Browse entries in the PDBbind-CN Database
HEADER 2I4Z_COMPLEX COMPND 2I4Z_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 270 GLU SER ALA ASP LEU ARG ALA LEU ALA LYS HIS LEU TYR SEQRES 2 A 270 ASP SER TYR ILE LYS SER PHE PRO LEU THR LYS ALA LYS SEQRES 3 A 270 ALA ARG ALA ILE LEU THR GLY LYS THR THR ASP LYS SER SEQRES 4 A 270 PRO PHE VAL ILE TYR ASP MET ASN SER LEU MET MET GLY SEQRES 5 A 270 GLU ASP LYS ILE LYS PHE LYS HIS ILE THR PRO LEU GLN SEQRES 6 A 270 GLU GLN SER LYS GLU VAL ALA ILE ARG ILE PHE GLN GLY SEQRES 7 A 270 CYS GLN PHE ARG SER VAL GLU ALA VAL GLN GLU ILE THR SEQRES 8 A 270 GLU TYR ALA LYS SER ILE PRO GLY PHE VAL ASN LEU ASP SEQRES 9 A 270 LEU ASN ASP GLN VAL THR LEU LEU LYS TYR GLY VAL HIS SEQRES 10 A 270 GLU ILE ILE TYR THR MET LEU ALA SER LEU MET ASN LYS SEQRES 11 A 270 ASP GLY VAL LEU ILE SER GLU GLY GLN GLY PHE MET THR SEQRES 12 A 270 ARG GLU PHE LEU LYS SER LEU ARG LYS PRO PHE GLY ASP SEQRES 13 A 270 PHE MET GLU PRO LYS PHE GLU PHE ALA VAL LYS PHE ASN SEQRES 14 A 270 ALA LEU GLU LEU ASP ASP SER ASP LEU ALA ILE PHE ILE SEQRES 15 A 270 ALA VAL ILE ILE LEU SER GLY ASP ARG PRO GLY LEU LEU SEQRES 16 A 270 ASN VAL LYS PRO ILE GLU ASP ILE GLN ASP ASN LEU LEU SEQRES 17 A 270 GLN ALA LEU GLU LEU GLN LEU LYS LEU ASN HIS PRO GLU SEQRES 18 A 270 SER SER GLN LEU PHE ALA LYS LEU LEU GLN LYS MET THR SEQRES 19 A 270 ASP LEU ARG GLN ILE VAL THR GLU HIS VAL GLN LEU LEU SEQRES 20 A 270 GLN VAL ILE LYS LYS THR GLU THR ASP MET SER LEU HIS SEQRES 21 A 270 PRO LEU LEU GLN GLU ILE TYR LYS ASP LEU SEQRES 1 B 270 GLU SER ALA ASP LEU ARG ALA LEU ALA LYS HIS LEU TYR SEQRES 2 B 270 ASP SER TYR ILE LYS SER PHE PRO LEU THR LYS ALA LYS SEQRES 3 B 270 ALA ARG ALA ILE LEU THR GLY LYS THR THR ASP LYS SER SEQRES 4 B 270 PRO PHE VAL ILE TYR ASP MET ASN SER LEU MET MET GLY SEQRES 5 B 270 GLU ASP LYS ILE LYS PHE LYS HIS ILE THR PRO LEU GLN SEQRES 6 B 270 GLU GLN SER LYS GLU VAL ALA ILE ARG ILE PHE GLN GLY SEQRES 7 B 270 CYS GLN PHE ARG SER VAL GLU ALA VAL GLN GLU ILE THR SEQRES 8 B 270 GLU TYR ALA LYS SER ILE PRO GLY PHE VAL ASN LEU ASP SEQRES 9 B 270 LEU ASN ASP GLN VAL THR LEU LEU LYS TYR GLY VAL HIS SEQRES 10 B 270 GLU ILE ILE TYR THR MET LEU ALA SER LEU MET ASN LYS SEQRES 11 B 270 ASP GLY VAL LEU ILE SER GLU GLY GLN GLY PHE MET THR SEQRES 12 B 270 ARG GLU PHE LEU LYS SER LEU ARG LYS PRO PHE GLY ASP SEQRES 13 B 270 PHE MET GLU PRO LYS PHE GLU PHE ALA VAL LYS PHE ASN SEQRES 14 B 270 ALA LEU GLU LEU ASP ASP SER ASP LEU ALA ILE PHE ILE SEQRES 15 B 270 ALA VAL ILE ILE LEU SER GLY ASP ARG PRO GLY LEU LEU SEQRES 16 B 270 ASN VAL LYS PRO ILE GLU ASP ILE GLN ASP ASN LEU LEU SEQRES 17 B 270 GLN ALA LEU GLU LEU GLN LEU LYS LEU ASN HIS PRO GLU SEQRES 18 B 270 SER SER GLN LEU PHE ALA LYS LEU LEU GLN LYS MET THR SEQRES 19 B 270 ASP LEU ARG GLN ILE VAL THR GLU HIS VAL GLN LEU LEU SEQRES 20 B 270 GLN VAL ILE LYS LYS THR GLU THR ASP MET SER LEU HIS SEQRES 21 B 270 PRO LEU LEU GLN GLU ILE TYR LYS ASP LEU HET DRH A 736 68 ATOM 1 N GLU A 207 -6.706 -10.839 28.278 1.00 52.56 N ATOM 2 CA GLU A 207 -7.443 -11.035 26.994 1.00 51.89 C ATOM 3 C GLU A 207 -6.735 -10.262 25.880 1.00 51.00 C ATOM 4 O GLU A 207 -6.489 -9.049 25.983 1.00 49.67 O ATOM 5 CB GLU A 207 -8.889 -10.542 27.141 1.00 53.68 C ATOM 6 CG GLU A 207 -9.822 -10.814 25.955 1.00 55.78 C ATOM 7 CD GLU A 207 -10.312 -12.254 25.903 1.00 58.27 C ATOM 8 OE1 GLU A 207 -9.521 -13.145 25.524 1.00 58.94 O ATOM 9 OE2 GLU A 207 -11.491 -12.494 26.253 1.00 58.31 O ATOM 10 HA GLU A 207 -7.459 -12.095 26.742 1.00 0.00 H ATOM 11 HB2 GLU A 207 -9.318 -11.025 28.019 1.00 0.00 H ATOM 12 HB3 GLU A 207 -8.858 -9.464 27.300 1.00 0.00 H ATOM 13 HG2 GLU A 207 -10.687 -10.155 26.034 1.00 0.00 H ATOM 14 HG3 GLU A 207 -9.284 -10.596 25.032 1.00 0.00 H ATOM 15 HN3 GLU A 207 -6.687 -9.826 28.514 1.00 0.00 H ATOM 16 HN2 GLU A 207 -5.733 -11.190 28.175 1.00 0.00 H ATOM 17 HN1 GLU A 207 -7.187 -11.364 29.036 1.00 0.00 H ATOM 18 N SER A 208 -6.387 -10.974 24.818 1.00 47.62 N ATOM 19 CA SER A 208 -5.722 -10.348 23.695 1.00 46.62 C ATOM 20 C SER A 208 -6.593 -9.246 23.083 1.00 44.10 C ATOM 21 O SER A 208 -6.096 -8.394 22.355 1.00 44.98 O ATOM 22 CB SER A 208 -5.393 -11.400 22.639 1.00 46.83 C ATOM 23 OG SER A 208 -6.565 -12.087 22.248 1.00 47.31 O ATOM 24 HA SER A 208 -4.800 -9.891 24.053 1.00 0.00 H ATOM 25 HB2 SER A 208 -4.679 -12.113 23.052 1.00 0.00 H ATOM 26 HB3 SER A 208 -4.955 -10.911 21.769 1.00 0.00 H ATOM 27 HG SER A 208 -6.963 -12.534 23.037 1.00 0.00 H ATOM 28 H SER A 208 -6.594 -11.993 24.791 1.00 0.00 H ATOM 29 N ALA A 209 -7.889 -9.264 23.382 1.00 41.69 N ATOM 30 CA ALA A 209 -8.804 -8.262 22.845 1.00 39.65 C ATOM 31 C ALA A 209 -8.507 -6.880 23.405 1.00 37.80 C ATOM 32 O ALA A 209 -8.550 -5.897 22.681 1.00 36.80 O ATOM 33 CB ALA A 209 -10.249 -8.642 23.151 1.00 39.49 C ATOM 34 HA ALA A 209 -8.660 -8.231 21.765 1.00 0.00 H ATOM 35 HB1 ALA A 209 -10.473 -9.607 22.697 1.00 0.00 H ATOM 36 HB2 ALA A 209 -10.386 -8.706 24.231 1.00 0.00 H ATOM 37 HB3 ALA A 209 -10.917 -7.883 22.743 1.00 0.00 H ATOM 38 H ALA A 209 -8.257 -10.006 24.010 1.00 0.00 H ATOM 39 N ASP A 210 -8.216 -6.807 24.699 1.00 38.05 N ATOM 40 CA ASP A 210 -7.922 -5.528 25.328 1.00 38.00 C ATOM 41 C ASP A 210 -6.637 -4.964 24.772 1.00 36.59 C ATOM 42 O ASP A 210 -6.499 -3.756 24.638 1.00 35.41 O ATOM 43 CB ASP A 210 -7.787 -5.667 26.846 1.00 40.69 C ATOM 44 CG ASP A 210 -9.126 -5.670 27.552 1.00 44.25 C ATOM 45 OD1 ASP A 210 -10.022 -4.916 27.110 1.00 43.36 O ATOM 46 OD2 ASP A 210 -9.275 -6.412 28.554 1.00 45.83 O ATOM 47 HA ASP A 210 -8.753 -4.856 25.112 1.00 0.00 H ATOM 48 HB2 ASP A 210 -7.274 -6.603 27.067 1.00 0.00 H ATOM 49 HB3 ASP A 210 -7.196 -4.832 27.222 1.00 0.00 H ATOM 50 H ASP A 210 -8.198 -7.676 25.270 1.00 0.00 H ATOM 51 N LEU A 211 -5.695 -5.848 24.457 1.00 35.89 N ATOM 52 CA LEU A 211 -4.413 -5.423 23.914 1.00 37.61 C ATOM 53 C LEU A 211 -4.550 -4.801 22.513 1.00 37.91 C ATOM 54 O LEU A 211 -3.824 -3.858 22.187 1.00 40.15 O ATOM 55 CB LEU A 211 -3.426 -6.604 23.892 1.00 35.80 C ATOM 56 CG LEU A 211 -3.035 -7.193 25.260 1.00 36.15 C ATOM 57 CD1 LEU A 211 -2.079 -8.367 25.071 1.00 33.57 C ATOM 58 CD2 LEU A 211 -2.393 -6.122 26.140 1.00 33.20 C ATOM 59 HA LEU A 211 -4.023 -4.645 24.570 1.00 0.00 H ATOM 60 HB2 LEU A 211 -3.877 -7.403 23.303 1.00 0.00 H ATOM 61 HB3 LEU A 211 -2.513 -6.265 23.403 1.00 0.00 H ATOM 62 HG LEU A 211 -3.937 -7.550 25.756 1.00 0.00 H ATOM 63 HD21 LEU A 211 -1.498 -5.739 25.650 1.00 0.00 H ATOM 64 HD22 LEU A 211 -3.101 -5.308 26.294 1.00 0.00 H ATOM 65 HD23 LEU A 211 -2.124 -6.558 27.102 1.00 0.00 H ATOM 66 HD11 LEU A 211 -2.566 -9.138 24.475 1.00 0.00 H ATOM 67 HD12 LEU A 211 -1.180 -8.023 24.559 1.00 0.00 H ATOM 68 HD13 LEU A 211 -1.810 -8.775 26.045 1.00 0.00 H ATOM 69 H LEU A 211 -5.877 -6.862 24.601 1.00 0.00 H ATOM 70 N ARG A 212 -5.483 -5.310 21.700 1.00 36.34 N ATOM 71 CA ARG A 212 -5.704 -4.786 20.346 1.00 34.84 C ATOM 72 C ARG A 212 -6.374 -3.420 20.418 1.00 35.96 C ATOM 73 O ARG A 212 -6.135 -2.548 19.571 1.00 34.88 O ATOM 74 CB ARG A 212 -6.589 -5.736 19.524 1.00 34.83 C ATOM 75 CG ARG A 212 -5.963 -7.089 19.278 1.00 37.22 C ATOM 76 CD ARG A 212 -4.556 -6.917 18.721 1.00 39.63 C ATOM 77 NE ARG A 212 -4.553 -6.405 17.351 1.00 41.13 N ATOM 78 CZ ARG A 212 -3.582 -5.657 16.835 1.00 41.78 C ATOM 79 NH1 ARG A 212 -2.531 -5.320 17.574 1.00 41.99 N ATOM 80 NH2 ARG A 212 -3.652 -5.259 15.575 1.00 43.41 N ATOM 81 HA ARG A 212 -4.733 -4.698 19.859 1.00 0.00 H ATOM 82 HB2 ARG A 212 -7.527 -5.883 20.060 1.00 0.00 H ATOM 83 HB3 ARG A 212 -6.792 -5.270 18.560 1.00 0.00 H ATOM 84 HG2 ARG A 212 -5.915 -7.641 20.217 1.00 0.00 H ATOM 85 HG3 ARG A 212 -6.570 -7.643 18.562 1.00 0.00 H ATOM 86 HD2 ARG A 212 -4.054 -7.885 18.734 1.00 0.00 H ATOM 87 HD3 ARG A 212 -4.011 -6.219 19.356 1.00 0.00 H ATOM 88 HE ARG A 212 -5.362 -6.641 16.741 1.00 0.00 H ATOM 89 HH12 ARG A 212 -1.774 -4.735 17.166 1.00 0.00 H ATOM 90 HH11 ARG A 212 -2.465 -5.641 18.561 1.00 0.00 H ATOM 91 HH22 ARG A 212 -2.893 -4.674 15.171 1.00 0.00 H ATOM 92 HH21 ARG A 212 -4.466 -5.531 14.988 1.00 0.00 H ATOM 93 H ARG A 212 -6.069 -6.100 22.037 1.00 0.00 H ATOM 94 N ALA A 213 -7.222 -3.247 21.429 1.00 33.75 N ATOM 95 CA ALA A 213 -7.920 -1.983 21.632 1.00 35.64 C ATOM 96 C ALA A 213 -6.879 -0.941 22.025 1.00 34.68 C ATOM 97 O ALA A 213 -6.938 0.207 21.586 1.00 35.38 O ATOM 98 CB ALA A 213 -8.971 -2.130 22.744 1.00 33.23 C ATOM 99 HA ALA A 213 -8.437 -1.681 20.721 1.00 0.00 H ATOM 100 HB1 ALA A 213 -9.693 -2.896 22.461 1.00 0.00 H ATOM 101 HB2 ALA A 213 -8.478 -2.419 23.672 1.00 0.00 H ATOM 102 HB3 ALA A 213 -9.484 -1.179 22.885 1.00 0.00 H ATOM 103 H ALA A 213 -7.391 -4.032 22.090 1.00 0.00 H ATOM 104 N LEU A 214 -5.925 -1.356 22.856 1.00 34.80 N ATOM 105 CA LEU A 214 -4.855 -0.472 23.304 1.00 33.87 C ATOM 106 C LEU A 214 -4.022 -0.064 22.100 1.00 32.32 C ATOM 107 O LEU A 214 -3.667 1.104 21.952 1.00 31.81 O ATOM 108 CB LEU A 214 -3.962 -1.184 24.327 1.00 33.62 C ATOM 109 CG LEU A 214 -2.746 -0.404 24.842 1.00 32.49 C ATOM 110 CD1 LEU A 214 -3.197 0.957 25.385 1.00 31.22 C ATOM 111 CD2 LEU A 214 -2.049 -1.211 25.941 1.00 31.34 C ATOM 112 HA LEU A 214 -5.290 0.408 23.778 1.00 0.00 H ATOM 113 HB2 LEU A 214 -4.582 -1.436 25.188 1.00 0.00 H ATOM 114 HB3 LEU A 214 -3.595 -2.100 23.864 1.00 0.00 H ATOM 115 HG LEU A 214 -2.044 -0.240 24.024 1.00 0.00 H ATOM 116 HD21 LEU A 214 -2.746 -1.382 26.762 1.00 0.00 H ATOM 117 HD22 LEU A 214 -1.722 -2.168 25.535 1.00 0.00 H ATOM 118 HD23 LEU A 214 -1.185 -0.655 26.306 1.00 0.00 H ATOM 119 HD11 LEU A 214 -3.679 1.523 24.588 1.00 0.00 H ATOM 120 HD12 LEU A 214 -3.902 0.805 26.202 1.00 0.00 H ATOM 121 HD13 LEU A 214 -2.329 1.507 25.750 1.00 0.00 H ATOM 122 H LEU A 214 -5.943 -2.339 23.195 1.00 0.00 H ATOM 123 N ALA A 215 -3.723 -1.035 21.239 1.00 30.26 N ATOM 124 CA ALA A 215 -2.922 -0.785 20.039 1.00 30.93 C ATOM 125 C ALA A 215 -3.571 0.250 19.129 1.00 32.61 C ATOM 126 O ALA A 215 -2.898 1.145 18.616 1.00 31.20 O ATOM 127 CB ALA A 215 -2.708 -2.084 19.273 1.00 26.38 C ATOM 128 HA ALA A 215 -1.960 -0.387 20.363 1.00 0.00 H ATOM 129 HB1 ALA A 215 -2.186 -2.798 19.910 1.00 0.00 H ATOM 130 HB2 ALA A 215 -3.674 -2.495 18.980 1.00 0.00 H ATOM 131 HB3 ALA A 215 -2.111 -1.885 18.383 1.00 0.00 H ATOM 132 H ALA A 215 -4.068 -1.998 21.424 1.00 0.00 H ATOM 133 N LYS A 216 -4.878 0.115 18.922 1.00 33.61 N ATOM 134 CA LYS A 216 -5.610 1.044 18.075 1.00 34.58 C ATOM 135 C LYS A 216 -5.612 2.437 18.693 1.00 33.71 C ATOM 136 O LYS A 216 -5.440 3.432 17.994 1.00 32.43 O ATOM 137 CB LYS A 216 -7.056 0.574 17.873 1.00 36.35 C ATOM 138 CG LYS A 216 -7.307 -0.214 16.591 1.00 37.89 C ATOM 139 CD LYS A 216 -7.056 -1.703 16.752 1.00 39.70 C ATOM 140 CE LYS A 216 -7.528 -2.462 15.513 1.00 41.00 C ATOM 141 NZ LYS A 216 -7.527 -3.942 15.699 1.00 41.20 N ATOM 142 HA LYS A 216 -5.111 1.079 17.106 1.00 0.00 H ATOM 143 HB2 LYS A 216 -7.327 -0.060 18.718 1.00 0.00 H ATOM 144 HB3 LYS A 216 -7.699 1.454 17.860 1.00 0.00 H ATOM 145 HG2 LYS A 216 -8.344 -0.067 16.290 1.00 0.00 H ATOM 146 HG3 LYS A 216 -6.646 0.168 15.813 1.00 0.00 H ATOM 147 HD2 LYS A 216 -5.989 -1.874 16.893 1.00 0.00 H ATOM 148 HD3 LYS A 216 -7.599 -2.066 17.624 1.00 0.00 H ATOM 149 HE2 LYS A 216 -6.867 -2.216 14.682 1.00 0.00 H ATOM 150 HE3 LYS A 216 -8.543 -2.142 15.275 1.00 0.00 H ATOM 151 HZ1 LYS A 216 -6.562 -4.262 15.917 1.00 0.00 H ATOM 152 HZ2 LYS A 216 -8.162 -4.192 16.484 1.00 0.00 H ATOM 153 HZ3 LYS A 216 -7.856 -4.400 14.825 1.00 0.00 H ATOM 154 H LYS A 216 -5.387 -0.671 19.375 1.00 0.00 H ATOM 155 N HIS A 217 -5.814 2.500 20.006 1.00 33.00 N ATOM 156 CA HIS A 217 -5.829 3.773 20.712 1.00 33.48 C ATOM 157 C HIS A 217 -4.506 4.515 20.506 1.00 33.39 C ATOM 158 O HIS A 217 -4.491 5.676 20.092 1.00 33.13 O ATOM 159 CB HIS A 217 -6.079 3.551 22.207 1.00 36.09 C ATOM 160 CG HIS A 217 -5.822 4.766 23.042 1.00 38.04 C ATOM 161 ND1 HIS A 217 -6.568 5.918 22.926 1.00 40.34 N ATOM 162 CD2 HIS A 217 -4.870 5.028 23.968 1.00 39.39 C ATOM 163 CE1 HIS A 217 -6.087 6.838 23.744 1.00 40.80 C ATOM 164 NE2 HIS A 217 -5.056 6.323 24.386 1.00 41.39 N ATOM 165 HA HIS A 217 -6.638 4.381 20.307 1.00 0.00 H ATOM 166 HB2 HIS A 217 -7.118 3.252 22.343 1.00 0.00 H ATOM 167 HB3 HIS A 217 -5.424 2.750 22.551 1.00 0.00 H ATOM 168 HD2 HIS A 217 -4.100 4.340 24.317 1.00 0.00 H ATOM 169 HE1 HIS A 217 -6.476 7.849 23.867 1.00 0.00 H ATOM 170 H HIS A 217 -5.965 1.620 20.540 1.00 0.00 H ATOM 171 N LEU A 218 -3.399 3.832 20.785 1.00 32.43 N ATOM 172 CA LEU A 218 -2.065 4.414 20.636 1.00 31.28 C ATOM 173 C LEU A 218 -1.759 4.841 19.187 1.00 29.88 C ATOM 174 O LEU A 218 -1.179 5.909 18.953 1.00 28.54 O ATOM 175 CB LEU A 218 -1.007 3.408 21.130 1.00 30.86 C ATOM 176 CG LEU A 218 -0.995 3.064 22.632 1.00 31.61 C ATOM 177 CD1 LEU A 218 -0.097 1.870 22.875 1.00 25.35 C ATOM 178 CD2 LEU A 218 -0.501 4.268 23.454 1.00 30.81 C ATOM 179 HA LEU A 218 -2.034 5.319 21.242 1.00 0.00 H ATOM 180 HB2 LEU A 218 -1.161 2.478 20.583 1.00 0.00 H ATOM 181 HB3 LEU A 218 -0.027 3.816 20.881 1.00 0.00 H ATOM 182 HG LEU A 218 -2.010 2.821 22.946 1.00 0.00 H ATOM 183 HD21 LEU A 218 0.510 4.530 23.141 1.00 0.00 H ATOM 184 HD22 LEU A 218 -1.165 5.116 23.289 1.00 0.00 H ATOM 185 HD23 LEU A 218 -0.499 4.007 24.512 1.00 0.00 H ATOM 186 HD11 LEU A 218 -0.471 1.015 22.311 1.00 0.00 H ATOM 187 HD12 LEU A 218 0.916 2.107 22.550 1.00 0.00 H ATOM 188 HD13 LEU A 218 -0.092 1.631 23.938 1.00 0.00 H ATOM 189 H LEU A 218 -3.485 2.851 21.120 1.00 0.00 H ATOM 190 N TYR A 219 -2.144 4.017 18.218 1.00 28.81 N ATOM 191 CA TYR A 219 -1.899 4.346 16.807 1.00 32.13 C ATOM 192 C TYR A 219 -2.652 5.620 16.428 1.00 32.68 C ATOM 193 O TYR A 219 -2.153 6.484 15.703 1.00 32.18 O ATOM 194 CB TYR A 219 -2.346 3.190 15.905 1.00 32.11 C ATOM 195 CG TYR A 219 -2.217 3.481 14.428 1.00 35.27 C ATOM 196 CD1 TYR A 219 -1.069 4.069 13.913 1.00 37.93 C ATOM 197 CD2 TYR A 219 -3.240 3.156 13.539 1.00 39.13 C ATOM 198 CE1 TYR A 219 -0.940 4.332 12.543 1.00 40.48 C ATOM 199 CE2 TYR A 219 -3.122 3.412 12.168 1.00 41.12 C ATOM 200 CZ TYR A 219 -1.968 4.002 11.682 1.00 41.70 C ATOM 201 OH TYR A 219 -1.844 4.274 10.337 1.00 46.95 O ATOM 202 HA TYR A 219 -0.830 4.508 16.668 1.00 0.00 H ATOM 203 HB3 TYR A 219 -3.391 2.970 16.122 1.00 0.00 H ATOM 204 HB2 TYR A 219 -1.736 2.317 16.138 1.00 0.00 H ATOM 205 HD2 TYR A 219 -4.151 2.693 13.919 1.00 0.00 H ATOM 206 HE2 TYR A 219 -3.932 3.149 11.488 1.00 0.00 H ATOM 207 HE1 TYR A 219 -0.032 4.795 12.158 1.00 0.00 H ATOM 208 HD1 TYR A 219 -0.253 4.331 14.587 1.00 0.00 H ATOM 209 HH TYR A 219 -0.963 4.692 10.166 1.00 0.00 H ATOM 210 H TYR A 219 -2.625 3.128 18.462 1.00 0.00 H ATOM 211 N ASP A 220 -3.868 5.712 16.943 1.00 34.33 N ATOM 212 CA ASP A 220 -4.746 6.839 16.723 1.00 34.08 C ATOM 213 C ASP A 220 -4.121 8.134 17.269 1.00 34.37 C ATOM 214 O ASP A 220 -4.122 9.171 16.587 1.00 32.21 O ATOM 215 CB ASP A 220 -6.061 6.546 17.432 1.00 38.41 C ATOM 216 CG ASP A 220 -7.155 7.455 17.009 1.00 41.88 C ATOM 217 OD1 ASP A 220 -7.543 7.368 15.828 1.00 45.93 O ATOM 218 OD2 ASP A 220 -7.621 8.251 17.857 1.00 44.42 O ATOM 219 HA ASP A 220 -4.911 6.982 15.655 1.00 0.00 H ATOM 220 HB2 ASP A 220 -6.355 5.520 17.212 1.00 0.00 H ATOM 221 HB3 ASP A 220 -5.911 6.657 18.506 1.00 0.00 H ATOM 222 H ASP A 220 -4.210 4.931 17.538 1.00 0.00 H ATOM 223 N SER A 221 -3.594 8.068 18.497 1.00 31.38 N ATOM 224 CA SER A 221 -2.966 9.225 19.142 1.00 31.18 C ATOM 225 C SER A 221 -1.693 9.632 18.433 1.00 29.96 C ATOM 226 O SER A 221 -1.316 10.801 18.430 1.00 31.59 O ATOM 227 CB SER A 221 -2.610 8.912 20.593 1.00 30.36 C ATOM 228 OG SER A 221 -3.737 8.458 21.300 1.00 33.89 O ATOM 229 HA SER A 221 -3.690 10.038 19.095 1.00 0.00 H ATOM 230 HB2 SER A 221 -2.229 9.815 21.070 1.00 0.00 H ATOM 231 HB3 SER A 221 -1.841 8.140 20.613 1.00 0.00 H ATOM 232 HG SER A 221 -4.084 7.635 20.872 1.00 0.00 H ATOM 233 H SER A 221 -3.631 7.165 19.012 1.00 0.00 H ATOM 234 N TYR A 222 -1.022 8.638 17.866 1.00 28.65 N ATOM 235 CA TYR A 222 0.221 8.823 17.132 1.00 28.93 C ATOM 236 C TYR A 222 -0.065 9.623 15.854 1.00 28.67 C ATOM 237 O TYR A 222 0.640 10.584 15.549 1.00 29.22 O ATOM 238 CB TYR A 222 0.799 7.436 16.811 1.00 26.63 C ATOM 239 CG TYR A 222 2.002 7.376 15.900 1.00 24.02 C ATOM 240 CD1 TYR A 222 3.291 7.222 16.420 1.00 21.66 C ATOM 241 CD2 TYR A 222 1.844 7.359 14.513 1.00 24.19 C ATOM 242 CE1 TYR A 222 4.391 7.041 15.583 1.00 19.83 C ATOM 243 CE2 TYR A 222 2.947 7.177 13.657 1.00 23.47 C ATOM 244 CZ TYR A 222 4.213 7.016 14.198 1.00 23.67 C ATOM 245 OH TYR A 222 5.302 6.826 13.354 1.00 22.47 O ATOM 246 HA TYR A 222 0.949 9.380 17.721 1.00 0.00 H ATOM 247 HB3 TYR A 222 0.006 6.852 16.344 1.00 0.00 H ATOM 248 HB2 TYR A 222 1.082 6.973 17.756 1.00 0.00 H ATOM 249 HD2 TYR A 222 0.850 7.489 14.085 1.00 0.00 H ATOM 250 HE2 TYR A 222 2.806 7.163 12.576 1.00 0.00 H ATOM 251 HE1 TYR A 222 5.387 6.919 16.008 1.00 0.00 H ATOM 252 HD1 TYR A 222 3.438 7.244 17.500 1.00 0.00 H ATOM 253 HH TYR A 222 5.162 6.007 12.815 1.00 0.00 H ATOM 254 H TYR A 222 -1.405 7.675 17.951 1.00 0.00 H ATOM 255 N ILE A 223 -1.097 9.234 15.114 1.00 28.51 N ATOM 256 CA ILE A 223 -1.443 9.952 13.890 1.00 32.22 C ATOM 257 C ILE A 223 -1.804 11.398 14.220 1.00 33.71 C ATOM 258 O ILE A 223 -1.428 12.321 13.513 1.00 36.51 O ATOM 259 CB ILE A 223 -2.657 9.328 13.167 1.00 34.36 C ATOM 260 CG1 ILE A 223 -2.331 7.910 12.700 1.00 34.31 C ATOM 261 CG2 ILE A 223 -3.039 10.200 11.949 1.00 34.82 C ATOM 262 CD1 ILE A 223 -1.207 7.854 11.683 1.00 39.44 C ATOM 263 HA ILE A 223 -0.571 9.895 13.239 1.00 0.00 H ATOM 264 HB ILE A 223 -3.494 9.283 13.863 1.00 0.00 H ATOM 265 HG12 ILE A 223 -2.042 7.318 13.568 1.00 0.00 H ATOM 266 HG13 ILE A 223 -3.226 7.480 12.250 1.00 0.00 H ATOM 267 HD11 ILE A 223 -1.486 8.433 10.803 1.00 0.00 H ATOM 268 HD12 ILE A 223 -0.301 8.271 12.122 1.00 0.00 H ATOM 269 HD13 ILE A 223 -1.029 6.817 11.396 1.00 0.00 H ATOM 270 HG21 ILE A 223 -3.295 11.204 12.288 1.00 0.00 H ATOM 271 HG22 ILE A 223 -2.195 10.252 11.262 1.00 0.00 H ATOM 272 HG23 ILE A 223 -3.896 9.757 11.441 1.00 0.00 H ATOM 273 H ILE A 223 -1.663 8.412 15.408 1.00 0.00 H ATOM 274 N LYS A 224 -2.535 11.582 15.308 1.00 34.16 N ATOM 275 CA LYS A 224 -2.964 12.896 15.727 1.00 34.52 C ATOM 276 C LYS A 224 -1.850 13.765 16.302 1.00 35.01 C ATOM 277 O LYS A 224 -1.954 14.990 16.297 1.00 36.23 O ATOM 278 CB LYS A 224 -4.100 12.738 16.740 1.00 34.56 C ATOM 279 CG LYS A 224 -5.300 11.966 16.153 1.00 37.41 C ATOM 280 CD LYS A 224 -6.396 11.667 17.188 1.00 35.72 C ATOM 281 CE LYS A 224 -7.526 10.872 16.547 1.00 33.91 C ATOM 282 NZ LYS A 224 -8.632 10.548 17.495 1.00 37.28 N ATOM 283 HA LYS A 224 -3.303 13.424 14.836 1.00 0.00 H ATOM 284 HB2 LYS A 224 -3.724 12.196 17.608 1.00 0.00 H ATOM 285 HB3 LYS A 224 -4.436 13.728 17.049 1.00 0.00 H ATOM 286 HG2 LYS A 224 -5.735 12.561 15.350 1.00 0.00 H ATOM 287 HG3 LYS A 224 -4.939 11.021 15.748 1.00 0.00 H ATOM 288 HD2 LYS A 224 -5.969 11.089 18.007 1.00 0.00 H ATOM 289 HD3 LYS A 224 -6.791 12.606 17.575 1.00 0.00 H ATOM 290 HE2 LYS A 224 -7.117 9.939 16.161 1.00 0.00 H ATOM 291 HE3 LYS A 224 -7.936 11.456 15.723 1.00 0.00 H ATOM 292 HZ1 LYS A 224 -8.257 9.981 18.282 1.00 0.00 H ATOM 293 HZ2 LYS A 224 -9.040 11.430 17.865 1.00 0.00 H ATOM 294 HZ3 LYS A 224 -9.367 10.007 16.996 1.00 0.00 H ATOM 295 H LYS A 224 -2.809 10.756 15.878 1.00 0.00 H ATOM 296 N SER A 225 -0.773 13.151 16.781 1.00 34.50 N ATOM 297 CA SER A 225 0.307 13.932 17.370 1.00 32.55 C ATOM 298 C SER A 225 1.483 14.203 16.452 1.00 32.49 C ATOM 299 O SER A 225 2.194 15.182 16.632 1.00 31.72 O ATOM 300 CB SER A 225 0.812 13.246 18.644 1.00 34.50 C ATOM 301 OG SER A 225 -0.218 13.143 19.611 1.00 35.77 O ATOM 302 HA SER A 225 -0.133 14.906 17.586 1.00 0.00 H ATOM 303 HB2 SER A 225 1.634 13.828 19.060 1.00 0.00 H ATOM 304 HB3 SER A 225 1.167 12.246 18.394 1.00 0.00 H ATOM 305 HG SER A 225 -0.966 12.611 19.240 1.00 0.00 H ATOM 306 H SER A 225 -0.701 12.114 16.736 1.00 0.00 H ATOM 307 N PHE A 226 1.692 13.337 15.467 1.00 33.15 N ATOM 308 CA PHE A 226 2.817 13.485 14.558 1.00 33.34 C ATOM 309 C PHE A 226 2.360 13.791 13.133 1.00 34.05 C ATOM 310 O PHE A 226 1.766 12.954 12.471 1.00 35.85 O ATOM 311 CB PHE A 226 3.670 12.213 14.606 1.00 30.51 C ATOM 312 CG PHE A 226 4.168 11.871 15.999 1.00 31.79 C ATOM 313 CD1 PHE A 226 5.093 12.698 16.649 1.00 30.28 C ATOM 314 CD2 PHE A 226 3.674 10.758 16.677 1.00 29.36 C ATOM 315 CE1 PHE A 226 5.516 12.426 17.958 1.00 30.59 C ATOM 316 CE2 PHE A 226 4.087 10.470 17.991 1.00 30.96 C ATOM 317 CZ PHE A 226 5.009 11.307 18.635 1.00 29.27 C ATOM 318 HA PHE A 226 3.418 14.336 14.879 1.00 0.00 H ATOM 319 HB2 PHE A 226 3.070 11.380 14.240 1.00 0.00 H ATOM 320 HB3 PHE A 226 4.533 12.351 13.955 1.00 0.00 H ATOM 321 HD2 PHE A 226 2.958 10.102 16.183 1.00 0.00 H ATOM 322 HE2 PHE A 226 3.690 9.596 18.508 1.00 0.00 H ATOM 323 HZ PHE A 226 5.329 11.090 19.654 1.00 0.00 H ATOM 324 HE1 PHE A 226 6.236 13.082 18.448 1.00 0.00 H ATOM 325 HD1 PHE A 226 5.491 13.569 16.128 1.00 0.00 H ATOM 326 H PHE A 226 1.038 12.538 15.344 1.00 0.00 H ATOM 327 N PRO A 227 2.640 15.013 12.649 1.00 36.33 N ATOM 328 CA PRO A 227 2.284 15.508 11.311 1.00 36.46 C ATOM 329 C PRO A 227 2.853 14.693 10.166 1.00 34.28 C ATOM 330 O PRO A 227 2.207 14.533 9.143 1.00 35.25 O ATOM 331 CB PRO A 227 2.843 16.931 11.301 1.00 36.62 C ATOM 332 CG PRO A 227 2.821 17.311 12.742 1.00 41.08 C ATOM 333 CD PRO A 227 3.337 16.062 13.408 1.00 37.70 C ATOM 334 HA PRO A 227 1.208 15.446 11.149 1.00 0.00 H ATOM 335 HD3 PRO A 227 4.419 15.975 13.307 1.00 0.00 H ATOM 336 HD2 PRO A 227 3.069 16.034 14.464 1.00 0.00 H ATOM 337 HG3 PRO A 227 1.810 17.547 13.073 1.00 0.00 H ATOM 338 HG2 PRO A 227 3.474 18.162 12.937 1.00 0.00 H ATOM 339 HB2 PRO A 227 3.859 16.950 10.906 1.00 0.00 H ATOM 340 HB3 PRO A 227 2.212 17.596 10.711 1.00 0.00 H ATOM 341 N LEU A 228 4.070 14.194 10.331 1.00 31.71 N ATOM 342 CA LEU A 228 4.690 13.422 9.272 1.00 32.25 C ATOM 343 C LEU A 228 4.915 11.967 9.698 1.00 31.26 C ATOM 344 O LEU A 228 5.881 11.660 10.394 1.00 29.45 O ATOM 345 CB LEU A 228 6.014 14.082 8.854 1.00 30.45 C ATOM 346 CG LEU A 228 6.806 13.360 7.749 1.00 34.58 C ATOM 347 CD1 LEU A 228 5.943 13.199 6.503 1.00 30.99 C ATOM 348 CD2 LEU A 228 8.075 14.148 7.414 1.00 31.76 C ATOM 349 HA LEU A 228 4.015 13.407 8.416 1.00 0.00 H ATOM 350 HB2 LEU A 228 5.789 15.088 8.501 1.00 0.00 H ATOM 351 HB3 LEU A 228 6.651 14.142 9.737 1.00 0.00 H ATOM 352 HG LEU A 228 7.090 12.371 8.108 1.00 0.00 H ATOM 353 HD21 LEU A 228 7.801 15.144 7.067 1.00 0.00 H ATOM 354 HD22 LEU A 228 8.696 14.230 8.306 1.00 0.00 H ATOM 355 HD23 LEU A 228 8.628 13.628 6.631 1.00 0.00 H ATOM 356 HD11 LEU A 228 5.057 12.613 6.749 1.00 0.00 H ATOM 357 HD12 LEU A 228 5.641 14.182 6.142 1.00 0.00 H ATOM 358 HD13 LEU A 228 6.516 12.687 5.730 1.00 0.00 H ATOM 359 H LEU A 228 4.581 14.357 11.222 1.00 0.00 H ATOM 360 N THR A 229 4.010 11.084 9.276 1.00 29.01 N ATOM 361 CA THR A 229 4.094 9.662 9.600 1.00 27.39 C ATOM 362 C THR A 229 5.154 9.009 8.721 1.00 26.56 C ATOM 363 O THR A 229 5.662 9.625 7.794 1.00 27.62 O ATOM 364 CB THR A 229 2.769 8.933 9.312 1.00 25.55 C ATOM 365 OG1 THR A 229 2.458 9.069 7.927 1.00 27.12 O ATOM 366 CG2 THR A 229 1.637 9.511 10.114 1.00 28.00 C ATOM 367 HA THR A 229 4.334 9.585 10.661 1.00 0.00 H ATOM 368 HB THR A 229 2.891 7.885 9.587 1.00 0.00 H ATOM 369 HG1 THR A 229 1.606 8.602 7.734 1.00 0.00 H ATOM 370 HG23 THR A 229 1.860 9.415 11.177 1.00 0.00 H ATOM 371 HG21 THR A 229 1.515 10.564 9.861 1.00 0.00 H ATOM 372 HG22 THR A 229 0.718 8.972 9.884 1.00 0.00 H ATOM 373 H THR A 229 3.215 11.420 8.695 1.00 0.00 H ATOM 374 N LYS A 230 5.492 7.761 9.019 1.00 25.54 N ATOM 375 CA LYS A 230 6.461 7.030 8.206 1.00 24.57 C ATOM 376 C LYS A 230 5.821 6.735 6.846 1.00 22.17 C ATOM 377 O LYS A 230 6.488 6.779 5.822 1.00 22.85 O ATOM 378 CB LYS A 230 6.853 5.710 8.887 1.00 22.66 C ATOM 379 CG LYS A 230 7.814 4.859 8.069 1.00 23.42 C ATOM 380 CD LYS A 230 8.300 3.627 8.848 1.00 21.79 C ATOM 381 CE LYS A 230 9.286 2.827 8.001 1.00 24.99 C ATOM 382 NZ LYS A 230 9.829 1.630 8.711 1.00 29.36 N ATOM 383 HA LYS A 230 7.362 7.631 8.084 1.00 0.00 H ATOM 384 HB2 LYS A 230 7.326 5.942 9.841 1.00 0.00 H ATOM 385 HB3 LYS A 230 5.946 5.132 9.064 1.00 0.00 H ATOM 386 HG2 LYS A 230 7.306 4.525 7.164 1.00 0.00 H ATOM 387 HG3 LYS A 230 8.677 5.466 7.797 1.00 0.00 H ATOM 388 HD2 LYS A 230 8.792 3.951 9.765 1.00 0.00 H ATOM 389 HD3 LYS A 230 7.446 2.998 9.098 1.00 0.00 H ATOM 390 HE2 LYS A 230 10.118 3.477 7.729 1.00 0.00 H ATOM 391 HE3 LYS A 230 8.777 2.493 7.097 1.00 0.00 H ATOM 392 HZ1 LYS A 230 10.326 1.935 9.572 1.00 0.00 H ATOM 393 HZ2 LYS A 230 9.046 0.996 8.968 1.00 0.00 H ATOM 394 HZ3 LYS A 230 10.492 1.129 8.086 1.00 0.00 H ATOM 395 H LYS A 230 5.061 7.296 9.843 1.00 0.00 H ATOM 396 N ALA A 231 4.522 6.444 6.841 1.00 24.23 N ATOM 397 CA ALA A 231 3.819 6.145 5.591 1.00 23.42 C ATOM 398 C ALA A 231 3.960 7.307 4.616 1.00 22.08 C ATOM 399 O ALA A 231 4.249 7.107 3.432 1.00 24.09 O ATOM 400 CB ALA A 231 2.342 5.857 5.872 1.00 23.31 C ATOM 401 HA ALA A 231 4.265 5.259 5.140 1.00 0.00 H ATOM 402 HB1 ALA A 231 2.261 5.001 6.542 1.00 0.00 H ATOM 403 HB2 ALA A 231 1.885 6.730 6.339 1.00 0.00 H ATOM 404 HB3 ALA A 231 1.831 5.636 4.935 1.00 0.00 H ATOM 405 H ALA A 231 3.998 6.429 7.739 1.00 0.00 H ATOM 406 N LYS A 232 3.763 8.525 5.110 1.00 24.62 N ATOM 407 CA LYS A 232 3.904 9.719 4.268 1.00 26.76 C ATOM 408 C LYS A 232 5.371 9.870 3.895 1.00 25.63 C ATOM 409 O LYS A 232 5.703 10.175 2.752 1.00 25.63 O ATOM 410 CB LYS A 232 3.440 10.961 5.028 1.00 31.18 C ATOM 411 CG LYS A 232 3.505 12.267 4.252 1.00 32.73 C ATOM 412 CD LYS A 232 2.194 13.018 4.443 1.00 38.23 C ATOM 413 CE LYS A 232 2.388 14.519 4.604 1.00 40.71 C ATOM 414 NZ LYS A 232 2.932 15.151 3.398 1.00 41.42 N ATOM 415 HA LYS A 232 3.292 9.612 3.373 1.00 0.00 H ATOM 416 HB2 LYS A 232 2.405 10.802 5.332 1.00 0.00 H ATOM 417 HB3 LYS A 232 4.066 11.066 5.914 1.00 0.00 H ATOM 418 HG2 LYS A 232 4.332 12.873 4.623 1.00 0.00 H ATOM 419 HG3 LYS A 232 3.656 12.057 3.193 1.00 0.00 H ATOM 420 HD2 LYS A 232 1.561 12.840 3.573 1.00 0.00 H ATOM 421 HD3 LYS A 232 1.700 12.633 5.335 1.00 0.00 H ATOM 422 HE2 LYS A 232 3.076 14.695 5.431 1.00 0.00 H ATOM 423 HE3 LYS A 232 1.424 14.973 4.832 1.00 0.00 H ATOM 424 HZ1 LYS A 232 3.857 14.731 3.175 1.00 0.00 H ATOM 425 HZ2 LYS A 232 2.280 14.997 2.603 1.00 0.00 H ATOM 426 HZ3 LYS A 232 3.044 16.172 3.563 1.00 0.00 H ATOM 427 H LYS A 232 3.504 8.634 6.111 1.00 0.00 H ATOM 428 N ALA A 233 6.257 9.644 4.861 1.00 25.66 N ATOM 429 CA ALA A 233 7.688 9.744 4.592 1.00 27.38 C ATOM 430 C ALA A 233 8.146 8.799 3.464 1.00 27.95 C ATOM 431 O ALA A 233 8.861 9.224 2.554 1.00 28.96 O ATOM 432 CB ALA A 233 8.493 9.468 5.877 1.00 29.09 C ATOM 433 HA ALA A 233 7.878 10.762 4.253 1.00 0.00 H ATOM 434 HB1 ALA A 233 8.221 10.199 6.639 1.00 0.00 H ATOM 435 HB2 ALA A 233 8.267 8.464 6.237 1.00 0.00 H ATOM 436 HB3 ALA A 233 9.558 9.546 5.661 1.00 0.00 H ATOM 437 H ALA A 233 5.928 9.394 5.815 1.00 0.00 H ATOM 438 N ARG A 234 7.751 7.530 3.519 1.00 26.99 N ATOM 439 CA ARG A 234 8.167 6.594 2.478 1.00 28.77 C ATOM 440 C ARG A 234 7.513 6.922 1.134 1.00 29.13 C ATOM 441 O ARG A 234 8.113 6.703 0.086 1.00 30.83 O ATOM 442 CB ARG A 234 7.851 5.139 2.872 1.00 28.70 C ATOM 443 CG ARG A 234 8.287 4.729 4.290 1.00 28.50 C ATOM 444 CD ARG A 234 9.598 5.380 4.771 1.00 28.80 C ATOM 445 NE ARG A 234 10.775 5.001 3.989 1.00 29.15 N ATOM 446 CZ ARG A 234 12.036 5.222 4.369 1.00 26.59 C ATOM 447 NH1 ARG A 234 12.297 5.813 5.522 1.00 20.52 N ATOM 448 NH2 ARG A 234 13.042 4.862 3.584 1.00 26.13 N ATOM 449 HA ARG A 234 9.247 6.699 2.372 1.00 0.00 H ATOM 450 HB2 ARG A 234 6.773 4.997 2.797 1.00 0.00 H ATOM 451 HB3 ARG A 234 8.353 4.482 2.162 1.00 0.00 H ATOM 452 HG2 ARG A 234 7.494 5.008 4.984 1.00 0.00 H ATOM 453 HG3 ARG A 234 8.418 3.647 4.306 1.00 0.00 H ATOM 454 HD2 ARG A 234 9.766 5.087 5.807 1.00 0.00 H ATOM 455 HD3 ARG A 234 9.484 6.463 4.715 1.00 0.00 H ATOM 456 HE ARG A 234 10.619 4.528 3.076 1.00 0.00 H ATOM 457 HH12 ARG A 234 13.282 5.981 5.809 1.00 0.00 H ATOM 458 HH11 ARG A 234 11.517 6.110 6.142 1.00 0.00 H ATOM 459 HH22 ARG A 234 14.023 5.036 3.883 1.00 0.00 H ATOM 460 HH21 ARG A 234 12.850 4.406 2.669 1.00 0.00 H ATOM 461 H ARG A 234 7.148 7.205 4.301 1.00 0.00 H ATOM 462 N ALA A 235 6.290 7.445 1.157 1.00 27.94 N ATOM 463 CA ALA A 235 5.613 7.807 -0.089 1.00 29.92 C ATOM 464 C ALA A 235 6.397 8.924 -0.786 1.00 32.32 C ATOM 465 O ALA A 235 6.534 8.940 -2.014 1.00 34.25 O ATOM 466 CB ALA A 235 4.180 8.258 0.192 1.00 26.91 C ATOM 467 HA ALA A 235 5.572 6.934 -0.741 1.00 0.00 H ATOM 468 HB1 ALA A 235 3.632 7.446 0.670 1.00 0.00 H ATOM 469 HB2 ALA A 235 4.196 9.125 0.852 1.00 0.00 H ATOM 470 HB3 ALA A 235 3.693 8.523 -0.747 1.00 0.00 H ATOM 471 H ALA A 235 5.811 7.598 2.068 1.00 0.00 H ATOM 472 N ILE A 236 6.911 9.863 -0.001 1.00 31.64 N ATOM 473 CA ILE A 236 7.686 10.956 -0.568 1.00 32.26 C ATOM 474 C ILE A 236 9.032 10.420 -1.060 1.00 34.02 C ATOM 475 O ILE A 236 9.482 10.766 -2.148 1.00 34.04 O ATOM 476 CB ILE A 236 7.955 12.055 0.490 1.00 33.14 C ATOM 477 CG1 ILE A 236 6.634 12.697 0.931 1.00 34.01 C ATOM 478 CG2 ILE A 236 8.918 13.096 -0.069 1.00 29.94 C ATOM 479 CD1 ILE A 236 6.786 13.731 2.083 1.00 32.81 C ATOM 480 HA ILE A 236 7.115 11.386 -1.391 1.00 0.00 H ATOM 481 HB ILE A 236 8.419 11.604 1.367 1.00 0.00 H ATOM 482 HG12 ILE A 236 6.195 13.203 0.071 1.00 0.00 H ATOM 483 HG13 ILE A 236 5.963 11.906 1.267 1.00 0.00 H ATOM 484 HD11 ILE A 236 7.213 13.239 2.957 1.00 0.00 H ATOM 485 HD12 ILE A 236 7.444 14.538 1.761 1.00 0.00 H ATOM 486 HD13 ILE A 236 5.807 14.138 2.335 1.00 0.00 H ATOM 487 HG21 ILE A 236 9.860 12.614 -0.332 1.00 0.00 H ATOM 488 HG22 ILE A 236 8.482 13.553 -0.957 1.00 0.00 H ATOM 489 HG23 ILE A 236 9.099 13.863 0.684 1.00 0.00 H ATOM 490 H ILE A 236 6.759 9.817 1.027 1.00 0.00 H ATOM 491 N LEU A 237 9.662 9.567 -0.254 1.00 34.17 N ATOM 492 CA LEU A 237 10.974 9.007 -0.584 1.00 35.34 C ATOM 493 C LEU A 237 11.016 8.054 -1.768 1.00 36.77 C ATOM 494 O LEU A 237 11.928 8.122 -2.586 1.00 35.86 O ATOM 495 CB LEU A 237 11.563 8.285 0.634 1.00 32.56 C ATOM 496 CG LEU A 237 12.044 9.150 1.793 1.00 33.19 C ATOM 497 CD1 LEU A 237 12.444 8.256 2.971 1.00 32.97 C ATOM 498 CD2 LEU A 237 13.215 10.010 1.333 1.00 31.44 C ATOM 499 HA LEU A 237 11.563 9.876 -0.877 1.00 0.00 H ATOM 500 HB2 LEU A 237 10.795 7.615 1.021 1.00 0.00 H ATOM 501 HB3 LEU A 237 12.414 7.698 0.288 1.00 0.00 H ATOM 502 HG LEU A 237 11.241 9.810 2.123 1.00 0.00 H ATOM 503 HD21 LEU A 237 14.028 9.366 0.998 1.00 0.00 H ATOM 504 HD22 LEU A 237 12.894 10.649 0.511 1.00 0.00 H ATOM 505 HD23 LEU A 237 13.558 10.628 2.163 1.00 0.00 H ATOM 506 HD11 LEU A 237 11.582 7.670 3.290 1.00 0.00 H ATOM 507 HD12 LEU A 237 13.246 7.586 2.661 1.00 0.00 H ATOM 508 HD13 LEU A 237 12.787 8.878 3.798 1.00 0.00 H ATOM 509 H LEU A 237 9.207 9.290 0.639 1.00 0.00 H ATOM 510 N THR A 238 10.036 7.159 -1.846 1.00 39.69 N ATOM 511 CA THR A 238 9.988 6.166 -2.908 1.00 41.65 C ATOM 512 C THR A 238 9.361 6.735 -4.160 1.00 45.06 C ATOM 513 O THR A 238 9.000 6.002 -5.077 1.00 45.42 O ATOM 514 CB THR A 238 9.199 4.929 -2.463 1.00 41.71 C ATOM 515 OG1 THR A 238 7.835 5.293 -2.202 1.00 44.45 O ATOM 516 CG2 THR A 238 9.809 4.349 -1.198 1.00 40.37 C ATOM 517 HA THR A 238 11.016 5.877 -3.128 1.00 0.00 H ATOM 518 HB THR A 238 9.236 4.184 -3.258 1.00 0.00 H ATOM 519 HG1 THR A 238 7.808 5.975 -1.485 1.00 0.00 H ATOM 520 HG23 THR A 238 10.845 4.071 -1.390 1.00 0.00 H ATOM 521 HG21 THR A 238 9.773 5.095 -0.404 1.00 0.00 H ATOM 522 HG22 THR A 238 9.245 3.467 -0.895 1.00 0.00 H ATOM 523 H THR A 238 9.283 7.169 -1.128 1.00 0.00 H ATOM 524 N GLY A 239 9.237 8.057 -4.180 1.00 48.36 N ATOM 525 CA GLY A 239 8.674 8.747 -5.322 1.00 51.18 C ATOM 526 C GLY A 239 7.427 8.139 -5.938 1.00 54.11 C ATOM 527 O GLY A 239 6.396 7.961 -5.282 1.00 53.93 O ATOM 528 HA3 GLY A 239 9.440 8.785 -6.096 1.00 0.00 H ATOM 529 HA2 GLY A 239 8.427 9.761 -5.007 1.00 0.00 H ATOM 530 H GLY A 239 9.551 8.609 -3.357 1.00 0.00 H ATOM 531 N LYS A 240 7.530 7.816 -7.221 1.00 57.17 N ATOM 532 CA LYS A 240 6.409 7.259 -7.959 1.00 60.17 C ATOM 533 C LYS A 240 5.270 8.251 -7.808 1.00 60.62 C ATOM 534 O LYS A 240 4.111 7.945 -8.089 1.00 61.74 O ATOM 535 CB LYS A 240 6.012 5.886 -7.406 1.00 61.02 C ATOM 536 CG LYS A 240 4.892 5.201 -8.194 1.00 62.89 C ATOM 537 CD LYS A 240 5.024 5.455 -9.697 1.00 63.48 C ATOM 538 CE LYS A 240 6.352 4.952 -10.257 1.00 64.88 C ATOM 539 NZ LYS A 240 6.592 5.438 -11.646 1.00 64.00 N ATOM 540 HA LYS A 240 6.667 7.106 -9.007 1.00 0.00 H ATOM 541 HB2 LYS A 240 6.890 5.241 -7.425 1.00 0.00 H ATOM 542 HB3 LYS A 240 5.679 6.014 -6.376 1.00 0.00 H ATOM 543 HG2 LYS A 240 4.936 4.127 -8.011 1.00 0.00 H ATOM 544 HG3 LYS A 240 3.932 5.587 -7.853 1.00 0.00 H ATOM 545 HD2 LYS A 240 4.210 4.944 -10.212 1.00 0.00 H ATOM 546 HD3 LYS A 240 4.950 6.527 -9.879 1.00 0.00 H ATOM 547 HE2 LYS A 240 6.342 3.862 -10.262 1.00 0.00 H ATOM 548 HE3 LYS A 240 7.160 5.304 -9.616 1.00 0.00 H ATOM 549 HZ1 LYS A 240 5.829 5.101 -12.267 1.00 0.00 H ATOM 550 HZ2 LYS A 240 6.610 6.478 -11.650 1.00 0.00 H ATOM 551 HZ3 LYS A 240 7.504 5.073 -11.987 1.00 0.00 H ATOM 552 H LYS A 240 8.435 7.965 -7.710 1.00 0.00 H ATOM 553 N THR A 241 5.632 9.452 -7.365 1.00 60.73 N ATOM 554 CA THR A 241 4.685 10.538 -7.159 1.00 60.73 C ATOM 555 C THR A 241 5.126 11.774 -7.921 1.00 60.83 C ATOM 556 O THR A 241 6.292 11.913 -8.292 1.00 60.85 O ATOM 557 CB THR A 241 4.557 10.908 -5.661 1.00 60.53 C ATOM 558 OG1 THR A 241 5.863 11.110 -5.094 1.00 60.63 O ATOM 559 CG2 THR A 241 3.828 9.805 -4.907 1.00 57.20 C ATOM 560 HA THR A 241 3.718 10.192 -7.524 1.00 0.00 H ATOM 561 HB THR A 241 3.983 11.831 -5.574 1.00 0.00 H ATOM 562 HG1 THR A 241 6.392 10.278 -5.182 1.00 0.00 H ATOM 563 HG23 THR A 241 2.840 9.660 -5.344 1.00 0.00 H ATOM 564 HG21 THR A 241 4.398 8.879 -4.979 1.00 0.00 H ATOM 565 HG22 THR A 241 3.725 10.089 -3.860 1.00 0.00 H ATOM 566 H THR A 241 6.637 9.623 -7.157 1.00 0.00 H ATOM 567 N THR A 242 4.173 12.668 -8.144 1.00 60.03 N ATOM 568 CA THR A 242 4.414 13.916 -8.850 1.00 60.26 C ATOM 569 C THR A 242 3.967 15.039 -7.928 1.00 59.06 C ATOM 570 O THR A 242 4.357 16.193 -8.081 1.00 59.54 O ATOM 571 CB THR A 242 3.568 13.975 -10.136 1.00 60.55 C ATOM 572 OG1 THR A 242 3.987 12.936 -11.026 1.00 64.13 O ATOM 573 CG2 THR A 242 3.715 15.320 -10.819 1.00 60.96 C ATOM 574 HA THR A 242 5.467 14.001 -9.118 1.00 0.00 H ATOM 575 HB THR A 242 2.520 13.838 -9.870 1.00 0.00 H ATOM 576 HG1 THR A 242 3.444 12.973 -11.853 1.00 0.00 H ATOM 577 HG23 THR A 242 3.395 16.109 -10.138 1.00 0.00 H ATOM 578 HG21 THR A 242 4.759 15.475 -11.092 1.00 0.00 H ATOM 579 HG22 THR A 242 3.097 15.340 -11.716 1.00 0.00 H ATOM 580 H THR A 242 3.212 12.468 -7.799 1.00 0.00 H ATOM 581 N ASP A 243 3.145 14.660 -6.959 1.00 57.51 N ATOM 582 CA ASP A 243 2.555 15.572 -5.991 1.00 56.16 C ATOM 583 C ASP A 243 3.446 15.976 -4.813 1.00 53.55 C ATOM 584 O ASP A 243 3.418 17.126 -4.373 1.00 54.12 O ATOM 585 CB ASP A 243 1.267 14.927 -5.462 1.00 58.33 C ATOM 586 CG ASP A 243 0.505 15.826 -4.526 1.00 62.88 C ATOM 587 OD1 ASP A 243 0.139 16.946 -4.950 1.00 66.46 O ATOM 588 OD2 ASP A 243 0.261 15.412 -3.370 1.00 64.59 O ATOM 589 HA ASP A 243 2.379 16.505 -6.526 1.00 0.00 H ATOM 590 HB2 ASP A 243 0.626 14.683 -6.309 1.00 0.00 H ATOM 591 HB3 ASP A 243 1.528 14.012 -4.930 1.00 0.00 H ATOM 592 H ASP A 243 2.908 13.650 -6.887 1.00 0.00 H ATOM 593 N LYS A 244 4.239 15.034 -4.311 1.00 52.10 N ATOM 594 CA LYS A 244 5.097 15.307 -3.167 1.00 49.23 C ATOM 595 C LYS A 244 6.579 15.000 -3.327 1.00 47.33 C ATOM 596 O LYS A 244 7.196 14.432 -2.427 1.00 46.76 O ATOM 597 CB LYS A 244 4.570 14.562 -1.940 1.00 49.97 C ATOM 598 CG LYS A 244 4.213 13.108 -2.187 1.00 47.28 C ATOM 599 CD LYS A 244 2.730 12.958 -2.451 1.00 45.67 C ATOM 600 CE LYS A 244 2.140 11.850 -1.587 1.00 44.82 C ATOM 601 NZ LYS A 244 2.359 12.079 -0.126 1.00 38.13 N ATOM 602 HA LYS A 244 5.048 16.390 -3.058 1.00 0.00 H ATOM 603 HB2 LYS A 244 5.336 14.597 -1.166 1.00 0.00 H ATOM 604 HB3 LYS A 244 3.676 15.077 -1.588 1.00 0.00 H ATOM 605 HG2 LYS A 244 4.769 12.745 -3.051 1.00 0.00 H ATOM 606 HG3 LYS A 244 4.482 12.519 -1.310 1.00 0.00 H ATOM 607 HD2 LYS A 244 2.228 13.898 -2.221 1.00 0.00 H ATOM 608 HD3 LYS A 244 2.576 12.713 -3.502 1.00 0.00 H ATOM 609 HE2 LYS A 244 2.606 10.905 -1.866 1.00 0.00 H ATOM 610 HE3 LYS A 244 1.068 11.795 -1.775 1.00 0.00 H ATOM 611 HZ1 LYS A 244 3.380 12.125 0.067 1.00 0.00 H ATOM 612 HZ2 LYS A 244 1.911 12.975 0.154 1.00 0.00 H ATOM 613 HZ3 LYS A 244 1.938 11.296 0.413 1.00 0.00 H ATOM 614 H LYS A 244 4.246 14.088 -4.742 1.00 0.00 H ATOM 615 N SER A 245 7.154 15.380 -4.460 1.00 45.90 N ATOM 616 CA SER A 245 8.575 15.156 -4.693 1.00 44.44 C ATOM 617 C SER A 245 9.261 16.326 -3.993 1.00 40.38 C ATOM 618 O SER A 245 8.837 17.471 -4.146 1.00 38.64 O ATOM 619 CB SER A 245 8.884 15.164 -6.195 1.00 47.66 C ATOM 620 OG SER A 245 8.412 16.350 -6.807 1.00 50.79 O ATOM 621 HA SER A 245 8.913 14.191 -4.316 1.00 0.00 H ATOM 622 HB2 SER A 245 8.401 14.306 -6.662 1.00 0.00 H ATOM 623 HB3 SER A 245 9.962 15.095 -6.337 1.00 0.00 H ATOM 624 HG SER A 245 8.851 17.133 -6.389 1.00 0.00 H ATOM 625 H SER A 245 6.582 15.845 -5.194 1.00 0.00 H ATOM 626 N PRO A 246 10.318 16.054 -3.204 1.00 36.63 N ATOM 627 CA PRO A 246 11.066 17.078 -2.463 1.00 34.36 C ATOM 628 C PRO A 246 12.208 17.748 -3.208 1.00 33.83 C ATOM 629 O PRO A 246 12.700 17.225 -4.207 1.00 31.08 O ATOM 630 CB PRO A 246 11.597 16.299 -1.275 1.00 35.16 C ATOM 631 CG PRO A 246 11.992 14.997 -1.932 1.00 35.26 C ATOM 632 CD PRO A 246 10.802 14.705 -2.851 1.00 35.60 C ATOM 633 HA PRO A 246 10.416 17.922 -2.231 1.00 0.00 H ATOM 634 HD3 PRO A 246 11.117 14.157 -3.739 1.00 0.00 H ATOM 635 HD2 PRO A 246 10.033 14.137 -2.328 1.00 0.00 H ATOM 636 HG3 PRO A 246 12.120 14.207 -1.192 1.00 0.00 H ATOM 637 HG2 PRO A 246 12.912 15.109 -2.505 1.00 0.00 H ATOM 638 HB2 PRO A 246 12.456 16.795 -0.823 1.00 0.00 H ATOM 639 HB3 PRO A 246 10.826 16.148 -0.519 1.00 0.00 H ATOM 640 N PHE A 247 12.625 18.910 -2.710 1.00 33.16 N ATOM 641 CA PHE A 247 13.758 19.613 -3.291 1.00 32.97 C ATOM 642 C PHE A 247 14.953 18.997 -2.576 1.00 31.72 C ATOM 643 O PHE A 247 14.937 18.847 -1.358 1.00 31.33 O ATOM 644 CB PHE A 247 13.725 21.115 -2.991 1.00 35.60 C ATOM 645 CG PHE A 247 14.856 21.873 -3.630 1.00 36.20 C ATOM 646 CD1 PHE A 247 14.878 22.083 -5.007 1.00 38.22 C ATOM 647 CD2 PHE A 247 15.927 22.322 -2.870 1.00 39.19 C ATOM 648 CE1 PHE A 247 15.951 22.726 -5.623 1.00 36.87 C ATOM 649 CE2 PHE A 247 17.013 22.970 -3.476 1.00 40.03 C ATOM 650 CZ PHE A 247 17.021 23.170 -4.857 1.00 39.82 C ATOM 651 HA PHE A 247 13.774 19.519 -4.377 1.00 0.00 H ATOM 652 HB2 PHE A 247 12.783 21.521 -3.360 1.00 0.00 H ATOM 653 HB3 PHE A 247 13.781 21.254 -1.911 1.00 0.00 H ATOM 654 HD2 PHE A 247 15.924 22.169 -1.791 1.00 0.00 H ATOM 655 HE2 PHE A 247 17.849 23.317 -2.869 1.00 0.00 H ATOM 656 HZ PHE A 247 17.863 23.672 -5.332 1.00 0.00 H ATOM 657 HE1 PHE A 247 15.950 22.880 -6.702 1.00 0.00 H ATOM 658 HD1 PHE A 247 14.041 21.738 -5.614 1.00 0.00 H ATOM 659 H PHE A 247 12.132 19.322 -1.892 1.00 0.00 H ATOM 660 N VAL A 248 15.992 18.657 -3.325 1.00 30.57 N ATOM 661 CA VAL A 248 17.164 18.020 -2.750 1.00 30.42 C ATOM 662 C VAL A 248 18.349 18.957 -2.492 1.00 32.81 C ATOM 663 O VAL A 248 18.848 19.619 -3.413 1.00 31.10 O ATOM 664 CB VAL A 248 17.619 16.852 -3.658 1.00 28.20 C ATOM 665 CG1 VAL A 248 18.931 16.310 -3.204 1.00 25.87 C ATOM 666 CG2 VAL A 248 16.565 15.746 -3.646 1.00 30.64 C ATOM 667 HA VAL A 248 16.850 17.664 -1.769 1.00 0.00 H ATOM 668 HB VAL A 248 17.736 17.228 -4.674 1.00 0.00 H ATOM 669 HG11 VAL A 248 19.682 17.099 -3.243 1.00 0.00 H ATOM 670 HG12 VAL A 248 18.838 15.945 -2.181 1.00 0.00 H ATOM 671 HG13 VAL A 248 19.230 15.490 -3.857 1.00 0.00 H ATOM 672 HG21 VAL A 248 16.434 15.381 -2.627 1.00 0.00 H ATOM 673 HG22 VAL A 248 15.619 16.143 -4.015 1.00 0.00 H ATOM 674 HG23 VAL A 248 16.892 14.927 -4.287 1.00 0.00 H ATOM 675 H VAL A 248 15.968 18.850 -4.347 1.00 0.00 H ATOM 676 N ILE A 249 18.777 19.006 -1.229 1.00 32.25 N ATOM 677 CA ILE A 249 19.922 19.811 -0.814 1.00 34.31 C ATOM 678 C ILE A 249 21.115 18.858 -0.756 1.00 33.44 C ATOM 679 O ILE A 249 21.140 17.935 0.059 1.00 32.83 O ATOM 680 CB ILE A 249 19.742 20.423 0.602 1.00 37.01 C ATOM 681 CG1 ILE A 249 18.444 21.233 0.688 1.00 37.88 C ATOM 682 CG2 ILE A 249 20.947 21.319 0.927 1.00 35.90 C ATOM 683 CD1 ILE A 249 18.374 22.376 -0.288 1.00 38.84 C ATOM 684 HA ILE A 249 20.048 20.635 -1.516 1.00 0.00 H ATOM 685 HB ILE A 249 19.682 19.613 1.329 1.00 0.00 H ATOM 686 HG12 ILE A 249 17.607 20.563 0.493 1.00 0.00 H ATOM 687 HG13 ILE A 249 18.357 21.637 1.697 1.00 0.00 H ATOM 688 HD11 ILE A 249 19.198 23.064 -0.099 1.00 0.00 H ATOM 689 HD12 ILE A 249 18.447 21.989 -1.304 1.00 0.00 H ATOM 690 HD13 ILE A 249 17.426 22.900 -0.165 1.00 0.00 H ATOM 691 HG21 ILE A 249 21.859 20.723 0.900 1.00 0.00 H ATOM 692 HG22 ILE A 249 21.013 22.119 0.189 1.00 0.00 H ATOM 693 HG23 ILE A 249 20.821 21.749 1.921 1.00 0.00 H ATOM 694 H ILE A 249 18.274 18.447 -0.510 1.00 0.00 H ATOM 695 N TYR A 250 22.102 19.089 -1.614 1.00 35.52 N ATOM 696 CA TYR A 250 23.288 18.239 -1.680 1.00 35.96 C ATOM 697 C TYR A 250 24.581 19.056 -1.700 1.00 36.46 C ATOM 698 O TYR A 250 25.675 18.491 -1.735 1.00 34.18 O ATOM 699 CB TYR A 250 23.214 17.368 -2.932 1.00 36.08 C ATOM 700 CG TYR A 250 23.294 18.154 -4.226 1.00 37.37 C ATOM 701 CD1 TYR A 250 24.513 18.331 -4.886 1.00 37.85 C ATOM 702 CD2 TYR A 250 22.152 18.714 -4.792 1.00 38.78 C ATOM 703 CE1 TYR A 250 24.587 19.042 -6.076 1.00 38.68 C ATOM 704 CE2 TYR A 250 22.213 19.432 -5.989 1.00 39.40 C ATOM 705 CZ TYR A 250 23.432 19.591 -6.624 1.00 41.64 C ATOM 706 OH TYR A 250 23.496 20.302 -7.802 1.00 42.70 O ATOM 707 HA TYR A 250 23.305 17.618 -0.784 1.00 0.00 H ATOM 708 HB3 TYR A 250 22.270 16.823 -2.918 1.00 0.00 H ATOM 709 HB2 TYR A 250 24.041 16.659 -2.908 1.00 0.00 H ATOM 710 HD2 TYR A 250 21.192 18.590 -4.292 1.00 0.00 H ATOM 711 HE2 TYR A 250 21.309 19.863 -6.419 1.00 0.00 H ATOM 712 HE1 TYR A 250 25.546 19.170 -6.579 1.00 0.00 H ATOM 713 HD1 TYR A 250 25.421 17.904 -4.459 1.00 0.00 H ATOM 714 HH TYR A 250 23.180 21.227 -7.645 1.00 0.00 H ATOM 715 H TYR A 250 22.028 19.901 -2.260 1.00 0.00 H ATOM 716 N ASP A 251 24.449 20.381 -1.706 1.00 37.94 N ATOM 717 CA ASP A 251 25.606 21.275 -1.705 1.00 40.96 C ATOM 718 C ASP A 251 25.185 22.699 -1.385 1.00 42.83 C ATOM 719 O ASP A 251 23.991 23.006 -1.359 1.00 42.51 O ATOM 720 CB ASP A 251 26.364 21.226 -3.045 1.00 40.96 C ATOM 721 CG ASP A 251 25.537 21.726 -4.237 1.00 44.45 C ATOM 722 OD1 ASP A 251 24.502 22.412 -4.057 1.00 44.12 O ATOM 723 OD2 ASP A 251 25.953 21.439 -5.379 1.00 44.36 O ATOM 724 HA ASP A 251 26.286 20.928 -0.927 1.00 0.00 H ATOM 725 HB2 ASP A 251 27.256 21.847 -2.960 1.00 0.00 H ATOM 726 HB3 ASP A 251 26.658 20.194 -3.238 1.00 0.00 H ATOM 727 H ASP A 251 23.494 20.793 -1.712 1.00 0.00 H ATOM 728 N MET A 252 26.165 23.562 -1.128 1.00 46.44 N ATOM 729 CA MET A 252 25.897 24.957 -0.780 1.00 48.52 C ATOM 730 C MET A 252 24.955 25.629 -1.762 1.00 49.19 C ATOM 731 O MET A 252 24.035 26.347 -1.368 1.00 49.26 O ATOM 732 CB MET A 252 27.205 25.759 -0.715 1.00 52.74 C ATOM 733 CG MET A 252 28.177 25.307 0.368 1.00 55.35 C ATOM 734 SD MET A 252 27.390 25.181 1.990 1.00 60.56 S ATOM 735 CE MET A 252 27.035 26.916 2.331 1.00 60.76 C ATOM 736 HA MET A 252 25.416 24.944 0.198 1.00 0.00 H ATOM 737 HB2 MET A 252 27.706 25.671 -1.679 1.00 0.00 H ATOM 738 HB3 MET A 252 26.954 26.804 -0.532 1.00 0.00 H ATOM 739 HG2 MET A 252 28.993 26.027 0.429 1.00 0.00 H ATOM 740 HG3 MET A 252 28.576 24.330 0.095 1.00 0.00 H ATOM 741 HE1 MET A 252 27.967 27.481 2.341 1.00 0.00 H ATOM 742 HE2 MET A 252 26.378 27.310 1.556 1.00 0.00 H ATOM 743 HE3 MET A 252 26.547 27.002 3.302 1.00 0.00 H ATOM 744 H MET A 252 27.151 23.235 -1.176 1.00 0.00 H ATOM 745 N ASN A 253 25.186 25.388 -3.045 1.00 49.94 N ATOM 746 CA ASN A 253 24.370 25.988 -4.081 1.00 50.76 C ATOM 747 C ASN A 253 22.915 25.575 -3.942 1.00 50.27 C ATOM 748 O ASN A 253 22.015 26.424 -3.929 1.00 49.91 O ATOM 749 CB ASN A 253 24.891 25.580 -5.455 1.00 55.79 C ATOM 750 CG ASN A 253 24.824 26.709 -6.453 1.00 58.95 C ATOM 751 OD1 ASN A 253 25.638 27.638 -6.413 1.00 60.04 O ATOM 752 ND2 ASN A 253 23.842 26.646 -7.353 1.00 60.25 N ATOM 753 HA ASN A 253 24.430 27.071 -3.974 1.00 0.00 H ATOM 754 HB2 ASN A 253 25.929 25.261 -5.356 1.00 0.00 H ATOM 755 HB3 ASN A 253 24.290 24.749 -5.825 1.00 0.00 H ATOM 756 HD22 ASN A 253 23.181 25.843 -7.346 1.00 0.00 H ATOM 757 HD21 ASN A 253 23.737 27.400 -8.062 1.00 0.00 H ATOM 758 H ASN A 253 25.968 24.756 -3.313 1.00 0.00 H ATOM 759 N SER A 254 22.677 24.269 -3.857 1.00 48.02 N ATOM 760 CA SER A 254 21.316 23.783 -3.716 1.00 46.86 C ATOM 761 C SER A 254 20.757 24.217 -2.359 1.00 46.54 C ATOM 762 O SER A 254 19.549 24.393 -2.204 1.00 42.84 O ATOM 763 CB SER A 254 21.265 22.257 -3.880 1.00 46.80 C ATOM 764 OG SER A 254 22.300 21.610 -3.161 1.00 47.26 O ATOM 765 HA SER A 254 20.696 24.215 -4.502 1.00 0.00 H ATOM 766 HB2 SER A 254 21.365 22.013 -4.938 1.00 0.00 H ATOM 767 HB3 SER A 254 20.304 21.896 -3.515 1.00 0.00 H ATOM 768 HG SER A 254 23.178 21.927 -3.491 1.00 0.00 H ATOM 769 H SER A 254 23.468 23.594 -3.892 1.00 0.00 H ATOM 770 N LEU A 255 21.638 24.408 -1.381 1.00 47.82 N ATOM 771 CA LEU A 255 21.187 24.850 -0.066 1.00 50.79 C ATOM 772 C LEU A 255 20.576 26.237 -0.244 1.00 52.20 C ATOM 773 O LEU A 255 19.536 26.546 0.335 1.00 50.59 O ATOM 774 CB LEU A 255 22.359 24.910 0.925 1.00 50.25 C ATOM 775 CG LEU A 255 22.031 25.465 2.319 1.00 51.73 C ATOM 776 CD1 LEU A 255 21.041 24.567 3.037 1.00 51.85 C ATOM 777 CD2 LEU A 255 23.295 25.576 3.122 1.00 51.10 C ATOM 778 HA LEU A 255 20.457 24.149 0.339 1.00 0.00 H ATOM 779 HB2 LEU A 255 22.743 23.898 1.050 1.00 0.00 H ATOM 780 HB3 LEU A 255 23.134 25.540 0.488 1.00 0.00 H ATOM 781 HG LEU A 255 21.579 26.451 2.207 1.00 0.00 H ATOM 782 HD21 LEU A 255 23.750 24.590 3.220 1.00 0.00 H ATOM 783 HD22 LEU A 255 23.988 26.248 2.616 1.00 0.00 H ATOM 784 HD23 LEU A 255 23.062 25.970 4.111 1.00 0.00 H ATOM 785 HD11 LEU A 255 20.120 24.506 2.457 1.00 0.00 H ATOM 786 HD12 LEU A 255 21.469 23.571 3.147 1.00 0.00 H ATOM 787 HD13 LEU A 255 20.825 24.981 4.022 1.00 0.00 H ATOM 788 H LEU A 255 22.650 24.242 -1.554 1.00 0.00 H ATOM 789 N MET A 256 21.227 27.064 -1.060 1.00 55.50 N ATOM 790 CA MET A 256 20.742 28.416 -1.334 1.00 60.36 C ATOM 791 C MET A 256 19.348 28.354 -1.955 1.00 61.38 C ATOM 792 O MET A 256 18.386 28.896 -1.405 1.00 61.45 O ATOM 793 CB MET A 256 21.687 29.145 -2.295 1.00 63.67 C ATOM 794 CG MET A 256 23.038 29.515 -1.714 1.00 67.70 C ATOM 795 SD MET A 256 24.122 30.274 -2.955 1.00 73.23 S ATOM 796 CE MET A 256 25.314 28.963 -3.223 1.00 72.66 C ATOM 797 HA MET A 256 20.702 28.961 -0.391 1.00 0.00 H ATOM 798 HB2 MET A 256 21.855 28.500 -3.157 1.00 0.00 H ATOM 799 HB3 MET A 256 21.196 30.063 -2.620 1.00 0.00 H ATOM 800 HG2 MET A 256 23.517 28.613 -1.332 1.00 0.00 H ATOM 801 HG3 MET A 256 22.889 30.221 -0.897 1.00 0.00 H ATOM 802 HE1 MET A 256 25.820 28.737 -2.285 1.00 0.00 H ATOM 803 HE2 MET A 256 24.798 28.073 -3.583 1.00 0.00 H ATOM 804 HE3 MET A 256 26.046 29.285 -3.964 1.00 0.00 H ATOM 805 H MET A 256 22.104 26.739 -1.515 1.00 0.00 H ATOM 806 N MET A 257 19.249 27.693 -3.104 1.00 62.31 N ATOM 807 CA MET A 257 17.976 27.545 -3.803 1.00 65.14 C ATOM 808 C MET A 257 16.886 27.046 -2.855 1.00 65.39 C ATOM 809 O MET A 257 15.705 27.335 -3.049 1.00 64.48 O ATOM 810 CB MET A 257 18.132 26.566 -4.971 1.00 67.52 C ATOM 811 CG MET A 257 19.027 27.070 -6.100 1.00 71.20 C ATOM 812 SD MET A 257 18.106 27.837 -7.458 1.00 74.11 S ATOM 813 CE MET A 257 17.854 26.403 -8.498 1.00 74.82 C ATOM 814 HA MET A 257 17.681 28.523 -4.184 1.00 0.00 H ATOM 815 HB2 MET A 257 18.558 25.640 -4.585 1.00 0.00 H ATOM 816 HB3 MET A 257 17.143 26.366 -5.383 1.00 0.00 H ATOM 817 HG2 MET A 257 19.591 26.226 -6.497 1.00 0.00 H ATOM 818 HG3 MET A 257 19.718 27.807 -5.691 1.00 0.00 H ATOM 819 HE1 MET A 257 18.821 25.993 -8.790 1.00 0.00 H ATOM 820 HE2 MET A 257 17.291 25.650 -7.946 1.00 0.00 H ATOM 821 HE3 MET A 257 17.297 26.695 -9.389 1.00 0.00 H ATOM 822 H MET A 257 20.104 27.269 -3.517 1.00 0.00 H ATOM 823 N GLY A 258 17.301 26.301 -1.830 1.00 65.81 N ATOM 824 CA GLY A 258 16.375 25.761 -0.848 1.00 66.05 C ATOM 825 C GLY A 258 15.403 26.747 -0.216 1.00 66.59 C ATOM 826 O GLY A 258 14.203 26.482 -0.167 1.00 65.29 O ATOM 827 HA3 GLY A 258 16.964 25.317 -0.046 1.00 0.00 H ATOM 828 HA2 GLY A 258 15.788 24.985 -1.338 1.00 0.00 H ATOM 829 H GLY A 258 18.317 26.100 -1.730 1.00 0.00 H ATOM 830 N GLU A 259 15.900 27.883 0.271 1.00 68.24 N ATOM 831 CA GLU A 259 15.014 28.864 0.893 1.00 70.21 C ATOM 832 C GLU A 259 14.138 29.538 -0.159 1.00 71.14 C ATOM 833 O GLU A 259 13.388 30.459 0.151 1.00 71.98 O ATOM 834 CB GLU A 259 15.816 29.929 1.653 1.00 70.51 C ATOM 835 CG GLU A 259 15.008 30.642 2.755 1.00 71.75 C ATOM 836 CD GLU A 259 15.717 31.859 3.352 1.00 71.78 C ATOM 837 OE1 GLU A 259 15.730 32.927 2.701 1.00 71.89 O ATOM 838 OE2 GLU A 259 16.262 31.751 4.472 1.00 71.15 O ATOM 839 HA GLU A 259 14.379 28.333 1.602 1.00 0.00 H ATOM 840 HB2 GLU A 259 16.678 29.447 2.115 1.00 0.00 H ATOM 841 HB3 GLU A 259 16.159 30.677 0.938 1.00 0.00 H ATOM 842 HG2 GLU A 259 14.061 30.971 2.328 1.00 0.00 H ATOM 843 HG3 GLU A 259 14.816 29.929 3.556 1.00 0.00 H ATOM 844 H GLU A 259 16.921 28.072 0.208 1.00 0.00 H ATOM 845 N ASP A 260 14.228 29.068 -1.400 1.00 72.21 N ATOM 846 CA ASP A 260 13.439 29.630 -2.492 1.00 73.17 C ATOM 847 C ASP A 260 12.282 28.706 -2.869 1.00 74.06 C ATOM 848 O ASP A 260 11.255 29.158 -3.375 1.00 74.10 O ATOM 849 CB ASP A 260 14.333 29.872 -3.713 1.00 72.93 C ATOM 850 CG ASP A 260 13.598 30.554 -4.852 1.00 72.81 C ATOM 851 OD1 ASP A 260 12.650 29.953 -5.400 1.00 72.72 O ATOM 852 OD2 ASP A 260 13.970 31.694 -5.200 1.00 72.72 O ATOM 853 HA ASP A 260 13.021 30.579 -2.155 1.00 0.00 H ATOM 854 HB2 ASP A 260 15.171 30.501 -3.413 1.00 0.00 H ATOM 855 HB3 ASP A 260 14.709 28.912 -4.066 1.00 0.00 H ATOM 856 H ASP A 260 14.877 28.280 -1.597 1.00 0.00 H ATOM 857 N LYS A 261 12.456 27.413 -2.617 1.00 75.22 N ATOM 858 CA LYS A 261 11.427 26.421 -2.927 1.00 76.57 C ATOM 859 C LYS A 261 10.666 26.021 -1.662 1.00 77.14 C ATOM 860 O LYS A 261 9.469 25.726 -1.705 1.00 77.23 O ATOM 861 CB LYS A 261 12.069 25.184 -3.572 1.00 76.44 C ATOM 862 CG LYS A 261 11.089 24.078 -3.979 1.00 77.78 C ATOM 863 CD LYS A 261 10.657 23.215 -2.795 1.00 78.27 C ATOM 864 CE LYS A 261 9.652 22.149 -3.218 1.00 78.34 C ATOM 865 NZ LYS A 261 9.235 21.281 -2.076 1.00 77.33 N ATOM 866 HA LYS A 261 10.719 26.862 -3.629 1.00 0.00 H ATOM 867 HB2 LYS A 261 12.603 25.508 -4.466 1.00 0.00 H ATOM 868 HB3 LYS A 261 12.778 24.762 -2.860 1.00 0.00 H ATOM 869 HG2 LYS A 261 10.204 24.539 -4.418 1.00 0.00 H ATOM 870 HG3 LYS A 261 11.570 23.440 -4.720 1.00 0.00 H ATOM 871 HD2 LYS A 261 11.535 22.727 -2.373 1.00 0.00 H ATOM 872 HD3 LYS A 261 10.200 23.853 -2.039 1.00 0.00 H ATOM 873 HE2 LYS A 261 10.106 21.524 -3.987 1.00 0.00 H ATOM 874 HE3 LYS A 261 8.769 22.641 -3.626 1.00 0.00 H ATOM 875 HZ1 LYS A 261 10.070 20.801 -1.684 1.00 0.00 H ATOM 876 HZ2 LYS A 261 8.793 21.868 -1.339 1.00 0.00 H ATOM 877 HZ3 LYS A 261 8.552 20.572 -2.412 1.00 0.00 H ATOM 878 H LYS A 261 13.349 27.098 -2.187 1.00 0.00 H ATOM 879 N ILE A 262 11.372 26.015 -0.537 1.00 77.27 N ATOM 880 CA ILE A 262 10.780 25.648 0.740 1.00 77.38 C ATOM 881 C ILE A 262 10.651 26.906 1.593 1.00 78.26 C ATOM 882 O ILE A 262 10.268 27.968 1.101 1.00 78.95 O ATOM 883 CB ILE A 262 11.671 24.631 1.489 1.00 76.06 C ATOM 884 CG1 ILE A 262 12.236 23.609 0.503 1.00 74.58 C ATOM 885 CG2 ILE A 262 10.859 23.911 2.554 1.00 77.19 C ATOM 886 CD1 ILE A 262 13.287 22.711 1.101 1.00 72.86 C ATOM 887 HA ILE A 262 9.806 25.194 0.560 1.00 0.00 H ATOM 888 HB ILE A 262 12.492 25.168 1.965 1.00 0.00 H ATOM 889 HG12 ILE A 262 11.416 22.988 0.143 1.00 0.00 H ATOM 890 HG13 ILE A 262 12.678 24.147 -0.335 1.00 0.00 H ATOM 891 HD11 ILE A 262 14.121 23.316 1.457 1.00 0.00 H ATOM 892 HD12 ILE A 262 12.857 22.156 1.935 1.00 0.00 H ATOM 893 HD13 ILE A 262 13.641 22.013 0.342 1.00 0.00 H ATOM 894 HG21 ILE A 262 10.469 24.639 3.266 1.00 0.00 H ATOM 895 HG22 ILE A 262 10.031 23.383 2.082 1.00 0.00 H ATOM 896 HG23 ILE A 262 11.497 23.197 3.075 1.00 0.00 H ATOM 897 H ILE A 262 12.377 26.280 -0.570 1.00 0.00 H ATOM 898 N LYS A 263 10.977 26.779 2.872 1.00 79.03 N ATOM 899 CA LYS A 263 10.920 27.899 3.797 1.00 80.25 C ATOM 900 C LYS A 263 11.876 27.652 4.955 1.00 80.68 C ATOM 901 O LYS A 263 11.696 26.718 5.738 1.00 81.55 O ATOM 902 CB LYS A 263 9.503 28.084 4.337 1.00 81.05 C ATOM 903 CG LYS A 263 9.391 29.216 5.345 1.00 81.70 C ATOM 904 CD LYS A 263 7.986 29.330 5.909 1.00 82.63 C ATOM 905 CE LYS A 263 7.931 30.379 7.003 1.00 82.26 C ATOM 906 NZ LYS A 263 8.902 30.060 8.083 1.00 81.80 N ATOM 907 HA LYS A 263 11.210 28.804 3.264 1.00 0.00 H ATOM 908 HB2 LYS A 263 8.838 28.297 3.500 1.00 0.00 H ATOM 909 HB3 LYS A 263 9.192 27.158 4.820 1.00 0.00 H ATOM 910 HG2 LYS A 263 10.086 29.030 6.164 1.00 0.00 H ATOM 911 HG3 LYS A 263 9.652 30.154 4.854 1.00 0.00 H ATOM 912 HD2 LYS A 263 7.301 29.610 5.109 1.00 0.00 H ATOM 913 HD3 LYS A 263 7.686 28.367 6.321 1.00 0.00 H ATOM 914 HE2 LYS A 263 6.925 30.408 7.422 1.00 0.00 H ATOM 915 HE3 LYS A 263 8.174 31.353 6.578 1.00 0.00 H ATOM 916 HZ1 LYS A 263 8.671 29.133 8.493 1.00 0.00 H ATOM 917 HZ2 LYS A 263 9.863 30.035 7.687 1.00 0.00 H ATOM 918 HZ3 LYS A 263 8.849 30.790 8.822 1.00 0.00 H ATOM 919 H LYS A 263 11.283 25.850 3.224 1.00 0.00 H ATOM 920 N PHE A 264 12.897 28.493 5.056 1.00 80.55 N ATOM 921 CA PHE A 264 13.880 28.364 6.119 1.00 80.42 C ATOM 922 C PHE A 264 14.156 29.711 6.766 1.00 80.63 C ATOM 923 O PHE A 264 14.647 30.632 6.116 1.00 80.66 O ATOM 924 CB PHE A 264 15.185 27.785 5.566 1.00 79.86 C ATOM 925 CG PHE A 264 15.056 26.381 5.050 1.00 79.33 C ATOM 926 CD1 PHE A 264 14.678 25.347 5.900 1.00 79.10 C ATOM 927 CD2 PHE A 264 15.317 26.090 3.715 1.00 79.10 C ATOM 928 CE1 PHE A 264 14.562 24.044 5.428 1.00 78.92 C ATOM 929 CE2 PHE A 264 15.205 24.789 3.233 1.00 78.92 C ATOM 930 CZ PHE A 264 14.826 23.764 4.092 1.00 78.87 C ATOM 931 HA PHE A 264 13.475 27.689 6.873 1.00 0.00 H ATOM 932 HB2 PHE A 264 15.524 28.422 4.749 1.00 0.00 H ATOM 933 HB3 PHE A 264 15.929 27.791 6.363 1.00 0.00 H ATOM 934 HD2 PHE A 264 15.613 26.891 3.038 1.00 0.00 H ATOM 935 HE2 PHE A 264 15.414 24.575 2.185 1.00 0.00 H ATOM 936 HZ PHE A 264 14.736 22.744 3.719 1.00 0.00 H ATOM 937 HE1 PHE A 264 14.264 23.243 6.105 1.00 0.00 H ATOM 938 HD1 PHE A 264 14.470 25.560 6.949 1.00 0.00 H ATOM 939 H PHE A 264 12.996 29.260 4.361 1.00 0.00 H ATOM 940 N LYS A 265 13.826 29.823 8.048 1.00 81.27 N ATOM 941 CA LYS A 265 14.060 31.055 8.783 1.00 80.85 C ATOM 942 C LYS A 265 15.560 31.193 9.012 1.00 80.62 C ATOM 943 O LYS A 265 16.045 31.017 10.129 1.00 81.86 O ATOM 944 CB LYS A 265 13.329 31.019 10.128 1.00 80.54 C ATOM 945 CG LYS A 265 11.816 30.925 10.010 1.00 80.17 C ATOM 946 CD LYS A 265 11.153 30.937 11.378 1.00 79.72 C ATOM 947 CE LYS A 265 9.642 30.955 11.250 1.00 79.32 C ATOM 948 NZ LYS A 265 9.191 32.108 10.424 1.00 79.91 N ATOM 949 HA LYS A 265 13.683 31.905 8.214 1.00 0.00 H ATOM 950 HB2 LYS A 265 13.683 30.153 10.687 1.00 0.00 H ATOM 951 HB3 LYS A 265 13.574 31.929 10.676 1.00 0.00 H ATOM 952 HG2 LYS A 265 11.451 31.773 9.431 1.00 0.00 H ATOM 953 HG3 LYS A 265 11.556 29.999 9.498 1.00 0.00 H ATOM 954 HD2 LYS A 265 11.454 30.045 11.928 1.00 0.00 H ATOM 955 HD3 LYS A 265 11.475 31.824 11.923 1.00 0.00 H ATOM 956 HE2 LYS A 265 9.201 31.033 12.244 1.00 0.00 H ATOM 957 HE3 LYS A 265 9.313 30.029 10.780 1.00 0.00 H ATOM 958 HZ1 LYS A 265 9.499 32.995 10.871 1.00 0.00 H ATOM 959 HZ2 LYS A 265 9.606 32.035 9.473 1.00 0.00 H ATOM 960 HZ3 LYS A 265 8.154 32.097 10.352 1.00 0.00 H ATOM 961 H LYS A 265 13.392 29.013 8.535 1.00 0.00 H ATOM 962 N HIS A 266 16.289 31.496 7.943 1.00 79.93 N ATOM 963 CA HIS A 266 17.737 31.659 8.008 1.00 79.09 C ATOM 964 C HIS A 266 18.209 32.599 6.902 1.00 78.85 C ATOM 965 O HIS A 266 17.580 33.624 6.637 1.00 78.74 O ATOM 966 CB HIS A 266 18.432 30.301 7.859 1.00 78.62 C ATOM 967 CG HIS A 266 18.119 29.335 8.960 1.00 78.10 C ATOM 968 ND1 HIS A 266 18.385 29.606 10.285 1.00 77.89 N ATOM 969 CD2 HIS A 266 17.564 28.101 8.932 1.00 77.89 C ATOM 970 CE1 HIS A 266 18.006 28.580 11.026 1.00 77.75 C ATOM 971 NE2 HIS A 266 17.505 27.653 10.230 1.00 77.75 N ATOM 972 HA HIS A 266 17.994 32.086 8.977 1.00 0.00 H ATOM 973 HB2 HIS A 266 18.120 29.857 6.914 1.00 0.00 H ATOM 974 HB3 HIS A 266 19.509 30.466 7.843 1.00 0.00 H ATOM 975 HD2 HIS A 266 17.227 27.563 8.046 1.00 0.00 H ATOM 976 HE1 HIS A 266 18.092 28.510 12.110 1.00 0.00 H ATOM 977 H HIS A 266 15.810 31.621 7.028 1.00 0.00 H ATOM 978 N ILE A 267 19.318 32.245 6.258 1.00 78.64 N ATOM 979 CA ILE A 267 19.872 33.055 5.179 1.00 78.50 C ATOM 980 C ILE A 267 20.021 32.217 3.912 1.00 78.42 C ATOM 981 O ILE A 267 20.587 31.124 3.945 1.00 78.39 O ATOM 982 CB ILE A 267 21.260 33.617 5.556 1.00 78.52 C ATOM 983 CG1 ILE A 267 21.188 34.338 6.903 1.00 78.59 C ATOM 984 CG2 ILE A 267 21.742 34.574 4.475 1.00 78.35 C ATOM 985 CD1 ILE A 267 22.529 34.837 7.401 1.00 79.30 C ATOM 986 HA ILE A 267 19.183 33.882 5.007 1.00 0.00 H ATOM 987 HB ILE A 267 21.966 32.791 5.639 1.00 0.00 H ATOM 988 HG12 ILE A 267 20.519 35.193 6.801 1.00 0.00 H ATOM 989 HG13 ILE A 267 20.782 33.647 7.642 1.00 0.00 H ATOM 990 HD11 ILE A 267 23.208 33.993 7.521 1.00 0.00 H ATOM 991 HD12 ILE A 267 22.945 35.539 6.679 1.00 0.00 H ATOM 992 HD13 ILE A 267 22.396 35.337 8.361 1.00 0.00 H ATOM 993 HG21 ILE A 267 21.814 34.042 3.526 1.00 0.00 H ATOM 994 HG22 ILE A 267 21.034 35.397 4.378 1.00 0.00 H ATOM 995 HG23 ILE A 267 22.722 34.966 4.749 1.00 0.00 H ATOM 996 H ILE A 267 19.803 31.367 6.531 1.00 0.00 H ATOM 997 N THR A 268 19.511 32.733 2.798 1.00 78.58 N ATOM 998 CA THR A 268 19.595 32.034 1.519 1.00 78.20 C ATOM 999 C THR A 268 20.971 32.204 0.878 1.00 77.87 C ATOM 1000 O THR A 268 21.642 31.218 0.565 1.00 78.32 O ATOM 1001 CB THR A 268 18.537 32.553 0.515 1.00 78.78 C ATOM 1002 OG1 THR A 268 17.224 32.301 1.024 1.00 78.90 O ATOM 1003 CG2 THR A 268 18.698 31.872 -0.840 1.00 78.31 C ATOM 1004 HA THR A 268 19.413 30.982 1.737 1.00 0.00 H ATOM 1005 HB THR A 268 18.681 33.626 0.385 1.00 0.00 H ATOM 1006 HG1 THR A 268 17.112 32.768 1.890 1.00 0.00 H ATOM 1007 HG23 THR A 268 19.699 32.065 -1.226 1.00 0.00 H ATOM 1008 HG21 THR A 268 18.553 30.798 -0.725 1.00 0.00 H ATOM 1009 HG22 THR A 268 17.957 32.268 -1.534 1.00 0.00 H ATOM 1010 H THR A 268 19.040 33.659 2.839 1.00 0.00 H ATOM 1011 N PRO A 269 21.408 33.464 0.680 1.00 77.16 N ATOM 1012 CA PRO A 269 22.702 33.798 0.072 1.00 76.40 C ATOM 1013 C PRO A 269 23.933 33.356 0.865 1.00 74.87 C ATOM 1014 O PRO A 269 23.929 32.294 1.483 1.00 76.16 O ATOM 1015 CB PRO A 269 22.615 35.311 -0.085 1.00 76.50 C ATOM 1016 CG PRO A 269 21.817 35.708 1.108 1.00 76.81 C ATOM 1017 CD PRO A 269 20.708 34.694 1.097 1.00 76.95 C ATOM 1018 HA PRO A 269 22.853 33.260 -0.864 1.00 0.00 H ATOM 1019 HD3 PRO A 269 20.267 34.581 2.087 1.00 0.00 H ATOM 1020 HD2 PRO A 269 19.931 34.967 0.383 1.00 0.00 H ATOM 1021 HG3 PRO A 269 21.428 36.721 1.005 1.00 0.00 H ATOM 1022 HG2 PRO A 269 22.408 35.638 2.021 1.00 0.00 H ATOM 1023 HB2 PRO A 269 23.605 35.768 -0.068 1.00 0.00 H ATOM 1024 HB3 PRO A 269 22.106 35.584 -1.009 1.00 0.00 H ATOM 1025 N LEU A 270 24.985 34.169 0.840 1.00 73.15 N ATOM 1026 CA LEU A 270 26.217 33.845 1.553 1.00 71.06 C ATOM 1027 C LEU A 270 25.954 33.664 3.046 1.00 69.84 C ATOM 1028 O LEU A 270 25.021 34.249 3.596 1.00 69.66 O ATOM 1029 CB LEU A 270 27.259 34.947 1.318 1.00 70.81 C ATOM 1030 CG LEU A 270 28.661 34.827 1.928 1.00 70.47 C ATOM 1031 CD1 LEU A 270 28.628 35.190 3.402 1.00 70.31 C ATOM 1032 CD2 LEU A 270 29.196 33.419 1.713 1.00 70.31 C ATOM 1033 HA LEU A 270 26.604 32.902 1.167 1.00 0.00 H ATOM 1034 HB2 LEU A 270 27.392 35.028 0.239 1.00 0.00 H ATOM 1035 HB3 LEU A 270 26.829 35.873 1.700 1.00 0.00 H ATOM 1036 HG LEU A 270 29.333 35.527 1.431 1.00 0.00 H ATOM 1037 HD21 LEU A 270 28.530 32.702 2.193 1.00 0.00 H ATOM 1038 HD22 LEU A 270 29.248 33.211 0.644 1.00 0.00 H ATOM 1039 HD23 LEU A 270 30.192 33.340 2.148 1.00 0.00 H ATOM 1040 HD11 LEU A 270 28.277 36.216 3.514 1.00 0.00 H ATOM 1041 HD12 LEU A 270 27.952 34.514 3.926 1.00 0.00 H ATOM 1042 HD13 LEU A 270 29.631 35.100 3.820 1.00 0.00 H ATOM 1043 H LEU A 270 24.929 35.056 0.300 1.00 0.00 H ATOM 1044 N GLN A 271 26.780 32.848 3.695 1.00 68.39 N ATOM 1045 CA GLN A 271 26.626 32.575 5.120 1.00 66.99 C ATOM 1046 C GLN A 271 27.917 32.702 5.926 1.00 66.31 C ATOM 1047 O GLN A 271 27.895 32.629 7.154 1.00 66.16 O ATOM 1048 CB GLN A 271 26.028 31.176 5.311 1.00 66.56 C ATOM 1049 CG GLN A 271 26.603 30.111 4.380 1.00 65.91 C ATOM 1050 CD GLN A 271 28.016 29.689 4.741 1.00 65.59 C ATOM 1051 OE1 GLN A 271 28.694 29.024 3.957 1.00 65.39 O ATOM 1052 NE2 GLN A 271 28.463 30.061 5.934 1.00 65.39 N ATOM 1053 HA GLN A 271 25.956 33.342 5.508 1.00 0.00 H ATOM 1054 HB2 GLN A 271 26.211 30.865 6.339 1.00 0.00 H ATOM 1055 HB3 GLN A 271 24.954 31.238 5.137 1.00 0.00 H ATOM 1056 HG2 GLN A 271 25.959 29.232 4.421 1.00 0.00 H ATOM 1057 HG3 GLN A 271 26.610 30.507 3.365 1.00 0.00 H ATOM 1058 HE22 GLN A 271 27.856 30.623 6.565 1.00 0.00 H ATOM 1059 HE21 GLN A 271 29.420 29.791 6.238 1.00 0.00 H ATOM 1060 H GLN A 271 27.556 32.393 3.173 1.00 0.00 H ATOM 1061 N GLU A 272 29.038 32.889 5.238 1.00 65.56 N ATOM 1062 CA GLU A 272 30.329 33.022 5.906 1.00 64.89 C ATOM 1063 C GLU A 272 30.324 34.105 6.983 1.00 64.77 C ATOM 1064 O GLU A 272 30.231 33.806 8.174 1.00 64.66 O ATOM 1065 CB GLU A 272 31.427 33.321 4.882 1.00 64.44 C ATOM 1066 CG GLU A 272 31.772 32.147 3.981 1.00 63.81 C ATOM 1067 CD GLU A 272 32.349 30.974 4.751 1.00 63.50 C ATOM 1068 OE1 GLU A 272 33.402 31.149 5.399 1.00 63.30 O ATOM 1069 OE2 GLU A 272 31.751 29.879 4.708 1.00 63.30 O ATOM 1070 HA GLU A 272 30.528 32.071 6.399 1.00 0.00 H ATOM 1071 HB2 GLU A 272 31.094 34.148 4.255 1.00 0.00 H ATOM 1072 HB3 GLU A 272 32.327 33.615 5.421 1.00 0.00 H ATOM 1073 HG2 GLU A 272 30.866 31.819 3.471 1.00 0.00 H ATOM 1074 HG3 GLU A 272 32.504 32.475 3.243 1.00 0.00 H ATOM 1075 H GLU A 272 28.995 32.942 4.200 1.00 0.00 H ATOM 1076 N GLN A 273 30.426 35.361 6.560 1.00 64.71 N ATOM 1077 CA GLN A 273 30.442 36.487 7.489 1.00 64.77 C ATOM 1078 C GLN A 273 29.064 36.788 8.071 1.00 65.13 C ATOM 1079 O GLN A 273 28.900 37.741 8.832 1.00 65.07 O ATOM 1080 CB GLN A 273 30.987 37.736 6.791 1.00 64.33 C ATOM 1081 CG GLN A 273 32.446 37.635 6.375 1.00 63.79 C ATOM 1082 CD GLN A 273 33.386 37.509 7.559 1.00 63.51 C ATOM 1083 OE1 GLN A 273 33.315 36.548 8.326 1.00 63.34 O ATOM 1084 NE2 GLN A 273 34.274 38.484 7.715 1.00 63.34 N ATOM 1085 HA GLN A 273 31.092 36.205 8.317 1.00 0.00 H ATOM 1086 HB2 GLN A 273 30.389 37.916 5.898 1.00 0.00 H ATOM 1087 HB3 GLN A 273 30.884 38.580 7.472 1.00 0.00 H ATOM 1088 HG2 GLN A 273 32.567 36.759 5.738 1.00 0.00 H ATOM 1089 HG3 GLN A 273 32.711 38.530 5.813 1.00 0.00 H ATOM 1090 HE22 GLN A 273 34.299 39.277 7.043 1.00 0.00 H ATOM 1091 HE21 GLN A 273 34.945 38.454 8.509 1.00 0.00 H ATOM 1092 H GLN A 273 30.496 35.547 5.539 1.00 0.00 H ATOM 1093 N SER A 274 28.078 35.974 7.710 1.00 65.66 N ATOM 1094 CA SER A 274 26.717 36.156 8.203 1.00 66.33 C ATOM 1095 C SER A 274 26.128 34.819 8.634 1.00 66.91 C ATOM 1096 O SER A 274 25.403 34.174 7.877 1.00 66.95 O ATOM 1097 CB SER A 274 25.841 36.786 7.118 1.00 66.17 C ATOM 1098 OG SER A 274 26.327 38.067 6.755 1.00 66.06 O ATOM 1099 HA SER A 274 26.747 36.823 9.065 1.00 0.00 H ATOM 1100 HB2 SER A 274 24.822 36.884 7.494 1.00 0.00 H ATOM 1101 HB3 SER A 274 25.842 36.141 6.239 1.00 0.00 H ATOM 1102 HG SER A 274 25.745 38.453 6.053 1.00 0.00 H ATOM 1103 H SER A 274 28.281 35.188 7.060 1.00 0.00 H ATOM 1104 N LYS A 275 26.446 34.418 9.861 1.00 67.93 N ATOM 1105 CA LYS A 275 25.978 33.157 10.428 1.00 68.20 C ATOM 1106 C LYS A 275 26.349 31.998 9.501 1.00 68.17 C ATOM 1107 O LYS A 275 25.796 31.852 8.408 1.00 68.98 O ATOM 1108 CB LYS A 275 24.464 33.205 10.657 1.00 68.38 C ATOM 1109 CG LYS A 275 24.022 32.481 11.921 1.00 69.38 C ATOM 1110 CD LYS A 275 22.547 32.694 12.210 1.00 69.47 C ATOM 1111 CE LYS A 275 22.159 32.105 13.559 1.00 69.74 C ATOM 1112 NZ LYS A 275 20.701 32.277 13.826 1.00 71.72 N ATOM 1113 HA LYS A 275 26.463 33.000 11.392 1.00 0.00 H ATOM 1114 HB2 LYS A 275 24.158 34.249 10.731 1.00 0.00 H ATOM 1115 HB3 LYS A 275 23.970 32.743 9.803 1.00 0.00 H ATOM 1116 HG2 LYS A 275 24.207 31.414 11.799 1.00 0.00 H ATOM 1117 HG3 LYS A 275 24.604 32.855 12.763 1.00 0.00 H ATOM 1118 HD2 LYS A 275 22.336 33.763 12.215 1.00 0.00 H ATOM 1119 HD3 LYS A 275 21.958 32.213 11.429 1.00 0.00 H ATOM 1120 HE2 LYS A 275 22.726 32.608 14.343 1.00 0.00 H ATOM 1121 HE3 LYS A 275 22.398 31.042 13.565 1.00 0.00 H ATOM 1122 HZ1 LYS A 275 20.467 33.290 13.827 1.00 0.00 H ATOM 1123 HZ2 LYS A 275 20.155 31.795 13.084 1.00 0.00 H ATOM 1124 HZ3 LYS A 275 20.469 31.865 14.752 1.00 0.00 H ATOM 1125 H LYS A 275 27.055 35.029 10.442 1.00 0.00 H ATOM 1126 N GLU A 276 27.296 31.178 9.950 1.00 67.24 N ATOM 1127 CA GLU A 276 27.778 30.036 9.176 1.00 65.89 C ATOM 1128 C GLU A 276 26.675 29.063 8.754 1.00 63.63 C ATOM 1129 O GLU A 276 25.599 29.026 9.351 1.00 62.94 O ATOM 1130 CB GLU A 276 28.822 29.274 9.984 1.00 67.40 C ATOM 