Browse entries in the PDBbind-CN Database
HEADER 3IA6_COMPLEX COMPND 3IA6_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 55 GLU SER ALA ASP LEU ARG ALA LEU ALA LYS HIS LEU TYR SEQRES 2 A 55 ASP SER TYR ILE LYS SER PHE PRO LEU THR LYS ALA LYS SEQRES 3 A 55 ALA ARG ALA ILE LEU THR GLY LYS THR THR ASP LYS SER SEQRES 4 A 55 PRO PHE VAL ILE TYR ASP MET ASN SER LEU MET MET GLY SEQRES 5 A 55 GLU ASP LYS SEQRES 1 A 199 GLU VAL ALA ILE ARG ILE PHE GLN GLY CYS GLN PHE ARG SEQRES 2 A 199 SER VAL GLU ALA VAL GLN GLU ILE THR GLU TYR ALA LYS SEQRES 3 A 199 SER ILE PRO GLY PHE VAL ASN LEU ASP LEU ASN ASP GLN SEQRES 4 A 199 VAL THR LEU LEU LYS TYR GLY VAL HIS GLU ILE ILE TYR SEQRES 5 A 199 THR MET LEU ALA SER LEU MET ASN LYS ASP GLY VAL LEU SEQRES 6 A 199 ILE SER GLU GLY GLN GLY PHE MET THR ARG GLU PHE LEU SEQRES 7 A 199 LYS SER LEU ARG LYS PRO PHE GLY ASP PHE MET GLU PRO SEQRES 8 A 199 LYS PHE GLU PHE ALA VAL LYS PHE ASN ALA LEU GLU LEU SEQRES 9 A 199 ASP ASP SER ASP LEU ALA ILE PHE ILE ALA VAL ILE ILE SEQRES 10 A 199 LEU SER GLY ASP ARG PRO GLY LEU LEU ASN VAL LYS PRO SEQRES 11 A 199 ILE GLU ASP ILE GLN ASP ASN LEU LEU GLN ALA LEU GLU SEQRES 12 A 199 LEU GLN LEU LYS LEU ASN HIS PRO GLU SER SER GLN LEU SEQRES 13 A 199 PHE ALA LYS LEU LEU GLN LYS MET THR ASP LEU ARG GLN SEQRES 14 A 199 ILE VAL THR GLU HIS VAL GLN LEU LEU GLN VAL ILE LYS SEQRES 15 A 199 LYS THR GLU THR ASP MET SER LEU HIS PRO LEU LEU GLN SEQRES 16 A 199 GLU ILE TYR LYS SEQRES 1 B 59 GLU SER ALA ASP LEU ARG ALA LEU ALA LYS HIS LEU TYR SEQRES 2 B 59 ASP SER TYR ILE LYS SER PHE PRO LEU THR LYS ALA LYS SEQRES 3 B 59 ALA ARG ALA ILE LEU THR GLY LYS THR THR ASP LYS SER SEQRES 4 B 59 PRO PHE VAL ILE TYR ASP MET ASN SER LEU MET MET GLY SEQRES 5 B 59 GLU ASP LYS ILE LYS PHE LYS SEQRES 1 B 187 LYS GLU VAL ALA ILE ARG ILE PHE GLN GLY CYS GLN PHE SEQRES 2 B 187 ARG SER VAL GLU ALA VAL GLN GLU ILE THR GLU TYR ALA SEQRES 3 B 187 LYS SER ILE PRO GLY PHE VAL ASN LEU ASP LEU ASN ASP SEQRES 4 B 187 GLN VAL THR LEU LEU LYS TYR GLY VAL HIS GLU ILE ILE SEQRES 5 B 187 TYR THR MET LEU ALA SER LEU MET ASN LYS ASP GLY VAL SEQRES 6 B 187 LEU ILE SER GLU GLY GLN GLY PHE MET THR ARG GLU PHE SEQRES 7 B 187 LEU LYS SER LEU ARG LYS PRO PHE GLY ASP PHE MET GLU SEQRES 8 B 187 PRO LYS PHE GLU PHE ALA VAL LYS PHE ASN ALA LEU GLU SEQRES 9 B 187 LEU ASP ASP SER ASP LEU ALA ILE PHE ILE ALA VAL ILE SEQRES 10 B 187 ILE LEU SER GLY ASP ARG PRO GLY LEU LEU ASN VAL LYS SEQRES 11 B 187 PRO ILE GLU ASP ILE GLN ASP ASN LEU LEU GLN ALA LEU SEQRES 12 B 187 GLU LEU GLN LEU LYS LEU ASN HIS PRO GLU SER SER GLN SEQRES 13 B 187 LEU PHE ALA LYS LEU LEU GLN LYS MET THR ASP LEU ARG SEQRES 14 B 187 GLN ILE VAL THR GLU HIS VAL GLN LEU LEU GLN VAL ILE SEQRES 15 B 187 LYS LYS THR GLU THR SEQRES 1 B 9 HIS PRO LEU LEU GLN GLU ILE TYR LYS HET UNT A 623 54 ATOM 1 N GLU A 207 -5.390 34.996 27.815 1.00 57.07 N ATOM 2 CA GLU A 207 -6.148 34.357 26.695 1.00 57.06 C ATOM 3 C GLU A 207 -5.893 35.058 25.358 1.00 56.28 C ATOM 4 O GLU A 207 -5.683 36.273 25.319 1.00 56.14 O ATOM 5 CB GLU A 207 -7.648 34.345 26.988 1.00 57.36 C ATOM 6 CG GLU A 207 -8.384 33.218 26.279 1.00 59.37 C ATOM 7 CD GLU A 207 -9.802 33.582 25.890 1.00 62.18 C ATOM 8 OE1 GLU A 207 -10.503 34.252 26.692 1.00 63.50 O ATOM 9 OE2 GLU A 207 -10.212 33.186 24.775 1.00 63.29 O ATOM 10 HA GLU A 207 -5.788 33.331 26.616 1.00 0.00 H ATOM 11 HB2 GLU A 207 -7.791 34.232 28.063 1.00 0.00 H ATOM 12 HB3 GLU A 207 -8.073 35.295 26.664 1.00 0.00 H ATOM 13 HG2 GLU A 207 -7.832 32.959 25.375 1.00 0.00 H ATOM 14 HG3 GLU A 207 -8.418 32.354 26.943 1.00 0.00 H ATOM 15 HN3 GLU A 207 -5.682 35.990 27.907 1.00 0.00 H ATOM 16 HN2 GLU A 207 -4.371 34.951 27.613 1.00 0.00 H ATOM 17 HN1 GLU A 207 -5.591 34.490 28.701 1.00 0.00 H ATOM 18 N SER A 208 -5.926 34.274 24.276 1.00 55.36 N ATOM 19 CA SER A 208 -5.681 34.758 22.918 1.00 54.52 C ATOM 20 C SER A 208 -6.471 36.020 22.620 1.00 53.66 C ATOM 21 O SER A 208 -5.898 37.048 22.254 1.00 53.64 O ATOM 22 CB SER A 208 -6.024 33.679 21.884 1.00 54.58 C ATOM 23 OG SER A 208 -5.385 32.454 22.194 1.00 55.30 O ATOM 24 HA SER A 208 -4.619 34.995 22.850 1.00 0.00 H ATOM 25 HB2 SER A 208 -5.697 34.012 20.899 1.00 0.00 H ATOM 26 HB3 SER A 208 -7.103 33.525 21.874 1.00 0.00 H ATOM 27 HG SER A 208 -5.623 31.777 21.512 1.00 0.00 H ATOM 28 H SER A 208 -6.138 33.264 24.407 1.00 0.00 H ATOM 29 N ALA A 209 -7.783 35.940 22.807 1.00 52.73 N ATOM 30 CA ALA A 209 -8.689 37.044 22.496 1.00 51.86 C ATOM 31 C ALA A 209 -8.322 38.370 23.185 1.00 51.09 C ATOM 32 O ALA A 209 -8.380 39.427 22.559 1.00 50.80 O ATOM 33 CB ALA A 209 -10.135 36.645 22.797 1.00 51.83 C ATOM 34 HA ALA A 209 -8.581 37.236 21.429 1.00 0.00 H ATOM 35 HB1 ALA A 209 -10.406 35.780 22.191 1.00 0.00 H ATOM 36 HB2 ALA A 209 -10.229 36.394 23.853 1.00 0.00 H ATOM 37 HB3 ALA A 209 -10.797 37.478 22.560 1.00 0.00 H ATOM 38 H ALA A 209 -8.181 35.059 23.189 1.00 0.00 H ATOM 39 N ASP A 210 -7.935 38.308 24.460 1.00 50.40 N ATOM 40 CA ASP A 210 -7.560 39.514 25.213 1.00 49.74 C ATOM 41 C ASP A 210 -6.265 40.130 24.684 1.00 48.71 C ATOM 42 O ASP A 210 -6.144 41.350 24.609 1.00 48.50 O ATOM 43 CB ASP A 210 -7.440 39.223 26.717 1.00 50.06 C ATOM 44 CG ASP A 210 -8.804 39.032 27.396 1.00 51.83 C ATOM 45 OD1 ASP A 210 -9.665 39.946 27.323 1.00 52.91 O ATOM 46 OD2 ASP A 210 -9.010 37.965 28.013 1.00 52.98 O ATOM 47 HA ASP A 210 -8.361 40.239 25.069 1.00 0.00 H ATOM 48 HB2 ASP A 210 -6.854 38.314 26.851 1.00 0.00 H ATOM 49 HB3 ASP A 210 -6.927 40.058 27.194 1.00 0.00 H ATOM 50 H ASP A 210 -7.898 37.383 24.934 1.00 0.00 H ATOM 51 N LEU A 211 -5.316 39.272 24.315 1.00 47.59 N ATOM 52 CA LEU A 211 -4.029 39.707 23.765 1.00 47.00 C ATOM 53 C LEU A 211 -4.154 40.293 22.353 1.00 46.40 C ATOM 54 O LEU A 211 -3.435 41.232 22.016 1.00 46.54 O ATOM 55 CB LEU A 211 -3.001 38.564 23.789 1.00 46.84 C ATOM 56 CG LEU A 211 -2.664 37.963 25.159 1.00 46.78 C ATOM 57 CD1 LEU A 211 -1.770 36.739 25.011 1.00 46.51 C ATOM 58 CD2 LEU A 211 -2.030 38.998 26.091 1.00 46.26 C ATOM 59 HA LEU A 211 -3.674 40.510 24.411 1.00 0.00 H ATOM 60 HB2 LEU A 211 -3.387 37.760 23.162 1.00 0.00 H ATOM 61 HB3 LEU A 211 -2.075 38.945 23.359 1.00 0.00 H ATOM 62 HG LEU A 211 -3.601 37.646 25.616 1.00 0.00 H ATOM 63 HD21 LEU A 211 -1.109 39.372 25.644 1.00 0.00 H ATOM 64 HD22 LEU A 211 -2.725 39.825 26.240 1.00 0.00 H ATOM 65 HD23 LEU A 211 -1.806 38.532 27.051 1.00 0.00 H ATOM 66 HD11 LEU A 211 -2.284 35.985 24.414 1.00 0.00 H ATOM 67 HD12 LEU A 211 -0.842 37.026 24.516 1.00 0.00 H ATOM 68 HD13 LEU A 211 -1.546 36.333 25.997 1.00 0.00 H ATOM 69 H LEU A 211 -5.495 38.253 24.421 1.00 0.00 H ATOM 70 N ARG A 212 -5.062 39.735 21.548 1.00 45.43 N ATOM 71 CA ARG A 212 -5.356 40.241 20.209 1.00 44.87 C ATOM 72 C ARG A 212 -5.967 41.635 20.308 1.00 43.90 C ATOM 73 O ARG A 212 -5.562 42.552 19.590 1.00 43.85 O ATOM 74 CB ARG A 212 -6.316 39.308 19.454 1.00 45.23 C ATOM 75 CG ARG A 212 -5.739 37.958 19.012 1.00 47.33 C ATOM 76 CD ARG A 212 -6.869 37.024 18.525 1.00 51.71 C ATOM 77 NE ARG A 212 -6.402 35.707 18.061 1.00 54.39 N ATOM 78 CZ ARG A 212 -6.494 35.263 16.804 1.00 56.24 C ATOM 79 NH1 ARG A 212 -6.038 34.055 16.490 1.00 56.61 N ATOM 80 NH2 ARG A 212 -7.043 36.016 15.853 1.00 56.72 N ATOM 81 HA ARG A 212 -4.420 40.286 19.652 1.00 0.00 H ATOM 82 HB2 ARG A 212 -7.168 39.109 20.105 1.00 0.00 H ATOM 83 HB3 ARG A 212 -6.657 39.833 18.561 1.00 0.00 H ATOM 84 HG2 ARG A 212 -5.030 38.119 18.200 1.00 0.00 H ATOM 85 HG3 ARG A 212 -5.226 37.493 19.854 1.00 0.00 H ATOM 86 HD2 ARG A 212 -7.387 37.514 17.700 1.00 0.00 H ATOM 87 HD3 ARG A 212 -7.565 36.870 19.349 1.00 0.00 H ATOM 88 HE ARG A 212 -5.968 35.075 18.764 1.00 0.00 H ATOM 89 HH12 ARG A 212 -6.110 33.710 15.511 1.00 0.00 H ATOM 90 HH11 ARG A 212 -5.609 33.454 17.223 1.00 0.00 H ATOM 91 HH22 ARG A 212 -7.108 35.658 14.879 1.00 0.00 H ATOM 92 HH21 ARG A 212 -7.407 36.962 16.084 1.00 0.00 H ATOM 93 H ARG A 212 -5.583 38.903 21.890 1.00 0.00 H ATOM 94 N ALA A 213 -6.936 41.778 21.213 1.00 42.81 N ATOM 95 CA ALA A 213 -7.577 43.056 21.519 1.00 41.53 C ATOM 96 C ALA A 213 -6.577 44.115 22.000 1.00 40.63 C ATOM 97 O ALA A 213 -6.721 45.289 21.670 1.00 40.36 O ATOM 98 CB ALA A 213 -8.695 42.859 22.548 1.00 41.52 C ATOM 99 HA ALA A 213 -8.009 43.430 20.590 1.00 0.00 H ATOM 100 HB1 ALA A 213 -9.441 42.174 22.145 1.00 0.00 H ATOM 101 HB2 ALA A 213 -8.275 42.443 23.464 1.00 0.00 H ATOM 102 HB3 ALA A 213 -9.161 43.820 22.764 1.00 0.00 H ATOM 103 H ALA A 213 -7.253 40.933 21.730 1.00 0.00 H ATOM 104 N LEU A 214 -5.566 43.702 22.768 1.00 39.96 N ATOM 105 CA LEU A 214 -4.477 44.617 23.158 1.00 39.09 C ATOM 106 C LEU A 214 -3.628 45.036 21.942 1.00 38.39 C ATOM 107 O LEU A 214 -3.273 46.204 21.802 1.00 38.16 O ATOM 108 CB LEU A 214 -3.598 44.007 24.265 1.00 39.13 C ATOM 109 CG LEU A 214 -2.385 44.815 24.756 1.00 38.71 C ATOM 110 CD1 LEU A 214 -2.789 46.196 25.251 1.00 38.22 C ATOM 111 CD2 LEU A 214 -1.613 44.073 25.844 1.00 39.57 C ATOM 112 HA LEU A 214 -4.940 45.517 23.562 1.00 0.00 H ATOM 113 HB2 LEU A 214 -4.240 43.831 25.128 1.00 0.00 H ATOM 114 HB3 LEU A 214 -3.223 43.054 23.892 1.00 0.00 H ATOM 115 HG LEU A 214 -1.728 44.939 23.895 1.00 0.00 H ATOM 116 HD21 LEU A 214 -2.270 43.891 26.694 1.00 0.00 H ATOM 117 HD22 LEU A 214 -1.255 43.122 25.449 1.00 0.00 H ATOM 118 HD23 LEU A 214 -0.764 44.678 26.163 1.00 0.00 H ATOM 119 HD11 LEU A 214 -3.262 46.748 24.439 1.00 0.00 H ATOM 120 HD12 LEU A 214 -3.490 46.093 26.079 1.00 0.00 H ATOM 121 HD13 LEU A 214 -1.903 46.733 25.589 1.00 0.00 H ATOM 122 H LEU A 214 -5.546 42.716 23.098 1.00 0.00 H ATOM 123 N ALA A 215 -3.321 44.082 21.067 1.00 38.04 N ATOM 124 CA ALA A 215 -2.544 44.351 19.854 1.00 37.97 C ATOM 125 C ALA A 215 -3.230 45.421 19.008 1.00 37.97 C ATOM 126 O ALA A 215 -2.594 46.381 18.572 1.00 37.64 O ATOM 127 CB ALA A 215 -2.356 43.075 19.051 1.00 37.60 C ATOM 128 HA ALA A 215 -1.562 44.721 20.147 1.00 0.00 H ATOM 129 HB1 ALA A 215 -1.826 42.341 19.657 1.00 0.00 H ATOM 130 HB2 ALA A 215 -3.331 42.678 18.768 1.00 0.00 H ATOM 131 HB3 ALA A 215 -1.777 43.294 18.154 1.00 0.00 H ATOM 132 H ALA A 215 -3.644 43.111 21.250 1.00 0.00 H ATOM 133 N LYS A 216 -4.538 45.255 18.817 1.00 38.35 N ATOM 134 CA LYS A 216 -5.351 46.178 18.022 1.00 38.71 C ATOM 135 C LYS A 216 -5.386 47.582 18.613 1.00 37.78 C ATOM 136 O LYS A 216 -5.184 48.557 17.896 1.00 37.64 O ATOM 137 CB LYS A 216 -6.771 45.620 17.824 1.00 39.34 C ATOM 138 CG LYS A 216 -6.855 44.485 16.794 1.00 42.47 C ATOM 139 CD LYS A 216 -8.311 44.090 16.473 1.00 46.89 C ATOM 140 CE LYS A 216 -8.368 42.796 15.645 1.00 49.05 C ATOM 141 NZ LYS A 216 -9.735 42.162 15.643 1.00 51.55 N ATOM 142 HA LYS A 216 -4.875 46.265 17.045 1.00 0.00 H ATOM 143 HB2 LYS A 216 -7.128 45.242 18.782 1.00 0.00 H ATOM 144 HB3 LYS A 216 -7.417 46.433 17.492 1.00 0.00 H ATOM 145 HG2 LYS A 216 -6.369 44.810 15.874 1.00 0.00 H ATOM 146 HG3 LYS A 216 -6.334 43.613 17.190 1.00 0.00 H ATOM 147 HD2 LYS A 216 -8.853 43.939 17.407 1.00 0.00 H ATOM 148 HD3 LYS A 216 -8.781 44.895 15.908 1.00 0.00 H ATOM 149 HE2 LYS A 216 -7.655 42.085 16.061 1.00 0.00 H ATOM 150 HE3 LYS A 216 -8.090 43.028 14.617 1.00 0.00 H ATOM 151 HZ1 LYS A 216 -10.008 41.927 16.619 1.00 0.00 H ATOM 152 HZ2 LYS A 216 -10.424 42.828 15.239 1.00 0.00 H ATOM 153 HZ3 LYS A 216 -9.713 41.295 15.070 1.00 0.00 H ATOM 154 H LYS A 216 -5.003 44.433 19.252 1.00 0.00 H ATOM 155 N HIS A 217 -5.622 47.679 19.919 1.00 37.51 N ATOM 156 CA HIS A 217 -5.632 48.967 20.618 1.00 37.24 C ATOM 157 C HIS A 217 -4.302 49.726 20.484 1.00 36.66 C ATOM 158 O HIS A 217 -4.290 50.949 20.282 1.00 36.35 O ATOM 159 CB HIS A 217 -6.006 48.773 22.096 1.00 37.99 C ATOM 160 CG HIS A 217 -5.641 49.933 22.971 1.00 39.95 C ATOM 161 ND1 HIS A 217 -6.352 51.116 22.978 1.00 42.98 N ATOM 162 CD2 HIS A 217 -4.626 50.101 23.851 1.00 41.43 C ATOM 163 CE1 HIS A 217 -5.792 51.962 23.827 1.00 43.14 C ATOM 164 NE2 HIS A 217 -4.745 51.368 24.373 1.00 43.93 N ATOM 165 HA HIS A 217 -6.391 49.584 20.138 1.00 0.00 H ATOM 166 HB2 HIS A 217 -7.083 48.619 22.161 1.00 0.00 H ATOM 167 HB3 HIS A 217 -5.491 47.887 22.467 1.00 0.00 H ATOM 168 HD2 HIS A 217 -3.858 49.369 24.100 1.00 0.00 H ATOM 169 HE1 HIS A 217 -6.135 52.975 24.040 1.00 0.00 H ATOM 170 H HIS A 217 -5.806 46.811 20.462 1.00 0.00 H ATOM 171 N LEU A 218 -3.184 49.006 20.608 1.00 35.83 N ATOM 172 CA LEU A 218 -1.861 49.632 20.505 1.00 34.67 C ATOM 173 C LEU A 218 -1.543 50.050 19.058 1.00 34.13 C ATOM 174 O LEU A 218 -0.962 51.121 18.835 1.00 33.24 O ATOM 175 CB LEU A 218 -0.765 48.714 21.057 1.00 34.83 C ATOM 176 CG LEU A 218 -0.712 48.390 22.551 1.00 34.57 C ATOM 177 CD1 LEU A 218 0.159 47.169 22.777 1.00 32.76 C ATOM 178 CD2 LEU A 218 -0.205 49.575 23.359 1.00 34.82 C ATOM 179 HA LEU A 218 -1.885 50.535 21.115 1.00 0.00 H ATOM 180 HB2 LEU A 218 -0.859 47.763 20.533 1.00 0.00 H ATOM 181 HB3 LEU A 218 0.189 49.176 20.802 1.00 0.00 H ATOM 182 HG LEU A 218 -1.724 48.175 22.895 1.00 0.00 H ATOM 183 HD21 LEU A 218 0.799 49.837 23.026 1.00 0.00 H ATOM 184 HD22 LEU A 218 -0.872 50.425 23.212 1.00 0.00 H ATOM 185 HD23 LEU A 218 -0.181 49.309 24.416 1.00 0.00 H ATOM 186 HD11 LEU A 218 -0.260 46.320 22.237 1.00 0.00 H ATOM 187 HD12 LEU A 218 1.167 47.371 22.414 1.00 0.00 H ATOM 188 HD13 LEU A 218 0.194 46.942 23.842 1.00 0.00 H ATOM 189 H LEU A 218 -3.252 47.983 20.781 1.00 0.00 H ATOM 190 N TYR A 219 -1.929 49.211 18.092 1.00 34.02 N ATOM 191 CA TYR A 219 -1.816 49.564 16.663 1.00 34.40 C ATOM 192 C TYR A 219 -2.622 50.826 16.361 1.00 34.31 C ATOM 193 O TYR A 219 -2.108 51.779 15.751 1.00 34.90 O ATOM 194 CB TYR A 219 -2.258 48.417 15.734 1.00 34.55 C ATOM 195 CG TYR A 219 -2.010 48.705 14.251 1.00 36.12 C ATOM 196 CD1 TYR A 219 -0.817 49.308 13.825 1.00 38.69 C ATOM 197 CD2 TYR A 219 -2.953 48.377 13.284 1.00 37.87 C ATOM 198 CE1 TYR A 219 -0.579 49.576 12.483 1.00 39.20 C ATOM 199 CE2 TYR A 219 -2.721 48.649 11.923 1.00 39.56 C ATOM 200 CZ TYR A 219 -1.529 49.247 11.542 1.00 39.26 C ATOM 201 OH TYR A 219 -1.280 49.526 10.224 1.00 40.91 O ATOM 202 HA TYR A 219 -0.761 49.750 16.465 1.00 0.00 H ATOM 203 HB3 TYR A 219 -3.325 48.246 15.879 1.00 0.00 H ATOM 204 HB2 TYR A 219 -1.706 47.518 16.008 1.00 0.00 H ATOM 205 HD2 TYR A 219 -3.887 47.902 13.585 1.00 0.00 H ATOM 206 HE2 TYR A 219 -3.471 48.392 11.175 1.00 0.00 H ATOM 207 HE1 TYR A 219 0.356 50.045 12.176 1.00 0.00 H ATOM 208 HD1 TYR A 219 -0.060 49.572 14.564 1.00 0.00 H ATOM 209 HH TYR A 219 -0.389 49.948 10.140 1.00 0.00 H ATOM 210 H TYR A 219 -2.320 48.284 18.354 1.00 0.00 H ATOM 211 N ASP A 220 -3.864 50.843 16.836 1.00 33.65 N ATOM 212 CA ASP A 220 -4.756 51.990 16.658 1.00 33.65 C ATOM 213 C ASP A 220 -4.146 53.291 17.178 1.00 32.81 C ATOM 214 O ASP A 220 -4.164 54.300 16.476 1.00 32.35 O ATOM 215 CB ASP A 220 -6.126 51.715 17.289 1.00 33.86 C ATOM 216 CG ASP A 220 -7.104 52.842 17.069 1.00 35.79 C ATOM 217 OD1 ASP A 220 -7.599 52.982 15.931 1.00 37.40 O ATOM 218 OD2 ASP A 220 -7.379 53.588 18.039 1.00 37.10 O ATOM 219 HA ASP A 220 -4.897 52.127 15.586 1.00 0.00 H ATOM 220 HB2 ASP A 220 -6.536 50.806 16.850 1.00 0.00 H ATOM 221 HB3 ASP A 220 -5.994 51.572 18.361 1.00 0.00 H ATOM 222 H ASP A 220 -4.214 50.011 17.353 1.00 0.00 H ATOM 223 N SER A 221 -3.561 53.250 18.378 1.00 32.27 N ATOM 224 CA SER A 221 -2.983 54.450 19.008 1.00 31.57 C ATOM 225 C SER A 221 -1.684 54.879 18.353 1.00 30.90 C ATOM 226 O SER A 221 -1.361 56.060 18.313 1.00 31.10 O ATOM 227 CB SER A 221 -2.742 54.225 20.498 1.00 31.64 C ATOM 228 OG SER A 221 -3.721 53.367 21.037 1.00 33.78 O ATOM 229 HA SER A 221 -3.713 55.247 18.871 1.00 0.00 H ATOM 230 HB2 SER A 221 -2.781 55.183 21.016 1.00 0.00 H ATOM 231 HB3 SER A 221 -1.758 53.778 20.638 1.00 0.00 H ATOM 232 HG SER A 221 -3.686 52.494 20.571 1.00 0.00 H ATOM 233 H SER A 221 -3.512 52.343 18.884 1.00 0.00 H ATOM 234 N TYR A 222 -0.933 53.900 17.871 1.00 30.93 N ATOM 235 CA TYR A 222 0.283 54.110 17.084 1.00 30.65 C ATOM 236 C TYR A 222 -0.040 54.902 15.810 1.00 30.30 C ATOM 237 O TYR A 222 0.585 55.917 15.529 1.00 30.02 O ATOM 238 CB TYR A 222 0.867 52.732 16.748 1.00 30.46 C ATOM 239 CG TYR A 222 2.084 52.692 15.862 1.00 30.51 C ATOM 240 CD1 TYR A 222 1.955 52.650 14.477 1.00 30.82 C ATOM 241 CD2 TYR A 222 3.373 52.640 16.413 1.00 30.31 C ATOM 242 CE1 TYR A 222 3.089 52.594 13.645 1.00 31.58 C ATOM 243 CE2 TYR A 222 4.503 52.572 15.603 1.00 30.31 C ATOM 244 CZ TYR A 222 4.358 52.548 14.221 1.00 30.81 C ATOM 245 OH TYR A 222 5.465 52.465 13.413 1.00 30.18 O ATOM 246 HA TYR A 222 1.012 54.690 17.649 1.00 0.00 H ATOM 247 HB3 TYR A 222 0.084 52.156 16.254 1.00 0.00 H ATOM 248 HB2 TYR A 222 1.132 52.250 17.689 1.00 0.00 H ATOM 249 HD2 TYR A 222 3.492 52.653 17.496 1.00 0.00 H ATOM 250 HE2 TYR A 222 5.496 52.538 16.050 1.00 0.00 H ATOM 251 HE1 TYR A 222 2.976 52.587 12.561 1.00 0.00 H ATOM 252 HD1 TYR A 222 0.961 52.661 14.030 1.00 0.00 H ATOM 253 HH TYR A 222 5.180 52.459 12.465 1.00 0.00 H ATOM 254 H TYR A 222 -1.226 52.921 18.064 1.00 0.00 H ATOM 255 N ILE A 223 -1.030 54.439 15.054 1.00 30.75 N ATOM 256 CA ILE A 223 -1.476 55.155 13.851 1.00 31.50 C ATOM 257 C ILE A 223 -1.828 56.598 14.196 1.00 31.50 C ATOM 258 O ILE A 223 -1.452 57.531 13.475 1.00 31.28 O ATOM 259 CB ILE A 223 -2.674 54.459 13.143 1.00 31.31 C ATOM 260 CG1 ILE A 223 -2.279 53.079 12.614 1.00 32.05 C ATOM 261 CG2 ILE A 223 -3.192 55.309 11.992 1.00 33.27 C ATOM 262 CD1 ILE A 223 -0.822 52.974 12.175 1.00 32.99 C ATOM 263 HA ILE A 223 -0.644 55.141 13.147 1.00 0.00 H ATOM 264 HB ILE A 223 -3.463 54.340 13.885 1.00 0.00 H ATOM 265 HG12 ILE A 223 -2.453 52.347 13.403 1.00 0.00 H ATOM 266 HG13 ILE A 223 -2.912 52.846 11.758 1.00 0.00 H ATOM 267 HD11 ILE A 223 -0.632 53.691 11.376 1.00 0.00 H ATOM 268 HD12 ILE A 223 -0.172 53.192 13.022 1.00 0.00 H ATOM 269 HD13 ILE A 223 -0.625 51.965 11.814 1.00 0.00 H ATOM 270 HG21 ILE A 223 -3.523 56.274 12.375 1.00 0.00 H ATOM 271 HG22 ILE A 223 -2.394 55.460 11.265 1.00 0.00 H ATOM 272 HG23 ILE A 223 -4.029 54.800 11.514 1.00 0.00 H ATOM 273 H ILE A 223 -1.500 53.550 15.320 1.00 0.00 H ATOM 274 N LYS A 224 -2.519 56.772 15.320 1.00 31.53 N ATOM 275 CA LYS A 224 -2.966 58.098 15.739 1.00 31.97 C ATOM 276 C LYS A 224 -1.843 58.991 16.231 1.00 31.91 C ATOM 277 O LYS A 224 -1.939 60.213 16.118 1.00 31.90 O ATOM 278 CB LYS A 224 -4.097 57.985 16.776 1.00 32.34 C ATOM 279 CG LYS A 224 -5.366 57.329 16.193 1.00 32.49 C ATOM 280 CD LYS A 224 -6.316 56.806 17.275 1.00 34.72 C ATOM 281 CE LYS A 224 -7.702 56.548 16.684 1.00 35.03 C ATOM 282 NZ LYS A 224 -8.612 55.817 17.615 1.00 36.10 N ATOM 283 HA LYS A 224 -3.356 58.590 14.848 1.00 0.00 H ATOM 284 HB2 LYS A 224 -3.745 57.383 17.614 1.00 0.00 H ATOM 285 HB3 LYS A 224 -4.350 58.985 17.129 1.00 0.00 H ATOM 286 HG2 LYS A 224 -5.896 58.068 15.592 1.00 0.00 H ATOM 287 HG3 LYS A 224 -5.067 56.494 15.559 1.00 0.00 H ATOM 288 HD2 LYS A 224 -5.920 55.876 17.683 1.00 0.00 H ATOM 289 HD3 LYS A 224 -6.396 57.546 18.072 1.00 0.00 H ATOM 290 HE2 LYS A 224 -7.587 55.956 15.776 1.00 0.00 H ATOM 291 HE3 LYS A 224 -8.157 57.507 16.436 1.00 0.00 H ATOM 292 HZ1 LYS A 224 -8.195 54.895 17.853 1.00 0.00 H ATOM 293 HZ2 LYS A 224 -8.739 56.375 18.483 1.00 0.00 H ATOM 294 HZ3 LYS A 224 -9.534 55.674 17.155 1.00 0.00 H ATOM 295 H LYS A 224 -2.745 55.947 15.912 1.00 0.00 H ATOM 296 N SER A 225 -0.770 58.393 16.755 1.00 32.28 N ATOM 297 CA SER A 225 0.331 59.169 17.344 1.00 32.13 C ATOM 298 C SER A 225 1.477 59.501 16.378 1.00 31.94 C ATOM 299 O SER A 225 2.156 60.511 16.549 1.00 31.69 O ATOM 300 CB SER A 225 0.904 58.444 18.568 1.00 32.64 C ATOM 301 OG SER A 225 -0.080 58.240 19.561 1.00 33.45 O ATOM 302 HA SER A 225 -0.120 60.121 17.625 1.00 0.00 H ATOM 303 HB2 SER A 225 1.712 59.043 18.988 1.00 0.00 H ATOM 304 HB3 SER A 225 1.296 57.477 18.255 1.00 0.00 H ATOM 305 HG SER A 225 -0.815 57.691 19.188 1.00 0.00 H ATOM 306 H SER A 225 -0.712 57.355 16.746 1.00 0.00 H ATOM 307 N PHE A 226 1.693 58.646 15.381 1.00 31.80 N ATOM 308 CA PHE A 226 2.847 58.768 14.487 1.00 31.96 C ATOM 309 C PHE A 226 2.387 58.987 13.047 1.00 32.40 C ATOM 310 O PHE A 226 1.974 58.036 12.382 1.00 32.60 O ATOM 311 CB PHE A 226 3.733 57.510 14.578 1.00 31.68 C ATOM 312 CG PHE A 226 4.227 57.199 15.972 1.00 31.10 C ATOM 313 CD1 PHE A 226 5.160 58.021 16.598 1.00 30.60 C ATOM 314 CD2 PHE A 226 3.787 56.062 16.641 1.00 31.48 C ATOM 315 CE1 PHE A 226 5.627 57.729 17.877 1.00 30.98 C ATOM 316 CE2 PHE A 226 4.258 55.746 17.925 1.00 30.28 C ATOM 317 CZ PHE A 226 5.175 56.583 18.545 1.00 29.84 C ATOM 318 HA PHE A 226 3.434 59.632 14.799 1.00 0.00 H ATOM 319 HB2 PHE A 226 3.154 56.658 14.222 1.00 0.00 H ATOM 320 HB3 PHE A 226 4.599 57.654 13.932 1.00 0.00 H ATOM 321 HD2 PHE A 226 3.063 55.404 16.160 1.00 0.00 H ATOM 322 HE2 PHE A 226 3.905 54.848 18.432 1.00 0.00 H ATOM 323 HZ PHE A 226 5.541 56.351 19.545 1.00 0.00 H ATOM 324 HE1 PHE A 226 6.345 58.393 18.359 1.00 0.00 H ATOM 325 HD1 PHE A 226 5.530 58.906 16.080 1.00 0.00 H ATOM 326 H PHE A 226 1.021 57.866 15.232 1.00 0.00 H ATOM 327 N PRO A 227 2.454 60.239 12.555 1.00 32.85 N ATOM 328 CA PRO A 227 1.883 60.504 11.230 1.00 33.44 C ATOM 329 C PRO A 227 2.675 59.905 10.052 1.00 33.86 C ATOM 330 O PRO A 227 2.089 59.672 8.992 1.00 34.48 O ATOM 331 CB PRO A 227 1.840 62.034 11.152 1.00 33.60 C ATOM 332 CG PRO A 227 2.844 62.511 12.158 1.00 33.49 C ATOM 333 CD PRO A 227 2.968 61.458 13.207 1.00 32.81 C ATOM 334 HA PRO A 227 0.908 60.026 11.132 1.00 0.00 H ATOM 335 HD3 PRO A 227 4.008 61.329 13.505 1.00 0.00 H ATOM 336 HD2 PRO A 227 2.370 61.711 14.082 1.00 0.00 H ATOM 337 HG3 PRO A 227 2.506 63.445 12.607 1.00 0.00 H ATOM 338 HG2 PRO A 227 3.808 62.670 11.675 1.00 0.00 H ATOM 339 HB2 PRO A 227 2.111 62.373 10.152 1.00 0.00 H ATOM 340 HB3 PRO A 227 0.845 62.401 11.402 1.00 0.00 H ATOM 341 N LEU A 228 3.973 59.653 10.230 1.00 33.54 N ATOM 342 CA LEU A 228 4.751 58.950 9.208 1.00 33.40 C ATOM 343 C LEU A 228 5.057 57.511 9.628 1.00 32.85 C ATOM 344 O LEU A 228 6.000 57.257 10.385 1.00 33.19 O ATOM 345 CB LEU A 228 6.040 59.718 8.848 1.00 33.95 C ATOM 346 CG LEU A 228 6.974 59.101 7.788 1.00 34.61 C ATOM 347 CD1 LEU A 228 6.225 58.729 6.509 1.00 34.66 C ATOM 348 CD2 LEU A 228 8.144 60.029 7.469 1.00 35.39 C ATOM 349 HA LEU A 228 4.137 58.905 8.308 1.00 0.00 H ATOM 350 HB2 LEU A 228 5.742 60.702 8.485 1.00 0.00 H ATOM 351 HB3 LEU A 228 6.618 59.830 9.765 1.00 0.00 H ATOM 352 HG LEU A 228 7.371 58.182 8.219 1.00 0.00 H ATOM 353 HD21 LEU A 228 7.762 60.975 7.086 1.00 0.00 H ATOM 354 HD22 LEU A 228 8.721 60.210 8.376 1.00 0.00 H ATOM 355 HD23 LEU A 228 8.782 59.562 6.718 1.00 0.00 H ATOM 356 HD11 LEU A 228 5.448 58.001 6.743 1.00 0.00 H ATOM 357 HD12 LEU A 228 5.770 59.623 6.083 1.00 0.00 H ATOM 358 HD13 LEU A 228 6.924 58.298 5.792 1.00 0.00 H ATOM 359 H LEU A 228 4.439 59.960 11.107 1.00 0.00 H ATOM 360 N THR A 229 4.250 56.578 9.125 1.00 31.69 N ATOM 361 CA THR A 229 4.354 55.174 9.475 1.00 30.64 C ATOM 362 C THR A 229 5.382 54.470 8.594 1.00 30.69 C ATOM 363 O THR A 229 5.870 55.045 7.614 1.00 30.21 O ATOM 364 CB THR A 229 3.012 54.454 9.274 1.00 30.60 C ATOM 365 OG1 THR A 229 2.634 54.553 7.900 1.00 29.25 O ATOM 366 CG2 THR A 229 1.920 55.049 10.163 1.00 29.97 C ATOM 367 HA THR A 229 4.654 55.132 10.522 1.00 0.00 H ATOM 368 HB THR A 229 3.131 53.408 9.555 1.00 0.00 H ATOM 369 HG1 THR A 229 1.769 54.091 7.763 1.00 0.00 H ATOM 370 HG23 THR A 229 2.220 54.968 11.208 1.00 0.00 H ATOM 371 HG21 THR A 229 1.775 56.098 9.906 1.00 0.00 H ATOM 372 HG22 THR A 229 0.989 54.504 10.007 1.00 0.00 H ATOM 373 H THR A 229 3.513 56.869 8.452 1.00 0.00 H ATOM 374 N LYS A 230 5.682 53.219 8.932 1.00 