 886 HB2 LEU A 254 8.675 21.995 -16.401 1.00 0.00 H ATOM 887 HB3 LEU A 254 9.910 21.326 -15.309 1.00 0.00 H ATOM 888 HG LEU A 254 9.998 24.105 -16.447 1.00 0.00 H ATOM 889 HD21 LEU A 254 11.473 22.853 -14.117 1.00 0.00 H ATOM 890 HD22 LEU A 254 12.162 23.315 -15.693 1.00 0.00 H ATOM 891 HD23 LEU A 254 11.544 24.569 -14.589 1.00 0.00 H ATOM 892 HD11 LEU A 254 7.978 23.835 -15.080 1.00 0.00 H ATOM 893 HD12 LEU A 254 8.948 23.134 -13.761 1.00 0.00 H ATOM 894 HD13 LEU A 254 9.170 24.840 -14.219 1.00 0.00 H ATOM 895 H LEU A 254 9.289 22.467 -18.866 1.00 0.00 H ATOM 896 N VAL A 255 9.739 19.493 -18.573 1.00 94.22 N ATOM 897 CA VAL A 255 9.534 18.041 -18.803 1.00 94.21 C ATOM 898 C VAL A 255 10.077 17.506 -20.150 1.00 94.32 C ATOM 899 O VAL A 255 10.859 18.180 -20.830 1.00 94.37 O ATOM 900 CB VAL A 255 8.039 17.601 -18.627 1.00 94.10 C ATOM 901 CG1 VAL A 255 7.618 17.665 -17.168 1.00 94.07 C ATOM 902 CG2 VAL A 255 7.105 18.417 -19.516 1.00 93.98 C ATOM 903 HA VAL A 255 10.138 17.583 -18.019 1.00 0.00 H ATOM 904 HB VAL A 255 7.961 16.562 -18.948 1.00 0.00 H ATOM 905 HG11 VAL A 255 8.250 17.000 -16.579 1.00 0.00 H ATOM 906 HG12 VAL A 255 7.726 18.687 -16.804 1.00 0.00 H ATOM 907 HG13 VAL A 255 6.577 17.354 -17.078 1.00 0.00 H ATOM 908 HG21 VAL A 255 7.187 19.472 -19.255 1.00 0.00 H ATOM 909 HG22 VAL A 255 7.385 18.277 -20.560 1.00 0.00 H ATOM 910 HG23 VAL A 255 6.078 18.083 -19.366 1.00 0.00 H ATOM 911 H VAL A 255 9.406 20.167 -19.291 1.00 0.00 H ATOM 912 N ALA A 256 9.663 16.289 -20.513 1.00 94.23 N ATOM 913 CA ALA A 256 10.046 15.663 -21.776 1.00 94.07 C ATOM 914 C ALA A 256 8.831 15.483 -22.687 1.00 94.07 C ATOM 915 O ALA A 256 8.396 16.420 -23.362 1.00 93.99 O ATOM 916 CB ALA A 256 10.719 14.328 -21.517 1.00 93.94 C ATOM 917 HA ALA A 256 10.753 16.319 -22.283 1.00 0.00 H ATOM 918 HB1 ALA A 256 11.611 14.484 -20.911 1.00 0.00 H ATOM 919 HB2 ALA A 256 10.029 13.671 -20.988 1.00 0.00 H ATOM 920 HB3 ALA A 256 10.999 13.873 -22.467 1.00 0.00 H ATOM 921 H ALA A 256 9.040 15.763 -19.867 1.00 0.00 H TER 922 ALA A 256 ATOM 923 N ILE A 263 0.941 13.815 -23.470 1.00 88.27 N ATOM 924 CA ILE A 263 1.522 15.156 -23.282 1.00 88.27 C ATOM 925 C ILE A 263 0.653 16.275 -23.916 1.00 88.17 C ATOM 926 O ILE A 263 -0.468 16.521 -23.450 1.00 88.19 O ATOM 927 CB ILE A 263 3.011 15.223 -23.772 1.00 88.28 C ATOM 928 HA ILE A 263 1.529 15.341 -22.208 1.00 0.00 H ATOM 929 HB ILE A 263 3.610 14.509 -23.208 1.00 0.00 H ATOM 930 HN3 ILE A 263 0.854 13.616 -24.487 1.00 0.00 H ATOM 931 HN2 ILE A 263 0.001 13.781 -23.027 1.00 0.00 H ATOM 932 HN1 ILE A 263 1.560 13.105 -23.028 1.00 0.00 H ATOM 933 N GLN A 264 1.168 16.928 -24.971 1.00 87.89 N ATOM 934 CA GLN A 264 0.513 18.074 -25.652 1.00 87.37 C ATOM 935 C GLN A 264 -0.846 17.734 -26.291 1.00 87.00 C ATOM 936 O GLN A 264 -1.712 18.607 -26.456 1.00 86.85 O ATOM 937 CB GLN A 264 1.454 18.663 -26.715 1.00 87.30 C ATOM 938 HA GLN A 264 0.308 18.807 -24.872 1.00 0.00 H ATOM 939 HB2 GLN A 264 2.371 19.007 -26.236 1.00 0.00 H ATOM 940 HB3 GLN A 264 1.693 17.896 -27.452 1.00 0.00 H ATOM 941 H GLN A 264 2.088 16.609 -25.336 1.00 0.00 H ATOM 942 N ASN A 265 -1.003 16.458 -26.646 1.00 86.43 N ATOM 943 CA ASN A 265 -2.223 15.892 -27.221 1.00 85.73 C ATOM 944 C ASN A 265 -3.414 15.927 -26.248 1.00 85.17 C ATOM 945 O ASN A 265 -4.575 15.985 -26.672 1.00 85.28 O ATOM 946 CB ASN A 265 -1.927 14.436 -27.637 1.00 85.86 C ATOM 947 CG ASN A 265 -2.995 13.841 -28.542 1.00 86.06 C ATOM 948 OD1 ASN A 265 -3.683 12.888 -28.168 1.00 86.14 O ATOM 949 ND2 ASN A 265 -3.131 14.394 -29.742 1.00 86.11 N ATOM 950 HA ASN A 265 -2.509 16.499 -28.080 1.00 0.00 H ATOM 951 HB2 ASN A 265 -0.974 14.414 -28.165 1.00 0.00 H ATOM 952 HB3 ASN A 265 -1.857 13.826 -26.737 1.00 0.00 H ATOM 953 HD22 ASN A 265 -2.529 15.197 -30.016 1.00 0.00 H ATOM 954 HD21 ASN A 265 -3.839 14.024 -30.408 1.00 0.00 H ATOM 955 H ASN A 265 -0.197 15.817 -26.503 1.00 0.00 H ATOM 956 N LYS A 266 -3.113 15.924 -24.948 1.00 84.30 N ATOM 957 CA LYS A 266 -4.090 15.579 -23.904 1.00 83.35 C ATOM 958 C LYS A 266 -4.643 16.769 -23.099 1.00 82.59 C ATOM 959 O LYS A 266 -4.040 17.847 -23.064 1.00 82.60 O ATOM 960 CB LYS A 266 -3.490 14.515 -22.959 1.00 83.34 C ATOM 961 CG LYS A 266 -3.001 13.220 -23.651 1.00 83.26 C ATOM 962 CD LYS A 266 -2.391 12.234 -22.651 1.00 83.34 C ATOM 963 CE LYS A 266 -2.151 10.846 -23.255 1.00 83.01 C ATOM 964 NZ LYS A 266 -0.783 10.680 -23.812 1.00 82.56 N ATOM 965 HA LYS A 266 -4.955 15.181 -24.434 1.00 0.00 H ATOM 966 HB2 LYS A 266 -2.641 14.963 -22.442 1.00 0.00 H ATOM 967 HB3 LYS A 266 -4.254 14.241 -22.231 1.00 0.00 H ATOM 968 HG2 LYS A 266 -3.847 12.743 -24.145 1.00 0.00 H ATOM 969 HG3 LYS A 266 -2.247 13.480 -24.394 1.00 0.00 H ATOM 970 HD2 LYS A 266 -1.437 12.633 -22.306 1.00 0.00 H ATOM 971 HD3 LYS A 266 -3.069 12.133 -21.804 1.00 0.00 H ATOM 972 HE2 LYS A 266 -2.873 10.686 -24.056 1.00 0.00 H ATOM 973 HE3 LYS A 266 -2.302 10.098 -22.477 1.00 0.00 H ATOM 974 HZ1 LYS A 266 -0.629 11.382 -24.564 1.00 0.00 H ATOM 975 HZ2 LYS A 266 -0.083 10.820 -23.056 1.00 0.00 H ATOM 976 HZ3 LYS A 266 -0.684 9.722 -24.205 1.00 0.00 H ATOM 977 H LYS A 266 -2.146 16.176 -24.661 1.00 0.00 H ATOM 978 N GLU A 267 -5.801 16.551 -22.470 1.00 81.57 N ATOM 979 CA GLU A 267 -6.429 17.496 -21.536 1.00 80.49 C ATOM 980 C GLU A 267 -5.428 17.898 -20.450 1.00 79.83 C ATOM 981 O GLU A 267 -4.483 17.157 -20.180 1.00 79.96 O ATOM 982 CB GLU A 267 -7.656 16.824 -20.908 1.00 80.43 C ATOM 983 CG GLU A 267 -8.633 17.749 -20.201 1.00 80.32 C ATOM 984 CD GLU A 267 -9.752 16.992 -19.489 1.00 80.40 C ATOM 985 OE1 GLU A 267 -10.189 17.453 -18.416 1.00 80.48 O ATOM 986 OE2 GLU A 267 -10.197 15.935 -19.988 1.00 79.70 O ATOM 987 HA GLU A 267 -6.738 18.396 -22.068 1.00 0.00 H ATOM 988 HB2 GLU A 267 -8.198 16.310 -21.702 1.00 0.00 H ATOM 989 HB3 GLU A 267 -7.301 16.094 -20.180 1.00 0.00 H ATOM 990 HG2 GLU A 267 -8.086 18.337 -19.464 1.00 0.00 H ATOM 991 HG3 GLU A 267 -9.078 18.416 -20.939 1.00 0.00 H ATOM 992 H GLU A 267 -6.291 15.652 -22.654 1.00 0.00 H ATOM 993 N ALA A 268 -5.629 19.058 -19.827 1.00 78.86 N ATOM 994 CA ALA A 268 -4.673 19.579 -18.825 1.00 77.92 C ATOM 995 C ALA A 268 -4.708 18.906 -17.439 1.00 77.12 C ATOM 996 O ALA A 268 -3.756 19.041 -16.659 1.00 77.02 O ATOM 997 CB ALA A 268 -4.809 21.099 -18.681 1.00 78.02 C ATOM 998 HA ALA A 268 -3.696 19.318 -19.232 1.00 0.00 H ATOM 999 HB1 ALA A 268 -4.606 21.573 -19.641 1.00 0.00 H ATOM 1000 HB2 ALA A 268 -5.822 21.343 -18.361 1.00 0.00 H ATOM 1001 HB3 ALA A 268 -4.096 21.458 -17.939 1.00 0.00 H ATOM 1002 H ALA A 268 -6.480 19.612 -20.051 1.00 0.00 H ATOM 1003 N GLU A 269 -5.799 18.197 -17.140 1.00 75.93 N ATOM 1004 CA GLU A 269 -5.953 17.465 -15.881 1.00 74.79 C ATOM 1005 C GLU A 269 -5.105 16.208 -15.862 1.00 73.67 C ATOM 1006 O GLU A 269 -4.423 15.909 -14.875 1.00 73.45 O ATOM 1007 CB GLU A 269 -7.416 17.076 -15.663 1.00 75.04 C ATOM 1008 CG GLU A 269 -8.175 17.966 -14.686 1.00 76.68 C ATOM 1009 CD GLU A 269 -8.595 19.316 -15.273 1.00 78.61 C ATOM 1010 OE1 GLU A 269 -9.253 20.089 -14.541 1.00 79.16 O ATOM 1011 OE2 GLU A 269 -8.274 19.608 -16.452 1.00 79.12 O ATOM 1012 HA GLU A 269 -5.621 18.127 -15.081 1.00 0.00 H ATOM 1013 HB2 GLU A 269 -7.925 17.117 -16.626 1.00 0.00 H ATOM 1014 HB3 GLU A 269 -7.443 16.055 -15.283 1.00 0.00 H ATOM 1015 HG2 GLU A 269 -9.072 17.437 -14.366 1.00 0.00 H ATOM 1016 HG3 GLU A 269 -7.536 18.151 -13.823 1.00 0.00 H ATOM 1017 H GLU A 269 -6.574 18.163 -17.832 1.00 0.00 H ATOM 1018 N VAL A 270 -5.163 15.474 -16.964 1.00 72.37 N ATOM 1019 CA VAL A 270 -4.453 14.217 -17.094 1.00 71.17 C ATOM 1020 C VAL A 270 -2.952 14.468 -17.245 1.00 70.17 C ATOM 1021 O VAL A 270 -2.147 13.645 -16.824 1.00 70.04 O ATOM 1022 CB VAL A 270 -5.037 13.359 -18.240 1.00 71.28 C ATOM 1023 CG1 VAL A 270 -4.156 12.164 -18.538 1.00 71.88 C ATOM 1024 CG2 VAL A 270 -6.451 12.896 -17.885 1.00 71.12 C ATOM 1025 HA VAL A 270 -4.592 13.637 -16.181 1.00 0.00 H ATOM 1026 HB VAL A 270 -5.078 13.979 -19.136 1.00 0.00 H ATOM 1027 HG11 VAL A 270 -3.165 12.509 -18.833 1.00 0.00 H ATOM 1028 HG12 VAL A 270 -4.075 11.543 -17.646 1.00 0.00 H ATOM 1029 HG13 VAL A 270 -4.596 11.583 -19.348 1.00 0.00 H ATOM 1030 HG21 VAL A 270 -6.419 12.300 -16.973 1.00 0.00 H ATOM 1031 HG22 VAL A 270 -7.089 13.766 -17.729 1.00 0.00 H ATOM 1032 HG23 VAL A 270 -6.850 12.293 -18.701 1.00 0.00 H ATOM 1033 H VAL A 270 -5.737 15.811 -17.763 1.00 0.00 H ATOM 1034 N ARG A 271 -2.580 15.615 -17.815 1.00 69.12 N ATOM 1035 CA ARG A 271 -1.164 16.039 -17.856 1.00 68.02 C ATOM 1036 C ARG A 271 -0.557 16.025 -16.454 1.00 67.17 C ATOM 1037 O ARG A 271 0.540 15.492 -16.237 1.00 67.31 O ATOM 1038 CB ARG A 271 -0.992 17.437 -18.479 1.00 67.96 C ATOM 1039 CG ARG A 271 -1.255 17.501 -19.980 1.00 67.61 C ATOM 1040 CD ARG A 271 -0.340 18.499 -20.689 1.00 66.71 C ATOM 1041 NE ARG A 271 -0.731 19.897 -20.513 1.00 65.62 N ATOM 1042 CZ ARG A 271 -1.774 20.469 -21.106 1.00 65.95 C ATOM 1043 NH1 ARG A 271 -2.571 19.763 -21.904 1.00 66.00 N ATOM 1044 NH2 ARG A 271 -2.034 21.749 -20.886 1.00 66.02 N ATOM 1045 HA ARG A 271 -0.639 15.323 -18.489 1.00 0.00 H ATOM 1046 HB2 ARG A 271 -1.684 18.118 -17.983 1.00 0.00 H ATOM 1047 HB3 ARG A 271 0.031 17.766 -18.299 1.00 0.00 H ATOM 1048 HG2 ARG A 271 -1.092 16.511 -20.407 1.00 0.00 H ATOM 1049 HG3 ARG A 271 -2.291 17.799 -20.142 1.00 0.00 H ATOM 1050 HD2 ARG A 271 -0.347 18.273 -21.755 1.00 0.00 H ATOM 1051 HD3 ARG A 271 0.670 18.374 -20.299 1.00 0.00 H ATOM 1052 HE ARG A 271 -0.152 20.485 -19.879 1.00 0.00 H ATOM 1053 HH12 ARG A 271 -3.384 20.220 -22.363 1.00 0.00 H ATOM 1054 HH11 ARG A 271 -2.380 18.754 -22.069 1.00 0.00 H ATOM 1055 HH22 ARG A 271 -2.849 22.201 -21.348 1.00 0.00 H ATOM 1056 HH21 ARG A 271 -1.423 22.302 -20.252 1.00 0.00 H ATOM 1057 H ARG A 271 -3.305 16.227 -18.242 1.00 0.00 H ATOM 1058 N ILE A 272 -1.292 16.613 -15.514 1.00 65.93 N ATOM 1059 CA ILE A 272 -0.908 16.635 -14.111 1.00 64.50 C ATOM 1060 C ILE A 272 -0.946 15.206 -13.551 1.00 63.48 C ATOM 1061 O ILE A 272 0.052 14.732 -13.022 1.00 63.43 O ATOM 1062 CB ILE A 272 -1.780 17.651 -13.322 1.00 64.62 C ATOM 1063 CG1 ILE A 272 -1.446 19.078 -13.791 1.00 64.64 C ATOM 1064 CG2 ILE A 272 -1.569 17.522 -11.814 1.00 64.29 C ATOM 1065 CD1 ILE A 272 -2.556 20.093 -13.602 1.00 64.48 C ATOM 1066 HA ILE A 272 0.117 16.988 -14.000 1.00 0.00 H ATOM 1067 HB ILE A 272 -2.829 17.434 -13.522 1.00 0.00 H ATOM 1068 HG12 ILE A 272 -0.575 19.422 -13.233 1.00 0.00 H ATOM 1069 HG13 ILE A 272 -1.203 19.037 -14.853 1.00 0.00 H ATOM 1070 HD11 ILE A 272 -3.435 19.777 -14.164 1.00 0.00 H ATOM 1071 HD12 ILE A 272 -2.806 20.163 -12.543 1.00 0.00 H ATOM 1072 HD13 ILE A 272 -2.222 21.066 -13.963 1.00 0.00 H ATOM 1073 HG21 ILE A 272 -1.840 16.515 -11.495 1.00 0.00 H ATOM 1074 HG22 ILE A 272 -0.522 17.710 -11.578 1.00 0.00 H ATOM 1075 HG23 ILE A 272 -2.196 18.249 -11.297 1.00 0.00 H ATOM 1076 H ILE A 272 -2.180 17.077 -15.794 1.00 0.00 H ATOM 1077 N PHE A 273 -2.066 14.510 -13.728 1.00 62.08 N ATOM 1078 CA PHE A 273 -2.207 13.118 -13.296 1.00 61.01 C ATOM 1079 C PHE A 273 -1.022 12.227 -13.686 1.00 60.61 C ATOM 1080 O PHE A 273 -0.535 11.442 -12.874 1.00 60.61 O ATOM 1081 CB PHE A 273 -3.491 12.534 -13.865 1.00 60.75 C ATOM 1082 CG PHE A 273 -3.948 11.281 -13.187 1.00 60.75 C ATOM 1083 CD1 PHE A 273 -4.575 11.337 -11.936 1.00 60.50 C ATOM 1084 CD2 PHE A 273 -3.780 10.041 -13.803 1.00 60.43 C ATOM 1085 CE1 PHE A 273 -5.012 10.172 -11.300 1.00 59.87 C ATOM 1086 CE2 PHE A 273 -4.215 8.868 -13.181 1.00 60.46 C ATOM 1087 CZ PHE A 273 -4.833 8.932 -11.926 1.00 60.54 C ATOM 1088 HA PHE A 273 -2.237 13.135 -12.207 1.00 0.00 H ATOM 1089 HB2 PHE A 273 -4.279 13.281 -13.770 1.00 0.00 H ATOM 1090 HB3 PHE A 273 -3.328 12.312 -14.920 1.00 0.00 H ATOM 1091 HD2 PHE A 273 -3.303 9.986 -14.782 1.00 0.00 H ATOM 1092 HE2 PHE A 273 -4.074 7.905 -13.672 1.00 0.00 H ATOM 1093 HZ PHE A 273 -5.174 8.019 -11.438 1.00 0.00 H ATOM 1094 HE1 PHE A 273 -5.490 10.228 -10.322 1.00 0.00 H ATOM 1095 HD1 PHE A 273 -4.724 12.302 -11.452 1.00 0.00 H ATOM 1096 H PHE A 273 -2.874 14.973 -14.192 1.00 0.00 H ATOM 1097 N HIS A 274 -0.569 12.353 -14.930 1.00 60.07 N ATOM 1098 CA HIS A 274 0.537 11.557 -15.452 1.00 59.37 C ATOM 1099 C HIS A 274 1.846 12.061 -14.856 1.00 58.64 C ATOM 1100 O HIS A 274 2.632 11.274 -14.323 1.00 58.69 O ATOM 1101 CB HIS A 274 0.553 11.600 -16.996 1.00 59.80 C ATOM 1102 CG HIS A 274 1.857 11.187 -17.615 1.00 60.65 C ATOM 1103 ND1 HIS A 274 2.101 9.900 -18.052 1.00 61.69 N ATOM 1104 CD2 HIS A 274 2.986 11.893 -17.875 1.00 60.91 C ATOM 1105 CE1 HIS A 274 3.327 9.830 -18.546 1.00 62.05 C ATOM 1106 NE2 HIS A 274 3.886 11.025 -18.447 1.00 61.70 N ATOM 1107 HA HIS A 274 0.409 10.514 -15.163 1.00 0.00 H ATOM 1108 HB2 HIS A 274 -0.226 10.932 -17.364 1.00 0.00 H ATOM 1109 HB3 HIS A 274 0.334 12.620 -17.311 1.00 0.00 H ATOM 1110 HD2 HIS A 274 3.149 12.951 -17.669 1.00 0.00 H ATOM 1111 HE1 HIS A 274 3.796 8.939 -18.963 1.00 0.00 H ATOM 1112 H HIS A 274 -1.022 13.048 -15.557 1.00 0.00 H ATOM 1113 N CYS A 275 2.073 13.371 -14.940 1.00 57.56 N ATOM 1114 CA CYS A 275 3.267 13.992 -14.370 1.00 56.50 C ATOM 1115 C CYS A 275 3.521 13.566 -12.929 1.00 55.42 C ATOM 1116 O CYS A 275 4.670 13.392 -12.528 1.00 55.07 O ATOM 1117 CB CYS A 275 3.157 15.512 -14.443 1.00 56.86 C ATOM 1118 SG CYS A 275 4.218 16.247 -15.688 1.00 57.67 S ATOM 1119 HA CYS A 275 4.114 13.650 -14.965 1.00 0.00 H ATOM 1120 HB2 CYS A 275 3.428 15.925 -13.471 1.00 0.00 H ATOM 1121 HB3 CYS A 275 2.124 15.773 -14.672 1.00 0.00 H ATOM 1122 HG CYS A 275 4.052 17.617 -15.681 1.00 0.00 H ATOM 1123 H CYS A 275 1.378 13.972 -15.427 1.00 0.00 H ATOM 1124 N CYS A 276 2.429 13.410 -12.174 1.00 54.32 N ATOM 1125 CA CYS A 276 2.434 12.941 -10.785 1.00 53.43 C ATOM 1126 C CYS A 276 3.063 11.556 -10.641 1.00 52.72 C ATOM 1127 O CYS A 276 3.820 11.302 -9.698 1.00 52.78 O ATOM 1128 CB CYS A 276 1.004 12.892 -10.232 1.00 53.62 C ATOM 1129 SG CYS A 276 0.286 14.470 -9.673 1.00 53.40 S ATOM 1130 HA CYS A 276 3.036 13.652 -10.219 1.00 0.00 H ATOM 1131 HB2 CYS A 276 1.002 12.209 -9.383 1.00 0.00 H ATOM 1132 HB3 CYS A 276 0.360 12.496 -11.017 1.00 0.00 H ATOM 1133 HG CYS A 276 1.062 14.993 -8.659 1.00 0.00 H ATOM 1134 H CYS A 276 1.509 13.638 -12.603 1.00 0.00 H ATOM 1135 N GLN A 277 2.740 10.672 -11.579 1.00 51.49 N ATOM 1136 CA GLN A 277 3.258 9.319 -11.573 1.00 50.52 C ATOM 1137 C GLN A 277 4.754 9.269 -11.923 1.00 50.33 C ATOM 1138 O GLN A 277 5.490 8.459 -11.356 1.00 50.29 O ATOM 1139 CB GLN A 277 2.415 8.421 -12.480 1.00 50.42 C ATOM 1140 CG GLN A 277 0.967 8.271 -12.016 1.00 49.37 C ATOM 1141 CD GLN A 277 0.145 7.310 -12.877 1.00 50.27 C ATOM 1142 OE1 GLN A 277 0.659 6.328 -13.405 1.00 50.66 O ATOM 1143 NE2 GLN A 277 -1.145 7.591 -13.005 1.00 50.63 N ATOM 1144 HA GLN A 277 3.179 8.932 -10.557 1.00 0.00 H ATOM 1145 HB2 GLN A 277 2.413 8.848 -13.483 1.00 0.00 H ATOM 1146 HB3 GLN A 277 2.873 7.432 -12.508 1.00 0.00 H ATOM 1147 HG2 GLN A 277 0.970 7.900 -10.991 1.00 0.00 H ATOM 1148 HG3 GLN A 277 0.492 9.252 -12.044 1.00 0.00 H ATOM 1149 HE22 GLN A 277 -1.542 8.433 -12.542 1.00 0.00 H ATOM 1150 HE21 GLN A 277 -1.759 6.969 -13.569 1.00 0.00 H ATOM 1151 H GLN A 277 2.095 10.961 -12.342 1.00 0.00 H ATOM 1152 N CYS A 278 5.199 10.147 -12.828 1.00 49.89 N ATOM 1153 CA CYS A 278 6.630 10.303 -13.143 1.00 49.65 C ATOM 1154 C CYS A 278 7.428 10.555 -11.878 1.00 49.06 C ATOM 1155 O CYS A 278 8.530 10.016 -11.706 1.00 49.20 O ATOM 1156 CB CYS A 278 6.881 11.481 -14.096 1.00 49.62 C ATOM 1157 SG CYS A 278 6.137 11.338 -15.730 1.00 51.81 S ATOM 1158 HA CYS A 278 6.946 9.376 -13.622 1.00 0.00 H ATOM 1159 HB2 CYS A 278 7.958 11.583 -14.226 1.00 0.00 H ATOM 1160 HB3 CYS A 278 6.487 12.382 -13.626 1.00 0.00 H ATOM 1161 HG CYS A 278 4.767 11.229 -15.602 1.00 0.00 H ATOM 1162 H CYS A 278 4.509 10.742 -13.329 1.00 0.00 H ATOM 1163 N THR A 279 6.868 11.398 -11.009 1.00 48.20 N ATOM 1164 CA THR A 279 7.532 11.797 -9.768 1.00 47.10 C ATOM 1165 C THR A 279 7.506 10.662 -8.752 1.00 46.38 C ATOM 1166 O THR A 279 8.523 10.375 -8.119 1.00 46.37 O ATOM 1167 CB THR A 279 6.922 13.101 -9.164 1.00 47.11 C ATOM 1168 OG1 THR A 279 7.178 14.201 -10.049 1.00 46.47 O ATOM 1169 CG2 THR A 279 7.525 13.416 -7.779 1.00 45.88 C ATOM 1170 HA THR A 279 8.570 12.017 -10.016 1.00 0.00 H ATOM 1171 HB THR A 279 5.849 12.950 -9.045 1.00 0.00 H ATOM 1172 HG1 THR A 279 6.791 15.028 -9.666 1.00 0.00 H ATOM 1173 HG23 THR A 279 7.333 12.583 -7.103 1.00 0.00 H ATOM 1174 HG21 THR A 279 8.600 13.565 -7.878 1.00 0.00 H ATOM 1175 HG22 THR A 279 7.066 14.321 -7.382 1.00 0.00 H ATOM 1176 H THR A 279 5.926 11.785 -11.221 1.00 0.00 H ATOM 1177 N SER A 280 6.355 10.011 -8.618 1.00 45.21 N ATOM 1178 CA SER A 280 6.195 8.983 -7.608 1.00 44.39 C ATOM 1179 C SER A 280 7.025 7.732 -7.913 1.00 44.13 C ATOM 1180 O SER A 280 7.563 7.113 -6.990 1.00 43.68 O ATOM 1181 CB SER A 280 4.719 8.665 -7.372 1.00 44.24 C ATOM 1182 OG SER A 280 4.108 8.132 -8.527 1.00 43.76 O ATOM 1183 HA SER A 280 6.591 9.381 -6.674 1.00 0.00 H ATOM 1184 HB2 SER A 280 4.201 9.581 -7.089 1.00 0.00 H ATOM 1185 HB3 SER A 280 4.639 7.939 -6.563 1.00 0.00 H ATOM 1186 HG SER A 280 3.156 7.939 -8.336 1.00 0.00 H ATOM 1187 H SER A 280 5.559 10.242 -9.246 1.00 0.00 H ATOM 1188 N VAL A 281 7.150 7.392 -9.197 1.00 43.90 N ATOM 1189 CA VAL A 281 7.992 6.271 -9.641 1.00 44.22 C ATOM 1190 C VAL A 281 9.485 6.504 -9.357 1.00 44.33 C ATOM 1191 O VAL A 281 10.186 5.610 -8.869 1.00 44.35 O ATOM 1192 CB VAL A 281 7.786 5.964 -11.134 1.00 44.37 C ATOM 1193 CG1 VAL A 281 8.899 5.056 -11.663 1.00 44.32 C ATOM 1194 CG2 VAL A 281 6.418 5.332 -11.355 1.00 44.34 C ATOM 1195 HA VAL A 281 7.672 5.408 -9.056 1.00 0.00 H ATOM 1196 HB VAL A 281 7.829 6.901 -11.690 1.00 0.00 H ATOM 1197 HG11 VAL A 281 9.862 5.551 -11.536 1.00 0.00 H ATOM 1198 HG12 VAL A 281 8.896 4.118 -11.108 1.00 0.00 H ATOM 1199 HG13 VAL A 281 8.730 4.854 -12.721 1.00 0.00 H ATOM 1200 HG21 VAL A 281 6.351 4.405 -10.786 1.00 0.00 H ATOM 1201 HG22 VAL A 281 5.643 6.021 -11.021 1.00 0.00 H ATOM 1202 HG23 VAL A 281 6.284 5.119 -12.416 1.00 0.00 H ATOM 1203 H VAL A 281 6.632 7.941 -9.912 1.00 0.00 H ATOM 1204 N GLU A 282 9.961 7.705 -9.664 1.00 44.42 N ATOM 1205 CA GLU A 282 11.311 8.118 -9.301 1.00 44.97 C ATOM 1206 C GLU A 282 11.517 7.940 -7.800 1.00 44.35 C ATOM 1207 O GLU A 282 12.516 7.347 -7.359 1.00 44.95 O ATOM 1208 CB GLU A 282 11.562 9.587 -9.671 1.00 44.87 C ATOM 1209 CG GLU A 282 11.643 9.898 -11.169 1.00 46.03 C ATOM 1210 CD GLU A 282 12.211 11.303 -11.457 1.00 46.86 C ATOM 1211 OE1 GLU A 282 13.207 11.387 -12.218 1.00 50.05 O ATOM 1212 OE2 GLU A 282 11.679 12.317 -10.930 1.00 47.54 O ATOM 1213 HA GLU A 282 12.014 7.495 -9.854 1.00 0.00 H ATOM 1214 HB2 GLU A 282 10.750 10.181 -9.250 1.00 0.00 H ATOM 1215 HB3 GLU A 282 12.505 9.889 -9.216 1.00 0.00 H ATOM 1216 HG2 GLU A 282 12.286 9.158 -11.645 1.00 0.00 H ATOM 1217 HG3 GLU A 282 10.641 9.833 -11.593 1.00 0.00 H ATOM 1218 H GLU A 282 9.352 8.372 -10.179 1.00 0.00 H ATOM 1219 N THR A 283 10.561 8.451 -7.025 1.00 43.46 N ATOM 1220 CA THR A 283 10.623 8.396 -5.570 1.00 42.12 C ATOM 1221 C THR A 283 10.604 6.963 -5.049 1.00 41.83 C ATOM 1222 O THR A 283 11.377 6.636 -4.147 1.00 41.70 O ATOM 1223 CB THR A 283 9.508 9.226 -4.934 1.00 41.89 C ATOM 1224 OG1 THR A 283 9.548 10.555 -5.462 1.00 39.93 O ATOM 1225 CG2 THR A 283 9.699 9.299 -3.434 1.00 42.00 C ATOM 1226 HA THR A 283 11.578 8.833 -5.277 1.00 0.00 H ATOM 1227 HB THR A 283 8.550 8.755 -5.157 1.00 0.00 H ATOM 1228 HG1 THR A 283 9.420 10.523 -6.443 1.00 0.00 H ATOM 1229 HG23 THR A 283 9.671 8.293 -3.016 1.00 0.00 H ATOM 1230 HG21 THR A 283 10.662 9.759 -3.214 1.00 0.00 H ATOM 1231 HG22 THR A 283 8.901 9.898 -2.996 1.00 0.00 H ATOM 1232 H THR A 283 9.741 8.906 -7.475 1.00 0.00 H ATOM 1233 N VAL A 284 9.749 6.115 -5.632 1.00 41.25 N ATOM 1234 CA VAL A 284 9.733 4.680 -5.322 1.00 40.78 C ATOM 1235 C VAL A 284 11.115 4.075 -5.524 1.00 40.98 C ATOM 1236 O VAL A 284 11.564 3.256 -4.740 1.00 40.76 O ATOM 1237 CB VAL A 284 8.717 3.891 -6.190 1.00 40.65 C ATOM 1238 CG1 VAL A 284 8.822 2.368 -5.920 1.00 39.55 C ATOM 1239 CG2 VAL A 284 7.315 4.354 -5.917 1.00 39.71 C ATOM 1240 HA VAL A 284 9.428 4.597 -4.279 1.00 0.00 H ATOM 1241 HB VAL A 284 8.958 4.080 -7.236 1.00 0.00 H ATOM 1242 HG11 VAL A 284 9.829 2.026 -6.161 1.00 0.00 H ATOM 1243 HG12 VAL A 284 8.612 2.171 -4.869 1.00 0.00 H ATOM 1244 HG13 VAL A 284 8.099 1.839 -6.541 1.00 0.00 H ATOM 1245 HG21 VAL A 284 7.079 4.194 -4.865 1.00 0.00 H ATOM 1246 HG22 VAL A 284 7.232 5.415 -6.152 1.00 0.00 H ATOM 1247 HG23 VAL A 284 6.620 3.787 -6.536 1.00 0.00 H ATOM 1248 H VAL A 284 9.072 6.485 -6.329 1.00 0.00 H ATOM 1249 N THR A 285 11.777 4.483 -6.590 1.00 41.58 N ATOM 1250 CA THR A 285 13.108 4.002 -6.874 1.00 42.39 C ATOM 1251 C THR A 285 14.062 4.480 -5.790 1.00 42.83 C ATOM 1252 O THR A 285 14.825 3.676 -5.243 1.00 43.14 O ATOM 1253 CB THR A 285 13.604 4.482 -8.246 1.00 42.37 C ATOM 1254 OG1 THR A 285 12.577 4.262 -9.221 1.00 43.10 O ATOM 1255 CG2 THR A 285 14.878 3.741 -8.652 1.00 41.84 C ATOM 1256 HA THR A 285 13.076 2.913 -6.892 1.00 0.00 H ATOM 1257 HB THR A 285 13.835 5.546 -8.187 1.00 0.00 H ATOM 1258 HG1 THR A 285 11.766 4.768 -8.964 1.00 0.00 H ATOM 1259 HG23 THR A 285 15.652 3.915 -7.904 1.00 0.00 H ATOM 1260 HG21 THR A 285 14.670 2.673 -8.720 1.00 0.00 H ATOM 1261 HG22 THR A 285 15.218 4.108 -9.620 1.00 0.00 H ATOM 1262 H THR A 285 11.331 5.164 -7.238 1.00 0.00 H ATOM 1263 N GLU A 286 14.017 5.777 -5.480 1.00 42.94 N ATOM 1264 CA GLU A 286 14.872 6.342 -4.439 1.00 43.33 C ATOM 1265 C GLU A 286 14.608 5.635 -3.114 1.00 43.08 C ATOM 1266 O GLU A 286 15.530 5.404 -2.328 1.00 43.20 O ATOM 1267 CB GLU A 286 14.630 7.841 -4.273 1.00 43.11 C ATOM 1268 CG GLU A 286 15.167 8.729 -5.386 1.00 43.92 C ATOM 1269 CD GLU A 286 15.099 10.228 -5.029 1.00 45.26 C ATOM 1270 OE1 GLU A 286 16.155 10.908 -5.139 1.00 47.91 O ATOM 1271 OE2 GLU A 286 14.004 10.732 -4.636 1.00 46.57 O ATOM 1272 HA GLU A 286 15.909 6.194 -4.739 1.00 0.00 H ATOM 1273 HB2 GLU A 286 13.554 8.001 -4.208 1.00 0.00 H ATOM 1274 HB3 GLU A 286 15.099 8.154 -3.340 1.00 0.00 H ATOM 1275 HG2 GLU A 286 16.206 8.461 -5.577 1.00 0.00 H ATOM 1276 HG3 GLU A 286 14.578 8.557 -6.287 1.00 0.00 H ATOM 1277 H GLU A 286 13.359 6.399 -5.991 1.00 0.00 H ATOM 1278 N LEU A 287 13.348 5.282 -2.874 1.00 42.80 N ATOM 1279 CA LEU A 287 12.973 4.652 -1.618 1.00 42.62 C ATOM 1280 C LEU A 287 13.503 3.244 -1.474 1.00 42.88 C ATOM 1281 O LEU A 287 13.788 2.809 -0.361 1.00 43.07 O ATOM 1282 CB LEU A 287 11.457 4.683 -1.403 1.00 42.38 C ATOM 1283 CG LEU A 287 10.973 5.828 -0.508 1.00 41.85 C ATOM 1284 CD1 LEU A 287 9.543 6.239 -0.834 1.00 42.30 C ATOM 1285 CD2 LEU A 287 11.105 5.450 0.948 1.00 40.05 C ATOM 1286 HA LEU A 287 13.447 5.247 -0.837 1.00 0.00 H ATOM 1287 HB2 LEU A 287 10.975 4.782 -2.376 1.00 0.00 H ATOM 1288 HB3 LEU A 287 11.157 3.740 -0.945 1.00 0.00 H ATOM 1289 HG LEU A 287 11.608 6.692 -0.705 1.00 0.00 H ATOM 1290 HD21 LEU A 287 10.503 4.564 1.148 1.00 0.00 H ATOM 1291 HD22 LEU A 287 12.150 5.239 1.174 1.00 0.00 H ATOM 1292 HD23 LEU A 287 10.757 6.275 1.569 1.00 0.00 H ATOM 1293 HD11 LEU A 287 9.489 6.570 -1.871 1.00 0.00 H ATOM 1294 HD12 LEU A 287 8.879 5.387 -0.688 1.00 0.00 H ATOM 1295 HD13 LEU A 287 9.241 7.053 -0.175 1.00 0.00 H ATOM 1296 H LEU A 287 12.620 5.459 -3.595 1.00 0.00 H ATOM 1297 N THR A 288 13.629 2.532 -2.587 1.00 43.14 N ATOM 1298 CA THR A 288 14.141 1.169 -2.566 1.00 43.58 C ATOM 1299 C THR A 288 15.629 1.170 -2.270 1.00 44.23 C ATOM 1300 O THR A 288 16.093 0.378 -1.451 1.00 44.21 O ATOM 1301 CB THR A 288 13.882 0.449 -3.894 1.00 43.56 C ATOM 1302 OG1 THR A 288 12.543 0.721 -4.319 1.00 43.24 O ATOM 1303 CG2 THR A 288 14.084 -1.062 -3.750 1.00 42.66 C ATOM 1304 HA THR A 288 13.612 0.633 -1.778 1.00 0.00 H ATOM 1305 HB THR A 288 14.592 0.815 -4.636 1.00 0.00 H ATOM 1306 HG1 THR A 288 12.428 1.697 -4.440 1.00 0.00 H ATOM 1307 HG23 THR A 288 15.106 -1.261 -3.426 1.00 0.00 H ATOM 1308 HG21 THR A 288 13.384 -1.452 -3.011 1.00 0.00 H ATOM 1309 HG22 THR A 288 13.905 -1.544 -4.711 1.00 0.00 H ATOM 1310 H THR A 288 13.356 2.958 -3.496 1.00 0.00 H ATOM 1311 N GLU A 289 16.364 2.068 -2.929 1.00 45.26 N ATOM 1312 CA GLU A 289 17.807 2.237 -2.700 1.00 46.56 C ATOM 1313 C GLU A 289 18.104 2.626 -1.241 1.00 46.93 C ATOM 1314 O GLU A 289 19.101 2.186 -0.646 1.00 47.26 O ATOM 1315 CB GLU A 289 18.422 3.255 -3.679 1.00 46.63 C ATOM 1316 CG GLU A 289 18.508 2.795 -5.153 1.00 48.72 C ATOM 1317 CD GLU A 289 19.176 1.421 -5.326 1.00 51.93 C ATOM 1318 OE1 GLU A 289 20.425 1.328 -5.255 1.00 52.66 O ATOM 1319 OE2 GLU A 289 18.444 0.425 -5.537 1.00 53.19 O ATOM 1320 HA GLU A 289 18.277 1.272 -2.890 1.00 0.00 H ATOM 1321 HB2 GLU A 289 17.817 4.161 -3.645 1.00 0.00 H ATOM 1322 HB3 GLU A 289 19.432 3.481 -3.338 1.00 0.00 H ATOM 1323 HG2 GLU A 289 17.497 2.742 -5.558 1.00 0.00 H ATOM 1324 HG3 GLU A 289 19.084 3.532 -5.712 1.00 0.00 H ATOM 1325 H GLU A 289 15.897 2.674 -3.634 1.00 0.00 H ATOM 1326 N PHE A 290 17.212 3.435 -0.676 1.00 47.23 N ATOM 1327 CA PHE A 290 17.248 3.814 0.733 1.00 47.26 C ATOM 1328 C PHE A 290 16.915 2.638 1.657 1.00 47.70 C ATOM 1329 O PHE A 290 17.528 2.512 2.713 1.00 48.09 O ATOM 1330 CB PHE A 290 16.296 4.997 0.971 1.00 46.94 C ATOM 1331 CG PHE A 290 16.029 5.292 2.414 1.00 46.24 C ATOM 1332 CD1 PHE A 290 16.971 5.953 3.187 1.00 45.59 C ATOM 1333 CD2 PHE A 290 14.818 4.924 2.995 1.00 45.90 C ATOM 1334 CE1 PHE A 290 16.723 6.234 4.526 1.00 45.67 C ATOM 1335 CE2 PHE A 290 14.564 5.197 4.333 1.00 45.98 C ATOM 1336 CZ PHE A 290 15.521 5.861 5.101 1.00 45.45 C ATOM 1337 HA PHE A 290 18.266 4.118 0.978 1.00 0.00 H ATOM 1338 HB2 PHE A 290 16.734 5.885 0.516 1.00 0.00 H ATOM 1339 HB3 PHE A 290 15.346 4.774 0.486 1.00 0.00 H ATOM 1340 HD2 PHE A 290 14.063 4.417 2.394 1.00 0.00 H ATOM 1341 HE2 PHE A 290 13.619 4.893 4.782 1.00 0.00 H ATOM 1342 HZ PHE A 290 15.323 6.085 6.149 1.00 0.00 H ATOM 1343 HE1 PHE A 290 17.476 6.748 5.123 1.00 0.00 H ATOM 1344 HD1 PHE A 290 17.918 6.256 2.740 1.00 0.00 H ATOM 1345 H PHE A 290 16.449 3.818 -1.270 1.00 0.00 H ATOM 1346 N ALA A 291 15.959 1.789 1.267 1.00 47.79 N ATOM 1347 CA ALA A 291 15.575 0.629 2.075 1.00 48.39 C ATOM 1348 C ALA A 291 16.719 -0.370 2.192 1.00 49.34 C ATOM 1349 O ALA A 291 16.992 -0.886 3.283 1.00 49.50 O ATOM 1350 CB ALA A 291 14.344 -0.052 1.512 1.00 47.96 C ATOM 1351 HA ALA A 291 15.338 0.998 3.073 1.00 0.00 H ATOM 1352 HB1 ALA A 291 13.513 0.653 1.501 1.00 0.00 H ATOM 1353 HB2 ALA A 291 14.550 -0.389 0.496 1.00 0.00 H ATOM 1354 HB3 ALA A 291 14.087 -0.908 2.136 1.00 0.00 H ATOM 1355 H ALA A 291 15.473 1.957 0.363 1.00 0.00 H ATOM 1356 N LYS A 292 17.382 -0.636 1.065 1.00 50.06 N ATOM 1357 CA LYS A 292 18.544 -1.515 1.027 1.00 50.53 C ATOM 1358 C LYS A 292 19.681 -0.996 1.904 1.00 50.71 C ATOM 1359 O LYS A 292 20.473 -1.784 2.423 1.00 51.23 O ATOM 1360 CB LYS A 292 19.061 -1.650 -0.401 1.00 50.93 C ATOM 1361 CG LYS A 292 18.381 -2.711 -1.252 1.00 51.11 C ATOM 1362 CD LYS A 292 19.144 -2.873 -2.558 1.00 51.10 C ATOM 1363 CE LYS A 292 19.179 -1.568 -3.342 1.00 50.58 C ATOM 1364 NZ LYS A 292 20.172 -1.572 -4.446 1.00 49.17 N ATOM 1365 HA LYS A 292 18.219 -2.483 1.408 1.00 0.00 H ATOM 1366 HB2 LYS A 292 18.930 -0.688 -0.897 1.00 0.00 H ATOM 1367 HB3 LYS A 292 20.123 -1.890 -0.351 1.00 0.00 H ATOM 1368 HG2 LYS A 292 18.373 -3.659 -0.715 1.00 0.00 H ATOM 1369 HG3 LYS A 292 17.356 -2.406 -1.464 1.00 0.00 H ATOM 1370 HD2 LYS A 292 20.165 -3.183 -2.337 1.00 0.00 H ATOM 1371 HD3 LYS A 292 18.656 -3.638 -3.162 1.00 0.00 H ATOM 1372 HE2 LYS A 292 19.428 -0.758 -2.656 1.00 0.00 H ATOM 1373 HE3 LYS A 292 18.190 -1.392 -3.766 1.00 0.00 H ATOM 1374 HZ1 LYS A 292 21.123 -1.729 -4.055 1.00 0.00 H ATOM 1375 HZ2 LYS A 292 19.941 -2.334 -5.115 1.00 0.00 H ATOM 1376 HZ3 LYS A 292 20.145 -0.656 -4.938 1.00 0.00 H ATOM 1377 H LYS A 292 17.057 -0.199 0.179 1.00 0.00 H ATOM 1378 N ALA A 293 19.769 0.323 2.061 1.00 50.54 N ATOM 1379 CA ALA A 293 20.812 0.915 2.896 1.00 50.45 C ATOM 1380 C ALA A 293 20.398 1.036 4.367 1.00 50.65 C ATOM 1381 O ALA A 293 21.072 1.710 5.148 1.00 51.05 O ATOM 1382 CB ALA A 293 21.253 2.257 2.344 1.00 50.13 C ATOM 1383 HA ALA A 293 21.660 0.231 2.866 1.00 0.00 H ATOM 1384 HB1 ALA A 293 21.645 2.123 1.336 1.00 0.00 H ATOM 1385 HB2 ALA A 293 20.400 2.935 2.316 1.00 0.00 H ATOM 1386 HB3 ALA A 293 22.030 2.675 2.985 1.00 0.00 H ATOM 1387 H ALA A 293 19.084 0.942 1.582 1.00 0.00 H ATOM 1388 N ILE A 294 19.296 0.390 4.747 1.00 50.49 N ATOM 1389 CA ILE A 294 18.931 0.296 6.158 1.00 50.32 C ATOM 1390 C ILE A 294 19.551 -0.978 6.705 1.00 50.23 C ATOM 1391 O ILE A 294 19.326 -2.066 6.153 1.00 49.89 O ATOM 1392 CB ILE A 294 17.396 0.289 6.396 1.00 50.53 C ATOM 1393 CG1 ILE A 294 16.765 1.625 5.987 1.00 50.09 C ATOM 1394 CG2 ILE A 294 17.066 -0.020 7.870 1.00 50.56 C ATOM 1395 CD1 ILE A 294 15.269 1.532 5.682 1.00 48.74 C ATOM 1396 HA ILE A 294 19.306 1.181 6.672 1.00 0.00 H ATOM 1397 HB ILE A 294 16.974 -0.498 5.771 1.00 0.00 H ATOM 1398 HG12 ILE A 294 16.907 2.336 6.801 1.00 0.00 H ATOM 1399 HG13 ILE A 294 17.276 1.988 5.095 1.00 0.00 H ATOM 1400 HD11 ILE A 294 15.110 0.833 4.861 1.00 0.00 H ATOM 1401 HD12 ILE A 294 14.740 1.181 6.568 1.00 0.00 H ATOM 1402 HD13 ILE A 294 14.895 2.516 5.400 1.00 0.00 H ATOM 1403 HG21 ILE A 294 17.465 -1.000 8.133 1.00 0.00 H ATOM 1404 HG22 ILE A 294 17.516 0.740 8.509 1.00 0.00 H ATOM 1405 HG23 ILE A 294 15.985 -0.018 8.007 1.00 0.00 H ATOM 1406 H ILE A 294 18.688 -0.053 4.029 1.00 0.00 H ATOM 1407 N PRO A 295 20.354 -0.844 7.779 1.00 50.23 N ATOM 1408 CA PRO A 295 20.973 -2.018 8.359 1.00 50.37 C ATOM 1409 C PRO A 295 19.891 -3.003 8.739 1.00 50.69 C ATOM 1410 O PRO A 295 18.925 -2.629 9.410 1.00 50.51 O ATOM 1411 CB PRO A 295 21.680 -1.468 9.604 1.00 50.20 C ATOM 1412 CG PRO A 295 21.921 -0.059 9.309 1.00 49.72 C ATOM 1413 CD PRO A 295 20.742 0.384 8.498 1.00 50.08 C ATOM 1414 HA PRO A 295 21.660 -2.539 7.692 1.00 0.00 H ATOM 1415 HD3 PRO A 295 19.934 0.734 9.140 1.00 0.00 H ATOM 1416 HD2 PRO A 295 21.020 1.175 7.801 1.00 0.00 H ATOM 1417 HG3 PRO A 295 22.843 0.060 8.739 1.00 0.00 H ATOM 1418 HG2 PRO A 295 21.989 0.518 10.231 1.00 0.00 H ATOM 1419 HB2 PRO A 295 21.045 -1.573 10.484 1.00 0.00 H ATOM 1420 HB3 PRO A 295 22.621 -1.991 9.773 1.00 0.00 H ATOM 1421 N GLY A 296 20.048 -4.241 8.269 1.00 51.24 N ATOM 1422 CA GLY A 296 19.099 -5.314 8.543 1.00 51.78 C ATOM 1423 C GLY A 296 18.191 -5.640 7.369 1.00 52.44 C ATOM 1424 O GLY A 296 17.845 -6.808 7.164 1.00 52.54 O ATOM 1425 HA3 GLY A 296 18.477 -5.017 9.387 1.00 0.00 H ATOM 1426 HA2 GLY A 296 19.660 -6.211 8.805 1.00 0.00 H ATOM 1427 H GLY A 296 20.881 -4.450 7.683 1.00 0.00 H ATOM 1428 N PHE A 297 17.809 -4.615 6.601 1.00 52.85 N ATOM 1429 CA PHE A 297 16.839 -4.777 5.512 1.00 53.41 C ATOM 1430 C PHE A 297 17.267 -5.833 4.488 1.00 53.85 C ATOM 1431 O PHE A 297 16.477 -6.733 4.154 1.00 53.93 O ATOM 1432 CB PHE A 297 16.528 -3.435 4.828 1.00 53.52 C ATOM 1433 CG PHE A 297 15.307 -3.470 3.932 1.00 53.38 C ATOM 1434 CD1 PHE A 297 14.033 -3.252 4.454 1.00 53.16 C ATOM 1435 CD2 PHE A 297 15.432 -3.719 2.563 1.00 53.53 C ATOM 1436 CE1 PHE A 297 12.904 -3.288 3.628 1.00 52.77 C ATOM 1437 CE2 PHE A 297 14.312 -3.760 1.731 1.00 52.79 C ATOM 1438 CZ PHE A 297 13.047 -3.543 2.263 1.00 53.10 C ATOM 1439 HA PHE A 297 15.921 -5.142 5.973 1.00 0.00 H ATOM 1440 HB2 PHE A 297 16.365 -2.685 5.602 1.00 0.00 H ATOM 1441 HB3 PHE A 297 17.389 -3.150 4.224 1.00 0.00 H ATOM 1442 HD2 PHE A 297 16.422 -3.884 2.137 1.00 0.00 H ATOM 1443 HE2 PHE A 297 14.430 -3.962 0.666 1.00 0.00 H ATOM 1444 HZ PHE A 297 12.170 -3.572 1.617 1.00 0.00 H ATOM 1445 HE1 PHE A 297 11.914 -3.117 4.050 1.00 0.00 H ATOM 1446 HD1 PHE A 297 13.915 -3.051 5.519 1.00 0.00 H ATOM 1447 H PHE A 297 18.212 -3.673 6.781 1.00 0.00 H ATOM 1448 N ALA A 298 18.511 -5.735 4.012 1.00 54.11 N ATOM 1449 CA ALA A 298 19.076 -6.734 3.083 1.00 54.65 C ATOM 1450 C ALA A 298 19.025 -8.192 3.609 1.00 55.02 C ATOM 1451 O ALA A 298 18.754 -9.126 2.842 1.00 54.94 O ATOM 1452 CB ALA A 298 20.494 -6.352 2.683 1.00 54.38 C ATOM 1453 HA ALA A 298 18.433 -6.718 2.203 1.00 0.00 H ATOM 1454 HB1 ALA A 298 20.482 -5.379 2.192 1.00 0.00 H ATOM 1455 HB2 ALA A 298 21.121 -6.303 3.574 1.00 0.00 H ATOM 1456 HB3 ALA A 298 20.891 -7.101 1.998 1.00 0.00 H ATOM 1457 H ALA A 298 19.100 -4.930 4.305 1.00 0.00 H ATOM 1458 N ASN A 299 19.256 -8.368 4.915 1.00 55.34 N ATOM 1459 CA ASN A 299 19.266 -9.692 5.553 1.00 55.70 C ATOM 1460 C ASN A 299 17.958 -10.475 5.410 1.00 55.99 C ATOM 1461 O ASN A 299 17.938 -11.689 5.626 1.00 56.34 O ATOM 1462 CB ASN A 299 19.606 -9.587 7.050 1.00 55.72 C ATOM 1463 CG ASN A 299 20.965 -8.946 7.319 1.00 55.55 C ATOM 1464 OD1 ASN A 299 21.874 -8.983 6.483 1.00 55.35 O ATOM 1465 ND2 ASN A 299 21.105 -8.353 8.506 1.00 54.86 N ATOM 1466 HA ASN A 299 20.038 -10.244 5.016 1.00 0.00 H ATOM 1467 HB2 ASN A 299 18.838 -8.987 7.538 1.00 0.00 H ATOM 1468 HB3 ASN A 299 19.606 -10.590 7.476 1.00 0.00 H ATOM 1469 HD22 ASN A 299 20.313 -8.345 9.180 1.00 0.00 H ATOM 1470 HD21 ASN A 299 22.006 -7.898 8.757 1.00 0.00 H ATOM 1471 H ASN A 299 19.437 -7.531 5.505 1.00 0.00 H ATOM 1472 N LEU A 300 16.876 -9.785 5.049 1.00 56.09 N ATOM 1473 CA LEU A 300 15.540 -10.385 5.032 1.00 56.03 C ATOM 1474 C LEU A 300 15.243 -11.122 3.744 1.00 55.92 C ATOM 1475 O LEU A 300 15.768 -10.781 2.681 1.00 55.87 O ATOM 1476 CB LEU A 300 14.473 -9.312 5.234 1.00 56.18 C ATOM 1477 CG LEU A 300 14.385 -8.632 6.596 1.00 56.49 C ATOM 1478 CD1 LEU A 300 13.992 -7.180 6.403 1.00 57.17 C ATOM 1479 CD2 LEU A 300 13.412 -9.359 7.514 1.00 56.32 C ATOM 1480 HA LEU A 300 15.520 -11.107 5.848 1.00 0.00 H ATOM 1481 HB2 LEU A 300 14.654 -8.532 4.494 1.00 0.00 H ATOM 1482 HB3 LEU A 300 13.506 -9.777 5.041 1.00 0.00 H ATOM 1483 HG LEU A 300 15.361 -8.671 7.081 1.00 0.00 H ATOM 1484 HD21 LEU A 300 12.420 -9.361 7.062 1.00 0.00 H ATOM 1485 HD22 LEU A 300 13.749 -10.385 7.659 1.00 0.00 H ATOM 1486 HD23 LEU A 300 13.373 -8.849 8.477 1.00 0.00 H ATOM 1487 HD11 LEU A 300 14.743 -6.680 5.791 1.00 0.00 H ATOM 1488 HD12 LEU A 300 13.024 -7.130 5.905 1.00 0.00 H ATOM 1489 HD13 LEU A 300 13.928 -6.690 7.375 1.00 0.00 H ATOM 1490 H LEU A 300 16.984 -8.789 4.771 1.00 0.00 H ATOM 1491 N ASP A 301 14.374 -12.120 3.856 1.00 55.98 N ATOM 1492 CA ASP A 301 13.881 -12.871 2.718 1.00 56.37 C ATOM 1493 C ASP A 301 13.573 -11.898 1.597 1.00 56.41 C ATOM 1494 O ASP A 301 13.004 -10.824 1.830 1.00 56.61 O ATOM 1495 CB ASP A 301 12.623 -13.658 3.118 1.00 56.52 C ATOM 1496 CG ASP A 301 11.975 -14.413 1.942 1.00 58.31 C ATOM 1497 OD1 ASP A 301 11.250 -15.402 2.202 1.00 59.23 O ATOM 1498 OD2 ASP A 301 12.164 -14.025 0.762 1.00 59.86 O ATOM 1499 HA ASP A 301 14.632 -13.585 2.381 1.00 0.00 H ATOM 1500 HB2 ASP A 301 12.897 -14.382 3.885 1.00 0.00 H ATOM 1501 HB3 ASP A 301 11.892 -12.959 3.525 1.00 0.00 H ATOM 1502 H ASP A 301 14.031 -12.375 4.804 1.00 0.00 H ATOM 1503 N LEU A 302 13.975 -12.275 0.387 1.00 56.29 N ATOM 1504 CA LEU A 302 13.672 -11.517 -0.815 1.00 55.98 C ATOM 1505 C LEU A 302 12.214 -11.036 -0.796 1.00 55.97 C ATOM 1506 O LEU A 302 11.946 -9.836 -0.920 1.00 55.97 O ATOM 1507 CB LEU A 302 13.960 -12.379 -2.043 1.00 55.95 C ATOM 1508 HA LEU A 302 14.306 -10.631 -0.856 1.00 0.00 H ATOM 1509 HB2 LEU A 302 15.012 -12.664 -2.047 1.00 0.00 H ATOM 1510 HB3 LEU A 302 13.340 -13.275 -2.010 1.00 0.00 H ATOM 1511 H LEU A 302 14.530 -13.150 0.297 1.00 0.00 H ATOM 1512 N ASN A 303 11.280 -11.963 -0.582 1.00 55.77 N ATOM 1513 CA ASN A 303 9.848 -11.636 -0.585 1.00 55.68 C ATOM 1514 C ASN A 303 9.337 -10.843 0.625 1.00 55.24 C ATOM 1515 O ASN A 303 8.179 -10.408 0.660 1.00 55.23 O ATOM 1516 CB ASN A 303 9.005 -12.884 -0.828 1.00 55.82 C ATOM 1517 CG ASN A 303 8.606 -13.025 -2.278 1.00 57.10 C ATOM 1518 OD1 ASN A 303 7.773 -12.267 -2.780 1.00 58.45 O ATOM 1519 ND2 ASN A 303 9.203 -13.990 -2.967 1.00 58.47 N ATOM 1520 HA ASN A 303 9.730 -10.944 -1.419 1.00 0.00 H ATOM 1521 HB2 ASN A 303 9.582 -13.761 -0.535 1.00 0.00 H ATOM 1522 HB3 ASN A 303 8.103 -12.824 -0.219 1.00 0.00 H ATOM 1523 HD22 ASN A 303 9.900 -14.606 -2.502 1.00 0.00 H ATOM 1524 HD21 ASN A 303 8.974 -14.130 -3.972 1.00 0.00 H ATOM 1525 H ASN A 303 11.574 -12.945 -0.408 1.00 0.00 H ATOM 1526 N ASP A 304 10.204 -10.661 1.613 1.00 54.45 N ATOM 1527 CA ASP A 304 9.910 -9.761 2.712 1.00 53.48 C ATOM 1528 C ASP A 304 10.397 -8.358 2.342 1.00 52.51 C ATOM 1529 O ASP A 304 9.760 -7.358 2.675 1.00 52.20 O ATOM 1530 CB ASP A 304 10.547 -10.265 4.014 1.00 53.67 C ATOM 1531 CG ASP A 304 9.622 -11.188 4.810 1.00 54.06 C ATOM 1532 OD1 ASP A 304 8.411 -11.271 4.497 1.00 54.83 O ATOM 1533 OD2 ASP A 304 10.111 -11.824 5.770 1.00 54.54 O ATOM 1534 HA ASP A 304 8.835 -9.724 2.885 1.00 0.00 H ATOM 1535 HB2 ASP A 304 11.457 -10.812 3.767 1.00 0.00 H ATOM 1536 HB3 ASP A 304 10.799 -9.405 4.634 1.00 0.00 H ATOM 1537 H ASP A 304 11.110 -11.172 1.599 1.00 0.00 H ATOM 1538 N GLN A 305 11.513 -8.293 1.627 1.00 51.34 N ATOM 1539 CA GLN A 305 12.027 -7.021 1.141 1.00 50.65 C ATOM 1540 C GLN A 305 11.071 -6.376 0.138 1.00 50.23 C ATOM 1541 O GLN A 305 11.038 -5.159 0.003 1.00 50.08 O ATOM 1542 CB GLN A 305 13.411 -7.198 0.511 1.00 50.65 C ATOM 1543 CG GLN A 305 14.513 -7.437 1.519 1.00 50.32 C ATOM 1544 CD GLN A 305 15.901 -7.434 0.899 1.00 50.54 C ATOM 1545 OE1 GLN A 305 16.313 -6.458 0.263 1.00 49.01 O ATOM 1546 NE2 GLN A 305 16.642 -8.527 1.104 1.00 49.79 N ATOM 1547 HA GLN A 305 12.114 -6.356 2.000 1.00 0.00 H ATOM 1548 HB2 GLN A 305 13.374 -8.051 -0.167 1.00 0.00 H ATOM 1549 HB3 GLN A 305 13.650 -6.297 -0.053 1.00 0.00 H ATOM 1550 HG2 GLN A 305 14.469 -6.652 2.274 1.00 0.00 H ATOM 1551 HG3 GLN A 305 14.346 -8.405 1.992 1.00 0.00 H ATOM 1552 HE22 GLN A 305 16.253 -9.325 1.646 1.00 0.00 H ATOM 1553 HE21 GLN A 305 17.608 -8.580 0.722 1.00 0.00 H ATOM 1554 H GLN A 305 12.031 -9.168 1.410 1.00 0.00 H ATOM 1555 N VAL A 306 10.290 -7.197 -0.555 1.00 49.68 N ATOM 1556 CA VAL A 306 9.326 -6.686 -1.520 1.00 48.81 C ATOM 1557 C VAL A 306 8.009 -6.271 -0.853 1.00 48.36 C ATOM 1558 O VAL A 306 7.322 -5.358 -1.320 1.00 48.41 O ATOM 1559 CB VAL A 306 9.067 -7.697 -2.661 1.00 48.80 C ATOM 1560 CG1 VAL A 306 8.319 -7.035 -3.796 1.00 48.44 C ATOM 1561 CG2 VAL A 306 10.376 -8.255 -3.182 1.00 48.56 C ATOM 1562 HA VAL A 306 9.770 -5.792 -1.958 1.00 0.00 H ATOM 1563 HB VAL A 306 8.463 -8.511 -2.260 1.00 0.00 H ATOM 1564 HG11 VAL A 306 7.363 -6.661 -3.430 1.00 0.00 H ATOM 1565 HG12 VAL A 306 8.910 -6.206 -4.184 1.00 0.00 H ATOM 1566 HG13 VAL A 306 8.146 -7.763 -4.589 1.00 0.00 H ATOM 1567 HG21 VAL A 306 10.991 -7.440 -3.563 1.00 0.00 H ATOM 1568 HG22 VAL A 306 10.902 -8.761 -2.372 1.00 0.00 H ATOM 1569 HG23 VAL A 306 10.173 -8.964 -3.984 1.00 0.00 H ATOM 1570 H VAL A 306 10.368 -8.223 -0.406 1.00 0.00 H ATOM 1571 N THR A 307 7.654 -6.930 0.241 1.00 47.70 N ATOM 1572 CA THR A 307 6.366 -6.649 0.875 1.00 47.06 C ATOM 1573 C THR A 307 6.378 -5.371 1.725 1.00 46.73 C ATOM 1574 O THR A 307 5.449 -4.560 1.639 1.00 46.57 O ATOM 1575 CB THR A 307 5.855 -7.851 1.667 1.00 46.85 C ATOM 1576 OG1 THR A 307 5.763 -8.973 0.784 1.00 47.05 O ATOM 1577 CG2 THR A 307 4.474 -7.572 2.234 1.00 47.00 C ATOM 1578 HA THR A 307 5.663 -6.463 0.063 1.00 0.00 H ATOM 1579 HB THR A 307 6.543 -8.052 2.488 1.00 0.00 H ATOM 1580 HG1 THR A 307 6.658 -9.171 0.409 1.00 0.00 H ATOM 1581 HG23 THR A 307 4.526 -6.719 2.910 1.00 0.00 H ATOM 1582 HG21 THR A 307 3.786 -7.350 1.418 1.00 0.00 H ATOM 1583 HG22 THR A 307 4.123 -8.448 2.779 1.00 0.00 H ATOM 1584 H THR A 307 8.290 -7.645 0.648 1.00 0.00 H ATOM 1585 N LEU A 308 7.432 -5.192 2.526 1.00 46.03 N ATOM 1586 CA LEU A 308 7.587 -3.994 3.353 1.00 45.12 C ATOM 1587 C LEU A 308 7.580 -2.781 2.447 1.00 44.65 C ATOM 1588 O LEU A 308 6.952 -1.754 2.752 1.00 44.66 O ATOM 1589 CB LEU A 308 8.893 -4.033 4.153 1.00 44.84 C ATOM 1590 CG LEU A 308 9.148 -5.222 5.078 1.00 45.30 C ATOM 1591 CD1 LEU A 308 10.582 -5.219 5.584 1.00 45.35 C ATOM 1592 CD2 LEU A 308 8.154 -5.274 6.235 1.00 45.41 C ATOM 1593 HA LEU A 308 6.763 -3.947 4.065 1.00 0.00 H ATOM 1594 HB2 LEU A 308 9.712 -4.003 3.434 1.00 0.00 H ATOM 1595 HB3 LEU A 308 8.920 -3.134 4.769 1.00 0.00 H ATOM 1596 HG LEU A 308 8.997 -6.127 4.489 1.00 0.00 H ATOM 1597 HD21 LEU A 308 8.237 -4.361 6.825 1.00 0.00 H ATOM 1598 HD22 LEU A 308 7.142 -5.362 5.839 1.00 0.00 H ATOM 1599 HD23 LEU A 308 8.376 -6.136 6.864 1.00 0.00 H ATOM 1600 HD11 LEU A 308 11.265 -5.281 4.737 1.00 0.00 H ATOM 1601 HD12 LEU A 308 10.769 -4.298 6.137 1.00 0.00 H ATOM 1602 HD13 LEU A 308 10.736 -6.076 6.240 1.00 0.00 H ATOM 1603 H LEU A 308 8.166 -5.928 2.563 1.00 0.00 H ATOM 1604 N LEU A 309 8.280 -2.922 1.325 1.00 43.86 N ATOM 1605 CA LEU A 309 8.366 -1.874 0.327 1.00 43.09 C ATOM 1606 C LEU A 309 7.042 -1.582 -0.362 1.00 42.52 C ATOM 1607 O LEU A 309 6.779 -0.448 -0.716 1.00 42.21 O ATOM 1608 CB LEU A 309 9.440 -2.211 -0.696 1.00 42.85 C ATOM 1609 CG LEU A 309 10.776 -1.644 -0.231 1.00 42.81 C ATOM 1610 CD1 LEU A 309 11.916 -2.172 -1.083 1.00 42.21 C ATOM 1611 CD2 LEU A 309 10.743 -0.110 -0.249 1.00 42.95 C ATOM 1612 HA LEU A 309 8.637 -0.961 0.857 1.00 0.00 H ATOM 1613 HB2 LEU A 309 9.519 -3.293 -0.798 1.00 0.00 H ATOM 1614 HB3 LEU A 309 9.175 -1.775 -1.659 1.00 0.00 H ATOM 1615 HG LEU A 309 10.948 -1.971 0.795 1.00 0.00 H ATOM 1616 HD21 LEU A 309 10.544 0.236 -1.263 1.00 0.00 H ATOM 1617 HD22 LEU A 309 9.956 0.243 0.418 1.00 0.00 H ATOM 1618 HD23 LEU A 309 11.705 0.277 0.086 1.00 0.00 H ATOM 1619 HD11 LEU A 309 11.951 -3.259 -1.008 1.00 0.00 H ATOM 1620 HD12 LEU A 309 11.755 -1.884 -2.122 1.00 0.00 H ATOM 1621 HD13 LEU A 309 12.857 -1.751 -0.729 1.00 0.00 H ATOM 1622 H LEU A 309 8.784 -3.816 1.158 1.00 0.00 H ATOM 1623 N LYS A 310 6.222 -2.613 -0.536 1.00 42.26 N ATOM 1624 CA LYS A 310 4.931 -2.506 -1.203 1.00 41.89 C ATOM 1625 C LYS A 310 4.013 -1.605 -0.391 1.00 41.88 C ATOM 1626 O LYS A 310 3.502 -0.598 -0.893 1.00 42.04 O ATOM 1627 CB LYS A 310 4.324 -3.899 -1.354 1.00 41.91 C ATOM 1628 CG LYS A 310 3.284 -4.041 -2.430 1.00 41.46 C ATOM 1629 CD LYS A 310 2.670 -5.434 -2.361 1.00 42.10 C ATOM 1630 CE LYS A 310 1.193 -5.424 -2.732 1.00 41.87 C ATOM 1631 NZ LYS A 310 0.964 -4.725 -4.028 1.00 42.71 N ATOM 1632 HA LYS A 310 5.059 -2.069 -2.194 1.00 0.00 H ATOM 1633 HB2 LYS A 310 5.133 -4.595 -1.575 1.00 0.00 H ATOM 1634 HB3 LYS A 310 3.863 -4.169 -0.404 1.00 0.00 H ATOM 1635 HG2 LYS A 310 2.505 -3.292 -2.284 1.00 0.00 H ATOM 1636 HG3 LYS A 310 3.748 -3.896 -3.406 1.00 0.00 H ATOM 1637 HD2 LYS A 310 3.202 -6.088 -3.051 1.00 0.00 H ATOM 1638 HD3 LYS A 310 2.776 -5.816 -1.346 1.00 0.00 H ATOM 1639 HE2 LYS A 310 0.634 -4.912 -1.949 1.00 0.00 H ATOM 1640 HE3 LYS A 310 0.841 -6.452 -2.816 1.00 0.00 H ATOM 1641 HZ1 LYS A 310 1.293 -3.741 -3.953 1.00 0.00 H ATOM 1642 HZ2 LYS A 310 1.491 -5.212 -4.781 1.00 0.00 H ATOM 1643 HZ3 LYS A 310 -0.052 -4.736 -4.252 1.00 0.00 H ATOM 1644 H LYS A 310 6.517 -3.544 -0.178 1.00 0.00 H ATOM 1645 N TYR A 311 3.843 -1.939 0.882 1.00 41.89 N ATOM 1646 CA TYR A 311 2.914 -1.212 1.738 1.00 41.83 C ATOM 1647 C TYR A 311 3.507 0.072 2.332 1.00 41.45 C ATOM 1648 O TYR A 311 2.767 0.978 2.759 1.00 42.16 O ATOM 1649 CB TYR A 311 2.341 -2.139 2.814 1.00 42.33 C ATOM 1650 CG TYR A 311 1.495 -3.274 2.261 1.00 43.06 C ATOM 1651 CD1 TYR A 311 2.068 -4.507 1.946 1.00 43.43 C ATOM 1652 CD2 TYR A 311 0.118 -3.109 2.044 1.00 44.11 C ATOM 1653 CE1 TYR A 311 1.292 -5.561 1.430 1.00 44.78 C ATOM 1654 CE2 TYR A 311 -0.672 -4.151 1.532 1.00 44.34 C ATOM 1655 CZ TYR A 311 -0.078 -5.380 1.229 1.00 44.56 C ATOM 1656 OH TYR A 311 -0.839 -6.420 0.725 1.00 43.52 O ATOM 1657 HA TYR A 311 2.094 -0.875 1.104 1.00 0.00 H ATOM 1658 HB3 TYR A 311 1.722 -1.544 3.486 1.00 0.00 H ATOM 1659 HB2 TYR A 311 3.171 -2.570 3.374 1.00 0.00 H ATOM 1660 HD2 TYR A 311 -0.348 -2.152 2.278 1.00 0.00 H ATOM 1661 HE2 TYR A 311 -1.740 -4.003 1.372 1.00 0.00 H ATOM 1662 HE1 TYR A 311 1.759 -6.516 1.188 1.00 0.00 H ATOM 1663 HD1 TYR A 311 3.136 -4.656 2.103 1.00 0.00 H ATOM 1664 HH TYR A 311 -1.253 -6.140 -0.130 1.00 0.00 H ATOM 1665 H TYR A 311 4.383 -2.735 1.277 1.00 0.00 H ATOM 1666 N GLY A 312 4.829 0.184 2.314 1.00 40.36 N ATOM 1667 CA GLY A 312 5.482 1.355 2.883 1.00 39.47 C ATOM 1668 C GLY A 312 5.630 2.573 1.982 1.00 38.90 C ATOM 1669 O GLY A 312 5.478 3.718 2.438 1.00 38.57 O ATOM 1670 HA3 GLY A 312 6.482 1.054 3.196 1.00 0.00 H ATOM 1671 HA2 GLY A 312 4.906 1.660 3.757 1.00 0.00 H ATOM 1672 H GLY A 312 5.404 -0.571 1.890 1.00 0.00 H ATOM 1673 N VAL A 313 5.915 2.335 0.704 1.00 38.23 N ATOM 1674 CA VAL A 313 6.388 3.410 -0.179 1.00 37.91 C ATOM 1675 C VAL A 313 5.478 4.635 -0.220 1.00 37.56 C ATOM 1676 O VAL A 313 5.964 5.767 -0.198 1.00 37.23 O ATOM 1677 CB VAL A 313 6.752 2.918 -1.621 1.00 37.87 C ATOM 1678 CG1 VAL A 313 8.088 2.185 -1.609 1.00 37.88 C ATOM 1679 CG2 VAL A 313 5.641 2.049 -2.233 1.00 37.99 C ATOM 1680 HA VAL A 313 7.315 3.739 0.290 1.00 0.00 H ATOM 1681 HB VAL A 313 6.846 3.797 -2.258 1.00 0.00 H ATOM 1682 HG11 VAL A 313 8.868 2.859 -1.255 1.00 0.00 H ATOM 1683 HG12 VAL A 313 8.022 1.323 -0.945 1.00 0.00 H ATOM 1684 HG13 VAL A 313 8.326 1.850 -2.618 1.00 0.00 H ATOM 1685 HG21 VAL A 313 5.480 1.173 -1.605 1.00 0.00 H ATOM 1686 HG22 VAL A 313 4.720 2.629 -2.294 1.00 0.00 H ATOM 1687 HG23 VAL A 313 5.939 1.732 -3.232 1.00 0.00 H ATOM 1688 H VAL A 313 5.801 1.373 0.324 1.00 0.00 H ATOM 1689 N TYR A 314 4.170 4.409 -0.252 1.00 37.29 N ATOM 1690 CA TYR A 314 3.233 5.530 -0.292 1.00 37.69 C ATOM 1691 C TYR A 314 3.170 6.300 1.017 1.00 37.14 C ATOM 1692 O TYR A 314 3.317 7.530 1.022 1.00 37.22 O ATOM 1693 CB TYR A 314 1.838 5.102 -0.766 1.00 37.86 C ATOM 1694 CG TYR A 314 1.734 5.084 -2.277 1.00 38.07 C ATOM 1695 CD1 TYR A 314 1.617 3.884 -2.970 1.00 39.80 C ATOM 1696 CD2 TYR A 314 1.784 6.264 -3.014 1.00 37.08 C ATOM 1697 CE1 TYR A 314 1.534 3.862 -4.372 1.00 39.71 C ATOM 1698 CE2 TYR A 314 1.711 6.254 -4.402 1.00 37.46 C ATOM 1699 CZ TYR A 314 1.586 5.050 -5.078 1.00 38.42 C ATOM 1700 OH TYR A 314 1.490 5.027 -6.456 1.00 38.25 O ATOM 1701 HA TYR A 314 3.630 6.222 -1.035 1.00 0.00 H ATOM 1702 HB3 TYR A 314 1.101 5.801 -0.370 1.00 0.00 H ATOM 1703 HB2 TYR A 314 1.628 4.102 -0.386 1.00 0.00 H ATOM 1704 HD2 TYR A 314 1.882 7.216 -2.492 1.00 0.00 H ATOM 1705 HE2 TYR A 314 1.752 7.191 -4.958 1.00 0.00 H ATOM 1706 HE1 TYR A 314 1.429 2.914 -4.900 1.00 0.00 H ATOM 1707 HD1 TYR A 314 1.589 2.945 -2.416 1.00 0.00 H ATOM 1708 HH TYR A 314 0.692 5.540 -6.739 1.00 0.00 H ATOM 1709 H TYR A 314 3.812 3.433 -0.249 1.00 0.00 H ATOM 1710 N GLU A 315 2.974 5.580 2.119 1.00 36.37 N ATOM 1711 CA GLU A 315 3.045 6.196 3.434 1.00 35.67 C ATOM 1712 C GLU A 315 4.299 7.072 3.490 1.00 35.40 C ATOM 1713 O GLU A 315 4.264 8.190 3.986 1.00 35.74 O ATOM 1714 CB GLU A 315 3.065 5.140 4.542 1.00 35.25 C ATOM 1715 CG GLU A 315 1.831 4.263 4.573 1.00 35.25 C ATOM 1716 CD GLU A 315 1.789 3.337 5.765 1.00 34.79 C ATOM 1717 OE1 GLU A 315 2.637 3.491 6.664 1.00 35.07 O ATOM 1718 OE2 GLU A 315 0.906 2.453 5.806 1.00 34.08 O ATOM 1719 HA GLU A 315 2.158 6.809 3.597 1.00 0.00 H ATOM 1720 HB2 GLU A 315 3.936 4.502 4.394 1.00 0.00 H ATOM 1721 HB3 GLU A 315 3.149 5.650 5.502 1.00 0.00 H ATOM 1722 HG2 GLU A 315 0.950 4.905 4.601 1.00 0.00 H ATOM 1723 HG3 GLU A 315 1.811 3.660 3.665 1.00 0.00 H ATOM 1724 H GLU A 315 2.767 4.564 2.038 1.00 0.00 H ATOM 1725 N ALA A 316 5.390 6.569 2.933 1.00 34.83 N ATOM 1726 CA ALA A 316 6.662 7.277 2.940 1.00 34.39 C ATOM 1727 C ALA A 316 6.701 8.426 1.933 1.00 34.21 C ATOM 1728 O ALA A 316 7.263 9.488 2.221 1.00 34.24 O ATOM 1729 CB ALA A 316 7.807 6.298 2.683 1.00 34.42 C ATOM 1730 HA ALA A 316 6.780 7.722 3.928 1.00 0.00 H ATOM 1731 HB1 ALA A 316 7.815 5.537 3.464 1.00 0.00 H ATOM 1732 HB2 ALA A 316 7.666 5.823 1.712 1.00 0.00 H ATOM 1733 HB3 ALA A 316 8.754 6.838 2.690 1.00 0.00 H ATOM 1734 H ALA A 316 5.336 5.637 2.475 1.00 0.00 H ATOM 1735 N ILE A 317 6.114 8.222 0.756 1.00 33.77 N ATOM 1736 CA ILE A 317 6.066 9.294 -0.230 1.00 33.57 C ATOM 1737 C ILE A 317 5.335 10.482 0.367 1.00 33.59 C ATOM 1738 O ILE A 317 5.828 11.608 0.311 1.00 34.13 O ATOM 1739 CB ILE A 317 5.404 8.855 -1.549 1.00 33.81 C ATOM 1740 CG1 ILE A 317 6.413 8.089 -2.403 1.00 33.52 C ATOM 1741 CG2 ILE A 317 4.848 10.066 -2.334 1.00 33.06 C ATOM 1742 CD1 ILE A 317 5.781 6.989 -3.250 1.00 33.32 C ATOM 1743 HA ILE A 317 7.090 9.571 -0.479 1.00 0.00 H ATOM 1744 HB ILE A 317 4.564 8.204 -1.308 1.00 0.00 H ATOM 1745 HG12 ILE A 317 6.909 8.795 -3.068 1.00 0.00 H ATOM 1746 HG13 ILE A 317 7.151 7.635 -1.742 1.00 0.00 H ATOM 1747 HD11 ILE A 317 5.289 6.267 -2.598 1.00 0.00 H ATOM 1748 HD12 ILE A 317 5.047 7.429 -3.926 1.00 0.00 H ATOM 1749 HD13 ILE A 317 6.556 6.488 -3.830 1.00 0.00 H ATOM 1750 HG21 ILE A 317 4.102 10.580 -1.727 1.00 0.00 H ATOM 1751 HG22 ILE A 317 5.663 10.751 -2.567 1.00 0.00 H ATOM 1752 HG23 ILE A 317 4.388 9.718 -3.259 1.00 0.00 H ATOM 1753 H ILE A 317 5.690 7.297 0.540 1.00 0.00 H ATOM 1754 N PHE A 318 4.180 10.237 0.970 1.00 33.32 N ATOM 1755 CA PHE A 318 3.392 11.348 1.479 1.00 33.26 C ATOM 1756 C PHE A 318 3.997 12.014 2.708 1.00 33.50 C ATOM 1757 O PHE A 318 3.819 13.216 2.916 1.00 33.92 O ATOM 1758 CB PHE A 318 1.948 10.941 1.683 1.00 32.65 C ATOM 1759 CG PHE A 318 1.289 10.485 0.420 1.00 32.21 C ATOM 1760 CD1 PHE A 318 1.268 11.315 -0.709 1.00 31.50 C ATOM 1761 CD2 PHE A 318 0.687 9.234 0.345 1.00 30.47 C ATOM 1762 CE1 PHE A 318 0.661 10.904 -1.886 1.00 30.24 C ATOM 1763 CE2 PHE A 318 0.066 8.821 -0.829 1.00 29.67 C ATOM 1764 CZ PHE A 318 0.062 9.647 -1.947 1.00 29.89 C ATOM 1765 HA PHE A 318 3.411 12.121 0.711 1.00 0.00 H ATOM 1766 HB2 PHE A 318 1.915 10.127 2.407 1.00 0.00 H ATOM 1767 HB3 PHE A 318 1.397 11.796 2.074 1.00 0.00 H ATOM 1768 HD2 PHE A 318 0.702 8.573 1.211 1.00 0.00 H ATOM 1769 HE2 PHE A 318 -0.419 7.846 -0.873 1.00 0.00 H ATOM 1770 HZ PHE A 318 -0.409 9.312 -2.871 1.00 0.00 H ATOM 1771 HE1 PHE A 318 0.652 11.559 -2.757 1.00 0.00 H ATOM 1772 HD1 PHE A 318 1.736 12.298 -0.661 1.00 0.00 H ATOM 1773 H PHE A 318 3.841 9.260 1.078 1.00 0.00 H ATOM 1774 N ALA A 319 4.757 11.264 3.490 1.00 33.47 N ATOM 1775 CA ALA A 319 5.438 11.881 4.620 1.00 34.13 C ATOM 1776 C ALA A 319 6.541 12.832 4.144 1.00 34.26 C ATOM 1777 O ALA A 319 6.678 13.940 4.670 1.00 33.65 O ATOM 1778 CB ALA A 319 5.988 10.827 5.581 1.00 33.84 C ATOM 1779 HA ALA A 319 4.704 12.471 5.169 1.00 0.00 H ATOM 1780 HB1 ALA A 319 5.167 10.219 5.961 1.00 0.00 H ATOM 1781 HB2 ALA A 319 6.698 10.191 5.053 1.00 0.00 H ATOM 1782 HB3 ALA A 319 6.490 11.322 6.412 1.00 0.00 H ATOM 1783 H ALA A 319 4.867 10.247 3.300 1.00 0.00 H ATOM 1784 N MET A 320 7.296 12.403 3.127 1.00 34.92 N ATOM 1785 CA MET A 320 8.398 13.219 2.557 1.00 35.40 C ATOM 1786 C MET A 320 7.879 14.324 1.662 1.00 35.26 C ATOM 1787 O MET A 320 8.517 15.363 1.537 1.00 35.46 O ATOM 1788 CB MET A 320 9.396 12.365 1.788 1.00 34.72 C ATOM 1789 CG MET A 320 10.242 11.490 2.682 1.00 36.05 C ATOM 1790 SD MET A 320 11.484 10.568 1.767 1.00 36.89 S ATOM 1791 CE MET A 320 10.408 9.711 0.596 1.00 37.72 C ATOM 1792 HA MET A 320 8.909 13.672 3.406 1.00 0.00 H ATOM 1793 HB2 MET A 320 8.846 11.726 1.097 1.00 0.00 H ATOM 1794 HB3 MET A 320 10.055 13.025 1.224 1.00 0.00 H ATOM 1795 HG2 MET A 320 9.591 10.784 3.198 1.00 0.00 H ATOM 1796 HG3 MET A 320 10.744 12.121 3.415 1.00 0.00 H ATOM 1797 HE1 MET A 320 9.700 9.089 1.143 1.00 0.00 H ATOM 1798 HE2 MET A 320 9.864 10.444 0.000 1.00 0.00 H ATOM 1799 HE3 MET A 320 11.013 9.085 -0.060 1.00 0.00 H ATOM 1800 H MET A 320 7.105 11.465 2.721 1.00 0.00 H ATOM 1801 N LEU A 321 6.719 14.087 1.054 1.00 35.40 N ATOM 1802 CA LEU A 321 6.009 15.094 0.279 1.00 35.98 C ATOM 1803 C LEU A 321 5.767 16.373 1.074 1.00 36.47 C ATOM 1804 O LEU A 321 5.660 17.449 0.497 1.00 36.58 O ATOM 1805 CB LEU A 321 4.657 14.539 -0.195 1.00 36.20 C ATOM 1806 CG LEU A 321 3.976 15.188 -1.403 1.00 35.86 C ATOM 1807 CD1 LEU A 321 4.906 15.187 -2.624 1.00 34.71 C ATOM 1808 CD2 LEU A 321 2.675 14.467 -1.708 1.00 35.44 C ATOM 1809 HA LEU A 321 6.640 15.340 -0.575 1.00 0.00 H ATOM 1810 HB2 LEU A 321 4.810 13.488 -0.439 1.00 0.00 H ATOM 1811 HB3 LEU A 321 3.966 14.619 0.644 1.00 0.00 H ATOM 1812 HG LEU A 321 3.752 16.227 -1.163 1.00 0.00 H ATOM 1813 HD21 LEU A 321 2.884 13.421 -1.930 1.00 0.00 H ATOM 1814 HD22 LEU A 321 2.014 14.531 -0.843 1.00 0.00 H ATOM 1815 HD23 LEU A 321 2.196 14.934 -2.568 1.00 0.00 H ATOM 1816 HD11 LEU A 321 5.812 15.747 -2.390 1.00 0.00 H ATOM 1817 HD12 LEU A 321 5.168 14.160 -2.879 1.00 0.00 H ATOM 1818 HD13 LEU A 321 4.397 15.654 -3.467 1.00 0.00 H ATOM 1819 H LEU A 321 6.301 13.138 1.136 1.00 0.00 H ATOM 1820 N SER A 322 5.672 16.252 2.396 1.00 37.04 N ATOM 1821 CA SER A 322 5.394 17.406 3.233 1.00 37.85 C ATOM 1822 C SER A 322 6.554 18.375 3.154 1.00 38.40 C ATOM 1823 O SER A 322 6.347 19.587 3.179 1.00 38.97 O ATOM 1824 CB SER A 322 5.133 16.993 4.675 1.00 37.87 C ATOM 1825 OG SER A 322 4.072 16.059 4.727 1.00 38.72 O ATOM 1826 HA SER A 322 4.491 17.895 2.867 1.00 0.00 H ATOM 1827 HB2 SER A 322 4.868 17.873 5.261 1.00 0.00 H ATOM 1828 HB3 SER A 322 6.034 16.540 5.090 1.00 0.00 H ATOM 1829 HG SER A 322 4.313 15.258 4.197 1.00 0.00 H ATOM 1830 H SER A 322 5.799 15.318 2.836 1.00 0.00 H ATOM 1831 N SER A 323 7.764 17.831 3.021 1.00 38.61 N ATOM 1832 CA SER A 323 8.982 18.629 2.912 1.00 39.05 C ATOM 1833 C SER A 323 8.936 19.684 1.804 1.00 39.46 C ATOM 1834 O SER A 323 9.521 20.756 1.959 1.00 39.33 O ATOM 1835 CB SER A 323 10.193 17.723 2.699 1.00 38.94 C ATOM 1836 OG SER A 323 10.318 16.812 3.773 1.00 39.19 O ATOM 1837 HA SER A 323 9.067 19.168 3.856 1.00 0.00 H ATOM 1838 HB2 SER A 323 11.094 18.334 2.638 1.00 0.00 H ATOM 1839 HB3 SER A 323 10.069 17.168 1.769 1.00 0.00 H ATOM 1840 HG SER A 323 11.106 16.232 3.622 1.00 0.00 H ATOM 1841 H SER A 323 7.844 16.794 2.994 1.00 0.00 H ATOM 1842 N VAL A 324 8.248 19.373 0.700 1.00 39.83 N ATOM 1843 CA VAL A 324 8.247 20.237 -0.487 1.00 40.12 C ATOM 1844 C VAL A 324 6.926 20.979 -0.644 1.00 40.42 C ATOM 1845 O VAL A 324 6.648 21.582 -1.678 1.00 40.09 O ATOM 1846 CB VAL A 324 8.568 19.452 -1.775 1.00 40.00 C ATOM 1847 CG1 VAL A 324 9.925 18.800 -1.662 1.00 40.53 C ATOM 1848 CG2 VAL A 324 7.504 18.413 -2.058 1.00 40.01 C ATOM 1849 HA VAL A 324 9.038 20.970 -0.331 1.00 0.00 H ATOM 1850 HB VAL A 324 8.582 20.154 -2.609 1.00 0.00 H ATOM 1851 HG11 VAL A 324 10.684 19.568 -1.512 1.00 0.00 H ATOM 1852 HG12 VAL A 324 9.928 18.114 -0.815 1.00 0.00 H ATOM 1853 HG13 VAL A 324 10.139 18.249 -2.578 1.00 0.00 H ATOM 1854 HG21 VAL A 324 7.452 17.712 -1.225 1.00 0.00 H ATOM 1855 HG22 VAL A 324 6.540 18.906 -2.180 1.00 0.00 H ATOM 