1131 CG GLU A 276 29.662 28.318 9.164 1.00 70.17 C ATOM 1132 CD GLU A 276 30.293 27.243 10.019 1.00 71.77 C ATOM 1133 OE1 GLU A 276 31.244 26.581 9.550 1.00 72.35 O ATOM 1134 OE2 GLU A 276 29.824 27.055 11.163 1.00 72.72 O ATOM 1135 HA GLU A 276 28.204 30.449 8.262 1.00 0.00 H ATOM 1136 HB2 GLU A 276 29.487 29.998 10.453 1.00 0.00 H ATOM 1137 HB3 GLU A 276 28.307 28.702 10.756 1.00 0.00 H ATOM 1138 HG2 GLU A 276 29.027 27.845 8.415 1.00 0.00 H ATOM 1139 HG3 GLU A 276 30.452 28.881 8.666 1.00 0.00 H ATOM 1140 H GLU A 276 27.709 31.357 10.888 1.00 0.00 H ATOM 1141 N VAL A 277 26.965 28.273 7.725 1.00 61.05 N ATOM 1142 CA VAL A 277 26.025 27.289 7.205 1.00 59.34 C ATOM 1143 C VAL A 277 25.873 26.092 8.140 1.00 57.59 C ATOM 1144 O VAL A 277 24.761 25.644 8.401 1.00 57.09 O ATOM 1145 CB VAL A 277 26.472 26.766 5.823 1.00 59.99 C ATOM 1146 CG1 VAL A 277 27.891 26.230 5.900 1.00 59.25 C ATOM 1147 CG2 VAL A 277 25.531 25.670 5.359 1.00 60.64 C ATOM 1148 HA VAL A 277 25.067 27.802 7.120 1.00 0.00 H ATOM 1149 HB VAL A 277 26.445 27.588 5.108 1.00 0.00 H ATOM 1150 HG11 VAL A 277 28.563 27.028 6.215 1.00 0.00 H ATOM 1151 HG12 VAL A 277 27.931 25.414 6.621 1.00 0.00 H ATOM 1152 HG13 VAL A 277 28.194 25.864 4.919 1.00 0.00 H ATOM 1153 HG21 VAL A 277 25.547 24.851 6.078 1.00 0.00 H ATOM 1154 HG22 VAL A 277 24.519 26.069 5.284 1.00 0.00 H ATOM 1155 HG23 VAL A 277 25.853 25.306 4.383 1.00 0.00 H ATOM 1156 H VAL A 277 27.898 28.361 7.274 1.00 0.00 H ATOM 1157 N ALA A 278 26.993 25.571 8.631 1.00 55.83 N ATOM 1158 CA ALA A 278 26.967 24.428 9.534 1.00 54.85 C ATOM 1159 C ALA A 278 26.153 24.798 10.759 1.00 53.55 C ATOM 1160 O ALA A 278 25.169 24.144 11.090 1.00 53.33 O ATOM 1161 CB ALA A 278 28.381 24.045 9.942 1.00 53.94 C ATOM 1162 HA ALA A 278 26.515 23.573 9.032 1.00 0.00 H ATOM 1163 HB1 ALA A 278 28.956 23.784 9.054 1.00 0.00 H ATOM 1164 HB2 ALA A 278 28.853 24.888 10.447 1.00 0.00 H ATOM 1165 HB3 ALA A 278 28.344 23.190 10.617 1.00 0.00 H ATOM 1166 H ALA A 278 27.908 25.988 8.365 1.00 0.00 H ATOM 1167 N ILE A 279 26.569 25.868 11.421 1.00 53.32 N ATOM 1168 CA ILE A 279 25.887 26.342 12.612 1.00 52.48 C ATOM 1169 C ILE A 279 24.433 26.678 12.306 1.00 49.98 C ATOM 1170 O ILE A 279 23.558 26.477 13.142 1.00 49.13 O ATOM 1171 CB ILE A 279 26.626 27.568 13.199 1.00 54.07 C ATOM 1172 CG1 ILE A 279 28.022 27.130 13.661 1.00 54.85 C ATOM 1173 CG2 ILE A 279 25.842 28.163 14.363 1.00 53.94 C ATOM 1174 CD1 ILE A 279 28.891 28.256 14.184 1.00 56.72 C ATOM 1175 HA ILE A 279 25.895 25.546 13.356 1.00 0.00 H ATOM 1176 HB ILE A 279 26.718 28.337 12.432 1.00 0.00 H ATOM 1177 HG12 ILE A 279 27.903 26.394 14.456 1.00 0.00 H ATOM 1178 HG13 ILE A 279 28.533 26.670 12.815 1.00 0.00 H ATOM 1179 HD11 ILE A 279 29.034 28.998 13.398 1.00 0.00 H ATOM 1180 HD12 ILE A 279 28.404 28.721 15.041 1.00 0.00 H ATOM 1181 HD13 ILE A 279 29.858 27.856 14.488 1.00 0.00 H ATOM 1182 HG21 ILE A 279 24.858 28.478 14.014 1.00 0.00 H ATOM 1183 HG22 ILE A 279 25.728 27.412 15.145 1.00 0.00 H ATOM 1184 HG23 ILE A 279 26.380 29.024 14.760 1.00 0.00 H ATOM 1185 H ILE A 279 27.406 26.382 11.078 1.00 0.00 H ATOM 1186 N ARG A 280 24.176 27.166 11.100 1.00 49.08 N ATOM 1187 CA ARG A 280 22.818 27.509 10.687 1.00 49.89 C ATOM 1188 C ARG A 280 21.953 26.246 10.595 1.00 48.94 C ATOM 1189 O ARG A 280 20.818 26.218 11.074 1.00 48.53 O ATOM 1190 CB ARG A 280 22.855 28.214 9.330 1.00 53.47 C ATOM 1191 CG ARG A 280 21.518 28.752 8.850 1.00 58.80 C ATOM 1192 CD ARG A 280 21.721 29.731 7.697 1.00 62.75 C ATOM 1193 NE ARG A 280 22.361 29.102 6.544 1.00 66.73 N ATOM 1194 CZ ARG A 280 22.905 29.772 5.532 1.00 67.94 C ATOM 1195 NH1 ARG A 280 22.890 31.098 5.530 1.00 69.11 N ATOM 1196 NH2 ARG A 280 23.471 29.117 4.526 1.00 68.12 N ATOM 1197 HA ARG A 280 22.382 28.177 11.430 1.00 0.00 H ATOM 1198 HB2 ARG A 280 23.550 29.050 9.402 1.00 0.00 H ATOM 1199 HB3 ARG A 280 23.219 27.503 8.589 1.00 0.00 H ATOM 1200 HG2 ARG A 280 20.897 27.922 8.512 1.00 0.00 H ATOM 1201 HG3 ARG A 280 21.020 29.265 9.673 1.00 0.00 H ATOM 1202 HD2 ARG A 280 22.348 30.554 8.041 1.00 0.00 H ATOM 1203 HD3 ARG A 280 20.750 30.119 7.391 1.00 0.00 H ATOM 1204 HE ARG A 280 22.393 28.063 6.513 1.00 0.00 H ATOM 1205 HH12 ARG A 280 23.315 31.622 4.739 1.00 0.00 H ATOM 1206 HH11 ARG A 280 22.453 31.614 6.320 1.00 0.00 H ATOM 1207 HH22 ARG A 280 23.896 29.644 3.736 1.00 0.00 H ATOM 1208 HH21 ARG A 280 23.490 28.077 4.528 1.00 0.00 H ATOM 1209 H ARG A 280 24.961 27.308 10.432 1.00 0.00 H ATOM 1210 N ILE A 281 22.495 25.199 9.984 1.00 46.26 N ATOM 1211 CA ILE A 281 21.764 23.949 9.851 1.00 45.24 C ATOM 1212 C ILE A 281 21.574 23.338 11.237 1.00 44.43 C ATOM 1213 O ILE A 281 20.535 22.754 11.532 1.00 42.13 O ATOM 1214 CB ILE A 281 22.519 22.968 8.939 1.00 43.77 C ATOM 1215 CG1 ILE A 281 22.665 23.584 7.547 1.00 44.33 C ATOM 1216 CG2 ILE A 281 21.768 21.652 8.851 1.00 43.27 C ATOM 1217 CD1 ILE A 281 23.482 22.757 6.593 1.00 42.45 C ATOM 1218 HA ILE A 281 20.793 24.149 9.397 1.00 0.00 H ATOM 1219 HB ILE A 281 23.508 22.775 9.356 1.00 0.00 H ATOM 1220 HG12 ILE A 281 21.669 23.713 7.123 1.00 0.00 H ATOM 1221 HG13 ILE A 281 23.143 24.558 7.652 1.00 0.00 H ATOM 1222 HD11 ILE A 281 24.487 22.628 6.995 1.00 0.00 H ATOM 1223 HD12 ILE A 281 23.012 21.782 6.466 1.00 0.00 H ATOM 1224 HD13 ILE A 281 23.537 23.264 5.630 1.00 0.00 H ATOM 1225 HG21 ILE A 281 21.679 21.218 9.847 1.00 0.00 H ATOM 1226 HG22 ILE A 281 20.774 21.829 8.441 1.00 0.00 H ATOM 1227 HG23 ILE A 281 22.313 20.967 8.202 1.00 0.00 H ATOM 1228 H ILE A 281 23.457 25.274 9.595 1.00 0.00 H ATOM 1229 N PHE A 282 22.580 23.488 12.090 1.00 45.23 N ATOM 1230 CA PHE A 282 22.499 22.963 13.449 1.00 48.00 C ATOM 1231 C PHE A 282 21.337 23.607 14.215 1.00 48.53 C ATOM 1232 O PHE A 282 20.620 22.935 14.952 1.00 48.52 O ATOM 1233 CB PHE A 282 23.805 23.230 14.198 1.00 49.15 C ATOM 1234 CG PHE A 282 23.797 22.741 15.616 1.00 50.61 C ATOM 1235 CD1 PHE A 282 24.122 21.424 15.910 1.00 50.68 C ATOM 1236 CD2 PHE A 282 23.433 23.592 16.658 1.00 50.63 C ATOM 1237 CE1 PHE A 282 24.086 20.956 17.221 1.00 51.57 C ATOM 1238 CE2 PHE A 282 23.392 23.134 17.967 1.00 50.88 C ATOM 1239 CZ PHE A 282 23.720 21.810 18.249 1.00 51.17 C ATOM 1240 HA PHE A 282 22.328 21.888 13.384 1.00 0.00 H ATOM 1241 HB2 PHE A 282 24.615 22.731 13.666 1.00 0.00 H ATOM 1242 HB3 PHE A 282 23.984 24.305 14.205 1.00 0.00 H ATOM 1243 HD2 PHE A 282 23.178 24.629 16.442 1.00 0.00 H ATOM 1244 HE2 PHE A 282 23.104 23.809 18.773 1.00 0.00 H ATOM 1245 HZ PHE A 282 23.689 21.446 19.276 1.00 0.00 H ATOM 1246 HE1 PHE A 282 24.345 19.920 17.438 1.00 0.00 H ATOM 1247 HD1 PHE A 282 24.409 20.748 15.105 1.00 0.00 H ATOM 1248 H PHE A 282 23.440 23.988 11.785 1.00 0.00 H ATOM 1249 N GLN A 283 21.157 24.912 14.034 1.00 50.02 N ATOM 1250 CA GLN A 283 20.092 25.643 14.710 1.00 51.90 C ATOM 1251 C GLN A 283 18.724 25.163 14.228 1.00 52.62 C ATOM 1252 O GLN A 283 17.760 25.134 14.995 1.00 53.12 O ATOM 1253 CB GLN A 283 20.234 27.145 14.441 1.00 55.12 C ATOM 1254 CG GLN A 283 20.017 28.027 15.660 1.00 58.89 C ATOM 1255 CD GLN A 283 21.139 27.893 16.673 1.00 62.65 C ATOM 1256 OE1 GLN A 283 21.378 26.811 17.217 1.00 66.16 O ATOM 1257 NE2 GLN A 283 21.840 28.990 16.925 1.00 62.68 N ATOM 1258 HA GLN A 283 20.173 25.458 15.781 1.00 0.00 H ATOM 1259 HB2 GLN A 283 21.239 27.330 14.061 1.00 0.00 H ATOM 1260 HB3 GLN A 283 19.503 27.426 13.683 1.00 0.00 H ATOM 1261 HG2 GLN A 283 19.959 29.066 15.336 1.00 0.00 H ATOM 1262 HG3 GLN A 283 19.078 27.743 16.136 1.00 0.00 H ATOM 1263 HE22 GLN A 283 21.603 29.881 16.443 1.00 0.00 H ATOM 1264 HE21 GLN A 283 22.627 28.960 17.605 1.00 0.00 H ATOM 1265 H GLN A 283 21.794 25.426 13.392 1.00 0.00 H ATOM 1266 N GLY A 284 18.639 24.807 12.950 1.00 51.98 N ATOM 1267 CA GLY A 284 17.384 24.317 12.409 1.00 51.72 C ATOM 1268 C GLY A 284 17.009 23.013 13.093 1.00 52.11 C ATOM 1269 O GLY A 284 15.903 22.869 13.615 1.00 50.69 O ATOM 1270 HA3 GLY A 284 17.492 24.147 11.338 1.00 0.00 H ATOM 1271 HA2 GLY A 284 16.601 25.056 12.581 1.00 0.00 H ATOM 1272 H GLY A 284 19.475 24.880 12.335 1.00 0.00 H ATOM 1273 N CYS A 285 17.935 22.059 13.093 1.00 52.69 N ATOM 1274 CA CYS A 285 17.694 20.778 13.743 1.00 55.58 C ATOM 1275 C CYS A 285 17.321 21.033 15.200 1.00 54.41 C ATOM 1276 O CYS A 285 16.472 20.350 15.767 1.00 53.38 O ATOM 1277 CB CYS A 285 18.946 19.905 13.672 1.00 57.52 C ATOM 1278 SG CYS A 285 19.483 19.567 11.981 1.00 65.35 S ATOM 1279 HA CYS A 285 16.882 20.257 13.236 1.00 0.00 H ATOM 1280 HB2 CYS A 285 18.735 18.956 14.165 1.00 0.00 H ATOM 1281 HB3 CYS A 285 19.754 20.414 14.197 1.00 0.00 H ATOM 1282 HG CYS A 285 19.767 20.758 11.344 1.00 0.00 H ATOM 1283 H CYS A 285 18.846 22.230 12.621 1.00 0.00 H ATOM 1284 N GLN A 286 17.961 22.036 15.791 1.00 54.56 N ATOM 1285 CA GLN A 286 17.709 22.408 17.177 1.00 55.52 C ATOM 1286 C GLN A 286 16.251 22.775 17.376 1.00 53.91 C ATOM 1287 O GLN A 286 15.578 22.213 18.236 1.00 53.50 O ATOM 1288 CB GLN A 286 18.605 23.591 17.576 1.00 58.93 C ATOM 1289 CG GLN A 286 18.436 24.054 19.013 1.00 63.29 C ATOM 1290 CD GLN A 286 19.523 25.023 19.447 1.00 66.77 C ATOM 1291 OE1 GLN A 286 19.600 26.157 18.966 1.00 68.61 O ATOM 1292 NE2 GLN A 286 20.378 24.573 20.357 1.00 66.50 N ATOM 1293 HA GLN A 286 17.941 21.552 17.811 1.00 0.00 H ATOM 1294 HB2 GLN A 286 19.644 23.294 17.434 1.00 0.00 H ATOM 1295 HB3 GLN A 286 18.375 24.429 16.919 1.00 0.00 H ATOM 1296 HG2 GLN A 286 17.469 24.548 19.109 1.00 0.00 H ATOM 1297 HG3 GLN A 286 18.464 23.182 19.667 1.00 0.00 H ATOM 1298 HE22 GLN A 286 20.275 23.610 20.735 1.00 0.00 H ATOM 1299 HE21 GLN A 286 21.150 25.184 20.692 1.00 0.00 H ATOM 1300 H GLN A 286 18.665 22.573 15.246 1.00 0.00 H ATOM 1301 N PHE A 287 15.769 23.719 16.575 1.00 53.33 N ATOM 1302 CA PHE A 287 14.385 24.164 16.665 1.00 52.34 C ATOM 1303 C PHE A 287 13.412 23.019 16.398 1.00 50.21 C ATOM 1304 O PHE A 287 12.372 22.910 17.051 1.00 48.07 O ATOM 1305 CB PHE A 287 14.133 25.307 15.677 1.00 54.58 C ATOM 1306 CG PHE A 287 12.692 25.709 15.577 1.00 58.99 C ATOM 1307 CD1 PHE A 287 11.906 25.278 14.509 1.00 60.07 C ATOM 1308 CD2 PHE A 287 12.103 26.486 16.574 1.00 60.77 C ATOM 1309 CE1 PHE A 287 10.554 25.616 14.437 1.00 61.32 C ATOM 1310 CE2 PHE A 287 10.752 26.828 16.514 1.00 61.28 C ATOM 1311 CZ PHE A 287 9.976 26.391 15.443 1.00 61.71 C ATOM 1312 HA PHE A 287 14.214 24.521 17.681 1.00 0.00 H ATOM 1313 HB2 PHE A 287 14.711 26.174 15.998 1.00 0.00 H ATOM 1314 HB3 PHE A 287 14.472 24.991 14.690 1.00 0.00 H ATOM 1315 HD2 PHE A 287 12.707 26.831 17.413 1.00 0.00 H ATOM 1316 HE2 PHE A 287 10.305 27.435 17.302 1.00 0.00 H ATOM 1317 HZ PHE A 287 8.919 26.654 15.391 1.00 0.00 H ATOM 1318 HE1 PHE A 287 9.950 25.275 13.596 1.00 0.00 H ATOM 1319 HD1 PHE A 287 12.352 24.670 13.722 1.00 0.00 H ATOM 1320 H PHE A 287 16.395 24.151 15.866 1.00 0.00 H ATOM 1321 N ARG A 288 13.745 22.172 15.428 1.00 49.23 N ATOM 1322 CA ARG A 288 12.892 21.036 15.106 1.00 48.64 C ATOM 1323 C ARG A 288 12.827 20.094 16.304 1.00 46.81 C ATOM 1324 O ARG A 288 11.765 19.556 16.630 1.00 45.49 O ATOM 1325 CB ARG A 288 13.427 20.287 13.885 1.00 50.57 C ATOM 1326 CG ARG A 288 12.580 19.092 13.500 1.00 54.18 C ATOM 1327 CD ARG A 288 11.146 19.516 13.246 1.00 57.07 C ATOM 1328 NE ARG A 288 10.273 18.390 12.919 1.00 59.52 N ATOM 1329 CZ ARG A 288 9.772 17.539 13.808 1.00 61.40 C ATOM 1330 NH1 ARG A 288 10.052 17.674 15.095 1.00 63.95 N ATOM 1331 NH2 ARG A 288 8.976 16.554 13.409 1.00 64.33 N ATOM 1332 HA ARG A 288 11.892 21.403 14.873 1.00 0.00 H ATOM 1333 HB2 ARG A 288 13.458 20.976 13.041 1.00 0.00 H ATOM 1334 HB3 ARG A 288 14.436 19.940 14.106 1.00 0.00 H ATOM 1335 HG2 ARG A 288 12.986 18.641 12.595 1.00 0.00 H ATOM 1336 HG3 ARG A 288 12.600 18.362 14.309 1.00 0.00 H ATOM 1337 HD2 ARG A 288 11.133 20.221 12.414 1.00 0.00 H ATOM 1338 HD3 ARG A 288 10.763 20.006 14.142 1.00 0.00 H ATOM 1339 HE ARG A 288 10.026 18.245 11.919 1.00 0.00 H ATOM 1340 HH12 ARG A 288 9.657 17.005 15.786 1.00 0.00 H ATOM 1341 HH11 ARG A 288 10.667 18.449 15.415 1.00 0.00 H ATOM 1342 HH22 ARG A 288 8.584 15.888 14.105 1.00 0.00 H ATOM 1343 HH21 ARG A 288 8.745 16.449 12.401 1.00 0.00 H ATOM 1344 H ARG A 288 14.624 22.323 14.893 1.00 0.00 H ATOM 1345 N SER A 289 13.966 19.906 16.966 1.00 44.98 N ATOM 1346 CA SER A 289 14.028 19.039 18.135 1.00 45.06 C ATOM 1347 C SER A 289 13.063 19.434 19.245 1.00 44.21 C ATOM 1348 O SER A 289 12.328 18.583 19.755 1.00 41.95 O ATOM 1349 CB SER A 289 15.444 19.003 18.710 1.00 46.22 C ATOM 1350 OG SER A 289 16.237 18.047 18.035 1.00 46.40 O ATOM 1351 HA SER A 289 13.731 18.053 17.776 1.00 0.00 H ATOM 1352 HB2 SER A 289 15.394 18.743 19.767 1.00 0.00 H ATOM 1353 HB3 SER A 289 15.900 19.987 18.600 1.00 0.00 H ATOM 1354 HG SER A 289 17.148 18.042 18.424 1.00 0.00 H ATOM 1355 H SER A 289 14.829 20.388 16.642 1.00 0.00 H ATOM 1356 N VAL A 290 13.063 20.707 19.638 1.00 43.33 N ATOM 1357 CA VAL A 290 12.165 21.109 20.709 1.00 45.59 C ATOM 1358 C VAL A 290 10.724 21.025 20.227 1.00 45.20 C ATOM 1359 O VAL A 290 9.803 20.936 21.032 1.00 45.46 O ATOM 1360 CB VAL A 290 12.495 22.542 21.285 1.00 47.32 C ATOM 1361 CG1 VAL A 290 13.805 23.055 20.712 1.00 45.87 C ATOM 1362 CG2 VAL A 290 11.341 23.511 21.040 1.00 42.66 C ATOM 1363 HA VAL A 290 12.310 20.416 21.538 1.00 0.00 H ATOM 1364 HB VAL A 290 12.618 22.464 22.365 1.00 0.00 H ATOM 1365 HG11 VAL A 290 14.610 22.370 20.980 1.00 0.00 H ATOM 1366 HG12 VAL A 290 13.726 23.118 19.627 1.00 0.00 H ATOM 1367 HG13 VAL A 290 14.016 24.043 21.120 1.00 0.00 H ATOM 1368 HG21 VAL A 290 11.162 23.598 19.968 1.00 0.00 H ATOM 1369 HG22 VAL A 290 10.443 23.136 21.530 1.00 0.00 H ATOM 1370 HG23 VAL A 290 11.597 24.489 21.447 1.00 0.00 H ATOM 1371 H VAL A 290 13.694 21.400 19.187 1.00 0.00 H ATOM 1372 N GLU A 291 10.529 21.045 18.912 1.00 46.71 N ATOM 1373 CA GLU A 291 9.182 20.914 18.367 1.00 48.57 C ATOM 1374 C GLU A 291 8.783 19.449 18.508 1.00 45.41 C ATOM 1375 O GLU A 291 7.646 19.132 18.845 1.00 44.86 O ATOM 1376 CB GLU A 291 9.133 21.325 16.892 1.00 51.89 C ATOM 1377 CG GLU A 291 8.913 22.814 16.661 1.00 56.46 C ATOM 1378 CD GLU A 291 8.741 23.153 15.189 1.00 59.38 C ATOM 1379 OE1 GLU A 291 9.657 22.840 14.397 1.00 59.88 O ATOM 1380 OE2 GLU A 291 7.693 23.734 14.824 1.00 61.00 O ATOM 1381 HA GLU A 291 8.498 21.569 18.907 1.00 0.00 H ATOM 1382 HB2 GLU A 291 10.078 21.044 16.428 1.00 0.00 H ATOM 1383 HB3 GLU A 291 8.319 20.781 16.413 1.00 0.00 H ATOM 1384 HG2 GLU A 291 8.017 23.123 17.199 1.00 0.00 H ATOM 1385 HG3 GLU A 291 9.774 23.359 17.048 1.00 0.00 H ATOM 1386 H GLU A 291 11.340 21.154 18.270 1.00 0.00 H ATOM 1387 N ALA A 292 9.740 18.563 18.249 1.00 43.37 N ATOM 1388 CA ALA A 292 9.516 17.126 18.359 1.00 39.19 C ATOM 1389 C ALA A 292 9.242 16.774 19.816 1.00 37.88 C ATOM 1390 O ALA A 292 8.426 15.900 20.107 1.00 36.79 O ATOM 1391 CB ALA A 292 10.730 16.367 17.857 1.00 38.65 C ATOM 1392 HA ALA A 292 8.658 16.844 17.749 1.00 0.00 H ATOM 1393 HB1 ALA A 292 10.910 16.622 16.813 1.00 0.00 H ATOM 1394 HB2 ALA A 292 11.600 16.640 18.454 1.00 0.00 H ATOM 1395 HB3 ALA A 292 10.549 15.296 17.945 1.00 0.00 H ATOM 1396 H ALA A 292 10.678 18.906 17.959 1.00 0.00 H ATOM 1397 N VAL A 293 9.927 17.455 20.732 1.00 38.36 N ATOM 1398 CA VAL A 293 9.734 17.207 22.158 1.00 38.00 C ATOM 1399 C VAL A 293 8.292 17.506 22.561 1.00 39.01 C ATOM 1400 O VAL A 293 7.721 16.817 23.408 1.00 39.25 O ATOM 1401 CB VAL A 293 10.683 18.074 23.027 1.00 37.79 C ATOM 1402 CG1 VAL A 293 10.314 17.938 24.495 1.00 40.00 C ATOM 1403 CG2 VAL A 293 12.117 17.628 22.838 1.00 37.26 C ATOM 1404 HA VAL A 293 9.962 16.155 22.332 1.00 0.00 H ATOM 1405 HB VAL A 293 10.580 19.114 22.717 1.00 0.00 H ATOM 1406 HG11 VAL A 293 9.287 18.272 24.643 1.00 0.00 H ATOM 1407 HG12 VAL A 293 10.405 16.894 24.796 1.00 0.00 H ATOM 1408 HG13 VAL A 293 10.986 18.551 25.096 1.00 0.00 H ATOM 1409 HG21 VAL A 293 12.214 16.584 23.136 1.00 0.00 H ATOM 1410 HG22 VAL A 293 12.394 17.735 21.789 1.00 0.00 H ATOM 1411 HG23 VAL A 293 12.772 18.245 23.453 1.00 0.00 H ATOM 1412 H VAL A 293 10.611 18.176 20.427 1.00 0.00 H ATOM 1413 N GLN A 294 7.698 18.524 21.943 1.00 39.72 N ATOM 1414 CA GLN A 294 6.325 18.899 22.258 1.00 39.64 C ATOM 1415 C GLN A 294 5.313 17.902 21.711 1.00 39.52 C ATOM 1416 O GLN A 294 4.314 17.597 22.372 1.00 40.52 O ATOM 1417 CB GLN A 294 6.014 20.288 21.715 1.00 41.53 C ATOM 1418 CG GLN A 294 4.589 20.731 22.009 1.00 48.51 C ATOM 1419 CD GLN A 294 4.246 20.666 23.493 1.00 51.81 C ATOM 1420 OE1 GLN A 294 4.926 21.275 24.324 1.00 53.67 O ATOM 1421 NE2 GLN A 294 3.185 19.929 23.831 1.00 49.85 N ATOM 1422 HA GLN A 294 6.240 18.900 23.345 1.00 0.00 H ATOM 1423 HB2 GLN A 294 6.701 21.002 22.169 1.00 0.00 H ATOM 1424 HB3 GLN A 294 6.161 20.281 20.635 1.00 0.00 H ATOM 1425 HG2 GLN A 294 4.466 21.759 21.667 1.00 0.00 H ATOM 1426 HG3 GLN A 294 3.903 20.083 21.464 1.00 0.00 H ATOM 1427 HE22 GLN A 294 2.641 19.433 23.096 1.00 0.00 H ATOM 1428 HE21 GLN A 294 2.902 19.851 24.829 1.00 0.00 H ATOM 1429 H GLN A 294 8.222 19.061 21.223 1.00 0.00 H ATOM 1430 N GLU A 295 5.562 17.409 20.500 1.00 36.48 N ATOM 1431 CA GLU A 295 4.683 16.433 19.873 1.00 36.04 C ATOM 1432 C GLU A 295 4.713 15.144 20.699 1.00 33.46 C ATOM 1433 O GLU A 295 3.671 14.595 21.058 1.00 31.86 O ATOM 1434 CB GLU A 295 5.152 16.159 18.437 1.00 39.23 C ATOM 1435 CG GLU A 295 5.504 17.428 17.672 1.00 43.58 C ATOM 1436 CD GLU A 295 5.874 17.170 16.226 1.00 45.53 C ATOM 1437 OE1 GLU A 295 6.615 16.199 15.961 1.00 48.26 O ATOM 1438 OE2 GLU A 295 5.436 17.950 15.352 1.00 46.19 O ATOM 1439 HA GLU A 295 3.664 16.817 19.835 1.00 0.00 H ATOM 1440 HB2 GLU A 295 6.035 15.521 18.476 1.00 0.00 H ATOM 1441 HB3 GLU A 295 4.354 15.642 17.904 1.00 0.00 H ATOM 1442 HG2 GLU A 295 4.644 18.097 17.696 1.00 0.00 H ATOM 1443 HG3 GLU A 295 6.349 17.907 18.166 1.00 0.00 H ATOM 1444 H GLU A 295 6.408 17.730 19.988 1.00 0.00 H ATOM 1445 N ILE A 296 5.920 14.675 21.002 1.00 32.87 N ATOM 1446 CA ILE A 296 6.103 13.469 21.805 1.00 31.28 C ATOM 1447 C ILE A 296 5.432 13.662 23.163 1.00 30.53 C ATOM 1448 O ILE A 296 4.773 12.753 23.667 1.00 32.21 O ATOM 1449 CB ILE A 296 7.610 13.176 22.019 1.00 31.80 C ATOM 1450 CG1 ILE A 296 8.247 12.778 20.685 1.00 32.22 C ATOM 1451 CG2 ILE A 296 7.804 12.088 23.096 1.00 32.84 C ATOM 1452 CD1 ILE A 296 9.774 12.901 20.658 1.00 31.21 C ATOM 1453 HA ILE A 296 5.654 12.627 21.278 1.00 0.00 H ATOM 1454 HB ILE A 296 8.109 14.075 22.380 1.00 0.00 H ATOM 1455 HG12 ILE A 296 7.983 11.741 20.475 1.00 0.00 H ATOM 1456 HG13 ILE A 296 7.838 13.420 19.905 1.00 0.00 H ATOM 1457 HD11 ILE A 296 10.057 13.935 20.853 1.00 0.00 H ATOM 1458 HD12 ILE A 296 10.203 12.255 21.424 1.00 0.00 H ATOM 1459 HD13 ILE A 296 10.144 12.600 19.678 1.00 0.00 H ATOM 1460 HG21 ILE A 296 7.373 12.429 24.037 1.00 0.00 H ATOM 1461 HG22 ILE A 296 7.307 11.171 22.778 1.00 0.00 H ATOM 1462 HG23 ILE A 296 8.869 11.898 23.231 1.00 0.00 H ATOM 1463 H ILE A 296 6.759 15.183 20.656 1.00 0.00 H ATOM 1464 N THR A 297 5.594 14.837 23.767 1.00 29.30 N ATOM 1465 CA THR A 297 4.968 15.066 25.068 1.00 31.40 C ATOM 1466 C THR A 297 3.448 14.979 24.916 1.00 32.81 C ATOM 1467 O THR A 297 2.758 14.373 25.745 1.00 32.10 O ATOM 1468 CB THR A 297 5.358 16.435 25.659 1.00 32.00 C ATOM 1469 OG1 THR A 297 6.779 16.497 25.829 1.00 31.87 O ATOM 1470 CG2 THR A 297 4.706 16.633 27.010 1.00 32.35 C ATOM 1471 HA THR A 297 5.323 14.299 25.757 1.00 0.00 H ATOM 1472 HB THR A 297 5.022 17.214 24.974 1.00 0.00 H ATOM 1473 HG1 THR A 297 7.221 16.379 24.951 1.00 0.00 H ATOM 1474 HG23 THR A 297 3.623 16.589 26.899 1.00 0.00 H ATOM 1475 HG21 THR A 297 5.035 15.847 27.690 1.00 0.00 H ATOM 1476 HG22 THR A 297 4.992 17.605 27.411 1.00 0.00 H ATOM 1477 H THR A 297 6.160 15.585 23.318 1.00 0.00 H ATOM 1478 N GLU A 298 2.928 15.572 23.846 1.00 32.58 N ATOM 1479 CA GLU A 298 1.492 15.526 23.591 1.00 33.65 C ATOM 1480 C GLU A 298 1.087 14.043 23.432 1.00 31.12 C ATOM 1481 O GLU A 298 0.080 13.606 23.967 1.00 28.30 O ATOM 1482 CB GLU A 298 1.154 16.323 22.319 1.00 35.36 C ATOM 1483 CG GLU A 298 -0.333 16.352 21.983 1.00 41.80 C ATOM 1484 CD GLU A 298 -0.617 16.857 20.570 1.00 46.02 C ATOM 1485 OE1 GLU A 298 -0.378 18.053 20.298 1.00 48.64 O ATOM 1486 OE2 GLU A 298 -1.076 16.052 19.725 1.00 47.39 O ATOM 1487 HA GLU A 298 0.942 15.975 24.418 1.00 0.00 H ATOM 1488 HB2 GLU A 298 1.495 17.349 22.456 1.00 0.00 H ATOM 1489 HB3 GLU A 298 1.687 15.874 21.481 1.00 0.00 H ATOM 1490 HG2 GLU A 298 -0.730 15.341 22.077 1.00 0.00 H ATOM 1491 HG3 GLU A 298 -0.837 17.007 22.694 1.00 0.00 H ATOM 1492 H GLU A 298 3.552 16.075 23.183 1.00 0.00 H ATOM 1493 N TYR A 299 1.883 13.270 22.702 1.00 30.16 N ATOM 1494 CA TYR A 299 1.588 11.846 22.526 1.00 29.87 C ATOM 1495 C TYR A 299 1.637 11.120 23.871 1.00 30.86 C ATOM 1496 O TYR A 299 0.752 10.328 24.197 1.00 28.16 O ATOM 1497 CB TYR A 299 2.606 11.193 21.582 1.00 28.91 C ATOM 1498 CG TYR A 299 2.388 9.697 21.415 1.00 31.38 C ATOM 1499 CD1 TYR A 299 1.261 9.210 20.757 1.00 26.80 C ATOM 1500 CD2 TYR A 299 3.291 8.771 21.949 1.00 28.98 C ATOM 1501 CE1 TYR A 299 1.031 7.845 20.633 1.00 30.10 C ATOM 1502 CE2 TYR A 299 3.073 7.398 21.831 1.00 30.34 C ATOM 1503 CZ TYR A 299 1.940 6.940 21.172 1.00 32.36 C ATOM 1504 OH TYR A 299 1.707 5.581 21.053 1.00 32.95 O ATOM 1505 HA TYR A 299 0.589 11.766 22.098 1.00 0.00 H ATOM 1506 HB3 TYR A 299 3.606 11.356 21.983 1.00 0.00 H ATOM 1507 HB2 TYR A 299 2.527 11.667 20.604 1.00 0.00 H ATOM 1508 HD2 TYR A 299 4.181 9.129 22.467 1.00 0.00 H ATOM 1509 HE2 TYR A 299 3.787 6.690 22.253 1.00 0.00 H ATOM 1510 HE1 TYR A 299 0.142 7.485 20.115 1.00 0.00 H ATOM 1511 HD1 TYR A 299 0.545 9.913 20.331 1.00 0.00 H ATOM 1512 HH TYR A 299 2.456 5.161 20.560 1.00 0.00 H ATOM 1513 H TYR A 299 2.725 13.680 22.250 1.00 0.00 H ATOM 1514 N ALA A 300 2.680 11.403 24.648 1.00 30.94 N ATOM 1515 CA ALA A 300 2.867 10.763 25.954 1.00 33.36 C ATOM 1516 C ALA A 300 1.627 10.857 26.834 1.00 32.14 C ATOM 1517 O ALA A 300 1.239 9.885 27.480 1.00 33.23 O ATOM 1518 CB ALA A 300 4.071 11.377 26.673 1.00 30.93 C ATOM 1519 HA ALA A 300 3.049 9.704 25.770 1.00 0.00 H ATOM 1520 HB1 ALA A 300 4.967 11.229 26.070 1.00 0.00 H ATOM 1521 HB2 ALA A 300 3.901 12.444 26.818 1.00 0.00 H ATOM 1522 HB3 ALA A 300 4.200 10.894 27.641 1.00 0.00 H ATOM 1523 H ALA A 300 3.382 12.097 24.320 1.00 0.00 H ATOM 1524 N LYS A 301 0.996 12.026 26.843 1.00 33.49 N ATOM 1525 CA LYS A 301 -0.205 12.240 27.643 1.00 32.44 C ATOM 1526 C LYS A 301 -1.351 11.291 27.300 1.00 33.03 C ATOM 1527 O LYS A 301 -2.219 11.041 28.138 1.00 33.82 O ATOM 1528 CB LYS A 301 -0.662 13.686 27.495 1.00 34.41 C ATOM 1529 CG LYS A 301 0.381 14.668 27.982 1.00 38.45 C ATOM 1530 CD LYS A 301 0.091 16.088 27.553 1.00 40.14 C ATOM 1531 CE LYS A 301 -1.244 16.558 28.059 1.00 40.78 C ATOM 1532 NZ LYS A 301 -1.452 17.978 27.653 1.00 44.23 N ATOM 1533 HA LYS A 301 0.065 12.025 28.677 1.00 0.00 H ATOM 1534 HB2 LYS A 301 -0.867 13.884 26.443 1.00 0.00 H ATOM 1535 HB3 LYS A 301 -1.575 13.827 28.074 1.00 0.00 H ATOM 1536 HG2 LYS A 301 0.413 14.632 29.071 1.00 0.00 H ATOM 1537 HG3 LYS A 301 1.351 14.374 27.582 1.00 0.00 H ATOM 1538 HD2 LYS A 301 0.869 16.742 27.946 1.00 0.00 H ATOM 1539 HD3 LYS A 301 0.094 16.136 26.464 1.00 0.00 H ATOM 1540 HE2 LYS A 301 -1.269 16.482 29.146 1.00 0.00 H ATOM 1541 HE3 LYS A 301 -2.034 15.938 27.634 1.00 0.00 H ATOM 1542 HZ1 LYS A 301 -0.698 18.567 28.059 1.00 0.00 H ATOM 1543 HZ2 LYS A 301 -1.428 18.048 26.616 1.00 0.00 H ATOM 1544 HZ3 LYS A 301 -2.375 18.305 28.002 1.00 0.00 H ATOM 1545 H LYS A 301 1.367 12.807 26.266 1.00 0.00 H ATOM 1546 N SER A 302 -1.362 10.762 26.077 1.00 32.77 N ATOM 1547 CA SER A 302 -2.419 9.844 25.660 1.00 31.82 C ATOM 1548 C SER A 302 -2.152 8.387 26.063 1.00 33.07 C ATOM 1549 O SER A 302 -3.025 7.532 25.899 1.00 33.40 O ATOM 1550 CB SER A 302 -2.606 9.896 24.149 1.00 31.23 C ATOM 1551 OG SER A 302 -1.751 8.952 23.519 1.00 36.19 O ATOM 1552 HA SER A 302 -3.320 10.177 26.176 1.00 0.00 H ATOM 1553 HB2 SER A 302 -2.366 10.897 23.790 1.00 0.00 H ATOM 1554 HB3 SER A 302 -3.643 9.663 23.905 1.00 0.00 H ATOM 1555 HG SER A 302 -0.809 9.164 23.738 1.00 0.00 H ATOM 1556 H SER A 302 -0.605 11.007 25.408 1.00 0.00 H ATOM 1557 N ILE A 303 -0.958 8.081 26.569 1.00 33.50 N ATOM 1558 CA ILE A 303 -0.680 6.698 26.977 1.00 32.97 C ATOM 1559 C ILE A 303 -1.451 6.451 28.270 1.00 33.14 C ATOM 1560 O ILE A 303 -1.248 7.143 29.268 1.00 34.47 O ATOM 1561 CB ILE A 303 0.831 6.459 27.215 1.00 34.26 C ATOM 1562 CG1 ILE A 303 1.605 6.732 25.924 1.00 31.91 C ATOM 1563 CG2 ILE A 303 1.073 5.008 27.674 1.00 32.17 C ATOM 1564 CD1 ILE A 303 3.111 6.791 26.113 1.00 33.56 C ATOM 1565 HA ILE A 303 -0.988 6.014 26.186 1.00 0.00 H ATOM 1566 HB ILE A 303 1.180 7.137 27.994 1.00 0.00 H ATOM 1567 HG12 ILE A 303 1.378 5.938 25.213 1.00 0.00 H ATOM 1568 HG13 ILE A 303 1.272 7.687 25.518 1.00 0.00 H ATOM 1569 HD11 ILE A 303 3.357 7.589 26.813 1.00 0.00 H ATOM 1570 HD12 ILE A 303 3.464 5.838 26.507 1.00 0.00 H ATOM 1571 HD13 ILE A 303 3.589 6.988 25.153 1.00 0.00 H ATOM 1572 HG21 ILE A 303 0.531 4.827 28.602 1.00 0.00 H ATOM 1573 HG22 ILE A 303 0.719 4.321 26.905 1.00 0.00 H ATOM 1574 HG23 ILE A 303 2.139 4.853 27.838 1.00 0.00 H ATOM 1575 H ILE A 303 -0.229 8.815 26.674 1.00 0.00 H ATOM 1576 N PRO A 304 -2.362 5.469 28.267 1.00 32.48 N ATOM 1577 CA PRO A 304 -3.142 5.189 29.472 1.00 31.14 C ATOM 1578 C PRO A 304 -2.312 5.024 30.738 1.00 32.58 C ATOM 1579 O PRO A 304 -1.390 4.222 30.786 1.00 32.29 O ATOM 1580 CB PRO A 304 -3.910 3.926 29.090 1.00 32.55 C ATOM 1581 CG PRO A 304 -4.179 4.156 27.631 1.00 32.09 C ATOM 1582 CD PRO A 304 -2.810 4.624 27.144 1.00 30.46 C ATOM 1583 HA PRO A 304 -3.788 6.024 29.744 1.00 0.00 H ATOM 1584 HD3 PRO A 304 -2.135 3.782 26.987 1.00 0.00 H ATOM 1585 HD2 PRO A 304 -2.892 5.200 26.222 1.00 0.00 H ATOM 1586 HG3 PRO A 304 -4.940 4.922 27.481 1.00 0.00 H ATOM 1587 HG2 PRO A 304 -4.488 3.237 27.132 1.00 0.00 H ATOM 1588 HB2 PRO A 304 -3.306 3.032 29.246 1.00 0.00 H ATOM 1589 HB3 PRO A 304 -4.838 3.839 29.656 1.00 0.00 H ATOM 1590 N GLY A 305 -2.660 5.797 31.764 1.00 32.95 N ATOM 1591 CA GLY A 305 -1.950 5.739 33.025 1.00 31.17 C ATOM 1592 C GLY A 305 -0.832 6.757 33.171 1.00 31.33 C ATOM 1593 O GLY A 305 -0.459 7.101 34.285 1.00 31.17 O ATOM 1594 HA3 GLY A 305 -1.518 4.743 33.127 1.00 0.00 H ATOM 1595 HA2 GLY A 305 -2.668 5.906 33.828 1.00 0.00 H ATOM 1596 H GLY A 305 -3.458 6.456 31.658 1.00 0.00 H ATOM 1597 N PHE A 306 -0.294 7.255 32.064 1.00 30.77 N ATOM 1598 CA PHE A 306 0.809 8.208 32.158 1.00 31.48 C ATOM 1599 C PHE A 306 0.494 9.463 32.972 1.00 32.61 C ATOM 1600 O PHE A 306 1.236 9.796 33.888 1.00 35.70 O ATOM 1601 CB PHE A 306 1.307 8.624 30.764 1.00 27.83 C ATOM 1602 CG PHE A 306 2.496 9.562 30.801 1.00 31.68 C ATOM 1603 CD1 PHE A 306 3.787 9.072 30.992 1.00 29.42 C ATOM 1604 CD2 PHE A 306 2.318 10.941 30.711 1.00 29.51 C ATOM 1605 CE1 PHE A 306 4.874 9.939 31.098 1.00 29.53 C ATOM 1606 CE2 PHE A 306 3.406 11.813 30.817 1.00 29.97 C ATOM 1607 CZ PHE A 306 4.683 11.309 31.013 1.00 29.51 C ATOM 1608 HA PHE A 306 1.590 7.670 32.695 1.00 0.00 H ATOM 1609 HB2 PHE A 306 1.593 7.725 30.217 1.00 0.00 H ATOM 1610 HB3 PHE A 306 0.491 9.122 30.240 1.00 0.00 H ATOM 1611 HD2 PHE A 306 1.318 11.345 30.556 1.00 0.00 H ATOM 1612 HE2 PHE A 306 3.250 12.889 30.746 1.00 0.00 H ATOM 1613 HZ PHE A 306 5.532 11.987 31.100 1.00 0.00 H ATOM 1614 HE1 PHE A 306 5.876 9.538 31.248 1.00 0.00 H ATOM 1615 HD1 PHE A 306 3.949 7.996 31.059 1.00 0.00 H ATOM 1616 H PHE A 306 -0.657 6.967 31.133 1.00 0.00 H ATOM 1617 N VAL A 307 -0.595 10.160 32.665 1.00 32.15 N ATOM 1618 CA VAL A 307 -0.896 11.382 33.406 1.00 33.77 C ATOM 1619 C VAL A 307 -1.249 11.149 34.877 1.00 33.73 C ATOM 1620 O VAL A 307 -1.220 12.084 35.669 1.00 30.42 O ATOM 1621 CB VAL A 307 -2.032 12.207 32.730 1.00 34.58 C ATOM 1622 CG1 VAL A 307 -1.564 12.730 31.395 1.00 33.89 C ATOM 1623 CG2 VAL A 307 -3.272 11.355 32.553 1.00 33.19 C ATOM 1624 HA VAL A 307 0.034 11.949 33.381 1.00 0.00 H ATOM 1625 HB VAL A 307 -2.282 13.051 33.373 1.00 0.00 H ATOM 1626 HG11 VAL A 307 -0.694 13.370 31.542 1.00 0.00 H ATOM 1627 HG12 VAL A 307 -1.296 11.892 30.751 1.00 0.00 H ATOM 1628 HG13 VAL A 307 -2.365 13.305 30.931 1.00 0.00 H ATOM 1629 HG21 VAL A 307 -3.035 10.496 31.925 1.00 0.00 H ATOM 1630 HG22 VAL A 307 -3.616 11.009 33.528 1.00 0.00 H ATOM 1631 HG23 VAL A 307 -4.054 11.948 32.079 1.00 0.00 H ATOM 1632 H VAL A 307 -1.227 9.838 31.904 1.00 0.00 H ATOM 1633 N ASN A 308 -1.566 9.905 35.233 1.00 34.91 N ATOM 1634 CA ASN A 308 -1.912 9.539 36.607 1.00 35.79 C ATOM 1635 C ASN A 308 -0.672 9.294 37.472 1.00 37.74 C ATOM 1636 O ASN A 308 -0.777 9.184 38.686 1.00 39.77 O ATOM 1637 CB ASN A 308 -2.757 8.264 36.633 1.00 37.95 C ATOM 1638 CG ASN A 308 -4.067 8.407 35.884 1.00 42.58 C ATOM 1639 OD1 ASN A 308 -4.876 9.306 36.164 1.00 41.58 O ATOM 1640 ND2 ASN A 308 -4.293 7.511 34.929 1.00 42.16 N ATOM 1641 HA ASN A 308 -2.472 10.382 37.012 1.00 0.00 H ATOM 1642 HB2 ASN A 308 -2.183 7.457 36.178 1.00 0.00 H ATOM 1643 HB3 ASN A 308 -2.975 8.013 37.671 1.00 0.00 H ATOM 1644 HD22 ASN A 308 -3.586 6.775 34.729 1.00 0.00 H ATOM 1645 HD21 ASN A 308 -5.177 7.546 34.382 1.00 0.00 H ATOM 1646 H ASN A 308 -1.568 9.163 34.504 1.00 0.00 H ATOM 1647 N LEU A 309 0.493 9.179 36.844 1.00 39.01 N ATOM 1648 CA LEU A 309 1.735 8.935 37.571 1.00 37.03 C ATOM 1649 C LEU A 309 2.201 10.186 38.304 1.00 39.35 C ATOM 1650 O LEU A 309 1.859 11.314 37.922 1.00 38.92 O ATOM 1651 CB LEU A 309 2.850 8.502 36.609 1.00 32.79 C ATOM 1652 CG LEU A 309 2.698 7.176 35.867 1.00 32.82 C ATOM 1653 CD1 LEU A 309 3.835 6.991 34.872 1.00 28.31 C ATOM 1654 CD2 LEU A 309 2.671 6.043 36.874 1.00 31.44 C ATOM 1655 HA LEU A 309 1.532 8.143 38.292 1.00 0.00 H ATOM 1656 HB2 LEU A 309 2.947 9.284 35.855 1.00 0.00 H ATOM 1657 HB3 LEU A 309 3.771 8.443 37.189 1.00 0.00 H ATOM 1658 HG LEU A 309 1.763 7.177 35.307 1.00 0.00 H ATOM 1659 HD21 LEU A 309 3.601 6.041 37.442 1.00 0.00 H ATOM 1660 HD22 LEU A 309 1.830 6.182 37.553 1.00 0.00 H ATOM 1661 HD23 LEU A 309 2.563 5.094 36.349 1.00 0.00 H ATOM 1662 HD11 LEU A 309 3.820 7.807 34.149 1.00 0.00 H ATOM 1663 HD12 LEU A 309 4.786 6.993 35.404 1.00 0.00 H ATOM 1664 HD13 LEU A 309 3.710 6.041 34.352 1.00 0.00 H ATOM 1665 H LEU A 309 0.521 9.265 35.808 1.00 0.00 H ATOM 1666 N ASP A 310 2.993 9.973 39.352 1.00 40.02 N ATOM 1667 CA ASP A 310 3.555 11.069 40.125 1.00 40.34 C ATOM 1668 C ASP A 310 4.097 12.041 39.085 1.00 40.56 C ATOM 1669 O ASP A 310 4.782 11.633 38.152 1.00 39.95 O ATOM 1670 CB ASP A 310 4.705 10.560 41.001 1.00 41.71 C ATOM 1671 CG ASP A 310 5.208 11.607 41.967 1.00 43.49 C ATOM 1672 OD1 ASP A 310 4.648 11.712 43.078 1.00 47.32 O ATOM 1673 OD2 ASP A 310 6.154 12.339 41.610 1.00 44.95 O ATOM 1674 HA ASP A 310 2.818 11.528 40.784 1.00 0.00 H ATOM 1675 HB2 ASP A 310 4.356 9.699 41.570 1.00 0.00 H ATOM 1676 HB3 ASP A 310 5.529 10.257 40.355 1.00 0.00 H ATOM 1677 H ASP A 310 3.216 8.995 39.626 1.00 0.00 H ATOM 1678 N LEU A 311 3.782 13.320 39.238 1.00 41.71 N ATOM 1679 CA LEU A 311 4.231 14.328 38.293 1.00 42.93 C ATOM 1680 C LEU A 311 5.740 14.274 38.050 1.00 44.05 C ATOM 1681 O LEU A 311 6.197 14.260 36.908 1.00 43.85 O ATOM 1682 CB LEU A 311 3.809 15.709 38.791 1.00 45.73 C ATOM 1683 CG LEU A 311 4.240 16.907 37.948 1.00 48.76 C ATOM 1684 CD1 LEU A 311 3.260 18.061 38.148 1.00 49.27 C ATOM 1685 CD2 LEU A 311 5.667 17.306 38.336 1.00 49.91 C ATOM 1686 HA LEU A 311 3.759 14.122 37.332 1.00 0.00 H ATOM 1687 HB2 LEU A 311 2.721 15.721 38.849 1.00 0.00 H ATOM 1688 HB3 LEU A 311 4.226 15.841 39.789 1.00 0.00 H ATOM 1689 HG LEU A 311 4.231 16.645 36.890 1.00 0.00 H ATOM 1690 HD21 LEU A 311 5.694 17.572 39.393 1.00 0.00 H ATOM 1691 HD22 LEU A 311 6.340 16.468 38.154 1.00 0.00 H ATOM 1692 HD23 LEU A 311 5.979 18.161 37.737 1.00 0.00 H ATOM 1693 HD11 LEU A 311 2.262 17.746 37.843 1.00 0.00 H ATOM 1694 HD12 LEU A 311 3.247 18.346 39.200 1.00 0.00 H ATOM 1695 HD13 LEU A 311 3.574 18.912 37.543 1.00 0.00 H ATOM 1696 H LEU A 311 3.201 13.608 40.052 1.00 0.00 H ATOM 1697 N ASN A 312 6.516 14.228 39.124 1.00 43.91 N ATOM 1698 CA ASN A 312 7.963 14.175 38.989 1.00 43.55 C ATOM 1699 C ASN A 312 8.401 13.020 38.097 1.00 41.33 C ATOM 1700 O ASN A 312 9.315 13.172 37.291 1.00 40.73 O ATOM 1701 CB ASN A 312 8.610 14.057 40.370 1.00 46.11 C ATOM 1702 CG ASN A 312 8.200 15.190 41.292 1.00 49.70 C ATOM 1703 OD1 ASN A 312 8.401 16.366 40.978 1.00 51.43 O ATOM 1704 ND2 ASN A 312 7.611 14.843 42.430 1.00 50.31 N ATOM 1705 HA ASN A 312 8.292 15.099 38.514 1.00 0.00 H ATOM 1706 HB2 ASN A 312 8.309 13.111 40.820 1.00 0.00 H ATOM 1707 HB3 ASN A 312 9.694 14.073 40.253 1.00 0.00 H ATOM 1708 HD22 ASN A 312 7.462 13.838 42.653 1.00 0.00 H ATOM 1709 HD21 ASN A 312 7.298 15.576 43.098 1.00 0.00 H ATOM 1710 H ASN A 312 6.086 14.230 40.071 1.00 0.00 H ATOM 1711 N ASP A 313 7.751 11.869 38.232 1.00 38.88 N ATOM 1712 CA ASP A 313 8.105 10.717 37.409 1.00 37.44 C ATOM 1713 C ASP A 313 7.708 10.975 35.954 1.00 38.08 C ATOM 1714 O ASP A 313 8.380 10.507 35.029 1.00 37.59 O ATOM 1715 CB ASP A 313 7.444 9.438 37.953 1.00 36.46 C ATOM 1716 CG ASP A 313 8.187 8.866 39.172 1.00 36.27 C ATOM 1717 OD1 ASP A 313 9.185 9.477 39.608 1.00 36.94 O ATOM 1718 OD2 ASP A 313 7.781 7.808 39.695 1.00 35.04 O ATOM 1719 HA ASP A 313 9.184 10.570 37.448 1.00 0.00 H ATOM 1720 HB2 ASP A 313 6.420 9.670 38.244 1.00 0.00 H ATOM 1721 HB3 ASP A 313 7.435 8.686 37.164 1.00 0.00 H ATOM 1722 H ASP A 313 6.984 11.788 38.930 1.00 0.00 H ATOM 1723 N GLN A 314 6.635 11.737 35.746 1.00 37.26 N ATOM 1724 CA GLN A 314 6.230 12.064 34.382 1.00 38.81 C ATOM 1725 C GLN A 314 7.396 12.825 33.762 1.00 38.10 C ATOM 1726 O GLN A 314 7.835 12.527 32.648 1.00 38.28 O ATOM 1727 CB GLN A 314 4.971 12.941 34.361 1.00 37.29 C ATOM 1728 CG GLN A 314 3.702 12.251 34.841 1.00 37.91 C ATOM 1729 CD GLN A 314 2.453 13.092 34.605 1.00 39.53 C ATOM 1730 OE1 GLN A 314 1.485 13.019 35.366 1.00 42.11 O ATOM 1731 NE2 GLN A 314 2.463 13.881 33.542 1.00 38.84 N ATOM 1732 HA GLN A 314 5.992 11.155 33.830 1.00 0.00 H ATOM 1733 HB2 GLN A 314 5.149 13.806 35.000 1.00 0.00 H ATOM 1734 HB3 GLN A 314 4.808 13.276 33.337 1.00 0.00 H ATOM 1735 HG2 GLN A 314 3.594 11.307 34.307 1.00 0.00 H ATOM 1736 HG3 GLN A 314 3.794 12.054 35.909 1.00 0.00 H ATOM 1737 HE22 GLN A 314 3.300 13.913 32.926 1.00 0.00 H ATOM 1738 HE21 GLN A 314 1.634 14.469 33.323 1.00 0.00 H ATOM 1739 H GLN A 314 6.087 12.098 36.553 1.00 0.00 H ATOM 1740 N VAL A 315 7.909 13.798 34.505 1.00 38.14 N ATOM 1741 CA VAL A 315 9.030 14.601 34.039 1.00 37.38 C ATOM 1742 C VAL A 315 10.240 13.723 33.747 1.00 36.29 C ATOM 1743 O VAL A 315 10.872 13.850 32.698 1.00 37.24 O ATOM 1744 CB VAL A 315 9.410 15.677 35.088 1.00 38.17 C ATOM 1745 CG1 VAL A 315 10.740 16.328 34.727 1.00 37.65 C ATOM 1746 CG2 VAL A 315 8.319 16.728 35.151 1.00 38.12 C ATOM 1747 HA VAL A 315 8.722 15.097 33.119 1.00 0.00 H ATOM 1748 HB VAL A 315 9.513 15.201 36.063 1.00 0.00 H ATOM 1749 HG11 VAL A 315 11.520 15.567 34.701 1.00 0.00 H ATOM 1750 HG12 VAL A 315 10.658 16.800 33.748 1.00 0.00 H ATOM 1751 HG13 VAL A 315 10.990 17.080 35.475 1.00 0.00 H ATOM 1752 HG21 VAL A 315 8.210 17.196 34.173 1.00 0.00 H ATOM 1753 HG22 VAL A 315 7.379 16.257 35.437 1.00 0.00 H ATOM 1754 HG23 VAL A 315 8.587 17.484 35.889 1.00 0.00 H ATOM 1755 H VAL A 315 7.501 13.991 35.442 1.00 0.00 H ATOM 1756 N THR A 316 10.563 12.826 34.670 1.00 35.50 N ATOM 1757 CA THR A 316 11.712 11.943 34.478 1.00 35.34 C ATOM 1758 C THR A 316 11.581 11.065 33.227 1.00 32.26 C ATOM 1759 O THR A 316 12.515 10.955 32.448 1.00 33.19 O ATOM 1760 CB THR A 316 11.929 11.031 35.709 1.00 34.46 C ATOM 1761 OG1 THR A 316 12.215 11.843 36.853 1.00 37.77 O ATOM 1762 CG2 THR A 316 13.096 10.076 35.473 1.00 33.10 C ATOM 1763 HA THR A 316 12.572 12.599 34.347 1.00 0.00 H ATOM 1764 HB THR A 316 11.023 10.448 35.875 1.00 0.00 H ATOM 1765 HG1 THR A 316 11.454 12.453 37.021 1.00 0.00 H ATOM 1766 HG23 THR A 316 12.885 9.454 34.603 1.00 0.00 H ATOM 1767 HG21 THR A 316 14.005 10.651 35.298 1.00 0.00 H ATOM 1768 HG22 THR A 316 13.229 9.443 36.350 1.00 0.00 H ATOM 1769 H THR A 316 9.994 12.751 35.537 1.00 0.00 H ATOM 1770 N LEU A 317 10.424 10.441 33.043 1.00 32.34 N ATOM 1771 CA LEU A 317 10.208 9.586 31.881 1.00 31.86 C ATOM 1772 C LEU A 317 10.352 10.368 30.584 1.00 30.03 C ATOM 1773 O LEU A 317 10.930 9.868 29.622 1.00 27.40 O ATOM 1774 CB LEU A 317 8.826 8.927 31.951 1.00 31.43 C ATOM 1775 CG LEU A 317 8.646 7.937 33.107 1.00 30.71 C ATOM 1776 CD1 LEU A 317 7.203 7.449 33.139 1.00 28.85 C ATOM 1777 CD2 LEU A 317 9.618 6.775 32.943 1.00 27.81 C ATOM 1778 HA LEU A 317 10.972 8.809 31.893 1.00 0.00 H ATOM 1779 HB2 LEU A 317 8.079 9.714 32.058 1.00 0.00 H ATOM 1780 HB3 LEU A 317 8.657 8.392 31.016 1.00 0.00 H ATOM 1781 HG LEU A 317 8.862 8.430 34.055 1.00 0.00 H ATOM 1782 HD21 LEU A 317 9.421 6.268 31.998 1.00 0.00 H ATOM 1783 HD22 LEU A 317 10.640 7.154 32.947 1.00 0.00 H ATOM 1784 HD23 LEU A 317 9.486 6.074 33.767 1.00 0.00 H ATOM 1785 HD11 LEU A 317 6.536 8.299 33.281 1.00 0.00 H ATOM 1786 HD12 LEU A 317 6.967 6.955 32.197 1.00 0.00 H ATOM 1787 HD13 LEU A 317 7.077 6.745 33.962 1.00 0.00 H ATOM 1788 H LEU A 317 9.660 10.564 33.738 1.00 0.00 H ATOM 1789 N LEU A 318 9.837 11.596 30.551 1.00 30.36 N ATOM 1790 CA LEU A 318 9.963 12.400 29.338 1.00 30.63 C ATOM 1791 C LEU A 318 11.411 12.787 29.078 1.00 29.77 C ATOM 1792 O LEU A 318 11.915 12.637 27.970 1.00 29.89 O ATOM 1793 CB LEU A 318 9.090 13.651 29.425 1.00 31.01 C ATOM 1794 CG LEU A 318 7.613 13.428 29.099 1.00 32.86 C ATOM 1795 CD1 LEU A 318 6.816 14.682 29.399 1.00 32.18 C ATOM 1796 CD2 LEU A 318 7.476 13.037 27.632 1.00 32.19 C ATOM 1797 HA LEU A 318 9.620 11.790 28.502 1.00 0.00 H ATOM 1798 HB2 LEU A 318 9.158 14.042 30.440 1.00 0.00 H ATOM 1799 HB3 LEU A 318 9.484 14.389 28.726 1.00 0.00 H ATOM 1800 HG LEU A 318 7.219 12.622 29.719 1.00 0.00 H ATOM 1801 HD21 LEU A 318 7.873 13.836 27.006 1.00 0.00 H ATOM 1802 HD22 LEU A 318 8.034 12.119 27.448 1.00 0.00 H ATOM 1803 HD23 LEU A 318 6.424 12.877 27.397 1.00 0.00 H ATOM 1804 HD11 LEU A 318 6.915 14.930 30.456 1.00 0.00 H ATOM 1805 HD12 LEU A 318 7.195 15.505 28.794 1.00 0.00 H ATOM 1806 HD13 LEU A 318 5.766 14.509 29.162 1.00 0.00 H ATOM 1807 H LEU A 318 9.348 11.980 31.384 1.00 0.00 H ATOM 1808 N LYS A 319 12.074 13.285 30.111 1.00 33.69 N ATOM 1809 CA LYS A 319 13.475 13.697 30.035 1.00 35.85 C ATOM 1810 C LYS A 319 14.374 12.613 29.430 1.00 37.06 C ATOM 1811 O LYS A 319 15.162 12.879 28.514 1.00 37.89 O ATOM 1812 CB LYS A 319 13.966 14.068 31.445 1.00 35.32 C ATOM 1813 CG LYS A 319 15.471 14.275 31.593 1.00 37.25 C ATOM 1814 CD LYS A 319 15.818 14.428 33.081 1.00 40.29 C ATOM 1815 CE LYS A 319 17.308 14.630 33.317 1.00 39.69 C ATOM 1816 NZ LYS A 319 17.816 15.887 32.708 1.00 40.64 N ATOM 1817 HA LYS A 319 13.535 14.560 29.373 1.00 0.00 H ATOM 1818 HB2 LYS A 319 13.471 14.993 31.739 1.00 0.00 H ATOM 1819 HB3 LYS A 319 13.670 13.268 32.123 1.00 0.00 H ATOM 1820 HG2 LYS A 319 15.999 13.415 31.182 1.00 0.00 H ATOM 1821 HG3 LYS A 319 15.770 15.174 31.055 1.00 0.00 H ATOM 1822 HD2 LYS A 319 15.281 15.290 33.478 1.00 0.00 H ATOM 1823 HD3 LYS A 319 15.500 13.529 33.608 1.00 0.00 H ATOM 1824 HE2 LYS A 319 17.848 13.788 32.884 1.00 0.00 H ATOM 1825 HE3 LYS A 319 17.491 14.663 34.391 1.00 0.00 H ATOM 1826 HZ1 LYS A 319 17.654 15.863 31.681 1.00 0.00 H ATOM 1827 HZ2 LYS A 319 17.313 16.699 33.121 1.00 0.00 H ATOM 1828 HZ3 LYS A 319 18.835 15.976 32.898 1.00 0.00 H ATOM 1829 H LYS A 319 11.575 13.388 31.018 1.00 0.00 H ATOM 1830 N TYR A 320 14.258 11.391 29.935 1.00 39.22 N ATOM 1831 CA TYR A 320 15.085 10.292 29.434 1.00 40.14 C ATOM 1832 C TYR A 320 14.544 9.604 28.190 1.00 39.26 C ATOM 1833 O TYR A 320 15.293 8.926 27.479 1.00 39.56 O ATOM 1834 CB TYR A 320 15.298 9.230 30.527 1.00 41.92 C ATOM 1835 CG TYR A 320 16.252 9.662 31.618 1.00 43.95 C ATOM 1836 CD1 TYR A 320 15.790 10.298 32.768 1.00 44.24 C ATOM 1837 CD2 TYR A 320 17.628 9.467 31.478 1.00 44.10 C ATOM 1838 CE1 TYR A 320 16.679 10.729 33.759 1.00 46.10 C ATOM 1839 CE2 TYR A 320 18.518 9.895 32.453 1.00 43.86 C ATOM 1840 CZ TYR A 320 18.040 10.523 33.589 1.00 44.20 C ATOM 1841 OH TYR A 320 18.925 10.943 34.547 1.00 43.59 O ATOM 1842 HA TYR A 320 16.026 10.763 29.152 1.00 0.00 H ATOM 1843 HB3 TYR A 320 15.695 8.329 30.059 1.00 0.00 H ATOM 1844 HB2 TYR A 320 14.333 9.006 30.982 1.00 0.00 H ATOM 1845 HD2 TYR A 320 18.010 8.969 30.586 1.00 0.00 H ATOM 1846 HE2 TYR A 320 19.589 9.737 32.324 1.00 0.00 H ATOM 1847 HE1 TYR A 320 16.305 11.222 34.656 1.00 0.00 H ATOM 1848 HD1 TYR A 320 14.720 10.462 32.898 1.00 0.00 H ATOM 1849 HH TYR A 320 18.428 11.369 35.290 1.00 0.00 H ATOM 1850 H TYR A 320 13.572 11.212 30.696 1.00 0.00 H ATOM 1851 N GLY A 321 13.251 9.763 27.922 1.00 36.20 N ATOM 1852 CA GLY A 321 12.681 9.098 26.764 1.00 34.39 C ATOM 1853 C GLY A 321 12.617 9.857 25.450 1.00 34.43 C ATOM 1854 O GLY A 321 12.723 9.250 24.384 1.00 33.75 O ATOM 1855 HA3 GLY A 321 11.660 8.818 27.024 1.00 0.00 H ATOM 1856 HA2 GLY A 321 13.270 8.198 26.587 1.00 0.00 H ATOM 1857 H GLY A 321 12.656 10.356 28.534 1.00 0.00 H ATOM 1858 N VAL A 322 12.466 11.177 25.513 1.00 33.06 N ATOM 1859 CA VAL A 322 12.337 11.982 24.307 1.00 32.93 C ATOM 1860 C VAL A 322 13.349 11.771 23.189 1.00 32.34 C ATOM 1861 O VAL A 322 12.962 11.548 22.039 1.00 32.96 O ATOM 1862 CB VAL A 322 12.262 13.495 24.663 1.00 35.19 C ATOM 1863 CG1 VAL A 322 12.702 14.348 23.483 1.00 36.27 C ATOM 1864 CG2 VAL A 322 10.820 13.856 25.020 1.00 33.78 C ATOM 1865 HA VAL A 322 11.405 11.611 23.880 1.00 0.00 H ATOM 1866 HB VAL A 322 12.925 13.687 25.507 1.00 0.00 H ATOM 1867 HG11 VAL A 322 13.730 14.098 23.219 1.00 0.00 H ATOM 1868 HG12 VAL A 322 12.049 14.153 22.632 1.00 0.00 H ATOM 1869 HG13 VAL A 322 12.641 15.402 23.755 1.00 0.00 H ATOM 1870 HG21 VAL A 322 10.173 13.647 24.168 1.00 0.00 H ATOM 1871 HG22 VAL A 322 10.499 13.262 25.876 1.00 0.00 H ATOM 1872 HG23 VAL A 322 10.763 14.915 25.270 1.00 0.00 H ATOM 1873 H VAL A 322 12.440 11.643 26.442 1.00 0.00 H ATOM 1874 N HIS A 323 14.638 11.834 23.493 1.00 32.79 N ATOM 1875 CA HIS A 323 15.615 11.658 22.433 1.00 31.71 C ATOM 1876 C HIS A 323 15.659 10.258 21.848 1.00 31.07 C ATOM 1877 O HIS A 323 15.928 10.085 20.655 1.00 31.76 O ATOM 1878 CB HIS A 323 16.997 12.103 22.904 1.00 33.47 C ATOM 1879 CG HIS A 323 17.157 13.588 22.925 1.00 36.18 C ATOM 1880 ND1 HIS A 323 16.837 14.358 24.020 1.00 40.43 N ATOM 1881 CD2 HIS A 323 17.525 14.455 21.952 1.00 38.80 C ATOM 1882 CE1 HIS A 323 17.001 15.635 23.722 1.00 39.58 C ATOM 1883 NE2 HIS A 323 17.418 15.720 22.472 1.00 38.15 N ATOM 1884 HA HIS A 323 15.287 12.297 21.614 1.00 0.00 H ATOM 1885 HB2 HIS A 323 17.160 11.722 23.912 1.00 0.00 H ATOM 1886 HB3 HIS A 323 17.745 11.682 22.232 1.00 0.00 H ATOM 1887 HD2 HIS A 323 17.846 14.196 20.943 1.00 0.00 H ATOM 1888 HE1 HIS A 323 16.822 16.475 24.393 1.00 0.00 H ATOM 1889 H HIS A 323 14.944 12.006 24.472 1.00 0.00 H ATOM 1890 N GLU A 324 15.390 9.247 22.661 1.00 29.66 N ATOM 1891 CA GLU A 324 15.398 7.901 22.116 1.00 30.40 C ATOM 1892 C GLU A 324 14.253 7.858 21.100 1.00 28.97 C ATOM 1893 O GLU A 324 14.384 7.267 20.026 1.00 29.40 O ATOM 1894 CB GLU A 324 15.223 6.855 23.237 1.00 30.62 C ATOM 1895 CG GLU A 324 16.422 6.809 24.213 1.00 33.41 C ATOM 1896 CD GLU A 324 16.253 5.799 25.354 1.00 35.55 C ATOM 1897 OE1 GLU A 324 15.148 5.223 25.511 1.00 35.12 O ATOM 1898 OE2 GLU A 324 17.232 5.593 26.104 1.00 33.78 O ATOM 1899 HA GLU A 324 16.346 7.659 21.636 1.00 0.00 H ATOM 1900 HB2 GLU A 324 14.324 7.099 23.802 1.00 0.00 H ATOM 1901 HB3 GLU A 324 15.108 5.872 22.780 1.00 0.00 H ATOM 1902 HG2 GLU A 324 17.315 6.543 23.648 1.00 0.00 H ATOM 1903 HG3 GLU A 324 16.550 7.800 24.647 1.00 0.00 H ATOM 1904 H GLU A 324 15.178 9.413 23.666 1.00 0.00 H ATOM 1905 N ILE A 325 13.140 8.509 21.424 1.00 26.26 N ATOM 1906 CA ILE A 325 12.001 8.539 20.514 1.00 27.67 C ATOM 1907 C ILE A 325 12.313 9.396 19.281 1.00 28.14 C ATOM 1908 O ILE A 325 11.956 9.044 18.152 1.00 26.81 O ATOM 1909 CB ILE A 325 10.730 9.064 21.231 1.00 27.58 C ATOM 1910 CG1 ILE A 325 10.365 8.109 22.365 1.00 25.21 C ATOM 1911 CG2 ILE A 325 9.554 9.176 20.236 1.00 25.37 C ATOM 1912 CD1 ILE A 325 9.120 8.504 23.141 1.00 30.46 C ATOM 1913 HA ILE A 325 11.809 7.518 20.185 1.00 0.00 H ATOM 1914 HB ILE A 325 10.931 10.056 21.636 1.00 0.00 H ATOM 1915 HG12 ILE A 325 10.202 7.119 21.939 1.00 0.00 H ATOM 1916 HG13 ILE A 325 11.203 8.070 23.061 1.00 0.00 H ATOM 1917 HD11 ILE A 325 9.268 9.487 23.587 1.00 0.00 H ATOM 1918 HD12 ILE A 325 8.266 8.536 22.464 1.00 0.00 H ATOM 1919 HD13 ILE A 325 8.935 7.771 23.926 1.00 0.00 H ATOM 1920 HG21 ILE A 325 9.821 9.867 19.436 1.00 0.00 H ATOM 1921 HG22 ILE A 325 9.342 8.194 19.814 1.00 0.00 H ATOM 1922 HG23 ILE A 325 8.672 9.546 20.758 1.00 0.00 H ATOM 1923 H ILE A 325 13.081 9.003 22.337 1.00 0.00 H ATOM 1924 N ILE A 326 12.988 10.520 19.492 1.00 28.71 N ATOM 1925 CA ILE A 326 13.350 11.372 18.371 1.00 28.60 C ATOM 1926 C ILE A 326 14.192 10.609 17.334 1.00 29.25 C ATOM 1927 O ILE A 326 13.987 10.768 16.128 1.00 29.62 O ATOM 1928 CB ILE A 326 14.138 12.629 18.848 1.00 26.74 C ATOM 1929 CG1 ILE A 326 13.155 13.681 19.388 1.00 28.68 C ATOM 1930 CG2 ILE A 326 14.981 13.193 17.703 1.00 22.04 C ATOM 1931 CD1 ILE A 326 13.817 14.937 20.007 1.00 28.18 C ATOM 1932 HA ILE A 326 12.418 11.691 17.904 1.00 0.00 H ATOM 1933 HB ILE A 326 14.817 12.347 19.653 1.00 0.00 H ATOM 1934 HG12 ILE A 326 12.519 14.005 18.564 1.00 0.00 H ATOM 1935 HG13 ILE A 326 12.541 13.209 20.155 1.00 0.00 H ATOM 1936 HD11 ILE A 326 14.448 14.638 20.844 1.00 0.00 H ATOM 1937 HD12 ILE A 326 14.425 15.435 19.252 1.00 0.00 H ATOM 1938 HD13 ILE A 326 13.042 15.618 20.359 1.00 0.00 H ATOM 1939 HG21 ILE A 326 15.689 12.435 17.367 1.00 0.00 H ATOM 1940 HG22 ILE A 326 14.328 13.474 16.877 1.00 0.00 H ATOM 1941 HG23 ILE A 326 15.525 14.070 18.052 1.00 0.00 H ATOM 1942 H ILE A 326 13.258 10.791 20.459 1.00 0.00 H ATOM 1943 N TYR A 327 15.138 9.787 17.788 1.00 28.89 N ATOM 1944 CA TYR A 327 15.982 9.043 16.846 1.00 29.52 C ATOM 1945 C TYR A 327 15.270 7.860 16.204 1.00 27.06 C ATOM 1946 O TYR A 327 15.622 7.445 15.099 1.00 25.17 O ATOM 1947 CB TYR A 327 17.269 8.570 17.526 1.00 33.27 C ATOM 1948 CG TYR A 327 18.093 9.707 18.067 1.00 37.41 C ATOM 1949 CD1 TYR A 327 18.379 10.819 17.278 1.00 39.37 C ATOM 1950 CD2 TYR A 327 18.561 9.690 19.380 1.00 39.25 C ATOM 1951 CE1 TYR A 327 19.104 11.890 17.786 1.00 41.94 C ATOM 1952 CE2 TYR A 327 19.287 10.752 19.897 1.00 40.58 C ATOM 1953 CZ TYR A 327 19.556 11.851 19.100 1.00 42.37 C ATOM 1954 OH TYR A 327 20.272 12.912 19.624 1.00 44.90 O ATOM 1955 HA TYR A 327 16.225 9.741 16.045 1.00 0.00 H ATOM 1956 HB3 TYR A 327 17.867 8.021 16.798 1.00 0.00 H ATOM 1957 HB2 TYR A 327 17.005 7.908 18.350 1.00 0.00 H ATOM 1958 HD2 TYR A 327 18.352 8.826 20.011 1.00 0.00 H ATOM 1959 HE2 TYR A 327 19.644 10.722 20.926 1.00 0.00 H ATOM 1960 HE1 TYR A 327 19.317 12.755 17.158 1.00 0.00 H ATOM 1961 HD1 TYR A 327 18.029 10.849 16.246 1.00 0.00 H ATOM 1962 HH TYR A 327 19.785 13.286 20.400 1.00 0.00 H ATOM 1963 H TYR A 327 15.278 9.673 18.812 1.00 0.00 H ATOM 1964 N THR A 328 14.275 7.316 16.895 1.00 25.94 N ATOM 1965 CA THR A 328 13.498 6.199 16.361 1.00 27.04 C ATOM 1966 C THR A 328 12.649 6.746 15.215 1.00 26.11 C ATOM 1967 O THR A 328 12.636 6.212 14.114 1.00 25.51 O ATOM 1968 CB THR A 328 12.556 5.601 17.439 1.00 25.74 C ATOM 1969 OG1 THR A 328 13.341 4.980 18.464 1.00 27.29 O ATOM 1970 CG2 THR A 328 11.612 4.574 16.832 1.00 24.84 C ATOM 1971 HA THR A 328 14.174 5.411 16.029 1.00 0.00 H ATOM 1972 HB THR A 328 11.959 6.409 17.862 1.00 0.00 H ATOM 1973 HG1 THR A 328 13.933 5.656 18.879 1.00 0.00 H ATOM 1974 HG23 THR A 328 11.015 5.047 16.052 1.00 0.00 H ATOM 1975 HG21 THR A 328 12.193 3.758 16.402 1.00 0.00 H ATOM 1976 HG22 THR A 328 10.954 4.184 17.608 1.00 0.00 H ATOM 1977 H THR A 328 14.044 7.693 17.836 1.00 0.00 H ATOM 1978 N MET A 329 11.955 7.840 15.486 1.00 29.34 N ATOM 1979 CA MET A 329 11.096 8.458 14.488 1.00 28.47 C ATOM 1980 C MET A 329 11.861 9.084 13.340 1.00 28.35 C ATOM 1981 O MET A 329 11.379 9.106 12.204 1.00 27.65 O ATOM 1982 CB MET A 329 10.185 9.469 15.177 1.00 31.73 C ATOM 1983 CG MET A 329 9.196 8.762 16.096 1.00 34.33 C ATOM 1984 SD MET A 329 7.944 9.813 16.746 1.00 41.30 S ATOM 1985 CE MET A 329 7.073 10.271 15.194 1.00 40.87 C ATOM 1986 HA MET A 329 10.495 7.673 14.030 1.00 0.00 H ATOM 1987 HB2 MET A 329 10.793 10.156 15.765 1.00 0.00 H ATOM 1988 HB3 MET A 329 9.634 10.029 14.421 1.00 0.00 H ATOM 1989 HG2 MET A 329 9.750 8.332 16.930 1.00 0.00 H ATOM 1990 HG3 MET A 329 8.714 7.963 15.532 1.00 0.00 H ATOM 1991 HE1 MET A 329 7.769 10.774 14.523 1.00 0.00 H ATOM 1992 HE2 MET A 329 6.690 9.370 14.714 1.00 0.00 H ATOM 1993 HE3 MET A 329 6.245 10.940 15.428 1.00 0.00 H ATOM 1994 H MET A 329 12.025 8.266 16.432 1.00 0.00 H ATOM 1995 N LEU A 330 13.062 9.574 13.630 1.00 25.71 N ATOM 1996 CA LEU A 330 13.908 10.173 12.602 1.00 25.06 C ATOM 1997 C LEU A 330 14.288 9.127 11.547 1.00 24.72 C ATOM 1998 O LEU A 330 14.480 9.452 10.369 1.00 23.85 O ATOM 1999 CB LEU A 330 15.178 10.745 13.239 1.00 23.20 C ATOM 2000 CG LEU A 330 16.170 11.389 12.275 1.00 26.52 C ATOM 2001 CD1 LEU A 330 15.595 12.697 11.757 1.00 28.04 C ATOM 2002 CD2 LEU A 330 17.495 11.621 12.983 1.00 25.24 C ATOM 2003 HA LEU A 330 13.352 10.977 12.119 1.00 0.00 H ATOM 2004 HB2 LEU A 330 14.878 11.500 13.965 1.00 0.00 H ATOM 2005 HB3 LEU A 330 15.690 9.932 13.753 1.00 0.00 H ATOM 2006 HG LEU A 330 16.346 10.727 11.427 1.00 0.00 H ATOM 2007 HD21 LEU A 330 17.339 12.281 13.836 1.00 0.00 H ATOM 2008 HD22 LEU A 330 17.893 10.667 13.328 1.00 0.00 H ATOM 2009 HD23 LEU A 330 18.200 12.081 12.290 1.00 0.00 H ATOM 2010 HD11 LEU A 330 14.657 12.500 11.237 1.00 0.00 H ATOM 2011 HD12 LEU A 330 15.413 13.369 12.595 1.00 0.00 H ATOM 2012 HD13 LEU A 330 16.304 13.157 11.068 1.00 0.00 H ATOM 2013 H LEU A 330 13.406 9.530 14.610 1.00 0.00 H ATOM 2014 N ALA A 331 14.401 7.868 11.966 1.00 25.95 N ATOM 2015 CA ALA A 331 14.747 6.796 11.023 1.00 25.05 C ATOM 2016 C ALA A 331 13.672 6.737 9.944 1.00 24.52 C ATOM 2017 O ALA A 331 13.960 6.453 8.786 1.00 26.54 O ATOM 2018 CB ALA A 331 14.841 5.449 11.758 1.00 26.56 C ATOM 2019 HA ALA A 331 15.717 7.000 10.569 1.00 0.00 H ATOM 2020 HB1 ALA A 331 15.611 5.509 12.527 1.00 0.00 H ATOM 2021 HB2 ALA A 331 13.881 5.221 12.220 1.00 0.00 H ATOM 2022 HB3 ALA A 331 15.098 4.665 11.046 1.00 0.00 H ATOM 2023 H ALA A 331 14.243 7.642 12.969 1.00 0.00 H ATOM 2024 N SER A 332 12.430 7.032 10.325 1.00 25.51 N ATOM 2025 CA SER A 332 11.324 7.011 9.375 1.00 26.12 C ATOM 2026 C SER A 332 11.566 7.970 8.227 1.00 26.71 C ATOM 2027 O SER A 332 11.137 7.706 7.108 1.00 26.71 O ATOM 2028 CB SER A 332 10.006 7.403 10.050 1.00 26.44 C ATOM 2029 OG SER A 332 9.669 6.527 11.101 1.00 23.52 O ATOM 2030 HA SER A 332 11.259 5.991 8.997 1.00 0.00 H ATOM 2031 HB2 SER A 332 9.210 7.383 9.306 1.00 0.00 H ATOM 2032 HB3 SER A 332 10.102 8.412 10.450 1.00 0.00 H ATOM 2033 HG SER A 332 8.814 6.815 11.508 1.00 0.00 H ATOM 2034 H SER A 332 12.246 7.282 11.318 1.00 0.00 H ATOM 2035 N LEU A 333 12.258 9.077 8.495 1.00 27.13 N ATOM 2036 CA LEU A 333 12.499 10.074 7.456 1.00 28.23 C ATOM 2037 C LEU A 333 13.815 9.875 6.708 1.00 30.26 C ATOM 2038 O LEU A 333 14.191 10.709 5.873 1.00 30.51 O ATOM 2039 CB LEU A 333 12.482 11.486 8.062 1.00 28.11 C ATOM 2040 CG LEU A 333 11.408 11.872 9.092 1.00 31.57 C ATOM 2041 CD1 LEU A 333 11.491 13.370 9.388 1.00 30.53 C ATOM 2042 CD2 LEU A 333 10.047 11.532 8.582 1.00 29.19 C ATOM 2043 HA LEU A 333 11.693 9.950 6.732 1.00 0.00 H ATOM 2044 HB2 LEU A 333 13.448 11.632 8.546 1.00 0.00 H ATOM 2045 HB3 LEU A 333 12.385 12.184 7.230 1.00 0.00 H ATOM 2046 HG LEU A 333 11.586 11.311 10.009 1.00 0.00 H ATOM 2047 HD21 LEU A 333 9.861 12.076 7.656 1.00 0.00 H ATOM 2048 HD22 LEU A 333 9.988 10.460 8.394 1.00 0.00 H ATOM 2049 HD23 LEU A 333 9.301 11.813 9.326 1.00 0.00 H ATOM 2050 HD11 LEU A 333 12.477 13.606 9.788 1.00 0.00 H ATOM 2051 HD12 LEU A 333 11.327 13.931 8.468 1.00 0.00 H ATOM 2052 HD13 LEU A 333 10.728 13.638 10.119 1.00 0.00 H ATOM 2053 H LEU A 333 12.630 9.232 9.454 1.00 0.00 H ATOM 2054 N MET A 334 14.507 8.775 6.993 1.00 29.84 N ATOM 2055 CA MET A 334 15.794 8.511 6.359 1.00 31.41 C ATOM 2056 C MET A 334 15.903 7.266 5.483 1.00 30.43 C ATOM 2057 O MET A 334 15.146 6.307 5.613 1.00 31.02 O ATOM 2058 CB MET A 334 16.893 8.382 7.429 1.00 31.00 C ATOM 2059 CG MET A 334 17.068 9.563 8.377 1.00 32.37 C ATOM 2060 SD MET A 334 18.266 9.188 9.708 1.00 32.38 S ATOM 2061 CE MET A 334 19.351 10.640 9.619 1.00 32.18 C ATOM 2062 HA MET A 334 15.910 9.368 5.696 1.00 0.00 H ATOM 2063 HB2 MET A 334 16.664 7.504 8.033 1.00 0.00 H ATOM 2064 HB3 MET A 334 17.841 8.229 6.913 1.00 0.00 H ATOM 2065 HG2 MET A 334 16.104 9.802 8.826 1.00 0.00 H ATOM 2066 HG3 MET A 334 17.427 10.422 7.810 1.00 0.00 H ATOM 2067 HE1 MET A 334 19.803 10.694 8.629 1.00 0.00 H ATOM 2068 HE2 MET A 334 18.766 11.541 9.802 1.00 0.00 H ATOM 2069 HE3 MET A 334 20.133 10.554 10.373 1.00 0.00 H ATOM 2070 H MET A 334 14.124 8.093 7.678 1.00 0.00 H ATOM 2071 N ASN A 335 16.869 7.316 4.581 1.00 30.93 N ATOM 2072 CA ASN A 335 17.225 6.178 3.753 1.00 33.05 C ATOM 2073 C ASN A 335 18.733 6.316 3.745 1.00 34.66 C ATOM 2074 O ASN A 335 19.269 7.192 4.424 1.00 33.80 O ATOM 2075 CB ASN A 335 16.633 6.227 2.333 1.00 30.16 C ATOM 2076 CG ASN A 335 17.091 7.415 1.526 1.00 32.09 C ATOM 2077 OD1 ASN A 335 18.130 8.019 1.790 1.00 30.05 O ATOM 2078 ND2 ASN A 335 16.312 7.744 0.498 1.00 34.52 N ATOM 2079 HA ASN A 335 16.842 5.229 4.127 1.00 0.00 H ATOM 2080 HB2 ASN A 335 16.926 5.319 1.806 1.00 0.00 H ATOM 2081 HB3 ASN A 335 15.547 6.264 2.414 1.00 0.00 H ATOM 2082 HD22 ASN A 335 15.442 7.206 0.312 1.00 0.00 H ATOM 2083 HD21 ASN A 335 16.573 8.539 -0.119 1.00 0.00 H ATOM 2084 H ASN A 335 17.394 8.205 4.460 1.00 0.00 H ATOM 2085 N LYS A 336 19.424 5.476 2.994 1.00 36.54 N ATOM 2086 CA LYS A 336 20.876 5.531 2.959 1.00 38.77 C ATOM 2087 C LYS A 336 21.498 6.829 2.438 1.00 38.79 C ATOM 2088 O LYS A 336 22.606 7.176 2.837 1.00 39.88 O ATOM 2089 CB LYS A 336 21.406 4.364 2.128 1.00 41.97 C ATOM 2090 CG LYS A 336 21.998 3.256 2.953 1.00 46.96 C ATOM 2091 CD LYS A 336 23.256 3.727 3.667 1.00 50.26 C ATOM 2092 CE LYS A 336 23.976 2.585 4.368 1.00 49.74 C ATOM 2093 NZ LYS A 336 25.156 3.084 5.129 1.00 52.50 N ATOM 2094 HA LYS A 336 21.175 5.475 4.006 1.00 0.00 H ATOM 2095 HB2 LYS A 336 20.582 3.956 1.543 1.00 0.00 H ATOM 2096 HB3 LYS A 336 22.176 4.742 1.455 1.00 0.00 H ATOM 2097 HG2 LYS A 336 21.267 2.931 3.693 1.00 0.00 H ATOM 2098 HG3 LYS A 336 22.249 2.419 2.301 1.00 0.00 H ATOM 2099 HD2 LYS A 336 23.930 4.172 2.935 1.00 0.00 H ATOM 2100 HD3 LYS A 336 22.980 4.477 4.408 1.00 0.00 H ATOM 2101 HE2 LYS A 336 24.311 1.864 3.623 1.00 0.00 H ATOM 2102 HE3 LYS A 336 23.286 2.099 5.058 1.00 0.00 H ATOM 2103 HZ1 LYS A 336 25.819 3.545 4.474 1.00 0.00 H ATOM 2104 HZ2 LYS A 336 24.841 3.769 5.845 1.00 0.00 H ATOM 2105 HZ3 LYS A 336 25.628 2.284 5.597 1.00 0.00 H ATOM 2106 H LYS A 336 18.923 4.767 2.421 1.00 0.00 H ATOM 2107 N ASP A 337 20.795 7.540 1.559 1.00 36.50 N ATOM 2108 CA ASP A 337 21.336 8.764 0.962 1.00 35.26 C ATOM 2109 C ASP A 337 21.031 10.092 1.648 1.00 33.61 C ATOM 2110 O ASP A 337 21.678 11.100 1.353 1.00 32.49 O ATOM 2111 CB ASP A 337 20.885 8.877 -0.498 1.00 34.76 C ATOM 2112 CG ASP A 337 21.240 7.654 -1.311 1.00 37.47 C ATOM 2113 OD1 ASP A 337 22.327 7.094 -1.094 1.00 35.58 O ATOM 2114 OD2 ASP A 337 20.439 7.255 -2.175 1.00 39.81 O ATOM 2115 HA ASP A 337 22.411 8.628 1.081 1.00 0.00 H ATOM 2116 HB2 ASP A 337 19.803 9.010 -0.520 1.00 0.00 H ATOM 2117 HB3 ASP A 337 21.366 9.746 -0.946 1.00 0.00 H ATOM 2118 H ASP A 337 19.842 7.220 1.291 1.00 0.00 H ATOM 2119 N GLY A 338 20.050 10.114 2.542 1.00 31.73 N ATOM 2120 CA GLY A 338 19.731 11.373 3.191 1.00 31.56 C ATOM 2121 C GLY A 338 18.513 11.341 4.085 1.00 30.58 C ATOM 2122 O GLY A 338 17.993 10.273 4.412 1.00 29.88 O ATOM 2123 HA3 GLY A 338 19.562 12.120 2.415 1.00 0.00 H ATOM 2124 HA2 GLY A 338 20.588 11.668 3.797 1.00 0.00 H ATOM 2125 H GLY A 338 19.522 9.248 2.772 1.00 0.00 H ATOM 2126 N VAL A 339 18.053 12.529 4.464 1.00 29.33 N ATOM 2127 CA VAL A 339 16.914 12.669 5.353 1.00 28.33 C ATOM 2128 C VAL A 339 15.981 13.802 4.921 1.00 28.62 C ATOM 2129 O VAL A 339 16.425 14.835 4.416 1.00 29.26 O ATOM 2130 CB VAL A 339 17.408 12.932 6.793 1.00 28.49 C ATOM 2131 CG1 VAL A 339 18.281 14.192 6.829 1.00 28.22 C ATOM 2132 CG2 VAL A 339 16.240 13.073 7.726 1.00 28.75 C ATOM 2133 HA VAL A 339 16.349 11.738 5.310 1.00 0.00 H ATOM 2134 HB VAL A 339 18.009 12.084 7.120 1.00 0.00 H ATOM 2135 HG11 VAL A 339 19.142 14.055 6.174 1.00 0.00 H ATOM 2136 HG12 VAL A 339 17.697 15.047 6.489 1.00 0.00 H ATOM 2137 HG13 VAL A 339 18.623 14.367 7.849 1.00 0.00 H ATOM 2138 HG21 VAL A 339 15.618 13.908 7.404 1.00 0.00 H ATOM 2139 HG22 VAL A 339 15.653 12.155 7.712 1.00 0.00 H ATOM 2140 HG23 VAL A 339 16.604 13.258 8.737 1.00 0.00 H ATOM 2141 H VAL A 339 18.525 13.387 4.112 1.00 0.00 H ATOM 2142 N LEU A 340 14.686 13.595 5.113 1.00 28.71 N ATOM 2143 CA LEU A 340 13.685 14.590 4.757 1.00 29.31 C ATOM 2144 C LEU A 340 13.734 15.735 5.768 1.00 31.11 C ATOM 2145 O LEU A 340 14.017 15.508 6.951 1.00 29.57 O ATOM 2146 CB LEU A 340 12.275 13.974 4.804 1.00 26.99 C ATOM 2147 CG LEU A 340 11.858 12.937 3.753 1.00 27.09 C ATOM 2148 CD1 LEU A 340 10.441 12.431 4.052 1.00 20.69 C ATOM 2149 CD2 LEU A 340 11.905 13.574 2.383 1.00 22.59 C ATOM 2150 HA LEU A 340 13.896 14.950 3.750 1.00 0.00 H ATOM 2151 HB2 LEU A 340 12.172 13.495 5.778 1.00 0.00 H ATOM 2152 HB3 LEU A 340 11.567 14.800 4.730 1.00 0.00 H ATOM 2153 HG LEU A 340 12.543 12.090 3.782 1.00 0.00 H ATOM 2154 HD21 LEU A 340 11.220 14.422 2.354 1.00 0.00 H ATOM 2155 HD22 LEU A 340 12.919 13.917 2.178 1.00 0.00 H ATOM 2156 HD23 LEU A 340 11.609 12.841 1.633 1.00 0.00 H ATOM 2157 HD11 LEU A 340 10.422 11.970 5.040 1.00 0.00 H ATOM 2158 HD12 LEU A 340 9.744 13.269 4.027 1.00 0.00 H ATOM 2159 HD13 LEU A 340 10.153 11.695 3.301 1.00 0.00 H ATOM 2160 H LEU A 340 14.376 12.694 5.531 1.00 0.00 H ATOM 2161 N ILE A 341 13.465 16.951 5.295 1.00 30.34 N ATOM 2162 CA ILE A 341 13.424 18.131 6.155 1.00 32.82 C ATOM 2163 C ILE A 341 12.241 19.011 5.756 1.00 32.59 C ATOM 2164 O ILE A 341 11.625 18.803 4.710 1.00 32.97 O ATOM 2165 CB ILE A 341 14.722 18.975 6.079 1.00 34.99 C ATOM 2166 CG1 ILE A 341 14.880 19.596 4.693 1.00 35.67 C ATOM 2167 CG2 ILE A 341 15.922 18.111 6.435 1.00 32.89 C ATOM 2168 CD1 ILE A 341 16.044 20.584 4.598 1.00 35.53 C ATOM 2169 HA ILE A 341 13.320 17.774 7.180 1.00 0.00 H ATOM 2170 HB ILE A 341 14.658 19.790 6.800 1.00 0.00 H ATOM 2171 HG12 ILE A 341 15.047 18.795 3.972 1.00 0.00 H ATOM 2172 HG13 ILE A 341 13.959 20.122 4.443 1.00 0.00 H ATOM 2173 HD11 ILE A 341 15.887 21.398 5.306 1.00 0.00 H ATOM 2174 HD12 ILE A 341 16.976 20.070 4.835 1.00 0.00 H ATOM 2175 HD13 ILE A 341 16.096 20.986 3.586 1.00 0.00 H ATOM 2176 HG21 ILE A 341 15.802 17.724 7.447 1.00 0.00 H ATOM 2177 HG22 ILE A 341 15.991 17.280 5.733 1.00 0.00 H ATOM 2178 HG23 ILE A 341 16.830 18.712 6.379 1.00 0.00 H ATOM 2179 H ILE A 341 13.278 17.064 4.278 1.00 0.00 H ATOM 2180 N SER A 342 11.913 19.981 6.599 1.00 33.61 N ATOM 2181 CA SER A 342 10.792 20.882 6.340 1.00 35.00 C ATOM 2182 C SER A 342 9.512 20.125 6.028 1.00 35.79 C ATOM 2183 O SER A 342 8.966 20.248 4.926 1.00 38.25 O ATOM 2184 CB SER A 342 11.100 21.808 5.164 1.00 34.70 C ATOM 2185 OG SER A 342 12.484 22.103 5.102 1.00 39.63 O ATOM 2186 HA SER A 342 10.648 21.463 7.251 1.00 0.00 H ATOM 2187 HB2 SER A 342 10.542 22.736 5.285 1.00 0.00 H ATOM 2188 HB3 SER A 342 10.797 21.321 4.237 1.00 0.00 H ATOM 2189 HG SER A 342 12.658 22.703 4.334 1.00 0.00 H ATOM 2190 H SER A 342 12.469 20.104 7.469 1.00 0.00 H ATOM 2191 N GLU A 343 9.035 19.335 6.981 1.00 36.61 N ATOM 2192 CA GLU A 343 7.789 18.589 6.797 1.00 40.54 C ATOM 2193 C GLU A 343 7.767 17.736 5.524 1.00 39.30 C ATOM 2194 O GLU A 343 6.688 17.433 5.003 1.00 40.74 O ATOM 2195 CB GLU A 343 6.605 19.559 6.724 1.00 44.95 C ATOM 2196 CG GLU A 343 6.577 20.676 7.759 1.00 52.48 C ATOM 2197 CD GLU A 343 5.517 21.731 7.432 1.00 57.10 C ATOM 2198 OE1 GLU A 343 5.778 22.598 6.572 1.00 57.80 O ATOM 2199 OE2 GLU A 343 4.412 21.677 8.021 1.00 60.93 O ATOM 2200 HA GLU A 343 7.716 17.921 7.655 1.00 0.00 H ATOM 2201 HB2 GLU A 343 6.616 20.022 5.737 1.00 0.00 H ATOM 2202 HB3 GLU A 343 5.691 18.976 6.841 1.00 0.00 H ATOM 2203 HG2 GLU A 343 6.357 20.246 8.736 1.00 0.00 H ATOM 2204 HG3 GLU A 343 7.555 21.156 7.787 1.00 0.00 H ATOM 2205 H GLU A 343 9.556 19.244 7.876 1.00 0.00 H ATOM 2206 N GLY A 344 8.936 17.375 5.006 1.00 37.11 N ATOM 2207 CA GLY A 344 8.988 16.559 3.804 1.00 36.83 C ATOM 2208 C GLY A 344 9.127 17.287 2.467 1.00 35.55 C ATOM 2209 O GLY A 344 9.197 16.647 1.423 1.00 35.55 O ATOM 2210 HA3 GLY A 344 8.069 15.975 3.765 1.00 0.00 H ATOM 2211 HA2 GLY A 344 9.840 15.887 3.901 1.00 0.00 H ATOM 2212 H GLY A 344 9.819 17.678 5.463 1.00 0.00 H ATOM 2213 N GLN A 345 9.180 18.613 2.485 1.00 36.01 N ATOM 2214 CA GLN A 345 9.309 19.394 1.249 1.00 35.51 C ATOM 2215 C GLN A 345 10.739 19.375 0.721 1.00 34.11 C ATOM 2216 O GLN A 345 10.985 19.649 -0.456 1.00 36.66 O ATOM 2217 CB GLN A 345 8.910 20.844 1.496 1.00 36.81 C ATOM 2218 CG GLN A 345 7.591 21.032 2.184 1.00 39.70 C ATOM 2219 CD GLN A 345 7.379 22.474 2.592 1.00 44.24 C ATOM 2220 OE1 GLN A 345 7.396 23.376 1.752 1.00 47.82 O ATOM 2221 NE2 GLN A 345 7.183 22.704 3.889 1.00 42.83 N ATOM 2222 HA GLN A 345 8.649 18.938 0.511 1.00 0.00 H ATOM 2223 HB2 GLN A 345 9.681 21.307 2.112 1.00 0.00 H ATOM 2224 HB3 GLN A 345 8.864 21.351 0.532 1.00 0.00 H ATOM 2225 HG2 GLN A 345 6.792 20.734 1.505 1.00 0.00 H ATOM 2226 HG3 GLN A 345 7.563 20.404 3.074 1.00 0.00 H ATOM 2227 HE22 GLN A 345 7.177 21.912 4.562 1.00 0.00 H ATOM 2228 HE21 GLN A 345 7.036 23.676 4.228 1.00 0.00 H ATOM 2229 H GLN A 345 9.129 19.111 3.397 1.00 0.00 H ATOM 2230 N GLY A 346 11.686 19.066 1.599 1.00 33.40 N ATOM 2231 CA GLY A 346 13.078 19.030 1.190 1.00 31.03 C ATOM 2232 C GLY A 346 13.728 17.724 1.578 1.00 31.08 C ATOM 2233 O GLY A 346 13.168 16.950 2.352 1.00 31.32 O ATOM 2234 HA3 GLY A 346 13.611 19.850 1.671 1.00 0.00 H ATOM 2235 HA2 GLY A 346 13.134 19.148 0.108 1.00 0.00 H ATOM 2236 H GLY A 346 11.429 18.849 2.583 1.00 0.00 H ATOM 2237 N PHE A 347 14.910 17.475 1.032 1.00 30.38 N ATOM 2238 CA PHE A 347 15.657 16.260 1.321 1.00 30.09 C ATOM 2239 C PHE A 347 17.114 16.684 1.368 1.00 31.48 C ATOM 2240 O PHE A 347 17.654 17.169 0.380 1.00 33.07 O ATOM 2241 CB PHE A 347 15.447 15.230 0.201 1.00 27.28 C ATOM 2242 CG PHE A 347 16.166 13.918 0.420 1.00 26.11 C ATOM 2243 CD1 PHE A 347 15.653 12.960 1.293 1.00 24.54 C ATOM 2244 CD2 PHE A 347 17.326 13.617 -0.296 1.00 26.85 C ATOM 2245 CE1 PHE A 347 16.277 11.712 1.445 1.00 27.17 C ATOM 2246 CE2 PHE A 347 17.969 12.365 -0.155 1.00 25.74 C ATOM 2247 CZ PHE A 347 17.443 11.411 0.714 1.00 26.51 C ATOM 2248 HA PHE A 347 15.335 15.798 2.254 1.00 0.00 H ATOM 2249 HB2 PHE A 347 14.379 15.025 0.121 1.00 0.00 H ATOM 2250 HB3 PHE A 347 15.804 15.663 -0.733 1.00 0.00 H ATOM 2251 HD2 PHE A 347 17.744 14.360 -0.976 1.00 0.00 H ATOM 2252 HE2 PHE A 347 18.873 12.147 -0.724 1.00 0.00 H ATOM 2253 HZ PHE A 347 17.929 10.442 0.827 1.00 0.00 H ATOM 2254 HE1 PHE A 347 15.859 10.974 2.130 1.00 0.00 H ATOM 2255 HD1 PHE A 347 14.753 13.184 1.866 1.00 0.00 H ATOM 2256 H PHE A 347 15.317 18.171 0.375 1.00 0.00 H ATOM 2257 N MET A 348 17.746 16.511 2.517 1.00 33.16 N ATOM 2258 CA MET A 348 19.142 16.882 2.666 1.00 34.78 C ATOM 2259 C MET A 348 20.018 15.626 2.632 1.00 35.67 C ATOM 2260 O MET A 348 19.842 14.697 3.426 1.00 34.97 O ATOM 2261 CB MET A 348 19.335 17.652 3.981 1.00 36.32 C ATOM 2262 CG MET A 348 20.659 18.390 4.102 1.00 38.63 C ATOM 2263 SD MET A 348 20.673 19.525 5.542 1.00 42.46 S ATOM 2264 CE MET A 348 19.774 20.901 4.863 1.00 40.50 C ATOM 2265 HA MET A 348 19.439 17.530 1.841 1.00 0.00 H ATOM 2266 HB2 MET A 348 18.531 18.383 4.067 1.00 0.00 H ATOM 2267 HB3 MET A 348 19.267 16.940 4.804 1.00 0.00 H ATOM 2268 HG2 MET A 348 20.825 18.969 3.194 1.00 0.00 H ATOM 2269 HG3 MET A 348 21.461 17.661 4.219 1.00 0.00 H ATOM 2270 HE1 MET A 348 20.304 21.285 3.991 1.00 0.00 H ATOM 2271 HE2 MET A 348 18.777 20.572 4.568 1.00 0.00 H ATOM 2272 HE3 MET A 348 19.691 21.686 5.615 1.00 0.00 H ATOM 2273 H MET A 348 17.235 16.103 3.326 1.00 0.00 H ATOM 2274 N THR A 349 20.961 15.625 1.699 1.00 33.23 N ATOM 2275 CA THR A 349 21.885 14.525 1.479 1.00 33.93 C ATOM 2276 C THR A 349 22.801 14.138 2.661 1.00 34.87 C ATOM 2277 O THR A 349 23.323 14.995 3.383 1.00 32.47 O ATOM 2278 CB THR A 349 22.739 14.849 0.240 1.00 33.02 C ATOM 2279 OG1 THR A 349 21.991 14.536 -0.945 1.00 39.52 O ATOM 2280 CG2 THR A 349 24.021 14.093 0.250 1.00 38.83 C ATOM 2281 HA THR A 349 21.256 13.645 1.342 1.00 0.00 H ATOM 2282 HB THR A 349 22.982 15.911 0.255 1.00 0.00 H ATOM 2283 HG1 THR A 349 22.538 14.743 -1.744 1.00 0.00 H ATOM 2284 HG23 THR A 349 24.579 14.339 1.153 1.00 0.00 H ATOM 2285 HG21 THR A 349 23.811 13.024 0.231 1.00 0.00 H ATOM 2286 HG22 THR A 349 24.609 14.365 -0.627 1.00 0.00 H ATOM 2287 H THR A 349 21.044 16.462 1.088 1.00 0.00 H ATOM 2288 N ARG A 350 22.986 12.832 2.841 1.00 32.61 N ATOM 2289 CA ARG A 350 23.837 12.307 3.892 1.00 34.83 C ATOM 2290 C ARG A 350 25.274 12.804 3.712 1.00 36.84 C ATOM 2291 O ARG A 350 25.946 13.167 4.678 1.00 34.22 O ATOM 2292 CB ARG A 350 23.826 10.781 