30.39 N ATOM 375 CA LYS A 230 6.575 52.397 8.116 1.00 30.72 C ATOM 376 C LYS A 230 5.940 52.051 6.765 1.00 30.90 C ATOM 377 O LYS A 230 6.612 52.102 5.733 1.00 30.43 O ATOM 378 CB LYS A 230 7.025 51.127 8.859 1.00 30.11 C ATOM 379 CG LYS A 230 8.038 50.302 8.058 1.00 29.72 C ATOM 380 CD LYS A 230 8.573 49.093 8.818 1.00 28.20 C ATOM 381 CE LYS A 230 9.579 48.332 7.956 1.00 29.64 C ATOM 382 NZ LYS A 230 10.224 47.215 8.694 1.00 30.09 N ATOM 383 HA LYS A 230 7.467 52.993 7.922 1.00 0.00 H ATOM 384 HB2 LYS A 230 7.482 51.419 9.804 1.00 0.00 H ATOM 385 HB3 LYS A 230 6.149 50.509 9.056 1.00 0.00 H ATOM 386 HG2 LYS A 230 7.554 49.951 7.147 1.00 0.00 H ATOM 387 HG3 LYS A 230 8.878 50.945 7.797 1.00 0.00 H ATOM 388 HD2 LYS A 230 9.063 49.429 9.732 1.00 0.00 H ATOM 389 HD3 LYS A 230 7.745 48.432 9.074 1.00 0.00 H ATOM 390 HE2 LYS A 230 10.352 49.025 7.624 1.00 0.00 H ATOM 391 HE3 LYS A 230 9.060 47.925 7.088 1.00 0.00 H ATOM 392 HZ1 LYS A 230 10.729 47.593 9.521 1.00 0.00 H ATOM 393 HZ2 LYS A 230 9.496 46.543 9.009 1.00 0.00 H ATOM 394 HZ3 LYS A 230 10.897 46.730 8.067 1.00 0.00 H ATOM 395 H LYS A 230 5.271 52.815 9.798 1.00 0.00 H ATOM 396 N ALA A 231 4.652 51.708 6.774 1.00 31.21 N ATOM 397 CA ALA A 231 3.913 51.454 5.525 1.00 32.11 C ATOM 398 C ALA A 231 4.034 52.628 4.535 1.00 32.55 C ATOM 399 O ALA A 231 4.243 52.426 3.334 1.00 33.01 O ATOM 400 CB ALA A 231 2.436 51.137 5.808 1.00 31.60 C ATOM 401 HA ALA A 231 4.370 50.581 5.058 1.00 0.00 H ATOM 402 HB1 ALA A 231 2.370 50.250 6.438 1.00 0.00 H ATOM 403 HB2 ALA A 231 1.976 51.982 6.319 1.00 0.00 H ATOM 404 HB3 ALA A 231 1.918 50.954 4.866 1.00 0.00 H ATOM 405 H ALA A 231 4.157 51.618 7.684 1.00 0.00 H ATOM 406 N LYS A 232 3.910 53.846 5.046 1.00 32.55 N ATOM 407 CA LYS A 232 4.048 55.037 4.221 1.00 33.12 C ATOM 408 C LYS A 232 5.505 55.263 3.788 1.00 32.88 C ATOM 409 O LYS A 232 5.771 55.537 2.623 1.00 32.97 O ATOM 410 CB LYS A 232 3.489 56.266 4.947 1.00 32.83 C ATOM 411 CG LYS A 232 3.616 57.542 4.143 1.00 34.50 C ATOM 412 CD LYS A 232 2.657 58.630 4.613 1.00 37.06 C ATOM 413 CE LYS A 232 2.948 59.925 3.859 1.00 39.05 C ATOM 414 NZ LYS A 232 2.023 61.030 4.220 1.00 39.01 N ATOM 415 HA LYS A 232 3.464 54.881 3.314 1.00 0.00 H ATOM 416 HB2 LYS A 232 2.434 56.093 5.159 1.00 0.00 H ATOM 417 HB3 LYS A 232 4.031 56.391 5.884 1.00 0.00 H ATOM 418 HG2 LYS A 232 4.637 57.913 4.235 1.00 0.00 H ATOM 419 HG3 LYS A 232 3.405 57.318 3.097 1.00 0.00 H ATOM 420 HD2 LYS A 232 1.631 58.319 4.419 1.00 0.00 H ATOM 421 HD3 LYS A 232 2.789 58.794 5.682 1.00 0.00 H ATOM 422 HE2 LYS A 232 2.858 59.732 2.790 1.00 0.00 H ATOM 423 HE3 LYS A 232 3.967 60.237 4.086 1.00 0.00 H ATOM 424 HZ1 LYS A 232 1.046 60.749 3.999 1.00 0.00 H ATOM 425 HZ2 LYS A 232 2.106 61.231 5.237 1.00 0.00 H ATOM 426 HZ3 LYS A 232 2.272 61.880 3.676 1.00 0.00 H ATOM 427 H LYS A 232 3.709 53.952 6.061 1.00 0.00 H ATOM 428 N ALA A 233 6.438 55.135 4.726 1.00 32.92 N ATOM 429 CA ALA A 233 7.864 55.265 4.428 1.00 33.16 C ATOM 430 C ALA A 233 8.326 54.320 3.302 1.00 33.53 C ATOM 431 O ALA A 233 9.044 54.748 2.406 1.00 32.95 O ATOM 432 CB ALA A 233 8.687 55.042 5.684 1.00 33.11 C ATOM 433 HA ALA A 233 8.023 56.282 4.068 1.00 0.00 H ATOM 434 HB1 ALA A 233 8.411 55.783 6.434 1.00 0.00 H ATOM 435 HB2 ALA A 233 8.493 54.042 6.071 1.00 0.00 H ATOM 436 HB3 ALA A 233 9.746 55.142 5.446 1.00 0.00 H ATOM 437 H ALA A 233 6.144 54.936 5.704 1.00 0.00 H ATOM 438 N ARG A 234 7.901 53.057 3.354 1.00 34.13 N ATOM 439 CA ARG A 234 8.226 52.065 2.318 1.00 35.87 C ATOM 440 C ARG A 234 7.605 52.413 0.972 1.00 36.39 C ATOM 441 O ARG A 234 8.262 52.292 -0.068 1.00 36.77 O ATOM 442 CB ARG A 234 7.801 50.645 2.735 1.00 36.10 C ATOM 443 CG ARG A 234 8.493 50.137 4.008 1.00 38.10 C ATOM 444 CD ARG A 234 9.976 49.876 3.776 1.00 41.84 C ATOM 445 NE ARG A 234 10.813 50.605 4.726 1.00 44.21 N ATOM 446 CZ ARG A 234 12.120 50.822 4.568 1.00 44.99 C ATOM 447 NH1 ARG A 234 12.759 50.367 3.489 1.00 44.50 N ATOM 448 NH2 ARG A 234 12.786 51.504 5.487 1.00 43.09 N ATOM 449 HA ARG A 234 9.310 52.088 2.209 1.00 0.00 H ATOM 450 HB2 ARG A 234 6.724 50.645 2.906 1.00 0.00 H ATOM 451 HB3 ARG A 234 8.038 49.962 1.919 1.00 0.00 H ATOM 452 HG2 ARG A 234 8.384 50.886 4.793 1.00 0.00 H ATOM 453 HG3 ARG A 234 8.016 49.209 4.324 1.00 0.00 H ATOM 454 HD2 ARG A 234 10.235 50.189 2.765 1.00 0.00 H ATOM 455 HD3 ARG A 234 10.167 48.808 3.884 1.00 0.00 H ATOM 456 HE ARG A 234 10.359 50.980 5.583 1.00 0.00 H ATOM 457 HH12 ARG A 234 13.778 50.542 3.376 1.00 0.00 H ATOM 458 HH11 ARG A 234 12.238 49.838 2.761 1.00 0.00 H ATOM 459 HH22 ARG A 234 13.805 51.677 5.370 1.00 0.00 H ATOM 460 HH21 ARG A 234 12.290 51.867 6.326 1.00 0.00 H ATOM 461 H ARG A 234 7.315 52.761 4.161 1.00 0.00 H ATOM 462 N ALA A 235 6.350 52.866 0.996 1.00 36.60 N ATOM 463 CA ALA A 235 5.669 53.308 -0.219 1.00 36.65 C ATOM 464 C ALA A 235 6.443 54.434 -0.915 1.00 36.84 C ATOM 465 O ALA A 235 6.565 54.435 -2.132 1.00 36.92 O ATOM 466 CB ALA A 235 4.236 53.740 0.088 1.00 36.63 C ATOM 467 HA ALA A 235 5.630 52.461 -0.904 1.00 0.00 H ATOM 468 HB1 ALA A 235 3.687 52.899 0.513 1.00 0.00 H ATOM 469 HB2 ALA A 235 4.251 54.563 0.802 1.00 0.00 H ATOM 470 HB3 ALA A 235 3.751 54.065 -0.832 1.00 0.00 H ATOM 471 H ALA A 235 5.843 52.906 1.903 1.00 0.00 H ATOM 472 N ILE A 236 6.970 55.378 -0.140 1.00 36.93 N ATOM 473 CA ILE A 236 7.776 56.468 -0.693 1.00 37.51 C ATOM 474 C ILE A 236 9.133 55.970 -1.218 1.00 38.13 C ATOM 475 O ILE A 236 9.572 56.375 -2.294 1.00 37.77 O ATOM 476 CB ILE A 236 7.990 57.605 0.331 1.00 37.16 C ATOM 477 CG1 ILE A 236 6.641 58.221 0.731 1.00 37.43 C ATOM 478 CG2 ILE A 236 8.916 58.674 -0.239 1.00 36.70 C ATOM 479 CD1 ILE A 236 6.692 59.119 1.968 1.00 37.25 C ATOM 480 HA ILE A 236 7.210 56.868 -1.534 1.00 0.00 H ATOM 481 HB ILE A 236 8.459 57.185 1.221 1.00 0.00 H ATOM 482 HG12 ILE A 236 6.277 58.816 -0.107 1.00 0.00 H ATOM 483 HG13 ILE A 236 5.942 57.409 0.929 1.00 0.00 H ATOM 484 HD11 ILE A 236 7.041 58.539 2.822 1.00 0.00 H ATOM 485 HD12 ILE A 236 7.377 59.947 1.786 1.00 0.00 H ATOM 486 HD13 ILE A 236 5.695 59.508 2.174 1.00 0.00 H ATOM 487 HG21 ILE A 236 9.881 58.227 -0.478 1.00 0.00 H ATOM 488 HG22 ILE A 236 8.474 59.091 -1.143 1.00 0.00 H ATOM 489 HG23 ILE A 236 9.053 59.465 0.498 1.00 0.00 H ATOM 490 H ILE A 236 6.805 55.341 0.886 1.00 0.00 H ATOM 491 N LEU A 237 9.778 55.089 -0.459 1.00 38.93 N ATOM 492 CA LEU A 237 11.108 54.589 -0.811 1.00 40.21 C ATOM 493 C LEU A 237 11.143 53.618 -1.995 1.00 41.29 C ATOM 494 O LEU A 237 12.130 53.558 -2.711 1.00 41.34 O ATOM 495 CB LEU A 237 11.799 53.960 0.403 1.00 39.61 C ATOM 496 CG LEU A 237 12.242 54.948 1.482 1.00 38.93 C ATOM 497 CD1 LEU A 237 12.693 54.213 2.720 1.00 38.79 C ATOM 498 CD2 LEU A 237 13.327 55.878 0.970 1.00 37.48 C ATOM 499 HA LEU A 237 11.655 55.473 -1.138 1.00 0.00 H ATOM 500 HB2 LEU A 237 11.106 53.252 0.857 1.00 0.00 H ATOM 501 HB3 LEU A 237 12.682 53.427 0.050 1.00 0.00 H ATOM 502 HG LEU A 237 11.384 55.566 1.746 1.00 0.00 H ATOM 503 HD21 LEU A 237 14.192 55.290 0.662 1.00 0.00 H ATOM 504 HD22 LEU A 237 12.948 56.442 0.118 1.00 0.00 H ATOM 505 HD23 LEU A 237 13.618 56.567 1.763 1.00 0.00 H ATOM 506 HD11 LEU A 237 11.868 53.613 3.106 1.00 0.00 H ATOM 507 HD12 LEU A 237 13.531 53.562 2.470 1.00 0.00 H ATOM 508 HD13 LEU A 237 13.004 54.934 3.476 1.00 0.00 H ATOM 509 H LEU A 237 9.324 54.745 0.411 1.00 0.00 H ATOM 510 N THR A 238 10.067 52.871 -2.208 1.00 42.90 N ATOM 511 CA THR A 238 10.075 51.840 -3.244 1.00 44.44 C ATOM 512 C THR A 238 9.368 52.254 -4.544 1.00 45.61 C ATOM 513 O THR A 238 9.391 51.507 -5.527 1.00 46.06 O ATOM 514 CB THR A 238 9.478 50.519 -2.722 1.00 44.36 C ATOM 515 OG1 THR A 238 8.142 50.753 -2.261 1.00 44.88 O ATOM 516 CG2 THR A 238 10.336 49.943 -1.580 1.00 43.95 C ATOM 517 HA THR A 238 11.126 51.695 -3.492 1.00 0.00 H ATOM 518 HB THR A 238 9.465 49.793 -3.535 1.00 0.00 H ATOM 519 HG1 THR A 238 8.158 51.421 -1.531 1.00 0.00 H ATOM 520 HG23 THR A 238 11.350 49.769 -1.941 1.00 0.00 H ATOM 521 HG21 THR A 238 10.361 50.652 -0.753 1.00 0.00 H ATOM 522 HG22 THR A 238 9.903 49.002 -1.241 1.00 0.00 H ATOM 523 H THR A 238 9.213 53.020 -1.634 1.00 0.00 H ATOM 524 N GLY A 239 8.740 53.430 -4.550 1.00 46.61 N ATOM 525 CA GLY A 239 8.071 53.948 -5.758 1.00 47.89 C ATOM 526 C GLY A 239 6.587 53.635 -5.935 1.00 48.75 C ATOM 527 O GLY A 239 6.076 53.707 -7.055 1.00 49.19 O ATOM 528 HA3 GLY A 239 8.596 53.540 -6.622 1.00 0.00 H ATOM 529 HA2 GLY A 239 8.177 55.033 -5.750 1.00 0.00 H ATOM 530 H GLY A 239 8.721 53.998 -3.679 1.00 0.00 H ATOM 531 N LYS A 240 5.887 53.313 -4.844 1.00 49.32 N ATOM 532 CA LYS A 240 4.436 53.016 -4.899 1.00 50.01 C ATOM 533 C LYS A 240 3.574 54.247 -5.227 1.00 49.83 C ATOM 534 O LYS A 240 3.886 55.364 -4.818 1.00 49.75 O ATOM 535 CB LYS A 240 3.945 52.318 -3.613 1.00 50.06 C ATOM 536 CG LYS A 240 4.393 50.857 -3.506 1.00 51.57 C ATOM 537 CD LYS A 240 3.621 50.050 -2.448 1.00 53.76 C ATOM 538 CE LYS A 240 3.760 48.540 -2.721 1.00 55.25 C ATOM 539 NZ LYS A 240 3.201 47.666 -1.633 1.00 56.32 N ATOM 540 HA LYS A 240 4.309 52.322 -5.730 1.00 0.00 H ATOM 541 HB2 LYS A 240 4.334 52.863 -2.753 1.00 0.00 H ATOM 542 HB3 LYS A 240 2.856 52.348 -3.598 1.00 0.00 H ATOM 543 HG2 LYS A 240 4.249 50.381 -4.476 1.00 0.00 H ATOM 544 HG3 LYS A 240 5.452 50.839 -3.248 1.00 0.00 H ATOM 545 HD2 LYS A 240 4.022 50.276 -1.460 1.00 0.00 H ATOM 546 HD3 LYS A 240 2.567 50.327 -2.483 1.00 0.00 H ATOM 547 HE2 LYS A 240 4.819 48.309 -2.836 1.00 0.00 H ATOM 548 HE3 LYS A 240 3.236 48.310 -3.649 1.00 0.00 H ATOM 549 HZ1 LYS A 240 3.698 47.864 -0.741 1.00 0.00 H ATOM 550 HZ2 LYS A 240 2.187 47.865 -1.517 1.00 0.00 H ATOM 551 HZ3 LYS A 240 3.332 46.667 -1.891 1.00 0.00 H ATOM 552 H LYS A 240 6.376 53.269 -3.927 1.00 0.00 H ATOM 553 N THR A 241 2.488 54.022 -5.967 1.00 50.04 N ATOM 554 CA THR A 241 1.671 55.115 -6.530 1.00 49.82 C ATOM 555 C THR A 241 0.709 55.728 -5.508 1.00 49.72 C ATOM 556 O THR A 241 0.098 56.770 -5.757 1.00 49.66 O ATOM 557 CB THR A 241 0.904 54.666 -7.798 1.00 49.87 C ATOM 558 OG1 THR A 241 -0.151 53.764 -7.440 1.00 49.35 O ATOM 559 CG2 THR A 241 1.851 53.968 -8.772 1.00 50.09 C ATOM 560 HA THR A 241 2.377 55.895 -6.815 1.00 0.00 H ATOM 561 HB THR A 241 0.483 55.550 -8.276 1.00 0.00 H ATOM 562 HG1 THR A 241 -0.635 53.483 -8.257 1.00 0.00 H ATOM 563 HG23 THR A 241 2.655 54.651 -9.047 1.00 0.00 H ATOM 564 HG21 THR A 241 2.271 53.082 -8.296 1.00 0.00 H ATOM 565 HG22 THR A 241 1.300 53.675 -9.666 1.00 0.00 H ATOM 566 H THR A 241 2.206 53.039 -6.155 1.00 0.00 H ATOM 567 N THR A 242 0.595 55.073 -4.356 1.00 49.65 N ATOM 568 CA THR A 242 -0.130 55.605 -3.198 1.00 49.34 C ATOM 569 C THR A 242 0.547 56.881 -2.677 1.00 49.54 C ATOM 570 O THR A 242 -0.096 57.757 -2.096 1.00 49.14 O ATOM 571 CB THR A 242 -0.198 54.560 -2.065 1.00 48.95 C ATOM 572 OG1 THR A 242 1.128 54.103 -1.756 1.00 48.47 O ATOM 573 CG2 THR A 242 -1.045 53.384 -2.479 1.00 47.95 C ATOM 574 HA THR A 242 -1.144 55.843 -3.521 1.00 0.00 H ATOM 575 HB THR A 242 -0.646 55.026 -1.187 1.00 0.00 H ATOM 576 HG1 THR A 242 1.681 54.871 -1.465 1.00 0.00 H ATOM 577 HG23 THR A 242 -2.052 53.728 -2.714 1.00 0.00 H ATOM 578 HG21 THR A 242 -0.606 52.913 -3.359 1.00 0.00 H ATOM 579 HG22 THR A 242 -1.087 52.663 -1.663 1.00 0.00 H ATOM 580 H THR A 242 1.042 54.138 -4.273 1.00 0.00 H ATOM 581 N ASP A 243 1.858 56.978 -2.887 1.00 49.94 N ATOM 582 CA ASP A 243 2.618 58.124 -2.410 1.00 50.27 C ATOM 583 C ASP A 243 3.548 58.724 -3.447 1.00 50.33 C ATOM 584 O ASP A 243 3.706 58.192 -4.556 1.00 50.78 O ATOM 585 CB ASP A 243 3.375 57.768 -1.138 1.00 50.36 C ATOM 586 CG ASP A 243 2.450 57.563 0.033 1.00 51.04 C ATOM 587 OD1 ASP A 243 2.345 58.481 0.876 1.00 52.44 O ATOM 588 OD2 ASP A 243 1.810 56.493 0.096 1.00 51.71 O ATOM 589 HA ASP A 243 1.887 58.902 -2.191 1.00 0.00 H ATOM 590 HB2 ASP A 243 3.936 56.849 -1.308 1.00 0.00 H ATOM 591 HB3 ASP A 243 4.067 58.577 -0.902 1.00 0.00 H ATOM 592 H ASP A 243 2.349 56.220 -3.402 1.00 0.00 H ATOM 593 N LYS A 244 4.155 59.847 -3.077 1.00 50.10 N ATOM 594 CA LYS A 244 4.973 60.611 -4.005 1.00 49.82 C ATOM 595 C LYS A 244 6.455 60.545 -3.650 1.00 49.34 C ATOM 596 O LYS A 244 6.837 60.348 -2.494 1.00 49.56 O ATOM 597 CB LYS A 244 4.485 62.064 -4.110 1.00 49.86 C ATOM 598 CG LYS A 244 3.003 62.217 -4.438 1.00 50.56 C ATOM 599 CD LYS A 244 2.563 61.365 -5.629 1.00 51.59 C ATOM 600 CE LYS A 244 1.140 60.859 -5.428 1.00 51.93 C ATOM 601 NZ LYS A 244 1.062 59.379 -5.631 1.00 51.75 N ATOM 602 HA LYS A 244 4.861 60.150 -4.986 1.00 0.00 H ATOM 603 HB2 LYS A 244 4.674 62.556 -3.156 1.00 0.00 H ATOM 604 HB3 LYS A 244 5.059 62.559 -4.893 1.00 0.00 H ATOM 605 HG2 LYS A 244 2.421 61.921 -3.565 1.00 0.00 H ATOM 606 HG3 LYS A 244 2.804 63.264 -4.667 1.00 0.00 H ATOM 607 HD2 LYS A 244 2.605 61.968 -6.536 1.00 0.00 H ATOM 608 HD3 LYS A 244 3.236 60.513 -5.729 1.00 0.00 H ATOM 609 HE2 LYS A 244 0.482 61.352 -6.143 1.00 0.00 H ATOM 610 HE3 LYS A 244 0.817 61.097 -4.415 1.00 0.00 H ATOM 611 HZ1 LYS A 244 1.365 59.147 -6.598 1.00 0.00 H ATOM 612 HZ2 LYS A 244 1.685 58.903 -4.947 1.00 0.00 H ATOM 613 HZ3 LYS A 244 0.082 59.062 -5.488 1.00 0.00 H ATOM 614 H LYS A 244 4.042 60.187 -2.101 1.00 0.00 H ATOM 615 N SER A 245 7.281 60.722 -4.671 1.00 48.58 N ATOM 616 CA SER A 245 8.720 60.543 -4.559 1.00 47.93 C ATOM 617 C SER A 245 9.411 61.742 -3.907 1.00 46.52 C ATOM 618 O SER A 245 8.995 62.883 -4.104 1.00 46.35 O ATOM 619 CB SER A 245 9.304 60.243 -5.941 1.00 48.27 C ATOM 620 OG SER A 245 8.816 61.160 -6.911 1.00 49.50 O ATOM 621 HA SER A 245 8.906 59.696 -3.899 1.00 0.00 H ATOM 622 HB2 SER A 245 9.024 59.231 -6.234 1.00 0.00 H ATOM 623 HB3 SER A 245 10.390 60.319 -5.893 1.00 0.00 H ATOM 624 HG SER A 245 9.208 60.944 -7.794 1.00 0.00 H ATOM 625 H SER A 245 6.884 61.001 -5.591 1.00 0.00 H ATOM 626 N PRO A 246 10.461 61.480 -3.114 1.00 45.38 N ATOM 627 CA PRO A 246 11.120 62.563 -2.399 1.00 45.01 C ATOM 628 C PRO A 246 12.133 63.307 -3.269 1.00 44.55 C ATOM 629 O PRO A 246 12.649 62.742 -4.234 1.00 43.79 O ATOM 630 CB PRO A 246 11.849 61.830 -1.276 1.00 44.65 C ATOM 631 CG PRO A 246 12.171 60.510 -1.848 1.00 44.92 C ATOM 632 CD PRO A 246 11.107 60.181 -2.856 1.00 45.22 C ATOM 633 HA PRO A 246 10.413 63.322 -2.065 1.00 0.00 H ATOM 634 HD3 PRO A 246 11.546 59.776 -3.768 1.00 0.00 H ATOM 635 HD2 PRO A 246 10.393 59.465 -2.449 1.00 0.00 H ATOM 636 HG3 PRO A 246 12.184 59.756 -1.061 1.00 0.00 H ATOM 637 HG2 PRO A 246 13.146 60.543 -2.334 1.00 0.00 H ATOM 638 HB2 PRO A 246 12.758 62.361 -0.995 1.00 0.00 H ATOM 639 HB3 PRO A 246 11.206 61.726 -0.402 1.00 0.00 H ATOM 640 N PHE A 247 12.397 64.565 -2.921 1.00 44.58 N ATOM 641 CA PHE A 247 13.555 65.284 -3.448 1.00 44.74 C ATOM 642 C PHE A 247 14.794 64.727 -2.752 1.00 44.68 C ATOM 643 O PHE A 247 14.758 64.468 -1.555 1.00 44.34 O ATOM 644 CB PHE A 247 13.443 66.797 -3.213 1.00 44.71 C ATOM 645 CG PHE A 247 14.573 67.590 -3.830 1.00 45.07 C ATOM 646 CD1 PHE A 247 15.728 67.866 -3.103 1.00 46.21 C ATOM 647 CD2 PHE A 247 14.490 68.045 -5.148 1.00 44.82 C ATOM 648 CE1 PHE A 247 16.793 68.589 -3.682 1.00 45.82 C ATOM 649 CE2 PHE A 247 15.537 68.768 -5.729 1.00 44.51 C ATOM 650 CZ PHE A 247 16.689 69.044 -4.992 1.00 44.94 C ATOM 651 HA PHE A 247 13.615 65.141 -4.527 1.00 0.00 H ATOM 652 HB2 PHE A 247 12.503 67.144 -3.642 1.00 0.00 H ATOM 653 HB3 PHE A 247 13.440 66.980 -2.138 1.00 0.00 H ATOM 654 HD2 PHE A 247 13.595 67.833 -5.733 1.00 0.00 H ATOM 655 HE2 PHE A 247 15.453 69.116 -6.758 1.00 0.00 H ATOM 656 HZ PHE A 247 17.503 69.613 -5.441 1.00 0.00 H ATOM 657 HE1 PHE A 247 17.695 68.790 -3.104 1.00 0.00 H ATOM 658 HD1 PHE A 247 15.811 67.519 -2.073 1.00 0.00 H ATOM 659 H PHE A 247 11.761 65.049 -2.256 1.00 0.00 H ATOM 660 N VAL A 248 15.877 64.537 -3.502 1.00 44.98 N ATOM 661 CA VAL A 248 17.063 63.862 -2.968 1.00 45.31 C ATOM 662 C VAL A 248 18.241 64.813 -2.727 1.00 46.18 C ATOM 663 O VAL A 248 18.704 65.518 -3.635 1.00 46.00 O ATOM 664 CB VAL A 248 17.482 62.650 -3.836 1.00 45.11 C ATOM 665 CG1 VAL A 248 18.772 62.025 -3.324 1.00 44.15 C ATOM 666 CG2 VAL A 248 16.363 61.602 -3.874 1.00 44.82 C ATOM 667 HA VAL A 248 16.770 63.482 -1.989 1.00 0.00 H ATOM 668 HB VAL A 248 17.659 63.012 -4.849 1.00 0.00 H ATOM 669 HG11 VAL A 248 19.570 62.767 -3.353 1.00 0.00 H ATOM 670 HG12 VAL A 248 18.628 61.685 -2.298 1.00 0.00 H ATOM 671 HG13 VAL A 248 19.039 61.177 -3.955 1.00 0.00 H ATOM 672 HG21 VAL A 248 16.155 61.257 -2.861 1.00 0.00 H ATOM 673 HG22 VAL A 248 15.464 62.048 -4.299 1.00 0.00 H ATOM 674 HG23 VAL A 248 16.677 60.759 -4.489 1.00 0.00 H ATOM 675 H VAL A 248 15.882 64.874 -4.486 1.00 0.00 H ATOM 676 N ILE A 249 18.705 64.813 -1.481 1.00 47.07 N ATOM 677 CA ILE A 249 19.809 65.642 -1.036 1.00 48.12 C ATOM 678 C ILE A 249 21.060 64.770 -0.935 1.00 48.78 C ATOM 679 O ILE A 249 21.125 63.853 -0.122 1.00 48.72 O ATOM 680 CB ILE A 249 19.460 66.333 0.303 1.00 48.21 C ATOM 681 CG1 ILE A 249 18.250 67.255 0.109 1.00 48.68 C ATOM 682 CG2 ILE A 249 20.656 67.115 0.846 1.00 48.52 C ATOM 683 CD1 ILE A 249 17.447 67.521 1.366 1.00 49.78 C ATOM 684 HA ILE A 249 20.002 66.440 -1.753 1.00 0.00 H ATOM 685 HB ILE A 249 19.208 65.567 1.036 1.00 0.00 H ATOM 686 HG12 ILE A 249 18.609 68.211 -0.273 1.00 0.00 H ATOM 687 HG13 ILE A 249 17.588 66.797 -0.626 1.00 0.00 H ATOM 688 HD11 ILE A 249 17.065 66.578 1.758 1.00 0.00 H ATOM 689 HD12 ILE A 249 18.087 67.993 2.111 1.00 0.00 H ATOM 690 HD13 ILE A 249 16.613 68.182 1.130 1.00 0.00 H ATOM 691 HG21 ILE A 249 21.490 66.433 1.012 1.00 0.00 H ATOM 692 HG22 ILE A 249 20.947 67.878 0.124 1.00 0.00 H ATOM 693 HG23 ILE A 249 20.381 67.590 1.788 1.00 0.00 H ATOM 694 H ILE A 249 18.252 64.184 -0.788 1.00 0.00 H ATOM 695 N TYR A 250 22.037 65.058 -1.791 1.00 50.05 N ATOM 696 CA TYR A 250 23.234 64.234 -1.930 1.00 51.56 C ATOM 697 C TYR A 250 24.520 65.071 -1.907 1.00 52.69 C ATOM 698 O TYR A 250 25.620 64.525 -1.815 1.00 52.60 O ATOM 699 CB TYR A 250 23.157 63.412 -3.225 1.00 51.51 C ATOM 700 CG TYR A 250 23.169 64.251 -4.496 1.00 51.70 C ATOM 701 CD1 TYR A 250 24.348 64.438 -5.225 1.00 51.56 C ATOM 702 CD2 TYR A 250 22.001 64.851 -4.972 1.00 51.59 C ATOM 703 CE1 TYR A 250 24.357 65.211 -6.394 1.00 51.52 C ATOM 704 CE2 TYR A 250 22.003 65.625 -6.130 1.00 50.65 C ATOM 705 CZ TYR A 250 23.179 65.800 -6.834 1.00 50.92 C ATOM 706 OH TYR A 250 23.168 66.564 -7.975 1.00 50.19 O ATOM 707 HA TYR A 250 23.272 63.562 -1.073 1.00 0.00 H ATOM 708 HB3 TYR A 250 22.235 62.830 -3.207 1.00 0.00 H ATOM 709 HB2 TYR A 250 24.011 62.736 -3.253 1.00 0.00 H ATOM 710 HD2 TYR A 250 21.068 64.711 -4.426 1.00 0.00 H ATOM 711 HE2 TYR A 250 21.081 66.090 -6.479 1.00 0.00 H ATOM 712 HE1 TYR A 250 25.282 65.349 -6.954 1.00 0.00 H ATOM 713 HD1 TYR A 250 25.273 63.976 -4.879 1.00 0.00 H ATOM 714 HH TYR A 250 24.079 66.593 -8.360 1.00 0.00 H ATOM 715 H TYR A 250 21.944 65.906 -2.386 1.00 0.00 H ATOM 716 N ASP A 251 24.368 66.389 -2.024 1.00 54.44 N ATOM 717 CA ASP A 251 25.483 67.332 -1.926 1.00 56.32 C ATOM 718 C ASP A 251 25.017 68.727 -1.500 1.00 57.72 C ATOM 719 O ASP A 251 23.811 68.972 -1.339 1.00 57.77 O ATOM 720 CB ASP A 251 26.299 67.391 -3.235 1.00 56.18 C ATOM 721 CG ASP A 251 25.567 68.095 -4.384 1.00 56.98 C ATOM 722 OD1 ASP A 251 26.102 68.045 -5.513 1.00 58.08 O ATOM 723 OD2 ASP A 251 24.481 68.697 -4.188 1.00 57.02 O ATOM 724 HA ASP A 251 26.143 66.957 -1.144 1.00 0.00 H ATOM 725 HB2 ASP A 251 27.228 67.926 -3.038 1.00 0.00 H ATOM 726 HB3 ASP A 251 26.528 66.371 -3.545 1.00 0.00 H ATOM 727 H ASP A 251 23.413 66.765 -2.193 1.00 0.00 H ATOM 728 N MET A 252 25.984 69.630 -1.335 1.00 59.35 N ATOM 729 CA MET A 252 25.733 71.013 -0.938 1.00 61.16 C ATOM 730 C MET A 252 24.648 71.676 -1.775 1.00 61.83 C ATOM 731 O MET A 252 23.695 72.237 -1.228 1.00 61.91 O ATOM 732 CB MET A 252 27.022 71.840 -1.031 1.00 61.62 C ATOM 733 CG MET A 252 28.154 71.354 -0.136 1.00 63.98 C ATOM 734 SD MET A 252 27.959 71.889 1.576 1.00 68.99 S ATOM 735 CE MET A 252 28.367 73.636 1.436 1.00 68.14 C ATOM 736 HA MET A 252 25.383 70.981 0.094 1.00 0.00 H ATOM 737 HB2 MET A 252 27.370 71.813 -2.064 1.00 0.00 H ATOM 738 HB3 MET A 252 26.787 72.868 -0.755 1.00 0.00 H ATOM 739 HG2 MET A 252 29.096 71.745 -0.520 1.00 0.00 H ATOM 740 HG3 MET A 252 28.177 70.265 -0.162 1.00 0.00 H ATOM 741 HE1 MET A 252 29.384 73.741 1.059 1.00 0.00 H ATOM 742 HE2 MET A 252 27.672 74.116 0.747 1.00 0.00 H ATOM 743 HE3 MET A 252 28.291 74.105 2.417 1.00 0.00 H ATOM 744 H MET A 252 26.968 69.334 -1.497 1.00 0.00 H ATOM 745 N ASN A 253 24.791 71.610 -3.097 1.00 62.82 N ATOM 746 CA ASN A 253 23.867 72.310 -3.992 1.00 64.01 C ATOM 747 C ASN A 253 22.444 71.741 -3.984 1.00 64.65 C ATOM 748 O ASN A 253 21.472 72.500 -3.975 1.00 64.69 O ATOM 749 CB ASN A 253 24.434 72.415 -5.415 1.00 64.00 C ATOM 750 CG ASN A 253 25.593 73.413 -5.515 1.00 64.68 C ATOM 751 OD1 ASN A 253 26.482 73.450 -4.655 1.00 64.93 O ATOM 752 ND2 ASN A 253 25.589 74.221 -6.571 1.00 64.65 N ATOM 753 HA ASN A 253 23.774 73.319 -3.591 1.00 0.00 H ATOM 754 HB2 ASN A 253 24.792 71.432 -5.722 1.00 0.00 H ATOM 755 HB3 ASN A 253 23.637 72.736 -6.086 1.00 0.00 H ATOM 756 HD22 ASN A 253 24.823 74.158 -7.271 1.00 0.00 H ATOM 757 HD21 ASN A 253 26.352 74.916 -6.697 1.00 0.00 H ATOM 758 H ASN A 253 25.571 71.053 -3.500 1.00 0.00 H ATOM 759 N SER A 254 22.323 70.415 -3.965 1.00 65.51 N ATOM 760 CA SER A 254 21.009 69.786 -3.829 1.00 66.40 C ATOM 761 C SER A 254 20.371 70.104 -2.470 1.00 67.12 C ATOM 762 O SER A 254 19.155 70.233 -2.373 1.00 67.06 O ATOM 763 CB SER A 254 21.073 68.279 -4.086 1.00 66.16 C ATOM 764 OG SER A 254 22.089 67.657 -3.324 1.00 66.27 O ATOM 765 HA SER A 254 20.365 70.214 -4.597 1.00 0.00 H ATOM 766 HB2 SER A 254 21.272 68.110 -5.144 1.00 0.00 H ATOM 767 HB3 SER A 254 20.113 67.835 -3.823 1.00 0.00 H ATOM 768 HG SER A 254 22.966 68.050 -3.562 1.00 0.00 H ATOM 769 H SER A 254 23.172 69.820 -4.048 1.00 0.00 H ATOM 770 N LEU A 255 21.195 70.259 -1.433 1.00 68.26 N ATOM 771 CA LEU A 255 20.711 70.751 -0.143 1.00 69.37 C ATOM 772 C LEU A 255 20.213 72.195 -0.249 1.00 70.32 C ATOM 773 O LEU A 255 19.178 72.533 0.323 1.00 70.48 O ATOM 774 CB LEU A 255 21.786 70.615 0.942 1.00 69.17 C ATOM 775 CG LEU A 255 21.539 71.204 2.341 1.00 69.29 C ATOM 776 CD1 LEU A 255 20.262 70.679 3.003 1.00 68.94 C ATOM 777 CD2 LEU A 255 22.743 70.947 3.236 1.00 69.21 C ATOM 778 HA LEU A 255 19.864 70.130 0.149 1.00 0.00 H ATOM 779 HB2 LEU A 255 21.967 69.548 1.076 1.00 0.00 H ATOM 780 HB3 LEU A 255 22.688 71.089 0.554 1.00 0.00 H ATOM 781 HG LEU A 255 21.398 72.277 2.208 1.00 0.00 H ATOM 782 HD21 LEU A 255 22.907 69.873 3.323 1.00 0.00 H ATOM 783 HD22 LEU A 255 23.625 71.416 2.800 1.00 0.00 H ATOM 784 HD23 LEU A 255 22.556 71.369 4.224 1.00 0.00 H ATOM 785 HD11 LEU A 255 19.402 70.933 2.383 1.00 0.00 H ATOM 786 HD12 LEU A 255 20.328 69.596 3.109 1.00 0.00 H ATOM 787 HD13 LEU A 255 20.150 71.136 3.986 1.00 0.00 H ATOM 788 H LEU A 255 22.202 70.025 -1.544 1.00 0.00 H ATOM 789 N MET A 256 20.948 73.034 -0.982 1.00 71.67 N ATOM 790 CA MET A 256 20.537 74.420 -1.250 1.00 73.00 C ATOM 791 C MET A 256 19.240 74.472 -2.068 1.00 73.70 C ATOM 792 O MET A 256 18.338 75.264 -1.773 1.00 73.78 O ATOM 793 CB MET A 256 21.651 75.195 -1.970 1.00 73.12 C ATOM 794 CG MET A 256 22.752 75.758 -1.062 1.00 74.28 C ATOM 795 SD MET A 256 24.073 76.616 -1.974 1.00 76.78 S ATOM 796 CE MET A 256 25.361 75.364 -2.005 1.00 76.22 C ATOM 797 HA MET A 256 20.350 74.895 -0.287 1.00 0.00 H ATOM 798 HB2 MET A 256 22.119 74.522 -2.689 1.00 0.00 H ATOM 799 HB3 MET A 256 21.192 76.030 -2.500 1.00 0.00 H ATOM 800 HG2 MET A 256 23.196 74.933 -0.505 1.00 0.00 H ATOM 801 HG3 