Browse entries in the PDBbind-CN Database
HEADER 4F3C_COMPLEX COMPND 4F3C_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 230 MET LYS ILE GLY ILE ILE GLY ALA MET GLU GLU GLU VAL SEQRES 2 A 230 THR LEU LEU ARG ASP LYS ILE ASP ASN ARG GLN THR ILE SEQRES 3 A 230 THR LEU GLY GLY CYS GLU ILE TYR THR GLY GLN LEU ASN SEQRES 4 A 230 GLY THR GLU VAL ALA LEU LEU LYS SER GLY ILE GLY LYS SEQRES 5 A 230 VAL ALA ALA ALA LEU GLY ALA THR LEU LEU LEU GLU HIS SEQRES 6 A 230 CYS LYS PRO ASP VAL ILE ILE ASN THR GLY SER ALA GLY SEQRES 7 A 230 GLY LEU ALA SER THR LEU LYS VAL GLY ASP ILE VAL VAL SEQRES 8 A 230 SER ASP GLU THR ARG TYR HIS ASP ALA ASP VAL THR ALA SEQRES 9 A 230 PHE GLY TYR GLU TYR GLY GLN LEU PRO GLY CYS PRO ALA SEQRES 10 A 230 GLY PHE LYS ALA ASP ASP LYS LEU ILE ALA ALA ALA GLU SEQRES 11 A 230 SER CYS ILE ARG GLU LEU ASN LEU ASN ALA VAL ARG GLY SEQRES 12 A 230 LEU ILE VAL SER GLY ASP ALA PHE ILE ASN GLY SER VAL SEQRES 13 A 230 GLY LEU ALA LYS ILE ARG HIS ASN PHE PRO ASP ALA VAL SEQRES 14 A 230 ALA VAL GLU MET GLU ALA THR ALA ILE ALA HIS VAL CYS SEQRES 15 A 230 HIS ASN PHE ASN VAL PRO PHE VAL VAL VAL ARG ALA ILE SEQRES 16 A 230 SER ASP VAL ALA ASP GLN GLN SER HIS LEU SER PHE ASP SEQRES 17 A 230 GLU PHE LEU ALA VAL ALA ALA LYS GLN SER THR LEU MET SEQRES 18 A 230 VAL GLU THR LEU VAL GLN LYS LEU ALA SEQRES 1 B 230 MET LYS ILE GLY ILE ILE GLY ALA MET GLU GLU GLU VAL SEQRES 2 B 230 THR LEU LEU ARG ASP LYS ILE ASP ASN ARG GLN THR ILE SEQRES 3 B 230 THR LEU GLY GLY CYS GLU ILE TYR THR GLY GLN LEU ASN SEQRES 4 B 230 GLY THR GLU VAL ALA LEU LEU LYS SER GLY ILE GLY LYS SEQRES 5 B 230 VAL ALA ALA ALA LEU GLY ALA THR LEU LEU LEU GLU HIS SEQRES 6 B 230 CYS LYS PRO ASP VAL ILE ILE ASN THR GLY SER ALA GLY SEQRES 7 B 230 GLY LEU ALA SER THR LEU LYS VAL GLY ASP ILE VAL VAL SEQRES 8 B 230 SER ASP GLU THR ARG TYR HIS ASP ALA ASP VAL THR ALA SEQRES 9 B 230 PHE GLY TYR GLU TYR GLY GLN LEU PRO GLY CYS PRO ALA SEQRES 10 B 230 GLY PHE LYS ALA ASP ASP LYS LEU ILE ALA ALA ALA GLU SEQRES 11 B 230 SER CYS ILE ARG GLU LEU ASN LEU ASN ALA VAL ARG GLY SEQRES 12 B 230 LEU ILE VAL SER GLY ASP ALA PHE ILE ASN GLY SER VAL SEQRES 13 B 230 GLY LEU ALA LYS ILE ARG HIS ASN PHE PRO ASP ALA VAL SEQRES 14 B 230 ALA VAL GLU MET GLU ALA THR ALA ILE ALA HIS VAL CYS SEQRES 15 B 230 HIS ASN PHE ASN VAL PRO PHE VAL VAL VAL ARG ALA ILE SEQRES 16 B 230 SER ASP VAL ALA ASP GLN GLN SER HIS LEU SER PHE ASP SEQRES 17 B 230 GLU PHE LEU ALA VAL ALA ALA LYS GLN SER THR LEU MET SEQRES 18 B 230 VAL GLU THR LEU VAL GLN LYS LEU ALA HET BIG A 622 49 ATOM 1 N MET A 1 -40.720 9.552 34.940 1.00 59.34 N ATOM 2 CA MET A 1 -40.980 8.601 33.823 1.00 58.43 C ATOM 3 C MET A 1 -40.656 9.239 32.469 1.00 55.30 C ATOM 4 O MET A 1 -41.522 9.877 31.866 1.00 55.43 O ATOM 5 CB MET A 1 -42.445 8.154 33.858 1.00 63.64 C ATOM 6 CG MET A 1 -42.829 7.142 32.788 1.00 65.89 C ATOM 7 SD MET A 1 -42.467 5.444 33.263 1.00 71.30 S ATOM 8 CE MET A 1 -43.630 5.234 34.615 1.00 70.53 C ATOM 9 HA MET A 1 -40.332 7.734 33.950 1.00 0.00 H ATOM 10 HB2 MET A 1 -42.641 7.708 34.833 1.00 0.00 H ATOM 11 HB3 MET A 1 -43.072 9.036 33.731 1.00 0.00 H ATOM 12 HG2 MET A 1 -42.277 7.373 31.877 1.00 0.00 H ATOM 13 HG3 MET A 1 -43.898 7.229 32.595 1.00 0.00 H ATOM 14 HE1 MET A 1 -43.415 5.965 35.394 1.00 0.00 H ATOM 15 HE2 MET A 1 -44.645 5.382 34.246 1.00 0.00 H ATOM 16 HE3 MET A 1 -43.533 4.228 35.023 1.00 0.00 H ATOM 17 HN3 MET A 1 -41.314 10.397 34.819 1.00 0.00 H ATOM 18 HN2 MET A 1 -39.717 9.827 34.933 1.00 0.00 H ATOM 19 HN1 MET A 1 -40.948 9.093 35.845 1.00 0.00 H ATOM 20 N LYS A 2 -39.414 9.086 32.002 1.00 48.02 N ATOM 21 CA LYS A 2 -39.072 9.469 30.635 1.00 44.91 C ATOM 22 C LYS A 2 -38.914 8.220 29.767 1.00 43.06 C ATOM 23 O LYS A 2 -38.146 7.319 30.108 1.00 41.05 O ATOM 24 CB LYS A 2 -37.799 10.297 30.565 1.00 45.57 C ATOM 25 CG LYS A 2 -37.612 10.953 29.202 1.00 45.86 C ATOM 26 CD LYS A 2 -36.258 11.620 29.064 1.00 49.32 C ATOM 27 CE LYS A 2 -36.187 12.928 29.842 1.00 49.46 C ATOM 28 NZ LYS A 2 -34.783 13.307 30.146 1.00 49.96 N ATOM 29 HA LYS A 2 -39.889 10.087 30.262 1.00 0.00 H ATOM 30 HB2 LYS A 2 -37.844 11.076 31.326 1.00 0.00 H ATOM 31 HB3 LYS A 2 -36.946 9.647 30.762 1.00 0.00 H ATOM 32 HG2 LYS A 2 -37.707 10.190 28.430 1.00 0.00 H ATOM 33 HG3 LYS A 2 -38.389 11.705 29.065 1.00 0.00 H ATOM 34 HD2 LYS A 2 -35.491 10.943 29.441 1.00 0.00 H ATOM 35 HD3 LYS A 2 -36.072 11.826 28.010 1.00 0.00 H ATOM 36 HE2 LYS A 2 -36.734 12.813 30.778 1.00 0.00 H ATOM 37 HE3 LYS A 2 -36.647 13.718 29.249 1.00 0.00 H ATOM 38 HZ1 LYS A 2 -34.339 12.560 30.717 1.00 0.00 H ATOM 39 HZ2 LYS A 2 -34.256 13.424 29.257 1.00 0.00 H ATOM 40 HZ3 LYS A 2 -34.774 14.202 30.676 1.00 0.00 H ATOM 41 H LYS A 2 -38.679 8.688 32.621 1.00 0.00 H ATOM 42 N ILE A 3 -39.650 8.177 28.653 1.00 41.12 N ATOM 43 CA ILE A 3 -39.609 7.040 27.736 1.00 37.43 C ATOM 44 C ILE A 3 -38.768 7.407 26.526 1.00 34.05 C ATOM 45 O ILE A 3 -39.006 8.428 25.878 1.00 34.86 O ATOM 46 CB ILE A 3 -41.016 6.602 27.264 1.00 38.75 C ATOM 47 CG1 ILE A 3 -41.979 6.406 28.451 1.00 38.18 C ATOM 48 CG2 ILE A 3 -40.947 5.302 26.452 1.00 37.52 C ATOM 49 CD1 ILE A 3 -41.593 5.305 29.419 1.00 39.20 C ATOM 50 HA ILE A 3 -39.172 6.200 28.277 1.00 0.00 H ATOM 51 HB ILE A 3 -41.398 7.403 26.631 1.00 0.00 H ATOM 52 HG12 ILE A 3 -42.026 7.343 29.006 1.00 0.00 H ATOM 53 HG13 ILE A 3 -42.966 6.173 28.051 1.00 0.00 H ATOM 54 HD11 ILE A 3 -41.555 4.354 28.889 1.00 0.00 H ATOM 55 HD12 ILE A 3 -40.614 5.524 29.845 1.00 0.00 H ATOM 56 HD13 ILE A 3 -42.334 5.248 30.217 1.00 0.00 H ATOM 57 HG21 ILE A 3 -40.317 5.455 25.576 1.00 0.00 H ATOM 58 HG22 ILE A 3 -40.524 4.511 27.071 1.00 0.00 H ATOM 59 HG23 ILE A 3 -41.951 5.020 26.134 1.00 0.00 H ATOM 60 H ILE A 3 -40.273 8.980 28.431 1.00 0.00 H ATOM 61 N GLY A 4 -37.761 6.577 26.249 1.00 30.50 N ATOM 62 CA GLY A 4 -37.005 6.676 25.024 1.00 28.08 C ATOM 63 C GLY A 4 -37.676 5.855 23.928 1.00 26.39 C ATOM 64 O GLY A 4 -38.083 4.715 24.152 1.00 28.57 O ATOM 65 HA3 GLY A 4 -35.996 6.299 25.191 1.00 0.00 H ATOM 66 HA2 GLY A 4 -36.955 7.720 24.714 1.00 0.00 H ATOM 67 H GLY A 4 -37.514 5.837 26.936 1.00 0.00 H ATOM 68 N ILE A 5 -37.793 6.458 22.752 1.00 27.48 N ATOM 69 CA ILE A 5 -38.286 5.803 21.539 1.00 27.12 C ATOM 70 C ILE A 5 -37.256 5.987 20.413 1.00 25.61 C ATOM 71 O ILE A 5 -36.764 7.096 20.166 1.00 25.81 O ATOM 72 CB ILE A 5 -39.639 6.396 21.071 1.00 28.11 C ATOM 73 CG1 ILE A 5 -40.650 6.441 22.225 1.00 28.89 C ATOM 74 CG2 ILE A 5 -40.214 5.589 19.900 1.00 28.69 C ATOM 75 CD1 ILE A 5 -41.845 7.324 21.956 1.00 29.66 C ATOM 76 HA ILE A 5 -38.435 4.748 21.768 1.00 0.00 H ATOM 77 HB ILE A 5 -39.453 7.416 20.734 1.00 0.00 H ATOM 78 HG12 ILE A 5 -41.006 5.428 22.410 1.00 0.00 H ATOM 79 HG13 ILE A 5 -40.141 6.813 23.114 1.00 0.00 H ATOM 80 HD11 ILE A 5 -41.508 8.346 21.781 1.00 0.00 H ATOM 81 HD12 ILE A 5 -42.374 6.959 21.076 1.00 0.00 H ATOM 82 HD13 ILE A 5 -42.512 7.303 22.818 1.00 0.00 H ATOM 83 HG21 ILE A 5 -39.513 5.612 19.066 1.00 0.00 H ATOM 84 HG22 ILE A 5 -40.373 4.557 20.214 1.00 0.00 H ATOM 85 HG23 ILE A 5 -41.163 6.026 19.591 1.00 0.00 H ATOM 86 H ILE A 5 -37.517 7.459 22.688 1.00 0.00 H ATOM 87 N ILE A 6 -36.925 4.892 19.731 1.00 23.82 N ATOM 88 CA ILE A 6 -35.971 4.958 18.629 1.00 21.82 C ATOM 89 C ILE A 6 -36.565 4.322 17.386 1.00 19.83 C ATOM 90 O ILE A 6 -37.052 3.199 17.424 1.00 20.52 O ATOM 91 CB ILE A 6 -34.645 4.231 18.973 1.00 23.30 C ATOM 92 CG1 ILE A 6 -33.954 4.872 20.182 1.00 24.11 C ATOM 93 CG2 ILE A 6 -33.737 4.195 17.754 1.00 23.55 C ATOM 94 CD1 ILE A 6 -32.658 4.173 20.594 1.00 25.24 C ATOM 95 HA ILE A 6 -35.756 6.012 18.451 1.00 0.00 H ATOM 96 HB ILE A 6 -34.875 3.203 19.253 1.00 0.00 H ATOM 97 HG12 ILE A 6 -33.723 5.909 19.936 1.00 0.00 H ATOM 98 HG13 ILE A 6 -34.643 4.845 21.026 1.00 0.00 H ATOM 99 HD11 ILE A 6 -32.873 3.137 20.855 1.00 0.00 H ATOM 100 HD12 ILE A 6 -31.952 4.201 19.764 1.00 0.00 H ATOM 101 HD13 ILE A 6 -32.229 4.685 21.456 1.00 0.00 H ATOM 102 HG21 ILE A 6 -34.238 3.663 16.945 1.00 0.00 H ATOM 103 HG22 ILE A 6 -33.515 5.214 17.438 1.00 0.00 H ATOM 104 HG23 ILE A 6 -32.809 3.682 18.008 1.00 0.00 H ATOM 105 H ILE A 6 -37.352 3.979 19.987 1.00 0.00 H ATOM 106 N GLY A 7 -36.506 5.057 16.293 1.00 19.24 N ATOM 107 CA GLY A 7 -36.810 4.553 14.969 1.00 20.42 C ATOM 108 C GLY A 7 -35.689 4.973 14.047 1.00 20.35 C ATOM 109 O GLY A 7 -35.007 5.976 14.284 1.00 19.77 O ATOM 110 HA3 GLY A 7 -37.754 4.972 14.620 1.00 0.00 H ATOM 111 HA2 GLY A 7 -36.883 3.466 14.993 1.00 0.00 H ATOM 112 H GLY A 7 -36.226 6.054 16.386 1.00 0.00 H ATOM 113 N ALA A 8 -35.499 4.212 12.972 1.00 19.45 N ATOM 114 CA ALA A 8 -34.393 4.439 12.079 1.00 18.11 C ATOM 115 C ALA A 8 -34.664 5.558 11.062 1.00 19.04 C ATOM 116 O ALA A 8 -33.784 6.347 10.734 1.00 17.88 O ATOM 117 CB ALA A 8 -34.052 3.140 11.364 1.00 18.13 C ATOM 118 HA ALA A 8 -33.547 4.771 12.680 1.00 0.00 H ATOM 119 HB1 ALA A 8 -33.780 2.383 12.099 1.00 0.00 H ATOM 120 HB2 ALA A 8 -34.918 2.801 10.796 1.00 0.00 H ATOM 121 HB3 ALA A 8 -33.215 3.308 10.687 1.00 0.00 H ATOM 122 H ALA A 8 -36.163 3.437 12.773 1.00 0.00 H ATOM 123 N MET A 9 -35.883 5.607 10.552 1.00 18.52 N ATOM 124 CA MET A 9 -36.154 6.379 9.356 1.00 19.83 C ATOM 125 C MET A 9 -37.093 7.509 9.685 1.00 19.69 C ATOM 126 O MET A 9 -37.900 7.429 10.621 1.00 19.97 O ATOM 127 CB MET A 9 -36.822 5.520 8.288 1.00 19.04 C ATOM 128 CG MET A 9 -35.955 4.374 7.807 1.00 19.90 C ATOM 129 SD MET A 9 -36.888 3.314 6.715 1.00 20.68 S ATOM 130 CE MET A 9 -36.829 4.257 5.193 1.00 20.16 C ATOM 131 HA MET A 9 -35.202 6.755 8.982 1.00 0.00 H ATOM 132 HB2 MET A 9 -37.742 5.107 8.702 1.00 0.00 H ATOM 133 HB3 MET A 9 -37.062 6.154 7.434 1.00 0.00 H ATOM 134 HG2 MET A 9 -35.613 3.796 8.665 1.00 0.00 H ATOM 135 HG3 MET A 9 -35.093 4.773 7.272 1.00 0.00 H ATOM 136 HE1 MET A 9 -37.290 5.232 5.353 1.00 0.00 H ATOM 137 HE2 MET A 9 -35.791 4.390 4.889 1.00 0.00 H ATOM 138 HE3 MET A 9 -37.371 3.721 4.414 1.00 0.00 H ATOM 139 H MET A 9 -36.655 5.086 11.014 1.00 0.00 H ATOM 140 N GLU A 10 -37.009 8.527 8.853 1.00 21.26 N ATOM 141 CA GLU A 10 -37.917 9.663 8.916 1.00 22.63 C ATOM 142 C GLU A 10 -39.361 9.169 8.918 1.00 22.17 C ATOM 143 O GLU A 10 -40.143 9.561 9.755 1.00 22.84 O ATOM 144 CB GLU A 10 -37.682 10.554 7.703 1.00 24.02 C ATOM 145 CG GLU A 10 -38.749 11.618 7.493 1.00 27.25 C ATOM 146 CD GLU A 10 -38.773 12.693 8.572 1.00 29.20 C ATOM 147 OE1 GLU A 10 -37.886 12.752 9.455 1.00 31.63 O ATOM 148 OE2 GLU A 10 -39.714 13.509 8.540 1.00 31.79 O ATOM 149 HA GLU A 10 -37.734 10.229 9.829 1.00 0.00 H ATOM 150 HB2 GLU A 10 -36.721 11.053 7.827 1.00 0.00 H ATOM 151 HB3 GLU A 10 -37.650 9.922 6.816 1.00 0.00 H ATOM 152 HG2 GLU A 10 -38.568 12.100 6.532 1.00 0.00 H ATOM 153 HG3 GLU A 10 -39.723 11.128 7.475 1.00 0.00 H ATOM 154 H GLU A 10 -36.267 8.519 8.125 1.00 0.00 H ATOM 155 N GLU A 11 -39.665 8.253 8.001 1.00 21.75 N ATOM 156 CA GLU A 11 -41.011 7.749 7.798 1.00 22.72 C ATOM 157 C GLU A 11 -41.536 7.025 9.013 1.00 21.50 C ATOM 158 O GLU A 11 -42.743 7.012 9.260 1.00 22.47 O ATOM 159 CB GLU A 11 -41.064 6.831 6.581 1.00 22.91 C ATOM 160 CG GLU A 11 -40.812 7.576 5.278 1.00 25.36 C ATOM 161 CD GLU A 11 -39.336 7.752 4.953 1.00 26.62 C ATOM 162 OE1 GLU A 11 -38.472 7.639 5.858 1.00 27.76 O ATOM 163 OE2 GLU A 11 -39.034 7.985 3.769 1.00 30.56 O ATOM 164 HA GLU A 11 -41.652 8.613 7.625 1.00 0.00 H ATOM 165 HB2 GLU A 11 -40.305 6.056 6.694 1.00 0.00 H ATOM 166 HB3 GLU A 11 -42.050 6.368 6.534 1.00 0.00 H ATOM 167 HG2 GLU A 11 -41.280 7.019 4.466 1.00 0.00 H ATOM 168 HG3 GLU A 11 -41.269 8.563 5.351 1.00 0.00 H ATOM 169 H GLU A 11 -38.901 7.881 7.401 1.00 0.00 H ATOM 170 N GLU A 12 -40.626 6.428 9.776 1.00 20.61 N ATOM 171 CA GLU A 12 -40.993 5.676 10.975 1.00 20.83 C ATOM 172 C GLU A 12 -41.202 6.579 12.203 1.00 20.09 C ATOM 173 O GLU A 12 -41.874 6.189 13.142 1.00 20.89 O ATOM 174 CB GLU A 12 -39.912 4.638 11.275 1.00 20.07 C ATOM 175 CG GLU A 12 -39.810 3.544 10.202 1.00 19.28 C ATOM 176 CD GLU A 12 -38.563 2.660 10.324 1.00 19.01 C ATOM 177 OE1 GLU A 12 -37.491 3.156 10.735 1.00 19.20 O ATOM 178 OE2 GLU A 12 -38.651 1.467 9.971 1.00 18.82 O ATOM 179 HA GLU A 12 -41.946 5.187 10.773 1.00 0.00 H ATOM 180 HB2 GLU A 12 -38.951 5.148 11.343 1.00 0.00 H ATOM 181 HB3 GLU A 12 -40.140 4.166 12.231 1.00 0.00 H ATOM 182 HG2 GLU A 12 -40.691 2.906 10.279 1.00 0.00 H ATOM 183 HG3 GLU A 12 -39.795 4.024 9.224 1.00 0.00 H ATOM 184 H GLU A 12 -39.622 6.498 9.512 1.00 0.00 H ATOM 185 N VAL A 13 -40.597 7.754 12.221 1.00 21.50 N ATOM 186 CA VAL A 13 -40.701 8.643 13.397 1.00 22.48 C ATOM 187 C VAL A 13 -41.647 9.842 13.191 1.00 24.57 C ATOM 188 O VAL A 13 -42.042 10.503 14.157 1.00 26.38 O ATOM 189 CB VAL A 13 -39.325 9.157 13.879 1.00 21.32 C ATOM 190 CG1 VAL A 13 -38.370 7.982 14.121 1.00 22.41 C ATOM 191 CG2 VAL A 13 -38.720 10.150 12.913 1.00 21.02 C ATOM 192 HA VAL A 13 -41.134 8.007 14.169 1.00 0.00 H ATOM 193 HB VAL A 13 -39.483 9.682 14.821 1.00 0.00 H ATOM 194 HG11 VAL A 13 -38.790 7.325 14.882 1.00 0.00 H ATOM 195 HG12 VAL A 13 -38.237 7.427 13.193 1.00 0.00 H ATOM 196 HG13 VAL A 13 -37.406 8.362 14.460 1.00 0.00 H ATOM 197 HG21 VAL A 13 -38.585 9.674 11.942 1.00 0.00 H ATOM 198 HG22 VAL A 13 -39.386 11.006 12.809 1.00 0.00 H ATOM 199 HG23 VAL A 13 -37.754 10.483 13.294 1.00 0.00 H ATOM 200 H VAL A 13 -40.040 8.057 11.396 1.00 0.00 H ATOM 201 N THR A 14 -42.027 10.108 11.960 1.00 25.64 N ATOM 202 CA THR A 14 -42.729 11.359 11.667 1.00 27.72 C ATOM 203 C THR A 14 -44.082 11.517 12.400 1.00 29.31 C ATOM 204 O THR A 14 -44.415 12.616 12.875 1.00 29.17 O ATOM 205 CB THR A 14 -42.872 11.571 10.154 1.00 29.15 C ATOM 206 OG1 THR A 14 -43.365 12.889 9.914 1.00 34.12 O ATOM 207 CG2 THR A 14 -43.812 10.567 9.538 1.00 29.28 C ATOM 208 HA THR A 14 -42.099 12.152 12.070 1.00 0.00 H ATOM 209 HB THR A 14 -41.892 11.438 9.696 1.00 0.00 H ATOM 210 HG1 THR A 14 -44.247 12.995 10.351 1.00 0.00 H ATOM 211 HG23 THR A 14 -43.437 9.560 9.721 1.00 0.00 H ATOM 212 HG21 THR A 14 -44.800 10.674 9.985 1.00 0.00 H ATOM 213 HG22 THR A 14 -43.877 10.743 8.464 1.00 0.00 H ATOM 214 H THR A 14 -41.829 9.431 11.196 1.00 0.00 H ATOM 215 N LEU A 15 -44.838 10.429 12.525 1.00 28.61 N ATOM 216 CA LEU A 15 -46.159 10.486 13.134 1.00 28.66 C ATOM 217 C LEU A 15 -46.028 10.713 14.647 1.00 30.74 C ATOM 218 O LEU A 15 -46.741 11.557 15.229 1.00 32.49 O ATOM 219 CB LEU A 15 -46.984 9.223 12.814 1.00 28.88 C ATOM 220 CG LEU A 15 -47.175 8.862 11.330 1.00 29.70 C ATOM 221 CD1 LEU A 15 -47.883 7.515 11.171 1.00 30.98 C ATOM 222 CD2 LEU A 15 -47.915 9.949 10.562 1.00 29.15 C ATOM 223 HA LEU A 15 -46.702 11.329 12.707 1.00 0.00 H ATOM 224 HB2 LEU A 15 -46.491 8.379 13.296 1.00 0.00 H ATOM 225 HB3 LEU A 15 -47.974 9.360 13.248 1.00 0.00 H ATOM 226 HG LEU A 15 -46.177 8.780 10.899 1.00 0.00 H ATOM 227 HD21 LEU A 15 -48.900 10.097 11.004 1.00 0.00 H ATOM 228 HD22 LEU A 15 -47.348 10.879 10.614 1.00 0.00 H ATOM 229 HD23 LEU A 15 -48.024 9.646 9.521 1.00 0.00 H ATOM 230 HD11 LEU A 15 -47.287 6.735 11.644 1.00 0.00 H ATOM 231 HD12 LEU A 15 -48.863 7.563 11.645 1.00 0.00 H ATOM 232 HD13 LEU A 15 -48.002 7.291 10.111 1.00 0.00 H ATOM 233 H LEU A 15 -44.477 9.517 12.180 1.00 0.00 H ATOM 234 N LEU A 16 -45.113 9.990 15.285 1.00 28.57 N ATOM 235 CA LEU A 16 -44.839 10.211 16.693 1.00 29.97 C ATOM 236 C LEU A 16 -44.252 11.609 16.942 1.00 31.19 C ATOM 237 O LEU A 16 -44.547 12.214 17.971 1.00 34.49 O ATOM 238 CB LEU A 16 -43.897 9.142 17.246 1.00 30.05 C ATOM 239 CG LEU A 16 -44.379 7.690 17.266 1.00 29.66 C ATOM 240 CD1 LEU A 16 -43.192 6.773 17.511 1.00 30.81 C ATOM 241 CD2 LEU A 16 -45.439 7.451 18.334 1.00 30.89 C ATOM 242 HA LEU A 16 -45.792 10.143 17.218 1.00 0.00 H ATOM 243 HB2 LEU A 16 -42.987 9.172 16.647 1.00 0.00 H ATOM 244 HB3 LEU A 16 -43.663 9.419 18.274 1.00 0.00 H ATOM 245 HG LEU A 16 -44.835 7.475 16.299 1.00 0.00 H ATOM 246 HD21 LEU A 16 -45.024 7.685 19.315 1.00 0.00 H ATOM 247 HD22 LEU A 16 -46.299 8.092 18.140 1.00 0.00 H ATOM 248 HD23 LEU A 16 -45.749 6.406 18.309 1.00 0.00 H ATOM 249 HD11 LEU A 16 -42.461 6.906 16.713 1.00 0.00 H ATOM 250 HD12 LEU A 16 -42.735 7.021 18.469 1.00 0.00 H ATOM 251 HD13 LEU A 16 -43.532 5.737 17.526 1.00 0.00 H ATOM 252 H LEU A 16 -44.587 9.257 14.769 1.00 0.00 H ATOM 253 N ARG A 17 -43.450 12.126 16.014 1.00 31.17 N ATOM 254 CA ARG A 17 -42.816 13.437 16.200 1.00 33.67 C ATOM 255 C ARG A 17 -43.860 14.555 16.231 1.00 36.90 C ATOM 256 O ARG A 17 -43.775 15.473 17.055 1.00 35.27 O ATOM 257 CB ARG A 17 -41.813 13.737 15.082 1.00 33.58 C ATOM 258 CG ARG A 17 -41.137 15.108 15.197 1.00 33.42 C ATOM 259 CD ARG A 17 -40.058 15.314 14.160 1.00 31.97 C ATOM 260 NE ARG A 17 -40.577 15.015 12.836 1.00 32.27 N ATOM 261 CZ ARG A 17 -39.867 14.563 11.809 1.00 31.21 C ATOM 262 NH1 ARG A 17 -38.573 14.347 11.902 1.00 32.29 N ATOM 263 NH2 ARG A 17 -40.478 14.323 10.666 1.00 33.53 N ATOM 264 HA ARG A 17 -42.292 13.399 17.155 1.00 0.00 H ATOM 265 HB2 ARG A 17 -41.038 12.971 15.102 1.00 0.00 H ATOM 266 HB3 ARG A 17 -42.340 13.694 14.129 1.00 0.00 H ATOM 267 HG2 ARG A 17 -41.894 15.882 15.072 1.00 0.00 H ATOM 268 HG3 ARG A 17 -40.690 15.195 16.188 1.00 0.00 H ATOM 269 HD2 ARG A 17 -39.218 14.654 14.376 1.00 0.00 H ATOM 270 HD3 ARG A 17 -39.721 16.350 14.190 1.00 0.00 H ATOM 271 HE ARG A 17 -41.594 15.168 12.679 1.00 0.00 H ATOM 272 HH12 ARG A 17 -38.045 13.993 11.079 1.00 0.00 H ATOM 273 HH11 ARG A 17 -38.078 14.531 12.798 1.00 0.00 H ATOM 274 HH22 ARG A 17 -39.937 13.969 9.852 1.00 0.00 H ATOM 275 HH21 ARG A 17 -41.501 14.488 10.579 1.00 0.00 H ATOM 276 H ARG A 17 -43.269 11.591 15.141 1.00 0.00 H ATOM 277 N ASP A 18 -44.820 14.470 15.313 1.00 39.61 N ATOM 278 CA ASP A 18 -45.865 15.489 15.160 1.00 40.60 C ATOM 279 C ASP A 18 -46.759 15.585 16.385 1.00 39.61 C ATOM 280 O ASP A 18 -47.325 16.637 16.638 1.00 40.34 O ATOM 281 CB ASP A 18 -46.719 15.194 13.929 1.00 43.73 C ATOM 282 CG ASP A 18 -45.909 15.157 12.653 1.00 48.22 C ATOM 283 OD1 ASP A 18 -44.810 15.753 12.615 1.00 56.20 O ATOM 284 OD2 ASP A 18 -46.355 14.510 11.684 1.00 54.67 O ATOM 285 HA ASP A 18 -45.359 16.447 15.039 1.00 0.00 H ATOM 286 HB2 ASP A 18 -47.203 14.227 14.063 1.00 0.00 H ATOM 287 HB3 ASP A 18 -47.479 15.970 13.838 1.00 0.00 H ATOM 288 H ASP A 18 -44.830 13.647 14.677 1.00 0.00 H ATOM 289 N LYS A 19 -46.867 14.502 17.154 1.00 37.11 N ATOM 290 CA LYS A 19 -47.706 14.475 18.349 1.00 38.07 C ATOM 291 C LYS A 19 -47.021 14.868 19.662 1.00 37.32 C ATOM 292 O LYS A 19 -47.604 14.732 20.735 1.00 34.46 O ATOM 293 CB LYS A 19 -48.335 13.098 18.480 1.00 39.57 C ATOM 294 CG LYS A 19 -49.227 12.809 17.293 1.00 43.41 C ATOM 295 CD LYS A 19 -50.010 11.530 17.456 1.00 47.19 C ATOM 296 CE LYS A 19 -49.075 10.345 17.457 1.00 50.25 C ATOM 297 NZ LYS A 19 -49.751 9.193 16.809 1.00 52.47 N ATOM 298 HA LYS A 19 -48.454 15.252 18.195 1.00 0.00 H ATOM 299 HB2 LYS A 19 -47.547 12.346 18.529 1.00 0.00 H ATOM 300 HB3 LYS A 19 -48.929 13.060 19.393 1.00 0.00 H ATOM 301 HG2 LYS A 19 -49.928 13.635 17.173 1.00 0.00 H ATOM 302 HG3 LYS A 19 -48.606 12.728 16.401 1.00 0.00 H ATOM 303 HD2 LYS A 19 -50.556 11.559 18.399 1.00 0.00 H ATOM 304 HD3 LYS A 19 -50.716 11.432 16.631 1.00 0.00 H ATOM 305 HE2 LYS A 19 -48.815 10.086 18.483 1.00 0.00 H ATOM 306 HE3 LYS A 19 -48.169 10.594 16.905 1.00 0.00 H ATOM 307 HZ1 LYS A 19 -50.615 8.958 17.337 1.00 0.00 H ATOM 308 HZ2 LYS A 19 -49.999 9.444 15.830 1.00 0.00 H ATOM 309 HZ3 LYS A 19 -49.111 8.373 16.807 1.00 0.00 H ATOM 310 H LYS A 19 -46.336 13.647 16.894 1.00 0.00 H ATOM 311 N ILE A 20 -45.798 15.379 19.584 1.00 37.20 N ATOM 312 CA ILE A 20 -45.077 15.788 20.791 1.00 39.23 C ATOM 313 C ILE A 20 -45.335 17.273 21.067 1.00 40.50 C ATOM 314 O ILE A 20 -45.109 18.110 20.192 1.00 42.97 O ATOM 315 CB ILE A 20 -43.573 15.497 20.653 1.00 36.39 C ATOM 316 CG1 ILE A 20 -43.349 13.978 20.717 1.00 35.10 C ATOM 317 CG2 ILE A 20 -42.773 16.227 21.731 1.00 35.77 C ATOM 318 CD1 ILE A 20 -42.005 13.534 20.195 1.00 35.62 C ATOM 319 HA ILE A 20 -45.443 15.210 21.639 1.00 0.00 H ATOM 320 HB ILE A 20 -43.218 15.867 19.691 1.00 0.00 H ATOM 321 HG12 ILE A 20 -43.435 13.662 21.757 1.00 0.00 H ATOM 322 HG13 ILE A 20 -44.125 13.492 20.126 1.00 0.00 H ATOM 323 HD11 ILE A 20 -41.906 13.831 19.151 1.00 0.00 H ATOM 324 HD12 ILE A 20 -41.216 14.002 20.783 1.00 0.00 H ATOM 325 HD13 ILE A 20 -41.926 12.450 20.275 1.00 0.00 H ATOM 326 HG21 ILE A 20 -42.932 17.301 21.635 1.00 0.00 H ATOM 327 HG22 ILE A 20 -43.105 15.896 22.715 1.00 0.00 H ATOM 328 HG23 ILE A 20 -41.713 16.003 21.609 1.00 0.00 H ATOM 329 H ILE A 20 -45.346 15.490 18.654 1.00 0.00 H ATOM 330 N ASP A 21 -45.815 17.579 22.273 1.00 44.15 N ATOM 331 CA ASP A 21 -46.067 18.969 22.703 1.00 47.28 C ATOM 332 C ASP A 21 -44.808 19.530 23.326 1.00 48.58 C ATOM 333 O ASP A 21 -44.027 18.780 23.916 1.00 50.14 O ATOM 334 CB ASP A 21 -47.194 19.040 23.737 1.00 47.29 C ATOM 335 CG ASP A 21 -48.505 18.490 23.213 1.00 47.85 C ATOM 336 OD1 ASP A 21 -48.951 18.910 22.116 1.00 47.28 O ATOM 337 OD2 ASP A 21 -49.088 17.630 23.905 1.00 49.01 O ATOM 338 HA ASP A 21 -46.361 19.546 21.826 1.00 0.00 H ATOM 339 HB2 ASP A 21 -46.900 18.464 24.614 1.00 0.00 H ATOM 340 HB3 ASP A 21 -47.342 20.082 24.021 1.00 0.00 H ATOM 341 H ASP A 21 -46.020 16.807 22.938 1.00 0.00 H ATOM 342 N ASN A 22 -44.621 20.844 23.204 1.00 47.82 N ATOM 343 CA ASN A 22 -43.400 21.495 23.667 1.00 49.35 C ATOM 344 C ASN A 22 -42.195 20.738 23.129 1.00 51.35 C ATOM 345 O ASN A 22 -41.305 20.336 23.879 1.00 53.30 O ATOM 346 CB ASN A 22 -43.363 21.549 25.194 1.00 47.99 C ATOM 347 CG ASN A 22 -44.645 22.085 25.776 1.00 47.38 C ATOM 348 OD1 ASN A 22 -45.170 23.074 25.284 1.00 48.11 O ATOM 349 ND2 ASN A 22 -45.166 21.429 26.805 1.00 44.99 N ATOM 350 HA ASN A 22 -43.377 22.520 23.297 1.00 0.00 H ATOM 351 HB2 ASN A 22 -43.197 20.542 25.577 1.00 0.00 H ATOM 352 HB3 ASN A 22 -42.540 22.194 25.503 1.00 0.00 H ATOM 353 HD22 ASN A 22 -44.681 20.593 27.188 1.00 0.00 H ATOM 354 HD21 ASN A 22 -46.059 21.751 27.229 1.00 0.00 H ATOM 355 H ASN A 22 -45.367 21.422 22.766 1.00 0.00 H ATOM 356 N ARG A 23 -42.202 20.532 21.818 1.00 52.93 N ATOM 357 CA ARG A 23 -41.184 19.751 21.150 1.00 51.29 C ATOM 358 C ARG A 23 -39.929 20.574 20.975 1.00 51.53 C ATOM 359 O ARG A 23 -39.954 21.629 20.350 1.00 49.46 O ATOM 360 CB ARG A 23 -41.678 19.294 19.775 1.00 52.41 C ATOM 361 CG ARG A 23 -40.628 18.555 18.959 1.00 50.98 C ATOM 362 CD ARG A 23 -41.237 17.775 17.811 1.00 51.67 C ATOM 363 NE ARG A 23 -41.569 18.609 16.654 1.00 52.00 N ATOM 364 CZ ARG A 23 -42.796 18.795 16.152 1.00 54.00 C ATOM 365 NH1 ARG A 23 -43.874 18.225 16.691 1.00 53.67 N ATOM 366 NH2 ARG A 23 -42.950 19.568 15.085 1.00 54.97 N ATOM 367 HA ARG A 23 -40.966 18.877 21.764 1.00 0.00 H ATOM 368 HB2 ARG A 23 -42.531 18.631 19.919 1.00 0.00 H ATOM 369 HB3 ARG A 23 -41.994 20.173 19.213 1.00 0.00 H ATOM 370 HG2 ARG A 23 -39.923 19.281 18.555 1.00 0.00 H ATOM 371 HG3 ARG A 23 -40.099 17.862 19.613 1.00 0.00 H ATOM 372 HD2 ARG A 23 -42.149 17.295 18.165 1.00 0.00 H ATOM 373 HD3 ARG A 23 -40.525 17.012 17.495 1.00 0.00 H ATOM 374 HE ARG A 23 -40.783 19.099 16.181 1.00 0.00 H ATOM 375 HH12 ARG A 23 -44.813 18.391 16.275 1.00 0.00 H ATOM 376 HH11 ARG A 23 -43.776 17.614 17.527 1.00 0.00 H ATOM 377 HH22 ARG A 23 -43.898 19.720 14.686 1.00 0.00 H ATOM 378 HH21 ARG A 23 -42.123 20.022 14.648 1.00 0.00 H ATOM 379 H ARG A 23 -42.968 20.947 21.250 1.00 0.00 H ATOM 380 N GLN A 24 -38.821 20.085 21.510 1.00 50.43 N ATOM 381 CA GLN A 24 -37.529 20.665 21.190 1.00 51.89 C ATOM 382 C GLN A 24 -36.671 19.597 20.535 1.00 51.98 C ATOM 383 O GLN A 24 -36.891 18.393 20.740 1.00 49.63 O ATOM 384 CB GLN A 24 -36.857 21.204 22.440 1.00 53.83 C ATOM 385 CG GLN A 24 -37.690 22.245 23.165 1.00 54.69 C ATOM 386 CD GLN A 24 -37.129 22.564 24.531 1.00 55.50 C ATOM 387 OE1 GLN A 24 -37.553 21.996 25.533 1.00 55.31 O ATOM 388 NE2 GLN A 24 -36.144 23.454 24.574 1.00 57.39 N ATOM 389 HA GLN A 24 -37.661 21.502 20.504 1.00 0.00 H ATOM 390 HB2 GLN A 24 -36.672 20.373 23.120 1.00 0.00 H ATOM 391 HB3 GLN A 24 -35.907 21.657 22.155 1.00 0.00 H ATOM 392 HG2 GLN A 24 -37.710 23.158 22.570 1.00 0.00 H ATOM 393 HG3 GLN A 24 -38.705 21.866 23.280 1.00 0.00 H ATOM 394 HE22 GLN A 24 -35.817 23.911 23.699 1.00 0.00 H ATOM 395 HE21 GLN A 24 -35.700 23.694 25.483 1.00 0.00 H ATOM 396 H GLN A 24 -38.877 19.279 22.165 1.00 0.00 H ATOM 397 N THR A 25 -35.706 20.049 19.742 1.00 49.70 N ATOM 398 CA THR A 25 -34.881 19.160 18.951 1.00 50.42 C ATOM 399 C THR A 25 -33.398 19.315 19.265 1.00 51.19 C ATOM 400 O THR A 25 -32.907 20.415 19.512 1.00 51.84 O ATOM 401 CB THR A 25 -35.126 19.393 17.454 1.00 49.13 C ATOM 402 OG1 THR A 25 -36.492 19.086 17.165 1.00 51.01 O ATOM 403 CG2 THR A 25 -34.223 18.507 16.589 1.00 48.84 C ATOM 404 HA THR A 25 -35.167 18.141 19.213 1.00 0.00 H ATOM 405 HB THR A 25 -34.898 20.434 17.224 1.00 0.00 H ATOM 406 HG1 THR A 25 -36.665 19.232 16.201 1.00 0.00 H ATOM 407 HG23 THR A 25 -33.179 18.735 16.804 1.00 0.00 H ATOM 408 HG21 THR A 25 -34.421 17.459 16.814 1.00 0.00 H ATOM 409 HG22 THR A 25 -34.429 18.699 15.536 1.00 0.00 H ATOM 410 H THR A 25 -35.538 21.074 19.688 1.00 0.00 H ATOM 411 N ILE A 26 -32.714 18.176 19.270 1.00 49.84 N ATOM 412 CA ILE A 26 -31.267 18.097 19.356 1.00 47.20 C ATOM 413 C ILE A 26 -30.810 17.355 18.110 1.00 44.73 C ATOM 414 O ILE A 26 -31.232 16.215 17.862 1.00 43.23 O ATOM 415 CB ILE A 26 -30.790 17.301 20.592 1.00 49.05 C ATOM 416 CG1 ILE A 26 -31.780 17.413 21.760 1.00 51.06 C ATOM 417 CG2 ILE A 26 -29.424 17.796 21.021 1.00 48.91 C ATOM 418 CD1 ILE A 26 -31.440 16.523 22.947 1.00 52.93 C ATOM 419 HA ILE A 26 -30.856 19.103 19.440 1.00 0.00 H ATOM 420 HB ILE A 26 -30.730 16.249 20.311 1.00 0.00 H ATOM 421 HG12 ILE A 26 -31.793 18.448 22.100 1.00 0.00 H ATOM 422 HG13 ILE A 26 -32.771 17.138 21.398 1.00 0.00 H ATOM 423 HD11 ILE A 26 -31.434 15.481 22.628 1.00 0.00 H ATOM 424 HD12 ILE A 26 -30.456 16.792 23.331 1.00 0.00 H ATOM 425 HD13 ILE A 26 -32.187 16.661 23.729 1.00 0.00 H ATOM 426 HG21 ILE A 26 -28.715 17.656 20.205 1.00 0.00 H ATOM 427 HG22 ILE A 26 -29.485 18.855 21.273 1.00 0.00 H ATOM 428 HG23 ILE A 26 -29.092 17.232 21.893 1.00 0.00 H ATOM 429 H ILE A 26 -33.248 17.286 19.208 1.00 0.00 H ATOM 430 N THR A 27 -29.999 18.022 17.304 1.00 42.28 N ATOM 431 CA THR A 27 -29.317 17.399 16.192 1.00 42.01 C ATOM 432 C THR A 27 -27.898 17.153 16.649 1.00 42.22 C ATOM 433 O THR A 27 -27.163 18.104 16.895 1.00 38.99 O ATOM 434 CB THR A 27 -29.292 18.321 14.970 1.00 42.15 C ATOM 435 OG1 THR A 27 -30.634 18.669 14.616 1.00 44.00 O ATOM 436 CG2 THR A 27 -28.614 17.639 13.787 1.00 43.93 C ATOM 437 HA THR A 27 -29.828 16.480 15.903 1.00 0.00 H ATOM 438 HB THR A 27 -28.725 19.218 15.220 1.00 0.00 H ATOM 439 HG1 THR A 27 -30.622 19.265 13.826 1.00 0.00 H ATOM 440 HG23 THR A 27 -27.592 17.375 14.059 1.00 0.00 H ATOM 441 HG21 THR A 27 -29.166 16.737 13.524 1.00 0.00 H ATOM 442 HG22 THR A 27 -28.601 18.320 12.936 1.00 0.00 H ATOM 443 H THR A 27 -29.846 19.036 17.478 1.00 0.00 H ATOM 444 N LEU A 28 -27.503 15.891 16.799 1.00 42.73 N ATOM 445 CA LEU A 28 -26.144 15.615 17.245 1.00 43.89 C ATOM 446 C LEU A 28 -25.635 14.257 16.826 1.00 44.32 C ATOM 447 O LEU A 28 -26.346 13.258 16.899 1.00 43.16 O ATOM 448 CB LEU A 28 -26.000 15.812 18.758 1.00 46.20 C ATOM 449 CG LEU A 28 -26.927 15.068 19.719 1.00 48.75 C ATOM 450 CD1 LEU A 28 -26.507 13.626 19.886 1.00 51.63 C ATOM 451 CD2 LEU A 28 -26.934 15.744 21.080 1.00 51.36 C ATOM 452 HA LEU A 28 -25.514 16.346 16.738 1.00 0.00 H ATOM 453 HB2 LEU A 28 -24.981 15.524 19.017 1.00 0.00 H ATOM 454 HB3 LEU A 28 -26.135 16.876 18.951 1.00 0.00 H ATOM 455 HG LEU A 28 -27.928 15.094 19.289 1.00 0.00 H ATOM 456 HD21 LEU A 28 -25.924 15.744 21.489 1.00 0.00 H ATOM 457 HD22 LEU A 28 -27.284 16.771 20.972 1.00 0.00 H ATOM 458 HD23 LEU A 28 -27.599 15.200 21.751 1.00 0.00 H ATOM 459 HD11 LEU A 28 -26.538 13.126 18.918 1.00 0.00 H ATOM 460 HD12 LEU A 28 -25.493 13.588 20.284 1.00 0.00 H ATOM 461 HD13 LEU A 28 -27.188 13.128 20.576 1.00 0.00 H ATOM 462 H LEU A 28 -28.159 15.109 16.600 1.00 0.00 H ATOM 463 N GLY A 29 -24.385 14.238 16.376 1.00 44.47 N ATOM 464 CA GLY A 29 -23.775 13.028 15.863 1.00 43.99 C ATOM 465 C GLY A 29 -24.493 12.499 14.633 1.00 45.45 C ATOM 466 O GLY A 29 -24.453 11.282 14.370 1.00 42.14 O ATOM 467 HA3 GLY A 29 -23.801 12.265 16.641 1.00 0.00 H ATOM 468 HA2 GLY A 29 -22.739 13.241 15.600 1.00 0.00 H ATOM 469 H GLY A 29 -23.829 15.117 16.392 1.00 0.00 H ATOM 470 N GLY A 30 -25.152 13.410 13.895 1.00 43.80 N ATOM 471 CA GLY A 30 -25.813 13.086 12.617 1.00 40.16 C ATOM 472 C GLY A 30 -27.193 12.472 12.777 1.00 37.83 C ATOM 473 O GLY A 30 -27.806 12.053 11.798 1.00 39.37 O ATOM 474 HA3 GLY A 30 -25.184 12.381 12.074 1.00 0.00 H ATOM 475 HA2 GLY A 30 -25.911 14.004 12.038 1.00 0.00 H ATOM 476 H GLY A 30 -25.198 14.389 14.242 1.00 0.00 H ATOM 477 N CYS A 31 -27.665 12.398 14.018 1.00 35.39 N ATOM 478 CA CYS A 31 -28.983 11.896 14.391 1.00 33.11 C ATOM 479 C CYS A 31 -29.819 13.048 14.929 1.00 35.09 C ATOM 480 O CYS A 31 -29.284 14.132 15.201 1.00 34.92 O ATOM 481 CB CYS A 31 -28.861 10.884 15.526 1.00 31.04 C ATOM 482 SG CYS A 31 -27.624 9.601 15.294 1.00 25.86 S ATOM 483 HA CYS A 31 -29.436 11.439 13.512 1.00 0.00 H ATOM 484 HB2 CYS A 31 -29.829 10.398 15.648 1.00 0.00 H ATOM 485 HB3 CYS A 31 -28.612 11.429 16.436 1.00 0.00 H ATOM 486 HG CYS A 31 -26.380 10.183 15.157 1.00 0.00 H ATOM 487 H CYS A 31 -27.044 12.725 14.785 1.00 0.00 H ATOM 488 N GLU A 32 -31.106 12.799 15.143 1.00 35.48 N ATOM 489 CA GLU A 32 -31.980 13.813 15.741 1.00 35.83 C ATOM 490 C GLU A 32 -32.775 13.242 16.883 1.00 33.80 C ATOM 491 O GLU A 32 -33.303 12.139 16.800 1.00 29.96 O ATOM 492 CB GLU A 32 -32.924 14.415 14.703 1.00 38.75 C ATOM 493 CG GLU A 32 -32.463 15.751 14.158 1.00 42.49 C ATOM 494 CD GLU A 32 -33.474 16.393 13.214 1.00 46.81 C ATOM 495 OE1 GLU A 32 -33.241 17.553 12.815 1.00 47.90 O ATOM 496 OE2 GLU A 32 -34.497 15.756 12.869 1.00 47.34 O ATOM 497 HA GLU A 32 -31.336 14.604 16.125 1.00 0.00 H ATOM 498 HB2 GLU A 32 -33.011 13.716 13.871 1.00 0.00 H ATOM 499 HB3 GLU A 32 -33.902 14.551 15.165 1.00 0.00 H ATOM 500 HG2 GLU A 32 -32.292 16.427 14.996 1.00 0.00 H ATOM 501 HG3 GLU A 32 -31.529 15.601 13.617 1.00 0.00 H ATOM 502 H GLU A 32 -31.499 11.872 14.883 1.00 0.00 H ATOM 503 N ILE A 33 -32.867 14.023 17.952 1.00 33.73 N ATOM 504 CA ILE A 33 -33.680 13.676 19.094 1.00 35.34 C ATOM 505 C ILE A 33 -34.765 14.751 19.258 1.00 35.93 C ATOM 506 O ILE A 33 -34.529 15.932 18.977 1.00 34.65 O ATOM 507 CB ILE A 33 -32.817 13.532 20.359 1.00 37.27 C ATOM 508 CG1 ILE A 33 -31.678 12.526 20.093 1.00 40.09 C ATOM 509 CG2 ILE A 33 -33.669 13.071 21.523 1.00 37.62 C ATOM 510 CD1 ILE A 33 -30.626 12.462 21.179 1.00 41.50 C ATOM 511 HA ILE A 33 -34.157 12.709 18.936 1.00 0.00 H ATOM 512 HB ILE A 33 -32.385 14.500 20.613 1.00 0.00 H ATOM 513 HG12 ILE A 33 -32.118 11.534 19.987 1.00 0.00 H ATOM 514 HG13 ILE A 33 -31.188 12.806 19.161 1.00 0.00 H ATOM 515 HD11 ILE A 33 -30.162 13.442 21.292 1.00 0.00 H ATOM 516 HD12 ILE A 33 -31.093 12.169 22.119 1.00 0.00 H ATOM 517 HD13 ILE A 33 -29.867 11.729 20.905 1.00 0.00 H ATOM 518 HG21 ILE A 33 -34.456 13.803 21.708 1.00 0.00 H ATOM 519 HG22 ILE A 33 -34.117 12.106 21.284 1.00 0.00 H ATOM 520 HG23 ILE A 33 -33.046 12.973 22.412 1.00 0.00 H ATOM 521 H ILE A 33 -32.335 14.916 17.968 1.00 0.00 H ATOM 522 N TYR A 34 -35.962 14.322 19.648 1.00 35.11 N ATOM 523 CA TYR A 34 -37.098 15.227 19.810 1.00 34.79 C ATOM 524 C TYR A 34 -37.615 14.993 21.204 1.00 37.57 C ATOM 525 O TYR A 34 -37.877 13.855 21.601 1.00 35.83 O ATOM 526 CB TYR A 34 -38.188 14.997 18.753 1.00 34.00 C ATOM 527 CG TYR A 34 -37.654 14.833 17.342 1.00 32.56 C ATOM 528 CD1 TYR A 34 -37.466 13.564 16.793 1.00 32.81 C ATOM 529 CD2 TYR A 34 -37.322 15.929 16.568 1.00 31.49 C ATOM 530 CE1 TYR A 34 -36.970 13.400 15.517 1.00 31.32 C ATOM 531 CE2 TYR A 34 -36.835 15.779 15.283 1.00 33.88 C ATOM 532 CZ TYR A 34 -36.657 14.502 14.767 1.00 34.21 C ATOM 533 OH TYR A 34 -36.170 14.336 13.490 1.00 37.12 O ATOM 534 HA TYR A 34 -36.789 16.263 19.668 1.00 0.00 H ATOM 535 HB3 TYR A 34 -38.865 15.851 18.767 1.00 0.00 H ATOM 536 HB2 TYR A 34 -38.739 14.095 19.019 1.00 0.00 H ATOM 537 HD2 TYR A 34 -37.447 16.931 16.979 1.00 0.00 H ATOM 538 HE2 TYR A 34 -36.593 16.655 14.681 1.00 0.00 H ATOM 539 HE1 TYR A 34 -36.828 12.400 15.108 1.00 0.00 H ATOM 540 HD1 TYR A 34 -37.717 12.684 17.385 1.00 0.00 H ATOM 541 HH TYR A 34 -35.272 14.748 13.424 1.00 0.00 H ATOM 542 H TYR A 34 -36.094 13.309 19.844 1.00 0.00 H ATOM 543 N THR A 35 -37.720 16.078 21.970 1.00 39.24 N ATOM 544 CA THR A 35 -38.065 15.981 23.373 1.00 40.05 C ATOM 545 C THR A 35 -39.349 16.767 23.651 1.00 39.44 C ATOM 546 O THR A 35 -39.602 17.812 23.051 1.00 38.23 O ATOM 547 CB THR A 35 -36.914 16.490 24.264 1.00 42.15 C ATOM 548 OG1 THR A 35 -36.433 17.738 23.753 1.00 45.67 O ATOM 549 CG2 THR A 35 -35.768 15.497 24.272 1.00 43.10 C ATOM 550 HA THR A 35 -38.233 14.931 23.614 1.00 0.00 H ATOM 551 HB THR A 35 -37.291 16.614 25.279 1.00 0.00 H ATOM 552 HG1 THR A 35 -36.104 17.610 22.828 1.00 0.00 H ATOM 553 HG23 THR A 35 -36.120 14.541 24.659 1.00 0.00 H ATOM 554 HG21 THR A 35 -35.397 15.364 23.256 1.00 0.00 H ATOM 555 HG22 THR A 35 -34.966 15.874 24.907 1.00 0.00 H ATOM 556 H THR A 35 -37.551 17.015 21.551 1.00 0.00 H ATOM 557 N GLY A 36 -40.156 16.242 24.557 1.00 40.00 N ATOM 558 CA GLY A 36 -41.400 16.890 24.917 1.00 43.58 C ATOM 559 C GLY A 36 -42.350 15.922 25.566 1.00 45.39 C ATOM 560 O GLY A 36 -41.936 14.923 26.160 1.00 43.39 O ATOM 561 HA3 GLY A 36 -41.864 17.295 24.017 1.00 0.00 H ATOM 562 HA2 GLY A 36 -41.190 17.702 25.613 1.00 0.00 H ATOM 563 H GLY A 36 -39.893 15.348 25.019 1.00 0.00 H ATOM 564 N GLN A 37 -43.639 16.231 25.462 1.00 49.42 N ATOM 565 CA GLN A 37 -44.665 15.453 26.126 1.00 47.86 C ATOM 566 C GLN A 37 -45.518 14.821 25.045 1.00 47.99 C ATOM 567 O GLN A 37 -45.898 15.495 24.078 1.00 46.76 O ATOM 568 CB GLN A 37 -45.517 16.333 27.059 1.00 48.65 C ATOM 569 CG GLN A 37 -44.747 16.982 28.208 1.00 47.67 C ATOM 570 CD GLN A 37 -43.894 18.164 27.765 1.00 50.45 C ATOM 571 OE1 GLN A 37 -44.312 18.982 26.938 1.00 49.05 O ATOM 572 NE2 GLN A 37 -42.683 18.256 28.310 1.00 52.15 N ATOM 573 HA GLN A 37 -44.212 14.686 26.754 1.00 0.00 H ATOM 574 HB2 GLN A 37 -45.966 17.126 26.461 1.00 0.00 H ATOM 575 HB3 GLN A 37 -46.304 15.712 27.486 1.00 0.00 H ATOM 576 HG2 GLN A 37 -45.463 17.330 28.952 1.00 0.00 H ATOM 577 HG3 GLN A 37 -44.095 16.232 28.656 1.00 0.00 H ATOM 578 HE22 GLN A 37 -42.369 17.546 29.003 1.00 0.00 H ATOM 579 HE21 GLN A 37 -42.051 19.037 28.043 1.00 0.00 H ATOM 580 H GLN A 37 -43.918 17.053 24.889 1.00 0.00 H ATOM 581 N LEU A 38 -45.782 13.526 25.205 1.00 47.66 N ATOM 582 CA LEU A 38 -46.659 12.772 24.318 1.00 50.32 C ATOM 583 C LEU A 38 -47.841 12.280 25.146 1.00 48.60 C ATOM 584 O LEU A 38 -47.697 11.354 25.941 1.00 45.72 O ATOM 585 CB LEU A 38 -45.911 11.578 23.711 1.00 52.97 C ATOM 586 CG LEU A 38 -46.677 10.757 22.664 1.00 56.06 C ATOM 587 CD1 LEU A 38 -46.769 11.527 21.350 1.00 56.88 C ATOM 588 CD2 LEU A 38 -46.034 9.389 22.450 1.00 56.59 C ATOM 589 HA LEU A 38 -46.999 13.405 23.498 1.00 0.00 H ATOM 590 HB2 LEU A 38 -45.006 11.958 23.238 1.00 0.00 H ATOM 591 HB3 LEU A 38 -45.639 10.907 24.526 1.00 0.00 H ATOM 592 HG LEU A 38 -47.687 10.589 23.039 1.00 0.00 H ATOM 593 HD21 LEU A 38 -45.009 9.521 22.105 1.00 0.00 H ATOM 594 HD22 LEU A 38 -46.034 8.838 23.390 1.00 0.00 H ATOM 595 HD23 LEU A 38 -46.602 8.835 21.703 1.00 0.00 H ATOM 596 HD11 LEU A 38 -47.293 12.468 21.518 1.00 0.00 H ATOM 597 HD12 LEU A 38 -45.765 11.730 20.978 1.00 0.00 H ATOM 598 HD13 LEU A 38 -47.315 10.931 20.619 1.00 0.00 H ATOM 599 H LEU A 38 -45.340 13.027 26.003 1.00 0.00 H ATOM 600 N ASN A 39 -49.000 12.917 24.957 1.00 52.06 N ATOM 601 CA ASN A 39 -50.184 12.698 25.802 1.00 50.55 C ATOM 602 C ASN A 39 -49.830 12.865 27.284 1.00 47.90 C ATOM 603 O ASN A 39 -50.122 12.008 28.128 1.00 43.78 O ATOM 604 CB ASN A 39 -50.815 11.329 25.504 1.00 53.90 C ATOM 605 CG ASN A 39 -51.247 11.191 24.051 1.00 55.65 C ATOM 606 OD1 ASN A 39 -51.783 12.129 23.464 1.00 60.16 O ATOM 607 ND2 ASN A 39 -51.021 10.020 23.468 1.00 56.35 N ATOM 608 HA ASN A 39 -50.932 13.455 25.565 1.00 0.00 H ATOM 609 HB2 ASN A 39 -50.085 10.551 25.727 1.00 0.00 H ATOM 610 HB3 ASN A 39 -51.689 11.200 26.143 1.00 0.00 H ATOM 611 HD22 ASN A 39 -50.565 9.253 24.002 1.00 0.00 H ATOM 612 HD21 ASN A 39 -51.300 9.870 22.478 1.00 0.00 H ATOM 613 H ASN A 39 -49.068 13.600 24.176 1.00 0.00 H ATOM 614 N GLY A 40 -49.182 13.988 27.579 1.00 47.41 N ATOM 615 CA GLY A 40 -48.652 14.264 28.905 1.00 49.89 C ATOM 616 C GLY A 40 -47.693 13.220 29.466 1.00 50.93 C ATOM 617 O GLY A 40 -47.779 12.866 30.644 1.00 54.22 O ATOM 618 HA3 GLY A 40 -49.494 14.348 29.592 1.00 0.00 H ATOM 619 HA2 GLY A 40 -48.123 15.216 28.863 1.00 0.00 H ATOM 620 H GLY A 40 -49.049 14.698 26.831 1.00 0.00 H ATOM 621 N THR A 41 -46.787 12.718 28.629 1.00 51.85 N ATOM 622 CA THR A 41 -45.696 11.843 29.088 1.00 48.57 C ATOM 623 C THR A 41 -44.395 12.366 28.506 1.00 45.04 C ATOM 624 O THR A 41 -44.333 12.703 27.323 1.00 38.33 O ATOM 625 CB THR A 41 -45.883 10.369 28.665 1.00 48.77 C ATOM 626 OG1 THR A 41 -46.901 9.760 29.460 1.00 47.09 O ATOM 627 CG2 THR A 41 -44.590 9.569 28.861 1.00 50.58 C ATOM 628 HA THR A 41 -45.690 11.860 30.178 1.00 0.00 H ATOM 629 HB THR A 41 -46.160 10.363 27.611 1.00 0.00 H ATOM 630 HG1 THR A 41 -47.014 8.816 29.183 1.00 0.00 H ATOM 631 HG23 THR A 41 -43.795 10.014 28.263 1.00 0.00 H ATOM 632 HG21 THR A 41 -44.309 9.588 29.914 1.00 0.00 H ATOM 633 HG22 THR A 41 -44.750 8.538 28.545 1.00 0.00 H ATOM 634 H THR A 41 -46.852 12.952 27.618 1.00 0.00 H ATOM 635 N GLU A 42 -43.361 12.425 29.345 1.00 44.36 N ATOM 636 CA GLU A 42 -42.053 12.876 28.903 1.00 44.39 C ATOM 637 C GLU A 42 -41.448 11.777 28.030 1.00 38.59 C ATOM 638 O GLU A 42 -41.365 10.622 28.435 1.00 38.31 O ATOM 639 CB GLU A 42 -41.142 13.195 30.093 1.00 45.05 C ATOM 640 CG GLU A 42 -39.988 14.118 29.742 1.00 47.85 C ATOM 641 CD GLU A 42 -40.435 15.514 29.317 1.00 50.68 C ATOM 642 OE1 GLU A 42 -41.576 15.914 29.644 1.00 53.39 O ATOM 643 OE2 GLU A 42 -39.640 16.222 28.651 1.00 54.98 O ATOM 644 HA GLU A 42 -42.154 13.798 28.331 1.00 0.00 H ATOM 645 HB2 GLU A 42 -41.741 13.671 30.869 1.00 0.00 H ATOM 646 HB3 GLU A 42 -40.732 12.260 30.475 1.00 0.00 H ATOM 647 HG2 GLU A 42 -39.343 14.213 30.616 1.00 0.00 H ATOM 648 HG3 GLU A 42 -39.425 13.671 28.923 1.00 0.00 H ATOM 649 H GLU A 42 -43.494 12.142 30.337 1.00 0.00 H ATOM 650 N VAL A 43 -41.083 12.146 26.815 1.00 39.63 N ATOM 651 CA VAL A 43 -40.458 11.216 25.884 1.00 37.72 C ATOM 652 C VAL A 43 -39.251 11.841 25.203 1.00 38.15 C ATOM 653 O VAL A 43 -39.143 13.083 25.062 1.00 39.15 O ATOM 654 CB VAL A 43 -41.440 10.755 24.788 1.00 36.43 C ATOM 655 CG1 VAL A 43 -42.696 10.171 25.409 1.00 35.55 C ATOM 656 CG2 VAL A 43 -41.769 11.897 23.822 1.00 36.05 C ATOM 657 HA VAL A 43 -40.147 10.357 26.479 1.00 0.00 H ATOM 658 HB VAL A 43 -40.958 9.970 24.206 1.00 0.00 H ATOM 659 HG11 VAL A 43 -42.429 9.315 26.028 1.00 0.00 H ATOM 660 HG12 VAL A 43 -43.182 10.929 26.024 1.00 0.00 H ATOM 661 HG13 VAL A 43 -43.376 9.852 24.619 1.00 0.00 H ATOM 662 HG21 VAL A 43 -42.225 12.719 24.375 1.00 0.00 H ATOM 663 HG22 VAL A 43 -40.852 12.243 23.345 1.00 0.00 H ATOM 664 HG23 VAL A 43 -42.463 11.539 23.062 1.00 0.00 H ATOM 665 H VAL A 43 -41.246 13.128 26.515 1.00 0.00 H ATOM 666 N ALA A 44 -38.360 10.955 24.767 1.00 35.70 N ATOM 667 CA ALA A 44 -37.222 11.307 23.925 1.00 34.02 C ATOM 668 C ALA A 44 -37.297 10.414 22.687 1.00 30.29 C ATOM 669 O ALA A 44 -37.228 9.205 22.799 1.00 31.26 O ATOM 670 CB ALA A 44 -35.933 11.067 24.678 1.00 34.78 C ATOM 671 HA ALA A 44 -37.247 12.359 23.642 1.00 0.00 H ATOM 672 HB1 ALA A 44 -35.920 11.682 25.578 1.00 0.00 H ATOM 673 HB2 ALA A 44 -35.866 10.015 24.954 1.00 0.00 H ATOM 674 HB3 ALA A 44 -35.088 11.332 24.043 1.00 0.00 H ATOM 675 H ALA A 44 -38.481 9.959 25.041 1.00 0.00 H ATOM 676 N LEU A 45 -37.504 11.016 21.525 1.00 29.57 N ATOM 677 CA LEU A 45 -37.709 10.258 20.299 1.00 29.37 C ATOM 678 C LEU A 45 -36.496 10.438 19.425 1.00 27.98 C ATOM 679 O LEU A 45 -36.246 11.545 18.944 1.00 31.98 O ATOM 680 CB LEU A 45 -38.954 10.747 19.562 1.00 29.15 C ATOM 681 CG LEU A 45 -39.199 10.185 18.157 1.00 29.05 C ATOM 682 CD1 LEU A 45 -39.428 8.687 18.227 1.00 27.57 C ATOM 683 CD2 LEU A 45 -40.385 10.873 17.515 1.00 28.51 C ATOM 684 HA LEU A 45 -37.853 9.205 20.541 1.00 0.00 H ATOM 685 HB2 LEU A 45 -39.819 10.492 20.174 1.00 0.00 H ATOM 686 HB3 LEU A 45 -38.880 11.831 19.474 1.00 0.00 H ATOM 687 HG LEU A 45 -38.318 10.374 17.544 1.00 0.00 H ATOM 688 HD21 LEU A 45 -41.273 10.708 18.125 1.00 0.00 H ATOM 689 HD22 LEU A 45 -40.187 11.942 17.442 1.00 0.00 H ATOM 690 HD23 LEU A 45 -40.546 10.463 16.518 1.00 0.00 H ATOM 691 HD11 LEU A 45 -38.549 8.206 18.657 1.00 0.00 H ATOM 692 HD12 LEU A 45 -40.298 8.482 18.851 1.00 0.00 H ATOM 693 HD13 LEU A 45 -39.601 8.300 17.223 1.00 0.00 H ATOM 694 H LEU A 45 -37.520 12.055 21.488 1.00 0.00 H ATOM 695 N LEU A 46 -35.759 9.352 19.186 1.00 26.58 N ATOM 696 CA LEU A 46 -34.537 9.434 18.377 1.00 25.41 C ATOM 697 C LEU A 46 -34.773 8.916 16.968 1.00 23.86 C ATOM 698 O LEU A 46 -35.336 7.843 16.798 1.00 25.47 O ATOM 699 CB LEU A 46 -33.402 8.647 19.034 1.00 26.85 C ATOM 700 CG LEU A 46 -32.171 8.351 18.158 1.00 26.83 C ATOM 701 CD1 LEU A 46 -31.205 9.513 18.179 1.00 27.99 C ATOM 702 CD2 LEU A 46 -31.488 7.074 18.598 1.00 27.80 C ATOM 703 HA LEU A 46 -34.254 10.485 18.315 1.00 0.00 H ATOM 704 HB2 LEU A 46 -33.063 9.216 19.900 1.00 0.00 H ATOM 705 HB3 LEU A 46 -33.810 7.692 19.365 1.00 0.00 H ATOM 706 HG LEU A 46 -32.513 8.213 17.132 1.00 0.00 H ATOM 707 HD21 LEU A 46 -31.165 7.175 19.634 1.00 0.00 H ATOM 708 HD22 LEU A 46 -32.187 6.242 18.513 1.00 0.00 H ATOM 709 HD23 LEU A 46 -30.622 6.889 17.962 1.00 0.00 H ATOM 710 HD11 LEU A 46 -31.703 10.404 17.797 1.00 0.00 H ATOM 711 HD12 LEU A 46 -30.874 9.690 19.202 1.00 0.00 H ATOM 712 HD13 LEU A 46 -30.344 9.279 17.553 1.00 0.00 H ATOM 713 H LEU A 46 -36.054 8.435 19.578 1.00 0.00 H ATOM 714 N LYS A 47 -34.346 9.688 15.975 1.00 21.91 N ATOM 715 CA LYS A 47 -34.230 9.215 14.595 1.00 22.68 C ATOM 716 C LYS A 47 -32.760 8.875 14.382 1.00 22.19 C ATOM 717 O LYS A 47 -31.925 9.786 14.290 1.00 22.09 O ATOM 718 CB LYS A 47 -34.671 10.291 13.605 1.00 23.42 C ATOM 719 CG LYS A 47 -34.469 9.886 12.148 1.00 25.04 C ATOM 720 CD LYS A 47 -35.168 10.794 11.174 1.00 25.34 C ATOM 721 CE LYS A 47 -34.556 12.184 11.148 1.00 26.17 C ATOM 722 NZ LYS A 47 -34.926 12.837 9.874 1.00 26.22 N ATOM 723 HA LYS A 47 -34.872 8.350 14.428 1.00 0.00 H ATOM 724 HB2 LYS A 47 -35.730 10.496 13.764 1.00 0.00 H ATOM 725 HB3 LYS A 47 -34.094 11.196 13.797 1.00 0.00 H ATOM 726 HG2 LYS A 47 -33.401 9.901 11.930 1.00 0.00 H ATOM 727 HG3 LYS A 47 -34.852 8.874 12.014 1.00 0.00 H ATOM 728 HD2 LYS A 47 -35.098 10.360 10.176 1.00 0.00 H ATOM 729 HD3 LYS A 47 -36.216 10.877 11.460 1.00 0.00 H ATOM 730 HE2 LYS A 47 -33.471 12.110 11.222 1.00 0.00 H ATOM 731 HE3 LYS A 47 -34.936 12.769 11.985 1.00 0.00 H ATOM 732 HZ1 LYS A 47 -34.562 12.274 9.079 1.00 0.00 H ATOM 733 HZ2 LYS A 47 -35.962 12.904 9.808 1.00 0.00 H ATOM 734 HZ3 LYS A 47 -34.513 13.791 9.842 1.00 0.00 H ATOM 735 H LYS A 47 -34.083 10.671 16.187 1.00 0.00 H ATOM 736 N SER A 48 -32.445 7.574 14.338 1.00 19.74 N ATOM 737 CA SER A 48 -31.045 7.086 14.331 1.00 19.61 C ATOM 738 C SER A 48 -30.371 6.993 12.975 1.00 18.46 C ATOM 739 O SER A 48 -29.155 7.105 12.878 1.00 19.21 O ATOM 740 CB SER A 48 -30.941 5.700 15.019 1.00 19.77 C ATOM 741 OG SER A 48 -31.646 4.677 14.292 1.00 20.57 O ATOM 742 HA SER A 48 -30.510 7.860 14.882 1.00 0.00 H ATOM 743 HB2 SER A 48 -31.363 5.773 16.021 1.00 0.00 H ATOM 744 HB3 SER A 48 -29.890 5.420 15.088 1.00 0.00 H ATOM 745 HG SER A 48 -31.265 4.598 13.382 1.00 0.00 H ATOM 746 H SER A 48 -33.215 6.876 14.307 1.00 0.00 H ATOM 747 N GLY A 49 -31.131 6.754 11.922 1.00 17.48 N ATOM 748 CA GLY A 49 -30.553 6.354 10.652 1.00 15.98 C ATOM 749 C GLY A 49 -30.506 4.813 10.631 1.00 15.30 C ATOM 750 O GLY A 49 -30.806 4.155 11.642 1.00 15.39 O ATOM 751 HA3 GLY A 49 -29.546 6.759 10.557 1.00 0.00 H ATOM 752 HA2 GLY A 49 -31.169 6.719 9.830 1.00 0.00 H ATOM 753 H GLY A 49 -32.163 6.854 12.004 1.00 0.00 H ATOM 754 N ILE A 50 -30.111 4.252 9.493 1.00 14.30 N ATOM 755 CA ILE A 50 -30.313 2.816 9.198 1.00 13.64 C ATOM 756 C ILE A 50 -29.069 1.949 9.493 1.00 12.58 C ATOM 757 O ILE A 50 -27.931 2.294 9.160 1.00 11.20 O ATOM 758 CB ILE A 50 -30.767 2.651 7.727 1.00 13.53 C ATOM 759 CG1 ILE A 50 -32.208 3.143 7.567 1.00 13.49 C ATOM 760 CG2 ILE A 50 -30.641 1.193 7.263 1.00 13.97 C ATOM 761 CD1 ILE A 50 -32.634 3.340 6.135 1.00 13.34 C ATOM 762 HA ILE A 50 -31.091 2.453 9.870 1.00 0.00 H ATOM 763 HB ILE A 50 -30.112 3.255 7.098 1.00 0.00 H ATOM 764 HG12 ILE A 50 -32.873 2.411 8.025 1.00 0.00 H ATOM 765 HG13 ILE A 50 -32.305 4.096 8.088 1.00 0.00 H ATOM 766 HD11 ILE A 50 -31.987 4.080 5.663 1.00 0.00 H ATOM 767 HD12 ILE A 50 -32.556 2.393 5.600 1.00 0.00 H ATOM 768 HD13 ILE A 50 -33.666 3.689 6.109 1.00 0.00 H ATOM 769 HG21 ILE A 50 -29.601 0.876 7.343 1.00 0.00 H ATOM 770 HG22 ILE A 50 -31.265 0.558 7.892 1.00 0.00 H ATOM 771 HG23 ILE A 50 -30.968 1.113 6.226 1.00 0.00 H ATOM 772 H ILE A 50 -29.641 4.846 8.781 1.00 0.00 H ATOM 773 N GLY A 51 -29.301 0.808 10.116 1.00 12.51 N ATOM 774 CA GLY A 51 -28.247 -0.168 10.327 1.00 12.08 C ATOM 775 C GLY A 51 -27.699 -0.147 11.735 1.00 12.53 C ATOM 776 O GLY A 51 -28.130 0.652 12.601 1.00 12.55 O ATOM 777 HA3 GLY A 51 -27.433 0.043 9.634 1.00 0.00 H ATOM 778 HA2 GLY A 51 -28.647 -1.161 10.124 1.00 0.00 H ATOM 779 H GLY A 51 -30.260 0.604 10.463 1.00 0.00 H ATOM 780 N LYS A 52 -26.780 -1.070 11.980 1.00 12.35 N ATOM 781 CA LYS A 52 -26.399 -1.442 13.338 1.00 12.48 C ATOM 782 C LYS A 52 -25.590 -0.358 14.015 1.00 11.83 C ATOM 783 O LYS A 52 -25.812 -0.006 15.186 1.00 11.84 O ATOM 784 CB LYS A 52 -25.616 -2.766 13.305 1.00 14.58 C ATOM 785 CG LYS A 52 -26.511 -3.970 13.141 1.00 15.90 C ATOM 786 CD LYS A 52 -25.821 -5.207 12.581 1.00 18.55 C ATOM 787 CE LYS A 52 -24.637 -5.648 13.350 1.00 19.89 C ATOM 788 NZ LYS A 52 -24.152 -6.933 12.757 1.00 23.33 N ATOM 789 HA LYS A 52 -27.308 -1.571 13.925 1.00 0.00 H ATOM 790 HB2 LYS A 52 -24.915 -2.736 12.471 1.00 0.00 H ATOM 791 HB3 LYS A 52 -25.063 -2.867 14.239 1.00 0.00 H ATOM 792 HG2 LYS A 52 -26.921 -4.223 14.118 1.00 0.00 H ATOM 793 HG3 LYS A 52 -27.323 -3.700 12.466 1.00 0.00 H ATOM 794 HD2 LYS A 52 -26.543 -6.024 12.568 1.00 0.00 H ATOM 795 HD3 LYS A 52 -25.503 -4.988 11.562 1.00 0.00 H ATOM 796 HE2 LYS A 52 -24.910 -5.802 14.394 1.00 0.00 H ATOM 797 HE3 LYS A 52 -23.853 -4.893 13.288 1.00 0.00 H ATOM 798 HZ1 LYS A 52 -24.906 -7.647 12.817 1.00 0.00 H ATOM 799 HZ2 LYS A 52 -23.897 -6.779 11.761 1.00 0.00 H ATOM 800 HZ3 LYS A 52 -23.318 -7.263 13.283 1.00 0.00 H ATOM 801 H LYS A 52 -26.316 -1.544 11.179 1.00 0.00 H ATOM 802 N VAL A 53 -24.671 0.214 13.265 1.00 11.74 N ATOM 803 CA VAL A 53 -23.805 1.239 13.812 1.00 11.98 C ATOM 804 C VAL A 53 -24.588 2.530 14.033 1.00 12.32 C ATOM 805 O VAL A 53 -24.422 3.196 15.064 1.00 12.20 O ATOM 806 CB VAL A 53 -22.591 1.445 12.909 1.00 12.04 C ATOM 807 CG1 VAL A 53 -21.831 2.741 13.294 1.00 12.33 C ATOM 808 CG2 VAL A 53 -21.692 0.206 13.012 1.00 12.07 C ATOM 809 HA VAL A 53 -23.433 0.916 14.784 1.00 0.00 H ATOM 810 HB VAL A 53 -22.912 1.567 11.874 1.00 0.00 H ATOM 811 HG11 VAL A 53 -22.498 3.597 13.188 1.00 0.00 H ATOM 812 HG12 VAL A 53 -21.492 2.669 14.328 1.00 0.00 H ATOM 813 HG13 VAL A 53 -20.971 2.865 12.636 1.00 0.00 H ATOM 814 HG21 VAL A 53 -21.370 0.077 14.045 1.00 0.00 H ATOM 815 HG22 VAL A 53 -22.250 -0.674 12.691 1.00 0.00 H ATOM 816 HG23 VAL A 53 -20.819 0.338 12.372 1.00 0.00 H ATOM 817 H VAL A 53 -24.566 -0.073 12.271 1.00 0.00 H ATOM 818 N ALA A 54 -25.425 2.897 13.067 1.00 13.19 N ATOM 819 CA ALA A 54 -26.259 4.108 13.216 1.00 14.13 C ATOM 820 C ALA A 54 -27.146 3.991 14.456 1.00 14.69 C ATOM 821 O ALA A 54 -27.244 4.911 15.241 1.00 16.86 O ATOM 822 CB ALA A 54 -27.095 4.350 11.965 1.00 13.41 C ATOM 823 HA ALA A 54 -25.601 4.967 13.345 1.00 0.00 H ATOM 824 HB1 ALA A 54 -26.434 4.482 11.108 1.00 0.00 H ATOM 825 HB2 ALA A 54 -27.747 3.494 11.794 1.00 0.00 H ATOM 826 HB3 ALA A 54 -27.699 5.247 12.101 1.00 0.00 H ATOM 827 H ALA A 54 -25.493 2.327 12.200 1.00 0.00 H ATOM 828 N ALA A 55 -27.779 2.836 14.631 1.00 15.10 N ATOM 829 CA ALA A 55 -28.612 2.588 15.788 1.00 14.94 C ATOM 830 C ALA A 55 -27.809 2.583 17.079 1.00 15.52 C ATOM 831 O ALA A 55 -28.286 3.092 18.102 1.00 14.74 O ATOM 832 CB ALA A 55 -29.390 1.282 15.627 1.00 14.64 C ATOM 833 HA ALA A 55 -29.325 3.410 15.855 1.00 0.00 H ATOM 834 HB1 ALA A 55 -30.025 1.345 14.743 1.00 0.00 H ATOM 835 HB2 ALA A 55 -28.689 0.455 15.514 1.00 0.00 H ATOM 836 HB3 ALA A 55 -30.009 1.118 16.509 1.00 0.00 H ATOM 837 H ALA A 55 -27.673 2.089 13.916 1.00 0.00 H ATOM 838 N ALA A 56 -26.608 2.002 17.062 1.00 14.90 N ATOM 839 CA ALA A 56 -25.797 1.948 18.286 1.00 14.74 C ATOM 840 C ALA A 56 -25.329 3.359 18.684 1.00 15.57 C ATOM 841 O ALA A 56 -25.349 3.732 19.876 1.00 16.51 O ATOM 842 CB ALA A 56 -24.604 1.017 18.107 1.00 14.08 C ATOM 843 HA ALA A 56 -26.418 1.550 19.089 1.00 0.00 H ATOM 844 HB1 ALA A 56 -24.960 0.013 17.877 1.00 0.00 H ATOM 845 HB2 ALA A 56 -23.981 1.379 17.289 1.00 0.00 H ATOM 846 HB3 ALA A 56 -24.020 0.995 19.027 1.00 0.00 H ATOM 847 H ALA A 56 -26.245 1.586 16.180 1.00 0.00 H ATOM 848 N LEU A 57 -24.909 4.126 17.693 1.00 16.20 N ATOM 849 CA LEU A 57 -24.502 5.526 17.901 1.00 18.84 C ATOM 850 C LEU A 57 -25.675 6.339 18.482 1.00 19.78 C ATOM 851 O LEU A 57 -25.558 6.977 19.538 1.00 21.19 O ATOM 852 CB LEU A 57 -24.026 6.116 16.574 1.00 20.56 C ATOM 853 CG LEU A 57 -23.919 7.637 16.400 1.00 22.25 C ATOM 854 CD1 LEU A 57 -22.975 8.254 17.407 1.00 22.87 C ATOM 855 CD2 LEU A 57 -23.487 7.968 14.991 1.00 22.05 C ATOM 856 HA LEU A 57 -23.681 5.568 18.616 1.00 0.00 H ATOM 857 HB2 LEU A 57 -23.033 5.708 16.387 1.00 0.00 H ATOM 858 HB3 LEU A 57 -24.714 5.760 15.807 1.00 0.00 H ATOM 859 HG LEU A 57 -24.906 8.064 16.580 1.00 0.00 H ATOM 860 HD21 LEU A 57 -22.515 7.515 14.794 1.00 0.00 H ATOM 861 HD22 LEU A 57 -24.221 7.577 14.286 1.00 0.00 H ATOM 862 HD23 LEU A 57 -23.414 9.050 14.879 1.00 0.00 H ATOM 863 HD11 LEU A 57 -23.336 8.049 18.415 1.00 0.00 H ATOM 864 HD12 LEU A 57 -21.981 7.824 17.282 1.00 0.00 H ATOM 865 HD13 LEU A 57 -22.929 9.331 17.248 1.00 0.00 H ATOM 866 H LEU A 57 -24.864 3.727 16.734 1.00 0.00 H ATOM 867 N GLY A 58 -26.804 6.263 17.802 1.00 20.76 N ATOM 868 CA GLY A 58 -28.049 6.909 18.230 1.00 20.88 C ATOM 869 C GLY A 58 -28.484 6.496 19.612 1.00 21.52 C ATOM 870 O GLY A 58 -28.772 7.348 20.436 1.00 21.45 O ATOM 871 HA3 GLY A 58 -28.837 6.646 17.525 1.00 0.00 H ATOM 872 HA2 GLY A 58 -27.901 7.989 18.221 1.00 0.00 H ATOM 873 H GLY A 58 -26.811 5.717 16.917 1.00 0.00 H ATOM 874 N ALA A 59 -28.529 5.193 19.884 1.00 20.27 N ATOM 875 CA ALA A 59 -28.900 4.724 21.201 1.00 19.93 C ATOM 876 C ALA A 59 -27.969 5.270 22.297 1.00 21.02 C ATOM 877 O ALA A 59 -28.427 5.629 23.387 1.00 20.19 O ATOM 878 CB ALA A 59 -28.932 3.213 21.252 1.00 19.35 C ATOM 879 HA ALA A 59 -29.902 5.105 21.397 1.00 0.00 H ATOM 880 HB1 ALA A 59 -29.660 2.842 20.531 1.00 0.00 H ATOM 881 HB2 ALA A 59 -27.945 2.821 21.007 1.00 0.00 H ATOM 882 HB3 ALA A 59 -29.214 2.890 22.254 1.00 0.00 H ATOM 883 H ALA A 59 -28.295 4.505 19.141 1.00 0.00 H ATOM 884 N THR A 60 -26.671 5.280 22.035 1.00 20.41 N ATOM 885 CA THR A 60 -25.704 5.778 23.005 1.00 20.81 C ATOM 886 C THR A 60 -25.972 7.268 23.304 1.00 23.38 C ATOM 887 O THR A 60 -26.006 7.674 24.473 1.00 21.87 O ATOM 888 CB THR A 60 -24.262 5.540 22.510 1.00 20.68 C ATOM 889 OG1 THR A 60 -24.064 4.118 22.269 1.00 20.53 O ATOM 890 CG2 THR A 60 -23.256 5.991 23.563 1.00 20.16 C ATOM 891 HA THR A 60 -25.819 5.225 23.938 1.00 0.00 H ATOM 892 HB THR A 60 -24.112 6.111 21.594 1.00 0.00 H ATOM 893 HG1 THR A 60 -24.706 3.808 21.582 1.00 0.00 H ATOM 894 HG23 THR A 60 -23.388 7.055 23.758 1.00 0.00 H ATOM 895 HG21 THR A 60 -23.418 5.429 24.483 1.00 0.00 H ATOM 896 HG22 THR A 60 -22.245 5.810 23.199 1.00 0.00 H ATOM 897 H THR A 60 -26.334 4.925 21.117 1.00 0.00 H ATOM 898 N LEU A 61 -26.153 8.059 22.251 1.00 23.88 N ATOM 899 CA LEU A 61 -26.440 9.481 22.398 1.00 25.49 C ATOM 900 C LEU A 61 -27.706 9.719 23.202 1.00 27.83 C ATOM 901 O LEU A 61 -27.729 10.586 24.115 1.00 27.08 O ATOM 902 CB LEU A 61 -26.566 10.137 21.039 1.00 25.68 C ATOM 903 CG LEU A 61 -25.269 10.264 20.231 1.00 26.58 C ATOM 904 CD1 LEU A 61 -25.568 10.807 18.852 1.00 26.81 C ATOM 905 CD2 LEU A 61 -24.225 11.110 20.947 1.00 26.97 C ATOM 906 HA LEU A 61 -25.606 9.927 22.941 1.00 0.00 H ATOM 907 HB2 LEU A 61 -27.271 9.550 20.449 1.00 0.00 H ATOM 908 HB3 LEU A 61 -26.966 11.140 21.188 1.00 0.00 H ATOM 909 HG LEU A 61 -24.840 9.267 20.129 1.00 0.00 H ATOM 910 HD21 LEU A 61 -24.622 12.112 21.111 1.00 0.00 H ATOM 911 HD22 LEU A 61 -23.983 10.652 21.906 1.00 0.00 H ATOM 912 HD23 LEU A 61 -23.325 11.170 20.335 1.00 0.00 H ATOM 913 HD11 LEU A 61 -26.247 10.129 18.335 1.00 0.00 H ATOM 914 HD12 LEU A 61 -26.032 11.789 18.942 1.00 0.00 H ATOM 915 HD13 LEU A 61 -24.640 10.893 18.288 1.00 0.00 H ATOM 916 H LEU A 61 -26.088 7.652 21.296 1.00 0.00 H ATOM 917 N LEU A 62 -28.747 8.949 22.880 1.00 28.30 N ATOM 918 CA LEU A 62 -30.021 9.050 23.582 1.00 30.57 C ATOM 919 C LEU A 62 -29.843 8.776 25.071 1.00 33.57 C ATOM 920 O LEU A 62 -30.313 9.553 25.912 1.00 33.28 O ATOM 921 CB LEU A 62 -31.057 8.085 22.991 1.00 30.32 C ATOM 922 CG LEU A 62 -32.488 8.168 23.537 1.00 31.00 C ATOM 923 CD1 LEU A 62 -33.090 9.542 23.278 1.00 31.98 C ATOM 924 CD2 LEU A 62 -33.355 7.082 22.924 1.00 32.17 C ATOM 925 HA LEU A 62 -30.387 10.069 23.454 1.00 0.00 H ATOM 926 HB2 LEU A 62 -31.104 8.272 21.918 1.00 0.00 H ATOM 927 HB3 LEU A 62 -30.698 7.071 23.166 1.00 0.00 H ATOM 928 HG LEU A 62 -32.449 8.013 24.615 1.00 0.00 H ATOM 929 HD21 LEU A 62 -33.381 7.207 21.841 1.00 0.00 H ATOM 930 HD22 LEU A 62 -32.938 6.105 23.168 1.00 0.00 H ATOM 931 HD23 LEU A 62 -34.366 7.157 23.324 1.00 0.00 H ATOM 932 HD11 LEU A 62 -32.482 10.302 23.769 1.00 0.00 H ATOM 933 HD12 LEU A 62 -33.113 9.731 22.205 1.00 0.00 H ATOM 934 HD13 LEU A 62 -34.105 9.573 23.675 1.00 0.00 H ATOM 935 H LEU A 62 -28.647 8.259 22.108 1.00 0.00 H ATOM 936 N LEU A 63 -29.188 7.662 25.393 1.00 33.81 N ATOM 937 CA LEU A 63 -28.973 7.280 26.788 1.00 34.93 C ATOM 938 C LEU A 63 -28.108 8.308 27.525 1.00 37.81 C ATOM 939 O LEU A 63 -28.417 8.698 28.652 1.00 39.68 O ATOM 940 CB LEU A 63 -28.340 5.891 26.891 1.00 33.22 C ATOM 941 CG LEU A 63 -29.229 4.678 26.574 1.00 33.42 C ATOM 942 CD1 LEU A 63 -28.460 3.384 26.792 1.00 31.83 C ATOM 943 CD2 LEU A 63 -30.504 4.667 27.403 1.00 32.65 C ATOM 944 HA LEU A 63 -29.952 7.251 27.266 1.00 0.00 H ATOM 945 HB2 LEU A 63 -27.495 5.865 26.202 1.00 0.00 H ATOM 946 HB3 LEU A 63 -27.978 5.772 27.912 1.00 0.00 H ATOM 947 HG LEU A 63 -29.517 4.759 25.526 1.00 0.00 H ATOM 948 HD21 LEU A 63 -30.247 4.632 28.462 1.00 0.00 H ATOM 949 HD22 LEU A 63 -31.078 5.571 27.197 1.00 0.00 H ATOM 950 HD23 LEU A 63 -31.098 3.791 27.142 1.00 0.00 H ATOM 951 HD11 LEU A 63 -27.588 3.366 26.138 1.00 0.00 H ATOM 952 HD12 LEU A 63 -28.137 3.326 27.831 1.00 0.00 H ATOM 953 HD13 LEU A 63 -29.106 2.536 26.563 1.00 0.00 H ATOM 954 H LEU A 63 -28.821 7.050 24.636 1.00 0.00 H ATOM 955 N GLU A 64 -27.040 8.758 26.886 1.00 38.30 N ATOM 956 CA GLU A 64 -26.180 9.769 27.483 1.00 42.88 C ATOM 957 C GLU A 64 -26.936 11.074 27.725 1.00 43.37 C ATOM 958 O GLU A 64 -27.015 11.523 28.866 1.00 42.30 O ATOM 959 CB GLU A 64 -24.934 10.012 26.628 1.00 43.59 C ATOM 960 CG GLU A 64 -23.955 8.851 26.683 1.00 45.13 C ATOM 961 CD GLU A 64 -23.253 8.752 28.020 1.00 47.17 C ATOM 962 OE1 GLU A 64 -22.313 9.529 28.252 1.00 48.68 O ATOM 963 OE2 GLU A 64 -23.634 7.900 28.847 1.00 50.33 O ATOM 964 HA GLU A 64 -25.855 9.388 28.451 1.00 0.00 H ATOM 965 HB2 GLU A 64 -25.243 10.160 25.593 1.00 0.00 H ATOM 966 HB3 GLU A 64 -24.432 10.910 26.988 1.00 0.00 H ATOM 967 HG2 GLU A 64 -24.500 7.924 26.504 1.00 0.00 H ATOM 968 HG3 GLU A 64 -23.206 8.987 25.903 1.00 0.00 H ATOM 969 H GLU A 64 -26.812 8.384 25.943 1.00 0.00 H ATOM 970 N HIS A 65 -27.511 11.652 26.668 1.00 43.45 N ATOM 971 CA HIS A 65 -28.107 12.992 26.743 1.00 44.77 C ATOM 972 C HIS A 65 -29.518 13.094 27.298 1.00 43.29 C ATOM 973 O HIS A 65 -29.907 14.165 27.738 1.00 44.58 O ATOM 974 CB HIS A 65 -28.100 13.666 25.379 1.00 45.77 C ATOM 975 CG HIS A 65 -26.734 13.933 24.862 1.00 50.88 C ATOM 976 ND1 HIS A 65 -26.417 13.826 23.528 1.00 54.17 N ATOM 977 CD2 HIS A 65 -25.592 14.282 25.497 1.00 53.38 C ATOM 978 CE1 HIS A 65 -25.139 14.111 23.359 1.00 53.40 C ATOM 979 NE2 HIS A 65 -24.614 14.386 24.539 1.00 53.78 N ATOM 980 HA HIS A 65 -27.463 13.492 27.467 1.00 0.00 H ATOM 981 HB2 HIS A 65 -28.618 13.019 24.671 1.00 0.00 H ATOM 982 HB3 HIS A 65 -28.631 14.614 25.459 1.00 0.00 H ATOM 983 HD2 HIS A 65 -25.471 14.449 26.567 1.00 0.00 H ATOM 984 HE1 HIS A 65 -24.608 14.118 22.407 1.00 0.00 H ATOM 985 H HIS A 65 -27.538 11.138 25.764 1.00 0.00 H ATOM 986 N CYS A 66 -30.293 12.019 27.260 1.00 43.67 N ATOM 987 CA CYS A 66 -31.672 12.076 27.730 1.00 41.92 C ATOM 988 C CYS A 66 -31.985 11.168 28.913 1.00 42.14 C ATOM 989 O CYS A 66 -33.061 11.279 29.492 1.00 42.51 O ATOM 990 CB CYS A 66 -32.628 11.798 26.570 1.00 39.67 C ATOM 991 SG CYS A 66 -32.558 13.063 25.286 1.00 42.58 S ATOM 992 HA CYS A 66 -31.815 13.088 28.108 1.00 0.00 H ATOM 993 HB2 CYS A 66 -33.645 11.753 26.960 1.00 0.00 H ATOM 994 HB3 CYS A 66 -32.368 10.837 26.127 1.00 0.00 H ATOM 995 HG CYS A 66 -33.445 12.743 24.278 1.00 0.00 H ATOM 996 H CYS A 66 -29.913 11.124 26.890 1.00 0.00 H ATOM 997 N LYS A 67 -31.068 10.270 29.267 1.00 40.78 N ATOM 998 CA LYS A 67 -31.232 9.419 30.445 1.00 43.48 C ATOM 999 C LYS A 67 -32.613 8.739 30.579 1.00 44.54 C ATOM 1000 O LYS A 67 -33.208 8.724 31.666 1.00 43.07 O ATOM 1001 CB LYS A 67 -30.912 10.228 31.714 1.00 45.62 C ATOM 1002 CG LYS A 67 -29.587 9.878 32.362 1.00 48.04 C ATOM 1003 CD LYS A 67 -28.400 10.279 31.502 1.00 48.81 C ATOM 1004 CE LYS A 67 -27.102 10.149 32.288 1.00 50.06 C ATOM 1005 NZ LYS A 67 -25.980 9.689 31.427 1.00 51.18 N ATOM 1006 HA LYS A 67 -30.527 8.598 30.315 1.00 0.00 H ATOM 1007 HB2 LYS A 67 -30.894 11.285 31.449 1.00 0.00 H ATOM 1008 HB3 LYS A 67 -31.705 10.051 32.441 1.00 0.00 H ATOM 1009 HG2 LYS A 67 -29.517 10.395 33.319 1.00 0.00 H ATOM 1010 HG3 LYS A 67 -29.552 8.801 32.529 1.00 0.00 H ATOM 1011 HD2 LYS A 67 -28.356 9.631 30.627 1.00 0.00 H ATOM 1012 HD3 LYS A 67 -28.523 11.313 31.181 1.00 0.00 H ATOM 1013 HE2 LYS A 67 -27.247 9.429 33.094 1.00 0.00 H ATOM 1014 HE3 LYS A 67 -26.847 11.120 32.712 1.00 0.00 H ATOM 1015 HZ1 LYS A 67 -26.213 8.759 31.023 1.00 0.00 H ATOM 1016 HZ2 LYS A 67 -25.831 10.374 30.659 1.00 0.00 H ATOM 1017 HZ3 LYS A 67 -25.115 9.613 31.999 1.00 0.00 H ATOM 1018 H LYS A 67 -30.209 10.171 28.689 1.00 0.00 H ATOM 1019 N PRO A 68 -33.100 8.116 29.492 1.00 42.94 N ATOM 1020 CA PRO A 68 -34.446 7.579 29.554 1.00 41.80 C ATOM 1021 C PRO A 68 -34.514 6.381 30.474 1.00 40.86 C ATOM 1022 O PRO A 68 -33.506 5.710 30.679 1.00 38.68 O ATOM 1023 CB PRO A 68 -34.716 7.159 28.109 1.00 44.12 C ATOM 1024 CG PRO A 68 -33.377 6.778 27.576 1.00 43.50 C ATOM 1025 CD PRO A 68 -32.347 7.562 28.349 1.00 44.22 C ATOM 1026 HA PRO A 68 -35.171 8.294 29.943 1.00 0.00 H ATOM 1027 HD3 PRO A 68 -31.543 6.911 28.693 1.00 0.00 H ATOM 1028 HD2 PRO A 68 -31.929 8.361 27.737 1.00 0.00 H ATOM 1029 HG3 PRO A 68 -33.314 7.023 26.516 1.00 0.00 H ATOM 1030 HG2 PRO A 68 -33.212 5.709 27.711 1.00 0.00 H ATOM 1031 HB2 PRO A 68 -35.400 6.311 28.075 1.00 0.00 H ATOM 1032 HB3 PRO A 68 -35.137 7.987 27.539 1.00 0.00 H ATOM 1033 N ASP A 69 -35.698 6.126 31.026 1.00 39.43 N ATOM 1034 CA ASP A 69 -35.917 5.010 31.941 1.00 37.14 C ATOM 1035 C ASP A 69 -36.038 3.696 31.195 1.00 35.49 C ATOM 1036 O ASP A 69 -35.689 2.649 31.719 1.00 34.80 O ATOM 1037 CB ASP A 69 -37.205 5.218 32.751 1.00 40.20 C ATOM 1038 CG ASP A 69 -37.202 6.507 33.552 1.00 41.45 C ATOM 1039 OD1 ASP A 69 -38.154 7.294 33.411 1.00 48.52 O ATOM 1040 OD2 ASP A 69 -36.241 6.748 34.306 1.00 41.61 O ATOM 1041 HA ASP A 69 -35.054 4.973 32.605 1.00 0.00 H ATOM 1042 HB2 ASP A 69 -38.049 5.239 32.062 1.00 0.00 H ATOM 1043 HB3 ASP A 69 -37.321 4.381 33.440 1.00 0.00 H ATOM 1044 H ASP A 69 -36.500 6.747 30.796 1.00 0.00 H ATOM 1045 N VAL A 70 -36.607 3.750 29.995 1.00 34.41 N ATOM 1046 CA VAL A 70 -36.758 2.568 29.144 1.00 34.22 C ATOM 1047 C VAL A 70 -36.604 3.009 27.702 1.00 29.78 C ATOM 1048 O VAL A 70 -36.647 4.203 27.406 1.00 27.92 O ATOM 1049 CB VAL A 70 -38.126 1.864 29.312 1.00 35.84 C ATOM 1050 CG1 VAL A 70 -38.320 1.400 30.747 1.00 38.00 C ATOM 1051 CG2 VAL A 70 -39.271 2.773 28.875 1.00 35.29 C ATOM 1052 HA VAL A 70 -35.996 1.846 29.438 1.00 0.00 H ATOM 1053 HB VAL A 70 -38.133 0.986 28.666 1.00 0.00 H ATOM 1054 HG11 VAL A 70 -37.528 0.699 31.011 1.00 0.00 H ATOM 1055 HG12 VAL A 70 -38.282 2.261 31.414 1.00 0.00 H ATOM 1056 HG13 VAL A 70 -39.288 0.908 30.841 1.00 0.00 H ATOM 1057 HG21 VAL A 70 -39.267 3.678 29.483 1.00 0.00 H ATOM 1058 HG22 VAL A 70 -39.142 3.039 27.826 1.00 0.00 H ATOM 1059 HG23 VAL A 70 -40.218 2.250 29.005 1.00 0.00 H ATOM 1060 H VAL A 70 -36.958 4.665 29.648 1.00 0.00 H ATOM 1061 N ILE A 71 -36.389 2.038 26.818 1.00 27.60 N ATOM 1062 CA ILE A 71 -36.279 2.300 25.384 1.00 27.84 C ATOM 1063 C ILE A 71 -37.198 1.358 24.625 1.00 24.24 C ATOM 1064 O ILE A 71 -37.232 0.152 24.877 1.00 23.70 O ATOM 1065 CB ILE A 71 -34.817 2.218 24.848 1.00 29.19 C ATOM 1066 CG1 ILE A 71 -34.043 3.459 25.308 1.00 31.29 C ATOM 1067 CG2 ILE A 71 -34.813 2.146 23.320 1.00 28.67 C ATOM 1068 CD1 ILE A 71 -32.694 3.690 24.651 1.00 33.77 C ATOM 1069 HA ILE A 71 -36.591 3.331 25.217 1.00 0.00 H ATOM 1070 HB ILE A 71 -34.342 1.319 25.240 1.00 0.00 H ATOM 1071 HG12 ILE A 71 -34.664 4.332 25.108 1.00 0.00 H ATOM 1072 HG13 ILE A 71 -33.879 3.370 26.382 1.00 0.00 H ATOM 1073 HD11 ILE A 71 -32.044 2.838 24.850 1.00 0.00 H ATOM 1074 HD12 ILE A 71 -32.830 3.801 23.575 1.00 0.00 H ATOM 1075 HD13 ILE A 71 -32.244 4.596 25.057 1.00 0.00 H ATOM 1076 HG21 ILE A 71 -35.360 1.260 22.998 1.00 0.00 H ATOM 1077 HG22 ILE A 71 -35.291 3.038 22.914 1.00 0.00 H ATOM 1078 HG23 ILE A 71 -33.785 2.089 22.963 1.00 0.00 H ATOM 1079 H ILE A 71 -36.296 1.060 27.159 1.00 0.00 H ATOM 1080 N ILE A 72 -37.980 1.951 23.733 1.00 24.46 N ATOM 1081 CA ILE A 72 -38.852 1.212 22.842 1.00 25.02 C ATOM 1082 C ILE A 72 -38.323 1.402 21.432 1.00 22.56 C ATOM 1083 O ILE A 72 -38.109 2.524 21.001 1.00 20.94 O ATOM 1084 CB ILE A 72 -40.311 1.728 22.874 1.00 26.90 C ATOM 1085 CG1 ILE A 72 -40.897 1.641 24.300 1.00 28.55 C ATOM 1086 CG2 ILE A 72 -41.155 0.914 21.909 1.00 26.33 C ATOM 1087 CD1 ILE A 72 -42.146 2.483 24.505 1.00 29.51 C ATOM 1088 HA ILE A 72 -38.860 0.169 23.158 1.00 0.00 H ATOM 1089 HB ILE A 72 -40.319 2.775 22.572 1.00 0.00 H ATOM 1090 HG12 ILE A 72 -41.147 0.600 24.506 1.00 0.00 H ATOM 1091 HG13 ILE A 72 -40.137 1.977 25.005 1.00 0.00 H ATOM 1092 HD11 ILE A 72 -41.912 3.530 24.315 1.00 0.00 H ATOM 1093 HD12 ILE A 72 -42.923 2.152 23.816 1.00 0.00 H ATOM 1094 HD13 ILE A 72 -42.496 2.368 25.531 1.00 0.00 H ATOM 1095 HG21 ILE A 72 -40.754 1.017 20.901 1.00 0.00 H ATOM 1096 HG22 ILE A 72 -41.133 -0.135 22.204 1.00 0.00 H ATOM 1097 HG23 ILE A 72 -42.182 1.277 21.931 1.00 0.00 H ATOM 1098 H ILE A 72 -37.967 2.989 23.670 1.00 0.00 H ATOM 1099 N ASN A 73 -38.122 0.304 20.712 1.00 22.01 N ATOM 1100 CA ASN A 73 -37.618 0.408 19.329 1.00 21.59 C ATOM 1101 C ASN A 73 -38.798 0.206 18.418 1.00 20.26 C ATOM 1102 O ASN A 73 -39.379 -0.878 18.392 1.00 21.49 O ATOM 1103 CB ASN A 73 -36.520 -0.630 19.051 1.00 21.66 C ATOM 1104 CG ASN A 73 -36.037 -0.640 17.593 1.00 21.71 C ATOM 1105 OD1 ASN A 73 -35.686 -1.703 17.059 1.00 21.21 O ATOM 1106 ND2 ASN A 73 -36.008 0.522 16.948 1.00 21.51 N ATOM 1107 HA ASN A 73 -37.162 1.384 19.162 1.00 0.00 H ATOM 1108 HB2 ASN A 73 -35.668 -0.412 19.695 1.00 0.00 H ATOM 1109 HB3 ASN A 73 -36.911 -1.619 19.291 1.00 0.00 H ATOM 1110 HD22 ASN A 73 -36.311 1.392 17.430 1.00 0.00 H ATOM 1111 HD21 ASN A 73 -35.683 0.561 15.961 1.00 0.00 H ATOM 1112 H ASN A 73 -38.320 -0.630 21.124 1.00 0.00 H ATOM 1113 N THR A 74 -39.140 1.253 17.671 1.00 20.25 N ATOM 1114 CA THR A 74 -40.304 1.257 16.793 1.00 21.38 C ATOM 1115 C THR A 74 -39.896 1.295 15.321 1.00 20.88 C ATOM 1116 O THR A 74 -38.767 1.655 14.990 1.00 21.94 O ATOM 1117 CB THR A 74 -41.239 2.463 17.064 1.00 22.74 C ATOM 1118 OG1 THR A 74 -42.433 2.312 16.288 1.00 27.88 O ATOM 1119 CG2 THR A 74 -40.622 3.777 16.689 1.00 23.27 C ATOM 1120 HA THR A 74 -40.838 0.332 17.008 1.00 0.00 H ATOM 1121 HB THR A 74 -41.440 2.471 18.135 1.00 0.00 H ATOM 1122 HG1 THR A 74 -42.199 2.280 15.327 1.00 0.00 H ATOM 1123 HG23 THR A 74 -39.707 3.925 17.263 1.00 0.00 H ATOM 1124 HG21 THR A 74 -40.388 3.776 15.624 1.00 0.00 H ATOM 1125 HG22 THR A 74 -41.324 4.582 16.908 1.00 0.00 H ATOM 1126 H THR A 74 -38.550 2.108 17.716 1.00 0.00 H ATOM 1127 N GLY A 75 -40.843 0.946 14.452 1.00 18.98 N ATOM 1128 CA GLY A 75 -40.632 1.010 13.031 1.00 17.17 C ATOM 1129 C GLY A 75 -41.155 -0.213 12.310 1.00 16.32 C ATOM 1130 O GLY A 75 -42.000 -0.938 12.828 1.00 16.36 O ATOM 1131 HA3 GLY A 75 -39.562 1.098 12.840 1.00 0.00 H ATOM 1132 HA2 GLY A 75 -41.143 1.891 12.641 1.00 0.00 H ATOM 1133 H GLY A 75 -41.762 0.618 14.812 1.00 0.00 H ATOM 1134 N SER A 76 -40.635 -0.415 11.106 1.00 14.77 N ATOM 1135 CA SER A 76 -41.056 -1.471 10.204 1.00 14.38 C ATOM 1136 C SER A 76 -40.222 -2.725 10.483 1.00 14.24 C ATOM 1137 O SER A 76 -39.272 -2.675 11.253 1.00 14.36 O ATOM 1138 CB SER A 76 -40.856 -1.007 8.757 1.00 14.12 C ATOM 1139 OG SER A 76 -39.500 -0.692 8.491 1.00 13.26 O ATOM 1140 HA SER A 76 -42.110 -1.702 10.357 1.00 0.00 H ATOM 1141 HB2 SER A 76 -41.466 -0.121 8.582 1.00 0.00 H ATOM 1142 HB3 SER A 76 -41.173 -1.803 8.083 1.00 0.00 H ATOM 1143 HG SER A 76 -39.207 0.035 9.096 1.00 0.00 H ATOM 1144 H SER A 76 -39.878 0.224 10.789 1.00 0.00 H ATOM 1145 N ALA A 77 -40.569 -3.843 9.855 1.00 14.29 N ATOM 1146 CA ALA A 77 -39.792 -5.080 9.981 1.00 13.93 C ATOM 1147 C ALA A 77 -40.230 -6.027 8.878 1.00 14.32 C ATOM 1148 O ALA A 77 -41.335 -5.877 8.343 1.00 13.85 O ATOM 1149 CB ALA A 77 -39.995 -5.722 11.361 1.00 14.94 C ATOM 1150 HA ALA A 77 -38.729 -4.858 9.884 1.00 0.00 H ATOM 1151 HB1 ALA A 77 -39.672 -5.026 12.135 1.00 0.00 H ATOM 1152 HB2 ALA A 77 -41.050 -5.957 11.499 1.00 0.00 H ATOM 1153 HB3 ALA A 77 -39.406 -6.637 11.425 1.00 0.00 H ATOM 1154 H ALA A 77 -41.419 -3.841 9.255 1.00 0.00 H ATOM 1155 N GLY A 78 -39.361 -6.978 8.528 1.00 13.91 N ATOM 1156 CA GLY A 78 -39.687 -8.034 7.583 1.00 15.11 C ATOM 1157 C GLY A 78 -40.220 -9.226 8.345 1.00 16.65 C ATOM 1158 O GLY A 78 -39.578 -9.709 9.272 1.00 15.98 O ATOM 1159 HA3 GLY A 78 -38.791 -8.322 7.032 1.00 0.00 H ATOM 1160 HA2 GLY A 78 -40.443 -7.679 6.883 1.00 0.00 H ATOM 1161 H GLY A 78 -38.410 -6.963 8.949 1.00 0.00 H ATOM 1162 N GLY A 79 -41.396 -9.712 7.957 1.00 18.05 N ATOM 1163 CA GLY A 79 -42.057 -10.784 8.662 1.00 18.22 C ATOM 1164 C GLY A 79 -41.514 -12.122 8.236 1.00 19.41 C ATOM 1165 O GLY A 79 -41.308 -12.355 7.047 1.00 20.82 O ATOM 1166 HA3 GLY A 79 -43.125 -10.747 8.448 1.00 0.00 H ATOM 1167 HA2 GLY A 79 -41.898 -10.659 9.733 1.00 0.00 H ATOM 1168 H GLY A 79 -41.855 -9.306 7.117 1.00 0.00 H ATOM 1169 N LEU A 80 -41.240 -12.996 9.201 1.00 19.54 N ATOM 1170 CA LEU A 80 -40.769 -14.343 8.890 1.00 20.95 C ATOM 1171 C LEU A 80 -41.813 -15.400 9.279 1.00 23.87 C ATOM 1172 O LEU A 80 -41.986 -16.368 8.557 1.00 25.49 O ATOM 1173 CB LEU A 80 -39.427 -14.639 9.580 1.00 20.91 C ATOM 1174 CG LEU A 80 -38.260 -13.712 9.220 1.00 20.20 C ATOM 1175 CD1 LEU A 80 -37.067 -13.928 10.132 1.00 20.54 C ATOM 1176 CD2 LEU A 80 -37.856 -13.874 7.772 1.00 21.40 C ATOM 1177 HA LEU A 80 -40.616 -14.392 7.812 1.00 0.00 H ATOM 1178 HB2 LEU A 80 -39.585 -14.572 10.656 1.00 0.00 H ATOM 1179 HB3 LEU A 80 -39.136 -15.657 9.319 1.00 0.00 H ATOM 1180 HG LEU A 80 -38.610 -12.690 9.366 1.00 0.00 H ATOM 1181 HD21 LEU A 80 -37.548 -14.905 7.595 1.00 0.00 H ATOM 1182 HD22 LEU A 80 -38.703 -13.631 7.130 1.00 0.00 H ATOM 1183 HD23 LEU A 80 -37.026 -13.203 7.550 1.00 0.00 H ATOM 1184 HD11 LEU A 80 -37.359 -13.728 11.163 1.00 0.00 H ATOM 1185 HD12 LEU A 80 -36.726 -14.959 10.043 1.00 0.00 H ATOM 1186 HD13 LEU A 80 -36.263 -13.252 9.843 1.00 0.00 H ATOM 1187 H LEU A 80 -41.363 -12.715 10.195 1.00 0.00 H ATOM 1188 N ALA A 81 -42.489 -15.233 10.408 1.00 26.73 N ATOM 1189 CA ALA A 81 -43.532 -16.181 10.811 1.00 30.33 C ATOM 1190 C ALA A 81 -44.729 -16.144 9.842 1.00 32.38 C ATOM 1191 O ALA A 81 -45.143 -15.078 9.400 1.00 30.51 O ATOM 1192 CB ALA A 81 -43.990 -15.897 12.225 1.00 30.08 C ATOM 1193 HA ALA A 81 -43.103 -17.182 10.775 1.00 0.00 H ATOM 1194 HB1 ALA A 81 -43.144 -15.991 12.905 1.00 0.00 H ATOM 1195 HB2 ALA A 81 -44.391 -14.885 12.279 1.00 0.00 H ATOM 1196 HB3 ALA A 81 -44.764 -16.611 12.505 1.00 0.00 H ATOM 1197 H ALA A 81 -42.276 -14.417 11.017 1.00 0.00 H ATOM 1198 N SER A 82 -45.290 -17.314 9.549 1.00 33.96 N ATOM 1199 CA SER A 82 -46.335 -17.468 8.532 1.00 35.50 C ATOM 1200 C SER A 82 -47.672 -16.768 8.838 1.00 37.12 C ATOM 1201 O SER A 82 -48.386 -16.393 7.910 1.00 40.94 O ATOM 1202 CB SER A 82 -46.595 -18.958 8.301 1.00 35.58 C ATOM 1203 OG SER A 82 -46.757 -19.620 9.544 1.00 35.66 O ATOM 1204 HA SER A 82 -45.945 -16.972 7.643 1.00 0.00 H ATOM 1205 HB2 SER A 82 -45.751 -19.394 7.767 1.00 0.00 H ATOM 1206 HB3 SER A 82 -47.501 -19.079 7.707 1.00 0.00 H ATOM 1207 HG SER A 82 -46.925 -20.583 9.385 1.00 0.00 H ATOM 1208 H SER A 82 -44.973 -18.159 10.065 1.00 0.00 H ATOM 1209 N THR A 83 -48.028 -16.601 10.110 1.00 38.76 N ATOM 1210 CA THR A 83 -49.278 -15.897 10.456 1.00 39.70 C ATOM 1211 C THR A 83 -49.260 -14.381 10.157 1.00 38.41 C ATOM 1212 O THR A 83 -50.313 -13.727 10.136 1.00 39.62 O ATOM 1213 CB THR A 83 -49.633 -16.068 11.945 1.00 44.03 C ATOM 1214 OG1 THR A 83 -48.579 -15.531 12.757 1.00 47.56 O ATOM 1215 CG2 THR A 83 -49.850 -17.547 12.285 1.00 44.71 C ATOM 1216 HA THR A 83 -50.025 -16.365 9.815 1.00 0.00 H ATOM 1217 HB THR A 83 -50.559 -15.529 12.146 1.00 0.00 H ATOM 1218 HG1 THR A 83 -48.811 -15.643 13.713 1.00 0.00 H ATOM 1219 HG23 THR A 83 -50.652 -17.947 11.664 1.00 0.00 H ATOM 1220 HG21 THR A 83 -48.931 -18.101 12.095 1.00 0.00 H ATOM 1221 HG22 THR A 83 -50.121 -17.641 13.336 1.00 0.00 H ATOM 1222 H THR A 83 -47.419 -16.971 10.868 1.00 0.00 H ATOM 1223 N LEU A 84 -48.073 -13.822 9.933 1.00 35.34 N ATOM 1224 CA LEU A 84 -47.916 -12.371 9.848 1.00 31.71 C ATOM 1225 C LEU A 84 -48.293 -11.803 8.487 1.00 30.60 C ATOM 1226 O LEU A 84 -47.879 -12.297 7.452 1.00 32.48 O ATOM 1227 CB LEU A 84 -46.472 -11.968 10.157 1.00 32.05 C ATOM 1228 CG LEU A 84 -46.002 -12.035 11.610 1.00 31.07 C ATOM 1229 CD1 LEU A 84 -44.497 -11.871 11.684 1.00 31.15 C ATOM 1230 CD2 LEU A 84 -46.667 -10.964 12.445 1.00 29.82 C ATOM 1231 HA LEU A 84 -48.602 -11.956 10.587 1.00 0.00 H ATOM 1232 HB2 LEU A 84 -45.822 -12.621 9.576 1.00 0.00 H ATOM 1233 HB3 LEU A 84 -46.344 -10.939 9.822 1.00 0.00 H ATOM 1234 HG LEU A 84 -46.281 -13.011 12.007 1.00 0.00 H ATOM 1235 HD21 LEU A 84 -46.417 -9.983 12.041 1.00 0.00 H ATOM 1236 HD22 LEU A 84 -47.748 -11.104 12.420 1.00 0.00 H ATOM 1237 HD23 LEU A 84 -46.314 -11.036 13.474 1.00 0.00 H ATOM 1238 HD11 LEU A 84 -44.018 -12.669 11.117 1.00 0.00 H ATOM 1239 HD12 LEU A 84 -44.217 -10.905 11.263 1.00 0.00 H ATOM 1240 HD13 LEU A 84 -44.178 -11.921 12.725 1.00 0.00 H ATOM 1241 H LEU A 84 -47.238 -14.431 9.816 1.00 0.00 H ATOM 1242 N LYS A 85 -49.062 -10.731 8.503 1.00 28.27 N ATOM 1243 CA LYS A 85 -49.333 -9.996 7.292 1.00 26.58 C ATOM 1244 C LYS A 85 -48.849 -8.573 7.458 1.00 24.22 C ATOM 1245 O LYS A 85 -48.582 -8.113 8.575 1.00 20.33 O ATOM 1246 CB LYS A 85 -50.811 -10.057 6.880 1.00 28.57 C ATOM 1247 CG LYS A 85 -51.841 -9.884 7.981 1.00 31.97 C ATOM 1248 CD LYS A 85 -53.052 -10.809 7.770 1.00 34.36 C ATOM 1249 CE LYS A 85 -53.837 -11.031 9.065 1.00 35.11 C ATOM 1250 NZ LYS A 85 -53.078 -11.887 10.017 1.00 35.46 N ATOM 1251 HA LYS A 85 -48.787 -10.466 6.474 1.00 0.00 H ATOM 1252 HB2 LYS A 85 -50.980 -9.271 6.144 1.00 0.00 H ATOM 1253 HB3 LYS A 85 -50.984 -11.029 6.417 1.00 0.00 H ATOM 1254 HG2 LYS A 85 -51.378 -10.119 8.940 1.00 0.00 H ATOM 1255 HG3 LYS A 85 -52.182 -8.849 7.988 1.00 0.00 H ATOM 1256 HD2 LYS A 85 -53.714 -10.359 7.030 1.00 0.00 H ATOM 1257 HD3 LYS A 85 -52.699 -11.773 7.402 1.00 0.00 H ATOM 1258 HE2 LYS A 85 -54.784 -11.516 8.828 1.00 0.00 H ATOM 1259 HE3 LYS A 85 -54.032 -10.066 9.532 1.00 0.00 H ATOM 1260 HZ1 LYS A 85 -52.893 -12.812 9.578 1.00 0.00 H ATOM 1261 HZ2 LYS A 85 -52.175 -11.427 10.251 1.00 0.00 H ATOM 1262 HZ3 LYS A 85 -53.637 -12.019 10.884 1.00 0.00 H ATOM 1263 H LYS A 85 -49.478 -10.412 9.401 1.00 0.00 H ATOM 1264 N VAL A 86 -48.768 -7.878 6.330 1.00 22.36 N ATOM 1265 CA VAL A 86 -48.367 -6.488 6.328 1.00 22.51 C ATOM 1266 C VAL A 86 -49.262 -5.711 7.290 1.00 22.03 C ATOM 1267 O VAL A 86 -50.470 -5.864 7.268 1.00 21.27 O ATOM 1268 CB VAL A 86 -48.471 -5.924 4.908 1.00 24.06 C ATOM 1269 CG1 VAL A 86 -48.216 -4.449 4.924 1.00 24.51 C ATOM 1270 CG2 VAL A 86 -47.467 -6.625 3.991 1.00 24.40 C ATOM 1271 HA VAL A 86 -47.332 -6.395 6.657 1.00 0.00 H ATOM 1272 HB VAL A 86 -49.477 -6.103 4.527 1.00 0.00 H ATOM 1273 HG11 VAL A 86 -48.955 -3.961 5.560 1.00 0.00 H ATOM 1274 HG12 VAL A 86 -47.216 -4.259 5.314 1.00 0.00 H ATOM 1275 HG13 VAL A 86 -48.292 -4.057 3.910 1.00 0.00 H ATOM 1276 HG21 VAL A 86 -46.457 -6.463 4.369 1.00 0.00 H ATOM 1277 HG22 VAL A 86 -47.681 -7.694 3.969 1.00 0.00 H ATOM 1278 HG23 VAL A 86 -47.550 -6.216 2.984 1.00 0.00 H ATOM 1279 H VAL A 86 -48.998 -8.343 5.428 1.00 0.00 H ATOM 1280 N GLY A 87 -48.673 -4.909 8.163 1.00 21.26 N ATOM 1281 CA GLY A 87 -49.433 -4.181 9.150 1.00 21.50 C ATOM 1282 C GLY A 87 -49.426 -4.790 10.526 1.00 21.78 C ATOM 1283 O GLY A 87 -49.523 -4.084 11.504 1.00 22.73 O ATOM 1284 HA3 GLY A 87 -50.467 -4.125 8.809 1.00 0.00 H ATOM 1285 HA2 GLY A 87 -49.020 -3.175 9.222 1.00 0.00 H ATOM 1286 H GLY A 87 -47.639 -4.801 8.137 1.00 0.00 H ATOM 1287 N ASP A 88 -49.309 -6.103 10.619 1.00 22.10 N ATOM 1288 CA ASP A 88 -49.257 -6.752 11.925 1.00 23.15 C ATOM 1289 C ASP A 88 -48.068 -6.339 12.808 1.00 22.65 C ATOM 1290 O ASP A 88 -47.009 -5.880 12.331 1.00 21.64 O ATOM 1291 CB ASP A 88 -49.248 -8.265 11.758 1.00 24.77 C ATOM 1292 CG ASP A 88 -50.541 -8.794 11.148 1.00 27.41 C ATOM 1293 OD1 ASP A 88 -51.512 -8.020 11.009 1.00 26.90 O ATOM 1294 OD2 ASP A 88 -50.561 -9.996 10.784 1.00 29.77 O ATOM 1295 HA ASP A 88 -50.154 -6.414 12.444 1.00 0.00 H ATOM 1296 HB2 ASP A 88 -48.417 -8.540 11.109 1.00 0.00 H ATOM 1297 HB3 ASP A 88 -49.110 -8.724 12.737 1.00 0.00 H ATOM 1298 H ASP A 88 -49.254 -6.678 9.754 1.00 0.00 H ATOM 1299 N ILE A 89 -48.241 -6.560 14.103 1.00 21.81 N ATOM 1300 CA ILE A 89 -47.255 -6.156 15.080 1.00 22.08 C ATOM 1301 C ILE A 89 -46.327 -7.319 15.406 1.00 21.89 C ATOM 1302 O ILE A 89 -46.754 -8.460 15.471 1.00 20.52 O ATOM 1303 CB ILE A 89 -47.944 -5.687 16.382 1.00 21.65 C ATOM 1304 CG1 ILE A 89 -48.938 -4.559 16.085 1.00 22.11 C ATOM 1305 CG2 ILE A 89 -46.934 -5.281 17.442 1.00 21.35 C ATOM 1306 CD1 ILE A 89 -48.374 -3.381 15.316 1.00 22.25 C ATOM 1307 HA ILE A 89 -46.678 -5.333 14.657 1.00 0.00 H ATOM 1308 HB ILE A 89 -48.501 -6.531 16.790 1.00 0.00 H ATOM 1309 HG12 ILE A 89 -49.759 -4.978 15.504 1.00 0.00 H ATOM 1310 HG13 ILE A 89 -49.320 -4.188 17.036 1.00 0.00 H ATOM 1311 HD11 ILE A 89 -47.560 -2.933 15.886 1.00 0.00 H ATOM 1312 HD12 ILE A 89 -47.999 -3.724 14.352 1.00 0.00 H ATOM 1313 HD13 ILE A 89 -49.159 -2.641 15.159 1.00 0.00 H ATOM 1314 HG21 ILE A 89 -46.296 -6.133 17.680 1.00 0.00 H ATOM 1315 HG22 ILE A 89 -46.322 -4.462 17.064 1.00 0.00 H ATOM 1316 HG23 ILE A 89 -47.461 -4.958 18.340 1.00 0.00 H ATOM 1317 H ILE A 89 -49.108 -7.036 14.425 1.00 0.00 H ATOM 1318 N VAL A 90 -45.055 -7.012 15.632 1.00 21.86 N ATOM 1319 CA VAL A 90 -44.139 -7.989 16.205 1.00 22.58 C ATOM 1320 C VAL A 90 -43.540 -7.383 17.468 1.00 24.01 C ATOM 1321 O VAL A 90 -43.270 -6.166 17.552 1.00 22.91 O ATOM 1322 CB VAL A 90 -43.049 -8.458 15.221 1.00 22.79 C ATOM 1323 CG1 VAL A 90 -43.675 -9.210 14.060 1.00 23.60 C ATOM 1324 CG2 VAL A 90 -42.214 -7.314 14.698 1.00 23.15 C ATOM 1325 HA VAL A 90 -44.697 -8.894 16.445 1.00 0.00 H ATOM 1326 HB VAL A 90 -42.385 -9.122 15.775 1.00 0.00 H ATOM 1327 HG11 VAL A 90 -44.211 -10.080 14.439 1.00 0.00 H ATOM 1328 HG12 VAL A 90 -44.370 -8.554 13.536 1.00 0.00 H ATOM 1329 HG13 VAL A 90 -42.892 -9.534 13.374 1.00 0.00 H ATOM 1330 HG21 VAL A 90 -42.857 -6.606 14.176 1.00 0.00 H ATOM 1331 HG22 VAL A 90 -41.722 -6.814 15.532 1.00 0.00 H ATOM 1332 HG23 VAL A 90 -41.462 -7.700 14.010 1.00 0.00 H ATOM 1333 H VAL A 90 -44.708 -6.060 15.397 1.00 0.00 H ATOM 1334 N VAL A 91 -43.400 -8.234 18.475 1.00 25.37 N ATOM 1335 CA VAL A 91 -42.846 -7.826 19.752 1.00 25.30 C ATOM 1336 C VAL A 91 -41.697 -8.768 20.111 1.00 24.40 C ATOM 1337 O VAL A 91 -41.818 -9.982 20.007 1.00 24.93 O ATOM 1338 CB VAL A 91 -43.915 -7.777 20.856 1.00 26.83 C ATOM 1339 CG1 VAL A 91 -43.281 -7.457 22.209 1.00 26.96 C ATOM 1340 CG2 VAL A 91 -44.958 -6.707 20.523 1.00 26.62 C ATOM 1341 HA VAL A 91 -42.464 -6.809 19.667 1.00 0.00 H ATOM 1342 HB VAL A 91 -44.393 -8.755 20.912 1.00 0.00 H ATOM 1343 HG11 VAL A 91 -42.552 -8.228 22.458 1.00 0.00 H ATOM 1344 HG12 VAL A 91 -42.784 -6.488 22.156 1.00 0.00 H ATOM 1345 HG13 VAL A 91 -44.057 -7.428 22.974 1.00 0.00 H ATOM 1346 HG21 VAL A 91 -44.470 -5.735 20.451 1.00 0.00 H ATOM 1347 HG22 VAL A 91 -45.433 -6.948 19.572 1.00 0.00 H ATOM 1348 HG23 VAL A 91 -45.712 -6.679 21.310 1.00 0.00 H ATOM 1349 H VAL A 91 -43.696 -9.223 18.346 1.00 0.00 H ATOM 1350 N SER A 92 -40.568 -8.186 20.503 1.00 23.42 N ATOM 1351 CA SER A 92 -39.390 -8.975 20.843 1.00 23.41 C ATOM 1352 C SER A 92 -39.556 -9.586 22.211 1.00 22.84 C ATOM 1353 O SER A 92 -39.879 -8.885 23.172 1.00 23.94 O ATOM 1354 CB SER A 92 -38.164 -8.072 20.915 1.00 21.62 C ATOM 1355 OG SER A 92 -38.387 -7.032 21.880 1.00 21.70 O ATOM 1356 HA SER A 92 -39.270 -9.745 20.080 1.00 0.00 H ATOM 1357 HB2 SER A 92 -37.983 -7.627 19.937 1.00 0.00 H ATOM 1358 HB3 SER A 92 -37.296 -8.661 21.211 1.00 0.00 H ATOM 1359 HG SER A 92 -38.550 -7.437 22.768 1.00 0.00 H ATOM 1360 H SER A 92 -40.524 -7.149 20.568 1.00 0.00 H ATOM 1361 N ASP A 93 -39.323 -10.876 22.314 1.00 26.06 N ATOM 1362 CA ASP A 93 -38.935 -11.404 23.605 1.00 28.83 C ATOM 1363 C ASP A 93 -37.422 -11.529 23.699 1.00 26.52 C ATOM 1364 O ASP A 93 -36.884 -11.604 24.796 1.00 25.75 O ATOM 1365 CB ASP A 93 -39.666 -12.695 23.982 1.00 32.58 C ATOM 1366 CG ASP A 93 -39.586 -13.750 22.940 1.00 35.71 C ATOM 1367 OD1 ASP A 93 -38.692 -13.669 22.076 1.00 36.69 O ATOM 1368 OD2 ASP A 93 -40.424 -14.691 23.008 1.00 39.01 O ATOM 1369 HA ASP A 93 -39.256 -10.682 24.356 1.00 0.00 H ATOM 1370 HB2 ASP A 93 -39.227 -13.084 24.901 1.00 0.00 H ATOM 1371 HB3 ASP A 93 -40.716 -12.459 24.154 1.00 0.00 H ATOM 1372 H ASP A 93 -39.415 -11.502 21.488 1.00 0.00 H ATOM 1373 N GLU A 94 -36.750 -11.514 22.546 1.00 25.03 N ATOM 1374 CA GLU A 94 -35.302 -11.643 22.470 1.00 25.44 C ATOM 1375 C GLU A 94 -34.824 -11.007 21.143 1.00 22.78 C ATOM 1376 O GLU A 94 -35.562 -11.004 20.140 1.00 21.31 O ATOM 1377 CB GLU A 94 -34.957 -13.129 22.507 1.00 27.55 C ATOM 1378 CG GLU A 94 -33.523 -13.486 22.815 1.00 31.77 C ATOM 1379 CD GLU A 94 -33.223 -14.949 22.492 1.00 35.70 C ATOM 1380 OE1 GLU A 94 -34.167 -15.749 22.334 1.00 40.53 O ATOM 1381 OE2 GLU A 94 -32.039 -15.317 22.366 1.00 42.34 O ATOM 1382 HA GLU A 94 -34.812 -11.138 23.302 1.00 0.00 H ATOM 1383 HB2 GLU A 94 -35.584 -13.595 23.267 1.00 0.00 H ATOM 1384 HB3 GLU A 94 -35.200 -13.549 21.531 1.00 0.00 H ATOM 1385 HG2 GLU A 94 -32.865 -12.851 22.222 1.00 0.00 H ATOM 1386 HG3 GLU A 94 -33.335 -13.312 23.875 1.00 0.00 H ATOM 1387 H GLU A 94 -37.285 -11.405 21.661 1.00 0.00 H ATOM 1388 N THR A 95 -33.609 -10.472 21.135 1.00 19.84 N ATOM 1389 CA THR A 95 -32.953 -10.100 19.883 1.00 18.43 C ATOM 1390 C THR A 95 -31.605 -10.808 19.709 1.00 17.26 C ATOM 1391 O THR A 95 -30.910 -11.053 20.688 1.00 16.30 O ATOM 1392 CB THR A 95 -32.790 -8.588 19.780 1.00 18.70 C ATOM 1393 OG1 THR A 95 -32.044 -8.092 20.900 1.00 19.16 O ATOM 1394 CG2 THR A 95 -34.147 -7.936 19.763 1.00 18.61 C ATOM 1395 HA THR A 95 -33.600 -10.431 19.071 1.00 0.00 H ATOM 1396 HB THR A 95 -32.254 -8.354 18.860 1.00 0.00 H ATOM 1397 HG1 THR A 95 -32.524 -8.310 21.738 1.00 0.00 H ATOM 1398 HG23 THR A 95 -34.718 -8.310 18.913 1.00 0.00 H ATOM 1399 HG21 THR A 95 -34.673 -8.172 20.688 1.00 0.00 H ATOM 1400 HG22 THR A 95 -34.029 -6.856 19.676 1.00 0.00 H ATOM 1401 H THR A 95 -33.115 -10.315 22.036 1.00 0.00 H ATOM 1402 N ARG A 96 -31.260 -11.146 18.463 1.00 16.22 N ATOM 1403 CA ARG A 96 -29.968 -11.726 18.112 1.00 16.17 C ATOM 1404 C ARG A 96 -29.476 -11.161 16.785 1.00 16.11 C ATOM 1405 O ARG A 96 -30.271 -10.810 15.900 1.00 16.39 O ATOM 1406 CB ARG A 96 -30.029 -13.266 17.969 1.00 17.01 C ATOM 1407 CG ARG A 96 -30.445 -14.011 19.227 1.00 17.86 C ATOM 1408 CD ARG A 96 -30.664 -15.495 18.962 1.00 19.33 C ATOM 1409 NE ARG A 96 -30.917 -16.170 20.234 1.00 22.01 N ATOM 1410 CZ ARG A 96 -30.106 -17.042 20.819 1.00 23.61 C ATOM 1411 NH1 ARG A 96 -28.974 -17.417 20.256 1.00 24.70 N ATOM 1412 NH2 ARG A 96 -30.459 -17.550 21.989 1.00 27.20 N ATOM 1413 HA ARG A 96 -29.290 -11.471 18.926 1.00 0.00 H ATOM 1414 HB2 ARG A 96 -30.744 -13.505 17.182 1.00 0.00 H ATOM 1415 HB3 ARG A 96 -29.039 -13.619 17.678 1.00 0.00 H ATOM 1416 HG2 ARG A 96 -29.663 -13.898 19.978 1.00 0.00 H ATOM 1417 HG3 ARG A 96 -31.373 -13.579 19.602 1.00 0.00 H ATOM 1418 HD2 ARG A 96 -29.776 -15.918 18.493 1.00 0.00 H ATOM 1419 HD3 ARG A 96 -31.520 -15.627 18.301 1.00 0.00 H ATOM 1420 HE ARG A 96 -31.808 -15.948 20.722 1.00 0.00 H ATOM 1421 HH12 ARG A 96 -28.356 -18.102 20.736 1.00 0.00 H ATOM 1422 HH11 ARG A 96 -28.699 -17.027 19.332 1.00 0.00 H ATOM 1423 HH22 ARG A 96 -29.839 -18.235 22.467 1.00 0.00 H ATOM 1424 HH21 ARG A 96 -31.356 -17.264 22.431 1.00 0.00 H ATOM 1425 H ARG A 96 -31.950 -10.987 17.702 1.00 0.00 H ATOM 1426 N TYR A 97 -28.166 -11.116 16.634 1.00 15.69 N ATOM 1427 CA TYR A 97 -27.558 -10.741 15.355 1.00 16.48 C ATOM 1428 C TYR A 97 -27.599 -11.939 14.446 1.00 17.60 C ATOM 1429 O TYR A 97 -27.111 -13.016 14.829 1.00 18.37 O ATOM 1430 CB TYR A 97 -26.094 -10.371 15.555 1.00 16.50 C ATOM 1431 CG TYR A 97 -25.853 -9.129 16.361 1.00 16.57 C ATOM 1432 CD1 TYR A 97 -25.146 -9.184 17.559 1.00 16.72 C ATOM 1433 CD2 TYR A 97 -26.287 -7.886 15.898 1.00 16.66 C ATOM 1434 CE1 TYR A 97 -24.885 -8.040 18.302 1.00 17.29 C ATOM 1435 CE2 TYR A 97 -26.040 -6.723 16.623 1.00 17.25 C ATOM 1436 CZ TYR A 97 -25.341 -6.796 17.822 1.00 17.81 C ATOM 1437 OH TYR A 97 -25.092 -5.652 18.545 1.00 17.82 O ATOM 1438 HA TYR A 97 -28.101 -9.894 14.936 1.00 0.00 H ATOM 1439 HB3 TYR A 97 -25.645 -10.228 14.572 1.00 0.00 H ATOM 1440 HB2 TYR A 97 -25.602 -11.202 16.060 1.00 0.00 H ATOM 1441 HD2 TYR A 97 -26.828 -7.825 14.954 1.00 0.00 H ATOM 1442 HE2 TYR A 97 -26.393 -5.761 16.252 1.00 0.00 H ATOM 1443 HE1 TYR A 97 -24.336 -8.103 19.242 1.00 0.00 H ATOM 1444 HD1 TYR A 97 -24.789 -10.148 17.922 1.00 0.00 H ATOM 1445 HH TYR A 97 -24.588 -5.884 19.365 1.00 0.00 H ATOM 1446 H TYR A 97 -27.552 -11.352 17.440 1.00 0.00 H ATOM 1447 N HIS A 98 -28.150 -11.801 13.244 1.00 16.70 N ATOM 1448 CA HIS A 98 -28.151 -12.961 12.343 1.00 16.89 C ATOM 1449 C HIS A 98 -26.891 -13.030 11.517 1.00 17.48 C ATOM 1450 O HIS A 98 -26.655 -14.034 10.845 1.00 18.46 O ATOM 1451 CB HIS A 98 -29.397 -13.024 11.447 1.00 15.39 C ATOM 1452 CG HIS A 98 -29.480 -11.936 10.425 1.00 14.20 C ATOM 1453 ND1 HIS A 98 -28.684 -11.895 9.305 1.00 14.11 N ATOM 1454 CD2 HIS A 98 -30.300 -10.853 10.343 1.00 13.41 C ATOM 1455 CE1 HIS A 98 -28.993 -10.825 8.584 1.00 13.96 C ATOM 1456 NE2 HIS A 98 -29.971 -10.180 9.193 1.00 12.46 N ATOM 1457 HA HIS A 98 -28.182 -13.838 12.989 1.00 0.00 H ATOM 1458 HB2 HIS A 98 -29.394 -13.982 10.926 1.00 0.00 H ATOM 1459 HB3 HIS A 98 -30.279 -12.961 12.084 1.00 0.00 H ATOM 1460 HD2 HIS A 98 -31.074 -10.572 11.057 1.00 0.00 H ATOM 1461 HE1 HIS A 98 -28.520 -10.529 7.648 1.00 0.00 H ATOM 1462 H HIS A 98 -28.569 -10.896 12.950 1.00 0.00 H ATOM 1463 N ASP A 99 -26.076 -11.972 11.551 1.00 18.81 N ATOM 1464 CA ASP A 99 -24.878 -11.911 10.716 1.00 19.66 C ATOM 1465 C ASP A 99 -23.572 -11.936 11.507 1.00 18.89 C ATOM 1466 O ASP A 99 -22.532 -11.625 10.970 1.00 21.07 O ATOM 1467 CB ASP A 99 -24.931 -10.699 9.767 1.00 20.09 C ATOM 1468 CG ASP A 99 -25.105 -9.351 10.496 1.00 21.06 C ATOM 1469 OD1 ASP A 99 -25.228 -9.320 11.753 1.00 19.74 O ATOM 1470 OD2 ASP A 99 -25.089 -8.313 9.772 1.00 22.10 O ATOM 1471 HA ASP A 99 -24.879 -12.825 10.122 1.00 0.00 H ATOM 1472 HB2 ASP A 99 -24.002 -10.666 9.198 1.00 0.00 H ATOM 1473 HB3 ASP A 99 -25.770 -10.832 9.084 1.00 0.00 H ATOM 1474 H ASP A 99 -26.298 -11.177 12.183 1.00 0.00 H ATOM 1475 N ALA A 100 -23.608 -12.321 12.768 1.00 17.35 N ATOM 1476 CA ALA A 100 -22.398 -12.312 13.574 1.00 18.06 C ATOM 1477 C ALA A 100 -21.819 -13.734 13.636 1.00 18.17 C ATOM 1478 O ALA A 100 -22.552 -14.678 13.892 1.00 19.73 O ATOM 1479 CB ALA A 100 -22.701 -11.783 14.964 1.00 17.61 C ATOM 1480 HA ALA A 100 -21.658 -11.653 13.120 1.00 0.00 H ATOM 1481 HB1 ALA A 100 -23.089 -10.767 14.888 1.00 0.00 H ATOM 1482 HB2 ALA A 100 -23.444 -12.422 15.441 1.00 0.00 H ATOM 1483 HB3 ALA A 100 -21.787 -11.781 15.558 1.00 0.00 H ATOM 1484 H ALA A 100 -24.507 -12.633 13.188 1.00 0.00 H ATOM 1485 N ASP A 101 -20.531 -13.879 13.369 1.00 18.96 N ATOM 1486 CA ASP A 101 -19.916 -15.221 13.304 1.00 19.70 C ATOM 1487 C ASP A 101 -18.478 -15.254 13.803 1.00 18.81 C ATOM 1488 O ASP A 101 -17.533 -14.991 13.067 1.00 18.83 O ATOM 1489 CB ASP A 101 -20.023 -15.814 11.894 1.00 20.65 C ATOM 1490 CG ASP A 101 -19.508 -17.277 11.812 1.00 21.46 C ATOM 1491 OD1 ASP A 101 -19.558 -17.835 10.691 1.00 23.73 O ATOM 1492 OD2 ASP A 101 -19.064 -17.856 12.841 1.00 19.82 O ATOM 1493 HA ASP A 101 -20.489 -15.846 13.989 1.00 0.00 H ATOM 1494 HB2 ASP A 101 -21.069 -15.796 11.587 1.00 0.00 H ATOM 1495 HB3 ASP A 101 -19.435 -15.199 11.212 1.00 0.00 H ATOM 1496 H ASP A 101 -19.944 -13.037 13.203 1.00 0.00 H ATOM 1497 N VAL A 102 -18.334 -15.575 15.080 1.00 20.02 N ATOM 1498 CA VAL A 102 -17.019 -15.868 15.658 1.00 20.89 C ATOM 1499 C VAL A 102 -17.034 -17.312 16.153 1.00 21.96 C ATOM 1500 O VAL A 102 -16.453 -17.647 17.186 1.00 23.11 O ATOM 1501 CB VAL A 102 -16.624 -14.884 16.780 1.00 20.85 C ATOM 1502 CG1 VAL A 102 -16.379 -13.493 16.203 1.00 20.67 C ATOM 1503 CG2 VAL A 102 -17.678 -14.837 17.879 1.00 20.50 C ATOM 1504 HA VAL A 102 -16.257 -15.741 14.889 1.00 0.00 H ATOM 1505 HB VAL A 102 -15.699 -15.243 17.231 1.00 0.00 H ATOM 1506 HG11 VAL A 102 -15.573 -13.541 15.471 1.00 0.00 H ATOM 1507 HG12 VAL A 102 -17.289 -13.136 15.720 1.00 0.00 H ATOM 1508 HG13 VAL A 102 -16.101 -12.811 17.007 1.00 0.00 H ATOM 1509 HG21 VAL A 102 -18.629 -14.514 17.455 1.00 0.00 H ATOM 1510 HG22 VAL A 102 -17.792 -15.830 18.314 1.00 0.00 H ATOM 1511 HG23 VAL A 102 -17.365 -14.134 18.651 1.00 0.00 H ATOM 1512 H VAL A 102 -19.176 -15.620 15.689 1.00 0.00 H ATOM 1513 N THR A 103 -17.698 -18.176 15.378 1.00 24.45 N ATOM 1514 CA THR A 103 -17.809 -19.601 15.716 1.00 24.93 C ATOM 1515 C THR A 103 -16.455 -20.325 15.701 1.00 26.89 C ATOM 1516 O THR A 103 -16.282 -21.324 16.402 1.00 27.74 O ATOM 1517 CB THR A 103 -18.809 -20.348 14.799 1.00 24.31 C ATOM 1518 OG1 THR A 103 -18.422 -20.221 13.422 1.00 22.70 O ATOM 1519 CG2 THR A 103 -20.221 -19.818 15.016 1.00 23.43 C ATOM 1520 HA THR A 103 -18.191 -19.621 16.737 1.00 0.00 H ATOM 1521 HB THR A 103 -18.796 -21.407 15.058 1.00 0.00 H ATOM 1522 HG1 THR A 103 -18.409 -19.263 13.171 1.00 0.00 H ATOM 1523 HG23 THR A 103 -20.491 -19.925 16.067 1.00 0.00 H ATOM 1524 HG21 THR A 103 -20.260 -18.765 14.735 1.00 0.00 H ATOM 1525 HG22 THR A 103 -20.919 -20.385 14.401 1.00 0.00 H ATOM 1526 H THR A 103 -18.150 -17.828 14.508 1.00 0.00 H ATOM 1527 N ALA A 104 -15.491 -19.807 14.939 1.00 28.27 N ATOM 1528 CA ALA A 104 -14.144 -20.368 14.943 1.00 29.01 C ATOM 1529 C ALA A 104 -13.512 -20.384 16.349 1.00 29.96 C ATOM 1530 O ALA A 104 -12.544 -21.090 16.575 1.00 29.66 O ATOM 1531 CB ALA A 104 -13.254 -19.629 13.954 1.00 30.27 C ATOM 1532 HA ALA A 104 -14.231 -21.408 14.629 1.00 0.00 H ATOM 1533 HB1 ALA A 104 -13.673 -19.720 12.952 1.00 0.00 H ATOM 1534 HB2 ALA A 104 -13.200 -18.576 14.232 1.00 0.00 H ATOM 1535 HB3 ALA A 104 -12.254 -20.063 13.972 1.00 0.00 H ATOM 1536 H ALA A 104 -15.703 -18.990 14.332 1.00 0.00 H ATOM 1537 N PHE A 105 -14.059 -19.610 17.290 1.00 28.87 N ATOM 1538 CA PHE A 105 -13.591 -19.611 18.678 1.00 27.10 C ATOM 1539 C PHE A 105 -14.600 -20.226 19.630 1.00 26.11 C ATOM 1540 O PHE A 105 -14.492 -20.074 20.840 1.00 25.48 O ATOM 1541 CB PHE A 105 -13.232 -18.181 19.107 1.00 25.31 C ATOM 1542 CG PHE A 105 -12.062 -17.615 18.358 1.00 24.50 C ATOM 1543 CD1 PHE A 105 -12.247 -16.745 17.296 1.00 24.44 C ATOM 1544 CD2 PHE A 105 -10.777 -17.977 18.693 1.00 25.33 C ATOM 1545 CE1 PHE A 105 -11.174 -16.236 16.604 1.00 23.60 C ATOM 1546 CE2 PHE A 105 -9.688 -17.478 17.995 1.00 24.43 C ATOM 1547 CZ PHE A 105 -9.885 -16.607 16.952 1.00 24.52 C ATOM 1548 HA PHE A 105 -12.700 -20.236 18.726 1.00 0.00 H ATOM 1549 HB2 PHE A 105 -14.097 -17.540 18.935 1.00 0.00 H ATOM 1550 HB3 PHE A 105 -12.992 -18.188 20.170 1.00 0.00 H ATOM 1551 HD2 PHE A 105 -10.613 -18.667 19.521 1.00 0.00 H ATOM 1552 HE2 PHE A 105 -8.677 -17.777 18.274 1.00 0.00 H ATOM 1553 HZ PHE A 105 -9.033 -16.210 16.401 1.00 0.00 H ATOM 1554 HE1 PHE A 105 -11.337 -15.540 15.781 1.00 0.00 H ATOM 1555 HD1 PHE A 105 -13.258 -16.460 17.005 1.00 0.00 H ATOM 1556 H PHE A 105 -14.846 -18.983 17.028 1.00 0.00 H ATOM 1557 N GLY A 106 -15.576 -20.932 19.079 1.00 26.57 N ATOM 1558 CA GLY A 106 -16.505 -21.692 19.887 1.00 27.84 C ATOM 1559 C GLY A 106 -17.652 -20.870 20.428 1.00 28.47 C ATOM 1560 O GLY A 106 -18.350 -21.294 21.333 1.00 26.77 O ATOM 1561 HA3 GLY A 106 -15.960 -22.119 20.729 1.00 0.00 H ATOM 1562 HA2 GLY A 106 -16.915 -22.496 19.276 1.00 0.00 H ATOM 1563 H GLY A 106 -15.677 -20.940 18.044 1.00 0.00 H ATOM 1564 N TYR A 107 -17.861 -19.683 19.877 1.00 26.01 N ATOM 1565 CA TYR A 107 -19.065 -18.960 20.229 1.00 27.09 C ATOM 1566 C TYR A 107 -20.224 -19.563 19.461 1.00 25.26 C ATOM 1567 O TYR A 107 -20.040 -20.239 18.460 1.00 24.35 O ATOM 1568 CB TYR A 107 -18.902 -17.487 19.921 1.00 25.60 C ATOM 1569 CG TYR A 107 -17.962 -16.863 20.897 1.00 25.52 C ATOM 1570 CD1 TYR A 107 -18.429 -16.420 22.120 1.00 25.46 C ATOM 1571 CD2 TYR A 107 -16.603 -16.740 20.621 1.00 25.61 C ATOM 1572 CE1 TYR A 107 -17.585 -15.860 23.037 1.00 25.99 C ATOM 1573 CE2 TYR A 107 -15.744 -16.187 21.551 1.00 26.25 C ATOM 1574 CZ TYR A 107 -16.252 -15.745 22.746 1.00 25.62 C ATOM 1575 OH TYR A 107 -15.462 -15.172 23.687 1.00 27.81 O ATOM 1576 HA TYR A 107 -19.261 -19.045 21.298 1.00 0.00 H ATOM 1577 HB3 TYR A 107 -19.872 -16.994 19.988 1.00 0.00 H ATOM 1578 HB2 TYR A 107 -18.506 -17.370 18.912 1.00 0.00 H ATOM 1579 HD2 TYR A 107 -16.213 -17.083 19.663 1.00 0.00 H ATOM 1580 HE2 TYR A 107 -14.678 -16.103 21.338 1.00 0.00 H ATOM 1581 HE1 TYR A 107 -17.970 -15.507 23.994 1.00 0.00 H ATOM 1582 HD1 TYR A 107 -19.488 -16.519 22.357 1.00 0.00 H ATOM 1583 HH TYR A 107 -16.012 -14.923 24.471 1.00 0.00 H ATOM 1584 H TYR A 107 -17.176 -19.280 19.207 1.00 0.00 H ATOM 1585 N GLU A 108 -21.413 -19.322 19.962 1.00 25.45 N ATOM 1586 CA GLU A 108 -22.626 -19.743 19.281 1.00 26.91 C ATOM 1587 C GLU A 108 -22.778 -18.837 18.067 1.00 24.97 C ATOM 1588 O GLU A 108 -22.324 -17.683 18.098 1.00 24.59 O ATOM 1589 CB GLU A 108 -23.783 -19.593 20.251 1.00 27.95 C ATOM 1590 CG GLU A 108 -25.122 -20.074 19.772 1.00 30.18 C ATOM 1591 CD GLU A 108 -26.127 -20.126 20.912 1.00 31.92 C ATOM 1592 OE1 GLU A 108 -27.343 -20.020 20.648 1.00 32.42 O ATOM 1593 OE2 GLU A 108 -25.688 -20.249 22.075 1.00 34.18 O ATOM 1594 HA GLU A 108 -22.597 -20.782 18.953 1.00 0.00 H ATOM 1595 HB2 GLU A 108 -23.534 -20.150 21.154 1.00 0.00 H ATOM 1596 HB3 GLU A 108 -23.878 -18.535 20.493 1.00 0.00 H ATOM 1597 HG2 GLU A 108 -25.490 -19.394 19.003 1.00 0.00 H ATOM 1598 HG3 GLU A 108 -25.011 -21.073 19.349 1.00 0.00 H ATOM 1599 H GLU A 108 -21.489 -18.818 20.868 1.00 0.00 H ATOM 1600 N TYR A 109 -23.351 -19.365 16.989 1.00 23.70 N ATOM 1601 CA TYR A 109 -23.633 -18.547 15.828 1.00 22.17 C ATOM 1602 C TYR A 109 -24.500 -17.372 16.296 1.00 20.72 C ATOM 1603 O TYR A 109 -25.449 -17.557 17.069 1.00 19.94 O ATOM 1604 CB TYR A 109 -24.330 -19.314 14.703 1.00 23.07 C ATOM 1605 CG TYR A 109 -24.320 -18.501 13.444 1.00 23.14 C ATOM 1606 CD1 TYR A 109 -25.333 -17.586 13.186 1.00 22.96 C ATOM 1607 CD2 TYR A 109 -23.246 -18.567 12.558 1.00 24.16 C ATOM 1608 CE1 TYR A 109 -25.302 -16.789 12.058 1.00 24.47 C ATOM 1609 CE2 TYR A 109 -23.202 -17.768 11.420 1.00 26.44 C ATOM 1610 CZ TYR A 109 -24.237 -16.874 11.178 1.00 26.96 C ATOM 1611 OH TYR A 109 -24.215 -16.069 10.055 1.00 30.81 O ATOM 1612 HA TYR A 109 -22.689 -18.204 15.404 1.00 0.00 H ATOM 1613 HB3 TYR A 109 -25.361 -19.520 14.991 1.00 0.00 H ATOM 1614 HB2 TYR A 109 -23.807 -20.255 14.530 1.00 0.00 H ATOM 1615 HD2 TYR A 109 -22.426 -19.257 12.760 1.00 0.00 H ATOM 1616 HE2 TYR A 109 -22.365 -17.843 10.726 1.00 0.00 H ATOM 1617 HE1 TYR A 109 -26.117 -16.093 11.861 1.00 0.00 H ATOM 1618 HD1 TYR A 109 -26.165 -17.496 13.884 1.00 0.00 H ATOM 1619 HH TYR A 109 -25.025 -15.499 10.043 1.00 0.00 H ATOM 1620 H TYR A 109 -23.599 -20.375 16.980 1.00 0.00 H ATOM 1621 N GLY A 110 -24.158 -16.166 15.839 1.00 19.62 N ATOM 1622 CA GLY A 110 -24.905 -14.959 16.215 1.00 18.66 C ATOM 1623 C GLY A 110 -24.284 -14.227 17.399 1.00 18.91 C ATOM 1624 O GLY A 110 -24.578 -13.064 17.637 1.00 16.97 O ATOM 1625 HA3 GLY A 110 -25.923 -15.246 16.478 1.00 0.00 H ATOM 1626 HA2 GLY A 110 -24.929 -14.283 15.360 1.00 0.00 H ATOM 1627 H GLY A 110 -23.342 -16.079 15.200 1.00 0.00 H ATOM 1628 N GLN A 111 -23.436 -14.907 18.154 1.00 19.10 N ATOM 1629 CA GLN A 111 -22.946 -14.349 19.406 1.00 19.73 C ATOM 1630 C GLN A 111 -21.637 -13.659 19.179 1.00 19.30 C ATOM 1631 O GLN A 111 -20.764 -14.189 18.496 1.00 18.49 O ATOM 1632 CB GLN A 111 -22.726 -15.445 20.445 1.00 20.11 C ATOM 1633 CG GLN A 111 -22.296 -14.936 21.818 1.00 20.88 C ATOM 1634 CD GLN A 111 -22.106 -16.077 22.796 1.00 21.50 C ATOM 1635 OE1 GLN A 111 -22.011 -17.246 22.384 1.00 22.39 O ATOM 1636 NE2 GLN A 111 -22.053 -15.760 24.078 1.00 21.76 N ATOM 1637 HA GLN A 111 -23.695 -13.645 19.769 1.00 0.00 H ATOM 1638 HB2 GLN A 111 -23.659 -15.996 20.562 1.00 0.00 H ATOM 1639 HB3 GLN A 111 -21.953 -16.117 20.073 1.00 0.00 H ATOM 1640 HG2 GLN A 111 -21.355 -14.395 21.717 1.00 0.00 H ATOM 1641 HG3 GLN A 111 -23.062 -14.263 22.203 1.00 0.00 H ATOM 1642 HE22 GLN A 111 -22.138 -14.766 24.372 1.00 0.00 H ATOM 1643 HE21 GLN A 111 -21.927 -16.505 24.793 1.00 0.00 H ATOM 1644 H GLN A 111 -23.117 -15.849 17.850 1.00 0.00 H ATOM 1645 N LEU A 112 -21.488 -12.486 19.784 1.00 18.28 N ATOM 1646 CA LEU A 112 -20.210 -11.787 19.756 1.00 18.57 C ATOM 1647 C LEU A 112 -19.481 -11.964 21.093 1.00 19.31 C ATOM 1648 O LEU A 112 -20.098 -12.026 22.136 1.00 18.06 O ATOM 1649 CB LEU A 112 -20.384 -10.303 19.426 1.00 18.24 C ATOM 1650 CG LEU A 112 -20.547 -9.948 17.939 1.00 18.63 C ATOM 1651 CD1 LEU A 112 -20.764 -8.457 17.740 1.00 18.58 C ATOM 1652 CD2 LEU A 112 -19.343 -10.409 17.119 1.00 18.26 C ATOM 1653 HA LEU A 112 -19.605 -12.227 18.963 1.00 0.00 H ATOM 1654 HB2 LEU A 112 -21.271 -9.948 19.951 1.00 0.00 H ATOM 1655 HB3 LEU A 112 -19.506 -9.775 19.799 1.00 0.00 H ATOM 1656 HG LEU A 112 -21.432 -10.477 17.586 1.00 0.00 H ATOM 1657 HD21 LEU A 112 -18.442 -9.923 17.494 1.00 0.00 H ATOM 1658 HD22 LEU A 112 -19.238 -11.490 17.207 1.00 0.00 H ATOM 1659 HD23 LEU A 112 -19.493 -10.141 16.073 1.00 0.00 H ATOM 1660 HD11 LEU A 112 -21.666 -8.149 18.269 1.00 0.00 H ATOM 1661 HD12 LEU A 112 -19.906 -7.911 18.133 1.00 0.00 H ATOM 1662 HD13 LEU A 112 -20.875 -8.246 16.676 1.00 0.00 H ATOM 1663 H LEU A 112 -22.294 -12.061 20.284 1.00 0.00 H ATOM 1664 N PRO A 113 -18.142 -12.038 21.054 1.00 20.33 N ATOM 1665 CA PRO A 113 -17.422 -12.216 22.315 1.00 20.60 C ATOM 1666 C PRO A 113 -17.724 -11.089 23.298 1.00 21.46 C ATOM 1667 O PRO A 113 -17.854 -9.928 22.914 1.00 23.98 O ATOM 1668 CB PRO A 113 -15.949 -12.245 21.887 1.00 20.69 C ATOM 1669 CG PRO A 113 -15.972 -12.618 20.446 1.00 20.95 C ATOM 1670 CD PRO A 113 -17.234 -12.020 19.895 1.00 21.56 C ATOM 1671 HA PRO A 113 -17.712 -13.121 22.849 1.00 0.00 H ATOM 1672 HD3 PRO A 113 -17.065 -11.002 19.545 1.00 0.00 H ATOM 1673 HD2 PRO A 113 -17.629 -12.623 19.078 1.00 0.00 H ATOM 1674 HG3 PRO A 113 -15.983 -13.702 20.333 1.00 0.00 H ATOM 1675 HG2 PRO A 113 -15.101 -12.210 19.933 1.00 0.00 H ATOM 1676 HB2 PRO A 113 -15.491 -11.265 22.022 1.00 0.00 H ATOM 1677 HB3 PRO A 113 -15.396 -12.985 22.466 1.00 0.00 H ATOM 1678 N GLY A 114 -17.927 -11.444 24.552 1.00 21.02 N ATOM 1679 CA GLY A 114 -18.294 -10.468 25.558 1.00 20.50 C ATOM 1680 C GLY A 114 -19.775 -10.173 25.619 1.00 20.88 C ATOM 1681 O GLY A 114 -20.197 -9.352 26.416 1.00 23.81 O ATOM 1682 HA3 GLY A 114 -17.768 -9.538 25.342 1.00 0.00 H ATOM 1683 HA2 GLY A 114 -17.979 -10.844 26.531 1.00 0.00 H ATOM 1684 H GLY A 114 -17.822 -12.442 24.824 1.00 0.00 H ATOM 1685 N CYS A 115 -20.580 -10.851 24.799 1.00 20.63 N ATOM 1686 CA CYS A 115 -22.016 -10.657 24.790 1.00 20.74 C ATOM 1687 C CYS A 115 -22.735 -11.974 25.066 1.00 19.05 C ATOM 1688 O CYS A 115 -22.218 -13.048 24.801 1.00 18.62 O ATOM 1689 CB CYS A 115 -22.483 -10.183 23.406 1.00 22.93 C ATOM 1690 SG CYS A 115 -22.016 -8.498 22.961 1.00 23.95 S ATOM 1691 HA CYS A 115 -22.248 -9.918 25.557 1.00 0.00 H ATOM 1692 HB2 CYS A 115 -23.571 -10.248 23.378 1.00 0.00 H ATOM 1693 HB3 CYS A 115 -22.061 -10.856 22.660 1.00 0.00 H ATOM 1694 HG CYS A 115 -20.640 -8.387 22.967 1.00 0.00 H ATOM 1695 H CYS A 115 -20.163 -11.542 24.144 1.00 0.00 H ATOM 1696 N PRO A 116 -23.970 -11.888 25.528 1.00 18.84 N ATOM 1697 CA PRO A 116 -24.785 -13.083 25.521 1.00 18.29 C ATOM 1698 C PRO A 116 -25.151 -13.460 24.066 1.00 19.97 C ATOM 1699 O PRO A 116 -25.001 -12.632 23.137 1.00 16.87 O ATOM 1700 CB PRO A 116 -26.002 -12.656 26.332 1.00 18.43 C ATOM 1701 CG PRO A 116 -26.132 -11.198 26.071 1.00 18.57 C ATOM 1702 CD PRO A 116 -24.724 -10.700 25.976 1.00 18.71 C ATOM 1703 HA PRO A 116 -24.301 -13.968 25.935 1.00 0.00 H ATOM 1704 HD3 PRO A 116 -24.644 -9.891 25.250 1.00 0.00 H ATOM 1705 HD2 PRO A 116 -24.366 -10.353 26.946 1.00 0.00 H ATOM 1706 HG3 PRO A 116 -26.659 -10.707 26.889 1.00 0.00 H ATOM 1707 HG2 PRO A 116 -26.666 -11.021 25.138 1.00 0.00 H ATOM 1708 HB2 PRO A 116 -26.893 -13.188 25.999 1.00 0.00 H ATOM 1709 HB3 PRO A 116 -25.843 -12.845 27.394 1.00 0.00 H ATOM 1710 N ALA A 117 -25.587 -14.703 23.857 1.00 20.22 N ATOM 1711 CA ALA A 117 -25.930 -15.167 22.511 1.00 21.49 C ATOM 1712 C ALA A 117 -27.107 -14.362 21.941 1.00 21.83 C ATOM 1713 O ALA A 117 -27.228 -14.205 20.733 1.00 22.91 O ATOM 1714 CB ALA A 117 -26.265 -16.645 22.521 1.00 21.00 C ATOM 1715 HA ALA A 117 -25.061 -15.012 21.871 1.00 0.00 H ATOM 1716 HB1 ALA A 117 -25.404 -17.209 22.879 1.00 0.00 H ATOM 1717 HB2 ALA A 117 -27.115 -16.819 23.181 1.00 0.00 H ATOM 1718 HB3 ALA A 117 -26.516 -16.966 21.510 1.00 0.00 H ATOM 1719 H ALA A 117 -25.685 -15.353 24.663 1.00 0.00 H ATOM 1720 N GLY A 118 -27.958 -13.875 22.839 1.00 21.20 N ATOM 1721 CA GLY A 118 -29.118 -13.098 22.490 1.00 21.87 C ATOM 1722 C GLY A 118 -29.427 -12.246 23.669 1.00 21.19 C ATOM 1723 O GLY A 118 -28.971 -12.538 24.767 1.00 22.44 O ATOM 1724 HA3 GLY A 118 -29.959 -13.755 22.269 1.00 0.00 H ATOM 1725 HA2 GLY A 118 -28.907 -12.476 21.620 1.00 0.00 H ATOM 1726 H GLY A 118 -27.776 -14.065 23.845 1.00 0.00 H ATOM 1727 N PHE A 119 -30.172 -11.187 23.446 1.00 19.38 N ATOM 1728 CA PHE A 119 -30.496 -10.233 24.480 1.00 20.97 C ATOM 1729 C PHE A 119 -31.973 -10.328 24.798 1.00 21.45 C ATOM 1730 O PHE A 119 -32.804 -10.124 23.915 1.00 20.89 O ATOM 1731 CB PHE A 119 -30.196 -8.810 24.004 1.00 20.65 C ATOM 1732 CG PHE A 119 -28.761 -8.567 23.716 1.00 21.18 C ATOM 1733 CD1 PHE A 119 -27.874 -8.264 24.744 1.00 21.91 C ATOM 1734 CD2 PHE A 119 -28.278 -8.661 22.424 1.00 22.35 C ATOM 1735 CE1 PHE A 119 -26.533 -8.042 24.477 1.00 23.17 C ATOM 1736 CE2 PHE A 119 -26.934 -8.447 22.149 1.00 23.37 C ATOM 1737 CZ PHE A 119 -26.057 -8.138 23.186 1.00 23.33 C ATOM 1738 HA PHE A 119 -29.896 -10.456 25.363 1.00 0.00 H ATOM 1739 HB2 PHE A 119 -30.766 -8.624 23.094 1.00 0.00 H ATOM 1740 HB3 PHE A 119 -30.514 -8.113 24.779 1.00 0.00 H ATOM 1741 HD2 PHE A 119 -28.961 -8.906 21.611 1.00 0.00 H ATOM 1742 HE2 PHE A 119 -26.567 -8.521 21.125 1.00 0.00 H ATOM 1743 HZ PHE A 119 -25.000 -7.973 22.978 1.00 0.00 H ATOM 1744 HE1 PHE A 119 -25.852 -7.791 25.290 1.00 0.00 H ATOM 1745 HD1 PHE A 119 -28.238 -8.201 25.770 1.00 0.00 H ATOM 1746 H PHE A 119 -30.543 -11.030 22.487 1.00 0.00 H ATOM 1747 N LYS A 120 -32.302 -10.582 26.059 1.00 23.25 N ATOM 1748 CA LYS A 120 -33.709 -10.668 26.524 1.00 23.40 C ATOM 1749 C LYS A 120 -34.378 -9.306 26.659 1.00 23.22 C ATOM 1750 O LYS A 120 -33.871 -8.406 27.321 1.00 23.39 O ATOM 1751 CB LYS A 120 -33.783 -11.419 27.869 1.00 25.31 C ATOM 1752 CG LYS A 120 -35.172 -11.933 28.239 1.00 26.00 C ATOM 1753 CD LYS A 120 -35.109 -12.879 29.427 1.00 26.74 C ATOM 1754 CE LYS A 120 -36.351 -13.755 29.516 1.00 27.17 C ATOM 