3.845 1.00 35.32 C ATOM 2293 CG ARG A 350 24.783 10.104 4.818 1.00 33.09 C ATOM 2294 CD ARG A 350 24.587 8.591 4.759 1.00 32.06 C ATOM 2295 NE ARG A 350 25.345 7.869 5.780 1.00 29.51 N ATOM 2296 CZ ARG A 350 25.276 6.552 5.959 1.00 33.30 C ATOM 2297 NH1 ARG A 350 24.486 5.819 5.187 1.00 33.90 N ATOM 2298 NH2 ARG A 350 25.997 5.959 6.907 1.00 34.83 N ATOM 2299 HA ARG A 350 23.457 12.652 4.854 1.00 0.00 H ATOM 2300 HB2 ARG A 350 22.815 10.442 4.072 1.00 0.00 H ATOM 2301 HB3 ARG A 350 24.094 10.471 2.835 1.00 0.00 H ATOM 2302 HG2 ARG A 350 25.810 10.348 4.546 1.00 0.00 H ATOM 2303 HG3 ARG A 350 24.582 10.457 5.830 1.00 0.00 H ATOM 2304 HD2 ARG A 350 24.905 8.239 3.778 1.00 0.00 H ATOM 2305 HD3 ARG A 350 23.528 8.374 4.896 1.00 0.00 H ATOM 2306 HE ARG A 350 25.974 8.416 6.402 1.00 0.00 H ATOM 2307 HH12 ARG A 350 24.432 4.790 5.327 1.00 0.00 H ATOM 2308 HH11 ARG A 350 23.920 6.273 4.442 1.00 0.00 H ATOM 2309 HH22 ARG A 350 25.936 4.929 7.039 1.00 0.00 H ATOM 2310 HH21 ARG A 350 26.621 6.525 7.516 1.00 0.00 H ATOM 2311 H ARG A 350 22.503 12.165 2.206 1.00 0.00 H ATOM 2312 N GLU A 351 25.723 12.810 2.460 1.00 38.40 N ATOM 2313 CA GLU A 351 27.067 13.240 2.101 1.00 41.85 C ATOM 2314 C GLU A 351 27.273 14.739 2.351 1.00 41.63 C ATOM 2315 O GLU A 351 28.345 15.156 2.770 1.00 41.02 O ATOM 2316 CB GLU A 351 27.325 12.920 0.627 1.00 44.16 C ATOM 2317 CG GLU A 351 28.710 12.410 0.353 1.00 50.17 C ATOM 2318 CD GLU A 351 28.950 11.059 0.994 1.00 53.65 C ATOM 2319 OE1 GLU A 351 28.340 10.078 0.524 1.00 56.45 O ATOM 2320 OE2 GLU A 351 29.735 10.978 1.967 1.00 53.75 O ATOM 2321 HA GLU A 351 27.774 12.701 2.732 1.00 0.00 H ATOM 2322 HB2 GLU A 351 26.610 12.162 0.309 1.00 0.00 H ATOM 2323 HB3 GLU A 351 27.171 13.829 0.045 1.00 0.00 H ATOM 2324 HG2 GLU A 351 28.846 12.318 -0.725 1.00 0.00 H ATOM 2325 HG3 GLU A 351 29.433 13.122 0.750 1.00 0.00 H ATOM 2326 H GLU A 351 25.085 12.493 1.703 1.00 0.00 H ATOM 2327 N PHE A 352 26.250 15.547 2.080 1.00 41.53 N ATOM 2328 CA PHE A 352 26.351 16.987 2.305 1.00 42.13 C ATOM 2329 C PHE A 352 26.553 17.219 3.797 1.00 44.32 C ATOM 2330 O PHE A 352 27.439 17.968 4.205 1.00 45.81 O ATOM 2331 CB PHE A 352 25.074 17.697 1.848 1.00 39.82 C ATOM 2332 CG PHE A 352 25.033 19.165 2.187 1.00 39.18 C ATOM 2333 CD1 PHE A 352 25.970 20.044 1.662 1.00 41.47 C ATOM 2334 CD2 PHE A 352 24.039 19.674 3.007 1.00 40.23 C ATOM 2335 CE1 PHE A 352 25.912 21.416 1.949 1.00 40.80 C ATOM 2336 CE2 PHE A 352 23.970 21.043 3.302 1.00 39.82 C ATOM 2337 CZ PHE A 352 24.906 21.910 2.771 1.00 39.94 C ATOM 2338 HA PHE A 352 27.188 17.388 1.733 1.00 0.00 H ATOM 2339 HB2 PHE A 352 24.992 17.592 0.766 1.00 0.00 H ATOM 2340 HB3 PHE A 352 24.222 17.211 2.324 1.00 0.00 H ATOM 2341 HD2 PHE A 352 23.297 18.998 3.431 1.00 0.00 H ATOM 2342 HE2 PHE A 352 23.179 21.423 3.949 1.00 0.00 H ATOM 2343 HZ PHE A 352 24.856 22.975 2.996 1.00 0.00 H ATOM 2344 HE1 PHE A 352 26.655 22.094 1.528 1.00 0.00 H ATOM 2345 HD1 PHE A 352 26.762 19.663 1.018 1.00 0.00 H ATOM 2346 H PHE A 352 25.367 15.148 1.703 1.00 0.00 H ATOM 2347 N LEU A 353 25.719 16.564 4.601 1.00 44.02 N ATOM 2348 CA LEU A 353 25.779 16.672 6.052 1.00 45.68 C ATOM 2349 C LEU A 353 27.134 16.291 6.625 1.00 47.51 C ATOM 2350 O LEU A 353 27.660 16.979 7.503 1.00 46.16 O ATOM 2351 CB LEU A 353 24.703 15.793 6.688 1.00 42.09 C ATOM 2352 CG LEU A 353 23.323 16.444 6.714 1.00 43.16 C ATOM 2353 CD1 LEU A 353 22.241 15.389 6.882 1.00 39.68 C ATOM 2354 CD2 LEU A 353 23.290 17.485 7.846 1.00 42.92 C ATOM 2355 HA LEU A 353 25.608 17.722 6.289 1.00 0.00 H ATOM 2356 HB2 LEU A 353 24.636 14.864 6.121 1.00 0.00 H ATOM 2357 HB3 LEU A 353 25.000 15.571 7.713 1.00 0.00 H ATOM 2358 HG LEU A 353 23.128 16.950 5.768 1.00 0.00 H ATOM 2359 HD21 LEU A 353 23.485 16.991 8.798 1.00 0.00 H ATOM 2360 HD22 LEU A 353 24.054 18.241 7.665 1.00 0.00 H ATOM 2361 HD23 LEU A 353 22.308 17.958 7.875 1.00 0.00 H ATOM 2362 HD11 LEU A 353 22.287 14.687 6.049 1.00 0.00 H ATOM 2363 HD12 LEU A 353 22.399 14.854 7.819 1.00 0.00 H ATOM 2364 HD13 LEU A 353 21.264 15.872 6.898 1.00 0.00 H ATOM 2365 H LEU A 353 24.995 15.950 4.176 1.00 0.00 H ATOM 2366 N LYS A 354 27.695 15.194 6.124 1.00 48.81 N ATOM 2367 CA LYS A 354 28.978 14.711 6.608 1.00 50.12 C ATOM 2368 C LYS A 354 30.145 15.613 6.189 1.00 50.15 C ATOM 2369 O LYS A 354 31.247 15.480 6.706 1.00 49.86 O ATOM 2370 CB LYS A 354 29.200 13.277 6.118 1.00 52.16 C ATOM 2371 CG LYS A 354 30.333 12.532 6.812 1.00 55.50 C ATOM 2372 CD LYS A 354 30.390 11.067 6.378 1.00 57.43 C ATOM 2373 CE LYS A 354 30.726 10.928 4.898 1.00 59.75 C ATOM 2374 NZ LYS A 354 30.658 9.510 4.441 1.00 60.97 N ATOM 2375 HA LYS A 354 28.950 14.730 7.697 1.00 0.00 H ATOM 2376 HB2 LYS A 354 28.278 12.717 6.278 1.00 0.00 H ATOM 2377 HB3 LYS A 354 29.421 13.313 5.051 1.00 0.00 H ATOM 2378 HG2 LYS A 354 31.279 13.013 6.562 1.00 0.00 H ATOM 2379 HG3 LYS A 354 30.178 12.576 7.890 1.00 0.00 H ATOM 2380 HD2 LYS A 354 31.154 10.555 6.963 1.00 0.00 H ATOM 2381 HD3 LYS A 354 29.420 10.605 6.565 1.00 0.00 H ATOM 2382 HE2 LYS A 354 31.735 11.305 4.729 1.00 0.00 H ATOM 2383 HE3 LYS A 354 30.017 11.519 4.319 1.00 0.00 H ATOM 2384 HZ1 LYS A 354 31.337 8.939 4.984 1.00 0.00 H ATOM 2385 HZ2 LYS A 354 29.696 9.144 4.592 1.00 0.00 H ATOM 2386 HZ3 LYS A 354 30.894 9.461 3.429 1.00 0.00 H ATOM 2387 H LYS A 354 27.206 14.671 5.370 1.00 0.00 H ATOM 2388 N SER A 355 29.899 16.542 5.269 1.00 50.86 N ATOM 2389 CA SER A 355 30.957 17.442 4.806 1.00 51.37 C ATOM 2390 C SER A 355 30.947 18.805 5.509 1.00 52.02 C ATOM 2391 O SER A 355 31.638 19.733 5.089 1.00 51.80 O ATOM 2392 CB SER A 355 30.849 17.661 3.296 1.00 47.86 C ATOM 2393 OG SER A 355 29.675 18.385 2.977 1.00 48.66 O ATOM 2394 HA SER A 355 31.898 16.951 5.056 1.00 0.00 H ATOM 2395 HB2 SER A 355 30.820 16.693 2.795 1.00 0.00 H ATOM 2396 HB3 SER A 355 31.719 18.221 2.952 1.00 0.00 H ATOM 2397 HG SER A 355 28.882 17.878 3.284 1.00 0.00 H ATOM 2398 H SER A 355 28.941 16.630 4.873 1.00 0.00 H ATOM 2399 N LEU A 356 30.163 18.931 6.571 1.00 51.99 N ATOM 2400 CA LEU A 356 30.106 20.192 7.300 1.00 53.76 C ATOM 2401 C LEU A 356 31.341 20.361 8.189 1.00 55.42 C ATOM 2402 O LEU A 356 32.068 19.396 8.436 1.00 55.58 O ATOM 2403 CB LEU A 356 28.831 20.247 8.143 1.00 50.92 C ATOM 2404 CG LEU A 356 27.558 20.195 7.295 1.00 50.36 C ATOM 2405 CD1 LEU A 356 26.322 20.142 8.184 1.00 46.44 C ATOM 2406 CD2 LEU A 356 27.523 21.410 6.383 1.00 49.22 C ATOM 2407 HA LEU A 356 30.092 21.011 6.580 1.00 0.00 H ATOM 2408 HB2 LEU A 356 28.829 19.399 8.828 1.00 0.00 H ATOM 2409 HB3 LEU A 356 28.831 21.175 8.715 1.00 0.00 H ATOM 2410 HG LEU A 356 27.561 19.291 6.686 1.00 0.00 H ATOM 2411 HD21 LEU A 356 27.526 22.317 6.988 1.00 0.00 H ATOM 2412 HD22 LEU A 356 28.399 21.401 5.734 1.00 0.00 H ATOM 2413 HD23 LEU A 356 26.619 21.381 5.775 1.00 0.00 H ATOM 2414 HD11 LEU A 356 26.365 19.252 8.811 1.00 0.00 H ATOM 2415 HD12 LEU A 356 26.291 21.031 8.814 1.00 0.00 H ATOM 2416 HD13 LEU A 356 25.429 20.106 7.560 1.00 0.00 H ATOM 2417 H LEU A 356 29.585 18.125 6.886 1.00 0.00 H ATOM 2418 N ARG A 357 31.565 21.589 8.662 1.00 58.08 N ATOM 2419 CA ARG A 357 32.708 21.924 9.519 1.00 60.29 C ATOM 2420 C ARG A 357 33.106 20.827 10.495 1.00 59.85 C ATOM 2421 O ARG A 357 32.256 20.205 11.121 1.00 60.48 O ATOM 2422 CB ARG A 357 32.431 23.199 10.320 1.00 62.94 C ATOM 2423 CG ARG A 357 33.539 23.530 11.325 1.00 65.37 C ATOM 2424 CD ARG A 357 33.037 24.415 12.454 1.00 67.29 C ATOM 2425 NE ARG A 357 32.676 25.753 12.003 1.00 67.40 N ATOM 2426 CZ ARG A 357 32.080 26.655 12.774 1.00 69.16 C ATOM 2427 NH1 ARG A 357 31.778 26.351 14.027 1.00 69.57 N ATOM 2428 NH2 ARG A 357 31.802 27.865 12.303 1.00 70.93 N ATOM 2429 HA ARG A 357 33.539 22.063 8.828 1.00 0.00 H ATOM 2430 HB2 ARG A 357 32.333 24.032 9.624 1.00 0.00 H ATOM 2431 HB3 ARG A 357 31.495 23.071 10.864 1.00 0.00 H ATOM 2432 HG2 ARG A 357 33.920 22.601 11.749 1.00 0.00 H ATOM 2433 HG3 ARG A 357 34.345 24.047 10.804 1.00 0.00 H ATOM 2434 HD2 ARG A 357 33.822 24.500 13.206 1.00 0.00 H ATOM 2435 HD3 ARG A 357 32.158 23.948 12.899 1.00 0.00 H ATOM 2436 HE ARG A 357 32.898 26.016 11.022 1.00 0.00 H ATOM 2437 HH12 ARG A 357 31.311 27.054 14.635 1.00 0.00 H ATOM 2438 HH11 ARG A 357 32.008 25.409 14.403 1.00 0.00 H ATOM 2439 HH22 ARG A 357 31.335 28.566 12.913 1.00 0.00 H ATOM 2440 HH21 ARG A 357 32.051 28.112 11.324 1.00 0.00 H ATOM 2441 H ARG A 357 30.897 22.345 8.411 1.00 0.00 H ATOM 2442 N LYS A 358 34.415 20.637 10.627 1.00 60.75 N ATOM 2443 CA LYS A 358 35.031 19.635 11.498 1.00 61.67 C ATOM 2444 C LYS A 358 34.127 18.922 12.500 1.00 61.45 C ATOM 2445 O LYS A 358 33.938 17.704 12.408 1.00 64.31 O ATOM 2446 CB LYS A 358 36.221 20.254 12.242 1.00 62.21 C ATOM 2447 CG LYS A 358 37.203 20.997 11.341 1.00 63.89 C ATOM 2448 CD LYS A 358 37.706 20.112 10.208 1.00 63.82 C ATOM 2449 CE LYS A 358 38.797 20.804 9.414 1.00 63.67 C ATOM 2450 NZ LYS A 358 39.380 19.909 8.374 1.00 64.94 N ATOM 2451 HA LYS A 358 35.332 18.848 10.806 1.00 0.00 H ATOM 2452 HB2 LYS A 358 35.835 20.957 12.980 1.00 0.00 H ATOM 2453 HB3 LYS A 358 36.760 19.455 12.750 1.00 0.00 H ATOM 2454 HG2 LYS A 358 36.704 21.867 10.915 1.00 0.00 H ATOM 2455 HG3 LYS A 358 38.054 21.324 11.939 1.00 0.00 H ATOM 2456 HD2 LYS A 358 38.103 19.188 10.628 1.00 0.00 H ATOM 2457 HD3 LYS A 358 36.875 19.879 9.542 1.00 0.00 H ATOM 2458 HE2 LYS A 358 39.588 21.113 10.097 1.00 0.00 H ATOM 2459 HE3 LYS A 358 38.375 21.683 8.927 1.00 0.00 H ATOM 2460 HZ1 LYS A 358 39.791 19.070 8.831 1.00 0.00 H ATOM 2461 HZ2 LYS A 358 38.633 19.614 7.714 1.00 0.00 H ATOM 2462 HZ3 LYS A 358 40.122 20.420 7.854 1.00 0.00 H ATOM 2463 H LYS A 358 35.048 21.245 10.070 1.00 0.00 H ATOM 2464 N PRO A 359 33.562 19.655 13.476 1.00 59.75 N ATOM 2465 CA PRO A 359 32.697 18.956 14.434 1.00 58.55 C ATOM 2466 C PRO A 359 31.276 18.664 13.934 1.00 57.10 C ATOM 2467 O PRO A 359 30.760 17.563 14.138 1.00 57.73 O ATOM 2468 CB PRO A 359 32.721 19.880 15.649 1.00 57.61 C ATOM 2469 CG PRO A 359 32.791 21.232 15.024 1.00 58.16 C ATOM 2470 CD PRO A 359 33.780 21.056 13.884 1.00 58.16 C ATOM 2471 HA PRO A 359 33.060 17.949 14.640 1.00 0.00 H ATOM 2472 HD3 PRO A 359 33.562 21.742 13.065 1.00 0.00 H ATOM 2473 HD2 PRO A 359 34.804 21.211 14.224 1.00 0.00 H ATOM 2474 HG3 PRO A 359 33.150 21.972 15.739 1.00 0.00 H ATOM 2475 HG2 PRO A 359 31.815 21.537 14.647 1.00 0.00 H ATOM 2476 HB2 PRO A 359 31.817 19.768 16.247 1.00 0.00 H ATOM 2477 HB3 PRO A 359 33.594 19.688 16.273 1.00 0.00 H ATOM 2478 N PHE A 360 30.648 19.640 13.282 1.00 54.11 N ATOM 2479 CA PHE A 360 29.287 19.462 12.780 1.00 51.85 C ATOM 2480 C PHE A 360 29.160 18.362 11.725 1.00 51.78 C ATOM 2481 O PHE A 360 28.095 17.765 11.564 1.00 49.72 O ATOM 2482 CB PHE A 360 28.759 20.775 12.201 1.00 47.76 C ATOM 2483 CG PHE A 360 28.605 21.861 13.218 1.00 48.97 C ATOM 2484 CD1 PHE A 360 29.509 22.916 13.275 1.00 49.73 C ATOM 2485 CD2 PHE A 360 27.576 21.813 14.146 1.00 49.29 C ATOM 2486 CE1 PHE A 360 29.390 23.905 14.244 1.00 49.17 C ATOM 2487 CE2 PHE A 360 27.447 22.795 15.120 1.00 49.30 C ATOM 2488 CZ PHE A 360 28.356 23.844 15.170 1.00 50.24 C ATOM 2489 HA PHE A 360 28.691 19.153 13.639 1.00 0.00 H ATOM 2490 HB2 PHE A 360 29.454 21.117 11.434 1.00 0.00 H ATOM 2491 HB3 PHE A 360 27.785 20.585 11.749 1.00 0.00 H ATOM 2492 HD2 PHE A 360 26.858 20.993 14.111 1.00 0.00 H ATOM 2493 HE2 PHE A 360 26.634 22.742 15.844 1.00 0.00 H ATOM 2494 HZ PHE A 360 28.259 24.616 15.933 1.00 0.00 H ATOM 2495 HE1 PHE A 360 30.106 24.726 14.277 1.00 0.00 H ATOM 2496 HD1 PHE A 360 30.322 22.968 12.550 1.00 0.00 H ATOM 2497 H PHE A 360 31.135 20.546 13.127 1.00 0.00 H ATOM 2498 N GLY A 361 30.254 18.089 11.021 1.00 51.69 N ATOM 2499 CA GLY A 361 30.231 17.086 9.973 1.00 51.56 C ATOM 2500 C GLY A 361 29.936 15.658 10.390 1.00 51.97 C ATOM 2501 O GLY A 361 29.764 14.793 9.533 1.00 53.15 O ATOM 2502 HA3 GLY A 361 31.208 17.092 9.491 1.00 0.00 H ATOM 2503 HA2 GLY A 361 29.469 17.382 9.252 1.00 0.00 H ATOM 2504 H GLY A 361 31.137 18.600 11.224 1.00 0.00 H ATOM 2505 N ASP A 362 29.875 15.389 11.689 1.00 51.64 N ATOM 2506 CA ASP A 362 29.600 14.031 12.133 1.00 52.06 C ATOM 2507 C ASP A 362 28.494 13.903 13.172 1.00 48.88 C ATOM 2508 O ASP A 362 28.454 12.939 13.931 1.00 47.45 O ATOM 2509 CB ASP A 362 30.886 13.376 12.654 1.00 56.38 C ATOM 2510 CG ASP A 362 31.664 14.276 13.578 1.00 59.82 C ATOM 2511 OD1 ASP A 362 31.051 14.826 14.518 1.00 62.39 O ATOM 2512 OD2 ASP A 362 32.890 14.427 13.367 1.00 62.33 O ATOM 2513 HA ASP A 362 29.229 13.511 11.250 1.00 0.00 H ATOM 2514 HB2 ASP A 362 30.621 12.467 13.194 1.00 0.00 H ATOM 2515 HB3 ASP A 362 31.517 13.120 11.803 1.00 0.00 H ATOM 2516 H ASP A 362 30.023 16.146 12.386 1.00 0.00 H ATOM 2517 N PHE A 363 27.595 14.876 13.207 1.00 46.53 N ATOM 2518 CA PHE A 363 26.488 14.825 14.144 1.00 47.26 C ATOM 2519 C PHE A 363 25.427 13.827 13.682 1.00 45.63 C ATOM 2520 O PHE A 363 24.849 13.111 14.495 1.00 45.27 O ATOM 2521 CB PHE A 363 25.845 16.209 14.288 1.00 50.94 C ATOM 2522 CG PHE A 363 26.158 16.892 15.592 1.00 55.74 C ATOM 2523 CD1 PHE A 363 25.642 16.401 16.791 1.00 56.14 C ATOM 2524 CD2 PHE A 363 26.978 18.018 15.626 1.00 56.18 C ATOM 2525 CE1 PHE A 363 25.942 17.022 18.006 1.00 57.44 C ATOM 2526 CE2 PHE A 363 27.282 18.644 16.837 1.00 57.54 C ATOM 2527 CZ PHE A 363 26.762 18.144 18.029 1.00 56.13 C ATOM 2528 HA PHE A 363 26.884 14.504 15.107 1.00 0.00 H ATOM 2529 HB2 PHE A 363 26.202 16.840 13.475 1.00 0.00 H ATOM 2530 HB3 PHE A 363 24.764 16.096 14.210 1.00 0.00 H ATOM 2531 HD2 PHE A 363 27.387 18.415 14.697 1.00 0.00 H ATOM 2532 HE2 PHE A 363 27.926 19.523 16.850 1.00 0.00 H ATOM 2533 HZ PHE A 363 26.997 18.631 18.976 1.00 0.00 H ATOM 2534 HE1 PHE A 363 25.533 16.627 18.936 1.00 0.00 H ATOM 2535 HD1 PHE A 363 24.997 15.522 16.780 1.00 0.00 H ATOM 2536 H PHE A 363 27.684 15.683 12.557 1.00 0.00 H ATOM 2537 N MET A 364 25.197 13.769 12.372 1.00 43.95 N ATOM 2538 CA MET A 364 24.174 12.898 11.801 1.00 43.07 C ATOM 2539 C MET A 364 24.556 11.476 11.375 1.00 42.79 C ATOM 2540 O MET A 364 23.701 10.586 11.379 1.00 40.40 O ATOM 2541 CB MET A 364 23.518 13.602 10.617 1.00 41.63 C ATOM 2542 CG MET A 364 22.729 14.846 10.993 1.00 42.99 C ATOM 2543 SD MET A 364 21.377 14.501 12.135 1.00 47.57 S ATOM 2544 CE MET A 364 20.234 13.668 11.077 1.00 41.80 C ATOM 2545 HA MET A 364 23.509 12.731 12.648 1.00 0.00 H ATOM 2546 HB2 MET A 364 24.300 13.892 9.915 1.00 0.00 H ATOM 2547 HB3 MET A 364 22.839 12.899 10.134 1.00 0.00 H ATOM 2548 HG2 MET A 364 22.314 15.283 10.085 1.00 0.00 H ATOM 2549 HG3 MET A 364 23.407 15.560 11.461 1.00 0.00 H ATOM 2550 HE1 MET A 364 19.951 14.329 10.258 1.00 0.00 H ATOM 2551 HE2 MET A 364 20.702 12.769 10.675 1.00 0.00 H ATOM 2552 HE3 MET A 364 19.347 13.394 11.647 1.00 0.00 H ATOM 2553 H MET A 364 25.765 14.363 11.735 1.00 0.00 H ATOM 2554 N GLU A 365 25.819 11.259 11.018 1.00 41.76 N ATOM 2555 CA GLU A 365 26.274 9.943 10.563 1.00 42.13 C ATOM 2556 C GLU A 365 25.836 8.785 11.479 1.00 42.03 C ATOM 2557 O GLU A 365 25.395 7.733 11.011 1.00 41.36 O ATOM 2558 CB GLU A 365 27.796 9.958 10.404 1.00 44.33 C ATOM 2559 CG GLU A 365 28.360 8.826 9.569 1.00 47.07 C ATOM 2560 CD GLU A 365 27.743 8.762 8.193 1.00 48.05 C ATOM 2561 OE1 GLU A 365 27.311 9.814 7.682 1.00 49.22 O ATOM 2562 OE2 GLU A 365 27.698 7.660 7.614 1.00 50.61 O ATOM 2563 HA GLU A 365 25.795 9.756 9.602 1.00 0.00 H ATOM 2564 HB2 GLU A 365 28.079 10.900 9.934 1.00 0.00 H ATOM 2565 HB3 GLU A 365 28.241 9.901 11.397 1.00 0.00 H ATOM 2566 HG2 GLU A 365 29.435 8.970 9.464 1.00 0.00 H ATOM 2567 HG3 GLU A 365 28.169 7.884 10.082 1.00 0.00 H ATOM 2568 H GLU A 365 26.500 12.043 11.063 1.00 0.00 H ATOM 2569 N PRO A 366 25.962 8.953 12.799 1.00 41.55 N ATOM 2570 CA PRO A 366 25.524 7.828 13.631 1.00 41.01 C ATOM 2571 C PRO A 366 24.004 7.610 13.610 1.00 40.68 C ATOM 2572 O PRO A 366 23.525 6.511 13.910 1.00 39.08 O ATOM 2573 CB PRO A 366 26.072 8.178 15.018 1.00 41.49 C ATOM 2574 CG PRO A 366 26.240 9.674 14.972 1.00 42.97 C ATOM 2575 CD PRO A 366 26.749 9.920 13.581 1.00 42.19 C ATOM 2576 HA PRO A 366 25.898 6.871 13.267 1.00 0.00 H ATOM 2577 HD3 PRO A 366 26.553 10.943 13.261 1.00 0.00 H ATOM 2578 HD2 PRO A 366 27.817 9.716 13.507 1.00 0.00 H ATOM 2579 HG3 PRO A 366 26.961 10.010 15.717 1.00 0.00 H ATOM 2580 HG2 PRO A 366 25.288 10.180 15.135 1.00 0.00 H ATOM 2581 HB2 PRO A 366 25.367 7.890 15.798 1.00 0.00 H ATOM 2582 HB3 PRO A 366 27.028 7.685 15.194 1.00 0.00 H ATOM 2583 N LYS A 367 23.247 8.648 13.256 1.00 39.45 N ATOM 2584 CA LYS A 367 21.794 8.519 13.199 1.00 38.30 C ATOM 2585 C LYS A 367 21.454 7.745 11.924 1.00 36.94 C ATOM 2586 O LYS A 367 20.538 6.924 11.910 1.00 35.93 O ATOM 2587 CB LYS A 367 21.117 9.896 13.174 1.00 39.97 C ATOM 2588 CG LYS A 367 21.786 10.958 14.051 1.00 41.88 C ATOM 2589 CD LYS A 367 22.003 10.483 15.469 1.00 40.31 C ATOM 2590 CE LYS A 367 22.976 11.394 16.213 1.00 42.58 C ATOM 2591 NZ LYS A 367 22.490 12.798 16.384 1.00 41.59 N ATOM 2592 HA LYS A 367 21.432 7.995 14.084 1.00 0.00 H ATOM 2593 HB2 LYS A 367 21.118 10.256 12.145 1.00 0.00 H ATOM 2594 HB3 LYS A 367 20.088 9.774 13.514 1.00 0.00 H ATOM 2595 HG2 LYS A 367 22.752 11.214 13.616 1.00 0.00 H ATOM 2596 HG3 LYS A 367 21.152 11.845 14.072 1.00 0.00 H ATOM 2597 HD2 LYS A 367 21.047 10.479 15.993 1.00 0.00 H ATOM 2598 HD3 LYS A 367 22.408 9.471 15.447 1.00 0.00 H ATOM 2599 HE2 LYS A 367 23.913 11.421 15.657 1.00 0.00 H ATOM 2600 HE3 LYS A 367 23.154 10.970 17.201 1.00 0.00 H ATOM 2601 HZ1 LYS A 367 22.326 13.223 15.449 1.00 0.00 H ATOM 2602 HZ2 LYS A 367 21.601 12.793 16.924 1.00 0.00 H ATOM 2603 HZ3 LYS A 367 23.206 13.351 16.897 1.00 0.00 H ATOM 2604 H LYS A 367 23.694 9.556 13.019 1.00 0.00 H ATOM 2605 N PHE A 368 22.209 8.013 10.862 1.00 36.24 N ATOM 2606 CA PHE A 368 22.024 7.341 9.581 1.00 34.54 C ATOM 2607 C PHE A 368 22.369 5.862 9.690 1.00 36.24 C ATOM 2608 O PHE A 368 21.629 5.003 9.203 1.00 35.63 O ATOM 2609 CB PHE A 368 22.925 7.969 8.521 1.00 33.41 C ATOM 2610 CG PHE A 368 22.350 9.190 7.875 1.00 34.93 C ATOM 2611 CD1 PHE A 368 21.242 9.091 7.038 1.00 32.83 C ATOM 2612 CD2 PHE A 368 22.924 10.442 8.090 1.00 35.05 C ATOM 2613 CE1 PHE A 368 20.711 10.219 6.421 1.00 35.08 C ATOM 2614 CE2 PHE A 368 22.404 11.582 7.477 1.00 36.02 C ATOM 2615 CZ PHE A 368 21.293 11.471 6.639 1.00 36.42 C ATOM 2616 HA PHE A 368 20.977 7.451 9.298 1.00 0.00 H ATOM 2617 HB2 PHE A 368 23.869 8.243 8.992 1.00 0.00 H ATOM 2618 HB3 PHE A 368 23.110 7.226 7.745 1.00 0.00 H ATOM 2619 HD2 PHE A 368 23.790 10.531 8.746 1.00 0.00 H ATOM 2620 HE2 PHE A 368 22.863 12.555 7.652 1.00 0.00 H ATOM 2621 HZ PHE A 368 20.881 12.357 6.157 1.00 0.00 H ATOM 2622 HE1 PHE A 368 19.843 10.127 5.769 1.00 0.00 H ATOM 2623 HD1 PHE A 368 20.785 8.117 6.864 1.00 0.00 H ATOM 2624 H PHE A 368 22.959 8.728 10.948 1.00 0.00 H ATOM 2625 N GLU A 369 23.504 5.568 10.319 1.00 37.11 N ATOM 2626 CA GLU A 369 23.946 4.188 10.477 1.00 37.72 C ATOM 2627 C GLU A 369 22.899 3.400 11.229 1.00 36.39 C ATOM 2628 O GLU A 369 22.640 2.231 10.926 1.00 35.79 O ATOM 2629 CB GLU A 369 25.282 4.129 11.227 1.00 40.74 C ATOM 2630 CG GLU A 369 26.468 4.638 10.413 1.00 44.41 C ATOM 2631 CD GLU A 369 27.799 4.453 11.125 1.00 49.02 C ATOM 2632 OE1 GLU A 369 28.149 3.298 11.443 1.00 51.89 O ATOM 2633 OE2 GLU A 369 28.500 5.460 11.365 1.00 52.18 O ATOM 2634 HA GLU A 369 24.087 3.753 9.488 1.00 0.00 H ATOM 2635 HB2 GLU A 369 25.198 4.736 12.128 1.00 0.00 H ATOM 2636 HB3 GLU A 369 25.475 3.093 11.505 1.00 0.00 H ATOM 2637 HG2 GLU A 369 26.500 4.095 9.468 1.00 0.00 H ATOM 2638 HG3 GLU A 369 26.324 5.700 10.215 1.00 0.00 H ATOM 2639 H GLU A 369 24.087 6.338 10.705 1.00 0.00 H ATOM 2640 N PHE A 370 22.291 4.049 12.212 1.00 34.32 N ATOM 2641 CA PHE A 370 21.257 3.411 13.008 1.00 32.83 C ATOM 2642 C PHE A 370 19.992 3.250 12.181 1.00 33.24 C ATOM 2643 O PHE A 370 19.343 2.203 12.208 1.00 31.60 O ATOM 2644 CB PHE A 370 20.934 4.258 14.238 1.00 30.83 C ATOM 2645 CG PHE A 370 19.592 3.953 14.842 1.00 30.52 C ATOM 2646 CD1 PHE A 370 19.352 2.728 15.464 1.00 29.36 C ATOM 2647 CD2 PHE A 370 18.564 4.887 14.785 1.00 27.50 C ATOM 2648 CE1 PHE A 370 18.111 2.441 16.023 1.00 25.94 C ATOM 2649 CE2 PHE A 370 17.322 4.607 15.339 1.00 30.08 C ATOM 2650 CZ PHE A 370 17.097 3.379 15.961 1.00 29.08 C ATOM 2651 HA PHE A 370 21.622 2.434 13.324 1.00 0.00 H ATOM 2652 HB2 PHE A 370 21.701 4.078 14.992 1.00 0.00 H ATOM 2653 HB3 PHE A 370 20.951 5.308 13.948 1.00 0.00 H ATOM 2654 HD2 PHE A 370 18.735 5.848 14.301 1.00 0.00 H ATOM 2655 HE2 PHE A 370 16.523 5.347 15.288 1.00 0.00 H ATOM 2656 HZ PHE A 370 16.123 3.159 16.398 1.00 0.00 H ATOM 2657 HE1 PHE A 370 17.939 1.480 16.508 1.00 0.00 H ATOM 2658 HD1 PHE A 370 20.148 1.985 15.513 1.00 0.00 H ATOM 2659 H PHE A 370 22.559 5.033 12.417 1.00 0.00 H ATOM 2660 N ALA A 371 19.643 4.304 11.454 1.00 32.62 N ATOM 2661 CA ALA A 371 18.439 4.295 10.642 1.00 33.11 C ATOM 2662 C ALA A 371 18.399 3.162 9.614 1.00 32.65 C ATOM 2663 O ALA A 371 17.375 2.487 9.467 1.00 32.22 O ATOM 2664 CB ALA A 371 18.276 5.644 9.947 1.00 30.96 C ATOM 2665 HA ALA A 371 17.606 4.116 11.322 1.00 0.00 H ATOM 2666 HB1 ALA A 371 18.200 6.431 10.697 1.00 0.00 H ATOM 2667 HB2 ALA A 371 19.141 5.830 9.310 1.00 0.00 H ATOM 2668 HB3 ALA A 371 17.371 5.631 9.339 1.00 0.00 H ATOM 2669 H ALA A 371 20.243 5.153 11.466 1.00 0.00 H ATOM 2670 N VAL A 372 19.503 2.951 8.905 1.00 32.67 N ATOM 2671 CA VAL A 372 19.553 1.914 7.877 1.00 35.17 C ATOM 2672 C VAL A 372 19.325 0.509 8.438 1.00 35.55 C ATOM 2673 O VAL A 372 18.697 -0.326 7.788 1.00 35.12 O ATOM 2674 CB VAL A 372 20.902 1.955 7.095 1.00 37.65 C ATOM 2675 CG1 VAL A 372 21.030 0.724 6.198 1.00 39.46 C ATOM 2676 CG2 VAL A 372 20.972 3.224 6.245 1.00 32.43 C ATOM 2677 HA VAL A 372 18.733 2.133 7.193 1.00 0.00 H ATOM 2678 HB VAL A 372 21.723 1.957 7.812 1.00 0.00 H ATOM 2679 HG11 VAL A 372 21.000 -0.176 6.812 1.00 0.00 H ATOM 2680 HG12 VAL A 372 20.205 0.707 5.486 1.00 0.00 H ATOM 2681 HG13 VAL A 372 21.976 0.766 5.658 1.00 0.00 H ATOM 2682 HG21 VAL A 372 20.144 3.231 5.536 1.00 0.00 H ATOM 2683 HG22 VAL A 372 20.904 4.098 6.893 1.00 0.00 H ATOM 2684 HG23 VAL A 372 21.917 3.245 5.702 1.00 0.00 H ATOM 2685 H VAL A 372 20.345 3.534 9.085 1.00 0.00 H ATOM 2686 N LYS A 373 19.830 0.266 9.644 1.00 35.85 N ATOM 2687 CA LYS A 373 19.682 -1.018 10.319 1.00 36.94 C ATOM 2688 C LYS A 373 18.288 -1.111 10.922 1.00 35.69 C ATOM 2689 O LYS A 373 17.652 -2.167 10.902 1.00 36.48 O ATOM 2690 CB LYS A 373 20.730 -1.161 11.432 1.00 39.01 C ATOM 2691 CG LYS A 373 22.171 -1.038 10.931 1.00 44.72 C ATOM 2692 CD LYS A 373 23.201 -1.200 12.046 1.00 44.72 C ATOM 2693 CE LYS A 373 23.046 -0.137 13.132 1.00 48.92 C ATOM 2694 NZ LYS A 373 24.191 -0.156 14.101 1.00 44.25 N ATOM 2695 HA LYS A 373 19.828 -1.818 9.594 1.00 0.00 H ATOM 2696 HB2 LYS A 373 20.554 -0.382 12.174 1.00 0.00 H ATOM 2697 HB3 LYS A 373 20.608 -2.139 11.898 1.00 0.00 H ATOM 2698 HG2 LYS A 373 22.346 -1.809 10.180 1.00 0.00 H ATOM 2699 HG3 LYS A 373 22.300 -0.055 10.478 1.00 0.00 H ATOM 2700 HD2 LYS A 373 23.078 -2.184 12.498 1.00 0.00 H ATOM 2701 HD3 LYS A 373 24.200 -1.121 11.616 1.00 0.00 H ATOM 2702 HE2 LYS A 373 22.120 -0.322 13.677 1.00 0.00 H ATOM 2703 HE3 LYS A 373 22.999 0.845 12.661 1.00 0.00 H ATOM 2704 HZ1 LYS A 373 24.239 -1.088 14.561 1.00 0.00 H ATOM 2705 HZ2 LYS A 373 25.079 0.026 13.591 1.00 0.00 H ATOM 2706 HZ3 LYS A 373 24.046 0.580 14.821 1.00 0.00 H ATOM 2707 H LYS A 373 20.353 1.024 10.127 1.00 0.00 H ATOM 2708 N PHE A 374 17.815 0.000 11.467 1.00 31.48 N ATOM 2709 CA PHE A 374 16.492 0.013 12.058 1.00 30.17 C ATOM 2710 C PHE A 374 15.433 -0.170 10.980 1.00 28.93 C ATOM 2711 O PHE A 374 14.503 -0.954 11.163 1.00 30.06 O ATOM 2712 CB PHE A 374 16.230 1.326 12.796 1.00 28.95 C ATOM 2713 CG PHE A 374 14.994 1.301 13.647 1.00 26.70 C ATOM 2714 CD1 PHE A 374 15.020 0.732 14.920 1.00 26.11 C ATOM 2715 CD2 PHE A 374 13.798 1.825 13.170 1.00 24.94 C ATOM 2716 CE1 PHE A 374 13.871 0.684 15.709 1.00 26.85 C ATOM 2717 CE2 PHE A 374 12.642 1.786 13.944 1.00 27.25 C ATOM 2718 CZ PHE A 374 12.674 1.215 15.219 1.00 27.06 C ATOM 2719 HA PHE A 374 16.440 -0.809 12.772 1.00 0.00 H ATOM 2720 HB2 PHE A 374 17.086 1.538 13.437 1.00 0.00 H ATOM 2721 HB3 PHE A 374 16.125 2.121 12.058 1.00 0.00 H ATOM 2722 HD2 PHE A 374 13.765 2.272 12.177 1.00 0.00 H ATOM 2723 HE2 PHE A 374 11.712 2.201 13.556 1.00 0.00 H ATOM 2724 HZ PHE A 374 11.771 1.184 15.828 1.00 0.00 H ATOM 2725 HE1 PHE A 374 13.906 0.235 16.702 1.00 0.00 H ATOM 2726 HD1 PHE A 374 15.953 0.319 15.304 1.00 0.00 H ATOM 2727 H PHE A 374 18.394 0.864 11.471 1.00 0.00 H ATOM 2728 N ASN A 375 15.572 0.537 9.858 1.00 27.44 N ATOM 2729 CA ASN A 375 14.575 0.428 8.798 1.00 29.13 C ATOM 2730 C ASN A 375 14.507 -0.959 8.154 1.00 30.64 C ATOM 2731 O ASN A 375 13.508 -1.298 7.508 1.00 30.30 O ATOM 2732 CB ASN A 375 14.784 1.511 7.724 1.00 26.35 C ATOM 2733 CG ASN A 375 14.593 2.937 8.274 1.00 26.60 C ATOM 2734 OD1 ASN A 375 13.892 3.154 9.265 1.00 25.02 O ATOM 2735 ND2 ASN A 375 15.212 3.908 7.617 1.00 22.00 N ATOM 2736 HA ASN A 375 13.613 0.587 9.285 1.00 0.00 H ATOM 2737 HB2 ASN A 375 15.796 1.421 7.330 1.00 0.00 H ATOM 2738 HB3 ASN A 375 14.067 1.348 6.920 1.00 0.00 H ATOM 2739 HD22 ASN A 375 15.795 3.684 6.785 1.00 0.00 H ATOM 2740 HD21 ASN A 375 15.115 4.894 7.933 1.00 0.00 H ATOM 2741 H ASN A 375 16.391 1.166 9.738 1.00 0.00 H ATOM 2742 N ALA A 376 15.549 -1.770 8.327 1.00 31.35 N ATOM 2743 CA ALA A 376 15.521 -3.121 7.765 1.00 33.56 C ATOM 2744 C ALA A 376 14.438 -3.933 8.486 1.00 34.46 C ATOM 2745 O ALA A 376 13.987 -4.962 7.986 1.00 36.49 O ATOM 2746 CB ALA A 376 16.877 -3.801 7.922 1.00 32.58 C ATOM 2747 HA ALA A 376 15.296 -3.063 6.700 1.00 0.00 H ATOM 2748 HB1 ALA A 376 17.637 -3.219 7.401 1.00 0.00 H ATOM 2749 HB2 ALA A 376 17.129 -3.865 8.980 1.00 0.00 H ATOM 2750 HB3 ALA A 376 16.831 -4.804 7.497 1.00 0.00 H ATOM 2751 H ALA A 376 16.380 -1.444 8.860 1.00 0.00 H ATOM 2752 N LEU A 377 14.017 -3.466 9.660 1.00 32.77 N ATOM 2753 CA LEU A 377 12.969 -4.158 10.409 1.00 31.74 C ATOM 2754 C LEU A 377 11.612 -3.975 9.742 1.00 29.85 C ATOM 2755 O LEU A 377 10.666 -4.713 10.023 1.00 28.03 O ATOM 2756 CB LEU A 377 12.908 -3.655 11.853 1.00 28.50 C ATOM 2757 CG LEU A 377 14.140 -3.925 12.718 1.00 31.25 C ATOM 2758 CD1 LEU A 377 13.787 -3.652 14.190 1.00 28.21 C ATOM 2759 CD2 LEU A 377 14.600 -5.380 12.544 1.00 30.11 C ATOM 2760 HA LEU A 377 13.216 -5.220 10.417 1.00 0.00 H ATOM 2761 HB2 LEU A 377 12.753 -2.576 11.823 1.00 0.00 H ATOM 2762 HB3 LEU A 377 12.053 -4.130 12.335 1.00 0.00 H ATOM 2763 HG LEU A 377 14.954 -3.268 12.410 1.00 0.00 H ATOM 2764 HD21 LEU A 377 13.797 -6.052 12.846 1.00 0.00 H ATOM 2765 HD22 LEU A 377 14.851 -5.558 11.498 1.00 0.00 H ATOM 2766 HD23 LEU A 377 15.478 -5.559 13.165 1.00 0.00 H ATOM 2767 HD11 LEU A 377 13.479 -2.612 14.302 1.00 0.00 H ATOM 2768 HD12 LEU A 377 12.972 -4.308 14.495 1.00 0.00 H ATOM 2769 HD13 LEU A 377 14.661 -3.842 14.813 1.00 0.00 H ATOM 2770 H LEU A 377 14.439 -2.599 10.049 1.00 0.00 H ATOM 2771 N GLU A 378 11.530 -2.984 8.860 1.00 31.48 N ATOM 2772 CA GLU A 378 10.308 -2.683 8.104 1.00 32.52 C ATOM 2773 C GLU A 378 9.060 -2.484 8.955 1.00 30.41 C ATOM 2774 O GLU A 378 7.983 -2.994 8.641 1.00 31.21 O ATOM 2775 CB GLU A 378 10.060 -3.785 7.067 1.00 34.36 C ATOM 2776 CG GLU A 378 11.251 -4.014 6.141 1.00 39.32 C ATOM 2777 CD GLU A 378 10.950 -4.984 5.007 1.00 45.37 C ATOM 2778 OE1 GLU A 378 10.192 -4.616 4.089 1.00 51.14 O ATOM 2779 OE2 GLU A 378 11.467 -6.119 5.029 1.00 49.09 O ATOM 2780 HA GLU A 378 10.488 -1.722 7.623 1.00 0.00 H ATOM 2781 HB2 GLU A 378 9.845 -4.715 7.593 1.00 0.00 H ATOM 2782 HB3 GLU A 378 9.198 -3.504 6.461 1.00 0.00 H ATOM 2783 HG2 GLU A 378 11.544 -3.057 5.710 1.00 0.00 H ATOM 2784 HG3 GLU A 378 12.076 -4.414 6.730 1.00 0.00 H ATOM 2785 H GLU A 378 12.371 -2.394 8.698 1.00 0.00 H ATOM 2786 N LEU A 379 9.202 -1.743 10.043 1.00 29.38 N ATOM 2787 CA LEU A 379 8.062 -1.487 10.909 1.00 29.51 C ATOM 2788 C LEU A 379 7.198 -0.403 10.279 1.00 28.80 C ATOM 2789 O LEU A 379 7.678 0.373 9.453 1.00 29.66 O ATOM 2790 CB LEU A 379 8.538 -1.007 12.280 1.00 28.96 C ATOM 2791 CG LEU A 379 9.419 -1.946 13.102 1.00 30.33 C ATOM 2792 CD1 LEU A 379 9.749 -1.276 14.441 1.00 29.32 C ATOM 2793 CD2 LEU A 379 8.685 -3.263 13.327 1.00 26.78 C ATOM 2794 HA LEU A 379 7.491 -2.407 11.031 1.00 0.00 H ATOM 2795 HB2 LEU A 379 9.101 -0.087 12.124 1.00 0.00 H ATOM 2796 HB3 LEU A 379 7.650 -0.792 12.875 1.00 0.00 H ATOM 2797 HG LEU A 379 10.348 -2.153 12.570 1.00 0.00 H ATOM 2798 HD21 LEU A 379 7.756 -3.072 13.864 1.00 0.00 H ATOM 2799 HD22 LEU A 379 8.462 -3.722 12.364 1.00 0.00 H ATOM 2800 HD23 LEU A 379 9.314 -3.933 13.914 1.00 0.00 H ATOM 2801 HD11 LEU A 379 10.278 -0.341 14.257 1.00 0.00 H ATOM 2802 HD12 LEU A 379 8.825 -1.071 14.981 1.00 0.00 H ATOM 2803 HD13 LEU A 379 10.378 -1.941 15.033 1.00 0.00 H ATOM 2804 H LEU A 379 10.132 -1.343 10.279 1.00 0.00 H ATOM 2805 N ASP A 380 5.923 -0.357 10.646 1.00 28.95 N ATOM 2806 CA ASP A 380 5.060 0.693 10.126 1.00 31.24 C ATOM 2807 C ASP A 380 4.543 1.504 11.310 1.00 30.08 C ATOM 2808 O ASP A 380 4.764 1.123 12.457 1.00 30.43 O ATOM 2809 CB ASP A 380 3.904 0.127 9.300 1.00 30.04 C ATOM 2810 CG ASP A 380 3.044 -0.815 10.074 1.00 32.38 C ATOM 2811 OD1 ASP A 380 2.838 -0.561 11.275 1.00 32.17 O ATOM 2812 OD2 ASP A 380 2.559 -1.806 9.468 1.00 34.64 O ATOM 2813 HA ASP A 380 5.631 1.330 9.451 1.00 0.00 H ATOM 2814 HB2 ASP A 380 3.287 0.955 8.951 1.00 0.00 H ATOM 2815 HB3 ASP A 380 4.316 -0.403 8.442 1.00 0.00 H ATOM 2816 H ASP A 380 5.543 -1.068 11.302 1.00 0.00 H ATOM 2817 N ASP A 381 3.872 2.619 11.034 1.00 28.00 N ATOM 2818 CA ASP A 381 3.372 3.485 12.090 1.00 27.96 C ATOM 2819 C ASP A 381 2.589 2.755 13.172 1.00 27.94 C ATOM 2820 O ASP A 381 2.712 3.081 14.348 1.00 28.90 O ATOM 2821 CB ASP A 381 2.514 4.606 11.486 1.00 29.86 C ATOM 2822 CG ASP A 381 3.317 5.534 10.593 1.00 30.69 C ATOM 2823 OD1 ASP A 381 4.319 6.101 11.080 1.00 33.43 O ATOM 2824 OD2 ASP A 381 2.955 5.702 9.408 1.00 29.93 O ATOM 2825 HA ASP A 381 4.251 3.901 12.582 1.00 0.00 H ATOM 2826 HB2 ASP A 381 1.716 4.156 10.896 1.00 0.00 H ATOM 2827 HB3 ASP A 381 2.080 5.190 12.297 1.00 0.00 H ATOM 2828 H ASP A 381 3.701 2.877 10.041 1.00 0.00 H ATOM 2829 N SER A 382 1.771 1.777 12.791 1.00 26.51 N ATOM 2830 CA SER A 382 1.004 1.046 13.794 1.00 27.23 C ATOM 2831 C SER A 382 1.951 0.314 14.760 1.00 26.87 C ATOM 2832 O SER A 382 1.625 0.141 15.932 1.00 27.42 O ATOM 2833 CB SER A 382 0.057 0.052 13.134 1.00 24.97 C ATOM 2834 OG SER A 382 0.801 -1.005 12.553 1.00 30.86 O ATOM 2835 HA SER A 382 0.409 1.764 14.358 1.00 0.00 H ATOM 2836 HB2 SER A 382 -0.518 0.559 12.359 1.00 0.00 H ATOM 2837 HB3 SER A 382 -0.623 -0.353 13.883 1.00 0.00 H ATOM 2838 HG SER A 382 1.418 -0.637 11.872 1.00 0.00 H ATOM 2839 H SER A 382 1.679 1.535 11.784 1.00 0.00 H ATOM 2840 N ASP A 383 3.116 -0.113 14.275 1.00 25.67 N ATOM 2841 CA ASP A 383 4.090 -0.787 15.147 1.00 27.24 C ATOM 2842 C ASP A 383 4.857 0.239 16.012 1.00 25.93 C ATOM 2843 O ASP A 383 5.000 0.090 17.235 1.00 20.47 O ATOM 2844 CB ASP A 383 5.129 -1.574 14.323 1.00 24.91 C ATOM 2845 CG ASP A 383 4.505 -2.597 13.391 1.00 25.91 C ATOM 2846 OD1 ASP A 383 3.608 -3.347 13.834 1.00 26.67 O ATOM 2847 OD2 ASP A 383 4.932 -2.661 12.209 1.00 27.65 O ATOM 2848 HA ASP A 383 3.523 -1.470 15.780 1.00 0.00 H ATOM 2849 HB2 ASP A 383 5.705 -0.867 13.726 1.00 0.00 H ATOM 2850 HB3 ASP A 383 5.795 -2.094 15.011 1.00 0.00 H ATOM 2851 H ASP A 383 3.339 0.032 13.270 1.00 0.00 H ATOM 2852 N LEU A 384 5.362 1.275 15.349 1.00 25.84 N ATOM 2853 CA LEU A 384 6.138 2.308 16.015 1.00 26.37 C ATOM 2854 C LEU A 384 5.384 2.958 17.157 1.00 28.41 C ATOM 2855 O LEU A 384 5.954 3.218 18.223 1.00 28.83 O ATOM 2856 CB LEU A 384 6.590 3.356 14.992 1.00 22.90 C ATOM 2857 CG LEU A 384 7.642 2.843 13.994 1.00 23.75 C ATOM 2858 CD1 LEU A 384 7.788 3.791 12.790 1.00 21.33 C ATOM 2859 CD2 LEU A 384 8.972 2.698 14.722 1.00 22.31 C ATOM 2860 HA LEU A 384 7.013 1.830 16.457 1.00 0.00 H ATOM 2861 HB2 LEU A 384 5.716 3.686 14.430 1.00 0.00 H ATOM 2862 HB3 LEU A 384 7.014 4.202 15.532 1.00 0.00 H ATOM 2863 HG LEU A 384 7.321 1.877 13.604 1.00 0.00 H ATOM 2864 HD21 LEU A 384 9.276 3.667 15.117 1.00 0.00 H ATOM 2865 HD22 LEU A 384 8.860 1.989 15.542 1.00 0.00 H ATOM 2866 HD23 LEU A 384 9.728 2.335 14.026 1.00 0.00 H ATOM 2867 HD11 LEU A 384 6.831 3.870 12.273 1.00 0.00 H ATOM 2868 HD12 LEU A 384 8.096 4.776 13.140 1.00 0.00 H ATOM 2869 HD13 LEU A 384 8.540 3.396 12.107 1.00 0.00 H ATOM 2870 H LEU A 384 5.197 1.348 14.325 1.00 0.00 H ATOM 2871 N ALA A 385 4.095 3.193 16.952 1.00 28.78 N ATOM 2872 CA ALA A 385 3.280 3.832 17.970 1.00 29.01 C ATOM 2873 C ALA A 385 3.338 3.115 19.322 1.00 29.10 C ATOM 2874 O ALA A 385 3.374 3.760 20.376 1.00 31.00 O ATOM 2875 CB ALA A 385 1.821 3.956 17.471 1.00 27.73 C ATOM 2876 HA ALA A 385 3.693 4.826 18.139 1.00 0.00 H ATOM 2877 HB1 ALA A 385 1.799 4.556 16.561 1.00 0.00 H ATOM 2878 HB2 ALA A 385 1.424 2.963 17.262 1.00 0.00 H ATOM 2879 HB3 ALA A 385 1.215 4.436 18.239 1.00 0.00 H ATOM 2880 H ALA A 385 3.661 2.915 16.048 1.00 0.00 H ATOM 2881 N ILE A 386 3.349 1.785 19.318 1.00 29.49 N ATOM 2882 CA ILE A 386 3.407 1.059 20.584 1.00 25.42 C ATOM 2883 C ILE A 386 4.835 1.065 21.112 1.00 23.70 C ATOM 2884 O ILE A 386 5.074 1.233 22.310 1.00 22.72 O ATOM 2885 CB ILE A 386 2.936 -0.394 20.440 1.00 25.79 C ATOM 2886 CG1 ILE A 386 1.595 -0.433 19.700 1.00 26.47 C ATOM 2887 CG2 ILE A 386 2.763 -1.012 21.834 1.00 24.62 C ATOM 2888 CD1 ILE A 386 1.083 -1.839 19.397 1.00 27.13 C ATOM 2889 HA ILE A 386 2.737 1.564 21.280 1.00 0.00 H ATOM 2890 HB ILE A 386 3.677 -0.959 19.875 1.00 0.00 H ATOM 2891 HG12 ILE A 386 0.852 0.076 20.314 1.00 0.00 H ATOM 2892 HG13 ILE A 386 1.711 0.099 18.756 1.00 0.00 H ATOM 2893 HD11 ILE A 386 1.807 -2.361 18.772 1.00 0.00 H ATOM 2894 HD12 ILE A 386 0.948 -2.384 20.331 1.00 0.00 H ATOM 2895 HD13 ILE A 386 0.130 -1.772 18.872 1.00 0.00 H ATOM 2896 HG21 ILE A 386 3.716 -0.988 22.362 1.00 0.00 H ATOM 2897 HG22 ILE A 386 2.022 -0.441 22.394 1.00 0.00 H ATOM 2898 HG23 ILE A 386 2.428 -2.044 21.733 1.00 0.00 H ATOM 2899 H ILE A 386 3.316 1.265 18.418 1.00 0.00 H ATOM 2900 N PHE A 387 5.786 0.896 20.209 1.00 24.36 N ATOM 2901 CA PHE A 387 7.194 0.884 20.582 1.00 27.80 C ATOM 2902 C PHE A 387 7.577 2.184 21.305 1.00 27.97 C ATOM 2903 O PHE A 387 8.202 2.173 22.368 1.00 27.30 O ATOM 2904 CB PHE A 387 8.055 0.703 19.331 1.00 26.87 C ATOM 2905 CG PHE A 387 9.526 0.711 19.607 1.00 28.22 C ATOM 2906 CD1 PHE A 387 10.063 -0.106 20.606 1.00 29.79 C ATOM 2907 CD2 PHE A 387 10.380 1.508 18.862 1.00 25.74 C ATOM 2908 CE1 PHE A 387 11.434 -0.126 20.851 1.00 27.97 C ATOM 2909 CE2 PHE A 387 11.750 1.501 19.096 1.00 27.29 C ATOM 2910 CZ PHE A 387 12.279 0.680 20.096 1.00 29.79 C ATOM 2911 HA PHE A 387 7.368 0.052 21.264 1.00 0.00 H ATOM 2912 HB2 PHE A 387 7.796 -0.250 18.870 1.00 0.00 H ATOM 2913 HB3 PHE A 387 7.830 1.514 18.638 1.00 0.00 H ATOM 2914 HD2 PHE A 387 9.972 2.150 18.081 1.00 0.00 H ATOM 2915 HE2 PHE A 387 12.410 2.133 18.502 1.00 0.00 H ATOM 2916 HZ PHE A 387 13.353 0.672 20.284 1.00 0.00 H ATOM 2917 HE1 PHE A 387 11.842 -0.770 21.630 1.00 0.00 H ATOM 2918 HD1 PHE A 387 9.401 -0.735 21.201 1.00 0.00 H ATOM 2919 H PHE A 387 5.523 0.769 19.211 1.00 0.00 H ATOM 2920 N ILE A 388 7.181 3.301 20.719 1.00 27.95 N ATOM 2921 CA ILE A 388 7.460 4.607 21.287 1.00 29.85 C ATOM 2922 C ILE A 388 6.898 4.719 22.699 1.00 28.73 C ATOM 2923 O ILE A 388 7.529 5.306 23.582 1.00 29.08 O ATOM 2924 CB ILE A 388 6.880 5.694 20.372 1.00 34.35 C ATOM 2925 CG1 ILE A 388 7.821 5.882 19.181 1.00 34.50 C ATOM 2926 CG2 ILE A 388 6.636 6.980 21.142 1.00 37.03 C ATOM 2927 CD1 ILE A 388 7.300 6.888 18.163 1.00 42.29 C ATOM 2928 HA ILE A 388 8.539 4.743 21.357 1.00 0.00 H ATOM 2929 HB ILE A 388 5.905 5.388 19.992 1.00 0.00 H ATOM 2930 HG12 ILE A 388 8.785 6.230 19.551 1.00 0.00 H ATOM 2931 HG13 ILE A 388 7.950 4.920 18.685 1.00 0.00 H ATOM 2932 HD11 ILE A 388 6.340 6.547 17.776 1.00 0.00 H ATOM 2933 HD12 ILE A 388 7.176 7.858 18.644 1.00 0.00 H ATOM 2934 HD13 ILE A 388 8.013 6.976 17.343 1.00 0.00 H ATOM 2935 HG21 ILE A 388 5.930 6.790 21.951 1.00 0.00 H ATOM 2936 HG22 ILE A 388 7.578 7.338 21.557 1.00 0.00 H ATOM 2937 HG23 ILE A 388 6.225 7.733 20.469 1.00 0.00 H ATOM 2938 H ILE A 388 6.654 3.242 19.824 1.00 0.00 H ATOM 2939 N ALA A 389 5.720 4.145 22.916 1.00 27.50 N ATOM 2940 CA ALA A 389 5.094 4.164 24.239 1.00 26.63 C ATOM 2941 C ALA A 389 5.911 3.292 25.202 1.00 26.57 C ATOM 2942 O ALA A 389 6.080 3.634 26.371 1.00 24.05 O ATOM 2943 CB ALA A 389 3.657 3.656 24.153 1.00 22.26 C ATOM 2944 HA ALA A 389 5.073 5.188 24.612 1.00 0.00 H ATOM 2945 HB1 ALA A 389 3.087 4.296 23.480 1.00 0.00 H ATOM 2946 HB2 ALA A 389 3.656 2.634 23.773 1.00 0.00 H ATOM 2947 HB3 ALA A 389 3.206 3.676 25.145 1.00 0.00 H ATOM 2948 H ALA A 389 5.232 3.672 22.129 1.00 0.00 H ATOM 2949 N VAL A 390 6.421 2.169 24.704 1.00 26.25 N ATOM 2950 CA VAL A 390 7.229 1.278 25.539 1.00 26.04 C ATOM 2951 C VAL A 390 8.483 2.022 26.010 1.00 26.08 C ATOM 2952 O VAL A 390 8.882 1.940 27.163 1.00 24.64 O ATOM 2953 CB VAL A 390 7.647 0.019 24.757 1.00 25.01 C ATOM 2954 CG1 VAL A 390 8.787 -0.697 25.479 1.00 23.98 C ATOM 2955 CG2 VAL A 390 6.441 -0.911 24.604 1.00 23.00 C ATOM 2956 HA VAL A 390 6.630 0.970 26.396 1.00 0.00 H ATOM 2957 HB VAL A 390 7.999 0.310 23.767 1.00 0.00 H ATOM 2958 HG11 VAL A 390 9.642 -0.026 25.560 1.00 0.00 H ATOM 2959 HG12 VAL A 390 8.457 -0.989 26.476 1.00 0.00 H ATOM 2960 HG13 VAL A 390 9.072 -1.585 24.915 1.00 0.00 H ATOM 2961 HG21 VAL A 390 6.079 -1.199 25.591 1.00 0.00 H ATOM 2962 HG22 VAL A 390 5.650 -0.392 24.062 1.00 0.00 H ATOM 2963 HG23 VAL A 390 6.738 -1.802 24.050 1.00 0.00 H ATOM 2964 H VAL A 390 6.244 1.921 23.710 1.00 0.00 H ATOM 2965 N ILE A 391 9.096 2.756 25.096 1.00 27.78 N ATOM 2966 CA ILE A 391 10.278 3.522 25.411 1.00 28.87 C ATOM 2967 C ILE A 391 10.049 4.510 26.538 1.00 31.75 C ATOM 2968 O ILE A 391 10.846 4.573 27.467 1.00 32.81 O ATOM 2969 CB ILE A 391 10.769 4.255 24.177 1.00 29.30 C ATOM 2970 CG1 ILE A 391 11.319 3.225 23.196 1.00 27.66 C ATOM 2971 CG2 ILE A 391 11.823 5.297 24.549 1.00 31.54 C ATOM 2972 CD1 ILE A 391 11.632 3.764 21.861 1.00 28.22 C ATOM 2973 HA ILE A 391 11.035 2.814 25.749 1.00 0.00 H ATOM 2974 HB ILE A 391 9.946 4.795 23.709 1.00 0.00 H ATOM 2975 HG12 ILE A 391 12.232 2.806 23.618 1.00 0.00 H ATOM 2976 HG13 ILE A 391 10.578 2.434 23.080 1.00 0.00 H ATOM 2977 HD11 ILE A 391 10.727 4.177 21.416 1.00 0.00 H ATOM 2978 HD12 ILE A 391 12.383 4.549 21.954 1.00 0.00 H ATOM 2979 HD13 ILE A 391 12.017 2.964 21.229 1.00 0.00 H ATOM 2980 HG21 ILE A 391 11.389 6.021 25.239 1.00 0.00 H ATOM 2981 HG22 ILE A 391 12.670 4.802 25.025 1.00 0.00 H ATOM 2982 HG23 ILE A 391 12.160 5.809 23.648 1.00 0.00 H ATOM 2983 H ILE A 391 8.717 2.782 24.128 1.00 0.00 H ATOM 2984 N ILE A 392 8.951 5.260 26.477 1.00 32.50 N ATOM 2985 CA ILE A 392 8.660 6.257 27.503 1.00 33.35 C ATOM 2986 C ILE A 392 8.447 5.644 28.880 1.00 32.17 C ATOM 2987 O ILE A 392 8.967 6.142 29.879 1.00 33.49 O ATOM 2988 CB ILE A 392 7.395 7.090 27.152 1.00 33.56 C ATOM 2989 CG1 ILE A 392 7.591 7.810 25.825 1.00 36.59 C ATOM 2990 CG2 ILE A 392 7.121 8.105 28.248 1.00 32.31 C ATOM 2991 CD1 ILE A 392 6.358 8.573 25.349 1.00 37.46 C ATOM 2992 HA ILE A 392 9.541 6.899 27.531 1.00 0.00 H ATOM 2993 HB ILE A 392 6.544 6.414 27.067 1.00 0.00 H ATOM 2994 HG12 ILE A 392 8.412 8.518 25.936 1.00 0.00 H ATOM 2995 HG13 ILE A 392 7.851 7.070 25.068 1.00 0.00 H ATOM 2996 HD11 ILE A 392 5.529 7.877 25.220 1.00 0.00 H ATOM 2997 HD12 ILE A 392 6.090 9.326 26.090 1.00 0.00 H ATOM 2998 HD13 ILE A 392 6.577 9.058 24.398 1.00 0.00 H ATOM 2999 HG21 ILE A 392 6.958 7.584 29.191 1.00 0.00 H ATOM 3000 HG22 ILE A 392 7.976 8.774 28.344 1.00 0.00 H ATOM 3001 HG23 ILE A 392 6.233 8.683 27.992 1.00 0.00 H ATOM 3002 H ILE A 392 8.289 5.134 25.685 1.00 0.00 H ATOM 3003 N LEU A 393 7.673 4.570 28.932 1.00 31.66 N ATOM 3004 CA LEU A 393 7.379 3.912 30.191 1.00 33.94 C ATOM 3005 C LEU A 393 8.469 2.928 30.636 1.00 35.28 C ATOM 3006 O LEU A 393 8.213 1.737 30.826 1.00 34.99 O ATOM 3007 CB LEU A 393 6.018 3.210 30.089 1.00 34.26 C ATOM 3008 CG LEU A 393 4.787 4.121 30.238 1.00 34.78 C ATOM 3009 CD1 LEU A 393 4.672 4.572 31.677 1.00 34.54 C ATOM 3010 CD2 LEU A 393 4.883 5.324 29.312 1.00 33.52 C ATOM 3011 HA LEU A 393 7.348 4.683 30.961 1.00 0.00 H ATOM 3012 HB2 LEU A 393 5.962 2.727 29.114 1.00 0.00 H ATOM 3013 HB3 LEU A 393 5.972 2.453 30.871 1.00 0.00 H ATOM 3014 HG LEU A 393 3.896 3.558 29.960 1.00 0.00 H ATOM 3015 HD21 LEU A 393 5.776 5.899 29.557 1.00 0.00 H ATOM 3016 HD22 LEU A 393 4.942 4.982 28.279 1.00 0.00 H ATOM 3017 HD23 LEU A 393 4.000 5.950 29.439 1.00 0.00 H ATOM 3018 HD11 LEU A 393 4.562 3.700 32.322 1.00 0.00 H ATOM 3019 HD12 LEU A 393 5.570 5.122 31.957 1.00 0.00 H ATOM 3020 HD13 LEU A 393 3.801 5.218 31.786 1.00 0.00 H ATOM 3021 H LEU A 393 7.268 4.191 28.052 1.00 0.00 H ATOM 3022 N SER A 394 9.682 3.441 30.811 1.00 35.67 N ATOM 3023 CA SER A 394 10.806 2.616 31.235 1.00 38.86 C ATOM 3024 C SER A 394 10.987 2.678 32.737 1.00 39.57 C ATOM 3025 O SER A 394 11.165 3.758 33.307 1.00 38.92 O ATOM 3026 CB SER A 394 12.099 3.086 30.572 1.00 40.62 C ATOM 3027 OG SER A 394 11.944 3.173 29.167 1.00 44.34 O ATOM 3028 HA SER A 394 10.588 1.591 30.936 1.00 0.00 H ATOM 3029 HB2 SER A 394 12.895 2.378 30.800 1.00 0.00 H ATOM 3030 HB3 SER A 394 12.365 4.068 30.964 1.00 0.00 H ATOM 3031 HG SER A 394 11.224 3.819 28.955 1.00 0.00 H ATOM 3032 H SER A 394 9.833 4.456 30.641 1.00 0.00 H ATOM 3033 N GLY A 395 10.955 1.514 33.377 1.00 40.24 N ATOM 3034 CA GLY A 395 11.129 1.468 34.815 1.00 42.20 C ATOM 3035 C GLY A 395 12.559 1.706 35.274 1.00 43.23 C ATOM 3036 O GLY A 395 12.780 2.071 36.422 1.00 44.65 O ATOM 3037 HA3 GLY A 395 10.815 0.485 35.167 1.00 0.00 H ATOM 3038 HA2 GLY A 395 10.494 2.233 35.262 1.00 0.00 H ATOM 3039 H GLY A 395 10.805 0.633 32.844 1.00 0.00 H ATOM 3040 N ASP A 396 13.535 1.512 34.394 1.00 43.88 N ATOM 3041 CA ASP A 396 14.925 1.716 34.784 1.00 46.28 C ATOM 3042 C ASP A 396 15.480 3.121 34.520 1.00 46.41 C ATOM 3043 O ASP A 396 16.685 3.270 34.312 1.00 46.96 O ATOM 3044 CB ASP A 396 15.830 0.693 34.092 1.00 49.82 C ATOM 3045 CG ASP A 396 15.423 -0.744 34.376 1.00 53.47 C ATOM 3046 OD1 ASP A 396 15.196 -1.090 35.559 1.00 54.68 O ATOM 3047 OD2 ASP A 396 15.342 -1.533 33.409 1.00 57.06 O ATOM 3048 HA ASP A 396 14.925 1.585 35.866 1.00 0.00 H ATOM 3049 HB2 ASP A 396 15.786 0.861 33.016 1.00 0.00 H ATOM 3050 HB3 ASP A 396 16.852 0.841 34.440 1.00 0.00 H ATOM 3051 H ASP A 396 13.307 1.214 33.424 1.00 0.00 H ATOM 3052 N ARG A 397 14.627 4.144 34.509 1.00 44.21 N ATOM 3053 CA ARG A 397 15.119 5.507 34.291 1.00 44.27 C ATOM 3054 C ARG A 397 15.665 6.027 35.625 1.00 45.69 C ATOM 3055 O ARG A 397 15.094 5.768 36.689 1.00 48.37 O ATOM 3056 CB ARG A 397 14.002 6.440 33.799 1.00 42.70 C ATOM 3057 CG ARG A 397 13.350 6.060 32.463 1.00 40.00 C ATOM 3058 CD ARG A 397 14.369 5.915 31.327 1.00 38.82 C ATOM 3059 NE ARG A 397 13.711 5.863 30.021 1.00 39.13 N ATOM 3060 CZ ARG A 397 14.349 5.759 28.859 1.00 41.03 C ATOM 3061 NH1 ARG A 397 15.670 5.683 28.830 1.00 40.40 N ATOM 3062 NH2 ARG A 397 13.665 5.756 27.719 1.00 41.48 N ATOM 3063 HA ARG A 397 15.894 5.489 33.524 1.00 0.00 H ATOM 3064 HB2 ARG A 397 13.221 6.456 34.559 1.00 0.00 H ATOM 3065 HB3 ARG A 397 14.424 7.439 33.692 1.00 0.00 H ATOM 3066 HG2 ARG A 397 12.828 5.111 32.587 1.00 0.00 H ATOM 3067 HG3 ARG A 397 12.633 6.835 32.192 1.00 0.00 H ATOM 3068 HD2 ARG A 397 14.937 4.996 31.475 1.00 0.00 H ATOM 3069 HD3 ARG A 397 15.048 6.768 31.348 1.00 0.00 H ATOM 3070 HE ARG A 397 12.672 5.911 30.000 1.00 0.00 H ATOM 3071 HH12 ARG A 397 16.166 5.602 27.920 1.00 0.00 H ATOM 3072 HH11 ARG A 397 16.212 5.705 29.718 1.00 0.00 H ATOM 3073 HH22 ARG A 397 14.167 5.675 26.812 1.00 0.00 H ATOM 3074 HH21 ARG A 397 12.628 5.835 27.734 1.00 0.00 H ATOM 3075 H ARG A 397 13.611 3.975 34.655 1.00 0.00 H ATOM 3076 N PRO A 398 16.786 6.760 35.590 1.00 44.52 N ATOM 3077 CA PRO A 398 17.360 7.285 36.834 1.00 43.20 C ATOM 3078 C PRO A 398 16.451 8.286 37.547 1.00 42.87 C ATOM 3079 O PRO A 398 15.874 9.157 36.906 1.00 42.05 O ATOM 3080 CB PRO A 398 18.658 7.950 36.368 1.00 42.48 C ATOM 3081 CG PRO A 398 19.002 7.215 35.109 1.00 43.96 C ATOM 3082 CD PRO A 398 17.662 7.047 34.441 1.00 43.25 C ATOM 3083 HA PRO A 398 17.509 6.497 37.573 1.00 0.00 H ATOM 3084 HD3 PRO A 398 17.357 7.959 33.927 1.00 0.00 H ATOM 3085 HD2 PRO A 398 17.672 6.219 33.733 1.00 0.00 H ATOM 3086 HG3 PRO A 398 19.454 6.248 35.330 1.00 0.00 H ATOM 3087 HG2 PRO A 398 19.680 7.799 34.487 1.00 0.00 H ATOM 3088 HB2 PRO A 398 18.502 9.010 36.169 1.00 0.00 H ATOM 3089 HB3 PRO A 398 19.444 7.833 37.114 1.00 0.00 H ATOM 3090 N GLY A 399 16.328 8.153 38.868 1.00 42.21 N ATOM 3091 CA GLY A 399 15.525 9.083 39.646 1.00 41.27 C ATOM 3092 C GLY A 399 14.041 8.827 39.853 1.00 42.23 C ATOM 3093 O GLY A 399 13.386 9.597 40.550 1.00 42.77 O ATOM 3094 HA3 GLY A 399 15.611 10.055 39.159 1.00 0.00 H ATOM 3095 HA2 GLY A 399 15.976 9.133 40.637 1.00 0.00 H ATOM 3096 H GLY A 399 16.815 7.371 39.350 1.00 0.00 H ATOM 3097 N LEU A 400 13.493 7.772 39.261 1.00 42.45 N ATOM 3098 CA LEU A 400 12.075 7.483 39.423 1.00 42.28 C ATOM 3099 C LEU A 400 11.728 7.213 40.882 1.00 45.33 C ATOM 3100 O LEU A 400 12.472 6.539 41.600 1.00 46.65 O ATOM 3101 CB LEU A 400 11.674 6.278 38.569 1.00 41.41 C ATOM 3102 CG LEU A 400 11.764 6.440 37.044 1.00 41.74 C ATOM 3103 CD1 LEU A 400 11.561 5.088 36.370 1.00 39.39 C ATOM 3104 CD2 LEU A 400 10.723 7.454 36.570 1.00 38.12 C ATOM 3105 HA LEU A 400 11.520 8.361 39.093 1.00 0.00 H ATOM 3106 HB2 LEU A 400 12.320 5.446 38.850 1.00 0.00 H ATOM 3107 HB3 LEU A 400 10.641 6.032 38.813 1.00 0.00 H ATOM 3108 HG LEU A 400 12.752 6.812 36.772 1.00 0.00 H ATOM 3109 HD21 LEU A 400 9.727 7.102 36.838 1.00 0.00 H ATOM 3110 HD22 LEU A 400 10.911 8.416 37.047 1.00 0.00 H ATOM 3111 HD23 LEU A 400 10.792 7.565 35.488 1.00 0.00 H ATOM 3112 HD11 LEU A 400 12.333 4.396 36.706 1.00 0.00 H ATOM 3113 HD12 LEU A 400 10.579 4.695 36.635 1.00 0.00 H ATOM 3114 HD13 LEU A 400 11.626 5.209 35.289 1.00 0.00 H ATOM 3115 H LEU A 400 14.082 7.146 38.676 1.00 0.00 H ATOM 3116 N LEU A 401 10.588 7.742 41.313 1.00 46.49 N ATOM 3117 CA LEU A 401 10.120 7.558 42.678 1.00 46.91 C ATOM 3118 C LEU A 401 9.303 6.272 42.795 1.00 48.55 C ATOM 3119 O LEU A 401 9.602 5.407 43.621 1.00 47.70 O ATOM 3120 CB LEU A 401 9.256 8.746 43.099 1.00 47.26 C ATOM 3121 CG LEU A 401 9.890 10.134 42.979 1.00 48.58 C ATOM 3122 CD1 LEU A 401 8.872 11.181 43.386 1.00 49.77 C ATOM 3123 CD2 LEU A 401 11.131 10.227 43.851 1.00 49.16 C ATOM 3124 HA LEU A 401 10.989 7.488 43.332 1.00 0.00 H ATOM 3125 HB2 LEU A 401 8.359 8.738 42.480 1.00 0.00 H ATOM 3126 HB3 LEU A 401 8.978 8.599 44.143 1.00 0.00 H ATOM 3127 HG LEU A 401 10.192 10.308 41.946 1.00 0.00 H ATOM 3128 HD21 LEU A 401 10.857 10.050 44.891 1.00 0.00 H ATOM 3129 HD22 LEU A 401 11.855 9.477 43.532 1.00 0.00 H ATOM 3130 HD23 LEU A 401 11.569 11.221 43.753 1.00 0.00 H ATOM 3131 HD11 LEU A 401 8.004 11.116 42.730 1.00 0.00 H ATOM 3132 HD12 LEU A 401 8.564 11.005 44.417 1.00 0.00 H ATOM 3133 HD13 LEU A 401 9.318 12.172 43.302 1.00 0.00 H ATOM 3134 H LEU A 401 10.013 8.305 40.654 1.00 0.00 H ATOM 3135 N ASN A 402 8.278 6.152 41.953 1.00 49.60 N ATOM 3136 CA ASN A 402 7.393 4.992 41.965 1.00 49.63 C ATOM 3137 C ASN A 402 7.600 4.132 40.735 1.00 49.02 C ATOM 3138 O ASN A 402 6.930 4.322 39.718 1.00 48.96 O ATOM 3139 CB ASN A 402 5.937 5.445 42.005 1.00 52.45 C ATOM 3140 CG ASN A 402 5.636 6.346 43.183 1.00 56.64 C ATOM 3141 OD1 ASN A 402 4.613 7.038 43.199 1.00 58.93 O ATOM 3142 ND2 ASN A 402 6.515 6.337 44.184 1.00 58.02 N ATOM 3143 HA ASN A 402 7.629 4.406 42.853 1.00 0.00 H ATOM 3144 HB2 ASN A 402 5.715 5.987 41.086 1.00 0.00 H ATOM 3145 HB3 ASN A 402 5.299 4.563 42.068 1.00 0.00 H ATOM 3146 HD22 ASN A 402 7.363 5.738 44.126 1.00 0.00 H ATOM 3147 HD21 ASN A 402 6.353 6.929 45.023 1.00 0.00 H ATOM 3148 H ASN A 402 8.103 6.911 41.264 1.00 0.00 H ATOM 3149 N VAL A 403 8.518 3.179 40.832 1.00 46.65 N ATOM 3150 CA VAL A 403 8.814 2.292 39.720 1.00 44.75 C ATOM 3151 C VAL A 403 7.696 1.313 39.380 1.00 44.82 C ATOM 3152 O VAL A 403 7.397 1.114 38.205 1.00 44.29 O ATOM 3153 CB VAL A 403 10.113 1.496 39.982 1.00 43.56 C ATOM 3154 CG1 VAL A 403 10.229 0.324 39.019 1.00 43.08 C ATOM 3155 CG2 VAL A 403 11.303 2.410 39.813 1.00 41.68 C ATOM 3156 HA VAL A 403 8.931 2.952 38.860 1.00 0.00 H ATOM 3157 HB VAL A 403 10.086 1.107 41.000 1.00 0.00 H ATOM 3158 HG11 VAL A 403 9.375 -0.340 39.153 1.00 0.00 H ATOM 3159 HG12 VAL A 403 10.244 0.697 37.995 1.00 0.00 H ATOM 3160 HG13 VAL A 403 11.151 -0.222 39.222 1.00 0.00 H ATOM 3161 HG21 VAL A 403 11.315 2.804 38.797 1.00 0.00 H ATOM 3162 HG22 VAL A 403 11.230 3.234 40.523 1.00 0.00 H ATOM 3163 HG23 VAL A 403 12.219 1.849 39.998 1.00 0.00 H ATOM 3164 H VAL A 403 9.038 3.064 41.725 1.00 0.00 H ATOM 3165 N LYS A 404 7.071 0.720 40.395 1.00 45.84 N ATOM 3166 CA LYS A 404 6.016 -0.273 40.165 1.00 46.84 C ATOM 3167 C LYS A 404 4.899 0.136 39.202 1.00 44.21 C ATOM 3168 O LYS A 404 4.643 -0.563 38.221 1.00 45.67 O ATOM 3169 CB LYS A 404 5.388 -0.734 41.484 1.00 49.21 C ATOM 3170 CG LYS A 404 4.384 -1.868 41.274 1.00 55.14 C ATOM 3171 CD LYS A 404 3.490 -2.116 42.480 1.00 59.59 C ATOM 3172 CE LYS A 404 4.239 -2.763 43.635 1.00 62.43 C ATOM 3173 NZ LYS A 404 3.306 -3.113 44.754 1.00 64.82 N ATOM 3174 HA LYS A 404 6.548 -1.087 39.673 1.00 0.00 H ATOM 3175 HB2 LYS A 404 6.179 -1.082 42.148 1.00 0.00 H ATOM 3176 HB3 LYS A 404 4.875 0.110 41.944 1.00 0.00 H ATOM 3177 HG2 LYS A 404 3.753 -1.617 40.422 1.00 0.00 H ATOM 3178 HG3 LYS A 404 4.936 -2.783 41.059 1.00 0.00 H ATOM 3179 HD2 LYS A 404 3.084 -1.162 42.817 1.00 0.00 H ATOM 3180 HD3 LYS A 404 2.673 -2.772 42.181 1.00 0.00 H ATOM 3181 HE2 LYS A 404 4.993 -2.068 44.004 1.00 0.00 H ATOM 3182 HE3 LYS A 404 4.726 -3.671 43.280 1.00 0.00 H ATOM 3183 HZ1 LYS A 404 2.842 -2.249 45.100 1.00 0.00 H ATOM 3184 HZ2 LYS A 404 2.587 -3.780 44.408 1.00 0.00 H ATOM 3185 HZ3 LYS A 404 3.844 -3.553 45.528 1.00 0.00 H ATOM 3186 H LYS A 404 7.336 0.966 41.370 1.00 0.00 H ATOM 3187 N PRO A 405 4.207 1.254 39.471 1.00 42.48 N ATOM 3188 CA PRO A 405 3.138 1.638 38.541 1.00 40.79 C ATOM 3189 C PRO A 405 3.633 1.812 37.102 1.00 39.19 C ATOM 3190 O PRO A 405 2.924 1.469 36.156 1.00 38.97 O ATOM 3191 CB PRO A 405 2.583 2.930 39.148 1.00 40.86 C ATOM 3192 CG PRO A 405 3.719 3.461 39.970 1.00 44.36 C ATOM 3193 CD PRO A 405 4.323 2.220 40.576 1.00 43.01 C ATOM 3194 HA PRO A 405 2.374 0.867 38.441 1.00 0.00 H ATOM 3195 HD3 PRO A 405 5.364 2.381 40.854 1.00 0.00 H ATOM 3196 HD2 PRO A 405 3.761 1.892 41.450 1.00 0.00 H ATOM 3197 HG3 PRO A 405 3.357 4.137 40.745 1.00 0.00 H ATOM 3198 HG2 PRO A 405 4.444 3.982 39.344 1.00 0.00 H ATOM 3199 HB2 PRO A 405 2.306 3.638 38.367 1.00 0.00 H ATOM 3200 HB3 PRO A 405 1.715 2.723 39.774 1.00 0.00 H ATOM 3201 N ILE A 406 4.854 2.319 36.946 1.00 37.29 N ATOM 3202 CA ILE A 406 5.448 2.514 35.626 1.00 36.76 C ATOM 3203 C ILE A 406 5.648 1.176 34.906 1.00 37.57 C ATOM 3204 O ILE A 406 5.359 1.055 33.713 1.00 35.17 O ATOM 3205 CB ILE A 406 6.814 3.253 35.739 1.00 37.15 C ATOM 3206 CG1 ILE A 406 6.577 4.738 36.018 1.00 34.57 C ATOM 3207 CG2 ILE A 406 7.623 3.092 34.460 1.00 34.28 C ATOM 3208 CD1 ILE A 406 7.816 5.479 36.446 1.00 33.39 C ATOM 3209 HA ILE A 406 4.758 3.125 35.044 1.00 0.00 H ATOM 3210 HB ILE A 406 7.378 2.813 36.562 1.00 0.00 H ATOM 3211 HG12 ILE A 406 6.195 5.202 35.109 1.00 0.00 H ATOM 3212 HG13 ILE A 406 5.833 4.825 36.810 1.00 0.00 H ATOM 3213 HD11 ILE A 406 8.206 5.034 37.362 1.00 0.00 H ATOM 3214 HD12 ILE A 406 8.568 5.412 35.660 1.00 0.00 H ATOM 3215 HD13 ILE A 406 7.568 6.525 36.625 1.00 0.00 H ATOM 3216 HG21 ILE A 406 7.809 2.033 34.280 1.00 0.00 H ATOM 3217 HG22 ILE A 406 7.064 3.511 33.623 1.00 0.00 H ATOM 3218 HG23 ILE A 406 8.573 3.617 34.564 1.00 0.00 H ATOM 3219 H ILE A 406 5.401 2.584 37.790 1.00 0.00 H ATOM 3220 N GLU A 407 6.133 0.171 35.633 1.00 38.07 N ATOM 3221 CA GLU A 407 6.366 -1.146 35.044 1.00 39.68 C ATOM 3222 C GLU A 407 5.067 -1.885 34.739 1.00 39.83 C ATOM 3223 O GLU A 407 5.006 -2.676 33.790 1.00 38.21 O ATOM 3224 CB GLU A 407 7.243 -1.996 35.961 1.00 41.88 C ATOM 3225 CG GLU A 407 8.559 -1.332 36.338 1.00 46.09 C ATOM 3226 CD GLU A 407 9.498 -2.279 37.069 1.00 49.24 C ATOM 3227 OE1 GLU A 407 9.010 -3.057 37.920 1.00 47.28 O ATOM 3228 OE2 GLU A 407 10.723 -2.237 36.796 1.00 52.12 O ATOM 3229 HA GLU A 407 6.881 -0.981 34.097 1.00 0.00 H ATOM 3230 HB2 GLU A 407 6.687 -2.202 36.876 1.00 0.00 H ATOM 3231 HB3 GLU A 407 7.464 -2.935 35.453 1.00 0.00 H ATOM 3232 HG2 GLU A 407 9.050 -0.985 35.429 1.00 0.00 H ATOM 3233 HG3 GLU A 407 8.349 -0.479 36.984 1.00 0.00 H ATOM 3234 H GLU A 407 6.350 0.326 36.638 1.00 0.00 H ATOM 3235 N ASP A 408 4.028 -1.638 35.537 1.00 39.66 N ATOM 3236 CA ASP A 408 2.743 -2.286 35.287 1.00 40.26 C ATOM 3237 C ASP A 408 2.203 -1.802 33.944 1.00 38.89 C ATOM 3238 O ASP A 408 1.603 -2.567 33.191 1.00 40.63 O ATOM 3239 CB ASP A 408 1.732 -1.965 36.393 1.00 41.97 C ATOM 3240 CG ASP A 408 2.088 -2.620 37.716 1.00 45.98 C ATOM 3241 OD1 ASP A 408 2.815 -3.644 37.708 1.00 46.00 O ATOM 3242 OD2 ASP A 408 1.626 -2.118 38.763 1.00 46.80 O ATOM 3243 HA ASP A 408 2.892 -3.366 35.273 1.00 0.00 H ATOM 3244 HB2 ASP A 408 1.700 -0.885 36.535 1.00 0.00 H ATOM 3245 HB3 ASP A 408 0.749 -2.318 36.081 1.00 0.00 H ATOM 3246 H ASP A 408 4.132 -0.983 36.338 1.00 0.00 H ATOM 3247 N ILE A 409 2.418 -0.527 33.650 1.00 35.92 N ATOM 3248 CA ILE A 409 1.967 0.036 32.393 1.00 35.48 C ATOM 3249 C ILE A 409 2.818 -0.488 31.246 1.00 35.33 C ATOM 3250 O ILE A 409 2.272 -0.898 30.218 1.00 33.65 O ATOM 3251 CB ILE A 409 2.031 1.580 32.403 1.00 36.21 C ATOM 3252 CG1 ILE A 409 0.915 2.134 33.290 1.00 34.93 C ATOM 3253 CG2 ILE A 409 1.903 2.123 30.980 1.00 36.25 C ATOM 3254 CD1 ILE A 409 0.981 3.635 33.492 1.00 36.64 C ATOM 3255 HA ILE A 409 0.929 -0.267 32.257 1.00 0.00 H ATOM 3256 HB ILE A 409 2.993 1.897 32.805 1.00 0.00 H ATOM 3257 HG12 ILE A 409 -0.043 1.891 32.830 1.00 0.00 H ATOM 3258 HG13 ILE A 409 0.980 1.653 34.266 1.00 0.00 H ATOM 3259 HD11 ILE A 409 1.929 3.896 33.963 1.00 0.00 H ATOM 3260 HD12 ILE A 409 0.905 4.134 32.526 1.00 0.00 H ATOM 3261 HD13 ILE A 409 0.157 3.951 34.132 1.00 0.00 H ATOM 3262 HG21 ILE A 409 2.719 1.735 30.370 1.00 0.00 H ATOM 3263 HG22 ILE A 409 0.949 1.808 30.557 1.00 0.00 H ATOM 3264 HG23 ILE A 409 1.950 3.212 31.002 1.00 0.00 H ATOM 3265 H ILE A 409 2.918 0.078 34.332 1.00 0.00 H ATOM 3266 N GLN A 410 4.144 -0.490 31.413 1.00 34.36 N ATOM 3267 CA GLN A 410 5.010 -0.980 30.343 1.00 34.73 C ATOM 3268 C GLN A 410 4.739 -2.441 30.036 1.00 35.53 C ATOM 3269 O GLN A 410 4.788 -2.845 28.878 1.00 38.40 O ATOM 3270 CB GLN A 410 6.498 -0.820 30.670 1.00 32.71 C ATOM 3271 CG GLN A 410 7.337 -0.557 29.411 1.00 34.79 C ATOM 3272 CD GLN A 410 8.793 -0.976 29.533 1.00 37.96 C ATOM 3273 OE1 GLN A 410 9.710 -0.232 29.148 1.00 37.78 O ATOM 3274 NE2 GLN A 410 9.017 -2.180 30.049 1.00 36.99 N ATOM 3275 HA GLN A 410 4.776 -0.367 29.472 1.00 0.00 H ATOM 3276 HB2 GLN A 410 6.620 0.018 31.356 1.00 0.00 H ATOM 3277 HB3 GLN A 410 6.854 -1.733 31.147 1.00 0.00 H ATOM 3278 HG2 GLN A 410 6.891 -1.107 28.582 1.00 0.00 H ATOM 3279 HG3 GLN A 410 7.305 0.511 29.196 1.00 0.00 H ATOM 3280 HE22 GLN A 410 8.218 -2.770 30.359 1.00 0.00 H ATOM 3281 HE21 GLN A 410 9.991 -2.532 30.143 1.00 0.00 H ATOM 3282 H GLN A 410 4.558 -0.144 32.302 1.00 0.00 H ATOM 3283 N ASP A 411 4.469 -3.240 31.063 1.00 37.38 N ATOM 3284 CA ASP A 411 4.187 -4.657 30.849 1.00 39.90 C ATOM 3285 C ASP A 411 2.987 -4.779 29.928 1.00 37.40 C ATOM 3286 O ASP A 411 2.937 -5.646 29.057 1.00 36.99 O ATOM 3287 CB ASP A 411 3.900 -5.357 32.185 1.00 46.87 C ATOM 3288 CG ASP A 411 5.169 -5.717 32.933 1.00 53.80 C ATOM 3289 OD1 ASP A 411 6.120 -4.898 32.925 1.00 56.51 O ATOM 3290 OD2 ASP A 411 5.216 -6.816 33.532 1.00 59.06 O ATOM 3291 HA ASP A 411 5.055 -5.137 30.396 1.00 0.00 H ATOM 3292 HB2 ASP A 411 3.303 -4.691 32.808 1.00 0.00 H ATOM 3293 HB3 ASP A 411 3.338 -6.270 31.989 1.00 0.00 H ATOM 3294 H ASP A 411 4.458 -2.853 32.028 1.00 0.00 H ATOM 3295 N ASN A 412 2.021 -3.894 30.136 1.00 35.87 N ATOM 3296 CA ASN A 412 0.809 -3.851 29.329 1.00 36.92 C ATOM 3297 C ASN A 412 1.171 -3.448 27.888 1.00 33.85 C ATOM 3298 O ASN A 412 0.660 -4.015 26.921 1.00 33.03 O ATOM 3299 CB ASN A 412 -0.156 -2.834 29.942 1.00 41.50 C ATOM 3300 CG ASN A 412 -1.567 -3.025 29.481 1.00 46.24 C ATOM 3301 OD1 ASN A 412 -2.455 -2.240 29.822 1.00 50.51 O ATOM 3302 ND2 ASN A 412 -1.797 -4.076 28.699 1.00 51.19 N ATOM 3303 HA ASN A 412 0.332 -4.831 29.309 1.00 0.00 H ATOM 3304 HB2 ASN A 412 -0.127 -2.935 31.027 1.00 0.00 H ATOM 3305 HB3 ASN A 412 0.170 -1.832 29.663 1.00 0.00 H ATOM 3306 HD22 ASN A 412 -1.016 -4.711 28.438 1.00 0.00 H ATOM 3307 HD21 ASN A 412 -2.758 -4.263 28.349 1.00 0.00 H ATOM 3308 H ASN A 412 2.133 -3.204 30.906 1.00 0.00 H ATOM 3309 N LEU A 413 2.070 -2.477 27.757 1.00 31.39 N ATOM 3310 CA LEU A 413 2.516 -2.004 26.449 1.00 29.35 C ATOM 3311 C LEU A 413 3.378 -3.059 25.736 1.00 30.14 C ATOM 3312 O LEU A 413 3.334 -3.182 24.499 1.00 28.14 O ATOM 3313 CB LEU A 413 3.308 -0.704 26.610 1.00 28.10 C ATOM 3314 CG LEU A 413 2.557 0.520 27.173 1.00 28.32 C ATOM 3315 CD1 LEU A 413 3.544 1.633 27.460 1.00 26.26 C ATOM 3316 CD2 LEU A 413 1.503 0.997 26.182 1.00 26.61 C ATOM 3317 HA LEU A 413 1.634 -1.821 25.836 1.00 0.00 H ATOM 3318 HB2 LEU A 413 4.144 -0.911 27.278 1.00 0.00 H ATOM 3319 HB3 LEU A 413 3.690 -0.430 25.627 1.00 0.00 H ATOM 3320 HG LEU A 413 2.057 0.235 28.099 1.00 0.00 H ATOM 3321 HD21 LEU A 413 1.986 1.276 25.246 1.00 0.00 H ATOM 3322 HD22 LEU A 413 0.789 0.194 25.999 1.00 0.00 H ATOM 3323 HD23 LEU A 413 0.983 1.861 26.595 1.00 0.00 H ATOM 3324 HD11 LEU A 413 4.276 1.288 28.191 1.00 0.00 H ATOM 3325 HD12 LEU A 413 4.053 1.912 26.538 1.00 0.00 H ATOM 3326 HD13 LEU A 413 3.011 2.496 27.858 1.00 0.00 H ATOM 3327 H LEU A 413 2.468 -2.041 28.613 1.00 0.00 H ATOM 3328 N LEU A 414 4.159 -3.822 26.504 1.00 26.24 N ATOM 3329 CA LEU A 414 5.003 -4.854 25.903 1.00 26.14 C ATOM 3330 C LEU A 414 4.122 -5.950 25.314 1.00 26.86 C ATOM 3331 O LEU A 414 4.386 -6.437 24.220 1.00 27.87 O ATOM 3332 CB LEU A 414 5.980 -5.414 26.941 1.00 24.16 C ATOM 3333 CG LEU A 414 7.092 -4.409 27.286 1.00 25.07 C ATOM 3334 CD1 LEU A 414 7.772 -4.804 28.574 1.00 25.73 C ATOM 3335 CD2 LEU A 414 8.089 -4.320 26.132 1.00 24.66 C ATOM 3336 HA LEU A 414 5.596 -4.420 25.098 1.00 0.00 H ATOM 3337 HB2 LEU A 414 5.429 -5.655 27.850 1.00 0.00 H ATOM 3338 HB3 LEU A 414 6.436 -6.321 26.543 1.00 0.00 H ATOM 3339 HG LEU A 414 6.654 -3.422 27.431 1.00 0.00 H ATOM 3340 HD21 LEU A 414 8.531 -5.301 25.959 1.00 0.00 H ATOM 3341 HD22 LEU A 414 7.572 -3.989 25.231 1.00 0.00 H ATOM 3342 HD23 LEU A 414 8.873 -3.606 26.385 1.00 0.00 H ATOM 3343 HD11 LEU A 414 7.039 -4.817 29.381 1.00 0.00 H ATOM 3344 HD12 LEU A 414 8.209 -5.796 28.463 1.00 0.00 H ATOM 3345 HD13 LEU A 414 8.557 -4.083 28.805 1.00 0.00 H ATOM 3346 H LEU A 414 4.167 -3.682 27.534 1.00 0.00 H ATOM 3347 N GLN A 415 3.060 -6.315 26.027 1.00 28.03 N ATOM 3348 CA GLN A 415 2.123 -7.317 25.529 1.00 30.17 C ATOM 3349 C GLN A 415 1.439 -6.822 24.244 1.00 29.29 C ATOM 3350 O GLN A 415 1.340 -7.553 23.260 1.00 30.51 O ATOM 3351 CB GLN A 415 1.045 -7.611 26.575 1.00 30.92 C ATOM 3352 CG GLN A 415 1.466 -8.525 27.703 1.00 34.93 C ATOM 3353 CD GLN A 415 0.348 -8.725 28.719 1.00 39.44 C ATOM 3354 OE1 GLN A 415 0.219 -7.968 29.677 1.00 40.82 O ATOM 3355 NE2 GLN A 415 -0.478 -9.741 28.496 1.00 42.97 N ATOM 3356 HA GLN A 415 2.687 -8.226 25.319 1.00 0.00 H ATOM 3357 HB2 GLN A 415 0.731 -6.662 27.010 1.00 0.00 H ATOM 3358 HB3 GLN A 415 0.199 -8.073 26.066 1.00 0.00 H ATOM 3359 HG2 GLN A 415 1.743 -9.494 27.287 1.00 0.00 H ATOM 3360 HG3 GLN A 415 2.328 -8.088 28.208 1.00 0.00 H ATOM 3361 HE22 GLN A 415 -0.332 -10.358 27.672 1.00 0.00 H ATOM 3362 HE21 GLN A 415 -1.270 -9.919 29.146 1.00 0.00 H ATOM 3363 H GLN A 415 2.894 -5.878 26.956 1.00 0.00 H ATOM 3364 N ALA A 416 0.957 -5.581 24.260 1.00 28.60 N ATOM 3365 CA ALA A 416 0.281 -5.012 23.093 1.00 26.92 C ATOM 3366 C ALA A 416 1.230 -4.975 21.898 1.00 25.56 C ATOM 3367 O ALA A 416 0.839 -5.269 20.768 1.00 27.81 O ATOM 3368 CB ALA A 416 -0.236 -3.587 23.417 1.00 25.58 C ATOM 3369 HA ALA A 416 -0.571 -5.642 22.839 1.00 0.00 H ATOM 3370 HB1 ALA A 416 -0.939 -3.637 24.248 1.00 0.00 H ATOM 3371 HB2 ALA A 416 0.605 -2.950 23.689 1.00 0.00 H ATOM 3372 HB3 ALA A 416 -0.737 -3.176 22.541 1.00 0.00 H ATOM 3373 H ALA A 416 1.063 -5.004 25.119 1.00 0.00 H ATOM 3374 N LEU A 417 2.483 -4.618 22.151 1.00 25.49 N ATOM 3375 CA LEU A 417 3.487 -4.560 21.094 1.00 25.57 C ATOM 3376 C LEU A 417 3.788 -5.950 20.555 1.00 26.18 C ATOM 3377 O LEU A 417 3.894 -6.131 19.352 1.00 28.75 O ATOM 3378 CB LEU A 417 4.791 -3.936 21.612 1.00 23.31 C ATOM 3379 CG LEU A 417 5.946 -3.857 20.605 1.00 23.46 C ATOM 3380 CD1 LEU A 417 5.497 -3.081 19.373 1.00 21.08 C ATOM 3381 CD2 LEU A 417 7.174 -3.195 21.254 1.00 21.83 C ATOM 3382 HA LEU A 417 3.081 -3.941 20.294 1.00 0.00 H ATOM 3383 HB2 LEU A 417 4.567 -2.922 21.943 1.00 0.00 H ATOM 3384 HB3 LEU A 417 5.130 -4.528 22.462 1.00 0.00 H ATOM 3385 HG LEU A 417 6.229 -4.864 20.299 1.00 0.00 H ATOM 3386 HD21 LEU A 417 6.913 -2.187 21.578 1.00 0.00 H ATOM 3387 HD22 LEU A 417 7.490 -3.784 22.115 1.00 0.00 H ATOM 3388 HD23 LEU A 417 7.985 -3.146 20.528 1.00 0.00 H ATOM 3389 HD11 LEU A 417 4.649 -3.590 18.914 1.00 0.00 H ATOM 3390 HD12 LEU A 417 5.202 -2.074 19.667 1.00 0.00 H ATOM 3391 HD13 LEU A 417 6.319 -3.027 18.660 1.00 0.00 H ATOM 3392 H LEU A 417 2.755 -4.374 23.125 1.00 0.00 H ATOM 3393 N GLU A 418 3.936 -6.923 21.448 1.00 29.48 N ATOM 3394 CA GLU A 418 4.234 -8.298 21.045 1.00 32.71 C ATOM 3395 C GLU A 418 3.122 -8.878 20.173 1.00 33.79 C ATOM 3396 O GLU A 418 3.388 -9.479 19.135 1.00 33.84 O ATOM 3397 CB GLU A 418 4.444 -9.192 22.276 1.00 34.48 C ATOM 3398 CG GLU A 418 4.592 -10.677 21.921 1.00 36.08 C ATOM 3399 CD GLU A 418 4.926 -11.546 23.112 1.00 35.43 C ATOM 3400 OE1 GLU A 418 4.217 -11.474 24.139 1.00 40.47 O ATOM 3401 OE2 GLU A 418 5.899 -12.307 23.015 1.00 39.09 O ATOM 3402 HA GLU A 418 5.153 -8.272 20.460 1.00 0.00 H ATOM 3403 HB2 GLU A 418 5.347 -8.866 22.792 1.00 0.00 H ATOM 3404 HB3 GLU A 418 3.587 -9.077 22.939 1.00 0.00 H ATOM 3405 HG2 GLU A 418 3.653 -11.025 21.491 1.00 0.00 H ATOM 3406 HG3 GLU A 418 5.388 -10.779 21.184 1.00 0.00 H ATOM 3407 H GLU A 418 3.838 -6.702 22.459 1.00 0.00 H ATOM 3408 N LEU A 419 1.878 -8.701 20.601 1.00 33.84 N ATOM 3409 CA LEU A 419 0.738 -9.190 19.831 1.00 34.65 C ATOM 3410 C LEU A 419 0.700 -8.499 18.467 1.00 34.96 C ATOM 3411 O LEU A 419 0.598 -9.148 17.421 1.00 35.39 O ATOM 3412 CB LEU A 419 -0.560 -8.909 20.588 1.00 35.60 C ATOM 3413 CG LEU A 419 -1.847 -9.423 19.939 1.00 39.04 C ATOM 3414 CD1 LEU A 419 -1.709 -10.912 19.620 1.00 39.56 C ATOM 3415 CD2 LEU A 419 -3.023 -9.180 20.878 1.00 38.46 C ATOM 3416 HA LEU A 419 0.841 -10.265 19.686 1.00 0.00 H ATOM 3417 HB2 LEU A 419 -0.477 -9.369 21.573 1.00 0.00 H ATOM 3418 HB3 LEU A 419 -0.652 -7.829 20.700 1.00 0.00 H ATOM 3419 HG LEU A 419 -2.026 -8.887 19.007 1.00 0.00 H ATOM 3420 HD21 LEU A 419 -2.853 -9.708 21.816 1.00 0.00 H ATOM 3421 HD22 LEU A 419 -3.116 -8.112 21.073 1.00 0.00 H ATOM 3422 HD23 LEU A 419 -3.939 -9.547 20.414 1.00 0.00 H ATOM 3423 HD11 LEU A 419 -0.875 -11.059 18.934 1.00 0.00 H ATOM 3424 HD12 LEU A 419 -1.525 -11.464 20.542 1.00 0.00 H ATOM 3425 HD13 LEU A 419 -2.629 -11.270 19.158 1.00 0.00 H ATOM 3426 H LEU A 419 1.713 -8.205 21.500 1.00 0.00 H ATOM 3427 N GLN A 420 0.804 -7.173 18.485 1.00 34.75 N ATOM 3428 CA GLN A 420 0.780 -6.364 17.267 1.00 30.93 C ATOM 3429 C GLN A 420 1.802 -6.828 16.253 1.00 30.75 C ATOM 3430 O GLN A 420 1.527 -6.867 15.057 1.00 31.35 O ATOM 3431 CB GLN A 420 1.040 -4.897 17.630 1.00 31.99 C ATOM 3432 CG GLN A 420 1.445 -3.999 16.477 1.00 27.56 C ATOM 3433 CD GLN A 420 0.299 -3.679 15.542 1.00 28.36 C ATOM 3434 OE1 GLN A 420 -0.864 -3.884 15.872 1.00 26.51 O ATOM 3435 NE2 GLN A 420 0.626 -3.150 14.372 1.00 28.73 N ATOM 3436 HA GLN A 420 -0.204 -6.474 16.811 1.00 0.00 H ATOM 3437 HB2 GLN A 420 0.127 -4.492 18.066 1.00 0.00 H ATOM 3438 HB3 GLN A 420 1.838 -4.871 18.372 1.00 0.00 H ATOM 3439 HG2 GLN A 420 1.832 -3.065 16.884 1.00 0.00 H ATOM 3440 HG3 GLN A 420 2.229 -4.498 15.907 1.00 0.00 H ATOM 3441 HE22 GLN A 420 1.626 -2.993 14.133 1.00 0.00 H ATOM 3442 HE21 GLN A 420 -0.117 -2.891 13.692 1.00 0.00 H ATOM 3443 H GLN A 420 0.906 -6.693 19.402 1.00 0.00 H ATOM 3444 N LEU A 421 2.998 -7.174 16.711 1.00 31.81 N ATOM 3445 CA LEU A 421 4.023 -7.620 15.767 1.00 32.19 C ATOM 3446 C LEU A 421 3.709 -9.013 15.223 1.00 32.49 C ATOM 3447 O LEU A 421 3.973 -9.309 14.060 1.00 33.32 O ATOM 3448 CB LEU A 421 5.412 -7.587 16.428 1.00 30.69 C ATOM 3449 CG LEU A 421 5.893 -6.181 16.851 1.00 30.39 C ATOM 3450 CD1 LEU A 421 7.186 -6.280 17.660 1.00 27.69 C ATOM 3451 CD2 LEU A 421 6.121 -5.313 15.609 1.00 29.14 C ATOM 3452 HA LEU A 421 4.027 -6.932 14.922 1.00 0.00 H ATOM 3453 HB2 LEU A 421 5.380 -8.217 17.317 1.00 0.00 H ATOM 3454 HB3 LEU A 421 6.134 -7.995 15.721 1.00 0.00 H ATOM 3455 HG LEU A 421 5.125 -5.722 17.474 1.00 0.00 H ATOM 3456 HD21 LEU A 421 6.877 -5.778 14.977 1.00 0.00 H ATOM 3457 HD22 LEU A 421 5.187 -5.223 15.054 1.00 0.00 H ATOM 3458 HD23 LEU A 421 6.460 -4.324 