Browse entries in the PDBbind-CN Database
HEADER 4HU1_COMPLEX COMPND 4HU1_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 B 260 ARG LEU SER TRP GLY TYR ARG GLU HIS ASN GLY PRO ILE SEQRES 2 B 260 HIS TRP LYS GLU PHE PHE PRO ILE ALA ASP GLY ASP GLN SEQRES 3 B 260 GLN SER PRO ILE GLU ILE LYS THR LYS GLU VAL LYS TYR SEQRES 4 B 260 ASP SER SER LEU ARG PRO LEU SER ILE LYS TYR ASP PRO SEQRES 5 B 260 SER SER ALA LYS ILE ILE SER ASN SER GLY HIS SER PHE SEQRES 6 B 260 ASN VAL ASP PHE ASP ASP THR GLU ASN LYS SER VAL LEU SEQRES 7 B 260 ARG GLY GLY PRO LEU THR GLY SER TYR ARG LEU ARG GLN SEQRES 8 B 260 VAL HIS LEU HIS TRP GLY SER ALA ASP ASP HIS GLY SER SEQRES 9 B 260 GLU HIS ILE VAL ASP GLY VAL SER TYR ALA ALA GLU LEU SEQRES 10 B 260 HIS VAL VAL HIS TRP ASN SER ASP LYS TYR PRO SER PHE SEQRES 11 B 260 VAL GLU ALA ALA HIS GLU PRO ASP GLY LEU ALA VAL LEU SEQRES 12 B 260 GLY VAL PHE LEU GLN ILE GLY GLU PRO ASN SER GLN LEU SEQRES 13 B 260 GLN LYS ILE THR ASP THR LEU ASP SER ILE LYS GLU LYS SEQRES 14 B 260 GLY LYS GLN THR ARG PHE THR ASN PHE ASP LEU LEU SER SEQRES 15 B 260 LEU LEU PRO PRO SER TRP ASP TYR TRP THR TYR PRO GLY SEQRES 16 B 260 SER LEU THR VAL PRO PRO LEU LEU GLU SER VAL THR TRP SEQRES 17 B 260 ILE VAL LEU LYS GLN PRO ILE ASN ILE SER SER GLN GLN SEQRES 18 B 260 LEU ALA LYS PHE ARG SER LEU LEU CYS THR ALA GLU GLY SEQRES 19 B 260 GLU ALA ALA ALA PHE LEU VAL SER ASN HIS ARG PRO PRO SEQRES 20 B 260 GLN PRO LEU LYS GLY ARG LYS VAL ARG ALA SER PHE HIS HET ZN A 1 1 HET V A 13 27 ATOM 1 N ARG B 4 -49.300 -46.398 22.982 1.00 42.61 N ATOM 2 CA ARG B 4 -50.137 -45.668 24.003 1.00 42.31 C ATOM 3 C ARG B 4 -49.818 -44.165 24.102 1.00 42.58 C ATOM 4 O ARG B 4 -48.646 -43.722 24.198 1.00 42.99 O ATOM 5 CB ARG B 4 -50.181 -46.344 25.385 1.00 42.78 C ATOM 6 CG ARG B 4 -48.993 -46.066 26.339 1.00 42.46 C ATOM 7 CD ARG B 4 -49.450 -45.655 27.794 1.00 47.06 C ATOM 8 NE ARG B 4 -49.621 -46.700 28.850 1.00 46.82 N ATOM 9 CZ ARG B 4 -48.667 -47.174 29.682 1.00 44.86 C ATOM 10 NH1 ARG B 4 -47.373 -46.763 29.624 1.00 34.60 N ATOM 11 NH2 ARG B 4 -49.023 -48.105 30.582 1.00 42.47 N ATOM 12 HA ARG B 4 -51.150 -45.741 23.609 1.00 0.00 H ATOM 13 HB2 ARG B 4 -51.090 -46.012 25.886 1.00 0.00 H ATOM 14 HB3 ARG B 4 -50.229 -47.421 25.224 1.00 0.00 H ATOM 15 HG2 ARG B 4 -48.385 -46.968 26.408 1.00 0.00 H ATOM 16 HG3 ARG B 4 -48.394 -45.256 25.921 1.00 0.00 H ATOM 17 HD2 ARG B 4 -50.411 -45.152 27.691 1.00 0.00 H ATOM 18 HD3 ARG B 4 -48.709 -44.948 28.168 1.00 0.00 H ATOM 19 HE ARG B 4 -50.573 -47.104 28.955 1.00 0.00 H ATOM 20 HH12 ARG B 4 -46.673 -47.156 30.285 1.00 0.00 H ATOM 21 HH11 ARG B 4 -47.083 -46.056 28.919 1.00 0.00 H ATOM 22 HH22 ARG B 4 -48.315 -48.492 31.238 1.00 0.00 H ATOM 23 HH21 ARG B 4 -50.007 -48.439 30.623 1.00 0.00 H ATOM 24 HN3 ARG B 4 -48.295 -46.309 23.233 1.00 0.00 H ATOM 25 HN2 ARG B 4 -49.462 -45.983 22.042 1.00 0.00 H ATOM 26 HN1 ARG B 4 -49.568 -47.403 22.970 1.00 0.00 H ATOM 27 N LEU B 5 -50.886 -43.383 24.076 1.00 41.03 N ATOM 28 CA LEU B 5 -50.779 -41.935 24.117 1.00 40.83 C ATOM 29 C LEU B 5 -50.704 -41.389 25.574 1.00 39.32 C ATOM 30 O LEU B 5 -50.576 -40.151 25.795 1.00 41.51 O ATOM 31 CB LEU B 5 -51.945 -41.318 23.330 1.00 41.03 C ATOM 32 CG LEU B 5 -51.854 -41.384 21.788 1.00 43.57 C ATOM 33 CD1 LEU B 5 -53.253 -41.362 21.104 1.00 45.77 C ATOM 34 CD2 LEU B 5 -51.004 -40.219 21.283 1.00 45.83 C ATOM 35 HA LEU B 5 -49.841 -41.642 23.645 1.00 0.00 H ATOM 36 HB2 LEU B 5 -52.856 -41.835 23.630 1.00 0.00 H ATOM 37 HB3 LEU B 5 -52.015 -40.268 23.612 1.00 0.00 H ATOM 38 HG LEU B 5 -51.389 -42.334 21.524 1.00 0.00 H ATOM 39 HD21 LEU B 5 -51.465 -39.278 21.582 1.00 0.00 H ATOM 40 HD22 LEU B 5 -50.004 -40.288 21.712 1.00 0.00 H ATOM 41 HD23 LEU B 5 -50.938 -40.263 20.196 1.00 0.00 H ATOM 42 HD11 LEU B 5 -53.835 -42.219 21.443 1.00 0.00 H ATOM 43 HD12 LEU B 5 -53.772 -40.441 21.370 1.00 0.00 H ATOM 44 HD13 LEU B 5 -53.128 -41.410 20.022 1.00 0.00 H ATOM 45 H LEU B 5 -51.829 -43.818 24.025 1.00 0.00 H ATOM 46 N SER B 6 -50.736 -42.304 26.546 1.00 35.60 N ATOM 47 CA SER B 6 -50.754 -41.935 27.965 1.00 33.03 C ATOM 48 C SER B 6 -49.535 -42.458 28.737 1.00 29.18 C ATOM 49 O SER B 6 -49.660 -42.818 29.872 1.00 29.65 O ATOM 50 CB SER B 6 -52.038 -42.461 28.631 1.00 33.96 C ATOM 51 OG SER B 6 -51.969 -43.877 28.812 1.00 34.65 O ATOM 52 HA SER B 6 -50.722 -40.846 28.002 1.00 0.00 H ATOM 53 HB2 SER B 6 -52.893 -42.222 27.999 1.00 0.00 H ATOM 54 HB3 SER B 6 -52.160 -41.981 29.602 1.00 0.00 H ATOM 55 HG SER B 6 -51.195 -44.097 29.389 1.00 0.00 H ATOM 56 H SER B 6 -50.749 -43.311 26.288 1.00 0.00 H ATOM 57 N TRP B 7 -48.366 -42.521 28.112 1.00 24.04 N ATOM 58 CA TRP B 7 -47.156 -42.859 28.832 1.00 21.07 C ATOM 59 C TRP B 7 -46.769 -41.647 29.721 1.00 18.85 C ATOM 60 O TRP B 7 -47.155 -40.531 29.452 1.00 19.98 O ATOM 61 CB TRP B 7 -46.061 -43.226 27.842 1.00 19.13 C ATOM 62 CG TRP B 7 -45.606 -42.018 27.049 1.00 16.75 C ATOM 63 CD1 TRP B 7 -46.061 -41.590 25.799 1.00 17.73 C ATOM 64 CD2 TRP B 7 -44.619 -41.075 27.470 1.00 16.72 C ATOM 65 NE1 TRP B 7 -45.383 -40.426 25.423 1.00 18.21 N ATOM 66 CE2 TRP B 7 -44.484 -40.100 26.414 1.00 17.09 C ATOM 67 CE3 TRP B 7 -43.777 -40.990 28.614 1.00 12.93 C ATOM 68 CZ2 TRP B 7 -43.554 -39.047 26.474 1.00 16.76 C ATOM 69 CZ3 TRP B 7 -42.819 -39.934 28.664 1.00 17.85 C ATOM 70 CH2 TRP B 7 -42.758 -38.963 27.614 1.00 16.88 C ATOM 71 HA TRP B 7 -47.306 -43.725 29.477 1.00 0.00 H ATOM 72 HB2 TRP B 7 -45.210 -43.633 28.388 1.00 0.00 H ATOM 73 HB3 TRP B 7 -46.443 -43.980 27.153 1.00 0.00 H ATOM 74 HE1 TRP B 7 -45.533 -39.895 24.541 1.00 0.00 H ATOM 75 HD1 TRP B 7 -46.828 -42.088 25.207 1.00 0.00 H ATOM 76 HZ2 TRP B 7 -43.460 -38.326 25.662 1.00 0.00 H ATOM 77 HH2 TRP B 7 -42.064 -38.128 27.710 1.00 0.00 H ATOM 78 HZ3 TRP B 7 -42.130 -39.866 29.506 1.00 0.00 H ATOM 79 HE3 TRP B 7 -43.861 -41.710 29.428 1.00 0.00 H ATOM 80 H TRP B 7 -48.318 -42.325 27.092 1.00 0.00 H ATOM 81 N GLY B 8 -46.023 -41.906 30.787 1.00 19.38 N ATOM 82 CA GLY B 8 -45.603 -40.854 31.730 1.00 17.53 C ATOM 83 C GLY B 8 -44.500 -41.403 32.605 1.00 17.08 C ATOM 84 O GLY B 8 -43.688 -42.271 32.180 1.00 16.83 O ATOM 85 HA3 GLY B 8 -46.449 -40.556 32.349 1.00 0.00 H ATOM 86 HA2 GLY B 8 -45.237 -39.989 31.177 1.00 0.00 H ATOM 87 H GLY B 8 -45.724 -42.886 30.964 1.00 0.00 H ATOM 88 N TYR B 9 -44.457 -40.882 33.825 1.00 16.18 N ATOM 89 CA TYR B 9 -43.474 -41.311 34.791 1.00 15.18 C ATOM 90 C TYR B 9 -44.139 -41.668 36.127 1.00 18.00 C ATOM 91 O TYR B 9 -43.443 -41.817 37.136 1.00 17.62 O ATOM 92 CB TYR B 9 -42.524 -40.131 35.026 1.00 14.37 C ATOM 93 CG TYR B 9 -41.686 -39.785 33.818 1.00 14.47 C ATOM 94 CD1 TYR B 9 -40.521 -40.486 33.533 1.00 11.66 C ATOM 95 CD2 TYR B 9 -42.085 -38.756 32.944 1.00 15.76 C ATOM 96 CE1 TYR B 9 -39.744 -40.151 32.369 1.00 15.03 C ATOM 97 CE2 TYR B 9 -41.311 -38.416 31.819 1.00 13.91 C ATOM 98 CZ TYR B 9 -40.149 -39.100 31.537 1.00 13.33 C ATOM 99 OH TYR B 9 -39.400 -38.696 30.420 1.00 15.49 O ATOM 100 HA TYR B 9 -42.952 -42.192 34.417 1.00 0.00 H ATOM 101 HB3 TYR B 9 -41.856 -40.384 35.849 1.00 0.00 H ATOM 102 HB2 TYR B 9 -43.118 -39.258 35.296 1.00 0.00 H ATOM 103 HD2 TYR B 9 -43.009 -38.213 33.142 1.00 0.00 H ATOM 104 HE2 TYR B 9 -41.633 -37.605 31.166 1.00 0.00 H ATOM 105 HE1 TYR B 9 -38.841 -40.715 32.135 1.00 0.00 H ATOM 106 HD1 TYR B 9 -40.195 -41.291 34.192 1.00 0.00 H ATOM 107 HH TYR B 9 -38.597 -39.270 30.337 1.00 0.00 H ATOM 108 H TYR B 9 -45.146 -40.149 34.090 1.00 0.00 H ATOM 109 N ARG B 10 -45.469 -41.794 36.126 1.00 19.87 N ATOM 110 CA ARG B 10 -46.214 -42.234 37.327 1.00 22.79 C ATOM 111 C ARG B 10 -46.120 -43.779 37.500 1.00 23.63 C ATOM 112 O ARG B 10 -45.480 -44.487 36.693 1.00 21.82 O ATOM 113 CB ARG B 10 -47.664 -41.711 37.272 1.00 23.18 C ATOM 114 CG ARG B 10 -47.736 -40.182 37.336 1.00 25.56 C ATOM 115 CD ARG B 10 -49.099 -39.645 36.953 1.00 31.94 C ATOM 116 NE ARG B 10 -50.089 -39.709 38.035 1.00 34.65 N ATOM 117 CZ ARG B 10 -51.370 -39.296 37.955 1.00 37.39 C ATOM 118 NH1 ARG B 10 -51.886 -38.744 36.851 1.00 35.75 N ATOM 119 NH2 ARG B 10 -52.151 -39.404 39.021 1.00 38.94 N ATOM 120 HA ARG B 10 -45.758 -41.803 38.218 1.00 0.00 H ATOM 121 HB2 ARG B 10 -48.122 -42.045 36.341 1.00 0.00 H ATOM 122 HB3 ARG B 10 -48.217 -42.123 38.116 1.00 0.00 H ATOM 123 HG2 ARG B 10 -47.509 -39.864 38.354 1.00 0.00 H ATOM 124 HG3 ARG B 10 -46.994 -39.769 36.653 1.00 0.00 H ATOM 125 HD2 ARG B 10 -49.473 -40.227 36.110 1.00 0.00 H ATOM 126 HD3 ARG B 10 -48.986 -38.603 36.652 1.00 0.00 H ATOM 127 HE ARG B 10 -49.775 -40.108 38.943 1.00 0.00 H ATOM 128 HH12 ARG B 10 -52.881 -38.441 36.837 1.00 0.00 H ATOM 129 HH11 ARG B 10 -51.292 -38.618 36.006 1.00 0.00 H ATOM 130 HH22 ARG B 10 -53.141 -39.090 38.974 1.00 0.00 H ATOM 131 HH21 ARG B 10 -51.773 -39.803 39.904 1.00 0.00 H ATOM 132 H ARG B 10 -45.996 -41.577 35.256 1.00 0.00 H ATOM 133 N GLU B 11 -46.722 -44.331 38.567 1.00 24.94 N ATOM 134 CA GLU B 11 -46.558 -45.795 38.808 1.00 25.49 C ATOM 135 C GLU B 11 -47.075 -46.677 37.626 1.00 24.42 C ATOM 136 O GLU B 11 -46.403 -47.639 37.200 1.00 24.36 O ATOM 137 CB GLU B 11 -47.117 -46.224 40.218 1.00 26.83 C ATOM 138 CG GLU B 11 -47.485 -47.705 40.368 1.00 32.47 C ATOM 139 CD GLU B 11 -46.305 -48.673 40.313 1.00 41.36 C ATOM 140 OE1 GLU B 11 -45.137 -48.238 40.462 1.00 44.39 O ATOM 141 OE2 GLU B 11 -46.564 -49.906 40.155 1.00 48.75 O ATOM 142 HA GLU B 11 -45.486 -45.989 38.839 1.00 0.00 H ATOM 143 HB2 GLU B 11 -46.357 -45.991 40.964 1.00 0.00 H ATOM 144 HB3 GLU B 11 -48.012 -45.635 40.416 1.00 0.00 H ATOM 145 HG2 GLU B 11 -47.984 -47.834 41.329 1.00 0.00 H ATOM 146 HG3 GLU B 11 -48.174 -47.965 39.564 1.00 0.00 H ATOM 147 H GLU B 11 -47.292 -43.749 39.213 1.00 0.00 H ATOM 148 N HIS B 12 -48.206 -46.320 37.045 1.00 24.51 N ATOM 149 CA HIS B 12 -48.812 -47.246 36.082 1.00 27.25 C ATOM 150 C HIS B 12 -48.470 -46.923 34.645 1.00 26.13 C ATOM 151 O HIS B 12 -48.681 -47.739 33.764 1.00 26.98 O ATOM 152 CB HIS B 12 -50.342 -47.421 36.323 1.00 28.74 C ATOM 153 CG HIS B 12 -50.629 -47.957 37.686 1.00 32.33 C ATOM 154 ND1 HIS B 12 -51.093 -47.162 38.713 1.00 36.99 N ATOM 155 CD2 HIS B 12 -50.370 -49.170 38.230 1.00 34.78 C ATOM 156 CE1 HIS B 12 -51.170 -47.883 39.819 1.00 37.23 C ATOM 157 NE2 HIS B 12 -50.720 -49.097 39.557 1.00 36.11 N ATOM 158 HA HIS B 12 -48.357 -48.219 36.267 1.00 0.00 H ATOM 159 HB2 HIS B 12 -50.830 -46.452 36.214 1.00 0.00 H ATOM 160 HB3 HIS B 12 -50.740 -48.112 35.580 1.00 0.00 H ATOM 161 HD2 HIS B 12 -49.962 -50.039 37.714 1.00 0.00 H ATOM 162 HE1 HIS B 12 -51.542 -47.535 40.783 1.00 0.00 H ATOM 163 H HIS B 12 -48.655 -45.408 37.264 1.00 0.00 H ATOM 164 N ASN B 13 -47.882 -45.754 34.412 1.00 25.02 N ATOM 165 CA ASN B 13 -47.457 -45.418 33.031 1.00 22.29 C ATOM 166 C ASN B 13 -45.933 -45.161 32.882 1.00 22.27 C ATOM 167 O ASN B 13 -45.521 -44.722 31.842 1.00 20.80 O ATOM 168 CB ASN B 13 -48.305 -44.228 32.510 1.00 21.32 C ATOM 169 CG ASN B 13 -48.048 -42.937 33.265 1.00 17.19 C ATOM 170 OD1 ASN B 13 -47.188 -42.893 34.097 1.00 18.93 O ATOM 171 ND2 ASN B 13 -48.756 -41.876 32.935 1.00 16.22 N ATOM 172 HA ASN B 13 -47.641 -46.295 32.411 1.00 0.00 H ATOM 173 HB2 ASN B 13 -48.069 -44.068 31.458 1.00 0.00 H ATOM 174 HB3 ASN B 13 -49.360 -44.484 32.609 1.00 0.00 H ATOM 175 HD22 ASN B 13 -49.496 -41.950 32.208 1.00 0.00 H ATOM 176 HD21 ASN B 13 -48.575 -40.964 33.402 1.00 0.00 H ATOM 177 H ASN B 13 -47.722 -45.082 35.189 1.00 0.00 H ATOM 178 N GLY B 14 -45.139 -45.414 33.928 1.00 19.65 N ATOM 179 CA GLY B 14 -43.733 -45.012 33.990 1.00 19.59 C ATOM 180 C GLY B 14 -42.824 -45.892 33.166 1.00 18.36 C ATOM 181 O GLY B 14 -43.272 -46.865 32.590 1.00 19.97 O ATOM 182 HA3 GLY B 14 -43.406 -45.053 35.029 1.00 0.00 H ATOM 183 HA2 GLY B 14 -43.649 -43.989 33.624 1.00 0.00 H ATOM 184 H GLY B 14 -45.542 -45.923 34.740 1.00 0.00 H ATOM 185 N PRO B 15 -41.510 -45.559 33.114 1.00 19.41 N ATOM 186 CA PRO B 15 -40.517 -46.252 32.307 1.00 17.97 C ATOM 187 C PRO B 15 -40.641 -47.762 32.231 1.00 20.38 C ATOM 188 O PRO B 15 -40.446 -48.309 31.143 1.00 17.83 O ATOM 189 CB PRO B 15 -39.183 -45.797 32.916 1.00 20.05 C ATOM 190 CG PRO B 15 -39.484 -44.317 33.219 1.00 16.75 C ATOM 191 CD PRO B 15 -40.914 -44.365 33.790 1.00 18.40 C ATOM 192 HA PRO B 15 -40.639 -45.992 31.256 1.00 0.00 H ATOM 193 HD3 PRO B 15 -40.899 -44.494 34.872 1.00 0.00 H ATOM 194 HD2 PRO B 15 -41.466 -43.458 33.541 1.00 0.00 H ATOM 195 HG3 PRO B 15 -39.444 -43.715 32.311 1.00 0.00 H ATOM 196 HG2 PRO B 15 -38.783 -43.916 33.951 1.00 0.00 H ATOM 197 HB2 PRO B 15 -38.948 -46.352 33.824 1.00 0.00 H ATOM 198 HB3 PRO B 15 -38.363 -45.901 32.206 1.00 0.00 H ATOM 199 N ILE B 16 -40.910 -48.440 33.355 1.00 20.70 N ATOM 200 CA ILE B 16 -40.943 -49.894 33.348 1.00 22.67 C ATOM 201 C ILE B 16 -42.055 -50.505 32.475 1.00 22.41 C ATOM 202 O ILE B 16 -41.948 -51.667 32.041 1.00 25.65 O ATOM 203 CB ILE B 16 -40.959 -50.472 34.827 1.00 23.58 C ATOM 204 CG1 ILE B 16 -40.590 -51.956 34.817 1.00 28.59 C ATOM 205 CG2 ILE B 16 -42.298 -50.189 35.498 1.00 23.17 C ATOM 206 CD1 ILE B 16 -39.100 -52.195 34.859 1.00 32.80 C ATOM 207 HA ILE B 16 -40.017 -50.206 32.866 1.00 0.00 H ATOM 208 HB ILE B 16 -40.203 -49.965 35.427 1.00 0.00 H ATOM 209 HG12 ILE B 16 -41.043 -52.432 35.686 1.00 0.00 H ATOM 210 HG13 ILE B 16 -40.989 -52.407 33.908 1.00 0.00 H ATOM 211 HD11 ILE B 16 -38.634 -51.732 33.989 1.00 0.00 H ATOM 212 HD12 ILE B 16 -38.689 -51.758 35.769 1.00 0.00 H ATOM 213 HD13 ILE B 16 -38.905 -53.267 34.850 1.00 0.00 H ATOM 214 HG21 ILE B 16 -42.463 -49.112 35.537 1.00 0.00 H ATOM 215 HG22 ILE B 16 -43.097 -50.660 34.925 1.00 0.00 H ATOM 216 HG23 ILE B 16 -42.288 -50.593 36.510 1.00 0.00 H ATOM 217 H ILE B 16 -41.096 -47.923 34.238 1.00 0.00 H ATOM 218 N HIS B 17 -43.100 -49.721 32.206 1.00 22.19 N ATOM 219 CA HIS B 17 -44.312 -50.112 31.475 1.00 21.61 C ATOM 220 C HIS B 17 -44.224 -49.702 30.025 1.00 21.50 C ATOM 221 O HIS B 17 -45.105 -50.063 29.235 1.00 22.36 O ATOM 222 CB HIS B 17 -45.524 -49.337 32.023 1.00 22.31 C ATOM 223 CG HIS B 17 -45.817 -49.652 33.447 1.00 29.09 C ATOM 224 ND1 HIS B 17 -46.425 -50.828 33.830 1.00 30.70 N ATOM 225 CD2 HIS B 17 -45.525 -48.983 34.588 1.00 31.38 C ATOM 226 CE1 HIS B 17 -46.521 -50.852 35.150 1.00 32.73 C ATOM 227 NE2 HIS B 17 -45.979 -49.749 35.631 1.00 34.24 N ATOM 228 HA HIS B 17 -44.412 -51.192 31.586 1.00 0.00 H ATOM 229 HB2 HIS B 17 -45.322 -48.269 31.937 1.00 0.00 H ATOM 230 HB3 HIS B 17 -46.399 -49.590 31.424 1.00 0.00 H ATOM 231 HD2 HIS B 17 -45.024 -48.018 34.663 1.00 0.00 H ATOM 232 HE1 HIS B 17 -46.972 -51.649 35.741 1.00 0.00 H ATOM 233 H HIS B 17 -43.052 -48.739 32.546 1.00 0.00 H ATOM 234 N TRP B 18 -43.207 -48.899 29.669 1.00 18.34 N ATOM 235 CA TRP B 18 -43.182 -48.356 28.291 1.00 17.98 C ATOM 236 C TRP B 18 -43.027 -49.445 27.262 1.00 18.46 C ATOM 237 O TRP B 18 -43.598 -49.318 26.193 1.00 19.74 O ATOM 238 CB TRP B 18 -42.061 -47.294 28.082 1.00 16.32 C ATOM 239 CG TRP B 18 -42.218 -46.038 28.896 1.00 13.54 C ATOM 240 CD1 TRP B 18 -43.341 -45.590 29.593 1.00 13.55 C ATOM 241 CD2 TRP B 18 -41.217 -45.015 29.032 1.00 15.35 C ATOM 242 NE1 TRP B 18 -43.070 -44.361 30.178 1.00 12.88 N ATOM 243 CE2 TRP B 18 -41.777 -43.980 29.824 1.00 13.73 C ATOM 244 CE3 TRP B 18 -39.891 -44.866 28.546 1.00 12.50 C ATOM 245 CZ2 TRP B 18 -41.044 -42.815 30.151 1.00 10.79 C ATOM 246 CZ3 TRP B 18 -39.162 -43.703 28.914 1.00 11.63 C ATOM 247 CH2 TRP B 18 -39.764 -42.694 29.680 1.00 10.60 C ATOM 248 HA TRP B 18 -44.147 -47.867 28.156 1.00 0.00 H ATOM 249 HB2 TRP B 18 -41.107 -47.752 28.345 1.00 0.00 H ATOM 250 HB3 TRP B 18 -42.050 -47.016 27.028 1.00 0.00 H ATOM 251 HE1 TRP B 18 -43.721 -43.817 30.779 1.00 0.00 H ATOM 252 HD1 TRP B 18 -44.288 -46.125 29.667 1.00 0.00 H ATOM 253 HZ2 TRP B 18 -41.488 -42.031 30.764 1.00 0.00 H ATOM 254 HH2 TRP B 18 -39.198 -41.790 29.906 1.00 0.00 H ATOM 255 HZ3 TRP B 18 -38.125 -43.594 28.598 1.00 0.00 H ATOM 256 HE3 TRP B 18 -39.443 -45.626 27.906 1.00 0.00 H ATOM 257 H TRP B 18 -42.454 -48.664 30.346 1.00 0.00 H ATOM 258 N LYS B 19 -42.261 -50.495 27.588 1.00 20.51 N ATOM 259 CA LYS B 19 -42.076 -51.685 26.696 1.00 23.50 C ATOM 260 C LYS B 19 -43.391 -52.314 26.236 1.00 24.70 C ATOM 261 O LYS B 19 -43.382 -52.984 25.222 1.00 25.63 O ATOM 262 CB LYS B 19 -41.221 -52.788 27.358 1.00 22.56 C ATOM 263 CG LYS B 19 -41.891 -53.467 28.627 1.00 23.85 C ATOM 264 CD LYS B 19 -40.984 -54.556 29.359 1.00 26.42 C ATOM 265 CE LYS B 19 -39.608 -54.117 29.952 1.00 34.93 C ATOM 266 NZ LYS B 19 -39.656 -53.175 31.177 1.00 33.85 N ATOM 267 HA LYS B 19 -41.557 -51.285 25.825 1.00 0.00 H ATOM 268 HB2 LYS B 19 -41.032 -53.564 26.616 1.00 0.00 H ATOM 269 HB3 LYS B 19 -40.274 -52.345 27.668 1.00 0.00 H ATOM 270 HG2 LYS B 19 -42.127 -52.683 29.346 1.00 0.00 H ATOM 271 HG3 LYS B 19 -42.812 -53.953 28.305 1.00 0.00 H ATOM 272 HD2 LYS B 19 -41.572 -54.962 30.182 1.00 0.00 H ATOM 273 HD3 LYS B 19 -40.783 -55.345 28.634 1.00 0.00 H ATOM 274 HE2 LYS B 19 -39.054 -53.608 29.163 1.00 0.00 H ATOM 275 HE3 LYS B 19 -39.071 -55.018 30.247 1.00 0.00 H ATOM 276 HZ1 LYS B 19 -40.149 -52.296 30.918 1.00 0.00 H ATOM 277 HZ2 LYS B 19 -40.165 -53.644 31.953 1.00 0.00 H ATOM 278 HZ3 LYS B 19 -38.686 -52.953 31.481 1.00 0.00 H ATOM 279 H LYS B 19 -41.771 -50.484 28.505 1.00 0.00 H ATOM 280 N GLU B 20 -44.491 -52.107 26.984 1.00 25.80 N ATOM 281 CA GLU B 20 -45.822 -52.693 26.685 1.00 26.76 C ATOM 282 C GLU B 20 -46.357 -52.148 25.397 1.00 26.53 C ATOM 283 O GLU B 20 -46.830 -52.931 24.519 1.00 28.11 O ATOM 284 CB GLU B 20 -46.837 -52.413 27.797 1.00 26.64 C ATOM 285 CG GLU B 20 -46.584 -53.214 29.081 1.00 29.26 C ATOM 286 CD GLU B 20 -47.275 -52.609 30.319 1.00 29.49 C ATOM 287 OE1 GLU B 20 -48.307 -51.911 30.160 1.00 30.84 O ATOM 288 OE2 GLU B 20 -46.736 -52.858 31.432 1.00 30.88 O ATOM 289 HA GLU B 20 -45.680 -53.771 26.608 1.00 0.00 H ATOM 290 HB2 GLU B 20 -46.797 -51.351 28.040 1.00 0.00 H ATOM 291 HB3 GLU B 20 -47.831 -52.662 27.426 1.00 0.00 H ATOM 292 HG2 GLU B 20 -46.957 -54.228 28.936 1.00 0.00 H ATOM 293 HG3 GLU B 20 -45.510 -53.246 29.264 1.00 0.00 H ATOM 294 H GLU B 20 -44.403 -51.499 27.823 1.00 0.00 H ATOM 295 N PHE B 21 -46.271 -50.835 25.239 1.00 24.65 N ATOM 296 CA PHE B 21 -46.583 -50.205 23.963 1.00 24.44 C ATOM 297 C PHE B 21 -45.451 -49.814 23.000 1.00 23.10 C ATOM 298 O PHE B 21 -45.703 -49.520 21.833 1.00 23.97 O ATOM 299 CB PHE B 21 -47.586 -49.071 24.197 1.00 26.82 C ATOM 300 CG PHE B 21 -48.936 -49.585 24.570 1.00 31.75 C ATOM 301 CD1 PHE B 21 -49.352 -49.604 25.893 1.00 34.47 C ATOM 302 CD2 PHE B 21 -49.753 -50.171 23.590 1.00 36.49 C ATOM 303 CE1 PHE B 21 -50.586 -50.140 26.257 1.00 34.05 C ATOM 304 CE2 PHE B 21 -51.005 -50.711 23.945 1.00 38.92 C ATOM 305 CZ PHE B 21 -51.402 -50.691 25.297 1.00 34.58 C ATOM 306 HA PHE B 21 -47.012 -51.020 23.380 1.00 0.00 H ATOM 307 HB2 PHE B 21 -47.217 -48.435 25.002 1.00 0.00 H ATOM 308 HB3 PHE B 21 -47.673 -48.484 23.283 1.00 0.00 H ATOM 309 HD2 PHE B 21 -49.418 -50.208 22.553 1.00 0.00 H ATOM 310 HE2 PHE B 21 -51.658 -51.139 23.184 1.00 0.00 H ATOM 311 HZ PHE B 21 -52.364 -51.116 25.584 1.00 0.00 H ATOM 312 HE1 PHE B 21 -50.903 -50.122 27.300 1.00 0.00 H ATOM 313 HD1 PHE B 21 -48.701 -49.191 26.664 1.00 0.00 H ATOM 314 H PHE B 21 -45.975 -50.243 26.041 1.00 0.00 H ATOM 315 N PHE B 22 -44.221 -49.787 23.492 1.00 21.50 N ATOM 316 CA PHE B 22 -43.045 -49.464 22.686 1.00 20.40 C ATOM 317 C PHE B 22 -41.963 -50.543 22.876 1.00 20.41 C ATOM 318 O PHE B 22 -41.057 -50.379 23.667 1.00 19.19 O ATOM 319 CB PHE B 22 -42.525 -48.027 23.070 1.00 19.71 C ATOM 320 CG PHE B 22 -43.595 -46.974 22.997 1.00 17.77 C ATOM 321 CD1 PHE B 22 -43.912 -46.357 21.762 1.00 20.92 C ATOM 322 CD2 PHE B 22 -44.328 -46.636 24.126 1.00 22.39 C ATOM 323 CE1 PHE B 22 -44.944 -45.387 21.682 1.00 20.62 C ATOM 324 CE2 PHE B 22 -45.361 -45.709 24.078 1.00 23.02 C ATOM 325 CZ PHE B 22 -45.684 -45.073 22.842 1.00 21.16 C ATOM 326 HA PHE B 22 -43.308 -49.453 21.628 1.00 0.00 H ATOM 327 HB2 PHE B 22 -42.138 -48.059 24.088 1.00 0.00 H ATOM 328 HB3 PHE B 22 -41.722 -47.754 22.386 1.00 0.00 H ATOM 329 HD2 PHE B 22 -44.086 -47.111 25.077 1.00 0.00 H ATOM 330 HE2 PHE B 22 -45.923 -45.468 24.981 1.00 0.00 H ATOM 331 HZ PHE B 22 -46.497 -44.349 22.794 1.00 0.00 H ATOM 332 HE1 PHE B 22 -45.163 -44.890 20.737 1.00 0.00 H ATOM 333 HD1 PHE B 22 -43.357 -46.630 20.864 1.00 0.00 H ATOM 334 H PHE B 22 -44.086 -50.006 24.500 1.00 0.00 H ATOM 335 N PRO B 23 -42.073 -51.703 22.195 1.00 20.93 N ATOM 336 CA PRO B 23 -41.099 -52.726 22.587 1.00 20.35 C ATOM 337 C PRO B 23 -39.610 -52.447 22.307 1.00 18.89 C ATOM 338 O PRO B 23 -38.757 -53.160 22.834 1.00 19.06 O ATOM 339 CB PRO B 23 -41.592 -54.005 21.850 1.00 21.22 C ATOM 340 CG PRO B 23 -42.378 -53.466 20.682 1.00 23.92 C ATOM 341 CD PRO B 23 -43.038 -52.199 21.190 1.00 21.55 C ATOM 342 HA PRO B 23 -41.082 -52.793 23.675 1.00 0.00 H ATOM 343 HD3 PRO B 23 -43.172 -51.477 20.385 1.00 0.00 H ATOM 344 HD2 PRO B 23 -44.004 -52.416 21.647 1.00 0.00 H ATOM 345 HG3 PRO B 23 -43.131 -54.187 20.363 1.00 0.00 H ATOM 346 HG2 PRO B 23 -41.715 -53.242 19.847 1.00 0.00 H ATOM 347 HB2 PRO B 23 -40.749 -54.605 21.507 1.00 0.00 H ATOM 348 HB3 PRO B 23 -42.226 -54.608 22.500 1.00 0.00 H ATOM 349 N ILE B 24 -39.321 -51.444 21.464 1.00 18.63 N ATOM 350 CA ILE B 24 -37.958 -50.962 21.241 1.00 18.37 C ATOM 351 C ILE B 24 -37.291 -50.521 22.583 1.00 16.99 C ATOM 352 O ILE B 24 -36.058 -50.373 22.625 1.00 16.93 O ATOM 353 CB ILE B 24 -37.898 -49.870 20.117 1.00 17.81 C ATOM 354 CG1 ILE B 24 -36.496 -49.833 19.431 1.00 16.57 C ATOM 355 CG2 ILE B 24 -38.375 -48.510 20.637 1.00 14.01 C ATOM 356 CD1 ILE B 24 -36.225 -51.026 18.500 1.00 19.76 C ATOM 357 HA ILE B 24 -37.361 -51.792 20.864 1.00 0.00 H ATOM 358 HB ILE B 24 -38.599 -50.145 19.329 1.00 0.00 H ATOM 359 HG12 ILE B 24 -36.425 -48.917 18.845 1.00 0.00 H ATOM 360 HG13 ILE B 24 -35.733 -49.825 20.209 1.00 0.00 H ATOM 361 HD11 ILE B 24 -36.280 -51.952 19.073 1.00 0.00 H ATOM 362 HD12 ILE B 24 -36.972 -51.043 17.707 1.00 0.00 H ATOM 363 HD13 ILE B 24 -35.231 -50.926 18.063 1.00 0.00 H ATOM 364 HG21 ILE B 24 -39.405 -48.596 20.984 1.00 0.00 H ATOM 365 HG22 ILE B 24 -37.737 -48.194 21.463 1.00 0.00 H ATOM 366 HG23 ILE B 24 -38.321 -47.776 19.833 1.00 0.00 H ATOM 367 H ILE B 24 -40.100 -50.989 20.946 1.00 0.00 H ATOM 368 N ALA B 25 -38.100 -50.344 23.649 1.00 18.49 N ATOM 369 CA ALA B 25 -37.580 -49.953 24.994 1.00 19.21 C ATOM 370 C ALA B 25 -36.461 -50.930 25.397 1.00 20.29 C ATOM 371 O ALA B 25 -35.486 -50.571 26.082 1.00 21.46 O ATOM 372 CB ALA B 25 -38.730 -49.983 26.044 1.00 17.10 C ATOM 373 HA ALA B 25 -37.182 -48.939 24.954 1.00 0.00 H ATOM 374 HB1 ALA B 25 -39.511 -49.284 25.745 1.00 0.00 H ATOM 375 HB2 ALA B 25 -39.144 -50.990 26.099 1.00 0.00 H ATOM 376 HB3 ALA B 25 -38.337 -49.696 27.019 1.00 0.00 H ATOM 377 H ALA B 25 -39.123 -50.485 23.530 1.00 0.00 H ATOM 378 N ASP B 26 -36.647 -52.194 24.985 1.00 21.20 N ATOM 379 CA ASP B 26 -35.657 -53.265 25.235 1.00 23.09 C ATOM 380 C ASP B 26 -34.712 -53.522 24.054 1.00 22.85 C ATOM 381 O ASP B 26 -34.095 -54.594 23.974 1.00 22.47 O ATOM 382 CB ASP B 26 -36.387 -54.549 25.634 1.00 24.65 C ATOM 383 CG ASP B 26 -37.374 -54.327 26.805 1.00 25.57 C ATOM 384 OD1 ASP B 26 -37.073 -53.599 27.765 1.00 29.37 O ATOM 385 OD2 ASP B 26 -38.472 -54.855 26.766 1.00 25.32 O ATOM 386 HA ASP B 26 -35.019 -52.925 26.051 1.00 0.00 H ATOM 387 HB2 ASP B 26 -36.943 -54.918 24.772 1.00 0.00 H ATOM 388 HB3 ASP B 26 -35.649 -55.293 25.934 1.00 0.00 H ATOM 389 H ASP B 26 -37.520 -52.429 24.471 1.00 0.00 H ATOM 390 N GLY B 27 -34.590 -52.517 23.173 1.00 21.63 N ATOM 391 CA GLY B 27 -33.692 -52.517 22.045 1.00 20.58 C ATOM 392 C GLY B 27 -32.209 -52.624 22.412 1.00 18.88 C ATOM 393 O GLY B 27 -31.831 -52.704 23.567 1.00 19.64 O ATOM 394 HA3 GLY B 27 -33.840 -51.589 21.492 1.00 0.00 H ATOM 395 HA2 GLY B 27 -33.947 -53.363 21.407 1.00 0.00 H ATOM 396 H GLY B 27 -35.187 -51.677 23.314 1.00 0.00 H ATOM 397 N ASP B 28 -31.398 -52.665 21.378 1.00 19.65 N ATOM 398 CA ASP B 28 -29.928 -52.709 21.428 1.00 17.09 C ATOM 399 C ASP B 28 -29.257 -51.322 21.380 1.00 15.43 C ATOM 400 O ASP B 28 -28.061 -51.232 21.543 1.00 14.34 O ATOM 401 CB ASP B 28 -29.441 -53.507 20.220 1.00 17.75 C ATOM 402 CG ASP B 28 -29.705 -55.025 20.389 1.00 20.88 C ATOM 403 OD1 ASP B 28 -29.959 -55.454 21.528 1.00 22.85 O ATOM 404 OD2 ASP B 28 -29.755 -55.746 19.383 1.00 22.93 O ATOM 405 HA ASP B 28 -29.655 -53.162 22.381 1.00 0.00 H ATOM 406 HB2 ASP B 28 -29.963 -53.155 19.330 1.00 0.00 H ATOM 407 HB3 ASP B 28 -28.370 -53.346 20.099 1.00 0.00 H ATOM 408 H ASP B 28 -31.837 -52.666 20.435 1.00 0.00 H ATOM 409 N GLN B 29 -30.012 -50.253 21.120 1.00 13.94 N ATOM 410 CA GLN B 29 -29.421 -48.881 21.076 1.00 14.98 C ATOM 411 C GLN B 29 -30.258 -47.905 21.869 1.00 14.91 C ATOM 412 O GLN B 29 -30.579 -46.841 21.392 1.00 14.48 O ATOM 413 CB GLN B 29 -29.215 -48.347 19.667 1.00 13.86 C ATOM 414 CG GLN B 29 -28.256 -49.270 18.912 1.00 21.23 C ATOM 415 CD GLN B 29 -27.314 -48.604 17.952 1.00 22.43 C ATOM 416 OE1 GLN B 29 -26.188 -49.107 17.752 1.00 27.43 O ATOM 417 NE2 GLN B 29 -27.748 -47.493 17.318 1.00 15.44 N ATOM 418 HA GLN B 29 -28.434 -48.977 21.527 1.00 0.00 H ATOM 419 HB2 GLN B 29 -30.172 -48.312 19.147 1.00 0.00 H ATOM 420 HB3 GLN B 29 -28.792 -47.343 19.716 1.00 0.00 H ATOM 421 HG2 GLN B 29 -27.657 -49.803 19.650 1.00 0.00 H ATOM 422 HG3 GLN B 29 -28.856 -49.984 18.348 1.00 0.00 H ATOM 423 HE22 GLN B 29 -28.695 -47.115 17.521 1.00 0.00 H ATOM 424 HE21 GLN B 29 -27.135 -47.016 16.627 1.00 0.00 H ATOM 425 H GLN B 29 -31.030 -50.377 20.945 1.00 0.00 H ATOM 426 N GLN B 30 -30.583 -48.313 23.092 1.00 14.27 N ATOM 427 CA GLN B 30 -31.442 -47.545 23.949 1.00 13.46 C ATOM 428 C GLN B 30 -30.646 -46.599 24.815 1.00 13.53 C ATOM 429 O GLN B 30 -29.498 -46.859 25.173 1.00 15.08 O ATOM 430 CB GLN B 30 -32.355 -48.456 24.771 1.00 12.47 C ATOM 431 CG GLN B 30 -33.487 -49.053 23.926 1.00 14.64 C ATOM 432 CD GLN B 30 -34.478 -48.032 23.466 1.00 11.05 C ATOM 433 OE1 GLN B 30 -35.186 -47.498 24.263 1.00 10.32 O ATOM 434 NE2 GLN B 30 -34.513 -47.739 22.147 1.00 11.33 N ATOM 435 HA GLN B 30 -32.087 -46.930 23.321 1.00 0.00 H ATOM 436 HB2 GLN B 30 -31.759 -49.269 25.186 1.00 0.00 H ATOM 437 HB3 GLN B 30 -32.791 -47.876 25.584 1.00 0.00 H ATOM 438 HG2 GLN B 30 -33.050 -49.532 23.050 1.00 0.00 H ATOM 439 HG3 GLN B 30 -34.010 -49.799 24.524 1.00 0.00 H ATOM 440 HE22 GLN B 30 -33.876 -48.231 21.488 1.00 0.00 H ATOM 441 HE21 GLN B 30 -35.177 -47.022 21.791 1.00 0.00 H ATOM 442 H GLN B 30 -30.203 -49.217 23.439 1.00 0.00 H ATOM 443 N SER B 31 -31.261 -45.470 25.090 1.00 12.62 N ATOM 444 CA SER B 31 -30.699 -44.433 25.909 1.00 11.97 C ATOM 445 C SER B 31 -31.647 -44.136 27.092 1.00 12.48 C ATOM 446 O SER B 31 -32.846 -44.451 27.052 1.00 12.01 O ATOM 447 CB SER B 31 -30.528 -43.142 25.106 1.00 11.90 C ATOM 448 OG SER B 31 -29.455 -43.245 24.213 1.00 12.11 O ATOM 449 HA SER B 31 -29.728 -44.774 26.267 1.00 0.00 H ATOM 450 HB2 SER B 31 -30.342 -42.316 25.793 1.00 0.00 H ATOM 451 HB3 SER B 31 -31.442 -42.947 24.545 1.00 0.00 H ATOM 452 HG SER B 31 -28.622 -43.418 24.719 1.00 0.00 H ATOM 453 H SER B 31 -32.210 -45.319 24.691 1.00 0.00 H ATOM 454 N PRO B 32 -31.111 -43.553 28.181 1.00 13.44 N ATOM 455 CA PRO B 32 -29.736 -43.241 28.424 1.00 13.19 C ATOM 456 C PRO B 32 -28.936 -44.499 28.832 1.00 15.21 C ATOM 457 O PRO B 32 -29.475 -45.575 28.823 1.00 13.56 O ATOM 458 CB PRO B 32 -29.824 -42.258 29.623 1.00 13.70 C ATOM 459 CG PRO B 32 -30.975 -42.829 30.418 1.00 12.02 C ATOM 460 CD PRO B 32 -31.969 -43.231 29.355 1.00 12.73 C ATOM 461 HA PRO B 32 -29.230 -42.837 27.547 1.00 0.00 H ATOM 462 HD3 PRO B 32 -32.544 -44.102 29.668 1.00 0.00 H ATOM 463 HD2 PRO B 32 -32.650 -42.411 29.127 1.00 0.00 H ATOM 464 HG3 PRO B 32 -31.399 -42.078 31.085 1.00 0.00 H ATOM 465 HG2 PRO B 32 -30.656 -43.693 31.001 1.00 0.00 H ATOM 466 HB2 PRO B 32 -28.902 -42.259 30.204 1.00 0.00 H ATOM 467 HB3 PRO B 32 -30.039 -41.243 29.288 1.00 0.00 H ATOM 468 N ILE B 33 -27.676 -44.304 29.212 1.00 14.71 N ATOM 469 CA ILE B 33 -26.752 -45.408 29.484 1.00 16.52 C ATOM 470 C ILE B 33 -25.920 -44.976 30.694 1.00 16.92 C ATOM 471 O ILE B 33 -25.988 -43.818 31.117 1.00 16.06 O ATOM 472 CB ILE B 33 -25.789 -45.730 28.293 1.00 16.23 C ATOM 473 CG1 ILE B 33 -24.849 -44.533 28.006 1.00 15.09 C ATOM 474 CG2 ILE B 33 -26.568 -46.294 27.067 1.00 16.56 C ATOM 475 CD1 ILE B 33 -23.680 -44.795 27.132 1.00 14.48 C ATOM 476 HA ILE B 33 -27.330 -46.316 29.655 1.00 0.00 H ATOM 477 HB ILE B 33 -25.119 -46.543 28.571 1.00 0.00 H ATOM 478 HG12 ILE B 33 -25.445 -43.751 27.535 1.00 0.00 H ATOM 479 HG13 ILE B 33 -24.471 -44.173 28.963 1.00 0.00 H ATOM 480 HD11 ILE B 33 -23.052 -45.561 27.587 1.00 0.00 H ATOM 481 HD12 ILE B 33 -24.026 -45.139 26.157 1.00 0.00 H ATOM 482 HD13 ILE B 33 -23.105 -43.877 27.011 1.00 0.00 H ATOM 483 HG21 ILE B 33 -27.081 -47.212 27.355 1.00 0.00 H ATOM 484 HG22 ILE B 33 -27.298 -45.557 26.732 1.00 0.00 H ATOM 485 HG23 ILE B 33 -25.867 -46.506 26.259 1.00 0.00 H ATOM 486 H ILE B 33 -27.333 -43.328 29.320 1.00 0.00 H ATOM 487 N GLU B 34 -25.201 -45.937 31.271 1.00 17.63 N ATOM 488 CA GLU B 34 -24.114 -45.664 32.181 1.00 18.04 C ATOM 489 C GLU B 34 -22.822 -45.546 31.386 1.00 17.79 C ATOM 490 O GLU B 34 -22.493 -46.399 30.571 1.00 18.75 O ATOM 491 CB GLU B 34 -23.950 -46.836 33.163 1.00 18.09 C ATOM 492 CG GLU B 34 -25.112 -46.927 34.186 1.00 17.35 C ATOM 493 CD GLU B 34 -24.830 -48.087 35.167 1.00 20.08 C ATOM 494 OE1 GLU B 34 -24.162 -47.801 36.213 1.00 20.41 O ATOM 495 OE2 GLU B 34 -25.174 -49.246 34.813 1.00 18.58 O ATOM 496 HA GLU B 34 -24.328 -44.743 32.723 1.00 0.00 H ATOM 497 HB2 GLU B 34 -23.912 -47.765 32.594 1.00 0.00 H ATOM 498 HB3 GLU B 34 -23.015 -46.707 33.708 1.00 0.00 H ATOM 499 HG2 GLU B 34 -25.187 -45.991 34.739 1.00 0.00 H ATOM 500 HG3 GLU B 34 -26.049 -47.112 33.660 1.00 0.00 H ATOM 501 H GLU B 34 -25.433 -46.928 31.057 1.00 0.00 H ATOM 502 N ILE B 35 -22.084 -44.504 31.662 1.00 19.11 N ATOM 503 CA ILE B 35 -20.764 -44.322 31.101 1.00 20.71 C ATOM 504 C ILE B 35 -19.646 -44.775 32.106 1.00 21.68 C ATOM 505 O ILE B 35 -19.490 -44.191 33.163 1.00 22.18 O ATOM 506 CB ILE B 35 -20.576 -42.859 30.670 1.00 19.81 C ATOM 507 CG1 ILE B 35 -21.629 -42.508 29.577 1.00 20.29 C ATOM 508 CG2 ILE B 35 -19.152 -42.664 30.140 1.00 18.30 C ATOM 509 CD1 ILE B 35 -21.874 -41.021 29.354 1.00 20.81 C ATOM 510 HA ILE B 35 -20.671 -44.956 30.219 1.00 0.00 H ATOM 511 HB ILE B 35 -20.722 -42.194 31.521 1.00 0.00 H ATOM 512 HG12 ILE B 35 -21.290 -42.938 28.634 1.00 0.00 H ATOM 513 HG13 ILE B 35 -22.576 -42.965 29.864 1.00 0.00 H ATOM 514 HD11 ILE B 35 -22.230 -40.570 30.280 1.00 0.00 H ATOM 515 HD12 ILE B 35 -20.943 -40.542 29.049 1.00 0.00 H ATOM 516 HD13 ILE B 35 -22.623 -40.891 28.573 1.00 0.00 H ATOM 517 HG21 ILE B 35 -18.437 -42.908 30.926 1.00 0.00 H ATOM 518 HG22 ILE B 35 -18.991 -43.320 29.284 1.00 0.00 H ATOM 519 HG23 ILE B 35 -19.018 -41.626 29.834 1.00 0.00 H ATOM 520 H ILE B 35 -22.459 -43.780 32.308 1.00 0.00 H ATOM 521 N LYS B 36 -18.932 -45.850 31.727 1.00 23.00 N ATOM 522 CA LYS B 36 -17.836 -46.389 32.507 1.00 25.26 C ATOM 523 C LYS B 36 -16.614 -45.807 31.878 1.00 25.47 C ATOM 524 O LYS B 36 -16.191 -46.281 30.832 1.00 26.70 O ATOM 525 CB LYS B 36 -17.780 -47.912 32.359 1.00 25.00 C ATOM 526 CG LYS B 36 -16.603 -48.637 33.116 1.00 26.98 C ATOM 527 CD LYS B 36 -16.862 -50.169 33.267 1.00 27.10 C ATOM 528 CE LYS B 36 -17.735 -50.574 34.478 1.00 27.43 C ATOM 529 NZ LYS B 36 -18.137 -52.075 34.402 1.00 22.00 N ATOM 530 HA LYS B 36 -17.935 -46.155 33.567 1.00 0.00 H ATOM 531 HB2 LYS B 36 -18.719 -48.319 32.735 1.00 0.00 H ATOM 532 HB3 LYS B 36 -17.685 -48.141 31.298 1.00 0.00 H ATOM 533 HG2 LYS B 36 -15.680 -48.489 32.556 1.00 0.00 H ATOM 534 HG3 LYS B 36 -16.499 -48.198 34.108 1.00 0.00 H ATOM 535 HD2 LYS B 36 -17.358 -50.518 32.362 1.00 0.00 H ATOM 536 HD3 LYS B 36 -15.897 -50.666 33.365 1.00 0.00 H ATOM 537 HE2 LYS B 36 -18.638 -49.963 34.486 1.00 0.00 H ATOM 538 HE3 LYS B 36 -17.173 -50.402 35.396 1.00 0.00 H ATOM 539 HZ1 LYS B 36 -18.678 -52.244 33.530 1.00 0.00 H ATOM 540 HZ2 LYS B 36 -17.279 -52.663 34.399 1.00 0.00 H ATOM 541 HZ3 LYS B 36 -18.722 -52.318 35.227 1.00 0.00 H ATOM 542 H LYS B 36 -19.178 -46.317 30.831 1.00 0.00 H ATOM 543 N THR B 37 -16.006 -44.829 32.524 1.00 26.29 