1755 NZ LYS A 120 -37.582 -12.936 29.622 1.00 27.26 N ATOM 1756 HA LYS A 120 -34.254 -11.219 25.758 1.00 0.00 H ATOM 1757 HB2 LYS A 120 -33.107 -12.273 27.819 1.00 0.00 H ATOM 1758 HB3 LYS A 120 -33.451 -10.741 28.655 1.00 0.00 H ATOM 1759 HG2 LYS A 120 -35.809 -11.086 28.492 1.00 0.00 H ATOM 1760 HG3 LYS A 120 -35.595 -12.462 27.385 1.00 0.00 H ATOM 1761 HD2 LYS A 120 -34.232 -13.518 29.324 1.00 0.00 H ATOM 1762 HD3 LYS A 120 -35.024 -12.293 30.342 1.00 0.00 H ATOM 1763 HE2 LYS A 120 -36.273 -14.394 30.395 1.00 0.00 H ATOM 1764 HE3 LYS A 120 -36.413 -14.375 28.622 1.00 0.00 H ATOM 1765 HZ1 LYS A 120 -37.531 -12.345 30.476 1.00 0.00 H ATOM 1766 HZ2 LYS A 120 -37.665 -12.327 28.783 1.00 0.00 H ATOM 1767 HZ3 LYS A 120 -38.410 -13.563 29.681 1.00 0.00 H ATOM 1768 H LYS A 120 -31.540 -10.727 26.752 1.00 0.00 H ATOM 1769 N ALA A 121 -35.539 -9.150 26.027 1.00 22.70 N ATOM 1770 CA ALA A 121 -36.318 -7.947 26.173 1.00 24.55 C ATOM 1771 C ALA A 121 -37.032 -7.964 27.537 1.00 25.21 C ATOM 1772 O ALA A 121 -37.257 -9.011 28.103 1.00 26.62 O ATOM 1773 CB ALA A 121 -37.318 -7.818 25.032 1.00 24.92 C ATOM 1774 HA ALA A 121 -35.658 -7.080 26.133 1.00 0.00 H ATOM 1775 HB1 ALA A 121 -36.782 -7.781 24.083 1.00 0.00 H ATOM 1776 HB2 ALA A 121 -37.988 -8.678 25.039 1.00 0.00 H ATOM 1777 HB3 ALA A 121 -37.897 -6.903 25.160 1.00 0.00 H ATOM 1778 H ALA A 121 -35.891 -9.913 25.415 1.00 0.00 H ATOM 1779 N ASP A 122 -37.348 -6.787 28.050 1.00 27.34 N ATOM 1780 CA ASP A 122 -37.893 -6.634 29.383 1.00 29.97 C ATOM 1781 C ASP A 122 -39.302 -7.245 29.477 1.00 32.07 C ATOM 1782 O ASP A 122 -40.205 -6.846 28.739 1.00 30.56 O ATOM 1783 CB ASP A 122 -37.958 -5.152 29.723 1.00 31.91 C ATOM 1784 CG ASP A 122 -38.420 -4.896 31.145 1.00 35.59 C ATOM 1785 OD1 ASP A 122 -37.593 -5.075 32.065 1.00 36.66 O ATOM 1786 OD2 ASP A 122 -39.597 -4.504 31.343 1.00 35.83 O ATOM 1787 HA ASP A 122 -37.247 -7.157 30.089 1.00 0.00 H ATOM 1788 HB2 ASP A 122 -36.965 -4.721 29.596 1.00 0.00 H ATOM 1789 HB3 ASP A 122 -38.653 -4.667 29.038 1.00 0.00 H ATOM 1790 H ASP A 122 -37.199 -5.935 27.472 1.00 0.00 H ATOM 1791 N ASP A 123 -39.483 -8.180 30.406 1.00 33.58 N ATOM 1792 CA ASP A 123 -40.793 -8.796 30.667 1.00 34.91 C ATOM 1793 C ASP A 123 -41.946 -7.843 31.017 1.00 34.96 C ATOM 1794 O ASP A 123 -43.075 -8.127 30.656 1.00 36.14 O ATOM 1795 CB ASP A 123 -40.657 -9.862 31.742 1.00 38.19 C ATOM 1796 CG ASP A 123 -39.914 -11.085 31.245 1.00 40.52 C ATOM 1797 OD1 ASP A 123 -39.929 -11.336 30.023 1.00 43.18 O ATOM 1798 OD2 ASP A 123 -39.304 -11.801 32.068 1.00 46.22 O ATOM 1799 HA ASP A 123 -41.084 -9.224 29.708 1.00 0.00 H ATOM 1800 HB2 ASP A 123 -40.114 -9.441 32.588 1.00 0.00 H ATOM 1801 HB3 ASP A 123 -41.653 -10.164 32.066 1.00 0.00 H ATOM 1802 H ASP A 123 -38.665 -8.488 30.970 1.00 0.00 H ATOM 1803 N LYS A 124 -41.682 -6.731 31.696 1.00 33.85 N ATOM 1804 CA LYS A 124 -42.736 -5.759 31.994 1.00 36.48 C ATOM 1805 C LYS A 124 -43.116 -4.994 30.746 1.00 36.65 C ATOM 1806 O LYS A 124 -44.295 -4.739 30.497 1.00 35.96 O ATOM 1807 CB LYS A 124 -42.313 -4.736 33.043 1.00 37.19 C ATOM 1808 CG LYS A 124 -42.272 -5.236 34.466 1.00 40.56 C ATOM 1809 CD LYS A 124 -41.811 -4.099 35.372 1.00 42.91 C ATOM 1810 CE LYS A 124 -41.349 -4.590 36.736 1.00 43.90 C ATOM 1811 NZ LYS A 124 -40.923 -3.432 37.575 1.00 44.19 N ATOM 1812 HA LYS A 124 -43.577 -6.337 32.378 1.00 0.00 H ATOM 1813 HB2 LYS A 124 -41.315 -4.383 32.783 1.00 0.00 H ATOM 1814 HB3 LYS A 124 -43.015 -3.903 33.001 1.00 0.00 H ATOM 1815 HG2 LYS A 124 -43.266 -5.566 34.768 1.00 0.00 H ATOM 1816 HG3 LYS A 124 -41.575 -6.071 34.542 1.00 0.00 H ATOM 1817 HD2 LYS A 124 -40.983 -3.580 34.888 1.00 0.00 H ATOM 1818 HD3 LYS A 124 -42.640 -3.406 35.512 1.00 0.00 H ATOM 1819 HE2 LYS A 124 -40.509 -5.273 36.609 1.00 0.00 H ATOM 1820 HE3 LYS A 124 -42.169 -5.112 37.229 1.00 0.00 H ATOM 1821 HZ1 LYS A 124 -40.140 -2.935 37.105 1.00 0.00 H ATOM 1822 HZ2 LYS A 124 -41.725 -2.781 37.698 1.00 0.00 H ATOM 1823 HZ3 LYS A 124 -40.609 -3.776 38.505 1.00 0.00 H ATOM 1824 H LYS A 124 -40.711 -6.548 32.021 1.00 0.00 H ATOM 1825 N LEU A 125 -42.114 -4.570 29.985 1.00 33.80 N ATOM 1826 CA LEU A 125 -42.393 -3.916 28.715 1.00 32.88 C ATOM 1827 C LEU A 125 -43.154 -4.854 27.773 1.00 31.66 C ATOM 1828 O LEU A 125 -44.053 -4.402 27.067 1.00 32.47 O ATOM 1829 CB LEU A 125 -41.103 -3.387 28.066 1.00 33.13 C ATOM 1830 CG LEU A 125 -40.381 -2.267 28.816 1.00 34.52 C ATOM 1831 CD1 LEU A 125 -39.199 -1.729 28.018 1.00 34.42 C ATOM 1832 CD2 LEU A 125 -41.327 -1.131 29.180 1.00 35.60 C ATOM 1833 HA LEU A 125 -43.033 -3.056 28.912 1.00 0.00 H ATOM 1834 HB2 LEU A 125 -40.411 -4.224 27.970 1.00 0.00 H ATOM 1835 HB3 LEU A 125 -41.358 -3.013 27.074 1.00 0.00 H ATOM 1836 HG LEU A 125 -40.002 -2.704 29.740 1.00 0.00 H ATOM 1837 HD21 LEU A 125 -41.758 -0.713 28.270 1.00 0.00 H ATOM 1838 HD22 LEU A 125 -42.124 -1.514 29.818 1.00 0.00 H ATOM 1839 HD23 LEU A 125 -40.775 -0.356 29.711 1.00 0.00 H ATOM 1840 HD11 LEU A 125 -38.489 -2.535 27.835 1.00 0.00 H ATOM 1841 HD12 LEU A 125 -39.554 -1.333 27.067 1.00 0.00 H ATOM 1842 HD13 LEU A 125 -38.712 -0.935 28.584 1.00 0.00 H ATOM 1843 H LEU A 125 -41.131 -4.705 30.296 1.00 0.00 H ATOM 1844 N ILE A 126 -42.828 -6.148 27.772 1.00 30.76 N ATOM 1845 CA ILE A 126 -43.517 -7.098 26.889 1.00 31.59 C ATOM 1846 C ILE A 126 -44.965 -7.297 27.330 1.00 35.15 C ATOM 1847 O ILE A 126 -45.870 -7.399 26.486 1.00 33.71 O ATOM 1848 CB ILE A 126 -42.821 -8.458 26.841 1.00 31.92 C ATOM 1849 CG1 ILE A 126 -41.465 -8.340 26.142 1.00 32.08 C ATOM 1850 CG2 ILE A 126 -43.667 -9.497 26.119 1.00 32.97 C ATOM 1851 CD1 ILE A 126 -40.553 -9.515 26.408 1.00 32.05 C ATOM 1852 HA ILE A 126 -43.489 -6.664 25.890 1.00 0.00 H ATOM 1853 HB ILE A 126 -42.678 -8.783 27.871 1.00 0.00 H ATOM 1854 HG12 ILE A 126 -41.634 -8.269 25.068 1.00 0.00 H ATOM 1855 HG13 ILE A 126 -40.972 -7.433 26.492 1.00 0.00 H ATOM 1856 HD11 ILE A 126 -40.366 -9.593 27.479 1.00 0.00 H ATOM 1857 HD12 ILE A 126 -41.028 -10.430 26.053 1.00 0.00 H ATOM 1858 HD13 ILE A 126 -39.609 -9.367 25.883 1.00 0.00 H ATOM 1859 HG21 ILE A 126 -44.617 -9.615 26.639 1.00 0.00 H ATOM 1860 HG22 ILE A 126 -43.850 -9.168 25.096 1.00 0.00 H ATOM 1861 HG23 ILE A 126 -43.137 -10.450 26.106 1.00 0.00 H ATOM 1862 H ILE A 126 -42.076 -6.488 28.405 1.00 0.00 H ATOM 1863 N ALA A 127 -45.178 -7.358 28.647 1.00 33.26 N ATOM 1864 CA ALA A 127 -46.519 -7.493 29.200 1.00 33.43 C ATOM 1865 C ALA A 127 -47.355 -6.295 28.792 1.00 32.17 C ATOM 1866 O ALA A 127 -48.453 -6.459 28.265 1.00 34.64 O ATOM 1867 CB ALA A 127 -46.468 -7.616 30.718 1.00 33.61 C ATOM 1868 HA ALA A 127 -46.975 -8.401 28.806 1.00 0.00 H ATOM 1869 HB1 ALA A 127 -45.884 -8.495 30.991 1.00 0.00 H ATOM 1870 HB2 ALA A 127 -46.002 -6.725 31.138 1.00 0.00 H ATOM 1871 HB3 ALA A 127 -47.481 -7.716 31.107 1.00 0.00 H ATOM 1872 H ALA A 127 -44.366 -7.308 29.294 1.00 0.00 H ATOM 1873 N ALA A 128 -46.821 -5.098 29.006 1.00 30.18 N ATOM 1874 CA ALA A 128 -47.498 -3.878 28.629 1.00 31.42 C ATOM 1875 C ALA A 128 -47.896 -3.892 27.158 1.00 33.39 C ATOM 1876 O ALA A 128 -49.022 -3.526 26.818 1.00 30.22 O ATOM 1877 CB ALA A 128 -46.637 -2.677 28.925 1.00 32.10 C ATOM 1878 HA ALA A 128 -48.409 -3.812 29.224 1.00 0.00 H ATOM 1879 HB1 ALA A 128 -46.417 -2.643 29.992 1.00 0.00 H ATOM 1880 HB2 ALA A 128 -45.706 -2.752 28.363 1.00 0.00 H ATOM 1881 HB3 ALA A 128 -47.167 -1.771 28.633 1.00 0.00 H ATOM 1882 H ALA A 128 -45.887 -5.037 29.459 1.00 0.00 H ATOM 1883 N ALA A 129 -46.980 -4.326 26.288 1.00 33.56 N ATOM 1884 CA ALA A 129 -47.232 -4.298 24.845 1.00 32.10 C ATOM 1885 C ALA A 129 -48.296 -5.318 24.435 1.00 32.22 C ATOM 1886 O ALA A 129 -49.055 -5.099 23.485 1.00 29.65 O ATOM 1887 CB ALA A 129 -45.937 -4.514 24.063 1.00 30.35 C ATOM 1888 HA ALA A 129 -47.619 -3.309 24.600 1.00 0.00 H ATOM 1889 HB1 ALA A 129 -45.228 -3.724 24.312 1.00 0.00 H ATOM 1890 HB2 ALA A 129 -45.512 -5.482 24.327 1.00 0.00 H ATOM 1891 HB3 ALA A 129 -46.151 -4.489 22.994 1.00 0.00 H ATOM 1892 H ALA A 129 -46.072 -4.690 26.641 1.00 0.00 H ATOM 1893 N GLU A 130 -48.354 -6.429 25.146 1.00 32.01 N ATOM 1894 CA GLU A 130 -49.355 -7.439 24.849 1.00 35.94 C ATOM 1895 C GLU A 130 -50.757 -6.988 25.256 1.00 36.47 C ATOM 1896 O GLU A 130 -51.724 -7.287 24.560 1.00 36.03 O ATOM 1897 CB GLU A 130 -48.976 -8.778 25.475 1.00 37.97 C ATOM 1898 CG GLU A 130 -47.887 -9.450 24.668 1.00 39.98 C ATOM 1899 CD GLU A 130 -47.426 -10.767 25.240 1.00 43.01 C ATOM 1900 OE1 GLU A 130 -47.368 -10.905 26.482 1.00 46.40 O ATOM 1901 OE2 GLU A 130 -47.084 -11.657 24.434 1.00 47.67 O ATOM 1902 HA GLU A 130 -49.379 -7.578 23.768 1.00 0.00 H ATOM 1903 HB2 GLU A 130 -48.619 -8.611 26.491 1.00 0.00 H ATOM 1904 HB3 GLU A 130 -49.854 -9.424 25.501 1.00 0.00 H ATOM 1905 HG2 GLU A 130 -48.265 -9.627 23.661 1.00 0.00 H ATOM 1906 HG3 GLU A 130 -47.030 -8.778 24.620 1.00 0.00 H ATOM 1907 H GLU A 130 -47.680 -6.582 25.923 1.00 0.00 H ATOM 1908 N SER A 131 -50.848 -6.254 26.360 1.00 37.52 N ATOM 1909 CA SER A 131 -52.083 -5.582 26.753 1.00 38.63 C ATOM 1910 C SER A 131 -52.521 -4.510 25.771 1.00 38.68 C ATOM 1911 O SER A 131 -53.725 -4.296 25.580 1.00 36.77 O ATOM 1912 CB SER A 131 -51.918 -4.935 28.124 1.00 39.42 C ATOM 1913 OG SER A 131 -51.711 -5.936 29.093 1.00 42.22 O ATOM 1914 HA SER A 131 -52.851 -6.355 26.773 1.00 0.00 H ATOM 1915 HB2 SER A 131 -52.817 -4.371 28.370 1.00 0.00 H ATOM 1916 HB3 SER A 131 -51.061 -4.262 28.108 1.00 0.00 H ATOM 1917 HG SER A 131 -50.894 -6.447 28.868 1.00 0.00 H ATOM 1918 H SER A 131 -50.009 -6.155 26.966 1.00 0.00 H ATOM 1919 N CYS A 132 -51.558 -3.815 25.174 1.00 37.30 N ATOM 1920 CA CYS A 132 -51.878 -2.805 24.169 1.00 36.09 C ATOM 1921 C CYS A 132 -52.419 -3.475 22.914 1.00 32.67 C ATOM 1922 O CYS A 132 -53.327 -2.961 22.262 1.00 32.30 O ATOM 1923 CB CYS A 132 -50.657 -1.956 23.842 1.00 36.65 C ATOM 1924 SG CYS A 132 -50.197 -0.896 25.209 1.00 37.98 S ATOM 1925 HA CYS A 132 -52.644 -2.144 24.573 1.00 0.00 H ATOM 1926 HB2 CYS A 132 -50.881 -1.336 22.974 1.00 0.00 H ATOM 1927 HB3 CYS A 132 -49.821 -2.615 23.610 1.00 0.00 H ATOM 1928 HG CYS A 132 -49.903 -1.672 26.312 1.00 0.00 H ATOM 1929 H CYS A 132 -50.565 -3.993 25.426 1.00 0.00 H ATOM 1930 N ILE A 133 -51.859 -4.629 22.601 1.00 31.05 N ATOM 1931 CA ILE A 133 -52.311 -5.444 21.470 1.00 30.88 C ATOM 1932 C ILE A 133 -53.741 -5.970 21.684 1.00 32.76 C ATOM 1933 O ILE A 133 -54.542 -6.048 20.742 1.00 28.62 O ATOM 1934 CB ILE A 133 -51.327 -6.609 21.242 1.00 28.42 C ATOM 1935 CG1 ILE A 133 -50.058 -6.083 20.525 1.00 29.75 C ATOM 1936 CG2 ILE A 133 -51.964 -7.736 20.460 1.00 27.82 C ATOM 1937 CD1 ILE A 133 -48.825 -6.962 20.675 1.00 29.40 C ATOM 1938 HA ILE A 133 -52.331 -4.813 20.581 1.00 0.00 H ATOM 1939 HB ILE A 133 -51.046 -7.017 22.213 1.00 0.00 H ATOM 1940 HG12 ILE A 133 -50.282 -5.993 19.462 1.00 0.00 H ATOM 1941 HG13 ILE A 133 -49.824 -5.099 20.930 1.00 0.00 H ATOM 1942 HD11 ILE A 133 -48.572 -7.054 21.731 1.00 0.00 H ATOM 1943 HD12 ILE A 133 -49.032 -7.949 20.262 1.00 0.00 H ATOM 1944 HD13 ILE A 133 -47.991 -6.510 20.139 1.00 0.00 H ATOM 1945 HG21 ILE A 133 -52.825 -8.117 21.010 1.00 0.00 H ATOM 1946 HG22 ILE A 133 -52.287 -7.364 19.488 1.00 0.00 H ATOM 1947 HG23 ILE A 133 -51.237 -8.536 20.321 1.00 0.00 H ATOM 1948 H ILE A 133 -51.066 -4.973 23.180 1.00 0.00 H ATOM 1949 N ARG A 134 -54.063 -6.344 22.919 1.00 35.26 N ATOM 1950 CA ARG A 134 -55.434 -6.804 23.223 1.00 36.95 C ATOM 1951 C ARG A 134 -56.442 -5.641 23.215 1.00 35.22 C ATOM 1952 O ARG A 134 -57.508 -5.778 22.645 1.00 35.09 O ATOM 1953 CB ARG A 134 -55.475 -7.599 24.534 1.00 39.97 C ATOM 1954 CG ARG A 134 -54.887 -9.002 24.386 1.00 42.54 C ATOM 1955 CD ARG A 134 -55.103 -9.854 25.628 1.00 45.22 C ATOM 1956 NE ARG A 134 -54.400 -9.298 26.781 1.00 47.31 N ATOM 1957 CZ ARG A 134 -53.142 -9.575 27.130 1.00 50.68 C ATOM 1958 NH1 ARG A 134 -52.402 -10.433 26.430 1.00 51.29 N ATOM 1959 NH2 ARG A 134 -52.619 -8.986 28.202 1.00 51.11 N ATOM 1960 HA ARG A 134 -55.738 -7.483 22.426 1.00 0.00 H ATOM 1961 HB2 ARG A 134 -54.904 -7.058 25.289 1.00 0.00 H ATOM 1962 HB3 ARG A 134 -56.512 -7.687 24.858 1.00 0.00 H ATOM 1963 HG2 ARG A 134 -55.362 -9.493 23.537 1.00 0.00 H ATOM 1964 HG3 ARG A 134 -53.816 -8.916 24.202 1.00 0.00 H ATOM 1965 HD2 ARG A 134 -54.732 -10.861 25.437 1.00 0.00 H ATOM 1966 HD3 ARG A 134 -56.170 -9.897 25.849 1.00 0.00 H ATOM 1967 HE ARG A 134 -54.924 -8.630 27.381 1.00 0.00 H ATOM 1968 HH12 ARG A 134 -51.424 -10.634 26.721 1.00 0.00 H ATOM 1969 HH11 ARG A 134 -52.802 -10.902 25.593 1.00 0.00 H ATOM 1970 HH22 ARG A 134 -51.640 -9.194 28.484 1.00 0.00 H ATOM 1971 HH21 ARG A 134 -53.189 -8.318 28.758 1.00 0.00 H ATOM 1972 H ARG A 134 -53.348 -6.313 23.673 1.00 0.00 H ATOM 1973 N GLU A 135 -56.080 -4.497 23.799 1.00 35.06 N ATOM 1974 CA GLU A 135 -56.928 -3.298 23.792 1.00 36.58 C ATOM 1975 C GLU A 135 -57.286 -2.850 22.382 1.00 36.57 C ATOM 1976 O GLU A 135 -58.438 -2.561 22.088 1.00 33.39 O ATOM 1977 CB GLU A 135 -56.239 -2.131 24.495 1.00 39.99 C ATOM 1978 CG GLU A 135 -56.294 -2.166 26.013 1.00 43.99 C ATOM 1979 CD GLU A 135 -55.616 -0.959 26.656 1.00 50.61 C ATOM 1980 OE1 GLU A 135 -55.535 -0.933 27.902 1.00 55.46 O ATOM 1981 OE2 GLU A 135 -55.159 -0.034 25.938 1.00 54.90 O ATOM 1982 HA GLU A 135 -57.839 -3.576 24.321 1.00 0.00 H ATOM 1983 HB2 GLU A 135 -55.191 -2.128 24.195 1.00 0.00 H ATOM 1984 HB3 GLU A 135 -56.714 -1.208 24.161 1.00 0.00 H ATOM 1985 HG2 GLU A 135 -57.339 -2.186 26.324 1.00 0.00 H ATOM 1986 HG3 GLU A 135 -55.796 -3.072 26.359 1.00 0.00 H ATOM 1987 H GLU A 135 -55.159 -4.453 24.279 1.00 0.00 H ATOM 1988 N LEU A 136 -56.276 -2.782 21.523 1.00 34.54 N ATOM 1989 CA LEU A 136 -56.438 -2.346 20.143 1.00 34.28 C ATOM 1990 C LEU A 136 -56.885 -3.477 19.230 1.00 32.07 C ATOM 1991 O LEU A 136 -57.183 -3.243 18.062 1.00 33.56 O ATOM 1992 CB LEU A 136 -55.118 -1.777 19.633 1.00 33.06 C ATOM 1993 CG LEU A 136 -54.635 -0.571 20.424 1.00 33.65 C ATOM 1994 CD1 LEU A 136 -53.180 -0.264 20.090 1.00 32.62 C ATOM 1995 CD2 LEU A 136 -55.537 0.626 20.162 1.00 33.46 C ATOM 1996 HA LEU A 136 -57.216 -1.583 20.128 1.00 0.00 H ATOM 1997 HB2 LEU A 136 -54.359 -2.557 19.693 1.00 0.00 H ATOM 1998 HB3 LEU A 136 -55.249 -1.479 18.593 1.00 0.00 H ATOM 1999 HG LEU A 136 -54.687 -0.799 21.489 1.00 0.00 H ATOM 2000 HD21 LEU A 136 -55.520 0.866 19.099 1.00 0.00 H ATOM 2001 HD22 LEU A 136 -56.556 0.385 20.465 1.00 0.00 H ATOM 2002 HD23 LEU A 136 -55.179 1.481 20.735 1.00 0.00 H ATOM 2003 HD11 LEU A 136 -52.561 -1.125 20.342 1.00 0.00 H ATOM 2004 HD12 LEU A 136 -53.090 -0.050 19.025 1.00 0.00 H ATOM 2005 HD13 LEU A 136 -52.851 0.602 20.665 1.00 0.00 H ATOM 2006 H LEU A 136 -55.327 -3.052 21.850 1.00 0.00 H ATOM 2007 N ASN A 137 -56.930 -4.693 19.761 1.00 30.80 N ATOM 2008 CA ASN A 137 -57.301 -5.879 19.000 1.00 31.26 C ATOM 2009 C ASN A 137 -56.494 -6.070 17.701 1.00 30.70 C ATOM 2010 O ASN A 137 -57.042 -6.377 16.639 1.00 28.52 O ATOM 2011 CB ASN A 137 -58.810 -5.883 18.710 1.00 33.00 C ATOM 2012 CG ASN A 137 -59.303 -7.244 18.257 1.00 34.83 C ATOM 2013 OD1 ASN A 137 -58.838 -8.275 18.739 1.00 36.20 O ATOM 2014 ND2 ASN A 137 -60.236 -7.257 17.316 1.00 36.22 N ATOM 2015 HA ASN A 137 -57.048 -6.731 19.631 1.00 0.00 H ATOM 2016 HB2 ASN A 137 -59.343 -5.601 19.618 1.00 0.00 H ATOM 2017 HB3 ASN A 137 -59.019 -5.155 17.926 1.00 0.00 H ATOM 2018 HD22 ASN A 137 -60.603 -6.362 16.935 1.00 0.00 H ATOM 2019 HD21 ASN A 137 -60.602 -8.163 16.959 1.00 0.00 H ATOM 2020 H ASN A 137 -56.689 -4.804 20.767 1.00 0.00 H ATOM 2021 N LEU A 138 -55.177 -5.905 17.804 1.00 29.70 N ATOM 2022 CA LEU A 138 -54.285 -6.064 16.663 1.00 27.64 C ATOM 2023 C LEU A 138 -53.849 -7.506 16.543 1.00 28.53 C ATOM 2024 O LEU A 138 -53.829 -8.233 17.525 1.00 29.55 O ATOM 2025 CB LEU A 138 -53.063 -5.168 16.843 1.00 26.51 C ATOM 2026 CG LEU A 138 -53.394 -3.679 16.980 1.00 27.25 C ATOM 2027 CD1 LEU A 138 -52.136 -2.817 17.087 1.00 28.15 C ATOM 2028 CD2 LEU A 138 -54.263 -3.212 15.818 1.00 26.43 C ATOM 2029 HA LEU A 138 -54.813 -5.778 15.753 1.00 0.00 H ATOM 2030 HB2 LEU A 138 -52.535 -5.486 17.742 1.00 0.00 H ATOM 2031 HB3 LEU A 138 -52.414 -5.296 15.977 1.00 0.00 H ATOM 2032 HG LEU A 138 -53.951 -3.558 17.909 1.00 0.00 H ATOM 2033 HD21 LEU A 138 -53.730 -3.371 14.881 1.00 0.00 H ATOM 2034 HD22 LEU A 138 -55.193 -3.781 15.809 1.00 0.00 H ATOM 2035 HD23 LEU A 138 -54.486 -2.152 15.936 1.00 0.00 H ATOM 2036 HD11 LEU A 138 -51.563 -3.120 17.963 1.00 0.00 H ATOM 2037 HD12 LEU A 138 -51.529 -2.949 16.191 1.00 0.00 H ATOM 2038 HD13 LEU A 138 -52.422 -1.769 17.182 1.00 0.00 H ATOM 2039 H LEU A 138 -54.772 -5.655 18.729 1.00 0.00 H ATOM 2040 N ASN A 139 -53.497 -7.937 15.342 1.00 28.23 N ATOM 2041 CA ASN A 139 -52.807 -9.211 15.204 1.00 29.41 C ATOM 2042 C ASN A 139 -51.296 -9.011 15.433 1.00 29.94 C ATOM 2043 O ASN A 139 -50.716 -8.052 14.944 1.00 30.18 O ATOM 2044 CB ASN A 139 -53.025 -9.843 13.836 1.00 30.78 C ATOM 2045 CG ASN A 139 -52.485 -11.262 13.787 1.00 34.31 C ATOM 2046 OD1 ASN A 139 -52.661 -12.023 14.755 1.00 39.63 O ATOM 2047 ND2 ASN A 139 -51.787 -11.620 12.706 1.00 33.54 N ATOM 2048 HA ASN A 139 -53.222 -9.886 15.953 1.00 0.00 H ATOM 2049 HB2 ASN A 139 -54.093 -9.862 13.620 1.00 0.00 H ATOM 2050 HB3 ASN A 139 -52.514 -9.243 13.083 1.00 0.00 H ATOM 2051 HD22 ASN A 139 -51.666 -10.950 11.920 1.00 0.00 H ATOM 2052 HD21 ASN A 139 -51.365 -12.569 12.650 1.00 0.00 H ATOM 2053 H ASN A 139 -53.713 -7.367 14.499 1.00 0.00 H ATOM 2054 N ALA A 140 -50.672 -9.932 16.157 1.00 30.37 N ATOM 2055 CA ALA A 140 -49.309 -9.738 16.640 1.00 27.20 C ATOM 2056 C ALA A 140 -48.654 -11.077 16.938 1.00 29.48 C ATOM 2057 O ALA A 140 -49.336 -12.064 17.232 1.00 26.52 O ATOM 2058 CB ALA A 140 -49.319 -8.871 17.882 1.00 28.12 C ATOM 2059 HA ALA A 140 -48.731 -9.237 15.863 1.00 0.00 H ATOM 2060 HB1 ALA A 140 -49.757 -7.902 17.644 1.00 0.00 H ATOM 2061 HB2 ALA A 140 -49.910 -9.357 18.658 1.00 0.00 H ATOM 2062 HB3 ALA A 140 -48.297 -8.732 18.235 1.00 0.00 H ATOM 2063 H ALA A 140 -51.168 -10.817 16.386 1.00 0.00 H ATOM 2064 N VAL A 141 -47.332 -11.111 16.806 1.00 28.84 N ATOM 2065 CA VAL A 141 -46.544 -12.285 17.144 1.00 29.59 C ATOM 2066 C VAL A 141 -45.417 -11.833 18.060 1.00 28.54 C ATOM 2067 O VAL A 141 -44.792 -10.798 17.827 1.00 26.77 O ATOM 2068 CB VAL A 141 -46.028 -12.992 15.880 1.00 29.05 C ATOM 2069 CG1 VAL A 141 -45.017 -14.062 16.221 1.00 29.30 C ATOM 2070 CG2 VAL A 141 -47.203 -13.592 15.103 1.00 30.68 C ATOM 2071 HA VAL A 141 -47.156 -13.023 17.662 1.00 0.00 H ATOM 2072 HB VAL A 141 -45.527 -12.252 15.256 1.00 0.00 H ATOM 2073 HG11 VAL A 141 -44.169 -13.609 16.735 1.00 0.00 H ATOM 2074 HG12 VAL A 141 -45.481 -14.805 16.869 1.00 0.00 H ATOM 2075 HG13 VAL A 141 -44.674 -14.541 15.304 1.00 0.00 H ATOM 2076 HG21 VAL A 141 -47.723 -14.314 15.733 1.00 0.00 H ATOM 2077 HG22 VAL A 141 -47.891 -12.797 14.816 1.00 0.00 H ATOM 2078 HG23 VAL A 141 -46.829 -14.091 14.209 1.00 0.00 H ATOM 2079 H VAL A 141 -46.843 -10.266 16.447 1.00 0.00 H ATOM 2080 N ARG A 142 -45.205 -12.587 19.129 1.00 27.69 N ATOM 2081 CA ARG A 142 -44.134 -12.307 20.066 1.00 29.90 C ATOM 2082 C ARG A 142 -43.047 -13.346 19.830 1.00 28.81 C ATOM 2083 O ARG A 142 -43.339 -14.524 19.705 1.00 29.94 O ATOM 2084 CB ARG A 142 -44.645 -12.410 21.494 1.00 31.87 C ATOM 2085 CG ARG A 142 -43.656 -11.916 22.534 1.00 33.71 C ATOM 2086 CD ARG A 142 -43.426 -12.947 23.628 1.00 35.21 C ATOM 2087 NE ARG A 142 -44.329 -12.772 24.761 1.00 35.20 N ATOM 2088 CZ ARG A 142 -45.015 -13.738 25.363 1.00 34.49 C ATOM 2089 NH1 ARG A 142 -44.933 -15.002 24.968 1.00 34.72 N ATOM 2090 NH2 ARG A 142 -45.797 -13.425 26.386 1.00 34.25 N ATOM 2091 HA ARG A 142 -43.749 -11.298 19.918 1.00 0.00 H ATOM 2092 HB2 ARG A 142 -45.556 -11.818 21.577 1.00 0.00 H ATOM 2093 HB3 ARG A 142 -44.872 -13.455 21.704 1.00 0.00 H ATOM 2094 HG2 ARG A 142 -42.706 -11.702 22.045 1.00 0.00 H ATOM 2095 HG3 ARG A 142 -44.044 -11.003 22.985 1.00 0.00 H ATOM 2096 HD2 ARG A 142 -42.399 -12.858 23.982 1.00 0.00 H ATOM 2097 HD3 ARG A 142 -43.579 -13.942 23.209 1.00 0.00 H ATOM 2098 HE ARG A 142 -44.446 -11.807 25.130 1.00 0.00 H ATOM 2099 HH12 ARG A 142 -45.482 -15.737 25.459 1.00 0.00 H ATOM 2100 HH11 ARG A 142 -44.320 -15.258 24.168 1.00 0.00 H ATOM 2101 HH22 ARG A 142 -46.342 -14.167 26.870 1.00 0.00 H ATOM 2102 HH21 ARG A 142 -45.866 -12.437 26.705 1.00 0.00 H ATOM 2103 H ARG A 142 -45.825 -13.404 19.301 1.00 0.00 H ATOM 2104 N GLY A 143 -41.789 -12.933 19.758 1.00 26.62 N ATOM 2105 CA GLY A 143 -40.738 -13.913 19.449 1.00 24.64 C ATOM 2106 C GLY A 143 -39.382 -13.273 19.273 1.00 21.77 C ATOM 2107 O GLY A 143 -39.203 -12.097 19.576 1.00 21.48 O ATOM 2108 HA3 GLY A 143 -41.003 -14.430 18.527 1.00 0.00 H ATOM 2109 HA2 GLY A 143 -40.681 -14.634 20.265 1.00 0.00 H ATOM 2110 H GLY A 143 -41.550 -11.933 19.917 1.00 0.00 H ATOM 2111 N LEU A 144 -38.448 -14.081 18.801 1.00 19.86 N ATOM 2112 CA LEU A 144 -37.081 -13.672 18.543 1.00 19.50 C ATOM 2113 C LEU A 144 -37.090 -12.785 17.308 1.00 19.08 C ATOM 2114 O LEU A 144 -37.618 -13.163 16.272 1.00 20.21 O ATOM 2115 CB LEU A 144 -36.223 -14.898 18.266 1.00 19.36 C ATOM 2116 CG LEU A 144 -34.890 -14.715 17.526 1.00 18.37 C ATOM 2117 CD1 LEU A 144 -33.950 -13.876 18.395 1.00 18.24 C ATOM 2118 CD2 LEU A 144 -34.301 -16.078 17.210 1.00 18.65 C ATOM 2119 HA LEU A 144 -36.675 -13.140 19.404 1.00 0.00 H ATOM 2120 HB2 LEU A 144 -35.995 -15.354 19.229 1.00 0.00 H ATOM 2121 HB3 LEU A 144 -36.827 -15.585 17.674 1.00 0.00 H ATOM 2122 HG LEU A 144 -35.040 -14.190 16.583 1.00 0.00 H ATOM 2123 HD21 LEU A 144 -34.132 -16.623 18.138 1.00 0.00 H ATOM 2124 HD22 LEU A 144 -34.995 -16.635 16.581 1.00 0.00 H ATOM 2125 HD23 LEU A 144 -33.355 -15.950 16.685 1.00 0.00 H ATOM 2126 HD11 LEU A 144 -34.403 -12.903 18.584 1.00 0.00 H ATOM 2127 HD12 LEU A 144 -33.779 -14.388 19.342 1.00 0.00 H ATOM 2128 HD13 LEU A 144 -33.001 -13.742 17.876 1.00 0.00 H ATOM 2129 H LEU A 144 -38.709 -15.068 18.603 1.00 0.00 H ATOM 2130 N ILE A 145 -36.518 -11.606 17.434 1.00 18.31 N ATOM 2131 CA ILE A 145 -36.262 -10.755 16.300 1.00 17.67 C ATOM 2132 C ILE A 145 -34.766 -10.724 16.021 1.00 16.27 C ATOM 2133 O ILE A 145 -33.974 -10.546 16.928 1.00 17.02 O ATOM 2134 CB ILE A 145 -36.806 -9.338 16.577 1.00 17.82 C ATOM 2135 CG1 ILE A 145 -38.325 -9.419 16.797 1.00 17.92 C ATOM 2136 CG2 ILE A 145 -36.448 -8.415 15.419 1.00 18.00 C ATOM 2137 CD1 ILE A 145 -39.011 -8.078 17.003 1.00 19.42 C ATOM 2138 HA ILE A 145 -36.771 -11.146 15.419 1.00 0.00 H ATOM 2139 HB ILE A 145 -36.353 -8.925 17.478 1.00 0.00 H ATOM 2140 HG12 ILE A 145 -38.769 -9.897 15.924 1.00 0.00 H ATOM 2141 HG13 ILE A 145 -38.508 -10.033 17.679 1.00 0.00 H ATOM 2142 HD11 ILE A 145 -38.591 -7.588 17.881 1.00 0.00 H ATOM 2143 HD12 ILE A 145 -38.853 -7.452 16.125 1.00 0.00 H ATOM 2144 HD13 ILE A 145 -40.079 -8.237 17.150 1.00 0.00 H ATOM 2145 HG21 ILE A 145 -35.364 -8.372 15.312 1.00 0.00 H ATOM 2146 HG22 ILE A 145 -36.890 -8.799 14.500 1.00 0.00 H ATOM 2147 HG23 ILE A 145 -36.834 -7.416 15.620 1.00 0.00 H ATOM 2148 H ILE A 145 -36.242 -11.279 18.382 1.00 0.00 H ATOM 2149 N VAL A 146 -34.376 -10.901 14.767 1.00 15.14 N ATOM 2150 CA VAL A 146 -32.979 -10.897 14.414 1.00 14.76 C ATOM 2151 C VAL A 146 -32.605 -9.665 13.601 1.00 14.26 C ATOM 2152 O VAL A 146 -33.393 -9.189 12.784 1.00 14.24 O ATOM 2153 CB VAL A 146 -32.579 -12.186 13.646 1.00 15.68 C ATOM 2154 CG1 VAL A 146 -32.796 -13.399 14.535 1.00 16.82 C ATOM 2155 CG2 VAL A 146 -33.374 -12.362 12.359 1.00 15.44 C ATOM 2156 HA VAL A 146 -32.422 -10.869 15.350 1.00 0.00 H ATOM 2157 HB VAL A 146 -31.527 -12.090 13.378 1.00 0.00 H ATOM 2158 HG11 VAL A 146 -32.182 -13.306 15.431 1.00 0.00 H ATOM 2159 HG12 VAL A 146 -33.847 -13.457 14.818 1.00 0.00 H ATOM 2160 HG13 VAL A 146 -32.514 -14.301 13.992 1.00 0.00 H ATOM 2161 HG21 VAL A 146 -34.436 -12.425 12.595 1.00 0.00 H ATOM 2162 HG22 VAL A 146 -33.196 -11.509 11.704 1.00 0.00 H ATOM 2163 HG23 VAL A 146 -33.057 -13.278 11.860 1.00 0.00 H ATOM 2164 H VAL A 146 -35.090 -11.045 14.025 1.00 0.00 H ATOM 2165 N SER A 147 -31.382 -9.189 13.809 1.00 13.88 N ATOM 2166 CA SER A 147 -30.873 -8.023 13.130 1.00 14.16 C ATOM 2167 C SER A 147 -29.594 -8.300 12.385 1.00 14.19 C ATOM 2168 O SER A 147 -28.758 -9.085 12.806 1.00 13.07 O ATOM 2169 CB SER A 147 -30.594 -6.882 14.103 1.00 14.76 C ATOM 2170 OG SER A 147 -31.679 -6.585 14.939 1.00 15.59 O ATOM 2171 HA SER A 147 -31.654 -7.742 12.424 1.00 0.00 H ATOM 2172 HB2 SER A 147 -30.346 -5.990 13.528 1.00 0.00 H ATOM 2173 HB3 SER A 147 -29.743 -7.159 14.726 1.00 0.00 H ATOM 2174 HG SER A 147 -32.457 -6.322 14.387 1.00 0.00 H ATOM 2175 H SER A 147 -30.766 -9.678 14.490 1.00 0.00 H ATOM 2176 N GLY A 148 -29.411 -7.566 11.292 1.00 14.31 N ATOM 2177 CA GLY A 148 -28.175 -7.613 10.518 1.00 13.85 C ATOM 2178 C GLY A 148 -28.060 -6.326 9.722 1.00 14.65 C ATOM 2179 O GLY A 148 -29.001 -5.532 9.672 1.00 15.20 O ATOM 2180 HA3 GLY A 148 -28.197 -8.466 9.839 1.00 0.00 H ATOM 2181 HA2 GLY A 148 -27.322 -7.708 11.190 1.00 0.00 H ATOM 2182 H GLY A 148 -30.176 -6.936 10.977 1.00 0.00 H ATOM 2183 N ASP A 149 -26.959 -6.138 9.028 1.00 14.35 N ATOM 2184 CA ASP A 149 -26.843 -4.988 8.143 1.00 14.55 C ATOM 2185 C ASP A 149 -27.260 -5.327 6.718 1.00 14.95 C ATOM 2186 O ASP A 149 -26.689 -4.819 5.768 1.00 14.97 O ATOM 2187 CB ASP A 149 -25.430 -4.406 8.190 1.00 14.97 C ATOM 2188 CG ASP A 149 -25.267 -3.393 9.302 1.00 15.90 C ATOM 2189 OD1 ASP A 149 -26.304 -2.936 9.797 1.00 16.77 O ATOM 2190 OD2 ASP A 149 -24.124 -3.048 9.679 1.00 16.95 O ATOM 2191 HA ASP A 149 -27.533 -4.224 8.502 1.00 0.00 H ATOM 2192 HB2 ASP A 149 -24.720 -5.218 8.348 1.00 0.00 H ATOM 2193 HB3 ASP A 149 -25.218 -3.920 7.238 1.00 0.00 H ATOM 2194 H ASP A 149 -26.171 -6.811 9.111 1.00 0.00 H ATOM 2195 N ALA A 150 -28.298 -6.147 6.570 1.00 14.68 N ATOM 2196 CA ALA A 150 -28.782 -6.528 5.245 1.00 14.64 C ATOM 2197 C ALA A 150 -30.271 -6.389 5.115 1.00 13.97 C ATOM 2198 O ALA A 150 -31.010 -6.797 6.004 1.00 13.71 O ATOM 2199 CB ALA A 150 -28.388 -7.972 4.941 1.00 15.05 C ATOM 2200 HA ALA A 150 -28.319 -5.847 4.531 1.00 0.00 H ATOM 2201 HB1 ALA A 150 -27.302 -8.064 4.967 1.00 0.00 H ATOM 2202 HB2 ALA A 150 -28.828 -8.632 5.688 1.00 0.00 H ATOM 2203 HB3 ALA A 150 -28.753 -8.246 3.951 1.00 0.00 H ATOM 2204 H ALA A 150 -28.774 -6.524 7.414 1.00 0.00 H ATOM 2205 N PHE A 151 -30.728 -5.867 3.976 1.00 13.34 N ATOM 2206 CA PHE A 151 -32.150 -5.891 3.681 1.00 13.62 C ATOM 2207 C PHE A 151 -32.502 -7.209 3.027 1.00 13.93 C ATOM 2208 O PHE A 151 -31.985 -7.533 1.977 1.00 13.66 O ATOM 2209 CB PHE A 151 -32.596 -4.734 2.796 1.00 13.40 C ATOM 2210 CG PHE A 151 -34.086 -4.685 2.595 1.00 13.73 C ATOM 2211 CD1 PHE A 151 -34.673 -5.260 1.469 1.00 13.49 C ATOM 2212 CD2 PHE A 151 -34.917 -4.134 3.564 1.00 13.68 C ATOM 2213 CE1 PHE A 151 -36.065 -5.227 1.303 1.00 13.51 C ATOM 2214 CE2 PHE A 151 -36.282 -4.080 3.390 1.00 13.40 C ATOM 2215 CZ PHE A 151 -36.866 -4.642 2.262 1.00 12.99 C ATOM 2216 HA PHE A 151 -32.680 -5.780 4.627 1.00 0.00 H ATOM 2217 HB2 PHE A 151 -32.277 -3.800 3.259 1.00 0.00 H ATOM 2218 HB3 PHE A 151 -32.118 -4.837 1.822 1.00 0.00 H ATOM 2219 HD2 PHE A 151 -34.479 -3.737 4.480 1.00 0.00 H ATOM 2220 HE2 PHE A 151 -36.906 -3.595 4.140 1.00 0.00 H ATOM 2221 HZ PHE A 151 -37.948 -4.621 2.135 1.00 0.00 H ATOM 2222 HE1 PHE A 151 -36.516 -5.665 0.413 1.00 0.00 H ATOM 2223 HD1 PHE A 151 -34.048 -5.737 0.715 1.00 0.00 H ATOM 2224 H PHE A 151 -30.065 -5.442 3.297 1.00 0.00 H ATOM 2225 N ILE A 152 -33.402 -7.961 3.645 1.00 14.40 N ATOM 2226 CA ILE A 152 -33.617 -9.329 3.246 1.00 14.99 C ATOM 2227 C ILE A 152 -34.705 -9.422 2.196 1.00 15.69 C ATOM 2228 O ILE A 152 -35.838 -8.965 2.395 1.00 14.85 O ATOM 2229 CB ILE A 152 -33.970 -10.223 4.445 1.00 15.38 C ATOM 2230 CG1 ILE A 152 -32.903 -10.101 5.521 1.00 14.85 C ATOM 2231 CG2 ILE A 152 -34.138 -11.693 4.010 1.00 15.63 C ATOM 2232 CD1 ILE A 152 -31.489 -10.380 5.026 1.00 15.14 C ATOM 2233 HA ILE A 152 -32.680 -9.688 2.819 1.00 0.00 H ATOM 2234 HB ILE A 152 -34.922 -9.886 4.855 1.00 0.00 H ATOM 2235 HG12 ILE A 152 -32.933 -9.087 5.920 1.00 0.00 H ATOM 2236 HG13 ILE A 152 -33.134 -10.810 6.316 1.00 0.00 H ATOM 2237 HD11 ILE A 152 -31.437 -11.396 4.634 1.00 0.00 H ATOM 2238 HD12 ILE A 152 -31.235 -9.671 4.238 1.00 0.00 H ATOM 2239 HD13 ILE A 152 -30.788 -10.272 5.854 1.00 0.00 H ATOM 2240 HG21 ILE A 152 -34.939 -11.763 3.274 1.00 0.00 H ATOM 2241 HG22 ILE A 152 -33.206 -12.049 3.571 1.00 0.00 H ATOM 2242 HG23 ILE A 152 -34.387 -12.302 4.879 1.00 0.00 H ATOM 2243 H ILE A 152 -33.959 -7.559 4.426 1.00 0.00 H ATOM 2244 N ASN A 153 -34.360 -10.044 1.070 1.00 17.75 N ATOM 2245 CA ASN A 153 -35.363 -10.360 0.055 1.00 19.35 C ATOM 2246 C ASN A 153 -35.230 -11.795 -0.493 1.00 19.98 C ATOM 2247 O ASN A 153 -34.784 -12.006 -1.610 1.00 20.32 O ATOM 2248 CB ASN A 153 -35.308 -9.357 -1.073 1.00 20.99 C ATOM 2249 CG ASN A 153 -36.463 -9.530 -2.062 1.00 21.78 C ATOM 2250 OD1 ASN A 153 -37.557 -10.085 -1.738 1.00 19.87 O ATOM 2251 ND2 ASN A 153 -36.221 -9.085 -3.273 1.00 22.25 N ATOM 2252 HA ASN A 153 -36.335 -10.299 0.545 1.00 0.00 H ATOM 2253 HB2 ASN A 153 -35.354 -8.353 -0.652 1.00 0.00 H ATOM 2254 HB3 ASN A 153 -34.367 -9.482 -1.608 1.00 0.00 H ATOM 2255 HD22 ASN A 153 -35.308 -8.637 -3.490 1.00 0.00 H ATOM 2256 HD21 ASN A 153 -36.942 -9.180 -4.016 1.00 0.00 H ATOM 2257 H ASN A 153 -33.367 -10.308 0.911 1.00 0.00 H ATOM 2258 N GLY A 154 -35.658 -12.764 0.298 1.00 20.55 N ATOM 2259 CA GLY A 154 -35.612 -14.136 -0.141 1.00 21.18 C ATOM 2260 C GLY A 154 -34.227 -14.642 -0.510 1.00 20.94 C ATOM 2261 O GLY A 154 -33.172 -14.116 -0.086 1.00 19.41 O ATOM 2262 HA3 GLY A 154 -36.253 -14.234 -1.017 1.00 0.00 H ATOM 2263 HA2 GLY A 154 -35.999 -14.762 0.663 1.00 0.00 H ATOM 2264 H GLY A 154 -36.030 -12.535 1.242 1.00 0.00 H ATOM 2265 N SER A 155 -34.260 -15.687 -1.321 1.00 20.76 N ATOM 2266 CA SER A 155 -33.087 -16.415 -1.747 1.00 22.92 C ATOM 2267 C SER A 155 -32.246 -16.878 -0.556 1.00 21.37 C ATOM 2268 O SER A 155 -32.764 -17.087 0.531 1.00 20.49 O ATOM 2269 CB SER A 155 -32.280 -15.564 -2.731 1.00 24.28 C ATOM 2270 OG SER A 155 -31.246 -16.339 -3.325 1.00 29.32 O ATOM 2271 HA SER A 155 -33.404 -17.321 -2.263 1.00 0.00 H ATOM 2272 HB2 SER A 155 -31.837 -14.722 -2.199 1.00 0.00 H ATOM 2273 HB3 SER A 155 -32.943 -15.191 -3.512 1.00 0.00 H ATOM 2274 HG SER A 155 -30.734 -15.775 -3.958 1.00 0.00 H ATOM 2275 H SER A 155 -35.186 -16.003 -1.673 1.00 0.00 H ATOM 2276 N VAL A 156 -30.950 -17.005 -0.788 1.00 24.25 N ATOM 2277 CA VAL A 156 -30.000 -17.576 0.177 1.00 24.71 C ATOM 2278 C VAL A 156 -29.866 -16.726 1.437 1.00 21.94 C ATOM 2279 O VAL A 156 -29.630 -17.245 2.507 1.00 22.67 O ATOM 2280 CB VAL A 156 -28.610 -17.797 -0.480 1.00 25.58 C ATOM 2281 CG1 VAL A 156 -27.671 -18.461 0.494 1.00 27.37 C ATOM 2282 CG2 VAL A 156 -28.740 -18.701 -1.695 1.00 29.78 C ATOM 2283 HA VAL A 156 -30.404 -18.541 0.482 1.00 0.00 H ATOM 2284 HB VAL A 156 -28.220 -16.823 -0.774 1.00 0.00 H ATOM 2285 HG11 VAL A 156 -27.553 -17.827 1.373 1.00 0.00 H ATOM 2286 HG12 VAL A 156 -28.082 -19.426 0.793 1.00 0.00 H ATOM 2287 HG13 VAL A 156 -26.701 -18.609 0.019 1.00 0.00 H ATOM 2288 HG21 VAL A 156 -29.147 -19.664 -1.388 1.00 0.00 H ATOM 2289 HG22 VAL A 156 -29.408 -18.238 -2.421 1.00 0.00 H ATOM 2290 HG23 VAL A 156 -27.758 -18.847 -2.145 1.00 0.00 H ATOM 2291 H VAL A 156 -30.582 -16.682 -1.706 1.00 0.00 H ATOM 2292 N GLY A 157 -30.031 -15.416 1.302 1.00 21.47 N ATOM 2293 CA GLY A 157 -30.068 -14.527 2.468 1.00 19.81 C ATOM 2294 C GLY A 157 -31.139 -14.937 3.461 1.00 18.92 C ATOM 2295 O GLY A 157 -30.866 -15.078 4.647 1.00 18.46 O ATOM 2296 HA3 GLY A 157 -30.271 -13.511 2.130 1.00 0.00 H ATOM 2297 HA2 GLY A 157 -29.098 -14.556 2.964 1.00 0.00 H ATOM 2298 H GLY A 157 -30.136 -15.011 0.350 1.00 0.00 H ATOM 2299 N LEU A 158 -32.355 -15.158 2.975 1.00 18.23 N ATOM 2300 CA LEU A 158 -33.464 -15.581 3.834 1.00 19.23 C ATOM 2301 C LEU A 158 -33.266 -17.043 4.300 1.00 18.67 C ATOM 2302 O LEU A 158 -33.505 -17.377 5.438 1.00 20.19 O ATOM 2303 CB LEU A 158 -34.798 -15.408 3.103 1.00 19.84 C ATOM 2304 CG LEU A 158 -36.069 -15.847 3.806 1.00 19.98 C ATOM 2305 CD1 LEU A 158 -36.341 -14.986 5.008 1.00 19.95 C ATOM 2306 CD2 LEU A 158 -37.266 -15.851 2.876 1.00 20.77 C ATOM 2307 HA LEU A 158 -33.480 -14.949 4.722 1.00 0.00 H ATOM 2308 HB2 LEU A 158 -34.906 -14.348 2.875 1.00 0.00 H ATOM 2309 HB3 LEU A 158 -34.732 -15.973 2.173 1.00 0.00 H ATOM 2310 HG LEU A 158 -35.910 -16.873 4.137 1.00 0.00 H ATOM 2311 HD21 LEU A 158 -37.424 -14.846 2.485 1.00 0.00 H ATOM 2312 HD22 LEU A 158 -37.081 -16.538 2.050 1.00 0.00 H ATOM 2313 HD23 LEU A 158 -38.151 -16.172 3.426 1.00 0.00 H ATOM 2314 HD11 LEU A 158 -35.508 -15.066 5.706 1.00 0.00 H ATOM 2315 HD12 LEU A 158 -36.454 -13.949 4.692 1.00 0.00 H ATOM 2316 HD13 LEU A 158 -37.257 -15.322 5.494 1.00 0.00 H ATOM 2317 H LEU A 158 -32.525 -15.027 1.957 1.00 0.00 H ATOM 2318 N ALA A 159 -32.815 -17.899 3.421 1.00 22.03 N ATOM 2319 CA ALA A 159 -32.624 -19.321 3.791 1.00 23.70 C ATOM 2320 C ALA A 159 -31.614 -19.460 4.956 1.00 24.19 C ATOM 2321 O ALA A 159 -31.845 -20.204 5.888 1.00 25.02 O ATOM 2322 CB ALA A 159 -32.159 -20.105 2.590 1.00 24.96 C ATOM 2323 HA ALA A 159 -33.579 -19.723 4.128 1.00 0.00 H ATOM 2324 HB1 ALA A 159 -32.907 -20.035 1.800 1.00 0.00 H ATOM 2325 HB2 ALA A 159 -31.214 -19.695 2.234 1.00 0.00 H ATOM 2326 HB3 ALA A 159 -32.021 -21.149 2.871 1.00 0.00 H ATOM 2327 H ALA A 159 -32.589 -17.580 2.457 1.00 0.00 H ATOM 2328 N LYS A 160 -30.516 -18.717 4.885 1.00 25.05 N ATOM 2329 CA LYS A 160 -29.499 -18.726 5.935 1.00 25.50 C ATOM 2330 C LYS A 160 -30.089 -18.345 7.280 1.00 24.15 C ATOM 2331 O LYS A 160 -29.880 -19.029 8.283 1.00 25.27 O ATOM 2332 CB LYS A 160 -28.407 -17.751 5.548 1.00 30.81 C ATOM 2333 CG LYS A 160 -27.054 -17.986 6.194 1.00 34.52 C ATOM 2334 CD LYS A 160 -25.996 -17.076 5.569 1.00 37.94 C ATOM 2335 CE LYS A 160 -26.038 -17.113 4.039 1.00 40.54 C ATOM 2336 NZ LYS A 160 -24.713 -17.350 3.425 1.00 43.89 N ATOM 2337 HA LYS A 160 -29.093 -19.733 6.033 1.00 0.00 H ATOM 2338 HB2 LYS A 160 -28.276 -17.806 4.467 1.00 0.00 H ATOM 2339 HB3 LYS A 160 -28.740 -16.750 5.822 1.00 0.00 H ATOM 2340 HG2 LYS A 160 -27.124 -17.775 7.261 1.00 0.00 H ATOM 2341 HG3 LYS A 160 -26.763 -19.026 6.049 1.00 0.00 H ATOM 2342 HD2 LYS A 160 -26.171 -16.053 5.901 1.00 0.00 H ATOM 2343 HD3 LYS A 160 -25.010 -17.401 5.902 1.00 0.00 H ATOM 2344 HE2 LYS A 160 -26.421 -16.158 3.679 1.00 0.00 H ATOM 2345 HE3 LYS A 160 -26.711 -17.912 3.730 1.00 0.00 H ATOM 2346 HZ1 LYS A 160 -24.062 -16.588 3.704 1.00 0.00 H ATOM 2347 HZ2 LYS A 160 -24.339 -18.264 3.752 1.00 0.00 H ATOM 2348 HZ3 LYS A 160 -24.810 -17.364 2.390 1.00 0.00 H ATOM 2349 H LYS A 160 -30.375 -18.108 4.054 1.00 0.00 H ATOM 2350 N ILE A 161 -30.869 -17.265 7.303 1.00 21.92 N ATOM 2351 CA ILE A 161 -31.556 -16.847 8.508 1.00 20.60 C ATOM 2352 C ILE A 161 -32.548 -17.905 9.021 1.00 21.43 C ATOM 2353 O ILE A 161 -32.615 -18.154 10.234 1.00 20.95 O ATOM 2354 CB ILE A 161 -32.311 -15.524 8.269 1.00 19.00 C ATOM 2355 CG1 ILE A 161 -31.305 -14.387 8.017 1.00 18.67 C ATOM 2356 CG2 ILE A 161 -33.209 -15.201 9.437 1.00 19.02 C ATOM 2357 CD1 ILE A 161 -31.963 -13.077 7.633 1.00 18.83 C ATOM 2358 HA ILE A 161 -30.787 -16.709 9.269 1.00 0.00 H ATOM 2359 HB ILE A 161 -32.942 -15.633 7.387 1.00 0.00 H ATOM 2360 HG12 ILE A 161 -30.726 -14.230 8.927 1.00 0.00 H ATOM 2361 HG13 ILE A 161 -30.637 -14.688 7.210 1.00 0.00 H ATOM 2362 HD11 ILE A 161 -32.538 -13.215 6.718 1.00 0.00 H ATOM 2363 HD12 ILE A 161 -32.627 -12.756 8.436 1.00 0.00 H ATOM 2364 HD13 ILE A 161 -31.195 -12.320 7.470 1.00 0.00 H ATOM 2365 HG21 ILE A 161 -33.936 -16.003 9.567 1.00 0.00 H ATOM 2366 HG22 ILE A 161 -32.607 -15.104 10.341 1.00 0.00 H ATOM 2367 HG23 ILE A 161 -33.730 -14.263 9.244 1.00 0.00 H ATOM 2368 H ILE A 161 -30.988 -16.707 6.433 1.00 0.00 H ATOM 2369 N ARG A 162 -33.356 -18.491 8.136 1.00 22.71 N ATOM 2370 CA ARG A 162 -34.305 -19.512 8.605 1.00 24.16 C ATOM 2371 C ARG A 162 -33.562 -20.769 9.103 1.00 24.64 C ATOM 2372 O ARG A 162 -34.010 -21.399 10.063 1.00 26.50 O ATOM 2373 CB ARG A 162 -35.361 -19.857 7.546 1.00 24.06 C ATOM 2374 CG ARG A 162 -36.473 -18.822 7.385 1.00 24.12 C ATOM 2375 CD ARG A 162 -37.514 -19.338 6.399 1.00 25.13 C ATOM 2376 NE ARG A 162 -38.548 -18.376 6.049 1.00 26.25 N ATOM 2377 CZ ARG A 162 -39.183 -18.357 4.881 1.00 26.68 C ATOM 2378 NH1 ARG A 162 -38.868 -19.238 3.939 1.00 25.73 N ATOM 2379 NH2 ARG A 162 -40.124 -17.445 4.645 1.00 26.61 N ATOM 2380 HA ARG A 162 -34.846 -19.086 9.450 1.00 0.00 H ATOM 2381 HB2 ARG A 162 -34.856 -19.964 6.586 1.00 0.00 H ATOM 2382 HB3 ARG A 162 -35.819 -20.807 7.821 1.00 0.00 H ATOM 2383 HG2 ARG A 162 -36.945 -18.643 8.351 1.00 0.00 H ATOM 2384 HG3 ARG A 162 -36.050 -17.890 7.011 1.00 0.00 H ATOM 2385 HD2 ARG A 162 -37.996 -20.211 6.839 1.00 0.00 H ATOM 2386 HD3 ARG A 162 -36.999 -19.632 5.484 1.00 0.00 H ATOM 2387 HE ARG A 162 -38.806 -17.659 6.756 1.00 0.00 H ATOM 2388 HH12 ARG A 162 -39.365 -19.223 3.026 1.00 0.00 H ATOM 2389 HH11 ARG A 162 -38.124 -19.943 4.115 1.00 0.00 H ATOM 2390 HH22 ARG A 162 -40.619 -17.433 3.730 1.00 0.00 H ATOM 2391 HH21 ARG A 162 -40.364 -16.745 5.375 1.00 0.00 H ATOM 2392 H ARG A 162 -33.315 -18.230 7.130 1.00 0.00 H ATOM 2393 N HIS A 163 -32.434 -21.114 8.483 1.00 26.23 N ATOM 2394 CA HIS A 163 -31.614 -22.263 8.961 1.00 27.21 C ATOM 2395 C HIS A 163 -31.000 -21.994 10.344 1.00 26.11 C ATOM 2396 O HIS A 163 -31.077 -22.827 11.243 1.00 24.77 O ATOM 2397 CB HIS A 163 -30.499 -22.630 7.963 1.00 29.44 C ATOM 2398 CG HIS A 163 -30.996 -23.164 6.649 1.00 33.45 C ATOM 2399 ND1 HIS A 163 -30.193 -23.248 5.527 1.00 36.48 N ATOM 2400 CD2 HIS A 163 -32.218 -23.621 6.267 1.00 36.30 C ATOM 2401 CE1 HIS A 163 -30.896 -23.723 4.514 1.00 35.29 C ATOM 2402 NE2 HIS A 163 -32.126 -23.964 4.939 1.00 34.97 N ATOM 2403 HA HIS A 163 -32.298 -23.108 9.043 1.00 0.00 H ATOM 2404 HB2 HIS A 163 -29.908 -21.735 7.767 1.00 0.00 H ATOM 2405 HB3 HIS A 163 -29.865 -23.389 8.422 1.00 0.00 H ATOM 2406 HD2 HIS A 163 -33.105 -23.701 6.896 1.00 0.00 H ATOM 2407 HE1 HIS A 163 -30.526 -23.888 3.502 1.00 0.00 H ATOM 2408 H HIS A 163 -32.121 -20.573 7.652 1.00 0.00 H ATOM 2409 N ASN A 164 -30.394 -20.823 10.517 1.00 25.01 N ATOM 2410 CA ASN A 164 -29.684 -20.492 11.756 1.00 24.45 C ATOM 2411 C ASN A 164 -30.602 -20.065 12.867 1.00 23.91 C ATOM 2412 O ASN A 164 -30.263 -20.213 14.036 1.00 23.61 O ATOM 2413 CB ASN A 164 -28.641 -19.401 11.508 1.00 25.30 C ATOM 2414 CG ASN A 164 -27.504 -19.880 10.638 1.00 26.90 C ATOM 2415 OD1 ASN A 164 -27.089 -21.043 10.718 1.00 28.33 O ATOM 2416 ND2 ASN A 164 -26.980 -18.991 9.808 1.00 25.22 N ATOM 2417 HA ASN A 164 -29.192 -21.411 12.075 1.00 0.00 H ATOM 2418 HB2 ASN A 164 -29.126 -18.557 11.017 1.00 0.00 H ATOM 2419 HB3 ASN A 164 -28.236 -19.078 12.467 1.00 0.00 H ATOM 2420 HD22 ASN A 164 -27.361 -18.024 9.774 1.00 0.00 H ATOM 2421 HD21 ASN A 164 -26.188 -19.260 9.190 1.00 0.00 H ATOM 2422 H ASN A 164 -30.425 -20.121 9.750 1.00 0.00 H ATOM 2423 N PHE A 165 -31.770 -19.528 12.521 1.00 23.26 N ATOM 2424 CA PHE A 165 -32.702 -19.050 13.528 1.00 23.71 C ATOM 2425 C PHE A 165 -34.125 -19.444 13.172 1.00 26.87 C ATOM 2426 O PHE A 165 -34.974 -18.582 12.907 1.00 25.43 O ATOM 2427 CB PHE A 165 -32.579 -17.527 13.675 1.00 23.32 C ATOM 2428 CG PHE A 165 -31.189 -17.075 13.905 1.00 22.77 C ATOM 2429 CD1 PHE A 165 -30.394 -16.693 12.849 1.00 21.81 C ATOM 2430 CD2 PHE A 165 -30.659 -17.052 15.189 1.00 23.25 C ATOM 2431 CE1 PHE A 165 -29.085 -16.298 13.061 1.00 22.09 C ATOM 2432 CE2 PHE A 165 -29.352 -16.632 15.401 1.00 22.34 C ATOM 2433 CZ PHE A 165 -28.574 -16.256 14.337 1.00 21.62 C ATOM 2434 HA PHE A 165 -32.455 -19.514 14.483 1.00 0.00 H ATOM 2435 HB2 PHE A 165 -32.949 -17.059 12.763 1.00 0.00 H ATOM 2436 HB3 PHE A 165 -33.191 -17.209 14.519 1.00 0.00 H ATOM 2437 HD2 PHE A 165 -31.272 -17.365 16.034 1.00 0.00 H ATOM 2438 HE2 PHE A 165 -28.946 -16.601 16.412 1.00 0.00 H ATOM 2439 HZ PHE A 165 -27.549 -15.923 14.502 1.00 0.00 H ATOM 2440 HE1 PHE A 165 -28.457 -16.019 12.215 1.00 0.00 H ATOM 2441 HD1 PHE A 165 -30.799 -16.702 11.837 1.00 0.00 H ATOM 2442 H PHE A 165 -32.019 -19.449 11.514 1.00 0.00 H ATOM 2443 N PRO A 166 -34.407 -20.765 13.198 1.00 31.59 N ATOM 2444 CA PRO A 166 -35.720 -21.257 12.792 1.00 30.88 C ATOM 2445 C PRO A 166 -36.880 -20.615 13.530 1.00 30.46 C ATOM 2446 O PRO A 166 -37.961 -20.536 12.959 1.00 33.55 O ATOM 2447 CB PRO A 166 -35.639 -22.773 13.070 1.00 32.62 C ATOM 2448 CG PRO A 166 -34.480 -22.955 13.979 1.00 32.29 C ATOM 2449 CD PRO A 166 -33.517 -21.871 13.586 1.00 31.27 C ATOM 2450 HA PRO A 166 -35.927 -21.012 11.750 1.00 0.00 H ATOM 2451 HD3 PRO A 166 -32.882 -21.588 14.425 1.00 0.00 H ATOM 2452 HD2 PRO A 166 -32.893 -22.185 12.749 1.00 0.00 H ATOM 2453 HG3 PRO A 166 -34.031 -23.938 13.839 1.00 0.00 H ATOM 2454 HG2 PRO A 166 -34.785 -22.841 15.019 1.00 0.00 H ATOM 2455 HB2 PRO A 166 -36.555 -23.121 13.547 1.00 0.00 H ATOM 2456 HB3 PRO A 166 -35.483 -23.322 12.141 1.00 0.00 H ATOM 2457 N ASP A 167 -36.669 -20.123 14.749 1.00 29.58 N ATOM 2458 CA ASP A 167 -37.731 -19.496 15.530 1.00 30.45 C ATOM 2459 C ASP A 167 -37.857 -17.970 15.359 1.00 27.01 C ATOM 2460 O ASP A 167 -38.720 -17.363 15.981 1.00 26.84 O ATOM 2461 CB ASP A 167 -37.527 -19.776 17.030 1.00 37.51 C ATOM 2462 CG ASP A 167 -37.426 -21.271 17.360 1.00 43.99 C ATOM 2463 OD1 ASP A 167 -38.034 -22.111 16.642 1.00 49.64 O ATOM 2464 OD2 ASP A 167 -36.735 -21.600 18.359 1.00 49.13 O ATOM 2465 HA ASP A 167 -38.647 -19.942 15.143 1.00 0.00 H ATOM 2466 HB2 ASP A 167 -36.607 -19.288 17.351 1.00 0.00 H ATOM 2467 HB3 ASP A 167 -38.370 -19.357 17.578 1.00 0.00 H ATOM 2468 H ASP A 167 -35.715 -20.188 15.159 1.00 0.00 H ATOM 2469 N ALA A 168 -36.994 -17.347 14.563 1.00 25.17 N ATOM 2470 CA ALA A 168 -37.054 -15.889 14.370 1.00 23.21 C ATOM 2471 C ALA A 168 -38.392 -15.556 13.718 1.00 21.47 C ATOM 2472 O ALA A 168 -38.742 -16.196 12.753 1.00 19.23 O ATOM 2473 CB ALA A 168 -35.913 -15.411 13.476 1.00 23.99 C ATOM 2474 HA ALA A 168 -36.957 -15.388 15.333 1.00 0.00 H ATOM 2475 HB1 ALA A 168 -34.959 -15.665 13.939 1.00 0.00 H ATOM 2476 HB2 ALA A 168 -35.987 -15.897 12.503 1.00 0.00 H ATOM 2477 HB3 ALA A 168 -35.980 -14.330 13.349 1.00 0.00 H ATOM 2478 H ALA A 168 -36.264 -17.899 14.068 1.00 0.00 H ATOM 2479 N VAL A 169 -39.117 -14.585 14.271 1.00 19.54 N ATOM 2480 CA VAL A 169 -40.412 -14.180 13.749 1.00 20.31 C ATOM 2481 C VAL A 169 -40.355 -12.961 12.830 1.00 19.32 C ATOM 2482 O VAL A 169 -41.313 -12.686 12.105 1.00 19.66 O ATOM 2483 CB VAL A 169 -41.430 -13.862 14.873 1.00 19.83 C ATOM 2484 CG1 VAL A 169 -41.629 -15.076 15.767 1.00 20.93 C ATOM 2485 CG2 VAL A 169 -41.040 -12.640 15.702 1.00 19.76 C ATOM 2486 HA VAL A 169 -40.736 -15.046 13.172 1.00 0.00 H ATOM 2487 HB VAL A 169 -42.373 -13.617 14.384 1.00 0.00 H ATOM 2488 HG11 VAL A 169 -42.006 -15.907 15.171 1.00 0.00 H ATOM 2489 HG12 VAL A 169 -40.676 -15.353 16.218 1.00 0.00 H ATOM 2490 HG13 VAL A 169 -42.347 -14.835 16.551 1.00 0.00 H ATOM 2491 HG21 VAL A 169 -40.072 -12.815 16.171 1.00 0.00 H ATOM 2492 HG22 VAL A 169 -40.979 -11.767 15.053 1.00 0.00 H ATOM 2493 HG23 VAL A 169 -41.792 -12.470 16.472 1.00 0.00 H ATOM 2494 H VAL A 169 -38.742 -14.097 15.109 1.00 0.00 H ATOM 2495 N ALA A 170 -39.270 -12.204 12.910 1.00 18.01 N ATOM 2496 CA ALA A 170 -39.091 -11.039 12.078 1.00 16.54 C ATOM 2497 C ALA A 170 -37.615 -10.723 11.976 1.00 16.30 C ATOM 2498 O ALA A 170 -36.825 -11.092 12.870 1.00 14.55 O ATOM 2499 CB ALA A 170 -39.867 -9.861 12.645 1.00 16.90 C ATOM 2500 HA ALA A 170 -39.477 -11.239 11.079 1.00 0.00 H ATOM 2501 HB1 ALA A 170 -40.927 -10.111 12.685 1.00 0.00 H ATOM 2502 HB2 ALA A 170 -39.507 -9.640 13.650 1.00 0.00 H ATOM 2503 HB3 ALA A 170 -39.721 -8.990 12.006 1.00 0.00 H ATOM 2504 H ALA A 170 -38.527 -12.457 13.592 1.00 0.00 H ATOM 2505 N VAL A 171 -37.246 -10.085 10.862 1.00 15.06 N ATOM 2506 CA VAL A 171 -35.877 -9.622 10.623 1.00 15.61 C ATOM 2507 C VAL A 171 -35.861 -8.102 10.477 1.00 15.65 C ATOM 2508 O VAL A 171 -36.759 -7.562 9.890 1.00 16.89 O ATOM 2509 CB VAL A 171 -35.247 -10.245 9.367 1.00 15.32 C ATOM 2510 CG1 VAL A 171 -36.050 -9.993 8.101 1.00 15.61 C ATOM 2511 CG2 VAL A 171 -33.825 -9.772 9.171 1.00 15.86 C ATOM 2512 HA VAL A 171 -35.287 -9.937 11.484 1.00 0.00 H ATOM 2513 HB VAL A 171 -35.250 -11.321 9.544 1.00 0.00 H ATOM 2514 HG11 VAL A 171 -37.047 -10.419 8.214 1.00 0.00 H ATOM 2515 HG12 VAL A 171 -36.129 -8.919 7.930 1.00 0.00 H ATOM 2516 HG13 VAL A 171 -35.547 -10.461 7.254 1.00 0.00 H ATOM 2517 HG21 VAL A 171 -33.816 -8.688 9.062 1.00 0.00 H ATOM 2518 HG22 VAL A 171 -33.226 -10.056 10.036 1.00 0.00 H ATOM 2519 HG23 VAL A 171 -33.411 -10.232 8.274 1.00 0.00 H ATOM 2520 H VAL A 171 -37.964 -9.909 10.130 1.00 0.00 H ATOM 2521 N GLU A 172 -34.841 -7.440 11.003 1.00 16.17 N ATOM 2522 CA GLU A 172 -34.610 -6.020 10.694 1.00 16.86 C ATOM 2523 C GLU A 172 -33.140 -5.663 10.824 1.00 15.55 C ATOM 2524 O GLU A 172 -32.325 -6.558 10.685 1.00 15.16 O ATOM 2525 CB GLU A 172 -35.589 -5.134 11.465 1.00 19.05 C ATOM 2526 CG GLU A 172 -35.796 -5.550 12.898 1.00 20.06 C ATOM 2527 CD GLU A 172 -34.571 -5.218 13.667 1.00 22.13 C ATOM 2528 OE1 GLU A 172 -33.803 -6.166 14.008 1.00 24.64 O ATOM 2529 OE2 GLU A 172 -34.351 -3.988 13.867 1.00 22.79 O ATOM 2530 HA GLU A 172 -34.834 -5.823 9.646 1.00 0.00 H ATOM 2531 HB2 GLU A 172 -35.207 -4.113 11.456 1.00 0.00 H ATOM 2532 HB3 GLU A 172 -36.553 -5.165 10.957 1.00 0.00 H ATOM 2533 HG2 GLU A 172 -36.649 -5.016 13.317 1.00 0.00 H ATOM 2534 HG3 GLU A 172 -35.981 -6.623 12.946 1.00 0.00 H ATOM 2535 H GLU A 172 -34.191 -7.934 11.647 1.00 0.00 H ATOM 2536 N MET A 173 -32.782 -4.391 11.022 1.00 14.52 N ATOM 2537 CA MET A 173 -31.381 -3.931 10.900 1.00 14.61 C ATOM 2538 C MET A 173 -30.879 -3.072 12.066 1.00 14.96 C ATOM 2539 O MET A 173 -29.764 -2.558 12.021 1.00 15.53 O ATOM 2540 CB MET A 173 -31.188 -3.139 9.584 1.00 14.77 C ATOM 2541 CG MET A 173 -31.598 -3.924 8.363 1.00 14.71 C ATOM 2542 SD MET A 173 -31.558 -3.139 6.757 1.00 17.19 S ATOM 2543 CE MET A 173 -29.941 -2.376 6.708 1.00 16.06 C ATOM 2544 HA MET A 173 -30.787 -4.845 10.908 1.00 0.00 H ATOM 2545 HB2 MET A 173 -31.789 -2.231 9.632 1.00 0.00 H ATOM 2546 HB3 MET A 173 -30.135 -2.872 9.489 1.00 0.00 H ATOM 2547 HG2 MET A 173 -32.623 -4.256 8.529 1.00 0.00 H ATOM 2548 HG3 MET A 173 -30.941 -4.792 8.308 1.00 0.00 H ATOM 2549 HE1 MET A 173 -29.854 -1.659 7.524 1.00 0.00 H ATOM 2550 HE2 MET A 173 -29.175 -3.144 6.815 1.00 0.00 H ATOM 2551 HE3 MET A 173 -29.812 -1.862 5.755 1.00 0.00 H ATOM 2552 H MET A 173 -33.516 -3.698 11.271 1.00 0.00 H ATOM 2553 N GLU A 174 -31.671 -2.894 13.113 1.00 15.28 N ATOM 2554 CA GLU A 174 -31.235 -2.055 14.230 1.00 15.46 C ATOM 2555 C GLU A 174 -31.470 -2.614 15.622 1.00 15.00 C ATOM 2556 O GLU A 174 -30.735 -2.283 16.542 1.00 15.08 O ATOM 2557 CB GLU A 174 -31.943 -0.696 14.162 1.00 16.67 C ATOM 2558 CG GLU A 174 -31.632 0.134 12.930 1.00 17.34 C ATOM 2559 CD GLU A 174 -32.570 -0.130 11.772 1.00 18.10 C ATOM 2560 OE1 GLU A 174 -32.186 0.158 10.626 1.00 16.94 O ATOM 2561 OE2 GLU A 174 -33.689 -0.654 11.993 1.00 22.98 O ATOM 2562 HA GLU A 174 -30.155 -1.989 14.101 1.00 0.00 H ATOM 2563 HB2 GLU A 174 -33.018 -0.874 14.186 1.00 0.00 H ATOM 2564 HB3 GLU A 174 -31.651 -0.119 15.040 1.00 0.00 H ATOM 2565 HG2 GLU A 174 -31.702 1.188 13.197 1.00 0.00 H ATOM 2566 HG3 GLU A 174 -30.615 -0.092 12.609 1.00 0.00 H ATOM 2567 H GLU A 174 -32.605 -3.351 13.141 1.00 0.00 H ATOM 2568 N ALA A 175 -32.524 -3.403 15.790 1.00 14.66 N ATOM 2569 CA ALA A 175 -33.030 -3.742 17.110 1.00 14.49 C ATOM 2570 C ALA A 175 -32.006 -4.390 18.019 1.00 14.87 C ATOM 2571 O ALA A 175 -31.940 -4.066 19.208 1.00 15.09 O ATOM 2572 CB ALA A 175 -34.245 -4.621 16.978 1.00 14.92 C ATOM 2573 HA ALA A 175 -33.293 -2.799 17.589 1.00 0.00 H ATOM 2574 HB1 ALA A 175 -35.017 -4.091 16.420 1.00 0.00 H ATOM 2575 HB2 ALA A 175 -33.975 -5.535 16.448 1.00 0.00 H ATOM 2576 HB3 ALA A 175 -34.620 -4.872 17.970 1.00 0.00 H ATOM 2577 H ALA A 175 -33.002 -3.790 14.952 1.00 0.00 H ATOM 2578 N THR A 176 -31.209 -5.313 17.474 1.00 14.72 N ATOM 2579 CA THR A 176 -30.235 -5.998 18.296 1.00 14.46 C ATOM 2580 C THR A 176 -29.102 -5.067 18.692 1.00 14.18 C ATOM 2581 O THR A 176 -28.546 -5.206 19.778 1.00 12.94 O ATOM 2582 CB THR A 176 -29.660 -7.235 17.627 1.00 14.16 C ATOM 2583 OG1 THR A 176 -30.725 -8.022 17.091 1.00 15.56 O ATOM 2584 CG2 THR A 176 -28.892 -8.043 18.616 1.00 14.51 C ATOM 2585 HA THR A 176 -30.773 -6.322 19.187 1.00 0.00 H ATOM 2586 HB THR A 176 -28.990 -6.928 16.824 1.00 0.00 H ATOM 2587 HG1 THR A 176 -31.226 -7.488 16.425 1.00 0.00 H ATOM 2588 HG23 THR A 176 -28.080 -7.440 19.023 1.00 0.00 H ATOM 2589 HG21 THR A 176 -29.556 -8.354 19.423 1.00 0.00 H ATOM 2590 HG22 THR A 176 -28.480 -8.923 18.123 1.00 0.00 H ATOM 2591 H THR A 176 -31.288 -5.539 16.462 1.00 0.00 H ATOM 2592 N ALA A 177 -28.786 -4.094 17.842 1.00 13.70 N ATOM 2593 CA ALA A 177 -27.754 -3.135 18.219 1.00 14.12 C ATOM 2594 C ALA A 177 -28.247 -2.263 19.405 1.00 14.46 C ATOM 2595 O ALA A 177 -27.499 -1.970 20.324 1.00 15.30 O ATOM 2596 CB ALA A 177 -27.377 -2.279 17.037 1.00 13.66 C ATOM 2597 HA ALA A 177 -26.864 -3.677 18.539 1.00 0.00 H ATOM 2598 HB1 ALA A 177 -26.998 -2.914 16.236 1.00 0.00 H ATOM 2599 HB2 ALA A 177 -28.256 -1.737 16.687 1.00 0.00 H ATOM 2600 HB3 ALA A 177 -26.606 -1.569 17.336 1.00 0.00 H ATOM 2601 H ALA A 177 -29.267 -4.018 16.923 1.00 0.00 H ATOM 2602 N ILE A 178 -29.501 -1.849 19.362 1.00 15.46 N ATOM 2603 CA ILE A 178 -30.088 -1.033 20.434 1.00 15.77 C ATOM 2604 C ILE A 178 -30.117 -1.858 21.726 1.00 16.25 C ATOM 2605 O ILE A 178 -29.755 -1.362 22.797 1.00 15.41 O ATOM 2606 CB ILE A 178 -31.491 -0.517 20.049 1.00 16.72 C ATOM 2607 CG1 ILE A 178 -31.405 0.422 18.836 1.00 16.94 C ATOM 2608 CG2 ILE A 178 -32.141 0.220 21.210 1.00 17.30 C ATOM 2609 CD1 ILE A 178 -32.745 0.748 18.210 1.00 16.74 C ATOM 2610 HA ILE A 178 -29.472 -0.148 20.593 1.00 0.00 H ATOM 2611 HB ILE A 178 -32.102 -1.383 19.795 1.00 0.00 H ATOM 2612 HG12 ILE A 178 -30.941 1.355 19.157 1.00 0.00 H ATOM 2613 HG13 ILE A 178 -30.780 -0.052 18.079 1.00 0.00 H ATOM 2614 HD11 ILE A 178 -33.220 -0.173 17.871 1.00 0.00 H ATOM 2615 HD12 ILE A 178 -33.381 1.235 18.949 1.00 0.00 H ATOM 2616 HD13 ILE A 178 -32.595 1.415 17.361 1.00 0.00 H ATOM 2617 HG21 ILE A 178 -32.239 -0.456 22.059 1.00 0.00 H ATOM 2618 HG22 ILE A 178 -31.521 1.071 21.491 1.00 0.00 H ATOM 2619 HG23 ILE A 178 -33.128 0.572 20.909 1.00 0.00 H ATOM 2620 H ILE A 178 -30.090 -2.108 18.545 1.00 0.00 H ATOM 2621 N ALA A 179 -30.526 -3.121 21.606 1.00 16.38 N ATOM 2622 CA ALA A 179 -30.530 -4.064 22.710 1.00 17.17 C ATOM 2623 C ALA A 179 -29.159 -4.240 23.359 1.00 17.49 C ATOM 2624 O ALA A 179 -29.037 -4.234 24.594 1.00 17.83 O ATOM 