MET A 256 22.299 76.463 -0.365 1.00 0.00 H ATOM 802 HE1 MET A 256 25.640 75.106 -0.983 1.00 0.00 H ATOM 803 HE2 MET A 256 24.990 74.476 -2.517 1.00 0.00 H ATOM 804 HE3 MET A 256 26.231 75.753 -2.533 1.00 0.00 H ATOM 805 H MET A 256 21.847 72.694 -1.379 1.00 0.00 H ATOM 806 N MET A 257 19.157 73.621 -3.088 1.00 74.62 N ATOM 807 CA MET A 257 17.954 73.487 -3.914 1.00 75.71 C ATOM 808 C MET A 257 16.791 72.915 -3.099 1.00 76.28 C ATOM 809 O MET A 257 15.630 73.270 -3.321 1.00 76.16 O ATOM 810 CB MET A 257 18.232 72.587 -5.126 1.00 75.76 C ATOM 811 CG MET A 257 19.021 73.242 -6.260 1.00 76.61 C ATOM 812 SD MET A 257 17.967 74.003 -7.520 1.00 78.81 S ATOM 813 CE MET A 257 19.182 74.462 -8.762 1.00 78.71 C ATOM 814 HA MET A 257 17.677 74.481 -4.265 1.00 0.00 H ATOM 815 HB2 MET A 257 18.796 71.721 -4.780 1.00 0.00 H ATOM 816 HB3 MET A 257 17.274 72.258 -5.528 1.00 0.00 H ATOM 817 HG2 MET A 257 19.637 72.480 -6.738 1.00 0.00 H ATOM 818 HG3 MET A 257 19.663 74.013 -5.834 1.00 0.00 H ATOM 819 HE1 MET A 257 19.903 75.153 -8.325 1.00 0.00 H ATOM 820 HE2 MET A 257 19.699 73.568 -9.111 1.00 0.00 H ATOM 821 HE3 MET A 257 18.679 74.943 -9.601 1.00 0.00 H ATOM 822 H MET A 257 19.981 73.026 -3.308 1.00 0.00 H ATOM 823 N GLY A 258 17.120 72.032 -2.158 1.00 76.99 N ATOM 824 CA GLY A 258 16.129 71.357 -1.328 1.00 77.96 C ATOM 825 C GLY A 258 15.487 72.248 -0.287 1.00 78.74 C ATOM 826 O GLY A 258 14.340 72.025 0.098 1.00 78.73 O ATOM 827 HA3 GLY A 258 16.618 70.528 -0.816 1.00 0.00 H ATOM 828 HA2 GLY A 258 15.345 70.969 -1.978 1.00 0.00 H ATOM 829 H GLY A 258 18.126 71.815 -2.009 1.00 0.00 H ATOM 830 N GLU A 259 16.220 73.264 0.162 1.00 79.69 N ATOM 831 CA GLU A 259 15.751 74.153 1.229 1.00 80.71 C ATOM 832 C GLU A 259 14.703 75.160 0.749 1.00 81.18 C ATOM 833 O GLU A 259 14.917 76.375 0.794 1.00 81.46 O ATOM 834 CB GLU A 259 16.930 74.850 1.927 1.00 80.80 C ATOM 835 CG GLU A 259 17.616 73.980 2.988 1.00 81.41 C ATOM 836 CD GLU A 259 18.952 74.536 3.478 1.00 82.21 C ATOM 837 OE1 GLU A 259 19.337 75.658 3.076 1.00 82.74 O ATOM 838 OE2 GLU A 259 19.620 73.838 4.274 1.00 82.45 O ATOM 839 HA GLU A 259 15.249 73.522 1.963 1.00 0.00 H ATOM 840 HB2 GLU A 259 17.668 75.119 1.171 1.00 0.00 H ATOM 841 HB3 GLU A 259 16.560 75.755 2.409 1.00 0.00 H ATOM 842 HG2 GLU A 259 16.947 73.891 3.844 1.00 0.00 H ATOM 843 HG3 GLU A 259 17.791 72.992 2.561 1.00 0.00 H ATOM 844 H GLU A 259 17.156 73.433 -0.258 1.00 0.00 H ATOM 845 N ASP A 260 13.575 74.628 0.281 1.00 81.72 N ATOM 846 CA ASP A 260 12.396 75.416 -0.068 1.00 82.17 C ATOM 847 C ASP A 260 11.209 74.949 0.781 1.00 82.42 C ATOM 848 O ASP A 260 10.423 75.765 1.272 1.00 82.39 O ATOM 849 CB ASP A 260 12.069 75.278 -1.560 1.00 82.17 C ATOM 850 CG ASP A 260 13.192 75.775 -2.458 1.00 82.53 C ATOM 851 OD1 ASP A 260 14.349 75.333 -2.279 1.00 82.70 O ATOM 852 OD2 ASP A 260 12.915 76.604 -3.353 1.00 82.43 O ATOM 853 HA ASP A 260 12.599 76.468 0.134 1.00 0.00 H ATOM 854 HB2 ASP A 260 11.886 74.226 -1.781 1.00 0.00 H ATOM 855 HB3 ASP A 260 11.170 75.855 -1.775 1.00 0.00 H ATOM 856 H ASP A 260 13.532 73.596 0.158 1.00 0.00 H ATOM 857 N LYS A 261 11.103 73.630 0.952 1.00 82.75 N ATOM 858 CA LYS A 261 10.020 73.002 1.712 1.00 83.00 C ATOM 859 C LYS A 261 10.563 72.071 2.795 1.00 83.03 C ATOM 860 O LYS A 261 11.475 71.278 2.551 1.00 83.15 O ATOM 861 CB LYS A 261 9.076 72.235 0.775 1.00 83.10 C ATOM 862 CG LYS A 261 8.217 73.121 -0.133 1.00 83.54 C ATOM 863 CD LYS A 261 7.227 72.295 -0.948 1.00 83.78 C ATOM 864 CE LYS A 261 6.398 73.172 -1.877 1.00 83.75 C ATOM 865 NZ LYS A 261 5.469 72.359 -2.713 1.00 83.52 N ATOM 866 HA LYS A 261 9.459 73.797 2.203 1.00 0.00 H ATOM 867 HB2 LYS A 261 9.680 71.584 0.142 1.00 0.00 H ATOM 868 HB3 LYS A 261 8.409 71.628 1.387 1.00 0.00 H ATOM 869 HG2 LYS A 261 7.664 73.829 0.484 1.00 0.00 H ATOM 870 HG3 LYS A 261 8.869 73.667 -0.815 1.00 0.00 H ATOM 871 HD2 LYS A 261 7.779 71.569 -1.545 1.00 0.00 H ATOM 872 HD3 LYS A 261 6.558 71.770 -0.266 1.00 0.00 H ATOM 873 HE2 LYS A 261 7.069 73.728 -2.532 1.00 0.00 H ATOM 874 HE3 LYS A 261 5.815 73.871 -1.278 1.00 0.00 H ATOM 875 HZ1 LYS A 261 6.019 71.693 -3.292 1.00 0.00 H ATOM 876 HZ2 LYS A 261 4.821 71.830 -2.095 1.00 0.00 H ATOM 877 HZ3 LYS A 261 4.921 72.989 -3.333 1.00 0.00 H ATOM 878 H LYS A 261 11.826 73.017 0.524 1.00 0.00 H TER 879 LYS A 261 ATOM 880 N GLU A 276 26.132 77.246 8.421 1.00 59.32 N ATOM 881 CA GLU A 276 26.911 76.062 8.063 1.00 59.67 C ATOM 882 C GLU A 276 25.984 74.862 7.882 1.00 59.47 C ATOM 883 O GLU A 276 25.050 74.671 8.669 1.00 59.51 O ATOM 884 CB GLU A 276 27.956 75.774 9.145 1.00 59.83 C ATOM 885 CG GLU A 276 29.004 74.733 8.771 1.00 60.58 C ATOM 886 CD GLU A 276 29.958 74.413 9.918 1.00 61.96 C ATOM 887 OE1 GLU A 276 30.740 73.447 9.784 1.00 62.23 O ATOM 888 OE2 GLU A 276 29.932 75.120 10.952 1.00 62.34 O ATOM 889 HA GLU A 276 27.428 76.247 7.122 1.00 0.00 H ATOM 890 HB2 GLU A 276 28.472 76.707 9.373 1.00 0.00 H ATOM 891 HB3 GLU A 276 27.433 75.423 10.035 1.00 0.00 H ATOM 892 HG2 GLU A 276 28.494 73.816 8.476 1.00 0.00 H ATOM 893 HG3 GLU A 276 29.585 75.111 7.930 1.00 0.00 H ATOM 894 HN3 GLU A 276 25.623 77.069 9.311 1.00 0.00 H ATOM 895 HN2 GLU A 276 25.449 77.452 7.664 1.00 0.00 H ATOM 896 HN1 GLU A 276 26.772 78.057 8.542 1.00 0.00 H ATOM 897 N VAL A 277 26.243 74.057 6.851 1.00 59.32 N ATOM 898 CA VAL A 277 25.347 72.939 6.512 1.00 59.13 C ATOM 899 C VAL A 277 25.317 71.842 7.582 1.00 58.70 C ATOM 900 O VAL A 277 24.234 71.399 7.969 1.00 58.75 O ATOM 901 CB VAL A 277 25.608 72.333 5.093 1.00 59.02 C ATOM 902 CG1 VAL A 277 25.488 73.405 4.020 1.00 59.62 C ATOM 903 CG2 VAL A 277 26.964 71.634 5.010 1.00 59.63 C ATOM 904 HA VAL A 277 24.355 73.390 6.484 1.00 0.00 H ATOM 905 HB VAL A 277 24.843 71.577 4.918 1.00 0.00 H ATOM 906 HG11 VAL A 277 24.484 73.830 4.043 1.00 0.00 H ATOM 907 HG12 VAL A 277 26.221 74.190 4.209 1.00 0.00 H ATOM 908 HG13 VAL A 277 25.673 72.961 3.042 1.00 0.00 H ATOM 909 HG21 VAL A 277 27.755 72.352 5.225 1.00 0.00 H ATOM 910 HG22 VAL A 277 26.999 70.824 5.739 1.00 0.00 H ATOM 911 HG23 VAL A 277 27.102 71.229 4.007 1.00 0.00 H ATOM 912 H VAL A 277 27.094 74.222 6.276 1.00 0.00 H ATOM 913 N ALA A 278 26.494 71.421 8.058 1.00 58.13 N ATOM 914 CA ALA A 278 26.595 70.377 9.076 1.00 57.83 C ATOM 915 C ALA A 278 25.795 70.752 10.322 1.00 57.69 C ATOM 916 O ALA A 278 25.089 69.913 10.875 1.00 57.68 O ATOM 917 CB ALA A 278 28.045 70.095 9.429 1.00 57.77 C ATOM 918 HA ALA A 278 26.168 69.464 8.661 1.00 0.00 H ATOM 919 HB1 ALA A 278 28.577 69.765 8.537 1.00 0.00 H ATOM 920 HB2 ALA A 278 28.507 71.004 9.814 1.00 0.00 H ATOM 921 HB3 ALA A 278 28.088 69.314 10.188 1.00 0.00 H ATOM 922 H ALA A 278 27.367 71.851 7.691 1.00 0.00 H ATOM 923 N ILE A 279 25.900 72.016 10.738 1.00 57.42 N ATOM 924 CA ILE A 279 25.114 72.552 11.847 1.00 57.18 C ATOM 925 C ILE A 279 23.622 72.487 11.535 1.00 57.00 C ATOM 926 O ILE A 279 22.857 71.938 12.328 1.00 57.31 O ATOM 927 CB ILE A 279 25.532 74.009 12.221 1.00 57.36 C ATOM 928 CG1 ILE A 279 26.925 74.024 12.866 1.00 57.22 C ATOM 929 CG2 ILE A 279 24.507 74.654 13.169 1.00 57.35 C ATOM 930 CD1 ILE A 279 27.433 75.415 13.233 1.00 58.13 C ATOM 931 HA ILE A 279 25.320 71.925 12.714 1.00 0.00 H ATOM 932 HB ILE A 279 25.563 74.591 11.300 1.00 0.00 H ATOM 933 HG12 ILE A 279 26.887 73.424 13.775 1.00 0.00 H ATOM 934 HG13 ILE A 279 27.630 73.577 12.166 1.00 0.00 H ATOM 935 HD11 ILE A 279 27.491 76.028 12.334 1.00 0.00 H ATOM 936 HD12 ILE A 279 26.747 75.875 13.944 1.00 0.00 H ATOM 937 HD13 ILE A 279 28.423 75.332 13.682 1.00 0.00 H ATOM 938 HG21 ILE A 279 23.532 74.685 12.682 1.00 0.00 H ATOM 939 HG22 ILE A 279 24.439 74.065 14.084 1.00 0.00 H ATOM 940 HG23 ILE A 279 24.826 75.668 13.411 1.00 0.00 H ATOM 941 H ILE A 279 26.570 72.646 10.252 1.00 0.00 H ATOM 942 N ARG A 280 23.222 73.024 10.379 1.00 56.42 N ATOM 943 CA ARG A 280 21.813 73.042 9.968 1.00 56.06 C ATOM 944 C ARG A 280 21.187 71.653 9.923 1.00 55.32 C ATOM 945 O ARG A 280 20.040 71.478 10.334 1.00 55.23 O ATOM 946 CB ARG A 280 21.628 73.743 8.618 1.00 56.29 C ATOM 947 CG ARG A 280 21.666 75.268 8.691 1.00 57.60 C ATOM 948 CD ARG A 280 20.990 75.925 7.483 1.00 59.44 C ATOM 949 NE ARG A 280 21.359 75.290 6.213 1.00 61.47 N ATOM 950 CZ ARG A 280 22.392 75.646 5.454 1.00 62.41 C ATOM 951 NH1 ARG A 280 23.184 76.648 5.818 1.00 63.83 N ATOM 952 NH2 ARG A 280 22.636 74.998 4.323 1.00 62.92 N ATOM 953 HA ARG A 280 21.290 73.611 10.737 1.00 0.00 H ATOM 954 HB2 ARG A 280 22.424 73.413 7.950 1.00 0.00 H ATOM 955 HB3 ARG A 280 20.663 73.445 8.207 1.00 0.00 H ATOM 956 HG2 ARG A 280 21.153 75.589 9.598 1.00 0.00 H ATOM 957 HG3 ARG A 280 22.706 75.592 8.730 1.00 0.00 H ATOM 958 HD2 ARG A 280 21.283 76.974 7.447 1.00 0.00 H ATOM 959 HD3 ARG A 280 19.909 75.855 7.607 1.00 0.00 H ATOM 960 HE ARG A 280 20.768 74.501 5.881 1.00 0.00 H ATOM 961 HH12 ARG A 280 23.989 76.919 5.218 1.00 0.00 H ATOM 962 HH11 ARG A 280 22.999 77.162 6.703 1.00 0.00 H ATOM 963 HH22 ARG A 280 23.443 75.275 3.729 1.00 0.00 H ATOM 964 HH21 ARG A 280 22.020 74.213 4.030 1.00 0.00 H ATOM 965 H ARG A 280 23.934 73.444 9.748 1.00 0.00 H ATOM 966 N ILE A 281 21.941 70.680 9.416 1.00 54.35 N ATOM 967 CA ILE A 281 21.526 69.280 9.435 1.00 53.65 C ATOM 968 C ILE A 281 21.359 68.804 10.884 1.00 53.39 C ATOM 969 O ILE A 281 20.372 68.139 11.216 1.00 53.29 O ATOM 970 CB ILE A 281 22.527 68.378 8.651 1.00 53.69 C ATOM 971 CG1 ILE A 281 22.408 68.636 7.143 1.00 53.78 C ATOM 972 CG2 ILE A 281 22.321 66.891 8.962 1.00 53.24 C ATOM 973 CD1 ILE A 281 23.562 68.092 6.328 1.00 53.31 C ATOM 974 HA ILE A 281 20.563 69.198 8.930 1.00 0.00 H ATOM 975 HB ILE A 281 23.533 68.641 8.977 1.00 0.00 H ATOM 976 HG12 ILE A 281 21.489 68.171 6.788 1.00 0.00 H ATOM 977 HG13 ILE A 281 22.354 69.713 6.983 1.00 0.00 H ATOM 978 HD11 ILE A 281 24.491 68.556 6.660 1.00 0.00 H ATOM 979 HD12 ILE A 281 23.625 67.012 6.465 1.00 0.00 H ATOM 980 HD13 ILE A 281 23.399 68.317 5.274 1.00 0.00 H ATOM 981 HG21 ILE A 281 22.470 66.720 10.028 1.00 0.00 H ATOM 982 HG22 ILE A 281 21.308 66.600 8.684 1.00 0.00 H ATOM 983 HG23 ILE A 281 23.039 66.299 8.394 1.00 0.00 H ATOM 984 H ILE A 281 22.858 70.926 8.991 1.00 0.00 H ATOM 985 N PHE A 282 22.317 69.176 11.737 1.00 52.93 N ATOM 986 CA PHE A 282 22.327 68.786 13.150 1.00 52.42 C ATOM 987 C PHE A 282 21.129 69.348 13.917 1.00 51.85 C ATOM 988 O PHE A 282 20.566 68.664 14.772 1.00 51.88 O ATOM 989 CB PHE A 282 23.643 69.214 13.818 1.00 52.33 C ATOM 990 CG PHE A 282 23.823 68.685 15.219 1.00 52.39 C ATOM 991 CD1 PHE A 282 24.195 67.361 15.437 1.00 51.76 C ATOM 992 CD2 PHE A 282 23.636 69.518 16.321 1.00 53.04 C ATOM 993 CE1 PHE A 282 24.372 66.873 16.727 1.00 52.29 C ATOM 994 CE2 PHE A 282 23.810 69.036 17.622 1.00 52.52 C ATOM 995 CZ PHE A 282 24.183 67.714 17.823 1.00 52.51 C ATOM 996 HA PHE A 282 22.248 67.699 13.183 1.00 0.00 H ATOM 997 HB2 PHE A 282 24.470 68.854 13.207 1.00 0.00 H ATOM 998 HB3 PHE A 282 23.669 70.303 13.857 1.00 0.00 H ATOM 999 HD2 PHE A 282 23.350 70.559 16.167 1.00 0.00 H ATOM 1000 HE2 PHE A 282 23.653 69.696 18.475 1.00 0.00 H ATOM 1001 HZ PHE A 282 24.328 67.335 18.835 1.00 0.00 H ATOM 1002 HE1 PHE A 282 24.659 65.833 16.881 1.00 0.00 H ATOM 1003 HD1 PHE A 282 24.349 66.698 14.585 1.00 0.00 H ATOM 1004 H PHE A 282 23.093 69.771 11.382 1.00 0.00 H ATOM 1005 N GLN A 283 20.753 70.586 13.608 1.00 51.24 N ATOM 1006 CA GLN A 283 19.599 71.228 14.227 1.00 51.04 C ATOM 1007 C GLN A 283 18.298 70.618 13.707 1.00 50.47 C ATOM 1008 O GLN A 283 17.323 70.495 14.451 1.00 50.45 O ATOM 1009 CB GLN A 283 19.607 72.740 13.975 1.00 51.38 C ATOM 1010 CG GLN A 283 20.899 73.458 14.350 1.00 53.15 C ATOM 1011 CD GLN A 283 21.050 73.684 15.845 1.00 55.40 C ATOM 1012 OE1 GLN A 283 20.987 72.745 16.643 1.00 56.35 O ATOM 1013 NE2 GLN A 283 21.276 74.936 16.229 1.00 55.60 N ATOM 1014 HA GLN A 283 19.663 71.058 15.302 1.00 0.00 H ATOM 1015 HB2 GLN A 283 19.426 72.905 12.913 1.00 0.00 H ATOM 1016 HB3 GLN A 283 18.796 73.182 14.554 1.00 0.00 H ATOM 1017 HG2 GLN A 283 21.741 72.859 14.004 1.00 0.00 H ATOM 1018 HG3 GLN A 283 20.914 74.427 13.850 1.00 0.00 H ATOM 1019 HE22 GLN A 283 21.321 75.697 15.521 1.00 0.00 H ATOM 1020 HE21 GLN A 283 21.408 75.155 17.237 1.00 0.00 H ATOM 1021 H GLN A 283 21.301 71.115 12.900 1.00 0.00 H ATOM 1022 N GLY A 284 18.293 70.255 12.426 1.00 49.76 N ATOM 1023 CA GLY A 284 17.180 69.529 11.813 1.00 49.15 C ATOM 1024 C GLY A 284 16.898 68.196 12.493 1.00 48.62 C ATOM 1025 O GLY A 284 15.739 67.825 12.662 1.00 48.45 O ATOM 1026 HA3 GLY A 284 17.420 69.342 10.766 1.00 0.00 H ATOM 1027 HA2 GLY A 284 16.285 70.148 11.874 1.00 0.00 H ATOM 1028 H GLY A 284 19.115 70.498 11.836 1.00 0.00 H ATOM 1029 N CYS A 285 17.956 67.481 12.880 1.00 48.08 N ATOM 1030 CA CYS A 285 17.819 66.261 13.678 1.00 47.85 C ATOM 1031 C CYS A 285 17.256 66.561 15.069 1.00 47.59 C ATOM 1032 O CYS A 285 16.428 65.804 15.575 1.00 47.48 O ATOM 1033 CB CYS A 285 19.152 65.522 13.799 1.00 47.67 C ATOM 1034 SG CYS A 285 19.845 64.978 12.225 1.00 48.85 S ATOM 1035 HA CYS A 285 17.113 65.616 13.155 1.00 0.00 H ATOM 1036 HB2 CYS A 285 19.000 64.644 14.427 1.00 0.00 H ATOM 1037 HB3 CYS A 285 19.870 66.189 14.276 1.00 0.00 H ATOM 1038 HG CYS A 285 20.063 66.075 11.416 1.00 0.00 H ATOM 1039 H CYS A 285 18.907 67.800 12.606 1.00 0.00 H ATOM 1040 N GLN A 286 17.701 67.670 15.669 1.00 47.48 N ATOM 1041 CA GLN A 286 17.238 68.095 16.996 1.00 47.41 C ATOM 1042 C GLN A 286 15.736 68.343 17.011 1.00 46.97 C ATOM 1043 O GLN A 286 15.030 67.789 17.862 1.00 47.09 O ATOM 1044 CB GLN A 286 17.971 69.353 17.474 1.00 47.68 C ATOM 1045 CG GLN A 286 19.409 69.123 17.920 1.00 49.58 C ATOM 1046 CD GLN A 286 19.896 70.187 18.893 1.00 51.65 C ATOM 1047 OE1 GLN A 286 19.257 70.458 19.914 1.00 52.12 O ATOM 1048 NE2 GLN A 286 21.040 70.787 18.588 1.00 53.54 N ATOM 1049 HA GLN A 286 17.465 67.278 17.681 1.00 0.00 H ATOM 1050 HB2 GLN A 286 17.980 70.072 16.655 1.00 0.00 H ATOM 1051 HB3 GLN A 286 17.417 69.770 18.315 1.00 0.00 H ATOM 1052 HG2 GLN A 286 19.473 68.149 18.406 1.00 0.00 H ATOM 1053 HG3 GLN A 286 20.053 69.132 17.041 1.00 0.00 H ATOM 1054 HE22 GLN A 286 21.547 70.529 17.717 1.00 0.00 H ATOM 1055 HE21 GLN A 286 21.430 71.516 19.220 1.00 0.00 H ATOM 1056 H GLN A 286 18.404 68.256 15.175 1.00 0.00 H ATOM 1057 N PHE A 287 15.253 69.159 16.066 1.00 46.30 N ATOM 1058 CA PHE A 287 13.818 69.455 15.950 1.00 45.85 C ATOM 1059 C PHE A 287 13.010 68.192 15.702 1.00 45.13 C ATOM 1060 O PHE A 287 11.945 68.008 16.295 1.00 45.22 O ATOM 1061 CB PHE A 287 13.523 70.518 14.870 1.00 46.10 C ATOM 1062 CG PHE A 287 12.050 70.812 14.684 1.00 46.65 C ATOM 1063 CD1 PHE A 287 11.392 71.698 15.522 1.00 47.51 C ATOM 1064 CD2 PHE A 287 11.325 70.197 13.673 1.00 47.17 C ATOM 1065 CE1 PHE A 287 10.040 71.964 15.355 1.00 47.60 C ATOM 1066 CE2 PHE A 287 9.976 70.457 13.506 1.00 47.18 C ATOM 1067 CZ PHE A 287 9.334 71.340 14.346 1.00 47.08 C ATOM 1068 HA PHE A 287 13.508 69.875 16.907 1.00 0.00 H ATOM 1069 HB2 PHE A 287 14.025 71.443 15.153 1.00 0.00 H ATOM 1070 HB3 PHE A 287 13.925 70.164 13.921 1.00 0.00 H ATOM 1071 HD2 PHE A 287 11.825 69.499 13.001 1.00 0.00 H ATOM 1072 HE2 PHE A 287 9.421 69.962 12.709 1.00 0.00 H ATOM 1073 HZ PHE A 287 8.272 71.545 14.214 1.00 0.00 H ATOM 1074 HE1 PHE A 287 9.536 72.665 16.020 1.00 0.00 H ATOM 1075 HD1 PHE A 287 11.943 72.192 16.322 1.00 0.00 H ATOM 1076 H PHE A 287 15.914 69.597 15.393 1.00 0.00 H ATOM 1077 N ARG A 288 13.532 67.321 14.842 1.00 44.39 N ATOM 1078 CA ARG A 288 12.876 66.059 14.523 1.00 43.65 C ATOM 1079 C ARG A 288 12.826 65.119 15.741 1.00 42.90 C ATOM 1080 O ARG A 288 11.838 64.416 15.952 1.00 42.47 O ATOM 1081 CB ARG A 288 13.545 65.388 13.309 1.00 43.58 C ATOM 1082 CG ARG A 288 13.023 63.985 12.974 1.00 44.44 C ATOM 1083 CD ARG A 288 11.578 64.009 12.450 1.00 46.11 C ATOM 1084 NE ARG A 288 10.889 62.759 12.767 1.00 48.09 N ATOM 1085 CZ ARG A 288 9.823 62.654 13.558 1.00 48.83 C ATOM 1086 NH1 ARG A 288 9.274 63.725 14.107 1.00 49.79 N ATOM 1087 NH2 ARG A 288 9.287 61.465 13.786 1.00 50.19 N ATOM 1088 HA ARG A 288 11.843 66.278 14.254 1.00 0.00 H ATOM 1089 HB2 ARG A 288 13.385 66.025 12.439 1.00 0.00 H ATOM 1090 HB3 ARG A 288 14.614 65.312 13.510 1.00 0.00 H ATOM 1091 HG2 ARG A 288 13.665 63.545 12.211 1.00 0.00 H ATOM 1092 HG3 ARG A 288 13.059 63.373 13.875 1.00 0.00 H ATOM 1093 HD2 ARG A 288 11.592 64.145 11.369 1.00 0.00 H ATOM 1094 HD3 ARG A 288 11.044 64.839 12.912 1.00 0.00 H ATOM 1095 HE ARG A 288 11.260 61.885 12.342 1.00 0.00 H ATOM 1096 HH12 ARG A 288 8.442 63.625 14.722 1.00 0.00 H ATOM 1097 HH11 ARG A 288 9.675 64.667 13.923 1.00 0.00 H ATOM 1098 HH22 ARG A 288 8.454 61.380 14.403 1.00 0.00 H ATOM 1099 HH21 ARG A 288 9.699 60.616 13.348 1.00 0.00 H ATOM 1100 H ARG A 288 14.437 67.548 14.383 1.00 0.00 H ATOM 1101 N SER A 289 13.893 65.122 16.536 1.00 42.14 N ATOM 1102 CA SER A 289 13.962 64.302 17.746 1.00 41.66 C ATOM 1103 C SER A 289 12.966 64.813 18.790 1.00 41.14 C ATOM 1104 O SER A 289 12.276 64.026 19.441 1.00 40.80 O ATOM 1105 CB SER A 289 15.383 64.316 18.311 1.00 41.68 C ATOM 1106 OG SER A 289 15.540 63.366 19.348 1.00 42.14 O ATOM 1107 HA SER A 289 13.699 63.275 17.491 1.00 0.00 H ATOM 1108 HB2 SER A 289 15.598 65.309 18.705 1.00 0.00 H ATOM 1109 HB3 SER A 289 16.085 64.085 17.510 1.00 0.00 H ATOM 1110 HG SER A 289 16.469 63.402 19.689 1.00 0.00 H ATOM 1111 H SER A 289 14.703 65.726 16.290 1.00 0.00 H ATOM 1112 N VAL A 290 12.895 66.138 18.918 1.00 40.52 N ATOM 1113 CA VAL A 290 11.958 66.809 19.818 1.00 39.94 C ATOM 1114 C VAL A 290 10.523 66.488 19.425 1.00 39.80 C ATOM 1115 O VAL A 290 9.704 66.131 20.279 1.00 39.39 O ATOM 1116 CB VAL A 290 12.193 68.334 19.812 1.00 40.07 C ATOM 1117 CG1 VAL A 290 11.018 69.090 20.435 1.00 39.24 C ATOM 1118 CG2 VAL A 290 13.499 68.660 20.534 1.00 39.65 C ATOM 1119 HA VAL A 290 12.131 66.442 20.830 1.00 0.00 H ATOM 1120 HB VAL A 290 12.270 68.663 18.776 1.00 0.00 H ATOM 1121 HG11 VAL A 290 10.111 68.880 19.868 1.00 0.00 H ATOM 1122 HG12 VAL A 290 10.886 68.767 21.468 1.00 0.00 H ATOM 1123 HG13 VAL A 290 11.223 70.160 20.411 1.00 0.00 H ATOM 1124 HG21 VAL A 290 13.441 68.308 21.564 1.00 0.00 H ATOM 1125 HG22 VAL A 290 14.327 68.165 20.026 1.00 0.00 H ATOM 1126 HG23 VAL A 290 13.658 69.738 20.526 1.00 0.00 H ATOM 1127 H VAL A 290 13.539 66.724 18.349 1.00 0.00 H ATOM 1128 N GLU A 291 10.237 66.610 18.129 1.00 39.56 N ATOM 1129 CA GLU A 291 8.938 66.247 17.569 1.00 39.59 C ATOM 1130 C GLU A 291 8.628 64.782 17.866 1.00 38.61 C ATOM 1131 O GLU A 291 7.496 64.450 18.222 1.00 38.58 O ATOM 1132 CB GLU A 291 8.895 66.524 16.058 1.00 39.92 C ATOM 1133 CG GLU A 291 7.497 66.427 15.442 1.00 43.50 C ATOM 1134 CD GLU A 291 7.418 66.964 14.002 1.00 47.68 C ATOM 1135 OE1 GLU A 291 8.177 66.482 13.119 1.00 47.48 O ATOM 1136 OE2 GLU A 291 6.576 67.865 13.761 1.00 48.70 O ATOM 1137 HA GLU A 291 8.173 66.864 18.040 1.00 0.00 H ATOM 1138 HB2 GLU A 291 9.277 67.530 15.884 1.00 0.00 H ATOM 1139 HB3 GLU A 291 9.540 65.801 15.559 1.00 0.00 H ATOM 1140 HG2 GLU A 291 7.195 65.380 15.436 1.00 0.00 H ATOM 1141 HG3 GLU A 291 6.807 67.000 16.062 1.00 0.00 H ATOM 1142 H GLU A 291 10.970 66.979 17.490 1.00 0.00 H ATOM 1143 N ALA A 292 9.641 63.922 17.742 1.00 37.51 N ATOM 1144 CA ALA A 292 9.489 62.494 18.015 1.00 37.08 C ATOM 1145 C ALA A 292 9.197 62.218 19.490 1.00 36.76 C ATOM 1146 O ALA A 292 8.357 61.382 19.814 1.00 36.84 O ATOM 1147 CB ALA A 292 10.724 61.714 17.550 1.00 36.76 C ATOM 1148 HA ALA A 292 8.626 62.149 17.445 1.00 0.00 H ATOM 1149 HB1 ALA A 292 10.858 61.854 16.477 1.00 0.00 H ATOM 1150 HB2 ALA A 292 11.604 62.081 18.078 1.00 0.00 H ATOM 1151 HB3 ALA A 292 10.585 60.654 17.765 1.00 0.00 H ATOM 1152 H ALA A 292 10.570 64.280 17.441 1.00 0.00 H ATOM 1153 N VAL A 293 9.880 62.927 20.380 1.00 36.47 N ATOM 1154 CA VAL A 293 9.625 62.781 21.815 1.00 36.85 C ATOM 1155 C VAL A 293 8.150 63.066 22.125 1.00 36.36 C ATOM 1156 O VAL A 293 7.496 62.308 22.851 1.00 35.60 O ATOM 1157 CB VAL A 293 10.569 63.678 22.673 1.00 37.12 C ATOM 1158 CG1 VAL A 293 10.151 63.668 24.133 1.00 37.45 C ATOM 1159 CG2 VAL A 293 12.017 63.212 22.535 1.00 37.19 C ATOM 1160 HA VAL A 293 9.844 61.749 22.088 1.00 0.00 H ATOM 1161 HB VAL A 293 10.491 64.700 22.303 1.00 0.00 H ATOM 1162 HG11 VAL A 293 9.133 64.047 24.221 1.00 0.00 H ATOM 1163 HG12 VAL A 293 10.195 62.648 24.515 1.00 0.00 H ATOM 1164 HG13 VAL A 293 10.827 64.302 24.707 1.00 0.00 H ATOM 1165 HG21 VAL A 293 12.099 62.180 22.877 1.00 0.00 H ATOM 1166 HG22 VAL A 293 12.320 63.275 21.490 1.00 0.00 H ATOM 1167 HG23 VAL A 293 12.662 63.849 23.140 1.00 0.00 H ATOM 1168 H VAL A 293 10.607 63.596 20.054 1.00 0.00 H ATOM 1169 N GLN A 294 7.628 64.145 21.539 1.00 36.36 N ATOM 1170 CA GLN A 294 6.222 64.521 21.710 1.00 36.24 C ATOM 1171 C GLN A 294 5.260 63.421 21.264 1.00 35.69 C ATOM 1172 O GLN A 294 4.311 63.113 21.980 1.00 36.05 O ATOM 1173 CB GLN A 294 5.925 65.853 21.005 1.00 36.74 C ATOM 1174 CG GLN A 294 6.722 67.017 21.603 1.00 38.87 C ATOM 1175 CD GLN A 294 6.598 68.306 20.811 1.00 43.30 C ATOM 1176 OE1 GLN A 294 6.862 68.339 19.602 1.00 45.59 O ATOM 1177 NE2 GLN A 294 6.205 69.384 21.494 1.00 44.21 N ATOM 1178 HA GLN A 294 6.054 64.656 22.779 1.00 0.00 H ATOM 1179 HB2 GLN A 294 6.182 65.757 19.950 1.00 0.00 H ATOM 1180 HB3 GLN A 294 4.861 66.071 21.100 1.00 0.00 H ATOM 1181 HG2 GLN A 294 6.362 67.198 22.616 1.00 0.00 H ATOM 1182 HG3 GLN A 294 7.774 66.733 21.638 1.00 0.00 H ATOM 1183 HE22 GLN A 294 5.994 69.308 22.510 1.00 0.00 H ATOM 1184 HE21 GLN A 294 6.110 70.300 21.010 1.00 0.00 H ATOM 1185 H GLN A 294 8.239 64.738 20.942 1.00 0.00 H ATOM 1186 N GLU A 295 5.517 62.818 20.102 1.00 34.92 N ATOM 1187 CA GLU A 295 4.650 61.756 19.567 1.00 34.57 C ATOM 1188 C GLU A 295 4.715 60.499 20.428 1.00 33.72 C ATOM 1189 O GLU A 295 3.677 59.904 20.739 1.00 33.11 O ATOM 1190 CB GLU A 295 4.994 61.428 18.103 1.00 34.72 C ATOM 1191 CG GLU A 295 4.735 62.579 17.133 1.00 36.70 C ATOM 1192 CD GLU A 295 5.583 62.521 15.855 1.00 39.67 C ATOM 1193 OE1 GLU A 295 6.319 61.535 15.625 1.00 40.67 O ATOM 1194 OE2 GLU A 295 5.505 63.484 15.070 1.00 41.08 O ATOM 1195 HA GLU A 295 3.628 62.133 19.594 1.00 0.00 H ATOM 1196 HB2 GLU A 295 6.050 61.165 18.049 1.00 0.00 H ATOM 1197 HB3 GLU A 295 4.392 60.574 17.792 1.00 0.00 H ATOM 1198 HG2 GLU A 295 3.683 62.557 16.848 1.00 0.00 H ATOM 1199 HG3 GLU A 295 4.952 63.516 17.646 1.00 0.00 H ATOM 1200 H GLU A 295 6.355 63.107 19.558 1.00 0.00 H ATOM 1201 N ILE A 296 5.932 60.114 20.821 1.00 32.95 N ATOM 1202 CA ILE A 296 6.131 58.993 21.743 1.00 32.49 C ATOM 1203 C ILE A 296 5.390 59.234 23.065 1.00 32.11 C ATOM 1204 O ILE A 296 4.718 58.334 23.571 1.00 31.73 O ATOM 1205 CB ILE A 296 7.641 58.694 21.986 1.00 32.63 C ATOM 1206 CG1 ILE A 296 8.298 58.178 20.700 1.00 31.92 C ATOM 1207 CG2 ILE A 296 7.821 57.664 23.106 1.00 32.87 C ATOM 1208 CD1 ILE A 296 9.811 58.499 20.587 1.00 31.88 C ATOM 1209 HA ILE A 296 5.706 58.107 21.272 1.00 0.00 H ATOM 1210 HB ILE A 296 8.123 59.624 22.286 1.00 0.00 H ATOM 1211 HG12 ILE A 296 8.174 57.096 20.663 1.00 0.00 H ATOM 1212 HG13 ILE A 296 7.788 58.630 19.850 1.00 0.00 H ATOM 1213 HD11 ILE A 296 9.955 59.579 20.609 1.00 0.00 H ATOM 1214 HD12 ILE A 296 10.341 58.043 21.423 1.00 0.00 H ATOM 1215 HD13 ILE A 296 10.197 58.099 19.649 1.00 0.00 H ATOM 1216 HG21 ILE A 296 7.387 58.052 24.028 1.00 0.00 H ATOM 1217 HG22 ILE A 296 7.320 56.737 22.829 1.00 0.00 H ATOM 1218 HG23 ILE A 296 8.884 57.473 23.255 1.00 0.00 H ATOM 1219 H ILE A 296 6.763 60.625 20.462 1.00 0.00 H ATOM 1220 N THR A 297 5.496 60.447 23.607 1.00 32.30 N ATOM 1221 CA THR A 297 4.771 