15.916 1.00 0.00 H ATOM 3459 HD11 LEU A 421 7.009 -6.879 18.554 1.00 0.00 H ATOM 3460 HD12 LEU A 421 7.958 -6.752 17.052 1.00 0.00 H ATOM 3461 HD13 LEU A 421 7.510 -5.280 17.949 1.00 0.00 H ATOM 3462 H LEU A 421 3.205 -7.129 17.729 1.00 0.00 H ATOM 3463 N LYS A 422 3.129 -9.864 16.055 1.00 35.41 N ATOM 3464 CA LYS A 422 2.785 -11.212 15.615 1.00 40.02 C ATOM 3465 C LYS A 422 1.710 -11.122 14.542 1.00 39.47 C ATOM 3466 O LYS A 422 1.761 -11.822 13.535 1.00 39.74 O ATOM 3467 CB LYS A 422 2.266 -12.046 16.793 1.00 43.45 C ATOM 3468 CG LYS A 422 1.838 -13.460 16.409 1.00 51.35 C ATOM 3469 CD LYS A 422 1.401 -14.286 17.624 1.00 54.25 C ATOM 3470 CE LYS A 422 1.037 -15.717 17.219 1.00 56.69 C ATOM 3471 NZ LYS A 422 0.617 -16.564 18.381 1.00 56.62 N ATOM 3472 HA LYS A 422 3.676 -11.696 15.214 1.00 0.00 H ATOM 3473 HB2 LYS A 422 3.058 -12.117 17.539 1.00 0.00 H ATOM 3474 HB3 LYS A 422 1.407 -11.533 17.225 1.00 0.00 H ATOM 3475 HG2 LYS A 422 1.004 -13.396 15.710 1.00 0.00 H ATOM 3476 HG3 LYS A 422 2.677 -13.962 15.927 1.00 0.00 H ATOM 3477 HD2 LYS A 422 2.218 -14.317 18.345 1.00 0.00 H ATOM 3478 HD3 LYS A 422 0.532 -13.814 18.081 1.00 0.00 H ATOM 3479 HE2 LYS A 422 1.906 -16.177 16.749 1.00 0.00 H ATOM 3480 HE3 LYS A 422 0.216 -15.678 16.503 1.00 0.00 H ATOM 3481 HZ1 LYS A 422 1.395 -16.617 19.069 1.00 0.00 H ATOM 3482 HZ2 LYS A 422 -0.218 -16.140 18.833 1.00 0.00 H ATOM 3483 HZ3 LYS A 422 0.383 -17.520 18.045 1.00 0.00 H ATOM 3484 H LYS A 422 2.917 -9.569 17.030 1.00 0.00 H ATOM 3485 N LEU A 423 0.738 -10.242 14.761 1.00 38.51 N ATOM 3486 CA LEU A 423 -0.351 -10.071 13.812 1.00 36.12 C ATOM 3487 C LEU A 423 0.059 -9.332 12.557 1.00 36.25 C ATOM 3488 O LEU A 423 -0.330 -9.716 11.462 1.00 34.38 O ATOM 3489 CB LEU A 423 -1.514 -9.327 14.478 1.00 36.04 C ATOM 3490 CG LEU A 423 -2.210 -10.086 15.612 1.00 36.62 C ATOM 3491 CD1 LEU A 423 -3.201 -9.180 16.322 1.00 36.13 C ATOM 3492 CD2 LEU A 423 -2.903 -11.316 15.037 1.00 37.49 C ATOM 3493 HA LEU A 423 -0.656 -11.073 13.511 1.00 0.00 H ATOM 3494 HB2 LEU A 423 -1.128 -8.392 14.885 1.00 0.00 H ATOM 3495 HB3 LEU A 423 -2.258 -9.109 13.712 1.00 0.00 H ATOM 3496 HG LEU A 423 -1.472 -10.408 16.347 1.00 0.00 H ATOM 3497 HD21 LEU A 423 -3.640 -11.004 14.297 1.00 0.00 H ATOM 3498 HD22 LEU A 423 -2.162 -11.961 14.564 1.00 0.00 H ATOM 3499 HD23 LEU A 423 -3.400 -11.860 15.840 1.00 0.00 H ATOM 3500 HD11 LEU A 423 -2.673 -8.322 16.739 1.00 0.00 H ATOM 3501 HD12 LEU A 423 -3.951 -8.836 15.610 1.00 0.00 H ATOM 3502 HD13 LEU A 423 -3.687 -9.734 17.125 1.00 0.00 H ATOM 3503 H LEU A 423 0.757 -9.665 15.626 1.00 0.00 H ATOM 3504 N ASN A 424 0.856 -8.276 12.715 1.00 37.89 N ATOM 3505 CA ASN A 424 1.269 -7.458 11.577 1.00 37.55 C ATOM 3506 C ASN A 424 2.473 -7.999 10.809 1.00 38.74 C ATOM 3507 O ASN A 424 2.664 -7.660 9.648 1.00 39.05 O ATOM 3508 CB ASN A 424 1.516 -6.015 12.047 1.00 38.71 C ATOM 3509 CG ASN A 424 1.516 -5.007 10.901 1.00 39.56 C ATOM 3510 OD1 ASN A 424 0.743 -5.130 9.946 1.00 37.21 O ATOM 3511 ND2 ASN A 424 2.374 -3.992 11.003 1.00 38.04 N ATOM 3512 HA ASN A 424 0.448 -7.488 10.861 1.00 0.00 H ATOM 3513 HB2 ASN A 424 0.732 -5.740 12.752 1.00 0.00 H ATOM 3514 HB3 ASN A 424 2.484 -5.973 12.547 1.00 0.00 H ATOM 3515 HD22 ASN A 424 3.008 -3.927 11.825 1.00 0.00 H ATOM 3516 HD21 ASN A 424 2.410 -3.265 10.260 1.00 0.00 H ATOM 3517 H ASN A 424 1.191 -8.029 13.668 1.00 0.00 H ATOM 3518 N HIS A 425 3.282 -8.840 11.444 1.00 40.40 N ATOM 3519 CA HIS A 425 4.449 -9.426 10.774 1.00 40.97 C ATOM 3520 C HIS A 425 4.494 -10.932 11.062 1.00 42.58 C ATOM 3521 O HIS A 425 5.426 -11.429 11.695 1.00 40.36 O ATOM 3522 CB HIS A 425 5.747 -8.774 11.265 1.00 40.03 C ATOM 3523 CG HIS A 425 5.856 -7.321 10.937 1.00 39.03 C ATOM 3524 ND1 HIS A 425 5.195 -6.344 11.649 1.00 40.85 N ATOM 3525 CD2 HIS A 425 6.537 -6.679 9.960 1.00 39.65 C ATOM 3526 CE1 HIS A 425 5.463 -5.162 11.125 1.00 39.83 C ATOM 3527 NE2 HIS A 425 6.274 -5.338 10.098 1.00 42.05 N ATOM 3528 HA HIS A 425 4.359 -9.251 9.702 1.00 0.00 H ATOM 3529 HB2 HIS A 425 5.800 -8.887 12.348 1.00 0.00 H ATOM 3530 HB3 HIS A 425 6.588 -9.294 10.806 1.00 0.00 H ATOM 3531 HD2 HIS A 425 7.175 -7.139 9.205 1.00 0.00 H ATOM 3532 HE1 HIS A 425 5.080 -4.205 11.480 1.00 0.00 H ATOM 3533 H HIS A 425 3.085 -9.088 12.435 1.00 0.00 H ATOM 3534 N PRO A 426 3.490 -11.675 10.572 1.00 44.20 N ATOM 3535 CA PRO A 426 3.362 -13.122 10.758 1.00 46.03 C ATOM 3536 C PRO A 426 4.606 -13.904 10.365 1.00 46.82 C ATOM 3537 O PRO A 426 4.969 -14.877 11.020 1.00 49.81 O ATOM 3538 CB PRO A 426 2.170 -13.483 9.872 1.00 46.76 C ATOM 3539 CG PRO A 426 1.394 -12.201 9.772 1.00 47.76 C ATOM 3540 CD PRO A 426 2.485 -11.188 9.613 1.00 46.27 C ATOM 3541 HA PRO A 426 3.226 -13.381 11.808 1.00 0.00 H ATOM 3542 HD3 PRO A 426 2.877 -11.182 8.596 1.00 0.00 H ATOM 3543 HD2 PRO A 426 2.139 -10.188 9.874 1.00 0.00 H ATOM 3544 HG3 PRO A 426 0.812 -12.018 10.675 1.00 0.00 H ATOM 3545 HG2 PRO A 426 0.729 -12.206 8.908 1.00 0.00 H ATOM 3546 HB2 PRO A 426 2.503 -13.813 8.888 1.00 0.00 H ATOM 3547 HB3 PRO A 426 1.568 -14.267 10.332 1.00 0.00 H ATOM 3548 N GLU A 427 5.257 -13.463 9.298 1.00 47.37 N ATOM 3549 CA GLU A 427 6.445 -14.124 8.775 1.00 48.77 C ATOM 3550 C GLU A 427 7.761 -13.590 9.333 1.00 48.47 C ATOM 3551 O GLU A 427 8.826 -13.900 8.803 1.00 49.81 O ATOM 3552 CB GLU A 427 6.459 -13.987 7.252 1.00 49.64 C ATOM 3553 CG GLU A 427 7.023 -12.656 6.741 1.00 53.80 C ATOM 3554 CD GLU A 427 6.532 -11.430 7.519 1.00 54.70 C ATOM 3555 OE1 GLU A 427 5.308 -11.243 7.660 1.00 53.50 O ATOM 3556 OE2 GLU A 427 7.385 -10.640 7.981 1.00 57.76 O ATOM 3557 HA GLU A 427 6.380 -15.165 9.091 1.00 0.00 H ATOM 3558 HB2 GLU A 427 7.066 -14.794 6.842 1.00 0.00 H ATOM 3559 HB3 GLU A 427 5.435 -14.085 6.891 1.00 0.00 H ATOM 3560 HG2 GLU A 427 8.110 -12.694 6.812 1.00 0.00 H ATOM 3561 HG3 GLU A 427 6.732 -12.539 5.697 1.00 0.00 H ATOM 3562 H GLU A 427 4.906 -12.611 8.815 1.00 0.00 H ATOM 3563 N SER A 428 7.700 -12.788 10.389 1.00 47.30 N ATOM 3564 CA SER A 428 8.914 -12.218 10.958 1.00 46.61 C ATOM 3565 C SER A 428 9.260 -12.862 12.294 1.00 45.76 C ATOM 3566 O SER A 428 8.646 -12.566 13.326 1.00 45.36 O ATOM 3567 CB SER A 428 8.747 -10.711 11.125 1.00 47.46 C ATOM 3568 OG SER A 428 9.906 -10.138 11.698 1.00 54.42 O ATOM 3569 HA SER A 428 9.737 -12.418 10.272 1.00 0.00 H ATOM 3570 HB2 SER A 428 7.893 -10.515 11.774 1.00 0.00 H ATOM 3571 HB3 SER A 428 8.571 -10.260 10.148 1.00 0.00 H ATOM 3572 HG SER A 428 10.068 -10.542 12.587 1.00 0.00 H ATOM 3573 H SER A 428 6.777 -12.565 10.814 1.00 0.00 H ATOM 3574 N SER A 429 10.258 -13.738 12.269 1.00 43.73 N ATOM 3575 CA SER A 429 10.677 -14.454 13.469 1.00 43.66 C ATOM 3576 C SER A 429 11.379 -13.589 14.509 1.00 40.70 C ATOM 3577 O SER A 429 12.380 -12.937 14.216 1.00 39.40 O ATOM 3578 CB SER A 429 11.593 -15.626 13.094 1.00 43.52 C ATOM 3579 OG SER A 429 12.058 -16.282 14.264 1.00 45.69 O ATOM 3580 HA SER A 429 9.754 -14.807 13.930 1.00 0.00 H ATOM 3581 HB2 SER A 429 12.446 -15.250 12.529 1.00 0.00 H ATOM 3582 HB3 SER A 429 11.037 -16.335 12.481 1.00 0.00 H ATOM 3583 HG SER A 429 12.565 -15.640 14.821 1.00 0.00 H ATOM 3584 H SER A 429 10.753 -13.918 11.372 1.00 0.00 H ATOM 3585 N GLN A 430 10.844 -13.602 15.724 1.00 39.89 N ATOM 3586 CA GLN A 430 11.409 -12.849 16.839 1.00 39.77 C ATOM 3587 C GLN A 430 11.555 -11.349 16.567 1.00 39.57 C ATOM 3588 O GLN A 430 12.472 -10.700 17.093 1.00 38.88 O ATOM 3589 CB GLN A 430 12.775 -13.435 17.214 1.00 41.35 C ATOM 3590 CG GLN A 430 12.843 -14.008 18.625 1.00 45.68 C ATOM 3591 CD GLN A 430 11.942 -15.193 18.799 1.00 46.89 C ATOM 3592 OE1 GLN A 430 11.902 -16.071 17.943 1.00 52.56 O ATOM 3593 NE2 GLN A 430 11.216 -15.239 19.911 1.00 47.13 N ATOM 3594 HA GLN A 430 10.701 -12.945 17.662 1.00 0.00 H ATOM 3595 HB2 GLN A 430 13.010 -14.232 16.509 1.00 0.00 H ATOM 3596 HB3 GLN A 430 13.521 -12.645 17.129 1.00 0.00 H ATOM 3597 HG2 GLN A 430 13.869 -14.313 18.831 1.00 0.00 H ATOM 3598 HG3 GLN A 430 12.546 -13.234 19.333 1.00 0.00 H ATOM 3599 HE22 GLN A 430 11.284 -14.470 20.608 1.00 0.00 H ATOM 3600 HE21 GLN A 430 10.580 -16.044 20.084 1.00 0.00 H ATOM 3601 H GLN A 430 9.989 -14.171 15.887 1.00 0.00 H ATOM 3602 N LEU A 431 10.658 -10.797 15.753 1.00 35.42 N ATOM 3603 CA LEU A 431 10.710 -9.375 15.446 1.00 35.16 C ATOM 3604 C LEU A 431 10.688 -8.601 16.761 1.00 32.53 C ATOM 3605 O LEU A 431 11.427 -7.635 16.941 1.00 32.27 O ATOM 3606 CB LEU A 431 9.523 -8.969 14.561 1.00 35.11 C ATOM 3607 CG LEU A 431 9.449 -7.504 14.116 1.00 36.40 C ATOM 3608 CD1 LEU A 431 10.755 -7.080 13.440 1.00 35.96 C ATOM 3609 CD2 LEU A 431 8.277 -7.334 13.167 1.00 34.38 C ATOM 3610 HA LEU A 431 11.623 -9.147 14.896 1.00 0.00 H ATOM 3611 HB2 LEU A 431 9.559 -9.584 13.662 1.00 0.00 H ATOM 3612 HB3 LEU A 431 8.610 -9.190 15.114 1.00 0.00 H ATOM 3613 HG LEU A 431 9.304 -6.867 14.989 1.00 0.00 H ATOM 3614 HD21 LEU A 431 8.419 -7.976 12.298 1.00 0.00 H ATOM 3615 HD22 LEU A 431 7.355 -7.611 13.678 1.00 0.00 H ATOM 3616 HD23 LEU A 431 8.219 -6.294 12.847 1.00 0.00 H ATOM 3617 HD11 LEU A 431 11.580 -7.195 14.143 1.00 0.00 H ATOM 3618 HD12 LEU A 431 10.930 -7.707 12.566 1.00 0.00 H ATOM 3619 HD13 LEU A 431 10.681 -6.037 13.132 1.00 0.00 H ATOM 3620 H LEU A 431 9.913 -11.388 15.332 1.00 0.00 H ATOM 3621 N PHE A 432 9.844 -9.051 17.679 1.00 29.67 N ATOM 3622 CA PHE A 432 9.725 -8.437 18.990 1.00 30.30 C ATOM 3623 C PHE A 432 11.117 -8.337 19.648 1.00 32.83 C ATOM 3624 O PHE A 432 11.562 -7.252 20.036 1.00 31.94 O ATOM 3625 CB PHE A 432 8.772 -9.281 19.843 1.00 27.81 C ATOM 3626 CG PHE A 432 8.449 -8.682 21.180 1.00 30.46 C ATOM 3627 CD1 PHE A 432 8.067 -7.347 21.291 1.00 32.51 C ATOM 3628 CD2 PHE A 432 8.489 -9.462 22.331 1.00 29.70 C ATOM 3629 CE1 PHE A 432 7.727 -6.798 22.535 1.00 30.96 C ATOM 3630 CE2 PHE A 432 8.151 -8.926 23.571 1.00 29.13 C ATOM 3631 CZ PHE A 432 7.771 -7.591 23.675 1.00 28.31 C ATOM 3632 HA PHE A 432 9.323 -7.428 18.901 1.00 0.00 H ATOM 3633 HB2 PHE A 432 7.841 -9.408 19.291 1.00 0.00 H ATOM 3634 HB3 PHE A 432 9.232 -10.256 20.007 1.00 0.00 H ATOM 3635 HD2 PHE A 432 8.789 -10.508 22.261 1.00 0.00 H ATOM 3636 HE2 PHE A 432 8.184 -9.553 24.462 1.00 0.00 H ATOM 3637 HZ PHE A 432 7.509 -7.170 24.646 1.00 0.00 H ATOM 3638 HE1 PHE A 432 7.429 -5.752 22.608 1.00 0.00 H ATOM 3639 HD1 PHE A 432 8.032 -6.721 20.399 1.00 0.00 H ATOM 3640 H PHE A 432 9.247 -9.872 17.453 1.00 0.00 H ATOM 3641 N ALA A 433 11.811 -9.466 19.761 1.00 32.37 N ATOM 3642 CA ALA A 433 13.143 -9.472 20.362 1.00 32.52 C ATOM 3643 C ALA A 433 14.103 -8.536 19.617 1.00 32.38 C ATOM 3644 O ALA A 433 14.850 -7.777 20.243 1.00 33.19 O ATOM 3645 CB ALA A 433 13.715 -10.898 20.372 1.00 31.02 C ATOM 3646 HA ALA A 433 13.043 -9.111 21.386 1.00 0.00 H ATOM 3647 HB1 ALA A 433 13.059 -11.547 20.952 1.00 0.00 H ATOM 3648 HB2 ALA A 433 13.783 -11.268 19.349 1.00 0.00 H ATOM 3649 HB3 ALA A 433 14.707 -10.887 20.823 1.00 0.00 H ATOM 3650 H ALA A 433 11.400 -10.357 19.417 1.00 0.00 H ATOM 3651 N LYS A 434 14.086 -8.594 18.286 1.00 31.26 N ATOM 3652 CA LYS A 434 14.974 -7.755 17.483 1.00 31.47 C ATOM 3653 C LYS A 434 14.692 -6.254 17.642 1.00 30.32 C ATOM 3654 O LYS A 434 15.626 -5.449 17.605 1.00 27.64 O ATOM 3655 CB LYS A 434 14.889 -8.147 16.007 1.00 36.81 C ATOM 3656 CG LYS A 434 15.349 -9.576 15.687 1.00 42.27 C ATOM 3657 CD LYS A 434 16.843 -9.785 15.944 1.00 48.23 C ATOM 3658 CE LYS A 434 17.256 -11.235 15.629 1.00 54.30 C ATOM 3659 NZ LYS A 434 18.716 -11.537 15.821 1.00 51.43 N ATOM 3660 HA LYS A 434 15.983 -7.931 17.855 1.00 0.00 H ATOM 3661 HB2 LYS A 434 13.851 -8.047 15.690 1.00 0.00 H ATOM 3662 HB3 LYS A 434 15.510 -7.456 15.437 1.00 0.00 H ATOM 3663 HG2 LYS A 434 14.787 -10.272 16.310 1.00 0.00 H ATOM 3664 HG3 LYS A 434 15.143 -9.782 14.637 1.00 0.00 H ATOM 3665 HD2 LYS A 434 17.413 -9.105 15.311 1.00 0.00 H ATOM 3666 HD3 LYS A 434 17.059 -9.571 16.991 1.00 0.00 H ATOM 3667 HE2 LYS A 434 17.002 -11.441 14.589 1.00 0.00 H ATOM 3668 HE3 LYS A 434 16.685 -11.898 16.279 1.00 0.00 H ATOM 3669 HZ1 LYS A 434 19.280 -10.924 15.198 1.00 0.00 H ATOM 3670 HZ2 LYS A 434 18.978 -11.361 16.812 1.00 0.00 H ATOM 3671 HZ3 LYS A 434 18.897 -12.534 15.585 1.00 0.00 H ATOM 3672 H LYS A 434 13.430 -9.247 17.811 1.00 0.00 H ATOM 3673 N LEU A 435 13.423 -5.875 17.821 1.00 27.47 N ATOM 3674 CA LEU A 435 13.085 -4.456 18.000 1.00 28.77 C ATOM 3675 C LEU A 435 13.571 -3.978 19.385 1.00 29.90 C ATOM 3676 O LEU A 435 14.172 -2.907 19.506 1.00 29.84 O ATOM 3677 CB LEU A 435 11.572 -4.224 17.853 1.00 24.36 C ATOM 3678 CG LEU A 435 11.053 -2.806 18.175 1.00 27.59 C ATOM 3679 CD1 LEU A 435 11.787 -1.762 17.347 1.00 22.37 C ATOM 3680 CD2 LEU A 435 9.546 -2.733 17.914 1.00 25.91 C ATOM 3681 HA LEU A 435 13.587 -3.879 17.223 1.00 0.00 H ATOM 3682 HB2 LEU A 435 11.302 -4.448 16.821 1.00 0.00 H ATOM 3683 HB3 LEU A 435 11.064 -4.921 18.520 1.00 0.00 H ATOM 3684 HG LEU A 435 11.242 -2.596 19.228 1.00 0.00 H ATOM 3685 HD21 LEU A 435 9.349 -2.960 16.866 1.00 0.00 H ATOM 3686 HD22 LEU A 435 9.033 -3.457 18.547 1.00 0.00 H ATOM 3687 HD23 LEU A 435 9.187 -1.730 18.143 1.00 0.00 H ATOM 3688 HD11 LEU A 435 12.853 -1.806 17.571 1.00 0.00 H ATOM 3689 HD12 LEU A 435 11.628 -1.963 16.288 1.00 0.00 H ATOM 3690 HD13 LEU A 435 11.404 -0.771 17.591 1.00 0.00 H ATOM 3691 H LEU A 435 12.668 -6.590 17.834 1.00 0.00 H ATOM 3692 N LEU A 436 13.328 -4.781 20.419 1.00 29.96 N ATOM 3693 CA LEU A 436 13.770 -4.450 21.775 1.00 29.77 C ATOM 3694 C LEU A 436 15.299 -4.283 21.866 1.00 31.70 C ATOM 3695 O LEU A 436 15.789 -3.411 22.598 1.00 31.24 O ATOM 3696 CB LEU A 436 13.317 -5.533 22.757 1.00 29.86 C ATOM 3697 CG LEU A 436 11.810 -5.726 22.938 1.00 31.44 C ATOM 3698 CD1 LEU A 436 11.562 -6.893 23.879 1.00 31.06 C ATOM 3699 CD2 LEU A 436 11.180 -4.452 23.477 1.00 30.87 C ATOM 3700 HA LEU A 436 13.314 -3.495 22.036 1.00 0.00 H ATOM 3701 HB2 LEU A 436 13.731 -6.481 22.414 1.00 0.00 H ATOM 3702 HB3 LEU A 436 13.736 -5.287 23.733 1.00 0.00 H ATOM 3703 HG LEU A 436 11.351 -5.947 21.974 1.00 0.00 H ATOM 3704 HD21 LEU A 436 11.628 -4.206 24.440 1.00 0.00 H ATOM 3705 HD22 LEU A 436 11.355 -3.637 22.775 1.00 0.00 H ATOM 3706 HD23 LEU A 436 10.108 -4.603 23.601 1.00 0.00 H ATOM 3707 HD11 LEU A 436 11.998 -7.798 23.456 1.00 0.00 H ATOM 3708 HD12 LEU A 436 12.022 -6.684 24.845 1.00 0.00 H ATOM 3709 HD13 LEU A 436 10.489 -7.032 24.009 1.00 0.00 H ATOM 3710 H LEU A 436 12.810 -5.668 20.259 1.00 0.00 H ATOM 3711 N GLN A 437 16.052 -5.113 21.137 1.00 30.78 N ATOM 3712 CA GLN A 437 17.514 -5.008 21.147 1.00 31.79 C ATOM 3713 C GLN A 437 17.937 -3.668 20.560 1.00 32.25 C ATOM 3714 O GLN A 437 18.958 -3.104 20.944 1.00 31.83 O ATOM 3715 CB GLN A 437 18.167 -6.136 20.336 1.00 31.60 C ATOM 3716 CG GLN A 437 17.826 -7.539 20.830 1.00 38.17 C ATOM 3717 CD GLN A 437 18.650 -8.629 20.153 1.00 40.65 C ATOM 3718 OE1 GLN A 437 19.816 -8.826 20.475 1.00 45.36 O ATOM 3719 NE2 GLN A 437 18.046 -9.334 19.210 1.00 40.92 N ATOM 3720 HA GLN A 437 17.845 -5.091 22.182 1.00 0.00 H ATOM 3721 HB2 GLN A 437 17.837 -6.048 19.301 1.00 0.00 H ATOM 3722 HB3 GLN A 437 19.249 -6.010 20.384 1.00 0.00 H ATOM 3723 HG2 GLN A 437 18.008 -7.583 21.904 1.00 0.00 H ATOM 3724 HG3 GLN A 437 16.771 -7.729 20.634 1.00 0.00 H ATOM 3725 HE22 GLN A 437 17.055 -9.135 18.967 1.00 0.00 H ATOM 3726 HE21 GLN A 437 18.563 -10.087 18.712 1.00 0.00 H ATOM 3727 H GLN A 437 15.594 -5.843 20.555 1.00 0.00 H ATOM 3728 N LYS A 438 17.148 -3.159 19.618 1.00 32.73 N ATOM 3729 CA LYS A 438 17.451 -1.875 19.008 1.00 33.60 C ATOM 3730 C LYS A 438 17.486 -0.783 20.076 1.00 33.41 C ATOM 3731 O LYS A 438 18.127 0.253 19.896 1.00 33.34 O ATOM 3732 CB LYS A 438 16.413 -1.541 17.932 1.00 34.31 C ATOM 3733 CG LYS A 438 16.564 -2.375 16.684 1.00 32.38 C ATOM 3734 CD LYS A 438 17.898 -2.089 16.026 1.00 37.51 C ATOM 3735 CE LYS A 438 18.153 -3.020 14.839 1.00 40.74 C ATOM 3736 NZ LYS A 438 18.273 -4.448 15.276 1.00 43.67 N ATOM 3737 HA LYS A 438 18.431 -1.931 18.535 1.00 0.00 H ATOM 3738 HB2 LYS A 438 15.418 -1.711 18.345 1.00 0.00 H ATOM 3739 HB3 LYS A 438 16.519 -0.490 17.662 1.00 0.00 H ATOM 3740 HG2 LYS A 438 16.510 -3.431 16.947 1.00 0.00 H ATOM 3741 HG3 LYS A 438 15.760 -2.134 15.989 1.00 0.00 H ATOM 3742 HD2 LYS A 438 17.905 -1.057 15.674 1.00 0.00 H ATOM 3743 HD3 LYS A 438 18.692 -2.227 16.760 1.00 0.00 H ATOM 3744 HE2 LYS A 438 19.078 -2.721 14.347 1.00 0.00 H ATOM 3745 HE3 LYS A 438 17.325 -2.933 14.136 1.00 0.00 H ATOM 3746 HZ1 LYS A 438 19.066 -4.540 15.943 1.00 0.00 H ATOM 3747 HZ2 LYS A 438 17.391 -4.742 15.742 1.00 0.00 H ATOM 3748 HZ3 LYS A 438 18.445 -5.050 14.446 1.00 0.00 H ATOM 3749 H LYS A 438 16.304 -3.686 19.314 1.00 0.00 H ATOM 3750 N MET A 439 16.809 -1.018 21.193 1.00 33.97 N ATOM 3751 CA MET A 439 16.794 -0.030 22.261 1.00 36.35 C ATOM 3752 C MET A 439 18.214 0.272 22.741 1.00 38.73 C ATOM 3753 O MET A 439 18.467 1.326 23.322 1.00 37.63 O ATOM 3754 CB MET A 439 15.932 -0.513 23.423 1.00 36.68 C ATOM 3755 CG MET A 439 14.456 -0.640 23.055 1.00 37.27 C ATOM 3756 SD MET A 439 13.402 -1.133 24.433 1.00 41.92 S ATOM 3757 CE MET A 439 13.072 0.474 25.219 1.00 40.34 C ATOM 3758 HA MET A 439 16.363 0.890 21.867 1.00 0.00 H ATOM 3759 HB2 MET A 439 16.296 -1.489 23.744 1.00 0.00 H ATOM 3760 HB3 MET A 439 16.026 0.197 24.245 1.00 0.00 H ATOM 3761 HG2 MET A 439 14.361 -1.386 22.266 1.00 0.00 H ATOM 3762 HG3 MET A 439 14.110 0.325 22.685 1.00 0.00 H ATOM 3763 HE1 MET A 439 14.014 0.924 25.533 1.00 0.00 H ATOM 3764 HE2 MET A 439 12.574 1.131 24.505 1.00 0.00 H ATOM 3765 HE3 MET A 439 12.431 0.327 26.088 1.00 0.00 H ATOM 3766 H MET A 439 16.288 -1.911 21.305 1.00 0.00 H ATOM 3767 N THR A 440 19.141 -0.649 22.479 1.00 38.26 N ATOM 3768 CA THR A 440 20.527 -0.468 22.879 1.00 38.80 C ATOM 3769 C THR A 440 21.206 0.542 21.961 1.00 38.89 C ATOM 3770 O THR A 440 21.969 1.395 22.413 1.00 39.10 O ATOM 3771 CB THR A 440 21.318 -1.796 22.809 1.00 40.34 C ATOM 3772 OG1 THR A 440 20.731 -2.760 23.700 1.00 41.44 O ATOM 3773 CG2 THR A 440 22.767 -1.561 23.194 1.00 39.31 C ATOM 3774 HA THR A 440 20.523 -0.111 23.909 1.00 0.00 H ATOM 3775 HB THR A 440 21.279 -2.177 21.788 1.00 0.00 H ATOM 3776 HG1 THR A 440 19.791 -2.924 23.435 1.00 0.00 H ATOM 3777 HG23 THR A 440 23.208 -0.830 22.516 1.00 0.00 H ATOM 3778 HG21 THR A 440 22.814 -1.185 24.216 1.00 0.00 H ATOM 3779 HG22 THR A 440 23.317 -2.500 23.125 1.00 0.00 H ATOM 3780 H THR A 440 18.867 -1.517 21.977 1.00 0.00 H ATOM 3781 N ASP A 441 20.935 0.436 20.665 1.00 37.03 N ATOM 3782 CA ASP A 441 21.527 1.350 19.703 1.00 37.31 C ATOM 3783 C ASP A 441 21.038 2.769 19.995 1.00 36.65 C ATOM 3784 O ASP A 441 21.778 3.735 19.819 1.00 35.97 O ATOM 3785 CB ASP A 441 21.149 0.923 18.285 1.00 38.06 C ATOM 3786 CG ASP A 441 21.547 -0.510 17.989 1.00 41.94 C ATOM 3787 OD1 ASP A 441 22.670 -0.734 17.497 1.00 46.74 O ATOM 3788 OD2 ASP A 441 20.742 -1.424 18.271 1.00 43.59 O ATOM 3789 HA ASP A 441 22.614 1.328 19.786 1.00 0.00 H ATOM 3790 HB2 ASP A 441 20.070 1.019 18.166 1.00 0.00 H ATOM 3791 HB3 ASP A 441 21.651 1.580 17.575 1.00 0.00 H ATOM 3792 H ASP A 441 20.291 -0.311 20.335 1.00 0.00 H ATOM 3793 N LEU A 442 19.797 2.893 20.457 1.00 35.13 N ATOM 3794 CA LEU A 442 19.247 4.204 20.764 1.00 37.38 C ATOM 3795 C LEU A 442 20.017 4.893 21.888 1.00 37.24 C ATOM 3796 O LEU A 442 20.415 6.049 21.741 1.00 36.32 O ATOM 3797 CB LEU A 442 17.765 4.092 21.137 1.00 36.19 C ATOM 3798 CG LEU A 442 16.836 3.755 19.969 1.00 35.82 C ATOM 3799 CD1 LEU A 442 15.453 3.425 20.483 1.00 35.87 C ATOM 3800 CD2 LEU A 442 16.787 4.925 19.014 1.00 35.07 C ATOM 3801 HA LEU A 442 19.346 4.815 19.867 1.00 0.00 H ATOM 3802 HB2 LEU A 442 17.662 3.310 21.890 1.00 0.00 H ATOM 3803 HB3 LEU A 442 17.448 5.045 21.559 1.00 0.00 H ATOM 3804 HG LEU A 442 17.218 2.882 19.439 1.00 0.00 H ATOM 3805 HD21 LEU A 442 16.411 5.804 19.537 1.00 0.00 H ATOM 3806 HD22 LEU A 442 17.790 5.126 18.637 1.00 0.00 H ATOM 3807 HD23 LEU A 442 16.125 4.685 18.182 1.00 0.00 H ATOM 3808 HD11 LEU A 442 15.511 2.568 21.153 1.00 0.00 H ATOM 3809 HD12 LEU A 442 15.053 4.283 21.023 1.00 0.00 H ATOM 3810 HD13 LEU A 442 14.801 3.187 19.642 1.00 0.00 H ATOM 3811 H LEU A 442 19.214 2.044 20.600 1.00 0.00 H ATOM 3812 N ARG A 443 20.218 4.196 23.005 1.00 38.17 N ATOM 3813 CA ARG A 443 20.962 4.771 24.131 1.00 39.38 C ATOM 3814 C ARG A 443 22.344 5.253 23.686 1.00 38.30 C ATOM 3815 O ARG A 443 22.775 6.337 24.072 1.00 37.36 O ATOM 3816 CB ARG A 443 21.130 3.749 25.268 1.00 39.28 C ATOM 3817 CG ARG A 443 20.095 3.848 26.395 1.00 44.04 C ATOM 3818 CD ARG A 443 20.213 5.130 27.225 1.00 43.28 C ATOM 3819 NE ARG A 443 19.274 5.124 28.353 1.00 47.50 N ATOM 3820 CZ ARG A 443 19.183 6.076 29.293 1.00 47.00 C ATOM 3821 NH1 ARG A 443 19.978 7.144 29.254 1.00 42.48 N ATOM 3822 NH2 ARG A 443 18.301 5.950 30.292 1.00 41.46 N ATOM 3823 HA ARG A 443 20.383 5.620 24.496 1.00 0.00 H ATOM 3824 HB2 ARG A 443 21.064 2.750 24.836 1.00 0.00 H ATOM 3825 HB3 ARG A 443 22.119 3.890 25.705 1.00 0.00 H ATOM 3826 HG2 ARG A 443 19.099 3.814 25.953 1.00 0.00 H ATOM 3827 HG3 ARG A 443 20.226 2.994 27.059 1.00 0.00 H ATOM 3828 HD2 ARG A 443 19.997 5.987 26.587 1.00 0.00 H ATOM 3829 HD3 ARG A 443 21.230 5.212 27.609 1.00 0.00 H ATOM 3830 HE ARG A 443 18.626 4.314 28.430 1.00 0.00 H ATOM 3831 HH12 ARG A 443 19.900 7.877 29.987 1.00 0.00 H ATOM 3832 HH11 ARG A 443 20.677 7.245 28.490 1.00 0.00 H ATOM 3833 HH22 ARG A 443 18.231 6.689 31.020 1.00 0.00 H ATOM 3834 HH21 ARG A 443 17.685 5.113 30.340 1.00 0.00 H ATOM 3835 H ARG A 443 19.842 3.229 23.080 1.00 0.00 H ATOM 3836 N GLN A 444 23.029 4.448 22.876 1.00 37.58 N ATOM 3837 CA GLN A 444 24.364 4.808 22.397 1.00 40.07 C ATOM 3838 C GLN A 444 24.321 6.087 21.560 1.00 39.55 C ATOM 3839 O GLN A 444 25.213 6.926 21.656 1.00 39.37 O ATOM 3840 CB GLN A 444 24.970 3.675 21.555 1.00 42.98 C ATOM 3841 CG GLN A 444 24.798 2.269 22.126 1.00 48.33 C ATOM 3842 CD GLN A 444 25.345 2.114 23.534 1.00 52.44 C ATOM 3843 OE1 GLN A 444 26.505 2.444 23.813 1.00 55.41 O ATOM 3844 NE2 GLN A 444 24.510 1.598 24.434 1.00 54.85 N ATOM 3845 HA GLN A 444 24.988 4.976 23.275 1.00 0.00 H ATOM 3846 HB2 GLN A 444 24.500 3.698 20.572 1.00 0.00 H ATOM 3847 HB3 GLN A 444 26.038 3.867 21.451 1.00 0.00 H ATOM 3848 HG2 GLN A 444 23.735 2.030 22.141 1.00 0.00 H ATOM 3849 HG3 GLN A 444 25.318 1.566 21.475 1.00 0.00 H ATOM 3850 HE22 GLN A 444 23.543 1.335 24.155 1.00 0.00 H ATOM 3851 HE21 GLN A 444 24.825 1.458 25.415 1.00 0.00 H ATOM 3852 H GLN A 444 22.607 3.546 22.578 1.00 0.00 H ATOM 3853 N ILE A 445 23.293 6.228 20.726 1.00 38.55 N ATOM 3854 CA ILE A 445 23.161 7.421 19.902 1.00 38.06 C ATOM 3855 C ILE A 445 23.040 8.628 20.830 1.00 37.47 C ATOM 3856 O ILE A 445 23.729 9.637 20.650 1.00 35.03 O ATOM 3857 CB ILE A 445 21.902 7.361 19.003 1.00 38.86 C ATOM 3858 CG1 ILE A 445 22.029 6.216 18.001 1.00 38.72 C ATOM 3859 CG2 ILE A 445 21.725 8.679 18.248 1.00 37.97 C ATOM 3860 CD1 ILE A 445 23.177 6.373 17.040 1.00 40.36 C ATOM 3861 HA ILE A 445 24.035 7.495 19.255 1.00 0.00 H ATOM 3862 HB ILE A 445 21.032 7.193 19.638 1.00 0.00 H ATOM 3863 HG12 ILE A 445 22.169 5.288 18.555 1.00 0.00 H ATOM 3864 HG13 ILE A 445 21.105 6.158 17.426 1.00 0.00 H ATOM 3865 HD11 ILE A 445 23.047 7.291 16.468 1.00 0.00 H ATOM 3866 HD12 ILE A 445 24.112 6.420 17.598 1.00 0.00 H ATOM 3867 HD13 ILE A 445 23.200 5.520 16.361 1.00 0.00 H ATOM 3868 HG21 ILE A 445 21.613 9.494 18.963 1.00 0.00 H ATOM 3869 HG22 ILE A 445 22.600 8.859 17.624 1.00 0.00 H ATOM 3870 HG23 ILE A 445 20.836 8.620 17.621 1.00 0.00 H ATOM 3871 H ILE A 445 22.576 5.477 20.662 1.00 0.00 H ATOM 3872 N VAL A 446 22.174 8.508 21.832 1.00 35.78 N ATOM 3873 CA VAL A 446 21.955 9.588 22.789 1.00 38.27 C ATOM 3874 C VAL A 446 23.238 9.975 23.514 1.00 40.86 C ATOM 3875 O VAL A 446 23.660 11.134 23.488 1.00 40.44 O ATOM 3876 CB VAL A 446 20.905 9.200 23.842 1.00 35.11 C ATOM 3877 CG1 VAL A 446 20.743 10.316 24.862 1.00 36.58 C ATOM 3878 CG2 VAL A 446 19.589 8.922 23.172 1.00 36.59 C ATOM 3879 HA VAL A 446 21.599 10.438 22.207 1.00 0.00 H ATOM 3880 HB VAL A 446 21.241 8.301 24.358 1.00 0.00 H ATOM 3881 HG11 VAL A 446 21.697 10.494 25.359 1.00 0.00 H ATOM 3882 HG12 VAL A 446 20.420 11.226 24.355 1.00 0.00 H ATOM 3883 HG13 VAL A 446 19.996 10.026 25.601 1.00 0.00 H ATOM 3884 HG21 VAL A 446 19.256 9.815 22.643 1.00 0.00 H ATOM 3885 HG22 VAL A 446 19.709 8.102 22.464 1.00 0.00 H ATOM 3886 HG23 VAL A 446 18.850 8.648 23.925 1.00 0.00 H ATOM 3887 H VAL A 446 21.639 7.622 21.936 1.00 0.00 H ATOM 3888 N THR A 447 23.853 8.994 24.160 1.00 43.02 N ATOM 3889 CA THR A 447 25.084 9.215 24.905 1.00 45.87 C ATOM 3890 C THR A 447 26.175 9.828 24.034 1.00 47.08 C ATOM 3891 O THR A 447 26.960 10.654 24.494 1.00 49.36 O ATOM 3892 CB THR A 447 25.601 7.887 25.508 1.00 45.56 C ATOM 3893 OG1 THR A 447 24.696 7.450 26.529 1.00 46.27 O ATOM 3894 CG2 THR A 447 26.985 8.072 26.107 1.00 49.01 C ATOM 3895 HA THR A 447 24.849 9.917 25.705 1.00 0.00 H ATOM 3896 HB THR A 447 25.662 7.141 24.715 1.00 0.00 H ATOM 3897 HG1 THR A 447 25.024 6.600 26.917 1.00 0.00 H ATOM 3898 HG23 THR A 447 27.674 8.405 25.331 1.00 0.00 H ATOM 3899 HG21 THR A 447 26.940 8.820 26.899 1.00 0.00 H ATOM 3900 HG22 THR A 447 27.331 7.124 26.520 1.00 0.00 H ATOM 3901 H THR A 447 23.444 8.038 24.134 1.00 0.00 H ATOM 3902 N GLU A 448 26.216 9.423 22.773 1.00 46.77 N ATOM 3903 CA GLU A 448 27.216 9.927 21.842 1.00 47.05 C ATOM 3904 C GLU A 448 26.887 11.357 21.408 1.00 45.59 C ATOM 3905 O GLU A 448 27.775 12.205 21.278 1.00 44.89 O ATOM 3906 CB GLU A 448 27.269 9.008 20.632 1.00 48.98 C ATOM 3907 CG GLU A 448 28.453 9.205 19.736 1.00 54.89 C ATOM 3908 CD GLU A 448 28.489 8.165 18.637 1.00 57.66 C ATOM 3909 OE1 GLU A 448 27.657 8.254 17.705 1.00 58.01 O ATOM 3910 OE2 GLU A 448 29.336 7.250 18.720 1.00 59.57 O ATOM 3911 HA GLU A 448 28.188 9.945 22.335 1.00 0.00 H ATOM 3912 HB2 GLU A 448 27.284 7.979 20.990 1.00 0.00 H ATOM 3913 HB3 GLU A 448 26.367 9.174 20.042 1.00 0.00 H ATOM 3914 HG2 GLU A 448 28.397 10.196 19.286 1.00 0.00 H ATOM 3915 HG3 GLU A 448 29.364 9.127 20.329 1.00 0.00 H ATOM 3916 H GLU A 448 25.517 8.728 22.440 1.00 0.00 H ATOM 3917 N HIS A 449 25.603 11.610 21.180 1.00 43.31 N ATOM 3918 CA HIS A 449 25.135 12.925 20.771 1.00 42.43 C ATOM 3919 C HIS A 449 25.478 13.918 21.882 1.00 42.25 C ATOM 3920 O HIS A 449 25.923 15.039 21.630 1.00 40.66 O ATOM 3921 CB HIS A 449 23.618 12.903 20.555 1.00 42.24 C ATOM 3922 CG HIS A 449 23.061 14.206 20.073 1.00 41.05 C ATOM 3923 ND1 HIS A 449 23.143 14.603 18.757 1.00 42.25 N ATOM 3924 CD2 HIS A 449 22.467 15.225 20.738 1.00 41.12 C ATOM 3925 CE1 HIS A 449 22.626 15.812 18.632 1.00 42.56 C ATOM 3926 NE2 HIS A 449 22.207 16.213 19.820 1.00 41.08 N ATOM 3927 HA HIS A 449 25.614 13.215 19.836 1.00 0.00 H ATOM 3928 HB2 HIS A 449 23.386 12.135 19.817 1.00 0.00 H ATOM 3929 HB3 HIS A 449 23.139 12.652 21.501 1.00 0.00 H ATOM 3930 HD2 HIS A 449 22.238 15.256 21.803 1.00 0.00 H ATOM 3931 HE1 HIS A 449 22.557 16.383 17.706 1.00 0.00 H ATOM 3932 H HIS A 449 24.910 10.843 21.298 1.00 0.00 H ATOM 3933 N VAL A 450 25.264 13.480 23.116 1.00 42.66 N ATOM 3934 CA VAL A 450 25.554 14.287 24.285 1.00 43.63 C ATOM 3935 C VAL A 450 27.028 14.691 24.350 1.00 44.04 C ATOM 3936 O VAL A 450 27.349 15.837 24.657 1.00 43.93 O ATOM 3937 CB VAL A 450 25.165 13.520 25.572 1.00 43.20 C ATOM 3938 CG1 VAL A 450 26.036 13.956 26.752 1.00 43.30 C ATOM 3939 CG2 VAL A 450 23.708 13.778 25.881 1.00 42.49 C ATOM 3940 HA VAL A 450 24.962 15.199 24.207 1.00 0.00 H ATOM 3941 HB VAL A 450 25.326 12.454 25.410 1.00 0.00 H ATOM 3942 HG11 VAL A 450 27.082 13.752 26.525 1.00 0.00 H ATOM 3943 HG12 VAL A 450 25.902 15.024 26.926 1.00 0.00 H ATOM 3944 HG13 VAL A 450 25.742 13.402 27.643 1.00 0.00 H ATOM 3945 HG21 VAL A 450 23.553 14.847 26.030 1.00 0.00 H ATOM 3946 HG22 VAL A 450 23.095 13.433 25.049 1.00 0.00 H ATOM 3947 HG23 VAL A 450 23.429 13.240 26.787 1.00 0.00 H ATOM 3948 H VAL A 450 24.875 12.525 23.249 1.00 0.00 H ATOM 3949 N GLN A 451 27.925 13.758 24.060 1.00 44.62 N ATOM 3950 CA GLN A 451 29.340 14.078 24.121 1.00 46.71 C ATOM 3951 C GLN A 451 29.751 15.045 23.005 1.00 45.56 C ATOM 3952 O GLN A 451 30.662 15.853 23.182 1.00 45.84 O ATOM 3953 CB GLN A 451 30.177 12.797 24.063 1.00 48.73 C ATOM 3954 CG GLN A 451 30.264 12.161 22.692 1.00 54.24 C ATOM 3955 CD GLN A 451 30.847 10.761 22.739 1.00 57.00 C ATOM 3956 OE1 GLN A 451 31.078 10.140 21.700 1.00 58.61 O ATOM 3957 NE2 GLN A 451 31.082 10.253 23.948 1.00 57.73 N ATOM 3958 HA GLN A 451 29.528 14.579 25.071 1.00 0.00 H ATOM 3959 HB2 GLN A 451 31.188 13.036 24.392 1.00 0.00 H ATOM 3960 HB3 GLN A 451 29.736 12.072 24.747 1.00 0.00 H ATOM 3961 HG2 GLN A 451 29.262 12.109 22.266 1.00 0.00 H ATOM 3962 HG3 GLN A 451 30.896 12.782 22.057 1.00 0.00 H ATOM 3963 HE22 GLN A 451 30.871 10.814 24.798 1.00 0.00 H ATOM 3964 HE21 GLN A 451 31.476 9.295 24.042 1.00 0.00 H ATOM 3965 H GLN A 451 27.616 12.802 23.790 1.00 0.00 H ATOM 3966 N LEU A 452 29.072 14.977 21.864 1.00 43.54 N ATOM 3967 CA LEU A 452 29.397 15.864 20.758 1.00 43.59 C ATOM 3968 C LEU A 452 28.902 17.274 21.058 1.00 43.27 C ATOM 3969 O LEU A 452 29.529 18.266 20.675 1.00 42.35 O ATOM 3970 CB LEU A 452 28.771 15.359 19.456 1.00 45.75 C ATOM 3971 CG LEU A 452 29.306 16.030 18.190 1.00 47.12 C ATOM 3972 CD1 LEU A 452 30.829 15.976 18.191 1.00 48.13 C ATOM 3973 CD2 LEU A 452 28.752 15.325 16.960 1.00 49.60 C ATOM 3974 HA LEU A 452 30.480 15.881 20.638 1.00 0.00 H ATOM 3975 HB2 LEU A 452 28.961 14.288 19.380 1.00 0.00 H ATOM 3976 HB3 LEU A 452 27.696 15.533 19.505 1.00 0.00 H ATOM 3977 HG LEU A 452 28.988 17.072 18.167 1.00 0.00 H ATOM 3978 HD21 LEU A 452 29.060 14.280 16.972 1.00 0.00 H ATOM 3979 HD22 LEU A 452 27.664 15.385 16.968 1.00 0.00 H ATOM 3980 HD23 LEU A 452 29.137 15.808 16.062 1.00 0.00 H ATOM 3981 HD11 LEU A 452 31.209 16.499 19.068 1.00 0.00 H ATOM 3982 HD12 LEU A 452 31.154 14.936 18.217 1.00 0.00 H ATOM 3983 HD13 LEU A 452 31.209 16.455 17.288 1.00 0.00 H ATOM 3984 H LEU A 452 28.303 14.285 21.762 1.00 0.00 H ATOM 3985 N LEU A 453 27.772 17.350 21.752 1.00 42.41 N ATOM 3986 CA LEU A 453 27.181 18.622 22.135 1.00 43.58 C ATOM 3987 C LEU A 453 28.125 19.388 23.073 1.00 44.16 C ATOM 3988 O LEU A 453 28.296 20.597 22.942 1.00 44.53 O ATOM 3989 CB LEU A 453 25.842 18.370 22.828 1.00 43.38 C ATOM 3990 CG LEU A 453 24.596 19.037 22.247 1.00 46.19 C ATOM 3991 CD1 LEU A 453 24.554 18.887 20.735 1.00 45.71 C ATOM 3992 CD2 LEU A 453 23.373 18.408 22.876 1.00 45.45 C ATOM 3993 HA LEU A 453 27.019 19.225 21.242 1.00 0.00 H ATOM 3994 HB2 LEU A 453 25.669 17.294 22.817 1.00 0.00 H ATOM 3995 HB3 LEU A 453 25.941 18.710 23.859 1.00 0.00 H ATOM 3996 HG LEU A 453 24.619 20.104 22.470 1.00 0.00 H ATOM 3997 HD21 LEU A 453 23.360 17.341 22.655 1.00 0.00 H ATOM 3998 HD22 LEU A 453 23.404 18.556 23.955 1.00 0.00 H ATOM 3999 HD23 LEU A 453 22.476 18.875 22.470 1.00 0.00 H ATOM 4000 HD11 LEU A 453 25.437 19.355 20.300 1.00 0.00 H ATOM 4001 HD12 LEU A 453 24.538 17.828 20.477 1.00 0.00 H ATOM 4002 HD13 LEU A 453 23.657 19.371 20.348 1.00 0.00 H ATOM 4003 H LEU A 453 27.294 16.470 22.031 1.00 0.00 H ATOM 4004 N GLN A 454 28.732 18.682 24.022 1.00 43.92 N ATOM 4005 CA GLN A 454 29.652 19.323 24.958 1.00 44.26 C ATOM 4006 C GLN A 454 30.886 19.873 24.242 1.00 43.99 C ATOM 4007 O GLN A 454 31.492 20.841 24.703 1.00 44.46 O ATOM 4008 CB GLN A 454 30.065 18.336 26.056 1.00 43.90 C ATOM 4009 CG GLN A 454 28.910 17.951 26.974 1.00 44.34 C ATOM 4010 CD GLN A 454 28.394 19.126 27.788 1.00 44.49 C ATOM 4011 OE1 GLN A 454 27.239 19.143 28.212 1.00 45.81 O ATOM 4012 NE2 GLN A 454 29.255 20.109 28.023 1.00 45.72 N ATOM 4013 HA GLN A 454 29.132 20.165 25.415 1.00 0.00 H ATOM 4014 HB2 GLN A 454 30.451 17.432 25.584 1.00 0.00 H ATOM 4015 HB3 GLN A 454 30.850 18.794 26.658 1.00 0.00 H ATOM 4016 HG2 GLN A 454 28.094 17.563 26.365 1.00 0.00 H ATOM 4017 HG3 GLN A 454 29.252 17.175 27.659 1.00 0.00 H ATOM 4018 HE22 GLN A 454 30.222 20.054 27.645 1.00 0.00 H ATOM 4019 HE21 GLN A 454 28.962 20.934 28.585 1.00 0.00 H ATOM 4020 H GLN A 454 28.550 17.661 24.099 1.00 0.00 H ATOM 4021 N VAL A 455 31.258 19.256 23.122 1.00 43.27 N ATOM 4022 CA VAL A 455 32.408 19.720 22.345 1.00 43.15 C ATOM 4023 C VAL A 455 32.028 21.023 21.648 1.00 44.00 C ATOM 4024 O VAL A 455 32.760 22.006 21.712 1.00 42.44 O ATOM 4025 CB VAL A 455 32.849 18.675 21.274 1.00 43.20 C ATOM 4026 CG1 VAL A 455 33.776 19.316 20.253 1.00 42.51 C ATOM 4027 CG2 VAL A 455 33.583 17.521 21.945 1.00 43.88 C ATOM 4028 HA VAL A 455 33.245 19.868 23.027 1.00 0.00 H ATOM 4029 HB VAL A 455 31.955 18.306 20.771 1.00 0.00 H ATOM 4030 HG11 VAL A 455 33.256 20.135 19.756 1.00 0.00 H ATOM 4031 HG12 VAL A 455 34.662 19.700 20.759 1.00 0.00 H ATOM 4032 HG13 VAL A 455 34.072 18.571 19.515 1.00 0.00 H ATOM 4033 HG21 VAL A 455 34.465 17.903 22.459 1.00 0.00 H ATOM 4034 HG22 VAL A 455 32.921 17.040 22.665 1.00 0.00 H ATOM 4035 HG23 VAL A 455 33.887 16.797 21.189 1.00 0.00 H ATOM 4036 H VAL A 455 30.721 18.428 22.793 1.00 0.00 H ATOM 4037 N ILE A 456 30.868 21.018 20.998 1.00 46.66 N ATOM 4038 CA ILE A 456 30.350 22.182 20.276 1.00 48.77 C ATOM 4039 C ILE A 456 30.188 23.379 21.204 1.00 49.21 C ATOM 4040 O ILE A 456 30.580 24.498 20.875 1.00 50.53 O ATOM 4041 CB ILE A 456 28.977 21.860 19.644 1.00 50.07 C ATOM 4042 CG1 ILE A 456 29.094 20.590 18.803 1.00 48.71 C ATOM 4043 CG2 ILE A 456 28.505 23.019 18.778 1.00 50.48 C ATOM 4044 CD1 ILE A 456 30.226 20.637 17.815 1.00 47.58 C ATOM 4045 HA ILE A 456 31.071 22.427 19.496 1.00 0.00 H ATOM 4046 HB ILE A 456 28.246 21.705 20.437 1.00 0.00 H ATOM 4047 HG12 ILE A 456 29.253 19.744 19.472 1.00 0.00 H ATOM 4048 HG13 ILE A 456 28.162 20.449 18.256 1.00 0.00 H ATOM 4049 HD11 ILE A 456 30.076 21.473 17.132 1.00 0.00 H ATOM 4050 HD12 ILE A 456 31.167 20.767 18.349 1.00 0.00 H ATOM 4051 HD13 ILE A 456 30.253 19.705 17.251 1.00 0.00 H ATOM 4052 HG21 ILE A 456 28.412 23.915 19.392 1.00 0.00 H ATOM 4053 HG22 ILE A 456 29.229 23.195 17.983 1.00 0.00 H ATOM 4054 HG23 ILE A 456 27.537 22.774 18.341 1.00 0.00 H ATOM 4055 H ILE A 456 30.302 20.146 21.003 1.00 0.00 H ATOM 4056 N LYS A 457 29.593 23.131 22.361 1.00 49.35 N ATOM 4057 CA LYS A 457 29.374 24.161 23.371 1.00 50.31 C ATOM 4058 C LYS A 457 30.673 24.938 23.647 1.00 49.66 C ATOM 4059 O LYS A 457 30.669 26.162 23.761 1.00 48.75 O ATOM 4060 CB LYS A 457 28.873 23.481 24.650 1.00 52.42 C ATOM 4061 CG LYS A 457 28.871 24.324 25.916 1.00 58.15 C ATOM 4062 CD LYS A 457 27.696 25.285 25.982 1.00 60.22 C ATOM 4063 CE LYS A 457 27.516 25.806 27.402 1.00 62.33 C ATOM 4064 NZ LYS A 457 28.776 26.406 27.942 1.00 64.31 N ATOM 4065 HA LYS A 457 28.633 24.876 23.014 1.00 0.00 H ATOM 4066 HB2 LYS A 457 27.849 23.152 24.470 1.00 0.00 H ATOM 4067 HB3 LYS A 457 29.506 22.612 24.832 1.00 0.00 H ATOM 4068 HG2 LYS A 457 28.826 23.658 26.778 1.00 0.00 H ATOM 4069 HG3 LYS A 457 29.795 24.901 25.952 1.00 0.00 H ATOM 4070 HD2 LYS A 457 27.880 26.125 25.312 1.00 0.00 H ATOM 4071 HD3 LYS A 457 26.789 24.766 25.672 1.00 0.00 H ATOM 4072 HE2 LYS A 457 27.216 24.979 28.045 1.00 0.00 H ATOM 4073 HE3 LYS A 457 26.735 26.567 27.402 1.00 0.00 H ATOM 4074 HZ1 LYS A 457 29.525 25.685 27.952 1.00 0.00 H ATOM 4075 HZ2 LYS A 457 29.067 27.201 27.338 1.00 0.00 H ATOM 4076 HZ3 LYS A 457 28.609 26.748 28.910 1.00 0.00 H ATOM 4077 H LYS A 457 29.269 22.163 22.558 1.00 0.00 H ATOM 4078 N LYS A 458 31.786 24.214 23.725 1.00 48.60 N ATOM 4079 CA LYS A 458 33.078 24.821 24.010 1.00 47.01 C ATOM 4080 C LYS A 458 33.819 25.464 22.841 1.00 46.45 C ATOM 4081 O LYS A 458 34.492 26.481 23.030 1.00 46.90 O ATOM 4082 CB LYS A 458 33.982 23.798 24.693 1.00 46.85 C ATOM 4083 CG LYS A 458 33.546 23.462 26.103 1.00 46.06 C ATOM 4084 CD LYS A 458 34.397 22.352 26.670 1.00 49.13 C ATOM 4085 CE LYS A 458 34.032 22.039 28.111 1.00 51.41 C ATOM 4086 NZ LYS A 458 34.297 23.192 29.019 1.00 51.53 N ATOM 4087 HA LYS A 458 32.838 25.662 24.660 1.00 0.00 H ATOM 4088 HB2 LYS A 458 33.978 22.882 24.102 1.00 0.00 H ATOM 4089 HB3 LYS A 458 34.994 24.200 24.730 1.00 0.00 H ATOM 4090 HG2 LYS A 458 33.647 24.348 26.730 1.00 0.00 H ATOM 4091 HG3 LYS A 458 32.503 23.144 26.090 1.00 0.00 H ATOM 4092 HD2 LYS A 458 34.255 21.455 26.067 1.00 0.00 H ATOM 4093 HD3 LYS A 458 35.444 22.654 26.629 1.00 0.00 H ATOM 4094 HE2 LYS A 458 34.621 21.185 28.446 1.00 0.00 H ATOM 4095 HE3 LYS A 458 32.972 21.789 28.159 1.00 0.00 H ATOM 4096 HZ1 LYS A 458 35.308 23.433 28.985 1.00 0.00 H ATOM 4097 HZ2 LYS A 458 33.734 24.010 28.712 1.00 0.00 H ATOM 4098 HZ3 LYS A 458 34.033 22.934 29.991 1.00 0.00 H ATOM 4099 H LYS A 458 31.732 23.186 23.578 1.00 0.00 H ATOM 4100 N THR A 459 33.704 24.901 21.641 1.00 45.13 N ATOM 4101 CA THR A 459 34.400 25.489 20.497 1.00 46.53 C ATOM 4102 C THR A 459 33.558 26.551 19.794 1.00 47.28 C ATOM 4103 O THR A 459 33.998 27.176 18.833 1.00 49.21 O ATOM 4104 CB THR A 459 34.798 24.418 19.459 1.00 46.41 C ATOM 4105 OG1 THR A 459 33.628 23.935 18.787 1.00 44.06 O ATOM 4106 CG2 THR A 459 35.507 23.261 20.146 1.00 45.72 C ATOM 4107 HA THR A 459 35.297 25.955 20.906 1.00 0.00 H ATOM 4108 HB THR A 459 35.474 24.867 18.731 1.00 0.00 H ATOM 4109 HG1 THR A 459 33.179 24.688 18.326 1.00 0.00 H ATOM 4110 HG23 THR A 459 36.396 23.632 20.656 1.00 0.00 H ATOM 4111 HG21 THR A 459 34.835 22.804 20.872 1.00 0.00 H ATOM 4112 HG22 THR A 459 35.797 22.520 19.401 1.00 0.00 H ATOM 4113 H THR A 459 33.123 24.048 21.517 1.00 0.00 H ATOM 4114 N GLU A 460 32.341 26.747 20.275 1.00 48.19 N ATOM 4115 CA GLU A 460 31.435 27.726 19.696 1.00 49.20 C ATOM 4116 C GLU A 460 30.767 28.503 20.834 1.00 49.72 C ATOM 4117 O GLU A 460 29.621 28.223 21.196 1.00 48.37 O ATOM 4118 CB GLU A 460 30.377 27.006 18.855 1.00 51.34 C ATOM 4119 CG GLU A 460 30.426 27.285 17.355 1.00 55.21 C ATOM 4120 CD GLU A 460 31.774 26.986 16.730 1.00 56.59 C ATOM 4121 OE1 GLU A 460 32.252 25.834 16.841 1.00 55.87 O ATOM 4122 OE2 GLU A 460 32.356 27.911 16.121 1.00 58.54 O ATOM 4123 HA GLU A 460 31.982 28.416 19.054 1.00 0.00 H ATOM 4124 HB2 GLU A 460 30.505 25.933 19.001 1.00 0.00 H ATOM 4125 HB3 GLU A 460 29.395 27.307 19.221 1.00 0.00 H ATOM 4126 HG2 GLU A 460 29.673 26.669 16.864 1.00 0.00 H ATOM 4127 HG3 GLU A 460 30.195 28.338 17.191 1.00 0.00 H ATOM 4128 H GLU A 460 32.023 26.185 21.090 1.00 0.00 H ATOM 4129 N THR A 461 31.489 29.476 21.395 1.00 49.14 N ATOM 4130 CA THR A 461 30.970 30.284 22.500 1.00 50.55 C ATOM 4131 C THR A 461 29.682 31.023 22.135 1.00 50.41 C ATOM 4132 O THR A 461 28.922 31.435 23.007 1.00 50.73 O ATOM 4133 CB THR A 461 32.001 31.332 22.969 1.00 50.75 C ATOM 4134 OG1 THR A 461 32.332 32.195 21.877 1.00 50.15 O ATOM 4135 CG2 THR A 461 33.264 30.661 23.470 1.00 51.39 C ATOM 4136 HA THR A 461 30.761 29.575 23.301 1.00 0.00 H ATOM 4137 HB THR A 461 31.562 31.906 23.785 1.00 0.00 H ATOM 4138 HG1 THR A 461 32.717 31.659 21.139 1.00 0.00 H ATOM 4139 HG23 THR A 461 33.018 30.002 24.303 1.00 0.00 H ATOM 4140 HG21 THR A 461 33.709 30.079 22.663 1.00 0.00 H ATOM 4141 HG22 THR A 461 33.970 31.421 23.803 1.00 0.00 H ATOM 4142 H THR A 461 32.447 29.665 21.037 1.00 0.00 H ATOM 4143 N ASP A 462 29.439 31.182 20.843 1.00 51.39 N ATOM 4144 CA ASP A 462 28.248 31.878 20.379 1.00 54.35 C ATOM 4145 C ASP A 462 27.147 30.911 19.973 1.00 55.15 C ATOM 4146 O ASP A 462 26.166 31.310 19.356 1.00 54.79 O ATOM 4147 CB ASP A 462 28.614 32.767 19.197 1.00 55.23 C ATOM 4148 CG ASP A 462 29.224 31.984 18.061 1.00 58.18 C ATOM 4149 OD1 ASP A 462 30.088 31.116 18.329 1.00 58.41 O ATOM 4150 OD2 ASP A 462 28.844 32.239 16.899 1.00 60.27 O ATOM 4151 HA ASP A 462 27.867 32.482 21.203 1.00 0.00 H ATOM 4152 HB2 ASP A 462 27.712 33.262 18.838 1.00 0.00 H ATOM 4153 HB3 ASP A 462 29.331 33.518 19.531 1.00 0.00 H ATOM 4154 H ASP A 462 30.112 30.802 20.147 1.00 0.00 H ATOM 4155 N MET A 463 27.315 29.639 20.321 1.00 58.04 N ATOM 4156 CA MET A 463 26.337 28.608 19.985 1.00 59.16 C ATOM 4157 C MET A 463 25.254 28.533 21.048 1.00 59.16 C ATOM 4158 O MET A 463 25.505 28.116 22.181 1.00 57.76 O ATOM 4159 CB MET A 463 27.030 27.249 19.855 1.00 62.01 C ATOM 4160 CG MET A 463 27.100 26.696 18.431 1.00 65.36 C ATOM 4161 SD MET A 463 25.657 25.701 17.987 1.00 67.59 S ATOM 4162 CE MET A 463 24.514 26.995 17.460 1.00 68.16 C ATOM 4163 HA MET A 463 25.875 28.868 19.033 1.00 0.00 H ATOM 4164 HB2 MET A 463 28.049 27.351 20.230 1.00 0.00 H ATOM 4165 HB3 MET A 463 26.488 26.532 20.471 1.00 0.00 H ATOM 4166 HG2 MET A 463 27.991 26.074 18.343 1.00 0.00 H ATOM 4167 HG3 MET A 463 27.172 27.533 17.736 1.00 0.00 H ATOM 4168 HE1 MET A 463 24.337 27.681 18.288 1.00 0.00 H ATOM 4169 HE2 MET A 463 24.946 27.540 16.621 1.00 0.00 H ATOM 4170 HE3 MET A 463 23.571 26.542 17.153 1.00 0.00 H ATOM 4171 H MET A 463 28.170 29.370 20.849 1.00 0.00 H ATOM 4172 N SER A 464 24.047 28.938 20.676 1.00 59.24 N ATOM 4173 CA SER A 464 22.925 28.920 21.604 1.00 60.51 C ATOM 4174 C SER A 464 22.138 27.612 21.546 1.00 60.63 C ATOM 4175 O SER A 464 22.054 26.964 20.505 1.00 61.91 O ATOM 4176 CB SER A 464 21.990 30.100 21.321 1.00 58.38 C ATOM 4177 OG SER A 464 21.674 30.172 19.946 1.00 59.49 O ATOM 4178 HA SER A 464 23.340 29.006 22.608 1.00 0.00 H ATOM 4179 HB2 SER A 464 22.480 31.025 21.624 1.00 0.00 H ATOM 4180 HB3 SER A 464 21.071 29.973 21.893 1.00 0.00 H ATOM 4181 HG SER A 464 21.070 30.940 19.787 1.00 0.00 H ATOM 4182 H SER A 464 23.899 29.275 19.703 1.00 0.00 H ATOM 4183 N LEU A 465 21.571 27.229 22.682 1.00 60.54 N ATOM 4184 CA LEU A 465 20.775 26.018 22.770 1.00 60.17 C ATOM 4185 C LEU A 465 19.493 26.370 23.510 1.00 59.74 C ATOM 4186 O LEU A 465 19.518 27.139 24.472 1.00 62.57 O ATOM 4187 CB LEU A 465 21.534 24.926 23.522 1.00 60.33 C ATOM 4188 CG LEU A 465 21.012 23.513 23.237 1.00 62.11 C ATOM 4189 CD1 LEU A 465 22.112 22.687 22.593 1.00 62.46 C ATOM 4190 CD2 LEU A 465 20.534 22.858 24.511 1.00 62.27 C ATOM 4191 HA LEU A 465 20.555 25.637 21.773 1.00 0.00 H ATOM 4192 HB2 LEU A 465 22.584 24.972 23.231 1.00 0.00 H ATOM 4193 HB3 LEU A 465 21.446 25.118 24.591 1.00 0.00 H ATOM 4194 HG LEU A 465 20.166 23.576 22.552 1.00 0.00 H ATOM 4195 HD21 LEU A 465 21.361 22.794 25.218 1.00 0.00 H ATOM 4196 HD22 LEU A 465 19.729 23.452 24.944 1.00 0.00 H ATOM 4197 HD23 LEU A 465 20.167 21.856 24.288 1.00 0.00 H ATOM 4198 HD11 LEU A 465 22.418 23.157 21.658 1.00 0.00 H ATOM 4199 HD12 LEU A 465 22.965 22.630 23.269 1.00 0.00 H ATOM 4200 HD13 LEU A 465 21.740 21.683 22.391 1.00 0.00 H ATOM 4201 H LEU A 465 21.700 27.812 23.533 1.00 0.00 H ATOM 4202 N HIS A 466 18.374 25.820 23.056 1.00 57.14 N ATOM 4203 CA HIS A 466 17.090 26.096 23.682 1.00 55.59 C ATOM 4204 C HIS A 466 17.053 25.593 25.126 1.00 54.79 C ATOM 4205 O HIS A 466 17.561 24.511 25.431 1.00 54.93 O ATOM 4206 CB HIS A 466 15.961 25.447 22.874 1.00 54.92 C ATOM 4207 CG HIS A 466 14.602 25.964 23.223 1.00 53.72 C ATOM 4208 ND1 HIS A 466 14.029 25.772 24.461 1.00 54.54 N ATOM 4209 CD2 HIS A 466 13.720 26.703 22.511 1.00 54.17 C ATOM 4210 CE1 HIS A 466 12.853 26.372 24.498 1.00 53.84 C ATOM 4211 NE2 HIS A 466 12.642 26.945 23.327 1.00 55.07 N ATOM 4212 HA HIS A 466 16.950 27.177 23.697 1.00 0.00 H ATOM 4213 HB2 HIS A 466 16.141 25.637 21.816 1.00 0.00 H ATOM 4214 HB3 HIS A 466 15.979 24.373 23.057 1.00 0.00 H ATOM 4215 HD2 HIS A 466 13.842 27.043 21.482 1.00 0.00 H ATOM 4216 HE1 HIS A 466 12.173 26.391 25.350 1.00 0.00 H ATOM 4217 H HIS A 466 18.416 25.180 22.237 1.00 0.00 H ATOM 4218 N PRO A 467 16.455 26.381 26.034 1.00 53.20 N ATOM 4219 CA PRO A 467 16.341 26.031 27.454 1.00 51.57 C ATOM 4220 C PRO A 467 15.731 24.645 27.680 1.00 49.61 C ATOM 4221 O PRO A 467 16.142 23.915 28.582 1.00 48.44 O ATOM 4222 CB PRO A 467 15.459 27.145 28.009 1.00 52.38 C ATOM 4223 CG PRO A 467 15.835 28.318 27.156 1.00 52.32 C ATOM 4224 CD PRO A 467 15.882 27.716 25.778 1.00 52.84 C ATOM 4225 HA PRO A 467 17.311 25.962 27.947 1.00 0.00 H ATOM 4226 HD3 PRO A 467 14.884 27.641 25.346 1.00 0.00 H ATOM 4227 HD2 PRO A 467 16.521 28.299 25.114 1.00 0.00 H ATOM 4228 HG3 PRO A 467 16.806 28.720 27.444 1.00 0.00 H ATOM 4229 HG2 PRO A 467 15.085 29.106 27.217 1.00 0.00 H ATOM 4230 HB2 PRO A 467 14.402 26.902 27.900 1.00 0.00 H ATOM 4231 HB3 PRO A 467 15.680 27.335 29.059 1.00 0.00 H ATOM 4232 N LEU A 468 14.750 24.290 26.856 1.00 48.04 N ATOM 4233 CA LEU A 468 14.080 22.995 26.960 1.00 46.58 C ATOM 4234 C LEU A 468 15.050 21.827 26.773 1.00 46.11 C ATOM 4235 O LEU A 468 15.083 20.901 27.580 1.00 45.87 O ATOM 4236 CB LEU A 468 12.965 22.893 25.921 1.00 45.01 C ATOM 4237 CG LEU A 468 12.114 21.624 26.014 1.00 45.87 C ATOM 4238 CD1 LEU A 468 11.401 21.576 27.367 1.00 44.64 C ATOM 4239 CD2 LEU A 468 11.103 21.605 24.879 1.00 44.44 C ATOM 4240 HA LEU A 468 13.663 22.931 27.965 1.00 0.00 H ATOM 4241 HB2 LEU A 468 12.307 23.753 26.044 1.00 0.00 H ATOM 4242 HB3 LEU A 468 13.420 22.925 24.931 1.00 0.00 H ATOM 4243 HG LEU A 468 12.756 20.747 25.928 1.00 0.00 H ATOM 4244 HD21 LEU A 468 10.458 22.481 24.954 1.00 0.00 H ATOM 4245 HD22 LEU A 468 11.630 21.620 23.925 1.00 0.00 H ATOM 4246 HD23 LEU A 468 10.499 20.701 24.948 1.00 0.00 H ATOM 4247 HD11 LEU A 468 12.142 21.573 28.167 1.00 0.00 H ATOM 4248 HD12 LEU A 468 10.758 22.450 27.469 1.00 0.00 H ATOM 4249 HD13 LEU A 468 10.797 20.670 27.426 1.00 0.00 H ATOM 4250 H LEU A 468 14.450 24.954 26.114 1.00 0.00 H ATOM 4251 N LEU A 469 15.834 21.876 25.704 1.00 45.64 N ATOM 4252 CA LEU A 469 16.807 20.828 25.406 1.00 46.70 C ATOM 4253 C LEU A 469 17.944 20.814 26.417 1.00 48.87 C ATOM 4254 O LEU A 469 18.477 19.753 26.761 1.00 49.15 O ATOM 4255 CB LEU A 469 17.393 21.032 24.010 1.00 43.89 C ATOM 4256 CG LEU A 469 16.415 20.969 22.843 1.00 41.40 C ATOM 4257 CD1 LEU A 469 17.181 21.174 21.546 1.00 38.55 C ATOM 4258 CD2 LEU A 469 15.704 19.609 22.847 1.00 42.12 C ATOM 4259 HA LEU A 469 16.281 19.875 25.457 1.00 0.00 H ATOM 4260 HB2 LEU A 469 17.868 22.013 23.991 1.00 0.00 H ATOM 4261 HB3 LEU A 469 18.147 20.261 23.852 1.00 0.00 H ATOM 4262 HG LEU A 469 15.662 21.752 22.937 1.00 0.00 H ATOM 4263 HD21 LEU A 469 16.443 18.814 22.747 1.00 0.00 H ATOM 4264 HD22 LEU A 469 15.162 19.487 23.784 1.00 0.00 H ATOM 4265 HD23 LEU A 469 15.004 19.564 22.012 1.00 0.00 H ATOM 4266 HD11 LEU A 469 17.671 22.148 21.565 1.00 0.00 H ATOM 4267 HD12 LEU A 469 17.931 20.390 21.441 1.00 0.00 H ATOM 4268 HD13 LEU A 469 16.488 21.130 20.706 1.00 0.00 H ATOM 4269 H LEU A 469 15.753 22.687 25.057 1.00 0.00 H ATOM 4270 N GLN A 470 18.323 21.997 26.883 1.00 49.46 N ATOM 4271 CA GLN A 470 19.403 22.097 27.849 1.00 52.29 C ATOM 4272 C GLN A 470 18.957 21.491 29.179 1.00 51.68 C ATOM 4273 O GLN A 470 19.756 20.902 29.912 1.00 49.38 O ATOM 4274 CB GLN A 470 19.804 23.564 28.029 1.00 53.13 C ATOM 4275 CG GLN A 470 21.120 23.760 28.750 1.00 57.29 C ATOM 4276 CD GLN A 470 21.622 25.191 28.659 1.00 60.23 C ATOM 4277 OE1 GLN A 470 22.693 25.518 29.169 1.00 60.60 O ATOM 4278 NE2 GLN A 470 20.846 26.052 28.004 1.00 60.79 N ATOM 4279 HA GLN A 470 20.270 21.545 27.487 1.00 0.00 H ATOM 4280 HB2 GLN A 470 19.882 24.021 27.043 1.00 0.00 H ATOM 4281 HB3 GLN A 470 19.022 24.065 28.600 1.00 0.00 H ATOM 4282 HG2 GLN A 470 20.986 23.502 29.800 1.00 0.00 H ATOM 4283 HG3 GLN A 470 21.864 23.099 28.307 1.00 0.00 H ATOM 4284 HE22 GLN A 470 19.948 25.731 27.589 1.00 0.00 H ATOM 4285 HE21 GLN A 470 21.138 27.046 27.908 1.00 0.00 H ATOM 4286 H GLN A 470 17.843 22.859 26.554 1.00 0.00 H ATOM 4287 N GLU A 471 17.669 21.617 29.475 1.00 52.29 N ATOM 4288 CA GLU A 471 17.133 21.084 30.716 1.00 53.48 C ATOM 4289 C GLU A 471 17.064 19.563 30.708 1.00 53.64 C ATOM 4290 O GLU A 471 17.398 18.924 31.707 1.00 54.44 O ATOM 4291 CB GLU A 471 15.743 21.655 30.988 1.00 53.54 C ATOM 4292 CG GLU A 471 15.131 21.188 32.300 1.00 55.43 C ATOM 4293 CD GLU A 471 15.980 21.554 33.505 1.00 58.08 C ATOM 4294 OE1 GLU A 471 16.248 22.762 33.709 1.00 59.39 O ATOM 4295 OE2 GLU A 471 16.378 20.632 34.249 1.00 57.99 O ATOM 4296 HA GLU A 471 17.817 21.385 31.510 1.00 0.00 H ATOM 4297 HB2 GLU A 471 15.817 22.742 31.011 1.00 0.00 H ATOM 4298 HB3 GLU A 471 15.083 21.354 30.175 1.00 0.00 H ATOM 4299 HG2 GLU A 471 14.150 21.649 32.411 1.00 0.00 H ATOM 4300 HG3 GLU A 471 15.020 20.104 32.267 1.00 0.00 H ATOM 4301 H GLU A 471 17.035 22.104 28.810 1.00 0.00 H ATOM 4302 N ILE A 472 16.639 18.972 29.595 1.00 53.19 N ATOM 4303 CA ILE A 472 16.551 17.518 29.555 1.00 53.96 C ATOM 4304 C ILE A 472 17.956 16.916 29.563 1.00 54.33 C ATOM 4305 O ILE A 472 18.165 15.826 30.088 1.00 52.61 O ATOM 4306 CB ILE A 472 15.719 16.999 28.324 1.00 54.03 C ATOM 4307 CG1 ILE A 472 16.577 16.918 27.069 1.00 55.39 C ATOM 4308 CG2 ILE A 472 14.511 17.896 28.081 1.00 53.05 C ATOM 4309 CD1 ILE A 472 17.309 15.608 26.931 1.00 55.93 C ATOM 4310 HA ILE A 472 16.015 17.192 30.446 1.00 0.00 H ATOM 4311 HB ILE A 472 15.371 15.993 28.558 1.00 0.00 H ATOM 4312 HG12 ILE A 472 15.932 17.048 26.200 1.00 0.00 H ATOM 4313 HG13 ILE A 472 17.311 17.723 27.099 1.00 0.00 H ATOM 4314 HD11 ILE A 472 17.967 15.469 27.789 1.00 0.00 H ATOM 4315 HD12 ILE A 472 16.587 14.792 26.889 1.00 0.00 H ATOM 4316 HD13 ILE A 472 17.901 15.619 26.016 1.00 0.00 H ATOM 4317 HG21 ILE A 472 13.875 17.894 28.966 1.00 0.00 H ATOM 4318 HG22 ILE A 472 14.849 18.912 27.878 1.00 0.00 H ATOM 4319 HG23 ILE A 472 13.948 17.521 27.226 1.00 0.00 H ATOM 4320 H ILE A 472 16.373 19.539 28.765 1.00 0.00 H ATOM 4321 N TYR A 473 18.921 17.642 29.003 1.00 55.45 N ATOM 4322 CA TYR A 473 20.308 17.179 28.964 1.00 57.55 C ATOM 4323 C TYR A 473 21.012 17.392 30.301 1.00 59.16 C ATOM 4324 O TYR A 473 22.089 16.851 30.547 1.00 58.15 O ATOM 4325 CB TYR A 473 21.069 17.902 27.851 1.00 57.41 C ATOM 4326 CG TYR A 473 20.814 17.320 26.481 1.00 59.36 C ATOM 4327 CD1 TYR A 473 20.649 18.141 25.368 1.00 57.32 C ATOM 4328 CD2 TYR A 473 20.744 15.938 26.296 1.00 59.30 C ATOM 4329 CE1 TYR A 473 20.420 17.602 24.110 1.00 58.37 C ATOM 4330 CE2 TYR A 473 20.518 15.391 25.038 1.00 60.02 C ATOM 4331 CZ TYR A 473 20.356 16.228 23.951 1.00 58.87 C ATOM 4332 OH TYR A 473 20.135 15.686 22.708 1.00 59.91 O ATOM 4333 HA TYR A 473 20.296 16.108 28.762 1.00 0.00 H ATOM 4334 HB3 TYR A 473 22.136 17.837 28.062 1.00 0.00 H ATOM 4335 HB2 TYR A 473 20.764 18.948 27.845 1.00 0.00 H ATOM 4336 HD2 TYR A 473 20.869 15.276 27.153 1.00 0.00 H ATOM 4337 HE2 TYR A 473 20.469 14.310 24.910 1.00 0.00 H ATOM 4338 HE1 TYR A 473 20.291 18.258 23.249 1.00 0.00 H ATOM 4339 HD1 TYR A 473 20.701 19.223 25.487 1.00 0.00 H ATOM 4340 HH TYR A 473 20.041 16.414 22.044 1.00 0.00 H ATOM 4341 H TYR A 473 18.683 18.563 28.582 1.00 0.00 H ATOM 4342 N LYS A 474 20.384 18.190 31.156 1.00 62.49 N ATOM 4343 CA LYS A 474 20.890 18.503 32.490 1.00 66.38 C ATOM 4344 C LYS A 474 20.709 17.270 33.371 1.00 68.27 C ATOM 4345 O LYS A 474 19.789 17.201 34.184 1.00 69.00 O ATOM 4346 CB LYS A 474 20.096 19.688 33.035 1.00 67.67 C ATOM 4347 CG LYS A 474 20.147 19.917 34.521 1.00 69.99 C ATOM 4348 CD LYS A 474 19.059 20.914 34.864 1.00 72.55 C ATOM 4349 CE LYS A 474 19.022 21.273 36.335 1.00 74.41 C ATOM 4350 NZ LYS A 474 17.999 22.333 36.575 1.00 76.01 N ATOM 4351 HA LYS A 474 21.947 18.767 32.468 1.00 0.00 H ATOM 4352 HB2 LYS A 474 20.473 20.588 32.550 1.00 0.00 H ATOM 4353 HB3 LYS A 474 19.052 19.539 32.760 1.00 0.00 H ATOM 4354 HG2 LYS A 474 19.973 18.979 35.049 1.00 0.00 H ATOM 4355 HG3 LYS A 474 21.121 20.316 34.803 1.00 0.00 H ATOM 4356 HD2 LYS A 474 19.229 21.824 34.289 1.00 0.00 H ATOM 4357 HD3 LYS A 474 18.096 20.485 34.587 1.00 0.00 H ATOM 4358 HE2 LYS A 474 20.001 21.640 36.642 1.00 0.00 H ATOM 4359 HE3 LYS A 474 18.768 20.387 36.917 1.00 0.00 H ATOM 4360 HZ1 LYS A 474 18.242 23.179 36.021 1.00 0.00 H ATOM 4361 HZ2 LYS A 474 17.064 21.983 36.284 1.00 0.00 H ATOM 4362 HZ3 LYS A 474 17.981 22.573 37.587 1.00 0.00 H ATOM 4363 H LYS A 474 19.482 18.616 30.860 1.00 0.00 H ATOM 4364 N ASP A 475 21.612 16.312 33.190 1.00 71.06 N ATOM 4365 CA ASP A 475 21.617 15.023 33.882 1.00 73.42 C ATOM 4366 C ASP A 475 21.723 14.098 32.680 1.00 73.68 C ATOM 4367 O ASP A 475 21.954 14.577 31.581 1.00 74.65 O ATOM 4368 CB ASP A 475 20.296 14.780 34.633 1.00 75.97 C ATOM 4369 CG ASP A 475 20.383 13.643 35.644 1.00 77.16 C ATOM 4370 OD1 ASP A 475 21.448 13.483 36.274 1.00 77.85 O ATOM 4371 OD2 ASP A 475 19.375 12.923 35.824 1.00 78.56 O ATOM 4372 HA ASP A 475 22.392 14.911 34.640 1.00 0.00 H ATOM 4373 HB2 ASP A 475 20.024 15.694 35.161 1.00 0.00 H ATOM 4374 HB3 ASP A 475 19.522 14.538 33.905 1.00 0.00 H ATOM 4375 H ASP A 475 22.373 16.492 32.504 1.00 0.00 H ATOM 4376 N LEU A 476 21.585 12.796 32.911 1.00 73.47 N ATOM 4377 CA LEU A 476 21.657 11.751 31.884 1.00 72.94 C ATOM 4378 C LEU A 476 22.594 10.661 32.404 1.00 73.28 C ATOM 4379 O LEU A 476 23.338 10.055 31.599 1.00 73.60 O ATOM 4380 CB LEU A 476 22.190 12.287 30.541 1.00 71.96 C ATOM 4381 CG LEU A 476 23.703 12.428 30.309 1.00 70.51 C ATOM 4382 CD1 LEU A 476 24.052 11.763 28.991 1.00 70.48 C ATOM 4383 CD2 LEU A 476 24.139 13.881 30.298 1.00 70.04 C ATOM 4384 HA LEU A 476 20.654 11.368 31.698 1.00 0.00 H ATOM 4385 OXT LEU A 476 22.556 10.418 33.628 1.00 73.04 O ATOM 4386 HB2 LEU A 476 21.815 11.619 29.766 1.00 0.00 H ATOM 4387 HB3 LEU A 476 21.758 13.279 30.405 1.00 0.00 H ATOM 4388 HG LEU A 476 24.232 11.944 31.130 1.00 0.00 H ATOM 4389 HD21 LEU A 476 23.619 14.409 29.499 1.00 0.00 H ATOM 4390 HD22 LEU A 476 23.895 14.339 31.256 1.00 0.00 H ATOM 4391 HD23 LEU A 476 25.215 13.935 30.131 1.00 0.00 H ATOM 4392 HD11 LEU A 476 23.778 10.709 29.034 1.00 0.00 H ATOM 4393 HD12 LEU A 476 23.504 12.249 28.184 1.00 0.00 H ATOM 4394 HD13 LEU A 476 25.123 11.855 28.812 1.00 0.00 H ATOM 4395 H LEU A 476 21.413 12.496 33.892 1.00 0.00 H TER 4396 LEU A 476 ATOM 4397 N GLU B 207 10.115 -26.038 16.330 1.00 75.96 N ATOM 4398 CA GLU B 207 9.486 -26.987 17.296 1.00 75.25 C ATOM 4399 C GLU B 207 10.120 -26.863 18.679 1.00 74.18 C ATOM 4400 O GLU B 207 11.340 -26.737 18.806 1.00 74.37 O ATOM 4401 CB GLU B 207 9.639 -28.421 16.791 1.00 76.20 C ATOM 4402 CG GLU B 207 8.892 -28.725 15.507 1.00 77.39 C ATOM 4403 CD GLU B 207 7.392 -28.719 15.698 1.00 78.45 C ATOM 4404 OE1 GLU B 207 6.904 -29.481 16.562 1.00 79.16 O ATOM 4405 OE2 GLU B 207 6.700 -27.958 14.986 1.00 78.84 O ATOM 4406 HA GLU B 207 8.428 -26.737 17.377 1.00 0.00 H ATOM 4407 HB2 GLU B 207 10.699 -28.610 16.620 1.00 0.00 H ATOM 4408 HB3 GLU B 207 9.272 -29.095 17.565 1.00 0.00 H ATOM 4409 HG2 GLU B 207 9.154 -27.973 14.763 1.00 0.00 H ATOM 4410 HG3 GLU B 207 9.196 -29.709 15.149 1.00 0.00 H ATOM 4411 HN3 GLU B 207 11.131 -26.248 16.251 1.00 0.00 H ATOM 4412 HN2 GLU B 207 9.986 -25.063 16.670 1.00 0.00 H ATOM 4413 HN1 GLU B 207 9.665 -26.144 15.399 1.00 0.00 H ATOM 4414 N SER B 208 9.285 -26.905 19.712 1.00 72.33 N ATOM 4415 CA SER B 208 9.759 -26.788 21.084 1.00 70.03 C ATOM 4416 C SER B 208 10.723 -27.911 21.463 1.00 68.67 C ATOM 4417 O SER B 208 11.397 -27.832 22.493 1.00 68.93 O ATOM 4418 CB SER B 208 8.576 -26.787 22.054 1.00 70.73 C ATOM 4419 OG SER B 208 7.958 -28.061 22.104 1.00 71.58 O ATOM 4420 HA SER B 208 10.301 -25.845 21.153 1.00 0.00 H ATOM 4421 HB2 SER B 208 7.845 -26.049 21.724 1.00 0.00 H ATOM 4422 HB3 SER B 208 8.932 -26.524 23.050 1.00 0.00 H ATOM 4423 HG SER B 208 7.198 -28.033 22.737 1.00 0.00 H ATOM 4424 H SER B 208 8.267 -27.024 19.536 1.00 0.00 H ATOM 4425 N ALA B 209 10.792 -28.954 20.638 1.00 65.91 N ATOM 4426 CA ALA B 209 11.682 -30.076 20.923 1.00 62.73 C ATOM 4427 C ALA B 209 13.150 -29.686 20.768 1.00 60.63 C ATOM 4428 O ALA B 209 13.987 -30.094 21.570 1.00 58.51 O ATOM 4429 CB ALA B 209 11.353 -31.259 20.020 1.00 63.39 C ATOM 4430 HA ALA B 209 11.523 -30.365 21.962 1.00 0.00 H ATOM 4431 HB1 ALA B 209 10.323 -31.570 20.192 1.00 0.00 H ATOM 4432 HB2 ALA B 209 11.476 -30.964 18.978 1.00 0.00 H ATOM 4433 HB3 ALA B 209 12.026 -32.086 20.247 1.00 0.00 H ATOM 4434 H ALA B 209 10.205 -28.970 19.780 1.00 0.00 H ATOM 4435 N ASP B 210 13.462 -28.901 19.737 1.00 58.98 N ATOM 4436 CA ASP B 210 14.838 -28.458 19.511 1.00 56.77 C ATOM 4437 C ASP B 210 15.183 -27.352 20.502 1.00 53.38 C ATOM 4438 O ASP B 210 16.322 -27.245 20.954 1.00 52.71 O ATOM 4439 CB ASP B 210 15.020 -27.897 18.099 1.00 60.53 C ATOM 4440 CG ASP B 210 14.570 -28.850 17.027 1.00 64.18 C ATOM 4441 OD1 ASP B 210 13.355 -29.111 16.937 1.00 67.91 O ATOM 4442 OD2 ASP B 210 15.430 -29.338 16.264 1.00 67.49 O ATOM 4443 HA ASP B 210 15.490 -29.322 19.640 1.00 0.00 H ATOM 4444 HB2 ASP B 210 14.441 -26.978 18.013 1.00 0.00 H ATOM 4445 HB3 ASP B 210 16.076 -27.675 17.946 1.00 0.00 H ATOM 4446 H ASP B 210 12.714 -28.598 19.081 1.00 0.00 H ATOM 4447 N LEU B 211 14.186 -26.533 20.826 1.00 49.29 N ATOM 4448 CA LEU B 211 14.368 -25.416 21.743 1.00 47.78 C ATOM 4449 C LEU B 211 14.671 -25.859 23.167 1.00 46.75 C ATOM 4450 O LEU B 211 15.496 -25.255 23.850 1.00 46.75 O ATOM 4451 CB LEU B 211 13.128 -24.510 21.719 1.00 44.90 C ATOM 4452 CG LEU B 211 12.837 -23.897 20.342 1.00 43.00 C ATOM 4453 CD1 LEU B 211 11.572 -23.051 20.394 1.00 40.10 C ATOM 4454 CD2 LEU B 211 14.036 -23.062 19.899 1.00 42.49 C ATOM 4455 HA LEU B 211 15.239 -24.860 21.398 1.00 0.00 H ATOM 4456 HB2 LEU B 211 12.264 -25.101 22.022 1.00 0.00 H ATOM 4457 HB3 LEU B 211 13.280 -23.699 22.432 1.00 0.00 H ATOM 4458 HG LEU B 211 12.674 -24.693 19.616 1.00 0.00 H ATOM 4459 HD21 LEU B 211 14.211 -22.267 20.624 1.00 0.00 H ATOM 4460 HD22 LEU B 211 14.918 -23.699 19.837 1.00 0.00 H ATOM 4461 HD23 LEU B 211 13.832 -22.626 18.921 1.00 0.00 H ATOM 4462 HD11 LEU B 211 10.730 -23.677 20.690 1.00 0.00 H ATOM 4463 HD12 LEU B 211 11.703 -22.249 21.120 1.00 0.00 H ATOM 4464 HD13 LEU B 211 11.381 -22.624 19.409 1.00 0.00 H ATOM 4465 H LEU B 211 13.246 -26.696 20.411 1.00 0.00 H ATOM 4466 N ARG B 212 14.001 -26.912 23.618 1.00 47.51 N ATOM 4467 CA ARG B 212 14.228 -27.423 24.963 1.00 46.94 C ATOM 4468 C ARG B 212 15.551 -28.177 25.002 1.00 45.09 C ATOM 4469 O ARG B 212 16.227 -28.220 26.029 1.00 43.24 O ATOM 4470 CB ARG B 212 13.077 -28.340 25.381 1.00 50.16 C ATOM 4471 CG ARG B 212 11.825 -27.583 25.794 1.00 52.91 C ATOM 4472 CD ARG B 212 12.048 -26.861 27.118 1.00 56.72 C ATOM 4473 NE ARG B 212 11.407 -27.545 28.241 1.00 61.58 N ATOM 4474 CZ ARG B 212 11.655 -28.800 28.612 1.00 63.78 C ATOM 4475 NH1 ARG B 212 12.542 -29.538 27.953 1.00 62.83 N ATOM 4476 NH2 ARG B 212 11.012 -29.321 29.651 1.00 64.99 N ATOM 4477 HA ARG B 212 14.273 -26.589 25.663 1.00 0.00 H ATOM 4478 HB2 ARG B 212 12.828 -28.989 24.541 1.00 0.00 H ATOM 4479 HB3 ARG B 212 13.407 -28.949 26.223 1.00 0.00 H ATOM 4480 HG2 ARG B 212 11.577 -26.852 25.024 1.00 0.00 H ATOM 4481 HG3 ARG B 212 11.000 -28.287 25.904 1.00 0.00 H ATOM 4482 HD2 ARG B 212 11.638 -25.854 27.041 1.00 0.00 H ATOM 4483 HD3 ARG B 212 13.120 -26.802 27.309 1.00 0.00 H ATOM 4484 HE ARG B 212 10.704 -27.011 28.791 1.00 0.00 H ATOM 4485 HH12 ARG B 212 12.728 -30.517 28.251 1.00 0.00 H ATOM 4486 HH11 ARG B 212 13.050 -29.137 27.139 1.00 0.00 H ATOM 4487 HH22 ARG B 212 11.203 -30.301 29.943 1.00 0.00 H ATOM 4488 HH21 ARG B 212 10.317 -28.749 30.172 1.00 0.00 H ATOM 4489 H ARG B 212 13.304 -27.379 23.003 1.00 0.00 H ATOM 4490 N ALA B 213 15.921 -28.759 23.869 1.00 42.77 N ATOM 4491 CA ALA B 213 17.168 -29.493 23.788 1.00 42.80 C ATOM 4492 C ALA B 213 18.314 -28.485 23.824 1.00 41.86 C ATOM 4493 O ALA B 213 19.331 -28.713 24.474 1.00 41.58 O ATOM 4494 CB ALA B 213 17.210 -30.310 22.505 1.00 42.82 C ATOM 4495 HA ALA B 213 17.258 -30.184 24.626 1.00 0.00 H ATOM 4496 HB1 ALA B 213 16.378 -31.014 22.497 1.00 0.00 H ATOM 4497 HB2 ALA B 213 17.131 -29.642 21.647 1.00 0.00 H ATOM 4498 HB3 ALA B 213 18.151 -30.857 22.455 1.00 0.00 H ATOM 4499 H ALA B 213 15.310 -28.688 23.030 1.00 0.00 H ATOM 4500 N LEU B 214 18.140 -27.368 23.122 1.00 41.18 N ATOM 4501 CA LEU B 214 19.156 -26.314 23.083 1.00 38.57 C ATOM 4502 C LEU B 214 19.338 -25.739 24.488 1.00 36.00 C ATOM 4503 O LEU B 214 20.459 -25.467 24.912 1.00 35.97 O ATOM 4504 CB LEU B 214 18.724 -25.208 22.109 1.00 40.24 C ATOM 4505 CG LEU B 214 19.691 -24.062 21.809 1.00 40.09 C ATOM 4506 CD1 LEU B 214 20.992 -24.612 21.253 1.00 38.25 C ATOM 4507 CD2 LEU B 214 19.044 -23.106 20.811 1.00 40.18 C ATOM 4508 HA LEU B 214 20.103 -26.730 22.739 1.00 0.00 H ATOM 4509 HB2 LEU B 214 18.496 -25.691 21.159 1.00 0.00 H ATOM 4510 HB3 LEU B 214 17.816 -24.762 22.515 1.00 0.00 H ATOM 4511 HG LEU B 214 19.913 -23.521 22.729 1.00 0.00 H ATOM 4512 HD21 LEU B 214 18.816 -23.643 19.890 1.00 0.00 H ATOM 4513 HD22 LEU B 214 18.124 -22.706 21.237 1.00 0.00 H ATOM 4514 HD23 LEU B 214 19.731 -22.288 20.595 1.00 0.00 H ATOM 4515 HD11 LEU B 214 21.444 -25.281 21.985 1.00 0.00 H ATOM 4516 HD12 LEU B 214 20.789 -25.161 20.333 1.00 0.00 H ATOM 4517 HD13 LEU B 214 21.673 -23.787 21.043 1.00 0.00 H ATOM 4518 H LEU B 214 17.258 -27.240 22.586 1.00 0.00 H ATOM 4519 N ALA B 215 18.229 -25.580 25.210 1.00 33.81 N ATOM 4520 CA ALA B 215 18.250 -25.048 26.572 1.00 34.89 C ATOM 4521 C ALA B 215 18.974 -25.977 27.544 1.00 37.01 C ATOM 4522 O ALA B 215 19.762 -25.536 28.390 1.00 36.84 O ATOM 4523 CB ALA B 215 16.826 -24.814 27.059 1.00 32.55 C ATOM 4524 HA ALA B 215 18.797 -24.106 26.543 1.00 0.00 H ATOM 4525 HB1 ALA B 215 16.331 -24.100 26.401 1.00 0.00 H ATOM 4526 HB2 ALA B 215 16.280 -25.758 27.049 1.00 0.00 H ATOM 4527 HB3 ALA B 215 16.851 -24.418 28.074 1.00 0.00 H ATOM 4528 H ALA B 215 17.315 -25.844 24.789 1.00 0.00 H ATOM 4529 N LYS B 216 18.699 -27.272 27.427 1.00 39.04 N ATOM 4530 CA LYS B 216 19.318 -28.258 28.298 1.00 38.07 C ATOM 4531 C LYS B 216 20.804 -28.315 28.001 1.00 36.48 C ATOM 4532 O LYS B 216 21.634 -28.347 28.912 1.00 34.36 O ATOM 4533 CB LYS B 216 18.692 -29.631 28.062 1.00 42.67 C ATOM 4534 CG LYS B 216 18.397 -30.393 29.336 1.00 46.24 C ATOM 4535 CD LYS B 216 19.641 -30.603 30.161 1.00 47.98 C ATOM 4536 CE LYS B 216 19.319 -31.347 31.447 1.00 49.50 C ATOM 4537 NZ LYS B 216 20.572 -31.770 32.125 1.00 49.93 N ATOM 4538 HA LYS B 216 19.160 -27.975 29.339 1.00 0.00 H ATOM 4539 HB2 LYS B 216 17.757 -29.494 27.518 1.00 0.00 H ATOM 4540 HB3 LYS B 216 19.379 -30.223 27.458 1.00 0.00 H ATOM 4541 HG2 LYS B 216 17.673 -29.830 29.925 1.00 0.00 H ATOM 4542 HG3 LYS B 216 17.976 -31.365 29.077 1.00 0.00 H ATOM 4543 HD2 LYS B 216 20.360 -31.184 29.583 1.00 0.00 H ATOM 4544 HD3 LYS B 216 20.074 -29.634 30.408 1.00 0.00 H ATOM 4545 HE2 LYS B 216 18.721 -32.228 31.213 1.00 0.00 H ATOM 4546 HE3 LYS B 216 18.754 -30.692 32.110 1.00 0.00 H ATOM 4547 HZ1 LYS B 216 21.111 -32.397 31.495 1.00 0.00 H ATOM 4548 HZ2 LYS B 216 21.143 -30.931 32.351 1.00 0.00 H ATOM 4549 HZ3 LYS B 216 20.336 -32.277 33.002 1.00 0.00 H ATOM 4550 H LYS B 216 18.028 -27.586 26.698 1.00 0.00 H ATOM 4551 N HIS B 217 21.133 -28.333 26.714 1.00 35.05 N ATOM 4552 CA HIS B 217 22.523 -28.381 26.287 1.00 36.43 C ATOM 4553 C HIS B 217 23.328 -27.192 26.820 1.00 35.84 C ATOM 4554 O HIS B 217 24.409 -27.371 27.384 1.00 35.53 O ATOM 4555 CB HIS B 217 22.607 -28.407 24.758 1.00 35.02 C ATOM 4556 CG HIS B 217 24.002 -28.557 24.236 1.00 37.31 C ATOM 4557 ND1 HIS B 217 24.725 -27.503 23.721 1.00 37.15 N ATOM 4558 CD2 HIS B 217 24.814 -29.638 24.167 1.00 37.32 C ATOM 4559 CE1 HIS B 217 25.920 -27.928 23.354 1.00 35.32 C ATOM 4560 NE2 HIS B 217 25.999 -29.220 23.614 1.00 38.77 N ATOM 4561 HA HIS B 217 22.955 -29.294 26.698 1.00 0.00 H ATOM 4562 HB2 HIS B 217 22.011 -29.244 24.394 1.00 0.00 H ATOM 4563 HB3 HIS B 217 22.194 -27.474 24.374 1.00 0.00 H ATOM 4564 HD2 HIS B 217 24.572 -30.651 24.490 1.00 0.00 H ATOM 4565 HE1 HIS B 217 26.707 -27.317 22.912 1.00 0.00 H ATOM 4566 H HIS B 217 20.381 -28.312 25.996 1.00 0.00 H ATOM 4567 N LEU B 218 22.792 -25.985 26.649 1.00 35.32 N ATOM 4568 CA LEU B 218 23.484 -24.774 27.095 1.00 33.62 C ATOM 4569 C LEU B 218 23.679 -24.785 28.601 1.00 32.42 C ATOM 4570 O LEU B 218 24.744 -24.435 29.107 1.00 29.88 O ATOM 4571 CB LEU B 218 22.699 -23.533 26.668 1.00 31.83 C ATOM 4572 CG LEU B 218 22.613 -23.335 25.151 1.00 33.32 C ATOM 4573 CD1 LEU B 218 21.559 -22.291 24.833 1.00 32.39 C ATOM 4574 CD2 LEU B 218 23.976 -22.916 24.599 1.00 31.67 C ATOM 4575 HA LEU B 218 24.468 -24.748 26.627 1.00 0.00 H ATOM 4576 HB2 LEU B 218 21.685 -23.618 27.060 1.00 0.00 H ATOM 4577 HB3 LEU B 218 23.182 -22.657 27.100 1.00 0.00 H ATOM 4578 HG LEU B 218 22.328 -24.275 24.678 1.00 0.00 H ATOM 4579 HD21 LEU B 218 24.284 -21.980 25.066 1.00 0.00 H ATOM 4580 HD22 LEU B 218 24.710 -23.692 24.819 1.00 0.00 H ATOM 4581 HD23 LEU B 218 23.903 -22.778 23.520 1.00 0.00 H ATOM 4582 HD11 LEU B 218 20.593 -22.625 25.211 1.00 0.00 H ATOM 4583 HD12 LEU B 218 21.829 -21.348 25.307 1.00 0.00 H ATOM 4584 HD13 LEU B 218 21.501 -22.153 23.753 1.00 0.00 H ATOM 4585 H LEU B 218 21.863 -25.901 26.189 1.00 0.00 H ATOM 4586 N TYR B 219 22.637 -25.188 29.311 1.00 33.91 N ATOM 4587 CA TYR B 219 22.688 -25.269 30.760 1.00 37.31 C ATOM 4588 C TYR B 219 23.793 -26.225 31.200 1.00 37.23 C ATOM 4589 O TYR B 219 24.629 -25.880 32.040 1.00 37.24 O ATOM 4590 CB TYR B 219 21.350 -25.765 31.308 1.00 39.32 C ATOM 4591 CG TYR B 219 21.350 -25.975 32.806 1.00 43.01 C ATOM 4592 CD1 TYR B 219 21.473 -24.896 33.681 1.00 43.60 C ATOM 4593 CD2 TYR B 219 21.218 -27.256 33.352 1.00 45.24 C ATOM 4594 CE1 TYR B 219 21.462 -25.079 35.060 1.00 42.63 C ATOM 4595 CE2 TYR B 219 21.205 -27.448 34.735 1.00 45.85 C ATOM 4596 CZ TYR B 219 21.327 -26.354 35.580 1.00 44.95 C ATOM 4597 OH TYR B 219 21.310 -26.534 36.945 1.00 46.29 O ATOM 4598 HA TYR B 219 22.895 -24.273 31.151 1.00 0.00 H ATOM 4599 HB3 TYR B 219 21.110 -26.713 30.827 1.00 0.00 H ATOM 4600 HB2 TYR B 219 20.583 -25.030 31.063 1.00 0.00 H ATOM 4601 HD2 TYR B 219 21.124 -28.116 32.689 1.00 0.00 H ATOM 4602 HE2 TYR B 219 21.100 -28.451 35.148 1.00 0.00 H ATOM 