2625 CB ALA A 179 -31.090 -5.413 22.247 1.00 17.13 C ATOM 2626 HA ALA A 179 -31.177 -3.645 23.481 1.00 0.00 H ATOM 2627 HB1 ALA A 179 -32.110 -5.277 21.887 1.00 0.00 H ATOM 2628 HB2 ALA A 179 -30.469 -5.806 21.442 1.00 0.00 H ATOM 2629 HB3 ALA A 179 -31.088 -6.112 23.083 1.00 0.00 H ATOM 2630 H ALA A 179 -30.859 -3.447 20.676 1.00 0.00 H ATOM 2631 N HIS A 180 -28.138 -4.386 22.521 1.00 16.93 N ATOM 2632 CA HIS A 180 -26.729 -4.488 22.940 1.00 17.29 C ATOM 2633 C HIS A 180 -26.330 -3.242 23.743 1.00 17.90 C ATOM 2634 O HIS A 180 -25.753 -3.350 24.832 1.00 19.96 O ATOM 2635 CB HIS A 180 -25.883 -4.633 21.659 1.00 16.68 C ATOM 2636 CG HIS A 180 -24.427 -4.896 21.859 1.00 17.42 C ATOM 2637 ND1 HIS A 180 -23.671 -5.545 20.899 1.00 16.77 N ATOM 2638 CD2 HIS A 180 -23.568 -4.568 22.855 1.00 18.43 C ATOM 2639 CE1 HIS A 180 -22.421 -5.618 21.306 1.00 17.96 C ATOM 2640 NE2 HIS A 180 -22.329 -5.027 22.485 1.00 18.24 N ATOM 2641 HA HIS A 180 -26.567 -5.349 23.588 1.00 0.00 H ATOM 2642 HB2 HIS A 180 -26.294 -5.460 21.080 1.00 0.00 H ATOM 2643 HB3 HIS A 180 -25.979 -3.709 21.090 1.00 0.00 H ATOM 2644 HD2 HIS A 180 -23.815 -4.040 23.776 1.00 0.00 H ATOM 2645 HE1 HIS A 180 -21.600 -6.087 20.763 1.00 0.00 H ATOM 2646 H HIS A 180 -28.347 -4.431 21.503 1.00 0.00 H ATOM 2647 N VAL A 181 -26.638 -2.061 23.227 1.00 17.48 N ATOM 2648 CA VAL A 181 -26.309 -0.823 23.946 1.00 18.48 C ATOM 2649 C VAL A 181 -27.091 -0.772 25.280 1.00 19.86 C ATOM 2650 O VAL A 181 -26.518 -0.482 26.343 1.00 19.64 O ATOM 2651 CB VAL A 181 -26.608 0.408 23.085 1.00 18.22 C ATOM 2652 CG1 VAL A 181 -26.435 1.682 23.876 1.00 19.16 C ATOM 2653 CG2 VAL A 181 -25.714 0.436 21.864 1.00 17.96 C ATOM 2654 HA VAL A 181 -25.241 -0.816 24.165 1.00 0.00 H ATOM 2655 HB VAL A 181 -27.647 0.340 22.763 1.00 0.00 H ATOM 2656 HG11 VAL A 181 -27.118 1.676 24.725 1.00 0.00 H ATOM 2657 HG12 VAL A 181 -25.408 1.749 24.235 1.00 0.00 H ATOM 2658 HG13 VAL A 181 -26.654 2.537 23.237 1.00 0.00 H ATOM 2659 HG21 VAL A 181 -24.671 0.471 22.179 1.00 0.00 H ATOM 2660 HG22 VAL A 181 -25.885 -0.461 21.269 1.00 0.00 H ATOM 2661 HG23 VAL A 181 -25.944 1.319 21.267 1.00 0.00 H ATOM 2662 H VAL A 181 -27.117 -2.010 22.305 1.00 0.00 H ATOM 2663 N CYS A 182 -28.394 -1.067 25.229 1.00 21.29 N ATOM 2664 CA CYS A 182 -29.238 -1.056 26.432 1.00 21.05 C ATOM 2665 C CYS A 182 -28.769 -2.068 27.473 1.00 22.09 C ATOM 2666 O CYS A 182 -28.809 -1.794 28.678 1.00 22.48 O ATOM 2667 CB CYS A 182 -30.695 -1.338 26.084 1.00 21.20 C ATOM 2668 SG CYS A 182 -31.484 0.058 25.298 1.00 22.23 S ATOM 2669 HA CYS A 182 -29.151 -0.056 26.858 1.00 0.00 H ATOM 2670 HB2 CYS A 182 -31.235 -1.577 27.000 1.00 0.00 H ATOM 2671 HB3 CYS A 182 -30.736 -2.191 25.407 1.00 0.00 H ATOM 2672 HG CYS A 182 -30.816 0.365 24.130 1.00 0.00 H ATOM 2673 H CYS A 182 -28.822 -1.311 24.313 1.00 0.00 H ATOM 2674 N HIS A 183 -28.337 -3.232 27.013 1.00 21.17 N ATOM 2675 CA HIS A 183 -27.779 -4.245 27.885 1.00 23.42 C ATOM 2676 C HIS A 183 -26.575 -3.707 28.628 1.00 24.34 C ATOM 2677 O HIS A 183 -26.418 -3.941 29.822 1.00 23.09 O ATOM 2678 CB HIS A 183 -27.364 -5.445 27.062 1.00 24.98 C ATOM 2679 CG HIS A 183 -26.744 -6.557 27.847 1.00 27.99 C ATOM 2680 ND1 HIS A 183 -27.480 -7.418 28.632 1.00 30.94 N ATOM 2681 CD2 HIS A 183 -25.465 -6.982 27.923 1.00 28.80 C ATOM 2682 CE1 HIS A 183 -26.673 -8.312 29.176 1.00 30.43 C ATOM 2683 NE2 HIS A 183 -25.447 -8.074 28.756 1.00 28.41 N ATOM 2684 HA HIS A 183 -28.538 -4.535 28.611 1.00 0.00 H ATOM 2685 HB2 HIS A 183 -28.249 -5.836 26.560 1.00 0.00 H ATOM 2686 HB3 HIS A 183 -26.642 -5.112 26.316 1.00 0.00 H ATOM 2687 HD2 HIS A 183 -24.606 -6.541 27.417 1.00 0.00 H ATOM 2688 HE1 HIS A 183 -26.971 -9.110 29.856 1.00 0.00 H ATOM 2689 H HIS A 183 -28.400 -3.425 25.993 1.00 0.00 H ATOM 2690 N ASN A 184 -25.709 -3.003 27.915 1.00 24.97 N ATOM 2691 CA ASN A 184 -24.495 -2.514 28.529 1.00 28.36 C ATOM 2692 C ASN A 184 -24.701 -1.424 29.561 1.00 30.73 C ATOM 2693 O ASN A 184 -23.834 -1.228 30.402 1.00 30.17 O ATOM 2694 CB ASN A 184 -23.514 -2.083 27.461 1.00 30.83 C ATOM 2695 CG ASN A 184 -22.894 -3.276 26.754 1.00 35.15 C ATOM 2696 OD1 ASN A 184 -23.326 -4.424 26.939 1.00 35.15 O ATOM 2697 ND2 ASN A 184 -21.877 -3.019 25.944 1.00 41.08 N ATOM 2698 HA ASN A 184 -24.084 -3.351 29.094 1.00 0.00 H ATOM 2699 HB2 ASN A 184 -24.037 -1.470 26.727 1.00 0.00 H ATOM 2700 HB3 ASN A 184 -22.722 -1.496 27.925 1.00 0.00 H ATOM 2701 HD22 ASN A 184 -21.547 -2.041 25.818 1.00 0.00 H ATOM 2702 HD21 ASN A 184 -21.409 -3.795 25.434 1.00 0.00 H ATOM 2703 H ASN A 184 -25.902 -2.802 26.913 1.00 0.00 H ATOM 2704 N PHE A 185 -25.839 -0.736 29.491 1.00 29.77 N ATOM 2705 CA PHE A 185 -26.211 0.299 30.452 1.00 31.16 C ATOM 2706 C PHE A 185 -27.367 -0.121 31.356 1.00 31.93 C ATOM 2707 O PHE A 185 -27.934 0.710 32.049 1.00 35.25 O ATOM 2708 CB PHE A 185 -26.595 1.566 29.695 1.00 32.73 C ATOM 2709 CG PHE A 185 -25.428 2.259 29.063 1.00 35.40 C ATOM 2710 CD1 PHE A 185 -24.390 2.745 29.848 1.00 37.78 C ATOM 2711 CD2 PHE A 185 -25.359 2.433 27.692 1.00 33.19 C ATOM 2712 CE1 PHE A 185 -23.301 3.387 29.265 1.00 38.76 C ATOM 2713 CE2 PHE A 185 -24.285 3.074 27.112 1.00 34.30 C ATOM 2714 CZ PHE A 185 -23.252 3.555 27.895 1.00 36.31 C ATOM 2715 HA PHE A 185 -25.348 0.474 31.095 1.00 0.00 H ATOM 2716 HB2 PHE A 185 -27.304 1.299 28.911 1.00 0.00 H ATOM 2717 HB3 PHE A 185 -27.070 2.255 30.393 1.00 0.00 H ATOM 2718 HD2 PHE A 185 -26.165 2.058 27.062 1.00 0.00 H ATOM 2719 HE2 PHE A 185 -24.250 3.202 26.030 1.00 0.00 H ATOM 2720 HZ PHE A 185 -22.405 4.063 27.434 1.00 0.00 H ATOM 2721 HE1 PHE A 185 -22.488 3.757 29.889 1.00 0.00 H ATOM 2722 HD1 PHE A 185 -24.429 2.623 30.930 1.00 0.00 H ATOM 2723 H PHE A 185 -26.496 -0.946 28.713 1.00 0.00 H ATOM 2724 N ASN A 186 -27.690 -1.414 31.346 1.00 33.72 N ATOM 2725 CA ASN A 186 -28.865 -1.991 32.011 1.00 36.00 C ATOM 2726 C ASN A 186 -30.116 -1.137 31.905 1.00 34.59 C ATOM 2727 O ASN A 186 -30.729 -0.805 32.917 1.00 36.11 O ATOM 2728 CB ASN A 186 -28.545 -2.323 33.476 1.00 38.90 C ATOM 2729 CG ASN A 186 -27.580 -3.482 33.599 1.00 42.98 C ATOM 2730 OD1 ASN A 186 -27.950 -4.636 33.382 1.00 48.57 O ATOM 2731 ND2 ASN A 186 -26.329 -3.181 33.914 1.00 45.93 N ATOM 2732 HA ASN A 186 -29.095 -2.911 31.474 1.00 0.00 H ATOM 2733 HB2 ASN A 186 -28.103 -1.445 33.947 1.00 0.00 H ATOM 2734 HB3 ASN A 186 -29.472 -2.581 33.989 1.00 0.00 H ATOM 2735 HD22 ASN A 186 -26.061 -2.192 34.089 1.00 0.00 H ATOM 2736 HD21 ASN A 186 -25.615 -3.934 33.986 1.00 0.00 H ATOM 2737 H ASN A 186 -27.063 -2.063 30.829 1.00 0.00 H ATOM 2738 N VAL A 187 -30.490 -0.778 30.677 1.00 31.40 N ATOM 2739 CA VAL A 187 -31.754 -0.082 30.432 1.00 29.08 C ATOM 2740 C VAL A 187 -32.767 -1.093 29.863 1.00 29.28 C ATOM 2741 O VAL A 187 -32.458 -1.817 28.917 1.00 26.39 O ATOM 2742 CB VAL A 187 -31.595 1.130 29.499 1.00 29.92 C ATOM 2743 CG1 VAL A 187 -32.935 1.776 29.211 1.00 29.36 C ATOM 2744 CG2 VAL A 187 -30.671 2.154 30.120 1.00 31.03 C ATOM 2745 HA VAL A 187 -32.116 0.320 31.378 1.00 0.00 H ATOM 2746 HB VAL A 187 -31.168 0.773 28.562 1.00 0.00 H ATOM 2747 HG11 VAL A 187 -33.591 1.050 28.732 1.00 0.00 H ATOM 2748 HG12 VAL A 187 -33.384 2.111 30.146 1.00 0.00 H ATOM 2749 HG13 VAL A 187 -32.791 2.630 28.549 1.00 0.00 H ATOM 2750 HG21 VAL A 187 -31.087 2.488 31.070 1.00 0.00 H ATOM 2751 HG22 VAL A 187 -29.693 1.704 30.289 1.00 0.00 H ATOM 2752 HG23 VAL A 187 -30.569 3.005 29.447 1.00 0.00 H ATOM 2753 H VAL A 187 -29.868 -0.998 29.873 1.00 0.00 H ATOM 2754 N PRO A 188 -33.977 -1.164 30.469 1.00 27.34 N ATOM 2755 CA PRO A 188 -35.010 -2.024 29.920 1.00 25.98 C ATOM 2756 C PRO A 188 -35.295 -1.654 28.472 1.00 24.82 C ATOM 2757 O PRO A 188 -35.303 -0.473 28.108 1.00 23.39 O ATOM 2758 CB PRO A 188 -36.232 -1.713 30.791 1.00 27.19 C ATOM 2759 CG PRO A 188 -35.662 -1.297 32.109 1.00 27.65 C ATOM 2760 CD PRO A 188 -34.371 -0.584 31.768 1.00 27.80 C ATOM 2761 HA PRO A 188 -34.733 -3.078 29.925 1.00 0.00 H ATOM 2762 HD3 PRO A 188 -34.533 0.490 31.680 1.00 0.00 H ATOM 2763 HD2 PRO A 188 -33.610 -0.775 32.525 1.00 0.00 H ATOM 2764 HG3 PRO A 188 -35.466 -2.168 32.734 1.00 0.00 H ATOM 2765 HG2 PRO A 188 -36.346 -0.625 32.628 1.00 0.00 H ATOM 2766 HB2 PRO A 188 -36.820 -0.906 30.354 1.00 0.00 H ATOM 2767 HB3 PRO A 188 -36.859 -2.598 30.905 1.00 0.00 H ATOM 2768 N PHE A 189 -35.515 -2.665 27.660 1.00 24.88 N ATOM 2769 CA PHE A 189 -35.692 -2.477 26.231 1.00 24.43 C ATOM 2770 C PHE A 189 -36.758 -3.421 25.711 1.00 22.15 C ATOM 2771 O PHE A 189 -36.910 -4.537 26.200 1.00 21.64 O ATOM 2772 CB PHE A 189 -34.352 -2.756 25.533 1.00 25.51 C ATOM 2773 CG PHE A 189 -34.431 -2.759 24.044 1.00 26.99 C ATOM 2774 CD1 PHE A 189 -34.577 -1.574 23.351 1.00 27.54 C ATOM 2775 CD2 PHE A 189 -34.367 -3.948 23.331 1.00 27.78 C ATOM 2776 CE1 PHE A 189 -34.650 -1.566 21.970 1.00 28.66 C ATOM 2777 CE2 PHE A 189 -34.425 -3.940 21.948 1.00 28.11 C ATOM 2778 CZ PHE A 189 -34.564 -2.750 21.267 1.00 28.25 C ATOM 2779 HA PHE A 189 -36.010 -1.455 26.027 1.00 0.00 H ATOM 2780 HB2 PHE A 189 -33.641 -1.988 25.837 1.00 0.00 H ATOM 2781 HB3 PHE A 189 -33.992 -3.732 25.859 1.00 0.00 H ATOM 2782 HD2 PHE A 189 -34.270 -4.894 23.863 1.00 0.00 H ATOM 2783 HE2 PHE A 189 -34.361 -4.878 21.396 1.00 0.00 H ATOM 2784 HZ PHE A 189 -34.606 -2.744 20.178 1.00 0.00 H ATOM 2785 HE1 PHE A 189 -34.776 -0.624 21.437 1.00 0.00 H ATOM 2786 HD1 PHE A 189 -34.635 -0.633 23.899 1.00 0.00 H ATOM 2787 H PHE A 189 -35.564 -3.627 28.053 1.00 0.00 H ATOM 2788 N VAL A 190 -37.504 -2.959 24.715 1.00 22.67 N ATOM 2789 CA VAL A 190 -38.404 -3.813 23.965 1.00 22.56 C ATOM 2790 C VAL A 190 -38.525 -3.304 22.527 1.00 21.78 C ATOM 2791 O VAL A 190 -38.437 -2.121 22.270 1.00 21.54 O ATOM 2792 CB VAL A 190 -39.822 -3.854 24.603 1.00 23.14 C ATOM 2793 CG1 VAL A 190 -40.547 -2.520 24.420 1.00 23.38 C ATOM 2794 CG2 VAL A 190 -40.633 -4.999 24.003 1.00 23.35 C ATOM 2795 HA VAL A 190 -37.988 -4.820 23.979 1.00 0.00 H ATOM 2796 HB VAL A 190 -39.713 -4.026 25.674 1.00 0.00 H ATOM 2797 HG11 VAL A 190 -39.972 -1.727 24.898 1.00 0.00 H ATOM 2798 HG12 VAL A 190 -40.649 -2.306 23.356 1.00 0.00 H ATOM 2799 HG13 VAL A 190 -41.535 -2.579 24.876 1.00 0.00 H ATOM 2800 HG21 VAL A 190 -40.728 -4.851 22.927 1.00 0.00 H ATOM 2801 HG22 VAL A 190 -40.125 -5.943 24.197 1.00 0.00 H ATOM 2802 HG23 VAL A 190 -41.624 -5.018 24.457 1.00 0.00 H ATOM 2803 H VAL A 190 -37.441 -1.952 24.465 1.00 0.00 H ATOM 2804 N VAL A 191 -38.761 -4.224 21.605 1.00 22.37 N ATOM 2805 CA VAL A 191 -39.028 -3.869 20.211 1.00 21.07 C ATOM 2806 C VAL A 191 -40.537 -4.000 19.974 1.00 20.99 C ATOM 2807 O VAL A 191 -41.140 -5.017 20.305 1.00 21.10 O ATOM 2808 CB VAL A 191 -38.283 -4.827 19.255 1.00 20.72 C ATOM 2809 CG1 VAL A 191 -38.500 -4.438 17.791 1.00 20.75 C ATOM 2810 CG2 VAL A 191 -36.800 -4.850 19.585 1.00 20.26 C ATOM 2811 HA VAL A 191 -38.685 -2.852 20.019 1.00 0.00 H ATOM 2812 HB VAL A 191 -38.693 -5.827 19.396 1.00 0.00 H ATOM 2813 HG11 VAL A 191 -39.564 -4.477 17.560 1.00 0.00 H ATOM 2814 HG12 VAL A 191 -38.128 -3.427 17.626 1.00 0.00 H ATOM 2815 HG13 VAL A 191 -37.961 -5.134 17.148 1.00 0.00 H ATOM 2816 HG21 VAL A 191 -36.389 -3.846 19.476 1.00 0.00 H ATOM 2817 HG22 VAL A 191 -36.663 -5.191 20.611 1.00 0.00 H ATOM 2818 HG23 VAL A 191 -36.288 -5.529 18.903 1.00 0.00 H ATOM 2819 H VAL A 191 -38.757 -5.227 21.879 1.00 0.00 H ATOM 2820 N VAL A 192 -41.120 -2.952 19.404 1.00 21.68 N ATOM 2821 CA VAL A 192 -42.504 -2.932 18.973 1.00 21.55 C ATOM 2822 C VAL A 192 -42.561 -2.363 17.562 1.00 20.20 C ATOM 2823 O VAL A 192 -42.586 -1.147 17.369 1.00 22.38 O ATOM 2824 CB VAL A 192 -43.385 -2.093 19.920 1.00 22.10 C ATOM 2825 CG1 VAL A 192 -44.837 -2.119 19.462 1.00 22.81 C ATOM 2826 CG2 VAL A 192 -43.305 -2.659 21.332 1.00 22.86 C ATOM 2827 HA VAL A 192 -42.893 -3.950 18.990 1.00 0.00 H ATOM 2828 HB VAL A 192 -43.022 -1.065 19.907 1.00 0.00 H ATOM 2829 HG11 VAL A 192 -44.907 -1.707 18.455 1.00 0.00 H ATOM 2830 HG12 VAL A 192 -45.198 -3.148 19.461 1.00 0.00 H ATOM 2831 HG13 VAL A 192 -45.442 -1.521 20.143 1.00 0.00 H ATOM 2832 HG21 VAL A 192 -43.657 -3.691 21.329 1.00 0.00 H ATOM 2833 HG22 VAL A 192 -42.271 -2.628 21.677 1.00 0.00 H ATOM 2834 HG23 VAL A 192 -43.929 -2.062 21.997 1.00 0.00 H ATOM 2835 H VAL A 192 -40.550 -2.095 19.258 1.00 0.00 H ATOM 2836 N ARG A 193 -42.553 -3.258 16.577 1.00 18.91 N ATOM 2837 CA ARG A 193 -42.474 -2.882 15.195 1.00 17.53 C ATOM 2838 C ARG A 193 -43.675 -3.457 14.452 1.00 18.32 C ATOM 2839 O ARG A 193 -44.443 -4.241 15.008 1.00 20.15 O ATOM 2840 CB ARG A 193 -41.146 -3.383 14.621 1.00 17.61 C ATOM 2841 CG ARG A 193 -39.933 -2.554 15.034 1.00 17.61 C ATOM 2842 CD ARG A 193 -38.683 -3.264 14.577 1.00 17.96 C ATOM 2843 NE ARG A 193 -37.433 -2.567 14.837 1.00 16.61 N ATOM 2844 CZ ARG A 193 -36.768 -1.825 13.954 1.00 16.25 C ATOM 2845 NH1 ARG A 193 -37.215 -1.628 12.725 1.00 16.51 N ATOM 2846 NH2 ARG A 193 -35.622 -1.280 14.304 1.00 17.02 N ATOM 2847 HA ARG A 193 -42.502 -1.798 15.081 1.00 0.00 H ATOM 2848 HB2 ARG A 193 -40.992 -4.407 14.960 1.00 0.00 H ATOM 2849 HB3 ARG A 193 -41.216 -3.368 13.533 1.00 0.00 H ATOM 2850 HG2 ARG A 193 -39.986 -1.569 14.570 1.00 0.00 H ATOM 2851 HG3 ARG A 193 -39.916 -2.443 16.118 1.00 0.00 H ATOM 2852 HD2 ARG A 193 -38.761 -3.423 13.501 1.00 0.00 H ATOM 2853 HD3 ARG A 193 -38.641 -4.229 15.083 1.00 0.00 H ATOM 2854 HE ARG A 193 -37.026 -2.655 15.790 1.00 0.00 H ATOM 2855 HH12 ARG A 193 -36.670 -1.042 12.061 1.00 0.00 H ATOM 2856 HH11 ARG A 193 -38.112 -2.059 12.423 1.00 0.00 H ATOM 2857 HH22 ARG A 193 -35.093 -0.698 13.623 1.00 0.00 H ATOM 2858 HH21 ARG A 193 -35.245 -1.431 15.262 1.00 0.00 H ATOM 2859 H ARG A 193 -42.606 -4.268 16.818 1.00 0.00 H ATOM 2860 N ALA A 194 -43.871 -3.029 13.213 1.00 18.18 N ATOM 2861 CA ALA A 194 -44.958 -3.542 12.392 1.00 17.34 C ATOM 2862 C ALA A 194 -44.442 -4.003 11.041 1.00 16.64 C ATOM 2863 O ALA A 194 -43.458 -3.477 10.529 1.00 16.51 O ATOM 2864 CB ALA A 194 -46.027 -2.478 12.224 1.00 18.08 C ATOM 2865 HA ALA A 194 -45.397 -4.404 12.894 1.00 0.00 H ATOM 2866 HB1 ALA A 194 -46.417 -2.199 13.203 1.00 0.00 H ATOM 2867 HB2 ALA A 194 -45.594 -1.602 11.741 1.00 0.00 H ATOM 2868 HB3 ALA A 194 -46.836 -2.871 11.608 1.00 0.00 H ATOM 2869 H ALA A 194 -43.233 -2.309 12.818 1.00 0.00 H ATOM 2870 N ILE A 195 -45.134 -4.958 10.443 1.00 15.62 N ATOM 2871 CA ILE A 195 -44.652 -5.594 9.219 1.00 16.08 C ATOM 2872 C ILE A 195 -44.902 -4.763 7.934 1.00 15.12 C ATOM 2873 O ILE A 195 -46.014 -4.368 7.631 1.00 14.27 O ATOM 2874 CB ILE A 195 -45.270 -6.993 9.106 1.00 16.39 C ATOM 2875 CG1 ILE A 195 -44.855 -7.829 10.325 1.00 17.34 C ATOM 2876 CG2 ILE A 195 -44.862 -7.661 7.820 1.00 16.70 C ATOM 2877 CD1 ILE A 195 -43.345 -7.891 10.555 1.00 17.81 C ATOM 2878 HA ILE A 195 -43.567 -5.666 9.298 1.00 0.00 H ATOM 2879 HB ILE A 195 -46.356 -6.906 9.091 1.00 0.00 H ATOM 2880 HG12 ILE A 195 -45.319 -7.396 11.211 1.00 0.00 H ATOM 2881 HG13 ILE A 195 -45.222 -8.846 10.184 1.00 0.00 H ATOM 2882 HD11 ILE A 195 -42.864 -8.334 9.683 1.00 0.00 H ATOM 2883 HD12 ILE A 195 -42.961 -6.883 10.711 1.00 0.00 H ATOM 2884 HD13 ILE A 195 -43.137 -8.500 11.435 1.00 0.00 H ATOM 2885 HG21 ILE A 195 -45.201 -7.060 6.976 1.00 0.00 H ATOM 2886 HG22 ILE A 195 -43.776 -7.754 7.789 1.00 0.00 H ATOM 2887 HG23 ILE A 195 -45.315 -8.651 7.767 1.00 0.00 H ATOM 2888 H ILE A 195 -46.040 -5.263 10.852 1.00 0.00 H ATOM 2889 N SER A 196 -43.836 -4.535 7.175 1.00 15.87 N ATOM 2890 CA SER A 196 -43.885 -3.795 5.917 1.00 15.17 C ATOM 2891 C SER A 196 -43.776 -4.743 4.738 1.00 15.36 C ATOM 2892 O SER A 196 -44.086 -4.392 3.624 1.00 15.63 O ATOM 2893 CB SER A 196 -42.698 -2.837 5.866 1.00 15.27 C ATOM 2894 OG SER A 196 -41.487 -3.518 6.149 1.00 15.15 O ATOM 2895 HA SER A 196 -44.830 -3.255 5.863 1.00 0.00 H ATOM 2896 HB2 SER A 196 -42.844 -2.047 6.603 1.00 0.00 H ATOM 2897 HB3 SER A 196 -42.636 -2.397 4.871 1.00 0.00 H ATOM 2898 HG SER A 196 -41.348 -4.234 5.480 1.00 0.00 H ATOM 2899 H SER A 196 -42.917 -4.903 7.494 1.00 0.00 H ATOM 2900 N ASP A 197 -43.254 -5.931 4.984 1.00 15.99 N ATOM 2901 CA ASP A 197 -42.985 -6.894 3.942 1.00 15.70 C ATOM 2902 C ASP A 197 -42.697 -8.248 4.604 1.00 16.64 C ATOM 2903 O ASP A 197 -42.526 -8.308 5.822 1.00 15.66 O ATOM 2904 CB ASP A 197 -41.771 -6.447 3.126 1.00 16.13 C ATOM 2905 CG ASP A 197 -40.517 -6.321 3.973 1.00 17.18 C ATOM 2906 OD1 ASP A 197 -39.745 -7.325 4.105 1.00 16.08 O ATOM 2907 OD2 ASP A 197 -40.299 -5.216 4.530 1.00 17.18 O ATOM 2908 HA ASP A 197 -43.842 -6.977 3.274 1.00 0.00 H ATOM 2909 HB2 ASP A 197 -41.590 -7.179 2.339 1.00 0.00 H ATOM 2910 HB3 ASP A 197 -41.989 -5.478 2.677 1.00 0.00 H ATOM 2911 H ASP A 197 -43.028 -6.183 5.967 1.00 0.00 H ATOM 2912 N VAL A 198 -42.590 -9.306 3.792 1.00 18.26 N ATOM 2913 CA VAL A 198 -42.310 -10.673 4.305 1.00 19.23 C ATOM 2914 C VAL A 198 -40.891 -11.172 3.985 1.00 18.72 C ATOM 2915 O VAL A 198 -40.640 -12.370 3.967 1.00 16.68 O ATOM 2916 CB VAL A 198 -43.393 -11.705 3.854 1.00 19.76 C ATOM 2917 CG1 VAL A 198 -44.741 -11.320 4.416 1.00 20.55 C ATOM 2918 CG2 VAL A 198 -43.491 -11.796 2.353 1.00 19.97 C ATOM 2919 HA VAL A 198 -42.363 -10.589 5.390 1.00 0.00 H ATOM 2920 HB VAL A 198 -43.091 -12.680 4.236 1.00 0.00 H ATOM 2921 HG11 VAL A 198 -44.689 -11.307 5.505 1.00 0.00 H ATOM 2922 HG12 VAL A 198 -45.015 -10.330 4.052 1.00 0.00 H ATOM 2923 HG13 VAL A 198 -45.488 -12.046 4.095 1.00 0.00 H ATOM 2924 HG21 VAL A 198 -43.758 -10.820 1.948 1.00 0.00 H ATOM 2925 HG22 VAL A 198 -42.530 -12.109 1.946 1.00 0.00 H ATOM 2926 HG23 VAL A 198 -44.256 -12.525 2.084 1.00 0.00 H ATOM 2927 H VAL A 198 -42.707 -9.168 2.768 1.00 0.00 H ATOM 2928 N ALA A 199 -39.955 -10.234 3.789 1.00 17.64 N ATOM 2929 CA ALA A 199 -38.541 -10.530 3.626 1.00 17.43 C ATOM 2930 C ALA A 199 -38.259 -11.421 2.422 1.00 17.72 C ATOM 2931 O ALA A 199 -37.269 -12.138 2.401 1.00 16.61 O ATOM 2932 CB ALA A 199 -37.975 -11.136 4.915 1.00 18.18 C ATOM 2933 HA ALA A 199 -38.033 -9.586 3.428 1.00 0.00 H ATOM 2934 HB1 ALA A 199 -38.100 -10.427 5.734 1.00 0.00 H ATOM 2935 HB2 ALA A 199 -38.509 -12.058 5.147 1.00 0.00 H ATOM 2936 HB3 ALA A 199 -36.916 -11.353 4.778 1.00 0.00 H ATOM 2937 H ALA A 199 -40.256 -9.239 3.751 1.00 0.00 H ATOM 2938 N ASP A 200 -39.161 -11.354 1.441 1.00 17.95 N ATOM 2939 CA ASP A 200 -39.222 -12.218 0.244 1.00 19.23 C ATOM 2940 C ASP A 200 -40.382 -11.653 -0.610 1.00 20.23 C ATOM 2941 O ASP A 200 -41.055 -10.705 -0.176 1.00 19.48 O ATOM 2942 CB ASP A 200 -39.523 -13.669 0.633 1.00 20.49 C ATOM 2943 CG ASP A 200 -39.386 -14.664 -0.553 1.00 22.06 C ATOM 2944 OD1 ASP A 200 -38.685 -14.395 -1.532 1.00 23.20 O ATOM 2945 OD2 ASP A 200 -40.018 -15.719 -0.502 1.00 25.22 O ATOM 2946 HA ASP A 200 -38.273 -12.221 -0.293 1.00 0.00 H ATOM 2947 HB2 ASP A 200 -38.829 -13.968 1.418 1.00 0.00 H ATOM 2948 HB3 ASP A 200 -40.543 -13.721 1.013 1.00 0.00 H ATOM 2949 H ASP A 200 -39.894 -10.621 1.528 1.00 0.00 H ATOM 2950 N GLN A 201 -40.649 -12.235 -1.776 1.00 21.17 N ATOM 2951 CA GLN A 201 -41.786 -11.799 -2.602 1.00 22.12 C ATOM 2952 C GLN A 201 -41.575 -10.315 -3.009 1.00 22.67 C ATOM 2953 O GLN A 201 -42.466 -9.480 -2.856 1.00 20.28 O ATOM 2954 CB GLN A 201 -43.126 -12.012 -1.855 1.00 23.96 C ATOM 2955 CG GLN A 201 -43.400 -13.481 -1.476 1.00 25.64 C ATOM 2956 CD GLN A 201 -44.661 -13.694 -0.638 1.00 26.63 C ATOM 2957 OE1 GLN A 201 -45.712 -13.121 -0.898 1.00 29.07 O ATOM 2958 NE2 GLN A 201 -44.552 -14.516 0.371 1.00 27.71 N ATOM 2959 HA GLN A 201 -41.836 -12.403 -3.508 1.00 0.00 H ATOM 2960 HB2 GLN A 201 -43.108 -11.418 -0.941 1.00 0.00 H ATOM 2961 HB3 GLN A 201 -43.936 -11.665 -2.496 1.00 0.00 H ATOM 2962 HG2 GLN A 201 -43.500 -14.057 -2.396 1.00 0.00 H ATOM 2963 HG3 GLN A 201 -42.547 -13.851 -0.908 1.00 0.00 H ATOM 2964 HE22 GLN A 201 -43.644 -14.986 0.563 1.00 0.00 H ATOM 2965 HE21 GLN A 201 -45.373 -14.701 0.982 1.00 0.00 H ATOM 2966 H GLN A 201 -40.043 -13.012 -2.110 1.00 0.00 H ATOM 2967 N GLN A 202 -40.380 -9.999 -3.509 1.00 22.28 N ATOM 2968 CA GLN A 202 -40.048 -8.607 -3.856 1.00 23.74 C ATOM 2969 C GLN A 202 -40.281 -7.656 -2.665 1.00 19.69 C ATOM 2970 O GLN A 202 -41.067 -6.689 -2.725 1.00 18.03 O ATOM 2971 CB GLN A 202 -40.837 -8.181 -5.104 1.00 27.81 C ATOM 2972 CG GLN A 202 -40.100 -8.307 -6.434 1.00 31.89 C ATOM 2973 CD GLN A 202 -39.106 -9.463 -6.531 1.00 36.54 C ATOM 2974 OE1 GLN A 202 -38.138 -9.565 -5.760 1.00 40.07 O ATOM 2975 NE2 GLN A 202 -39.320 -10.326 -7.517 1.00 37.78 N ATOM 2976 HA GLN A 202 -38.985 -8.546 -4.090 1.00 0.00 H ATOM 2977 HB2 GLN A 202 -41.734 -8.798 -5.159 1.00 0.00 H ATOM 2978 HB3 GLN A 202 -41.123 -7.137 -4.978 1.00 0.00 H ATOM 2979 HG2 GLN A 202 -40.845 -8.438 -7.219 1.00 0.00 H ATOM 2980 HG3 GLN A 202 -39.554 -7.379 -6.604 1.00 0.00 H ATOM 2981 HE22 GLN A 202 -40.142 -10.207 -8.143 1.00 0.00 H ATOM 2982 HE21 GLN A 202 -38.665 -11.121 -7.664 1.00 0.00 H ATOM 2983 H GLN A 202 -39.672 -10.747 -3.656 1.00 0.00 H ATOM 2984 N SER A 203 -39.563 -7.935 -1.583 1.00 16.72 N ATOM 2985 CA SER A 203 -39.745 -7.196 -0.341 1.00 16.31 C ATOM 2986 C SER A 203 -39.423 -5.708 -0.488 1.00 16.06 C ATOM 2987 O SER A 203 -39.999 -4.897 0.216 1.00 15.30 O ATOM 2988 CB SER A 203 -38.922 -7.801 0.785 1.00 15.43 C ATOM 2989 OG SER A 203 -37.565 -7.864 0.446 1.00 15.17 O ATOM 2990 HA SER A 203 -40.803 -7.277 -0.090 1.00 0.00 H ATOM 2991 HB2 SER A 203 -39.285 -8.809 0.989 1.00 0.00 H ATOM 2992 HB3 SER A 203 -39.037 -7.187 1.679 1.00 0.00 H ATOM 2993 HG SER A 203 -37.057 -8.261 1.197 1.00 0.00 H ATOM 2994 H SER A 203 -38.856 -8.697 -1.623 1.00 0.00 H ATOM 2995 N HIS A 204 -38.523 -5.381 -1.405 1.00 17.48 N ATOM 2996 CA HIS A 204 -38.172 -3.977 -1.683 1.00 19.53 C ATOM 2997 C HIS A 204 -39.380 -3.186 -2.213 1.00 19.13 C ATOM 2998 O HIS A 204 -39.557 -2.024 -1.856 1.00 19.16 O ATOM 2999 CB HIS A 204 -36.947 -3.871 -2.607 1.00 20.54 C ATOM 3000 CG HIS A 204 -37.111 -4.518 -3.950 1.00 22.82 C ATOM 3001 ND1 HIS A 204 -37.380 -5.861 -4.112 1.00 23.85 N ATOM 3002 CD2 HIS A 204 -37.025 -4.003 -5.198 1.00 23.52 C ATOM 3003 CE1 HIS A 204 -37.451 -6.145 -5.398 1.00 24.33 C ATOM 3004 NE2 HIS A 204 -37.245 -5.035 -6.081 1.00 24.06 N ATOM 3005 HA HIS A 204 -37.888 -3.515 -0.737 1.00 0.00 H ATOM 3006 HB2 HIS A 204 -36.731 -2.814 -2.764 1.00 0.00 H ATOM 3007 HB3 HIS A 204 -36.102 -4.342 -2.105 1.00 0.00 H ATOM 3008 HD2 HIS A 204 -36.820 -2.964 -5.456 1.00 0.00 H ATOM 3009 HE1 HIS A 204 -37.647 -7.129 -5.824 1.00 0.00 H ATOM 3010 H HIS A 204 -38.052 -6.136 -1.943 1.00 0.00 H ATOM 3011 N LEU A 205 -40.228 -3.843 -3.014 1.00 19.20 N ATOM 3012 CA LEU A 205 -41.457 -3.238 -3.535 1.00 19.55 C ATOM 3013 C LEU A 205 -42.550 -3.173 -2.490 1.00 19.13 C ATOM 3014 O LEU A 205 -43.247 -2.172 -2.395 1.00 17.20 O ATOM 3015 CB LEU A 205 -41.993 -3.998 -4.761 1.00 21.35 C ATOM 3016 CG LEU A 205 -40.944 -4.271 -5.856 1.00 23.23 C ATOM 3017 CD1 LEU A 205 -41.536 -4.957 -7.083 1.00 24.31 C ATOM 3018 CD2 LEU A 205 -40.230 -3.007 -6.271 1.00 24.56 C ATOM 3019 HA LEU A 205 -41.185 -2.224 -3.828 1.00 0.00 H ATOM 3020 HB2 LEU A 205 -42.388 -4.956 -4.422 1.00 0.00 H ATOM 3021 HB3 LEU A 205 -42.798 -3.410 -5.201 1.00 0.00 H ATOM 3022 HG LEU A 205 -40.222 -4.955 -5.410 1.00 0.00 H ATOM 3023 HD21 LEU A 205 -40.955 -2.292 -6.660 1.00 0.00 H ATOM 3024 HD22 LEU A 205 -39.722 -2.578 -5.407 1.00 0.00 H ATOM 3025 HD23 LEU A 205 -39.499 -3.242 -7.044 1.00 0.00 H ATOM 3026 HD11 LEU A 205 -41.969 -5.913 -6.790 1.00 0.00 H ATOM 3027 HD12 LEU A 205 -42.311 -4.323 -7.514 1.00 0.00 H ATOM 3028 HD13 LEU A 205 -40.750 -5.123 -7.819 1.00 0.00 H ATOM 3029 H LEU A 205 -40.005 -4.824 -3.278 1.00 0.00 H ATOM 3030 N SER A 206 -42.745 -4.258 -1.737 1.00 17.43 N ATOM 3031 CA SER A 206 -43.679 -4.231 -0.632 1.00 17.44 C ATOM 3032 C SER A 206 -43.304 -3.090 0.345 1.00 16.97 C ATOM 3033 O SER A 206 -44.177 -2.376 0.874 1.00 15.66 O ATOM 3034 CB SER A 206 -43.700 -5.587 0.089 1.00 18.12 C ATOM 3035 OG SER A 206 -44.535 -5.564 1.232 1.00 18.50 O ATOM 3036 HA SER A 206 -44.681 -4.042 -1.018 1.00 0.00 H ATOM 3037 HB2 SER A 206 -42.685 -5.838 0.398 1.00 0.00 H ATOM 3038 HB3 SER A 206 -44.067 -6.347 -0.600 1.00 0.00 H ATOM 3039 HG SER A 206 -44.205 -4.880 1.867 1.00 0.00 H ATOM 3040 H SER A 206 -42.220 -5.131 -1.947 1.00 0.00 H ATOM 3041 N PHE A 207 -42.004 -2.941 0.585 1.00 16.76 N ATOM 3042 CA PHE A 207 -41.535 -1.961 1.528 1.00 16.85 C ATOM 3043 C PHE A 207 -41.926 -0.558 1.051 1.00 18.39 C ATOM 3044 O PHE A 207 -42.518 0.194 1.822 1.00 16.60 O ATOM 3045 CB PHE A 207 -40.038 -2.099 1.717 1.00 16.30 C ATOM 3046 CG PHE A 207 -39.482 -1.179 2.736 1.00 15.74 C ATOM 3047 CD1 PHE A 207 -38.820 -0.023 2.352 1.00 16.21 C ATOM 3048 CD2 PHE A 207 -39.611 -1.463 4.077 1.00 16.13 C ATOM 3049 CE1 PHE A 207 -38.305 0.846 3.301 1.00 15.82 C ATOM 3050 CE2 PHE A 207 -39.101 -0.595 5.034 1.00 15.76 C ATOM 3051 CZ PHE A 207 -38.440 0.557 4.639 1.00 15.57 C ATOM 3052 HA PHE A 207 -42.004 -2.126 2.498 1.00 0.00 H ATOM 3053 HB2 PHE A 207 -39.822 -3.123 2.022 1.00 0.00 H ATOM 3054 HB3 PHE A 207 -39.550 -1.894 0.764 1.00 0.00 H ATOM 3055 HD2 PHE A 207 -40.117 -2.376 4.390 1.00 0.00 H ATOM 3056 HE2 PHE A 207 -39.221 -0.820 6.094 1.00 0.00 H ATOM 3057 HZ PHE A 207 -38.028 1.233 5.388 1.00 0.00 H ATOM 3058 HE1 PHE A 207 -37.794 1.756 2.988 1.00 0.00 H ATOM 3059 HD1 PHE A 207 -38.703 0.205 1.292 1.00 0.00 H ATOM 3060 H PHE A 207 -41.318 -3.541 0.084 1.00 0.00 H ATOM 3061 N ASP A 208 -41.643 -0.229 -0.209 1.00 20.51 N ATOM 3062 CA ASP A 208 -41.981 1.093 -0.744 1.00 22.91 C ATOM 3063 C ASP A 208 -43.477 1.359 -0.499 1.00 24.06 C ATOM 3064 O ASP A 208 -43.865 2.449 -0.044 1.00 23.87 O ATOM 3065 CB ASP A 208 -41.646 1.200 -2.252 1.00 24.04 C ATOM 3066 CG ASP A 208 -40.134 1.125 -2.552 1.00 24.94 C ATOM 3067 OD1 ASP A 208 -39.746 1.198 -3.753 1.00 26.62 O ATOM 3068 OD2 ASP A 208 -39.328 0.999 -1.605 1.00 25.90 O ATOM 3069 HA ASP A 208 -41.382 1.846 -0.231 1.00 0.00 H ATOM 3070 HB2 ASP A 208 -42.143 0.383 -2.775 1.00 0.00 H ATOM 3071 HB3 ASP A 208 -42.025 2.152 -2.624 1.00 0.00 H ATOM 3072 H ASP A 208 -41.173 -0.924 -0.824 1.00 0.00 H ATOM 3073 N GLU A 209 -44.298 0.348 -0.770 1.00 22.91 N ATOM 3074 CA GLU A 209 -45.736 0.485 -0.745 1.00 24.23 C ATOM 3075 C GLU A 209 -46.310 0.546 0.661 1.00 24.60 C ATOM 3076 O GLU A 209 -47.215 1.355 0.923 1.00 22.44 O ATOM 3077 CB GLU A 209 -46.390 -0.677 -1.520 1.00 26.44 C ATOM 3078 CG GLU A 209 -47.903 -0.742 -1.372 1.00 31.18 C ATOM 3079 CD GLU A 209 -48.629 -1.416 -2.531 1.00 35.21 C ATOM 3080 OE1 GLU A 209 -49.817 -1.074 -2.734 1.00 44.02 O ATOM 3081 OE2 GLU A 209 -48.047 -2.286 -3.231 1.00 36.95 O ATOM 3082 HA GLU A 209 -45.964 1.438 -1.223 1.00 0.00 H ATOM 3083 HB2 GLU A 209 -46.153 -0.561 -2.578 1.00 0.00 H ATOM 3084 HB3 GLU A 209 -45.969 -1.614 -1.155 1.00 0.00 H ATOM 3085 HG2 GLU A 209 -48.132 -1.294 -0.461 1.00 0.00 H ATOM 3086 HG3 GLU A 209 -48.280 0.277 -1.282 1.00 0.00 H ATOM 3087 H GLU A 209 -43.889 -0.578 -1.009 1.00 0.00 H ATOM 3088 N PHE A 210 -45.816 -0.319 1.550 1.00 21.90 N ATOM 3089 CA PHE A 210 -46.456 -0.526 2.840 1.00 22.23 C ATOM 3090 C PHE A 210 -45.724 -0.006 4.069 1.00 20.62 C ATOM 3091 O PHE A 210 -46.208 -0.185 5.205 1.00 21.55 O ATOM 3092 CB PHE A 210 -46.749 -2.018 3.016 1.00 23.27 C ATOM 3093 CG PHE A 210 -47.762 -2.533 2.047 1.00 24.39 C ATOM 3094 CD1 PHE A 210 -49.076 -2.040 2.073 1.00 24.95 C ATOM 3095 CD2 PHE A 210 -47.421 -3.487 1.096 1.00 24.59 C ATOM 3096 CE1 PHE A 210 -50.015 -2.500 1.168 1.00 25.40 C ATOM 3097 CE2 PHE A 210 -48.353 -3.947 0.200 1.00 25.97 C ATOM 3098 CZ PHE A 210 -49.653 -3.466 0.240 1.00 26.83 C ATOM 3099 HA PHE A 210 -47.360 0.082 2.796 1.00 0.00 H ATOM 3100 HB2 PHE A 210 -45.821 -2.573 2.877 1.00 0.00 H ATOM 3101 HB3 PHE A 210 -47.121 -2.182 4.027 1.00 0.00 H ATOM 3102 HD2 PHE A 210 -46.403 -3.874 1.061 1.00 0.00 H ATOM 3103 HE2 PHE A 210 -48.071 -4.692 -0.544 1.00 0.00 H ATOM 3104 HZ PHE A 210 -50.394 -3.849 -0.461 1.00 0.00 H ATOM 3105 HE1 PHE A 210 -51.032 -2.107 1.184 1.00 0.00 H ATOM 3106 HD1 PHE A 210 -49.358 -1.290 2.811 1.00 0.00 H ATOM 3107 H PHE A 210 -44.956 -0.856 1.316 1.00 0.00 H ATOM 3108 N LEU A 211 -44.580 0.630 3.874 1.00 19.08 N ATOM 3109 CA LEU A 211 -43.903 1.293 4.989 1.00 18.56 C ATOM 3110 C LEU A 211 -44.849 2.245 5.716 1.00 17.44 C ATOM 3111 O LEU A 211 -44.785 2.363 6.935 1.00 17.10 O ATOM 3112 CB LEU A 211 -42.659 2.062 4.514 1.00 17.69 C ATOM 3113 CG LEU A 211 -41.941 2.892 5.568 1.00 18.63 C ATOM 3114 CD1 LEU A 211 -41.430 1.990 6.673 1.00 19.14 C ATOM 3115 CD2 LEU A 211 -40.797 3.710 4.988 1.00 19.28 C ATOM 3116 HA LEU A 211 -43.585 0.513 5.681 1.00 0.00 H ATOM 3117 HB2 LEU A 211 -41.948 1.335 4.121 1.00 0.00 H ATOM 3118 HB3 LEU A 211 -42.968 2.735 3.714 1.00 0.00 H ATOM 3119 HG LEU A 211 -42.665 3.599 5.972 1.00 0.00 H ATOM 3120 HD21 LEU A 211 -40.067 3.040 4.534 1.00 0.00 H ATOM 3121 HD22 LEU A 211 -41.186 4.392 4.232 1.00 0.00 H ATOM 3122 HD23 LEU A 211 -40.321 4.282 5.784 1.00 0.00 H ATOM 3123 HD11 LEU A 211 -42.270 1.470 7.134 1.00 0.00 H ATOM 3124 HD12 LEU A 211 -40.736 1.261 6.254 1.00 0.00 H ATOM 3125 HD13 LEU A 211 -40.917 2.592 7.423 1.00 0.00 H ATOM 3126 H LEU A 211 -44.160 0.659 2.923 1.00 0.00 H ATOM 3127 N ALA A 212 -45.708 2.949 4.978 1.00 17.99 N ATOM 3128 CA ALA A 212 -46.594 3.929 5.621 1.00 18.68 C ATOM 3129 C ALA A 212 -47.574 3.217 6.535 1.00 19.36 C ATOM 3130 O ALA A 212 -47.804 3.663 7.659 1.00 20.25 O ATOM 3131 CB ALA A 212 -47.322 4.771 4.604 1.00 19.50 C ATOM 3132 HA ALA A 212 -45.980 4.604 6.217 1.00 0.00 H ATOM 3133 HB1 ALA A 212 -46.597 5.310 3.994 1.00 0.00 H ATOM 3134 HB2 ALA A 212 -47.927 4.126 3.966 1.00 0.00 H ATOM 3135 HB3 ALA A 212 -47.967 5.483 5.119 1.00 0.00 H ATOM 3136 H ALA A 212 -45.751 2.805 3.949 1.00 0.00 H ATOM 3137 N VAL A 213 -48.118 2.094 6.066 1.00 18.95 N ATOM 3138 CA VAL A 213 -49.014 1.258 6.891 1.00 21.42 C ATOM 3139 C VAL A 213 -48.277 0.781 8.137 1.00 19.24 C ATOM 3140 O VAL A 213 -48.789 0.887 9.238 1.00 20.21 O ATOM 3141 CB VAL A 213 -49.557 0.021 6.131 1.00 22.84 C ATOM 3142 CG1 VAL A 213 -50.449 -0.822 7.046 1.00 24.86 C ATOM 3143 CG2 VAL A 213 -50.364 0.448 4.920 1.00 25.93 C ATOM 3144 HA VAL A 213 -49.865 1.885 7.157 1.00 0.00 H ATOM 3145 HB VAL A 213 -48.701 -0.571 5.807 1.00 0.00 H ATOM 3146 HG11 VAL A 213 -49.870 -1.160 7.905 1.00 0.00 H ATOM 3147 HG12 VAL A 213 -51.290 -0.219 7.388 1.00 0.00 H ATOM 3148 HG13 VAL A 213 -50.820 -1.686 6.494 1.00 0.00 H ATOM 3149 HG21 VAL A 213 -51.205 1.061 5.243 1.00 0.00 H ATOM 3150 HG22 VAL A 213 -49.730 1.025 4.247 1.00 0.00 H ATOM 3151 HG23 VAL A 213 -50.735 -0.436 4.402 1.00 0.00 H ATOM 3152 H VAL A 213 -47.906 1.798 5.092 1.00 0.00 H ATOM 3153 N ALA A 214 -47.057 0.275 7.959 1.00 18.60 N ATOM 3154 CA ALA A 214 -46.272 -0.205 9.093 1.00 18.49 C ATOM 3155 C ALA A 214 -45.961 0.924 10.071 1.00 19.25 C ATOM 3156 O ALA A 214 -46.002 0.716 11.277 1.00 20.84 O ATOM 3157 CB ALA A 214 -44.987 -0.884 8.623 1.00 18.23 C ATOM 3158 HA ALA A 214 -46.874 -0.946 9.619 1.00 0.00 H ATOM 3159 HB1 ALA A 214 -45.238 -1.733 7.987 1.00 0.00 H ATOM 3160 HB2 ALA A 214 -44.386 -0.171 8.059 1.00 0.00 H ATOM 3161 HB3 ALA A 214 -44.423 -1.231 9.489 1.00 0.00 H ATOM 3162 H ALA A 214 -46.659 0.221 7.000 1.00 0.00 H ATOM 3163 N ALA A 215 -45.686 2.121 9.564 1.00 19.56 N ATOM 3164 CA ALA A 215 -45.390 3.262 10.441 1.00 19.94 C ATOM 3165 C ALA A 215 -46.631 3.619 11.257 1.00 21.19 C ATOM 3166 O ALA A 215 -46.548 3.871 12.459 1.00 20.56 O ATOM 3167 CB ALA A 215 -44.905 4.455 9.625 1.00 19.74 C ATOM 3168 HA ALA A 215 -44.590 2.987 11.128 1.00 0.00 H ATOM 3169 HB1 ALA A 215 -43.999 4.180 9.085 1.00 0.00 H ATOM 3170 HB2 ALA A 215 -45.679 4.746 8.915 1.00 0.00 H ATOM 3171 HB3 ALA A 215 -44.692 5.289 10.294 1.00 0.00 H ATOM 3172 H ALA A 215 -45.680 2.252 8.532 1.00 0.00 H ATOM 3173 N LYS A 216 -47.785 3.616 10.604 1.00 22.65 N ATOM 3174 CA LYS A 216 -49.038 3.924 11.293 1.00 23.94 C ATOM 3175 C LYS A 216 -49.357 2.907 12.388 1.00 22.76 C ATOM 3176 O LYS A 216 -49.683 3.287 13.517 1.00 24.41 O ATOM 3177 CB LYS A 216 -50.200 4.019 10.295 1.00 25.19 C ATOM 3178 CG LYS A 216 -51.477 4.635 10.866 1.00 29.02 C ATOM 3179 CD LYS A 216 -51.204 5.864 11.735 1.00 30.37 C ATOM 3180 CE LYS A 216 -52.462 6.685 11.942 1.00 31.61 C ATOM 3181 NZ LYS A 216 -53.409 5.963 12.828 1.00 30.44 N ATOM 3182 HA LYS A 216 -48.908 4.893 11.775 1.00 0.00 H ATOM 3183 HB2 LYS A 216 -49.876 4.628 9.451 1.00 0.00 H ATOM 3184 HB3 LYS A 216 -50.433 3.013 9.947 1.00 0.00 H ATOM 3185 HG2 LYS A 216 -52.122 4.929 10.038 1.00 0.00 H ATOM 3186 HG3 LYS A 216 -51.985 3.885 11.472 1.00 0.00 H ATOM 3187 HD2 LYS A 216 -50.830 5.537 12.705 1.00 0.00 H ATOM 3188 HD3 LYS A 216 -50.452 6.484 11.247 1.00 0.00 H ATOM 3189 HE2 LYS A 216 -52.937 6.865 10.978 1.00 0.00 H ATOM 3190 HE3 LYS A 216 -52.198 7.639 12.399 1.00 0.00 H ATOM 3191 HZ1 LYS A 216 -53.664 5.054 12.393 1.00 0.00 H ATOM 3192 HZ2 LYS A 216 -52.958 5.793 13.750 1.00 0.00 H ATOM 3193 HZ3 LYS A 216 -54.265 6.538 12.960 1.00 0.00 H ATOM 3194 H LYS A 216 -47.799 3.392 9.589 1.00 0.00 H ATOM 3195 N GLN A 217 -49.241 1.622 12.084 1.00 22.53 N ATOM 3196 CA GLN A 217 -49.532 0.602 13.089 1.00 23.03 C ATOM 3197 C GLN A 217 -48.564 0.582 14.288 1.00 23.98 C ATOM 3198 O GLN A 217 -49.006 0.498 15.438 1.00 24.35 O ATOM 3199 CB GLN A 217 -49.641 -0.775 12.457 1.00 24.39 C ATOM 3200 CG GLN A 217 -50.840 -0.898 11.519 1.00 25.29 C ATOM 3201 CD GLN A 217 -52.174 -0.555 12.195 1.00 26.16 C ATOM 3202 OE1 GLN A 217 -52.756 0.461 11.894 1.00 27.29 O ATOM 3203 NE2 GLN A 217 -52.644 -1.407 13.099 1.00 25.74 N ATOM 3204 HA GLN A 217 -50.498 0.885 13.506 1.00 0.00 H ATOM 3205 HB2 GLN A 217 -48.732 -0.972 11.889 1.00 0.00 H ATOM 3206 HB3 GLN A 217 -49.740 -1.516 13.250 1.00 0.00 H ATOM 3207 HG2 GLN A 217 -50.693 -0.220 10.678 1.00 0.00 H ATOM 3208 HG3 GLN A 217 -50.890 -1.924 11.153 1.00 0.00 H ATOM 3209 HE22 GLN A 217 -52.110 -2.270 13.328 1.00 0.00 H ATOM 3210 HE21 GLN A 217 -53.546 -1.211 13.578 1.00 0.00 H ATOM 3211 H GLN A 217 -48.942 1.339 11.129 1.00 0.00 H ATOM 3212 N SER A 218 -47.260 0.667 14.038 1.00 23.31 N ATOM 3213 CA SER A 218 -46.305 0.749 15.139 1.00 23.61 C ATOM 3214 C SER A 218 -46.505 2.056 15.926 1.00 23.28 C ATOM 3215 O SER A 218 -46.363 2.069 17.131 1.00 22.38 O ATOM 3216 CB SER A 218 -44.871 0.673 14.628 1.00 23.21 C ATOM 3217 OG SER A 218 -44.646 1.713 13.709 1.00 25.34 O ATOM 3218 HA SER A 218 -46.484 -0.100 15.799 1.00 0.00 H ATOM 3219 HB2 SER A 218 -44.710 -0.287 14.138 1.00 0.00 H ATOM 3220 HB3 SER A 218 -44.181 0.772 15.466 1.00 0.00 H ATOM 3221 HG SER A 218 -45.273 1.621 12.949 1.00 0.00 H ATOM 3222 H SER A 218 -46.920 0.675 13.055 1.00 0.00 H ATOM 3223 N THR A 219 -46.796 3.151 15.234 1.00 24.96 N ATOM 3224 CA THR A 219 -47.083 4.425 15.905 1.00 25.96 C ATOM 3225 C THR A 219 -48.284 4.262 16.857 1.00 27.69 C ATOM 3226 O THR A 219 -48.232 4.677 18.019 1.00 29.39 O ATOM 3227 CB THR A 219 -47.336 5.558 14.889 1.00 26.54 C ATOM 3228 OG1 THR A 219 -46.103 5.888 14.232 1.00 27.52 O ATOM 3229 CG2 THR A 219 -47.871 6.821 15.567 1.00 27.50 C ATOM 3230 HA THR A 219 -46.206 4.705 16.489 1.00 0.00 H ATOM 3231 HB THR A 219 -48.081 5.203 14.177 1.00 0.00 H ATOM 3232 HG1 THR A 219 -45.758 5.089 13.760 1.00 0.00 H ATOM 3233 HG23 THR A 219 -48.809 6.591 16.073 1.00 0.00 H ATOM 3234 HG21 THR A 219 -47.142 7.178 16.295 1.00 0.00 H ATOM 3235 HG22 THR A 219 -48.042 7.591 14.815 1.00 0.00 H ATOM 3236 H THR A 219 -46.821 3.105 14.195 1.00 0.00 H ATOM 3237 N LEU A 220 -49.352 3.633 16.379 1.00 27.67 N ATOM 3238 CA LEU A 220 -50.527 3.422 17.218 1.00 28.21 C ATOM 3239 C LEU A 220 -50.120 2.651 18.452 1.00 27.99 C ATOM 3240 O LEU A 220 -50.450 3.044 19.578 1.00 26.63 O ATOM 3241 CB LEU A 220 -51.635 2.665 16.471 1.00 28.50 C ATOM 3242 CG LEU A 220 -52.918 2.443 17.287 1.00 28.74 C ATOM 3243 CD1 LEU A 220 -53.524 3.781 17.695 1.00 28.99 C ATOM 3244 CD2 LEU A 220 -53.919 1.617 16.500 1.00 29.28 C ATOM 3245 HA LEU A 220 -50.928 4.397 17.496 1.00 0.00 H ATOM 3246 HB2 LEU A 220 -51.894 3.234 15.578 1.00 0.00 H ATOM 3247 HB3 LEU A 220 -51.244 1.690 16.179 1.00 0.00 H ATOM 3248 HG LEU A 220 -52.661 1.891 18.191 1.00 0.00 H ATOM 3249 HD21 LEU A 220 -54.174 2.139 15.578 1.00 0.00 H ATOM 3250 HD22 LEU A 220 -53.481 0.648 16.261 1.00 0.00 H ATOM 3251 HD23 LEU A 220 -54.819 1.473 17.098 1.00 0.00 H ATOM 3252 HD11 LEU A 220 -52.807 4.333 18.302 1.00 0.00 H ATOM 3253 HD12 LEU A 220 -53.765 4.357 16.801 1.00 0.00 H ATOM 3254 HD13 LEU A 220 -54.432 3.606 18.272 1.00 0.00 H ATOM 3255 H LEU A 220 -49.351 3.288 15.398 1.00 0.00 H ATOM 3256 N MET A 221 -49.428 1.534 18.233 1.00 27.88 N ATOM 3257 CA MET A 221 -48.924 0.711 19.331 1.00 27.83 C ATOM 3258 C MET A 221 -48.101 1.490 20.339 1.00 28.74 C ATOM 3259 O MET A 221 -48.276 1.323 21.553 1.00 28.44 O ATOM 3260 CB MET A 221 -48.057 -0.438 18.792 1.00 28.71 C ATOM 3261 CG MET A 221 -48.817 -1.721 18.585 1.00 30.05 C ATOM 3262 SD MET A 221 -49.605 -2.256 20.123 1.00 32.27 S ATOM 3263 CE MET A 221 -48.178 -2.628 21.150 1.00 32.91 C ATOM 3264 HA MET A 221 -49.809 0.329 19.839 1.00 0.00 H ATOM 3265 HB2 MET A 221 -47.632 -0.131 17.836 1.00 0.00 H ATOM 3266 HB3 MET A 221 -47.252 -0.625 19.502 1.00 0.00 H ATOM 3267 HG2 MET A 221 -48.127 -2.495 18.248 1.00 0.00 H ATOM 3268 HG3 MET A 221 -49.584 -1.564 17.826 1.00 0.00 H ATOM 3269 HE1 MET A 221 -47.584 -3.410 20.676 1.00 0.00 H ATOM 3270 HE2 MET A 221 -47.572 -1.730 21.267 1.00 0.00 H ATOM 3271 HE3 MET A 221 -48.515 -2.970 22.129 1.00 0.00 H ATOM 3272 H MET A 221 -49.241 1.239 17.253 1.00 0.00 H ATOM 3273 N VAL A 222 -47.201 2.334 19.840 1.00 28.44 N ATOM 3274 CA VAL A 222 -46.227 2.988 20.701 1.00 28.78 C ATOM 3275 C VAL A 222 -46.917 4.015 21.569 1.00 30.79 C ATOM 3276 O VAL A 222 -46.622 4.102 22.755 1.00 32.40 O ATOM 3277 CB VAL A 222 -45.079 3.630 19.881 1.00 28.39 C ATOM 3278 CG1 VAL A 222 -44.232 4.562 20.730 1.00 28.77 C ATOM 3279 CG2 VAL A 222 -44.205 2.540 19.282 1.00 30.02 C ATOM 3280 HA VAL A 222 -45.775 2.232 21.342 1.00 0.00 H ATOM 3281 HB VAL A 222 -45.529 4.224 19.085 1.00 0.00 H ATOM 3282 HG11 VAL A 222 -44.859 5.361 21.126 1.00 0.00 H ATOM 3283 HG12 VAL A 222 -43.792 4.001 21.555 1.00 0.00 H ATOM 3284 HG13 VAL A 222 -43.439 4.990 20.117 1.00 0.00 H ATOM 3285 HG21 VAL A 222 -43.782 1.934 20.083 1.00 0.00 H ATOM 3286 HG22 VAL A 222 -44.809 1.910 18.628 1.00 0.00 H ATOM 3287 HG23 VAL A 222 -43.400 2.997 18.707 1.00 0.00 H ATOM 3288 H VAL A 222 -47.194 2.529 18.819 1.00 0.00 H ATOM 3289 N GLU A 223 -47.810 4.797 20.965 1.00 33.60 N ATOM 3290 CA GLU A 223 -48.606 5.804 21.676 1.00 34.80 C ATOM 3291 C GLU A 223 -49.347 5.194 22.842 1.00 34.69 C ATOM 3292 O GLU A 223 -49.343 5.711 23.947 1.00 36.74 O ATOM 3293 CB GLU A 223 -49.658 6.395 20.743 1.00 35.26 C ATOM 3294 CG GLU A 223 -49.276 7.695 20.080 1.00 35.54 C ATOM 3295 CD GLU A 223 -50.508 8.533 19.822 1.00 37.05 C ATOM 3296 OE1 GLU A 223 -50.969 8.560 18.664 1.00 37.70 O ATOM 3297 OE2 GLU A 223 -51.042 9.125 20.783 1.00 37.21 O ATOM 3298 HA GLU A 223 -47.913 6.568 22.028 1.00 0.00 H ATOM 3299 HB2 GLU A 223 -49.862 5.665 19.960 1.00 0.00 H ATOM 3300 HB3 GLU A 223 -50.565 6.567 21.323 1.00 0.00 H ATOM 3301 HG2 GLU A 223 -48.596 8.245 20.731 1.00 0.00 H ATOM 3302 HG3 GLU A 223 -48.779 7.484 19.133 1.00 0.00 H ATOM 3303 H GLU A 223 -47.950 4.689 19.940 1.00 0.00 H ATOM 3304 N THR A 224 -50.004 4.079 22.561 1.00 34.35 N ATOM 3305 CA THR A 224 -50.788 3.368 23.540 1.00 35.19 C ATOM 3306 C THR A 224 -49.902 2.813 24.639 1.00 35.82 C ATOM 3307 O THR A 224 -50.236 2.905 25.819 1.00 35.26 O ATOM 3308 CB THR A 224 -51.548 2.223 22.866 1.00 34.65 C ATOM 3309 OG1 THR A 224 -52.311 2.768 21.781 1.00 35.15 O ATOM 3310 CG2 THR A 224 -52.481 1.514 23.854 1.00 35.01 C ATOM 3311 HA THR A 224 -51.498 4.066 23.984 1.00 0.00 H ATOM 3312 HB THR A 224 -50.833 1.485 22.502 1.00 0.00 H ATOM 3313 HG1 THR A 224 -51.699 3.199 21.133 1.00 0.00 H ATOM 3314 HG23 THR A 224 -51.894 1.103 24.675 1.00 0.00 H ATOM 3315 HG21 THR A 224 -53.205 2.229 24.245 1.00 0.00 H ATOM 3316 HG22 THR A 224 -53.006 0.708 23.342 1.00 0.00 H ATOM 3317 H THR A 224 -49.952 3.700 21.594 1.00 0.00 H ATOM 3318 N LEU A 225 -48.775 2.230 24.235 1.00 35.54 N ATOM 3319 CA LEU A 225 -47.804 1.658 25.163 1.00 34.00 C ATOM 3320 C LEU A 225 -47.241 2.715 26.113 1.00 33.61 C ATOM 3321 O LEU A 225 -47.126 2.472 27.316 1.00 34.04 O ATOM 3322 CB LEU A 225 -46.668 0.990 24.374 1.00 32.00 C ATOM 3323 CG LEU A 225 -45.532 0.402 25.194 1.00 32.09 C ATOM 3324 CD1 LEU A 225 -46.057 -0.477 26.313 1.00 31.20 C ATOM 3325 CD2 LEU A 225 -44.619 -0.393 24.272 1.00 34.05 C ATOM 3326 HA LEU A 225 -48.314 0.911 25.771 1.00 0.00 H ATOM 3327 HB2 LEU A 225 -47.103 0.184 23.783 1.00 0.00 H ATOM 3328 HB3 LEU A 225 -46.242 1.739 23.706 1.00 0.00 H ATOM 3329 HG LEU A 225 -44.971 1.214 25.657 1.00 0.00 H ATOM 3330 HD21 LEU A 225 -45.188 -1.195 23.802 1.00 0.00 H ATOM 3331 HD22 LEU A 225 -44.216 0.267 23.504 1.00 0.00 H ATOM 3332 HD23 LEU A 225 -43.800 -0.819 24.852 1.00 0.00 H ATOM 3333 HD11 LEU A 225 -46.690 0.116 26.973 1.00 0.00 H ATOM 3334 HD12 LEU A 225 -46.638 -1.295 25.888 1.00 0.00 H ATOM 3335 HD13 LEU A 225 -45.218 -0.881 26.880 1.00 0.00 H ATOM 3336 H LEU A 225 -48.578 2.180 23.215 1.00 0.00 H ATOM 3337 N VAL A 226 -46.898 3.878 25.573 1.00 32.13 N ATOM 3338 CA VAL A 226 -46.366 4.983 26.368 1.00 36.67 C ATOM 3339 C VAL A 226 -47.394 5.462 27.400 1.00 41.21 C ATOM 3340 O VAL A 226 -47.062 5.688 28.569 1.00 42.58 O ATOM 3341 CB VAL A 226 -45.960 6.166 25.460 1.00 37.24 C ATOM 3342 CG1 VAL A 226 -45.868 7.477 26.244 1.00 38.56 C ATOM 3343 CG2 VAL A 226 -44.649 5.855 24.745 1.00 36.34 C ATOM 3344 HA VAL A 226 -45.484 4.615 26.892 1.00 0.00 H ATOM 3345 HB VAL A 226 -46.740 6.300 24.711 1.00 0.00 H ATOM 3346 HG11 VAL A 226 -46.838 7.702 26.688 1.00 0.00 H ATOM 3347 HG12 VAL A 226 -45.121 7.376 27.031 1.00 0.00 H ATOM 3348 HG13 VAL A 226 -45.580 8.283 25.569 1.00 0.00 H ATOM 3349 HG21 VAL A 226 -43.865 5.686 25.483 1.00 0.00 H ATOM 3350 HG22 VAL A 226 -44.773 4.961 24.134 1.00 0.00 H ATOM 3351 HG23 VAL A 226 -44.375 6.697 24.109 1.00 0.00 H ATOM 3352 H VAL A 226 -47.012 4.008 24.547 1.00 0.00 H ATOM 3353 N GLN A 227 -48.636 5.623 26.952 1.00 43.38 N ATOM 3354 CA GLN A 227 -49.754 5.934 27.852 1.00 47.25 C ATOM 3355 C GLN A 227 -49.866 4.930 29.000 1.00 45.51 C ATOM 3356 O GLN A 227 -49.989 5.322 30.162 1.00 48.13 O ATOM 3357 CB GLN A 227 -51.073 5.985 27.071 1.00 49.45 C ATOM 3358 CG GLN A 227 -51.462 7.385 26.637 1.00 52.71 C ATOM 3359 CD GLN A 227 -51.801 8.277 27.816 1.00 57.22 C ATOM 3360 OE1 GLN A 227 -51.491 9.469 27.824 1.00 60.79 O ATOM 3361 NE2 GLN A 227 -52.423 7.696 28.831 1.00 58.76 N ATOM 3362 HA GLN A 227 -49.552 6.913 28.287 1.00 0.00 H ATOM 3363 HB2 GLN A 227 -50.973 5.363 26.182 1.00 0.00 H ATOM 3364 HB3 GLN A 227 -51.866 5.587 27.704 1.00 0.00 H ATOM 3365 HG2 GLN A 227 -50.629 7.827 26.090 1.00 0.00 H ATOM 3366 HG3 GLN A 227 -52.332 7.321 25.983 1.00 0.00 H ATOM 3367 HE22 GLN A 227 -52.666 6.686 28.782 1.00 0.00 H ATOM 3368 HE21 GLN A 227 -52.668 8.250 29.676 1.00 0.00 H ATOM 3369 H GLN A 227 -48.821 5.526 25.933 1.00 0.00 H ATOM 3370 N LYS A 228 -49.799 3.645 28.661 1.00 43.74 N ATOM 3371 CA LYS A 228 -49.960 2.559 29.618 1.00 43.05 C ATOM 3372 C LYS A 228 -48.803 2.399 30.610 1.00 44.61 C ATOM 3373 O LYS A 228 -48.977 1.795 31.671 1.00 41.89 O ATOM 3374 CB LYS A 228 -50.157 1.247 28.868 1.00 42.92 C ATOM 3375 CG LYS A 228 -50.322 0.030 29.765 1.00 45.68 C ATOM 3376 CD LYS A 228 -50.676 -1.223 28.973 1.00 48.66 C ATOM 3377 CE LYS A 228 -52.000 -1.096 28.222 1.00 50.88 C ATOM 3378 NZ LYS A 228 -53.102 -0.574 29.081 1.00 53.58 N ATOM 3379 HA LYS A 228 -50.835 2.820 30.214 1.00 0.00 H ATOM 3380 HB2 LYS A 228 -51.050 1.338 28.249 1.00 0.00 H ATOM 3381 HB3 LYS A 228 -49.289 1.085 28.229 1.00 0.00 H ATOM 3382 HG2 LYS A 228 -49.387 -0.143 30.298 1.00 0.00 H ATOM 3383 HG3 LYS A 228 -51.117 0.228 30.484 1.00 0.00 H ATOM 3384 HD2 LYS A 228 -49.883 -1.414 28.250 1.00 0.00 H ATOM 3385 HD3 LYS A 228 -50.747 -2.063 29.664 1.00 0.00 H ATOM 3386 HE2 LYS A 228 -52.285 -2.080 27.848 1.00 0.00 H ATOM 3387 HE3 LYS A 228 -51.861 -0.416 27.382 1.00 0.00 H ATOM 3388 HZ1 LYS A 228 -53.251 -1.220 29.883 1.00 0.00 H ATOM 3389 HZ2 LYS A 228 -52.845 0.369 29.437 1.00 0.00 H ATOM 3390 HZ3 LYS A 228 -53.976 -0.508 28.520 1.00 0.00 H ATOM 3391 H LYS A 228 -49.623 3.405 27.665 1.00 0.00 H ATOM 3392 N LEU A 229 -47.621 2.896 30.260 1.00 43.74 N ATOM 3393 CA LEU A 229 -46.482 2.855 31.181 1.00 44.99 C ATOM 3394 C LEU A 229 -46.522 4.008 32.181 1.00 45.74 C ATOM 3395 O LEU A 229 -46.140 3.832 33.337 1.00 53.13 O ATOM 3396 CB LEU A 229 -45.159 2.880 30.416 1.00 42.23 C ATOM 3397 CG LEU A 229 -44.908 1.683 29.509 1.00 41.82 C ATOM 3398 CD1 LEU A 229 -43.754 2.020 28.576 1.00 42.14 C ATOM 3399 CD2 LEU A 229 -44.646 0.406 30.295 1.00 41.07 C ATOM 3400 HA LEU A 229 -46.555 1.919 31.736 1.00 0.00 H ATOM 3401 HB2 LEU A 229 -45.143 3.779 29.800 1.00 0.00 H ATOM 3402 HB3 LEU A 229 -44.349 2.926 31.144 1.00 0.00 H ATOM 3403 HG LEU A 229 -45.806 1.485 28.924 1.00 0.00 H ATOM 3404 HD21 LEU A 229 -43.767 0.543 30.925 1.00 0.00 H ATOM 3405 HD22 LEU A 229 -45.511 0.181 30.919 1.00 0.00 H ATOM 3406 HD23 LEU A 229 -44.473 -0.417 29.602 1.00 0.00 H ATOM 3407 HD11 LEU A 229 -44.015 2.893 27.978 1.00 0.00 H ATOM 3408 HD12 LEU A 229 -42.863 2.235 29.166 1.00 0.00 H ATOM 3409 HD13 LEU A 229 -43.561 1.172 27.919 1.00 0.00 H ATOM 3410 H LEU A 229 -47.503 3.321 29.318 1.00 0.00 H ATOM 3411 N ALA A 230 -46.976 5.179 31.737 1.00 46.57 N ATOM 3412 CA ALA A 230 -47.123 6.348 32.613 1.00 51.98 C ATOM 3413 C ALA A 230 -48.258 6.181 33.634 1.00 52.57 C ATOM 3414 O ALA A 230 -48.989 5.188 33.614 1.00 53.01 O ATOM 3415 CB ALA A 230 -47.352 7.604 31.783 1.00 52.45 C ATOM 3416 HA ALA A 230 -46.194 6.442 33.175 1.00 0.00 H ATOM 3417 HB1 ALA A 230 -46.501 7.760 31.120 1.00 0.00 H ATOM 3418 HB2 ALA A 230 -48.259 7.486 31.190 1.00 0.00 H ATOM 3419 HB3 ALA A 230 -47.459 8.462 32.447 1.00 0.00 H ATOM 3420 H ALA A 230 -47.236 5.268 30.734 1.00 0.00 H TER 3421 ALA A 230 ATOM 3422 N MET B 1 -3.525 19.384 21.865 1.00 51.32 N ATOM 3423 CA MET B 1 -4.084 18.302 20.992 1.00 50.97 C ATOM 3424 C MET B 1 -4.185 16.953 21.719 1.00 45.48 C ATOM 3425 O MET B 1 -3.176 16.372 22.114 1.00 48.92 O ATOM 3426 CB MET B 1 -3.231 18.144 19.741 1.00 52.78 C ATOM 3427 CG MET B 1 -3.763 17.103 18.766 1.00 55.70 C ATOM 3428 SD MET B 1 -2.515 16.528 17.600 1.00 61.54 S ATOM 3429 CE MET B 1 -1.172 16.118 18.715 1.00 60.28 C ATOM 3430 HA MET B 1 -5.095 18.605 20.719 1.00 0.00 H ATOM 3431 HB2 MET B 1 -3.188 19.105 19.229 1.00 0.00 H ATOM 3432 HB3 MET B 1 -2.226 17.850 20.044 1.00 0.00 H ATOM 3433 HG2 MET B 1 -4.588 17.542 18.204 1.00 0.00 H ATOM 3434 HG3 MET B 1 -4.127 16.248 19.335 1.00 0.00 H ATOM 3435 HE1 MET B 1 -0.875 17.010 19.267 1.00 0.00 H ATOM 3436 HE2 MET B 1 -1.503 15.350 19.414 1.00 0.00 H ATOM 3437 HE3 MET B 1 -0.324 15.746 18.139 1.00 0.00 H ATOM 3438 HN3 MET B 1 -2.570 19.116 22.178 1.00 0.00 H ATOM 3439 HN2 MET B 1 -4.140 19.512 22.694 1.00 0.00 H ATOM 3440 HN1 MET B 1 -3.478 20.273 21.327 1.00 0.00 H ATOM 3441 N LYS B 2 -5.407 16.457 21.877 1.00 40.72 N ATOM 3442 CA LYS B 2 -5.652 15.191 22.560 1.00 35.59 C ATOM 3443 C LYS B 2 -5.926 14.100 21.546 1.00 33.34 C ATOM 3444 O LYS B 2 -6.794 14.251 20.675 1.00 30.90 O ATOM 3445 CB LYS B 2 -6.842 15.298 23.480 1.00 35.20 C ATOM 3446 CG LYS B 2 -7.150 13.984 24.182 1.00 35.35 C ATOM 3447 CD LYS B 2 -8.479 14.046 24.893 1.00 35.37 C ATOM 3448 CE LYS B 2 -8.443 15.055 26.022 1.00 35.60 C ATOM 3449 NZ LYS B 2 -9.540 14.824 26.995 1.00 35.97 N ATOM 3450 HA LYS B 2 -4.764 14.949 23.144 1.00 0.00 H ATOM 3451 HB2 LYS B 2 -6.636 16.058 24.233 1.00 0.00 H ATOM 3452 HB3 LYS B 2 -7.712 15.595 22.895 1.00 0.00 H ATOM 3453 HG2 LYS B 2 -7.178 13.183 23.443 1.00 0.00 H ATOM 3454 HG3 LYS B 2 -6.366 13.777 24.910 1.00 0.00 H ATOM 3455 HD2 LYS B 2 -9.252 14.335 24.181 1.00 0.00 H ATOM 3456 HD3 LYS B 2 -8.712 13.062 25.301 1.00 0.00 H ATOM 3457 HE2 LYS B 2 -8.544 16.057 25.605 1.00 0.00 H ATOM 3458 HE3 LYS B 2 -7.487 14.973 26.540 1.00 0.00 H ATOM 3459 HZ1 LYS B 2 -10.456 14.906 26.509 1.00 0.00 H ATOM 3460 HZ2 LYS B 2 -9.446 13.871 27.402 1.00 0.00 H ATOM 3461 HZ3 LYS B 2 -9.484 15.533 27.754 1.00 0.00 H ATOM 3462 H LYS B 2 -6.217 16.989 21.501 1.00 0.00 H ATOM 3463 N ILE B 3 -5.195 12.998 21.680 1.00 28.99 N ATOM 3464 CA ILE B 3 -5.263 11.889 20.726 1.00 28.04 C ATOM 3465 C ILE B 3 -6.084 10.753 21.332 1.00 25.46 C ATOM 3466 O ILE B 3 -5.750 10.240 22.401 1.00 25.50 O ATOM 3467 CB ILE B 3 -3.863 11.312 20.401 1.00 27.90 C ATOM 3468 CG1 ILE B 3 -2.830 12.437 20.142 1.00 29.27 C ATOM 3469 CG2 ILE B 3 -3.937 10.305 19.247 1.00 27.52 C ATOM 3470 CD1 ILE B 3 -3.076 13.279 18.922 1.00 30.47 C ATOM 3471 HA ILE B 3 -5.712 12.280 19.813 1.00 0.00 H ATOM 3472 HB ILE B 3 -3.511 10.767 21.277 1.00 0.00 H ATOM 3473 HG12 ILE B 3 -2.828 13.097 21.010 1.00 0.00 H ATOM 3474 HG13 ILE B 3 -1.849 11.974 20.037 1.00 0.00 H ATOM 3475 HD11 ILE B 3 -3.066 12.644 18.036 1.00 0.00 H ATOM 3476 HD12 ILE B 3 -4.046 13.768 19.009 1.00 0.00 H ATOM 3477 HD13 ILE B 3 -2.294 14.033 18.839 1.00 0.00 H ATOM 3478 HG21 ILE B 3 -4.598 9.484 19.525 1.00 0.00 H ATOM 3479 HG22 ILE B 3 -4.326 10.801 18.358 1.00 0.00 H ATOM 3480 HG23 ILE B 3 -2.940 9.917 19.041 1.00 0.00 H ATOM 3481 H ILE B 3 -4.551 12.920 22.493 1.00 0.00 H ATOM 3482 N GLY B 4 -7.149 10.371 20.633 1.00 23.74 N ATOM 3483 CA GLY B 4 -7.944 9.213 20.978 1.00 22.15 C ATOM 3484 C GLY B 4 -7.391 7.964 20.327 1.00 20.70 C ATOM 3485 O GLY B 4 -6.963 7.979 19.164 1.00 21.66 O ATOM 3486 HA3 GLY B 4 -8.968 9.369 20.639 1.00 0.00 H ATOM 3487 HA2 GLY B 4 -7.937 9.085 22.060 1.00 0.00 H ATOM 3488 H GLY B 4 -7.423 10.931 19.800 1.00 0.00 H ATOM 3489 N ILE B 5 -7.369 6.879 21.081 1.00 19.08 N ATOM 3490 CA ILE B 5 -6.879 5.615 20.568 1.00 17.79 C ATOM 3491 C ILE B 5 -7.914 4.561 20.957 1.00 17.68 C ATOM 3492 O ILE B 5 -8.397 4.540 22.094 1.00 17.33 O ATOM 3493 CB ILE B 5 -5.494 5.257 21.133 1.00 17.23 C ATOM 3494 CG1 ILE B 5 -4.478 6.399 20.923 1.00 16.28 C ATOM 3495 CG2 ILE B 5 -4.977 3.942 20.521 1.00 17.72 C ATOM 3496 CD1 ILE B 5 -3.320 6.369 21.907 1.00 15.38 C ATOM 3497 HA ILE B 5 -6.751 5.671 19.487 1.00 0.00 H ATOM 3498 HB ILE B 5 -5.606 5.115 22.208 1.00 0.00 H ATOM 3499 HG12 ILE B 5 -4.075 6.321 19.913 1.00 0.00 H ATOM 3500 HG13 ILE B 5 -5.000 7.350 21.033 1.00 0.00 H ATOM 3501 HD11 ILE B 5 -3.706 6.457 22.923 1.00 0.00 H ATOM 3502 HD12 ILE B 5 -2.780 5.428 21.802 1.00 0.00 H ATOM 3503 HD13 ILE B 5 -2.647 7.201 21.699 1.00 0.00 H ATOM 3504 HG21 ILE B 5 -5.672 3.136 20.755 1.00 0.00 H ATOM 3505 HG22 ILE B 5 -4.898 4.052 19.439 1.00 0.00 H ATOM 3506 HG23 ILE B 5 -3.996 3.710 20.936 1.00 0.00 H ATOM 3507 H ILE B 5 -7.710 6.933 22.062 1.00 0.00 H ATOM 3508 N ILE B 6 -8.265 3.702 20.007 1.00 17.14 N ATOM 3509 CA ILE B 6 -9.273 2.666 20.246 1.00 15.58 C ATOM 3510 C ILE B 6 -8.725 1.310 19.871 1.00 15.98 C ATOM 