60.804 24.842 1.00 33.47 C ATOM 1222 C THR A 297 3.254 60.626 24.687 1.00 33.36 C ATOM 1223 O THR A 297 2.613 60.022 25.547 1.00 32.79 O ATOM 1224 CB THR A 297 5.101 62.224 25.344 1.00 33.48 C ATOM 1225 OG1 THR A 297 6.503 62.320 25.624 1.00 34.65 O ATOM 1226 CG2 THR A 297 4.348 62.526 26.631 1.00 35.11 C ATOM 1227 HA THR A 297 5.122 60.105 25.601 1.00 0.00 H ATOM 1228 HB THR A 297 4.809 62.933 24.569 1.00 0.00 H ATOM 1229 HG1 THR A 297 7.017 62.134 24.798 1.00 0.00 H ATOM 1230 HG23 THR A 297 3.276 62.460 26.447 1.00 0.00 H ATOM 1231 HG21 THR A 297 4.632 61.802 27.395 1.00 0.00 H ATOM 1232 HG22 THR A 297 4.599 63.531 26.970 1.00 0.00 H ATOM 1233 H THR A 297 6.103 61.157 23.150 1.00 0.00 H ATOM 1234 N GLU A 298 2.695 61.106 23.573 1.00 33.86 N ATOM 1235 CA GLU A 298 1.264 60.880 23.284 1.00 34.39 C ATOM 1236 C GLU A 298 0.917 59.408 23.209 1.00 33.88 C ATOM 1237 O GLU A 298 -0.128 58.980 23.703 1.00 34.16 O ATOM 1238 CB GLU A 298 0.832 61.557 21.981 1.00 34.66 C ATOM 1239 CG GLU A 298 0.600 63.055 22.127 1.00 35.22 C ATOM 1240 CD GLU A 298 -0.691 63.385 22.863 1.00 36.18 C ATOM 1241 OE1 GLU A 298 -1.772 63.001 22.363 1.00 37.28 O ATOM 1242 OE2 GLU A 298 -0.626 64.030 23.934 1.00 36.73 O ATOM 1243 HA GLU A 298 0.723 61.326 24.119 1.00 0.00 H ATOM 1244 HB2 GLU A 298 1.610 61.399 21.234 1.00 0.00 H ATOM 1245 HB3 GLU A 298 -0.095 61.095 21.642 1.00 0.00 H ATOM 1246 HG2 GLU A 298 1.436 63.484 22.680 1.00 0.00 H ATOM 1247 HG3 GLU A 298 0.557 63.499 21.133 1.00 0.00 H ATOM 1248 H GLU A 298 3.275 61.646 22.900 1.00 0.00 H ATOM 1249 N TYR A 299 1.789 58.638 22.568 1.00 33.72 N ATOM 1250 CA TYR A 299 1.564 57.213 22.398 1.00 32.87 C ATOM 1251 C TYR A 299 1.605 56.487 23.740 1.00 32.91 C ATOM 1252 O TYR A 299 0.750 55.653 24.011 1.00 32.98 O ATOM 1253 CB TYR A 299 2.587 56.609 21.432 1.00 32.62 C ATOM 1254 CG TYR A 299 2.452 55.117 21.313 1.00 32.13 C ATOM 1255 CD1 TYR A 299 3.438 54.267 21.813 1.00 31.25 C ATOM 1256 CD2 TYR A 299 1.309 54.549 20.745 1.00 31.68 C ATOM 1257 CE1 TYR A 299 3.309 52.878 21.714 1.00 30.81 C ATOM 1258 CE2 TYR A 299 1.167 53.169 20.647 1.00 32.76 C ATOM 1259 CZ TYR A 299 2.177 52.339 21.126 1.00 31.77 C ATOM 1260 OH TYR A 299 2.022 50.970 21.035 1.00 32.51 O ATOM 1261 HA TYR A 299 0.570 57.083 21.971 1.00 0.00 H ATOM 1262 HB3 TYR A 299 3.589 56.842 21.792 1.00 0.00 H ATOM 1263 HB2 TYR A 299 2.444 57.053 20.447 1.00 0.00 H ATOM 1264 HD2 TYR A 299 0.516 55.198 20.373 1.00 0.00 H ATOM 1265 HE2 TYR A 299 0.271 52.740 20.198 1.00 0.00 H ATOM 1266 HE1 TYR A 299 4.093 52.225 22.097 1.00 0.00 H ATOM 1267 HD1 TYR A 299 4.322 54.692 22.288 1.00 0.00 H ATOM 1268 HH TYR A 299 2.819 50.523 21.415 1.00 0.00 H ATOM 1269 H TYR A 299 2.653 59.065 22.179 1.00 0.00 H ATOM 1270 N ALA A 300 2.601 56.813 24.562 1.00 32.87 N ATOM 1271 CA ALA A 300 2.775 56.200 25.878 1.00 33.56 C ATOM 1272 C ALA A 300 1.495 56.230 26.727 1.00 34.28 C ATOM 1273 O ALA A 300 1.058 55.194 27.243 1.00 34.03 O ATOM 1274 CB ALA A 300 3.930 56.862 26.626 1.00 33.24 C ATOM 1275 HA ALA A 300 3.011 55.150 25.706 1.00 0.00 H ATOM 1276 HB1 ALA A 300 4.849 56.741 26.053 1.00 0.00 H ATOM 1277 HB2 ALA A 300 3.718 57.923 26.754 1.00 0.00 H ATOM 1278 HB3 ALA A 300 4.045 56.393 27.603 1.00 0.00 H ATOM 1279 H ALA A 300 3.284 57.534 24.255 1.00 0.00 H ATOM 1280 N LYS A 301 0.882 57.411 26.828 1.00 34.84 N ATOM 1281 CA LYS A 301 -0.353 57.589 27.595 1.00 35.31 C ATOM 1282 C LYS A 301 -1.459 56.614 27.191 1.00 35.36 C ATOM 1283 O LYS A 301 -2.333 56.298 27.997 1.00 35.67 O ATOM 1284 CB LYS A 301 -0.838 59.040 27.507 1.00 35.66 C ATOM 1285 CG LYS A 301 0.181 60.050 28.028 1.00 36.57 C ATOM 1286 CD LYS A 301 -0.415 61.441 28.212 1.00 39.10 C ATOM 1287 CE LYS A 301 -0.328 62.260 26.934 1.00 41.06 C ATOM 1288 NZ LYS A 301 -0.881 63.631 27.135 1.00 41.77 N ATOM 1289 HA LYS A 301 -0.111 57.359 28.633 1.00 0.00 H ATOM 1290 HB2 LYS A 301 -1.052 59.271 26.463 1.00 0.00 H ATOM 1291 HB3 LYS A 301 -1.752 59.136 28.094 1.00 0.00 H ATOM 1292 HG2 LYS A 301 0.559 59.701 28.989 1.00 0.00 H ATOM 1293 HG3 LYS A 301 1.005 60.114 27.317 1.00 0.00 H ATOM 1294 HD2 LYS A 301 -1.462 61.343 28.499 1.00 0.00 H ATOM 1295 HD3 LYS A 301 0.130 61.958 29.002 1.00 0.00 H ATOM 1296 HE2 LYS A 301 -0.896 61.758 26.150 1.00 0.00 H ATOM 1297 HE3 LYS A 301 0.716 62.338 26.631 1.00 0.00 H ATOM 1298 HZ1 LYS A 301 -1.879 63.563 27.419 1.00 0.00 H ATOM 1299 HZ2 LYS A 301 -0.340 64.116 27.879 1.00 0.00 H ATOM 1300 HZ3 LYS A 301 -0.808 64.167 26.246 1.00 0.00 H ATOM 1301 H LYS A 301 1.296 58.234 26.345 1.00 0.00 H ATOM 1302 N SER A 302 -1.401 56.107 25.962 1.00 35.00 N ATOM 1303 CA SER A 302 -2.383 55.131 25.500 1.00 34.96 C ATOM 1304 C SER A 302 -2.100 53.706 25.986 1.00 34.84 C ATOM 1305 O SER A 302 -2.965 52.832 25.902 1.00 34.85 O ATOM 1306 CB SER A 302 -2.447 55.138 23.975 1.00 35.44 C ATOM 1307 OG SER A 302 -1.427 54.313 23.419 1.00 36.73 O ATOM 1308 HA SER A 302 -3.339 55.432 25.928 1.00 0.00 H ATOM 1309 HB2 SER A 302 -2.315 56.159 23.617 1.00 0.00 H ATOM 1310 HB3 SER A 302 -3.421 54.765 23.657 1.00 0.00 H ATOM 1311 HG SER A 302 -0.540 54.650 23.702 1.00 0.00 H ATOM 1312 H SER A 302 -0.642 56.412 25.319 1.00 0.00 H ATOM 1313 N ILE A 303 -0.885 53.458 26.465 1.00 34.78 N ATOM 1314 CA ILE A 303 -0.519 52.125 26.939 1.00 34.75 C ATOM 1315 C ILE A 303 -1.294 51.849 28.227 1.00 34.63 C ATOM 1316 O ILE A 303 -1.115 52.564 29.208 1.00 34.98 O ATOM 1317 CB ILE A 303 1.017 52.004 27.163 1.00 34.79 C ATOM 1318 CG1 ILE A 303 1.763 52.261 25.842 1.00 34.19 C ATOM 1319 CG2 ILE A 303 1.369 50.634 27.766 1.00 35.18 C ATOM 1320 CD1 ILE A 303 3.259 52.496 25.980 1.00 33.76 C ATOM 1321 HA ILE A 303 -0.779 51.381 26.186 1.00 0.00 H ATOM 1322 HB ILE A 303 1.337 52.762 27.878 1.00 0.00 H ATOM 1323 HG12 ILE A 303 1.615 51.395 25.197 1.00 0.00 H ATOM 1324 HG13 ILE A 303 1.325 53.142 25.372 1.00 0.00 H ATOM 1325 HD11 ILE A 303 3.432 53.368 26.610 1.00 0.00 H ATOM 1326 HD12 ILE A 303 3.723 51.620 26.434 1.00 0.00 H ATOM 1327 HD13 ILE A 303 3.691 52.667 24.994 1.00 0.00 H ATOM 1328 HG21 ILE A 303 0.861 50.519 28.724 1.00 0.00 H ATOM 1329 HG22 ILE A 303 1.047 49.846 27.086 1.00 0.00 H ATOM 1330 HG23 ILE A 303 2.447 50.570 27.915 1.00 0.00 H ATOM 1331 H ILE A 303 -0.184 54.225 26.503 1.00 0.00 H ATOM 1332 N PRO A 304 -2.176 50.836 28.221 1.00 34.38 N ATOM 1333 CA PRO A 304 -3.029 50.589 29.381 1.00 34.57 C ATOM 1334 C PRO A 304 -2.224 50.407 30.672 1.00 34.69 C ATOM 1335 O PRO A 304 -1.329 49.559 30.740 1.00 34.94 O ATOM 1336 CB PRO A 304 -3.756 49.293 29.011 1.00 34.56 C ATOM 1337 CG PRO A 304 -3.745 49.288 27.516 1.00 34.71 C ATOM 1338 CD PRO A 304 -2.398 49.833 27.168 1.00 34.40 C ATOM 1339 HA PRO A 304 -3.697 51.426 29.584 1.00 0.00 H ATOM 1340 HD3 PRO A 304 -1.637 49.053 27.200 1.00 0.00 H ATOM 1341 HD2 PRO A 304 -2.403 50.294 26.180 1.00 0.00 H ATOM 1342 HG3 PRO A 304 -4.536 49.924 27.119 1.00 0.00 H ATOM 1343 HG2 PRO A 304 -3.866 48.276 27.130 1.00 0.00 H ATOM 1344 HB2 PRO A 304 -3.227 48.425 29.406 1.00 0.00 H ATOM 1345 HB3 PRO A 304 -4.777 49.299 29.392 1.00 0.00 H ATOM 1346 N GLY A 305 -2.548 51.224 31.668 1.00 34.49 N ATOM 1347 CA GLY A 305 -1.891 51.198 32.965 1.00 33.96 C ATOM 1348 C GLY A 305 -0.767 52.208 33.113 1.00 33.59 C ATOM 1349 O GLY A 305 -0.329 52.473 34.229 1.00 34.14 O ATOM 1350 HA3 GLY A 305 -1.478 50.201 33.120 1.00 0.00 H ATOM 1351 HA2 GLY A 305 -2.638 51.403 33.731 1.00 0.00 H ATOM 1352 H GLY A 305 -3.309 51.916 31.513 1.00 0.00 H ATOM 1353 N PHE A 306 -0.287 52.772 32.007 1.00 32.81 N ATOM 1354 CA PHE A 306 0.857 53.687 32.068 1.00 32.38 C ATOM 1355 C PHE A 306 0.601 55.000 32.827 1.00 32.71 C ATOM 1356 O PHE A 306 1.467 55.448 33.584 1.00 32.87 O ATOM 1357 CB PHE A 306 1.394 54.022 30.673 1.00 31.96 C ATOM 1358 CG PHE A 306 2.544 55.009 30.691 1.00 30.94 C ATOM 1359 CD1 PHE A 306 3.858 54.569 30.824 1.00 30.07 C ATOM 1360 CD2 PHE A 306 2.309 56.371 30.590 1.00 28.86 C ATOM 1361 CE1 PHE A 306 4.908 55.479 30.846 1.00 29.05 C ATOM 1362 CE2 PHE A 306 3.353 57.290 30.612 1.00 27.46 C ATOM 1363 CZ PHE A 306 4.652 56.839 30.747 1.00 28.66 C ATOM 1364 HA PHE A 306 1.599 53.129 32.639 1.00 0.00 H ATOM 1365 HB2 PHE A 306 1.737 53.100 30.204 1.00 0.00 H ATOM 1366 HB3 PHE A 306 0.582 54.448 30.083 1.00 0.00 H ATOM 1367 HD2 PHE A 306 1.284 56.730 30.491 1.00 0.00 H ATOM 1368 HE2 PHE A 306 3.148 58.357 30.523 1.00 0.00 H ATOM 1369 HZ PHE A 306 5.476 57.552 30.776 1.00 0.00 H ATOM 1370 HE1 PHE A 306 5.934 55.124 30.941 1.00 0.00 H ATOM 1371 HD1 PHE A 306 4.065 53.502 30.912 1.00 0.00 H ATOM 1372 H PHE A 306 -0.728 52.561 31.089 1.00 0.00 H ATOM 1373 N VAL A 307 -0.556 55.626 32.603 1.00 32.52 N ATOM 1374 CA VAL A 307 -0.843 56.926 33.223 1.00 32.75 C ATOM 1375 C VAL A 307 -1.207 56.810 34.696 1.00 33.28 C ATOM 1376 O VAL A 307 -1.191 57.807 35.411 1.00 33.11 O ATOM 1377 CB VAL A 307 -1.954 57.746 32.473 1.00 33.07 C ATOM 1378 CG1 VAL A 307 -1.445 58.235 31.130 1.00 32.82 C ATOM 1379 CG2 VAL A 307 -3.273 56.957 32.341 1.00 31.07 C ATOM 1380 HA VAL A 307 0.095 57.475 33.137 1.00 0.00 H ATOM 1381 HB VAL A 307 -2.185 58.621 33.080 1.00 0.00 H ATOM 1382 HG11 VAL A 307 -0.577 58.876 31.283 1.00 0.00 H ATOM 1383 HG12 VAL A 307 -1.163 57.379 30.516 1.00 0.00 H ATOM 1384 HG13 VAL A 307 -2.231 58.800 30.629 1.00 0.00 H ATOM 1385 HG21 VAL A 307 -3.092 56.040 31.780 1.00 0.00 H ATOM 1386 HG22 VAL A 307 -3.647 56.709 33.334 1.00 0.00 H ATOM 1387 HG23 VAL A 307 -4.008 57.566 31.816 1.00 0.00 H ATOM 1388 H VAL A 307 -1.264 55.187 31.981 1.00 0.00 H ATOM 1389 N ASN A 308 -1.536 55.592 35.128 1.00 34.06 N ATOM 1390 CA ASN A 308 -1.871 55.305 36.518 1.00 35.16 C ATOM 1391 C ASN A 308 -0.637 55.013 37.380 1.00 36.02 C ATOM 1392 O ASN A 308 -0.761 54.823 38.590 1.00 36.12 O ATOM 1393 CB ASN A 308 -2.841 54.122 36.606 1.00 34.94 C ATOM 1394 CG ASN A 308 -4.039 54.274 35.679 1.00 36.31 C ATOM 1395 OD1 ASN A 308 -4.859 55.196 35.827 1.00 36.05 O ATOM 1396 ND2 ASN A 308 -4.147 53.368 34.713 1.00 35.09 N ATOM 1397 HA ASN A 308 -2.343 56.206 36.910 1.00 0.00 H ATOM 1398 HB2 ASN A 308 -2.306 53.211 36.338 1.00 0.00 H ATOM 1399 HB3 ASN A 308 -3.201 54.042 37.632 1.00 0.00 H ATOM 1400 HD22 ASN A 308 -3.437 52.613 34.626 1.00 0.00 H ATOM 1401 HD21 ASN A 308 -4.942 53.414 34.044 1.00 0.00 H ATOM 1402 H ASN A 308 -1.555 54.811 34.442 1.00 0.00 H ATOM 1403 N LEU A 309 0.541 54.963 36.758 1.00 36.42 N ATOM 1404 CA LEU A 309 1.782 54.731 37.496 1.00 37.15 C ATOM 1405 C LEU A 309 2.198 56.027 38.155 1.00 37.60 C ATOM 1406 O LEU A 309 1.830 57.114 37.688 1.00 37.79 O ATOM 1407 CB LEU A 309 2.919 54.248 36.572 1.00 36.67 C ATOM 1408 CG LEU A 309 2.785 52.925 35.807 1.00 37.24 C ATOM 1409 CD1 LEU A 309 3.854 52.834 34.698 1.00 37.30 C ATOM 1410 CD2 LEU A 309 2.859 51.713 36.722 1.00 36.14 C ATOM 1411 HA LEU A 309 1.601 53.952 38.237 1.00 0.00 H ATOM 1412 HB2 LEU A 309 3.069 55.028 35.826 1.00 0.00 H ATOM 1413 HB3 LEU A 309 3.812 54.163 37.192 1.00 0.00 H ATOM 1414 HG LEU A 309 1.795 52.918 35.351 1.00 0.00 H ATOM 1415 HD21 LEU A 309 3.819 51.707 37.238 1.00 0.00 H ATOM 1416 HD22 LEU A 309 2.052 51.762 37.453 1.00 0.00 H ATOM 1417 HD23 LEU A 309 2.759 50.804 36.128 1.00 0.00 H ATOM 1418 HD11 LEU A 309 3.724 53.662 34.001 1.00 0.00 H ATOM 1419 HD12 LEU A 309 4.846 52.887 35.146 1.00 0.00 H ATOM 1420 HD13 LEU A 309 3.744 51.889 34.166 1.00 0.00 H ATOM 1421 H LEU A 309 0.578 55.092 35.727 1.00 0.00 H ATOM 1422 N ASP A 310 2.960 55.903 39.239 1.00 38.26 N ATOM 1423 CA ASP A 310 3.613 57.030 39.892 1.00 38.79 C ATOM 1424 C ASP A 310 4.164 57.973 38.829 1.00 39.12 C ATOM 1425 O ASP A 310 4.803 57.532 37.868 1.00 39.19 O ATOM 1426 CB ASP A 310 4.755 56.516 40.784 1.00 39.34 C ATOM 1427 CG ASP A 310 5.296 57.580 41.734 1.00 40.81 C ATOM 1428 OD1 ASP A 310 5.879 58.580 41.269 1.00 41.04 O ATOM 1429 OD2 ASP A 310 5.161 57.397 42.963 1.00 44.47 O ATOM 1430 HA ASP A 310 2.894 57.566 40.512 1.00 0.00 H ATOM 1431 HB2 ASP A 310 4.384 55.679 41.375 1.00 0.00 H ATOM 1432 HB3 ASP A 310 5.569 56.175 40.144 1.00 0.00 H ATOM 1433 H ASP A 310 3.096 54.953 39.640 1.00 0.00 H ATOM 1434 N LEU A 311 3.915 59.267 39.006 1.00 39.49 N ATOM 1435 CA LEU A 311 4.300 60.273 38.024 1.00 39.66 C ATOM 1436 C LEU A 311 5.803 60.279 37.764 1.00 40.16 C ATOM 1437 O LEU A 311 6.235 60.391 36.609 1.00 40.39 O ATOM 1438 CB LEU A 311 3.825 61.664 38.459 1.00 39.62 C ATOM 1439 CG LEU A 311 4.094 62.840 37.507 1.00 39.36 C ATOM 1440 CD1 LEU A 311 3.611 62.558 36.087 1.00 36.66 C ATOM 1441 CD2 LEU A 311 3.460 64.114 38.050 1.00 38.19 C ATOM 1442 HA LEU A 311 3.810 60.010 37.087 1.00 0.00 H ATOM 1443 HB2 LEU A 311 2.747 61.608 38.611 1.00 0.00 H ATOM 1444 HB3 LEU A 311 4.313 61.893 39.406 1.00 0.00 H ATOM 1445 HG LEU A 311 5.174 62.975 37.453 1.00 0.00 H ATOM 1446 HD21 LEU A 311 2.384 63.971 38.145 1.00 0.00 H ATOM 1447 HD22 LEU A 311 3.885 64.342 39.028 1.00 0.00 H ATOM 1448 HD23 LEU A 311 3.659 64.938 37.365 1.00 0.00 H ATOM 1449 HD11 LEU A 311 4.128 61.681 35.696 1.00 0.00 H ATOM 1450 HD12 LEU A 311 2.537 62.372 36.100 1.00 0.00 H ATOM 1451 HD13 LEU A 311 3.824 63.419 35.454 1.00 0.00 H ATOM 1452 H LEU A 311 3.429 59.571 39.874 1.00 0.00 H ATOM 1453 N ASN A 312 6.584 60.158 38.837 1.00 40.21 N ATOM 1454 CA ASN A 312 8.043 60.178 38.763 1.00 40.26 C ATOM 1455 C ASN A 312 8.580 59.035 37.905 1.00 39.77 C ATOM 1456 O ASN A 312 9.544 59.211 37.163 1.00 39.98 O ATOM 1457 CB ASN A 312 8.647 60.135 40.171 1.00 40.51 C ATOM 1458 CG ASN A 312 8.078 61.220 41.087 1.00 42.06 C ATOM 1459 OD1 ASN A 312 8.248 62.416 40.834 1.00 43.73 O ATOM 1460 ND2 ASN A 312 7.397 60.804 42.154 1.00 42.34 N ATOM 1461 HA ASN A 312 8.341 61.110 38.283 1.00 0.00 H ATOM 1462 HB2 ASN A 312 8.438 59.160 40.612 1.00 0.00 H ATOM 1463 HB3 ASN A 312 9.725 60.273 40.093 1.00 0.00 H ATOM 1464 HD22 ASN A 312 7.277 59.786 42.330 1.00 0.00 H ATOM 1465 HD21 ASN A 312 6.985 61.497 42.811 1.00 0.00 H ATOM 1466 H ASN A 312 6.135 60.044 39.768 1.00 0.00 H ATOM 1467 N ASP A 313 7.935 57.880 38.008 1.00 39.12 N ATOM 1468 CA ASP A 313 8.252 56.717 37.189 1.00 39.13 C ATOM 1469 C ASP A 313 7.823 56.868 35.714 1.00 39.17 C ATOM 1470 O ASP A 313 8.487 56.332 34.822 1.00 39.49 O ATOM 1471 CB ASP A 313 7.629 55.462 37.801 1.00 38.90 C ATOM 1472 CG ASP A 313 8.365 54.989 39.054 1.00 39.23 C ATOM 1473 OD1 ASP A 313 9.328 55.655 39.494 1.00 39.74 O ATOM 1474 OD2 ASP A 313 7.980 53.936 39.599 1.00 39.13 O ATOM 1475 HA ASP A 313 9.338 56.627 37.181 1.00 0.00 H ATOM 1476 HB2 ASP A 313 6.594 55.679 38.065 1.00 0.00 H ATOM 1477 HB3 ASP A 313 7.653 54.663 37.060 1.00 0.00 H ATOM 1478 H ASP A 313 7.168 57.801 38.706 1.00 0.00 H ATOM 1479 N GLN A 314 6.716 57.574 35.473 1.00 38.42 N ATOM 1480 CA GLN A 314 6.294 57.941 34.128 1.00 38.07 C ATOM 1481 C GLN A 314 7.382 58.770 33.461 1.00 37.94 C ATOM 1482 O GLN A 314 7.796 58.460 32.347 1.00 38.06 O ATOM 1483 CB GLN A 314 4.980 58.743 34.141 1.00 37.91 C ATOM 1484 CG GLN A 314 3.697 57.937 34.383 1.00 37.28 C ATOM 1485 CD GLN A 314 2.443 58.822 34.340 1.00 38.56 C ATOM 1486 OE1 GLN A 314 2.309 59.687 33.469 1.00 37.72 O ATOM 1487 NE2 GLN A 314 1.528 58.611 35.290 1.00 37.56 N ATOM 1488 HA GLN A 314 6.123 57.021 33.570 1.00 0.00 H ATOM 1489 HB2 GLN A 314 5.056 59.493 34.928 1.00 0.00 H ATOM 1490 HB3 GLN A 314 4.884 59.240 33.176 1.00 0.00 H ATOM 1491 HG2 GLN A 314 3.613 57.170 33.613 1.00 0.00 H ATOM 1492 HG3 GLN A 314 3.759 57.462 35.362 1.00 0.00 H ATOM 1493 HE22 GLN A 314 1.681 57.871 36.005 1.00 0.00 H ATOM 1494 HE21 GLN A 314 0.662 59.187 35.315 1.00 0.00 H ATOM 1495 H GLN A 314 6.131 57.874 36.279 1.00 0.00 H ATOM 1496 N VAL A 315 7.841 59.819 34.144 1.00 37.79 N ATOM 1497 CA VAL A 315 8.931 60.655 33.647 1.00 37.77 C ATOM 1498 C VAL A 315 10.195 59.812 33.402 1.00 37.78 C ATOM 1499 O VAL A 315 10.789 59.890 32.331 1.00 37.58 O ATOM 1500 CB VAL A 315 9.202 61.877 34.575 1.00 38.02 C ATOM 1501 CG1 VAL A 315 10.458 62.629 34.158 1.00 37.70 C ATOM 1502 CG2 VAL A 315 8.007 62.831 34.561 1.00 37.39 C ATOM 1503 HA VAL A 315 8.623 61.070 32.687 1.00 0.00 H ATOM 1504 HB VAL A 315 9.352 61.494 35.584 1.00 0.00 H ATOM 1505 HG11 VAL A 315 11.316 61.959 34.211 1.00 0.00 H ATOM 1506 HG12 VAL A 315 10.341 62.991 33.137 1.00 0.00 H ATOM 1507 HG13 VAL A 315 10.613 63.474 34.829 1.00 0.00 H ATOM 1508 HG21 VAL A 315 7.839 63.186 33.544 1.00 0.00 H ATOM 1509 HG22 VAL A 315 7.120 62.305 34.914 1.00 0.00 H ATOM 1510 HG23 VAL A 315 8.213 63.679 35.214 1.00 0.00 H ATOM 1511 H VAL A 315 7.409 60.050 35.061 1.00 0.00 H ATOM 1512 N THR A 316 10.552 58.973 34.374 1.00 37.87 N ATOM 1513 CA THR A 316 11.720 58.087 34.278 1.00 38.01 C ATOM 1514 C THR A 316 11.673 57.130 33.081 1.00 37.77 C ATOM 1515 O THR A 316 12.674 56.977 32.364 1.00 37.74 O ATOM 1516 CB THR A 316 11.929 57.276 35.588 1.00 38.17 C ATOM 1517 OG1 THR A 316 12.263 58.176 36.649 1.00 37.78 O ATOM 1518 CG2 THR A 316 13.047 56.237 35.427 1.00 37.28 C ATOM 1519 HA THR A 316 12.569 58.753 34.122 1.00 0.00 H ATOM 1520 HB THR A 316 11.004 56.747 35.818 1.00 0.00 H ATOM 1521 HG1 THR A 316 12.397 57.663 37.485 1.00 0.00 H ATOM 1522 HG23 THR A 316 12.791 55.552 34.618 1.00 0.00 H ATOM 1523 HG21 THR A 316 13.982 56.745 35.192 1.00 0.00 H ATOM 1524 HG22 THR A 316 13.159 55.678 36.356 1.00 0.00 H ATOM 1525 H THR A 316 9.977 58.944 35.240 1.00 0.00 H ATOM 1526 N LEU A 317 10.522 56.497 32.875 1.00 37.36 N ATOM 1527 CA LEU A 317 10.336 55.593 31.739 1.00 37.37 C ATOM 1528 C LEU A 317 10.443 56.315 30.403 1.00 37.17 C ATOM 1529 O LEU A 317 11.012 55.782 29.457 1.00 37.41 O ATOM 1530 CB LEU A 317 9.002 54.833 31.821 1.00 36.98 C ATOM 1531 CG LEU A 317 8.810 53.836 32.972 1.00 36.92 C ATOM 1532 CD1 LEU A 317 7.380 53.278 32.962 1.00 34.91 C ATOM 1533 CD2 LEU A 317 9.856 52.695 32.947 1.00 34.61 C ATOM 1534 HA LEU A 317 11.148 54.869 31.797 1.00 0.00 H ATOM 1535 HB2 LEU A 317 8.209 55.577 31.901 1.00 0.00 H ATOM 1536 HB3 LEU A 317 8.886 54.279 30.889 1.00 0.00 H ATOM 1537 HG LEU A 317 8.968 54.380 33.903 1.00 0.00 H ATOM 1538 HD21 LEU A 317 9.771 52.147 32.009 1.00 0.00 H ATOM 1539 HD22 LEU A 317 10.856 53.119 33.032 1.00 0.00 H ATOM 1540 HD23 LEU A 317 9.674 52.019 33.782 1.00 0.00 H ATOM 1541 HD11 LEU A 317 6.671 54.097 33.079 1.00 0.00 H ATOM 1542 HD12 LEU A 317 7.197 52.769 32.016 1.00 0.00 H ATOM 1543 HD13 LEU A 317 7.261 52.573 33.784 1.00 0.00 H ATOM 1544 H LEU A 317 9.735 56.648 33.537 1.00 0.00 H ATOM 1545 N LEU A 318 9.898 57.523 30.325 1.00 37.51 N ATOM 1546 CA LEU A 318 9.967 58.299 29.094 1.00 37.59 C ATOM 1547 C LEU A 318 11.411 58.744 28.843 1.00 37.68 C ATOM 1548 O LEU A 318 11.928 58.596 27.737 1.00 37.52 O ATOM 1549 CB LEU A 318 8.994 59.478 29.131 1.00 37.16 C ATOM 1550 CG LEU A 318 7.517 59.131 28.864 1.00 37.94 C ATOM 1551 CD1 LEU A 318 6.585 60.298 29.214 1.00 36.51 C ATOM 1552 CD2 LEU A 318 7.295 58.708 27.417 1.00 37.37 C ATOM 1553 HA LEU A 318 9.660 57.672 28.257 1.00 0.00 H ATOM 1554 HB2 LEU A 318 9.058 59.935 30.118 1.00 0.00 H ATOM 1555 HB3 LEU A 318 9.311 60.199 28.377 1.00 0.00 H ATOM 1556 HG LEU A 318 7.273 58.291 29.514 1.00 0.00 H ATOM 1557 HD21 LEU A 318 7.584 59.523 26.753 1.00 0.00 H ATOM 1558 HD22 LEU A 318 7.901 57.829 27.200 1.00 0.00 H ATOM 1559 HD23 LEU A 318 6.242 58.471 27.267 1.00 0.00 H ATOM 1560 HD11 LEU A 318 6.694 60.544 30.270 1.00 0.00 H ATOM 1561 HD12 LEU A 318 6.848 61.166 28.609 1.00 0.00 H ATOM 1562 HD13 LEU A 318 5.553 60.011 29.011 1.00 0.00 H ATOM 1563 H LEU A 318 9.415 57.921 31.155 1.00 0.00 H ATOM 1564 N LYS A 319 12.057 59.243 29.895 1.00 37.87 N ATOM 1565 CA LYS A 319 13.458 59.671 29.871 1.00 38.32 C ATOM 1566 C LYS A 319 14.422 58.659 29.215 1.00 38.25 C ATOM 1567 O LYS A 319 15.262 59.039 28.396 1.00 37.89 O ATOM 1568 CB LYS A 319 13.921 59.986 31.302 1.00 38.52 C ATOM 1569 CG LYS A 319 15.305 60.610 31.402 1.00 39.09 C ATOM 1570 CD LYS A 319 15.778 60.699 32.854 1.00 40.73 C ATOM 1571 CE LYS A 319 17.129 61.405 32.956 1.00 40.70 C ATOM 1572 NZ LYS A 319 17.057 62.816 32.470 1.00 41.29 N ATOM 1573 HA LYS A 319 13.495 60.562 29.244 1.00 0.00 H ATOM 1574 HB2 LYS A 319 13.204 60.677 31.746 1.00 0.00 H ATOM 1575 HB3 LYS A 319 13.926 59.055 31.870 1.00 0.00 H ATOM 1576 HG2 LYS A 319 16.010 60.001 30.837 1.00 0.00 H ATOM 1577 HG3 LYS A 319 15.273 61.614 30.978 1.00 0.00 H ATOM 1578 HD2 LYS A 319 15.042 61.255 33.434 1.00 0.00 H ATOM 1579 HD3 LYS A 319 15.872 59.692 33.259 1.00 0.00 H ATOM 1580 HE2 LYS A 319 17.858 60.861 32.355 1.00 0.00 H ATOM 1581 HE3 LYS A 319 17.449 61.407 33.998 1.00 0.00 H ATOM 1582 HZ1 LYS A 319 16.759 62.823 31.474 1.00 0.00 H ATOM 1583 HZ2 LYS A 319 16.368 63.344 33.043 1.00 0.00 H ATOM 1584 HZ3 LYS A 319 17.994 63.259 32.556 1.00 0.00 H ATOM 1585 H LYS A 319 11.534 59.335 30.790 1.00 0.00 H ATOM 1586 N TYR A 320 14.282 57.384 29.574 1.00 38.32 N ATOM 1587 CA TYR A 320 15.182 56.329 29.105 1.00 38.69 C ATOM 1588 C TYR A 320 14.663 55.553 27.900 1.00 38.44 C ATOM 1589 O TYR A 320 15.436 54.855 27.230 1.00 38.75 O ATOM 1590 CB TYR A 320 15.475 55.344 30.239 1.00 39.14 C ATOM 1591 CG TYR A 320 16.374 55.911 31.317 1.00 40.89 C ATOM 1592 CD1 TYR A 320 17.762 55.761 31.247 1.00 41.79 C ATOM 1593 CD2 TYR A 320 15.836 56.599 32.403 1.00 41.96 C ATOM 1594 CE1 TYR A 320 18.589 56.280 32.234 1.00 43.33 C ATOM 1595 CE2 TYR A 320 16.649 57.120 33.395 1.00 43.87 C ATOM 1596 CZ TYR A 320 18.027 56.958 33.308 1.00 44.13 C ATOM 1597 OH TYR A 320 18.828 57.487 34.292 1.00 45.42 O ATOM 1598 HA TYR A 320 16.089 56.842 28.784 1.00 0.00 H ATOM 1599 HB3 TYR A 320 15.958 54.464 29.815 1.00 0.00 H ATOM 1600 HB2 TYR A 320 14.529 55.053 30.696 1.00 0.00 H ATOM 1601 HD2 TYR A 320 14.756 56.729 32.473 1.00 0.00 H ATOM 1602 HE2 TYR A 320 16.212 57.654 34.239 1.00 0.00 H ATOM 1603 HE1 TYR A 320 19.670 56.156 32.167 1.00 0.00 H ATOM 1604 HD1 TYR A 320 18.202 55.228 30.404 1.00 0.00 H ATOM 1605 HH TYR A 320 19.776 57.288 34.087 1.00 0.00 H ATOM 1606 H TYR A 320 13.502 57.128 30.213 1.00 0.00 H ATOM 1607 N GLY A 321 13.363 55.661 27.638 1.00 37.56 N ATOM 1608 CA GLY A 321 12.743 54.955 26.523 1.00 36.78 C ATOM 1609 C GLY A 321 12.773 55.679 25.183 1.00 36.63 C ATOM 1610 O GLY A 321 12.886 55.035 24.133 1.00 36.72 O ATOM 1611 HA3 GLY A 321 11.700 54.771 26.781 1.00 0.00 H ATOM 1612 HA2 GLY A 321 13.259 54.003 26.401 1.00 0.00 H ATOM 1613 H GLY A 321 12.773 56.265 28.245 1.00 0.00 H ATOM 1614 N VAL A 322 12.672 57.009 25.203 1.00 36.03 N ATOM 1615 CA VAL A 322 12.461 57.761 23.963 1.00 35.81 C ATOM 1616 C VAL A 322 13.524 57.519 22.897 1.00 35.46 C ATOM 1617 O VAL A 322 13.175 57.244 21.752 1.00 34.90 O ATOM 1618 CB VAL A 322 12.204 59.280 24.166 1.00 35.71 C ATOM 1619 CG1 VAL A 322 10.813 59.505 24.721 1.00 34.80 C ATOM 1620 CG2 VAL A 322 13.286 59.926 25.040 1.00 36.54 C ATOM 1621 HA VAL A 322 11.531 57.340 23.581 1.00 0.00 H ATOM 1622 HB VAL A 322 12.261 59.771 23.195 1.00 0.00 H ATOM 1623 HG11 VAL A 322 10.076 59.108 24.023 1.00 0.00 H ATOM 1624 HG12 VAL A 322 10.719 58.995 25.680 1.00 0.00 H ATOM 1625 HG13 VAL A 322 10.646 60.573 24.858 1.00 0.00 H ATOM 1626 HG21 VAL A 322 13.296 59.445 26.018 1.00 0.00 H ATOM 1627 HG22 VAL A 322 14.258 59.802 24.563 1.00 0.00 H ATOM 1628 HG23 VAL A 322 13.070 60.988 25.158 1.00 0.00 H ATOM 1629 H VAL A 322 12.744 57.517 26.108 1.00 0.00 H ATOM 1630 N HIS A 323 14.802 57.621 23.262 1.00 35.24 N ATOM 1631 CA HIS A 323 15.859 57.436 22.268 1.00 35.24 C ATOM 1632 C HIS A 323 15.899 56.032 21.672 1.00 35.17 C ATOM 1633 O HIS A 323 16.108 55.881 20.470 1.00 35.83 O ATOM 1634 CB HIS A 323 17.221 57.906 22.780 1.00 35.44 C ATOM 1635 CG HIS A 323 17.370 59.395 22.772 1.00 35.34 C ATOM 1636 ND1 HIS A 323 17.319 60.154 23.922 1.00 35.93 N ATOM 1637 CD2 HIS A 323 17.515 60.269 21.749 