N ATOM 544 CA THR B 37 -14.857 -44.138 31.871 1.00 27.85 C ATOM 545 C THR B 37 -13.608 -45.010 31.518 1.00 29.02 C ATOM 546 O THR B 37 -12.937 -44.705 30.527 1.00 26.79 O ATOM 547 CB THR B 37 -14.480 -42.838 32.585 1.00 26.73 C ATOM 548 OG1 THR B 37 -14.044 -43.144 33.904 1.00 25.80 O ATOM 549 CG2 THR B 37 -15.705 -41.981 32.674 1.00 27.20 C ATOM 550 HA THR B 37 -15.255 -43.889 30.887 1.00 0.00 H ATOM 551 HB THR B 37 -13.688 -42.323 32.041 1.00 0.00 H ATOM 552 HG1 THR B 37 -14.775 -43.596 34.396 1.00 0.00 H ATOM 553 HG23 THR B 37 -16.051 -41.738 31.669 1.00 0.00 H ATOM 554 HG21 THR B 37 -16.487 -42.521 33.208 1.00 0.00 H ATOM 555 HG22 THR B 37 -15.466 -41.062 33.209 1.00 0.00 H ATOM 556 H THR B 37 -16.323 -44.545 33.473 1.00 0.00 H ATOM 557 N LYS B 38 -13.319 -46.077 32.279 1.00 30.03 N ATOM 558 CA LYS B 38 -12.105 -46.886 32.023 1.00 32.40 C ATOM 559 C LYS B 38 -12.202 -47.656 30.712 1.00 33.13 C ATOM 560 O LYS B 38 -11.187 -48.008 30.108 1.00 34.42 O ATOM 561 CB LYS B 38 -11.739 -47.852 33.178 1.00 34.25 C ATOM 562 CG LYS B 38 -12.806 -48.904 33.519 1.00 35.44 C ATOM 563 CD LYS B 38 -12.236 -50.339 33.560 1.00 40.04 C ATOM 564 CE LYS B 38 -13.388 -51.364 33.645 1.00 39.23 C ATOM 565 NZ LYS B 38 -13.248 -52.525 32.706 1.00 44.03 N ATOM 566 HA LYS B 38 -11.297 -46.158 31.951 1.00 0.00 H ATOM 567 HB2 LYS B 38 -10.825 -48.377 32.901 1.00 0.00 H ATOM 568 HB3 LYS B 38 -11.557 -47.255 34.072 1.00 0.00 H ATOM 569 HG2 LYS B 38 -13.229 -48.668 34.496 1.00 0.00 H ATOM 570 HG3 LYS B 38 -13.591 -48.862 32.764 1.00 0.00 H ATOM 571 HD2 LYS B 38 -11.655 -50.523 32.656 1.00 0.00 H ATOM 572 HD3 LYS B 38 -11.592 -50.447 34.433 1.00 0.00 H ATOM 573 HE2 LYS B 38 -14.321 -50.850 33.416 1.00 0.00 H ATOM 574 HE3 LYS B 38 -13.428 -51.750 34.663 1.00 0.00 H ATOM 575 HZ1 LYS B 38 -13.221 -52.176 31.727 1.00 0.00 H ATOM 576 HZ2 LYS B 38 -12.367 -53.036 32.918 1.00 0.00 H ATOM 577 HZ3 LYS B 38 -14.059 -53.165 32.825 1.00 0.00 H ATOM 578 H LYS B 38 -13.956 -46.339 33.058 1.00 0.00 H ATOM 579 N GLU B 39 -13.439 -47.879 30.277 1.00 33.69 N ATOM 580 CA GLU B 39 -13.752 -48.523 29.014 1.00 34.55 C ATOM 581 C GLU B 39 -13.900 -47.576 27.832 1.00 34.71 C ATOM 582 O GLU B 39 -13.975 -48.021 26.685 1.00 37.07 O ATOM 583 CB GLU B 39 -15.026 -49.349 29.180 1.00 35.74 C ATOM 584 CG GLU B 39 -14.962 -50.306 30.386 1.00 38.56 C ATOM 585 CD GLU B 39 -15.617 -51.630 30.093 1.00 42.78 C ATOM 586 OE1 GLU B 39 -14.913 -52.651 30.158 1.00 45.97 O ATOM 587 OE2 GLU B 39 -16.824 -51.642 29.756 1.00 46.87 O ATOM 588 HA GLU B 39 -12.895 -49.152 28.772 1.00 0.00 H ATOM 589 HB2 GLU B 39 -15.867 -48.669 29.318 1.00 0.00 H ATOM 590 HB3 GLU B 39 -15.181 -49.937 28.276 1.00 0.00 H ATOM 591 HG2 GLU B 39 -13.917 -50.480 30.642 1.00 0.00 H ATOM 592 HG3 GLU B 39 -15.470 -49.841 31.231 1.00 0.00 H ATOM 593 H GLU B 39 -14.230 -47.573 30.878 1.00 0.00 H ATOM 594 N VAL B 40 -13.920 -46.278 28.102 1.00 33.82 N ATOM 595 CA VAL B 40 -14.188 -45.305 27.098 1.00 31.99 C ATOM 596 C VAL B 40 -12.877 -45.018 26.404 1.00 32.47 C ATOM 597 O VAL B 40 -11.878 -44.711 27.059 1.00 34.80 O ATOM 598 CB VAL B 40 -14.776 -44.012 27.736 1.00 32.31 C ATOM 599 CG1 VAL B 40 -14.556 -42.821 26.836 1.00 31.14 C ATOM 600 CG2 VAL B 40 -16.245 -44.194 28.094 1.00 28.76 C ATOM 601 HA VAL B 40 -14.926 -45.672 26.385 1.00 0.00 H ATOM 602 HB VAL B 40 -14.243 -43.818 28.667 1.00 0.00 H ATOM 603 HG11 VAL B 40 -13.487 -42.680 26.677 1.00 0.00 H ATOM 604 HG12 VAL B 40 -15.047 -42.995 25.879 1.00 0.00 H ATOM 605 HG13 VAL B 40 -14.976 -41.931 27.304 1.00 0.00 H ATOM 606 HG21 VAL B 40 -16.811 -44.426 27.192 1.00 0.00 H ATOM 607 HG22 VAL B 40 -16.345 -45.012 28.808 1.00 0.00 H ATOM 608 HG23 VAL B 40 -16.626 -43.274 28.537 1.00 0.00 H ATOM 609 H VAL B 40 -13.735 -45.962 29.075 1.00 0.00 H ATOM 610 N LYS B 41 -12.859 -45.107 25.085 1.00 31.33 N ATOM 611 CA LYS B 41 -11.667 -44.706 24.329 1.00 30.92 C ATOM 612 C LYS B 41 -11.794 -43.315 23.694 1.00 29.83 C ATOM 613 O LYS B 41 -12.772 -43.029 22.990 1.00 26.09 O ATOM 614 CB LYS B 41 -11.295 -45.760 23.259 1.00 32.17 C ATOM 615 CG LYS B 41 -10.721 -47.075 23.814 1.00 35.00 C ATOM 616 CD LYS B 41 -9.843 -47.749 22.737 1.00 42.79 C ATOM 617 CE LYS B 41 -9.753 -49.274 22.927 1.00 45.43 C ATOM 618 NZ LYS B 41 -11.094 -49.983 22.849 1.00 45.44 N ATOM 619 HA LYS B 41 -10.859 -44.647 25.058 1.00 0.00 H ATOM 620 HB2 LYS B 41 -12.194 -45.997 22.690 1.00 0.00 H ATOM 621 HB3 LYS B 41 -10.551 -45.320 22.595 1.00 0.00 H ATOM 622 HG2 LYS B 41 -10.117 -46.864 24.696 1.00 0.00 H ATOM 623 HG3 LYS B 41 -11.539 -47.742 24.086 1.00 0.00 H ATOM 624 HD2 LYS B 41 -10.271 -47.542 21.756 1.00 0.00 H ATOM 625 HD3 LYS B 41 -8.839 -47.329 22.790 1.00 0.00 H ATOM 626 HE2 LYS B 41 -9.315 -49.473 23.905 1.00 0.00 H ATOM 627 HE3 LYS B 41 -9.104 -49.679 22.151 1.00 0.00 H ATOM 628 HZ1 LYS B 41 -11.723 -49.616 23.592 1.00 0.00 H ATOM 629 HZ2 LYS B 41 -11.521 -49.813 21.916 1.00 0.00 H ATOM 630 HZ3 LYS B 41 -10.953 -51.004 22.986 1.00 0.00 H ATOM 631 H LYS B 41 -13.695 -45.464 24.580 1.00 0.00 H ATOM 632 N TYR B 42 -10.769 -42.494 23.948 1.00 28.52 N ATOM 633 CA TYR B 42 -10.478 -41.279 23.190 1.00 28.83 C ATOM 634 C TYR B 42 -10.401 -41.540 21.668 1.00 29.04 C ATOM 635 O TYR B 42 -9.707 -42.446 21.222 1.00 29.47 O ATOM 636 CB TYR B 42 -9.160 -40.658 23.685 1.00 28.98 C ATOM 637 CG TYR B 42 -8.664 -39.592 22.760 1.00 30.27 C ATOM 638 CD1 TYR B 42 -9.369 -38.403 22.623 1.00 27.64 C ATOM 639 CD2 TYR B 42 -7.493 -39.763 22.005 1.00 29.29 C ATOM 640 CE1 TYR B 42 -8.945 -37.403 21.763 1.00 30.24 C ATOM 641 CE2 TYR B 42 -7.069 -38.764 21.138 1.00 31.20 C ATOM 642 CZ TYR B 42 -7.794 -37.576 21.052 1.00 29.24 C ATOM 643 OH TYR B 42 -7.448 -36.565 20.200 1.00 32.42 O ATOM 644 HA TYR B 42 -11.301 -40.584 23.358 1.00 0.00 H ATOM 645 HB3 TYR B 42 -8.406 -41.442 23.757 1.00 0.00 H ATOM 646 HB2 TYR B 42 -9.324 -40.222 24.670 1.00 0.00 H ATOM 647 HD2 TYR B 42 -6.915 -40.682 22.099 1.00 0.00 H ATOM 648 HE2 TYR B 42 -6.176 -38.908 20.529 1.00 0.00 H ATOM 649 HE1 TYR B 42 -9.526 -36.487 21.656 1.00 0.00 H ATOM 650 HD1 TYR B 42 -10.278 -38.253 23.206 1.00 0.00 H ATOM 651 HH TYR B 42 -6.536 -36.248 20.419 1.00 0.00 H ATOM 652 H TYR B 42 -10.137 -42.737 24.738 1.00 0.00 H ATOM 653 N ASP B 43 -11.099 -40.726 20.875 1.00 29.22 N ATOM 654 CA ASP B 43 -11.071 -40.851 19.416 1.00 28.84 C ATOM 655 C ASP B 43 -10.581 -39.576 18.742 1.00 28.98 C ATOM 656 O ASP B 43 -11.335 -38.584 18.633 1.00 26.27 O ATOM 657 CB ASP B 43 -12.483 -41.229 18.885 1.00 30.04 C ATOM 658 CG ASP B 43 -12.477 -41.571 17.373 1.00 31.44 C ATOM 659 OD1 ASP B 43 -11.492 -41.243 16.661 1.00 33.23 O ATOM 660 OD2 ASP B 43 -13.470 -42.142 16.905 1.00 30.58 O ATOM 661 HA ASP B 43 -10.365 -41.644 19.168 1.00 0.00 H ATOM 662 HB2 ASP B 43 -12.844 -42.096 19.438 1.00 0.00 H ATOM 663 HB3 ASP B 43 -13.156 -40.388 19.051 1.00 0.00 H ATOM 664 H ASP B 43 -11.681 -39.980 21.306 1.00 0.00 H ATOM 665 N SER B 44 -9.342 -39.623 18.221 1.00 28.80 N ATOM 666 CA SER B 44 -8.695 -38.453 17.583 1.00 29.24 C ATOM 667 C SER B 44 -9.344 -38.045 16.265 1.00 29.63 C ATOM 668 O SER B 44 -9.110 -36.905 15.781 1.00 30.19 O ATOM 669 CB SER B 44 -7.195 -38.732 17.343 1.00 29.45 C ATOM 670 OG SER B 44 -7.041 -39.983 16.717 1.00 30.75 O ATOM 671 HA SER B 44 -8.823 -37.623 18.278 1.00 0.00 H ATOM 672 HB2 SER B 44 -6.669 -38.737 18.298 1.00 0.00 H ATOM 673 HB3 SER B 44 -6.779 -37.953 16.704 1.00 0.00 H ATOM 674 HG SER B 44 -6.079 -40.158 16.565 1.00 0.00 H ATOM 675 H SER B 44 -8.816 -40.519 18.268 1.00 0.00 H ATOM 676 N SER B 45 -10.138 -38.967 15.684 1.00 28.83 N ATOM 677 CA SER B 45 -10.922 -38.686 14.466 1.00 29.50 C ATOM 678 C SER B 45 -12.158 -37.745 14.635 1.00 29.61 C ATOM 679 O SER B 45 -12.637 -37.093 13.655 1.00 30.85 O ATOM 680 CB SER B 45 -11.326 -39.973 13.768 1.00 29.40 C ATOM 681 OG SER B 45 -12.534 -40.464 14.280 1.00 30.09 O ATOM 682 HA SER B 45 -10.233 -38.115 13.844 1.00 0.00 H ATOM 683 HB2 SER B 45 -10.546 -40.720 13.917 1.00 0.00 H ATOM 684 HB3 SER B 45 -11.443 -39.779 12.702 1.00 0.00 H ATOM 685 HG SER B 45 -12.431 -40.646 15.248 1.00 0.00 H ATOM 686 H SER B 45 -10.200 -39.913 16.111 1.00 0.00 H ATOM 687 N LEU B 46 -12.636 -37.630 15.860 1.00 29.84 N ATOM 688 CA LEU B 46 -13.618 -36.564 16.202 1.00 29.57 C ATOM 689 C LEU B 46 -13.148 -35.127 15.861 1.00 30.06 C ATOM 690 O LEU B 46 -12.045 -34.731 16.239 1.00 29.53 O ATOM 691 CB LEU B 46 -14.027 -36.675 17.672 1.00 28.48 C ATOM 692 CG LEU B 46 -14.643 -38.032 18.039 1.00 27.31 C ATOM 693 CD1 LEU B 46 -14.582 -38.206 19.560 1.00 23.19 C ATOM 694 CD2 LEU B 46 -16.104 -38.224 17.543 1.00 24.36 C ATOM 695 HA LEU B 46 -14.485 -36.737 15.565 1.00 0.00 H ATOM 696 HB2 LEU B 46 -13.142 -36.520 18.289 1.00 0.00 H ATOM 697 HB3 LEU B 46 -14.758 -35.895 17.886 1.00 0.00 H ATOM 698 HG LEU B 46 -14.056 -38.794 17.527 1.00 0.00 H ATOM 699 HD21 LEU B 46 -16.739 -37.455 17.982 1.00 0.00 H ATOM 700 HD22 LEU B 46 -16.131 -38.143 16.456 1.00 0.00 H ATOM 701 HD23 LEU B 46 -16.462 -39.208 17.844 1.00 0.00 H ATOM 702 HD11 LEU B 46 -13.543 -38.171 19.887 1.00 0.00 H ATOM 703 HD12 LEU B 46 -15.143 -37.403 20.039 1.00 0.00 H ATOM 704 HD13 LEU B 46 -15.017 -39.168 19.832 1.00 0.00 H ATOM 705 H LEU B 46 -12.322 -38.293 16.597 1.00 0.00 H ATOM 706 N ARG B 47 -13.969 -34.372 15.119 1.00 29.85 N ATOM 707 CA ARG B 47 -13.586 -33.043 14.652 1.00 31.53 C ATOM 708 C ARG B 47 -13.930 -32.102 15.770 1.00 29.57 C ATOM 709 O ARG B 47 -14.642 -32.513 16.673 1.00 31.07 O ATOM 710 CB ARG B 47 -14.354 -32.672 13.357 1.00 31.99 C ATOM 711 CG ARG B 47 -13.917 -33.456 12.086 1.00 32.56 C ATOM 712 CD ARG B 47 -14.076 -32.581 10.763 1.00 37.30 C ATOM 713 NE ARG B 47 -13.199 -32.993 9.618 1.00 44.73 N ATOM 714 CZ ARG B 47 -13.535 -33.867 8.646 1.00 50.38 C ATOM 715 NH1 ARG B 47 -14.741 -34.436 8.645 1.00 51.96 N ATOM 716 NH2 ARG B 47 -12.674 -34.173 7.657 1.00 49.58 N ATOM 717 HA ARG B 47 -12.525 -32.995 14.405 1.00 0.00 H ATOM 718 HB2 ARG B 47 -15.414 -32.864 13.525 1.00 0.00 H ATOM 719 HB3 ARG B 47 -14.204 -31.609 13.167 1.00 0.00 H ATOM 720 HG2 ARG B 47 -12.872 -33.747 12.193 1.00 0.00 H ATOM 721 HG3 ARG B 47 -14.534 -34.350 11.994 1.00 0.00 H ATOM 722 HD2 ARG B 47 -13.842 -31.546 11.012 1.00 0.00 H ATOM 723 HD3 ARG B 47 -15.113 -32.649 10.436 1.00 0.00 H ATOM 724 HE ARG B 47 -12.251 -32.569 9.569 1.00 0.00 H ATOM 725 HH12 ARG B 47 -14.998 -35.109 7.895 1.00 0.00 H ATOM 726 HH11 ARG B 47 -15.425 -34.207 9.394 1.00 0.00 H ATOM 727 HH22 ARG B 47 -12.951 -34.849 6.917 1.00 0.00 H ATOM 728 HH21 ARG B 47 -11.732 -33.733 7.633 1.00 0.00 H ATOM 729 H ARG B 47 -14.907 -34.744 14.868 1.00 0.00 H ATOM 730 N PRO B 48 -13.396 -30.855 15.784 1.00 28.13 N ATOM 731 CA PRO B 48 -13.947 -29.941 16.814 1.00 27.49 C ATOM 732 C PRO B 48 -15.488 -29.813 16.820 1.00 26.31 C ATOM 733 O PRO B 48 -16.081 -29.747 15.763 1.00 25.65 O ATOM 734 CB PRO B 48 -13.252 -28.602 16.511 1.00 27.79 C ATOM 735 CG PRO B 48 -11.876 -29.065 15.948 1.00 27.62 C ATOM 736 CD PRO B 48 -12.286 -30.219 15.029 1.00 28.46 C ATOM 737 HA PRO B 48 -13.751 -30.321 17.817 1.00 0.00 H ATOM 738 HD3 PRO B 48 -12.628 -29.850 14.062 1.00 0.00 H ATOM 739 HD2 PRO B 48 -11.461 -30.916 14.880 1.00 0.00 H ATOM 740 HG3 PRO B 48 -11.216 -29.407 16.745 1.00 0.00 H ATOM 741 HG2 PRO B 48 -11.386 -28.267 15.390 1.00 0.00 H ATOM 742 HB2 PRO B 48 -13.808 -28.026 15.771 1.00 0.00 H ATOM 743 HB3 PRO B 48 -13.129 -28.007 17.416 1.00 0.00 H ATOM 744 N LEU B 49 -16.095 -29.836 18.010 1.00 24.53 N ATOM 745 CA LEU B 49 -17.543 -29.526 18.208 1.00 24.75 C ATOM 746 C LEU B 49 -17.740 -28.073 17.891 1.00 23.63 C ATOM 747 O LEU B 49 -16.955 -27.255 18.371 1.00 25.18 O ATOM 748 CB LEU B 49 -17.946 -29.702 19.660 1.00 24.51 C ATOM 749 CG LEU B 49 -19.377 -30.107 19.966 1.00 26.08 C ATOM 750 CD1 LEU B 49 -19.800 -31.344 19.173 1.00 26.63 C ATOM 751 CD2 LEU B 49 -19.445 -30.478 21.405 1.00 29.00 C ATOM 752 HA LEU B 49 -18.133 -30.190 17.576 1.00 0.00 H ATOM 753 HB2 LEU B 49 -17.296 -30.467 20.085 1.00 0.00 H ATOM 754 HB3 LEU B 49 -17.765 -28.752 20.163 1.00 0.00 H ATOM 755 HG LEU B 49 -20.030 -29.274 19.706 1.00 0.00 H ATOM 756 HD21 LEU B 49 -18.766 -31.309 21.597 1.00 0.00 H ATOM 757 HD22 LEU B 49 -19.155 -29.622 22.014 1.00 0.00 H ATOM 758 HD23 LEU B 49 -20.464 -30.774 21.655 1.00 0.00 H ATOM 759 HD11 LEU B 49 -19.724 -31.134 18.106 1.00 0.00 H ATOM 760 HD12 LEU B 49 -19.146 -32.178 19.427 1.00 0.00 H ATOM 761 HD13 LEU B 49 -20.830 -31.599 19.422 1.00 0.00 H ATOM 762 H LEU B 49 -15.528 -30.084 18.846 1.00 0.00 H ATOM 763 N SER B 50 -18.736 -27.757 17.065 1.00 21.85 N ATOM 764 CA SER B 50 -19.001 -26.371 16.613 1.00 20.05 C ATOM 765 C SER B 50 -20.438 -25.967 16.949 1.00 18.92 C ATOM 766 O SER B 50 -21.392 -26.626 16.524 1.00 18.15 O ATOM 767 CB SER B 50 -18.767 -26.264 15.102 1.00 19.87 C ATOM 768 OG SER B 50 -19.571 -25.216 14.549 1.00 22.18 O ATOM 769 HA SER B 50 -18.319 -25.696 17.130 1.00 0.00 H ATOM 770 HB2 SER B 50 -19.032 -27.209 14.629 1.00 0.00 H ATOM 771 HB3 SER B 50 -17.715 -26.048 14.915 1.00 0.00 H ATOM 772 HG SER B 50 -20.527 -25.412 14.716 1.00 0.00 H ATOM 773 H SER B 50 -19.356 -28.518 16.722 1.00 0.00 H ATOM 774 N ILE B 51 -20.609 -24.880 17.721 1.00 18.62 N ATOM 775 CA ILE B 51 -21.926 -24.573 18.245 1.00 17.61 C ATOM 776 C ILE B 51 -22.216 -23.144 17.896 1.00 16.54 C ATOM 777 O ILE B 51 -21.612 -22.228 18.464 1.00 16.90 O ATOM 778 CB ILE B 51 -22.042 -24.865 19.790 1.00 17.01 C ATOM 779 CG1 ILE B 51 -21.792 -26.365 20.065 1.00 17.24 C ATOM 780 CG2 ILE B 51 -23.379 -24.413 20.326 1.00 20.19 C ATOM 781 CD1 ILE B 51 -21.815 -26.756 21.587 1.00 19.08 C ATOM 782 HA ILE B 51 -22.676 -25.223 17.794 1.00 0.00 H ATOM 783 HB ILE B 51 -21.277 -24.293 20.316 1.00 0.00 H ATOM 784 HG12 ILE B 51 -22.564 -26.940 19.553 1.00 0.00 H ATOM 785 HG13 ILE B 51 -20.815 -26.629 19.659 1.00 0.00 H ATOM 786 HD11 ILE B 51 -21.040 -26.201 22.115 1.00 0.00 H ATOM 787 HD12 ILE B 51 -22.790 -26.512 22.009 1.00 0.00 H ATOM 788 HD13 ILE B 51 -21.631 -27.826 21.689 1.00 0.00 H ATOM 789 HG21 ILE B 51 -23.491 -23.341 20.162 1.00 0.00 H ATOM 790 HG22 ILE B 51 -24.176 -24.946 19.808 1.00 0.00 H ATOM 791 HG23 ILE B 51 -23.432 -24.626 21.394 1.00 0.00 H ATOM 792 H ILE B 51 -19.802 -24.263 17.941 1.00 0.00 H ATOM 793 N LYS B 52 -23.112 -22.974 16.928 1.00 15.59 N ATOM 794 CA LYS B 52 -23.574 -21.635 16.492 1.00 16.38 C ATOM 795 C LYS B 52 -25.030 -21.541 16.913 1.00 15.63 C ATOM 796 O LYS B 52 -25.874 -22.160 16.309 1.00 12.67 O ATOM 797 CB LYS B 52 -23.455 -21.415 14.984 1.00 13.59 C ATOM 798 CG LYS B 52 -23.770 -19.953 14.544 1.00 16.89 C ATOM 799 CD LYS B 52 -23.437 -19.679 13.104 1.00 18.18 C ATOM 800 CE LYS B 52 -24.218 -20.563 12.122 1.00 20.33 C ATOM 801 NZ LYS B 52 -23.786 -20.099 10.812 1.00 23.42 N ATOM 802 HA LYS B 52 -22.948 -20.868 16.948 1.00 0.00 H ATOM 803 HB2 LYS B 52 -22.437 -21.656 14.679 1.00 0.00 H ATOM 804 HB3 LYS B 52 -24.152 -22.085 14.481 1.00 0.00 H ATOM 805 HG2 LYS B 52 -24.834 -19.768 14.694 1.00 0.00 H ATOM 806 HG3 LYS B 52 -23.192 -19.272 15.168 1.00 0.00 H ATOM 807 HD2 LYS B 52 -23.666 -18.635 12.888 1.00 0.00 H ATOM 808 HD3 LYS B 52 -22.371 -19.854 12.956 1.00 0.00 H ATOM 809 HE2 LYS B 52 -25.292 -20.427 12.247 1.00 0.00 H ATOM 810 HE3 LYS B 52 -23.968 -21.614 12.263 1.00 0.00 H ATOM 811 HZ1 LYS B 52 -24.022 -19.092 10.707 1.00 0.00 H ATOM 812 HZ2 LYS B 52 -22.758 -20.226 10.722 1.00 0.00 H ATOM 813 HZ3 LYS B 52 -24.270 -20.649 10.074 1.00 0.00 H ATOM 814 H LYS B 52 -23.504 -23.815 16.458 1.00 0.00 H ATOM 815 N TYR B 53 -25.300 -20.696 17.913 1.00 16.84 N ATOM 816 CA TYR B 53 -26.640 -20.543 18.427 1.00 16.97 C ATOM 817 C TYR B 53 -26.993 -19.048 18.353 1.00 17.49 C ATOM 818 O TYR B 53 -26.267 -18.143 18.819 1.00 15.61 O ATOM 819 CB TYR B 53 -26.786 -21.106 19.878 1.00 19.16 C ATOM 820 CG TYR B 53 -26.825 -22.642 20.037 1.00 20.07 C ATOM 821 CD1 TYR B 53 -27.094 -23.531 18.940 1.00 17.70 C ATOM 822 CD2 TYR B 53 -26.589 -23.197 21.282 1.00 19.70 C ATOM 823 CE1 TYR B 53 -27.106 -24.919 19.111 1.00 22.10 C ATOM 824 CE2 TYR B 53 -26.619 -24.589 21.469 1.00 24.15 C ATOM 825 CZ TYR B 53 -26.872 -25.439 20.391 1.00 22.16 C ATOM 826 OH TYR B 53 -26.824 -26.778 20.644 1.00 21.87 O ATOM 827 HA TYR B 53 -27.337 -21.125 17.824 1.00 0.00 H ATOM 828 HB3 TYR B 53 -27.713 -20.709 20.293 1.00 0.00 H ATOM 829 HB2 TYR B 53 -25.942 -20.737 20.460 1.00 0.00 H ATOM 830 HD2 TYR B 53 -26.377 -22.545 22.130 1.00 0.00 H ATOM 831 HE2 TYR B 53 -26.444 -25.007 22.460 1.00 0.00 H ATOM 832 HE1 TYR B 53 -27.293 -25.582 18.267 1.00 0.00 H ATOM 833 HD1 TYR B 53 -27.293 -23.114 17.953 1.00 0.00 H ATOM 834 HH TYR B 53 -27.018 -27.277 19.811 1.00 0.00 H ATOM 835 H TYR B 53 -24.528 -20.137 18.329 1.00 0.00 H ATOM 836 N ASP B 54 -28.170 -18.810 17.783 1.00 16.69 N ATOM 837 CA ASP B 54 -28.753 -17.491 17.704 1.00 15.66 C ATOM 838 C ASP B 54 -29.921 -17.343 18.721 1.00 16.76 C ATOM 839 O ASP B 54 -30.920 -18.051 18.620 1.00 15.68 O ATOM 840 CB ASP B 54 -29.315 -17.357 16.310 1.00 14.81 C ATOM 841 CG ASP B 54 -29.724 -15.934 15.980 1.00 16.88 C ATOM 842 OD1 ASP B 54 -30.365 -15.272 16.811 1.00 17.29 O ATOM 843 OD2 ASP B 54 -29.375 -15.494 14.874 1.00 22.67 O ATOM 844 HA ASP B 54 -28.004 -16.732 17.928 1.00 0.00 H ATOM 845 HB2 ASP B 54 -28.557 -17.677 15.595 1.00 0.00 H ATOM 846 HB3 ASP B 54 -30.190 -18.001 16.223 1.00 0.00 H ATOM 847 H ASP B 54 -28.695 -19.610 17.375 1.00 0.00 H ATOM 848 N PRO B 55 -29.803 -16.417 19.685 1.00 16.83 N ATOM 849 CA PRO B 55 -30.909 -16.248 20.640 1.00 16.94 C ATOM 850 C PRO B 55 -32.289 -15.927 20.044 1.00 16.92 C ATOM 851 O PRO B 55 -33.287 -16.308 20.627 1.00 17.84 O ATOM 852 CB PRO B 55 -30.382 -15.114 21.564 1.00 16.45 C ATOM 853 CG PRO B 55 -28.828 -15.269 21.462 1.00 14.48 C ATOM 854 CD PRO B 55 -28.662 -15.503 19.991 1.00 15.42 C ATOM 855 HA PRO B 55 -31.129 -17.188 21.146 1.00 0.00 H ATOM 856 HD3 PRO B 55 -28.741 -14.571 19.431 1.00 0.00 H ATOM 857 HD2 PRO B 55 -27.706 -15.977 19.772 1.00 0.00 H ATOM 858 HG3 PRO B 55 -28.470 -16.117 22.046 1.00 0.00 H ATOM 859 HG2 PRO B 55 -28.313 -14.364 21.785 1.00 0.00 H ATOM 860 HB2 PRO B 55 -30.703 -14.136 21.206 1.00 0.00 H ATOM 861 HB3 PRO B 55 -30.723 -15.254 22.590 1.00 0.00 H ATOM 862 N SER B 56 -32.366 -15.306 18.876 1.00 16.18 N ATOM 863 CA SER B 56 -33.673 -15.000 18.283 1.00 17.27 C ATOM 864 C SER B 56 -34.320 -16.236 17.627 1.00 17.77 C ATOM 865 O SER B 56 -35.465 -16.169 17.214 1.00 18.31 O ATOM 866 CB SER B 56 -33.537 -13.901 17.220 1.00 18.92 C ATOM 867 OG SER B 56 -33.020 -14.448 16.011 1.00 21.11 O ATOM 868 HA SER B 56 -34.313 -14.664 19.099 1.00 0.00 H ATOM 869 HB2 SER B 56 -32.860 -13.129 17.585 1.00 0.00 H ATOM 870 HB3 SER B 56 -34.516 -13.463 17.027 1.00 0.00 H ATOM 871 HG SER B 56 -32.130 -14.845 16.184 1.00 0.00 H ATOM 872 H SER B 56 -31.495 -15.034 18.377 1.00 0.00 H ATOM 873 N SER B 57 -33.583 -17.363 17.547 1.00 15.46 N ATOM 874 CA SER B 57 -34.146 -18.642 17.130 1.00 15.52 C ATOM 875 C SER B 57 -35.244 -19.161 18.068 1.00 14.62 C ATOM 876 O SER B 57 -36.153 -19.875 17.609 1.00 16.41 O ATOM 877 CB SER B 57 -33.061 -19.722 17.006 1.00 13.80 C ATOM 878 OG SER B 57 -32.172 -19.418 15.930 1.00 18.58 O ATOM 879 HA SER B 57 -34.595 -18.446 16.157 1.00 0.00 H ATOM 880 HB2 SER B 57 -33.534 -20.686 16.819 1.00 0.00 H ATOM 881 HB3 SER B 57 -32.495 -19.771 17.936 1.00 0.00 H ATOM 882 HG SER B 57 -31.481 -20.124 15.865 1.00 0.00 H ATOM 883 H SER B 57 -32.573 -17.318 17.792 1.00 0.00 H ATOM 884 N ALA B 58 -35.135 -18.872 19.361 1.00 14.77 N ATOM 885 CA ALA B 58 -36.097 -19.432 20.361 1.00 16.01 C ATOM 886 C ALA B 58 -37.476 -18.816 20.109 1.00 17.57 C ATOM 887 O ALA B 58 -37.559 -17.629 19.767 1.00 19.79 O ATOM 888 CB ALA B 58 -35.615 -19.137 21.834 1.00 14.35 C ATOM 889 HA ALA B 58 -36.151 -20.515 20.248 1.00 0.00 H ATOM 890 HB1 ALA B 58 -34.638 -19.593 21.994 1.00 0.00 H ATOM 891 HB2 ALA B 58 -35.543 -18.060 21.982 1.00 0.00 H ATOM 892 HB3 ALA B 58 -36.332 -19.555 22.540 1.00 0.00 H ATOM 893 H ALA B 58 -34.369 -18.247 19.683 1.00 0.00 H ATOM 894 N LYS B 59 -38.548 -19.583 20.239 1.00 17.18 N ATOM 895 CA LYS B 59 -39.894 -19.038 19.904 1.00 18.72 C ATOM 896 C LYS B 59 -40.872 -19.172 21.050 1.00 17.50 C ATOM 897 O LYS B 59 -41.592 -18.220 21.380 1.00 17.48 O ATOM 898 CB LYS B 59 -40.472 -19.684 18.628 1.00 19.34 C ATOM 899 CG LYS B 59 -39.692 -19.319 17.352 1.00 25.00 C ATOM 900 CD LYS B 59 -39.380 -17.794 17.258 1.00 27.91 C ATOM 901 CE LYS B 59 -38.343 -17.440 16.171 1.00 29.94 C ATOM 902 NZ LYS B 59 -38.256 -15.933 15.986 1.00 30.87 N ATOM 903 HA LYS B 59 -39.750 -17.974 19.715 1.00 0.00 H ATOM 904 HB2 LYS B 59 -40.451 -20.767 18.749 1.00 0.00 H ATOM 905 HB3 LYS B 59 -41.504 -19.353 18.509 1.00 0.00 H ATOM 906 HG2 LYS B 59 -38.751 -19.869 17.348 1.00 0.00 H ATOM 907 HG3 LYS B 59 -40.285 -19.609 16.485 1.00 0.00 H ATOM 908 HD2 LYS B 59 -40.307 -17.266 17.035 1.00 0.00 H ATOM 909 HD3 LYS B 59 -38.996 -17.461 18.222 1.00 0.00 H ATOM 910 HE2 LYS B 59 -38.640 -17.901 15.229 1.00 0.00 H ATOM 911 HE3 LYS B 59 -37.366 -17.822 16.469 1.00 0.00 H ATOM 912 HZ1 LYS B 59 -39.186 -15.566 15.698 1.00 0.00 H ATOM 913 HZ2 LYS B 59 -37.970 -15.491 16.883 1.00 0.00 H ATOM 914 HZ3 LYS B 59 -37.553 -15.715 15.251 1.00 0.00 H ATOM 915 H LYS B 59 -38.451 -20.563 20.574 1.00 0.00 H ATOM 916 N ILE B 60 -40.918 -20.352 21.680 1.00 16.59 N ATOM 917 CA ILE B 60 -41.934 -20.620 22.679 1.00 16.99 C ATOM 918 C ILE B 60 -41.390 -21.524 23.724 1.00 15.84 C ATOM 919 O ILE B 60 -40.459 -22.299 23.462 1.00 14.82 O ATOM 920 CB ILE B 60 -43.354 -21.177 22.098 1.00 17.30 C ATOM 921 CG1 ILE B 60 -43.221 -22.485 21.358 1.00 20.24 C ATOM 922 CG2 ILE B 60 -44.057 -20.147 21.145 1.00 20.35 C ATOM 923 CD1 ILE B 60 -44.482 -23.371 21.440 1.00 22.17 C ATOM 924 HA ILE B 60 -42.184 -19.651 23.111 1.00 0.00 H ATOM 925 HB ILE B 60 -43.965 -21.333 22.987 1.00 0.00 H ATOM 926 HG12 ILE B 60 -43.019 -22.269 20.309 1.00 0.00 H ATOM 927 HG13 ILE B 60 -42.383 -23.038 21.782 1.00 0.00 H ATOM 928 HD11 ILE B 60 -44.692 -23.606 22.483 1.00 0.00 H ATOM 929 HD12 ILE B 60 -45.329 -22.837 21.009 1.00 0.00 H ATOM 930 HD13 ILE B 60 -44.313 -24.294 20.885 1.00 0.00 H ATOM 931 HG21 ILE B 60 -44.255 -19.225 21.691 1.00 0.00 H ATOM 932 HG22 ILE B 60 -43.406 -19.936 20.297 1.00 0.00 H ATOM 933 HG23 ILE B 60 -44.997 -20.568 20.787 1.00 0.00 H ATOM 934 H ILE B 60 -40.217 -21.085 21.450 1.00 0.00 H ATOM 935 N ILE B 61 -41.983 -21.447 24.904 1.00 14.54 N ATOM 936 CA ILE B 61 -41.764 -22.477 25.902 1.00 14.01 C ATOM 937 C ILE B 61 -43.152 -22.995 26.208 1.00 15.90 C ATOM 938 O ILE B 61 -44.086 -22.223 26.267 1.00 15.36 O ATOM 939 CB ILE B 61 -41.011 -21.932 27.152 1.00 14.33 C ATOM 940 CG1 ILE B 61 -40.448 -23.077 28.063 1.00 10.98 C ATOM 941 CG2 ILE B 61 -41.892 -20.961 27.928 1.00 10.51 C ATOM 942 CD1 ILE B 61 -39.546 -22.526 29.272 1.00 12.77 C ATOM 943 HA ILE B 61 -41.112 -23.276 25.549 1.00 0.00 H ATOM 944 HB ILE B 61 -40.140 -21.383 26.795 1.00 0.00 H ATOM 945 HG12 ILE B 61 -41.287 -23.634 28.480 1.00 0.00 H ATOM 946 HG13 ILE B 61 -39.840 -23.743 27.450 1.00 0.00 H ATOM 947 HD11 ILE B 61 -38.697 -21.974 28.868 1.00 0.00 H ATOM 948 HD12 ILE B 61 -40.145 -21.866 29.899 1.00 0.00 H ATOM 949 HD13 ILE B 61 -39.185 -23.365 29.867 1.00 0.00 H ATOM 950 HG21 ILE B 61 -42.162 -20.123 27.285 1.00 0.00 H ATOM 951 HG22 ILE B 61 -42.796 -21.475 28.256 1.00 0.00 H ATOM 952 HG23 ILE B 61 -41.347 -20.592 28.797 1.00 0.00 H ATOM 953 H ILE B 61 -42.609 -20.644 25.117 1.00 0.00 H ATOM 954 N SER B 62 -43.266 -24.316 26.413 1.00 16.16 N ATOM 955 CA SER B 62 -44.528 -24.936 26.706 1.00 16.80 C ATOM 956 C SER B 62 -44.312 -26.084 27.708 1.00 16.40 C ATOM 957 O SER B 62 -43.172 -26.576 27.924 1.00 15.08 O ATOM 958 CB SER B 62 -45.151 -25.506 25.399 1.00 17.03 C ATOM 959 OG SER B 62 -44.309 -26.546 24.876 1.00 20.46 O ATOM 960 HA SER B 62 -45.202 -24.194 27.134 1.00 0.00 H ATOM 961 HB2 SER B 62 -45.242 -24.708 24.662 1.00 0.00 H ATOM 962 HB3 SER B 62 -46.139 -25.913 25.615 1.00 0.00 H ATOM 963 HG SER B 62 -43.412 -26.175 24.679 1.00 0.00 H ATOM 964 H SER B 62 -42.414 -24.910 26.358 1.00 0.00 H ATOM 965 N ASN B 63 -45.413 -26.493 28.306 1.00 14.50 N ATOM 966 CA ASN B 63 -45.448 -27.678 29.128 1.00 16.48 C ATOM 967 C ASN B 63 -46.020 -28.872 28.286 1.00 15.81 C ATOM 968 O ASN B 63 -47.191 -28.928 28.014 1.00 15.73 O ATOM 969 CB ASN B 63 -46.258 -27.424 30.439 1.00 15.78 C ATOM 970 CG ASN B 63 -46.313 -28.666 31.364 1.00 16.10 C ATOM 971 OD1 ASN B 63 -45.942 -29.759 30.970 1.00 17.14 O ATOM 972 ND2 ASN B 63 -46.730 -28.469 32.601 1.00 16.93 N ATOM 973 HA ASN B 63 -44.438 -27.940 29.442 1.00 0.00 H ATOM 974 HB2 ASN B 63 -45.790 -26.604 30.984 1.00 0.00 H ATOM 975 HB3 ASN B 63 -47.277 -27.145 30.170 1.00 0.00 H ATOM 976 HD22 ASN B 63 -47.039 -27.522 32.901 1.00 0.00 H ATOM 977 HD21 ASN B 63 -46.750 -29.260 33.275 1.00 0.00 H ATOM 978 H ASN B 63 -46.286 -25.943 28.181 1.00 0.00 H ATOM 979 N SER B 64 -45.157 -29.842 27.950 1.00 16.24 N ATOM 980 CA SER B 64 -45.543 -31.044 27.188 1.00 15.48 C ATOM 981 C SER B 64 -46.258 -32.051 28.104 1.00 15.70 C ATOM 982 O SER B 64 -46.812 -33.054 27.643 1.00 16.05 O ATOM 983 CB SER B 64 -44.277 -31.703 26.601 1.00 14.87 C ATOM 984 OG SER B 64 -43.493 -32.294 27.615 1.00 11.59 O ATOM 985 HA SER B 64 -46.220 -30.751 26.385 1.00 0.00 H ATOM 986 HB2 SER B 64 -43.685 -30.944 26.090 1.00 0.00 H ATOM 987 HB3 SER B 64 -44.574 -32.471 25.887 1.00 0.00 H ATOM 988 HG SER B 64 -42.690 -32.708 27.210 1.00 0.00 H ATOM 989 H SER B 64 -44.164 -29.741 28.242 1.00 0.00 H ATOM 990 N GLY B 65 -46.229 -31.818 29.412 1.00 14.95 N ATOM 991 CA GLY B 65 -46.679 -32.854 30.395 1.00 16.40 C ATOM 992 C GLY B 65 -45.569 -33.774 30.854 1.00 15.34 C ATOM 993 O GLY B 65 -45.725 -34.516 31.821 1.00 16.20 O ATOM 994 HA3 GLY B 65 -47.457 -33.458 29.928 1.00 0.00 H ATOM 995 HA2 GLY B 65 -47.090 -32.346 31.268 1.00 0.00 H ATOM 996 H GLY B 65 -45.887 -30.899 29.759 1.00 0.00 H ATOM 997 N HIS B 66 -44.426 -33.737 30.141 1.00 13.84 N ATOM 998 CA HIS B 66 -43.265 -34.627 30.411 1.00 12.41 C ATOM 999 C HIS B 66 -41.995 -33.805 30.796 1.00 11.78 C ATOM 1000 O HIS B 66 -41.096 -34.347 31.419 1.00 11.78 O ATOM 1001 CB HIS B 66 -42.936 -35.446 29.183 1.00 12.44 C ATOM 1002 CG HIS B 66 -44.139 -36.018 28.521 1.00 17.49 C ATOM 1003 ND1 HIS B 66 -44.985 -36.894 29.180 1.00 18.39 N ATOM 1004 CD2 HIS B 66 -44.621 -35.884 27.259 1.00 18.52 C ATOM 1005 CE1 HIS B 66 -45.940 -37.268 28.341 1.00 20.77 C ATOM 1006 NE2 HIS B 66 -45.743 -36.668 27.180 1.00 20.16 N ATOM 1007 HA HIS B 66 -43.544 -35.276 31.242 1.00 0.00 H ATOM 1008 HB2 HIS B 66 -42.418 -34.807 28.468 1.00 0.00 H ATOM 1009 HB3 HIS B 66 -42.280 -36.265 29.478 1.00 0.00 H ATOM 1010 HD2 HIS B 66 -44.198 -35.272 26.463 1.00 0.00 H ATOM 1011 HE1 HIS B 66 -46.753 -37.956 28.570 1.00 0.00 H ATOM 1012 H HIS B 66 -44.352 -33.051 29.362 1.00 0.00 H ATOM 1013 N SER B 67 -42.012 -32.521 30.443 1.00 11.78 N ATOM 1014 CA SER B 67 -40.977 -31.532 30.733 1.00 13.20 C ATOM 1015 C SER B 67 -41.458 -30.192 30.264 1.00 13.75 C ATOM 1016 O SER B 67 -42.575 -30.044 29.796 1.00 12.77 O ATOM 1017 CB SER B 67 -39.634 -31.856 30.042 1.00 12.33 C ATOM 1018 OG SER B 67 -38.557 -30.997 30.494 1.00 14.16 O ATOM 1019 HA SER B 67 -40.798 -31.540 31.808 1.00 0.00 H ATOM 1020 HB2 SER B 67 -39.754 -31.730 28.966 1.00 0.00 H ATOM 1021 HB3 SER B 67 -39.370 -32.891 30.258 1.00 0.00 H ATOM 1022 HG SER B 67 -38.434 -31.110 31.470 1.00 0.00 H ATOM 1023 H SER B 67 -42.842 -32.191 29.910 1.00 0.00 H ATOM 1024 N PHE B 68 -40.650 -29.159 30.467 1.00 12.42 N ATOM 1025 CA PHE B 68 -40.884 -27.977 29.656 1.00 12.70 C ATOM 1026 C PHE B 68 -40.153 -28.193 28.312 1.00 12.09 C ATOM 1027 O PHE B 68 -39.097 -28.836 28.274 1.00 12.12 O ATOM 1028 CB PHE B 68 -40.351 -26.683 30.335 1.00 11.07 C ATOM 1029 CG PHE B 68 -38.884 -26.628 30.431 1.00 15.07 C ATOM 1030 CD1 PHE B 68 -38.250 -27.079 31.593 1.00 16.23 C ATOM 1031 CD2 PHE B 68 -38.081 -26.113 29.343 1.00 14.28 C ATOM 1032 CE1 PHE B 68 -36.824 -27.038 31.697 1.00 13.96 C ATOM 1033 CE2 PHE B 68 -36.670 -26.099 29.421 1.00 15.89 C ATOM 1034 CZ PHE B 68 -36.038 -26.569 30.577 1.00 14.74 C ATOM 1035 HA PHE B 68 -41.957 -27.843 29.519 1.00 0.00 H ATOM 1036 HB2 PHE B 68 -40.691 -25.825 29.755 1.00 0.00 H ATOM 1037 HB3 PHE B 68 -40.765 -26.627 31.342 1.00 0.00 H ATOM 1038 HD2 PHE B 68 -38.572 -25.730 28.449 1.00 0.00 H ATOM 1039 HE2 PHE B 68 -36.078 -25.724 28.586 1.00 0.00 H ATOM 1040 HZ PHE B 68 -34.950 -26.582 30.634 1.00 0.00 H ATOM 1041 HE1 PHE B 68 -36.332 -27.359 32.615 1.00 0.00 H ATOM 1042 HD1 PHE B 68 -38.844 -27.463 32.422 1.00 0.00 H ATOM 1043 H PHE B 68 -39.887 -29.194 31.172 1.00 0.00 H ATOM 1044 N ASN B 69 -40.665 -27.596 27.242 1.00 12.68 N ATOM 1045 CA ASN B 69 -39.966 -27.653 25.926 1.00 12.66 C ATOM 1046 C ASN B 69 -39.786 -26.219 25.437 1.00 12.95 C ATOM 1047 O ASN B 69 -40.747 -25.484 25.299 1.00 13.62 O ATOM 1048 CB ASN B 69 -40.739 -28.350 24.783 1.00 10.24 C ATOM 1049 CG ASN B 69 -40.908 -29.839 24.956 1.00 13.37 C ATOM 1050 OD1 ASN B 69 -40.098 -30.558 25.590 1.00 14.45 O ATOM 1051 ND2 ASN B 69 -41.925 -30.348 24.271 1.00 16.18 N ATOM 1052 HA ASN B 69 -39.054 -28.218 26.116 1.00 0.00 H ATOM 1053 HB2 ASN B 69 -41.730 -27.900 24.719 1.00 0.00 H ATOM 1054 HB3 ASN B 69 -40.201 -28.175 23.852 1.00 0.00 H ATOM 1055 HD22 ASN B 69 -42.574 -29.718 23.759 1.00 0.00 H ATOM 1056 HD21 ASN B 69 -42.072 -31.377 24.247 1.00 0.00 H ATOM 1057 H ASN B 69 -41.565 -27.082 27.323 1.00 0.00 H ATOM 1058 N VAL B 70 -38.543 -25.837 25.140 1.00 12.72 N ATOM 1059 CA VAL B 70 -38.297 -24.566 24.421 1.00 13.31 C ATOM 1060 C VAL B 70 -38.176 -24.979 22.973 1.00 14.37 C ATOM 1061 O VAL B 70 -37.343 -25.823 22.657 1.00 13.06 O ATOM 1062 CB VAL B 70 -37.025 -23.920 24.863 1.00 14.84 C ATOM 1063 CG1 VAL B 70 -36.769 -22.634 24.024 1.00 10.99 C ATOM 1064 CG2 VAL B 70 -37.123 -23.601 26.373 1.00 11.33 C ATOM 1065 HA VAL B 70 -39.090 -23.841 24.605 1.00 0.00 H ATOM 1066 HB VAL B 70 -36.183 -24.593 24.704 1.00 0.00 H ATOM 1067 HG11 VAL B 70 -36.692 -22.899 22.969 1.00 0.00 H ATOM 1068 HG12 VAL B 70 -37.596 -21.938 24.166 1.00 0.00 H ATOM 1069 HG13 VAL B 70 -35.840 -22.167 24.351 1.00 0.00 H ATOM 1070 HG21 VAL B 70 -37.960 -22.925 26.547 1.00 0.00 H ATOM 1071 HG22 VAL B 70 -37.280 -24.525 26.929 1.00 0.00 H ATOM 1072 HG23 VAL B 70 -36.198 -23.129 26.704 1.00 0.00 H ATOM 1073 H VAL B 70 -37.740 -26.437 25.416 1.00 0.00 H ATOM 1074 N ASP B 71 -39.037 -24.416 22.129 1.00 13.41 N ATOM 1075 CA ASP B 71 -39.013 -24.713 20.694 1.00 15.93 C ATOM 1076 C ASP B 71 -38.396 -23.535 19.923 1.00 16.05 C ATOM 1077 O ASP B 71 -38.551 -22.356 20.286 1.00 15.09 O ATOM 1078 CB ASP B 71 -40.386 -25.045 20.133 1.00 16.93 C ATOM 1079 CG ASP B 71 -40.954 -26.317 20.710 1.00 18.25 C ATOM 1080 OD1 ASP B 71 -40.224 -27.293 20.799 1.00 21.03 O ATOM 1081 OD2 ASP B 71 -42.141 -26.345 21.080 1.00 23.83 O ATOM 1082 HA ASP B 71 -38.398 -25.604 20.565 1.00 0.00 H ATOM 1083 HB2 ASP B 71 -41.065 -24.224 20.361 1.00 0.00 H ATOM 1084 HB3 ASP B 71 -40.304 -25.157 19.052 1.00 0.00 H ATOM 1085 H ASP B 71 -39.745 -23.749 22.497 1.00 0.00 H ATOM 1086 N PHE B 72 -37.687 -23.921 18.865 1.00 15.23 N ATOM 1087 CA PHE B 72 -36.847 -23.008 18.115 1.00 15.25 C ATOM 1088 C PHE B 72 -37.320 -23.036 16.667 1.00 16.25 C ATOM 1089 O PHE B 72 -37.921 -23.986 16.185 1.00 15.36 O ATOM 1090 CB PHE B 72 -35.382 -23.381 18.180 1.00 13.08 C ATOM 1091 CG PHE B 72 -34.778 -23.236 19.573 1.00 14.85 C ATOM 1092 CD1 PHE B 72 -34.888 -24.276 20.512 1.00 11.15 C ATOM 1093 CD2 PHE B 72 -34.086 -22.072 19.921 1.00 14.70 C ATOM 1094 CE1 PHE B 72 -34.296 -24.142 21.765 1.00 11.29 C ATOM 1095 CE2 PHE B 72 -33.511 -21.939 21.186 1.00 13.59 C ATOM 1096 CZ PHE B 72 -33.644 -22.969 22.100 1.00 11.84 C ATOM 1097 HA PHE B 72 -36.934 -22.012 18.549 1.00 0.00 H ATOM 1098 HB2 PHE B 72 -35.276 -24.419 17.864 1.00 0.00 H ATOM 1099 HB3 PHE B 72 -34.831 -22.736 17.496 1.00 0.00 H ATOM 1100 HD2 PHE B 72 -33.995 -21.261 19.198 1.00 0.00 H ATOM 1101 HE2 PHE B 72 -32.964 -21.034 21.451 1.00 0.00 H ATOM 1102 HZ PHE B 72 -33.228 -22.854 23.101 1.00 0.00 H ATOM 1103 HE1 PHE B 72 -34.346 -24.961 22.482 1.00 0.00 H ATOM 1104 HD1 PHE B 72 -35.435 -25.185 20.260 1.00 0.00 H ATOM 1105 H PHE B 72 -37.737 -24.915 18.565 1.00 0.00 H ATOM 1106 N ASP B 73 -37.098 -21.932 16.030 1.00 18.55 N ATOM 1107 CA ASP B 73 -37.496 -21.821 14.661 1.00 22.64 C ATOM 1108 C ASP B 73 -36.444 -22.633 13.983 1.00 23.01 