3511 O ILE B 6 -8.258 1.082 18.745 1.00 16.78 O ATOM 3512 CB ILE B 6 -10.555 2.908 19.424 1.00 15.37 C ATOM 3513 CG1 ILE B 6 -11.104 4.314 19.705 1.00 15.43 C ATOM 3514 CG2 ILE B 6 -11.587 1.794 19.689 1.00 14.63 C ATOM 3515 CD1 ILE B 6 -12.438 4.597 19.072 1.00 15.15 C ATOM 3516 HA ILE B 6 -9.520 2.704 21.307 1.00 0.00 H ATOM 3517 HB ILE B 6 -10.321 2.865 18.360 1.00 0.00 H ATOM 3518 HG12 ILE B 6 -11.206 4.431 20.784 1.00 0.00 H ATOM 3519 HG13 ILE B 6 -10.386 5.042 19.328 1.00 0.00 H ATOM 3520 HD11 ILE B 6 -12.354 4.498 17.990 1.00 0.00 H ATOM 3521 HD12 ILE B 6 -13.175 3.886 19.447 1.00 0.00 H ATOM 3522 HD13 ILE B 6 -12.750 5.611 19.322 1.00 0.00 H ATOM 3523 HG21 ILE B 6 -11.161 0.831 19.406 1.00 0.00 H ATOM 3524 HG22 ILE B 6 -11.843 1.782 20.748 1.00 0.00 H ATOM 3525 HG23 ILE B 6 -12.484 1.984 19.099 1.00 0.00 H ATOM 3526 H ILE B 6 -7.814 3.766 19.072 1.00 0.00 H ATOM 3527 N GLY B 7 -8.834 0.386 20.815 1.00 16.05 N ATOM 3528 CA GLY B 7 -8.518 -1.017 20.568 1.00 15.35 C ATOM 3529 C GLY B 7 -9.683 -1.864 21.066 1.00 16.29 C ATOM 3530 O GLY B 7 -10.421 -1.492 22.020 1.00 15.86 O ATOM 3531 HA3 GLY B 7 -7.608 -1.290 21.103 1.00 0.00 H ATOM 3532 HA2 GLY B 7 -8.373 -1.180 19.500 1.00 0.00 H ATOM 3533 H GLY B 7 -9.155 0.670 21.762 1.00 0.00 H ATOM 3534 N ALA B 8 -9.859 -3.001 20.434 1.00 15.63 N ATOM 3535 CA ALA B 8 -10.986 -3.872 20.747 1.00 16.87 C ATOM 3536 C ALA B 8 -10.733 -4.714 21.974 1.00 17.51 C ATOM 3537 O ALA B 8 -11.603 -4.845 22.825 1.00 16.71 O ATOM 3538 CB ALA B 8 -11.306 -4.770 19.558 1.00 16.64 C ATOM 3539 HA ALA B 8 -11.840 -3.229 20.960 1.00 0.00 H ATOM 3540 HB1 ALA B 8 -11.561 -4.153 18.696 1.00 0.00 H ATOM 3541 HB2 ALA B 8 -10.436 -5.383 19.323 1.00 0.00 H ATOM 3542 HB3 ALA B 8 -12.149 -5.414 19.807 1.00 0.00 H ATOM 3543 H ALA B 8 -9.183 -3.286 19.697 1.00 0.00 H ATOM 3544 N MET B 9 -9.552 -5.307 22.049 1.00 17.29 N ATOM 3545 CA MET B 9 -9.296 -6.349 23.045 1.00 18.66 C ATOM 3546 C MET B 9 -8.322 -5.876 24.107 1.00 18.67 C ATOM 3547 O MET B 9 -7.500 -4.995 23.872 1.00 17.17 O ATOM 3548 CB MET B 9 -8.727 -7.583 22.366 1.00 19.36 C ATOM 3549 CG MET B 9 -9.685 -8.232 21.390 1.00 19.87 C ATOM 3550 SD MET B 9 -8.841 -9.535 20.478 1.00 20.74 S ATOM 3551 CE MET B 9 -8.730 -10.794 21.748 1.00 19.54 C ATOM 3552 HA MET B 9 -10.245 -6.587 23.526 1.00 0.00 H ATOM 3553 HB2 MET B 9 -7.826 -7.295 21.825 1.00 0.00 H ATOM 3554 HB3 MET B 9 -8.470 -8.312 23.134 1.00 0.00 H ATOM 3555 HG2 MET B 9 -10.053 -7.481 20.691 1.00 0.00 H ATOM 3556 HG3 MET B 9 -10.525 -8.659 21.938 1.00 0.00 H ATOM 3557 HE1 MET B 9 -8.160 -10.407 22.593 1.00 0.00 H ATOM 3558 HE2 MET B 9 -9.733 -11.065 22.078 1.00 0.00 H ATOM 3559 HE3 MET B 9 -8.229 -11.674 21.343 1.00 0.00 H ATOM 3560 H MET B 9 -8.796 -5.029 21.391 1.00 0.00 H ATOM 3561 N GLU B 10 -8.412 -6.503 25.276 1.00 19.78 N ATOM 3562 CA GLU B 10 -7.419 -6.331 26.333 1.00 20.20 C ATOM 3563 C GLU B 10 -5.988 -6.474 25.804 1.00 19.73 C ATOM 3564 O GLU B 10 -5.139 -5.638 26.085 1.00 18.53 O ATOM 3565 CB GLU B 10 -7.672 -7.358 27.434 1.00 21.98 C ATOM 3566 CG GLU B 10 -6.614 -7.413 28.510 1.00 22.89 C ATOM 3567 CD GLU B 10 -6.548 -6.150 29.337 1.00 24.26 C ATOM 3568 OE1 GLU B 10 -7.446 -5.262 29.260 1.00 22.60 O ATOM 3569 OE2 GLU B 10 -5.549 -6.048 30.075 1.00 27.67 O ATOM 3570 HA GLU B 10 -7.520 -5.321 26.730 1.00 0.00 H ATOM 3571 HB2 GLU B 10 -8.624 -7.119 27.907 1.00 0.00 H ATOM 3572 HB3 GLU B 10 -7.735 -8.343 26.971 1.00 0.00 H ATOM 3573 HG2 GLU B 10 -6.834 -8.251 29.172 1.00 0.00 H ATOM 3574 HG3 GLU B 10 -5.645 -7.570 28.037 1.00 0.00 H ATOM 3575 H GLU B 10 -9.218 -7.138 25.444 1.00 0.00 H ATOM 3576 N GLU B 11 -5.737 -7.524 25.027 1.00 19.81 N ATOM 3577 CA GLU B 11 -4.408 -7.806 24.510 1.00 21.28 C ATOM 3578 C GLU B 11 -3.916 -6.735 23.548 1.00 19.66 C ATOM 3579 O GLU B 11 -2.708 -6.603 23.358 1.00 20.83 O ATOM 3580 CB GLU B 11 -4.343 -9.185 23.829 1.00 23.31 C ATOM 3581 CG GLU B 11 -4.631 -10.337 24.772 1.00 25.43 C ATOM 3582 CD GLU B 11 -6.094 -10.751 24.855 1.00 28.89 C ATOM 3583 OE1 GLU B 11 -7.017 -9.914 24.631 1.00 29.20 O ATOM 3584 OE2 GLU B 11 -6.321 -11.943 25.190 1.00 30.81 O ATOM 3585 HA GLU B 11 -3.747 -7.809 25.377 1.00 0.00 H ATOM 3586 HB2 GLU B 11 -5.076 -9.207 23.022 1.00 0.00 H ATOM 3587 HB3 GLU B 11 -3.344 -9.319 23.414 1.00 0.00 H ATOM 3588 HG2 GLU B 11 -4.054 -11.199 24.439 1.00 0.00 H ATOM 3589 HG3 GLU B 11 -4.304 -10.047 25.771 1.00 0.00 H ATOM 3590 H GLU B 11 -6.518 -8.165 24.781 1.00 0.00 H ATOM 3591 N GLU B 12 -4.840 -5.960 22.977 1.00 18.94 N ATOM 3592 CA GLU B 12 -4.491 -4.865 22.057 1.00 18.46 C ATOM 3593 C GLU B 12 -4.251 -3.523 22.718 1.00 17.97 C ATOM 3594 O GLU B 12 -3.621 -2.635 22.118 1.00 18.02 O ATOM 3595 CB GLU B 12 -5.568 -4.733 20.983 1.00 19.06 C ATOM 3596 CG GLU B 12 -5.658 -5.953 20.074 1.00 20.05 C ATOM 3597 CD GLU B 12 -6.894 -5.947 19.197 1.00 21.70 C ATOM 3598 OE1 GLU B 12 -7.954 -5.441 19.651 1.00 20.28 O ATOM 3599 OE2 GLU B 12 -6.820 -6.483 18.059 1.00 24.43 O ATOM 3600 HA GLU B 12 -3.532 -5.144 21.620 1.00 0.00 H ATOM 3601 HB2 GLU B 12 -6.532 -4.593 21.473 1.00 0.00 H ATOM 3602 HB3 GLU B 12 -5.343 -3.860 20.371 1.00 0.00 H ATOM 3603 HG2 GLU B 12 -4.777 -5.975 19.433 1.00 0.00 H ATOM 3604 HG3 GLU B 12 -5.676 -6.849 20.695 1.00 0.00 H ATOM 3605 H GLU B 12 -5.843 -6.136 23.190 1.00 0.00 H ATOM 3606 N VAL B 13 -4.782 -3.333 23.927 1.00 17.03 N ATOM 3607 CA VAL B 13 -4.625 -2.051 24.608 1.00 17.23 C ATOM 3608 C VAL B 13 -3.644 -2.074 25.768 1.00 17.03 C ATOM 3609 O VAL B 13 -3.180 -1.009 26.200 1.00 15.44 O ATOM 3610 CB VAL B 13 -5.975 -1.489 25.105 1.00 17.37 C ATOM 3611 CG1 VAL B 13 -6.926 -1.338 23.933 1.00 17.88 C ATOM 3612 CG2 VAL B 13 -6.568 -2.350 26.205 1.00 17.48 C ATOM 3613 HA VAL B 13 -4.209 -1.396 23.842 1.00 0.00 H ATOM 3614 HB VAL B 13 -5.805 -0.505 25.542 1.00 0.00 H ATOM 3615 HG11 VAL B 13 -6.495 -0.653 23.203 1.00 0.00 H ATOM 3616 HG12 VAL B 13 -7.087 -2.311 23.470 1.00 0.00 H ATOM 3617 HG13 VAL B 13 -7.877 -0.941 24.287 1.00 0.00 H ATOM 3618 HG21 VAL B 13 -6.733 -3.359 25.826 1.00 0.00 H ATOM 3619 HG22 VAL B 13 -5.878 -2.386 27.048 1.00 0.00 H ATOM 3620 HG23 VAL B 13 -7.517 -1.922 26.528 1.00 0.00 H ATOM 3621 H VAL B 13 -5.310 -4.102 24.387 1.00 0.00 H ATOM 3622 N THR B 14 -3.309 -3.274 26.237 1.00 17.51 N ATOM 3623 CA THR B 14 -2.601 -3.431 27.506 1.00 19.22 C ATOM 3624 C THR B 14 -1.235 -2.768 27.506 1.00 21.05 C ATOM 3625 O THR B 14 -0.856 -2.139 28.509 1.00 19.92 O ATOM 3626 CB THR B 14 -2.492 -4.904 27.942 1.00 19.84 C ATOM 3627 OG1 THR B 14 -1.865 -4.967 29.228 1.00 20.16 O ATOM 3628 CG2 THR B 14 -1.681 -5.763 26.944 1.00 20.91 C ATOM 3629 HA THR B 14 -3.213 -2.911 28.243 1.00 0.00 H ATOM 3630 HB THR B 14 -3.503 -5.309 27.977 1.00 0.00 H ATOM 3631 HG1 THR B 14 -1.793 -5.912 29.513 1.00 0.00 H ATOM 3632 HG23 THR B 14 -2.153 -5.720 25.962 1.00 0.00 H ATOM 3633 HG21 THR B 14 -0.664 -5.377 26.877 1.00 0.00 H ATOM 3634 HG22 THR B 14 -1.657 -6.796 27.292 1.00 0.00 H ATOM 3635 H THR B 14 -3.557 -4.121 25.687 1.00 0.00 H ATOM 3636 N LEU B 15 -0.498 -2.864 26.392 1.00 21.22 N ATOM 3637 CA LEU B 15 0.851 -2.278 26.352 1.00 21.95 C ATOM 3638 C LEU B 15 0.813 -0.747 26.355 1.00 22.27 C ATOM 3639 O LEU B 15 1.577 -0.093 27.093 1.00 22.85 O ATOM 3640 CB LEU B 15 1.649 -2.788 25.152 1.00 22.06 C ATOM 3641 CG LEU B 15 1.851 -4.288 25.090 1.00 22.95 C ATOM 3642 CD1 LEU B 15 2.410 -4.669 23.717 1.00 24.55 C ATOM 3643 CD2 LEU B 15 2.776 -4.745 26.193 1.00 24.27 C ATOM 3644 HA LEU B 15 1.356 -2.601 27.262 1.00 0.00 H ATOM 3645 HB2 LEU B 15 1.125 -2.482 24.246 1.00 0.00 H ATOM 3646 HB3 LEU B 15 2.632 -2.318 25.178 1.00 0.00 H ATOM 3647 HG LEU B 15 0.892 -4.786 25.233 1.00 0.00 H ATOM 3648 HD21 LEU B 15 3.742 -4.253 26.082 1.00 0.00 H ATOM 3649 HD22 LEU B 15 2.343 -4.486 27.159 1.00 0.00 H ATOM 3650 HD23 LEU B 15 2.908 -5.825 26.131 1.00 0.00 H ATOM 3651 HD11 LEU B 15 1.707 -4.363 22.942 1.00 0.00 H ATOM 3652 HD12 LEU B 15 3.364 -4.166 23.562 1.00 0.00 H ATOM 3653 HD13 LEU B 15 2.555 -5.748 23.672 1.00 0.00 H ATOM 3654 H LEU B 15 -0.879 -3.352 25.556 1.00 0.00 H ATOM 3655 N LEU B 16 -0.060 -0.171 25.534 1.00 20.85 N ATOM 3656 CA LEU B 16 -0.243 1.261 25.561 1.00 21.97 C ATOM 3657 C LEU B 16 -0.744 1.699 26.932 1.00 20.97 C ATOM 3658 O LEU B 16 -0.295 2.725 27.462 1.00 21.54 O ATOM 3659 CB LEU B 16 -1.219 1.737 24.484 1.00 21.79 C ATOM 3660 CG LEU B 16 -0.781 1.666 23.024 1.00 24.20 C ATOM 3661 CD1 LEU B 16 -1.982 1.833 22.092 1.00 23.71 C ATOM 3662 CD2 LEU B 16 0.297 2.704 22.701 1.00 24.63 C ATOM 3663 HA LEU B 16 0.727 1.715 25.357 1.00 0.00 H ATOM 3664 HB2 LEU B 16 -2.123 1.135 24.579 1.00 0.00 H ATOM 3665 HB3 LEU B 16 -1.454 2.779 24.700 1.00 0.00 H ATOM 3666 HG LEU B 16 -0.345 0.680 22.863 1.00 0.00 H ATOM 3667 HD21 LEU B 16 -0.094 3.703 22.893 1.00 0.00 H ATOM 3668 HD22 LEU B 16 1.170 2.527 23.329 1.00 0.00 H ATOM 3669 HD23 LEU B 16 0.579 2.618 21.652 1.00 0.00 H ATOM 3670 HD11 LEU B 16 -2.702 1.038 22.284 1.00 0.00 H ATOM 3671 HD12 LEU B 16 -2.450 2.801 22.274 1.00 0.00 H ATOM 3672 HD13 LEU B 16 -1.647 1.779 21.056 1.00 0.00 H ATOM 3673 H LEU B 16 -0.612 -0.753 24.872 1.00 0.00 H ATOM 3674 N ARG B 17 -1.668 0.939 27.508 1.00 20.90 N ATOM 3675 CA ARG B 17 -2.260 1.330 28.795 1.00 22.29 C ATOM 3676 C ARG B 17 -1.164 1.530 29.843 1.00 24.28 C ATOM 3677 O ARG B 17 -1.162 2.520 30.573 1.00 21.20 O ATOM 3678 CB ARG B 17 -3.249 0.267 29.288 1.00 22.05 C ATOM 3679 CG ARG B 17 -3.978 0.658 30.585 1.00 23.33 C ATOM 3680 CD ARG B 17 -5.109 -0.301 30.904 1.00 24.02 C ATOM 3681 NE ARG B 17 -4.629 -1.675 30.905 1.00 24.08 N ATOM 3682 CZ ARG B 17 -5.359 -2.753 30.639 1.00 24.86 C ATOM 3683 NH1 ARG B 17 -6.645 -2.674 30.344 1.00 26.30 N ATOM 3684 NH2 ARG B 17 -4.776 -3.935 30.671 1.00 24.72 N ATOM 3685 HA ARG B 17 -2.797 2.267 28.647 1.00 0.00 H ATOM 3686 HB2 ARG B 17 -3.994 0.102 28.510 1.00 0.00 H ATOM 3687 HB3 ARG B 17 -2.701 -0.658 29.466 1.00 0.00 H ATOM 3688 HG2 ARG B 17 -3.264 0.649 31.408 1.00 0.00 H ATOM 3689 HG3 ARG B 17 -4.387 1.662 30.472 1.00 0.00 H ATOM 3690 HD2 ARG B 17 -5.892 -0.195 30.153 1.00 0.00 H ATOM 3691 HD3 ARG B 17 -5.515 -0.062 31.887 1.00 0.00 H ATOM 3692 HE ARG B 17 -3.626 -1.827 31.134 1.00 0.00 H ATOM 3693 HH12 ARG B 17 -7.186 -3.539 30.141 1.00 0.00 H ATOM 3694 HH11 ARG B 17 -7.116 -1.747 30.315 1.00 0.00 H ATOM 3695 HH22 ARG B 17 -5.328 -4.793 30.466 1.00 0.00 H ATOM 3696 HH21 ARG B 17 -3.765 -4.010 30.901 1.00 0.00 H ATOM 3697 H ARG B 17 -1.975 0.060 27.045 1.00 0.00 H ATOM 3698 N ASP B 18 -0.225 0.584 29.875 1.00 26.92 N ATOM 3699 CA ASP B 18 0.858 0.581 30.861 1.00 29.51 C ATOM 3700 C ASP B 18 1.862 1.695 30.687 1.00 27.29 C ATOM 3701 O ASP B 18 2.613 1.970 31.615 1.00 26.57 O ATOM 3702 CB ASP B 18 1.588 -0.758 30.836 1.00 32.20 C ATOM 3703 CG ASP B 18 0.725 -1.886 31.343 1.00 35.47 C ATOM 3704 OD1 ASP B 18 -0.339 -1.601 31.944 1.00 41.92 O ATOM 3705 OD2 ASP B 18 1.104 -3.059 31.135 1.00 42.06 O ATOM 3706 HA ASP B 18 0.374 0.746 31.824 1.00 0.00 H ATOM 3707 HB2 ASP B 18 1.886 -0.977 29.811 1.00 0.00 H ATOM 3708 HB3 ASP B 18 2.476 -0.686 31.463 1.00 0.00 H ATOM 3709 H ASP B 18 -0.263 -0.182 29.172 1.00 0.00 H ATOM 3710 N LYS B 19 1.870 2.327 29.519 1.00 24.69 N ATOM 3711 CA LYS B 19 2.709 3.491 29.269 1.00 25.29 C ATOM 3712 C LYS B 19 2.079 4.842 29.647 1.00 22.41 C ATOM 3713 O LYS B 19 2.753 5.848 29.543 1.00 22.55 O ATOM 3714 CB LYS B 19 3.129 3.551 27.790 1.00 26.86 C ATOM 3715 CG LYS B 19 4.151 2.494 27.410 1.00 30.50 C ATOM 3716 CD LYS B 19 4.341 2.431 25.906 1.00 34.19 C ATOM 3717 CE LYS B 19 5.250 1.272 25.510 1.00 36.06 C ATOM 3718 NZ LYS B 19 6.680 1.652 25.660 1.00 38.34 N ATOM 3719 HA LYS B 19 3.568 3.348 29.924 1.00 0.00 H ATOM 3720 HB2 LYS B 19 2.242 3.412 27.173 1.00 0.00 H ATOM 3721 HB3 LYS B 19 3.558 4.533 27.592 1.00 0.00 H ATOM 3722 HG2 LYS B 19 5.105 2.736 27.879 1.00 0.00 H ATOM 3723 HG3 LYS B 19 3.808 1.523 27.766 1.00 0.00 H ATOM 3724 HD2 LYS B 19 3.369 2.299 25.430 1.00 0.00 H ATOM 3725 HD3 LYS B 19 4.787 3.365 25.565 1.00 0.00 H ATOM 3726 HE2 LYS B 19 5.057 1.004 24.471 1.00 0.00 H ATOM 3727 HE3 LYS B 19 5.038 0.415 26.150 1.00 0.00 H ATOM 3728 HZ1 LYS B 19 6.887 2.467 25.048 1.00 0.00 H ATOM 3729 HZ2 LYS B 19 6.868 1.905 26.651 1.00 0.00 H ATOM 3730 HZ3 LYS B 19 7.281 0.849 25.385 1.00 0.00 H ATOM 3731 H LYS B 19 1.255 1.978 28.756 1.00 0.00 H ATOM 3732 N ILE B 20 0.806 4.891 30.050 1.00 21.46 N ATOM 3733 CA ILE B 20 0.137 6.189 30.302 1.00 20.93 C ATOM 3734 C ILE B 20 0.489 6.747 31.685 1.00 21.27 C ATOM 3735 O ILE B 20 0.342 6.068 32.684 1.00 19.18 O ATOM 3736 CB ILE B 20 -1.408 6.089 30.193 1.00 20.68 C ATOM 3737 CG1 ILE B 20 -1.821 5.664 28.768 1.00 20.06 C ATOM 3738 CG2 ILE B 20 -2.045 7.436 30.540 1.00 21.50 C ATOM 3739 CD1 ILE B 20 -3.296 5.369 28.576 1.00 19.17 C ATOM 3740 HA ILE B 20 0.504 6.863 29.528 1.00 0.00 H ATOM 3741 HB ILE B 20 -1.759 5.335 30.898 1.00 0.00 H ATOM 3742 HG12 ILE B 20 -1.547 6.468 28.085 1.00 0.00 H ATOM 3743 HG13 ILE B 20 -1.262 4.764 28.510 1.00 0.00 H ATOM 3744 HD11 ILE B 20 -3.592 4.555 29.238 1.00 0.00 H ATOM 3745 HD12 ILE B 20 -3.877 6.260 28.812 1.00 0.00 H ATOM 3746 HD13 ILE B 20 -3.476 5.080 27.540 1.00 0.00 H ATOM 3747 HG21 ILE B 20 -1.774 7.713 31.559 1.00 0.00 H ATOM 3748 HG22 ILE B 20 -1.684 8.196 29.847 1.00 0.00 H ATOM 3749 HG23 ILE B 20 -3.129 7.355 30.460 1.00 0.00 H ATOM 3750 H ILE B 20 0.277 4.006 30.189 1.00 0.00 H ATOM 3751 N ASP B 21 0.942 7.990 31.732 1.00 22.44 N ATOM 3752 CA ASP B 21 1.230 8.647 33.013 1.00 23.95 C ATOM 3753 C ASP B 21 -0.035 9.295 33.517 1.00 23.25 C ATOM 3754 O ASP B 21 -0.893 9.643 32.718 1.00 23.63 O ATOM 3755 CB ASP B 21 2.309 9.717 32.840 1.00 24.60 C ATOM 3756 CG ASP B 21 3.672 9.125 32.435 1.00 26.98 C ATOM 3757 OD1 ASP B 21 4.116 8.138 33.060 1.00 25.69 O ATOM 3758 OD2 ASP B 21 4.297 9.665 31.497 1.00 28.59 O ATOM 3759 HA ASP B 21 1.590 7.903 33.724 1.00 0.00 H ATOM 3760 HB2 ASP B 21 1.988 10.415 32.067 1.00 0.00 H ATOM 3761 HB3 ASP B 21 2.426 10.250 33.783 1.00 0.00 H ATOM 3762 H ASP B 21 1.097 8.511 30.845 1.00 0.00 H ATOM 3763 N ASN B 22 -0.137 9.501 34.834 1.00 22.28 N ATOM 3764 CA ASN B 22 -1.300 10.197 35.414 1.00 22.30 C ATOM 3765 C ASN B 22 -2.598 9.546 34.962 1.00 21.59 C ATOM 3766 O ASN B 22 -3.567 10.215 34.623 1.00 20.93 O ATOM 3767 CB ASN B 22 -1.284 11.667 35.016 1.00 21.26 C ATOM 3768 CG ASN B 22 -0.037 12.379 35.497 1.00 21.90 C ATOM 3769 OD1 ASN B 22 0.454 12.103 36.594 1.00 21.64 O ATOM 3770 ND2 ASN B 22 0.481 13.297 34.687 1.00 20.49 N ATOM 3771 HA ASN B 22 -1.238 10.123 36.500 1.00 0.00 H ATOM 3772 HB2 ASN B 22 -1.331 11.737 33.929 1.00 0.00 H ATOM 3773 HB3 ASN B 22 -2.157 12.157 35.448 1.00 0.00 H ATOM 3774 HD22 ASN B 22 0.031 13.495 33.771 1.00 0.00 H ATOM 3775 HD21 ASN B 22 1.336 13.817 34.970 1.00 0.00 H ATOM 3776 H ASN B 22 0.620 9.163 35.462 1.00 0.00 H ATOM 3777 N ARG B 23 -2.586 8.225 34.934 1.00 23.04 N ATOM 3778 CA ARG B 23 -3.676 7.461 34.360 1.00 23.59 C ATOM 3779 C ARG B 23 -4.952 7.511 35.199 1.00 23.39 C ATOM 3780 O ARG B 23 -4.936 7.249 36.406 1.00 21.21 O ATOM 3781 CB ARG B 23 -3.281 5.999 34.194 1.00 24.49 C ATOM 3782 CG ARG B 23 -4.194 5.281 33.217 1.00 26.99 C ATOM 3783 CD ARG B 23 -3.666 3.910 32.859 1.00 27.92 C ATOM 3784 NE ARG B 23 -3.736 3.019 34.004 1.00 29.71 N ATOM 3785 CZ ARG B 23 -2.721 2.298 34.477 1.00 34.18 C ATOM 3786 NH1 ARG B 23 -1.512 2.319 33.903 1.00 35.49 N ATOM 3787 NH2 ARG B 23 -2.918 1.522 35.533 1.00 36.60 N ATOM 3788 HA ARG B 23 -3.879 7.923 33.394 1.00 0.00 H ATOM 3789 HB2 ARG B 23 -2.257 5.949 33.824 1.00 0.00 H ATOM 3790 HB3 ARG B 23 -3.340 5.504 35.163 1.00 0.00 H ATOM 3791 HG2 ARG B 23 -5.180 5.173 33.669 1.00 0.00 H ATOM 3792 HG3 ARG B 23 -4.276 5.876 32.308 1.00 0.00 H ATOM 3793 HD2 ARG B 23 -2.628 3.998 32.537 1.00 0.00 H ATOM 3794 HD3 ARG B 23 -4.264 3.497 32.046 1.00 0.00 H ATOM 3795 HE ARG B 23 -4.650 2.938 34.493 1.00 0.00 H ATOM 3796 HH12 ARG B 23 -0.740 1.744 34.296 1.00 0.00 H ATOM 3797 HH11 ARG B 23 -1.345 2.910 33.064 1.00 0.00 H ATOM 3798 HH22 ARG B 23 -2.135 0.953 35.914 1.00 0.00 H ATOM 3799 HH21 ARG B 23 -3.856 1.482 35.981 1.00 0.00 H ATOM 3800 H ARG B 23 -1.771 7.719 35.335 1.00 0.00 H ATOM 3801 N GLN B 24 -6.060 7.820 34.536 1.00 23.53 N ATOM 3802 CA GLN B 24 -7.385 7.615 35.128 1.00 24.41 C ATOM 3803 C GLN B 24 -8.151 6.567 34.326 1.00 24.93 C ATOM 3804 O GLN B 24 -7.924 6.437 33.117 1.00 21.56 O ATOM 3805 CB GLN B 24 -8.136 8.924 35.140 1.00 25.12 C ATOM 3806 CG GLN B 24 -7.487 9.922 36.060 1.00 26.64 C ATOM 3807 CD GLN B 24 -8.275 11.196 36.169 1.00 26.47 C ATOM 3808 OE1 GLN B 24 -9.391 11.207 36.664 1.00 28.35 O ATOM 3809 NE2 GLN B 24 -7.701 12.273 35.676 1.00 27.84 N ATOM 3810 HA GLN B 24 -7.279 7.259 36.153 1.00 0.00 H ATOM 3811 HB2 GLN B 24 -8.154 9.332 34.129 1.00 0.00 H ATOM 3812 HB3 GLN B 24 -9.157 8.744 35.476 1.00 0.00 H ATOM 3813 HG2 GLN B 24 -7.399 9.479 37.052 1.00 0.00 H ATOM 3814 HG3 GLN B 24 -6.493 10.156 35.678 1.00 0.00 H ATOM 3815 HE22 GLN B 24 -6.748 12.212 35.265 1.00 0.00 H ATOM 3816 HE21 GLN B 24 -8.201 13.185 35.698 1.00 0.00 H ATOM 3817 H GLN B 24 -5.986 8.216 33.577 1.00 0.00 H ATOM 3818 N THR B 25 -9.015 5.811 35.006 1.00 24.72 N ATOM 3819 CA THR B 25 -9.890 4.831 34.357 1.00 26.57 C ATOM 3820 C THR B 25 -11.337 5.245 34.531 1.00 28.45 C ATOM 3821 O THR B 25 -11.782 5.537 35.651 1.00 27.65 O ATOM 3822 CB THR B 25 -9.680 3.406 34.895 1.00 26.47 C ATOM 3823 OG1 THR B 25 -8.310 3.037 34.718 1.00 26.31 O ATOM 3824 CG2 THR B 25 -10.570 2.388 34.142 1.00 27.22 C ATOM 3825 HA THR B 25 -9.632 4.813 33.298 1.00 0.00 H ATOM 3826 HB THR B 25 -9.951 3.394 35.951 1.00 0.00 H ATOM 3827 HG1 THR B 25 -8.169 2.120 35.063 1.00 0.00 H ATOM 3828 HG23 THR B 25 -11.618 2.659 34.270 1.00 0.00 H ATOM 3829 HG21 THR B 25 -10.317 2.400 33.082 1.00 0.00 H ATOM 3830 HG22 THR B 25 -10.400 1.390 34.546 1.00 0.00 H ATOM 3831 H THR B 25 -9.070 5.922 36.039 1.00 0.00 H ATOM 3832 N ILE B 26 -12.044 5.309 33.406 1.00 29.59 N ATOM 3833 CA ILE B 26 -13.489 5.487 33.362 1.00 31.89 C ATOM 3834 C ILE B 26 -14.061 4.161 32.849 1.00 34.18 C ATOM 3835 O ILE B 26 -13.703 3.715 31.748 1.00 30.71 O ATOM 3836 CB ILE B 26 -13.875 6.632 32.402 1.00 33.91 C ATOM 3837 CG1 ILE B 26 -13.059 7.898 32.691 1.00 35.59 C ATOM 3838 CG2 ILE B 26 -15.361 6.965 32.505 1.00 35.17 C ATOM 3839 CD1 ILE B 26 -13.165 8.946 31.601 1.00 34.48 C ATOM 3840 HA ILE B 26 -13.880 5.748 34.345 1.00 0.00 H ATOM 3841 HB ILE B 26 -13.655 6.285 31.392 1.00 0.00 H ATOM 3842 HG12 ILE B 26 -13.415 8.333 33.625 1.00 0.00 H ATOM 3843 HG13 ILE B 26 -12.011 7.617 32.799 1.00 0.00 H ATOM 3844 HD11 ILE B 26 -12.801 8.529 30.662 1.00 0.00 H ATOM 3845 HD12 ILE B 26 -14.207 9.247 31.488 1.00 0.00 H ATOM 3846 HD13 ILE B 26 -12.563 9.813 31.873 1.00 0.00 H ATOM 3847 HG21 ILE B 26 -15.948 6.083 32.248 1.00 0.00 H ATOM 3848 HG22 ILE B 26 -15.593 7.273 33.524 1.00 0.00 H ATOM 3849 HG23 ILE B 26 -15.599 7.775 31.816 1.00 0.00 H ATOM 3850 H ILE B 26 -11.534 5.227 32.503 1.00 0.00 H ATOM 3851 N THR B 27 -14.912 3.521 33.653 1.00 33.77 N ATOM 3852 CA THR B 27 -15.562 2.270 33.292 1.00 35.74 C ATOM 3853 C THR B 27 -17.022 2.609 33.003 1.00 39.57 C ATOM 3854 O THR B 27 -17.688 3.204 33.838 1.00 38.63 O ATOM 3855 CB THR B 27 -15.456 1.228 34.431 1.00 35.99 C ATOM 3856 OG1 THR B 27 -14.085 0.955 34.732 1.00 35.88 O ATOM 3857 CG2 THR B 27 -16.089 -0.062 34.048 1.00 36.95 C ATOM 3858 HA THR B 27 -15.079 1.823 32.423 1.00 0.00 H ATOM 3859 HB THR B 27 -15.968 1.652 35.294 1.00 0.00 H ATOM 3860 HG1 THR B 27 -13.636 0.598 33.925 1.00 0.00 H ATOM 3861 HG23 THR B 27 -17.139 0.107 33.810 1.00 0.00 H ATOM 3862 HG21 THR B 27 -15.579 -0.471 33.176 1.00 0.00 H ATOM 3863 HG22 THR B 27 -16.011 -0.764 34.878 1.00 0.00 H ATOM 3864 H THR B 27 -15.121 3.936 34.583 1.00 0.00 H ATOM 3865 N LEU B 28 -17.519 2.277 31.812 1.00 42.21 N ATOM 3866 CA LEU B 28 -18.862 2.721 31.427 1.00 45.96 C ATOM 3867 C LEU B 28 -19.397 1.997 30.208 1.00 47.87 C ATOM 3868 O LEU B 28 -18.749 1.952 29.177 1.00 48.06 O ATOM 3869 CB LEU B 28 -18.905 4.246 31.212 1.00 49.49 C ATOM 3870 CG LEU B 28 -17.749 4.962 30.495 1.00 53.53 C ATOM 3871 CD1 LEU B 28 -17.612 4.564 29.030 1.00 57.54 C ATOM 3872 CD2 LEU B 28 -17.938 6.468 30.580 1.00 55.82 C ATOM 3873 HA LEU B 28 -19.516 2.465 32.260 1.00 0.00 H ATOM 3874 HB2 LEU B 28 -19.808 4.456 30.638 1.00 0.00 H ATOM 3875 HB3 LEU B 28 -18.990 4.699 32.200 1.00 0.00 H ATOM 3876 HG LEU B 28 -16.836 4.656 31.005 1.00 0.00 H ATOM 3877 HD21 LEU B 28 -18.880 6.742 30.105 1.00 0.00 H ATOM 3878 HD22 LEU B 28 -17.955 6.772 31.627 1.00 0.00 H ATOM 3879 HD23 LEU B 28 -17.114 6.966 30.069 1.00 0.00 H ATOM 3880 HD11 LEU B 28 -17.429 3.492 28.962 1.00 0.00 H ATOM 3881 HD12 LEU B 28 -18.532 4.811 28.500 1.00 0.00 H ATOM 3882 HD13 LEU B 28 -16.778 5.106 28.584 1.00 0.00 H ATOM 3883 H LEU B 28 -16.954 1.702 31.155 1.00 0.00 H ATOM 3884 N GLY B 29 -20.582 1.414 30.348 1.00 49.26 N ATOM 3885 CA GLY B 29 -21.245 0.725 29.245 1.00 49.46 C ATOM 3886 C GLY B 29 -20.597 -0.569 28.762 1.00 47.05 C ATOM 3887 O GLY B 29 -20.851 -0.972 27.629 1.00 50.43 O ATOM 3888 HA3 GLY B 29 -21.283 1.412 28.400 1.00 0.00 H ATOM 3889 HA2 GLY B 29 -22.260 0.488 29.564 1.00 0.00 H ATOM 3890 H GLY B 29 -21.053 1.450 31.274 1.00 0.00 H ATOM 3891 N GLY B 30 -19.787 -1.233 29.598 1.00 40.36 N ATOM 3892 CA GLY B 30 -19.051 -2.446 29.176 1.00 35.05 C ATOM 3893 C GLY B 30 -17.744 -2.119 28.455 1.00 31.61 C ATOM 3894 O GLY B 30 -17.102 -2.988 27.883 1.00 32.06 O ATOM 3895 HA3 GLY B 30 -19.686 -3.024 28.504 1.00 0.00 H ATOM 3896 HA2 GLY B 30 -18.823 -3.042 30.060 1.00 0.00 H ATOM 3897 H GLY B 30 -19.672 -0.886 30.572 1.00 0.00 H ATOM 3898 N CYS B 31 -17.373 -0.846 28.459 1.00 28.84 N ATOM 3899 CA CYS B 31 -16.195 -0.275 27.792 1.00 25.68 C ATOM 3900 C CYS B 31 -15.343 0.432 28.838 1.00 26.71 C ATOM 3901 O CYS B 31 -15.881 0.937 29.811 1.00 27.22 O ATOM 3902 CB CYS B 31 -16.623 0.826 26.815 1.00 23.35 C ATOM 3903 SG CYS B 31 -17.596 0.352 25.370 1.00 19.46 S ATOM 3904 HA CYS B 31 -15.666 -1.080 27.282 1.00 0.00 H ATOM 3905 HB2 CYS B 31 -15.715 1.306 26.450 1.00 0.00 H ATOM 3906 HB3 CYS B 31 -17.213 1.548 27.380 1.00 0.00 H ATOM 3907 HG CYS B 31 -16.876 -0.544 24.606 1.00 0.00 H ATOM 3908 H CYS B 31 -17.977 -0.185 28.988 1.00 0.00 H ATOM 3909 N GLU B 32 -14.062 0.584 28.580 1.00 25.36 N ATOM 3910 CA GLU B 32 -13.209 1.225 29.547 1.00 24.90 C ATOM 3911 C GLU B 32 -12.355 2.228 28.822 1.00 23.25 C ATOM 3912 O GLU B 32 -11.830 1.952 27.732 1.00 21.80 O ATOM 3913 CB GLU B 32 -12.387 0.156 30.253 1.00 28.02 C ATOM 3914 CG GLU B 32 -12.051 0.456 31.690 1.00 32.24 C ATOM 3915 CD GLU B 32 -11.667 -0.801 32.449 1.00 34.75 C ATOM 3916 OE1 GLU B 32 -12.339 -1.116 33.457 1.00 36.79 O ATOM 3917 OE2 GLU B 32 -10.703 -1.474 32.032 1.00 33.54 O ATOM 3918 HA GLU B 32 -13.779 1.756 30.309 1.00 0.00 H ATOM 3919 HB2 GLU B 32 -12.950 -0.777 30.225 1.00 0.00 H ATOM 3920 HB3 GLU B 32 -11.452 0.032 29.706 1.00 0.00 H ATOM 3921 HG2 GLU B 32 -11.216 1.156 31.719 1.00 0.00 H ATOM 3922 HG3 GLU B 32 -12.919 0.908 32.170 1.00 0.00 H ATOM 3923 H GLU B 32 -13.667 0.242 27.681 1.00 0.00 H ATOM 3924 N ILE B 33 -12.253 3.415 29.401 1.00 21.86 N ATOM 3925 CA ILE B 33 -11.396 4.457 28.870 1.00 20.83 C ATOM 3926 C ILE B 33 -10.294 4.781 29.868 1.00 21.78 C ATOM 3927 O ILE B 33 -10.560 4.855 31.074 1.00 23.63 O ATOM 3928 CB ILE B 33 -12.193 5.726 28.560 1.00 20.85 C ATOM 3929 CG1 ILE B 33 -13.334 5.417 27.584 1.00 21.84 C ATOM 3930 CG2 ILE B 33 -11.271 6.803 27.994 1.00 20.62 C ATOM 3931 CD1 ILE B 33 -14.294 6.569 27.399 1.00 23.55 C ATOM 3932 HA ILE B 33 -10.957 4.091 27.942 1.00 0.00 H ATOM 3933 HB ILE B 33 -12.631 6.100 29.486 1.00 0.00 H ATOM 3934 HG12 ILE B 33 -12.902 5.168 26.615 1.00 0.00 H ATOM 3935 HG13 ILE B 33 -13.891 4.560 27.963 1.00 0.00 H ATOM 3936 HD11 ILE B 33 -14.743 6.824 28.359 1.00 0.00 H ATOM 3937 HD12 ILE B 33 -13.754 7.432 27.009 1.00 0.00 H ATOM 3938 HD13 ILE B 33 -15.075 6.280 26.696 1.00 0.00 H ATOM 3939 HG21 ILE B 33 -10.497 7.037 28.724 1.00 0.00 H ATOM 3940 HG22 ILE B 33 -10.809 6.438 27.077 1.00 0.00 H ATOM 3941 HG23 ILE B 33 -11.852 7.700 27.778 1.00 0.00 H ATOM 3942 H ILE B 33 -12.804 3.605 30.262 1.00 0.00 H ATOM 3943 N TYR B 34 -9.068 4.933 29.368 1.00 20.50 N ATOM 3944 CA TYR B 34 -7.908 5.303 30.181 1.00 20.75 C ATOM 3945 C TYR B 34 -7.369 6.618 29.681 1.00 20.90 C ATOM 3946 O TYR B 34 -7.041 6.745 28.503 1.00 20.08 O ATOM 3947 CB TYR B 34 -6.827 4.218 30.103 1.00 20.97 C ATOM 3948 CG TYR B 34 -7.414 2.832 30.150 1.00 20.97 C ATOM 3949 CD1 TYR B 34 -7.590 2.105 28.984 1.00 21.20 C ATOM 3950 CD2 TYR B 34 -7.810 2.253 31.356 1.00 21.18 C ATOM 3951 CE1 TYR B 34 -8.144 0.843 29.004 1.00 20.83 C ATOM 3952 CE2 TYR B 34 -8.367 0.986 31.390 1.00 21.27 C ATOM 3953 CZ TYR B 34 -8.541 0.300 30.202 1.00 21.98 C ATOM 3954 OH TYR B 34 -9.100 -0.939 30.174 1.00 22.60 O ATOM 3955 HA TYR B 34 -8.209 5.400 31.224 1.00 0.00 H ATOM 3956 HB3 TYR B 34 -6.144 4.340 30.944 1.00 0.00 H ATOM 3957 HB2 TYR B 34 -6.276 4.336 29.170 1.00 0.00 H ATOM 3958 HD2 TYR B 34 -7.679 2.807 32.286 1.00 0.00 H ATOM 3959 HE2 TYR B 34 -8.664 0.537 32.338 1.00 0.00 H ATOM 3960 HE1 TYR B 34 -8.266 0.281 28.078 1.00 0.00 H ATOM 3961 HD1 TYR B 34 -7.284 2.539 28.032 1.00 0.00 H ATOM 3962 HH TYR B 34 -10.016 -0.895 30.547 1.00 0.00 H ATOM 3963 H TYR B 34 -8.928 4.781 28.349 1.00 0.00 H ATOM 3964 N THR B 35 -7.290 7.614 30.561 1.00 20.73 N ATOM 3965 CA THR B 35 -6.877 8.939 30.154 1.00 20.94 C ATOM 3966 C THR B 35 -5.589 9.314 30.897 1.00 21.13 C ATOM 3967 O THR B 35 -5.327 8.835 31.990 1.00 21.96 O ATOM 3968 CB THR B 35 -7.992 9.976 30.413 1.00 22.83 C ATOM 3969 OG1 THR B 35 -8.073 10.237 31.812 1.00 22.52 O ATOM 3970 CG2 THR B 35 -9.345 9.454 29.934 1.00 24.84 C ATOM 3971 HA THR B 35 -6.684 8.939 29.081 1.00 0.00 H ATOM 3972 HB THR B 35 -7.750 10.886 29.865 1.00 0.00 H ATOM 3973 HG1 THR B 35 -7.206 10.594 32.131 1.00 0.00 H ATOM 3974 HG23 THR B 35 -9.296 9.250 28.864 1.00 0.00 H ATOM 3975 HG21 THR B 35 -9.589 8.536 30.469 1.00 0.00 H ATOM 3976 HG22 THR B 35 -10.112 10.204 30.128 1.00 0.00 H ATOM 3977 H THR B 35 -7.529 7.436 31.557 1.00 0.00 H ATOM 3978 N GLY B 36 -4.775 10.142 30.273 1.00 23.18 N ATOM 3979 CA GLY B 36 -3.493 10.532 30.846 1.00 24.73 C ATOM 3980 C GLY B 36 -2.543 11.006 29.767 1.00 25.45 C ATOM 3981 O GLY B 36 -2.973 11.450 28.707 1.00 25.41 O ATOM 3982 HA3 GLY B 36 -3.054 9.675 31.357 1.00 0.00 H ATOM 3983 HA2 GLY B 36 -3.652 11.338 31.562 1.00 0.00 H ATOM 3984 H GLY B 36 -5.055 10.527 29.348 1.00 0.00 H ATOM 3985 N GLN B 37 -1.244 10.925 30.028 1.00 28.16 N ATOM 3986 CA GLN B 37 -0.264 11.379 29.052 1.00 29.34 C ATOM 3987 C GLN B 37 0.633 10.240 28.607 1.00 28.81 C ATOM 3988 O GLN B 37 1.063 9.435 29.413 1.00 24.13 O ATOM 3989 CB GLN B 37 0.578 12.521 29.617 1.00 31.18 C ATOM 3990 CG GLN B 37 -0.208 13.814 29.828 1.00 33.04 C ATOM 3991 CD GLN B 37 -1.036 13.805 31.098 1.00 32.64 C ATOM 3992 OE1 GLN B 37 -0.603 13.320 32.132 1.00 35.31 O ATOM 3993 NE2 GLN B 37 -2.225 14.351 31.025 1.00 33.73 N ATOM 3994 HA GLN B 37 -0.810 11.746 28.183 1.00 0.00 H ATOM 3995 HB2 GLN B 37 0.987 12.206 30.577 1.00 0.00 H ATOM 3996 HB3 GLN B 37 1.395 12.723 28.924 1.00 0.00 H ATOM 3997 HG2 GLN B 37 0.496 14.644 29.878 1.00 0.00 H ATOM 3998 HG3 GLN B 37 -0.876 13.957 28.979 1.00 0.00 H ATOM 3999 HE22 GLN B 37 -2.558 14.754 30.126 1.00 0.00 H ATOM 4000 HE21 GLN B 37 -2.836 14.382 31.866 1.00 0.00 H ATOM 4001 H GLN B 37 -0.924 10.534 30.937 1.00 0.00 H ATOM 4002 N LEU B 38 0.901 10.188 27.307 1.00 29.79 N ATOM 4003 CA LEU B 38 1.790 9.180 26.745 1.00 31.25 C ATOM 4004 C LEU B 38 3.012 9.947 26.269 1.00 32.39 C ATOM 4005 O LEU B 38 2.954 10.677 25.269 1.00 32.00 O ATOM 4006 CB LEU B 38 1.100 8.411 25.602 1.00 30.63 C ATOM 4007 CG LEU B 38 1.816 7.248 24.895 1.00 32.03 C ATOM 4008 CD1 LEU B 38 2.402 6.233 25.851 1.00 32.58 C ATOM 4009 CD2 LEU B 38 0.852 6.556 23.946 1.00 31.32 C ATOM 4010 HA LEU B 38 2.067 8.419 27.475 1.00 0.00 H ATOM 4011 HB2 LEU B 38 0.176 8.004 26.013 1.00 0.00 H ATOM 4012 HB3 LEU B 38 0.862 9.145 24.832 1.00 0.00 H ATOM 4013 HG LEU B 38 2.652 7.682 24.347 1.00 0.00 H ATOM 4014 HD21 LEU B 38 0.003 6.170 24.510 1.00 0.00 H ATOM 4015 HD22 LEU B 38 0.500 7.271 23.202 1.00 0.00 H ATOM 4016 HD23 LEU B 38 1.363 5.733 23.447 1.00 0.00 H ATOM 4017 HD11 LEU B 38 3.131 6.723 26.497 1.00 0.00 H ATOM 4018 HD12 LEU B 38 1.605 5.806 26.459 1.00 0.00 H ATOM 4019 HD13 LEU B 38 2.891 5.442 25.283 1.00 0.00 H ATOM 4020 H LEU B 38 0.464 10.887 26.673 1.00 0.00 H ATOM 4021 N ASN B 39 4.108 9.807 27.010 1.00 34.45 N ATOM 4022 CA ASN B 39 5.327 10.552 26.722 1.00 37.38 C ATOM 4023 C ASN B 39 5.004 12.040 26.562 1.00 38.13 C ATOM 4024 O ASN B 39 5.369 12.668 25.569 1.00 41.90 O ATOM 4025 CB ASN B 39 6.027 9.978 25.474 1.00 38.99 C ATOM 4026 CG ASN B 39 6.216 8.457 25.549 1.00 41.99 C ATOM 4027 OD1 ASN B 39 6.610 7.919 26.592 1.00 44.85 O ATOM 4028 ND2 ASN B 39 5.926 7.754 24.439 1.00 41.08 N ATOM 4029 HA ASN B 39 6.019 10.449 27.558 1.00 0.00 H ATOM 4030 HB2 ASN B 39 5.424 10.212 24.597 1.00 0.00 H ATOM 4031 HB3 ASN B 39 7.006 10.447 25.376 1.00 0.00 H ATOM 4032 HD22 ASN B 39 5.598 8.245 23.583 1.00 0.00 H ATOM 4033 HD21 ASN B 39 6.030 6.719 24.437 1.00 0.00 H ATOM 4034 H ASN B 39 4.095 9.149 27.815 1.00 0.00 H ATOM 4035 N GLY B 40 4.273 12.589 27.527 1.00 39.03 N ATOM 4036 CA GLY B 40 3.919 14.009 27.516 1.00 38.16 C ATOM 4037 C GLY B 40 2.650 14.386 26.762 1.00 39.29 C ATOM 4038 O GLY B 40 2.085 15.440 27.020 1.00 40.71 O ATOM 4039 HA3 GLY B 40 4.748 14.554 27.064 1.00 0.00 H ATOM 4040 HA2 GLY B 40 3.797 14.329 28.551 1.00 0.00 H ATOM 4041 H GLY B 40 3.943 11.992 28.312 1.00 0.00 H ATOM 4042 N THR B 41 2.181 13.540 25.842 1.00 36.37 N ATOM 4043 CA THR B 41 1.034 13.897 24.990 1.00 35.35 C ATOM 4044 C THR B 41 -0.280 13.418 25.586 1.00 31.91 C ATOM 4045 O THR B 41 -0.380 12.283 26.035 1.00 27.48 O ATOM 4046 CB THR B 41 1.168 13.266 23.597 1.00 38.36 C ATOM 4047 OG1 THR B 41 2.424 13.643 23.019 1.00 40.21 O ATOM 4048 CG2 THR B 41 0.022 13.706 22.679 1.00 37.82 C ATOM 4049 HA THR B 41 1.032 14.985 24.919 1.00 0.00 H ATOM 4050 HB THR B 41 1.121 12.182 23.704 1.00 0.00 H ATOM 4051 HG1 THR B 41 2.508 13.235 22.121 1.00 0.00 H ATOM 4052 HG23 THR B 41 -0.930 13.416 23.124 1.00 0.00 H ATOM 4053 HG21 THR B 41 0.052 14.789 22.555 1.00 0.00 H ATOM 4054 HG22 THR B 41 0.131 13.225 21.707 1.00 0.00 H ATOM 4055 H THR B 41 2.634 12.611 25.725 1.00 0.00 H ATOM 4056 N GLU B 42 -1.297 14.264 25.553 1.00 30.66 N ATOM 4057 CA GLU B 42 -2.588 13.890 26.114 1.00 31.53 C ATOM 4058 C GLU B 42 -3.218 12.777 25.267 1.00 29.38 C ATOM 4059 O GLU B 42 -3.301 12.902 24.055 1.00 27.42 O ATOM 4060 CB GLU B 42 -3.512 15.105 26.171 1.00 33.48 C ATOM 4061 CG GLU B 42 -4.747 14.923 27.047 1.00 36.59 C ATOM 4062 CD GLU B 42 -4.405 14.659 28.499 1.00 43.18 C ATOM 4063 OE1 GLU B 42 -3.264 14.983 28.905 1.00 47.23 O ATOM 4064 OE2 GLU B 42 -5.268 14.117 29.234 1.00 46.24 O ATOM 4065 HA GLU B 42 -2.442 13.521 27.129 1.00 0.00 H ATOM 4066 HB2 GLU B 42 -2.941 15.949 26.559 1.00 0.00 H ATOM 4067 HB3 GLU B 42 -3.844 15.328 25.157 1.00 0.00 H ATOM 4068 HG2 GLU B 42 -5.351 15.829 26.991 1.00 0.00 H ATOM 4069 HG3 GLU B 42 -5.323 14.080 26.666 1.00 0.00 H ATOM 4070 H GLU B 42 -1.174 15.203 25.123 1.00 0.00 H ATOM 4071 N VAL B 43 -3.614 11.678 25.901 1.00 26.85 N ATOM 4072 CA VAL B 43 -4.314 10.623 25.180 1.00 26.25 C ATOM 4073 C VAL B 43 -5.545 10.147 25.918 1.00 23.93 C ATOM 4074 O VAL B 43 -5.690 10.328 27.126 1.00 24.22 O ATOM 4075 CB VAL B 43 -3.424 9.392 24.879 1.00 25.84 C ATOM 4076 CG1 VAL B 43 -2.246 9.784 24.001 1.00 26.21 C ATOM 4077 CG2 VAL B 43 -2.973 8.713 26.167 1.00 26.22 C ATOM 4078 HA VAL B 43 -4.603 11.085 24.236 1.00 0.00 H ATOM 4079 HB VAL B 43 -4.018 8.665 24.326 1.00 0.00 H ATOM 4080 HG11 VAL B 43 -2.616 10.191 23.060 1.00 0.00 H ATOM 4081 HG12 VAL B 43 -1.647 10.536 24.514 1.00 0.00 H ATOM 4082 HG13 VAL B 43 -1.634 8.904 23.802 1.00 0.00 H ATOM 4083 HG21 VAL B 43 -2.400 9.420 26.767 1.00 0.00 H ATOM 4084 HG22 VAL B 43 -3.848 8.383 26.728 1.00 0.00 H ATOM 4085 HG23 VAL B 43 -2.350 7.852 25.924 1.00 0.00 H ATOM 4086 H VAL B 43 -3.423 11.570 26.918 1.00 0.00 H ATOM 4087 N ALA B 44 -6.432 9.532 25.157 1.00 21.97 N ATOM 4088 CA ALA B 44 -7.512 8.759 25.734 1.00 21.09 C ATOM 4089 C ALA B 44 -7.621 7.445 24.966 1.00 19.58 C ATOM 4090 O ALA B 44 -7.881 7.447 23.779 1.00 19.97 O ATOM 4091 CB ALA B 44 -8.809 9.538 25.659 1.00 21.46 C ATOM 4092 HA ALA B 44 -7.311 8.552 26.785 1.00 0.00 H ATOM 4093 HB1 ALA B 44 -8.703 10.472 26.211 1.00 0.00 H ATOM 4094 HB2 ALA B 44 -9.041 9.755 24.616 1.00 0.00 H ATOM 4095 HB3 ALA B 44 -9.613 8.946 26.096 1.00 0.00 H ATOM 4096 H ALA B 44 -6.353 9.604 24.123 1.00 0.00 H ATOM 4097 N LEU B 45 -7.454 6.338 25.673 1.00 18.75 N ATOM 4098 CA LEU B 45 -7.398 5.018 25.082 1.00 17.49 C ATOM 4099 C LEU B 45 -8.654 4.252 25.505 1.00 17.88 C ATOM 4100 O LEU B 45 -8.887 4.006 26.701 1.00 18.90 O ATOM 4101 CB LEU B 45 -6.132 4.313 25.570 1.00 16.93 C ATOM 4102 CG LEU B 45 -5.916 2.810 25.356 1.00 17.08 C ATOM 4103 CD1 LEU B 45 -5.787 2.442 23.881 1.00 17.59 C ATOM 4104 CD2 LEU B 45 -4.686 2.347 26.126 1.00 17.49 C ATOM 4105 HA LEU B 45 -7.364 5.072 23.994 1.00 0.00 H ATOM 4106 HB2 LEU B 45 -5.294 4.816 25.086 1.00 0.00 H ATOM 4107 HB3 LEU B 45 -6.082 4.480 26.646 1.00 0.00 H ATOM 4108 HG LEU B 45 -6.800 2.298 25.735 1.00 0.00 H ATOM 4109 HD21 LEU B 45 -3.811 2.890 25.771 1.00 0.00 H ATOM 4110 HD22 LEU B 45 -4.830 2.542 27.189 1.00 0.00 H ATOM 4111 HD23 LEU B 45 -4.541 1.278 25.968 1.00 0.00 H ATOM 4112 HD11 LEU B 45 -6.698 2.729 23.355 1.00 0.00 H ATOM 4113 HD12 LEU B 45 -4.936 2.969 23.450 1.00 0.00 H ATOM 4114 HD13 LEU B 45 -5.636 1.367 23.788 1.00 0.00 H ATOM 4115 H LEU B 45 -7.358 6.421 26.705 1.00 0.00 H ATOM 4116 N LEU B 46 -9.423 3.836 24.512 1.00 18.97 N ATOM 4117 CA LEU B 46 -10.628 3.023 24.698 1.00 18.55 C ATOM 4118 C LEU B 46 -10.362 1.531 24.447 1.00 18.36 C ATOM 4119 O LEU B 46 -9.774 1.145 23.402 1.00 17.27 O ATOM 4120 CB LEU B 46 -11.705 3.472 23.713 1.00 20.23 C ATOM 4121 CG LEU B 46 -12.954 2.579 23.631 1.00 21.25 C ATOM 4122 CD1 LEU B 46 -13.754 2.649 24.918 1.00 21.66 C ATOM 4123 CD2 LEU B 46 -13.784 2.999 22.429 1.00 22.20 C ATOM 4124 HA LEU B 46 -10.948 3.158 25.731 1.00 0.00 H ATOM 4125 HB2 LEU B 46 -12.027 4.472 24.003 1.00 0.00 H ATOM 4126 HB3 LEU B 46 -11.256 3.510 22.721 1.00 0.00 H ATOM 4127 HG LEU B 46 -12.653 1.539 23.503 1.00 0.00 H ATOM 4128 HD21 LEU B 46 -14.083 4.041 22.542 1.00 0.00 H ATOM 4129 HD22 LEU B 46 -13.190 2.886 21.522 1.00 0.00 H ATOM 4130 HD23 LEU B 46 -14.672 2.370 22.364 1.00 0.00 H ATOM 4131 HD11 LEU B 46 -13.134 2.311 25.748 1.00 0.00 H ATOM 4132 HD12 LEU B 46 -14.069 3.678 25.093 1.00 0.00 H ATOM 4133 HD13 LEU B 46 -14.632 2.009 24.834 1.00 0.00 H ATOM 4134 H LEU B 46 -9.157 4.102 23.542 1.00 0.00 H ATOM 4135 N LYS B 47 -10.782 0.708 25.402 1.00 16.19 N ATOM 4136 CA LYS B 47 -10.961 -0.701 25.159 1.00 16.30 C ATOM 4137 C LYS B 47 -12.454 -0.885 24.865 1.00 15.22 C ATOM 4138 O LYS B 47 -13.283 -0.795 25.766 1.00 14.32 O ATOM 4139 CB LYS B 47 -10.500 -1.537 26.350 1.00 17.25 C ATOM 4140 CG LYS B 47 -10.580 -3.026 26.056 1.00 19.41 C ATOM 4141 CD LYS B 47 -10.007 -3.880 27.186 1.00 21.18 C ATOM 4142 CE LYS B 47 -10.866 -3.885 28.416 1.00 23.23 C ATOM 4143 NZ LYS B 47 -10.456 -5.024 29.288 1.00 23.93 N ATOM 4144 HA LYS B 47 -10.355 -1.044 24.321 1.00 0.00 H ATOM 4145 HB2 LYS B 47 -9.468 -1.278 26.585 1.00 0.00 H ATOM 4146 HB3 LYS B 47 -11.134 -1.311 27.207 1.00 0.00 H ATOM 4147 HG2 LYS B 47 -11.625 -3.297 25.909 1.00 0.00 H ATOM 4148 HG3 LYS B 47 -10.020 -3.233 25.144 1.00 0.00 H ATOM 4149 HD2 LYS B 47 -9.906 -4.905 26.829 1.00 0.00 H ATOM 4150 HD3 LYS B 47 -9.024 -3.490 27.451 1.00 0.00 H ATOM 4151 HE2 LYS B 47 -11.912 -4.000 28.132 1.00 0.00 H ATOM 4152 HE3 LYS B 47 -10.738 -2.947 28.955 1.00 0.00 H ATOM 4153 HZ1 LYS B 47 -10.578 -5.917 28.770 1.00 0.00 H ATOM 4154 HZ2 LYS B 47 -9.458 -4.912 29.557 1.00 0.00 H ATOM 4155 HZ3 LYS B 47 -11.047 -5.034 30.144 1.00 0.00 H ATOM 4156 H LYS B 47 -10.986 1.090 26.347 1.00 0.00 H ATOM 4157 N SER B 48 -12.783 -1.117 23.594 1.00 14.92 N ATOM 4158 CA SER B 48 -14.164 -1.137 23.127 1.00 15.13 C ATOM 4159 C SER B 48 -14.918 -2.463 23.301 1.00 16.17 C ATOM 4160 O SER B 48 -16.126 -2.456 23.449 1.00 15.61 O ATOM 4161 CB SER B 48 -14.242 -0.685 21.667 1.00 15.53 C ATOM 4162 OG SER B 48 -13.702 -1.671 20.766 1.00 16.37 O ATOM 4163 HA SER B 48 -14.676 -0.435 23.785 1.00 0.00 H ATOM 4164 HB2 SER B 48 -13.678 0.241 21.555 1.00 0.00 H ATOM 4165 HB3 SER B 48 -15.286 -0.507 21.409 1.00 0.00 H ATOM 4166 HG SER B 48 -14.213 -2.514 20.857 1.00 0.00 H ATOM 4167 H SER B 48 -12.022 -1.291 22.907 1.00 0.00 H ATOM 4168 N GLY B 49 -14.222 -3.590 23.266 1.00 16.97 N ATOM 4169 CA GLY B 49 -14.887 -4.854 23.025 1.00 16.45 C ATOM 4170 C GLY B 49 -14.936 -5.076 21.515 1.00 16.77 C ATOM 4171 O GLY B 49 -14.591 -4.199 20.725 1.00 14.60 O ATOM 4172 HA3 GLY B 49 -15.899 -4.824 23.429 1.00 0.00 H ATOM 4173 HA2 GLY B 49 -14.332 -5.662 23.501 1.00 0.00 H ATOM 4174 H GLY B 49 -13.193 -3.567 23.412 1.00 0.00 H ATOM 4175 N ILE B 50 -15.421 -6.240 21.127 1.00 15.56 N ATOM 4176 CA ILE B 50 -15.301 -6.736 19.775 1.00 15.46 C ATOM 4177 C ILE B 50 -16.555 -6.530 18.910 1.00 14.91 C ATOM 4178 O ILE B 50 -17.693 -6.686 19.371 1.00 14.19 O ATOM 4179 CB ILE B 50 -14.914 -8.235 19.851 1.00 15.63 C ATOM 4180 CG1 ILE B 50 -13.487 -8.356 20.408 1.00 16.11 C ATOM 4181 CG2 ILE B 50 -15.090 -8.920 18.513 1.00 15.33 C ATOM 4182 CD1 ILE B 50 -12.981 -9.779 20.569 1.00 16.58 C ATOM 4183 HA ILE B 50 -14.529 -6.153 19.273 1.00 0.00 H ATOM 4184 HB ILE B 50 -15.586 -8.756 20.533 1.00 0.00 H ATOM 4185 HG12 ILE B 50 -12.813 -7.832 19.730 1.00 0.00 H ATOM 4186 HG13 ILE B 50 -13.463 -7.875 21.386 1.00 0.00 H ATOM 4187 HD11 ILE B 50 -13.632 -10.319 21.256 1.00 0.00 H ATOM 4188 HD12 ILE B 50 -12.982 -10.276 19.599 1.00 0.00 H ATOM 4189 HD13 ILE B 50 -11.967 -9.760 20.968 1.00 0.00 H ATOM 4190 HG21 ILE B 50 -16.132 -8.847 18.203 1.00 0.00 H ATOM 4191 HG22 ILE B 50 -14.454 -8.435 17.772 1.00 0.00 H ATOM 4192 HG23 ILE B 50 -14.809 -9.969 18.604 1.00 0.00 H ATOM 4193 H ILE B 50 -15.914 -6.829 21.828 1.00 0.00 H ATOM 4194 N GLY B 51 -16.344 -6.222 17.638 1.00 14.32 N ATOM 4195 CA GLY B 51 -17.432 -6.083 16.698 1.00 13.87 C ATOM 4196 C GLY B 51 -17.940 -4.653 16.504 1.00 13.60 C ATOM 4197 O GLY B 51 -17.559 -3.721 17.234 1.00 13.70 O ATOM 4198 HA3 GLY B 51 -18.264 -6.693 17.051 1.00 0.00 H ATOM 4199 HA2 GLY B 51 -17.094 -6.456 15.731 1.00 0.00 H ATOM 4200 H GLY B 51 -15.369 -6.076 17.308 1.00 0.00 H ATOM 4201 N LYS B 52 -18.814 -4.509 15.513 1.00 13.38 N ATOM 4202 CA LYS B 52 -19.275 -3.205 15.027 1.00 13.26 C ATOM 4203 C LYS B 52 -20.020 -2.364 16.083 1.00 13.41 C ATOM 4204 O LYS B 52 -19.764 -1.149 16.248 1.00 12.04 O ATOM 4205 CB LYS B 52 -20.115 -3.418 13.751 1.00 14.74 C ATOM 4206 CG LYS B 52 -19.240 -3.827 12.555 1.00 15.94 C ATOM 4207 CD LYS B 52 -19.931 -4.372 11.323 1.00 16.56 C ATOM 4208 CE LYS B 52 -21.372 -4.037 11.178 1.00 17.46 C ATOM 4209 NZ LYS B 52 -21.870 -4.553 9.861 1.00 18.06 N ATOM 4210 HA LYS B 52 -18.393 -2.609 14.793 1.00 0.00 H ATOM 4211 HB2 LYS B 52 -20.848 -4.203 13.937 1.00 0.00 H ATOM 4212 HB3 LYS B 52 -20.632 -2.489 13.509 1.00 0.00 H ATOM 4213 HG2 LYS B 52 -18.677 -2.945 12.248 1.00 0.00 H ATOM 4214 HG3 LYS B 52 -18.549 -4.594 12.906 1.00 0.00 H ATOM 4215 HD2 LYS B 52 -19.409 -3.983 10.449 1.00 0.00 H ATOM 4216 HD3 LYS B 52 -19.842 -5.458 11.344 1.00 0.00 H ATOM 4217 HE2 LYS B 52 -21.501 -2.955 11.218 1.00 0.00 H ATOM 4218 HE3 LYS B 52 -21.937 -4.499 11.988 1.00 0.00 H ATOM 4219 HZ1 LYS B 52 -21.330 -4.111 9.090 1.00 0.00 H ATOM 4220 HZ2 LYS B 52 -21.746 -5.585 9.825 1.00 0.00 H ATOM 4221 HZ3 LYS B 52 -22.878 -4.320 9.757 1.00 0.00 H ATOM 4222 H LYS B 52 -19.190 -5.366 15.059 1.00 0.00 H ATOM 4223 N VAL B 53 -20.916 -2.997 16.824 1.00 12.73 N ATOM 4224 CA VAL B 53 -21.765 -2.245 17.768 1.00 12.89 C ATOM 4225 C VAL B 53 -20.945 -1.880 18.986 1.00 12.92 C ATOM 4226 O VAL B 53 -21.031 -0.741 19.509 1.00 11.53 O ATOM 4227 CB VAL B 53 -23.019 -3.069 18.129 1.00 13.90 C ATOM 4228 CG1 VAL B 53 -23.762 -2.450 19.336 1.00 13.39 C ATOM 4229 CG2 VAL B 53 -23.902 -3.217 16.893 1.00 14.11 C ATOM 4230 HA VAL B 53 -22.116 -1.321 17.308 1.00 0.00 H ATOM 4231 HB VAL B 53 -22.724 -4.070 18.444 1.00 0.00 H ATOM 4232 HG11 VAL B 53 -23.097 -2.430 20.199 1.00 0.00 H ATOM 4233 HG12 VAL B 53 -24.070 -1.434 19.089 1.00 0.00 H ATOM 4234 HG13 VAL B 53 -24.641 -3.052 19.567 1.00 0.00 H ATOM 4235 HG21 VAL B 53 -24.203 -2.230 16.543 1.00 0.00 H ATOM 4236 HG22 VAL B 53 -23.344 -3.728 16.108 1.00 0.00 H ATOM 4237 HG23 VAL B 53 -24.788 -3.799 17.148 1.00 0.00 H ATOM 4238 H VAL B 53 -21.022 -4.028 16.740 1.00 0.00 H ATOM 4239 N ALA B 54 -20.104 -2.819 19.427 1.00 12.27 N ATOM 4240 CA ALA B 54 -19.205 -2.542 20.549 1.00 13.05 C ATOM 4241 C ALA B 54 -18.321 -1.361 20.219 1.00 13.29 C ATOM 4242 O ALA B 54 -18.146 -0.476 21.033 1.00 11.71 O ATOM 4243 CB ALA B 54 -18.360 -3.764 20.914 1.00 12.75 C ATOM 4244 HA ALA B 54 -19.815 -2.301 21.419 1.00 0.00 H ATOM 4245 HB1 ALA B 54 -19.017 -4.587 21.196 1.00 0.00 H ATOM 4246 HB2 ALA B 54 -17.756 -4.057 20.055 1.00 0.00 H ATOM 4247 HB3 ALA B 54 -17.707 -3.516 21.751 1.00 0.00 H ATOM 4248 H ALA B 54 -20.088 -3.753 18.970 1.00 0.00 H ATOM 4249 N ALA B 55 -17.752 -1.356 19.011 1.00 13.85 N ATOM 4250 CA ALA B 55 -16.884 -0.280 18.584 1.00 13.96 C ATOM 4251 C ALA B 55 -17.620 1.038 18.423 1.00 14.42 C ATOM 4252 O ALA B 55 -17.087 2.070 18.842 1.00 13.97 O ATOM 4253 CB ALA B 55 -16.168 -0.618 17.287 1.00 14.44 C ATOM 4254 HA ALA B 55 -16.149 -0.163 19.380 1.00 0.00 H ATOM 4255 HB1 ALA B 55 -15.562 -1.513 17.430 1.00 0.00 H ATOM 4256 HB2 ALA B 55 -16.904 -0.798 16.503 1.00 0.00 H ATOM 4257 HB3 ALA B 55 -15.526 0.215 17.000 1.00 0.00 H ATOM 4258 H ALA B 55 -17.938 -2.146 18.360 1.00 0.00 H ATOM 4259 N ALA B 56 -18.808 1.003 17.831 1.00 14.24 N ATOM 4260 CA ALA B 56 -19.645 2.208 17.683 1.00 14.75 C ATOM 4261 C ALA B 56 -20.021 2.830 19.040 1.00 15.44 C ATOM 4262 O ALA B 56 -19.890 4.033 19.248 1.00 14.22 O ATOM 4263 CB ALA B 56 -20.894 1.864 16.909 1.00 14.31 C ATOM 4264 HA ALA B 56 -19.061 2.951 17.140 1.00 0.00 H ATOM 4265 HB1 ALA B 56 -20.618 1.491 15.923 1.00 0.00 H ATOM 4266 HB2 ALA B 56 -21.453 1.097 17.446 1.00 0.00 H ATOM 4267 HB3 ALA B 56 -21.510 2.756 16.801 1.00 0.00 H ATOM 4268 H ALA B 56 -19.159 0.097 17.460 1.00 0.00 H ATOM 4269 N LEU B 57 -20.478 1.988 19.952 1.00 16.41 N ATOM 4270 CA LEU B 57 -20.808 2.402 21.322 1.00 18.27 C ATOM 4271 C LEU B 57 -19.598 3.109 21.976 1.00 18.02 C ATOM 4272 O LEU B 57 -19.694 4.241 22.476 1.00 18.35 O ATOM 4273 CB LEU B 57 -21.251 1.168 22.116 1.00 19.14 C ATOM 4274 CG LEU B 57 -21.180 1.139 23.643 1.00 21.48 C ATOM 4275 CD1 LEU B 57 -21.976 2.271 24.230 1.00 23.95 C ATOM 4276 CD2 LEU B 57 -21.701 -0.188 24.156 1.00 22.55 C ATOM 4277 HA LEU B 57 -21.627 3.121 21.313 1.00 0.00 H ATOM 4278 HB2 LEU B 57 -22.293 0.989 21.852 1.00 0.00 H ATOM 4279 HB3 LEU B 57 -20.640 0.338 21.763 1.00 0.00 H ATOM 4280 HG LEU B 57 -20.140 1.256 23.948 1.00 0.00 H ATOM 4281 HD21 LEU B 57 -22.736 -0.317 23.840 1.00 0.00 H ATOM 4282 HD22 LEU B 57 -21.093 -0.997 23.751 1.00 0.00 H ATOM 4283 HD23 LEU B 57 -21.647 -0.202 25.245 1.00 0.00 H ATOM 4284 HD11 LEU B 57 -21.573 3.219 23.875 1.00 0.00 H ATOM 4285 HD12 LEU B 57 -23.018 2.179 23.922 1.00 0.00 H ATOM 4286 HD13 LEU B 57 -21.913 2.232 25.317 1.00 0.00 H ATOM 4287 H LEU B 57 -20.609 0.991 19.688 1.00 0.00 H ATOM 4288 N GLY B 58 -18.450 2.441 21.929 1.00 18.28 N ATOM 4289 CA GLY B 58 -17.263 2.940 22.577 1.00 17.40 C ATOM 4290 C GLY B 58 -16.741 4.198 21.939 1.00 18.06 C ATOM 4291 O GLY B 58 -16.347 5.120 22.658 1.00 18.13 O ATOM 4292 HA3 GLY B 58 -16.489 2.175 22.525 1.00 0.00 H ATOM 4293 HA2 GLY B 58 -17.496 3.149 23.621 1.00 0.00 H ATOM 4294 H GLY B 58 -18.407 1.539 21.414 1.00 0.00 H ATOM 4295 N ALA B 59 -16.701 4.252 20.598 1.00 17.39 N ATOM 4296 CA ALA B 59 -16.229 5.462 19.931 1.00 17.63 C ATOM 4297 C ALA B 59 -17.135 6.634 20.298 1.00 19.02 C ATOM 4298 O ALA B 59 -16.641 7.747 20.527 1.00 19.63 O ATOM 4299 CB ALA B 59 -16.181 5.303 18.430 1.00 17.63 C ATOM 4300 HA ALA B 59 -15.211 5.653 20.272 1.00 0.00 H ATOM 4301 HB1 ALA B 59 -15.504 4.488 18.174 1.00 0.00 H ATOM 4302 HB2 ALA B 59 -17.180 5.078 18.058 1.00 0.00 H ATOM 4303 HB3 ALA B 59 -15.824 6.229 17.979 1.00 0.00 H ATOM 4304 H ALA B 59 -17.006 3.433 20.035 1.00 0.00 H ATOM 4305 N THR B 60 -18.443 6.380 20.323 1.00 18.08 N ATOM 4306 CA THR B 60 -19.434 7.387 20.692 1.00 18.93 C ATOM 4307 C THR B 60 -19.187 7.935 22.112 1.00 20.33 C ATOM 4308 O THR B 60 -19.091 9.136 22.287 1.00 21.23 O ATOM 4309 CB THR B 60 -20.853 6.830 20.511 1.00 19.16 C ATOM 4310 OG1 THR B 60 -21.036 6.467 19.127 1.00 17.75 O ATOM 4311 CG2 THR B 60 -21.887 7.855 20.894 1.00 18.68 C ATOM 4312 HA THR B 60 -19.330 8.239 20.020 1.00 0.00 H ATOM 4313 HB THR B 60 -20.975 5.960 21.156 1.00 0.00 H ATOM 4314 HG1 THR B 60 -20.370 5.779 18.877 1.00 0.00 H ATOM 4315 HG23 THR B 60 -21.752 8.132 21.940 1.00 0.00 H ATOM 4316 HG21 THR B 60 -21.772 8.738 20.265 1.00 0.00 H ATOM 4317 HG22 THR B 60 -22.883 7.435 20.754 1.00 0.00 H ATOM 4318 H THR B 60 -18.771 5.426 20.070 1.00 0.00 H ATOM 4319 N LEU B 61 -19.053 7.050 23.093 1.00 21.93 N ATOM 4320 CA LEU B 61 -18.669 7.427 24.468 1.00 24.95 C ATOM 4321 C LEU B 61 -17.326 8.123 24.582 1.00 24.64 C ATOM 4322 O LEU B 61 -17.184 9.061 25.378 1.00 26.47 O ATOM 4323 CB LEU B 61 -18.604 6.206 25.359 1.00 24.95 C ATOM 4324 CG LEU B 61 -19.942 5.538 25.571 1.00 26.65 C ATOM 4325 CD1 LEU B 61 -19.746 4.218 26.289 1.00 26.32 C ATOM 4326 CD2 LEU B 61 -20.870 6.476 26.346 1.00 27.40 C ATOM 4327 HA LEU B 61 -19.444 8.127 24.778 1.00 0.00 H ATOM 4328 HB2 LEU B 61 -17.926 5.483 24.904 1.00 0.00 H ATOM 4329 HB3 LEU B 61 -18.212 6.509 26.330 1.00 0.00 H ATOM 4330 HG LEU B 61 -20.410 5.327 24.609 1.00 0.00 H ATOM 4331 HD21 LEU B 61 -20.424 6.708 27.313 1.00 0.00 H ATOM 4332 HD22 LEU B 61 -21.011 7.396 25.779 1.00 0.00 H ATOM 4333 HD23 LEU B 61 -21.834 5.989 26.496 1.00 0.00 H ATOM 4334 HD11 LEU B 61 -19.109 3.570 25.687 1.00 0.00 H ATOM 4335 HD12 LEU B 61 -19.274 4.398 27.255 1.00 0.00 H ATOM 4336 HD13 LEU B 61 -20.714 3.740 26.439 1.00 0.00 H ATOM 4337 H LEU B 61 -19.226 6.046 22.883 1.00 0.00 H ATOM 4338 N LEU B 62 -16.339 7.658 23.822 1.00 23.91 N ATOM 4339 CA LEU B 62 -15.026 8.290 23.795 1.00 25.13 C ATOM 4340 C LEU B 62 -15.098 9.731 23.275 1.00 26.38 C ATOM 4341 O LEU B 62 -14.545 10.642 23.905 1.00 25.13 O ATOM 4342 CB LEU B 62 -14.043 7.472 22.956 1.00 25.01 C ATOM 4343 CG LEU B 62 -12.649 8.043 22.773 1.00 24.36 C ATOM 4344 CD1 LEU B 62 -11.950 8.252 24.115 1.00 24.44 C ATOM 4345 CD2 LEU B 62 -11.832 7.123 21.902 1.00 24.92 C ATOM 4346 HA LEU B 62 -14.665 8.324 24.823 1.00 0.00 H ATOM 4347 HB2 LEU B 62 -13.939 6.496 23.430 1.00 0.00 H ATOM 4348 HB3 LEU B 62 -14.480 7.348 21.965 1.00 0.00 H ATOM 4349 HG LEU B 62 -12.742 9.016 22.291 1.00 0.00 H ATOM 4350 HD21 LEU B 62 -11.762 6.144 22.375 1.00 0.00 H ATOM 4351 HD22 LEU B 62 -12.313 7.024 20.929 1.00 0.00 H ATOM 4352 HD23 LEU B 62 -10.832 7.538 21.774 1.00 0.00 H ATOM 4353 HD11 LEU B 62 -12.531 8.946 24.722 1.00 0.00 H ATOM 4354 HD12 LEU B 62 -11.867 7.296 24.633 1.00 0.00 H ATOM 4355 HD13 LEU B 62 -10.954 8.662 23.945 1.00 0.00 H ATOM 4356 H LEU B 62 -16.509 6.820 23.230 1.00 0.00 H ATOM 4357 N LEU B 63 -15.783 9.937 22.150 1.00 27.51 N ATOM 4358 CA LEU B 63 -15.956 11.283 21.577 1.00 28.77 C ATOM 4359 C LEU B 63 -16.731 12.230 22.483 1.00 32.16 C ATOM 4360 O LEU B 63 -16.371 13.403 22.597 1.00 34.26 O ATOM 4361 CB LEU B 63 -16.647 11.218 20.222 1.00 28.18 C ATOM 4362 CG LEU B 63 -15.772 10.676 19.103 1.00 30.11 C ATOM 4363 CD1 LEU B 63 -16.565 10.479 17.817 1.00 30.36 C ATOM 4364 CD2 LEU B 63 -14.591 11.609 18.856 1.00 29.99 C ATOM 4365 HA LEU B 63 -14.948 11.682 21.465 1.00 0.00 H ATOM 4366 HB2 LEU B 63 -17.522 10.575 20.314 1.00 0.00 H ATOM 4367 HB3 LEU B 63 -16.965 12.225 19.951 1.00 0.00 H ATOM 4368 HG LEU B 63 -15.398 9.701 19.417 1.00 0.00 H ATOM 4369 HD21 LEU B 63 -14.961 12.595 18.574 1.00 0.00 H ATOM 4370 HD22 LEU B 63 -13.997 11.690 19.766 1.00 0.00 H ATOM 4371 HD23 LEU B 63 -13.974 11.207 18.052 1.00 0.00 H ATOM 4372 HD11 LEU B 63 -17.374 9.771 17.996 1.00 0.00 H ATOM 4373 HD12 LEU B 63 -16.980 11.435 17.498 1.00 0.00 H ATOM 4374 HD13 LEU B 63 -15.906 10.091 17.041 1.00 0.00 H ATOM 4375 H LEU B 63 -16.208 9.123 21.662 1.00 0.00 H ATOM 4376 N GLU B 64 -17.777 11.718 23.123 1.00 34.14 N ATOM 4377 CA GLU B 64 -18.604 12.505 24.051 1.00 36.87 C ATOM 4378 C GLU B 64 -17.910 12.831 25.363 1.00 38.84 C ATOM 4379 O GLU B 64 -18.016 13.943 25.858 1.00 39.37 O ATOM 4380 CB GLU B 64 -19.885 11.744 24.400 1.00 38.67 C ATOM 4381 CG GLU B 64 -20.855 11.609 23.242 1.00 41.17 C ATOM 4382 CD GLU B 64 -21.607 12.897 22.970 1.00 43.72 C ATOM 4383 OE1 GLU B 64 -22.802 12.928 23.275 1.00 44.10 O ATOM 4384 OE2 GLU B 64 -21.014 13.870 22.464 1.00 48.84 O ATOM 4385 HA GLU B 64 -18.811 13.437 23.526 1.00 0.00 H ATOM 4386 HB2 GLU B 64 -19.610 10.744 24.736 1.00 0.00 H ATOM 4387 HB3 GLU B 64 -20.388 12.272 25.210 1.00 0.00 H ATOM 4388 HG2 GLU B 64 -20.297 11.332 22.347 1.00 0.00 H ATOM 4389 HG3 GLU B 64 -21.575 10.825 23.477 1.00 0.00 H ATOM 4390 H GLU B 64 -18.021 10.720 22.961 1.00 0.00 H ATOM 4391 N HIS B 65 -17.246 11.846 25.953 1.00 37.02 N ATOM 4392 CA HIS B 65 -16.639 12.019 27.277 1.00 37.58 C ATOM 4393 C HIS B 65 -15.264 12.668 27.267 1.00 35.73 C ATOM 4394 O HIS B 65 -14.861 13.259 28.279 1.00 34.50 O ATOM 4395 CB HIS B 65 -16.545 10.682 28.009 1.00 38.69 C ATOM 4396 CG HIS B 65 -17.858 10.199 28.523 1.00 43.67 C ATOM 4397 ND1 HIS B 65 -18.120 10.057 29.867 1.00 47.35 N ATOM 4398 CD2 HIS B 65 -18.998 9.859 27.876 1.00 46.18 C ATOM 4399 CE1 HIS B 65 -19.362 9.636 30.028 1.00 49.35 C ATOM 4400 NE2 HIS B 65 -19.916 9.511 28.836 1.00 48.15 N ATOM 4401 HA HIS B 65 -17.307 12.705 27.798 1.00 0.00 H ATOM 4402 HB2 HIS B 65 -16.147 9.937 27.320 1.00 0.00 H ATOM 4403 HB3 HIS B 65 -15.863 10.796 28.852 1.00 0.00 H ATOM 4404 HD2 HIS B 65 -19.157 9.861 26.798 1.00 0.00 H ATOM 4405 HE1 HIS B 65 -19.847 9.427 30.982 1.00 0.00 H ATOM 4406 H HIS B 65 -17.154 10.931 25.466 1.00 0.00 H ATOM 4407 N CYS B 66 -14.539 12.549 26.153 1.00 33.77 N ATOM 4408 CA CYS B 66 -13.158 13.021 26.080 1.00 31.43 C ATOM 4409 C CYS B 66 -12.899 13.996 24.952 1.00 31.50 C ATOM 4410 O CYS B 66 -11.836 14.620 24.907 1.00 28.62 O ATOM 4411 CB CYS B 66 -12.206 11.824 25.962 1.00 31.67 C ATOM 4412 SG CYS B 66 -12.318 10.665 27.354 1.00 32.95 S ATOM 4413 HA CYS B 66 -12.975 13.570 27.004 1.00 0.00 H ATOM 4414 HB2 CYS B 66 -11.184 12.200 25.908 1.00 0.00 H ATOM 4415 HB3 CYS B 66 -12.442 11.285 25.045 1.00 0.00 H ATOM 4416 HG CYS B 66 -12.008 11.325 28.526 1.00 0.00 H ATOM 4417 H CYS B 66 -14.968 12.109 25.314 1.00 0.00 H ATOM 4418 N