1856 HG23 VAL A 324 7.757 17.875 -2.972 1.00 0.00 H ATOM 1857 H VAL A 324 7.696 18.491 0.682 1.00 0.00 H ATOM 1858 N MET A 325 6.113 20.920 0.400 1.00 40.98 N ATOM 1859 CA MET A 325 4.840 21.600 0.408 1.00 41.21 C ATOM 1860 C MET A 325 4.841 22.699 1.453 1.00 42.29 C ATOM 1861 O MET A 325 5.456 22.560 2.506 1.00 42.15 O ATOM 1862 CB MET A 325 3.731 20.615 0.749 1.00 41.22 C ATOM 1863 CG MET A 325 3.399 19.612 -0.328 1.00 40.17 C ATOM 1864 SD MET A 325 2.089 18.611 0.351 1.00 39.42 S ATOM 1865 CE MET A 325 1.220 18.015 -1.086 1.00 40.63 C ATOM 1866 HA MET A 325 4.672 22.029 -0.580 1.00 0.00 H ATOM 1867 HB2 MET A 325 4.033 20.064 1.640 1.00 0.00 H ATOM 1868 HB3 MET A 325 2.829 21.187 0.966 1.00 0.00 H ATOM 1869 HG2 MET A 325 4.269 18.997 -0.559 1.00 0.00 H ATOM 1870 HG3 MET A 325 3.063 20.119 -1.232 1.00 0.00 H ATOM 1871 HE1 MET A 325 0.839 18.862 -1.656 1.00 0.00 H ATOM 1872 HE2 MET A 325 1.903 17.435 -1.707 1.00 0.00 H ATOM 1873 HE3 MET A 325 0.389 17.384 -0.771 1.00 0.00 H ATOM 1874 H MET A 325 6.399 20.370 1.235 1.00 0.00 H ATOM 1875 N ASN A 326 4.173 23.802 1.131 1.00 43.60 N ATOM 1876 CA ASN A 326 3.649 24.721 2.141 1.00 44.85 C ATOM 1877 C ASN A 326 2.163 24.951 1.868 1.00 45.98 C ATOM 1878 O ASN A 326 1.554 24.185 1.119 1.00 46.33 O ATOM 1879 CB ASN A 326 4.443 26.031 2.210 1.00 44.64 C ATOM 1880 CG ASN A 326 4.452 26.796 0.893 1.00 44.60 C ATOM 1881 OD1 ASN A 326 3.494 26.760 0.114 1.00 45.31 O ATOM 1882 ND2 ASN A 326 5.538 27.511 0.651 1.00 43.83 N ATOM 1883 HA ASN A 326 3.764 24.271 3.127 1.00 0.00 H ATOM 1884 HB2 ASN A 326 3.999 26.666 2.977 1.00 0.00 H ATOM 1885 HB3 ASN A 326 5.472 25.799 2.483 1.00 0.00 H ATOM 1886 HD22 ASN A 326 6.322 27.513 1.334 1.00 0.00 H ATOM 1887 HD21 ASN A 326 5.608 28.071 -0.222 1.00 0.00 H ATOM 1888 H ASN A 326 4.017 24.019 0.126 1.00 0.00 H ATOM 1889 N LYS A 327 1.578 25.991 2.466 1.00 47.68 N ATOM 1890 CA LYS A 327 0.127 26.253 2.343 1.00 48.80 C ATOM 1891 C LYS A 327 -0.289 26.713 0.952 1.00 49.38 C ATOM 1892 O LYS A 327 -1.445 26.533 0.569 1.00 49.58 O ATOM 1893 CB LYS A 327 -0.352 27.249 3.399 1.00 48.79 C ATOM 1894 CG LYS A 327 0.435 28.557 3.440 1.00 50.48 C ATOM 1895 CD LYS A 327 0.398 29.181 4.841 1.00 52.60 C ATOM 1896 CE LYS A 327 1.212 30.465 4.911 1.00 53.53 C ATOM 1897 NZ LYS A 327 0.574 31.569 4.124 1.00 54.22 N ATOM 1898 HA LYS A 327 -0.360 25.293 2.515 1.00 0.00 H ATOM 1899 HB2 LYS A 327 -1.396 27.486 3.195 1.00 0.00 H ATOM 1900 HB3 LYS A 327 -0.273 26.773 4.377 1.00 0.00 H ATOM 1901 HG2 LYS A 327 1.471 28.358 3.166 1.00 0.00 H ATOM 1902 HG3 LYS A 327 -0.000 29.257 2.727 1.00 0.00 H ATOM 1903 HD2 LYS A 327 -0.637 29.405 5.100 1.00 0.00 H ATOM 1904 HD3 LYS A 327 0.804 28.466 5.557 1.00 0.00 H ATOM 1905 HE2 LYS A 327 2.208 30.275 4.510 1.00 0.00 H ATOM 1906 HE3 LYS A 327 1.294 30.775 5.953 1.00 0.00 H ATOM 1907 HZ1 LYS A 327 0.498 31.283 3.127 1.00 0.00 H ATOM 1908 HZ2 LYS A 327 -0.375 31.761 4.505 1.00 0.00 H ATOM 1909 HZ3 LYS A 327 1.158 32.427 4.196 1.00 0.00 H ATOM 1910 H LYS A 327 2.160 26.637 3.036 1.00 0.00 H ATOM 1911 N ASP A 328 0.659 27.266 0.194 1.00 50.05 N ATOM 1912 CA ASP A 328 0.356 27.843 -1.115 1.00 50.99 C ATOM 1913 C ASP A 328 0.613 26.883 -2.280 1.00 51.38 C ATOM 1914 O ASP A 328 -0.130 26.886 -3.266 1.00 51.86 O ATOM 1915 CB ASP A 328 1.095 29.174 -1.312 1.00 51.02 C ATOM 1916 CG ASP A 328 0.761 30.200 -0.224 1.00 51.85 C ATOM 1917 OD1 ASP A 328 -0.435 30.532 -0.031 1.00 51.20 O ATOM 1918 OD2 ASP A 328 1.708 30.673 0.447 1.00 53.10 O ATOM 1919 HA ASP A 328 -0.717 28.036 -1.123 1.00 0.00 H ATOM 1920 HB2 ASP A 328 2.168 28.984 -1.295 1.00 0.00 H ATOM 1921 HB3 ASP A 328 0.816 29.589 -2.281 1.00 0.00 H ATOM 1922 H ASP A 328 1.639 27.287 0.543 1.00 0.00 H ATOM 1923 N GLY A 329 1.647 26.060 -2.178 1.00 51.34 N ATOM 1924 CA GLY A 329 1.894 25.072 -3.218 1.00 51.72 C ATOM 1925 C GLY A 329 2.996 24.097 -2.886 1.00 52.01 C ATOM 1926 O GLY A 329 3.345 23.912 -1.713 1.00 52.26 O ATOM 1927 HA3 GLY A 329 2.165 25.598 -4.134 1.00 0.00 H ATOM 1928 HA2 GLY A 329 0.975 24.509 -3.382 1.00 0.00 H ATOM 1929 H GLY A 329 2.281 26.120 -1.356 1.00 0.00 H ATOM 1930 N MET A 330 3.551 23.477 -3.925 1.00 52.13 N ATOM 1931 CA MET A 330 4.606 22.475 -3.748 1.00 52.04 C ATOM 1932 C MET A 330 5.721 22.546 -4.783 1.00 52.15 C ATOM 1933 O MET A 330 5.521 23.023 -5.899 1.00 52.30 O ATOM 1934 CB MET A 330 4.012 21.070 -3.725 1.00 51.66 C ATOM 1935 CG MET A 330 3.184 20.722 -4.925 1.00 51.48 C ATOM 1936 SD MET A 330 2.517 19.052 -4.840 1.00 51.99 S ATOM 1937 CE MET A 330 4.010 18.071 -4.822 1.00 51.98 C ATOM 1938 HA MET A 330 5.067 22.708 -2.788 1.00 0.00 H ATOM 1939 HB2 MET A 330 4.832 20.355 -3.659 1.00 0.00 H ATOM 1940 HB3 MET A 330 3.382 20.981 -2.840 1.00 0.00 H ATOM 1941 HG2 MET A 330 3.806 20.805 -5.816 1.00 0.00 H ATOM 1942 HG3 MET A 330 2.355 21.427 -4.995 1.00 0.00 H ATOM 1943 HE1 MET A 330 4.580 18.262 -5.731 1.00 0.00 H ATOM 1944 HE2 MET A 330 4.610 18.340 -3.953 1.00 0.00 H ATOM 1945 HE3 MET A 330 3.748 17.014 -4.771 1.00 0.00 H ATOM 1946 H MET A 330 3.228 23.709 -4.886 1.00 0.00 H ATOM 1947 N LEU A 331 6.891 22.052 -4.398 1.00 52.33 N ATOM 1948 CA LEU A 331 8.034 21.995 -5.292 1.00 52.61 C ATOM 1949 C LEU A 331 7.947 20.785 -6.213 1.00 53.17 C ATOM 1950 O LEU A 331 8.014 19.631 -5.764 1.00 53.52 O ATOM 1951 CB LEU A 331 9.355 21.986 -4.507 1.00 52.37 C ATOM 1952 CG LEU A 331 9.799 23.258 -3.778 1.00 51.44 C ATOM 1953 CD1 LEU A 331 11.103 23.006 -3.056 1.00 50.53 C ATOM 1954 CD2 LEU A 331 9.940 24.439 -4.731 1.00 50.76 C ATOM 1955 HA LEU A 331 8.016 22.894 -5.908 1.00 0.00 H ATOM 1956 HB2 LEU A 331 9.274 21.200 -3.756 1.00 0.00 H ATOM 1957 HB3 LEU A 331 10.144 21.732 -5.214 1.00 0.00 H ATOM 1958 HG LEU A 331 9.026 23.516 -3.054 1.00 0.00 H ATOM 1959 HD21 LEU A 331 10.684 24.203 -5.492 1.00 0.00 H ATOM 1960 HD22 LEU A 331 8.980 24.636 -5.208 1.00 0.00 H ATOM 1961 HD23 LEU A 331 10.256 25.320 -4.172 1.00 0.00 H ATOM 1962 HD11 LEU A 331 10.966 22.204 -2.331 1.00 0.00 H ATOM 1963 HD12 LEU A 331 11.867 22.719 -3.778 1.00 0.00 H ATOM 1964 HD13 LEU A 331 11.413 23.915 -2.540 1.00 0.00 H ATOM 1965 H LEU A 331 6.992 21.695 -3.427 1.00 0.00 H ATOM 1966 N VAL A 332 7.791 21.070 -7.504 1.00 53.71 N ATOM 1967 CA VAL A 332 7.800 20.055 -8.554 1.00 53.93 C ATOM 1968 C VAL A 332 9.056 20.138 -9.418 1.00 54.31 C ATOM 1969 O VAL A 332 9.936 20.972 -9.178 1.00 54.15 O ATOM 1970 CB VAL A 332 6.569 20.166 -9.446 1.00 53.82 C ATOM 1971 CG1 VAL A 332 5.331 19.724 -8.678 1.00 53.87 C ATOM 1972 CG2 VAL A 332 6.421 21.591 -9.965 1.00 54.16 C ATOM 1973 HA VAL A 332 7.790 19.090 -8.047 1.00 0.00 H ATOM 1974 HB VAL A 332 6.687 19.508 -10.307 1.00 0.00 H ATOM 1975 HG11 VAL A 332 5.453 18.689 -8.360 1.00 0.00 H ATOM 1976 HG12 VAL A 332 5.201 20.361 -7.803 1.00 0.00 H ATOM 1977 HG13 VAL A 332 4.456 19.807 -9.323 1.00 0.00 H ATOM 1978 HG21 VAL A 332 6.314 22.274 -9.122 1.00 0.00 H ATOM 1979 HG22 VAL A 332 7.306 21.860 -10.542 1.00 0.00 H ATOM 1980 HG23 VAL A 332 5.538 21.655 -10.600 1.00 0.00 H ATOM 1981 H VAL A 332 7.656 22.064 -7.778 1.00 0.00 H ATOM 1982 N ALA A 333 9.124 19.261 -10.420 1.00 54.98 N ATOM 1983 CA ALA A 333 10.259 19.172 -11.336 1.00 55.40 C ATOM 1984 C ALA A 333 11.586 19.426 -10.629 1.00 55.87 C ATOM 1985 O ALA A 333 12.252 20.427 -10.876 1.00 55.90 O ATOM 1986 CB ALA A 333 10.071 20.117 -12.535 1.00 55.05 C ATOM 1987 HA ALA A 333 10.294 18.150 -11.714 1.00 0.00 H ATOM 1988 HB1 ALA A 333 9.163 19.843 -13.073 1.00 0.00 H ATOM 1989 HB2 ALA A 333 9.988 21.143 -12.178 1.00 0.00 H ATOM 1990 HB3 ALA A 333 10.929 20.032 -13.201 1.00 0.00 H ATOM 1991 H ALA A 333 8.328 18.606 -10.557 1.00 0.00 H ATOM 1992 N TYR A 334 11.944 18.518 -9.725 1.00 56.67 N ATOM 1993 CA TYR A 334 13.274 18.492 -9.097 1.00 57.62 C ATOM 1994 C TYR A 334 13.580 19.766 -8.329 1.00 57.90 C ATOM 1995 O TYR A 334 14.722 20.011 -7.938 1.00 57.87 O ATOM 1996 CB TYR A 334 14.374 18.178 -10.134 1.00 58.00 C ATOM 1997 CG TYR A 334 14.001 17.023 -11.034 1.00 58.73 C ATOM 1998 CD1 TYR A 334 13.308 17.242 -12.230 1.00 58.85 C ATOM 1999 CD2 TYR A 334 14.303 15.704 -10.675 1.00 59.41 C ATOM 2000 CE1 TYR A 334 12.933 16.186 -13.049 1.00 59.28 C ATOM 2001 CE2 TYR A 334 13.939 14.632 -11.497 1.00 59.48 C ATOM 2002 CZ TYR A 334 13.252 14.886 -12.681 1.00 59.67 C ATOM 2003 OH TYR A 334 12.878 13.847 -13.502 1.00 59.99 O ATOM 2004 HA TYR A 334 13.262 17.685 -8.364 1.00 0.00 H ATOM 2005 HB3 TYR A 334 15.294 17.928 -9.605 1.00 0.00 H ATOM 2006 HB2 TYR A 334 14.539 19.063 -10.749 1.00 0.00 H ATOM 2007 HD2 TYR A 334 14.830 15.509 -9.741 1.00 0.00 H ATOM 2008 HE2 TYR A 334 14.190 13.610 -11.214 1.00 0.00 H ATOM 2009 HE1 TYR A 334 12.391 16.376 -13.976 1.00 0.00 H ATOM 2010 HD1 TYR A 334 13.058 18.261 -12.524 1.00 0.00 H ATOM 2011 HH TYR A 334 12.278 13.235 -13.006 1.00 0.00 H ATOM 2012 H TYR A 334 11.251 17.793 -9.449 1.00 0.00 H ATOM 2013 N GLY A 335 12.542 20.568 -8.112 1.00 58.51 N ATOM 2014 CA GLY A 335 12.648 21.802 -7.336 1.00 59.21 C ATOM 2015 C GLY A 335 12.653 23.052 -8.191 1.00 59.61 C ATOM 2016 O GLY A 335 12.641 24.168 -7.660 1.00 59.99 O ATOM 2017 HA3 GLY A 335 13.575 21.771 -6.763 1.00 0.00 H ATOM 2018 HA2 GLY A 335 11.801 21.854 -6.652 1.00 0.00 H ATOM 2019 H GLY A 335 11.618 20.307 -8.510 1.00 0.00 H ATOM 2020 N ASN A 336 12.677 22.862 -9.509 1.00 59.70 N ATOM 2021 CA ASN A 336 12.710 23.968 -10.463 1.00 59.95 C ATOM 2022 C ASN A 336 11.346 24.613 -10.662 1.00 60.24 C ATOM 2023 O ASN A 336 11.258 25.772 -11.073 1.00 60.43 O ATOM 2024 CB ASN A 336 13.274 23.502 -11.812 1.00 59.76 C ATOM 2025 CG ASN A 336 14.684 22.968 -11.697 1.00 59.59 C ATOM 2026 OD1 ASN A 336 15.477 23.442 -10.883 1.00 59.40 O ATOM 2027 ND2 ASN A 336 15.005 21.970 -12.513 1.00 59.84 N ATOM 2028 HA ASN A 336 13.367 24.727 -10.038 1.00 0.00 H ATOM 2029 HB2 ASN A 336 12.632 22.714 -12.206 1.00 0.00 H ATOM 2030 HB3 ASN A 336 13.275 24.346 -12.501 1.00 0.00 H ATOM 2031 HD22 ASN A 336 14.302 21.601 -13.185 1.00 0.00 H ATOM 2032 HD21 ASN A 336 15.959 21.558 -12.480 1.00 0.00 H ATOM 2033 H ASN A 336 12.672 21.888 -9.873 1.00 0.00 H ATOM 2034 N GLY A 337 10.289 23.855 -10.379 1.00 60.42 N ATOM 2035 CA GLY A 337 8.919 24.345 -10.512 1.00 60.85 C ATOM 2036 C GLY A 337 8.210 24.530 -9.178 1.00 61.13 C ATOM 2037 O GLY A 337 8.773 24.240 -8.114 1.00 61.04 O ATOM 2038 HA3 GLY A 337 8.352 23.630 -11.108 1.00 0.00 H ATOM 2039 HA2 GLY A 337 8.944 25.306 -11.026 1.00 0.00 H ATOM 2040 H GLY A 337 10.444 22.880 -10.052 1.00 0.00 H ATOM 2041 N PHE A 338 6.970 25.015 -9.252 1.00 61.28 N ATOM 2042 CA PHE A 338 6.105 25.245 -8.095 1.00 61.43 C ATOM 2043 C PHE A 338 4.686 25.406 -8.583 1.00 61.40 C ATOM 2044 O PHE A 338 4.396 26.332 -9.330 1.00 61.60 O ATOM 2045 CB PHE A 338 6.523 26.510 -7.352 1.00 61.61 C ATOM 2046 CG PHE A 338 5.663 26.835 -6.160 1.00 62.18 C ATOM 2047 CD1 PHE A 338 5.972 26.324 -4.904 1.00 62.43 C ATOM 2048 CD2 PHE A 338 4.557 27.680 -6.287 1.00 63.10 C ATOM 2049 CE1 PHE A 338 5.190 26.636 -3.796 1.00 62.18 C ATOM 2050 CE2 PHE A 338 3.768 27.996 -5.186 1.00 62.87 C ATOM 2051 CZ PHE A 338 4.091 27.474 -3.937 1.00 62.48 C ATOM 2052 HA PHE A 338 6.186 24.398 -7.413 1.00 0.00 H ATOM 2053 HB2 PHE A 338 7.550 26.383 -7.009 1.00 0.00 H ATOM 2054 HB3 PHE A 338 6.475 27.348 -8.048 1.00 0.00 H ATOM 2055 HD2 PHE A 338 4.309 28.097 -7.263 1.00 0.00 H ATOM 2056 HE2 PHE A 338 2.902 28.648 -5.301 1.00 0.00 H ATOM 2057 HZ PHE A 338 3.481 27.723 -3.069 1.00 0.00 H ATOM 2058 HE1 PHE A 338 5.440 26.223 -2.818 1.00 0.00 H ATOM 2059 HD1 PHE A 338 6.837 25.671 -4.786 1.00 0.00 H ATOM 2060 H PHE A 338 6.593 25.245 -10.194 1.00 0.00 H ATOM 2061 N ILE A 339 3.799 24.513 -8.160 1.00 61.56 N ATOM 2062 CA ILE A 339 2.397 24.557 -8.585 1.00 61.41 C ATOM 2063 C ILE A 339 1.481 24.866 -7.391 1.00 61.69 C ATOM 2064 O ILE A 339 1.530 24.171 -6.369 1.00 61.95 O ATOM 2065 CB ILE A 339 1.985 23.240 -9.300 1.00 61.39 C ATOM 2066 CG1 ILE A 339 0.520 23.291 -9.741 1.00 60.94 C ATOM 2067 CG2 ILE A 339 2.296 22.004 -8.423 1.00 61.22 C ATOM 2068 CD1 ILE A 339 0.046 22.035 -10.452 1.00 61.26 C ATOM 2069 HA ILE A 339 2.283 25.364 -9.309 1.00 0.00 H ATOM 2070 HB ILE A 339 2.586 23.140 -10.204 1.00 0.00 H ATOM 2071 HG12 ILE A 339 -0.100 23.440 -8.857 1.00 0.00 H ATOM 2072 HG13 ILE A 339 0.394 24.136 -10.417 1.00 0.00 H ATOM 2073 HD11 ILE A 339 0.647 21.877 -11.347 1.00 0.00 H ATOM 2074 HD12 ILE A 339 0.153 21.179 -9.785 1.00 0.00 H ATOM 2075 HD13 ILE A 339 -1.001 22.151 -10.732 1.00 0.00 H ATOM 2076 HG21 ILE A 339 3.365 21.967 -8.216 1.00 0.00 H ATOM 2077 HG22 ILE A 339 1.745 22.078 -7.485 1.00 0.00 H ATOM 2078 HG23 ILE A 339 1.996 21.100 -8.952 1.00 0.00 H ATOM 2079 H ILE A 339 4.107 23.762 -7.510 1.00 0.00 H ATOM 2080 N THR A 340 0.659 25.911 -7.520 1.00 61.76 N ATOM 2081 CA THR A 340 -0.201 26.360 -6.412 1.00 61.60 C ATOM 2082 C THR A 340 -1.219 25.304 -6.009 1.00 61.77 C ATOM 2083 O THR A 340 -1.706 24.534 -6.850 1.00 61.71 O ATOM 2084 CB THR A 340 -0.984 27.679 -6.701 1.00 61.34 C ATOM 2085 OG1 THR A 340 -2.007 27.429 -7.666 1.00 60.78 O ATOM 2086 CG2 THR A 340 -0.074 28.804 -7.170 1.00 60.83 C ATOM 2087 HA THR A 340 0.505 26.545 -5.603 1.00 0.00 H ATOM 2088 HB THR A 340 -1.434 28.008 -5.764 1.00 0.00 H ATOM 2089 HG1 THR A 340 -2.631 26.746 -7.314 1.00 0.00 H ATOM 2090 HG23 THR A 340 0.699 28.980 -6.422 1.00 0.00 H ATOM 2091 HG21 THR A 340 0.391 28.524 -8.115 1.00 0.00 H ATOM 2092 HG22 THR A 340 -0.662 29.712 -7.308 1.00 0.00 H ATOM 2093 H THR A 340 0.625 26.421 -8.426 1.00 0.00 H ATOM 2094 N ARG A 341 -1.524 25.288 -4.713 1.00 61.78 N ATOM 2095 CA ARG A 341 -2.580 24.459 -4.145 1.00 61.91 C ATOM 2096 C ARG A 341 -3.930 24.881 -4.695 1.00 62.63 C ATOM 2097 O ARG A 341 -4.773 24.040 -5.013 1.00 62.54 O ATOM 2098 CB ARG A 341 -2.581 24.604 -2.624 1.00 61.60 C ATOM 2099 CG ARG A 341 -3.709 23.879 -1.912 1.00 59.27 C ATOM 2100 CD ARG A 341 -3.587 24.158 -0.452 1.00 55.38 C ATOM 2101 NE ARG A 341 -4.398 23.276 0.369 1.00 51.22 N ATOM 2102 CZ ARG A 341 -4.297 23.231 1.688 1.00 48.89 C ATOM 2103 NH1 ARG A 341 -3.414 24.007 2.308 1.00 46.35 N ATOM 2104 NH2 ARG A 341 -5.070 22.411 2.381 1.00 48.62 N ATOM 2105 HA ARG A 341 -2.397 23.419 -4.414 1.00 0.00 H ATOM 2106 HB2 ARG A 341 -1.636 24.214 -2.246 1.00 0.00 H ATOM 2107 HB3 ARG A 341 -2.656 25.665 -2.385 1.00 0.00 H ATOM 2108 HG2 ARG A 341 -4.670 24.239 -2.279 1.00 0.00 H ATOM 2109 HG3 ARG A 341 -3.632 22.807 -2.092 1.00 0.00 H ATOM 2110 HD2 ARG A 341 -3.898 25.186 -0.268 1.00 0.00 H ATOM 2111 HD3 ARG A 341 -2.543 24.039 -0.162 1.00 0.00 H ATOM 2112 HE ARG A 341 -5.087 22.654 -0.099 1.00 0.00 H ATOM 2113 HH12 ARG A 341 -3.331 23.975 3.344 1.00 0.00 H ATOM 2114 HH11 ARG A 341 -2.806 24.646 1.757 1.00 0.00 H ATOM 2115 HH22 ARG A 341 -4.992 22.374 3.417 1.00 0.00 H ATOM 2116 HH21 ARG A 341 -5.756 21.803 1.889 1.00 0.00 H ATOM 2117 H ARG A 341 -0.980 25.900 -4.072 1.00 0.00 H ATOM 2118 N GLU A 342 -4.120 26.198 -4.785 1.00 63.64 N ATOM 2119 CA GLU A 342 -5.318 26.793 -5.369 1.00 64.48 C ATOM 2120 C GLU A 342 -5.578 26.226 -6.766 1.00 64.79 C ATOM 2121 O GLU A 342 -6.663 25.686 -7.024 1.00 64.63 O ATOM 2122 CB GLU A 342 -5.196 28.326 -5.401 1.00 64.69 C ATOM 2123 CG GLU A 342 -5.052 28.992 -4.019 1.00 65.66 C ATOM 2124 CD GLU A 342 -6.254 28.747 -3.090 1.00 67.18 C ATOM 2125 OE1 GLU A 342 -6.052 28.747 -1.852 1.00 67.31 O ATOM 2126 OE2 GLU A 342 -7.393 28.547 -3.589 1.00 67.56 O ATOM 2127 HA GLU A 342 -6.173 26.537 -4.744 1.00 0.00 H ATOM 2128 HB2 GLU A 342 -4.319 28.584 -5.995 1.00 0.00 H ATOM 2129 HB3 GLU A 342 -6.089 28.728 -5.880 1.00 0.00 H ATOM 2130 HG2 GLU A 342 -4.157 28.597 -3.537 1.00 0.00 H ATOM 2131 HG3 GLU A 342 -4.941 30.067 -4.164 1.00 0.00 H ATOM 2132 H GLU A 342 -3.379 26.831 -4.422 1.00 0.00 H ATOM 2133 N PHE A 343 -4.567 26.317 -7.639 1.00 65.18 N ATOM 2134 CA PHE A 343 -4.656 25.774 -9.001 1.00 65.77 C ATOM 2135 C PHE A 343 -5.058 24.297 -9.017 1.00 65.85 C ATOM 2136 O PHE A 343 -5.884 23.889 -9.842 1.00 66.12 O ATOM 2137 CB PHE A 343 -3.358 26.011 -9.800 1.00 65.95 C ATOM 2138 CG PHE A 343 -3.378 25.422 -11.194 1.00 66.98 C ATOM 2139 CD1 PHE A 343 -4.429 25.694 -12.077 1.00 67.64 C ATOM 2140 CD2 PHE A 343 -2.341 24.603 -11.628 1.00 67.68 C ATOM 2141 CE1 PHE A 343 -4.450 25.147 -13.356 1.00 67.33 C ATOM 2142 CE2 PHE A 343 -2.355 24.053 -12.910 1.00 67.34 C ATOM 2143 CZ PHE A 343 -3.412 24.327 -13.773 1.00 66.99 C ATOM 2144 HA PHE A 343 -5.454 26.325 -9.499 1.00 0.00 H ATOM 2145 HB2 PHE A 343 -3.198 27.086 -9.884 1.00 0.00 H ATOM 2146 HB3 PHE A 343 -2.530 25.564 -9.250 1.00 0.00 H ATOM 2147 HD2 PHE A 343 -1.508 24.388 -10.959 1.00 0.00 H ATOM 2148 HE2 PHE A 343 -1.538 23.409 -13.236 1.00 0.00 H ATOM 2149 HZ PHE A 343 -3.424 23.898 -14.775 1.00 0.00 H ATOM 2150 HE1 PHE A 343 -5.280 25.362 -14.029 1.00 0.00 H ATOM 2151 HD1 PHE A 343 -5.244 26.344 -11.758 1.00 0.00 H ATOM 2152 H PHE A 343 -3.689 26.788 -7.343 1.00 0.00 H ATOM 2153 N LEU A 344 -4.493 23.508 -8.101 1.00 65.80 N ATOM 2154 CA LEU A 344 -4.836 22.088 -7.997 1.00 65.72 C ATOM 2155 C LEU A 344 -6.289 21.877 -7.587 1.00 65.78 C ATOM 2156 O LEU A 344 -6.932 20.932 -8.039 1.00 65.66 O ATOM 2157 CB LEU A 344 -3.891 21.371 -7.032 1.00 65.75 C ATOM 2158 CG LEU A 344 -2.446 21.180 -7.499 1.00 65.29 C ATOM 2159 CD1 LEU A 344 -1.487 21.202 -6.324 1.00 65.03 C ATOM 2160 CD2 LEU A 344 -2.286 19.899 -8.304 1.00 65.13 C ATOM 2161 HA LEU A 344 -4.715 21.654 -8.990 1.00 0.00 H ATOM 2162 HB2 LEU A 344 -3.866 21.946 -6.106 1.00 0.00 H ATOM 2163 HB3 LEU A 344 -4.308 20.383 -6.834 1.00 0.00 H ATOM 2164 HG LEU A 344 -2.200 22.016 -8.154 1.00 0.00 H ATOM 2165 HD21 LEU A 344 -2.566 19.046 -7.686 1.00 0.00 H ATOM 2166 HD22 LEU A 344 -2.931 19.940 -9.182 1.00 0.00 H ATOM 2167 HD23 LEU A 344 -1.247 19.797 -8.619 1.00 0.00 H ATOM 2168 HD11 LEU A 344 -1.565 22.160 -5.811 1.00 0.00 H ATOM 2169 HD12 LEU A 344 -1.741 20.397 -5.634 1.00 0.00 H ATOM 2170 HD13 LEU A 344 -0.468 21.064 -6.686 1.00 0.00 H ATOM 2171 H LEU A 344 -3.793 23.911 -7.446 1.00 0.00 H ATOM 2172 N LYS A 345 -6.798 22.764 -6.734 1.00 66.20 N ATOM 2173 CA LYS A 345 -8.196 22.723 -6.307 1.00 66.50 C ATOM 2174 C LYS A 345 -9.128 23.235 -7.394 1.00 66.75 C ATOM 2175 O LYS A 345 -10.238 22.727 -7.552 1.00 66.76 O ATOM 2176 CB LYS A 345 -8.411 23.529 -5.032 1.00 66.56 C ATOM 2177 CG LYS A 345 -7.956 22.826 -3.771 1.00 66.72 C ATOM 2178 CD LYS A 345 -8.933 23.059 -2.630 1.00 66.17 C ATOM 2179 CE LYS A 345 -10.053 22.036 -2.665 1.00 65.48 C ATOM 2180 NZ LYS A 345 -11.001 22.267 -1.552 1.00 65.99 N ATOM 2181 HA LYS A 345 -8.432 21.678 -6.108 1.00 0.00 H ATOM 2182 HB2 LYS A 345 -7.858 24.464 -5.121 1.00 0.00 H ATOM 2183 HB3 LYS A 345 -9.475 23.745 -4.939 1.00 0.00 H ATOM 2184 HG2 LYS A 345 -7.885 21.756 -3.966 1.00 0.00 H ATOM 2185 HG3 LYS A 345 -6.976 23.208 -3.484 1.00 0.00 H ATOM 2186 HD2 LYS A 345 -8.402 22.976 -1.682 1.00 0.00 H ATOM 2187 HD3 LYS A 345 -9.358 24.059 -2.721 1.00 0.00 H ATOM 2188 HE2 LYS A 345 -9.629 21.036 -2.574 1.00 0.00 H ATOM 2189 HE3 LYS A 345 -10.585 22.118 -3.613 1.00 0.00 H ATOM 2190 HZ1 LYS A 345 -10.497 22.186 -0.646 1.00 0.00 H ATOM 2191 HZ2 LYS A 345 -11.410 23.219 -1.638 1.00 0.00 H ATOM 2192 HZ3 LYS A 345 -11.760 21.558 -1.592 1.00 0.00 H ATOM 2193 H LYS A 345 -6.180 23.512 -6.359 1.00 0.00 H ATOM 2194 N SER A 346 -8.681 24.240 -8.142 1.00 67.08 N ATOM 2195 CA SER A 346 -9.458 24.720 -9.285 1.00 67.54 C ATOM 2196 C SER A 346 -9.191 23.907 -10.561 1.00 67.66 C ATOM 2197 O SER A 346 -9.077 24.461 -11.653 1.00 67.68 O ATOM 2198 CB SER A 346 -9.299 26.233 -9.504 1.00 67.50 C ATOM 2199 OG SER A 346 -8.028 26.704 -9.089 1.00 68.23 O ATOM 2200 HA SER A 346 -10.506 24.555 -9.036 1.00 0.00 H ATOM 2201 HB2 SER A 346 -10.069 26.753 -8.935 1.00 0.00 H ATOM 2202 HB3 SER A 346 -9.425 26.449 -10.565 1.00 0.00 H ATOM 2203 HG SER A 346 -7.907 26.518 -8.124 1.00 0.00 H ATOM 2204 H SER A 346 -7.771 24.688 -7.912 1.00 0.00 H ATOM 2205 N LEU A 347 -9.091 22.591 -10.397 1.00 67.91 N ATOM 2206 CA LEU A 347 -9.168 21.641 -11.507 1.00 68.21 C ATOM 2207 C LEU A 347 -10.457 20.862 -11.317 1.00 68.27 C ATOM 2208 O LEU A 347 -10.962 20.763 -10.205 1.00 68.16 O ATOM 2209 CB LEU A 347 -7.965 20.682 -11.530 1.00 68.25 C ATOM 2210 CG LEU A 347 -6.535 21.257 -11.509 1.00 68.55 C ATOM 2211 CD1 LEU A 347 -5.507 20.150 -11.290 1.00 68.34 C ATOM 2212 CD2 LEU A 347 -6.178 22.079 -12.759 1.00 68.52 C ATOM 2213 HA LEU A 347 -9.152 22.174 -12.458 1.00 0.00 H ATOM 2214 HB2 LEU A 347 -8.059 20.034 -10.659 1.00 0.00 H ATOM 2215 HB3 LEU A 347 -8.053 20.084 -12.437 1.00 0.00 H ATOM 2216 HG LEU A 347 -6.508 21.951 -10.669 1.00 0.00 H ATOM 2217 HD21 LEU A 347 -6.260 21.447 -13.643 1.00 0.00 H ATOM 2218 HD22 LEU A 347 -6.865 22.921 -12.847 1.00 0.00 H ATOM 2219 HD23 LEU A 347 -5.157 22.449 -12.669 1.00 0.00 H ATOM 2220 HD11 LEU A 347 -5.702 19.658 -10.337 1.00 0.00 H ATOM 2221 HD12 LEU A 347 -5.581 19.422 -12.098 1.00 0.00 H ATOM 2222 HD13 LEU A 347 -4.506 20.582 -11.279 1.00 0.00 H ATOM 2223 H LEU A 347 -8.952 22.220 -9.435 1.00 0.00 H ATOM 2224 N ARG A 348 -10.999 20.318 -12.398 1.00 68.68 N ATOM 2225 CA ARG A 348 -12.318 19.697 -12.335 1.00 69.05 C ATOM 2226 C ARG A 348 -12.257 18.372 -11.617 1.00 68.82 C ATOM 2227 O ARG A 348 -11.202 17.745 -11.558 1.00 68.91 O ATOM 2228 CB ARG A 348 -12.937 19.531 -13.729 1.00 69.29 C ATOM 2229 CG ARG A 348 -12.231 18.539 -14.634 1.00 70.69 C ATOM 2230 CD ARG A 348 -13.121 18.121 -15.795 1.00 72.25 C ATOM 2231 NE ARG A 348 -12.403 17.224 -16.697 1.00 73.10 N ATOM 2232 CZ ARG A 348 -12.442 15.897 -16.632 1.00 73.27 C ATOM 2233 NH1 ARG A 348 -13.180 15.291 -15.707 1.00 73.58 N ATOM 2234 NH2 ARG A 348 -11.743 15.179 -17.502 1.00 73.22 N ATOM 2235 HA ARG A 348 -12.964 20.367 -11.767 1.00 0.00 H ATOM 2236 HB2 ARG A 348 -13.968 19.199 -13.604 1.00 0.00 H ATOM 2237 HB3 ARG A 348 -12.927 20.504 -14.221 1.00 0.00 H ATOM 2238 HG2 ARG A 348 -11.325 19.000 -15.028 1.00 0.00 H ATOM 2239 HG3 ARG A 348 -11.965 17.655 -14.054 1.00 0.00 H ATOM 2240 HD2 ARG A 348 -13.433 19.009 -16.345 1.00 0.00 H ATOM 2241 HD3 ARG A 348 -14.001 17.609 -15.406 1.00 0.00 H ATOM 2242 HE ARG A 348 -11.820 17.654 -17.443 1.00 0.00 H ATOM 2243 HH12 ARG A 348 -13.206 14.252 -15.661 1.00 0.00 H ATOM 2244 HH11 ARG A 348 -13.731 15.856 -15.029 1.00 0.00 H ATOM 2245 HH22 ARG A 348 -11.768 14.140 -17.458 1.00 0.00 H ATOM 2246 HH21 ARG A 348 -11.170 15.655 -18.228 1.00 0.00 H ATOM 2247 H ARG A 348 -10.479 20.334 -13.299 1.00 0.00 H ATOM 2248 N LYS A 349 -13.398 17.968 -11.075 1.00 68.70 N ATOM 2249 CA LYS A 349 -13.549 16.698 -10.373 1.00 68.83 C ATOM 2250 C LYS A 349 -13.240 15.500 -11.288 1.00 68.72 C ATOM 2251 O LYS A 349 -13.369 15.615 -12.517 1.00 68.94 O ATOM 2252 CB LYS A 349 -14.978 16.593 -9.828 1.00 68.99 C ATOM 2253 CG LYS A 349 -15.480 17.863 -9.122 1.00 69.59 C ATOM 2254 CD LYS A 349 -14.845 18.012 -7.738 1.00 70.47 C ATOM 2255 CE LYS A 349 -15.300 19.286 -7.027 1.00 70.65 C ATOM 2256 NZ LYS A 349 -14.974 19.223 -5.563 1.00 70.29 N ATOM 2257 HA LYS A 349 -12.833 16.671 -9.552 1.00 0.00 H ATOM 2258 HB2 LYS A 349 -15.647 16.378 -10.662 1.00 0.00 H ATOM 2259 HB3 LYS A 349 -15.012 15.769 -9.115 1.00 0.00 H ATOM 2260 HG2 LYS A 349 -15.223 18.732 -9.727 1.00 0.00 H ATOM 2261 HG3 LYS A 349 -16.563 17.805 -9.013 1.00 0.00 H ATOM 2262 HD2 LYS A 349 -15.124 17.152 -7.129 1.00 0.00 H ATOM 2263 HD3 LYS A 349 -13.761 18.040 -7.850 1.00 0.00 H ATOM 2264 HE2 LYS A 349 -16.377 19.399 -7.149 1.00 0.00 H ATOM 2265 HE3 LYS A 349 -14.793 20.143 -7.470 1.00 0.00 H ATOM 2266 HZ1 LYS A 349 -15.459 18.408 -5.136 1.00 0.00 H ATOM 2267 HZ2 LYS A 349 -13.946 19.119 -5.442 1.00 0.00 H ATOM 2268 HZ3 LYS A 349 -15.292 20.098 -5.100 1.00 0.00 H ATOM 2269 H LYS A 349 -14.228 18.589 -11.155 1.00 0.00 H ATOM 2270 N PRO A 350 -12.795 14.360 -10.702 1.00 68.43 N ATOM 2271 CA PRO A 350 -12.438 14.205 -9.293 1.00 68.04 C ATOM 2272 C PRO A 350 -10.964 14.534 -9.020 1.00 67.53 C ATOM 2273 O PRO A 350 -10.476 14.306 -7.914 1.00 67.69 O ATOM 2274 CB PRO A 350 -12.736 12.722 -9.013 1.00 67.96 C ATOM 2275 CG PRO A 350 -13.017 12.079 -10.371 1.00 68.26 C ATOM 2276 CD PRO A 350 -12.645 13.081 -11.418 1.00 68.48 C ATOM 2277 HA PRO A 350 -12.993 14.889 -8.651 1.00 0.00 H ATOM 2278 HD3 PRO A 350 -11.619 12.936 -11.756 1.00 0.00 H ATOM 2279 HD2 PRO A 350 -13.319 13.026 -12.273 1.00 0.00 H ATOM 2280 HG3 PRO A 350 -14.074 11.826 -10.454 1.00 0.00 H ATOM 2281 HG2 PRO A 350 -12.418 11.176 -10.488 1.00 0.00 H ATOM 2282 HB2 PRO A 350 -11.877 12.246 -8.540 1.00 0.00 H ATOM 2283 HB3 PRO A 350 -13.606 12.627 -8.363 1.00 0.00 H ATOM 2284 N PHE A 351 -10.295 15.114 -10.013 1.00 66.77 N ATOM 2285 CA PHE A 351 -8.860 15.421 -9.969 1.00 66.23 C ATOM 2286 C PHE A 351 -8.416 16.450 -8.914 1.00 65.64 C ATOM 2287 O PHE A 351 -7.215 16.592 -8.651 1.00 65.54 O ATOM 2288 CB PHE A 351 -8.374 15.885 -11.350 1.00 66.43 C ATOM 2289 CG PHE A 351 -8.478 14.837 -12.428 1.00 67.08 C ATOM 2290 CD1 PHE A 351 -9.709 14.267 -12.759 1.00 67.79 C ATOM 2291 CD2 PHE A 351 -7.352 14.444 -13.136 1.00 67.92 C ATOM 2292 CE1 PHE A 351 -9.815 13.314 -13.751 1.00 67.00 C ATOM 2293 CE2 PHE A 351 -7.447 13.490 -14.144 1.00 68.21 C ATOM 2294 CZ PHE A 351 -8.687 12.924 -14.448 1.00 67.92 C ATOM 2295 HA PHE A 351 -8.400 14.480 -9.668 1.00 0.00 H ATOM 2296 HB2 PHE A 351 -8.971 16.746 -11.651 1.00 0.00 H ATOM 2297 HB3 PHE A 351 -7.329 16.183 -11.262 1.00 0.00 H ATOM 2298 HD2 PHE A 351 -6.384 14.887 -12.901 1.00 0.00 H ATOM 2299 HE2 PHE A 351 -6.557 13.185 -14.695 1.00 0.00 H ATOM 2300 HZ PHE A 351 -8.765 12.174 -15.235 1.00 0.00 H ATOM 2301 HE1 PHE A 351 -10.783 12.871 -13.984 1.00 0.00 H ATOM 2302 HD1 PHE A 351 -10.604 14.581 -12.223 1.00 0.00 H ATOM 2303 H PHE A 351 -10.821 15.366 -10.874 1.00 0.00 H ATOM 2304 N CYS A 352 -9.360 17.181 -8.326 1.00 64.78 N ATOM 2305 CA CYS A 352 -8.994 18.214 -7.353 1.00 63.80 C ATOM 2306 C CYS A 352 -9.073 17.650 -5.949 1.00 62.60 C ATOM 2307 O CYS A 352 -8.500 18.211 -5.014 1.00 62.26 O ATOM 2308 CB CYS A 352 -9.905 19.426 -7.479 1.00 64.09 C ATOM 2309 SG CYS A 352 -11.592 19.093 -6.957 1.00 64.99 S ATOM 2310 HA CYS A 352 -7.972 18.532 -7.557 1.00 0.00 H ATOM 2311 HB2 CYS A 352 -9.920 19.743 -8.522 1.00 0.00 H ATOM 2312 HB3 CYS A 352 -9.502 20.229 -6.862 1.00 0.00 H ATOM 2313 HG CYS A 352 -11.594 18.702 -5.634 1.00 0.00 H ATOM 2314 H CYS A 352 -10.361 17.019 -8.558 1.00 0.00 H ATOM 2315 N ASP A 353 -9.801 16.542 -5.823 1.00 61.28 N ATOM 2316 CA ASP A 353 -9.852 15.766 -4.586 1.00 60.30 C ATOM 2317 C ASP A 353 -8.576 14.951 -4.361 1.00 59.03 C ATOM 2318 O ASP A 353 -8.423 14.329 -3.311 1.00 59.08 O ATOM 2319 CB ASP A 353 -11.058 14.821 -4.584 1.00 60.62 C ATOM 2320 CG ASP A 353 -12.319 15.484 -5.083 1.00 61.68 C ATOM 2321 OD1 ASP A 353 -12.984 14.904 -5.964 1.00 63.10 O ATOM 2322 OD2 ASP A 353 -12.641 16.590 -4.607 1.00 63.77 O ATOM 2323 HA ASP A 353 -9.947 16.486 -3.773 1.00 0.00 H ATOM 2324 HB2 ASP A 353 -10.835 13.969 -5.226 1.00 0.00 H ATOM 2325 HB3 ASP A 353 -11.227 14.473 -3.565 1.00 0.00 H ATOM 2326 H ASP A 353 -10.357 16.215 -6.639 1.00 0.00 H ATOM 2327 N ILE A 354 -7.673 14.956 -5.345 1.00 57.52 N ATOM 2328 CA ILE A 354 -6.432 14.187 -5.265 1.00 55.88 C ATOM 2329 C ILE A 354 -5.510 14.789 -4.226 1.00 54.71 C ATOM 2330 O ILE A 354 -5.308 14.209 -3.166 1.00 54.82 O ATOM 2331 CB ILE A 354 -5.662 14.104 -6.629 1.00 55.99 C ATOM 2332 CG1 ILE A 354 -6.540 13.546 -7.759 1.00 55.81 C ATOM 2333 CG2 ILE A 354 -4.374 13.283 -6.477 1.00 55.55 C ATOM 2334 CD1 ILE A 354 -6.741 12.045 -7.745 1.00 55.98 C ATOM 2335 HA ILE A 354 -6.724 13.174 -4.988 1.00 0.00 H ATOM 2336 HB ILE A 354 -5.393 15.122 -6.910 1.00 0.00 H ATOM 2337 HG12 ILE A 354 -7.520 14.017 -7.688 1.00 0.00 H ATOM 2338 HG13 ILE A 354 -6.077 13.815 -8.709 1.00 0.00 H ATOM 2339 HD11 ILE A 354 -5.774 11.549 -7.832 1.00 0.00 H ATOM 2340 HD12 ILE A 354 -7.218 11.752 -6.810 1.00 0.00 H ATOM 2341 HD13 ILE A 354 -7.375 11.757 -8.584 1.00 0.00 H ATOM 2342 HG21 ILE A 354 -3.729 13.755 -5.736 1.00 0.00 H ATOM 2343 HG22 ILE A 354 -4.625 12.273 -6.152 1.00 0.00 H ATOM 2344 HG23 ILE A 354 -3.857 13.239 -7.436 1.00 0.00 H ATOM 2345 H ILE A 354 -7.858 15.525 -6.195 1.00 0.00 H ATOM 2346 N MET A 355 -4.976 15.964 -4.536 1.00 53.42 N ATOM 2347 CA MET A 355 -3.862 16.547 -3.783 1.00 52.09 C ATOM 2348 C MET A 355 -4.237 17.251 -2.486 1.00 51.26 C ATOM 2349 O MET A 355 -3.437 17.287 -1.555 1.00 51.61 O ATOM 2350 CB MET A 355 -3.065 17.503 -4.672 1.00 51.85 C ATOM 2351 CG MET A 355 -2.299 16.812 -5.789 1.00 51.53 C ATOM 2352 SD MET A 355 -1.280 15.416 -5.255 1.00 50.41 S ATOM 2353 CE MET A 355 -0.070 16.216 -4.201 1.00 49.39 C ATOM 2354 HA MET A 355 -3.259 15.691 -3.481 1.00 0.00 H ATOM 2355 HB2 MET A 355 -3.759 18.214 -5.120 1.00 0.00 H ATOM 2356 HB3 MET A 355 -2.351 18.039 -4.047 1.00 0.00 H ATOM 2357 HG2 MET A 355 -1.647 17.548 -6.260 1.00 0.00 H ATOM 2358 HG3 MET A 355 -3.020 16.446 -6.520 1.00 0.00 H ATOM 2359 HE1 MET A 355 0.485 16.952 -4.782 1.00 0.00 H ATOM 2360 HE2 MET A 355 -0.581 16.712 -3.376 1.00 0.00 H ATOM 2361 HE3 MET A 355 0.618 15.468 -3.807 1.00 0.00 H ATOM 2362 H MET A 355 -5.363 16.491 -5.345 1.00 0.00 H ATOM 2363 N GLU A 356 -5.442 17.811 -2.425 1.00 50.07 N ATOM 2364 CA GLU A 356 -5.885 18.543 -1.240 1.00 48.68 C ATOM 2365 C GLU A 356 -5.616 17.828 0.097 1.00 47.44 C ATOM 2366 O GLU A 356 -4.950 18.408 0.955 1.00 47.55 O ATOM 2367 CB GLU A 356 -7.345 18.992 -1.371 1.00 48.89 C ATOM 2368 CG GLU A 356 -7.780 20.023 -0.344 1.00 49.31 C ATOM 2369 CD GLU A 356 -6.789 21.166 -0.189 1.00 50.91 C ATOM 2370 OE1 GLU A 356 -6.174 21.594 -1.193 1.00 50.28 O ATOM 2371 OE2 GLU A 356 -6.629 21.646 0.955 1.00 51.90 O ATOM 2372 HA GLU A 356 -5.257 19.433 -1.203 1.00 0.00 H ATOM 2373 HB2 GLU A 356 -7.482 19.421 -2.364 1.00 0.00 H ATOM 2374 HB3 GLU A 356 -7.983 18.114 -1.264 1.00 0.00 H ATOM 2375 HG2 GLU A 356 -8.741 20.436 -0.652 1.00 0.00 H ATOM 2376 HG3 GLU A 356 -7.891 19.527 0.620 1.00 0.00 H ATOM 2377 H GLU A 356 -6.084 17.726 -3.239 1.00 0.00 H ATOM 2378 N PRO A 357 -6.096 16.565 0.269 1.00 45.97 N ATOM 2379 CA PRO A 357 -5.881 15.853 1.546 1.00 44.70 C ATOM 2380 C PRO A 357 -4.419 15.712 1.982 1.00 43.59 C ATOM 2381 O PRO A 357 -4.142 15.625 3.186 1.00 43.48 O ATOM 2382 CB PRO A 357 -6.487 14.469 1.296 1.00 44.64 C ATOM 2383 CG PRO A 357 -7.442 14.656 0.169 1.00 45.24 C ATOM 2384 CD PRO A 357 -6.875 15.745 -0.684 1.00 45.81 C ATOM 2385 HA PRO A 357 -6.334 16.417 2.361 1.00 0.00 H ATOM 2386 HD3 PRO A 357 -6.231 15.335 -1.462 1.00 0.00 H ATOM 2387 HD2 PRO A 357 -7.669 16.332 -1.144 1.00 0.00 H ATOM 2388 HG3 PRO A 357 -8.422 14.945 0.548 1.00 0.00 H ATOM 2389 HG2 PRO A 357 -7.533 13.734 -0.406 1.00 0.00 H ATOM 2390 HB2 PRO A 357 -5.710 13.755 1.024 1.00 0.00 H ATOM 2391 HB3 PRO A 357 -7.009 14.114 2.185 1.00 0.00 H ATOM 2392 N LYS A 358 -3.503 15.695 1.016 1.00 42.34 N ATOM 2393 CA LYS A 358 -2.069 15.617 1.302 1.00 41.11 C ATOM 2394 C LYS A 358 -1.565 16.931 1.861 1.00 40.45 C ATOM 2395 O LYS A 358 -0.689 16.947 2.730 1.00 40.32 O ATOM 2396 CB LYS A 358 -1.265 15.240 0.056 1.00 40.83 C ATOM 2397 CG LYS A 358 -1.356 13.774 -0.325 1.00 40.30 C ATOM 2398 CD LYS A 358 -2.724 13.428 -0.896 1.00 39.62 C ATOM 2399 CE LYS A 358 -2.795 11.986 -1.361 1.00 39.55 C ATOM 2400 NZ LYS A 358 -4.128 11.682 -1.953 1.00 38.77 N ATOM 2401 HA LYS A 358 -1.928 14.833 2.046 1.00 0.00 H ATOM 2402 HB2 LYS A 358 -1.633 15.834 -0.781 1.00 0.00 H ATOM 2403 HB3 LYS A 358 -0.218 15.481 0.239 1.00 0.00 H ATOM 2404 HG2 LYS A 358 -0.594 13.555 -1.073 1.00 0.00 H ATOM 2405 HG3 LYS A 358 -1.178 13.166 0.562 1.00 0.00 H ATOM 2406 HD2 LYS A 358 -3.478 13.588 -0.126 1.00 0.00 H ATOM 2407 HD3 LYS A 358 -2.928 14.082 -1.744 1.00 0.00 H ATOM 2408 HE2 LYS A 358 -2.624 11.327 -0.509 1.00 0.00 H ATOM 2409 HE3 LYS A 358 -2.024 11.815 -2.112 1.00 0.00 H ATOM 2410 HZ1 LYS A 358 -4.867 11.840 -1.239 1.00 0.00 H ATOM 2411 HZ2 LYS A 358 -4.294 12.305 -2.769 1.00 0.00 H ATOM 2412 HZ3 LYS A 358 -4.150 10.690 -2.263 1.00 0.00 H ATOM 2413 H LYS A 358 -3.816 15.739 0.025 1.00 0.00 H ATOM 2414 N PHE A 359 -2.116 18.031 1.364 1.00 39.54 N ATOM 2415 CA PHE A 359 -1.786 19.339 1.901 1.00 39.05 C ATOM 2416 C PHE A 359 -2.250 19.441 3.351 1.00 39.15 C ATOM 2417 O PHE A 359 -1.518 19.955 4.211 1.00 39.12 O ATOM 2418 CB PHE A 359 -2.441 20.428 1.076 1.00 38.76 C ATOM 2419 CG PHE A 359 -1.717 20.753 -0.185 1.00 38.11 C ATOM 2420 CD1 PHE A 359 -0.649 21.647 -0.176 1.00 38.07 C ATOM 2421 CD2 PHE A 359 -2.112 20.194 -1.385 1.00 37.22 C ATOM 2422 CE1 PHE A 359 0.020 21.970 -1.340 1.00 37.31 C ATOM 2423 CE2 PHE A 359 -1.453 20.513 -2.551 1.00 37.65 C ATOM 2424 CZ PHE A 359 -0.389 21.407 -2.532 1.00 37.79 C ATOM 2425 HA PHE A 359 -0.704 19.468 1.861 1.00 0.00 H ATOM 2426 HB2 PHE A 359 -3.449 20.103 0.819 1.00 0.00 H ATOM 2427 HB3 PHE A 359 -2.495 21.332 1.683 1.00 0.00 H ATOM 2428 HD2 PHE A 359 -2.950 19.497 -1.409 1.00 0.00 H ATOM 2429 HE2 PHE A 359 -1.767 20.063 -3.493 1.00 0.00 H ATOM 2430 HZ PHE A 359 0.123 21.664 -3.459 1.00 0.00 H ATOM 2431 HE1 PHE A 359 0.862 22.662 -1.318 1.00 0.00 H ATOM 2432 HD1 PHE A 359 -0.336 22.099 0.765 1.00 0.00 H ATOM 2433 H PHE A 359 -2.794 17.955 0.579 1.00 0.00 H ATOM 2434 N ASP A 360 -3.453 18.934 3.627 1.00 38.91 N ATOM 2435 CA ASP A 360 -3.961 18.937 4.988 1.00 39.15 C ATOM 2436 C ASP A 360 -2.923 18.257 5.845 1.00 38.67 C ATOM 2437 O ASP A 360 -2.377 18.869 6.782 1.00 39.14 O ATOM 2438 CB ASP A 360 -5.324 18.248 5.097 1.00 39.53 C ATOM 2439 CG ASP A 360 -6.426 19.006 4.347 1.00 41.31 C ATOM 2440 OD1 ASP A 360 -7.226 18.339 3.660 1.00 44.05 O ATOM 2441 OD2 ASP A 360 -6.493 20.261 4.420 1.00 42.45 O ATOM 2442 HA ASP A 360 -4.128 19.960 5.325 1.00 0.00 H ATOM 2443 HB2 ASP A 360 -5.243 17.244 4.680 1.00 0.00 H ATOM 2444 HB3 ASP A 360 -5.599 18.181 6.150 1.00 0.00 H ATOM 2445 H ASP A 360 -4.032 18.533 2.861 1.00 0.00 H ATOM 2446 N PHE A 361 -2.599 17.019 5.475 1.00 37.56 N ATOM 2447 CA PHE A 361 -1.591 16.257 6.177 1.00 36.30 C ATOM 2448 C PHE A 361 -0.276 17.025 6.399 1.00 36.30 C ATOM 2449 O PHE A 361 0.247 17.087 7.515 1.00 35.83 O ATOM 2450 CB PHE A 361 -1.325 14.934 5.469 1.00 35.83 C ATOM 2451 CG PHE A 361 -0.407 14.056 6.237 1.00 35.83 C ATOM 2452 CD1 PHE A 361 -0.912 13.202 7.223 1.00 35.47 C ATOM 2453 CD2 PHE A 361 0.977 14.145 6.052 1.00 34.21 C ATOM 2454 CE1 PHE A 361 -0.060 12.417 7.981 1.00 35.00 C ATOM 2455 CE2 PHE A 361 1.834 13.381 6.802 1.00 35.29 C ATOM 2456 CZ PHE A 361 1.323 12.504 7.771 1.00 35.98 C ATOM 2457 HA PHE A 361 -1.999 16.063 7.169 1.00 0.00 H ATOM 2458 HB2 PHE A 361 -2.273 14.414 5.330 1.00 0.00 H ATOM 2459 HB3 PHE A 361 -0.880 15.141 4.496 1.00 0.00 H ATOM 2460 HD2 PHE A 361 1.378 14.829 5.304 1.00 0.00 H ATOM 2461 HE2 PHE A 361 2.910 13.455 6.646 1.00 0.00 H ATOM 2462 HZ PHE A 361 2.003 11.889 8.361 1.00 0.00 H ATOM 2463 HE1 PHE A 361 -0.461 11.738 8.734 1.00 0.00 H ATOM 2464 HD1 PHE A 361 -1.987 13.154 7.396 1.00 0.00 H ATOM 2465 H PHE A 361 -3.083 16.590 4.661 1.00 0.00 H ATOM 2466 N ALA A 362 0.250 17.617 5.335 1.00 36.53 N ATOM 2467 CA ALA A 362 1.561 18.266 5.386 1.00 37.03 C ATOM 2468 C ALA A 362 1.613 19.448 6.338 1.00 37.45 C ATOM 2469 O ALA A 362 2.619 19.644 7.023 1.00 37.24 O ATOM 2470 CB ALA A 362 1.993 18.703 3.996 1.00 37.17 C ATOM 2471 HA ALA A 362 2.254 17.519 5.773 1.00 0.00 H ATOM 2472 HB1 ALA A 362 2.054 17.831 3.345 1.00 0.00 H ATOM 2473 HB2 ALA A 362 1.264 19.407 3.595 1.00 0.00 H ATOM 2474 HB3 ALA A 362 2.970 19.183 4.055 1.00 0.00 H ATOM 2475 H ALA A 362 -0.283 17.620 4.442 1.00 0.00 H ATOM 2476 N MET A 363 0.537 20.239 6.361 1.00 37.99 N ATOM 2477 CA MET A 363 0.475 21.436 7.202 1.00 38.08 C ATOM 2478 C MET A 363 0.579 20.985 8.634 1.00 38.05 C ATOM 2479 O MET A 363 1.391 21.497 9.392 1.00 38.26 O ATOM 2480 CB MET A 363 -0.824 22.234 6.968 1.00 38.34 C ATOM 2481 CG MET A 363 -1.011 22.807 5.561 1.00 37.93 C ATOM 2482 SD MET A 363 0.458 23.668 4.940 1.00 40.41 S ATOM 2483 CE MET A 363 1.313 22.349 4.074 1.00 40.21 C ATOM 2484 HA MET A 363 1.295 22.109 6.949 1.00 0.00 H ATOM 2485 HB2 MET A 363 -1.665 21.572 7.174 1.00 0.00 H ATOM 2486 HB3 MET A 363 -0.837 23.066 7.672 1.00 0.00 H ATOM 2487 HG2 MET A 363 -1.843 23.511 5.581 1.00 0.00 H ATOM 2488 HG3 MET A 363 -1.246 21.988 4.881 1.00 0.00 H ATOM 2489 HE1 MET A 363 1.548 21.548 4.775 1.00 0.00 H ATOM 2490 HE2 MET A 363 0.673 21.963 3.281 1.00 0.00 H ATOM 2491 HE3 MET A 363 2.235 22.738 3.642 1.00 0.00 H ATOM 2492 H MET A 363 -0.280 19.998 5.765 1.00 0.00 H ATOM 2493 N LYS A 364 -0.222 19.985 8.979 1.00 38.42 N ATOM 2494 CA LYS A 364 -0.166 19.368 10.304 1.00 39.10 C ATOM 2495 C LYS A 364 1.227 18.781 10.574 1.00 38.76 C ATOM 2496 O LYS A 364 1.809 18.994 11.628 1.00 38.62 O ATOM 2497 CB LYS A 364 -1.271 18.301 10.454 1.00 39.05 C ATOM 2498 CG LYS A 364 -2.705 18.868 10.497 1.00 39.57 C ATOM 2499 CD LYS A 364 -3.787 17.788 10.765 1.00 40.25 C ATOM 2500 CE LYS A 364 -4.085 16.950 9.519 1.00 43.04 C ATOM 2501 NZ LYS A 364 -5.279 16.068 9.675 1.00 44.41 N ATOM 2502 HA LYS A 364 -0.347 20.139 11.053 1.00 0.00 H ATOM 2503 HB2 LYS A 364 -1.200 17.616 9.609 1.00 0.00 H ATOM 2504 HB3 LYS A 364 -1.093 17.754 11.380 1.00 0.00 H ATOM 2505 HG2 LYS A 364 -2.758 19.615 11.289 1.00 0.00 H ATOM 2506 HG3 LYS A 364 -2.919 19.341 9.539 1.00 0.00 H ATOM 2507 HD2 LYS A 364 -3.436 17.127 11.558 1.00 0.00 H ATOM 2508 HD3 LYS A 364 -4.705 18.281 11.085 1.00 0.00 H ATOM 2509 HE2 LYS A 364 -3.218 16.325 9.306 1.00 0.00 H ATOM 2510 HE3 LYS A 364 -4.260 17.625 8.681 1.00 0.00 H ATOM 2511 HZ1 LYS A 364 -5.122 15.411 10.466 1.00 0.00 H ATOM 2512 HZ2 LYS A 364 -6.117 16.652 9.869 1.00 0.00 H ATOM 2513 HZ3 LYS A 364 -5.427 15.528 8.798 1.00 0.00 H ATOM 2514 H LYS A 364 -0.911 19.629 8.286 1.00 0.00 H ATOM 2515 N PHE A 365 1.764 18.077 9.593 1.00 38.91 N ATOM 2516 CA PHE A 365 3.067 17.465 9.727 1.00 39.48 C ATOM 2517 C PHE A 365 4.212 18.467 9.920 1.00 40.11 C ATOM 2518 O PHE A 365 5.041 18.324 10.828 1.00 40.32 O ATOM 2519 CB PHE A 365 3.333 16.596 8.511 1.00 39.46 C ATOM 2520 CG PHE A 365 4.217 15.444 8.789 1.00 38.89 C ATOM 2521 CD1 PHE A 365 3.717 14.315 9.428 1.00 38.51 C ATOM 2522 CD2 PHE A 365 5.557 15.481 8.419 1.00 39.16 C ATOM 2523 CE1 PHE A 365 4.537 13.225 9.702 1.00 38.69 C ATOM 2524 CE2 PHE A 365 6.394 14.394 8.683 1.00 39.36 C ATOM 2525 CZ PHE A 365 5.877 13.259 9.332 1.00 38.93 C ATOM 2526 HA PHE A 365 3.043 16.867 10.638 1.00 0.00 H ATOM 2527 HB2 PHE A 365 2.380 16.218 8.142 1.00 0.00 H ATOM 2528 HB3 PHE A 365 3.800 17.212 7.743 1.00 0.00 H ATOM 2529 HD2 PHE A 365 5.957 16.364 7.920 1.00 0.00 H ATOM 2530 HE2 PHE A 365 7.443 14.426 8.387 1.00 0.00 H ATOM 2531 HZ PHE A 365 6.525 12.408 9.544 1.00 0.00 H ATOM 2532 HE1 PHE A 365 4.131 12.348 10.205 1.00 0.00 H ATOM 2533 HD1 PHE A 365 2.667 14.283 9.719 1.00 0.00 H ATOM 2534 H PHE A 365 1.237 17.960 8.704 1.00 0.00 H ATOM 2535 N ASN A 366 4.263 19.481 9.071 1.00 40.84 N ATOM 2536 CA ASN A 366 5.341 20.460 9.143 1.00 41.73 C ATOM 2537 C ASN A 366 5.235 21.321 10.408 1.00 42.53 C ATOM 2538 O ASN A 366 6.215 21.954 10.834 1.00 42.68 O ATOM 2539 CB ASN A 366 5.363 21.314 7.876 1.00 41.40 C ATOM 2540 CG ASN A 366 5.628 20.491 6.625 1.00 40.87 C ATOM 2541 OD1 ASN A 366 6.204 19.389 6.689 1.00 40.49 O ATOM 2542 ND2 ASN A 366 5.215 21.021 5.477 1.00 38.79 N ATOM 2543 HA ASN A 366 6.288 19.925 9.207 1.00 0.00 H ATOM 2544 HB2 ASN A 366 4.398 21.810 7.771 1.00 0.00 H ATOM 2545 HB3 ASN A 366 6.147 22.065 7.974 1.00 0.00 H ATOM 2546 HD22 ASN A 366 4.738 21.945 5.473 1.00 0.00 H ATOM 2547 HD21 ASN A 366 5.369 20.511 4.584 1.00 0.00 H ATOM 2548 H ASN A 366 3.526 19.581 8.344 1.00 0.00 H ATOM 2549 N ALA A 367 4.043 21.323 11.010 1.00 42.99 N ATOM 2550 CA ALA A 367 3.844 21.921 12.342 1.00 43.45 C ATOM 2551 C ALA A 367 4.725 21.249 13.407 1.00 43.38 C ATOM 2552 O ALA A 367 5.179 21.911 14.344 1.00 43.65 O ATOM 2553 CB ALA A 367 2.358 21.896 12.749 1.00 43.27 C ATOM 2554 HA ALA A 367 4.155 22.964 12.277 1.00 0.00 H ATOM 2555 HB1 ALA A 367 1.774 22.462 12.023 1.00 0.00 H ATOM 2556 HB2 ALA A 367 2.007 20.864 12.775 1.00 0.00 H ATOM 2557 HB3 ALA A 367 2.245 22.344 13.736 1.00 0.00 H ATOM 2558 H ALA A 367 3.232 20.890 10.525 1.00 0.00 H ATOM 2559 N LEU A 368 4.977 19.948 13.242 1.00 43.12 N ATOM 2560 CA LEU A 368 5.940 19.236 14.081 1.00 43.14 C ATOM 2561 C LEU A 368 7.359 19.746 13.838 1.00 43.26 C ATOM 2562 O LEU A 368 8.236 19.568 14.681 1.00 43.09 O ATOM 2563 CB LEU A 368 5.875 17.726 13.830 1.00 43.06 C ATOM 2564 CG LEU A 368 4.499 17.063 13.980 1.00 43.70 C ATOM 2565 CD1 LEU A 368 4.528 15.667 13.425 1.00 44.43 C ATOM 2566 CD2 LEU A 368 4.002 17.028 15.424 1.00 42.69 C ATOM 2567 HA LEU A 368 5.675 19.427 15.121 1.00 0.00 H ATOM 2568 HB2 LEU A 368 6.221 17.544 12.812 1.00 0.00 H ATOM 2569 HB3 LEU A 368 6.553 17.244 14.534 1.00 0.00 H ATOM 2570 HG LEU A 368 3.800 17.679 13.414 1.00 0.00 H ATOM 2571 HD21 LEU A 368 4.707 16.466 16.036 1.00 0.00 H ATOM 2572 HD22 LEU A 368 3.921 18.046 15.804 1.00 0.00 H ATOM 2573 HD23 LEU A 368 3.025 16.547 15.459 1.00 0.00 H ATOM 2574 HD11 LEU A 368 4.792 15.703 12.368 1.00 0.00 H ATOM 2575 HD12 LEU A 368 5.268 15.078 13.966 1.00 0.00 H ATOM 2576 HD13 LEU A 368 3.544 15.211 13.539 1.00 0.00 H ATOM 2577 H LEU A 368 4.474 19.427 12.496 1.00 0.00 H ATOM 2578 N GLU A 369 7.575 20.374 12.680 1.00 43.68 N ATOM 2579 CA GLU A 369 8.847 21.030 12.352 1.00 44.23 C ATOM 2580 C GLU A 369 9.985 20.044 12.520 1.00 43.72 C ATOM 2581 O GLU A 369 10.967 20.301 13.232 1.00 43.67 O ATOM 2582 CB GLU A 369 9.064 22.282 13.217 1.00 44.20 C ATOM 2583 CG GLU A 369 7.922 23.308 13.130 1.00 45.41 C ATOM 2584 CD GLU A 369 8.104 24.479 14.087 1.00 46.09 C ATOM 2585 OE1 GLU A 369 7.307 25.450 14.013 1.00 47.89 O ATOM 2586 OE2 GLU A 369 9.043 24.429 14.919 1.00 48.21 O ATOM 2587 HA GLU A 369 8.817 21.358 11.313 1.00 0.00 H ATOM 2588 HB2 GLU A 369 9.165 21.968 14.256 1.00 0.00 H ATOM 2589 HB3 GLU A 369 9.986 22.766 12.894 1.00 0.00 H ATOM 2590 HG2 GLU A 369 7.878 23.694 12.112 1.00 0.00 H ATOM 2591 HG3 GLU A 369 6.984 22.806 13.368 1.00 0.00 H ATOM 2592 H GLU A 369 6.808 20.400 11.978 1.00 0.00 H ATOM 2593 N LEU A 370 9.816 18.890 11.884 1.00 43.36 N ATOM 2594 CA LEU A 370 10.824 17.843 11.896 1.00 42.85 C ATOM 2595 C LEU A 370 11.954 18.222 10.971 1.00 42.48 C ATOM 2596 O LEU A 370 11.785 19.084 10.094 1.00 42.26 O ATOM 2597 CB LEU A 370 10.217 16.521 11.423 1.00 42.83 C ATOM 2598 CG LEU A 370 9.364 15.707 12.385 1.00 42.23 C ATOM 2599 CD1 LEU A 370 9.218 14.325 11.821 1.00 40.41 C ATOM 2600 CD2 LEU A 370 10.001 15.649 13.759 1.00 42.19 C ATOM 2601 HA LEU A 370 11.197 17.726 12.913 1.00 0.00 H ATOM 2602 HB2 LEU A 370 9.593 16.748 10.559 1.00 0.00 H ATOM 2603 HB3 LEU A 370 11.045 15.883 11.114 1.00 0.00 H ATOM 2604 HG LEU A 370 8.387 16.177 12.497 1.00 0.00 H ATOM 2605 HD21 LEU A 370 10.984 15.184 13.683 1.00 0.00 H ATOM 2606 HD22 LEU A 370 10.105 16.660 14.153 1.00 0.00 H ATOM 2607 HD23 LEU A 370 9.370 15.061 14.426 1.00 0.00 H ATOM 2608 HD11 LEU A 370 8.736 14.381 10.845 1.00 0.00 H ATOM 2609 HD12 LEU A 370 10.203 13.871 11.715 1.00 0.00 H ATOM 2610 HD13 LEU A 370 8.609 13.722 12.494 1.00 0.00 H ATOM 2611 H LEU A 370 8.932 18.730 11.360 1.00 0.00 H ATOM 2612 N ASP A 371 13.100 17.577 11.154 1.00 41.98 N ATOM 2613 CA ASP A 371 14.198 17.753 10.208 1.00 42.08 C ATOM 2614 C ASP A 371 14.680 16.442 9.567 1.00 41.98 C ATOM 2615 O ASP A 371 14.329 15.343 10.003 1.00 41.81 O ATOM 2616 CB ASP A 371 15.357 18.603 10.791 1.00 41.88 C ATOM 2617 CG ASP A 371 15.978 18.003 12.029 1.00 42.38 C ATOM 2618 OD1 ASP A 371 16.257 16.784 12.059 1.00 42.43 O ATOM 2619 OD2 ASP A 371 16.209 18.770 12.985 1.00 44.50 O ATOM 2620 HA ASP A 371 13.779 18.331 9.384 1.00 0.00 H ATOM 2621 HB2 ASP A 371 16.130 18.701 10.029 1.00 0.00 H ATOM 2622 HB3 ASP A 371 14.969 19.590 11.043 1.00 0.00 H ATOM 2623 H ASP A 371 13.216 16.946 11.972 1.00 0.00 H ATOM 2624 N ASP A 372 15.490 16.576 8.525 1.00 41.78 N ATOM 2625 CA ASP A 372 15.905 15.437 7.742 1.00 41.63 C ATOM 2626 C ASP A 372 16.449 14.282 8.569 1.00 41.31 C ATOM 2627 O ASP A 372 16.207 13.122 8.238 1.00 41.38 O ATOM 2628 CB ASP A 372 16.847 15.887 6.630 1.00 41.83 C ATOM 2629 CG ASP A 372 16.116 16.676 5.555 1.00 43.12 C ATOM 2630 OD1 ASP A 372 15.054 16.193 5.099 1.00 44.60 O ATOM 2631 OD2 ASP A 372 16.584 17.774 5.170 1.00 43.87 O ATOM 2632 HA ASP A 372 15.013 15.015 7.279 1.00 0.00 H ATOM 2633 HB2 ASP A 372 17.627 16.515 7.060 1.00 0.00 H ATOM 2634 HB3 ASP A 372 17.301 15.007 6.175 1.00 0.00 H ATOM 2635 H ASP A 372 15.834 17.523 8.267 1.00 0.00 H ATOM 2636 N SER A 373 17.141 14.586 9.662 1.00 41.27 N ATOM 2637 CA SER A 373 17.575 13.533 10.591 1.00 41.28 C ATOM 2638 C SER A 373 16.383 12.790 11.237 1.00 41.19 C ATOM 2639 O SER A 373 16.401 11.560 11.326 1.00 41.24 O ATOM 2640 CB SER A 373 18.544 14.074 11.650 1.00 41.20 C ATOM 2641 OG SER A 373 17.906 14.980 12.537 1.00 41.32 O ATOM 2642 HA SER A 373 18.118 12.798 9.996 1.00 0.00 H ATOM 2643 HB2 SER A 373 19.363 14.589 11.148 1.00 0.00 H ATOM 2644 HB3 SER A 373 18.941 13.238 12.225 1.00 0.00 H ATOM 2645 HG SER A 373 17.548 15.747 12.023 1.00 0.00 H ATOM 2646 H SER A 373 17.378 15.579 9.862 1.00 0.00 H ATOM 2647 N ASP A 374 15.356 13.527 11.666 1.00 40.74 N ATOM 2648 CA ASP A 374 14.143 12.898 12.183 1.00 40.62 C ATOM 2649 C ASP A 374 13.434 12.126 11.073 1.00 40.22 C ATOM 2650 O ASP A 374 12.979 11.004 11.295 1.00 40.34 O ATOM 2651 CB ASP A 374 13.146 13.911 12.763 1.00 40.82 C ATOM 2652 CG ASP A 374 13.796 14.981 13.619 1.00 41.60 C ATOM 2653 OD1 ASP A 374 14.678 14.656 14.445 1.00 42.33 O ATOM 2654 OD2 ASP A 374 13.389 16.158 13.473 1.00 42.50 O ATOM 2655 HA ASP A 374 14.466 12.232 12.983 1.00 0.00 H ATOM 2656 HB2 ASP A 374 12.629 14.398 11.936 1.00 0.00 H ATOM 2657 HB3 ASP A 374 12.423 13.372 13.375 1.00 0.00 H ATOM 2658 H ASP A 374 15.420 14.564 11.632 1.00 0.00 H ATOM 2659 N ILE A 375 13.341 12.731 9.887 1.00 39.56 N ATOM 2660 CA ILE A 375 12.572 12.148 8.783 1.00 38.80 C ATOM 2661 C ILE A 375 13.229 10.877 8.226 1.00 39.05 C ATOM 2662 O ILE A 375 12.540 9.937 7.825 1.00 39.34 O ATOM 2663 CB ILE A 375 12.243 13.173 7.654 1.00 38.73 C ATOM 2664 CG1 ILE A 375 11.478 14.369 8.229 1.00 38.11 C ATOM 2665 CG2 ILE A 375 11.401 12.514 6.550 1.00 37.36 C ATOM 2666 CD1 ILE A 375 11.212 15.474 7.248 1.00 38.02 C ATOM 2667 HA ILE A 375 11.615 11.855 9.214 1.00 0.00 H ATOM 2668 HB ILE A 375 13.185 13.516 7.225 1.00 0.00 H ATOM 2669 HG12 ILE A 375 10.520 14.011 8.605 1.00 0.00 H ATOM 2670 HG13 ILE A 375 12.060 14.780 9.054 1.00 0.00 H ATOM 2671 HD11 ILE A 375 12.159 15.858 6.869 1.00 0.00 H ATOM 2672 HD12 ILE A 375 10.618 15.088 6.420 1.00 0.00 H ATOM 2673 HD13 ILE A 375 10.666 16.276 7.745 1.00 0.00 H ATOM 2674 HG21 ILE A 375 11.957 11.681 6.119 1.00 0.00 H ATOM 2675 HG22 ILE A 375 10.467 12.148 6.977 1.00 0.00 H ATOM 2676 HG23 ILE A 375 11.184 13.248 5.774 1.00 0.00 H ATOM 2677 H ILE A 375 13.826 13.639 9.742 1.00 0.00 H ATOM 2678 N SER A 376 14.552 10.834 8.216 1.00 38.72 N ATOM 2679 CA SER A 376 15.217 9.590 7.872 1.00 38.71 C ATOM 2680 C SER A 376 14.668 8.450 8.734 1.00 38.48 C ATOM 2681 O SER A 376 14.099 7.481 8.204 1.00 38.65 O ATOM 2682 CB SER A 376 16.756 9.697 7.970 1.00 38.86 C ATOM 2683 OG SER A 376 17.202 10.510 9.053 1.00 39.51 O ATOM 2684 HA SER A 376 15.000 9.370 6.827 1.00 0.00 H ATOM 2685 HB2 SER A 376 17.132 10.124 7.040 1.00 0.00 H ATOM 2686 HB3 SER A 376 17.164 8.695 8.100 1.00 0.00 H ATOM 2687 HG SER A 376 16.847 11.428 8.943 1.00 0.00 H ATOM 2688 H SER A 376 15.108 11.681 8.452 1.00 0.00 H ATOM 2689 N LEU A 377 14.800 8.581 10.055 1.00 38.01 N ATOM 2690 CA LEU A 377 14.473 7.477 10.967 1.00 37.38 C ATOM 2691 C LEU A 377 12.998 7.169 10.870 1.00 37.10 C ATOM 2692 O LEU A 377 12.601 5.995 10.796 1.00 37.22 O ATOM 2693 CB LEU A 377 14.870 7.803 12.408 1.00 37.55 C ATOM 2694 CG LEU A 377 16.191 8.566 12.637 1.00 37.82 C ATOM 2695 CD1 LEU A 377 16.279 9.111 14.041 1.00 37.09 C ATOM 2696 CD2 LEU A 377 17.414 7.718 12.326 1.00 38.27 C ATOM 2697 HA LEU A 377 15.045 6.598 10.670 1.00 0.00 H ATOM 2698 HB2 LEU A 377 14.069 8.404 12.838 1.00 0.00 H ATOM 2699 HB3 LEU A 377 14.943 6.858 12.947 1.00 0.00 H ATOM 2700 HG LEU A 377 16.183 9.402 11.938 1.00 0.00 H ATOM 2701 HD21 LEU A 377 17.418 6.838 12.970 1.00 0.00 H ATOM 2702 HD22 LEU A 377 17.382 7.406 11.282 1.00 0.00 H ATOM 2703 HD23 LEU A 377 18.316 8.304 12.504 1.00 0.00 H ATOM 2704 HD11 LEU A 377 15.450 9.796 14.216 1.00 0.00 H ATOM 2705 HD12 LEU A 377 16.228 8.287 14.753 1.00 0.00 H ATOM 2706 HD13 LEU A 377 17.223 9.642 14.165 1.00 0.00 H ATOM 2707 H LEU A 377 15.141 9.482 10.447 1.00 0.00 H ATOM 2708 N PHE A 378 12.194 8.230 10.817 1.00 36.37 N ATOM 2709 CA PHE A 378 10.746 8.101 10.704 1.00 35.93 C ATOM 2710 C PHE A 378 10.349 7.287 9.480 1.00 35.98 C ATOM 2711 O PHE A 378 9.586 6.320 9.590 1.00 36.13 O ATOM 2712 CB PHE A 378 10.087 9.472 10.653 1.00 35.85 C ATOM 2713 CG PHE A 378 8.588 9.425 10.546 1.00 35.40 C ATOM 2714 CD1 PHE A 378 7.815 8.909 11.580 1.00 35.81 C ATOM 2715 CD2 PHE A 378 7.947 9.920 9.422 1.00 34.26 C ATOM 2716 CE1 PHE A 378 6.429 8.883 11.490 1.00 35.04 C ATOM 2717 CE2 PHE A 378 6.567 9.896 9.323 1.00 33.52 C ATOM 2718 CZ PHE A 378 5.805 9.374 10.357 1.00 35.01 C ATOM 2719 HA PHE A 378 10.397 7.571 11.590 1.00 0.00 H ATOM 2720 HB2 PHE A 378 10.349 10.013 11.562 1.00 0.00 H ATOM 2721 HB3 PHE A 378 10.476 10.008 9.787 1.00 0.00 H ATOM 2722 HD2 PHE A 378 8.538 10.334 8.605 1.00 0.00 H ATOM 2723 HE2 PHE A 378 6.078 10.288 8.431 1.00 0.00 H ATOM 2724 HZ PHE A 378 4.718 9.351 10.278 1.00 0.00 H ATOM 2725 HE1 PHE A 378 5.835 8.477 12.309 1.00 0.00 H ATOM 2726 HD1 PHE A 378 8.303 8.520 12.473 1.00 0.00 H ATOM 2727 H PHE A 378 12.613 9.181 10.858 1.00 0.00 H ATOM 2728 N VAL A 379 10.876 7.675 8.320 1.00 35.57 N ATOM 2729 CA VAL A 379 10.616 6.947 7.093 1.00 35.17 C ATOM 2730 C VAL A 379 11.064 5.499 7.233 1.00 35.33 C ATOM 2731 O VAL A 379 10.351 4.590 6.812 1.00 35.60 O ATOM 2732 CB VAL A 379 11.254 7.647 5.861 1.00 35.05 C ATOM 2733 CG1 VAL A 379 11.399 6.697 4.686 1.00 33.37 C ATOM 2734 CG2 VAL A 379 10.400 8.825 5.463 1.00 35.42 C ATOM 2735 HA VAL A 379 9.540 6.946 6.916 1.00 0.00 H ATOM 2736 HB VAL A 379 12.253 7.982 6.139 1.00 0.00 H ATOM 2737 HG11 VAL A 379 12.036 5.860 4.973 1.00 0.00 H ATOM 2738 HG12 VAL A 379 10.416 6.325 4.398 1.00 0.00 H ATOM 2739 HG13 VAL A 379 11.849 7.226 3.846 1.00 0.00 H ATOM 2740 HG21 VAL A 379 9.399 8.477 5.209 1.00 0.00 H ATOM 2741 HG22 VAL A 379 10.342 9.527 6.294 1.00 0.00 H ATOM 2742 HG23 VAL A 379 10.844 9.319 4.599 1.00 0.00 H ATOM 2743 H VAL A 379 11.486 8.517 8.294 1.00 0.00 H ATOM 2744 N ALA A 380 12.221 5.283 7.851 1.00 35.37 N ATOM 2745 CA ALA A 380 12.725 3.923 8.042 1.00 35.50 C ATOM 2746 C ALA A 380 11.796 3.084 8.933 1.00 35.53 C ATOM 2747 O ALA A 380 11.651 1.881 8.732 1.00 35.23 O ATOM 2748 CB ALA A 380 14.134 3.953 8.600 1.00 35.48 C ATOM 2749 HA ALA A 380 12.748 3.441 7.065 1.00 0.00 H ATOM 2750 HB1 ALA A 380 14.788 4.479 7.904 1.00 0.00 H ATOM 2751 HB2 ALA A 380 14.132 4.469 9.560 1.00 0.00 H ATOM 2752 HB3 ALA A 380 14.492 2.932 8.735 1.00 0.00 H ATOM 2753 H ALA A 380 12.774 6.090 8.203 1.00 0.00 H ATOM 2754 N ALA A 381 11.149 3.729 9.895 1.00 35.76 N ATOM 2755 CA ALA A 381 10.202 3.039 10.760 1.00 36.50 C ATOM 2756 C ALA A 381 8.936 2.640 10.018 1.00 37.40 C ATOM 2757 O ALA A 381 8.237 1.692 10.435 1.00 37.53 O ATOM 2758 CB ALA A 381 9.853 3.905 11.948 1.00 36.44 C ATOM 2759 HA ALA A 381 10.684 2.124 11.105 1.00 0.00 H ATOM 2760 HB1 ALA A 381 10.758 4.126 12.514 1.00 0.00 H ATOM 2761 HB2 ALA A 381 9.405 4.835 11.599 1.00 0.00 H ATOM 2762 HB3 ALA A 381 9.144 3.376 12.586 1.00 0.00 H ATOM 2763 H ALA A 381 11.321 4.745 10.034 1.00 0.00 H ATOM 2764 N ILE A 382 8.639 3.383 8.943 1.00 38.12 N ATOM 2765 CA ILE A 382 7.471 3.158 8.102 1.00 39.15 C ATOM 2766 C ILE A 382 7.704 1.943 7.227 1.00 40.29 C ATOM 2767 O ILE A 382 6.869 1.032 7.191 1.00 40.59 O ATOM 2768 CB ILE A 382 7.156 4.390 7.218 1.00 39.45 C ATOM 2769 CG1 ILE A 382 6.540 5.514 8.059 1.00 39.65 C ATOM 2770 CG2 ILE A 382 6.223 4.033 6.056 1.00 38.96 C ATOM 2771 CD1 ILE A 382 6.520 6.867 7.356 1.00 38.23 C ATOM 2772 HA ILE A 382 6.613 2.989 8.753 1.00 0.00 H ATOM 2773 HB ILE A 382 8.100 4.735 6.796 1.00 0.00 H ATOM 2774 HG12 ILE A 382 5.514 5.238 8.304 1.00 0.00 H ATOM 2775 HG13 ILE A 382 7.118 5.612 8.978 1.00 0.00 H ATOM 2776 HD11 ILE A 382 7.540 7.164 7.114 1.00 0.00 H ATOM 2777 HD12 ILE A 382 5.936 6.790 6.439 1.00 0.00 H ATOM 2778 HD13 ILE A 382 6.070 7.610 8.014 1.00 0.00 H ATOM 2779 HG21 ILE A 382 6.696 3.275 5.432 1.00 0.00 H ATOM 2780 HG22 ILE A 382 5.284 3.646 6.451 1.00 0.00 H ATOM 2781 HG23 ILE A 382 6.028 4.925 5.461 1.00 0.00 H ATOM 2782 H ILE A 382 9.279 4.165 8.695 1.00 0.00 H ATOM 2783 N ILE A 383 8.835 1.922 6.525 1.00 41.41 N ATOM 2784 CA ILE A 383 9.192 0.755 5.726 1.00 42.81 C ATOM 2785 C ILE A 383 9.285 -0.507 6.586 1.00 43.82 C ATOM 2786 O ILE A 383 8.666 -1.520 6.261 1.00 44.35 O ATOM 2787 CB ILE A 383 10.519 0.928 4.953 1.00 42.87 C ATOM 2788 CG1 ILE A 383 10.507 2.195 4.098 1.00 42.47 C ATOM 2789 CG2 ILE A 383 10.768 -0.301 4.079 1.00 42.43 C ATOM 2790 CD1 ILE A 383 11.880 2.584 3.604 1.00 43.05 C ATOM 2791 HA ILE A 383 8.387 0.651 4.999 1.00 0.00 H ATOM 2792 HB ILE A 383 11.327 1.028 5.678 1.00 0.00 H ATOM 2793 HG12 ILE A 383 9.862 2.027 3.236 1.00 0.00 H ATOM 2794 HG13 ILE A 383 10.107 3.014 4.695 1.00 0.00 H ATOM 2795 HD11 ILE A 383 12.534 2.765 4.457 1.00 0.00 H ATOM 2796 HD12 ILE A 383 12.288 1.777 2.996 1.00 0.00 H ATOM 2797 HD13 ILE A 383 11.805 3.491 3.003 1.00 0.00 H ATOM 2798 HG21 ILE A 383 10.829 -1.188 4.710 1.00 0.00 H ATOM 2799 HG22 ILE A 383 9.948 -0.414 3.370 1.00 0.00 H ATOM 2800 HG23 ILE A 383 11.704 -0.175 3.536 1.00 0.00 H ATOM 2801 H ILE A 383 9.470 2.745 6.546 1.00 0.00 H ATOM 2802 N CYS A 384 10.038 -0.431 7.686 1.00 45.07 N ATOM 2803 CA CYS A 384 10.345 -1.611 8.515 1.00 46.39 C ATOM 2804 C CYS A 384 9.216 -1.926 9.477 1.00 46.90 C ATOM 2805 O CYS A 384 9.383 -1.829 10.689 1.00 47.26 O ATOM 2806 CB CYS A 384 11.658 -1.431 9.295 1.00 46.08 C ATOM 2807 SG CYS A 384 13.059 -0.960 8.268 1.00 46.74 S ATOM 2808 HA CYS A 384 10.462 -2.450 7.830 1.00 0.00 H ATOM 2809 HB2 CYS A 384 11.896 -2.373 9.789 1.00 0.00 H ATOM 2810 HB3 CYS A 384 11.507 -0.656 10.047 1.00 0.00 H ATOM 2811 HG CYS A 384 12.787 0.240 7.644 1.00 0.00 H ATOM 2812 H CYS A 384 10.422 0.494 7.968 1.00 0.00 H ATOM 2813 N CYS A 385 8.080 -2.336 8.928 1.00 47.42 N ATOM 2814 CA CYS A 385 6.854 -2.423 9.695 1.00 48.23 C ATOM 2815 C CYS A 385 6.311 -3.844 9.689 1.00 49.07 C ATOM 2816 O CYS A 385 6.197 -4.456 8.629 1.00 49.24 O ATOM 2817 CB CYS A 385 5.845 -1.440 9.112 1.00 48.05 C ATOM 2818 SG CYS A 385 4.285 -1.390 9.905 1.00 47.20 S ATOM 2819 HA CYS A 385 7.050 -2.163 10.735 1.00 0.00 H ATOM 2820 HB2 CYS A 385 5.681 -1.708 8.068 1.00 0.00 H ATOM 2821 HB3 CYS A 385 6.280 -0.442 9.166 1.00 0.00 H ATOM 2822 HG CYS A 385 3.480 -0.463 9.275 1.00 0.00 H ATOM 2823 H CYS A 385 8.069 -2.601 7.923 1.00 0.00 H ATOM 2824 N GLY A 386 5.987 -4.353 10.880 1.00 49.99 N ATOM 2825 CA GLY A 386 5.557 -5.738 11.083 1.00 50.99 C ATOM 2826 C GLY A 386 4.068 -5.992 10.951 1.00 52.00 C ATOM 2827 O GLY A 386 3.613 -7.122 11.133 1.00 52.42 O ATOM 2828 HA3 GLY A 386 5.861 -6.039 12.086 1.00 0.00 H ATOM 2829 HA2 GLY A 386 6.069 -6.359 10.348 1.00 0.00 H ATOM 2830 H GLY A 386 6.043 -3.730 11.711 1.00 0.00 H ATOM 2831 N ASP A 387 3.309 -4.943 10.637 1.00 52.83 N ATOM 2832 CA ASP A 387 1.870 -5.051 10.419 1.00 53.58 C ATOM 2833 C ASP A 387 1.609 -5.603 9.043 1.00 53.98 C ATOM 2834 O ASP A 387 0.699 -6.409 8.861 1.00 54.20 O ATOM 2835 CB ASP A 387 1.212 -3.675 10.512 1.00 53.72 C ATOM 2836 CG ASP A 387 1.036 -3.207 11.941 1.00 54.76 C ATOM 2837 OD1 ASP A 387 0.067 -2.445 12.200 1.00 55.03 O ATOM 2838 OD2 ASP A 387 1.857 -3.610 12.804 1.00 54.78 O ATOM 2839 HA ASP A 387 1.456 -5.710 11.182 1.00 0.00 H ATOM 2840 HB2 ASP A 387 1.835 -2.954 9.983 1.00 0.00 H ATOM 2841 HB3 ASP A 387 0.232 -3.724 10.038 1.00 0.00 H ATOM 2842 H ASP A 387 3.760 -4.010 10.544 1.00 0.00 H ATOM 2843 N ARG A 388 2.425 -5.152 8.085 1.00 54.47 N ATOM 2844 CA ARG A 388 2.282 -5.454 6.652 1.00 54.55 C ATOM 2845 C ARG A 388 1.894 -6.909 6.410 1.00 55.21 C ATOM 2846 O ARG A 388 2.676 -7.822 6.724 1.00 55.44 O ATOM 2847 CB ARG A 388 3.576 -5.123 5.880 1.00 54.13 C ATOM 2848 CG ARG A 388 4.273 -3.790 6.229 1.00 52.83 C ATOM 2849 CD ARG A 388 3.332 -2.579 6.254 1.00 50.53 C ATOM 2850 NE ARG A 388 4.078 -1.323 6.323 1.00 49.63 N ATOM 2851 CZ ARG A 388 3.535 -0.105 6.343 1.00 48.63 C ATOM 2852 NH1 ARG A 388 2.220 0.060 6.299 1.00 47.86 N ATOM 2853 NH2 ARG A 388 4.316 0.964 6.406 1.00 47.97 N ATOM 2854 HA ARG A 388 1.476 -4.822 6.280 1.00 0.00 H ATOM 2855 HB2 ARG A 388 4.288 -5.927 6.069 1.00 0.00 H ATOM 2856 HB3 ARG A 388 3.330 -5.099 4.818 1.00 0.00 H ATOM 2857 HG2 ARG A 388 4.729 -3.890 7.214 1.00 0.00 H ATOM 2858 HG3 ARG A 388 5.050 -3.605 5.487 1.00 0.00 H ATOM 2859 HD2 ARG A 388 2.681 -2.653 7.125 1.00 0.00 H ATOM 2860 HD3 ARG A 388 2.726 -2.582 5.348 1.00 0.00 H ATOM 2861 HE ARG A 388 5.116 -1.385 6.359 1.00 0.00 H ATOM 2862 HH12 ARG A 388 1.815 1.018 6.316 1.00 0.00 H ATOM 2863 HH11 ARG A 388 1.593 -0.768 6.248 1.00 0.00 H ATOM 2864 HH22 ARG A 388 3.895 1.915 6.422 1.00 0.00 H ATOM 2865 HH21 ARG A 388 5.349 0.852 6.440 1.00 0.00 H ATOM 2866 H ARG A 388 3.218 -4.544 8.373 1.00 0.00 H ATOM 2867 N PRO A 389 0.681 -7.136 5.858 1.00 55.56 N ATOM 2868 CA PRO A 389 0.173 -8.494 5.592 1.00 55.71 C ATOM 2869 C PRO A 389 1.175 -9.379 4.849 1.00 55.96 C ATOM 2870 O PRO A 389 2.008 -8.873 4.101 1.00 56.25 O ATOM 2871 CB PRO A 389 -1.067 -8.252 4.715 1.00 55.60 C ATOM 2872 CG PRO A 389 -1.063 -6.774 4.372 1.00 55.59 C ATOM 2873 CD PRO A 389 -0.285 -6.098 5.451 1.00 55.50 C ATOM 2874 HA PRO A 389 -0.032 -9.025 6.522 1.00 0.00 H ATOM 2875 HD3 PRO A 389 0.226 -5.213 5.071 1.00 0.00 H ATOM 2876 HD2 PRO A 389 -0.931 -5.815 6.282 1.00 0.00 H ATOM 2877 HG3 PRO A 389 -2.083 -6.390 4.343 1.00 0.00 H ATOM 2878 HG2 PRO A 389 -0.588 -6.612 3.405 1.00 0.00 H ATOM 2879 HB2 PRO A 389 -1.010 -8.851 3.806 1.00 0.00 H ATOM 2880 HB3 PRO A 389 -1.973 -8.510 5.263 1.00 0.00 H ATOM 2881 N GLY A 390 1.108 -10.686 5.083 1.00 56.25 N ATOM 2882 CA GLY A 390 1.897 -11.653 4.324 1.00 56.21 C ATOM 2883 C GLY A 390 3.392 -11.703 4.590 1.00 56.23 C ATOM 2884 O GLY A 390 4.140 -12.309 3.811 1.00 56.37 O ATOM 2885 HA3 GLY A 390 1.761 -11.427 3.266 1.00 0.00 H ATOM 2886 HA2 GLY A 390 1.494 -12.643 4.538 1.00 0.00 H ATOM 2887 H GLY A 390 0.473 -11.031 5.831 1.00 0.00 H ATOM 2888 N LEU A 391 3.844 -11.079 5.677 1.00 56.09 N ATOM 2889 CA LEU A 391 5.271 -11.132 6.020 1.00 56.04 C ATOM 2890 C LEU A 391 5.665 -12.550 6.396 1.00 56.08 C ATOM 2891 O LEU A 391 4.836 -13.316 6.888 1.00 56.59 O ATOM 2892 CB LEU A 391 5.623 -10.163 7.147 1.00 55.68 C ATOM 2893 CG LEU A 391 5.433 -8.675 6.865 1.00 54.99 C ATOM 2894 CD1 LEU A 391 5.996 -7.874 8.009 1.00 54.81 C ATOM 2895 CD2 LEU A 391 6.071 -8.261 5.563 1.00 54.38 C ATOM 2896 HA LEU A 391 5.835 -10.824 5.140 1.00 0.00 H ATOM 2897 HB2 LEU A 391 5.002 -10.417 8.006 1.00 0.00 H ATOM 2898 HB3 LEU A 391 6.672 -10.319 7.400 1.00 0.00 H ATOM 2899 HG LEU A 391 4.365 -8.480 6.771 1.00 0.00 H ATOM 2900 HD21 LEU A 391 7.141 -8.467 5.602 1.00 0.00 H ATOM 2901 HD22 LEU A 391 5.621 -8.823 4.745 1.00 0.00 H ATOM 2902 HD23 LEU A 391 5.910 -7.195 5.404 1.00 0.00 H ATOM 2903 HD11 LEU A 391 5.475 -8.141 8.929 1.00 0.00 H ATOM 2904 HD12 LEU A 391 7.059 -8.092 8.116 1.00 0.00 H ATOM 2905 HD13 LEU A 391 5.861 -6.811 7.808 1.00 0.00 H ATOM 2906 H LEU A 391 3.184 -10.553 6.285 1.00 0.00 H ATOM 2907 N LEU A 392 6.914 -12.917 6.149 1.00 55.76 N ATOM 2908 CA LEU A 392 7.319 -14.272 6.455 1.00 55.84 C ATOM 2909 C LEU A 392 7.988 -14.376 7.817 1.00 55.77 C ATOM 2910 O LEU A 392 7.514 -15.118 8.683 1.00 55.99 O ATOM 2911 CB LEU A 392 8.173 -14.850 5.333 1.00 56.08 C ATOM 2912 CG LEU A 392 7.348 -15.081 4.059 1.00 56.89 C ATOM 2913 CD1 LEU A 392 8.217 -15.658 2.949 1.00 57.50 C ATOM 2914 CD2 LEU A 392 6.082 -15.956 4.306 1.00 57.14 C ATOM 2915 HA LEU A 392 6.419 -14.883 6.520 1.00 0.00 H ATOM 2916 HB2 LEU A 392 8.983 -14.155 5.110 1.00 0.00 H ATOM 2917 HB3 LEU A 392 8.592 -15.801 5.661 1.00 0.00 H ATOM 2918 HG LEU A 392 6.983 -14.105 3.738 1.00 0.00 H ATOM 2919 HD21 LEU A 392 6.385 -16.931 4.687 1.00 0.00 H ATOM 2920 HD22 LEU A 392 5.438 -15.463 5.034 1.00 0.00 H ATOM 2921 HD23 LEU A 392 5.541 -16.083 3.368 1.00 0.00 H ATOM 2922 HD11 LEU A 392 9.025 -14.963 2.724 1.00 0.00 H ATOM 2923 HD12 LEU A 392 8.636 -16.610 3.275 1.00 0.00 H ATOM 2924 HD13 LEU A 392 7.610 -15.813 2.057 1.00 0.00 H ATOM 2925 H LEU A 392 7.592 -12.242 5.742 1.00 0.00 H ATOM 2926 N ASN A 393 9.063 -13.616 8.016 1.00 55.24 N ATOM 2927 CA ASN A 393 9.707 -13.546 9.323 1.00 54.70 C ATOM 2928 C ASN A 393 9.195 -12.399 10.201 1.00 54.40 C ATOM 2929 O ASN A 393 9.934 -11.457 10.534 1.00 53.96 O ATOM 2930 CB ASN A 393 11.223 -13.486 9.168 1.00 54.81 C ATOM 2931 CG ASN A 393 11.953 -13.912 10.425 1.00 54.44 C ATOM 2932 OD1 ASN A 393 11.359 -14.084 11.498 1.00 52.63 O ATOM 2933 ND2 ASN A 393 13.260 -14.071 10.298 1.00 55.47 N ATOM 2934 HA ASN A 393 9.437 -14.462 9.849 1.00 0.00 H ATOM 2935 HB2 ASN A 393 11.517 -14.146 8.352 1.00 0.00 H ATOM 2936 HB3 ASN A 393 11.510 -12.462 8.927 1.00 0.00 H ATOM 2937 HD22 ASN A 393 13.716 -13.915 9.376 1.00 0.00 H ATOM 2938 HD21 ASN A 393 13.832 -14.352 11.120 1.00 0.00 H ATOM 2939 H ASN A 393 9.450 -13.062 7.225 1.00 0.00 H ATOM 2940 N VAL A 394 7.929 -12.525 10.592 1.00 54.16 N ATOM 2941 CA VAL A 394 7.205 -11.516 11.367 1.00 54.21 C ATOM 2942 C VAL A 394 7.908 -11.116 12.664 1.00 54.26 C ATOM 2943 O VAL A 394 7.902 -9.935 13.044 1.00 54.20 O ATOM 2944 CB VAL A 394 5.754 -11.979 11.646 1.00 54.08 C ATOM 2945 CG1 VAL A 394 5.192 -11.376 12.936 1.00 54.42 C ATOM 2946 CG2 VAL A 394 4.867 -11.634 10.468 1.00 54.35 C ATOM 2947 HA VAL A 394 7.183 -10.618 10.750 1.00 0.00 H ATOM 2948 HB VAL A 394 5.772 -13.060 11.782 1.00 0.00 H ATOM 2949 HG11 VAL A 394 5.813 -11.680 13.779 1.00 0.00 H ATOM 2950 HG12 VAL A 394 5.192 -10.289 12.857 1.00 0.00 H ATOM 2951 HG13 VAL A 394 4.173 -11.731 13.087 1.00 0.00 H ATOM 2952 HG21 VAL A 394 4.877 -10.555 10.311 1.00 0.00 H ATOM 2953 HG22 VAL A 394 5.240 -12.136 9.575 1.00 0.00 H ATOM 2954 HG23 VAL A 394 3.848 -11.963 10.673 1.00 0.00 H ATOM 2955 H VAL A 394 7.422 -13.395 10.331 1.00 0.00 H ATOM 2956 N GLY A 395 8.521 -12.093 13.325 1.00 54.12 N ATOM 2957 CA GLY A 395 9.140 -11.862 14.626 1.00 54.30 C ATOM 2958 C GLY A 395 10.379 -10.989 14.569 1.00 54.30 C ATOM 2959 O GLY A 395 10.661 -10.220 15.498 1.00 54.27 O ATOM 2960 HA3 GLY A 395 9.418 -12.827 15.050 1.00 0.00 H ATOM 2961 HA2 GLY A 395 8.409 -11.379 15.274 1.00 0.00 H ATOM 2962 H GLY A 395 8.560 -13.044 12.905 1.00 0.00 H ATOM 2963 N HIS A 396 11.117 -11.111 13.470 1.00 54.29 N ATOM 2964 CA HIS A 396 12.386 -10.421 13.335 1.00 54.08 C ATOM 2965 C HIS A 396 12.203 -9.017 12.774 1.00 54.31 C ATOM 2966 O HIS A 396 12.917 -8.093 13.165 1.00 54.58 O ATOM 2967 CB HIS A 396 13.343 -11.214 12.459 1.00 53.74 C ATOM 2968 CG HIS A 396 14.612 -10.484 12.167 1.00 53.44 C ATOM 2969 ND1 HIS A 396 15.000 -10.144 10.890 1.00 52.49 N ATOM 2970 CD2 HIS A 396 15.561 -9.988 12.994 1.00 52.52 C ATOM 2971 CE1 HIS A 396 16.149 -9.498 10.939 1.00 52.16 C ATOM 2972 NE2 HIS A 396 16.510 -9.389 12.204 1.00 52.14 N ATOM 2973 HA HIS A 396 12.815 -10.333 14.333 1.00 0.00 H ATOM 2974 HB2 HIS A 396 13.588 -12.146 12.968 1.00 0.00 H ATOM 2975 HB3 HIS A 396 12.846 -11.437 11.515 1.00 0.00 H ATOM 2976 HD2 HIS A 396 15.570 -10.052 14.082 1.00 0.00 H ATOM 2977 HE1 HIS A 396 16.705 -9.119 10.082 1.00 0.00 H ATOM 2978 H HIS A 396 10.778 -11.713 12.692 1.00 0.00 H ATOM 2979 N ILE A 397 11.262 -8.871 11.845 1.00 54.30 N ATOM 2980 CA ILE A 397 10.842 -7.560 11.372 1.00 54.42 C ATOM 2981 C ILE A 397 10.387 -6.713 12.564 1.00 54.62 C ATOM 2982 O ILE A 397 10.712 -5.530 12.647 1.00 54.49 O ATOM 2983 CB ILE A 397 9.735 -7.680 10.294 1.00 54.42 C ATOM 2984 CG1 ILE A 397 10.336 -8.276 9.020 1.00 54.78 C ATOM 2985 CG2 ILE A 397 9.111 -6.321 9.976 1.00 53.57 C ATOM 2986 CD1 ILE A 397 9.426 -9.243 8.285 1.00 55.56 C ATOM 2987 HA ILE A 397 11.687 -7.063 10.895 1.00 0.00 H ATOM 2988 HB ILE A 397 8.949 -8.328 10.682 1.00 0.00 H ATOM 2989 HG12 ILE A 397 10.580 -7.457 8.343 1.00 0.00 H ATOM 2990 HG13 ILE A 397 11.249 -8.806 9.290 1.00 0.00 H ATOM 2991 HD11 ILE A 397 9.181 -10.079 8.941 1.00 0.00 H ATOM 2992 HD12 ILE A 397 8.511 -8.728 7.993 1.00 0.00 H ATOM 2993 HD13 ILE A 397 9.935 -9.615 7.396 1.00 0.00 H ATOM 2994 HG21 ILE A 397 8.668 -5.905 10.881 1.00 0.00 H ATOM 2995 HG22 ILE A 397 9.882 -5.646 9.605 1.00 0.00 H ATOM 2996 HG23 ILE A 397 8.339 -6.446 9.216 1.00 0.00 H ATOM 2997 H ILE A 397 10.813 -9.719 11.445 1.00 0.00 H ATOM 2998 N GLU A 398 9.672 -7.334 13.498 1.00 54.79 N ATOM 2999 CA GLU A 398 9.243 -6.656 14.714 1.00 55.17 C ATOM 3000 C GLU A 398 10.394 -6.252 15.622 1.00 55.26 C ATOM 3001 O GLU A 398 10.426 -5.122 16.116 1.00 55.67 O ATOM 3002 CB GLU A 398 8.255 -7.512 15.479 1.00 54.98 C ATOM 3003 CG GLU A 398 6.854 -7.335 15.000 1.00 55.75 C ATOM 3004 CD GLU A 398 5.940 -8.389 15.555 1.00 57.44 C ATOM 3005 OE1 GLU A 398 6.397 -9.178 16.411 1.00 57.86 O ATOM 3006 OE2 GLU A 398 4.766 -8.436 15.133 1.00 58.24 O ATOM 3007 HA GLU A 398 8.761 -5.733 14.391 1.00 0.00 H ATOM 3008 HB2 GLU A 398 8.535 -8.559 15.362 1.00 0.00 H ATOM 3009 HB3 GLU A 398 8.301 -7.241 16.534 1.00 0.00 H ATOM 3010 HG2 GLU A 398 6.495 -6.355 15.313 1.00 0.00 H ATOM 3011 HG3 GLU A 398 6.842 -7.394 13.912 1.00 0.00 H ATOM 3012 H GLU A 398 9.412 -8.331 13.356 1.00 0.00 H ATOM 3013 N LYS A 399 11.330 -7.171 15.841 1.00 55.43 N ATOM 3014 CA LYS A 399 12.525 -6.885 16.639 1.00 55.51 C ATOM 3015 C LYS A 399 13.339 -5.785 15.970 1.00 55.29 C ATOM 3016 O LYS A 399 13.926 -4.932 16.628 1.00 55.15 O ATOM 3017 CB LYS A 399 13.371 -8.149 16.818 1.00 55.52 C ATOM 3018 CG LYS A 399 12.799 -9.146 17.816 1.00 55.58 C ATOM 3019 CD LYS A 399 13.608 -10.434 17.805 1.00 57.32 C ATOM 3020 CE LYS A 399 12.877 -11.564 18.519 1.00 58.62 C ATOM 3021 NZ LYS A 399 12.881 -11.427 20.010 1.00 59.32 N ATOM 3022 HA LYS A 399 12.216 -6.545 17.627 1.00 0.00 H ATOM 3023 HB2 LYS A 399 13.456 -8.644 15.850 1.00 0.00 H ATOM 3024 HB3 LYS A 399 14.362 -7.852 17.161 1.00 0.00 H ATOM 3025 HG2 LYS A 399 12.829 -8.711 18.815 1.00 0.00 H ATOM 3026 HG3 LYS A 399 11.766 -9.369 17.549 1.00 0.00 H ATOM 3027 HD2 LYS A 399 13.790 -10.728 16.771 1.00 0.00 H ATOM 3028 HD3 LYS A 399 14.561 -10.258 18.305 1.00 0.00 H ATOM 3029 HE2 LYS A 399 13.358 -12.507 18.257 1.00 0.00 H ATOM 3030 HE3 LYS A 399 11.843 -11.578 18.176 1.00 0.00 H ATOM 3031 HZ1 LYS A 399 13.862 -11.423 20.354 1.00 0.00 H ATOM 3032 HZ2 LYS A 399 12.415 -10.536 20.276 1.00 0.00 H ATOM 3033 HZ3 LYS A 399 12.368 -12.227 20.432 1.00 0.00 H ATOM 3034 H LYS A 399 11.210 -8.120 15.434 1.00 0.00 H ATOM 3035 N MET A 400 13.340 -5.816 14.648 1.00 55.20 N ATOM 3036 CA MET A 400 14.016 -4.828 13.830 1.00 55.37 C ATOM 3037 C MET A 400 13.265 -3.492 13.831 1.00 55.15 C ATOM 3038 O MET A 400 13.872 -2.433 13.708 1.00 55.32 O ATOM 3039 CB MET A 400 14.119 -5.375 12.413 1.00 55.49 C ATOM 3040 CG MET A 400 15.224 -4.817 11.566 1.00 55.80 C ATOM 3041 SD MET A 400 14.793 -5.101 9.844 1.00 55.81 S ATOM 3042 CE MET A 400 15.603 -3.683 9.082 1.00 55.66 C ATOM 3043 HA MET A 400 15.009 -4.639 14.239 1.00 0.00 H ATOM 3044 HB2 MET A 400 14.265 -6.453 12.482 1.00 0.00 H ATOM 3045 HB3 MET A 400 13.176 -5.169 11.907 1.00 0.00 H ATOM 3046 HG2 MET A 400 16.162 -5.320 11.802 1.00 0.00 H ATOM 3047 HG3 MET A 400 15.330 -3.748 11.751 1.00 0.00 H ATOM 3048 HE1 MET A 400 15.190 -2.764 9.497 1.00 0.00 H ATOM 3049 HE2 MET A 400 16.673 -3.725 9.284 1.00 0.00 H ATOM 3050 HE3 MET A 400 15.434 -3.705 8.005 1.00 0.00 H ATOM 3051 H MET A 400 12.831 -6.587 14.171 1.00 0.00 H ATOM 3052 N GLN A 401 11.946 -3.542 13.964 1.00 54.98 N ATOM 3053 CA GLN A 401 11.137 -2.329 14.054 1.00 54.93 C ATOM 3054 C GLN A 401 11.361 -1.685 15.410 1.00 54.83 C ATOM 3055 O GLN A 401 11.735 -0.516 15.494 1.00 54.58 O ATOM 3056 CB GLN A 401 9.649 -2.653 13.867 1.00 54.90 C ATOM 3057 CG GLN A 401 8.727 -1.439 13.904 1.00 54.90 C ATOM 3058 CD GLN A 401 7.238 -1.800 13.856 1.00 55.46 C ATOM 3059 OE1 GLN A 401 6.848 -2.984 13.865 1.00 54.69 O ATOM 3060 NE2 GLN A 401 6.394 -0.767 13.805 1.00 55.76 N ATOM 3061 HA GLN A 401 11.436 -1.641 13.263 1.00 0.00 H ATOM 3062 HB2 GLN A 401 9.526 -3.145 12.902 1.00 0.00 H ATOM 3063 HB3 GLN A 401 9.346 -3.335 14.662 1.00 0.00 H ATOM 3064 HG2 GLN A 401 8.919 -0.888 14.824 1.00 0.00 H ATOM 3065 HG3 GLN A 401 8.956 -0.805 13.047 1.00 0.00 H ATOM 3066 HE22 GLN A 401 6.762 0.206 13.799 1.00 0.00 H ATOM 3067 HE21 GLN A 401 5.368 -0.935 13.771 1.00 0.00 H ATOM 3068 H GLN A 401 11.476 -4.469 14.005 1.00 0.00 H ATOM 3069 N GLU A 402 11.137 -2.470 16.464 1.00 54.72 N ATOM 3070 CA GLU A 402 11.293 -2.020 17.844 1.00 54.94 C ATOM 3071 C GLU A 402 12.670 -1.380 18.066 1.00 54.28 C ATOM 3072 O GLU A 402 12.839 -0.563 18.972 1.00 54.52 O ATOM 3073 CB GLU A 402 11.006 -3.184 18.808 1.00 54.94 C ATOM 3074 CG GLU A 402 11.664 -3.116 20.195 1.00 55.97 C ATOM 3075 CD GLU A 402 11.777 -4.504 20.829 1.00 56.08 C ATOM 3076 OE1 GLU A 402 12.674 -5.284 20.422 1.00 56.51 O ATOM 3077 OE2 GLU A 402 10.958 -4.812 21.731 1.00 57.94 O ATOM 3078 HA GLU A 402 10.564 -1.238 18.054 1.00 0.00 H ATOM 3079 HB2 GLU A 402 9.927 -3.230 18.957 1.00 0.00 H ATOM 3080 HB3 GLU A 402 11.345 -4.102 18.327 1.00 0.00 H ATOM 3081 HG2 GLU A 402 12.662 -2.690 20.094 1.00 0.00 H ATOM 3082 HG3 GLU A 402 11.062 -2.478 20.842 1.00 0.00 H ATOM 3083 H GLU A 402 10.836 -3.451 16.295 1.00 0.00 H ATOM 3084 N GLY A 403 13.625 -1.721 17.201 1.00 53.69 N ATOM 3085 CA GLY A 403 14.970 -1.146 17.233 1.00 52.93 C ATOM 3086 C GLY A 403 15.097 0.226 16.581 1.00 52.74 C ATOM 3087 O GLY A 403 15.779 1.109 17.112 1.00 52.58 O ATOM 3088 HA3 GLY A 403 15.643 -1.830 16.717 1.00 0.00 H ATOM 3089 HA2 GLY A 403 15.275 -1.055 18.275 1.00 0.00 H ATOM 3090 H GLY A 403 13.404 -2.428 16.470 1.00 0.00 H ATOM 3091 N ILE A 404 14.456 0.405 15.423 1.00 52.37 N ATOM 3092 CA ILE A 404 14.451 1.693 14.720 1.00 51.98 C ATOM 3093 C ILE A 404 13.543 2.700 15.444 1.00 52.01 C ATOM 3094 O ILE A 404 13.871 3.885 15.548 1.00 51.88 O ATOM 3095 CB ILE A 404 14.080 1.510 13.220 1.00 52.24 C ATOM 3096 CG1 ILE A 404 15.263 0.889 12.473 1.00 51.41 C ATOM 3097 CG2 ILE A 404 13.659 2.839 12.561 1.00 51.57 C ATOM 3098 CD1 ILE A 404 14.864 0.019 11.328 1.00 51.22 C ATOM 3099 HA ILE A 404 15.459 2.108 14.737 1.00 0.00 H ATOM 3100 HB ILE A 404 13.221 0.842 13.163 1.00 0.00 H ATOM 3101 HG12 ILE A 404 15.889 1.695 12.090 1.00 0.00 H ATOM 3102 HG13 ILE A 404 15.837 0.288 13.178 1.00 0.00 H ATOM 3103 HD11 ILE A 404 14.246 -0.801 11.694 1.00 0.00 H ATOM 3104 HD12 ILE A 404 14.298 0.608 10.606 1.00 0.00 H ATOM 3105 HD13 ILE A 404 15.757 -0.383 10.850 1.00 0.00 H ATOM 3106 HG21 ILE A 404 12.789 3.241 13.080 1.00 0.00 H ATOM 3107 HG22 ILE A 404 14.482 3.551 12.624 1.00 0.00 H ATOM 3108 HG23 ILE A 404 13.409 2.661 11.515 1.00 0.00 H ATOM 3109 H ILE A 404 13.942 -0.397 15.005 1.00 0.00 H ATOM 3110 N VAL A 405 12.418 2.199 15.953 1.00 52.03 N ATOM 3111 CA VAL A 405 11.541 2.918 16.882 1.00 52.03 C ATOM 3112 C VAL A 405 12.287 3.479 18.117 1.00 52.26 C ATOM 3113 O VAL A 405 12.045 4.620 18.527 1.00 52.39 O ATOM 3114 CB VAL A 405 10.336 2.006 17.276 1.00 51.97 C ATOM 3115 CG1 VAL A 405 9.733 2.359 18.647 1.00 51.85 C ATOM 3116 CG2 VAL A 405 9.286 2.030 16.174 1.00 51.77 C ATOM 3117 HA VAL A 405 11.159 3.799 16.367 1.00 0.00 H ATOM 3118 HB VAL A 405 10.716 0.990 17.380 1.00 0.00 H ATOM 3119 HG11 VAL A 405 10.496 2.249 19.417 1.00 0.00 H ATOM 3120 HG12 VAL A 405 9.376 3.389 18.631 1.00 0.00 H ATOM 3121 HG13 VAL A 405 8.901 1.688 18.860 1.00 0.00 H ATOM 3122 HG21 VAL A 405 8.933 3.052 16.032 1.00 0.00 H ATOM 3123 HG22 VAL A 405 9.726 1.664 15.246 1.00 0.00 H ATOM 3124 HG23 VAL A 405 8.449 1.391 16.457 1.00 0.00 H ATOM 3125 H VAL A 405 12.144 1.235 15.673 1.00 0.00 H ATOM 3126 N HIS A 406 13.199 2.691 18.692 1.00 52.50 N ATOM 3127 CA HIS A 406 13.953 3.107 19.894 1.00 52.90 C ATOM 3128 C HIS A 406 14.874 4.304 19.603 1.00 52.66 C ATOM 3129 O HIS A 406 14.866 5.305 20.341 1.00 52.66 O ATOM 3130 CB HIS A 406 14.732 1.917 20.500 1.00 53.09 C ATOM 3131 CG HIS A 406 15.323 2.192 21.854 1.00 54.56 C ATOM 3132 ND1 HIS A 406 14.556 2.319 22.994 1.00 56.09 N ATOM 3133 CD2 HIS A 406 16.610 2.343 22.252 1.00 55.63 C ATOM 3134 CE1 HIS A 406 15.343 2.552 24.031 1.00 55.80 C ATOM 3135 NE2 HIS A 406 16.594 2.575 23.607 1.00 55.34 N ATOM 3136 HA HIS A 406 13.230 3.440 20.638 1.00 0.00 H ATOM 3137 HB2 HIS A 406 14.050 1.072 20.590 1.00 0.00 H ATOM 3138 HB3 HIS A 406 15.543 1.657 19.819 1.00 0.00 H ATOM 3139 HD2 HIS A 406 17.494 2.290 21.616 1.00 0.00 H ATOM 3140 HE1 HIS A 406 15.015 2.700 25.060 1.00 0.00 H ATOM 3141 H HIS A 406 13.385 1.754 18.281 1.00 0.00 H ATOM 3142 N VAL A 407 15.642 4.205 18.518 1.00 52.11 N ATOM 3143 CA VAL A 407 16.550 5.274 18.130 1.00 51.70 C ATOM 3144 C VAL A 407 15.774 6.526 17.727 1.00 51.34 C ATOM 3145 O VAL A 407 16.165 7.640 18.070 1.00 51.02 O ATOM 3146 CB VAL A 407 17.561 4.822 17.038 1.00 51.71 C ATOM 3147 CG1 VAL A 407 16.872 4.108 15.915 1.00 51.81 C ATOM 3148 CG2 VAL A 407 18.353 6.001 16.502 1.00 52.01 C ATOM 3149 HA VAL A 407 17.151 5.530 19.002 1.00 0.00 H ATOM 3150 HB VAL A 407 18.254 4.126 17.510 1.00 0.00 H ATOM 3151 HG11 VAL A 407 16.365 3.225 16.304 1.00 0.00 H ATOM 3152 HG12 VAL A 407 16.142 4.775 15.456 1.00 0.00 H ATOM 3153 HG13 VAL A 407 17.609 3.807 15.171 1.00 0.00 H ATOM 3154 HG21 VAL A 407 17.669 6.728 16.064 1.00 0.00 H ATOM 3155 HG22 VAL A 407 18.906 6.467 17.318 1.00 0.00 H ATOM 3156 HG23 VAL A 407 19.051 5.652 15.741 1.00 0.00 H ATOM 3157 H VAL A 407 15.591 3.345 17.936 1.00 0.00 H ATOM 3158 N LEU A 408 14.665 6.333 17.022 1.00 51.25 N ATOM 3159 CA LEU A 408 13.780 7.445 16.685 1.00 51.38 C ATOM 3160 C LEU A 408 13.282 8.170 17.943 1.00 51.68 C ATOM 3161 O LEU A 408 13.324 9.405 18.002 1.00 51.44 O ATOM 3162 CB LEU A 408 12.599 6.979 15.818 1.00 51.45 C ATOM 3163 CG LEU A 408 11.416 7.939 15.598 1.00 50.85 C ATOM 3164 CD1 LEU A 408 11.799 9.119 14.714 1.00 49.59 C ATOM 3165 CD2 LEU A 408 10.232 7.188 15.018 1.00 50.72 C ATOM 3166 HA LEU A 408 14.364 8.156 16.101 1.00 0.00 H ATOM 3167 HB2 LEU A 408 13.000 6.734 14.835 1.00 0.00 H ATOM 3168 HB3 LEU A 408 12.198 6.077 16.280 1.00 0.00 H ATOM 3169 HG LEU A 408 11.132 8.346 16.568 1.00 0.00 H ATOM 3170 HD21 LEU A 408 10.516 6.746 14.063 1.00 0.00 H ATOM 3171 HD22 LEU A 408 9.929 6.400 15.708 1.00 0.00 H ATOM 3172 HD23 LEU A 408 9.403 7.880 14.868 1.00 0.00 H ATOM 3173 HD11 LEU A 408 12.609 9.676 15.185 1.00 0.00 H ATOM 3174 HD12 LEU A 408 12.127 8.752 13.742 1.00 0.00 H ATOM 3175 HD13 LEU A 408 10.935 9.770 14.585 1.00 0.00 H ATOM 3176 H LEU A 408 14.422 5.373 16.704 1.00 0.00 H ATOM 3177 N ARG A 409 12.827 7.402 18.937 1.00 51.95 N ATOM 3178 CA ARG A 409 12.352 7.964 20.208 1.00 52.52 C ATOM 3179 C ARG A 409 13.426 8.816 20.892 1.00 52.37 C ATOM 3180 O ARG A 409 13.173 9.968 21.244 1.00 52.33 O ATOM 3181 CB ARG A 409 11.843 6.858 21.144 1.00 52.45 C ATOM 3182 CG ARG A 409 11.296 7.352 22.491 1.00 52.97 C ATOM 3183 CD ARG A 409 10.350 6.342 23.173 1.00 53.51 C ATOM 3184 NE ARG A 409 11.013 5.091 23.549 1.00 56.18 N ATOM 3185 CZ ARG A 409 10.950 3.956 22.849 1.00 57.52 C ATOM 3186 NH1 ARG A 409 10.246 3.887 21.726 1.00 57.63 N ATOM 3187 NH2 ARG A 409 11.596 2.874 23.275 1.00 58.31 N ATOM 3188 HA ARG A 409 11.516 8.624 19.978 1.00 0.00 H ATOM 3189 HB2 ARG A 409 11.046 6.320 20.631 1.00 0.00 H ATOM 3190 HB3 ARG A 409 12.669 6.176 21.343 1.00 0.00 H ATOM 3191 HG2 ARG A 409 12.137 7.543 23.157 1.00 0.00 H ATOM 3192 HG3 ARG A 409 10.749 8.280 22.323 1.00 0.00 H ATOM 3193 HD2 ARG A 409 9.537 6.110 22.485 1.00 0.00 H ATOM 3194 HD3 ARG A 409 9.943 6.802 24.073 1.00 0.00 H ATOM 3195 HE ARG A 409 11.574 5.087 24.425 1.00 0.00 H ATOM 3196 HH12 ARG A 409 10.206 2.996 21.191 1.00 0.00 H ATOM 3197 HH11 ARG A 409 9.734 4.724 21.381 1.00 0.00 H ATOM 3198 HH22 ARG A 409 11.546 1.990 22.729 1.00 0.00 H ATOM 3199 HH21 ARG A 409 12.151 2.912 24.154 1.00 0.00 H ATOM 3200 H ARG A 409 12.809 6.370 18.806 1.00 0.00 H ATOM 3201 N LEU A 410 14.623 8.254 21.048 1.00 52.39 N ATOM 3202 CA LEU A 410 15.715 8.951 21.718 1.00 52.64 C ATOM 3203 C LEU A 410 16.274 10.098 20.899 1.00 52.80 C ATOM 3204 O LEU A 410 16.751 11.081 21.471 1.00 52.95 O ATOM 3205 CB LEU A 410 16.851 7.994 22.065 1.00 52.65 C ATOM 3206 CG LEU A 410 16.512 6.792 22.948 1.00 53.45 C ATOM 3207 CD1 LEU A 410 17.620 5.744 22.846 1.00 54.63 C ATOM 3208 CD2 LEU A 410 16.228 7.172 24.401 1.00 52.91 C ATOM 3209 HA LEU A 410 15.284 9.363 22.630 1.00 0.00 H ATOM 3210 HB2 LEU A 410 17.253 7.609 21.128 1.00 0.00 H ATOM 3211 HB3 LEU A 410 17.620 8.571 22.579 1.00 0.00 H ATOM 3212 HG LEU A 410 15.582 6.365 22.573 1.00 0.00 H ATOM 3213 HD21 LEU A 410 17.107 7.656 24.827 1.00 0.00 H ATOM 3214 HD22 LEU A 410 15.381 7.857 24.437 1.00 0.00 H ATOM 3215 HD23 LEU A 410 15.995 6.273 24.971 1.00 0.00 H ATOM 3216 HD11 LEU A 410 17.714 5.416 21.811 1.00 0.00 H ATOM 3217 HD12 LEU A 410 18.562 6.180 23.177 1.00 0.00 H ATOM 3218 HD13 LEU A 410 17.371 4.891 23.478 1.00 0.00 H ATOM 3219 H LEU A 410 14.783 7.294 20.683 1.00 0.00 H ATOM 3220 N HIS A 411 16.238 9.975 19.571 1.00 52.90 N ATOM 3221 CA HIS A 411 16.741 11.048 18.710 1.00 52.84 C ATOM 3222 C HIS A 411 15.880 12.287 18.855 1.00 52.83 C ATOM 3223 O HIS A 411 16.401 13.395 18.997 1.00 52.98 O ATOM 3224 CB HIS A 411 16.826 10.636 17.237 1.00 52.75 C ATOM 3225 CG HIS A 411 17.409 11.698 16.350 1.00 52.07 C ATOM 3226 ND1 HIS A 411 18.766 11.893 16.217 1.00 51.74 N ATOM 3227 CD2 HIS A 411 16.818 12.630 15.564 1.00 51.50 C ATOM 3228 CE1 HIS A 411 18.986 12.898 15.387 1.00 51.43 C ATOM 3229 NE2 HIS A 411 17.821 13.362 14.976 1.00 50.70 N ATOM 3230 HA HIS A 411 17.757 11.266 19.040 1.00 0.00 H ATOM 3231 HB2 HIS A 411 17.449 9.745 17.163 1.00 0.00 H ATOM 3232 HB3 HIS A 411 15.821 10.405 16.884 1.00 0.00 H ATOM 3233 HD2 HIS A 411 15.746 12.772 15.424 1.00 0.00 H ATOM 3234 HE1 HIS A 411 19.964 13.279 15.092 1.00 0.00 H ATOM 3235 H HIS A 411 15.850 9.110 19.144 1.00 0.00 H ATOM 3236 N LEU A 412 14.567 12.084 18.837 1.00 52.78 N ATOM 3237 CA LEU A 412 13.606 13.176 18.950 1.00 53.00 C ATOM 3238 C LEU A 412 13.707 13.854 20.315 1.00 53.34 C ATOM 3239 O LEU A 412 13.388 15.032 20.459 1.00 53.45 O ATOM 3240 CB LEU A 412 12.177 12.672 18.698 1.00 52.80 C ATOM 3241 CG LEU A 412 11.824 12.110 17.315 1.00 51.84 C ATOM 3242 CD1 LEU A 412 10.595 11.225 17.395 1.00 50.76 C ATOM 3243 CD2 LEU A 412 11.623 13.216 16.301 1.00 51.05 C ATOM 3244 HA LEU A 412 13.846 13.916 18.187 1.00 0.00 H ATOM 3245 HB2 LEU A 412 11.983 11.882 19.424 1.00 0.00 H ATOM 3246 HB3 LEU A 412 11.504 13.509 18.885 1.00 0.00 H ATOM 3247 HG LEU A 412 12.666 11.504 16.979 1.00 0.00 H ATOM 3248 HD21 LEU A 412 10.810 13.864 16.628 1.00 0.00 H ATOM 3249 HD22 LEU A 412 12.540 13.798 16.213 1.00 0.00 H ATOM 3250 HD23 LEU A 412 11.374 12.780 15.334 1.00 0.00 H ATOM 3251 HD11 LEU A 412 10.790 10.395 18.074 1.00 0.00 H ATOM 3252 HD12 LEU A 412 9.752 11.809 17.765 1.00 0.00 H ATOM 3253 HD13 LEU A 412 10.363 10.837 16.403 1.00 0.00 H ATOM 3254 H LEU A 412 14.211 11.112 18.739 1.00 0.00 H ATOM 3255 N GLN A 413 14.169 13.107 21.310 1.00 53.76 N ATOM 3256 CA GLN A 413 14.351 13.656 22.647 1.00 54.48 C ATOM 3257 C GLN A 413 15.634 14.488 22.766 1.00 54.54 C ATOM 3258 O GLN A 413 15.698 15.415 23.570 1.00 54.91 O ATOM 3259 CB GLN A 413 14.274 12.542 23.697 1.00 54.69 C ATOM 3260 CG GLN A 413 12.895 11.844 23.713 1.00 55.10 C ATOM 3261 CD GLN A 413 12.800 10.645 24.654 1.00 55.19 C ATOM 3262 OE1 GLN A 413 13.774 10.259 25.310 1.00 56.45 O ATOM 3263 NE2 GLN A 413 11.609 10.048 24.718 1.00 55.74 N ATOM 3264 HA GLN A 413 13.533 14.350 22.839 1.00 0.00 H ATOM 3265 HB2 GLN A 413 15.041 11.799 23.477 1.00 0.00 H ATOM 3266 HB3 GLN A 413 14.460 12.974 24.680 1.00 0.00 H ATOM 3267 HG2 GLN A 413 12.147 12.576 24.018 1.00 0.00 H ATOM 3268 HG3 GLN A 413 12.675 11.501 22.702 1.00 0.00 H ATOM 3269 HE22 GLN A 413 10.816 10.407 24.148 1.00 0.00 H ATOM 3270 HE21 GLN A 413 11.473 9.224 25.338 1.00 0.00 H ATOM 3271 H GLN A 413 14.406 12.110 21.132 1.00 0.00 H ATOM 3272 N SER A 414 16.639 14.178 21.950 1.00 54.50 N ATOM 3273 CA SER A 414 17.829 15.018 21.846 1.00 54.51 C ATOM 3274 C SER A 414 17.546 16.255 20.994 1.00 54.68 C ATOM 3275 O SER A 414 17.996 17.365 21.315 1.00 55.00 O ATOM 3276 CB SER A 414 18.989 14.240 21.218 1.00 54.58 C ATOM 3277 OG SER A 414 19.311 13.086 21.971 1.00 54.86 O ATOM 3278 HA SER A 414 18.102 15.326 22.855 1.00 0.00 H ATOM 3279 HB2 SER A 414 19.865 14.887 21.170 1.00 0.00 H ATOM 3280 HB3 SER A 414 18.707 13.937 20.209 1.00 0.00 H ATOM 3281 HG SER A 414 18.521 12.490 22.014 1.00 0.00 H ATOM 3282 H SER A 414 16.575 13.316 21.372 1.00 0.00 H ATOM 3283 N ASN A 415 16.806 16.057 19.902 1.00 54.26 N ATOM 3284 CA ASN A 415 16.611 17.094 18.893 1.00 53.85 C ATOM 3285 C ASN A 415 15.439 18.010 19.230 1.00 53.68 C ATOM 3286 O ASN A 415 15.456 19.197 18.909 1.00 53.71 O ATOM 3287 CB ASN A 415 16.425 16.446 17.514 1.00 54.04 C ATOM 3288 CG ASN A 415 16.788 17.374 16.363 1.00 53.87 C ATOM 3289 OD1 ASN A 415 17.487 18.371 16.544 1.00 53.86 O ATOM 3290 ND2 ASN A 415 16.314 17.037 15.163 1.00 53.46 N ATOM 3291 HA ASN A 415 17.502 17.721 18.877 1.00 0.00 H ATOM 3292 HB2 ASN A 415 17.058 15.560 17.459 1.00 0.00 H ATOM 3293 HB3 ASN A 415 15.381 16.152 17.407 1.00 0.00 H ATOM 3294 HD22 ASN A 415 15.727 16.185 15.056 1.00 0.00 H ATOM 3295 HD21 ASN A 415 16.531 17.626 14.334 1.00 0.00 H ATOM 3296 H ASN A 415 16.352 15.131 19.765 1.00 0.00 H ATOM 3297 N HIS A 416 14.425 17.457 19.892 1.00 53.38 N ATOM 3298 CA HIS A 416 13.269 18.246 20.295 1.00 53.14 C ATOM 3299 C HIS A 416 12.946 18.093 21.788 1.00 53.08 C ATOM 3300 O HIS A 416 11.873 17.599 22.153 1.00 53.18 O ATOM 3301 CB HIS A 416 12.056 17.904 19.427 1.00 53.13 C ATOM 3302 CG HIS A 416 12.280 18.124 17.963 1.00 52.98 C ATOM 3303 ND1 HIS A 416 11.764 19.208 17.287 1.00 52.59 N ATOM 3304 CD2 HIS A 416 12.969 17.401 17.048 1.00 52.70 C ATOM 3305 CE1 HIS A 416 12.127 19.146 16.018 1.00 52.36 C ATOM 3306 NE2 HIS A 416 12.861 18.060 15.848 1.00 52.81 N ATOM 3307 HA HIS A 416 13.523 19.295 20.139 1.00 0.00 H ATOM 3308 HB2 HIS A 416 11.806 16.855 19.583 1.00 0.00 H ATOM 3309 HB3 HIS A 416 11.219 18.526 19.744 1.00 0.00 H ATOM 3310 HD2 HIS A 416 13.508 16.471 17.230 1.00 0.00 H ATOM 3311 HE1 HIS A 416 11.866 19.867 15.244 1.00 0.00 H ATOM 3312 H HIS A 416 14.459 16.444 20.125 1.00 0.00 H ATOM 3313 N PRO A 417 13.861 18.552 22.661 1.00 53.03 N ATOM 3314 CA PRO A 417 13.605 18.465 24.095 1.00 52.90 C ATOM 3315 C PRO A 417 12.404 19.313 24.452 1.00 52.85 C ATOM 3316 O PRO A 417 11.715 19.027 25.428 1.00 53.09 O ATOM 3317 CB PRO A 417 14.857 19.085 24.718 1.00 52.98 C ATOM 3318 CG PRO A 417 15.893 19.038 23.641 1.00 53.22 C ATOM 3319 CD PRO A 417 15.156 19.196 22.372 1.00 52.94 C ATOM 3320 HA PRO A 417 13.406 17.448 24.432 1.00 0.00 H ATOM 3321 HD3 PRO A 417 15.024 20.249 22.123 1.00 0.00 H ATOM 3322 HD2 PRO A 417 15.671 18.693 21.554 1.00 0.00 H ATOM 3323 HG3 PRO A 417 16.418 18.083 23.660 1.00 0.00 H ATOM 3324 HG2 PRO A 417 16.611 19.849 23.768 1.00 0.00 H ATOM 3325 HB2 PRO A 417 14.665 20.115 25.020 1.00 0.00 H ATOM 3326 HB3 PRO A 417 15.179 18.508 25.585 1.00 0.00 H ATOM 3327 N ASP A 418 12.169 20.345 23.647 1.00 52.41 N ATOM 3328 CA ASP A 418 11.082 21.302 23.844 1.00 52.21 C ATOM 3329 C ASP A 418 9.694 20.676 23.699 1.00 51.71 C ATOM 3330 O ASP A 418 8.689 21.291 24.071 1.00 51.71 O ATOM 3331 CB ASP A 418 11.254 22.489 22.885 1.00 52.22 C ATOM 3332 CG ASP A 418 12.071 22.123 21.652 1.00 52.90 C ATOM 3333 OD1 ASP A 418 12.965 21.257 21.756 1.00 53.35 O ATOM 3334 OD2 ASP A 418 11.832 22.697 20.573 1.00 53.73 O ATOM 3335 HA ASP A 418 11.144 21.653 24.874 1.00 0.00 H ATOM 3336 HB2 ASP A 418 10.268 22.827 22.565 1.00 0.00 H ATOM 3337 HB3 ASP A 418 11.760 23.297 23.414 1.00 0.00 H ATOM 3338 H ASP A 418 12.796 20.479 22.828 1.00 0.00 H ATOM 3339 N ASP A 419 9.641 19.466 23.149 1.00 51.16 N ATOM 3340 CA ASP A 419 8.407 18.690 23.119 1.00 50.86 C ATOM 3341 C ASP A 419 8.732 17.212 23.286 1.00 50.54 C ATOM 3342 O ASP A 419 9.096 16.520 22.330 1.00 50.60 O ATOM 3343 CB ASP A 419 7.611 18.937 21.839 1.00 50.94 C ATOM 3344 CG ASP A 419 6.307 18.128 21.782 1.00 52.02 C ATOM 3345 OD1 ASP A 419 5.700 17.813 22.846 1.00 51.68 O ATOM 3346 OD2 ASP A 419 5.886 17.818 20.645 1.00 52.83 O ATOM 3347 HA ASP A 419 7.777 19.014 23.947 1.00 0.00 H ATOM 3348 HB2 ASP A 419 7.366 19.997 21.780 1.00 0.00 H ATOM 3349 HB3 ASP A 419 8.230 18.661 20.985 1.00 0.00 H ATOM 3350 H ASP A 419 10.503 19.063 22.729 1.00 0.00 H ATOM 3351 N ILE A 420 8.595 16.741 24.521 1.00 49.97 N ATOM 3352 CA ILE A 420 8.994 15.389 24.877 1.00 49.42 C ATOM 3353 C ILE A 420 7.966 14.360 24.366 1.00 48.71 C ATOM 3354 O ILE A 420 8.228 13.149 24.332 1.00 48.60 O ATOM 3355 CB ILE A 420 9.339 15.278 26.411 1.00 49.75 C ATOM 3356 CG1 ILE A 420 9.569 13.824 26.843 1.00 50.31 C ATOM 3357 CG2 ILE A 420 8.285 15.983 27.293 1.00 50.04 C ATOM 3358 CD1 ILE A 420 10.850 13.187 26.288 1.00 50.73 C ATOM 3359 HA ILE A 420 9.924 15.142 24.366 1.00 0.00 H ATOM 3360 HB ILE A 420 10.281 15.806 26.562 1.00 0.00 H ATOM 3361 HG12 ILE A 420 9.619 13.796 27.931 1.00 0.00 H ATOM 3362 HG13 ILE A 420 8.720 13.230 26.505 1.00 0.00 H ATOM 3363 HD11 ILE A 420 10.814 13.191 25.199 1.00 0.00 H ATOM 3364 HD12 ILE A 420 11.714 13.758 26.627 1.00 0.00 H ATOM 3365 HD13 ILE A 420 10.928 12.160 26.646 1.00 0.00 H ATOM 3366 HG21 ILE A 420 8.240 17.040 27.029 1.00 0.00 H ATOM 3367 HG22 ILE A 420 7.310 15.524 27.128 1.00 0.00 H ATOM 3368 HG23 ILE A 420 8.564 15.881 28.342 1.00 0.00 H ATOM 3369 H ILE A 420 8.191 17.358 25.254 1.00 0.00 H ATOM 3370 N PHE A 421 6.824 14.864 23.905 1.00 47.51 N ATOM 3371 CA PHE A 421 5.761 14.005 23.397 1.00 46.48 C ATOM 3372 C PHE A 421 5.675 13.957 21.861 1.00 45.73 C ATOM 3373 O PHE A 421 4.705 13.433 21.290 1.00 45.39 O ATOM 3374 CB PHE A 421 4.440 14.404 24.045 1.00 46.59 C ATOM 3375 CG PHE A 421 4.491 14.364 25.538 1.00 47.09 C ATOM 3376 CD1 PHE A 421 4.523 15.540 26.278 1.00 47.98 C ATOM 3377 CD2 PHE A 421 4.567 13.148 26.207 1.00 46.80 C ATOM 3378 CE1 PHE A 421 4.596 15.501 27.661 1.00 46.98 C ATOM 3379 CE2 PHE A 421 4.643 13.104 27.582 1.00 46.59 C ATOM 3380 CZ PHE A 421 4.659 14.281 28.310 1.00 46.56 C ATOM 3381 HA PHE A 421 6.003 12.980 23.678 1.00 0.00 H ATOM 3382 HB2 PHE A 421 4.191 15.418 23.732 1.00 0.00 H ATOM 3383 HB3 PHE A 421 3.664 13.719 23.704 1.00 0.00 H ATOM 3384 HD2 PHE A 421 4.566 12.219 25.637 1.00 0.00 H ATOM 3385 HE2 PHE A 421 4.690 12.144 28.096 1.00 0.00 H ATOM 3386 HZ PHE A 421 4.721 14.247 29.398 1.00 0.00 H ATOM 3387 HE1 PHE A 421 4.604 16.428 28.235 1.00 0.00 H ATOM 3388 HD1 PHE A 421 4.490 16.502 25.766 1.00 0.00 H ATOM 3389 H PHE A 421 6.686 15.895 23.907 1.00 0.00 H ATOM 3390 N LEU A 422 6.707 14.490 21.202 1.00 44.58 N ATOM 3391 CA LEU A 422 6.796 14.469 19.739 1.00 43.38 C ATOM 3392 C LEU A 422 6.678 13.057 19.146 1.00 42.58 C ATOM 3393 O LEU A 422 5.946 12.865 18.176 1.00 42.26 O ATOM 3394 CB LEU A 422 8.096 15.139 19.265 1.00 43.39 C ATOM 3395 CG LEU A 422 8.371 15.255 17.768 1.00 42.29 C ATOM 3396 CD1 LEU A 422 7.197 15.896 17.050 1.00 41.33 C ATOM 3397 CD2 LEU A 422 9.603 16.086 17.561 1.00 43.06 C ATOM 3398 HA LEU A 422 5.940 15.036 19.372 1.00 0.00 H ATOM 3399 HB2 LEU A 422 8.098 16.151 19.669 1.00 0.00 H ATOM 3400 HB3 LEU A 422 8.922 14.574 19.698 1.00 0.00 H ATOM 3401 HG LEU A 422 8.518 14.256 17.358 1.00 0.00 H ATOM 3402 HD21 LEU A 422 9.446 17.078 17.985 1.00 0.00 H ATOM 3403 HD22 LEU A 422 10.449 15.608 18.055 1.00 0.00 H ATOM 3404 HD23 LEU A 422 9.806 16.173 16.494 1.00 0.00 H ATOM 3405 HD11 LEU A 422 6.306 15.286 17.197 1.00 0.00 H ATOM 3406 HD12 LEU A 422 7.027 16.894 17.454 1.00 0.00 H ATOM 3407 HD13 LEU A 422 7.419 15.967 15.985 1.00 0.00 H ATOM 3408 H LEU A 422 7.474 14.935 21.745 1.00 0.00 H ATOM 3409 N PHE A 423 7.406 12.098 19.731 1.00 41.38 N ATOM 3410 CA PHE A 423 7.387 10.704 19.291 1.00 40.43 C ATOM 3411 C PHE A 423 5.984 10.100 19.322 1.00 39.92 C ATOM 3412 O PHE A 423 5.556 9.513 18.324 1.00 39.55 O ATOM 3413 CB PHE A 423 8.379 9.837 20.089 1.00 40.43 C ATOM 3414 CG PHE A 423 8.263 8.358 19.797 1.00 40.83 C ATOM 3415 CD1 PHE A 423 8.434 7.867 18.496 1.00 40.21 C ATOM 3416 CD2 PHE A 423 7.967 7.458 20.813 1.00 40.72 C ATOM 3417 CE1 PHE A 423 8.312 6.501 18.212 1.00 39.74 C ATOM 3418 CE2 PHE A 423 7.848 6.091 20.540 1.00 40.53 C ATOM 3419 CZ PHE A 423 8.025 5.614 19.228 1.00 40.23 C ATOM 3420 HA PHE A 423 7.711 10.710 18.250 1.00 0.00 H ATOM 3421 HB2 PHE A 423 9.392 10.158 19.845 1.00 0.00 H ATOM 3422 HB3 PHE A 423 8.196 9.994 21.152 1.00 0.00 H ATOM 3423 HD2 PHE A 423 7.826 7.820 21.831 1.00 0.00 H ATOM 3424 HE2 PHE A 423 7.618 5.394 21.346 1.00 0.00 H ATOM 3425 HZ PHE A 423 7.936 4.549 19.016 1.00 0.00 H ATOM 3426 HE1 PHE A 423 8.443 6.140 17.192 1.00 0.00 H ATOM 3427 HD1 PHE A 423 8.667 8.562 17.689 1.00 0.00 H ATOM 3428 H PHE A 423 8.013 12.356 20.535 1.00 0.00 H ATOM 3429 N PRO A 424 5.271 10.219 20.469 1.00 39.51 N ATOM 3430 CA PRO A 424 3.868 9.822 20.497 1.00 39.06 C ATOM 3431 C PRO A 424 3.098 10.412 19.335 1.00 38.67 C ATOM 3432 O PRO A 424 2.301 9.705 18.723 1.00 39.12 O ATOM 3433 CB PRO A 424 3.356 10.413 21.817 1.00 38.85 C ATOM 3434 CG PRO A 424 4.512 10.455 22.683 1.00 38.85 C ATOM 3435 CD PRO A 424 5.720 10.671 21.799 1.00 39.56 C ATOM 3436 HA PRO A 424 3.745 8.742 20.421 1.00 0.00 H ATOM 3437 HD3 PRO A 424 6.001 11.724 21.777 1.00 0.00 H ATOM 3438 HD2 PRO A 424 6.566 10.077 22.146 1.00 0.00 H ATOM 3439 HG3 PRO A 424 4.608 9.514 23.225 1.00 0.00 H ATOM 3440 HG2 PRO A 424 4.417 11.275 23.395 1.00 0.00 H ATOM 3441 HB2 PRO A 424 2.959 11.416 21.659 1.00 0.00 H ATOM 3442 HB3 PRO A 424 2.579 9.779 22.245 1.00 0.00 H ATOM 3443 N LYS A 425 3.335 11.684 19.028 1.00 38.09 N ATOM 3444 CA LYS A 425 2.597 12.358 17.950 1.00 37.90 C ATOM 3445 C LYS A 425 2.937 11.833 16.558 1.00 37.54 C ATOM 3446 O LYS A 425 2.107 11.900 15.644 1.00 37.29 O ATOM 3447 CB LYS A 425 2.757 13.885 18.013 1.00 37.97 C ATOM 3448 CG LYS A 425 1.666 14.572 18.822 1.00 37.78 C ATOM 3449 CD LYS A 425 1.917 16.050 18.973 1.00 38.07 C ATOM 3450 CE LYS A 425 2.885 16.342 20.093 1.00 39.41 C ATOM 3451 NZ LYS A 425 3.651 17.617 19.809 1.00 41.16 N ATOM 3452 HA LYS A 425 1.549 12.116 18.124 1.00 0.00 H ATOM 3453 HB2 LYS A 425 3.721 14.114 18.467 1.00 0.00 H ATOM 3454 HB3 LYS A 425 2.734 14.278 16.997 1.00 0.00 H ATOM 3455 HG2 LYS A 425 0.710 14.427 18.318 1.00 0.00 H ATOM 3456 HG3 LYS A 425 1.625 14.119 19.813 1.00 0.00 H ATOM 3457 HD2 LYS A 425 2.329 16.435 18.040 1.00 0.00 H ATOM 3458 HD3 LYS A 425 0.971 16.549 19.184 1.00 0.00 H ATOM 3459 HE2 LYS A 425 3.587 15.514 20.186 1.00 0.00 H ATOM 3460 HE3 LYS A 425 2.332 16.455 21.026 1.00 0.00 H ATOM 3461 HZ1 LYS A 425 4.182 17.511 18.921 1.00 0.00 H ATOM 3462 HZ2 LYS A 425 2.983 18.409 19.722 1.00 0.00 H ATOM 3463 HZ3 LYS A 425 4.313 17.804 20.589 1.00 0.00 H ATOM 3464 H LYS A 425 4.056 12.212 19.560 1.00 0.00 H ATOM 3465 N LEU A 426 4.150 11.309 16.401 1.00 37.46 N ATOM 3466 CA LEU A 426 4.570 10.757 15.121 1.00 37.47 C ATOM 3467 C LEU A 426 3.935 9.415 14.905 1.00 37.48 C ATOM 3468 O LEU A 426 3.625 9.043 13.779 1.00 37.69 O ATOM 3469 CB LEU A 426 6.084 10.673 15.017 1.00 37.43 C ATOM 3470 CG LEU A 426 6.664 12.026 14.634 1.00 37.98 C ATOM 3471 CD1 LEU A 426 8.177 11.917 14.515 1.00 38.12 C ATOM 3472 CD2 LEU A 426 6.023 12.513 13.335 1.00 37.97 C ATOM 3473 HA LEU A 426 4.234 11.431 14.333 1.00 0.00 H ATOM 3474 HB2 LEU A 426 6.494 10.365 15.979 1.00 0.00 H ATOM 3475 HB3 LEU A 426 6.352 9.939 14.257 1.00 0.00 H ATOM 3476 HG LEU A 426 6.443 12.761 15.408 1.00 0.00 H ATOM 3477 HD21 LEU A 426 6.225 11.795 12.540 1.00 0.00 H ATOM 3478 HD22 LEU A 426 4.946 12.608 13.476 1.00 0.00 H ATOM 3479 HD23 LEU A 426 6.442 13.482 13.066 1.00 0.00 H ATOM 3480 HD11 LEU A 426 8.594 11.601 15.471 1.00 0.00 H ATOM 3481 HD12 LEU A 426 8.428 11.184 13.748 1.00 0.00 H ATOM 3482 HD13 LEU A 426 8.589 12.888 14.241 1.00 0.00 H ATOM 3483 H LEU A 426 4.809 11.294 17.206 1.00 0.00 H ATOM 3484 N LEU A 427 3.711 8.699 15.995 1.00 37.74 N ATOM 3485 CA LEU A 427 2.967 7.461 15.922 1.00 38.21 C ATOM 3486 C LEU A 427 1.516 7.688 15.473 1.00 38.71 C ATOM 3487 O LEU A 427 0.943 6.815 14.831 1.00 38.38 O ATOM 3488 CB LEU A 427 3.058 6.698 17.241 1.00 38.05 C ATOM 3489 CG LEU A 427 4.446 6.191 17.663 1.00 37.31 C ATOM 3490 CD1 LEU A 427 4.308 5.447 18.960 1.00 36.67 C ATOM 3491 CD2 LEU A 427 5.112 5.283 16.633 1.00 35.92 C ATOM 3492 HA LEU A 427 3.425 6.838 15.153 1.00 0.00 H ATOM 3493 HB2 LEU A 427 2.696 7.359 18.029 1.00 0.00 H ATOM 3494 HB3 LEU A 427 2.401 5.832 17.165 1.00 0.00 H ATOM 3495 HG LEU A 427 5.089 7.066 17.762 1.00 0.00 H ATOM 3496 HD21 LEU A 427 4.486 4.407 16.464 1.00 0.00 H ATOM 3497 HD22 LEU A 427 5.238 5.828 15.697 1.00 0.00 H ATOM 3498 HD23 LEU A 427 6.087 4.968 17.005 1.00 0.00 H ATOM 3499 HD11 LEU A 427 3.909 6.117 19.721 1.00 0.00 H ATOM 3500 HD12 LEU A 427 3.629 4.605 18.824 1.00 0.00 H ATOM 3501 HD13 LEU A 427 5.286 5.081 19.273 1.00 0.00 H ATOM 3502 H LEU A 427 4.073 9.029 16.912 1.00 0.00 H ATOM 3503 N GLN A 428 0.942 8.857 15.783 1.00 39.53 N ATOM 3504 CA GLN A 428 -0.397 9.224 15.280 1.00 40.66 C ATOM 3505 C GLN A 428 -0.360 9.560 13.794 1.00 40.63 C ATOM 3506 O GLN A 428 -1.262 9.181 13.045 1.00 40.70 O ATOM 3507 CB GLN A 428 -0.983 10.432 16.009 1.00 40.48 C ATOM 3508 CG GLN A 428 -0.833 10.440 17.523 1.00 41.86 C ATOM 3509 CD GLN A 428 -1.602 11.600 18.171 1.00 42.21 C ATOM 3510 OE1 GLN A 428 -1.002 12.575 18.649 1.00 44.00 O ATOM 3511 NE2 GLN A 428 -2.936 11.502 18.175 1.00 43.68 N ATOM 3512 HA GLN A 428 -1.024 8.351 15.460 1.00 0.00 H ATOM 3513 HB2 GLN A 428 -0.493 11.325 15.621 1.00 0.00 H ATOM 3514 HB3 GLN A 428 -2.048 10.475 15.780 1.00 0.00 H ATOM 3515 HG2 GLN A 428 -1.215 9.499 17.920 1.00 0.00 H ATOM 3516 HG3 GLN A 428 0.224 10.536 17.772 1.00 0.00 H ATOM 3517 HE22 GLN A 428 -3.397 10.666 17.763 1.00 0.00 H ATOM 3518 HE21 GLN A 428 -3.512 12.262 18.590 1.00 0.00 H ATOM 3519 H GLN A 428 1.453 9.525 16.395 1.00 0.00 H ATOM 3520 N LYS A 429 0.675 10.298 13.386 1.00 40.71 N ATOM 3521 CA LYS A 429 0.868 10.689 11.985 1.00 40.82 C ATOM 3522 C LYS A 429 1.062 9.440 11.123 1.00 41.01 C ATOM 3523 O LYS A 429 0.589 9.367 9.989 1.00 40.86 O ATOM 3524 CB LYS A 429 2.065 11.647 11.845 1.00 40.72 C ATOM 3525 CG LYS A 429 1.849 13.025 12.478 1.00 40.99 C ATOM 3526 CD LYS A 429 0.826 13.838 11.680 1.00 41.70 C ATOM 3527 CE LYS A 429 -0.246 14.462 12.563 1.00 42.66 C ATOM 3528 NZ LYS A 429 0.204 15.709 13.221 1.00 43.38 N ATOM 3529 HA LYS A 429 -0.020 11.218 11.640 1.00 0.00 H ATOM 3530 HB2 LYS A 429 2.930 11.185 12.321 1.00 0.00 H ATOM 3531 HB3 LYS A 429 2.268 11.787 10.783 1.00 0.00 H ATOM 3532 HG2 LYS A 429 1.486 12.897 13.498 1.00 0.00 H ATOM 3533 HG3 LYS A 429 2.797 13.563 12.496 1.00 0.00 H ATOM 3534 HD2 LYS A 429 1.349 14.634 11.151 1.00 0.00 H ATOM 3535 HD3 LYS A 429 0.344 13.179 10.958 1.00 0.00 H ATOM 3536 HE2 LYS A 429 -0.525 13.743 13.333 1.00 0.00 H ATOM 3537 HE3 LYS A 429 -1.116 14.688 11.947 1.00 0.00 H ATOM 3538 HZ1 LYS A 429 1.029 15.505 13.820 1.00 0.00 H ATOM 3539 HZ2 LYS A 429 0.464 16.408 12.496 1.00 0.00 H ATOM 3540 HZ3 LYS A 429 -0.567 16.087 13.808 1.00 0.00 H ATOM 3541 H LYS A 429 1.374 10.609 14.091 1.00 0.00 H ATOM 3542 N MET A 430 1.753 8.459 11.687 1.00 41.07 N ATOM 3543 CA MET A 430 1.892 7.148 11.086 1.00 41.78 C ATOM 3544 C MET A 430 0.518 6.532 10.851 1.00 41.36 C ATOM 3545 O MET A 430 0.259 5.946 9.795 1.00 41.52 O ATOM 3546 CB MET A 430 2.703 6.263 12.021 1.00 41.60 C ATOM 3547 CG MET A 430 3.449 5.144 11.375 1.00 41.92 C ATOM 3548 SD MET A 430 4.710 4.546 12.521 1.00 44.09 S ATOM 3549 CE MET A 430 5.868 5.912 12.521 1.00 44.93 C ATOM 3550 HA MET A 430 2.401 7.237 10.126 1.00 0.00 H ATOM 3551 HB2 MET A 430 3.427 6.895 12.535 1.00 0.00 H ATOM 3552 HB3 MET A 430 2.018 5.831 12.750 1.00 0.00 H ATOM 3553 HG2 MET A 430 3.924 5.500 10.461 1.00 0.00 H ATOM 3554 HG3 MET A 430 2.760 4.335 11.134 1.00 0.00 H ATOM 3555 HE1 MET A 430 6.243 6.069 11.510 1.00 0.00 H ATOM 3556 HE2 MET A 430 5.364 6.814 12.867 1.00 0.00 H ATOM 3557 HE3 MET A 430 6.700 5.682 13.187 1.00 0.00 H ATOM 3558 H MET A 430 2.216 8.638 12.601 1.00 0.00 H ATOM 3559 N ALA A 431 -0.361 6.677 11.838 1.00 41.25 N ATOM 3560 CA ALA A 431 -1.741 6.243 11.698 1.00 40.92 C ATOM 3561 C ALA A 431 -2.403 7.056 10.607 1.00 40.53 C ATOM 3562 O ALA A 431 -2.892 6.486 9.647 1.00 40.93 O ATOM 3563 CB ALA A 431 -2.497 6.376 13.010 1.00 40.72 C ATOM 3564 HA ALA A 431 -1.758 5.188 11.426 1.00 0.00 H ATOM 3565 HB1 ALA A 431 -2.015 5.761 13.770 1.00 0.00 H ATOM 3566 HB2 ALA A 431 -2.491 7.419 13.327 1.00 0.00 H ATOM 3567 HB3 ALA A 431 -3.526 6.043 12.871 1.00 0.00 H ATOM 3568 H ALA A 431 -0.054 7.111 12.732 1.00 0.00 H ATOM 3569 N ASP A 432 -2.387 8.380 10.720 1.00 40.23 N ATOM 3570 CA ASP A 432 -3.058 9.223 9.714 1.00 40.54 C ATOM 3571 C ASP A 432 -2.589 8.947 8.285 1.00 40.52 C ATOM 3572 O ASP A 432 -3.340 9.194 7.335 1.00 40.94 O ATOM 3573 CB ASP A 432 -2.887 10.720 9.989 1.00 40.36 C ATOM 3574 CG ASP A 432 -3.324 11.122 11.368 1.00 40.42 C ATOM 3575 OD1 ASP A 432 -4.213 10.463 11.956 1.00 40.94 O ATOM 3576 OD2 ASP A 432 -2.768 12.123 11.856 1.00 40.72 O ATOM 3577 HA ASP A 432 -4.110 8.952 9.801 1.00 0.00 H ATOM 3578 HB2 ASP A 432 -1.834 10.976 9.870 1.00 0.00 H ATOM 3579 HB3 ASP A 432 -3.479 11.276 9.262 1.00 0.00 H ATOM 3580 H ASP A 432 -1.898 8.824 11.523 1.00 0.00 H ATOM 3581 N LEU A 433 -1.350 8.472 8.142 1.00 40.31 N ATOM 3582 CA LEU A 433 -0.770 8.158 6.834 1.00 39.96 C ATOM 3583 C LEU A 433 -1.363 6.912 6.220 1.00 40.32 C ATOM 3584 O LEU A 433 -1.617 6.884 5.014 1.00 39.98 O ATOM 3585 CB LEU A 433 0.750 8.024 6.907 1.00 39.72 C ATOM 3586 CG LEU A 433 1.538 9.325 6.713 1.00 38.78 C ATOM 3587 CD1 LEU A 433 2.934 9.174 7.247 1.00 38.18 C ATOM 3588 CD2 LEU A 433 1.574 9.751 5.265 1.00 37.59 C ATOM 3589 HA LEU A 433 -1.019 9.001 6.189 1.00 0.00 H ATOM 3590 HB2 LEU A 433 1.005 7.620 7.887 1.00 0.00 H ATOM 3591 HB3 LEU A 433 1.063 7.323 6.133 1.00 0.00 H ATOM 3592 HG LEU A 433 1.023 10.106 7.272 1.00 0.00 H ATOM 3593 HD21 LEU A 433 2.049 8.971 4.670 1.00 0.00 H ATOM 3594 HD22 LEU A 433 0.556 9.911 4.909 1.00 0.00 H ATOM 3595 HD23 LEU A 433 2.142 10.677 5.174 1.00 0.00 H ATOM 3596 HD11 LEU A 433 2.891 8.938 8.310 1.00 0.00 H ATOM 3597 HD12 LEU A 433 3.440 8.368 6.715 1.00 0.00 H ATOM 3598 HD13 LEU A 433 3.480 10.106 7.102 1.00 0.00 H ATOM 3599 H LEU A 433 -0.773 8.319 8.994 1.00 0.00 H ATOM 3600 N ARG A 434 -1.591 5.891 7.047 1.00 40.85 N ATOM 3601 CA ARG A 434 -2.185 4.651 6.560 1.00 41.73 C ATOM 3602 C ARG A 434 -3.599 4.864 6.000 1.00 41.01 C ATOM 3603 O ARG A 434 -3.930 4.325 4.946 1.00 41.02 O ATOM 3604 CB ARG A 434 -2.131 3.524 7.601 1.00 41.46 C ATOM 3605 CG ARG A 434 -2.194 2.143 6.923 1.00 43.37 C ATOM 3606 CD ARG A 434 -1.806 0.971 7.816 1.00 43.95 C ATOM 3607 NE ARG A 434 -0.520 1.143 8.497 1.00 49.25 N ATOM 3608 CZ ARG A 434 0.005 0.246 9.338 1.00 51.86 C ATOM 3609 NH1 ARG A 434 -0.646 -0.891 9.595 1.00 51.90 N ATOM 3610 NH2 ARG A 434 1.176 0.484 9.934 1.00 52.53 N ATOM 3611 HA ARG A 434 -1.567 4.322 5.724 1.00 0.00 H ATOM 3612 HB2 ARG A 434 -1.201 3.603 8.164 1.00 0.00 H ATOM 3613 HB3 ARG A 434 -2.976 3.626 8.282 1.00 0.00 H ATOM 3614 HG2 ARG A 434 -3.215 1.982 6.577 1.00 0.00 H ATOM 3615 HG3 ARG A 434 -1.519 2.155 6.067 1.00 0.00 H ATOM 3616 HD2 ARG A 434 -1.751 0.073 7.200 1.00 0.00 H ATOM 3617 HD3 ARG A 434 -2.581 0.844 8.572 1.00 0.00 H ATOM 3618 HE ARG A 434 0.017 2.015 8.315 1.00 0.00 H ATOM 3619 HH12 ARG A 434 -0.237 -1.588 10.249 1.00 0.00 H ATOM 3620 HH11 ARG A 434 -1.562 -1.080 9.141 1.00 0.00 H ATOM 3621 HH22 ARG A 434 1.579 -0.218 10.587 1.00 0.00 H ATOM 3622 HH21 ARG A 434 1.685 1.371 9.745 1.00 0.00 H ATOM 3623 H ARG A 434 -1.342 5.980 8.053 1.00 0.00 H ATOM 3624 N GLN A 435 -4.398 5.665 6.698 1.00 40.83 N ATOM 3625 CA GLN A 435 -5.725 6.106 6.238 1.00 40.79 C ATOM 3626 C GLN A 435 -5.613 6.939 4.961 1.00 40.65 C ATOM 3627 O GLN A 435 -6.325 6.682 3.989 1.00 40.74 O ATOM 3628 CB GLN A 435 -6.439 6.906 7.350 1.00 40.96 C ATOM 3629 CG GLN A 435 -7.658 7.728 6.908 1.00 41.55 C ATOM 3630 HA GLN A 435 -6.319 5.221 6.010 1.00 0.00 H ATOM 3631 HB2 GLN A 435 -6.771 6.199 8.110 1.00 0.00 H ATOM 3632 HB3 GLN A 435 -5.713 7.592 7.786 1.00 0.00 H ATOM 3633 HG2 GLN A 435 -7.351 8.457 6.158 1.00 0.00 H ATOM 3634 HG3 GLN A 435 -8.409 7.062 6.483 1.00 0.00 H ATOM 3635 H GLN A 435 -4.066 6.000 7.625 1.00 0.00 H ATOM 3636 N LEU A 436 -4.711 7.924 4.969 1.00 40.51 N ATOM 3637 CA LEU A 436 -4.429 8.767 3.803 1.00 40.42 C ATOM 3638 C LEU A 436 -4.115 7.965 2.543 1.00 41.00 C ATOM 3639 O LEU A 436 -4.558 8.324 1.456 1.00 40.51 O ATOM 3640 CB LEU A 436 -3.265 9.708 4.098 1.00 40.01 C ATOM 3641 CG LEU A 436 -3.183 10.959 3.227 1.00 39.30 C ATOM 3642 CD1 LEU A 436 -4.272 11.960 3.588 1.00 38.88 C ATOM 3643 CD2 LEU A 436 -1.836 11.588 3.369 1.00 39.33 C ATOM 3644 HA LEU A 436 -5.340 9.334 3.612 1.00 0.00 H ATOM 3645 HB2 LEU A 436 -3.349 10.028 5.136 1.00 0.00 H ATOM 3646 HB3 LEU A 436 -2.340 9.147 3.966 1.00 0.00 H ATOM 3647 HG LEU A 436 -3.336 10.661 2.190 1.00 0.00 H ATOM 3648 HD21 LEU A 436 -1.673 11.863 4.411 1.00 0.00 H ATOM 3649 HD22 LEU A 436 -1.070 10.879 3.055 1.00 0.00 H ATOM 3650 HD23 LEU A 436 -1.785 12.480 2.745 1.00 0.00 H ATOM 3651 HD11 LEU A 436 -5.249 11.500 3.442 1.00 0.00 H ATOM 3652 HD12 LEU A 436 -4.160 12.256 4.631 1.00 0.00 H ATOM 3653 HD13 LEU A 436 -4.183 12.838 2.948 1.00 0.00 H ATOM 3654 H LEU A 436 -4.182 8.102 5.847 1.00 0.00 H ATOM 3655 N VAL A 437 -3.348 6.886 2.710 1.00 41.90 N ATOM 3656 CA VAL A 437 -3.027 5.951 1.632 1.00 42.83 C ATOM 3657 C VAL A 437 -4.240 5.099 1.192 1.00 43.83 C ATOM 3658 O VAL A 437 -4.487 4.975 -0.008 1.00 43.66 O ATOM 3659 CB VAL A 437 -1.796 5.072 1.993 1.00 42.68 C ATOM 3660 CG1 VAL A 437 -1.629 3.923 1.025 1.00 42.39 C ATOM 3661 CG2 VAL A 437 -0.534 5.907 2.017 1.00 42.78 C ATOM 3662 HA VAL A 437 -2.758 6.555 0.765 1.00 0.00 H ATOM 3663 HB VAL A 437 -1.973 4.658 2.986 1.00 0.00 H ATOM 3664 HG11 VAL A 437 -2.520 3.295 1.051 1.00 0.00 H ATOM 3665 HG12 VAL A 437 -1.489 4.316 0.018 1.00 0.00 H ATOM 3666 HG13 VAL A 437 -0.759 3.332 1.311 1.00 0.00 H ATOM 3667 HG21 VAL A 437 -0.375 6.352 1.035 1.00 0.00 H ATOM 3668 HG22 VAL A 437 -0.636 6.696 2.762 1.00 0.00 H ATOM 3669 HG23 VAL A 437 0.315 5.273 2.272 1.00 0.00 H ATOM 3670 H VAL A 437 -2.958 6.700 3.656 1.00 0.00 H ATOM 3671 N THR A 438 -4.980 4.513 2.144 1.00 45.23 N ATOM 3672 CA THR A 438 -6.255 3.819 1.834 1.00 46.68 C ATOM 3673 C THR A 438 -7.170 4.761 1.014 1.00 47.86 C ATOM 3674 O THR A 438 -7.593 4.420 -0.093 1.00 47.93 O ATOM 3675 CB THR A 438 -7.018 3.297 3.120 1.00 46.68 C ATOM 3676 OG1 THR A 438 -6.118 2.658 4.038 1.00 45.82 O ATOM 3677 CG2 THR A 438 -8.098 2.299 2.746 1.00 46.50 C ATOM 3678 HA THR A 438 -6.001 2.933 1.251 1.00 0.00 H ATOM 3679 HB THR A 438 -7.466 4.171 3.593 1.00 0.00 H ATOM 3680 HG1 THR A 438 -5.425 3.305 4.323 1.00 0.00 H ATOM 3681 HG23 THR A 438 -8.794 2.764 2.048 1.00 0.00 H ATOM 3682 HG21 THR A 438 -7.640 1.428 2.278 1.00 0.00 H ATOM 3683 HG22 THR A 438 -8.633 1.991 3.644 1.00 0.00 H ATOM 3684 H THR A 438 -4.651 4.546 3.130 1.00 0.00 H ATOM 3685 N GLU A 439 -7.443 5.948 1.563 1.00 49.26 N ATOM 3686 CA GLU A 439 -8.110 7.044 0.845 1.00 50.48 C ATOM 3687 C GLU A 439 -7.525 7.265 -0.550 1.00 51.10 C ATOM 3688 O GLU A 439 -8.264 7.454 -1.515 1.00 51.53 O ATOM 3689 CB GLU A 439 -8.009 8.342 1.658 1.00 50.67 C ATOM 3690 CG GLU A 439 -8.199 9.645 0.847 1.00 51.72 C ATOM 3691 CD GLU A 439 -7.158 10.744 1.191 1.00 53.31 C ATOM 3692 OE1 GLU A 439 -6.005 10.706 0.653 1.00 50.53 O ATOM 3693 OE2 GLU A 439 -7.514 11.650 1.988 1.00 53.18 O ATOM 3694 HA GLU A 439 -9.155 6.760 0.723 1.00 0.00 H ATOM 3695 HB2 GLU A 439 -8.773 8.314 2.435 1.00 0.00 H ATOM 3696 HB3 GLU A 439 -7.023 8.374 2.121 1.00 0.00 H ATOM 3697 HG2 GLU A 439 -8.113 9.408 -0.213 1.00 0.00 H ATOM 3698 HG3 GLU A 439 -9.195 10.037 1.051 1.00 0.00 H ATOM 3699 H GLU A 439 -7.168 6.106 2.554 1.00 0.00 H ATOM 3700 N HIS A 440 -6.199 7.245 -0.655 1.00 52.02 N ATOM 3701 CA HIS A 440 -5.536 7.513 -1.934 1.00 52.78 C ATOM 3702 C HIS A 440 -5.702 6.360 -2.909 1.00 53.71 C ATOM 3703 O HIS A 440 -5.909 6.579 -4.096 1.00 53.89 O ATOM 3704 CB HIS A 440 -4.054 7.837 -1.750 1.00 52.33 C ATOM 3705 CG HIS A 440 -3.380 8.285 -3.009 1.00 51.56 C ATOM 3706 ND1 HIS A 440 -3.514 9.561 -3.511 1.00 50.38 N ATOM 3707 CD2 HIS A 440 -2.578 7.623 -3.876 1.00 51.01 C ATOM 3708 CE1 HIS A 440 -2.818 9.667 -4.629 1.00 50.26 C ATOM 3709 NE2 HIS A 440 -2.243 8.504 -4.875 1.00 49.76 N ATOM 3710 HA HIS A 440 -6.026 8.390 -2.356 1.00 0.00 H ATOM 3711 HB2 HIS A 440 -3.964 8.631 -1.009 1.00 0.00 H ATOM 3712 HB3 HIS A 440 -3.548 6.943 -1.387 1.00 0.00 H ATOM 3713 HD2 HIS A 440 -2.258 6.584 -3.796 1.00 0.00 H ATOM 3714 HE1 HIS A 440 -2.733 10.563 -5.244 1.00 0.00 H ATOM 3715 H HIS A 440 -5.623 7.036 0.185 1.00 0.00 H ATOM 3716 N ALA A 441 -5.618 5.137 -2.398 1.00 54.95 N ATOM 3717 CA ALA A 441 -5.832 3.944 -3.205 1.00 55.98 C ATOM 3718 C ALA A 441 -7.141 4.031 -3.988 1.00 56.86 C ATOM 3719 O ALA A 441 -7.194 3.660 -5.161 1.00 57.12 O ATOM 3720 CB ALA A 441 -5.805 2.694 -2.334 1.00 55.66 C ATOM 3721 HA ALA A 441 -5.018 3.878 -3.927 1.00 0.00 H ATOM 3722 HB1 ALA A 441 -4.836 2.618 -1.840 1.00 0.00 H ATOM 3723 HB2 ALA A 441 -6.593 2.759 -1.583 1.00 0.00 H ATOM 3724 HB3 ALA A 441 -5.967 1.815 -2.957 1.00 0.00 H ATOM 3725 H ALA A 441 -5.392 5.028 -1.389 1.00 0.00 H ATOM 3726 N GLN A 442 -8.187 4.548 -3.352 1.00 58.04 N ATOM 3727 CA GLN A 442 -9.514 4.529 -3.966 1.00 59.26 C ATOM 3728 C GLN A 442 -9.729 5.662 -4.970 1.00 59.87 C ATOM 3729 O GLN A 442 -10.214 5.422 -6.082 1.00 59.86 O ATOM 3730 CB GLN A 442 -10.599 4.473 -2.897 1.00 59.19 C ATOM 3731 CG GLN A 442 -10.486 3.215 -2.050 1.00 60.00 C ATOM 3732 CD GLN A 442 -11.383 3.229 -0.830 1.00 61.98 C ATOM 3733 OE1 GLN A 442 -10.931 2.936 0.278 1.00 63.26 O ATOM 3734 NE2 GLN A 442 -12.664 3.559 -1.023 1.00 61.77 N ATOM 3735 HA GLN A 442 -9.584 3.616 -4.557 1.00 0.00 H ATOM 3736 HB2 GLN A 442 -10.504 5.345 -2.250 1.00 0.00 H ATOM 3737 HB3 GLN A 442 -11.575 4.487 -3.382 1.00 0.00 H ATOM 3738 HG2 GLN A 442 -10.755 2.357 -2.667 1.00 0.00 H ATOM 3739 HG3 GLN A 442 -9.453 3.113 -1.718 1.00 0.00 H ATOM 3740 HE22 GLN A 442 -13.001 3.799 -1.977 1.00 0.00 H ATOM 3741 HE21 GLN A 442 -13.324 3.576 -0.219 1.00 0.00 H ATOM 3742 H GLN A 442 -8.061 4.970 -2.410 1.00 0.00 H ATOM 3743 N LEU A 443 -9.345 6.880 -4.589 1.00 60.58 N ATOM 3744 CA LEU A 443 -9.336 8.008 -5.519 1.00 61.41 C ATOM 3745 C LEU A 443 -8.538 7.687 -6.777 1.00 61.91 C ATOM 3746 O LEU A 443 -8.820 8.218 -7.858 1.00 62.27 O ATOM 3747 CB LEU A 443 -8.753 9.249 -4.856 1.00 61.47 C ATOM 3748 CG LEU A 443 -9.744 10.141 -4.114 1.00 62.31 C ATOM 3749 CD1 LEU A 443 -9.052 10.888 -2.964 1.00 62.88 C ATOM 3750 CD2 LEU A 443 -10.440 11.106 -5.083 1.00 62.27 C ATOM 3751 HA LEU A 443 -10.371 8.200 -5.802 1.00 0.00 H ATOM 3752 HB2 LEU A 443 -7.999 8.922 -4.141 1.00 0.00 H ATOM 3753 HB3 LEU A 443 -8.279 9.850 -5.632 1.00 0.00 H ATOM 3754 HG LEU A 443 -10.515 9.508 -3.674 1.00 0.00 H ATOM 3755 HD21 LEU A 443 -9.693 11.736 -5.566 1.00 0.00 H ATOM 3756 HD22 LEU A 443 -10.979 10.534 -5.839 1.00 0.00 H ATOM 3757 HD23 LEU A 443 -11.141 11.731 -4.530 1.00 0.00 H ATOM 3758 HD11 LEU A 443 -8.635 10.166 -2.262 1.00 0.00 H ATOM 3759 HD12 LEU A 443 -8.252 11.510 -3.366 1.00 0.00 H ATOM 3760 HD13 LEU A 443 -9.780 11.517 -2.451 1.00 0.00 H ATOM 3761 H LEU A 443 -9.044 7.032 -3.605 1.00 0.00 H ATOM 3762 N VAL A 444 -7.537 6.824 -6.627 1.00 62.21 N ATOM 3763 CA VAL A 444 -6.771 6.347 -7.763 1.00 62.47 C ATOM 3764 C VAL A 444 -7.550 5.291 -8.540 1.00 63.05 C ATOM 3765 O VAL A 444 -7.616 5.360 -9.767 1.00 63.04 O ATOM 3766 CB VAL A 444 -5.346 5.902 -7.352 1.00 62.31 C ATOM 3767 CG1 VAL A 444 -4.995 4.517 -7.875 1.00 62.11 C ATOM 3768 CG2 VAL A 444 -4.343 6.922 -7.825 1.00 61.88 C ATOM 3769 HA VAL A 444 -6.620 7.178 -8.451 1.00 0.00 H ATOM 3770 HB VAL A 444 -5.318 5.838 -6.264 1.00 0.00 H ATOM 3771 HG11 VAL A 444 -5.702 3.790 -7.477 1.00 0.00 H ATOM 3772 HG12 VAL A 444 -5.046 4.517 -8.964 1.00 0.00 H ATOM 3773 HG13 VAL A 444 -3.986 4.255 -7.558 1.00 0.00 H ATOM 3774 HG21 VAL A 444 -4.398 7.008 -8.910 1.00 0.00 H ATOM 3775 HG22 VAL A 444 -4.567 7.887 -7.371 1.00 0.00 H ATOM 3776 HG23 VAL A 444 -3.341 6.606 -7.534 1.00 0.00 H ATOM 3777 H VAL A 444 -7.298 6.483 -5.674 1.00 0.00 H ATOM 3778 N GLN A 445 -8.154 4.334 -7.836 1.00 63.84 N ATOM 3779 CA GLN A 445 -8.980 3.321 -8.494 1.00 64.80 C ATOM 3780 C GLN A 445 -10.046 4.011 -9.346 1.00 65.09 C ATOM 3781 O GLN A 445 -10.102 3.846 -10.571 1.00 65.12 O ATOM 3782 CB GLN A 445 -9.639 2.385 -7.473 1.00 64.85 C ATOM 3783 CG GLN A 445 -8.728 1.291 -6.913 1.00 66.44 C ATOM 3784 CD GLN A 445 -8.483 0.127 -7.883 1.00 68.10 C ATOM 3785 OE1 GLN A 445 -7.970 0.317 -8.997 1.00 68.40 O ATOM 3786 NE2 GLN A 445 -8.831 -1.088 -7.448 1.00 67.21 N ATOM 3787 HA GLN A 445 -8.338 2.712 -9.131 1.00 0.00 H ATOM 3788 