C ATOM 1109 O ASP B 73 -35.259 -22.299 14.087 1.00 25.58 O ATOM 1110 CB ASP B 73 -37.445 -20.351 14.193 1.00 23.30 C ATOM 1111 CG ASP B 73 -37.581 -20.257 12.673 1.00 26.90 C ATOM 1112 OD1 ASP B 73 -37.020 -21.151 12.024 1.00 29.24 O ATOM 1113 OD2 ASP B 73 -38.233 -19.332 12.123 1.00 33.28 O ATOM 1114 HA ASP B 73 -38.515 -22.152 14.461 1.00 0.00 H ATOM 1115 HB2 ASP B 73 -38.261 -19.799 14.659 1.00 0.00 H ATOM 1116 HB3 ASP B 73 -36.493 -19.913 14.494 1.00 0.00 H ATOM 1117 H ASP B 73 -36.635 -21.133 16.509 1.00 0.00 H ATOM 1118 N ASP B 74 -36.819 -23.729 13.332 1.00 23.45 N ATOM 1119 CA ASP B 74 -35.812 -24.570 12.715 1.00 23.91 C ATOM 1120 C ASP B 74 -36.117 -24.704 11.138 1.00 24.90 C ATOM 1121 O ASP B 74 -36.212 -25.815 10.580 1.00 23.79 O ATOM 1122 CB ASP B 74 -35.815 -25.949 13.388 1.00 25.48 C ATOM 1123 CG ASP B 74 -37.136 -26.703 13.160 1.00 24.64 C ATOM 1124 OD1 ASP B 74 -38.147 -26.096 12.641 1.00 26.46 O ATOM 1125 OD2 ASP B 74 -37.144 -27.912 13.453 1.00 29.54 O ATOM 1126 HA ASP B 74 -34.826 -24.123 12.842 1.00 0.00 H ATOM 1127 HB2 ASP B 74 -34.997 -26.542 12.979 1.00 0.00 H ATOM 1128 HB3 ASP B 74 -35.666 -25.817 14.460 1.00 0.00 H ATOM 1129 H ASP B 74 -37.826 -23.981 13.266 1.00 0.00 H ATOM 1130 N THR B 75 -36.357 -23.583 10.444 1.00 24.87 N ATOM 1131 CA THR B 75 -36.338 -23.677 8.947 1.00 24.34 C ATOM 1132 C THR B 75 -35.136 -22.970 8.387 1.00 22.89 C ATOM 1133 O THR B 75 -34.983 -22.848 7.166 1.00 21.01 O ATOM 1134 CB THR B 75 -37.668 -23.283 8.190 1.00 26.09 C ATOM 1135 OG1 THR B 75 -38.357 -22.219 8.886 1.00 31.76 O ATOM 1136 CG2 THR B 75 -38.609 -24.588 7.925 1.00 28.79 C ATOM 1137 HA THR B 75 -36.264 -24.746 8.747 1.00 0.00 H ATOM 1138 HB THR B 75 -37.406 -22.896 7.205 1.00 0.00 H ATOM 1139 HG1 THR B 75 -37.769 -21.424 8.936 1.00 0.00 H ATOM 1140 HG23 THR B 75 -38.033 -25.349 7.399 1.00 0.00 H ATOM 1141 HG21 THR B 75 -38.954 -24.986 8.880 1.00 0.00 H ATOM 1142 HG22 THR B 75 -39.468 -24.298 7.319 1.00 0.00 H ATOM 1143 H THR B 75 -36.549 -22.681 10.925 1.00 0.00 H ATOM 1144 N GLU B 76 -34.290 -22.481 9.283 1.00 20.33 N ATOM 1145 CA GLU B 76 -33.053 -21.859 8.890 1.00 22.25 C ATOM 1146 C GLU B 76 -31.874 -22.489 9.623 1.00 18.89 C ATOM 1147 O GLU B 76 -32.049 -23.191 10.634 1.00 16.03 O ATOM 1148 CB GLU B 76 -33.103 -20.364 9.248 1.00 22.95 C ATOM 1149 CG GLU B 76 -33.458 -19.391 8.095 1.00 29.19 C ATOM 1150 CD GLU B 76 -33.281 -17.928 8.547 1.00 28.42 C ATOM 1151 OE1 GLU B 76 -33.917 -17.551 9.560 1.00 40.48 O ATOM 1152 OE2 GLU B 76 -32.483 -17.188 7.943 1.00 37.31 O ATOM 1153 HA GLU B 76 -32.924 -21.997 7.816 1.00 0.00 H ATOM 1154 HB2 GLU B 76 -33.849 -20.235 10.032 1.00 0.00 H ATOM 1155 HB3 GLU B 76 -32.122 -20.081 9.631 1.00 0.00 H ATOM 1156 HG2 GLU B 76 -32.802 -19.586 7.246 1.00 0.00 H ATOM 1157 HG3 GLU B 76 -34.494 -19.551 7.796 1.00 0.00 H ATOM 1158 H GLU B 76 -34.526 -22.548 10.294 1.00 0.00 H ATOM 1159 N ASN B 77 -30.673 -22.219 9.130 1.00 17.65 N ATOM 1160 CA ASN B 77 -29.462 -22.677 9.780 1.00 17.25 C ATOM 1161 C ASN B 77 -28.828 -21.601 10.677 1.00 17.48 C ATOM 1162 O ASN B 77 -27.620 -21.493 10.742 1.00 15.77 O ATOM 1163 CB ASN B 77 -28.489 -23.284 8.731 1.00 17.93 C ATOM 1164 CG ASN B 77 -28.948 -24.630 8.266 1.00 16.58 C ATOM 1165 OD1 ASN B 77 -29.755 -25.274 8.973 1.00 16.43 O ATOM 1166 ND2 ASN B 77 -28.412 -25.116 7.122 1.00 13.25 N ATOM 1167 HA ASN B 77 -29.721 -23.478 10.472 1.00 0.00 H ATOM 1168 HB2 ASN B 77 -28.431 -22.614 7.873 1.00 0.00 H ATOM 1169 HB3 ASN B 77 -27.501 -23.383 9.181 1.00 0.00 H ATOM 1170 HD22 ASN B 77 -27.745 -24.537 6.573 1.00 0.00 H ATOM 1171 HD21 ASN B 77 -28.667 -26.069 6.792 1.00 0.00 H ATOM 1172 H ASN B 77 -30.598 -21.664 8.254 1.00 0.00 H ATOM 1173 N LYS B 78 -29.667 -20.819 11.383 1.00 16.14 N ATOM 1174 CA LYS B 78 -29.105 -19.785 12.282 1.00 17.57 C ATOM 1175 C LYS B 78 -28.498 -20.455 13.539 1.00 16.14 C ATOM 1176 O LYS B 78 -27.512 -19.949 14.095 1.00 14.62 O ATOM 1177 CB LYS B 78 -30.152 -18.733 12.672 1.00 16.87 C ATOM 1178 CG LYS B 78 -30.508 -17.774 11.470 1.00 19.97 C ATOM 1179 CD LYS B 78 -31.570 -16.700 11.878 1.00 22.07 C ATOM 1180 CE LYS B 78 -31.669 -15.575 10.791 1.00 25.55 C ATOM 1181 NZ LYS B 78 -32.250 -14.303 11.323 1.00 33.81 N ATOM 1182 HA LYS B 78 -28.317 -19.261 11.742 1.00 0.00 H ATOM 1183 HB2 LYS B 78 -31.059 -19.243 12.995 1.00 0.00 H ATOM 1184 HB3 LYS B 78 -29.760 -18.135 13.495 1.00 0.00 H ATOM 1185 HG2 LYS B 78 -29.601 -17.267 11.142 1.00 0.00 H ATOM 1186 HG3 LYS B 78 -30.906 -18.370 10.649 1.00 0.00 H ATOM 1187 HD2 LYS B 78 -32.542 -17.181 11.985 1.00 0.00 H ATOM 1188 HD3 LYS B 78 -31.280 -16.254 12.829 1.00 0.00 H ATOM 1189 HE2 LYS B 78 -32.299 -15.932 9.977 1.00 0.00 H ATOM 1190 HE3 LYS B 78 -30.668 -15.369 10.411 1.00 0.00 H ATOM 1191 HZ1 LYS B 78 -33.209 -14.485 11.681 1.00 0.00 H ATOM 1192 HZ2 LYS B 78 -31.652 -13.947 12.096 1.00 0.00 H ATOM 1193 HZ3 LYS B 78 -32.291 -13.597 10.561 1.00 0.00 H ATOM 1194 H LYS B 78 -30.696 -20.940 11.298 1.00 0.00 H ATOM 1195 N SER B 79 -29.074 -21.603 13.939 1.00 14.74 N ATOM 1196 CA SER B 79 -28.651 -22.292 15.186 1.00 13.11 C ATOM 1197 C SER B 79 -28.441 -23.742 14.843 1.00 13.86 C ATOM 1198 O SER B 79 -29.442 -24.450 14.590 1.00 14.15 O ATOM 1199 CB SER B 79 -29.781 -22.217 16.231 1.00 13.26 C ATOM 1200 OG SER B 79 -30.054 -20.900 16.649 1.00 12.91 O ATOM 1201 HA SER B 79 -27.749 -21.828 15.585 1.00 0.00 H ATOM 1202 HB2 SER B 79 -29.490 -22.805 17.101 1.00 0.00 H ATOM 1203 HB3 SER B 79 -30.687 -22.639 15.795 1.00 0.00 H ATOM 1204 HG SER B 79 -30.328 -20.357 15.868 1.00 0.00 H ATOM 1205 H SER B 79 -29.833 -22.018 13.362 1.00 0.00 H ATOM 1206 N VAL B 80 -27.172 -24.156 14.775 1.00 12.71 N ATOM 1207 CA VAL B 80 -26.788 -25.456 14.260 1.00 13.07 C ATOM 1208 C VAL B 80 -25.602 -25.995 15.064 1.00 13.63 C ATOM 1209 O VAL B 80 -24.794 -25.231 15.599 1.00 14.52 O ATOM 1210 CB VAL B 80 -26.394 -25.401 12.756 1.00 12.97 C ATOM 1211 CG1 VAL B 80 -27.596 -25.009 11.923 1.00 12.00 C ATOM 1212 CG2 VAL B 80 -25.196 -24.321 12.540 1.00 14.20 C ATOM 1213 HA VAL B 80 -27.652 -26.113 14.358 1.00 0.00 H ATOM 1214 HB VAL B 80 -26.049 -26.386 12.441 1.00 0.00 H ATOM 1215 HG11 VAL B 80 -28.388 -25.745 12.061 1.00 0.00 H ATOM 1216 HG12 VAL B 80 -27.951 -24.028 12.239 1.00 0.00 H ATOM 1217 HG13 VAL B 80 -27.311 -24.973 10.871 1.00 0.00 H ATOM 1218 HG21 VAL B 80 -25.534 -23.336 12.861 1.00 0.00 H ATOM 1219 HG22 VAL B 80 -24.329 -24.619 13.130 1.00 0.00 H ATOM 1220 HG23 VAL B 80 -24.925 -24.287 11.485 1.00 0.00 H ATOM 1221 H VAL B 80 -26.424 -23.515 15.108 1.00 0.00 H ATOM 1222 N LEU B 81 -25.549 -27.316 15.133 1.00 13.20 N ATOM 1223 CA LEU B 81 -24.530 -28.070 15.813 1.00 14.58 C ATOM 1224 C LEU B 81 -23.836 -28.813 14.679 1.00 15.92 C ATOM 1225 O LEU B 81 -24.492 -29.457 13.850 1.00 14.94 O ATOM 1226 CB LEU B 81 -25.168 -29.084 16.797 1.00 15.05 C ATOM 1227 CG LEU B 81 -24.150 -30.029 17.454 1.00 14.53 C ATOM 1228 CD1 LEU B 81 -23.193 -29.167 18.294 1.00 13.68 C ATOM 1229 CD2 LEU B 81 -24.925 -31.094 18.253 1.00 15.87 C ATOM 1230 HA LEU B 81 -23.858 -27.445 16.402 1.00 0.00 H ATOM 1231 HB2 LEU B 81 -25.679 -28.527 17.583 1.00 0.00 H ATOM 1232 HB3 LEU B 81 -25.894 -29.686 16.250 1.00 0.00 H ATOM 1233 HG LEU B 81 -23.538 -30.575 16.736 1.00 0.00 H ATOM 1234 HD21 LEU B 81 -25.529 -30.605 19.017 1.00 0.00 H ATOM 1235 HD22 LEU B 81 -25.573 -31.653 17.578 1.00 0.00 H ATOM 1236 HD23 LEU B 81 -24.219 -31.775 18.728 1.00 0.00 H ATOM 1237 HD11 LEU B 81 -22.686 -28.452 17.646 1.00 0.00 H ATOM 1238 HD12 LEU B 81 -23.761 -28.631 19.054 1.00 0.00 H ATOM 1239 HD13 LEU B 81 -22.455 -29.809 18.775 1.00 0.00 H ATOM 1240 H LEU B 81 -26.304 -27.851 14.658 1.00 0.00 H ATOM 1241 N ARG B 82 -22.514 -28.660 14.617 1.00 15.45 N ATOM 1242 CA ARG B 82 -21.698 -29.375 13.606 1.00 15.56 C ATOM 1243 C ARG B 82 -20.492 -29.908 14.325 1.00 14.54 C ATOM 1244 O ARG B 82 -20.281 -29.588 15.486 1.00 16.28 O ATOM 1245 CB ARG B 82 -21.286 -28.387 12.505 1.00 14.54 C ATOM 1246 CG ARG B 82 -22.477 -27.923 11.626 1.00 17.05 C ATOM 1247 CD ARG B 82 -22.131 -26.651 10.759 1.00 14.52 C ATOM 1248 NE ARG B 82 -22.082 -25.432 11.579 1.00 21.27 N ATOM 1249 CZ ARG B 82 -21.807 -24.204 11.131 1.00 22.63 C ATOM 1250 NH1 ARG B 82 -21.586 -24.018 9.836 1.00 17.65 N ATOM 1251 NH2 ARG B 82 -21.762 -23.158 11.970 1.00 16.48 N ATOM 1252 HA ARG B 82 -22.249 -30.190 13.137 1.00 0.00 H ATOM 1253 HB2 ARG B 82 -20.839 -27.511 12.975 1.00 0.00 H ATOM 1254 HB3 ARG B 82 -20.549 -28.870 11.864 1.00 0.00 H ATOM 1255 HG2 ARG B 82 -22.755 -28.737 10.957 1.00 0.00 H ATOM 1256 HG3 ARG B 82 -23.319 -27.685 12.276 1.00 0.00 H ATOM 1257 HD2 ARG B 82 -22.893 -26.529 9.990 1.00 0.00 H ATOM 1258 HD3 ARG B 82 -21.160 -26.799 10.286 1.00 0.00 H ATOM 1259 HE ARG B 82 -22.278 -25.534 12.595 1.00 0.00 H ATOM 1260 HH12 ARG B 82 -21.371 -23.066 9.477 1.00 0.00 H ATOM 1261 HH11 ARG B 82 -21.628 -24.824 9.180 1.00 0.00 H ATOM 1262 HH22 ARG B 82 -21.547 -22.208 11.606 1.00 0.00 H ATOM 1263 HH21 ARG B 82 -21.943 -23.297 12.985 1.00 0.00 H ATOM 1264 H ARG B 82 -22.044 -28.025 15.293 1.00 0.00 H ATOM 1265 N GLY B 83 -19.716 -30.731 13.663 1.00 17.90 N ATOM 1266 CA GLY B 83 -18.445 -31.202 14.198 1.00 16.88 C ATOM 1267 C GLY B 83 -18.660 -32.388 15.121 1.00 17.85 C ATOM 1268 O GLY B 83 -19.677 -33.089 15.051 1.00 15.23 O ATOM 1269 HA3 GLY B 83 -17.970 -30.395 14.756 1.00 0.00 H ATOM 1270 HA2 GLY B 83 -17.798 -31.502 13.374 1.00 0.00 H ATOM 1271 H GLY B 83 -20.018 -31.059 12.723 1.00 0.00 H ATOM 1272 N GLY B 84 -17.732 -32.550 16.064 1.00 17.96 N ATOM 1273 CA GLY B 84 -17.678 -33.714 16.908 1.00 19.30 C ATOM 1274 C GLY B 84 -17.804 -34.993 16.075 1.00 18.53 C ATOM 1275 O GLY B 84 -17.074 -35.189 15.126 1.00 22.61 O ATOM 1276 HA3 GLY B 84 -18.496 -33.673 17.627 1.00 0.00 H ATOM 1277 HA2 GLY B 84 -16.727 -33.726 17.441 1.00 0.00 H ATOM 1278 H GLY B 84 -17.018 -31.805 16.195 1.00 0.00 H ATOM 1279 N PRO B 85 -18.766 -35.866 16.409 1.00 17.55 N ATOM 1280 CA PRO B 85 -18.981 -37.085 15.665 1.00 16.79 C ATOM 1281 C PRO B 85 -19.886 -36.914 14.457 1.00 16.45 C ATOM 1282 O PRO B 85 -20.089 -37.908 13.746 1.00 17.84 O ATOM 1283 CB PRO B 85 -19.722 -37.994 16.657 1.00 17.05 C ATOM 1284 CG PRO B 85 -20.649 -36.933 17.414 1.00 18.66 C ATOM 1285 CD PRO B 85 -19.716 -35.697 17.529 1.00 16.89 C ATOM 1286 HA PRO B 85 -18.028 -37.459 15.290 1.00 0.00 H ATOM 1287 HD3 PRO B 85 -20.282 -34.772 17.422 1.00 0.00 H ATOM 1288 HD2 PRO B 85 -19.193 -35.693 18.485 1.00 0.00 H ATOM 1289 HG3 PRO B 85 -20.944 -37.298 18.398 1.00 0.00 H ATOM 1290 HG2 PRO B 85 -21.541 -36.702 16.831 1.00 0.00 H ATOM 1291 HB2 PRO B 85 -20.316 -38.749 16.141 1.00 0.00 H ATOM 1292 HB3 PRO B 85 -19.032 -38.484 17.344 1.00 0.00 H ATOM 1293 N LEU B 86 -20.324 -35.679 14.156 1.00 14.64 N ATOM 1294 CA LEU B 86 -21.437 -35.525 13.222 1.00 15.85 C ATOM 1295 C LEU B 86 -20.984 -35.316 11.789 1.00 16.91 C ATOM 1296 O LEU B 86 -20.072 -34.558 11.545 1.00 18.18 O ATOM 1297 CB LEU B 86 -22.268 -34.293 13.610 1.00 13.41 C ATOM 1298 CG LEU B 86 -22.931 -34.378 15.017 1.00 15.04 C ATOM 1299 CD1 LEU B 86 -23.631 -33.091 15.319 1.00 12.25 C ATOM 1300 CD2 LEU B 86 -23.882 -35.684 15.164 1.00 10.79 C ATOM 1301 HA LEU B 86 -22.012 -36.449 13.280 1.00 0.00 H ATOM 1302 HB2 LEU B 86 -21.613 -33.422 13.594 1.00 0.00 H ATOM 1303 HB3 LEU B 86 -23.057 -34.167 12.869 1.00 0.00 H ATOM 1304 HG LEU B 86 -22.155 -34.514 15.771 1.00 0.00 H ATOM 1305 HD21 LEU B 86 -24.674 -35.641 14.416 1.00 0.00 H ATOM 1306 HD22 LEU B 86 -23.286 -36.584 15.013 1.00 0.00 H ATOM 1307 HD23 LEU B 86 -24.322 -35.701 16.161 1.00 0.00 H ATOM 1308 HD11 LEU B 86 -22.909 -32.275 15.306 1.00 0.00 H ATOM 1309 HD12 LEU B 86 -24.398 -32.911 14.566 1.00 0.00 H ATOM 1310 HD13 LEU B 86 -24.094 -33.153 16.304 1.00 0.00 H ATOM 1311 H LEU B 86 -19.876 -34.843 14.583 1.00 0.00 H ATOM 1312 N THR B 87 -21.691 -35.930 10.855 1.00 18.00 N ATOM 1313 CA THR B 87 -21.544 -35.595 9.452 1.00 18.01 C ATOM 1314 C THR B 87 -22.659 -34.612 9.091 1.00 17.48 C ATOM 1315 O THR B 87 -23.849 -34.945 9.233 1.00 19.88 O ATOM 1316 CB THR B 87 -21.675 -36.888 8.596 1.00 18.45 C ATOM 1317 OG1 THR B 87 -20.622 -37.782 8.983 1.00 19.58 O ATOM 1318 CG2 THR B 87 -21.616 -36.597 7.010 1.00 18.06 C ATOM 1319 HA THR B 87 -20.569 -35.148 9.258 1.00 0.00 H ATOM 1320 HB THR B 87 -22.653 -37.332 8.783 1.00 0.00 H ATOM 1321 HG1 THR B 87 -20.710 -37.997 9.945 1.00 0.00 H ATOM 1322 HG23 THR B 87 -22.423 -35.917 6.736 1.00 0.00 H ATOM 1323 HG21 THR B 87 -20.657 -36.144 6.761 1.00 0.00 H ATOM 1324 HG22 THR B 87 -21.729 -37.534 6.465 1.00 0.00 H ATOM 1325 H THR B 87 -22.367 -36.669 11.133 1.00 0.00 H ATOM 1326 N GLY B 88 -22.268 -33.432 8.627 1.00 16.90 N ATOM 1327 CA GLY B 88 -23.189 -32.379 8.188 1.00 17.87 C ATOM 1328 C GLY B 88 -23.771 -31.525 9.343 1.00 17.95 C ATOM 1329 O GLY B 88 -23.305 -31.583 10.484 1.00 18.54 O ATOM 1330 HA3 GLY B 88 -24.018 -32.848 7.658 1.00 0.00 H ATOM 1331 HA2 GLY B 88 -22.653 -31.716 7.509 1.00 0.00 H ATOM 1332 H GLY B 88 -21.247 -33.243 8.571 1.00 0.00 H ATOM 1333 N SER B 89 -24.808 -30.764 9.013 1.00 16.29 N ATOM 1334 CA SER B 89 -25.375 -29.770 9.895 1.00 16.18 C ATOM 1335 C SER B 89 -26.711 -30.294 10.544 1.00 14.90 C ATOM 1336 O SER B 89 -27.659 -30.670 9.895 1.00 15.04 O ATOM 1337 CB SER B 89 -25.570 -28.450 9.155 1.00 14.47 C ATOM 1338 OG SER B 89 -26.051 -27.413 9.995 1.00 14.59 O ATOM 1339 HA SER B 89 -24.678 -29.584 10.712 1.00 0.00 H ATOM 1340 HB2 SER B 89 -26.287 -28.605 8.348 1.00 0.00 H ATOM 1341 HB3 SER B 89 -24.613 -28.142 8.734 1.00 0.00 H ATOM 1342 HG SER B 89 -26.925 -27.678 10.377 1.00 0.00 H ATOM 1343 H SER B 89 -25.233 -30.890 8.072 1.00 0.00 H ATOM 1344 N TYR B 90 -26.725 -30.223 11.858 1.00 14.81 N ATOM 1345 CA TYR B 90 -27.855 -30.582 12.642 1.00 13.05 C ATOM 1346 C TYR B 90 -28.453 -29.311 13.238 1.00 12.57 C ATOM 1347 O TYR B 90 -27.846 -28.561 14.032 1.00 12.66 O ATOM 1348 CB TYR B 90 -27.392 -31.554 13.726 1.00 12.38 C ATOM 1349 CG TYR B 90 -27.130 -32.929 13.194 1.00 13.06 C ATOM 1350 CD1 TYR B 90 -25.977 -33.193 12.378 1.00 12.23 C ATOM 1351 CD2 TYR B 90 -28.015 -33.975 13.466 1.00 11.22 C ATOM 1352 CE1 TYR B 90 -25.740 -34.477 11.870 1.00 11.04 C ATOM 1353 CE2 TYR B 90 -27.755 -35.280 12.963 1.00 12.06 C ATOM 1354 CZ TYR B 90 -26.636 -35.500 12.168 1.00 10.57 C ATOM 1355 OH TYR B 90 -26.414 -36.779 11.665 1.00 14.45 O ATOM 1356 HA TYR B 90 -28.624 -31.071 12.045 1.00 0.00 H ATOM 1357 HB3 TYR B 90 -28.165 -31.617 14.492 1.00 0.00 H ATOM 1358 HB2 TYR B 90 -26.473 -31.170 14.170 1.00 0.00 H ATOM 1359 HD2 TYR B 90 -28.907 -33.791 14.065 1.00 0.00 H ATOM 1360 HE2 TYR B 90 -28.429 -36.103 13.200 1.00 0.00 H ATOM 1361 HE1 TYR B 90 -24.865 -34.672 11.250 1.00 0.00 H ATOM 1362 HD1 TYR B 90 -25.280 -32.386 12.152 1.00 0.00 H ATOM 1363 HH TYR B 90 -27.181 -37.048 11.100 1.00 0.00 H ATOM 1364 H TYR B 90 -25.869 -29.889 12.346 1.00 0.00 H ATOM 1365 N ARG B 91 -29.688 -29.101 12.878 1.00 11.93 N ATOM 1366 CA ARG B 91 -30.379 -27.880 13.191 1.00 12.70 C ATOM 1367 C ARG B 91 -31.029 -27.916 14.588 1.00 11.79 C ATOM 1368 O ARG B 91 -31.765 -28.826 14.904 1.00 12.29 O ATOM 1369 CB ARG B 91 -31.503 -27.663 12.181 1.00 12.79 C ATOM 1370 CG ARG B 91 -32.105 -26.221 12.218 1.00 13.99 C ATOM 1371 CD ARG B 91 -33.129 -26.079 11.127 1.00 11.85 C ATOM 1372 NE ARG B 91 -32.442 -26.038 9.864 1.00 15.46 N ATOM 1373 CZ ARG B 91 -32.985 -26.279 8.655 1.00 16.84 C ATOM 1374 NH1 ARG B 91 -34.270 -26.583 8.541 1.00 16.03 N ATOM 1375 NH2 ARG B 91 -32.209 -26.237 7.561 1.00 8.51 N ATOM 1376 HA ARG B 91 -29.638 -27.081 13.161 1.00 0.00 H ATOM 1377 HB2 ARG B 91 -31.109 -27.847 11.181 1.00 0.00 H ATOM 1378 HB3 ARG B 91 -32.300 -28.375 12.393 1.00 0.00 H ATOM 1379 HG2 ARG B 91 -32.577 -26.049 13.185 1.00 0.00 H ATOM 1380 HG3 ARG B 91 -31.310 -25.491 12.068 1.00 0.00 H ATOM 1381 HD2 ARG B 91 -33.694 -25.158 11.269 1.00 0.00 H ATOM 1382 HD3 ARG B 91 -33.811 -26.929 11.148 1.00 0.00 H ATOM 1383 HE ARG B 91 -31.430 -25.800 9.886 1.00 0.00 H ATOM 1384 HH12 ARG B 91 -34.680 -26.767 7.603 1.00 0.00 H ATOM 1385 HH11 ARG B 91 -34.869 -26.637 9.390 1.00 0.00 H ATOM 1386 HH22 ARG B 91 -32.621 -26.422 6.624 1.00 0.00 H ATOM 1387 HH21 ARG B 91 -31.196 -26.020 7.650 1.00 0.00 H ATOM 1388 H ARG B 91 -30.190 -29.841 12.347 1.00 0.00 H ATOM 1389 N LEU B 92 -30.857 -26.865 15.371 1.00 12.41 N ATOM 1390 CA LEU B 92 -31.490 -26.864 16.708 1.00 10.66 C ATOM 1391 C LEU B 92 -33.004 -26.908 16.592 1.00 12.98 C ATOM 1392 O LEU B 92 -33.585 -26.183 15.819 1.00 13.21 O ATOM 1393 CB LEU B 92 -31.042 -25.623 17.483 1.00 11.41 C ATOM 1394 CG LEU B 92 -31.644 -25.340 18.831 1.00 10.35 C ATOM 1395 CD1 LEU B 92 -31.208 -26.481 19.762 1.00 8.06 C ATOM 1396 CD2 LEU B 92 -31.165 -23.930 19.321 1.00 10.46 C ATOM 1397 HA LEU B 92 -31.175 -27.756 17.249 1.00 0.00 H ATOM 1398 HB2 LEU B 92 -29.965 -25.710 17.627 1.00 0.00 H ATOM 1399 HB3 LEU B 92 -31.255 -24.760 16.852 1.00 0.00 H ATOM 1400 HG LEU B 92 -32.733 -25.305 18.807 1.00 0.00 H ATOM 1401 HD21 LEU B 92 -30.078 -23.923 19.396 1.00 0.00 H ATOM 1402 HD22 LEU B 92 -31.487 -23.171 18.608 1.00 0.00 H ATOM 1403 HD23 LEU B 92 -31.599 -23.720 20.299 1.00 0.00 H ATOM 1404 HD11 LEU B 92 -31.572 -27.430 19.367 1.00 0.00 H ATOM 1405 HD12 LEU B 92 -30.120 -26.504 19.821 1.00 0.00 H ATOM 1406 HD13 LEU B 92 -31.624 -26.316 20.756 1.00 0.00 H ATOM 1407 H LEU B 92 -30.288 -26.055 15.053 1.00 0.00 H ATOM 1408 N ARG B 93 -33.636 -27.801 17.356 1.00 12.70 N ATOM 1409 CA ARG B 93 -35.065 -27.988 17.372 1.00 12.72 C ATOM 1410 C ARG B 93 -35.625 -27.564 18.725 1.00 12.49 C ATOM 1411 O ARG B 93 -36.595 -26.823 18.800 1.00 13.17 O ATOM 1412 CB ARG B 93 -35.363 -29.478 17.080 1.00 14.02 C ATOM 1413 CG ARG B 93 -36.820 -29.899 17.302 1.00 16.75 C ATOM 1414 CD ARG B 93 -37.761 -29.147 16.348 1.00 18.28 C ATOM 1415 NE ARG B 93 -39.063 -29.809 16.377 1.00 22.13 N ATOM 1416 CZ ARG B 93 -40.019 -29.671 15.449 1.00 30.98 C ATOM 1417 NH1 ARG B 93 -39.835 -28.856 14.400 1.00 30.57 N ATOM 1418 NH2 ARG B 93 -41.164 -30.368 15.552 1.00 30.44 N ATOM 1419 HA ARG B 93 -35.543 -27.373 16.610 1.00 0.00 H ATOM 1420 HB2 ARG B 93 -35.107 -29.677 16.039 1.00 0.00 H ATOM 1421 HB3 ARG B 93 -34.732 -30.084 17.730 1.00 0.00 H ATOM 1422 HG2 ARG B 93 -36.913 -30.970 17.124 1.00 0.00 H ATOM 1423 HG3 ARG B 93 -37.103 -29.677 18.331 1.00 0.00 H ATOM 1424 HD2 ARG B 93 -37.357 -29.170 15.336 1.00 0.00 H ATOM 1425 HD3 ARG B 93 -37.866 -28.112 16.672 1.00 0.00 H ATOM 1426 HE ARG B 93 -39.263 -30.437 17.182 1.00 0.00 H ATOM 1427 HH12 ARG B 93 -40.582 -28.754 13.683 1.00 0.00 H ATOM 1428 HH11 ARG B 93 -38.945 -28.326 14.303 1.00 0.00 H ATOM 1429 HH22 ARG B 93 -41.905 -30.260 14.831 1.00 0.00 H ATOM 1430 HH21 ARG B 93 -41.308 -31.015 16.353 1.00 0.00 H ATOM 1431 H ARG B 93 -33.060 -28.401 17.980 1.00 0.00 H ATOM 1432 N GLN B 94 -35.071 -28.103 19.808 1.00 12.38 N ATOM 1433 CA GLN B 94 -35.674 -27.854 21.080 1.00 11.30 C ATOM 1434 C GLN B 94 -34.779 -28.155 22.265 1.00 11.54 C ATOM 1435 O GLN B 94 -33.777 -28.879 22.142 1.00 10.35 O ATOM 1436 CB GLN B 94 -37.019 -28.605 21.175 1.00 14.15 C ATOM 1437 CG GLN B 94 -36.915 -30.050 21.237 1.00 13.56 C ATOM 1438 CD GLN B 94 -37.072 -30.536 22.673 1.00 19.76 C ATOM 1439 OE1 GLN B 94 -36.102 -30.618 23.420 1.00 17.83 O ATOM 1440 NE2 GLN B 94 -38.276 -30.923 23.026 1.00 15.49 N ATOM 1441 HA GLN B 94 -35.850 -26.780 21.138 1.00 0.00 H ATOM 1442 HB2 GLN B 94 -37.533 -28.265 22.074 1.00 0.00 H ATOM 1443 HB3 GLN B 94 -37.613 -28.346 20.298 1.00 0.00 H ATOM 1444 HG2 GLN B 94 -37.697 -30.493 20.621 1.00 0.00 H ATOM 1445 HG3 GLN B 94 -35.940 -30.356 20.859 1.00 0.00 H ATOM 1446 HE22 GLN B 94 -39.068 -30.834 22.358 1.00 0.00 H ATOM 1447 HE21 GLN B 94 -38.438 -31.319 23.974 1.00 0.00 H ATOM 1448 H GLN B 94 -34.218 -28.693 19.731 1.00 0.00 H ATOM 1449 N VAL B 95 -35.182 -27.616 23.409 1.00 10.49 N ATOM 1450 CA VAL B 95 -34.455 -27.818 24.654 1.00 9.97 C ATOM 1451 C VAL B 95 -35.459 -28.285 25.701 1.00 9.91 C ATOM 1452 O VAL B 95 -36.577 -27.713 25.801 1.00 10.16 O ATOM 1453 CB VAL B 95 -33.634 -26.526 25.064 1.00 10.25 C ATOM 1454 CG1 VAL B 95 -33.071 -26.643 26.507 1.00 9.73 C ATOM 1455 CG2 VAL B 95 -32.486 -26.262 24.065 1.00 8.32 C ATOM 1456 HA VAL B 95 -33.692 -28.589 24.546 1.00 0.00 H ATOM 1457 HB VAL B 95 -34.323 -25.682 25.037 1.00 0.00 H ATOM 1458 HG11 VAL B 95 -33.896 -26.765 27.209 1.00 0.00 H ATOM 1459 HG12 VAL B 95 -32.409 -27.507 26.568 1.00 0.00 H ATOM 1460 HG13 VAL B 95 -32.514 -25.739 26.753 1.00 0.00 H ATOM 1461 HG21 VAL B 95 -31.811 -27.118 24.055 1.00 0.00 H ATOM 1462 HG22 VAL B 95 -32.901 -26.113 23.068 1.00 0.00 H ATOM 1463 HG23 VAL B 95 -31.939 -25.370 24.370 1.00 0.00 H ATOM 1464 H VAL B 95 -36.043 -27.032 23.416 1.00 0.00 H ATOM 1465 N HIS B 96 -35.072 -29.289 26.481 1.00 9.36 N ATOM 1466 CA HIS B 96 -35.875 -29.666 27.683 1.00 8.99 C ATOM 1467 C HIS B 96 -34.970 -30.131 28.798 1.00 10.15 C ATOM 1468 O HIS B 96 -33.711 -30.136 28.658 1.00 10.10 O ATOM 1469 CB HIS B 96 -36.930 -30.755 27.325 1.00 6.27 C ATOM 1470 CG HIS B 96 -36.313 -32.008 26.825 1.00 7.83 C ATOM 1471 ND1 HIS B 96 -35.938 -32.204 25.507 1.00 9.31 N ATOM 1472 CD2 HIS B 96 -35.880 -33.095 27.517 1.00 7.19 C ATOM 1473 CE1 HIS B 96 -35.310 -33.364 25.412 1.00 12.18 C ATOM 1474 NE2 HIS B 96 -35.237 -33.914 26.626 1.00 8.01 N ATOM 1475 HA HIS B 96 -36.413 -28.783 28.029 1.00 0.00 H ATOM 1476 HB2 HIS B 96 -37.511 -30.985 28.218 1.00 0.00 H ATOM 1477 HB3 HIS B 96 -37.591 -30.360 26.554 1.00 0.00 H ATOM 1478 HD2 HIS B 96 -36.018 -33.281 28.582 1.00 0.00 H ATOM 1479 HE1 HIS B 96 -34.917 -33.799 24.493 1.00 0.00 H ATOM 1480 H HIS B 96 -34.205 -29.816 26.253 1.00 0.00 H ATOM 1481 N LEU B 97 -35.604 -30.529 29.915 1.00 10.69 N ATOM 1482 CA LEU B 97 -34.850 -30.916 31.106 1.00 10.92 C ATOM 1483 C LEU B 97 -35.435 -32.141 31.787 1.00 11.37 C ATOM 1484 O LEU B 97 -36.667 -32.275 31.839 1.00 13.70 O ATOM 1485 CB LEU B 97 -34.948 -29.768 32.134 1.00 8.89 C ATOM 1486 CG LEU B 97 -34.022 -29.877 33.354 1.00 7.44 C ATOM 1487 CD1 LEU B 97 -32.531 -29.804 32.974 1.00 11.73 C ATOM 1488 CD2 LEU B 97 -34.435 -28.722 34.378 1.00 10.50 C ATOM 1489 HA LEU B 97 -33.829 -31.129 30.789 1.00 0.00 H ATOM 1490 HB2 LEU B 97 -34.713 -28.837 31.618 1.00 0.00 H ATOM 1491 HB3 LEU B 97 -35.975 -29.731 32.497 1.00 0.00 H ATOM 1492 HG LEU B 97 -34.146 -30.855 33.819 1.00 0.00 H ATOM 1493 HD21 LEU B 97 -34.317 -27.752 33.896 1.00 0.00 H ATOM 1494 HD22 LEU B 97 -35.475 -28.857 34.676 1.00 0.00 H ATOM 1495 HD23 LEU B 97 -33.794 -28.772 35.258 1.00 0.00 H ATOM 1496 HD11 LEU B 97 -32.290 -30.622 32.296 1.00 0.00 H ATOM 1497 HD12 LEU B 97 -32.329 -28.852 32.483 1.00 0.00 H ATOM 1498 HD13 LEU B 97 -31.923 -29.886 33.875 1.00 0.00 H ATOM 1499 H LEU B 97 -36.643 -30.562 29.932 1.00 0.00 H ATOM 1500 N HIS B 98 -34.572 -32.976 32.371 1.00 9.89 N ATOM 1501 CA HIS B 98 -34.999 -34.106 33.204 1.00 9.58 C ATOM 1502 C HIS B 98 -34.515 -33.953 34.646 1.00 9.96 C ATOM 1503 O HIS B 98 -33.440 -33.423 34.890 1.00 11.69 O ATOM 1504 CB HIS B 98 -34.442 -35.424 32.652 1.00 7.65 C ATOM 1505 CG HIS B 98 -34.866 -35.680 31.248 1.00 11.37 C ATOM 1506 ND1 HIS B 98 -36.027 -36.366 30.932 1.00 11.49 N ATOM 1507 CD2 HIS B 98 -34.294 -35.346 30.074 1.00 12.68 C ATOM 1508 CE1 HIS B 98 -36.124 -36.482 29.617 1.00 13.49 C ATOM 1509 NE2 HIS B 98 -35.076 -35.889 29.077 1.00 12.39 N ATOM 1510 HA HIS B 98 -36.089 -34.118 33.186 1.00 0.00 H ATOM 1511 HB2 HIS B 98 -33.353 -35.385 32.687 1.00 0.00 H ATOM 1512 HB3 HIS B 98 -34.795 -36.243 33.279 1.00 0.00 H ATOM 1513 HD2 HIS B 98 -33.386 -34.758 29.939 1.00 0.00 H ATOM 1514 HE1 HIS B 98 -36.928 -36.980 29.075 1.00 0.00 H ATOM 1515 H HIS B 98 -33.554 -32.819 32.229 1.00 0.00 H ATOM 1516 N TRP B 99 -35.336 -34.386 35.584 1.00 10.63 N ATOM 1517 CA TRP B 99 -34.924 -34.258 36.995 1.00 12.18 C ATOM 1518 C TRP B 99 -35.573 -35.454 37.757 1.00 12.10 C ATOM 1519 O TRP B 99 -36.341 -36.215 37.171 1.00 13.44 O ATOM 1520 CB TRP B 99 -35.345 -32.885 37.546 1.00 11.91 C ATOM 1521 CG TRP B 99 -36.878 -32.670 37.403 1.00 12.80 C ATOM 1522 CD1 TRP B 99 -37.853 -33.180 38.206 1.00 12.70 C ATOM 1523 CD2 TRP B 99 -37.547 -31.948 36.347 1.00 14.24 C ATOM 1524 NE1 TRP B 99 -39.128 -32.813 37.746 1.00 14.16 N ATOM 1525 CE2 TRP B 99 -38.964 -32.037 36.611 1.00 16.17 C ATOM 1526 CE3 TRP B 99 -37.092 -31.222 35.225 1.00 9.42 C ATOM 1527 CZ2 TRP B 99 -39.932 -31.440 35.778 1.00 13.97 C ATOM 1528 CZ3 TRP B 99 -38.056 -30.596 34.379 1.00 12.75 C ATOM 1529 CH2 TRP B 99 -39.483 -30.746 34.639 1.00 9.70 C ATOM 1530 HA TRP B 99 -33.842 -34.302 37.117 1.00 0.00 H ATOM 1531 HB2 TRP B 99 -35.074 -32.826 38.600 1.00 0.00 H ATOM 1532 HB3 TRP B 99 -34.823 -32.104 36.993 1.00 0.00 H ATOM 1533 HE1 TRP B 99 -40.035 -33.077 38.181 1.00 0.00 H ATOM 1534 HD1 TRP B 99 -37.668 -33.792 39.089 1.00 0.00 H ATOM 1535 HZ2 TRP B 99 -40.995 -31.514 36.009 1.00 0.00 H ATOM 1536 HH2 TRP B 99 -40.207 -30.317 33.946 1.00 0.00 H ATOM 1537 HZ3 TRP B 99 -37.722 -30.000 33.530 1.00 0.00 H ATOM 1538 HE3 TRP B 99 -36.027 -31.141 35.009 1.00 0.00 H ATOM 1539 H TRP B 99 -36.253 -34.808 35.334 1.00 0.00 H ATOM 1540 N GLY B 100 -35.289 -35.593 39.049 1.00 12.54 N ATOM 1541 CA GLY B 100 -35.996 -36.566 39.896 1.00 13.30 C ATOM 1542 C GLY B 100 -36.769 -35.925 41.052 1.00 13.72 C ATOM 1543 O GLY B 100 -36.793 -34.695 41.210 1.00 14.12 O ATOM 1544 HA3 GLY B 100 -35.263 -37.257 40.312 1.00 0.00 H ATOM 1545 HA2 GLY B 100 -36.701 -37.117 39.273 1.00 0.00 H ATOM 1546 H GLY B 100 -34.548 -34.998 39.471 1.00 0.00 H ATOM 1547 N SER B 101 -37.365 -36.740 41.900 1.00 13.80 N ATOM 1548 CA SER B 101 -38.170 -36.179 42.993 1.00 15.95 C ATOM 1549 C SER B 101 -37.289 -35.596 44.107 1.00 15.57 C ATOM 1550 O SER B 101 -37.798 -34.911 44.993 1.00 18.98 O ATOM 1551 CB SER B 101 -39.148 -37.226 43.569 1.00 14.94 C ATOM 1552 OG SER B 101 -38.424 -38.411 43.816 1.00 19.27 O ATOM 1553 HA SER B 101 -38.756 -35.364 42.568 1.00 0.00 H ATOM 1554 HB2 SER B 101 -39.945 -37.422 42.852 1.00 0.00 H ATOM 1555 HB3 SER B 101 -39.581 -36.856 44.499 1.00 0.00 H ATOM 1556 HG SER B 101 -39.033 -39.098 44.187 1.00 0.00 H ATOM 1557 H SER B 101 -37.266 -37.770 41.796 1.00 0.00 H ATOM 1558 N ALA B 102 -36.005 -35.935 44.114 1.00 17.51 N ATOM 1559 CA ALA B 102 -35.083 -35.414 45.111 1.00 17.55 C ATOM 1560 C ALA B 102 -33.767 -35.065 44.451 1.00 16.61 C ATOM 1561 O ALA B 102 -33.433 -35.606 43.386 1.00 16.50 O ATOM 1562 CB ALA B 102 -34.859 -36.410 46.248 1.00 16.39 C ATOM 1563 HA ALA B 102 -35.523 -34.517 45.546 1.00 0.00 H ATOM 1564 HB1 ALA B 102 -35.810 -36.622 46.737 1.00 0.00 H ATOM 1565 HB2 ALA B 102 -34.443 -37.333 45.844 1.00 0.00 H ATOM 1566 HB3 ALA B 102 -34.165 -35.983 46.972 1.00 0.00 H ATOM 1567 H ALA B 102 -35.650 -36.590 43.388 1.00 0.00 H ATOM 1568 N ASP B 103 -33.019 -34.147 45.066 1.00 16.60 N ATOM 1569 CA ASP B 103 -31.776 -33.616 44.451 1.00 17.41 C ATOM 1570 C ASP B 103 -30.633 -34.562 44.246 1.00 18.48 C ATOM 1571 O ASP B 103 -29.733 -34.309 43.439 1.00 19.14 O ATOM 1572 CB ASP B 103 -31.204 -32.486 45.279 1.00 17.08 C ATOM 1573 CG ASP B 103 -32.077 -31.251 45.370 1.00 18.78 C ATOM 1574 OD1 ASP B 103 -33.052 -31.072 44.611 1.00 18.61 O ATOM 1575 OD2 ASP B 103 -31.735 -30.426 46.246 1.00 22.53 O ATOM 1576 HA ASP B 103 -32.140 -33.326 43.465 1.00 0.00 H ATOM 1577 HB2 ASP B 103 -31.038 -32.858 46.290 1.00 0.00 H ATOM 1578 HB3 ASP B 103 -30.250 -32.194 44.840 1.00 0.00 H ATOM 1579 H ASP B 103 -33.314 -33.795 45.999 1.00 0.00 H ATOM 1580 N ASP B 104 -30.644 -35.668 44.973 1.00 19.27 N ATOM 1581 CA ASP B 104 -29.537 -36.646 44.944 1.00 21.27 C ATOM 1582 C ASP B 104 -29.483 -37.442 43.621 1.00 22.00 C ATOM 1583 O ASP B 104 -28.443 -37.975 43.255 1.00 21.96 O ATOM 1584 CB ASP B 104 -29.664 -37.603 46.160 1.00 22.36 C ATOM 1585 CG ASP B 104 -30.977 -38.390 46.161 1.00 23.76 C ATOM 1586 OD1 ASP B 104 -32.000 -37.886 46.660 1.00 29.36 O ATOM 1587 OD2 ASP B 104 -31.001 -39.497 45.618 1.00 28.18 O ATOM 1588 HA ASP B 104 -28.600 -36.093 45.007 1.00 0.00 H ATOM 1589 HB2 ASP B 104 -28.834 -38.309 46.136 1.00 0.00 H ATOM 1590 HB3 ASP B 104 -29.611 -37.013 47.075 1.00 0.00 H ATOM 1591 H ASP B 104 -31.462 -35.855 45.587 1.00 0.00 H ATOM 1592 N HIS B 105 -30.578 -37.510 42.865 1.00 21.03 N ATOM 1593 CA HIS B 105 -30.439 -38.080 41.513 1.00 22.63 C ATOM 1594 C HIS B 105 -31.509 -37.545 40.577 1.00 21.71 C ATOM 1595 O HIS B 105 -32.380 -36.808 41.000 1.00 22.93 O ATOM 1596 CB HIS B 105 -30.428 -39.627 41.493 1.00 22.65 C ATOM 1597 CG HIS B 105 -31.604 -40.255 42.175 1.00 28.20 C ATOM 1598 ND1 HIS B 105 -32.716 -40.704 41.487 1.00 36.37 N ATOM 1599 CD2 HIS B 105 -31.858 -40.484 43.485 1.00 32.35 C ATOM 1600 CE1 HIS B 105 -33.597 -41.195 42.348 1.00 35.75 C ATOM 1601 NE2 HIS B 105 -33.099 -41.075 43.566 1.00 37.32 N ATOM 1602 HA HIS B 105 -29.461 -37.758 41.157 1.00 0.00 H ATOM 1603 HB2 HIS B 105 -30.418 -39.956 40.454 1.00 0.00 H ATOM 1604 HB3 HIS B 105 -29.520 -39.970 41.990 1.00 0.00 H ATOM 1605 HD2 HIS B 105 -31.201 -40.245 44.321 1.00 0.00 H ATOM 1606 HE1 HIS B 105 -34.566 -41.624 42.094 1.00 0.00 H ATOM 1607 H HIS B 105 -31.497 -37.173 43.216 1.00 0.00 H ATOM 1608 N GLY B 106 -31.458 -37.918 39.298 1.00 19.55 N ATOM 1609 CA GLY B 106 -32.363 -37.252 38.385 1.00 17.44 C ATOM 1610 C GLY B 106 -31.798 -37.053 37.021 1.00 16.31 C ATOM 1611 O GLY B 106 -32.570 -36.934 36.065 1.00 16.58 O ATOM 1612 HA3 GLY B 106 -32.614 -36.276 38.800 1.00 0.00 H ATOM 1613 HA2 GLY B 106 -33.269 -37.852 38.299 1.00 0.00 H ATOM 1614 H GLY B 106 -30.799 -38.653 38.971 1.00 0.00 H ATOM 1615 N SER B 107 -30.469 -37.070 36.896 1.00 15.12 N ATOM 1616 CA SER B 107 -29.880 -37.230 35.539 1.00 14.52 C ATOM 1617 C SER B 107 -30.312 -38.541 34.820 1.00 14.52 C ATOM 1618 O SER B 107 -30.657 -39.593 35.468 1.00 14.28 O ATOM 1619 CB SER B 107 -28.376 -37.044 35.509 1.00 11.84 C ATOM 1620 OG SER B 107 -27.662 -38.113 36.114 1.00 13.00 O ATOM 1621 HA SER B 107 -30.307 -36.410 34.962 1.00 0.00 H ATOM 1622 HB2 SER B 107 -28.131 -36.122 36.037 1.00 0.00 H ATOM 1623 HB3 SER B 107 -28.059 -36.961 34.470 1.00 0.00 H ATOM 1624 HG SER B 107 -27.867 -38.956 35.638 1.00 0.00 H ATOM 1625 H SER B 107 -29.857 -36.973 37.731 1.00 0.00 H ATOM 1626 N GLU B 108 -30.299 -38.478 33.487 1.00 13.01 N ATOM 1627 CA GLU B 108 -30.591 -39.712 32.710 1.00 12.87 C ATOM 1628 C GLU B 108 -29.351 -40.582 32.540 1.00 12.70 C ATOM 1629 O GLU B 108 -29.355 -41.772 32.876 1.00 13.38 O ATOM 1630 CB GLU B 108 -31.258 -39.308 31.388 1.00 10.75 C ATOM 1631 CG GLU B 108 -32.585 -38.612 31.680 1.00 15.82 C ATOM 1632 CD GLU B 108 -33.628 -38.915 30.593 1.00 16.45 C ATOM 1633 OE1 GLU B 108 -33.263 -38.761 29.423 1.00 13.71 O ATOM 1634 OE2 GLU B 108 -34.760 -39.331 30.893 1.00 12.01 O ATOM 1635 HA GLU B 108 -31.289 -40.346 33.257 1.00 0.00 H ATOM 1636 HB2 GLU B 108 -30.603 -38.628 30.843 1.00 0.00 H ATOM 1637 HB3 GLU B 108 -31.439 -40.198 30.785 1.00 0.00 H ATOM 1638 HG2 GLU B 108 -32.964 -38.959 32.642 1.00 0.00 H ATOM 1639 HG3 GLU B 108 -32.419 -37.536 31.723 1.00 0.00 H ATOM 1640 H GLU B 108 -30.089 -37.583 33.001 1.00 0.00 H ATOM 1641 N HIS B 109 -28.272 -39.995 32.050 1.00 12.88 N ATOM 1642 CA HIS B 109 -26.981 -40.644 31.989 1.00 13.35 C ATOM 1643 C HIS B 109 -26.378 -40.628 33.422 1.00 14.59 C ATOM 1644 O HIS B 109 -26.599 -39.698 34.217 1.00 14.22 O ATOM 1645 CB HIS B 109 -26.080 -39.947 30.965 1.00 13.46 C ATOM 1646 CG HIS B 109 -26.601 -40.054 29.542 1.00 10.48 C ATOM 1647 ND1 HIS B 109 -27.558 -39.203 29.017 1.00 10.38 N ATOM 1648 CD2 HIS B 109 -26.358 -40.980 28.578 1.00 11.56 C ATOM 1649 CE1 HIS B 109 -27.831 -39.552 27.773 1.00 8.29 C ATOM 1650 NE2 HIS B 109 -27.145 -40.656 27.490 1.00 12.30 N ATOM 1651 HA HIS B 109 -27.075 -41.677 31.655 1.00 0.00 H ATOM 1652 HB2 HIS B 109 -26.006 -38.892 31.229 1.00 0.00 H ATOM 1653 HB3 HIS B 109 -25.090 -40.401 31.007 1.00 0.00 H ATOM 1654 HD2 HIS B 109 -25.670 -41.822 28.650 1.00 0.00 H ATOM 1655 HE1 HIS B 109 -28.503 -39.026 27.095 1.00 0.00 H ATOM 1656 H HIS B 109 -28.356 -39.022 31.692 1.00 0.00 H ATOM 1657 N ILE B 110 -25.609 -41.662 33.703 1.00 16.68 N ATOM 1658 CA ILE B 110 -24.932 -41.831 35.019 1.00 18.13 C ATOM 1659 C ILE B 110 -23.480 -42.186 34.707 1.00 17.42 C ATOM 1660 O ILE B 110 -23.219 -43.113 33.917 1.00 17.14 O ATOM 1661 CB ILE B 110 -25.645 -42.952 35.815 1.00 18.38 C ATOM 1662 CG1 ILE B 110 -27.127 -42.573 36.118 1.00 17.89 C ATOM 1663 CG2 ILE B 110 -24.788 -43.365 37.042 1.00 20.45 C ATOM 1664 CD1 ILE B 110 -27.914 -43.721 36.934 1.00 21.98 C ATOM 1665 HA ILE B 110 -24.970 -40.931 35.632 1.00 0.00 H ATOM 1666 HB ILE B 110 -25.725 -43.854 35.209 1.00 0.00 H ATOM 1667 HG12 ILE B 110 -27.138 -41.657 36.708 1.00 0.00 H ATOM 1668 HG13 ILE B 110 -27.643 -42.402 35.173 1.00 0.00 H ATOM 1669 HD11 ILE B 110 -27.919 -44.642 36.350 1.00 0.00 H ATOM 1670 HD12 ILE B 110 -27.414 -43.896 37.887 1.00 0.00 H ATOM 1671 HD13 ILE B 110 -28.939 -43.399 37.114 1.00 0.00 H ATOM 1672 HG21 ILE B 110 -23.819 -43.729 36.701 1.00 0.00 H ATOM 1673 HG22 ILE B 110 -24.645 -42.501 37.691 1.00 0.00 H ATOM 1674 HG23 ILE B 110 -25.301 -44.154 37.593 1.00 0.00 H ATOM 1675 H ILE B 110 -25.469 -42.391 32.974 1.00 0.00 H ATOM 1676 N VAL B 111 -22.537 -41.404 35.262 1.00 17.41 N ATOM 1677 CA VAL B 111 -21.109 -41.476 34.899 1.00 18.71 C ATOM 1678 C VAL B 111 -20.329 -42.120 36.031 1.00 20.02 C ATOM 1679 O VAL B 111 -20.298 -41.589 37.127 1.00 19.84 O ATOM 1680 CB VAL B 111 -20.485 -40.082 34.586 1.00 19.35 C ATOM 1681 CG1 VAL B 111 -18.990 -40.222 34.264 1.00 20.38 C ATOM 1682 CG2 VAL B 111 -21.205 -39.435 33.327 1.00 18.15 C ATOM 1683 HA VAL B 111 -21.047 -42.073 33.989 1.00 0.00 H ATOM 1684 HB VAL B 111 -20.616 -39.449 35.464 1.00 0.00 H ATOM 1685 HG11 VAL B 111 -18.474 -40.657 35.120 1.00 0.00 H ATOM 1686 HG12 VAL B 111 -18.866 -40.869 33.396 1.00 0.00 H ATOM 1687 HG13 VAL B 111 -18.572 -39.239 34.048 1.00 0.00 H ATOM 1688 HG21 VAL B 111 -21.079 -40.087 32.463 1.00 0.00 H ATOM 1689 HG22 VAL B 111 -22.267 -39.314 33.540 1.00 0.00 H ATOM 1690 HG23 VAL B 111 -20.762 -38.462 33.117 1.00 0.00 H ATOM 1691 H VAL B 111 -22.829 -40.714 35.983 1.00 0.00 H ATOM 1692 N ASP B 112 -19.728 -43.262 35.746 1.00 21.04 N ATOM 1693 CA ASP B 112 -19.067 -44.075 36.795 1.00 23.51 C ATOM 1694 C ASP B 112 -19.890 -44.111 38.113 1.00 24.29 C ATOM 1695 O ASP B 112 -19.379 -43.774 39.206 1.00 25.12 O ATOM 1696 CB ASP B 112 -17.648 -43.584 37.065 1.00 21.89 C ATOM 1697 CG ASP B 112 -16.706 -43.799 35.885 1.00 24.28 C ATOM 1698 OD1 ASP B 112 -16.754 -44.901 35.269 1.00 25.28 O ATOM 1699 OD2 ASP B 112 -15.876 -42.878 35.623 1.00 24.21 O ATOM 1700 HA ASP B 112 -19.013 -45.094 36.413 1.00 0.00 H ATOM 1701 HB2 ASP B 112 -17.686 -42.518 37.289 1.00 0.00 H ATOM 1702 HB3 ASP B 112 -17.253 -44.121 37.927 1.00 0.00 H ATOM 1703 H ASP B 112 -19.718 -43.599 34.762 1.00 0.00 H ATOM 1704 N GLY B 113 -21.166 -44.490 38.009 1.00 24.64 N ATOM 1705 CA GLY B 113 -22.038 -44.515 39.190 1.00 25.04 C ATOM 1706 C GLY B 113 -22.555 -43.167 39.667 1.00 25.07 C ATOM 1707 O GLY B 113 -23.521 -43.104 40.435 1.00 26.63 O ATOM 1708 HA3 GLY B 113 -21.478 -44.966 40.009 1.00 0.00 H ATOM 1709 HA2 GLY B 113 -22.900 -45.139 38.955 1.00 0.00 H ATOM 1710 H GLY B 113 -21.546 -44.770 37.082 1.00 0.00 H ATOM 1711 N VAL B 114 -21.914 -42.081 39.253 1.00 24.55 N ATOM 1712 CA VAL B 114 -22.380 -40.761 39.635 1.00 25.06 C ATOM 1713 C VAL B 114 -23.624 -40.304 38.844 1.00 25.76 C ATOM 1714 O VAL B 114 -23.589 -40.226 37.613 1.00 25.41 O ATOM 1715 CB VAL B 114 -21.270 -39.673 39.542 1.00 24.64 C ATOM 1716 CG1 VAL B 114 -21.766 -38.350 40.137 1.00 25.34 C ATOM 1717 CG2 VAL B 114 -19.993 -40.125 40.259 1.00 26.46 C ATOM 1718 HA VAL B 114 -22.666 -40.868 40.681 1.00 0.00 H ATOM 1719 HB VAL B 114 -21.036 -39.523 38.488 1.00 0.00 H ATOM 1720 HG11 VAL B 114 -22.643 -38.011 39.585 1.00 0.00 H ATOM 1721 HG12 VAL B 114 -22.030 -38.500 41.184 1.00 0.00 H ATOM 1722 HG13 VAL B 114 -20.977 -37.602 40.063 1.00 0.00 H ATOM 1723 HG21 VAL B 114 -20.214 -40.310 41.310 1.00 0.00 H ATOM 1724 HG22 VAL B 114 -19.624 -41.041 39.798 1.00 0.00 H ATOM 1725 HG23 VAL B 114 -19.236 -39.345 40.177 1.00 0.00 H ATOM 1726 H VAL B 114 -21.072 -42.177 38.651 1.00 0.00 H ATOM 1727 N SER B 115 -24.706 -39.995 39.573 1.00 25.50 N ATOM 1728 CA SER B 115 -25.792 -39.216 38.994 1.00 25.57 C ATOM 1729 C SER B 115 -25.782 -37.762 39.525 1.00 25.31 C ATOM 1730 O SER B 115 -25.294 -37.422 40.632 1.00 25.72 O ATOM 1731 CB SER B 115 -27.174 -39.863 39.189 1.00 26.16 C ATOM 1732 OG SER B 115 -27.268 -40.647 40.375 1.00 30.49 O ATOM 1733 HA SER B 115 -25.611 -39.196 37.919 1.00 0.00 H ATOM 1734 HB2 SER B 115 -27.379 -40.505 38.332 1.00 0.00 H ATOM 1735 HB3 SER B 115 -27.923 -39.072 39.237 1.00 0.00 H ATOM 1736 HG SER B 115 -26.599 -41.376 40.341 1.00 0.00 H ATOM 1737 H SER B 115 -24.770 -40.314 40.561 1.00 0.00 H ATOM 1738 N TYR B 116 -26.397 -36.941 38.702 1.00 22.55 N ATOM 1739 CA TYR B 116 -26.538 -35.536 38.899 1.00 18.70 C ATOM 1740 C TYR B 116 -27.961 -35.287 39.189 1.00 16.33 C ATOM 1741 O TYR B 116 -28.791 -36.232 39.112 1.00 16.75 O ATOM 1742 CB TYR B 116 -26.080 -34.922 37.601 1.00 16.84 C ATOM 1743 CG TYR B 116 -24.625 -35.081 37.456 1.00 17.83 C ATOM 1744 CD1 TYR B 116 -23.758 -34.252 38.165 1.00 20.41 C ATOM 1745 CD2 TYR B 116 -24.090 -36.043 36.601 1.00 21.17 C ATOM 1746 CE1 TYR B 116 -22.390 -34.367 38.016 1.00 17.25 C ATOM 1747 CE2 TYR B 116 -22.740 -36.190 36.469 1.00 18.95 C ATOM 1748 CZ TYR B 116 -21.904 -35.304 37.169 1.00 18.79 C ATOM 1749 OH TYR B 116 -20.556 -35.422 37.026 1.00 22.34 O ATOM 1750 HA TYR B 116 -25.960 -35.116 39.723 1.00 0.00 H ATOM 1751 HB3 TYR B 116 -26.330 -33.861 37.595 1.00 0.00 H ATOM 1752 HB2 TYR B 116 -26.582 -35.417 36.770 1.00 0.00 H ATOM 1753 HD2 TYR B 116 -24.759 -36.687 36.030 1.00 0.00 H ATOM 1754 HE2 TYR B 116 -22.321 -36.974 35.838 1.00 0.00 H ATOM 1755 HE1 TYR B 116 -21.714 -33.715 38.570 1.00 0.00 H ATOM 1756 HD1 TYR B 116 -24.165 -33.504 38.845 1.00 0.00 H ATOM 1757 HH TYR B 116 -20.105 -34.734 37.577 1.00 0.00 H ATOM 1758 H TYR B 116 -26.813 -37.348 37.840 1.00 0.00 H ATOM 1759 N ALA B 117 -28.220 -34.088 39.685 1.00 14.01 N ATOM 1760 CA ALA B 117 -29.568 -33.626 40.046 1.00 12.83 C ATOM 1761 C ALA B 117 -30.507 -33.558 38.840 1.00 10.47 C ATOM 1762 O ALA B 117 -31.684 -33.760 38.980 1.00 11.35 O ATOM 1763 CB ALA B 117 -29.508 -32.193 40.703 1.00 10.88 C ATOM 1764 HA ALA B 117 -29.959 -34.357 40.753 1.00 0.00 H ATOM 1765 HB1 ALA B 117 -28.895 -32.233 41.604 1.00 0.00 H ATOM 1766 HB2 ALA B 117 -29.071 -31.488 39.996 1.00 0.00 H ATOM 1767 HB3 ALA B 117 -30.517 -31.871 40.962 1.00 0.00 H ATOM 1768 H ALA B 117 -27.424 -33.435 39.828 1.00 0.00 H ATOM 1769 N ALA B 118 -29.962 -33.227 37.671 1.00 11.04 N ATOM 1770 CA ALA B 118 -30.814 -32.978 36.510 1.00 10.39 C ATOM 1771 C ALA B 118 -29.924 -33.058 35.269 1.00 8.77 C ATOM 1772 O ALA B 118 -28.697 -33.141 35.372 1.00 8.55 O ATOM 1773 CB ALA B 118 -31.488 -31.562 36.669 1.00 9.65 C ATOM 1774 HA ALA B 118 -31.615 -33.712 36.419 1.00 0.00 H ATOM 1775 HB1 ALA B 118 -32.088 -31.547 37.579 1.00 0.00 H ATOM 1776 HB2 ALA B 118 -30.714 -30.797 36.731 1.00 0.00 H ATOM 1777 HB3 ALA B 118 -32.126 -31.366 35.807 1.00 0.00 H ATOM 1778 H ALA B 118 -28.929 -33.146 37.584 1.00 0.00 H ATOM 1779 N GLU B 119 -30.565 -33.121 34.104 1.00 9.09 N ATOM 1780 CA GLU B 119 -29.870 -33.229 32.823 1.00 10.58 C ATOM 1781 C GLU B 119 -30.691 -32.479 31.755 1.00 12.42 C ATOM 1782 O GLU B 119 -31.918 -32.720 31.545 1.00 11.16 O ATOM 1783 CB GLU B 119 -29.688 -34.658 32.439 1.00 10.80 C ATOM 1784 CG GLU B 119 -28.761 -34.842 31.268 1.00 12.24 C ATOM 1785 CD GLU B 119 -28.550 -36.297 30.940 1.00 13.49 C ATOM 1786 OE1 GLU B 119 -28.441 -37.124 31.843 1.00 11.52 O ATOM 1787 OE2 GLU B 119 -28.498 -36.639 29.761 1.00 14.00 O ATOM 1788 HA GLU B 119 -28.879 -32.783 32.905 1.00 0.00 H ATOM 1789 HB2 GLU B 119 -29.279 -35.198 33.293 1.00 0.00 H ATOM 1790 HB3 GLU B 119 -30.661 -35.074 32.180 1.00 0.00 H ATOM 1791 HG2 GLU B 119 -29.189 -34.343 30.398 1.00 0.00 H ATOM 1792 HG3 GLU B 119 -27.798 -34.391 31.507 1.00 0.00 H ATOM 1793 H GLU B 119 -31.605 -33.092 34.106 1.00 0.00 H ATOM 1794 N LEU B 120 -29.977 -31.590 31.104 1.00 11.23 N ATOM 1795 CA LEU B 120 -30.507 -30.714 30.063 1.00 13.45 C ATOM 1796 C LEU B 120 -30.187 -31.381 28.747 1.00 12.15 C ATOM 1797 O LEU B 120 -29.021 -31.775 28.561 1.00 12.57 O ATOM 1798 CB LEU B 120 -29.753 -29.368 30.089 1.00 12.32 C ATOM 1799 CG LEU B 120 -30.331 -28.264 29.102 1.00 16.71 C ATOM 1800 CD1 LEU B 120 -31.625 -27.610 29.649 1.00 10.04 C ATOM 1801 CD2 LEU B 120 -29.271 -27.151 28.723 1.00 15.51 C ATOM 1802 HA LEU B 120 -31.574 -30.544 30.205 1.00 0.00 H ATOM 1803 HB2 LEU B 120 -29.797 -28.973 31.104 1.00 0.00 H ATOM 1804 HB3 LEU B 120 -28.714 -29.555 29.818 1.00 0.00 H ATOM 1805 HG LEU B 120 -30.578 -28.801 28.186 1.00 0.00 H ATOM 1806 HD21 LEU B 120 -28.940 -26.643 29.629 1.00 0.00 H ATOM 1807 HD22 LEU B 120 -28.416 -27.617 28.233 1.00 0.00 H ATOM 1808 HD23 LEU B 120 -29.730 -26.429 28.047 1.00 0.00 H ATOM 1809 HD11 LEU B 120 -32.388 -28.376 29.785 1.00 0.00 H ATOM 1810 HD12 LEU B 120 -31.413 -27.132 30.606 1.00 0.00 H ATOM 1811 HD13 LEU B 120 -31.981 -26.863 28.939 1.00 0.00 H ATOM 1812 H LEU B 120 -28.969 -31.504 31.345 1.00 0.00 H ATOM 1813 N HIS B 121 -31.179 -31.389 27.823 1.00 11.88 N ATOM 1814 CA HIS B 121 -31.014 -31.964 26.532 1.00 10.93 C ATOM 1815 C HIS B 121 -31.338 -30.928 25.460 1.00 10.84 C ATOM 1816 O HIS B 121 -32.360 -30.205 25.498 1.00 12.77 O ATOM 1817 CB HIS B 121 -31.904 -33.204 26.334 1.00 9.21 C ATOM 1818 CG HIS B 121 -31.490 -34.403 27.122 1.00 11.43 C ATOM 1819 ND1 HIS B 121 -32.372 -35.412 27.432 1.00 9.69 N ATOM 1820 CD2 HIS B 121 -30.307 -34.747 27.693 1.00 10.38 C ATOM 1821 CE1 HIS B 121 -31.746 -36.326 28.162 1.00 13.29 C ATOM 1822 NE2 HIS B 121 -30.499 -35.942 28.337 1.00 13.39 N ATOM 1823 HA HIS B 121 -29.975 -32.282 26.445 1.00 0.00 H ATOM 1824 HB2 HIS B 121 -32.921 -32.942 26.624 1.00 0.00 H ATOM 1825 HB3 HIS B 121 -31.886 -33.470 25.277 1.00 0.00 H ATOM 1826 HD2 HIS B 121 -29.378 -34.179 27.648 1.00 0.00 H ATOM 1827 HE1 HIS B 121 -32.190 -37.242 28.552 1.00 0.00 H ATOM 1828 H HIS B 121 -32.094 -30.959 28.067 1.00 0.00 H ATOM 1829 N VAL B 122 -30.440 -30.866 24.485 1.00 10.54 N ATOM 1830 CA VAL B 122 -30.564 -29.956 23.362 1.00 10.22 C ATOM 1831 C VAL B 122 -30.637 -30.824 22.129 1.00 10.18 C ATOM 1832 O VAL B 122 -29.640 -31.455 21.711 1.00 10.02 O ATOM 1833 CB VAL B 122 -29.373 -28.933 23.267 1.00 9.70 C ATOM 1834 CG1 VAL B 122 -29.637 -27.824 22.189 1.00 8.48 C ATOM 1835 CG2 VAL B 122 -28.990 -28.348 24.646 1.00 10.05 C ATOM 1836 HA VAL B 122 -31.454 -29.338 23.477 1.00 0.00 H ATOM 1837 HB VAL B 122 -28.502 -29.492 22.926 1.00 0.00 H ATOM 1838 HG11 VAL B 122 -29.764 -28.291 21.213 1.00 0.00 H ATOM 1839 HG12 VAL B 122 -30.540 -27.273 22.450 1.00 0.00 H ATOM 1840 HG13 VAL B 122 -28.789 -27.140 22.158 1.00 0.00 H ATOM 1841 HG21 VAL B 122 -29.849 -27.828 25.070 1.00 0.00 H ATOM 1842 HG22 VAL B 122 -28.688 -29.157 25.311 1.00 0.00 H ATOM 1843 HG23 VAL B 122 -28.163 -27.648 24.525 1.00 0.00 H ATOM 1844 H VAL B 122 -29.613 -31.496 24.528 1.00 0.00 H ATOM 1845 N VAL B 123 -31.817 -30.803 21.528 1.00 9.75 N ATOM 1846 CA VAL B 123 -32.171 -31.698 20.443 1.00 9.57 C ATOM 1847 C VAL B 123 -31.947 -30.957 19.098 1.00 9.93 C ATOM 1848 O VAL B 123 -32.430 -29.829 18.906 1.00 9.02 O ATOM 1849 CB VAL B 123 -33.678 -32.121 20.534 1.00 8.45 C ATOM 1850 CG1 VAL B 123 -34.075 -33.105 19.408 1.00 8.60 C ATOM 1851 CG2 VAL B 123 -34.020 -32.757 21.929 1.00 8.33 C ATOM 1852 HA VAL B 123 -31.550 -32.592 20.509 1.00 0.00 H ATOM 1853 HB VAL B 123 -34.256 -31.205 20.413 1.00 0.00 H ATOM 1854 HG11 VAL B 123 -33.912 -32.632 18.440 1.00 0.00 H ATOM 1855 HG12 VAL B 123 -33.464 -34.005 19.481 1.00 0.00 H ATOM 1856 HG13 VAL B 123 -35.127 -33.369 19.512 1.00 0.00 H ATOM 1857 HG21 VAL B 123 -33.404 -33.643 22.084 1.00 0.00 H ATOM 1858 HG22 VAL B 123 -33.819 -32.031 22.717 1.00 0.00 H ATOM 1859 HG23 VAL B 123 -35.073 -33.036 21.951 1.00 0.00 H ATOM 1860 H VAL B 123 -32.524 -30.111 21.850 1.00 0.00 H ATOM 1861 N HIS B 124 -31.309 -31.683 18.168 1.00 11.62 N ATOM 1862 CA HIS B 124 -30.954 -31.188 16.821 1.00 11.56 C ATOM 1863 C HIS B 124 -31.309 -32.295 15.822 1.00 11.08 C ATOM 1864 O HIS B 124 -31.292 -33.489 16.155 1.00 11.27 O ATOM 1865 CB HIS B 124 -29.439 -30.889 16.686 1.00 9.49 C ATOM 1866 CG HIS B 124 -28.882 -30.043 17.777 1.00 13.09 C ATOM 1867 ND1 HIS B 124 -28.612 -30.543 19.039 1.00 10.67 N ATOM 1868 CD2 HIS B 124 -28.483 -28.745 17.788 1.00 14.72 C ATOM 1869 CE1 HIS B 124 -28.075 -29.598 19.777 1.00 10.94 C ATOM 1870 NE2 HIS B 124 -28.009 -28.492 19.059 1.00 14.25 N ATOM 1871 HA HIS B 124 -31.496 -30.261 16.636 1.00 0.00 H ATOM 1872 HB2 HIS B 124 -28.903 -31.838 16.682 1.00 0.00 H ATOM 1873 HB3 HIS B 124 -29.275 -30.376 15.738 1.00 0.00 H ATOM 1874 HD2 HIS B 124 -28.528 -28.042 16.957 1.00 0.00 H ATOM 1875 HE1 HIS B 124 -27.740 -29.708 20.808 1.00 0.00 H ATOM 1876 H HIS B 124 -31.046 -32.660 18.411 1.00 0.00 H ATOM 1877 N TRP B 125 -31.585 -31.879 14.588 1.00 11.49 N ATOM 1878 CA TRP B 125 -31.910 -32.809 13.512 1.00 11.57 C ATOM 1879 C TRP B 125 -31.165 -32.476 12.220 1.00 12.42 C ATOM 1880 O TRP B 125 -31.011 -31.299 11.852 1.00 12.63 O ATOM 1881 CB TRP B 125 -33.431 -32.893 13.245 1.00 11.33 C ATOM 1882 CG TRP B 125 -34.066 -31.631 12.830 1.00 13.62 C ATOM 1883 CD1 TRP B 125 -34.430 -30.564 13.665 1.00 12.74 C ATOM 1884 CD2 TRP B 125 -34.503 -31.252 11.495 1.00 13.81 C ATOM 1885 NE1 TRP B 125 -35.030 -29.563 12.914 1.00 12.68 N ATOM 1886 CE2 TRP B 125 -35.088 -29.954 11.593 1.00 12.63 C ATOM 1887 CE3 TRP B 125 -34.401 -31.846 10.231 1.00 15.75 C ATOM 1888 CZ2 TRP B 125 -35.628 -29.276 10.469 1.00 14.24 C ATOM 1889 CZ3 TRP B 125 -34.949 -31.150 9.107 1.00 13.97 C ATOM 1890 CH2 TRP B 125 -35.495 -29.876 9.234 1.00 12.98 C ATOM 1891 HA TRP B 125 -31.576 -33.788 13.855 1.00 0.00 H ATOM 1892 HB2 TRP B 125 -33.595 -33.628 12.457 1.00 0.00 H ATOM 1893 HB3 TRP B 125 -33.916 -33.230 14.161 1.00 0.00 H ATOM 1894 HE1 TRP B 125 -35.381 -28.659 13.289 1.00 0.00 H ATOM 1895 HD1 TRP B 125 -34.266 -30.527 14.742 1.00 0.00 H ATOM 1896 HZ2 TRP B 125 -36.130 -28.315 10.578 1.00 0.00 H ATOM 1897 HH2 TRP B 125 -35.823 -29.343 8.342 1.00 0.00 H ATOM 1898 HZ3 TRP B 125 -34.939 -31.629 8.128 1.00 0.00 H ATOM 1899 HE3 TRP B 125 -33.916 -32.814 10.106 1.00 0.00 H ATOM 1900 H TRP B 125 -31.568 -30.859 14.385 1.00 0.00 H ATOM 1901 N ASN B 126 -30.817 -33.548 11.514 1.00 13.47 N ATOM 1902 CA ASN B 126 -30.068 -33.488 10.278 1.00 14.31 C ATOM 1903 C ASN B 126 -30.935 -32.947 9.126 1.00 12.78 C ATOM 1904 O ASN B 126 -31.676 -33.683 8.485 1.00 13.86 O ATOM 1905 CB ASN B 126 -29.538 -34.895 9.989 1.00 13.74 C ATOM 1906 CG ASN B 126 -28.614 -34.964 8.770 1.00 14.75 C ATOM 1907 OD1 ASN B 126 -28.594 -34.057 7.900 1.00 14.46 O ATOM 1908 ND2 ASN B 126 -27.865 -36.112 8.673 1.00 20.37 N ATOM 1909 HA ASN B 126 -29.232 -32.795 10.372 1.00 0.00 H ATOM 1910 HB2 ASN B 126 -28.984 -35.241 10.862 1.00 0.00 H ATOM 1911 HB3 ASN B 126 -30.388 -35.555 9.815 1.00 0.00 H ATOM 1912 HD22 ASN B 126 -27.918 -36.832 9.421 1.00 0.00 H ATOM 1913 HD21 ASN B 126 -27.245 -36.261 7.851 1.00 0.00 H ATOM 1914 H ASN B 126 -31.100 -34.483 11.871 1.00 0.00 H ATOM 1915 N SER B 127 -30.902 -31.622 8.957 1.00 13.90 N ATOM 1916 CA SER B 127 -31.579 -30.917 7.850 1.00 13.96 C ATOM 1917 C SER B 127 -30.812 -30.976 6.506 1.00 15.60 C ATOM 1918 O SER B 127 -31.348 -30.565 5.466 1.00 16.75 O ATOM 1919 CB SER B 127 -31.762 -29.468 8.254 1.00 13.13 C ATOM 1920 OG SER B 127 -30.499 -28.806 8.480 1.00 15.67 O ATOM 1921 HA SER B 127 -32.531 -31.421 7.681 1.00 0.00 H ATOM 1922 HB2 SER B 127 -32.349 -29.430 9.172 1.00 0.00 H ATOM 1923 HB3 SER B 127 -32.296 -28.946 7.460 1.00 0.00 H ATOM 1924 HG SER B 127 -30.009 -29.270 9.205 1.00 0.00 H ATOM 1925 H SER B 127 -30.368 -31.054 9.645 1.00 0.00 H ATOM 1926 N ASP B 128 -29.566 -31.459 6.540 1.00 14.25 N ATOM 1927 CA ASP B 128 -28.792 -31.766 5.334 1.00 16.97 C ATOM 1928 C ASP B 128 -29.349 -32.977 4.575 1.00 16.50 C ATOM 1929 O ASP B 128 -29.276 -33.054 3.318 1.00 18.44 O ATOM 1930 CB ASP B 128 -27.297 -31.955 5.652 1.00 16.33 C ATOM 1931 CG ASP B 128 -26.568 -30.679 5.913 1.00 17.25 C ATOM 1932 OD1 ASP B 128 -25.342 -30.791 6.269 1.00 19.01 O ATOM 1933 OD2 ASP B 128 -27.161 -29.574 5.806 1.00 18.27 O ATOM 1934 HA ASP B 128 -28.890 -30.902 4.677 1.00 0.00 H ATOM 1935 HB2 ASP B 128 -27.211 -32.587 6.536 1.00 0.00 H ATOM 1936 HB3 ASP B 128 -26.826 -32.453 4.804 1.00 0.00 H ATOM 1937 H ASP B 128 -29.125 -31.625 7.467 1.00 0.00 H ATOM 1938 N LYS B 129 -29.983 -33.912 5.279 1.00 15.98 N ATOM 1939 CA LYS B 129 -30.559 -35.087 4.626 1.00 14.60 C ATOM 1940 C LYS B 129 -32.065 -35.231 4.687 1.00 15.59 C ATOM 1941 O LYS B 129 -32.658 -35.876 3.793 1.00 16.71 O ATOM 1942 CB LYS B 129 -29.972 -36.430 5.186 1.00 15.10 C ATOM 1943 CG LYS B 129 -28.529 -36.609 4.887 1.00 15.42 C ATOM 1944 CD LYS B 129 -27.963 -37.883 5.429 1.00 16.81 C ATOM 1945 CE LYS B 129 -28.678 -39.135 4.950 1.00 19.75 C ATOM 1946 NZ LYS B 129 -27.912 -40.372 5.355 1.00 18.41 N ATOM 1947 HA LYS B 129 -30.280 -34.905 3.588 1.00 0.00 H ATOM 1948 HB2 LYS B 129 -30.106 -36.442 6.268 1.00 0.00 H ATOM 1949 HB3 LYS B 129 -30.523 -37.260 4.744 1.00 0.00 H ATOM 1950 HG2 LYS B 129 -28.397 -36.605 3.805 1.00 0.00 H ATOM 1951 HG3 LYS B 129 -27.980 -35.774 5.322 1.00 0.00 H ATOM 1952 HD2 LYS B 129 -26.918 -37.949 5.127 1.00 0.00 H ATOM 1953 HD3 LYS B 129 -28.024 -37.849 6.517 1.00 0.00 H ATOM 1954 HE2 LYS B 129 -28.763 -39.106 3.864 1.00 0.00 H ATOM 1955 HE3 LYS B 129 -29.674 -39.170 5.391 1.00 0.00 H ATOM 1956 HZ1 LYS B 129 -26.962 -40.344 4.933 1.00 0.00 H ATOM 1957 HZ2 LYS B 129 -27.832 -40.405 6.391 1.00 0.00 H ATOM 1958 HZ3 LYS B 129 -28.417 -41.217 5.018 1.00 0.00 H ATOM 1959 H LYS B 129 -30.070 -33.805 6.310 1.00 0.00 H ATOM 1960 N TYR B 130 -32.704 -34.723 5.744 1.00 14.98 N ATOM 1961 CA TYR B 130 -34.104 -35.026 5.976 1.00 15.28 C ATOM 1962 C TYR B 130 -34.902 -33.751 5.935 1.00 13.74 C ATOM 1963 O TYR B 130 -34.357 -32.722 6.220 1.00 14.37 O ATOM 1964 CB TYR B 130 -34.299 -35.772 7.325 1.00 14.22 C ATOM 1965 CG TYR B 130 -33.420 -36.992 7.321 1.00 13.68 C ATOM 1966 CD1 TYR B 130 -33.624 -38.016 6.360 1.00 16.79 C ATOM 1967 CD2 TYR B 130 -32.337 -37.108 8.205 1.00 16.28 C ATOM 1968 CE1 TYR B 130 -32.771 -39.085 6.270 1.00 18.65 C ATOM 1969 CE2 TYR B 130 -31.518 -38.232 8.173 1.00 15.26 C ATOM 1970 CZ TYR B 130 -31.742 -39.211 7.176 1.00 16.04 C ATOM 1971 OH TYR B 130 -30.957 -40.338 7.130 1.00 13.91 O ATOM 1972 HA TYR B 130 -34.461 -35.691 5.190 1.00 0.00 H ATOM 1973 HB3 TYR B 130 -35.342 -36.069 7.435 1.00 0.00 H ATOM 1974 HB2 TYR B 130 -34.020 -35.119 8.152 1.00 0.00 H ATOM 1975 HD2 TYR B 130 -32.136 -36.312 8.922 1.00 0.00 H ATOM 1976 HE2 TYR B 130 -30.718 -38.356 8.903 1.00 0.00 H ATOM 1977 HE1 TYR B 130 -32.906 -39.830 5.486 1.00 0.00 H ATOM 1978 HD1 TYR B 130 -34.474 -37.951 5.681 1.00 0.00 H ATOM 1979 HH TYR B 130 -31.048 -40.837 7.980 1.00 0.00 H ATOM 1980 H TYR B 130 -32.194 -34.105 6.407 1.00 0.00 H ATOM 1981 N PRO B 131 -36.177 -33.835 5.541 1.00 14.91 N ATOM 1982 CA PRO B 131 -37.036 -32.670 5.288 1.00 16.28 C ATOM 1983 C PRO B 131 -37.608 -32.028 6.521 1.00 15.88 C ATOM 1984 O PRO B 131 -38.113 -30.932 6.449 1.00 15.41 O ATOM 1985 CB PRO B 131 -38.182 -33.268 4.436 1.00 15.41 C ATOM 1986 CG PRO B 131 -38.311 -34.634 4.898 1.00 17.17 C ATOM 1987 CD PRO B 131 -36.869 -35.091 5.163 1.00 16.04 C ATOM 1988 HA PRO B 131 -36.465 -31.869 4.817 1.00 0.00 H ATOM 1989 HD3 PRO B 131 -36.832 -35.817 5.975 1.00 0.00 H ATOM 1990 HD2 PRO B 131 -36.426 -35.527 4.267 1.00 0.00 H ATOM 1991 HG3 PRO B 131 -38.778 -35.256 4.135 1.00 0.00 H ATOM 1992 HG2 PRO B 131 -38.903 -34.677 5.812 1.00 0.00 H ATOM 1993 HB2 PRO B 131 -39.109 -32.718 4.598 1.00 0.00 H ATOM 1994 HB3 PRO B 131 -37.927 -33.243 3.377 1.00 0.00 H ATOM 1995 N SER B 132 -37.574 -32.761 7.633 1.00 16.19 N ATOM 1996 CA SER B 132 -38.274 -32.365 8.850 1.00 17.01 C ATOM 1997 C SER B 132 -37.696 -33.129 10.052 1.00 17.82 C ATOM 1998 O SER B 132 -37.120 -34.220 9.892 1.00 18.32 O ATOM 1999 CB SER B 132 -39.782 -32.615 8.720 1.00 16.72 C ATOM 2000 OG SER B 132 -40.056 -34.005 8.818 1.00 17.08 O ATOM 2001 HA SER B 132 -38.128 -31.296 9.007 1.00 0.00 H ATOM 2002 HB2 SER B 132 -40.127 -32.246 7.754 1.00 0.00 H ATOM 2003 HB3 SER B 132 -40.305 -32.087 9.517 1.00 0.00 H ATOM 2004 HG SER B 132 -41.031 -34.155 8.733 1.00 0.00 H ATOM 2005 H SER B 132 -37.029 -33.647 7.633 1.00 0.00 H ATOM 2006 N PHE B 133 -37.815 -32.513 11.235 1.00 18.90 N ATOM 2007 CA PHE B 133 -37.468 -33.157 12.493 1.00 18.07 C ATOM 2008 C PHE B 133 -38.223 -34.489 12.589 1.00 17.28 C ATOM 2009 O PHE B 133 -37.655 -35.509 12.906 1.00 13.09 O ATOM 2010 CB PHE B 133 -37.867 -32.275 13.685 1.00 18.82 C ATOM 2011 CG PHE B 133 -37.793 -33.003 14.990 1.00 19.36 C ATOM 2012 CD1 PHE B 133 -36.541 -33.248 15.604 1.00 17.45 C ATOM 2013 CD2 PHE B 133 -38.962 -33.447 15.612 1.00 21.93 C ATOM 2014 CE1 PHE B 133 -36.479 -33.934 16.820 1.00 20.32 C ATOM 2015 CE2 PHE B 133 -38.906 -34.190 16.819 1.00 23.02 C ATOM 2016 CZ PHE B 133 -37.636 -34.391 17.440 1.00 21.67 C ATOM 2017 HA PHE B 133 -36.390 -33.319 12.521 1.00 0.00 H ATOM 2018 HB2 PHE B 133 -37.196 -31.417 13.725 1.00 0.00 H ATOM 2019 HB3 PHE B 133 -38.890 -31.928 13.536 1.00 0.00 H ATOM 2020 HD2 PHE B 133 -39.929 -33.220 15.164 1.00 0.00 H ATOM 2021 HE2 PHE B 133 -39.813 -34.599 17.263 1.00 0.00 H ATOM 2022 HZ PHE B 133 -37.574 -34.903 18.400 1.00 0.00 H ATOM 2023 HE1 PHE B 133 -35.511 -34.113 17.288 1.00 0.00 H ATOM 2024 HD1 PHE B 133 -35.624 -32.901 15.128 1.00 0.00 H ATOM 2025 H PHE B 133 -38.169 -31.535 11.256 1.00 0.00 H ATOM 2026 N VAL B 134 -39.531 -34.452 12.314 1.00 17.98 N ATOM 2027 CA VAL B 134 -40.331 -35.646 12.400 1.00 19.39 C ATOM 2028 C VAL B 134 -39.753 -36.778 11.538 1.00 20.16 C ATOM 2029 O VAL B 134 -39.621 -37.944 12.000 1.00 19.92 O ATOM 2030 CB VAL B 134 -41.855 -35.347 12.049 1.00 21.21 C ATOM 2031 CG1 VAL B 134 -42.525 -36.611 11.573 1.00 22.33 C ATOM 2032 CG2 VAL B 134 -42.526 -34.758 13.271 1.00 21.63 C ATOM 2033 HA VAL B 134 -40.300 -35.990 13.434 1.00 0.00 H ATOM 2034 HB VAL B 134 -41.934 -34.622 11.239 1.00 0.00 H ATOM 2035 HG11 VAL B 134 -42.014 -36.978 10.683 1.00 0.00 H ATOM 2036 HG12 VAL B 134 -42.476 -37.365 12.359 1.00 0.00 H ATOM 2037 HG13 VAL B 134 -43.567 -36.400 11.334 1.00 0.00 H ATOM 2038 HG21 VAL B 134 -42.467 -35.470 14.095 1.00 0.00 H ATOM 2039 HG22 VAL B 134 -42.021 -33.834 13.551 1.00 0.00 H ATOM 2040 HG23 VAL B 134 -43.571 -34.548 13.044 1.00 0.00 H ATOM 2041 H VAL B 134 -39.974 -33.553 12.036 1.00 0.00 H ATOM 2042 N GLU B 135 -39.379 -36.481 10.283 1.00 19.75 N ATOM 2043 CA GLU B 135 -38.772 -37.526 9.467 1.00 19.77 C ATOM 2044 C GLU B 135 -37.401 -38.003 9.984 1.00 18.64 C ATOM 2045 O GLU B 135 -37.094 -39.225 9.961 1.00 18.97 O ATOM 2046 CB GLU B 135 -38.668 -37.096 7.978 1.00 20.21 C ATOM 2047 CG GLU B 135 -37.648 -37.936 7.242 1.00 26.44 C ATOM 2048 CD GLU B 135 -38.160 -39.353 7.051 1.00 33.31 C ATOM 2049 OE1 GLU B 135 -37.357 -40.329 7.149 1.00 28.54 O ATOM 2050 OE2 GLU B 135 -39.390 -39.465 6.854 1.00 36.79 O ATOM 2051 HA GLU B 135 -39.446 -38.379 9.546 1.00 0.00 H ATOM 2052 HB2 GLU B 135 -39.641 -37.218 7.502 1.00 0.00 H ATOM 2053 HB3 GLU B 135 -38.370 -36.049 7.929 1.00 0.00 H ATOM 2054 HG2 GLU B 135 -37.453 -37.491 6.266 1.00 0.00 H ATOM 2055 HG3 GLU B 135 -36.723 -37.964 7.818 1.00 0.00 H ATOM 2056 H GLU B 135 -39.520 -35.524 9.900 1.00 0.00 H ATOM 2057 N ALA B 136 -36.576 -37.035 10.417 1.00 17.53 N ATOM 2058 CA ALA B 136 -35.172 -37.249 10.867 1.00 17.15 C ATOM 2059 C ALA B 136 -35.172 -38.193 12.081 1.00 16.74 C ATOM 2060 O ALA B 136 -34.302 -39.056 12.211 1.00 16.02 O ATOM 2061 CB ALA B 136 -34.517 -35.893 11.237 1.00 15.19 C ATOM 2062 HA ALA B 136 -34.594 -37.699 10.060 1.00 0.00 H ATOM 2063 HB1 ALA B 136 -34.517 -35.241 10.364 1.00 0.00 H ATOM 2064 HB2 ALA B 136 -35.083 -35.425 12.042 1.00 0.00 H ATOM 2065 HB3 ALA B 136 -33.491 -36.064 11.564 1.00 0.00 H ATOM 2066 H ALA B 136 -36.945 -36.063 10.440 1.00 0.00 H ATOM 2067 N ALA B 137 -36.171 -38.016 12.947 1.00 15.78 N ATOM 2068 CA ALA B 137 -36.411 -38.871 14.133 1.00 15.32 C ATOM 2069 C ALA B 137 -36.548 -40.345 13.821 1.00 16.42 C ATOM 2070 O ALA B 137 -36.415 -41.177 14.713 1.00 16.78 O ATOM 2071 CB ALA B 137 -37.635 -38.385 14.907 1.00 14.52 C ATOM 2072 HA ALA B 137 -35.515 -38.774 14.747 1.00 0.00 H ATOM 2073 HB1 ALA B 137 -37.471 -37.359 15.238 1.00 0.00 H ATOM 2074 HB2 ALA B 137 -38.511 -38.423 14.260 1.00 0.00 H ATOM 2075 HB3 ALA B 137 -37.793 -39.027 15.774 1.00 0.00 H ATOM 2076 H ALA B 137 -36.825 -37.225 12.778 1.00 0.00 H ATOM 2077 N HIS B 138 -36.767 -40.692 12.553 1.00 15.97 N ATOM 2078 CA HIS B 138 -36.877 -42.061 12.200 1.00 17.41 C ATOM 2079 C HIS B 138 -35.663 -42.628 11.487 1.00 18.66 C ATOM 2080 O HIS B 138 -35.725 -43.748 10.943 1.00 20.22 O ATOM 2081 CB HIS B 138 -38.160 -42.306 11.392 1.00 18.44 C ATOM 2082 CG HIS B 138 -39.400 -42.108 12.212 1.00 19.31 C ATOM 2083 ND1 HIS B 138 -39.991 -43.132 12.919 1.00 24.43 N ATOM 2084 CD2 HIS B 138 -40.123 -40.997 12.488 1.00 22.04 C ATOM 2085 CE1 HIS B 138 -41.050 -42.675 13.556 1.00 21.06 C ATOM 2086 NE2 HIS B 138 -41.152 -41.383 13.317 1.00 22.69 N ATOM 2087 HA HIS B 138 -36.930 -42.606 13.142 1.00 0.00 H ATOM 2088 HB2 HIS B 138 -38.182 -41.613 10.551 1.00 0.00 H ATOM 2089 HB3 HIS B 138 -38.148 -43.330 11.017 1.00 0.00 H ATOM 2090 HD2 HIS B 138 -39.927 -39.989 12.123 1.00 0.00 H ATOM 2091 HE1 HIS B 138 -41.726 -43.265 14.175 1.00 0.00 H ATOM 2092 H HIS B 138 -36.857 -39.958 11.822 1.00 0.00 H ATOM 2093 N GLU B 139 -34.554 -41.889 11.493 1.00 17.86 N ATOM 2094 CA GLU B 139 -33.361 -42.306 10.753 1.00 17.19 C ATOM 2095 C GLU B 139 -32.198 -42.476 11.682 1.00 15.36 C ATOM 2096 O GLU B 139 -31.979 -41.621 12.517 1.00 14.46 O ATOM 2097 CB GLU B 139 -33.041 -41.153 9.797 1.00 19.40 C ATOM 2098 CG GLU B 139 -34.162 -40.775 8.912 1.00 20.44 C ATOM 2099 CD GLU B 139 -34.315 -41.702 7.788 1.00 25.71 C ATOM 2100 OE1 GLU B 139 -33.545 -42.707 7.721 1.00 26.56 O ATOM 2101 OE2 GLU B 139 -35.234 -41.411 6.949 1.00 32.68 O ATOM 2102 HA GLU B 139 -33.536 -43.252 10.240 1.00 0.00 H ATOM 2103 HB2 GLU B 139 -32.765 -40.282 10.391 1.00 0.00 H ATOM 2104 HB3 GLU B 139 -32.197 -41.449 9.174 1.00 0.00 H ATOM 2105 HG2 GLU B 139 -35.084 -40.773 9.494 1.00 0.00 H ATOM 2106 HG3 GLU B 139 -33.979 -39.775 8.520 1.00 0.00 H ATOM 2107 H GLU B 139 -34.535 -41.000 12.033 1.00 0.00 H ATOM 2108 N PRO B 140 -31.375 -43.509 11.516 1.00 17.28 N ATOM 2109 CA PRO B 140 -30.255 -43.647 12.452 1.00 15.95 C ATOM 2110 C PRO B 140 -29.325 -42.465 12.657 1.00 15.18 C ATOM 2111 O PRO B 140 -28.833 -42.288 13.779 1.00 13.73 O ATOM 2112 CB PRO B 140 -29.476 -44.842 11.868 1.00 19.18 C ATOM 2113 CG PRO B 140 -30.602 -45.716 11.403 1.00 20.29 C ATOM 2114 CD PRO B 140 -31.386 -44.643 10.582 1.00 18.69 C ATOM 2115 HA PRO B 140 -30.659 -43.758 13.458 1.00 0.00 H ATOM 2116 HD3 PRO B 140 -30.875 -44.399 9.651 1.00 0.00 H ATOM 2117 HD2 PRO B 140 -32.402 -44.971 10.362 1.00 0.00 H ATOM 2118 HG3 PRO B 140 -31.188 -46.111 12.233 1.00 0.00 H ATOM 2119 HG2 PRO B 140 -30.255 -46.540 10.780 1.00 0.00 H ATOM 2120 HB2 PRO B 140 -28.837 -44.537 11.040 1.00 0.00 H ATOM 2121 HB3 PRO B 140 -28.872 -45.337 12.628 1.00 0.00 H ATOM 2122 N ASP B 141 -29.077 -41.692 11.581 1.00 13.67 N ATOM 2123 CA ASP B 141 -28.288 -40.490 11.579 1.00 13.92 C ATOM 2124 C ASP B 141 -29.149 -39.194 11.627 1.00 13.97 C ATOM 2125 O ASP B 141 -28.586 -38.069 11.417 1.00 14.36 O ATOM 2126 CB ASP B 141 -27.365 -40.416 10.335 1.00 14.43 C ATOM 2127 CG ASP B 141 -28.141 -40.365 9.004 1.00 12.83 C ATOM 2128 OD1 ASP B 141 -29.349 -40.644 8.996 1.00 13.20 O ATOM 2129 OD2 ASP B 141 -27.512 -40.075 7.936 1.00 20.48 O ATOM 2130 HA ASP B 141 -27.690 -40.542 12.488 1.00 0.00 H ATOM 2131 HB2 ASP B 141 -26.750 -39.519 10.412 1.00 0.00 H ATOM 2132 HB3 ASP B 141 -26.722 -41.296 10.328 1.00 0.00 H ATOM 2133 H ASP B 141 -29.492 -41.990 10.675 1.00 0.00 H ATOM 2134 N GLY B 142 -30.444 -39.328 11.960 1.00 14.88 N ATOM 2135 CA GLY B 142 -31.352 -38.189 11.905 1.00 14.02 C ATOM 2136 C GLY B 142 -31.153 -37.160 13.031 1.00 14.83 C ATOM 2137 O GLY B 142 -31.227 -35.961 12.824 1.00 14.36 O ATOM 2138 HA3 GLY B 142 -32.374 -38.564 11.963 1.00 0.00 H ATOM 2139 HA2 GLY B 142 -31.206 -37.683 10.951 1.00 0.00 H ATOM 2140 H GLY B 142 -30.803 -40.257 12.261 1.00 0.00 H ATOM 2141 N LEU B 143 -30.930 -37.632 14.254 1.00 14.44 N ATOM 2142 CA LEU B 143 -30.901 -36.703 15.429 1.00 13.91 C ATOM 2143 C LEU B 143 -29.577 -36.675 16.157 1.00 12.38 C ATOM 2144 O LEU B 143 -28.862 -37.649 16.137 1.00 13.64 O ATOM 2145 CB LEU B 143 -32.025 -37.054 16.427 1.00 12.98 C ATOM 2146 CG LEU B 143 -33.489 -37.168 15.851 1.00 12.04 C ATOM 2147 CD1 LEU B 143 -34.459 -37.606 16.985 1.00 13.90 C ATOM 2148 CD2 LEU B 143 -33.952 -35.800 15.201 1.00 7.94 C ATOM 2149 HA LEU B 143 -31.056 -35.706 15.015 1.00 0.00 H ATOM 2150 HB2 LEU B 143 -31.775 -38.013 16.880 1.00 0.00 H ATOM 2151 HB3 LEU B 143 -32.034 -36.282 17.196 1.00 0.00 H ATOM 2152 HG LEU B 143 -33.503 -37.922 15.064 1.00 0.00 H ATOM 2153 HD21 LEU B 143 -33.934 -35.015 15.957 1.00 0.00 H ATOM 2154 HD22 LEU B 143 -33.275 -35.538 14.388 1.00 0.00 H ATOM 2155 HD23 LEU B 143 -34.965 -35.908 14.812 1.00 0.00 H ATOM 2156 HD11 LEU B 143 -34.145 -38.574 17.376 1.00 0.00 H ATOM 2157 HD12 LEU B 143 -34.439 -36.866 17.785 1.00 0.00 H ATOM 2158 HD13 LEU B 143 -35.470 -37.685 16.586 1.00 0.00 H ATOM 2159 H LEU B 143 -30.775 -38.651 14.395 1.00 0.00 H ATOM 2160 N ALA B 144 -29.262 -35.527 16.749 1.00 11.62 N ATOM 2161 CA ALA B 144 -28.118 -35.281 17.656 1.00 11.72 C ATOM 2162 C ALA B 144 -28.615 -34.514 18.888 1.00 11.46 C ATOM 2163 O ALA B 144 -29.227 -33.427 18.796 1.00 13.02 O ATOM 2164 CB ALA B 144 -26.966 -34.443 16.981 1.00 11.67 C ATOM 2165 HA ALA B 144 -27.706 -36.254 17.923 1.00 0.00 H ATOM 2166 HB1 ALA B 144 -26.590 -34.980 16.111 1.00 0.00 H ATOM 2167 HB2 ALA B 144 -27.357 -33.474 16.670 1.00 0.00 H ATOM 2168 HB3 ALA B 144 -26.157 -34.297 17.697 1.00 0.00 H ATOM 2169 H ALA B 144 -29.884 -34.717 16.555 1.00 0.00 H ATOM 2170 N VAL B 145 -28.343 -35.073 20.062 1.00 11.80 N ATOM 2171 CA VAL B 145 -28.787 -34.442 21.284 1.00 10.01 C ATOM 2172 C VAL B 145 -27.545 -34.265 22.120 1.00 11.41 C ATOM 2173 O VAL B 145 -26.738 -35.221 22.349 1.00 9.72 O ATOM 2174 CB VAL B 145 -29.835 -35.312 22.108 1.00 9.98 C ATOM 2175 CG1 VAL B 145 -30.263 -34.541 23.346 1.00 8.03 C ATOM 2176 CG2 VAL B 145 -31.097 -35.691 21.262 1.00 10.37 C ATOM 2177 HA VAL B 145 -29.296 -33.510 21.040 1.00 0.00 H ATOM 2178 HB VAL B 145 -29.343 -36.243 22.387 1.00 0.00 H ATOM 2179 HG11 VAL B 145 -29.390 -34.337 23.965 1.00 0.00 H ATOM 2180 HG12 VAL B 145 -30.724 -33.600 23.045 1.00 0.00 H ATOM 2181 HG13 VAL B 145 -30.981 -35.135 23.912 1.00 0.00 H ATOM 2182 HG21 VAL B 145 -31.600 -34.781 20.934 1.00 0.00 H ATOM 2183 HG22 VAL B 145 -30.789 -36.271 20.392 1.00 0.00 H ATOM 2184 HG23 VAL B 145 -31.778 -36.284 21.873 1.00 0.00 H ATOM 2185 H VAL B 145 -27.810 -35.965 20.102 1.00 0.00 H ATOM 2186 N LEU B 146 -27.430 -33.041 22.576 1.00 12.07 N ATOM 2187 CA LEU B 146 -26.411 -32.640 23.510 1.00 14.64 C ATOM 2188 C LEU B 146 -26.996 -32.703 24.904 1.00 15.06 C ATOM 2189 O LEU B 146 -28.052 -32.105 25.164 1.00 14.27 O ATOM 2190 CB LEU B 146 -26.018 -31.211 23.178 1.00 15.52 C ATOM 2191 CG LEU B 146 -24.651 -30.680 23.475 1.00 21.46 C ATOM 2192 CD1 LEU B 146 -23.729 -31.378 22.541 1.00 24.23 C ATOM 2193 CD2 LEU B 146 -24.647 -29.212 23.084 1.00 28.31 C ATOM 2194 HA LEU B 146 -25.537 -33.289 23.454 1.00 0.00 H ATOM 2195 HB2 LEU B 146 -26.165 -31.094 22.104 1.00 0.00 H ATOM 2196 HB3 LEU B 146 -26.719 -30.569 23.712 1.00 0.00 H ATOM 2197 HG LEU B 146 -24.371 -30.817 24.520 1.00 0.00 H ATOM 2198 HD21 LEU B 146 -24.873 -29.120 22.022 1.00 0.00 H ATOM 2199 HD22 LEU B 146 -25.401 -28.681 23.665 1.00 0.00 H ATOM 2200 HD23 LEU B 146 -23.664 -28.786 23.286 1.00 0.00 H ATOM 2201 HD11 LEU B 146 -23.781 -32.453 22.716 1.00 0.00 H ATOM 2202 HD12 LEU B 146 -24.022 -31.161 21.514 1.00 0.00 H ATOM 2203 HD13 LEU B 146 -22.710 -31.030 22.711 1.00 0.00 H ATOM 2204 H LEU B 146 -28.108 -32.325 22.247 1.00 0.00 H ATOM 2205 N GLY B 147 -26.327 -33.468 25.782 1.00 15.38 N ATOM 2206 CA GLY B 147 -26.719 -33.570 27.200 1.00 14.41 C ATOM 2207 C GLY B 147 -25.743 -32.808 28.072 1.00 13.66 C ATOM 2208 O GLY B 147 -24.533 -32.914 27.859 1.00 13.20 O ATOM 2209 HA3 GLY B 147 -26.724 -34.619 27.497 1.00 0.00 H ATOM 2210 HA2 GLY B 147 -27.718 -33.152 27.328 1.00 0.00 H ATOM 2211 H GLY B 147 -25.503 -34.008 25.450 1.00 0.00 H ATOM 2212 N VAL B 148 -26.307 -32.096 29.060 1.00 13.77 N ATOM 2213 CA VAL B 148 -25.560 -31.296 29.992 1.00 