LYS B 67 -13.837 14.133 24.021 1.00 32.14 N ATOM 4419 CA LYS B 67 -13.618 14.994 22.869 1.00 32.12 C ATOM 4420 C LYS B 67 -12.180 14.974 22.369 1.00 32.19 C ATOM 4421 O LYS B 67 -11.525 16.014 22.377 1.00 30.02 O ATOM 4422 CB LYS B 67 -13.971 16.450 23.216 1.00 35.63 C ATOM 4423 CG LYS B 67 -15.432 16.805 23.108 1.00 39.16 C ATOM 4424 CD LYS B 67 -16.218 16.423 24.342 1.00 41.03 C ATOM 4425 CE LYS B 67 -17.579 17.101 24.298 1.00 43.60 C ATOM 4426 NZ LYS B 67 -18.662 16.296 24.933 1.00 43.70 N ATOM 4427 HA LYS B 67 -14.263 14.603 22.082 1.00 0.00 H ATOM 4428 HB2 LYS B 67 -13.654 16.638 24.242 1.00 0.00 H ATOM 4429 HB3 LYS B 67 -13.416 17.101 22.541 1.00 0.00 H ATOM 4430 HG2 LYS B 67 -15.520 17.881 22.958 1.00 0.00 H ATOM 4431 HG3 LYS B 67 -15.855 16.284 22.249 1.00 0.00 H ATOM 4432 HD2 LYS B 67 -16.350 15.341 24.370 1.00 0.00 H ATOM 4433 HD3 LYS B 67 -15.678 16.745 25.233 1.00 0.00 H ATOM 4434 HE2 LYS B 67 -17.844 17.277 23.255 1.00 0.00 H ATOM 4435 HE3 LYS B 67 -17.507 18.056 24.819 1.00 0.00 H ATOM 4436 HZ1 LYS B 67 -18.750 15.385 24.439 1.00 0.00 H ATOM 4437 HZ2 LYS B 67 -18.428 16.129 25.932 1.00 0.00 H ATOM 4438 HZ3 LYS B 67 -19.561 16.815 24.869 1.00 0.00 H ATOM 4439 H LYS B 67 -14.736 13.620 24.117 1.00 0.00 H ATOM 4440 N PRO B 68 -11.683 13.814 21.887 1.00 30.05 N ATOM 4441 CA PRO B 68 -10.362 13.840 21.267 1.00 29.19 C ATOM 4442 C PRO B 68 -10.373 14.566 19.922 1.00 30.24 C ATOM 4443 O PRO B 68 -11.416 14.647 19.301 1.00 30.47 O ATOM 4444 CB PRO B 68 -10.032 12.361 21.079 1.00 29.70 C ATOM 4445 CG PRO B 68 -11.358 11.695 20.963 1.00 29.44 C ATOM 4446 CD PRO B 68 -12.287 12.471 21.856 1.00 29.14 C ATOM 4447 HA PRO B 68 -9.632 14.376 21.873 1.00 0.00 H ATOM 4448 HD3 PRO B 68 -13.293 12.504 21.438 1.00 0.00 H ATOM 4449 HD2 PRO B 68 -12.324 12.036 22.855 1.00 0.00 H ATOM 4450 HG3 PRO B 68 -11.292 10.658 21.293 1.00 0.00 H ATOM 4451 HG2 PRO B 68 -11.709 11.725 19.932 1.00 0.00 H ATOM 4452 HB2 PRO B 68 -9.444 12.209 20.174 1.00 0.00 H ATOM 4453 HB3 PRO B 68 -9.481 11.977 21.938 1.00 0.00 H ATOM 4454 N ASP B 69 -9.217 15.059 19.481 1.00 29.49 N ATOM 4455 CA ASP B 69 -9.102 15.768 18.203 1.00 30.76 C ATOM 4456 C ASP B 69 -8.924 14.845 17.006 1.00 28.37 C ATOM 4457 O ASP B 69 -9.223 15.213 15.870 1.00 27.83 O ATOM 4458 CB ASP B 69 -7.922 16.731 18.246 1.00 34.16 C ATOM 4459 CG ASP B 69 -8.037 17.714 19.367 1.00 36.59 C ATOM 4460 OD1 ASP B 69 -9.005 18.512 19.372 1.00 39.01 O ATOM 4461 OD2 ASP B 69 -7.172 17.658 20.263 1.00 42.36 O ATOM 4462 HA ASP B 69 -10.045 16.299 18.071 1.00 0.00 H ATOM 4463 HB2 ASP B 69 -7.004 16.157 18.375 1.00 0.00 H ATOM 4464 HB3 ASP B 69 -7.879 17.276 17.303 1.00 0.00 H ATOM 4465 H ASP B 69 -8.365 14.937 20.065 1.00 0.00 H ATOM 4466 N VAL B 70 -8.376 13.666 17.258 1.00 26.98 N ATOM 4467 CA VAL B 70 -8.225 12.647 16.232 1.00 25.75 C ATOM 4468 C VAL B 70 -8.420 11.301 16.899 1.00 24.66 C ATOM 4469 O VAL B 70 -8.305 11.194 18.124 1.00 23.09 O ATOM 4470 CB VAL B 70 -6.833 12.646 15.573 1.00 26.73 C ATOM 4471 CG1 VAL B 70 -6.547 13.964 14.862 1.00 27.86 C ATOM 4472 CG2 VAL B 70 -5.747 12.324 16.588 1.00 27.25 C ATOM 4473 HA VAL B 70 -8.956 12.852 15.450 1.00 0.00 H ATOM 4474 HB VAL B 70 -6.830 11.861 14.817 1.00 0.00 H ATOM 4475 HG11 VAL B 70 -7.295 14.127 14.086 1.00 0.00 H ATOM 4476 HG12 VAL B 70 -6.586 14.780 15.583 1.00 0.00 H ATOM 4477 HG13 VAL B 70 -5.556 13.924 14.410 1.00 0.00 H ATOM 4478 HG21 VAL B 70 -5.758 13.073 17.380 1.00 0.00 H ATOM 4479 HG22 VAL B 70 -5.932 11.339 17.016 1.00 0.00 H ATOM 4480 HG23 VAL B 70 -4.776 12.331 16.093 1.00 0.00 H ATOM 4481 H VAL B 70 -8.043 13.462 18.222 1.00 0.00 H ATOM 4482 N ILE B 71 -8.713 10.297 16.079 1.00 23.51 N ATOM 4483 CA ILE B 71 -8.870 8.912 16.537 1.00 21.84 C ATOM 4484 C ILE B 71 -7.991 8.011 15.695 1.00 20.02 C ATOM 4485 O ILE B 71 -8.052 8.018 14.479 1.00 19.69 O ATOM 4486 CB ILE B 71 -10.352 8.452 16.529 1.00 22.45 C ATOM 4487 CG1 ILE B 71 -11.079 9.096 17.722 1.00 23.29 C ATOM 4488 CG2 ILE B 71 -10.454 6.926 16.652 1.00 23.11 C ATOM 4489 CD1 ILE B 71 -12.559 8.847 17.797 1.00 24.80 C ATOM 4490 HA ILE B 71 -8.551 8.849 17.577 1.00 0.00 H ATOM 4491 HB ILE B 71 -10.807 8.758 15.587 1.00 0.00 H ATOM 4492 HG12 ILE B 71 -10.628 8.711 18.637 1.00 0.00 H ATOM 4493 HG13 ILE B 71 -10.923 10.173 17.667 1.00 0.00 H ATOM 4494 HD11 ILE B 71 -13.038 9.239 16.900 1.00 0.00 H ATOM 4495 HD12 ILE B 71 -12.743 7.775 17.870 1.00 0.00 H ATOM 4496 HD13 ILE B 71 -12.966 9.347 18.676 1.00 0.00 H ATOM 4497 HG21 ILE B 71 -9.938 6.460 15.813 1.00 0.00 H ATOM 4498 HG22 ILE B 71 -9.993 6.606 17.587 1.00 0.00 H ATOM 4499 HG23 ILE B 71 -11.503 6.631 16.644 1.00 0.00 H ATOM 4500 H ILE B 71 -8.837 10.502 15.067 1.00 0.00 H ATOM 4501 N ILE B 72 -7.168 7.230 16.383 1.00 19.12 N ATOM 4502 CA ILE B 72 -6.410 6.153 15.809 1.00 19.15 C ATOM 4503 C ILE B 72 -7.007 4.820 16.301 1.00 18.42 C ATOM 4504 O ILE B 72 -7.108 4.600 17.505 1.00 17.46 O ATOM 4505 CB ILE B 72 -4.953 6.227 16.262 1.00 20.02 C ATOM 4506 CG1 ILE B 72 -4.349 7.613 15.907 1.00 21.26 C ATOM 4507 CG2 ILE B 72 -4.158 5.074 15.668 1.00 20.28 C ATOM 4508 CD1 ILE B 72 -3.027 7.882 16.604 1.00 22.38 C ATOM 4509 HA ILE B 72 -6.452 6.225 14.722 1.00 0.00 H ATOM 4510 HB ILE B 72 -4.903 6.125 17.346 1.00 0.00 H ATOM 4511 HG12 ILE B 72 -4.189 7.656 14.830 1.00 0.00 H ATOM 4512 HG13 ILE B 72 -5.059 8.387 16.199 1.00 0.00 H ATOM 4513 HD11 ILE B 72 -3.174 7.852 17.684 1.00 0.00 H ATOM 4514 HD12 ILE B 72 -2.303 7.121 16.313 1.00 0.00 H ATOM 4515 HD13 ILE B 72 -2.658 8.866 16.314 1.00 0.00 H ATOM 4516 HG21 ILE B 72 -4.588 4.129 16.000 1.00 0.00 H ATOM 4517 HG22 ILE B 72 -4.197 5.130 14.580 1.00 0.00 H ATOM 4518 HG23 ILE B 72 -3.122 5.140 16.000 1.00 0.00 H ATOM 4519 H ILE B 72 -7.065 7.409 17.402 1.00 0.00 H ATOM 4520 N ASN B 73 -7.415 3.968 15.362 1.00 17.02 N ATOM 4521 CA ASN B 73 -7.900 2.631 15.681 1.00 17.10 C ATOM 4522 C ASN B 73 -6.718 1.687 15.545 1.00 17.77 C ATOM 4523 O ASN B 73 -6.139 1.556 14.456 1.00 19.02 O ATOM 4524 CB ASN B 73 -9.030 2.221 14.744 1.00 16.77 C ATOM 4525 CG ASN B 73 -9.447 0.753 14.908 1.00 16.66 C ATOM 4526 OD1 ASN B 73 -9.737 0.081 13.937 1.00 17.41 O ATOM 4527 ND2 ASN B 73 -9.487 0.273 16.124 1.00 15.16 N ATOM 4528 HA ASN B 73 -8.305 2.602 16.693 1.00 0.00 H ATOM 4529 HB2 ASN B 73 -9.895 2.852 14.947 1.00 0.00 H ATOM 4530 HB3 ASN B 73 -8.702 2.376 13.716 1.00 0.00 H ATOM 4531 HD22 ASN B 73 -9.232 0.878 16.931 1.00 0.00 H ATOM 4532 HD21 ASN B 73 -9.774 -0.714 16.284 1.00 0.00 H ATOM 4533 H ASN B 73 -7.387 4.267 14.366 1.00 0.00 H ATOM 4534 N THR B 74 -6.355 1.032 16.643 1.00 18.52 N ATOM 4535 CA THR B 74 -5.240 0.106 16.636 1.00 18.72 C ATOM 4536 C THR B 74 -5.659 -1.339 16.899 1.00 17.88 C ATOM 4537 O THR B 74 -6.826 -1.628 17.167 1.00 17.65 O ATOM 4538 CB THR B 74 -4.152 0.522 17.649 1.00 20.86 C ATOM 4539 OG1 THR B 74 -2.945 -0.196 17.355 1.00 24.82 O ATOM 4540 CG2 THR B 74 -4.557 0.256 19.062 1.00 20.93 C ATOM 4541 HA THR B 74 -4.830 0.152 15.627 1.00 0.00 H ATOM 4542 HB THR B 74 -3.999 1.597 17.553 1.00 0.00 H ATOM 4543 HG1 THR B 74 -2.648 0.022 16.436 1.00 0.00 H ATOM 4544 HG23 THR B 74 -5.474 0.802 19.285 1.00 0.00 H ATOM 4545 HG21 THR B 74 -4.727 -0.812 19.195 1.00 0.00 H ATOM 4546 HG22 THR B 74 -3.764 0.585 19.734 1.00 0.00 H ATOM 4547 H THR B 74 -6.882 1.187 17.526 1.00 0.00 H ATOM 4548 N GLY B 75 -4.688 -2.241 16.796 1.00 16.20 N ATOM 4549 CA GLY B 75 -4.905 -3.647 17.067 1.00 16.06 C ATOM 4550 C GLY B 75 -4.450 -4.555 15.933 1.00 15.48 C ATOM 4551 O GLY B 75 -3.591 -4.186 15.126 1.00 14.61 O ATOM 4552 HA3 GLY B 75 -5.970 -3.807 17.233 1.00 0.00 H ATOM 4553 HA2 GLY B 75 -4.354 -3.915 17.968 1.00 0.00 H ATOM 4554 H GLY B 75 -3.739 -1.926 16.511 1.00 0.00 H ATOM 4555 N SER B 76 -5.081 -5.723 15.874 1.00 16.07 N ATOM 4556 CA SER B 76 -4.722 -6.765 14.938 1.00 16.20 C ATOM 4557 C SER B 76 -5.634 -6.675 13.725 1.00 17.42 C ATOM 4558 O SER B 76 -6.634 -5.941 13.734 1.00 15.71 O ATOM 4559 CB SER B 76 -4.872 -8.143 15.616 1.00 17.13 C ATOM 4560 OG SER B 76 -6.199 -8.403 16.117 1.00 17.22 O ATOM 4561 HA SER B 76 -3.686 -6.641 14.622 1.00 0.00 H ATOM 4562 HB2 SER B 76 -4.173 -8.194 16.451 1.00 0.00 H ATOM 4563 HB3 SER B 76 -4.622 -8.914 14.887 1.00 0.00 H ATOM 4564 HG SER B 76 -6.437 -7.716 16.789 1.00 0.00 H ATOM 4565 H SER B 76 -5.869 -5.895 16.531 1.00 0.00 H ATOM 4566 N ALA B 77 -5.325 -7.473 12.704 1.00 17.22 N ATOM 4567 CA ALA B 77 -6.112 -7.565 11.481 1.00 17.88 C ATOM 4568 C ALA B 77 -5.737 -8.825 10.705 1.00 19.31 C ATOM 4569 O ALA B 77 -4.624 -9.316 10.835 1.00 18.96 O ATOM 4570 CB ALA B 77 -5.885 -6.353 10.605 1.00 17.88 C ATOM 4571 HA ALA B 77 -7.165 -7.609 11.760 1.00 0.00 H ATOM 4572 HB1 ALA B 77 -6.180 -5.454 11.147 1.00 0.00 H ATOM 4573 HB2 ALA B 77 -4.829 -6.290 10.341 1.00 0.00 H ATOM 4574 HB3 ALA B 77 -6.483 -6.445 9.698 1.00 0.00 H ATOM 4575 H ALA B 77 -4.473 -8.064 12.784 1.00 0.00 H ATOM 4576 N GLY B 78 -6.697 -9.347 9.940 1.00 20.79 N ATOM 4577 CA GLY B 78 -6.479 -10.460 9.006 1.00 20.69 C ATOM 4578 C GLY B 78 -5.957 -9.871 7.708 1.00 22.17 C ATOM 4579 O GLY B 78 -6.574 -8.969 7.129 1.00 21.39 O ATOM 4580 HA3 GLY B 78 -7.417 -10.985 8.826 1.00 0.00 H ATOM 4581 HA2 GLY B 78 -5.749 -11.156 9.420 1.00 0.00 H ATOM 4582 H GLY B 78 -7.653 -8.944 10.009 1.00 0.00 H ATOM 4583 N GLY B 79 -4.783 -10.333 7.275 1.00 23.07 N ATOM 4584 CA GLY B 79 -4.110 -9.747 6.129 1.00 23.39 C ATOM 4585 C GLY B 79 -4.656 -10.329 4.837 1.00 25.23 C ATOM 4586 O GLY B 79 -4.840 -11.549 4.725 1.00 24.71 O ATOM 4587 HA3 GLY B 79 -3.042 -9.956 6.194 1.00 0.00 H ATOM 4588 HA2 GLY B 79 -4.269 -8.669 6.132 1.00 0.00 H ATOM 4589 H GLY B 79 -4.339 -11.132 7.770 1.00 0.00 H ATOM 4590 N LEU B 80 -4.936 -9.446 3.876 1.00 25.57 N ATOM 4591 CA LEU B 80 -5.437 -9.869 2.555 1.00 27.92 C ATOM 4592 C LEU B 80 -4.498 -9.543 1.404 1.00 29.15 C ATOM 4593 O LEU B 80 -4.473 -10.285 0.431 1.00 31.12 O ATOM 4594 CB LEU B 80 -6.802 -9.237 2.257 1.00 25.87 C ATOM 4595 CG LEU B 80 -7.873 -9.511 3.295 1.00 25.57 C ATOM 4596 CD1 LEU B 80 -9.086 -8.637 3.023 1.00 25.71 C ATOM 4597 CD2 LEU B 80 -8.231 -10.988 3.307 1.00 25.79 C ATOM 4598 HA LEU B 80 -5.517 -10.954 2.621 1.00 0.00 H ATOM 4599 HB2 LEU B 80 -6.667 -8.158 2.186 1.00 0.00 H ATOM 4600 HB3 LEU B 80 -7.152 -9.622 1.299 1.00 0.00 H ATOM 4601 HG LEU B 80 -7.494 -9.261 4.286 1.00 0.00 H ATOM 4602 HD21 LEU B 80 -8.604 -11.278 2.325 1.00 0.00 H ATOM 4603 HD22 LEU B 80 -7.344 -11.574 3.547 1.00 0.00 H ATOM 4604 HD23 LEU B 80 -9.001 -11.168 4.057 1.00 0.00 H ATOM 4605 HD11 LEU B 80 -8.795 -7.588 3.072 1.00 0.00 H ATOM 4606 HD12 LEU B 80 -9.478 -8.860 2.031 1.00 0.00 H ATOM 4607 HD13 LEU B 80 -9.852 -8.838 3.772 1.00 0.00 H ATOM 4608 H LEU B 80 -4.797 -8.433 4.064 1.00 0.00 H ATOM 4609 N ALA B 81 -3.772 -8.428 1.484 1.00 30.55 N ATOM 4610 CA ALA B 81 -2.806 -8.060 0.438 1.00 33.35 C ATOM 4611 C ALA B 81 -1.631 -9.048 0.380 1.00 37.58 C ATOM 4612 O ALA B 81 -1.281 -9.698 1.385 1.00 36.61 O ATOM 4613 CB ALA B 81 -2.296 -6.637 0.630 1.00 32.30 C ATOM 4614 HA ALA B 81 -3.333 -8.108 -0.515 1.00 0.00 H ATOM 4615 HB1 ALA B 81 -3.135 -5.943 0.587 1.00 0.00 H ATOM 4616 HB2 ALA B 81 -1.805 -6.556 1.600 1.00 0.00 H ATOM 4617 HB3 ALA B 81 -1.584 -6.398 -0.160 1.00 0.00 H ATOM 4618 H ALA B 81 -3.892 -7.803 2.306 1.00 0.00 H ATOM 4619 N SER B 82 -1.034 -9.150 -0.811 1.00 43.93 N ATOM 4620 CA SER B 82 0.000 -10.161 -1.095 1.00 45.83 C ATOM 4621 C SER B 82 1.272 -9.924 -0.301 1.00 45.55 C ATOM 4622 O SER B 82 1.827 -10.859 0.265 1.00 48.18 O ATOM 4623 CB SER B 82 0.334 -10.186 -2.593 1.00 46.19 C ATOM 4624 OG SER B 82 0.752 -8.904 -3.054 1.00 46.68 O ATOM 4625 HA SER B 82 -0.412 -11.123 -0.792 1.00 0.00 H ATOM 4626 HB2 SER B 82 -0.552 -10.492 -3.149 1.00 0.00 H ATOM 4627 HB3 SER B 82 1.136 -10.904 -2.766 1.00 0.00 H ATOM 4628 HG SER B 82 0.959 -8.954 -4.021 1.00 0.00 H ATOM 4629 H SER B 82 -1.310 -8.491 -1.567 1.00 0.00 H ATOM 4630 N THR B 83 1.708 -8.667 -0.240 1.00 45.89 N ATOM 4631 CA THR B 83 2.978 -8.326 0.387 1.00 46.14 C ATOM 4632 C THR B 83 2.922 -8.236 1.924 1.00 46.84 C ATOM 4633 O THR B 83 3.763 -7.561 2.517 1.00 47.09 O ATOM 4634 CB THR B 83 3.524 -6.985 -0.156 1.00 46.60 C ATOM 4635 OG1 THR B 83 2.593 -5.940 0.125 1.00 49.17 O ATOM 4636 CG2 THR B 83 3.769 -7.044 -1.665 1.00 45.14 C ATOM 4637 HA THR B 83 3.641 -9.152 0.129 1.00 0.00 H ATOM 4638 HB THR B 83 4.476 -6.789 0.338 1.00 0.00 H ATOM 4639 HG1 THR B 83 2.462 -5.870 1.104 1.00 0.00 H ATOM 4640 HG23 THR B 83 4.480 -7.841 -1.886 1.00 0.00 H ATOM 4641 HG21 THR B 83 2.828 -7.243 -2.177 1.00 0.00 H ATOM 4642 HG22 THR B 83 4.174 -6.090 -2.004 1.00 0.00 H ATOM 4643 H THR B 83 1.126 -7.909 -0.651 1.00 0.00 H ATOM 4644 N LEU B 84 1.977 -8.932 2.568 1.00 45.34 N ATOM 4645 CA LEU B 84 1.768 -8.806 4.018 1.00 43.80 C ATOM 4646 C LEU B 84 2.111 -10.077 4.766 1.00 42.14 C ATOM 4647 O LEU B 84 1.559 -11.127 4.479 1.00 42.83 O ATOM 4648 CB LEU B 84 0.308 -8.451 4.326 1.00 43.77 C ATOM 4649 CG LEU B 84 -0.118 -7.019 4.003 1.00 42.37 C ATOM 4650 CD1 LEU B 84 -1.620 -6.858 4.192 1.00 42.71 C ATOM 4651 CD2 LEU B 84 0.636 -6.022 4.861 1.00 42.69 C ATOM 4652 HA LEU B 84 2.436 -8.012 4.352 1.00 0.00 H ATOM 4653 HB2 LEU B 84 -0.327 -9.125 3.752 1.00 0.00 H ATOM 4654 HB3 LEU B 84 0.142 -8.616 5.391 1.00 0.00 H ATOM 4655 HG LEU B 84 0.126 -6.818 2.960 1.00 0.00 H ATOM 4656 HD21 LEU B 84 0.429 -6.220 5.913 1.00 0.00 H ATOM 4657 HD22 LEU B 84 1.705 -6.120 4.675 1.00 0.00 H ATOM 4658 HD23 LEU B 84 0.313 -5.012 4.610 1.00 0.00 H ATOM 4659 HD11 LEU B 84 -2.144 -7.544 3.527 1.00 0.00 H ATOM 4660 HD12 LEU B 84 -1.881 -7.082 5.226 1.00 0.00 H ATOM 4661 HD13 LEU B 84 -1.907 -5.833 3.958 1.00 0.00 H ATOM 4662 H LEU B 84 1.372 -9.582 2.026 1.00 0.00 H ATOM 4663 N LYS B 85 3.002 -9.965 5.747 1.00 40.70 N ATOM 4664 CA LYS B 85 3.312 -11.067 6.649 1.00 40.91 C ATOM 4665 C LYS B 85 2.718 -10.794 8.025 1.00 37.32 C ATOM 4666 O LYS B 85 2.437 -9.657 8.372 1.00 35.61 O ATOM 4667 CB LYS B 85 4.823 -11.217 6.854 1.00 43.92 C ATOM 4668 CG LYS B 85 5.715 -11.054 5.630 1.00 46.34 C ATOM 4669 CD LYS B 85 7.190 -11.218 6.016 1.00 47.97 C ATOM 4670 CE LYS B 85 7.728 -10.143 6.975 1.00 46.00 C ATOM 4671 NZ LYS B 85 7.774 -8.783 6.365 1.00 45.76 N ATOM 4672 HA LYS B 85 2.899 -11.969 6.198 1.00 0.00 H ATOM 4673 HB2 LYS B 85 5.130 -10.469 7.585 1.00 0.00 H ATOM 4674 HB3 LYS B 85 5.001 -12.213 7.259 1.00 0.00 H ATOM 4675 HG2 LYS B 85 5.451 -11.810 4.890 1.00 0.00 H ATOM 4676 HG3 LYS B 85 5.563 -10.062 5.204 1.00 0.00 H ATOM 4677 HD2 LYS B 85 7.310 -12.190 6.494 1.00 0.00 H ATOM 4678 HD3 LYS B 85 7.785 -11.188 5.103 1.00 0.00 H ATOM 4679 HE2 LYS B 85 8.737 -10.422 7.278 1.00 0.00 H ATOM 4680 HE3 LYS B 85 7.083 -10.108 7.853 1.00 0.00 H ATOM 4681 HZ1 LYS B 85 8.394 -8.800 5.530 1.00 0.00 H ATOM 4682 HZ2 LYS B 85 6.815 -8.500 6.080 1.00 0.00 H ATOM 4683 HZ3 LYS B 85 8.145 -8.105 7.061 1.00 0.00 H ATOM 4684 H LYS B 85 3.495 -9.058 5.875 1.00 0.00 H ATOM 4685 N VAL B 86 2.591 -11.849 8.815 1.00 34.14 N ATOM 4686 CA VAL B 86 2.259 -11.726 10.217 1.00 34.55 C ATOM 4687 C VAL B 86 3.239 -10.744 10.863 1.00 33.48 C ATOM 4688 O VAL B 86 4.455 -10.884 10.714 1.00 30.77 O ATOM 4689 CB VAL B 86 2.299 -13.102 10.895 1.00 36.58 C ATOM 4690 CG1 VAL B 86 2.216 -12.983 12.407 1.00 38.10 C ATOM 4691 CG2 VAL B 86 1.159 -13.965 10.370 1.00 37.85 C ATOM 4692 HA VAL B 86 1.246 -11.342 10.336 1.00 0.00 H ATOM 4693 HB VAL B 86 3.253 -13.572 10.655 1.00 0.00 H ATOM 4694 HG11 VAL B 86 3.059 -12.395 12.771 1.00 0.00 H ATOM 4695 HG12 VAL B 86 1.283 -12.491 12.681 1.00 0.00 H ATOM 4696 HG13 VAL B 86 2.247 -13.978 12.851 1.00 0.00 H ATOM 4697 HG21 VAL B 86 0.208 -13.481 10.589 1.00 0.00 H ATOM 4698 HG22 VAL B 86 1.265 -14.089 9.292 1.00 0.00 H ATOM 4699 HG23 VAL B 86 1.191 -14.941 10.854 1.00 0.00 H ATOM 4700 H VAL B 86 2.735 -12.798 8.414 1.00 0.00 H ATOM 4701 N GLY B 87 2.709 -9.710 11.515 1.00 29.70 N ATOM 4702 CA GLY B 87 3.541 -8.663 12.106 1.00 27.66 C ATOM 4703 C GLY B 87 3.598 -7.386 11.317 1.00 26.12 C ATOM 4704 O GLY B 87 3.884 -6.335 11.870 1.00 25.94 O ATOM 4705 HA3 GLY B 87 4.556 -9.049 12.202 1.00 0.00 H ATOM 4706 HA2 GLY B 87 3.146 -8.434 13.096 1.00 0.00 H ATOM 4707 H GLY B 87 1.675 -9.646 11.606 1.00 0.00 H ATOM 4708 N ASP B 88 3.313 -7.451 10.022 1.00 26.12 N ATOM 4709 CA ASP B 88 3.334 -6.252 9.195 1.00 25.67 C ATOM 4710 C ASP B 88 2.177 -5.318 9.491 1.00 23.88 C ATOM 4711 O ASP B 88 1.175 -5.710 10.057 1.00 23.06 O ATOM 4712 CB ASP B 88 3.351 -6.609 7.709 1.00 30.13 C ATOM 4713 CG ASP B 88 4.685 -7.257 7.275 1.00 33.16 C ATOM 4714 OD1 ASP B 88 5.702 -7.099 7.991 1.00 33.39 O ATOM 4715 OD2 ASP B 88 4.705 -7.928 6.223 1.00 35.58 O ATOM 4716 HA ASP B 88 4.254 -5.723 9.446 1.00 0.00 H ATOM 4717 HB2 ASP B 88 2.540 -7.308 7.507 1.00 0.00 H ATOM 4718 HB3 ASP B 88 3.198 -5.699 7.128 1.00 0.00 H ATOM 4719 H ASP B 88 3.072 -8.368 9.593 1.00 0.00 H ATOM 4720 N ILE B 89 2.356 -4.072 9.110 1.00 23.50 N ATOM 4721 CA ILE B 89 1.428 -3.015 9.424 1.00 24.60 C ATOM 4722 C ILE B 89 0.482 -2.777 8.244 1.00 24.44 C ATOM 4723 O ILE B 89 0.907 -2.736 7.090 1.00 21.69 O ATOM 4724 CB ILE B 89 2.172 -1.695 9.701 1.00 24.61 C ATOM 4725 CG1 ILE B 89 3.138 -1.833 10.898 1.00 26.72 C ATOM 4726 CG2 ILE B 89 1.207 -0.532 9.880 1.00 24.36 C ATOM 4727 CD1 ILE B 89 2.519 -2.347 12.180 1.00 27.08 C ATOM 4728 HA ILE B 89 0.871 -3.320 10.310 1.00 0.00 H ATOM 4729 HB ILE B 89 2.778 -1.471 8.823 1.00 0.00 H ATOM 4730 HG12 ILE B 89 3.934 -2.520 10.610 1.00 0.00 H ATOM 4731 HG13 ILE B 89 3.564 -0.850 11.101 1.00 0.00 H ATOM 4732 HD11 ILE B 89 1.729 -1.667 12.499 1.00 0.00 H ATOM 4733 HD12 ILE B 89 2.099 -3.338 12.007 1.00 0.00 H ATOM 4734 HD13 ILE B 89 3.284 -2.405 12.954 1.00 0.00 H ATOM 4735 HG21 ILE B 89 0.616 -0.409 8.973 1.00 0.00 H ATOM 4736 HG22 ILE B 89 0.545 -0.737 10.722 1.00 0.00 H ATOM 4737 HG23 ILE B 89 1.771 0.380 10.073 1.00 0.00 H ATOM 4738 H ILE B 89 3.206 -3.839 8.557 1.00 0.00 H ATOM 4739 N VAL B 90 -0.793 -2.568 8.556 1.00 23.81 N ATOM 4740 CA VAL B 90 -1.735 -2.039 7.567 1.00 23.44 C ATOM 4741 C VAL B 90 -2.277 -0.711 8.016 1.00 23.59 C ATOM 4742 O VAL B 90 -2.563 -0.496 9.202 1.00 23.96 O ATOM 4743 CB VAL B 90 -2.883 -3.004 7.246 1.00 23.32 C ATOM 4744 CG1 VAL B 90 -2.363 -4.137 6.393 1.00 24.67 C ATOM 4745 CG2 VAL B 90 -3.517 -3.551 8.504 1.00 23.26 C ATOM 4746 HA VAL B 90 -1.172 -1.910 6.643 1.00 0.00 H ATOM 4747 HB VAL B 90 -3.651 -2.454 6.702 1.00 0.00 H ATOM 4748 HG11 VAL B 90 -1.955 -3.734 5.466 1.00 0.00 H ATOM 4749 HG12 VAL B 90 -1.581 -4.669 6.935 1.00 0.00 H ATOM 4750 HG13 VAL B 90 -3.179 -4.823 6.165 1.00 0.00 H ATOM 4751 HG21 VAL B 90 -2.766 -4.088 9.084 1.00 0.00 H ATOM 4752 HG22 VAL B 90 -3.914 -2.727 9.097 1.00 0.00 H ATOM 4753 HG23 VAL B 90 -4.326 -4.231 8.236 1.00 0.00 H ATOM 4754 H VAL B 90 -1.127 -2.783 9.517 1.00 0.00 H ATOM 4755 N VAL B 91 -2.408 0.174 7.044 1.00 23.43 N ATOM 4756 CA VAL B 91 -2.867 1.524 7.247 1.00 25.19 C ATOM 4757 C VAL B 91 -4.056 1.768 6.327 1.00 24.17 C ATOM 4758 O VAL B 91 -4.010 1.442 5.120 1.00 22.71 O ATOM 4759 CB VAL B 91 -1.757 2.523 6.915 1.00 25.91 C ATOM 4760 CG1 VAL B 91 -2.230 3.958 7.117 1.00 27.37 C ATOM 4761 CG2 VAL B 91 -0.521 2.197 7.752 1.00 27.36 C ATOM 4762 HA VAL B 91 -3.153 1.659 8.290 1.00 0.00 H ATOM 4763 HB VAL B 91 -1.491 2.435 5.862 1.00 0.00 H ATOM 4764 HG11 VAL B 91 -3.082 4.154 6.465 1.00 0.00 H ATOM 4765 HG12 VAL B 91 -2.526 4.099 8.156 1.00 0.00 H ATOM 4766 HG13 VAL B 91 -1.419 4.644 6.873 1.00 0.00 H ATOM 4767 HG21 VAL B 91 -0.772 2.266 8.810 1.00 0.00 H ATOM 4768 HG22 VAL B 91 -0.185 1.186 7.523 1.00 0.00 H ATOM 4769 HG23 VAL B 91 0.272 2.907 7.518 1.00 0.00 H ATOM 4770 H VAL B 91 -2.166 -0.121 6.077 1.00 0.00 H ATOM 4771 N SER B 92 -5.121 2.328 6.896 1.00 22.31 N ATOM 4772 CA SER B 92 -6.326 2.605 6.127 1.00 22.73 C ATOM 4773 C SER B 92 -6.192 3.840 5.251 1.00 23.43 C ATOM 4774 O SER B 92 -5.897 4.949 5.749 1.00 23.29 O ATOM 4775 CB SER B 92 -7.520 2.864 7.048 1.00 22.20 C ATOM 4776 OG SER B 92 -7.297 4.024 7.845 1.00 21.17 O ATOM 4777 HA SER B 92 -6.477 1.721 5.508 1.00 0.00 H ATOM 4778 HB2 SER B 92 -7.663 2.003 7.701 1.00 0.00 H ATOM 4779 HB3 SER B 92 -8.414 3.012 6.443 1.00 0.00 H ATOM 4780 HG SER B 92 -7.170 4.809 7.255 1.00 0.00 H ATOM 4781 H SER B 92 -5.092 2.572 7.907 1.00 0.00 H ATOM 4782 N ASP B 93 -6.448 3.673 3.954 1.00 23.70 N ATOM 4783 CA ASP B 93 -6.772 4.810 3.096 1.00 23.96 C ATOM 4784 C ASP B 93 -8.285 5.057 3.145 1.00 23.09 C ATOM 4785 O ASP B 93 -8.770 6.207 3.074 1.00 23.34 O ATOM 4786 CB ASP B 93 -6.341 4.552 1.658 1.00 24.44 C ATOM 4787 CG ASP B 93 -6.492 5.777 0.800 1.00 25.37 C ATOM 4788 OD1 ASP B 93 -7.320 5.748 -0.127 1.00 26.59 O ATOM 4789 OD2 ASP B 93 -5.808 6.783 1.088 1.00 27.25 O ATOM 4790 HA ASP B 93 -6.235 5.687 3.458 1.00 0.00 H ATOM 4791 HB2 ASP B 93 -5.295 4.244 1.653 1.00 0.00 H ATOM 4792 HB3 ASP B 93 -6.956 3.753 1.243 1.00 0.00 H ATOM 4793 H ASP B 93 -6.417 2.717 3.546 1.00 0.00 H ATOM 4794 N GLU B 94 -9.026 3.964 3.300 1.00 21.90 N ATOM 4795 CA GLU B 94 -10.491 3.974 3.347 1.00 22.01 C ATOM 4796 C GLU B 94 -10.975 2.728 4.119 1.00 18.88 C ATOM 4797 O GLU B 94 -10.260 1.739 4.200 1.00 19.61 O ATOM 4798 CB GLU B 94 -11.019 3.938 1.896 1.00 23.70 C ATOM 4799 CG GLU B 94 -12.513 3.738 1.699 1.00 26.56 C ATOM 4800 CD GLU B 94 -12.881 3.559 0.231 1.00 29.91 C ATOM 4801 OE1 GLU B 94 -12.041 3.092 -0.565 1.00 33.46 O ATOM 4802 OE2 GLU B 94 -14.024 3.850 -0.136 1.00 34.44 O ATOM 4803 HA GLU B 94 -10.858 4.868 3.850 1.00 0.00 H ATOM 4804 HB2 GLU B 94 -10.751 4.885 1.427 1.00 0.00 H ATOM 4805 HB3 GLU B 94 -10.509 3.123 1.383 1.00 0.00 H ATOM 4806 HG2 GLU B 94 -12.824 2.851 2.250 1.00 0.00 H ATOM 4807 HG3 GLU B 94 -13.039 4.609 2.089 1.00 0.00 H ATOM 4808 H GLU B 94 -8.539 3.050 3.393 1.00 0.00 H ATOM 4809 N THR B 95 -12.205 2.796 4.629 1.00 17.77 N ATOM 4810 CA THR B 95 -12.888 1.661 5.261 1.00 16.86 C ATOM 4811 C THR B 95 -14.283 1.473 4.662 1.00 16.26 C ATOM 4812 O THR B 95 -14.959 2.433 4.340 1.00 16.99 O ATOM 4813 CB THR B 95 -13.015 1.852 6.786 1.00 16.54 C ATOM 4814 OG1 THR B 95 -13.697 3.097 7.074 1.00 16.46 O ATOM 4815 CG2 THR B 95 -11.644 1.883 7.400 1.00 16.85 C ATOM 4816 HA THR B 95 -12.283 0.775 5.070 1.00 0.00 H ATOM 4817 HB THR B 95 -13.588 1.024 7.203 1.00 0.00 H ATOM 4818 HG1 THR B 95 -13.181 3.851 6.693 1.00 0.00 H ATOM 4819 HG23 THR B 95 -11.129 0.947 7.184 1.00 0.00 H ATOM 4820 HG21 THR B 95 -11.078 2.715 6.981 1.00 0.00 H ATOM 4821 HG22 THR B 95 -11.733 2.010 8.479 1.00 0.00 H ATOM 4822 H THR B 95 -12.709 3.704 4.576 1.00 0.00 H ATOM 4823 N ARG B 96 -14.670 0.216 4.477 1.00 16.48 N ATOM 4824 CA ARG B 96 -15.995 -0.167 4.066 1.00 16.56 C ATOM 4825 C ARG B 96 -16.463 -1.380 4.860 1.00 16.58 C ATOM 4826 O ARG B 96 -15.637 -2.238 5.224 1.00 15.71 O ATOM 4827 CB ARG B 96 -15.994 -0.537 2.584 1.00 17.67 C ATOM 4828 CG ARG B 96 -15.753 0.643 1.661 1.00 18.92 C ATOM 4829 CD ARG B 96 -15.460 0.175 0.257 1.00 20.14 C ATOM 4830 NE ARG B 96 -15.290 1.273 -0.680 1.00 21.98 N ATOM 4831 CZ ARG B 96 -16.170 1.615 -1.626 1.00 23.61 C ATOM 4832 NH1 ARG B 96 -17.331 0.977 -1.778 1.00 22.98 N ATOM 4833 NH2 ARG B 96 -15.875 2.617 -2.436 1.00 23.52 N ATOM 4834 HA ARG B 96 -16.664 0.675 4.244 1.00 0.00 H ATOM 4835 HB2 ARG B 96 -15.209 -1.274 2.413 1.00 0.00 H ATOM 4836 HB3 ARG B 96 -16.961 -0.975 2.338 1.00 0.00 H ATOM 4837 HG2 ARG B 96 -16.641 1.275 1.649 1.00 0.00 H ATOM 4838 HG3 ARG B 96 -14.904 1.218 2.030 1.00 0.00 H ATOM 4839 HD2 ARG B 96 -16.288 -0.448 -0.082 1.00 0.00 H ATOM 4840 HD3 ARG B 96 -14.544 -0.416 0.271 1.00 0.00 H ATOM 4841 HE ARG B 96 -14.418 1.835 -0.609 1.00 0.00 H ATOM 4842 HH12 ARG B 96 -17.992 1.271 -2.525 1.00 0.00 H ATOM 4843 HH11 ARG B 96 -17.576 0.186 -1.149 1.00 0.00 H ATOM 4844 HH22 ARG B 96 -16.545 2.900 -3.179 1.00 0.00 H ATOM 4845 HH21 ARG B 96 -14.972 3.123 -2.330 1.00 0.00 H ATOM 4846 H ARG B 96 -13.972 -0.538 4.639 1.00 0.00 H ATOM 4847 N TYR B 97 -17.784 -1.461 5.075 1.00 15.68 N ATOM 4848 CA TYR B 97 -18.427 -2.692 5.598 1.00 16.57 C ATOM 4849 C TYR B 97 -18.439 -3.791 4.529 1.00 16.91 C ATOM 4850 O TYR B 97 -18.914 -3.537 3.413 1.00 17.08 O ATOM 4851 CB TYR B 97 -19.876 -2.387 5.956 1.00 15.92 C ATOM 4852 CG TYR B 97 -20.063 -1.400 7.070 1.00 15.06 C ATOM 4853 CD1 TYR B 97 -20.732 -0.214 6.863 1.00 15.10 C ATOM 4854 CD2 TYR B 97 -19.585 -1.661 8.324 1.00 15.04 C ATOM 4855 CE1 TYR B 97 -20.904 0.697 7.867 1.00 14.64 C ATOM 4856 CE2 TYR B 97 -19.760 -0.764 9.354 1.00 15.04 C ATOM 4857 CZ TYR B 97 -20.420 0.424 9.103 1.00 15.08 C ATOM 4858 OH TYR B 97 -20.572 1.346 10.089 1.00 15.47 O ATOM 4859 HA TYR B 97 -17.865 -3.027 6.470 1.00 0.00 H ATOM 4860 HB3 TYR B 97 -20.356 -3.321 6.248 1.00 0.00 H ATOM 4861 HB2 TYR B 97 -20.367 -1.990 5.067 1.00 0.00 H ATOM 4862 HD2 TYR B 97 -19.056 -2.595 8.512 1.00 0.00 H ATOM 4863 HE2 TYR B 97 -19.384 -0.988 10.352 1.00 0.00 H ATOM 4864 HE1 TYR B 97 -21.426 1.635 7.675 1.00 0.00 H ATOM 4865 HD1 TYR B 97 -21.134 0.003 5.874 1.00 0.00 H ATOM 4866 HH TYR B 97 -21.064 2.128 9.735 1.00 0.00 H ATOM 4867 H TYR B 97 -18.378 -0.633 4.868 1.00 0.00 H ATOM 4868 N HIS B 98 -17.964 -4.997 4.834 1.00 16.94 N ATOM 4869 CA HIS B 98 -18.050 -6.078 3.837 1.00 16.70 C ATOM 4870 C HIS B 98 -19.333 -6.870 3.975 1.00 16.66 C ATOM 4871 O HIS B 98 -19.662 -7.636 3.072 1.00 16.19 O ATOM 4872 CB HIS B 98 -16.814 -7.013 3.849 1.00 16.21 C ATOM 4873 CG HIS B 98 -16.637 -7.776 5.126 1.00 15.98 C ATOM 4874 ND1 HIS B 98 -17.375 -8.897 5.436 1.00 15.65 N ATOM 4875 CD2 HIS B 98 -15.792 -7.584 6.165 1.00 14.84 C ATOM 4876 CE1 HIS B 98 -17.003 -9.354 6.616 1.00 15.63 C ATOM 4877 NE2 HIS B 98 -16.044 -8.573 7.077 1.00 15.18 N ATOM 4878 HA HIS B 98 -18.061 -5.586 2.864 1.00 0.00 H ATOM 4879 HB2 HIS B 98 -16.918 -7.729 3.034 1.00 0.00 H ATOM 4880 HB3 HIS B 98 -15.923 -6.406 3.686 1.00 0.00 H ATOM 4881 HD2 HIS B 98 -15.050 -6.791 6.258 1.00 0.00 H ATOM 4882 HE1 HIS B 98 -17.416 -10.226 7.123 1.00 0.00 H ATOM 4883 H HIS B 98 -17.537 -5.174 5.766 1.00 0.00 H ATOM 4884 N ASP B 99 -20.058 -6.679 5.090 1.00 16.04 N ATOM 4885 CA ASP B 99 -21.277 -7.415 5.349 1.00 16.40 C ATOM 4886 C ASP B 99 -22.568 -6.576 5.267 1.00 16.61 C ATOM 4887 O ASP B 99 -23.617 -7.003 5.765 1.00 18.11 O ATOM 4888 CB ASP B 99 -21.187 -8.191 6.682 1.00 16.42 C ATOM 4889 CG ASP B 99 -21.027 -7.290 7.913 1.00 17.12 C ATOM 4890 OD1 ASP B 99 -20.928 -6.040 7.775 1.00 16.20 O ATOM 4891 OD2 ASP B 99 -20.983 -7.858 9.029 1.00 16.93 O ATOM 4892 HA ASP B 99 -21.359 -8.130 4.530 1.00 0.00 H ATOM 4893 HB2 ASP B 99 -22.098 -8.777 6.801 1.00 0.00 H ATOM 4894 HB3 ASP B 99 -20.329 -8.861 6.633 1.00 0.00 H ATOM 4895 H ASP B 99 -19.733 -5.981 5.789 1.00 0.00 H ATOM 4896 N ALA B 100 -22.509 -5.396 4.659 1.00 15.04 N ATOM 4897 CA ALA B 100 -23.704 -4.575 4.541 1.00 15.77 C ATOM 4898 C ALA B 100 -24.304 -4.747 3.145 1.00 16.01 C ATOM 4899 O ALA B 100 -23.583 -4.664 2.162 1.00 16.86 O ATOM 4900 CB ALA B 100 -23.392 -3.129 4.800 1.00 15.29 C ATOM 4901 HA ALA B 100 -24.427 -4.900 5.289 1.00 0.00 H ATOM 4902 HB1 ALA B 100 -22.991 -3.020 5.808 1.00 0.00 H ATOM 4903 HB2 ALA B 100 -22.656 -2.782 4.075 1.00 0.00 H ATOM 4904 HB3 ALA B 100 -24.304 -2.539 4.705 1.00 0.00 H ATOM 4905 H ALA B 100 -21.607 -5.059 4.267 1.00 0.00 H ATOM 4906 N ASP B 101 -25.610 -4.988 3.071 1.00 15.67 N ATOM 4907 CA ASP B 101 -26.273 -5.221 1.774 1.00 16.79 C ATOM 4908 C ASP B 101 -27.672 -4.646 1.715 1.00 15.60 C ATOM 4909 O ASP B 101 -28.632 -5.252 2.170 1.00 14.93 O ATOM 4910 CB ASP B 101 -26.301 -6.722 1.438 1.00 18.08 C ATOM 4911 CG ASP B 101 -26.849 -7.012 0.035 1.00 19.22 C ATOM 4912 OD1 ASP B 101 -26.862 -8.205 -0.343 1.00 21.38 O ATOM 4913 OD2 ASP B 101 -27.281 -6.086 -0.682 1.00 19.70 O ATOM 4914 HA ASP B 101 -25.680 -4.694 1.026 1.00 0.00 H ATOM 4915 HB2 ASP B 101 -25.285 -7.112 1.502 1.00 0.00 H ATOM 4916 HB3 ASP B 101 -26.930 -7.230 2.169 1.00 0.00 H ATOM 4917 H ASP B 101 -26.174 -5.013 3.944 1.00 0.00 H ATOM 4918 N VAL B 102 -27.765 -3.458 1.135 1.00 16.00 N ATOM 4919 CA VAL B 102 -29.034 -2.826 0.824 1.00 16.71 C ATOM 4920 C VAL B 102 -29.031 -2.552 -0.691 1.00 16.58 C ATOM 4921 O VAL B 102 -29.630 -1.583 -1.171 1.00 16.24 O ATOM 4922 CB VAL B 102 -29.249 -1.541 1.656 1.00 18.33 C ATOM 4923 CG1 VAL B 102 -30.692 -1.080 1.565 1.00 20.31 C ATOM 4924 CG2 VAL B 102 -28.962 -1.794 3.108 1.00 19.28 C ATOM 4925 HA VAL B 102 -29.869 -3.476 1.086 1.00 0.00 H ATOM 4926 HB VAL B 102 -28.574 -0.785 1.255 1.00 0.00 H ATOM 4927 HG11 VAL B 102 -30.941 -0.873 0.524 1.00 0.00 H ATOM 4928 HG12 VAL B 102 -31.347 -1.863 1.948 1.00 0.00 H ATOM 4929 HG13 VAL B 102 -30.821 -0.174 2.158 1.00 0.00 H ATOM 4930 HG21 VAL B 102 -29.631 -2.571 3.479 1.00 0.00 H ATOM 4931 HG22 VAL B 102 -27.928 -2.119 3.221 1.00 0.00 H ATOM 4932 HG23 VAL B 102 -29.120 -0.876 3.674 1.00 0.00 H ATOM 4933 H VAL B 102 -26.888 -2.955 0.891 1.00 0.00 H ATOM 4934 N THR B 103 -28.405 -3.465 -1.448 1.00 16.19 N ATOM 4935 CA THR B 103 -28.404 -3.411 -2.912 1.00 16.43 C ATOM 4936 C THR B 103 -29.819 -3.503 -3.528 1.00 16.58 C ATOM 4937 O THR B 103 -30.003 -3.077 -4.656 1.00 18.63 O ATOM 4938 CB THR B 103 -27.502 -4.501 -3.564 1.00 16.74 C ATOM 4939 OG1 THR B 103 -27.917 -5.794 -3.113 1.00 14.53 O ATOM 4940 CG2 THR B 103 -26.040 -4.303 -3.215 1.00 16.49 C ATOM 4941 HA THR B 103 -27.988 -2.429 -3.137 1.00 0.00 H ATOM 4942 HB THR B 103 -27.609 -4.419 -4.646 1.00 0.00 H ATOM 4943 HG1 THR B 103 -27.833 -5.841 -2.128 1.00 0.00 H ATOM 4944 HG23 THR B 103 -25.716 -3.319 -3.556 1.00 0.00 H ATOM 4945 HG21 THR B 103 -25.913 -4.375 -2.135 1.00 0.00 H ATOM 4946 HG22 THR B 103 -25.443 -5.073 -3.704 1.00 0.00 H ATOM 4947 H THR B 103 -27.900 -4.243 -0.977 1.00 0.00 H ATOM 4948 N ALA B 104 -30.801 -4.038 -2.807 1.00 17.06 N ATOM 4949 CA ALA B 104 -32.175 -4.103 -3.293 1.00 18.36 C ATOM 4950 C ALA B 104 -32.777 -2.705 -3.510 1.00 18.32 C ATOM 4951 O ALA B 104 -33.699 -2.540 -4.274 1.00 19.70 O ATOM 4952 CB ALA B 104 -33.053 -4.926 -2.338 1.00 18.77 C ATOM 4953 HA ALA B 104 -32.150 -4.601 -4.262 1.00 0.00 H ATOM 4954 HB1 ALA B 104 -32.657 -5.939 -2.265 1.00 0.00 H ATOM 4955 HB2 ALA B 104 -33.050 -4.461 -1.352 1.00 0.00 H ATOM 4956 HB3 ALA B 104 -34.073 -4.960 -2.722 1.00 0.00 H ATOM 4957 H ALA B 104 -30.582 -4.423 -1.866 1.00 0.00 H ATOM 4958 N PHE B 105 -32.214 -1.703 -2.865 1.00 17.52 N ATOM 4959 CA PHE B 105 -32.645 -0.316 -3.049 1.00 18.61 C ATOM 4960 C PHE B 105 -31.640 0.513 -3.854 1.00 19.92 C ATOM 4961 O PHE B 105 -31.715 1.745 -3.861 1.00 20.26 O ATOM 4962 CB PHE B 105 -32.863 0.309 -1.684 1.00 18.08 C ATOM 4963 CG PHE B 105 -33.984 -0.323 -0.921 1.00 17.78 C ATOM 4964 CD1 PHE B 105 -33.738 -1.114 0.167 1.00 18.13 C ATOM 4965 CD2 PHE B 105 -35.290 -0.137 -1.316 1.00 18.75 C ATOM 4966 CE1 PHE B 105 -34.771 -1.676 0.880 1.00 17.40 C ATOM 4967 CE2 PHE B 105 -36.338 -0.703 -0.619 1.00 19.22 C ATOM 4968 CZ PHE B 105 -36.069 -1.482 0.483 1.00 18.61 C ATOM 4969 HA PHE B 105 -33.572 -0.323 -3.623 1.00 0.00 H ATOM 4970 HB2 PHE B 105 -31.946 0.205 -1.104 1.00 0.00 H ATOM 4971 HB3 PHE B 105 -33.088 1.367 -1.819 1.00 0.00 H ATOM 4972 HD2 PHE B 105 -35.500 0.470 -2.197 1.00 0.00 H ATOM 4973 HE2 PHE B 105 -37.367 -0.535 -0.938 1.00 0.00 H ATOM 4974 HZ PHE B 105 -36.885 -1.943 1.039 1.00 0.00 H ATOM 4975 HE1 PHE B 105 -34.557 -2.278 1.763 1.00 0.00 H ATOM 4976 HD1 PHE B 105 -32.709 -1.302 0.473 1.00 0.00 H ATOM 4977 H PHE B 105 -31.438 -1.904 -2.203 1.00 0.00 H ATOM 4978 N GLY B 106 -30.714 -0.166 -4.530 1.00 20.12 N ATOM 4979 CA GLY B 106 -29.770 0.480 -5.455 1.00 20.43 C ATOM 4980 C GLY B 106 -28.456 0.999 -4.901 1.00 21.04 C ATOM 4981 O GLY B 106 -27.652 1.594 -5.632 1.00 20.30 O ATOM 4982 HA3 GLY B 106 -30.288 1.328 -5.904 1.00 0.00 H ATOM 4983 HA2 GLY B 106 -29.528 -0.248 -6.229 1.00 0.00 H ATOM 4984 H GLY B 106 -30.656 -1.196 -4.398 1.00 0.00 H ATOM 4985 N TYR B 107 -28.225 0.803 -3.610 1.00 21.21 N ATOM 4986 CA TYR B 107 -26.927 1.119 -3.018 1.00 22.11 C ATOM 4987 C TYR B 107 -25.826 0.174 -3.489 1.00 21.86 C ATOM 4988 O TYR B 107 -26.095 -0.974 -3.830 1.00 20.84 O ATOM 4989 CB TYR B 107 -27.021 1.007 -1.497 1.00 23.24 C ATOM 4990 CG TYR B 107 -27.921 2.047 -0.957 1.00 21.33 C ATOM 4991 CD1 TYR B 107 -27.451 3.347 -0.761 1.00 22.24 C ATOM 4992 CD2 TYR B 107 -29.250 1.774 -0.705 1.00 20.80 C ATOM 4993 CE1 TYR B 107 -28.285 4.346 -0.305 1.00 21.92 C ATOM 4994 CE2 TYR B 107 -30.101 2.768 -0.251 1.00 21.26 C ATOM 4995 CZ TYR B 107 -29.604 4.056 -0.054 1.00 22.32 C ATOM 4996 OH TYR B 107 -30.415 5.044 0.436 1.00 26.16 O ATOM 4997 HA TYR B 107 -26.673 2.132 -3.332 1.00 0.00 H ATOM 4998 HB3 TYR B 107 -26.028 1.132 -1.066 1.00 0.00 H ATOM 4999 HB2 TYR B 107 -27.409 0.023 -1.233 1.00 0.00 H ATOM 5000 HD2 TYR B 107 -29.634 0.766 -0.865 1.00 0.00 H ATOM 5001 HE2 TYR B 107 -31.149 2.546 -0.050 1.00 0.00 H ATOM 5002 HE1 TYR B 107 -27.902 5.354 -0.146 1.00 0.00 H ATOM 5003 HD1 TYR B 107 -26.407 3.576 -0.972 1.00 0.00 H ATOM 5004 HH TYR B 107 -31.179 5.177 -0.179 1.00 0.00 H ATOM 5005 H TYR B 107 -28.981 0.418 -3.008 1.00 0.00 H ATOM 5006 N GLU B 108 -24.595 0.676 -3.502 1.00 22.02 N ATOM 5007 CA GLU B 108 -23.444 -0.163 -3.760 1.00 22.18 C ATOM 5008 C GLU B 108 -23.336 -1.209 -2.648 1.00 20.44 C ATOM 5009 O GLU B 108 -23.754 -0.977 -1.513 1.00 17.12 O ATOM 5010 CB GLU B 108 -22.180 0.693 -3.829 1.00 24.38 C ATOM 5011 CG GLU B 108 -20.982 0.001 -4.437 1.00 26.71 C ATOM 5012 CD GLU B 108 -19.790 0.927 -4.558 1.00 28.47 C ATOM 5013 OE1 GLU B 108 -19.954 2.139 -4.294 1.00 31.25 O ATOM 5014 OE2 GLU B 108 -18.691 0.453 -4.918 1.00 30.28 O ATOM 5015 HA GLU B 108 -23.558 -0.671 -4.717 1.00 0.00 H ATOM 5016 HB2 GLU B 108 -22.401 1.578 -4.426 1.00 0.00 H ATOM 5017 HB3 GLU B 108 -21.919 0.996 -2.815 1.00 0.00 H ATOM 5018 HG2 GLU B 108 -20.708 -0.845 -3.807 1.00 0.00 H ATOM 5019 HG3 GLU B 108 -21.250 -0.359 -5.430 1.00 0.00 H ATOM 5020 H GLU B 108 -24.456 1.691 -3.323 1.00 0.00 H ATOM 5021 N TYR B 109 -22.791 -2.371 -2.992 1.00 19.37 N ATOM 5022 CA TYR B 109 -22.555 -3.393 -2.000 1.00 18.20 C ATOM 5023 C TYR B 109 -21.638 -2.857 -0.871 1.00 17.74 C ATOM 5024 O TYR B 109 -20.630 -2.192 -1.139 1.00 17.36 O ATOM 5025 CB TYR B 109 -21.953 -4.656 -2.641 1.00 19.09 C ATOM 5026 CG TYR B 109 -21.973 -5.776 -1.652 1.00 19.76 C ATOM 5027 CD1 TYR B 109 -20.957 -5.892 -0.732 1.00 19.39 C ATOM 5028 CD2 TYR B 109 -23.062 -6.649 -1.555 1.00 20.84 C ATOM 5029 CE1 TYR B 109 -20.973 -6.866 0.218 1.00 21.56 C ATOM 5030 CE2 TYR B 109 -23.085 -7.658 -0.590 1.00 21.53 C ATOM 5031 CZ TYR B 109 -22.032 -7.745 0.295 1.00 22.69 C ATOM 5032 OH TYR B 109 -21.967 -8.695 1.284 1.00 27.22 O ATOM 5033 HA TYR B 109 -23.514 -3.666 -1.561 1.00 0.00 H ATOM 5034 HB3 TYR B 109 -20.925 -4.456 -2.943 1.00 0.00 H ATOM 5035 HB2 TYR B 109 -22.540 -4.934 -3.517 1.00 0.00 H ATOM 5036 HD2 TYR B 109 -23.902 -6.540 -2.241 1.00 0.00 H ATOM 5037 HE2 TYR B 109 -23.917 -8.361 -0.538 1.00 0.00 H ATOM 5038 HE1 TYR B 109 -20.145 -6.952 0.921 1.00 0.00 H ATOM 5039 HD1 TYR B 109 -20.123 -5.190 -0.765 1.00 0.00 H ATOM 5040 HH TYR B 109 -21.131 -8.576 1.800 1.00 0.00 H ATOM 5041 H TYR B 109 -22.532 -2.546 -3.984 1.00 0.00 H ATOM 5042 N GLY B 110 -22.000 -3.138 0.387 1.00 16.83 N ATOM 5043 CA GLY B 110 -21.237 -2.621 1.546 1.00 17.62 C ATOM 5044 C GLY B 110 -21.689 -1.246 2.028 1.00 17.11 C ATOM 5045 O GLY B 110 -21.361 -0.844 3.147 1.00 17.80 O ATOM 5046 HA3 GLY B 110 -20.186 -2.556 1.263 1.00 0.00 H ATOM 5047 HA2 GLY B 110 -21.347 -3.326 2.370 1.00 0.00 H ATOM 5048 H GLY B 110 -22.836 -3.733 0.554 1.00 0.00 H ATOM 5049 N GLN B 111 -22.438 -0.521 1.204 1.00 16.98 N ATOM 5050 CA GLN B 111 -22.948 0.816 1.581 1.00 17.11 C ATOM 5051 C GLN B 111 -24.235 0.745 2.414 1.00 16.70 C ATOM 5052 O GLN B 111 -25.161 -0.012 2.103 1.00 15.92 O ATOM 5053 CB GLN B 111 -23.193 1.640 0.310 1.00 17.51 C ATOM 5054 CG GLN B 111 -23.652 3.070 0.542 1.00 17.58 C ATOM 5055 CD GLN B 111 -23.779 3.842 -0.762 1.00 18.70 C ATOM 5056 OE1 GLN B 111 -23.873 3.255 -1.845 1.00 18.50 O ATOM 5057 NE2 GLN B 111 -23.736 5.161 -0.668 1.00 19.20 N ATOM 5058 HA GLN B 111 -22.193 1.293 2.205 1.00 0.00 H ATOM 5059 HB2 GLN B 111 -22.262 1.672 -0.255 1.00 0.00 H ATOM 5060 HB3 GLN B 111 -23.957 1.132 -0.279 1.00 0.00 H ATOM 5061 HG2 GLN B 111 -24.622 3.053 1.038 1.00 0.00 H ATOM 5062 HG3 GLN B 111 -22.927 3.574 1.181 1.00 0.00 H ATOM 5063 HE22 GLN B 111 -23.656 5.614 0.265 1.00 0.00 H ATOM 5064 HE21 GLN B 111 -23.782 5.745 -1.527 1.00 0.00 H ATOM 5065 H GLN B 111 -22.673 -0.905 0.266 1.00 0.00 H ATOM 5066 N LEU B 112 -24.314 1.537 3.474 1.00 16.40 N ATOM 5067 CA LEU B 112 -25.555 1.652 4.210 1.00 17.26 C ATOM 5068 C LEU B 112 -26.283 2.935 3.780 1.00 18.67 C ATOM 5069 O LEU B 112 -25.629 3.906 3.396 1.00 19.24 O ATOM 5070 CB LEU B 112 -25.301 1.608 5.712 1.00 17.87 C ATOM 5071 CG LEU B 112 -24.992 0.156 6.156 1.00 18.80 C ATOM 5072 CD1 LEU B 112 -24.540 0.049 7.592 1.00 19.66 C ATOM 5073 CD2 LEU B 112 -26.175 -0.790 5.932 1.00 19.27 C ATOM 5074 HA LEU B 112 -26.198 0.803 3.979 1.00 0.00 H ATOM 5075 HB2 LEU B 112 -24.452 2.248 5.954 1.00 0.00 H ATOM 5076 HB3 LEU B 112 -26.186 1.966 6.238 1.00 0.00 H ATOM 5077 HG LEU B 112 -24.164 -0.150 5.517 1.00 0.00 H ATOM 5078 HD21 LEU B 112 -27.033 -0.439 6.505 1.00 0.00 H ATOM 5079 HD22 LEU B 112 -26.428 -0.809 4.872 1.00 0.00 H ATOM 5080 HD23 LEU B 112 -25.903 -1.793 6.260 1.00 0.00 H ATOM 5081 HD11 LEU B 112 -23.630 0.634 7.730 1.00 0.00 H ATOM 5082 HD12 LEU B 112 -25.322 0.432 8.247 1.00 0.00 H ATOM 5083 HD13 LEU B 112 -24.342 -0.996 7.832 1.00 0.00 H ATOM 5084 H LEU B 112 -23.480 2.079 3.778 1.00 0.00 H ATOM 5085 N PRO B 113 -27.626 2.923 3.794 1.00 19.03 N ATOM 5086 CA PRO B 113 -28.374 4.118 3.332 1.00 19.07 C ATOM 5087 C PRO B 113 -27.981 5.316 4.139 1.00 19.63 C ATOM 5088 O PRO B 113 -27.833 5.206 5.366 1.00 20.09 O ATOM 5089 CB PRO B 113 -29.824 3.772 3.639 1.00 19.64 C ATOM 5090 CG PRO B 113 -29.861 2.261 3.613 1.00 19.00 C ATOM 5091 CD PRO B 113 -28.516 1.785 4.078 1.00 18.61 C ATOM 5092 HA PRO B 113 -28.189 4.350 2.283 1.00 0.00 H ATOM 5093 HD3 PRO B 113 -28.531 1.559 5.144 1.00 0.00 H ATOM 5094 HD2 PRO B 113 -28.204 0.899 3.524 1.00 0.00 H ATOM 5095 HG3 PRO B 113 -30.055 1.908 2.600 1.00 0.00 H ATOM 5096 HG2 PRO B 113 -30.641 1.893 4.280 1.00 0.00 H ATOM 5097 HB2 PRO B 113 -30.112 4.149 4.620 1.00 0.00 H ATOM 5098 HB3 PRO B 113 -30.489 4.188 2.882 1.00 0.00 H ATOM 5099 N GLY B 114 -27.782 6.449 3.471 1.00 19.40 N ATOM 5100 CA GLY B 114 -27.404 7.656 4.182 1.00 19.60 C ATOM 5101 C GLY B 114 -25.933 7.766 4.475 1.00 18.06 C ATOM 5102 O GLY B 114 -25.495 8.788 5.009 1.00 18.71 O ATOM 5103 HA3 GLY B 114 -27.944 7.678 5.129 1.00 0.00 H ATOM 5104 HA2 GLY B 114 -27.697 8.515 3.578 1.00 0.00 H ATOM 5105 H GLY B 114 -27.898 6.470 2.438 1.00 0.00 H ATOM 5106 N CYS B 115 -25.147 6.760 4.100 1.00 18.92 N ATOM 5107 CA CYS B 115 -23.679 6.829 4.232 1.00 18.82 C ATOM 5108 C CYS B 115 -22.984 6.819 2.891 1.00 18.78 C ATOM 5109 O CYS B 115 -23.512 6.304 1.898 1.00 17.94 O ATOM 5110 CB CYS B 115 -23.123 5.624 5.014 1.00 20.35 C ATOM 5111 SG CYS B 115 -23.742 5.386 6.677 1.00 22.69 S ATOM 5112 HA CYS B 115 -23.485 7.764 4.757 1.00 0.00 H ATOM 5113 HB2 CYS B 115 -22.041 5.743 5.078 1.00 0.00 H ATOM 5114 HB3 CYS B 115 -23.355 4.725 4.444 1.00 0.00 H ATOM 5115 HG CYS B 115 -25.110 5.207 6.636 1.00 0.00 H ATOM 5116 H CYS B 115 -25.579 5.901 3.703 1.00 0.00 H ATOM 5117 N PRO B 116 -21.749 7.336 2.860 1.00 18.44 N ATOM 5118 CA PRO B 116 -20.968 7.118 1.669 1.00 19.78 C ATOM 5119 C PRO B 116 -20.685 5.615 1.579 1.00 20.15 C ATOM 5120 O PRO B 116 -20.836 4.908 2.596 1.00 20.14 O ATOM 5121 CB PRO B 116 -19.692 7.916 1.954 1.00 20.17 C ATOM 5122 CG PRO B 116 -19.570 7.874 3.437 1.00 19.99 C ATOM 5123 CD PRO B 116 -20.967 7.998 3.925 1.00 19.57 C ATOM 5124 HA PRO B 116 -21.435 7.421 0.732 1.00 0.00 H ATOM 5125 HD3 PRO B 116 -21.096 7.489 4.880 1.00 0.00 H ATOM 5126 HD2 PRO B 116 -21.254 9.044 4.030 1.00 0.00 H ATOM 5127 HG3 PRO B 116 -18.960 8.702 3.798 1.00 0.00 H ATOM 5128 HG2 PRO B 116 -19.130 6.931 3.762 1.00 0.00 H ATOM 5129 HB2 PRO B 116 -18.828 7.450 1.480 1.00 0.00 H ATOM 5130 HB3 PRO B 116 -19.789 8.943 1.601 1.00 0.00 H ATOM 5131 N ALA B 117 -20.274 5.140 0.415 1.00 20.06 N ATOM 5132 CA ALA B 117 -20.024 3.697 0.221 1.00 21.14 C ATOM 5133 C ALA B 117 -18.768 3.258 0.951 1.00 20.58 C ATOM 5134 O ALA B 117 -18.633 2.092 1.289 1.00 21.64 O ATOM 5135 CB ALA B 117 -19.912 3.363 -1.247 1.00 20.98 C ATOM 5136 HA ALA B 117 -20.873 3.156 0.638 1.00 0.00 H ATOM 5137 HB1 ALA B 117 -20.841 3.629 -1.751 1.00 0.00 H ATOM 5138 HB2 ALA B 117 -19.086 3.924 -1.684 1.00 0.00 H ATOM 5139 HB3 ALA B 117 -19.728 2.295 -1.362 1.00 0.00 H ATOM 5140 H ALA B 117 -20.124 5.795 -0.379 1.00 0.00 H ATOM 5141 N GLY B 118 -17.856 4.202 1.185 1.00 20.61 N ATOM 5142 CA GLY B 118 -16.674 3.973 2.007 1.00 20.08 C ATOM 5143 C GLY B 118 -16.315 5.246 2.740 1.00 20.07 C ATOM 5144 O GLY B 118 -16.760 6.333 2.357 1.00 20.60 O ATOM 5145 HA3 GLY B 118 -15.841 3.673 1.371 1.00 0.00 H ATOM 5146 HA2 GLY B 118 -16.881 3.183 2.729 1.00 0.00 H ATOM 5147 H GLY B 118 -17.994 5.142 0.763 1.00 0.00 H ATOM 5148 N PHE B 119 -15.574 5.112 3.834 1.00 18.76 N ATOM 5149 CA PHE B 119 -15.178 6.253 4.631 1.00 18.97 C ATOM 5150 C PHE B 119 -13.689 6.508 4.402 1.00 19.12 C ATOM 5151 O PHE B 119 -12.833 5.643 4.630 1.00 17.63 O ATOM 5152 CB PHE B 119 -15.464 6.017 6.123 1.00 18.89 C ATOM 5153 CG PHE B 119 -16.912 5.819 6.446 1.00 17.61 C ATOM 5154 CD1 PHE B 119 -17.750 6.912 6.662 1.00 18.14 C ATOM 5155 CD2 PHE B 119 -17.446 4.551 6.573 1.00 18.60 C ATOM 5156 CE1 PHE B 119 -19.083 6.736 6.963 1.00 17.46 C ATOM 5157 CE2 PHE B 119 -18.798 4.374 6.875 1.00 17.38 C ATOM 5158 CZ PHE B 119 -19.605 5.455 7.056 1.00 17.92 C ATOM 5159 HA PHE B 119 -15.757 7.125 4.327 1.00 0.00 H ATOM 5160 HB2 PHE B 119 -14.918 5.128 6.440 1.00 0.00 H ATOM 5161 HB3 PHE B 119 -15.104 6.881 6.681 1.00 0.00 H ATOM 5162 HD2 PHE B 119 -16.805 3.680 6.436 1.00 0.00 H ATOM 5163 HE2 PHE B 119 -19.208 3.368 6.966 1.00 0.00 H ATOM 5164 HZ PHE B 119 -20.663 5.313 7.274 1.00 0.00 H ATOM 5165 HE1 PHE B 119 -19.725 7.601 7.127 1.00 0.00 H ATOM 5166 HD1 PHE B 119 -17.344 7.921 6.592 1.00 0.00 H ATOM 5167 H PHE B 119 -15.270 4.161 4.126 1.00 0.00 H ATOM 5168 N LYS B 120 -13.381 7.710 3.947 1.00 21.44 N ATOM 5169 CA LYS B 120 -11.992 8.095 3.659 1.00 23.69 C ATOM 5170 C LYS B 120 -11.281 8.437 4.948 1.00 22.32 C ATOM 5171 O LYS B 120 -11.729 9.276 5.696 1.00 23.49 O ATOM 5172 CB LYS B 120 -11.929 9.316 2.723 1.00 26.12 C ATOM 5173 CG LYS B 120 -12.222 9.014 1.267 1.00 29.18 C ATOM 5174 CD LYS B 120 -12.570 10.290 0.506 1.00 28.97 C ATOM 5175 CE LYS B 120 -12.917 10.044 -0.954 1.00 29.12 C ATOM 5176 NZ LYS B 120 -11.730 10.142 -1.846 1.00 29.83 N ATOM 5177 HA LYS B 120 -11.509 7.251 3.167 1.00 0.00 H ATOM 5178 HB2 LYS B 120 -12.657 10.049 3.071 1.00 0.00 H ATOM 5179 HB3 LYS B 120 -10.928 9.742 2.787 1.00 0.00 H ATOM 5180 HG2 LYS B 120 -11.343 8.556 0.813 1.00 0.00 H ATOM 5181 HG3 LYS B 120 -13.062 8.322 1.208 1.00 0.00 H ATOM 5182 HD2 LYS B 120 -13.426 10.760 0.991 1.00 0.00 H ATOM 5183 HD3 LYS B 120 -11.714 10.964 0.550 1.00 0.00 H ATOM 5184 HE2 LYS B 120 -13.653 10.784 -1.268 1.00 0.00 H ATOM 5185 HE3 LYS B 120 -13.344 9.046 -1.049 1.00 0.00 H ATOM 5186 HZ1 LYS B 120 -11.318 11.094 -1.770 1.00 0.00 H ATOM 5187 HZ2 LYS B 120 -11.024 9.434 -1.560 1.00 0.00 H ATOM 5188 HZ3 LYS B 120 -12.021 9.966 -2.829 1.00 0.00 H ATOM 5189 H LYS B 120 -14.141 8.402 3.789 1.00 0.00 H ATOM 5190 N ALA B 121 -10.185 7.762 5.208 1.00 23.82 N ATOM 5191 CA ALA B 121 -9.353 8.054 6.356 1.00 25.41 C ATOM 5192 C ALA B 121 -8.617 9.380 6.092 1.00 26.69 C ATOM 5193 O ALA B 121 -8.421 9.763 4.948 1.00 27.36 O ATOM 5194 CB ALA B 121 -8.368 6.907 6.577 1.00 24.92 C ATOM 5195 HA ALA B 121 -9.956 8.154 7.258 1.00 0.00 H ATOM 5196 HB1 ALA B 121 -8.921 5.984 6.754 1.00 0.00 H ATOM 5197 HB2 ALA B 121 -7.741 6.793 5.693 1.00 0.00 H ATOM 5198 HB3 ALA B 121 -7.742 7.129 7.442 1.00 0.00 H ATOM 5199 H ALA B 121 -9.905 6.992 4.568 1.00 0.00 H ATOM 5200 N ASP B 122 -8.238 10.072 7.152 1.00 28.33 N ATOM 5201 CA ASP B 122 -7.652 11.409 7.049 1.00 30.37 C ATOM 5202 C ASP B 122 -6.252 11.400 6.402 1.00 32.04 C ATOM 5203 O ASP B 122 -5.393 10.579 6.740 1.00 29.52 O ATOM 5204 CB ASP B 122 -7.630 12.041 8.441 1.00 31.78 C ATOM 5205 CG ASP B 122 -7.079 13.458 8.442 1.00 36.31 C ATOM 5206 OD1 ASP B 122 -5.835 13.626 8.329 1.00 39.93 O ATOM 5207 OD2 ASP B 122 -7.891 14.393 8.595 1.00 34.05 O ATOM 5208 HA ASP B 122 -8.271 12.010 6.383 1.00 0.00 H ATOM 5209 HB2 ASP B 122 -8.649 12.064 8.828 1.00 0.00 H ATOM 5210 HB3 ASP B 122 -7.009 11.426 9.092 1.00 0.00 H ATOM 5211 H ASP B 122 -8.361 9.651 8.095 1.00 0.00 H ATOM 5212 N ASP B 123 -6.032 12.313 5.451 1.00 33.26 N ATOM 5213 CA ASP B 123 -4.779 12.325 4.694 1.00 36.31 C ATOM 5214 C ASP B 123 -3.573 12.753 5.535 1.00 32.77 C ATOM 5215 O ASP B 123 -2.496 12.229 5.324 1.00 33.61 O ATOM 5216 CB ASP B 123 -4.879 13.200 3.430 1.00 39.32 C ATOM 5217 CG ASP B 123 -5.510 12.467 2.233 1.00 42.97 C ATOM 5218 OD1 ASP B 123 -5.315 11.240 2.086 1.00 43.38 O ATOM 5219 OD2 ASP B 123 -6.172 13.143 1.409 1.00 47.54 O ATOM 5220 HA ASP B 123 -4.615 11.291 4.391 1.00 0.00 H ATOM 5221 HB2 ASP B 123 -5.487 14.074 3.661 1.00 0.00 H ATOM 5222 HB3 ASP B 123 -3.876 13.521 3.150 1.00 0.00 H ATOM 5223 H ASP B 123 -6.762 13.025 5.246 1.00 0.00 H ATOM 5224 N LYS B 124 -3.747 13.681 6.471 1.00 34.81 N ATOM 5225 CA LYS B 124 -2.635 14.074 7.353 1.00 34.87 C ATOM 5226 C LYS B 124 -2.240 12.938 8.322 1.00 34.65 C ATOM 5227 O LYS B 124 -1.052 12.680 8.533 1.00 31.01 O ATOM 5228 CB LYS B 124 -2.970 15.344 8.120 1.00 37.90 C ATOM 5229 CG LYS B 124 -3.132 16.557 7.218 1.00 44.29 C ATOM 5230 CD LYS B 124 -3.458 17.824 8.004 1.00 46.65 C ATOM 5231 CE LYS B 124 -3.958 18.935 7.084 1.00 49.84 C ATOM 5232 NZ LYS B 124 -3.034 19.168 5.936 1.00 49.69 N ATOM 5233 HA LYS B 124 -1.774 14.274 6.715 1.00 0.00 H ATOM 5234 HB2 LYS B 124 -3.902 15.187 8.662 1.00 0.00 H ATOM 5235 HB3 LYS B 124 -2.167 15.543 8.830 1.00 0.00 H ATOM 5236 HG2 LYS B 124 -2.203 16.713 6.670 1.00 0.00 H ATOM 5237 HG3 LYS B 124 -3.940 16.364 6.513 1.00 0.00 H ATOM 5238 HD2 LYS B 124 -4.230 17.597 8.739 1.00 0.00 H ATOM 5239 HD3 LYS B 124 -2.559 18.165 8.517 1.00 0.00 H ATOM 5240 HE2 LYS B 124 -4.044 19.857 7.659 1.00 0.00 H ATOM 5241 HE3 LYS B 124 -4.938 18.657 6.696 1.00 0.00 H ATOM 5242 HZ1 LYS B 124 -2.097 19.441 6.296 1.00 0.00 H ATOM 5243 HZ2 LYS B 124 -2.951 18.295 5.377 1.00 0.00 H ATOM 5244 HZ3 LYS B 124 -3.412 19.930 5.338 1.00 0.00 H ATOM 5245 H LYS B 124 -4.677 14.134 6.581 1.00 0.00 H ATOM 5246 N LEU B 125 -3.236 12.245 8.883 1.00 30.68 N ATOM 5247 CA LEU B 125 -2.971 11.060 9.698 1.00 28.23 C ATOM 5248 C LEU B 125 -2.264 9.960 8.916 1.00 26.97 C ATOM 5249 O LEU B 125 -1.300 9.357 9.402 1.00 26.72 O ATOM 5250 CB LEU B 125 -4.275 10.531 10.312 1.00 27.70 C ATOM 5251 CG LEU B 125 -4.953 11.449 11.327 1.00 28.23 C ATOM 5252 CD1 LEU B 125 -6.197 10.778 11.895 1.00 28.06 C ATOM 5253 CD2 LEU B 125 -3.982 11.850 12.436 1.00 29.35 C ATOM 5254 HA LEU B 125 -2.296 11.365 10.497 1.00 0.00 H ATOM 5255 HB2 LEU B 125 -4.979 10.353 9.499 1.00 0.00 H ATOM 5256 HB3 LEU B 125 -4.051 9.588 10.811 1.00 0.00 H ATOM 5257 HG LEU B 125 -5.261 12.362 10.818 1.00 0.00 H ATOM 5258 HD21 LEU B 125 -3.632 10.956 12.952 1.00 0.00 H ATOM 5259 HD22 LEU B 125 -3.132 12.376 12.001 1.00 0.00 H ATOM 5260 HD23 LEU B 125 -4.491 12.503 13.144 1.00 0.00 H ATOM 5261 HD11 LEU B 125 -6.895 10.564 11.085 1.00 0.00 H ATOM 5262 HD12 LEU B 125 -5.914 9.848 12.388 1.00 0.00 H ATOM 5263 HD13 LEU B 125 -6.670 11.444 12.617 1.00 0.00 H ATOM 5264 H LEU B 125 -4.218 12.554 8.737 1.00 0.00 H ATOM 5265 N ILE B 126 -2.729 9.687 7.700 1.00 27.85 N ATOM 5266 CA ILE B 126 -2.105 8.657 6.887 1.00 28.43 C ATOM 5267 C ILE B 126 -0.634 9.009 6.635 1.00 29.64 C ATOM 5268 O ILE B 126 0.245 8.158 6.786 1.00 32.06 O ATOM 5269 CB ILE B 126 -2.824 8.476 5.531 1.00 28.40 C ATOM 5270 CG1 ILE B 126 -4.202 7.845 5.734 1.00 28.05 C ATOM 5271 CG2 ILE B 126 -1.987 7.609 4.584 1.00 28.28 C ATOM 5272 CD1 ILE B 126 -5.170 8.132 4.595 1.00 27.28 C ATOM 5273 HA ILE B 126 -2.179 7.719 7.438 1.00 0.00 H ATOM 5274 HB ILE B 126 -2.950 9.461 5.082 1.00 0.00 H ATOM 5275 HG12 ILE B 126 -4.079 6.765 5.820 1.00 0.00 H ATOM 5276 HG13 ILE B 126 -4.629 8.236 6.658 1.00 0.00 H ATOM 5277 HD11 ILE B 126 -5.312 9.209 4.503 1.00 0.00 H ATOM 5278 HD12 ILE B 126 -4.762 7.737 3.665 1.00 0.00 H ATOM 5279 HD13 ILE B 126 -6.127 7.655 4.804 1.00 0.00 H ATOM 5280 HG21 ILE B 126 -1.023 8.088 4.411 1.00 0.00 H ATOM 5281 HG22 ILE B 126 -1.831 6.628 5.034 1.00 0.00 H ATOM 5282 HG23 ILE B 126 -2.514 7.496 3.636 1.00 0.00 H ATOM 5283 H ILE B 126 -3.545 10.214 7.329 1.00 0.00 H ATOM 5284 N ALA B 127 -0.394 10.252 6.236 1.00 31.48 N ATOM 5285 CA ALA B 127 0.961 10.772 5.994 1.00 33.38 C ATOM 5286 C ALA B 127 1.879 10.538 7.201 1.00 32.34 C ATOM 5287 O ALA B 127 2.986 10.033 7.047 1.00 31.11 O ATOM 5288 CB ALA B 127 0.900 12.260 5.674 1.00 34.53 C ATOM 5289 HA ALA B 127 1.377 10.232 5.144 1.00 0.00 H ATOM 5290 HB1 ALA B 127 0.292 12.414 4.782 1.00 0.00 H ATOM 5291 HB2 ALA B 127 0.456 12.793 6.515 1.00 0.00 H ATOM 5292 HB3 ALA B 127 1.908 12.634 5.497 1.00 0.00 H ATOM 5293 H ALA B 127 -1.203 10.889 6.087 1.00 0.00 H ATOM 5294 N ALA B 128 1.397 10.891 8.393 1.00 31.57 N ATOM 5295 CA ALA B 128 2.151 10.676 9.644 1.00 29.00 C ATOM 5296 C ALA B 128 2.458 9.216 9.904 1.00 28.57 C ATOM 5297 O ALA B 128 3.574 8.874 10.266 1.00 29.31 O ATOM 5298 CB ALA B 128 1.400 11.260 10.814 1.00 29.66 C ATOM 5299 HA ALA B 128 3.106 11.187 9.525 1.00 0.00 H ATOM 5300 HB1 ALA B 128 1.264 12.330 10.659 1.00 0.00 H ATOM 5301 HB2 ALA B 128 0.426 10.777 10.897 1.00 0.00 H ATOM 5302 HB3 ALA B 128 1.969 11.093 11.729 1.00 0.00 H ATOM 5303 H ALA B 128 0.457 11.333 8.443 1.00 0.00 H ATOM 5304 N ALA B 129 1.456 8.356 9.731 1.00 27.27 N ATOM 5305 CA ALA B 129 1.634 6.919 9.902 1.00 25.08 C ATOM 5306 C ALA B 129 2.735 6.401 8.982 1.00 25.89 C ATOM 5307 O ALA B 129 3.610 5.637 9.399 1.00 23.47 O ATOM 5308 CB ALA B 129 0.325 6.185 9.645 1.00 23.19 C ATOM 5309 HA ALA B 129 1.935 6.729 10.932 1.00 0.00 H ATOM 5310 HB1 ALA B 129 -0.430 6.535 10.348 1.00 0.00 H ATOM 5311 HB2 ALA B 129 -0.007 6.382 8.626 1.00 0.00 H ATOM 5312 HB3 ALA B 129 0.478 5.114 9.778 1.00 0.00 H ATOM 5313 H ALA B 129 0.519 8.720 9.466 1.00 0.00 H ATOM 5314 N GLU B 130 2.691 6.844 7.727 1.00 27.49 N ATOM 5315 CA GLU B 130 3.666 6.444 6.728 1.00 29.76 C ATOM 5316 C GLU B 130 5.068 6.966 7.066 1.00 29.19 C ATOM 5317 O GLU B 130 6.054 6.264 6.873 1.00 28.81 O ATOM 5318 CB GLU B 130 3.207 6.894 5.325 1.00 32.26 C ATOM 5319 CG GLU B 130 2.085 6.015 4.781 1.00 34.52 C ATOM 5320 CD GLU B 130 1.698 6.323 3.338 1.00 39.14 C ATOM 5321 OE1 GLU B 130 1.718 7.513 2.957 1.00 42.36 O ATOM 5322 OE2 GLU B 130 1.346 5.376 2.592 1.00 40.92 O ATOM 5323 HA GLU B 130 3.732 5.356 6.729 1.00 0.00 H ATOM 5324 HB2 GLU B 130 2.851 7.923 5.384 1.00 0.00 H ATOM 5325 HB3 GLU