1.00 35.02 C ATOM 1638 CE1 HIS A 323 17.446 61.432 23.610 1.00 35.92 C ATOM 1639 NE2 HIS A 323 17.577 61.528 22.299 1.00 37.23 N ATOM 1640 HA HIS A 323 15.599 58.087 21.433 1.00 0.00 H ATOM 1641 HB2 HIS A 323 17.349 57.550 23.802 1.00 0.00 H ATOM 1642 HB3 HIS A 323 17.997 57.476 22.147 1.00 0.00 H ATOM 1643 HD2 HIS A 323 17.572 60.022 20.689 1.00 0.00 H ATOM 1644 HE1 HIS A 323 17.443 62.264 24.314 1.00 0.00 H ATOM 1645 H HIS A 323 15.047 57.831 24.251 1.00 0.00 H ATOM 1646 N GLU A 324 15.656 55.014 22.490 1.00 34.76 N ATOM 1647 CA GLU A 324 15.597 53.632 21.992 1.00 34.50 C ATOM 1648 C GLU A 324 14.462 53.456 20.968 1.00 34.21 C ATOM 1649 O GLU A 324 14.603 52.711 19.984 1.00 33.36 O ATOM 1650 CB GLU A 324 15.473 52.628 23.151 1.00 34.35 C ATOM 1651 CG GLU A 324 16.647 52.693 24.155 1.00 35.04 C ATOM 1652 CD GLU A 324 16.491 51.763 25.365 1.00 35.98 C ATOM 1653 OE1 GLU A 324 15.445 51.082 25.512 1.00 35.48 O ATOM 1654 OE2 GLU A 324 17.435 51.716 26.179 1.00 37.07 O ATOM 1655 HA GLU A 324 16.535 53.423 21.478 1.00 0.00 H ATOM 1656 HB2 GLU A 324 14.548 52.835 23.689 1.00 0.00 H ATOM 1657 HB3 GLU A 324 15.432 51.622 22.733 1.00 0.00 H ATOM 1658 HG2 GLU A 324 17.562 52.420 23.630 1.00 0.00 H ATOM 1659 HG3 GLU A 324 16.730 53.717 24.519 1.00 0.00 H ATOM 1660 H GLU A 324 15.505 55.198 23.502 1.00 0.00 H ATOM 1661 N ILE A 325 13.355 54.167 21.211 1.00 33.73 N ATOM 1662 CA ILE A 325 12.209 54.211 20.304 1.00 33.17 C ATOM 1663 C ILE A 325 12.523 55.023 19.041 1.00 33.34 C ATOM 1664 O ILE A 325 12.152 54.625 17.933 1.00 33.40 O ATOM 1665 CB ILE A 325 10.937 54.743 21.018 1.00 33.02 C ATOM 1666 CG1 ILE A 325 10.523 53.754 22.105 1.00 33.08 C ATOM 1667 CG2 ILE A 325 9.778 54.927 20.024 1.00 32.16 C ATOM 1668 CD1 ILE A 325 9.726 54.343 23.216 1.00 33.34 C ATOM 1669 HA ILE A 325 12.003 53.187 19.992 1.00 0.00 H ATOM 1670 HB ILE A 325 11.166 55.714 21.458 1.00 0.00 H ATOM 1671 HG12 ILE A 325 9.928 52.968 21.640 1.00 0.00 H ATOM 1672 HG13 ILE A 325 11.428 53.319 22.530 1.00 0.00 H ATOM 1673 HD11 ILE A 325 10.309 55.123 23.706 1.00 0.00 H ATOM 1674 HD12 ILE A 325 8.808 54.772 22.815 1.00 0.00 H ATOM 1675 HD13 ILE A 325 9.480 53.564 23.938 1.00 0.00 H ATOM 1676 HG21 ILE A 325 10.071 55.642 19.255 1.00 0.00 H ATOM 1677 HG22 ILE A 325 9.543 53.969 19.561 1.00 0.00 H ATOM 1678 HG23 ILE A 325 8.902 55.300 20.554 1.00 0.00 H ATOM 1679 H ILE A 325 13.307 54.718 22.092 1.00 0.00 H ATOM 1680 N ILE A 326 13.221 56.142 19.210 1.00 33.23 N ATOM 1681 CA ILE A 326 13.573 57.000 18.087 1.00 33.53 C ATOM 1682 C ILE A 326 14.447 56.279 17.058 1.00 33.89 C ATOM 1683 O ILE A 326 14.190 56.354 15.855 1.00 33.96 O ATOM 1684 CB ILE A 326 14.230 58.310 18.562 1.00 33.87 C ATOM 1685 CG1 ILE A 326 13.153 59.249 19.121 1.00 33.49 C ATOM 1686 CG2 ILE A 326 15.012 59.000 17.417 1.00 32.63 C ATOM 1687 CD1 ILE A 326 13.697 60.336 20.066 1.00 33.78 C ATOM 1688 HA ILE A 326 12.641 57.259 17.585 1.00 0.00 H ATOM 1689 HB ILE A 326 14.947 58.072 19.348 1.00 0.00 H ATOM 1690 HG12 ILE A 326 12.658 59.740 18.283 1.00 0.00 H ATOM 1691 HG13 ILE A 326 12.427 58.649 19.670 1.00 0.00 H ATOM 1692 HD11 ILE A 326 14.186 59.863 20.918 1.00 0.00 H ATOM 1693 HD12 ILE A 326 14.417 60.955 19.530 1.00 0.00 H ATOM 1694 HD13 ILE A 326 12.872 60.957 20.417 1.00 0.00 H ATOM 1695 HG21 ILE A 326 15.794 58.331 17.058 1.00 0.00 H ATOM 1696 HG22 ILE A 326 14.328 59.232 16.600 1.00 0.00 H ATOM 1697 HG23 ILE A 326 15.462 59.921 17.789 1.00 0.00 H ATOM 1698 H ILE A 326 13.523 56.411 20.168 1.00 0.00 H ATOM 1699 N TYR A 327 15.460 55.564 17.534 1.00 34.10 N ATOM 1700 CA TYR A 327 16.357 54.829 16.648 1.00 34.01 C ATOM 1701 C TYR A 327 15.672 53.592 16.043 1.00 33.52 C ATOM 1702 O TYR A 327 15.977 53.200 14.917 1.00 33.44 O ATOM 1703 CB TYR A 327 17.665 54.488 17.378 1.00 34.30 C ATOM 1704 CG TYR A 327 18.380 55.722 17.907 1.00 35.56 C ATOM 1705 CD1 TYR A 327 18.566 56.847 17.097 1.00 36.68 C ATOM 1706 CD2 TYR A 327 18.856 55.776 19.215 1.00 36.09 C ATOM 1707 CE1 TYR A 327 19.203 57.982 17.573 1.00 35.62 C ATOM 1708 CE2 TYR A 327 19.507 56.918 19.702 1.00 36.06 C ATOM 1709 CZ TYR A 327 19.674 58.010 18.874 1.00 36.27 C ATOM 1710 OH TYR A 327 20.321 59.135 19.338 1.00 37.51 O ATOM 1711 HA TYR A 327 16.613 55.469 15.804 1.00 0.00 H ATOM 1712 HB3 TYR A 327 18.328 53.971 16.684 1.00 0.00 H ATOM 1713 HB2 TYR A 327 17.436 53.831 18.217 1.00 0.00 H ATOM 1714 HD2 TYR A 327 18.720 54.916 19.871 1.00 0.00 H ATOM 1715 HE2 TYR A 327 19.878 56.944 20.726 1.00 0.00 H ATOM 1716 HE1 TYR A 327 19.333 58.849 16.925 1.00 0.00 H ATOM 1717 HD1 TYR A 327 18.202 56.831 16.070 1.00 0.00 H ATOM 1718 HH TYR A 327 20.352 59.816 18.620 1.00 0.00 H ATOM 1719 H TYR A 327 15.618 55.527 18.561 1.00 0.00 H ATOM 1720 N THR A 328 14.727 53.007 16.776 1.00 32.86 N ATOM 1721 CA THR A 328 13.932 51.891 16.262 1.00 32.48 C ATOM 1722 C THR A 328 13.070 52.337 15.078 1.00 32.75 C ATOM 1723 O THR A 328 13.059 51.689 14.016 1.00 32.41 O ATOM 1724 CB THR A 328 13.030 51.291 17.364 1.00 32.58 C ATOM 1725 OG1 THR A 328 13.852 50.652 18.351 1.00 33.11 O ATOM 1726 CG2 THR A 328 12.056 50.280 16.791 1.00 30.57 C ATOM 1727 HA THR A 328 14.629 51.123 15.926 1.00 0.00 H ATOM 1728 HB THR A 328 12.455 52.100 17.814 1.00 0.00 H ATOM 1729 HG1 THR A 328 14.466 51.319 18.750 1.00 0.00 H ATOM 1730 HG23 THR A 328 11.431 50.764 16.041 1.00 0.00 H ATOM 1731 HG21 THR A 328 12.611 49.463 16.330 1.00 0.00 H ATOM 1732 HG22 THR A 328 11.428 49.888 17.591 1.00 0.00 H ATOM 1733 H THR A 328 14.549 53.353 17.741 1.00 0.00 H ATOM 1734 N MET A 329 12.353 53.442 15.275 1.00 32.77 N ATOM 1735 CA MET A 329 11.410 53.954 14.292 1.00 33.26 C ATOM 1736 C MET A 329 12.121 54.689 13.152 1.00 33.30 C ATOM 1737 O MET A 329 11.602 54.775 12.043 1.00 32.92 O ATOM 1738 CB MET A 329 10.383 54.873 14.970 1.00 33.64 C ATOM 1739 CG MET A 329 9.442 54.137 15.921 1.00 34.41 C ATOM 1740 SD MET A 329 8.171 55.196 16.651 1.00 37.37 S ATOM 1741 CE MET A 329 7.112 55.500 15.231 1.00 36.72 C ATOM 1742 HA MET A 329 10.890 53.102 13.855 1.00 0.00 H ATOM 1743 HB2 MET A 329 10.921 55.634 15.536 1.00 0.00 H ATOM 1744 HB3 MET A 329 9.785 55.353 14.196 1.00 0.00 H ATOM 1745 HG2 MET A 329 10.035 53.706 16.727 1.00 0.00 H ATOM 1746 HG3 MET A 329 8.948 53.338 15.367 1.00 0.00 H ATOM 1747 HE1 MET A 329 7.689 55.992 14.448 1.00 0.00 H ATOM 1748 HE2 MET A 329 6.725 54.552 14.858 1.00 0.00 H ATOM 1749 HE3 MET A 329 6.282 56.141 15.529 1.00 0.00 H ATOM 1750 H MET A 329 12.472 53.961 16.169 1.00 0.00 H ATOM 1751 N LEU A 330 13.305 55.221 13.432 1.00 33.61 N ATOM 1752 CA LEU A 330 14.130 55.853 12.403 1.00 34.36 C ATOM 1753 C LEU A 330 14.568 54.857 11.324 1.00 34.16 C ATOM 1754 O LEU A 330 14.731 55.222 10.165 1.00 35.10 O ATOM 1755 CB LEU A 330 15.353 56.530 13.033 1.00 34.86 C ATOM 1756 CG LEU A 330 16.283 57.284 12.085 1.00 36.26 C ATOM 1757 CD1 LEU A 330 15.570 58.486 11.469 1.00 35.88 C ATOM 1758 CD2 LEU A 330 17.557 57.689 12.818 1.00 37.82 C ATOM 1759 HA LEU A 330 13.515 56.611 11.917 1.00 0.00 H ATOM 1760 HB2 LEU A 330 14.991 57.241 13.776 1.00 0.00 H ATOM 1761 HB3 LEU A 330 15.941 55.757 13.527 1.00 0.00 H ATOM 1762 HG LEU A 330 16.566 56.626 11.263 1.00 0.00 H ATOM 1763 HD21 LEU A 330 17.301 58.334 13.659 1.00 0.00 H ATOM 1764 HD22 LEU A 330 18.064 56.796 13.184 1.00 0.00 H ATOM 1765 HD23 LEU A 330 18.213 58.226 12.133 1.00 0.00 H ATOM 1766 HD11 LEU A 330 14.700 58.143 10.910 1.00 0.00 H ATOM 1767 HD12 LEU A 330 15.251 59.163 12.262 1.00 0.00 H ATOM 1768 HD13 LEU A 330 16.253 59.007 10.798 1.00 0.00 H ATOM 1769 H LEU A 330 13.656 55.187 14.411 1.00 0.00 H ATOM 1770 N ALA A 331 14.737 53.600 11.704 1.00 33.76 N ATOM 1771 CA ALA A 331 15.025 52.524 10.746 1.00 33.59 C ATOM 1772 C ALA A 331 13.911 52.357 9.691 1.00 33.52 C ATOM 1773 O ALA A 331 14.182 52.059 8.505 1.00 32.96 O ATOM 1774 CB ALA A 331 15.255 51.202 11.497 1.00 33.12 C ATOM 1775 HA ALA A 331 15.931 52.802 10.207 1.00 0.00 H ATOM 1776 HB1 ALA A 331 16.099 51.314 12.177 1.00 0.00 H ATOM 1777 HB2 ALA A 331 14.360 50.948 12.065 1.00 0.00 H ATOM 1778 HB3 ALA A 331 15.468 50.410 10.779 1.00 0.00 H ATOM 1779 H ALA A 331 14.663 53.366 12.715 1.00 0.00 H ATOM 1780 N SER A 332 12.667 52.554 10.127 1.00 32.84 N ATOM 1781 CA SER A 332 11.512 52.499 9.224 1.00 32.62 C ATOM 1782 C SER A 332 11.676 53.472 8.060 1.00 32.77 C ATOM 1783 O SER A 332 11.166 53.224 6.983 1.00 32.91 O ATOM 1784 CB SER A 332 10.219 52.815 9.980 1.00 32.62 C ATOM 1785 OG SER A 332 9.942 51.824 10.944 1.00 30.97 O ATOM 1786 HA SER A 332 11.454 51.486 8.826 1.00 0.00 H ATOM 1787 HB2 SER A 332 9.393 52.863 9.270 1.00 0.00 H ATOM 1788 HB3 SER A 332 10.324 53.778 10.479 1.00 0.00 H ATOM 1789 HG SER A 332 10.688 51.780 11.594 1.00 0.00 H ATOM 1790 H SER A 332 12.511 52.752 11.136 1.00 0.00 H ATOM 1791 N LEU A 333 12.410 54.560 8.281 1.00 33.10 N ATOM 1792 CA LEU A 333 12.563 55.597 7.277 1.00 34.08 C ATOM 1793 C LEU A 333 13.907 55.505 6.560 1.00 34.50 C ATOM 1794 O LEU A 333 14.283 56.419 5.832 1.00 34.71 O ATOM 1795 CB LEU A 333 12.398 56.995 7.899 1.00 34.19 C ATOM 1796 CG LEU A 333 11.355 57.327 8.979 1.00 34.67 C ATOM 1797 CD1 LEU A 333 11.279 58.851 9.235 1.00 33.39 C ATOM 1798 CD2 LEU A 333 9.970 56.777 8.651 1.00 34.52 C ATOM 1799 HA LEU A 333 11.776 55.440 6.540 1.00 0.00 H ATOM 1800 HB2 LEU A 333 13.366 57.244 8.333 1.00 0.00 H ATOM 1801 HB3 LEU A 333 12.190 57.668 7.067 1.00 0.00 H ATOM 1802 HG LEU A 333 11.692 56.832 9.890 1.00 0.00 H ATOM 1803 HD21 LEU A 333 9.624 57.205 7.710 1.00 0.00 H ATOM 1804 HD22 LEU A 333 10.023 55.692 8.561 1.00 0.00 H ATOM 1805 HD23 LEU A 333 9.277 57.043 9.449 1.00 0.00 H ATOM 1806 HD11 LEU A 333 12.252 59.211 9.569 1.00 0.00 H ATOM 1807 HD12 LEU A 333 10.999 59.360 8.313 1.00 0.00 H ATOM 1808 HD13 LEU A 333 10.533 59.052 10.004 1.00 0.00 H ATOM 1809 H LEU A 333 12.887 54.670 9.198 1.00 0.00 H ATOM 1810 N MET A 334 14.618 54.397 6.773 1.00 35.07 N ATOM 1811 CA MET A 334 15.955 54.205 6.235 1.00 35.38 C ATOM 1812 C MET A 334 16.030 53.025 5.275 1.00 35.93 C ATOM 1813 O MET A 334 15.342 52.034 5.443 1.00 35.66 O ATOM 1814 CB MET A 334 16.951 53.944 7.369 1.00 35.10 C ATOM 1815 CG MET A 334 17.408 55.169 8.105 1.00 34.54 C ATOM 1816 SD MET A 334 18.500 54.823 9.512 1.00 35.94 S ATOM 1817 CE MET A 334 19.227 56.444 9.698 1.00 34.14 C ATOM 1818 HA MET A 334 16.202 55.119 5.695 1.00 0.00 H ATOM 1819 HB2 MET A 334 16.478 53.274 8.087 1.00 0.00 H ATOM 1820 HB3 MET A 334 17.829 53.458 6.943 1.00 0.00 H ATOM 1821 HG2 MET A 334 16.528 55.694 8.475 1.00 0.00 H ATOM 1822 HG3 MET A 334 17.944 55.810 7.405 1.00 0.00 H ATOM 1823 HE1 MET A 334 19.746 56.716 8.779 1.00 0.00 H ATOM 1824 HE2 MET A 334 18.442 57.172 9.903 1.00 0.00 H ATOM 1825 HE3 MET A 334 19.936 56.430 10.526 1.00 0.00 H ATOM 1826 H MET A 334 14.199 53.639 7.348 1.00 0.00 H ATOM 1827 N ASN A 335 16.875 53.148 4.259 1.00 36.98 N ATOM 1828 CA ASN A 335 17.393 51.967 3.569 1.00 37.93 C ATOM 1829 C ASN A 335 18.915 52.050 3.570 1.00 38.82 C ATOM 1830 O ASN A 335 19.484 52.967 4.166 1.00 38.97 O ATOM 1831 CB ASN A 335 16.808 51.807 2.154 1.00 37.53 C ATOM 1832 CG ASN A 335 17.148 52.966 1.227 1.00 37.36 C ATOM 1833 OD1 ASN A 335 18.167 53.637 1.381 1.00 37.87 O ATOM 1834 ND2 ASN A 335 16.291 53.192 0.243 1.00 37.75 N ATOM 1835 HA ASN A 335 17.079 51.068 4.099 1.00 0.00 H ATOM 1836 HB2 ASN A 335 17.201 50.888 1.719 1.00 0.00 H ATOM 1837 HB3 ASN A 335 15.723 51.734 2.234 1.00 0.00 H ATOM 1838 HD22 ASN A 335 15.441 52.601 0.148 1.00 0.00 H ATOM 1839 HD21 ASN A 335 16.468 53.961 -0.435 1.00 0.00 H ATOM 1840 H ASN A 335 17.172 54.095 3.950 1.00 0.00 H ATOM 1841 N LYS A 336 19.577 51.112 2.904 1.00 39.96 N ATOM 1842 CA LYS A 336 21.040 51.071 2.926 1.00 40.77 C ATOM 1843 C LYS A 336 21.664 52.359 2.395 1.00 40.80 C ATOM 1844 O LYS A 336 22.780 52.703 2.789 1.00 41.12 O ATOM 1845 CB LYS A 336 21.581 49.838 2.180 1.00 41.29 C ATOM 1846 CG LYS A 336 21.307 49.829 0.679 1.00 42.13 C ATOM 1847 CD LYS A 336 21.717 48.506 0.053 1.00 44.27 C ATOM 1848 CE LYS A 336 22.046 48.668 -1.424 1.00 45.17 C ATOM 1849 NZ LYS A 336 23.301 49.472 -1.606 1.00 47.06 N ATOM 1850 HA LYS A 336 21.335 50.984 3.972 1.00 0.00 H ATOM 1851 HB2 LYS A 336 22.660 49.798 2.329 1.00 0.00 H ATOM 1852 HB3 LYS A 336 21.122 48.950 2.614 1.00 0.00 H ATOM 1853 HG2 LYS A 336 20.242 49.987 0.511 1.00 0.00 H ATOM 1854 HG3 LYS A 336 21.871 50.635 0.209 1.00 0.00 H ATOM 1855 HD2 LYS A 336 22.596 48.125 0.573 1.00 0.00 H ATOM 1856 HD3 LYS A 336 20.898 47.795 0.158 1.00 0.00 H ATOM 1857 HE2 LYS A 336 21.220 49.177 -1.921 1.00 0.00 H ATOM 1858 HE3 LYS A 336 22.185 47.683 -1.870 1.00 0.00 H ATOM 1859 HZ1 LYS A 336 23.172 50.414 -1.186 1.00 0.00 H ATOM 1860 HZ2 LYS A 336 24.093 48.988 -1.137 1.00 0.00 H ATOM 1861 HZ3 LYS A 336 23.505 49.569 -2.621 1.00 0.00 H ATOM 1862 H LYS A 336 19.051 50.398 2.361 1.00 0.00 H ATOM 1863 N ASP A 337 20.930 53.085 1.547 1.00 40.63 N ATOM 1864 CA ASP A 337 21.476 54.269 0.870 1.00 40.28 C ATOM 1865 C ASP A 337 21.114 55.637 1.458 1.00 39.76 C ATOM 1866 O ASP A 337 21.706 56.655 1.065 1.00 39.62 O ATOM 1867 CB ASP A 337 21.139 54.228 -0.628 1.00 40.82 C ATOM 1868 CG ASP A 337 21.904 53.138 -1.372 1.00 42.49 C ATOM 1869 OD1 ASP A 337 22.982 52.703 -0.898 1.00 44.20 O ATOM 1870 OD2 ASP A 337 21.423 52.713 -2.437 1.00 45.25 O ATOM 1871 HA ASP A 337 22.550 54.191 1.040 1.00 0.00 H ATOM 1872 HB2 ASP A 337 20.071 54.044 -0.741 1.00 0.00 H ATOM 1873 HB3 ASP A 337 21.389 55.193 -1.069 1.00 0.00 H ATOM 1874 H ASP A 337 19.946 52.805 1.361 1.00 0.00 H ATOM 1875 N GLY A 338 20.144 55.683 2.372 1.00 38.89 N ATOM 1876 CA GLY A 338 19.791 56.952 3.014 1.00 38.42 C ATOM 1877 C GLY A 338 18.551 56.976 3.886 1.00 37.74 C ATOM 1878 O GLY A 338 18.030 55.931 4.274 1.00 37.87 O ATOM 1879 HA3 GLY A 338 19.649 57.689 2.224 1.00 0.00 H ATOM 1880 HA2 GLY A 338 20.634 57.248 3.638 1.00 0.00 H ATOM 1881 H GLY A 338 19.635 54.814 2.631 1.00 0.00 H ATOM 1882 N VAL A 339 18.071 58.183 4.174 1.00 37.36 N ATOM 1883 CA VAL A 339 16.993 58.373 5.144 1.00 36.90 C ATOM 1884 C VAL A 339 15.980 59.426 4.698 1.00 37.17 C ATOM 1885 O VAL A 339 16.348 60.493 4.211 1.00 37.02 O ATOM 1886 CB VAL A 339 17.574 58.739 6.542 1.00 36.87 C ATOM 1887 CG1 VAL A 339 18.286 60.099 6.504 1.00 35.04 C ATOM 1888 CG2 VAL A 339 16.501 58.692 7.623 1.00 35.25 C ATOM 1889 HA VAL A 339 16.460 57.425 5.213 1.00 0.00 H ATOM 1890 HB VAL A 339 18.319 57.986 6.801 1.00 0.00 H ATOM 1891 HG11 VAL A 339 19.104 60.059 5.785 1.00 0.00 H ATOM 1892 HG12 VAL A 339 17.576 60.871 6.207 1.00 0.00 H ATOM 1893 HG13 VAL A 339 18.681 60.328 7.493 1.00 0.00 H ATOM 1894 HG21 VAL A 339 15.711 59.403 7.380 1.00 0.00 H ATOM 1895 HG22 VAL A 339 16.083 57.687 7.675 1.00 0.00 H ATOM 1896 HG23 VAL A 339 16.944 58.953 8.584 1.00 0.00 H ATOM 1897 H VAL A 339 18.473 59.014 3.696 1.00 0.00 H ATOM 1898 N LEU A 340 14.700 59.116 4.875 1.00 37.68 N ATOM 1899 CA LEU A 340 13.635 60.085 4.631 1.00 38.05 C ATOM 1900 C LEU A 340 13.680 61.193 5.672 1.00 38.64 C ATOM 1901 O LEU A 340 13.981 60.951 6.839 1.00 38.45 O ATOM 1902 CB LEU A 340 12.259 59.413 4.633 1.00 37.61 C ATOM 1903 CG LEU A 340 11.930 58.481 3.466 1.00 37.61 C ATOM 1904 CD1 LEU A 340 10.670 57.683 3.771 1.00 36.34 C ATOM 1905 CD2 LEU A 340 11.778 59.257 2.164 1.00 36.02 C ATOM 1906 HA LEU A 340 13.797 60.518 3.644 1.00 0.00 H ATOM 1907 HB2 LEU A 340 12.181 58.829 5.550 1.00 0.00 H ATOM 1908 HB3 LEU A 340 11.509 60.204 4.642 1.00 0.00 H ATOM 1909 HG LEU A 340 12.761 57.787 3.339 1.00 0.00 H ATOM 1910 HD21 LEU A 340 10.971 59.983 2.267 1.00 0.00 H ATOM 1911 HD22 LEU A 340 12.710 59.777 1.941 1.00 0.00 H ATOM 1912 HD23 LEU A 340 11.544 58.565 1.355 1.00 0.00 H ATOM 1913 HD11 LEU A 340 10.827 57.088 4.671 1.00 0.00 H ATOM 1914 HD12 LEU A 340 9.837 58.368 3.928 1.00 0.00 H ATOM 1915 HD13 LEU A 340 10.447 57.024 2.932 1.00 0.00 H ATOM 1916 H LEU A 340 14.450 58.159 5.196 1.00 0.00 H ATOM 1917 N ILE A 341 13.409 62.415 5.228 1.00 39.43 N ATOM 1918 CA ILE A 341 13.405 63.575 6.104 1.00 40.30 C ATOM 1919 C ILE A 341 12.167 64.400 5.812 1.00 41.08 C ATOM 1920 O ILE A 341 11.522 64.221 4.773 1.00 40.73 O ATOM 1921 CB ILE A 341 14.665 64.468 5.917 1.00 40.39 C ATOM 1922 CG1 ILE A 341 14.724 65.053 4.502 1.00 40.14 C ATOM 1923 CG2 ILE A 341 15.935 63.688 6.240 1.00 40.47 C ATOM 1924 CD1 ILE A 341 15.450 66.380 4.414 1.00 41.71 C ATOM 1925 HA ILE A 341 13.409 63.215 7.133 1.00 0.00 H ATOM 1926 HB ILE A 341 14.592 65.301 6.617 1.00 0.00 H ATOM 1927 HG12 ILE A 341 15.235 64.339 3.856 1.00 0.00 H ATOM 1928 HG13 ILE A 341 13.703 65.196 4.147 1.00 0.00 H ATOM 1929 HD11 ILE A 341 14.945 67.112 5.045 1.00 0.00 H ATOM 1930 HD12 ILE A 341 16.478 66.254 4.754 1.00 0.00 H ATOM 1931 HD13 ILE A 341 15.448 66.726 3.380 1.00 0.00 H ATOM 1932 HG21 ILE A 341 15.897 63.346 7.274 1.00 0.00 H ATOM 1933 HG22 ILE A 341 16.011 62.828 5.574 1.00 0.00 H ATOM 1934 HG23 ILE A 341 16.802 64.334 6.102 1.00 0.00 H ATOM 1935 H ILE A 341 13.192 62.546 4.219 1.00 0.00 H ATOM 1936 N SER A 342 11.839 65.289 6.744 1.00 42.17 N ATOM 1937 CA SER A 342 10.788 66.285 6.547 1.00 43.27 C ATOM 1938 C SER A 342 9.470 65.643 6.091 1.00 43.33 C ATOM 1939 O SER A 342 8.951 65.951 5.014 1.00 43.46 O ATOM 1940 CB SER A 342 11.282 67.363 5.578 1.00 43.19 C ATOM 1941 OG SER A 342 10.221 68.189 5.147 1.00 46.05 O ATOM 1942 HA SER A 342 10.568 66.761 7.503 1.00 0.00 H ATOM 1943 HB2 SER A 342 11.733 66.882 4.710 1.00 0.00 H ATOM 1944 HB3 SER A 342 12.029 67.977 6.080 1.00 0.00 H ATOM 1945 HG SER A 342 9.541 67.637 4.685 1.00 0.00 H ATOM 1946 H SER A 342 12.351 65.275 7.649 1.00 0.00 H ATOM 1947 N GLU A 343 8.954 64.745 6.930 1.00 43.58 N ATOM 1948 CA GLU A 343 7.748 63.942 6.657 1.00 44.19 C ATOM 1949 C GLU A 343 7.714 63.216 5.291 1.00 43.58 C ATOM 1950 O GLU A 343 6.658 63.100 4.658 1.00 43.81 O ATOM 1951 CB GLU A 343 6.449 64.745 6.944 1.00 45.17 C ATOM 1952 CG GLU A 343 6.051 65.810 5.913 1.00 48.11 C ATOM 1953 CD GLU A 343 5.037 66.832 6.442 1.00 52.48 C ATOM 1954 OE1 GLU A 343 4.935 67.013 7.681 1.00 53.46 O ATOM 1955 OE2 GLU A 343 4.350 67.467 5.603 1.00 54.02 O ATOM 1956 HA GLU A 343 7.804 63.119 7.370 1.00 0.00 H ATOM 1957 HB2 GLU A 343 5.628 64.031 7.014 1.00 0.00 H ATOM 1958 HB3 GLU A 343 6.576 65.246 7.904 1.00 0.00 H ATOM 1959 HG2 GLU A 343 6.950 66.344 5.605 1.00 0.00 H ATOM 1960 HG3 GLU A 343 5.615 65.307 5.050 1.00 0.00 H ATOM 1961 H GLU A 343 9.436 64.601 7.840 1.00 0.00 H ATOM 1962 N GLY A 344 8.864 62.707 4.857 1.00 42.66 N ATOM 1963 CA GLY A 344 8.951 61.954 3.606 1.00 41.73 C ATOM 1964 C GLY A 344 9.054 62.797 2.338 1.00 41.30 C ATOM 1965 O GLY A 344 9.126 62.242 1.241 1.00 41.12 O ATOM 1966 HA3 GLY A 344 8.059 61.333 3.525 1.00 0.00 H ATOM 1967 HA2 GLY A 344 9.833 61.316 3.658 1.00 0.00 H ATOM 1968 H GLY A 344 9.725 62.848 5.423 1.00 0.00 H ATOM 1969 N GLN A 345 9.073 64.123 2.483 1.00 40.37 N ATOM 1970 CA GLN A 345 9.221 65.027 1.338 1.00 40.42 C ATOM 1971 C GLN A 345 10.635 64.988 0.773 1.00 40.01 C ATOM 1972 O GLN A 345 10.839 65.288 -0.408 1.00 40.12 O ATOM 1973 CB GLN A 345 8.861 66.473 1.700 1.00 40.34 C ATOM 1974 CG GLN A 345 7.376 66.716 1.954 1.00 41.93 C ATOM 1975 CD GLN A 345 7.078 68.110 2.529 1.00 44.67 C ATOM 1976 OE1 GLN A 345 7.839 68.648 3.344 1.00 45.01 O ATOM 1977 NE2 GLN A 345 5.952 68.687 2.117 1.00 45.39 N ATOM 1978 HA GLN A 345 8.524 64.673 0.578 1.00 0.00 H ATOM 1979 HB2 GLN A 345 9.409 66.744 2.603 1.00 0.00 H ATOM 1980 HB3 GLN A 345 9.175 67.117 0.879 1.00 0.00 H ATOM 1981 HG2 GLN A 345 6.841 66.609 1.010 1.00 0.00 H ATOM 1982 HG3 GLN A 345 7.018 65.966 2.660 1.00 0.00 H ATOM 1983 HE22 GLN A 345 5.340 68.201 1.431 1.00 0.00 H ATOM 1984 HE21 GLN A 345 5.684 69.624 2.481 1.00 0.00 H ATOM 1985 H GLN A 345 8.980 64.528 3.437 1.00 0.00 H ATOM 1986 N GLY A 346 11.599 64.613 1.616 1.00 39.20 N ATOM 1987 CA GLY A 346 13.006 64.572 1.228 1.00 38.58 C ATOM 1988 C GLY A 346 13.711 63.261 1.537 1.00 38.38 C ATOM 1989 O GLY A 346 13.224 62.445 2.310 1.00 38.30 O ATOM 1990 HA3 GLY A 346 13.527 65.371 1.755 1.00 0.00 H ATOM 1991 HA2 GLY A 346 13.068 64.746 0.154 1.00 0.00 H ATOM 1992 H GLY A 346 11.339 64.340 2.585 1.00 0.00 H ATOM 1993 N PHE A 347 14.867 63.060 0.922 1.00 38.56 N ATOM 1994 CA PHE A 347 15.670 61.872 1.158 1.00 38.92 C ATOM 1995 C PHE A 347 17.136 62.262 1.178 1.00 39.53 C ATOM 1996 O PHE A 347 17.675 62.745 0.174 1.00 39.76 O ATOM 1997 CB PHE A 347 15.389 60.814 0.091 1.00 38.62 C ATOM 1998 CG PHE A 347 16.129 59.521 0.295 1.00 38.71 C ATOM 1999 CD1 PHE A 347 17.247 59.214 -0.486 1.00 37.66 C ATOM 2000 CD2 PHE A 347 15.706 58.602 1.255 1.00 37.46 C ATOM 2001 CE1 PHE A 347 17.934 58.027 -0.312 1.00 37.44 C ATOM 2002 CE2 PHE A 347 16.382 57.405 1.432 1.00 37.57 C ATOM 2003 CZ PHE A 347 17.502 57.115 0.645 1.00 39.09 C ATOM 2004 HA PHE A 347 15.408 61.437 2.122 1.00 0.00 H ATOM 2005 HB2 PHE A 347 14.320 60.601 0.094 1.00 0.00 H ATOM 2006 HB3 PHE A 347 15.674 61.222 -0.879 1.00 0.00 H ATOM 2007 HD2 PHE A 347 14.836 58.827 1.872 1.00 0.00 H ATOM 2008 HE2 PHE A 347 16.042 56.691 2.182 1.00 0.00 H ATOM 2009 HZ PHE A 347 18.036 56.175 0.782 1.00 0.00 H ATOM 2010 HE1 PHE A 347 18.810 57.807 -0.922 1.00 0.00 H ATOM 2011 HD1 PHE A 347 17.582 59.922 -1.244 1.00 0.00 H ATOM 2012 H PHE A 347 15.211 63.775 0.249 1.00 0.00 H ATOM 2013 N MET A 348 17.774 62.068 2.329 1.00 40.05 N ATOM 2014 CA MET A 348 19.171 62.457 2.510 1.00 40.79 C ATOM 2015 C MET A 348 20.058 61.219 2.484 1.00 40.72 C ATOM 2016 O MET A 348 19.836 60.263 3.235 1.00 40.67 O ATOM 2017 CB MET A 348 19.353 63.247 3.811 1.00 41.39 C ATOM 2018 CG MET A 348 20.671 64.004 3.913 1.00 42.53 C ATOM 2019 SD MET A 348 20.688 65.148 5.306 1.00 47.33 S ATOM 2020 CE MET A 348 19.604 66.446 4.719 1.00 44.55 C ATOM 2021 HA MET A 348 19.467 63.111 1.689 1.00 0.00 H ATOM 2022 HB2 MET A 348 18.539 63.968 3.888 1.00 0.00 H ATOM 2023 HB3 MET A 348 19.297 62.547 4.645 1.00 0.00 H ATOM 2024 HG2 MET A 348 20.825 64.567 2.993 1.00 0.00 H ATOM 2025 HG3 MET A 348 21.481 63.285 4.038 1.00 0.00 H ATOM 2026 HE1 MET A 348 20.014 66.875 3.805 1.00 0.00 H ATOM 2027 HE2 MET A 348 18.617 66.029 4.516 1.00 0.00 H ATOM 2028 HE3 MET A 348 19.522 67.222 5.481 1.00 0.00 H ATOM 2029 H MET A 348 17.265 61.628 3.122 1.00 0.00 H ATOM 2030 N THR A 349 21.052 61.238 1.599 1.00 40.73 N ATOM 2031 CA THR A 349 21.881 60.065 1.356 1.00 40.72 C ATOM 2032 C THR A 349 22.850 59.812 2.507 1.00 41.17 C ATOM 2033 O THR A 349 23.367 60.748 3.117 1.00 40.32 O ATOM 2034 CB THR A 349 22.658 60.168 0.014 1.00 40.93 C ATOM 2035 OG1 THR A 349 23.624 61.222 0.085 1.00 39.91 O ATOM 2036 CG2 THR A 349 21.699 60.429 -1.163 1.00 40.13 C ATOM 2037 HA THR A 349 21.200 59.216 1.287 1.00 0.00 H ATOM 2038 HB THR A 349 23.165 59.218 -0.155 1.00 0.00 H ATOM 2039 HG1 THR A 349 24.113 61.279 -0.774 1.00 0.00 H ATOM 2040 HG23 THR A 349 20.964 59.626 -1.216 1.00 0.00 H ATOM 2041 HG21 THR A 349 21.189 61.380 -1.011 1.00 0.00 H ATOM 2042 HG22 THR A 349 22.268 60.465 -2.092 1.00 0.00 H ATOM 2043 H THR A 349 21.242 62.112 1.068 1.00 0.00 H ATOM 2044 N ARG A 350 23.061 58.529 2.795 1.00 42.30 N ATOM 2045 CA ARG A 350 24.024 58.065 3.782 1.00 43.79 C ATOM 2046 C ARG A 350 25.408 58.667 3.520 1.00 45.16 C ATOM 2047 O ARG A 350 26.059 59.157 4.454 1.00 45.37 O ATOM 2048 CB ARG A 350 24.079 56.534 3.754 1.00 43.76 C ATOM 2049 CG ARG A 350 24.854 55.859 4.879 1.00 43.10 C ATOM 2050 CD ARG A 350 24.744 54.362 4.700 1.00 43.15 C ATOM 2051 NE ARG A 350 25.429 53.571 5.724 1.00 43.24 N ATOM 2052 CZ ARG A 350 25.279 52.253 5.854 1.00 43.74 C ATOM 2053 NH1 ARG A 350 24.474 51.591 5.031 1.00 43.99 N ATOM 2054 NH2 ARG A 350 25.932 51.587 6.799 1.00 44.00 N ATOM 2055 HA ARG A 350 23.707 