13.13 C ATOM 2214 C VAL B 148 -26.071 -31.713 31.348 1.00 12.55 C ATOM 2215 O VAL B 148 -27.310 -31.675 31.630 1.00 12.97 O ATOM 2216 CB VAL B 148 -25.732 -29.754 29.731 1.00 14.54 C ATOM 2217 CG1 VAL B 148 -24.991 -28.911 30.895 1.00 13.99 C ATOM 2218 CG2 VAL B 148 -25.201 -29.367 28.330 1.00 14.43 C ATOM 2219 HA VAL B 148 -24.486 -31.459 29.898 1.00 0.00 H ATOM 2220 HB VAL B 148 -26.794 -29.511 29.754 1.00 0.00 H ATOM 2221 HG11 VAL B 148 -25.430 -29.163 31.860 1.00 0.00 H ATOM 2222 HG12 VAL B 148 -23.929 -29.158 30.901 1.00 0.00 H ATOM 2223 HG13 VAL B 148 -25.116 -27.845 30.705 1.00 0.00 H ATOM 2224 HG21 VAL B 148 -24.142 -29.618 28.262 1.00 0.00 H ATOM 2225 HG22 VAL B 148 -25.755 -29.915 27.568 1.00 0.00 H ATOM 2226 HG23 VAL B 148 -25.332 -28.296 28.176 1.00 0.00 H ATOM 2227 H VAL B 148 -27.342 -32.125 29.157 1.00 0.00 H ATOM 2228 N PHE B 149 -25.149 -32.152 32.200 1.00 12.53 N ATOM 2229 CA PHE B 149 -25.509 -32.457 33.625 1.00 11.78 C ATOM 2230 C PHE B 149 -25.668 -31.216 34.468 1.00 12.52 C ATOM 2231 O PHE B 149 -24.990 -30.168 34.276 1.00 13.14 O ATOM 2232 CB PHE B 149 -24.426 -33.337 34.232 1.00 11.11 C ATOM 2233 CG PHE B 149 -24.271 -34.690 33.560 1.00 12.77 C ATOM 2234 CD1 PHE B 149 -25.322 -35.610 33.577 1.00 14.00 C ATOM 2235 CD2 PHE B 149 -23.065 -35.022 32.943 1.00 13.11 C ATOM 2236 CE1 PHE B 149 -25.194 -36.866 33.009 1.00 12.01 C ATOM 2237 CE2 PHE B 149 -22.877 -36.311 32.378 1.00 13.70 C ATOM 2238 CZ PHE B 149 -23.967 -37.227 32.399 1.00 10.39 C ATOM 2239 HA PHE B 149 -26.473 -32.967 33.615 1.00 0.00 H ATOM 2240 HB2 PHE B 149 -23.476 -32.808 34.159 1.00 0.00 H ATOM 2241 HB3 PHE B 149 -24.669 -33.503 35.282 1.00 0.00 H ATOM 2242 HD2 PHE B 149 -22.262 -34.287 32.894 1.00 0.00 H ATOM 2243 HE2 PHE B 149 -21.920 -36.593 31.938 1.00 0.00 H ATOM 2244 HZ PHE B 149 -23.857 -38.211 31.943 1.00 0.00 H ATOM 2245 HE1 PHE B 149 -26.027 -37.569 33.031 1.00 0.00 H ATOM 2246 HD1 PHE B 149 -26.265 -35.333 34.048 1.00 0.00 H ATOM 2247 H PHE B 149 -24.170 -32.285 31.876 1.00 0.00 H ATOM 2248 N LEU B 150 -26.601 -31.288 35.395 1.00 14.68 N ATOM 2249 CA LEU B 150 -26.754 -30.177 36.327 1.00 14.91 C ATOM 2250 C LEU B 150 -26.484 -30.729 37.708 1.00 14.67 C ATOM 2251 O LEU B 150 -27.112 -31.668 38.099 1.00 14.55 O ATOM 2252 CB LEU B 150 -28.163 -29.567 36.289 1.00 14.12 C ATOM 2253 CG LEU B 150 -28.429 -28.629 35.118 1.00 15.06 C ATOM 2254 CD1 LEU B 150 -28.731 -29.511 33.878 1.00 16.75 C ATOM 2255 CD2 LEU B 150 -29.710 -27.763 35.376 1.00 13.50 C ATOM 2256 HA LEU B 150 -26.062 -29.380 36.054 1.00 0.00 H ATOM 2257 HB2 LEU B 150 -28.884 -30.383 36.239 1.00 0.00 H ATOM 2258 HB3 LEU B 150 -28.314 -29.007 37.212 1.00 0.00 H ATOM 2259 HG LEU B 150 -27.566 -27.978 34.980 1.00 0.00 H ATOM 2260 HD21 LEU B 150 -30.571 -28.419 35.503 1.00 0.00 H ATOM 2261 HD22 LEU B 150 -29.569 -27.168 36.278 1.00 0.00 H ATOM 2262 HD23 LEU B 150 -29.878 -27.102 34.526 1.00 0.00 H ATOM 2263 HD11 LEU B 150 -27.872 -30.149 33.670 1.00 0.00 H ATOM 2264 HD12 LEU B 150 -29.605 -30.130 34.078 1.00 0.00 H ATOM 2265 HD13 LEU B 150 -28.927 -28.871 33.018 1.00 0.00 H ATOM 2266 H LEU B 150 -27.218 -32.123 35.461 1.00 0.00 H ATOM 2267 N GLN B 151 -25.538 -30.125 38.423 1.00 14.85 N ATOM 2268 CA GLN B 151 -25.240 -30.543 39.770 1.00 15.46 C ATOM 2269 C GLN B 151 -25.706 -29.472 40.733 1.00 16.93 C ATOM 2270 O GLN B 151 -25.759 -28.266 40.385 1.00 16.14 O ATOM 2271 CB GLN B 151 -23.733 -30.782 39.980 1.00 15.02 C ATOM 2272 CG GLN B 151 -22.990 -29.437 39.972 1.00 17.68 C ATOM 2273 CD GLN B 151 -21.499 -29.551 39.970 1.00 23.34 C ATOM 2274 OE1 GLN B 151 -20.948 -30.619 40.264 1.00 25.09 O ATOM 2275 NE2 GLN B 151 -20.807 -28.413 39.672 1.00 22.56 N ATOM 2276 HA GLN B 151 -25.759 -31.485 39.951 1.00 0.00 H ATOM 2277 HB2 GLN B 151 -23.574 -31.278 40.937 1.00 0.00 H ATOM 2278 HB3 GLN B 151 -23.350 -31.413 39.177 1.00 0.00 H ATOM 2279 HG2 GLN B 151 -23.291 -28.887 39.080 1.00 0.00 H ATOM 2280 HG3 GLN B 151 -23.288 -28.878 40.859 1.00 0.00 H ATOM 2281 HE22 GLN B 151 -21.320 -27.541 39.431 1.00 0.00 H ATOM 2282 HE21 GLN B 151 -19.767 -28.418 39.686 1.00 0.00 H ATOM 2283 H GLN B 151 -25.004 -29.338 38.003 1.00 0.00 H ATOM 2284 N ILE B 152 -26.055 -29.928 41.940 1.00 17.22 N ATOM 2285 CA ILE B 152 -26.501 -29.008 42.966 1.00 19.64 C ATOM 2286 C ILE B 152 -25.320 -28.099 43.303 1.00 19.76 C ATOM 2287 O ILE B 152 -24.207 -28.549 43.508 1.00 18.10 O ATOM 2288 CB ILE B 152 -27.070 -29.702 44.216 1.00 19.07 C ATOM 2289 CG1 ILE B 152 -28.343 -30.452 43.889 1.00 20.47 C ATOM 2290 CG2 ILE B 152 -27.309 -28.636 45.358 1.00 18.80 C ATOM 2291 CD1 ILE B 152 -29.513 -29.597 43.294 1.00 16.08 C ATOM 2292 HA ILE B 152 -27.341 -28.428 42.583 1.00 0.00 H ATOM 2293 HB ILE B 152 -26.346 -30.435 44.572 1.00 0.00 H ATOM 2294 HG12 ILE B 152 -28.096 -31.228 43.165 1.00 0.00 H ATOM 2295 HG13 ILE B 152 -28.702 -30.915 44.808 1.00 0.00 H ATOM 2296 HD11 ILE B 152 -29.794 -28.821 44.007 1.00 0.00 H ATOM 2297 HD12 ILE B 152 -29.186 -29.135 42.362 1.00 0.00 H ATOM 2298 HD13 ILE B 152 -30.370 -30.242 43.100 1.00 0.00 H ATOM 2299 HG21 ILE B 152 -26.363 -28.157 45.610 1.00 0.00 H ATOM 2300 HG22 ILE B 152 -28.017 -27.884 45.009 1.00 0.00 H ATOM 2301 HG23 ILE B 152 -27.712 -29.134 46.240 1.00 0.00 H ATOM 2302 H ILE B 152 -26.006 -30.947 42.143 1.00 0.00 H ATOM 2303 N GLY B 153 -25.552 -26.805 43.217 1.00 20.18 N ATOM 2304 CA GLY B 153 -24.477 -25.842 43.417 1.00 20.55 C ATOM 2305 C GLY B 153 -25.108 -24.478 43.618 1.00 20.19 C ATOM 2306 O GLY B 153 -26.326 -24.340 43.923 1.00 20.06 O ATOM 2307 HA3 GLY B 153 -23.827 -25.825 42.542 1.00 0.00 H ATOM 2308 HA2 GLY B 153 -23.894 -26.114 44.297 1.00 0.00 H ATOM 2309 H GLY B 153 -26.512 -26.467 43.004 1.00 0.00 H ATOM 2310 N GLU B 154 -24.303 -23.443 43.560 1.00 20.34 N ATOM 2311 CA GLU B 154 -24.887 -22.138 43.803 1.00 19.27 C ATOM 2312 C GLU B 154 -25.750 -21.807 42.558 1.00 19.97 C ATOM 2313 O GLU B 154 -25.506 -22.344 41.454 1.00 19.17 O ATOM 2314 CB GLU B 154 -23.794 -21.095 44.141 1.00 19.58 C ATOM 2315 CG GLU B 154 -23.158 -21.291 45.534 1.00 13.86 C ATOM 2316 CD GLU B 154 -21.672 -20.985 45.563 1.00 14.18 C ATOM 2317 OE1 GLU B 154 -21.091 -20.839 46.668 1.00 12.78 O ATOM 2318 OE2 GLU B 154 -21.050 -20.883 44.481 1.00 13.36 O ATOM 2319 HA GLU B 154 -25.532 -22.123 44.682 1.00 0.00 H ATOM 2320 HB2 GLU B 154 -23.007 -21.165 43.390 1.00 0.00 H ATOM 2321 HB3 GLU B 154 -24.242 -20.102 44.104 1.00 0.00 H ATOM 2322 HG2 GLU B 154 -23.661 -20.631 46.241 1.00 0.00 H ATOM 2323 HG3 GLU B 154 -23.304 -22.327 45.839 1.00 0.00 H ATOM 2324 H GLU B 154 -23.291 -23.554 43.349 1.00 0.00 H ATOM 2325 N PRO B 155 -26.786 -20.961 42.737 1.00 20.29 N ATOM 2326 CA PRO B 155 -27.764 -20.708 41.692 1.00 20.55 C ATOM 2327 C PRO B 155 -27.186 -20.262 40.325 1.00 20.46 C ATOM 2328 O PRO B 155 -26.194 -19.508 40.216 1.00 20.66 O ATOM 2329 CB PRO B 155 -28.716 -19.662 42.302 1.00 21.60 C ATOM 2330 CG PRO B 155 -27.925 -19.088 43.455 1.00 20.52 C ATOM 2331 CD PRO B 155 -27.062 -20.217 43.964 1.00 18.44 C ATOM 2332 HA PRO B 155 -28.265 -21.637 41.419 1.00 0.00 H ATOM 2333 HD3 PRO B 155 -26.144 -19.842 44.416 1.00 0.00 H ATOM 2334 HD2 PRO B 155 -27.598 -20.831 44.688 1.00 0.00 H ATOM 2335 HG3 PRO B 155 -28.596 -18.739 44.240 1.00 0.00 H ATOM 2336 HG2 PRO B 155 -27.304 -18.259 43.115 1.00 0.00 H ATOM 2337 HB2 PRO B 155 -28.961 -18.888 41.575 1.00 0.00 H ATOM 2338 HB3 PRO B 155 -29.634 -20.131 42.655 1.00 0.00 H ATOM 2339 N ASN B 156 -27.850 -20.756 39.292 1.00 20.29 N ATOM 2340 CA ASN B 156 -27.482 -20.483 37.917 1.00 19.21 C ATOM 2341 C ASN B 156 -28.352 -19.393 37.329 1.00 17.99 C ATOM 2342 O ASN B 156 -29.509 -19.624 37.023 1.00 19.17 O ATOM 2343 CB ASN B 156 -27.592 -21.799 37.085 1.00 19.63 C ATOM 2344 CG ASN B 156 -26.783 -21.725 35.841 1.00 20.28 C ATOM 2345 OD1 ASN B 156 -26.618 -20.619 35.311 1.00 19.68 O ATOM 2346 ND2 ASN B 156 -26.297 -22.869 35.335 1.00 17.15 N ATOM 2347 HA ASN B 156 -26.452 -20.127 37.886 1.00 0.00 H ATOM 2348 HB2 ASN B 156 -27.236 -22.632 37.691 1.00 0.00 H ATOM 2349 HB3 ASN B 156 -28.636 -21.965 36.820 1.00 0.00 H ATOM 2350 HD22 ASN B 156 -26.469 -23.769 35.826 1.00 0.00 H ATOM 2351 HD21 ASN B 156 -25.749 -22.855 34.451 1.00 0.00 H ATOM 2352 H ASN B 156 -28.672 -21.367 39.475 1.00 0.00 H ATOM 2353 N SER B 157 -27.814 -18.184 37.228 1.00 19.75 N ATOM 2354 CA SER B 157 -28.535 -16.994 36.749 1.00 20.57 C ATOM 2355 C SER B 157 -29.045 -17.262 35.332 1.00 22.17 C ATOM 2356 O SER B 157 -30.061 -16.674 34.839 1.00 21.12 O ATOM 2357 CB SER B 157 -27.561 -15.781 36.743 1.00 22.08 C ATOM 2358 OG SER B 157 -26.442 -15.991 35.822 1.00 22.78 O ATOM 2359 HA SER B 157 -29.380 -16.774 37.402 1.00 0.00 H ATOM 2360 HB2 SER B 157 -27.168 -15.637 37.750 1.00 0.00 H ATOM 2361 HB3 SER B 157 -28.108 -14.889 36.437 1.00 0.00 H ATOM 2362 HG SER B 157 -25.936 -16.796 36.097 1.00 0.00 H ATOM 2363 H SER B 157 -26.818 -18.070 37.505 1.00 0.00 H ATOM 2364 N GLN B 158 -28.379 -18.217 34.671 1.00 21.78 N ATOM 2365 CA GLN B 158 -28.739 -18.497 33.265 1.00 22.21 C ATOM 2366 C GLN B 158 -29.994 -19.317 33.144 1.00 22.51 C ATOM 2367 O GLN B 158 -30.509 -19.477 32.031 1.00 21.85 O ATOM 2368 CB GLN B 158 -27.596 -19.176 32.513 1.00 22.72 C ATOM 2369 CG GLN B 158 -26.329 -18.366 32.484 1.00 26.29 C ATOM 2370 CD GLN B 158 -26.461 -17.002 31.790 1.00 32.10 C ATOM 2371 OE1 GLN B 158 -27.249 -16.803 30.823 1.00 31.49 O ATOM 2372 NE2 GLN B 158 -25.649 -16.042 32.276 1.00 35.71 N ATOM 2373 HA GLN B 158 -28.930 -17.527 32.806 1.00 0.00 H ATOM 2374 HB2 GLN B 158 -27.384 -20.130 32.996 1.00 0.00 H ATOM 2375 HB3 GLN B 158 -27.916 -19.353 31.486 1.00 0.00 H ATOM 2376 HG2 GLN B 158 -26.010 -18.196 33.512 1.00 0.00 H ATOM 2377 HG3 GLN B 158 -25.568 -18.943 31.959 1.00 0.00 H ATOM 2378 HE22 GLN B 158 -25.016 -16.251 33.074 1.00 0.00 H ATOM 2379 HE21 GLN B 158 -25.655 -15.092 31.853 1.00 0.00 H ATOM 2380 H GLN B 158 -27.621 -18.753 35.139 1.00 0.00 H ATOM 2381 N LEU B 159 -30.474 -19.857 34.267 1.00 20.88 N ATOM 2382 CA LEU B 159 -31.786 -20.512 34.265 1.00 21.63 C ATOM 2383 C LEU B 159 -32.989 -19.552 34.488 1.00 20.48 C ATOM 2384 O LEU B 159 -34.107 -19.996 34.356 1.00 21.58 O ATOM 2385 CB LEU B 159 -31.850 -21.714 35.212 1.00 20.34 C ATOM 2386 CG LEU B 159 -30.935 -22.912 34.955 1.00 24.07 C ATOM 2387 CD1 LEU B 159 -30.857 -23.673 36.253 1.00 23.39 C ATOM 2388 CD2 LEU B 159 -31.404 -23.812 33.783 1.00 21.17 C ATOM 2389 HA LEU B 159 -31.892 -20.885 33.246 1.00 0.00 H ATOM 2390 HB2 LEU B 159 -31.620 -21.345 36.212 1.00 0.00 H ATOM 2391 HB3 LEU B 159 -32.875 -22.084 35.189 1.00 0.00 H ATOM 2392 HG LEU B 159 -29.952 -22.562 34.638 1.00 0.00 H ATOM 2393 HD21 LEU B 159 -32.398 -24.202 34.001 1.00 0.00 H ATOM 2394 HD22 LEU B 159 -31.437 -23.224 32.866 1.00 0.00 H ATOM 2395 HD23 LEU B 159 -30.706 -24.640 33.661 1.00 0.00 H ATOM 2396 HD11 LEU B 159 -30.446 -23.026 37.028 1.00 0.00 H ATOM 2397 HD12 LEU B 159 -31.856 -23.999 36.542 1.00 0.00 H ATOM 2398 HD13 LEU B 159 -30.213 -24.543 36.125 1.00 0.00 H ATOM 2399 H LEU B 159 -29.917 -19.813 35.144 1.00 0.00 H ATOM 2400 N GLN B 160 -32.765 -18.253 34.761 1.00 20.92 N ATOM 2401 CA GLN B 160 -33.853 -17.327 35.120 1.00 20.97 C ATOM 2402 C GLN B 160 -34.905 -17.148 34.027 1.00 20.35 C ATOM 2403 O GLN B 160 -36.080 -17.138 34.315 1.00 22.12 O ATOM 2404 CB GLN B 160 -33.319 -15.905 35.513 1.00 22.42 C ATOM 2405 CG GLN B 160 -34.463 -14.943 36.003 1.00 19.49 C ATOM 2406 CD GLN B 160 -34.145 -13.461 35.909 1.00 22.77 C ATOM 2407 OE1 GLN B 160 -32.979 -13.065 35.876 1.00 28.23 O ATOM 2408 NE2 GLN B 160 -35.185 -12.629 35.892 1.00 23.78 N ATOM 2409 HA GLN B 160 -34.325 -17.805 35.978 1.00 0.00 H ATOM 2410 HB2 GLN B 160 -32.588 -16.015 36.314 1.00 0.00 H ATOM 2411 HB3 GLN B 160 -32.837 -15.460 34.642 1.00 0.00 H ATOM 2412 HG2 GLN B 160 -35.349 -15.137 35.399 1.00 0.00 H ATOM 2413 HG3 GLN B 160 -34.677 -15.177 37.046 1.00 0.00 H ATOM 2414 HE22 GLN B 160 -36.154 -13.007 35.921 1.00 0.00 H ATOM 2415 HE21 GLN B 160 -35.028 -11.602 35.849 1.00 0.00 H ATOM 2416 H GLN B 160 -31.791 -17.891 34.717 1.00 0.00 H ATOM 2417 N LYS B 161 -34.489 -16.952 32.790 1.00 19.85 N ATOM 2418 CA LYS B 161 -35.449 -16.794 31.714 1.00 19.33 C ATOM 2419 C LYS B 161 -36.482 -17.942 31.768 1.00 18.59 C ATOM 2420 O LYS B 161 -37.688 -17.692 31.665 1.00 18.24 O ATOM 2421 CB LYS B 161 -34.781 -16.785 30.330 1.00 18.76 C ATOM 2422 CG LYS B 161 -35.686 -16.005 29.243 1.00 20.07 C ATOM 2423 CD LYS B 161 -35.166 -16.227 27.852 1.00 18.52 C ATOM 2424 CE LYS B 161 -36.253 -16.079 26.818 1.00 18.52 C ATOM 2425 NZ LYS B 161 -36.690 -14.604 26.927 1.00 21.87 N ATOM 2426 HA LYS B 161 -35.937 -15.830 31.855 1.00 0.00 H ATOM 2427 HB2 LYS B 161 -33.813 -16.290 30.406 1.00 0.00 H ATOM 2428 HB3 LYS B 161 -34.637 -17.813 29.999 1.00 0.00 H ATOM 2429 HG2 LYS B 161 -36.711 -16.371 29.303 1.00 0.00 H ATOM 2430 HG3 LYS B 161 -35.669 -14.938 29.464 1.00 0.00 H ATOM 2431 HD2 LYS B 161 -34.382 -15.498 27.647 1.00 0.00 H ATOM 2432 HD3 LYS B 161 -34.751 -17.233 27.786 1.00 0.00 H ATOM 2433 HE2 LYS B 161 -37.087 -16.746 27.037 1.00 0.00 H ATOM 2434 HE3 LYS B 161 -35.869 -16.295 25.821 1.00 0.00 H ATOM 2435 HZ1 LYS B 161 -37.040 -14.418 27.888 1.00 0.00 H ATOM 2436 HZ2 LYS B 161 -35.877 -13.987 26.727 1.00 0.00 H ATOM 2437 HZ3 LYS B 161 -37.447 -14.416 26.239 1.00 0.00 H ATOM 2438 H LYS B 161 -33.470 -16.911 32.586 1.00 0.00 H ATOM 2439 N ILE B 162 -35.989 -19.170 31.944 1.00 17.92 N ATOM 2440 CA ILE B 162 -36.831 -20.392 32.035 1.00 16.42 C ATOM 2441 C ILE B 162 -37.670 -20.463 33.333 1.00 16.19 C ATOM 2442 O ILE B 162 -38.887 -20.613 33.291 1.00 16.00 O ATOM 2443 CB ILE B 162 -35.948 -21.714 31.945 1.00 15.62 C ATOM 2444 CG1 ILE B 162 -35.271 -21.871 30.578 1.00 16.37 C ATOM 2445 CG2 ILE B 162 -36.811 -23.047 32.218 1.00 15.08 C ATOM 2446 CD1 ILE B 162 -34.173 -23.033 30.581 1.00 14.47 C ATOM 2447 HA ILE B 162 -37.512 -20.328 31.186 1.00 0.00 H ATOM 2448 HB ILE B 162 -35.191 -21.598 32.721 1.00 0.00 H ATOM 2449 HG12 ILE B 162 -36.032 -22.107 29.834 1.00 0.00 H ATOM 2450 HG13 ILE B 162 -34.787 -20.930 30.315 1.00 0.00 H ATOM 2451 HD11 ILE B 162 -33.403 -22.802 31.317 1.00 0.00 H ATOM 2452 HD12 ILE B 162 -34.649 -23.980 30.836 1.00 0.00 H ATOM 2453 HD13 ILE B 162 -33.721 -23.107 29.592 1.00 0.00 H ATOM 2454 HG21 ILE B 162 -37.246 -22.999 33.216 1.00 0.00 H ATOM 2455 HG22 ILE B 162 -37.607 -23.121 31.477 1.00 0.00 H ATOM 2456 HG23 ILE B 162 -36.162 -23.920 32.145 1.00 0.00 H ATOM 2457 H ILE B 162 -34.958 -19.278 32.022 1.00 0.00 H ATOM 2458 N THR B 163 -37.020 -20.370 34.490 1.00 17.43 N ATOM 2459 CA THR B 163 -37.757 -20.469 35.746 1.00 19.25 C ATOM 2460 C THR B 163 -38.853 -19.374 35.937 1.00 18.62 C ATOM 2461 O THR B 163 -39.901 -19.693 36.526 1.00 20.07 O ATOM 2462 CB THR B 163 -36.853 -20.537 36.996 1.00 18.42 C ATOM 2463 OG1 THR B 163 -36.063 -19.353 37.070 1.00 21.45 O ATOM 2464 CG2 THR B 163 -35.927 -21.808 36.923 1.00 20.34 C ATOM 2465 HA THR B 163 -38.270 -21.426 35.652 1.00 0.00 H ATOM 2466 HB THR B 163 -37.472 -20.612 37.890 1.00 0.00 H ATOM 2467 HG1 THR B 163 -35.483 -19.395 37.871 1.00 0.00 H ATOM 2468 HG23 THR B 163 -36.545 -22.704 36.867 1.00 0.00 H ATOM 2469 HG21 THR B 163 -35.295 -21.745 36.037 1.00 0.00 H ATOM 2470 HG22 THR B 163 -35.302 -21.852 37.815 1.00 0.00 H ATOM 2471 H THR B 163 -35.990 -20.227 34.500 1.00 0.00 H ATOM 2472 N ASP B 164 -38.577 -18.130 35.499 1.00 19.04 N ATOM 2473 CA ASP B 164 -39.598 -17.045 35.412 1.00 19.92 C ATOM 2474 C ASP B 164 -40.868 -17.408 34.646 1.00 20.40 C ATOM 2475 O ASP B 164 -41.898 -16.765 34.811 1.00 19.45 O ATOM 2476 CB ASP B 164 -39.048 -15.799 34.718 1.00 21.43 C ATOM 2477 CG ASP B 164 -38.131 -14.974 35.612 1.00 24.89 C ATOM 2478 OD1 ASP B 164 -38.073 -15.285 36.842 1.00 30.28 O ATOM 2479 OD2 ASP B 164 -37.442 -14.061 35.058 1.00 24.73 O ATOM 2480 HA ASP B 164 -39.846 -16.870 36.459 1.00 0.00 H ATOM 2481 HB2 ASP B 164 -38.486 -16.111 33.838 1.00 0.00 H ATOM 2482 HB3 ASP B 164 -39.886 -15.174 34.410 1.00 0.00 H ATOM 2483 H ASP B 164 -37.602 -17.915 35.207 1.00 0.00 H ATOM 2484 N THR B 165 -40.801 -18.409 33.763 1.00 19.85 N ATOM 2485 CA THR B 165 -42.000 -18.792 32.988 1.00 18.60 C ATOM 2486 C THR B 165 -42.803 -19.921 33.544 1.00 17.72 C ATOM 2487 O THR B 165 -43.892 -20.152 33.054 1.00 16.57 O ATOM 2488 CB THR B 165 -41.667 -19.248 31.558 1.00 18.91 C ATOM 2489 OG1 THR B 165 -40.965 -20.501 31.632 1.00 19.99 O ATOM 2490 CG2 THR B 165 -40.866 -18.259 30.870 1.00 19.01 C ATOM 2491 HA THR B 165 -42.572 -17.865 33.027 1.00 0.00 H ATOM 2492 HB THR B 165 -42.590 -19.370 30.992 1.00 0.00 H ATOM 2493 HG1 THR B 165 -40.131 -20.381 32.152 1.00 0.00 H ATOM 2494 HG23 THR B 165 -41.414 -17.318 30.824 1.00 0.00 H ATOM 2495 HG21 THR B 165 -39.931 -18.111 31.410 1.00 0.00 H ATOM 2496 HG22 THR B 165 -40.652 -18.606 29.859 1.00 0.00 H ATOM 2497 H THR B 165 -39.905 -18.918 33.621 1.00 0.00 H ATOM 2498 N LEU B 166 -42.288 -20.633 34.538 1.00 16.81 N ATOM 2499 CA LEU B 166 -42.881 -21.880 34.937 1.00 18.21 C ATOM 2500 C LEU B 166 -44.298 -21.739 35.481 1.00 19.31 C ATOM 2501 O LEU B 166 -45.171 -22.607 35.221 1.00 19.28 O ATOM 2502 CB LEU B 166 -41.990 -22.741 35.855 1.00 17.72 C ATOM 2503 CG LEU B 166 -40.566 -23.055 35.354 1.00 17.66 C ATOM 2504 CD1 LEU B 166 -39.693 -23.697 36.444 1.00 15.47 C ATOM 2505 CD2 LEU B 166 -40.666 -23.985 34.185 1.00 17.20 C ATOM 2506 HA LEU B 166 -42.965 -22.436 34.003 1.00 0.00 H ATOM 2507 HB2 LEU B 166 -41.896 -22.218 36.807 1.00 0.00 H ATOM 2508 HB3 LEU B 166 -42.501 -23.691 36.012 1.00 0.00 H ATOM 2509 HG LEU B 166 -40.091 -22.116 35.069 1.00 0.00 H ATOM 2510 HD21 LEU B 166 -41.162 -24.904 34.495 1.00 0.00 H ATOM 2511 HD22 LEU B 166 -41.243 -23.509 33.392 1.00 0.00 H ATOM 2512 HD23 LEU B 166 -39.665 -24.216 33.820 1.00 0.00 H ATOM 2513 HD11 LEU B 166 -39.611 -23.015 37.291 1.00 0.00 H ATOM 2514 HD12 LEU B 166 -40.150 -24.631 36.771 1.00 0.00 H ATOM 2515 HD13 LEU B 166 -38.701 -23.899 36.041 1.00 0.00 H ATOM 2516 H LEU B 166 -41.444 -20.284 35.035 1.00 0.00 H ATOM 2517 N ASP B 167 -44.584 -20.613 36.112 1.00 20.75 N ATOM 2518 CA ASP B 167 -45.950 -20.435 36.622 1.00 22.02 C ATOM 2519 C ASP B 167 -46.996 -20.383 35.500 1.00 22.06 C ATOM 2520 O ASP B 167 -48.024 -21.046 35.544 1.00 22.70 O ATOM 2521 CB ASP B 167 -46.011 -19.213 37.500 1.00 23.23 C ATOM 2522 CG ASP B 167 -45.409 -19.478 38.862 1.00 27.52 C ATOM 2523 OD1 ASP B 167 -45.296 -20.688 39.242 1.00 29.46 O ATOM 2524 OD2 ASP B 167 -45.020 -18.488 39.510 1.00 32.21 O ATOM 2525 HA ASP B 167 -46.201 -21.310 37.221 1.00 0.00 H ATOM 2526 HB2 ASP B 167 -45.460 -18.404 37.020 1.00 0.00 H ATOM 2527 HB3 ASP B 167 -47.053 -18.918 37.624 1.00 0.00 H ATOM 2528 H ASP B 167 -43.863 -19.875 36.243 1.00 0.00 H ATOM 2529 N SER B 168 -46.719 -19.569 34.498 1.00 21.94 N ATOM 2530 CA SER B 168 -47.538 -19.482 33.269 1.00 20.60 C ATOM 2531 C SER B 168 -47.711 -20.794 32.463 1.00 19.25 C ATOM 2532 O SER B 168 -48.698 -20.940 31.742 1.00 16.61 O ATOM 2533 CB SER B 168 -46.926 -18.413 32.373 1.00 20.98 C ATOM 2534 OG SER B 168 -45.767 -18.988 31.743 1.00 23.37 O ATOM 2535 HA SER B 168 -48.547 -19.238 33.601 1.00 0.00 H ATOM 2536 HB2 SER B 168 -46.635 -17.549 32.970 1.00 0.00 H ATOM 2537 HB3 SER B 168 -47.647 -18.104 31.616 1.00 0.00 H ATOM 2538 HG SER B 168 -45.120 -19.269 32.438 1.00 0.00 H ATOM 2539 H SER B 168 -45.882 -18.957 34.577 1.00 0.00 H ATOM 2540 N ILE B 169 -46.808 -21.773 32.628 1.00 17.14 N ATOM 2541 CA ILE B 169 -46.954 -23.074 31.929 1.00 17.26 C ATOM 2542 C ILE B 169 -47.186 -24.237 32.905 1.00 17.23 C ATOM 2543 O ILE B 169 -46.808 -25.377 32.638 1.00 17.89 O ATOM 2544 CB ILE B 169 -45.764 -23.348 30.944 1.00 16.75 C ATOM 2545 CG1 ILE B 169 -44.402 -23.403 31.683 1.00 13.02 C ATOM 2546 CG2 ILE B 169 -45.773 -22.250 29.817 1.00 17.34 C ATOM 2547 CD1 ILE B 169 -43.211 -23.894 30.786 1.00 17.39 C ATOM 2548 HA ILE B 169 -47.854 -23.004 31.319 1.00 0.00 H ATOM 2549 HB ILE B 169 -45.898 -24.329 30.489 1.00 0.00 H ATOM 2550 HG12 ILE B 169 -44.168 -22.403 32.047 1.00 0.00 H ATOM 2551 HG13 ILE B 169 -44.498 -24.083 32.529 1.00 0.00 H ATOM 2552 HD11 ILE B 169 -43.422 -24.900 30.422 1.00 0.00 H ATOM 2553 HD12 ILE B 169 -43.092 -23.218 29.940 1.00 0.00 H ATOM 2554 HD13 ILE B 169 -42.294 -23.905 31.375 1.00 0.00 H ATOM 2555 HG21 ILE B 169 -46.718 -22.294 29.276 1.00 0.00 H ATOM 2556 HG22 ILE B 169 -45.658 -21.265 30.270 1.00 0.00 H ATOM 2557 HG23 ILE B 169 -44.949 -22.432 29.127 1.00 0.00 H ATOM 2558 H ILE B 169 -45.993 -21.618 33.255 1.00 0.00 H ATOM 2559 N LYS B 170 -47.804 -23.951 34.062 1.00 18.35 N ATOM 2560 CA LYS B 170 -47.981 -24.968 35.091 1.00 17.98 C ATOM 2561 C LYS B 170 -48.697 -26.232 34.542 1.00 17.99 C ATOM 2562 O LYS B 170 -48.305 -27.374 34.823 1.00 18.21 O ATOM 2563 CB LYS B 170 -48.750 -24.413 36.317 1.00 19.73 C ATOM 2564 CG LYS B 170 -48.777 -25.469 37.472 1.00 18.34 C ATOM 2565 CD LYS B 170 -49.742 -25.073 38.669 1.00 22.78 C ATOM 2566 CE LYS B 170 -49.316 -25.801 40.051 1.00 28.75 C ATOM 2567 NZ LYS B 170 -47.830 -25.901 40.412 1.00 30.96 N ATOM 2568 HA LYS B 170 -46.981 -25.258 35.412 1.00 0.00 H ATOM 2569 HB2 LYS B 170 -48.257 -23.507 36.670 1.00 0.00 H ATOM 2570 HB3 LYS B 170 -49.773 -24.177 36.023 1.00 0.00 H ATOM 2571 HG2 LYS B 170 -49.110 -26.422 37.061 1.00 0.00 H ATOM 2572 HG3 LYS B 170 -47.766 -25.577 37.865 1.00 0.00 H ATOM 2573 HD2 LYS B 170 -49.702 -23.993 38.812 1.00 0.00 H ATOM 2574 HD3 LYS B 170 -50.760 -25.367 38.414 1.00 0.00 H ATOM 2575 HE2 LYS B 170 -49.704 -26.819 40.009 1.00 0.00 H ATOM 2576 HE3 LYS B 170 -49.806 -25.261 40.861 1.00 0.00 H ATOM 2577 HZ1 LYS B 170 -47.330 -26.433 39.672 1.00 0.00 H ATOM 2578 HZ2 LYS B 170 -47.427 -24.945 40.486 1.00 0.00 H ATOM 2579 HZ3 LYS B 170 -47.728 -26.393 41.323 1.00 0.00 H ATOM 2580 H LYS B 170 -48.162 -22.989 34.227 1.00 0.00 H ATOM 2581 N GLU B 171 -49.708 -26.007 33.711 1.00 17.10 N ATOM 2582 CA GLU B 171 -50.604 -27.062 33.249 1.00 18.98 C ATOM 2583 C GLU B 171 -50.058 -27.594 31.914 1.00 17.54 C ATOM 2584 O GLU B 171 -49.648 -26.810 31.061 1.00 17.17 O ATOM 2585 CB GLU B 171 -52.036 -26.507 33.053 1.00 19.90 C ATOM 2586 CG GLU B 171 -52.822 -26.082 34.368 1.00 23.54 C ATOM 2587 CD GLU B 171 -52.390 -24.713 34.966 1.00 30.19 C ATOM 2588 OE1 GLU B 171 -52.610 -24.504 36.200 1.00 39.30 O ATOM 2589 OE2 GLU B 171 -51.826 -23.838 34.253 1.00 30.77 O ATOM 2590 HA GLU B 171 -50.652 -27.862 33.987 1.00 0.00 H ATOM 2591 HB2 GLU B 171 -51.965 -25.629 32.411 1.00 0.00 H ATOM 2592 HB3 GLU B 171 -52.623 -27.276 32.551 1.00 0.00 H ATOM 2593 HG2 GLU B 171 -53.884 -26.029 34.128 1.00 0.00 H ATOM 2594 HG3 GLU B 171 -52.660 -26.850 35.124 1.00 0.00 H ATOM 2595 H GLU B 171 -49.868 -25.036 33.375 1.00 0.00 H ATOM 2596 N LYS B 172 -50.068 -28.906 31.741 1.00 17.37 N ATOM 2597 CA LYS B 172 -49.785 -29.513 30.443 1.00 16.35 C ATOM 2598 C LYS B 172 -50.626 -28.791 29.348 1.00 18.43 C ATOM 2599 O LYS B 172 -51.874 -28.586 29.495 1.00 18.09 O ATOM 2600 CB LYS B 172 -50.136 -31.016 30.529 1.00 16.33 C ATOM 2601 CG LYS B 172 -50.002 -31.813 29.229 1.00 16.02 C ATOM 2602 CD LYS B 172 -50.422 -33.318 29.395 1.00 14.34 C ATOM 2603 CE LYS B 172 -50.299 -34.089 28.044 1.00 17.27 C ATOM 2604 NZ LYS B 172 -50.310 -35.634 28.306 1.00 15.23 N ATOM 2605 HA LYS B 172 -48.733 -29.411 30.178 1.00 0.00 H ATOM 2606 HB2 LYS B 172 -49.477 -31.471 31.268 1.00 0.00 H ATOM 2607 HB3 LYS B 172 -51.169 -31.098 30.866 1.00 0.00 H ATOM 2608 HG2 LYS B 172 -50.638 -31.355 28.471 1.00 0.00 H ATOM 2609 HG3 LYS B 172 -48.963 -31.775 28.901 1.00 0.00 H ATOM 2610 HD2 LYS B 172 -49.774 -33.789 30.134 1.00 0.00 H ATOM 2611 HD3 LYS B 172 -51.456 -33.364 29.738 1.00 0.00 H ATOM 2612 HE2 LYS B 172 -49.366 -33.812 27.554 1.00 0.00 H ATOM 2613 HE3 LYS B 172 -51.138 -33.826 27.400 1.00 0.00 H ATOM 2614 HZ1 LYS B 172 -49.508 -35.886 28.919 1.00 0.00 H ATOM 2615 HZ2 LYS B 172 -51.201 -35.899 28.772 1.00 0.00 H ATOM 2616 HZ3 LYS B 172 -50.228 -36.139 27.400 1.00 0.00 H ATOM 2617 H LYS B 172 -50.283 -29.522 32.551 1.00 0.00 H ATOM 2618 N GLY B 173 -49.953 -28.409 28.255 1.00 18.93 N ATOM 2619 CA GLY B 173 -50.607 -27.790 27.076 1.00 18.82 C ATOM 2620 C GLY B 173 -50.415 -26.278 27.034 1.00 19.54 C ATOM 2621 O GLY B 173 -50.602 -25.667 25.983 1.00 21.31 O ATOM 2622 HA3 GLY B 173 -51.675 -28.007 27.113 1.00 0.00 H ATOM 2623 HA2 GLY B 173 -50.181 -28.223 26.171 1.00 0.00 H ATOM 2624 H GLY B 173 -48.923 -28.553 28.232 1.00 0.00 H ATOM 2625 N LYS B 174 -50.044 -25.667 28.175 1.00 18.12 N ATOM 2626 CA LYS B 174 -49.802 -24.234 28.254 1.00 17.51 C ATOM 2627 C LYS B 174 -48.506 -23.896 27.502 1.00 18.74 C ATOM 2628 O LYS B 174 -47.518 -24.691 27.527 1.00 17.58 O ATOM 2629 CB LYS B 174 -49.682 -23.794 29.706 1.00 20.57 C ATOM 2630 CG LYS B 174 -51.007 -23.984 30.534 1.00 20.07 C ATOM 2631 CD LYS B 174 -51.983 -22.901 30.157 1.00 28.09 C ATOM 2632 CE LYS B 174 -53.308 -23.007 30.916 1.00 32.13 C ATOM 2633 NZ LYS B 174 -53.150 -22.415 32.322 1.00 38.62 N ATOM 2634 HA LYS B 174 -50.641 -23.707 27.799 1.00 0.00 H ATOM 2635 HB2 LYS B 174 -48.893 -24.378 30.179 1.00 0.00 H ATOM 2636 HB3 LYS B 174 -49.412 -22.738 29.725 1.00 0.00 H ATOM 2637 HG2 LYS B 174 -51.440 -24.959 30.312 1.00 0.00 H ATOM 2638 HG3 LYS B 174 -50.784 -23.921 31.599 1.00 0.00 H ATOM 2639 HD2 LYS B 174 -51.532 -21.933 30.376 1.00 0.00 H ATOM 2640 HD3 LYS B 174 -52.187 -22.972 29.089 1.00 0.00 H ATOM 2641 HE2 LYS B 174 -53.598 -24.055 30.995 1.00 0.00 H ATOM 2642 HE3 LYS B 174 -54.079 -22.458 30.376 1.00 0.00 H ATOM 2643 HZ1 LYS B 174 -52.415 -22.940 32.837 1.00 0.00 H ATOM 2644 HZ2 LYS B 174 -52.875 -21.415 32.247 1.00 0.00 H ATOM 2645 HZ3 LYS B 174 -54.053 -22.490 32.832 1.00 0.00 H ATOM 2646 H LYS B 174 -49.926 -26.242 29.034 1.00 0.00 H ATOM 2647 N GLN B 175 -48.479 -22.718 26.913 1.00 16.52 N ATOM 2648 CA GLN B 175 -47.258 -22.255 26.270 1.00 20.01 C ATOM 2649 C GLN B 175 -47.206 -20.748 26.394 1.00 18.62 C ATOM 2650 O GLN B 175 -48.249 -20.103 26.593 1.00 20.61 O ATOM 2651 CB GLN B 175 -47.189 -22.694 24.812 1.00 18.60 C ATOM 2652 CG GLN B 175 -48.169 -21.960 23.923 1.00 22.63 C ATOM 2653 CD GLN B 175 -48.117 -22.367 22.465 1.00 21.31 C ATOM 2654 OE1 GLN B 175 -48.333 -23.530 22.138 1.00 19.64 O ATOM 2655 NE2 GLN B 175 -47.817 -21.421 21.599 1.00 21.40 N ATOM 2656 HA GLN B 175 -46.393 -22.699 26.763 1.00 0.00 H ATOM 2657 HB2 GLN B 175 -46.180 -22.511 24.442 1.00 0.00 H ATOM 2658 HB3 GLN B 175 -47.405 -23.761 24.760 1.00 0.00 H ATOM 2659 HG2 GLN B 175 -49.176 -22.150 24.295 1.00 0.00 H ATOM 2660 HG3 GLN B 175 -47.955 -20.893 23.987 1.00 0.00 H ATOM 2661 HE22 GLN B 175 -47.643 -20.450 21.929 1.00 0.00 H ATOM 2662 HE21 GLN B 175 -47.754 -21.645 20.585 1.00 0.00 H ATOM 2663 H GLN B 175 -49.329 -22.119 26.907 1.00 0.00 H ATOM 2664 N THR B 176 -46.016 -20.181 26.318 1.00 18.29 N ATOM 2665 CA THR B 176 -45.869 -18.723 26.334 1.00 17.96 C ATOM 2666 C THR B 176 -44.725 -18.331 25.438 1.00 17.39 C ATOM 2667 O THR B 176 -43.806 -19.143 25.214 1.00 16.33 O ATOM 2668 CB THR B 176 -45.738 -18.129 27.801 1.00 19.31 C ATOM 2669 OG1 THR B 176 -46.016 -16.727 27.787 1.00 19.62 O ATOM 2670 CG2 THR B 176 -44.378 -18.360 28.408 1.00 19.35 C ATOM 2671 HA THR B 176 -46.784 -18.279 25.943 1.00 0.00 H ATOM 2672 HB THR B 176 -46.465 -18.656 28.418 1.00 0.00 H ATOM 2673 HG1 THR B 176 -46.937 -16.578 27.455 1.00 0.00 H ATOM 2674 HG23 THR B 176 -44.164 -19.429 28.420 1.00 0.00 H ATOM 2675 HG21 THR B 176 -43.624 -17.843 27.814 1.00 0.00 H ATOM 2676 HG22 THR B 176 -44.366 -17.974 29.427 1.00 0.00 H ATOM 2677 H THR B 176 -45.168 -20.779 26.246 1.00 0.00 H ATOM 2678 N ARG B 177 -44.824 -17.131 24.872 1.00 15.89 N ATOM 2679 CA ARG B 177 -43.754 -16.502 24.104 1.00 16.90 C ATOM 2680 C ARG B 177 -42.347 -16.597 24.754 1.00 17.09 C ATOM 2681 O ARG B 177 -42.179 -16.204 25.907 1.00 16.98 O ATOM 2682 CB ARG B 177 -44.081 -15.029 23.936 1.00 15.86 C ATOM 2683 CG ARG B 177 -43.142 -14.342 22.979 1.00 18.71 C ATOM 2684 CD ARG B 177 -43.405 -12.872 22.817 1.00 17.35 C ATOM 2685 NE ARG B 177 -42.746 -12.494 21.578 1.00 17.96 N ATOM 2686 CZ ARG B 177 -41.933 -11.463 21.401 1.00 18.88 C ATOM 2687 NH1 ARG B 177 -41.671 -10.630 22.389 1.00 23.82 N ATOM 2688 NH2 ARG B 177 -41.394 -11.260 20.201 1.00 18.80 N ATOM 2689 HA ARG B 177 -43.706 -17.044 23.159 1.00 0.00 H ATOM 2690 HB2 ARG B 177 -45.099 -14.936 23.557 1.00 0.00 H ATOM 2691 HB3 ARG B 177 -44.011 -14.541 24.908 1.00 0.00 H ATOM 2692 HG2 ARG B 177 -42.124 -14.470 23.346 1.00 0.00 H ATOM 2693 HG3 ARG B 177 -43.238 -14.818 22.003 1.00 0.00 H ATOM 2694 HD2 ARG B 177 -42.988 -12.315 23.656 1.00 0.00 H ATOM 2695 HD3 ARG B 177 -44.476 -12.681 22.753 1.00 0.00 H ATOM 2696 HE ARG B 177 -42.931 -13.092 20.748 1.00 0.00 H ATOM 2697 HH12 ARG B 177 -41.031 -9.825 22.235 1.00 0.00 H ATOM 2698 HH11 ARG B 177 -42.105 -10.778 23.323 1.00 0.00 H ATOM 2699 HH22 ARG B 177 -40.754 -10.455 20.048 1.00 0.00 H ATOM 2700 HH21 ARG B 177 -41.613 -11.907 19.417 1.00 0.00 H ATOM 2701 H ARG B 177 -45.717 -16.610 24.983 1.00 0.00 H ATOM 2702 N PHE B 178 -41.338 -17.087 24.026 1.00 17.56 N ATOM 2703 CA PHE B 178 -40.011 -17.274 24.653 1.00 17.67 C ATOM 2704 C PHE B 178 -38.988 -17.089 23.597 1.00 19.06 C ATOM 2705 O PHE B 178 -38.698 -18.040 22.839 1.00 20.67 O ATOM 2706 CB PHE B 178 -39.903 -18.716 25.168 1.00 16.59 C ATOM 2707 CG PHE B 178 -38.802 -18.937 26.140 1.00 14.02 C ATOM 2708 CD1 PHE B 178 -38.946 -18.553 27.471 1.00 13.23 C ATOM 2709 CD2 PHE B 178 -37.632 -19.550 25.727 1.00 12.70 C ATOM 2710 CE1 PHE B 178 -37.879 -18.786 28.376 1.00 17.29 C ATOM 2711 CE2 PHE B 178 -36.585 -19.745 26.581 1.00 13.25 C ATOM 2712 CZ PHE B 178 -36.697 -19.414 27.899 1.00 14.61 C ATOM 2713 HA PHE B 178 -39.872 -16.569 25.473 1.00 0.00 H ATOM 2714 HB2 PHE B 178 -40.844 -18.977 25.652 1.00 0.00 H ATOM 2715 HB3 PHE B 178 -39.741 -19.373 24.313 1.00 0.00 H ATOM 2716 HD2 PHE B 178 -37.544 -19.886 24.694 1.00 0.00 H ATOM 2717 HE2 PHE B 178 -35.653 -20.168 26.207 1.00 0.00 H ATOM 2718 HZ PHE B 178 -35.880 -19.631 28.587 1.00 0.00 H ATOM 2719 HE1 PHE B 178 -37.964 -18.488 29.421 1.00 0.00 H ATOM 2720 HD1 PHE B 178 -39.866 -18.080 27.813 1.00 0.00 H ATOM 2721 H PHE B 178 -41.485 -17.335 23.027 1.00 0.00 H ATOM 2722 N THR B 179 -38.442 -15.888 23.516 1.00 20.56 N ATOM 2723 CA THR B 179 -37.380 -15.583 22.541 1.00 19.88 C ATOM 2724 C THR B 179 -36.275 -14.839 23.179 1.00 20.89 C ATOM 2725 O THR B 179 -36.326 -14.523 24.363 1.00 21.40 O ATOM 2726 CB THR B 179 -37.897 -14.917 21.264 1.00 22.85 C ATOM 2727 OG1 THR B 179 -36.911 -15.072 20.186 1.00 23.39 O ATOM 2728 CG2 THR B 179 -38.377 -13.453 21.525 1.00 17.93 C ATOM 2729 HA THR B 179 -36.975 -16.537 22.203 1.00 0.00 H ATOM 2730 HB THR B 179 -38.798 -15.425 20.920 1.00 0.00 H ATOM 2731 HG1 THR B 179 -36.760 -16.035 20.015 1.00 0.00 H ATOM 2732 HG23 THR B 179 -39.102 -13.449 22.339 1.00 0.00 H ATOM 2733 HG21 THR B 179 -37.521 -12.834 21.796 1.00 0.00 H ATOM 2734 HG22 THR B 179 -38.841 -13.058 20.621 1.00 0.00 H ATOM 2735 H THR B 179 -38.771 -15.138 24.157 1.00 0.00 H ATOM 2736 N ASN B 180 -35.218 -14.618 22.417 1.00 20.67 N ATOM 2737 CA ASN B 180 -34.030 -13.968 22.912 1.00 21.14 C ATOM 2738 C ASN B 180 -33.433 -14.743 24.059 1.00 20.03 C ATOM 2739 O ASN B 180 -33.180 -14.199 25.145 1.00 20.43 O ATOM 2740 CB ASN B 180 -34.249 -12.437 23.139 1.00 22.51 C ATOM 2741 CG ASN B 180 -34.739 -11.730 21.817 1.00 25.22 C ATOM 2742 OD1 ASN B 180 -34.188 -11.963 20.728 1.00 30.11 O ATOM 2743 ND2 ASN B 180 -35.798 -10.921 21.920 1.00 29.15 N ATOM 2744 HA ASN B 180 -33.256 -13.988 22.145 1.00 0.00 H ATOM 2745 HB2 ASN B 180 -34.999 -12.296 23.917 1.00 0.00 H ATOM 2746 HB3 ASN B 180 -33.309 -11.986 23.457 1.00 0.00 H ATOM 2747 HD22 ASN B 180 -36.233 -10.750 22.849 1.00 0.00 H ATOM 2748 HD21 ASN B 180 -36.187 -10.463 21.071 1.00 0.00 H ATOM 2749 H ASN B 180 -35.244 -14.924 21.423 1.00 0.00 H ATOM 2750 N PHE B 181 -33.238 -16.036 23.794 1.00 18.45 N ATOM 2751 CA PHE B 181 -32.856 -17.023 24.812 1.00 17.48 C ATOM 2752 C PHE B 181 -31.425 -17.369 24.559 1.00 17.07 C ATOM 2753 O PHE B 181 -31.082 -17.848 23.504 1.00 17.06 O ATOM 2754 CB PHE B 181 -33.736 -18.310 24.738 1.00 18.11 C ATOM 2755 CG PHE B 181 -33.220 -19.460 25.602 1.00 17.72 C ATOM 2756 CD1 PHE B 181 -32.858 -19.227 26.929 1.00 16.33 C ATOM 2757 CD2 PHE B 181 -33.166 -20.749 25.090 1.00 16.20 C ATOM 2758 CE1 PHE B 181 -32.392 -20.247 27.742 1.00 16.38 C ATOM 2759 CE2 PHE B 181 -32.720 -21.841 25.892 1.00 18.49 C ATOM 