B 130 4.056 6.843 4.644 1.00 0.00 H ATOM 5326 HG2 GLU B 130 2.407 4.975 4.835 1.00 0.00 H ATOM 5327 HG3 GLU B 130 1.205 6.154 5.409 1.00 0.00 H ATOM 5328 H GLU B 130 1.932 7.500 7.453 1.00 0.00 H ATOM 5329 N SER B 131 5.153 8.177 7.594 1.00 30.06 N ATOM 5330 CA SER B 131 6.434 8.697 8.066 1.00 33.58 C ATOM 5331 C SER B 131 6.972 7.793 9.184 1.00 34.35 C ATOM 5332 O SER B 131 8.161 7.442 9.187 1.00 30.30 O ATOM 5333 CB SER B 131 6.272 10.139 8.528 1.00 36.91 C ATOM 5334 OG SER B 131 7.421 10.597 9.208 1.00 42.33 O ATOM 5335 HA SER B 131 7.160 8.695 7.253 1.00 0.00 H ATOM 5336 HB2 SER B 131 5.415 10.202 9.198 1.00 0.00 H ATOM 5337 HB3 SER B 131 6.099 10.773 7.658 1.00 0.00 H ATOM 5338 HG SER B 131 7.282 11.535 9.494 1.00 0.00 H ATOM 5339 H SER B 131 4.299 8.765 7.674 1.00 0.00 H ATOM 5340 N CYS B 132 6.087 7.361 10.097 1.00 31.90 N ATOM 5341 CA CYS B 132 6.505 6.478 11.186 1.00 30.78 C ATOM 5342 C CYS B 132 6.964 5.133 10.656 1.00 29.80 C ATOM 5343 O CYS B 132 7.954 4.590 11.132 1.00 29.33 O ATOM 5344 CB CYS B 132 5.379 6.251 12.202 1.00 29.97 C ATOM 5345 SG CYS B 132 4.872 7.724 13.080 1.00 34.68 S ATOM 5346 HA CYS B 132 7.335 6.977 11.685 1.00 0.00 H ATOM 5347 HB2 CYS B 132 5.721 5.518 12.933 1.00 0.00 H ATOM 5348 HB3 CYS B 132 4.514 5.855 11.670 1.00 0.00 H ATOM 5349 HG CYS B 132 4.418 8.663 12.176 1.00 0.00 H ATOM 5350 H CYS B 132 5.093 7.658 10.029 1.00 0.00 H ATOM 5351 N ILE B 133 6.245 4.600 9.671 1.00 29.92 N ATOM 5352 CA ILE B 133 6.582 3.315 9.044 1.00 28.93 C ATOM 5353 C ILE B 133 8.009 3.309 8.470 1.00 31.40 C ATOM 5354 O ILE B 133 8.748 2.328 8.608 1.00 30.06 O ATOM 5355 CB ILE B 133 5.566 2.966 7.926 1.00 28.72 C ATOM 5356 CG1 ILE B 133 4.214 2.589 8.560 1.00 30.07 C ATOM 5357 CG2 ILE B 133 6.065 1.800 7.055 1.00 28.16 C ATOM 5358 CD1 ILE B 133 3.016 2.710 7.646 1.00 29.08 C ATOM 5359 HA ILE B 133 6.532 2.558 9.827 1.00 0.00 H ATOM 5360 HB ILE B 133 5.451 3.842 7.288 1.00 0.00 H ATOM 5361 HG12 ILE B 133 4.277 1.555 8.898 1.00 0.00 H ATOM 5362 HG13 ILE B 133 4.051 3.241 9.418 1.00 0.00 H ATOM 5363 HD11 ILE B 133 2.922 3.742 7.306 1.00 0.00 H ATOM 5364 HD12 ILE B 133 3.149 2.054 6.786 1.00 0.00 H ATOM 5365 HD13 ILE B 133 2.116 2.422 8.189 1.00 0.00 H ATOM 5366 HG21 ILE B 133 7.011 2.075 6.589 1.00 0.00 H ATOM 5367 HG22 ILE B 133 6.209 0.918 7.679 1.00 0.00 H ATOM 5368 HG23 ILE B 133 5.327 1.584 6.282 1.00 0.00 H ATOM 5369 H ILE B 133 5.408 5.116 9.330 1.00 0.00 H ATOM 5370 N ARG B 134 8.370 4.415 7.828 1.00 33.05 N ATOM 5371 CA ARG B 134 9.706 4.597 7.247 1.00 35.00 C ATOM 5372 C ARG B 134 10.728 4.741 8.361 1.00 34.12 C ATOM 5373 O ARG B 134 11.713 4.009 8.401 1.00 36.29 O ATOM 5374 CB ARG B 134 9.740 5.846 6.361 1.00 35.71 C ATOM 5375 CG ARG B 134 8.921 5.721 5.086 1.00 37.71 C ATOM 5376 CD ARG B 134 9.252 6.823 4.091 1.00 38.67 C ATOM 5377 NE ARG B 134 8.850 8.144 4.587 1.00 39.49 N ATOM 5378 CZ ARG B 134 7.625 8.657 4.491 1.00 40.23 C ATOM 5379 NH1 ARG B 134 6.641 7.981 3.908 1.00 41.39 N ATOM 5380 NH2 ARG B 134 7.380 9.865 4.982 1.00 41.73 N ATOM 5381 HA ARG B 134 9.944 3.726 6.637 1.00 0.00 H ATOM 5382 HB2 ARG B 134 9.352 6.686 6.937 1.00 0.00 H ATOM 5383 HB3 ARG B 134 10.776 6.043 6.086 1.00 0.00 H ATOM 5384 HG2 ARG B 134 9.130 4.755 4.626 1.00 0.00 H ATOM 5385 HG3 ARG B 134 7.862 5.780 5.339 1.00 0.00 H ATOM 5386 HD2 ARG B 134 8.729 6.623 3.156 1.00 0.00 H ATOM 5387 HD3 ARG B 134 10.327 6.825 3.912 1.00 0.00 H ATOM 5388 HE ARG B 134 9.578 8.725 5.049 1.00 0.00 H ATOM 5389 HH12 ARG B 134 5.691 8.399 3.843 1.00 0.00 H ATOM 5390 HH11 ARG B 134 6.821 7.034 3.517 1.00 0.00 H ATOM 5391 HH22 ARG B 134 6.425 10.272 4.910 1.00 0.00 H ATOM 5392 HH21 ARG B 134 8.142 10.405 5.438 1.00 0.00 H ATOM 5393 H ARG B 134 7.677 5.184 7.733 1.00 0.00 H ATOM 5394 N GLU B 135 10.482 5.673 9.276 1.00 34.24 N ATOM 5395 CA GLU B 135 11.364 5.851 10.421 1.00 35.23 C ATOM 5396 C GLU B 135 11.738 4.522 11.070 1.00 34.83 C ATOM 5397 O GLU B 135 12.915 4.303 11.358 1.00 33.87 O ATOM 5398 CB GLU B 135 10.742 6.791 11.449 1.00 37.51 C ATOM 5399 CG GLU B 135 10.795 8.252 11.012 1.00 40.55 C ATOM 5400 CD GLU B 135 10.144 9.195 12.000 1.00 45.23 C ATOM 5401 OE1 GLU B 135 9.991 10.381 11.655 1.00 47.18 O ATOM 5402 OE2 GLU B 135 9.781 8.759 13.121 1.00 52.57 O ATOM 5403 HA GLU B 135 12.283 6.302 10.047 1.00 0.00 H ATOM 5404 HB2 GLU B 135 9.700 6.508 11.597 1.00 0.00 H ATOM 5405 HB3 GLU B 135 11.282 6.687 12.390 1.00 0.00 H ATOM 5406 HG2 GLU B 135 11.839 8.541 10.894 1.00 0.00 H ATOM 5407 HG3 GLU B 135 10.283 8.346 10.054 1.00 0.00 H ATOM 5408 H GLU B 135 9.647 6.284 9.173 1.00 0.00 H ATOM 5409 N LEU B 136 10.754 3.636 11.267 1.00 32.24 N ATOM 5410 CA LEU B 136 10.958 2.360 11.959 1.00 32.19 C ATOM 5411 C LEU B 136 11.289 1.222 11.024 1.00 31.84 C ATOM 5412 O LEU B 136 11.480 0.081 11.472 1.00 26.83 O ATOM 5413 CB LEU B 136 9.702 1.960 12.757 1.00 32.87 C ATOM 5414 CG LEU B 136 9.201 2.966 13.789 1.00 33.05 C ATOM 5415 CD1 LEU B 136 7.817 2.559 14.279 1.00 32.72 C ATOM 5416 CD2 LEU B 136 10.187 3.081 14.946 1.00 33.74 C ATOM 5417 HA LEU B 136 11.807 2.525 12.622 1.00 0.00 H ATOM 5418 HB2 LEU B 136 8.896 1.789 12.043 1.00 0.00 H ATOM 5419 HB3 LEU B 136 9.925 1.031 13.281 1.00 0.00 H ATOM 5420 HG LEU B 136 9.124 3.948 13.323 1.00 0.00 H ATOM 5421 HD21 LEU B 136 10.299 2.108 15.425 1.00 0.00 H ATOM 5422 HD22 LEU B 136 11.153 3.414 14.567 1.00 0.00 H ATOM 5423 HD23 LEU B 136 9.812 3.803 15.671 1.00 0.00 H ATOM 5424 HD11 LEU B 136 7.127 2.534 13.435 1.00 0.00 H ATOM 5425 HD12 LEU B 136 7.871 1.571 14.736 1.00 0.00 H ATOM 5426 HD13 LEU B 136 7.466 3.282 15.015 1.00 0.00 H ATOM 5427 H LEU B 136 9.803 3.863 10.913 1.00 0.00 H ATOM 5428 N ASN B 137 11.339 1.520 9.730 1.00 32.64 N ATOM 5429 CA ASN B 137 11.720 0.548 8.716 1.00 34.84 C ATOM 5430 C ASN B 137 10.866 -0.699 8.728 1.00 32.13 C ATOM 5431 O ASN B 137 11.364 -1.807 8.639 1.00 31.33 O ATOM 5432 CB ASN B 137 13.197 0.180 8.858 1.00 39.24 C ATOM 5433 CG ASN B 137 13.886 0.052 7.518 1.00 43.17 C ATOM 5434 OD1 ASN B 137 14.256 1.063 6.895 1.00 46.79 O ATOM 5435 ND2 ASN B 137 14.041 -1.183 7.047 1.00 42.81 N ATOM 5436 HA ASN B 137 11.552 1.029 7.752 1.00 0.00 H ATOM 5437 HB2 ASN B 137 13.698 0.955 9.438 1.00 0.00 H ATOM 5438 HB3 ASN B 137 13.273 -0.772 9.384 1.00 0.00 H ATOM 5439 HD22 ASN B 137 13.715 -1.997 7.606 1.00 0.00 H ATOM 5440 HD21 ASN B 137 14.488 -1.334 6.120 1.00 0.00 H ATOM 5441 H ASN B 137 11.096 2.486 9.430 1.00 0.00 H ATOM 5442 N LEU B 138 9.557 -0.504 8.801 1.00 33.15 N ATOM 5443 CA LEU B 138 8.618 -1.628 8.810 1.00 31.56 C ATOM 5444 C LEU B 138 8.092 -1.886 7.420 1.00 30.66 C ATOM 5445 O LEU B 138 8.082 -0.971 6.592 1.00 34.76 O ATOM 5446 CB LEU B 138 7.430 -1.296 9.714 1.00 31.24 C ATOM 5447 CG LEU B 138 7.846 -0.962 11.141 1.00 32.00 C ATOM 5448 CD1 LEU B 138 6.649 -0.467 11.946 1.00 31.68 C ATOM 5449 CD2 LEU B 138 8.528 -2.155 11.797 1.00 30.99 C ATOM 5450 HA LEU B 138 9.143 -2.510 9.175 1.00 0.00 H ATOM 5451 HB2 LEU B 138 6.903 -0.439 9.295 1.00 0.00 H ATOM 5452 HB3 LEU B 138 6.760 -2.156 9.739 1.00 0.00 H ATOM 5453 HG LEU B 138 8.575 -0.152 11.115 1.00 0.00 H ATOM 5454 HD21 LEU B 138 7.839 -2.999 11.819 1.00 0.00 H ATOM 5455 HD22 LEU B 138 9.416 -2.424 11.225 1.00 0.00 H ATOM 5456 HD23 LEU B 138 8.816 -1.893 12.815 1.00 0.00 H ATOM 5457 HD11 LEU B 138 6.243 0.429 11.477 1.00 0.00 H ATOM 5458 HD12 LEU B 138 5.884 -1.243 11.973 1.00 0.00 H ATOM 5459 HD13 LEU B 138 6.967 -0.234 12.962 1.00 0.00 H ATOM 5460 H LEU B 138 9.189 0.467 8.853 1.00 0.00 H ATOM 5461 N ASN B 139 7.655 -3.118 7.186 1.00 30.14 N ATOM 5462 CA ASN B 139 6.858 -3.470 6.010 1.00 33.41 C ATOM 5463 C ASN B 139 5.371 -3.159 6.257 1.00 33.68 C ATOM 5464 O ASN B 139 4.766 -3.649 7.223 1.00 33.91 O ATOM 5465 CB ASN B 139 7.014 -4.952 5.666 1.00 35.01 C ATOM 5466 CG ASN B 139 6.305 -5.324 4.372 1.00 39.67 C ATOM 5467 OD1 ASN B 139 6.315 -4.557 3.409 1.00 43.80 O ATOM 5468 ND2 ASN B 139 5.678 -6.492 4.345 1.00 41.43 N ATOM 5469 HA ASN B 139 7.220 -2.874 5.173 1.00 0.00 H ATOM 5470 HB2 ASN B 139 8.075 -5.178 5.562 1.00 0.00 H ATOM 5471 HB3 ASN B 139 6.596 -5.546 6.478 1.00 0.00 H ATOM 5472 HD22 ASN B 139 5.694 -7.110 5.181 1.00 0.00 H ATOM 5473 HD21 ASN B 139 5.170 -6.790 3.488 1.00 0.00 H ATOM 5474 H ASN B 139 7.890 -3.866 7.869 1.00 0.00 H ATOM 5475 N ALA B 140 4.802 -2.336 5.386 1.00 32.14 N ATOM 5476 CA ALA B 140 3.430 -1.860 5.522 1.00 31.75 C ATOM 5477 C ALA B 140 2.718 -1.776 4.171 1.00 33.13 C ATOM 5478 O ALA B 140 3.357 -1.670 3.110 1.00 32.87 O ATOM 5479 CB ALA B 140 3.415 -0.498 6.181 1.00 30.85 C ATOM 5480 HA ALA B 140 2.897 -2.581 6.142 1.00 0.00 H ATOM 5481 HB1 ALA B 140 3.869 -0.569 7.169 1.00 0.00 H ATOM 5482 HB2 ALA B 140 3.980 0.206 5.570 1.00 0.00 H ATOM 5483 HB3 ALA B 140 2.385 -0.154 6.277 1.00 0.00 H ATOM 5484 H ALA B 140 5.360 -2.016 4.569 1.00 0.00 H ATOM 5485 N VAL B 141 1.393 -1.822 4.230 1.00 30.74 N ATOM 5486 CA VAL B 141 0.543 -1.628 3.075 1.00 30.39 C ATOM 5487 C VAL B 141 -0.579 -0.670 3.467 1.00 30.18 C ATOM 5488 O VAL B 141 -1.218 -0.854 4.523 1.00 27.26 O ATOM 5489 CB VAL B 141 -0.063 -2.956 2.604 1.00 32.22 C ATOM 5490 CG1 VAL B 141 -1.114 -2.712 1.529 1.00 32.59 C ATOM 5491 CG2 VAL B 141 1.029 -3.901 2.105 1.00 34.08 C ATOM 5492 HA VAL B 141 1.137 -1.221 2.257 1.00 0.00 H ATOM 5493 HB VAL B 141 -0.554 -3.433 3.452 1.00 0.00 H ATOM 5494 HG11 VAL B 141 -1.908 -2.084 1.934 1.00 0.00 H ATOM 5495 HG12 VAL B 141 -0.652 -2.212 0.678 1.00 0.00 H ATOM 5496 HG13 VAL B 141 -1.532 -3.666 1.208 1.00 0.00 H ATOM 5497 HG21 VAL B 141 1.555 -3.438 1.271 1.00 0.00 H ATOM 5498 HG22 VAL B 141 1.732 -4.101 2.914 1.00 0.00 H ATOM 5499 HG23 VAL B 141 0.576 -4.836 1.776 1.00 0.00 H ATOM 5500 H VAL B 141 0.944 -2.006 5.150 1.00 0.00 H ATOM 5501 N ARG B 142 -0.806 0.329 2.612 1.00 27.01 N ATOM 5502 CA ARG B 142 -1.890 1.295 2.751 1.00 28.58 C ATOM 5503 C ARG B 142 -3.008 0.948 1.761 1.00 28.19 C ATOM 5504 O ARG B 142 -2.756 0.608 0.607 1.00 26.72 O ATOM 5505 CB ARG B 142 -1.382 2.711 2.490 1.00 31.87 C ATOM 5506 CG ARG B 142 -2.406 3.822 2.703 1.00 33.60 C ATOM 5507 CD ARG B 142 -2.466 4.811 1.540 1.00 36.32 C ATOM 5508 NE ARG B 142 -1.447 5.851 1.602 1.00 37.96 N ATOM 5509 CZ ARG B 142 -1.142 6.676 0.601 1.00 37.47 C ATOM 5510 NH1 ARG B 142 -1.761 6.589 -0.568 1.00 38.35 N ATOM 5511 NH2 ARG B 142 -0.194 7.588 0.763 1.00 36.33 N ATOM 5512 HA ARG B 142 -2.277 1.252 3.769 1.00 0.00 H ATOM 5513 HB2 ARG B 142 -0.541 2.896 3.158 1.00 0.00 H ATOM 5514 HB3 ARG B 142 -1.041 2.761 1.456 1.00 0.00 H ATOM 5515 HG2 ARG B 142 -3.390 3.369 2.825 1.00 0.00 H ATOM 5516 HG3 ARG B 142 -2.144 4.367 3.610 1.00 0.00 H ATOM 5517 HD2 ARG B 142 -3.446 5.288 1.544 1.00 0.00 H ATOM 5518 HD3 ARG B 142 -2.337 4.257 0.610 1.00 0.00 H ATOM 5519 HE ARG B 142 -0.920 5.957 2.492 1.00 0.00 H ATOM 5520 HH12 ARG B 142 -1.511 7.241 -1.339 1.00 0.00 H ATOM 5521 HH11 ARG B 142 -2.497 5.869 -0.714 1.00 0.00 H ATOM 5522 HH22 ARG B 142 0.046 8.233 -0.017 1.00 0.00 H ATOM 5523 HH21 ARG B 142 0.310 7.659 1.670 1.00 0.00 H ATOM 5524 H ARG B 142 -0.170 0.425 1.795 1.00 0.00 H ATOM 5525 N GLY B 143 -4.252 1.016 2.212 1.00 27.29 N ATOM 5526 CA GLY B 143 -5.376 0.691 1.325 1.00 25.87 C ATOM 5527 C GLY B 143 -6.687 0.425 2.049 1.00 23.88 C ATOM 5528 O GLY B 143 -6.864 0.805 3.211 1.00 21.50 O ATOM 5529 HA3 GLY B 143 -5.114 -0.200 0.754 1.00 0.00 H ATOM 5530 HA2 GLY B 143 -5.526 1.528 0.643 1.00 0.00 H ATOM 5531 H GLY B 143 -4.433 1.300 3.196 1.00 0.00 H ATOM 5532 N LEU B 144 -7.593 -0.245 1.341 1.00 21.00 N ATOM 5533 CA LEU B 144 -8.944 -0.448 1.818 1.00 20.42 C ATOM 5534 C LEU B 144 -8.964 -1.528 2.880 1.00 19.15 C ATOM 5535 O LEU B 144 -8.451 -2.637 2.703 1.00 19.66 O ATOM 5536 CB LEU B 144 -9.886 -0.832 0.675 1.00 21.27 C ATOM 5537 CG LEU B 144 -11.295 -1.289 1.082 1.00 20.49 C ATOM 5538 CD1 LEU B 144 -12.085 -0.133 1.683 1.00 20.14 C ATOM 5539 CD2 LEU B 144 -11.994 -1.870 -0.143 1.00 20.87 C ATOM 5540 HA LEU B 144 -9.292 0.492 2.247 1.00 0.00 H ATOM 5541 HB2 LEU B 144 -9.993 0.037 0.025 1.00 0.00 H ATOM 5542 HB3 LEU B 144 -9.420 -1.645 0.119 1.00 0.00 H ATOM 5543 HG LEU B 144 -11.227 -2.059 1.850 1.00 0.00 H ATOM 5544 HD21 LEU B 144 -12.061 -1.106 -0.918 1.00 0.00 H ATOM 5545 HD22 LEU B 144 -11.422 -2.719 -0.517 1.00 0.00 H ATOM 5546 HD23 LEU B 144 -12.996 -2.198 0.134 1.00 0.00 H ATOM 5547 HD11 LEU B 144 -11.566 0.239 2.566 1.00 0.00 H ATOM 5548 HD12 LEU B 144 -12.173 0.667 0.948 1.00 0.00 H ATOM 5549 HD13 LEU B 144 -13.079 -0.481 1.963 1.00 0.00 H ATOM 5550 H LEU B 144 -7.322 -0.635 0.416 1.00 0.00 H ATOM 5551 N ILE B 145 -9.568 -1.183 4.005 1.00 18.56 N ATOM 5552 CA ILE B 145 -9.767 -2.114 5.075 1.00 17.64 C ATOM 5553 C ILE B 145 -11.277 -2.338 5.182 1.00 16.73 C ATOM 5554 O ILE B 145 -12.071 -1.396 5.184 1.00 15.96 O ATOM 5555 CB ILE B 145 -9.162 -1.597 6.389 1.00 18.06 C ATOM 5556 CG1 ILE B 145 -7.639 -1.569 6.247 1.00 19.23 C ATOM 5557 CG2 ILE B 145 -9.576 -2.483 7.548 1.00 18.69 C ATOM 5558 CD1 ILE B 145 -6.891 -0.851 7.339 1.00 20.35 C ATOM 5559 HA ILE B 145 -9.258 -3.057 4.875 1.00 0.00 H ATOM 5560 HB ILE B 145 -9.528 -0.591 6.594 1.00 0.00 H ATOM 5561 HG12 ILE B 145 -7.286 -2.600 6.222 1.00 0.00 H ATOM 5562 HG13 ILE B 145 -7.400 -1.082 5.302 1.00 0.00 H ATOM 5563 HD11 ILE B 145 -7.213 0.190 7.375 1.00 0.00 H ATOM 5564 HD12 ILE B 145 -7.099 -1.330 8.296 1.00 0.00 H ATOM 5565 HD13 ILE B 145 -5.821 -0.895 7.134 1.00 0.00 H ATOM 5566 HG21 ILE B 145 -10.663 -2.483 7.633 1.00 0.00 H ATOM 5567 HG22 ILE B 145 -9.224 -3.499 7.371 1.00 0.00 H ATOM 5568 HG23 ILE B 145 -9.138 -2.101 8.470 1.00 0.00 H ATOM 5569 H ILE B 145 -9.909 -0.207 4.116 1.00 0.00 H ATOM 5570 N VAL B 146 -11.671 -3.595 5.234 1.00 16.28 N ATOM 5571 CA VAL B 146 -13.084 -3.889 5.370 1.00 16.56 C ATOM 5572 C VAL B 146 -13.408 -4.470 6.754 1.00 16.37 C ATOM 5573 O VAL B 146 -12.600 -5.217 7.336 1.00 16.18 O ATOM 5574 CB VAL B 146 -13.572 -4.796 4.215 1.00 16.89 C ATOM 5575 CG1 VAL B 146 -13.423 -4.086 2.861 1.00 16.38 C ATOM 5576 CG2 VAL B 146 -12.824 -6.116 4.223 1.00 16.40 C ATOM 5577 HA VAL B 146 -13.636 -2.952 5.295 1.00 0.00 H ATOM 5578 HB VAL B 146 -14.631 -5.005 4.367 1.00 0.00 H ATOM 5579 HG11 VAL B 146 -14.016 -3.172 2.864 1.00 0.00 H ATOM 5580 HG12 VAL B 146 -12.374 -3.839 2.695 1.00 0.00 H ATOM 5581 HG13 VAL B 146 -13.773 -4.745 2.066 1.00 0.00 H ATOM 5582 HG21 VAL B 146 -11.757 -5.928 4.100 1.00 0.00 H ATOM 5583 HG22 VAL B 146 -12.998 -6.625 5.171 1.00 0.00 H ATOM 5584 HG23 VAL B 146 -13.181 -6.740 3.404 1.00 0.00 H ATOM 5585 H VAL B 146 -10.976 -4.367 5.178 1.00 0.00 H ATOM 5586 N SER B 147 -14.579 -4.101 7.286 1.00 16.28 N ATOM 5587 CA SER B 147 -15.050 -4.590 8.577 1.00 16.51 C ATOM 5588 C SER B 147 -16.369 -5.331 8.450 1.00 14.84 C ATOM 5589 O SER B 147 -17.191 -5.046 7.582 1.00 14.40 O ATOM 5590 CB SER B 147 -15.245 -3.456 9.595 1.00 17.68 C ATOM 5591 OG SER B 147 -14.146 -2.568 9.597 1.00 20.32 O ATOM 5592 HA SER B 147 -14.272 -5.267 8.931 1.00 0.00 H ATOM 5593 HB2 SER B 147 -15.354 -3.888 10.590 1.00 0.00 H ATOM 5594 HB3 SER B 147 -16.148 -2.902 9.340 1.00 0.00 H ATOM 5595 HG SER B 147 -13.323 -3.064 9.834 1.00 0.00 H ATOM 5596 H SER B 147 -15.179 -3.437 6.756 1.00 0.00 H ATOM 5597 N GLY B 148 -16.577 -6.254 9.368 1.00 14.59 N ATOM 5598 CA GLY B 148 -17.817 -6.991 9.457 1.00 14.44 C ATOM 5599 C GLY B 148 -17.904 -7.623 10.808 1.00 14.47 C ATOM 5600 O GLY B 148 -16.935 -7.598 11.550 1.00 15.72 O ATOM 5601 HA3 GLY B 148 -17.841 -7.763 8.688 1.00 0.00 H ATOM 5602 HA2 GLY B 148 -18.658 -6.313 9.314 1.00 0.00 H ATOM 5603 H GLY B 148 -15.822 -6.459 10.053 1.00 0.00 H ATOM 5604 N ASP B 149 -19.060 -8.158 11.152 1.00 14.10 N ATOM 5605 CA ASP B 149 -19.200 -8.876 12.423 1.00 14.10 C ATOM 5606 C ASP B 149 -18.821 -10.369 12.344 1.00 15.18 C ATOM 5607 O ASP B 149 -19.437 -11.203 12.988 1.00 14.65 O ATOM 5608 CB ASP B 149 -20.604 -8.701 12.988 1.00 14.73 C ATOM 5609 CG ASP B 149 -20.688 -7.508 13.965 1.00 15.01 C ATOM 5610 OD1 ASP B 149 -19.640 -7.020 14.389 1.00 15.96 O ATOM 5611 OD2 ASP B 149 -21.791 -7.096 14.303 1.00 16.41 O ATOM 5612 HA ASP B 149 -18.478 -8.424 13.103 1.00 0.00 H ATOM 5613 HB2 ASP B 149 -21.297 -8.531 12.164 1.00 0.00 H ATOM 5614 HB3 ASP B 149 -20.887 -9.611 13.517 1.00 0.00 H ATOM 5615 H ASP B 149 -19.879 -8.070 10.517 1.00 0.00 H ATOM 5616 N ALA B 150 -17.768 -10.699 11.615 1.00 16.45 N ATOM 5617 CA ALA B 150 -17.365 -12.098 11.518 1.00 16.18 C ATOM 5618 C ALA B 150 -15.868 -12.238 11.541 1.00 16.25 C ATOM 5619 O ALA B 150 -15.122 -11.448 10.948 1.00 16.33 O ATOM 5620 CB ALA B 150 -17.915 -12.733 10.243 1.00 16.94 C ATOM 5621 HA ALA B 150 -17.778 -12.615 12.384 1.00 0.00 H ATOM 5622 HB1 ALA B 150 -19.004 -12.680 10.253 1.00 0.00 H ATOM 5623 HB2 ALA B 150 -17.531 -12.195 9.376 1.00 0.00 H ATOM 5624 HB3 ALA B 150 -17.601 -13.776 10.193 1.00 0.00 H ATOM 5625 H ALA B 150 -17.229 -9.964 11.113 1.00 0.00 H ATOM 5626 N PHE B 151 -15.428 -13.269 12.232 1.00 17.03 N ATOM 5627 CA PHE B 151 -14.024 -13.642 12.192 1.00 18.20 C ATOM 5628 C PHE B 151 -13.864 -14.486 10.968 1.00 18.51 C ATOM 5629 O PHE B 151 -14.525 -15.540 10.871 1.00 20.12 O ATOM 5630 CB PHE B 151 -13.614 -14.417 13.429 1.00 18.82 C ATOM 5631 CG PHE B 151 -12.163 -14.743 13.437 1.00 20.27 C ATOM 5632 CD1 PHE B 151 -11.718 -16.009 13.044 1.00 20.34 C ATOM 5633 CD2 PHE B 151 -11.239 -13.782 13.796 1.00 19.64 C ATOM 5634 CE1 PHE B 151 -10.362 -16.299 13.028 1.00 21.47 C ATOM 5635 CE2 PHE B 151 -9.884 -14.065 13.781 1.00 22.09 C ATOM 5636 CZ PHE B 151 -9.440 -15.315 13.375 1.00 21.89 C ATOM 5637 HA PHE B 151 -13.388 -12.757 12.165 1.00 0.00 H ATOM 5638 HB2 PHE B 151 -13.844 -13.818 14.310 1.00 0.00 H ATOM 5639 HB3 PHE B 151 -14.182 -15.346 13.465 1.00 0.00 H ATOM 5640 HD2 PHE B 151 -11.580 -12.791 14.094 1.00 0.00 H ATOM 5641 HE2 PHE B 151 -9.165 -13.305 14.088 1.00 0.00 H ATOM 5642 HZ PHE B 151 -8.372 -15.526 13.328 1.00 0.00 H ATOM 5643 HE1 PHE B 151 -10.019 -17.294 12.745 1.00 0.00 H ATOM 5644 HD1 PHE B 151 -12.440 -16.771 12.749 1.00 0.00 H ATOM 5645 H PHE B 151 -16.091 -13.822 12.812 1.00 0.00 H ATOM 5646 N ILE B 152 -13.026 -14.006 10.047 1.00 19.64 N ATOM 5647 CA ILE B 152 -12.851 -14.599 8.734 1.00 20.29 C ATOM 5648 C ILE B 152 -11.784 -15.699 8.808 1.00 23.42 C ATOM 5649 O ILE B 152 -10.654 -15.488 9.291 1.00 21.95 O ATOM 5650 CB ILE B 152 -12.451 -13.551 7.687 1.00 19.84 C ATOM 5651 CG1 ILE B 152 -13.404 -12.346 7.729 1.00 19.19 C ATOM 5652 CG2 ILE B 152 -12.453 -14.159 6.290 1.00 20.79 C ATOM 5653 CD1 ILE B 152 -14.859 -12.739 7.706 1.00 18.90 C ATOM 5654 HA ILE B 152 -13.805 -15.027 8.425 1.00 0.00 H ATOM 5655 HB ILE B 152 -11.443 -13.210 7.924 1.00 0.00 H ATOM 5656 HG12 ILE B 152 -13.211 -11.783 8.642 1.00 0.00 H ATOM 5657 HG13 ILE B 152 -13.202 -11.714 6.864 1.00 0.00 H ATOM 5658 HD11 ILE B 152 -15.070 -13.295 6.792 1.00 0.00 H ATOM 5659 HD12 ILE B 152 -15.079 -13.364 8.572 1.00 0.00 H ATOM 5660 HD13 ILE B 152 -15.477 -11.842 7.738 1.00 0.00 H ATOM 5661 HG21 ILE B 152 -11.742 -14.984 6.253 1.00 0.00 H ATOM 5662 HG22 ILE B 152 -13.452 -14.528 6.057 1.00 0.00 H ATOM 5663 HG23 ILE B 152 -12.167 -13.398 5.564 1.00 0.00 H ATOM 5664 H ILE B 152 -12.468 -13.161 10.283 1.00 0.00 H ATOM 5665 N ASN B 153 -12.170 -16.867 8.310 1.00 23.84 N ATOM 5666 CA ASN B 153 -11.469 -18.105 8.554 1.00 25.50 C ATOM 5667 C ASN B 153 -11.624 -18.944 7.272 1.00 26.30 C ATOM 5668 O ASN B 153 -12.125 -20.039 7.313 1.00 27.02 O ATOM 5669 CB ASN B 153 -12.134 -18.751 9.779 1.00 26.50 C ATOM 5670 CG ASN B 153 -11.384 -19.960 10.323 1.00 29.83 C ATOM 5671 OD1 ASN B 153 -12.004 -20.893 10.825 1.00 30.45 O ATOM 5672 ND2 ASN B 153 -10.060 -19.938 10.254 1.00 30.24 N ATOM 5673 HA ASN B 153 -10.406 -17.993 8.767 1.00 0.00 H ATOM 5674 HB2 ASN B 153 -12.199 -18.003 10.569 1.00 0.00 H ATOM 5675 HB3 ASN B 153 -13.138 -19.068 9.497 1.00 0.00 H ATOM 5676 HD22 ASN B 153 -9.575 -19.127 9.820 1.00 0.00 H ATOM 5677 HD21 ASN B 153 -9.506 -20.732 10.634 1.00 0.00 H ATOM 5678 H ASN B 153 -13.021 -16.892 7.713 1.00 0.00 H ATOM 5679 N GLY B 154 -11.236 -18.368 6.136 1.00 26.88 N ATOM 5680 CA GLY B 154 -11.421 -18.989 4.829 1.00 30.20 C ATOM 5681 C GLY B 154 -12.864 -19.253 4.400 1.00 32.89 C ATOM 5682 O GLY B 154 -13.800 -18.548 4.816 1.00 30.12 O ATOM 5683 HA3 GLY B 154 -10.897 -19.945 4.839 1.00 0.00 H ATOM 5684 HA2 GLY B 154 -10.968 -18.335 4.084 1.00 0.00 H ATOM 5685 H GLY B 154 -10.781 -17.434 6.183 1.00 0.00 H ATOM 5686 N SER B 155 -13.039 -20.259 3.538 1.00 33.96 N ATOM 5687 CA SER B 155 -14.364 -20.687 3.103 1.00 34.43 C ATOM 5688 C SER B 155 -15.142 -19.529 2.479 1.00 32.08 C ATOM 5689 O SER B 155 -14.565 -18.684 1.819 1.00 34.61 O ATOM 5690 CB SER B 155 -15.120 -21.298 4.289 1.00 37.17 C ATOM 5691 OG SER B 155 -16.472 -21.587 3.970 1.00 43.42 O ATOM 5692 HA SER B 155 -14.255 -21.448 2.330 1.00 0.00 H ATOM 5693 HB2 SER B 155 -15.098 -20.594 5.121 1.00 0.00 H ATOM 5694 HB3 SER B 155 -14.623 -22.222 4.584 1.00 0.00 H ATOM 5695 HG SER B 155 -16.920 -21.978 4.761 1.00 0.00 H ATOM 5696 H SER B 155 -12.203 -20.753 3.165 1.00 0.00 H ATOM 5697 N VAL B 156 -16.445 -19.493 2.720 1.00 33.57 N ATOM 5698 CA VAL B 156 -17.373 -18.547 2.091 1.00 34.02 C ATOM 5699 C VAL B 156 -17.035 -17.102 2.406 1.00 32.10 C ATOM 5700 O VAL B 156 -17.074 -16.240 1.517 1.00 32.07 O ATOM 5701 CB VAL B 156 -18.828 -18.825 2.554 1.00 35.70 C ATOM 5702 CG1 VAL B 156 -19.782 -17.691 2.168 1.00 36.64 C ATOM 5703 CG2 VAL B 156 -19.309 -20.153 1.985 1.00 36.78 C ATOM 5704 HA VAL B 156 -17.279 -18.695 1.015 1.00 0.00 H ATOM 5705 HB VAL B 156 -18.826 -18.881 3.643 1.00 0.00 H ATOM 5706 HG11 VAL B 156 -19.449 -16.763 2.633 1.00 0.00 H ATOM 5707 HG12 VAL B 156 -19.786 -17.575 1.084 1.00 0.00 H ATOM 5708 HG13 VAL B 156 -20.788 -17.931 2.513 1.00 0.00 H ATOM 5709 HG21 VAL B 156 -19.279 -20.112 0.896 1.00 0.00 H ATOM 5710 HG22 VAL B 156 -18.660 -20.954 2.338 1.00 0.00 H ATOM 5711 HG23 VAL B 156 -20.331 -20.340 2.315 1.00 0.00 H ATOM 5712 H VAL B 156 -16.834 -20.179 3.398 1.00 0.00 H ATOM 5713 N GLY B 157 -16.703 -16.852 3.669 1.00 29.39 N ATOM 5714 CA GLY B 157 -16.421 -15.513 4.144 1.00 29.92 C ATOM 5715 C GLY B 157 -15.277 -14.881 3.391 1.00 27.86 C ATOM 5716 O GLY B 157 -15.417 -13.787 2.844 1.00 27.54 O ATOM 5717 HA3 GLY B 157 -16.164 -15.561 5.202 1.00 0.00 H ATOM 5718 HA2 GLY B 157 -17.311 -14.898 4.015 1.00 0.00 H ATOM 5719 H GLY B 157 -16.644 -17.645 4.339 1.00 0.00 H ATOM 5720 N LEU B 158 -14.149 -15.588 3.331 1.00 28.03 N ATOM 5721 CA LEU B 158 -12.991 -15.090 2.583 1.00 26.72 C ATOM 5722 C LEU B 158 -13.332 -14.955 1.114 1.00 26.26 C ATOM 5723 O LEU B 158 -13.083 -13.914 0.498 1.00 24.73 O ATOM 5724 CB LEU B 158 -11.783 -16.005 2.772 1.00 28.62 C ATOM 5725 CG LEU B 158 -10.442 -15.577 2.180 1.00 29.03 C ATOM 5726 CD1 LEU B 158 -10.015 -14.201 2.682 1.00 28.98 C ATOM 5727 CD2 LEU B 158 -9.379 -16.626 2.479 1.00 29.03 C ATOM 5728 HA LEU B 158 -12.731 -14.106 2.972 1.00 0.00 H ATOM 5729 HB2 LEU B 158 -11.637 -16.127 3.845 1.00 0.00 H ATOM 5730 HB3 LEU B 158 -12.037 -16.968 2.330 1.00 0.00 H ATOM 5731 HG LEU B 158 -10.560 -15.498 1.099 1.00 0.00 H ATOM 5732 HD21 LEU B 158 -9.275 -16.738 3.558 1.00 0.00 H ATOM 5733 HD22 LEU B 158 -9.677 -17.578 2.040 1.00 0.00 H ATOM 5734 HD23 LEU B 158 -8.428 -16.309 2.052 1.00 0.00 H ATOM 5735 HD11 LEU B 158 -10.766 -13.463 2.399 1.00 0.00 H ATOM 5736 HD12 LEU B 158 -9.919 -14.225 3.767 1.00 0.00 H ATOM 5737 HD13 LEU B 158 -9.056 -13.935 2.237 1.00 0.00 H ATOM 5738 H LEU B 158 -14.090 -16.504 3.821 1.00 0.00 H ATOM 5739 N ALA B 159 -13.911 -16.005 0.536 1.00 27.29 N ATOM 5740 CA ALA B 159 -14.283 -15.953 -0.879 1.00 27.28 C ATOM 5741 C ALA B 159 -15.120 -14.703 -1.180 1.00 27.06 C ATOM 5742 O ALA B 159 -14.812 -13.939 -2.104 1.00 27.72 O ATOM 5743 CB ALA B 159 -15.040 -17.219 -1.267 1.00 27.79 C ATOM 5744 HA ALA B 159 -13.372 -15.894 -1.475 1.00 0.00 H ATOM 5745 HB1 ALA B 159 -14.405 -18.088 -1.095 1.00 0.00 H ATOM 5746 HB2 ALA B 159 -15.943 -17.301 -0.661 1.00 0.00 H ATOM 5747 HB3 ALA B 159 -15.312 -17.170 -2.321 1.00 0.00 H ATOM 5748 H ALA B 159 -14.100 -16.864 1.091 1.00 0.00 H ATOM 5749 N LYS B 160 -16.159 -14.491 -0.371 1.00 26.22 N ATOM 5750 CA LYS B 160 -17.074 -13.375 -0.548 1.00 27.42 C ATOM 5751 C LYS B 160 -16.361 -12.020 -0.500 1.00 24.06 C ATOM 5752 O LYS B 160 -16.615 -11.157 -1.343 1.00 23.46 O ATOM 5753 CB LYS B 160 -18.201 -13.441 0.493 1.00 31.97 C ATOM 5754 CG LYS B 160 -19.257 -12.357 0.329 1.00 38.02 C ATOM 5755 CD LYS B 160 -20.226 -12.282 1.512 1.00 41.67 C ATOM 5756 CE LYS B 160 -21.442 -13.180 1.331 1.00 44.24 C ATOM 5757 NZ LYS B 160 -22.655 -12.530 1.901 1.00 45.13 N ATOM 5758 HA LYS B 160 -17.507 -13.464 -1.544 1.00 0.00 H ATOM 5759 HB2 LYS B 160 -18.689 -14.412 0.409 1.00 0.00 H ATOM 5760 HB3 LYS B 160 -17.759 -13.343 1.484 1.00 0.00 H ATOM 5761 HG2 LYS B 160 -18.755 -11.395 0.229 1.00 0.00 H ATOM 5762 HG3 LYS B 160 -19.829 -12.563 -0.576 1.00 0.00 H ATOM 5763 HD2 LYS B 160 -19.698 -12.587 2.416 1.00 0.00 H ATOM 5764 HD3 LYS B 160 -20.565 -11.252 1.621 1.00 0.00 H ATOM 5765 HE2 LYS B 160 -21.268 -14.128 1.841 1.00 0.00 H ATOM 5766 HE3 LYS B 160 -21.598 -13.364 0.268 1.00 0.00 H ATOM 5767 HZ1 LYS B 160 -22.509 -12.356 2.916 1.00 0.00 H ATOM 5768 HZ2 LYS B 160 -22.824 -11.627 1.414 1.00 0.00 H ATOM 5769 HZ3 LYS B 160 -23.476 -13.155 1.770 1.00 0.00 H ATOM 5770 H LYS B 160 -16.321 -15.150 0.417 1.00 0.00 H ATOM 5771 N ILE B 161 -15.454 -11.838 0.460 1.00 22.91 N ATOM 5772 CA ILE B 161 -14.688 -10.596 0.558 1.00 22.69 C ATOM 5773 C ILE B 161 -13.770 -10.379 -0.641 1.00 23.66 C ATOM 5774 O ILE B 161 -13.735 -9.273 -1.204 1.00 21.85 O ATOM 5775 CB ILE B 161 -13.852 -10.532 1.854 1.00 23.45 C ATOM 5776 CG1 ILE B 161 -14.768 -10.414 3.065 1.00 23.51 C ATOM 5777 CG2 ILE B 161 -12.892 -9.343 1.806 1.00 24.18 C ATOM 5778 CD1 ILE B 161 -14.060 -10.644 4.374 1.00 23.62 C ATOM 5779 HA ILE B 161 -15.431 -9.798 0.574 1.00 0.00 H ATOM 5780 HB ILE B 161 -13.271 -11.450 1.940 1.00 0.00 H ATOM 5781 HG12 ILE B 161 -15.199 -9.413 3.076 1.00 0.00 H ATOM 5782 HG13 ILE B 161 -15.565 -11.151 2.969 1.00 0.00 H ATOM 5783 HD11 ILE B 161 -13.632 -11.646 4.383 1.00 0.00 H ATOM 5784 HD12 ILE B 161 -13.265 -9.907 4.490 1.00 0.00 H ATOM 5785 HD13 ILE B 161 -14.772 -10.545 5.193 1.00 0.00 H ATOM 5786 HG21 ILE B 161 -12.222 -9.453 0.954 1.00 0.00 H ATOM 5787 HG22 ILE B 161 -13.463 -8.420 1.704 1.00 0.00 H ATOM 5788 HG23 ILE B 161 -12.309 -9.311 2.727 1.00 0.00 H ATOM 5789 H ILE B 161 -15.288 -12.595 1.154 1.00 0.00 H ATOM 5790 N ARG B 162 -13.031 -11.421 -1.055 1.00 24.81 N ATOM 5791 CA ARG B 162 -12.125 -11.293 -2.203 1.00 26.20 C ATOM 5792 C ARG B 162 -12.908 -10.980 -3.479 1.00 26.38 C ATOM 5793 O ARG B 162 -12.435 -10.247 -4.339 1.00 28.00 O ATOM 5794 CB ARG B 162 -11.261 -12.553 -2.405 1.00 27.23 C ATOM 5795 CG ARG B 162 -10.582 -13.068 -1.140 1.00 27.55 C ATOM 5796 CD ARG B 162 -9.180 -13.589 -1.403 1.00 28.28 C ATOM 5797 NE ARG B 162 -8.205 -12.514 -1.583 1.00 27.84 N ATOM 5798 CZ ARG B 162 -7.164 -12.302 -0.780 1.00 27.32 C ATOM 5799 NH1 ARG B 162 -6.951 -13.089 0.267 1.00 27.10 N ATOM 5800 NH2 ARG B 162 -6.326 -11.304 -1.032 1.00 27.04 N ATOM 5801 HA ARG B 162 -11.452 -10.464 -1.986 1.00 0.00 H ATOM 5802 HB2 ARG B 162 -11.901 -13.345 -2.794 1.00 0.00 H ATOM 5803 HB3 ARG B 162 -10.487 -12.321 -3.136 1.00 0.00 H ATOM 5804 HG2 ARG B 162 -10.523 -12.253 -0.418 1.00 0.00 H ATOM 5805 HG3 ARG B 162 -11.183 -13.877 -0.725 1.00 0.00 H ATOM 5806 HD2 ARG B 162 -9.198 -14.199 -2.306 1.00 0.00 H ATOM 5807 HD3 ARG B 162 -8.871 -14.203 -0.557 1.00 0.00 H ATOM 5808 HE ARG B 162 -8.333 -11.873 -2.392 1.00 0.00 H ATOM 5809 HH12 ARG B 162 -6.136 -12.917 0.889 1.00 0.00 H ATOM 5810 HH11 ARG B 162 -7.599 -13.878 0.465 1.00 0.00 H ATOM 5811 HH22 ARG B 162 -5.513 -11.137 -0.406 1.00 0.00 H ATOM 5812 HH21 ARG B 162 -6.483 -10.689 -1.856 1.00 0.00 H ATOM 5813 H ARG B 162 -13.101 -12.331 -0.556 1.00 0.00 H ATOM 5814 N HIS B 163 -14.119 -11.526 -3.595 1.00 26.34 N ATOM 5815 CA HIS B 163 -14.951 -11.227 -4.756 1.00 27.59 C ATOM 5816 C HIS B 163 -15.454 -9.789 -4.735 1.00 26.28 C ATOM 5817 O HIS B 163 -15.234 -9.032 -5.683 1.00 27.56 O ATOM 5818 CB HIS B 163 -16.133 -12.189 -4.868 1.00 29.58 C ATOM 5819 CG HIS B 163 -16.981 -11.938 -6.073 1.00 31.76 C ATOM 5820 ND1 HIS B 163 -18.177 -11.256 -6.015 1.00 34.17 N ATOM 5821 CD2 HIS B 163 -16.787 -12.244 -7.375 1.00 33.53 C ATOM 5822 CE1 HIS B 163 -18.696 -11.171 -7.226 1.00 34.94 C ATOM 5823 NE2 HIS B 163 -17.866 -11.753 -8.072 1.00 36.02 N ATOM 5824 HA HIS B 163 -14.316 -11.357 -5.632 1.00 0.00 H ATOM 5825 HB2 HIS B 163 -15.748 -13.207 -4.920 1.00 0.00 H ATOM 5826 HB3 HIS B 163 -16.753 -12.082 -3.978 1.00 0.00 H ATOM 5827 HD2 HIS B 163 -15.935 -12.780 -7.794 1.00 0.00 H ATOM 5828 HE1 HIS B 163 -19.646 -10.702 -7.483 1.00 0.00 H ATOM 5829 H HIS B 163 -14.472 -12.167 -2.856 1.00 0.00 H ATOM 5830 N ASN B 164 -16.108 -9.416 -3.636 1.00 25.24 N ATOM 5831 CA ASN B 164 -16.737 -8.093 -3.484 1.00 23.87 C ATOM 5832 C ASN B 164 -15.762 -6.927 -3.310 1.00 22.72 C ATOM 5833 O ASN B 164 -16.054 -5.821 -3.734 1.00 20.11 O ATOM 5834 CB ASN B 164 -17.715 -8.110 -2.297 1.00 24.57 C ATOM 5835 CG ASN B 164 -18.962 -8.925 -2.586 1.00 26.00 C ATOM 5836 OD1 ASN B 164 -19.476 -8.881 -3.700 1.00 27.39 O ATOM 5837 ND2 ASN B 164 -19.466 -9.659 -1.583 1.00 25.05 N ATOM 5838 HA ASN B 164 -17.254 -7.916 -4.427 1.00 0.00 H ATOM 5839 HB2 ASN B 164 -17.209 -8.539 -1.432 1.00 0.00 H ATOM 5840 HB3 ASN B 164 -18.011 -7.085 -2.072 1.00 0.00 H ATOM 5841 HD22 ASN B 164 -18.995 -9.665 -0.656 1.00 0.00 H ATOM 5842 HD21 ASN B 164 -20.327 -10.222 -1.733 1.00 0.00 H ATOM 5843 H ASN B 164 -16.178 -10.091 -2.848 1.00 0.00 H ATOM 5844 N PHE B 165 -14.627 -7.171 -2.664 1.00 21.19 N ATOM 5845 CA PHE B 165 -13.637 -6.112 -2.424 1.00 21.12 C ATOM 5846 C PHE B 165 -12.257 -6.652 -2.763 1.00 22.49 C ATOM 5847 O PHE B 165 -11.455 -6.872 -1.841 1.00 22.49 O ATOM 5848 CB PHE B 165 -13.664 -5.671 -0.938 1.00 19.23 C ATOM 5849 CG PHE B 165 -15.026 -5.297 -0.465 1.00 18.30 C ATOM 5850 CD1 PHE B 165 -15.844 -6.255 0.098 1.00 17.27 C ATOM 5851 CD2 PHE B 165 -15.500 -4.005 -0.624 1.00 17.35 C ATOM 5852 CE1 PHE B 165 -17.128 -5.958 0.484 1.00 17.38 C ATOM 5853 CE2 PHE B 165 -16.778 -3.686 -0.215 1.00 18.12 C ATOM 5854 CZ PHE B 165 -17.602 -4.667 0.341 1.00 17.45 C ATOM 5855 HA PHE B 165 -13.873 -5.250 -3.047 1.00 0.00 H ATOM 5856 HB2 PHE B 165 -13.297 -6.494 -0.325 1.00 0.00 H ATOM 5857 HB3 PHE B 165 -13.006 -4.810 -0.819 1.00 0.00 H ATOM 5858 HD2 PHE B 165 -14.864 -3.242 -1.072 1.00 0.00 H ATOM 5859 HE2 PHE B 165 -17.146 -2.666 -0.326 1.00 0.00 H ATOM 5860 HZ PHE B 165 -18.613 -4.416 0.661 1.00 0.00 H ATOM 5861 HE1 PHE B 165 -17.769 -6.735 0.900 1.00 0.00 H ATOM 5862 HD1 PHE B 165 -15.464 -7.267 0.239 1.00 0.00 H ATOM 5863 H PHE B 165 -14.435 -8.134 -2.320 1.00 0.00 H ATOM 5864 N PRO B 166 -11.972 -6.892 -4.068 1.00 24.75 N ATOM 5865 CA PRO B 166 -10.641 -7.370 -4.473 1.00 26.07 C ATOM 5866 C PRO B 166 -9.498 -6.437 -4.078 1.00 27.51 C ATOM 5867 O PRO B 166 -8.381 -6.886 -3.957 1.00 29.84 O ATOM 5868 CB PRO B 166 -10.738 -7.460 -6.015 1.00 26.14 C ATOM 5869 CG PRO B 166 -11.940 -6.670 -6.381 1.00 25.49 C ATOM 5870 CD PRO B 166 -12.881 -6.834 -5.226 1.00 25.64 C ATOM 5871 HA PRO B 166 -10.406 -8.312 -3.977 1.00 0.00 H ATOM 5872 HD3 PRO B 166 -13.561 -5.985 -5.150 1.00 0.00 H ATOM 5873 HD2 PRO B 166 -13.459 -7.754 -5.318 1.00 0.00 H ATOM 5874 HG3 PRO B 166 -12.387 -7.055 -7.297 1.00 0.00 H ATOM 5875 HG2 PRO B 166 -11.681 -5.620 -6.518 1.00 0.00 H ATOM 5876 HB2 PRO B 166 -9.847 -7.037 -6.479 1.00 0.00 H ATOM 5877 HB3 PRO B 166 -10.852 -8.497 -6.330 1.00 0.00 H ATOM 5878 N ASP B 167 -9.767 -5.156 -3.877 1.00 31.29 N ATOM 5879 CA ASP B 167 -8.712 -4.216 -3.462 1.00 33.25 C ATOM 5880 C ASP B 167 -8.475 -4.085 -1.956 1.00 31.27 C ATOM 5881 O ASP B 167 -7.586 -3.331 -1.550 1.00 28.90 O ATOM 5882 CB ASP B 167 -8.980 -2.833 -4.052 1.00 36.78 C ATOM 5883 CG ASP B 167 -8.595 -2.758 -5.519 1.00 44.51 C ATOM 5884 OD1 ASP B 167 -8.433 -3.845 -6.137 1.00 47.78 O ATOM 5885 OD2 ASP B 167 -8.430 -1.625 -6.043 1.00 50.87 O ATOM 5886 HA ASP B 167 -7.795 -4.655 -3.855 1.00 0.00 H ATOM 5887 HB2 ASP B 167 -10.042 -2.608 -3.954 1.00 0.00 H ATOM 5888 HB3 ASP B 167 -8.401 -2.095 -3.497 1.00 0.00 H ATOM 5889 H ASP B 167 -10.738 -4.809 -4.014 1.00 0.00 H ATOM 5890 N ALA B 168 -9.249 -4.806 -1.143 1.00 28.76 N ATOM 5891 CA ALA B 168 -9.087 -4.762 0.315 1.00 26.81 C ATOM 5892 C ALA B 168 -7.781 -5.432 0.751 1.00 25.42 C ATOM 5893 O ALA B 168 -7.514 -6.594 0.431 1.00 25.13 O ATOM 5894 CB ALA B 168 -10.265 -5.422 1.017 1.00 25.64 C ATOM 5895 HA ALA B 168 -9.050 -3.711 0.603 1.00 0.00 H ATOM 5896 HB1 ALA B 168 -11.184 -4.899 0.752 1.00 0.00 H ATOM 5897 HB2 ALA B 168 -10.335 -6.464 0.705 1.00 0.00 H ATOM 5898 HB3 ALA B 168 -10.117 -5.374 2.096 1.00 0.00 H ATOM 5899 H ALA B 168 -9.986 -5.415 -1.553 1.00 0.00 H ATOM 5900 N VAL B 169 -7.009 -4.713 1.549 1.00 24.55 N ATOM 5901 CA VAL B 169 -5.714 -5.213 2.024 1.00 23.82 C ATOM 5902 C VAL B 169 -5.785 -5.962 3.361 1.00 23.04 C ATOM 5903 O VAL B 169 -4.877 -6.753 3.703 1.00 22.14 O ATOM 5904 CB VAL B 169 -4.692 -4.066 2.048 1.00 23.45 C ATOM 5905 CG1 VAL B 169 -4.564 -3.466 0.662 1.00 23.72 C ATOM 5906 CG2 VAL B 169 -5.060 -2.974 3.046 1.00 23.73 C ATOM 5907 HA VAL B 169 -5.381 -5.969 1.313 1.00 0.00 H ATOM 5908 HB VAL B 169 -3.740 -4.490 2.367 1.00 0.00 H ATOM 5909 HG11 VAL B 169 -4.230 -4.234 -0.036 1.00 0.00 H ATOM 5910 HG12 VAL B 169 -5.533 -3.081 0.343 1.00 0.00 H ATOM 5911 HG13 VAL B 169 -3.838 -2.653 0.685 1.00 0.00 H ATOM 5912 HG21 VAL B 169 -6.030 -2.553 2.781 1.00 0.00 H ATOM 5913 HG22 VAL B 169 -5.109 -3.401 4.048 1.00 0.00 H ATOM 5914 HG23 VAL B 169 -4.303 -2.190 3.020 1.00 0.00 H ATOM 5915 H VAL B 169 -7.328 -3.769 1.847 1.00 0.00 H ATOM 5916 N ALA B 170 -6.877 -5.750 4.100 1.00 20.47 N ATOM 5917 CA ALA B 170 -7.053 -6.382 5.395 1.00 19.60 C ATOM 5918 C ALA B 170 -8.513 -6.345 5.821 1.00 17.74 C ATOM 5919 O ALA B 170 -9.300 -5.510 5.362 1.00 16.91 O ATOM 5920 CB ALA B 170 -6.187 -5.694 6.453 1.00 20.02 C ATOM 5921 HA ALA B 170 -6.741 -7.422 5.304 1.00 0.00 H ATOM 5922 HB1 ALA B 170 -5.138 -5.765 6.165 1.00 0.00 H ATOM 5923 HB2 ALA B 170 -6.474 -4.645 6.530 1.00 0.00 H ATOM 5924 HB3 ALA B 170 -6.334 -6.184 7.416 1.00 0.00 H ATOM 5925 H ALA B 170 -7.619 -5.117 3.739 1.00 0.00 H ATOM 5926 N VAL B 171 -8.843 -7.266 6.717 1.00 18.15 N ATOM 5927 CA VAL B 171 -10.173 -7.379 7.275 1.00 17.39 C ATOM 5928 C VAL B 171 -10.126 -7.348 8.798 1.00 17.84 C ATOM 5929 O VAL B 171 -9.218 -7.903 9.418 1.00 17.90 O ATOM 5930 CB VAL B 171 -10.880 -8.636 6.757 1.00 18.26 C ATOM 5931 CG1 VAL B 171 -10.066 -9.918 7.056 1.00 19.06 C ATOM 5932 CG2 VAL B 171 -12.297 -8.728 7.334 1.00 18.81 C ATOM 5933 HA VAL B 171 -10.756 -6.518 6.946 1.00 0.00 H ATOM 5934 HB VAL B 171 -10.955 -8.555 5.673 1.00 0.00 H ATOM 5935 HG11 VAL B 171 -9.091 -9.849 6.573 1.00 0.00 H ATOM 5936 HG12 VAL B 171 -9.932 -10.019 8.133 1.00 0.00 H ATOM 5937 HG13 VAL B 171 -10.603 -10.786 6.672 1.00 0.00 H ATOM 5938 HG21 VAL B 171 -12.243 -8.773 8.422 1.00 0.00 H ATOM 5939 HG22 VAL B 171 -12.868 -7.849 7.034 1.00 0.00 H ATOM 5940 HG23 VAL B 171 -12.784 -9.627 6.956 1.00 0.00 H ATOM 5941 H VAL B 171 -8.113 -7.937 7.032 1.00 0.00 H ATOM 5942 N GLU B 172 -11.126 -6.715 9.402 1.00 16.59 N ATOM 5943 CA GLU B 172 -11.271 -6.763 10.827 1.00 16.57 C ATOM 5944 C GLU B 172 -12.740 -6.528 11.205 1.00 15.55 C ATOM 5945 O GLU B 172 -13.633 -6.785 10.388 1.00 14.46 O ATOM 5946 CB GLU B 172 -10.230 -5.852 11.498 1.00 18.01 C ATOM 5947 CG GLU B 172 -10.059 -4.514 10.837 1.00 18.47 C ATOM 5948 CD GLU B 172 -11.290 -3.708 11.042 1.00 19.03 C ATOM 5949 OE1 GLU B 172 -12.127 -3.651 10.122 1.00 19.78 O ATOM 5950 OE2 GLU B 172 -11.457 -3.219 12.182 1.00 21.95 O ATOM 5951 HA GLU B 172 -11.044 -7.753 11.223 1.00 0.00 H ATOM 5952 HB2 GLU B 172 -10.537 -5.686 12.531 1.00 0.00 H ATOM 5953 HB3 GLU B 172 -9.268 -6.365 11.484 1.00 0.00 H ATOM 5954 HG2 GLU B 172 -9.206 -3.996 11.276 1.00 0.00 H ATOM 5955 HG3 GLU B 172 -9.887 -4.653 9.770 1.00 0.00 H ATOM 5956 H GLU B 172 -11.812 -6.178 8.834 1.00 0.00 H ATOM 5957 N MET B 173 -13.014 -6.122 12.434 1.00 14.30 N ATOM 5958 CA MET B 173 -14.388 -6.161 12.920 1.00 14.30 C ATOM 5959 C MET B 173 -14.877 -4.859 13.558 1.00 14.72 C ATOM 5960 O MET B 173 -16.015 -4.800 14.030 1.00 14.61 O ATOM 5961 CB MET B 173 -14.559 -7.334 13.893 1.00 14.25 C ATOM 5962 CG MET B 173 -14.447 -8.699 13.228 1.00 15.08 C ATOM 5963 SD MET B 173 -14.423 -10.081 14.388 1.00 15.96 S ATOM 5964 CE MET B 173 -16.129 -10.209 14.864 1.00 16.28 C ATOM 5965 HA MET B 173 -15.015 -6.299 12.039 1.00 0.00 H ATOM 5966 HB2 MET B 173 -13.789 -7.260 14.661 1.00 0.00 H ATOM 5967 HB3 MET B 173 -15.542 -7.256 14.357 1.00 0.00 H ATOM 5968 HG2 MET B 173 -13.525 -8.723 12.647 1.00 0.00 H ATOM 5969 HG3 MET B 173 -15.299 -8.826 12.560 1.00 0.00 H ATOM 5970 HE1 MET B 173 -16.448 -9.274 15.325 1.00 0.00 H ATOM 5971 HE2 MET B 173 -16.737 -10.406 13.981 1.00 0.00 H ATOM 5972 HE3 MET B 173 -16.246 -11.025 15.577 1.00 0.00 H ATOM 5973 H MET B 173 -12.252 -5.776 13.051 1.00 0.00 H ATOM 5974 N GLU B 174 -14.039 -3.815 13.556 1.00 15.56 N ATOM 5975 CA GLU B 174 -14.371 -2.579 14.264 1.00 15.02 C ATOM 5976 C GLU B 174 -14.123 -1.299 13.492 1.00 14.61 C ATOM 5977 O GLU B 174 -14.823 -0.337 13.693 1.00 13.51 O ATOM 5978 CB GLU B 174 -13.616 -2.487 15.589 1.00 14.93 C ATOM 5979 CG GLU B 174 -13.945 -3.586 16.581 1.00 15.52 C ATOM 5980 CD GLU B 174 -13.074 -4.815 16.404 1.00 16.32 C ATOM 5981 OE1 GLU B 174 -13.501 -5.902 16.858 1.00 14.83 O ATOM 5982 OE2 GLU B 174 -11.981 -4.666 15.797 1.00 18.62 O ATOM 5983 HA GLU B 174 -15.448 -2.652 14.418 1.00 0.00 H ATOM 5984 HB2 GLU B 174 -12.548 -2.530 15.376 1.00 0.00 H ATOM 5985 HB3 GLU B 174 -13.855 -1.529 16.051 1.00 0.00 H ATOM 5986 HG2 GLU B 174 -13.802 -3.199 17.590 1.00 0.00 H ATOM 5987 HG3 GLU B 174 -14.988 -3.875 16.448 1.00 0.00 H ATOM 5988 H GLU B 174 -13.137 -3.884 13.043 1.00 0.00 H ATOM 5989 N ALA B 175 -13.132 -1.291 12.614 1.00 15.08 N ATOM 5990 CA ALA B 175 -12.624 -0.049 12.038 1.00 14.95 C ATOM 5991 C ALA B 175 -13.675 0.807 11.333 1.00 14.57 C ATOM 5992 O ALA B 175 -13.721 2.027 11.547 1.00 15.21 O ATOM 5993 CB ALA B 175 -11.461 -0.348 11.102 1.00 15.00 C ATOM 5994 HA ALA B 175 -12.287 0.553 12.882 1.00 0.00 H ATOM 5995 HB1 ALA B 175 -10.664 -0.838 11.661 1.00 0.00 H ATOM 5996 HB2 ALA B 175 -11.801 -1.004 10.300 1.00 0.00 H ATOM 5997 HB3 ALA B 175 -11.089 0.584 10.677 1.00 0.00 H ATOM 5998 H ALA B 175 -12.704 -2.194 12.327 1.00 0.00 H ATOM 5999 N THR B 176 -14.507 0.182 10.491 1.00 13.59 N ATOM 6000 CA THR B 176 -15.478 0.929 9.701 1.00 13.43 C ATOM 6001 C THR B 176 -16.572 1.514 10.619 1.00 12.57 C ATOM 6002 O THR B 176 -17.077 2.583 10.361 1.00 12.38 O ATOM 6003 CB THR B 176 -16.132 0.094 8.572 1.00 13.76 C ATOM 6004 OG1 THR B 176 -15.133 -0.653 7.839 1.00 14.50 O ATOM 6005 CG2 THR B 176 -16.884 0.993 7.615 1.00 14.56 C ATOM 6006 HA THR B 176 -14.923 1.731 9.214 1.00 0.00 H ATOM 6007 HB THR B 176 -16.829 -0.604 9.036 1.00 0.00 H ATOM 6008 HG1 THR B 176 -14.661 -1.266 8.457 1.00 0.00 H ATOM 6009 HG23 THR B 176 -17.638 1.557 8.165 1.00 0.00 H ATOM 6010 HG21 THR B 176 -16.185 1.683 7.142 1.00 0.00 H ATOM 6011 HG22 THR B 176 -17.369 0.384 6.852 1.00 0.00 H ATOM 6012 H THR B 176 -14.460 -0.853 10.399 1.00 0.00 H ATOM 6013 N ALA B 177 -16.945 0.789 11.671 1.00 12.51 N ATOM 6014 CA ALA B 177 -17.902 1.282 12.649 1.00 12.52 C ATOM 6015 C ALA B 177 -17.349 2.524 13.345 1.00 12.62 C ATOM 6016 O ALA B 177 -18.063 3.522 13.578 1.00 12.40 O ATOM 6017 CB ALA B 177 -18.235 0.180 13.660 1.00 12.56 C ATOM 6018 HA ALA B 177 -18.824 1.563 12.140 1.00 0.00 H ATOM 6019 HB1 ALA B 177 -18.665 -0.674 13.136 1.00 0.00 H ATOM 6020 HB2 ALA B 177 -17.324 -0.128 14.173 1.00 0.00 H ATOM 6021 HB3 ALA B 177 -18.952 0.561 14.387 1.00 0.00 H ATOM 6022 H ALA B 177 -16.539 -0.160 11.798 1.00 0.00 H ATOM 6023 N ILE B 178 -16.061 2.482 13.658 1.00 13.18 N ATOM 6024 CA ILE B 178 -15.413 3.665 14.227 1.00 13.46 C ATOM 6025 C ILE B 178 -15.354 4.831 13.231 1.00 14.18 C ATOM 6026 O ILE B 178 -15.638 5.968 13.604 1.00 15.89 O ATOM 6027 CB ILE B 178 -14.018 3.343 14.742 1.00 13.08 C ATOM 6028 CG1 ILE B 178 -14.087 2.263 15.832 1.00 12.27 C ATOM 6029 CG2 ILE B 178 -13.394 4.599 15.314 1.00 13.30 C ATOM 6030 CD1 ILE B 178 -12.739 1.634 16.071 1.00 11.70 C ATOM 6031 HA ILE B 178 -16.030 3.978 15.069 1.00 0.00 H ATOM 6032 HB ILE B 178 -13.412 2.971 13.916 1.00 0.00 H ATOM 6033 HG12 ILE B 178 -14.436 2.717 16.759 1.00 0.00 H ATOM 6034 HG13 ILE B 178 -14.789 1.489 15.521 1.00 0.00 H ATOM 6035 HD11 ILE B 178 -12.386 1.173 15.149 1.00 0.00 H ATOM 6036 HD12 ILE B 178 -12.033 2.401 16.388 1.00 0.00 H ATOM 6037 HD13 ILE B 178 -12.826 0.875 16.848 1.00 0.00 H ATOM 6038 HG21 ILE B 178 -13.330 5.359 14.535 1.00 0.00 H ATOM 6039 HG22 ILE B 178 -14.010 4.968 16.134 1.00 0.00 H ATOM 6040 HG23 ILE B 178 -12.394 4.371 15.684 1.00 0.00 H ATOM 6041 H ILE B 178 -15.513 1.612 13.500 1.00 0.00 H ATOM 6042 N ALA B 179 -14.983 4.557 11.985 1.00 14.73 N ATOM 6043 CA ALA B 179 -14.964 5.589 10.908 1.00 14.95 C ATOM 6044 C ALA B 179 -16.337 6.229 10.687 1.00 14.77 C ATOM 6045 O ALA B 179 -16.462 7.444 10.512 1.00 15.71 O ATOM 6046 CB ALA B 179 -14.459 4.984 9.610 1.00 14.41 C ATOM 6047 HA ALA B 179 -14.286 6.378 11.233 1.00 0.00 H ATOM 6048 HB1 ALA B 179 -13.449 4.603 9.757 1.00 0.00 H ATOM 6049 HB2 ALA B 179 -15.117 4.168 9.311 1.00 0.00 H ATOM 6050 HB3 ALA B 179 -14.451 5.749 8.833 1.00 0.00 H ATOM 6051 H ALA B 179 -14.695 3.585 11.751 1.00 0.00 H ATOM 6052 N HIS B 180 -17.359 5.398 10.705 1.00 15.09 N ATOM 6053 CA HIS B 180 -18.753 5.816 10.645 1.00 15.45 C ATOM 6054 C HIS B 180 -19.126 6.803 11.776 1.00 16.01 C ATOM 6055 O HIS B 180 -19.741 7.840 11.526 1.00 16.37 O ATOM 6056 CB HIS B 180 -19.604 4.536 10.683 1.00 16.01 C ATOM 6057 CG HIS B 180 -21.058 4.725 10.436 1.00 16.56 C ATOM 6058 ND1 HIS B 180 -21.861 3.701 9.974 1.00 17.37 N ATOM 6059 CD2 HIS B 180 -21.870 5.796 10.606 1.00 18.09 C ATOM 6060 CE1 HIS B 180 -23.100 4.143 9.852 1.00 18.22 C ATOM 6061 NE2 HIS B 180 -23.134 5.410 10.237 1.00 18.43 N ATOM 6062 HA HIS B 180 -18.940 6.371 9.726 1.00 0.00 H ATOM 6063 HB2 HIS B 180 -19.220 3.855 9.924 1.00 0.00 H ATOM 6064 HB3 HIS B 180 -19.487 4.084 11.668 1.00 0.00 H ATOM 6065 HD2 HIS B 180 -21.574 6.781 10.968 1.00 0.00 H ATOM 6066 HE1 HIS B 180 -23.951 3.563 9.495 1.00 0.00 H ATOM 6067 H HIS B 180 -17.158 4.379 10.766 1.00 0.00 H ATOM 6068 N VAL B 181 -18.769 6.492 13.008 1.00 16.24 N ATOM 6069 CA VAL B 181 -19.056 7.397 14.129 1.00 17.27 C ATOM 6070 C VAL B 181 -18.232 8.684 13.908 1.00 17.79 C ATOM 6071 O VAL B 181 -18.764 9.774 13.987 1.00 18.39 O ATOM 6072 CB VAL B 181 -18.714 6.751 15.488 1.00 16.49 C ATOM 6073 CG1 VAL B 181 -18.817 7.756 16.646 1.00 16.74 C ATOM 6074 CG2 VAL B 181 -19.622 5.553 15.759 1.00 16.68 C ATOM 6075 HA VAL B 181 -20.122 7.623 14.158 1.00 0.00 H ATOM 6076 HB VAL B 181 -17.679 6.413 15.429 1.00 0.00 H ATOM 6077 HG11 VAL B 181 -18.122 8.578 16.475 1.00 0.00 H ATOM 6078 HG12 VAL B 181 -19.834 8.144 16.699 1.00 0.00 H ATOM 6079 HG13 VAL B 181 -18.568 7.257 17.582 1.00 0.00 H ATOM 6080 HG21 VAL B 181 -20.661 5.883 15.776 1.00 0.00 H ATOM 6081 HG22 VAL B 181 -19.488 4.811 14.972 1.00 0.00 H ATOM 6082 HG23 VAL B 181 -19.363 5.113 16.722 1.00 0.00 H ATOM 6083 H VAL B 181 -18.277 5.593 13.188 1.00 0.00 H ATOM 6084 N CYS B 182 -16.957 8.535 13.567 1.00 18.53 N ATOM 6085 CA CYS B 182 -16.087 9.707 13.338 1.00 20.42 C ATOM 6086 C CYS B 182 -16.600 10.622 12.212 1.00 21.38 C ATOM 6087 O CYS B 182 -16.512 11.881 12.301 1.00 21.87 O ATOM 6088 CB CYS B 182 -14.678 9.246 13.022 1.00 20.66 C ATOM 6089 SG CYS B 182 -13.877 8.683 14.524 1.00 21.10 S ATOM 6090 HA CYS B 182 -16.096 10.295 14.256 1.00 0.00 H ATOM 6091 HB2 CYS B 182 -14.112 10.075 12.597 1.00 0.00 H ATOM 6092 HB3 CYS B 182 -14.717 8.428 12.303 1.00 0.00 H ATOM 6093 HG CYS B 182 -14.594 7.633 15.060 1.00 0.00 H ATOM 6094 H CYS B 182 -16.565 7.578 13.459 1.00 0.00 H ATOM 6095 N HIS B 183 -17.126 9.982 11.172 1.00 20.59 N ATOM 6096 CA HIS B 183 -17.764 10.669 10.063 1.00 22.77 C ATOM 6097 C HIS B 183 -18.915 11.544 10.572 1.00 24.12 C ATOM 6098 O HIS B 183 -19.042 12.706 10.190 1.00 22.90 O ATOM 6099 CB HIS B 183 -18.293 9.665 9.045 1.00 22.87 C ATOM 6100 CG HIS B 183 -18.996 10.304 7.893 1.00 24.49 C ATOM 6101 ND1 HIS B 183 -18.316 10.881 6.844 1.00 25.14 N ATOM 6102 CD2 HIS B 183 -20.311 10.475 7.630 1.00 24.28 C ATOM 6103 CE1 HIS B 183 -19.184 11.371 5.977 1.00 25.42 C ATOM 6104 NE2 HIS B 183 -20.402 11.143 6.431 1.00 24.86 N ATOM 6105 HA HIS B 183 -17.020 11.302 9.580 1.00 0.00 H ATOM 6106 HB2 HIS B 183 -17.453 9.087 8.660 1.00 0.00 H ATOM 6107 HB3 HIS B 183 -18.991 8.997 9.549 1.00 0.00 H ATOM 6108 HD2 HIS B 183 -21.143 10.145 8.252 1.00 0.00 H ATOM 6109 HE1 HIS B 183 -18.936 11.878 5.044 1.00 0.00 H ATOM 6110 H HIS B 183 -17.078 8.943 11.152 1.00 0.00 H ATOM 6111 N ASN B 184 -19.729 10.974 11.452 1.00 25.49 N ATOM 6112 CA ASN B 184 -20.876 11.662 11.984 1.00 27.87 C ATOM 6113 C ASN B 184 -20.508 12.816 12.925 1.00 30.23 C ATOM 6114 O ASN B 184 -21.320 13.689 13.151 1.00 29.04 O ATOM 6115 CB ASN B 184 -21.780 10.682 12.717 1.00 29.65 C ATOM 6116 CG ASN B 184 -22.789 10.007 11.794 1.00 32.56 C ATOM 6117 OD1 ASN B 184 -22.451 9.535 10.700 1.00 33.86 O ATOM 6118 ND2 ASN B 184 -24.027 9.938 12.242 1.00 34.34 N ATOM 6119 HA ASN B 184 -21.396 12.097 11.131 1.00 0.00 H ATOM 6120 HB2 ASN B 184 -21.160 9.913 13.178 1.00 0.00 H ATOM 6121 HB3 ASN B 184 -22.323 11.222 13.493 1.00 0.00 H ATOM 6122 HD22 ASN B 184 -24.269 10.347 13.167 1.00 0.00 H ATOM 6123 HD21 ASN B 184 -24.762 9.474 11.671 1.00 0.00 H ATOM 6124 H ASN B 184 -19.532 10.002 11.766 1.00 0.00 H ATOM 6125 N PHE B 185 -19.313 12.797 13.506 1.00 31.70 N ATOM 6126 CA PHE B 185 -18.880 13.887 14.386 1.00 32.38 C ATOM 6127 C PHE B 185 -17.768 14.695 13.757 1.00 31.07 C ATOM 6128 O PHE B 185 -17.150 15.488 14.427 1.00 31.02 O ATOM 6129 CB PHE B 185 -18.381 13.345 15.707 1.00 32.93 C ATOM 6130 CG PHE B 185 -19.458 12.874 16.607 1.00 36.04 C ATOM 6131 CD1 PHE B 185 -20.009 13.722 17.560 1.00 40.57 C ATOM 6132 CD2 PHE B 185 -19.914 11.571 16.534 1.00 37.11 C ATOM 6133 CE1 PHE B 185 -21.005 13.277 18.412 1.00 40.73 C ATOM 6134 CE2 PHE B 185 -20.904 11.122 17.374 1.00 37.82 C ATOM 6135 CZ PHE B 185 -21.457 11.974 18.312 1.00 41.48 C ATOM 6136 HA PHE B 185 -19.748 14.526 14.547 1.00 0.00 H ATOM 6137 HB2 PHE B 185 -17.712 12.509 15.505 1.00 0.00 H ATOM 6138 HB3 PHE B 185 -17.829 14.135 16.216 1.00 0.00 H ATOM 6139 HD2 PHE B 185 -19.482 10.891 15.800 1.00 0.00 H ATOM 6140 HE2 PHE B 185 -21.254 10.092 17.301 1.00 0.00 H ATOM 6141 HZ PHE B 185 -22.248 11.619 18.972 1.00 0.00 H ATOM 6142 HE1 PHE B 185 -21.430 13.949 19.157 1.00 0.00 H ATOM 6143 HD1 PHE B 185 -19.653 14.749 17.637 1.00 0.00 H ATOM 6144 H PHE B 185 -18.674 11.995 13.334 1.00 0.00 H ATOM 6145 N ASN B 186 -17.501 14.463 12.485 1.00 33.32 N ATOM 6146 CA ASN B 186 -16.410 15.118 11.770 1.00 37.35 C ATOM 6147 C ASN B 186 -15.015 15.085 12.455 1.00 36.54 C ATOM 6148 O ASN B 186 -14.284 16.082 12.451 1.00 35.57 O ATOM 6149 CB ASN B 186 -16.823 16.556 11.457 1.00 42.68 C ATOM 6150 CG ASN B 186 -16.042 17.148 10.304 1.00 46.05 C ATOM 6151 OD1 ASN B 186 -15.449 16.426 9.485 1.00 50.20 O ATOM 6152 ND2 ASN B 186 -16.033 18.473 10.231 1.00 49.67 N ATOM 6153 HA ASN B 186 -16.260 14.530 10.864 1.00 0.00 H ATOM 6154 HB2 ASN B 186 -17.883 16.568 11.204 1.00 0.00 H ATOM 6155 HB3 ASN B 186 -16.656 17.168 12.343 1.00 0.00 H ATOM 6156 HD22 ASN B 186 -16.544 19.036 10.940 1.00 0.00 H ATOM 6157 HD21 ASN B 186 -15.515 18.948 9.465 1.00 0.00 H ATOM 6158 H ASN B 186 -18.095 13.783 11.969 1.00 0.00 H ATOM 6159 N VAL B 187 -14.641 13.930 13.008 1.00 31.14 N ATOM 6160 CA VAL B 187 -13.343 13.738 13.650 1.00 27.81 C ATOM 6161 C VAL B 187 -12.417 12.948 12.722 1.00 28.89 C ATOM 6162 O VAL B 187 -12.796 11.848 12.254 1.00 27.24 O ATOM 6163 CB VAL B 187 -13.533 12.988 14.970 1.00 28.09 C ATOM 6164 CG1 VAL B 187 -12.202 12.699 15.668 1.00 28.93 C ATOM 6165 CG2 VAL B 187 -14.484 13.760 15.861 1.00 28.26 C ATOM 6166 HA VAL B 187 -12.891 14.709 13.853 1.00 0.00 H ATOM 6167 HB VAL B 187 -13.972 12.015 14.752 1.00 0.00 H ATOM 6168 HG11 VAL B 187 -11.577 12.087 15.017 1.00 0.00 H ATOM 6169 HG12 VAL B 187 -11.694 13.639 15.882 1.00 0.00 H ATOM 6170 HG13 VAL B 187 -12.390 12.166 16.600 1.00 0.00 H ATOM 6171 HG21 VAL B 187 -14.070 14.748 16.062 1.00 0.00 H ATOM 6172 HG22 VAL B 187 -15.447 13.862 15.360 1.00 0.00 H ATOM 6173 HG23 VAL B 187 -14.617 13.223 16.800 1.00 0.00 H ATOM 6174 H VAL B 187 -15.304 13.129 12.981 1.00 0.00 H ATOM 6175 N PRO B 188 -11.206 13.491 12.431 1.00 25.34 N ATOM 6176 CA PRO B 188 -10.243 12.753 11.626 1.00 25.10 C ATOM 6177 C PRO B 188 -9.926 11.387 12.213 1.00 23.90 C ATOM 6178 O PRO B 188 -9.832 11.244 13.419 1.00 22.98 O ATOM 6179 CB PRO B 188 -8.983 13.634 11.659 1.00 25.66 C ATOM 6180 CG PRO B 188 -9.481 14.999 11.961 1.00 25.97 C ATOM 6181 CD PRO B 188 -10.668 14.795 12.855 1.00 26.12 C ATOM 6182 HA PRO B 188 -10.626 12.564 10.623 1.00 0.00 H ATOM 6183 HD3 PRO B 188 -10.366 14.769 13.902 1.00 0.00 H ATOM 6184 HD2 PRO B 188 -11.405 15.585 12.710 1.00 0.00 H ATOM 6185 HG3 PRO B 188 -9.776 15.510 11.045 1.00 0.00 H ATOM 6186 HG2 PRO B 188 -8.714 15.582 12.470 1.00 0.00 H ATOM 6187 HB2 PRO B 188 -8.297 13.295 12.436 1.00 0.00 H ATOM 6188 HB3 PRO B 188 -8.476 13.615 10.694 1.00 0.00 H ATOM 6189 N PHE B 189 -9.716 10.412 11.337 1.00 23.25 N ATOM 6190 CA PHE B 189 -9.620 9.026 11.747 1.00 23.12 C ATOM 6191 C PHE B 189 -8.612 8.292 10.883 1.00 21.87 C ATOM 6192 O PHE B 189 -8.497 8.552 9.688 1.00 23.67 O ATOM 6193 CB PHE B 189 -11.009 8.389 11.657 1.00 24.14 C ATOM 6194 CG PHE B 189 -11.004 6.886 11.749 1.00 24.69 C ATOM 6195 CD1 PHE B 189 -10.844 6.256 12.973 1.00 24.48 C ATOM 6196 CD2 PHE B 189 -11.133 6.110 10.612 1.00 24.23 C ATOM 6197 CE1 PHE B 189 -10.828 4.862 13.057 1.00 23.27 C ATOM 6198 CE2 PHE B 189 -11.131 4.719 10.692 1.00 24.03 C ATOM 6199 CZ PHE B 189 -10.985 4.102 11.916 1.00 22.88 C ATOM 6200 HA PHE B 189 -9.270 8.962 12.777 1.00 0.00 H ATOM 6201 HB2 PHE B 189 -11.618 8.780 12.472 1.00 0.00 H ATOM 6202 HB3 PHE B 189 -11.455 8.672 10.703 1.00 0.00 H ATOM 6203 HD2 PHE B 189 -11.238 6.593 9.640 1.00 0.00 H ATOM 6204 HE2 PHE B 189 -11.245 4.120 9.789 1.00 0.00 H ATOM 6205 HZ PHE B 189 -10.994 3.014 11.983 1.00 0.00 H ATOM 6206 HE1 PHE B 189 -10.692 4.375 14.023 1.00 0.00 H ATOM 6207 HD1 PHE B 189 -10.730 6.853 13.878 1.00 0.00 H ATOM 6208 H PHE B 189 -9.618 10.650 10.329 1.00 0.00 H ATOM 6209 N VAL B 190 -7.845 7.404 11.505 1.00 21.34 N ATOM 6210 CA VAL B 190 -7.019 6.462 10.769 1.00 20.76 C ATOM 6211 C VAL B 190 -6.980 5.118 11.489 1.00 20.52 C ATOM 6212 O VAL B 190 -7.100 5.049 12.733 1.00 18.30 O ATOM 6213 CB VAL B 190 -5.580 7.008 10.597 1.00 21.34 C ATOM 