4603 HE1 TYR B 219 21.559 -24.223 35.727 1.00 0.00 H ATOM 4604 HD1 TYR B 219 21.580 -23.890 33.276 1.00 0.00 H ATOM 4605 HH TYR B 219 21.407 -25.657 37.394 1.00 0.00 H ATOM 4606 H TYR B 219 21.760 -25.453 28.819 1.00 0.00 H ATOM 4607 N ASP B 220 23.805 -27.428 30.632 1.00 36.48 N ATOM 4608 CA ASP B 220 24.831 -28.390 31.018 1.00 37.54 C ATOM 4609 C ASP B 220 26.210 -27.825 30.724 1.00 36.48 C ATOM 4610 O ASP B 220 27.094 -27.902 31.561 1.00 38.25 O ATOM 4611 CB ASP B 220 24.623 -29.742 30.314 1.00 35.11 C ATOM 4612 CG ASP B 220 23.378 -30.467 30.805 1.00 38.28 C ATOM 4613 OD1 ASP B 220 23.024 -30.321 31.998 1.00 37.47 O ATOM 4614 OD2 ASP B 220 22.753 -31.194 30.006 1.00 41.16 O ATOM 4615 HA ASP B 220 24.750 -28.569 32.090 1.00 0.00 H ATOM 4616 HB2 ASP B 220 24.527 -29.568 29.242 1.00 0.00 H ATOM 4617 HB3 ASP B 220 25.492 -30.372 30.502 1.00 0.00 H ATOM 4618 H ASP B 220 23.090 -27.680 29.920 1.00 0.00 H ATOM 4619 N SER B 221 26.383 -27.239 29.544 1.00 36.47 N ATOM 4620 CA SER B 221 27.662 -26.639 29.162 1.00 36.38 C ATOM 4621 C SER B 221 28.064 -25.491 30.106 1.00 37.54 C ATOM 4622 O SER B 221 29.243 -25.292 30.411 1.00 37.52 O ATOM 4623 CB SER B 221 27.576 -26.115 27.730 1.00 38.12 C ATOM 4624 OG SER B 221 28.778 -25.466 27.355 1.00 42.35 O ATOM 4625 HA SER B 221 28.426 -27.413 29.234 1.00 0.00 H ATOM 4626 HB2 SER B 221 26.751 -25.407 27.658 1.00 0.00 H ATOM 4627 HB3 SER B 221 27.396 -26.951 27.054 1.00 0.00 H ATOM 4628 HG SER B 221 28.697 -25.136 26.425 1.00 0.00 H ATOM 4629 H SER B 221 25.588 -27.206 28.874 1.00 0.00 H ATOM 4630 N TYR B 222 27.068 -24.736 30.562 1.00 38.16 N ATOM 4631 CA TYR B 222 27.277 -23.616 31.468 1.00 36.45 C ATOM 4632 C TYR B 222 27.804 -24.117 32.818 1.00 37.30 C ATOM 4633 O TYR B 222 28.736 -23.546 33.382 1.00 34.83 O ATOM 4634 CB TYR B 222 25.946 -22.870 31.622 1.00 35.15 C ATOM 4635 CG TYR B 222 25.866 -21.795 32.682 1.00 33.32 C ATOM 4636 CD1 TYR B 222 25.603 -22.122 34.007 1.00 34.18 C ATOM 4637 CD2 TYR B 222 25.933 -20.439 32.340 1.00 35.17 C ATOM 4638 CE1 TYR B 222 25.388 -21.137 34.971 1.00 34.96 C ATOM 4639 CE2 TYR B 222 25.722 -19.435 33.302 1.00 33.20 C ATOM 4640 CZ TYR B 222 25.442 -19.798 34.616 1.00 35.68 C ATOM 4641 OH TYR B 222 25.170 -18.843 35.579 1.00 35.14 O ATOM 4642 HA TYR B 222 28.025 -22.933 31.066 1.00 0.00 H ATOM 4643 HB3 TYR B 222 25.180 -23.612 31.850 1.00 0.00 H ATOM 4644 HB2 TYR B 222 25.722 -22.401 30.664 1.00 0.00 H ATOM 4645 HD2 TYR B 222 26.152 -20.157 31.310 1.00 0.00 H ATOM 4646 HE2 TYR B 222 25.777 -18.383 33.021 1.00 0.00 H ATOM 4647 HE1 TYR B 222 25.178 -21.420 36.002 1.00 0.00 H ATOM 4648 HD1 TYR B 222 25.564 -23.171 34.299 1.00 0.00 H ATOM 4649 HH TYR B 222 25.947 -18.236 35.669 1.00 0.00 H ATOM 4650 H TYR B 222 26.098 -24.956 30.258 1.00 0.00 H ATOM 4651 N ILE B 223 27.210 -25.191 33.327 1.00 37.83 N ATOM 4652 CA ILE B 223 27.638 -25.767 34.602 1.00 39.44 C ATOM 4653 C ILE B 223 29.095 -26.236 34.512 1.00 39.69 C ATOM 4654 O ILE B 223 29.890 -26.015 35.421 1.00 40.42 O ATOM 4655 CB ILE B 223 26.719 -26.964 35.004 1.00 39.68 C ATOM 4656 CG1 ILE B 223 25.365 -26.432 35.465 1.00 37.15 C ATOM 4657 CG2 ILE B 223 27.364 -27.808 36.099 1.00 39.89 C ATOM 4658 CD1 ILE B 223 25.468 -25.403 36.570 1.00 39.41 C ATOM 4659 HA ILE B 223 27.559 -24.995 35.367 1.00 0.00 H ATOM 4660 HB ILE B 223 26.578 -27.605 34.134 1.00 0.00 H ATOM 4661 HG12 ILE B 223 24.865 -25.974 34.612 1.00 0.00 H ATOM 4662 HG13 ILE B 223 24.769 -27.270 35.827 1.00 0.00 H ATOM 4663 HD11 ILE B 223 25.957 -25.849 37.436 1.00 0.00 H ATOM 4664 HD12 ILE B 223 26.052 -24.552 36.219 1.00 0.00 H ATOM 4665 HD13 ILE B 223 24.468 -25.069 36.848 1.00 0.00 H ATOM 4666 HG21 ILE B 223 28.314 -28.203 35.739 1.00 0.00 H ATOM 4667 HG22 ILE B 223 27.536 -27.189 36.979 1.00 0.00 H ATOM 4668 HG23 ILE B 223 26.701 -28.633 36.358 1.00 0.00 H ATOM 4669 H ILE B 223 26.424 -25.632 32.808 1.00 0.00 H ATOM 4670 N LYS B 224 29.444 -26.864 33.401 1.00 40.02 N ATOM 4671 CA LYS B 224 30.801 -27.360 33.204 1.00 42.14 C ATOM 4672 C LYS B 224 31.849 -26.252 33.091 1.00 42.10 C ATOM 4673 O LYS B 224 32.937 -26.357 33.654 1.00 43.90 O ATOM 4674 CB LYS B 224 30.846 -28.229 31.946 1.00 42.27 C ATOM 4675 CG LYS B 224 32.242 -28.519 31.423 1.00 46.45 C ATOM 4676 CD LYS B 224 32.177 -29.332 30.130 1.00 48.42 C ATOM 4677 CE LYS B 224 33.565 -29.567 29.536 1.00 54.23 C ATOM 4678 NZ LYS B 224 34.493 -30.302 30.464 1.00 54.22 N ATOM 4679 HA LYS B 224 31.053 -27.939 34.092 1.00 0.00 H ATOM 4680 HB2 LYS B 224 30.364 -29.180 32.173 1.00 0.00 H ATOM 4681 HB3 LYS B 224 30.288 -27.719 31.161 1.00 0.00 H ATOM 4682 HG2 LYS B 224 32.754 -27.577 31.228 1.00 0.00 H ATOM 4683 HG3 LYS B 224 32.795 -29.084 32.173 1.00 0.00 H ATOM 4684 HD2 LYS B 224 31.716 -30.297 30.342 1.00 0.00 H ATOM 4685 HD3 LYS B 224 31.569 -28.792 29.404 1.00 0.00 H ATOM 4686 HE2 LYS B 224 34.008 -28.600 29.298 1.00 0.00 H ATOM 4687 HE3 LYS B 224 33.456 -30.150 28.622 1.00 0.00 H ATOM 4688 HZ1 LYS B 224 34.615 -29.752 31.338 1.00 0.00 H ATOM 4689 HZ2 LYS B 224 34.088 -31.232 30.692 1.00 0.00 H ATOM 4690 HZ3 LYS B 224 35.416 -30.429 30.001 1.00 0.00 H ATOM 4691 H LYS B 224 28.736 -27.007 32.653 1.00 0.00 H ATOM 4692 N SER B 225 31.516 -25.191 32.361 1.00 41.45 N ATOM 4693 CA SER B 225 32.439 -24.081 32.134 1.00 38.99 C ATOM 4694 C SER B 225 32.602 -23.097 33.282 1.00 36.41 C ATOM 4695 O SER B 225 33.668 -22.518 33.442 1.00 35.33 O ATOM 4696 CB SER B 225 32.022 -23.299 30.883 1.00 39.01 C ATOM 4697 OG SER B 225 31.947 -24.139 29.749 1.00 38.49 O ATOM 4698 HA SER B 225 33.409 -24.565 32.019 1.00 0.00 H ATOM 4699 HB2 SER B 225 32.754 -22.514 30.695 1.00 0.00 H ATOM 4700 HB3 SER B 225 31.045 -22.848 31.056 1.00 0.00 H ATOM 4701 HG SER B 225 32.833 -24.547 29.583 1.00 0.00 H ATOM 4702 H SER B 225 30.567 -25.150 31.938 1.00 0.00 H ATOM 4703 N PHE B 226 31.557 -22.903 34.075 1.00 36.12 N ATOM 4704 CA PHE B 226 31.620 -21.951 35.175 1.00 39.65 C ATOM 4705 C PHE B 226 31.620 -22.587 36.564 1.00 42.51 C ATOM 4706 O PHE B 226 30.666 -23.255 36.959 1.00 44.31 O ATOM 4707 CB PHE B 226 30.455 -20.955 35.055 1.00 37.73 C ATOM 4708 CG PHE B 226 30.419 -20.237 33.741 1.00 34.65 C ATOM 4709 CD1 PHE B 226 31.394 -19.295 33.420 1.00 34.24 C ATOM 4710 CD2 PHE B 226 29.451 -20.548 32.791 1.00 33.22 C ATOM 4711 CE1 PHE B 226 31.410 -18.673 32.163 1.00 32.92 C ATOM 4712 CE2 PHE B 226 29.459 -19.935 31.535 1.00 33.45 C ATOM 4713 CZ PHE B 226 30.440 -18.997 31.220 1.00 32.08 C ATOM 4714 HA PHE B 226 32.581 -21.444 35.084 1.00 0.00 H ATOM 4715 HB2 PHE B 226 29.519 -21.501 35.176 1.00 0.00 H ATOM 4716 HB3 PHE B 226 30.549 -20.216 35.851 1.00 0.00 H ATOM 4717 HD2 PHE B 226 28.678 -21.278 33.029 1.00 0.00 H ATOM 4718 HE2 PHE B 226 28.696 -20.191 30.800 1.00 0.00 H ATOM 4719 HZ PHE B 226 30.447 -18.520 30.240 1.00 0.00 H ATOM 4720 HE1 PHE B 226 32.180 -17.938 31.926 1.00 0.00 H ATOM 4721 HD1 PHE B 226 32.155 -19.038 34.156 1.00 0.00 H ATOM 4722 H PHE B 226 30.681 -23.438 33.909 1.00 0.00 H ATOM 4723 N PRO B 227 32.700 -22.378 37.329 1.00 45.51 N ATOM 4724 CA PRO B 227 32.803 -22.942 38.681 1.00 46.38 C ATOM 4725 C PRO B 227 31.698 -22.451 39.609 1.00 46.52 C ATOM 4726 O PRO B 227 30.850 -23.231 40.052 1.00 48.51 O ATOM 4727 CB PRO B 227 34.184 -22.481 39.145 1.00 44.76 C ATOM 4728 CG PRO B 227 34.961 -22.433 37.873 1.00 46.82 C ATOM 4729 CD PRO B 227 33.980 -21.774 36.916 1.00 46.07 C ATOM 4730 HA PRO B 227 32.686 -24.026 38.690 1.00 0.00 H ATOM 4731 HD3 PRO B 227 33.967 -20.692 37.044 1.00 0.00 H ATOM 4732 HD2 PRO B 227 34.216 -22.014 35.879 1.00 0.00 H ATOM 4733 HG3 PRO B 227 35.229 -23.434 37.536 1.00 0.00 H ATOM 4734 HG2 PRO B 227 35.865 -21.835 37.985 1.00 0.00 H ATOM 4735 HB2 PRO B 227 34.134 -21.497 39.612 1.00 0.00 H ATOM 4736 HB3 PRO B 227 34.621 -23.193 39.846 1.00 0.00 H ATOM 4737 N LEU B 228 31.704 -21.154 39.891 1.00 45.33 N ATOM 4738 CA LEU B 228 30.711 -20.566 40.782 1.00 46.04 C ATOM 4739 C LEU B 228 29.418 -20.195 40.067 1.00 44.71 C ATOM 4740 O LEU B 228 29.360 -19.179 39.384 1.00 45.72 O ATOM 4741 CB LEU B 228 31.284 -19.310 41.448 1.00 47.70 C ATOM 4742 CG LEU B 228 31.067 -19.148 42.956 1.00 49.64 C ATOM 4743 CD1 LEU B 228 31.655 -17.814 43.412 1.00 50.80 C ATOM 4744 CD2 LEU B 228 29.596 -19.223 43.285 1.00 50.17 C ATOM 4745 HA LEU B 228 30.473 -21.326 41.526 1.00 0.00 H ATOM 4746 HB2 LEU B 228 32.359 -19.308 41.270 1.00 0.00 H ATOM 4747 HB3 LEU B 228 30.834 -18.446 40.958 1.00 0.00 H ATOM 4748 HG LEU B 228 31.572 -19.957 43.483 1.00 0.00 H ATOM 4749 HD21 LEU B 228 29.067 -18.427 42.761 1.00 0.00 H ATOM 4750 HD22 LEU B 228 29.203 -20.190 42.970 1.00 0.00 H ATOM 4751 HD23 LEU B 228 29.459 -19.106 44.360 1.00 0.00 H ATOM 4752 HD11 LEU B 228 32.723 -17.795 43.193 1.00 0.00 H ATOM 4753 HD12 LEU B 228 31.160 -17.000 42.883 1.00 0.00 H ATOM 4754 HD13 LEU B 228 31.501 -17.698 44.485 1.00 0.00 H ATOM 4755 H LEU B 228 32.432 -20.544 39.467 1.00 0.00 H ATOM 4756 N THR B 229 28.386 -21.015 40.231 1.00 43.54 N ATOM 4757 CA THR B 229 27.088 -20.745 39.619 1.00 43.21 C ATOM 4758 C THR B 229 26.292 -19.790 40.507 1.00 43.62 C ATOM 4759 O THR B 229 26.613 -19.619 41.686 1.00 43.34 O ATOM 4760 CB THR B 229 26.267 -22.024 39.460 1.00 42.57 C ATOM 4761 OG1 THR B 229 26.142 -22.665 40.736 1.00 41.53 O ATOM 4762 CG2 THR B 229 26.932 -22.960 38.476 1.00 43.25 C ATOM 4763 HA THR B 229 27.274 -20.310 38.637 1.00 0.00 H ATOM 4764 HB THR B 229 25.278 -21.769 39.078 1.00 0.00 H ATOM 4765 HG1 THR B 229 27.043 -22.888 41.082 1.00 0.00 H ATOM 4766 HG23 THR B 229 27.023 -22.464 37.509 1.00 0.00 H ATOM 4767 HG21 THR B 229 27.923 -23.227 38.843 1.00 0.00 H ATOM 4768 HG22 THR B 229 26.328 -23.861 38.369 1.00 0.00 H ATOM 4769 H THR B 229 28.505 -21.871 40.810 1.00 0.00 H ATOM 4770 N LYS B 230 25.251 -19.178 39.947 1.00 41.86 N ATOM 4771 CA LYS B 230 24.434 -18.242 40.710 1.00 41.38 C ATOM 4772 C LYS B 230 23.760 -18.980 41.865 1.00 41.43 C ATOM 4773 O LYS B 230 23.678 -18.465 42.975 1.00 41.41 O ATOM 4774 CB LYS B 230 23.367 -17.590 39.812 1.00 39.97 C ATOM 4775 CG LYS B 230 22.496 -16.568 40.538 1.00 36.02 C ATOM 4776 CD LYS B 230 21.442 -15.945 39.628 1.00 31.81 C ATOM 4777 CE LYS B 230 20.678 -14.870 40.387 1.00 30.88 C ATOM 4778 NZ LYS B 230 19.594 -14.251 39.571 1.00 30.01 N ATOM 4779 HA LYS B 230 25.078 -17.455 41.103 1.00 0.00 H ATOM 4780 HB2 LYS B 230 23.871 -17.088 38.986 1.00 0.00 H ATOM 4781 HB3 LYS B 230 22.721 -18.375 39.418 1.00 0.00 H ATOM 4782 HG2 LYS B 230 21.992 -17.064 41.368 1.00 0.00 H ATOM 4783 HG3 LYS B 230 23.136 -15.775 40.925 1.00 0.00 H ATOM 4784 HD2 LYS B 230 21.930 -15.499 38.761 1.00 0.00 H ATOM 4785 HD3 LYS B 230 20.748 -16.717 39.296 1.00 0.00 H ATOM 4786 HE2 LYS B 230 21.378 -14.090 40.687 1.00 0.00 H ATOM 4787 HE3 LYS B 230 20.233 -15.319 41.275 1.00 0.00 H ATOM 4788 HZ1 LYS B 230 20.007 -13.811 38.724 1.00 0.00 H ATOM 4789 HZ2 LYS B 230 18.914 -14.985 39.286 1.00 0.00 H ATOM 4790 HZ3 LYS B 230 19.107 -13.527 40.136 1.00 0.00 H ATOM 4791 H LYS B 230 25.017 -19.370 38.952 1.00 0.00 H ATOM 4792 N ALA B 231 23.265 -20.182 41.590 1.00 41.33 N ATOM 4793 CA ALA B 231 22.619 -20.986 42.622 1.00 41.53 C ATOM 4794 C ALA B 231 23.616 -21.158 43.768 1.00 42.76 C ATOM 4795 O ALA B 231 23.271 -20.988 44.932 1.00 43.50 O ATOM 4796 CB ALA B 231 22.223 -22.346 42.058 1.00 37.30 C ATOM 4797 HA ALA B 231 21.713 -20.494 42.977 1.00 0.00 H ATOM 4798 HB1 ALA B 231 21.531 -22.206 41.228 1.00 0.00 H ATOM 4799 HB2 ALA B 231 23.114 -22.865 41.706 1.00 0.00 H ATOM 4800 HB3 ALA B 231 21.742 -22.936 42.839 1.00 0.00 H ATOM 4801 H ALA B 231 23.339 -20.556 40.622 1.00 0.00 H ATOM 4802 N LYS B 232 24.858 -21.476 43.415 1.00 44.51 N ATOM 4803 CA LYS B 232 25.925 -21.665 44.387 1.00 47.82 C ATOM 4804 C LYS B 232 26.169 -20.368 45.164 1.00 47.72 C ATOM 4805 O LYS B 232 26.104 -20.340 46.390 1.00 48.12 O ATOM 4806 CB LYS B 232 27.207 -22.088 43.661 1.00 50.25 C ATOM 4807 CG LYS B 232 28.039 -23.131 44.390 1.00 55.64 C ATOM 4808 CD LYS B 232 28.564 -22.614 45.720 1.00 59.98 C ATOM 4809 CE LYS B 232 29.341 -23.700 46.454 1.00 61.23 C ATOM 4810 NZ LYS B 232 28.482 -24.896 46.707 1.00 63.83 N ATOM 4811 HA LYS B 232 25.633 -22.444 45.092 1.00 0.00 H ATOM 4812 HB2 LYS B 232 26.928 -22.495 42.689 1.00 0.00 H ATOM 4813 HB3 LYS B 232 27.824 -21.201 43.518 1.00 0.00 H ATOM 4814 HG2 LYS B 232 27.420 -24.010 44.573 1.00 0.00 H ATOM 4815 HG3 LYS B 232 28.885 -23.409 43.761 1.00 0.00 H ATOM 4816 HD2 LYS B 232 29.222 -21.764 45.539 1.00 0.00 H ATOM 4817 HD3 LYS B 232 27.724 -22.296 46.337 1.00 0.00 H ATOM 4818 HE2 LYS B 232 29.692 -23.305 47.407 1.00 0.00 H ATOM 4819 HE3 LYS B 232 30.197 -23.997 45.848 1.00 0.00 H ATOM 4820 HZ1 LYS B 232 27.666 -24.618 47.289 1.00 0.00 H ATOM 4821 HZ2 LYS B 232 28.148 -25.280 45.800 1.00 0.00 H ATOM 4822 HZ3 LYS B 232 29.036 -25.620 47.208 1.00 0.00 H ATOM 4823 H LYS B 232 25.076 -21.594 42.405 1.00 0.00 H ATOM 4824 N ALA B 233 26.438 -19.291 44.434 1.00 48.15 N ATOM 4825 CA ALA B 233 26.700 -17.985 45.028 1.00 46.62 C ATOM 4826 C ALA B 233 25.534 -17.456 45.860 1.00 48.13 C ATOM 4827 O ALA B 233 25.745 -16.869 46.917 1.00 47.15 O ATOM 4828 CB ALA B 233 27.057 -16.989 43.936 1.00 44.31 C ATOM 4829 HA ALA B 233 27.537 -18.110 45.714 1.00 0.00 H ATOM 4830 HB1 ALA B 233 27.947 -17.333 43.409 1.00 0.00 H ATOM 4831 HB2 ALA B 233 26.227 -16.908 43.234 1.00 0.00 H ATOM 4832 HB3 ALA B 233 27.252 -16.015 44.384 1.00 0.00 H ATOM 4833 H ALA B 233 26.463 -19.383 43.398 1.00 0.00 H ATOM 4834 N ARG B 234 24.307 -17.649 45.380 1.00 50.72 N ATOM 4835 CA ARG B 234 23.119 -17.183 46.103 1.00 52.63 C ATOM 4836 C ARG B 234 23.039 -17.784 47.499 1.00 53.70 C ATOM 4837 O ARG B 234 22.762 -17.083 48.472 1.00 54.15 O ATOM 4838 CB ARG B 234 21.838 -17.543 45.344 1.00 52.61 C ATOM 4839 CG ARG B 234 21.544 -16.674 44.122 1.00 54.01 C ATOM 4840 CD ARG B 234 21.319 -15.217 44.503 1.00 53.32 C ATOM 4841 NE ARG B 234 22.413 -14.368 44.044 1.00 53.32 N ATOM 4842 CZ ARG B 234 22.449 -13.045 44.183 1.00 53.72 C ATOM 4843 NH1 ARG B 234 21.446 -12.405 44.779 1.00 51.08 N ATOM 4844 NH2 ARG B 234 23.484 -12.360 43.710 1.00 51.53 N ATOM 4845 HA ARG B 234 23.209 -16.100 46.184 1.00 0.00 H ATOM 4846 HB2 ARG B 234 21.922 -18.578 45.011 1.00 0.00 H ATOM 4847 HB3 ARG B 234 20.999 -17.451 46.034 1.00 0.00 H ATOM 4848 HG2 ARG B 234 22.389 -16.733 43.436 1.00 0.00 H ATOM 4849 HG3 ARG B 234 20.649 -17.052 43.628 1.00 0.00 H ATOM 4850 HD2 ARG B 234 21.244 -15.142 45.588 1.00 0.00 H ATOM 4851 HD3 ARG B 234 20.389 -14.872 44.051 1.00 0.00 H ATOM 4852 HE ARG B 234 23.220 -14.828 43.576 1.00 0.00 H ATOM 4853 HH12 ARG B 234 21.479 -11.371 44.885 1.00 0.00 H ATOM 4854 HH11 ARG B 234 20.629 -12.939 45.139 1.00 0.00 H ATOM 4855 HH22 ARG B 234 23.516 -11.326 43.817 1.00 0.00 H ATOM 4856 HH21 ARG B 234 24.263 -12.858 43.233 1.00 0.00 H ATOM 4857 H ARG B 234 24.188 -18.141 44.472 1.00 0.00 H ATOM 4858 N ALA B 235 23.271 -19.088 47.593 1.00 53.64 N ATOM 4859 CA ALA B 235 23.230 -19.768 48.876 1.00 54.84 C ATOM 4860 C ALA B 235 24.198 -19.091 49.845 1.00 55.47 C ATOM 4861 O ALA B 235 23.944 -19.024 51.049 1.00 55.75 O ATOM 4862 CB ALA B 235 23.597 -21.237 48.696 1.00 53.45 C ATOM 4863 HA ALA B 235 22.222 -19.710 49.286 1.00 0.00 H ATOM 4864 HB1 ALA B 235 22.886 -21.707 48.016 1.00 0.00 H ATOM 4865 HB2 ALA B 235 24.602 -21.311 48.281 1.00 0.00 H ATOM 4866 HB3 ALA B 235 23.564 -21.740 49.663 1.00 0.00 H ATOM 4867 H ALA B 235 23.486 -19.632 46.733 1.00 0.00 H ATOM 4868 N ILE B 236 25.302 -18.580 49.309 1.00 56.30 N ATOM 4869 CA ILE B 236 26.312 -17.907 50.118 1.00 57.27 C ATOM 4870 C ILE B 236 25.921 -16.486 50.519 1.00 60.37 C ATOM 4871 O ILE B 236 25.844 -16.179 51.703 1.00 61.86 O ATOM 4872 CB ILE B 236 27.661 -17.854 49.380 1.00 55.44 C ATOM 4873 CG1 ILE B 236 28.267 -19.253 49.312 1.00 52.57 C ATOM 4874 CG2 ILE B 236 28.597 -16.883 50.074 1.00 54.74 C ATOM 4875 CD1 ILE B 236 29.536 -19.321 48.507 1.00 51.95 C ATOM 4876 HA ILE B 236 26.397 -18.501 51.028 1.00 0.00 H ATOM 4877 HB ILE B 236 27.504 -17.499 48.361 1.00 0.00 H ATOM 4878 HG12 ILE B 236 28.484 -19.584 50.327 1.00 0.00 H ATOM 4879 HG13 ILE B 236 27.536 -19.924 48.861 1.00 0.00 H ATOM 4880 HD11 ILE B 236 29.333 -19.003 47.484 1.00 0.00 H ATOM 4881 HD12 ILE B 236 30.283 -18.663 48.952 1.00 0.00 H ATOM 4882 HD13 ILE B 236 29.908 -20.346 48.504 1.00 0.00 H ATOM 4883 HG21 ILE B 236 28.150 -15.889 50.076 1.00 0.00 H ATOM 4884 HG22 ILE B 236 28.763 -17.211 51.100 1.00 0.00 H ATOM 4885 HG23 ILE B 236 29.548 -16.854 49.542 1.00 0.00 H ATOM 4886 H ILE B 236 25.450 -18.663 48.283 1.00 0.00 H ATOM 4887 N LEU B 237 25.685 -15.621 49.538 1.00 63.89 N ATOM 4888 CA LEU B 237 25.311 -14.235 49.813 1.00 67.27 C ATOM 4889 C LEU B 237 24.172 -14.141 50.819 1.00 70.83 C ATOM 4890 O LEU B 237 24.357 -14.330 52.023 1.00 70.99 O ATOM 4891 CB LEU B 237 24.882 -13.539 48.526 1.00 66.71 C ATOM 4892 CG LEU B 237 25.943 -13.360 47.449 1.00 68.06 C ATOM 4893 CD1 LEU B 237 25.310 -12.715 46.222 1.00 66.81 C ATOM 4894 CD2 LEU B 237 27.076 -12.504 47.997 1.00 67.89 C ATOM 4895 HA LEU B 237 26.189 -13.747 50.235 1.00 0.00 H ATOM 4896 HB2 LEU B 237 24.069 -14.121 48.093 1.00 0.00 H ATOM 4897 HB3 LEU B 237 24.515 -12.548 48.794 1.00 0.00 H ATOM 4898 HG LEU B 237 26.353 -14.327 47.157 1.00 0.00 H ATOM 4899 HD21 LEU B 237 26.685 -11.530 48.290 1.00 0.00 H ATOM 4900 HD22 LEU B 237 27.515 -12.997 48.865 1.00 0.00 H ATOM 4901 HD23 LEU B 237 27.837 -12.375 47.227 1.00 0.00 H ATOM 4902 HD11 LEU B 237 24.512 -13.356 45.847 1.00 0.00 H ATOM 4903 HD12 LEU B 237 24.899 -11.743 46.495 1.00 0.00 H ATOM 4904 HD13 LEU B 237 26.068 -12.586 45.449 1.00 0.00 H ATOM 4905 H LEU B 237 25.768 -15.938 48.551 1.00 0.00 H ATOM 4906 N THR B 238 22.991 -13.817 50.306 1.00 74.61 N ATOM 4907 CA THR B 238 21.798 -13.708 51.126 1.00 77.34 C ATOM 4908 C THR B 238 21.201 -15.108 51.250 1.00 78.66 C ATOM 4909 O THR B 238 20.166 -15.421 50.658 1.00 77.91 O ATOM 4910 CB THR B 238 20.773 -12.737 50.484 1.00 78.10 C ATOM 4911 OG1 THR B 238 19.492 -12.907 51.103 1.00 79.16 O ATOM 4912 CG2 THR B 238 20.663 -12.982 48.984 1.00 78.23 C ATOM 4913 HA THR B 238 22.050 -13.308 52.108 1.00 0.00 H ATOM 4914 HB THR B 238 21.118 -11.715 50.640 1.00 0.00 H ATOM 4915 HG1 THR B 238 19.186 -13.840 50.975 1.00 0.00 H ATOM 4916 HG23 THR B 238 21.642 -12.850 48.523 1.00 0.00 H ATOM 4917 HG21 THR B 238 20.311 -13.998 48.808 1.00 0.00 H ATOM 4918 HG22 THR B 238 19.958 -12.272 48.552 1.00 0.00 H ATOM 4919 H THR B 238 22.918 -13.636 49.285 1.00 0.00 H ATOM 4920 N GLY B 239 21.889 -15.951 52.012 1.00 80.46 N ATOM 4921 CA GLY B 239 21.440 -17.314 52.218 1.00 83.46 C ATOM 4922 C GLY B 239 22.062 -17.880 53.477 1.00 85.01 C ATOM 4923 O GLY B 239 22.960 -17.266 54.056 1.00 84.51 O ATOM 4924 HA3 GLY B 239 21.734 -17.924 51.364 1.00 0.00 H ATOM 4925 HA2 GLY B 239 20.354 -17.326 52.315 1.00 0.00 H ATOM 4926 H GLY B 239 22.765 -15.627 52.469 1.00 0.00 H ATOM 4927 N LYS B 240 21.593 -19.045 53.912 1.00 86.66 N ATOM 4928 CA LYS B 240 22.136 -19.652 55.116 1.00 88.33 C ATOM 4929 C LYS B 240 23.335 -20.553 54.852 1.00 89.12 C ATOM 4930 O LYS B 240 24.406 -20.067 54.483 1.00 89.04 O ATOM 4931 CB LYS B 240 21.040 -20.412 55.882 1.00 88.94 C ATOM 4932 CG LYS B 240 20.045 -21.185 55.025 1.00 89.35 C ATOM 4933 CD LYS B 240 18.893 -21.694 55.886 1.00 88.80 C ATOM 4934 CE LYS B 240 17.802 -22.345 55.053 1.00 88.33 C ATOM 4935 NZ LYS B 240 16.632 -22.719 55.894 1.00 88.58 N ATOM 4936 HA LYS B 240 22.503 -18.832 55.734 1.00 0.00 H ATOM 4937 HB2 LYS B 240 21.529 -21.122 56.549 1.00 0.00 H ATOM 4938 HB3 LYS B 240 20.480 -19.687 56.472 1.00 0.00 H ATOM 4939 HG2 LYS B 240 19.652 -20.529 54.248 1.00 0.00 H ATOM 4940 HG3 LYS B 240 20.550 -22.032 54.562 1.00 0.00 H ATOM 4941 HD2 LYS B 240 19.280 -22.427 56.594 1.00 0.00 H ATOM 4942 HD3 LYS B 240 18.464 -20.854 56.433 1.00 0.00 H ATOM 4943 HE2 LYS B 240 18.202 -23.242 54.581 1.00 0.00 H ATOM 4944 HE3 LYS B 240 17.477 -21.645 54.283 1.00 0.00 H ATOM 4945 HZ1 LYS B 240 16.935 -23.391 56.628 1.00 0.00 H ATOM 4946 HZ2 LYS B 240 16.242 -21.866 56.343 1.00 0.00 H ATOM 4947 HZ3 LYS B 240 15.904 -23.161 55.297 1.00 0.00 H ATOM 4948 H LYS B 240 20.833 -19.525 53.388 1.00 0.00 H ATOM 4949 N THR B 241 23.160 -21.859 55.032 1.00 90.20 N ATOM 4950 CA THR B 241 24.255 -22.802 54.838 1.00 90.67 C ATOM 4951 C THR B 241 25.276 -22.452 55.921 1.00 91.23 C ATOM 4952 O THR B 241 26.273 -21.775 55.660 1.00 91.97 O ATOM 4953 CB THR B 241 24.897 -22.632 53.445 1.00 90.64 C ATOM 4954 OG1 THR B 241 23.867 -22.477 52.463 1.00 90.57 O ATOM 4955 CG2 THR B 241 25.735 -23.851 53.090 1.00 90.30 C ATOM 4956 HA THR B 241 23.907 -23.833 54.902 1.00 0.00 H ATOM 4957 HB THR B 241 25.538 -21.751 53.463 1.00 0.00 H ATOM 4958 HG1 THR B 241 23.325 -21.677 52.678 1.00 0.00 H ATOM 4959 HG23 THR B 241 26.523 -23.978 53.833 1.00 0.00 H ATOM 4960 HG21 THR B 241 25.099 -24.736 53.078 1.00 0.00 H ATOM 4961 HG22 THR B 241 26.181 -23.709 52.106 1.00 0.00 H ATOM 4962 H THR B 241 22.225 -22.214 55.316 1.00 0.00 H ATOM 4963 N THR B 242 25.001 -22.908 57.142 1.00 91.31 N ATOM 4964 CA THR B 242 25.853 -22.637 58.298 1.00 91.12 C ATOM 4965 C THR B 242 27.191 -23.375 58.278 1.00 90.55 C ATOM 4966 O THR B 242 27.585 -23.987 59.272 1.00 90.86 O ATOM 4967 CB THR B 242 25.122 -22.993 59.613 1.00 91.62 C ATOM 4968 OG1 THR B 242 23.769 -22.523 59.551 1.00 92.03 O ATOM 4969 CG2 THR B 242 25.822 -22.339 60.807 1.00 91.47 C ATOM 4970 HA THR B 242 26.067 -21.570 58.243 1.00 0.00 H ATOM 4971 HB THR B 242 25.137 -24.076 59.738 1.00 0.00 H ATOM 4972 HG1 THR B 242 23.302 -22.752 60.394 1.00 0.00 H ATOM 4973 HG23 THR B 242 26.852 -22.692 60.861 1.00 0.00 H ATOM 4974 HG21 THR B 242 25.814 -21.256 60.683 1.00 0.00 H ATOM 4975 HG22 THR B 242 25.297 -22.605 61.725 1.00 0.00 H ATOM 4976 H THR B 242 24.144 -23.481 57.278 1.00 0.00 H ATOM 4977 N ASP B 243 27.885 -23.318 57.147 1.00 89.38 N ATOM 4978 CA ASP B 243 29.187 -23.964 57.012 1.00 87.69 C ATOM 4979 C ASP B 243 30.016 -23.188 55.999 1.00 85.57 C ATOM 4980 O ASP B 243 29.479 -22.660 55.029 1.00 85.81 O ATOM 4981 CB ASP B 243 29.031 -25.420 56.558 1.00 88.61 C ATOM 4982 CG ASP B 243 28.264 -25.547 55.261 1.00 89.65 C ATOM 4983 OD1 ASP B 243 27.045 -25.277 55.265 1.00 89.60 O ATOM 4984 OD2 ASP B 243 28.883 -25.913 54.237 1.00 90.51 O ATOM 4985 HA ASP B 243 29.687 -23.967 57.980 1.00 0.00 H ATOM 4986 HB2 ASP B 243 30.023 -25.851 56.421 1.00 0.00 H ATOM 4987 HB3 ASP B 243 28.500 -25.972 57.333 1.00 0.00 H ATOM 4988 H ASP B 243 27.490 -22.800 56.336 1.00 0.00 H ATOM 4989 N LYS B 244 31.323 -23.123 56.231 1.00 82.89 N ATOM 4990 CA LYS B 244 32.235 -22.396 55.355 1.00 79.87 C ATOM 4991 C LYS B 244 31.628 -21.080 54.869 1.00 77.29 C ATOM 4992 O LYS B 244 31.047 -21.003 53.787 1.00 76.68 O ATOM 4993 CB LYS B 244 32.652 -23.267 54.158 1.00 80.84 C ATOM 4994 CG LYS B 244 31.517 -23.747 53.258 1.00 81.41 C ATOM 4995 CD LYS B 244 32.046 -24.532 52.061 1.00 81.31 C ATOM 4996 CE LYS B 244 32.730 -25.825 52.494 1.00 81.68 C ATOM 4997 NZ LYS B 244 33.261 -26.594 51.333 1.00 81.38 N ATOM 4998 HA LYS B 244 33.122 -22.155 55.941 1.00 0.00 H ATOM 4999 HB2 LYS B 244 33.342 -22.686 53.546 1.00 0.00 H ATOM 5000 HB3 LYS B 244 33.165 -24.146 54.547 1.00 0.00 H ATOM 5001 HG2 LYS B 244 30.853 -24.388 53.837 1.00 0.00 H ATOM 5002 HG3 LYS B 244 30.961 -22.882 52.897 1.00 0.00 H ATOM 5003 HD2 LYS B 244 31.213 -24.776 51.402 1.00 0.00 H ATOM 5004 HD3 LYS B 244 32.765 -23.914 51.523 1.00 0.00 H ATOM 5005 HE2 LYS B 244 32.007 -26.444 53.025 1.00 0.00 H ATOM 5006 HE3 LYS B 244 33.556 -25.580 53.161 1.00 0.00 H ATOM 5007 HZ1 LYS B 244 32.478 -26.839 50.694 1.00 0.00 H ATOM 5008 HZ2 LYS B 244 33.957 -26.013 50.823 1.00 0.00 H ATOM 5009 HZ3 LYS B 244 33.717 -27.464 51.674 1.00 0.00 H ATOM 5010 H LYS B 244 31.709 -23.607 57.066 1.00 0.00 H ATOM 5011 N SER B 245 31.762 -20.044 55.689 1.00 74.32 N ATOM 5012 CA SER B 245 31.240 -18.729 55.348 1.00 70.74 C ATOM 5013 C SER B 245 32.372 -17.905 54.734 1.00 68.64 C ATOM 5014 O SER B 245 33.547 -18.149 55.006 1.00 67.80 O ATOM 5015 CB SER B 245 30.691 -18.044 56.602 1.00 70.35 C ATOM 5016 OG SER B 245 29.915 -16.905 56.272 1.00 69.63 O ATOM 5017 HA SER B 245 30.425 -18.820 54.630 1.00 0.00 H ATOM 5018 HB2 SER B 245 31.525 -17.735 57.231 1.00 0.00 H ATOM 5019 HB3 SER B 245 30.068 -18.752 57.149 1.00 0.00 H ATOM 5020 HG SER B 245 29.576 -16.486 57.103 1.00 0.00 H ATOM 5021 H SER B 245 32.252 -20.176 56.597 1.00 0.00 H ATOM 5022 N PRO B 246 32.031 -16.926 53.883 1.00 66.70 N ATOM 5023 CA PRO B 246 33.020 -16.068 53.223 1.00 64.28 C ATOM 5024 C PRO B 246 33.762 -15.126 54.156 1.00 61.96 C ATOM 5025 O PRO B 246 33.198 -14.634 55.131 1.00 61.20 O ATOM 5026 CB PRO B 246 32.182 -15.289 52.211 1.00 64.10 C ATOM 5027 CG PRO B 246 31.040 -16.195 51.940 1.00 66.09 C ATOM 5028 CD PRO B 246 30.695 -16.695 53.313 1.00 66.32 C ATOM 5029 HA PRO B 246 33.822 -16.662 52.785 1.00 0.00 H ATOM 5030 HD3 PRO B 246 30.142 -15.948 53.882 1.00 0.00 H ATOM 5031 HD2 PRO B 246 30.116 -17.617 53.268 1.00 0.00 H ATOM 5032 HG3 PRO B 246 31.333 -17.014 51.283 1.00 0.00 H ATOM 5033 HG2 PRO B 246 30.204 -15.655 51.495 1.00 0.00 H ATOM 5034 HB2 PRO B 246 31.839 -14.344 52.633 1.00 0.00 H ATOM 5035 HB3 PRO B 246 32.750 -15.094 51.301 1.00 0.00 H ATOM 5036 N PHE B 247 35.030 -14.880 53.844 1.00 60.54 N ATOM 5037 CA PHE B 247 35.845 -13.963 54.621 1.00 58.69 C ATOM 5038 C PHE B 247 35.413 -12.586 54.145 1.00 57.71 C ATOM 5039 O PHE B 247 35.506 -12.281 52.959 1.00 58.29 O ATOM 5040 CB PHE B 247 37.327 -14.163 54.317 1.00 60.27 C ATOM 5041 CG PHE B 247 38.231 -13.354 55.197 1.00 61.14 C ATOM 5042 CD1 PHE B 247 38.514 -13.771 56.496 1.00 60.90 C ATOM 5043 CD2 PHE B 247 38.764 -12.152 54.747 1.00 60.19 C ATOM 5044 CE1 PHE B 247 39.312 -13.002 57.335 1.00 60.56 C ATOM 5045 CE2 PHE B 247 39.564 -11.372 55.580 1.00 61.26 C ATOM 5046 CZ PHE B 247 39.839 -11.799 56.878 1.00 60.84 C ATOM 5047 HA PHE B 247 35.716 -14.110 55.693 1.00 0.00 H ATOM 5048 HB2 PHE B 247 37.568 -15.218 54.451 1.00 0.00 H ATOM 5049 HB3 PHE B 247 37.509 -13.879 53.281 1.00 0.00 H ATOM 5050 HD2 PHE B 247 38.554 -11.816 53.732 1.00 0.00 H ATOM 5051 HE2 PHE B 247 39.974 -10.430 55.217 1.00 0.00 H ATOM 5052 HZ PHE B 247 40.465 -11.192 57.532 1.00 0.00 H ATOM 5053 HE1 PHE B 247 39.524 -13.341 58.349 1.00 0.00 H ATOM 5054 HD1 PHE B 247 38.104 -14.713 56.859 1.00 0.00 H ATOM 5055 H PHE B 247 35.450 -15.357 53.021 1.00 0.00 H ATOM 5056 N VAL B 248 34.952 -11.754 55.066 1.00 56.36 N ATOM 5057 CA VAL B 248 34.467 -10.426 54.723 1.00 54.49 C ATOM 5058 C VAL B 248 35.507 -9.311 54.693 1.00 54.69 C ATOM 5059 O VAL B 248 36.003 -8.883 55.736 1.00 56.06 O ATOM 5060 CB VAL B 248 33.349 -10.000 55.693 1.00 53.34 C ATOM 5061 CG1 VAL B 248 32.722 -8.697 55.229 1.00 53.28 C ATOM 5062 CG2 VAL B 248 32.313 -11.104 55.794 1.00 54.31 C ATOM 5063 HA VAL B 248 34.116 -10.541 53.697 1.00 0.00 H ATOM 5064 HB VAL B 248 33.771 -9.833 56.684 1.00 0.00 H ATOM 5065 HG11 VAL B 248 33.485 -7.919 55.198 1.00 0.00 H ATOM 5066 HG12 VAL B 248 32.299 -8.833 54.233 1.00 0.00 H ATOM 5067 HG13 VAL B 248 31.933 -8.407 55.923 1.00 0.00 H ATOM 5068 HG21 VAL B 248 31.886 -11.291 54.809 1.00 0.00 H ATOM 5069 HG22 VAL B 248 32.787 -12.013 56.164 1.00 0.00 H ATOM 5070 HG23 VAL B 248 31.524 -10.798 56.481 1.00 0.00 H ATOM 5071 H VAL B 248 34.936 -12.058 56.061 1.00 0.00 H ATOM 5072 N ILE B 249 35.831 -8.834 53.495 1.00 53.02 N ATOM 5073 CA ILE B 249 36.783 -7.739 53.358 1.00 51.97 C ATOM 5074 C ILE B 249 35.945 -6.460 53.421 1.00 52.06 C ATOM 5075 O ILE B 249 35.267 -6.102 52.453 1.00 52.08 O ATOM 5076 CB ILE B 249 37.511 -7.766 51.998 1.00 51.42 C ATOM 5077 CG1 ILE B 249 38.025 -9.172 51.685 1.00 51.59 C ATOM 5078 CG2 ILE B 249 38.659 -6.777 52.023 1.00 48.64 C ATOM 5079 CD1 ILE B 249 39.124 -9.651 52.601 1.00 55.84 C ATOM 5080 HA ILE B 249 37.543 -7.809 54.136 1.00 0.00 H ATOM 5081 HB ILE B 249 36.808 -7.484 51.214 1.00 0.00 H ATOM 5082 HG12 ILE B 249 37.189 -9.867 51.763 1.00 0.00 H ATOM 5083 HG13 ILE B 249 38.406 -9.177 50.664 1.00 0.00 H ATOM 5084 HD11 ILE B 249 39.977 -8.976 52.527 1.00 0.00 H ATOM 5085 HD12 ILE B 249 38.759 -9.666 53.628 1.00 0.00 H ATOM 5086 HD13 ILE B 249 39.428 -10.656 52.307 1.00 0.00 H ATOM 5087 HG21 ILE B 249 38.270 -5.776 52.209 1.00 0.00 H ATOM 5088 HG22 ILE B 249 39.356 -7.051 52.815 1.00 0.00 H ATOM 5089 HG23 ILE B 249 39.174 -6.796 51.062 1.00 0.00 H ATOM 5090 H ILE B 249 35.399 -9.248 52.644 1.00 0.00 H ATOM 5091 N TYR B 250 35.983 -5.778 54.557 1.00 51.09 N ATOM 5092 CA TYR B 250 35.203 -4.558 54.733 1.00 52.09 C ATOM 5093 C TYR B 250 36.086 -3.371 55.084 1.00 53.20 C ATOM 5094 O TYR B 250 35.636 -2.226 55.055 1.00 52.52 O ATOM 5095 CB TYR B 250 34.178 -4.772 55.849 1.00 51.78 C ATOM 5096 CG TYR B 250 34.821 -5.154 57.166 1.00 50.61 C ATOM 5097 CD1 TYR B 250 35.312 -4.179 58.033 1.00 50.31 C ATOM 5098 CD2 TYR B 250 35.002 -6.494 57.511 1.00 51.21 C ATOM 5099 CE1 TYR B 250 35.971 -4.529 59.212 1.00 51.51 C ATOM 5100 CE2 TYR B 250 35.662 -6.856 58.686 1.00 50.44 C ATOM 5101 CZ TYR B 250 36.145 -5.868 59.530 1.00 50.38 C ATOM 5102 OH TYR B 250 36.811 -6.216 60.681 1.00 49.22 O ATOM 5103 HA TYR B 250 34.702 -4.338 53.790 1.00 0.00 H ATOM 5104 HB3 TYR B 250 33.496 -5.568 55.549 1.00 0.00 H ATOM 5105 HB2 TYR B 250 33.617 -3.848 55.989 1.00 0.00 H ATOM 5106 HD2 TYR B 250 34.621 -7.273 56.850 1.00 0.00 H ATOM 5107 HE2 TYR B 250 35.797 -7.908 58.938 1.00 0.00 H ATOM 5108 HE1 TYR B 250 36.347 -3.754 59.880 1.00 0.00 H ATOM 5109 HD1 TYR B 250 35.179 -3.126 57.786 1.00 0.00 H ATOM 5110 HH TYR B 250 37.086 -5.396 61.163 1.00 0.00 H ATOM 5111 H TYR B 250 36.580 -6.119 55.337 1.00 0.00 H ATOM 5112 N ASP B 251 37.341 -3.661 55.419 1.00 55.44 N ATOM 5113 CA ASP B 251 38.309 -2.642 55.818 1.00 58.70 C ATOM 5114 C ASP B 251 39.703 -2.847 55.237 1.00 58.77 C ATOM 5115 O ASP B 251 40.008 -3.883 54.641 1.00 57.11 O ATOM 5116 CB ASP B 251 38.416 -2.604 57.345 1.00 59.57 C ATOM 5117 CG ASP B 251 37.777 -1.374 57.936 1.00 62.57 C ATOM 5118 OD1 ASP B 251 36.759 -0.912 57.377 1.00 65.04 O ATOM 5119 OD2 ASP B 251 38.282 -0.874 58.964 1.00 63.93 O ATOM 5120 HA ASP B 251 37.933 -1.700 55.418 1.00 0.00 H ATOM 5121 HB2 ASP B 251 37.922 -3.486 57.753 1.00 0.00 H ATOM 5122 HB3 ASP B 251 39.470 -2.619 57.623 1.00 0.00 H ATOM 5123 H ASP B 251 37.646 -4.655 55.396 1.00 0.00 H ATOM 5124 N MET B 252 40.552 -1.845 55.438 1.00 59.97 N ATOM 5125 CA MET B 252 41.919 -1.893 54.946 1.00 61.55 C ATOM 5126 C MET B 252 42.681 -3.001 55.665 1.00 61.78 C ATOM 5127 O MET B 252 43.492 -3.700 55.061 1.00 61.95 O ATOM 5128 CB MET B 252 42.603 -0.546 55.180 1.00 61.63 C ATOM 5129 CG MET B 252 43.687 -0.222 54.174 1.00 63.76 C ATOM 5130 SD MET B 252 43.020 -0.129 52.504 1.00 65.39 S ATOM 5131 CE MET B 252 42.420 1.578 52.459 1.00 65.95 C ATOM 5132 HA MET B 252 41.912 -2.101 53.876 1.00 0.00 H ATOM 5133 HB2 MET B 252 41.845 0.236 55.132 1.00 0.00 H ATOM 5134 HB3 MET B 252 43.050 -0.556 56.174 1.00 0.00 H ATOM 5135 HG2 MET B 252 44.449 -1.000 54.210 1.00 0.00 H ATOM 5136 HG3 MET B 252 44.136 0.737 54.432 1.00 0.00 H ATOM 5137 HE1 MET B 252 41.668 1.718 53.235 1.00 0.00 H ATOM 5138 HE2 MET B 252 43.253 2.259 52.632 1.00 0.00 H ATOM 5139 HE3 MET B 252 41.979 1.781 51.483 1.00 0.00 H ATOM 5140 H MET B 252 40.230 -1.005 55.960 1.00 0.00 H ATOM 5141 N ASN B 253 42.411 -3.173 56.954 1.00 62.26 N ATOM 5142 CA ASN B 253 43.097 -4.203 57.719 1.00 63.12 C ATOM 5143 C ASN B 253 42.517 -5.583 57.424 1.00 63.17 C ATOM 5144 O ASN B 253 43.246 -6.577 57.404 1.00 62.99 O ATOM 5145 CB ASN B 253 43.001 -3.914 59.219 1.00 65.02 C ATOM 5146 CG ASN B 253 44.069 -4.645 60.021 1.00 67.71 C ATOM 5147 OD1 ASN B 253 45.224 -4.209 60.089 1.00 67.02 O ATOM 5148 ND2 ASN B 253 43.690 -5.774 60.620 1.00 68.37 N ATOM 5149 HA ASN B 253 44.145 -4.194 57.420 1.00 0.00 H ATOM 5150 HB2 ASN B 253 43.117 -2.842 59.377 1.00 0.00 H ATOM 5151 HB3 ASN B 253 42.020 -4.229 59.574 1.00 0.00 H ATOM 5152 HD22 ASN B 253 42.707 -6.103 60.535 1.00 0.00 H ATOM 5153 HD21 ASN B 253 44.377 -6.326 61.172 1.00 0.00 H ATOM 5154 H ASN B 253 41.705 -2.568 57.419 1.00 0.00 H ATOM 5155 N SER B 254 41.208 -5.645 57.193 1.00 63.09 N ATOM 5156 CA SER B 254 40.563 -6.921 56.900 1.00 64.30 C ATOM 5157 C SER B 254 40.987 -7.451 55.535 1.00 65.19 C ATOM 5158 O SER B 254 40.976 -8.658 55.298 1.00 65.45 O ATOM 5159 CB SER B 254 39.041 -6.780 56.962 1.00 63.42 C ATOM 5160 OG SER B 254 38.587 -5.781 56.073 1.00 64.30 O ATOM 5161 HA SER B 254 40.881 -7.637 57.657 1.00 0.00 H ATOM 5162 HB2 SER B 254 38.749 -6.513 57.978 1.00 0.00 H ATOM 5163 HB3 SER B 254 38.584 -7.732 56.692 1.00 0.00 H ATOM 5164 HG SER B 254 38.996 -4.913 56.317 1.00 0.00 H ATOM 5165 H SER B 254 40.639 -4.775 57.222 1.00 0.00 H ATOM 5166 N LEU B 255 41.355 -6.547 54.634 1.00 67.33 N ATOM 5167 CA LEU B 255 41.804 -6.954 53.309 1.00 69.40 C ATOM 5168 C LEU B 255 43.190 -7.556 53.453 1.00 70.69 C ATOM 5169 O LEU B 255 43.488 -8.603 52.878 1.00 70.74 O ATOM 5170 CB LEU B 255 41.865 -5.758 52.359 1.00 69.51 C ATOM 5171 CG LEU B 255 42.529 -6.034 51.005 1.00 70.62 C ATOM 5172 CD1 LEU B 255 41.812 -7.170 50.279 1.00 69.52 C ATOM 5173 CD2 LEU B 255 42.504 -4.764 50.174 1.00 70.03 C ATOM 5174 HA LEU B 255 41.103 -7.677 52.893 1.00 0.00 H ATOM 5175 HB2 LEU B 255 40.845 -5.422 52.173 1.00 0.00 H ATOM 5176 HB3 LEU B 255 42.423 -4.963 52.853 1.00 0.00 H ATOM 5177 HG LEU B 255 43.563 -6.341 51.162 1.00 0.00 H ATOM 5178 HD21 LEU B 255 41.471 -4.452 50.021 1.00 0.00 H ATOM 5179 HD22 LEU B 255 43.048 -3.978 50.697 1.00 0.00 H ATOM 5180 HD23 LEU B 255 42.975 -4.953 49.209 1.00 0.00 H ATOM 5181 HD11 LEU B 255 41.857 -8.074 50.887 1.00 0.00 H ATOM 5182 HD12 LEU B 255 40.771 -6.894 50.113 1.00 0.00 H ATOM 5183 HD13 LEU B 255 42.298 -7.351 49.320 1.00 0.00 H ATOM 5184 H LEU B 255 41.322 -5.536 54.877 1.00 0.00 H ATOM 5185 N MET B 256 44.031 -6.881 54.232 1.00 72.40 N ATOM 5186 CA MET B 256 45.389 -7.344 54.474 1.00 74.32 C ATOM 5187 C MET B 256 45.364 -8.797 54.934 1.00 74.75 C ATOM 5188 O MET B 256 45.934 -9.676 54.285 1.00 74.69 O ATOM 5189 CB MET B 256 46.058 -6.485 55.548 1.00 76.74 C ATOM 5190 CG MET B 256 46.252 -5.025 55.168 1.00 79.69 C ATOM 5191 SD MET B 256 47.358 -4.799 53.762 1.00 83.81 S ATOM 5192 CE MET B 256 46.184 -4.300 52.485 1.00 82.82 C ATOM 5193 HA MET B 256 45.956 -7.263 53.547 1.00 0.00 H ATOM 5194 HB2 MET B 256 45.441 -6.523 56.446 1.00 0.00 H ATOM 5195 HB3 MET B 256 47.037 -6.913 55.763 1.00 0.00 H ATOM 5196 HG2 MET B 256 46.668 -4.496 56.025 1.00 0.00 H ATOM 5197 HG3 MET B 256 45.280 -4.600 54.917 1.00 0.00 H ATOM 5198 HE1 MET B 256 45.449 -5.091 52.340 1.00 0.00 H ATOM 5199 HE2 MET B 256 45.679 -3.385 52.795 1.00 0.00 H ATOM 5200 HE3 MET B 256 46.718 -4.123 51.551 1.00 0.00 H ATOM 5201 H MET B 256 43.709 -5.999 54.680 1.00 0.00 H ATOM 5202 N MET B 257 44.696 -9.046 56.056 1.00 75.01 N ATOM 5203 CA MET B 257 44.610 -10.395 56.593 1.00 75.32 C ATOM 5204 C MET B 257 43.938 -11.336 55.600 1.00 75.68 C ATOM 5205 O MET B 257 44.165 -12.547 55.629 1.00 76.13 O ATOM 5206 CB MET B 257 43.830 -10.403 57.904 1.00 75.91 C ATOM 5207 CG MET B 257 43.912 -11.729 58.639 1.00 76.48 C ATOM 5208 SD MET B 257 42.976 -11.731 60.168 1.00 77.80 S ATOM 5209 CE MET B 257 41.576 -12.740 59.705 1.00 76.45 C ATOM 5210 HA MET B 257 45.627 -10.742 56.777 1.00 0.00 H ATOM 5211 HB2 MET B 257 44.230 -9.622 58.551 1.00 0.00 H ATOM 5212 HB3 MET B 257 42.783 -10.191 57.686 1.00 0.00 H ATOM 5213 HG2 MET B 257 44.957 -11.937 58.869 1.00 0.00 H ATOM 5214 HG3 MET B 257 43.522 -12.513 57.990 1.00 0.00 H ATOM 5215 HE1 MET B 257 41.051 -12.271 58.873 1.00 0.00 H ATOM 5216 HE2 MET B 257 41.925 -13.728 59.406 1.00 0.00 H ATOM 5217 HE3 MET B 257 40.901 -12.834 60.555 1.00 0.00 H ATOM 5218 H MET B 257 44.228 -8.264 56.557 1.00 0.00 H ATOM 5219 N GLY B 258 43.110 -10.779 54.722 1.00 75.14 N ATOM 5220 CA GLY B 258 42.434 -11.605 53.741 1.00 75.22 C ATOM 5221 C GLY B 258 43.420 -12.228 52.773 1.00 75.45 C ATOM 5222 O GLY B 258 43.278 -13.388 52.377 1.00 74.95 O ATOM 5223 HA3 GLY B 258 41.729 -10.989 53.183 1.00 0.00 H ATOM 5224 HA2 GLY B 258 41.893 -12.398 54.257 1.00 0.00 H ATOM 5225 H GLY B 258 42.947 -9.752 54.739 1.00 0.00 H ATOM 5226 N GLU B 259 44.432 -11.448 52.408 1.00 75.36 N ATOM 5227 CA GLU B 259 45.468 -11.874 51.473 1.00 75.63 C ATOM 5228 C GLU B 259 46.386 -12.976 51.987 1.00 75.62 C ATOM 5229 O GLU B 259 47.145 -13.563 51.214 1.00 76.21 O ATOM 5230 CB GLU B 259 46.323 -10.670 51.066 1.00 75.63 C ATOM 5231 CG GLU B 259 45.901 -10.007 49.770 1.00 75.41 C ATOM 5232 CD GLU B 259 46.633 -8.700 49.522 1.00 77.27 C ATOM 5233 OE1 GLU B 259 47.873 -8.659 49.686 1.00 77.34 O ATOM 5234 OE2 GLU B 259 45.963 -7.712 49.156 1.00 78.35 O ATOM 5235 HA GLU B 259 44.931 -12.297 50.624 1.00 0.00 H ATOM 5236 HB2 GLU B 259 46.267 -9.928 51.862 1.00 0.00 H ATOM 5237 HB3 GLU B 259 47.354 -11.006 50.957 1.00 0.00 H ATOM 5238 HG2 GLU B 259 46.110 -10.687 48.944 1.00 0.00 H ATOM 5239 HG3 GLU B 259 44.830 -9.806 49.812 1.00 0.00 H ATOM 5240 H GLU B 259 44.488 -10.489 52.807 1.00 0.00 H ATOM 5241 N ASP B 260 46.325 -13.257 53.284 1.00 75.84 N ATOM 5242 CA ASP B 260 47.181 -14.282 53.866 1.00 75.23 C ATOM 5243 C ASP B 260 46.355 -15.423 54.450 1.00 75.12 C ATOM 5244 O ASP B 260 46.887 -16.308 55.120 1.00 75.03 O ATOM 5245 CB ASP B 260 48.064 -13.663 54.953 1.00 75.04 C ATOM 5246 CG ASP B 260 49.358 -14.427 55.161 1.00 74.81 C ATOM 5247 OD1 ASP B 260 49.301 -15.619 55.525 1.00 74.71 O ATOM 5248 OD2 ASP B 260 50.437 -13.829 54.959 1.00 74.71 O ATOM 5249 HA ASP B 260 47.811 -14.692 53.076 1.00 0.00 H ATOM 5250 HB2 ASP B 260 48.305 -12.639 54.666 1.00 0.00 H ATOM 5251 HB3 ASP B 260 47.509 -13.655 55.891 1.00 0.00 H ATOM 5252 H ASP B 260 45.658 -12.739 53.891 1.00 0.00 H ATOM 5253 N LYS B 261 45.052 -15.398 54.189 1.00 74.97 N ATOM 5254 CA LYS B 261 44.157 -16.434 54.688 1.00 74.97 C ATOM 5255 C LYS B 261 43.146 -16.875 53.634 1.00 75.21 C ATOM 5256 O LYS B 261 42.060 -17.351 53.964 1.00 75.17 O ATOM 5257 CB LYS B 261 43.422 -15.941 55.938 1.00 74.59 C ATOM 5258 CG LYS B 261 44.337 -15.673 57.122 1.00 74.14 C ATOM 5259 CD LYS B 261 43.546 -15.302 58.364 1.00 73.78 C ATOM 5260 CE LYS B 261 44.465 -15.090 59.556 1.00 73.57 C ATOM 5261 NZ LYS B 261 45.269 -16.307 59.858 1.00 73.40 N ATOM 5262 HA LYS B 261 44.771 -17.298 54.940 1.00 0.00 H ATOM 5263 HB2 LYS B 261 42.902 -15.016 55.689 1.00 0.00 H ATOM 5264 HB3 LYS B 261 42.694 -16.698 56.230 1.00 0.00 H ATOM 5265 HG2 LYS B 261 44.921 -16.570 57.329 1.00 0.00 H ATOM 5266 HG3 LYS B 261 45.009 -14.852 56.872 1.00 0.00 H ATOM 5267 HD2 LYS B 261 42.993 -14.382 58.173 1.00 0.00 H ATOM 5268 HD3 LYS B 261 42.845 -16.105 58.593 1.00 0.00 H ATOM 5269 HE2 LYS B 261 43.860 -14.841 60.428 1.00 0.00 H ATOM 5270 HE3 LYS B 261 45.142 -14.265 59.337 1.00 0.00 H ATOM 5271 HZ1 LYS B 261 44.630 -17.098 60.074 1.00 0.00 H ATOM 5272 HZ2 LYS B 261 45.854 -16.548 59.033 1.00 0.00 H ATOM 5273 HZ3 LYS B 261 45.882 -16.121 60.677 1.00 0.00 H ATOM 5274 H LYS B 261 44.663 -14.622 53.616 1.00 0.00 H ATOM 5275 N ILE B 262 43.510 -16.712 52.366 1.00 75.74 N ATOM 5276 CA ILE B 262 42.639 -17.108 51.264 1.00 75.82 C ATOM 5277 C ILE B 262 43.458 -17.343 49.993 1.00 75.70 C ATOM 5278 O ILE B 262 44.439 -16.641 49.736 1.00 75.53 O ATOM 5279 CB ILE B 262 41.559 -16.037 50.991 1.00 75.70 C ATOM 5280 CG1 ILE B 262 40.406 -16.656 50.201 1.00 75.80 C ATOM 5281 CG2 ILE B 262 42.153 -14.875 50.205 1.00 75.62 C ATOM 5282 CD1 ILE B 262 39.204 -15.750 50.074 1.00 76.33 C ATOM 5283 HA ILE B 262 42.144 -18.035 51.552 1.00 0.00 H ATOM 5284 HB ILE B 262 41.186 -15.663 51.945 1.00 0.00 H ATOM 5285 HG12 ILE B 262 40.764 -16.896 49.200 1.00 0.00 H ATOM 5286 HG13 ILE B 262 40.096 -17.572 50.704 1.00 0.00 H ATOM 5287 HD11 ILE B 262 38.826 -15.509 51.067 1.00 0.00 H ATOM 5288 HD12 ILE B 262 39.494 -14.833 49.562 1.00 0.00 H ATOM 5289 HD13 ILE B 262 38.427 -16.257 49.501 1.00 0.00 H ATOM 5290 HG21 ILE B 262 42.963 -14.426 50.780 1.00 0.00 H ATOM 5291 HG22 ILE B 262 42.540 -15.241 49.254 1.00 0.00 H ATOM 5292 HG23 ILE B 262 41.379 -14.129 50.021 1.00 0.00 H ATOM 5293 H ILE B 262 44.438 -16.292 52.154 1.00 0.00 H ATOM 5294 N LYS B 263 43.050 -18.339 49.211 1.00 75.45 N ATOM 5295 CA LYS B 263 43.730 -18.696 47.968 1.00 75.69 C ATOM 5296 C LYS B 263 44.014 -17.473 47.095 1.00 75.87 C ATOM 5297 O LYS B 263 43.163 -17.054 46.310 1.00 77.01 O ATOM 5298 CB LYS B 263 42.879 -19.699 47.182 1.00 75.20 C ATOM 5299 CG LYS B 263 43.457 -20.135 45.836 1.00 74.71 C ATOM 5300 CD LYS B 263 44.580 -21.160 45.977 1.00 74.32 C ATOM 5301 CE LYS B 263 45.858 -20.553 46.535 1.00 74.10 C ATOM 5302 NZ LYS B 263 46.945 -21.564 46.643 1.00 73.91 N ATOM 5303 HA LYS B 263 44.688 -19.143 48.235 1.00 0.00 H ATOM 5304 HB2 LYS B 263 42.753 -20.589 47.798 1.00 0.00 H ATOM 5305 HB3 LYS B 263 41.906 -19.244 46.999 1.00 0.00 H ATOM 5306 HG2 LYS B 263 42.657 -20.574 45.239 1.00 0.00 H ATOM 5307 HG3 LYS B 263 43.850 -19.256 45.324 1.00 0.00 H ATOM 5308 HD2 LYS B 263 44.248 -21.953 46.647 1.00 0.00 H ATOM 5309 HD3 LYS B 263 44.793 -21.582 44.995 1.00 0.00 H ATOM 5310 HE2 LYS B 263 45.653 -20.146 47.525 1.00 0.00 H ATOM 5311 HE3 LYS B 263 46.186 -19.750 45.875 1.00 0.00 H ATOM 5312 HZ1 LYS B 263 46.642 -22.331 47.277 1.00 0.00 H ATOM 5313 HZ2 LYS B 263 47.150 -21.952 45.700 1.00 0.00 H ATOM 5314 HZ3 LYS B 263 47.800 -21.113 47.027 1.00 0.00 H ATOM 5315 H LYS B 263 42.213 -18.886 49.496 1.00 0.00 H ATOM 5316 N PHE B 264 45.210 -16.907 47.232 1.00 74.77 N ATOM 5317 CA PHE B 264 45.591 -15.737 46.447 1.00 74.10 C ATOM 5318 C PHE B 264 46.871 -16.021 45.656 1.00 73.98 C ATOM 5319 O PHE B 264 47.836 -16.576 46.190 1.00 74.14 O ATOM 5320 CB PHE B 264 45.806 -14.531 47.365 1.00 73.43 C ATOM 5321 CG PHE B 264 45.916 -13.223 46.634 1.00 72.74 C ATOM 5322 CD1 PHE B 264 44.852 -12.746 45.874 1.00 72.44 C ATOM 5323 CD2 PHE B 264 47.080 -12.466 46.706 1.00 72.44 C ATOM 5324 CE1 PHE B 264 44.945 -11.532 45.197 1.00 72.22 C ATOM 5325 CE2 PHE B 264 47.183 -11.250 46.032 1.00 72.22 C ATOM 5326 CZ PHE B 264 46.113 -10.783 45.277 1.00 72.15 C ATOM 5327 HA PHE B 264 44.785 -15.513 45.748 1.00 0.00 H ATOM 5328 HB2 PHE B 264 44.964 -14.470 48.055 1.00 0.00 H ATOM 5329 HB3 PHE B 264 46.725 -14.688 47.929 1.00 0.00 H ATOM 5330 HD2 PHE B 264 47.922 -12.828 47.296 1.00 0.00 H ATOM 5331 HE2 PHE B 264 48.101 -10.666 46.097 1.00 0.00 H ATOM 5332 HZ PHE B 264 46.190 -9.832 44.749 1.00 0.00 H ATOM 5333 HE1 PHE B 264 44.104 -11.170 44.606 1.00 0.00 H ATOM 5334 HD1 PHE B 264 43.934 -13.330 45.808 1.00 0.00 H ATOM 5335 H PHE B 264 45.888 -17.306 47.912 1.00 0.00 H ATOM 5336 N LYS B 265 46.874 -15.639 44.384 1.00 72.49 N ATOM 5337 CA LYS B 265 48.033 -15.859 43.527 1.00 71.22 C ATOM 5338 C LYS B 265 48.398 -14.617 42.720 1.00 70.62 C ATOM 5339 O LYS B 265 48.089 -14.521 41.531 1.00 70.47 O ATOM 5340 CB LYS B 265 47.768 -17.040 42.587 1.00 70.75 C ATOM 5341 CG LYS B 265 46.478 -16.928 41.785 1.00 70.11 C ATOM 5342 CD LYS B 265 46.236 -18.171 40.940 1.00 69.63 C ATOM 5343 CE LYS B 265 46.040 -19.407 41.806 1.00 69.33 C ATOM 5344 NZ LYS B 265 44.867 -19.270 42.714 1.00 69.10 N ATOM 5345 HA LYS B 265 48.881 -16.085 44.173 1.00 0.00 H ATOM 5346 HB2 LYS B 265 48.600 -17.112 41.887 1.00 0.00 H ATOM 5347 HB3 LYS B 265 47.719 -17.949 43.186 1.00 0.00 H ATOM 5348 HG2 LYS B 265 45.643 -16.799 42.473 1.00 0.00 H ATOM 5349 HG3 LYS B 265 46.543 -16.060 41.128 1.00 0.00 H ATOM 5350 HD2 LYS B 265 45.343 -18.019 40.333 1.00 0.00 H ATOM 5351 HD3 LYS B 265 47.095 -18.328 40.287 1.00 0.00 H ATOM 5352 HE2 LYS B 265 46.936 -19.561 42.408 1.00 0.00 H ATOM 5353 HE3 LYS B 265 45.886 -20.270 41.159 1.00 0.00 H ATOM 5354 HZ1 LYS B 265 45.009 -18.452 43.341 1.00 0.00 H ATOM 5355 HZ2 LYS B 265 44.006 -19.129 42.148 1.00 0.00 H ATOM 5356 HZ3 LYS B 265 44.770 -20.133 43.286 1.00 0.00 H ATOM 5357 H LYS B 265 46.032 -15.173 43.991 1.00 0.00 H ATOM 5358 N HIS B 266 49.063 -13.669 43.373 1.00 69.99 N ATOM 5359 CA HIS B 266 49.476 -12.435 42.717 1.00 69.49 C ATOM 5360 C HIS B 266 50.683 -11.807 43.407 1.00 69.58 C ATOM 5361 O HIS B 266 51.757 -11.699 42.815 1.00 69.48 O ATOM 5362 CB HIS B 266 48.319 -11.433 42.695 1.00 68.81 C ATOM 5363 CG HIS B 266 48.655 -10.139 42.022 1.00 68.14 C ATOM 5364 ND1 HIS B 266 49.056 -10.067 40.705 1.00 67.86 N ATOM 5365 CD2 HIS B 266 48.653 -8.866 42.484 1.00 67.86 C ATOM 5366 CE1 HIS B 266 49.287 -8.806 40.385 1.00 67.68 C ATOM 5367 NE2 HIS B 266 49.050 -8.057 41.447 1.00 67.68 N ATOM 5368 HA HIS B 266 49.761 -12.687 41.696 1.00 0.00 H ATOM 5369 HB2 HIS B 266 47.480 -11.887 42.168 1.00 0.00 H ATOM 5370 HB3 HIS B 266 48.028 -11.221 43.724 1.00 0.00 H ATOM 5371 HD2 HIS B 266 48.386 -8.544 43.490 1.00 0.00 H ATOM 5372 HE1 HIS B 266 49.617 -8.445 39.411 1.00 0.00 H ATOM 5373 H HIS B 266 49.294 -13.812 44.377 1.00 0.00 H ATOM 5374 N ILE B 267 50.504 -11.394 44.658 1.00 69.85 N ATOM 5375 CA ILE B 267 51.588 -10.773 45.411 1.00 70.24 C ATOM 5376 C ILE B 267 51.335 -10.893 46.916 1.00 70.89 C ATOM 5377 O ILE B 267 50.315 -11.438 47.339 1.00 70.82 O ATOM 5378 CB ILE B 267 51.731 -9.277 45.024 1.00 69.85 C ATOM 5379 CG1 ILE B 267 53.199 -8.854 45.098 1.00 69.59 C ATOM 5380 CG2 ILE B 267 50.871 -8.410 45.931 1.00 69.67 C ATOM 5381 CD1 ILE B 267 54.061 -9.441 43.985 1.00 69.31 C ATOM 5382 HA ILE B 267 52.513 -11.294 45.164 1.00 0.00 H ATOM 5383 HB ILE B 267 51.385 -9.142 43.999 1.00 0.00 H ATOM 5384 HG12 ILE B 267 53.248 -7.767 45.035 1.00 0.00 H ATOM 5385 HG13 ILE B 267 53.604 -9.180 46.056 1.00 0.00 H ATOM 5386 HD11 ILE B 267 54.032 -10.529 44.040 1.00 0.00 H ATOM 5387 HD12 ILE B 267 53.676 -9.115 43.019 1.00 0.00 H ATOM 5388 HD13 ILE B 267 55.089 -9.097 44.103 1.00 0.00 H ATOM 5389 HG21 ILE B 267 49.827 -8.705 45.830 1.00 0.00 H ATOM 5390 HG22 ILE B 267 51.189 -8.542 46.965 1.00 0.00 H ATOM 5391 HG23 ILE B 267 50.984 -7.364 45.645 1.00 0.00 H ATOM 5392 H ILE B 267 49.574 -11.516 45.108 1.00 0.00 H ATOM 5393 N THR B 268 52.265 -10.382 47.719 1.00 71.83 N ATOM 5394 CA THR B 268 52.139 -10.437 49.174 1.00 72.92 C ATOM 5395 C THR B 268 51.671 -9.100 49.752 1.00 74.03 C ATOM 5396 O THR B 268 52.066 -8.036 49.276 1.00 73.98 O ATOM 5397 CB THR B 268 53.480 -10.817 49.834 1.00 72.65 C ATOM 5398 OG1 THR B 268 54.477 -9.846 49.491 1.00 72.49 O ATOM 5399 CG2 THR B 268 53.934 -12.191 49.361 1.00 72.49 C ATOM 5400 HA THR B 268 51.393 -11.201 49.392 1.00 0.00 H ATOM 5401 HB THR B 268 53.343 -10.841 50.915 1.00 0.00 H ATOM 5402 HG1 THR B 268 54.192 -8.954 49.813 1.00 0.00 H ATOM 5403 HG23 THR B 268 53.177 -12.932 49.621 1.00 0.00 H ATOM 5404 HG21 THR B 268 54.072 -12.174 48.280 1.00 0.00 H ATOM 5405 HG22 THR B 268 54.876 -12.447 49.845 1.00 0.00 H ATOM 5406 H THR B 268 53.104 -9.932 47.300 1.00 0.00 H ATOM 5407 N PRO B 269 50.822 -9.143 50.793 1.00 75.41 N ATOM 5408 CA PRO B 269 50.279 -7.951 51.460 1.00 75.98 C ATOM 5409 C PRO B 269 51.293 -7.106 52.239 1.00 76.04 C ATOM 5410 O PRO B 269 51.696 -7.457 53.349 1.00 75.68 O ATOM 5411 CB PRO B 269 49.197 -8.532 52.369 1.00 75.61 C ATOM 5412 CG PRO B 269 49.768 -9.864 52.741 1.00 75.83 C ATOM 5413 CD PRO B 269 50.281 -10.370 51.406 1.00 75.91 C ATOM 5414 HA PRO B 269 49.915 -7.230 50.728 1.00 0.00 H ATOM 5415 HD3 PRO B 269 51.059 -11.121 51.541 1.00 0.00 H ATOM 5416 HD2 PRO B 269 49.474 -10.789 50.805 1.00 0.00 H ATOM 5417 HG3 PRO B 269 49.002 -10.524 53.148 1.00 0.00 H ATOM 5418 HG2 PRO B 269 50.578 -9.761 53.464 1.00 0.00 H ATOM 5419 HB2 PRO B 269 49.045 -7.908 53.250 1.00 0.00 H ATOM 5420 HB3 PRO B 269 48.252 -8.643 51.837 1.00 0.00 H ATOM 5421 N LEU B 270 51.693 -5.988 51.642 1.00 76.47 N ATOM 5422 CA LEU B 270 52.638 -5.057 52.255 1.00 76.69 C ATOM 5423 C LEU B 270 52.300 -3.638 51.798 1.00 76.34 C ATOM 5424 O LEU B 270 52.226 -3.362 50.597 1.00 76.54 O ATOM 5425 CB LEU B 270 54.079 -5.394 51.853 1.00 77.86 C ATOM 5426 CG LEU B 270 54.736 -6.646 52.444 1.00 79.10 C ATOM 5427 CD1 LEU B 270 56.132 -6.814 51.847 1.00 80.13 C ATOM 5428 CD2 LEU B 270 54.817 -6.525 53.959 1.00 79.50 C ATOM 5429 HA LEU B 270 52.559 -5.136 53.339 1.00 0.00 H ATOM 5430 HB2 LEU B 270 54.092 -5.507 50.769 1.00 0.00 H ATOM 5431 HB3 LEU B 270 54.698 -4.543 52.136 1.00 0.00 H ATOM 5432 HG LEU B 270 54.136 -7.523 52.200 1.00 0.00 H ATOM 5433 HD21 LEU B 270 55.411 -5.650 54.221 1.00 0.00 H ATOM 5434 HD22 LEU B 270 53.812 -6.419 54.368 1.00 0.00 H ATOM 5435 HD23 LEU B 270 55.285 -7.420 54.369 1.00 0.00 H ATOM 5436 HD11 LEU B 270 56.053 -6.919 50.765 1.00 0.00 H ATOM 5437 HD12 LEU B 270 56.735 -5.938 52.085 1.00 0.00 H ATOM 5438 HD13 LEU B 270 56.600 -7.704 52.267 1.00 0.00 H ATOM 5439 H LEU B 270 51.317 -5.766 50.698 1.00 0.00 H ATOM 5440 N GLN B 271 52.103 -2.740 52.757 1.00 74.84 N ATOM 5441 CA GLN B 271 51.763 -1.358 52.444 1.00 73.52 C ATOM 5442 C GLN B 271 52.826 -0.386 52.949 1.00 72.87 C ATOM 5443 O GLN B 271 52.891 -0.090 54.143 1.00 72.72 O ATOM 5444 CB GLN B 271 50.408 -1.006 53.061 1.00 73.10 C ATOM 5445 CG GLN B 271 49.819 0.310 52.577 1.00 72.45 C ATOM 5446 CD GLN B 271 49.357 0.252 51.131 1.00 72.14 C ATOM 5447 OE1 GLN B 271 48.882 1.245 50.581 1.00 71.94 O ATOM 5448 NE2 GLN B 271 49.491 -0.915 50.511 1.00 71.94 N ATOM 5449 HA GLN B 271 51.713 -1.265 51.359 1.00 0.00 H ATOM 5450 HB2 GLN B 271 49.706 -1.804 52.819 1.00 0.00 H ATOM 5451 HB3 GLN B 271 50.531 -0.947 54.142 1.00 0.00 H ATOM 5452 HG2 GLN B 271 48.965 0.562 53.206 1.00 0.00 H ATOM 5453 HG3 GLN B 271 50.578 1.087 52.669 1.00 0.00 H ATOM 5454 HE22 GLN B 271 49.898 -1.728 51.016 1.00 0.00 H ATOM 5455 HE21 GLN B 271 49.189 -1.016 49.521 1.00 0.00 H ATOM 5456 H GLN B 271 52.193 -3.029 53.752 1.00 0.00 H ATOM 5457 N GLU B 272 53.656 0.107 52.035 1.00 72.16 N ATOM 5458 CA GLU B 272 54.712 1.052 52.379 1.00 71.55 C ATOM 5459 C GLU B 272 55.308 1.690 51.125 1.00 71.49 C ATOM 5460 O GLU B 272 56.444 1.403 50.747 1.00 71.38 O ATOM 5461 CB GLU B 272 55.817 0.355 53.185 1.00 71.04 C ATOM 5462 CG GLU B 272 56.426 -0.871 52.517 1.00 70.35 C ATOM 5463 CD GLU B 272 55.478 -2.053 52.483 1.00 70.01 C ATOM 5464 OE1 GLU B 272 55.072 -2.521 53.567 1.00 69.79 O ATOM 5465 OE2 GLU B 272 55.140 -2.515 51.372 1.00 69.79 O ATOM 5466 HA GLU B 272 54.269 1.839 52.990 1.00 0.00 H ATOM 5467 HB2 GLU B 272 56.615 1.077 53.359 1.00 0.00 H ATOM 5468 HB3 GLU B 272 55.394 0.045 54.141 1.00 0.00 H ATOM 5469 HG2 GLU B 272 56.697 -0.612 51.493 1.00 0.00 H ATOM 5470 HG3 GLU B 272 57.322 -1.159 53.067 1.00 0.00 H ATOM 5471 H GLU B 272 53.549 -0.190 51.044 1.00 0.00 H ATOM 5472 N GLN B 273 54.530 2.561 50.487 1.00 71.54 N ATOM 5473 CA GLN B 273 54.966 3.241 49.273 1.00 71.72 C ATOM 5474 C GLN B 273 55.343 2.241 48.185 1.00 72.24 C ATOM 5475 O GLN B 273 55.976 2.599 47.191 1.00 72.18 O ATOM 5476 CB GLN B 273 56.160 4.155 49.568 1.00 71.19 C ATOM 5477 CG GLN B 273 55.807 5.469 50.260 1.00 70.55 C ATOM 5478 CD GLN B 273 55.178 5.276 51.627 1.00 70.21 C ATOM 5479 OE1 GLN B 273 54.081 4.732 51.749 1.00 70.01 O ATOM 5480 NE2 GLN B 273 55.873 5.726 52.664 1.00 70.01 N ATOM 5481 HA GLN B 273 54.131 3.844 48.915 1.00 0.00 H ATOM 5482 HB2 GLN B 273 56.854 3.610 50.208 1.00 0.00 H ATOM 5483 HB3 GLN B 273 56.649 4.390 48.622 1.00 0.00 H ATOM 5484 HG2 GLN B 273 56.719 6.054 50.378 1.00 0.00 H ATOM 5485 HG3 GLN B 273 55.105 6.015 49.630 1.00 0.00 H ATOM 5486 HE22 GLN B 273 56.797 6.180 52.514 1.00 0.00 H ATOM 5487 HE21 GLN B 273 55.494 5.625 53.627 1.00 0.00 H ATOM 5488 H GLN B 273 53.583 2.763 50.866 1.00 0.00 H ATOM 5489 N SER B 274 54.948 0.987 48.380 1.00 72.99 N ATOM 5490 CA SER B 274 55.236 -0.070 47.419 1.00 73.93 C ATOM 5491 C SER B 274 53.969 -0.860 47.114 1.00 74.69 C ATOM 5492 O SER B 274 53.503 -1.649 47.936 1.00 74.76 O ATOM 5493 CB SER B 274 56.310 -1.010 47.970 1.00 73.69 C ATOM 5494 OG SER B 274 56.616 -2.033 47.039 1.00 73.56 O ATOM 5495 HA SER B 274 55.603 0.387 46.500 1.00 0.00 H ATOM 5496 HB2 SER B 274 55.948 -1.464 48.892 1.00 0.00 H ATOM 5497 HB3 SER B 274 57.213 -0.436 48.179 1.00 0.00 H ATOM 5498 HG SER B 274 57.312 -2.626 47.419 1.00 0.00 H ATOM 5499 H SER B 274 54.418 0.753 49.244 1.00 0.00 H ATOM 5500 N LYS B 275 53.421 -0.641 45.924 1.00 76.11 N ATOM 5501 CA LYS B 275 52.202 -1.316 45.491 1.00 76.24 C ATOM 5502 C LYS B 275 51.086 -1.121 46.517 1.00 75.44 C ATOM 5503 O LYS B 275 50.919 -1.923 47.440 1.00 75.43 O ATOM 5504 CB LYS B 275 52.474 -2.809 45.271 1.00 76.97 C ATOM 5505 CG LYS B 275 52.089 -3.298 43.880 1.00 78.64 C ATOM 5506 CD LYS B 275 52.800 -2.494 42.792 1.00 79.69 C ATOM 5507 CE LYS B 275 52.356 -2.919 41.399 1.00 80.11 C ATOM 5508 NZ LYS B 275 52.976 -2.081 40.334 1.00 79.82 N ATOM 5509 HA LYS B 275 51.878 -0.877 44.547 1.00 0.00 H ATOM 5510 HB2 LYS B 275 53.538 -2.992 45.419 1.00 0.00 H ATOM 5511 HB3 LYS B 275 51.904 -3.376 46.007 1.00 0.00 H ATOM 5512 HG2 LYS B 275 52.365 -4.348 43.783 1.00 0.00 H ATOM 5513 HG3 LYS B 275 51.012 -3.194 43.752 1.00 0.00 H ATOM 5514 HD2 LYS B 275 52.573 -1.437 42.928 1.00 0.00 H ATOM 5515 HD3 LYS B 275 53.875 -2.649 42.883 1.00 0.00 H ATOM 5516 HE2 LYS B 275 51.272 -2.828 41.332 1.00 0.00 H ATOM 5517 HE3 LYS B 275 52.642 -3.959 41.240 1.00 0.00 H ATOM 5518 HZ1 LYS B 275 52.702 -1.087 40.473 1.00 0.00 H ATOM 5519 HZ2 LYS B 275 54.011 -2.167 40.385 1.00 0.00 H ATOM 5520 HZ3 LYS B 275 52.646 -2.406 39.403 1.00 0.00 H ATOM 5521 H LYS B 275 53.877 0.035 45.278 1.00 0.00 H ATOM 5522 N GLU B 276 50.328 -0.042 46.341 1.00 73.40 N ATOM 5523 CA GLU B 276 49.229 0.297 47.236 1.00 71.49 C ATOM 5524 C GLU B 276 48.079 -0.703 47.143 1.00 70.24 C ATOM 5525 O GLU B 276 48.089 -1.606 46.306 1.00 70.08 O ATOM 5526 CB GLU B 276 48.713 1.704 46.921 1.00 71.32 C ATOM 5527 CG GLU B 276 49.783 2.789 46.965 1.00 70.94 C ATOM 5528 CD GLU B 276 50.383 2.969 48.347 1.00 70.77 C ATOM 5529 OE1 GLU B 276 49.638 3.346 49.276 1.00 70.66 O ATOM 5530 OE2 GLU B 276 51.600 2.735 48.503 1.00 70.66 O ATOM 5531 HA GLU B 276 49.617 0.261 48.254 1.00 0.00 H ATOM 5532 HB2 GLU B 276 48.279 1.693 45.921 1.00 0.00 H ATOM 5533 HB3 GLU B 276 47.941 1.956 47.648 1.00 0.00 H ATOM 5534 HG2 GLU B 276 50.580 2.521 46.271 1.00 0.00 H ATOM 5535 HG3 GLU B 276 49.335 3.733 46.654 1.00 0.00 H ATOM 5536 H GLU B 276 50.527 0.583 45.534 1.00 0.00 H ATOM 5537 N VAL B 277 47.089 -0.522 48.010 1.00 68.68 N ATOM 5538 CA VAL B 277 45.914 -1.389 48.066 1.00 67.24 C ATOM 5539 C VAL B 277 45.019 -1.295 46.830 1.00 66.13 C ATOM 5540 O VAL B 277 44.634 -2.313 46.257 1.00 65.55 O ATOM 5541 CB VAL B 277 45.058 -1.066 49.308 1.00 66.55 C ATOM 5542 CG1 VAL B 277 43.819 -1.936 49.327 1.00 66.30 C ATOM 5543 CG2 VAL B 277 45.877 -1.278 50.569 1.00 67.26 C ATOM 5544 HA VAL B 277 46.309 -2.404 48.115 1.00 0.00 H ATOM 5545 HB VAL B 277 44.746 -0.022 49.265 1.00 0.00 H ATOM 5546 HG11 VAL B 277 43.231 -1.749 48.428 1.00 0.00 H ATOM 5547 HG12 VAL B 277 44.114 -2.985 49.358 1.00 0.00 H ATOM 5548 HG13 VAL B 277 43.223 -1.698 50.208 1.00 0.00 H ATOM 5549 HG21 VAL B 277 46.205 -2.316 50.618 1.00 0.00 H ATOM 5550 HG22 VAL B 277 46.747 -0.622 50.550 1.00 0.00 H ATOM 5551 HG23 VAL B 277 45.265 -1.048 51.441 1.00 0.00 H ATOM 5552 H VAL B 277 47.153 0.272 48.679 1.00 0.00 H ATOM 5553 N ALA B 278 44.686 -0.071 46.435 1.00 64.85 N ATOM 5554 CA ALA B 278 43.830 0.171 45.281 1.00 64.75 C ATOM 5555 C ALA B 278 44.306 -0.553 44.018 1.00 65.08 C ATOM 5556 O ALA B 278 43.529 -1.246 43.356 1.00 64.75 O ATOM 5557 CB ALA B 278 43.740 1.666 45.021 1.00 65.60 C ATOM 5558 HA ALA B 278 42.846 -0.233 45.520 1.00 0.00 H ATOM 5559 HB1 ALA B 278 43.319 2.161 45.896 1.00 0.00 H ATOM 5560 HB2 ALA B 278 44.737 2.060 44.823 1.00 0.00 H ATOM 5561 HB3 ALA B 278 43.099 1.845 44.158 1.00 0.00 H ATOM 5562 H ALA B 278 45.050 0.744 46.969 1.00 0.00 H ATOM 5563 N ILE B 279 45.581 -0.381 43.682 1.00 64.36 N ATOM 5564 CA ILE B 279 46.160 -1.015 42.505 1.00 62.89 C ATOM 5565 C ILE B 279 46.170 -2.527 42.657 1.00 62.42 C ATOM 5566 O ILE B 279 45.900 -3.254 41.704 1.00 62.56 O ATOM 5567 CB ILE B 279 47.607 -0.520 42.263 1.00 63.07 C ATOM 5568 CG1 ILE B 279 47.588 0.848 41.573 1.00 63.70 C ATOM 5569 CG2 ILE B 279 48.362 -1.510 41.385 1.00 62.84 C ATOM 5570 CD1 ILE B 279 46.585 1.825 42.140 1.00 66.06 C ATOM 5571 HA ILE B 279 45.542 -0.742 41.650 1.00 0.00 H ATOM 5572 HB ILE B 279 48.107 -0.435 43.228 1.00 0.00 H ATOM 5573 HG12 ILE B 279 48.581 1.289 41.664 1.00 0.00 H ATOM 5574 HG13 ILE B 279 47.355 0.694 40.519 1.00 0.00 H ATOM 5575 HD11 ILE B 279 45.582 1.409 42.046 1.00 0.00 H ATOM 5576 HD12 ILE B 279 46.809 2.004 43.192 1.00 0.00 H ATOM 5577 HD13 ILE B 279 46.643 2.764 41.590 1.00 0.00 H ATOM 5578 HG21 ILE B 279 48.394 -2.481 41.879 1.00 0.00 H ATOM 5579 HG22 ILE B 279 47.852 -1.606 40.426 1.00 0.00 H ATOM 5580 HG23 ILE B 279 49.378 -1.149 41.223 1.00 0.00 H ATOM 5581 H ILE B 279 46.183 0.224 44.277 1.00 0.00 H ATOM 5582 N ARG B 280 46.480 -3.000 43.858 1.00 61.05 N ATOM 5583 CA ARG B 280 46.522 -4.430 44.111 1.00 60.55 C ATOM 5584 C ARG B 280 45.127 -5.024 43.952 1.00 59.56 C ATOM 5585 O ARG B 280 44.980 -6.209 43.652 1.00 60.59 O ATOM 5586 CB ARG B 280 47.069 -4.704 45.516 1.00 61.62 C ATOM 5587 CG ARG B 280 48.017 -5.892 45.571 1.00 63.60 C ATOM 5588 CD ARG B 280 48.891 -5.889 46.825 1.00 64.91 C ATOM 5589 NE ARG B 280 48.177 -6.291 48.035 1.00 65.97 N ATOM 5590 CZ ARG B 280 47.871 -5.471 49.037 1.00 67.61 C ATOM 5591 NH1 ARG B 280 48.212 -4.188 48.983 1.00 67.86 N ATOM 5592 NH2 ARG B 280 47.243 -5.941 50.108 1.00 67.60 N ATOM 5593 HA ARG B 280 47.187 -4.901 43.388 1.00 0.00 H ATOM 5594 HB2 ARG B 280 47.604 -3.818 45.858 1.00 0.00 H ATOM 5595 HB3 ARG B 280 46.229 -4.900 46.183 1.00 0.00 H ATOM 5596 HG2 ARG B 280 47.429 -6.809 45.557 1.00 0.00 H ATOM 5597 HG3 ARG B 280 48.664 -5.864 44.694 1.00 0.00 H ATOM 5598 HD2 ARG B 280 49.280 -4.881 46.972 1.00 0.00 H ATOM 5599 HD3 ARG B 280 49.721 -6.578 46.669 1.00 0.00 H ATOM 5600 HE ARG B 280 47.888 -7.287 48.119 1.00 0.00 H ATOM 5601 HH12 ARG B 280 47.970 -3.552 49.770 1.00 0.00 H ATOM 5602 HH11 ARG B 280 48.721 -3.820 48.154 1.00 0.00 H ATOM 5603 HH22 ARG B 280 47.003 -5.302 50.892 1.00 0.00 H ATOM 5604 HH21 ARG B 280 46.991 -6.949 50.163 1.00 0.00 H ATOM 5605 H ARG B 280 46.696 -2.337 44.629 1.00 0.00 H ATOM 5606 N ILE B 281 44.105 -4.199 44.155 1.00 57.97 N ATOM 5607 CA ILE B 281 42.726 -4.647 44.008 1.00 56.70 C ATOM 5608 C ILE B 281 42.381 -4.626 42.517 1.00 55.55 C ATOM 5609 O ILE B 281 41.791 -5.563 41.992 1.00 53.15 O ATOM 5610 CB ILE B 281 41.737 -3.725 44.773 1.00 56.95 C ATOM 5611 CG1 ILE B 281 42.018 -3.775 46.276 1.00 57.38 C ATOM 5612 CG2 ILE B 281 40.299 -4.169 44.519 1.00 56.95 C ATOM 5613 CD1 ILE B 281 41.765 -5.135 46.906 1.00 57.32 C ATOM 5614 HA ILE B 281 42.634 -5.650 44.426 1.00 0.00 H ATOM 5615 HB ILE B 281 41.873 -2.705 44.413 1.00 0.00 H ATOM 5616 HG12 ILE B 281 43.063 -3.510 46.439 1.00 0.00 H ATOM 5617 HG13 ILE B 281 41.378 -3.044 46.769 1.00 0.00 H ATOM 5618 HD11 ILE B 281 40.720 -5.411 46.763 1.00 0.00 H ATOM 5619 HD12 ILE B 281 42.407 -5.878 46.433 1.00 0.00 H ATOM 5620 HD13 ILE B 281 41.987 -5.087 47.972 1.00 0.00 H ATOM 5621 HG21 ILE B 281 40.086 -4.114 43.451 1.00 0.00 H ATOM 5622 HG22 ILE B 281 40.171 -5.195 44.864 1.00 0.00 H ATOM 5623 HG23 ILE B 281 39.617 -3.514 45.061 1.00 0.00 H ATOM 5624 H ILE B 281 44.293 -3.212 44.425 1.00 0.00 H ATOM 5625 N PHE B 282 42.766 -3.550 41.841 1.00 55.63 N ATOM 5626 CA PHE B 282 42.504 -3.414 40.412 1.00 56.81 C ATOM 5627 C PHE B 282 43.109 -4.584 39.628 1.00 56.46 C ATOM 5628 O PHE B 282 42.450 -5.180 38.778 1.00 54.89 O ATOM 5629 CB PHE B 282 43.096 -2.107 39.889 1.00 56.69 C ATOM 5630 CG PHE B 282 42.831 -1.868 38.431 1.00 58.20 C ATOM 5631 CD1 PHE B 282 41.588 -1.414 38.004 1.00 58.89 C ATOM 5632 CD2 PHE B 282 43.821 -2.106 37.482 1.00 58.94 C ATOM 5633 CE1 PHE B 282 41.331 -1.197 36.653 1.00 58.24 C ATOM 5634 CE2 PHE B 282 43.576 -1.893 36.127 1.00 58.23 C ATOM 5635 CZ PHE B 282 42.328 -1.437 35.713 1.00 59.16 C ATOM 5636 HA PHE B 282 41.423 -3.413 40.271 1.00 0.00 H ATOM 5637 HB2 PHE B 282 42.666 -1.282 40.457 1.00 0.00 H ATOM 5638 HB3 PHE B 282 44.175 -2.131 40.044 1.00 0.00 H ATOM 5639 HD2 PHE B 282 44.800 -2.463 37.803 1.00 0.00 H ATOM 5640 HE2 PHE B 282 44.359 -2.083 35.393 1.00 0.00 H ATOM 5641 HZ PHE B 282 42.132 -1.268 34.654 1.00 0.00 H ATOM 5642 HE1 PHE B 282 40.352 -0.840 36.333 1.00 0.00 H ATOM 5643 HD1 PHE B 282 40.804 -1.225 38.737 1.00 0.00 H ATOM 5644 H PHE B 282 43.265 -2.787 42.341 1.00 0.00 H ATOM 5645 N GLN B 283 44.369 -4.895 39.916 1.00 55.67 N ATOM 5646 CA GLN B 283 45.074 -5.981 39.248 1.00 54.84 C ATOM 5647 C GLN B 283 44.385 -7.301 39.553 1.00 53.48 C ATOM 5648 O GLN B 283 44.408 -8.225 38.745 1.00 52.70 O ATOM 5649 CB GLN B 283 46.523 -6.046 39.732 1.00 56.03 C ATOM 5650 CG GLN B 283 47.257 -4.714 39.674 1.00 59.33 C ATOM 5651 CD GLN B 283 48.637 -4.789 40.291 1.00 60.89 C ATOM 5652 OE1 GLN B 283 48.811 -5.336 41.384 1.00 63.45 O ATOM 5653 NE2 GLN B 283 49.627 -4.232 39.603 1.00 60.40 N ATOM 5654 HA GLN B 283 45.063 -5.799 38.173 1.00 0.00 H ATOM 5655 HB2 GLN B 283 46.524 -6.393 40.765 1.00 0.00 H ATOM 5656 HB3 GLN B 283 47.061 -6.761 39.109 1.00 0.00 H ATOM 5657 HG2 GLN B 283 47.355 -4.413 38.631 1.00 0.00 H ATOM 5658 HG3 GLN B 283 46.672 -3.968 40.212 1.00 0.00 H ATOM 5659 HE22 GLN B 283 49.434 -3.782 38.686 1.00 0.00 H ATOM 5660 HE21 GLN B 283 50.596 -4.246 39.982 1.00 0.00 H ATOM 5661 H GLN B 283 44.869 -4.344 40.643 1.00 0.00 H ATOM 5662 N GLY B 284 43.780 -7.381 40.733 1.00 51.86 N ATOM 5663 CA GLY B 284 43.090 -8.592 41.128 1.00 50.41 C ATOM 5664 C GLY B 284 41.910 -8.900 40.229 1.00 48.80 C ATOM 5665 O GLY B 284 41.763 -10.027 39.762 1.00 48.36 O ATOM 5666 HA3 GLY B 284 42.731 -8.474 42.150 1.00 0.00 H ATOM 5667 HA2 GLY B 284 43.791 -9.425 41.085 1.00 0.00 H ATOM 5668 H GLY B 284 43.802 -6.567 41.379 1.00 0.00 H ATOM 5669 N CYS B 285 41.063 -7.904 39.989 1.00 47.03 N ATOM 5670 CA CYS B 285 39.906 -8.105 39.130 1.00 47.31 C ATOM 5671 C CYS B 285 40.350 -8.395 37.701 1.00 46.04 C ATOM 5672 O CYS B 285 39.644 -9.060 36.946 1.00 43.31 O ATOM 5673 CB CYS B 285 38.983 -6.883 39.175 1.00 48.04 C ATOM 5674 SG CYS B 285 37.936 -6.822 40.659 1.00 54.77 S ATOM 5675 HA CYS B 285 39.347 -8.966 39.497 1.00 0.00 H ATOM 5676 HB2 CYS B 285 38.337 -6.905 38.297 1.00 0.00 H ATOM 5677 HB3 CYS B 285 39.599 -5.984 39.149 1.00 0.00 H ATOM 5678 HG CYS B 285 37.142 -5.694 40.614 1.00 0.00 H ATOM 5679 H CYS B 285 41.229 -6.972 40.419 1.00 0.00 H ATOM 5680 N GLN B 286 41.527 -7.894 37.338 1.00 46.19 N ATOM 5681 CA GLN B 286 42.079 -8.127 36.015 1.00 47.92 C ATOM 5682 C GLN B 286 42.465 -9.596 35.866 1.00 48.10 C ATOM 5683 O GLN B 286 42.162 -10.217 34.851 1.00 48.74 O ATOM 5684 CB GLN B 286 43.302 -7.244 35.781 1.00 49.67 C ATOM 5685 CG GLN B 286 42.967 -5.776 35.588 1.00 55.32 C ATOM 5686 CD GLN B 286 42.086 -5.543 34.377 1.00 57.52 C ATOM 5687 OE1 GLN B 286 42.500 -5.772 33.242 1.00 62.30 O ATOM 5688 NE2 GLN B 286 40.863 -5.092 34.613 1.00 59.18 N ATOM 5689 HA GLN B 286 41.321 -7.876 35.273 1.00 0.00 H ATOM 5690 HB2 GLN B 286 43.963 -7.336 36.643 1.00 0.00 H ATOM 5691 HB3 GLN B 286 43.818 -7.600 34.889 1.00 0.00 H ATOM 5692 HG2 GLN B 286 42.447 -5.415 36.475 1.00 0.00 H ATOM 5693 HG3 GLN B 286 43.895 -5.218 35.460 1.00 0.00 H ATOM 5694 HE22 GLN B 286 40.555 -4.912 35.590 1.00 0.00 H ATOM 5695 HE21 GLN B 286 40.211 -4.918 33.822 1.00 0.00 H ATOM 5696 H GLN B 286 42.066 -7.321 38.018 1.00 0.00 H ATOM 5697 N PHE B 287 43.119 -10.154 36.881 1.00 46.94 N ATOM 5698 CA PHE B 287 43.523 -11.555 36.838 1.00 46.81 C ATOM 5699 C PHE B 287 42.312 -12.464 36.717 1.00 46.21 C ATOM 5700 O PHE B 287 42.274 -13.346 35.855 1.00 44.05 O ATOM 5701 CB PHE B 287 44.317 -11.933 38.095 1.00 49.43 C ATOM 5702 CG PHE B 287 44.648 -13.406 38.189 1.00 52.42 C ATOM 5703 CD1 PHE B 287 43.696 -14.327 38.623 1.00 53.19 C ATOM 5704 CD2 PHE B 287 45.906 -13.874 37.822 1.00 53.75 C ATOM 5705 CE1 PHE B 287 43.993 -15.689 38.687 1.00 53.39 C ATOM 5706 CE2 PHE B 287 46.213 -15.233 37.885 1.00 54.48 C ATOM 5707 CZ PHE B 287 45.253 -16.142 38.318 1.00 53.36 C ATOM 5708 HA PHE B 287 44.157 -11.687 35.961 1.00 0.00 H ATOM 5709 HB2 PHE B 287 45.250 -11.370 38.094 1.00 0.00 H ATOM 5710 HB3 PHE B 287 43.728 -11.656 38.970 1.00 0.00 H ATOM 5711 HD2 PHE B 287 46.663 -13.168 37.480 1.00 0.00 H ATOM 5712 HE2 PHE B 287 47.204 -15.583 37.595 1.00 0.00 H ATOM 5713 HZ PHE B 287 45.489 -17.205 38.367 1.00 0.00 H ATOM 5714 HE1 PHE B 287 43.237 -16.397 39.026 1.00 0.00 H ATOM 5715 HD1 PHE B 287 42.706 -13.979 38.916 1.00 0.00 H ATOM 5716 H PHE B 287 43.346 -9.582 37.719 1.00 0.00 H ATOM 5717 N ARG B 288 41.324 -12.259 37.586 1.00 44.42 N ATOM 5718 CA ARG B 288 40.129 -13.087 37.546 1.00 44.44 C ATOM 5719 C ARG B 288 39.438 -12.915 36.196 1.00 42.60 C ATOM 5720 O ARG B 288 38.862 -13.864 35.663 1.00 41.28 O ATOM 5721 CB ARG B 288 39.169 -12.719 38.687 1.00 45.22 C ATOM 5722 CG ARG B 288 39.787 -12.791 40.090 1.00 52.18 C ATOM 5723 CD ARG B 288 40.498 -14.123 40.389 1.00 55.11 C ATOM 5724 NE ARG B 288 39.600 -15.279 40.396 1.00 59.40 N ATOM 5725 CZ ARG B 288 39.962 -16.513 40.743 1.00 59.27 C ATOM 5726 NH1 ARG B 288 41.208 -16.762 41.121 1.00 58.01 N ATOM 5727 NH2 ARG B 288 39.078 -17.506 40.698 1.00 60.12 N ATOM 5728 HA ARG B 288 40.419 -14.130 37.675 1.00 0.00 H ATOM 5729 HB2 ARG B 288 38.818 -11.700 38.521 1.00 0.00 H ATOM 5730 HB3 ARG B 288 38.322 -13.404 38.653 1.00 0.00 H ATOM 5731 HG2 ARG B 288 40.513 -11.984 40.188 1.00 0.00 H ATOM 5732 HG3 ARG B 288 38.992 -12.653 40.823 1.00 0.00 H ATOM 5733 HD2 ARG B 288 40.972 -14.049 41.368 1.00 0.00 H ATOM 5734 HD3 ARG B 288 41.262 -14.284 39.628 1.00 0.00 H ATOM 5735 HE ARG B 288 38.612 -15.126 40.110 1.00 0.00 H ATOM 5736 HH12 ARG B 288 41.486 -17.727 41.391 1.00 0.00 H ATOM 5737 