58.393 4.772 1.00 0.00 H ATOM 2056 HB2 ARG A 350 23.054 56.165 3.790 1.00 0.00 H ATOM 2057 HB3 ARG A 350 24.538 56.236 2.811 1.00 0.00 H ATOM 2058 HG2 ARG A 350 25.901 56.159 4.838 1.00 0.00 H ATOM 2059 HG3 ARG A 350 24.432 56.147 5.842 1.00 0.00 H ATOM 2060 HD2 ARG A 350 25.169 54.104 3.730 1.00 0.00 H ATOM 2061 HD3 ARG A 350 23.687 54.095 4.715 1.00 0.00 H ATOM 2062 HE ARG A 350 26.065 54.063 6.384 1.00 0.00 H ATOM 2063 HH12 ARG A 350 24.357 50.563 5.133 1.00 0.00 H ATOM 2064 HH11 ARG A 350 23.960 52.101 4.284 1.00 0.00 H ATOM 2065 HH22 ARG A 350 25.807 50.559 6.891 1.00 0.00 H ATOM 2066 HH21 ARG A 350 26.568 52.094 7.447 1.00 0.00 H ATOM 2067 H ARG A 350 22.504 57.815 2.283 1.00 0.00 H ATOM 2068 N GLU A 351 25.834 58.650 2.250 1.00 46.61 N ATOM 2069 CA GLU A 351 27.139 59.186 1.845 1.00 48.06 C ATOM 2070 C GLU A 351 27.291 60.676 2.117 1.00 48.45 C ATOM 2071 O GLU A 351 28.340 61.105 2.586 1.00 48.70 O ATOM 2072 CB GLU A 351 27.438 58.895 0.367 1.00 48.61 C ATOM 2073 CG GLU A 351 28.255 57.623 0.129 1.00 50.98 C ATOM 2074 CD GLU A 351 28.761 57.491 -1.303 1.00 54.98 C ATOM 2075 OE1 GLU A 351 28.862 58.526 -2.015 1.00 56.75 O ATOM 2076 OE2 GLU A 351 29.069 56.347 -1.716 1.00 55.84 O ATOM 2077 HA GLU A 351 27.868 58.666 2.467 1.00 0.00 H ATOM 2078 HB2 GLU A 351 26.489 58.796 -0.160 1.00 0.00 H ATOM 2079 HB3 GLU A 351 27.993 59.739 -0.042 1.00 0.00 H ATOM 2080 HG2 GLU A 351 29.114 57.632 0.800 1.00 0.00 H ATOM 2081 HG3 GLU A 351 27.628 56.761 0.355 1.00 0.00 H ATOM 2082 H GLU A 351 25.215 58.240 1.522 1.00 0.00 H ATOM 2083 N PHE A 352 26.257 61.465 1.825 1.00 49.04 N ATOM 2084 CA PHE A 352 26.325 62.902 2.077 1.00 49.61 C ATOM 2085 C PHE A 352 26.524 63.191 3.561 1.00 50.43 C ATOM 2086 O PHE A 352 27.247 64.117 3.927 1.00 50.60 O ATOM 2087 CB PHE A 352 25.082 63.620 1.554 1.00 49.39 C ATOM 2088 CG PHE A 352 25.034 65.084 1.899 1.00 48.60 C ATOM 2089 CD1 PHE A 352 26.030 65.952 1.464 1.00 48.44 C ATOM 2090 CD2 PHE A 352 23.992 65.594 2.656 1.00 47.97 C ATOM 2091 CE1 PHE A 352 25.989 67.304 1.780 1.00 47.49 C ATOM 2092 CE2 PHE A 352 23.942 66.946 2.977 1.00 48.36 C ATOM 2093 CZ PHE A 352 24.945 67.801 2.538 1.00 48.07 C ATOM 2094 HA PHE A 352 27.189 63.286 1.534 1.00 0.00 H ATOM 2095 HB2 PHE A 352 25.060 63.522 0.469 1.00 0.00 H ATOM 2096 HB3 PHE A 352 24.202 63.138 1.979 1.00 0.00 H ATOM 2097 HD2 PHE A 352 23.202 64.928 3.004 1.00 0.00 H ATOM 2098 HE2 PHE A 352 23.116 67.335 3.573 1.00 0.00 H ATOM 2099 HZ PHE A 352 24.909 68.861 2.790 1.00 0.00 H ATOM 2100 HE1 PHE A 352 26.777 67.971 1.431 1.00 0.00 H ATOM 2101 HD1 PHE A 352 26.855 65.565 0.866 1.00 0.00 H ATOM 2102 H PHE A 352 25.395 61.054 1.414 1.00 0.00 H ATOM 2103 N LEU A 353 25.888 62.378 4.401 1.00 51.48 N ATOM 2104 CA LEU A 353 25.955 62.528 5.853 1.00 52.43 C ATOM 2105 C LEU A 353 27.352 62.240 6.419 1.00 53.48 C ATOM 2106 O LEU A 353 27.774 62.898 7.367 1.00 53.69 O ATOM 2107 CB LEU A 353 24.868 61.679 6.537 1.00 51.99 C ATOM 2108 CG LEU A 353 23.441 62.246 6.410 1.00 51.29 C ATOM 2109 CD1 LEU A 353 22.375 61.188 6.592 1.00 50.01 C ATOM 2110 CD2 LEU A 353 23.215 63.404 7.383 1.00 50.90 C ATOM 2111 HA LEU A 353 25.758 63.576 6.078 1.00 0.00 H ATOM 2112 HB2 LEU A 353 24.881 60.685 6.090 1.00 0.00 H ATOM 2113 HB3 LEU A 353 25.111 61.603 7.597 1.00 0.00 H ATOM 2114 HG LEU A 353 23.351 62.623 5.391 1.00 0.00 H ATOM 2115 HD21 LEU A 353 23.359 63.052 8.404 1.00 0.00 H ATOM 2116 HD22 LEU A 353 23.926 64.202 7.168 1.00 0.00 H ATOM 2117 HD23 LEU A 353 22.199 63.781 7.268 1.00 0.00 H ATOM 2118 HD11 LEU A 353 22.497 60.416 5.832 1.00 0.00 H ATOM 2119 HD12 LEU A 353 22.472 60.743 7.582 1.00 0.00 H ATOM 2120 HD13 LEU A 353 21.390 61.645 6.492 1.00 0.00 H ATOM 2121 H LEU A 353 25.319 61.602 4.007 1.00 0.00 H ATOM 2122 N LYS A 354 28.065 61.276 5.830 1.00 54.73 N ATOM 2123 CA LYS A 354 29.456 60.974 6.213 1.00 56.04 C ATOM 2124 C LYS A 354 30.450 62.081 5.855 1.00 56.73 C ATOM 2125 O LYS A 354 31.470 62.238 6.519 1.00 57.02 O ATOM 2126 CB LYS A 354 29.929 59.667 5.572 1.00 56.15 C ATOM 2127 CG LYS A 354 29.552 58.402 6.333 1.00 56.92 C ATOM 2128 CD LYS A 354 29.670 57.160 5.448 1.00 57.99 C ATOM 2129 CE LYS A 354 31.125 56.783 5.183 1.00 59.60 C ATOM 2130 NZ LYS A 354 31.251 55.844 4.029 1.00 59.96 N ATOM 2131 HA LYS A 354 29.438 60.885 7.299 1.00 0.00 H ATOM 2132 HB2 LYS A 354 29.495 59.603 4.574 1.00 0.00 H ATOM 2133 HB3 LYS A 354 31.016 59.703 5.493 1.00 0.00 H ATOM 2134 HG2 LYS A 354 30.217 58.292 7.189 1.00 0.00 H ATOM 2135 HG3 LYS A 354 28.524 58.492 6.683 1.00 0.00 H ATOM 2136 HD2 LYS A 354 29.175 56.325 5.944 1.00 0.00 H ATOM 2137 HD3 LYS A 354 29.178 57.358 4.496 1.00 0.00 H ATOM 2138 HE2 LYS A 354 31.534 56.306 6.073 1.00 0.00 H ATOM 2139 HE3 LYS A 354 31.691 57.689 4.965 1.00 0.00 H ATOM 2140 HZ1 LYS A 354 30.719 54.974 4.232 1.00 0.00 H ATOM 2141 HZ2 LYS A 354 30.868 56.295 3.174 1.00 0.00 H ATOM 2142 HZ3 LYS A 354 32.254 55.612 3.881 1.00 0.00 H ATOM 2143 H LYS A 354 27.622 60.718 5.073 1.00 0.00 H ATOM 2144 N SER A 355 30.148 62.842 4.807 1.00 57.59 N ATOM 2145 CA SER A 355 31.073 63.848 4.278 1.00 58.27 C ATOM 2146 C SER A 355 31.090 65.146 5.085 1.00 58.71 C ATOM 2147 O SER A 355 31.850 66.067 4.773 1.00 58.96 O ATOM 2148 CB SER A 355 30.729 64.157 2.818 1.00 58.23 C ATOM 2149 OG SER A 355 29.556 64.950 2.737 1.00 58.51 O ATOM 2150 HA SER A 355 32.071 63.417 4.354 1.00 0.00 H ATOM 2151 HB2 SER A 355 30.567 63.222 2.282 1.00 0.00 H ATOM 2152 HB3 SER A 355 31.558 64.697 2.361 1.00 0.00 H ATOM 2153 HG SER A 355 28.800 64.461 3.148 1.00 0.00 H ATOM 2154 H SER A 355 29.223 62.719 4.347 1.00 0.00 H ATOM 2155 N LEU A 356 30.247 65.221 6.111 1.00 59.17 N ATOM 2156 CA LEU A 356 30.141 66.422 6.938 1.00 59.55 C ATOM 2157 C LEU A 356 31.395 66.649 7.782 1.00 59.77 C ATOM 2158 O LEU A 356 32.131 65.706 8.063 1.00 59.91 O ATOM 2159 CB LEU A 356 28.891 66.349 7.830 1.00 59.41 C ATOM 2160 CG LEU A 356 27.524 66.266 7.140 1.00 59.19 C ATOM 2161 CD1 LEU A 356 26.402 66.198 8.170 1.00 58.52 C ATOM 2162 CD2 LEU A 356 27.301 67.436 6.188 1.00 59.30 C ATOM 2163 HA LEU A 356 30.046 67.275 6.267 1.00 0.00 H ATOM 2164 HB2 LEU A 356 28.992 65.465 8.460 1.00 0.00 H ATOM 2165 HB3 LEU A 356 28.886 67.241 8.456 1.00 0.00 H ATOM 2166 HG LEU A 356 27.513 65.350 6.549 1.00 0.00 H ATOM 2167 HD21 LEU A 356 27.348 68.371 6.746 1.00 0.00 H ATOM 2168 HD22 LEU A 356 28.075 67.430 5.420 1.00 0.00 H ATOM 2169 HD23 LEU A 356 26.322 67.340 5.720 1.00 0.00 H ATOM 2170 HD11 LEU A 356 26.536 65.314 8.794 1.00 0.00 H ATOM 2171 HD12 LEU A 356 26.428 67.092 8.794 1.00 0.00 H ATOM 2172 HD13 LEU A 356 25.442 66.140 7.657 1.00 0.00 H ATOM 2173 H LEU A 356 29.646 64.402 6.331 1.00 0.00 H ATOM 2174 N ARG A 357 31.628 67.902 8.176 1.00 60.31 N ATOM 2175 CA ARG A 357 32.764 68.281 9.027 1.00 60.95 C ATOM 2176 C ARG A 357 32.960 67.294 10.186 1.00 61.12 C ATOM 2177 O ARG A 357 31.985 66.850 10.790 1.00 61.20 O ATOM 2178 CB ARG A 357 32.593 69.718 9.544 1.00 60.99 C ATOM 2179 CG ARG A 357 33.612 70.132 10.590 1.00 61.75 C ATOM 2180 CD ARG A 357 33.885 71.631 10.603 1.00 63.18 C ATOM 2181 NE ARG A 357 32.822 72.425 11.227 1.00 64.22 N ATOM 2182 CZ ARG A 357 32.495 72.391 12.519 1.00 64.25 C ATOM 2183 NH1 ARG A 357 33.119 71.573 13.359 1.00 64.37 N ATOM 2184 NH2 ARG A 357 31.520 73.167 12.972 1.00 63.86 N ATOM 2185 HA ARG A 357 33.666 68.240 8.416 1.00 0.00 H ATOM 2186 HB2 ARG A 357 32.678 70.398 8.697 1.00 0.00 H ATOM 2187 HB3 ARG A 357 31.599 69.807 9.982 1.00 0.00 H ATOM 2188 HG2 ARG A 357 33.240 69.839 11.572 1.00 0.00 H ATOM 2189 HG3 ARG A 357 34.548 69.611 10.387 1.00 0.00 H ATOM 2190 HD2 ARG A 357 34.005 71.967 9.573 1.00 0.00 H ATOM 2191 HD3 ARG A 357 34.811 71.806 11.151 1.00 0.00 H ATOM 2192 HE ARG A 357 32.280 73.066 10.613 1.00 0.00 H ATOM 2193 HH12 ARG A 357 32.853 71.558 14.364 1.00 0.00 H ATOM 2194 HH11 ARG A 357 33.874 70.948 13.012 1.00 0.00 H ATOM 2195 HH22 ARG A 357 31.262 73.143 13.979 1.00 0.00 H ATOM 2196 HH21 ARG A 357 31.013 73.799 12.320 1.00 0.00 H ATOM 2197 H ARG A 357 30.973 68.648 7.865 1.00 0.00 H ATOM 2198 N LYS A 358 34.226 66.981 10.479 1.00 61.30 N ATOM 2199 CA LYS A 358 34.657 65.888 11.385 1.00 61.31 C ATOM 2200 C LYS A 358 33.807 65.496 12.617 1.00 60.88 C ATOM 2201 O LYS A 358 33.603 64.297 12.860 1.00 61.10 O ATOM 2202 CB LYS A 358 36.122 66.080 11.812 1.00 61.57 C ATOM 2203 CG LYS A 358 37.122 65.230 11.032 1.00 62.76 C ATOM 2204 CD LYS A 358 38.435 65.082 11.806 1.00 64.32 C ATOM 2205 CE LYS A 358 39.379 64.085 11.144 1.00 64.33 C ATOM 2206 NZ LYS A 358 40.597 63.879 11.974 1.00 64.49 N ATOM 2207 HA LYS A 358 34.498 65.030 10.732 1.00 0.00 H ATOM 2208 HB2 LYS A 358 36.384 67.129 11.672 1.00 0.00 H ATOM 2209 HB3 LYS A 358 36.206 65.823 12.868 1.00 0.00 H ATOM 2210 HG2 LYS A 358 36.694 64.242 10.862 1.00 0.00 H ATOM 2211 HG3 LYS A 358 37.325 65.707 10.073 1.00 0.00 H ATOM 2212 HD2 LYS A 358 38.927 66.054 11.855 1.00 0.00 H ATOM 2213 HD3 LYS A 358 38.212 64.738 12.816 1.00 0.00 H ATOM 2214 HE2 LYS A 358 39.673 64.466 10.166 1.00 0.00 H ATOM 2215 HE3 LYS A 358 38.864 63.132 11.022 1.00 0.00 H ATOM 2216 HZ1 LYS A 358 41.093 64.785 12.090 1.00 0.00 H ATOM 2217 HZ2 LYS A 358 40.321 63.512 12.907 1.00 0.00 H ATOM 2218 HZ3 LYS A 358 41.225 63.196 11.503 1.00 0.00 H ATOM 2219 H LYS A 358 34.972 67.552 10.034 1.00 0.00 H ATOM 2220 N PRO A 359 33.341 66.481 13.418 1.00 60.27 N ATOM 2221 CA PRO A 359 32.489 66.054 14.542 1.00 59.63 C ATOM 2222 C PRO A 359 31.003 65.819 14.195 1.00 58.89 C ATOM 2223 O PRO A 359 30.219 65.503 15.092 1.00 58.98 O ATOM 2224 CB PRO A 359 32.630 67.207 15.543 1.00 59.61 C ATOM 2225 CG PRO A 359 32.901 68.403 14.694 1.00 60.02 C ATOM 2226 CD PRO A 359 33.696 67.913 13.508 1.00 60.13 C ATOM 2227 HA PRO A 359 32.809 65.079 14.909 1.00 0.00 H ATOM 2228 HD3 PRO A 359 33.408 68.443 12.600 1.00 0.00 H ATOM 2229 HD2 PRO A 359 34.765 68.039 13.677 1.00 0.00 H ATOM 2230 HG3 PRO A 359 33.475 69.141 15.254 1.00 0.00 H ATOM 2231 HG2 PRO A 359 31.964 68.850 14.361 1.00 0.00 H ATOM 2232 HB2 PRO A 359 31.710 67.338 16.113 1.00 0.00 H ATOM 2233 HB3 PRO A 359 33.458 67.024 16.228 1.00 0.00 H ATOM 2234 N PHE A 360 30.629 65.956 12.921 1.00 57.84 N ATOM 2235 CA PHE A 360 29.226 65.820 12.489 1.00 56.84 C ATOM 2236 C PHE A 360 28.989 64.719 11.446 1.00 56.49 C ATOM 2237 O PHE A 360 27.841 64.376 11.154 1.00 56.46 O ATOM 2238 CB PHE A 360 28.694 67.150 11.944 1.00 56.53 C ATOM 2239 CG PHE A 360 28.622 68.248 12.967 1.00 55.94 C ATOM 2240 CD1 PHE A 360 27.541 68.336 13.843 1.00 55.29 C ATOM 2241 CD2 PHE A 360 29.629 69.210 13.047 1.00 55.62 C ATOM 2242 CE1 PHE A 360 27.468 69.362 14.793 1.00 54.79 C ATOM 2243 CE2 PHE A 360 29.565 70.237 13.993 1.00 55.32 C ATOM 2244 CZ PHE A 360 28.479 70.313 14.865 1.00 54.98 C ATOM 2245 HA PHE A 360 28.682 65.526 13.386 1.00 0.00 H ATOM 2246 HB2 PHE A 360 29.350 67.476 11.137 1.00 0.00 H ATOM 2247 HB3 PHE A 360 27.691 66.982 11.550 1.00 0.00 H ATOM 2248 HD2 PHE A 360 30.476 69.160 12.363 1.00 0.00 H ATOM 2249 HE2 PHE A 360 30.363 70.978 14.049 1.00 0.00 H ATOM 2250 HZ PHE A 360 28.423 71.116 15.600 1.00 0.00 H ATOM 2251 HE1 PHE A 360 26.619 69.415 15.475 1.00 0.00 H ATOM 2252 HD1 PHE A 360 26.742 67.596 13.788 1.00 0.00 H ATOM 2253 H PHE A 360 31.355 66.167 12.206 1.00 0.00 H ATOM 2254 N GLY A 361 30.064 64.174 10.881 1.00 55.82 N ATOM 2255 CA GLY A 361 29.946 63.137 9.862 1.00 54.97 C ATOM 2256 C GLY A 361 29.931 61.740 10.439 1.00 54.67 C ATOM 2257 O GLY A 361 30.011 60.754 9.706 1.00 54.60 O ATOM 2258 HA3 GLY A 361 30.792 63.222 9.180 1.00 0.00 H ATOM 2259 HA2 GLY A 361 29.019 63.295 9.311 1.00 0.00 H ATOM 2260 H GLY A 361 31.009 64.495 11.173 1.00 0.00 H ATOM 2261 N ASP A 362 29.802 61.661 11.761 1.00 54.42 N ATOM 2262 CA ASP A 362 29.920 60.409 12.499 1.00 53.99 C ATOM 2263 C ASP A 362 28.608 59.877 13.074 1.00 53.07 C ATOM 2264 O ASP A 362 28.408 58.666 13.135 1.00 53.07 O ATOM 2265 CB ASP A 362 30.922 60.582 13.641 1.00 54.21 C ATOM 2266 CG ASP A 362 32.333 60.288 13.219 1.00 55.86 C ATOM 2267 OD1 ASP A 362 32.595 59.143 12.790 1.00 58.23 O ATOM 2268 OD2 ASP A 362 33.184 61.196 13.329 1.00 57.17 O ATOM 2269 HA ASP A 362 30.256 59.672 11.770 1.00 0.00 H ATOM 2270 HB2 ASP A 362 30.871 61.611 13.998 1.00 0.00 H ATOM 2271 HB3 ASP A 362 30.651 59.904 14.450 1.00 0.00 H ATOM 2272 H ASP A 362 29.608 62.533 12.293 1.00 0.00 H ATOM 2273 N PHE A 363 27.728 60.775 13.504 1.00 52.20 N ATOM 2274 CA PHE A 363 26.590 60.371 14.333 1.00 51.37 C ATOM 2275 C PHE A 363 25.528 59.522 13.646 1.00 50.46 C ATOM 2276 O PHE A 363 24.865 58.730 14.314 1.00 50.51 O ATOM 2277 CB PHE A 363 25.977 61.566 15.087 1.00 51.57 C ATOM 2278 CG PHE A 363 25.225 62.544 14.218 1.00 51.99 C ATOM 2279 CD1 PHE A 363 25.882 63.610 13.619 1.00 52.08 C ATOM 2280 CD2 PHE A 363 23.844 62.428 14.049 1.00 52.49 C ATOM 2281 CE1 PHE A 363 25.184 64.535 12.831 1.00 52.76 C ATOM 2282 CE2 PHE A 363 23.135 63.349 13.270 1.00 53.21 C ATOM 2283 CZ PHE A 363 23.807 64.403 12.654 1.00 53.20 C ATOM 2284 HA PHE A 363 27.029 59.689 15.061 1.00 0.00 H ATOM 2285 HB2 PHE A 363 25.287 61.177 15.836 1.00 0.00 H ATOM 2286 HB3 PHE A 363 26.784 62.104 15.584 1.00 0.00 H ATOM 2287 HD2 PHE A 363 23.311 61.608 14.531 1.00 0.00 H ATOM 2288 HE2 PHE A 363 22.057 63.242 13.145 1.00 0.00 H ATOM 2289 HZ PHE A 363 23.261 65.118 12.039 1.00 0.00 H ATOM 2290 HE1 PHE A 363 25.718 65.358 12.356 1.00 0.00 H ATOM 2291 HD1 PHE A 363 26.956 63.729 13.764 1.00 0.00 H ATOM 2292 H PHE A 363 27.849 61.776 13.249 1.00 0.00 H ATOM 2293 N MET A 364 25.393 59.648 12.326 1.00 49.57 N ATOM 2294 CA MET A 364 24.349 58.914 11.591 1.00 48.68 C ATOM 2295 C MET A 364 24.714 57.489 11.194 1.00 47.98 C ATOM 2296 O MET A 364 23.832 56.633 11.105 1.00 48.04 O ATOM 2297 CB MET A 364 23.873 59.689 10.358 1.00 48.63 C ATOM 2298 CG MET A 364 22.945 60.864 10.667 1.00 48.52 C ATOM 2299 SD MET A 364 21.538 60.483 11.742 1.00 48.32 S ATOM 2300 CE MET A 364 20.552 59.438 10.680 1.00 46.64 C ATOM 2301 HA MET A 364 23.537 58.826 12.312 1.00 0.00 H ATOM 2302 HB2 MET A 364 24.750 60.075 9.839 1.00 0.00 H ATOM 2303 HB3 MET A 364 23.341 58.997 9.705 1.00 0.00 H ATOM 2304 HG2 MET A 364 22.554 61.241 9.722 1.00 0.00 H ATOM 2305 HG3 MET A 364 23.537 61.642 11.150 1.00 0.00 H ATOM 2306 HE1 MET A 364 20.273 59.993 9.784 1.00 0.00 H ATOM 2307 HE2 MET A 364 21.131 58.558 10.399 1.00 0.00 H ATOM 2308 HE3 MET A 364 19.652 59.128 11.212 1.00 0.00 H ATOM 2309 H MET A 364 26.037 60.277 11.805 1.00 0.00 H ATOM 2310 N GLU A 365 25.998 57.228 10.960 1.00 47.03 N ATOM 2311 CA GLU A 365 26.426 55.915 10.438 1.00 46.45 C ATOM 2312 C GLU A 365 25.993 54.685 11.272 1.00 45.49 C ATOM 2313 O GLU A 365 25.452 53.732 10.711 1.00 45.45 O ATOM 2314 CB GLU A 365 27.935 55.912 10.133 1.00 46.90 C ATOM 2315 CG GLU A 365 28.466 54.673 9.402 1.00 48.32 C ATOM 2316 CD GLU A 365 27.817 54.416 8.049 1.00 50.66 C ATOM 2317 OE1 GLU A 365 27.315 55.370 7.404 1.00 51.68 O ATOM 2318 OE2 GLU A 365 27.813 53.238 7.629 1.00 51.79 O ATOM 2319 HA GLU A 365 25.875 55.790 9.506 1.00 0.00 H ATOM 2320 HB2 GLU A 365 28.153 56.784 9.516 1.00 0.00 H ATOM 2321 HB3 GLU A 365 28.468 55.996 11.080 1.00 0.00 H ATOM 2322 HG2 GLU A 365 29.537 54.801 9.248 1.00 0.00 H ATOM 2323 HG3 GLU A 365 28.292 53.803 10.035 1.00 0.00 H ATOM 2324 H GLU A 365 26.711 57.961 11.148 1.00 0.00 H ATOM 2325 N PRO A 366 26.205 54.700 12.603 1.00 44.65 N ATOM 2326 CA PRO A 366 25.747 53.540 13.390 1.00 44.16 C ATOM 2327 C PRO A 366 24.218 53.344 13.422 1.00 43.42 C ATOM 2328 O PRO A 366 23.754 52.226 13.626 1.00 43.32 O ATOM 2329 CB PRO A 366 26.287 53.827 14.798 1.00 44.28 C ATOM 2330 CG PRO A 366 26.505 55.309 14.827 1.00 44.92 C ATOM 2331 CD PRO A 366 26.931 55.674 13.439 1.00 44.73 C ATOM 2332 HA PRO A 366 26.108 52.612 12.947 1.00 0.00 H ATOM 2333 HD3 PRO A 366 26.639 56.695 13.195 1.00 0.00 H ATOM 2334 HD2 PRO A 366 28.009 55.567 13.319 1.00 0.00 H ATOM 2335 HG3 PRO A 366 27.283 55.567 15.546 1.00 0.00 H ATOM 2336 HG2 PRO A 366 25.582 55.826 15.092 1.00 0.00 H ATOM 2337 HB2 PRO A 366 25.562 53.530 15.556 1.00 0.00 H ATOM 2338 HB3 PRO A 366 27.224 53.297 14.966 1.00 0.00 H ATOM 2339 N LYS A 367 23.454 54.416 13.215 1.00 42.63 N ATOM 2340 CA LYS A 367 21.995 54.312 13.054 1.00 41.77 C ATOM 2341 C LYS A 367 21.641 53.571 11.761 1.00 41.14 C ATOM 2342 O LYS A 367 20.735 52.730 11.753 1.00 40.99 O ATOM 2343 CB LYS A 367 21.329 55.697 13.094 1.00 41.75 C ATOM 2344 CG LYS A 367 21.197 56.307 14.489 1.00 41.96 C ATOM 2345 CD LYS A 367 22.534 56.769 15.013 1.00 43.27 C ATOM 2346 CE LYS A 367 22.451 57.447 16.366 1.00 43.47 C ATOM 2347 NZ LYS A 367 23.823 57.868 16.808 1.00 44.45 N ATOM 2348 HA LYS A 367 21.608 53.734 13.893 1.00 0.00 H ATOM 2349 HB2 LYS A 367 21.922 56.376 12.482 1.00 0.00 H ATOM 2350 HB3 LYS A 367 20.330 55.605 12.668 1.00 0.00 H ATOM 2351 HG2 LYS A 367 20.520 57.160 14.442 1.00 0.00 H ATOM 2352 HG3 LYS A 367 20.789 55.558 15.167 1.00 0.00 H ATOM 2353 HD2 LYS A 367 23.189 55.902 15.101 1.00 0.00 H ATOM 2354 HD3 LYS A 367 22.960 57.474 14.299 1.00 0.00 H ATOM 2355 HE2 LYS A 367 22.033 56.752 17.094 1.00 0.00 H ATOM 2356 HE3 LYS A 367 21.809 58.325 16.293 1.00 0.00 H ATOM 2357 HZ1 LYS A 367 24.435 57.030 16.879 1.00 0.00 H ATOM 2358 HZ2 LYS A 367 24.221 58.532 16.114 1.00 0.00 H ATOM 2359 HZ3 LYS A 367 23.760 58.332 17.736 1.00 0.00 H ATOM 2360 H LYS A 367 23.902 55.353 13.166 1.00 0.00 H ATOM 2361 N PHE A 368 22.368 53.873 10.681 1.00 40.38 N ATOM 2362 CA PHE A 368 22.215 53.159 9.411 1.00 39.51 C ATOM 2363 C PHE A 368 22.553 51.684 9.562 1.00 39.86 C ATOM 2364 O PHE A 368 21.784 50.815 9.132 1.00 39.53 O ATOM 2365 CB PHE A 368 23.074 53.790 8.303 1.00 38.98 C ATOM 2366 CG PHE A 368 22.470 55.023 7.695 1.00 37.27 C ATOM 2367 CD1 PHE A 368 21.292 54.949 6.958 1.00 35.93 C ATOM 2368 CD2 PHE A 368 23.067 56.257 7.864 1.00 35.47 C ATOM 2369 CE1 PHE A 368 20.722 56.089 6.399 1.00 34.76 C ATOM 2370 CE2 PHE A 368 22.497 57.403 7.308 1.00 35.33 C ATOM 2371 CZ PHE A 368 21.324 57.313 6.576 1.00 34.51 C ATOM 2372 HA PHE A 368 21.168 53.244 9.121 1.00 0.00 H ATOM 2373 HB2 PHE A 368 24.042 54.055 8.728 1.00 0.00 H ATOM 2374 HB3 PHE A 368 23.215 53.051 7.514 1.00 0.00 H ATOM 2375 HD2 PHE A 368 23.991 56.336 8.436 1.00 0.00 H ATOM 2376 HE2 PHE A 368 22.976 58.372 7.450 1.00 0.00 H ATOM 2377 HZ PHE A 368 20.880 58.209 6.142 1.00 0.00 H ATOM 2378 HE1 PHE A 368 19.800 56.012 5.822 1.00 0.00 H ATOM 2379 HD1 PHE A 368 20.808 53.983 6.816 1.00 0.00 H ATOM 2380 H PHE A 368 23.066 54.641 10.744 1.00 0.00 H ATOM 2381 N GLU A 369 23.698 51.405 10.190 1.00 40.40 N ATOM 2382 CA GLU A 369 24.148 50.022 10.407 1.00 40.86 C ATOM 2383 C GLU A 369 23.161 49.240 11.257 1.00 40.33 C ATOM 2384 O GLU A 369 22.945 48.051 11.020 1.00 40.06 O ATOM 2385 CB GLU A 369 25.558 49.966 11.019 1.00 41.34 C ATOM 2386 CG GLU A 369 26.667 50.336 10.026 1.00 44.06 C ATOM 2387 CD GLU A 369 28.063 50.085 10.569 1.00 48.27 C ATOM 2388 OE1 GLU A 369 28.717 51.061 11.003 1.00 49.46 O ATOM 2389 OE2 GLU A 369 28.502 48.911 10.564 1.00 50.63 O ATOM 2390 HA GLU A 369 24.195 49.550 9.426 1.00 0.00 H ATOM 2391 HB2 GLU A 369 25.599 50.661 11.858 1.00 0.00 H ATOM 2392 HB3 GLU A 369 25.739 48.953 11.378 1.00 0.00 H ATOM 2393 HG2 GLU A 369 26.535 49.743 9.121 1.00 0.00 H ATOM 2394 HG3 GLU A 369 26.575 51.394 9.782 1.00 0.00 H ATOM 2395 H GLU A 369 24.288 52.188 10.536 1.00 0.00 H ATOM 2396 N PHE A 370 22.554 49.905 12.240 1.00 39.88 N ATOM 2397 CA PHE A 370 21.465 49.274 12.984 1.00 39.67 C ATOM 2398 C PHE A 370 20.260 49.028 12.075 1.00 39.08 C ATOM 2399 O PHE A 370 19.710 47.930 12.044 1.00 39.03 O ATOM 2400 CB PHE A 370 21.065 50.093 14.216 1.00 39.65 C ATOM 2401 CG PHE A 370 19.810 49.593 14.892 1.00 39.93 C ATOM 2402 CD1 PHE A 370 19.836 48.449 15.679 1.00 40.28 C ATOM 2403 CD2 PHE A 370 18.598 50.258 14.716 1.00 39.76 C ATOM 2404 CE1 PHE A 370 18.679 47.980 16.294 1.00 40.62 C ATOM 2405 CE2 PHE A 370 17.432 49.801 15.330 1.00 39.49 C ATOM 2406 CZ PHE A 370 17.472 48.663 16.116 1.00 40.21 C ATOM 2407 HA PHE A 370 21.829 48.311 13.342 1.00 0.00 H ATOM 2408 HB2 PHE A 370 21.883 50.056 14.936 1.00 0.00 H ATOM 2409 HB3 PHE A 370 20.902 51.125 13.906 1.00 0.00 H ATOM 2410 HD2 PHE A 370 18.561 51.149 14.089 1.00 0.00 H ATOM 2411 HE2 PHE A 370 16.494 50.338 15.191 1.00 0.00 H ATOM 2412 HZ PHE A 370 16.563 48.299 16.596 1.00 0.00 H ATOM 2413 HE1 PHE A 370 18.714 47.083 16.912 1.00 0.00 H ATOM 2414 HD1 PHE A 370 20.774 47.912 15.817 1.00 0.00 H ATOM 2415 H PHE A 370 22.855 50.872 12.477 1.00 0.00 H ATOM 2416 N ALA A 371 19.874 50.051 11.322 1.00 39.33 N ATOM 2417 CA ALA A 371 18.688 49.985 10.460 1.00 39.38 C ATOM 2418 C ALA A 371 18.747 48.844 9.444 1.00 39.82 C ATOM 2419 O ALA A 371 17.750 48.151 9.233 1.00 40.03 O ATOM 2420 CB ALA A 371 18.475 51.302 9.760 1.00 39.12 C ATOM 2421 HA ALA A 371 17.839 49.777 11.112 1.00 0.00 H ATOM 2422 HB1 ALA A 371 18.333 52.088 10.502 1.00 0.00 H ATOM 2423 HB2 ALA A 371 19.347 51.532 9.148 1.00 0.00 H ATOM 2424 HB3 ALA A 371 17.592 51.236 9.125 1.00 0.00 H ATOM 2425 H ALA A 371 20.431 50.929 11.344 1.00 0.00 H ATOM 2426 N VAL A 372 19.914 48.647 8.825 1.00 40.18 N ATOM 2427 CA VAL A 372 20.112 47.572 7.838 1.00 40.12 C ATOM 2428 C VAL A 372 19.852 46.189 8.434 1.00 40.11 C ATOM 2429 O VAL A 372 19.241 45.334 7.790 1.00 40.31 O ATOM 2430 CB VAL A 372 21.520 47.672 7.169 1.00 40.47 C ATOM 2431 CG1 VAL A 372 21.965 46.345 6.541 1.00 40.57 C ATOM 2432 CG2 VAL A 372 21.525 48.783 6.132 1.00 39.82 C ATOM 2433 HA VAL A 372 19.370 47.710 7.052 1.00 0.00 H ATOM 2434 HB VAL A 372 22.239 47.906 7.954 1.00 0.00 H ATOM 2435 HG11 VAL A 372 22.012 45.577 7.313 1.00 0.00 H ATOM 2436 HG12 VAL A 372 21.248 46.048 5.775 1.00 0.00 H ATOM 2437 HG13 VAL A 372 22.949 46.470 6.090 1.00 0.00 H ATOM 2438 HG21 VAL A 372 20.778 48.568 5.367 1.00 0.00 H ATOM 2439 HG22 VAL A 372 21.289 49.731 6.616 1.00 0.00 H ATOM 2440 HG23 VAL A 372 22.511 48.844 5.672 1.00 0.00 H ATOM 2441 H VAL A 372 20.712 49.276 9.048 1.00 0.00 H ATOM 2442 N LYS A 373 20.298 45.980 9.670 1.00 40.52 N ATOM 2443 CA LYS A 373 20.044 44.723 10.391 1.00 40.64 C ATOM 2444 C LYS A 373 18.633 44.660 10.987 1.00 40.06 C ATOM 2445 O LYS A 373 17.985 43.615 10.933 1.00 40.18 O ATOM 2446 CB LYS A 373 21.080 44.499 11.505 1.00 41.32 C ATOM 2447 CG LYS A 373 22.544 44.455 11.045 1.00 43.39 C ATOM 2448 CD LYS A 373 23.361 43.488 11.914 1.00 47.27 C ATOM 2449 CE LYS A 373 23.004 42.016 11.598 1.00 48.78 C ATOM 2450 NZ LYS A 373 23.197 41.089 12.761 1.00 50.80 N ATOM 2451 HA LYS A 373 20.132 43.929 9.650 1.00 0.00 H ATOM 2452 HB2 LYS A 373 20.978 45.309 12.227 1.00 0.00 H ATOM 2453 HB3 LYS A 373 20.851 43.551 11.991 1.00 0.00 H ATOM 2454 HG2 LYS A 373 22.583 44.123 10.007 1.00 0.00 H ATOM 2455 HG3 LYS A 373 22.973 45.454 11.122 1.00 0.00 H ATOM 2456 HD2 LYS A 373 24.422 43.646 11.722 1.00 0.00 H ATOM 2457 HD3 LYS A 373 23.150 43.688 12.964 1.00 0.00 H ATOM 2458 HE2 LYS A 373 23.636 41.676 10.777 1.00 0.00 H ATOM 2459 HE3 LYS A 373 21.959 41.973 11.292 1.00 0.00 H ATOM 2460 HZ1 LYS A 373 24.193 41.111 13.059 1.00 0.00 H ATOM 2461 HZ2 LYS A 373 22.592 41.394 13.550 1.00 0.00 H ATOM 2462 HZ3 LYS A 373 22.939 40.122 12.478 1.00 0.00 H ATOM 2463 H LYS A 373 20.844 46.729 10.142 1.00 0.00 H ATOM 2464 N PHE A 374 18.154 45.765 11.561 1.00 39.32 N ATOM 2465 CA PHE A 374 16.809 45.762 12.145 1.00 38.49 C ATOM 2466 C PHE A 374 15.747 45.539 11.077 1.00 37.98 C ATOM 2467 O PHE A 374 14.811 44.756 11.277 1.00 37.47 O ATOM 2468 CB PHE A 374 16.532 47.036 12.954 1.00 38.65 C ATOM 2469 CG PHE A 374 15.267 46.970 13.784 1.00 38.35 C ATOM 2470 CD1 PHE A 374 15.243 46.265 14.992 1.00 38.61 C ATOM 2471 CD2 PHE A 374 14.101 