2760 CZ PHE B 181 -32.338 -21.587 27.232 1.00 18.12 C ATOM 2761 HA PHE B 181 -33.003 -16.603 25.807 1.00 0.00 H ATOM 2762 HB2 PHE B 181 -34.744 -18.057 25.068 1.00 0.00 H ATOM 2763 HB3 PHE B 181 -33.768 -18.646 23.702 1.00 0.00 H ATOM 2764 HD2 PHE B 181 -33.469 -20.930 24.059 1.00 0.00 H ATOM 2765 HE2 PHE B 181 -32.674 -22.850 25.482 1.00 0.00 H ATOM 2766 HZ PHE B 181 -32.005 -22.404 27.872 1.00 0.00 H ATOM 2767 HE1 PHE B 181 -32.069 -20.033 28.761 1.00 0.00 H ATOM 2768 HD1 PHE B 181 -32.944 -18.219 27.335 1.00 0.00 H ATOM 2769 H PHE B 181 -33.363 -16.362 22.814 1.00 0.00 H ATOM 2770 N ASP B 182 -30.581 -17.047 25.510 1.00 15.85 N ATOM 2771 CA ASP B 182 -29.168 -17.345 25.429 1.00 16.74 C ATOM 2772 C ASP B 182 -28.868 -18.800 25.840 1.00 16.09 C ATOM 2773 O ASP B 182 -28.493 -19.075 26.928 1.00 16.47 O ATOM 2774 CB ASP B 182 -28.366 -16.347 26.274 1.00 16.99 C ATOM 2775 CG ASP B 182 -26.876 -16.578 26.193 1.00 16.48 C ATOM 2776 OD1 ASP B 182 -26.408 -17.466 25.439 1.00 20.32 O ATOM 2777 OD2 ASP B 182 -26.180 -15.869 26.946 1.00 16.43 O ATOM 2778 HA ASP B 182 -28.859 -17.241 24.389 1.00 0.00 H ATOM 2779 HB2 ASP B 182 -28.582 -15.339 25.921 1.00 0.00 H ATOM 2780 HB3 ASP B 182 -28.678 -16.441 27.314 1.00 0.00 H ATOM 2781 H ASP B 182 -30.942 -16.559 26.355 1.00 0.00 H ATOM 2782 N LEU B 183 -29.026 -19.705 24.887 1.00 15.36 N ATOM 2783 CA LEU B 183 -28.794 -21.120 25.144 1.00 14.77 C ATOM 2784 C LEU B 183 -27.290 -21.405 25.365 1.00 15.09 C ATOM 2785 O LEU B 183 -26.860 -22.226 26.250 1.00 15.01 O ATOM 2786 CB LEU B 183 -29.406 -21.923 23.980 1.00 13.12 C ATOM 2787 CG LEU B 183 -29.158 -23.433 24.096 1.00 15.05 C ATOM 2788 CD1 LEU B 183 -29.651 -24.016 25.484 1.00 11.58 C ATOM 2789 CD2 LEU B 183 -29.827 -24.054 22.891 1.00 15.76 C ATOM 2790 HA LEU B 183 -29.281 -21.431 26.068 1.00 0.00 H ATOM 2791 HB2 LEU B 183 -30.482 -21.748 23.965 1.00 0.00 H ATOM 2792 HB3 LEU B 183 -28.968 -21.570 23.046 1.00 0.00 H ATOM 2793 HG LEU B 183 -28.094 -23.671 24.092 1.00 0.00 H ATOM 2794 HD21 LEU B 183 -30.893 -23.825 22.910 1.00 0.00 H ATOM 2795 HD22 LEU B 183 -29.383 -23.649 21.982 1.00 0.00 H ATOM 2796 HD23 LEU B 183 -29.686 -25.135 22.915 1.00 0.00 H ATOM 2797 HD11 LEU B 183 -29.116 -23.521 26.295 1.00 0.00 H ATOM 2798 HD12 LEU B 183 -30.721 -23.839 25.591 1.00 0.00 H ATOM 2799 HD13 LEU B 183 -29.454 -25.087 25.517 1.00 0.00 H ATOM 2800 H LEU B 183 -29.321 -19.400 23.937 1.00 0.00 H ATOM 2801 N LEU B 184 -26.493 -20.728 24.575 1.00 16.38 N ATOM 2802 CA LEU B 184 -25.057 -20.874 24.601 1.00 19.22 C ATOM 2803 C LEU B 184 -24.492 -20.767 26.023 1.00 19.67 C ATOM 2804 O LEU B 184 -23.702 -21.589 26.423 1.00 17.57 O ATOM 2805 CB LEU B 184 -24.403 -19.847 23.657 1.00 19.87 C ATOM 2806 CG LEU B 184 -22.950 -20.219 23.376 1.00 22.76 C ATOM 2807 CD1 LEU B 184 -22.868 -21.625 22.671 1.00 22.59 C ATOM 2808 CD2 LEU B 184 -22.270 -19.134 22.570 1.00 20.81 C ATOM 2809 HA LEU B 184 -24.815 -21.876 24.246 1.00 0.00 H ATOM 2810 HB2 LEU B 184 -24.954 -19.823 22.717 1.00 0.00 H ATOM 2811 HB3 LEU B 184 -24.437 -18.862 24.122 1.00 0.00 H ATOM 2812 HG LEU B 184 -22.415 -20.300 24.322 1.00 0.00 H ATOM 2813 HD21 LEU B 184 -22.792 -19.006 21.622 1.00 0.00 H ATOM 2814 HD22 LEU B 184 -22.294 -18.199 23.129 1.00 0.00 H ATOM 2815 HD23 LEU B 184 -21.235 -19.419 22.380 1.00 0.00 H ATOM 2816 HD11 LEU B 184 -23.309 -22.382 23.320 1.00 0.00 H ATOM 2817 HD12 LEU B 184 -23.414 -21.590 21.728 1.00 0.00 H ATOM 2818 HD13 LEU B 184 -21.824 -21.873 22.479 1.00 0.00 H ATOM 2819 H LEU B 184 -26.913 -20.057 23.901 1.00 0.00 H ATOM 2820 N SER B 185 -24.981 -19.786 26.794 1.00 20.10 N ATOM 2821 CA SER B 185 -24.532 -19.547 28.144 1.00 20.08 C ATOM 2822 C SER B 185 -24.970 -20.590 29.131 1.00 20.82 C ATOM 2823 O SER B 185 -24.500 -20.605 30.275 1.00 18.78 O ATOM 2824 CB SER B 185 -24.914 -18.140 28.609 1.00 21.05 C ATOM 2825 OG SER B 185 -24.263 -17.186 27.760 1.00 23.42 O ATOM 2826 HA SER B 185 -23.445 -19.622 28.111 1.00 0.00 H ATOM 2827 HB2 SER B 185 -24.593 -17.994 29.640 1.00 0.00 H ATOM 2828 HB3 SER B 185 -25.995 -18.012 28.545 1.00 0.00 H ATOM 2829 HG SER B 185 -24.557 -17.324 26.825 1.00 0.00 H ATOM 2830 H SER B 185 -25.719 -19.168 26.401 1.00 0.00 H ATOM 2831 N LEU B 186 -25.852 -21.503 28.694 1.00 18.97 N ATOM 2832 CA LEU B 186 -26.261 -22.566 29.594 1.00 19.38 C ATOM 2833 C LEU B 186 -25.230 -23.705 29.561 1.00 19.88 C ATOM 2834 O LEU B 186 -25.193 -24.567 30.450 1.00 24.13 O ATOM 2835 CB LEU B 186 -27.666 -23.109 29.234 1.00 19.06 C ATOM 2836 CG LEU B 186 -28.842 -22.608 30.075 1.00 22.23 C ATOM 2837 CD1 LEU B 186 -30.123 -23.380 29.734 1.00 23.95 C ATOM 2838 CD2 LEU B 186 -28.550 -22.744 31.590 1.00 19.41 C ATOM 2839 HA LEU B 186 -26.313 -22.152 30.601 1.00 0.00 H ATOM 2840 HB2 LEU B 186 -27.866 -22.841 28.196 1.00 0.00 H ATOM 2841 HB3 LEU B 186 -27.633 -24.194 29.328 1.00 0.00 H ATOM 2842 HG LEU B 186 -28.982 -21.553 29.838 1.00 0.00 H ATOM 2843 HD21 LEU B 186 -28.372 -23.792 31.832 1.00 0.00 H ATOM 2844 HD22 LEU B 186 -27.667 -22.156 31.843 1.00 0.00 H ATOM 2845 HD23 LEU B 186 -29.406 -22.379 32.158 1.00 0.00 H ATOM 2846 HD11 LEU B 186 -30.360 -23.241 28.679 1.00 0.00 H ATOM 2847 HD12 LEU B 186 -29.972 -24.440 29.937 1.00 0.00 H ATOM 2848 HD13 LEU B 186 -30.945 -23.006 30.345 1.00 0.00 H ATOM 2849 H LEU B 186 -26.235 -21.450 27.729 1.00 0.00 H ATOM 2850 N LEU B 187 -24.393 -23.731 28.555 1.00 17.97 N ATOM 2851 CA LEU B 187 -23.401 -24.795 28.442 1.00 17.81 C ATOM 2852 C LEU B 187 -22.269 -24.550 29.421 1.00 16.98 C ATOM 2853 O LEU B 187 -21.980 -23.384 29.710 1.00 16.85 O ATOM 2854 CB LEU B 187 -22.905 -24.864 27.016 1.00 15.36 C ATOM 2855 CG LEU B 187 -23.995 -25.118 25.953 1.00 20.07 C ATOM 2856 CD1 LEU B 187 -23.323 -25.436 24.574 1.00 18.88 C ATOM 2857 CD2 LEU B 187 -25.091 -26.157 26.261 1.00 19.04 C ATOM 2858 HA LEU B 187 -23.850 -25.756 28.693 1.00 0.00 H ATOM 2859 HB2 LEU B 187 -22.419 -23.917 26.781 1.00 0.00 H ATOM 2860 HB3 LEU B 187 -22.175 -25.671 26.951 1.00 0.00 H ATOM 2861 HG LEU B 187 -24.552 -24.181 25.942 1.00 0.00 H ATOM 2862 HD21 LEU B 187 -24.630 -27.131 26.428 1.00 0.00 H ATOM 2863 HD22 LEU B 187 -25.637 -25.854 27.155 1.00 0.00 H ATOM 2864 HD23 LEU B 187 -25.779 -26.219 25.418 1.00 0.00 H ATOM 2865 HD11 LEU B 187 -22.708 -24.590 24.267 1.00 0.00 H ATOM 2866 HD12 LEU B 187 -22.699 -26.324 24.672 1.00 0.00 H ATOM 2867 HD13 LEU B 187 -24.096 -25.615 23.827 1.00 0.00 H ATOM 2868 H LEU B 187 -24.435 -22.987 27.830 1.00 0.00 H ATOM 2869 N PRO B 188 -21.591 -25.631 29.904 1.00 16.45 N ATOM 2870 CA PRO B 188 -20.413 -25.424 30.744 1.00 15.70 C ATOM 2871 C PRO B 188 -19.237 -24.900 29.868 1.00 17.47 C ATOM 2872 O PRO B 188 -19.300 -24.989 28.638 1.00 14.58 O ATOM 2873 CB PRO B 188 -20.051 -26.869 31.237 1.00 15.51 C ATOM 2874 CG PRO B 188 -20.441 -27.739 30.029 1.00 14.32 C ATOM 2875 CD PRO B 188 -21.801 -27.079 29.629 1.00 16.20 C ATOM 2876 HA PRO B 188 -20.589 -24.712 31.551 1.00 0.00 H ATOM 2877 HD3 PRO B 188 -22.018 -27.246 28.574 1.00 0.00 H ATOM 2878 HD2 PRO B 188 -22.617 -27.475 30.234 1.00 0.00 H ATOM 2879 HG3 PRO B 188 -20.568 -28.784 30.310 1.00 0.00 H ATOM 2880 HG2 PRO B 188 -19.707 -27.666 29.227 1.00 0.00 H ATOM 2881 HB2 PRO B 188 -18.987 -26.955 31.458 1.00 0.00 H ATOM 2882 HB3 PRO B 188 -20.628 -27.140 32.121 1.00 0.00 H ATOM 2883 N PRO B 189 -18.184 -24.328 30.508 1.00 17.17 N ATOM 2884 CA PRO B 189 -17.014 -23.782 29.809 1.00 17.77 C ATOM 2885 C PRO B 189 -16.327 -24.806 28.950 1.00 16.18 C ATOM 2886 O PRO B 189 -15.948 -24.518 27.804 1.00 14.36 O ATOM 2887 CB PRO B 189 -16.110 -23.319 30.965 1.00 18.81 C ATOM 2888 CG PRO B 189 -17.000 -22.992 32.006 1.00 20.06 C ATOM 2889 CD PRO B 189 -18.084 -24.072 31.948 1.00 17.85 C ATOM 2890 HA PRO B 189 -17.277 -22.984 29.114 1.00 0.00 H ATOM 2891 HD3 PRO B 189 -17.780 -24.968 32.490 1.00 0.00 H ATOM 2892 HD2 PRO B 189 -19.028 -23.708 32.352 1.00 0.00 H ATOM 2893 HG3 PRO B 189 -17.433 -22.004 31.846 1.00 0.00 H ATOM 2894 HG2 PRO B 189 -16.489 -23.012 32.969 1.00 0.00 H ATOM 2895 HB2 PRO B 189 -15.437 -24.120 31.272 1.00 0.00 H ATOM 2896 HB3 PRO B 189 -15.525 -22.447 30.671 1.00 0.00 H ATOM 2897 N SER B 190 -16.128 -25.998 29.513 1.00 15.55 N ATOM 2898 CA SER B 190 -15.494 -27.093 28.770 1.00 15.33 C ATOM 2899 C SER B 190 -16.601 -27.917 28.056 1.00 14.44 C ATOM 2900 O SER B 190 -17.581 -28.351 28.698 1.00 12.98 O ATOM 2901 CB SER B 190 -14.707 -28.036 29.703 1.00 14.51 C ATOM 2902 OG SER B 190 -14.216 -29.109 28.952 1.00 15.69 O ATOM 2903 HA SER B 190 -14.797 -26.658 28.054 1.00 0.00 H ATOM 2904 HB2 SER B 190 -15.366 -28.409 30.487 1.00 0.00 H ATOM 2905 HB3 SER B 190 -13.876 -27.495 30.155 1.00 0.00 H ATOM 2906 HG SER B 190 -13.619 -28.766 28.240 1.00 0.00 H ATOM 2907 H SER B 190 -16.428 -26.155 30.497 1.00 0.00 H ATOM 2908 N TRP B 191 -16.364 -28.181 26.773 1.00 13.83 N ATOM 2909 CA TRP B 191 -17.248 -28.998 25.925 1.00 15.25 C ATOM 2910 C TRP B 191 -16.735 -30.415 25.636 1.00 15.01 C ATOM 2911 O TRP B 191 -17.286 -31.087 24.748 1.00 14.32 O ATOM 2912 CB TRP B 191 -17.632 -28.268 24.604 1.00 14.96 C ATOM 2913 CG TRP B 191 -18.262 -26.916 24.805 1.00 14.77 C ATOM 2914 CD1 TRP B 191 -18.799 -26.421 25.981 1.00 17.64 C ATOM 2915 CD2 TRP B 191 -18.538 -25.923 23.797 1.00 15.13 C ATOM 2916 NE1 TRP B 191 -19.322 -25.160 25.762 1.00 17.57 N ATOM 2917 CE2 TRP B 191 -19.203 -24.861 24.423 1.00 17.15 C ATOM 2918 CE3 TRP B 191 -18.289 -25.844 22.423 1.00 15.02 C ATOM 2919 CZ2 TRP B 191 -19.597 -23.678 23.722 1.00 19.29 C ATOM 2920 CZ3 TRP B 191 -18.703 -24.707 21.712 1.00 14.27 C ATOM 2921 CH2 TRP B 191 -19.359 -23.627 22.373 1.00 13.96 C ATOM 2922 HA TRP B 191 -18.147 -29.129 26.527 1.00 0.00 H ATOM 2923 HB2 TRP B 191 -16.728 -28.139 24.010 1.00 0.00 H ATOM 2924 HB3 TRP B 191 -18.337 -28.896 24.059 1.00 0.00 H ATOM 2925 HE1 TRP B 191 -19.736 -24.541 26.487 1.00 0.00 H ATOM 2926 HD1 TRP B 191 -18.808 -26.946 26.936 1.00 0.00 H ATOM 2927 HZ2 TRP B 191 -20.070 -22.846 24.243 1.00 0.00 H ATOM 2928 HH2 TRP B 191 -19.674 -22.754 21.801 1.00 0.00 H ATOM 2929 HZ3 TRP B 191 -18.520 -24.649 20.639 1.00 0.00 H ATOM 2930 HE3 TRP B 191 -17.778 -26.658 21.909 1.00 0.00 H ATOM 2931 H TRP B 191 -15.503 -27.787 26.344 1.00 0.00 H ATOM 2932 N ASP B 192 -15.772 -30.902 26.438 1.00 13.09 N ATOM 2933 CA ASP B 192 -15.375 -32.280 26.339 1.00 13.09 C ATOM 2934 C ASP B 192 -16.622 -33.142 26.529 1.00 12.30 C ATOM 2935 O ASP B 192 -17.492 -32.813 27.369 1.00 12.57 O ATOM 2936 CB ASP B 192 -14.366 -32.611 27.413 1.00 13.15 C ATOM 2937 CG ASP B 192 -13.005 -31.910 27.197 1.00 16.30 C ATOM 2938 OD1 ASP B 192 -12.735 -31.413 26.083 1.00 17.92 O ATOM 2939 OD2 ASP B 192 -12.251 -31.912 28.174 1.00 18.41 O ATOM 2940 HA ASP B 192 -14.919 -32.468 25.367 1.00 0.00 H ATOM 2941 HB2 ASP B 192 -14.769 -32.300 28.377 1.00 0.00 H ATOM 2942 HB3 ASP B 192 -14.205 -33.689 27.419 1.00 0.00 H ATOM 2943 H ASP B 192 -15.313 -30.279 27.133 1.00 0.00 H ATOM 2944 N TYR B 193 -16.706 -34.203 25.736 1.00 11.88 N ATOM 2945 CA TYR B 193 -17.905 -35.029 25.776 1.00 12.82 C ATOM 2946 C TYR B 193 -17.613 -36.511 25.513 1.00 13.51 C ATOM 2947 O TYR B 193 -16.550 -36.869 24.995 1.00 14.34 O ATOM 2948 CB TYR B 193 -18.879 -34.463 24.751 1.00 13.51 C ATOM 2949 CG TYR B 193 -18.336 -34.548 23.349 1.00 14.68 C ATOM 2950 CD1 TYR B 193 -18.458 -35.748 22.634 1.00 13.23 C ATOM 2951 CD2 TYR B 193 -17.643 -33.431 22.745 1.00 14.75 C ATOM 2952 CE1 TYR B 193 -17.971 -35.858 21.347 1.00 18.74 C ATOM 2953 CE2 TYR B 193 -17.118 -33.557 21.430 1.00 11.32 C ATOM 2954 CZ TYR B 193 -17.300 -34.789 20.765 1.00 15.55 C ATOM 2955 OH TYR B 193 -16.799 -35.009 19.467 1.00 18.79 O ATOM 2956 HA TYR B 193 -18.335 -34.997 26.777 1.00 0.00 H ATOM 2957 HB3 TYR B 193 -19.074 -33.418 24.990 1.00 0.00 H ATOM 2958 HB2 TYR B 193 -19.811 -35.026 24.802 1.00 0.00 H ATOM 2959 HD2 TYR B 193 -17.524 -32.498 23.295 1.00 0.00 H ATOM 2960 HE2 TYR B 193 -16.593 -32.730 20.951 1.00 0.00 H ATOM 2961 HE1 TYR B 193 -18.113 -36.783 20.788 1.00 0.00 H ATOM 2962 HD1 TYR B 193 -18.944 -36.605 23.100 1.00 0.00 H ATOM 2963 HH TYR B 193 -15.815 -34.899 19.471 1.00 0.00 H ATOM 2964 H TYR B 193 -15.924 -34.442 25.093 1.00 0.00 H ATOM 2965 N TRP B 194 -18.586 -37.355 25.839 1.00 13.69 N ATOM 2966 CA TRP B 194 -18.658 -38.701 25.323 1.00 14.33 C ATOM 2967 C TRP B 194 -19.783 -38.782 24.276 1.00 13.19 C ATOM 2968 O TRP B 194 -20.753 -38.042 24.320 1.00 15.25 O ATOM 2969 CB TRP B 194 -18.994 -39.685 26.440 1.00 15.04 C ATOM 2970 CG TRP B 194 -18.034 -39.612 27.632 1.00 14.85 C ATOM 2971 CD1 TRP B 194 -16.774 -40.169 27.717 1.00 16.16 C ATOM 2972 CD2 TRP B 194 -18.264 -38.942 28.875 1.00 11.66 C ATOM 2973 NE1 TRP B 194 -16.215 -39.863 28.921 1.00 13.17 N ATOM 2974 CE2 TRP B 194 -17.107 -39.143 29.669 1.00 12.82 C ATOM 2975 CE3 TRP B 194 -19.341 -38.208 29.398 1.00 10.18 C ATOM 2976 CZ2 TRP B 194 -16.971 -38.634 30.997 1.00 14.66 C ATOM 2977 CZ3 TRP B 194 -19.217 -37.676 30.750 1.00 16.28 C ATOM 2978 CH2 TRP B 194 -18.014 -37.906 31.511 1.00 14.42 C ATOM 2979 HA TRP B 194 -17.692 -38.953 24.885 1.00 0.00 H ATOM 2980 HB2 TRP B 194 -20.002 -39.472 26.796 1.00 0.00 H ATOM 2981 HB3 TRP B 194 -18.960 -40.695 26.031 1.00 0.00 H ATOM 2982 HE1 TRP B 194 -15.258 -40.135 29.225 1.00 0.00 H ATOM 2983 HD1 TRP B 194 -16.298 -40.764 26.938 1.00 0.00 H ATOM 2984 HZ2 TRP B 194 -16.070 -38.818 31.582 1.00 0.00 H ATOM 2985 HH2 TRP B 194 -17.932 -37.493 32.516 1.00 0.00 H ATOM 2986 HZ3 TRP B 194 -20.035 -37.103 31.186 1.00 0.00 H ATOM 2987 HE3 TRP B 194 -20.244 -38.041 28.810 1.00 0.00 H ATOM 2988 H TRP B 194 -19.327 -37.032 26.494 1.00 0.00 H ATOM 2989 N THR B 195 -19.675 -39.746 23.399 1.00 13.74 N ATOM 2990 CA THR B 195 -20.631 -39.908 22.326 1.00 13.38 C ATOM 2991 C THR B 195 -20.860 -41.377 22.075 1.00 13.85 C ATOM 2992 O THR B 195 -19.945 -42.208 22.297 1.00 14.06 O ATOM 2993 CB THR B 195 -20.227 -39.119 21.043 1.00 13.12 C ATOM 2994 OG1 THR B 195 -21.243 -39.346 20.056 1.00 10.62 O ATOM 2995 CG2 THR B 195 -18.820 -39.540 20.481 1.00 14.10 C ATOM 2996 HA THR B 195 -21.580 -39.468 22.632 1.00 0.00 H ATOM 2997 HB THR B 195 -20.145 -38.062 21.296 1.00 0.00 H ATOM 2998 HG1 THR B 195 -22.114 -39.024 20.400 1.00 0.00 H ATOM 2999 HG23 THR B 195 -18.059 -39.362 21.241 1.00 0.00 H ATOM 3000 HG21 THR B 195 -18.836 -40.598 20.221 1.00 0.00 H ATOM 3001 HG22 THR B 195 -18.594 -38.950 19.593 1.00 0.00 H ATOM 3002 H THR B 195 -18.881 -40.413 23.475 1.00 0.00 H ATOM 3003 N TYR B 196 -22.113 -41.706 21.744 1.00 13.33 N ATOM 3004 CA TYR B 196 -22.501 -43.087 21.443 1.00 13.16 C ATOM 3005 C TYR B 196 -23.793 -43.052 20.651 1.00 13.66 C ATOM 3006 O TYR B 196 -24.515 -42.038 20.655 1.00 14.28 O ATOM 3007 CB TYR B 196 -22.618 -43.911 22.774 1.00 12.09 C ATOM 3008 CG TYR B 196 -23.835 -43.553 23.595 1.00 10.22 C ATOM 3009 CD1 TYR B 196 -23.841 -42.437 24.490 1.00 12.37 C ATOM 3010 CD2 TYR B 196 -25.030 -44.279 23.437 1.00 11.55 C ATOM 3011 CE1 TYR B 196 -24.989 -42.090 25.161 1.00 11.36 C ATOM 3012 CE2 TYR B 196 -26.168 -43.940 24.076 1.00 9.59 C ATOM 3013 CZ TYR B 196 -26.153 -42.873 24.962 1.00 10.26 C ATOM 3014 OH TYR B 196 -27.353 -42.609 25.580 1.00 13.27 O ATOM 3015 HA TYR B 196 -21.746 -43.589 20.838 1.00 0.00 H ATOM 3016 HB3 TYR B 196 -21.728 -43.725 23.375 1.00 0.00 H ATOM 3017 HB2 TYR B 196 -22.670 -44.970 22.522 1.00 0.00 H ATOM 3018 HD2 TYR B 196 -25.036 -45.145 22.775 1.00 0.00 H ATOM 3019 HE2 TYR B 196 -27.088 -44.497 23.899 1.00 0.00 H ATOM 3020 HE1 TYR B 196 -25.004 -41.231 25.832 1.00 0.00 H ATOM 3021 HD1 TYR B 196 -22.930 -41.858 24.641 1.00 0.00 H ATOM 3022 HH TYR B 196 -27.246 -41.836 26.190 1.00 0.00 H ATOM 3023 H TYR B 196 -22.835 -40.959 21.699 1.00 0.00 H ATOM 3024 N PRO B 197 -24.096 -44.144 19.923 1.00 15.55 N ATOM 3025 CA PRO B 197 -25.369 -44.196 19.205 1.00 14.07 C ATOM 3026 C PRO B 197 -26.490 -44.684 20.155 1.00 13.79 C ATOM 3027 O PRO B 197 -26.314 -45.678 20.880 1.00 13.18 O ATOM 3028 CB PRO B 197 -25.058 -45.204 18.061 1.00 11.79 C ATOM 3029 CG PRO B 197 -24.107 -46.238 18.776 1.00 14.68 C ATOM 3030 CD PRO B 197 -23.232 -45.336 19.638 1.00 15.12 C ATOM 3031 HA PRO B 197 -25.726 -43.239 18.824 1.00 0.00 H ATOM 3032 HD3 PRO B 197 -22.951 -45.840 20.563 1.00 0.00 H ATOM 3033 HD2 PRO B 197 -22.332 -45.041 19.099 1.00 0.00 H ATOM 3034 HG3 PRO B 197 -23.510 -46.792 18.051 1.00 0.00 H ATOM 3035 HG2 PRO B 197 -24.675 -46.939 19.388 1.00 0.00 H ATOM 3036 HB2 PRO B 197 -25.967 -45.686 17.701 1.00 0.00 H ATOM 3037 HB3 PRO B 197 -24.554 -44.714 17.228 1.00 0.00 H ATOM 3038 N GLY B 198 -27.592 -43.933 20.220 1.00 12.34 N ATOM 3039 CA GLY B 198 -28.646 -44.311 21.084 1.00 12.79 C ATOM 3040 C GLY B 198 -29.996 -43.867 20.568 1.00 12.76 C ATOM 3041 O GLY B 198 -30.275 -43.992 19.394 1.00 13.13 O ATOM 3042 HA3 GLY B 198 -28.478 -43.859 22.062 1.00 0.00 H ATOM 3043 HA2 GLY B 198 -28.647 -45.397 21.182 1.00 0.00 H ATOM 3044 H GLY B 198 -27.675 -43.075 19.638 1.00 0.00 H ATOM 3045 N SER B 199 -30.844 -43.471 21.484 1.00 12.32 N ATOM 3046 CA SER B 199 -32.276 -43.314 21.224 1.00 13.09 C ATOM 3047 C SER B 199 -32.845 -42.089 21.874 1.00 11.93 C ATOM 3048 O SER B 199 -32.134 -41.463 22.696 1.00 11.27 O ATOM 3049 CB SER B 199 -33.073 -44.550 21.710 1.00 12.52 C ATOM 3050 OG SER B 199 -33.149 -44.595 23.079 1.00 11.76 O ATOM 3051 HA SER B 199 -32.374 -43.211 20.143 1.00 0.00 H ATOM 3052 HB2 SER B 199 -32.578 -45.453 21.353 1.00 0.00 H ATOM 3053 HB3 SER B 199 -34.082 -44.504 21.301 1.00 0.00 H ATOM 3054 HG SER B 199 -33.603 -43.780 23.410 1.00 0.00 H ATOM 3055 H SER B 199 -30.485 -43.259 22.437 1.00 0.00 H ATOM 3056 N LEU B 200 -34.137 -41.799 21.545 1.00 10.72 N ATOM 3057 CA LEU B 200 -34.993 -40.947 22.427 1.00 11.74 C ATOM 3058 C LEU B 200 -35.096 -41.644 23.758 1.00 10.55 C ATOM 3059 O LEU B 200 -35.269 -42.885 23.834 1.00 12.47 O ATOM 3060 CB LEU B 200 -36.410 -40.647 21.915 1.00 10.03 C ATOM 3061 CG LEU B 200 -36.468 -40.238 20.405 1.00 14.23 C ATOM 3062 CD1 LEU B 200 -37.860 -40.291 19.898 1.00 14.52 C ATOM 3063 CD2 LEU B 200 -35.912 -38.818 20.280 1.00 15.57 C ATOM 3064 HA LEU B 200 -34.506 -39.973 22.473 1.00 0.00 H ATOM 3065 HB2 LEU B 200 -37.021 -41.539 22.052 1.00 0.00 H ATOM 3066 HB3 LEU B 200 -36.823 -39.831 22.508 1.00 0.00 H ATOM 3067 HG LEU B 200 -35.875 -40.933 19.810 1.00 0.00 H ATOM 3068 HD21 LEU B 200 -36.518 -38.138 20.879 1.00 0.00 H ATOM 3069 HD22 LEU B 200 -34.882 -38.800 20.637 1.00 0.00 H ATOM 3070 HD23 LEU B 200 -35.941 -38.508 19.235 1.00 0.00 H ATOM 3071 HD11 LEU B 200 -38.245 -41.305 20.003 1.00 0.00 H ATOM 3072 HD12 LEU B 200 -38.481 -39.604 20.473 1.00 0.00 H ATOM 3073 HD13 LEU B 200 -37.874 -40.003 18.847 1.00 0.00 H ATOM 3074 H LEU B 200 -34.535 -42.178 20.662 1.00 0.00 H ATOM 3075 N THR B 201 -35.027 -40.837 24.810 1.00 11.28 N ATOM 3076 CA THR B 201 -35.215 -41.369 26.172 1.00 11.00 C ATOM 3077 C THR B 201 -36.639 -41.346 26.567 1.00 11.48 C ATOM 3078 O THR B 201 -36.986 -41.635 27.726 1.00 11.58 O ATOM 3079 CB THR B 201 -34.323 -40.620 27.219 1.00 11.19 C ATOM 3080 OG1 THR B 201 -34.829 -39.294 27.474 1.00 11.46 O ATOM 3081 CG2 THR B 201 -32.840 -40.669 26.742 1.00 8.34 C ATOM 3082 HA THR B 201 -34.891 -42.410 26.157 1.00 0.00 H ATOM 3083 HB THR B 201 -34.361 -41.118 28.188 1.00 0.00 H ATOM 3084 HG1 THR B 201 -34.249 -38.843 28.137 1.00 0.00 H ATOM 3085 HG23 THR B 201 -32.547 -41.706 26.575 1.00 0.00 H ATOM 3086 HG21 THR B 201 -32.740 -40.108 25.813 1.00 0.00 H ATOM 3087 HG22 THR B 201 -32.199 -40.227 27.505 1.00 0.00 H ATOM 3088 H THR B 201 -34.839 -39.823 24.672 1.00 0.00 H ATOM 3089 N VAL B 202 -37.487 -40.951 25.621 1.00 11.56 N ATOM 3090 CA VAL B 202 -38.926 -40.889 25.883 1.00 12.59 C ATOM 3091 C VAL B 202 -39.597 -41.677 24.718 1.00 12.89 C ATOM 3092 O VAL B 202 -39.041 -41.740 23.591 1.00 12.82 O ATOM 3093 CB VAL B 202 -39.550 -39.414 25.994 1.00 13.32 C ATOM 3094 CG1 VAL B 202 -39.037 -38.565 27.241 1.00 14.90 C ATOM 3095 CG2 VAL B 202 -39.381 -38.607 24.691 1.00 9.19 C ATOM 3096 HA VAL B 202 -39.114 -41.315 26.868 1.00 0.00 H ATOM 3097 HB VAL B 202 -40.612 -39.592 26.164 1.00 0.00 H ATOM 3098 HG11 VAL B 202 -39.293 -39.086 28.164 1.00 0.00 H ATOM 3099 HG12 VAL B 202 -37.955 -38.446 27.178 1.00 0.00 H ATOM 3100 HG13 VAL B 202 -39.513 -37.584 27.232 1.00 0.00 H ATOM 3101 HG21 VAL B 202 -38.320 -38.509 24.461 1.00 0.00 H ATOM 3102 HG22 VAL B 202 -39.884 -39.126 23.876 1.00 0.00 H ATOM 3103 HG23 VAL B 202 -39.820 -37.617 24.819 1.00 0.00 H ATOM 3104 H VAL B 202 -37.123 -40.683 24.684 1.00 0.00 H ATOM 3105 N PRO B 203 -40.752 -42.329 24.986 1.00 12.66 N ATOM 3106 CA PRO B 203 -41.539 -42.941 23.866 1.00 12.22 C ATOM 3107 C PRO B 203 -41.675 -41.907 22.716 1.00 13.50 C ATOM 3108 O PRO B 203 -41.945 -40.770 23.018 1.00 12.95 O ATOM 3109 CB PRO B 203 -42.902 -43.213 24.519 1.00 10.93 C ATOM 3110 CG PRO B 203 -42.492 -43.574 26.037 1.00 12.18 C ATOM 3111 CD PRO B 203 -41.379 -42.510 26.314 1.00 9.94 C ATOM 3112 HA PRO B 203 -41.090 -43.836 23.436 1.00 0.00 H ATOM 3113 HD3 PRO B 203 -41.811 -41.576 26.674 1.00 0.00 H ATOM 3114 HD2 PRO B 203 -40.656 -42.879 27.042 1.00 0.00 H ATOM 3115 HG3 PRO B 203 -42.103 -44.589 26.115 1.00 0.00 H ATOM 3116 HG2 PRO B 203 -43.335 -43.456 26.717 1.00 0.00 H ATOM 3117 HB2 PRO B 203 -43.541 -42.331 24.482 1.00 0.00 H ATOM 3118 HB3 PRO B 203 -43.411 -44.049 24.038 1.00 0.00 H ATOM 3119 N PRO B 204 -41.547 -42.317 21.425 1.00 14.38 N ATOM 3120 CA PRO B 204 -41.386 -43.692 20.958 1.00 14.64 C ATOM 3121 C PRO B 204 -39.997 -44.330 21.027 1.00 14.54 C ATOM 3122 O PRO B 204 -39.841 -45.453 20.491 1.00 13.91 O ATOM 3123 CB PRO B 204 -41.863 -43.618 19.479 1.00 15.58 C ATOM 3124 CG PRO B 204 -41.495 -42.199 19.048 1.00 15.29 C ATOM 3125 CD PRO B 204 -41.613 -41.338 20.291 1.00 16.03 C ATOM 3126 HA PRO B 204 -41.947 -44.345 21.627 1.00 0.00 H ATOM 3127 HD3 PRO B 204 -40.790 -40.625 20.347 1.00 0.00 H ATOM 3128 HD2 PRO B 204 -42.560 -40.799 20.300 1.00 0.00 H ATOM 3129 HG3 PRO B 204 -42.181 -41.847 18.277 1.00 0.00 H ATOM 3130 HG2 PRO B 204 -40.475 -42.172 18.664 1.00 0.00 H ATOM 3131 HB2 PRO B 204 -41.346 -44.357 18.866 1.00 0.00 H ATOM 3132 HB3 PRO B 204 -42.939 -43.779 19.409 1.00 0.00 H ATOM 3133 N LEU B 205 -39.012 -43.723 21.707 1.00 13.10 N ATOM 3134 CA LEU B 205 -37.729 -44.430 22.030 1.00 13.09 C ATOM 3135 C LEU B 205 -37.004 -44.795 20.747 1.00 12.36 C ATOM 3136 O LEU B 205 -36.286 -45.815 20.653 1.00 10.90 O ATOM 3137 CB LEU B 205 -37.999 -45.688 22.878 1.00 14.05 C ATOM 3138 CG LEU B 205 -38.624 -45.397 24.285 1.00 15.73 C ATOM 3139 CD1 LEU B 205 -39.137 -46.688 25.023 1.00 12.79 C ATOM 3140 CD2 LEU B 205 -37.790 -44.559 25.210 1.00 16.98 C ATOM 3141 HA LEU B 205 -37.097 -43.761 22.613 1.00 0.00 H ATOM 3142 HB2 LEU B 205 -38.685 -46.331 22.326 1.00 0.00 H ATOM 3143 HB3 LEU B 205 -37.053 -46.210 23.026 1.00 0.00 H ATOM 3144 HG LEU B 205 -39.486 -44.782 24.028 1.00 0.00 H ATOM 3145 HD21 LEU B 205 -36.840 -45.061 25.396 1.00 0.00 H ATOM 3146 HD22 LEU B 205 -37.606 -43.588 24.751 1.00 0.00 H ATOM 3147 HD23 LEU B 205 -38.321 -44.422 26.152 1.00 0.00 H ATOM 3148 HD11 LEU B 205 -39.905 -47.170 24.418 1.00 0.00 H ATOM 3149 HD12 LEU B 205 -38.304 -47.375 25.171 1.00 0.00 H ATOM 3150 HD13 LEU B 205 -39.556 -46.410 25.990 1.00 0.00 H ATOM 3151 H LEU B 205 -39.141 -42.739 22.017 1.00 0.00 H ATOM 3152 N LEU B 206 -37.207 -43.974 19.712 1.00 12.12 N ATOM 3153 CA LEU B 206 -36.571 -44.298 18.404 1.00 12.34 C ATOM 3154 C LEU B 206 -35.061 -44.263 18.458 1.00 11.48 C ATOM 3155 O LEU B 206 -34.474 -43.321 19.016 1.00 11.21 O ATOM 3156 CB LEU B 206 -37.042 -43.326 17.297 1.00 12.39 C ATOM 3157 CG LEU B 206 -38.567 -43.298 17.129 1.00 12.48 C ATOM 3158 CD1 LEU B 206 -38.946 -42.101 16.278 1.00 15.00 C ATOM 3159 CD2 LEU B 206 -38.998 -44.607 16.471 1.00 16.41 C ATOM 3160 HA LEU B 206 -36.885 -45.316 18.172 1.00 0.00 H ATOM 3161 HB2 LEU B 206 -36.702 -42.322 17.549 1.00 0.00 H ATOM 3162 HB3 LEU B 206 -36.594 -43.633 16.352 1.00 0.00 H ATOM 3163 HG LEU B 206 -39.070 -43.204 18.091 1.00 0.00 H ATOM 3164 HD21 LEU B 206 -38.515 -44.700 15.498 1.00 0.00 H ATOM 3165 HD22 LEU B 206 -38.705 -45.444 17.105 1.00 0.00 H ATOM 3166 HD23 LEU B 206 -40.080 -44.608 16.342 1.00 0.00 H ATOM 3167 HD11 LEU B 206 -38.612 -41.187 16.769 1.00 0.00 H ATOM 3168 HD12 LEU B 206 -38.469 -42.185 15.302 1.00 0.00 H ATOM 3169 HD13 LEU B 206 -40.029 -42.073 16.154 1.00 0.00 H ATOM 3170 H LEU B 206 -37.798 -43.125 19.818 1.00 0.00 H ATOM 3171 N GLU B 207 -34.429 -45.224 17.786 1.00 11.19 N ATOM 3172 CA GLU B 207 -32.990 -45.343 17.791 1.00 10.53 C ATOM 3173 C GLU B 207 -32.376 -44.543 16.655 1.00 12.55 C ATOM 3174 O GLU B 207 -31.841 -45.081 15.663 1.00 13.59 O ATOM 3175 CB GLU B 207 -32.630 -46.828 17.782 1.00 12.00 C ATOM 3176 CG GLU B 207 -33.110 -47.482 19.117 1.00 10.46 C ATOM 3177 CD GLU B 207 -32.766 -48.950 19.212 1.00 10.80 C ATOM 3178 OE1 GLU B 207 -32.602 -49.588 18.169 1.00 15.91 O ATOM 3179 OE2 GLU B 207 -32.722 -49.480 20.346 1.00 13.75 O ATOM 3180 HA GLU B 207 -32.564 -44.910 18.696 1.00 0.00 H ATOM 3181 HB2 GLU B 207 -33.120 -47.317 16.940 1.00 0.00 H ATOM 3182 HB3 GLU B 207 -31.550 -46.941 17.688 1.00 0.00 H ATOM 3183 HG2 GLU B 207 -32.638 -46.960 19.949 1.00 0.00 H ATOM 3184 HG3 GLU B 207 -34.192 -47.373 19.188 1.00 0.00 H ATOM 3185 H GLU B 207 -34.989 -45.910 17.241 1.00 0.00 H ATOM 3186 N SER B 208 -32.420 -43.238 16.841 1.00 13.85 N ATOM 3187 CA SER B 208 -32.151 -42.273 15.785 1.00 14.41 C ATOM 3188 C SER B 208 -31.173 -41.178 16.288 1.00 14.36 C ATOM 3189 O SER B 208 -30.934 -40.168 15.585 1.00 15.50 O ATOM 3190 CB SER B 208 -33.487 -41.608 15.422 1.00 15.31 C ATOM 3191 OG SER B 208 -34.025 -40.875 16.496 1.00 17.97 O ATOM 3192 HA SER B 208 -31.703 -42.775 14.927 1.00 0.00 H ATOM 3193 HB2 SER B 208 -34.198 -42.382 15.134 1.00 0.00 H ATOM 3194 HB3 SER B 208 -33.326 -40.933 14.581 1.00 0.00 H ATOM 3195 HG SER B 208 -34.882 -40.465 16.218 1.00 0.00 H ATOM 3196 H SER B 208 -32.658 -42.881 17.788 1.00 0.00 H ATOM 3197 N VAL B 209 -30.652 -41.358 17.505 1.00 12.80 N ATOM 3198 CA VAL B 209 -29.912 -40.245 18.221 1.00 11.46 C ATOM 3199 C VAL B 209 -28.405 -40.528 18.317 1.00 11.27 C ATOM 3200 O VAL B 209 -27.985 -41.568 18.834 1.00 10.98 O ATOM 3201 CB VAL B 209 -30.504 -39.947 19.685 1.00 10.62 C ATOM 3202 CG1 VAL B 209 -29.649 -38.773 20.423 1.00 7.90 C ATOM 3203 CG2 VAL B 209 -32.043 -39.679 19.659 1.00 12.22 C ATOM 3204 HA VAL B 209 -30.063 -39.354 17.612 1.00 0.00 H ATOM 3205 HB VAL B 209 -30.387 -40.847 20.289 1.00 0.00 H ATOM 3206 HG11 VAL B 209 -28.610 -39.088 20.520 1.00 0.00 H ATOM 3207 HG12 VAL B 209 -29.700 -37.860 19.829 1.00 0.00 H ATOM 3208 HG13 VAL B 209 -30.067 -38.588 21.412 1.00 0.00 H ATOM 3209 HG21 VAL B 209 -32.249 -38.814 19.028 1.00 0.00 H ATOM 3210 HG22 VAL B 209 -32.556 -40.553 19.258 1.00 0.00 H ATOM 3211 HG23 VAL B 209 -32.394 -39.483 20.672 1.00 0.00 H ATOM 3212 H VAL B 209 -30.756 -42.282 17.971 1.00 0.00 H ATOM 3213 N THR B 210 -27.608 -39.616 17.780 1.00 11.89 N ATOM 3214 CA THR B 210 -26.189 -39.466 18.147 1.00 12.25 C ATOM 3215 C THR B 210 -26.125 -38.633 19.439 1.00 12.32 C ATOM 3216 O THR B 210 -26.384 -37.438 19.445 1.00 11.74 O ATOM 3217 CB THR B 210 -25.290 -38.826 16.995 1.00 11.41 C ATOM 3218 OG1 THR B 210 -25.425 -39.645 15.797 1.00 12.22 O ATOM 3219 CG2 THR B 210 -23.881 -38.716 17.425 1.00 10.38 C ATOM 3220 HA THR B 210 -25.766 -40.459 18.302 1.00 0.00 H ATOM 3221 HB THR B 210 -25.629 -37.813 16.777 1.00 0.00 H ATOM 3222 HG1 THR B 210 -24.872 -39.260 15.072 1.00 0.00 H ATOM 3223 HG23 THR B 210 -23.823 -38.098 18.321 1.00 0.00 H ATOM 3224 HG21 THR B 210 -23.490 -39.710 17.642 1.00 0.00 H ATOM 3225 HG22 THR B 210 -23.294 -38.259 16.628 1.00 0.00 H ATOM 3226 H THR B 210 -28.004 -38.974 17.064 1.00 0.00 H ATOM 3227 N TRP B 211 -25.801 -39.324 20.534 1.00 12.15 N ATOM 3228 CA TRP B 211 -25.686 -38.676 21.868 1.00 12.56 C ATOM 3229 C TRP B 211 -24.331 -38.029 22.036 1.00 11.13 C ATOM 3230 O TRP B 211 -23.317 -38.618 21.660 1.00 11.81 O ATOM 3231 CB TRP B 211 -25.960 -39.695 22.963 1.00 11.21 C ATOM 3232 CG TRP B 211 -27.366 -39.813 23.172 1.00 12.05 C ATOM 3233 CD1 TRP B 211 -28.172 -40.785 22.688 1.00 10.47 C ATOM 3234 CD2 TRP B 211 -28.198 -38.921 23.930 1.00 14.44 C ATOM 3235 NE1 TRP B 211 -29.491 -40.544 23.040 1.00 10.27 N ATOM 3236 CE2 TRP B 211 -29.529 -39.405 23.818 1.00 10.31 C ATOM 3237 CE3 TRP B 211 -27.956 -37.738 24.678 1.00 11.04 C ATOM 3238 CZ2 TRP B 211 -30.613 -38.758 24.421 1.00 12.02 C ATOM 3239 CZ3 TRP B 211 -29.060 -37.093 25.296 1.00 10.46 C ATOM 3240 CH2 TRP B 211 -30.364 -37.608 25.151 1.00 11.82 C ATOM 3241 HA TRP B 211 -26.432 -37.885 21.944 1.00 0.00 H ATOM 3242 HB2 TRP B 211 -25.555 -40.663 22.667 1.00 0.00 H ATOM 3243 HB3 TRP B 211 -25.482 -39.371 23.887 1.00 0.00 H ATOM 3244 HE1 TRP B 211 -30.311 -41.122 22.765 1.00 0.00 H ATOM 3245 HD1 TRP B 211 -27.832 -41.639 22.103 1.00 0.00 H ATOM 3246 HZ2 TRP B 211 -31.626 -39.148 24.319 1.00 0.00 H ATOM 3247 HH2 TRP B 211 -31.197 -37.088 25.625 1.00 0.00 H ATOM 3248 HZ3 TRP B 211 -28.898 -36.192 25.888 1.00 0.00 H ATOM 3249 HE3 TRP B 211 -26.948 -37.335 24.775 1.00 0.00 H ATOM 3250 H TRP B 211 -25.624 -40.346 20.452 1.00 0.00 H ATOM 3251 N ILE B 212 -24.326 -36.814 22.545 1.00 10.07 N ATOM 3252 CA ILE B 212 -23.139 -36.065 22.828 1.00 11.95 C ATOM 3253 C ILE B 212 -23.347 -35.532 24.255 1.00 11.36 C ATOM 3254 O ILE B 212 -24.064 -34.559 24.479 1.00 11.03 O ATOM 3255 CB ILE B 212 -22.956 -34.873 21.802 1.00 12.69 C ATOM 3256 CG1 ILE B 212 -22.672 -35.386 20.374 1.00 13.04 C ATOM 3257 CG2 ILE B 212 -21.802 -33.928 22.207 1.00 12.97 C ATOM 3258 CD1 ILE B 212 -22.930 -34.366 19.290 1.00 11.66 C ATOM 3259 HA ILE B 212 -22.240 -36.675 22.741 1.00 0.00 H ATOM 3260 HB ILE B 212 -23.898 -34.325 21.819 1.00 0.00 H ATOM 3261 HG12 ILE B 212 -21.626 -35.687 20.320 1.00 0.00 H ATOM 3262 HG13 ILE B 212 -23.308 -36.252 20.188 1.00 0.00 H ATOM 3263 HD11 ILE B 212 -23.976 -34.062 19.320 1.00 0.00 H ATOM 3264 HD12 ILE B 212 -22.293 -33.496 19.452 1.00 0.00 H ATOM 3265 HD13 ILE B 212 -22.706 -34.806 18.318 1.00 0.00 H ATOM 3266 HG21 ILE B 212 -22.010 -33.502 23.189 1.00 0.00 H ATOM 3267 HG22 ILE B 212 -20.869 -34.491 22.244 1.00 0.00 H ATOM 3268 HG23 ILE B 212 -21.716 -33.127 21.473 1.00 0.00 H ATOM 3269 H ILE B 212 -25.243 -36.370 22.755 1.00 0.00 H ATOM 3270 N VAL B 213 -22.730 -36.224 25.217 1.00 12.05 N ATOM 3271 CA VAL B 213 -22.935 -35.987 26.650 1.00 10.15 C ATOM 3272 C VAL B 213 -21.706 -35.279 27.188 1.00 12.88 C ATOM 3273 O VAL B 213 -20.613 -35.881 27.179 1.00 11.38 O ATOM 3274 CB VAL B 213 -23.150 -37.325 27.399 1.00 11.99 C ATOM 3275 CG1 VAL B 213 -23.440 -37.080 28.911 1.00 12.18 C ATOM 3276 CG2 VAL B 213 -24.347 -38.083 26.734 1.00 11.05 C ATOM 3277 HA VAL B 213 -23.824 -35.374 26.802 1.00 0.00 H ATOM 3278 HB VAL B 213 -22.243 -37.925 27.331 1.00 0.00 H ATOM 3279 HG11 VAL B 213 -22.596 -36.559 29.362 1.00 0.00 H ATOM 3280 HG12 VAL B 213 -24.340 -36.473 29.013 1.00 0.00 H ATOM 3281 HG13 VAL B 213 -23.587 -38.037 29.411 1.00 0.00 H ATOM 3282 HG21 VAL B 213 -25.246 -37.470 26.802 1.00 0.00 H ATOM 3283 HG22 VAL B 213 -24.116 -38.276 25.686 1.00 0.00 H ATOM 3284 HG23 VAL B 213 -24.510 -39.028 27.252 1.00 0.00 H ATOM 3285 H VAL B 213 -22.067 -36.973 24.934 1.00 0.00 H ATOM 3286 N LEU B 214 -21.885 -34.012 27.650 1.00 12.62 N ATOM 3287 CA LEU B 214 -20.739 -33.187 28.064 1.00 13.85 C ATOM 3288 C LEU B 214 -20.270 -33.694 29.441 1.00 13.25 C ATOM 3289 O LEU B 214 -21.085 -33.951 30.256 1.00 11.34 O ATOM 3290 CB LEU B 214 -21.134 -31.725 28.222 1.00 12.74 C ATOM 3291 CG LEU B 214 -21.558 -30.967 26.950 1.00 17.57 C ATOM 3292 CD1 LEU B 214 -21.186 -29.480 26.955 1.00 8.08 C ATOM 3293 CD2 LEU B 214 -21.132 -31.622 25.720 1.00 16.23 C ATOM 3294 HA LEU B 214 -19.961 -33.262 27.304 1.00 0.00 H ATOM 3295 HB2 LEU B 214 -21.969 -31.685 28.921 1.00 0.00 H ATOM 3296 HB3 LEU B 214 -20.280 -31.199 28.648 1.00 0.00 H ATOM 3297 HG LEU B 214 -22.647 -31.005 26.970 1.00 0.00 H ATOM 3298 HD21 LEU B 214 -20.045 -31.700 25.709 1.00 0.00 H ATOM 3299 HD22 LEU B 214 -21.570 -32.619 25.670 1.00 0.00 H ATOM 3300 HD23 LEU B 214 -21.464 -31.035 24.864 1.00 0.00 H ATOM 3301 HD11 LEU B 214 -21.670 -28.988 27.799 1.00 0.00 H ATOM 3302 HD12 LEU B 214 -20.105 -29.378 27.045 1.00 0.00 H ATOM 3303 HD13 LEU B 214 -21.520 -29.020 26.025 1.00 0.00 H ATOM 3304 H LEU B 214 -22.847 -33.620 27.712 1.00 0.00 H ATOM 3305 N LYS B 215 -18.969 -33.771 29.666 1.00 12.90 N ATOM 3306 