HH11 ARG B 288 41.907 -15.992 41.147 1.00 0.00 H ATOM 5738 HH22 ARG B 288 39.363 -18.469 40.969 1.00 0.00 H ATOM 5739 HH21 ARG B 288 38.102 -17.320 40.391 1.00 0.00 H ATOM 5740 H ARG B 288 41.407 -11.504 38.296 1.00 0.00 H ATOM 5741 N SER B 289 39.521 -11.704 35.644 1.00 40.67 N ATOM 5742 CA SER B 289 38.912 -11.385 34.359 1.00 40.69 C ATOM 5743 C SER B 289 39.473 -12.221 33.229 1.00 39.68 C ATOM 5744 O SER B 289 38.723 -12.702 32.383 1.00 41.25 O ATOM 5745 CB SER B 289 39.106 -9.903 34.021 1.00 42.26 C ATOM 5746 OG SER B 289 38.162 -9.107 34.713 1.00 45.35 O ATOM 5747 HA SER B 289 37.851 -11.612 34.458 1.00 0.00 H ATOM 5748 HB2 SER B 289 38.978 -9.760 32.948 1.00 0.00 H ATOM 5749 HB3 SER B 289 40.112 -9.598 34.309 1.00 0.00 H ATOM 5750 HG SER B 289 38.278 -9.232 35.688 1.00 0.00 H ATOM 5751 H SER B 289 40.040 -10.958 36.150 1.00 0.00 H ATOM 5752 N VAL B 290 40.794 -12.371 33.198 1.00 36.95 N ATOM 5753 CA VAL B 290 41.440 -13.165 32.163 1.00 35.18 C ATOM 5754 C VAL B 290 40.994 -14.611 32.330 1.00 34.67 C ATOM 5755 O VAL B 290 40.880 -15.354 31.364 1.00 34.80 O ATOM 5756 CB VAL B 290 42.977 -13.064 32.266 1.00 34.44 C ATOM 5757 CG1 VAL B 290 43.641 -14.132 31.399 1.00 31.48 C ATOM 5758 CG2 VAL B 290 43.425 -11.680 31.808 1.00 31.75 C ATOM 5759 HA VAL B 290 41.153 -12.790 31.181 1.00 0.00 H ATOM 5760 HB VAL B 290 43.273 -13.222 33.303 1.00 0.00 H ATOM 5761 HG11 VAL B 290 43.326 -15.119 31.737 1.00 0.00 H ATOM 5762 HG12 VAL B 290 43.345 -13.990 30.360 1.00 0.00 H ATOM 5763 HG13 VAL B 290 44.724 -14.045 31.484 1.00 0.00 H ATOM 5764 HG21 VAL B 290 43.118 -11.524 30.774 1.00 0.00 H ATOM 5765 HG22 VAL B 290 42.966 -10.922 32.443 1.00 0.00 H ATOM 5766 HG23 VAL B 290 44.510 -11.608 31.881 1.00 0.00 H ATOM 5767 H VAL B 290 41.377 -11.912 33.927 1.00 0.00 H ATOM 5768 N GLU B 291 40.726 -15.006 33.565 1.00 35.13 N ATOM 5769 CA GLU B 291 40.269 -16.360 33.814 1.00 36.56 C ATOM 5770 C GLU B 291 38.877 -16.526 33.238 1.00 37.13 C ATOM 5771 O GLU B 291 38.605 -17.494 32.529 1.00 37.10 O ATOM 5772 CB GLU B 291 40.200 -16.647 35.302 1.00 38.47 C ATOM 5773 CG GLU B 291 41.512 -16.904 35.978 1.00 42.25 C ATOM 5774 CD GLU B 291 41.295 -17.400 37.389 1.00 44.32 C ATOM 5775 OE1 GLU B 291 40.897 -16.590 38.253 1.00 46.67 O ATOM 5776 OE2 GLU B 291 41.500 -18.604 37.624 1.00 46.28 O ATOM 5777 HA GLU B 291 40.973 -17.049 33.348 1.00 0.00 H ATOM 5778 HB2 GLU B 291 39.736 -15.788 35.787 1.00 0.00 H ATOM 5779 HB3 GLU B 291 39.572 -17.527 35.444 1.00 0.00 H ATOM 5780 HG2 GLU B 291 42.064 -17.656 35.415 1.00 0.00 H ATOM 5781 HG3 GLU B 291 42.087 -15.979 36.008 1.00 0.00 H ATOM 5782 H GLU B 291 40.843 -14.344 34.358 1.00 0.00 H ATOM 5783 N ALA B 292 37.997 -15.575 33.560 1.00 36.59 N ATOM 5784 CA ALA B 292 36.613 -15.606 33.091 1.00 36.55 C ATOM 5785 C ALA B 292 36.552 -15.641 31.574 1.00 35.52 C ATOM 5786 O ALA B 292 35.723 -16.341 31.001 1.00 36.03 O ATOM 5787 CB ALA B 292 35.845 -14.392 33.616 1.00 38.63 C ATOM 5788 HA ALA B 292 36.149 -16.514 33.475 1.00 0.00 H ATOM 5789 HB1 ALA B 292 35.852 -14.403 34.706 1.00 0.00 H ATOM 5790 HB2 ALA B 292 36.322 -13.479 33.258 1.00 0.00 H ATOM 5791 HB3 ALA B 292 34.817 -14.431 33.257 1.00 0.00 H ATOM 5792 H ALA B 292 38.306 -14.787 34.164 1.00 0.00 H ATOM 5793 N VAL B 293 37.431 -14.883 30.925 1.00 35.04 N ATOM 5794 CA VAL B 293 37.458 -14.858 29.468 1.00 34.95 C ATOM 5795 C VAL B 293 37.681 -16.257 28.891 1.00 33.77 C ATOM 5796 O VAL B 293 37.094 -16.604 27.871 1.00 32.96 O ATOM 5797 CB VAL B 293 38.555 -13.914 28.937 1.00 35.92 C ATOM 5798 CG1 VAL B 293 38.709 -14.086 27.419 1.00 34.36 C ATOM 5799 CG2 VAL B 293 38.189 -12.464 29.268 1.00 36.30 C ATOM 5800 HA VAL B 293 36.485 -14.488 29.145 1.00 0.00 H ATOM 5801 HB VAL B 293 39.503 -14.162 29.414 1.00 0.00 H ATOM 5802 HG11 VAL B 293 38.985 -15.117 27.198 1.00 0.00 H ATOM 5803 HG12 VAL B 293 37.764 -13.849 26.930 1.00 0.00 H ATOM 5804 HG13 VAL B 293 39.487 -13.414 27.056 1.00 0.00 H ATOM 5805 HG21 VAL B 293 37.237 -12.215 28.799 1.00 0.00 H ATOM 5806 HG22 VAL B 293 38.104 -12.350 30.349 1.00 0.00 H ATOM 5807 HG23 VAL B 293 38.966 -11.799 28.891 1.00 0.00 H ATOM 5808 H VAL B 293 38.106 -14.302 31.462 1.00 0.00 H ATOM 5809 N GLN B 294 38.520 -17.062 29.538 1.00 32.63 N ATOM 5810 CA GLN B 294 38.776 -18.411 29.042 1.00 31.70 C ATOM 5811 C GLN B 294 37.582 -19.317 29.315 1.00 31.62 C ATOM 5812 O GLN B 294 37.267 -20.200 28.525 1.00 29.76 O ATOM 5813 CB GLN B 294 40.045 -18.990 29.668 1.00 31.26 C ATOM 5814 CG GLN B 294 41.301 -18.278 29.215 1.00 30.08 C ATOM 5815 CD GLN B 294 41.274 -17.952 27.735 1.00 32.98 C ATOM 5816 OE1 GLN B 294 41.015 -18.810 26.904 1.00 35.68 O ATOM 5817 NE2 GLN B 294 41.548 -16.698 27.401 1.00 41.15 N ATOM 5818 HA GLN B 294 38.926 -18.354 27.964 1.00 0.00 H ATOM 5819 HB2 GLN B 294 39.968 -18.906 30.752 1.00 0.00 H ATOM 5820 HB3 GLN B 294 40.122 -20.041 29.391 1.00 0.00 H ATOM 5821 HG2 GLN B 294 41.400 -17.349 29.777 1.00 0.00 H ATOM 5822 HG3 GLN B 294 42.160 -18.918 29.418 1.00 0.00 H ATOM 5823 HE22 GLN B 294 41.763 -15.998 28.140 1.00 0.00 H ATOM 5824 HE21 GLN B 294 41.548 -16.414 26.400 1.00 0.00 H ATOM 5825 H GLN B 294 38.995 -16.729 30.401 1.00 0.00 H ATOM 5826 N GLU B 295 36.905 -19.080 30.432 1.00 31.92 N ATOM 5827 CA GLU B 295 35.733 -19.863 30.769 1.00 31.44 C ATOM 5828 C GLU B 295 34.615 -19.546 29.777 1.00 31.78 C ATOM 5829 O GLU B 295 33.904 -20.442 29.320 1.00 31.35 O ATOM 5830 CB GLU B 295 35.297 -19.540 32.192 1.00 33.27 C ATOM 5831 CG GLU B 295 36.207 -20.153 33.238 1.00 36.99 C ATOM 5832 CD GLU B 295 36.040 -19.534 34.612 1.00 38.15 C ATOM 5833 OE1 GLU B 295 34.909 -19.140 34.963 1.00 38.64 O ATOM 5834 OE2 GLU B 295 37.042 -19.453 35.349 1.00 38.99 O ATOM 5835 HA GLU B 295 35.965 -20.926 30.711 1.00 0.00 H ATOM 5836 HB2 GLU B 295 35.298 -18.458 32.320 1.00 0.00 H ATOM 5837 HB3 GLU B 295 34.287 -19.921 32.342 1.00 0.00 H ATOM 5838 HG2 GLU B 295 35.986 -21.218 33.308 1.00 0.00 H ATOM 5839 HG3 GLU B 295 37.241 -20.018 32.920 1.00 0.00 H ATOM 5840 H GLU B 295 37.219 -18.324 31.073 1.00 0.00 H ATOM 5841 N ILE B 296 34.470 -18.268 29.435 1.00 31.00 N ATOM 5842 CA ILE B 296 33.434 -17.844 28.502 1.00 29.42 C ATOM 5843 C ILE B 296 33.740 -18.357 27.097 1.00 29.48 C ATOM 5844 O ILE B 296 32.850 -18.809 26.379 1.00 26.86 O ATOM 5845 CB ILE B 296 33.322 -16.310 28.491 1.00 30.09 C ATOM 5846 CG1 ILE B 296 32.715 -15.845 29.816 1.00 29.39 C ATOM 5847 CG2 ILE B 296 32.474 -15.837 27.294 1.00 29.05 C ATOM 5848 CD1 ILE B 296 32.872 -14.357 30.059 1.00 32.46 C ATOM 5849 HA ILE B 296 32.483 -18.264 28.828 1.00 0.00 H ATOM 5850 HB ILE B 296 34.314 -15.871 28.381 1.00 0.00 H ATOM 5851 HG12 ILE B 296 31.652 -16.085 29.813 1.00 0.00 H ATOM 5852 HG13 ILE B 296 33.205 -16.382 30.628 1.00 0.00 H ATOM 5853 HD11 ILE B 296 33.932 -14.103 30.076 1.00 0.00 H ATOM 5854 HD12 ILE B 296 32.377 -13.805 29.259 1.00 0.00 H ATOM 5855 HD13 ILE B 296 32.419 -14.097 31.016 1.00 0.00 H ATOM 5856 HG21 ILE B 296 32.943 -16.164 26.366 1.00 0.00 H ATOM 5857 HG22 ILE B 296 31.474 -16.264 27.367 1.00 0.00 H ATOM 5858 HG23 ILE B 296 32.407 -14.749 27.305 1.00 0.00 H ATOM 5859 H ILE B 296 35.110 -17.557 29.842 1.00 0.00 H ATOM 5860 N THR B 297 35.006 -18.278 26.709 1.00 29.12 N ATOM 5861 CA THR B 297 35.429 -18.750 25.403 1.00 30.15 C ATOM 5862 C THR B 297 35.058 -20.231 25.235 1.00 32.60 C ATOM 5863 O THR B 297 34.572 -20.644 24.181 1.00 33.17 O ATOM 5864 CB THR B 297 36.939 -18.589 25.245 1.00 30.09 C ATOM 5865 OG1 THR B 297 37.274 -17.188 25.288 1.00 33.12 O ATOM 5866 CG2 THR B 297 37.410 -19.200 23.938 1.00 27.67 C ATOM 5867 HA THR B 297 34.923 -18.158 24.641 1.00 0.00 H ATOM 5868 HB THR B 297 37.440 -19.110 26.061 1.00 0.00 H ATOM 5869 HG1 THR B 297 36.988 -16.808 26.156 1.00 0.00 H ATOM 5870 HG23 THR B 297 37.150 -20.258 23.919 1.00 0.00 H ATOM 5871 HG21 THR B 297 36.926 -18.691 23.105 1.00 0.00 H ATOM 5872 HG22 THR B 297 38.491 -19.088 23.855 1.00 0.00 H ATOM 5873 H THR B 297 35.711 -17.869 27.355 1.00 0.00 H ATOM 5874 N GLU B 298 35.284 -21.017 26.284 1.00 31.99 N ATOM 5875 CA GLU B 298 34.978 -22.436 26.263 1.00 35.84 C ATOM 5876 C GLU B 298 33.478 -22.631 26.143 1.00 35.60 C ATOM 5877 O GLU B 298 33.009 -23.496 25.407 1.00 35.90 O ATOM 5878 CB GLU B 298 35.469 -23.116 27.548 1.00 38.57 C ATOM 5879 CG GLU B 298 35.208 -24.615 27.561 1.00 46.12 C ATOM 5880 CD GLU B 298 35.278 -25.206 28.953 1.00 49.71 C ATOM 5881 OE1 GLU B 298 34.513 -24.750 29.825 1.00 53.39 O ATOM 5882 OE2 GLU B 298 36.088 -26.126 29.180 1.00 53.98 O ATOM 5883 HA GLU B 298 35.484 -22.885 25.408 1.00 0.00 H ATOM 5884 HB2 GLU B 298 36.542 -22.949 27.642 1.00 0.00 H ATOM 5885 HB3 GLU B 298 34.956 -22.666 28.398 1.00 0.00 H ATOM 5886 HG2 GLU B 298 34.215 -24.800 27.152 1.00 0.00 H ATOM 5887 HG3 GLU B 298 35.954 -25.105 26.935 1.00 0.00 H ATOM 5888 H GLU B 298 35.693 -20.602 27.146 1.00 0.00 H ATOM 5889 N TYR B 299 32.725 -21.835 26.892 1.00 34.62 N ATOM 5890 CA TYR B 299 31.278 -21.912 26.850 1.00 33.23 C ATOM 5891 C TYR B 299 30.770 -21.594 25.441 1.00 33.44 C ATOM 5892 O TYR B 299 29.857 -22.257 24.933 1.00 33.95 O ATOM 5893 CB TYR B 299 30.666 -20.926 27.837 1.00 31.98 C ATOM 5894 CG TYR B 299 29.159 -20.943 27.807 1.00 32.62 C ATOM 5895 CD1 TYR B 299 28.453 -22.070 28.227 1.00 30.27 C ATOM 5896 CD2 TYR B 299 28.438 -19.858 27.308 1.00 32.23 C ATOM 5897 CE1 TYR B 299 27.074 -22.126 28.149 1.00 30.03 C ATOM 5898 CE2 TYR B 299 27.047 -19.902 27.222 1.00 32.49 C ATOM 5899 CZ TYR B 299 26.373 -21.044 27.642 1.00 33.03 C ATOM 5900 OH TYR B 299 25.006 -21.129 27.517 1.00 32.62 O ATOM 5901 HA TYR B 299 30.983 -22.925 27.122 1.00 0.00 H ATOM 5902 HB3 TYR B 299 31.010 -19.922 27.588 1.00 0.00 H ATOM 5903 HB2 TYR B 299 30.999 -21.184 28.842 1.00 0.00 H ATOM 5904 HD2 TYR B 299 28.969 -18.964 26.981 1.00 0.00 H ATOM 5905 HE2 TYR B 299 26.493 -19.049 26.829 1.00 0.00 H ATOM 5906 HE1 TYR B 299 26.541 -23.016 28.484 1.00 0.00 H ATOM 5907 HD1 TYR B 299 29.000 -22.925 28.625 1.00 0.00 H ATOM 5908 HH TYR B 299 24.582 -20.400 28.035 1.00 0.00 H ATOM 5909 H TYR B 299 33.181 -21.143 27.520 1.00 0.00 H ATOM 5910 N ALA B 300 31.369 -20.583 24.815 1.00 30.65 N ATOM 5911 CA ALA B 300 30.985 -20.160 23.471 1.00 31.26 C ATOM 5912 C ALA B 300 31.047 -21.292 22.461 1.00 32.91 C ATOM 5913 O ALA B 300 30.124 -21.497 21.677 1.00 32.25 O ATOM 5914 CB ALA B 300 31.881 -19.018 23.010 1.00 30.14 C ATOM 5915 HA ALA B 300 29.948 -19.828 23.526 1.00 0.00 H ATOM 5916 HB1 ALA B 300 31.777 -18.177 23.695 1.00 0.00 H ATOM 5917 HB2 ALA B 300 32.918 -19.353 22.999 1.00 0.00 H ATOM 5918 HB3 ALA B 300 31.587 -18.709 22.007 1.00 0.00 H ATOM 5919 H ALA B 300 32.137 -20.077 25.300 1.00 0.00 H ATOM 5920 N LYS B 301 32.152 -22.025 22.486 1.00 36.34 N ATOM 5921 CA LYS B 301 32.359 -23.133 21.572 1.00 38.55 C ATOM 5922 C LYS B 301 31.335 -24.257 21.731 1.00 38.36 C ATOM 5923 O LYS B 301 31.272 -25.156 20.901 1.00 39.53 O ATOM 5924 CB LYS B 301 33.786 -23.669 21.732 1.00 41.09 C ATOM 5925 CG LYS B 301 34.853 -22.637 21.352 1.00 42.45 C ATOM 5926 CD LYS B 301 36.257 -23.229 21.396 1.00 45.42 C ATOM 5927 CE LYS B 301 37.295 -22.214 20.935 1.00 45.86 C ATOM 5928 NZ LYS B 301 38.639 -22.835 20.805 1.00 48.78 N ATOM 5929 HA LYS B 301 32.216 -22.746 20.563 1.00 0.00 H ATOM 5930 HB2 LYS B 301 33.935 -23.958 22.772 1.00 0.00 H ATOM 5931 HB3 LYS B 301 33.904 -24.544 21.093 1.00 0.00 H ATOM 5932 HG2 LYS B 301 34.653 -22.278 20.342 1.00 0.00 H ATOM 5933 HG3 LYS B 301 34.800 -21.802 22.050 1.00 0.00 H ATOM 5934 HD2 LYS B 301 36.484 -23.532 22.418 1.00 0.00 H ATOM 5935 HD3 LYS B 301 36.297 -24.101 20.743 1.00 0.00 H ATOM 5936 HE2 LYS B 301 37.347 -21.404 21.662 1.00 0.00 H ATOM 5937 HE3 LYS B 301 36.994 -21.813 19.967 1.00 0.00 H ATOM 5938 HZ1 LYS B 301 38.935 -23.215 21.727 1.00 0.00 H ATOM 5939 HZ2 LYS B 301 38.597 -23.606 20.108 1.00 0.00 H ATOM 5940 HZ3 LYS B 301 39.322 -22.117 20.490 1.00 0.00 H ATOM 5941 H LYS B 301 32.892 -21.799 23.181 1.00 0.00 H ATOM 5942 N SER B 302 30.523 -24.201 22.782 1.00 38.07 N ATOM 5943 CA SER B 302 29.500 -25.227 22.984 1.00 37.76 C ATOM 5944 C SER B 302 28.152 -24.789 22.402 1.00 38.02 C ATOM 5945 O SER B 302 27.230 -25.597 22.287 1.00 39.22 O ATOM 5946 CB SER B 302 29.309 -25.522 24.463 1.00 37.95 C ATOM 5947 OG SER B 302 28.209 -24.783 24.956 1.00 42.21 O ATOM 5948 HA SER B 302 29.846 -26.124 22.470 1.00 0.00 H ATOM 5949 HB2 SER B 302 30.210 -25.240 25.009 1.00 0.00 H ATOM 5950 HB3 SER B 302 29.121 -26.587 24.599 1.00 0.00 H ATOM 5951 HG SER B 302 28.087 -24.977 25.919 1.00 0.00 H ATOM 5952 H SER B 302 30.616 -23.422 23.465 1.00 0.00 H ATOM 5953 N ILE B 303 28.026 -23.511 22.048 1.00 35.81 N ATOM 5954 CA ILE B 303 26.778 -23.015 21.466 1.00 33.72 C ATOM 5955 C ILE B 303 26.700 -23.582 20.057 1.00 32.10 C ATOM 5956 O ILE B 303 27.573 -23.326 19.232 1.00 31.74 O ATOM 5957 CB ILE B 303 26.757 -21.462 21.399 1.00 34.12 C ATOM 5958 CG1 ILE B 303 26.822 -20.888 22.812 1.00 31.90 C ATOM 5959 CG2 ILE B 303 25.490 -20.970 20.683 1.00 27.89 C ATOM 5960 CD1 ILE B 303 27.080 -19.398 22.857 1.00 33.65 C ATOM 5961 HA ILE B 303 25.932 -23.323 22.080 1.00 0.00 H ATOM 5962 HB ILE B 303 27.623 -21.121 20.832 1.00 0.00 H ATOM 5963 HG12 ILE B 303 25.872 -21.087 23.308 1.00 0.00 H ATOM 5964 HG13 ILE B 303 27.624 -21.392 23.351 1.00 0.00 H ATOM 5965 HD11 ILE B 303 28.034 -19.181 22.376 1.00 0.00 H ATOM 5966 HD12 ILE B 303 26.280 -18.876 22.332 1.00 0.00 H ATOM 5967 HD13 ILE B 303 27.112 -19.067 23.895 1.00 0.00 H ATOM 5968 HG21 ILE B 303 25.469 -21.369 19.669 1.00 0.00 H ATOM 5969 HG22 ILE B 303 24.610 -21.313 21.227 1.00 0.00 H ATOM 5970 HG23 ILE B 303 25.495 -19.881 20.647 1.00 0.00 H ATOM 5971 H ILE B 303 28.824 -22.858 22.187 1.00 0.00 H ATOM 5972 N PRO B 304 25.655 -24.367 19.760 1.00 32.85 N ATOM 5973 CA PRO B 304 25.527 -24.952 18.421 1.00 32.05 C ATOM 5974 C PRO B 304 25.692 -23.948 17.292 1.00 31.69 C ATOM 5975 O PRO B 304 25.002 -22.928 17.258 1.00 34.86 O ATOM 5976 CB PRO B 304 24.139 -25.586 18.453 1.00 30.93 C ATOM 5977 CG PRO B 304 24.026 -26.039 19.887 1.00 32.08 C ATOM 5978 CD PRO B 304 24.558 -24.821 20.636 1.00 34.09 C ATOM 5979 HA PRO B 304 26.321 -25.668 18.209 1.00 0.00 H ATOM 5980 HD3 PRO B 304 23.791 -24.054 20.738 1.00 0.00 H ATOM 5981 HD2 PRO B 304 24.929 -25.096 21.624 1.00 0.00 H ATOM 5982 HG3 PRO B 304 24.638 -26.921 20.075 1.00 0.00 H ATOM 5983 HG2 PRO B 304 22.992 -26.252 20.157 1.00 0.00 H ATOM 5984 HB2 PRO B 304 23.366 -24.858 18.207 1.00 0.00 H ATOM 5985 HB3 PRO B 304 24.074 -26.430 17.766 1.00 0.00 H ATOM 5986 N GLY B 305 26.624 -24.246 16.386 1.00 31.45 N ATOM 5987 CA GLY B 305 26.880 -23.390 15.242 1.00 29.60 C ATOM 5988 C GLY B 305 28.041 -22.427 15.412 1.00 31.75 C ATOM 5989 O GLY B 305 28.658 -22.010 14.425 1.00 32.09 O ATOM 5990 HA3 GLY B 305 25.981 -22.806 15.048 1.00 0.00 H ATOM 5991 HA2 GLY B 305 27.091 -24.027 14.383 1.00 0.00 H ATOM 5992 H GLY B 305 27.183 -25.115 16.502 1.00 0.00 H ATOM 5993 N PHE B 306 28.354 -22.071 16.656 1.00 30.16 N ATOM 5994 CA PHE B 306 29.434 -21.126 16.901 1.00 28.93 C ATOM 5995 C PHE B 306 30.752 -21.489 16.241 1.00 29.28 C ATOM 5996 O PHE B 306 31.328 -20.676 15.514 1.00 31.30 O ATOM 5997 CB PHE B 306 29.670 -20.942 18.403 1.00 29.87 C ATOM 5998 CG PHE B 306 30.661 -19.851 18.719 1.00 31.41 C ATOM 5999 CD1 PHE B 306 30.283 -18.513 18.651 1.00 29.17 C ATOM 6000 CD2 PHE B 306 31.985 -20.161 19.024 1.00 28.63 C ATOM 6001 CE1 PHE B 306 31.212 -17.498 18.878 1.00 28.29 C ATOM 6002 CE2 PHE B 306 32.923 -19.155 19.254 1.00 31.23 C ATOM 6003 CZ PHE B 306 32.531 -17.816 19.179 1.00 31.97 C ATOM 6004 HA PHE B 306 29.095 -20.196 16.444 1.00 0.00 H ATOM 6005 HB2 PHE B 306 28.719 -20.695 18.876 1.00 0.00 H ATOM 6006 HB3 PHE B 306 30.045 -21.880 18.813 1.00 0.00 H ATOM 6007 HD2 PHE B 306 32.292 -21.205 19.084 1.00 0.00 H ATOM 6008 HE2 PHE B 306 33.956 -19.412 19.491 1.00 0.00 H ATOM 6009 HZ PHE B 306 33.258 -17.023 19.356 1.00 0.00 H ATOM 6010 HE1 PHE B 306 30.903 -16.454 18.819 1.00 0.00 H ATOM 6011 HD1 PHE B 306 29.250 -18.256 18.418 1.00 0.00 H ATOM 6012 H PHE B 306 27.824 -22.470 17.457 1.00 0.00 H ATOM 6013 N VAL B 307 31.245 -22.699 16.485 1.00 28.97 N ATOM 6014 CA VAL B 307 32.527 -23.101 15.904 1.00 30.34 C ATOM 6015 C VAL B 307 32.524 -23.176 14.385 1.00 30.62 C ATOM 6016 O VAL B 307 33.580 -23.182 13.754 1.00 29.47 O ATOM 6017 CB VAL B 307 33.012 -24.460 16.478 1.00 31.98 C ATOM 6018 CG1 VAL B 307 33.474 -24.277 17.927 1.00 29.82 C ATOM 6019 CG2 VAL B 307 31.894 -25.483 16.423 1.00 32.65 C ATOM 6020 HA VAL B 307 33.218 -22.307 16.188 1.00 0.00 H ATOM 6021 HB VAL B 307 33.847 -24.817 15.875 1.00 0.00 H ATOM 6022 HG11 VAL B 307 34.294 -23.559 17.958 1.00 0.00 H ATOM 6023 HG12 VAL B 307 32.643 -23.907 18.528 1.00 0.00 H ATOM 6024 HG13 VAL B 307 33.813 -25.235 18.323 1.00 0.00 H ATOM 6025 HG21 VAL B 307 31.049 -25.128 17.013 1.00 0.00 H ATOM 6026 HG22 VAL B 307 31.583 -25.624 15.388 1.00 0.00 H ATOM 6027 HG23 VAL B 307 32.250 -26.430 16.829 1.00 0.00 H ATOM 6028 H VAL B 307 30.719 -23.361 17.090 1.00 0.00 H ATOM 6029 N ASN B 308 31.335 -23.205 13.798 1.00 32.56 N ATOM 6030 CA ASN B 308 31.193 -23.288 12.354 1.00 34.51 C ATOM 6031 C ASN B 308 31.192 -21.930 11.678 1.00 35.24 C ATOM 6032 O ASN B 308 31.106 -21.828 10.453 1.00 36.52 O ATOM 6033 CB ASN B 308 29.916 -24.053 12.020 1.00 37.67 C ATOM 6034 CG ASN B 308 30.069 -25.545 12.249 1.00 40.58 C ATOM 6035 OD1 ASN B 308 29.139 -26.219 12.690 1.00 43.17 O ATOM 6036 ND2 ASN B 308 31.254 -26.070 11.939 1.00 40.58 N ATOM 6037 HA ASN B 308 32.063 -23.818 11.967 1.00 0.00 H ATOM 6038 HB2 ASN B 308 29.108 -23.681 12.650 1.00 0.00 H ATOM 6039 HB3 ASN B 308 29.667 -23.881 10.973 1.00 0.00 H ATOM 6040 HD22 ASN B 308 32.012 -25.461 11.569 1.00 0.00 H ATOM 6041 HD21 ASN B 308 31.421 -27.088 12.067 1.00 0.00 H ATOM 6042 H ASN B 308 30.479 -23.167 14.388 1.00 0.00 H ATOM 6043 N LEU B 309 31.271 -20.876 12.477 1.00 34.92 N ATOM 6044 CA LEU B 309 31.302 -19.537 11.920 1.00 32.81 C ATOM 6045 C LEU B 309 32.730 -19.221 11.499 1.00 31.69 C ATOM 6046 O LEU B 309 33.685 -19.827 11.997 1.00 30.33 O ATOM 6047 CB LEU B 309 30.846 -18.519 12.967 1.00 33.76 C ATOM 6048 CG LEU B 309 29.417 -18.651 13.498 1.00 34.01 C ATOM 6049 CD1 LEU B 309 29.251 -17.770 14.745 1.00 34.26 C ATOM 6050 CD2 LEU B 309 28.420 -18.261 12.397 1.00 32.69 C ATOM 6051 HA LEU B 309 30.632 -19.483 11.062 1.00 0.00 H ATOM 6052 HB2 LEU B 309 31.521 -18.600 13.819 1.00 0.00 H ATOM 6053 HB3 LEU B 309 30.941 -17.528 12.523 1.00 0.00 H ATOM 6054 HG LEU B 309 29.217 -19.684 13.783 1.00 0.00 H ATOM 6055 HD21 LEU B 309 28.601 -17.230 12.094 1.00 0.00 H ATOM 6056 HD22 LEU B 309 28.551 -18.921 11.540 1.00 0.00 H ATOM 6057 HD23 LEU B 309 27.403 -18.356 12.779 1.00 0.00 H ATOM 6058 HD11 LEU B 309 29.956 -18.092 15.512 1.00 0.00 H ATOM 6059 HD12 LEU B 309 29.447 -16.730 14.483 1.00 0.00 H ATOM 6060 HD13 LEU B 309 28.233 -17.865 15.122 1.00 0.00 H ATOM 6061 H LEU B 309 31.311 -21.009 13.508 1.00 0.00 H ATOM 6062 N ASP B 310 32.858 -18.290 10.564 1.00 30.17 N ATOM 6063 CA ASP B 310 34.147 -17.808 10.077 1.00 30.90 C ATOM 6064 C ASP B 310 34.989 -17.573 11.347 1.00 30.72 C ATOM 6065 O ASP B 310 34.492 -17.005 12.324 1.00 28.56 O ATOM 6066 CB ASP B 310 33.881 -16.501 9.308 1.00 34.32 C ATOM 6067 CG ASP B 310 35.139 -15.790 8.858 1.00 35.38 C ATOM 6068 OD1 ASP B 310 35.326 -15.666 7.633 1.00 37.55 O ATOM 6069 OD2 ASP B 310 35.921 -15.331 9.716 1.00 37.28 O ATOM 6070 HA ASP B 310 34.667 -18.492 9.406 1.00 0.00 H ATOM 6071 HB2 ASP B 310 33.285 -16.736 8.426 1.00 0.00 H ATOM 6072 HB3 ASP B 310 33.319 -15.829 9.956 1.00 0.00 H ATOM 6073 H ASP B 310 31.994 -17.881 10.155 1.00 0.00 H ATOM 6074 N LEU B 311 36.238 -18.033 11.353 1.00 30.30 N ATOM 6075 CA LEU B 311 37.111 -17.878 12.526 1.00 32.04 C ATOM 6076 C LEU B 311 37.280 -16.424 12.984 1.00 30.77 C ATOM 6077 O LEU B 311 37.334 -16.153 14.184 1.00 27.23 O ATOM 6078 CB LEU B 311 38.494 -18.485 12.245 1.00 34.73 C ATOM 6079 CG LEU B 311 38.686 -20.005 12.393 1.00 40.24 C ATOM 6080 CD1 LEU B 311 37.476 -20.766 11.875 1.00 40.17 C ATOM 6081 CD2 LEU B 311 39.950 -20.423 11.632 1.00 42.74 C ATOM 6082 HA LEU B 311 36.615 -18.410 13.338 1.00 0.00 H ATOM 6083 HB2 LEU B 311 38.753 -18.229 11.218 1.00 0.00 H ATOM 6084 HB3 LEU B 311 39.198 -18.006 12.926 1.00 0.00 H ATOM 6085 HG LEU B 311 38.795 -20.248 13.450 1.00 0.00 H ATOM 6086 HD21 LEU B 311 39.840 -20.166 10.578 1.00 0.00 H ATOM 6087 HD22 LEU B 311 40.812 -19.900 12.047 1.00 0.00 H ATOM 6088 HD23 LEU B 311 40.093 -21.499 11.732 1.00 0.00 H ATOM 6089 HD11 LEU B 311 36.593 -20.470 12.441 1.00 0.00 H ATOM 6090 HD12 LEU B 311 37.327 -20.535 10.820 1.00 0.00 H ATOM 6091 HD13 LEU B 311 37.643 -21.836 11.994 1.00 0.00 H ATOM 6092 H LEU B 311 36.605 -18.514 10.507 1.00 0.00 H ATOM 6093 N ASN B 312 37.377 -15.497 12.033 1.00 28.78 N ATOM 6094 CA ASN B 312 37.529 -14.078 12.377 1.00 30.09 C ATOM 6095 C ASN B 312 36.291 -13.595 13.131 1.00 28.83 C ATOM 6096 O ASN B 312 36.392 -12.809 14.078 1.00 24.24 O ATOM 6097 CB ASN B 312 37.710 -13.231 11.116 1.00 31.45 C ATOM 6098 CG ASN B 312 39.016 -13.521 10.403 1.00 35.00 C ATOM 6099 OD1 ASN B 312 40.090 -13.257 10.926 1.00 38.63 O ATOM 6100 ND2 ASN B 312 38.926 -14.067 9.200 1.00 39.52 N ATOM 6101 HA ASN B 312 38.413 -13.970 13.005 1.00 0.00 H ATOM 6102 HB2 ASN B 312 36.886 -13.439 10.434 1.00 0.00 H ATOM 6103 HB3 ASN B 312 37.691 -12.178 11.396 1.00 0.00 H ATOM 6104 HD22 ASN B 312 37.992 -14.275 8.792 1.00 0.00 H ATOM 6105 HD21 ASN B 312 39.789 -14.287 8.663 1.00 0.00 H ATOM 6106 H ASN B 312 37.345 -15.782 11.033 1.00 0.00 H ATOM 6107 N ASP B 313 35.123 -14.078 12.709 1.00 27.04 N ATOM 6108 CA ASP B 313 33.883 -13.691 13.354 1.00 27.98 C ATOM 6109 C ASP B 313 33.762 -14.283 14.751 1.00 27.13 C ATOM 6110 O ASP B 313 33.173 -13.673 15.633 1.00 29.01 O ATOM 6111 CB ASP B 313 32.687 -14.079 12.489 1.00 25.71 C ATOM 6112 CG ASP B 313 32.507 -13.148 11.308 1.00 26.74 C ATOM 6113 OD1 ASP B 313 33.249 -12.143 11.217 1.00 26.89 O ATOM 6114 OD2 ASP B 313 31.617 -13.401 10.471 1.00 28.92 O ATOM 6115 HA ASP B 313 33.893 -12.607 13.466 1.00 0.00 H ATOM 6116 HB2 ASP B 313 32.837 -15.093 12.117 1.00 0.00 H ATOM 6117 HB3 ASP B 313 31.786 -14.047 13.101 1.00 0.00 H ATOM 6118 H ASP B 313 35.100 -14.740 11.908 1.00 0.00 H ATOM 6119 N GLN B 314 34.325 -15.463 14.965 1.00 27.88 N ATOM 6120 CA GLN B 314 34.288 -16.068 16.298 1.00 28.89 C ATOM 6121 C GLN B 314 35.106 -15.188 17.252 1.00 27.34 C ATOM 6122 O GLN B 314 34.694 -14.902 18.380 1.00 26.84 O ATOM 6123 CB GLN B 314 34.905 -17.477 16.278 1.00 28.27 C ATOM 6124 CG GLN B 314 34.096 -18.515 15.522 1.00 30.03 C ATOM 6125 CD GLN B 314 34.718 -19.910 15.603 1.00 30.28 C ATOM 6126 OE1 GLN B 314 35.117 -20.358 16.682 1.00 30.57 O ATOM 6127 NE2 GLN B 314 34.793 -20.600 14.463 1.00 24.83 N ATOM 6128 HA GLN B 314 33.251 -16.145 16.624 1.00 0.00 H ATOM 6129 HB2 GLN B 314 35.889 -17.410 15.814 1.00 0.00 H ATOM 6130 HB3 GLN B 314 35.013 -17.815 17.309 1.00 0.00 H ATOM 6131 HG2 GLN B 314 33.092 -18.554 15.945 1.00 0.00 H ATOM 6132 HG3 GLN B 314 34.036 -18.218 14.475 1.00 0.00 H ATOM 6133 HE22 GLN B 314 34.444 -20.181 13.578 1.00 0.00 H ATOM 6134 HE21 GLN B 314 35.201 -21.557 14.460 1.00 0.00 H ATOM 6135 H GLN B 314 34.795 -15.962 14.183 1.00 0.00 H ATOM 6136 N VAL B 315 36.278 -14.778 16.788 1.00 27.16 N ATOM 6137 CA VAL B 315 37.167 -13.946 17.585 1.00 29.67 C ATOM 6138 C VAL B 315 36.537 -12.574 17.828 1.00 30.09 C ATOM 6139 O VAL B 315 36.639 -12.019 18.922 1.00 30.35 O ATOM 6140 CB VAL B 315 38.534 -13.782 16.878 1.00 30.95 C ATOM 6141 CG1 VAL B 315 39.388 -12.717 17.590 1.00 27.59 C ATOM 6142 CG2 VAL B 315 39.258 -15.134 16.861 1.00 30.27 C ATOM 6143 HA VAL B 315 37.326 -14.436 18.546 1.00 0.00 H ATOM 6144 HB VAL B 315 38.372 -13.448 15.853 1.00 0.00 H ATOM 6145 HG11 VAL B 315 38.864 -11.761 17.572 1.00 0.00 H ATOM 6146 HG12 VAL B 315 39.558 -13.021 18.623 1.00 0.00 H ATOM 6147 HG13 VAL B 315 40.345 -12.618 17.077 1.00 0.00 H ATOM 6148 HG21 VAL B 315 39.413 -15.474 17.885 1.00 0.00 H ATOM 6149 HG22 VAL B 315 38.652 -15.863 16.323 1.00 0.00 H ATOM 6150 HG23 VAL B 315 40.222 -15.023 16.364 1.00 0.00 H ATOM 6151 H VAL B 315 36.570 -15.058 15.830 1.00 0.00 H ATOM 6152 N THR B 316 35.874 -12.043 16.807 1.00 29.04 N ATOM 6153 CA THR B 316 35.216 -10.750 16.917 1.00 28.20 C ATOM 6154 C THR B 316 34.059 -10.821 17.917 1.00 29.48 C ATOM 6155 O THR B 316 33.914 -9.934 18.768 1.00 29.59 O ATOM 6156 CB THR B 316 34.691 -10.271 15.534 1.00 29.03 C ATOM 6157 OG1 THR B 316 35.806 -9.963 14.675 1.00 27.60 O ATOM 6158 CG2 THR B 316 33.816 -9.029 15.686 1.00 26.41 C ATOM 6159 HA THR B 316 35.952 -10.030 17.275 1.00 0.00 H ATOM 6160 HB THR B 316 34.092 -11.070 15.097 1.00 0.00 H ATOM 6161 HG1 THR B 316 36.362 -10.773 14.554 1.00 0.00 H ATOM 6162 HG23 THR B 316 32.971 -9.259 16.335 1.00 0.00 H ATOM 6163 HG21 THR B 316 34.404 -8.223 16.124 1.00 0.00 H ATOM 6164 HG22 THR B 316 33.450 -8.722 14.706 1.00 0.00 H ATOM 6165 H THR B 316 35.824 -12.564 15.908 1.00 0.00 H ATOM 6166 N LEU B 317 33.245 -11.875 17.832 1.00 27.09 N ATOM 6167 CA LEU B 317 32.103 -12.013 18.738 1.00 27.56 C ATOM 6168 C LEU B 317 32.536 -12.173 20.190 1.00 27.07 C ATOM 6169 O LEU B 317 31.852 -11.717 21.098 1.00 27.28 O ATOM 6170 CB LEU B 317 31.218 -13.202 18.344 1.00 25.20 C ATOM 6171 CG LEU B 317 30.490 -13.179 16.996 1.00 26.52 C ATOM 6172 CD1 LEU B 317 29.746 -14.515 16.788 1.00 19.24 C ATOM 6173 CD2 LEU B 317 29.509 -12.010 16.970 1.00 23.30 C ATOM 6174 HA LEU B 317 31.531 -11.090 18.647 1.00 0.00 H ATOM 6175 HB2 LEU B 317 31.854 -14.087 18.348 1.00 0.00 H ATOM 6176 HB3 LEU B 317 30.455 -13.301 19.116 1.00 0.00 H ATOM 6177 HG LEU B 317 31.211 -13.052 16.188 1.00 0.00 H ATOM 6178 HD21 LEU B 317 28.783 -12.128 17.775 1.00 0.00 H ATOM 6179 HD22 LEU B 317 30.055 -11.076 17.106 1.00 0.00 H ATOM 6180 HD23 LEU B 317 28.991 -11.993 16.011 1.00 0.00 H ATOM 6181 HD11 LEU B 317 30.464 -15.335 16.799 1.00 0.00 H ATOM 6182 HD12 LEU B 317 29.021 -14.654 17.590 1.00 0.00 H ATOM 6183 HD13 LEU B 317 29.229 -14.496 15.829 1.00 0.00 H ATOM 6184 H LEU B 317 33.424 -12.606 17.114 1.00 0.00 H ATOM 6185 N LEU B 318 33.669 -12.830 20.412 1.00 28.22 N ATOM 6186 CA LEU B 318 34.165 -13.022 21.767 1.00 27.54 C ATOM 6187 C LEU B 318 34.788 -11.716 22.247 1.00 26.19 C ATOM 6188 O LEU B 318 34.527 -11.266 23.353 1.00 25.63 O ATOM 6189 CB LEU B 318 35.196 -14.163 21.793 1.00 26.04 C ATOM 6190 CG LEU B 318 34.856 -15.485 22.511 1.00 29.36 C ATOM 6191 CD1 LEU B 318 33.390 -15.646 22.693 1.00 25.59 C ATOM 6192 CD2 LEU B 318 35.423 -16.666 21.726 1.00 25.73 C ATOM 6193 HA LEU B 318 33.346 -13.296 22.432 1.00 0.00 H ATOM 6194 HB2 LEU B 318 35.416 -14.414 20.755 1.00 0.00 H ATOM 6195 HB3 LEU B 318 36.094 -13.767 22.268 1.00 0.00 H ATOM 6196 HG LEU B 318 35.312 -15.457 23.501 1.00 0.00 H ATOM 6197 HD21 LEU B 318 34.989 -16.678 20.726 1.00 0.00 H ATOM 6198 HD22 LEU B 318 36.506 -16.565 21.652 1.00 0.00 H ATOM 6199 HD23 LEU B 318 35.177 -17.595 22.241 1.00 0.00 H ATOM 6200 HD11 LEU B 318 33.007 -14.820 23.292 1.00 0.00 H ATOM 6201 HD12 LEU B 318 32.902 -15.647 21.718 1.00 0.00 H ATOM 6202 HD13 LEU B 318 33.190 -16.589 23.202 1.00 0.00 H ATOM 6203 H LEU B 318 34.208 -13.212 19.608 1.00 0.00 H ATOM 6204 N LYS B 319 35.609 -11.102 21.408 1.00 28.98 N ATOM 6205 CA LYS B 319 36.258 -9.853 21.780 1.00 33.22 C ATOM 6206 C LYS B 319 35.283 -8.796 22.308 1.00 34.54 C ATOM 6207 O LYS B 319 35.552 -8.167 23.328 1.00 32.85 O ATOM 6208 CB LYS B 319 37.022 -9.270 20.594 1.00 36.80 C ATOM 6209 CG LYS B 319 37.714 -7.949 20.921 1.00 42.31 C ATOM 6210 CD LYS B 319 38.513 -7.417 19.740 1.00 45.75 C ATOM 6211 CE LYS B 319 39.248 -6.138 20.117 1.00 50.25 C ATOM 6212 NZ LYS B 319 38.327 -5.110 20.698 1.00 51.57 N ATOM 6213 HA LYS B 319 36.943 -10.105 22.590 1.00 0.00 H ATOM 6214 HB2 LYS B 319 37.778 -9.990 20.280 1.00 0.00 H ATOM 6215 HB3 LYS B 319 36.320 -9.102 19.777 1.00 0.00 H ATOM 6216 HG2 LYS B 319 36.958 -7.213 21.195 1.00 0.00 H ATOM 6217 HG3 LYS B 319 38.390 -8.104 21.762 1.00 0.00 H ATOM 6218 HD2 LYS B 319 39.239 -8.169 19.431 1.00 0.00 H ATOM 6219 HD3 LYS B 319 37.834 -7.209 18.913 1.00 0.00 H ATOM 6220 HE2 LYS B 319 39.717 -5.725 19.224 1.00 0.00 H ATOM 6221 HE3 LYS B 319 40.017 -6.377 20.852 1.00 0.00 H ATOM 6222 HZ1 LYS B 319 37.594 -4.870 20.001 1.00 0.00 H ATOM 6223 HZ2 LYS B 319 37.880 -5.492 21.556 1.00 0.00 H ATOM 6224 HZ3 LYS B 319 38.870 -4.257 20.940 1.00 0.00 H ATOM 6225 H LYS B 319 35.792 -11.517 20.472 1.00 0.00 H ATOM 6226 N TYR B 320 34.156 -8.602 21.621 1.00 34.00 N ATOM 6227 CA TYR B 320 33.182 -7.592 22.045 1.00 34.73 C ATOM 6228 C TYR B 320 32.109 -8.081 22.993 1.00 34.68 C ATOM 6229 O TYR B 320 31.404 -7.274 23.586 1.00 37.97 O ATOM 6230 CB TYR B 320 32.486 -6.955 20.836 1.00 35.47 C ATOM 6231 CG TYR B 320 33.403 -6.157 19.952 1.00 37.48 C ATOM 6232 CD1 TYR B 320 34.171 -6.781 18.967 1.00 38.10 C ATOM 6233 CD2 TYR B 320 33.535 -4.777 20.120 1.00 40.30 C ATOM 6234 CE1 TYR B 320 35.051 -6.055 18.169 1.00 41.55 C ATOM 6235 CE2 TYR B 320 34.418 -4.034 19.322 1.00 42.40 C ATOM 6236 CZ TYR B 320 35.168 -4.683 18.351 1.00 43.01 C ATOM 6237 OH TYR B 320 36.028 -3.967 17.555 1.00 46.25 O ATOM 6238 HA TYR B 320 33.786 -6.868 22.592 1.00 0.00 H ATOM 6239 HB3 TYR B 320 31.701 -6.293 21.202 1.00 0.00 H ATOM 6240 HB2 TYR B 320 32.040 -7.750 20.239 1.00 0.00 H ATOM 6241 HD2 TYR B 320 32.943 -4.270 20.882 1.00 0.00 H ATOM 6242 HE2 TYR B 320 34.514 -2.957 19.463 1.00 0.00 H ATOM 6243 HE1 TYR B 320 35.644 -6.560 17.407 1.00 0.00 H ATOM 6244 HD1 TYR B 320 34.080 -7.857 18.820 1.00 0.00 H ATOM 6245 HH TYR B 320 36.479 -4.581 16.923 1.00 0.00 H ATOM 6246 H TYR B 320 33.966 -9.175 20.774 1.00 0.00 H ATOM 6247 N GLY B 321 31.966 -9.390 23.145 1.00 33.03 N ATOM 6248 CA GLY B 321 30.924 -9.871 24.026 1.00 32.78 C ATOM 6249 C GLY B 321 31.335 -10.237 25.437 1.00 34.20 C ATOM 6250 O GLY B 321 30.503 -10.219 26.352 1.00 34.32 O ATOM 6251 HA3 GLY B 321 30.489 -10.760 23.568 1.00 0.00 H ATOM 6252 HA2 GLY B 321 30.165 -9.092 24.095 1.00 0.00 H ATOM 6253 H GLY B 321 32.588 -10.055 22.643 1.00 0.00 H ATOM 6254 N VAL B 322 32.614 -10.557 25.619 1.00 34.14 N ATOM 6255 CA VAL B 322 33.125 -10.986 26.918 1.00 35.15 C ATOM 6256 C VAL B 322 32.871 -9.995 28.047 1.00 31.63 C ATOM 6257 O VAL B 322 32.481 -10.394 29.140 1.00 31.24 O ATOM 6258 CB VAL B 322 34.648 -11.345 26.822 1.00 36.64 C ATOM 6259 CG1 VAL B 322 35.458 -10.121 26.476 1.00 38.45 C ATOM 6260 CG2 VAL B 322 35.125 -11.942 28.120 1.00 40.84 C ATOM 6261 HA VAL B 322 32.557 -11.879 27.180 1.00 0.00 H ATOM 6262 HB VAL B 322 34.782 -12.081 26.030 1.00 0.00 H ATOM 6263 HG11 VAL B 322 35.125 -9.726 25.516 1.00 0.00 H ATOM 6264 HG12 VAL B 322 35.320 -9.365 27.249 1.00 0.00 H ATOM 6265 HG13 VAL B 322 36.512 -10.390 26.414 1.00 0.00 H ATOM 6266 HG21 VAL B 322 34.978 -11.222 28.925 1.00 0.00 H ATOM 6267 HG22 VAL B 322 34.557 -12.848 28.332 1.00 0.00 H ATOM 6268 HG23 VAL B 322 36.184 -12.186 28.039 1.00 0.00 H ATOM 6269 H VAL B 322 33.268 -10.500 24.813 1.00 0.00 H ATOM 6270 N HIS B 323 33.066 -8.706 27.792 1.00 32.14 N ATOM 6271 CA HIS B 323 32.824 -7.698 28.828 1.00 32.31 C ATOM 6272 C HIS B 323 31.372 -7.678 29.278 1.00 30.83 C ATOM 6273 O HIS B 323 31.087 -7.619 30.479 1.00 29.00 O ATOM 6274 CB HIS B 323 33.192 -6.299 28.335 1.00 37.90 C ATOM 6275 CG HIS B 323 34.661 -6.029 28.316 1.00 41.35 C ATOM 6276 ND1 HIS B 323 35.476 -6.400 27.267 1.00 44.76 N ATOM 6277 CD2 HIS B 323 35.465 -5.428 29.224 1.00 44.74 C ATOM 6278 CE1 HIS B 323 36.719 -6.036 27.529 1.00 46.35 C ATOM 6279 NE2 HIS B 323 36.739 -5.445 28.711 1.00 48.01 N ATOM 6280 HA HIS B 323 33.456 -7.975 29.672 1.00 0.00 H ATOM 6281 HB2 HIS B 323 32.808 -6.180 27.322 1.00 0.00 H ATOM 6282 HB3 HIS B 323 32.717 -5.568 28.990 1.00 0.00 H ATOM 6283 HD2 HIS B 323 35.159 -5.009 30.183 1.00 0.00 H ATOM 6284 HE1 HIS B 323 37.581 -6.196 26.881 1.00 0.00 H ATOM 6285 H HIS B 323 33.393 -8.410 26.850 1.00 0.00 H ATOM 6286 N GLU B 324 30.459 -7.724 28.309 1.00 28.75 N ATOM 6287 CA GLU B 324 29.029 -7.699 28.587 1.00 29.38 C ATOM 6288 C GLU B 324 28.648 -8.910 29.413 1.00 30.51 C ATOM 6289 O GLU B 324 27.801 -8.820 30.307 1.00 30.97 O ATOM 6290 CB GLU B 324 28.226 -7.681 27.281 1.00 26.94 C ATOM 6291 CG GLU B 324 28.204 -6.319 26.595 1.00 29.26 C ATOM 6292 CD GLU B 324 27.593 -6.368 25.200 1.00 31.43 C ATOM 6293 OE1 GLU B 324 26.845 -7.330 24.896 1.00 31.31 O ATOM 6294 OE2 GLU B 324 27.853 -5.438 24.408 1.00 30.32 O ATOM 6295 HA GLU B 324 28.797 -6.793 29.147 1.00 0.00 H ATOM 6296 HB2 GLU B 324 28.666 -8.405 26.596 1.00 0.00 H ATOM 6297 HB3 GLU B 324 27.199 -7.971 27.504 1.00 0.00 H ATOM 6298 HG2 GLU B 324 27.621 -5.631 27.207 1.00 0.00 H ATOM 6299 HG3 GLU B 324 29.228 -5.953 26.514 1.00 0.00 H ATOM 6300 H GLU B 324 30.778 -7.780 27.321 1.00 0.00 H ATOM 6301 N ILE B 325 29.287 -10.037 29.108 1.00 28.93 N ATOM 6302 CA ILE B 325 29.047 -11.291 29.811 1.00 29.31 C ATOM 6303 C ILE B 325 29.672 -11.256 31.214 1.00 28.39 C ATOM 6304 O ILE B 325 29.064 -11.715 32.182 1.00 25.74 O ATOM 6305 CB ILE B 325 29.630 -12.473 28.992 1.00 31.83 C ATOM 6306 CG1 ILE B 325 28.820 -12.630 27.695 1.00 32.56 C ATOM 6307 CG2 ILE B 325 29.618 -13.767 29.823 1.00 29.86 C ATOM 6308 CD1 ILE B 325 29.561 -13.373 26.596 1.00 37.48 C ATOM 6309 HA ILE B 325 27.971 -11.429 29.921 1.00 0.00 H ATOM 6310 HB ILE B 325 30.669 -12.266 28.736 1.00 0.00 H ATOM 6311 HG12 ILE B 325 27.906 -13.177 27.924 1.00 0.00 H ATOM 6312 HG13 ILE B 325 28.564 -11.637 27.327 1.00 0.00 H ATOM 6313 HD11 ILE B 325 30.474 -12.832 26.345 1.00 0.00 H ATOM 6314 HD12 ILE B 325 29.814 -14.375 26.943 1.00 0.00 H ATOM 6315 HD13 ILE B 325 28.925 -13.443 25.714 1.00 0.00 H ATOM 6316 HG21 ILE B 325 30.222 -13.627 30.720 1.00 0.00 H ATOM 6317 HG22 ILE B 325 28.593 -14.005 30.107 1.00 0.00 H ATOM 6318 HG23 ILE B 325 30.031 -14.582 29.229 1.00 0.00 H ATOM 6319 H ILE B 325 29.985 -10.022 28.337 1.00 0.00 H ATOM 6320 N ILE B 326 30.885 -10.723 31.328 1.00 26.86 N ATOM 6321 CA ILE B 326 31.522 -10.638 32.638 1.00 28.00 C ATOM 6322 C ILE B 326 30.620 -9.921 33.648 1.00 28.68 C ATOM 6323 O ILE B 326 30.368 -10.440 34.735 1.00 28.77 O ATOM 6324 CB ILE B 326 32.896 -9.914 32.547 1.00 30.67 C ATOM 6325 CG1 ILE B 326 33.957 -10.902 32.046 1.00 29.35 C ATOM 6326 CG2 ILE B 326 33.288 -9.318 33.904 1.00 29.19 C ATOM 6327 CD1 ILE B 326 35.323 -10.290 31.823 1.00 30.21 C ATOM 6328 HA ILE B 326 31.688 -11.658 32.984 1.00 0.00 H ATOM 6329 HB ILE B 326 32.822 -9.088 31.840 1.00 0.00 H ATOM 6330 HG12 ILE B 326 34.056 -11.699 32.783 1.00 0.00 H ATOM 6331 HG13 ILE B 326 33.613 -11.323 31.101 1.00 0.00 H ATOM 6332 HD11 ILE B 326 35.248 -9.498 31.078 1.00 0.00 H ATOM 6333 HD12 ILE B 326 35.691 -9.875 32.761 1.00 0.00 H ATOM 6334 HD13 ILE B 326 36.011 -11.058 31.470 1.00 0.00 H ATOM 6335 HG21 ILE B 326 32.531 -8.598 34.216 1.00 0.00 H ATOM 6336 HG22 ILE B 326 33.359 -10.116 34.643 1.00 0.00 H ATOM 6337 HG23 ILE B 326 34.252 -8.817 33.815 1.00 0.00 H ATOM 6338 H ILE B 326 31.379 -10.367 30.485 1.00 0.00 H ATOM 6339 N TYR B 327 30.109 -8.746 33.286 1.00 30.79 N ATOM 6340 CA TYR B 327 29.244 -7.991 34.192 1.00 32.52 C ATOM 6341 C TYR B 327 27.906 -8.653 34.449 1.00 33.40 C ATOM 6342 O TYR B 327 27.329 -8.507 35.528 1.00 33.41 O ATOM 6343 CB TYR B 327 29.055 -6.565 33.673 1.00 37.13 C ATOM 6344 CG TYR B 327 30.372 -5.837 33.642 1.00 40.46 C ATOM 6345 CD1 TYR B 327 31.145 -5.731 34.794 1.00 44.87 C ATOM 6346 CD2 TYR B 327 30.884 -5.325 32.455 1.00 42.79 C ATOM 6347 CE1 TYR B 327 32.407 -5.135 34.766 1.00 49.34 C ATOM 6348 CE2 TYR B 327 32.140 -4.729 32.412 1.00 45.79 C ATOM 6349 CZ TYR B 327 32.895 -4.638 33.570 1.00 48.33 C ATOM 6350 OH TYR B 327 34.140 -4.053 33.535 1.00 51.86 O ATOM 6351 HA TYR B 327 29.752 -7.966 35.156 1.00 0.00 H ATOM 6352 HB3 TYR B 327 28.366 -6.033 34.328 1.00 0.00 H ATOM 6353 HB2 TYR B 327 28.641 -6.602 32.665 1.00 0.00 H ATOM 6354 HD2 TYR B 327 30.291 -5.392 31.543 1.00 0.00 H ATOM 6355 HE2 TYR B 327 32.528 -4.336 31.472 1.00 0.00 H ATOM 6356 HE1 TYR B 327 33.002 -5.062 35.676 1.00 0.00 H ATOM 6357 HD1 TYR B 327 30.758 -6.120 35.736 1.00 0.00 H ATOM 6358 HH TYR B 327 34.054 -3.115 33.230 1.00 0.00 H ATOM 6359 H TYR B 327 30.328 -8.360 32.346 1.00 0.00 H ATOM 6360 N THR B 328 27.412 -9.395 33.467 1.00 33.18 N ATOM 6361 CA THR B 328 26.149 -10.103 33.641 1.00 33.58 C ATOM 6362 C THR B 328 26.305 -11.169 34.738 1.00 34.45 C ATOM 6363 O THR B 328 25.497 -11.254 35.665 1.00 32.28 O ATOM 6364 CB THR B 328 25.724 -10.792 32.328 1.00 32.82 C ATOM 6365 OG1 THR B 328 25.382 -9.794 31.358 1.00 31.10 O ATOM 6366 CG2 THR B 328 24.539 -11.719 32.564 1.00 27.47 C ATOM 6367 HA THR B 328 25.384 -9.380 33.925 1.00 0.00 H ATOM 6368 HB THR B 328 26.556 -11.392 31.958 1.00 0.00 H ATOM 6369 HG1 THR B 328 26.168 -9.216 31.190 1.00 0.00 H ATOM 6370 HG23 THR B 328 24.811 -12.473 33.303 1.00 0.00 H ATOM 6371 HG21 THR B 328 23.692 -11.138 32.930 1.00 0.00 H ATOM 6372 HG22 THR B 328 24.269 -12.207 31.627 1.00 0.00 H ATOM 6373 H THR B 328 27.928 -9.472 32.568 1.00 0.00 H ATOM 6374 N MET B 329 27.346 -11.985 34.618 1.00 34.89 N ATOM 6375 CA MET B 329 27.597 -13.048 35.589 1.00 37.45 C ATOM 6376 C MET B 329 28.116 -12.493 36.920 1.00 36.35 C ATOM 6377 O MET B 329 27.999 -13.137 37.960 1.00 35.40 O ATOM 6378 CB MET B 329 28.585 -14.066 35.003 1.00 38.61 C ATOM 6379 CG MET B 329 28.100 -14.674 33.679 1.00 44.35 C ATOM 6380 SD MET B 329 29.046 -16.095 33.096 1.00 49.30 S ATOM 6381 CE MET B 329 30.753 -15.456 33.249 1.00 49.34 C ATOM 6382 HA MET B 329 26.650 -13.546 35.797 1.00 0.00 H ATOM 6383 HB2 MET B 329 29.538 -13.566 34.828 1.00 0.00 H ATOM 6384 HB3 MET B 329 28.725 -14.870 35.725 1.00 0.00 H ATOM 6385 HG2 MET B 329 28.148 -13.899 32.914 1.00 0.00 H ATOM 6386 HG3 MET B 329 27.065 -14.989 33.811 1.00 0.00 H ATOM 6387 HE1 MET B 329 30.865 -14.570 32.624 1.00 0.00 H ATOM 6388 HE2 MET B 329 30.950 -15.196 34.289 1.00 0.00 H ATOM 6389 HE3 MET B 329 31.457 -16.222 32.925 1.00 0.00 H ATOM 6390 H MET B 329 27.997 -11.865 33.816 1.00 0.00 H ATOM 6391 N LEU B 330 28.677 -11.290 36.890 1.00 35.71 N ATOM 6392 CA LEU B 330 29.167 -10.694 38.117 1.00 35.49 C ATOM 6393 C LEU B 330 27.963 -10.429 39.021 1.00 35.70 C ATOM 6394 O LEU B 330 28.043 -10.578 40.237 1.00 35.33 O ATOM 6395 CB LEU B 330 29.899 -9.375 37.834 1.00 37.04 C ATOM 6396 CG LEU B 330 31.240 -9.143 38.556 1.00 38.76 C ATOM 6397 CD1 LEU B 330 31.408 -7.654 38.831 1.00 38.82 C ATOM 6398 CD2 LEU B 330 31.304 -9.919 39.863 1.00 35.84 C ATOM 6399 HA LEU B 330 29.874 -11.371 38.596 1.00 0.00 H ATOM 6400 HB2 LEU B 330 30.092 -9.330 36.762 1.00 0.00 H ATOM 6401 HB3 LEU B 330 29.230 -8.562 38.116 1.00 0.00 H ATOM 6402 HG LEU B 330 32.046 -9.499 37.915 1.00 0.00 H ATOM 6403 HD21 LEU B 330 30.496 -9.593 40.517 1.00 0.00 H ATOM 6404 HD22 LEU B 330 31.199 -10.984 39.657 1.00 0.00 H ATOM 6405 HD23 LEU B 330 32.263 -9.734 40.348 1.00 0.00 H ATOM 6406 HD11 LEU B 330 31.400 -7.108 37.887 1.00 0.00 H ATOM 6407 HD12 LEU B 330 30.588 -7.307 39.460 1.00 0.00 H ATOM 6408 HD13 LEU B 330 32.356 -7.485 39.342 1.00 0.00 H ATOM 6409 H LEU B 330 28.765 -10.777 35.989 1.00 0.00 H ATOM 6410 N ALA B 331 26.846 -10.031 38.416 1.00 35.54 N ATOM 6411 CA ALA B 331 25.625 -9.751 39.171 1.00 35.86 C ATOM 6412 C ALA B 331 25.232 -10.949 40.041 1.00 36.59 C ATOM 6413 O ALA B 331 24.708 -10.783 41.145 1.00 33.27 O ATOM 6414 CB ALA B 331 24.479 -9.407 38.212 1.00 35.18 C ATOM 6415 HA ALA B 331 25.817 -8.899 39.823 1.00 0.00 H ATOM 6416 HB1 ALA B 331 24.748 -8.527 37.627 1.00 0.00 H ATOM 6417 HB2 ALA B 331 24.301 -10.249 37.543 1.00 0.00 H ATOM 6418 HB3 ALA B 331 23.576 -9.201 38.786 1.00 0.00 H ATOM 6419 H ALA B 331 26.841 -9.916 37.382 1.00 0.00 H ATOM 6420 N SER B 332 25.478 -12.150 39.526 1.00 36.76 N ATOM 6421 CA SER B 332 25.157 -13.374 40.252 1.00 38.41 C ATOM 6422 C SER B 332 25.904 -13.422 41.575 1.00 38.09 C ATOM 6423 O SER B 332 25.430 -14.023 42.539 1.00 39.59 O ATOM 6424 CB SER B 332 25.541 -14.608 39.424 1.00 37.50 C ATOM 6425 OG SER B 332 24.752 -14.715 38.254 1.00 35.81 O ATOM 6426 HA SER B 332 24.083 -13.378 40.438 1.00 0.00 H ATOM 6427 HB2 SER B 332 25.397 -15.501 40.032 1.00 0.00 H ATOM 6428 HB3 SER B 332 26.590 -14.530 39.138 1.00 0.00 H ATOM 6429 HG SER B 332 25.025 -15.519 37.745 1.00 0.00 H ATOM 6430 H SER B 332 25.910 -12.218 38.582 1.00 0.00 H ATOM 6431 N LEU B 333 27.066 -12.781 41.618 1.00 37.82 N ATOM 6432 CA LEU B 333 27.889 -12.781 42.823 1.00 41.06 C ATOM 6433 C LEU B 333 27.731 -11.506 43.638 1.00 41.34 C ATOM 6434 O LEU B 333 28.520 -11.245 44.547 1.00 42.79 O ATOM 6435 CB LEU B 333 29.370 -12.940 42.455 1.00 41.16 C ATOM 6436 CG LEU B 333 29.798 -13.984 41.421 1.00 42.66 C ATOM 6437 CD1 LEU B 333 31.314 -13.906 41.231 1.00 41.88 C ATOM 6438 CD2 LEU B 333 29.379 -15.371 41.863 1.00 42.07 C ATOM 6439 HA LEU B 333 27.549 -13.621 43.429 1.00 0.00 H ATOM 6440 HB2 LEU B 333 29.707 -11.973 42.082 1.00 0.00 H ATOM 6441 HB3 LEU B 333 29.899 -13.177 43.378 1.00 0.00 H ATOM 6442 HG LEU B 333 29.308 -13.778 40.470 1.00 0.00 H ATOM 6443 HD21 LEU B 333 29.849 -15.604 42.818 1.00 0.00 H ATOM 6444 HD22 LEU B 333 28.295 -15.404 41.973 1.00 0.00 H ATOM 6445 HD23 LEU B 333 29.692 -16.099 41.115 1.00 0.00 H ATOM 6446 HD11 LEU B 333 31.584 -12.910 40.881 1.00 0.00 H ATOM 6447 HD12 LEU B 333 31.809 -14.105 42.182 1.00 0.00 H ATOM 6448 HD13 LEU B 333 31.625 -14.648 40.495 1.00 0.00 H ATOM 6449 H LEU B 333 27.396 -12.268 40.776 1.00 0.00 H ATOM 6450 N MET B 334 26.717 -10.712 43.320 1.00 42.24 N ATOM 6451 CA MET B 334 26.506 -9.455 44.030 1.00 42.73 C ATOM 6452 C MET B 334 25.132 -9.297 44.655 1.00 41.89 C ATOM 6453 O MET B 334 24.177 -10.003 44.311 1.00 42.39 O ATOM 6454 CB MET B 334 26.691 -8.264 43.088 1.00 42.18 C ATOM 6455 CG MET B 334 28.060 -8.084 42.480 1.00 44.02 C ATOM 6456 SD MET B 334 28.018 -6.684 41.331 1.00 43.25 S ATOM 6457 CE MET B 334 29.504 -5.839 41.757 1.00 43.16 C ATOM 6458 HA MET B 334 27.247 -9.479 44.829 1.00 0.00 H ATOM 6459 HB2 MET B 334 25.979 -8.376 42.270 1.00 0.00 H ATOM 6460 HB3 MET B 334 26.458 -7.359 43.650 1.00 0.00 H ATOM 6461 HG2 MET B 334 28.343 -8.989 41.943 1.00 0.00 H ATOM 6462 HG3 MET B 334 28.787 -7.888 43.268 1.00 0.00 H ATOM 6463 HE1 MET B 334 29.463 -5.540 42.804 1.00 0.00 H ATOM 6464 HE2 MET B 334 30.355 -6.502 41.600 1.00 0.00 H ATOM 6465 HE3 MET B 334 29.610 -4.954 41.129 1.00 0.00 H ATOM 6466 H MET B 334 26.066 -10.988 42.557 1.00 0.00 H ATOM 6467 N ASN B 335 25.062 -8.353 45.587 1.00 40.73 N ATOM 6468 CA ASN B 335 23.821 -7.967 46.231 1.00 41.37 C ATOM 6469 C ASN B 335 24.017 -6.483 46.489 1.00 41.71 C ATOM 6470 O ASN B 335 25.100 -5.956 46.225 1.00 40.28 O ATOM 6471 CB ASN B 335 23.535 -8.782 47.511 1.00 41.56 C ATOM 6472 CG ASN B 335 24.509 -8.513 48.654 1.00 42.78 C ATOM 6473 OD1 ASN B 335 24.640 -9.346 49.549 1.00 42.03 O ATOM 6474 ND2 ASN B 335 25.173 -7.365 48.643 1.00 42.02 N ATOM 6475 HA ASN B 335 22.941 -8.169 45.620 1.00 0.00 H ATOM 6476 HB2 ASN B 335 22.529 -8.539 47.854 1.00 0.00 H ATOM 6477 HB3 ASN B 335 23.586 -9.842 47.260 1.00 0.00 H ATOM 6478 HD22 ASN B 335 25.031 -6.689 47.865 1.00 0.00 H ATOM 6479 HD21 ASN B 335 25.836 -7.140 49.412 1.00 0.00 H ATOM 6480 H ASN B 335 25.938 -7.868 45.868 1.00 0.00 H ATOM 6481 N LYS B 336 22.985 -5.802 46.967 1.00 43.92 N ATOM 6482 CA LYS B 336 23.072 -4.366 47.224 1.00 45.78 C ATOM 6483 C LYS B 336 24.242 -3.973 48.146 1.00 46.41 C ATOM 6484 O LYS B 336 24.710 -2.828 48.108 1.00 45.72 O ATOM 6485 CB LYS B 336 21.748 -3.875 47.827 1.00 48.87 C ATOM 6486 CG LYS B 336 20.573 -4.824 47.568 1.00 54.81 C ATOM 6487 CD LYS B 336 19.229 -4.268 48.056 1.00 58.13 C ATOM 6488 CE LYS B 336 18.563 -3.357 47.012 1.00 61.50 C ATOM 6489 NZ LYS B 336 19.315 -2.093 46.735 1.00 62.33 N ATOM 6490 HA LYS B 336 23.263 -3.886 46.264 1.00 0.00 H ATOM 6491 HB2 LYS B 336 21.877 -3.770 48.904 1.00 0.00 H ATOM 6492 HB3 LYS B 336 21.510 -2.903 47.394 1.00 0.00 H ATOM 6493 HG2 LYS B 336 20.504 -5.006 46.496 1.00 0.00 H ATOM 6494 HG3 LYS B 336 20.767 -5.765 48.083 1.00 0.00 H ATOM 6495 HD2 LYS B 336 18.561 -5.102 48.271 1.00 0.00 H ATOM 6496 HD3 LYS B 336 19.397 -3.694 48.967 1.00 0.00 H ATOM 6497 HE2 LYS B 336 17.569 -3.092 47.373 1.00 0.00 H ATOM 6498 HE3 LYS B 336 18.473 -3.914 46.079 1.00 0.00 H ATOM 6499 HZ1 LYS B 336 19.400 -1.542 47.613 1.00 0.00 H ATOM 6500 HZ2 LYS B 336 20.263 -2.326 46.378 1.00 0.00 H ATOM 6501 HZ3 LYS B 336 18.802 -1.535 46.022 1.00 0.00 H ATOM 6502 H LYS B 336 22.094 -6.301 47.163 1.00 0.00 H ATOM 6503 N ASP B 337 24.727 -4.921 48.949 1.00 44.76 N ATOM 6504 CA ASP B 337 25.813 -4.642 49.889 1.00 45.74 C ATOM 6505 C ASP B 337 27.227 -5.095 49.512 1.00 47.40 C ATOM 6506 O ASP B 337 28.200 -4.608 50.099 1.00 48.35 O ATOM 6507 CB ASP B 337 25.465 -5.214 51.274 1.00 44.49 C ATOM 6508 CG ASP B 337 24.114 -4.720 51.794 1.00 43.66 C ATOM 6509 OD1 ASP B 337 23.904 -3.493 51.843 1.00 40.64 O ATOM 6510 OD2 ASP B 337 23.262 -5.561 52.151 1.00 44.49 O ATOM 6511 HA ASP B 337 25.871 -3.554 49.874 1.00 0.00 H ATOM 6512 HB2 ASP B 337 25.436 -6.301 51.205 1.00 0.00 H ATOM 6513 HB3 ASP B 337 26.241 -4.916 51.980 1.00 0.00 H ATOM 6514 H ASP B 337 24.325 -5.879 48.906 1.00 0.00 H ATOM 6515 N GLY B 338 27.368 -6.018 48.560 1.00 46.34 N ATOM 6516 CA GLY B 338 28.709 -6.455 48.200 1.00 45.75 C ATOM 6517 C GLY B 338 28.839 -7.511 47.117 1.00 46.34 C ATOM 6518 O GLY B 338 27.847 -7.954 46.535 1.00 45.92 O ATOM 6519 HA3 GLY B 338 29.175 -6.853 49.101 1.00 0.00 H ATOM 6520 HA2 GLY B 338 29.260 -5.576 47.866 1.00 0.00 H ATOM 6521 H GLY B 338 26.535 -6.418 48.083 1.00 0.00 H ATOM 6522 N VAL B 339 30.078 -7.915 46.843 1.00 45.13 N ATOM 6523 CA VAL B 339 30.347 -8.918 45.820 1.00 44.71 C ATOM 6524 C VAL B 339 31.214 -10.054 46.340 1.00 44.28 C ATOM 6525 O VAL B 339 32.176 -9.818 47.062 1.00 44.33 O ATOM 6526 CB VAL B 339 31.057 -8.284 44.600 1.00 45.00 C ATOM 6527 CG1 VAL B 339 32.180 -7.356 45.070 1.00 43.73 C ATOM 6528 CG2 VAL B 339 31.632 -9.384 43.701 1.00 43.59 C ATOM 6529 HA VAL B 339 29.377 -9.321 45.527 1.00 0.00 H ATOM 6530 HB VAL B 339 30.331 -7.702 44.032 1.00 0.00 H ATOM 6531 HG11 VAL B 339 31.760 -6.565 45.691 1.00 0.00 H ATOM 6532 HG12 VAL B 339 32.904 -7.929 45.649 1.00 0.00 H ATOM 6533 HG13 VAL B 339 32.672 -6.916 44.203 1.00 0.00 H ATOM 6534 HG21 VAL B 339 32.350 -9.976 44.268 1.00 0.00 H ATOM 6535 HG22 VAL B 339 30.823 -10.027 43.353 1.00 0.00 H ATOM 6536 HG23 VAL B 339 32.130 -8.929 42.845 1.00 0.00 H ATOM 6537 H VAL B 339 30.874 -7.505 47.372 1.00 0.00 H ATOM 6538 N LEU B 340 30.868 -11.284 45.971 1.00 45.07 N ATOM 6539 CA LEU B 340 31.643 -12.452 46.383 1.00 45.15 C ATOM 6540 C LEU B 340 32.957 -12.441 45.634 1.00 47.11 C ATOM 6541 O LEU B 340 33.012 -12.018 44.478 1.00 47.58 O ATOM 6542 CB LEU B 340 30.916 -13.753 46.049 1.00 43.68 C ATOM 6543 CG LEU B 340 29.806 -14.241 46.970 1.00 45.08 C ATOM 6544 CD1 LEU B 340 29.299 -15.580 46.441 1.00 44.44 C ATOM 6545 CD2 LEU B 340 30.332 -14.389 48.410 1.00 45.90 C ATOM 6546 HA LEU B 340 31.792 -12.403 47.462 1.00 0.00 H ATOM 6547 HB2 LEU B 340 30.477 -13.628 45.059 1.00 0.00 H ATOM 6548 HB3 LEU B 340 31.670 -14.539 46.014 1.00 0.00 H ATOM 6549 HG LEU B 340 28.990 -13.519 46.988 1.00 0.00 H ATOM 6550 HD21 LEU B 340 31.150 -15.110 48.425 1.00 0.00 H ATOM 6551 HD22 LEU B 340 30.691 -13.423 48.765 1.00 0.00 H ATOM 6552 HD23 LEU B 340 29.526 -14.739 49.056 1.00 0.00 H ATOM 6553 HD11 LEU B 340 28.915 -15.448 45.429 1.00 0.00 H ATOM 6554 HD12 LEU B 340 30.119 -16.298 46.429 1.00 0.00 H ATOM 6555 HD13 LEU B 340 28.502 -15.947 47.088 1.00 0.00 H ATOM 6556 H LEU B 340 30.026 -11.418 45.375 1.00 0.00 H ATOM 6557 N ILE B 341 34.009 -12.927 46.282 1.00 50.10 N ATOM 6558 CA ILE B 341 35.328 -12.960 45.665 1.00 52.00 C ATOM 6559 C ILE B 341 36.007 -14.295 45.940 1.00 53.53 C ATOM 6560 O ILE B 341 35.641 -15.008 46.871 1.00 53.76 O ATOM 6561 CB ILE B 341 36.206 -11.801 46.204 1.00 53.67 C ATOM 6562 CG1 ILE B 341 36.945 -11.130 45.050 1.00 55.43 C ATOM 6563 CG2 ILE B 341 37.196 -12.309 47.256 1.00 53.82 C ATOM 6564 CD1 ILE B 341 37.863 -12.059 44.253 1.00 59.69 C ATOM 6565 HA ILE B 341 35.208 -12.839 44.588 1.00 0.00 H ATOM 6566 HB ILE B 341 35.558 -11.067 46.683 1.00 0.00 H ATOM 6567 HG12 ILE B 341 36.204 -10.716 44.366 1.00 0.00 H ATOM 6568 HG13 ILE B 341 37.551 -10.322 45.459 1.00 0.00 H ATOM 6569 HD11 ILE B 341 38.622 -12.474 44.916 1.00 0.00 H ATOM 6570 HD12 ILE B 341 37.274 -12.868 43.823 1.00 0.00 H ATOM 6571 HD13 ILE B 341 38.345 -11.494 43.455 1.00 0.00 H ATOM 6572 HG21 ILE B 341 36.646 -12.749 48.088 1.00 0.00 H ATOM 6573 HG22 ILE B 341 37.845 -13.062 46.809 1.00 0.00 H ATOM 6574 HG23 ILE B 341 37.799 -11.476 47.617 1.00 0.00 H ATOM 6575 H ILE B 341 33.889 -13.291 47.249 1.00 0.00 H ATOM 6576 N SER B 342 36.980 -14.640 45.109 1.00 54.91 N ATOM 6577 CA SER B 342 37.727 -15.876 45.277 1.00 57.35 C ATOM 6578 C SER B 342 36.879 -17.148 45.395 1.00 58.06 C ATOM 6579 O SER B 342 36.728 -17.704 46.478 1.00 58.49 O ATOM 6580 CB SER B 342 38.635 -15.751 46.503 1.00 57.47 C ATOM 6581 OG SER B 342 39.410 -16.925 46.683 1.00 61.82 O ATOM 6582 HA SER B 342 38.299 -15.999 44.357 1.00 0.00 H ATOM 6583 HB2 SER B 342 38.019 -15.591 47.388 1.00 0.00 H ATOM 6584 HB3 SER B 342 39.303 -14.900 46.367 1.00 0.00 H ATOM 6585 HG SER B 342 38.808 -17.700 46.811 1.00 0.00 H ATOM 6586 H SER B 342 37.215 -14.010 44.316 1.00 0.00 H ATOM 6587 N GLU B 343 36.332 -17.612 44.277 1.00 59.69 N ATOM 6588 CA GLU B 343 35.537 -18.839 44.272 1.00 61.39 C ATOM 6589 C GLU B 343 34.434 -18.824 45.330 1.00 61.52 C ATOM 6590 O GLU B 343 33.929 -19.875 45.726 1.00 62.57 O ATOM 6591 CB GLU B 343 36.461 -20.043 44.506 1.00 64.16 C ATOM 6592 CG GLU B 343 35.803 -21.421 44.394 1.00 66.43 C ATOM 6593 CD GLU B 343 35.761 -21.949 42.969 1.00 67.58 C ATOM 6594 OE1 GLU B 343 36.843 -22.151 42.373 1.00 67.20 O ATOM 6595 OE2 GLU B 343 34.647 -22.168 42.451 1.00 68.33 O ATOM 6596 HA GLU B 343 35.051 -18.914 43.299 1.00 0.00 H ATOM 6597 HB2 GLU B 343 37.265 -19.995 43.771 1.00 0.00 H ATOM 6598 HB3 GLU B 343 36.880 -19.953 45.508 1.00 0.00 H ATOM 6599 HG2 GLU B 343 36.365 -22.125 45.008 1.00 0.00 H ATOM 6600 HG3 GLU B 343 34.782 -21.349 44.768 1.00 0.00 H ATOM 6601 H GLU B 343 36.472 -17.092 43.387 1.00 0.00 H ATOM 6602 N GLY B 344 34.060 -17.634 45.789 1.00 60.82 N ATOM 6603 CA GLY B 344 33.013 -17.530 46.790 1.00 58.96 C ATOM 6604 C GLY B 344 33.542 -17.695 48.202 1.00 58.85 C ATOM 6605 O GLY B 344 32.776 -17.766 49.165 1.00 57.79 O ATOM 6606 HA3 GLY B 344 32.270 -18.305 46.602 1.00 0.00 H ATOM 6607 HA2 GLY B 344 32.543 -16.550 46.705 1.00 0.00 H ATOM 6608 H GLY B 344 34.519 -16.773 45.429 1.00 0.00 H ATOM 6609 N GLN B 345 34.862 -17.756 48.321 1.00 57.65 N ATOM 6610 CA GLN B 345 35.511 -17.910 49.612 1.00 57.71 C ATOM 6611 C GLN B 345 35.661 -16.546 50.280 1.00 55.97 C ATOM 6612 O GLN B 345 36.115 -16.447 51.420 1.00 55.78 O ATOM 6613 CB GLN B 345 36.890 -18.551 49.430 1.00 60.65 C ATOM 6614 CG GLN B 345 36.860 -19.924 48.772 1.00 64.95 C ATOM 6615 CD GLN B 345 38.240 -20.388 48.346 1.00 68.12 C ATOM 6616 OE1 GLN B 345 39.232 -19.681 48.543 1.00 70.66 O ATOM 6617 NE2 GLN B 345 38.312 -21.578 47.754 1.00 69.43 N ATOM 6618 HA GLN B 345 34.899 -18.554 50.243 1.00 0.00 H ATOM 6619 HB2 GLN B 345 37.496 -17.889 48.812 1.00 0.00 H ATOM 6620 HB3 GLN B 345 37.352 -18.653 50.412 1.00 0.00 H ATOM 6621 HG2 GLN B 345 36.451 -20.644 49.481 1.00 0.00 H ATOM 6622 HG3 GLN B 345 36.218 -19.878 47.892 1.00 0.00 H ATOM 6623 HE22 GLN B 345 37.449 -22.140 47.609 1.00 0.00 H ATOM 6624 HE21 GLN B 345 39.231 -21.946 47.437 1.00 0.00 H ATOM 6625 H GLN B 345 35.449 -17.692 47.465 1.00 0.00 H ATOM 6626 N GLY B 346 35.277 -15.495 49.563 1.00 52.32 N ATOM 6627 CA GLY B 346 35.386 -14.159 50.113 1.00 48.90 C ATOM 6628 C GLY B 346 34.202 -13.270 49.796 1.00 47.58 C ATOM 6629 O GLY B 346 33.335 -13.627 49.003 1.00 45.80 O ATOM 6630 HA3 GLY B 346 36.284 -13.693 49.709 1.00 0.00 H ATOM 6631 HA2 GLY B 346 35.476 -14.239 51.196 1.00 0.00 H ATOM 6632 H GLY B 346 34.897 -15.632 48.605 1.00 0.00 H ATOM 6633 N PHE B 347 34.168 -12.105 50.429 1.00 46.68 N ATOM 6634 CA PHE B 347 33.097 -11.143 50.220 1.00 46.64 C ATOM 6635 C PHE B 347 33.641 -9.742 50.474 1.00 47.54 C ATOM 6636 O PHE B 347 34.013 -9.404 51.596 1.00 46.66 O ATOM 6637 CB PHE B 347 31.924 -11.418 51.172 1.00 45.28 C ATOM 6638 CG PHE B 347 30.754 -10.483 50.982 1.00 45.03 C ATOM 6639 CD1 PHE B 347 29.829 -10.697 49.964 1.00 44.65 C ATOM 6640 CD2 PHE B 347 30.595 -9.371 51.805 1.00 45.45 C ATOM 6641 CE1 PHE B 347 28.758 -9.819 49.767 1.00 44.29 C ATOM 6642 CE2 PHE B 347 29.527 -8.482 51.618 1.00 46.37 C ATOM 6643 CZ PHE B 347 28.607 -8.709 50.597 1.00 44.81 C ATOM 6644 HA PHE B 347 32.735 -11.230 49.196 1.00 0.00 H ATOM 6645 HB2 PHE B 347 31.579 -12.439 51.007 1.00 0.00 H ATOM 6646 HB3 PHE B 347 32.282 -11.318 52.197 1.00 0.00 H ATOM 6647 HD2 PHE B 347 31.311 -9.189 52.606 1.00 0.00 H ATOM 6648 HE2 PHE B 347 29.417 -7.615 52.270 1.00 0.00 H ATOM 6649 HZ PHE B 347 27.774 -8.023 50.448 1.00 0.00 H ATOM 6650 HE1 PHE B 347 28.042 -10.002 48.966 1.00 0.00 H ATOM 6651 HD1 PHE B 347 29.941 -11.562 49.310 1.00 0.00 H ATOM 6652 H PHE B 347 34.931 -11.872 51.096 1.00 0.00 H ATOM 6653 N MET B 348 33.695 -8.932 49.425 1.00 48.73 N ATOM 6654 CA MET B 348 34.189 -7.568 49.552 1.00 49.95 C ATOM 6655 C MET B 348 32.979 -6.645 49.526 1.00 48.95 C ATOM 6656 O MET B 348 32.237 -6.619 48.544 1.00 49.70 O ATOM 6657 CB MET B 348 35.143 -7.241 48.400 1.00 51.71 C ATOM 6658 CG MET B 348 35.970 -5.990 48.628 1.00 53.54 C ATOM 6659 SD MET B 348 37.276 -5.819 47.406 1.00 58.00 S ATOM 6660 CE MET B 348 38.217 -7.298 47.741 1.00 56.52 C ATOM 6661 HA MET B 348 34.744 -7.441 50.482 1.00 0.00 H ATOM 6662 HB2 MET B 348 35.822 -8.083 48.266 1.00 0.00 H ATOM 6663 HB3 MET B 348 34.554 -7.103 47.493 1.00 0.00 H ATOM 6664 HG2 MET B 348 36.419 -6.040 49.620 1.00 0.00 H ATOM 6665 HG3 MET B 348 35.316 -5.120 48.570 1.00 0.00 H ATOM 6666 HE1 MET B 348 38.571 -7.276 48.772 1.00 0.00 H ATOM 6667 HE2 MET B 348 37.583 -8.172 47.591 1.00 0.00 H ATOM 6668 HE3 MET B 348 39.070 -7.346 47.064 1.00 0.00 H ATOM 6669 H MET B 348 33.379 -9.277 48.496 1.00 0.00 H ATOM 6670 N THR B 349 32.786 -5.885 50.601 1.00 47.28 N ATOM 6671 CA THR B 349 31.634 -5.001 50.697 1.00 46.04 C ATOM 6672 C THR B 349 31.650 -3.857 49.704 1.00 48.04 C ATOM 6673 O THR B 349 32.702 -3.453 49.213 1.00 48.10 O ATOM 6674 CB THR B 349 31.484 -4.400 52.119 1.00 44.58 C ATOM 6675 OG1 THR B 349 32.378 -3.290 52.274 1.00 43.40 O ATOM 6676 CG2 THR B 349 31.785 -5.447 53.168 1.00 40.74 C ATOM 6677 HA THR B 349 30.786 -5.644 50.462 1.00 0.00 H ATOM 6678 HB THR B 349 30.457 -4.059 52.248 1.00 0.00 H ATOM 6679 HG1 THR B 349 32.162 -2.597 51.601 1.00 0.00 H ATOM 6680 HG23 THR B 349 31.103 -6.288 53.046 1.00 0.00 H ATOM 6681 HG21 THR B 349 32.813 -5.791 53.052 1.00 0.00 H ATOM 6682 HG22 THR B 349 31.656 -5.014 54.160 1.00 0.00 H ATOM 6683 H THR B 349 33.469 -5.923 51.385 1.00 0.00 H ATOM 6684 N ARG B 350 30.458 -3.337 49.422 1.00 49.64 N ATOM 6685 CA ARG B 350 30.279 -2.227 48.498 1.00 49.45 C ATOM 6686 C ARG B 350 30.913 -0.978 49.093 1.00 51.22 C ATOM 6687 O ARG B 350 31.480 -0.160 48.375 1.00 52.14 O ATOM 6688 CB ARG B 350 28.780 -2.004 48.263 1.00 47.57 C ATOM 6689 CG ARG B 350 28.413 -0.951 47.219 1.00 45.63 C ATOM 6690 CD ARG B 350 26.915 -1.027 46.887 1.00 44.79 C ATOM 6691 NE ARG B 350 26.488 -0.002 45.939 1.00 46.20 N ATOM 6692 CZ ARG B 350 25.244 0.123 45.479 1.00 47.80 C ATOM 6693 NH1 ARG B 350 24.297 -0.717 45.875 1.00 48.89 N ATOM 6694 NH2 ARG B 350 24.942 1.087 44.620 1.00 46.91 N ATOM 6695 HA ARG B 350 30.758 -2.449 47.544 1.00 0.00 H ATOM 6696 HB2 ARG B 350 28.348 -2.953 47.946 1.00 0.00 H ATOM 6697 HB3 ARG B 350 28.335 -1.702 49.211 1.00 0.00 H ATOM 6698 HG2 ARG B 350 28.645 0.040 47.610 1.00 0.00 H ATOM 6699 HG3 ARG B 350 28.992 -1.127 46.312 1.00 0.00 H ATOM 6700 HD2 ARG B 350 26.348 -0.905 47.810 1.00 0.00 H ATOM 6701 HD3 ARG B 350 26.703 -2.007 46.459 1.00 0.00 H ATOM 6702 HE ARG B 350 27.202 0.675 45.601 1.00 0.00 H ATOM 6703 HH12 ARG B 350 23.327 -0.615 45.513 1.00 0.00 H ATOM 6704 HH11 ARG B 350 24.524 -1.477 46.547 1.00 0.00 H ATOM 6705 HH22 ARG B 350 23.969 1.180 44.264 1.00 0.00 H ATOM 6706 HH21 ARG B 350 25.678 1.750 44.302 1.00 0.00 H ATOM 6707 H ARG B 350 29.618 -3.742 49.882 1.00 0.00 H ATOM 6708 N GLU B 351 30.819 -0.850 50.414 1.00 54.16 N ATOM 6709 CA GLU B 351 31.361 0.298 51.152 1.00 55.71 C ATOM 6710 C GLU B 351 32.867 0.448 50.942 1.00 54.66 C ATOM 6711 O GLU B 351 33.351 1.510 50.541 1.00 53.02 O ATOM 6712 CB GLU B 351 31.037 0.129 52.644 1.00 58.59 C ATOM 6713 CG GLU B 351 31.464 1.270 53.575 1.00 62.54 C ATOM 6714 CD GLU B 351 32.863 1.085 54.154 1.00 64.69 C ATOM 6715 OE1 GLU B 351 33.280 -0.080 54.363 1.00 64.54 O ATOM 6716 OE2 GLU B 351 33.537 2.109 54.417 1.00 65.42 O ATOM 6717 HA GLU B 351 30.896 1.208 50.772 1.00 0.00 H ATOM 6718 HB2 GLU B 351 29.957 0.013 52.737 1.00 0.00 H ATOM 6719 HB3 GLU B 351 31.529 -0.780 52.988 1.00 0.00 H ATOM 6720 HG2 GLU B 351 31.443 2.203 53.012 1.00 0.00 H ATOM 6721 HG3 GLU B 351 30.753 1.329 54.399 1.00 0.00 H ATOM 6722 H GLU B 351 30.338 -1.600 50.950 1.00 0.00 H ATOM 6723 N PHE B 352 33.601 -0.624 51.211 1.00 54.82 N ATOM 6724 CA PHE B 352 35.047 -0.623 51.039 1.00 55.84 C ATOM 6725 C PHE B 352 35.430 -0.246 49.604 1.00 57.42 C ATOM 6726 O PHE B 352 36.201 0.692 49.388 1.00 58.19 O ATOM 6727 CB PHE B 352 35.613 -2.002 51.394 1.00 55.94 C ATOM 6728 CG PHE B 352 37.093 -2.139 51.146 1.00 57.56 C ATOM 6729 CD1 PHE B 352 37.992 -1.211 51.672 1.00 56.86 C ATOM 6730 CD2 PHE B 352 37.589 -3.199 50.394 1.00 55.63 C ATOM 6731 CE1 PHE B 352 39.364 -1.341 51.449 1.00 55.91 C ATOM 6732 CE2 PHE B 352 38.958 -3.335 50.168 1.00 56.35 C ATOM 6733 CZ PHE B 352 39.846 -2.403 50.697 1.00 55.76 C ATOM 6734 HA PHE B 352 35.473 0.124 51.709 1.00 0.00 H ATOM 6735 HB2 PHE B 352 35.423 -2.189 52.451 1.00 0.00 H ATOM 6736 HB3 PHE B 352 35.094 -2.750 50.795 1.00 0.00 H ATOM 6737 HD2 PHE B 352 36.899 -3.932 49.976 1.00 0.00 H ATOM 6738 HE2 PHE B 352 39.333 -4.171 49.577 1.00 0.00 H ATOM 6739 HZ PHE B 352 40.917 -2.507 50.521 1.00 0.00 H ATOM 6740 HE1 PHE B 352 40.056 -0.609 51.865 1.00 0.00 H ATOM 6741 HD1 PHE B 352 37.619 -0.375 52.264 1.00 0.00 H ATOM 6742 H PHE B 352 33.132 -1.487 51.553 1.00 0.00 H ATOM 6743 N LEU B 353 34.882 -0.962 48.625 1.00 57.38 N ATOM 6744 CA LEU B 353 35.192 -0.687 47.221 1.00 58.30 C ATOM 6745 C LEU B 353 34.917 0.757 46.830 1.00 58.87 C ATOM 6746 O LEU B 353 35.687 1.366 46.091 1.00 59.53 O ATOM 6747 CB LEU B 353 34.396 -1.624 46.301 1.00 56.33 C ATOM 6748 CG LEU B 353 34.834 -3.092 46.339 1.00 56.64 C ATOM 6749 CD1 LEU B 353 33.878 -3.954 45.542 1.00 55.82 C ATOM 6750 CD2 LEU B 353 36.248 -3.203 45.793 1.00 55.66 C ATOM 6751 HA LEU B 353 36.261 -0.864 47.100 1.00 0.00 H ATOM 6752 HB2 LEU B 353 33.347 -1.576 46.594 1.00 0.00 H ATOM 6753 HB3 LEU B 353 34.503 -1.265 45.277 1.00 0.00 H ATOM 6754 HG LEU B 353 34.819 -3.449 47.369 1.00 0.00 H ATOM 6755 HD21 LEU B 353 36.269 -2.840 44.765 1.00 0.00 H ATOM 6756 HD22 LEU B 353 36.921 -2.603 46.406 1.00 0.00 H ATOM 6757 HD23 LEU B 353 36.565 -4.246 45.818 1.00 0.00 H ATOM 6758 HD11 LEU B 353 32.877 -3.872 45.966 1.00 0.00 H ATOM 6759 HD12 LEU B 353 33.863 -3.616 44.506 1.00 0.00 H ATOM 6760 HD13 LEU B 353 34.207 -4.992 45.582 1.00 0.00 H ATOM 6761 H LEU B 353 34.222 -1.730 48.862 1.00 0.00 H ATOM 6762 N LYS B 354 33.824 1.306 47.342 1.00 60.81 N ATOM 6763 CA LYS B 354 33.435 2.672 47.024 1.00 62.34 C ATOM 6764 C LYS B 354 34.255 3.731 47.760 1.00 63.68 C ATOM 6765 O LYS B 354 34.073 4.928 47.529 1.00 64.26 O ATOM 6766 CB LYS B 354 31.948 2.858 47.329 1.00 63.24 C ATOM 6767 CG LYS B 354 31.323 4.101 46.715 1.00 66.25 C ATOM 6768 CD LYS B 354 29.810 4.086 46.883 1.00 66.87 C ATOM 6769 CE LYS B 354 29.420 3.984 48.347 1.00 68.20 C ATOM 6770 NZ LYS B 354 27.958 3.774 48.532 1.00 70.62 N ATOM 6771 HA LYS B 354 33.634 2.818 45.962 1.00 0.00 H ATOM 6772 HB2 LYS B 354 31.412 1.987 46.952 1.00 0.00 H ATOM 6773 HB3 LYS B 354 31.828 2.916 48.411 1.00 0.00 H ATOM 6774 HG2 LYS B 354 31.729 4.985 47.207 1.00 0.00 H ATOM 6775 HG3 LYS B 354 31.564 4.135 45.653 1.00 0.00 H ATOM 6776 HD2 LYS B 354 29.397 5.005 46.468 1.00 0.00 H ATOM 6777 HD3 LYS B 354 29.401 3.230 46.346 1.00 0.00 H ATOM 6778 HE2 LYS B 354 29.708 4.906 48.851 1.00 0.00 H ATOM 6779 HE3 LYS B 354 29.954 3.145 48.794 1.00 0.00 H ATOM 6780 HZ1 LYS B 354 27.439 4.573 48.116 1.00 0.00 H ATOM 6781 HZ2 LYS B 354 27.673 2.891 48.061 1.00 0.00 H ATOM 6782 HZ3 LYS B 354 27.744 3.711 49.548 1.00 0.00 H ATOM 6783 H LYS B 354 33.230 0.747 47.987 1.00 0.00 H ATOM 6784 N SER B 355 35.163 3.296 48.632 1.00 64.10 N ATOM 6785 CA SER B 355 35.987 4.234 49.393 1.00 64.20 C ATOM 6786 C SER B 355 37.419 4.332 48.866 1.00 65.70 C ATOM 6787 O SER B 355 38.214 5.139 49.355 1.00 66.71 O ATOM 6788 CB SER B 355 36.026 3.835 50.872 1.00 62.23 C ATOM 6789 OG SER B 355 36.864 2.711 51.077 1.00 60.08 O ATOM 6790 HA SER B 355 35.522 5.213 49.276 1.00 0.00 H ATOM 6791 HB2 SER B 355 35.016 3.591 51.202 1.00 0.00 H ATOM 6792 HB3 SER B 355 36.405 4.673 51.457 1.00 0.00 H ATOM 6793 HG SER B 355 36.521 1.945 50.551 1.00 0.00 H ATOM 6794 H SER B 355 35.288 2.273 48.774 1.00 0.00 H ATOM 6795 N LEU B 356 37.752 3.514 47.873 1.00 65.70 N ATOM 6796 CA LEU B 356 39.095 3.538 47.316 1.00 65.54 C ATOM 6797 C LEU B 356 39.370 4.896 46.672 1.00 66.64 C ATOM 6798 O LEU B 356 38.455 5.708 46.512 1.00 65.75 O ATOM 6799 CB LEU B 356 39.255 2.409 46.293 1.00 64.42 C ATOM 6800 CG LEU B 356 39.046 0.987 46.836 1.00 63.65 C ATOM 6801 CD1 LEU B 356 39.254 -0.030 45.727 1.00 61.46 C ATOM 6802 CD2 LEU B 356 40.014 0.723 47.975 1.00 62.85 C ATOM 6803 HA LEU B 356 39.819 3.385 48.116 1.00 0.00 H ATOM 6804 HB2 LEU B 356 38.531 2.574 45.495 1.00 0.00 H ATOM 6805 HB3 LEU B 356 40.264 2.467 45.884 1.00 0.00 H ATOM 6806 HG LEU B 356 38.026 0.895 47.209 1.00 0.00 H ATOM 6807 HD21 LEU B 356 41.037 0.824 47.612 1.00 0.00 H ATOM 6808 HD22 LEU B 356 39.838 1.444 48.774 1.00 0.00 H ATOM 6809 HD23 LEU B 356 39.860 -0.287 48.355 1.00 0.00 H ATOM 6810 HD11 LEU B 356 38.539 0.157 44.926 1.00 0.00 H ATOM 6811 HD12 LEU B 356 40.268 0.060 45.339 1.00 0.00 H ATOM 6812 HD13 LEU B 356 39.103 -1.034 46.124 1.00 0.00 H ATOM 6813 H LEU B 356 37.047 2.852 47.491 1.00 0.00 H ATOM 6814 N ARG B 357 40.633 5.137 46.319 1.00 68.54 N ATOM 6815 CA ARG B 357 41.065 6.388 45.690 1.00 70.32 C ATOM 6816 C ARG B 357 40.033 6.943 44.712 1.00 71.52 C ATOM 6817 O ARG B 357 39.156 6.220 44.241 1.00 72.90 O ATOM 6818 CB ARG B 357 42.391 6.179 44.954 1.00 71.13 C ATOM 6819 CG ARG B 357 43.520 5.651 45.821 1.00 70.09 C ATOM 6820 CD ARG B 357 44.732 6.561 45.742 1.00 71.11 C ATOM 6821 NE ARG B 357 45.298 6.641 44.395 1.00 72.69 N ATOM 6822 CZ ARG B 357 45.960 5.654 43.795 1.00 73.45 C ATOM 6823 NH1 ARG B 357 46.145 4.498 44.420 1.00 74.18 N ATOM 6824 NH2 ARG B 357 46.447 5.825 42.572 1.00 72.18 N ATOM 6825 HA ARG B 357 41.187 7.115 46.493 1.00 0.00 H ATOM 6826 HB2 ARG B 357 42.223 5.468 44.145 1.00 0.00 H ATOM 6827 HB3 ARG B 357 42.702 7.136 44.536 1.00 0.00 H ATOM 6828 HG2 ARG B 357 43.181 5.596 46.855 1.00 0.00 H ATOM 6829 HG3 ARG B 357 43.798 4.654 45.478 1.00 0.00 H ATOM 6830 HD2 ARG B 357 45.497 6.181 46.419 1.00 0.00 H ATOM 6831 HD3 ARG B 357 44.436 7.562 46.055 1.00 0.00 H ATOM 6832 HE ARG B 357 45.175 7.530 43.870 1.00 0.00 H ATOM 6833 HH12 ARG B 357 46.663 3.729 43.949 1.00 0.00 H ATOM 6834 HH11 ARG B 357 45.772 4.361 45.381 1.00 0.00 H ATOM 6835 HH22 ARG B 357 46.964 5.052 42.105 1.00 0.00 H ATOM 6836 HH21 ARG B 357 46.312 6.731 42.080 1.00 0.00 H ATOM 6837 H ARG B 357 41.346 4.402 46.499 1.00 0.00 H ATOM 6838 N LYS B 358 40.150 8.228 44.398 1.00 72.49 N ATOM 6839 CA LYS B 358 39.212 8.886 43.493 1.00 73.21 C ATOM 6840 C LYS B 358 38.921 8.095 42.220 1.00 73.60 C ATOM 6841 O LYS B 358 37.757 7.918 41.847 1.00 73.95 O ATOM 6842 CB LYS B 358 39.723 10.283 43.114 1.00 74.17 C ATOM 6843 CG LYS B 358 39.662 11.335 44.225 1.00 75.75 C ATOM 6844 CD LYS B 358 40.572 11.012 45.411 1.00 76.68 C ATOM 6845 CE LYS B 358 39.872 10.153 46.454 1.00 76.47 C ATOM 6846 NZ LYS B 358 40.781 9.812 47.586 1.00 77.67 N ATOM 6847 HA LYS B 358 38.274 8.956 44.044 1.00 0.00 H ATOM 6848 HB2 LYS B 358 40.762 10.186 42.800 1.00 0.00 H ATOM 6849 HB3 LYS B 358 39.124 10.644 42.277 1.00 0.00 H ATOM 6850 HG2 LYS B 358 39.963 12.297 43.809 1.00 0.00 H ATOM 6851 HG3 LYS B 358 38.635 11.401 44.584 1.00 0.00 H ATOM 6852 HD2 LYS B 358 41.449 10.477 45.046 1.00 0.00 H ATOM 6853 HD3 LYS B 358 40.886 11.946 45.878 1.00 0.00 H ATOM 6854 HE2 LYS B 358 39.532 9.231 45.983 1.00 0.00 H ATOM 6855 HE3 LYS B 358 39.012 10.699 46.843 1.00 0.00 H ATOM 6856 HZ1 LYS B 358 41.601 9.285 47.224 1.00 0.00 H ATOM 6857 HZ2 LYS B 358 41.105 10.687 48.045 1.00 0.00 H ATOM 6858 HZ3 LYS B 358 40.269 9.226 48.276 1.00 0.00 H ATOM 6859 H LYS B 358 40.930 8.780 44.808 1.00 0.00 H ATOM 6860 N PRO B 359 39.971 7.604 41.537 1.00 72.97 N ATOM 6861 CA PRO B 359 39.811 6.832 40.296 1.00 72.19 C ATOM 6862 C PRO B 359 39.202 5.443 40.484 1.00 71.24 C ATOM 6863 O PRO B 359 38.280 5.056 39.769 1.00 70.74 O ATOM 6864 CB PRO B 359 41.239 6.741 39.751 1.00 72.47 C ATOM 6865 CG PRO B 359 41.963 7.890 40.422 1.00 73.56 C ATOM 6866 CD PRO B 359 41.396 7.855 41.808 1.00 73.08 C ATOM 6867 HA PRO B 359 39.104 7.319 39.624 1.00 0.00 H ATOM 6868 HD3 PRO B 359 41.837 7.052 42.399 1.00 0.00 H ATOM 6869 HD2 PRO B 359 41.542 8.805 42.322 1.00 0.00 H ATOM 6870 HG3 PRO B 359 41.744 8.837 39.929 1.00 0.00 H ATOM 6871 HG2 PRO B 359 43.041 7.727 