6214 CG1 VAL B 190 -4.863 7.050 11.934 1.00 21.65 C ATOM 6215 CG2 VAL B 190 -4.788 6.176 9.599 1.00 21.22 C ATOM 6216 HA VAL B 190 -7.459 6.326 9.781 1.00 0.00 H ATOM 6217 HB VAL B 190 -5.654 8.023 10.206 1.00 0.00 H ATOM 6218 HG11 VAL B 190 -5.409 7.700 12.618 1.00 0.00 H ATOM 6219 HG12 VAL B 190 -4.813 6.044 12.350 1.00 0.00 H ATOM 6220 HG13 VAL B 190 -3.854 7.436 11.792 1.00 0.00 H ATOM 6221 HG21 VAL B 190 -4.729 5.147 9.952 1.00 0.00 H ATOM 6222 HG22 VAL B 190 -5.287 6.201 8.630 1.00 0.00 H ATOM 6223 HG23 VAL B 190 -3.783 6.587 9.502 1.00 0.00 H ATOM 6224 H VAL B 190 -7.835 7.382 12.545 1.00 0.00 H ATOM 6225 N VAL B 191 -6.835 4.051 10.698 1.00 19.09 N ATOM 6226 CA VAL B 191 -6.565 2.725 11.222 1.00 18.58 C ATOM 6227 C VAL B 191 -5.079 2.442 11.066 1.00 19.80 C ATOM 6228 O VAL B 191 -4.523 2.581 9.966 1.00 20.16 O ATOM 6229 CB VAL B 191 -7.328 1.605 10.477 1.00 17.90 C ATOM 6230 CG1 VAL B 191 -7.109 0.260 11.143 1.00 18.61 C ATOM 6231 CG2 VAL B 191 -8.809 1.906 10.361 1.00 17.16 C ATOM 6232 HA VAL B 191 -6.892 2.721 12.262 1.00 0.00 H ATOM 6233 HB VAL B 191 -6.922 1.562 9.466 1.00 0.00 H ATOM 6234 HG11 VAL B 191 -6.045 0.022 11.137 1.00 0.00 H ATOM 6235 HG12 VAL B 191 -7.467 0.303 12.172 1.00 0.00 H ATOM 6236 HG13 VAL B 191 -7.657 -0.508 10.597 1.00 0.00 H ATOM 6237 HG21 VAL B 191 -9.238 2.005 11.358 1.00 0.00 H ATOM 6238 HG22 VAL B 191 -8.947 2.837 9.811 1.00 0.00 H ATOM 6239 HG23 VAL B 191 -9.303 1.092 9.831 1.00 0.00 H ATOM 6240 H VAL B 191 -6.919 4.175 9.669 1.00 0.00 H ATOM 6241 N VAL B 192 -4.441 2.037 12.166 1.00 18.75 N ATOM 6242 CA VAL B 192 -3.081 1.537 12.104 1.00 19.26 C ATOM 6243 C VAL B 192 -3.047 0.208 12.811 1.00 18.63 C ATOM 6244 O VAL B 192 -2.927 0.166 14.009 1.00 17.98 O ATOM 6245 CB VAL B 192 -2.084 2.518 12.752 1.00 19.37 C ATOM 6246 CG1 VAL B 192 -0.683 1.907 12.773 1.00 20.02 C ATOM 6247 CG2 VAL B 192 -2.089 3.841 11.987 1.00 19.56 C ATOM 6248 HA VAL B 192 -2.781 1.427 11.062 1.00 0.00 H ATOM 6249 HB VAL B 192 -2.386 2.711 13.781 1.00 0.00 H ATOM 6250 HG11 VAL B 192 -0.700 0.982 13.349 1.00 0.00 H ATOM 6251 HG12 VAL B 192 -0.365 1.695 11.752 1.00 0.00 H ATOM 6252 HG13 VAL B 192 0.012 2.610 13.233 1.00 0.00 H ATOM 6253 HG21 VAL B 192 -1.798 3.662 10.952 1.00 0.00 H ATOM 6254 HG22 VAL B 192 -3.090 4.272 12.015 1.00 0.00 H ATOM 6255 HG23 VAL B 192 -1.382 4.530 12.450 1.00 0.00 H ATOM 6256 H VAL B 192 -4.928 2.081 13.084 1.00 0.00 H ATOM 6257 N ARG B 193 -3.177 -0.885 12.066 1.00 19.01 N ATOM 6258 CA ARG B 193 -3.205 -2.197 12.691 1.00 19.27 C ATOM 6259 C ARG B 193 -2.041 -3.069 12.205 1.00 20.11 C ATOM 6260 O ARG B 193 -1.258 -2.636 11.337 1.00 21.05 O ATOM 6261 CB ARG B 193 -4.561 -2.861 12.452 1.00 19.61 C ATOM 6262 CG ARG B 193 -5.733 -2.179 13.145 1.00 18.65 C ATOM 6263 CD ARG B 193 -7.028 -2.849 12.674 1.00 19.72 C ATOM 6264 NE ARG B 193 -8.257 -2.439 13.355 1.00 19.03 N ATOM 6265 CZ ARG B 193 -8.941 -3.155 14.243 1.00 20.59 C ATOM 6266 NH1 ARG B 193 -8.541 -4.353 14.649 1.00 19.65 N ATOM 6267 NH2 ARG B 193 -10.074 -2.666 14.730 1.00 21.38 N ATOM 6268 HA ARG B 193 -3.076 -2.077 13.767 1.00 0.00 H ATOM 6269 HB2 ARG B 193 -4.754 -2.863 11.379 1.00 0.00 H ATOM 6270 HB3 ARG B 193 -4.505 -3.889 12.811 1.00 0.00 H ATOM 6271 HG2 ARG B 193 -5.635 -2.285 14.225 1.00 0.00 H ATOM 6272 HG3 ARG B 193 -5.750 -1.121 12.885 1.00 0.00 H ATOM 6273 HD2 ARG B 193 -6.915 -3.924 12.812 1.00 0.00 H ATOM 6274 HD3 ARG B 193 -7.148 -2.631 11.613 1.00 0.00 H ATOM 6275 HE ARG B 193 -8.631 -1.497 13.122 1.00 0.00 H ATOM 6276 HH12 ARG B 193 -9.105 -4.881 15.345 1.00 0.00 H ATOM 6277 HH11 ARG B 193 -7.664 -4.764 14.271 1.00 0.00 H ATOM 6278 HH22 ARG B 193 -10.620 -3.214 15.425 1.00 0.00 H ATOM 6279 HH21 ARG B 193 -10.416 -1.735 14.417 1.00 0.00 H ATOM 6280 H ARG B 193 -3.259 -0.801 11.033 1.00 0.00 H ATOM 6281 N ALA B 194 -1.906 -4.252 12.818 1.00 20.57 N ATOM 6282 CA ALA B 194 -0.867 -5.231 12.474 1.00 20.03 C ATOM 6283 C ALA B 194 -1.459 -6.611 12.208 1.00 19.84 C ATOM 6284 O ALA B 194 -2.435 -7.007 12.821 1.00 18.11 O ATOM 6285 CB ALA B 194 0.172 -5.301 13.591 1.00 20.41 C ATOM 6286 HA ALA B 194 -0.384 -4.901 11.554 1.00 0.00 H ATOM 6287 HB1 ALA B 194 0.630 -4.321 13.721 1.00 0.00 H ATOM 6288 HB2 ALA B 194 -0.314 -5.603 14.519 1.00 0.00 H ATOM 6289 HB3 ALA B 194 0.939 -6.030 13.327 1.00 0.00 H ATOM 6290 H ALA B 194 -2.573 -4.490 13.579 1.00 0.00 H ATOM 6291 N ILE B 195 -0.834 -7.365 11.306 1.00 20.07 N ATOM 6292 CA ILE B 195 -1.361 -8.643 10.866 1.00 20.96 C ATOM 6293 C ILE B 195 -1.089 -9.766 11.857 1.00 21.58 C ATOM 6294 O ILE B 195 0.057 -10.023 12.253 1.00 23.41 O ATOM 6295 CB ILE B 195 -0.773 -9.019 9.484 1.00 21.92 C ATOM 6296 CG1 ILE B 195 -1.049 -7.912 8.463 1.00 22.99 C ATOM 6297 CG2 ILE B 195 -1.331 -10.347 9.012 1.00 22.68 C ATOM 6298 CD1 ILE B 195 -2.512 -7.528 8.358 1.00 24.23 C ATOM 6299 HA ILE B 195 -2.442 -8.526 10.794 1.00 0.00 H ATOM 6300 HB ILE B 195 0.307 -9.124 9.584 1.00 0.00 H ATOM 6301 HG12 ILE B 195 -0.481 -7.028 8.752 1.00 0.00 H ATOM 6302 HG13 ILE B 195 -0.712 -8.255 7.485 1.00 0.00 H ATOM 6303 HD11 ILE B 195 -3.094 -8.399 8.057 1.00 0.00 H ATOM 6304 HD12 ILE B 195 -2.863 -7.171 9.326 1.00 0.00 H ATOM 6305 HD13 ILE B 195 -2.627 -6.739 7.615 1.00 0.00 H ATOM 6306 HG21 ILE B 195 -1.072 -11.125 9.731 1.00 0.00 H ATOM 6307 HG22 ILE B 195 -2.415 -10.275 8.928 1.00 0.00 H ATOM 6308 HG23 ILE B 195 -0.905 -10.593 8.039 1.00 0.00 H ATOM 6309 H ILE B 195 0.063 -7.026 10.903 1.00 0.00 H ATOM 6310 N SER B 196 -2.153 -10.456 12.228 1.00 21.96 N ATOM 6311 CA SER B 196 -2.108 -11.577 13.138 1.00 21.99 C ATOM 6312 C SER B 196 -2.339 -12.928 12.447 1.00 22.65 C ATOM 6313 O SER B 196 -2.126 -13.984 13.054 1.00 23.46 O ATOM 6314 CB SER B 196 -3.197 -11.378 14.185 1.00 21.74 C ATOM 6315 OG SER B 196 -4.447 -11.155 13.547 1.00 22.86 O ATOM 6316 HA SER B 196 -1.110 -11.606 13.576 1.00 0.00 H ATOM 6317 HB2 SER B 196 -2.949 -10.517 14.806 1.00 0.00 H ATOM 6318 HB3 SER B 196 -3.264 -12.268 14.811 1.00 0.00 H ATOM 6319 HG SER B 196 -4.673 -11.938 12.985 1.00 0.00 H ATOM 6320 H SER B 196 -3.077 -10.176 11.842 1.00 0.00 H ATOM 6321 N ASP B 197 -2.810 -12.870 11.205 1.00 24.17 N ATOM 6322 CA ASP B 197 -3.269 -14.024 10.426 1.00 23.35 C ATOM 6323 C ASP B 197 -3.638 -13.560 9.010 1.00 24.19 C ATOM 6324 O ASP B 197 -3.640 -12.367 8.717 1.00 22.40 O ATOM 6325 CB ASP B 197 -4.475 -14.684 11.064 1.00 24.03 C ATOM 6326 CG ASP B 197 -5.677 -13.749 11.108 1.00 24.76 C ATOM 6327 OD1 ASP B 197 -6.521 -13.806 10.179 1.00 23.10 O ATOM 6328 OD2 ASP B 197 -5.733 -12.936 12.064 1.00 23.69 O ATOM 6329 HA ASP B 197 -2.461 -14.755 10.393 1.00 0.00 H ATOM 6330 HB2 ASP B 197 -4.739 -15.570 10.487 1.00 0.00 H ATOM 6331 HB3 ASP B 197 -4.219 -14.978 12.082 1.00 0.00 H ATOM 6332 H ASP B 197 -2.856 -11.935 10.752 1.00 0.00 H ATOM 6333 N VAL B 198 -3.921 -14.504 8.121 1.00 26.50 N ATOM 6334 CA VAL B 198 -4.258 -14.152 6.733 1.00 27.73 C ATOM 6335 C VAL B 198 -5.696 -14.545 6.391 1.00 29.08 C ATOM 6336 O VAL B 198 -6.046 -14.683 5.210 1.00 30.21 O ATOM 6337 CB VAL B 198 -3.248 -14.701 5.686 1.00 29.03 C ATOM 6338 CG1 VAL B 198 -1.866 -14.101 5.911 1.00 30.96 C ATOM 6339 CG2 VAL B 198 -3.185 -16.211 5.694 1.00 30.42 C ATOM 6340 HA VAL B 198 -4.179 -13.066 6.673 1.00 0.00 H ATOM 6341 HB VAL B 198 -3.605 -14.400 4.701 1.00 0.00 H ATOM 6342 HG11 VAL B 198 -1.922 -13.017 5.815 1.00 0.00 H ATOM 6343 HG12 VAL B 198 -1.517 -14.361 6.910 1.00 0.00 H ATOM 6344 HG13 VAL B 198 -1.174 -14.498 5.168 1.00 0.00 H ATOM 6345 HG21 VAL B 198 -2.873 -16.555 6.680 1.00 0.00 H ATOM 6346 HG22 VAL B 198 -4.170 -16.616 5.461 1.00 0.00 H ATOM 6347 HG23 VAL B 198 -2.467 -16.547 4.947 1.00 0.00 H ATOM 6348 H VAL B 198 -3.904 -15.503 8.409 1.00 0.00 H ATOM 6349 N ALA B 199 -6.518 -14.711 7.433 1.00 28.24 N ATOM 6350 CA ALA B 199 -7.960 -14.854 7.295 1.00 27.88 C ATOM 6351 C ALA B 199 -8.374 -16.150 6.586 1.00 29.83 C ATOM 6352 O ALA B 199 -9.473 -16.243 6.033 1.00 28.15 O ATOM 6353 CB ALA B 199 -8.522 -13.638 6.574 1.00 27.31 C ATOM 6354 HA ALA B 199 -8.379 -14.917 8.299 1.00 0.00 H ATOM 6355 HB1 ALA B 199 -8.298 -12.740 7.150 1.00 0.00 H ATOM 6356 HB2 ALA B 199 -8.067 -13.560 5.586 1.00 0.00 H ATOM 6357 HB3 ALA B 199 -9.602 -13.745 6.471 1.00 0.00 H ATOM 6358 H ALA B 199 -6.107 -14.739 8.388 1.00 0.00 H ATOM 6359 N ASP B 200 -7.487 -17.147 6.599 1.00 31.70 N ATOM 6360 CA ASP B 200 -7.736 -18.407 5.887 1.00 33.54 C ATOM 6361 C ASP B 200 -8.208 -19.453 6.890 1.00 35.59 C ATOM 6362 O ASP B 200 -8.591 -19.111 8.011 1.00 33.59 O ATOM 6363 CB ASP B 200 -6.487 -18.870 5.108 1.00 34.36 C ATOM 6364 CG ASP B 200 -5.256 -19.087 6.002 1.00 36.45 C ATOM 6365 OD1 ASP B 200 -5.365 -19.235 7.240 1.00 37.33 O ATOM 6366 OD2 ASP B 200 -4.147 -19.108 5.437 1.00 41.36 O ATOM 6367 HA ASP B 200 -8.517 -18.257 5.142 1.00 0.00 H ATOM 6368 HB2 ASP B 200 -6.720 -19.809 4.607 1.00 0.00 H ATOM 6369 HB3 ASP B 200 -6.244 -18.113 4.363 1.00 0.00 H ATOM 6370 H ASP B 200 -6.598 -17.029 7.126 1.00 0.00 H ATOM 6371 N GLN B 201 -8.128 -20.725 6.514 1.00 34.75 N ATOM 6372 CA GLN B 201 -8.709 -21.801 7.304 1.00 35.76 C ATOM 6373 C GLN B 201 -7.907 -22.017 8.579 1.00 33.10 C ATOM 6374 O GLN B 201 -8.410 -22.601 9.538 1.00 32.77 O ATOM 6375 CB GLN B 201 -8.777 -23.102 6.488 1.00 40.49 C ATOM 6376 CG GLN B 201 -9.307 -22.931 5.070 1.00 44.13 C ATOM 6377 CD GLN B 201 -8.320 -22.225 4.137 1.00 49.55 C ATOM 6378 OE1 GLN B 201 -8.689 -21.294 3.413 1.00 54.42 O ATOM 6379 NE2 GLN B 201 -7.056 -22.647 4.171 1.00 51.71 N ATOM 6380 HA GLN B 201 -9.725 -21.514 7.575 1.00 0.00 H ATOM 6381 HB2 GLN B 201 -7.772 -23.520 6.428 1.00 0.00 H ATOM 6382 HB3 GLN B 201 -9.429 -23.800 7.013 1.00 0.00 H ATOM 6383 HG2 GLN B 201 -9.526 -23.917 4.661 1.00 0.00 H ATOM 6384 HG3 GLN B 201 -10.225 -22.344 5.112 1.00 0.00 H ATOM 6385 HE22 GLN B 201 -6.787 -23.434 4.795 1.00 0.00 H ATOM 6386 HE21 GLN B 201 -6.339 -22.189 3.574 1.00 0.00 H ATOM 6387 H GLN B 201 -7.635 -20.959 5.628 1.00 0.00 H ATOM 6388 N GLN B 202 -6.674 -21.521 8.602 1.00 33.15 N ATOM 6389 CA GLN B 202 -5.849 -21.590 9.812 1.00 37.79 C ATOM 6390 C GLN B 202 -5.772 -20.235 10.557 1.00 36.12 C ATOM 6391 O GLN B 202 -4.875 -20.039 11.387 1.00 35.23 O ATOM 6392 CB GLN B 202 -4.427 -22.087 9.470 1.00 41.66 C ATOM 6393 CG GLN B 202 -4.354 -23.388 8.669 1.00 45.47 C ATOM 6394 CD GLN B 202 -4.977 -24.580 9.389 1.00 47.70 C ATOM 6395 OE1 GLN B 202 -6.201 -24.687 9.502 1.00 53.73 O ATOM 6396 NE2 GLN B 202 -4.134 -25.496 9.861 1.00 47.67 N ATOM 6397 HA GLN B 202 -6.332 -22.301 10.482 1.00 0.00 H ATOM 6398 HB2 GLN B 202 -3.930 -21.309 8.891 1.00 0.00 H ATOM 6399 HB3 GLN B 202 -3.891 -22.240 10.407 1.00 0.00 H ATOM 6400 HG2 GLN B 202 -4.878 -23.242 7.725 1.00 0.00 H ATOM 6401 HG3 GLN B 202 -3.306 -23.613 8.470 1.00 0.00 H ATOM 6402 HE22 GLN B 202 -3.108 -25.368 9.745 1.00 0.00 H ATOM 6403 HE21 GLN B 202 -4.501 -26.340 10.346 1.00 0.00 H ATOM 6404 H GLN B 202 -6.287 -21.076 7.746 1.00 0.00 H ATOM 6405 N SER B 203 -6.706 -19.312 10.286 1.00 31.80 N ATOM 6406 CA SER B 203 -6.639 -17.978 10.909 1.00 29.92 C ATOM 6407 C SER B 203 -6.862 -18.016 12.409 1.00 27.48 C ATOM 6408 O SER B 203 -6.247 -17.248 13.125 1.00 29.05 O ATOM 6409 CB SER B 203 -7.609 -16.984 10.237 1.00 29.38 C ATOM 6410 OG SER B 203 -8.944 -17.260 10.593 1.00 28.36 O ATOM 6411 HA SER B 203 -5.621 -17.624 10.747 1.00 0.00 H ATOM 6412 HB2 SER B 203 -7.505 -17.061 9.155 1.00 0.00 H ATOM 6413 HB3 SER B 203 -7.358 -15.972 10.553 1.00 0.00 H ATOM 6414 HG SER B 203 -9.544 -16.609 10.149 1.00 0.00 H ATOM 6415 H SER B 203 -7.482 -19.539 9.632 1.00 0.00 H ATOM 6416 N HIS B 204 -7.729 -18.905 12.884 1.00 27.33 N ATOM 6417 CA HIS B 204 -8.023 -19.011 14.309 1.00 29.56 C ATOM 6418 C HIS B 204 -6.785 -19.433 15.130 1.00 31.86 C ATOM 6419 O HIS B 204 -6.525 -18.901 16.232 1.00 28.63 O ATOM 6420 CB HIS B 204 -9.234 -19.910 14.566 1.00 30.92 C ATOM 6421 CG HIS B 204 -9.066 -21.340 14.132 1.00 35.20 C ATOM 6422 ND1 HIS B 204 -8.874 -21.717 12.819 1.00 36.93 N ATOM 6423 CD2 HIS B 204 -9.093 -22.489 14.848 1.00 36.16 C ATOM 6424 CE1 HIS B 204 -8.780 -23.030 12.745 1.00 36.50 C ATOM 6425 NE2 HIS B 204 -8.912 -23.523 13.962 1.00 37.04 N ATOM 6426 HA HIS B 204 -8.291 -18.014 14.660 1.00 0.00 H ATOM 6427 HB2 HIS B 204 -9.440 -19.903 15.636 1.00 0.00 H ATOM 6428 HB3 HIS B 204 -10.086 -19.491 14.031 1.00 0.00 H ATOM 6429 HD2 HIS B 204 -9.232 -22.577 15.925 1.00 0.00 H ATOM 6430 HE1 HIS B 204 -8.621 -23.609 11.835 1.00 0.00 H ATOM 6431 H HIS B 204 -8.212 -19.544 12.220 1.00 0.00 H ATOM 6432 N LEU B 205 -5.994 -20.330 14.548 1.00 30.68 N ATOM 6433 CA LEU B 205 -4.755 -20.796 15.163 1.00 31.37 C ATOM 6434 C LEU B 205 -3.667 -19.726 15.089 1.00 29.11 C ATOM 6435 O LEU B 205 -3.002 -19.449 16.072 1.00 29.77 O ATOM 6436 CB LEU B 205 -4.299 -22.101 14.481 1.00 32.90 C ATOM 6437 CG LEU B 205 -5.352 -23.228 14.516 1.00 34.38 C ATOM 6438 CD1 LEU B 205 -4.849 -24.487 13.820 1.00 36.43 C ATOM 6439 CD2 LEU B 205 -5.784 -23.559 15.931 1.00 34.71 C ATOM 6440 HA LEU B 205 -4.939 -20.996 16.219 1.00 0.00 H ATOM 6441 HB2 LEU B 205 -4.067 -21.881 13.439 1.00 0.00 H ATOM 6442 HB3 LEU B 205 -3.400 -22.456 14.985 1.00 0.00 H ATOM 6443 HG LEU B 205 -6.220 -22.853 13.974 1.00 0.00 H ATOM 6444 HD21 LEU B 205 -4.918 -23.884 16.507 1.00 0.00 H ATOM 6445 HD22 LEU B 205 -6.218 -22.673 16.394 1.00 0.00 H ATOM 6446 HD23 LEU B 205 -6.526 -24.357 15.906 1.00 0.00 H ATOM 6447 HD11 LEU B 205 -4.622 -24.259 12.778 1.00 0.00 H ATOM 6448 HD12 LEU B 205 -3.948 -24.842 14.320 1.00 0.00 H ATOM 6449 HD13 LEU B 205 -5.618 -25.258 13.865 1.00 0.00 H ATOM 6450 H LEU B 205 -6.268 -20.713 13.621 1.00 0.00 H ATOM 6451 N SER B 206 -3.497 -19.124 13.920 1.00 28.13 N ATOM 6452 CA SER B 206 -2.520 -18.067 13.738 1.00 27.48 C ATOM 6453 C SER B 206 -2.826 -16.819 14.605 1.00 28.41 C ATOM 6454 O SER B 206 -1.920 -16.139 15.110 1.00 26.12 O ATOM 6455 CB SER B 206 -2.482 -17.671 12.282 1.00 26.89 C ATOM 6456 OG SER B 206 -1.615 -16.588 12.111 1.00 27.91 O ATOM 6457 HA SER B 206 -1.553 -18.455 14.058 1.00 0.00 H ATOM 6458 HB2 SER B 206 -3.483 -17.389 11.957 1.00 0.00 H ATOM 6459 HB3 SER B 206 -2.132 -18.514 11.686 1.00 0.00 H ATOM 6460 HG SER B 206 -1.934 -15.823 12.652 1.00 0.00 H ATOM 6461 H SER B 206 -4.080 -19.418 13.111 1.00 0.00 H ATOM 6462 N PHE B 207 -4.109 -16.521 14.762 1.00 27.05 N ATOM 6463 CA PHE B 207 -4.517 -15.432 15.621 1.00 26.85 C ATOM 6464 C PHE B 207 -4.109 -15.707 17.073 1.00 28.46 C ATOM 6465 O PHE B 207 -3.477 -14.858 17.707 1.00 26.96 O ATOM 6466 CB PHE B 207 -6.012 -15.200 15.512 1.00 25.12 C ATOM 6467 CG PHE B 207 -6.498 -14.039 16.331 1.00 22.97 C ATOM 6468 CD1 PHE B 207 -7.095 -14.244 17.565 1.00 24.02 C ATOM 6469 CD2 PHE B 207 -6.362 -12.749 15.857 1.00 22.77 C ATOM 6470 CE1 PHE B 207 -7.528 -13.174 18.322 1.00 23.08 C ATOM 6471 CE2 PHE B 207 -6.804 -11.674 16.605 1.00 22.23 C ATOM 6472 CZ PHE B 207 -7.406 -11.895 17.831 1.00 22.85 C ATOM 6473 HA PHE B 207 -4.008 -14.525 15.294 1.00 0.00 H ATOM 6474 HB2 PHE B 207 -6.257 -15.012 14.467 1.00 0.00 H ATOM 6475 HB3 PHE B 207 -6.527 -16.100 15.849 1.00 0.00 H ATOM 6476 HD2 PHE B 207 -5.902 -12.577 14.884 1.00 0.00 H ATOM 6477 HE2 PHE B 207 -6.679 -10.658 16.231 1.00 0.00 H ATOM 6478 HZ PHE B 207 -7.785 -11.053 18.410 1.00 0.00 H ATOM 6479 HE1 PHE B 207 -7.965 -13.342 19.306 1.00 0.00 H ATOM 6480 HD1 PHE B 207 -7.224 -15.259 17.941 1.00 0.00 H ATOM 6481 H PHE B 207 -4.830 -17.078 14.261 1.00 0.00 H ATOM 6482 N ASP B 208 -4.450 -16.896 17.574 1.00 31.38 N ATOM 6483 CA ASP B 208 -4.036 -17.329 18.914 1.00 35.09 C ATOM 6484 C ASP B 208 -2.520 -17.276 19.069 1.00 33.38 C ATOM 6485 O ASP B 208 -2.022 -16.866 20.100 1.00 34.08 O ATOM 6486 CB ASP B 208 -4.546 -18.746 19.236 1.00 39.28 C ATOM 6487 CG ASP B 208 -5.991 -18.766 19.799 1.00 46.52 C ATOM 6488 OD1 ASP B 208 -6.481 -17.739 20.340 1.00 49.49 O ATOM 6489 OD2 ASP B 208 -6.640 -19.840 19.716 1.00 50.55 O ATOM 6490 HA ASP B 208 -4.485 -16.634 19.623 1.00 0.00 H ATOM 6491 HB2 ASP B 208 -4.523 -19.338 18.321 1.00 0.00 H ATOM 6492 HB3 ASP B 208 -3.881 -19.194 19.974 1.00 0.00 H ATOM 6493 H ASP B 208 -5.029 -17.538 16.995 1.00 0.00 H ATOM 6494 N GLU B 209 -1.786 -17.662 18.038 1.00 35.67 N ATOM 6495 CA GLU B 209 -0.324 -17.646 18.095 1.00 38.73 C ATOM 6496 C GLU B 209 0.258 -16.239 18.039 1.00 36.61 C ATOM 6497 O GLU B 209 1.152 -15.915 18.816 1.00 34.85 O ATOM 6498 CB GLU B 209 0.245 -18.477 16.938 1.00 44.03 C ATOM 6499 CG GLU B 209 1.767 -18.519 16.826 1.00 49.55 C ATOM 6500 CD GLU B 209 2.427 -19.402 17.877 1.00 54.63 C ATOM 6501 OE1 GLU B 209 3.677 -19.390 17.965 1.00 55.80 O ATOM 6502 OE2 GLU B 209 1.702 -20.112 18.612 1.00 60.84 O ATOM 6503 HA GLU B 209 -0.039 -18.075 19.056 1.00 0.00 H ATOM 6504 HB2 GLU B 209 -0.109 -19.501 17.058 1.00 0.00 H ATOM 6505 HB3 GLU B 209 -0.146 -18.065 16.008 1.00 0.00 H ATOM 6506 HG2 GLU B 209 2.031 -18.900 15.839 1.00 0.00 H ATOM 6507 HG3 GLU B 209 2.150 -17.505 16.937 1.00 0.00 H ATOM 6508 H GLU B 209 -2.258 -17.984 17.169 1.00 0.00 H ATOM 6509 N PHE B 210 -0.231 -15.412 17.109 1.00 32.91 N ATOM 6510 CA PHE B 210 0.450 -14.167 16.753 1.00 31.54 C ATOM 6511 C PHE B 210 -0.258 -12.857 17.154 1.00 27.96 C ATOM 6512 O PHE B 210 0.194 -11.783 16.785 1.00 25.46 O ATOM 6513 CB PHE B 210 0.737 -14.156 15.255 1.00 34.12 C ATOM 6514 CG PHE B 210 1.600 -15.302 14.794 1.00 37.99 C ATOM 6515 CD1 PHE B 210 2.968 -15.290 15.034 1.00 40.38 C ATOM 6516 CD2 PHE B 210 1.052 -16.381 14.109 1.00 38.59 C ATOM 6517 CE1 PHE B 210 3.778 -16.336 14.598 1.00 41.68 C ATOM 6518 CE2 PHE B 210 1.854 -17.428 13.665 1.00 42.11 C ATOM 6519 CZ PHE B 210 3.222 -17.404 13.913 1.00 41.54 C ATOM 6520 HA PHE B 210 1.364 -14.174 17.347 1.00 0.00 H ATOM 6521 HB2 PHE B 210 -0.213 -14.204 14.722 1.00 0.00 H ATOM 6522 HB3 PHE B 210 1.243 -13.223 15.008 1.00 0.00 H ATOM 6523 HD2 PHE B 210 -0.021 -16.407 13.917 1.00 0.00 H ATOM 6524 HE2 PHE B 210 1.411 -18.264 13.124 1.00 0.00 H ATOM 6525 HZ PHE B 210 3.855 -18.223 13.570 1.00 0.00 H ATOM 6526 HE1 PHE B 210 4.850 -16.314 14.796 1.00 0.00 H ATOM 6527 HD1 PHE B 210 3.413 -14.452 15.570 1.00 0.00 H ATOM 6528 H PHE B 210 -1.118 -15.660 16.626 1.00 0.00 H ATOM 6529 N LEU B 211 -1.353 -12.945 17.902 1.00 26.77 N ATOM 6530 CA LEU B 211 -1.984 -11.736 18.461 1.00 26.02 C ATOM 6531 C LEU B 211 -0.972 -10.878 19.218 1.00 24.63 C ATOM 6532 O LEU B 211 -0.954 -9.682 19.050 1.00 23.36 O ATOM 6533 CB LEU B 211 -3.141 -12.106 19.405 1.00 24.29 C ATOM 6534 CG LEU B 211 -3.881 -10.959 20.125 1.00 23.84 C ATOM 6535 CD1 LEU B 211 -4.403 -9.933 19.122 1.00 22.59 C ATOM 6536 CD2 LEU B 211 -5.019 -11.496 20.994 1.00 22.61 C ATOM 6537 HA LEU B 211 -2.374 -11.161 17.621 1.00 0.00 H ATOM 6538 HB2 LEU B 211 -3.880 -12.650 18.816 1.00 0.00 H ATOM 6539 HB3 LEU B 211 -2.735 -12.764 20.174 1.00 0.00 H ATOM 6540 HG LEU B 211 -3.166 -10.461 20.780 1.00 0.00 H ATOM 6541 HD21 LEU B 211 -5.732 -12.031 20.367 1.00 0.00 H ATOM 6542 HD22 LEU B 211 -4.613 -12.174 21.744 1.00 0.00 H ATOM 6543 HD23 LEU B 211 -5.521 -10.664 21.488 1.00 0.00 H ATOM 6544 HD11 LEU B 211 -3.566 -9.514 18.563 1.00 0.00 H ATOM 6545 HD12 LEU B 211 -5.094 -10.419 18.433 1.00 0.00 H ATOM 6546 HD13 LEU B 211 -4.920 -9.136 19.656 1.00 0.00 H ATOM 6547 H LEU B 211 -1.770 -13.878 18.095 1.00 0.00 H ATOM 6548 N ALA B 212 -0.140 -11.496 20.055 1.00 25.44 N ATOM 6549 CA ALA B 212 0.851 -10.744 20.846 1.00 26.67 C ATOM 6550 C ALA B 212 1.850 -9.986 19.957 1.00 26.40 C ATOM 6551 O ALA B 212 2.136 -8.834 20.217 1.00 23.96 O ATOM 6552 CB ALA B 212 1.590 -11.662 21.819 1.00 27.90 C ATOM 6553 HA ALA B 212 0.297 -10.002 21.421 1.00 0.00 H ATOM 6554 HB1 ALA B 212 0.873 -12.119 22.501 1.00 0.00 H ATOM 6555 HB2 ALA B 212 2.108 -12.441 21.259 1.00 0.00 H ATOM 6556 HB3 ALA B 212 2.314 -11.079 22.388 1.00 0.00 H ATOM 6557 H ALA B 212 -0.191 -12.530 20.152 1.00 0.00 H ATOM 6558 N VAL B 213 2.347 -10.614 18.889 1.00 26.64 N ATOM 6559 CA VAL B 213 3.227 -9.918 17.944 1.00 26.35 C ATOM 6560 C VAL B 213 2.521 -8.735 17.265 1.00 24.36 C ATOM 6561 O VAL B 213 3.072 -7.654 17.162 1.00 23.27 O ATOM 6562 CB VAL B 213 3.765 -10.856 16.840 1.00 28.64 C ATOM 6563 CG1 VAL B 213 4.700 -10.085 15.904 1.00 29.48 C ATOM 6564 CG2 VAL B 213 4.479 -12.048 17.475 1.00 30.39 C ATOM 6565 HA VAL B 213 4.061 -9.553 18.544 1.00 0.00 H ATOM 6566 HB VAL B 213 2.931 -11.233 16.247 1.00 0.00 H ATOM 6567 HG11 VAL B 213 4.153 -9.264 15.441 1.00 0.00 H ATOM 6568 HG12 VAL B 213 5.538 -9.688 16.476 1.00 0.00 H ATOM 6569 HG13 VAL B 213 5.072 -10.757 15.131 1.00 0.00 H ATOM 6570 HG21 VAL B 213 5.311 -11.690 18.082 1.00 0.00 H ATOM 6571 HG22 VAL B 213 3.778 -12.597 18.104 1.00 0.00 H ATOM 6572 HG23 VAL B 213 4.855 -12.705 16.690 1.00 0.00 H ATOM 6573 H VAL B 213 2.107 -11.612 18.724 1.00 0.00 H ATOM 6574 N ALA B 214 1.299 -8.961 16.805 1.00 23.32 N ATOM 6575 CA ALA B 214 0.529 -7.899 16.183 1.00 22.11 C ATOM 6576 C ALA B 214 0.266 -6.742 17.176 1.00 20.10 C ATOM 6577 O ALA B 214 0.391 -5.565 16.840 1.00 20.47 O ATOM 6578 CB ALA B 214 -0.773 -8.459 15.639 1.00 21.49 C ATOM 6579 HA ALA B 214 1.107 -7.489 15.355 1.00 0.00 H ATOM 6580 HB1 ALA B 214 -0.555 -9.228 14.898 1.00 0.00 H ATOM 6581 HB2 ALA B 214 -1.350 -8.893 16.456 1.00 0.00 H ATOM 6582 HB3 ALA B 214 -1.346 -7.657 15.174 1.00 0.00 H ATOM 6583 H ALA B 214 0.886 -9.912 16.891 1.00 0.00 H ATOM 6584 N ALA B 215 -0.086 -7.077 18.402 1.00 20.49 N ATOM 6585 CA ALA B 215 -0.279 -6.046 19.436 1.00 20.87 C ATOM 6586 C ALA B 215 0.987 -5.227 19.682 1.00 21.37 C ATOM 6587 O ALA B 215 0.922 -4.021 19.895 1.00 21.41 O ATOM 6588 CB ALA B 215 -0.742 -6.675 20.736 1.00 21.01 C ATOM 6589 HA ALA B 215 -1.047 -5.367 19.065 1.00 0.00 H ATOM 6590 HB1 ALA B 215 -1.687 -7.193 20.571 1.00 0.00 H ATOM 6591 HB2 ALA B 215 0.008 -7.387 21.081 1.00 0.00 H ATOM 6592 HB3 ALA B 215 -0.879 -5.896 21.486 1.00 0.00 H ATOM 6593 H ALA B 215 -0.229 -8.079 18.641 1.00 0.00 H ATOM 6594 N LYS B 216 2.136 -5.893 19.725 1.00 22.79 N ATOM 6595 CA LYS B 216 3.391 -5.177 19.923 1.00 24.36 C ATOM 6596 C LYS B 216 3.730 -4.231 18.766 1.00 22.55 C ATOM 6597 O LYS B 216 4.105 -3.082 18.996 1.00 21.47 O ATOM 6598 CB LYS B 216 4.551 -6.156 20.150 1.00 26.77 C ATOM 6599 CG LYS B 216 5.859 -5.470 20.500 1.00 30.94 C ATOM 6600 CD LYS B 216 5.701 -4.569 21.723 1.00 33.69 C ATOM 6601 CE LYS B 216 7.005 -3.974 22.190 1.00 36.66 C ATOM 6602 NZ LYS B 216 7.791 -4.987 22.941 1.00 40.21 N ATOM 6603 HA LYS B 216 3.251 -4.564 20.813 1.00 0.00 H ATOM 6604 HB2 LYS B 216 4.283 -6.827 20.966 1.00 0.00 H ATOM 6605 HB3 LYS B 216 4.698 -6.736 19.239 1.00 0.00 H ATOM 6606 HG2 LYS B 216 6.613 -6.228 20.712 1.00 0.00 H ATOM 6607 HG3 LYS B 216 6.182 -4.866 19.652 1.00 0.00 H ATOM 6608 HD2 LYS B 216 5.019 -3.757 21.471 1.00 0.00 H ATOM 6609 HD3 LYS B 216 5.277 -5.158 22.536 1.00 0.00 H ATOM 6610 HE2 LYS B 216 6.801 -3.123 22.839 1.00 0.00 H ATOM 6611 HE3 LYS B 216 7.579 -3.641 21.326 1.00 0.00 H ATOM 6612 HZ1 LYS B 216 7.245 -5.304 23.768 1.00 0.00 H ATOM 6613 HZ2 LYS B 216 7.989 -5.799 22.322 1.00 0.00 H ATOM 6614 HZ3 LYS B 216 8.687 -4.564 23.257 1.00 0.00 H ATOM 6615 H LYS B 216 2.140 -6.927 19.617 1.00 0.00 H ATOM 6616 N GLN B 217 3.615 -4.724 17.536 1.00 23.56 N ATOM 6617 CA GLN B 217 3.901 -3.913 16.340 1.00 24.33 C ATOM 6618 C GLN B 217 2.947 -2.727 16.197 1.00 22.43 C ATOM 6619 O GLN B 217 3.386 -1.609 15.977 1.00 21.70 O ATOM 6620 CB GLN B 217 3.886 -4.782 15.059 1.00 26.74 C ATOM 6621 CG GLN B 217 5.019 -5.810 14.985 1.00 28.48 C ATOM 6622 CD GLN B 217 6.375 -5.157 15.224 1.00 31.12 C ATOM 6623 OE1 GLN B 217 7.041 -5.435 16.219 1.00 33.35 O ATOM 6624 NE2 GLN B 217 6.740 -4.223 14.365 1.00 30.27 N ATOM 6625 HA GLN B 217 4.903 -3.506 16.472 1.00 0.00 H ATOM 6626 HB2 GLN B 217 2.936 -5.316 15.019 1.00 0.00 H ATOM 6627 HB3 GLN B 217 3.967 -4.121 14.196 1.00 0.00 H ATOM 6628 HG2 GLN B 217 4.855 -6.575 15.743 1.00 0.00 H ATOM 6629 HG3 GLN B 217 5.016 -6.272 13.998 1.00 0.00 H ATOM 6630 HE22 GLN B 217 6.147 -4.019 13.535 1.00 0.00 H ATOM 6631 HE21 GLN B 217 7.621 -3.691 14.518 1.00 0.00 H ATOM 6632 H GLN B 217 3.314 -5.712 17.415 1.00 0.00 H ATOM 6633 N SER B 218 1.646 -2.955 16.360 1.00 22.57 N ATOM 6634 CA SER B 218 0.703 -1.830 16.344 1.00 22.05 C ATOM 6635 C SER B 218 0.981 -0.848 17.477 1.00 21.10 C ATOM 6636 O SER B 218 0.909 0.357 17.277 1.00 21.64 O ATOM 6637 CB SER B 218 -0.746 -2.321 16.376 1.00 22.94 C ATOM 6638 OG SER B 218 -0.926 -3.234 17.444 1.00 23.87 O ATOM 6639 HA SER B 218 0.851 -1.294 15.407 1.00 0.00 H ATOM 6640 HB2 SER B 218 -0.980 -2.817 15.434 1.00 0.00 H ATOM 6641 HB3 SER B 218 -1.413 -1.470 16.513 1.00 0.00 H ATOM 6642 HG SER B 218 -0.322 -4.009 17.320 1.00 0.00 H ATOM 6643 H SER B 218 1.299 -3.926 16.498 1.00 0.00 H ATOM 6644 N THR B 219 1.350 -1.352 18.653 1.00 23.25 N ATOM 6645 CA THR B 219 1.666 -0.483 19.798 1.00 22.89 C ATOM 6646 C THR B 219 2.895 0.383 19.491 1.00 22.67 C ATOM 6647 O THR B 219 2.862 1.596 19.693 1.00 20.21 O ATOM 6648 CB THR B 219 1.870 -1.308 21.095 1.00 23.57 C ATOM 6649 OG1 THR B 219 0.618 -1.896 21.491 1.00 22.86 O ATOM 6650 CG2 THR B 219 2.406 -0.429 22.218 1.00 24.21 C ATOM 6651 HA THR B 219 0.816 0.178 19.966 1.00 0.00 H ATOM 6652 HB THR B 219 2.599 -2.094 20.898 1.00 0.00 H ATOM 6653 HG1 THR B 219 0.291 -2.490 20.770 1.00 0.00 H ATOM 6654 HG23 THR B 219 3.354 0.013 21.911 1.00 0.00 H ATOM 6655 HG21 THR B 219 1.688 0.362 22.433 1.00 0.00 H ATOM 6656 HG22 THR B 219 2.558 -1.035 23.111 1.00 0.00 H ATOM 6657 H THR B 219 1.416 -2.384 18.765 1.00 0.00 H ATOM 6658 N LEU B 220 3.967 -0.226 18.973 1.00 23.63 N ATOM 6659 CA LEU B 220 5.152 0.554 18.566 1.00 25.14 C ATOM 6660 C LEU B 220 4.779 1.651 17.568 1.00 24.36 C ATOM 6661 O LEU B 220 5.150 2.815 17.727 1.00 23.89 O ATOM 6662 CB LEU B 220 6.217 -0.342 17.952 1.00 28.32 C ATOM 6663 CG LEU B 220 6.888 -1.266 18.960 1.00 31.56 C ATOM 6664 CD1 LEU B 220 7.455 -2.521 18.297 1.00 33.67 C ATOM 6665 CD2 LEU B 220 7.962 -0.499 19.730 1.00 32.63 C ATOM 6666 HA LEU B 220 5.553 1.016 19.468 1.00 0.00 H ATOM 6667 HB2 LEU B 220 5.750 -0.954 17.180 1.00 0.00 H ATOM 6668 HB3 LEU B 220 6.982 0.290 17.500 1.00 0.00 H ATOM 6669 HG LEU B 220 6.132 -1.609 19.666 1.00 0.00 H ATOM 6670 HD21 LEU B 220 8.709 -0.123 19.031 1.00 0.00 H ATOM 6671 HD22 LEU B 220 7.502 0.337 20.257 1.00 0.00 H ATOM 6672 HD23 LEU B 220 8.438 -1.166 20.449 1.00 0.00 H ATOM 6673 HD11 LEU B 220 6.648 -3.072 17.814 1.00 0.00 H ATOM 6674 HD12 LEU B 220 8.197 -2.233 17.552 1.00 0.00 H ATOM 6675 HD13 LEU B 220 7.924 -3.150 19.054 1.00 0.00 H ATOM 6676 H LEU B 220 3.966 -1.259 18.856 1.00 0.00 H ATOM 6677 N MET B 221 3.993 1.297 16.562 1.00 24.50 N ATOM 6678 CA MET B 221 3.575 2.285 15.555 1.00 23.74 C ATOM 6679 C MET B 221 2.767 3.427 16.174 1.00 23.92 C ATOM 6680 O MET B 221 3.021 4.599 15.889 1.00 24.36 O ATOM 6681 CB MET B 221 2.772 1.611 14.440 1.00 24.49 C ATOM 6682 CG MET B 221 3.599 1.230 13.220 1.00 25.75 C ATOM 6683 SD MET B 221 4.288 2.685 12.404 1.00 29.01 S ATOM 6684 CE MET B 221 2.814 3.590 11.935 1.00 28.16 C ATOM 6685 HA MET B 221 4.482 2.716 15.130 1.00 0.00 H ATOM 6686 HB2 MET B 221 2.320 0.705 14.843 1.00 0.00 H ATOM 6687 HB3 MET B 221 1.987 2.297 14.121 1.00 0.00 H ATOM 6688 HG2 MET B 221 2.963 0.696 12.514 1.00 0.00 H ATOM 6689 HG3 MET B 221 4.416 0.580 13.535 1.00 0.00 H ATOM 6690 HE1 MET B 221 2.208 2.975 11.269 1.00 0.00 H ATOM 6691 HE2 MET B 221 2.240 3.835 12.829 1.00 0.00 H ATOM 6692 HE3 MET B 221 3.101 4.509 11.423 1.00 0.00 H ATOM 6693 H MET B 221 3.669 0.312 16.483 1.00 0.00 H ATOM 6694 N VAL B 222 1.800 3.083 17.027 1.00 23.63 N ATOM 6695 CA VAL B 222 0.901 4.070 17.616 1.00 24.67 C ATOM 6696 C VAL B 222 1.641 4.998 18.576 1.00 24.72 C ATOM 6697 O VAL B 222 1.392 6.201 18.586 1.00 24.11 O ATOM 6698 CB VAL B 222 -0.281 3.389 18.339 1.00 25.80 C ATOM 6699 CG1 VAL B 222 -1.021 4.388 19.228 1.00 26.95 C ATOM 6700 CG2 VAL B 222 -1.210 2.734 17.318 1.00 25.43 C ATOM 6701 HA VAL B 222 0.505 4.671 16.798 1.00 0.00 H ATOM 6702 HB VAL B 222 0.103 2.605 18.992 1.00 0.00 H ATOM 6703 HG11 VAL B 222 -0.334 4.787 19.975 1.00 0.00 H ATOM 6704 HG12 VAL B 222 -1.406 5.203 18.615 1.00 0.00 H ATOM 6705 HG13 VAL B 222 -1.849 3.885 19.727 1.00 0.00 H ATOM 6706 HG21 VAL B 222 -1.594 3.494 16.638 1.00 0.00 H ATOM 6707 HG22 VAL B 222 -0.656 1.986 16.752 1.00 0.00 H ATOM 6708 HG23 VAL B 222 -2.040 2.256 17.838 1.00 0.00 H ATOM 6709 H VAL B 222 1.684 2.081 17.280 1.00 0.00 H ATOM 6710 N GLU B 223 2.536 4.444 19.389 1.00 26.42 N ATOM 6711 CA GLU B 223 3.404 5.253 20.261 1.00 26.33 C ATOM 6712 C GLU B 223 4.222 6.239 19.443 1.00 26.74 C ATOM 6713 O GLU B 223 4.282 7.423 19.750 1.00 25.24 O ATOM 6714 CB GLU B 223 4.352 4.362 21.061 1.00 26.73 C ATOM 6715 CG GLU B 223 5.336 5.121 21.944 1.00 26.98 C ATOM 6716 CD GLU B 223 5.736 4.307 23.157 1.00 27.58 C ATOM 6717 OE1 GLU B 223 5.392 3.113 23.199 1.00 28.11 O ATOM 6718 OE2 GLU B 223 6.371 4.858 24.072 1.00 29.00 O ATOM 6719 HA GLU B 223 2.759 5.801 20.948 1.00 0.00 H ATOM 6720 HB2 GLU B 223 3.753 3.712 21.699 1.00 0.00 H ATOM 6721 HB3 GLU B 223 4.923 3.754 20.359 1.00 0.00 H ATOM 6722 HG2 GLU B 223 6.228 5.352 21.362 1.00 0.00 H ATOM 6723 HG3 GLU B 223 4.870 6.049 22.277 1.00 0.00 H ATOM 6724 H GLU B 223 2.626 3.408 19.409 1.00 0.00 H ATOM 6725 N THR B 224 4.849 5.740 18.379 1.00 26.43 N ATOM 6726 CA THR B 224 5.636 6.615 17.479 1.00 27.69 C ATOM 6727 C THR B 224 4.746 7.678 16.817 1.00 26.38 C ATOM 6728 O THR B 224 5.066 8.864 16.781 1.00 25.33 O ATOM 6729 CB THR B 224 6.352 5.783 16.392 1.00 28.50 C ATOM 6730 OG1 THR B 224 6.979 4.640 16.997 1.00 29.12 O ATOM 6731 CG2 THR B 224 7.395 6.607 15.650 1.00 28.78 C ATOM 6732 HA THR B 224 6.385 7.121 18.089 1.00 0.00 H ATOM 6733 HB THR B 224 5.604 5.460 15.668 1.00 0.00 H ATOM 6734 HG1 THR B 224 6.290 4.083 17.439 1.00 0.00 H ATOM 6735 HG23 THR B 224 6.915 7.472 15.193 1.00 0.00 H ATOM 6736 HG21 THR B 224 8.158 6.942 16.352 1.00 0.00 H ATOM 6737 HG22 THR B 224 7.856 5.995 14.875 1.00 0.00 H ATOM 6738 H THR B 224 4.785 4.722 18.177 1.00 0.00 H ATOM 6739 N LEU B 225 3.592 7.251 16.321 1.00 27.41 N ATOM 6740 CA LEU B 225 2.695 8.150 15.610 1.00 26.88 C ATOM 6741 C LEU B 225 2.169 9.224 16.527 1.00 25.43 C ATOM 6742 O LEU B 225 1.991 10.361 16.105 1.00 25.32 O ATOM 6743 CB LEU B 225 1.535 7.359 14.977 1.00 27.63 C ATOM 6744 CG LEU B 225 0.377 8.155 14.377 1.00 26.84 C ATOM 6745 CD1 LEU B 225 0.847 8.978 13.173 1.00 27.57 C ATOM 6746 CD2 LEU B 225 -0.737 7.191 13.972 1.00 26.82 C ATOM 6747 HA LEU B 225 3.259 8.636 14.814 1.00 0.00 H ATOM 6748 HB2 LEU B 225 1.956 6.745 14.181 1.00 0.00 H ATOM 6749 HB3 LEU B 225 1.120 6.713 15.751 1.00 0.00 H ATOM 6750 HG LEU B 225 -0.003 8.852 15.123 1.00 0.00 H ATOM 6751 HD21 LEU B 225 -0.355 6.486 13.234 1.00 0.00 H ATOM 6752 HD22 LEU B 225 -1.082 6.647 14.851 1.00 0.00 H ATOM 6753 HD23 LEU B 225 -1.566 7.755 13.543 1.00 0.00 H ATOM 6754 HD11 LEU B 225 1.624 9.673 13.491 1.00 0.00 H ATOM 6755 HD12 LEU B 225 1.246 8.309 12.411 1.00 0.00 H ATOM 6756 HD13 LEU B 225 0.004 9.535 12.764 1.00 0.00 H ATOM 6757 H LEU B 225 3.323 6.254 16.443 1.00 0.00 H ATOM 6758 N VAL B 226 1.892 8.859 17.778 1.00 26.67 N ATOM 6759 CA VAL B 226 1.404 9.826 18.761 1.00 26.88 C ATOM 6760 C VAL B 226 2.403 10.977 18.956 1.00 27.93 C ATOM 6761 O VAL B 226 1.996 12.137 19.030 1.00 27.43 O ATOM 6762 CB VAL B 226 1.061 9.160 20.125 1.00 27.30 C ATOM 6763 CG1 VAL B 226 0.993 10.188 21.245 1.00 27.51 C ATOM 6764 CG2 VAL B 226 -0.273 8.417 20.023 1.00 27.09 C ATOM 6765 HA VAL B 226 0.478 10.238 18.359 1.00 0.00 H ATOM 6766 HB VAL B 226 1.857 8.454 20.362 1.00 0.00 H ATOM 6767 HG11 VAL B 226 1.957 10.688 21.337 1.00 0.00 H ATOM 6768 HG12 VAL B 226 0.222 10.923 21.015 1.00 0.00 H ATOM 6769 HG13 VAL B 226 0.751 9.687 22.182 1.00 0.00 H ATOM 6770 HG21 VAL B 226 -1.061 9.122 19.759 1.00 0.00 H ATOM 6771 HG22 VAL B 226 -0.201 7.647 19.255 1.00 0.00 H ATOM 6772 HG23 VAL B 226 -0.504 7.954 20.983 1.00 0.00 H ATOM 6773 H VAL B 226 2.025 7.867 18.061 1.00 0.00 H ATOM 6774 N GLN B 227 3.687 10.647 19.043 1.00 31.66 N ATOM 6775 CA GLN B 227 4.734 11.661 19.231 1.00 36.14 C ATOM 6776 C GLN B 227 4.940 12.493 17.971 1.00 35.16 C ATOM 6777 O GLN B 227 5.107 13.709 18.055 1.00 35.70 O ATOM 6778 CB GLN B 227 6.049 11.014 19.676 1.00 40.61 C ATOM 6779 CG GLN B 227 5.954 10.372 21.047 1.00 45.79 C ATOM 6780 CD GLN B 227 5.407 11.321 22.106 1.00 51.01 C ATOM 6781 OE1 GLN B 227 4.316 11.119 22.663 1.00 50.51 O ATOM 6782 NE2 GLN B 227 6.156 12.387 22.369 1.00 55.64 N ATOM 6783 HA GLN B 227 4.400 12.334 20.020 1.00 0.00 H ATOM 6784 HB2 GLN B 227 6.324 10.248 18.951 1.00 0.00 H ATOM 6785 HB3 GLN B 227 6.823 11.781 19.703 1.00 0.00 H ATOM 6786 HG2 GLN B 227 5.296 9.506 20.982 1.00 0.00 H ATOM 6787 HG3 GLN B 227 6.950 10.048 21.350 1.00 0.00 H ATOM 6788 HE22 GLN B 227 7.064 12.518 21.879 1.00 0.00 H ATOM 6789 HE21 GLN B 227 5.834 13.090 23.064 1.00 0.00 H ATOM 6790 H GLN B 227 3.958 9.645 18.976 1.00 0.00 H ATOM 6791 N LYS B 228 4.890 11.847 16.811 1.00 34.43 N ATOM 6792 CA LYS B 228 4.945 12.571 15.540 1.00 35.94 C ATOM 6793 C LYS B 228 3.835 13.609 15.416 1.00 37.58 C ATOM 6794 O LYS B 228 4.074 14.718 14.970 1.00 36.20 O ATOM 6795 CB LYS B 228 4.868 11.599 14.374 1.00 37.24 C ATOM 6796 CG LYS B 228 5.107 12.244 13.020 1.00 37.72 C ATOM 6797 CD LYS B 228 5.663 11.260 12.007 1.00 38.39 C ATOM 6798 CE LYS B 228 7.058 10.770 12.384 1.00 39.83 C ATOM 6799 NZ LYS B 228 8.006 11.899 12.639 1.00 40.60 N ATOM 6800 HA LYS B 228 5.898 13.100 15.517 1.00 0.00 H ATOM 6801 HB2 LYS B 228 5.619 10.824 14.523 1.00 0.00 H ATOM 6802 HB3 LYS B 228 3.877 11.146 14.369 1.00 0.00 H ATOM 6803 HG2 LYS B 228 4.162 12.637 12.646 1.00 0.00 H ATOM 6804 HG3 LYS B 228 5.817 13.062 13.141 1.00 0.00 H ATOM 6805 HD2 LYS B 228 4.994 10.402 11.947 1.00 0.00 H ATOM 6806 HD3 LYS B 228 5.713 11.749 11.034 1.00 0.00 H ATOM 6807 HE2 LYS B 228 7.448 10.161 11.568 1.00 0.00 H ATOM 6808 HE3 LYS B 228 6.985 10.163 13.286 1.00 0.00 H ATOM 6809 HZ1 LYS B 228 8.089 12.481 11.781 1.00 0.00 H ATOM 6810 HZ2 LYS B 228 7.646 12.482 13.421 1.00 0.00 H ATOM 6811 HZ3 LYS B 228 8.939 11.516 12.891 1.00 0.00 H ATOM 6812 H LYS B 228 4.810 10.810 16.806 1.00 0.00 H ATOM 6813 N LEU B 229 2.619 13.237 15.809 1.00 38.17 N ATOM 6814 CA LEU B 229 1.491 14.157 15.793 1.00 38.46 C ATOM 6815 C LEU B 229 1.639 15.251 16.850 1.00 39.67 C ATOM 6816 O LEU B 229 1.124 16.351 16.668 1.00 39.68 O ATOM 6817 CB LEU B 229 0.167 13.399 16.003 1.00 37.98 C ATOM 6818 CG LEU B 229 -0.237 12.437 14.879 1.00 38.74 C ATOM 6819 CD1 LEU B 229 -1.450 11.589 15.255 1.00 37.59 C ATOM 6820 CD2 LEU B 229 -0.485 13.203 13.584 1.00 38.33 C ATOM 6821 HA LEU B 229 1.477 14.634 14.813 1.00 0.00 H ATOM 6822 HB2 LEU B 229 0.255 12.821 16.923 1.00 0.00 H ATOM 6823 HB3 LEU B 229 -0.627 14.137 16.113 1.00 0.00 H ATOM 6824 HG LEU B 229 0.594 11.749 14.723 1.00 0.00 H ATOM 6825 HD21 LEU B 229 -1.287 13.925 13.738 1.00 0.00 H ATOM 6826 HD22 LEU B 229 0.426 13.726 13.293 1.00 0.00 H ATOM 6827 HD23 LEU B 229 -0.771 12.503 12.798 1.00 0.00 H ATOM 6828 HD11 LEU B 229 -1.218 10.998 16.141 1.00 0.00 H ATOM 6829 HD12 LEU B 229 -2.297 12.242 15.464 1.00 0.00 H ATOM 6830 HD13 LEU B 229 -1.697 10.924 14.427 1.00 0.00 H ATOM 6831 H LEU B 229 2.470 12.261 16.137 1.00 0.00 H ATOM 6832 N ALA B 230 2.319 14.944 17.955 1.00 40.49 N ATOM 6833 CA ALA B 230 2.452 15.883 19.075 1.00 43.83 C ATOM 6834 C ALA B 230 3.279 17.115 18.701 1.00 44.95 C ATOM 6835 O ALA B 230 4.476 16.999 18.431 1.00 48.95 O ATOM 6836 CB ALA B 230 3.083 15.184 20.274 1.00 44.01 C ATOM 6837 HA ALA B 230 1.449 16.224 19.332 1.00 0.00 H ATOM 6838 HB1 ALA B 230 2.452 14.349 20.580 1.00 0.00 H ATOM 6839 HB2 ALA B 230 4.070 14.813 19.999 1.00 0.00 H ATOM 6840 HB3 ALA B 230 3.176 15.892 21.098 1.00 0.00 H ATOM 6841 H ALA B 230 2.770 14.009 18.025 1.00 0.00 H TER 6842 ALA B 230 HETATM 6843 O HOH 1 -25.507 1.755 10.349 1.00 13.14 O HETATM 6844 O HOH 2 -31.102 -7.887 8.509 1.00 14.76 O HETATM 6845 O HOH 3 -27.055 4.415 7.963 1.00 21.26 O HETATM 6846 O HOH 4 -23.813 -0.575 10.390 1.00 15.01 O HETATM 6847 O HOH 5 -42.776 -8.863 0.902 1.00 14.06 O HETATM 6848 O HOH 6 -38.466 -12.193 -4.019 1.00 31.05 O HETATM 6849 O HOH 7 -26.642 -11.999 19.094 1.00 18.37 O HETATM 6850 O HOH 8 -36.349 0.192 10.744 1.00 15.30 O HETATM 6851 O HOH 9 -27.359 -16.184 18.511 1.00 22.06 O HETATM 6852 O HOH 10 -36.906 -17.797 10.923 1.00 27.61 O HETATM 6853 O HOH 11 -36.644 1.597 13.226 1.00 20.01 O HETATM 6854 O HOH 12 -29.840 6.049 7.399 1.00 17.99 O HETATM 6855 O HOH 13 -18.606 -7.620 21.829 1.00 20.41 O HETATM 6856 O HOH 14 -33.133 -6.336 25.434 1.00 23.90 O HETATM 6857 O HOH 15 -27.543 -13.908 7.845 1.00 22.62 O HETATM 6858 O HOH 16 -20.625 -16.148 16.799 1.00 18.65 O HETATM 6859 O HOH 17 -19.133 -6.093 23.966 1.00 38.12 O HETATM 6860 O HOH 18 -35.164 8.512 6.956 1.00 36.66 O HETATM 6861 O HOH 19 -39.497 -16.692 18.480 1.00 25.83 O HETATM 6862 O HOH 20 -24.852 -10.722 30.102 1.00 30.84 O HETATM 6863 O HOH 21 -25.162 -8.659 7.220 1.00 23.78 O HETATM 6864 O HOH 22 -49.521 -9.419 3.962 1.00 34.93 O HETATM 6865 O HOH 23 -51.629 -3.925 13.413 1.00 28.14 O HETATM 6866 O HOH 24 -44.953 3.547 2.338 1.00 27.47 O HETATM 6867 O HOH 25 -28.077 -16.347 9.639 1.00 22.75 O HETATM 6868 O HOH 26 -43.685 5.907 2.198 1.00 46.18 O HETATM 6869 O HOH 27 -46.997 -14.665 19.610 1.00 34.03 O HETATM 6870 O HOH 28 -38.900 18.582 27.547 1.00 48.21 O HETATM 6871 O HOH 29 -28.766 -13.800 5.604 1.00 32.08 O HETATM 6872 O HOH 30 -44.143 7.702 13.750 1.00 25.13 O HETATM 6873 O HOH 31 -24.127 -11.103 20.815 1.00 25.52 O HETATM 6874 O HOH 32 -44.943 7.487 7.342 1.00 41.54 O HETATM 6875 O HOH 33 -16.505 -13.781 25.714 1.00 33.97 O HETATM 6876 O HOH 34 -26.641 -16.239 26.148 1.00 25.83 O HETATM 6877 O HOH 35 -42.167 -17.142 19.046 1.00 37.77 O HETATM 6878 O HOH 36 -33.227 8.406 9.092 1.00 32.63 O HETATM 6879 O HOH 37 -50.027 -8.586 29.417 1.00 42.19 O HETATM 6880 O HOH 38 -27.301 -19.708 17.657 1.00 35.72 O HETATM 6881 O HOH 39 -15.634 -8.155 23.321 1.00 25.22 O HETATM 6882 O HOH 40 -44.934 -8.814 -0.856 1.00 37.69 O HETATM 6883 O HOH 41 -45.583 9.960 6.189 1.00 53.99 O HETATM 6884 O HOH 42 -37.277 -4.910 -8.855 1.00 39.75 O HETATM 6885 O HOH 43 -29.965 -19.812 16.922 1.00 48.76 O HETATM 6886 O HOH 44 -31.006 9.897 9.770 1.00 36.58 O HETATM 6887 O HOH 45 -31.719 -4.287 28.600 1.00 31.28 O HETATM 6888 O HOH 46 -33.907 -7.582 23.284 1.00 31.59 O HETATM 6889 O HOH 47 -42.889 3.593 13.389 1.00 26.61 O HETATM 6890 O HOH 48 -34.220 -5.143 28.554 1.00 28.05 O HETATM 6891 O HOH 49 -49.294 11.768 13.664 1.00 33.19 O HETATM 6892 O HOH 50 -42.497 -18.908 4.130 1.00 40.85 O HETATM 6893 O HOH 51 -53.043 -6.129 13.273 1.00 37.76 O HETATM 6894 O HOH 52 -30.800 -5.322 26.026 1.00 30.25 O HETATM 6895 O HOH 53 -14.715 -11.349 26.178 1.00 40.50 O HETATM 6896 O HOH 54 -26.196 -10.813 6.064 1.00 30.19 O HETATM 6897 O HOH 55 -38.102 -12.167 27.308 1.00 33.45 O HETATM 6898 O HOH 56 -33.841 -7.842 -3.438 1.00 47.17 O HETATM 6899 O HOH 57 -47.555 6.332 7.972 1.00 29.44 O HETATM 6900 O HOH 58 -23.095 -6.880 10.457 1.00 27.34 O HETATM 6901 O HOH 59 -36.341 -19.243 3.208 1.00 36.96 O HETATM 6902 O HOH 60 -52.752 2.238 9.370 1.00 41.49 O HETATM 6903 O HOH 61 -26.153 6.972 9.294 1.00 16.26 O HETATM 6904 O HOH 62 -30.507 -6.080 30.018 1.00 37.65 O HETATM 6905 O HOH 63 -41.059 -14.921 4.978 1.00 34.29 O HETATM 6906 O HOH 64 -16.878 -6.100 25.942 1.00 35.48 O HETATM 6907 O HOH 65 -34.371 -19.693 16.419 1.00 39.95 O HETATM 6908 O HOH 66 -32.094 -11.744 0.806 1.00 15.64 O HETATM 6909 O HOH 67 -20.130 -5.518 18.815 1.00 14.46 O HETATM 6910 O HOH 68 -30.527 -5.830 -0.149 1.00 15.51 O HETATM 6911 O HOH 69 -21.887 -5.760 16.517 1.00 13.04 O HETATM 6912 O HOH 70 -25.453 -2.025 0.420 1.00 12.11 O HETATM 6913 O HOH 71 -9.353 -5.956 16.905 1.00 15.85 O HETATM 6914 O HOH 72 -14.773 8.952 9.035 1.00 19.80 O HETATM 6915 O HOH 73 -19.245 0.732 3.846 1.00 15.92 O HETATM 6916 O HOH 74 -21.511 2.724 4.191 1.00 13.83 O HETATM 6917 O HOH 75 -15.075 -9.190 9.462 1.00 22.21 O HETATM 6918 O HOH 76 4.391 7.957 29.105 1.00 27.53 O HETATM 6919 O HOH 77 -18.759 -0.334 -0.171 1.00 19.91 O HETATM 6920 O HOH 78 -8.848 -3.367 17.814 1.00 19.78 O HETATM 6921 O HOH 79 -13.581 11.296 9.942 1.00 25.12 O HETATM 6922 O HOH 80 -2.676 -3.096 19.378 1.00 20.70 O HETATM 6923 O HOH 81 -18.915 -10.757 3.880 1.00 25.97 O HETATM 6924 O HOH 82 -1.201 -1.872 23.448 1.00 20.74 O HETATM 6925 O HOH 83 -31.223 6.905 2.407 1.00 27.10 O HETATM 6926 O HOH 84 -10.947 10.908 8.701 1.00 28.33 O HETATM 6927 O HOH 85 3.884 -1.427 27.743 1.00 34.64 O HETATM 6928 O HOH 86 -27.339 -8.584 -2.994 1.00 36.94 O HETATM 6929 O HOH 87 -12.385 7.727 8.000 1.00 26.49 O HETATM 6930 O HOH 88 1.057 -5.199 29.416 1.00 34.96 O HETATM 6931 O HOH 89 -5.721 15.503 10.895 1.00 43.85 O HETATM 6932 O HOH 90 -10.708 13.922 8.233 1.00 34.80 O HETATM 6933 O HOH 91 -14.030 15.683 19.274 1.00 35.15 O HETATM 6934 O HOH 92 7.355 -5.146 9.336 1.00 30.85 O HETATM 6935 O HOH 93 -6.750 -0.917 -1.331 1.00 25.72 O HETATM 6936 O HOH 94 -0.459 -14.184 20.867 1.00 30.50 O HETATM 6937 O HOH 95 -0.468 -8.147 24.183 1.00 36.44 O HETATM 6938 O HOH 96 -25.069 2.869 -6.229 1.00 40.76 O HETATM 6939 O HOH 97 -3.566 -13.156 2.484 1.00 32.99 O HETATM 6940 O HOH 98 -19.173 -2.252 -3.285 1.00 37.20 O HETATM 6941 O HOH 99 -14.236 -1.818 -3.168 1.00 46.04 O HETATM 6942 O HOH 100 -3.115 -7.264 30.162 1.00 39.07 O HETATM 6943 O HOH 101 -10.218 9.323 38.518 1.00 33.42 O HETATM 6944 O HOH 102 -9.439 -8.609 -0.896 1.00 25.73 O HETATM 6945 O HOH 103 -15.764 -17.444 12.779 1.00 29.12 O HETATM 6946 O HOH 104 -20.993 -10.456 9.190 1.00 28.97 O HETATM 6947 O HOH 105 1.628 -7.658 29.004 1.00 47.50 O HETATM 6948 O HOH 106 -8.494 13.614 4.312 1.00 49.83 O HETATM 6949 O HOH 107 12.450 -0.832 13.791 1.00 24.10 O HETATM 6950 O HOH 108 -7.777 9.039 1.978 1.00 36.60 O HETATM 6951 O HOH 109 -9.126 6.259 37.929 1.00 36.02 O HETATM 6952 O HOH 110 5.913 -0.831 22.960 1.00 44.50 O HETATM 6953 O HOH 111 -22.578 11.864 4.427 1.00 40.62 O HETATM 6954 O HOH 112 15.534 -3.310 5.137 1.00 53.79 O HETATM 6955 O HOH 113 -15.473 9.697 3.380 1.00 35.65 O HETATM 6956 O HOH 114 -2.295 -13.460 23.072 1.00 53.46 O HETATM 6957 O HOH 115 -0.914 16.686 24.338 1.00 34.22 O HETATM 6958 O HOH 116 -21.954 -2.880 -5.626 1.00 36.93 O HETATM 6959 O HOH 117 3.971 8.225 22.266 1.00 35.23 O HETATM 6960 O HOH 118 -12.204 -19.023 0.673 1.00 38.49 O HETATM 6961 O HOH 119 -5.678 -14.505 2.327 1.00 43.51 O HETATM 6962 O HOH 120 -8.729 6.836 -2.550 1.00 50.75 O HETATM 6963 O HOH 121 -6.460 16.178 6.722 1.00 38.27 O HETATM 6964 O HOH 122 -1.825 -19.805 6.820 1.00 42.64 O HETATM 6965 O HOH 123 -17.874 -1.925 31.502 1.00 32.95 O HETATM 6966 O HOH 124 -4.045 -17.569 8.908 1.00 32.83 O HETATM 6967 O HOH 125 -15.379 10.043 6.312 1.00 45.72 O HETATM 6968 O HOH 126 -14.535 13.479 9.252 1.00 41.55 O HETATM 6969 O HOH 127 -0.093 6.305 35.429 1.00 28.77 O HETATM 6970 O HOH 128 -20.398 6.968 -1.807 1.00 35.71 O HETATM 6971 O HOH 129 9.727 1.634 5.693 1.00 41.09 O HETATM 6972 O HOH 130 -22.919 -11.595 6.231 1.00 30.09 O HETATM 6973 O HOH 131 -7.220 12.384 27.916 1.00 40.24 O HETATM 6974 O HOH 132 8.877 13.302 15.342 1.00 49.60 O HETATM 6975 O HOH 133 -19.363 -11.765 6.694 1.00 10.50 O HETATM 6976 O HOH 134 -17.400 6.614 -1.191 1.00 35.28 O HETATM 6977 O HOH 135 -11.747 5.373 7.157 1.00 27.01 O HETATM 6978 O HOH 136 -11.126 -1.355 17.857 1.00 31.54 O HETATM 6979 O HOH 137 3.992 11.794 30.133 1.00 32.25 O HETATM 6980 O HOH 138 9.835 -3.978 14.920 1.00 31.46 O HETATM 6981 O HOH 139 -10.735 -8.041 26.137 1.00 31.23 O HETATM 6982 O HOH 140 10.501 -1.520 15.502 1.00 39.42 O HETATM 6983 O HOH 141 -17.510 3.477 -4.540 1.00 35.42 O HETATM 6984 O HOH 142 -32.815 4.753 -1.049 1.00 36.86 O HETATM 6985 O HOH 143 -1.152 -4.637 23.933 1.00 39.62 O HETATM 6986 O HOH 144 -9.894 12.630 28.060 1.00 36.57 O HETATM 6987 O HOH 145 -19.744 -0.309 31.787 1.00 35.65 O HETATM 6988 O HOH 146 -10.800 -17.335 -1.136 1.00 18.93 O HETATM 6989 O HOH 147 -18.129 -9.274 1.280 1.00 32.99 O HETATM 6990 O HOH 148 -22.013 -11.497 -2.495 1.00 48.20 O HETATM 6991 O HOH 149 -1.485 -18.735 9.145 1.00 41.01 O HETATM 6992 O HOH 150 -21.583 15.933 20.767 1.00 42.15 O HETATM 6993 O HOH 151 -12.346 -6.078 25.179 1.00 33.59 O HETATM 6994 O HOH 152 -12.536 15.409 9.755 1.00 41.63 O HETATM 6995 O HOH 153 -2.360 -15.148 2.045 1.00 44.68 O HETATM 6996 O HOH 154 -12.220 -3.175 35.231 1.00 40.77 O HETATM 6997 O HOH 155 -14.098 -5.278 26.877 1.00 40.09 O HETATM 6998 O HOH 156 -8.434 2.096 -1.151 1.00 43.86 O HETATM 6999 O HOH 157 -3.488 -8.853 28.133 1.00 37.22 O HETATM 7000 O HOH 158 -21.698 -10.513 4.034 1.00 40.73 O HETATM 7001 O HOH 159 -16.442 15.583 18.797 1.00 39.17 O HETATM 7002 O HOH 160 -12.187 -3.386 -3.672 1.00 30.33 O HETATM 7003 O HOH 161 0.676 0.664 0.069 1.00 41.71 O HETATM 7004 C2 BIG A 162 -34.301 -6.145 6.796 1.00 0.04 C HETATM 7005 N3 BIG A 162 -34.865 -5.121 7.496 1.00 -0.31 N HETATM 7006 C4 BIG A 162 -36.145 -4.793 7.217 1.00 0.05 C HETATM 7007 C5 BIG A 162 -36.927 -5.514 6.227 1.00 0.13 C HETATM 7008 N7 BIG A 162 -38.154 -4.961 6.204 1.00 -0.28 N HETATM 7009 C8 BIG A 162 -38.239 -3.955 7.105 1.00 0.03 C HETATM 7010 C9 BIG A 162 -37.060 -3.782 7.800 1.00 0.02 C HETATM 7011 C10 BIG A 162 -36.841 -2.742 8.881 1.00 -0.01 C HETATM 7012 N1' BIG A 162 -35.979 -1.599 8.551 1.00 0.24 N HETATM 7013 C1' BIG A 162 -36.345 -0.862 7.334 1.00 -0.02 C HETATM 7014 C4' BIG A 162 -35.050 -0.282 6.757 1.00 0.04 C HETATM 7015 C3' BIG A 162 -34.016 -0.593 7.813 1.00 0.10 C HETATM 7016 O3' BIG A 162 -33.922 0.506 8.714 1.00 -0.39 O HETATM 7017 H3 BIG A 162 -33.272 0.314 9.380 1.00 0.21 H HETATM 7018 C2' BIG A 162 -34.531 -1.875 8.454 1.00 -0.00 C HETATM 7019 H20 BIG A 162 -34.086 -2.034 9.447 1.00 0.08 H HETATM 7020 H21 BIG A 162 -34.331 -2.750 7.818 1.00 0.08 H HETATM 7021 H4 BIG A 162 -33.029 -0.769 7.359 1.00 0.07 H HETATM 7022 C5' BIG A 162 -34.777 -0.971 5.426 1.00 0.00 C HETATM 7023 S5' BIG A 162 -33.445 -0.324 4.457 1.00 -0.16 S HETATM 7024 C20 BIG A 162 -34.367 0.833 3.468 1.00 -0.01 C HETATM 7025 C21 BIG A 162 -33.476 1.522 2.438 1.00 -0.04 C HETATM 7026 C22 BIG A 162 -33.978 2.917 2.023 1.00 -0.06 C HETATM 7027 C23 BIG A 162 -35.326 2.858 1.378 1.00 -0.07 C HETATM 7028 H14 BIG A 162 -35.644 3.873 1.099 1.00 0.02 H HETATM 7029 H15 BIG A 162 -36.052 2.428 2.084 1.00 0.02 H HETATM 7030 H16 BIG A 162 -35.274 2.229 0.477 1.00 0.02 H HETATM 7031 H12 BIG A 162 -33.263 3.355 1.311 1.00 0.03 H HETATM 7032 H13 BIG A 162 -34.040 3.553 2.918 1.00 0.03 H HETATM 7033 H10 BIG A 162 -33.428 0.888 1.540 1.00 0.03 H HETATM 7034 H11 BIG A 162 -32.468 1.628 2.866 1.00 0.03 H HETATM 7035 H8 BIG A 162 -34.807 1.596 4.127 1.00 0.04 H HETATM 7036 H9 BIG A 162 -35.170 0.294 2.943 1.00 0.04 H HETATM 7037 H6 BIG A 162 -35.693 -0.903 4.821 1.00 0.04 H HETATM 7038 H7 BIG A 162 -34.554 -2.027 5.637 1.00 0.04 H HETATM 7039 H5 BIG A 162 -35.127 0.804 6.602 1.00 0.04 H HETATM 7040 H17 BIG A 162 -36.812 -1.542 6.606 1.00 0.08 H HETATM 7041 H18 BIG A 162 -37.046 -0.051 7.580 1.00 0.08 H HETATM 7042 H19 BIG A 162 -36.096 -0.960 9.321 1.00 0.20 H HETATM 7043 H22 BIG A 162 -37.827 -2.343 9.160 1.00 0.09 H HETATM 7044 H23 BIG A 162 -36.395 -3.254 9.746 1.00 0.09 H HETATM 7045 H2 BIG A 162 -39.133 -3.353 7.263 1.00 0.09 H HETATM 7046 H24 BIG A 162 -38.922 -5.262 5.586 1.00 0.23 H HETATM 7047 C6 BIG A 162 -36.268 -6.605 5.526 1.00 0.15 C HETATM 7048 N6 BIG A 162 -36.957 -7.287 4.572 1.00 -0.32 N HETATM 7049 H25 BIG A 162 -36.506 -8.062 4.066 1.00 0.18 H HETATM 7050 H26 BIG A 162 -37.930 -7.028 4.356 1.00 0.18 H HETATM 7051 N1 BIG A 162 -34.951 -6.855 5.834 1.00 -0.27 N HETATM 7052 H1 BIG A 162 -33.274 -6.410 7.019 1.00 0.10 H CONECT 1 2 17 18 19 CONECT 17 1 CONECT 18 1 CONECT 19 1 CONECT 3422 3423 3438 3439 3440 CONECT 3438 3422 CONECT 3439 3422 CONECT 3440 3422 CONECT 7004 7005 7051 7052 CONECT 7005 7004 7006 CONECT 7006 7005 7007 7010 CONECT 7007 7006 7008 7047 CONECT 7008 7007 7009 7046 CONECT 7009 7008 7010 7045 CONECT 7010 7006 7009 7011 CONECT 7011 7010 7012 7043 7044 CONECT 7012 7011 7013 7018 7042 CONECT 7013 7012 7014 7040 7041 CONECT 7014 7013 7015 7022 7039 CONECT 7015 7014 7016 7018 7021 CONECT 7016 7015 7017 CONECT 7017 7016 CONECT 7018 7012 7015 7019 7020 CONECT 7019 7018 CONECT 7020 7018 CONECT 7021 7015 CONECT 7022 7014 7023 7037 7038 CONECT 7023 7022 7024 CONECT 7024 7023 7025 7035 7036 CONECT 7025 7024 7026 7033 7034 CONECT 7026 7025 7027 7031 7032 CONECT 7027 7026 7028 7029 7030 CONECT 7028 7027 CONECT 7029 7027 CONECT 7030 7027 CONECT 7031 7026 CONECT 7032 7026 CONECT 7033 7025 CONECT 7034 7025 CONECT 7035 7024 CONECT 7036 7024 CONECT 7037 7022 CONECT 7038 7022 CONECT 7039 7014 CONECT 7040 7013 CONECT 7041 7013 CONECT 7042 7012 CONECT 7043 7011 CONECT 7044 7011 CONECT 7045 7009 CONECT 7046 7008 CONECT 7047 7007 7048 7051 CONECT 7048 7047 7049 7050 CONECT 7049 7048 CONECT 7050 7048 CONECT 7051 7004 7047 CONECT 7052 7004 MASTER 0 0 0 0 0 0 0 0 7050 2 57 36 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 4f3c
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
1jys
RCSB PDB
PDBbind
242aa, >1JYS_1|Chains... at 92%
1nc1
RCSB PDB
PDBbind
242aa, >1NC1_1|Chains... at 92%
1nc3
RCSB PDB
PDBbind
242aa, >1NC3_1|Chains... at 92%
1y6q
RCSB PDB
PDBbind
242aa, >1Y6Q_1|Chains... at 92%
1y6r
RCSB PDB
PDBbind
242aa, >1Y6R_1|Chains... at 92%
4f2w
RCSB PDB
PDBbind
248aa, >4F2W_1|Chains... *
4f3k
RCSB PDB
PDBbind
248aa, >4F3K_1|Chains... at 100%
4wkc
RCSB PDB
PDBbind
245aa, >4WKC_1|Chain... at 90%
4yml
RCSB PDB
PDBbind
245aa, >4YML_1|Chain... at 90%
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
3dp9
RCSB PDB
PDBbind
BIG
4ffs
RCSB PDB
PDBbind
BIG
4wkc
RCSB PDB
PDBbind
BIG
6ayr
RCSB PDB
PDBbind
BIG
Entry Information
PDB ID
4f3c
Complex Type
Protein-Ligand
PDBbind Subset
refined set
Protein Name
5'-methylthioadenosine/S-adenosylhomocysteine nucleosidase
Ligand Name
BIG
EC.Number
E.C.3.2.2.9
Resolution
1.93(Å)
Affinity (Kd/Ki/IC50)
Ki=1.5pM
Release Year
2013
Protein/NA Sequence
Check fasta file
Primary Reference
(2013) Structure Vol. 21: pp. 963-974
Ligand Properties
Formula
C
1
6
H
2
6
N
5
OS
Molecular Weight
336.476
Exact Mass
336.186
No. of atoms
49
No. of bonds
51
Polar Surface Area
117.56
LOGP Value
1.22 (
Computed with XLOGP3
)
2.60 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 4
No. of Hydrogen Bond Acceptors: 3
No. of Rotatable Bonds: 8
No. of Nitrogen and Oxygen Atoms: 6
No. of Rings: 3
Canonical SMILES
CCCCSC[C@H]1C[N@H+](C[C@@H]1O)Cc1c[nH]c2c1ncnc2N
InChI String
InChI=1S/C16H25N5OS/c1-2-3-4-23-9-12-7-21(8-13(12)22)6-11-5-18-15-14(11)19-10-20-16(15)17/h5,10,12-13,18,22H,2-4,6-9H2,1H3,(H2,17,19,20)/p+1/t12-,13+/m1/s1
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
No matched UniProt accession number (AC) found!
Entrez Gene ID
No matched NCBI Entrez Gene ID found!
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com