HB2 GLN A 445 -9.993 2.990 -6.638 1.00 0.00 H ATOM 3789 HB3 GLN A 445 -10.489 1.903 -7.956 1.00 0.00 H ATOM 3790 HG2 GLN A 445 -7.766 1.739 -6.665 1.00 0.00 H ATOM 3791 HG3 GLN A 445 -9.186 0.893 -6.008 1.00 0.00 H ATOM 3792 HE22 GLN A 445 -9.258 -1.201 -6.507 1.00 0.00 H ATOM 3793 HE21 GLN A 445 -8.674 -1.921 -8.051 1.00 0.00 H ATOM 3794 H GLN A 445 -8.036 4.307 -6.803 1.00 0.00 H ATOM 3795 N ILE A 446 -10.861 4.815 -8.679 1.00 65.43 N ATOM 3796 CA ILE A 446 -11.949 5.534 -9.315 1.00 65.84 C ATOM 3797 C ILE A 446 -11.494 6.257 -10.585 1.00 65.90 C ATOM 3798 O ILE A 446 -12.050 6.026 -11.664 1.00 65.85 O ATOM 3799 CB ILE A 446 -12.659 6.469 -8.290 1.00 65.89 C ATOM 3800 CG1 ILE A 446 -13.600 5.636 -7.407 1.00 65.77 C ATOM 3801 CG2 ILE A 446 -13.409 7.609 -8.994 1.00 66.28 C ATOM 3802 CD1 ILE A 446 -13.669 6.069 -5.954 1.00 66.03 C ATOM 3803 HA ILE A 446 -12.692 4.810 -9.649 1.00 0.00 H ATOM 3804 HB ILE A 446 -11.904 6.936 -7.657 1.00 0.00 H ATOM 3805 HG12 ILE A 446 -14.604 5.701 -7.827 1.00 0.00 H ATOM 3806 HG13 ILE A 446 -13.262 4.600 -7.435 1.00 0.00 H ATOM 3807 HD11 ILE A 446 -12.677 5.998 -5.508 1.00 0.00 H ATOM 3808 HD12 ILE A 446 -14.020 7.099 -5.900 1.00 0.00 H ATOM 3809 HD13 ILE A 446 -14.359 5.420 -5.415 1.00 0.00 H ATOM 3810 HG21 ILE A 446 -12.703 8.204 -9.573 1.00 0.00 H ATOM 3811 HG22 ILE A 446 -14.163 7.189 -9.659 1.00 0.00 H ATOM 3812 HG23 ILE A 446 -13.891 8.240 -8.248 1.00 0.00 H ATOM 3813 H ILE A 446 -10.715 4.936 -7.656 1.00 0.00 H ATOM 3814 N ILE A 447 -10.467 7.095 -10.469 1.00 66.10 N ATOM 3815 CA ILE A 447 -10.005 7.861 -11.623 1.00 66.49 C ATOM 3816 C ILE A 447 -9.568 6.959 -12.778 1.00 67.01 C ATOM 3817 O ILE A 447 -9.751 7.309 -13.950 1.00 67.21 O ATOM 3818 CB ILE A 447 -8.923 8.894 -11.257 1.00 66.26 C ATOM 3819 CG1 ILE A 447 -9.564 10.053 -10.481 1.00 66.50 C ATOM 3820 CG2 ILE A 447 -8.238 9.410 -12.510 1.00 66.33 C ATOM 3821 CD1 ILE A 447 -8.856 11.402 -10.612 1.00 66.45 C ATOM 3822 HA ILE A 447 -10.867 8.430 -11.973 1.00 0.00 H ATOM 3823 HB ILE A 447 -8.170 8.417 -10.630 1.00 0.00 H ATOM 3824 HG12 ILE A 447 -10.586 10.173 -10.840 1.00 0.00 H ATOM 3825 HG13 ILE A 447 -9.580 9.783 -9.425 1.00 0.00 H ATOM 3826 HD11 ILE A 447 -7.834 11.312 -10.244 1.00 0.00 H ATOM 3827 HD12 ILE A 447 -8.841 11.703 -11.660 1.00 0.00 H ATOM 3828 HD13 ILE A 447 -9.390 12.150 -10.026 1.00 0.00 H ATOM 3829 HG21 ILE A 447 -7.771 8.577 -13.036 1.00 0.00 H ATOM 3830 HG22 ILE A 447 -8.976 9.883 -13.158 1.00 0.00 H ATOM 3831 HG23 ILE A 447 -7.477 10.139 -12.232 1.00 0.00 H ATOM 3832 H ILE A 447 -9.991 7.205 -9.551 1.00 0.00 H ATOM 3833 N LYS A 448 -9.027 5.788 -12.449 1.00 67.58 N ATOM 3834 CA LYS A 448 -8.643 4.826 -13.479 1.00 68.07 C ATOM 3835 C LYS A 448 -9.871 4.178 -14.137 1.00 68.36 C ATOM 3836 O LYS A 448 -9.904 4.021 -15.358 1.00 68.41 O ATOM 3837 CB LYS A 448 -7.686 3.765 -12.921 1.00 68.00 C ATOM 3838 CG LYS A 448 -6.503 3.460 -13.849 1.00 68.18 C ATOM 3839 CD LYS A 448 -6.764 2.320 -14.837 1.00 68.32 C ATOM 3840 CE LYS A 448 -6.235 0.986 -14.311 1.00 68.55 C ATOM 3841 NZ LYS A 448 -6.047 -0.019 -15.402 1.00 68.18 N ATOM 3842 HA LYS A 448 -8.112 5.377 -14.255 1.00 0.00 H ATOM 3843 HB2 LYS A 448 -7.295 4.120 -11.968 1.00 0.00 H ATOM 3844 HB3 LYS A 448 -8.247 2.844 -12.762 1.00 0.00 H ATOM 3845 HG2 LYS A 448 -6.272 4.361 -14.418 1.00 0.00 H ATOM 3846 HG3 LYS A 448 -5.645 3.191 -13.233 1.00 0.00 H ATOM 3847 HD2 LYS A 448 -7.838 2.234 -15.003 1.00 0.00 H ATOM 3848 HD3 LYS A 448 -6.269 2.549 -15.781 1.00 0.00 H ATOM 3849 HE2 LYS A 448 -6.945 0.588 -13.586 1.00 0.00 H ATOM 3850 HE3 LYS A 448 -5.276 1.157 -13.822 1.00 0.00 H ATOM 3851 HZ1 LYS A 448 -6.959 -0.195 -15.870 1.00 0.00 H ATOM 3852 HZ2 LYS A 448 -5.365 0.348 -16.096 1.00 0.00 H ATOM 3853 HZ3 LYS A 448 -5.687 -0.906 -14.996 1.00 0.00 H ATOM 3854 H LYS A 448 -8.876 5.555 -11.447 1.00 0.00 H ATOM 3855 N LYS A 449 -10.872 3.819 -13.331 1.00 68.74 N ATOM 3856 CA LYS A 449 -12.073 3.133 -13.830 1.00 69.22 C ATOM 3857 C LYS A 449 -13.173 4.064 -14.373 1.00 69.53 C ATOM 3858 O LYS A 449 -14.188 3.597 -14.905 1.00 69.86 O ATOM 3859 CB LYS A 449 -12.654 2.199 -12.769 1.00 69.26 C ATOM 3860 CG LYS A 449 -11.930 0.862 -12.651 1.00 69.55 C ATOM 3861 CD LYS A 449 -12.884 -0.271 -12.238 1.00 70.34 C ATOM 3862 CE LYS A 449 -13.633 0.029 -10.934 1.00 70.80 C ATOM 3863 NZ LYS A 449 -14.583 -1.062 -10.569 1.00 71.22 N ATOM 3864 HA LYS A 449 -11.724 2.555 -14.686 1.00 0.00 H ATOM 3865 HB2 LYS A 449 -12.602 2.703 -11.804 1.00 0.00 H ATOM 3866 HB3 LYS A 449 -13.697 2.003 -13.019 1.00 0.00 H ATOM 3867 HG2 LYS A 449 -11.485 0.615 -13.615 1.00 0.00 H ATOM 3868 HG3 LYS A 449 -11.143 0.952 -11.902 1.00 0.00 H ATOM 3869 HD2 LYS A 449 -13.614 -0.419 -13.033 1.00 0.00 H ATOM 3870 HD3 LYS A 449 -12.304 -1.184 -12.105 1.00 0.00 H ATOM 3871 HE2 LYS A 449 -14.192 0.957 -11.055 1.00 0.00 H ATOM 3872 HE3 LYS A 449 -12.906 0.146 -10.130 1.00 0.00 H ATOM 3873 HZ1 LYS A 449 -15.285 -1.177 -11.328 1.00 0.00 H ATOM 3874 HZ2 LYS A 449 -14.057 -1.951 -10.444 1.00 0.00 H ATOM 3875 HZ3 LYS A 449 -15.067 -0.816 -9.682 1.00 0.00 H ATOM 3876 H LYS A 449 -10.800 4.032 -12.315 1.00 0.00 H ATOM 3877 N THR A 450 -12.984 5.373 -14.237 1.00 69.48 N ATOM 3878 CA THR A 450 -13.849 6.303 -14.937 1.00 69.34 C ATOM 3879 C THR A 450 -13.031 6.990 -16.026 1.00 69.23 C ATOM 3880 O THR A 450 -13.004 6.522 -17.159 1.00 69.14 O ATOM 3881 CB THR A 450 -14.536 7.327 -13.985 1.00 69.52 C ATOM 3882 OG1 THR A 450 -13.556 8.222 -13.435 1.00 70.09 O ATOM 3883 CG2 THR A 450 -15.288 6.611 -12.850 1.00 69.23 C ATOM 3884 HA THR A 450 -14.671 5.748 -15.389 1.00 0.00 H ATOM 3885 HB THR A 450 -15.260 7.898 -14.567 1.00 0.00 H ATOM 3886 HG1 THR A 450 -12.885 7.702 -12.925 1.00 0.00 H ATOM 3887 HG23 THR A 450 -16.029 5.935 -13.277 1.00 0.00 H ATOM 3888 HG21 THR A 450 -14.579 6.042 -12.248 1.00 0.00 H ATOM 3889 HG22 THR A 450 -15.787 7.350 -12.224 1.00 0.00 H ATOM 3890 H THR A 450 -12.218 5.729 -13.630 1.00 0.00 H ATOM 3891 N GLU A 451 -12.325 8.059 -15.653 1.00 69.36 N ATOM 3892 CA GLU A 451 -11.682 8.997 -16.594 1.00 69.44 C ATOM 3893 C GLU A 451 -10.941 8.340 -17.762 1.00 69.34 C ATOM 3894 O GLU A 451 -9.974 7.599 -17.565 1.00 69.50 O ATOM 3895 CB GLU A 451 -10.771 9.972 -15.842 1.00 69.48 C ATOM 3896 CG GLU A 451 -11.451 10.655 -14.652 1.00 70.01 C ATOM 3897 CD GLU A 451 -12.652 11.511 -15.044 1.00 70.16 C ATOM 3898 OE1 GLU A 451 -12.482 12.485 -15.820 1.00 69.12 O ATOM 3899 OE2 GLU A 451 -13.763 11.208 -14.555 1.00 69.80 O ATOM 3900 HA GLU A 451 -12.502 9.543 -17.060 1.00 0.00 H ATOM 3901 HB2 GLU A 451 -9.905 9.421 -15.475 1.00 0.00 H ATOM 3902 HB3 GLU A 451 -10.441 10.742 -16.539 1.00 0.00 H ATOM 3903 HG2 GLU A 451 -11.788 9.885 -13.959 1.00 0.00 H ATOM 3904 HG3 GLU A 451 -10.720 11.293 -14.156 1.00 0.00 H ATOM 3905 H GLU A 451 -12.221 8.243 -14.635 1.00 0.00 H ATOM 3906 N SER A 452 -11.407 8.646 -18.975 1.00 69.05 N ATOM 3907 CA SER A 452 -11.101 7.864 -20.184 1.00 68.54 C ATOM 3908 C SER A 452 -9.649 7.942 -20.638 1.00 67.86 C ATOM 3909 O SER A 452 -9.145 7.023 -21.289 1.00 67.88 O ATOM 3910 CB SER A 452 -12.038 8.268 -21.333 1.00 68.73 C ATOM 3911 OG SER A 452 -13.389 7.950 -21.021 1.00 69.02 O ATOM 3912 HA SER A 452 -11.268 6.823 -19.908 1.00 0.00 H ATOM 3913 HB2 SER A 452 -11.745 7.735 -22.237 1.00 0.00 H ATOM 3914 HB3 SER A 452 -11.954 9.341 -21.502 1.00 0.00 H ATOM 3915 HG SER A 452 -13.972 8.219 -21.774 1.00 0.00 H ATOM 3916 H SER A 452 -12.019 9.481 -19.071 1.00 0.00 H ATOM 3917 N ASP A 453 -8.993 9.045 -20.296 1.00 66.98 N ATOM 3918 CA ASP A 453 -7.606 9.270 -20.675 1.00 66.03 C ATOM 3919 C ASP A 453 -6.649 9.067 -19.475 1.00 65.28 C ATOM 3920 O ASP A 453 -5.478 9.480 -19.517 1.00 65.07 O ATOM 3921 CB ASP A 453 -7.463 10.670 -21.294 1.00 66.11 C ATOM 3922 CG ASP A 453 -6.313 10.759 -22.287 1.00 66.55 C ATOM 3923 OD1 ASP A 453 -5.634 9.731 -22.529 1.00 67.25 O ATOM 3924 HA ASP A 453 -7.320 8.531 -21.423 1.00 0.00 H ATOM 3925 HB2 ASP A 453 -8.390 10.920 -21.810 1.00 0.00 H ATOM 3926 HB3 ASP A 453 -7.289 11.389 -20.494 1.00 0.00 H ATOM 3927 H ASP A 453 -9.487 9.772 -19.739 1.00 0.00 H ATOM 3928 N ALA A 454 -7.154 8.415 -18.420 1.00 64.03 N ATOM 3929 CA ALA A 454 -6.389 8.182 -17.183 1.00 62.61 C ATOM 3930 C ALA A 454 -5.522 6.923 -17.270 1.00 61.46 C ATOM 3931 O ALA A 454 -6.040 5.795 -17.331 1.00 61.24 O ATOM 3932 CB ALA A 454 -7.315 8.122 -15.966 1.00 62.70 C ATOM 3933 HA ALA A 454 -5.716 9.030 -17.061 1.00 0.00 H ATOM 3934 HB1 ALA A 454 -7.852 9.066 -15.872 1.00 0.00 H ATOM 3935 HB2 ALA A 454 -8.029 7.308 -16.094 1.00 0.00 H ATOM 3936 HB3 ALA A 454 -6.722 7.949 -15.068 1.00 0.00 H ATOM 3937 H ALA A 454 -8.129 8.057 -18.476 1.00 0.00 H ATOM 3938 N ALA A 455 -4.205 7.145 -17.249 1.00 59.78 N ATOM 3939 CA ALA A 455 -3.203 6.113 -17.497 1.00 57.96 C ATOM 3940 C ALA A 455 -2.407 5.781 -16.240 1.00 56.59 C ATOM 3941 O ALA A 455 -1.565 6.577 -15.809 1.00 56.61 O ATOM 3942 CB ALA A 455 -2.260 6.566 -18.610 1.00 58.07 C ATOM 3943 HA ALA A 455 -3.725 5.207 -17.804 1.00 0.00 H ATOM 3944 HB1 ALA A 455 -2.833 6.740 -19.521 1.00 0.00 H ATOM 3945 HB2 ALA A 455 -1.762 7.488 -18.310 1.00 0.00 H ATOM 3946 HB3 ALA A 455 -1.514 5.792 -18.790 1.00 0.00 H ATOM 3947 H ALA A 455 -3.874 8.109 -17.044 1.00 0.00 H ATOM 3948 N LEU A 456 -2.657 4.606 -15.666 1.00 54.45 N ATOM 3949 CA LEU A 456 -1.915 4.179 -14.487 1.00 52.45 C ATOM 3950 C LEU A 456 -0.678 3.346 -14.815 1.00 50.97 C ATOM 3951 O LEU A 456 -0.774 2.186 -15.218 1.00 50.80 O ATOM 3952 CB LEU A 456 -2.821 3.431 -13.514 1.00 52.66 C ATOM 3953 CG LEU A 456 -2.420 3.427 -12.029 1.00 52.97 C ATOM 3954 CD1 LEU A 456 -2.092 4.830 -11.542 1.00 53.37 C ATOM 3955 CD2 LEU A 456 -3.522 2.809 -11.171 1.00 52.75 C ATOM 3956 HA LEU A 456 -1.555 5.092 -14.012 1.00 0.00 H ATOM 3957 HB2 LEU A 456 -3.813 3.877 -13.583 1.00 0.00 H ATOM 3958 HB3 LEU A 456 -2.867 2.393 -13.843 1.00 0.00 H ATOM 3959 HG LEU A 456 -1.522 2.817 -11.931 1.00 0.00 H ATOM 3960 HD21 LEU A 456 -4.438 3.388 -11.286 1.00 0.00 H ATOM 3961 HD22 LEU A 456 -3.697 1.782 -11.491 1.00 0.00 H ATOM 3962 HD23 LEU A 456 -3.215 2.818 -10.125 1.00 0.00 H ATOM 3963 HD11 LEU A 456 -1.263 5.231 -12.125 1.00 0.00 H ATOM 3964 HD12 LEU A 456 -2.966 5.469 -11.664 1.00 0.00 H ATOM 3965 HD13 LEU A 456 -1.813 4.792 -10.489 1.00 0.00 H ATOM 3966 H LEU A 456 -3.391 3.986 -16.064 1.00 0.00 H ATOM 3967 N HIS A 457 0.484 3.963 -14.626 1.00 49.04 N ATOM 3968 CA HIS A 457 1.787 3.315 -14.733 1.00 46.83 C ATOM 3969 C HIS A 457 1.758 1.892 -14.163 1.00 45.80 C ATOM 3970 O HIS A 457 1.223 1.660 -13.073 1.00 44.94 O ATOM 3971 CB HIS A 457 2.801 4.174 -13.986 1.00 46.68 C ATOM 3972 CG HIS A 457 4.233 3.898 -14.327 1.00 45.94 C ATOM 3973 ND1 HIS A 457 4.833 2.674 -14.112 1.00 44.62 N ATOM 3974 CD2 HIS A 457 5.204 4.719 -14.794 1.00 44.34 C ATOM 3975 CE1 HIS A 457 6.104 2.747 -14.463 1.00 45.31 C ATOM 3976 NE2 HIS A 457 6.354 3.977 -14.880 1.00 45.26 N ATOM 3977 HA HIS A 457 2.064 3.226 -15.783 1.00 0.00 H ATOM 3978 HB2 HIS A 457 2.593 5.219 -14.215 1.00 0.00 H ATOM 3979 HB3 HIS A 457 2.668 4.004 -12.918 1.00 0.00 H ATOM 3980 HD2 HIS A 457 5.092 5.772 -15.053 1.00 0.00 H ATOM 3981 HE1 HIS A 457 6.825 1.931 -14.417 1.00 0.00 H ATOM 3982 H HIS A 457 0.463 4.975 -14.386 1.00 0.00 H ATOM 3983 N PRO A 458 2.313 0.929 -14.918 1.00 45.02 N ATOM 3984 CA PRO A 458 2.273 -0.489 -14.557 1.00 44.32 C ATOM 3985 C PRO A 458 2.977 -0.849 -13.254 1.00 43.62 C ATOM 3986 O PRO A 458 2.576 -1.806 -12.599 1.00 43.60 O ATOM 3987 CB PRO A 458 2.953 -1.175 -15.746 1.00 44.24 C ATOM 3988 CG PRO A 458 3.734 -0.124 -16.401 1.00 44.30 C ATOM 3989 CD PRO A 458 2.979 1.135 -16.214 1.00 44.87 C ATOM 3990 HA PRO A 458 1.246 -0.803 -14.372 1.00 0.00 H ATOM 3991 HD3 PRO A 458 3.650 1.993 -16.179 1.00 0.00 H ATOM 3992 HD2 PRO A 458 2.250 1.278 -17.012 1.00 0.00 H ATOM 3993 HG3 PRO A 458 3.846 -0.343 -17.463 1.00 0.00 H ATOM 3994 HG2 PRO A 458 4.720 -0.045 -15.942 1.00 0.00 H ATOM 3995 HB2 PRO A 458 3.605 -1.978 -15.403 1.00 0.00 H ATOM 3996 HB3 PRO A 458 2.208 -1.581 -16.431 1.00 0.00 H ATOM 3997 N LEU A 459 4.011 -0.105 -12.883 1.00 43.10 N ATOM 3998 CA LEU A 459 4.685 -0.321 -11.599 1.00 42.64 C ATOM 3999 C LEU A 459 3.766 0.036 -10.434 1.00 42.58 C ATOM 4000 O LEU A 459 3.553 -0.770 -9.534 1.00 42.35 O ATOM 4001 CB LEU A 459 5.964 0.505 -11.521 1.00 42.55 C ATOM 4002 CG LEU A 459 6.622 0.682 -10.157 1.00 41.62 C ATOM 4003 CD1 LEU A 459 7.265 -0.617 -9.736 1.00 41.89 C ATOM 4004 CD2 LEU A 459 7.637 1.807 -10.201 1.00 40.59 C ATOM 4005 HA LEU A 459 4.940 -1.378 -11.529 1.00 0.00 H ATOM 4006 HB2 LEU A 459 6.696 0.031 -12.175 1.00 0.00 H ATOM 4007 HB3 LEU A 459 5.731 1.500 -11.900 1.00 0.00 H ATOM 4008 HG LEU A 459 5.864 0.950 -9.421 1.00 0.00 H ATOM 4009 HD21 LEU A 459 8.405 1.573 -10.938 1.00 0.00 H ATOM 4010 HD22 LEU A 459 7.137 2.735 -10.477 1.00 0.00 H ATOM 4011 HD23 LEU A 459 8.096 1.919 -9.219 1.00 0.00 H ATOM 4012 HD11 LEU A 459 6.504 -1.395 -9.675 1.00 0.00 H ATOM 4013 HD12 LEU A 459 8.019 -0.902 -10.470 1.00 0.00 H ATOM 4014 HD13 LEU A 459 7.735 -0.489 -8.761 1.00 0.00 H ATOM 4015 H LEU A 459 4.350 0.647 -13.516 1.00 0.00 H ATOM 4016 N LEU A 460 3.220 1.246 -10.473 1.00 42.65 N ATOM 4017 CA LEU A 460 2.255 1.702 -9.483 1.00 42.97 C ATOM 4018 C LEU A 460 1.013 0.817 -9.430 1.00 43.51 C ATOM 4019 O LEU A 460 0.474 0.588 -8.348 1.00 43.71 O ATOM 4020 CB LEU A 460 1.862 3.154 -9.746 1.00 42.54 C ATOM 4021 CG LEU A 460 3.007 4.152 -9.931 1.00 42.10 C ATOM 4022 CD1 LEU A 460 2.460 5.522 -10.229 1.00 40.18 C ATOM 4023 CD2 LEU A 460 3.917 4.195 -8.695 1.00 41.95 C ATOM 4024 HA LEU A 460 2.741 1.633 -8.510 1.00 0.00 H ATOM 4025 HB2 LEU A 460 1.256 3.174 -10.652 1.00 0.00 H ATOM 4026 HB3 LEU A 460 1.262 3.492 -8.902 1.00 0.00 H ATOM 4027 HG LEU A 460 3.610 3.820 -10.776 1.00 0.00 H ATOM 4028 HD21 LEU A 460 3.332 4.495 -7.825 1.00 0.00 H ATOM 4029 HD22 LEU A 460 4.343 3.206 -8.524 1.00 0.00 H ATOM 4030 HD23 LEU A 460 4.719 4.914 -8.861 1.00 0.00 H ATOM 4031 HD11 LEU A 460 1.868 5.484 -11.143 1.00 0.00 H ATOM 4032 HD12 LEU A 460 1.832 5.849 -9.401 1.00 0.00 H ATOM 4033 HD13 LEU A 460 3.286 6.221 -10.358 1.00 0.00 H ATOM 4034 H LEU A 460 3.492 1.893 -11.240 1.00 0.00 H ATOM 4035 N GLN A 461 0.575 0.319 -10.588 1.00 44.26 N ATOM 4036 CA GLN A 461 -0.518 -0.661 -10.677 1.00 45.00 C ATOM 4037 C GLN A 461 -0.243 -1.861 -9.799 1.00 45.25 C ATOM 4038 O GLN A 461 -1.094 -2.280 -9.019 1.00 44.91 O ATOM 4039 CB GLN A 461 -0.715 -1.148 -12.114 1.00 44.86 C ATOM 4040 CG GLN A 461 -1.963 -0.633 -12.786 1.00 46.68 C ATOM 4041 CD GLN A 461 -2.392 -1.493 -13.988 1.00 49.23 C ATOM 4042 OE1 GLN A 461 -2.957 -2.578 -13.825 1.00 49.55 O ATOM 4043 NE2 GLN A 461 -2.137 -0.993 -15.199 1.00 50.12 N ATOM 4044 HA GLN A 461 -1.422 -0.155 -10.339 1.00 0.00 H ATOM 4045 HB2 GLN A 461 0.145 -0.828 -12.703 1.00 0.00 H ATOM 4046 HB3 GLN A 461 -0.760 -2.237 -12.101 1.00 0.00 H ATOM 4047 HG2 GLN A 461 -2.773 -0.624 -12.057 1.00 0.00 H ATOM 4048 HG3 GLN A 461 -1.778 0.383 -13.133 1.00 0.00 H ATOM 4049 HE22 GLN A 461 -1.658 -0.074 -15.292 1.00 0.00 H ATOM 4050 HE21 GLN A 461 -2.417 -1.522 -16.050 1.00 0.00 H ATOM 4051 H GLN A 461 1.027 0.639 -11.468 1.00 0.00 H ATOM 4052 N GLU A 462 0.964 -2.405 -9.938 1.00 46.21 N ATOM 4053 CA GLU A 462 1.388 -3.588 -9.192 1.00 47.02 C ATOM 4054 C GLU A 462 1.405 -3.318 -7.691 1.00 47.37 C ATOM 4055 O GLU A 462 0.943 -4.132 -6.898 1.00 47.75 O ATOM 4056 CB GLU A 462 2.757 -4.056 -9.689 1.00 47.00 C ATOM 4057 CG GLU A 462 3.343 -5.264 -8.969 1.00 47.96 C ATOM 4058 CD GLU A 462 2.507 -6.521 -9.114 1.00 50.47 C ATOM 4059 OE1 GLU A 462 1.656 -6.592 -10.048 1.00 50.99 O ATOM 4060 OE2 GLU A 462 2.713 -7.442 -8.281 1.00 50.29 O ATOM 4061 HA GLU A 462 0.666 -4.386 -9.366 1.00 0.00 H ATOM 4062 HB2 GLU A 462 2.662 -4.309 -10.745 1.00 0.00 H ATOM 4063 HB3 GLU A 462 3.456 -3.227 -9.577 1.00 0.00 H ATOM 4064 HG2 GLU A 462 4.335 -5.460 -9.376 1.00 0.00 H ATOM 4065 HG3 GLU A 462 3.427 -5.026 -7.909 1.00 0.00 H ATOM 4066 H GLU A 462 1.633 -1.970 -10.605 1.00 0.00 H ATOM 4067 N ILE A 463 1.919 -2.159 -7.309 1.00 47.86 N ATOM 4068 CA ILE A 463 1.919 -1.757 -5.919 1.00 48.49 C ATOM 4069 C ILE A 463 0.506 -1.797 -5.366 1.00 49.47 C ATOM 4070 O ILE A 463 0.293 -2.290 -4.261 1.00 49.55 O ATOM 4071 CB ILE A 463 2.558 -0.377 -5.742 1.00 48.16 C ATOM 4072 CG1 ILE A 463 4.072 -0.508 -5.923 1.00 47.51 C ATOM 4073 CG2 ILE A 463 2.227 0.202 -4.377 1.00 47.78 C ATOM 4074 CD1 ILE A 463 4.764 0.739 -6.414 1.00 47.16 C ATOM 4075 HA ILE A 463 2.526 -2.462 -5.351 1.00 0.00 H ATOM 4076 HB ILE A 463 2.159 0.306 -6.492 1.00 0.00 H ATOM 4077 HG12 ILE A 463 4.506 -0.780 -4.961 1.00 0.00 H ATOM 4078 HG13 ILE A 463 4.259 -1.305 -6.643 1.00 0.00 H ATOM 4079 HD11 ILE A 463 4.356 1.022 -7.384 1.00 0.00 H ATOM 4080 HD12 ILE A 463 4.602 1.547 -5.701 1.00 0.00 H ATOM 4081 HD13 ILE A 463 5.832 0.546 -6.510 1.00 0.00 H ATOM 4082 HG21 ILE A 463 1.146 0.300 -4.278 1.00 0.00 H ATOM 4083 HG22 ILE A 463 2.606 -0.463 -3.600 1.00 0.00 H ATOM 4084 HG23 ILE A 463 2.693 1.182 -4.277 1.00 0.00 H ATOM 4085 H ILE A 463 2.331 -1.525 -8.023 1.00 0.00 H ATOM 4086 N TYR A 464 -0.454 -1.313 -6.148 1.00 50.71 N ATOM 4087 CA TYR A 464 -1.849 -1.321 -5.720 1.00 52.16 C ATOM 4088 C TYR A 464 -2.472 -2.699 -5.752 1.00 53.25 C ATOM 4089 O TYR A 464 -3.396 -2.962 -4.989 1.00 53.60 O ATOM 4090 CB TYR A 464 -2.713 -0.349 -6.535 1.00 52.01 C ATOM 4091 CG TYR A 464 -2.383 1.101 -6.302 1.00 51.81 C ATOM 4092 CD1 TYR A 464 -1.893 1.889 -7.333 1.00 51.33 C ATOM 4093 CD2 TYR A 464 -2.555 1.685 -5.045 1.00 51.90 C ATOM 4094 CE1 TYR A 464 -1.570 3.216 -7.129 1.00 51.72 C ATOM 4095 CE2 TYR A 464 -2.238 3.023 -4.827 1.00 51.58 C ATOM 4096 CZ TYR A 464 -1.744 3.776 -5.875 1.00 51.76 C ATOM 4097 OH TYR A 464 -1.429 5.095 -5.684 1.00 51.97 O ATOM 4098 HA TYR A 464 -1.826 -0.987 -4.683 1.00 0.00 H ATOM 4099 HB3 TYR A 464 -3.757 -0.511 -6.268 1.00 0.00 H ATOM 4100 HB2 TYR A 464 -2.571 -0.568 -7.593 1.00 0.00 H ATOM 4101 HD2 TYR A 464 -2.943 1.084 -4.222 1.00 0.00 H ATOM 4102 HE2 TYR A 464 -2.378 3.471 -3.843 1.00 0.00 H ATOM 4103 HE1 TYR A 464 -1.181 3.818 -7.950 1.00 0.00 H ATOM 4104 HD1 TYR A 464 -1.760 1.453 -8.323 1.00 0.00 H ATOM 4105 HH TYR A 464 -1.092 5.479 -6.532 1.00 0.00 H ATOM 4106 H TYR A 464 -0.207 -0.922 -7.080 1.00 0.00 H ATOM 4107 N ARG A 465 -1.984 -3.574 -6.628 1.00 54.83 N ATOM 4108 CA ARG A 465 -2.560 -4.916 -6.734 1.00 56.48 C ATOM 4109 C ARG A 465 -2.670 -5.497 -5.332 1.00 57.68 C ATOM 4110 O ARG A 465 -1.678 -5.577 -4.598 1.00 57.65 O ATOM 4111 CB ARG A 465 -1.735 -5.838 -7.645 1.00 56.46 C ATOM 4112 CG ARG A 465 -2.438 -7.156 -8.044 1.00 56.44 C ATOM 4113 CD ARG A 465 -1.434 -8.314 -8.259 1.00 56.83 C ATOM 4114 NE ARG A 465 -0.611 -8.156 -9.461 1.00 56.53 N ATOM 4115 HA ARG A 465 -3.545 -4.841 -7.194 1.00 0.00 H ATOM 4116 HB2 ARG A 465 -1.499 -5.290 -8.557 1.00 0.00 H ATOM 4117 HB3 ARG A 465 -0.811 -6.091 -7.125 1.00 0.00 H ATOM 4118 HG2 ARG A 465 -3.133 -7.437 -7.253 1.00 0.00 H ATOM 4119 HG3 ARG A 465 -2.990 -6.993 -8.970 1.00 0.00 H ATOM 4120 HD2 ARG A 465 -1.994 -9.246 -8.343 1.00 0.00 H ATOM 4121 HD3 ARG A 465 -0.774 -8.365 -7.393 1.00 0.00 H ATOM 4122 HE ARG A 465 -0.736 -7.323 -10.071 1.00 0.00 H ATOM 4123 H ARG A 465 -1.189 -3.303 -7.241 1.00 0.00 H ATOM 4124 N ASP A 466 -3.897 -5.855 -4.960 1.00 59.26 N ATOM 4125 CA ASP A 466 -4.192 -6.440 -3.657 1.00 60.74 C ATOM 4126 C ASP A 466 -3.766 -5.477 -2.537 1.00 61.51 C ATOM 4127 O ASP A 466 -2.999 -5.855 -1.641 1.00 61.80 O ATOM 4128 CB ASP A 466 -3.494 -7.804 -3.522 1.00 60.96 C ATOM 4129 CG ASP A 466 -4.427 -8.909 -3.035 1.00 62.51 C ATOM 4130 OD1 ASP A 466 -5.636 -8.644 -2.848 1.00 64.19 O ATOM 4131 OD2 ASP A 466 -3.949 -10.057 -2.843 1.00 63.51 O ATOM 4132 HA ASP A 466 -5.266 -6.602 -3.568 1.00 0.00 H ATOM 4133 HB2 ASP A 466 -3.097 -8.089 -4.497 1.00 0.00 H ATOM 4134 HB3 ASP A 466 -2.673 -7.705 -2.812 1.00 0.00 H ATOM 4135 H ASP A 466 -4.680 -5.711 -5.629 1.00 0.00 H ATOM 4136 N MET A 467 -4.252 -4.234 -2.603 1.00 62.19 N ATOM 4137 CA MET A 467 -3.942 -3.230 -1.579 1.00 62.95 C ATOM 4138 C MET A 467 -4.632 -3.525 -0.249 1.00 63.06 C ATOM 4139 O MET A 467 -5.657 -2.928 0.094 1.00 63.23 O ATOM 4140 CB MET A 467 -4.265 -1.796 -2.049 1.00 63.18 C ATOM 4141 CG MET A 467 -3.032 -0.888 -2.269 1.00 63.73 C ATOM 4142 SD MET A 467 -1.719 -0.968 -1.004 1.00 64.49 S ATOM 4143 CE MET A 467 -0.998 0.668 -1.148 1.00 63.28 C ATOM 4144 HA MET A 467 -2.866 -3.294 -1.417 1.00 0.00 H ATOM 4145 HB2 MET A 467 -4.809 -1.863 -2.991 1.00 0.00 H ATOM 4146 HB3 MET A 467 -4.900 -1.328 -1.297 1.00 0.00 H ATOM 4147 HG2 MET A 467 -3.384 0.142 -2.315 1.00 0.00 H ATOM 4148 HG3 MET A 467 -2.587 -1.161 -3.226 1.00 0.00 H ATOM 4149 HE1 MET A 467 -0.618 0.808 -2.160 1.00 0.00 H ATOM 4150 HE2 MET A 467 -1.759 1.419 -0.937 1.00 0.00 H ATOM 4151 HE3 MET A 467 -0.180 0.767 -0.434 1.00 0.00 H ATOM 4152 H MET A 467 -4.866 -3.972 -3.401 1.00 0.00 H ATOM 4153 N TYR A 468 -4.161 -4.375 0.513 1.00 63.26 N ATOM 4154 HN3 TYR A 468 -4.864 -5.124 0.672 1.00 0.00 H ATOM 4155 HN2 TYR A 468 -3.918 -3.929 1.420 1.00 0.00 H ATOM 4156 HN1 TYR A 468 -3.306 -4.785 0.087 1.00 0.00 H TER 4157 TYR A 468 ATOM 4158 N SER B 193 -22.883 62.310 -34.087 1.00111.43 N ATOM 4159 CA SER B 193 -23.467 61.197 -33.281 1.00111.46 C ATOM 4160 C SER B 193 -24.365 61.719 -32.147 1.00111.51 C ATOM 4161 O SER B 193 -25.361 62.395 -32.418 1.00111.55 O ATOM 4162 CB SER B 193 -22.360 60.278 -32.745 1.00111.46 C ATOM 4163 OG SER B 193 -21.585 59.738 -33.802 1.00111.39 O ATOM 4164 HA SER B 193 -24.105 60.610 -33.941 1.00 0.00 H ATOM 4165 HB2 SER B 193 -22.816 59.461 -32.185 1.00 0.00 H ATOM 4166 HB3 SER B 193 -21.710 60.852 -32.084 1.00 0.00 H ATOM 4167 HG SER B 193 -20.881 59.151 -33.427 1.00 0.00 H ATOM 4168 HN3 SER B 193 -22.308 62.919 -33.470 1.00 0.00 H ATOM 4169 HN2 SER B 193 -23.651 62.870 -34.510 1.00 0.00 H ATOM 4170 HN1 SER B 193 -22.285 61.914 -34.840 1.00 0.00 H ATOM 4171 N HIS B 194 -24.004 61.409 -30.893 1.00111.54 N ATOM 4172 CA HIS B 194 -24.812 61.735 -29.694 1.00111.43 C ATOM 4173 C HIS B 194 -24.005 61.721 -28.374 1.00111.08 C ATOM 4174 O HIS B 194 -23.280 60.759 -28.093 1.00111.11 O ATOM 4175 CB HIS B 194 -26.006 60.766 -29.570 1.00111.57 C ATOM 4176 CG HIS B 194 -25.622 59.317 -29.663 1.00112.24 C ATOM 4177 ND1 HIS B 194 -25.139 58.601 -28.584 1.00112.89 N ATOM 4178 CD2 HIS B 194 -25.639 58.455 -30.710 1.00112.66 C ATOM 4179 CE1 HIS B 194 -24.879 57.361 -28.960 1.00112.85 C ATOM 4180 NE2 HIS B 194 -25.172 57.246 -30.247 1.00112.90 N ATOM 4181 HA HIS B 194 -25.161 62.757 -29.843 1.00 0.00 H ATOM 4182 HB2 HIS B 194 -26.486 60.933 -28.606 1.00 0.00 H ATOM 4183 HB3 HIS B 194 -26.713 60.987 -30.370 1.00 0.00 H ATOM 4184 HD2 HIS B 194 -25.962 58.678 -31.727 1.00 0.00 H ATOM 4185 HE1 HIS B 194 -24.490 56.568 -28.321 1.00 0.00 H ATOM 4186 H HIS B 194 -23.102 60.910 -30.754 1.00 0.00 H ATOM 4187 N MET B 195 -24.136 62.777 -27.566 1.00110.48 N ATOM 4188 CA MET B 195 -23.601 62.756 -26.195 1.00109.96 C ATOM 4189 C MET B 195 -24.476 61.835 -25.333 1.00109.38 C ATOM 4190 O MET B 195 -25.321 61.112 -25.872 1.00109.36 O ATOM 4191 CB MET B 195 -23.476 64.173 -25.600 1.00109.97 C ATOM 4192 CG MET B 195 -24.786 64.962 -25.436 1.00110.23 C ATOM 4193 SD MET B 195 -24.601 66.604 -24.672 1.00110.38 S ATOM 4194 CE MET B 195 -24.209 66.183 -22.971 1.00109.86 C ATOM 4195 HA MET B 195 -22.586 62.359 -26.214 1.00 0.00 H ATOM 4196 HB2 MET B 195 -23.018 64.081 -24.615 1.00 0.00 H ATOM 4197 HB3 MET B 195 -22.820 64.750 -26.251 1.00 0.00 H ATOM 4198 HG2 MET B 195 -25.461 64.373 -24.815 1.00 0.00 H ATOM 4199 HG3 MET B 195 -25.227 65.096 -26.424 1.00 0.00 H ATOM 4200 HE1 MET B 195 -25.027 65.603 -22.544 1.00 0.00 H ATOM 4201 HE2 MET B 195 -23.292 65.594 -22.946 1.00 0.00 H ATOM 4202 HE3 MET B 195 -24.071 67.098 -22.394 1.00 0.00 H ATOM 4203 H MET B 195 -24.624 63.628 -27.912 1.00 0.00 H ATOM 4204 N GLU B 196 -24.282 61.842 -24.014 1.00108.66 N ATOM 4205 CA GLU B 196 -25.060 60.954 -23.138 1.00107.94 C ATOM 4206 C GLU B 196 -26.521 61.386 -22.984 1.00107.22 C ATOM 4207 O GLU B 196 -26.808 62.483 -22.498 1.00107.20 O ATOM 4208 CB GLU B 196 -24.404 60.786 -21.759 1.00108.01 C ATOM 4209 CG GLU B 196 -25.091 59.717 -20.886 1.00108.28 C ATOM 4210 CD GLU B 196 -24.449 59.529 -19.513 1.00108.23 C ATOM 4211 OE1 GLU B 196 -23.251 59.172 -19.442 1.00108.34 O ATOM 4212 OE2 GLU B 196 -25.156 59.717 -18.500 1.00108.47 O ATOM 4213 HA GLU B 196 -25.063 59.986 -23.639 1.00 0.00 H ATOM 4214 HB2 GLU B 196 -23.362 60.499 -21.903 1.00 0.00 H ATOM 4215 HB3 GLU B 196 -24.447 61.741 -21.236 1.00 0.00 H ATOM 4216 HG2 GLU B 196 -26.131 60.009 -20.741 1.00 0.00 H ATOM 4217 HG3 GLU B 196 -25.053 58.765 -21.416 1.00 0.00 H ATOM 4218 H GLU B 196 -23.574 62.482 -23.601 1.00 0.00 H ATOM 4219 N ASP B 197 -27.432 60.507 -23.404 1.00106.29 N ATOM 4220 CA ASP B 197 -28.875 60.706 -23.216 1.00105.22 C ATOM 4221 C ASP B 197 -29.274 60.482 -21.749 1.00104.40 C ATOM 4222 O ASP B 197 -28.486 59.942 -20.963 1.00104.31 O ATOM 4223 CB ASP B 197 -29.693 59.812 -24.175 1.00105.23 C ATOM 4224 CG ASP B 197 -29.459 58.315 -23.951 1.00104.93 C ATOM 4225 OD1 ASP B 197 -30.159 57.718 -23.104 1.00104.51 O ATOM 4226 OD2 ASP B 197 -28.595 57.732 -24.643 1.00104.18 O ATOM 4227 HA ASP B 197 -29.108 61.741 -23.464 1.00 0.00 H ATOM 4228 HB2 ASP B 197 -30.752 60.023 -24.027 1.00 0.00 H ATOM 4229 HB3 ASP B 197 -29.414 60.057 -25.200 1.00 0.00 H ATOM 4230 H ASP B 197 -27.107 59.644 -23.885 1.00 0.00 H ATOM 4231 N SER B 198 -30.490 60.903 -21.390 1.00103.26 N ATOM 4232 CA SER B 198 -30.984 60.783 -20.009 1.00102.01 C ATOM 4233 C SER B 198 -31.795 59.502 -19.720 1.00100.98 C ATOM 4234 O SER B 198 -32.290 59.308 -18.605 1.00100.88 O ATOM 4235 CB SER B 198 -31.752 62.044 -19.592 1.00102.11 C ATOM 4236 OG SER B 198 -32.889 62.242 -20.410 1.00102.09 O ATOM 4237 HA SER B 198 -30.092 60.688 -19.390 1.00 0.00 H ATOM 4238 HB2 SER B 198 -31.094 62.908 -19.682 1.00 0.00 H ATOM 4239 HB3 SER B 198 -32.073 61.939 -18.556 1.00 0.00 H ATOM 4240 HG SER B 198 -33.365 63.060 -20.120 1.00 0.00 H ATOM 4241 H SER B 198 -31.108 61.329 -22.110 1.00 0.00 H ATOM 4242 N GLU B 199 -31.917 58.627 -20.717 1.00 99.51 N ATOM 4243 CA GLU B 199 -32.405 57.273 -20.482 1.00 98.02 C ATOM 4244 C GLU B 199 -31.271 56.459 -19.852 1.00 96.98 C ATOM 4245 O GLU B 199 -31.519 55.495 -19.120 1.00 96.87 O ATOM 4246 CB GLU B 199 -32.890 56.631 -21.785 1.00 98.04 C ATOM 4247 CG GLU B 199 -33.784 55.417 -21.591 1.00 97.86 C ATOM 4248 HA GLU B 199 -33.259 57.298 -19.805 1.00 0.00 H ATOM 4249 HB2 GLU B 199 -33.448 57.380 -22.347 1.00 0.00 H ATOM 4250 HB3 GLU B 199 -32.016 56.323 -22.360 1.00 0.00 H ATOM 4251 HG2 GLU B 199 -33.239 54.650 -21.041 1.00 0.00 H ATOM 4252 HG3 GLU B 199 -34.672 55.707 -21.029 1.00 0.00 H ATOM 4253 H GLU B 199 -31.659 58.915 -21.682 1.00 0.00 H ATOM 4254 N THR B 200 -30.030 56.868 -20.137 1.00 95.57 N ATOM 4255 CA THR B 200 -28.818 56.241 -19.576 1.00 94.20 C ATOM 4256 C THR B 200 -28.085 57.120 -18.541 1.00 93.10 C ATOM 4257 O THR B 200 -27.115 56.678 -17.916 1.00 92.97 O ATOM 4258 CB THR B 200 -27.824 55.759 -20.681 1.00 94.22 C ATOM 4259 OG1 THR B 200 -27.717 56.751 -21.709 1.00 94.41 O ATOM 4260 CG2 THR B 200 -28.287 54.442 -21.305 1.00 94.11 C ATOM 4261 HA THR B 200 -29.188 55.365 -19.044 1.00 0.00 H ATOM 4262 HB THR B 200 -26.853 55.602 -20.211 1.00 0.00 H ATOM 4263 HG1 THR B 200 -28.608 56.902 -22.114 1.00 0.00 H ATOM 4264 HG23 THR B 200 -28.370 53.683 -20.528 1.00 0.00 H ATOM 4265 HG21 THR B 200 -29.258 54.587 -21.778 1.00 0.00 H ATOM 4266 HG22 THR B 200 -27.561 54.121 -22.052 1.00 0.00 H ATOM 4267 H THR B 200 -29.913 57.670 -20.788 1.00 0.00 H ATOM 4268 N ALA B 201 -28.548 58.358 -18.370 1.00 91.68 N ATOM 4269 CA ALA B 201 -28.108 59.201 -17.258 1.00 90.32 C ATOM 4270 C ALA B 201 -28.895 58.816 -16.016 1.00 89.35 C ATOM 4271 O ALA B 201 -28.420 58.990 -14.897 1.00 89.28 O ATOM 4272 CB ALA B 201 -28.296 60.676 -17.577 1.00 90.41 C ATOM 4273 HA ALA B 201 -27.043 59.042 -17.086 1.00 0.00 H ATOM 4274 HB1 ALA B 201 -27.712 60.933 -18.461 1.00 0.00 H ATOM 4275 HB2 ALA B 201 -29.351 60.874 -17.767 1.00 0.00 H ATOM 4276 HB3 ALA B 201 -27.960 61.275 -16.731 1.00 0.00 H ATOM 4277 H ALA B 201 -29.242 58.736 -19.046 1.00 0.00 H ATOM 4278 N ASP B 202 -30.107 58.302 -16.237 1.00 88.10 N ATOM 4279 CA ASP B 202 -30.921 57.655 -15.205 1.00 86.86 C ATOM 4280 C ASP B 202 -30.195 56.441 -14.631 1.00 86.02 C ATOM 4281 O ASP B 202 -30.278 56.158 -13.432 1.00 85.94 O ATOM 4282 CB ASP B 202 -32.261 57.187 -15.793 1.00 86.77 C ATOM 4283 CG ASP B 202 -33.322 58.278 -15.806 1.00 86.56 C ATOM 4284 OD1 ASP B 202 -34.444 57.995 -16.276 1.00 86.12 O ATOM 4285 OD2 ASP B 202 -33.047 59.408 -15.348 1.00 86.29 O ATOM 4286 HA ASP B 202 -31.098 58.386 -14.416 1.00 0.00 H ATOM 4287 HB2 ASP B 202 -32.093 56.854 -16.817 1.00 0.00 H ATOM 4288 HB3 ASP B 202 -32.629 56.352 -15.197 1.00 0.00 H ATOM 4289 H ASP B 202 -30.497 58.365 -17.199 1.00 0.00 H ATOM 4290 N LEU B 203 -29.494 55.727 -15.509 1.00 84.79 N ATOM 4291 CA LEU B 203 -28.784 54.507 -15.149 1.00 83.36 C ATOM 4292 C LEU B 203 -27.498 54.799 -14.371 1.00 82.31 C ATOM 4293 O LEU B 203 -27.264 54.200 -13.320 1.00 82.25 O ATOM 4294 CB LEU B 203 -28.518 53.637 -16.392 1.00 83.46 C ATOM 4295 CG LEU B 203 -29.717 53.132 -17.220 1.00 83.46 C ATOM 4296 CD1 LEU B 203 -29.238 52.312 -18.408 1.00 83.41 C ATOM 4297 CD2 LEU B 203 -30.726 52.330 -16.393 1.00 83.29 C ATOM 4298 HA LEU B 203 -29.429 53.938 -14.479 1.00 0.00 H ATOM 4299 HB2 LEU B 203 -27.889 54.222 -17.063 1.00 0.00 H ATOM 4300 HB3 LEU B 203 -27.969 52.758 -16.056 1.00 0.00 H ATOM 4301 HG LEU B 203 -30.240 54.019 -17.577 1.00 0.00 H ATOM 4302 HD21 LEU B 203 -30.231 51.459 -15.964 1.00 0.00 H ATOM 4303 HD22 LEU B 203 -31.119 52.958 -15.593 1.00 0.00 H ATOM 4304 HD23 LEU B 203 -31.544 52.005 -17.036 1.00 0.00 H ATOM 4305 HD11 LEU B 203 -28.604 52.931 -19.043 1.00 0.00 H ATOM 4306 HD12 LEU B 203 -28.668 51.454 -18.050 1.00 0.00 H ATOM 4307 HD13 LEU B 203 -30.099 51.965 -18.979 1.00 0.00 H ATOM 4308 H LEU B 203 -29.451 56.055 -16.495 1.00 0.00 H ATOM 4309 N LYS B 204 -26.676 55.722 -14.866 1.00 80.97 N ATOM 4310 CA LYS B 204 -25.489 56.137 -14.109 1.00 79.70 C ATOM 4311 C LYS B 204 -25.877 56.863 -12.821 1.00 78.63 C ATOM 4312 O LYS B 204 -25.069 56.986 -11.900 1.00 78.46 O ATOM 4313 CB LYS B 204 -24.529 56.981 -14.957 1.00 79.89 C ATOM 4314 CG LYS B 204 -23.519 56.139 -15.722 1.00 80.02 C ATOM 4315 CD LYS B 204 -22.223 56.879 -15.993 1.00 80.09 C ATOM 4316 CE LYS B 204 -21.161 55.886 -16.450 1.00 80.79 C ATOM 4317 NZ LYS B 204 -19.868 56.527 -16.833 1.00 81.25 N ATOM 4318 HA LYS B 204 -24.954 55.228 -13.832 1.00 0.00 H ATOM 4319 HB2 LYS B 204 -25.113 57.559 -15.673 1.00 0.00 H ATOM 4320 HB3 LYS B 204 -23.988 57.660 -14.298 1.00 0.00 H ATOM 4321 HG2 LYS B 204 -23.295 55.246 -15.138 1.00 0.00 H ATOM 4322 HG3 LYS B 204 -23.959 55.847 -16.675 1.00 0.00 H ATOM 4323 HD2 LYS B 204 -22.385 57.624 -16.772 1.00 0.00 H ATOM 4324 HD3 LYS B 204 -21.890 57.375 -15.082 1.00 0.00 H ATOM 4325 HE2 LYS B 204 -21.546 55.343 -17.313 1.00 0.00 H ATOM 4326 HE3 LYS B 204 -20.971 55.186 -15.637 1.00 0.00 H ATOM 4327 HZ1 LYS B 204 -20.030 57.191 -17.617 1.00 0.00 H ATOM 4328 HZ2 LYS B 204 -19.482 57.041 -16.016 1.00 0.00 H ATOM 4329 HZ3 LYS B 204 -19.194 55.794 -17.133 1.00 0.00 H ATOM 4330 H LYS B 204 -26.876 56.150 -15.792 1.00 0.00 H ATOM 4331 N SER B 205 -27.121 57.331 -12.767 1.00 77.17 N ATOM 4332 CA SER B 205 -27.679 57.884 -11.545 1.00 75.79 C ATOM 4333 C SER B 205 -27.958 56.760 -10.553 1.00 74.57 C ATOM 4334 O SER B 205 -27.605 56.861 -9.387 1.00 74.45 O ATOM 4335 CB SER B 205 -28.960 58.672 -11.839 1.00 75.93 C ATOM 4336 OG SER B 205 -29.598 59.075 -10.639 1.00 75.92 O ATOM 4337 HA SER B 205 -26.955 58.572 -11.109 1.00 0.00 H ATOM 4338 HB2 SER B 205 -29.642 58.043 -12.411 1.00 0.00 H ATOM 4339 HB3 SER B 205 -28.708 59.557 -12.423 1.00 0.00 H ATOM 4340 HG SER B 205 -30.421 59.581 -10.858 1.00 0.00 H ATOM 4341 H SER B 205 -27.710 57.300 -13.623 1.00 0.00 H ATOM 4342 N LEU B 206 -28.592 55.694 -11.034 1.00 73.20 N ATOM 4343 CA LEU B 206 -28.920 54.531 -10.214 1.00 71.83 C ATOM 4344 C LEU B 206 -27.648 53.891 -9.655 1.00 70.96 C ATOM 4345 O LEU B 206 -27.528 53.705 -8.448 1.00 70.56 O ATOM 4346 CB LEU B 206 -29.733 53.519 -11.037 1.00 71.89 C ATOM 4347 CG LEU B 206 -30.446 52.364 -10.329 1.00 71.73 C ATOM 4348 CD1 LEU B 206 -31.414 52.887 -9.277 1.00 71.87 C ATOM 4349 CD2 LEU B 206 -31.167 51.477 -11.333 1.00 71.39 C ATOM 4350 HA LEU B 206 -29.529 54.855 -9.370 1.00 0.00 H ATOM 4351 HB2 LEU B 206 -30.498 54.085 -11.568 1.00 0.00 H ATOM 4352 HB3 LEU B 206 -29.047 53.073 -11.757 1.00 0.00 H ATOM 4353 HG LEU B 206 -29.692 51.761 -9.824 1.00 0.00 H ATOM 4354 HD21 LEU B 206 -31.906 52.068 -11.873 1.00 0.00 H ATOM 4355 HD22 LEU B 206 -30.444 51.065 -12.037 1.00 0.00 H ATOM 4356 HD23 LEU B 206 -31.666 50.664 -10.805 1.00 0.00 H ATOM 4357 HD11 LEU B 206 -30.864 53.467 -8.536 1.00 0.00 H ATOM 4358 HD12 LEU B 206 -32.161 53.520 -9.755 1.00 0.00 H ATOM 4359 HD13 LEU B 206 -31.907 52.046 -8.789 1.00 0.00 H ATOM 4360 H LEU B 206 -28.866 55.689 -12.037 1.00 0.00 H ATOM 4361 N ALA B 207 -26.700 53.594 -10.542 1.00 69.97 N ATOM 4362 CA ALA B 207 -25.410 53.008 -10.180 1.00 69.18 C ATOM 4363 C ALA B 207 -24.605 53.940 -9.292 1.00 68.77 C ATOM 4364 O ALA B 207 -23.640 53.529 -8.644 1.00 68.76 O ATOM 4365 CB ALA B 207 -24.618 52.663 -11.434 1.00 69.10 C ATOM 4366 HA ALA B 207 -25.605 52.095 -9.617 1.00 0.00 H ATOM 4367 HB1 ALA B 207 -25.181 51.946 -12.032 1.00 0.00 H ATOM 4368 HB2 ALA B 207 -24.448 53.569 -12.016 1.00 0.00 H ATOM 4369 HB3 ALA B 207 -23.660 52.228 -11.149 1.00 0.00 H ATOM 4370 H ALA B 207 -26.887 53.789 -11.546 1.00 0.00 H ATOM 4371 N LYS B 208 -25.015 55.202 -9.284 1.00 68.24 N ATOM 4372 CA LYS B 208 -24.392 56.234 -8.473 1.00 67.79 C ATOM 4373 C LYS B 208 -25.080 56.327 -7.102 1.00 67.07 C ATOM 4374 O LYS B 208 -24.407 56.315 -6.065 1.00 67.18 O ATOM 4375 CB LYS B 208 -24.411 57.565 -9.241 1.00 68.00 C ATOM 4376 CG LYS B 208 -24.019 58.821 -8.460 1.00 68.97 C ATOM 4377 CD LYS B 208 -25.237 59.725 -8.187 1.00 69.94 C ATOM 4378 CE LYS B 208 -25.743 60.418 -9.454 1.00 69.30 C ATOM 4379 NZ LYS B 208 -27.100 60.979 -9.251 1.00 69.47 N ATOM 4380 HA LYS B 208 -23.350 55.980 -8.279 1.00 0.00 H ATOM 4381 HB2 LYS B 208 -23.722 57.471 -10.081 1.00 0.00 H ATOM 4382 HB3 LYS B 208 -25.423 57.714 -9.618 1.00 0.00 H ATOM 4383 HG2 LYS B 208 -23.579 58.523 -7.508 1.00 0.00 H ATOM 4384 HG3 LYS B 208 -23.285 59.382 -9.038 1.00 0.00 H ATOM 4385 HD2 LYS B 208 -26.041 59.115 -7.776 1.00 0.00 H ATOM 4386 HD3 LYS B 208 -24.953 60.486 -7.461 1.00 0.00 H ATOM 4387 HE2 LYS B 208 -25.775 59.693 -10.268 1.00 0.00 H ATOM 4388 HE3 LYS B 208 -25.059 61.226 -9.715 1.00 0.00 H ATOM 4389 HZ1 LYS B 208 -27.758 60.212 -9.006 1.00 0.00 H ATOM 4390 HZ2 LYS B 208 -27.074 61.675 -8.479 1.00 0.00 H ATOM 4391 HZ3 LYS B 208 -27.417 61.442 -10.126 1.00 0.00 H ATOM 4392 H LYS B 208 -25.821 55.465 -9.887 1.00 0.00 H ATOM 4393 N ARG B 209 -26.412 56.398 -7.099 1.00 65.96 N ATOM 4394 CA ARG B 209 -27.198 56.418 -5.856 1.00 64.96 C ATOM 4395 C ARG B 209 -26.997 55.153 -5.012 1.00 64.33 C ATOM 4396 O ARG B 209 -26.963 55.225 -3.778 1.00 64.43 O ATOM 4397 CB ARG B 209 -28.693 56.681 -6.138 1.00 64.99 C ATOM 4398 CG ARG B 209 -29.172 58.097 -5.744 1.00 64.60 C ATOM 4399 CD ARG B 209 -30.016 58.785 -6.832 1.00 64.39 C ATOM 4400 NE ARG B 209 -31.202 58.022 -7.220 1.00 64.33 N ATOM 4401 HA ARG B 209 -26.821 57.250 -5.261 1.00 0.00 H ATOM 4402 HB2 ARG B 209 -28.869 56.545 -7.205 1.00 0.00 H ATOM 4403 HB3 ARG B 209 -29.280 55.953 -5.578 1.00 0.00 H ATOM 4404 HG2 ARG B 209 -29.774 58.018 -4.839 1.00 0.00 H ATOM 4405 HG3 ARG B 209 -28.296 58.715 -5.544 1.00 0.00 H ATOM 4406 HD2 ARG B 209 -29.392 58.927 -7.715 1.00 0.00 H ATOM 4407 HD3 ARG B 209 -30.338 59.756 -6.457 1.00 0.00 H ATOM 4408 HE ARG B 209 -31.403 57.107 -6.768 1.00 0.00 H ATOM 4409 H ARG B 209 -26.913 56.441 -8.009 1.00 0.00 H ATOM 4410 N ILE B 210 -26.848 54.007 -5.684 1.00 63.35 N ATOM 4411 CA ILE B 210 -26.601 52.721 -5.023 1.00 62.03 C ATOM 4412 C ILE B 210 -25.199 52.671 -4.420 1.00 61.43 C ATOM 4413 O ILE B 210 -25.044 52.288 -3.258 1.00 61.43 O ATOM 4414 CB ILE B 210 -26.829 51.515 -5.988 1.00 62.06 C ATOM 4415 CG1 ILE B 210 -28.329 51.285 -6.206 1.00 61.81 C ATOM 4416 CG2 ILE B 210 -26.155 50.237 -5.463 1.00 61.97 C ATOM 4417 CD1 ILE B 210 -28.668 50.235 -7.252 1.00 61.71 C ATOM 4418 HA ILE B 210 -27.326 52.635 -4.214 1.00 0.00 H ATOM 4419 HB ILE B 210 -26.368 51.760 -6.945 1.00 0.00 H ATOM 4420 HG12 ILE B 210 -28.766 50.972 -5.257 1.00 0.00 H ATOM 4421 HG13 ILE B 210 -28.776 52.230 -6.516 1.00 0.00 H ATOM 4422 HD11 ILE B 210 -28.253 50.535 -8.214 1.00 0.00 H ATOM 4423 HD12 ILE B 210 -28.243 49.277 -6.954 1.00 0.00 H ATOM 4424 HD13 ILE B 210 -29.751 50.143 -7.335 1.00 0.00 H ATOM 4425 HG21 ILE B 210 -25.082 50.406 -5.369 1.00 0.00 H ATOM 4426 HG22 ILE B 210 -26.571 49.983 -4.488 1.00 0.00 H ATOM 4427 HG23 ILE B 210 -26.336 49.420 -6.161 1.00 0.00 H ATOM 4428 H ILE B 210 -26.910 54.028 -6.722 1.00 0.00 H ATOM 4429 N TYR B 211 -24.192 53.066 -5.203 1.00 60.46 N ATOM 4430 CA TYR B 211 -22.794 52.991 -4.771 1.00 59.59 C ATOM 4431 C TYR B 211 -22.495 53.799 -3.503 1.00 59.11 C ATOM 4432 O TYR B 211 -21.709 53.362 -2.657 1.00 58.63 O ATOM 4433 CB TYR B 211 -21.851 53.403 -5.902 1.00 59.44 C ATOM 4434 CG TYR B 211 -20.385 53.429 -5.498 1.00 59.52 C ATOM 4435 CD1 TYR B 211 -19.755 52.285 -5.018 1.00 59.17 C ATOM 4436 CD2 TYR B 211 -19.627 54.604 -5.599 1.00 59.75 C ATOM 4437 CE1 TYR B 211 -18.419 52.306 -4.644 1.00 59.16 C ATOM 4438 CE2 TYR B 211 -18.277 54.629 -5.228 1.00 58.70 C ATOM 4439 CZ TYR B 211 -17.688 53.476 -4.752 1.00 58.67 C ATOM 4440 OH TYR B 211 -16.369 53.473 -4.379 1.00 59.11 O ATOM 4441 HA TYR B 211 -22.618 51.946 -4.515 1.00 0.00 H ATOM 4442 HB3 TYR B 211 -22.133 54.400 -6.239 1.00 0.00 H ATOM 4443 HB2 TYR B 211 -21.969 52.696 -6.723 1.00 0.00 H ATOM 4444 HD2 TYR B 211 -20.097 55.514 -5.973 1.00 0.00 H ATOM 4445 HE2 TYR B 211 -17.698 55.549 -5.314 1.00 0.00 H ATOM 4446 HE1 TYR B 211 -17.945 51.401 -4.265 1.00 0.00 H ATOM 4447 HD1 TYR B 211 -20.320 51.357 -4.934 1.00 0.00 H ATOM 4448 HH TYR B 211 -16.118 52.568 -4.065 1.00 0.00 H ATOM 4449 H TYR B 211 -24.407 53.439 -6.150 1.00 0.00 H ATOM 4450 N GLU B 212 -23.121 54.972 -3.393 1.00 58.76 N ATOM 4451 CA GLU B 212 -22.983 55.849 -2.223 1.00 58.37 C ATOM 4452 C GLU B 212 -23.690 55.262 -1.021 1.00 57.49 C ATOM 4453 O GLU B 212 -23.154 55.279 0.082 1.00 57.35 O ATOM 4454 CB GLU B 212 -23.540 57.244 -2.517 1.00 58.73 C ATOM 4455 CG GLU B 212 -22.568 58.158 -3.262 1.00 60.00 C ATOM 4456 CD GLU B 212 -23.256 58.996 -4.327 1.00 62.20 C ATOM 4457 OE1 GLU B 212 -24.509 59.070 -4.327 1.00 62.95 O ATOM 4458 OE2 GLU B 212 -22.540 59.574 -5.177 1.00 62.86 O ATOM 4459 HA GLU B 212 -21.919 55.934 -2.000 1.00 0.00 H ATOM 4460 HB2 GLU B 212 -24.439 57.133 -3.123 1.00 0.00 H ATOM 4461 HB3 GLU B 212 -23.798 57.717 -1.569 1.00 0.00 H ATOM 4462 HG2 GLU B 212 -22.095 58.826 -2.542 1.00 0.00 H ATOM 4463 HG3 GLU B 212 -21.806 57.543 -3.740 1.00 0.00 H ATOM 4464 H GLU B 212 -23.736 55.280 -4.173 1.00 0.00 H ATOM 4465 N ALA B 213 -24.896 54.747 -1.252 1.00 56.67 N ATOM 4466 CA ALA B 213 -25.666 54.057 -0.223 1.00 55.98 C ATOM 4467 C ALA B 213 -24.858 52.907 0.358 1.00 55.55 C ATOM 4468 O ALA B 213 -24.932 52.626 1.554 1.00 55.46 O ATOM 4469 CB ALA B 213 -26.971 53.552 -0.793 1.00 55.78 C ATOM 4470 HA ALA B 213 -25.889 54.762 0.577 1.00 0.00 H ATOM 4471 HB1 ALA B 213 -27.552 54.394 -1.168 1.00 0.00 H ATOM 4472 HB2 ALA B 213 -26.766 52.859 -1.609 1.00 0.00 H ATOM 4473 HB3 ALA B 213 -27.533 53.040 -0.012 1.00 0.00 H ATOM 4474 H ALA B 213 -25.305 54.840 -2.204 1.00 0.00 H ATOM 4475 N TYR B 214 -24.078 52.262 -0.506 1.00 55.16 N ATOM 4476 CA TYR B 214 -23.213 51.160 -0.125 1.00 54.71 C ATOM 4477 C TYR B 214 -22.056 51.676 0.723 1.00 54.63 C ATOM 4478 O TYR B 214 -21.732 51.077 1.748 1.00 54.64 O ATOM 4479 CB TYR B 214 -22.725 50.426 -1.381 1.00 54.49 C ATOM 4480 CG TYR B 214 -21.656 49.364 -1.177 1.00 54.04 C ATOM 4481 CD1 TYR B 214 -22.001 48.036 -0.941 1.00 53.20 C ATOM 4482 CD2 TYR B 214 -20.298 49.690 -1.259 1.00 53.39 C ATOM 4483 CE1 TYR B 214 -21.015 47.059 -0.766 1.00 53.64 C ATOM 4484 CE2 TYR B 214 -19.306 48.728 -1.088 1.00 53.10 C ATOM 4485 CZ TYR B 214 -19.668 47.416 -0.845 1.00 54.03 C ATOM 4486 OH TYR B 214 -18.684 46.462 -0.677 1.00 54.71 O ATOM 4487 HA TYR B 214 -23.769 50.445 0.481 1.00 0.00 H ATOM 4488 HB3 TYR B 214 -22.323 51.173 -2.066 1.00 0.00 H ATOM 4489 HB2 TYR B 214 -23.588 49.943 -1.838 1.00 0.00 H ATOM 4490 HD2 TYR B 214 -20.010 50.721 -1.462 1.00 0.00 H ATOM 4491 HE2 TYR B 214 -18.254 49.007 -1.145 1.00 0.00 H ATOM 4492 HE1 TYR B 214 -21.297 46.025 -0.569 1.00 0.00 H ATOM 4493 HD1 TYR B 214 -23.053 47.754 -0.892 1.00 0.00 H ATOM 4494 HH TYR B 214 -19.105 45.581 -0.513 1.00 0.00 H ATOM 4495 H TYR B 214 -24.089 52.562 -1.502 1.00 0.00 H ATOM 4496 N LEU B 215 -21.450 52.788 0.303 1.00 54.55 N ATOM 4497 CA LEU B 215 -20.369 53.414 1.071 1.00 54.59 C ATOM 4498 C LEU B 215 -20.866 53.984 2.400 1.00 54.89 C ATOM 4499 O LEU B 215 -20.177 53.862 3.414 1.00 55.07 O ATOM 4500 CB LEU B 215 -19.658 54.502 0.264 1.00 54.48 C ATOM 4501 CG LEU B 215 -18.737 54.128 -0.902 1.00 53.89 C ATOM 4502 CD1 LEU B 215 -18.590 55.332 -1.808 1.00 52.90 C ATOM 4503 CD2 LEU B 215 -17.369 53.622 -0.447 1.00 52.44 C ATOM 4504 HA LEU B 215 -19.651 52.624 1.290 1.00 0.00 H ATOM 4505 HB2 LEU B 215 -20.436 55.146 -0.146 1.00 0.00 H ATOM 4506 HB3 LEU B 215 -19.053 55.070 0.970 1.00 0.00 H ATOM 4507 HG LEU B 215 -19.195 53.299 -1.441 1.00 0.00 H ATOM 4508 HD21 LEU B 215 -16.870 54.399 0.133 1.00 0.00 H ATOM 4509 HD22 LEU B 215 -17.499 52.733 0.170 1.00 0.00 H ATOM 4510 HD23 LEU B 215 -16.766 53.375 -1.320 1.00 0.00 H ATOM 4511 HD11 LEU B 215 -19.570 55.622 -2.187 1.00 0.00 H ATOM 4512 HD12 LEU B 215 -18.158 56.159 -1.244 1.00 0.00 H ATOM 4513 HD13 LEU B 215 -17.936 55.079 -2.643 1.00 0.00 H ATOM 4514 H LEU B 215 -21.752 53.222 -0.592 1.00 0.00 H ATOM 4515 N LYS B 216 -22.058 54.589 2.391 1.00 55.15 N ATOM 4516 CA LYS B 216 -22.710 55.086 3.613 1.00 55.53 C ATOM 4517 C LYS B 216 -22.990 53.977 4.642 1.00 55.75 C ATOM 4518 O LYS B 216 -22.677 54.132 5.818 1.00 55.90 O ATOM 4519 CB LYS B 216 -24.009 55.848 3.281 1.00 55.50 C ATOM 4520 CG LYS B 216 -24.716 56.514 4.487 1.00 55.82 C ATOM 4521 CD LYS B 216 -26.131 57.006 4.133 1.00 55.48 C ATOM 4522 HA LYS B 216 -22.001 55.775 4.073 1.00 0.00 H ATOM 4523 HB2 LYS B 216 -23.766 56.629 2.560 1.00 0.00 H ATOM 4524 HB3 LYS B 216 -24.707 55.143 2.829 1.00 0.00 H ATOM 4525 HG2 LYS B 216 -24.789 55.788 5.296 1.00 0.00 H ATOM 4526 HG3 LYS B 216 -24.120 57.365 4.817 1.00 0.00 H ATOM 4527 HD2 LYS B 216 -26.069 57.739 3.329 1.00 0.00 H ATOM 4528 HD3 LYS B 216 -26.738 56.160 3.809 1.00 0.00 H ATOM 4529 H LYS B 216 -22.546 54.714 1.481 1.00 0.00 H ATOM 4530 N ASN B 217 -23.550 52.854 4.201 1.00 56.03 N ATOM 4531 CA ASN B 217 -24.037 51.853 5.151 1.00 56.44 C ATOM 4532 C ASN B 217 -23.150 50.659 5.483 1.00 56.60 C ATOM 4533 O ASN B 217 -23.526 49.860 6.325 1.00 56.74 O ATOM 4534 CB ASN B 217 -25.434 51.386 4.764 1.00 56.46 C ATOM 4535 CG ASN B 217 -26.483 52.434 5.036 1.00 57.14 C ATOM 4536 OD1 ASN B 217 -26.782 52.744 6.193 1.00 58.13 O ATOM 4537 ND2 ASN B 217 -27.048 52.995 3.973 1.00 56.93 N ATOM 4538 HA ASN B 217 -24.034 52.409 6.089 1.00 0.00 H ATOM 4539 HB2 ASN B 217 -25.443 51.149 3.700 1.00 0.00 H ATOM 4540 HB3 ASN B 217 -25.676 50.491 5.337 1.00 0.00 H ATOM 4541 HD22 ASN B 217 -26.763 52.701 3.017 1.00 0.00 H ATOM 4542 HD21 ASN B 217 -27.775 53.728 4.097 1.00 0.00 H ATOM 4543 H ASN B 217 -23.642 52.687 3.179 1.00 0.00 H ATOM 4544 N PHE B 218 -21.991 50.527 4.845 1.00 57.04 N ATOM 4545 CA PHE B 218 -21.075 49.431 5.182 1.00 57.51 C ATOM 4546 C PHE B 218 -19.745 49.909 5.730 1.00 58.30 C ATOM 4547 O PHE B 218 -18.967 50.573 5.042 1.00 58.08 O ATOM 4548 CB PHE B 218 -20.858 48.475 4.008 1.00 57.29 C ATOM 4549 CG PHE B 218 -22.070 47.678 3.660 1.00 56.78 C ATOM 4550 CD1 PHE B 218 -22.756 47.920 2.477 1.00 56.38 C ATOM 4551 CD2 PHE B 218 -22.552 46.704 4.531 1.00 56.67 C ATOM 4552 CE1 PHE B 218 -23.902 47.191 2.153 1.00 56.92 C ATOM 4553 CE2 PHE B 218 -23.698 45.972 4.222 1.00 56.59 C ATOM 4554 CZ PHE B 218 -24.374 46.216 3.028 1.00 56.93 C ATOM 4555 HA PHE B 218 -21.572 48.881 5.981 1.00 0.00 H ATOM 4556 HB2 PHE B 218 -20.567 49.060 3.135 1.00 0.00 H ATOM 4557 HB3 PHE B 218 -20.054 47.786 4.267 1.00 0.00 H ATOM 4558 HD2 PHE B 218 -22.027 46.511 5.466 1.00 0.00 H ATOM 4559 HE2 PHE B 218 -24.064 45.212 4.912 1.00 0.00 H ATOM 4560 HZ PHE B 218 -25.269 45.646 2.780 1.00 0.00 H ATOM 4561 HE1 PHE B 218 -24.426 47.385 1.217 1.00 0.00 H ATOM 4562 HD1 PHE B 218 -22.395 48.688 1.793 1.00 0.00 H ATOM 4563 H PHE B 218 -21.731 51.206 4.101 1.00 0.00 H ATOM 4564 N ASN B 219 -19.498 49.552 6.984 1.00 59.36 N ATOM 4565 CA ASN B 219 -18.298 49.969 7.681 1.00 60.32 C ATOM 4566 C ASN B 219 -17.054 49.442 6.982 1.00 60.98 C ATOM 4567 O ASN B 219 -16.074 50.166 6.806 1.00 61.07 O ATOM 4568 CB ASN B 219 -18.345 49.490 9.127 1.00 60.20 C ATOM 4569 CG ASN B 219 -18.208 50.619 10.105 1.00 60.35 C ATOM 4570 OD1 ASN B 219 -18.962 50.706 11.079 1.00 60.43 O ATOM 4571 ND2 ASN B 219 -17.259 51.518 9.844 1.00 60.03 N ATOM 4572 HA ASN B 219 -18.251 51.058 7.671 1.00 0.00 H ATOM 4573 HB2 ASN B 219 -19.298 48.989 9.300 1.00 0.00 H ATOM 4574 HB3 ASN B 219 -17.530 48.784 9.290 1.00 0.00 H ATOM 4575 HD22 ASN B 219 -16.648 51.402 9.011 1.00 0.00 H ATOM 4576 HD21 ASN B 219 -17.130 52.336 10.474 1.00 0.00 H ATOM 4577 H ASN B 219 -20.188 48.954 7.482 1.00 0.00 H ATOM 4578 N MET B 220 -17.124 48.181 6.564 1.00 61.81 N ATOM 4579 CA MET B 220 -16.037 47.528 5.845 1.00 62.66 C ATOM 4580 C MET B 220 -16.326 47.434 4.339 1.00 63.28 C ATOM 4581 O MET B 220 -17.461 47.140 3.935 1.00 63.60 O ATOM 4582 CB MET B 220 -15.782 46.137 6.432 1.00 62.53 C ATOM 4583 CG MET B 220 -14.490 45.500 5.967 1.00 62.66 C ATOM 4584 SD MET B 220 -13.059 46.562 6.221 1.00 62.64 S ATOM 4585 CE MET B 220 -12.840 46.336 7.977 1.00 63.00 C ATOM 4586 HA MET B 220 -15.141 48.137 5.966 1.00 0.00 H ATOM 4587 HB2 MET B 220 -15.750 46.223 7.518 1.00 0.00 H ATOM 4588 HB3 MET B 220 -16.608 45.487 6.144 1.00 0.00 H ATOM 4589 HG2 MET B 220 -14.574 45.277 4.903 1.00 0.00 H ATOM 4590 HG3 MET B 220 -14.339 44.573 6.521 1.00 0.00 H ATOM 4591 HE1 MET B 220 -13.739 46.663 8.499 1.00 0.00 H ATOM 4592 HE2 MET B 220 -12.659 45.282 8.187 1.00 0.00 H ATOM 4593 HE3 MET B 220 -11.988 46.926 8.315 1.00 0.00 H ATOM 4594 H MET B 220 -17.990 47.639 6.758 1.00 0.00 H ATOM 4595 N ASN B 221 -15.301 47.701 3.524 1.00 63.75 N ATOM 4596 CA ASN B 221 -15.369 47.528 2.065 1.00 64.26 C ATOM 4597 C ASN B 221 -14.046 47.049 1.465 1.00 64.51 C ATOM 4598 O ASN B 221 -13.003 47.115 2.124 1.00 64.52 O ATOM 4599 CB ASN B 221 -15.856 48.809 1.375 1.00 64.30 C ATOM 4600 CG ASN B 221 -14.884 49.979 1.529 1.00 64.81 C ATOM 4601 OD1 ASN B 221 -13.684 49.794 1.772 1.00 64.34 O ATOM 4602 ND2 ASN B 221 -15.402 51.197 1.361 1.00 64.10 N ATOM 4603 HA ASN B 221 -16.100 46.741 1.880 1.00 0.00 H ATOM 4604 HB2 ASN B 221 -15.986 48.603 0.313 1.00 0.00 H ATOM 4605 HB3 ASN B 221 -16.814 49.094 1.809 1.00 0.00 H ATOM 4606 HD22 ASN B 221 -16.416 51.307 1.158 1.00 0.00 H ATOM 4607 HD21 ASN B 221 -14.792 52.036 1.433 1.00 0.00 H ATOM 4608 H ASN B 221 -14.414 48.047 3.941 1.00 0.00 H ATOM 4609 N LYS B 222 -14.090 46.589 0.213 1.00 64.97 N ATOM 4610 CA LYS B 222 -12.907 46.021 -0.460 1.00 65.39 C ATOM 4611 C LYS B 222 -11.694 46.959 -0.522 1.00 65.92 C ATOM 4612 O LYS B 222 -10.562 46.504 -0.383 1.00 65.87 O ATOM 4613 CB LYS B 222 -13.255 45.511 -1.863 1.00 65.22 C ATOM 4614 CG LYS B 222 -12.314 44.436 -2.397 1.00 64.50 C ATOM 4615 CD LYS B 222 -12.938 43.751 -3.590 1.00 64.00 C ATOM 4616 CE LYS B 222 -12.266 42.429 -3.941 1.00 63.65 C ATOM 4617 NZ LYS B 222 -13.136 41.589 -4.826 1.00 62.95 N ATOM 4618 HA LYS B 222 -12.606 45.184 0.170 1.00 0.00 H ATOM 4619 HB2 LYS B 222 -14.263 45.098 -1.835 1.00 0.00 H ATOM 4620 HB3 LYS B 222 -13.230 46.357 -2.549 1.00 0.00 H ATOM 4621 HG2 LYS B 222 -11.372 44.896 -2.696 1.00 0.00 H ATOM 4622 HG3 LYS B 222 -12.125 43.700 -1.615 1.00 0.00 H ATOM 4623 HD2 LYS B 222 -13.988 43.559 -3.370 1.00 0.00 H ATOM 4624 HD3 LYS B 222 -12.864 44.417 -4.450 1.00 0.00 H ATOM 4625 HE2 LYS B 222 -12.061 41.880 -3.022 1.00 0.00 H ATOM 4626 HE3 LYS B 222 -11.328 42.634 -4.457 1.00 0.00 H ATOM 4627 HZ1 LYS B 222 -14.031 41.385 -4.337 1.00 0.00 H ATOM 4628 HZ2 LYS B 222 -13.331 42.104 -5.708 1.00 0.00 H ATOM 4629 HZ3 LYS B 222 -12.648 40.697 -5.045 1.00 0.00 H ATOM 4630 H LYS B 222 -14.990 46.633 -0.306 1.00 0.00 H ATOM 4631 N VAL B 223 -11.915 48.255 -0.727 1.00 66.72 N ATOM 4632 CA VAL B 223 -10.793 49.192 -0.695 1.00 67.63 C ATOM 4633 C VAL B 223 -10.145 49.251 0.700 1.00 68.21 C ATOM 4634 O VAL B 223 -8.924 49.109 0.802 1.00 68.17 O ATOM 4635 CB VAL B 223 -11.119 50.597 -1.305 1.00 67.66 C ATOM 4636 CG1 VAL B 223 -12.185 51.355 -0.499 1.00 67.79 C ATOM 4637 CG2 VAL B 223 -9.840 51.422 -1.457 1.00 67.75 C ATOM 4638 HA VAL B 223 -10.037 48.790 -1.370 1.00 0.00 H ATOM 4639 HB VAL B 223 -11.545 50.432 -2.295 1.00 0.00 H ATOM 4640 HG11 VAL B 223 -13.107 50.774 -0.482 1.00 0.00 H ATOM 4641 HG12 VAL B 223 -11.829 51.505 0.520 1.00 0.00 H ATOM 4642 HG13 VAL B 223 -12.372 52.322 -0.966 1.00 0.00 H ATOM 4643 HG21 VAL B 223 -9.378 51.557 -0.479 1.00 0.00 H ATOM 4644 HG22 VAL B 223 -9.148 50.899 -2.118 1.00 0.00 H ATOM 4645 HG23 VAL B 223 -10.085 52.395 -1.882 1.00 0.00 H ATOM 4646 H VAL B 223 -12.879 48.599 -0.909 1.00 0.00 H ATOM 4647 N LYS B 224 -10.956 49.410 1.756 1.00 68.96 N ATOM 4648 CA LYS B 224 -10.459 49.375 3.146 1.00 69.55 C ATOM 4649 C LYS B 224 -9.723 48.081 3.427 1.00 70.23 C ATOM 4650 O LYS B 224 -8.582 48.099 3.895 1.00 70.32 O ATOM 4651 CB LYS B 224 -11.592 49.512 4.173 1.00 69.48 C ATOM 4652 CG LYS B 224 -12.090 50.929 4.416 1.00 69.63 C ATOM 4653 CD LYS B 224 -13.083 50.979 5.564 1.00 69.41 C ATOM 4654 CE LYS B 224 -13.958 52.221 5.460 1.00 69.92 C ATOM 4655 NZ LYS B 224 -14.711 52.504 6.719 1.00 69.73 N ATOM 4656 HA LYS B 224 -9.784 50.225 3.246 1.00 0.00 H ATOM 4657 HB2 LYS B 224 -12.435 48.915 3.825 1.00 0.00 H ATOM 4658 HB3 LYS B 224 -11.234 49.114 5.123 1.00 0.00 H ATOM 4659 HG2 LYS B 224 -11.240 51.568 4.654 1.00 0.00 H ATOM 4660 HG3 LYS B 224 -12.575 51.295 3.511 1.00 0.00 H ATOM 4661 HD2 LYS B 224 -13.715 50.091 5.531 1.00 0.00 H ATOM 4662 HD3 LYS B 224 -12.539 51.001 6.508 1.00 0.00 H ATOM 4663 HE2 LYS B 224 -14.674 52.077 4.650 1.00 0.00 H ATOM 4664 HE3 LYS B 224 -13.323 53.077 5.233 1.00 0.00 H ATOM 4665 HZ1 LYS B 224 -15.328 51.697 6.941 1.00 0.00 H ATOM 4666 HZ2 LYS B 224 -14.038 52.652 7.498 1.00 0.00 H ATOM 4667 HZ3 LYS B 224 -15.289 53.359 6.591 1.00 0.00 H ATOM 4668 H LYS B 224 -11.971 49.563 1.590 1.00 0.00 H ATOM 4669 N ALA B 225 -10.384 46.964 3.122 1.00 71.03 N ATOM 4670 CA ALA B 225 -9.887 45.634 3.465 1.00 71.90 C ATOM 4671 C ALA B 225 -8.491 45.304 2.916 1.00 72.68 C ATOM 4672 O ALA B 225 -7.684 44.693 3.619 1.00 72.99 O ATOM 4673 CB ALA B 225 -10.896 44.567 3.063 1.00 71.68 C ATOM 4674 HA ALA B 225 -9.768 45.640 4.548 1.00 0.00 H ATOM 4675 HB1 ALA B 225 -11.835 44.741 3.588 1.00 0.00 H ATOM 4676 HB2 ALA B 225 -11.065 44.616 1.987 1.00 0.00 H ATOM 4677 HB3 ALA B 225 -10.507 43.583 3.327 1.00 0.00 H ATOM 4678 H ALA B 225 -11.291 47.043 2.619 1.00 0.00 H ATOM 4679 N ARG B 226 -8.205 45.709 1.678 1.00 73.53 N ATOM 4680 CA ARG B 226 -6.911 45.400 1.048 1.00 74.37 C ATOM 4681 C ARG B 226 -5.772 46.250 1.620 1.00 74.90 C ATOM 4682 O ARG B 226 -4.669 45.743 1.860 1.00 75.03 O ATOM 4683 CB ARG B 226 -6.979 45.514 -0.488 1.00 74.44 C ATOM 4684 CG ARG B 226 -8.056 44.640 -1.162 1.00 74.27 C ATOM 4685 CD ARG B 226 -7.884 43.144 -0.891 1.00 73.80 C ATOM 4686 NE ARG B 226 -9.160 42.426 -0.971 1.00 73.72 N ATOM 4687 CZ ARG B 226 -9.299 41.103 -0.879 1.00 72.87 C ATOM 4688 NH1 ARG B 226 -8.246 40.315 -0.703 1.00 71.70 N ATOM 4689 NH2 ARG B 226 -10.502 40.564 -0.969 1.00 72.66 N ATOM 4690 HA ARG B 226 -6.688 44.361 1.290 1.00 0.00 H ATOM 4691 HB2 ARG B 226 -7.181 46.555 -0.741 1.00 0.00 H ATOM 4692 HB3 ARG B 226 -6.008 45.225 -0.892 1.00 0.00 H ATOM 4693 HG2 ARG B 226 -9.033 44.948 -0.791 1.00 0.00 H ATOM 4694 HG3 ARG B 226 -8.010 44.804 -2.239 1.00 0.00 H ATOM 4695 HD2 ARG B 226 -7.466 43.012 0.107 1.00 0.00 H ATOM 4696 HD3 ARG B 226 -7.198 42.728 -1.629 1.00 0.00 H ATOM 4697 HE ARG B 226 -10.022 42.991 -1.110 1.00 0.00 H ATOM 4698 HH12 ARG B 226 -8.373 39.285 -0.633 1.00 0.00 H ATOM 4699 HH11 ARG B 226 -7.294 40.727 -0.635 1.00 0.00 H ATOM 4700 HH22 ARG B 226 -10.616 39.533 -0.898 1.00 0.00 H ATOM 4701 HH21 ARG B 226 -11.334 41.171 -1.111 1.00 0.00 H ATOM 4702 H ARG B 226 -8.912 46.255 1.146 1.00 0.00 H ATOM 4703 N VAL B 227 -6.054 47.536 1.841 1.00 75.54 N ATOM 4704 CA VAL B 227 -5.131 48.449 2.529 1.00 76.07 C ATOM 4705 C VAL B 227 -4.717 47.855 3.886 1.00 76.49 C ATOM 4706 O VAL B 227 -3.532 47.807 4.229 1.00 76.51 O ATOM 4707 CB VAL B 227 -5.762 49.860 2.720 1.00 75.92 C ATOM 4708 CG1 VAL B 227 -4.772 50.819 3.356 1.00 76.25 C ATOM 4709 CG2 VAL B 227 -6.238 50.426 1.388 1.00 76.04 C ATOM 4710 HA VAL B 227 -4.244 48.567 1.906 1.00 0.00 H ATOM 4711 HB VAL B 227 -6.619 49.748 3.385 1.00 0.00 H ATOM 4712 HG11 VAL B 227 -4.472 50.435 4.331 1.00 0.00 H ATOM 4713 HG12 VAL B 227 -3.895 50.912 2.715 1.00 0.00 H ATOM 4714 HG13 VAL B 227 -5.241 51.796 3.477 1.00 0.00 H ATOM 4715 HG21 VAL B 227 -5.391 50.509 0.707 1.00 0.00 H ATOM 4716 HG22 VAL B 227 -6.988 49.761 0.959 1.00 0.00 H ATOM 4717 HG23 VAL B 227 -6.675 51.412 1.549 1.00 0.00 H ATOM 4718 H VAL B 227 -6.968 47.908 1.512 1.00 0.00 H ATOM 4719 N ILE B 228 -5.709 47.380 4.629 1.00 76.97 N ATOM 4720 CA ILE B 228 -5.505 46.755 5.927 1.00 77.57 C ATOM 4721 C ILE B 228 -4.665 45.468 5.817 1.00 78.28 C ATOM 4722 O ILE B 228 -3.868 45.154 6.705 1.00 78.62 O ATOM 4723 CB ILE B 228 -6.886 46.509 6.618 1.00 77.56 C ATOM 4724 CG1 ILE B 228 -7.555 47.854 6.955 1.00 77.42 C ATOM 4725 CG2 ILE B 228 -6.751 45.638 7.859 1.00 77.29 C ATOM 4726 CD1 ILE B 228 -9.068 47.799 7.155 1.00 77.29 C ATOM 4727 HA ILE B 228 -4.929 47.434 6.556 1.00 0.00 H ATOM 4728 HB ILE B 228 -7.521 45.967 5.918 1.00 0.00 H ATOM 4729 HG12 ILE B 228 -7.107 48.232 7.874 1.00 0.00 H ATOM 4730 HG13 ILE B 228 -7.348 48.547 6.140 1.00 0.00 H ATOM 4731 HD11 ILE B 228 -9.541 47.438 6.242 1.00 0.00 H ATOM 4732 HD12 ILE B 228 -9.300 47.123 7.978 1.00 0.00 H ATOM 4733 HD13 ILE B 228 -9.439 48.797 7.388 