47.615 13.359 1.00 37.62 C ATOM 2472 CE1 PHE A 374 14.081 46.203 15.766 1.00 37.78 C ATOM 2473 CE2 PHE A 374 12.935 47.561 14.126 1.00 37.51 C ATOM 2474 CZ PHE A 374 12.925 46.854 15.330 1.00 37.62 C ATOM 2475 HA PHE A 374 16.761 44.926 12.843 1.00 0.00 H ATOM 2476 HB2 PHE A 374 17.374 47.208 13.624 1.00 0.00 H ATOM 2477 HB3 PHE A 374 16.445 47.872 12.260 1.00 0.00 H ATOM 2478 HD2 PHE A 374 14.102 48.166 12.419 1.00 0.00 H ATOM 2479 HE2 PHE A 374 12.034 48.070 13.785 1.00 0.00 H ATOM 2480 HZ PHE A 374 12.016 46.810 15.929 1.00 0.00 H ATOM 2481 HE1 PHE A 374 14.077 45.649 16.705 1.00 0.00 H ATOM 2482 HD1 PHE A 374 16.144 45.756 15.335 1.00 0.00 H ATOM 2483 H PHE A 374 18.734 46.628 11.594 1.00 0.00 H ATOM 2484 N ASN A 375 15.921 46.192 9.929 1.00 37.69 N ATOM 2485 CA ASN A 375 14.983 46.064 8.812 1.00 37.58 C ATOM 2486 C ASN A 375 14.879 44.671 8.212 1.00 37.87 C ATOM 2487 O ASN A 375 13.842 44.331 7.635 1.00 37.39 O ATOM 2488 CB ASN A 375 15.289 47.085 7.712 1.00 37.68 C ATOM 2489 CG ASN A 375 14.926 48.501 8.116 1.00 37.35 C ATOM 2490 OD1 ASN A 375 15.365 49.469 7.492 1.00 37.79 O ATOM 2491 ND2 ASN A 375 14.135 48.630 9.173 1.00 35.32 N ATOM 2492 HA ASN A 375 14.008 46.269 9.254 1.00 0.00 H ATOM 2493 HB2 ASN A 375 16.355 47.048 7.487 1.00 0.00 H ATOM 2494 HB3 ASN A 375 14.721 46.819 6.820 1.00 0.00 H ATOM 2495 HD22 ASN A 375 13.788 47.784 9.669 1.00 0.00 H ATOM 2496 HD21 ASN A 375 13.862 49.577 9.506 1.00 0.00 H ATOM 2497 H ASN A 375 16.749 46.812 9.823 1.00 0.00 H ATOM 2498 N ALA A 376 15.941 43.870 8.359 1.00 38.16 N ATOM 2499 CA ALA A 376 15.948 42.473 7.888 1.00 38.82 C ATOM 2500 C ALA A 376 14.892 41.600 8.580 1.00 39.00 C ATOM 2501 O ALA A 376 14.490 40.562 8.044 1.00 39.33 O ATOM 2502 CB ALA A 376 17.354 41.844 8.047 1.00 39.00 C ATOM 2503 HA ALA A 376 15.687 42.506 6.830 1.00 0.00 H ATOM 2504 HB1 ALA A 376 18.075 42.416 7.462 1.00 0.00 H ATOM 2505 HB2 ALA A 376 17.642 41.862 9.098 1.00 0.00 H ATOM 2506 HB3 ALA A 376 17.332 40.814 7.692 1.00 0.00 H ATOM 2507 H ALA A 376 16.792 44.247 8.822 1.00 0.00 H ATOM 2508 N LEU A 377 14.440 42.022 9.762 1.00 39.10 N ATOM 2509 CA LEU A 377 13.361 41.319 10.478 1.00 39.09 C ATOM 2510 C LEU A 377 11.999 41.460 9.782 1.00 39.25 C ATOM 2511 O LEU A 377 11.096 40.649 10.007 1.00 39.26 O ATOM 2512 CB LEU A 377 13.275 41.782 11.939 1.00 39.02 C ATOM 2513 CG LEU A 377 14.561 41.712 12.771 1.00 39.62 C ATOM 2514 CD1 LEU A 377 14.288 42.070 14.219 1.00 39.97 C ATOM 2515 CD2 LEU A 377 15.225 40.322 12.666 1.00 39.51 C ATOM 2516 HA LEU A 377 13.617 40.260 10.463 1.00 0.00 H ATOM 2517 HB2 LEU A 377 12.942 42.820 11.936 1.00 0.00 H ATOM 2518 HB3 LEU A 377 12.528 41.163 12.436 1.00 0.00 H ATOM 2519 HG LEU A 377 15.258 42.444 12.363 1.00 0.00 H ATOM 2520 HD21 LEU A 377 14.534 39.562 13.031 1.00 0.00 H ATOM 2521 HD22 LEU A 377 15.474 40.118 11.625 1.00 0.00 H ATOM 2522 HD23 LEU A 377 16.134 40.308 13.268 1.00 0.00 H ATOM 2523 HD11 LEU A 377 13.890 43.083 14.273 1.00 0.00 H ATOM 2524 HD12 LEU A 377 13.562 41.371 14.634 1.00 0.00 H ATOM 2525 HD13 LEU A 377 15.216 42.013 14.787 1.00 0.00 H ATOM 2526 H LEU A 377 14.861 42.871 10.190 1.00 0.00 H ATOM 2527 N GLU A 378 11.871 42.482 8.932 1.00 39.35 N ATOM 2528 CA GLU A 378 10.644 42.752 8.151 1.00 39.72 C ATOM 2529 C GLU A 378 9.395 42.971 9.017 1.00 39.03 C ATOM 2530 O GLU A 378 8.321 42.448 8.720 1.00 39.08 O ATOM 2531 CB GLU A 378 10.395 41.659 7.097 1.00 39.95 C ATOM 2532 CG GLU A 378 11.465 41.574 6.008 1.00 42.00 C ATOM 2533 CD GLU A 378 11.065 40.626 4.897 1.00 45.50 C ATOM 2534 OE1 GLU A 378 11.115 39.395 5.101 1.00 46.41 O ATOM 2535 OE2 GLU A 378 10.681 41.115 3.817 1.00 49.40 O ATOM 2536 HA GLU A 378 10.828 43.696 7.639 1.00 0.00 H ATOM 2537 HB2 GLU A 378 10.351 40.697 7.607 1.00 0.00 H ATOM 2538 HB3 GLU A 378 9.436 41.859 6.618 1.00 0.00 H ATOM 2539 HG2 GLU A 378 11.619 42.567 5.586 1.00 0.00 H ATOM 2540 HG3 GLU A 378 12.395 41.222 6.454 1.00 0.00 H ATOM 2541 H GLU A 378 12.680 43.125 8.812 1.00 0.00 H ATOM 2542 N LEU A 379 9.548 43.736 10.091 1.00 38.67 N ATOM 2543 CA LEU A 379 8.426 44.032 10.972 1.00 38.29 C ATOM 2544 C LEU A 379 7.546 45.052 10.259 1.00 37.92 C ATOM 2545 O LEU A 379 8.038 45.847 9.463 1.00 38.30 O ATOM 2546 CB LEU A 379 8.912 44.580 12.324 1.00 38.02 C ATOM 2547 CG LEU A 379 9.887 43.767 13.192 1.00 38.78 C ATOM 2548 CD1 LEU A 379 10.310 44.575 14.404 1.00 40.09 C ATOM 2549 CD2 LEU A 379 9.335 42.419 13.644 1.00 38.36 C ATOM 2550 HA LEU A 379 7.864 43.123 11.186 1.00 0.00 H ATOM 2551 HB2 LEU A 379 9.398 45.534 12.118 1.00 0.00 H ATOM 2552 HB3 LEU A 379 8.022 44.751 12.930 1.00 0.00 H ATOM 2553 HG LEU A 379 10.746 43.554 12.556 1.00 0.00 H ATOM 2554 HD21 LEU A 379 8.432 42.577 14.233 1.00 0.00 H ATOM 2555 HD22 LEU A 379 9.098 41.813 12.769 1.00 0.00 H ATOM 2556 HD23 LEU A 379 10.082 41.907 14.251 1.00 0.00 H ATOM 2557 HD11 LEU A 379 10.803 45.490 14.075 1.00 0.00 H ATOM 2558 HD12 LEU A 379 9.430 44.827 14.996 1.00 0.00 H ATOM 2559 HD13 LEU A 379 11.000 43.986 15.009 1.00 0.00 H ATOM 2560 H LEU A 379 10.485 44.131 10.307 1.00 0.00 H ATOM 2561 N ASP A 380 6.245 45.004 10.504 1.00 37.40 N ATOM 2562 CA ASP A 380 5.367 46.077 10.035 1.00 37.33 C ATOM 2563 C ASP A 380 4.898 46.912 11.230 1.00 36.19 C ATOM 2564 O ASP A 380 5.259 46.619 12.362 1.00 36.04 O ATOM 2565 CB ASP A 380 4.202 45.534 9.192 1.00 37.46 C ATOM 2566 CG ASP A 380 3.269 44.625 9.977 1.00 38.82 C ATOM 2567 OD1 ASP A 380 3.126 44.794 11.205 1.00 40.02 O ATOM 2568 OD2 ASP A 380 2.656 43.738 9.347 1.00 41.60 O ATOM 2569 HA ASP A 380 5.928 46.731 9.367 1.00 0.00 H ATOM 2570 HB2 ASP A 380 3.626 46.378 8.812 1.00 0.00 H ATOM 2571 HB3 ASP A 380 4.613 44.970 8.355 1.00 0.00 H ATOM 2572 H ASP A 380 5.846 44.201 11.031 1.00 0.00 H ATOM 2573 N ASP A 381 4.118 47.954 10.966 1.00 35.47 N ATOM 2574 CA ASP A 381 3.688 48.899 11.996 1.00 34.50 C ATOM 2575 C ASP A 381 2.993 48.246 13.190 1.00 34.46 C ATOM 2576 O ASP A 381 3.229 48.641 14.324 1.00 34.30 O ATOM 2577 CB ASP A 381 2.760 49.954 11.391 1.00 34.08 C ATOM 2578 CG ASP A 381 3.472 50.877 10.432 1.00 33.19 C ATOM 2579 OD1 ASP A 381 4.426 51.559 10.858 1.00 30.98 O ATOM 2580 OD2 ASP A 381 3.061 50.934 9.251 1.00 32.31 O ATOM 2581 HA ASP A 381 4.602 49.356 12.375 1.00 0.00 H ATOM 2582 HB2 ASP A 381 1.957 49.447 10.856 1.00 0.00 H ATOM 2583 HB3 ASP A 381 2.336 50.550 12.199 1.00 0.00 H ATOM 2584 H ASP A 381 3.800 48.104 9.987 1.00 0.00 H ATOM 2585 N SER A 382 2.134 47.260 12.924 1.00 34.35 N ATOM 2586 CA SER A 382 1.380 46.586 13.972 1.00 34.76 C ATOM 2587 C SER A 382 2.294 45.797 14.896 1.00 34.50 C ATOM 2588 O SER A 382 2.013 45.684 16.092 1.00 34.55 O ATOM 2589 CB SER A 382 0.286 45.687 13.377 1.00 35.17 C ATOM 2590 OG SER A 382 0.844 44.594 12.672 1.00 37.01 O ATOM 2591 HA SER A 382 0.892 47.355 14.571 1.00 0.00 H ATOM 2592 HB2 SER A 382 -0.325 46.276 12.693 1.00 0.00 H ATOM 2593 HB3 SER A 382 -0.339 45.307 14.185 1.00 0.00 H ATOM 2594 HG SER A 382 1.409 44.933 11.933 1.00 0.00 H ATOM 2595 H SER A 382 1.999 46.963 11.936 1.00 0.00 H ATOM 2596 N ASP A 383 3.379 45.251 14.336 1.00 33.81 N ATOM 2597 CA ASP A 383 4.449 44.649 15.139 1.00 32.90 C ATOM 2598 C ASP A 383 5.142 45.716 15.994 1.00 31.97 C ATOM 2599 O ASP A 383 5.302 45.551 17.203 1.00 31.60 O ATOM 2600 CB ASP A 383 5.496 43.949 14.248 1.00 32.75 C ATOM 2601 CG ASP A 383 4.919 42.803 13.441 1.00 32.96 C ATOM 2602 OD1 ASP A 383 4.083 42.036 13.965 1.00 32.92 O ATOM 2603 OD2 ASP A 383 5.323 42.653 12.271 1.00 33.93 O ATOM 2604 HA ASP A 383 3.990 43.903 15.787 1.00 0.00 H ATOM 2605 HB2 ASP A 383 5.913 44.684 13.559 1.00 0.00 H ATOM 2606 HB3 ASP A 383 6.290 43.560 14.885 1.00 0.00 H ATOM 2607 H ASP A 383 3.467 45.253 13.300 1.00 0.00 H ATOM 2608 N LEU A 384 5.549 46.808 15.351 1.00 31.52 N ATOM 2609 CA LEU A 384 6.319 47.882 16.005 1.00 31.24 C ATOM 2610 C LEU A 384 5.559 48.593 17.132 1.00 31.21 C ATOM 2611 O LEU A 384 6.155 49.016 18.142 1.00 31.27 O ATOM 2612 CB LEU A 384 6.807 48.898 14.962 1.00 30.85 C ATOM 2613 CG LEU A 384 7.907 48.395 14.011 1.00 31.92 C ATOM 2614 CD1 LEU A 384 8.016 49.293 12.769 1.00 31.43 C ATOM 2615 CD2 LEU A 384 9.264 48.286 14.739 1.00 30.62 C ATOM 2616 HA LEU A 384 7.173 47.398 16.479 1.00 0.00 H ATOM 2617 HB2 LEU A 384 5.951 49.196 14.357 1.00 0.00 H ATOM 2618 HB3 LEU A 384 7.195 49.767 15.495 1.00 0.00 H ATOM 2619 HG LEU A 384 7.628 47.396 13.677 1.00 0.00 H ATOM 2620 HD21 LEU A 384 9.551 49.267 15.118 1.00 0.00 H ATOM 2621 HD22 LEU A 384 9.174 47.586 15.570 1.00 0.00 H ATOM 2622 HD23 LEU A 384 10.021 47.928 14.042 1.00 0.00 H ATOM 2623 HD11 LEU A 384 7.065 49.291 12.236 1.00 0.00 H ATOM 2624 HD12 LEU A 384 8.259 50.310 13.078 1.00 0.00 H ATOM 2625 HD13 LEU A 384 8.801 48.913 12.115 1.00 0.00 H ATOM 2626 H LEU A 384 5.314 46.908 14.343 1.00 0.00 H ATOM 2627 N ALA A 385 4.246 48.719 16.965 1.00 30.71 N ATOM 2628 CA ALA A 385 3.417 49.353 17.980 1.00 30.91 C ATOM 2629 C ALA A 385 3.604 48.668 19.343 1.00 30.74 C ATOM 2630 O ALA A 385 3.845 49.341 20.346 1.00 30.14 O ATOM 2631 CB ALA A 385 1.944 49.371 17.543 1.00 30.17 C ATOM 2632 HA ALA A 385 3.736 50.389 18.093 1.00 0.00 H ATOM 2633 HB1 ALA A 385 1.850 49.928 16.611 1.00 0.00 H ATOM 2634 HB2 ALA A 385 1.598 48.348 17.393 1.00 0.00 H ATOM 2635 HB3 ALA A 385 1.343 49.849 18.316 1.00 0.00 H ATOM 2636 H ALA A 385 3.804 48.359 16.095 1.00 0.00 H ATOM 2637 N ILE A 386 3.540 47.336 19.354 1.00 31.22 N ATOM 2638 CA ILE A 386 3.710 46.544 20.583 1.00 32.17 C ATOM 2639 C ILE A 386 5.145 46.542 21.126 1.00 32.74 C ATOM 2640 O ILE A 386 5.354 46.663 22.331 1.00 33.47 O ATOM 2641 CB ILE A 386 3.222 45.081 20.422 1.00 32.09 C ATOM 2642 CG1 ILE A 386 1.865 45.041 19.719 1.00 31.65 C ATOM 2643 CG2 ILE A 386 3.110 44.406 21.799 1.00 32.57 C ATOM 2644 CD1 ILE A 386 1.329 43.637 19.470 1.00 31.54 C ATOM 2645 HA ILE A 386 3.080 47.052 21.313 1.00 0.00 H ATOM 2646 HB ILE A 386 3.949 44.542 19.814 1.00 0.00 H ATOM 2647 HG12 ILE A 386 1.144 45.577 20.336 1.00 0.00 H ATOM 2648 HG13 ILE A 386 1.963 45.545 18.757 1.00 0.00 H ATOM 2649 HD11 ILE A 386 2.030 43.088 18.842 1.00 0.00 H ATOM 2650 HD12 ILE A 386 1.211 43.120 20.422 1.00 0.00 H ATOM 2651 HD13 ILE A 386 0.364 43.702 18.968 1.00 0.00 H ATOM 2652 HG21 ILE A 386 4.087 44.406 22.283 1.00 0.00 H ATOM 2653 HG22 ILE A 386 2.398 44.955 22.415 1.00 0.00 H ATOM 2654 HG23 ILE A 386 2.766 43.379 21.672 1.00 0.00 H ATOM 2655 H ILE A 386 3.363 46.837 18.459 1.00 0.00 H ATOM 2656 N PHE A 387 6.121 46.428 20.231 1.00 33.55 N ATOM 2657 CA PHE A 387 7.530 46.373 20.602 1.00 33.67 C ATOM 2658 C PHE A 387 7.959 47.641 21.315 1.00 33.94 C ATOM 2659 O PHE A 387 8.687 47.587 22.308 1.00 34.71 O ATOM 2660 CB PHE A 387 8.392 46.146 19.350 1.00 34.13 C ATOM 2661 CG PHE A 387 9.874 46.255 19.594 1.00 33.74 C ATOM 2662 CD1 PHE A 387 10.525 45.371 20.459 1.00 33.88 C ATOM 2663 CD2 PHE A 387 10.621 47.229 18.953 1.00 34.47 C ATOM 2664 CE1 PHE A 387 11.900 45.466 20.682 1.00 33.15 C ATOM 2665 CE2 PHE A 387 12.004 47.332 19.169 1.00 34.18 C ATOM 2666 CZ PHE A 387 12.636 46.450 20.037 1.00 33.25 C ATOM 2667 HA PHE A 387 7.671 45.539 21.290 1.00 0.00 H ATOM 2668 HB2 PHE A 387 8.181 45.148 18.965 1.00 0.00 H ATOM 2669 HB3 PHE A 387 8.113 46.889 18.603 1.00 0.00 H ATOM 2670 HD2 PHE A 387 10.129 47.924 18.273 1.00 0.00 H ATOM 2671 HE2 PHE A 387 12.581 48.102 18.657 1.00 0.00 H ATOM 2672 HZ PHE A 387 13.709 46.531 20.211 1.00 0.00 H ATOM 2673 HE1 PHE A 387 12.394 44.770 21.360 1.00 0.00 H ATOM 2674 HD1 PHE A 387 9.951 44.596 20.967 1.00 0.00 H ATOM 2675 H PHE A 387 5.869 46.376 19.223 1.00 0.00 H ATOM 2676 N ILE A 388 7.516 48.781 20.791 1.00 33.67 N ATOM 2677 CA ILE A 388 7.804 50.096 21.367 1.00 33.21 C ATOM 2678 C ILE A 388 7.127 50.268 22.734 1.00 32.87 C ATOM 2679 O ILE A 388 7.691 50.884 23.633 1.00 32.26 O ATOM 2680 CB ILE A 388 7.367 51.209 20.389 1.00 33.69 C ATOM 2681 CG1 ILE A 388 8.410 51.384 19.284 1.00 34.36 C ATOM 2682 CG2 ILE A 388 7.150 52.526 21.098 1.00 34.74 C ATOM 2683 CD1 ILE A 388 7.798 51.744 17.967 1.00 37.98 C ATOM 2684 HA ILE A 388 8.880 50.173 21.526 1.00 0.00 H ATOM 2685 HB ILE A 388 6.418 50.902 19.950 1.00 0.00 H ATOM 2686 HG12 ILE A 388 9.100 52.176 19.577 1.00 0.00 H ATOM 2687 HG13 ILE A 388 8.959 50.449 19.170 1.00 0.00 H ATOM 2688 HD11 ILE A 388 7.112 50.955 17.659 1.00 0.00 H ATOM 2689 HD12 ILE A 388 7.253 52.683 18.066 1.00 0.00 H ATOM 2690 HD13 ILE A 388 8.585 51.855 17.221 1.00 0.00 H ATOM 2691 HG21 ILE A 388 6.372 52.407 21.852 1.00 0.00 H ATOM 2692 HG22 ILE A 388 8.078 52.836 21.578 1.00 0.00 H ATOM 2693 HG23 ILE A 388 6.844 53.281 20.374 1.00 0.00 H ATOM 2694 H ILE A 388 6.936 48.736 19.929 1.00 0.00 H ATOM 2695 N ALA A 389 5.925 49.711 22.880 1.00 32.66 N ATOM 2696 CA ALA A 389 5.256 49.637 24.175 1.00 32.48 C ATOM 2697 C ALA A 389 6.112 48.845 25.171 1.00 32.51 C ATOM 2698 O ALA A 389 6.308 49.282 26.308 1.00 32.15 O ATOM 2699 CB ALA A 389 3.877 48.998 24.031 1.00 32.20 C ATOM 2700 HA ALA A 389 5.126 50.650 24.556 1.00 0.00 H ATOM 2701 HB1 ALA A 389 3.270 49.597 23.352 1.00 0.00 H ATOM 2702 HB2 ALA A 389 3.985 47.990 23.630 1.00 0.00 H ATOM 2703 HB3 ALA A 389 3.395 48.952 25.008 1.00 0.00 H ATOM 2704 H ALA A 389 5.448 49.316 22.044 1.00 0.00 H ATOM 2705 N VAL A 390 6.617 47.689 24.728 1.00 32.41 N ATOM 2706 CA VAL A 390 7.519 46.855 25.534 1.00 32.55 C ATOM 2707 C VAL A 390 8.723 47.662 26.023 1.00 32.63 C ATOM 2708 O VAL A 390 9.064 47.604 27.197 1.00 33.16 O ATOM 2709 CB VAL A 390 8.000 45.598 24.741 1.00 32.72 C ATOM 2710 CG1 VAL A 390 9.233 44.978 25.384 1.00 31.89 C ATOM 2711 CG2 VAL A 390 6.877 44.576 24.611 1.00 31.62 C ATOM 2712 HA VAL A 390 6.953 46.513 26.401 1.00 0.00 H ATOM 2713 HB VAL A 390 8.279 45.922 23.738 1.00 0.00 H ATOM 2714 HG11 VAL A 390 10.041 45.710 25.399 1.00 0.00 H ATOM 2715 HG12 VAL A 390 8.996 44.676 26.404 1.00 0.00 H ATOM 2716 HG13 VAL A 390 9.542 44.106 24.808 1.00 0.00 H ATOM 2717 HG21 VAL A 390 6.555 44.263 25.604 1.00 0.00 H ATOM 2718 HG22 VAL A 390 6.038 45.026 24.081 1.00 0.00 H ATOM 2719 HG23 VAL A 390 7.238 43.711 24.055 1.00 0.00 H ATOM 2720 H VAL A 390 6.361 47.367 23.773 1.00 0.00 H ATOM 2721 N ILE A 391 9.341 48.426 25.123 1.00 32.59 N ATOM 2722 CA ILE A 391 10.501 49.271 25.449 1.00 32.40 C ATOM 2723 C ILE A 391 10.221 50.310 26.531 1.00 33.00 C ATOM 2724 O ILE A 391 11.048 50.509 27.415 1.00 33.06 O ATOM 2725 CB ILE A 391 11.056 50.005 24.197 1.00 32.14 C ATOM 2726 CG1 ILE A 391 11.660 49.006 23.210 1.00 31.72 C ATOM 2727 CG2 ILE A 391 12.096 51.079 24.577 1.00 31.58 C ATOM 2728 CD1 ILE A 391 12.239 49.668 21.958 1.00 31.13 C ATOM 2729 HA ILE A 391 11.243 48.571 25.833 1.00 0.00 H ATOM 2730 HB ILE A 391 10.217 50.511 23.718 1.00 0.00 H ATOM 2731 HG12 ILE A 391 12.458 48.461 23.714 1.00 0.00 H ATOM 2732 HG13 ILE A 391 10.881 48.308 22.904 1.00 0.00 H ATOM 2733 HD11 ILE A 391 11.450 50.209 21.437 1.00 0.00 H ATOM 2734 HD12 ILE A 391 13.028 50.363 22.247 1.00 0.00 H ATOM 2735 HD13 ILE A 391 12.651 48.902 21.301 1.00 0.00 H ATOM 2736 HG21 ILE A 391 11.631 51.818 25.230 1.00 0.00 H ATOM 2737 HG22 ILE A 391 12.930 50.607 25.096 1.00 0.00 H ATOM 2738 HG23 ILE A 391 12.458 51.568 23.673 1.00 0.00 H ATOM 2739 H ILE A 391 8.987 48.425 24.145 1.00 0.00 H ATOM 2740 N ILE A 392 9.078 50.991 26.439 1.00 33.46 N ATOM 2741 CA ILE A 392 8.707 52.028 27.410 1.00 33.89 C ATOM 2742 C ILE A 392 8.589 51.428 28.808 1.00 34.21 C ATOM 2743 O ILE A 392 9.046 52.016 29.780 1.00 34.13 O ATOM 2744 CB ILE A 392 7.340 52.684 27.080 1.00 33.97 C ATOM 2745 CG1 ILE A 392 7.285 53.183 25.629 1.00 33.74 C ATOM 2746 CG2 ILE A 392 7.012 53.785 28.104 1.00 33.27 C ATOM 2747 CD1 ILE A 392 7.355 54.681 25.456 1.00 36.18 C ATOM 2748 HA ILE A 392 9.493 52.782 27.363 1.00 0.00 H ATOM 2749 HB ILE A 392 6.563 51.924 27.162 1.00 0.00 H ATOM 2750 HG12 ILE A 392 8.123 52.742 25.090 1.00 0.00 H ATOM 2751 HG13 ILE A 392 6.350 52.837 25.189 1.00 0.00 H ATOM 2752 HD11 ILE A 392 6.516 55.145 25.974 1.00 0.00 H ATOM 2753 HD12 ILE A 392 8.291 55.050 25.874 1.00 0.00 H ATOM 2754 HD13 ILE A 392 7.308 54.925 24.395 1.00 0.00 H ATOM 2755 HG21 ILE A 392 6.965 53.349 29.102 1.00 0.00 H ATOM 2756 HG22 ILE A 392 7.789 54.549 28.076 1.00 0.00 H ATOM 2757 HG23 ILE A 392 6.050 54.234 27.857 1.00 0.00 H ATOM 2758 H ILE A 392 8.429 50.781 25.654 1.00 0.00 H ATOM 2759 N LEU A 393 7.967 50.258 28.903 1.00 34.77 N ATOM 2760 CA LEU A 393 7.692 49.687 30.204 1.00 35.73 C ATOM 2761 C LEU A 393 8.779 48.714 30.697 1.00 36.64 C ATOM 2762 O LEU A 393 8.499 47.569 31.027 1.00 36.66 O ATOM 2763 CB LEU A 393 6.258 49.137 30.262 1.00 35.39 C ATOM 2764 CG LEU A 393 5.360 50.383 30.445 1.00 35.95 C ATOM 2765 CD1 LEU A 393 4.686 50.833 29.149 1.00 32.79 C ATOM 2766 CD2 LEU A 393 4.352 50.213 31.563 1.00 34.94 C ATOM 2767 HA LEU A 393 7.742 50.493 30.936 1.00 0.00 H ATOM 2768 HB2 LEU A 393 6.009 48.617 29.337 1.00 0.00 H ATOM 2769 HB3 LEU A 393 6.143 48.454 31.104 1.00 0.00 H ATOM 2770 HG LEU A 393 6.037 51.185 30.739 1.00 0.00 H ATOM 2771 HD21 LEU A 393 3.706 49.363 31.342 1.00 0.00 H ATOM 2772 HD22 LEU A 393 4.878 50.037 32.501 1.00 0.00 H ATOM 2773 HD23 LEU A 393 3.749 51.117 31.647 1.00 0.00 H ATOM 2774 HD11 LEU A 393 5.449 51.081 28.411 1.00 0.00 H ATOM 2775 HD12 LEU A 393 4.059 50.027 28.768 1.00 0.00 H ATOM 2776 HD13 LEU A 393 4.071 51.711 29.347 1.00 0.00 H ATOM 2777 H LEU A 393 7.677 49.752 28.042 1.00 0.00 H ATOM 2778 N SER A 394 10.018 49.211 30.744 1.00 37.72 N ATOM 2779 CA SER A 394 11.183 48.459 31.225 1.00 38.97 C ATOM 2780 C SER A 394 11.395 48.704 32.710 1.00 39.62 C ATOM 2781 O SER A 394 11.735 49.813 33.112 1.00 39.90 O ATOM 2782 CB SER A 394 12.441 48.894 30.470 1.00 38.60 C ATOM 2783 OG SER A 394 12.327 48.617 29.092 1.00 40.08 O ATOM 2784 HA SER A 394 10.997 47.399 31.052 1.00 0.00 H ATOM 2785 HB2 SER A 394 13.301 48.358 30.871 1.00 0.00 H ATOM 2786 HB3 SER A 394 12.586 49.966 30.607 1.00 0.00 H ATOM 2787 HG SER A 394 11.550 49.106 28.722 1.00 0.00 H ATOM 2788 H SER A 394 10.166 50.188 30.421 1.00 0.00 H ATOM 2789 N GLY A 395 11.208 47.672 33.523 1.00 40.92 N ATOM 2790 CA GLY A 395 11.347 47.806 34.973 1.00 42.61 C ATOM 2791 C GLY A 395 12.762 48.035 35.480 1.00 43.85 C ATOM 2792 O GLY A 395 12.964 48.244 36.674 1.00 44.37 O ATOM 2793 HA3 GLY A 395 10.970 46.892 35.432 1.00 0.00 H ATOM 2794 HA2 GLY A 395 10.736 48.650 35.292 1.00 0.00 H ATOM 2795 H GLY A 395 10.957 46.747 33.120 1.00 0.00 H ATOM 2796 N ASP A 396 13.740 48.014 34.577 1.00 44.93 N ATOM 2797 CA ASP A 396 15.143 48.088 34.965 1.00 46.10 C ATOM 2798 C ASP A 396 15.770 49.464 34.783 1.00 46.10 C ATOM 2799 O ASP A 396 16.985 49.604 34.900 1.00 46.51 O ATOM 2800 CB ASP A 396 15.963 47.019 34.218 1.00 46.92 C ATOM 2801 CG ASP A 396 16.057 47.281 32.718 1.00 49.16 C ATOM 2802 OD1 ASP A 396 15.239 48.070 32.182 1.00 51.08 O ATOM 2803 OD2 ASP A 396 16.952 46.687 32.072 1.00 50.93 O ATOM 2804 HA ASP A 396 15.166 47.892 36.037 1.00 0.00 H ATOM 2805 HB2 ASP A 396 16.971 47.002 34.632 1.00 0.00 H ATOM 2806 HB3 ASP A 396 15.492 46.048 34.373 1.00 0.00 H ATOM 2807 H ASP A 396 13.497 47.943 33.568 1.00 0.00 H ATOM 2808 N ARG A 397 14.951 50.477 34.505 1.00 46.00 N ATOM 2809 CA ARG A 397 15.460 51.834 34.308 1.00 45.85 C ATOM 2810 C ARG A 397 15.981 52.405 35.619 1.00 46.30 C ATOM 2811 O ARG A 397 15.387 52.156 36.671 1.00 46.57 O ATOM 2812 CB ARG A 397 14.379 52.761 33.727 1.00 45.81 C ATOM 2813 CG ARG A 397 13.726 52.266 32.436 1.00 44.64 C ATOM 2814 CD ARG A 397 14.740 52.082 31.306 1.00 43.03 C ATOM 2815 NE ARG A 397 14.082 52.056 30.002 1.00 42.34 N ATOM 2816 CZ ARG A 397 14.698 51.913 28.831 1.00 41.93 C ATOM 2817 NH1 ARG A 397 16.017 51.769 28.775 1.00 41.46 N ATOM 2818 NH2 ARG A 397 13.985 51.920 27.708 1.00 41.03 N ATOM 2819 HA ARG A 397 16.280 51.776 33.592 1.00 0.00 H ATOM 2820 HB2 ARG A 397 13.597 52.880 34.477 1.00 0.00 H ATOM 2821 HB3 ARG A 397 14.837 53.729 33.524 1.00 0.00 H ATOM 2822 HG2 ARG A 397 13.242 51.309 32.632 1.00 0.00 H ATOM 2823 HG3 ARG A 397 12.977 52.993 32.121 1.00 0.00 H ATOM 2824 HD2 ARG A 397 15.271 51.142 31.455 1.00 0.00 H ATOM 2825 HD3 ARG A 397 15.451 52.908 31.329 1.00 0.00 H ATOM 2826 HE ARG A 397 13.047 52.158 29.988 1.00 0.00 H ATOM 2827 HH12 ARG A 397 16.489 51.658 27.855 1.00 0.00 H ATOM 2828 HH11 ARG A 397 16.578 51.767 29.651 1.00 0.00 H ATOM 2829 HH22 ARG A 397 14.460 51.809 26.790 1.00 0.00 H ATOM 2830 HH21 ARG A 397 12.952 52.037 27.748 1.00 0.00 H ATOM 2831 H ARG A 397 13.929 50.300 34.426 1.00 0.00 H ATOM 2832 N PRO A 398 17.102 53.158 35.566 1.00 46.46 N ATOM 2833 CA PRO A 398 17.661 53.775 36.771 1.00 46.60 C ATOM 2834 C PRO A 398 16.669 54.664 37.523 1.00 46.89 C ATOM 2835 O PRO A 398 16.008 55.521 36.923 1.00 46.98 O ATOM 2836 CB PRO A 398 18.820 54.617 36.224 1.00 46.53 C ATOM 2837 CG PRO A 398 19.261 53.880 35.015 1.00 46.24 C ATOM 2838 CD PRO A 398 18.006 53.310 34.408 1.00 46.18 C ATOM 2839 HA PRO A 398 17.953 53.021 37.502 1.00 0.00 H ATOM 2840 HD3 PRO A 398 17.584 53.993 33.671 1.00 0.00 H ATOM 2841 HD2 PRO A 398 18.203 52.347 33.938 1.00 0.00 H ATOM 2842 HG3 PRO A 398 19.950 53.080 35.287 1.00 0.00 H ATOM 2843 HG2 PRO A 398 19.750 54.556 34.314 1.00 0.00 H ATOM 2844 HB2 PRO A 398 18.482 55.620 35.965 1.00 0.00 H ATOM 2845 HB3 PRO A 398 19.628 54.685 36.953 1.00 0.00 H ATOM 2846 N GLY A 399 16.568 54.435 38.831 1.00 46.98 N ATOM 2847 CA GLY A 399 15.809 55.297 39.726 1.00 47.03 C ATOM 2848 C GLY A 399 14.308 55.087 39.754 1.00 47.21 C ATOM 2849 O GLY A 399 13.578 55.973 40.183 1.00 47.58 O ATOM 2850 HA3 GLY A 399 15.994 56.329 39.428 1.00 0.00 H ATOM 2851 HA2 GLY A 399 16.185 55.139 40.737 1.00 0.00 H ATOM 2852 H GLY A 399 17.052 53.605 39.230 1.00 0.00 H ATOM 2853 N LEU A 400 13.845 53.922 39.312 1.00 47.30 N ATOM 2854 CA LEU A 400 12.421 53.604 39.342 1.00 47.41 C ATOM 2855 C LEU A 400 11.933 53.352 40.761 1.00 47.72 C ATOM 2856 O LEU A 400 12.576 52.633 41.525 1.00 47.82 O ATOM 2857 CB LEU A 400 12.110 52.399 38.447 1.00 47.10 C ATOM 2858 CG LEU A 400 12.011 52.662 36.938 1.00 46.73 C ATOM 2859 CD1 LEU A 400 11.835 51.362 36.182 1.00 45.17 C ATOM 2860 CD2 LEU A 400 10.871 53.620 36.611 1.00 45.17 C ATOM 2861 HA LEU A 400 11.887 54.471 38.954 1.00 0.00 H ATOM 2862 HB2 LEU A 400 12.897 51.661 38.602 1.00 0.00 H ATOM 2863 HB3 LEU A 400 11.156 51.984 38.773 1.00 0.00 H ATOM 2864 HG LEU A 400 12.944 53.130 36.624 1.00 0.00 H ATOM 2865 HD21 LEU A 400 9.928 53.190 36.949 1.00 0.00 H ATOM 2866 HD22 LEU A 400 11.040 54.570 37.117 1.00 0.00 H ATOM 2867 HD23 LEU A 400 10.832 53.782 35.534 1.00 0.00 H ATOM 2868 HD11 LEU A 400 12.690 50.713 36.373 1.00 0.00 H ATOM 2869 HD12 LEU A 400 10.922 50.870 36.516 1.00 0.00 H ATOM 2870 HD13 LEU A 400 11.767 51.570 35.114 1.00 0.00 H ATOM 2871 H LEU A 400 14.514 53.220 38.936 1.00 0.00 H ATOM 2872 N LEU A 401 10.782 53.932 41.097 1.00 48.10 N ATOM 2873 CA LEU A 401 10.240 53.859 42.452 1.00 48.14 C ATOM 2874 C LEU A 401 9.414 52.612 42.734 1.00 48.17 C ATOM 2875 O LEU A 401 9.522 52.045 43.820 1.00 48.33 O ATOM 2876 CB LEU A 401 9.438 55.123 42.794 1.00 48.28 C ATOM 2877 CG LEU A 401 10.212 56.446 42.812 1.00 48.42 C ATOM 2878 CD1 LEU A 401 9.269 57.616 43.042 1.00 48.84 C ATOM 2879 CD2 LEU A 401 11.330 56.447 43.853 1.00 48.84 C ATOM 2880 HA LEU A 401 11.111 53.791 43.104 1.00 0.00 H ATOM 2881 HB2 LEU A 401 8.640 55.217 42.058 1.00 0.00 H ATOM 2882 HB3 LEU A 401 9.003 54.981 43.783 1.00 0.00 H ATOM 2883 HG LEU A 401 10.681 56.557 41.834 1.00 0.00 H ATOM 2884 HD21 LEU A 401 10.903 56.291 44.843 1.00 0.00 H ATOM 2885 HD22 LEU A 401 12.034 55.645 43.629 1.00 0.00 H ATOM 2886 HD23 LEU A 401 11.848 57.405 43.827 1.00 0.00 H ATOM 2887 HD11 LEU A 401 8.531 57.649 42.240 1.00 0.00 H ATOM 2888 