40.431 1.00 0.00 H ATOM 6872 HB2 PRO B 359 41.695 5.787 40.017 1.00 0.00 H ATOM 6873 HB3 PRO B 359 41.248 6.857 38.667 1.00 0.00 H ATOM 6874 N PHE B 360 39.727 4.704 41.454 1.00 70.54 N ATOM 6875 CA PHE B 360 39.279 3.345 41.725 1.00 70.99 C ATOM 6876 C PHE B 360 37.990 3.232 42.535 1.00 71.69 C ATOM 6877 O PHE B 360 37.397 2.153 42.621 1.00 71.83 O ATOM 6878 CB PHE B 360 40.406 2.588 42.426 1.00 69.67 C ATOM 6879 CG PHE B 360 41.676 2.536 41.628 1.00 69.39 C ATOM 6880 CD1 PHE B 360 41.893 1.519 40.703 1.00 69.04 C ATOM 6881 CD2 PHE B 360 42.646 3.522 41.779 1.00 69.80 C ATOM 6882 CE1 PHE B 360 43.056 1.483 39.942 1.00 68.85 C ATOM 6883 CE2 PHE B 360 43.816 3.497 41.020 1.00 69.58 C ATOM 6884 CZ PHE B 360 44.021 2.476 40.101 1.00 69.57 C ATOM 6885 HA PHE B 360 39.037 2.907 40.757 1.00 0.00 H ATOM 6886 HB2 PHE B 360 40.614 3.080 43.376 1.00 0.00 H ATOM 6887 HB3 PHE B 360 40.073 1.567 42.613 1.00 0.00 H ATOM 6888 HD2 PHE B 360 42.490 4.324 42.500 1.00 0.00 H ATOM 6889 HE2 PHE B 360 44.567 4.276 41.148 1.00 0.00 H ATOM 6890 HZ PHE B 360 44.934 2.451 39.506 1.00 0.00 H ATOM 6891 HE1 PHE B 360 43.213 0.680 39.222 1.00 0.00 H ATOM 6892 HD1 PHE B 360 41.141 0.740 40.573 1.00 0.00 H ATOM 6893 H PHE B 360 40.484 5.109 42.040 1.00 0.00 H ATOM 6894 N GLY B 361 37.551 4.347 43.110 1.00 71.83 N ATOM 6895 CA GLY B 361 36.341 4.345 43.916 1.00 71.30 C ATOM 6896 C GLY B 361 35.036 4.138 43.171 1.00 70.13 C ATOM 6897 O GLY B 361 34.183 3.378 43.620 1.00 70.02 O ATOM 6898 HA3 GLY B 361 36.282 5.305 44.429 1.00 0.00 H ATOM 6899 HA2 GLY B 361 36.434 3.546 44.652 1.00 0.00 H ATOM 6900 H GLY B 361 38.080 5.233 42.982 1.00 0.00 H ATOM 6901 N ASP B 362 34.872 4.813 42.038 1.00 70.51 N ATOM 6902 CA ASP B 362 33.646 4.698 41.251 1.00 70.77 C ATOM 6903 C ASP B 362 33.780 3.650 40.148 1.00 70.55 C ATOM 6904 O ASP B 362 33.137 3.733 39.098 1.00 71.11 O ATOM 6905 CB ASP B 362 33.295 6.060 40.649 1.00 71.30 C ATOM 6906 CG ASP B 362 34.460 6.683 39.910 1.00 72.51 C ATOM 6907 OD1 ASP B 362 34.846 6.146 38.847 1.00 71.76 O ATOM 6908 OD2 ASP B 362 34.994 7.705 40.399 1.00 73.03 O ATOM 6909 HA ASP B 362 32.845 4.373 41.914 1.00 0.00 H ATOM 6910 HB2 ASP B 362 32.467 5.932 39.952 1.00 0.00 H ATOM 6911 HB3 ASP B 362 32.991 6.730 41.453 1.00 0.00 H ATOM 6912 H ASP B 362 35.634 5.437 41.704 1.00 0.00 H ATOM 6913 N PHE B 363 34.617 2.657 40.410 1.00 69.67 N ATOM 6914 CA PHE B 363 34.871 1.574 39.472 1.00 68.47 C ATOM 6915 C PHE B 363 33.736 0.554 39.505 1.00 67.47 C ATOM 6916 O PHE B 363 33.061 0.323 38.499 1.00 67.07 O ATOM 6917 CB PHE B 363 36.190 0.902 39.847 1.00 70.53 C ATOM 6918 CG PHE B 363 36.665 -0.113 38.855 1.00 71.48 C ATOM 6919 CD1 PHE B 363 36.925 0.251 37.540 1.00 72.41 C ATOM 6920 CD2 PHE B 363 36.888 -1.431 39.246 1.00 71.98 C ATOM 6921 CE1 PHE B 363 37.405 -0.685 36.627 1.00 73.10 C ATOM 6922 CE2 PHE B 363 37.367 -2.375 38.343 1.00 71.94 C ATOM 6923 CZ PHE B 363 37.627 -2.003 37.032 1.00 73.23 C ATOM 6924 HA PHE B 363 34.931 1.978 38.461 1.00 0.00 H ATOM 6925 HB2 PHE B 363 36.954 1.674 39.939 1.00 0.00 H ATOM 6926 HB3 PHE B 363 36.060 0.406 40.809 1.00 0.00 H ATOM 6927 HD2 PHE B 363 36.684 -1.727 40.275 1.00 0.00 H ATOM 6928 HE2 PHE B 363 37.537 -3.403 38.664 1.00 0.00 H ATOM 6929 HZ PHE B 363 38.004 -2.737 36.320 1.00 0.00 H ATOM 6930 HE1 PHE B 363 37.607 -0.389 35.598 1.00 0.00 H ATOM 6931 HD1 PHE B 363 36.752 1.278 37.220 1.00 0.00 H ATOM 6932 H PHE B 363 35.113 2.651 41.324 1.00 0.00 H ATOM 6933 N MET B 364 33.524 -0.043 40.675 1.00 66.02 N ATOM 6934 CA MET B 364 32.490 -1.056 40.860 1.00 63.99 C ATOM 6935 C MET B 364 31.073 -0.539 41.107 1.00 62.52 C ATOM 6936 O MET B 364 30.105 -1.285 40.952 1.00 62.90 O ATOM 6937 CB MET B 364 32.892 -1.991 42.001 1.00 63.99 C ATOM 6938 CG MET B 364 33.986 -2.973 41.630 1.00 65.18 C ATOM 6939 SD MET B 364 33.444 -4.147 40.371 1.00 67.09 S ATOM 6940 CE MET B 364 32.907 -5.492 41.368 1.00 65.19 C ATOM 6941 HA MET B 364 32.436 -1.572 39.902 1.00 0.00 H ATOM 6942 HB2 MET B 364 33.243 -1.384 42.836 1.00 0.00 H ATOM 6943 HB3 MET B 364 32.012 -2.556 42.309 1.00 0.00 H ATOM 6944 HG2 MET B 364 34.281 -3.525 42.522 1.00 0.00 H ATOM 6945 HG3 MET B 364 34.843 -2.418 41.248 1.00 0.00 H ATOM 6946 HE1 MET B 364 33.742 -5.854 41.968 1.00 0.00 H ATOM 6947 HE2 MET B 364 32.104 -5.158 42.025 1.00 0.00 H ATOM 6948 HE3 MET B 364 32.544 -6.295 40.727 1.00 0.00 H ATOM 6949 H MET B 364 34.117 0.222 41.487 1.00 0.00 H ATOM 6950 N GLU B 365 30.939 0.726 41.489 1.00 60.52 N ATOM 6951 CA GLU B 365 29.619 1.279 41.760 1.00 57.89 C ATOM 6952 C GLU B 365 28.595 1.071 40.646 1.00 55.82 C ATOM 6953 O GLU B 365 27.507 0.552 40.889 1.00 55.52 O ATOM 6954 CB GLU B 365 29.723 2.764 42.105 1.00 57.69 C ATOM 6955 CG GLU B 365 29.771 3.016 43.598 1.00 58.64 C ATOM 6956 CD GLU B 365 28.589 2.394 44.316 1.00 58.34 C ATOM 6957 OE1 GLU B 365 27.442 2.774 44.008 1.00 58.69 O ATOM 6958 OE2 GLU B 365 28.806 1.523 45.184 1.00 58.38 O ATOM 6959 HA GLU B 365 29.243 0.715 42.613 1.00 0.00 H ATOM 6960 HB2 GLU B 365 30.631 3.164 41.654 1.00 0.00 H ATOM 6961 HB3 GLU B 365 28.856 3.280 41.692 1.00 0.00 H ATOM 6962 HG2 GLU B 365 30.691 2.589 43.998 1.00 0.00 H ATOM 6963 HG3 GLU B 365 29.764 4.092 43.774 1.00 0.00 H ATOM 6964 H GLU B 365 31.782 1.326 41.595 1.00 0.00 H ATOM 6965 N PRO B 366 28.918 1.481 39.414 1.00 53.96 N ATOM 6966 CA PRO B 366 27.949 1.289 38.332 1.00 53.08 C ATOM 6967 C PRO B 366 27.526 -0.169 38.129 1.00 51.39 C ATOM 6968 O PRO B 366 26.423 -0.439 37.653 1.00 52.82 O ATOM 6969 CB PRO B 366 28.666 1.878 37.115 1.00 53.46 C ATOM 6970 CG PRO B 366 30.121 1.741 37.459 1.00 54.02 C ATOM 6971 CD PRO B 366 30.145 2.122 38.915 1.00 54.32 C ATOM 6972 HA PRO B 366 26.997 1.775 38.543 1.00 0.00 H ATOM 6973 HD3 PRO B 366 31.030 1.728 39.414 1.00 0.00 H ATOM 6974 HD2 PRO B 366 30.108 3.204 39.043 1.00 0.00 H ATOM 6975 HG3 PRO B 366 30.733 2.418 36.863 1.00 0.00 H ATOM 6976 HG2 PRO B 366 30.467 0.718 37.313 1.00 0.00 H ATOM 6977 HB2 PRO B 366 28.425 1.317 36.212 1.00 0.00 H ATOM 6978 HB3 PRO B 366 28.397 2.925 36.973 1.00 0.00 H ATOM 6979 N LYS B 367 28.395 -1.105 38.495 1.00 49.26 N ATOM 6980 CA LYS B 367 28.077 -2.525 38.351 1.00 48.35 C ATOM 6981 C LYS B 367 27.085 -2.939 39.437 1.00 46.29 C ATOM 6982 O LYS B 367 26.204 -3.767 39.201 1.00 46.38 O ATOM 6983 CB LYS B 367 29.337 -3.381 38.472 1.00 47.87 C ATOM 6984 CG LYS B 367 30.594 -2.712 37.984 1.00 51.45 C ATOM 6985 CD LYS B 367 30.616 -2.515 36.485 1.00 54.40 C ATOM 6986 CE LYS B 367 31.960 -1.915 36.074 1.00 57.37 C ATOM 6987 NZ LYS B 367 32.130 -1.814 34.603 1.00 60.95 N ATOM 6988 HA LYS B 367 27.641 -2.680 37.364 1.00 0.00 H ATOM 6989 HB2 LYS B 367 29.474 -3.640 39.522 1.00 0.00 H ATOM 6990 HB3 LYS B 367 29.188 -4.291 37.891 1.00 0.00 H ATOM 6991 HG2 LYS B 367 30.677 -1.737 38.464 1.00 0.00 H ATOM 6992 HG3 LYS B 367 31.448 -3.328 38.266 1.00 0.00 H ATOM 6993 HD2 LYS B 367 30.479 -3.476 35.989 1.00 0.00 H ATOM 6994 HD3 LYS B 367 29.811 -1.840 36.194 1.00 0.00 H ATOM 6995 HE2 LYS B 367 32.757 -2.543 36.473 1.00 0.00 H ATOM 6996 HE3 LYS B 367 32.039 -0.915 36.502 1.00 0.00 H ATOM 6997 HZ1 LYS B 367 32.067 -2.763 34.182 1.00 0.00 H ATOM 6998 HZ2 LYS B 367 31.382 -1.209 34.210 1.00 0.00 H ATOM 6999 HZ3 LYS B 367 33.060 -1.400 34.390 1.00 0.00 H ATOM 7000 H LYS B 367 29.315 -0.824 38.890 1.00 0.00 H ATOM 7001 N PHE B 368 27.237 -2.369 40.630 1.00 43.73 N ATOM 7002 CA PHE B 368 26.331 -2.680 41.731 1.00 43.52 C ATOM 7003 C PHE B 368 24.939 -2.177 41.385 1.00 42.34 C ATOM 7004 O PHE B 368 23.952 -2.840 41.676 1.00 44.47 O ATOM 7005 CB PHE B 368 26.809 -2.037 43.044 1.00 43.09 C ATOM 7006 CG PHE B 368 27.861 -2.838 43.771 1.00 42.34 C ATOM 7007 CD1 PHE B 368 27.526 -4.018 44.429 1.00 41.54 C ATOM 7008 CD2 PHE B 368 29.192 -2.430 43.773 1.00 42.54 C ATOM 7009 CE1 PHE B 368 28.502 -4.783 45.075 1.00 40.33 C ATOM 7010 CE2 PHE B 368 30.177 -3.188 44.418 1.00 40.85 C ATOM 7011 CZ PHE B 368 29.828 -4.368 45.068 1.00 40.01 C ATOM 7012 HA PHE B 368 26.313 -3.760 41.875 1.00 0.00 H ATOM 7013 HB2 PHE B 368 27.223 -1.055 42.815 1.00 0.00 H ATOM 7014 HB3 PHE B 368 25.949 -1.922 43.703 1.00 0.00 H ATOM 7015 HD2 PHE B 368 29.471 -1.507 43.265 1.00 0.00 H ATOM 7016 HE2 PHE B 368 31.215 -2.855 44.411 1.00 0.00 H ATOM 7017 HZ PHE B 368 30.591 -4.964 45.569 1.00 0.00 H ATOM 7018 HE1 PHE B 368 28.222 -5.705 45.584 1.00 0.00 H ATOM 7019 HD1 PHE B 368 26.488 -4.350 44.441 1.00 0.00 H ATOM 7020 H PHE B 368 28.012 -1.692 40.780 1.00 0.00 H ATOM 7021 N GLU B 369 24.865 -1.006 40.758 1.00 42.28 N ATOM 7022 CA GLU B 369 23.583 -0.427 40.365 1.00 43.00 C ATOM 7023 C GLU B 369 22.918 -1.311 39.323 1.00 41.76 C ATOM 7024 O GLU B 369 21.721 -1.581 39.399 1.00 40.75 O ATOM 7025 CB GLU B 369 23.772 0.973 39.779 1.00 45.42 C ATOM 7026 CG GLU B 369 24.553 1.927 40.666 1.00 49.35 C ATOM 7027 CD GLU B 369 24.556 3.344 40.127 1.00 51.01 C ATOM 7028 OE1 GLU B 369 24.735 3.519 38.905 1.00 53.09 O ATOM 7029 OE2 GLU B 369 24.390 4.286 40.926 1.00 54.81 O ATOM 7030 HA GLU B 369 22.956 -0.357 41.254 1.00 0.00 H ATOM 7031 HB2 GLU B 369 24.302 0.877 38.832 1.00 0.00 H ATOM 7032 HB3 GLU B 369 22.787 1.403 39.600 1.00 0.00 H ATOM 7033 HG2 GLU B 369 24.103 1.931 41.659 1.00 0.00 H ATOM 7034 HG3 GLU B 369 25.583 1.577 40.737 1.00 0.00 H ATOM 7035 H GLU B 369 25.742 -0.490 40.542 1.00 0.00 H ATOM 7036 N PHE B 370 23.699 -1.749 38.340 1.00 41.27 N ATOM 7037 CA PHE B 370 23.174 -2.620 37.301 1.00 41.02 C ATOM 7038 C PHE B 370 22.731 -3.950 37.918 1.00 39.18 C ATOM 7039 O PHE B 370 21.637 -4.430 37.642 1.00 39.37 O ATOM 7040 CB PHE B 370 24.237 -2.886 36.221 1.00 42.12 C ATOM 7041 CG PHE B 370 23.847 -3.966 35.248 1.00 41.24 C ATOM 7042 CD1 PHE B 370 22.888 -3.729 34.269 1.00 41.49 C ATOM 7043 CD2 PHE B 370 24.401 -5.238 35.344 1.00 41.88 C ATOM 7044 CE1 PHE B 370 22.485 -4.747 33.399 1.00 40.60 C ATOM 7045 CE2 PHE B 370 24.005 -6.263 34.482 1.00 39.63 C ATOM 7046 CZ PHE B 370 23.048 -6.020 33.509 1.00 39.61 C ATOM 7047 HA PHE B 370 22.321 -2.126 36.836 1.00 0.00 H ATOM 7048 HB2 PHE B 370 24.403 -1.963 35.665 1.00 0.00 H ATOM 7049 HB3 PHE B 370 25.163 -3.183 36.714 1.00 0.00 H ATOM 7050 HD2 PHE B 370 25.156 -5.438 36.104 1.00 0.00 H ATOM 7051 HE2 PHE B 370 24.449 -7.254 34.574 1.00 0.00 H ATOM 7052 HZ PHE B 370 22.737 -6.818 32.834 1.00 0.00 H ATOM 7053 HE1 PHE B 370 21.733 -4.547 32.636 1.00 0.00 H ATOM 7054 HD1 PHE B 370 22.445 -2.737 34.179 1.00 0.00 H ATOM 7055 H PHE B 370 24.699 -1.465 38.314 1.00 0.00 H ATOM 7056 N ALA B 371 23.582 -4.530 38.759 1.00 38.79 N ATOM 7057 CA ALA B 371 23.288 -5.815 39.397 1.00 38.71 C ATOM 7058 C ALA B 371 22.007 -5.777 40.207 1.00 40.26 C ATOM 7059 O ALA B 371 21.214 -6.728 40.176 1.00 41.86 O ATOM 7060 CB ALA B 371 24.453 -6.243 40.289 1.00 36.05 C ATOM 7061 HA ALA B 371 23.150 -6.544 38.598 1.00 0.00 H ATOM 7062 HB1 ALA B 371 25.354 -6.343 39.684 1.00 0.00 H ATOM 7063 HB2 ALA B 371 24.614 -5.490 41.061 1.00 0.00 H ATOM 7064 HB3 ALA B 371 24.219 -7.200 40.756 1.00 0.00 H ATOM 7065 H ALA B 371 24.484 -4.057 38.970 1.00 0.00 H ATOM 7066 N VAL B 372 21.800 -4.691 40.944 1.00 39.79 N ATOM 7067 CA VAL B 372 20.591 -4.575 41.747 1.00 40.62 C ATOM 7068 C VAL B 372 19.386 -4.706 40.837 1.00 40.05 C ATOM 7069 O VAL B 372 18.482 -5.491 41.099 1.00 40.79 O ATOM 7070 CB VAL B 372 20.531 -3.226 42.502 1.00 42.57 C ATOM 7071 CG1 VAL B 372 19.139 -3.019 43.092 1.00 43.97 C ATOM 7072 CG2 VAL B 372 21.568 -3.220 43.632 1.00 42.71 C ATOM 7073 HA VAL B 372 20.595 -5.369 42.494 1.00 0.00 H ATOM 7074 HB VAL B 372 20.748 -2.419 41.802 1.00 0.00 H ATOM 7075 HG11 VAL B 372 18.402 -3.014 42.289 1.00 0.00 H ATOM 7076 HG12 VAL B 372 18.916 -3.829 43.786 1.00 0.00 H ATOM 7077 HG13 VAL B 372 19.108 -2.067 43.621 1.00 0.00 H ATOM 7078 HG21 VAL B 372 21.353 -4.033 44.325 1.00 0.00 H ATOM 7079 HG22 VAL B 372 22.564 -3.355 43.210 1.00 0.00 H ATOM 7080 HG23 VAL B 372 21.522 -2.268 44.161 1.00 0.00 H ATOM 7081 H VAL B 372 22.502 -3.924 40.947 1.00 0.00 H ATOM 7082 N LYS B 373 19.376 -3.941 39.756 1.00 40.96 N ATOM 7083 CA LYS B 373 18.266 -4.008 38.813 1.00 40.74 C ATOM 7084 C LYS B 373 18.224 -5.364 38.105 1.00 39.07 C ATOM 7085 O LYS B 373 17.164 -5.962 37.968 1.00 39.60 O ATOM 7086 CB LYS B 373 18.371 -2.878 37.776 1.00 42.74 C ATOM 7087 CG LYS B 373 18.018 -1.492 38.318 1.00 46.50 C ATOM 7088 CD LYS B 373 18.075 -0.408 37.235 1.00 49.55 C ATOM 7089 CE LYS B 373 19.506 -0.136 36.769 1.00 52.25 C ATOM 7090 NZ LYS B 373 19.551 0.892 35.683 1.00 55.54 N ATOM 7091 HA LYS B 373 17.342 -3.887 39.378 1.00 0.00 H ATOM 7092 HB2 LYS B 373 19.395 -2.849 37.405 1.00 0.00 H ATOM 7093 HB3 LYS B 373 17.694 -3.106 36.953 1.00 0.00 H ATOM 7094 HG2 LYS B 373 17.009 -1.523 38.729 1.00 0.00 H ATOM 7095 HG3 LYS B 373 18.723 -1.235 39.108 1.00 0.00 H ATOM 7096 HD2 LYS B 373 17.482 -0.733 36.380 1.00 0.00 H ATOM 7097 HD3 LYS B 373 17.655 0.514 37.637 1.00 0.00 H ATOM 7098 HE2 LYS B 373 19.938 -1.064 36.395 1.00 0.00 H ATOM 7099 HE3 LYS B 373 20.092 0.220 37.617 1.00 0.00 H ATOM 7100 HZ1 LYS B 373 19.000 0.557 34.867 1.00 0.00 H ATOM 7101 HZ2 LYS B 373 19.146 1.783 36.034 1.00 0.00 H ATOM 7102 HZ3 LYS B 373 20.538 1.048 35.395 1.00 0.00 H ATOM 7103 H LYS B 373 20.166 -3.288 39.578 1.00 0.00 H ATOM 7104 N PHE B 374 19.376 -5.859 37.663 1.00 37.77 N ATOM 7105 CA PHE B 374 19.395 -7.138 36.963 1.00 36.70 C ATOM 7106 C PHE B 374 18.865 -8.269 37.849 1.00 34.94 C ATOM 7107 O PHE B 374 18.003 -9.032 37.425 1.00 32.23 O ATOM 7108 CB PHE B 374 20.807 -7.479 36.478 1.00 34.37 C ATOM 7109 CG PHE B 374 20.850 -8.627 35.498 1.00 35.51 C ATOM 7110 CD1 PHE B 374 20.421 -8.452 34.182 1.00 33.98 C ATOM 7111 CD2 PHE B 374 21.313 -9.883 35.891 1.00 32.14 C ATOM 7112 CE1 PHE B 374 20.456 -9.516 33.270 1.00 35.55 C ATOM 7113 CE2 PHE B 374 21.349 -10.947 34.988 1.00 33.96 C ATOM 7114 CZ PHE B 374 20.922 -10.769 33.676 1.00 31.19 C ATOM 7115 HA PHE B 374 18.739 -7.040 36.098 1.00 0.00 H ATOM 7116 HB2 PHE B 374 21.228 -6.597 35.995 1.00 0.00 H ATOM 7117 HB3 PHE B 374 21.415 -7.742 37.344 1.00 0.00 H ATOM 7118 HD2 PHE B 374 21.651 -10.035 36.916 1.00 0.00 H ATOM 7119 HE2 PHE B 374 21.713 -11.922 35.312 1.00 0.00 H ATOM 7120 HZ PHE B 374 20.951 -11.600 32.971 1.00 0.00 H ATOM 7121 HE1 PHE B 374 20.120 -9.366 32.244 1.00 0.00 H ATOM 7122 HD1 PHE B 374 20.055 -7.477 33.860 1.00 0.00 H ATOM 7123 H PHE B 374 20.261 -5.335 37.816 1.00 0.00 H ATOM 7124 N ASN B 375 19.356 -8.357 39.084 1.00 34.78 N ATOM 7125 CA ASN B 375 18.914 -9.415 39.991 1.00 36.46 C ATOM 7126 C ASN B 375 17.428 -9.353 40.363 1.00 36.99 C ATOM 7127 O ASN B 375 16.851 -10.348 40.815 1.00 36.03 O ATOM 7128 CB ASN B 375 19.783 -9.433 41.252 1.00 35.80 C ATOM 7129 CG ASN B 375 21.227 -9.844 40.957 1.00 38.48 C ATOM 7130 OD1 ASN B 375 21.504 -10.505 39.953 1.00 38.89 O ATOM 7131 ND2 ASN B 375 22.147 -9.458 41.831 1.00 39.86 N ATOM 7132 HA ASN B 375 19.037 -10.347 39.439 1.00 0.00 H ATOM 7133 HB2 ASN B 375 19.785 -8.435 41.691 1.00 0.00 H ATOM 7134 HB3 ASN B 375 19.355 -10.140 41.963 1.00 0.00 H ATOM 7135 HD22 ASN B 375 21.871 -8.901 42.665 1.00 0.00 H ATOM 7136 HD21 ASN B 375 23.145 -9.712 41.682 1.00 0.00 H ATOM 7137 H ASN B 375 20.062 -7.665 39.407 1.00 0.00 H ATOM 7138 N ALA B 376 16.803 -8.196 40.157 1.00 36.74 N ATOM 7139 CA ALA B 376 15.382 -8.050 40.460 1.00 37.65 C ATOM 7140 C ALA B 376 14.566 -8.939 39.517 1.00 37.56 C ATOM 7141 O ALA B 376 13.371 -9.128 39.699 1.00 38.68 O ATOM 7142 CB ALA B 376 14.953 -6.586 40.311 1.00 37.58 C ATOM 7143 HA ALA B 376 15.202 -8.357 41.490 1.00 0.00 H ATOM 7144 HB1 ALA B 376 15.529 -5.968 41.000 1.00 0.00 H ATOM 7145 HB2 ALA B 376 15.134 -6.258 39.287 1.00 0.00 H ATOM 7146 HB3 ALA B 376 13.891 -6.495 40.540 1.00 0.00 H ATOM 7147 H ALA B 376 17.333 -7.386 39.776 1.00 0.00 H ATOM 7148 N LEU B 377 15.223 -9.480 38.500 1.00 37.99 N ATOM 7149 CA LEU B 377 14.563 -10.361 37.550 1.00 36.62 C ATOM 7150 C LEU B 377 14.551 -11.801 38.067 1.00 35.11 C ATOM 7151 O LEU B 377 13.857 -12.656 37.535 1.00 35.21 O ATOM 7152 CB LEU B 377 15.276 -10.298 36.198 1.00 35.49 C ATOM 7153 CG LEU B 377 15.286 -8.917 35.542 1.00 36.28 C ATOM 7154 CD1 LEU B 377 15.837 -9.053 34.145 1.00 36.84 C ATOM 7155 CD2 LEU B 377 13.872 -8.337 35.498 1.00 32.56 C ATOM 7156 HA LEU B 377 13.532 -10.029 37.429 1.00 0.00 H ATOM 7157 HB2 LEU B 377 16.310 -10.612 36.344 1.00 0.00 H ATOM 7158 HB3 LEU B 377 14.780 -10.992 35.520 1.00 0.00 H ATOM 7159 HG LEU B 377 15.911 -8.239 36.123 1.00 0.00 H ATOM 7160 HD21 LEU B 377 13.227 -9.000 34.921 1.00 0.00 H ATOM 7161 HD22 LEU B 377 13.487 -8.245 36.513 1.00 0.00 H ATOM 7162 HD23 LEU B 377 13.898 -7.354 35.028 1.00 0.00 H ATOM 7163 HD11 LEU B 377 16.851 -9.449 34.193 1.00 0.00 H ATOM 7164 HD12 LEU B 377 15.207 -9.733 33.572 1.00 0.00 H ATOM 7165 HD13 LEU B 377 15.850 -8.075 33.664 1.00 0.00 H ATOM 7166 H LEU B 377 16.234 -9.269 38.379 1.00 0.00 H ATOM 7167 N GLU B 378 15.341 -12.069 39.096 1.00 36.37 N ATOM 7168 CA GLU B 378 15.386 -13.409 39.676 1.00 38.46 C ATOM 7169 C GLU B 378 15.559 -14.536 38.662 1.00 36.03 C ATOM 7170 O GLU B 378 14.805 -15.499 38.656 1.00 34.25 O ATOM 7171 CB GLU B 378 14.123 -13.648 40.501 1.00 40.69 C ATOM 7172 CG GLU B 378 14.150 -12.928 41.836 1.00 46.55 C ATOM 7173 CD GLU B 378 12.800 -12.894 42.507 1.00 50.29 C ATOM 7174 OE1 GLU B 378 12.052 -13.888 42.392 1.00 52.43 O ATOM 7175 OE2 GLU B 378 12.492 -11.873 43.159 1.00 54.18 O ATOM 7176 HA GLU B 378 16.278 -13.436 40.301 1.00 0.00 H ATOM 7177 HB2 GLU B 378 13.263 -13.296 39.932 1.00 0.00 H ATOM 7178 HB3 GLU B 378 14.023 -14.718 40.684 1.00 0.00 H ATOM 7179 HG2 GLU B 378 14.854 -13.438 42.494 1.00 0.00 H ATOM 7180 HG3 GLU B 378 14.485 -11.903 41.673 1.00 0.00 H ATOM 7181 H GLU B 378 15.937 -11.316 39.496 1.00 0.00 H ATOM 7182 N LEU B 379 16.554 -14.401 37.796 1.00 35.53 N ATOM 7183 CA LEU B 379 16.841 -15.430 36.814 1.00 36.12 C ATOM 7184 C LEU B 379 17.723 -16.478 37.495 1.00 35.88 C ATOM 7185 O LEU B 379 18.391 -16.185 38.482 1.00 35.53 O ATOM 7186 CB LEU B 379 17.602 -14.827 35.631 1.00 36.09 C ATOM 7187 CG LEU B 379 16.872 -14.174 34.451 1.00 37.12 C ATOM 7188 CD1 LEU B 379 15.681 -13.385 34.913 1.00 39.01 C ATOM 7189 CD2 LEU B 379 17.857 -13.298 33.702 1.00 35.26 C ATOM 7190 HA LEU B 379 15.915 -15.872 36.445 1.00 0.00 H ATOM 7191 HB2 LEU B 379 18.259 -14.063 36.046 1.00 0.00 H ATOM 7192 HB3 LEU B 379 18.204 -15.633 35.211 1.00 0.00 H ATOM 7193 HG LEU B 379 16.492 -14.948 33.785 1.00 0.00 H ATOM 7194 HD21 LEU B 379 18.242 -12.530 34.373 1.00 0.00 H ATOM 7195 HD22 LEU B 379 18.682 -13.910 33.337 1.00 0.00 H ATOM 7196 HD23 LEU B 379 17.353 -12.826 32.859 1.00 0.00 H ATOM 7197 HD11 LEU B 379 14.985 -14.048 35.427 1.00 0.00 H ATOM 7198 HD12 LEU B 379 16.009 -12.600 35.595 1.00 0.00 H ATOM 7199 HD13 LEU B 379 15.188 -12.936 34.051 1.00 0.00 H ATOM 7200 H LEU B 379 17.139 -13.542 37.821 1.00 0.00 H ATOM 7201 N ASP B 380 17.722 -17.702 36.988 1.00 36.47 N ATOM 7202 CA ASP B 380 18.592 -18.715 37.559 1.00 36.98 C ATOM 7203 C ASP B 380 19.576 -19.119 36.480 1.00 36.77 C ATOM 7204 O ASP B 380 19.571 -18.557 35.389 1.00 37.45 O ATOM 7205 CB ASP B 380 17.802 -19.930 38.045 1.00 38.45 C ATOM 7206 CG ASP B 380 16.921 -20.517 36.979 1.00 41.02 C ATOM 7207 OD1 ASP B 380 17.374 -20.629 35.815 1.00 43.70 O ATOM 7208 OD2 ASP B 380 15.776 -20.882 37.310 1.00 44.32 O ATOM 7209 HA ASP B 380 19.108 -18.312 38.430 1.00 0.00 H ATOM 7210 HB2 ASP B 380 18.506 -20.694 38.375 1.00 0.00 H ATOM 7211 HB3 ASP B 380 17.177 -19.626 38.885 1.00 0.00 H ATOM 7212 H ASP B 380 17.102 -17.936 36.186 1.00 0.00 H ATOM 7213 N ASP B 381 20.419 -20.096 36.780 1.00 35.80 N ATOM 7214 CA ASP B 381 21.413 -20.555 35.829 1.00 33.88 C ATOM 7215 C ASP B 381 20.854 -21.069 34.494 1.00 33.10 C ATOM 7216 O ASP B 381 21.415 -20.792 33.438 1.00 33.49 O ATOM 7217 CB ASP B 381 22.284 -21.616 36.499 1.00 34.76 C ATOM 7218 CG ASP B 381 22.901 -21.118 37.794 1.00 36.10 C ATOM 7219 OD1 ASP B 381 22.421 -21.514 38.877 1.00 38.22 O ATOM 7220 OD2 ASP B 381 23.858 -20.311 37.730 1.00 38.72 O ATOM 7221 HA ASP B 381 22.001 -19.680 35.553 1.00 0.00 H ATOM 7222 HB2 ASP B 381 21.669 -22.489 36.716 1.00 0.00 H ATOM 7223 HB3 ASP B 381 23.084 -21.897 35.814 1.00 0.00 H ATOM 7224 H ASP B 381 20.367 -20.543 37.717 1.00 0.00 H ATOM 7225 N SER B 382 19.755 -21.814 34.520 1.00 32.88 N ATOM 7226 CA SER B 382 19.191 -22.315 33.269 1.00 31.40 C ATOM 7227 C SER B 382 18.790 -21.131 32.381 1.00 28.47 C ATOM 7228 O SER B 382 19.000 -21.161 31.179 1.00 28.07 O ATOM 7229 CB SER B 382 17.984 -23.221 33.539 1.00 31.33 C ATOM 7230 OG SER B 382 16.970 -22.532 34.251 1.00 35.60 O ATOM 7231 HA SER B 382 19.944 -22.911 32.754 1.00 0.00 H ATOM 7232 HB2 SER B 382 18.309 -24.080 34.126 1.00 0.00 H ATOM 7233 HB3 SER B 382 17.579 -23.565 32.588 1.00 0.00 H ATOM 7234 HG SER B 382 17.331 -22.221 35.119 1.00 0.00 H ATOM 7235 H SER B 382 19.298 -22.040 35.427 1.00 0.00 H ATOM 7236 N ASP B 383 18.225 -20.085 32.972 1.00 29.27 N ATOM 7237 CA ASP B 383 17.848 -18.899 32.188 1.00 30.05 C ATOM 7238 C ASP B 383 19.095 -18.158 31.704 1.00 28.26 C ATOM 7239 O ASP B 383 19.226 -17.846 30.512 1.00 30.10 O ATOM 7240 CB ASP B 383 17.008 -17.929 33.022 1.00 29.51 C ATOM 7241 CG ASP B 383 15.785 -18.576 33.606 1.00 29.28 C ATOM 7242 OD1 ASP B 383 15.120 -19.339 32.871 1.00 29.74 O ATOM 7243 OD2 ASP B 383 15.486 -18.308 34.795 1.00 30.86 O ATOM 7244 HA ASP B 383 17.263 -19.248 31.337 1.00 0.00 H ATOM 7245 HB2 ASP B 383 17.623 -17.546 33.836 1.00 0.00 H ATOM 7246 HB3 ASP B 383 16.695 -17.102 32.385 1.00 0.00 H ATOM 7247 H ASP B 383 18.048 -20.104 33.997 1.00 0.00 H ATOM 7248 N LEU B 384 20.011 -17.888 32.628 1.00 25.90 N ATOM 7249 CA LEU B 384 21.236 -17.170 32.296 1.00 27.64 C ATOM 7250 C LEU B 384 22.077 -17.852 31.228 1.00 28.87 C ATOM 7251 O LEU B 384 22.720 -17.179 30.412 1.00 29.36 O ATOM 7252 CB LEU B 384 22.084 -16.954 33.553 1.00 27.57 C ATOM 7253 CG LEU B 384 21.538 -15.976 34.588 1.00 28.46 C ATOM 7254 CD1 LEU B 384 22.415 -16.015 35.839 1.00 28.91 C ATOM 7255 CD2 LEU B 384 21.523 -14.564 33.990 1.00 31.21 C ATOM 7256 HA LEU B 384 20.917 -16.213 31.882 1.00 0.00 H ATOM 7257 HB2 LEU B 384 22.202 -17.921 34.042 1.00 0.00 H ATOM 7258 HB3 LEU B 384 23.060 -16.588 33.234 1.00 0.00 H ATOM 7259 HG LEU B 384 20.521 -16.256 34.864 1.00 0.00 H ATOM 7260 HD21 LEU B 384 22.538 -14.277 33.714 1.00 0.00 H ATOM 7261 HD22 LEU B 384 20.888 -14.553 33.104 1.00 0.00 H ATOM 7262 HD23 LEU B 384 21.133 -13.863 34.728 1.00 0.00 H ATOM 7263 HD11 LEU B 384 22.410 -17.023 36.253 1.00 0.00 H ATOM 7264 HD12 LEU B 384 23.435 -15.734 35.575 1.00 0.00 H ATOM 7265 HD13 LEU B 384 22.023 -15.316 36.578 1.00 0.00 H ATOM 7266 H LEU B 384 19.851 -18.195 33.609 1.00 0.00 H ATOM 7267 N ALA B 385 22.087 -19.184 31.224 1.00 29.49 N ATOM 7268 CA ALA B 385 22.869 -19.907 30.228 1.00 28.65 C ATOM 7269 C ALA B 385 22.450 -19.518 28.819 1.00 27.85 C ATOM 7270 O ALA B 385 23.301 -19.306 27.947 1.00 27.67 O ATOM 7271 CB ALA B 385 22.718 -21.419 30.423 1.00 29.61 C ATOM 7272 HA ALA B 385 23.916 -19.636 30.362 1.00 0.00 H ATOM 7273 HB1 ALA B 385 23.070 -21.693 31.418 1.00 0.00 H ATOM 7274 HB2 ALA B 385 21.669 -21.694 30.319 1.00 0.00 H ATOM 7275 HB3 ALA B 385 23.309 -21.942 29.671 1.00 0.00 H ATOM 7276 H ALA B 385 21.536 -19.709 31.933 1.00 0.00 H ATOM 7277 N ILE B 386 21.142 -19.424 28.590 1.00 28.31 N ATOM 7278 CA ILE B 386 20.627 -19.057 27.269 1.00 29.04 C ATOM 7279 C ILE B 386 20.913 -17.579 26.986 1.00 26.83 C ATOM 7280 O ILE B 386 21.363 -17.209 25.888 1.00 24.46 O ATOM 7281 CB ILE B 386 19.101 -19.252 27.176 1.00 33.75 C ATOM 7282 CG1 ILE B 386 18.672 -20.522 27.928 1.00 35.22 C ATOM 7283 CG2 ILE B 386 18.681 -19.313 25.713 1.00 31.04 C ATOM 7284 CD1 ILE B 386 18.864 -21.786 27.178 1.00 37.53 C ATOM 7285 HA ILE B 386 21.124 -19.704 26.546 1.00 0.00 H ATOM 7286 HB ILE B 386 18.602 -18.405 27.647 1.00 0.00 H ATOM 7287 HG12 ILE B 386 19.252 -20.583 28.849 1.00 0.00 H ATOM 7288 HG13 ILE B 386 17.614 -20.430 28.172 1.00 0.00 H ATOM 7289 HD11 ILE B 386 18.280 -21.753 26.258 1.00 0.00 H ATOM 7290 HD12 ILE B 386 19.920 -21.906 26.936 1.00 0.00 H ATOM 7291 HD13 ILE B 386 18.533 -22.624 27.791 1.00 0.00 H ATOM 7292 HG21 ILE B 386 18.958 -18.383 25.218 1.00 0.00 H ATOM 7293 HG22 ILE B 386 19.184 -20.149 25.227 1.00 0.00 H ATOM 7294 HG23 ILE B 386 17.602 -19.451 25.652 1.00 0.00 H ATOM 7295 H ILE B 386 20.473 -19.615 29.363 1.00 0.00 H ATOM 7296 N PHE B 387 20.652 -16.733 27.979 1.00 27.75 N ATOM 7297 CA PHE B 387 20.880 -15.299 27.825 1.00 27.01 C ATOM 7298 C PHE B 387 22.313 -14.995 27.380 1.00 26.87 C ATOM 7299 O PHE B 387 22.540 -14.251 26.423 1.00 26.86 O ATOM 7300 CB PHE B 387 20.580 -14.568 29.135 1.00 28.07 C ATOM 7301 CG PHE B 387 20.709 -13.071 29.034 1.00 27.64 C ATOM 7302 CD1 PHE B 387 20.007 -12.365 28.065 1.00 28.14 C ATOM 7303 CD2 PHE B 387 21.533 -12.372 29.900 1.00 26.55 C ATOM 7304 CE1 PHE B 387 20.128 -10.981 27.963 1.00 27.89 C ATOM 7305 CE2 PHE B 387 21.662 -10.992 29.808 1.00 28.30 C ATOM 7306 CZ PHE B 387 20.959 -10.292 28.837 1.00 25.49 C ATOM 7307 HA PHE B 387 20.203 -14.945 27.047 1.00 0.00 H ATOM 7308 HB2 PHE B 387 19.560 -14.807 29.437 1.00 0.00 H ATOM 7309 HB3 PHE B 387 21.276 -14.923 29.895 1.00 0.00 H ATOM 7310 HD2 PHE B 387 22.089 -12.913 30.666 1.00 0.00 H ATOM 7311 HE2 PHE B 387 22.315 -10.459 30.498 1.00 0.00 H ATOM 7312 HZ PHE B 387 21.058 -9.209 28.761 1.00 0.00 H ATOM 7313 HE1 PHE B 387 19.571 -10.439 27.198 1.00 0.00 H ATOM 7314 HD1 PHE B 387 19.354 -12.901 27.376 1.00 0.00 H ATOM 7315 H PHE B 387 20.280 -17.099 28.879 1.00 0.00 H ATOM 7316 N ILE B 388 23.285 -15.587 28.062 1.00 27.55 N ATOM 7317 CA ILE B 388 24.681 -15.357 27.713 1.00 27.66 C ATOM 7318 C ILE B 388 24.969 -15.706 26.260 1.00 28.19 C ATOM 7319 O ILE B 388 25.744 -15.026 25.591 1.00 26.62 O ATOM 7320 CB ILE B 388 25.601 -16.165 28.650 1.00 32.07 C ATOM 7321 CG1 ILE B 388 25.562 -15.541 30.049 1.00 32.83 C ATOM 7322 CG2 ILE B 388 27.023 -16.192 28.122 1.00 28.85 C ATOM 7323 CD1 ILE B 388 26.286 -16.386 31.096 1.00 41.12 C ATOM 7324 HA ILE B 388 24.882 -14.293 27.839 1.00 0.00 H ATOM 7325 HB ILE B 388 25.246 -17.194 28.698 1.00 0.00 H ATOM 7326 HG12 ILE B 388 26.034 -14.560 30.006 1.00 0.00 H ATOM 7327 HG13 ILE B 388 24.521 -15.429 30.351 1.00 0.00 H ATOM 7328 HD11 ILE B 388 25.817 -17.368 31.156 1.00 0.00 H ATOM 7329 HD12 ILE B 388 27.332 -16.498 30.810 1.00 0.00 H ATOM 7330 HD13 ILE B 388 26.224 -15.892 32.066 1.00 0.00 H ATOM 7331 HG21 ILE B 388 27.034 -16.654 27.135 1.00 0.00 H ATOM 7332 HG22 ILE B 388 27.402 -15.173 28.051 1.00 0.00 H ATOM 7333 HG23 ILE B 388 27.651 -16.768 28.802 1.00 0.00 H ATOM 7334 H ILE B 388 23.049 -16.220 28.852 1.00 0.00 H ATOM 7335 N ALA B 389 24.328 -16.762 25.766 1.00 28.47 N ATOM 7336 CA ALA B 389 24.526 -17.193 24.391 1.00 29.18 C ATOM 7337 C ALA B 389 23.967 -16.144 23.411 1.00 28.47 C ATOM 7338 O ALA B 389 24.578 -15.854 22.384 1.00 27.12 O ATOM 7339 CB ALA B 389 23.860 -18.551 24.180 1.00 26.24 C ATOM 7340 HA ALA B 389 25.594 -17.293 24.196 1.00 0.00 H ATOM 7341 HB1 ALA B 389 24.304 -19.281 24.857 1.00 0.00 H ATOM 7342 HB2 ALA B 389 22.793 -18.466 24.384 1.00 0.00 H ATOM 7343 HB3 ALA B 389 24.010 -18.871 23.149 1.00 0.00 H ATOM 7344 H ALA B 389 23.672 -17.290 26.376 1.00 0.00 H ATOM 7345 N VAL B 390 22.804 -15.591 23.742 1.00 28.45 N ATOM 7346 CA VAL B 390 22.173 -14.553 22.936 1.00 26.31 C ATOM 7347 C VAL B 390 23.176 -13.399 22.786 1.00 26.38 C ATOM 7348 O VAL B 390 23.437 -12.918 21.687 1.00 30.05 O ATOM 7349 CB VAL B 390 20.873 -14.047 23.640 1.00 25.74 C ATOM 7350 CG1 VAL B 390 20.375 -12.759 23.003 1.00 23.96 C ATOM 7351 CG2 VAL B 390 19.799 -15.115 23.557 1.00 25.34 C ATOM 7352 HA VAL B 390 21.899 -14.945 21.957 1.00 0.00 H ATOM 7353 HB VAL B 390 21.103 -13.842 24.686 1.00 0.00 H ATOM 7354 HG11 VAL B 390 21.143 -11.991 23.092 1.00 0.00 H ATOM 7355 HG12 VAL B 390 20.157 -12.937 21.950 1.00 0.00 H ATOM 7356 HG13 VAL B 390 19.469 -12.430 23.513 1.00 0.00 H ATOM 7357 HG21 VAL B 390 19.584 -15.331 22.511 1.00 0.00 H ATOM 7358 HG22 VAL B 390 20.150 -16.021 24.052 1.00 0.00 H ATOM 7359 HG23 VAL B 390 18.894 -14.758 24.049 1.00 0.00 H ATOM 7360 H VAL B 390 22.326 -15.911 24.609 1.00 0.00 H ATOM 7361 N ILE B 391 23.754 -12.973 23.901 1.00 27.24 N ATOM 7362 CA ILE B 391 24.733 -11.883 23.903 1.00 26.00 C ATOM 7363 C ILE B 391 25.937 -12.144 23.005 1.00 26.34 C ATOM 7364 O ILE B 391 26.449 -11.228 22.358 1.00 22.62 O ATOM 7365 CB ILE B 391 25.277 -11.621 25.324 1.00 25.17 C ATOM 7366 CG1 ILE B 391 24.172 -11.077 26.223 1.00 25.55 C ATOM 7367 CG2 ILE B 391 26.437 -10.649 25.261 1.00 27.60 C ATOM 7368 CD1 ILE B 391 24.637 -10.825 27.655 1.00 24.51 C ATOM 7369 HA ILE B 391 24.185 -11.021 23.522 1.00 0.00 H ATOM 7370 HB ILE B 391 25.630 -12.562 25.747 1.00 0.00 H ATOM 7371 HG12 ILE B 391 23.814 -10.137 25.803 1.00 0.00 H ATOM 7372 HG13 ILE B 391 23.355 -11.798 26.245 1.00 0.00 H ATOM 7373 HD11 ILE B 391 24.989 -11.760 28.091 1.00 0.00 H ATOM 7374 HD12 ILE B 391 25.448 -10.097 27.649 1.00 0.00 H ATOM 7375 HD13 ILE B 391 23.805 -10.439 28.243 1.00 0.00 H ATOM 7376 HG21 ILE B 391 27.230 -11.071 24.644 1.00 0.00 H ATOM 7377 HG22 ILE B 391 26.098 -9.709 24.826 1.00 0.00 H ATOM 7378 HG23 ILE B 391 26.814 -10.470 26.268 1.00 0.00 H ATOM 7379 H ILE B 391 23.504 -13.427 24.803 1.00 0.00 H ATOM 7380 N ILE B 392 26.406 -13.389 22.973 1.00 24.89 N ATOM 7381 CA ILE B 392 27.571 -13.702 22.160 1.00 25.22 C ATOM 7382 C ILE B 392 27.262 -13.636 20.677 1.00 24.51 C ATOM 7383 O ILE B 392 28.052 -13.125 19.904 1.00 26.53 O ATOM 7384 CB ILE B 392 28.139 -15.110 22.511 1.00 25.21 C ATOM 7385 CG1 ILE B 392 28.691 -15.094 23.934 1.00 27.99 C ATOM 7386 CG2 ILE B 392 29.228 -15.503 21.522 1.00 21.58 C ATOM 7387 CD1 ILE B 392 29.005 -16.463 24.501 1.00 29.90 C ATOM 7388 HA ILE B 392 28.322 -12.945 22.388 1.00 0.00 H ATOM 7389 HB ILE B 392 27.339 -15.847 22.446 1.00 0.00 H ATOM 7390 HG12 ILE B 392 29.608 -14.505 23.937 1.00 0.00 H ATOM 7391 HG13 ILE B 392 27.953 -14.618 24.580 1.00 0.00 H ATOM 7392 HD11 ILE B 392 28.096 -17.064 24.519 1.00 0.00 H ATOM 7393 HD12 ILE B 392 29.753 -16.951 23.876 1.00 0.00 H ATOM 7394 HD13 ILE B 392 29.392 -16.355 25.514 1.00 0.00 H ATOM 7395 HG21 ILE B 392 28.811 -15.528 20.515 1.00 0.00 H ATOM 7396 HG22 ILE B 392 30.036 -14.772 21.564 1.00 0.00 H ATOM 7397 HG23 ILE B 392 29.614 -16.489 21.781 1.00 0.00 H ATOM 7398 H ILE B 392 25.941 -14.136 23.528 1.00 0.00 H ATOM 7399 N LEU B 393 26.102 -14.152 20.291 1.00 26.76 N ATOM 7400 CA LEU B 393 25.674 -14.189 18.898 1.00 28.30 C ATOM 7401 C LEU B 393 24.925 -12.910 18.501 1.00 30.84 C ATOM 7402 O LEU B 393 23.842 -12.950 17.907 1.00 30.04 O ATOM 7403 CB LEU B 393 24.775 -15.416 18.684 1.00 25.98 C ATOM 7404 CG LEU B 393 25.494 -16.768 18.535 1.00 29.09 C ATOM 7405 CD1 LEU B 393 26.212 -16.788 17.202 1.00 27.14 C ATOM 7406 CD2 LEU B 393 26.489 -17.006 19.673 1.00 25.36 C ATOM 7407 HA LEU B 393 26.559 -14.257 18.265 1.00 0.00 H ATOM 7408 HB2 LEU B 393 24.103 -15.489 19.539 1.00 0.00 H ATOM 7409 HB3 LEU B 393 24.192 -15.248 17.778 1.00 0.00 H ATOM 7410 HG LEU B 393 24.754 -17.567 18.580 1.00 0.00 H ATOM 7411 HD21 LEU B 393 27.239 -16.215 19.670 1.00 0.00 H ATOM 7412 HD22 LEU B 393 25.958 -17.001 20.625 1.00 0.00 H ATOM 7413 HD23 LEU B 393 26.976 -17.971 19.532 1.00 0.00 H ATOM 7414 HD11 LEU B 393 25.487 -16.662 16.398 1.00 0.00 H ATOM 7415 HD12 LEU B 393 26.938 -15.975 17.169 1.00 0.00 H ATOM 7416 HD13 LEU B 393 26.727 -17.741 17.082 1.00 0.00 H ATOM 7417 H LEU B 393 25.469 -14.548 21.015 1.00 0.00 H ATOM 7418 N SER B 394 25.512 -11.768 18.812 1.00 31.05 N ATOM 7419 CA SER B 394 24.850 -10.521 18.503 1.00 36.02 C ATOM 7420 C SER B 394 24.654 -10.239 17.022 1.00 37.90 C ATOM 7421 O SER B 394 23.532 -10.349 16.511 1.00 45.43 O ATOM 7422 CB SER B 394 25.576 -9.378 19.196 1.00 35.27 C ATOM 7423 OG SER B 394 25.382 -9.503 20.588 1.00 34.06 O ATOM 7424 HA SER B 394 23.834 -10.614 18.887 1.00 0.00 H ATOM 7425 HB2 SER B 394 25.174 -8.425 18.853 1.00 0.00 H ATOM 7426 HB3 SER B 394 26.641 -9.426 18.967 1.00 0.00 H ATOM 7427 HG SER B 394 25.747 -10.371 20.894 1.00 0.00 H ATOM 7428 H SER B 394 26.443 -11.766 19.275 1.00 0.00 H ATOM 7429 N GLY B 395 25.704 -9.884 16.306 1.00 35.86 N ATOM 7430 CA GLY B 395 25.474 -9.613 14.895 1.00 36.11 C ATOM 7431 C GLY B 395 25.757 -8.174 14.520 1.00 34.74 C ATOM 7432 O GLY B 395 26.009 -7.878 13.358 1.00 34.77 O ATOM 7433 HA3 GLY B 395 24.433 -9.835 14.663 1.00 0.00 H ATOM 7434 HA2 GLY B 395 26.123 -10.261 14.305 1.00 0.00 H ATOM 7435 H GLY B 395 26.650 -9.802 16.730 1.00 0.00 H ATOM 7436 N ASP B 396 25.737 -7.282 15.505 1.00 35.12 N ATOM 7437 CA ASP B 396 26.020 -5.877 15.250 1.00 36.15 C ATOM 7438 C ASP B 396 27.419 -5.501 15.725 1.00 35.29 C ATOM 7439 O ASP B 396 27.769 -4.322 15.773 1.00 36.71 O ATOM 7440 CB ASP B 396 24.962 -4.975 15.912 1.00 36.76 C ATOM 7441 CG ASP B 396 24.949 -5.088 17.423 1.00 41.13 C ATOM 7442 OD1 ASP B 396 25.448 -6.103 17.957 1.00 45.37 O ATOM 7443 OD2 ASP B 396 24.427 -4.165 18.082 1.00 43.49 O ATOM 7444 HA ASP B 396 25.977 -5.721 14.172 1.00 0.00 H ATOM 7445 HB2 ASP B 396 25.170 -3.940 15.643 1.00 0.00 H ATOM 7446 HB3 ASP B 396 23.979 -5.257 15.534 1.00 0.00 H ATOM 7447 H ASP B 396 25.516 -7.592 16.473 1.00 0.00 H ATOM 7448 N ARG B 397 28.233 -6.493 16.071 1.00 33.10 N ATOM 7449 CA ARG B 397 29.595 -6.178 16.498 1.00 33.62 C ATOM 7450 C ARG B 397 30.315 -5.633 15.269 1.00 34.86 C ATOM 7451 O ARG B 397 30.094 -6.101 14.149 1.00 35.97 O ATOM 7452 CB ARG B 397 30.353 -7.422 17.001 1.00 31.49 C ATOM 7453 CG ARG B 397 29.691 -8.187 18.130 1.00 28.79 C ATOM 7454 CD ARG B 397 29.341 -7.306 19.332 1.00 27.15 C ATOM 7455 NE ARG B 397 28.831 -8.134 20.420 1.00 26.79 N ATOM 7456 CZ ARG B 397 28.374 -7.680 21.578 1.00 27.52 C ATOM 7457 NH1 ARG B 397 28.354 -6.376 21.841 1.00 26.39 N ATOM 7458 NH2 ARG B 397 27.909 -8.542 22.469 1.00 26.32 N ATOM 7459 HA ARG B 397 29.561 -5.467 17.323 1.00 0.00 H ATOM 7460 HB2 ARG B 397 30.472 -8.104 16.159 1.00 0.00 H ATOM 7461 HB3 ARG B 397 31.335 -7.099 17.347 1.00 0.00 H ATOM 7462 HG2 ARG B 397 28.774 -8.638 17.752 1.00 0.00 H ATOM 7463 HG3 ARG B 397 30.370 -8.972 18.462 1.00 0.00 H ATOM 7464 HD2 ARG B 397 28.580 -6.582 19.041 1.00 0.00 H ATOM 7465 HD3 ARG B 397 30.234 -6.778 19.667 1.00 0.00 H ATOM 7466 HE ARG B 397 28.826 -9.164 20.275 1.00 0.00 H ATOM 7467 HH12 ARG B 397 27.992 -6.035 22.755 1.00 0.00 H ATOM 7468 HH11 ARG B 397 28.700 -5.697 21.133 1.00 0.00 H ATOM 7469 HH22 ARG B 397 27.547 -8.201 23.382 1.00 0.00 H ATOM 7470 HH21 ARG B 397 27.906 -9.560 22.255 1.00 0.00 H ATOM 7471 H ARG B 397 27.905 -7.480 16.038 1.00 0.00 H ATOM 7472 N PRO B 398 31.176 -4.627 15.456 1.00 33.62 N ATOM 7473 CA PRO B 398 31.901 -4.066 14.312 1.00 33.77 C ATOM 7474 C PRO B 398 32.928 -5.026 13.709 1.00 34.01 C ATOM 7475 O PRO B 398 33.601 -5.768 14.429 1.00 35.13 O ATOM 7476 CB PRO B 398 32.556 -2.810 14.897 1.00 33.30 C ATOM 7477 CG PRO B 398 32.733 -3.153 16.356 1.00 34.02 C ATOM 7478 CD PRO B 398 31.434 -3.858 16.687 1.00 33.76 C ATOM 7479 HA PRO B 398 31.239 -3.857 13.471 1.00 0.00 H ATOM 7480 HD3 PRO B 398 31.549 -4.516 17.548 1.00 0.00 H ATOM 7481 HD2 PRO B 398 30.634 -3.143 16.882 1.00 0.00 H ATOM 7482 HG3 PRO B 398 32.859 -2.254 16.960 1.00 0.00 H ATOM 7483 HG2 PRO B 398 33.588 -3.812 16.505 1.00 0.00 H ATOM 7484 HB2 PRO B 398 33.518 -2.615 14.423 1.00 0.00 H ATOM 7485 HB3 PRO B 398 31.910 -1.941 14.776 1.00 0.00 H ATOM 7486 N GLY B 399 33.039 -5.002 12.386 1.00 32.68 N ATOM 7487 CA GLY B 399 33.991 -5.851 11.697 1.00 30.58 C ATOM 7488 C GLY B 399 33.549 -7.265 11.342 1.00 32.21 C ATOM 7489 O GLY B 399 34.350 -8.022 10.803 1.00 33.77 O ATOM 7490 HA3 GLY B 399 34.873 -5.935 12.332 1.00 0.00 H ATOM 7491 HA2 GLY B 399 34.261 -5.351 10.767 1.00 0.00 H ATOM 7492 H GLY B 399 32.432 -4.363 11.834 1.00 0.00 H ATOM 7493 N LEU B 400 32.307 -7.645 11.635 1.00 30.55 N ATOM 7494 CA LEU B 400 31.859 -8.994 11.297 1.00 30.54 C ATOM 7495 C LEU B 400 31.896 -9.194 9.788 1.00 31.54 C ATOM 7496 O LEU B 400 31.582 -8.277 9.025 1.00 32.16 O ATOM 7497 CB LEU B 400 30.444 -9.255 11.830 1.00 28.30 C ATOM 7498 CG LEU B 400 30.380 -9.399 13.355 1.00 29.45 C ATOM 7499 CD1 LEU B 400 28.945 -9.602 13.817 1.00 28.60 C ATOM 7500 CD2 LEU B 400 31.262 -10.574 13.776 1.00 28.21 C ATOM 7501 HA LEU B 400 32.536 -9.706 11.769 1.00 0.00 H ATOM 7502 HB2 LEU B 400 29.805 -8.423 11.535 1.00 0.00 H ATOM 7503 HB3 LEU B 400 30.070 -10.175 11.381 1.00 0.00 H ATOM 7504 HG LEU B 400 30.747 -8.486 13.824 1.00 0.00 H ATOM 7505 HD21 LEU B 400 30.900 -11.487 13.303 1.00 0.00 H ATOM 7506 HD22 LEU B 400 32.289 -10.385 13.465 1.00 0.00 H ATOM 7507 HD23 LEU B 400 31.224 -10.685 14.860 1.00 0.00 H ATOM 7508 HD11 LEU B 400 28.344 -8.743 13.518 1.00 0.00 H ATOM 7509 HD12 LEU B 400 28.542 -10.506 13.360 1.00 0.00 H ATOM 7510 HD13 LEU B 400 28.925 -9.702 14.902 1.00 0.00 H ATOM 7511 H LEU B 400 31.657 -6.983 12.104 1.00 0.00 H ATOM 7512 N LEU B 401 32.291 -10.389 9.357 1.00 30.85 N ATOM 7513 CA LEU B 401 32.372 -10.684 7.931 1.00 31.61 C ATOM 7514 C LEU B 401 31.111 -11.344 7.374 1.00 31.17 C ATOM 7515 O LEU B 401 30.721 -11.070 6.246 1.00 32.83 O ATOM 7516 CB LEU B 401 33.607 -11.556 7.648 1.00 33.77 C ATOM 7517 CG LEU B 401 34.954 -10.865 7.931 1.00 33.22 C ATOM 7518 CD1 LEU B 401 36.051 -11.902 8.084 1.00 32.57 C ATOM 7519 CD2 LEU B 401 35.279 -9.889 6.808 1.00 29.27 C ATOM 7520 HA LEU B 401 32.465 -9.728 7.416 1.00 0.00 H ATOM 7521 HB2 LEU B 401 33.544 -12.448 8.271 1.00 0.00 H ATOM 7522 HB3 LEU B 401 33.586 -11.845 6.597 1.00 0.00 H ATOM 7523 HG LEU B 401 34.884 -10.306 8.864 1.00 0.00 H ATOM 7524 HD21 LEU B 401 35.342 -10.431 5.864 1.00 0.00 H ATOM 7525 HD22 LEU B 401 34.493 -9.136 6.744 1.00 0.00 H ATOM 7526 HD23 LEU B 401 36.233 -9.404 7.015 1.00 0.00 H ATOM 7527 HD11 LEU B 401 35.808 -12.566 8.913 1.00 0.00 H ATOM 7528 HD12 LEU B 401 36.132 -12.482 7.164 1.00 0.00 H ATOM 7529 HD13 LEU B 401 36.998 -11.401 8.284 1.00 0.00 H ATOM 7530 H LEU B 401 32.546 -11.124 10.047 1.00 0.00 H ATOM 7531 N ASN B 402 30.469 -12.205 8.156 1.00 32.41 N ATOM 7532 CA ASN B 402 29.250 -12.880 7.704 1.00 31.43 C ATOM 7533 C ASN B 402 28.153 -12.853 8.783 1.00 31.15 C ATOM 7534 O ASN B 402 28.002 -13.802 9.548 1.00 32.06 O ATOM 7535 CB ASN B 402 29.580 -14.321 7.319 1.00 31.68 C ATOM 7536 CG ASN B 402 28.407 -15.034 6.669 1.00 34.44 C ATOM 7537 OD1 ASN B 402 27.302 -14.493 6.595 1.00 35.57 O ATOM 7538 ND2 ASN B 402 28.641 -16.251 6.197 1.00 33.26 N ATOM 7539 HA ASN B 402 28.865 -12.347 6.835 1.00 0.00 H ATOM 7540 HB2 ASN B 402 30.416 -14.313 6.619 1.00 0.00 H ATOM 7541 HB3 ASN B 402 29.866 -14.866 8.218 1.00 0.00 H ATOM 7542 HD22 ASN B 402 29.590 -16.668 6.282 1.00 0.00 H ATOM 7543 HD21 ASN B 402 27.876 -16.788 5.742 1.00 0.00 H ATOM 7544 H ASN B 402 30.839 -12.404 9.107 1.00 0.00 H ATOM 7545 N VAL B 403 27.372 -11.771 8.816 1.00 29.17 N ATOM 7546 CA VAL B 403 26.315 -11.581 9.816 1.00 28.12 C ATOM 7547 C VAL B 403 25.120 -12.522 9.767 1.00 29.26 C ATOM 7548 O VAL B 403 24.476 -12.768 10.793 1.00 29.98 O ATOM 7549 CB VAL B 403 25.778 -10.112 9.773 1.00 29.00 C ATOM 7550 CG1 VAL B 403 24.616 -9.929 10.746 1.00 26.20 C ATOM 7551 CG2 VAL B 403 26.904 -9.141 10.112 1.00 29.72 C ATOM 7552 HA VAL B 403 26.828 -11.821 10.747 1.00 0.00 H ATOM 7553 HB VAL B 403 25.414 -9.905 8.766 1.00 0.00 H ATOM 7554 HG11 VAL B 403 23.807 -10.607 10.475 1.00 0.00 H ATOM 7555 HG12 VAL B 403 24.953 -10.150 11.759 1.00 0.00 H ATOM 7556 HG13 VAL B 403 24.261 -8.900 10.697 1.00 0.00 H ATOM 7557 HG21 VAL B 403 27.281 -9.359 11.111 1.00 0.00 H ATOM 7558 HG22 VAL B 403 27.709 -9.253 9.386 1.00 0.00 H ATOM 7559 HG23 VAL B 403 26.523 -8.120 10.080 1.00 0.00 H ATOM 7560 H VAL B 403 27.519 -11.030 8.101 1.00 0.00 H ATOM 7561 N LYS B 404 24.820 -13.067 8.594 1.00 31.26 N ATOM 7562 CA LYS B 404 23.662 -13.944 8.461 1.00 31.18 C ATOM 7563 C LYS B 404 23.581 -15.140 9.419 1.00 29.30 C ATOM 7564 O LYS B 404 22.641 -15.235 10.200 1.00 29.24 O ATOM 7565 CB LYS B 404 23.531 -14.416 7.010 1.00 32.43 C ATOM 7566 CG LYS B 404 22.338 -15.323 6.754 1.00 34.70 C ATOM 7567 CD LYS B 404 22.126 -15.494 5.247 1.00 39.83 C ATOM 7568 CE LYS B 404 21.314 -16.732 4.913 1.00 38.02 C ATOM 7569 NZ LYS B 404 20.016 -16.774 5.621 1.00 41.46 N ATOM 7570 HA LYS B 404 22.820 -13.319 8.759 1.00 0.00 H ATOM 7571 HB2 LYS B 404 23.436 -13.537 6.372 1.00 0.00 H ATOM 7572 HB3 LYS B 404 24.437 -14.960 6.744 1.00 0.00 H ATOM 7573 HG2 LYS B 404 22.521 -16.298 7.206 1.00 0.00 H ATOM 7574 HG3 LYS B 404 21.446 -14.880 7.197 1.00 0.00 H ATOM 7575 HD2 LYS B 404 21.602 -14.618 4.865 1.00 0.00 H ATOM 7576 HD3 LYS B 404 23.100 -15.573 4.763 1.00 0.00 H ATOM 7577 HE2 LYS B 404 21.892 -17.613 5.191 1.00 0.00 H ATOM 7578 HE3 LYS B 404 21.126 -16.747 3.839 1.00 0.00 H ATOM 7579 HZ1 LYS B 404 20.182 -16.770 6.648 1.00 0.00 H ATOM 7580 HZ2 LYS B 404 19.451 -15.942 5.356 1.00 0.00 H ATOM 7581 HZ3 LYS B 404 19.505 -17.640 5.355 1.00 0.00 H ATOM 7582 H LYS B 404 25.415 -12.867 7.764 1.00 0.00 H ATOM 7583 N PRO B 405 24.550 -16.077 9.370 1.00 29.14 N ATOM 7584 CA PRO B 405 24.463 -17.224 10.293 1.00 26.87 C ATOM 7585 C PRO B 405 24.448 -16.824 11.765 1.00 28.56 C ATOM 7586 O PRO B 405 23.842 -17.501 12.598 1.00 29.63 O ATOM 7587 CB PRO B 405 25.689 -18.067 9.931 1.00 28.76 C ATOM 7588 CG PRO B 405 26.659 -17.051 9.318 1.00 26.51 C ATOM 7589 CD PRO B 405 25.736 -16.178 8.501 1.00 25.47 C ATOM 7590 HA PRO B 405 23.524 -17.765 10.179 1.00 0.00 H ATOM 7591 HD3 PRO B 405 26.177 -15.198 8.319 1.00 0.00 H ATOM 7592 HD2 PRO B 405 25.489 -16.647 7.548 1.00 0.00 H ATOM 7593 HG3 PRO B 405 27.399 -17.543 8.687 1.00 0.00 H ATOM 7594 HG2 PRO B 405 27.167 -16.474 10.091 1.00 0.00 H ATOM 7595 HB2 PRO B 405 26.120 -18.529 10.819 1.00 0.00 H ATOM 7596 HB3 PRO B 405 25.429 -18.842 9.209 1.00 0.00 H ATOM 7597 N ILE B 406 25.105 -15.716 12.090 1.00 29.00 N ATOM 7598 CA ILE B 406 25.140 -15.254 13.470 1.00 28.30 C ATOM 7599 C ILE B 406 23.730 -14.861 13.894 1.00 29.59 C ATOM 7600 O ILE B 406 23.265 -15.239 14.970 1.00 29.95 O ATOM 7601 CB ILE B 406 26.101 -14.059 13.619 1.00 27.61 C ATOM 7602 CG1 ILE B 406 27.522 -14.520 13.290 1.00 21.51 C ATOM 7603 CG2 ILE B 406 26.011 -13.477 15.033 1.00 27.71 C ATOM 7604 CD1 ILE B 406 28.485 -13.405 13.014 1.00 17.24 C ATOM 7605 HA ILE B 406 25.505 -16.056 14.112 1.00 0.00 H ATOM 7606 HB ILE B 406 25.821 -13.267 12.924 1.00 0.00 H ATOM 7607 HG12 ILE B 406 27.899 -15.095 14.136 1.00 0.00 H ATOM 7608 HG13 ILE B 406 27.478 -15.159 12.408 1.00 0.00 H ATOM 7609 HD11 ILE B 406 28.132 -12.825 12.161 1.00 0.00 H ATOM 7610 HD12 ILE B 406 28.553 -12.760 13.890 1.00 0.00 H ATOM 7611 HD13 ILE B 406 29.467 -13.822 12.790 1.00 0.00 H ATOM 7612 HG21 ILE B 406 24.992 -13.140 15.222 1.00 0.00 H ATOM 7613 HG22 ILE B 406 26.282 -14.244 15.758 1.00 0.00 H ATOM 7614 HG23 ILE B 406 26.696 -12.634 15.122 1.00 0.00 H ATOM 7615 H ILE B 406 25.599 -15.174 11.352 1.00 0.00 H ATOM 7616 N GLU B 407 23.028 -14.124 13.041 1.00 32.14 N ATOM 7617 CA GLU B 407 21.665 -13.727 13.383 1.00 32.81 C ATOM 7618 C GLU B 407 20.733 -14.919 13.327 1.00 29.01 C ATOM 7619 O GLU B 407 19.773 -14.985 14.081 1.00 29.99 O ATOM 7620 CB GLU B 407 21.176 -12.602 12.465 1.00 36.25 C ATOM 7621 CG GLU B 407 21.963 -11.311 12.684 1.00 43.97 C ATOM 7622 CD GLU B 407 21.403 -10.114 11.928 1.00 47.41 C ATOM 7623 OE1 GLU B 407 21.232 -10.212 10.695 1.00 47.99 O ATOM 7624 OE2 GLU B 407 21.150 -9.073 12.573 1.00 50.16 O ATOM 7625 HA GLU B 407 21.667 -13.346 14.404 1.00 0.00 H ATOM 7626 HB2 GLU B 407 21.293 -12.916 11.428 1.00 0.00 H ATOM 7627 HB3 GLU B 407 20.122 -12.412 12.669 1.00 0.00 H ATOM 7628 HG2 GLU B 407 21.955 -11.080 13.749 1.00 0.00 H ATOM 7629 HG3 GLU B 407 22.990 -11.475 12.357 1.00 0.00 H ATOM 7630 H GLU B 407 23.446 -13.831 12.135 1.00 0.00 H ATOM 7631 N ASP B 408 21.022 -15.874 12.451 1.00 30.80 N ATOM 7632 CA ASP B 408 20.194 -17.075 12.362 1.00 31.30 C ATOM 7633 C ASP B 408 20.288 -17.845 13.673 1.00 30.81 C ATOM 7634 O ASP B 408 19.276 -18.289 14.218 1.00 31.60 O ATOM 7635 CB ASP B 408 20.643 -17.976 11.204 1.00 34.66 C ATOM 7636 CG ASP B 408 20.173 -17.470 9.849 1.00 36.83 C ATOM 7637 OD1 ASP B 408 19.058 -16.928 9.779 1.00 43.14 O ATOM 7638 OD2 ASP B 408 20.901 -17.629 8.849 1.00 41.37 O ATOM 7639 HA ASP B 408 19.164 -16.772 12.175 1.00 0.00 H ATOM 7640 HB2 ASP B 408 21.732 -18.023 11.200 1.00 0.00 H ATOM 7641 HB3 ASP B 408 20.238 -18.976 11.363 1.00 0.00 H ATOM 7642 H ASP B 408 21.844 -15.767 11.823 1.00 0.00 H ATOM 7643 N ILE B 409 21.500 -17.984 14.200 1.00 30.15 N ATOM 7644 CA ILE B 409 21.676 -18.700 15.464 1.00 29.80 C ATOM 7645 C ILE B 409 21.020 -17.941 16.627 1.00 30.24 C ATOM 7646 O ILE B 409 20.244 -18.515 17.403 1.00 32.99 O ATOM 7647 CB ILE B 409 23.175 -18.941 15.738 1.00 29.08 C ATOM 7648 CG1 ILE B 409 23.729 -19.887 14.660 1.00 28.55 C ATOM 7649 CG2 ILE B 409 23.378 -19.513 17.143 1.00 26.71 C ATOM 7650 CD1 ILE B 409 25.234 -19.925 14.561 1.00 29.04 C ATOM 7651 HA ILE B 409 21.180 -19.667 15.381 1.00 0.00 H ATOM 7652 HB ILE B 409 23.718 -17.997 15.693 1.00 0.00 H ATOM 7653 HG12 ILE B 409 23.378 -20.895 14.881 1.00 0.00 H ATOM 7654 HG13 ILE B 409 23.334 -19.570 13.695 1.00 0.00 H ATOM 7655 HD11 ILE B 409 25.607 -18.928 14.325 1.00 0.00 H ATOM 7656 HD12 ILE B 409 25.651 -20.255 15.512 1.00 0.00 H ATOM 7657 HD13 ILE B 409 25.528 -20.619 13.774 1.00 0.00 H ATOM 7658 HG21 ILE B 409 22.991 -18.809 17.880 1.00 0.00 H ATOM 7659 HG22 ILE B 409 22.845 -20.460 17.229 1.00 0.00 H ATOM 7660 HG23 ILE B 409 24.442 -19.676 17.317 1.00 0.00 H ATOM 7661 H ILE B 409 22.326 -17.583 13.712 1.00 0.00 H ATOM 7662 N GLN B 410 21.302 -16.647 16.745 1.00 30.91 N ATOM 7663 CA GLN B 410 20.697 -15.872 17.820 1.00 29.90 C ATOM 7664 C GLN B 410 19.172 -15.945 17.763 1.00 28.17 C ATOM 7665 O GLN B 410 18.526 -15.984 18.806 1.00 27.60 O ATOM 7666 CB GLN B 410 21.124 -14.408 17.774 1.00 30.43 C ATOM 7667 CG GLN B 410 20.718 -13.675 19.054 1.00 31.95 C ATOM 7668 CD GLN B 410 20.984 -12.190 19.015 1.00 34.90 C ATOM 7669 OE1 GLN B 410 21.665 -11.646 19.893 1.00 36.00 O ATOM 7670 NE2 GLN B 410 20.434 -11.515 18.005 1.00 33.83 N ATOM 7671 HA GLN B 410 21.048 -16.312 18.753 1.00 0.00 H ATOM 7672 HB2 GLN B 410 22.207 -14.356 17.662 1.00 0.00 H ATOM 7673 HB3 GLN B 410 20.648 -13.925 16.921 1.00 0.00 H ATOM 7674 HG2 GLN B 410 19.651 -13.829 19.215 1.00 0.00 H ATOM 7675 HG3 GLN B 410 21.276 -14.103 19.887 1.00 0.00 H ATOM 7676 HE22 GLN B 410 19.869 -12.017 17.290 1.00 0.00 H ATOM 7677 HE21 GLN B 410 20.570 -10.487 17.932 1.00 0.00 H ATOM 7678 H GLN B 410 21.951 -16.190 16.073 1.00 0.00 H ATOM 7679 N ASP B 411 18.596 -15.954 16.560 1.00 28.47 N ATOM 7680 CA ASP B 411 17.136 -16.062 16.438 1.00 32.24 C ATOM 7681 C ASP B 411 16.700 -17.345 17.151 1.00 33.15 C ATOM 7682 O ASP B 411 15.788 -17.324 17.973 1.00 34.32 O ATOM 7683 CB ASP B 411 16.704 -16.133 14.965 1.00 35.66 C ATOM 7684 CG ASP B 411 15.211 -16.456 14.801 1.00 39.78 C ATOM 7685 OD1 ASP B 411 14.372 -15.534 14.882 1.00 41.32 O ATOM 7686 OD2 ASP B 411 14.866 -17.642 14.601 1.00 41.96 O ATOM 7687 HA ASP B 411 16.671 -15.182 16.883 1.00 0.00 H ATOM 7688 HB2 ASP B 411 16.907 -15.171 14.495 1.00 0.00 H ATOM 7689 HB3 ASP B 411 17.286 -16.909 14.467 1.00 0.00 H ATOM 7690 H ASP B 411 19.183 -15.884 15.704 1.00 0.00 H ATOM 7691 N ASN B 412 17.375 -18.453 16.842 1.00 33.48 N ATOM 7692 CA ASN B 412 17.067 -19.743 17.455 1.00 34.94 C ATOM 7693 C ASN B 412 17.297 -19.683 18.968 1.00 33.04 C ATOM 7694 O ASN B 412 16.531 -20.261 19.734 1.00 32.87 O ATOM 7695 CB ASN B 412 17.937 -20.845 16.826 1.00 40.87 C ATOM 7696 CG ASN B 412 17.369 -22.244 17.043 1.00 46.59 C ATOM 7697 OD1 ASN B 412 17.887 -23.229 16.509 1.00 50.83 O ATOM 7698 ND2 ASN B 412 16.301 -22.337 17.828 1.00 50.28 N ATOM 7699 HA ASN B 412 16.018 -19.976 17.274 1.00 0.00 H ATOM 7700 HB2 ASN B 412 18.011 -20.661 15.754 1.00 0.00 H ATOM 7701 HB3 ASN B 412 18.931 -20.800 17.270 1.00 0.00 H ATOM 7702 HD22 ASN B 412 15.896 -21.481 18.258 1.00 0.00 H ATOM 7703 HD21 ASN B 412 15.870 -23.266 18.012 1.00 0.00 H ATOM 7704 H ASN B 412 18.144 -18.397 16.144 1.00 0.00 H ATOM 7705 N LEU B 413 18.350 -18.985 19.395 1.00 31.30 N ATOM 7706 CA LEU B 413 18.645 -18.839 20.826 1.00 29.40 C ATOM 7707 C LEU B 413 17.583 -18.016 21.552 1.00 29.46 C ATOM 7708 O LEU B 413 17.243 -18.311 22.698 1.00 29.89 O ATOM 7709 CB LEU B 413 20.008 -18.178 21.030 1.00 26.52 C ATOM 7710 CG LEU B 413 21.215 -19.067 20.754 1.00 27.97 C ATOM 7711 CD1 LEU B 413 22.490 -18.217 20.726 1.00 24.62 C ATOM 7712 CD2 LEU B 413 21.285 -20.153 21.834 1.00 26.88 C ATOM 7713 HA LEU B 413 18.650 -19.844 21.248 1.00 0.00 H ATOM 7714 HB2 LEU B 413 20.066 -17.316 20.366 1.00 0.00 H ATOM 7715 HB3 LEU B 413 20.067 -17.842 22.065 1.00 0.00 H ATOM 7716 HG LEU B 413 21.119 -19.549 19.781 1.00 0.00 H ATOM 7717 HD21 LEU B 413 21.387 -19.684 22.813 1.00 0.00 H ATOM 7718 HD22 LEU B 413 20.373 -20.749 21.808 1.00 0.00 H ATOM 7719 HD23 LEU B 413 22.145 -20.795 21.646 1.00 0.00 H ATOM 7720 HD11 LEU B 413 22.407 -17.466 19.940 1.00 0.00 H ATOM 7721 HD12 LEU B 413 22.618 -17.724 21.690 1.00 0.00 H ATOM 7722 HD13 LEU B 413 23.349 -18.859 20.528 1.00 0.00 H ATOM 7723 H LEU B 413 18.977 -18.534 18.698 1.00 0.00 H ATOM 7724 N LEU B 414 17.074 -16.974 20.893 1.00 31.04 N ATOM 7725 CA LEU B 414 16.026 -16.123 21.480 1.00 30.73 C ATOM 7726 C LEU B 414 14.749 -16.942 21.640 1.00 30.51 C ATOM 7727 O LEU B 414 14.056 -16.854 22.660 1.00 30.26 O ATOM 7728 CB LEU B 414 15.759 -14.907 20.577 1.00 28.78 C ATOM 7729 CG LEU B 414 16.908 -13.894 20.547 1.00 27.94 C ATOM 7730 CD1 LEU B 414 16.889 -13.129 19.250 1.00 27.23 C ATOM 7731 CD2 LEU B 414 16.805 -12.959 21.761 1.00 25.20 C ATOM 7732 HA LEU B 414 16.357 -15.764 22.455 1.00 0.00 H ATOM 7733 HB2 LEU B 414 15.589 -15.264 19.561 1.00 0.00 H ATOM 7734 HB3 LEU B 414 14.864 -14.401 20.938 1.00 0.00 H ATOM 7735 HG LEU B 414 17.862 -14.418 20.606 1.00 0.00 H ATOM 7736 HD21 LEU B 414 15.853 -12.428 21.730 1.00 0.00 H ATOM 7737 HD22 LEU B 414 16.864 -13.547 22.677 1.00 0.00 H ATOM 7738 HD23 LEU B 414 17.624 -12.240 21.735 1.00 0.00 H ATOM 7739 HD11 LEU B 414 17.002 -13.824 18.418 1.00 0.00 H ATOM 7740 HD12 LEU B 414 15.941 -12.599 19.156 1.00 0.00 H ATOM 7741 HD13 LEU B 414 17.710 -12.412 19.240 1.00 0.00 H ATOM 7742 H LEU B 414 17.427 -16.757 19.939 1.00 0.00 H ATOM 7743 N GLN B 415 14.427 -17.734 20.623 1.00 32.10 N ATOM 7744 CA GLN B 415 13.243 -18.581 20.710 1.00 34.34 C ATOM 7745 C GLN B 415 13.424 -19.445 21.952 1.00 33.99 C ATOM 7746 O GLN B 415 12.522 -19.543 22.773 1.00 35.06 O ATOM 7747 CB GLN B 415 13.102 -19.488 19.476 1.00 34.51 C ATOM 7748 CG GLN B 415 12.706 -18.773 18.201 1.00 38.18 C ATOM 7749 CD GLN B 415 12.605 -19.712 17.000 1.00 42.28 C ATOM 7750 OE1 GLN B 415 11.919 -20.730 17.049 1.00 42.03 O ATOM 7751 NE2 GLN B 415 13.283 -19.359 15.912 1.00 42.55 N ATOM 7752 HA GLN B 415 12.345 -17.965 20.760 1.00 0.00 H ATOM 7753 HB2 GLN B 415 14.060 -19.979 19.305 1.00 0.00 H ATOM 7754 HB3 GLN B 415 12.343 -20.240 19.693 1.00 0.00 H ATOM 7755 HG2 GLN B 415 11.737 -18.299 18.355 1.00 0.00 H ATOM 7756 HG3 GLN B 415 13.453 -18.009 17.984 1.00 0.00 H ATOM 7757 HE22 GLN B 415 13.852 -18.488 15.913 1.00 0.00 H ATOM 7758 HE21 GLN B 415 13.244 -19.954 15.060 1.00 0.00 H ATOM 7759 H GLN B 415 15.018 -17.750 19.767 1.00 0.00 H ATOM 7760 N ALA B 416 14.600 -20.052 22.102 1.00 33.61 N ATOM 7761 CA ALA B 416 14.844 -20.913 23.259 1.00 34.21 C ATOM 7762 C ALA B 416 14.741 -20.150 24.565 1.00 32.59 C ATOM 7763 O ALA B 416 14.161 -20.641 25.534 1.00 32.42 O ATOM 7764 CB ALA B 416 16.217 -21.589 23.152 1.00 35.27 C ATOM 7765 HA ALA B 416 14.068 -21.678 23.258 1.00 0.00 H ATOM 7766 HB1 ALA B 416 16.252 -22.196 22.247 1.00 0.00 H ATOM 7767 HB2 ALA B 416 16.994 -20.826 23.110 1.00 0.00 H ATOM 7768 HB3 ALA B 416 16.377 -22.224 24.023 1.00 0.00 H ATOM 7769 H ALA B 416 15.348 -19.913 21.393 1.00 0.00 H ATOM 7770 N LEU B 417 15.293 -18.943 24.596 1.00 34.43 N ATOM 7771 CA LEU B 417 15.250 -18.135 25.812 1.00 32.64 C ATOM 7772 C LEU B 417 13.816 -17.794 26.196 1.00 33.39 C ATOM 7773 O LEU B 417 13.440 -17.855 27.374 1.00 35.03 O ATOM 7774 CB LEU B 417 16.059 -16.845 25.620 1.00 32.60 C ATOM 7775 CG LEU B 417 16.067 -15.867 26.806 1.00 31.06 C ATOM 7776 CD1 LEU B 417 16.584 -16.564 28.052 1.00 30.26 C ATOM 7777 CD2 LEU B 417 16.941 -14.658 26.470 1.00 30.97 C ATOM 7778 HA LEU B 417 15.690 -18.720 26.619 1.00 0.00 H ATOM 7779 HB2 LEU B 417 17.092 -17.127 25.414 1.00 0.00 H ATOM 7780 HB3 LEU B 417 15.648 -16.320 24.758 1.00 0.00 H ATOM 7781 HG LEU B 417 15.050 -15.525 26.997 1.00 0.00 H ATOM 7782 HD21 LEU B 417 17.959 -14.992 26.269 1.00 0.00 H ATOM 7783 HD22 LEU B 417 16.541 -14.156 25.589 1.00 0.00 H ATOM 7784 HD23 LEU B 417 16.944 -13.968 27.313 1.00 0.00 H ATOM 7785 HD11 LEU B 417 15.938 -17.409 28.288 1.00 0.00 H ATOM 7786 HD12 LEU B 417 17.599 -16.920 27.873 1.00 0.00 H ATOM 7787 HD13 LEU B 417 16.585 -15.862 28.886 1.00 0.00 H ATOM 7788 H LEU B 417 15.761 -18.569 23.746 1.00 0.00 H ATOM 7789 N GLU B 418 13.014 -17.442 25.202 1.00 33.16 N ATOM 7790 CA GLU B 418 11.618 -17.081 25.439 1.00 34.86 C ATOM 7791 C GLU B 418 10.835 -18.262 26.016 1.00 35.19 C ATOM 7792 O GLU B 418 10.142 -18.134 27.038 1.00 30.94 O ATOM 7793 CB GLU B 418 10.974 -16.592 24.129 1.00 35.67 C ATOM 7794 CG GLU B 418 9.485 -16.298 24.222 1.00 38.19 C ATOM 7795 CD GLU B 418 8.969 -15.496 23.036 1.00 41.07 C ATOM 7796 OE1 GLU B 418 9.354 -15.789 21.881 1.00 41.04 O ATOM 7797 OE2 GLU B 418 8.165 -14.568 23.260 1.00 45.10 O ATOM 7798 HA GLU B 418 11.589 -16.274 26.171 1.00 0.00 H ATOM 7799 HB2 GLU B 418 11.482 -15.678 23.822 1.00 0.00 H ATOM 7800 HB3 GLU B 418 11.122 -17.361 23.371 1.00 0.00 H ATOM 7801 HG2 GLU B 418 8.945 -17.244 24.265 1.00 0.00 H ATOM 7802 HG3 GLU B 418 9.297 -15.732 25.134 1.00 0.00 H ATOM 7803 H GLU B 418 13.386 -17.422 24.231 1.00 0.00 H ATOM 7804 N LEU B 419 10.951 -19.417 25.369 1.00 34.22 N ATOM 7805 CA LEU B 419 10.246 -20.594 25.853 1.00 35.42 C ATOM 7806 C LEU B 419 10.734 -20.943 27.260 1.00 37.54 C ATOM 7807 O LEU B 419 9.939 -21.289 28.131 1.00 39.17 O ATOM 7808 CB LEU B 419 10.470 -21.774 24.905 1.00 34.64 C ATOM 7809 CG LEU B 419 9.781 -23.083 25.302 1.00 34.99 C ATOM 7810 CD1 LEU B 419 8.272 -22.881 25.358 1.00 33.70 C ATOM 7811 CD2 LEU B 419 10.133 -24.160 24.294 1.00 33.44 C ATOM 7812 HA LEU B 419 9.178 -20.380 25.889 1.00 0.00 H ATOM 7813 HB2 LEU B 419 10.103 -21.487 23.920 1.00 0.00 H ATOM 7814 HB3 LEU B 419 11.542 -21.962 24.851 1.00 0.00 H ATOM 7815 HG LEU B 419 10.124 -23.391 26.289 1.00 0.00 H ATOM 7816 HD21 LEU B 419 9.794 -23.854 23.304 1.00 0.00 H ATOM 7817 HD22 LEU B 419 11.213 -24.305 24.281 1.00 0.00 H ATOM 7818 HD23 LEU B 419 9.644 -25.093 24.575 1.00 0.00 H ATOM 7819 HD11 LEU B 419 8.037 -22.113 26.095 1.00 0.00 H ATOM 7820 HD12 LEU B 419 7.912 -22.568 24.378 1.00 0.00 H ATOM 7821 HD13 LEU B 419 7.792 -23.818 25.641 1.00 0.00 H ATOM 7822 H LEU B 419 11.545 -19.479 24.518 1.00 0.00 H ATOM 7823 N GLN B 420 12.043 -20.838 27.485 1.00 37.83 N ATOM 7824 CA GLN B 420 12.618 -21.146 28.791 1.00 37.18 C ATOM 7825 C GLN B 420 12.003 -20.276 29.876 1.00 39.19 C ATOM 7826 O GLN B 420 11.572 -20.776 30.923 1.00 40.73 O ATOM 7827 CB GLN B 420 14.133 -20.937 28.754 1.00 36.11 C ATOM 7828 CG GLN B 420 14.807 -20.815 30.122 1.00 35.17 C ATOM 7829 CD GLN B 420 14.778 -22.105 30.927 1.00 36.23 C ATOM 7830 OE1 GLN B 420 14.556 -23.194 30.382 1.00 34.32 O ATOM 7831 NE2 GLN B 420 15.023 -21.990 32.231 1.00 31.93 N ATOM 7832 HA GLN B 420 12.400 -22.188 29.024 1.00 0.00 H ATOM 7833 HB2 GLN B 420 14.578 -21.785 28.233 1.00 0.00 H ATOM 7834 HB3 GLN B 420 14.334 -20.023 28.196 1.00 0.00 H ATOM 7835 HG2 GLN B 420 15.847 -20.525 29.971 1.00 0.00 H ATOM 7836 HG3 GLN B 420 14.295 -20.040 30.692 1.00 0.00 H ATOM 7837 HE22 GLN B 420 15.204 -21.054 32.645 1.00 0.00 H ATOM 7838 HE21 GLN B 420 15.033 -22.837 32.835 1.00 0.00 H ATOM 7839 H GLN B 420 12.669 -20.530 26.714 1.00 0.00 H ATOM 7840 N LEU B 421 11.952 -18.972 29.624 1.00 37.96 N ATOM 7841 CA LEU B 421 11.394 -18.043 30.594 1.00 36.99 C ATOM 7842 C LEU B 421 9.896 -18.233 30.819 1.00 38.65 C ATOM 7843 O LEU B 421 9.391 -17.951 31.895 1.00 35.85 O ATOM 7844 CB LEU B 421 11.687 -16.607 30.161 1.00 36.68 C ATOM 7845 CG LEU B 421 13.180 -16.272 30.100 1.00 36.21 C ATOM 7846 CD1 LEU B 421 13.359 -14.814 29.705 1.00 33.96 C ATOM 7847 CD2 LEU B 421 13.825 -16.553 31.458 1.00 30.78 C ATOM 7848 HA LEU B 421 11.877 -18.253 31.549 1.00 0.00 H ATOM 7849 HB2 LEU B 421 11.259 -16.452 29.170 1.00 0.00 H ATOM 7850 HB3 LEU B 421 11.211 -15.930 30.871 1.00 0.00 H ATOM 7851 HG LEU B 421 13.668 -16.895 29.351 1.00 0.00 H ATOM 7852 HD21 LEU B 421 13.346 -15.938 32.220 1.00 0.00 H ATOM 7853 HD22 LEU B 421 13.700 -17.607 31.707 1.00 0.00 H ATOM 7854 HD23 LEU B 421 14.887 -16.313 31.411 1.00 0.00 H ATOM 7855 HD11 LEU B 421 12.909 -14.646 28.727 1.00 0.00 H ATOM 7856 HD12 LEU B 421 12.874 -14.176 30.444 1.00 0.00 H ATOM 7857 HD13 LEU B 421 14.422 -14.578 29.662 1.00 0.00 H ATOM 7858 H LEU B 421 12.317 -18.610 28.720 1.00 0.00 H ATOM 7859 N LYS B 422 9.191 -18.709 29.799 1.00 40.38 N ATOM 7860 CA LYS B 422 7.756 -18.939 29.919 1.00 42.88 C ATOM 7861 C LYS B 422 7.469 -20.194 30.735 1.00 43.75 C ATOM 7862 O LYS B 422 6.472 -20.261 31.454 1.00 44.50 O ATOM 7863 CB LYS B 422 7.107 -19.058 28.536 1.00 43.63 C ATOM 7864 CG LYS B 422 6.970 -17.728 27.814 1.00 44.62 C ATOM 7865 CD LYS B 422 5.869 -17.773 26.771 1.00 45.10 C ATOM 7866 CE LYS B 422 5.402 -16.364 26.419 1.00 45.47 C ATOM 7867 NZ LYS B 422 4.144 -16.372 25.628 1.00 44.67 N ATOM 7868 HA LYS B 422 7.327 -18.082 30.437 1.00 0.00 H ATOM 7869 HB2 LYS B 422 7.718 -19.722 27.924 1.00 0.00 H ATOM 7870 HB3 LYS B 422 6.113 -19.489 28.657 1.00 0.00 H ATOM 7871 HG2 LYS B 422 6.737 -16.951 28.542 1.00 0.00 H ATOM 7872 HG3 LYS B 422 7.914 -17.492 27.323 1.00 0.00 H ATOM 7873 HD2 LYS B 422 6.247 -18.260 25.872 1.00 0.00 H ATOM 7874 HD3 LYS B 422 5.026 -18.342 27.164 1.00 0.00 H ATOM 7875 HE2 LYS B 422 6.180 -15.871 25.837 1.00 0.00 H ATOM 7876 HE3 LYS B 422 5.234 -15.809 27.342 1.00 0.00 H ATOM 7877 HZ1 LYS B 422 4.297 -16.894 24.741 1.00 0.00 H ATOM 7878 HZ2 LYS B 422 3.393 -16.834 26.179 1.00 0.00 H ATOM 7879 HZ3 LYS B 422 3.865 -15.394 25.412 1.00 0.00 H ATOM 7880 H LYS B 422 9.670 -18.921 28.901 1.00 0.00 H ATOM 7881 N LEU B 423 8.346 -21.186 30.621 1.00 43.44 N ATOM 7882 CA LEU B 423 8.182 -22.431 31.355 1.00 44.98 C ATOM 7883 C LEU B 423 8.712 -22.313 32.778 1.00 45.19 C ATOM 7884 O LEU B 423 8.109 -22.816 33.726 1.00 46.33 O ATOM 7885 CB LEU B 423 8.922 -23.569 30.650 1.00 45.19 C ATOM 7886 CG LEU B 423 8.441 -23.964 29.256 1.00 45.99 C ATOM 7887 CD1 LEU B 423 9.346 -25.052 28.707 1.00 44.43 C ATOM 7888 CD2 LEU B 423 7.000 -24.436 29.318 1.00 45.86 C ATOM 7889 HA LEU B 423 7.114 -22.645 31.390 1.00 0.00 H ATOM 7890 HB2 LEU B 423 9.968 -23.275 30.564 1.00 0.00 H ATOM 7891 HB3 LEU B 423 8.845 -24.452 31.285 1.00 0.00 H ATOM 7892 HG LEU B 423 8.484 -23.101 28.591 1.00 0.00 H ATOM 7893 HD21 LEU B 423 6.930 -25.299 29.980 1.00 0.00 H ATOM 7894 HD22 LEU B 423 6.372 -23.631 29.700 1.00 0.00 H ATOM 7895 HD23 LEU B 423 6.667 -24.715 28.318 1.00 0.00 H ATOM 7896 HD11 LEU B 423 10.368 -24.678 28.650 1.00 0.00 H ATOM 7897 HD12 LEU B 423 9.311 -25.919 29.367 1.00 0.00 H ATOM 7898 HD13 LEU B 423 9.006 -25.337 27.711 1.00 0.00 H ATOM 7899 H LEU B 423 9.167 -21.070 29.994 1.00 0.00 H ATOM 7900 N ASN B 424 9.844 -21.635 32.923 1.00 45.31 N ATOM 7901 CA ASN B 424 10.482 -21.480 34.222 1.00 44.60 C ATOM 7902 C ASN B 424 9.906 -20.369 35.106 1.00 44.57 C ATOM 7903 O ASN B 424 10.085 -20.394 36.320 1.00 46.00 O ATOM 7904 CB ASN B 424 11.988 -21.268 34.009 1.00 43.88 C ATOM 7905 CG ASN B 424 12.799 -21.473 35.275 1.00 43.72 C ATOM 7906 OD1 ASN B 424 12.447 -22.292 36.120 1.00 43.96 O ATOM 7907 ND2 ASN B 424 13.908 -20.745 35.399 1.00 41.01 N ATOM 7908 HA ASN B 424 10.280 -22.398 34.773 1.00 0.00 H ATOM 7909 HB2 ASN B 424 12.336 -21.974 33.255 1.00 0.00 H ATOM 7910 HB3 ASN B 424 12.149 -20.250 33.653 1.00 0.00 H ATOM 7911 HD22 ASN B 424 14.168 -20.063 34.658 1.00 0.00 H ATOM 7912 HD21 ASN B 424 14.514 -20.859 36.237 1.00 0.00 H ATOM 7913 H ASN B 424 10.287 -21.203 32.087 1.00 0.00 H ATOM 7914 N HIS B 425 9.209 -19.406 34.511 1.00 43.17 N ATOM 7915 CA HIS B 425 8.641 -18.291 35.273 1.00 42.52 C ATOM 7916 C HIS B 425 7.252 -17.966 34.743 1.00 44.63 C ATOM 7917 O HIS B 425 6.958 -16.810 34.418 1.00 43.64 O ATOM 7918 CB HIS B 425 9.512 -17.043 35.117 1.00 40.49 C ATOM 7919 CG HIS B 425 10.932 -17.228 35.539 1.00 39.80 C ATOM 7920 ND1 HIS B 425 11.379 -16.910 36.802 1.00 40.55 N ATOM 7921 CD2 HIS B 425 12.015 -17.669 34.856 1.00 40.55 C ATOM 7922 CE1 HIS B 425 12.677 -17.142 36.880 1.00 39.86 C ATOM 7923 NE2 HIS B 425 13.088 -17.602 35.712 1.00 39.13 N ATOM 7924 HA HIS B 425 8.593 -18.581 36.323 1.00 0.00 H ATOM 7925 HB2 HIS B 425 9.503 -16.749 34.067 1.00 0.00 H ATOM 7926 HB3 HIS B 425 9.078 -16.246 35.720 1.00 0.00 H ATOM 7927 HD2 HIS B 425 12.032 -18.013 33.822 1.00 0.00 H ATOM 7928 HE1 HIS B 425 13.302 -16.981 37.758 1.00 0.00 H ATOM 7929 H HIS B 425 9.064 -19.445 33.482 1.00 0.00 H ATOM 7930 N PRO B 426 6.371 -18.976 34.669 1.00 46.35 N ATOM 7931 CA PRO B 426 5.002 -18.816 34.168 1.00 47.26 C ATOM 7932 C PRO B 426 4.228 -17.635 34.721 1.00 47.70 C ATOM 7933 O PRO B 426 3.350 -17.103 34.046 1.00 50.02 O ATOM 7934 CB PRO B 426 4.347 -20.151 34.523 1.00 47.39 C ATOM 7935 CG PRO B 426 5.070 -20.556 35.757 1.00 45.70 C ATOM 7936 CD PRO B 426 6.504 -20.264 35.368 1.00 46.57 C ATOM 7937 HA PRO B 426 5.008 -18.585 33.103 1.00 0.00 H ATOM 7938 HD3 PRO B 426 7.143 -20.175 36.246 1.00 0.00 H ATOM 7939 HD2 PRO B 426 6.901 -21.035 34.708 1.00 0.00 H ATOM 7940 HG3 PRO B 426 4.923 -21.613 35.977 1.00 0.00 H ATOM 7941 HG2 PRO B 426 4.760 -19.961 36.616 1.00 0.00 H ATOM 7942 HB2 PRO B 426 3.281 -20.027 34.715 1.00 0.00 H ATOM 7943 HB3 PRO B 426 4.489 -20.882 33.727 1.00 0.00 H ATOM 7944 N GLU B 427 4.554 -17.222 35.938 1.00 48.19 N ATOM 7945 CA GLU B 427 3.857 -16.113 36.580 1.00 51.13 C ATOM 7946 C GLU B 427 4.569 -14.782 36.373 1.00 50.11 C ATOM 7947 O GLU B 427 4.196 -13.774 36.970 1.00 50.04 O ATOM 7948 CB GLU B 427 3.736 -16.373 38.084 1.00 54.35 C ATOM 7949 CG GLU B 427 3.542 -17.837 38.454 1.00 60.40 C ATOM 7950 CD GLU B 427 2.122 -18.319 38.249 1.00 64.10 C ATOM 7951 OE1 GLU B 427 1.587 -18.169 37.127 1.00 65.82 O ATOM 7952 OE2 GLU B 427 1.541 -18.855 39.219 1.00 67.40 O ATOM 7953 HA GLU B 427 2.872 -16.049 36.118 1.00 0.00 H ATOM 7954 HB2 GLU B 427 4.646 -16.017 38.566 1.00 0.00 H ATOM 7955 HB3 GLU B 427 2.882 -15.810 38.460 1.00 0.00 H ATOM 7956 HG2 GLU B 427 4.206 -18.442 37.837 1.00 0.00 H ATOM 7957 HG3 GLU B 427 3.805 -17.967 39.504 1.00 0.00 H ATOM 7958 H GLU B 427 5.325 -17.700 36.447 1.00 0.00 H ATOM 7959 N SER B 428 5.599 -14.775 35.539 1.00 49.34 N ATOM 7960 CA SER B 428 6.342 -13.547 35.303 1.00 47.97 C ATOM 7961 C SER B 428 6.044 -12.995 33.919 1.00 45.16 C ATOM 7962 O SER B 428 6.695 -13.345 32.930 1.00 43.30 O ATOM 7963 CB SER B 428 7.841 -13.794 35.466 1.00 49.87 C ATOM 7964 OG SER B 428 8.535 -12.556 35.481 1.00 55.49 O ATOM 7965 HA SER B 428 6.027 -12.809 36.040 1.00 0.00 H ATOM 7966 HB2 SER B 428 8.200 -14.400 34.635 1.00 0.00 H ATOM 7967 HB3 SER B 428 8.021 -14.321 36.403 1.00 0.00 H ATOM 7968 HG SER B 428 8.373 -12.078 34.630 1.00 0.00 H ATOM 7969 H SER B 428 5.877 -15.651 35.052 1.00 0.00 H ATOM 7970 N SER B 429 5.055 -12.112 33.867 1.00 43.77 N ATOM 7971 CA SER B 429 4.624 -11.502 32.618 1.00 41.30 C ATOM 7972 C SER B 429 5.719 -10.764 31.862 1.00 39.62 C ATOM 7973 O SER B 429 6.446 -9.947 32.428 1.00 39.42 O ATOM 7974 CB SER B 429 3.476 -10.535 32.889 1.00 43.10 C ATOM 7975 OG SER B 429 2.974 -10.015 31.674 1.00 43.92 O ATOM 7976 HA SER B 429 4.313 -12.330 31.981 1.00 0.00 H ATOM 7977 HB2 SER B 429 3.836 -9.715 33.510 1.00 0.00 H ATOM 7978 HB3 SER B 429 2.678 -11.062 33.412 1.00 0.00 H ATOM 7979 HG SER B 429 2.231 -9.390 31.866 1.00 0.00 H ATOM 7980 H SER B 429 4.571 -11.847 34.749 1.00 0.00 H ATOM 7981 N GLN B 430 5.828 -11.058 30.576 1.00 35.95 N ATOM 7982 CA GLN B 430 6.802 -10.405 29.722 1.00 35.17 C ATOM 7983 C GLN B 430 8.242 -10.336 30.275 1.00 34.27 C ATOM 7984 O GLN B 430 8.920 -9.319 30.114 1.00 33.25 O ATOM 7985 CB GLN B 430 6.290 -8.994 29.405 1.00 38.47 C ATOM 7986 CG GLN B 430 6.830 -8.413 28.113 1.00 42.06 C ATOM 7987 CD GLN B 430 6.569 -9.328 26.946 1.00 43.61 C ATOM 7988 OE1 GLN B 430 5.438 -9.416 26.460 1.00 45.16 O ATOM 7989 NE2 GLN B 430 7.612 -10.056 26.507 1.00 43.75 N ATOM 7990 HA GLN B 430 6.889 -11.025 28.830 1.00 0.00 H ATOM 7991 HB2 GLN B 430 5.203 -9.032 29.335 1.00 0.00 H ATOM 7992 HB3 GLN B 430 6.577 -8.334 30.223 1.00 0.00 H ATOM 7993 HG2 GLN B 430 6.347 -7.454 27.926 1.00 0.00 H ATOM 7994 HG3 GLN B 430 7.905 -8.264 28.213 1.00 0.00 H ATOM 7995 HE22 GLN B 430 8.546 -9.945 26.950 1.00 0.00 H ATOM 7996 HE21 GLN B 430 7.484 -10.729 25.725 1.00 0.00 H ATOM 7997 H GLN B 430 5.198 -11.777 30.167 1.00 0.00 H ATOM 7998 N LEU B 431 8.719 -11.409 30.905 1.00 32.65 N ATOM 7999 CA LEU B 431 10.083 -11.420 31.457 1.00 31.15 C ATOM 8000 C LEU B 431 11.110 -11.418 30.330 1.00 29.35 C ATOM 8001 O LEU B 431 12.226 -10.918 30.477 1.00 29.68 O ATOM 8002 CB LEU B 431 10.306 -12.648 32.358 1.00 29.87 C ATOM 8003 CG LEU B 431 11.646 -12.739 33.110 1.00 30.49 C ATOM 8004 CD1 LEU B 431 11.810 -11.554 34.049 1.00 26.25 C ATOM 8005 CD2 LEU B 431 11.687 -14.039 33.906 1.00 29.85 C ATOM 8006 HA LEU B 431 10.207 -10.520 32.060 1.00 0.00 H ATOM 8007 HB2 LEU B 431 9.511 -12.656 33.104 1.00 0.00 H