1.00 0.00 H ATOM 4734 HG21 ILE B 228 -6.331 44.672 7.579 1.00 0.00 H ATOM 4735 HG22 ILE B 228 -6.092 46.128 8.576 1.00 0.00 H ATOM 4736 HG23 ILE B 228 -7.734 45.492 8.308 1.00 0.00 H ATOM 4737 H ILE B 228 -6.680 47.458 4.265 1.00 0.00 H ATOM 4738 N LEU B 229 -4.819 44.740 4.717 1.00 78.97 N ATOM 4739 CA LEU B 229 -4.159 43.444 4.579 1.00 79.67 C ATOM 4740 C LEU B 229 -2.744 43.538 4.027 1.00 80.21 C ATOM 4741 O LEU B 229 -1.899 42.696 4.332 1.00 80.19 O ATOM 4742 CB LEU B 229 -5.002 42.496 3.726 1.00 79.62 C ATOM 4743 CG LEU B 229 -6.193 41.872 4.454 1.00 79.43 C ATOM 4744 CD1 LEU B 229 -7.254 41.414 3.470 1.00 79.77 C ATOM 4745 CD2 LEU B 229 -5.744 40.724 5.335 1.00 78.93 C ATOM 4746 HA LEU B 229 -4.069 43.042 5.588 1.00 0.00 H ATOM 4747 HB2 LEU B 229 -5.381 43.055 2.870 1.00 0.00 H ATOM 4748 HB3 LEU B 229 -4.357 41.690 3.375 1.00 0.00 H ATOM 4749 HG LEU B 229 -6.635 42.637 5.092 1.00 0.00 H ATOM 4750 HD21 LEU B 229 -5.268 39.960 4.720 1.00 0.00 H ATOM 4751 HD22 LEU B 229 -5.033 41.092 6.075 1.00 0.00 H ATOM 4752 HD23 LEU B 229 -6.609 40.297 5.842 1.00 0.00 H ATOM 4753 HD11 LEU B 229 -7.606 42.269 2.893 1.00 0.00 H ATOM 4754 HD12 LEU B 229 -6.827 40.671 2.797 1.00 0.00 H ATOM 4755 HD13 LEU B 229 -8.089 40.975 4.016 1.00 0.00 H ATOM 4756 H LEU B 229 -5.417 45.097 3.944 1.00 0.00 H ATOM 4757 N SER B 230 -2.490 44.556 3.211 1.00 80.86 N ATOM 4758 CA SER B 230 -1.149 44.774 2.674 1.00 81.57 C ATOM 4759 C SER B 230 -0.178 45.297 3.751 1.00 82.08 C ATOM 4760 O SER B 230 1.045 45.154 3.615 1.00 82.37 O ATOM 4761 CB SER B 230 -1.193 45.708 1.456 1.00 81.48 C ATOM 4762 OG SER B 230 -1.746 46.972 1.779 1.00 81.37 O ATOM 4763 HA SER B 230 -0.766 43.808 2.344 1.00 0.00 H ATOM 4764 HB2 SER B 230 -1.801 45.245 0.679 1.00 0.00 H ATOM 4765 HB3 SER B 230 -0.178 45.851 1.085 1.00 0.00 H ATOM 4766 HG SER B 230 -2.671 46.851 2.111 1.00 0.00 H ATOM 4767 H SER B 230 -3.258 45.207 2.951 1.00 0.00 H ATOM 4768 N GLY B 231 -0.733 45.869 4.824 1.00 82.44 N ATOM 4769 CA GLY B 231 0.049 46.553 5.855 1.00 82.71 C ATOM 4770 C GLY B 231 0.586 47.886 5.349 1.00 83.05 C ATOM 4771 O GLY B 231 1.663 48.326 5.762 1.00 83.13 O ATOM 4772 HA3 GLY B 231 0.887 45.919 6.144 1.00 0.00 H ATOM 4773 HA2 GLY B 231 -0.586 46.732 6.723 1.00 0.00 H ATOM 4774 H GLY B 231 -1.767 45.826 4.931 1.00 0.00 H ATOM 4775 N LYS B 232 -0.163 48.520 4.443 1.00 83.16 N ATOM 4776 CA LYS B 232 0.209 49.815 3.863 1.00 83.20 C ATOM 4777 C LYS B 232 -0.803 50.890 4.279 1.00 83.30 C ATOM 4778 O LYS B 232 -1.168 51.770 3.481 1.00 83.34 O ATOM 4779 CB LYS B 232 0.300 49.717 2.331 1.00 83.30 C ATOM 4780 CG LYS B 232 1.260 48.644 1.811 1.00 83.27 C ATOM 4781 HA LYS B 232 1.191 50.098 4.242 1.00 0.00 H ATOM 4782 HB2 LYS B 232 -0.696 49.497 1.946 1.00 0.00 H ATOM 4783 HB3 LYS B 232 0.631 50.682 1.948 1.00 0.00 H ATOM 4784 HG2 LYS B 232 2.267 48.853 2.173 1.00 0.00 H ATOM 4785 HG3 LYS B 232 0.939 47.666 2.170 1.00 0.00 H ATOM 4786 H LYS B 232 -1.051 48.075 4.134 1.00 0.00 H ATOM 4787 N ALA B 233 -1.229 50.812 5.543 1.00 83.36 N ATOM 4788 CA ALA B 233 -2.312 51.640 6.092 1.00 83.31 C ATOM 4789 C ALA B 233 -1.832 52.721 7.067 1.00 83.28 C ATOM 4790 O ALA B 233 -0.694 53.198 6.985 1.00 83.15 O ATOM 4791 CB ALA B 233 -3.351 50.750 6.770 1.00 83.22 C ATOM 4792 HA ALA B 233 -2.754 52.168 5.247 1.00 0.00 H ATOM 4793 HB1 ALA B 233 -3.764 50.054 6.040 1.00 0.00 H ATOM 4794 HB2 ALA B 233 -2.878 50.192 7.578 1.00 0.00 H ATOM 4795 HB3 ALA B 233 -4.151 51.371 7.175 1.00 0.00 H ATOM 4796 H ALA B 233 -0.768 50.126 6.174 1.00 0.00 H TER 4797 ALA B 233 ATOM 4798 N ASN B 235 -1.842 53.111 12.479 1.00 83.31 N ATOM 4799 CA ASN B 235 -1.077 52.239 11.584 1.00 83.46 C ATOM 4800 C ASN B 235 -0.488 51.004 12.283 1.00 83.28 C ATOM 4801 O ASN B 235 0.432 50.364 11.766 1.00 83.16 O ATOM 4802 CB ASN B 235 0.022 53.033 10.849 1.00 83.59 C ATOM 4803 CG ASN B 235 0.620 52.269 9.663 1.00 83.86 C ATOM 4804 OD1 ASN B 235 0.054 51.278 9.194 1.00 84.71 O ATOM 4805 ND2 ASN B 235 1.766 52.736 9.173 1.00 83.61 N ATOM 4806 HA ASN B 235 -1.790 51.859 10.852 1.00 0.00 H ATOM 4807 HB2 ASN B 235 -0.409 53.964 10.481 1.00 0.00 H ATOM 4808 HB3 ASN B 235 0.820 53.258 11.556 1.00 0.00 H ATOM 4809 HD22 ASN B 235 2.210 53.575 9.598 1.00 0.00 H ATOM 4810 HD21 ASN B 235 2.217 52.262 8.365 1.00 0.00 H ATOM 4811 HN3 ASN B 235 -1.223 53.451 13.242 1.00 0.00 H ATOM 4812 HN2 ASN B 235 -2.635 52.577 12.887 1.00 0.00 H ATOM 4813 HN1 ASN B 235 -2.209 53.922 11.941 1.00 0.00 H ATOM 4814 N ASN B 236 -1.008 50.683 13.465 1.00 83.14 N ATOM 4815 CA ASN B 236 -0.710 49.401 14.082 1.00 82.99 C ATOM 4816 C ASN B 236 -1.649 48.383 13.460 1.00 82.96 C ATOM 4817 O ASN B 236 -2.849 48.370 13.768 1.00 83.00 O ATOM 4818 CB ASN B 236 -0.855 49.445 15.602 1.00 83.03 C ATOM 4819 HA ASN B 236 0.330 49.129 13.900 1.00 0.00 H ATOM 4820 HB2 ASN B 236 -0.168 50.186 16.010 1.00 0.00 H ATOM 4821 HB3 ASN B 236 -1.879 49.716 15.860 1.00 0.00 H ATOM 4822 H ASN B 236 -1.634 51.356 13.952 1.00 0.00 H ATOM 4823 N PRO B 237 -1.104 47.539 12.560 1.00 82.91 N ATOM 4824 CA PRO B 237 -1.840 46.607 11.699 1.00 82.71 C ATOM 4825 C PRO B 237 -2.721 45.601 12.467 1.00 82.51 C ATOM 4826 O PRO B 237 -2.738 45.621 13.699 1.00 82.48 O ATOM 4827 CB PRO B 237 -0.714 45.887 10.939 1.00 82.68 C ATOM 4828 CG PRO B 237 0.430 46.844 10.969 1.00 82.82 C ATOM 4829 CD PRO B 237 0.351 47.438 12.333 1.00 82.84 C ATOM 4830 HA PRO B 237 -2.554 47.130 11.063 1.00 0.00 H ATOM 4831 HD3 PRO B 237 0.820 46.789 13.072 1.00 0.00 H ATOM 4832 HD2 PRO B 237 0.823 48.420 12.362 1.00 0.00 H ATOM 4833 HG3 PRO B 237 0.317 47.611 10.203 1.00 0.00 H ATOM 4834 HG2 PRO B 237 1.377 46.324 10.824 1.00 0.00 H ATOM 4835 HB2 PRO B 237 -0.449 44.954 11.436 1.00 0.00 H ATOM 4836 HB3 PRO B 237 -1.015 45.678 9.912 1.00 0.00 H ATOM 4837 N PRO B 238 -3.482 44.753 11.740 1.00 82.34 N ATOM 4838 CA PRO B 238 -4.241 43.632 12.303 1.00 82.23 C ATOM 4839 C PRO B 238 -3.523 42.830 13.386 1.00 82.15 C ATOM 4840 O PRO B 238 -2.330 43.008 13.606 1.00 82.01 O ATOM 4841 CB PRO B 238 -4.466 42.736 11.085 1.00 82.16 C ATOM 4842 CG PRO B 238 -4.569 43.677 9.958 1.00 82.19 C ATOM 4843 CD PRO B 238 -3.709 44.870 10.285 1.00 82.22 C ATOM 4844 HA PRO B 238 -5.136 44.001 12.805 1.00 0.00 H ATOM 4845 HD3 PRO B 238 -2.766 44.830 9.740 1.00 0.00 H ATOM 4846 HD2 PRO B 238 -4.226 45.799 10.046 1.00 0.00 H ATOM 4847 HG3 PRO B 238 -5.605 43.989 9.827 1.00 0.00 H ATOM 4848 HG2 PRO B 238 -4.215 43.202 9.043 1.00 0.00 H ATOM 4849 HB2 PRO B 238 -3.626 42.055 10.945 1.00 0.00 H ATOM 4850 HB3 PRO B 238 -5.385 42.160 11.193 1.00 0.00 H ATOM 4851 N PHE B 239 -4.261 41.951 14.051 1.00 82.30 N ATOM 4852 CA PHE B 239 -3.673 41.033 15.009 1.00 82.61 C ATOM 4853 C PHE B 239 -3.993 39.604 14.617 1.00 82.90 C ATOM 4854 O PHE B 239 -5.148 39.177 14.674 1.00 83.01 O ATOM 4855 CB PHE B 239 -4.156 41.320 16.436 1.00 82.62 C ATOM 4856 CG PHE B 239 -3.761 40.264 17.431 1.00 82.51 C ATOM 4857 CD1 PHE B 239 -2.433 40.144 17.851 1.00 82.58 C ATOM 4858 CD2 PHE B 239 -4.712 39.383 17.942 1.00 82.53 C ATOM 4859 CE1 PHE B 239 -2.056 39.164 18.769 1.00 82.48 C ATOM 4860 CE2 PHE B 239 -4.350 38.393 18.862 1.00 82.75 C ATOM 4861 CZ PHE B 239 -3.015 38.287 19.278 1.00 82.95 C ATOM 4862 HA PHE B 239 -2.592 41.176 14.995 1.00 0.00 H ATOM 4863 HB2 PHE B 239 -3.734 42.272 16.758 1.00 0.00 H ATOM 4864 HB3 PHE B 239 -5.244 41.392 16.424 1.00 0.00 H ATOM 4865 HD2 PHE B 239 -5.750 39.466 17.621 1.00 0.00 H ATOM 4866 HE2 PHE B 239 -5.102 37.708 19.253 1.00 0.00 H ATOM 4867 HZ PHE B 239 -2.727 37.521 19.998 1.00 0.00 H ATOM 4868 HE1 PHE B 239 -1.017 39.083 19.088 1.00 0.00 H ATOM 4869 HD1 PHE B 239 -1.681 40.827 17.455 1.00 0.00 H ATOM 4870 H PHE B 239 -5.287 41.919 13.882 1.00 0.00 H ATOM 4871 N VAL B 240 -2.954 38.871 14.236 1.00 83.35 N ATOM 4872 CA VAL B 240 -3.081 37.490 13.794 1.00 83.69 C ATOM 4873 C VAL B 240 -3.534 36.577 14.924 1.00 84.16 C ATOM 4874 O VAL B 240 -2.930 36.549 15.993 1.00 84.09 O ATOM 4875 CB VAL B 240 -1.749 36.954 13.211 1.00 83.72 C ATOM 4876 CG1 VAL B 240 -1.911 35.519 12.711 1.00 83.54 C ATOM 4877 CG2 VAL B 240 -1.239 37.862 12.092 1.00 83.50 C ATOM 4878 HA VAL B 240 -3.839 37.487 13.011 1.00 0.00 H ATOM 4879 HB VAL B 240 -1.009 36.953 14.011 1.00 0.00 H ATOM 4880 HG11 VAL B 240 -2.214 34.879 13.540 1.00 0.00 H ATOM 4881 HG12 VAL B 240 -2.672 35.491 11.931 1.00 0.00 H ATOM 4882 HG13 VAL B 240 -0.962 35.167 12.307 1.00 0.00 H ATOM 4883 HG21 VAL B 240 -1.980 37.904 11.294 1.00 0.00 H ATOM 4884 HG22 VAL B 240 -1.071 38.864 12.487 1.00 0.00 H ATOM 4885 HG23 VAL B 240 -0.303 37.463 11.700 1.00 0.00 H ATOM 4886 H VAL B 240 -2.008 39.302 14.254 1.00 0.00 H ATOM 4887 N ILE B 241 -4.619 35.857 14.668 1.00 84.98 N ATOM 4888 CA ILE B 241 -5.049 34.734 15.487 1.00 85.79 C ATOM 4889 C ILE B 241 -4.659 33.481 14.714 1.00 86.65 C ATOM 4890 O ILE B 241 -4.971 33.376 13.529 1.00 86.79 O ATOM 4891 CB ILE B 241 -6.581 34.746 15.699 1.00 85.68 C ATOM 4892 CG1 ILE B 241 -7.030 36.078 16.306 1.00 85.50 C ATOM 4893 CG2 ILE B 241 -7.024 33.575 16.568 1.00 85.29 C ATOM 4894 CD1 ILE B 241 -8.508 36.350 16.159 1.00 85.31 C ATOM 4895 HA ILE B 241 -4.586 34.779 16.473 1.00 0.00 H ATOM 4896 HB ILE B 241 -7.058 34.636 14.725 1.00 0.00 H ATOM 4897 HG12 ILE B 241 -6.786 36.071 17.368 1.00 0.00 H ATOM 4898 HG13 ILE B 241 -6.482 36.882 15.814 1.00 0.00 H ATOM 4899 HD11 ILE B 241 -8.768 36.373 15.101 1.00 0.00 H ATOM 4900 HD12 ILE B 241 -9.073 35.561 16.657 1.00 0.00 H ATOM 4901 HD13 ILE B 241 -8.746 37.311 16.614 1.00 0.00 H ATOM 4902 HG21 ILE B 241 -6.746 32.639 16.084 1.00 0.00 H ATOM 4903 HG22 ILE B 241 -6.536 33.641 17.541 1.00 0.00 H ATOM 4904 HG23 ILE B 241 -8.105 33.610 16.699 1.00 0.00 H ATOM 4905 H ILE B 241 -5.192 36.109 13.838 1.00 0.00 H ATOM 4906 N HIS B 242 -3.958 32.551 15.365 1.00 87.82 N ATOM 4907 CA HIS B 242 -3.555 31.286 14.721 1.00 88.83 C ATOM 4908 C HIS B 242 -3.449 30.087 15.669 1.00 89.34 C ATOM 4909 O HIS B 242 -3.064 28.991 15.243 1.00 89.47 O ATOM 4910 CB HIS B 242 -2.275 31.453 13.871 1.00 88.94 C ATOM 4911 CG HIS B 242 -1.087 31.966 14.628 1.00 89.57 C ATOM 4912 ND1 HIS B 242 -0.967 33.280 15.031 1.00 90.22 N ATOM 4913 CD2 HIS B 242 0.053 31.349 15.020 1.00 89.85 C ATOM 4914 CE1 HIS B 242 0.184 33.444 15.660 1.00 90.04 C ATOM 4915 NE2 HIS B 242 0.821 32.287 15.668 1.00 90.10 N ATOM 4916 HA HIS B 242 -4.381 31.044 14.052 1.00 0.00 H ATOM 4917 HB2 HIS B 242 -2.017 30.481 13.450 1.00 0.00 H ATOM 4918 HB3 HIS B 242 -2.492 32.152 13.063 1.00 0.00 H ATOM 4919 HD2 HIS B 242 0.313 30.304 14.853 1.00 0.00 H ATOM 4920 HE1 HIS B 242 0.546 34.375 16.097 1.00 0.00 H ATOM 4921 H HIS B 242 -3.688 32.723 16.355 1.00 0.00 H ATOM 4922 N ASP B 243 -3.818 30.299 16.936 1.00 89.95 N ATOM 4923 CA ASP B 243 -3.800 29.260 17.982 1.00 90.57 C ATOM 4924 C ASP B 243 -4.681 29.659 19.169 1.00 90.90 C ATOM 4925 O ASP B 243 -5.315 30.719 19.152 1.00 90.79 O ATOM 4926 CB ASP B 243 -2.366 28.985 18.461 1.00 90.55 C ATOM 4927 CG ASP B 243 -1.535 30.259 18.593 1.00 91.05 C ATOM 4928 OD1 ASP B 243 -1.786 31.071 19.512 1.00 91.22 O ATOM 4929 OD2 ASP B 243 -0.625 30.450 17.765 1.00 91.63 O ATOM 4930 HA ASP B 243 -4.201 28.346 17.543 1.00 0.00 H ATOM 4931 HB2 ASP B 243 -2.411 28.495 19.434 1.00 0.00 H ATOM 4932 HB3 ASP B 243 -1.879 28.323 17.744 1.00 0.00 H ATOM 4933 H ASP B 243 -4.137 31.253 17.200 1.00 0.00 H ATOM 4934 N MET B 244 -4.699 28.811 20.198 1.00 91.36 N ATOM 4935 CA MET B 244 -5.487 29.043 21.410 1.00 91.78 C ATOM 4936 C MET B 244 -5.076 30.301 22.163 1.00 92.11 C ATOM 4937 O MET B 244 -5.930 31.030 22.667 1.00 92.12 O ATOM 4938 CB MET B 244 -5.391 27.838 22.344 1.00 91.82 C ATOM 4939 CG MET B 244 -5.876 26.535 21.731 1.00 92.04 C ATOM 4940 SD MET B 244 -7.349 26.781 20.722 1.00 92.90 S ATOM 4941 CE MET B 244 -8.117 25.155 20.783 1.00 92.15 C ATOM 4942 HA MET B 244 -6.516 29.186 21.081 1.00 0.00 H ATOM 4943 HB2 MET B 244 -4.348 27.712 22.634 1.00 0.00 H ATOM 4944 HB3 MET B 244 -5.991 28.043 23.230 1.00 0.00 H ATOM 4945 HG2 MET B 244 -6.109 25.833 22.531 1.00 0.00 H ATOM 4946 HG3 MET B 244 -5.084 26.122 21.106 1.00 0.00 H ATOM 4947 HE1 MET B 244 -7.432 24.415 20.368 1.00 0.00 H ATOM 4948 HE2 MET B 244 -8.345 24.901 21.818 1.00 0.00 H ATOM 4949 HE3 MET B 244 -9.038 25.167 20.200 1.00 0.00 H ATOM 4950 H MET B 244 -4.127 27.945 20.137 1.00 0.00 H ATOM 4951 N GLU B 245 -3.767 30.544 22.222 1.00 92.59 N ATOM 4952 CA GLU B 245 -3.180 31.672 22.960 1.00 93.02 C ATOM 4953 C GLU B 245 -3.649 33.003 22.394 1.00 93.22 C ATOM 4954 O GLU B 245 -4.149 33.867 23.119 1.00 93.22 O ATOM 4955 CB GLU B 245 -1.645 31.632 22.887 1.00 93.07 C ATOM 4956 CG GLU B 245 -1.021 30.264 22.615 1.00 93.31 C ATOM 4957 CD GLU B 245 -0.988 29.372 23.839 1.00 94.00 C ATOM 4958 OE1 GLU B 245 0.127 29.005 24.265 1.00 94.26 O ATOM 4959 OE2 GLU B 245 -2.069 29.041 24.378 1.00 94.54 O ATOM 4960 HA GLU B 245 -3.507 31.580 23.996 1.00 0.00 H ATOM 4961 HB2 GLU B 245 -1.331 32.306 22.090 1.00 0.00 H ATOM 4962 HB3 GLU B 245 -1.256 31.992 23.840 1.00 0.00 H ATOM 4963 HG2 GLU B 245 -1.601 29.766 21.838 1.00 0.00 H ATOM 4964 HG3 GLU B 245 0.001 30.412 22.265 1.00 0.00 H ATOM 4965 H GLU B 245 -3.125 29.900 21.718 1.00 0.00 H ATOM 4966 N THR B 246 -3.471 33.147 21.086 1.00 93.48 N ATOM 4967 CA THR B 246 -3.816 34.362 20.359 1.00 93.69 C ATOM 4968 C THR B 246 -5.333 34.526 20.204 1.00 93.85 C ATOM 4969 O THR B 246 -5.824 35.638 20.021 1.00 93.74 O ATOM 4970 CB THR B 246 -3.115 34.387 18.988 1.00 93.69 C ATOM 4971 OG1 THR B 246 -3.082 33.059 18.450 1.00 93.64 O ATOM 4972 CG2 THR B 246 -1.681 34.901 19.129 1.00 93.61 C ATOM 4973 HA THR B 246 -3.462 35.209 20.946 1.00 0.00 H ATOM 4974 HB THR B 246 -3.668 35.051 18.324 1.00 0.00 H ATOM 4975 HG1 THR B 246 -2.584 32.466 19.067 1.00 0.00 H ATOM 4976 HG23 THR B 246 -1.697 35.911 19.538 1.00 0.00 H ATOM 4977 HG21 THR B 246 -1.126 34.245 19.799 1.00 0.00 H ATOM 4978 HG22 THR B 246 -1.202 34.912 18.150 1.00 0.00 H ATOM 4979 H THR B 246 -3.064 32.352 20.553 1.00 0.00 H ATOM 4980 N LEU B 247 -6.064 33.415 20.279 1.00 94.07 N ATOM 4981 CA LEU B 247 -7.519 33.453 20.357 1.00 94.36 C ATOM 4982 C LEU B 247 -7.937 34.088 21.674 1.00 94.78 C ATOM 4983 O LEU B 247 -8.690 35.063 21.696 1.00 94.74 O ATOM 4984 CB LEU B 247 -8.103 32.041 20.252 1.00 94.09 C ATOM 4985 CG LEU B 247 -9.570 31.839 20.635 1.00 93.78 C ATOM 4986 CD1 LEU B 247 -10.509 32.500 19.638 1.00 93.40 C ATOM 4987 CD2 LEU B 247 -9.868 30.363 20.740 1.00 93.76 C ATOM 4988 HA LEU B 247 -7.901 34.046 19.526 1.00 0.00 H ATOM 4989 HB2 LEU B 247 -7.991 31.720 19.216 1.00 0.00 H ATOM 4990 HB3 LEU B 247 -7.508 31.395 20.897 1.00 0.00 H ATOM 4991 HG LEU B 247 -9.737 32.314 21.602 1.00 0.00 H ATOM 4992 HD21 LEU B 247 -9.675 29.885 19.779 1.00 0.00 H ATOM 4993 HD22 LEU B 247 -9.229 29.918 21.503 1.00 0.00 H ATOM 4994 HD23 LEU B 247 -10.914 30.223 21.013 1.00 0.00 H ATOM 4995 HD11 LEU B 247 -10.307 33.571 19.605 1.00 0.00 H ATOM 4996 HD12 LEU B 247 -10.350 32.069 18.650 1.00 0.00 H ATOM 4997 HD13 LEU B 247 -11.541 32.333 19.947 1.00 0.00 H ATOM 4998 H LEU B 247 -5.582 32.493 20.282 1.00 0.00 H ATOM 4999 N CYS B 248 -7.425 33.520 22.765 1.00 95.33 N ATOM 5000 CA CYS B 248 -7.758 33.956 24.113 1.00 95.72 C ATOM 5001 C CYS B 248 -7.194 35.334 24.423 1.00 95.94 C ATOM 5002 O CYS B 248 -7.895 36.167 24.997 1.00 96.09 O ATOM 5003 CB CYS B 248 -7.297 32.922 25.138 1.00 95.68 C ATOM 5004 SG CYS B 248 -8.028 31.279 24.880 1.00 96.32 S ATOM 5005 HA CYS B 248 -8.843 34.041 24.175 1.00 0.00 H ATOM 5006 HB2 CYS B 248 -7.575 33.272 26.132 1.00 0.00 H ATOM 5007 HB3 CYS B 248 -6.213 32.832 25.076 1.00 0.00 H ATOM 5008 HG CYS B 248 -7.676 30.812 23.630 1.00 0.00 H ATOM 5009 H CYS B 248 -6.758 32.730 22.648 1.00 0.00 H ATOM 5010 N MET B 249 -5.945 35.582 24.024 1.00 96.20 N ATOM 5011 CA MET B 249 -5.318 36.893 24.213 1.00 96.50 C ATOM 5012 C MET B 249 -5.926 37.946 23.284 1.00 96.80 C ATOM 5013 O MET B 249 -5.689 39.145 23.453 1.00 96.76 O ATOM 5014 CB MET B 249 -3.803 36.811 24.014 1.00 96.42 C ATOM 5015 HA MET B 249 -5.514 37.201 25.240 1.00 0.00 H ATOM 5016 HB2 MET B 249 -3.380 36.113 24.737 1.00 0.00 H ATOM 5017 HB3 MET B 249 -3.589 36.463 23.003 1.00 0.00 H ATOM 5018 H MET B 249 -5.401 34.823 23.566 1.00 0.00 H ATOM 5019 N ALA B 250 -6.711 37.484 22.311 1.00 97.27 N ATOM 5020 CA ALA B 250 -7.440 38.369 21.404 1.00 97.68 C ATOM 5021 C ALA B 250 -8.697 38.905 22.073 1.00 97.96 C ATOM 5022 O ALA B 250 -8.832 40.114 22.272 1.00 97.98 O ATOM 5023 CB ALA B 250 -7.795 37.646 20.119 1.00 97.69 C ATOM 5024 HA ALA B 250 -6.792 39.211 21.159 1.00 0.00 H ATOM 5025 HB1 ALA B 250 -6.881 37.312 19.627 1.00 0.00 H ATOM 5026 HB2 ALA B 250 -8.421 36.784 20.350 1.00 0.00 H ATOM 5027 HB3 ALA B 250 -8.337 38.324 19.460 1.00 0.00 H ATOM 5028 H ALA B 250 -6.809 36.455 22.193 1.00 0.00 H ATOM 5029 N GLU B 251 -9.605 37.990 22.422 1.00 98.25 N ATOM 5030 CA GLU B 251 -10.851 38.302 23.133 1.00 98.49 C ATOM 5031 C GLU B 251 -10.648 39.268 24.297 1.00 98.66 C ATOM 5032 O GLU B 251 -11.570 39.983 24.688 1.00 98.69 O ATOM 5033 CB GLU B 251 -11.494 37.016 23.645 1.00 98.46 C ATOM 5034 CG GLU B 251 -11.793 36.012 22.551 1.00 98.63 C ATOM 5035 CD GLU B 251 -11.601 34.579 22.994 1.00 99.10 C ATOM 5036 OE1 GLU B 251 -10.867 34.336 23.976 1.00 99.79 O ATOM 5037 OE2 GLU B 251 -12.180 33.685 22.347 1.00 99.28 O ATOM 5038 HA GLU B 251 -11.506 38.796 22.415 1.00 0.00 H ATOM 5039 HB2 GLU B 251 -10.816 36.553 24.362 1.00 0.00 H ATOM 5040 HB3 GLU B 251 -12.429 37.272 24.143 1.00 0.00 H ATOM 5041 HG2 GLU B 251 -12.828 36.142 22.234 1.00 0.00 H ATOM 5042 HG3 GLU B 251 -11.129 36.207 21.709 1.00 0.00 H ATOM 5043 H GLU B 251 -9.418 36.997 22.175 1.00 0.00 H ATOM 5044 N LYS B 252 -9.436 39.274 24.846 1.00 98.84 N ATOM 5045 CA LYS B 252 -9.053 40.223 25.881 1.00 99.03 C ATOM 5046 C LYS B 252 -8.966 41.650 25.326 1.00 99.09 C ATOM 5047 O LYS B 252 -9.607 42.559 25.855 1.00 99.15 O ATOM 5048 CB LYS B 252 -7.725 39.810 26.530 1.00 99.04 C ATOM 5049 HA LYS B 252 -9.829 40.212 26.647 1.00 0.00 H ATOM 5050 HB2 LYS B 252 -7.833 38.823 26.979 1.00 0.00 H ATOM 5051 HB3 LYS B 252 -6.944 39.782 25.770 1.00 0.00 H ATOM 5052 H LYS B 252 -8.737 38.575 24.524 1.00 0.00 H ATOM 5053 N THR B 253 -8.193 41.838 24.256 1.00 99.16 N ATOM 5054 CA THR B 253 -7.925 43.183 23.728 1.00 99.17 C ATOM 5055 C THR B 253 -8.680 43.533 22.436 1.00 99.31 C ATOM 5056 O THR B 253 -8.379 44.549 21.801 1.00 99.23 O ATOM 5057 CB THR B 253 -6.401 43.437 23.536 1.00 99.09 C ATOM 5058 OG1 THR B 253 -5.799 42.311 22.887 1.00 98.88 O ATOM 5059 CG2 THR B 253 -5.713 43.670 24.877 1.00 98.89 C ATOM 5060 HA THR B 253 -8.313 43.850 24.497 1.00 0.00 H ATOM 5061 HB THR B 253 -6.281 44.329 22.921 1.00 0.00 H ATOM 5062 HG1 THR B 253 -5.929 41.503 23.443 1.00 0.00 H ATOM 5063 HG23 THR B 253 -6.169 44.526 25.374 1.00 0.00 H ATOM 5064 HG21 THR B 253 -5.827 42.784 25.501 1.00 0.00 H ATOM 5065 HG22 THR B 253 -4.654 43.866 24.711 1.00 0.00 H ATOM 5066 H THR B 253 -7.770 41.014 23.784 1.00 0.00 H ATOM 5067 N LEU B 254 -9.668 42.710 22.067 1.00 99.52 N ATOM 5068 CA LEU B 254 -10.425 42.902 20.810 1.00 99.62 C ATOM 5069 C LEU B 254 -11.966 43.024 20.918 1.00 99.59 C ATOM 5070 O LEU B 254 -12.543 43.989 20.398 1.00 99.64 O ATOM 5071 CB LEU B 254 -10.034 41.852 19.759 1.00 99.59 C ATOM 5072 CG LEU B 254 -8.713 42.079 19.012 1.00 99.68 C ATOM 5073 CD1 LEU B 254 -8.348 40.850 18.197 1.00100.00 C ATOM 5074 CD2 LEU B 254 -8.755 43.321 18.116 1.00 99.47 C ATOM 5075 HA LEU B 254 -10.115 43.897 20.492 1.00 0.00 H ATOM 5076 HB2 LEU B 254 -9.966 40.889 20.264 1.00 0.00 H ATOM 5077 HB3 LEU B 254 -10.831 41.816 19.016 1.00 0.00 H ATOM 5078 HG LEU B 254 -7.944 42.253 19.765 1.00 0.00 H ATOM 5079 HD21 LEU B 254 -9.546 43.206 17.375 1.00 0.00 H ATOM 5080 HD22 LEU B 254 -8.953 44.202 18.727 1.00 0.00 H ATOM 5081 HD23 LEU B 254 -7.796 43.436 17.611 1.00 0.00 H ATOM 5082 HD11 LEU B 254 -8.238 39.994 18.863 1.00 0.00 H ATOM 5083 HD12 LEU B 254 -9.137 40.649 17.472 1.00 0.00 H ATOM 5084 HD13 LEU B 254 -7.409 41.028 17.674 1.00 0.00 H ATOM 5085 H LEU B 254 -9.912 41.909 22.684 1.00 0.00 H ATOM 5086 N VAL B 255 -12.623 42.049 21.557 1.00 99.44 N ATOM 5087 CA VAL B 255 -14.090 42.095 21.739 1.00 99.20 C ATOM 5088 C VAL B 255 -14.505 42.993 22.925 1.00 99.17 C ATOM 5089 O VAL B 255 -15.404 42.619 23.724 1.00 99.11 O ATOM 5090 CB VAL B 255 -14.761 40.671 21.806 1.00 99.10 C ATOM 5091 CG1 VAL B 255 -14.697 39.980 20.453 1.00 98.94 C ATOM 5092 CG2 VAL B 255 -14.148 39.794 22.895 1.00 98.79 C ATOM 5093 HA VAL B 255 -14.481 42.560 20.834 1.00 0.00 H ATOM 5094 HB VAL B 255 -15.808 40.822 22.070 1.00 0.00 H ATOM 5095 HG11 VAL B 255 -15.224 40.583 19.713 1.00 0.00 H ATOM 5096 HG12 VAL B 255 -13.655 39.865 20.154 1.00 0.00 H ATOM 5097 HG13 VAL B 255 -15.167 38.999 20.525 1.00 0.00 H ATOM 5098 HG21 VAL B 255 -13.085 39.659 22.695 1.00 0.00 H ATOM 5099 HG22 VAL B 255 -14.278 40.276 23.864 1.00 0.00 H ATOM 5100 HG23 VAL B 255 -14.644 38.824 22.901 1.00 0.00 H ATOM 5101 H VAL B 255 -12.090 41.240 21.934 1.00 0.00 H TER 5102 VAL B 255 ATOM 5103 N VAL B 259 -13.079 41.565 26.752 1.00 96.68 N ATOM 5104 CA VAL B 259 -13.311 40.370 27.561 1.00 96.67 C ATOM 5105 C VAL B 259 -14.782 39.934 27.515 1.00 96.62 C ATOM 5106 O VAL B 259 -15.690 40.764 27.627 1.00 96.61 O ATOM 5107 CB VAL B 259 -12.860 40.585 29.025 1.00 96.69 C ATOM 5108 HA VAL B 259 -12.708 39.571 27.130 1.00 0.00 H ATOM 5109 HB VAL B 259 -11.795 40.817 29.045 1.00 0.00 H ATOM 5110 HN3 VAL B 259 -13.665 42.345 27.112 1.00 0.00 H ATOM 5111 HN2 VAL B 259 -13.333 41.367 25.763 1.00 0.00 H ATOM 5112 HN1 VAL B 259 -12.075 41.830 26.807 1.00 0.00 H ATOM 5113 N ALA B 260 -15.001 38.629 27.344 1.00 96.52 N ATOM 5114 CA ALA B 260 -16.345 38.056 27.253 1.00 96.45 C ATOM 5115 C ALA B 260 -17.070 38.091 28.600 1.00 96.38 C ATOM 5116 O ALA B 260 -16.525 37.646 29.616 1.00 96.29 O ATOM 5117 CB ALA B 260 -16.277 36.628 26.716 1.00 96.37 C ATOM 5118 HA ALA B 260 -16.920 38.668 26.558 1.00 0.00 H ATOM 5119 HB1 ALA B 260 -15.825 36.635 25.724 1.00 0.00 H ATOM 5120 HB2 ALA B 260 -15.674 36.017 27.387 1.00 0.00 H ATOM 5121 HB3 ALA B 260 -17.284 36.216 26.654 1.00 0.00 H ATOM 5122 H ALA B 260 -14.182 37.992 27.272 1.00 0.00 H ATOM 5123 N ASN B 261 -18.293 38.626 28.592 1.00 96.35 N ATOM 5124 CA ASN B 261 -19.122 38.739 29.803 1.00 96.38 C ATOM 5125 C ASN B 261 -19.898 37.459 30.133 1.00 96.30 C ATOM 5126 O ASN B 261 -19.913 37.011 31.284 1.00 96.22 O ATOM 5127 CB ASN B 261 -20.078 39.939 29.709 1.00 96.34 C ATOM 5128 HA ASN B 261 -18.426 38.901 30.626 1.00 0.00 H ATOM 5129 HB2 ASN B 261 -19.499 40.855 29.595 1.00 0.00 H ATOM 5130 HB3 ASN B 261 -20.734 39.813 28.847 1.00 0.00 H ATOM 5131 H ASN B 261 -18.676 38.978 27.692 1.00 0.00 H ATOM 5132 N GLY B 262 -20.537 36.879 29.117 1.00 96.24 N ATOM 5133 CA GLY B 262 -21.271 35.616 29.260 1.00 96.00 C ATOM 5134 C GLY B 262 -20.827 34.552 28.269 1.00 95.77 C ATOM 5135 O GLY B 262 -21.656 33.953 27.572 1.00 95.83 O ATOM 5136 HA3 GLY B 262 -22.332 35.812 29.107 1.00 0.00 H ATOM 5137 HA2 GLY B 262 -21.115 35.236 30.270 1.00 0.00 H ATOM 5138 H GLY B 262 -20.515 37.340 28.185 1.00 0.00 H ATOM 5139 N ILE B 263 -19.512 34.326 28.212 1.00 95.44 N ATOM 5140 CA ILE B 263 -18.898 33.350 27.302 1.00 95.02 C ATOM 5141 C ILE B 263 -17.477 32.964 27.747 1.00 94.62 C ATOM 5142 O ILE B 263 -16.885 32.009 27.223 1.00 94.62 O ATOM 5143 CB ILE B 263 -18.860 33.877 25.840 1.00 95.02 C ATOM 5144 HA ILE B 263 -19.525 32.459 27.339 1.00 0.00 H ATOM 5145 HB ILE B 263 -19.877 34.074 25.500 1.00 0.00 H ATOM 5146 H ILE B 263 -18.890 34.869 28.845 1.00 0.00 H ATOM 5147 N GLN B 264 -16.957 33.699 28.732 1.00 94.01 N ATOM 5148 CA GLN B 264 -15.557 33.612 29.172 1.00 93.37 C ATOM 5149 C GLN B 264 -15.034 32.173 29.367 1.00 92.86 C ATOM 5150 O GLN B 264 -13.851 31.898 29.135 1.00 92.80 O ATOM 5151 CB GLN B 264 -15.363 34.444 30.454 1.00 93.38 C ATOM 5152 CG GLN B 264 -13.974 35.044 30.627 1.00 93.12 C ATOM 5153 HA GLN B 264 -14.957 34.022 28.360 1.00 0.00 H ATOM 5154 HB2 GLN B 264 -16.085 35.260 30.440 1.00 0.00 H ATOM 5155 HB3 GLN B 264 -15.562 33.799 31.310 1.00 0.00 H ATOM 5156 HG2 GLN B 264 -13.235 34.243 30.659 1.00 0.00 H ATOM 5157 HG3 GLN B 264 -13.759 35.706 29.788 1.00 0.00 H ATOM 5158 H GLN B 264 -17.580 34.375 29.218 1.00 0.00 H ATOM 5159 N ASN B 265 -15.928 31.263 29.759 1.00 92.07 N ATOM 5160 CA ASN B 265 -15.538 29.920 30.195 1.00 91.13 C ATOM 5161 C ASN B 265 -16.013 28.765 29.318 1.00 90.33 C ATOM 5162 O ASN B 265 -15.892 27.596 29.699 1.00 90.32 O ATOM 5163 CB ASN B 265 -15.991 29.701 31.639 1.00 91.30 C ATOM 5164 CG ASN B 265 -15.141 30.467 32.634 1.00 91.67 C ATOM 5165 OD1 ASN B 265 -15.497 31.572 33.055 1.00 92.02 O ATOM 5166 ND2 ASN B 265 -13.995 29.893 32.999 1.00 91.84 N ATOM 5167 HA ASN B 265 -14.452 29.899 30.106 1.00 0.00 H ATOM 5168 HB2 ASN B 265 -17.026 30.030 31.735 1.00 0.00 H ATOM 5169 HB3 ASN B 265 -15.927 28.637 31.869 1.00 0.00 H ATOM 5170 HD22 ASN B 265 -13.736 28.960 32.618 1.00 0.00 H ATOM 5171 HD21 ASN B 265 -13.359 30.378 33.664 1.00 0.00 H ATOM 5172 H ASN B 265 -16.937 31.516 29.755 1.00 0.00 H ATOM 5173 N LYS B 266 -16.543 29.090 28.143 1.00 89.24 N ATOM 5174 CA LYS B 266 -17.013 28.066 27.211 1.00 88.16 C ATOM 5175 C LYS B 266 -15.817 27.373 26.550 1.00 87.25 C ATOM 5176 O LYS B 266 -14.662 27.682 26.869 1.00 87.27 O ATOM 5177 CB LYS B 266 -17.952 28.673 26.159 1.00 88.13 C ATOM 5178 CG LYS B 266 -19.136 29.474 26.715 1.00 88.10 C ATOM 5179 CD LYS B 266 -20.242 29.609 25.664 1.00 88.48 C ATOM 5180 CE LYS B 266 -21.139 30.827 25.889 1.00 89.08 C ATOM 5181 NZ LYS B 266 -21.810 30.830 27.221 1.00 89.47 N ATOM 5182 HA LYS B 266 -17.581 27.320 27.767 1.00 0.00 H ATOM 5183 HB2 LYS B 266 -17.364 29.338 25.527 1.00 0.00 H ATOM 5184 HB3 LYS B 266 -18.351 27.858 25.555 1.00 0.00 H ATOM 5185 HG2 LYS B 266 -19.535 28.962 27.590 1.00 0.00 H ATOM 5186 HG3 LYS B 266 -18.792 30.468 27.002 1.00 0.00 H ATOM 5187 HD2 LYS B 266 -19.778 29.696 24.681 1.00 0.00 H ATOM 5188 HD3 LYS B 266 -20.861 28.712 25.694 1.00 0.00 H ATOM 5189 HE2 LYS B 266 -21.906 30.839 25.115 1.00 0.00 H ATOM 5190 HE3 LYS B 266 -20.528 31.726 25.807 1.00 0.00 H ATOM 5191 HZ1 LYS B 266 -22.405 29.982 27.310 1.00 0.00 H ATOM 5192 HZ2 LYS B 266 -21.089 30.829 27.971 1.00 0.00 H ATOM 5193 HZ3 LYS B 266 -22.401 31.681 27.308 1.00 0.00 H ATOM 5194 H LYS B 266 -16.625 30.093 27.881 1.00 0.00 H ATOM 5195 N GLU B 267 -16.097 26.433 25.645 1.00 86.01 N ATOM 5196 CA GLU B 267 -15.067 25.775 24.834 1.00 84.72 C ATOM 5197 C GLU B 267 -14.348 26.813 23.949 1.00 83.81 C ATOM 5198 O GLU B 267 -14.494 28.020 24.167 1.00 83.80 O ATOM 5199 CB GLU B 267 -15.717 24.674 23.985 1.00 84.82 C ATOM 5200 CG GLU B 267 -14.764 23.569 23.522 1.00 84.85 C ATOM 5201 CD GLU B 267 -15.449 22.499 22.688 1.00 84.62 C ATOM 5202 OE1 GLU B 267 -14.797 21.971 21.760 1.00 84.28 O ATOM 5203 OE2 GLU B 267 -16.631 22.182 22.955 1.00 84.33 O ATOM 5204 HA GLU B 267 -14.321 25.317 25.484 1.00 0.00 H ATOM 5205 HB2 GLU B 267 -16.508 24.213 24.576 1.00 0.00 H ATOM 5206 HB3 GLU B 267 -16.151 25.140 23.100 1.00 0.00 H ATOM 5207 HG2 GLU B 267 -13.973 24.021 22.924 1.00 0.00 H ATOM 5208 HG3 GLU B 267 -14.327 23.096 24.402 1.00 0.00 H ATOM 5209 H GLU B 267 -17.090 26.155 25.509 1.00 0.00 H ATOM 5210 N ALA B 268 -13.576 26.360 22.959 1.00 82.51 N ATOM 5211 CA ALA B 268 -12.883 27.292 22.050 1.00 81.22 C ATOM 5212 C ALA B 268 -13.572 27.454 20.682 1.00 80.08 C ATOM 5213 O ALA B 268 -13.490 28.520 20.058 1.00 79.83 O ATOM 5214 CB ALA B 268 -11.415 26.884 21.875 1.00 81.49 C ATOM 5215 HA ALA B 268 -12.932 28.271 22.527 1.00 0.00 H ATOM 5216 HB1 ALA B 268 -10.917 26.899 22.844 1.00 0.00 H ATOM 5217 HB2 ALA B 268 -11.366 25.879 21.456 1.00 0.00 H ATOM 5218 HB3 ALA B 268 -10.922 27.585 21.201 1.00 0.00 H ATOM 5219 H ALA B 268 -13.461 25.335 22.827 1.00 0.00 H ATOM 5220 N GLU B 269 -14.235 26.385 20.233 1.00 78.47 N ATOM 5221 CA GLU B 269 -14.958 26.355 18.962 1.00 76.76 C ATOM 5222 C GLU B 269 -16.258 27.135 19.049 1.00 75.36 C ATOM 5223 O GLU B 269 -16.627 27.842 18.112 1.00 75.15 O ATOM 5224 CB GLU B 269 -15.266 24.908 18.550 1.00 77.02 C ATOM 5225 CG GLU B 269 -14.270 24.280 17.571 1.00 78.07 C ATOM 5226 CD GLU B 269 -13.145 23.483 18.248 1.00 79.25 C ATOM 5227 OE1 GLU B 269 -13.003 22.276 17.937 1.00 79.51 O ATOM 5228 OE2 GLU B 269 -12.400 24.057 19.079 1.00 79.14 O ATOM 5229 HA GLU B 269 -14.318 26.820 18.212 1.00 0.00 H ATOM 5230 HB2 GLU B 269 -15.282 24.297 19.452 1.00 0.00 H ATOM 5231 HB3 GLU B 269 -16.251 24.893 18.084 1.00 0.00 H ATOM 5232 HG2 GLU B 269 -14.817 23.608 16.910 1.00 0.00 H ATOM 5233 HG3 GLU B 269 -13.818 25.078 16.982 1.00 0.00 H ATOM 5234 H GLU B 269 -14.237 25.526 20.820 1.00 0.00 H ATOM 5235 N VAL B 270 -16.951 26.987 20.176 1.00 73.74 N ATOM 5236 CA VAL B 270 -18.243 27.630 20.401 1.00 72.02 C ATOM 5237 C VAL B 270 -18.084 29.147 20.528 1.00 70.84 C ATOM 5238 O VAL B 270 -19.004 29.895 20.213 1.00 70.66 O ATOM 5239 CB VAL B 270 -18.980 27.013 21.623 1.00 72.13 C ATOM 5240 CG1 VAL B 270 -20.015 27.970 22.205 1.00 72.32 C ATOM 5241 CG2 VAL B 270 -19.635 25.687 21.244 1.00 71.78 C ATOM 5242 HA VAL B 270 -18.870 27.442 19.529 1.00 0.00 H ATOM 5243 HB VAL B 270 -18.232 26.829 22.394 1.00 0.00 H ATOM 5244 HG11 VAL B 270 -19.520 28.885 22.530 1.00 0.00 H ATOM 5245 HG12 VAL B 270 -20.757 28.208 21.443 1.00 0.00 H ATOM 5246 HG13 VAL B 270 -20.506 27.498 23.056 1.00 0.00 H ATOM 5247 HG21 VAL B 270 -20.356 25.855 20.444 1.00 0.00 H ATOM 5248 HG22 VAL B 270 -18.870 24.989 20.904 1.00 0.00 H ATOM 5249 HG23 VAL B 270 -20.145 25.273 22.114 1.00 0.00 H ATOM 5250 H VAL B 270 -16.555 26.388 20.928 1.00 0.00 H ATOM 5251 N ARG B 271 -16.910 29.594 20.967 1.00 69.47 N ATOM 5252 CA ARG B 271 -16.596 31.030 21.000 1.00 68.23 C ATOM 5253 C ARG B 271 -16.651 31.642 19.588 1.00 67.20 C ATOM 5254 O ARG B 271 -17.371 32.625 19.351 1.00 67.30 O ATOM 5255 CB ARG B 271 -15.230 31.314 21.675 1.00 68.32 C ATOM 5256 CG ARG B 271 -15.133 30.871 23.150 1.00 68.40 C ATOM 5257 CD ARG B 271 -14.194 31.738 24.017 1.00 68.01 C ATOM 5258 NE ARG B 271 -12.762 31.538 23.769 1.00 66.86 N ATOM 5259 CZ ARG B 271 -12.048 30.498 24.200 1.00 67.44 C ATOM 5260 NH1 ARG B 271 -12.621 29.518 24.893 1.00 68.28 N ATOM 5261 NH2 ARG B 271 -10.754 30.425 23.926 1.00 66.81 N ATOM 5262 HA ARG B 271 -17.361 31.510 21.610 1.00 0.00 H ATOM 5263 HB2 ARG B 271 -14.458 30.790 21.112 1.00 0.00 H ATOM 5264 HB3 ARG B 271 -15.046 32.387 21.630 1.00 0.00 H ATOM 5265 HG2 ARG B 271 -16.132 30.911 23.584 1.00 0.00 H ATOM 5266 HG3 ARG B 271 -14.768 29.844 23.174 1.00 0.00 H ATOM 5267 HD2 ARG B 271 -14.392 31.508 25.064 1.00 0.00 H ATOM 5268 HD3 ARG B 271 -14.428 32.785 23.826 1.00 0.00 H ATOM 5269 HE ARG B 271 -12.265 32.264 23.214 1.00 0.00 H ATOM 5270 HH12 ARG B 271 -12.052 28.713 25.223 1.00 0.00 H ATOM 5271 HH11 ARG B 271 -13.638 29.557 25.105 1.00 0.00 H ATOM 5272 HH22 ARG B 271 -10.196 29.614 24.262 1.00 0.00 H ATOM 5273 HH21 ARG B 271 -10.296 31.179 23.375 1.00 0.00 H ATOM 5274 H ARG B 271 -16.197 28.911 21.295 1.00 0.00 H ATOM 5275 N ILE B 272 -15.891 31.051 18.665 1.00 65.56 N ATOM 5276 CA ILE B 272 -15.873 31.468 17.261 1.00 63.84 C ATOM 5277 C ILE B 272 -17.301 31.476 16.711 1.00 62.35 C ATOM 5278 O ILE B 272 -17.777 32.497 16.219 1.00 62.15 O ATOM 5279 CB ILE B 272 -14.934 30.556 16.425 1.00 64.05 C ATOM 5280 CG1 ILE B 272 -13.493 30.704 16.934 1.00 64.64 C ATOM 5281 CG2 ILE B 272 -15.017 30.887 14.930 1.00 63.79 C ATOM 5282 CD1 ILE B 272 -12.635 29.474 16.750 1.00 65.22 C ATOM 5283 HA ILE B 272 -15.475 32.480 17.190 1.00 0.00 H ATOM 5284 HB ILE B 272 -15.256 29.522 16.546 1.00 0.00 H ATOM 5285 HG12 ILE B 272 -13.025 31.529 16.398 1.00 0.00 H ATOM 5286 HG13 ILE B 272 -13.530 30.938 17.998 1.00 0.00 H ATOM 5287 HD11 ILE B 272 -13.079 28.638 17.291 1.00 0.00 H ATOM 5288 HD12 ILE B 272 -12.574 29.230 15.689 1.00 0.00 H ATOM 5289 HD13 ILE B 272 -11.635 29.669 17.137 1.00 0.00 H ATOM 5290 HG21 ILE B 272 -16.040 30.741 14.583 1.00 0.00 H ATOM 5291 HG22 ILE B 272 -14.723 31.925 14.772 1.00 0.00 H ATOM 5292 HG23 ILE B 272 -14.347 30.230 14.376 1.00 0.00 H ATOM 5293 H ILE B 272 -15.284 30.258 18.955 1.00 0.00 H ATOM 5294 N PHE B 273 -17.981 30.342 16.841 1.00 60.38 N ATOM 5295 CA PHE B 273 -19.366 30.196 16.436 1.00 58.76 C ATOM 5296 C PHE B 273 -20.220 31.405 16.840 1.00 58.30 C ATOM 5297 O PHE B 273 -20.852 32.046 15.995 1.00 58.32 O ATOM 5298 CB PHE B 273 -19.916 28.935 17.062 1.00 58.09 C ATOM 5299 CG PHE B 273 -21.210 28.497 16.498 1.00 57.48 C ATOM 5300 CD1 PHE B 273 -21.261 27.847 15.270 1.00 57.00 C ATOM 5301 CD2 PHE B 273 -22.389 28.702 17.201 1.00 57.09 C ATOM 5302 CE1 PHE B 273 -22.479 27.418 14.743 1.00 56.82 C ATOM 5303 CE2 PHE B 273 -23.615 28.274 16.687 1.00 56.94 C ATOM 5304 CZ PHE B 273 -23.661 27.632 15.458 1.00 57.05 C ATOM 5305 HA PHE B 273 -19.405 30.134 15.348 1.00 0.00 H ATOM 5306 HB2 PHE B 273 -19.190 28.135 16.916 1.00 0.00 H ATOM 5307 HB3 PHE B 273 -20.050 29.112 18.129 1.00 0.00 H ATOM 5308 HD2 PHE B 273 -22.358 29.204 18.168 1.00 0.00 H ATOM 5309 HE2 PHE B 273 -24.533 28.444 17.250 1.00 0.00 H ATOM 5310 HZ PHE B 273 -24.615 27.296 15.052 1.00 0.00 H ATOM 5311 HE1 PHE B 273 -22.509 26.917 13.776 1.00 0.00 H ATOM 5312 HD1 PHE B 273 -20.340 27.671 14.714 1.00 0.00 H ATOM 5313 H PHE B 273 -17.497 29.519 17.253 1.00 0.00 H ATOM 5314 N HIS B 274 -20.215 31.718 18.131 1.00 57.43 N ATOM 5315 CA HIS B 274 -20.960 32.841 18.673 1.00 56.40 C ATOM 5316 C HIS B 274 -20.387 34.153 18.136 1.00 55.34 C ATOM 5317 O HIS B 274 -21.137 35.027 17.680 1.00 55.41 O ATOM 5318 CB HIS B 274 -20.935 32.784 20.213 1.00 56.94 C ATOM 5319 CG HIS B 274 -21.550 33.976 20.887 1.00 58.02 C ATOM 5320 ND1 HIS B 274 -22.915 34.140 21.018 1.00 59.20 N ATOM 5321 CD2 HIS B 274 -20.983 35.057 21.478 1.00 58.48 C ATOM 5322 CE1 HIS B 274 -23.161 35.272 21.654 1.00 60.44 C ATOM 5323 NE2 HIS B 274 -22.006 35.847 21.945 1.00 59.98 N ATOM 5324 HA HIS B 274 -22.002 32.786 18.356 1.00 0.00 H ATOM 5325 HB2 HIS B 274 -21.479 31.894 20.531 1.00 0.00 H ATOM 5326 HB3 HIS B 274 -19.896 32.708 20.535 1.00 0.00 H ATOM 5327 HD2 HIS B 274 -19.916 35.261 21.566 1.00 0.00 H ATOM 5328 HE1 HIS B 274 -24.148 35.665 21.897 1.00 0.00 H ATOM 5329 H HIS B 274 -19.653 31.133 18.782 1.00 0.00 H ATOM 5330 N CYS B 275 -19.061 34.276 18.169 1.00 53.75 N ATOM 5331 CA CYS B 275 -18.382 35.453 17.631 1.00 52.30 C ATOM 5332 C CYS B 275 -18.811 35.777 16.204 1.00 51.07 C ATOM 5333 O CYS B 275 -19.057 36.933 15.876 1.00 50.53 O ATOM 5334 CB CYS B 275 -16.869 35.260 17.684 1.00 52.47 C ATOM 5335 SG CYS B 275 -16.050 36.292 18.902 1.00 53.00 S ATOM 5336 HA CYS B 275 -18.670 36.298 18.257 1.00 0.00 H ATOM 5337 HB2 CYS B 275 -16.458 35.494 16.702 1.00 0.00 H ATOM 5338 HB3 CYS B 275 -16.663 34.217 17.923 1.00 0.00 H ATOM 5339 HG CYS B 275 -14.692 36.046 18.873 1.00 0.00 H ATOM 5340 H CYS B 275 -18.493 33.513 18.589 1.00 0.00 H ATOM 5341 N CYS B 276 -18.898 34.739 15.372 1.00 49.94 N ATOM 5342 CA CYS B 276 -19.358 34.859 13.991 1.00 49.12 C ATOM 5343 C CYS B 276 -20.731 35.530 13.901 1.00 48.44 C ATOM 5344 O CYS B 276 -20.972 36.345 13.001 1.00 48.30 O ATOM 5345 CB CYS B 276 -19.416 33.485 13.315 1.00 49.31 C ATOM 5346 SG CYS B 276 -17.815 32.710 12.901 1.00 49.17 S ATOM 5347 HA CYS B 276 -18.636 35.489 13.472 1.00 0.00 H ATOM 5348 HB2 CYS B 276 -19.980 33.595 12.389 1.00 0.00 H ATOM 5349 HB3 CYS B 276 -19.948 32.809 13.984 1.00 0.00 H ATOM 5350 HG CYS B 276 -17.080 32.532 14.055 1.00 0.00 H ATOM 5351 H CYS B 276 -18.625 33.799 15.723 1.00 0.00 H ATOM 5352 N GLN B 277 -21.611 35.199 14.846 1.00 47.10 N ATOM 5353 CA GLN B 277 -22.978 35.684 14.823 1.00 46.24 C ATOM 5354 C GLN B 277 -23.088 37.190 15.100 1.00 46.13 C ATOM 5355 O GLN B 277 -23.869 37.888 14.452 1.00 45.99 O ATOM 5356 CB GLN B 277 -23.850 34.856 15.761 1.00 46.11 C ATOM 5357 CG GLN B 277 -23.966 33.405 15.326 1.00 45.37 C ATOM 5358 CD GLN B 277 -24.892 32.569 16.200 1.00 45.90 C ATOM 5359 OE1 GLN B 277 -25.997 32.988 16.551 1.00 45.94 O ATOM 5360 NE2 GLN B 277 -24.451 31.365 16.534 1.00 45.54 N ATOM 5361 HA GLN B 277 -23.352 35.554 13.807 1.00 0.00 H ATOM 5362 HB2 GLN B 277 -23.415 34.887 16.760 1.00 0.00 H ATOM 5363 HB3 GLN B 277 -24.848 35.293 15.787 1.00 0.00 H ATOM 5364 HG2 GLN B 277 -24.345 33.382 14.304 1.00 0.00 H ATOM 5365 HG3 GLN B 277 -22.972 32.958 15.353 1.00 0.00 H ATOM 5366 HE22 GLN B 277 -23.512 31.049 16.218 1.00 0.00 H ATOM 5367 HE21 GLN B 277 -25.044 30.736 17.113 1.00 0.00 H ATOM 5368 H GLN B 277 -21.309 34.575 15.622 1.00 0.00 H ATOM 5369 N CYS B 278 -22.287 37.687 16.038 1.00 45.77 N ATOM 5370 CA CYS B 278 -22.204 39.120 16.309 1.00 45.71 C ATOM 5371 C CYS B 278 -21.964 39.900 15.045 1.00 45.22 C ATOM 5372 O CYS B 278 -22.474 41.019 14.890 1.00 45.20 O ATOM 5373 CB CYS B 278 -21.033 39.433 17.238 1.00 45.62 C ATOM 5374 SG CYS B 278 -21.102 38.599 18.797 1.00 48.17 S ATOM 5375 HA CYS B 278 -23.153 39.401 16.765 1.00 0.00 H ATOM 5376 HB2 CYS B 278 -21.022 40.507 17.425 1.00 0.00 H ATOM 5377 HB3 CYS B 278 -20.110 39.143 16.735 1.00 0.00 H ATOM 5378 HG CYS B 278 -21.101 37.235 18.588 1.00 0.00 H ATOM 5379 H CYS B 278 -21.701 37.034 16.597 1.00 0.00 H ATOM 5380 N THR B 279 -21.147 39.316 14.166 1.00 44.56 N ATOM 5381 CA THR B 279 -20.682 40.007 12.976 1.00 43.72 C ATOM 5382 C THR B 279 -21.770 39.991 11.919 1.00 43.40 C ATOM 5383 O THR B 279 -22.024 41.009 11.278 1.00 43.46 O ATOM 5384 CB THR B 279 -19.342 39.428 12.440 1.00 43.76 C ATOM 5385 OG1 THR B 279 -18.339 39.517 13.459 1.00 41.99 O ATOM 5386 CG2 THR B 279 -18.866 40.206 11.199 1.00 43.14 C ATOM 5387 HA THR B 279 -20.470 41.042 13.244 1.00 0.00 H ATOM 5388 HB THR B 279 -19.505 38.387 12.163 1.00 0.00 H ATOM 5389 HG1 THR B 279 -17.487 39.148 13.115 1.00 0.00 H ATOM 5390 HG23 THR B 279 -19.625 40.143 10.419 1.00 0.00 H ATOM 5391 HG21 THR B 279 -18.704 41.250 11.466 1.00 0.00 H ATOM 5392 HG22 THR B 279 -17.933 39.774 10.836 1.00 0.00 H ATOM 5393 H THR B 279 -20.835 38.339 14.338 1.00 0.00 H ATOM 5394 N SER B 280 -22.429 38.849 11.764 1.00 43.03 N ATOM 5395 CA SER B 280 -23.475 38.714 10.751 1.00 42.92 C ATOM 5396 C SER B 280 -24.751 39.472 11.132 1.00 42.87 C ATOM 5397 O SER B 280 -25.389 40.071 10.265 1.00 42.95 O ATOM 5398 CB SER B 280 -23.757 37.247 10.432 1.00 42.72 C ATOM 5399 OG SER B 280 -24.508 36.638 11.456 1.00 42.80 O ATOM 5400 HA SER B 280 -23.099 39.179 9.839 1.00 0.00 H ATOM 5401 HB2 SER B 280 -22.810 36.718 10.323 1.00 0.00 H ATOM 5402 HB3 SER B 280 -24.315 37.187 9.498 1.00 0.00 H ATOM 5403 HG SER B 280 -24.003 36.685 12.306 1.00 0.00 H ATOM 5404 H SER B 280 -22.198 38.038 12.372 1.00 0.00 H ATOM 5405 N VAL B 281 -25.101 39.458 12.422 1.00 42.81 N ATOM 5406 CA VAL B 281 -26.194 40.286 12.954 1.00 42.87 C ATOM 5407 C VAL B 281 -25.917 41.769 12.712 1.00 43.00 C ATOM 5408 O VAL B 281 -26.804 42.512 12.297 1.00 43.31 O ATOM 5409 CB VAL B 281 -26.445 40.032 14.458 1.00 42.76 C ATOM 5410 CG1 VAL B 281 -27.308 41.134 15.052 1.00 43.18 C ATOM 5411 CG2 VAL B 281 -27.112 38.676 14.665 1.00 43.02 C ATOM 5412 HA VAL B 281 -27.098 39.997 12.417 1.00 0.00 H ATOM 5413 HB VAL B 281 -25.482 40.032 14.968 1.00 0.00 H ATOM 5414 HG11 VAL B 281 -26.802 42.092 14.935 1.00 0.00 H ATOM 5415 HG12 VAL B 281 -28.267 41.162 14.534 1.00 0.00 H ATOM 5416 HG13 VAL B 281 -27.472 40.935 16.111 1.00 0.00 H ATOM 5417 HG21 VAL B 281 -28.066 38.657 14.138 1.00 0.00 H ATOM 5418 HG22 VAL B 281 -26.464 37.891 14.275 1.00 0.00 H ATOM 5419 HG23 VAL B 281 -27.281 38.514 15.730 1.00 0.00 H ATOM 5420 H VAL B 281 -24.580 38.838 13.075 1.00 0.00 H ATOM 5421 N GLU B 282 -24.683 42.193 12.953 1.00 43.00 N ATOM 5422 CA GLU B 282 -24.271 43.548 12.620 1.00 43.61 C ATOM 5423 C GLU B 282 -24.294 43.822 11.107 1.00 43.20 C ATOM 5424 O GLU B 282 -24.452 44.967 10.671 1.00 43.72 O ATOM 5425 CB GLU B 282 -22.881 43.850 13.196 1.00 44.15 C ATOM 5426 CG GLU B 282 -22.876 44.229 14.688 1.00 46.57 C ATOM 5427 CD GLU B 282 -21.548 43.902 15.385 1.00 50.77 C ATOM 5428 OE1 GLU B 282 -20.460 44.099 14.770 1.00 52.24 O ATOM 5429 OE2 GLU B 282 -21.595 43.440 16.554 1.00 51.32 O ATOM 5430 HA GLU B 282 -25.001 44.217 13.076 1.00 0.00 H ATOM 5431 HB2 GLU B 282 -22.259 42.964 13.068 1.00 0.00 H ATOM 5432 HB3 GLU B 282 -22.452 44.678 12.633 1.00 0.00 H ATOM 5433 HG2 GLU B 282 -23.060 45.300 14.775 1.00 0.00 H ATOM 5434 HG3 GLU B 282 -23.675 43.682 15.188 1.00 0.00 H ATOM 5435 H GLU B 282 -23.997 41.544 13.388 1.00 0.00 H ATOM 5436 N THR B 283 -24.132 42.778 10.304 1.00 42.49 N ATOM 5437 CA THR B 283 -24.113 42.954 8.866 1.00 41.21 C ATOM 5438 C THR B 283 -25.534 43.038 8.312 1.00 40.90 C ATOM 5439 O THR B 283 -25.809 43.881 7.458 1.00 40.54 O ATOM 5440 CB THR B 283 -23.261 41.875 8.180 1.00 41.32 C ATOM 5441 OG1 THR B 283 -21.892 42.017 8.596 1.00 39.65 O ATOM 5442 CG2 THR B 283 -23.332 42.025 6.667 1.00 41.25 C ATOM 5443 HA THR B 283 -23.632 43.905 8.639 1.00 0.00 H ATOM 5444 HB THR B 283 -23.644 40.894 8.462 1.00 0.00 H ATOM 5445 HG1 THR B 283 -21.834 41.911 9.579 1.00 0.00 H ATOM 5446 HG23 THR B 283 -24.367 41.919 6.341 1.00 0.00 H ATOM 5447 HG21 THR B 283 -22.959 43.009 6.383 1.00 0.00 H ATOM 5448 HG22 THR B 283 -22.721 41.254 6.198 1.00 0.00 H ATOM 5449 H THR B 283 -24.018 41.827 10.710 1.00 0.00 H ATOM 5450 N VAL B 284 -26.434 42.191 8.823 1.00 40.33 N ATOM 5451 CA VAL B 284 -27.844 42.215 8.418 1.00 39.92 C ATOM 5452 C VAL B 284 -28.413 43.608 8.621 1.00 40.30 C ATOM 5453 O VAL B 284 -29.187 44.095 7.799 1.00 40.23 O ATOM 5454 CB VAL B 284 -28.716 41.198 9.206 1.00 39.78 C ATOM 5455 CG1 VAL B 284 -30.198 41.361 8.858 1.00 37.94 C ATOM 5456 CG2 VAL B 284 -28.265 39.767 8.937 1.00 39.19 C ATOM 5457 HA VAL B 284 -27.873 41.932 7.366 1.00 0.00 H ATOM 5458 HB VAL B 284 -28.586 41.406 10.268 1.00 0.00 H ATOM 5459 HG11 VAL B 284 -30.521 42.370 9.113 1.00 0.00 H ATOM 5460 HG12 VAL B 284 -30.340 41.191 7.791 1.00 0.00 H ATOM 5461 HG13 VAL B 284 -30.784 40.637 9.424 1.00 0.00 H ATOM 5462 HG21 VAL B 284 -28.355 39.553 7.872 1.00 0.00 H ATOM 5463 HG22 VAL B 284 -27.226 39.651 9.246 1.00 0.00 H ATOM 5464 HG23 VAL B 284 -28.893 39.077 9.501 1.00 0.00 H ATOM 5465 H VAL B 284 -26.125 41.493 9.530 1.00 0.00 H ATOM 5466 N THR B 285 -28.025 44.232 9.728 1.00 40.76 N ATOM 5467 CA THR B 285 -28.470 45.578 10.055 1.00 41.42 C ATOM 5468 C THR B 285 -27.964 46.517 8.988 1.00 41.79 C ATOM 5469 O THR B 285 -28.730 47.334 8.471 1.00 42.09 O ATOM 5470 CB THR B 285 -27.936 46.080 11.424 1.00 41.26 C ATOM 5471 OG1 THR B 285 -28.134 45.078 12.419 1.00 41.88 O ATOM 5472 CG2 THR B 285 -28.663 47.342 11.851 1.00 41.02 C ATOM 5473 HA THR B 285 -29.558 45.555 10.111 1.00 0.00 H ATOM 5474 HB THR B 285 -26.873 46.295 11.316 1.00 0.00 H ATOM 5475 HG1 THR B 285 -27.647 44.256 12.159 1.00 0.00 H ATOM 5476 HG23 THR B 285 -28.518 48.116 11.097 1.00 0.00 H ATOM 5477 HG21 THR B 285 -29.727 47.129 11.956 1.00 0.00 H ATOM 5478 HG22 THR B 285 -28.264 47.684 12.806 1.00 0.00 H ATOM 5479 H THR B 285 -27.382 43.742 10.382 1.00 0.00 H ATOM 5480 N GLU B 286 -26.676 46.402 8.667 1.00 41.85 N ATOM 5481 CA GLU B 286 -26.076 47.264 7.669 1.00 42.51 C ATOM 5482 C GLU B 286 -26.700 46.976 6.314 1.00 42.40 C ATOM 5483 O GLU B 286 -26.836 47.873 5.490 1.00 42.74 O ATOM 5484 CB GLU B 286 -24.570 47.062 7.600 1.00 42.36 C ATOM 5485 CG GLU B 286 -23.779 47.621 8.763 1.00 42.58 C ATOM 5486 CD GLU B 286 -22.276 47.571 8.499 1.00 44.26 C ATOM 5487 OE1 GLU B 286 -21.600 48.612 8.721 1.00 46.31 O ATOM 5488 OE2 GLU B 286 -21.768 46.499 8.050 1.00 46.52 O ATOM 5489 HA GLU B 286 -26.263 48.301 7.950 1.00 0.00 H ATOM 5490 HB2 GLU B 286 -24.378 45.990 7.548 1.00 0.00 H ATOM 5491 HB3 GLU B 286 -24.209 47.539 6.689 1.00 0.00 H ATOM 5492 HG2 GLU B 286 -24.075 48.657 8.927 1.00 0.00 H ATOM 5493 HG3 GLU B 286 -24.001 47.036 9.655 1.00 0.00 H ATOM 5494 H GLU B 286 -26.093 45.683 9.140 1.00 0.00 H ATOM 5495 N LEU B 287 -27.092 45.726 6.093 1.00 42.36 N ATOM 5496 CA LEU B 287 -27.716 45.343 4.842 1.00 42.27 C ATOM 5497 C LEU B 287 -29.117 45.886 4.722 1.00 42.78 C ATOM 5498 O LEU B 287 -29.567 46.208 3.628 1.00 43.11 O ATOM 5499 CB LEU B 287 -27.729 43.833 4.674 1.00 41.98 C ATOM 5500 CG LEU B 287 -26.574 43.314 3.820 1.00 41.80 C ATOM 5501 CD1 LEU B 287 -26.261 41.836 4.085 1.00 41.93 C ATOM 5502 CD2 LEU B 287 -26.887 43.552 2.359 1.00 41.43 C ATOM 5503 HA LEU B 287 -27.115 45.781 4.045 1.00 0.00 H ATOM 5504 HB2 LEU B 287 -27.665 43.374 5.660 1.00 0.00 H ATOM 5505 HB3 LEU B 287 -28.667 43.545 4.201 1.00 0.00 H ATOM 5506 HG LEU B 287 -25.676 43.866 4.097 1.00 0.00 H ATOM 5507 HD21 LEU B 287 -27.803 43.024 2.094 1.00 0.00 H ATOM 5508 HD22 LEU B 287 -27.018 44.620 2.186 1.00 0.00 H ATOM 5509 HD23 LEU B 287 -26.064 43.182 1.747 1.00 0.00 H ATOM 5510 HD11 LEU B 287 -25.988 41.706 5.132 1.00 0.00 H ATOM 5511 HD12 LEU B 287 -27.141 41.234 3.860 1.00 0.00 H ATOM 5512 HD13 LEU B 287 -25.432 41.522 3.450 1.00 0.00 H ATOM 5513 H LEU B 287 -26.948 45.008 6.832 1.00 0.00 H ATOM 5514 N THR B 288 -29.813 45.979 5.842 1.00 43.32 N ATOM 5515 CA THR B 288 -31.181 46.459 5.834 1.00 43.96 C ATOM 5516 C THR B 288 -31.201 47.950 5.543 1.00 44.61 C ATOM 5517 O THR B 288 -31.986 48.407 4.722 1.00 44.72 O ATOM 5518 CB THR B 288 -31.867 46.151 7.159 1.00 44.08 C ATOM 5519 OG1 THR B 288 -31.681 44.761 7.465 1.00 43.98 O ATOM 5520 CG2 THR B 288 -33.345 46.477 7.097 1.00 43.11 C ATOM 5521 HA THR B 288 -31.733 45.944 5.048 1.00 0.00 H ATOM 5522 HB THR B 288 -31.424 46.768 7.940 1.00 0.00 H ATOM 5523 HG1 THR B 288 -30.713 44.566 7.535 1.00 0.00 H ATOM 5524 HG23 THR B 288 -33.473 47.534 6.864 1.00 0.00 H ATOM 5525 HG21 THR B 288 -33.817 45.873 6.322 1.00 0.00 H ATOM 5526 HG22 THR B 288 -33.805 46.257 8.061 1.00 0.00 H ATOM 5527 H THR B 288 -29.372 45.704 6.743 1.00 0.00 H ATOM 5528 N GLU B 289 -30.317 48.699 6.197 1.00 45.62 N ATOM 5529 CA GLU B 289 -30.192 50.141 5.956 1.00 46.96 C ATOM 5530 C GLU B 289 -29.874 50.425 4.487 1.00 47.24 C ATOM 5531 O GLU B 289 -30.486 51.288 3.852 1.00 47.37 O ATOM 5532 CB GLU B 289 -29.124 50.770 6.866 1.00 47.05 C ATOM 5533 CG GLU B 289 -29.509 50.847 8.352 1.00 49.52 C ATOM 5534 CD GLU B 289 -30.958 51.278 8.569 1.00 53.04 C ATOM 5535 OE1 GLU B 289 -31.248 52.489 8.458 1.00 54.77 O ATOM 5536 OE2 GLU B 289 -31.817 50.405 8.842 1.00 54.68 O ATOM 5537 HA GLU B 289 -31.152 50.597 6.196 1.00 0.00 H ATOM 5538 HB2 GLU B 289 -28.214 50.177 6.781 1.00 0.00 H ATOM 5539 HB3 GLU B 289 -28.930 51.783 6.512 1.00 0.00 H ATOM 5540 HG2 GLU B 289 -29.368 49.863 8.800 1.00 0.00 H ATOM 5541 HG3 GLU B 289 -28.854 51.566 8.844 1.00 0.00 H ATOM 5542 H GLU B 289 -29.696 48.249 6.900 1.00 0.00 H ATOM 5543 N PHE B 290 -28.915 49.672 3.962 1.00 47.59 N ATOM 5544 CA PHE B 290 -28.539 49.728 2.564 1.00 47.71 C ATOM 5545 C PHE B 290 -29.722 49.416 1.646 1.00 47.87 C ATOM 5546 O PHE B 290 -29.904 50.099 0.645 1.00 47.82 O ATOM 5547 CB PHE B 290 -27.387 48.759 2.324 1.00 47.75 C ATOM 5548 CG PHE B 290 -27.111 48.485 0.884 1.00 48.16 C ATOM 5549 CD1 PHE B 290 -26.533 49.460 0.074 1.00 48.09 C ATOM 5550 CD2 PHE B 290 -27.404 47.234 0.336 1.00 48.18 C ATOM 5551 CE1 PHE B 290 -26.260 49.200 -1.269 1.00 48.46 C ATOM 5552 CE2 PHE B 290 -27.137 46.963 -1.003 1.00 48.38 C ATOM 5553 CZ PHE B 290 -26.559 47.946 -1.809 1.00 48.24 C ATOM 5554 HA PHE B 290 -28.219 50.742 2.325 1.00 0.00 H ATOM 5555 HB2 PHE B 290 -26.487 49.180 2.771 1.00 0.00 H ATOM 5556 HB3 PHE B 290 -27.626 47.815 2.813 1.00 0.00 H ATOM 5557 HD2 PHE B 290 -27.847 46.461 0.964 1.00 0.00 H ATOM 5558 HE2 PHE B 290 -27.379 45.986 -1.421 1.00 0.00 H ATOM 5559 HZ PHE B 290 -26.342 47.736 -2.856 1.00 0.00 H ATOM 5560 HE1 PHE B 290 -25.815 49.973 -1.896 1.00 0.00 H ATOM 5561 HD1 PHE B 290 -26.292 50.436 0.494 1.00 0.00 H ATOM 5562 H PHE B 290 -28.409 49.010 4.584 1.00 0.00 H ATOM 5563 N ALA B 291 -30.517 48.398 1.994 1.00 47.91 N ATOM 5564 CA ALA B 291 -31.731 48.042 1.246 1.00 48.01 C ATOM 5565 C ALA B 291 -32.782 49.153 1.262 1.00 48.62 C ATOM 5566 O ALA B 291 -33.449 49.391 0.249 1.00 49.00 O ATOM 5567 CB ALA B 291 -32.331 46.755 1.762 1.00 47.51 C ATOM 5568 HA ALA B 291 -31.420 47.902 0.211 1.00 0.00 H ATOM 5569 HB1 ALA B 291 -31.606 45.949 1.654 1.00 0.00 H ATOM 5570 HB2 ALA B 291 -32.591 46.873 2.814 1.00 0.00 H ATOM 5571 HB3 ALA B 291 -33.227 46.518 1.189 1.00 0.00 H ATOM 5572 H ALA B 291 -30.265 47.834 2.830 1.00 0.00 H ATOM 5573 N LYS B 292 -32.940 49.832 2.399 1.00 48.90 N ATOM 5574 CA LYS B 292 -33.853 50.976 2.465 1.00 49.22 C ATOM 5575 C LYS B 292 -33.419 52.080 1.497 1.00 49.17 C ATOM 5576 O LYS B 292 -34.250 52.842 1.012 1.00 49.57 O ATOM 5577 CB LYS B 292 -33.966 51.529 3.892 1.00 49.31 C ATOM 5578 CG LYS B 292 -34.494 50.520 4.931 1.00 49.65 C ATOM 5579 CD LYS B 292 -34.938 51.195 6.222 1.00 49.64 C ATOM 5580 CE LYS B 292 -33.831 52.040 6.841 1.00 49.83 C ATOM 5581 NZ LYS B 292 -34.332 52.970 7.894 1.00 49.42 N ATOM 5582 HA LYS B 292 -34.839 50.620 2.166 1.00 0.00 H ATOM 5583 HB2 LYS B 292 -32.976 51.857 4.209 1.00 0.00 H ATOM 5584 HB3 LYS B 292 -34.642 52.384 3.873 1.00 0.00 H ATOM 5585 HG2 LYS B 292 -35.344 49.989 4.503 1.00 0.00 H ATOM 5586 HG3 LYS B 292 -33.702 49.808 5.162 1.00 0.00 H ATOM 5587 HD2 LYS B 292 -35.792 51.838 6.007 1.00 0.00 H ATOM 5588 HD3 LYS B 292 -35.234 50.427 6.936 1.00 0.00 H ATOM 5589 HE2 LYS B 292 -33.359 52.627 6.053 1.00 0.00 H ATOM 5590 HE3 LYS B 292 -33.093 51.374 7.287 1.00 0.00 H ATOM 5591 HZ1 LYS B 292 -35.032 53.618 7.478 1.00 0.00 H ATOM 5592 HZ2 LYS B 292 -34.777 52.421 8.657 1.00 0.00 H ATOM 5593 HZ3 LYS B 292 -33.536 53.518 8.278 1.00 0.00 H ATOM 5594 H LYS B 292 -32.410 49.547 3.247 1.00 0.00 H ATOM 5595 N ALA B 293 -32.126 52.144 1.195 1.00 49.13 N ATOM 5596 CA ALA B 293 -31.585 53.186 0.332 1.00 49.23 C ATOM 5597 C ALA B 293 -31.601 52.854 -1.177 1.00 49.76 C ATOM 5598 O ALA B 293 -31.238 53.700 -2.004 1.00 50.16 O ATOM 5599 CB ALA B 293 -30.194 53.566 0.785 1.00 49.04 C ATOM 5600 HA ALA B 293 -32.260 54.036 0.438 1.00 0.00 H ATOM 5601 HB1 ALA B 293 -30.235 53.935 1.810 1.00 0.00 H ATOM 5602 HB2 ALA B 293 -29.546 52.691 0.739 1.00 0.00 H ATOM 5603 HB3 ALA B 293 -29.801 54.345 0.132 1.00 0.00 H ATOM 5604 H ALA B 293 -31.481 51.428 1.587 1.00 0.00 H ATOM 5605 N ILE B 294 -32.022 51.644 -1.547 1.00 49.80 N ATOM 5606 CA ILE B 294 -32.138 51.303 -2.965 1.00 49.73 C ATOM 5607 C ILE B 294 -33.392 51.967 -3.500 1.00 49.76 C ATOM 5608 O ILE B 294 -34.467 51.791 -2.916 1.00 49.74 O ATOM 5609 CB ILE B 294 -32.199 49.770 -3.234 1.00 49.90 C ATOM 5610 CG1 ILE B 294 -30.885 49.084 -2.849 1.00 49.29 C ATOM 5611 CG2 ILE B 294 -32.513 49.485 -4.714 1.00 49.82 C ATOM 5612 CD1 ILE B 294 -31.040 47.612 -2.519 1.00 48.73 C ATOM 5613 HA ILE B 294 -31.241 51.660 -3.471 1.00 0.00 H ATOM 5614 HB ILE B 294 -32.999 49.365 -2.614 1.00 0.00 H ATOM 5615 HG12 ILE B 294 -30.190 49.179 -3.683 1.00 0.00 H ATOM 5616 HG13 ILE B 294 -30.474 49.591 -1.976 1.00 0.00 H ATOM 5617 HD11 ILE B 294 -31.724 47.500 -1.678 1.00 0.00 H ATOM 5618 HD12 ILE B 294 -31.439 47.087 -3.387 1.00 0.00 H ATOM 5619 HD13 ILE B 294 -30.068 47.196 -2.256 1.00 0.00 H ATOM 5620 HG21 ILE B 294 -33.476 49.925 -4.971 1.00 0.00 H ATOM 5621 HG22 ILE B 294 -31.734 49.921 -5.340 1.00 0.00 H ATOM 5622 HG23 ILE B 294 -32.550 48.408 -4.875 1.00 0.00 H ATOM 5623 H ILE B 294 -32.269 50.939 -0.824 1.00 0.00 H ATOM 5624 N PRO B 295 -33.252 52.750 -4.596 1.00 49.84 N ATOM 5625 CA PRO B 295 -34.407 53.362 -5.220 1.00 49.72 C ATOM 5626 C PRO B 295 -35.433 52.294 -5.546 1.00 49.92 C ATOM 5627 O PRO B 295 -35.113 51.301 -6.215 1.00 49.87 O ATOM 5628 CB PRO B 295 -33.827 53.972 -6.503 1.00 49.54 C ATOM 5629 CG PRO B 295 -32.438 54.287 -6.161 1.00 49.39 C ATOM 5630 CD PRO B 295 -32.009 53.119 -5.306 1.00 49.92 C ATOM 5631 HA PRO B 295 -34.911 54.098 -4.594 1.00 0.00 H ATOM 5632 HD3 PRO B 295 -31.650 52.294 -5.921 1.00 0.00 H ATOM 5633 HD2 PRO B 295 -31.229 53.413 -4.604 1.00 0.00 H ATOM 5634 HG3 PRO B 295 -32.377 55.221 -5.603 1.00 0.00 H ATOM 5635 HG2 PRO B 295 -31.823 54.360 -7.058 1.00 0.00 H ATOM 5636 HB2 PRO B 295 -33.870 53.256 -7.324 1.00 0.00 H ATOM 5637 HB3 PRO B 295 -34.370 54.875 -6.781 1.00 0.00 H ATOM 5638 N GLY B 296 -36.646 52.495 -5.037 1.00 50.08 N ATOM 5639 CA GLY B 296 -37.766 51.612 -5.318 1.00 50.33 C ATOM 5640 C GLY B 296 -38.078 50.674 -4.174 1.00 50.72 C ATOM 5641 O GLY B 296 -39.212 50.208 -4.055 1.00 50.80 O ATOM 5642 HA3 GLY B 296 -37.528 51.018 -6.200 1.00 0.00 H ATOM 5643 HA2 GLY B 296 -38.647 52.221 -5.519 1.00 0.00 H ATOM 5644 H GLY B 296 -36.798 53.314 -4.415 1.00 0.00 H ATOM 5645 N PHE B 297 -37.075 50.403 -3.334 1.00 50.97 N ATOM 5646 CA PHE B 297 -37.190 49.384 -2.296 1.00 51.23 C ATOM 5647 C PHE B 297 -38.132 49.773 -1.178 1.00 51.63 C ATOM 5648 O PHE B 297 -38.926 48.947 -0.720 1.00 51.77 O ATOM 5649 CB PHE B 297 -35.837 48.993 -1.708 1.00 51.15 C ATOM 5650 CG PHE B 297 -35.900 47.756 -0.845 1.00 50.91 C ATOM 5651 CD1 PHE B 297 -35.669 46.505 -1.389 1.00 49.97 C ATOM 5652 CD2 PHE B 297 -36.222 47.844 0.511 1.00 51.28 C ATOM 5653 CE1 PHE B 297 -35.739 45.359 -0.598 1.00 49.99 C ATOM 5654 CE2 PHE B 297 -36.303 46.704 1.308 1.00 50.43 C ATOM 5655 CZ PHE B 297 -36.058 45.460 0.752 1.00 50.59 C ATOM 5656 HA PHE B 297 -37.614 48.519 -2.807 1.00 0.00 H ATOM 5657 HB2 PHE B 297 -35.143 48.809 -2.528 1.00 0.00 H ATOM 5658 HB3 PHE B 297 -35.470 49.821 -1.101 1.00 0.00 H ATOM 5659 HD2 PHE B 297 -36.413 48.822 0.954 1.00 0.00 H ATOM 5660 HE2 PHE B 297 -36.558 46.791 2.364 1.00 0.00 H ATOM 5661 HZ PHE B 297 -36.115 44.564 1.370 1.00 0.00 H ATOM 5662 HE1 PHE B 297 -35.543 44.381 -1.039 1.00 0.00 H ATOM 5663 HD1 PHE B 297 -35.429 46.414 -2.448 1.00 0.00 H ATOM 5664 H PHE B 297 -36.185 50.934 -3.423 1.00 0.00 H ATOM 5665 N ALA B 298 -38.036 51.022 -0.732 1.00 52.11 N ATOM 5666 CA ALA B 298 -38.989 51.563 0.240 1.00 52.70 C ATOM 5667 C ALA B 298 -40.440 51.512 -0.279 1.00 53.17 C ATOM 5668 O ALA B 298 -41.375 51.299 0.503 1.00 53.06 O ATOM 5669 CB ALA B 298 -38.603 52.980 0.635 1.00 52.28 C ATOM 5670 HA ALA B 298 -38.945 50.930 1.126 1.00 0.00 H ATOM 5671 HB1 ALA B 298 -37.608 52.973 1.080 1.00 0.00 H ATOM 5672 HB2 ALA B 298 -38.602 53.615 -0.251 1.00 0.00 H ATOM 5673 HB3 ALA B 298 -39.323 53.363 1.358 1.00 0.00 H ATOM 5674 H ALA B 298 -37.267 51.629 -1.081 1.00 0.00 H ATOM 5675 N ASN B 299 -40.605 51.682 -1.595 1.00 53.79 N ATOM 5676 CA ASN B 299 -41.920 51.723 -2.247 1.00 54.41 C ATOM 5677 C ASN B 299 -42.657 50.391 -2.224 1.00 54.65 C ATOM 5678 O ASN B 299 -43.830 50.330 -2.587 1.00 54.73 O ATOM 5679 CB ASN B 299 -41.799 52.167 -3.715 1.00 54.69 C ATOM 5680 CG ASN B 299 -41.337 53.605 -3.874 1.00 54.88 C ATOM 5681 OD1 ASN B 299 -41.632 54.466 -3.045 1.00 55.62 O ATOM 5682 ND2 ASN B 299 -40.618 53.873 -4.962 1.00 54.68 N ATOM 5683 HA ASN B 299 -42.495 52.444 -1.666 1.00 0.00 H ATOM 5684 HB2 ASN B 299 -41.082 51.516 -4.215 1.00 0.00 H ATOM 5685 HB3 ASN B 299 -42.775 52.063 -4.189 1.00 0.00 H ATOM 5686 HD22 ASN B 299 -40.392 53.114 -5.636 1.00 0.00 H ATOM 5687 HD21 ASN B 299 -40.282 54.841 -5.138 1.00 0.00 H ATOM 5688 H ASN B 299 -39.757 51.791 -2.188 1.00 0.00 H ATOM 5689 N LEU B 300 -41.971 49.330 -1.811 1.00 54.85 N ATOM 5690 CA LEU B 300 -42.546 47.989 -1.855 1.00 55.06 C ATOM 5691 C LEU B 300 -43.371 47.666 -0.620 1.00 55.06 C ATOM 5692 O LEU B 300 -43.098 48.178 0.462 1.00 54.82 O ATOM 5693 CB LEU B 300 -41.439 46.951 -2.022 1.00 55.12 C ATOM 5694 CG LEU B 300 -40.440 47.175 -3.155 1.00 55.52 C ATOM 5695 CD1 LEU B 300 -39.185 46.390 -2.862 1.00 56.56 C ATOM 5696 CD2 LEU B 300 -41.026 46.795 -4.523 1.00 56.01 C ATOM 5697 HA LEU B 300 -43.219 47.958 -2.712 1.00 0.00 H ATOM 5698 HB2 LEU B 300 -40.876 46.918 -1.089 1.00 0.00 H ATOM 5699 HB3 LEU B 300 -41.916 45.986 -2.191 1.00 0.00 H ATOM 5700 HG LEU B 300 -40.203 48.238 -3.208 1.00 0.00 H ATOM 5701 HD21 LEU B 300 -41.304 45.741 -4.518 1.00 0.00 H ATOM 5702 HD22 LEU B 300 -41.908 47.404 -4.721 1.00 0.00 H ATOM 5703 HD23 LEU B 300 -40.280 46.971 -5.298 1.00 0.00 H ATOM 5704 HD11 LEU B 300 -38.757 46.731 -1.919 1.00 0.00 H ATOM 5705 HD12 LEU B 300 -39.429 45.330 -2.789 1.00 0.00 H ATOM 5706 HD13 LEU B 300 -38.466 46.544 -3.666 1.00 0.00 H ATOM 5707 H LEU B 300 -41.004 49.458 -1.449 1.00 0.00 H ATOM 5708 N ASP B 301 -44.371 46.803 -0.795 1.00 55.57 N ATOM 5709 CA ASP B 301 -45.169 46.274 0.313 1.00 56.36 C ATOM 5710 C ASP B 301 -44.261 45.958 1.487 1.00 56.63 C ATOM 5711 O ASP B 301 -43.176 45.390 1.322 1.00 57.24 O ATOM 5712 CB ASP B 301 -45.933 45.013 -0.115 1.00 56.44 C ATOM 5713 CG ASP B 301 -46.771 44.396 1.022 1.00 58.62 C ATOM 5714 OD1 ASP B 301 -47.893 43.917 0.739 1.00 60.40 O ATOM 5715 OD2 ASP B 301 -46.320 44.362 2.194 1.00 60.58 O ATOM 5716 HA ASP B 301 -45.898 47.029 0.609 1.00 0.00 H ATOM 5717 HB2 ASP B 301 -46.601 45.274 -0.936 1.00 0.00 H ATOM 5718 HB3 ASP B 301 -45.212 44.270 -0.457 1.00 0.00 H ATOM 5719 H ASP B 301 -44.595 46.491 -1.762 1.00 0.00 H ATOM 5720 N LEU B 302 -44.718 46.323 2.676 1.00 56.62 N ATOM 5721 CA LEU B 302 -43.928 46.172 3.888 1.00 56.44 C ATOM 5722 C LEU B 302 -43.459 44.718 4.105 1.00 56.06 C ATOM 5723 O LEU B 302 -42.307 44.483 4.494 1.00 56.08 O ATOM 5724 CB LEU B 302 -44.716 46.741 5.075 1.00 56.73 C ATOM 5725 CG LEU B 302 -45.373 48.121 4.823 1.00 57.42 C ATOM 5726 CD1 LEU B 302 -46.375 48.500 5.916 1.00 57.61 C ATOM 5727 CD2 LEU B 302 -44.348 49.248 4.626 1.00 57.48 C ATOM 5728 HA LEU B 302 -43.006 46.745 3.789 1.00 0.00 H ATOM 5729 HB2 LEU B 302 -45.504 46.032 5.329 1.00 0.00 H ATOM 5730 HB3 LEU B 302 -44.033 46.840 5.918 1.00 0.00 H ATOM 5731 HG LEU B 302 -45.919 48.008 3.887 1.00 0.00 H ATOM 5732 HD21 LEU B 302 -43.728 49.334 5.519 1.00 0.00 H ATOM 5733 HD22 LEU B 302 -43.719 49.019 3.766 1.00 0.00 H ATOM 5734 HD23 LEU B 302 -44.872 50.188 4.454 1.00 0.00 H ATOM 5735 HD11 LEU B 302 -47.167 47.752 5.956 1.00 0.00 H ATOM 5736 HD12 LEU B 302 -45.863 48.541 6.878 1.00 0.00 H ATOM 5737 HD13 LEU B 302 -46.806 49.476 5.690 1.00 0.00 H ATOM 5738 H LEU B 302 -45.672 46.731 2.745 1.00 0.00 H ATOM 5739 N ASN B 303 -44.330 43.752 3.806 1.00 55.36 N ATOM 5740 CA ASN B 303 -43.970 42.338 3.891 1.00 54.90 C ATOM 5741 C ASN B 303 -42.931 41.948 2.862 1.00 54.35 C ATOM 5742 O ASN B 303 -42.029 41.166 3.155 1.00 54.19 O ATOM 5743 CB ASN B 303 -45.190 41.440 3.744 1.00 55.12 C ATOM 5744 CG ASN B 303 -45.940 41.258 5.047 1.00 56.34 C ATOM 5745 OD1 ASN B 303 -45.364 40.894 6.085 1.00 58.00 O ATOM 5746 ND2 ASN B 303 -47.240 41.496 5.000 1.00 57.30 N ATOM 5747 HA ASN B 303 -43.541 42.196 4.883 1.00 0.00 H ATOM 5748 HB2 ASN B 303 -45.864 41.884 3.012 1.00 0.00 H ATOM 5749 HB3 ASN B 303 -44.863 40.462 3.389 1.00 0.00 H ATOM 5750 HD22 ASN B 303 -47.681 41.799 4.108 1.00 0.00 H ATOM 5751 HD21 ASN B 303 -47.821 41.380 5.855 1.00 0.00 H ATOM 5752 H ASN B 303 -45.291 44.012 3.504 1.00 0.00 H ATOM 5753 N ASP B 304 -43.068 42.501 1.660 1.00 53.58 N ATOM 5754 CA ASP B 304 -42.100 42.292 0.582 1.00 52.81 C ATOM 5755 C ASP B 304 -40.703 42.809 0.949 1.00 52.06 C ATOM 5756 O ASP B 304 -39.700 42.192 0.598 1.00 52.00 O ATOM 5757 CB ASP B 304 -42.582 42.951 -0.720 1.00 52.82 C ATOM 5758 CG ASP B 304 -43.635 42.131 -1.446 1.00 52.96 C ATOM 5759 OD1 ASP B 304 -44.050 41.065 -0.933 1.00 54.69 O ATOM 5760 OD2 ASP B 304 -44.049 42.557 -2.543 1.00 51.73 O ATOM 5761 HA ASP B 304 -42.024 41.215 0.430 1.00 0.00 H ATOM 5762 HB2 ASP B 304 -43.005 43.926 -0.480 1.00 0.00 H ATOM 5763 HB3 ASP B 304 -41.726 43.081 -1.382 1.00 0.00 H ATOM 5764 H ASP B 304 -43.895 43.105 1.479 1.00 0.00 H ATOM 5765 N GLN B 305 -40.642 43.933 1.654 1.00 51.11 N ATOM 5766 CA GLN B 305 -39.363 44.467 2.108 1.00 50.55 C ATOM 5767 C GLN B 305 -38.609 43.457 2.985 1.00 50.31 C ATOM 5768 O GLN B 305 -37.390 43.339 2.875 1.00 50.28 O ATOM 5769 CB GLN B 305 -39.546 45.803 2.849 1.00 50.66 C ATOM 5770 CG GLN B 305 -39.952 46.962 1.948 1.00 49.91 C ATOM 5771 CD GLN B 305 -39.811 48.328 2.612 1.00 50.10 C ATOM 5772 OE1 GLN B 305 -38.808 48.628 3.258 1.00 48.64 O ATOM 5773 NE2 GLN B 305 -40.817 49.171 2.431 1.00 50.01 N ATOM 5774 HA GLN B 305 -38.759 44.653 1.220 1.00 0.00 H ATOM 5775 HB2 GLN B 305 -40.318 45.672 3.607 1.00 0.00 H ATOM 5776 HB3 GLN B 305 -38.603 46.059 3.333 1.00 0.00 H ATOM 5777 HG2 GLN B 305 -39.323 46.944 1.058 1.00 0.00 H ATOM 5778 HG3 GLN B 305 -40.994 46.825 1.658 1.00 0.00 H ATOM 5779 HE22 GLN B 305 -41.648 48.878 1.878 1.00 0.00 H ATOM 5780 HE21 GLN B 305 -40.776 50.125 2.842 1.00 0.00 H ATOM 5781 H GLN B 305 -41.520 44.440 1.886 1.00 0.00 H ATOM 5782 N VAL B 306 -39.335 42.713 3.826 1.00 49.74 N ATOM 5783 CA VAL B 306 -38.703 41.728 4.722 1.00 48.93 C ATOM 5784 C VAL B 306 -38.504 40.319 4.115 1.00 48.47 C ATOM 5785 O VAL B 306 -37.675 39.547 4.589 1.00 48.56 O ATOM 5786 CB VAL B 306 -39.389 41.665 6.133 1.00 48.68 C ATOM 5787 CG1 VAL B 306 -39.884 43.044 6.547 1.00 48.82 C ATOM 5788 CG2 VAL B 306 -40.528 40.667 6.160 1.00 48.49 C ATOM 5789 HA VAL B 306 -37.694 42.115 4.861 1.00 0.00 H ATOM 5790 HB VAL B 306 -38.638 41.328 6.847 1.00 0.00 H ATOM 5791 HG11 VAL B 306 -39.040 43.733 6.593 1.00 0.00 H ATOM 5792 HG12 VAL B 306 -40.608 43.403 5.816 1.00 0.00 H ATOM 5793 HG13 VAL B 306 -40.356 42.980 7.527 1.00 0.00 H ATOM 5794 HG21 VAL B 306 -41.280 40.956 5.426 1.00 0.00 H ATOM 5795 HG22 VAL B 306 -40.146 39.675 5.920 1.00 0.00 H ATOM 5796 HG23 VAL B 306 -40.975 40.655 7.154 1.00 0.00 H ATOM 5797 H VAL B 306 -40.368 42.832 3.848 1.00 0.00 H ATOM 5798 N THR B 307 -39.261 39.981 3.078 1.00 48.05 N ATOM 5799 CA THR B 307 -39.087 38.694 2.392 1.00 47.47 C ATOM 5800 C THR B 307 -37.851 38.737 1.496 1.00 46.94 C ATOM 5801 O THR B 307 -37.077 37.778 1.444 1.00 46.82 O ATOM 5802 CB THR B 307 -40.299 38.329 1.526 1.00 47.37 C ATOM 5803 OG1 THR B 307 -41.497 38.748 2.182 1.00 48.38 O ATOM 5804 CG2 THR B 307 -40.360 36.833 1.293 1.00 47.86 C ATOM 5805 HA THR B 307 -38.974 37.938 3.169 1.00 0.00 H ATOM 5806 HB THR B 307 -40.201 38.833 0.564 1.00 0.00 H ATOM 5807 HG1 THR B 307 -41.472 39.728 2.319 1.00 0.00 H ATOM 5808 HG23 THR B 307 -39.448 36.507 0.792 1.00 0.00 H ATOM 5809 HG21 THR B 307 -40.453 36.321 2.251 1.00 0.00 H ATOM 5810 HG22 THR B 307 -41.222 36.599 0.669 1.00 0.00 H ATOM 5811 H THR B 307 -39.992 40.641 2.745 1.00 0.00 H ATOM 5812 N LEU B 308 -37.666 39.850 0.785 1.00 46.05 N ATOM 5813 CA LEU B 308 -36.486 40.005 -0.066 1.00 44.93 C ATOM 5814 C LEU B 308 -35.240 39.999 0.801 1.00 44.17 C ATOM 5815 O LEU B 308 -34.206 39.457 0.414 1.00 44.21 O ATOM 5816 CB LEU B 308 -36.566 41.288 -0.905 1.00 44.87 C ATOM 5817 CG LEU B 308 -37.616 41.334 -2.021 1.00 43.99 C ATOM 5818 CD1 LEU B 308 -37.773 42.744 -2.575 1.00 43.91 C ATOM 5819 CD2 LEU B 308 -37.276 40.349 -3.115 1.00 42.86 C ATOM 5820 HA LEU B 308 -36.442 39.169 -0.764 1.00 0.00 H ATOM 5821 HB2 LEU B 308 -36.776 42.113 -0.224 1.00 0.00 H ATOM 5822 HB3 LEU B 308 -35.590 41.439 -1.367 1.00 0.00 H ATOM 5823 HG LEU B 308 -38.576 41.044 -1.593 1.00 0.00 H ATOM 5824 HD21 LEU B 308 -36.302 40.598 -3.536 1.00 0.00 H ATOM 5825 HD22 LEU B 308 -37.247 39.342 -2.699 1.00 0.00 H ATOM 5826 HD23 LEU B 308 -38.035 40.399 -3.896 1.00 0.00 H ATOM 5827 HD11 LEU B 308 -38.087 43.415 -1.775 1.00 0.00 H ATOM 5828 HD12 LEU B 308 -36.819 43.082 -2.981 1.00 0.00 H ATOM 5829 HD13 LEU B 308 -38.525 42.741 -3.364 1.00 0.00 H ATOM 5830 H LEU B 308 -38.368 40.616 0.836 1.00 0.00 H ATOM 5831 N LEU B 309 -35.368 40.594 1.984 1.00 43.38 N ATOM 5832 CA LEU B 309 -34.299 40.641 2.965 1.00 42.44 C ATOM 5833 C LEU B 309 -33.986 39.301 3.610 1.00 41.95 C ATOM 5834 O LEU B 309 -32.820 38.956 3.775 1.00 42.05 O ATOM 5835 CB LEU B 309 -34.621 41.677 4.027 1.00 42.33 C ATOM 5836 CG LEU B 309 -34.057 43.042 3.653 1.00 42.07 C ATOM 5837 CD1 LEU B 309 -34.317 44.028 4.760 1.00 42.17 C ATOM 5838 CD2 LEU B 309 -32.571 42.934 3.414 1.00 42.77 C ATOM 5839 HA LEU B 309 -33.397 40.922 2.421 1.00 0.00 H ATOM 5840 HB2 LEU B 309 -35.703 41.755 4.131 1.00 0.00 H ATOM 5841 HB3 LEU B 309 -34.188 41.361 4.976 1.00 0.00 H ATOM 5842 HG LEU B 309 -34.546 43.388 2.742 1.00 0.00 H ATOM 5843 HD21 LEU B 309 -32.083 42.579 4.322 1.00 0.00 H ATOM 5844 HD22 LEU B 309 -32.385 42.232 2.601 1.00 0.00 H ATOM 5845 HD23 LEU B 309 -32.175 43.914 3.147 1.00 0.00 H ATOM 5846 HD11 LEU B 309 -35.391 44.116 4.922 1.00 0.00 H ATOM 5847 HD12 LEU B 309 -33.838 43.680 5.675 1.00 0.00 H ATOM 5848 HD13 LEU B 309 -33.910 45.000 4.482 1.00 0.00 H ATOM 5849 H LEU B 309 -36.275 41.046 2.217 1.00 0.00 H ATOM 5850 N LYS B 310 -35.027 38.557 3.966 1.00 41.43 N ATOM 5851 CA LYS B 310 -34.902 37.218 4.540 1.00 41.16 C ATOM 5852 C LYS B 310 -34.015 36.324 3.679 1.00 41.29 C ATOM 5853 O LYS B 310 -33.061 35.724 4.174 1.00 41.76 O ATOM 5854 CB LYS B 310 -36.295 36.590 4.703 1.00 41.30 C ATOM 5855 CG LYS B 310 -36.392 35.378 5.636 1.00 41.07 C ATOM 5856 CD LYS B 310 -37.848 34.896 5.733 1.00 40.84 C ATOM 5857 CE LYS B 310 -37.954 33.368 5.827 1.00 39.25 C ATOM 5858 NZ LYS B 310 -37.592 32.843 7.172 1.00 39.08 N ATOM 5859 HA LYS B 310 -34.430 37.309 5.518 1.00 0.00 H ATOM 5860 HB2 LYS B 310 -36.963 37.360 5.089 1.00 0.00 H ATOM 5861 HB3 LYS B 310 -36.635 36.277 3.716 1.00 0.00 H ATOM 5862 HG2 LYS B 310 -35.771 34.572 5.245 1.00 0.00 H ATOM 5863 HG3 LYS B 310 -36.039 35.658 6.628 1.00 0.00 H ATOM 5864 HD2 LYS B 310 -38.303 35.334 6.621 1.00 0.00 H ATOM 5865 HD3 LYS B 310 -38.387 35.231 4.847 1.00 0.00 H ATOM 5866 HE2 LYS B 310 -37.284 32.927 5.089 1.00 0.00 H ATOM 5867 HE3 LYS B 310 -38.980 33.076 5.604 1.00 0.00 H ATOM 5868 HZ1 LYS B 310 -36.611 33.107 7.393 1.00 0.00 H ATOM 5869 HZ2 LYS B 310 -38.231 33.250 7.885 1.00 0.00 H ATOM 5870 HZ3 LYS B 310 -37.683 31.807 7.174 1.00 0.00 H ATOM 5871 H LYS B 310 -35.981 38.947 3.829 1.00 0.00 H ATOM 5872 N TYR B 311 -34.308 36.271 2.383 1.00 41.09 N ATOM 5873 CA TYR B 311 -33.622 35.369 1.457 1.00 40.60 C ATOM 5874 C TYR B 311 -32.337 35.946 0.863 1.00 40.12 C ATOM 5875 O TYR B 311 -31.434 35.197 0.433 1.00 40.36 O ATOM 5876 CB TYR B 311 -34.577 34.944 0.355 1.00 40.85 C ATOM 5877 CG TYR B 311 -35.759 34.156 0.866 1.00 41.59 C ATOM 5878 CD1 TYR B 311 -36.930 34.801 1.266 1.00 42.00 C ATOM 5879 CD2 TYR B 311 -35.706 32.757 0.955 1.00 42.30 C ATOM 5880 CE1 TYR B 311 -38.029 34.077 1.743 1.00 43.30 C ATOM 5881 CE2 TYR B 311 -36.796 32.016 1.426 1.00 42.85 C ATOM 5882 CZ TYR B 311 -37.959 32.683 1.815 1.00 43.02 C ATOM 5883 OH TYR B 311 -39.043 31.971 2.274 1.00 42.31 O ATOM 5884 HA TYR B 311 -33.310 34.503 2.041 1.00 0.00 H ATOM 5885 HB3 TYR B 311 -34.031 34.327 -0.359 1.00 0.00 H ATOM 5886 HB2 TYR B 311 -34.947 35.838 -0.148 1.00 0.00 H ATOM 5887 HD2 TYR B 311 -34.798 32.237 0.651 1.00 0.00 H ATOM 5888 HE2 TYR B 311 -36.737 30.929 1.488 1.00 0.00 H ATOM 5889 HE1 TYR B 311 -38.934 34.597 2.056 1.00 0.00 H ATOM 5890 HD1 TYR B 311 -36.990 35.888 1.206 1.00 0.00 H ATOM 5891 HH TYR B 311 -39.774 32.597 2.504 1.00 0.00 H ATOM 5892 H TYR B 311 -35.054 36.895 2.013 1.00 0.00 H ATOM 5893 N GLY B 312 -32.234 37.267 0.865 1.00 38.97 N ATOM 5894 CA GLY B 312 -31.052 37.910 0.330 1.00 38.39 C ATOM 5895 C GLY B 312 -29.851 38.020 1.252 1.00 38.06 C ATOM 5896 O GLY B 312 -28.714 37.967 0.781 1.00 37.86 O ATOM 5897 HA3 GLY B 312 -31.333 38.921 0.033 1.00 0.00 H ATOM 5898 HA2 GLY B 312 -30.741 37.347 -0.550 1.00 0.00 H ATOM 5899 H GLY B 312 -33.006 37.845 1.253 1.00 0.00 H ATOM 5900 N VAL B 313 -30.088 38.181 2.557 1.00 37.72 N ATOM 5901 CA VAL B 313 -29.018 38.627 3.458 1.00 37.96 C ATOM 5902 C VAL B 313 -27.779 37.730 3.488 1.00 37.81 C ATOM 5903 O VAL B 313 -26.656 38.233 3.447 1.00 37.93 O ATOM 5904 CB VAL B 313 -29.506 39.011 4.918 1.00 38.20 C ATOM 5905 CG1 VAL B 313 -30.292 40.325 4.906 1.00 38.87 C ATOM 5906 CG2 VAL B 313 -30.324 37.903 5.576 1.00 38.49 C ATOM 5907 HA VAL B 313 -28.693 39.556 2.990 1.00 0.00 H ATOM 5908 HB VAL B 313 -28.607 39.144 5.520 1.00 0.00 H ATOM 5909 HG11 VAL B 313 -29.655 41.125 4.528 1.00 0.00 H ATOM 5910 HG12 VAL B 313 -31.165 40.219 4.262 1.00 0.00 H ATOM 5911 HG13 VAL B 313 -30.614 40.564 5.920 1.00 0.00 H ATOM 5912 HG21 VAL B 313 -31.207 37.697 4.971 1.00 0.00 H ATOM 5913 HG22 VAL B 313 -29.716 37.001 5.653 1.00 0.00 H ATOM 5914 HG23 VAL B 313 -30.630 38.222 6.572 1.00 0.00 H ATOM 5915 H VAL B 313 -31.037 37.989 2.937 1.00 0.00 H ATOM 5916 N TYR B 314 -27.970 36.416 3.548 1.00 37.79 N ATOM 5917 CA TYR B 314 -26.818 35.507 3.556 1.00 37.89 C ATOM 5918 C TYR B 314 -26.132 35.406 2.204 1.00 37.49 C ATOM 5919 O TYR B 314 -24.899 35.286 2.132 1.00 37.87 O ATOM 5920 CB TYR B 314 -27.176 34.116 4.074 1.00 38.10 C ATOM 5921 CG TYR B 314 -27.143 34.016 5.576 1.00 38.06 C ATOM 5922 CD1 TYR B 314 -28.312 33.822 6.297 1.00 39.08 C ATOM 5923 CD2 TYR B 314 -25.951 34.126 6.274 1.00 37.19 C ATOM 5924 CE1 TYR B 314 -28.295 33.744 7.671 1.00 39.01 C ATOM 5925 CE2 TYR B 314 -25.920 34.054 7.640 1.00 37.68 C ATOM 5926 CZ TYR B 314 -27.097 33.863 8.337 1.00 38.92 C ATOM 5927 OH TYR B 314 -27.089 33.766 9.712 1.00 40.19 O ATOM 5928 HA TYR B 314 -26.108 35.955 4.251 1.00 0.00 H ATOM 5929 HB3 TYR B 314 -26.465 33.399 3.663 1.00 0.00 H ATOM 5930 HB2 TYR B 314 -28.180 33.866 3.732 1.00 0.00 H ATOM 5931 HD2 TYR B 314 -25.021 34.273 5.725 1.00 0.00 H ATOM 5932 HE2 TYR B 314 -24.974 34.147 8.174 1.00 0.00 H ATOM 5933 HE1 TYR B 314 -29.221 33.590 8.226 1.00 0.00 H ATOM 5934 HD1 TYR B 314 -29.260 33.730 5.767 1.00 0.00 H ATOM 5935 HH TYR B 314 -28.014 33.632 10.038 1.00 0.00 H ATOM 5936 H TYR B 314 -28.936 36.032 3.589 1.00 0.00 H ATOM 5937 N GLU B 315 -26.912 35.460 1.133 1.00 36.43 N ATOM 5938 CA GLU B 315 -26.300 35.473 -0.177 1.00 35.68 C ATOM 5939 C GLU B 315 -25.374 36.677 -0.271 1.00 35.25 C ATOM 5940 O GLU B 315 -24.281 36.579 -0.837 1.00 35.79 O ATOM 5941 CB GLU B 315 -27.345 35.488 -1.282 1.00 35.31 C ATOM 5942 CG GLU B 315 -27.961 34.140 -1.539 1.00 34.98 C ATOM 5943 CD GLU B 315 -28.886 34.182 -2.718 1.00 35.68 C ATOM 5944 OE1 GLU B 315 -28.674 35.066 -3.573 1.00 37.35 O ATOM 5945 OE2 GLU B 315 -29.822 33.355 -2.803 1.00 34.21 O ATOM 5946 HA GLU B 315 -25.721 34.559 -0.313 1.00 0.00 H ATOM 5947 HB2 GLU B 315 -28.137 36.182 -1.000 1.00 0.00 H ATOM 5948 HB3 GLU B 315 -26.872 35.833 -2.201 1.00 0.00 H ATOM 5949 HG2 GLU B 315 -27.168 33.418 -1.734 1.00 0.00 H ATOM 5950 HG3 GLU B 315 -28.522 33.831 -0.657 1.00 0.00 H ATOM 5951 H GLU B 315 -27.947 35.492 1.234 1.00 0.00 H ATOM 5952 N ALA B 316 -25.801 37.789 0.324 1.00 34.24 N ATOM 5953 CA ALA B 316 -25.074 39.057 0.271 1.00 33.44 C ATOM 5954 C ALA B 316 -23.891 39.110 1.234 1.00 32.92 C ATOM 5955 O ALA B 316 -22.825 39.618 0.887 1.00 32.61 O ATOM 5956 CB ALA B 316 -26.026 40.213 0.534 1.00 33.46 C ATOM 5957 HA ALA B 316 -24.658 39.143 -0.733 1.00 0.00 H ATOM 5958 HB1 ALA B 316 -26.810 40.216 -0.224 1.00 0.00 H ATOM 5959 HB2 ALA B 316 -26.473 40.096 1.521 1.00 0.00 H ATOM 5960 HB3 ALA B 316 -25.475 41.153 0.492 1.00 0.00 H ATOM 5961 H ALA B 316 -26.696 37.754 0.853 1.00 0.00 H ATOM 5962 N ILE B 317 -24.089 38.585 2.441 1.00 32.62 N ATOM 5963 CA ILE B 317 -23.009 38.460 3.420 1.00 32.26 C ATOM 5964 C ILE B 317 -21.815 37.698 2.859 1.00 31.68 C ATOM 5965 O ILE B 317 -20.692 38.184 2.928 1.00 32.16 O ATOM 5966 CB ILE B 317 -23.487 37.796 4.724 1.00 32.61 C ATOM 5967 CG1 ILE B 317 -24.305 38.799 5.539 1.00 32.23 C ATOM 5968 CG2 ILE B 317 -22.288 37.249 5.542 1.00 32.05 C ATOM 5969 CD1 ILE B 317 -25.191 38.154 6.587 1.00 32.16 C ATOM 5970 HA ILE B 317 -22.690 39.477 3.649 1.00 0.00 H ATOM 5971 HB ILE B 317 -24.122 36.945 4.477 1.00 0.00 H ATOM 5972 HG12 ILE B 317 -23.616 39.478 6.041 1.00 0.00 H ATOM 5973 HG13 ILE B 317 -24.937 39.365 4.855 1.00 0.00 H ATOM 5974 HD11 ILE B 317 -25.895 37.479 6.100 1.00 0.00 H ATOM 5975 HD12 ILE B 317 -24.573 37.593 7.288 1.00 0.00 H ATOM 5976 HD13 ILE B 317 -25.739 38.928 7.124 1.00 0.00 H ATOM 5977 HG21 ILE B 317 -21.752 36.508 4.948 1.00 0.00 H ATOM 5978 HG22 ILE B 317 -21.616 38.070 5.793 1.00 0.00 H ATOM 5979 HG23 ILE B 317 -22.656 36.786 6.458 1.00 0.00 H ATOM 5980 H ILE B 317 -25.041 38.253 2.696 1.00 0.00 H ATOM 5981 N PHE B 318 -22.046 36.521 2.297 1.00 30.95 N ATOM 5982 CA PHE B 318 -20.934 35.749 1.764 1.00 30.52 C ATOM 5983 C PHE B 318 -20.331 36.399 0.527 1.00 30.93 C ATOM 5984 O PHE B 318 -19.115 36.370 0.335 1.00 31.26 O ATOM 5985 CB PHE B 318 -21.347 34.310 1.525 1.00 29.73 C ATOM 5986 CG PHE B 318 -21.861 33.635 2.762 1.00 28.96 C ATOM 5987 CD1 PHE B 318 -21.143 33.714 3.960 1.00 27.16 C ATOM 5988 CD2 PHE B 318 -23.060 32.931 2.741 1.00 27.12 C ATOM 5989 CE1 PHE B 318 -21.614 33.111 5.108 1.00 26.65 C ATOM 5990 CE2 PHE B 318 -23.532 32.312 3.884 1.00 25.85 C ATOM 5991 CZ PHE B 318 -22.815 32.404 5.073 1.00 26.96 C ATOM 5992 HA PHE B 318 -20.141 35.738 2.512 1.00 0.00 H ATOM 5993 HB2 PHE B 318 -22.132 34.295 0.769 1.00 0.00 H ATOM 5994 HB3 PHE B 318 -20.482 33.756 1.160 1.00 0.00 H ATOM 5995 HD2 PHE B 318 -23.633 32.867 1.816 1.00 0.00 H ATOM 5996 HE2 PHE B 318 -24.466 31.752 3.854 1.00 0.00 H ATOM 5997 HZ PHE B 318 -23.192 31.924 5.976 1.00 0.00 H ATOM 5998 HE1 PHE B 318 -21.050 33.187 6.038 1.00 0.00 H ATOM 5999 HD1 PHE B 318 -20.199 34.259 3.987 1.00 0.00 H ATOM 6000 H PHE B 318 -23.016 36.151 2.237 1.00 0.00 H ATOM 6001 N ALA B 319 -21.166 37.032 -0.284 1.00 31.27 N ATOM 6002 CA ALA B 319 -20.657 37.788 -1.421 1.00 31.86 C ATOM 6003 C ALA B 319 -19.690 38.884 -0.970 1.00 32.21 C ATOM 6004 O ALA B 319 -18.619 39.053 -1.558 1.00 31.64 O ATOM 6005 CB ALA B 319 -21.791 38.372 -2.219 1.00 31.60 C ATOM 6006 HA ALA B 319 -20.104 37.100 -2.061 1.00 0.00 H ATOM 6007 HB1 ALA B 319 -22.428 37.567 -2.586 1.00 0.00 H ATOM 6008 HB2 ALA B 319 -22.375 39.038 -1.584 1.00 0.00 H ATOM 6009 HB3 ALA B 319 -21.389 38.932 -3.063 1.00 0.00 H ATOM 6010 H ALA B 319 -22.190 36.989 -0.108 1.00 0.00 H ATOM 6011 N MET B 320 -20.067 39.597 0.096 1.00 32.97 N ATOM 6012 CA MET B 320 -19.271 40.727 0.619 1.00 33.72 C ATOM 6013 C MET B 320 -18.110 40.283 1.472 1.00 33.43 C ATOM 6014 O MET B 320 -17.091 40.951 1.503 1.00 33.59 O ATOM 6015 CB MET B 320 -20.133 41.684 1.421 1.00 33.17 C ATOM 6016 CG MET B 320 -21.059 42.513 0.580 1.00 34.33 C ATOM 6017 SD MET B 320 -21.768 43.791 1.604 1.00 36.02 S ATOM 6018 CE MET B 320 -22.969 42.819 2.540 1.00 36.43 C ATOM 6019 HA MET B 320 -18.872 41.235 -0.259 1.00 0.00 H ATOM 6020 HB2 MET B 320 -20.732 41.103 2.122 1.00 0.00 H ATOM 6021 HB3 MET B 320 -19.477 42.356 1.975 1.00 0.00 H ATOM 6022 HG2 MET B 320 -21.852 41.883 0.177 1.00 0.00 H ATOM 6023 HG3 MET B 320 -20.503 42.966 -0.241 1.00 0.00 H ATOM 6024 HE1 MET B 320 -23.678 42.360 1.852 1.00 0.00 H ATOM 6025 HE2 MET B 320 -22.448 42.042 3.100 1.00 0.00 H ATOM 6026 HE3 MET B 320 -23.502 43.471 3.232 1.00 0.00 H ATOM 6027 H MET B 320 -20.955 39.347 0.576 1.00 0.00 H ATOM 6028 N LEU B 321 -18.285 39.162 2.165 1.00 33.67 N ATOM 6029 CA LEU B 321 -17.233 38.505 2.939 1.00 34.49 C ATOM 6030 C LEU B 321 -15.958 38.246 2.136 1.00 34.89 C ATOM 6031 O LEU B 321 -14.868 38.162 2.697 1.00 35.04 O ATOM 6032 CB LEU B 321 -17.757 37.166 3.463 1.00 34.56 C ATOM 6033 CG LEU B 321 -17.170 36.551 4.731 1.00 34.64 C ATOM 6034 CD1 LEU B 321 -17.494 37.419 5.945 1.00 33.02 C ATOM 6035 CD2 LEU B 321 -17.724 35.125 4.908 1.00 34.65 C ATOM 6036 HA LEU B 321 -16.973 39.184 3.751 1.00 0.00 H ATOM 6037 HB2 LEU B 321 -18.824 37.296 3.643 1.00 0.00 H ATOM 6038 HB3 LEU B 321 -17.610 36.438 2.665 1.00 0.00 H ATOM 6039 HG LEU B 321 -16.085 36.500 4.641 1.00 0.00 H ATOM 6040 HD21 LEU B 321 -18.810 35.166 4.990 1.00 0.00 H ATOM 6041 HD22 LEU B 321 -17.447 34.519 4.045 1.00 0.00 H ATOM 6042 HD23 LEU B 321 -17.306 34.684 5.813 1.00 0.00 H ATOM 6043 HD11 LEU B 321 -17.069 38.413 5.803 1.00 0.00 H ATOM 6044 HD12 LEU B 321 -18.576 37.497 6.056 1.00 0.00 H ATOM 6045 HD13 LEU B 321 -17.067 36.965 6.839 1.00 0.00 H ATOM 6046 H LEU B 321 -19.229 38.725 2.156 1.00 0.00 H ATOM 6047 N SER B 322 -16.103 38.109 0.822 1.00 35.28 N ATOM 6048 CA SER B 322 -14.973 37.850 -0.040 1.00 35.76 C ATOM 6049 C SER B 322 -13.996 39.008 0.003 1.00 36.18 C ATOM 6050 O SER B 322 -12.784 38.802 -0.047 1.00 36.47 O ATOM 6051 CB SER B 322 -15.449 37.589 -1.459 1.00 35.91 C ATOM 6052 OG SER B 322 -16.429 36.565 -1.459 1.00 37.30 O ATOM 6053 HA SER B 322 -14.453 36.961 0.316 1.00 0.00 H ATOM 6054 HB2 SER B 322 -14.603 37.280 -2.073 1.00 0.00 H ATOM 6055 HB3 SER B 322 -15.880 38.502 -1.870 1.00 0.00 H ATOM 6056 HG SER B 322 -17.198 36.846 -0.903 1.00 0.00 H ATOM 6057 H SER B 322 -17.052 38.190 0.405 1.00 0.00 H ATOM 6058 N SER B 323 -14.526 40.225 0.117 1.00 36.69 N ATOM 6059 CA SER B 323 -13.705 41.427 0.272 1.00 37.14 C ATOM 6060 C SER B 323 -12.681 41.347 1.422 1.00 37.75 C ATOM 6061 O SER B 323 -11.575 41.880 1.290 1.00 37.33 O ATOM 6062 CB SER B 323 -14.591 42.657 0.449 1.00 36.91 C ATOM 6063 OG SER B 323 -15.414 42.841 -0.685 1.00 36.98 O ATOM 6064 HA SER B 323 -13.125 41.509 -0.647 1.00 0.00 H ATOM 6065 HB2 SER B 323 -13.962 43.537 0.582 1.00 0.00 H ATOM 6066 HB3 SER B 323 -15.218 42.524 1.330 1.00 0.00 H ATOM 6067 HG SER B 323 -15.981 43.642 -0.553 1.00 0.00 H ATOM 6068 H SER B 323 -15.561 40.325 0.095 1.00 0.00 H ATOM 6069 N VAL B 324 -13.056 40.676 2.522 1.00 38.38 N ATOM 6070 CA VAL B 324 -12.234 40.620 3.732 1.00 39.10 C ATOM 6071 C VAL B 324 -11.416 39.337 3.825 1.00 40.10 C ATOM 6072 O VAL B 324 -10.737 39.091 4.827 1.00 40.47 O ATOM 6073 CB VAL B 324 -13.059 40.820 5.038 1.00 38.92 C ATOM 6074 CG1 VAL B 324 -13.827 42.142 5.008 1.00 38.80 C ATOM 6075 CG2 VAL B 324 -13.996 39.650 5.301 1.00 39.05 C ATOM 6076 HA VAL B 324 -11.544 41.459 3.641 1.00 0.00 H ATOM 6077 HB VAL B 324 -12.349 40.859 5.864 1.00 0.00 H ATOM 6078 HG11 VAL B 324 -13.122 42.968 4.910 1.00 0.00 H ATOM 6079 HG12 VAL B 324 -14.511 42.144 4.159 1.00 0.00 H ATOM 6080 HG13 VAL B 324 -14.393 42.253 5.933 1.00 0.00 H ATOM 6081 HG21 VAL B 324 -14.692 39.549 4.468 1.00 0.00 H ATOM 6082 HG22 VAL B 324 -13.413 38.735 5.401 1.00 0.00 H ATOM 6083 HG23 VAL B 324 -14.552 39.831 6.221 1.00 0.00 H ATOM 6084 H VAL B 324 -13.968 40.175 2.515 1.00 0.00 H ATOM 6085 N MET B 325 -11.471 38.529 2.772 1.00 40.99 N ATOM 6086 CA MET B 325 -10.731 37.276 2.739 1.00 41.54 C ATOM 6087 C MET B 325 -9.596 37.275 1.714 1.00 42.83 C ATOM 6088 O MET B 325 -9.713 37.857 0.632 1.00 42.78 O ATOM 6089 CB MET B 325 -11.672 36.128 2.403 1.00 41.46 C ATOM 6090 CG MET B 325 -12.747 35.865 3.418 1.00 40.98 C ATOM 6091 SD MET B 325 -13.720 34.499 2.807 1.00 40.02 S ATOM 6092 CE MET B 325 -14.122 33.627 4.306 1.00 40.77 C ATOM 6093 HA MET B 325 -10.292 37.155 3.730 1.00 0.00 H ATOM 6094 HB2 MET B 325 -12.154 36.354 1.452 1.00 0.00 H ATOM 6095 HB3 MET B 325 -11.075 35.222 2.300 1.00 0.00 H ATOM 6096 HG2 MET B 325 -13.374 36.748 3.536 1.00 0.00 H ATOM 6097 HG3 MET B 325 -12.300 35.607 4.378 1.00 0.00 H ATOM 6098 HE1 MET B 325 -13.203 33.310 4.798 1.00 0.00 H ATOM 6099 HE2 MET B 325 -14.682 34.286 4.969 1.00 0.00 H ATOM 6100 HE3 MET B 325 -14.727 32.753 4.065 1.00 0.00 H ATOM 6101 H MET B 325 -12.055 38.797 1.954 1.00 0.00 H ATOM 6102 N ASN B 326 -8.493 36.622 2.073 1.00 44.15 N ATOM 6103 CA ASN B 326 -7.558 36.096 1.079 1.00 45.36 C ATOM 6104 C ASN B 326 -7.382 34.587 1.280 1.00 46.40 C ATOM 6105 O ASN B 326 -8.181 33.969 1.993 1.00 46.69 O ATOM 6106 CB ASN B 326 -6.226 36.851 1.070 1.00 45.15 C ATOM 6107 CG ASN B 326 -5.534 36.838 2.408 1.00 45.02 C ATOM 6108 OD1 ASN B 326 -5.588 35.848 3.162 1.00 44.92 O ATOM 6109 ND2 ASN B 326 -4.858 37.938 2.711 1.00 43.34 N ATOM 6110 HA ASN B 326 -7.983 36.258 0.089 1.00 0.00 H ATOM 6111 HB2 ASN B 326 -5.569 36.388 0.334 1.00 0.00 H ATOM 6112 HB3 ASN B 326 -6.415 37.886 0.786 1.00 0.00 H ATOM 6113 HD22 ASN B 326 -4.843 38.739 2.047 1.00 0.00 H ATOM 6114 HD21 ASN B 326 -4.343 38.000 3.612 1.00 0.00 H ATOM 6115 H ASN B 326 -8.291 36.483 3.084 1.00 0.00 H ATOM 6116 N LYS B 327 -6.361 33.992 0.654 1.00 47.86 N ATOM 6117 CA LYS B 327 -6.161 32.528 0.705 1.00 48.82 C ATOM 6118 C LYS B 327 -5.747 32.009 2.070 1.00 49.51 C ATOM 6119 O LYS B 327 -5.848 30.808 2.312 1.00 49.69 O ATOM 6120 CB LYS B 327 -5.167 32.061 -0.354 1.00 48.86 C ATOM 6121 CG LYS B 327 -3.855 32.828 -0.377 1.00 50.17 C ATOM 6122 CD LYS B 327 -3.333 32.937 -1.814 1.00 51.62 C ATOM 6123 CE LYS B 327 -1.809 32.779 -1.890 1.00 51.98 C ATOM 6124 NZ LYS B 327 -1.073 33.747 -1.020 1.00 50.55 N ATOM 6125 HA LYS B 327 -7.142 32.103 0.493 1.00 0.00 H ATOM 6126 HB2 LYS B 327 -4.943 31.010 -0.170 1.00 0.00 H ATOM 6127 HB3 LYS B 327 -5.638 32.165 -1.331 1.00 0.00 H ATOM 6128 HG2 LYS B 327 -4.015 33.828 0.026 1.00 0.00 H ATOM 6129 HG3 LYS B 327 -3.120 32.305 0.235 1.00 0.00 H ATOM 6130 HD2 LYS B 327 -3.798 32.157 -2.417 1.00 0.00 H ATOM 6131 HD3 LYS B 327 -3.605 33.914 -2.214 1.00 0.00 H ATOM 6132 HE2 LYS B 327 -1.495 32.933 -2.923 1.00 0.00 H ATOM 6133 HE3 LYS B 327 -1.549 31.767 -1.580 1.00 0.00 H ATOM 6134 HZ1 LYS B 327 -1.304 34.718 -1.312 1.00 0.00 H ATOM 6135 HZ2 LYS B 327 -1.355 33.605 -0.029 1.00 0.00 H ATOM 6136 HZ3 LYS B 327 -0.050 33.589 -1.116 1.00 0.00 H ATOM 6137 H LYS B 327 -5.689 34.575 0.116 1.00 0.00 H ATOM 6138 N ASP B 328 -5.327 32.923 2.954 1.00 50.29 N ATOM 6139 CA ASP B 328 -4.762 32.584 4.262 1.00 51.12 C ATOM 6140 C ASP B 328 -5.747 32.741 5.412 1.00 51.61 C ATOM 6141 O ASP B 328 -5.807 31.885 6.308 1.00 51.80 O ATOM 6142 CB ASP B 328 -3.533 33.451 4.539 1.00 51.40 C ATOM 6143 CG ASP B 328 -2.418 33.225 3.533 1.00 52.01 C ATOM 6144 OD1 ASP B 328 -1.964 32.063 3.375 1.00 51.05 O ATOM 6145 OD2 ASP B 328 -2.000 34.226 2.906 1.00 53.10 O ATOM 6146 HA ASP B 328 -4.494 31.529 4.211 1.00 0.00 H ATOM 6147 HB2 ASP B 328 -3.830 34.499 4.502 1.00 0.00 H ATOM 6148 HB3 ASP B 328 -3.157 33.216 5.535 1.00 0.00 H ATOM 6149 H ASP B 328 -5.406 33.928 2.698 1.00 0.00 H ATOM 6150 N GLY B 329 -6.484 33.849 5.404 1.00 51.71 N ATOM 6151 CA GLY B 329 -7.519 34.086 6.396 1.00 52.02 C ATOM 6152 C GLY B 329 -8.425 35.254 6.059 1.00 52.48 C ATOM 6153 O GLY B 329 -8.478 35.707 4.905 1.00 52.49 O ATOM 6154 HA3 GLY B 329 -7.039 34.286 7.354 1.00 0.00 H ATOM 6155 HA2 GLY B 329 -8.130 33.187 6.478 1.00 0.00 H ATOM 6156 H GLY B 329 -6.315 34.564 4.668 1.00 0.00 H ATOM 6157 N MET B 330 -9.136 35.746 7.073 1.00 52.71 N ATOM 6158 CA MET B 330 -10.088 36.845 6.891 1.00 52.88 C ATOM 6159 C MET B 330 -9.955 37.942 7.940 1.00 53.38 C ATOM 6160 O MET B 330 -9.617 37.676 9.095 1.00 53.72 O ATOM 6161 CB MET B 330 -11.518 36.311 6.898 1.00 52.66 C ATOM 6162 CG MET B 330 -11.934 35.667 8.203 1.00 52.08 C ATOM 6163 SD MET B 330 -13.480 34.747 8.103 1.00 52.26 S ATOM 6164 CE MET B 330 -14.648 36.056 7.752 1.00 50.89 C ATOM 6165 HA MET B 330 -9.852 37.294 5.926 1.00 0.00 H ATOM 6166 HB2 MET B 330 -12.194 37.142 6.696 1.00 0.00 H ATOM 6167 HB3 MET B 330 -11.610 35.568 6.106 1.00 0.00 H ATOM 6168 HG2 MET B 330 -12.049 36.451 8.952 1.00 0.00 H ATOM 6169 HG3 MET B 330 -11.146 34.981 8.514 1.00 0.00 H ATOM 6170 HE1 MET B 330 -14.630 36.784 8.563 1.00 0.00 H ATOM 6171 HE2 MET B 330 -14.374 36.544 6.817 1.00 0.00 H ATOM 6172 HE3 MET B 330 -15.649 35.634 7.663 1.00 0.00 H ATOM 6173 H MET B 330 -9.012 35.338 8.021 1.00 0.00 H ATOM 6174 N LEU B 331 -10.233 39.175 7.540 1.00 53.66 N ATOM 6175 CA LEU B 331 -10.301 40.260 8.503 1.00 54.09 C ATOM 6176 C LEU B 331 -11.490 40.047 9.424 1.00 54.52 C ATOM 6177 O LEU B 331 -12.565 39.640 8.980 1.00 55.09 O ATOM 6178 CB LEU B 331 -10.411 41.620 7.810 1.00 53.98 C ATOM 6179 CG LEU B 331 -9.211 42.160 7.030 1.00 53.49 C ATOM 6180 CD1 LEU B 331 -9.576 43.491 6.428 1.00 53.31 C ATOM 6181 CD2 LEU B 331 -7.980 42.302 7.912 1.00 53.21 C ATOM 6182 HA LEU B 331 -9.379 40.258 9.085 1.00 0.00 H ATOM 6183 HB2 LEU B 331 -11.243 41.554 7.109 1.00 0.00 H ATOM 6184 HB3 LEU B 331 -10.645 42.353 8.582 1.00 0.00 H ATOM 6185 HG LEU B 331 -8.963 41.448 6.243 1.00 0.00 H ATOM 6186 HD21 LEU B 331 -8.197 42.992 8.728 1.00 0.00 H ATOM 6187 HD22 LEU B 331 -7.713 41.327 8.320 1.00 0.00 H ATOM 6188 HD23 LEU B 331 -7.152 42.688 7.318 1.00 0.00 H ATOM 6189 HD11 LEU B 331 -10.425 43.364 5.756 1.00 0.00 H ATOM 6190 HD12 LEU B 331 -9.842 44.187 7.223 1.00 0.00 H ATOM 6191 HD13 LEU B 331 -8.725 43.882 5.870 1.00 0.00 H ATOM 6192 H LEU B 331 -10.403 39.366 6.532 1.00 0.00 H ATOM 6193 N VAL B 332 -11.271 40.295 10.713 1.00 54.91 N ATOM 6194 CA VAL B 332 -12.325 40.283 11.721 1.00 54.69 C ATOM 6195 C VAL B 332 -12.233 41.547 12.571 1.00 55.00 C ATOM 6196 O VAL B 332 -11.413 42.433 12.301 1.00 54.92 O ATOM 6197 CB VAL B 332 -12.270 39.024 12.615 1.00 54.62 C ATOM 6198 CG1 VAL B 332 -12.707 37.777 11.841 1.00 54.06 C ATOM 6199 CG2 VAL B 332 -10.885 38.842 13.210 1.00 55.03 C ATOM 6200 HA VAL B 332 -13.283 40.258 11.201 1.00 0.00 H ATOM 6201 HB VAL B 332 -12.972 39.166 13.437 1.00 0.00 H ATOM 6202 HG11 VAL B 332 -13.730 37.910 11.488 1.00 0.00 H ATOM 6203 HG12 VAL B 332 -12.044 37.629 10.989 1.00 0.00 H ATOM 6204 HG13 VAL B 332 -12.658 36.908 12.497 1.00 0.00 H ATOM 6205 HG21 VAL B 332 -10.157 38.734 12.406 1.00 0.00 H ATOM 6206 HG22 VAL B 332 -10.633 39.713 13.815 1.00 0.00 H ATOM 6207 HG23 VAL B 332 -10.874 37.949 13.835 1.00 0.00 H ATOM 6208 H VAL B 332 -10.299 40.508 11.017 1.00 0.00 H ATOM 6209 N ALA B 333 -13.090 41.622 13.588 1.00 55.49 N ATOM 6210 CA ALA B 333 -13.184 42.767 14.486 1.00 55.71 C ATOM 6211 C ALA B 333 -12.961 44.102 13.769 1.00 56.11 C ATOM 6212 O ALA B 333 -11.983 44.807 14.016 1.00 56.12 O ATOM 6213 CB ALA B 333 -12.242 42.598 15.683 1.00 55.35 C ATOM 6214 HA ALA B 333 -14.207 42.797 14.862 1.00 0.00 H ATOM 6215 HB1 ALA B 333 -12.513 41.696 16.232 1.00 0.00 H ATOM 6216 HB2 ALA B 333 -11.215 42.513 15.327 1.00 0.00 H ATOM 6217 HB3 ALA B 333 -12.330 43.465 16.338 1.00 0.00 H ATOM 6218 H ALA B 333 -13.729 40.818 13.751 1.00 0.00 H ATOM 6219 N TYR B 334 -13.876 44.432 12.863 1.00 56.74 N ATOM 6220 CA TYR B 334 -13.926 45.765 12.247 1.00 57.75 C ATOM 6221 C TYR B 334 -12.627 46.093 11.527 1.00 58.05 C ATOM 6222 O TYR B 334 -12.348 47.252 11.230 1.00 58.12 O ATOM 6223 CB TYR B 334 -14.305 46.848 13.288 1.00 57.90 C ATOM 6224 CG TYR B 334 -15.498 46.429 14.120 1.00 58.59 C ATOM 6225 CD1 TYR B 334 -15.332 45.618 15.260 1.00 58.66 C ATOM 6226 CD2 TYR B 334 -16.797 46.792 13.750 1.00 58.84 C ATOM 6227 CE1 TYR B 334 -16.425 45.190 16.012 1.00 58.47 C ATOM 6228 CE2 TYR B 334 -17.903 46.374 14.505 1.00 58.81 C ATOM 6229 CZ TYR B 334 -17.704 45.573 15.631 1.00 58.66 C ATOM 6230 OH TYR B 334 -18.779 45.158 16.378 1.00 58.69 O ATOM 6231 HA TYR B 334 -14.712 45.756 11.492 1.00 0.00 H ATOM 6232 HB3 TYR B 334 -14.546 47.773 12.764 1.00 0.00 H ATOM 6233 HB2 TYR B 334 -13.455 47.017 13.949 1.00 0.00 H ATOM 6234 HD2 TYR B 334 -16.952 47.407 12.864 1.00 0.00 H ATOM 6235 HE2 TYR B 334 -18.910 46.672 14.215 1.00 0.00 H ATOM 6236 HE1 TYR B 334 -16.277 44.561 16.890 1.00 0.00 H ATOM 6237 HD1 TYR B 334 -14.328 45.319 15.560 1.00 0.00 H ATOM 6238 HH TYR B 334 -19.388 44.624 15.809 1.00 0.00 H ATOM 6239 H TYR B 334 -14.581 43.722 12.580 1.00 0.00 H ATOM 6240 N GLY B 335 -11.848 45.052 11.244 1.00 58.58 N ATOM 6241 CA GLY B 335 -10.622 45.174 10.465 1.00 59.19 C ATOM 6242 C GLY B 335 -9.379 44.914 11.284 1.00 59.66 C ATOM 6243 O GLY B 335 -8.354 44.488 10.748 1.00 59.93 O ATOM 6244 HA3 GLY B 335 -10.567 46.184 10.058 1.00 0.00 H ATOM 6245 HA2 GLY B 335 -10.656 44.455 9.646 1.00 0.00 H ATOM 6246 H GLY B 335 -12.125 44.112 11.593 1.00 0.00 H ATOM 6247 N ASN B 336 -9.479 45.166 12.587 1.00 59.92 N ATOM 6248 CA ASN B 336 -8.324 45.140 13.491 1.00 60.10 C ATOM 6249 C ASN B 336 -7.804 43.734 13.814 1.00 60.36 C ATOM 6250 O ASN B 336 -6.718 43.583 14.389 1.00 60.41 O ATOM 6251 CB ASN B 336 -8.636 45.910 14.786 1.00 59.95 C ATOM 6252 CG ASN B 336 -9.143 47.331 14.531 1.00 59.85 C ATOM 6253 OD1 ASN B 336 -10.084 47.784 15.186 1.00 59.48 O ATOM 6254 ND2 ASN B 336 -8.515 48.040 13.588 1.00 59.14 N ATOM 6255 HA ASN B 336 -7.517 45.634 12.950 1.00 0.00 H ATOM 6256 HB2 ASN B 336 -9.399 45.363 15.340 1.00 0.00 H ATOM 6257 HB3 ASN B 336 -7.726 45.968 15.384 1.00 0.00 H ATOM 6258 HD22 ASN B 336 -7.725 47.618 13.059 1.00 0.00 H ATOM 6259 HD21 ASN B 336 -8.816 49.014 13.383 1.00 0.00 H ATOM 6260 H ASN B 336 -10.415 45.391 12.981 1.00 0.00 H ATOM 6261 N GLY B 337 -8.582 42.715 13.447 1.00 60.60 N ATOM 6262 CA GLY B 337 -8.192 41.311 13.646 1.00 61.06 C ATOM 6263 C GLY B 337 -7.983 40.530 12.349 1.00 61.23 C ATOM 6264 O GLY B 337 -8.313 41.012 11.258 1.00 61.08 O ATOM 6265 HA3 GLY B 337 -8.975 40.816 14.221 1.00 0.00 H ATOM 6266 HA2 GLY B 337 -7.260 41.291 14.211 1.00 0.00 H ATOM 6267 H GLY B 337 -9.500 42.921 13.003 1.00 0.00 H ATOM 6268 N PHE B 338 -7.429 39.324 12.477 1.00 61.39 N ATOM 6269 CA PHE B 338 -7.156 38.443 11.341 1.00 61.55 C ATOM 6270 C PHE B 338 -7.075 37.009 11.821 1.00 61.68 C ATOM 6271 O PHE B 338 -6.327 36.715 12.756 1.00 61.86 O ATOM 6272 CB PHE B 338 -5.847 38.826 10.654 1.00 61.62 C ATOM 6273 CG PHE B 338 -5.597 38.084 9.373 1.00 62.11 C ATOM 6274 CD1 PHE B 338 -6.244 38.453 8.202 1.00 62.72 C ATOM 6275 CD2 PHE B 338 -4.711 37.014 9.336 1.00 62.39 C ATOM 6276 CE1 PHE B 338 -6.016 37.758 7.017 1.00 62.59 C ATOM 6277 CE2 PHE B 338 -4.480 36.324 8.161 1.00 62.36 C ATOM 6278 CZ PHE B 338 -5.133 36.702 6.998 1.00 62.21 C ATOM 6279 HA PHE B 338 -7.967 38.548 10.620 1.00 0.00 H ATOM 6280 HB2 PHE B 338 -5.873 39.893 10.434 1.00 0.00 H ATOM 6281 HB3 PHE B 338 -5.025 38.617 11.339 1.00 0.00 H ATOM 6282 HD2 PHE B 338 -4.191 36.715 10.246 1.00 0.00 H ATOM 6283 HE2 PHE B 338 -3.786 35.484 8.149 1.00 0.00 H ATOM 6284 HZ PHE B 338 -4.947 36.163 6.069 1.00 0.00 H ATOM 6285 HE1 PHE B 338 -6.536 38.050 6.105 1.00 0.00 H ATOM 6286 HD1 PHE B 338 -6.937 39.294 8.210 1.00 0.00 H ATOM 6287 H PHE B 338 -7.179 38.993 13.431 1.00 0.00 H ATOM 6288 N ILE B 339 -7.839 36.122 11.181 1.00 61.80 N ATOM 6289 CA ILE B 339 -7.929 34.716 11.606 1.00 61.86 C ATOM 6290 C ILE B 339 -7.591 33.745 10.459 1.00 62.05 C ATOM 6291 O ILE B 339 -8.187 33.828 9.379 1.00 62.25 O ATOM 6292 CB ILE B 339 -9.320 34.410 12.265 1.00 61.77 C ATOM 6293 CG1 ILE B 339 -9.248 33.196 13.188 1.00 61.12 C ATOM 6294 CG2 ILE B 339 -10.448 34.271 11.225 1.00 61.66 C ATOM 6295 CD1 ILE B 339 -10.423 33.123 14.140 1.00 60.40 C ATOM 6296 HA ILE B 339 -7.172 34.553 12.373 1.00 0.00 H ATOM 6297 HB ILE B 339 -9.572 35.275 12.879 1.00 0.00 H ATOM 6298 HG12 ILE B 339 -9.235 32.293 12.578 1.00 0.00 H ATOM 6299 HG13 ILE B 339 -8.328 33.253 13.770 1.00 0.00 H ATOM 6300 HD11 ILE B 339 -10.441 34.018 14.762 1.00 0.00 H ATOM 6301 HD12 ILE B 339 -11.349 33.057 13.568 1.00 0.00 H ATOM 6302 HD13 ILE B 339 -10.322 32.241 14.773 1.00 0.00 H ATOM 6303 HG21 ILE B 339 -10.539 35.201 10.663 1.00 0.00 H ATOM 6304 HG22 ILE B 339 -10.213 33.454 10.542 1.00 0.00 H ATOM 6305 HG23 ILE B 339 -11.387 34.060 11.736 1.00 0.00 H ATOM 6306 H ILE B 339 -8.389 36.434 10.355 1.00 0.00 H ATOM 6307 N THR B 340 -6.636 32.838 10.696 1.00 62.06 N ATOM 6308 CA THR B 340 -6.130 31.952 9.636 1.00 61.91 C ATOM 6309 C THR B 340 -7.148 30.895 9.243 1.00 62.00 C ATOM 6310 O THR B 340 -7.760 30.253 10.106 1.00 61.75 O ATOM 6311 CB THR B 340 -4.790 31.233 9.985 1.00 61.79 C ATOM 6312 OG1 THR B 340 -5.010 30.278 11.026 1.00 61.81 O ATOM 6313 CG2 THR B 340 -3.698 32.212 10.387 1.00 61.12 C ATOM 6314 HA THR B 340 -5.941 32.627 8.801 1.00 0.00 H ATOM 6315 HB THR B 340 -4.445 30.722 9.086 1.00 0.00 H ATOM 6316 HG1 THR B 340 -5.673 29.608 10.723 1.00 0.00 H ATOM 6317 HG23 THR B 340 -3.543 32.932 9.583 1.00 0.00 H ATOM 6318 HG21 THR B 340 -3.998 32.737 11.294 1.00 0.00 H ATOM 6319 HG22 THR B 340 -2.772 31.666 10.571 1.00 0.00 H ATOM 6320 H THR B 340 -6.241 32.757 11.655 1.00 0.00 H ATOM 6321 N ARG B 341 -7.308 30.734 7.930 1.00 62.03 N ATOM 6322 CA ARG B 341 -8.136 29.694 7.341 1.00 62.20 C ATOM 6323 C ARG B 341 -7.650 28.363 7.858 1.00 63.23 C ATOM 6324 O ARG B 341 -8.430 27.558 8.366 1.00 63.50 O ATOM 6325 CB ARG B 341 -7.994 29.739 5.826 1.00 61.68 C ATOM 6326 CG ARG B 341 -8.685 28.629 5.075 1.00 59.15 C ATOM 6327 CD ARG B 341 -8.370 28.808 3.620 1.00 55.15 C ATOM 6328 NE ARG B 341 -9.170 27.964 2.746 1.00 50.50 N ATOM 6329 CZ ARG B 341 -9.130 28.037 1.423 1.00 48.36 C ATOM 6330 NH1 ARG B 341 -8.336 28.920 0.816 1.00 46.08 N ATOM 6331 NH2 ARG B 341 -9.892 27.225 0.710 1.00 48.38 N ATOM 6332 HA ARG B 341 -9.184 29.840 7.604 1.00 0.00 H ATOM 6333 HB2 ARG B 341 -8.405 30.687 5.478 1.00 0.00 H ATOM 6334 HB3 ARG B 341 -6.931 29.696 5.587 1.00 0.00 H ATOM 6335 HG2 ARG B 341 -8.319 27.662 5.419 1.00 0.00 H ATOM 6336 HG3 ARG B 341 -9.762 28.686 5.233 1.00 0.00 H ATOM 6337 HD2 ARG B 341 -7.318 28.570 3.462 1.00 0.00 H ATOM 6338 HD3 ARG B 341 -8.549 29.850 3.353 1.00 0.00 H ATOM 6339 HE ARG B 341 -9.807 27.267 3.182 1.00 0.00 H ATOM 6340 HH12 ARG B 341 -8.312 28.970 -0.223 1.00 0.00 H ATOM 6341 HH11 ARG B 341 -7.741 29.559 1.381 1.00 0.00 H ATOM 6342 HH22 ARG B 341 -9.871 27.271 -0.329 1.00 0.00 H ATOM 6343 HH21 ARG B 341 -10.512 26.541 1.188 1.00 0.00 H ATOM 6344 H ARG B 341 -6.813 31.389 7.291 1.00 0.00 H ATOM 6345 N GLU B 342 -6.348 28.147 7.688 1.00 64.36 N ATOM 6346 CA GLU B 342 -5.593 27.104 8.360 1.00 65.69 C ATOM 6347 C GLU B 342 -6.177 26.794 9.754 1.00 65.95 C ATOM 6348 O GLU B 342 -6.703 25.697 9.980 1.00 66.02 O ATOM 6349 CB GLU B 342 -4.145 27.582 8.458 1.00 65.71 C ATOM 6350 CG GLU B 342 -3.109 26.540 8.838 1.00 66.90 C ATOM 6351 CD GLU B 342 -1.702 27.137 8.906 1.00 66.77 C ATOM 6352 OE1 GLU B 342 -1.564 28.365 8.668 1.00 67.83 O ATOM 6353 OE2 GLU B 342 -0.741 26.383 9.193 1.00 67.70 O ATOM 6354 HA GLU B 342 -5.648 26.174 7.794 1.00 0.00 H ATOM 6355 HB2 GLU B 342 -3.864 27.989 7.486 1.00 0.00 H ATOM 6356 HB3 GLU B 342 -4.108 28.374 9.206 1.00 0.00 H ATOM 6357 HG2 GLU B 342 -3.365 26.127 9.814 1.00 0.00 H ATOM 6358 HG3 GLU B 342 -3.119 25.744 8.094 1.00 0.00 H ATOM 6359 H GLU B 342 -5.836 28.767 7.029 1.00 0.00 H ATOM 6360 N PHE B 343 -6.117 27.772 10.664 1.00 66.42 N ATOM 6361 CA PHE B 343 -6.663 27.621 12.021 1.00 67.01 C ATOM 6362 C PHE B 343 -8.146 27.203 12.044 1.00 67.17 C ATOM 6363 O PHE B 343 -8.541 26.356 12.854 1.00 67.19 O ATOM 6364 CB PHE B 343 -6.399 28.890 12.860 1.00 67.25 C ATOM 6365 CG PHE B 343 -7.031 28.877 14.239 1.00 68.35 C ATOM 6366 CD1 PHE B 343 -7.032 27.720 15.032 1.00 68.76 C ATOM 6367 CD2 PHE B 343 -7.600 30.041 14.760 1.00 68.80 C ATOM 6368 CE1 PHE B 343 -7.620 27.714 16.303 1.00 68.37 C ATOM 6369 CE2 PHE B 343 -8.186 30.045 16.034 1.00 68.24 C ATOM 6370 CZ PHE B 343 -8.195 28.878 16.804 1.00 68.07 C ATOM 6371 HA PHE B 343 -6.129 26.791 12.484 1.00 0.00 H ATOM 6372 HB2 PHE B 343 -5.321 29.000 12.980 1.00 0.00 H ATOM 6373 HB3 PHE B 343 -6.792 29.747 12.313 1.00 0.00 H ATOM 6374 HD2 PHE B 343 -7.589 30.957 14.170 1.00 0.00 H ATOM 6375 HE2 PHE B 343 -8.635 30.958 16.424 1.00 0.00 H ATOM 6376 HZ PHE B 343 -8.651 28.880 17.794 1.00 0.00 H ATOM 6377 HE1 PHE B 343 -7.627 26.801 16.898 1.00 0.00 H ATOM 6378 HD1 PHE B 343 -6.567 26.810 14.652 1.00 0.00 H ATOM 6379 H PHE B 343 -5.668 28.673 10.402 1.00 0.00 H ATOM 6380 N LEU B 344 -8.955 27.767 11.146 1.00 67.41 N ATOM 6381 CA LEU B 344 -10.374 27.402 11.067 1.00 67.46 C ATOM 6382 C LEU B 344 -10.571 25.963 10.578 1.00 67.78 C ATOM 6383 O LEU B 344 -11.552 25.316 10.940 1.00 67.52 O ATOM 6384 CB LEU B 344 -11.161 28.401 10.209 1.00 67.41 C ATOM 6385 CG LEU B 344 -11.175 29.880 10.633 1.00 66.91 C ATOM 6386 CD1 LEU B 344 -11.750 30.761 9.542 1.00 66.69 C ATOM 6387 CD2 LEU B 344 -11.941 30.103 11.918 1.00 66.98 C ATOM 6388 HA LEU B 344 -10.774 27.450 12.080 1.00 0.00 H ATOM 6389 HB2 LEU B 344 -10.746 28.358 9.202 1.00 0.00 H ATOM 6390 HB3 LEU B 344 -12.197 28.062 10.188 1.00 0.00 H ATOM 6391 HG LEU B 344 -10.135 30.156 10.806 1.00 0.00 H ATOM 6392 HD21 LEU B 344 -12.974 29.780 11.785 1.00 0.00 H ATOM 6393 HD22 LEU B 344 -11.479 29.526 12.719 1.00 0.00 H ATOM 6394 HD23 LEU B 344 -11.920 31.163 12.173 1.00 0.00 H ATOM 6395 HD11 LEU B 344 -11.144 30.664 8.641 1.00 0.00 H ATOM 6396 HD12 LEU B 344 -12.773 30.451 9.328 1.00 0.00 H ATOM 6397 HD13 LEU B 344 -11.745 31.799 9.875 1.00 0.00 H ATOM 6398 H LEU B 344 -8.573 28.478 10.490 1.00 0.00 H ATOM 6399 N LYS B 345 -9.630 25.471 9.769 1.00 68.34 N ATOM 6400 CA LYS B 345 -9.624 24.068 9.342 1.00 68.87 C ATOM 6401 C LYS B 345 -9.184 23.180 10.495 1.00 69.14 C ATOM 6402 O LYS B 345 -9.689 22.068 10.667 1.00 68.92 O ATOM 6403 CB LYS B 345 -8.675 23.843 8.157 1.00 68.97 C ATOM 6404 CG LYS B 345 -9.130 24.426 6.825 1.00 69.27 C ATOM 6405 CD LYS B 345 -8.364 23.830 5.635 1.00 68.93 C ATOM 6406 CE LYS B 345 -9.053 22.591 5.076 1.00 68.32 C ATOM 6407 NZ LYS B 345 -8.408 22.139 3.817 1.00 68.20 N ATOM 6408 HA LYS B 345 -10.637 23.815 9.031 1.00 0.00 H ATOM 6409 HB2 LYS B 345 -7.714 24.291 8.408 1.00 0.00 H ATOM 6410 HB3 LYS B 345 -8.550 22.768 8.027 1.00 0.00 H ATOM 6411 HG2 LYS B 345 -10.193 24.220 6.697 1.00 0.00 H ATOM 6412 HG3 LYS B 345 -8.970 25.504 6.841 1.00 0.00 H ATOM 6413 HD2 LYS B 345 -8.296 24.581 4.848 1.00 0.00 H ATOM 6414 HD3 LYS B 345 -7.361 23.558 5.963 1.00 0.00 H ATOM 6415 HE2 LYS B 345 -10.099 22.825 4.876 1.00 0.00 H ATOM 6416 HE3 LYS B 345 -8.996 21.790 5.813 1.00 0.00 H ATOM 6417 HZ1 LYS B 345 -8.464 22.898 3.108 1.00 0.00 H ATOM 6418 HZ2 LYS B 345 -7.411 21.909 4.003 1.00 0.00 H ATOM 6419 HZ3 LYS B 345 -8.899 21.294 3.461 1.00 0.00 H ATOM 6420 H LYS B 345 -8.877 26.103 9.431 1.00 0.00 H ATOM 6421 N SER B 346 -8.242 23.686 11.289 1.00 69.65 N ATOM 6422 CA SER B 346 -7.674 22.918 12.395 1.00 70.22 C ATOM 6423 C SER B 346 -8.559 22.895 13.651 1.00 70.63 C ATOM 6424 O SER B 346 -8.062 22.733 14.763 1.00 70.89 O ATOM 6425 CB SER B 346 -6.249 23.397 12.717 1.00 70.17 C ATOM 6426 OG SER B 346 -6.247 24.586 13.488 1.00 69.94 O ATOM 6427 HA SER B 346 -7.627 21.883 12.055 1.00 0.00 H ATOM 6428 HB2 SER B 346 -5.721 23.583 11.782 1.00 0.00 H ATOM 6429 HB3 SER B 346 -5.733 22.615 13.275 1.00 0.00 H ATOM 6430 HG SER B 346 -6.708 25.304 12.986 1.00 0.00 H ATOM 6431 H SER B 346 -7.902 24.654 11.117 1.00 0.00 H ATOM 6432 N LEU B 347 -9.863 23.071 13.467 1.00 71.09 N ATOM 6433 CA LEU B 347 -10.838 22.854 14.529 1.00 71.53 C ATOM 6434 C LEU B 347 -11.486 21.518 14.202 1.00 71.82 C ATOM 6435 O LEU B 347 -11.135 20.911 13.200 1.00 71.71 O ATOM 6436 CB LEU B 347 -11.870 23.992 14.583 1.00 71.59 C ATOM 6437 CG LEU B 347 -11.370 25.453 14.572 1.00 71.90 C ATOM 6438 CD1 LEU B 347 -12.534 26.442 14.555 1.00 72.05 C ATOM 6439 CD2 LEU B 347 -10.428 25.777 15.730 1.00 71.94 C ATOM 6440 HA LEU B 347 -10.373 22.843 15.515 1.00 0.00 H ATOM 6441 HB2 LEU B 347 -12.525 23.871 13.720 1.00 0.00 H ATOM 6442 HB3 LEU B 347 -12.447 23.858 15.498 1.00 0.00 H ATOM 6443 HG LEU B 347 -10.797 25.559 13.651 1.00 0.00 H ATOM 6444 HD21 LEU B 347 -10.946 25.613 16.675 1.00 0.00 H ATOM 6445 HD22 LEU B 347 -9.553 25.129 15.677 1.00 0.00 H ATOM 6446 HD23 LEU B 347 -10.115 26.819 15.661 1.00 0.00 H ATOM 6447 HD11 LEU B 347 -13.137 26.276 13.662 1.00 0.00 H ATOM 6448 HD12 LEU B 347 -13.148 26.293 15.443 1.00 0.00 H ATOM 6449 HD13 LEU B 347 -12.144 27.460 14.548 1.00 0.00 H ATOM 6450 H LEU B 347 -10.201 23.375 12.531 1.00 0.00 H ATOM 6451 N ARG B 348 -12.415 21.054 15.034 1.00 72.40 N ATOM 6452 CA ARG B 348 -12.985 19.714 14.854 1.00 73.16 C ATOM 6453 C ARG B 348 -14.276 19.736 14.055 1.00 73.02 C ATOM 6454 O ARG B 348 -14.802 20.803 13.754 1.00 73.34 O ATOM 6455 CB ARG B 348 -13.225 19.033 16.208 1.00 73.19 C ATOM 6456 CG ARG B 348 -14.397 19.599 17.011 1.00 74.22 C ATOM 6457 CD ARG B 348 -14.750 18.697 18.190 1.00 74.08 C ATOM 6458 NE ARG B 348 -15.230 19.460 19.347 1.00 75.87 N ATOM 6459 CZ ARG B 348 -16.503 19.534 19.736 1.00 76.41 C ATOM 6460 NH1 ARG B 348 -17.459 18.892 19.065 1.00 76.79 N ATOM 6461 NH2 ARG B 348 -16.819 20.253 20.808 1.00 75.99 N ATOM 6462 HA ARG B 348 -12.252 19.140 14.286 1.00 0.00 H ATOM 6463 HB2 ARG B 348 -13.417 17.975 16.027 1.00 0.00 H ATOM 6464 HB3 ARG B 348 -12.320 19.140 16.807 1.00 0.00 H ATOM 6465 HG2 ARG B 348 -14.126 20.586 17.387 1.00 0.00 H ATOM 6466 HG3 ARG B 348 -15.266 19.686 16.358 1.00 0.00 H ATOM 6467 HD2 ARG B 348 -13.862 18.137 18.482 1.00 0.00 H ATOM 6468 HD3 ARG B 348 -15.530 18.002 17.879 1.00 0.00 H ATOM 6469 HE ARG B 348 -14.525 19.982 19.905 1.00 0.00 H ATOM 6470 HH12 ARG B 348 -18.448 18.958 19.379 1.00 0.00 H ATOM 6471 HH11 ARG B 348 -17.216 18.325 18.228 1.00 0.00 H ATOM 6472 HH22 ARG B 348 -17.810 20.316 21.118 1.00 0.00 H ATOM 6473 HH21 ARG B 348 -16.076 20.753 21.337 1.00 0.00 H ATOM 6474 H ARG B 348 -12.741 21.649 15.822 1.00 0.00 H ATOM 6475 N LYS B 349 -14.783 18.553 13.722 1.00 72.97 N ATOM 6476 CA LYS B 349 -16.099 18.431 13.100 1.00 73.01 C ATOM 6477 C LYS B 349 -17.216 18.830 14.061 1.00 72.71 C ATOM 6478 O LYS B 349 -17.090 18.636 15.270 1.00 72.96 O ATOM 6479 CB LYS B 349 -16.348 17.007 12.600 1.00 73.02 C ATOM 6480 CG LYS B 349 -15.567 16.664 11.352 1.00 74.08 C ATOM 6481 CD LYS B 349 -16.329 15.704 10.449 1.00 74.64 C ATOM 6482 CE LYS B 349 -15.589 15.483 9.129 1.00 74.73 C ATOM 6483 NZ LYS B 349 -15.519 16.714 8.283 1.00 75.28 N ATOM 6484 HA LYS B 349 -16.107 19.114 12.251 1.00 0.00 H ATOM 6485 HB2 LYS B 349 -16.065 16.309 13.388 1.00 0.00 H ATOM 6486 HB3 LYS B 349 -17.411 16.897 12.384 1.00 0.00 H ATOM 6487 HG2 LYS B 349 -15.365 17.582 10.800 1.00 0.00 H ATOM 6488 HG3 LYS B 349 -14.624 16.201 11.643 1.00 0.00 H ATOM 6489 HD2 LYS B 349 -16.440 14.747 10.959 1.00 0.00 H ATOM 6490 HD3 LYS B 349 -17.315 16.119 10.239 1.00 0.00 H ATOM 6491 HE2 LYS B 349 -16.106 14.705 8.567 1.00 0.00 H ATOM 6492 HE3 LYS B 349 -14.573 15.156 9.351 1.00 0.00 H ATOM 6493 HZ1 LYS B 349 -16.483 17.032 8.055 1.00 0.00 H ATOM 6494 HZ2 LYS B 349 -15.019 17.463 8.804 1.00 0.00 H ATOM 6495 HZ3 LYS B 349 -15.006 16.500 7.404 1.00 0.00 H ATOM 6496 H LYS B 349 -14.229 17.693 13.909 1.00 0.00 H ATOM 6497 N PRO B 350 -18.301 19.420 13.527 1.00 72.34 N ATOM 6498 CA PRO B 350 -18.374 19.915 12.163 1.00 71.82 C ATOM 6499 C PRO B 350 -18.024 21.400 12.073 1.00 71.18 C ATOM 6500 O PRO B 350 -18.260 22.017 11.041 1.00 71.39 O ATOM 6501 CB PRO B 350 -19.841 19.669 11.780 1.00 71.82 C ATOM 6502 CG PRO B 350 -20.569 19.334 13.090 1.00 72.28 C ATOM 6503 CD PRO B 350 -19.594 19.577 14.207 1.00 72.50 C ATOM 6504 HA PRO B 350 -17.664 19.420 11.500 1.00 0.00 H ATOM 6505 HD3 PRO B 350 -19.706 20.580 14.619 1.00 0.00 H ATOM 6506 HD2 PRO B 350 -19.714 18.843 15.004 1.00 0.00 H ATOM 6507 HG3 PRO B 350 -20.884 18.291 13.088 1.00 0.00 H ATOM 6508 HG2 PRO B 350 -21.442 19.976 13.208 1.00 0.00 H ATOM 6509 HB2 PRO B 350 -20.269 20.563 11.326 1.00 0.00 H ATOM 6510 HB3 PRO B 350 -19.916 18.836 11.081 1.00 0.00 H ATOM 6511 N PHE B 351 -17.437 21.947 13.134 1.00 70.38 N ATOM 6512 CA PHE B 351 -17.089 23.376 13.219 1.00 69.76 C ATOM 6513 C PHE B 351 -16.130 23.896 12.142 1.00 69.03 C ATOM 6514 O PHE B 351 -16.194 25.065 11.755 1.00 68.92 O ATOM 6515 CB PHE B 351 -16.504 23.698 14.597 1.00 70.03 C ATOM 6516 CG PHE B 351 -17.532 23.826 15.684 1.00 70.67 C ATOM 6517 CD1 PHE B 351 -18.203 22.700 16.169 1.00 71.14 C ATOM 6518 CD2 PHE B 351 -17.823 25.074 16.232 1.00 71.35 C ATOM 6519 CE1 PHE B 351 -19.148 22.813 17.175 1.00 71.17 C ATOM 6520 CE2 PHE B 351 -18.768 25.202 17.246 1.00 71.53 C ATOM 6521 CZ PHE B 351 -19.433 24.066 17.719 1.00 71.57 C ATOM 6522 HA PHE B 351 -18.034 23.891 13.048 1.00 0.00 H ATOM 6523 HB2 PHE B 351 -15.813 22.901 14.871 1.00 0.00 H ATOM 6524 HB3 PHE B 351 -15.960 24.640 14.527 1.00 0.00 H ATOM 6525 HD2 PHE B 351 -17.305 25.959 15.863 1.00 0.00 H ATOM 6526 HE2 PHE B 351 -18.989 26.182 17.669 1.00 0.00 H ATOM 6527 HZ PHE B 351 -20.174 24.160 18.513 1.00 0.00 H ATOM 6528 HE1 PHE B 351 -19.667 21.927 17.540 1.00 0.00 H ATOM 6529 HD1 PHE B 351 -17.979 21.719 15.750 1.00 0.00 H ATOM 6530 H PHE B 351 -17.212 21.335 13.944 1.00 0.00 H ATOM 6531 N CYS B 352 -15.227 23.042 11.677 1.00 68.12 N ATOM 6532 CA CYS B 352 -14.230 23.470 10.697 1.00 67.17 C ATOM 6533 C CYS B 352 -14.749 23.312 9.274 1.00 66.17 C ATOM 6534 O CYS B 352 -14.094 23.726 8.316 1.00 66.01 O ATOM 6535 CB CYS B 352 -12.923 22.704 10.888 1.00 67.40 C ATOM 6536 SG CYS B 352 -13.128 20.925 10.900 1.00 67.69 S ATOM 6537 HA CYS B 352 -14.033 24.529 10.861 1.00 0.00 H ATOM 6538 HB2 CYS B 352 -12.482 23.007 11.838 1.00 0.00 H ATOM 6539 HB3 CYS B 352 -12.247 22.968 10.075 1.00 0.00 H ATOM 6540 HG CYS B 352 -13.970 20.568 11.933 1.00 0.00 H ATOM 6541 H CYS B 352 -15.229 22.058 12.013 1.00 0.00 H ATOM 6542 N ASP B 353 -15.931 22.710 9.155 1.00 64.94 N ATOM 6543 CA ASP B 353 -16.631 22.592 7.877 1.00 63.77 C ATOM 6544 C ASP B 353 -17.474 23.826 7.547 1.00 62.71 C ATOM 6545 O ASP B 353 -18.037 23.918 6.455 1.00 63.00 O ATOM 6546 CB ASP B 353 -17.514 21.344 7.862 1.00 63.81 C ATOM 6547 CG ASP B 353 -16.725 20.067 7.666 1.00 64.17 C ATOM 6548 OD1 ASP B 353 -17.359 18.992 7.645 1.00 64.61 O ATOM 6549 OD2 ASP B 353 -15.483 20.128 7.530 1.00 64.91 O ATOM 6550 HA ASP B 353 -15.862 22.508 7.109 1.00 0.00 H ATOM 6551 HB2 ASP B 353 -18.046 21.282 8.811 1.00 0.00 H ATOM 6552 HB3 ASP B 353 -18.234 21.437 7.049 1.00 0.00 H ATOM 6553 H ASP B 353 -16.374 22.308 10.006 1.00 0.00 H ATOM 6554 N ILE B 354 -17.550 24.769 8.484 1.00 61.23 N ATOM 6555 CA ILE B 354 -18.362 25.971 8.319 1.00 59.72 C ATOM 6556 C ILE B 354 -17.714 26.943 7.352 1.00 58.60 C ATOM 6557 O ILE B 354 -18.287 27.275 6.316 1.00 58.67 O ATOM 6558 CB ILE B 354 -18.584 26.714 9.658 1.00 59.81 C ATOM 6559 CG1 ILE B 354 -19.271 25.813 10.682 1.00 60.08 C ATOM 6560 CG2 ILE B 354 -19.406 27.980 9.443 1.00 59.71 C ATOM 6561 CD1 ILE B 354 -19.151 26.325 12.107 1.00 61.27 C ATOM 6562 HA ILE B 354 -19.322 25.631 7.930 1.00 0.00 H ATOM 6563 HB ILE B 354 -17.604 26.992 10.047 1.00 0.00 H ATOM 6564 HG12 ILE B 354 -20.328 25.742 10.427 1.00 0.00 H ATOM 6565 HG13 ILE B 354 -18.819 24.822 10.630 1.00 0.00 H ATOM 6566 HD11 ILE B 354 -18.098 26.391 12.380 1.00 0.00 H ATOM 6567 HD12 ILE B 354 -19.609 27.312 12.177 1.00 0.00 H ATOM 6568 HD13 ILE B 354 -19.661 25.638 12.783 1.00 0.00 H ATOM 6569 HG21 ILE B 354 -18.879 28.642 8.756 1.00 0.00 H ATOM 6570 HG22 ILE B 354 -20.376 27.715 9.022 1.00 0.00 H ATOM 6571 HG23 ILE B 354 -19.549 28.485 10.398 1.00 0.00 H ATOM 6572 H ILE B 354 -17.012 24.645 9.365 1.00 0.00 H ATOM 6573 N MET B 355 -16.514 27.389 7.700 1.00 57.23 N ATOM 6574 CA MET B 355 -15.894 28.534 7.037 1.00 55.93 C ATOM 6575 C MET B 355 -15.132 28.227 5.755 1.00 54.93 C ATOM 6576 O MET B 355 -14.947 29.108 4.917 1.00 55.33 O ATOM 6577 CB MET B 355 -15.012 29.296 8.022 1.00 55.82 C ATOM 6578 CG MET B 355 -15.832 30.119 8.998 1.00 56.23 C ATOM 6579 SD MET B 355 -17.162 31.041 8.177 1.00 55.90 S ATOM 6580 CE MET B 355 -16.240 32.385 7.443 1.00 54.27 C ATOM 6581 HA MET B 355 -16.728 29.154 6.709 1.00 0.00 H ATOM 6582 HB2 MET B 355 -14.410 28.581 8.583 1.00 0.00 H ATOM 6583 HB3 MET B 355 -14.355 29.963 7.464 1.00 0.00 H ATOM 6584 HG2 MET B 355 -15.173 30.827 9.500 1.00 0.00 H ATOM 6585 HG3 MET B 355 -16.274 29.450 9.736 1.00 0.00 H ATOM 6586 HE1 MET B 355 -15.738 32.950 8.228 1.00 0.00 H ATOM 6587 HE2 MET B 355 -15.499 31.981 6.753 1.00 0.00 H ATOM 6588 HE3 MET B 355 -16.923 33.040 6.902 1.00 0.00 H ATOM 6589 H MET B 355 -16.000 26.910 8.467 1.00 0.00 H ATOM 6590 N GLU B 356 -14.694 26.982 5.601 1.00 53.49 N ATOM 6591 CA GLU B 356 -13.965 26.571 4.413 1.00 51.65 C ATOM 6592 C GLU B 356 -14.757 26.870 3.124 1.00 50.32 C ATOM 6593 O GLU B 356 -14.261 27.616 2.276 1.00 50.14 O ATOM 6594 CB GLU B 356 -13.525 25.104 4.526 1.00 51.78 C ATOM 6595 CG GLU B 356 -12.435 24.688 3.558 1.00 52.32 C ATOM 6596 CD GLU B 356 -11.255 25.648 3.530 1.00 53.61 C ATOM 6597 OE1 GLU B 356 -10.888 26.211 4.584 1.00 54.07 O ATOM 6598 OE2 GLU B 356 -10.682 25.841 2.440 1.00 54.16 O ATOM 6599 HA GLU B 356 -13.056 27.168 4.344 1.00 0.00 H ATOM 6600 HB2 GLU B 356 -13.160 24.937 5.539 1.00 0.00 H ATOM 6601 HB3 GLU B 356 -14.396 24.474 4.346 1.00 0.00 H ATOM 6602 HG2 GLU B 356 -12.072 23.702 3.848 1.00 0.00 H ATOM 6603 HG3 GLU B 356 -12.863 24.636 2.557 1.00 0.00 H ATOM 6604 H GLU B 356 -14.878 26.284 6.350 1.00 0.00 H ATOM 6605 N PRO B 357 -15.997 26.331 2.988 1.00 48.87 N ATOM 6606 CA PRO B 357 -16.730 26.496 1.721 1.00 47.63 C ATOM 6607 C PRO B 357 -16.826 27.942 1.236 1.00 46.61 C ATOM 6608 O PRO B 357 -16.870 28.180 0.023 1.00 46.59 O ATOM 6609 CB PRO B 357 -18.118 25.949 2.042 1.00 47.59 C ATOM 6610 CG PRO B 357 -17.890 24.972 3.156 1.00 48.36 C ATOM 6611 CD PRO B 357 -16.777 25.548 3.969 1.00 48.70 C ATOM 6612 HA PRO B 357 -16.217 25.982 0.908 1.00 0.00 H ATOM 6613 HD3 PRO B 357 -17.165 26.190 4.760 1.00 0.00 H ATOM 6614 HD2 PRO B 357 -16.168 24.759 4.410 1.00 0.00 H ATOM 6615 HG3 PRO B 357 -17.607 23.998 2.757 1.00 0.00 H ATOM 6616 HG2 PRO B 357 -18.790 24.867 3.762 1.00 0.00 H ATOM 6617 HB2 PRO B 357 -18.783 26.751 2.363 1.00 0.00 H ATOM 6618 HB3 PRO B 357 -18.546 25.449 1.173 1.00 0.00 H ATOM 6619 N LYS B 358 -16.847 28.885 2.180 1.00 45.22 N ATOM 6620 CA LYS B 358 -16.841 30.315 1.879 1.00 43.68 C ATOM 6621 C LYS B 358 -15.469 30.789 1.407 1.00 42.83 C ATOM 6622 O LYS B 358 -15.369 31.772 0.676 1.00 42.51 O ATOM 6623 CB LYS B 358 -17.282 31.135 3.093 1.00 43.58 C ATOM 6624 CG LYS B 358 -18.753 30.998 3.453 1.00 43.53 C ATOM 6625 CD LYS B 358 -19.025 29.649 4.083 1.00 43.70 C ATOM 6626 CE LYS B 358 -20.432 29.527 4.601 1.00 43.77 C ATOM 6627 NZ LYS B 358 -20.648 28.118 5.041 1.00 44.16 N ATOM 6628 HA LYS B 358 -17.553 30.470 1.069 1.00 0.00 H ATOM 6629 HB2 LYS B 358 -16.691 30.816 3.951 1.00 0.00 H ATOM 6630 HB3 LYS B 358 -17.080 32.186 2.885 1.00 0.00 H ATOM 6631 HG2 LYS B 358 -19.024 31.784 4.158 1.00 0.00 H ATOM 6632 HG3 LYS B 358 -19.354 31.099 2.549 1.00 0.00 H ATOM 6633 HD2 LYS B 358 -18.859 28.874 3.335 1.00 0.00 H ATOM 6634 HD3 LYS