CA LYS B 215 -18.418 -34.245 30.904 1.00 14.58 C ATOM 3307 C LYS B 215 -18.659 -33.222 32.011 1.00 15.34 C ATOM 3308 O LYS B 215 -18.972 -33.597 33.141 1.00 15.71 O ATOM 3309 CB LYS B 215 -16.913 -34.483 30.677 1.00 15.94 C ATOM 3310 CG LYS B 215 -16.129 -34.716 31.999 1.00 18.92 C ATOM 3311 CD LYS B 215 -14.740 -35.275 31.683 1.00 22.52 C ATOM 3312 CE LYS B 215 -13.862 -35.263 32.962 1.00 26.49 C ATOM 3313 NZ LYS B 215 -12.652 -36.145 32.665 1.00 32.93 N ATOM 3314 HA LYS B 215 -18.896 -35.174 31.216 1.00 0.00 H ATOM 3315 HB2 LYS B 215 -16.792 -35.360 30.042 1.00 0.00 H ATOM 3316 HB3 LYS B 215 -16.495 -33.611 30.174 1.00 0.00 H ATOM 3317 HG2 LYS B 215 -16.027 -33.770 32.532 1.00 0.00 H ATOM 3318 HG3 LYS B 215 -16.672 -35.426 32.623 1.00 0.00 H ATOM 3319 HD2 LYS B 215 -14.836 -36.298 31.320 1.00 0.00 H ATOM 3320 HD3 LYS B 215 -14.269 -34.661 30.915 1.00 0.00 H ATOM 3321 HE2 LYS B 215 -14.422 -35.663 33.807 1.00 0.00 H ATOM 3322 HE3 LYS B 215 -13.541 -34.246 33.189 1.00 0.00 H ATOM 3323 HZ1 LYS B 215 -12.973 -37.109 32.443 1.00 0.00 H ATOM 3324 HZ2 LYS B 215 -12.132 -35.756 31.853 1.00 0.00 H ATOM 3325 HZ3 LYS B 215 -12.029 -36.169 33.498 1.00 0.00 H ATOM 3326 H LYS B 215 -18.316 -33.475 28.913 1.00 0.00 H ATOM 3327 N GLN B 216 -18.556 -31.922 31.696 1.00 13.82 N ATOM 3328 CA GLN B 216 -18.561 -30.899 32.803 1.00 14.41 C ATOM 3329 C GLN B 216 -19.987 -30.469 33.163 1.00 13.77 C ATOM 3330 O GLN B 216 -20.708 -29.984 32.312 1.00 12.76 O ATOM 3331 CB GLN B 216 -17.729 -29.636 32.447 1.00 14.57 C ATOM 3332 CG GLN B 216 -17.719 -28.608 33.604 1.00 14.02 C ATOM 3333 CD GLN B 216 -16.827 -27.396 33.391 1.00 16.66 C ATOM 3334 OE1 GLN B 216 -16.348 -27.152 32.304 1.00 16.77 O ATOM 3335 NE2 GLN B 216 -16.629 -26.629 34.457 1.00 15.49 N ATOM 3336 HA GLN B 216 -18.100 -31.388 33.661 1.00 0.00 H ATOM 3337 HB2 GLN B 216 -16.703 -29.937 32.234 1.00 0.00 H ATOM 3338 HB3 GLN B 216 -18.160 -29.167 31.562 1.00 0.00 H ATOM 3339 HG2 GLN B 216 -18.740 -28.254 33.748 1.00 0.00 H ATOM 3340 HG3 GLN B 216 -17.382 -29.119 34.506 1.00 0.00 H ATOM 3341 HE22 GLN B 216 -17.063 -26.882 35.368 1.00 0.00 H ATOM 3342 HE21 GLN B 216 -16.040 -25.775 34.381 1.00 0.00 H ATOM 3343 H GLN B 216 -18.474 -31.625 30.703 1.00 0.00 H ATOM 3344 N PRO B 217 -20.402 -30.644 34.417 1.00 15.88 N ATOM 3345 CA PRO B 217 -21.749 -30.195 34.802 1.00 14.53 C ATOM 3346 C PRO B 217 -21.884 -28.665 34.974 1.00 15.64 C ATOM 3347 O PRO B 217 -20.855 -27.941 35.131 1.00 13.94 O ATOM 3348 CB PRO B 217 -22.047 -30.992 36.105 1.00 15.48 C ATOM 3349 CG PRO B 217 -20.770 -31.422 36.595 1.00 17.38 C ATOM 3350 CD PRO B 217 -19.674 -31.243 35.552 1.00 16.90 C ATOM 3351 HA PRO B 217 -22.478 -30.393 34.016 1.00 0.00 H ATOM 3352 HD3 PRO B 217 -18.892 -30.576 35.914 1.00 0.00 H ATOM 3353 HD2 PRO B 217 -19.234 -32.201 35.276 1.00 0.00 H ATOM 3354 HG3 PRO B 217 -20.832 -32.476 36.865 1.00 0.00 H ATOM 3355 HG2 PRO B 217 -20.516 -30.837 37.479 1.00 0.00 H ATOM 3356 HB2 PRO B 217 -22.541 -30.353 36.838 1.00 0.00 H ATOM 3357 HB3 PRO B 217 -22.681 -31.852 35.889 1.00 0.00 H ATOM 3358 N ILE B 218 -23.112 -28.140 34.888 1.00 12.83 N ATOM 3359 CA ILE B 218 -23.313 -26.757 35.255 1.00 14.64 C ATOM 3360 C ILE B 218 -24.023 -26.830 36.613 1.00 14.75 C ATOM 3361 O ILE B 218 -24.351 -27.909 37.044 1.00 15.63 O ATOM 3362 CB ILE B 218 -24.200 -25.992 34.205 1.00 13.42 C ATOM 3363 CG1 ILE B 218 -25.585 -26.670 34.088 1.00 15.39 C ATOM 3364 CG2 ILE B 218 -23.455 -25.969 32.884 1.00 11.91 C ATOM 3365 CD1 ILE B 218 -26.634 -25.833 33.200 1.00 15.31 C ATOM 3366 HA ILE B 218 -22.372 -26.208 35.293 1.00 0.00 H ATOM 3367 HB ILE B 218 -24.380 -24.964 34.520 1.00 0.00 H ATOM 3368 HG12 ILE B 218 -25.452 -27.651 33.633 1.00 0.00 H ATOM 3369 HG13 ILE B 218 -25.998 -26.789 35.090 1.00 0.00 H ATOM 3370 HD11 ILE B 218 -26.786 -24.852 33.649 1.00 0.00 H ATOM 3371 HD12 ILE B 218 -26.241 -25.715 32.190 1.00 0.00 H ATOM 3372 HD13 ILE B 218 -27.583 -26.368 33.161 1.00 0.00 H ATOM 3373 HG21 ILE B 218 -22.502 -25.457 33.015 1.00 0.00 H ATOM 3374 HG22 ILE B 218 -23.277 -26.991 32.551 1.00 0.00 H ATOM 3375 HG23 ILE B 218 -24.053 -25.442 32.140 1.00 0.00 H ATOM 3376 H ILE B 218 -23.911 -28.720 34.561 1.00 0.00 H ATOM 3377 N ASN B 219 -24.274 -25.693 37.254 1.00 14.58 N ATOM 3378 CA ASN B 219 -24.859 -25.696 38.586 1.00 16.28 C ATOM 3379 C ASN B 219 -26.335 -25.362 38.522 1.00 15.29 C ATOM 3380 O ASN B 219 -26.791 -24.706 37.613 1.00 16.75 O ATOM 3381 CB ASN B 219 -24.201 -24.693 39.542 1.00 17.66 C ATOM 3382 CG ASN B 219 -22.794 -25.125 40.039 1.00 22.96 C ATOM 3383 OD1 ASN B 219 -22.434 -26.303 40.062 1.00 23.08 O ATOM 3384 ND2 ASN B 219 -22.008 -24.125 40.509 1.00 29.25 N ATOM 3385 HA ASN B 219 -24.694 -26.703 38.970 1.00 0.00 H ATOM 3386 HB2 ASN B 219 -24.104 -23.739 39.025 1.00 0.00 H ATOM 3387 HB3 ASN B 219 -24.849 -24.570 40.410 1.00 0.00 H ATOM 3388 HD22 ASN B 219 -22.342 -23.141 40.475 1.00 0.00 H ATOM 3389 HD21 ASN B 219 -21.071 -24.342 40.904 1.00 0.00 H ATOM 3390 H ASN B 219 -24.049 -24.787 36.796 1.00 0.00 H ATOM 3391 N ILE B 220 -27.073 -25.829 39.513 1.00 14.11 N ATOM 3392 CA ILE B 220 -28.454 -25.410 39.726 1.00 13.58 C ATOM 3393 C ILE B 220 -28.580 -25.448 41.266 1.00 15.28 C ATOM 3394 O ILE B 220 -28.045 -26.351 41.940 1.00 14.04 O ATOM 3395 CB ILE B 220 -29.494 -26.337 39.032 1.00 12.39 C ATOM 3396 CG1 ILE B 220 -30.923 -25.725 39.148 1.00 14.02 C ATOM 3397 CG2 ILE B 220 -29.429 -27.818 39.572 1.00 13.42 C ATOM 3398 CD1 ILE B 220 -32.097 -26.462 38.213 1.00 9.27 C ATOM 3399 HA ILE B 220 -28.666 -24.433 39.291 1.00 0.00 H ATOM 3400 HB ILE B 220 -29.240 -26.398 37.974 1.00 0.00 H ATOM 3401 HG12 ILE B 220 -31.233 -25.790 40.191 1.00 0.00 H ATOM 3402 HG13 ILE B 220 -30.866 -24.678 38.852 1.00 0.00 H ATOM 3403 HD11 ILE B 220 -31.817 -26.396 37.162 1.00 0.00 H ATOM 3404 HD12 ILE B 220 -32.185 -27.509 38.502 1.00 0.00 H ATOM 3405 HD13 ILE B 220 -33.052 -25.960 38.368 1.00 0.00 H ATOM 3406 HG21 ILE B 220 -28.435 -28.227 39.389 1.00 0.00 H ATOM 3407 HG22 ILE B 220 -29.633 -27.822 40.643 1.00 0.00 H ATOM 3408 HG23 ILE B 220 -30.174 -28.424 39.056 1.00 0.00 H ATOM 3409 H ILE B 220 -26.654 -26.521 40.166 1.00 0.00 H ATOM 3410 N SER B 221 -29.291 -24.485 41.829 1.00 15.39 N ATOM 3411 CA SER B 221 -29.574 -24.584 43.262 1.00 15.16 C ATOM 3412 C SER B 221 -30.730 -25.481 43.543 1.00 16.58 C ATOM 3413 O SER B 221 -31.573 -25.787 42.661 1.00 16.41 O ATOM 3414 CB SER B 221 -29.820 -23.157 43.834 1.00 14.96 C ATOM 3415 OG SER B 221 -31.145 -22.717 43.548 1.00 16.17 O ATOM 3416 HA SER B 221 -28.710 -25.030 43.755 1.00 0.00 H ATOM 3417 HB2 SER B 221 -29.109 -22.464 43.384 1.00 0.00 H ATOM 3418 HB3 SER B 221 -29.675 -23.175 44.914 1.00 0.00 H ATOM 3419 HG SER B 221 -31.278 -21.809 43.921 1.00 0.00 H ATOM 3420 H SER B 221 -29.639 -23.680 41.270 1.00 0.00 H ATOM 3421 N SER B 222 -30.768 -25.979 44.777 1.00 15.78 N ATOM 3422 CA SER B 222 -31.891 -26.755 45.184 1.00 15.65 C ATOM 3423 C SER B 222 -33.229 -25.995 45.052 1.00 15.08 C ATOM 3424 O SER B 222 -34.237 -26.563 44.620 1.00 13.81 O ATOM 3425 CB SER B 222 -31.629 -27.409 46.569 1.00 15.87 C ATOM 3426 OG SER B 222 -32.894 -27.839 46.994 1.00 21.17 O ATOM 3427 HA SER B 222 -32.013 -27.583 44.485 1.00 0.00 H ATOM 3428 HB2 SER B 222 -31.213 -26.682 47.267 1.00 0.00 H ATOM 3429 HB3 SER B 222 -30.945 -28.253 46.475 1.00 0.00 H ATOM 3430 HG SER B 222 -33.258 -28.487 46.340 1.00 0.00 H ATOM 3431 H SER B 222 -29.985 -25.803 45.438 1.00 0.00 H ATOM 3432 N GLN B 223 -33.219 -24.695 45.346 1.00 14.02 N ATOM 3433 CA GLN B 223 -34.402 -23.822 45.184 1.00 15.81 C ATOM 3434 C GLN B 223 -34.868 -23.686 43.755 1.00 15.85 C ATOM 3435 O GLN B 223 -36.073 -23.699 43.476 1.00 16.46 O ATOM 3436 CB GLN B 223 -34.163 -22.432 45.772 1.00 13.97 C ATOM 3437 CG GLN B 223 -34.445 -22.376 47.316 1.00 18.17 C ATOM 3438 CD GLN B 223 -34.475 -20.958 47.867 1.00 19.24 C ATOM 3439 OE1 GLN B 223 -35.280 -20.119 47.438 1.00 25.70 O ATOM 3440 NE2 GLN B 223 -33.553 -20.660 48.774 1.00 23.02 N ATOM 3441 HA GLN B 223 -35.195 -24.324 45.738 1.00 0.00 H ATOM 3442 HB2 GLN B 223 -33.125 -22.151 45.595 1.00 0.00 H ATOM 3443 HB3 GLN B 223 -34.820 -21.722 45.270 1.00 0.00 H ATOM 3444 HG2 GLN B 223 -35.410 -22.844 47.510 1.00 0.00 H ATOM 3445 HG3 GLN B 223 -33.663 -22.932 47.832 1.00 0.00 H ATOM 3446 HE22 GLN B 223 -32.896 -21.394 49.108 1.00 0.00 H ATOM 3447 HE21 GLN B 223 -33.488 -19.693 49.151 1.00 0.00 H ATOM 3448 H GLN B 223 -32.338 -24.275 45.706 1.00 0.00 H ATOM 3449 N GLN B 224 -33.912 -23.581 42.845 1.00 14.16 N ATOM 3450 CA GLN B 224 -34.249 -23.441 41.430 1.00 15.27 C ATOM 3451 C GLN B 224 -34.915 -24.755 40.967 1.00 14.75 C ATOM 3452 O GLN B 224 -35.954 -24.753 40.291 1.00 14.85 O ATOM 3453 CB GLN B 224 -32.946 -23.155 40.644 1.00 14.20 C ATOM 3454 CG GLN B 224 -32.516 -21.700 40.725 1.00 13.98 C ATOM 3455 CD GLN B 224 -31.297 -21.475 39.875 1.00 13.03 C ATOM 3456 OE1 GLN B 224 -30.285 -22.168 40.041 1.00 13.93 O ATOM 3457 NE2 GLN B 224 -31.386 -20.535 38.933 1.00 13.51 N ATOM 3458 HA GLN B 224 -34.942 -22.617 41.256 1.00 0.00 H ATOM 3459 HB2 GLN B 224 -32.149 -23.777 41.052 1.00 0.00 H ATOM 3460 HB3 GLN B 224 -33.107 -23.413 39.597 1.00 0.00 H ATOM 3461 HG2 GLN B 224 -33.326 -21.064 40.370 1.00 0.00 H ATOM 3462 HG3 GLN B 224 -32.286 -21.449 41.760 1.00 0.00 H ATOM 3463 HE22 GLN B 224 -32.259 -19.979 38.834 1.00 0.00 H ATOM 3464 HE21 GLN B 224 -30.582 -20.358 38.297 1.00 0.00 H ATOM 3465 H GLN B 224 -32.915 -23.598 43.139 1.00 0.00 H ATOM 3466 N LEU B 225 -34.277 -25.871 41.307 1.00 14.25 N ATOM 3467 CA LEU B 225 -34.681 -27.183 40.786 1.00 14.56 C ATOM 3468 C LEU B 225 -36.085 -27.570 41.264 1.00 14.25 C ATOM 3469 O LEU B 225 -36.852 -28.174 40.552 1.00 14.36 O ATOM 3470 CB LEU B 225 -33.583 -28.238 41.145 1.00 14.62 C ATOM 3471 CG LEU B 225 -33.797 -29.706 40.673 1.00 15.42 C ATOM 3472 CD1 LEU B 225 -34.131 -29.755 39.187 1.00 14.28 C ATOM 3473 CD2 LEU B 225 -32.658 -30.669 40.892 1.00 11.59 C ATOM 3474 HA LEU B 225 -34.755 -27.143 39.699 1.00 0.00 H ATOM 3475 HB2 LEU B 225 -32.646 -27.891 40.710 1.00 0.00 H ATOM 3476 HB3 LEU B 225 -33.494 -28.256 42.231 1.00 0.00 H ATOM 3477 HG LEU B 225 -34.615 -30.036 41.313 1.00 0.00 H ATOM 3478 HD21 LEU B 225 -31.776 -30.315 40.358 1.00 0.00 H ATOM 3479 HD22 LEU B 225 -32.437 -30.733 41.958 1.00 0.00 H ATOM 3480 HD23 LEU B 225 -32.939 -31.654 40.518 1.00 0.00 H ATOM 3481 HD11 LEU B 225 -35.045 -29.190 39.002 1.00 0.00 H ATOM 3482 HD12 LEU B 225 -33.311 -29.319 38.617 1.00 0.00 H ATOM 3483 HD13 LEU B 225 -34.276 -30.792 38.882 1.00 0.00 H ATOM 3484 H LEU B 225 -33.470 -25.813 41.960 1.00 0.00 H ATOM 3485 N ALA B 226 -36.398 -27.289 42.532 1.00 14.54 N ATOM 3486 CA ALA B 226 -37.704 -27.534 43.111 1.00 15.41 C ATOM 3487 C ALA B 226 -38.854 -26.920 42.309 1.00 14.92 C ATOM 3488 O ALA B 226 -39.977 -27.469 42.295 1.00 16.56 O ATOM 3489 CB ALA B 226 -37.772 -27.034 44.599 1.00 15.68 C ATOM 3490 HA ALA B 226 -37.834 -28.616 43.082 1.00 0.00 H ATOM 3491 HB1 ALA B 226 -37.025 -27.561 45.192 1.00 0.00 H ATOM 3492 HB2 ALA B 226 -37.574 -25.963 44.630 1.00 0.00 H ATOM 3493 HB3 ALA B 226 -38.765 -27.233 45.003 1.00 0.00 H ATOM 3494 H ALA B 226 -35.663 -26.871 43.138 1.00 0.00 H ATOM 3495 N LYS B 227 -38.614 -25.788 41.693 1.00 15.46 N ATOM 3496 CA LYS B 227 -39.603 -25.139 40.822 1.00 17.13 C ATOM 3497 C LYS B 227 -40.052 -25.981 39.640 1.00 15.37 C ATOM 3498 O LYS B 227 -41.216 -25.930 39.263 1.00 14.36 O ATOM 3499 CB LYS B 227 -39.078 -23.788 40.321 1.00 16.00 C ATOM 3500 CG LYS B 227 -38.587 -22.826 41.408 1.00 22.02 C ATOM 3501 CD LYS B 227 -38.240 -21.448 40.739 1.00 22.87 C ATOM 3502 CE LYS B 227 -38.893 -20.200 41.486 1.00 31.83 C ATOM 3503 NZ LYS B 227 -38.362 -18.781 41.018 1.00 28.18 N ATOM 3504 HA LYS B 227 -40.484 -24.998 41.448 1.00 0.00 H ATOM 3505 HB2 LYS B 227 -38.247 -23.981 39.643 1.00 0.00 H ATOM 3506 HB3 LYS B 227 -39.883 -23.296 39.776 1.00 0.00 H ATOM 3507 HG2 LYS B 227 -39.369 -22.685 42.155 1.00 0.00 H ATOM 3508 HG3 LYS B 227 -37.698 -23.236 41.887 1.00 0.00 H ATOM 3509 HD2 LYS B 227 -37.157 -21.325 40.742 1.00 0.00 H ATOM 3510 HD3 LYS B 227 -38.600 -21.463 39.710 1.00 0.00 H ATOM 3511 HE2 LYS B 227 -38.691 -20.301 42.552 1.00 0.00 H ATOM 3512 HE3 LYS B 227 -39.969 -20.230 41.317 1.00 0.00 H ATOM 3513 HZ1 LYS B 227 -37.337 -18.724 41.184 1.00 0.00 H ATOM 3514 HZ2 LYS B 227 -38.558 -18.656 40.004 1.00 0.00 H ATOM 3515 HZ3 LYS B 227 -38.844 -18.036 41.560 1.00 0.00 H ATOM 3516 H LYS B 227 -37.689 -25.332 41.826 1.00 0.00 H ATOM 3517 N PHE B 228 -39.152 -26.762 39.046 1.00 14.28 N ATOM 3518 CA PHE B 228 -39.583 -27.656 37.927 1.00 16.27 C ATOM 3519 C PHE B 228 -40.518 -28.768 38.377 1.00 16.97 C ATOM 3520 O PHE B 228 -41.415 -29.164 37.636 1.00 14.30 O ATOM 3521 CB PHE B 228 -38.387 -28.274 37.210 1.00 14.91 C ATOM 3522 CG PHE B 228 -37.515 -27.231 36.588 1.00 16.51 C ATOM 3523 CD1 PHE B 228 -36.422 -26.687 37.295 1.00 13.63 C ATOM 3524 CD2 PHE B 228 -37.834 -26.712 35.317 1.00 14.70 C ATOM 3525 CE1 PHE B 228 -35.624 -25.680 36.681 1.00 12.77 C ATOM 3526 CE2 PHE B 228 -37.073 -25.690 34.719 1.00 15.27 C ATOM 3527 CZ PHE B 228 -35.961 -25.169 35.369 1.00 12.19 C ATOM 3528 HA PHE B 228 -40.131 -27.011 37.240 1.00 0.00 H ATOM 3529 HB2 PHE B 228 -37.799 -28.843 37.930 1.00 0.00 H ATOM 3530 HB3 PHE B 228 -38.750 -28.943 36.429 1.00 0.00 H ATOM 3531 HD2 PHE B 228 -38.695 -27.114 34.782 1.00 0.00 H ATOM 3532 HE2 PHE B 228 -37.358 -25.305 33.740 1.00 0.00 H ATOM 3533 HZ PHE B 228 -35.356 -24.393 34.901 1.00 0.00 H ATOM 3534 HE1 PHE B 228 -34.751 -25.290 37.204 1.00 0.00 H ATOM 3535 HD1 PHE B 228 -36.191 -27.034 38.302 1.00 0.00 H ATOM 3536 H PHE B 228 -38.160 -26.751 39.357 1.00 0.00 H ATOM 3537 N ARG B 229 -40.354 -29.191 39.639 1.00 16.78 N ATOM 3538 CA ARG B 229 -41.250 -30.194 40.219 1.00 16.79 C ATOM 3539 C ARG B 229 -42.680 -29.716 40.466 1.00 17.32 C ATOM 3540 O ARG B 229 -43.545 -30.554 40.676 1.00 15.88 O ATOM 3541 CB ARG B 229 -40.679 -30.776 41.519 1.00 16.60 C ATOM 3542 CG ARG B 229 -39.226 -31.223 41.399 1.00 16.85 C ATOM 3543 CD ARG B 229 -38.846 -32.195 42.570 1.00 14.05 C ATOM 3544 NE ARG B 229 -37.420 -32.485 42.479 1.00 15.87 N ATOM 3545 CZ ARG B 229 -36.452 -31.849 43.125 1.00 16.39 C ATOM 3546 NH1 ARG B 229 -36.738 -30.878 44.009 1.00 13.38 N ATOM 3547 NH2 ARG B 229 -35.194 -32.207 42.896 1.00 15.07 N ATOM 3548 HA ARG B 229 -41.310 -30.967 39.453 1.00 0.00 H ATOM 3549 HB2 ARG B 229 -40.743 -30.014 42.296 1.00 0.00 H ATOM 3550 HB3 ARG B 229 -41.283 -31.637 41.806 1.00 0.00 H ATOM 3551 HG2 ARG B 229 -39.087 -31.737 40.448 1.00 0.00 H ATOM 3552 HG3 ARG B 229 -38.578 -30.347 41.436 1.00 0.00 H ATOM 3553 HD2 ARG B 229 -39.417 -33.119 42.482 1.00 0.00 H ATOM 3554 HD3 ARG B 229 -39.066 -31.723 43.528 1.00 0.00 H ATOM 3555 HE ARG B 229 -37.136 -33.262 41.849 1.00 0.00 H ATOM 3556 HH12 ARG B 229 -35.969 -30.387 44.509 1.00 0.00 H ATOM 3557 HH11 ARG B 229 -37.728 -30.618 44.193 1.00 0.00 H ATOM 3558 HH22 ARG B 229 -34.417 -31.723 43.390 1.00 0.00 H ATOM 3559 HH21 ARG B 229 -34.985 -32.971 42.222 1.00 0.00 H ATOM 3560 H ARG B 229 -39.580 -28.801 40.214 1.00 0.00 H ATOM 3561 N SER B 230 -42.950 -28.413 40.410 1.00 16.15 N ATOM 3562 CA SER B 230 -44.348 -28.011 40.544 1.00 18.91 C ATOM 3563 C SER B 230 -45.057 -27.788 39.186 1.00 18.08 C ATOM 3564 O SER B 230 -46.281 -27.429 39.135 1.00 16.21 O ATOM 3565 CB SER B 230 -44.530 -26.849 41.543 1.00 20.04 C ATOM 3566 OG SER B 230 -43.834 -25.736 41.032 1.00 28.20 O ATOM 3567 HA SER B 230 -44.869 -28.861 40.984 1.00 0.00 H ATOM 3568 HB2 SER B 230 -44.124 -27.127 42.516 1.00 0.00 H ATOM 3569 HB3 SER B 230 -45.588 -26.610 41.647 1.00 0.00 H ATOM 3570 HG SER B 230 -42.875 -25.963 40.937 1.00 0.00 H ATOM 3571 H SER B 230 -42.196 -27.710 40.276 1.00 0.00 H ATOM 3572 N LEU B 231 -44.323 -28.083 38.100 1.00 15.11 N ATOM 3573 CA LEU B 231 -45.044 -28.404 36.858 1.00 16.13 C ATOM 3574 C LEU B 231 -46.035 -29.570 36.985 1.00 15.88 C ATOM 3575 O LEU B 231 -45.752 -30.605 37.633 1.00 14.99 O ATOM 3576 CB LEU B 231 -44.042 -28.653 35.691 1.00 16.14 C ATOM 3577 CG LEU B 231 -43.243 -27.424 35.288 1.00 15.10 C ATOM 3578 CD1 LEU B 231 -42.207 -27.941 34.259 1.00 15.26 C ATOM 3579 CD2 LEU B 231 -44.075 -26.276 34.718 1.00 16.21 C ATOM 3580 HA LEU B 231 -45.653 -27.528 36.636 1.00 0.00 H ATOM 3581 HB2 LEU B 231 -43.343 -29.430 35.999 1.00 0.00 H ATOM 3582 HB3 LEU B 231 -44.605 -28.996 34.823 1.00 0.00 H ATOM 3583 HG LEU B 231 -42.785 -26.977 36.170 1.00 0.00 H ATOM 3584 HD21 LEU B 231 -44.599 -26.617 33.825 1.00 0.00 H ATOM 3585 HD22 LEU B 231 -44.800 -25.949 35.464 1.00 0.00 H ATOM 3586 HD23 LEU B 231 -43.418 -25.446 34.460 1.00 0.00 H ATOM 3587 HD11 LEU B 231 -41.576 -28.696 34.728 1.00 0.00 H ATOM 3588 HD12 LEU B 231 -42.729 -28.379 33.409 1.00 0.00 H ATOM 3589 HD13 LEU B 231 -41.589 -27.110 33.919 1.00 0.00 H ATOM 3590 H LEU B 231 -43.284 -28.084 38.136 1.00 0.00 H ATOM 3591 N LEU B 232 -47.198 -29.433 36.329 1.00 17.15 N ATOM 3592 CA LEU B 232 -48.104 -30.545 36.246 1.00 18.77 C ATOM 3593 C LEU B 232 -47.859 -31.413 35.000 1.00 19.50 C ATOM 3594 O LEU B 232 -47.465 -30.909 33.958 1.00 19.70 O ATOM 3595 CB LEU B 232 -49.589 -30.092 36.290 1.00 17.81 C ATOM 3596 CG LEU B 232 -49.993 -29.211 37.458 1.00 20.83 C ATOM 3597 CD1 LEU B 232 -51.492 -28.860 37.324 1.00 21.52 C ATOM 3598 CD2 LEU B 232 -49.685 -29.942 38.835 1.00 17.26 C ATOM 3599 HA LEU B 232 -47.902 -31.155 37.127 1.00 0.00 H ATOM 3600 HB2 LEU B 232 -49.795 -29.541 35.372 1.00 0.00 H ATOM 3601 HB3 LEU B 232 -50.208 -30.988 36.321 1.00 0.00 H ATOM 3602 HG LEU B 232 -49.414 -28.288 37.446 1.00 0.00 H ATOM 3603 HD21 LEU B 232 -50.246 -30.875 38.883 1.00 0.00 H ATOM 3604 HD22 LEU B 232 -48.618 -30.154 38.902 1.00 0.00 H ATOM 3605 HD23 LEU B 232 -49.981 -29.296 39.662 1.00 0.00 H ATOM 3606 HD11 LEU B 232 -51.657 -28.329 36.386 1.00 0.00 H ATOM 3607 HD12 LEU B 232 -52.081 -29.777 37.332 1.00 0.00 H ATOM 3608 HD13 LEU B 232 -51.792 -28.227 38.159 1.00 0.00 H ATOM 3609 H LEU B 232 -47.442 -28.526 35.883 1.00 0.00 H ATOM 3610 N CYS B 233 -48.074 -32.709 35.143 1.00 18.70 N ATOM 3611 CA CYS B 233 -48.146 -33.591 33.979 1.00 19.68 C ATOM 3612 C CYS B 233 -49.602 -33.735 33.450 1.00 19.76 C ATOM 3613 O CYS B 233 -49.883 -34.585 32.614 1.00 18.92 O ATOM 3614 CB CYS B 233 -47.586 -34.974 34.317 1.00 20.33 C ATOM 3615 SG CYS B 233 -48.474 -35.915 35.639 1.00 22.10 S ATOM 3616 HA CYS B 233 -47.543 -33.135 33.194 1.00 0.00 H ATOM 3617 HB2 CYS B 233 -46.552 -34.845 34.638 1.00 0.00 H ATOM 3618 HB3 CYS B 233 -47.611 -35.574 33.408 1.00 0.00 H ATOM 3619 HG CYS B 233 -48.443 -35.193 36.815 1.00 0.00 H ATOM 3620 H CYS B 233 -48.194 -33.107 36.096 1.00 0.00 H ATOM 3621 N THR B 234 -50.482 -32.880 33.941 1.00 20.26 N ATOM 3622 CA THR B 234 -51.915 -32.956 33.685 1.00 22.12 C ATOM 3623 C THR B 234 -52.442 -31.629 33.154 1.00 23.58 C ATOM 3624 O THR B 234 -51.939 -30.548 33.460 1.00 22.53 O ATOM 3625 CB THR B 234 -52.696 -33.355 34.969 1.00 22.86 C ATOM 3626 OG1 THR B 234 -52.232 -32.534 36.040 1.00 17.52 O ATOM 3627 CG2 THR B 234 -52.451 -34.830 35.369 1.00 22.05 C ATOM 3628 HA THR B 234 -52.071 -33.727 32.930 1.00 0.00 H ATOM 3629 HB THR B 234 -53.760 -33.224 34.771 1.00 0.00 H ATOM 3630 HG1 THR B 234 -52.397 -31.583 35.820 1.00 0.00 H ATOM 3631 HG23 THR B 234 -52.796 -35.484 34.569 1.00 0.00 H ATOM 3632 HG21 THR B 234 -51.385 -34.988 35.535 1.00 0.00 H ATOM 3633 HG22 THR B 234 -53.000 -35.053 36.284 1.00 0.00 H ATOM 3634 H THR B 234 -50.132 -32.109 34.545 1.00 0.00 H ATOM 3635 N ALA B 235 -53.469 -31.718 32.328 1.00 25.29 N ATOM 3636 CA ALA B 235 -53.940 -30.543 31.622 1.00 27.55 C ATOM 3637 C ALA B 235 -55.007 -29.850 32.490 1.00 29.23 C ATOM 3638 O ALA B 235 -55.493 -30.416 33.470 1.00 29.26 O ATOM 3639 CB ALA B 235 -54.475 -30.938 30.196 1.00 26.59 C ATOM 3640 HA ALA B 235 -53.125 -29.839 31.456 1.00 0.00 H ATOM 3641 HB1 ALA B 235 -53.671 -31.399 29.623 1.00 0.00 H ATOM 3642 HB2 ALA B 235 -55.299 -31.644 30.301 1.00 0.00 H ATOM 3643 HB3 ALA B 235 -54.825 -30.044 29.680 1.00 0.00 H ATOM 3644 H ALA B 235 -53.941 -32.634 32.184 1.00 0.00 H ATOM 3645 N GLU B 236 -55.307 -28.609 32.157 1.00 31.80 N ATOM 3646 CA GLU B 236 -56.329 -27.841 32.848 1.00 36.06 C ATOM 3647 C GLU B 236 -57.637 -28.641 32.747 1.00 36.04 C ATOM 3648 O GLU B 236 -57.986 -29.106 31.660 1.00 36.82 O ATOM 3649 CB GLU B 236 -56.472 -26.488 32.144 1.00 35.95 C ATOM 3650 CG GLU B 236 -57.431 -25.521 32.778 1.00 36.97 C ATOM 3651 CD GLU B 236 -57.756 -24.324 31.852 1.00 38.95 C ATOM 3652 OE1 GLU B 236 -57.087 -24.152 30.788 1.00 42.10 O ATOM 3653 OE2 GLU B 236 -58.680 -23.555 32.193 1.00 39.10 O ATOM 3654 HA GLU B 236 -56.077 -27.668 33.894 1.00 0.00 H ATOM 3655 HB2 GLU B 236 -55.489 -26.018 32.119 1.00 0.00 H ATOM 3656 HB3 GLU B 236 -56.810 -26.675 31.125 1.00 0.00 H ATOM 3657 HG2 GLU B 236 -58.357 -26.047 33.010 1.00 0.00 H ATOM 3658 HG3 GLU B 236 -56.989 -25.142 33.699 1.00 0.00 H ATOM 3659 H GLU B 236 -54.793 -28.164 31.370 1.00 0.00 H ATOM 3660 N GLY B 237 -58.309 -28.844 33.881 1.00 37.64 N ATOM 3661 CA GLY B 237 -59.534 -29.678 33.934 1.00 37.50 C ATOM 3662 C GLY B 237 -59.330 -31.186 34.135 1.00 38.21 C ATOM 3663 O GLY B 237 -60.308 -31.976 34.096 1.00 38.41 O ATOM 3664 HA3 GLY B 237 -60.070 -29.539 32.995 1.00 0.00 H ATOM 3665 HA2 GLY B 237 -60.147 -29.314 34.759 1.00 0.00 H ATOM 3666 H GLY B 237 -57.963 -28.403 34.757 1.00 0.00 H ATOM 3667 N GLU B 238 -58.081 -31.619 34.358 1.00 37.77 N ATOM 3668 CA GLU B 238 -57.798 -33.049 34.616 1.00 37.40 C ATOM 3669 C GLU B 238 -57.294 -33.068 36.066 1.00 36.54 C ATOM 3670 O GLU B 238 -56.792 -32.051 36.531 1.00 37.10 O ATOM 3671 CB GLU B 238 -56.810 -33.611 33.557 1.00 37.65 C ATOM 3672 CG GLU B 238 -56.101 -34.969 33.818 1.00 36.74 C ATOM 3673 CD GLU B 238 -55.004 -35.318 32.744 1.00 39.19 C ATOM 3674 OE1 GLU B 238 -54.616 -34.428 31.920 1.00 39.87 O ATOM 3675 OE2 GLU B 238 -54.501 -36.488 32.731 1.00 39.90 O ATOM 3676 HA GLU B 238 -58.660 -33.709 34.517 1.00 0.00 H ATOM 3677 HB2 GLU B 238 -57.368 -33.718 32.627 1.00 0.00 H ATOM 3678 HB3 GLU B 238 -56.027 -32.864 33.425 1.00 0.00 H ATOM 3679 HG2 GLU B 238 -55.625 -34.928 34.798 1.00 0.00 H ATOM 3680 HG3 GLU B 238 -56.853 -35.758 33.813 1.00 0.00 H ATOM 3681 H GLU B 238 -57.296 -30.937 34.350 1.00 0.00 H ATOM 3682 N ALA B 239 -57.491 -34.171 36.796 1.00 35.69 N ATOM 3683 CA ALA B 239 -57.050 -34.260 38.219 1.00 34.20 C ATOM 3684 C ALA B 239 -55.550 -33.961 38.244 1.00 31.94 C ATOM 3685 O ALA B 239 -54.796 -34.645 37.564 1.00 32.31 O ATOM 3686 CB ALA B 239 -57.328 -35.645 38.785 1.00 33.76 C ATOM 3687 HA ALA B 239 -57.597 -33.546 38.835 1.00 0.00 H ATOM 3688 HB1 ALA B 239 -58.398 -35.849 38.734 1.00 0.00 H ATOM 3689 HB2 ALA B 239 -56.787 -36.390 38.201 1.00 0.00 H ATOM 3690 HB3 ALA B 239 -56.998 -35.685 39.823 1.00 0.00 H ATOM 3691 H ALA B 239 -57.964 -34.988 36.361 1.00 0.00 H ATOM 3692 N ALA B 240 -55.158 -32.905 38.947 1.00 29.52 N ATOM 3693 CA ALA B 240 -53.774 -32.491 39.017 1.00 26.35 C ATOM 3694 C ALA B 240 -52.809 -33.588 39.556 1.00 25.28 C ATOM 3695 O ALA B 240 -53.065 -34.318 40.542 1.00 21.69 O ATOM 3696 CB ALA B 240 -53.643 -31.204 39.783 1.00 26.05 C ATOM 3697 HA ALA B 240 -53.455 -32.320 37.989 1.00 0.00 H ATOM 3698 HB1 ALA B 240 -54.220 -30.425 39.284 1.00 0.00 H ATOM 3699 HB2 ALA B 240 -54.021 -31.345 40.796 1.00 0.00 H ATOM 3700 HB3 ALA B 240 -52.594 -30.912 39.823 1.00 0.00 H ATOM 3701 H ALA B 240 -55.872 -32.356 39.466 1.00 0.00 H ATOM 3702 N ALA B 241 -51.697 -33.750 38.840 1.00 22.43 N ATOM 3703 CA ALA B 241 -50.596 -34.590 39.331 1.00 20.85 C ATOM 3704 C ALA B 241 -49.351 -33.802 38.946 1.00 19.98 C ATOM 3705 O ALA B 241 -49.305 -33.199 37.852 1.00 19.74 O ATOM 3706 CB ALA B 241 -50.607 -35.959 38.659 1.00 19.90 C ATOM 3707 HA ALA B 241 -50.659 -34.789 40.401 1.00 0.00 H ATOM 3708 HB1 ALA B 241 -51.551 -36.460 38.874 1.00 0.00 H ATOM 3709 HB2 ALA B 241 -50.497 -35.834 37.582 1.00 0.00 H ATOM 3710 HB3 ALA B 241 -49.781 -36.557 39.043 1.00 0.00 H ATOM 3711 H ALA B 241 -51.607 -33.275 37.919 1.00 0.00 H ATOM 3712 N PHE B 242 -48.395 -33.786 39.856 1.00 18.38 N ATOM 3713 CA PHE B 242 -47.156 -33.041 39.676 1.00 18.12 C ATOM 3714 C PHE B 242 -46.120 -33.848 38.926 1.00 17.72 C ATOM 3715 O PHE B 242 -45.974 -35.077 39.121 1.00 13.96 O ATOM 3716 CB PHE B 242 -46.571 -32.576 41.033 1.00 17.96 C ATOM 3717 CG PHE B 242 -47.399 -31.552 41.728 1.00 18.98 C ATOM 3718 CD1 PHE B 242 -48.392 -31.946 42.611 1.00 21.03 C ATOM 3719 CD2 PHE B 242 -47.181 -30.168 41.498 1.00 19.29 C ATOM 3720 CE1 PHE B 242 -49.174 -30.981 43.305 1.00 22.92 C ATOM 3721 CE2 PHE B 242 -47.948 -29.187 42.174 1.00 22.42 C ATOM 3722 CZ PHE B 242 -48.973 -29.612 43.082 1.00 21.91 C ATOM 3723 HA PHE B 242 -47.406 -32.162 39.082 1.00 0.00 H ATOM 3724 HB2 PHE B 242 -46.482 -33.445 41.684 1.00 0.00 H ATOM 3725 HB3 PHE B 242 -45.582 -32.154 40.854 1.00 0.00 H ATOM 3726 HD2 PHE B 242 -46.412 -29.856 40.791 1.00 0.00 H ATOM 3727 HE2 PHE B 242 -47.762 -28.126 42.006 1.00 0.00 H ATOM 3728 HZ PHE B 242 -49.591 -28.876 43.595 1.00 0.00 H ATOM 3729 HE1 PHE B 242 -49.934 -31.308 44.014 1.00 0.00 H ATOM 3730 HD1 PHE B 242 -48.576 -33.008 42.776 1.00 0.00 H ATOM 3731 H PHE B 242 -48.531 -34.326 40.735 1.00 0.00 H ATOM 3732 N LEU B 243 -45.348 -33.123 38.109 1.00 17.15 N ATOM 3733 CA LEU B 243 -44.241 -33.746 37.398 1.00 16.76 C ATOM 3734 C LEU B 243 -42.957 -33.721 38.275 1.00 15.90 C ATOM 3735 O LEU B 243 -42.031 -32.950 37.978 1.00 13.51 O ATOM 3736 CB LEU B 243 -44.050 -32.996 36.042 1.00 16.04 C ATOM 3737 CG LEU B 243 -43.014 -33.543 35.071 1.00 16.47 C ATOM 3738 CD1 LEU B 243 -43.309 -34.968 34.650 1.00 9.10 C ATOM 3739 CD2 LEU B 243 -42.859 -32.645 33.844 1.00 15.13 C ATOM 3740 HA LEU B 243 -44.454 -34.795 37.189 1.00 0.00 H ATOM 3741 HB2 LEU B 243 -45.012 -33.000 35.529 1.00 0.00 H ATOM 3742 HB3 LEU B 243 -43.768 -31.969 36.275 1.00 0.00 H ATOM 3743 HG LEU B 243 -42.068 -33.551 35.612 1.00 0.00 H ATOM 3744 HD21 LEU B 243 -43.814 -32.575 33.324 1.00 0.00 H ATOM 3745 HD22 LEU B 243 -42.542 -31.651 34.160 1.00 0.00 H ATOM 3746 HD23 LEU B 243 -42.110 -33.071 33.176 1.00 0.00 H ATOM 3747 HD11 LEU B 243 -43.318 -35.611 35.530 1.00 0.00 H ATOM 3748 HD12 LEU B 243 -44.282 -35.007 34.161 1.00 0.00 H ATOM 3749 HD13 LEU B 243 -42.539 -35.308 33.958 1.00 0.00 H ATOM 3750 H LEU B 243 -45.540 -32.109 37.981 1.00 0.00 H ATOM 3751 N VAL B 244 -42.883 -34.557 39.346 1.00 14.29 N ATOM 3752 CA VAL B 244 -41.783 -34.407 40.331 1.00 14.44 C ATOM 3753 C VAL B 244 -40.536 -35.133 39.909 1.00 12.49 C ATOM 3754 O VAL B 244 -39.471 -34.894 40.452 1.00 13.98 O ATOM 3755 CB VAL B 244 -42.187 -34.939 41.812 1.00 15.53 C ATOM 3756 CG1 VAL B 244 -43.285 -34.070 42.364 1.00 15.56 C ATOM 3757 CG2 VAL B 244 -42.685 -36.385 41.695 1.00 17.06 C ATOM 3758 HA VAL B 244 -41.594 -33.334 40.370 1.00 0.00 H ATOM 3759 HB VAL B 244 -41.324 -34.898 42.477 1.00 0.00 H ATOM 3760 HG11 VAL B 244 -42.935 -33.040 42.426 1.00 0.00 H ATOM 3761 HG12 VAL B 244 -44.152 -34.121 41.706 1.00 0.00 H ATOM 3762 HG13 VAL B 244 -43.560 -34.422 43.358 1.00 0.00 H ATOM 3763 HG21 VAL B 244 -43.555 -36.416 41.039 1.00 0.00 H ATOM 3764 HG22 VAL B 244 -41.893 -37.008 41.280 1.00 0.00 H ATOM 3765 HG23 VAL B 244 -42.960 -36.754 42.683 1.00 0.00 H ATOM 3766 H VAL B 244 -43.598 -35.302 39.474 1.00 0.00 H ATOM 3767 N SER B 245 -40.685 -36.037 38.934 1.00 13.96 N ATOM 3768 CA SER B 245 -39.598 -36.861 38.394 1.00 13.39 C ATOM 3769 C SER B 245 -39.932 -37.190 36.909 1.00 13.81 C ATOM 3770 O SER B 245 -41.076 -37.532 36.551 1.00 14.71 O ATOM 3771 CB SER B 245 -39.491 -38.175 39.148 1.00 12.62 C ATOM 3772 OG SER B 245 -38.244 -38.804 38.872 1.00 15.35 O ATOM 3773 HA SER B 245 -38.659 -36.315 38.488 1.00 0.00 H ATOM 3774 HB2 SER B 245 -40.302 -38.834 38.839 1.00 0.00 H ATOM 3775 HB3 SER B 245 -39.568 -37.983 40.218 1.00 0.00 H ATOM 3776 HG SER B 245 -38.173 -38.982 37.901 1.00 0.00 H ATOM 3777 H SER B 245 -41.636 -36.164 38.532 1.00 0.00 H ATOM 3778 N ASN B 246 -38.942 -37.075 36.038 1.00 14.25 N ATOM 3779 CA ASN B 246 -39.198 -37.286 34.581 1.00 12.97 C ATOM 3780 C ASN B 246 -37.927 -37.804 33.869 1.00 12.17 C ATOM 3781 O ASN B 246 -37.544 -37.377 32.746 1.00 11.03 O ATOM 3782 CB ASN B 246 -39.772 -36.023 33.934 1.00 12.45 C ATOM 3783 CG ASN B 246 -38.765 -34.901 33.913 1.00 14.16 C ATOM 3784 OD1 ASN B 246 -37.718 -35.014 34.562 1.00 13.13 O ATOM 3785 ND2 ASN B 246 -39.019 -33.872 33.125 1.00 11.79 N ATOM 3786 HA ASN B 246 -39.957 -38.060 34.468 1.00 0.00 H ATOM 3787 HB2 ASN B 246 -40.067 -36.253 32.910 1.00 0.00 H ATOM 3788 HB3 ASN B 246 -40.647 -35.702 34.499 1.00 0.00 H ATOM 3789 HD22 ASN B 246 -39.916 -33.827 32.601 1.00 0.00 H ATOM 3790 HD21 ASN B 246 -38.322 -33.107 33.028 1.00 0.00 H ATOM 3791 H ASN B 246 -37.985 -36.838 36.368 1.00 0.00 H ATOM 3792 N HIS B 247 -37.267 -38.729 34.541 1.00 11.78 N ATOM 3793 CA HIS B 247 -36.015 -39.300 34.059 1.00 14.24 C ATOM 3794 C HIS B 247 -36.146 -40.810 33.830 1.00 14.27 C ATOM 3795 O HIS B 247 -36.791 -41.548 34.595 1.00 13.70 O ATOM 3796 CB HIS B 247 -34.735 -38.930 34.924 1.00 12.97 C ATOM 3797 CG HIS B 247 -34.778 -39.490 36.325 1.00 14.73 C ATOM 3798 ND1 HIS B 247 -34.032 -40.583 36.738 1.00 14.75 N ATOM 3799 CD2 HIS B 247 -35.541 -39.137 37.384 1.00 15.70 C ATOM 3800 CE1 HIS B 247 -34.308 -40.843 38.001 1.00 17.84 C ATOM 3801 NE2 HIS B 247 -35.245 -40.010 38.410 1.00 15.97 N ATOM 3802 HA HIS B 247 -35.832 -38.822 33.097 1.00 0.00 H ATOM 3803 HB2 HIS B 247 -33.852 -39.323 34.421 1.00 0.00 H ATOM 3804 HB3 HIS B 247 -34.662 -37.844 34.987 1.00 0.00 H ATOM 3805 HD2 HIS B 247 -36.257 -38.316 37.420 1.00 0.00 H ATOM 3806 HE1 HIS B 247 -33.839 -41.618 38.607 1.00 0.00 H ATOM 3807 H HIS B 247 -37.654 -39.062 35.447 1.00 0.00 H ATOM 3808 N ARG B 248 -35.562 -41.271 32.734 1.00 14.51 N ATOM 3809 CA ARG B 248 -35.536 -42.688 32.446 1.00 14.94 C ATOM 3810 C ARG B 248 -34.238 -43.285 32.946 1.00 15.02 C ATOM 3811 O ARG B 248 -33.205 -42.645 32.764 1.00 13.73 O ATOM 3812 CB ARG B 248 -35.651 -42.915 30.907 1.00 14.52 C ATOM 3813 CG ARG B 248 -35.649 -44.414 30.569 1.00 15.85 C ATOM 3814 CD ARG B 248 -35.554 -44.730 29.097 1.00 14.99 C ATOM 3815 NE ARG B 248 -36.007 -46.117 28.799 1.00 15.34 N ATOM 3816 CZ ARG B 248 -35.675 -46.808 27.707 1.00 13.71 C ATOM 3817 NH1 ARG B 248 -34.832 -46.325 26.774 1.00 13.24 N ATOM 3818 NH2 ARG B 248 -36.199 -47.990 27.544 1.00 14.95 N ATOM 3819 HA ARG B 248 -36.375 -43.170 32.947 1.00 0.00 H ATOM 3820 HB2 ARG B 248 -36.580 -42.470 30.549 1.00 0.00 H ATOM 3821 HB3 ARG B 248 -34.806 -42.437 30.412 1.00 0.00 H ATOM 3822 HG2 ARG B 248 -34.798 -44.874 31.071 1.00 0.00 H ATOM 3823 HG3 ARG B 248 -36.573 -44.849 30.951 1.00 0.00 H ATOM 3824 HD2 ARG B 248 -34.517 -44.621 28.779 1.00 0.00 H ATOM 3825 HD3 ARG B 248 -36.178 -44.028 28.544 1.00 0.00 H ATOM 3826 HE ARG B 248 -36.628 -46.581 29.493 1.00 0.00 H ATOM 3827 HH12 ARG B 248 -34.600 -46.897 25.937 1.00 0.00 H ATOM 3828 HH11 ARG B 248 -34.413 -45.380 26.891 1.00 0.00 H ATOM 3829 HH22 ARG B 248 -35.960 -48.553 26.703 1.00 0.00 H ATOM 3830 HH21 ARG B 248 -36.856 -48.370 28.255 1.00 0.00 H ATOM 3831 H ARG B 248 -35.116 -40.605 32.072 1.00 0.00 H ATOM 3832 N PRO B 249 -34.274 -44.513 33.590 1.00 15.61 N ATOM 3833 CA PRO B 249 -33.039 -45.224 33.965 1.00 15.95 C ATOM 3834 C PRO B 249 -32.147 -45.604 32.782 1.00 15.71 C ATOM 3835 O PRO B 249 -32.683 -45.819 31.678 1.00 15.15 O ATOM 3836 CB PRO B 249 -33.539 -46.464 34.721 1.00 15.96 C ATOM 3837 CG PRO B 249 -34.966 -46.093 35.170 1.00 18.07 C ATOM 3838 CD PRO B 249 -35.485 -45.263 33.988 1.00 15.42 C ATOM 3839 HA PRO B 249 -32.391 -44.584 34.563 1.00 0.00 H ATOM 3840 HD3 PRO B 249 -35.840 -45.902 33.179 1.00 0.00 H ATOM 3841 HD2 PRO B 249 -36.285 -44.590 34.296 1.00 0.00 H ATOM 3842 HG3 PRO B 249 -34.950 -45.504 36.087 1.00 0.00 H ATOM 3843 HG2 PRO B 249 -35.575 -46.984 35.323 1.00 0.00 H ATOM 3844 HB2 PRO B 249 -33.555 -47.335 34.066 1.00 0.00 H ATOM 3845 HB3 PRO B 249 -32.905 -46.672 35.583 1.00 0.00 H ATOM 3846 N PRO B 250 -30.799 -45.632 32.998 1.00 15.09 N ATOM 3847 CA PRO B 250 -29.862 -46.136 32.027 1.00 13.91 C ATOM 3848 C PRO B 250 -30.241 -47.510 31.576 1.00 14.48 C ATOM 3849 O PRO B 250 -30.759 -48.328 32.366 1.00 13.85 O ATOM 3850 CB PRO B 250 -28.536 -46.206 32.774 1.00 13.63 C ATOM 3851 CG PRO B 250 -28.627 -45.060 33.756 1.00 13.21 C ATOM 3852 CD PRO B 250 -30.092 -45.092 34.181 1.00 15.55 C