ATOM 8008 HB3 LEU B 431 10.222 -13.535 31.730 1.00 0.00 H ATOM 8009 HG LEU B 431 12.462 -12.723 32.388 1.00 0.00 H ATOM 8010 HD21 LEU B 431 10.864 -14.052 34.621 1.00 0.00 H ATOM 8011 HD22 LEU B 431 11.591 -14.884 33.224 1.00 0.00 H ATOM 8012 HD23 LEU B 431 12.635 -14.107 34.440 1.00 0.00 H ATOM 8013 HD11 LEU B 431 11.789 -10.629 33.472 1.00 0.00 H ATOM 8014 HD12 LEU B 431 10.996 -11.551 34.774 1.00 0.00 H ATOM 8015 HD13 LEU B 431 12.763 -11.636 34.572 1.00 0.00 H ATOM 8016 H LEU B 431 8.118 -12.252 31.008 1.00 0.00 H ATOM 8017 N PHE B 432 10.721 -11.977 29.196 1.00 28.18 N ATOM 8018 CA PHE B 432 11.591 -12.028 28.037 1.00 27.14 C ATOM 8019 C PHE B 432 11.961 -10.583 27.668 1.00 29.84 C ATOM 8020 O PHE B 432 13.147 -10.210 27.599 1.00 29.40 O ATOM 8021 CB PHE B 432 10.833 -12.714 26.898 1.00 24.17 C ATOM 8022 CG PHE B 432 11.647 -12.963 25.666 1.00 22.64 C ATOM 8023 CD1 PHE B 432 12.949 -13.441 25.752 1.00 22.30 C ATOM 8024 CD2 PHE B 432 11.086 -12.769 24.413 1.00 25.74 C ATOM 8025 CE1 PHE B 432 13.683 -13.725 24.608 1.00 22.02 C ATOM 8026 CE2 PHE B 432 11.802 -13.048 23.256 1.00 24.90 C ATOM 8027 CZ PHE B 432 13.112 -13.531 23.354 1.00 25.49 C ATOM 8028 HA PHE B 432 12.503 -12.591 28.235 1.00 0.00 H ATOM 8029 HB2 PHE B 432 10.467 -13.674 27.263 1.00 0.00 H ATOM 8030 HB3 PHE B 432 9.987 -12.084 26.625 1.00 0.00 H ATOM 8031 HD2 PHE B 432 10.067 -12.391 24.335 1.00 0.00 H ATOM 8032 HE2 PHE B 432 11.347 -12.892 22.278 1.00 0.00 H ATOM 8033 HZ PHE B 432 13.682 -13.754 22.452 1.00 0.00 H ATOM 8034 HE1 PHE B 432 14.703 -14.099 24.692 1.00 0.00 H ATOM 8035 HD1 PHE B 432 13.401 -13.595 26.732 1.00 0.00 H ATOM 8036 H PHE B 432 9.768 -12.390 29.134 1.00 0.00 H ATOM 8037 N ALA B 433 10.931 -9.770 27.457 1.00 30.88 N ATOM 8038 CA ALA B 433 11.102 -8.374 27.080 1.00 31.45 C ATOM 8039 C ALA B 433 11.955 -7.596 28.078 1.00 29.22 C ATOM 8040 O ALA B 433 12.871 -6.889 27.685 1.00 29.36 O ATOM 8041 CB ALA B 433 9.728 -7.701 26.931 1.00 30.22 C ATOM 8042 HA ALA B 433 11.630 -8.361 26.127 1.00 0.00 H ATOM 8043 HB1 ALA B 433 9.155 -8.215 26.159 1.00 0.00 H ATOM 8044 HB2 ALA B 433 9.193 -7.755 27.879 1.00 0.00 H ATOM 8045 HB3 ALA B 433 9.865 -6.657 26.649 1.00 0.00 H ATOM 8046 H ALA B 433 9.967 -10.145 27.565 1.00 0.00 H ATOM 8047 N LYS B 434 11.656 -7.726 29.367 1.00 30.37 N ATOM 8048 CA LYS B 434 12.411 -6.994 30.384 1.00 30.65 C ATOM 8049 C LYS B 434 13.895 -7.333 30.409 1.00 29.28 C ATOM 8050 O LYS B 434 14.740 -6.452 30.590 1.00 29.73 O ATOM 8051 CB LYS B 434 11.812 -7.227 31.770 1.00 30.87 C ATOM 8052 CG LYS B 434 10.423 -6.638 31.963 1.00 34.75 C ATOM 8053 CD LYS B 434 9.986 -6.856 33.396 1.00 38.24 C ATOM 8054 CE LYS B 434 8.536 -6.484 33.609 1.00 42.24 C ATOM 8055 NZ LYS B 434 8.153 -6.625 35.047 1.00 45.53 N ATOM 8056 HA LYS B 434 12.331 -5.942 30.110 1.00 0.00 H ATOM 8057 HB2 LYS B 434 11.753 -8.302 31.940 1.00 0.00 H ATOM 8058 HB3 LYS B 434 12.477 -6.780 32.509 1.00 0.00 H ATOM 8059 HG2 LYS B 434 10.446 -5.570 31.747 1.00 0.00 H ATOM 8060 HG3 LYS B 434 9.721 -7.129 31.289 1.00 0.00 H ATOM 8061 HD2 LYS B 434 10.121 -7.908 33.649 1.00 0.00 H ATOM 8062 HD3 LYS B 434 10.606 -6.244 34.050 1.00 0.00 H ATOM 8063 HE2 LYS B 434 7.907 -7.139 33.006 1.00 0.00 H ATOM 8064 HE3 LYS B 434 8.384 -5.450 33.299 1.00 0.00 H ATOM 8065 HZ1 LYS B 434 8.293 -7.611 35.347 1.00 0.00 H ATOM 8066 HZ2 LYS B 434 8.747 -5.998 35.626 1.00 0.00 H ATOM 8067 HZ3 LYS B 434 7.153 -6.364 35.165 1.00 0.00 H ATOM 8068 H LYS B 434 10.878 -8.354 29.655 1.00 0.00 H ATOM 8069 N LEU B 435 14.211 -8.610 30.224 1.00 28.56 N ATOM 8070 CA LEU B 435 15.599 -9.046 30.221 1.00 28.31 C ATOM 8071 C LEU B 435 16.333 -8.438 29.031 1.00 27.69 C ATOM 8072 O LEU B 435 17.445 -7.930 29.178 1.00 25.90 O ATOM 8073 CB LEU B 435 15.678 -10.580 30.177 1.00 26.78 C ATOM 8074 CG LEU B 435 17.066 -11.201 30.004 1.00 29.05 C ATOM 8075 CD1 LEU B 435 18.012 -10.686 31.102 1.00 27.48 C ATOM 8076 CD2 LEU B 435 16.949 -12.734 30.072 1.00 28.44 C ATOM 8077 HA LEU B 435 16.078 -8.705 31.139 1.00 0.00 H ATOM 8078 HB2 LEU B 435 15.263 -10.958 31.112 1.00 0.00 H ATOM 8079 HB3 LEU B 435 15.061 -10.917 29.344 1.00 0.00 H ATOM 8080 HG LEU B 435 17.475 -10.917 29.035 1.00 0.00 H ATOM 8081 HD21 LEU B 435 16.537 -13.023 31.039 1.00 0.00 H ATOM 8082 HD22 LEU B 435 16.291 -13.083 29.276 1.00 0.00 H ATOM 8083 HD23 LEU B 435 17.937 -13.178 29.949 1.00 0.00 H ATOM 8084 HD11 LEU B 435 18.092 -9.601 31.031 1.00 0.00 H ATOM 8085 HD12 LEU B 435 17.615 -10.960 32.080 1.00 0.00 H ATOM 8086 HD13 LEU B 435 18.997 -11.134 30.970 1.00 0.00 H ATOM 8087 H LEU B 435 13.455 -9.309 30.079 1.00 0.00 H ATOM 8088 N LEU B 436 15.709 -8.482 27.856 1.00 27.90 N ATOM 8089 CA LEU B 436 16.327 -7.918 26.668 1.00 28.71 C ATOM 8090 C LEU B 436 16.599 -6.422 26.801 1.00 29.77 C ATOM 8091 O LEU B 436 17.635 -5.939 26.353 1.00 30.42 O ATOM 8092 CB LEU B 436 15.464 -8.167 25.420 1.00 29.70 C ATOM 8093 CG LEU B 436 15.306 -9.601 24.894 1.00 30.09 C ATOM 8094 CD1 LEU B 436 14.528 -9.561 23.597 1.00 31.63 C ATOM 8095 CD2 LEU B 436 16.669 -10.258 24.674 1.00 29.33 C ATOM 8096 HA LEU B 436 17.284 -8.427 26.558 1.00 0.00 H ATOM 8097 HB2 LEU B 436 14.463 -7.798 25.645 1.00 0.00 H ATOM 8098 HB3 LEU B 436 15.894 -7.576 24.611 1.00 0.00 H ATOM 8099 HG LEU B 436 14.768 -10.196 25.632 1.00 0.00 H ATOM 8100 HD21 LEU B 436 17.237 -9.679 23.946 1.00 0.00 H ATOM 8101 HD22 LEU B 436 17.212 -10.290 25.618 1.00 0.00 H ATOM 8102 HD23 LEU B 436 16.526 -11.272 24.301 1.00 0.00 H ATOM 8103 HD11 LEU B 436 13.546 -9.122 23.777 1.00 0.00 H ATOM 8104 HD12 LEU B 436 15.069 -8.957 22.869 1.00 0.00 H ATOM 8105 HD13 LEU B 436 14.410 -10.575 23.214 1.00 0.00 H ATOM 8106 H LEU B 436 14.770 -8.924 27.788 1.00 0.00 H ATOM 8107 N GLN B 437 15.693 -5.670 27.411 1.00 32.32 N ATOM 8108 CA GLN B 437 15.962 -4.244 27.519 1.00 36.86 C ATOM 8109 C GLN B 437 17.091 -3.990 28.500 1.00 35.82 C ATOM 8110 O GLN B 437 17.698 -2.923 28.496 1.00 36.04 O ATOM 8111 CB GLN B 437 14.700 -3.454 27.899 1.00 40.59 C ATOM 8112 CG GLN B 437 13.994 -3.890 29.149 1.00 50.24 C ATOM 8113 CD GLN B 437 12.721 -3.080 29.400 1.00 55.31 C ATOM 8114 OE1 GLN B 437 11.840 -2.982 28.532 1.00 52.37 O ATOM 8115 NE2 GLN B 437 12.619 -2.500 30.597 1.00 57.93 N ATOM 8116 HA GLN B 437 16.275 -3.887 26.538 1.00 0.00 H ATOM 8117 HB2 GLN B 437 14.987 -2.410 28.026 1.00 0.00 H ATOM 8118 HB3 GLN B 437 13.994 -3.537 27.072 1.00 0.00 H ATOM 8119 HG2 GLN B 437 13.729 -4.943 29.055 1.00 0.00 H ATOM 8120 HG3 GLN B 437 14.667 -3.761 29.997 1.00 0.00 H ATOM 8121 HE22 GLN B 437 13.383 -2.609 31.294 1.00 0.00 H ATOM 8122 HE21 GLN B 437 11.776 -1.939 30.833 1.00 0.00 H ATOM 8123 H GLN B 437 14.821 -6.085 27.798 1.00 0.00 H ATOM 8124 N LYS B 438 17.392 -4.988 29.325 1.00 35.70 N ATOM 8125 CA LYS B 438 18.479 -4.860 30.282 1.00 35.21 C ATOM 8126 C LYS B 438 19.789 -4.771 29.513 1.00 36.65 C ATOM 8127 O LYS B 438 20.806 -4.337 30.052 1.00 38.07 O ATOM 8128 CB LYS B 438 18.500 -6.062 31.233 1.00 36.57 C ATOM 8129 CG LYS B 438 18.107 -5.732 32.664 1.00 38.69 C ATOM 8130 CD LYS B 438 16.796 -4.979 32.727 1.00 42.29 C ATOM 8131 CE LYS B 438 16.423 -4.648 34.157 1.00 46.33 C ATOM 8132 NZ LYS B 438 17.453 -3.772 34.795 1.00 48.16 N ATOM 8133 HA LYS B 438 18.339 -3.961 30.882 1.00 0.00 H ATOM 8134 HB2 LYS B 438 17.806 -6.812 30.852 1.00 0.00 H ATOM 8135 HB3 LYS B 438 19.509 -6.474 31.242 1.00 0.00 H ATOM 8136 HG2 LYS B 438 18.008 -6.661 33.226 1.00 0.00 H ATOM 8137 HG3 LYS B 438 18.889 -5.119 33.112 1.00 0.00 H ATOM 8138 HD2 LYS B 438 16.890 -4.053 32.160 1.00 0.00 H ATOM 8139 HD3 LYS B 438 16.011 -5.594 32.288 1.00 0.00 H ATOM 8140 HE2 LYS B 438 16.341 -5.574 34.727 1.00 0.00 H ATOM 8141 HE3 LYS B 438 15.463 -4.132 34.164 1.00 0.00 H ATOM 8142 HZ1 LYS B 438 18.371 -4.262 34.795 1.00 0.00 H ATOM 8143 HZ2 LYS B 438 17.532 -2.885 34.258 1.00 0.00 H ATOM 8144 HZ3 LYS B 438 17.170 -3.562 35.774 1.00 0.00 H ATOM 8145 H LYS B 438 16.843 -5.871 29.285 1.00 0.00 H ATOM 8146 N MET B 439 19.761 -5.170 28.242 1.00 36.36 N ATOM 8147 CA MET B 439 20.961 -5.105 27.424 1.00 37.89 C ATOM 8148 C MET B 439 21.386 -3.656 27.145 1.00 37.02 C ATOM 8149 O MET B 439 22.555 -3.405 26.850 1.00 36.64 O ATOM 8150 CB MET B 439 20.758 -5.858 26.099 1.00 39.34 C ATOM 8151 CG MET B 439 20.510 -7.360 26.269 1.00 44.83 C ATOM 8152 SD MET B 439 20.316 -8.295 24.710 1.00 50.40 S ATOM 8153 CE MET B 439 18.721 -7.690 24.151 1.00 49.65 C ATOM 8154 HA MET B 439 21.760 -5.585 27.988 1.00 0.00 H ATOM 8155 HB2 MET B 439 19.900 -5.424 25.586 1.00 0.00 H ATOM 8156 HB3 MET B 439 21.651 -5.724 25.488 1.00 0.00 H ATOM 8157 HG2 MET B 439 19.600 -7.488 26.855 1.00 0.00 H ATOM 8158 HG3 MET B 439 21.354 -7.782 26.814 1.00 0.00 H ATOM 8159 HE1 MET B 439 17.963 -7.924 24.898 1.00 0.00 H ATOM 8160 HE2 MET B 439 18.773 -6.610 24.010 1.00 0.00 H ATOM 8161 HE3 MET B 439 18.463 -8.169 23.207 1.00 0.00 H ATOM 8162 H MET B 439 18.875 -5.530 27.833 1.00 0.00 H ATOM 8163 N THR B 440 20.465 -2.699 27.245 1.00 35.88 N ATOM 8164 CA THR B 440 20.854 -1.312 26.977 1.00 39.39 C ATOM 8165 C THR B 440 21.755 -0.842 28.102 1.00 39.48 C ATOM 8166 O THR B 440 22.779 -0.215 27.858 1.00 39.81 O ATOM 8167 CB THR B 440 19.646 -0.338 26.873 1.00 40.13 C ATOM 8168 OG1 THR B 440 19.143 -0.050 28.183 1.00 43.22 O ATOM 8169 CG2 THR B 440 18.542 -0.945 26.018 1.00 38.51 C ATOM 8170 HA THR B 440 21.358 -1.300 26.011 1.00 0.00 H ATOM 8171 HB THR B 440 19.982 0.586 26.402 1.00 0.00 H ATOM 8172 HG1 THR B 440 18.850 -0.891 28.615 1.00 0.00 H ATOM 8173 HG23 THR B 440 18.932 -1.161 25.023 1.00 0.00 H ATOM 8174 HG21 THR B 440 18.191 -1.868 26.481 1.00 0.00 H ATOM 8175 HG22 THR B 440 17.715 -0.239 25.940 1.00 0.00 H ATOM 8176 H THR B 440 19.486 -2.932 27.509 1.00 0.00 H ATOM 8177 N ASP B 441 21.374 -1.165 29.335 1.00 40.89 N ATOM 8178 CA ASP B 441 22.166 -0.797 30.500 1.00 42.52 C ATOM 8179 C ASP B 441 23.538 -1.468 30.492 1.00 39.98 C ATOM 8180 O ASP B 441 24.526 -0.859 30.893 1.00 38.72 O ATOM 8181 CB ASP B 441 21.427 -1.171 31.781 1.00 48.32 C ATOM 8182 CG ASP B 441 20.129 -0.423 31.932 1.00 54.01 C ATOM 8183 OD1 ASP B 441 19.220 -0.657 31.102 1.00 58.46 O ATOM 8184 OD2 ASP B 441 20.020 0.397 32.873 1.00 55.70 O ATOM 8185 HA ASP B 441 22.316 0.282 30.460 1.00 0.00 H ATOM 8186 HB2 ASP B 441 21.216 -2.240 31.765 1.00 0.00 H ATOM 8187 HB3 ASP B 441 22.065 -0.941 32.634 1.00 0.00 H ATOM 8188 H ASP B 441 20.489 -1.693 29.470 1.00 0.00 H ATOM 8189 N LEU B 442 23.594 -2.723 30.049 1.00 38.14 N ATOM 8190 CA LEU B 442 24.858 -3.453 29.979 1.00 37.75 C ATOM 8191 C LEU B 442 25.845 -2.746 29.056 1.00 36.53 C ATOM 8192 O LEU B 442 26.979 -2.474 29.438 1.00 35.17 O ATOM 8193 CB LEU B 442 24.643 -4.877 29.454 1.00 39.50 C ATOM 8194 CG LEU B 442 24.746 -6.044 30.434 1.00 40.74 C ATOM 8195 CD1 LEU B 442 24.603 -7.345 29.658 1.00 42.06 C ATOM 8196 CD2 LEU B 442 26.074 -6.011 31.157 1.00 37.27 C ATOM 8197 HA LEU B 442 25.261 -3.491 30.991 1.00 0.00 H ATOM 8198 HB2 LEU B 442 23.645 -4.911 29.018 1.00 0.00 H ATOM 8199 HB3 LEU B 442 25.385 -5.047 28.674 1.00 0.00 H ATOM 8200 HG LEU B 442 23.954 -5.968 31.179 1.00 0.00 H ATOM 8201 HD21 LEU B 442 26.884 -6.084 30.431 1.00 0.00 H ATOM 8202 HD22 LEU B 442 26.163 -5.075 31.709 1.00 0.00 H ATOM 8203 HD23 LEU B 442 26.129 -6.850 31.851 1.00 0.00 H ATOM 8204 HD11 LEU B 442 23.634 -7.364 29.158 1.00 0.00 H ATOM 8205 HD12 LEU B 442 25.398 -7.413 28.915 1.00 0.00 H ATOM 8206 HD13 LEU B 442 24.675 -8.187 30.346 1.00 0.00 H ATOM 8207 H LEU B 442 22.718 -3.194 29.746 1.00 0.00 H ATOM 8208 N ARG B 443 25.409 -2.467 27.833 1.00 37.07 N ATOM 8209 CA ARG B 443 26.253 -1.791 26.852 1.00 39.41 C ATOM 8210 C ARG B 443 26.769 -0.466 27.425 1.00 39.77 C ATOM 8211 O ARG B 443 27.929 -0.105 27.230 1.00 38.03 O ATOM 8212 CB ARG B 443 25.460 -1.526 25.571 1.00 42.22 C ATOM 8213 CG ARG B 443 26.026 -2.171 24.309 1.00 47.16 C ATOM 8214 CD ARG B 443 25.529 -3.602 24.081 1.00 49.22 C ATOM 8215 NE ARG B 443 25.493 -3.931 22.650 1.00 49.37 N ATOM 8216 CZ ARG B 443 25.203 -5.133 22.155 1.00 53.69 C ATOM 8217 NH1 ARG B 443 24.920 -6.147 22.968 1.00 54.91 N ATOM 8218 NH2 ARG B 443 25.192 -5.329 20.840 1.00 51.75 N ATOM 8219 HA ARG B 443 27.102 -2.433 26.619 1.00 0.00 H ATOM 8220 HB2 ARG B 443 24.448 -1.903 25.717 1.00 0.00 H ATOM 8221 HB3 ARG B 443 25.426 -0.448 25.412 1.00 0.00 H ATOM 8222 HG2 ARG B 443 25.737 -1.564 23.451 1.00 0.00 H ATOM 8223 HG3 ARG B 443 27.113 -2.191 24.389 1.00 0.00 H ATOM 8224 HD2 ARG B 443 24.525 -3.700 24.494 1.00 0.00 H ATOM 8225 HD3 ARG B 443 26.199 -4.296 24.589 1.00 0.00 H ATOM 8226 HE ARG B 443 25.710 -3.170 21.975 1.00 0.00 H ATOM 8227 HH12 ARG B 443 24.695 -7.083 22.574 1.00 0.00 H ATOM 8228 HH11 ARG B 443 24.924 -6.004 23.998 1.00 0.00 H ATOM 8229 HH22 ARG B 443 24.965 -6.269 20.456 1.00 0.00 H ATOM 8230 HH21 ARG B 443 25.410 -4.543 20.195 1.00 0.00 H ATOM 8231 H ARG B 443 24.441 -2.737 27.567 1.00 0.00 H ATOM 8232 N GLN B 444 25.900 0.256 28.127 1.00 39.38 N ATOM 8233 CA GLN B 444 26.289 1.522 28.728 1.00 40.46 C ATOM 8234 C GLN B 444 27.319 1.310 29.832 1.00 41.16 C ATOM 8235 O GLN B 444 28.278 2.074 29.957 1.00 40.40 O ATOM 8236 CB GLN B 444 25.062 2.250 29.278 1.00 41.20 C ATOM 8237 CG GLN B 444 24.524 3.277 28.309 1.00 40.73 C ATOM 8238 CD GLN B 444 25.563 4.334 27.984 1.00 40.88 C ATOM 8239 OE1 GLN B 444 25.526 4.952 26.921 1.00 40.59 O ATOM 8240 NE2 GLN B 444 26.496 4.552 28.908 1.00 41.50 N ATOM 8241 HA GLN B 444 26.745 2.138 27.953 1.00 0.00 H ATOM 8242 HB2 GLN B 444 24.281 1.517 29.482 1.00 0.00 H ATOM 8243 HB3 GLN B 444 25.338 2.753 30.205 1.00 0.00 H ATOM 8244 HG2 GLN B 444 24.229 2.775 27.388 1.00 0.00 H ATOM 8245 HG3 GLN B 444 23.653 3.760 28.752 1.00 0.00 H ATOM 8246 HE22 GLN B 444 26.489 4.006 29.793 1.00 0.00 H ATOM 8247 HE21 GLN B 444 27.232 5.269 28.745 1.00 0.00 H ATOM 8248 H GLN B 444 24.927 -0.090 28.248 1.00 0.00 H ATOM 8249 N ILE B 445 27.115 0.270 30.631 1.00 40.88 N ATOM 8250 CA ILE B 445 28.046 -0.052 31.707 1.00 42.30 C ATOM 8251 C ILE B 445 29.416 -0.300 31.085 1.00 41.59 C ATOM 8252 O ILE B 445 30.421 0.262 31.523 1.00 41.31 O ATOM 8253 CB ILE B 445 27.625 -1.333 32.459 1.00 45.35 C ATOM 8254 CG1 ILE B 445 26.305 -1.096 33.191 1.00 47.40 C ATOM 8255 CG2 ILE B 445 28.719 -1.760 33.416 1.00 47.72 C ATOM 8256 CD1 ILE B 445 26.327 0.111 34.107 1.00 50.62 C ATOM 8257 HA ILE B 445 28.059 0.777 32.414 1.00 0.00 H ATOM 8258 HB ILE B 445 27.475 -2.141 31.742 1.00 0.00 H ATOM 8259 HG12 ILE B 445 25.520 -0.951 32.449 1.00 0.00 H ATOM 8260 HG13 ILE B 445 26.079 -1.979 33.789 1.00 0.00 H ATOM 8261 HD11 ILE B 445 27.100 -0.023 34.864 1.00 0.00 H ATOM 8262 HD12 ILE B 445 26.541 1.006 33.522 1.00 0.00 H ATOM 8263 HD13 ILE B 445 25.356 0.215 34.592 1.00 0.00 H ATOM 8264 HG21 ILE B 445 29.633 -1.958 32.856 1.00 0.00 H ATOM 8265 HG22 ILE B 445 28.899 -0.964 34.138 1.00 0.00 H ATOM 8266 HG23 ILE B 445 28.409 -2.664 33.940 1.00 0.00 H ATOM 8267 H ILE B 445 26.275 -0.327 30.487 1.00 0.00 H ATOM 8268 N VAL B 446 29.445 -1.138 30.051 1.00 39.84 N ATOM 8269 CA VAL B 446 30.692 -1.468 29.367 1.00 41.08 C ATOM 8270 C VAL B 446 31.360 -0.223 28.784 1.00 41.00 C ATOM 8271 O VAL B 446 32.518 0.053 29.074 1.00 40.43 O ATOM 8272 CB VAL B 446 30.446 -2.502 28.245 1.00 39.56 C ATOM 8273 CG1 VAL B 446 31.705 -2.719 27.441 1.00 39.26 C ATOM 8274 CG2 VAL B 446 29.997 -3.812 28.861 1.00 42.32 C ATOM 8275 HA VAL B 446 31.362 -1.900 30.110 1.00 0.00 H ATOM 8276 HB VAL B 446 29.671 -2.125 27.578 1.00 0.00 H ATOM 8277 HG11 VAL B 446 32.015 -1.775 26.992 1.00 0.00 H ATOM 8278 HG12 VAL B 446 32.494 -3.088 28.096 1.00 0.00 H ATOM 8279 HG13 VAL B 446 31.512 -3.450 26.656 1.00 0.00 H ATOM 8280 HG21 VAL B 446 30.772 -4.180 29.534 1.00 0.00 H ATOM 8281 HG22 VAL B 446 29.075 -3.652 29.419 1.00 0.00 H ATOM 8282 HG23 VAL B 446 29.823 -4.543 28.071 1.00 0.00 H ATOM 8283 H VAL B 446 28.557 -1.568 29.722 1.00 0.00 H ATOM 8284 N THR B 447 30.629 0.524 27.963 1.00 42.43 N ATOM 8285 CA THR B 447 31.169 1.741 27.366 1.00 45.29 C ATOM 8286 C THR B 447 31.808 2.605 28.449 1.00 46.90 C ATOM 8287 O THR B 447 32.971 2.986 28.346 1.00 49.02 O ATOM 8288 CB THR B 447 30.064 2.560 26.667 1.00 45.00 C ATOM 8289 OG1 THR B 447 29.597 1.844 25.523 1.00 43.88 O ATOM 8290 CG2 THR B 447 30.594 3.924 26.227 1.00 45.95 C ATOM 8291 HA THR B 447 31.912 1.448 26.624 1.00 0.00 H ATOM 8292 HB THR B 447 29.248 2.715 27.372 1.00 0.00 H ATOM 8293 HG1 THR B 447 29.231 0.970 25.809 1.00 0.00 H ATOM 8294 HG23 THR B 447 30.951 4.472 27.099 1.00 0.00 H ATOM 8295 HG21 THR B 447 31.415 3.784 25.523 1.00 0.00 H ATOM 8296 HG22 THR B 447 29.793 4.486 25.746 1.00 0.00 H ATOM 8297 H THR B 447 29.654 0.236 27.742 1.00 0.00 H ATOM 8298 N GLU B 448 31.030 2.902 29.484 1.00 47.61 N ATOM 8299 CA GLU B 448 31.478 3.706 30.609 1.00 49.08 C ATOM 8300 C GLU B 448 32.760 3.145 31.214 1.00 49.37 C ATOM 8301 O GLU B 448 33.715 3.882 31.471 1.00 48.81 O ATOM 8302 CB GLU B 448 30.387 3.731 31.677 1.00 50.16 C ATOM 8303 CG GLU B 448 30.119 5.095 32.266 1.00 55.01 C ATOM 8304 CD GLU B 448 28.793 5.149 33.003 1.00 58.35 C ATOM 8305 OE1 GLU B 448 28.718 4.654 34.151 1.00 59.40 O ATOM 8306 OE2 GLU B 448 27.820 5.678 32.421 1.00 57.53 O ATOM 8307 HA GLU B 448 31.681 4.715 30.250 1.00 0.00 H ATOM 8308 HB2 GLU B 448 29.463 3.366 31.229 1.00 0.00 H ATOM 8309 HB3 GLU B 448 30.686 3.064 32.485 1.00 0.00 H ATOM 8310 HG2 GLU B 448 30.920 5.340 32.964 1.00 0.00 H ATOM 8311 HG3 GLU B 448 30.104 5.829 31.460 1.00 0.00 H ATOM 8312 H GLU B 448 30.054 2.542 29.490 1.00 0.00 H ATOM 8313 N HIS B 449 32.773 1.835 31.434 1.00 49.58 N ATOM 8314 CA HIS B 449 33.921 1.165 32.026 1.00 50.51 C ATOM 8315 C HIS B 449 35.210 1.248 31.208 1.00 51.09 C ATOM 8316 O HIS B 449 36.269 1.545 31.757 1.00 48.88 O ATOM 8317 CB HIS B 449 33.580 -0.301 32.313 1.00 50.92 C ATOM 8318 CG HIS B 449 34.747 -1.109 32.791 1.00 52.12 C ATOM 8319 ND1 HIS B 449 35.760 -1.522 31.952 1.00 53.29 N ATOM 8320 CD2 HIS B 449 35.063 -1.580 34.020 1.00 53.05 C ATOM 8321 CE1 HIS B 449 36.645 -2.218 32.642 1.00 52.11 C ATOM 8322 NE2 HIS B 449 36.245 -2.269 33.900 1.00 53.14 N ATOM 8323 HA HIS B 449 34.127 1.706 32.950 1.00 0.00 H ATOM 8324 HB2 HIS B 449 32.804 -0.331 33.078 1.00 0.00 H ATOM 8325 HB3 HIS B 449 33.201 -0.752 31.396 1.00 0.00 H ATOM 8326 HD2 HIS B 449 34.487 -1.439 34.934 1.00 0.00 H ATOM 8327 HE1 HIS B 449 37.551 -2.673 32.242 1.00 0.00 H ATOM 8328 H HIS B 449 31.938 1.272 31.175 1.00 0.00 H ATOM 8329 N VAL B 450 35.138 0.978 29.908 1.00 52.51 N ATOM 8330 CA VAL B 450 36.345 1.052 29.094 1.00 56.09 C ATOM 8331 C VAL B 450 36.850 2.494 29.116 1.00 57.92 C ATOM 8332 O VAL B 450 38.042 2.751 28.969 1.00 58.26 O ATOM 8333 CB VAL B 450 36.093 0.608 27.625 1.00 55.56 C ATOM 8334 CG1 VAL B 450 35.557 -0.816 27.598 1.00 53.37 C ATOM 8335 CG2 VAL B 450 35.137 1.567 26.940 1.00 55.58 C ATOM 8336 HA VAL B 450 37.086 0.370 29.511 1.00 0.00 H ATOM 8337 HB VAL B 450 37.036 0.629 27.078 1.00 0.00 H ATOM 8338 HG11 VAL B 450 36.285 -1.486 28.056 1.00 0.00 H ATOM 8339 HG12 VAL B 450 34.620 -0.861 28.153 1.00 0.00 H ATOM 8340 HG13 VAL B 450 35.384 -1.118 26.565 1.00 0.00 H ATOM 8341 HG21 VAL B 450 34.188 1.577 27.476 1.00 0.00 H ATOM 8342 HG22 VAL B 450 35.567 2.569 26.940 1.00 0.00 H ATOM 8343 HG23 VAL B 450 34.972 1.241 25.913 1.00 0.00 H ATOM 8344 H VAL B 450 34.229 0.716 29.476 1.00 0.00 H ATOM 8345 N GLN B 451 35.927 3.428 29.312 1.00 61.06 N ATOM 8346 CA GLN B 451 36.255 4.847 29.380 1.00 64.38 C ATOM 8347 C GLN B 451 37.089 5.143 30.626 1.00 65.90 C ATOM 8348 O GLN B 451 38.054 5.901 30.569 1.00 67.28 O ATOM 8349 CB GLN B 451 34.963 5.673 29.386 1.00 65.74 C ATOM 8350 CG GLN B 451 35.106 7.108 29.867 1.00 70.07 C ATOM 8351 CD GLN B 451 34.805 7.260 31.353 1.00 72.14 C ATOM 8352 OE1 GLN B 451 35.456 6.646 32.197 1.00 73.00 O ATOM 8353 NE2 GLN B 451 33.810 8.085 31.675 1.00 72.38 N ATOM 8354 HA GLN B 451 36.846 5.120 28.505 1.00 0.00 H ATOM 8355 HB2 GLN B 451 34.575 5.697 28.368 1.00 0.00 H ATOM 8356 HB3 GLN B 451 34.246 5.171 30.035 1.00 0.00 H ATOM 8357 HG2 GLN B 451 36.128 7.438 29.682 1.00 0.00 H ATOM 8358 HG3 GLN B 451 34.415 7.736 29.304 1.00 0.00 H ATOM 8359 HE22 GLN B 451 33.286 8.584 30.928 1.00 0.00 H ATOM 8360 HE21 GLN B 451 33.557 8.230 32.673 1.00 0.00 H ATOM 8361 H GLN B 451 34.934 3.137 29.421 1.00 0.00 H ATOM 8362 N LEU B 452 36.714 4.542 31.751 1.00 66.90 N ATOM 8363 CA LEU B 452 37.438 4.732 33.002 1.00 67.61 C ATOM 8364 C LEU B 452 38.812 4.096 32.887 1.00 68.78 C ATOM 8365 O LEU B 452 39.805 4.619 33.399 1.00 67.75 O ATOM 8366 CB LEU B 452 36.678 4.085 34.164 1.00 67.20 C ATOM 8367 CG LEU B 452 35.444 4.826 34.687 1.00 69.24 C ATOM 8368 CD1 LEU B 452 34.635 3.913 35.597 1.00 69.10 C ATOM 8369 CD2 LEU B 452 35.886 6.086 35.426 1.00 69.12 C ATOM 8370 HA LEU B 452 37.535 5.800 33.195 1.00 0.00 H ATOM 8371 HB2 LEU B 452 36.354 3.097 33.836 1.00 0.00 H ATOM 8372 HB3 LEU B 452 37.375 3.980 34.995 1.00 0.00 H ATOM 8373 HG LEU B 452 34.808 5.117 33.851 1.00 0.00 H ATOM 8374 HD21 LEU B 452 36.527 5.809 36.263 1.00 0.00 H ATOM 8375 HD22 LEU B 452 36.437 6.732 34.743 1.00 0.00 H ATOM 8376 HD23 LEU B 452 35.008 6.614 35.799 1.00 0.00 H ATOM 8377 HD11 LEU B 452 34.316 3.034 35.037 1.00 0.00 H ATOM 8378 HD12 LEU B 452 35.252 3.603 36.440 1.00 0.00 H ATOM 8379 HD13 LEU B 452 33.760 4.450 35.963 1.00 0.00 H ATOM 8380 H LEU B 452 35.881 3.919 31.738 1.00 0.00 H ATOM 8381 N LEU B 453 38.856 2.956 32.210 1.00 70.21 N ATOM 8382 CA LEU B 453 40.094 2.221 32.023 1.00 72.33 C ATOM 8383 C LEU B 453 41.164 3.106 31.389 1.00 74.62 C ATOM 8384 O LEU B 453 42.353 2.931 31.649 1.00 75.91 O ATOM 8385 CB LEU B 453 39.838 1.000 31.144 1.00 71.40 C ATOM 8386 CG LEU B 453 40.492 -0.305 31.587 1.00 70.91 C ATOM 8387 CD1 LEU B 453 39.973 -0.688 32.962 1.00 71.31 C ATOM 8388 CD2 LEU B 453 40.181 -1.399 30.579 1.00 70.85 C ATOM 8389 HA LEU B 453 40.456 1.897 32.999 1.00 0.00 H ATOM 8390 HB2 LEU B 453 38.761 0.836 31.109 1.00 0.00 H ATOM 8391 HB3 LEU B 453 40.202 1.230 30.143 1.00 0.00 H ATOM 8392 HG LEU B 453 41.573 -0.176 31.641 1.00 0.00 H ATOM 8393 HD21 LEU B 453 39.102 -1.537 30.516 1.00 0.00 H ATOM 8394 HD22 LEU B 453 40.569 -1.112 29.602 1.00 0.00 H ATOM 8395 HD23 LEU B 453 40.650 -2.330 30.899 1.00 0.00 H ATOM 8396 HD11 LEU B 453 40.216 0.101 33.673 1.00 0.00 H ATOM 8397 HD12 LEU B 453 38.892 -0.819 32.917 1.00 0.00 H ATOM 8398 HD13 LEU B 453 40.440 -1.620 33.279 1.00 0.00 H ATOM 8399 H LEU B 453 37.978 2.578 31.801 1.00 0.00 H ATOM 8400 N GLN B 454 40.743 4.056 30.558 1.00 76.66 N ATOM 8401 CA GLN B 454 41.691 4.956 29.909 1.00 78.80 C ATOM 8402 C GLN B 454 42.203 5.972 30.928 1.00 79.41 C ATOM 8403 O GLN B 454 43.375 6.349 30.915 1.00 80.75 O ATOM 8404 CB GLN B 454 41.031 5.694 28.736 1.00 79.70 C ATOM 8405 CG GLN B 454 40.268 6.951 29.133 1.00 80.98 C ATOM 8406 CD GLN B 454 39.862 7.795 27.938 1.00 82.30 C ATOM 8407 OE1 GLN B 454 38.954 7.437 27.185 1.00 81.91 O ATOM 8408 NE2 GLN B 454 40.546 8.921 27.754 1.00 82.24 N ATOM 8409 HA GLN B 454 42.521 4.366 29.521 1.00 0.00 H ATOM 8410 HB2 GLN B 454 41.811 5.977 28.029 1.00 0.00 H ATOM 8411 HB3 GLN B 454 40.334 5.010 28.252 1.00 0.00 H ATOM 8412 HG2 GLN B 454 39.368 6.657 29.674 1.00 0.00 H ATOM 8413 HG3 GLN B 454 40.902 7.552 29.785 1.00 0.00 H ATOM 8414 HE22 GLN B 454 41.304 9.183 28.416 1.00 0.00 H ATOM 8415 HE21 GLN B 454 40.322 9.540 26.948 1.00 0.00 H ATOM 8416 H GLN B 454 39.726 4.159 30.369 1.00 0.00 H ATOM 8417 N VAL B 455 41.317 6.414 31.811 1.00 79.93 N ATOM 8418 CA VAL B 455 41.682 7.379 32.838 1.00 80.71 C ATOM 8419 C VAL B 455 42.587 6.709 33.866 1.00 82.03 C ATOM 8420 O VAL B 455 43.333 7.375 34.583 1.00 82.70 O ATOM 8421 CB VAL B 455 40.429 7.930 33.544 1.00 80.13 C ATOM 8422 CG1 VAL B 455 40.822 8.981 34.570 1.00 79.95 C ATOM 8423 CG2 VAL B 455 39.481 8.518 32.516 1.00 79.67 C ATOM 8424 HA VAL B 455 42.206 8.208 32.362 1.00 0.00 H ATOM 8425 HB VAL B 455 39.924 7.116 34.065 1.00 0.00 H ATOM 8426 HG11 VAL B 455 41.482 8.533 35.313 1.00 0.00 H ATOM 8427 HG12 VAL B 455 41.339 9.800 34.070 1.00 0.00 H ATOM 8428 HG13 VAL B 455 39.926 9.361 35.061 1.00 0.00 H ATOM 8429 HG21 VAL B 455 39.981 9.326 31.983 1.00 0.00 H ATOM 8430 HG22 VAL B 455 39.187 7.742 31.809 1.00 0.00 H ATOM 8431 HG23 VAL B 455 38.596 8.907 33.020 1.00 0.00 H ATOM 8432 H VAL B 455 40.339 6.063 31.769 1.00 0.00 H ATOM 8433 N ILE B 456 42.513 5.383 33.933 1.00 83.35 N ATOM 8434 CA ILE B 456 43.336 4.618 34.860 1.00 84.28 C ATOM 8435 C ILE B 456 44.658 4.316 34.173 1.00 85.46 C ATOM 8436 O ILE B 456 45.720 4.387 34.787 1.00 85.86 O ATOM 8437 CB ILE B 456 42.660 3.280 35.252 1.00 83.92 C ATOM 8438 CG1 ILE B 456 41.346 3.554 35.989 1.00 83.69 C ATOM 8439 CG2 ILE B 456 43.602 2.454 36.124 1.00 83.42 C ATOM 8440 CD1 ILE B 456 40.551 2.305 36.335 1.00 82.72 C ATOM 8441 HA ILE B 456 43.479 5.202 35.769 1.00 0.00 H ATOM 8442 HB ILE B 456 42.439 2.713 34.348 1.00 0.00 H ATOM 8443 HG12 ILE B 456 41.577 4.080 36.916 1.00 0.00 H ATOM 8444 HG13 ILE B 456 40.726 4.190 35.357 1.00 0.00 H ATOM 8445 HD11 ILE B 456 40.298 1.771 35.419 1.00 0.00 H ATOM 8446 HD12 ILE B 456 41.150 1.661 36.979 1.00 0.00 H ATOM 8447 HD13 ILE B 456 39.636 2.590 36.855 1.00 0.00 H ATOM 8448 HG21 ILE B 456 44.518 2.245 35.571 1.00 0.00 H ATOM 8449 HG22 ILE B 456 43.842 3.013 37.028 1.00 0.00 H ATOM 8450 HG23 ILE B 456 43.117 1.516 36.394 1.00 0.00 H ATOM 8451 H ILE B 456 41.851 4.880 33.308 1.00 0.00 H ATOM 8452 N LYS B 457 44.581 3.983 32.889 1.00 86.69 N ATOM 8453 CA LYS B 457 45.763 3.666 32.100 1.00 88.32 C ATOM 8454 C LYS B 457 46.855 4.701 32.346 1.00 89.76 C ATOM 8455 O LYS B 457 48.041 4.425 32.156 1.00 90.08 O ATOM 8456 CB LYS B 457 45.398 3.617 30.613 1.00 87.85 C ATOM 8457 CG LYS B 457 46.561 3.317 29.683 1.00 88.85 C ATOM 8458 CD LYS B 457 47.260 2.011 30.043 1.00 89.67 C ATOM 8459 CE LYS B 457 48.364 1.685 29.042 1.00 90.08 C ATOM 8460 NZ LYS B 457 49.342 2.804 28.882 1.00 90.43 N ATOM 8461 HA LYS B 457 46.140 2.689 32.402 1.00 0.00 H ATOM 8462 HB2 LYS B 457 44.643 2.843 30.474 1.00 0.00 H ATOM 8463 HB3 LYS B 457 44.980 4.584 30.334 1.00 0.00 H ATOM 8464 HG2 LYS B 457 46.186 3.246 28.662 1.00 0.00 H ATOM 8465 HG3 LYS B 457 47.282 4.132 29.747 1.00 0.00 H ATOM 8466 HD2 LYS B 457 47.697 2.103 31.038 1.00 0.00 H ATOM 8467 HD3 LYS B 457 46.528 1.203 30.042 1.00 0.00 H ATOM 8468 HE2 LYS B 457 47.908 1.478 28.074 1.00 0.00 H ATOM 8469 HE3 LYS B 457 48.899 0.800 29.387 1.00 0.00 H ATOM 8470 HZ1 LYS B 457 48.844 3.652 28.545 1.00 0.00 H ATOM 8471 HZ2 LYS B 457 49.790 3.005 29.799 1.00 0.00 H ATOM 8472 HZ3 LYS B 457 50.070 2.530 28.192 1.00 0.00 H ATOM 8473 H LYS B 457 43.647 3.948 32.433 1.00 0.00 H ATOM 8474 N LYS B 458 46.443 5.893 32.773 1.00 91.06 N ATOM 8475 CA LYS B 458 47.371 6.979 33.069 1.00 91.84 C ATOM 8476 C LYS B 458 47.575 7.046 34.580 1.00 92.50 C ATOM 8477 O LYS B 458 47.441 8.104 35.199 1.00 91.73 O ATOM 8478 CB LYS B 458 46.810 8.307 32.555 1.00 92.40 C ATOM 8479 CG LYS B 458 46.531 8.316 31.058 1.00 93.40 C ATOM 8480 CD LYS B 458 45.918 9.634 30.598 1.00 94.70 C ATOM 8481 CE LYS B 458 44.539 9.860 31.206 1.00 95.64 C ATOM 8482 NZ LYS B 458 43.930 11.146 30.752 1.00 95.28 N ATOM 8483 HA LYS B 458 48.325 6.796 32.574 1.00 0.00 H ATOM 8484 HB2 LYS B 458 45.877 8.513 33.080 1.00 0.00 H ATOM 8485 HB3 LYS B 458 47.531 9.094 32.776 1.00 0.00 H ATOM 8486 HG2 LYS B 458 47.468 8.158 30.524 1.00 0.00 H ATOM 8487 HG3 LYS B 458 45.840 7.506 30.824 1.00 0.00 H ATOM 8488 HD2 LYS B 458 46.574 10.452 30.897 1.00 0.00 H ATOM 8489 HD3 LYS B 458 45.827 9.621 29.512 1.00 0.00 H ATOM 8490 HE2 LYS B 458 44.632 9.878 32.292 1.00 0.00 H ATOM 8491 HE3 LYS B 458 43.886 9.038 30.912 1.00 0.00 H ATOM 8492 HZ1 LYS B 458 44.543 11.937 31.034 1.00 0.00 H ATOM 8493 HZ2 LYS B 458 43.831 11.135 29.717 1.00 0.00 H ATOM 8494 HZ3 LYS B 458 42.993 11.258 31.190 1.00 0.00 H ATOM 8495 H LYS B 458 45.424 6.056 32.900 1.00 0.00 H ATOM 8496 N THR B 459 47.892 5.893 35.163 1.00 93.50 N ATOM 8497 CA THR B 459 48.119 5.771 36.599 1.00 94.52 C ATOM 8498 C THR B 459 49.065 4.590 36.832 1.00 95.18 C ATOM 8499 O THR B 459 49.302 4.180 37.970 1.00 95.79 O ATOM 8500 CB THR B 459 46.788 5.511 37.353 1.00 94.76 C ATOM 8501 OG1 THR B 459 45.767 6.373 36.835 1.00 95.79 O ATOM 8502 CG2 THR B 459 46.950 5.791 38.842 1.00 94.38 C ATOM 8503 HA THR B 459 48.548 6.700 36.975 1.00 0.00 H ATOM 8504 HB THR B 459 46.512 4.466 37.211 1.00 0.00 H ATOM 8505 HG1 THR B 459 45.641 6.190 35.870 1.00 0.00 H ATOM 8506 HG23 THR B 459 47.724 5.142 39.250 1.00 0.00 H ATOM 8507 HG21 THR B 459 47.235 6.833 38.986 1.00 0.00 H ATOM 8508 HG22 THR B 459 46.006 5.598 39.352 1.00 0.00 H ATOM 8509 H THR B 459 47.982 5.043 34.570 1.00 0.00 H ATOM 8510 N GLU B 460 49.600 4.051 35.739 1.00 95.58 N ATOM 8511 CA GLU B 460 50.519 2.916 35.791 1.00 96.72 C ATOM 8512 C GLU B 460 50.933 2.584 34.360 1.00 97.21 C ATOM 8513 O GLU B 460 50.112 2.123 33.564 1.00 97.22 O ATOM 8514 CB GLU B 460 49.824 1.704 36.434 1.00 97.11 C ATOM 8515 CG GLU B 460 50.753 0.565 36.859 1.00 97.45 C ATOM 8516 CD GLU B 460 51.168 -0.348 35.713 1.00 97.81 C ATOM 8517 OE1 GLU B 460 51.798 0.131 34.745 1.00 97.35 O ATOM 8518 OE2 GLU B 460 50.865 -1.557 35.787 1.00 97.83 O ATOM 8519 HA GLU B 460 51.394 3.164 36.391 1.00 0.00 H ATOM 8520 HB2 GLU B 460 49.291 2.052 37.319 1.00 0.00 H ATOM 8521 HB3 GLU B 460 49.109 1.305 35.714 1.00 0.00 H ATOM 8522 HG2 GLU B 460 51.652 0.999 37.296 1.00 0.00 H ATOM 8523 HG3 GLU B 460 50.240 -0.036 37.609 1.00 0.00 H ATOM 8524 H GLU B 460 49.354 4.453 34.812 1.00 0.00 H ATOM 8525 N THR B 461 52.204 2.813 34.037 1.00 97.54 N ATOM 8526 CA THR B 461 52.707 2.548 32.689 1.00 97.73 C ATOM 8527 C THR B 461 54.215 2.311 32.593 1.00 98.10 C ATOM 8528 O THR B 461 54.658 1.282 32.077 1.00 98.45 O ATOM 8529 CB THR B 461 52.355 3.709 31.738 1.00 97.20 C ATOM 8530 OG1 THR B 461 52.518 4.954 32.429 1.00 97.35 O ATOM 8531 CG2 THR B 461 50.928 3.585 31.236 1.00 96.43 C ATOM 8532 HA THR B 461 52.214 1.619 32.401 1.00 0.00 H ATOM 8533 HB THR B 461 53.024 3.671 30.878 1.00 0.00 H ATOM 8534 HG1 THR B 461 52.292 5.701 31.819 1.00 0.00 H ATOM 8535 HG23 THR B 461 50.810 2.637 30.712 1.00 0.00 H ATOM 8536 HG21 THR B 461 50.242 3.622 32.082 1.00 0.00 H ATOM 8537 HG22 THR B 461 50.711 4.408 30.555 1.00 0.00 H ATOM 8538 H THR B 461 52.853 3.188 34.758 1.00 0.00 H ATOM 8539 N ASP B 462 54.996 3.268 33.086 1.00 98.29 N ATOM 8540 CA ASP B 462 56.457 3.199 33.037 1.00 98.00 C ATOM 8541 C ASP B 462 57.060 2.005 33.782 1.00 98.04 C ATOM 8542 O ASP B 462 56.359 1.060 34.153 1.00 98.18 O ATOM 8543 CB ASP B 462 57.050 4.499 33.591 1.00 97.58 C ATOM 8544 CG ASP B 462 58.297 4.937 32.847 1.00 97.24 C ATOM 8545 OD1 ASP B 462 59.294 4.187 32.846 1.00 97.02 O ATOM 8546 OD2 ASP B 462 58.279 6.038 32.258 1.00 97.57 O ATOM 8547 HA ASP B 462 56.716 3.061 31.987 1.00 0.00 H ATOM 8548 HB2 ASP B 462 56.301 5.287 33.510 1.00 0.00 H ATOM 8549 HB3 ASP B 462 57.305 4.347 34.640 1.00 0.00 H ATOM 8550 H ASP B 462 54.550 4.099 33.524 1.00 0.00 H ATOM 8551 N MET B 463 58.375 2.067 33.985 1.00 97.92 N ATOM 8552 CA MET B 463 59.137 1.027 34.674 1.00 97.29 C ATOM 8553 C MET B 463 59.323 -0.228 33.827 1.00 96.60 C ATOM 8554 O MET B 463 58.359 -0.796 33.307 1.00 96.78 O ATOM 8555 CB MET B 463 58.467 0.654 36.001 1.00 98.03 C ATOM 8556 CG MET B 463 59.273 -0.323 36.846 1.00 98.26 C ATOM 8557 SD MET B 463 60.909 0.316 37.262 1.00 99.72 S ATOM 8558 CE MET B 463 60.537 1.266 38.746 1.00 98.93 C ATOM 8559 HA MET B 463 60.125 1.446 34.864 1.00 0.00 H ATOM 8560 HB2 MET B 463 58.318 1.566 36.579 1.00 0.00 H ATOM 8561 HB3 MET B 463 57.500 0.202 35.782 1.00 0.00 H ATOM 8562 HG2 MET B 463 59.391 -1.253 36.290 1.00 0.00 H ATOM 8563 HG3 MET B 463 58.728 -0.520 37.769 1.00 0.00 H ATOM 8564 HE1 MET B 463 59.813 2.044 38.506 1.00 0.00 H ATOM 8565 HE2 MET B 463 60.121 0.604 39.505 1.00 0.00 H ATOM 8566 HE3 MET B 463 61.452 1.723 39.122 1.00 0.00 H ATOM 8567 H MET B 463 58.888 2.901 33.634 1.00 0.00 H ATOM 8568 N SER B 464 60.577 -0.652 33.696 1.00 95.27 N ATOM 8569 CA SER B 464 60.925 -1.841 32.926 1.00 93.68 C ATOM 8570 C SER B 464 60.546 -3.105 33.691 1.00 92.58 C ATOM 8571 O SER B 464 60.873 -4.215 33.272 1.00 93.02 O ATOM 8572 CB SER B 464 62.428 -1.855 32.630 1.00 93.89 C ATOM 8573 OG SER B 464 62.816 -3.065 32.003 1.00 93.30 O ATOM 8574 HA SER B 464 60.371 -1.816 31.988 1.00 0.00 H ATOM 8575 HB2 SER B 464 62.976 -1.748 33.566 1.00 0.00 H ATOM 8576 HB3 SER B 464 62.669 -1.020 31.972 1.00 0.00 H ATOM 8577 HG SER B 464 62.604 -3.827 32.599 1.00 0.00 H ATOM 8578 H SER B 464 61.338 -0.116 34.160 1.00 0.00 H ATOM 8579 N LEU B 465 59.865 -2.932 34.820 1.00 90.32 N ATOM 8580 CA LEU B 465 59.446 -4.067 35.632 1.00 87.51 C ATOM 8581 C LEU B 465 57.989 -4.399 35.339 1.00 85.34 C ATOM 8582 O LEU B 465 57.234 -3.545 34.872 1.00 85.42 O ATOM 8583 CB LEU B 465 59.617 -3.747 37.119 1.00 88.20 C ATOM 8584 CG LEU B 465 59.370 -4.896 38.101 1.00 88.64 C ATOM 8585 CD1 LEU B 465 60.369 -6.020 37.843 1.00 87.85 C ATOM 8586 CD2 LEU B 465 59.502 -4.381 39.530 1.00 88.93 C ATOM 8587 HA LEU B 465 60.069 -4.927 35.384 1.00 0.00 H ATOM 8588 HB2 LEU B 465 60.639 -3.399 37.267 1.00 0.00 H ATOM 8589 HB3 LEU B 465 58.922 -2.945 37.367 1.00 0.00 H ATOM 8590 HG LEU B 465 58.363 -5.288 37.959 1.00 0.00 H ATOM 8591 HD21 LEU B 465 60.506 -3.983 39.680 1.00 0.00 H ATOM 8592 HD22 LEU B 465 58.768 -3.593 39.700 1.00 0.00 H ATOM 8593 HD23 LEU B 465 59.326 -5.200 40.228 1.00 0.00 H ATOM 8594 HD11 LEU B 465 60.248 -6.385 36.823 1.00 0.00 H ATOM 8595 HD12 LEU B 465 61.382 -5.642 37.977 1.00 0.00 H ATOM 8596 HD13 LEU B 465 60.188 -6.834 38.545 1.00 0.00 H ATOM 8597 H LEU B 465 59.627 -1.968 35.129 1.00 0.00 H ATOM 8598 N HIS B 466 57.614 -5.652 35.596 1.00 82.32 N ATOM 8599 CA HIS B 466 56.253 -6.147 35.383 1.00 78.86 C ATOM 8600 C HIS B 466 55.917 -6.530 33.933 1.00 76.39 C ATOM 8601 O HIS B 466 54.780 -6.899 33.640 1.00 75.34 O ATOM 8602 CB HIS B 466 55.232 -5.113 35.881 1.00 78.63 C ATOM 8603 CG HIS B 466 53.907 -5.699 36.265 1.00 79.17 C ATOM 8604 ND1 HIS B 466 52.807 -4.921 36.555 1.00 79.03 N ATOM 8605 CD2 HIS B 466 53.513 -6.984 36.431 1.00 79.23 C ATOM 8606 CE1 HIS B 466 51.792 -5.701 36.883 1.00 78.53 C ATOM 8607 NE2 HIS B 466 52.193 -6.958 36.816 1.00 78.96 N ATOM 8608 HA HIS B 466 56.197 -7.071 35.958 1.00 0.00 H ATOM 8609 HB2 HIS B 466 55.650 -4.611 36.753 1.00 0.00 H ATOM 8610 HB3 HIS B 466 55.067 -4.384 35.088 1.00 0.00 H ATOM 8611 HD2 HIS B 466 54.127 -7.873 36.286 1.00 0.00 H ATOM 8612 HE1 HIS B 466 50.793 -5.364 37.162 1.00 0.00 H ATOM 8613 H HIS B 466 58.326 -6.313 35.967 1.00 0.00 H ATOM 8614 N PRO B 467 56.892 -6.461 33.006 1.00 74.34 N ATOM 8615 CA PRO B 467 56.509 -6.837 31.643 1.00 73.39 C ATOM 8616 C PRO B 467 56.121 -8.309 31.598 1.00 72.57 C ATOM 8617 O PRO B 467 56.190 -9.001 32.615 1.00 73.19 O ATOM 8618 CB PRO B 467 57.770 -6.539 30.844 1.00 72.41 C ATOM 8619 CG PRO B 467 58.834 -6.898 31.800 1.00 72.87 C ATOM 8620 CD PRO B 467 58.352 -6.280 33.094 1.00 73.79 C ATOM 8621 HA PRO B 467 55.642 -6.303 31.253 1.00 0.00 H ATOM 8622 HD3 PRO B 467 58.763 -6.802 33.958 1.00 0.00 H ATOM 8623 HD2 PRO B 467 58.616 -5.224 33.150 1.00 0.00 H ATOM 8624 HG3 PRO B 467 59.792 -6.476 31.497 1.00 0.00 H ATOM 8625 HG2 PRO B 467 58.928 -7.980 31.893 1.00 0.00 H ATOM 8626 HB2 PRO B 467 57.823 -7.152 29.944 1.00 0.00 H ATOM 8627 HB3 PRO B 467 57.824 -5.486 30.568 1.00 0.00 H ATOM 8628 N LEU B 468 55.719 -8.782 30.424 1.00 70.49 N ATOM 8629 CA LEU B 468 55.308 -10.174 30.255 1.00 69.72 C ATOM 8630 C LEU B 468 54.017 -10.375 31.041 1.00 69.23 C ATOM 8631 O LEU B 468 53.034 -10.905 30.526 1.00 69.22 O ATOM 8632 CB LEU B 468 56.400 -11.126 30.763 1.00 68.01 C ATOM 8633 CG LEU B 468 56.551 -12.462 30.026 1.00 67.39 C ATOM 8634 CD1 LEU B 468 56.821 -12.199 28.551 1.00 66.64 C ATOM 8635 CD2 LEU B 468 57.690 -13.272 30.633 1.00 66.41 C ATOM 8636 HA LEU B 468 55.148 -10.394 29.200 1.00 0.00 H ATOM 8637 HB2 LEU B 468 57.353 -10.602 30.694 1.00 0.00 H ATOM 8638 HB3 LEU B 468 56.184 -11.348 31.808 1.00 0.00 H ATOM 8639 HG LEU B 468 55.629 -13.034 30.126 1.00 0.00 H ATOM 8640 HD21 LEU B 468 58.620 -12.710 30.548 1.00 0.00 H ATOM 8641 HD22 LEU B 468 57.476 -13.466 31.684 1.00 0.00 H ATOM 8642 HD23 LEU B 468 57.786 -14.218 30.100 1.00 0.00 H ATOM 8643 HD11 LEU B 468 55.988 -11.640 28.125 1.00 0.00 H ATOM 8644 HD12 LEU B 468 57.739 -11.621 28.449 1.00 0.00 H ATOM 8645 HD13 LEU B 468 56.928 -13.149 28.028 1.00 0.00 H ATOM 8646 H LEU B 468 55.696 -8.144 29.603 1.00 0.00 H ATOM 8647 N LEU B 469 54.020 -9.939 32.293 1.00 69.54 N ATOM 8648 CA LEU B 469 52.836 -10.052 33.125 1.00 70.91 C ATOM 8649 C LEU B 469 51.858 -9.017 32.578 1.00 70.83 C ATOM 8650 O LEU B 469 50.654 -9.249 32.524 1.00 70.32 O ATOM 8651 CB LEU B 469 53.191 -9.759 34.589 1.00 71.84 C ATOM 8652 CG LEU B 469 52.224 -10.259 35.665 1.00 71.60 C ATOM 8653 CD1 LEU B 469 50.992 -9.379 35.723 1.00 72.89 C ATOM 8654 CD2 LEU B 469 51.847 -11.698 35.357 1.00 72.08 C ATOM 8655 HA LEU B 469 52.407 -11.054 33.102 1.00 0.00 H ATOM 8656 HB2 LEU B 469 54.162 -10.212 34.787 1.00 0.00 H ATOM 8657 HB3 LEU B 469 53.268 -8.677 34.696 1.00 0.00 H ATOM 8658 HG LEU B 469 52.707 -10.214 36.641 1.00 0.00 H ATOM 8659 HD21 LEU B 469 51.368 -11.745 34.379 1.00 0.00 H ATOM 8660 HD22 LEU B 469 52.746 -12.315 35.353 1.00 0.00 H ATOM 8661 HD23 LEU B 469 51.158 -12.063 36.119 1.00 0.00 H ATOM 8662 HD11 LEU B 469 51.288 -8.357 35.960 1.00 0.00 H ATOM 8663 HD12 LEU B 469 50.488 -9.398 34.757 1.00 0.00 H ATOM 8664 HD13 LEU B 469 50.317 -9.751 36.494 1.00 0.00 H ATOM 8665 H LEU B 469 54.883 -9.510 32.684 1.00 0.00 H ATOM 8666 N GLN B 470 52.401 -7.879 32.154 1.00 71.93 N ATOM 8667 CA GLN B 470 51.608 -6.796 31.581 1.00 72.94 C ATOM 8668 C GLN B 470 51.220 -7.176 30.156 1.00 72.51 C ATOM 8669 O GLN B 470 50.294 -6.608 29.571 1.00 72.02 O ATOM 8670 CB GLN B 470 52.424 -5.495 31.589 1.00 75.46 C ATOM 8671 CG GLN B 470 51.792 -4.328 30.839 1.00 78.89 C ATOM 8672 CD GLN B 470 52.178 -4.301 29.370 1.00 81.88 C ATOM 8673 OE1 GLN B 470 51.641 -3.510 28.585 1.00 82.92 O ATOM 8674 NE2 GLN B 470 53.120 -5.162 28.990 1.00 83.00 N ATOM 8675 HA GLN B 470 50.706 -6.637 32.171 1.00 0.00 H ATOM 8676 HB2 GLN B 470 52.566 -5.192 32.626 1.00 0.00 H ATOM 8677 HB3 GLN B 470 53.394 -5.702 31.136 1.00 0.00 H ATOM 8678 HG2 GLN B 470 50.708 -4.410 30.914 1.00 0.00 H ATOM 8679 HG3 GLN B 470 52.117 -3.397 31.303 1.00 0.00 H ATOM 8680 HE22 GLN B 470 53.544 -5.809 29.685 1.00 0.00 H ATOM 8681 HE21 GLN B 470 53.432 -5.187 27.998 1.00 0.00 H ATOM 8682 H GLN B 470 53.431 -7.756 32.234 1.00 0.00 H ATOM 8683 N GLU B 471 51.939 -8.151 29.610 1.00 72.05 N ATOM 8684 CA GLU B 471 51.686 -8.641 28.265 1.00 70.82 C ATOM 8685 C GLU B 471 50.430 -9.508 28.311 1.00 70.25 C ATOM 8686 O GLU B 471 49.564 -9.418 27.444 1.00 69.91 O ATOM 8687 CB GLU B 471 52.880 -9.471 27.786 1.00 70.66 C ATOM 8688 CG GLU B 471 53.292 -9.193 26.360 1.00 70.52 C ATOM 8689 CD GLU B 471 53.645 -7.736 26.144 1.00 71.85 C ATOM 8690 OE1 GLU B 471 54.587 -7.249 26.806 1.00 73.21 O ATOM 8691 OE2 GLU B 471 52.980 -7.075 25.319 1.00 71.80 O ATOM 8692 HA GLU B 471 51.545 -7.810 27.574 1.00 0.00 H ATOM 8693 HB2 GLU B 471 53.729 -9.257 28.436 1.00 0.00 H ATOM 8694 HB3 GLU B 471 52.619 -10.526 27.868 1.00 0.00 H ATOM 8695 HG2 GLU B 471 54.161 -9.805 26.119 1.00 0.00 H ATOM 8696 HG3 GLU B 471 52.468 -9.457 25.698 1.00 0.00 H ATOM 8697 H GLU B 471 52.709 -8.578 30.164 1.00 0.00 H ATOM 8698 N ILE B 472 50.345 -10.340 29.344 1.00 70.40 N ATOM 8699 CA ILE B 472 49.210 -11.236 29.536 1.00 70.85 C ATOM 8700 C ILE B 472 47.905 -10.471 29.708 1.00 72.33 C ATOM 8701 O ILE B 472 46.903 -10.794 29.078 1.00 71.71 O ATOM 8702 CB ILE B 472 49.399 -12.128 30.789 1.00 69.58 C ATOM 8703 CG1 ILE B 472 50.659 -12.982 30.646 1.00 67.48 C ATOM 8704 CG2 ILE B 472 48.175 -13.014 30.988 1.00 68.45 C ATOM 8705 CD1 ILE B 472 50.916 -13.883 31.834 1.00 66.13 C ATOM 8706 HA ILE B 472 49.161 -11.851 28.638 1.00 0.00 H ATOM 8707 HB ILE B 472 49.513 -11.488 31.664 1.00 0.00 H ATOM 8708 HG12 ILE B 472 50.555 -13.604 29.757 1.00 0.00 H ATOM 8709 HG13 ILE B 472 51.515 -12.318 30.525 1.00 0.00 H ATOM 8710 HD11 ILE B 472 51.033 -13.275 32.731 1.00 0.00 H ATOM 8711 HD12 ILE B 472 50.073 -14.563 31.962 1.00 0.00 H ATOM 8712 HD13 ILE B 472 51.826 -14.458 31.662 1.00 0.00 H ATOM 8713 HG21 ILE B 472 47.293 -12.388 31.123 1.00 0.00 H ATOM 8714 HG22 ILE B 472 48.041 -13.649 30.112 1.00 0.00 H ATOM 8715 HG23 ILE B 472 48.318 -13.637 31.871 1.00 0.00 H ATOM 8716 H ILE B 472 51.116 -10.353 30.041 1.00 0.00 H ATOM 8717 N TYR B 473 47.926 -9.460 30.568 1.00 75.54 N ATOM 8718 CA TYR B 473 46.738 -8.662 30.844 1.00 79.47 C ATOM 8719 C TYR B 473 46.351 -7.697 29.724 1.00 81.53 C ATOM 8720 O TYR B 473 45.392 -7.947 28.991 1.00 82.13 O ATOM 8721 CB TYR B 473 46.927 -7.888 32.148 1.00 80.27 C ATOM 8722 CG TYR B 473 46.922 -8.747 33.397 1.00 81.19 C ATOM 8723 CD1 TYR B 473 47.753 -9.863 33.516 1.00 81.74 C ATOM 8724 CD2 TYR B 473 46.120 -8.411 34.483 1.00 82.69 C ATOM 8725 CE1 TYR B 473 47.785 -10.619 34.694 1.00 82.29 C ATOM 8726 CE2 TYR B 473 46.144 -9.155 35.663 1.00 83.22 C ATOM 8727 CZ TYR B 473 46.977 -10.254 35.765 1.00 83.15 C ATOM 8728 OH TYR B 473 47.001 -10.963 36.947 1.00 82.38 O ATOM 8729 HA TYR B 473 45.914 -9.371 30.927 1.00 0.00 H ATOM 8730 HB3 TYR B 473 46.120 -7.160 32.232 1.00 0.00 H ATOM 8731 HB2 TYR B 473 47.882 -7.365 32.098 1.00 0.00 H ATOM 8732 HD2 TYR B 473 45.459 -7.548 34.410 1.00 0.00 H ATOM 8733 HE2 TYR B 473 45.508 -8.871 36.502 1.00 0.00 H ATOM 8734 HE1 TYR B 473 48.439 -11.488 34.771 1.00 0.00 H ATOM 8735 HD1 TYR B 473 48.387 -10.150 32.678 1.00 0.00 H ATOM 8736 HH TYR B 473 47.640 -11.715 36.867 1.00 0.00 H ATOM 8737 H TYR B 473 48.814 -9.231 31.058 1.00 0.00 H ATOM 8738 N LYS B 474 47.090 -6.599 29.591 1.00 83.79 N ATOM 8739 CA LYS B 474 46.792 -5.604 28.562 1.00 86.20 C ATOM 8740 C LYS B 474 45.375 -5.061 28.746 1.00 87.37 C ATOM 8741 O LYS B 474 44.874 -4.994 29.868 1.00 87.77 O ATOM 8742 CB LYS B 474 46.930 -6.220 27.167 1.00 86.77 C ATOM 8743 CG LYS B 474 48.364 -6.391 26.697 1.00 88.05 C ATOM 8744 CD LYS B 474 49.060 -5.043 26.584 1.00 89.25 C ATOM 8745 CE LYS B 474 50.444 -5.181 25.973 1.00 90.08 C ATOM 8746 NZ LYS B 474 50.378 -5.731 24.589 1.00 90.83 N ATOM 8747 HA LYS B 474 47.505 -4.785 28.660 1.00 0.00 H ATOM 8748 HB2 LYS B 474 46.455 -7.201 27.178 1.00 0.00 H ATOM 8749 HB3 LYS B 474 46.412 -5.576 26.456 1.00 0.00 H ATOM 8750 HG2 LYS B 474 48.903 -7.013 27.412 1.00 0.00 H ATOM 8751 HG3 LYS B 474 48.365 -6.877 25.721 1.00 0.00 H ATOM 8752 HD2 LYS B 474 48.459 -4.385 25.956 1.00 0.00 H ATOM 8753 HD3 LYS B 474 49.153 -4.608 27.579 1.00 0.00 H ATOM 8754 HE2 LYS B 474 51.040 -5.851 26.593 1.00 0.00 H ATOM 8755 HE3 LYS B 474 50.917 -4.200 25.942 1.00 0.00 H ATOM 8756 HZ1 LYS B 474 49.932 -6.670 24.611 1.00 0.00 H ATOM 8757 HZ2 LYS B 474 49.815 -5.093 23.990 1.00 0.00 H ATOM 8758 HZ3 LYS B 474 51.340 -5.812 24.203 1.00 0.00 H ATOM 8759 H LYS B 474 47.895 -6.445 30.231 1.00 0.00 H ATOM 8760 N ASP B 475 44.740 -4.664 27.645 1.00 88.53 N ATOM 8761 CA ASP B 475 43.372 -4.144 27.690 1.00 89.47 C ATOM 8762 C ASP B 475 42.384 -5.303 27.629 1.00 89.65 C ATOM 8763 O ASP B 475 41.182 -5.097 27.440 1.00 89.60 O ATOM 8764 CB ASP B 475 43.109 -3.194 26.511 1.00 89.49 C ATOM 8765 CG ASP B 475 43.470 -1.751 26.823 1.00 89.81 C ATOM 8766 OD1 ASP B 475 42.798 -1.137 27.679 1.00 89.01 O ATOM 8767 OD2 ASP B 475 44.425 -1.227 26.211 1.00 90.69 O ATOM 8768 HA ASP B 475 43.244 -3.591 28.621 1.00 0.00 H ATOM 8769 HB2 ASP B 475 43.702 -3.525 25.658 1.00 0.00 H ATOM 8770 HB3 ASP B 475 42.050 -3.241 26.256 1.00 0.00 H ATOM 8771 H ASP B 475 45.229 -4.725 26.729 1.00 0.00 H ATOM 8772 N LEU B 476 42.905 -6.519 27.787 1.00 89.34 N ATOM 8773 CA LEU B 476 42.088 -7.729 27.747 1.00 89.32 C ATOM 8774 C LEU B 476 41.343 -7.839 26.420 1.00 89.77 C ATOM 8775 O LEU B 476 41.801 -8.612 25.553 1.00 90.50 O ATOM 8776 CB LEU B 476 41.082 -7.721 28.902 1.00 87.75 C ATOM 8777 CG LEU B 476 40.007 -8.808 28.898 1.00 86.36 C ATOM 8778 CD1 LEU B 476 40.655 -10.179 28.977 1.00 85.05 C ATOM 8779 CD2 LEU B 476 39.065 -8.584 30.068 1.00 85.45 C ATOM 8780 HA LEU B 476 42.750 -8.589 27.847 1.00 0.00 H ATOM 8781 OXT LEU B 476 40.321 -7.140 26.257 1.00 89.77 O ATOM 8782 HB2 LEU B 476 41.646 -7.820 29.829 1.00 0.00 H ATOM 8783 HB3 LEU B 476 40.574 -6.757 28.888 1.00 0.00 H ATOM 8784 HG LEU B 476 39.435 -8.758 27.972 1.00 0.00 H ATOM 8785 HD21 LEU B 476 39.628 -8.629 31.000 1.00 0.00 H ATOM 8786 HD22 LEU B 476 38.596 -7.605 29.973 1.00 0.00 H ATOM 8787 HD23 LEU B 476 38.297 -9.358 30.068 1.00 0.00 H ATOM 8788 HD11 LEU B 476 41.311 -10.319 28.118 1.00 0.00 H ATOM 8789 HD12 LEU B 476 41.237 -10.252 29.896 1.00 0.00 H ATOM 8790 HD13 LEU B 476 39.881 -10.946 28.974 1.00 0.00 H ATOM 8791 H LEU B 476 43.929 -6.610 27.944 1.00 0.00 H TER 8792 LEU B 476 HETATM 8793 O HOH 1 20.826 19.688 22.469 1.00 68.74 O HETATM 8794 O HOH 2 0.647 10.159 -4.990 1.00 40.05 O HETATM 8795 O HOH 3 23.476 1.835 15.435 1.00 40.83 O HETATM 8796 O HOH 4 7.778 7.512 12.438 1.00 25.97 O HETATM 8797 O HOH 5 18.759 7.678 26.945 1.00 32.26 O HETATM 8798 O HOH 6 16.315 12.790 26.018 1.00 32.46 O HETATM 8799 O HOH 7 7.305 -12.931 24.986 1.00 41.01 O HETATM 8800 O HOH 8 3.360 3.060 8.248 1.00 32.80 O HETATM 8801 O HOH 9 24.215 11.304 0.400 1.00 33.90 O HETATM 8802 O HOH 10 -0.419 8.607 7.687 1.00 40.45 O HETATM 8803 O HOH 11 11.512 0.340 6.720 1.00 35.49 O HETATM 8804 O HOH 12 -1.121 0.073 16.922 1.00 34.43 O HETATM 8805 O HOH 13 -1.627 -5.480 20.197 1.00 37.53 O HETATM 8806 O HOH 14 13.415 16.993 10.170 1.00 58.91 O HETATM 8807 O HOH 15 18.937 2.966 29.060 1.00 43.64 O HETATM 8808 O HOH 16 12.963 14.992 -5.743 1.00 32.52 O HETATM 8809 O HOH 17 21.776 8.798 29.952 1.00 54.13 O HETATM 8810 O HOH 18 11.637 -0.489 10.497 1.00 32.35 O HETATM 8811 O HOH 19 11.377 7.048 29.535 1.00 32.03 O HETATM 8812 O HOH 20 16.784 3.034 4.934 1.00 37.51 O HETATM 8813 O HOH 21 11.555 2.574 10.657 1.00 30.31 O HETATM 8814 O HOH 22 35.162 27.067 25.626 1.00 39.22 O HETATM 8815 O HOH 23 -2.208 9.563 30.149 1.00 32.70 O HETATM 8816 O HOH 24 -1.070 5.310 36.279 1.00 40.98 O HETATM 8817 O HOH 25 17.438 -0.149 5.401 1.00 40.08 O HETATM 8818 O HOH 26 16.039 9.221 -1.924 1.00 50.52 O HETATM 8819 O HOH 27 11.172 4.474 12.530 1.00 29.73 O HETATM 8820 O HOH 28 10.550 -11.883 19.786 1.00 40.11 O HETATM 8821 O HOH 29 8.010 10.385 11.924 1.00 35.53 O HETATM 8822 O HOH 30 15.968 2.849 26.751 1.00 39.76 O HETATM 8823 O HOH 31 17.999 8.025 14.015 1.00 36.96 O HETATM 8824 O HOH 32 23.851 27.888 24.841 1.00 53.03 O HETATM 8825 O HOH 33 3.774 4.898 2.223 1.00 46.04 O HETATM 8826 O HOH 34 0.135 5.867 9.132 1.00 39.88 O HETATM 8827 O HOH 35 21.507 -4.020 19.037 1.00 64.62 O HETATM 8828 O HOH 36 17.970 -3.488 24.654 1.00 44.09 O HETATM 8829 O HOH 37 -6.405 -6.957 14.397 1.00 63.73 O HETATM 8830 O HOH 38 -7.168 -1.624 26.200 1.00 51.71 O HETATM 8831 O HOH 39 7.691 -10.604 16.900 1.00 45.22 O HETATM 8832 O HOH 40 5.448 6.750 39.280 1.00 38.72 O HETATM 8833 O HOH 41 1.423 17.481 17.865 1.00 55.92 O HETATM 8834 O HOH 42 0.493 -6.844 7.857 1.00 47.95 O HETATM 8835 O HOH 43 28.685 14.847 30.826 1.00 84.68 O HETATM 8836 O HOH 44 18.176 3.070 2.155 1.00 52.15 O HETATM 8837 O HOH 45 -0.457 12.255 11.163 1.00 41.34 O HETATM 8838 O HOH 46 12.989 20.174 9.532 1.00 77.54 O HETATM 8839 O HOH 47 2.081 5.664 -6.721 1.00 42.21 O HETATM 8840 O HOH 48 1.863 12.114 7.981 1.00 38.63 O HETATM 8841 O HOH 49 10.821 -7.544 9.831 1.00 50.41 O HETATM 8842 O HOH 50 20.237 12.741 22.355 1.00 50.68 O HETATM 8843 O HOH 51 10.592 17.864 9.513 1.00 64.80 O HETATM 8844 O HOH 52 15.442 11.474 37.423 1.00 61.29 O HETATM 8845 O HOH 53 25.076 10.126 17.935 1.00 46.40 O HETATM 8846 O HOH 54 24.757 1.245 9.721 1.00 67.13 O HETATM 8847 O HOH 55 16.742 10.024 25.822 1.00 40.46 O HETATM 8848 O HOH 56 33.210 31.049 18.092 1.00 48.86 O HETATM 8849 O HOH 57 5.029 23.365 15.785 1.00 72.36 O HETATM 8850 O HOH 58 18.876 13.071 31.577 1.00 83.71 O HETATM 8851 O HOH 59 22.546 20.921 29.824 1.00 68.52 O HETATM 8852 O HOH 60 6.931 -7.353 31.506 1.00 89.82 O HETATM 8853 O HOH 61 6.054 17.047 12.462 1.00 71.40 O HETATM 8854 O HOH 62 -6.462 2.500 15.490 1.00 55.07 O HETATM 8855 O HOH 63 -4.061 17.838 27.601 1.00 59.07 O HETATM 8856 O HOH 64 25.157 4.483 15.789 1.00 61.21 O HETATM 8857 O HOH 65 6.995 13.613 12.648 1.00 43.30 O HETATM 8858 O HOH 66 19.543 10.038 27.624 1.00 91.15 O HETATM 8859 O HOH 67 5.387 2.522 6.230 1.00 48.56 O HETATM 8860 O HOH 68 5.320 2.694 3.489 1.00 61.80 O HETATM 8861 O HOH 69 24.192 11.648 -2.318 1.00 57.17 O HETATM 8862 O HOH 70 -2.930 -1.504 15.179 1.00 53.04 O HETATM 8863 O HOH 71 33.668 22.572 31.718 1.00 75.76 O HETATM 8864 O HOH 72 -0.818 5.627 39.335 1.00 66.42 O HETATM 8865 O HOH 73 20.600 11.956 -3.959 1.00 61.58 O HETATM 8866 O HOH 74 -9.472 -6.542 15.681 1.00 69.95 O HETATM 8867 O HOH 75 3.381 7.500 40.319 1.00 38.85 O HETATM 8868 O HOH 76 3.197 19.933 18.729 1.00 80.41 O HETATM 8869 O HOH 77 26.604 16.921 29.850 1.00 69.37 O HETATM 8870 O HOH 78 32.604 32.851 19.735 1.00 45.33 O HETATM 8871 O HOH 79 6.054 21.220 14.985 1.00 90.83 O HETATM 8872 O HOH 80 0.471 8.758 -1.765 1.00 46.70 O HETATM 8873 O HOH 81 4.064 7.056 -4.187 1.00 99.68 O HETATM 8874 O HOH 82 14.728 11.209 -3.185 1.00 63.97 O HETATM 8875 O HOH 83 24.177 11.577 36.471 1.00 54.45 O HETATM 8876 O HOH 84 -0.886 -12.352 17.126 1.00 81.52 O HETATM 8877 O HOH 85 -6.955 -14.279 24.937 1.00 49.60 O HETATM 8878 O HOH 86 4.838 17.303 2.208 1.00 59.08 O HETATM 8879 O HOH 87 -9.380 -8.084 26.416 1.00 70.53 O HETATM 8880 O HOH 88 28.991 22.945 -1.408 1.00 66.86 O HETATM 8881 O HOH 89 27.927 3.421 20.776 1.00 86.25 O HETATM 8882 O HOH 90 0.511 1.612 10.206 1.00 38.75 O HETATM 8883 O HOH 91 22.342 22.751 -7.511 1.00 52.16 O HETATM 8884 O HOH 92 30.271 18.188 16.477 1.00 95.62 O HETATM 8885 O HOH 93 29.256 28.196 30.150 1.00 73.47 O HETATM 8886 O HOH 94 7.355 16.581 -0.499 1.00 46.13 O HETATM 8887 O HOH 95 6.961 2.372 -11.753 1.00 81.94 O HETATM 8888 O HOH 96 0.490 16.029 34.288 1.00 56.61 O HETATM 8889 O HOH 97 17.962 -6.592 13.405 1.00 54.42 O HETATM 8890 O HOH 98 25.315 11.058 33.518 1.00 71.93 O HETATM 8891 O HOH 99 10.038 3.283 -7.122 1.00 69.59 O HETATM 8892 O HOH 100 -9.259 -13.942 23.110 1.00 66.87 O HETATM 8893 O HOH 101 12.825 5.880 21.257 1.00 83.63 O HETATM 8894 O HOH 102 9.121 -1.752 22.820 1.00 99.01 O HETATM 8895 O HOH 103 22.797 19.394 35.577 1.00 88.44 O HETATM 8896 O HOH 104 -4.943 -3.643 28.095 1.00 61.37 O HETATM 8897 O HOH 105 10.246 20.870 9.602 1.00 81.02 O HETATM 8898 O HOH 106 8.593 -0.226 43.008 1.00 79.39 O HETATM 8899 O HOH 107 9.659 12.844 12.364 1.00 78.90 O HETATM 8900 O HOH 108 22.268 -8.409 20.596 1.00 61.74 O HETATM 8901 O HOH 109 -0.980 -11.722 26.108 1.00 86.10 O HETATM 8902 O HOH 110 4.864 4.780 37.997 1.00 98.02 O HETATM 8903 O HOH 111 1.082 19.449 -4.798 1.00 71.30 O HETATM 8904 O HOH 112 28.663 19.524 -5.780 1.00 78.45 O HETATM 8905 O HOH 113 8.759 -0.457 5.253 1.00 77.38 O HETATM 8906 O HOH 114 -9.634 1.736 20.970 1.00 60.35 O HETATM 8907 O HOH 115 25.700 14.436 -2.003 1.00 82.59 O HETATM 8908 O HOH 116 26.170 12.062 7.229 1.00 43.58 O HETATM 8909 O HOH 117 -4.045 15.770 25.743 1.00 59.97 O HETATM 8910 O HOH 118 28.193 2.552 8.954 1.00 70.27 O HETATM 8911 O HOH 119 -8.388 11.665 20.118 1.00 68.90 O HETATM 8912 O HOH 120 29.306 -10.691 20.753 1.00 28.34 O HETATM 8913 O HOH 121 35.192 -10.689 12.154 1.00 32.86 O HETATM 8914 O HOH 122 25.916 -16.765 36.754 1.00 33.62 O HETATM 8915 O HOH 123 29.993 -24.235 18.503 1.00 47.06 O HETATM 8916 O HOH 124 21.153 -12.408 38.202 1.00 39.40 O HETATM 8917 O HOH 125 18.134 -12.567 41.467 1.00 49.37 O HETATM 8918 O HOH 126 36.692 -18.547 8.778 1.00 59.44 O HETATM 8919 O HOH 127 29.701 -15.642 9.608 1.00 80.39 O HETATM 8920 O HOH 128 23.586 -12.841 36.751 1.00 34.68 O HETATM 8921 O HOH 129 57.395 -8.904 34.953 1.00 79.16 O HETATM 8922 O HOH 130 36.521 -7.067 14.881 1.00 49.74 O HETATM 8923 O HOH 131 27.794 -10.015 6.483 1.00 32.13 O HETATM 8924 O HOH 132 8.921 -14.005 29.424 1.00 40.73 O HETATM 8925 O HOH 133 38.686 -10.697 14.226 1.00 45.56 O HETATM 8926 O HOH 134 31.009 1.279 34.037 1.00 51.07 O HETATM 8927 O HOH 135 36.100 -23.443 14.671 1.00 52.76 O HETATM 8928 O HOH 136 18.391 -11.884 37.573 1.00 32.35 O HETATM 8929 O HOH 137 29.860 -3.922 24.435 1.00 37.88 O HETATM 8930 O HOH 138 5.063 -13.320 29.669 1.00 52.23 O HETATM 8931 O HOH 139 28.475 -5.821 11.711 1.00 56.83 O HETATM 8932 O HOH 140 29.447 -25.315 37.732 1.00 44.74 O HETATM 8933 O HOH 141 22.501 0.582 35.121 1.00 47.50 O HETATM 8934 O HOH 142 40.026 -6.294 31.940 1.00 72.57 O HETATM 8935 O HOH 143 22.146 -24.442 38.538 1.00 47.11 O HETATM 8936 O HOH 144 21.344 -21.273 52.394 1.00 81.73 O HETATM 8937 O HOH 145 38.280 -12.827 20.930 1.00 48.08 O HETATM 8938 O HOH 146 19.129 -23.766 30.295 1.00 50.46 O HETATM 8939 O HOH 147 40.162 -21.308 27.043 1.00 87.24 O HETATM 8940 O HOH 148 36.999 -3.703 22.744 1.00 75.83 O HETATM 8941 O HOH 149 40.645 -23.269 47.336 1.00 82.69 O HETATM 8942 O HOH 150 35.824 -23.517 31.686 1.00 75.56 O HETATM 8943 O HOH 151 38.714 -8.003 16.475 1.00 77.74 O HETATM 8944 O HOH 152 40.387 -12.505 13.561 1.00 45.95 O HETATM 8945 O HOH 153 30.493 -15.195 11.507 1.00 84.55 O HETATM 8946 O HOH 154 29.340 -16.094 37.323 1.00 71.36 O HETATM 8947 O HOH 155 27.655 -17.174 38.408 1.00 77.82 O HETATM 8948 O HOH 156 17.037 -14.624 43.116 1.00 59.01 O HETATM 8949 O HOH 157 17.063 -16.894 41.504 1.00 77.03 O HETATM 8950 O HOH 158 32.146 -4.351 23.622 1.00 51.75 O HETATM 8951 O HOH 159 34.887 -3.598 24.373 1.00 64.37 O HETATM 8952 O HOH 160 29.400 -6.331 9.236 1.00 52.82 O HETATM 8953 O HOH 161 42.580 -5.175 30.817 1.00100.00 O HETATM 8954 O HOH 162 7.807 -9.728 34.443 1.00 88.15 O HETATM 8955 O HOH 163 29.020 -3.853 19.978 1.00 42.47 O HETATM 8956 O HOH 164 50.892 -15.676 41.820 1.00 89.11 O HETATM 8957 O HOH 165 21.833 -10.129 49.624 1.00 87.94 O HETATM 8958 O HOH 166 38.618 -12.869 23.571 1.00 64.33 O HETATM 8959 O HOH 167 30.722 -17.898 9.132 1.00 40.76 O HETATM 8960 O HOH 168 6.536 -16.937 38.166 1.00 58.44 O HETATM 8961 O HOH 169 27.582 -6.216 37.166 1.00 42.30 O HETATM 8962 O HOH 170 44.385 -15.303 35.514 1.00 46.92 O HETATM 8963 O HOH 171 11.992 -4.024 33.872 1.00 61.53 O HETATM 8964 O HOH 172 13.318 -24.496 28.416 1.00 59.84 O HETATM 8965 O HOH 173 13.797 -23.359 25.257 1.00 42.10 O HETATM 8966 O HOH 174 28.657 -2.036 51.586 1.00 45.83 O HETATM 8967 O HOH 175 8.020 -12.982 20.571 1.00 51.58 O HETATM 8968 O HOH 176 34.590 -1.938 37.320 1.00 89.77 O HETATM 8969 O HOH 177 35.044 -27.079 32.322 1.00 93.63 O HETATM 8970 O HOH 178 58.183 2.092 45.771 1.00 69.50 O HETATM 8971 O HOH 179 35.604 0.865 55.388 1.00 74.11 O HETATM 8972 O HOH 180 49.829 -13.182 52.340 1.00 79.19 O HETATM 8973 O HOH 181 7.985 -15.460 31.730 1.00 47.00 O HETATM 8974 O HOH 182 16.609 -25.898 31.279 1.00 51.11 O HETATM 8975 O HOH 183 28.897 -24.157 41.888 1.00 72.24 O HETATM 8976 O HOH 184 33.594 -26.244 23.973 1.00 53.91 O HETATM 8977 O HOH 185 26.473 -9.814 47.370 1.00 99.01 O HETATM 8978 O HOH 186 18.695 -1.607 33.850 1.00 71.86 O HETATM 8979 O HOH 187 26.973 -7.362 7.140 1.00 55.40 O HETATM 8980 O HOH 188 11.449 -29.997 17.734 1.00 99.68 O HETATM 8981 O HOH 189 13.912 -4.289 32.191 1.00 83.48 O HETATM 8982 O HOH 190 18.665 -23.828 36.885 1.00 70.25 O HETATM 8983 O HOH 191 46.638 2.337 36.972 1.00 84.08 O HETATM 8984 O HOH 192 5.839 -16.389 21.690 1.00 73.58 O HETATM 8985 O HOH 193 32.942 4.776 50.547 1.00 68.06 O HETATM 8986 O HOH 194 60.865 -5.123 31.119 1.00 84.79 O HETATM 8987 O HOH 195 10.981 -23.140 15.767 1.00 99.51 O HETATM 8988 CAB DRH A 196 20.300 20.665 17.319 1.00 -0.06 C HETATM 8989 CAO DRH A 196 19.426 19.937 18.342 1.00 -0.02 C HETATM 8990 CBG DRH A 196 20.208 18.845 19.078 1.00 0.13 C HETATM 8991 CAZ DRH A 196 19.313 18.137 20.100 1.00 0.08 C HETATM 8992 OAE DRH A 196 19.881 17.557 21.051 1.00 -0.54 O HETATM 8993 OAD DRH A 196 18.078 18.178 19.911 1.00 -0.54 O HETATM 8994 CAC DRH A 196 21.387 19.465 19.833 1.00 -0.03 C HETATM 8995 H6 DRH A 196 21.943 18.674 20.358 1.00 0.03 H HETATM 8996 H7 DRH A 196 21.011 20.196 20.564 1.00 0.03 H HETATM 8997 H8 DRH A 196 22.055 19.970 19.119 1.00 0.03 H HETATM 8998 OAX DRH A 196 20.749 17.911 18.135 1.00 -0.31 O HETATM 8999 CBB DRH A 196 19.992 17.137 17.303 1.00 0.08 C HETATM 9000 CAK DRH A 196 18.752 16.620 17.672 1.00 -0.04 C HETATM 9001 CAI DRH A 196 18.057 15.774 16.810 1.00 -0.07 C HETATM 9002 CBA DRH A 196 18.596 15.441 15.570 1.00 -0.05 C HETATM 9003 CAH DRH A 196 19.830 15.964 15.197 1.00 -0.07 C HETATM 9004 CAJ DRH A 196 20.523 16.809 16.059 1.00 -0.04 C HETATM 9005 H11 DRH A 196 21.483 17.214 15.759 1.00 0.05 H HETATM 9006 H12 DRH A 196 20.253 15.713 14.231 1.00 0.05 H HETATM 9007 CAT DRH A 196 17.899 14.457 14.624 1.00 -0.00 C HETATM 9008 CAV DRH A 196 16.369 14.501 14.676 1.00 0.05 C HETATM 9009 NBF DRH A 196 15.734 15.279 13.598 1.00 -0.25 N HETATM 9010 CAU DRH A 196 14.271 15.232 13.437 1.00 0.04 C HETATM 9011 CAS DRH A 196 13.584 14.544 14.618 1.00 -0.03 C HETATM 9012 CAR DRH A 196 12.075 14.418 14.402 1.00 -0.05 C HETATM 9013 CAQ DRH A 196 11.429 13.883 15.681 1.00 -0.05 C HETATM 9014 CAP DRH A 196 9.914 13.721 15.542 1.00 -0.05 C HETATM 9015 CAN DRH A 196 9.282 13.341 16.883 1.00 -0.06 C HETATM 9016 CAA DRH A 196 9.849 12.028 17.429 1.00 -0.07 C HETATM 9017 H29 DRH A 196 9.369 11.793 18.390 1.00 0.02 H HETATM 9018 H30 DRH A 196 10.934 12.130 17.576 1.00 0.02 H HETATM 9019 H31 DRH A 196 9.651 11.217 16.713 1.00 0.02 H HETATM 9020 H27 DRH A 196 8.196 13.230 16.746 1.00 0.03 H HETATM 9021 H28 DRH A 196 9.480 14.143 17.609 1.00 0.03 H HETATM 9022 H25 DRH A 196 9.702 12.931 14.807 1.00 0.03 H HETATM 9023 H26 DRH A 196 9.480 14.671 15.195 1.00 0.03 H HETATM 9024 H23 DRH A 196 11.636 14.585 16.502 1.00 0.03 H HETATM 9025 H24 DRH A 196 11.869 12.903 15.917 1.00 0.03 H HETATM 9026 H21 DRH A 196 11.879 13.724 13.572 1.00 0.03 H HETATM 9027 H22 DRH A 196 11.654 15.405 14.162 1.00 0.03 H HETATM 9028 H19 DRH A 196 13.765 15.134 15.528 1.00 0.03 H HETATM 9029 H20 DRH A 196 14.011 13.538 14.742 1.00 0.03 H HETATM 9030 H17 DRH A 196 14.033 14.678 12.517 1.00 0.05 H HETATM 9031 H18 DRH A 196 13.890 16.261 13.355 1.00 0.05 H HETATM 9032 CBC DRH A 196 16.422 15.879 12.627 1.00 0.28 C HETATM 9033 OAY DRH A 196 17.770 15.787 12.421 1.00 -0.20 O HETATM 9034 CBE DRH A 196 18.022 16.468 11.265 1.00 0.14 C HETATM 9035 CAM DRH A 196 19.188 16.699 10.542 1.00 -0.03 C HETATM 9036 CAG DRH A 196 19.137 17.428 9.357 1.00 -0.08 C HETATM 9037 CAF DRH A 196 17.921 17.926 8.899 1.00 -0.08 C HETATM 9038 CAL DRH A 196 16.754 17.696 9.621 1.00 -0.07 C HETATM 9039 CBD DRH A 196 16.807 16.964 10.803 1.00 0.03 C HETATM 9040 NAW DRH A 196 15.858 16.589 11.655 1.00 -0.30 N HETATM 9041 H35 DRH A 196 15.807 18.085 9.264 1.00 0.05 H HETATM 9042 H34 DRH A 196 17.883 18.495 7.977 1.00 0.05 H HETATM 9043 H33 DRH A 196 20.044 17.608 8.791 1.00 0.05 H HETATM 9044 H32 DRH A 196 20.135 16.312 10.901 1.00 0.06 H HETATM 9045 H15 DRH A 196 16.072 14.945 15.638 1.00 0.06 H HETATM 9046 H16 DRH A 196 15.995 13.468 14.618 1.00 0.06 H HETATM 9047 H13 DRH A 196 18.223 13.439 14.888 1.00 0.04 H HETATM 9048 H14 DRH A 196 18.215 14.687 13.596 1.00 0.04 H HETATM 9049 H10 DRH A 196 17.094 15.374 17.106 1.00 0.05 H HETATM 9050 H9 DRH A 196 18.326 16.877 18.635 1.00 0.05 H HETATM 9051 H4 DRH A 196 18.575 19.476 17.820 1.00 0.03 H HETATM 9052 H5 DRH A 196 19.054 20.666 19.077 1.00 0.03 H HETATM 9053 H1 DRH A 196 19.704 21.439 16.813 1.00 0.02 H HETATM 9054 H2 DRH A 196 20.672 19.945 16.576 1.00 0.02 H HETATM 9055 H3 DRH A 196 21.152 21.135 17.833 1.00 0.02 H CONECT 1 2 15 16 17 CONECT 15 1 CONECT 16 1 CONECT 17 1 CONECT 4397 4398 4411 4412 4413 CONECT 4411 4397 CONECT 4412 4397 CONECT 4413 4397 CONECT 8988 8989 9053 9054 9055 CONECT 8989 8988 8990 9051 9052 CONECT 8990 8989 8991 8994 8998 CONECT 8991 8990 8992 8993 CONECT 8992 8991 CONECT 8993 8991 CONECT 8994 8990 8995 8996 8997 CONECT 8995 8994 CONECT 8996 8994 CONECT 8997 8994 CONECT 8998 8990 8999 CONECT 8999 8998 9000 9004 CONECT 9000 8999 9001 9050 CONECT 9001 9000 9002 9049 CONECT 9002 9001 9003 9007 CONECT 9003 9002 9004 9006 CONECT 9004 8999 9003 9005 CONECT 9005 9004 CONECT 9006 9003 CONECT 9007 9002 9008 9047 9048 CONECT 9008 9007 9009 9045 9046 CONECT 9009 9008 9010 9032 CONECT 9010 9009 9011 9030 9031 CONECT 9011 9010 9012 9028 9029 CONECT 9012 9011 9013 9026 9027 CONECT 9013 9012 9014 9024 9025 CONECT 9014 9013 9015 9022 9023 CONECT 9015 9014 9016 9020 9021 CONECT 9016 9015 9017 9018 9019 CONECT 9017 9016 CONECT 9018 9016 CONECT 9019 9016 CONECT 9020 9015 CONECT 9021 9015 CONECT 9022 9014 CONECT 9023 9014 CONECT 9024 9013 CONECT 9025 9013 CONECT 9026 9012 CONECT 9027 9012 CONECT 9028 9011 CONECT 9029 9011 CONECT 9030 9010 CONECT 9031 9010 CONECT 9032 9009 9033 9040 CONECT 9033 9032 9034 CONECT 9034 9033 9035 9039 CONECT 9035 9034 9036 9044 CONECT 9036 9035 9037 9043 CONECT 9037 9036 9038 9042 CONECT 9038 9037 9039 9041 CONECT 9039 9034 9038 9040 CONECT 9040 9032 9039 CONECT 9041 9038 CONECT 9042 9037 CONECT 9043 9036 CONECT 9044 9035 CONECT 9045 9008 CONECT 9046 9008 CONECT 9047 9007 CONECT 9048 9007 CONECT 9049 9001 CONECT 9050 9000 CONECT 9051 8989 CONECT 9052 8989 CONECT 9053 8988 CONECT 9054 8988 CONECT 9055 8988 MASTER 0 0 0 0 0 0 0 0 9053 2 76 42 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 2i4z
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
1i7i
RCSB PDB
PDBbind
292aa, >1I7I_1|Chains... at 98%
1nyx
RCSB PDB
PDBbind
276aa, >1NYX_1|Chains... at 100%
1zeo
RCSB PDB
PDBbind
277aa, >1ZEO_1|Chains... at 99%
2ath
RCSB PDB
PDBbind
271aa, >2ATH_1|Chains... at 100%
2f4b
RCSB PDB
PDBbind
271aa, >2F4B_1|Chains... at 100%
2g0g
RCSB PDB
PDBbind
271aa, >2G0G_1|Chains... at 100%
2g0h
RCSB PDB
PDBbind
271aa, >2G0H_1|Chains... at 100%
2gtk
RCSB PDB
PDBbind
271aa, >2GTK_1|Chain... at 100%
2i4j
RCSB PDB
PDBbind
286aa, >2I4J_1|Chains... at 100%
2i4p
RCSB PDB
PDBbind
286aa, >2I4P_1|Chains... at 100%
2p4y
RCSB PDB
PDBbind
277aa, >2P4Y_1|Chains... at 99%
2q8s
RCSB PDB
PDBbind
271aa, >2Q8S_1|Chains... at 100%
2yfe
RCSB PDB
PDBbind
287aa, >2YFE_1|Chains... at 100%
3ads
RCSB PDB
PDBbind
287aa, >3ADS_1|Chains... at 100%
3adt
RCSB PDB
PDBbind
287aa, >3ADT_1|Chains... at 100%
3adu
RCSB PDB
PDBbind
287aa, >3ADU_1|Chains... at 100%
3adv
RCSB PDB
PDBbind
287aa, >3ADV_1|Chains... at 100%
3bc5
RCSB PDB
PDBbind
296aa, >3BC5_1|Chain... at 100%
3ia6
RCSB PDB
PDBbind
271aa, >3IA6_1|Chains... at 100%
3osi
RCSB PDB
PDBbind
285aa, >3OSI_1|Chains... at 100%
3osw
RCSB PDB
PDBbind
285aa, >3OSW_1|Chains... at 100%
3r5n
RCSB PDB
PDBbind
274aa, >3R5N_1|Chain... at 100%
3r8i
RCSB PDB
PDBbind
287aa, >3R8I_1|Chains... at 100%
3sz1
RCSB PDB
PDBbind
278aa, >3SZ1_1|Chains... at 100%
3ty0
RCSB PDB
PDBbind
277aa, >3TY0_1|Chains... at 99%
3u9q
RCSB PDB
PDBbind
269aa, >3U9Q_1|Chain... at 100%
4a4v
RCSB PDB
PDBbind
287aa, >4A4V_1|Chains... at 100%
4a4w
RCSB PDB
PDBbind
287aa, >4A4W_1|Chains... at 100%
4jaz
RCSB PDB
PDBbind
287aa, >4JAZ_1|Chains... at 100%
4prg
RCSB PDB
PDBbind
270aa, >4PRG_1|Chains... at 100%
4r06
RCSB PDB
PDBbind
273aa, >4R06_1|Chains... at 100%
4xta
RCSB PDB
PDBbind
278aa, >4XTA_1|Chains... at 100%
4xuh
RCSB PDB
PDBbind
278aa, >4XUH_1|Chains... at 100%
4xum
RCSB PDB
PDBbind
278aa, >4XUM_1|Chains... at 100%
4y29
RCSB PDB
PDBbind
269aa, >4Y29_1|Chain... at 100%
5f9b
RCSB PDB
PDBbind
287aa, >5F9B_1|Chains... at 100%
5lsg
RCSB PDB
PDBbind
304aa, >5LSG_1|Chains... *
5u5l
RCSB PDB
PDBbind
273aa, >5U5L_1|Chains... at 100%
6an1
RCSB PDB
PDBbind
286aa, >6AN1_1|Chains... at 100%
6c5q
RCSB PDB
PDBbind
281aa, >6C5Q_1|Chain... at 100%
6c5t
RCSB PDB
PDBbind
276aa, >6C5T_1|Chain... at 99%
6o68
RCSB PDB
PDBbind
275aa, >6O68_1|Chains... at 100%
6md4
RCSB PDB
PDBbind
275aa, >6MD4_1|Chains... at 100%
6md0
RCSB PDB
PDBbind
275aa, >6MD0_1|Chains... at 100%
6fzg
RCSB PDB
PDBbind
276aa, >6FZG_1|Chain... at 99%
6dgr
RCSB PDB
PDBbind
297aa, >6DGR_1|Chains... at 95%
6dgq
RCSB PDB
PDBbind
276aa, >6DGQ_1|Chains... at 99%
6dgo
RCSB PDB
PDBbind
275aa, >6DGO_1|Chains... at 100%
6dgl
RCSB PDB
PDBbind
276aa, >6DGL_1|Chains... at 99%
6avi
RCSB PDB
PDBbind
276aa, >6AVI_1|Chains... at 99%
5ugm
RCSB PDB
PDBbind
271aa, >5UGM_1|Chains... at 100%
6dha
RCSB PDB
PDBbind
271aa, >6DHA_1|Chains... at 100%
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
2i4p
RCSB PDB
PDBbind
DRH
Entry Information
PDB ID
2i4z
Complex Type
Protein-Ligand
PDBbind Subset
refined set
Protein Name
Peroxisome proliferator-activated receptor gamma
Ligand Name
DRH
EC.Number
E.C.-.-.-.-
Resolution
2.25(Å)
Affinity (Kd/Ki/IC50)
Kd=1978nM
Release Year
2007
Protein/NA Sequence
Check fasta file
Primary Reference
J. Biol. Chem. 2007, 282, 17314-17324.
Ligand Properties
Formula
C
2
7
H
3
6
N
2
O
4
Molecular Weight
452.586
Exact Mass
452.268
No. of atoms
69
No. of bonds
71
Polar Surface Area
75.8
LOGP Value
8.62 (
Computed with XLOGP3
)
6.48 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 0
No. of Hydrogen Bond Acceptors: 3
No. of Rotatable Bonds: 13
No. of Nitrogen and Oxygen Atoms: 6
No. of Rings: 3
Canonical SMILES
CCCCCCCN(c1nc2c(o1)cccc2)CCc1ccc(cc1)O[C@](C(=O)O)(CC)C
InChI String
InChI=1S/C27H36N2O4/c1-4-6-7-8-11-19-29(26-28-23-12-9-10-13-24(23)32-26)20-18-21-14-16-22(17-15-21)33-27(3,5-2)25(30)31/h9-10,12-17H,4-8,11,18-20H2,1-3H3,(H,30,31)/t27-/m0/s1
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
P37231
Entrez Gene ID
NCBI Entrez Gene ID:
5468
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com