B 358 -18.333 29.505 4.913 1.00 0.00 H ATOM 6635 HE2 LYS B 358 -21.139 29.779 3.811 1.00 0.00 H ATOM 6636 HE3 LYS B 358 -20.575 30.203 5.444 1.00 0.00 H ATOM 6637 HZ1 LYS B 358 -20.508 27.478 4.233 1.00 0.00 H ATOM 6638 HZ2 LYS B 358 -19.969 27.883 5.793 1.00 0.00 H ATOM 6639 HZ3 LYS B 358 -21.617 28.014 5.403 1.00 0.00 H ATOM 6640 H LYS B 358 -16.869 28.588 3.177 1.00 0.00 H ATOM 6641 N PHE B 359 -14.409 30.108 1.821 1.00 41.69 N ATOM 6642 CA PHE B 359 -13.093 30.425 1.276 1.00 40.91 C ATOM 6643 C PHE B 359 -13.006 29.957 -0.181 1.00 40.62 C ATOM 6644 O PHE B 359 -12.463 30.663 -1.029 1.00 40.89 O ATOM 6645 CB PHE B 359 -11.980 29.809 2.117 1.00 40.50 C ATOM 6646 CG PHE B 359 -11.571 30.639 3.308 1.00 39.53 C ATOM 6647 CD1 PHE B 359 -10.647 31.672 3.172 1.00 39.81 C ATOM 6648 CD2 PHE B 359 -12.075 30.366 4.570 1.00 38.29 C ATOM 6649 CE1 PHE B 359 -10.246 32.432 4.272 1.00 39.29 C ATOM 6650 CE2 PHE B 359 -11.675 31.117 5.676 1.00 38.54 C ATOM 6651 CZ PHE B 359 -10.761 32.147 5.525 1.00 38.96 C ATOM 6652 HA PHE B 359 -12.959 31.506 1.306 1.00 0.00 H ATOM 6653 HB2 PHE B 359 -12.321 28.839 2.478 1.00 0.00 H ATOM 6654 HB3 PHE B 359 -11.106 29.672 1.480 1.00 0.00 H ATOM 6655 HD2 PHE B 359 -12.792 29.555 4.700 1.00 0.00 H ATOM 6656 HE2 PHE B 359 -12.083 30.893 6.662 1.00 0.00 H ATOM 6657 HZ PHE B 359 -10.448 32.731 6.390 1.00 0.00 H ATOM 6658 HE1 PHE B 359 -9.531 33.245 4.145 1.00 0.00 H ATOM 6659 HD1 PHE B 359 -10.230 31.891 2.189 1.00 0.00 H ATOM 6660 H PHE B 359 -14.515 29.354 2.529 1.00 0.00 H ATOM 6661 N ASP B 360 -13.573 28.790 -0.478 1.00 40.11 N ATOM 6662 CA ASP B 360 -13.611 28.300 -1.854 1.00 39.75 C ATOM 6663 C ASP B 360 -14.282 29.332 -2.714 1.00 39.10 C ATOM 6664 O ASP B 360 -13.679 29.838 -3.658 1.00 39.55 O ATOM 6665 CB ASP B 360 -14.351 26.966 -1.967 1.00 40.05 C ATOM 6666 CG ASP B 360 -13.564 25.801 -1.368 1.00 41.15 C ATOM 6667 OD1 ASP B 360 -14.188 24.734 -1.150 1.00 43.75 O ATOM 6668 OD2 ASP B 360 -12.342 25.940 -1.104 1.00 40.25 O ATOM 6669 HA ASP B 360 -12.587 28.130 -2.188 1.00 0.00 H ATOM 6670 HB2 ASP B 360 -15.303 27.050 -1.443 1.00 0.00 H ATOM 6671 HB3 ASP B 360 -14.535 26.757 -3.021 1.00 0.00 H ATOM 6672 H ASP B 360 -13.995 28.218 0.281 1.00 0.00 H ATOM 6673 N PHE B 361 -15.515 29.672 -2.359 1.00 38.20 N ATOM 6674 CA PHE B 361 -16.247 30.715 -3.045 1.00 37.44 C ATOM 6675 C PHE B 361 -15.436 31.998 -3.254 1.00 37.71 C ATOM 6676 O PHE B 361 -15.317 32.482 -4.380 1.00 37.58 O ATOM 6677 CB PHE B 361 -17.550 31.048 -2.320 1.00 36.84 C ATOM 6678 CG PHE B 361 -18.355 32.090 -3.032 1.00 37.11 C ATOM 6679 CD1 PHE B 361 -19.240 31.723 -4.059 1.00 36.60 C ATOM 6680 CD2 PHE B 361 -18.180 33.444 -2.743 1.00 35.66 C ATOM 6681 CE1 PHE B 361 -19.963 32.680 -4.751 1.00 35.17 C ATOM 6682 CE2 PHE B 361 -18.891 34.405 -3.436 1.00 36.62 C ATOM 6683 CZ PHE B 361 -19.786 34.026 -4.444 1.00 36.19 C ATOM 6684 HA PHE B 361 -16.469 30.308 -4.032 1.00 0.00 H ATOM 6685 HB2 PHE B 361 -18.147 30.140 -2.240 1.00 0.00 H ATOM 6686 HB3 PHE B 361 -17.311 31.413 -1.321 1.00 0.00 H ATOM 6687 HD2 PHE B 361 -17.478 33.745 -1.966 1.00 0.00 H ATOM 6688 HE2 PHE B 361 -18.755 35.460 -3.198 1.00 0.00 H ATOM 6689 HZ PHE B 361 -20.345 34.786 -4.989 1.00 0.00 H ATOM 6690 HE1 PHE B 361 -20.665 32.382 -5.530 1.00 0.00 H ATOM 6691 HD1 PHE B 361 -19.359 30.670 -4.315 1.00 0.00 H ATOM 6692 H PHE B 361 -15.968 29.175 -1.566 1.00 0.00 H ATOM 6693 N ALA B 362 -14.883 32.538 -2.171 1.00 38.00 N ATOM 6694 CA ALA B 362 -14.246 33.855 -2.190 1.00 38.48 C ATOM 6695 C ALA B 362 -13.033 33.930 -3.095 1.00 38.99 C ATOM 6696 O ALA B 362 -12.775 34.973 -3.715 1.00 38.64 O ATOM 6697 CB ALA B 362 -13.852 34.270 -0.797 1.00 38.48 C ATOM 6698 HA ALA B 362 -14.992 34.539 -2.595 1.00 0.00 H ATOM 6699 HB1 ALA B 362 -14.741 34.315 -0.168 1.00 0.00 H ATOM 6700 HB2 ALA B 362 -13.151 33.543 -0.387 1.00 0.00 H ATOM 6701 HB3 ALA B 362 -13.380 35.252 -0.832 1.00 0.00 H ATOM 6702 H ALA B 362 -14.904 32.005 -1.279 1.00 0.00 H ATOM 6703 N MET B 363 -12.272 32.838 -3.144 1.00 39.35 N ATOM 6704 CA MET B 363 -11.042 32.836 -3.925 1.00 39.85 C ATOM 6705 C MET B 363 -11.367 32.927 -5.409 1.00 39.91 C ATOM 6706 O MET B 363 -10.735 33.686 -6.136 1.00 40.24 O ATOM 6707 CB MET B 363 -10.159 31.627 -3.583 1.00 39.87 C ATOM 6708 CG MET B 363 -9.589 31.653 -2.161 1.00 40.59 C ATOM 6709 SD MET B 363 -8.658 33.155 -1.738 1.00 42.87 S ATOM 6710 CE MET B 363 -9.927 34.378 -1.392 1.00 40.75 C ATOM 6711 HA MET B 363 -10.456 33.717 -3.662 1.00 0.00 H ATOM 6712 HB2 MET B 363 -10.757 30.723 -3.696 1.00 0.00 H ATOM 6713 HB3 MET B 363 -9.326 31.601 -4.286 1.00 0.00 H ATOM 6714 HG2 MET B 363 -8.923 30.798 -2.047 1.00 0.00 H ATOM 6715 HG3 MET B 363 -10.420 31.561 -1.461 1.00 0.00 H ATOM 6716 HE1 MET B 363 -10.547 34.517 -2.278 1.00 0.00 H ATOM 6717 HE2 MET B 363 -10.546 34.033 -0.564 1.00 0.00 H ATOM 6718 HE3 MET B 363 -9.455 35.324 -1.126 1.00 0.00 H ATOM 6719 H MET B 363 -12.557 31.984 -2.623 1.00 0.00 H ATOM 6720 N LYS B 364 -12.380 32.172 -5.832 1.00 40.13 N ATOM 6721 CA LYS B 364 -12.908 32.234 -7.196 1.00 40.34 C ATOM 6722 C LYS B 364 -13.568 33.579 -7.462 1.00 40.10 C ATOM 6723 O LYS B 364 -13.445 34.133 -8.541 1.00 40.28 O ATOM 6724 CB LYS B 364 -13.934 31.116 -7.424 1.00 40.48 C ATOM 6725 CG LYS B 364 -13.349 29.735 -7.669 1.00 41.22 C ATOM 6726 CD LYS B 364 -14.474 28.754 -7.943 1.00 43.56 C ATOM 6727 CE LYS B 364 -14.148 27.357 -7.440 1.00 44.61 C ATOM 6728 NZ LYS B 364 -15.331 26.785 -6.719 1.00 45.39 N ATOM 6729 HA LYS B 364 -12.071 32.107 -7.882 1.00 0.00 H ATOM 6730 HB2 LYS B 364 -14.572 31.060 -6.542 1.00 0.00 H ATOM 6731 HB3 LYS B 364 -14.538 31.385 -8.291 1.00 0.00 H ATOM 6732 HG2 LYS B 364 -12.679 29.770 -8.528 1.00 0.00 H ATOM 6733 HG3 LYS B 364 -12.792 29.414 -6.789 1.00 0.00 H ATOM 6734 HD2 LYS B 364 -15.377 29.106 -7.444 1.00 0.00 H ATOM 6735 HD3 LYS B 364 -14.648 28.709 -9.018 1.00 0.00 H ATOM 6736 HE2 LYS B 364 -13.299 27.407 -6.759 1.00 0.00 H ATOM 6737 HE3 LYS B 364 -13.896 26.718 -8.286 1.00 0.00 H ATOM 6738 HZ1 LYS B 364 -15.570 27.394 -5.911 1.00 0.00 H ATOM 6739 HZ2 LYS B 364 -16.141 26.736 -7.369 1.00 0.00 H ATOM 6740 HZ3 LYS B 364 -15.099 25.830 -6.379 1.00 0.00 H ATOM 6741 H LYS B 364 -12.816 31.507 -5.162 1.00 0.00 H ATOM 6742 N PHE B 365 -14.271 34.086 -6.460 1.00 40.13 N ATOM 6743 CA PHE B 365 -14.991 35.325 -6.576 1.00 40.20 C ATOM 6744 C PHE B 365 -14.055 36.509 -6.643 1.00 40.69 C ATOM 6745 O PHE B 365 -14.266 37.417 -7.432 1.00 40.96 O ATOM 6746 CB PHE B 365 -15.952 35.481 -5.405 1.00 40.25 C ATOM 6747 CG PHE B 365 -16.915 36.600 -5.574 1.00 39.49 C ATOM 6748 CD1 PHE B 365 -18.072 36.424 -6.323 1.00 38.83 C ATOM 6749 CD2 PHE B 365 -16.659 37.847 -5.001 1.00 39.76 C ATOM 6750 CE1 PHE B 365 -18.973 37.478 -6.505 1.00 39.66 C ATOM 6751 CE2 PHE B 365 -17.551 38.923 -5.174 1.00 39.24 C ATOM 6752 CZ PHE B 365 -18.714 38.738 -5.924 1.00 39.59 C ATOM 6753 HA PHE B 365 -15.557 35.297 -7.507 1.00 0.00 H ATOM 6754 HB2 PHE B 365 -16.515 34.554 -5.295 1.00 0.00 H ATOM 6755 HB3 PHE B 365 -15.369 35.660 -4.501 1.00 0.00 H ATOM 6756 HD2 PHE B 365 -15.754 37.990 -4.410 1.00 0.00 H ATOM 6757 HE2 PHE B 365 -17.335 39.893 -4.726 1.00 0.00 H ATOM 6758 HZ PHE B 365 -19.417 39.560 -6.060 1.00 0.00 H ATOM 6759 HE1 PHE B 365 -19.876 37.326 -7.096 1.00 0.00 H ATOM 6760 HD1 PHE B 365 -18.280 35.454 -6.774 1.00 0.00 H ATOM 6761 H PHE B 365 -14.303 33.570 -5.558 1.00 0.00 H ATOM 6762 N ASN B 366 -13.020 36.512 -5.814 1.00 41.50 N ATOM 6763 CA ASN B 366 -12.083 37.623 -5.810 1.00 42.25 C ATOM 6764 C ASN B 366 -11.277 37.624 -7.099 1.00 43.24 C ATOM 6765 O ASN B 366 -10.763 38.665 -7.526 1.00 43.83 O ATOM 6766 CB ASN B 366 -11.164 37.559 -4.592 1.00 42.03 C ATOM 6767 CG ASN B 366 -11.871 37.938 -3.294 1.00 41.57 C ATOM 6768 OD1 ASN B 366 -13.011 38.419 -3.301 1.00 40.97 O ATOM 6769 ND2 ASN B 366 -11.186 37.733 -2.171 1.00 39.53 N ATOM 6770 HA ASN B 366 -12.646 38.554 -5.749 1.00 0.00 H ATOM 6771 HB2 ASN B 366 -10.783 36.542 -4.497 1.00 0.00 H ATOM 6772 HB3 ASN B 366 -10.331 38.245 -4.748 1.00 0.00 H ATOM 6773 HD22 ASN B 366 -10.230 37.326 -2.212 1.00 0.00 H ATOM 6774 HD21 ASN B 366 -11.607 37.980 -1.253 1.00 0.00 H ATOM 6775 H ASN B 366 -12.878 35.714 -5.162 1.00 0.00 H ATOM 6776 N ALA B 367 -11.184 36.454 -7.729 1.00 43.81 N ATOM 6777 CA ALA B 367 -10.494 36.332 -9.021 1.00 44.57 C ATOM 6778 C ALA B 367 -11.206 37.117 -10.135 1.00 44.74 C ATOM 6779 O ALA B 367 -10.620 37.404 -11.181 1.00 44.92 O ATOM 6780 CB ALA B 367 -10.308 34.856 -9.410 1.00 44.34 C ATOM 6781 HA ALA B 367 -9.507 36.778 -8.901 1.00 0.00 H ATOM 6782 HB1 ALA B 367 -9.714 34.353 -8.647 1.00 0.00 H ATOM 6783 HB2 ALA B 367 -11.284 34.376 -9.488 1.00 0.00 H ATOM 6784 HB3 ALA B 367 -9.795 34.796 -10.370 1.00 0.00 H ATOM 6785 H ALA B 367 -11.609 35.609 -7.297 1.00 0.00 H ATOM 6786 N LEU B 368 -12.465 37.468 -9.896 1.00 44.88 N ATOM 6787 CA LEU B 368 -13.200 38.334 -10.807 1.00 45.16 C ATOM 6788 C LEU B 368 -12.741 39.791 -10.679 1.00 45.47 C ATOM 6789 O LEU B 368 -13.142 40.648 -11.474 1.00 45.27 O ATOM 6790 CB LEU B 368 -14.708 38.198 -10.575 1.00 45.03 C ATOM 6791 CG LEU B 368 -15.295 36.832 -10.967 1.00 45.59 C ATOM 6792 CD1 LEU B 368 -16.797 36.768 -10.698 1.00 45.61 C ATOM 6793 CD2 LEU B 368 -15.007 36.484 -12.433 1.00 44.82 C ATOM 6794 HA LEU B 368 -12.986 38.017 -11.828 1.00 0.00 H ATOM 6795 HB2 LEU B 368 -14.906 38.362 -9.516 1.00 0.00 H ATOM 6796 HB3 LEU B 368 -15.213 38.966 -11.161 1.00 0.00 H ATOM 6797 HG LEU B 368 -14.800 36.091 -10.340 1.00 0.00 H ATOM 6798 HD21 LEU B 368 -15.448 37.243 -13.079 1.00 0.00 H ATOM 6799 HD22 LEU B 368 -13.929 36.451 -12.592 1.00 0.00 H ATOM 6800 HD23 LEU B 368 -15.440 35.511 -12.666 1.00 0.00 H ATOM 6801 HD11 LEU B 368 -16.982 36.931 -9.636 1.00 0.00 H ATOM 6802 HD12 LEU B 368 -17.302 37.540 -11.279 1.00 0.00 H ATOM 6803 HD13 LEU B 368 -17.175 35.788 -10.988 1.00 0.00 H ATOM 6804 H LEU B 368 -12.936 37.116 -9.038 1.00 0.00 H ATOM 6805 N GLU B 369 -11.906 40.052 -9.664 1.00 45.84 N ATOM 6806 CA GLU B 369 -11.254 41.357 -9.440 1.00 45.96 C ATOM 6807 C GLU B 369 -12.259 42.503 -9.495 1.00 45.50 C ATOM 6808 O GLU B 369 -12.071 43.503 -10.196 1.00 45.55 O ATOM 6809 CB GLU B 369 -10.068 41.561 -10.404 1.00 45.64 C ATOM 6810 CG GLU B 369 -8.904 40.574 -10.165 1.00 46.28 C ATOM 6811 CD GLU B 369 -7.706 40.786 -11.105 1.00 47.21 C ATOM 6812 OE1 GLU B 369 -6.591 40.315 -10.764 1.00 47.59 O ATOM 6813 OE2 GLU B 369 -7.869 41.426 -12.180 1.00 48.41 O ATOM 6814 HA GLU B 369 -10.842 41.358 -8.431 1.00 0.00 H ATOM 6815 HB2 GLU B 369 -10.427 41.432 -11.425 1.00 0.00 H ATOM 6816 HB3 GLU B 369 -9.691 42.576 -10.278 1.00 0.00 H ATOM 6817 HG2 GLU B 369 -8.560 40.691 -9.137 1.00 0.00 H ATOM 6818 HG3 GLU B 369 -9.278 39.560 -10.308 1.00 0.00 H ATOM 6819 H GLU B 369 -11.704 39.286 -8.991 1.00 0.00 H ATOM 6820 N LEU B 370 -13.343 42.324 -8.755 1.00 45.06 N ATOM 6821 CA LEU B 370 -14.407 43.303 -8.707 1.00 44.87 C ATOM 6822 C LEU B 370 -14.089 44.359 -7.670 1.00 44.79 C ATOM 6823 O LEU B 370 -13.317 44.109 -6.738 1.00 44.91 O ATOM 6824 CB LEU B 370 -15.722 42.624 -8.331 1.00 45.05 C ATOM 6825 CG LEU B 370 -16.383 41.649 -9.293 1.00 44.80 C ATOM 6826 CD1 LEU B 370 -17.817 41.512 -8.882 1.00 44.53 C ATOM 6827 CD2 LEU B 370 -16.304 42.182 -10.697 1.00 45.72 C ATOM 6828 HA LEU B 370 -14.499 43.767 -9.689 1.00 0.00 H ATOM 6829 HB2 LEU B 370 -15.539 42.077 -7.406 1.00 0.00 H ATOM 6830 HB3 LEU B 370 -16.444 43.419 -8.145 1.00 0.00 H ATOM 6831 HG LEU B 370 -15.880 40.682 -9.264 1.00 0.00 H ATOM 6832 HD21 LEU B 370 -16.817 43.143 -10.749 1.00 0.00 H ATOM 6833 HD22 LEU B 370 -15.259 42.311 -10.977 1.00 0.00 H ATOM 6834 HD23 LEU B 370 -16.780 41.477 -11.379 1.00 0.00 H ATOM 6835 HD11 LEU B 370 -17.866 41.133 -7.861 1.00 0.00 H ATOM 6836 HD12 LEU B 370 -18.303 42.486 -8.933 1.00 0.00 H ATOM 6837 HD13 LEU B 370 -18.321 40.817 -9.554 1.00 0.00 H ATOM 6838 H LEU B 370 -13.432 41.454 -8.192 1.00 0.00 H ATOM 6839 N ASP B 371 -14.688 45.536 -7.824 1.00 44.42 N ATOM 6840 CA ASP B 371 -14.527 46.593 -6.836 1.00 44.24 C ATOM 6841 C ASP B 371 -15.862 47.064 -6.288 1.00 44.08 C ATOM 6842 O ASP B 371 -16.921 46.650 -6.757 1.00 43.93 O ATOM 6843 CB ASP B 371 -13.680 47.767 -7.367 1.00 44.22 C ATOM 6844 CG ASP B 371 -14.336 48.513 -8.506 1.00 44.37 C ATOM 6845 OD1 ASP B 371 -15.576 48.636 -8.548 1.00 45.21 O ATOM 6846 OD2 ASP B 371 -13.591 49.005 -9.367 1.00 45.85 O ATOM 6847 HA ASP B 371 -13.973 46.159 -6.004 1.00 0.00 H ATOM 6848 HB2 ASP B 371 -13.507 48.467 -6.549 1.00 0.00 H ATOM 6849 HB3 ASP B 371 -12.725 47.374 -7.715 1.00 0.00 H ATOM 6850 H ASP B 371 -15.280 45.704 -8.662 1.00 0.00 H ATOM 6851 N ASP B 372 -15.795 47.943 -5.297 1.00 43.95 N ATOM 6852 CA ASP B 372 -16.972 48.360 -4.567 1.00 43.94 C ATOM 6853 C ASP B 372 -18.077 48.886 -5.464 1.00 43.70 C ATOM 6854 O ASP B 372 -19.253 48.611 -5.204 1.00 43.98 O ATOM 6855 CB ASP B 372 -16.593 49.364 -3.491 1.00 44.19 C ATOM 6856 CG ASP B 372 -15.531 48.821 -2.548 1.00 45.83 C ATOM 6857 OD1 ASP B 372 -15.764 47.744 -1.946 1.00 46.36 O ATOM 6858 OD2 ASP B 372 -14.468 49.474 -2.411 1.00 47.47 O ATOM 6859 HA ASP B 372 -17.385 47.472 -4.088 1.00 0.00 H ATOM 6860 HB2 ASP B 372 -16.210 50.265 -3.970 1.00 0.00 H ATOM 6861 HB3 ASP B 372 -17.483 49.612 -2.913 1.00 0.00 H ATOM 6862 H ASP B 372 -14.871 48.343 -5.038 1.00 0.00 H ATOM 6863 N SER B 373 -17.718 49.603 -6.530 1.00 43.35 N ATOM 6864 CA SER B 373 -18.730 50.040 -7.510 1.00 42.94 C ATOM 6865 C SER B 373 -19.525 48.852 -8.075 1.00 42.63 C ATOM 6866 O SER B 373 -20.742 48.942 -8.217 1.00 43.04 O ATOM 6867 CB SER B 373 -18.142 50.931 -8.627 1.00 42.96 C ATOM 6868 OG SER B 373 -17.272 50.234 -9.512 1.00 41.91 O ATOM 6869 HA SER B 373 -19.433 50.670 -6.965 1.00 0.00 H ATOM 6870 HB2 SER B 373 -17.583 51.743 -8.162 1.00 0.00 H ATOM 6871 HB3 SER B 373 -18.966 51.345 -9.208 1.00 0.00 H ATOM 6872 HG SER B 373 -16.512 49.861 -8.999 1.00 0.00 H ATOM 6873 H SER B 373 -16.719 49.855 -6.671 1.00 0.00 H ATOM 6874 N ASP B 374 -18.846 47.741 -8.359 1.00 42.06 N ATOM 6875 CA ASP B 374 -19.515 46.549 -8.891 1.00 41.79 C ATOM 6876 C ASP B 374 -20.318 45.842 -7.813 1.00 41.35 C ATOM 6877 O ASP B 374 -21.478 45.496 -8.036 1.00 41.34 O ATOM 6878 CB ASP B 374 -18.525 45.529 -9.461 1.00 41.84 C ATOM 6879 CG ASP B 374 -17.443 46.154 -10.286 1.00 42.07 C ATOM 6880 OD1 ASP B 374 -17.745 47.024 -11.134 1.00 42.78 O ATOM 6881 OD2 ASP B 374 -16.284 45.744 -10.092 1.00 42.42 O ATOM 6882 HA ASP B 374 -20.167 46.911 -9.686 1.00 0.00 H ATOM 6883 HB2 ASP B 374 -18.063 44.993 -8.632 1.00 0.00 H ATOM 6884 HB3 ASP B 374 -19.074 44.825 -10.086 1.00 0.00 H ATOM 6885 H ASP B 374 -17.818 47.719 -8.200 1.00 0.00 H ATOM 6886 N ILE B 375 -19.681 45.614 -6.660 1.00 40.59 N ATOM 6887 CA ILE B 375 -20.288 44.875 -5.550 1.00 39.52 C ATOM 6888 C ILE B 375 -21.566 45.563 -5.083 1.00 39.53 C ATOM 6889 O ILE B 375 -22.598 44.913 -4.896 1.00 39.54 O ATOM 6890 CB ILE B 375 -19.294 44.677 -4.375 1.00 39.23 C ATOM 6891 CG1 ILE B 375 -18.104 43.828 -4.830 1.00 37.75 C ATOM 6892 CG2 ILE B 375 -19.979 44.007 -3.191 1.00 38.31 C ATOM 6893 CD1 ILE B 375 -16.972 43.780 -3.860 1.00 35.89 C ATOM 6894 HA ILE B 375 -20.548 43.882 -5.917 1.00 0.00 H ATOM 6895 HB ILE B 375 -18.939 45.659 -4.061 1.00 0.00 H ATOM 6896 HG12 ILE B 375 -18.455 42.809 -4.995 1.00 0.00 H ATOM 6897 HG13 ILE B 375 -17.731 44.239 -5.768 1.00 0.00 H ATOM 6898 HD11 ILE B 375 -16.596 44.789 -3.692 1.00 0.00 H ATOM 6899 HD12 ILE B 375 -17.321 43.359 -2.917 1.00 0.00 H ATOM 6900 HD13 ILE B 375 -16.174 43.157 -4.265 1.00 0.00 H ATOM 6901 HG21 ILE B 375 -20.805 44.631 -2.850 1.00 0.00 H ATOM 6902 HG22 ILE B 375 -20.360 43.033 -3.497 1.00 0.00 H ATOM 6903 HG23 ILE B 375 -19.260 43.880 -2.381 1.00 0.00 H ATOM 6904 H ILE B 375 -18.713 45.977 -6.546 1.00 0.00 H ATOM 6905 N SER B 376 -21.501 46.882 -4.931 1.00 39.25 N ATOM 6906 CA SER B 376 -22.683 47.649 -4.571 1.00 38.95 C ATOM 6907 C SER B 376 -23.859 47.237 -5.437 1.00 38.47 C ATOM 6908 O SER B 376 -24.914 46.882 -4.909 1.00 39.07 O ATOM 6909 CB SER B 376 -22.434 49.171 -4.623 1.00 39.13 C ATOM 6910 OG SER B 376 -21.678 49.584 -5.756 1.00 39.68 O ATOM 6911 HA SER B 376 -22.926 47.421 -3.533 1.00 0.00 H ATOM 6912 HB2 SER B 376 -21.894 49.464 -3.722 1.00 0.00 H ATOM 6913 HB3 SER B 376 -23.399 49.678 -4.648 1.00 0.00 H ATOM 6914 HG SER B 376 -20.794 49.139 -5.742 1.00 0.00 H ATOM 6915 H SER B 376 -20.594 47.371 -5.071 1.00 0.00 H ATOM 6916 N LEU B 377 -23.669 47.242 -6.755 1.00 37.82 N ATOM 6917 CA LEU B 377 -24.755 46.910 -7.698 1.00 37.33 C ATOM 6918 C LEU B 377 -25.167 45.444 -7.612 1.00 36.90 C ATOM 6919 O LEU B 377 -26.357 45.124 -7.571 1.00 37.42 O ATOM 6920 CB LEU B 377 -24.359 47.282 -9.135 1.00 37.57 C ATOM 6921 CG LEU B 377 -23.941 48.752 -9.335 1.00 37.04 C ATOM 6922 CD1 LEU B 377 -23.263 48.974 -10.672 1.00 35.46 C ATOM 6923 CD2 LEU B 377 -25.150 49.673 -9.162 1.00 36.52 C ATOM 6924 HA LEU B 377 -25.623 47.503 -7.410 1.00 0.00 H ATOM 6925 HB2 LEU B 377 -23.522 46.649 -9.430 1.00 0.00 H ATOM 6926 HB3 LEU B 377 -25.212 47.081 -9.784 1.00 0.00 H ATOM 6927 HG LEU B 377 -23.205 48.998 -8.569 1.00 0.00 H ATOM 6928 HD21 LEU B 377 -25.911 49.414 -9.899 1.00 0.00 H ATOM 6929 HD22 LEU B 377 -25.558 49.551 -8.159 1.00 0.00 H ATOM 6930 HD23 LEU B 377 -24.840 50.708 -9.306 1.00 0.00 H ATOM 6931 HD11 LEU B 377 -22.368 48.354 -10.731 1.00 0.00 H ATOM 6932 HD12 LEU B 377 -23.948 48.703 -11.475 1.00 0.00 H ATOM 6933 HD13 LEU B 377 -22.987 50.024 -10.768 1.00 0.00 H ATOM 6934 H LEU B 377 -22.730 47.486 -7.130 1.00 0.00 H ATOM 6935 N PHE B 378 -24.171 44.566 -7.546 1.00 35.90 N ATOM 6936 CA PHE B 378 -24.374 43.133 -7.397 1.00 35.15 C ATOM 6937 C PHE B 378 -25.178 42.763 -6.143 1.00 35.10 C ATOM 6938 O PHE B 378 -26.105 41.927 -6.199 1.00 35.12 O ATOM 6939 CB PHE B 378 -23.017 42.439 -7.376 1.00 35.13 C ATOM 6940 CG PHE B 378 -23.086 40.949 -7.315 1.00 33.66 C ATOM 6941 CD1 PHE B 378 -23.611 40.224 -8.363 1.00 33.60 C ATOM 6942 CD2 PHE B 378 -22.574 40.272 -6.226 1.00 34.00 C ATOM 6943 CE1 PHE B 378 -23.651 38.839 -8.316 1.00 34.74 C ATOM 6944 CE2 PHE B 378 -22.601 38.884 -6.165 1.00 33.42 C ATOM 6945 CZ PHE B 378 -23.140 38.166 -7.208 1.00 34.30 C ATOM 6946 HA PHE B 378 -24.965 42.796 -8.248 1.00 0.00 H ATOM 6947 HB2 PHE B 378 -22.477 42.719 -8.281 1.00 0.00 H ATOM 6948 HB3 PHE B 378 -22.467 42.791 -6.503 1.00 0.00 H ATOM 6949 HD2 PHE B 378 -22.141 40.836 -5.400 1.00 0.00 H ATOM 6950 HE2 PHE B 378 -22.197 38.366 -5.295 1.00 0.00 H ATOM 6951 HZ PHE B 378 -23.167 37.077 -7.168 1.00 0.00 H ATOM 6952 HE1 PHE B 378 -24.082 38.277 -9.145 1.00 0.00 H ATOM 6953 HD1 PHE B 378 -23.999 40.745 -9.238 1.00 0.00 H ATOM 6954 H PHE B 378 -23.196 44.922 -7.604 1.00 0.00 H ATOM 6955 N VAL B 379 -24.832 43.379 -5.019 1.00 34.23 N ATOM 6956 CA VAL B 379 -25.573 43.127 -3.806 1.00 34.11 C ATOM 6957 C VAL B 379 -27.031 43.539 -3.988 1.00 34.47 C ATOM 6958 O VAL B 379 -27.939 42.772 -3.642 1.00 34.39 O ATOM 6959 CB VAL B 379 -24.929 43.807 -2.588 1.00 34.03 C ATOM 6960 CG1 VAL B 379 -25.886 43.813 -1.404 1.00 32.64 C ATOM 6961 CG2 VAL B 379 -23.655 43.082 -2.235 1.00 34.02 C ATOM 6962 HA VAL B 379 -25.545 42.056 -3.605 1.00 0.00 H ATOM 6963 HB VAL B 379 -24.700 44.844 -2.835 1.00 0.00 H ATOM 6964 HG11 VAL B 379 -26.791 44.357 -1.673 1.00 0.00 H ATOM 6965 HG12 VAL B 379 -26.142 42.787 -1.140 1.00 0.00 H ATOM 6966 HG13 VAL B 379 -25.407 44.300 -0.554 1.00 0.00 H ATOM 6967 HG21 VAL B 379 -23.884 42.043 -1.998 1.00 0.00 H ATOM 6968 HG22 VAL B 379 -22.970 43.120 -3.082 1.00 0.00 H ATOM 6969 HG23 VAL B 379 -23.194 43.560 -1.371 1.00 0.00 H ATOM 6970 H VAL B 379 -24.030 44.041 -5.012 1.00 0.00 H ATOM 6971 N ALA B 380 -27.245 44.729 -4.557 1.00 34.69 N ATOM 6972 CA ALA B 380 -28.596 45.229 -4.836 1.00 35.02 C ATOM 6973 C ALA B 380 -29.404 44.244 -5.692 1.00 35.07 C ATOM 6974 O ALA B 380 -30.581 43.997 -5.436 1.00 34.65 O ATOM 6975 CB ALA B 380 -28.523 46.581 -5.515 1.00 35.26 C ATOM 6976 HA ALA B 380 -29.113 45.334 -3.882 1.00 0.00 H ATOM 6977 HB1 ALA B 380 -28.008 47.286 -4.863 1.00 0.00 H ATOM 6978 HB2 ALA B 380 -27.976 46.486 -6.453 1.00 0.00 H ATOM 6979 HB3 ALA B 380 -29.532 46.940 -5.716 1.00 0.00 H ATOM 6980 H ALA B 380 -26.428 45.320 -4.810 1.00 0.00 H ATOM 6981 N ALA B 381 -28.761 43.666 -6.699 1.00 35.39 N ATOM 6982 CA ALA B 381 -29.430 42.673 -7.523 1.00 35.94 C ATOM 6983 C ALA B 381 -29.748 41.414 -6.736 1.00 36.21 C ATOM 6984 O ALA B 381 -30.714 40.720 -7.066 1.00 36.53 O ATOM 6985 CB ALA B 381 -28.609 42.344 -8.750 1.00 36.22 C ATOM 6986 HA ALA B 381 -30.376 43.106 -7.849 1.00 0.00 H ATOM 6987 HB1 ALA B 381 -28.463 43.248 -9.341 1.00 0.00 H ATOM 6988 HB2 ALA B 381 -27.641 41.949 -8.443 1.00 0.00 H ATOM 6989 HB3 ALA B 381 -29.134 41.599 -9.348 1.00 0.00 H ATOM 6990 H ALA B 381 -27.774 43.925 -6.899 1.00 0.00 H ATOM 6991 N ILE B 382 -28.949 41.123 -5.707 1.00 36.32 N ATOM 6992 CA ILE B 382 -29.199 39.963 -4.852 1.00 36.86 C ATOM 6993 C ILE B 382 -30.440 40.194 -4.003 1.00 37.48 C ATOM 6994 O ILE B 382 -31.346 39.360 -3.977 1.00 37.82 O ATOM 6995 CB ILE B 382 -27.983 39.606 -3.954 1.00 36.79 C ATOM 6996 CG1 ILE B 382 -26.971 38.790 -4.746 1.00 36.07 C ATOM 6997 CG2 ILE B 382 -28.413 38.793 -2.728 1.00 36.67 C ATOM 6998 CD1 ILE B 382 -25.631 38.693 -4.081 1.00 35.34 C ATOM 6999 HA ILE B 382 -29.364 39.110 -5.510 1.00 0.00 H ATOM 7000 HB ILE B 382 -27.537 40.543 -3.620 1.00 0.00 H ATOM 7001 HG12 ILE B 382 -27.366 37.782 -4.876 1.00 0.00 H ATOM 7002 HG13 ILE B 382 -26.839 39.256 -5.722 1.00 0.00 H ATOM 7003 HD11 ILE B 382 -25.217 39.693 -3.953 1.00 0.00 H ATOM 7004 HD12 ILE B 382 -25.744 38.218 -3.107 1.00 0.00 H ATOM 7005 HD13 ILE B 382 -24.961 38.098 -4.701 1.00 0.00 H ATOM 7006 HG21 ILE B 382 -29.121 39.375 -2.138 1.00 0.00 H ATOM 7007 HG22 ILE B 382 -28.886 37.867 -3.055 1.00 0.00 H ATOM 7008 HG23 ILE B 382 -27.537 38.561 -2.122 1.00 0.00 H ATOM 7009 H ILE B 382 -28.131 41.734 -5.509 1.00 0.00 H ATOM 7010 N ILE B 383 -30.485 41.334 -3.325 1.00 38.19 N ATOM 7011 CA ILE B 383 -31.631 41.683 -2.503 1.00 39.06 C ATOM 7012 C ILE B 383 -32.902 41.769 -3.341 1.00 40.17 C ATOM 7013 O ILE B 383 -33.946 41.241 -2.952 1.00 40.16 O ATOM 7014 CB ILE B 383 -31.385 42.989 -1.737 1.00 39.00 C ATOM 7015 CG1 ILE B 383 -30.151 42.830 -0.839 1.00 38.58 C ATOM 7016 CG2 ILE B 383 -32.608 43.368 -0.928 1.00 37.99 C ATOM 7017 CD1 ILE B 383 -29.667 44.108 -0.237 1.00 38.82 C ATOM 7018 HA ILE B 383 -31.769 40.888 -1.770 1.00 0.00 H ATOM 7019 HB ILE B 383 -31.198 43.795 -2.446 1.00 0.00 H ATOM 7020 HG12 ILE B 383 -30.402 42.144 -0.030 1.00 0.00 H ATOM 7021 HG13 ILE B 383 -29.344 42.406 -1.437 1.00 0.00 H ATOM 7022 HD11 ILE B 383 -29.399 44.804 -1.032 1.00 0.00 H ATOM 7023 HD12 ILE B 383 -30.457 44.542 0.376 1.00 0.00 H ATOM 7024 HD13 ILE B 383 -28.793 43.908 0.383 1.00 0.00 H ATOM 7025 HG21 ILE B 383 -33.457 43.504 -1.598 1.00 0.00 H ATOM 7026 HG22 ILE B 383 -32.830 42.575 -0.214 1.00 0.00 H ATOM 7027 HG23 ILE B 383 -32.414 44.297 -0.392 1.00 0.00 H ATOM 7028 H ILE B 383 -29.682 41.992 -3.383 1.00 0.00 H ATOM 7029 N CYS B 384 -32.794 42.393 -4.510 1.00 41.67 N ATOM 7030 CA CYS B 384 -33.963 42.654 -5.351 1.00 43.38 C ATOM 7031 C CYS B 384 -34.294 41.493 -6.275 1.00 44.25 C ATOM 7032 O CYS B 384 -34.267 41.623 -7.492 1.00 44.74 O ATOM 7033 CB CYS B 384 -33.792 43.960 -6.130 1.00 43.04 C ATOM 7034 SG CYS B 384 -33.623 45.376 -5.028 1.00 44.03 S ATOM 7035 HA CYS B 384 -34.817 42.763 -4.683 1.00 0.00 H ATOM 7036 HB2 CYS B 384 -34.665 44.109 -6.766 1.00 0.00 H ATOM 7037 HB3 CYS B 384 -32.899 43.887 -6.751 1.00 0.00 H ATOM 7038 HG CYS B 384 -32.516 45.201 -4.223 1.00 0.00 H ATOM 7039 H CYS B 384 -31.856 42.703 -4.835 1.00 0.00 H ATOM 7040 N CYS B 385 -34.636 40.359 -5.689 1.00 45.34 N ATOM 7041 CA CYS B 385 -34.793 39.164 -6.476 1.00 46.23 C ATOM 7042 C CYS B 385 -36.255 38.782 -6.628 1.00 47.18 C ATOM 7043 O CYS B 385 -36.943 38.532 -5.642 1.00 47.37 O ATOM 7044 CB CYS B 385 -33.986 38.040 -5.853 1.00 46.01 C ATOM 7045 SG CYS B 385 -33.953 36.594 -6.844 1.00 45.96 S ATOM 7046 HA CYS B 385 -34.416 39.354 -7.481 1.00 0.00 H ATOM 7047 HB2 CYS B 385 -34.425 37.790 -4.887 1.00 0.00 H ATOM 7048 HB3 CYS B 385 -32.963 38.386 -5.707 1.00 0.00 H ATOM 7049 HG CYS B 385 -33.203 35.623 -6.213 1.00 0.00 H ATOM 7050 H CYS B 385 -34.791 40.330 -4.661 1.00 0.00 H ATOM 7051 N GLY B 386 -36.725 38.738 -7.874 1.00 48.23 N ATOM 7052 CA GLY B 386 -38.107 38.367 -8.167 1.00 49.16 C ATOM 7053 C GLY B 386 -38.376 36.887 -7.984 1.00 50.02 C ATOM 7054 O GLY B 386 -39.485 36.422 -8.229 1.00 50.42 O ATOM 7055 HA3 GLY B 386 -38.327 38.635 -9.200 1.00 0.00 H ATOM 7056 HA2 GLY B 386 -38.765 38.925 -7.501 1.00 0.00 H ATOM 7057 H GLY B 386 -36.089 38.975 -8.662 1.00 0.00 H ATOM 7058 N ASP B 387 -37.360 36.157 -7.533 1.00 50.91 N ATOM 7059 CA ASP B 387 -37.406 34.702 -7.432 1.00 51.82 C ATOM 7060 C ASP B 387 -37.942 34.231 -6.106 1.00 52.18 C ATOM 7061 O ASP B 387 -38.560 33.170 -6.033 1.00 52.59 O ATOM 7062 CB ASP B 387 -36.003 34.112 -7.588 1.00 52.04 C ATOM 7063 CG ASP B 387 -35.617 33.898 -9.027 1.00 52.54 C ATOM 7064 OD2 ASP B 387 -35.177 32.767 -9.317 1.00 54.34 O ATOM 7065 HA ASP B 387 -38.071 34.367 -8.228 1.00 0.00 H ATOM 7066 HB2 ASP B 387 -35.285 34.794 -7.132 1.00 0.00 H ATOM 7067 HB3 ASP B 387 -35.969 33.153 -7.072 1.00 0.00 H ATOM 7068 H ASP B 387 -36.491 36.647 -7.238 1.00 0.00 H ATOM 7069 N ARG B 388 -37.678 35.012 -5.059 1.00 52.58 N ATOM 7070 CA ARG B 388 -37.920 34.599 -3.674 1.00 52.62 C ATOM 7071 C ARG B 388 -39.405 34.331 -3.401 1.00 53.21 C ATOM 7072 O ARG B 388 -40.259 35.166 -3.728 1.00 53.24 O ATOM 7073 CB ARG B 388 -37.396 35.653 -2.686 1.00 52.46 C ATOM 7074 CG ARG B 388 -36.143 36.417 -3.111 1.00 51.34 C ATOM 7075 CD ARG B 388 -34.876 35.583 -3.019 1.00 49.92 C ATOM 7076 NE ARG B 388 -33.701 36.451 -2.930 1.00 49.89 N ATOM 7077 CZ ARG B 388 -32.438 36.030 -2.979 1.00 48.95 C ATOM 7078 NH1 ARG B 388 -32.163 34.739 -3.109 1.00 48.51 N ATOM 7079 NH2 ARG B 388 -31.444 36.905 -2.901 1.00 47.25 N ATOM 7080 HA ARG B 388 -37.376 33.666 -3.528 1.00 0.00 H ATOM 7081 HB2 ARG B 388 -38.191 36.382 -2.525 1.00 0.00 H ATOM 7082 HB3 ARG B 388 -37.174 35.146 -1.747 1.00 0.00 H ATOM 7083 HG2 ARG B 388 -36.269 36.744 -4.143 1.00 0.00 H ATOM 7084 HG3 ARG B 388 -36.032 37.289 -2.466 1.00 0.00 H ATOM 7085 HD2 ARG B 388 -34.793 34.955 -3.906 1.00 0.00 H ATOM 7086 HD3 ARG B 388 -34.925 34.951 -2.132 1.00 0.00 H ATOM 7087 HE ARG B 388 -33.864 37.472 -2.820 1.00 0.00 H ATOM 7088 HH12 ARG B 388 -31.174 34.419 -3.146 1.00 0.00 H ATOM 7089 HH11 ARG B 388 -32.936 34.047 -3.174 1.00 0.00 H ATOM 7090 HH22 ARG B 388 -30.458 36.577 -2.939 1.00 0.00 H ATOM 7091 HH21 ARG B 388 -31.651 37.919 -2.802 1.00 0.00 H ATOM 7092 H ARG B 388 -37.282 35.958 -5.233 1.00 0.00 H ATOM 7093 N PRO B 389 -39.710 33.172 -2.779 1.00 53.52 N ATOM 7094 CA PRO B 389 -41.061 32.705 -2.451 1.00 53.78 C ATOM 7095 C PRO B 389 -41.924 33.734 -1.728 1.00 54.11 C ATOM 7096 O PRO B 389 -41.412 34.755 -1.276 1.00 54.32 O ATOM 7097 CB PRO B 389 -40.806 31.504 -1.524 1.00 53.76 C ATOM 7098 CG PRO B 389 -39.352 31.571 -1.158 1.00 53.62 C ATOM 7099 CD PRO B 389 -38.691 32.210 -2.326 1.00 53.58 C ATOM 7100 HA PRO B 389 -41.617 32.478 -3.361 1.00 0.00 H ATOM 7101 HD3 PRO B 389 -37.773 32.718 -2.031 1.00 0.00 H ATOM 7102 HD2 PRO B 389 -38.467 31.478 -3.102 1.00 0.00 H ATOM 7103 HG3 PRO B 389 -38.952 30.571 -0.991 1.00 0.00 H ATOM 7104 HG2 PRO B 389 -39.210 32.173 -0.260 1.00 0.00 H ATOM 7105 HB2 PRO B 389 -41.426 31.575 -0.631 1.00 0.00 H ATOM 7106 HB3 PRO B 389 -41.024 30.571 -2.043 1.00 0.00 H ATOM 7107 N GLY B 390 -43.226 33.460 -1.643 1.00 54.42 N ATOM 7108 CA GLY B 390 -44.181 34.303 -0.930 1.00 54.84 C ATOM 7109 C GLY B 390 -44.110 35.801 -1.191 1.00 55.30 C ATOM 7110 O GLY B 390 -44.402 36.607 -0.290 1.00 55.50 O ATOM 7111 HA3 GLY B 390 -44.025 34.147 0.137 1.00 0.00 H ATOM 7112 HA2 GLY B 390 -45.182 33.969 -1.202 1.00 0.00 H ATOM 7113 H GLY B 390 -43.580 32.600 -2.109 1.00 0.00 H ATOM 7114 N LEU B 391 -43.718 36.187 -2.404 1.00 55.38 N ATOM 7115 CA LEU B 391 -43.682 37.610 -2.757 1.00 55.82 C ATOM 7116 C LEU B 391 -45.075 38.120 -3.144 1.00 56.11 C ATOM 7117 O LEU B 391 -45.874 37.378 -3.723 1.00 56.17 O ATOM 7118 CB LEU B 391 -42.642 37.898 -3.848 1.00 55.61 C ATOM 7119 CG LEU B 391 -41.172 37.935 -3.409 1.00 55.23 C ATOM 7120 CD1 LEU B 391 -40.309 38.481 -4.514 1.00 54.73 C ATOM 7121 CD2 LEU B 391 -40.968 38.755 -2.157 1.00 55.05 C ATOM 7122 HA LEU B 391 -43.369 38.162 -1.871 1.00 0.00 H ATOM 7123 HB2 LEU B 391 -42.740 37.125 -4.610 1.00 0.00 H ATOM 7124 HB3 LEU B 391 -42.881 38.868 -4.284 1.00 0.00 H ATOM 7125 HG LEU B 391 -40.882 36.908 -3.186 1.00 0.00 H ATOM 7126 HD21 LEU B 391 -41.293 39.780 -2.338 1.00 0.00 H ATOM 7127 HD22 LEU B 391 -41.553 38.326 -1.344 1.00 0.00 H ATOM 7128 HD23 LEU B 391 -39.912 38.749 -1.889 1.00 0.00 H ATOM 7129 HD11 LEU B 391 -40.402 37.844 -5.394 1.00 0.00 H ATOM 7130 HD12 LEU B 391 -40.633 39.492 -4.760 1.00 0.00 H ATOM 7131 HD13 LEU B 391 -39.270 38.500 -4.186 1.00 0.00 H ATOM 7132 H LEU B 391 -43.435 35.474 -3.106 1.00 0.00 H ATOM 7133 N LEU B 392 -45.367 39.377 -2.818 1.00 56.31 N ATOM 7134 CA LEU B 392 -46.734 39.885 -2.956 1.00 56.79 C ATOM 7135 C LEU B 392 -46.997 40.736 -4.196 1.00 56.79 C ATOM 7136 O LEU B 392 -48.111 40.735 -4.712 1.00 57.20 O ATOM 7137 CB LEU B 392 -47.179 40.612 -1.685 1.00 56.95 C ATOM 7138 CG LEU B 392 -47.168 39.753 -0.411 1.00 57.95 C ATOM 7139 CD1 LEU B 392 -47.274 40.627 0.839 1.00 58.87 C ATOM 7140 CD2 LEU B 392 -48.251 38.660 -0.430 1.00 58.00 C ATOM 7141 HA LEU B 392 -47.345 38.994 -3.102 1.00 0.00 H ATOM 7142 HB2 LEU B 392 -46.512 41.460 -1.528 1.00 0.00 H ATOM 7143 HB3 LEU B 392 -48.195 40.975 -1.840 1.00 0.00 H ATOM 7144 HG LEU B 392 -46.209 39.236 -0.382 1.00 0.00 H ATOM 7145 HD21 LEU B 392 -49.233 39.125 -0.514 1.00 0.00 H ATOM 7146 HD22 LEU B 392 -48.085 38.001 -1.282 1.00 0.00 H ATOM 7147 HD23 LEU B 392 -48.199 38.083 0.493 1.00 0.00 H ATOM 7148 HD11 LEU B 392 -46.429 41.315 0.873 1.00 0.00 H ATOM 7149 HD12 LEU B 392 -48.204 41.194 0.807 1.00 0.00 H ATOM 7150 HD13 LEU B 392 -47.264 39.993 1.726 1.00 0.00 H ATOM 7151 H LEU B 392 -44.618 40.004 -2.462 1.00 0.00 H ATOM 7152 N ASN B 393 -45.989 41.468 -4.659 1.00 56.60 N ATOM 7153 CA ASN B 393 -46.063 42.154 -5.949 1.00 56.41 C ATOM 7154 C ASN B 393 -44.905 41.705 -6.832 1.00 56.23 C ATOM 7155 O ASN B 393 -43.970 42.461 -7.119 1.00 56.02 O ATOM 7156 CB ASN B 393 -46.077 43.676 -5.770 1.00 56.49 C ATOM 7157 CG ASN B 393 -46.464 44.427 -7.046 1.00 56.55 C ATOM 7158 OD1 ASN B 393 -46.240 43.968 -8.177 1.00 56.05 O ATOM 7159 ND2 ASN B 393 -47.034 45.608 -6.859 1.00 57.03 N ATOM 7160 HA ASN B 393 -46.999 41.886 -6.439 1.00 0.00 H ATOM 7161 HB2 ASN B 393 -46.794 43.927 -4.988 1.00 0.00 H ATOM 7162 HB3 ASN B 393 -45.081 43.999 -5.465 1.00 0.00 H ATOM 7163 HD22 ASN B 393 -47.204 45.956 -5.894 1.00 0.00 H ATOM 7164 HD21 ASN B 393 -47.311 46.187 -7.677 1.00 0.00 H ATOM 7165 H ASN B 393 -45.124 41.556 -4.089 1.00 0.00 H ATOM 7166 N VAL B 394 -44.993 40.456 -7.265 1.00 56.16 N ATOM 7167 CA VAL B 394 -43.901 39.800 -7.952 1.00 56.28 C ATOM 7168 C VAL B 394 -43.559 40.470 -9.286 1.00 56.36 C ATOM 7169 O VAL B 394 -42.402 40.443 -9.718 1.00 56.58 O ATOM 7170 CB VAL B 394 -44.196 38.302 -8.135 1.00 56.02 C ATOM 7171 CG1 VAL B 394 -45.022 38.060 -9.381 1.00 56.74 C ATOM 7172 CG2 VAL B 394 -42.908 37.510 -8.189 1.00 56.89 C ATOM 7173 HA VAL B 394 -43.017 39.902 -7.322 1.00 0.00 H ATOM 7174 HB VAL B 394 -44.775 37.964 -7.275 1.00 0.00 H ATOM 7175 HG11 VAL B 394 -45.968 38.596 -9.298 1.00 0.00 H ATOM 7176 HG12 VAL B 394 -44.475 38.418 -10.253 1.00 0.00 H ATOM 7177 HG13 VAL B 394 -45.216 36.992 -9.485 1.00 0.00 H ATOM 7178 HG21 VAL B 394 -42.304 37.857 -9.027 1.00 0.00 H ATOM 7179 HG22 VAL B 394 -42.357 37.652 -7.259 1.00 0.00 H ATOM 7180 HG23 VAL B 394 -43.138 36.453 -8.319 1.00 0.00 H ATOM 7181 H VAL B 394 -45.876 39.930 -7.106 1.00 0.00 H ATOM 7182 N GLY B 395 -44.555 41.083 -9.922 1.00 56.24 N ATOM 7183 CA GLY B 395 -44.368 41.680 -11.237 1.00 56.08 C ATOM 7184 C GLY B 395 -43.486 42.905 -11.196 1.00 56.13 C ATOM 7185 O GLY B 395 -42.581 43.054 -12.017 1.00 56.28 O ATOM 7186 HA3 GLY B 395 -45.343 41.964 -11.634 1.00 0.00 H ATOM 7187 HA2 GLY B 395 -43.910 40.941 -11.895 1.00 0.00 H ATOM 7188 H GLY B 395 -45.489 41.137 -9.469 1.00 0.00 H ATOM 7189 N HIS B 396 -43.753 43.786 -10.235 1.00 56.08 N ATOM 7190 CA HIS B 396 -42.983 45.010 -10.084 1.00 55.86 C ATOM 7191 C HIS B 396 -41.562 44.716 -9.619 1.00 55.80 C ATOM 7192 O HIS B 396 -40.611 45.339 -10.094 1.00 56.06 O ATOM 7193 CB HIS B 396 -43.666 45.955 -9.100 1.00 55.81 C ATOM 7194 CG HIS B 396 -42.890 47.208 -8.832 1.00 56.18 C ATOM 7195 ND1 HIS B 396 -42.474 47.569 -7.567 1.00 56.28 N ATOM 7196 CD2 HIS B 396 -42.449 48.181 -9.665 1.00 55.91 C ATOM 7197 CE1 HIS B 396 -41.825 48.719 -7.631 1.00 56.26 C ATOM 7198 NE2 HIS B 396 -41.795 49.111 -8.893 1.00 55.54 N ATOM 7199 HA HIS B 396 -42.931 45.490 -11.061 1.00 0.00 H ATOM 7200 HB2 HIS B 396 -44.638 46.232 -9.507 1.00 0.00 H ATOM 7201 HB3 HIS B 396 -43.806 45.428 -8.156 1.00 0.00 H ATOM 7202 HD2 HIS B 396 -42.587 48.219 -10.746 1.00 0.00 H ATOM 7203 HE1 HIS B 396 -41.389 49.253 -6.787 1.00 0.00 H ATOM 7204 H HIS B 396 -44.533 43.594 -9.575 1.00 0.00 H ATOM 7205 N ILE B 397 -41.427 43.781 -8.680 1.00 55.44 N ATOM 7206 CA ILE B 397 -40.114 43.366 -8.200 1.00 55.21 C ATOM 7207 C ILE B 397 -39.294 42.732 -9.332 1.00 55.20 C ATOM 7208 O ILE B 397 -38.108 43.021 -9.464 1.00 55.01 O ATOM 7209 CB ILE B 397 -40.219 42.461 -6.949 1.00 55.34 C ATOM 7210 CG1 ILE B 397 -40.821 43.271 -5.798 1.00 55.03 C ATOM 7211 CG2 ILE B 397 -38.845 41.880 -6.546 1.00 54.16 C ATOM 7212 CD1 ILE B 397 -41.581 42.443 -4.800 1.00 55.43 C ATOM 7213 HA ILE B 397 -39.573 44.256 -7.878 1.00 0.00 H ATOM 7214 HB ILE B 397 -40.865 41.615 -7.183 1.00 0.00 H ATOM 7215 HG12 ILE B 397 -40.011 43.779 -5.276 1.00 0.00 H ATOM 7216 HG13 ILE B 397 -41.501 44.011 -6.219 1.00 0.00 H ATOM 7217 HD11 ILE B 397 -42.405 41.936 -5.303 1.00 0.00 H ATOM 7218 HD12 ILE B 397 -40.912 41.704 -4.359 1.00 0.00 H ATOM 7219 HD13 ILE B 397 -41.975 43.091 -4.017 1.00 0.00 H ATOM 7220 HG21 ILE B 397 -38.448 41.285 -7.368 1.00 0.00 H ATOM 7221 HG22 ILE B 397 -38.158 42.696 -6.323 1.00 0.00 H ATOM 7222 HG23 ILE B 397 -38.963 41.251 -5.664 1.00 0.00 H ATOM 7223 H ILE B 397 -42.278 43.337 -8.280 1.00 0.00 H ATOM 7224 N GLU B 398 -39.931 41.903 -10.158 1.00 55.23 N ATOM 7225 CA GLU B 398 -39.309 41.429 -11.397 1.00 55.35 C ATOM 7226 C GLU B 398 -38.767 42.615 -12.196 1.00 55.60 C ATOM 7227 O GLU B 398 -37.584 42.644 -12.552 1.00 55.60 O ATOM 7228 CB GLU B 398 -40.300 40.636 -12.252 1.00 55.15 C ATOM 7229 CG GLU B 398 -40.249 39.127 -12.078 1.00 54.90 C ATOM 7230 CD GLU B 398 -41.143 38.391 -13.079 1.00 55.35 C ATOM 7231 OE1 GLU B 398 -42.123 38.995 -13.568 1.00 55.33 O ATOM 7232 OE2 GLU B 398 -40.871 37.206 -13.382 1.00 55.19 O ATOM 7233 HA GLU B 398 -38.488 40.765 -11.128 1.00 0.00 H ATOM 7234 HB2 GLU B 398 -41.306 40.970 -11.998 1.00 0.00 H ATOM 7235 HB3 GLU B 398 -40.097 40.861 -13.299 1.00 0.00 H ATOM 7236 HG2 GLU B 398 -39.221 38.793 -12.216 1.00 0.00 H ATOM 7237 HG3 GLU B 398 -40.577 38.880 -11.068 1.00 0.00 H ATOM 7238 H GLU B 398 -40.892 41.585 -9.918 1.00 0.00 H ATOM 7239 N LYS B 399 -39.632 43.601 -12.446 1.00 55.93 N ATOM 7240 CA LYS B 399 -39.267 44.794 -13.218 1.00 56.33 C ATOM 7241 C LYS B 399 -38.112 45.539 -12.576 1.00 56.27 C ATOM 7242 O LYS B 399 -37.263 46.110 -13.256 1.00 56.27 O ATOM 7243 CB LYS B 399 -40.461 45.747 -13.360 1.00 56.46 C ATOM 7244 CG LYS B 399 -41.469 45.348 -14.428 1.00 57.08 C ATOM 7245 CD LYS B 399 -42.376 46.514 -14.804 1.00 58.93 C ATOM 7246 CE LYS B 399 -41.698 47.480 -15.785 1.00 59.74 C ATOM 7247 NZ LYS B 399 -42.704 48.321 -16.522 1.00 59.79 N ATOM 7248 HA LYS B 399 -38.961 44.449 -14.206 1.00 0.00 H ATOM 7249 HB2 LYS B 399 -40.979 45.788 -12.402 1.00 0.00 H ATOM 7250 HB3 LYS B 399 -40.078 46.737 -13.607 1.00 0.00 H ATOM 7251 HG2 LYS B 399 -40.932 45.016 -15.316 1.00 0.00 H ATOM 7252 HG3 LYS B 399 -42.082 44.530 -14.049 1.00 0.00 H ATOM 7253 HD2 LYS B 399 -43.281 46.121 -15.267 1.00 0.00 H ATOM 7254 HD3 LYS B 399 -42.640 47.060 -13.899 1.00 0.00 H ATOM 7255 HE2 LYS B 399 -41.122 46.903 -16.508 1.00 0.00 H ATOM 7256 HE3 LYS B 399 -41.028 48.136 -15.229 1.00 0.00 H ATOM 7257 HZ1 LYS B 399 -43.344 47.702 -17.060 1.00 0.00 H ATOM 7258 HZ2 LYS B 399 -43.254 48.880 -15.839 1.00 0.00 H ATOM 7259 HZ3 LYS B 399 -42.208 48.960 -17.175 1.00 0.00 H ATOM 7260 H LYS B 399 -40.602 43.520 -12.079 1.00 0.00 H ATOM 7261 N MET B 400 -38.100 45.519 -11.254 1.00 56.39 N ATOM 7262 CA MET B 400 -37.133 46.252 -10.461 1.00 56.63 C ATOM 7263 C MET B 400 -35.741 45.614 -10.545 1.00 55.96 C ATOM 7264 O MET B 400 -34.740 46.306 -10.723 1.00 56.28 O ATOM 7265 CB MET B 400 -37.632 46.291 -9.023 1.00 56.67 C ATOM 7266 CG MET B 400 -37.261 47.526 -8.271 1.00 57.48 C ATOM 7267 SD MET B 400 -37.555 47.248 -6.529 1.00 58.18 S ATOM 7268 CE MET B 400 -36.147 48.135 -5.843 1.00 57.55 C ATOM 7269 HA MET B 400 -37.034 47.266 -10.849 1.00 0.00 H ATOM 7270 HB2 MET B 400 -38.719 46.215 -9.038 1.00 0.00 H ATOM 7271 HB3 MET B 400 -37.216 45.433 -8.495 1.00 0.00 H ATOM 7272 HG2 MET B 400 -37.868 48.362 -8.617 1.00 0.00 H ATOM 7273 HG3 MET B 400 -36.207 47.752 -8.434 1.00 0.00 H ATOM 7274 HE1 MET B 400 -35.223 47.693 -6.216 1.00 0.00 H ATOM 7275 HE2 MET B 400 -36.197 49.182 -6.143 1.00 0.00 H ATOM 7276 HE3 MET B 400 -36.171 48.066 -4.755 1.00 0.00 H ATOM 7277 H MET B 400 -38.818 44.951 -10.760 1.00 0.00 H ATOM 7278 N GLN B 401 -35.689 44.292 -10.421 1.00 55.29 N ATOM 7279 CA GLN B 401 -34.459 43.532 -10.595 1.00 54.62 C ATOM 7280 C GLN B 401 -33.899 43.854 -11.967 1.00 54.15 C ATOM 7281 O GLN B 401 -32.725 44.197 -12.109 1.00 54.11 O ATOM 7282 CB GLN B 401 -34.754 42.027 -10.509 1.00 54.47 C ATOM 7283 CG GLN B 401 -33.515 41.149 -10.502 1.00 54.41 C ATOM 7284 CD GLN B 401 -33.789 39.686 -10.844 1.00 54.98 C ATOM 7285 OE1 GLN B 401 -34.933 39.194 -10.779 1.00 54.51 O ATOM 7286 NE2 GLN B 401 -32.724 38.975 -11.208 1.00 54.90 N ATOM 7287 HA GLN B 401 -33.745 43.795 -9.815 1.00 0.00 H ATOM 7288 HB2 GLN B 401 -35.311 41.840 -9.591 1.00 0.00 H ATOM 7289 HB3 GLN B 401 -35.366 41.749 -11.367 1.00 0.00 H ATOM 7290 HG2 GLN B 401 -32.809 41.546 -11.232 1.00 0.00 H ATOM 7291 HG3 GLN B 401 -33.070 41.191 -9.508 1.00 0.00 H ATOM 7292 HE22 GLN B 401 -31.787 39.425 -11.249 1.00 0.00 H ATOM 7293 HE21 GLN B 401 -32.829 37.969 -11.451 1.00 0.00 H ATOM 7294 H GLN B 401 -36.563 43.779 -10.190 1.00 0.00 H ATOM 7295 N GLU B 402 -34.774 43.755 -12.966 1.00 53.46 N ATOM 7296 CA GLU B 402 -34.423 43.927 -14.367 1.00 52.84 C ATOM 7297 C GLU B 402 -33.683 45.241 -14.625 1.00 52.00 C ATOM 7298 O GLU B 402 -32.726 45.273 -15.399 1.00 51.84 O ATOM 7299 CB GLU B 402 -35.691 43.839 -15.206 1.00 53.00 C ATOM 7300 CG GLU B 402 -35.483 43.685 -16.688 1.00 53.75 C ATOM 7301 CD GLU B 402 -36.800 43.513 -17.410 1.00 55.81 C ATOM 7302 OE1 GLU B 402 -37.853 43.445 -16.727 1.00 56.65 O ATOM 7303 OE2 GLU B 402 -36.787 43.447 -18.658 1.00 56.83 O ATOM 7304 HA GLU B 402 -33.735 43.131 -14.651 1.00 0.00 H ATOM 7305 HB2 GLU B 402 -36.265 42.981 -14.857 1.00 0.00 H ATOM 7306 HB3 GLU B 402 -36.266 44.750 -15.041 1.00 0.00 H ATOM 7307 HG2 GLU B 402 -34.981 44.573 -17.071 1.00 0.00 H ATOM 7308 HG3 GLU B 402 -34.860 42.809 -16.871 1.00 0.00 H ATOM 7309 H GLU B 402 -35.765 43.543 -12.731 1.00 0.00 H ATOM 7310 N GLY B 403 -34.123 46.306 -13.958 1.00 51.05 N ATOM 7311 CA GLY B 403 -33.469 47.606 -14.040 1.00 50.14 C ATOM 7312 C GLY B 403 -32.097 47.567 -13.404 1.00 49.87 C ATOM 7313 O GLY B 403 -31.110 48.023 -13.996 1.00 49.78 O ATOM 7314 HA3 GLY B 403 -34.080 48.346 -13.523 1.00 0.00 H ATOM 7315 HA2 GLY B 403 -33.368 47.888 -15.088 1.00 0.00 H ATOM 7316 H GLY B 403 -34.965 46.207 -13.356 1.00 0.00 H ATOM 7317 N ILE B 404 -32.030 46.999 -12.200 1.00 49.27 N ATOM 7318 CA ILE B 404 -30.770 46.905 -11.470 1.00 48.75 C ATOM 7319 C ILE B 404 -29.790 45.965 -12.178 1.00 48.65 C ATOM 7320 O ILE B 404 -28.605 46.288 -12.314 1.00 48.69 O ATOM 7321 CB ILE B 404 -31.005 46.555 -9.979 1.00 48.81 C ATOM 7322 CG1 ILE B 404 -31.656 47.758 -9.284 1.00 48.68 C ATOM 7323 CG2 ILE B 404 -29.696 46.199 -9.269 1.00 47.99 C ATOM 7324 CD1 ILE B 404 -32.473 47.416 -8.080 1.00 48.31 C ATOM 7325 HA ILE B 404 -30.295 47.886 -11.470 1.00 0.00 H ATOM 7326 HB ILE B 404 -31.658 45.684 -9.928 1.00 0.00 H ATOM 7327 HG12 ILE B 404 -30.865 48.441 -8.975 1.00 0.00 H ATOM 7328 HG13 ILE B 404 -32.304 48.257 -10.004 1.00 0.00 H ATOM 7329 HD11 ILE B 404 -33.280 46.743 -8.369 1.00 0.00 H ATOM 7330 HD12 ILE B 404 -31.840 46.928 -7.339 1.00 0.00 H ATOM 7331 HD13 ILE B 404 -32.893 48.328 -7.656 1.00 0.00 H ATOM 7332 HG21 ILE B 404 -29.242 45.337 -9.757 1.00 0.00 H ATOM 7333 HG22 ILE B 404 -29.014 47.048 -9.320 1.00 0.00 H ATOM 7334 HG23 ILE B 404 -29.903 45.960 -8.226 1.00 0.00 H ATOM 7335 H ILE B 404 -32.896 46.614 -11.771 1.00 0.00 H ATOM 7336 N VAL B 405 -30.298 44.833 -12.663 1.00 48.46 N ATOM 7337 CA VAL B 405 -29.518 43.902 -13.477 1.00 48.44 C ATOM 7338 C VAL B 405 -28.957 44.577 -14.744 1.00 48.91 C ATOM 7339 O VAL B 405 -27.808 44.337 -15.123 1.00 48.71 O ATOM 7340 CB VAL B 405 -30.351 42.629 -13.804 1.00 48.45 C ATOM 7341 CG1 VAL B 405 -29.868 41.933 -15.078 1.00 47.81 C ATOM 7342 CG2 VAL B 405 -30.346 41.670 -12.607 1.00 47.29 C ATOM 7343 HA VAL B 405 -28.653 43.587 -12.893 1.00 0.00 H ATOM 7344 HB VAL B 405 -31.377 42.944 -13.994 1.00 0.00 H ATOM 7345 HG11 VAL B 405 -29.953 42.620 -15.920 1.00 0.00 H ATOM 7346 HG12 VAL B 405 -28.827 41.635 -14.955 1.00 0.00 H ATOM 7347 HG13 VAL B 405 -30.481 41.051 -15.263 1.00 0.00 H ATOM 7348 HG21 VAL B 405 -29.320 41.378 -12.382 1.00 0.00 H ATOM 7349 HG22 VAL B 405 -30.781 42.169 -11.741 1.00 0.00 H ATOM 7350 HG23 VAL B 405 -30.933 40.784 -12.850 1.00 0.00 H ATOM 7351 H VAL B 405 -31.290 44.602 -12.454 1.00 0.00 H ATOM 7352 N HIS B 406 -29.761 45.439 -15.371 1.00 49.64 N ATOM 7353 CA HIS B 406 -29.360 46.153 -16.596 1.00 50.25 C ATOM 7354 C HIS B 406 -28.269 47.193 -16.325 1.00 50.11 C ATOM 7355 O HIS B 406 -27.355 47.364 -17.143 1.00 50.28 O ATOM 7356 CB HIS B 406 -30.591 46.764 -17.313 1.00 50.73 C ATOM 7357 CG HIS B 406 -30.267 47.574 -18.540 1.00 52.44 C ATOM 7358 ND1 HIS B 406 -29.284 47.220 -19.442 1.00 54.70 N ATOM 7359 CD2 HIS B 406 -30.823 48.712 -19.023 1.00 54.01 C ATOM 7360 CE1 HIS B 406 -29.234 48.116 -20.415 1.00 54.71 C ATOM 7361 NE2 HIS B 406 -30.159 49.030 -20.186 1.00 54.42 N ATOM 7362 HA HIS B 406 -28.920 45.422 -17.274 1.00 0.00 H ATOM 7363 HB2 HIS B 406 -31.251 45.949 -17.609 1.00 0.00 H ATOM 7364 HB3 HIS B 406 -31.109 47.411 -16.606 1.00 0.00 H ATOM 7365 HD2 HIS B 406 -31.644 49.271 -18.574 1.00 0.00 H ATOM 7366 HE1 HIS B 406 -28.547 48.102 -21.261 1.00 0.00 H ATOM 7367 H HIS B 406 -30.708 45.614 -14.979 1.00 0.00 H ATOM 7368 N VAL B 407 -28.362 47.878 -15.185 1.00 49.74 N ATOM 7369 CA VAL B 407 -27.325 48.823 -14.781 1.00 49.48 C ATOM 7370 C VAL B 407 -26.015 48.100 -14.497 1.00 49.45 C ATOM 7371 O VAL B 407 -24.949 48.546 -14.918 1.00 49.16 O ATOM 7372 CB VAL B 407 -27.777 49.698 -13.586 1.00 49.40 C ATOM 7373 CG1 VAL B 407 -26.789 49.651 -12.434 1.00 49.48 C ATOM 7374 CG2 VAL B 407 -27.946 51.101 -14.034 1.00 49.17 C ATOM 7375 HA VAL B 407 -27.151 49.504 -15.614 1.00 0.00 H ATOM 7376 HB VAL B 407 -28.724 49.297 -13.226 1.00 0.00 H ATOM 7377 HG11 VAL B 407 -26.690 48.624 -12.084 1.00 0.00 H ATOM 7378 HG12 VAL B 407 -25.819 50.015 -12.773 1.00 0.00 H ATOM 7379 HG13 VAL B 407 -27.151 50.280 -11.621 1.00 0.00 H ATOM 7380 HG21 VAL B 407 -26.997 51.475 -14.419 1.00 0.00 H ATOM 7381 HG22 VAL B 407 -28.700 51.142 -14.820 1.00 0.00 H ATOM 7382 HG23 VAL B 407 -28.264 51.714 -13.191 1.00 0.00 H ATOM 7383 H VAL B 407 -29.190 47.736 -14.571 1.00 0.00 H ATOM 7384 N LEU B 408 -26.115 46.978 -13.790 1.00 49.79 N ATOM 7385 CA LEU B 408 -24.962 46.130 -13.502 1.00 50.29 C ATOM 7386 C LEU B 408 -24.304 45.663 -14.805 1.00 50.81 C ATOM 7387 O LEU B 408 -23.077 45.648 -14.913 1.00 50.89 O ATOM 7388 CB LEU B 408 -25.376 44.933 -12.620 1.00 50.18 C ATOM 7389 CG LEU B 408 -24.399 43.782 -12.337 1.00 49.63 C ATOM 7390 CD1 LEU B 408 -23.218 44.232 -11.491 1.00 49.13 C ATOM 7391 CD2 LEU B 408 -25.110 42.636 -11.665 1.00 49.67 C ATOM 7392 HA LEU B 408 -24.228 46.713 -12.946 1.00 0.00 H ATOM 7393 HB2 LEU B 408 -25.659 45.345 -11.651 1.00 0.00 H ATOM 7394 HB3 LEU B 408 -26.251 44.487 -13.093 1.00 0.00 H ATOM 7395 HG LEU B 408 -24.010 43.447 -13.298 1.00 0.00 H ATOM 7396 HD21 LEU B 408 -25.537 42.978 -10.722 1.00 0.00 H ATOM 7397 HD22 LEU B 408 -25.906 42.273 -12.315 1.00 0.00 H ATOM 7398 HD23 LEU B 408 -24.400 41.832 -11.474 1.00 0.00 H ATOM 7399 HD11 LEU B 408 -22.676 45.018 -12.016 1.00 0.00 H ATOM 7400 HD12 LEU B 408 -23.581 44.614 -10.537 1.00 0.00 H ATOM 7401 HD13 LEU B 408 -22.554 43.385 -11.316 1.00 0.00 H ATOM 7402 H LEU B 408 -27.048 46.694 -13.429 1.00 0.00 H ATOM 7403 N ARG B 409 -25.131 45.309 -15.786 1.00 51.18 N ATOM 7404 CA ARG B 409 -24.662 44.843 -17.087 1.00 51.97 C ATOM 7405 C ARG B 409 -23.743 45.875 -17.760 1.00 51.79 C ATOM 7406 O ARG B 409 -22.618 45.551 -18.161 1.00 51.80 O ATOM 7407 CB ARG B 409 -25.870 44.508 -17.973 1.00 51.87 C ATOM 7408 CG ARG B 409 -25.659 43.389 -18.977 1.00 52.72 C ATOM 7409 CD ARG B 409 -26.982 42.965 -19.646 1.00 53.22 C ATOM 7410 NE ARG B 409 -27.641 44.107 -20.280 1.00 57.36 N ATOM 7411 CZ ARG B 409 -27.294 44.629 -21.460 1.00 58.76 C ATOM 7412 NH1 ARG B 409 -26.296 44.105 -22.171 1.00 59.35 N ATOM 7413 NH2 ARG B 409 -27.949 45.684 -21.934 1.00 58.87 N ATOM 7414 HA ARG B 409 -24.066 43.942 -16.943 1.00 0.00 H ATOM 7415 HB2 ARG B 409 -26.695 44.222 -17.321 1.00 0.00 H ATOM 7416 HB3 ARG B 409 -26.140 45.408 -18.526 1.00 0.00 H ATOM 7417 HG2 ARG B 409 -24.967 43.731 -19.747 1.00 0.00 H ATOM 7418 HG3 ARG B 409 -25.232 42.528 -18.462 1.00 0.00 H ATOM 7419 HD2 ARG B 409 -27.645 42.546 -18.890 1.00 0.00 H ATOM 7420 HD3 ARG B 409 -26.772 42.209 -20.403 1.00 0.00 H ATOM 7421 HE ARG B 409 -28.438 44.545 -19.775 1.00 0.00 H ATOM 7422 HH12 ARG B 409 -26.036 44.521 -23.088 1.00 0.00 H ATOM 7423 HH11 ARG B 409 -25.777 43.280 -21.809 1.00 0.00 H ATOM 7424 HH22 ARG B 409 -27.681 46.093 -22.852 1.00 0.00 H ATOM 7425 HH21 ARG B 409 -28.729 46.101 -21.387 1.00 0.00 H ATOM 7426 H ARG B 409 -26.156 45.367 -15.618 1.00 0.00 H ATOM 7427 N LEU B 410 -24.211 47.118 -17.850 1.00 51.81 N ATOM 7428 CA LEU B 410 -23.473 48.161 -18.560 1.00 52.03 C ATOM 7429 C LEU B 410 -22.300 48.681 -17.752 1.00 52.13 C ATOM 7430 O LEU B 410 -21.259 49.022 -18.320 1.00 51.92 O ATOM 7431 CB LEU B 410 -24.387 49.318 -18.982 1.00 52.08 C ATOM 7432 CG LEU B 410 -25.536 49.035 -19.973 1.00 52.71 C ATOM 7433 CD1 LEU B 410 -26.050 50.334 -20.588 1.00 53.19 C ATOM 7434 CD2 LEU B 410 -25.184 48.024 -21.083 1.00 52.29 C ATOM 7435 HA LEU B 410 -23.076 47.695 -19.462 1.00 0.00 H ATOM 7436 HB2 LEU B 410 -24.838 49.718 -18.074 1.00 0.00 H ATOM 7437 HB3 LEU B 410 -23.752 50.079 -19.436 1.00 0.00 H ATOM 7438 HG LEU B 410 -26.321 48.567 -19.379 1.00 0.00 H ATOM 7439 HD21 LEU B 410 -24.346 48.404 -21.667 1.00 0.00 H ATOM 7440 HD22 LEU B 410 -24.911 47.071 -20.631 1.00 0.00 H ATOM 7441 HD23 LEU B 410 -26.048 47.885 -21.733 1.00 0.00 H ATOM 7442 HD11 LEU B 410 -26.419 50.988 -19.798 1.00 0.00 H ATOM 7443 HD12 LEU B 410 -25.238 50.828 -21.121 1.00 0.00 H ATOM 7444 HD13 LEU B 410 -26.859 50.110 -21.283 1.00 0.00 H ATOM 7445 H LEU B 410 -25.122 47.352 -17.405 1.00 0.00 H ATOM 7446 N HIS B 411 -22.474 48.747 -16.431 1.00 52.40 N ATOM 7447 CA HIS B 411 -21.389 49.139 -15.533 1.00 52.52 C ATOM 7448 C HIS B 411 -20.202 48.186 -15.659 1.00 52.61 C ATOM 7449 O HIS B 411 -19.052 48.630 -15.742 1.00 52.77 O ATOM 7450 CB HIS B 411 -21.848 49.213 -14.076 1.00 52.42 C ATOM 7451 CG HIS B 411 -20.815 49.786 -13.152 1.00 52.45 C ATOM 7452 ND1 HIS B 411 -20.855 51.090 -12.709 1.00 53.01 N ATOM 7453 CD2 HIS B 411 -19.702 49.238 -12.606 1.00 52.43 C ATOM 7454 CE1 HIS B 411 -19.816 51.318 -11.922 1.00 53.22 C ATOM 7455 NE2 HIS B 411 -19.098 50.212 -11.848 1.00 52.27 N ATOM 7456 HA HIS B 411 -21.075 50.138 -15.836 1.00 0.00 H ATOM 7457 HB2 HIS B 411 -22.740 49.837 -14.026 1.00 0.00 H ATOM 7458 HB3 HIS B 411 -22.092 48.205 -13.739 1.00 0.00 H ATOM 7459 HD2 HIS B 411 -19.351 48.215 -12.743 1.00 0.00 H ATOM 7460 HE1 HIS B 411 -19.591 52.259 -11.420 1.00 0.00 H ATOM 7461 H HIS B 411 -23.405 48.514 -16.030 1.00 0.00 H ATOM 7462 N LEU B 412 -20.489 46.886 -15.683 1.00 52.67 N ATOM 7463 CA LEU B 412 -19.463 45.860 -15.859 1.00 52.82 C ATOM 7464 C LEU B 412 -18.766 45.988 -17.212 1.00 53.13 C ATOM 7465 O LEU B 412 -17.556 45.821 -17.306 1.00 53.05 O ATOM 7466 CB LEU B 412 -20.068 44.463 -15.712 1.00 52.69 C ATOM 7467 CG LEU B 412 -20.544 44.034 -14.327 1.00 51.94 C ATOM 7468 CD1 LEU B 412 -21.431 42.828 -14.456 1.00 51.20 C ATOM 7469 CD2 LEU B 412 -19.379 43.735 -13.418 1.00 51.31 C ATOM 7470 HA LEU B 412 -18.716 46.009 -15.079 1.00 0.00 H ATOM 7471 HB2 LEU B 412 -20.926 44.408 -16.382 1.00 0.00 H ATOM 7472 HB3 LEU B 412 -19.312 43.746 -16.032 1.00 0.00 H ATOM 7473 HG LEU B 412 -21.107 44.854 -13.882 1.00 0.00 H ATOM 7474 HD21 LEU B 412 -18.783 42.929 -13.846 1.00 0.00 H ATOM 7475 HD22 LEU B 412 -18.763 44.628 -13.313 1.00 0.00 H ATOM 7476 HD23 LEU B 412 -19.752 43.432 -12.439 1.00 0.00 H ATOM 7477 HD11 LEU B 412 -22.292 43.076 -15.077 1.00 0.00 H ATOM 7478 HD12 LEU B 412 -20.871 42.015 -14.918 1.00 0.00 H ATOM 7479 HD13 LEU B 412 -21.771 42.521 -13.467 1.00 0.00 H ATOM 7480 H LEU B 412 -21.480 46.590 -15.572 1.00 0.00 H ATOM 7481 N GLN B 413 -19.542 46.291 -18.251 1.00 53.65 N ATOM 7482 CA GLN B 413 -18.997 46.491 -19.596 1.00 54.19 C ATOM 7483 C GLN B 413 -18.081 47.710 -19.683 1.00 54.20 C ATOM 7484 O GLN B 413 -17.116 47.703 -20.450 1.00 54.34 O ATOM 7485 CB GLN B 413 -20.124 46.583 -20.633 1.00 54.49 C ATOM 7486 CG GLN B 413 -20.526 45.231 -21.216 1.00 55.27 C ATOM 7487 CD GLN B 413 -21.996 45.131 -21.596 1.00 56.75 C ATOM 7488 OE1 GLN B 413 -22.654 44.133 -21.284 1.00 57.24 O ATOM 7489 NE2 GLN B 413 -22.518 46.155 -22.280 1.00 57.41 N ATOM 7490 HA GLN B 413 -18.384 45.618 -19.820 1.00 0.00 H ATOM 7491 HB2 GLN B 413 -20.998 47.027 -20.155 1.00 0.00 H ATOM 7492 HB3 GLN B 413 -19.792 47.226 -21.448 1.00 0.00 H ATOM 7493 HG2 GLN B 413 -19.928 45.052 -22.110 1.00 0.00 H ATOM 7494 HG3 GLN B 413 -20.310 44.461 -20.476 1.00 0.00 H ATOM 7495 HE22 GLN B 413 -21.926 46.975 -22.521 1.00 0.00 H ATOM 7496 HE21 GLN B 413 -23.516 46.131 -22.571 1.00 0.00 H ATOM 7497 H GLN B 413 -20.567 46.389 -18.103 1.00 0.00 H ATOM 7498 N SER B 414 -18.387 48.744 -18.897 1.00 54.17 N ATOM 7499 CA SER B 414 -17.549 49.943 -18.809 1.00 54.01 C ATOM 7500 C SER B 414 -16.271 49.662 -18.033 1.00 53.99 C ATOM 7501 O SER B 414 -15.170 49.787 -18.571 1.00 54.11 O ATOM 7502 CB SER B 414 -18.304 51.099 -18.148 1.00 54.11 C ATOM 7503 OG SER B 414 -19.260 51.662 -19.034 1.00 54.62 O ATOM 7504 HA SER B 414 -17.289 50.229 -19.828 1.00 0.00 H ATOM 7505 HB2 SER B 414 -17.590 51.870 -17.858 1.00 0.00 H ATOM 7506 HB3 SER B 414 -18.817 50.728 -17.261 1.00 0.00 H ATOM 7507 HG SER B 414 -19.914 50.967 -19.297 1.00 0.00 H ATOM 7508 H SER B 414 -19.254 48.697 -18.325 1.00 0.00 H ATOM 7509 N ASN B 415 -16.419 49.261 -16.774 1.00 53.74 N ATOM 7510 CA ASN B 415 -15.281 49.156 -15.885 1.00 53.38 C ATOM 7511 C ASN B 415 -14.430 47.923 -16.132 1.00 53.18 C ATOM 7512 O ASN B 415 -13.304 47.835 -15.642 1.00 53.22 O ATOM 7513 CB ASN B 415 -15.735 49.218 -14.429 1.00 53.63 C ATOM 7514 CG ASN B 415 -14.749 49.955 -13.549 1.00 54.19 C ATOM 7515 OD1 ASN B 415 -14.418 51.117 -13.804 1.00 56.10 O ATOM 7516 ND2 ASN B 415 -14.266 49.283 -12.512 1.00 54.32 N ATOM 7517 HA ASN B 415 -14.641 50.011 -16.102 1.00 0.00 H ATOM 7518 HB2 ASN B 415 -16.696 49.730 -14.383 1.00 0.00 H ATOM 7519 HB3 ASN B 415 -15.848 48.201 -14.053 1.00 0.00 H ATOM 7520 HD22 ASN B 415 -14.574 48.305 -12.337 1.00 0.00 H ATOM 7521 HD21 ASN B 415 -13.579 49.734 -11.874 1.00 0.00 H ATOM 7522 H ASN B 415 -17.367 49.019 -16.422 1.00 0.00 H ATOM 7523 N HIS B 416 -14.964 46.969 -16.890 1.00 53.05 N ATOM 7524 CA HIS B 416 -14.220 45.748 -17.203 1.00 53.02 C ATOM 7525 C HIS B 416 -14.365 45.299 -18.667 1.00 52.84 C ATOM 7526 O HIS B 416 -14.841 44.194 -18.937 1.00 52.94 O ATOM 7527 CB HIS B 416 -14.630 44.605 -16.267 1.00 53.15 C ATOM 7528 CG HIS B 416 -14.478 44.910 -14.806 1.00 53.48 C ATOM 7529 ND1 HIS B 416 -13.431 44.423 -14.049 1.00 53.50 N ATOM 7530 CD2 HIS B 416 -15.265 45.614 -13.955 1.00 53.26 C ATOM 7531 CE1 HIS B 416 -13.568 44.834 -12.800 1.00 53.64 C ATOM 7532 NE2 HIS B 416 -14.672 45.559 -12.717 1.00 54.02 N ATOM 7533 HA HIS B 416 -13.169 45.993 -17.049 1.00 0.00 H ATOM 7534 HB2 HIS B 416 -15.676 44.367 -16.458 1.00 0.00 H ATOM 7535 HB3 HIS B 416 -14.013 43.737 -16.499 1.00 0.00 H ATOM 7536 HD2 HIS B 416 -16.193 46.127 -14.206 1.00 0.00 H ATOM 7537 HE1 HIS B 416 -12.887 44.613 -11.978 1.00 0.00 H ATOM 7538 H HIS B 416 -15.926 47.093 -17.266 1.00 0.00 H ATOM 7539 N PRO B 417 -13.909 46.130 -19.620 1.00 52.85 N ATOM 7540 CA PRO B 417 -14.121 45.762 -21.019 1.00 52.77 C ATOM 7541 C PRO B 417 -13.165 44.673 -21.478 1.00 52.71 C ATOM 7542 O PRO B 417 -13.174 44.316 -22.654 1.00 52.76 O ATOM 7543 CB PRO B 417 -13.828 47.058 -21.768 1.00 52.97 C ATOM 7544 CG PRO B 417 -12.838 47.772 -20.899 1.00 53.19 C ATOM 7545 CD PRO B 417 -13.159 47.395 -19.481 1.00 52.77 C ATOM 7546 HA PRO B 417 -15.121 45.363 -21.189 1.00 0.00 H ATOM 7547 HD3 PRO B 417 -12.248 47.246 -18.902 1.00 0.00 H ATOM 7548 HD2 PRO B 417 -13.771 48.160 -19.003 1.00 0.00 H ATOM 7549 HG3 PRO B 417 -12.930 48.850 -21.032 1.00 0.00 H ATOM 7550 HG2 PRO B 417 -11.824 47.461 -21.150 1.00 0.00 H ATOM 7551 HB2 PRO B 417 -13.401 46.849 -22.749 1.00 0.00 H ATOM 7552 HB3 PRO B 417 -14.736 47.650 -21.886 1.00 0.00 H ATOM 7553 N ASP B 418 -12.356 44.161 -20.550 1.00 52.52 N ATOM 7554 CA ASP B 418 -11.388 43.087 -20.817 1.00 52.41 C ATOM 7555 C ASP B 418 -11.988 41.708 -20.610 1.00 52.12 C ATOM 7556 O ASP B 418 -11.506 40.723 -21.175 1.00 52.11 O ATOM 7557 CB ASP B 418 -10.129 43.249 -19.955 1.00 52.49 C ATOM 7558 CG ASP B 418 -10.340 44.197 -18.783 1.00 53.34 C ATOM 7559 OD1 ASP B 418 -11.200 45.105 -18.884 1.00 53.58 O ATOM 7560 OD2 ASP B 418 -9.638 44.045 -17.762 1.00 53.48 O ATOM 7561 HA ASP B 418 -11.110 43.173 -21.867 1.00 0.00 H ATOM 7562 HB2 ASP B 418 -9.843 42.271 -19.567 1.00 0.00 H ATOM 7563 HB3 ASP B 418 -9.326 43.639 -20.580 1.00 0.00 H ATOM 7564 H ASP B 418 -12.413 44.542 -19.584 1.00 0.00 H ATOM 7565 N ASP B 419 -13.022 41.633 -19.775 