ATOM 3853 HA PRO B 250 -29.827 -45.504 31.140 1.00 0.00 H ATOM 3854 HD3 PRO B 250 -30.231 -45.742 35.045 1.00 0.00 H ATOM 3855 HD2 PRO B 250 -30.448 -44.090 34.421 1.00 0.00 H ATOM 3856 HG3 PRO B 250 -28.377 -44.113 33.278 1.00 0.00 H ATOM 3857 HG2 PRO B 250 -27.967 -45.220 34.609 1.00 0.00 H ATOM 3858 HB2 PRO B 250 -28.430 -47.158 33.294 1.00 0.00 H ATOM 3859 HB3 PRO B 250 -27.696 -46.070 32.092 1.00 0.00 H ATOM 3860 N GLN B 251 -29.989 -47.737 30.307 1.00 12.12 N ATOM 3861 CA GLN B 251 -30.336 -48.986 29.674 1.00 12.82 C ATOM 3862 C GLN B 251 -28.983 -49.660 29.319 1.00 13.99 C ATOM 3863 O GLN B 251 -27.931 -48.991 29.246 1.00 14.72 O ATOM 3864 CB GLN B 251 -31.192 -48.690 28.431 1.00 11.93 C ATOM 3865 CG GLN B 251 -32.628 -48.167 28.725 1.00 11.81 C ATOM 3866 CD GLN B 251 -33.398 -48.952 29.824 1.00 13.88 C ATOM 3867 OE1 GLN B 251 -33.585 -50.134 29.714 1.00 16.90 O ATOM 3868 NE2 GLN B 251 -33.789 -48.282 30.855 1.00 15.08 N ATOM 3869 HA GLN B 251 -30.925 -49.648 30.308 1.00 0.00 H ATOM 3870 HB2 GLN B 251 -30.674 -47.938 27.836 1.00 0.00 H ATOM 3871 HB3 GLN B 251 -31.280 -49.611 27.854 1.00 0.00 H ATOM 3872 HG2 GLN B 251 -32.552 -47.127 29.042 1.00 0.00 H ATOM 3873 HG3 GLN B 251 -33.205 -48.223 27.802 1.00 0.00 H ATOM 3874 HE22 GLN B 251 -33.607 -47.260 30.910 1.00 0.00 H ATOM 3875 HE21 GLN B 251 -34.286 -48.764 31.631 1.00 0.00 H ATOM 3876 H GLN B 251 -29.526 -46.996 29.743 1.00 0.00 H ATOM 3877 N PRO B 252 -28.975 -50.979 29.157 1.00 15.71 N ATOM 3878 CA PRO B 252 -27.676 -51.673 28.895 1.00 17.16 C ATOM 3879 C PRO B 252 -27.052 -51.257 27.579 1.00 17.48 C ATOM 3880 O PRO B 252 -27.802 -50.996 26.627 1.00 16.74 O ATOM 3881 CB PRO B 252 -28.098 -53.145 28.820 1.00 17.16 C ATOM 3882 CG PRO B 252 -29.397 -53.193 29.544 1.00 17.40 C ATOM 3883 CD PRO B 252 -30.084 -51.946 29.188 1.00 16.67 C ATOM 3884 HA PRO B 252 -26.928 -51.446 29.654 1.00 0.00 H ATOM 3885 HD3 PRO B 252 -30.568 -52.025 28.214 1.00 0.00 H ATOM 3886 HD2 PRO B 252 -30.825 -51.674 29.940 1.00 0.00 H ATOM 3887 HG3 PRO B 252 -29.233 -53.245 30.620 1.00 0.00 H ATOM 3888 HG2 PRO B 252 -29.981 -54.056 29.224 1.00 0.00 H ATOM 3889 HB2 PRO B 252 -28.221 -53.459 27.784 1.00 0.00 H ATOM 3890 HB3 PRO B 252 -27.361 -53.784 29.307 1.00 0.00 H ATOM 3891 N LEU B 253 -25.712 -51.260 27.509 1.00 17.87 N ATOM 3892 CA LEU B 253 -24.961 -50.909 26.289 1.00 19.12 C ATOM 3893 C LEU B 253 -25.163 -51.867 25.145 1.00 19.53 C ATOM 3894 O LEU B 253 -25.148 -51.459 23.996 1.00 19.87 O ATOM 3895 CB LEU B 253 -23.453 -50.733 26.551 1.00 19.34 C ATOM 3896 CG LEU B 253 -22.915 -49.321 26.690 1.00 23.73 C ATOM 3897 CD1 LEU B 253 -23.496 -48.301 25.640 1.00 23.90 C ATOM 3898 CD2 LEU B 253 -23.196 -48.818 28.034 1.00 27.76 C ATOM 3899 HA LEU B 253 -25.384 -49.950 25.989 1.00 0.00 H ATOM 3900 HB2 LEU B 253 -23.220 -51.261 27.475 1.00 0.00 H ATOM 3901 HB3 LEU B 253 -22.923 -51.202 25.722 1.00 0.00 H ATOM 3902 HG LEU B 253 -21.844 -49.392 26.502 1.00 0.00 H ATOM 3903 HD21 LEU B 253 -24.273 -48.814 28.201 1.00 0.00 H ATOM 3904 HD22 LEU B 253 -22.716 -49.463 28.770 1.00 0.00 H ATOM 3905 HD23 LEU B 253 -22.808 -47.804 28.130 1.00 0.00 H ATOM 3906 HD11 LEU B 253 -23.251 -48.639 24.633 1.00 0.00 H ATOM 3907 HD12 LEU B 253 -24.579 -48.243 25.752 1.00 0.00 H ATOM 3908 HD13 LEU B 253 -23.059 -47.317 25.811 1.00 0.00 H ATOM 3909 H LEU B 253 -25.175 -51.524 28.360 1.00 0.00 H ATOM 3910 N LYS B 254 -25.307 -53.154 25.487 1.00 19.45 N ATOM 3911 CA LYS B 254 -25.530 -54.201 24.541 1.00 20.87 C ATOM 3912 C LYS B 254 -24.502 -54.294 23.433 1.00 20.30 C ATOM 3913 O LYS B 254 -24.870 -54.556 22.309 1.00 21.86 O ATOM 3914 CB LYS B 254 -26.960 -54.111 23.991 1.00 22.02 C ATOM 3915 CG LYS B 254 -27.927 -54.632 24.999 1.00 24.02 C ATOM 3916 CD LYS B 254 -29.282 -54.466 24.555 1.00 31.28 C ATOM 3917 CE LYS B 254 -30.160 -55.524 25.213 1.00 37.93 C ATOM 3918 NZ LYS B 254 -29.630 -55.958 26.569 1.00 41.15 N ATOM 3919 HA LYS B 254 -25.406 -55.135 25.089 1.00 0.00 H ATOM 3920 HB2 LYS B 254 -27.196 -53.071 23.767 1.00 0.00 H ATOM 3921 HB3 LYS B 254 -27.034 -54.703 23.079 1.00 0.00 H ATOM 3922 HG2 LYS B 254 -27.734 -55.692 25.162 1.00 0.00 H ATOM 3923 HG3 LYS B 254 -27.791 -54.091 25.935 1.00 0.00 H ATOM 3924 HD2 LYS B 254 -29.637 -53.474 24.832 1.00 0.00 H ATOM 3925 HD3 LYS B 254 -29.327 -54.577 23.472 1.00 0.00 H ATOM 3926 HE2 LYS B 254 -30.206 -56.396 24.560 1.00 0.00 H ATOM 3927 HE3 LYS B 254 -31.162 -55.115 25.343 1.00 0.00 H ATOM 3928 HZ1 LYS B 254 -28.677 -56.357 26.455 1.00 0.00 H ATOM 3929 HZ2 LYS B 254 -29.589 -55.135 27.203 1.00 0.00 H ATOM 3930 HZ3 LYS B 254 -30.263 -56.678 26.973 1.00 0.00 H ATOM 3931 H LYS B 254 -25.254 -53.404 26.495 1.00 0.00 H ATOM 3932 N GLY B 255 -23.227 -54.053 23.755 1.00 19.60 N ATOM 3933 CA GLY B 255 -22.122 -54.152 22.780 1.00 19.57 C ATOM 3934 C GLY B 255 -21.636 -52.818 22.233 1.00 20.31 C ATOM 3935 O GLY B 255 -20.580 -52.755 21.567 1.00 20.82 O ATOM 3936 HA3 GLY B 255 -22.462 -54.760 21.941 1.00 0.00 H ATOM 3937 HA2 GLY B 255 -21.282 -54.646 23.268 1.00 0.00 H ATOM 3938 H GLY B 255 -23.004 -53.784 24.734 1.00 0.00 H ATOM 3939 N ARG B 256 -22.412 -51.736 22.446 1.00 18.96 N ATOM 3940 CA ARG B 256 -21.985 -50.415 21.962 1.00 18.60 C ATOM 3941 C ARG B 256 -20.794 -49.918 22.733 1.00 19.56 C ATOM 3942 O ARG B 256 -20.626 -50.263 23.908 1.00 19.44 O ATOM 3943 CB ARG B 256 -23.105 -49.351 22.116 1.00 18.89 C ATOM 3944 CG ARG B 256 -24.378 -49.711 21.318 1.00 17.75 C ATOM 3945 CD ARG B 256 -25.440 -48.737 21.717 1.00 14.88 C ATOM 3946 NE ARG B 256 -26.053 -49.104 22.992 1.00 14.42 N ATOM 3947 CZ ARG B 256 -26.969 -48.378 23.611 1.00 12.79 C ATOM 3948 NH1 ARG B 256 -27.325 -47.206 23.097 1.00 14.57 N ATOM 3949 NH2 ARG B 256 -27.475 -48.787 24.757 1.00 13.91 N ATOM 3950 HA ARG B 256 -21.739 -50.547 20.908 1.00 0.00 H ATOM 3951 HB2 ARG B 256 -23.366 -49.268 23.171 1.00 0.00 H ATOM 3952 HB3 ARG B 256 -22.728 -48.392 21.759 1.00 0.00 H ATOM 3953 HG2 ARG B 256 -24.183 -49.634 20.248 1.00 0.00 H ATOM 3954 HG3 ARG B 256 -24.694 -50.727 21.556 1.00 0.00 H ATOM 3955 HD2 ARG B 256 -26.210 -48.717 20.946 1.00 0.00 H ATOM 3956 HD3 ARG B 256 -24.995 -47.746 21.810 1.00 0.00 H ATOM 3957 HE ARG B 256 -25.750 -49.992 23.441 1.00 0.00 H ATOM 3958 HH12 ARG B 256 -28.044 -46.626 23.574 1.00 0.00 H ATOM 3959 HH11 ARG B 256 -26.885 -46.869 22.217 1.00 0.00 H ATOM 3960 HH22 ARG B 256 -28.195 -48.214 25.241 1.00 0.00 H ATOM 3961 HH21 ARG B 256 -27.154 -49.683 25.177 1.00 0.00 H ATOM 3962 H ARG B 256 -23.314 -51.836 22.954 1.00 0.00 H ATOM 3963 N LYS B 257 -19.992 -49.091 22.094 1.00 20.08 N ATOM 3964 CA LYS B 257 -18.825 -48.542 22.771 1.00 23.14 C ATOM 3965 C LYS B 257 -18.960 -46.983 22.816 1.00 23.03 C ATOM 3966 O LYS B 257 -19.410 -46.367 21.862 1.00 25.88 O ATOM 3967 CB LYS B 257 -17.517 -49.056 22.128 1.00 24.32 C ATOM 3968 CG LYS B 257 -17.399 -50.610 22.098 1.00 25.10 C ATOM 3969 CD LYS B 257 -15.998 -51.021 21.762 1.00 31.43 C ATOM 3970 CE LYS B 257 -15.829 -52.494 21.978 1.00 33.71 C ATOM 3971 NZ LYS B 257 -16.187 -53.187 20.761 1.00 35.40 N ATOM 3972 HA LYS B 257 -18.775 -48.889 23.803 1.00 0.00 H ATOM 3973 HB2 LYS B 257 -17.470 -48.688 21.103 1.00 0.00 H ATOM 3974 HB3 LYS B 257 -16.675 -48.658 22.695 1.00 0.00 H ATOM 3975 HG2 LYS B 257 -17.666 -51.010 23.076 1.00 0.00 H ATOM 3976 HG3 LYS B 257 -18.080 -51.008 21.346 1.00 0.00 H ATOM 3977 HD2 LYS B 257 -15.792 -50.783 20.718 1.00 0.00 H ATOM 3978 HD3 LYS B 257 -15.300 -50.480 22.401 1.00 0.00 H ATOM 3979 HE2 LYS B 257 -16.477 -52.822 22.791 1.00 0.00 H ATOM 3980 HE3 LYS B 257 -14.791 -52.711 22.232 1.00 0.00 H ATOM 3981 HZ1 LYS B 257 -17.177 -52.976 20.522 1.00 0.00 H ATOM 3982 HZ2 LYS B 257 -15.568 -52.870 19.988 1.00 0.00 H ATOM 3983 HZ3 LYS B 257 -16.073 -54.211 20.900 1.00 0.00 H ATOM 3984 H LYS B 257 -20.192 -48.830 21.107 1.00 0.00 H ATOM 3985 N VAL B 258 -18.709 -46.401 23.974 1.00 22.60 N ATOM 3986 CA VAL B 258 -18.759 -44.946 24.175 1.00 21.16 C ATOM 3987 C VAL B 258 -17.386 -44.401 23.856 1.00 21.43 C ATOM 3988 O VAL B 258 -16.386 -44.963 24.329 1.00 21.67 O ATOM 3989 CB VAL B 258 -19.165 -44.626 25.627 1.00 22.22 C ATOM 3990 CG1 VAL B 258 -19.361 -43.058 25.874 1.00 18.20 C ATOM 3991 CG2 VAL B 258 -20.398 -45.421 25.969 1.00 20.55 C ATOM 3992 HA VAL B 258 -19.502 -44.484 23.525 1.00 0.00 H ATOM 3993 HB VAL B 258 -18.356 -44.919 26.296 1.00 0.00 H ATOM 3994 HG11 VAL B 258 -18.426 -42.539 25.663 1.00 0.00 H ATOM 3995 HG12 VAL B 258 -20.144 -42.683 25.215 1.00 0.00 H ATOM 3996 HG13 VAL B 258 -19.646 -42.888 26.912 1.00 0.00 H ATOM 3997 HG21 VAL B 258 -21.205 -45.148 25.289 1.00 0.00 H ATOM 3998 HG22 VAL B 258 -20.182 -46.485 25.870 1.00 0.00 H ATOM 3999 HG23 VAL B 258 -20.696 -45.204 26.995 1.00 0.00 H ATOM 4000 H VAL B 258 -18.463 -47.003 24.786 1.00 0.00 H ATOM 4001 N ARG B 259 -17.338 -43.366 23.020 1.00 20.27 N ATOM 4002 CA ARG B 259 -16.088 -42.661 22.688 1.00 22.59 C ATOM 4003 C ARG B 259 -15.990 -41.324 23.398 1.00 22.37 C ATOM 4004 O ARG B 259 -17.000 -40.712 23.704 1.00 22.79 O ATOM 4005 CB ARG B 259 -15.954 -42.464 21.175 1.00 22.97 C ATOM 4006 CG ARG B 259 -16.120 -43.762 20.376 1.00 23.36 C ATOM 4007 CD ARG B 259 -16.099 -43.513 18.898 1.00 25.47 C ATOM 4008 NE ARG B 259 -17.277 -42.751 18.439 1.00 28.50 N ATOM 4009 CZ ARG B 259 -17.356 -42.006 17.344 1.00 25.56 C ATOM 4010 NH1 ARG B 259 -16.325 -41.861 16.503 1.00 25.45 N ATOM 4011 NH2 ARG B 259 -18.508 -41.428 17.070 1.00 26.34 N ATOM 4012 HA ARG B 259 -15.267 -43.288 23.035 1.00 0.00 H ATOM 4013 HB2 ARG B 259 -16.717 -41.757 20.849 1.00 0.00 H ATOM 4014 HB3 ARG B 259 -14.966 -42.053 20.966 1.00 0.00 H ATOM 4015 HG2 ARG B 259 -15.306 -44.440 20.631 1.00 0.00 H ATOM 4016 HG3 ARG B 259 -17.072 -44.222 20.643 1.00 0.00 H ATOM 4017 HD2 ARG B 259 -16.079 -44.473 18.381 1.00 0.00 H ATOM 4018 HD3 ARG B 259 -15.199 -42.950 18.650 1.00 0.00 H ATOM 4019 HE ARG B 259 -18.129 -42.803 19.033 1.00 0.00 H ATOM 4020 HH12 ARG B 259 -16.426 -41.268 15.654 1.00 0.00 H ATOM 4021 HH11 ARG B 259 -15.423 -42.341 16.698 1.00 0.00 H ATOM 4022 HH22 ARG B 259 -18.604 -40.837 16.219 1.00 0.00 H ATOM 4023 HH21 ARG B 259 -19.321 -41.562 17.704 1.00 0.00 H ATOM 4024 H ARG B 259 -18.223 -43.041 22.582 1.00 0.00 H ATOM 4025 N ALA B 260 -14.757 -40.890 23.659 1.00 22.30 N ATOM 4026 CA ALA B 260 -14.476 -39.627 24.301 1.00 20.74 C ATOM 4027 C ALA B 260 -13.711 -38.704 23.355 1.00 21.01 C ATOM 4028 O ALA B 260 -12.807 -39.135 22.590 1.00 20.39 O ATOM 4029 CB ALA B 260 -13.715 -39.861 25.578 1.00 20.89 C ATOM 4030 HA ALA B 260 -15.416 -39.135 24.550 1.00 0.00 H ATOM 4031 HB1 ALA B 260 -14.312 -40.481 26.247 1.00 0.00 H ATOM 4032 HB2 ALA B 260 -12.777 -40.368 25.353 1.00 0.00 H ATOM 4033 HB3 ALA B 260 -13.507 -38.904 26.056 1.00 0.00 H ATOM 4034 H ALA B 260 -13.955 -41.493 23.386 1.00 0.00 H ATOM 4035 N SER B 261 -14.085 -37.425 23.427 1.00 19.98 N ATOM 4036 CA SER B 261 -13.501 -36.405 22.656 1.00 19.92 C ATOM 4037 C SER B 261 -12.115 -35.939 23.182 1.00 20.61 C ATOM 4038 O SER B 261 -11.470 -35.056 22.572 1.00 20.42 O ATOM 4039 CB SER B 261 -14.449 -35.220 22.603 1.00 19.17 C ATOM 4040 OG SER B 261 -14.478 -34.530 23.808 1.00 16.27 O ATOM 4041 HA SER B 261 -13.329 -36.819 21.662 1.00 0.00 H ATOM 4042 HB2 SER B 261 -15.453 -35.580 22.378 1.00 0.00 H ATOM 4043 HB3 SER B 261 -14.123 -34.541 21.815 1.00 0.00 H ATOM 4044 HG SER B 261 -13.570 -34.194 24.017 1.00 0.00 H ATOM 4045 H SER B 261 -14.847 -37.170 24.087 1.00 0.00 H ATOM 4046 N PHE B 262 -11.699 -36.534 24.301 1.00 21.35 N ATOM 4047 CA PHE B 262 -10.657 -35.967 25.136 1.00 23.38 C ATOM 4048 C PHE B 262 -9.875 -37.090 25.815 1.00 25.71 C ATOM 4049 O PHE B 262 -10.397 -38.180 26.023 1.00 23.29 O ATOM 4050 CB PHE B 262 -11.290 -35.065 26.222 1.00 22.68 C ATOM 4051 CG PHE B 262 -12.154 -35.815 27.195 1.00 23.42 C ATOM 4052 CD1 PHE B 262 -11.624 -36.302 28.422 1.00 21.59 C ATOM 4053 CD2 PHE B 262 -13.479 -36.098 26.886 1.00 19.06 C ATOM 4054 CE1 PHE B 262 -12.438 -36.995 29.297 1.00 22.30 C ATOM 4055 CE2 PHE B 262 -14.286 -36.785 27.750 1.00 19.85 C ATOM 4056 CZ PHE B 262 -13.780 -37.262 28.953 1.00 21.61 C ATOM 4057 HA PHE B 262 -9.986 -35.375 24.514 1.00 0.00 H ATOM 4058 HB2 PHE B 262 -10.488 -34.578 26.777 1.00 0.00 H ATOM 4059 HB3 PHE B 262 -11.901 -34.309 25.729 1.00 0.00 H ATOM 4060 HD2 PHE B 262 -13.885 -35.764 25.931 1.00 0.00 H ATOM 4061 HE2 PHE B 262 -15.331 -36.959 27.494 1.00 0.00 H ATOM 4062 HZ PHE B 262 -14.415 -37.838 29.626 1.00 0.00 H ATOM 4063 HE1 PHE B 262 -12.043 -37.336 30.254 1.00 0.00 H ATOM 4064 HD1 PHE B 262 -10.577 -36.129 28.671 1.00 0.00 H ATOM 4065 H PHE B 262 -12.136 -37.434 24.584 1.00 0.00 H ATOM 4066 N HIS B 263 -8.618 -36.806 26.183 1.00 29.83 N ATOM 4067 CA HIS B 263 -7.844 -37.783 26.936 1.00 34.29 C ATOM 4068 C HIS B 263 -7.060 -37.160 28.056 1.00 36.44 C ATOM 4069 O HIS B 263 -6.672 -37.915 28.963 1.00 37.79 O ATOM 4070 CB HIS B 263 -6.924 -38.618 26.028 1.00 34.94 C ATOM 4071 CG HIS B 263 -6.082 -37.820 25.073 1.00 39.93 C ATOM 4072 ND1 HIS B 263 -6.134 -36.445 24.973 1.00 43.49 N ATOM 4073 CD2 HIS B 263 -5.190 -38.226 24.134 1.00 43.10 C ATOM 4074 CE1 HIS B 263 -5.312 -36.035 24.021 1.00 45.11 C ATOM 4075 NE2 HIS B 263 -4.717 -37.098 23.503 1.00 45.97 N ATOM 4076 HA HIS B 263 -8.574 -38.457 27.385 1.00 0.00 H ATOM 4077 OXT HIS B 263 -6.790 -35.931 28.043 1.00 37.75 O ATOM 4078 HB2 HIS B 263 -6.256 -39.199 26.665 1.00 0.00 H ATOM 4079 HB3 HIS B 263 -7.548 -39.295 25.445 1.00 0.00 H ATOM 4080 HD2 HIS B 263 -4.902 -39.255 23.919 1.00 0.00 H ATOM 4081 HE1 HIS B 263 -5.152 -35.001 23.716 1.00 0.00 H ATOM 4082 H HIS B 263 -8.196 -35.889 25.931 1.00 0.00 H TER 4083 HIS B 263 HETATM 4084 ZN ZN A 1 -34.368 -35.567 27.162 1.00 11.49 ZN HETATM 4085 O HOH 2 -22.465 -31.842 31.403 1.00 12.84 O HETATM 4086 O HOH 3 -17.353 -30.895 29.478 1.00 16.94 O HETATM 4087 O HOH 4 -33.195 -23.544 15.021 1.00 15.85 O HETATM 4088 O HOH 5 -24.702 -17.108 20.634 1.00 15.09 O HETATM 4089 O HOH 6 -38.592 -40.562 36.695 1.00 11.61 O HETATM 4090 O HOH 7 -20.079 -20.786 20.086 1.00 14.32 O HETATM 4091 O HOH 8 -28.949 -45.274 17.344 1.00 16.09 O HETATM 4092 O HOH 9 -40.990 -47.088 35.927 1.00 22.64 O HETATM 4093 O HOH 10 -39.359 -36.157 29.743 1.00 11.77 O HETATM 4094 O HOH 11 -37.152 -39.790 29.934 1.00 12.00 O HETATM 4095 O HOH 12 -41.178 -32.689 26.744 1.00 20.61 O HETATM 4096 O HOH 13 -32.089 -42.043 35.185 1.00 13.82 O HETATM 4097 O HOH 14 -18.050 -23.620 18.424 1.00 14.28 O HETATM 4098 O HOH 15 -29.988 -50.688 24.584 1.00 16.46 O HETATM 4099 O HOH 16 -21.132 -41.759 18.601 1.00 16.74 O HETATM 4100 O HOH 17 -27.469 -56.390 31.232 1.00 15.90 O HETATM 4101 O HOH 18 -34.702 -32.848 47.119 1.00 20.09 O HETATM 4102 O HOH 19 -31.702 -22.307 13.139 1.00 11.10 O HETATM 4103 O HOH 20 -27.853 -39.562 14.634 1.00 19.04 O HETATM 4104 O HOH 21 -20.731 -31.906 11.150 1.00 21.86 O HETATM 4105 O HOH 22 -30.278 -40.334 38.209 1.00 20.44 O HETATM 4106 O HOH 23 -23.623 -39.205 13.852 1.00 22.02 O HETATM 4107 O HOH 24 -42.568 -25.202 23.272 1.00 19.34 O HETATM 4108 O HOH 25 -22.183 -21.530 8.483 1.00 16.76 O HETATM 4109 O HOH 26 -37.870 -47.731 30.239 1.00 15.47 O HETATM 4110 O HOH 27 -29.188 -11.860 19.693 1.00 19.63 O HETATM 4111 O HOH 28 -40.979 -31.864 12.016 1.00 24.50 O HETATM 4112 O HOH 29 -40.453 -33.979 45.024 1.00 18.69 O HETATM 4113 O HOH 30 -26.951 -15.082 14.365 1.00 21.39 O HETATM 4114 O HOH 31 -24.994 -54.635 28.147 1.00 16.42 O HETATM 4115 O HOH 32 -54.272 -30.808 36.021 1.00 23.73 O HETATM 4116 O HOH 33 -36.098 -47.216 16.336 1.00 14.79 O HETATM 4117 O HOH 34 -16.536 -22.348 26.271 1.00 14.67 O HETATM 4118 O HOH 35 -31.215 -23.746 47.275 1.00 16.69 O HETATM 4119 O HOH 36 -30.091 -47.137 14.845 1.00 17.15 O HETATM 4120 O HOH 37 -32.529 -52.458 18.746 1.00 16.97 O HETATM 4121 O HOH 38 -43.274 -37.811 38.057 1.00 15.37 O HETATM 4122 O HOH 39 -33.363 -51.364 27.273 1.00 27.64 O HETATM 4123 O HOH 40 -19.293 -36.011 34.371 1.00 19.75 O HETATM 4124 O HOH 41 -29.934 -21.266 47.077 1.00 16.32 O HETATM 4125 O HOH 42 -15.119 -30.100 22.766 1.00 30.91 O HETATM 4126 O HOH 43 -48.473 -18.019 23.870 1.00 27.82 O HETATM 4127 O HOH 44 -24.588 -22.588 32.933 1.00 18.50 O HETATM 4128 O HOH 45 -34.546 -38.272 42.836 1.00 21.92 O HETATM 4129 O HOH 46 -33.594 -44.877 13.307 1.00 22.17 O HETATM 4130 O HOH 47 -40.242 -50.405 29.481 1.00 19.01 O HETATM 4131 O HOH 48 -36.989 -54.451 21.031 1.00 34.62 O HETATM 4132 O HOH 49 -41.345 -49.597 19.566 1.00 17.97 O HETATM 4133 O HOH 50 -48.998 -54.416 24.787 1.00 28.71 O HETATM 4134 O HOH 51 -33.653 -33.896 40.900 1.00 14.46 O HETATM 4135 O HOH 52 -23.920 -37.685 11.585 1.00 16.54 O HETATM 4136 O HOH 53 -25.139 -25.133 8.702 1.00 23.25 O HETATM 4137 O HOH 54 -45.972 -38.362 34.260 1.00 15.86 O HETATM 4138 O HOH 55 -28.999 -19.034 21.946 1.00 25.72 O HETATM 4139 O HOH 56 -25.685 -48.558 30.458 1.00 17.21 O HETATM 4140 O HOH 57 -38.892 -29.681 11.220 1.00 17.55 O HETATM 4141 O HOH 58 -28.729 -27.667 10.112 1.00 14.49 O HETATM 4142 O HOH 59 -51.211 -21.707 26.533 1.00 20.79 O HETATM 4143 O HOH 60 -24.283 -52.511 29.885 1.00 20.60 O HETATM 4144 O HOH 61 -29.391 -12.784 17.340 1.00 18.56 O HETATM 4145 O HOH 62 -33.775 -19.227 38.666 1.00 20.48 O HETATM 4146 O HOH 63 -40.529 -47.181 18.604 1.00 20.60 O HETATM 4147 O HOH 64 -25.259 -36.129 7.374 1.00 21.01 O HETATM 4148 O HOH 65 -40.589 -29.622 21.305 1.00 27.65 O HETATM 4149 O HOH 66 -27.732 -56.433 28.771 1.00 28.60 O HETATM 4150 O HOH 67 -24.663 -39.542 42.514 1.00 28.48 O HETATM 4151 O HOH 68 -13.895 -28.083 24.993 1.00 21.05 O HETATM 4152 O HOH 69 -27.266 -54.037 32.954 1.00 17.62 O HETATM 4153 O HOH 70 -14.910 -31.293 31.032 1.00 25.30 O HETATM 4154 O HOH 71 -42.904 -16.636 19.505 1.00 15.05 O HETATM 4155 O HOH 72 -48.581 -35.943 30.410 1.00 21.32 O HETATM 4156 O HOH 73 -31.369 -16.090 28.005 1.00 17.80 O HETATM 4157 O HOH 74 -38.990 -50.648 16.094 1.00 25.58 O HETATM 4158 O HOH 75 -21.812 -53.995 26.440 1.00 24.96 O HETATM 4159 O HOH 76 -39.533 -34.840 27.396 1.00 17.17 O HETATM 4160 O HOH 77 -26.113 -33.002 41.757 1.00 25.52 O HETATM 4161 O HOH 78 -34.497 -49.387 15.939 1.00 21.13 O HETATM 4162 O HOH 79 -13.632 -40.763 29.891 1.00 21.85 O HETATM 4163 O HOH 80 -25.836 -18.032 10.597 1.00 26.48 O HETATM 4164 O HOH 81 -23.619 -39.816 9.878 1.00 21.22 O HETATM 4165 O HOH 82 -20.585 -39.005 11.265 1.00 20.70 O HETATM 4166 O HOH 83 -48.563 -39.088 33.538 1.00 27.22 O HETATM 4167 O HOH 84 -15.038 -25.580 25.475 1.00 19.40 O HETATM 4168 O HOH 85 -14.518 -32.985 19.122 1.00 19.97 O HETATM 4169 O HOH 86 -12.928 -32.085 23.885 1.00 22.43 O HETATM 4170 O HOH 87 -12.295 -33.867 20.081 1.00 21.97 O HETATM 4171 O HOH 88 -31.285 -11.605 21.073 1.00 32.51 O HETATM 4172 O HOH 89 -51.786 -36.699 32.138 1.00 28.26 O HETATM 4173 O HOH 90 -50.880 -38.419 34.272 1.00 28.01 O HETATM 4174 O HOH 91 -37.587 -51.307 28.847 1.00 34.81 O HETATM 4175 O HOH 92 -47.352 -44.598 43.363 1.00 31.96 O HETATM 4176 O HOH 93 -47.538 -42.499 40.730 1.00 38.10 O HETATM 4177 O HOH 94 -43.686 -55.222 24.262 1.00 37.67 O HETATM 4178 O HOH 95 -38.536 -45.826 12.869 1.00 29.13 O HETATM 4179 O HOH 96 -36.088 -45.370 14.277 1.00 25.56 O HETATM 4180 O HOH 97 -38.772 -46.047 10.304 1.00 36.32 O HETATM 4181 O HOH 98 -37.250 -49.034 32.386 1.00 29.38 O HETATM 4182 O HOH 99 -20.273 -47.541 34.623 1.00 25.29 O HETATM 4183 O HOH 100 -20.678 -47.789 39.180 1.00 23.47 O HETATM 4184 O HOH 101 -32.154 -17.152 38.255 1.00 25.60 O HETATM 4185 O HOH 102 -30.677 -14.218 36.155 1.00 28.87 O HETATM 4186 O HOH 103 -17.309 -48.274 25.894 1.00 27.32 O HETATM 4187 O HOH 104 -14.992 -38.581 34.550 1.00 32.23 O HETATM 4188 O HOH 105 -13.298 -38.806 32.322 1.00 26.47 O HETATM 4189 O HOH 106 -15.686 -39.508 14.253 1.00 33.65 O HETATM 4190 O HOH 107 -17.472 -34.321 12.575 1.00 27.00 O HETATM 4191 O HOH 108 -26.391 -17.279 22.722 1.00 29.89 O HETATM 4192 O HOH 109 -42.680 -37.131 23.468 1.00 33.95 O HETATM 4193 O HOH 110 -43.178 -28.545 21.974 1.00 31.34 O HETATM 4194 O HOH 111 -22.203 -25.018 14.278 1.00 22.74 O HETATM 4195 O HOH 112 -22.228 -45.273 35.744 1.00 27.42 O HETATM 4196 O HOH 113 -24.636 -46.434 38.426 1.00 21.57 O HETATM 4197 O HOH 114 -26.747 -45.480 39.929 1.00 26.78 O HETATM 4198 O HOH 115 -18.248 -39.431 37.483 1.00 35.47 O HETATM 4199 O HOH 116 -18.525 -33.881 38.151 1.00 40.02 O HETATM 4200 O HOH 117 -18.726 -27.590 36.649 1.00 24.66 O HETATM 4201 O HOH 118 -16.796 -29.542 37.551 1.00 23.74 O HETATM 4202 O HOH 119 -13.051 -32.695 38.848 1.00 44.34 O HETATM 4203 O HOH 120 -15.299 -24.329 35.233 1.00 31.49 O HETATM 4204 O HOH 121 -22.752 -23.271 36.532 1.00 28.41 O HETATM 4205 O HOH 122 -26.657 -24.259 46.385 1.00 21.77 O HETATM 4206 O HOH 123 -27.147 -21.724 47.182 1.00 22.55 O HETATM 4207 O HOH 124 -24.673 -18.019 42.152 1.00 27.22 O HETATM 4208 O HOH 125 -21.454 -23.791 43.669 1.00 31.23 O HETATM 4209 O HOH 126 -23.797 -21.469 38.075 1.00 34.65 O HETATM 4210 O HOH 127 -37.532 -17.292 38.293 1.00 28.05 O HETATM 4211 O HOH 128 -44.558 -17.499 34.792 1.00 24.47 O HETATM 4212 O HOH 129 -42.510 -19.060 37.415 1.00 22.82 O HETATM 4213 O HOH 130 -45.532 -24.237 37.648 1.00 23.15 O HETATM 4214 O HOH 131 -47.258 -15.633 25.470 1.00 27.33 O HETATM 4215 O HOH 132 -13.491 -26.905 32.855 1.00 31.12 O HETATM 4216 O HOH 133 -19.574 -43.906 19.928 1.00 36.45 O HETATM 4217 O HOH 134 -38.608 -48.185 16.814 1.00 18.55 O HETATM 4218 O HOH 135 -54.102 -27.136 29.728 1.00 27.34 O HETATM 4219 O HOH 136 -31.904 -53.407 26.031 1.00 25.29 O HETATM 4220 O HOH 137 -20.797 -48.528 19.184 1.00 31.46 O HETATM 4221 O HOH 138 -18.575 -49.555 18.144 1.00 34.60 O HETATM 4222 O HOH 139 -7.938 -33.751 25.414 1.00 37.53 O HETATM 4223 O HOH 140 -10.918 -39.830 27.962 1.00 35.05 O HETATM 4224 O HOH 141 -45.877 -41.719 21.551 1.00 39.63 O HETATM 4225 O HOH 142 -42.520 -33.727 24.313 1.00 34.13 O HETATM 4226 O HOH 143 -39.916 -31.401 18.639 1.00 32.25 O HETATM 4227 O HOH 144 -47.960 -39.076 27.235 1.00 20.20 O HETATM 4228 O HOH 145 -48.378 -38.593 30.943 1.00 31.30 O HETATM 4229 O HOH 146 -39.363 -28.513 8.825 1.00 27.28 O HETATM 4230 O HOH 147 -25.130 -38.953 7.678 1.00 35.48 O HETATM 4231 O HOH 148 -21.306 -25.955 7.535 1.00 25.89 O HETATM 4232 O HOH 149 -19.839 -32.824 7.621 1.00 28.44 O HETATM 4233 O HOH 150 -21.463 -32.836 4.869 1.00 38.54 O HETATM 4234 O HOH 151 -19.139 -40.352 14.310 1.00 28.75 O HETATM 4235 O HOH 152 -21.847 -41.177 14.363 1.00 24.62 O HETATM 4236 O HOH 153 -25.245 -42.207 16.221 1.00 24.26 O HETATM 4237 O HOH 154 -27.780 -43.813 15.588 1.00 16.95 O HETATM 4238 O HOH 155 -25.211 -22.077 9.451 1.00 23.08 O HETATM 4239 O HOH 156 -41.731 -26.560 43.562 1.00 22.21 O HETATM 4240 O HOH 157 -45.661 -37.250 36.834 1.00 18.56 O HETATM 4241 O HOH 158 -45.201 -37.031 32.163 1.00 19.11 O HETATM 4242 O HOH 159 -13.689 -43.682 14.918 1.00 35.18 O HETATM 4243 O HOH 160 -25.797 -42.664 40.794 1.00 22.86 O HETATM 4244 O HOH 161 -14.485 -46.329 34.870 1.00 23.73 O HETATM 4245 O HOH 162 -37.594 -51.652 31.808 1.00 35.60 O HETATM 4246 O HOH 163 -21.564 -48.598 36.898 1.00 28.05 O HETATM 4247 O HOH 164 -34.838 -29.158 44.966 1.00 17.16 O HETATM 4248 O HOH 165 -14.613 -30.117 20.276 1.00 30.22 O HETATM 4249 O HOH 166 -21.125 -21.919 27.229 1.00 25.25 O HETATM 4250 O HOH 167 -20.138 -25.171 34.490 1.00 23.81 O HETATM 4251 O HOH 168 -21.737 -23.266 34.177 1.00 24.72 O HETATM 4252 O HOH 169 -39.360 -13.795 25.540 1.00 26.03 O HETATM 4253 O HOH 170 -38.730 -15.338 31.332 1.00 24.79 O HETATM 4254 O HOH 171 -31.730 -16.474 32.319 1.00 23.19 O HETATM 4255 O HOH 172 -21.766 -28.533 8.021 1.00 22.56 O HETATM 4256 O HOH 173 -23.612 -28.899 6.104 1.00 21.31 O HETATM 4257 O HOH 174 -24.936 -35.373 4.851 1.00 31.21 O HETATM 4258 O HOH 175 -24.262 -32.537 4.667 1.00 26.83 O HETATM 4259 O HOH 176 -4.970 -36.503 18.823 1.00 39.75 O HETATM 4260 O HOH 177 -51.813 -46.099 31.819 1.00 37.70 O HETATM 4261 O HOH 178 -46.681 -37.115 40.656 1.00 32.76 O HETATM 4262 O HOH 179 -39.801 -47.329 14.255 1.00 26.21 O HETATM 4263 O HOH 180 -51.668 -38.818 30.163 1.00 36.10 O HETATM 4264 O HOH 181 -26.376 -17.740 13.215 1.00 25.53 O HETATM 4265 O HOH 182 -22.575 -42.674 16.678 1.00 25.11 O HETATM 4266 O HOH 183 -27.525 -46.710 14.698 1.00 25.86 O HETATM 4267 O HOH 184 -28.187 -30.369 1.603 1.00 52.37 O HETATM 4268 O HOH 185 -49.276 -19.231 29.045 1.00 33.92 O HETATM 4269 O HOH 186 -41.120 -15.707 28.184 1.00 31.52 O HETATM 4270 O HOH 187 -31.494 -11.228 15.926 1.00 33.93 O HETATM 4271 O HOH 188 -30.218 -13.439 13.438 1.00 34.99 O HETATM 4272 O HOH 189 -37.046 -12.974 18.064 1.00 31.52 O HETATM 4273 O HOH 190 -37.899 -11.312 24.568 1.00 43.28 O HETATM 4274 O HOH 191 -34.329 -12.657 27.147 1.00 34.19 O HETATM 4275 O HOH 192 -29.411 -18.251 29.489 1.00 27.09 O HETATM 4276 O HOH 193 -23.413 -13.889 28.453 1.00 45.64 O HETATM 4277 O HOH 194 -18.309 -23.746 35.503 1.00 31.74 O HETATM 4278 O HOH 195 -40.930 -15.212 39.059 1.00 39.02 O HETATM 4279 O HOH 196 -26.246 -27.375 4.410 1.00 34.33 O HETATM 4280 O HOH 197 -23.532 -30.830 44.519 1.00 29.50 O HETATM 4281 O HOH 198 -34.716 -54.243 28.873 1.00 35.53 O HETATM 4282 O HOH 199 -21.639 -27.913 43.879 1.00 32.55 O HETATM 4283 O HOH 200 -39.762 -28.111 18.532 1.00 39.37 O HETATM 4284 O HOH 201 -22.337 -19.225 30.682 1.00 28.73 O HETATM 4285 O HOH 202 -18.685 -53.607 32.097 1.00 29.74 O HETATM 4286 O HOH 203 -39.018 -14.630 28.615 1.00 33.82 O HETATM 4287 O HOH 204 -38.447 -18.608 43.789 1.00 31.07 O HETATM 4288 O HOH 205 -37.243 -13.660 32.680 1.00 27.76 O HETATM 4289 O HOH 206 -11.792 -27.981 28.048 1.00 33.12 O HETATM 4290 O HOH 207 -51.060 -19.066 31.959 1.00 42.01 O HETATM 4291 O HOH 208 -18.331 -31.273 39.153 1.00 32.23 O HETATM 4292 O HOH 209 -3.090 -34.794 20.855 1.00 42.76 O HETATM 4293 O HOH 210 -40.371 -26.752 13.037 1.00 32.96 O HETATM 4294 O HOH 211 -24.277 -48.472 15.281 1.00 38.05 O HETATM 4295 O HOH 212 -32.508 -44.243 37.386 1.00 31.23 O HETATM 4296 O HOH 213 -35.306 -26.529 48.096 1.00 27.83 O HETATM 4297 O HOH 214 -34.761 -13.087 31.899 1.00 41.64 O HETATM 4298 O HOH 215 -36.658 -43.045 36.811 1.00 29.74 O HETATM 4299 O HOH 216 -10.845 -35.624 18.691 1.00 34.22 O HETATM 4300 O HOH 217 -38.529 -54.034 18.985 1.00 33.25 O HETATM 4301 O HOH 218 -28.111 -40.892 44.859 1.00 32.25 O HETATM 4302 O HOH 219 -43.512 -47.028 37.268 1.00 37.18 O HETATM 4303 O HOH 220 -33.467 -20.158 13.296 1.00 35.48 O HETATM 4304 O HOH 221 -24.535 -25.514 47.422 1.00 31.24 O HETATM 4305 O HOH 222 -24.816 -31.785 2.297 1.00 34.01 O HETATM 4306 O HOH 223 -39.376 -26.423 17.021 1.00 32.51 O HETATM 4307 O HOH 224 -40.069 -52.424 18.037 1.00 32.03 O HETATM 4308 O HOH 225 -19.675 -47.350 29.288 1.00 33.47 O HETATM 4309 O HOH 226 -16.377 -33.342 35.564 1.00 39.19 O HETATM 4310 O HOH 227 -19.112 -25.976 38.619 1.00 32.13 O HETATM 4311 O HOH 228 -35.572 -58.009 25.996 1.00 40.15 O HETATM 4312 O HOH 229 -9.623 -39.017 30.682 1.00 38.61 O HETATM 4313 O HOH 230 -16.916 -36.739 35.219 1.00 26.34 O HETATM 4314 O HOH 231 -23.316 -34.811 41.572 1.00 37.78 O HETATM 4315 O HOH 232 -35.919 -16.708 13.674 1.00 38.92 O HETATM 4316 O HOH 233 -40.440 -22.752 13.026 1.00 37.34 O HETATM 4317 O HOH 234 -14.860 -31.247 33.707 1.00 38.51 O HETATM 4318 O HOH 235 -9.586 -32.974 22.781 1.00 34.85 O HETATM 4319 O HOH 236 -44.116 -44.090 40.992 1.00 33.69 O HETATM 4320 O HOH 237 -46.217 -31.293 23.353 1.00 33.23 O HETATM 4321 O HOH 238 -47.751 -22.665 18.852 1.00 29.90 O HETATM 4322 O HOH 239 -36.389 -17.765 10.174 1.00 36.30 O HETATM 4323 O HOH 240 -36.664 -20.474 9.573 1.00 49.32 O HETATM 4324 O HOH 241 -42.477 -34.381 7.888 1.00 30.65 O HETATM 4325 O HOH 242 -24.796 -42.506 12.511 1.00 37.38 O HETATM 4326 O HOH 243 -42.547 -45.979 17.070 1.00 38.19 O HETATM 4327 O HOH 244 -19.579 -22.029 40.402 1.00 38.33 O HETATM 4328 O HOH 245 -34.233 -24.620 50.295 1.00 26.30 O HETATM 4329 O HOH 246 -48.448 -29.625 24.982 1.00 42.92 O HETATM 4330 O HOH 247 -46.622 -23.012 39.256 1.00 32.02 O HETATM 4331 O HOH 248 -54.716 -28.038 37.499 1.00 35.33 O HETATM 4332 O HOH 249 -29.126 -20.354 7.553 1.00 27.37 O HETATM 4333 O HOH 250 -43.597 -53.972 32.446 1.00 39.63 O HETATM 4334 O HOH 251 -24.931 -17.719 38.162 1.00 37.92 O HETATM 4335 O HOH 252 -41.086 -37.910 16.314 1.00 30.00 O HETATM 4336 O HOH 253 -50.595 -54.409 26.897 1.00 42.01 O HETATM 4337 O20 V A 13 -38.815 -33.083 20.504 1.00 -0.17 O HETATM 4338 S15 V A 13 -39.497 -34.038 21.460 1.00 -0.00 S HETATM 4339 O19 V A 13 -40.178 -33.016 22.364 1.00 -0.17 O HETATM 4340 C16 V A 13 -40.780 -34.963 20.591 1.00 0.09 C HETATM 4341 C17 V A 13 -40.065 -36.212 20.165 1.00 0.06 C HETATM 4342 O18 V A 13 -40.092 -37.056 21.269 1.00 -0.39 O HETATM 4343 H5 V A 13 -40.994 -37.237 21.506 1.00 0.21 H HETATM 4344 H3 V A 13 -39.027 -35.982 19.883 1.00 0.06 H HETATM 4345 H4 V A 13 -40.582 -36.678 19.313 1.00 0.06 H HETATM 4346 H1 V A 13 -41.150 -34.403 19.720 1.00 0.05 H HETATM 4347 H2 V A 13 -41.621 -35.197 21.261 1.00 0.05 H HETATM 4348 C1 V A 13 -38.082 -34.838 22.324 1.00 0.15 C HETATM 4349 C6 V A 13 -36.910 -35.226 21.641 1.00 0.19 C HETATM 4350 F11 V A 13 -36.755 -34.967 20.337 1.00 -0.19 F HETATM 4351 C5 V A 13 -35.858 -35.852 22.290 1.00 0.19 C HETATM 4352 F12 V A 13 -34.722 -36.154 21.629 1.00 -0.19 F HETATM 4353 C4 V A 13 -35.978 -36.140 23.667 1.00 0.17 C HETATM 4354 S7 V A 13 -34.576 -36.918 24.437 1.00 0.07 S HETATM 4355 O9 V A 13 -33.573 -35.908 24.242 1.00 -0.15 O HETATM 4356 N10 V A 13 -34.730 -37.132 26.132 1.00 -0.26 N HETATM 4357 H6 V A 13 -33.991 -37.561 26.651 1.00 0.16 H HETATM 4358 H7 V A 13 -35.559 -36.828 26.601 1.00 0.16 H HETATM 4359 O8 V A 13 -34.251 -38.230 23.783 1.00 -0.15 O HETATM 4360 C3 V A 13 -37.144 -35.785 24.329 1.00 0.19 C HETATM 4361 F13 V A 13 -37.403 -36.064 25.586 1.00 -0.19 F HETATM 4362 C2 V A 13 -38.181 -35.174 23.643 1.00 0.19 C HETATM 4363 F14 V A 13 -39.275 -34.873 24.327 1.00 -0.19 F CONECT 1 2 24 25 26 CONECT 24 1 CONECT 25 1 CONECT 26 1 CONECT 1474 1472 1473 4084 CONECT 1509 1507 1508 4084 CONECT 1819 1818 1821 4084 CONECT 4084 1474 1509 1819 CONECT 4337 4338 CONECT 4338 4337 4339 4340 4348 CONECT 4339 4338 CONECT 4340 4338 4341 4346 4347 CONECT 4341 4340 4342 4344 4345 CONECT 4342 4341 4343 CONECT 4343 4342 CONECT 4344 4341 CONECT 4345 4341 CONECT 4346 4340 CONECT 4347 4340 CONECT 4348 4338 4349 4362 CONECT 4349 4348 4350 4351 CONECT 4350 4349 CONECT 4351 4349 4352 4353 CONECT 4352 4351 CONECT 4353 4351 4354 4360 CONECT 4354 4353 4355 4356 4359 CONECT 4355 4354 CONECT 4356 4354 4357 4358 CONECT 4357 4356 CONECT 4358 4356 CONECT 4359 4354 CONECT 4360 4353 4361 4362 CONECT 4361 4360 CONECT 4362 4348 4360 4363 CONECT 4363 4362 MASTER 0 0 0 0 0 0 0 0 4362 1 35 20 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 4hu1
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
3czv
RCSB PDB
PDBbind
264aa, >3CZV_1|Chains... *
4knm
RCSB PDB
PDBbind
263aa, >4KNM_1|Chains... at 99%
4knn
RCSB PDB
PDBbind
263aa, >4KNN_1|Chains... at 99%
4qiz
RCSB PDB
PDBbind
263aa, >4QIZ_1|Chains... at 99%
4qjp
RCSB PDB
PDBbind
263aa, >4QJP_1|Chains... at 99%
4qjx
RCSB PDB
PDBbind
263aa, >4QJX_1|Chain... at 99%
5e2n
RCSB PDB
PDBbind
263aa, >5E2N_1|Chains... at 99%
5lla
RCSB PDB
PDBbind
263aa, >5LLA_1|Chains... at 99%
6g5u
RCSB PDB
PDBbind
263aa, >6G5U_1|Chains... at 99%
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
4pzh
RCSB PDB
PDBbind
V13
5msb
RCSB PDB
PDBbind
V13
Entry Information
PDB ID
4hu1
Complex Type
Protein-Ligand
PDBbind Subset
refined set
Protein Name
Carbonic anhydrase 13
Ligand Name
V13
EC.Number
E.C.4.2.1.1
Resolution
1.95(Å)
Affinity (Kd/Ki/IC50)
Kd=29nM
Release Year
2013
Protein/NA Sequence
Check fasta file
Primary Reference
(2013) Bioorg.Med.Chem. Vol. 21: pp. 2093-2106
Ligand Properties
Formula
C
8
H
7
F
4
NO
5
S
2
Molecular Weight
337.268
Exact Mass
336.970
No. of atoms
27
No. of bonds
27
Polar Surface Area
131.29
LOGP Value
-0.56 (
Computed with XLOGP3
)
2.52 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 2
No. of Hydrogen Bond Acceptors: 5
No. of Rotatable Bonds: 5
No. of Nitrogen and Oxygen Atoms: 6
No. of Rings: 1
Canonical SMILES
OCCS(=O)(=O)c1c(F)c(F)c(c(c1F)F)S(=O)(=O)N
InChI String
InChI=1S/C8H7F4NO5S2/c9-3-5(11)8(20(13,17)18)6(12)4(10)7(3)19(15,16)2-1-14/h14H,1-2H2,(H2,13,17,18)
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
Q8N1Q1
Entrez Gene ID
NCBI Entrez Gene ID:
377677
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com