1.00 51.91 N ATOM 7566 CA ASP B 419 -13.847 40.434 -19.723 1.00 51.71 C ATOM 7567 C ASP B 419 -15.291 40.809 -20.000 1.00 51.39 C ATOM 7568 O ASP B 419 -16.098 41.026 -19.090 1.00 51.37 O ATOM 7569 CB ASP B 419 -13.703 39.661 -18.408 1.00 51.88 C ATOM 7570 CG ASP B 419 -14.406 38.286 -18.446 1.00 52.25 C ATOM 7571 OD1 ASP B 419 -14.783 37.791 -19.554 1.00 48.84 O ATOM 7572 OD2 ASP B 419 -14.577 37.708 -17.339 1.00 53.23 O ATOM 7573 HA ASP B 419 -13.495 39.751 -20.496 1.00 0.00 H ATOM 7574 HB2 ASP B 419 -12.643 39.506 -18.208 1.00 0.00 H ATOM 7575 HB3 ASP B 419 -14.140 40.254 -17.605 1.00 0.00 H ATOM 7576 H ASP B 419 -13.243 42.438 -19.154 1.00 0.00 H ATOM 7577 N ILE B 420 -15.592 40.873 -21.290 1.00 50.88 N ATOM 7578 CA ILE B 420 -16.895 41.253 -21.778 1.00 50.43 C ATOM 7579 C ILE B 420 -17.991 40.322 -21.227 1.00 49.66 C ATOM 7580 O ILE B 420 -19.161 40.713 -21.125 1.00 49.84 O ATOM 7581 CB ILE B 420 -16.879 41.371 -23.345 1.00 50.87 C ATOM 7582 CG1 ILE B 420 -18.274 41.683 -23.918 1.00 51.78 C ATOM 7583 CG2 ILE B 420 -16.255 40.126 -23.997 1.00 50.72 C ATOM 7584 CD1 ILE B 420 -18.920 42.986 -23.407 1.00 52.30 C ATOM 7585 HA ILE B 420 -17.147 42.244 -21.402 1.00 0.00 H ATOM 7586 HB ILE B 420 -16.244 42.221 -23.595 1.00 0.00 H ATOM 7587 HG12 ILE B 420 -18.185 41.754 -25.002 1.00 0.00 H ATOM 7588 HG13 ILE B 420 -18.936 40.856 -23.662 1.00 0.00 H ATOM 7589 HD11 ILE B 420 -19.034 42.933 -22.324 1.00 0.00 H ATOM 7590 HD12 ILE B 420 -18.283 43.832 -23.665 1.00 0.00 H ATOM 7591 HD13 ILE B 420 -19.898 43.111 -23.871 1.00 0.00 H ATOM 7592 HG21 ILE B 420 -15.229 40.011 -23.648 1.00 0.00 H ATOM 7593 HG22 ILE B 420 -16.835 39.245 -23.722 1.00 0.00 H ATOM 7594 HG23 ILE B 420 -16.261 40.243 -25.081 1.00 0.00 H ATOM 7595 H ILE B 420 -14.853 40.638 -21.983 1.00 0.00 H ATOM 7596 N PHE B 421 -17.604 39.115 -20.827 1.00 48.40 N ATOM 7597 CA PHE B 421 -18.562 38.170 -20.258 1.00 47.37 C ATOM 7598 C PHE B 421 -18.497 38.075 -18.728 1.00 46.49 C ATOM 7599 O PHE B 421 -18.841 37.043 -18.135 1.00 46.39 O ATOM 7600 CB PHE B 421 -18.392 36.797 -20.899 1.00 47.57 C ATOM 7601 CG PHE B 421 -18.314 36.841 -22.390 1.00 48.25 C ATOM 7602 CD1 PHE B 421 -17.117 36.564 -23.040 1.00 49.09 C ATOM 7603 CD2 PHE B 421 -19.433 37.181 -23.148 1.00 48.26 C ATOM 7604 CE1 PHE B 421 -17.043 36.612 -24.428 1.00 48.91 C ATOM 7605 CE2 PHE B 421 -19.365 37.230 -24.526 1.00 47.70 C ATOM 7606 CZ PHE B 421 -18.173 36.946 -25.166 1.00 47.96 C ATOM 7607 HA PHE B 421 -19.555 38.557 -20.488 1.00 0.00 H ATOM 7608 HB2 PHE B 421 -17.474 36.349 -20.518 1.00 0.00 H ATOM 7609 HB3 PHE B 421 -19.242 36.176 -20.616 1.00 0.00 H ATOM 7610 HD2 PHE B 421 -20.373 37.411 -22.647 1.00 0.00 H ATOM 7611 HE2 PHE B 421 -20.249 37.492 -25.108 1.00 0.00 H ATOM 7612 HZ PHE B 421 -18.119 36.984 -26.254 1.00 0.00 H ATOM 7613 HE1 PHE B 421 -16.104 36.389 -24.935 1.00 0.00 H ATOM 7614 HD1 PHE B 421 -16.231 36.308 -22.459 1.00 0.00 H ATOM 7615 H PHE B 421 -16.606 38.839 -20.920 1.00 0.00 H ATOM 7616 N LEU B 422 -18.056 39.161 -18.092 1.00 45.25 N ATOM 7617 CA LEU B 422 -18.040 39.250 -16.626 1.00 43.66 C ATOM 7618 C LEU B 422 -19.457 39.103 -16.031 1.00 42.87 C ATOM 7619 O LEU B 422 -19.638 38.446 -15.004 1.00 42.65 O ATOM 7620 CB LEU B 422 -17.391 40.572 -16.175 1.00 43.44 C ATOM 7621 CG LEU B 422 -17.172 40.840 -14.685 1.00 42.09 C ATOM 7622 CD1 LEU B 422 -16.290 39.790 -14.047 1.00 41.34 C ATOM 7623 CD2 LEU B 422 -16.547 42.183 -14.506 1.00 42.81 C ATOM 7624 HA LEU B 422 -17.441 38.421 -16.249 1.00 0.00 H ATOM 7625 HB2 LEU B 422 -16.413 40.623 -16.653 1.00 0.00 H ATOM 7626 HB3 LEU B 422 -18.020 41.378 -16.552 1.00 0.00 H ATOM 7627 HG LEU B 422 -18.145 40.805 -14.195 1.00 0.00 H ATOM 7628 HD21 LEU B 422 -15.589 42.208 -15.024 1.00 0.00 H ATOM 7629 HD22 LEU B 422 -17.205 42.947 -14.920 1.00 0.00 H ATOM 7630 HD23 LEU B 422 -16.392 42.372 -13.444 1.00 0.00 H ATOM 7631 HD11 LEU B 422 -16.758 38.811 -14.153 1.00 0.00 H ATOM 7632 HD12 LEU B 422 -15.318 39.785 -14.540 1.00 0.00 H ATOM 7633 HD13 LEU B 422 -16.161 40.019 -12.989 1.00 0.00 H ATOM 7634 H LEU B 422 -17.713 39.969 -18.650 1.00 0.00 H ATOM 7635 N PHE B 423 -20.440 39.719 -16.693 1.00 41.39 N ATOM 7636 CA PHE B 423 -21.825 39.710 -16.249 1.00 40.17 C ATOM 7637 C PHE B 423 -22.398 38.291 -16.128 1.00 39.76 C ATOM 7638 O PHE B 423 -22.910 37.941 -15.063 1.00 39.39 O ATOM 7639 CB PHE B 423 -22.695 40.624 -17.137 1.00 39.74 C ATOM 7640 CG PHE B 423 -24.148 40.617 -16.776 1.00 39.41 C ATOM 7641 CD1 PHE B 423 -24.566 40.936 -15.484 1.00 38.62 C ATOM 7642 CD2 PHE B 423 -25.103 40.273 -17.718 1.00 39.04 C ATOM 7643 CE1 PHE B 423 -25.916 40.918 -15.138 1.00 37.03 C ATOM 7644 CE2 PHE B 423 -26.454 40.255 -17.377 1.00 38.43 C ATOM 7645 CZ PHE B 423 -26.854 40.582 -16.082 1.00 38.01 C ATOM 7646 HA PHE B 423 -21.844 40.120 -15.239 1.00 0.00 H ATOM 7647 HB2 PHE B 423 -22.324 41.645 -17.047 1.00 0.00 H ATOM 7648 HB3 PHE B 423 -22.596 40.293 -18.171 1.00 0.00 H ATOM 7649 HD2 PHE B 423 -24.796 40.015 -18.732 1.00 0.00 H ATOM 7650 HE2 PHE B 423 -27.200 39.985 -18.124 1.00 0.00 H ATOM 7651 HZ PHE B 423 -27.912 40.571 -15.819 1.00 0.00 H ATOM 7652 HE1 PHE B 423 -26.225 41.169 -14.123 1.00 0.00 H ATOM 7653 HD1 PHE B 423 -23.824 41.204 -14.732 1.00 0.00 H ATOM 7654 H PHE B 423 -20.204 40.229 -17.568 1.00 0.00 H ATOM 7655 N PRO B 424 -22.342 37.484 -17.216 1.00 39.44 N ATOM 7656 CA PRO B 424 -22.741 36.079 -17.105 1.00 39.21 C ATOM 7657 C PRO B 424 -21.973 35.334 -16.032 1.00 39.14 C ATOM 7658 O PRO B 424 -22.572 34.550 -15.281 1.00 39.41 O ATOM 7659 CB PRO B 424 -22.412 35.491 -18.489 1.00 39.12 C ATOM 7660 CG PRO B 424 -21.658 36.501 -19.202 1.00 38.90 C ATOM 7661 CD PRO B 424 -21.988 37.823 -18.604 1.00 39.23 C ATOM 7662 HA PRO B 424 -23.790 35.989 -16.823 1.00 0.00 H ATOM 7663 HD3 PRO B 424 -21.129 38.493 -18.636 1.00 0.00 H ATOM 7664 HD2 PRO B 424 -22.828 38.287 -19.120 1.00 0.00 H ATOM 7665 HG3 PRO B 424 -21.932 36.492 -20.257 1.00 0.00 H ATOM 7666 HG2 PRO B 424 -20.590 36.305 -19.103 1.00 0.00 H ATOM 7667 HB2 PRO B 424 -21.817 34.584 -18.380 1.00 0.00 H ATOM 7668 HB3 PRO B 424 -23.331 35.258 -19.027 1.00 0.00 H ATOM 7669 N LYS B 425 -20.664 35.563 -15.961 1.00 38.88 N ATOM 7670 CA LYS B 425 -19.854 34.973 -14.890 1.00 38.82 C ATOM 7671 C LYS B 425 -20.439 35.284 -13.510 1.00 38.49 C ATOM 7672 O LYS B 425 -20.402 34.441 -12.612 1.00 38.66 O ATOM 7673 CB LYS B 425 -18.386 35.416 -14.978 1.00 38.85 C ATOM 7674 CG LYS B 425 -17.491 34.410 -15.677 1.00 39.02 C ATOM 7675 CD LYS B 425 -16.320 35.091 -16.354 1.00 40.50 C ATOM 7676 CE LYS B 425 -15.813 34.248 -17.506 1.00 42.18 C ATOM 7677 NZ LYS B 425 -14.900 34.998 -18.427 1.00 45.11 N ATOM 7678 HA LYS B 425 -19.880 33.892 -15.028 1.00 0.00 H ATOM 7679 HB2 LYS B 425 -18.342 36.357 -15.526 1.00 0.00 H ATOM 7680 HB3 LYS B 425 -18.010 35.568 -13.966 1.00 0.00 H ATOM 7681 HG2 LYS B 425 -17.112 33.700 -14.942 1.00 0.00 H ATOM 7682 HG3 LYS B 425 -18.074 33.877 -16.428 1.00 0.00 H ATOM 7683 HD2 LYS B 425 -16.639 36.062 -16.732 1.00 0.00 H ATOM 7684 HD3 LYS B 425 -15.517 35.230 -15.630 1.00 0.00 H ATOM 7685 HE2 LYS B 425 -16.669 33.893 -18.079 1.00 0.00 H ATOM 7686 HE3 LYS B 425 -15.271 33.394 -17.099 1.00 0.00 H ATOM 7687 HZ1 LYS B 425 -15.408 35.811 -18.831 1.00 0.00 H ATOM 7688 HZ2 LYS B 425 -14.073 35.335 -17.895 1.00 0.00 H ATOM 7689 HZ3 LYS B 425 -14.588 34.368 -19.193 1.00 0.00 H ATOM 7690 H LYS B 425 -20.209 36.168 -16.674 1.00 0.00 H ATOM 7691 N LEU B 426 -20.996 36.485 -13.365 1.00 38.30 N ATOM 7692 CA LEU B 426 -21.621 36.914 -12.119 1.00 38.13 C ATOM 7693 C LEU B 426 -22.993 36.306 -11.885 1.00 37.89 C ATOM 7694 O LEU B 426 -23.402 36.125 -10.745 1.00 38.10 O ATOM 7695 CB LEU B 426 -21.698 38.433 -12.051 1.00 38.17 C ATOM 7696 CG LEU B 426 -20.385 39.063 -11.609 1.00 38.76 C ATOM 7697 CD1 LEU B 426 -20.494 40.566 -11.692 1.00 39.58 C ATOM 7698 CD2 LEU B 426 -20.015 38.620 -10.188 1.00 39.36 C ATOM 7699 HA LEU B 426 -20.980 36.544 -11.319 1.00 0.00 H ATOM 7700 HB2 LEU B 426 -21.954 38.815 -13.039 1.00 0.00 H ATOM 7701 HB3 LEU B 426 -22.477 38.713 -11.341 1.00 0.00 H ATOM 7702 HG LEU B 426 -19.590 38.727 -12.275 1.00 0.00 H ATOM 7703 HD21 LEU B 426 -20.801 38.926 -9.497 1.00 0.00 H ATOM 7704 HD22 LEU B 426 -19.909 37.535 -10.163 1.00 0.00 H ATOM 7705 HD23 LEU B 426 -19.073 39.085 -9.898 1.00 0.00 H ATOM 7706 HD11 LEU B 426 -20.709 40.857 -12.720 1.00 0.00 H ATOM 7707 HD12 LEU B 426 -21.299 40.907 -11.041 1.00 0.00 H ATOM 7708 HD13 LEU B 426 -19.553 41.015 -11.375 1.00 0.00 H ATOM 7709 H LEU B 426 -20.985 37.142 -14.171 1.00 0.00 H ATOM 7710 N LEU B 427 -23.702 35.982 -12.956 1.00 37.70 N ATOM 7711 CA LEU B 427 -24.958 35.265 -12.824 1.00 37.61 C ATOM 7712 C LEU B 427 -24.731 33.845 -12.309 1.00 37.83 C ATOM 7713 O LEU B 427 -25.524 33.351 -11.512 1.00 36.92 O ATOM 7714 CB LEU B 427 -25.720 35.268 -14.141 1.00 37.51 C ATOM 7715 CG LEU B 427 -26.112 36.652 -14.672 1.00 37.44 C ATOM 7716 CD1 LEU B 427 -26.793 36.493 -16.017 1.00 37.95 C ATOM 7717 CD2 LEU B 427 -27.007 37.445 -13.711 1.00 37.18 C ATOM 7718 HA LEU B 427 -25.570 35.783 -12.085 1.00 0.00 H ATOM 7719 HB2 LEU B 427 -25.096 34.784 -14.892 1.00 0.00 H ATOM 7720 HB3 LEU B 427 -26.634 34.690 -14.002 1.00 0.00 H ATOM 7721 HG LEU B 427 -25.194 37.231 -14.773 1.00 0.00 H ATOM 7722 HD21 LEU B 427 -27.928 36.890 -13.533 1.00 0.00 H ATOM 7723 HD22 LEU B 427 -26.483 37.593 -12.767 1.00 0.00 H ATOM 7724 HD23 LEU B 427 -27.244 38.413 -14.153 1.00 0.00 H ATOM 7725 HD11 LEU B 427 -26.108 36.012 -16.715 1.00 0.00 H ATOM 7726 HD12 LEU B 427 -27.685 35.878 -15.901 1.00 0.00 H ATOM 7727 HD13 LEU B 427 -27.074 37.475 -16.399 1.00 0.00 H ATOM 7728 H LEU B 427 -23.356 36.244 -13.901 1.00 0.00 H ATOM 7729 N GLN B 428 -23.642 33.212 -12.757 1.00 38.41 N ATOM 7730 CA GLN B 428 -23.201 31.923 -12.214 1.00 39.22 C ATOM 7731 C GLN B 428 -22.969 32.033 -10.709 1.00 38.80 C ATOM 7732 O GLN B 428 -23.454 31.193 -9.944 1.00 38.83 O ATOM 7733 CB GLN B 428 -21.917 31.427 -12.894 1.00 39.00 C ATOM 7734 CG GLN B 428 -22.014 31.284 -14.407 1.00 40.87 C ATOM 7735 CD GLN B 428 -20.692 30.859 -15.067 1.00 41.27 C ATOM 7736 OE1 GLN B 428 -19.803 31.692 -15.313 1.00 43.77 O ATOM 7737 NE2 GLN B 428 -20.572 29.561 -15.386 1.00 42.73 N ATOM 7738 HA GLN B 428 -23.992 31.200 -12.413 1.00 0.00 H ATOM 7739 HB2 GLN B 428 -21.118 32.134 -12.670 1.00 0.00 H ATOM 7740 HB3 GLN B 428 -21.665 30.452 -12.476 1.00 0.00 H ATOM 7741 HG2 GLN B 428 -22.771 30.534 -14.635 1.00 0.00 H ATOM 7742 HG3 GLN B 428 -22.317 32.244 -14.826 1.00 0.00 H ATOM 7743 HE22 GLN B 428 -21.341 28.897 -15.162 1.00 0.00 H ATOM 7744 HE21 GLN B 428 -19.710 29.219 -15.857 1.00 0.00 H ATOM 7745 H GLN B 428 -23.087 33.650 -13.519 1.00 0.00 H ATOM 7746 N LYS B 429 -22.238 33.072 -10.294 1.00 38.46 N ATOM 7747 CA LYS B 429 -21.927 33.306 -8.864 1.00 38.54 C ATOM 7748 C LYS B 429 -23.173 33.412 -7.970 1.00 38.47 C ATOM 7749 O LYS B 429 -23.177 32.875 -6.865 1.00 38.62 O ATOM 7750 CB LYS B 429 -21.016 34.537 -8.652 1.00 38.35 C ATOM 7751 CG LYS B 429 -19.680 34.504 -9.391 1.00 37.63 C ATOM 7752 CD LYS B 429 -18.812 33.362 -8.917 1.00 37.30 C ATOM 7753 CE LYS B 429 -17.619 33.192 -9.820 1.00 38.13 C ATOM 7754 NZ LYS B 429 -16.944 31.885 -9.560 1.00 40.42 N ATOM 7755 HA LYS B 429 -21.383 32.414 -8.553 1.00 0.00 H ATOM 7756 HB2 LYS B 429 -21.562 35.420 -8.985 1.00 0.00 H ATOM 7757 HB3 LYS B 429 -20.808 34.621 -7.585 1.00 0.00 H ATOM 7758 HG2 LYS B 429 -19.868 34.387 -10.458 1.00 0.00 H ATOM 7759 HG3 LYS B 429 -19.156 35.444 -9.217 1.00 0.00 H ATOM 7760 HD2 LYS B 429 -18.468 33.570 -7.904 1.00 0.00 H ATOM 7761 HD3 LYS B 429 -19.397 32.442 -8.919 1.00 0.00 H ATOM 7762 HE2 LYS B 429 -16.913 34.002 -9.638 1.00 0.00 H ATOM 7763 HE3 LYS B 429 -17.948 33.225 -10.859 1.00 0.00 H ATOM 7764 HZ1 LYS B 429 -16.626 31.851 -8.571 1.00 0.00 H ATOM 7765 HZ2 LYS B 429 -17.614 31.109 -9.736 1.00 0.00 H ATOM 7766 HZ3 LYS B 429 -16.124 31.788 -10.193 1.00 0.00 H ATOM 7767 H LYS B 429 -21.874 33.742 -11.001 1.00 0.00 H ATOM 7768 N MET B 430 -24.213 34.098 -8.446 1.00 38.31 N ATOM 7769 CA MET B 430 -25.508 34.106 -7.760 1.00 38.81 C ATOM 7770 C MET B 430 -25.963 32.687 -7.440 1.00 38.46 C ATOM 7771 O MET B 430 -26.326 32.386 -6.297 1.00 38.49 O ATOM 7772 CB MET B 430 -26.585 34.836 -8.575 1.00 38.59 C ATOM 7773 CG MET B 430 -26.358 36.334 -8.702 1.00 39.31 C ATOM 7774 SD MET B 430 -27.815 37.255 -9.244 1.00 40.28 S ATOM 7775 CE MET B 430 -27.047 38.735 -9.894 1.00 41.39 C ATOM 7776 HA MET B 430 -25.370 34.651 -6.826 1.00 0.00 H ATOM 7777 HB2 MET B 430 -26.607 34.407 -9.577 1.00 0.00 H ATOM 7778 HB3 MET B 430 -27.548 34.675 -8.091 1.00 0.00 H ATOM 7779 HG2 MET B 430 -25.559 36.500 -9.425 1.00 0.00 H ATOM 7780 HG3 MET B 430 -26.052 36.718 -7.729 1.00 0.00 H ATOM 7781 HE1 MET B 430 -26.485 39.230 -9.101 1.00 0.00 H ATOM 7782 HE2 MET B 430 -26.371 38.466 -10.706 1.00 0.00 H ATOM 7783 HE3 MET B 430 -27.818 39.408 -10.269 1.00 0.00 H ATOM 7784 H MET B 430 -24.102 34.641 -9.326 1.00 0.00 H ATOM 7785 N ALA B 431 -25.927 31.831 -8.458 1.00 38.42 N ATOM 7786 CA ALA B 431 -26.269 30.429 -8.333 1.00 38.45 C ATOM 7787 C ALA B 431 -25.360 29.769 -7.301 1.00 38.52 C ATOM 7788 O ALA B 431 -25.845 29.158 -6.355 1.00 38.71 O ATOM 7789 CB ALA B 431 -26.172 29.733 -9.687 1.00 38.13 C ATOM 7790 HA ALA B 431 -27.300 30.338 -7.991 1.00 0.00 H ATOM 7791 HB1 ALA B 431 -26.861 30.205 -10.387 1.00 0.00 H ATOM 7792 HB2 ALA B 431 -25.153 29.817 -10.065 1.00 0.00 H ATOM 7793 HB3 ALA B 431 -26.433 28.681 -9.573 1.00 0.00 H ATOM 7794 H ALA B 431 -25.638 32.187 -9.392 1.00 0.00 H ATOM 7795 N ASP B 432 -24.051 29.931 -7.454 1.00 38.68 N ATOM 7796 CA ASP B 432 -23.088 29.375 -6.494 1.00 39.11 C ATOM 7797 C ASP B 432 -23.377 29.768 -5.042 1.00 39.18 C ATOM 7798 O ASP B 432 -23.128 28.980 -4.118 1.00 39.22 O ATOM 7799 CB ASP B 432 -21.666 29.806 -6.846 1.00 39.19 C ATOM 7800 CG ASP B 432 -21.142 29.139 -8.086 1.00 39.75 C ATOM 7801 OD1 ASP B 432 -21.681 28.091 -8.494 1.00 41.49 O ATOM 7802 OD2 ASP B 432 -20.174 29.671 -8.658 1.00 41.96 O ATOM 7803 HA ASP B 432 -23.191 28.292 -6.569 1.00 0.00 H ATOM 7804 HB2 ASP B 432 -21.658 30.885 -7.001 1.00 0.00 H ATOM 7805 HB3 ASP B 432 -21.010 29.555 -6.012 1.00 0.00 H ATOM 7806 H ASP B 432 -23.699 30.465 -8.274 1.00 0.00 H ATOM 7807 N LEU B 433 -23.885 30.989 -4.858 1.00 39.13 N ATOM 7808 CA LEU B 433 -24.248 31.508 -3.545 1.00 39.03 C ATOM 7809 C LEU B 433 -25.537 30.936 -3.016 1.00 39.64 C ATOM 7810 O LEU B 433 -25.662 30.710 -1.819 1.00 39.66 O ATOM 7811 CB LEU B 433 -24.340 33.029 -3.558 1.00 38.61 C ATOM 7812 CG LEU B 433 -23.009 33.753 -3.329 1.00 37.51 C ATOM 7813 CD1 LEU B 433 -23.031 35.144 -3.952 1.00 36.11 C ATOM 7814 CD2 LEU B 433 -22.663 33.817 -1.868 1.00 34.85 C ATOM 7815 HA LEU B 433 -23.448 31.193 -2.876 1.00 0.00 H ATOM 7816 HB2 LEU B 433 -24.732 33.337 -4.527 1.00 0.00 H ATOM 7817 HB3 LEU B 433 -25.032 33.334 -2.773 1.00 0.00 H ATOM 7818 HG LEU B 433 -22.228 33.176 -3.824 1.00 0.00 H ATOM 7819 HD21 LEU B 433 -23.446 34.355 -1.334 1.00 0.00 H ATOM 7820 HD22 LEU B 433 -22.580 32.805 -1.471 1.00 0.00 H ATOM 7821 HD23 LEU B 433 -21.713 34.337 -1.743 1.00 0.00 H ATOM 7822 HD11 LEU B 433 -23.203 35.058 -5.025 1.00 0.00 H ATOM 7823 HD12 LEU B 433 -23.831 35.730 -3.500 1.00 0.00 H ATOM 7824 HD13 LEU B 433 -22.074 35.635 -3.775 1.00 0.00 H ATOM 7825 H LEU B 433 -24.028 31.597 -5.689 1.00 0.00 H ATOM 7826 N ARG B 434 -26.496 30.688 -3.897 1.00 40.51 N ATOM 7827 CA ARG B 434 -27.756 30.110 -3.454 1.00 41.50 C ATOM 7828 C ARG B 434 -27.510 28.780 -2.763 1.00 41.71 C ATOM 7829 O ARG B 434 -28.095 28.502 -1.723 1.00 41.62 O ATOM 7830 CB ARG B 434 -28.741 29.953 -4.603 1.00 41.67 C ATOM 7831 CG ARG B 434 -29.129 31.261 -5.234 1.00 43.56 C ATOM 7832 CD ARG B 434 -30.636 31.407 -5.229 1.00 48.44 C ATOM 7833 NE ARG B 434 -31.090 32.561 -6.007 1.00 51.72 N ATOM 7834 CZ ARG B 434 -31.198 32.584 -7.337 1.00 53.21 C ATOM 7835 NH1 ARG B 434 -30.875 31.513 -8.070 1.00 53.42 N ATOM 7836 NH2 ARG B 434 -31.634 33.683 -7.937 1.00 53.47 N ATOM 7837 HA ARG B 434 -28.206 30.798 -2.739 1.00 0.00 H ATOM 7838 HB2 ARG B 434 -28.286 29.322 -5.366 1.00 0.00 H ATOM 7839 HB3 ARG B 434 -29.642 29.470 -4.224 1.00 0.00 H ATOM 7840 HG2 ARG B 434 -28.684 32.081 -4.670 1.00 0.00 H ATOM 7841 HG3 ARG B 434 -28.766 31.289 -6.261 1.00 0.00 H ATOM 7842 HD2 ARG B 434 -30.973 31.525 -4.199 1.00 0.00 H ATOM 7843 HD3 ARG B 434 -31.076 30.504 -5.653 1.00 0.00 H ATOM 7844 HE ARG B 434 -31.347 33.424 -5.486 1.00 0.00 H ATOM 7845 HH12 ARG B 434 -30.964 31.546 -9.106 1.00 0.00 H ATOM 7846 HH11 ARG B 434 -30.535 30.648 -7.604 1.00 0.00 H ATOM 7847 HH22 ARG B 434 -31.721 33.710 -8.973 1.00 0.00 H ATOM 7848 HH21 ARG B 434 -31.889 34.518 -7.372 1.00 0.00 H ATOM 7849 H ARG B 434 -26.348 30.906 -4.903 1.00 0.00 H ATOM 7850 N GLN B 435 -26.609 27.982 -3.323 1.00 42.18 N ATOM 7851 CA GLN B 435 -26.299 26.681 -2.757 1.00 43.04 C ATOM 7852 C GLN B 435 -25.321 26.768 -1.609 1.00 42.49 C ATOM 7853 O GLN B 435 -25.423 25.997 -0.665 1.00 42.79 O ATOM 7854 CB GLN B 435 -25.805 25.711 -3.826 1.00 43.21 C ATOM 7855 CG GLN B 435 -26.929 24.849 -4.417 1.00 44.71 C ATOM 7856 CD GLN B 435 -26.410 23.810 -5.402 1.00 45.35 C ATOM 7857 OE1 GLN B 435 -25.397 24.033 -6.083 1.00 48.73 O ATOM 7858 NE2 GLN B 435 -27.103 22.669 -5.489 1.00 47.10 N ATOM 7859 HA GLN B 435 -27.232 26.290 -2.350 1.00 0.00 H ATOM 7860 HB2 GLN B 435 -25.347 26.285 -4.631 1.00 0.00 H ATOM 7861 HB3 GLN B 435 -25.059 25.053 -3.381 1.00 0.00 H ATOM 7862 HG2 GLN B 435 -27.440 24.335 -3.603 1.00 0.00 H ATOM 7863 HG3 GLN B 435 -27.634 25.500 -4.934 1.00 0.00 H ATOM 7864 HE22 GLN B 435 -27.947 22.527 -4.898 1.00 0.00 H ATOM 7865 HE21 GLN B 435 -26.798 21.924 -6.148 1.00 0.00 H ATOM 7866 H GLN B 435 -26.116 28.294 -4.184 1.00 0.00 H ATOM 7867 N LEU B 436 -24.383 27.705 -1.680 1.00 42.22 N ATOM 7868 CA LEU B 436 -23.498 27.963 -0.556 1.00 42.19 C ATOM 7869 C LEU B 436 -24.315 28.279 0.706 1.00 42.79 C ATOM 7870 O LEU B 436 -24.135 27.644 1.740 1.00 42.52 O ATOM 7871 CB LEU B 436 -22.556 29.118 -0.884 1.00 42.05 C ATOM 7872 CG LEU B 436 -21.365 29.324 0.047 1.00 40.31 C ATOM 7873 CD1 LEU B 436 -20.164 28.601 -0.496 1.00 39.15 C ATOM 7874 CD2 LEU B 436 -21.092 30.801 0.162 1.00 39.87 C ATOM 7875 HA LEU B 436 -22.903 27.070 -0.366 1.00 0.00 H ATOM 7876 HB2 LEU B 436 -22.165 28.949 -1.887 1.00 0.00 H ATOM 7877 HB3 LEU B 436 -23.144 30.036 -0.875 1.00 0.00 H ATOM 7878 HG LEU B 436 -21.585 28.921 1.036 1.00 0.00 H ATOM 7879 HD21 LEU B 436 -20.866 31.205 -0.825 1.00 0.00 H ATOM 7880 HD22 LEU B 436 -21.971 31.301 0.568 1.00 0.00 H ATOM 7881 HD23 LEU B 436 -20.242 30.962 0.825 1.00 0.00 H ATOM 7882 HD11 LEU B 436 -20.385 27.536 -0.570 1.00 0.00 H ATOM 7883 HD12 LEU B 436 -19.922 28.992 -1.484 1.00 0.00 H ATOM 7884 HD13 LEU B 436 -19.317 28.752 0.173 1.00 0.00 H ATOM 7885 H LEU B 436 -24.280 28.262 -2.552 1.00 0.00 H ATOM 7886 N VAL B 437 -25.209 29.261 0.589 1.00 43.75 N ATOM 7887 CA VAL B 437 -26.221 29.587 1.596 1.00 44.74 C ATOM 7888 C VAL B 437 -27.087 28.369 2.014 1.00 45.81 C ATOM 7889 O VAL B 437 -27.286 28.143 3.211 1.00 45.60 O ATOM 7890 CB VAL B 437 -27.099 30.811 1.126 1.00 44.60 C ATOM 7891 CG1 VAL B 437 -28.320 31.023 2.002 1.00 44.55 C ATOM 7892 CG2 VAL B 437 -26.282 32.076 1.100 1.00 44.06 C ATOM 7893 HA VAL B 437 -25.687 29.880 2.500 1.00 0.00 H ATOM 7894 HB VAL B 437 -27.444 30.572 0.120 1.00 0.00 H ATOM 7895 HG11 VAL B 437 -28.945 30.131 1.973 1.00 0.00 H ATOM 7896 HG12 VAL B 437 -28.002 31.212 3.027 1.00 0.00 H ATOM 7897 HG13 VAL B 437 -28.887 31.878 1.632 1.00 0.00 H ATOM 7898 HG21 VAL B 437 -25.899 32.280 2.100 1.00 0.00 H ATOM 7899 HG22 VAL B 437 -25.448 31.954 0.408 1.00 0.00 H ATOM 7900 HG23 VAL B 437 -26.909 32.905 0.773 1.00 0.00 H ATOM 7901 H VAL B 437 -25.186 29.835 -0.278 1.00 0.00 H ATOM 7902 N THR B 438 -27.579 27.584 1.048 1.00 47.22 N ATOM 7903 CA THR B 438 -28.390 26.377 1.356 1.00 49.02 C ATOM 7904 C THR B 438 -27.614 25.365 2.211 1.00 50.21 C ATOM 7905 O THR B 438 -28.061 24.972 3.289 1.00 50.44 O ATOM 7906 CB THR B 438 -28.943 25.665 0.077 1.00 48.99 C ATOM 7907 OG1 THR B 438 -29.884 26.516 -0.589 1.00 49.19 O ATOM 7908 CG2 THR B 438 -29.643 24.355 0.430 1.00 48.59 C ATOM 7909 HA THR B 438 -29.242 26.746 1.927 1.00 0.00 H ATOM 7910 HB THR B 438 -28.094 25.452 -0.573 1.00 0.00 H ATOM 7911 HG1 THR B 438 -29.436 27.359 -0.852 1.00 0.00 H ATOM 7912 HG23 THR B 438 -28.940 23.695 0.938 1.00 0.00 H ATOM 7913 HG21 THR B 438 -30.489 24.562 1.086 1.00 0.00 H ATOM 7914 HG22 THR B 438 -29.998 23.877 -0.483 1.00 0.00 H ATOM 7915 H THR B 438 -27.389 27.825 0.054 1.00 0.00 H ATOM 7916 N GLU B 439 -26.454 24.948 1.715 1.00 51.60 N ATOM 7917 CA GLU B 439 -25.545 24.109 2.477 1.00 52.97 C ATOM 7918 C GLU B 439 -25.273 24.730 3.845 1.00 53.40 C ATOM 7919 O GLU B 439 -25.334 24.040 4.858 1.00 53.64 O ATOM 7920 CB GLU B 439 -24.263 23.883 1.677 1.00 52.83 C ATOM 7921 CG GLU B 439 -23.008 23.557 2.481 1.00 53.69 C ATOM 7922 CD GLU B 439 -21.743 23.675 1.625 1.00 54.12 C ATOM 7923 OE1 GLU B 439 -20.944 24.623 1.844 1.00 55.06 O ATOM 7924 OE2 GLU B 439 -21.569 22.833 0.711 1.00 55.19 O ATOM 7925 HA GLU B 439 -26.001 23.135 2.654 1.00 0.00 H ATOM 7926 HB2 GLU B 439 -24.442 23.055 0.991 1.00 0.00 H ATOM 7927 HB3 GLU B 439 -24.064 24.790 1.106 1.00 0.00 H ATOM 7928 HG2 GLU B 439 -22.934 24.250 3.319 1.00 0.00 H ATOM 7929 HG3 GLU B 439 -23.085 22.538 2.860 1.00 0.00 H ATOM 7930 H GLU B 439 -26.188 25.231 0.750 1.00 0.00 H ATOM 7931 N HIS B 440 -25.015 26.035 3.880 1.00 54.39 N ATOM 7932 CA HIS B 440 -24.731 26.715 5.153 1.00 55.50 C ATOM 7933 C HIS B 440 -25.921 26.682 6.111 1.00 56.48 C ATOM 7934 O HIS B 440 -25.746 26.628 7.323 1.00 56.77 O ATOM 7935 CB HIS B 440 -24.268 28.155 4.933 1.00 55.12 C ATOM 7936 CG HIS B 440 -23.864 28.863 6.190 1.00 54.54 C ATOM 7937 ND1 HIS B 440 -22.588 28.805 6.701 1.00 54.11 N ATOM 7938 CD2 HIS B 440 -24.570 29.653 7.035 1.00 54.36 C ATOM 7939 CE1 HIS B 440 -22.523 29.526 7.807 1.00 54.19 C ATOM 7940 NE2 HIS B 440 -23.714 30.051 8.032 1.00 53.40 N ATOM 7941 HA HIS B 440 -23.918 26.158 5.618 1.00 0.00 H ATOM 7942 HB2 HIS B 440 -23.413 28.141 4.257 1.00 0.00 H ATOM 7943 HB3 HIS B 440 -25.084 28.712 4.473 1.00 0.00 H ATOM 7944 HD2 HIS B 440 -25.622 29.922 6.941 1.00 0.00 H ATOM 7945 HE1 HIS B 440 -21.638 29.664 8.428 1.00 0.00 H ATOM 7946 H HIS B 440 -25.014 26.582 2.995 1.00 0.00 H ATOM 7947 N ALA B 441 -27.127 26.696 5.559 1.00 57.70 N ATOM 7948 CA ALA B 441 -28.338 26.633 6.364 1.00 58.80 C ATOM 7949 C ALA B 441 -28.467 25.307 7.110 1.00 59.69 C ATOM 7950 O ALA B 441 -29.147 25.226 8.131 1.00 59.95 O ATOM 7951 CB ALA B 441 -29.568 26.885 5.494 1.00 58.61 C ATOM 7952 HA ALA B 441 -28.269 27.418 7.118 1.00 0.00 H ATOM 7953 HB1 ALA B 441 -29.494 27.873 5.039 1.00 0.00 H ATOM 7954 HB2 ALA B 441 -29.620 26.127 4.712 1.00 0.00 H ATOM 7955 HB3 ALA B 441 -30.465 26.834 6.112 1.00 0.00 H ATOM 7956 H ALA B 441 -27.209 26.753 4.524 1.00 0.00 H ATOM 7957 N GLN B 442 -27.807 24.270 6.604 1.00 60.97 N ATOM 7958 CA GLN B 442 -27.959 22.930 7.174 1.00 62.15 C ATOM 7959 C GLN B 442 -26.854 22.544 8.164 1.00 62.73 C ATOM 7960 O GLN B 442 -27.123 21.858 9.153 1.00 62.81 O ATOM 7961 CB GLN B 442 -28.183 21.889 6.069 1.00 62.06 C ATOM 7962 CG GLN B 442 -29.649 21.884 5.581 1.00 63.22 C ATOM 7963 CD GLN B 442 -29.832 21.481 4.120 1.00 64.50 C ATOM 7964 OE1 GLN B 442 -28.900 21.001 3.471 1.00 65.64 O ATOM 7965 NE2 GLN B 442 -31.045 21.678 3.598 1.00 63.88 N ATOM 7966 HA GLN B 442 -28.859 22.950 7.789 1.00 0.00 H ATOM 7967 HB2 GLN B 442 -27.530 22.120 5.227 1.00 0.00 H ATOM 7968 HB3 GLN B 442 -27.936 20.901 6.458 1.00 0.00 H ATOM 7969 HG2 GLN B 442 -30.211 21.184 6.200 1.00 0.00 H ATOM 7970 HG3 GLN B 442 -30.054 22.888 5.710 1.00 0.00 H ATOM 7971 HE22 GLN B 442 -31.803 22.086 4.182 1.00 0.00 H ATOM 7972 HE21 GLN B 442 -31.232 21.424 2.607 1.00 0.00 H ATOM 7973 H GLN B 442 -27.174 24.413 5.792 1.00 0.00 H ATOM 7974 N LEU B 443 -25.633 23.017 7.915 1.00 63.56 N ATOM 7975 CA LEU B 443 -24.534 22.878 8.875 1.00 64.54 C ATOM 7976 C LEU B 443 -24.769 23.675 10.152 1.00 65.06 C ATOM 7977 O LEU B 443 -24.246 23.326 11.214 1.00 65.28 O ATOM 7978 CB LEU B 443 -23.205 23.314 8.262 1.00 64.72 C ATOM 7979 CG LEU B 443 -22.386 22.269 7.504 1.00 65.85 C ATOM 7980 CD1 LEU B 443 -22.889 22.061 6.059 1.00 66.28 C ATOM 7981 CD2 LEU B 443 -20.929 22.685 7.516 1.00 66.41 C ATOM 7982 HA LEU B 443 -24.494 21.819 9.131 1.00 0.00 H ATOM 7983 HB2 LEU B 443 -23.420 24.125 7.566 1.00 0.00 H ATOM 7984 HB3 LEU B 443 -22.581 23.689 9.073 1.00 0.00 H ATOM 7985 HG LEU B 443 -22.503 21.309 8.008 1.00 0.00 H ATOM 7986 HD21 LEU B 443 -20.826 23.657 7.033 1.00 0.00 H ATOM 7987 HD22 LEU B 443 -20.580 22.751 8.546 1.00 0.00 H ATOM 7988 HD23 LEU B 443 -20.337 21.945 6.977 1.00 0.00 H ATOM 7989 HD11 LEU B 443 -23.926 21.725 6.081 1.00 0.00 H ATOM 7990 HD12 LEU B 443 -22.822 23.002 5.513 1.00 0.00 H ATOM 7991 HD13 LEU B 443 -22.273 21.309 5.566 1.00 0.00 H ATOM 7992 H LEU B 443 -25.454 23.500 7.011 1.00 0.00 H ATOM 7993 N VAL B 444 -25.535 24.759 10.039 1.00 65.65 N ATOM 7994 CA VAL B 444 -25.927 25.558 11.198 1.00 65.94 C ATOM 7995 C VAL B 444 -26.958 24.817 12.045 1.00 66.38 C ATOM 7996 O VAL B 444 -26.822 24.736 13.267 1.00 66.35 O ATOM 7997 CB VAL B 444 -26.412 26.966 10.774 1.00 65.80 C ATOM 7998 CG1 VAL B 444 -27.688 27.383 11.504 1.00 65.61 C ATOM 7999 CG2 VAL B 444 -25.302 27.974 10.995 1.00 65.67 C ATOM 8000 HA VAL B 444 -25.047 25.708 11.823 1.00 0.00 H ATOM 8001 HB VAL B 444 -26.661 26.932 9.713 1.00 0.00 H ATOM 8002 HG11 VAL B 444 -28.482 26.670 11.281 1.00 0.00 H ATOM 8003 HG12 VAL B 444 -27.502 27.398 12.578 1.00 0.00 H ATOM 8004 HG13 VAL B 444 -27.987 28.377 11.172 1.00 0.00 H ATOM 8005 HG21 VAL B 444 -25.029 27.987 12.050 1.00 0.00 H ATOM 8006 HG22 VAL B 444 -24.434 27.694 10.398 1.00 0.00 H ATOM 8007 HG23 VAL B 444 -25.647 28.964 10.696 1.00 0.00 H ATOM 8008 H VAL B 444 -25.865 25.046 9.095 1.00 0.00 H ATOM 8009 N GLN B 445 -27.968 24.252 11.390 1.00 66.99 N ATOM 8010 CA GLN B 445 -28.998 23.502 12.093 1.00 67.83 C ATOM 8011 C GLN B 445 -28.392 22.281 12.786 1.00 68.10 C ATOM 8012 O GLN B 445 -28.704 21.995 13.942 1.00 68.30 O ATOM 8013 CB GLN B 445 -30.129 23.093 11.146 1.00 67.87 C ATOM 8014 CG GLN B 445 -31.387 22.581 11.859 1.00 68.95 C ATOM 8015 CD GLN B 445 -32.319 23.695 12.345 1.00 69.68 C ATOM 8016 OE1 GLN B 445 -31.882 24.679 12.955 1.00 69.68 O ATOM 8017 NE2 GLN B 445 -33.616 23.533 12.079 1.00 69.60 N ATOM 8018 HA GLN B 445 -29.428 24.150 12.857 1.00 0.00 H ATOM 8019 HB2 GLN B 445 -30.404 23.960 10.546 1.00 0.00 H ATOM 8020 HB3 GLN B 445 -29.760 22.303 10.492 1.00 0.00 H ATOM 8021 HG2 GLN B 445 -31.941 21.947 11.167 1.00 0.00 H ATOM 8022 HG3 GLN B 445 -31.077 21.991 12.722 1.00 0.00 H ATOM 8023 HE22 GLN B 445 -33.940 22.690 11.563 1.00 0.00 H ATOM 8024 HE21 GLN B 445 -34.304 24.250 12.387 1.00 0.00 H ATOM 8025 H GLN B 445 -28.023 24.348 10.356 1.00 0.00 H ATOM 8026 N ILE B 446 -27.517 21.576 12.078 1.00 68.24 N ATOM 8027 CA ILE B 446 -26.795 20.467 12.664 1.00 68.44 C ATOM 8028 C ILE B 446 -26.144 20.941 13.957 1.00 68.57 C ATOM 8029 O ILE B 446 -26.501 20.482 15.043 1.00 68.63 O ATOM 8030 CB ILE B 446 -25.777 19.861 11.652 1.00 68.61 C ATOM 8031 CG1 ILE B 446 -26.503 18.850 10.746 1.00 68.46 C ATOM 8032 CG2 ILE B 446 -24.566 19.222 12.375 1.00 68.41 C ATOM 8033 CD1 ILE B 446 -25.918 18.688 9.358 1.00 67.85 C ATOM 8034 HA ILE B 446 -27.481 19.655 12.906 1.00 0.00 H ATOM 8035 HB ILE B 446 -25.374 20.661 11.031 1.00 0.00 H ATOM 8036 HG12 ILE B 446 -26.478 17.878 11.238 1.00 0.00 H ATOM 8037 HG13 ILE B 446 -27.538 19.175 10.640 1.00 0.00 H ATOM 8038 HD11 ILE B 446 -25.947 19.646 8.839 1.00 0.00 H ATOM 8039 HD12 ILE B 446 -24.886 18.347 9.438 1.00 0.00 H ATOM 8040 HD13 ILE B 446 -26.502 17.954 8.802 1.00 0.00 H ATOM 8041 HG21 ILE B 446 -24.054 19.982 12.965 1.00 0.00 H ATOM 8042 HG22 ILE B 446 -24.915 18.425 13.031 1.00 0.00 H ATOM 8043 HG23 ILE B 446 -23.879 18.811 11.636 1.00 0.00 H ATOM 8044 H ILE B 446 -27.347 21.826 11.083 1.00 0.00 H ATOM 8045 N ILE B 447 -25.237 21.902 13.839 1.00 68.84 N ATOM 8046 CA ILE B 447 -24.508 22.415 14.992 1.00 69.24 C ATOM 8047 C ILE B 447 -25.447 22.909 16.103 1.00 69.67 C ATOM 8048 O ILE B 447 -25.121 22.813 17.293 1.00 69.99 O ATOM 8049 CB ILE B 447 -23.467 23.482 14.578 1.00 69.09 C ATOM 8050 CG1 ILE B 447 -22.412 22.846 13.664 1.00 69.06 C ATOM 8051 CG2 ILE B 447 -22.794 24.094 15.800 1.00 69.11 C ATOM 8052 CD1 ILE B 447 -21.418 23.818 13.070 1.00 68.72 C ATOM 8053 HA ILE B 447 -23.952 21.579 15.417 1.00 0.00 H ATOM 8054 HB ILE B 447 -23.984 24.277 14.041 1.00 0.00 H ATOM 8055 HG12 ILE B 447 -21.859 22.109 14.246 1.00 0.00 H ATOM 8056 HG13 ILE B 447 -22.929 22.347 12.845 1.00 0.00 H ATOM 8057 HD11 ILE B 447 -21.949 24.558 12.471 1.00 0.00 H ATOM 8058 HD12 ILE B 447 -20.878 24.319 13.873 1.00 0.00 H ATOM 8059 HD13 ILE B 447 -20.713 23.275 12.440 1.00 0.00 H ATOM 8060 HG21 ILE B 447 -23.548 24.567 16.430 1.00 0.00 H ATOM 8061 HG22 ILE B 447 -22.287 23.311 16.364 1.00 0.00 H ATOM 8062 HG23 ILE B 447 -22.068 24.840 15.478 1.00 0.00 H ATOM 8063 H ILE B 447 -25.041 22.300 12.898 1.00 0.00 H ATOM 8064 N LYS B 448 -26.621 23.402 15.730 1.00 69.93 N ATOM 8065 CA LYS B 448 -27.606 23.760 16.742 1.00 70.23 C ATOM 8066 C LYS B 448 -28.159 22.492 17.407 1.00 70.34 C ATOM 8067 O LYS B 448 -28.054 22.348 18.624 1.00 70.25 O ATOM 8068 CB LYS B 448 -28.720 24.639 16.154 1.00 70.23 C ATOM 8069 CG LYS B 448 -29.437 25.535 17.178 1.00 70.29 C ATOM 8070 CD LYS B 448 -30.593 24.821 17.893 1.00 71.22 C ATOM 8071 CE LYS B 448 -31.845 24.670 17.011 1.00 71.31 C ATOM 8072 NZ LYS B 448 -32.714 25.891 17.002 1.00 71.14 N ATOM 8073 HA LYS B 448 -27.117 24.357 17.512 1.00 0.00 H ATOM 8074 HB2 LYS B 448 -28.280 25.280 15.390 1.00 0.00 H ATOM 8075 HB3 LYS B 448 -29.462 23.986 15.695 1.00 0.00 H ATOM 8076 HG2 LYS B 448 -28.712 25.858 17.925 1.00 0.00 H ATOM 8077 HG3 LYS B 448 -29.835 26.407 16.659 1.00 0.00 H ATOM 8078 HD2 LYS B 448 -30.257 23.828 18.192 1.00 0.00 H ATOM 8079 HD3 LYS B 448 -30.860 25.395 18.780 1.00 0.00 H ATOM 8080 HE2 LYS B 448 -32.432 23.830 17.383 1.00 0.00 H ATOM 8081 HE3 LYS B 448 -31.526 24.464 15.989 1.00 0.00 H ATOM 8082 HZ1 LYS B 448 -33.035 26.094 17.970 1.00 0.00 H ATOM 8083 HZ2 LYS B 448 -32.170 26.700 16.639 1.00 0.00 H ATOM 8084 HZ3 LYS B 448 -33.538 25.724 16.390 1.00 0.00 H ATOM 8085 H LYS B 448 -26.837 23.532 14.721 1.00 0.00 H ATOM 8086 N LYS B 449 -28.710 21.582 16.594 1.00 70.60 N ATOM 8087 CA LYS B 449 -29.343 20.325 17.041 1.00 70.89 C ATOM 8088 C LYS B 449 -28.447 19.348 17.816 1.00 70.89 C ATOM 8089 O LYS B 449 -28.942 18.575 18.641 1.00 70.91 O ATOM 8090 CB LYS B 449 -29.914 19.571 15.843 1.00 71.03 C ATOM 8091 CG LYS B 449 -31.398 19.763 15.601 1.00 72.04 C ATOM 8092 CD LYS B 449 -31.756 19.412 14.146 1.00 73.84 C ATOM 8093 CE LYS B 449 -31.496 17.938 13.796 1.00 74.84 C ATOM 8094 NZ LYS B 449 -32.706 17.082 14.029 1.00 75.95 N ATOM 8095 HA LYS B 449 -30.109 20.660 17.741 1.00 0.00 H ATOM 8096 HB2 LYS B 449 -29.382 19.903 14.952 1.00 0.00 H ATOM 8097 HB3 LYS B 449 -29.733 18.507 15.997 1.00 0.00 H ATOM 8098 HG2 LYS B 449 -31.959 19.115 16.275 1.00 0.00 H ATOM 8099 HG3 LYS B 449 -31.662 20.803 15.795 1.00 0.00 H ATOM 8100 HD2 LYS B 449 -32.813 19.624 13.988 1.00 0.00 H ATOM 8101 HD3 LYS B 449 -31.159 20.036 13.482 1.00 0.00 H ATOM 8102 HE2 LYS B 449 -30.679 17.568 14.415 1.00 0.00 H ATOM 8103 HE3 LYS B 449 -31.214 17.870 12.745 1.00 0.00 H ATOM 8104 HZ1 LYS B 449 -32.979 17.135 15.031 1.00 0.00 H ATOM 8105 HZ2 LYS B 449 -33.490 17.423 13.437 1.00 0.00 H ATOM 8106 HZ3 LYS B 449 -32.485 16.097 13.780 1.00 0.00 H ATOM 8107 H LYS B 449 -28.691 21.775 15.572 1.00 0.00 H ATOM 8108 N THR B 450 -27.145 19.357 17.540 1.00 70.65 N ATOM 8109 CA THR B 450 -26.247 18.417 18.194 1.00 70.33 C ATOM 8110 C THR B 450 -25.464 19.081 19.316 1.00 70.09 C ATOM 8111 O THR B 450 -25.685 18.769 20.482 1.00 70.30 O ATOM 8112 CB THR B 450 -25.284 17.741 17.197 1.00 70.46 C ATOM 8113 OG1 THR B 450 -24.387 18.722 16.661 1.00 71.08 O ATOM 8114 CG2 THR B 450 -26.059 17.069 16.055 1.00 70.11 C ATOM 8115 HA THR B 450 -26.877 17.640 18.626 1.00 0.00 H ATOM 8116 HB THR B 450 -24.719 16.973 17.726 1.00 0.00 H ATOM 8117 HG1 THR B 450 -24.907 19.423 16.195 1.00 0.00 H ATOM 8118 HG23 THR B 450 -26.739 16.324 16.468 1.00 0.00 H ATOM 8119 HG21 THR B 450 -26.630 17.823 15.512 1.00 0.00 H ATOM 8120 HG22 THR B 450 -25.357 16.585 15.377 1.00 0.00 H ATOM 8121 H THR B 450 -26.767 20.040 16.853 1.00 0.00 H ATOM 8122 N GLU B 451 -24.576 20.012 18.959 1.00 69.86 N ATOM 8123 CA GLU B 451 -23.594 20.593 19.896 1.00 69.52 C ATOM 8124 C GLU B 451 -24.217 21.401 21.043 1.00 69.27 C ATOM 8125 O GLU B 451 -24.658 22.534 20.863 1.00 69.15 O ATOM 8126 CB GLU B 451 -22.542 21.422 19.150 1.00 69.51 C ATOM 8127 CG GLU B 451 -21.800 20.664 18.046 1.00 69.50 C ATOM 8128 CD GLU B 451 -20.962 19.499 18.562 1.00 69.45 C ATOM 8129 OE1 GLU B 451 -21.210 18.364 18.103 1.00 69.05 O ATOM 8130 OE2 GLU B 451 -20.062 19.714 19.413 1.00 68.56 O ATOM 8131 HA GLU B 451 -23.107 19.740 20.369 1.00 0.00 H ATOM 8132 HB2 GLU B 451 -23.042 22.279 18.698 1.00 0.00 H ATOM 8133 HB3 GLU B 451 -21.808 21.772 19.875 1.00 0.00 H ATOM 8134 HG2 GLU B 451 -22.535 20.275 17.341 1.00 0.00 H ATOM 8135 HG3 GLU B 451 -21.140 21.363 17.532 1.00 0.00 H ATOM 8136 H GLU B 451 -24.576 20.344 17.973 1.00 0.00 H ATOM 8137 N SER B 452 -24.200 20.793 22.229 1.00 69.11 N ATOM 8138 CA SER B 452 -24.992 21.215 23.397 1.00 68.56 C ATOM 8139 C SER B 452 -24.705 22.622 23.929 1.00 67.78 C ATOM 8140 O SER B 452 -25.485 23.156 24.728 1.00 67.61 O ATOM 8141 CB SER B 452 -24.840 20.181 24.526 1.00 68.87 C ATOM 8142 OG SER B 452 -25.863 20.322 25.499 1.00 69.41 O ATOM 8143 HA SER B 452 -26.020 21.265 23.037 1.00 0.00 H ATOM 8144 HB2 SER B 452 -23.872 20.320 25.007 1.00 0.00 H ATOM 8145 HB3 SER B 452 -24.892 19.179 24.099 1.00 0.00 H ATOM 8146 HG SER B 452 -25.818 21.228 25.894 1.00 0.00 H ATOM 8147 H SER B 452 -23.584 19.962 22.337 1.00 0.00 H ATOM 8148 N ASP B 453 -23.595 23.216 23.496 1.00 66.70 N ATOM 8149 CA ASP B 453 -23.284 24.589 23.886 1.00 65.76 C ATOM 8150 C ASP B 453 -23.344 25.552 22.688 1.00 64.92 C ATOM 8151 O ASP B 453 -22.710 26.619 22.683 1.00 64.78 O ATOM 8152 CB ASP B 453 -21.937 24.667 24.615 1.00 65.84 C ATOM 8153 CG ASP B 453 -21.801 25.931 25.454 1.00 66.47 C ATOM 8154 OD1 ASP B 453 -20.653 26.291 25.812 1.00 66.97 O ATOM 8155 OD2 ASP B 453 -22.844 26.568 25.748 1.00 66.07 O ATOM 8156 HA ASP B 453 -24.054 24.912 24.587 1.00 0.00 H ATOM 8157 HB2 ASP B 453 -21.843 23.801 25.270 1.00 0.00 H ATOM 8158 HB3 ASP B 453 -21.137 24.650 23.875 1.00 0.00 H ATOM 8159 H ASP B 453 -22.943 22.697 22.874 1.00 0.00 H ATOM 8160 N ALA B 454 -24.128 25.173 21.680 1.00 63.59 N ATOM 8161 CA ALA B 454 -24.306 26.013 20.500 1.00 62.23 C ATOM 8162 C ALA B 454 -25.653 26.750 20.521 1.00 61.13 C ATOM 8163 O ALA B 454 -26.712 26.174 20.205 1.00 60.99 O ATOM 8164 CB ALA B 454 -24.131 25.196 19.213 1.00 62.31 C ATOM 8165 HA ALA B 454 -23.527 26.776 20.520 1.00 0.00 H ATOM 8166 HB1 ALA B 454 -23.129 24.767 19.190 1.00 0.00 H ATOM 8167 HB2 ALA B 454 -24.871 24.396 19.189 1.00 0.00 H ATOM 8168 HB3 ALA B 454 -24.269 25.847 18.349 1.00 0.00 H ATOM 8169 H ALA B 454 -24.623 24.260 21.735 1.00 0.00 H ATOM 8170 N ALA B 455 -25.588 28.024 20.918 1.00 59.50 N ATOM 8171 CA ALA B 455 -26.735 28.923 20.891 1.00 57.83 C ATOM 8172 C ALA B 455 -26.805 29.633 19.543 1.00 56.57 C ATOM 8173 O ALA B 455 -25.811 30.185 19.072 1.00 56.50 O ATOM 8174 CB ALA B 455 -26.648 29.940 22.026 1.00 57.84 C ATOM 8175 HA ALA B 455 -27.643 28.337 21.030 1.00 0.00 H ATOM 8176 HB1 ALA B 455 -26.632 29.416 22.981 1.00 0.00 H ATOM 8177 HB2 ALA B 455 -25.736 30.527 21.917 1.00 0.00 H ATOM 8178 HB3 ALA B 455 -27.514 30.601 21.987 1.00 0.00 H ATOM 8179 H ALA B 455 -24.678 28.391 21.262 1.00 0.00 H ATOM 8180 N LEU B 456 -27.980 29.598 18.923 1.00 54.72 N ATOM 8181 CA LEU B 456 -28.244 30.382 17.728 1.00 52.91 C ATOM 8182 C LEU B 456 -28.986 31.681 18.076 1.00 51.60 C ATOM 8183 O LEU B 456 -30.060 31.652 18.673 1.00 51.28 O ATOM 8184 CB LEU B 456 -29.056 29.549 16.738 1.00 53.07 C ATOM 8185 CG LEU B 456 -29.237 30.041 15.297 1.00 53.38 C ATOM 8186 CD1 LEU B 456 -27.936 30.596 14.711 1.00 53.30 C ATOM 8187 CD2 LEU B 456 -29.811 28.928 14.417 1.00 53.06 C ATOM 8188 HA LEU B 456 -27.293 30.655 17.271 1.00 0.00 H ATOM 8189 HB2 LEU B 456 -28.577 28.571 16.680 1.00 0.00 H ATOM 8190 HB3 LEU B 456 -30.054 29.439 17.162 1.00 0.00 H ATOM 8191 HG LEU B 456 -29.950 30.865 15.319 1.00 0.00 H ATOM 8192 HD21 LEU B 456 -29.129 28.078 14.418 1.00 0.00 H ATOM 8193 HD22 LEU B 456 -30.780 28.619 14.810 1.00 0.00 H ATOM 8194 HD23 LEU B 456 -29.932 29.298 13.399 1.00 0.00 H ATOM 8195 HD11 LEU B 456 -27.595 31.435 15.317 1.00 0.00 H ATOM 8196 HD12 LEU B 456 -27.176 29.814 14.711 1.00 0.00 H ATOM 8197 HD13 LEU B 456 -28.113 30.932 13.689 1.00 0.00 H ATOM 8198 H LEU B 456 -28.734 28.991 19.305 1.00 0.00 H ATOM 8199 N HIS B 457 -28.395 32.815 17.704 1.00 50.02 N ATOM 8200 CA HIS B 457 -29.016 34.135 17.865 1.00 48.28 C ATOM 8201 C HIS B 457 -30.453 34.130 17.345 1.00 47.52 C ATOM 8202 O HIS B 457 -30.712 33.666 16.233 1.00 47.30 O ATOM 8203 CB HIS B 457 -28.184 35.170 17.115 1.00 48.03 C ATOM 8204 CG HIS B 457 -28.535 36.595 17.418 1.00 47.23 C ATOM 8205 ND1 HIS B 457 -29.772 37.139 17.146 1.00 46.02 N ATOM 8206 CD2 HIS B 457 -27.781 37.606 17.912 1.00 46.17 C ATOM 8207 CE1 HIS B 457 -29.772 38.415 17.481 1.00 45.68 C ATOM 8208 NE2 HIS B 457 -28.576 38.723 17.949 1.00 45.96 N ATOM 8209 HA HIS B 457 -29.048 34.387 18.925 1.00 0.00 H ATOM 8210 HB2 HIS B 457 -27.136 35.016 17.374 1.00 0.00 H ATOM 8211 HB3 HIS B 457 -28.321 35.006 16.046 1.00 0.00 H ATOM 8212 HD2 HIS B 457 -26.738 37.544 18.222 1.00 0.00 H ATOM 8213 HE1 HIS B 457 -30.616 39.099 17.387 1.00 0.00 H ATOM 8214 H HIS B 457 -27.447 32.763 17.279 1.00 0.00 H ATOM 8215 N PRO B 458 -31.398 34.635 18.154 1.00 46.78 N ATOM 8216 CA PRO B 458 -32.816 34.575 17.805 1.00 46.31 C ATOM 8217 C PRO B 458 -33.180 35.307 16.515 1.00 45.93 C ATOM 8218 O PRO B 458 -34.134 34.909 15.844 1.00 45.80 O ATOM 8219 CB PRO B 458 -33.507 35.225 19.009 1.00 46.21 C ATOM 8220 CG PRO B 458 -32.464 36.002 19.677 1.00 46.35 C ATOM 8221 CD PRO B 458 -31.191 35.272 19.463 1.00 46.63 C ATOM 8222 HA PRO B 458 -33.122 33.547 17.610 1.00 0.00 H ATOM 8223 HD3 PRO B 458 -30.344 35.958 19.437 1.00 0.00 H ATOM 8224 HD2 PRO B 458 -31.030 34.527 20.242 1.00 0.00 H ATOM 8225 HG3 PRO B 458 -32.678 36.082 20.743 1.00 0.00 H ATOM 8226 HG2 PRO B 458 -32.403 37.001 19.244 1.00 0.00 H ATOM 8227 HB2 PRO B 458 -34.317 35.876 18.680 1.00 0.00 H ATOM 8228 HB3 PRO B 458 -33.905 34.463 19.679 1.00 0.00 H ATOM 8229 N LEU B 459 -32.445 36.359 16.167 1.00 45.51 N ATOM 8230 CA LEU B 459 -32.672 37.025 14.879 1.00 45.47 C ATOM 8231 C LEU B 459 -32.359 36.082 13.716 1.00 45.36 C ATOM 8232 O LEU B 459 -33.153 35.940 12.784 1.00 45.18 O ATOM 8233 CB LEU B 459 -31.844 38.299 14.761 1.00 45.62 C ATOM 8234 CG LEU B 459 -31.687 38.921 13.377 1.00 45.42 C ATOM 8235 CD1 LEU B 459 -33.015 39.504 12.920 1.00 45.80 C ATOM 8236 CD2 LEU B 459 -30.586 39.981 13.396 1.00 45.09 C ATOM 8237 HA LEU B 459 -33.726 37.299 14.832 1.00 0.00 H ATOM 8238 HB2 LEU B 459 -32.307 39.048 15.404 1.00 0.00 H ATOM 8239 HB3 LEU B 459 -30.844 38.072 15.131 1.00 0.00 H ATOM 8240 HG LEU B 459 -31.392 38.151 12.664 1.00 0.00 H ATOM 8241 HD21 LEU B 459 -30.847 40.761 14.111 1.00 0.00 H ATOM 8242 HD22 LEU B 459 -29.643 39.519 13.689 1.00 0.00 H ATOM 8243 HD23 LEU B 459 -30.485 40.416 12.402 1.00 0.00 H ATOM 8244 HD11 LEU B 459 -33.763 38.712 12.877 1.00 0.00 H ATOM 8245 HD12 LEU B 459 -33.336 40.270 13.626 1.00 0.00 H ATOM 8246 HD13 LEU B 459 -32.895 39.946 11.931 1.00 0.00 H ATOM 8247 H LEU B 459 -31.707 36.711 16.810 1.00 0.00 H ATOM 8248 N LEU B 460 -31.211 35.422 13.800 1.00 45.11 N ATOM 8249 CA LEU B 460 -30.811 34.453 12.791 1.00 44.86 C ATOM 8250 C LEU B 460 -31.741 33.243 12.740 1.00 45.01 C ATOM 8251 O LEU B 460 -31.946 32.677 11.675 1.00 44.87 O ATOM 8252 CB LEU B 460 -29.347 34.055 12.986 1.00 44.50 C ATOM 8253 CG LEU B 460 -28.378 35.250 13.101 1.00 44.20 C ATOM 8254 CD1 LEU B 460 -26.951 34.801 13.334 1.00 42.81 C ATOM 8255 CD2 LEU B 460 -28.448 36.160 11.879 1.00 42.85 C ATOM 8256 HA LEU B 460 -30.902 34.932 11.816 1.00 0.00 H ATOM 8257 HB2 LEU B 460 -29.272 33.464 13.899 1.00 0.00 H ATOM 8258 HB3 LEU B 460 -29.041 33.447 12.135 1.00 0.00 H ATOM 8259 HG LEU B 460 -28.702 35.822 13.971 1.00 0.00 H ATOM 8260 HD21 LEU B 460 -28.184 35.591 10.988 1.00 0.00 H ATOM 8261 HD22 LEU B 460 -29.461 36.550 11.776 1.00 0.00 H ATOM 8262 HD23 LEU B 460 -27.749 36.987 12.003 1.00 0.00 H ATOM 8263 HD11 LEU B 460 -26.898 34.228 14.260 1.00 0.00 H ATOM 8264 HD12 LEU B 460 -26.627 34.178 12.501 1.00 0.00 H ATOM 8265 HD13 LEU B 460 -26.304 35.675 13.409 1.00 0.00 H ATOM 8266 H LEU B 460 -30.581 35.602 14.608 1.00 0.00 H ATOM 8267 N GLN B 461 -32.320 32.867 13.880 1.00 45.70 N ATOM 8268 CA GLN B 461 -33.285 31.757 13.939 1.00 46.37 C ATOM 8269 C GLN B 461 -34.447 32.057 13.028 1.00 46.52 C ATOM 8270 O GLN B 461 -34.776 31.265 12.155 1.00 46.39 O ATOM 8271 CB GLN B 461 -33.830 31.537 15.354 1.00 46.18 C ATOM 8272 CG GLN B 461 -32.864 30.926 16.345 1.00 46.85 C ATOM 8273 CD GLN B 461 -33.561 30.356 17.587 1.00 47.17 C ATOM 8274 OE1 GLN B 461 -34.724 29.936 17.532 1.00 48.04 O ATOM 8275 NE2 GLN B 461 -32.842 30.329 18.711 1.00 47.11 N ATOM 8276 HA GLN B 461 -32.759 30.854 13.628 1.00 0.00 H ATOM 8277 HB2 GLN B 461 -34.144 32.505 15.746 1.00 0.00 H ATOM 8278 HB3 GLN B 461 -34.695 30.878 15.281 1.00 0.00 H ATOM 8279 HG2 GLN B 461 -32.321 30.120 15.850 1.00 0.00 H ATOM 8280 HG3 GLN B 461 -32.160 31.695 16.663 1.00 0.00 H ATOM 8281 HE22 GLN B 461 -31.868 30.692 18.714 1.00 0.00 H ATOM 8282 HE21 GLN B 461 -33.256 29.945 19.584 1.00 0.00 H ATOM 8283 H GLN B 461 -32.082 33.374 14.756 1.00 0.00 H ATOM 8284 N GLU B 462 -35.053 33.223 13.236 1.00 47.36 N ATOM 8285 CA GLU B 462 -36.175 33.693 12.425 1.00 48.02 C ATOM 8286 C GLU B 462 -35.832 33.718 10.936 1.00 48.34 C ATOM 8287 O GLU B 462 -36.582 33.207 10.111 1.00 48.44 O ATOM 8288 CB GLU B 462 -36.622 35.078 12.902 1.00 48.07 C ATOM 8289 CG GLU B 462 -37.927 35.568 12.314 1.00 48.95 C ATOM 8290 CD GLU B 462 -39.053 34.552 12.453 1.00 52.34 C ATOM 8291 OE1 GLU B 462 -38.988 33.673 13.365 1.00 52.00 O ATOM 8292 OE2 GLU B 462 -40.009 34.642 11.638 1.00 53.24 O ATOM 8293 HA GLU B 462 -36.997 32.989 12.552 1.00 0.00 H ATOM 8294 HB2 GLU B 462 -36.731 35.043 13.986 1.00 0.00 H ATOM 8295 HB3 GLU B 462 -35.843 35.794 12.639 1.00 0.00 H ATOM 8296 HG2 GLU B 462 -38.219 36.484 12.827 1.00 0.00 H ATOM 8297 HG3 GLU B 462 -37.776 35.778 11.255 1.00 0.00 H ATOM 8298 H GLU B 462 -34.713 33.828 14.011 1.00 0.00 H ATOM 8299 N ILE B 463 -34.690 34.303 10.604 1.00 49.04 N ATOM 8300 CA ILE B 463 -34.202 34.319 9.238 1.00 50.01 C ATOM 8301 C ILE B 463 -34.194 32.921 8.635 1.00 51.16 C ATOM 8302 O ILE B 463 -34.732 32.727 7.550 1.00 51.18 O ATOM 8303 CB ILE B 463 -32.817 34.994 9.145 1.00 49.61 C ATOM 8304 CG1 ILE B 463 -32.989 36.510 9.287 1.00 49.29 C ATOM 8305 CG2 ILE B 463 -32.132 34.659 7.831 1.00 49.31 C ATOM 8306 CD1 ILE B 463 -31.737 37.259 9.694 1.00 49.38 C ATOM 8307 HA ILE B 463 -34.893 34.919 8.646 1.00 0.00 H ATOM 8308 HB ILE B 463 -32.185 34.619 9.950 1.00 0.00 H ATOM 8309 HG12 ILE B 463 -33.323 36.904 8.327 1.00 0.00 H ATOM 8310 HG13 ILE B 463 -33.755 36.695 10.041 1.00 0.00 H ATOM 8311 HD11 ILE B 463 -31.393 36.891 10.660 1.00 0.00 H ATOM 8312 HD12 ILE B 463 -30.961 37.100 8.946 1.00 0.00 H ATOM 8313 HD13 ILE B 463 -31.960 38.323 9.768 1.00 0.00 H ATOM 8314 HG21 ILE B 463 -32.000 33.580 7.756 1.00 0.00 H ATOM 8315 HG22 ILE B 463 -32.747 35.009 7.002 1.00 0.00 H ATOM 8316 HG23 ILE B 463 -31.159 35.149 7.795 1.00 0.00 H ATOM 8317 H ILE B 463 -34.126 34.765 11.346 1.00 0.00 H ATOM 8318 N TYR B 464 -33.627 31.952 9.356 1.00 52.80 N ATOM 8319 CA TYR B 464 -33.511 30.575 8.856 1.00 54.41 C ATOM 8320 C TYR B 464 -34.832 29.850 8.739 1.00 55.52 C ATOM 8321 O TYR B 464 -34.947 28.923 7.936 1.00 55.99 O ATOM 8322 CB TYR B 464 -32.556 29.730 9.708 1.00 54.14 C ATOM 8323 CG TYR B 464 -31.100 29.986 9.422 1.00 54.17 C ATOM 8324 CD1 TYR B 464 -30.298 30.635 10.351 1.00 53.78 C ATOM 8325 CD2 TYR B 464 -30.523 29.582 8.217 1.00 54.05 C ATOM 8326 CE1 TYR B 464 -28.966 30.884 10.100 1.00 53.85 C ATOM 8327 CE2 TYR B 464 -29.182 29.827 7.952 1.00 53.88 C ATOM 8328 CZ TYR B 464 -28.411 30.478 8.901 1.00 54.18 C ATOM 8329 OH TYR B 464 -27.079 30.727 8.664 1.00 54.41 O ATOM 8330 HA TYR B 464 -33.105 30.690 7.851 1.00 0.00 H ATOM 8331 HB3 TYR B 464 -32.764 28.677 9.517 1.00 0.00 H ATOM 8332 HB2 TYR B 464 -32.745 29.952 10.758 1.00 0.00 H ATOM 8333 HD2 TYR B 464 -31.133 29.068 7.474 1.00 0.00 H ATOM 8334 HE2 TYR B 464 -28.741 29.510 7.007 1.00 0.00 H ATOM 8335 HE1 TYR B 464 -28.354 31.398 10.842 1.00 0.00 H ATOM 8336 HD1 TYR B 464 -30.731 30.954 11.299 1.00 0.00 H ATOM 8337 HH TYR B 464 -26.688 31.196 9.443 1.00 0.00 H ATOM 8338 H TYR B 464 -33.256 32.178 10.301 1.00 0.00 H ATOM 8339 N ARG B 465 -35.816 30.254 9.537 1.00 57.02 N ATOM 8340 CA ARG B 465 -37.083 29.534 9.600 1.00 58.91 C ATOM 8341 C ARG B 465 -37.720 29.487 8.215 1.00 60.08 C ATOM 8342 O ARG B 465 -38.408 30.420 7.801 1.00 60.13 O ATOM 8343 CB ARG B 465 -38.031 30.143 10.649 1.00 58.95 C ATOM 8344 CG ARG B 465 -39.107 29.179 11.177 1.00 59.82 C ATOM 8345 CD ARG B 465 -39.535 29.529 12.613 1.00 61.27 C ATOM 8346 NE ARG B 465 -40.383 30.726 12.647 1.00 63.70 N ATOM 8347 CZ ARG B 465 -40.858 31.309 13.749 1.00 64.11 C ATOM 8348 NH1 ARG B 465 -40.580 30.827 14.958 1.00 63.89 N ATOM 8349 NH2 ARG B 465 -41.623 32.388 13.637 1.00 64.47 N ATOM 8350 HA ARG B 465 -36.887 28.511 9.922 1.00 0.00 H ATOM 8351 HB2 ARG B 465 -37.431 30.480 11.495 1.00 0.00 H ATOM 8352 HB3 ARG B 465 -38.533 30.999 10.198 1.00 0.00 H ATOM 8353 HG2 ARG B 465 -39.979 29.233 10.526 1.00 0.00 H ATOM 8354 HG3 ARG B 465 -38.708 28.165 11.165 1.00 0.00 H ATOM 8355 HD2 ARG B 465 -38.644 29.709 13.214 1.00 0.00 H ATOM 8356 HD3 ARG B 465 -40.090 28.690 13.031 1.00 0.00 H ATOM 8357 HE ARG B 465 -40.635 31.157 11.735 1.00 0.00 H ATOM 8358 HH12 ARG B 465 -40.960 31.296 15.805 1.00 0.00 H ATOM 8359 HH11 ARG B 465 -39.983 29.981 15.056 1.00 0.00 H ATOM 8360 HH22 ARG B 465 -41.998 32.850 14.490 1.00 0.00 H ATOM 8361 HH21 ARG B 465 -41.847 32.771 12.697 1.00 0.00 H ATOM 8362 H ARG B 465 -35.680 31.099 10.127 1.00 0.00 H ATOM 8363 N ASP B 466 -37.428 28.396 7.504 1.00 61.64 N ATOM 8364 CA ASP B 466 -38.042 28.029 6.213 1.00 63.10 C ATOM 8365 C ASP B 466 -37.132 28.153 4.977 1.00 63.96 C ATOM 8366 O ASP B 466 -37.513 28.726 3.942 1.00 64.19 O ATOM 8367 CB ASP B 466 -39.425 28.670 6.016 1.00 63.08 C ATOM 8368 CG ASP B 466 -40.466 28.108 6.978 1.00 63.83 C ATOM 8369 OD1 ASP B 466 -40.084 27.552 8.036 1.00 64.86 O ATOM 8370 OD2 ASP B 466 -41.673 28.218 6.676 1.00 65.08 O ATOM 8371 HA ASP B 466 -38.197 26.953 6.294 1.00 0.00 H ATOM 8372 HB2 ASP B 466 -39.340 29.744 6.179 1.00 0.00 H ATOM 8373 HB3 ASP B 466 -39.755 28.484 4.994 1.00 0.00 H ATOM 8374 H ASP B 466 -36.709 27.752 7.891 1.00 0.00 H ATOM 8375 N MET B 467 -35.925 27.608 5.106 1.00 64.76 N ATOM 8376 CA MET B 467 -34.985 27.519 3.992 1.00 65.60 C ATOM 8377 C MET B 467 -34.268 26.170 4.043 1.00 65.56 C ATOM 8378 O MET B 467 -34.908 25.122 3.887 1.00 65.53 O ATOM 8379 CB MET B 467 -33.961 28.659 4.033 1.00 65.68 C ATOM 8380 CG MET B 467 -34.526 30.057 4.287 1.00 65.83 C ATOM 8381 SD MET B 467 -33.250 31.337 4.184 1.00 66.65 S ATOM 8382 CE MET B 467 -31.779 30.471 4.753 1.00 66.43 C ATOM 8383 HA MET B 467 -35.544 27.607 3.060 1.00 0.00 H ATOM 8384 HB2 MET B 467 -33.247 28.438 4.826 1.00 0.00 H ATOM 8385 HB3 MET B 467 -33.443 28.677 3.074 1.00 0.00 H ATOM 8386 HG2 MET B 467 -34.969 30.082 5.282 1.00 0.00 H ATOM 8387 HG3 MET B 467 -35.295 30.266 3.543 1.00 0.00 H ATOM 8388 HE1 MET B 467 -31.939 30.115 5.771 1.00 0.00 H ATOM 8389 HE2 MET B 467 -31.581 29.623 4.097 1.00 0.00 H ATOM 8390 HE3 MET B 467 -30.928 31.152 4.735 1.00 0.00 H ATOM 8391 H MET B 467 -35.641 27.232 6.033 1.00 0.00 H ATOM 8392 N TYR B 468 -33.049 26.099 4.256 1.00 65.51 N ATOM 8393 HN3 TYR B 468 -32.585 25.624 3.455 1.00 0.00 H ATOM 8394 HN2 TYR B 468 -32.882 25.556 5.127 1.00 0.00 H ATOM 8395 HN1 TYR B 468 -32.661 27.058 4.364 1.00 0.00 H TER 8396 TYR B 468 HETATM 8397 O HOH 1 -1.029 1.547 3.851 1.00 30.58 O HETATM 8398 O HOH 2 2.499 2.095 0.039 1.00 32.85 O HETATM 8399 C1 UNN A 3 0.775 17.140 -8.104 1.00 -0.00 C HETATM 8400 C2 UNN A 3 1.937 17.245 -9.065 1.00 0.12 C HETATM 8401 C3 UNN A 3 3.211 16.664 -8.957 1.00 0.04 C HETATM 8402 N4 UNN A 3 3.894 17.049 -10.043 1.00 -0.31 N HETATM 8403 C5 UNN A 3 3.060 17.814 -10.778 1.00 0.19 C HETATM 8404 O6 UNN A 3 1.920 17.916 -10.167 1.00 -0.24 O HETATM 8405 C7 UNN A 3 3.488 18.462 -12.052 1.00 0.03 C HETATM 8406 C8 UNN A 3 2.621 18.841 -13.083 1.00 -0.05 C HETATM 8407 C9 UNN A 3 3.152 19.466 -14.212 1.00 -0.05 C HETATM 8408 C10 UNN A 3 4.530 19.720 -14.287 1.00 0.04 C HETATM 8409 C11 UNN A 3 5.384 19.356 -13.252 1.00 -0.05 C HETATM 8410 C12 UNN A 3 4.853 18.737 -12.139 1.00 -0.05 C HETATM 8411 H UNN A 3 5.510 18.459 -11.315 1.00 0.06 H HETATM 8412 H UNN A 3 6.453 19.556 -13.319 1.00 0.06 H HETATM 8413 CL13 UNN A 3 5.270 20.497 -15.656 1.00 -0.07 CL HETATM 8414 H UNN A 3 2.498 19.756 -15.034 1.00 0.06 H HETATM 8415 H UNN A 3 1.550 18.651 -13.006 1.00 0.06 H HETATM 8416 C14 UNN A 3 3.769 15.774 -7.876 1.00 0.10 C HETATM 8417 O15 UNN A 3 2.681 15.110 -7.199 1.00 -0.31 O HETATM 8418 C16 UNN A 3 2.793 13.970 -6.535 1.00 0.09 C HETATM 8419 C17 UNN A 3 4.026 13.609 -5.981 1.00 -0.04 C HETATM 8420 C18 UNN A 3 4.124 12.411 -5.298 1.00 -0.08 C HETATM 8421 C19 UNN A 3 3.021 11.581 -5.152 1.00 -0.07 C HETATM 8422 C20 UNN A 3 1.790 11.943 -5.683 1.00 -0.03 C HETATM 8423 C21 UNN A 3 1.685 13.137 -6.385 1.00 -0.03 C HETATM 8424 H UNN A 3 0.729 13.425 -6.822 1.00 0.05 H HETATM 8425 C22 UNN A 3 0.628 11.005 -5.524 1.00 0.07 C HETATM 8426 N23 UNN A 3 0.271 10.568 -6.869 1.00 -0.22 N HETATM 8427 C24 UNN A 3 1.158 9.717 -7.668 1.00 0.09 C HETATM 8428 C25 UNN A 3 0.905 8.253 -7.410 1.00 0.06 C HETATM 8429 O26 UNN A 3 1.800 7.460 -7.635 1.00 -0.57 O HETATM 8430 O27 UNN A 3 -0.267 7.829 -6.951 1.00 -0.57 O HETATM 8431 H UNN A 3 2.189 9.941 -7.394 1.00 0.07 H HETATM 8432 H UNN A 3 0.970 9.918 -8.723 1.00 0.07 H HETATM 8433 C28 UNN A 3 -0.867 11.004 -7.407 1.00 0.33 C HETATM 8434 O29 UNN A 3 -1.647 11.652 -6.733 1.00 -0.38 O HETATM 8435 O30 UNN A 3 -1.136 10.741 -8.681 1.00 -0.27 O HETATM 8436 C31 UNN A 3 -2.069 9.679 -9.022 1.00 0.07 C HETATM 8437 H UNN A 3 -1.699 8.732 -8.629 1.00 0.06 H HETATM 8438 H UNN A 3 -3.043 9.899 -8.586 1.00 0.06 H HETATM 8439 H UNN A 3 -2.161 9.613 -10.106 1.00 0.06 H HETATM 8440 H UNN A 3 -0.212 11.499 -5.035 1.00 0.07 H HETATM 8441 H UNN A 3 0.891 10.157 -4.892 1.00 0.07 H HETATM 8442 H UNN A 3 3.122 10.637 -4.616 1.00 0.05 H HETATM 8443 H UNN A 3 5.081 12.114 -4.868 1.00 0.06 H HETATM 8444 H UNN A 3 4.894 14.261 -6.086 1.00 0.05 H HETATM 8445 H UNN A 3 4.332 16.375 -7.162 1.00 0.07 H HETATM 8446 H UNN A 3 4.431 15.031 -8.320 1.00 0.07 H HETATM 8447 H UNN A 3 0.486 16.094 -7.998 1.00 0.04 H HETATM 8448 H UNN A 3 1.071 17.537 -7.133 1.00 0.04 H HETATM 8449 H UNN A 3 -0.068 17.713 -8.491 1.00 0.04 H CONECT 1 2 11 12 13 CONECT 11 1 CONECT 12 1 CONECT 13 1 CONECT 923 924 930 931 932 CONECT 930 923 CONECT 931 923 CONECT 932 923 CONECT 4153 4138 4154 4155 4156 CONECT 4154 4153 CONECT 4155 4153 CONECT 4156 4153 CONECT 4158 4159 4168 4169 4170 CONECT 4168 4158 CONECT 4169 4158 CONECT 4170 4158 CONECT 4798 4799 4811 4812 4813 CONECT 4811 4798 CONECT 4812 4798 CONECT 4813 4798 CONECT 5103 5104 5110 5111 5112 CONECT 5110 5103 CONECT 5111 5103 CONECT 5112 5103 CONECT 8392 8377 8393 8394 8395 CONECT 8393 8392 CONECT 8394 8392 CONECT 8395 8392 CONECT 8399 8400 8447 8448 8449 CONECT 8400 8399 8401 8404 CONECT 8401 8400 8402 8416 CONECT 8402 8401 8403 CONECT 8403 8402 8404 8405 CONECT 8404 8400 8403 CONECT 8405 8403 8406 8410 CONECT 8406 8405 8407 8415 CONECT 8407 8406 8408 8414 CONECT 8408 8407 8409 8413 CONECT 8409 8408 8410 8412 CONECT 8410 8405 8409 8411 CONECT 8411 8410 CONECT 8412 8409 CONECT 8413 8408 CONECT 8414 8407 CONECT 8415 8406 CONECT 8416 8401 8417 8445 8446 CONECT 8417 8416 8418 CONECT 8418 8417 8419 8423 CONECT 8419 8418 8420 8444 CONECT 8420 8419 8421 8443 CONECT 8421 8420 8422 8442 CONECT 8422 8421 8423 8425 CONECT 8423 8418 8422 8424 CONECT 8424 8423 CONECT 8425 8422 8426 8440 8441 CONECT 8426 8425 8427 8433 CONECT 8427 8426 8428 8431 8432 CONECT 8428 8427 8429 8430 CONECT 8429 8428 CONECT 8430 8428 CONECT 8431 8427 CONECT 8432 8427 CONECT 8433 8426 8434 8435 CONECT 8434 8433 CONECT 8435 8433 8436 CONECT 8436 8435 8437 8438 8439 CONECT 8437 8436 CONECT 8438 8436 CONECT 8439 8436 CONECT 8440 8425 CONECT 8441 8425 CONECT 8442 8421 CONECT 8443 8420 CONECT 8444 8419 CONECT 8445 8416 CONECT 8446 8416 CONECT 8447 8399 CONECT 8448 8399 CONECT 8449 8399 MASTER 0 0 0 0 0 0 0 0 8444 5 79 44 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 3kdt
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
1i7g
RCSB PDB
PDBbind
287aa, >1I7G_1|Chain... *
3kdu
RCSB PDB
PDBbind
277aa, >3KDU_1|Chains... at 98%
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
No complexes with the same small molecule ligand are found!
Entry Information
PDB ID
3kdt
Complex Type
Protein-Ligand
PDBbind Subset
general set
Protein Name
peroxisome proliferator-activatedeceptor alpha (PPARalpha)
Ligand Name
7HA
EC.Number
E.C.-.-.-.-
Resolution
2.7(Å)
Affinity (Kd/Ki/IC50)
IC50=260nM
Release Year
2010
Protein/NA Sequence
Check fasta file
Primary Reference
(2010) J.Med.Chem. Vol. 53: pp. 2854-2864
Ligand Properties
Formula
C
2
2
H
2
1
ClN
2
O
6
Molecular Weight
444.865
Exact Mass
444.109
No. of atoms
52
No. of bonds
54
Polar Surface Area
102.1
LOGP Value
4.71 (
Computed with XLOGP3
)
4.54 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 0
No. of Hydrogen Bond Acceptors: 4
No. of Rotatable Bonds: 9
No. of Nitrogen and Oxygen Atoms: 8
No. of Rings: 3
Canonical SMILES
COC(=O)N(Cc1cccc(c1)OCc1nc(oc1C)c1ccc(cc1)Cl)CC(=O)O
InChI String
InChI=1S/C22H21ClN2O6/c1-14-19(24-21(31-14)16-6-8-17(23)9-7-16)13-30-18-5-3-4-15(10-18)11-25(12-20(26)27)22(28)29-2/h3-10H,11-13H2,1-2H3,(H,26,27)
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
Q07869
Entrez Gene ID
NCBI Entrez Gene ID:
5465
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com