HD12 LEU A 401 8.762 57.490 43.999 1.00 0.00 H ATOM 2889 HD13 LEU A 401 9.840 58.545 43.051 1.00 0.00 H ATOM 2890 H LEU A 401 10.251 54.454 40.371 1.00 0.00 H ATOM 2891 N ASN A 402 8.595 52.191 41.771 1.00 48.14 N ATOM 2892 CA ASN A 402 7.749 50.995 41.914 1.00 48.11 C ATOM 2893 C ASN A 402 7.881 50.069 40.714 1.00 47.66 C ATOM 2894 O ASN A 402 7.069 50.121 39.787 1.00 47.66 O ATOM 2895 CB ASN A 402 6.268 51.360 42.090 1.00 48.42 C ATOM 2896 CG ASN A 402 6.044 52.442 43.109 1.00 49.68 C ATOM 2897 OD1 ASN A 402 5.775 53.588 42.757 1.00 51.90 O ATOM 2898 ND2 ASN A 402 6.145 52.090 44.386 1.00 51.83 N ATOM 2899 HA ASN A 402 8.101 50.482 42.809 1.00 0.00 H ATOM 2900 HB2 ASN A 402 5.878 51.700 41.131 1.00 0.00 H ATOM 2901 HB3 ASN A 402 5.726 50.469 42.405 1.00 0.00 H ATOM 2902 HD22 ASN A 402 6.375 51.108 44.638 1.00 0.00 H ATOM 2903 HD21 ASN A 402 5.994 52.797 45.134 1.00 0.00 H ATOM 2904 H ASN A 402 8.552 52.729 40.882 1.00 0.00 H ATOM 2905 N VAL A 403 8.896 49.213 40.753 1.00 47.05 N ATOM 2906 CA VAL A 403 9.242 48.314 39.647 1.00 46.26 C ATOM 2907 C VAL A 403 8.127 47.327 39.253 1.00 46.08 C ATOM 2908 O VAL A 403 7.900 47.092 38.070 1.00 46.09 O ATOM 2909 CB VAL A 403 10.603 47.605 39.942 1.00 46.31 C ATOM 2910 CG1 VAL A 403 10.838 46.414 39.040 1.00 45.38 C ATOM 2911 CG2 VAL A 403 11.749 48.607 39.821 1.00 45.93 C ATOM 2912 HA VAL A 403 9.357 48.936 38.759 1.00 0.00 H ATOM 2913 HB VAL A 403 10.562 47.224 40.963 1.00 0.00 H ATOM 2914 HG11 VAL A 403 10.039 45.686 39.186 1.00 0.00 H ATOM 2915 HG12 VAL A 403 10.847 46.743 38.001 1.00 0.00 H ATOM 2916 HG13 VAL A 403 11.797 45.957 39.286 1.00 0.00 H ATOM 2917 HG21 VAL A 403 11.768 49.015 38.811 1.00 0.00 H ATOM 2918 HG22 VAL A 403 11.601 49.415 40.538 1.00 0.00 H ATOM 2919 HG23 VAL A 403 12.693 48.104 40.028 1.00 0.00 H ATOM 2920 H VAL A 403 9.477 49.178 41.615 1.00 0.00 H ATOM 2921 N LYS A 404 7.420 46.785 40.243 1.00 45.78 N ATOM 2922 CA LYS A 404 6.432 45.711 40.040 1.00 45.48 C ATOM 2923 C LYS A 404 5.182 46.038 39.197 1.00 44.80 C ATOM 2924 O LYS A 404 4.781 45.216 38.370 1.00 45.15 O ATOM 2925 CB LYS A 404 6.008 45.119 41.394 1.00 45.91 C ATOM 2926 CG LYS A 404 4.966 43.995 41.336 1.00 46.99 C ATOM 2927 CD LYS A 404 5.548 42.705 40.739 1.00 50.26 C ATOM 2928 CE LYS A 404 4.727 41.472 41.134 1.00 51.63 C ATOM 2929 NZ LYS A 404 3.278 41.553 40.758 1.00 51.85 N ATOM 2930 HA LYS A 404 6.972 44.989 39.427 1.00 0.00 H ATOM 2931 HB2 LYS A 404 6.900 44.723 41.880 1.00 0.00 H ATOM 2932 HB3 LYS A 404 5.595 45.927 41.998 1.00 0.00 H ATOM 2933 HG2 LYS A 404 4.613 43.788 42.347 1.00 0.00 H ATOM 2934 HG3 LYS A 404 4.128 44.322 40.720 1.00 0.00 H ATOM 2935 HD2 LYS A 404 5.555 42.791 39.652 1.00 0.00 H ATOM 2936 HD3 LYS A 404 6.569 42.579 41.099 1.00 0.00 H ATOM 2937 HE2 LYS A 404 4.794 41.348 42.215 1.00 0.00 H ATOM 2938 HE3 LYS A 404 5.160 40.601 40.642 1.00 0.00 H ATOM 2939 HZ1 LYS A 404 2.844 42.373 41.228 1.00 0.00 H ATOM 2940 HZ2 LYS A 404 3.194 41.659 39.727 1.00 0.00 H ATOM 2941 HZ3 LYS A 404 2.794 40.683 41.059 1.00 0.00 H ATOM 2942 H LYS A 404 7.573 47.138 41.209 1.00 0.00 H ATOM 2943 N PRO A 405 4.532 47.198 39.428 1.00 43.95 N ATOM 2944 CA PRO A 405 3.421 47.494 38.510 1.00 43.29 C ATOM 2945 C PRO A 405 3.884 47.681 37.051 1.00 42.69 C ATOM 2946 O PRO A 405 3.165 47.290 36.126 1.00 42.34 O ATOM 2947 CB PRO A 405 2.801 48.783 39.081 1.00 43.09 C ATOM 2948 CG PRO A 405 3.762 49.276 40.125 1.00 43.41 C ATOM 2949 CD PRO A 405 4.543 48.101 40.595 1.00 43.79 C ATOM 2950 HA PRO A 405 2.710 46.669 38.457 1.00 0.00 H ATOM 2951 HD3 PRO A 405 5.561 48.388 40.858 1.00 0.00 H ATOM 2952 HD2 PRO A 405 4.065 47.633 41.456 1.00 0.00 H ATOM 2953 HG3 PRO A 405 3.215 49.718 40.958 1.00 0.00 H ATOM 2954 HG2 PRO A 405 4.431 50.021 39.695 1.00 0.00 H ATOM 2955 HB2 PRO A 405 2.681 49.527 38.294 1.00 0.00 H ATOM 2956 HB3 PRO A 405 1.830 48.571 39.529 1.00 0.00 H ATOM 2957 N ILE A 406 5.080 48.243 36.864 1.00 42.01 N ATOM 2958 CA ILE A 406 5.698 48.384 35.538 1.00 41.71 C ATOM 2959 C ILE A 406 5.941 47.020 34.861 1.00 41.87 C ATOM 2960 O ILE A 406 5.543 46.801 33.706 1.00 41.38 O ATOM 2961 CB ILE A 406 7.019 49.196 35.619 1.00 41.67 C ATOM 2962 CG1 ILE A 406 6.752 50.589 36.205 1.00 40.56 C ATOM 2963 CG2 ILE A 406 7.716 49.257 34.258 1.00 41.28 C ATOM 2964 CD1 ILE A 406 7.981 51.447 36.388 1.00 39.57 C ATOM 2965 HA ILE A 406 4.991 48.935 34.918 1.00 0.00 H ATOM 2966 HB ILE A 406 7.705 48.684 36.294 1.00 0.00 H ATOM 2967 HG12 ILE A 406 6.069 51.113 35.536 1.00 0.00 H ATOM 2968 HG13 ILE A 406 6.279 50.462 37.179 1.00 0.00 H ATOM 2969 HD11 ILE A 406 8.673 50.948 37.066 1.00 0.00 H ATOM 2970 HD12 ILE A 406 8.463 51.599 35.422 1.00 0.00 H ATOM 2971 HD13 ILE A 406 7.691 52.411 36.807 1.00 0.00 H ATOM 2972 HG21 ILE A 406 7.949 48.246 33.925 1.00 0.00 H ATOM 2973 HG22 ILE A 406 7.056 49.736 33.535 1.00 0.00 H ATOM 2974 HG23 ILE A 406 8.637 49.832 34.349 1.00 0.00 H ATOM 2975 H ILE A 406 5.598 48.597 37.694 1.00 0.00 H ATOM 2976 N GLU A 407 6.571 46.105 35.597 1.00 41.87 N ATOM 2977 CA GLU A 407 6.908 44.779 35.072 1.00 42.10 C ATOM 2978 C GLU A 407 5.685 43.909 34.805 1.00 41.74 C ATOM 2979 O GLU A 407 5.719 43.076 33.912 1.00 41.79 O ATOM 2980 CB GLU A 407 7.914 44.061 35.990 1.00 42.29 C ATOM 2981 CG GLU A 407 9.283 44.765 36.034 1.00 44.82 C ATOM 2982 CD GLU A 407 10.412 43.911 36.614 1.00 48.94 C ATOM 2983 OE1 GLU A 407 10.178 43.187 37.615 1.00 49.41 O ATOM 2984 OE2 GLU A 407 11.547 43.996 36.077 1.00 49.99 O ATOM 2985 HA GLU A 407 7.379 44.943 34.103 1.00 0.00 H ATOM 2986 HB2 GLU A 407 7.505 44.029 37.000 1.00 0.00 H ATOM 2987 HB3 GLU A 407 8.056 43.044 35.625 1.00 0.00 H ATOM 2988 HG2 GLU A 407 9.555 45.046 35.017 1.00 0.00 H ATOM 2989 HG3 GLU A 407 9.186 45.663 36.644 1.00 0.00 H ATOM 2990 H GLU A 407 6.832 46.340 36.576 1.00 0.00 H ATOM 2991 N ASP A 408 4.619 44.097 35.586 1.00 41.59 N ATOM 2992 CA ASP A 408 3.337 43.431 35.343 1.00 41.43 C ATOM 2993 C ASP A 408 2.704 43.879 34.012 1.00 41.18 C ATOM 2994 O ASP A 408 2.095 43.074 33.299 1.00 41.32 O ATOM 2995 CB ASP A 408 2.357 43.712 36.488 1.00 41.66 C ATOM 2996 CG ASP A 408 2.680 42.936 37.769 1.00 43.15 C ATOM 2997 OD1 ASP A 408 3.484 41.967 37.736 1.00 44.61 O ATOM 2998 OD2 ASP A 408 2.101 43.299 38.820 1.00 43.64 O ATOM 2999 HA ASP A 408 3.539 42.361 35.287 1.00 0.00 H ATOM 3000 HB2 ASP A 408 2.385 44.778 36.713 1.00 0.00 H ATOM 3001 HB3 ASP A 408 1.354 43.437 36.161 1.00 0.00 H ATOM 3002 H ASP A 408 4.702 44.741 36.398 1.00 0.00 H ATOM 3003 N ILE A 409 2.832 45.165 33.688 1.00 40.60 N ATOM 3004 CA ILE A 409 2.364 45.664 32.394 1.00 40.37 C ATOM 3005 C ILE A 409 3.237 45.121 31.257 1.00 40.19 C ATOM 3006 O ILE A 409 2.706 44.606 30.272 1.00 40.15 O ATOM 3007 CB ILE A 409 2.248 47.214 32.338 1.00 40.15 C ATOM 3008 CG1 ILE A 409 1.272 47.712 33.416 1.00 40.47 C ATOM 3009 CG2 ILE A 409 1.756 47.658 30.962 1.00 39.54 C ATOM 3010 CD1 ILE A 409 1.317 49.225 33.683 1.00 39.94 C ATOM 3011 HA ILE A 409 1.349 45.289 32.262 1.00 0.00 H ATOM 3012 HB ILE A 409 3.234 47.641 32.521 1.00 0.00 H ATOM 3013 HG12 ILE A 409 0.261 47.453 33.102 1.00 0.00 H ATOM 3014 HG13 ILE A 409 1.505 47.197 34.348 1.00 0.00 H ATOM 3015 HD11 ILE A 409 2.317 49.505 34.013 1.00 0.00 H ATOM 3016 HD12 ILE A 409 1.072 49.762 32.767 1.00 0.00 H ATOM 3017 HD13 ILE A 409 0.593 49.478 34.458 1.00 0.00 H ATOM 3018 HG21 ILE A 409 2.461 47.325 30.201 1.00 0.00 H ATOM 3019 HG22 ILE A 409 0.777 47.220 30.769 1.00 0.00 H ATOM 3020 HG23 ILE A 409 1.680 48.745 30.938 1.00 0.00 H ATOM 3021 H ILE A 409 3.270 45.823 34.364 1.00 0.00 H ATOM 3022 N GLN A 410 4.560 45.205 31.402 1.00 39.99 N ATOM 3023 CA GLN A 410 5.458 44.712 30.349 1.00 40.07 C ATOM 3024 C GLN A 410 5.242 43.237 30.048 1.00 40.14 C ATOM 3025 O GLN A 410 5.309 42.824 28.885 1.00 39.55 O ATOM 3026 CB GLN A 410 6.933 44.960 30.659 1.00 39.71 C ATOM 3027 CG GLN A 410 7.804 44.762 29.414 1.00 39.42 C ATOM 3028 CD GLN A 410 9.288 44.798 29.695 1.00 38.34 C ATOM 3029 OE1 GLN A 410 10.028 45.548 29.067 1.00 37.89 O ATOM 3030 NE2 GLN A 410 9.734 43.977 30.632 1.00 39.14 N ATOM 3031 HA GLN A 410 5.197 45.291 29.463 1.00 0.00 H ATOM 3032 HB2 GLN A 410 7.054 45.982 31.018 1.00 0.00 H ATOM 3033 HB3 GLN A 410 7.256 44.264 31.433 1.00 0.00 H ATOM 3034 HG2 GLN A 410 7.561 43.795 28.974 1.00 0.00 H ATOM 3035 HG3 GLN A 410 7.570 45.553 28.701 1.00 0.00 H ATOM 3036 HE22 GLN A 410 9.070 43.358 31.140 1.00 0.00 H ATOM 3037 HE21 GLN A 410 10.748 43.951 30.861 1.00 0.00 H ATOM 3038 H GLN A 410 4.959 45.623 32.267 1.00 0.00 H ATOM 3039 N ASP A 411 4.984 42.456 31.098 1.00 40.35 N ATOM 3040 CA ASP A 411 4.663 41.033 30.947 1.00 40.78 C ATOM 3041 C ASP A 411 3.465 40.797 30.033 1.00 39.85 C ATOM 3042 O ASP A 411 3.511 39.930 29.165 1.00 39.54 O ATOM 3043 CB ASP A 411 4.442 40.372 32.312 1.00 41.53 C ATOM 3044 CG ASP A 411 5.755 39.999 33.002 1.00 45.11 C ATOM 3045 OD1 ASP A 411 6.806 40.639 32.721 1.00 48.01 O ATOM 3046 OD2 ASP A 411 5.737 39.059 33.834 1.00 49.08 O ATOM 3047 HA ASP A 411 5.525 40.567 30.469 1.00 0.00 H ATOM 3048 HB2 ASP A 411 3.895 41.065 32.952 1.00 0.00 H ATOM 3049 HB3 ASP A 411 3.852 39.467 32.171 1.00 0.00 H ATOM 3050 H ASP A 411 5.011 42.868 32.052 1.00 0.00 H ATOM 3051 N ASN A 412 2.402 41.571 30.241 1.00 38.98 N ATOM 3052 CA ASN A 412 1.210 41.518 29.396 1.00 38.52 C ATOM 3053 C ASN A 412 1.491 42.011 27.961 1.00 37.49 C ATOM 3054 O ASN A 412 0.952 41.471 26.983 1.00 37.24 O ATOM 3055 CB ASN A 412 0.084 42.336 30.043 1.00 39.18 C ATOM 3056 CG ASN A 412 -1.263 42.085 29.406 1.00 41.41 C ATOM 3057 OD1 ASN A 412 -1.475 41.068 28.742 1.00 44.53 O ATOM 3058 ND2 ASN A 412 -2.194 43.010 29.615 1.00 44.41 N ATOM 3059 HA ASN A 412 0.901 40.476 29.314 1.00 0.00 H ATOM 3060 HB2 ASN A 412 0.025 42.073 31.099 1.00 0.00 H ATOM 3061 HB3 ASN A 412 0.323 43.395 29.947 1.00 0.00 H ATOM 3062 HD22 ASN A 412 -1.971 43.853 30.182 1.00 0.00 H ATOM 3063 HD21 ASN A 412 -3.145 42.891 29.212 1.00 0.00 H ATOM 3064 H ASN A 412 2.420 42.240 31.037 1.00 0.00 H ATOM 3065 N LEU A 413 2.336 43.031 27.853 1.00 36.05 N ATOM 3066 CA LEU A 413 2.831 43.518 26.567 1.00 35.14 C ATOM 3067 C LEU A 413 3.673 42.464 25.814 1.00 35.03 C ATOM 3068 O LEU A 413 3.492 42.260 24.603 1.00 34.29 O ATOM 3069 CB LEU A 413 3.616 44.831 26.760 1.00 34.58 C ATOM 3070 CG LEU A 413 2.780 46.084 27.108 1.00 33.80 C ATOM 3071 CD1 LEU A 413 3.659 47.241 27.535 1.00 31.79 C ATOM 3072 CD2 LEU A 413 1.871 46.508 25.946 1.00 31.97 C ATOM 3073 HA LEU A 413 1.963 43.717 25.939 1.00 0.00 H ATOM 3074 HB2 LEU A 413 4.332 44.675 27.567 1.00 0.00 H ATOM 3075 HB3 LEU A 413 4.153 45.036 25.834 1.00 0.00 H ATOM 3076 HG LEU A 413 2.144 45.808 27.949 1.00 0.00 H ATOM 3077 HD21 LEU A 413 2.482 46.737 25.073 1.00 0.00 H ATOM 3078 HD22 LEU A 413 1.185 45.695 25.708 1.00 0.00 H ATOM 3079 HD23 LEU A 413 1.302 47.392 26.235 1.00 0.00 H ATOM 3080 HD11 LEU A 413 4.232 46.954 28.416 1.00 0.00 H ATOM 3081 HD12 LEU A 413 4.341 47.496 26.724 1.00 0.00 H ATOM 3082 HD13 LEU A 413 3.034 48.102 27.771 1.00 0.00 H ATOM 3083 H LEU A 413 2.659 43.503 28.721 1.00 0.00 H ATOM 3084 N LEU A 414 4.574 41.790 26.538 1.00 34.90 N ATOM 3085 CA LEU A 414 5.442 40.767 25.948 1.00 35.05 C ATOM 3086 C LEU A 414 4.649 39.572 25.433 1.00 35.31 C ATOM 3087 O LEU A 414 4.916 39.067 24.344 1.00 35.31 O ATOM 3088 CB LEU A 414 6.518 40.318 26.942 1.00 35.14 C ATOM 3089 CG LEU A 414 7.662 41.282 27.274 1.00 34.26 C ATOM 3090 CD1 LEU A 414 8.231 40.937 28.631 1.00 34.67 C ATOM 3091 CD2 LEU A 414 8.742 41.295 26.208 1.00 33.31 C ATOM 3092 HA LEU A 414 5.936 41.223 25.090 1.00 0.00 H ATOM 3093 HB2 LEU A 414 6.012 40.085 27.879 1.00 0.00 H ATOM 3094 HB3 LEU A 414 6.969 39.411 26.539 1.00 0.00 H ATOM 3095 HG LEU A 414 7.255 42.293 27.299 1.00 0.00 H ATOM 3096 HD21 LEU A 414 9.164 40.295 26.108 1.00 0.00 H ATOM 3097 HD22 LEU A 414 8.308 41.604 25.257 1.00 0.00 H ATOM 3098 HD23 LEU A 414 9.526 41.995 26.496 1.00 0.00 H ATOM 3099 HD11 LEU A 414 7.449 41.026 29.385 1.00 0.00 H ATOM 3100 HD12 LEU A 414 8.608 39.915 28.616 1.00 0.00 H ATOM 3101 HD13 LEU A 414 9.045 41.623 28.867 1.00 0.00 H ATOM 3102 H LEU A 414 4.661 41.999 27.553 1.00 0.00 H ATOM 3103 N GLN A 415 3.659 39.139 26.206 1.00 35.99 N ATOM 3104 CA GLN A 415 2.703 38.129 25.745 1.00 36.83 C ATOM 3105 C GLN A 415 1.984 38.559 24.467 1.00 36.60 C ATOM 3106 O GLN A 415 1.738 37.735 23.576 1.00 36.95 O ATOM 3107 CB GLN A 415 1.631 37.855 26.807 1.00 37.32 C ATOM 3108 CG GLN A 415 2.091 37.140 28.053 1.00 38.85 C ATOM 3109 CD GLN A 415 0.921 36.813 28.968 1.00 40.91 C ATOM 3110 OE1 GLN A 415 -0.035 36.154 28.557 1.00 41.84 O ATOM 3111 NE2 GLN A 415 0.990 37.277 30.210 1.00 41.62 N ATOM 3112 HA GLN A 415 3.289 37.231 25.551 1.00 0.00 H ATOM 3113 HB2 GLN A 415 1.211 38.814 27.110 1.00 0.00 H ATOM 3114 HB3 GLN A 415 0.852 37.249 26.344 1.00 0.00 H ATOM 3115 HG2 GLN A 415 2.588 36.213 27.767 1.00 0.00 H ATOM 3116 HG3 GLN A 415 2.794 37.778 28.589 1.00 0.00 H ATOM 3117 HE22 GLN A 415 1.817 37.829 30.514 1.00 0.00 H ATOM 3118 HE21 GLN A 415 0.217 37.088 30.879 1.00 0.00 H ATOM 3119 H GLN A 415 3.560 39.528 27.165 1.00 0.00 H ATOM 3120 N ALA A 416 1.618 39.836 24.398 1.00 36.20 N ATOM 3121 CA ALA A 416 0.894 40.362 23.238 1.00 36.28 C ATOM 3122 C ALA A 416 1.811 40.445 22.003 1.00 36.08 C ATOM 3123 O ALA A 416 1.404 40.077 20.902 1.00 35.60 O ATOM 3124 CB ALA A 416 0.254 41.715 23.562 1.00 35.76 C ATOM 3125 HA ALA A 416 0.089 39.668 22.996 1.00 0.00 H ATOM 3126 HB1 ALA A 416 -0.446 41.596 24.389 1.00 0.00 H ATOM 3127 HB2 ALA A 416 1.032 42.425 23.843 1.00 0.00 H ATOM 3128 HB3 ALA A 416 -0.277 42.084 22.685 1.00 0.00 H ATOM 3129 H ALA A 416 1.851 40.475 25.185 1.00 0.00 H ATOM 3130 N LEU A 417 3.051 40.896 22.201 1.00 36.43 N ATOM 3131 CA LEU A 417 4.074 40.843 21.143 1.00 36.94 C ATOM 3132 C LEU A 417 4.270 39.418 20.612 1.00 37.88 C ATOM 3133 O LEU A 417 4.185 39.188 19.406 1.00 37.93 O ATOM 3134 CB LEU A 417 5.405 41.420 21.638 1.00 36.32 C ATOM 3135 CG LEU A 417 6.574 41.543 20.652 1.00 35.17 C ATOM 3136 CD1 LEU A 417 6.220 42.414 19.447 1.00 32.05 C ATOM 3137 CD2 LEU A 417 7.801 42.089 21.362 1.00 33.37 C ATOM 3138 HA LEU A 417 3.716 41.457 20.317 1.00 0.00 H ATOM 3139 HB2 LEU A 417 5.199 42.421 22.016 1.00 0.00 H ATOM 3140 HB3 LEU A 417 5.743 40.786 22.458 1.00 0.00 H ATOM 3141 HG LEU A 417 6.793 40.544 20.274 1.00 0.00 H ATOM 3142 HD21 LEU A 417 7.574 43.073 21.773 1.00 0.00 H ATOM 3143 HD22 LEU A 417 8.083 41.413 22.169 1.00 0.00 H ATOM 3144 HD23 LEU A 417 8.624 42.172 20.652 1.00 0.00 H ATOM 3145 HD11 LEU A 417 5.374 41.974 18.919 1.00 0.00 H ATOM 3146 HD12 LEU A 417 5.956 43.415 19.789 1.00 0.00 H ATOM 3147 HD13 LEU A 417 7.078 42.472 18.777 1.00 0.00 H ATOM 3148 H LEU A 417 3.302 41.296 23.128 1.00 0.00 H ATOM 3149 N GLU A 418 4.502 38.474 21.527 1.00 39.17 N ATOM 3150 CA GLU A 418 4.731 37.060 21.196 1.00 40.44 C ATOM 3151 C GLU A 418 3.638 36.509 20.296 1.00 40.88 C ATOM 3152 O GLU A 418 3.930 35.966 19.221 1.00 41.28 O ATOM 3153 CB GLU A 418 4.847 36.213 22.478 1.00 40.94 C ATOM 3154 CG GLU A 418 5.155 34.725 22.266 1.00 42.63 C ATOM 3155 CD GLU A 418 5.515 34.002 23.556 1.00 45.13 C ATOM 3156 OE1 GLU A 418 4.882 34.263 24.603 1.00 46.61 O ATOM 3157 OE2 GLU A 418 6.446 33.170 23.527 1.00 47.94 O ATOM 3158 HA GLU A 418 5.672 37.002 20.649 1.00 0.00 H ATOM 3159 HB2 GLU A 418 5.644 36.637 23.089 1.00 0.00 H ATOM 3160 HB3 GLU A 418 3.901 36.286 23.015 1.00 0.00 H ATOM 3161 HG2 GLU A 418 4.277 34.247 21.833 1.00 0.00 H ATOM 3162 HG3 GLU A 418 5.993 34.639 21.574 1.00 0.00 H ATOM 3163 H GLU A 418 4.522 38.754 22.528 1.00 0.00 H ATOM 3164 N LEU A 419 2.382 36.655 20.716 1.00 41.22 N ATOM 3165 CA LEU A 419 1.266 36.188 19.891 1.00 41.55 C ATOM 3166 C LEU A 419 1.166 36.921 18.542 1.00 41.65 C ATOM 3167 O LEU A 419 0.910 36.294 17.507 1.00 41.94 O ATOM 3168 CB LEU A 419 -0.059 36.244 20.655 1.00 41.85 C ATOM 3169 CG LEU A 419 -1.260 35.583 19.964 1.00 42.77 C ATOM 3170 CD1 LEU A 419 -1.018 34.093 19.689 1.00 43.07 C ATOM 3171 CD2 LEU A 419 -2.539 35.801 20.770 1.00 43.85 C ATOM 3172 HA LEU A 419 1.477 35.144 19.658 1.00 0.00 H ATOM 3173 HB2 LEU A 419 0.088 35.750 21.615 1.00 0.00 H ATOM 3174 HB3 LEU A 419 -0.305 37.293 20.821 1.00 0.00 H ATOM 3175 HG LEU A 419 -1.385 36.066 18.995 1.00 0.00 H ATOM 3176 HD21 LEU A 419 -2.421 35.365 21.762 1.00 0.00 H ATOM 3177 HD22 LEU A 419 -2.731 36.870 20.862 1.00 0.00 H ATOM 3178 HD23 LEU A 419 -3.375 35.323 20.259 1.00 0.00 H ATOM 3179 HD11 LEU A 419 -0.148 33.981 19.041 1.00 0.00 H ATOM 3180 HD12 LEU A 419 -0.840 33.575 20.631 1.00 0.00 H ATOM 3181 HD13 LEU A 419 -1.894 33.668 19.199 1.00 0.00 H ATOM 3182 H LEU A 419 2.193 37.103 21.635 1.00 0.00 H ATOM 3183 N GLN A 420 1.374 38.236 18.554 1.00 41.67 N ATOM 3184 CA GLN A 420 1.344 39.036 17.324 1.00 41.60 C ATOM 3185 C GLN A 420 2.384 38.545 16.317 1.00 41.95 C ATOM 3186 O GLN A 420 2.076 38.344 15.145 1.00 41.62 O ATOM 3187 CB GLN A 420 1.557 40.524 17.641 1.00 41.41 C ATOM 3188 CG GLN A 420 1.920 41.411 16.447 1.00 40.87 C ATOM 3189 CD GLN A 420 0.768 41.674 15.490 1.00 40.27 C ATOM 3190 OE1 GLN A 420 -0.391 41.403 15.795 1.00 41.02 O ATOM 3191 NE2 GLN A 420 1.089 42.213 14.322 1.00 40.40 N ATOM 3192 HA GLN A 420 0.360 38.916 16.872 1.00 0.00 H ATOM 3193 HB2 GLN A 420 0.635 40.909 18.077 1.00 0.00 H ATOM 3194 HB3 GLN A 420 2.362 40.599 18.372 1.00 0.00 H ATOM 3195 HG2 GLN A 420 2.273 42.369 16.828 1.00 0.00 H ATOM 3196 HG3 GLN A 420 2.722 40.925 15.891 1.00 0.00 H ATOM 3197 HE22 GLN A 420 2.083 42.427 14.104 1.00 0.00 H ATOM 3198 HE21 GLN A 420 0.347 42.422 13.624 1.00 0.00 H ATOM 3199 H GLN A 420 1.563 38.710 19.460 1.00 0.00 H ATOM 3200 N LEU A 421 3.615 38.348 16.780 1.00 42.49 N ATOM 3201 CA LEU A 421 4.690 37.915 15.890 1.00 43.06 C ATOM 3202 C LEU A 421 4.407 36.551 15.266 1.00 43.52 C ATOM 3203 O LEU A 421 4.617 36.345 14.074 1.00 43.80 O ATOM 3204 CB LEU A 421 6.042 37.949 16.608 1.00 42.71 C ATOM 3205 CG LEU A 421 6.479 39.368 16.993 1.00 42.69 C ATOM 3206 CD1 LEU A 421 7.800 39.343 17.744 1.00 41.35 C ATOM 3207 CD2 LEU A 421 6.568 40.290 15.762 1.00 42.06 C ATOM 3208 HA LEU A 421 4.737 38.625 15.064 1.00 0.00 H ATOM 3209 HB2 LEU A 421 5.969 37.349 17.515 1.00 0.00 H ATOM 3210 HB3 LEU A 421 6.797 37.519 15.949 1.00 0.00 H ATOM 3211 HG LEU A 421 5.715 39.776 17.655 1.00 0.00 H ATOM 3212 HD21 LEU A 421 7.295 39.885 15.058 1.00 0.00 H ATOM 3213 HD22 LEU A 421 5.591 40.349 15.283 1.00 0.00 H ATOM 3214 HD23 LEU A 421 6.881 41.286 16.077 1.00 0.00 H ATOM 3215 HD11 LEU A 421 7.689 38.751 18.652 1.00 0.00 H ATOM 3216 HD12 LEU A 421 8.568 38.899 17.111 1.00 0.00 H ATOM 3217 HD13 LEU A 421 8.087 40.361 18.005 1.00 0.00 H ATOM 3218 H LEU A 421 3.815 38.504 17.789 1.00 0.00 H ATOM 3219 N LYS A 422 3.893 35.631 16.067 1.00 44.35 N ATOM 3220 CA LYS A 422 3.608 34.287 15.586 1.00 44.98 C ATOM 3221 C LYS A 422 2.396 34.203 14.656 1.00 45.21 C ATOM 3222 O LYS A 422 2.299 33.278 13.837 1.00 45.28 O ATOM 3223 CB LYS A 422 3.484 33.333 16.768 1.00 45.16 C ATOM 3224 CG LYS A 422 4.849 32.919 17.292 1.00 46.47 C ATOM 3225 CD LYS A 422 4.778 32.319 18.681 1.00 49.82 C ATOM 3226 CE LYS A 422 6.173 31.971 19.171 1.00 50.91 C ATOM 3227 NZ LYS A 422 6.141 31.390 20.542 1.00 53.09 N ATOM 3228 HA LYS A 422 4.452 33.985 14.966 1.00 0.00 H ATOM 3229 HB2 LYS A 422 2.932 33.828 17.567 1.00 0.00 H ATOM 3230 HB3 LYS A 422 2.941 32.443 16.450 1.00 0.00 H ATOM 3231 HG2 LYS A 422 5.275 32.181 16.613 1.00 0.00 H ATOM 3232 HG3 LYS A 422 5.493 33.798 17.323 1.00 0.00 H ATOM 3233 HD2 LYS A 422 4.325 33.039 19.363 1.00 0.00 H ATOM 3234 HD3 LYS A 422 4.169 31.415 18.653 1.00 0.00 H ATOM 3235 HE2 LYS A 422 6.780 32.876 19.184 1.00 0.00 H ATOM 3236 HE3 LYS A 422 6.618 31.246 18.489 1.00 0.00 H ATOM 3237 HZ1 LYS A 422 5.723 32.079 21.199 1.00 0.00 H ATOM 3238 HZ2 LYS A 422 5.568 30.522 20.536 1.00 0.00 H ATOM 3239 HZ3 LYS A 422 7.110 31.164 20.844 1.00 0.00 H ATOM 3240 H LYS A 422 3.689 35.873 17.058 1.00 0.00 H ATOM 3241 N LEU A 423 1.481 35.161 14.779 1.00 45.22 N ATOM 3242 CA LEU A 423 0.316 35.214 13.897 1.00 45.54 C ATOM 3243 C LEU A 423 0.647 35.966 12.616 1.00 45.75 C ATOM 3244 O LEU A 423 0.226 35.566 11.527 1.00 45.79 O ATOM 3245 CB LEU A 423 -0.884 35.868 14.594 1.00 45.46 C ATOM 3246 CG LEU A 423 -1.566 35.131 15.753 1.00 45.13 C ATOM 3247 CD1 LEU A 423 -2.561 36.065 16.436 1.00 43.57 C ATOM 3248 CD2 LEU A 423 -2.242 33.831 15.293 1.00 44.19 C ATOM 3249 HA LEU A 423 0.047 34.188 13.647 1.00 0.00 H ATOM 3250 HB2 LEU A 423 -0.543 36.828 14.982 1.00 0.00 H ATOM 3251 HB3 LEU A 423 -1.644 36.035 13.831 1.00 0.00 H ATOM 3252 HG LEU A 423 -0.800 34.840 16.472 1.00 0.00 H ATOM 3253 HD21 LEU A 423 -3.000 34.062 14.544 1.00 0.00 H ATOM 3254 HD22 LEU A 423 -1.493 33.167 14.861 1.00 0.00 H ATOM 3255 HD23 LEU A 423 -2.711 33.345 16.148 1.00 0.00 H ATOM 3256 HD11 LEU A 423 -2.033 36.938 16.821 1.00 0.00 H ATOM 3257 HD12 LEU A 423 -3.313 36.383 15.714 1.00 0.00 H ATOM 3258 HD13 LEU A 423 -3.045 35.539 17.259 1.00 0.00 H ATOM 3259 H LEU A 423 1.597 35.886 15.516 1.00 0.00 H ATOM 3260 N ASN A 424 1.407 37.049 12.756 1.00 45.77 N ATOM 3261 CA ASN A 424 1.753 37.896 11.626 1.00 46.16 C ATOM 3262 C ASN A 424 2.920 37.320 10.837 1.00 46.48 C ATOM 3263 O ASN A 424 2.979 37.492 9.624 1.00 46.56 O ATOM 3264 CB ASN A 424 2.052 39.328 12.091 1.00 46.11 C ATOM 3265 CG ASN A 424 1.977 40.356 10.964 1.00 45.99 C ATOM 3266 OD1 ASN A 424 1.277 40.171 9.964 1.00 45.23 O ATOM 3267 ND2 ASN A 424 2.700 41.457 11.137 1.00 45.78 N ATOM 3268 HA ASN A 424 0.892 37.929 10.958 1.00 0.00 H ATOM 3269 HB2 ASN A 424 1.328 39.602 12.858 1.00 0.00 H ATOM 3270 HB3 ASN A 424 3.056 39.352 12.516 1.00 0.00 H ATOM 3271 HD22 ASN A 424 3.276 41.571 11.995 1.00 0.00 H ATOM 3272 HD21 ASN A 424 2.690 42.205 10.414 1.00 0.00 H ATOM 3273 H ASN A 424 1.764 37.297 13.701 1.00 0.00 H ATOM 3274 N HIS A 425 3.830 36.619 11.518 1.00 46.88 N ATOM 3275 CA HIS A 425 4.993 36.009 10.857 1.00 47.20 C ATOM 3276 C HIS A 425 5.116 34.511 11.150 1.00 47.49 C ATOM 3277 O HIS A 425 6.099 34.089 11.770 1.00 47.63 O ATOM 3278 CB HIS A 425 6.286 36.720 11.264 1.00 47.11 C ATOM 3279 CG HIS A 425 6.234 38.207 11.120 1.00 47.72 C ATOM 3280 ND1 HIS A 425 6.771 38.867 10.038 1.00 48.59 N ATOM 3281 CD2 HIS A 425 5.714 39.163 11.925 1.00 47.89 C ATOM 3282 CE1 HIS A 425 6.576 40.166 10.176 1.00 48.80 C ATOM 3283 NE2 HIS A 425 5.937 40.371 11.313 1.00 48.89 N ATOM 3284 HA HIS A 425 4.835 36.126 9.785 1.00 0.00 H ATOM 3285 HB2 HIS A 425 6.494 36.484 12.308 1.00 0.00 H ATOM 3286 HB3 HIS A 425 7.096 36.343 10.639 1.00 0.00 H ATOM 3287 HD2 HIS A 425 5.213 39.003 12.880 1.00 0.00 H ATOM 3288 HE1 HIS A 425 6.889 40.937 9.472 1.00 0.00 H ATOM 3289 H HIS A 425 3.713 36.501 12.545 1.00 0.00 H ATOM 3290 N PRO A 426 4.144 33.697 10.681 1.00 47.93 N ATOM 3291 CA PRO A 426 4.115 32.268 11.044 1.00 48.26 C ATOM 3292 C PRO A 426 5.329 31.476 10.567 1.00 48.36 C ATOM 3293 O PRO A 426 5.672 30.471 11.176 1.00 48.86 O ATOM 3294 CB PRO A 426 2.845 31.752 10.357 1.00 48.13 C ATOM 3295 CG PRO A 426 2.650 32.670 9.190 1.00 48.18 C ATOM 3296 CD PRO A 426 3.104 34.023 9.683 1.00 48.24 C ATOM 3297 HA PRO A 426 4.129 32.146 12.127 1.00 0.00 H ATOM 3298 HD3 PRO A 426 3.519 34.616 8.868 1.00 0.00 H ATOM 3299 HD2 PRO A 426 2.279 34.567 10.143 1.00 0.00 H ATOM 3300 HG3 PRO A 426 1.601 32.700 8.896 1.00 0.00 H ATOM 3301 HG2 PRO A 426 3.254 32.347 8.342 1.00 0.00 H ATOM 3302 HB2 PRO A 426 2.979 30.724 10.021 1.00 0.00 H ATOM 3303 HB3 PRO A 426 1.992 31.803 11.034 1.00 0.00 H ATOM 3304 N GLU A 427 5.973 31.935 9.500 1.00 48.54 N ATOM 3305 CA GLU A 427 7.139 31.253 8.936 1.00 48.69 C ATOM 3306 C GLU A 427 8.467 31.731 9.524 1.00 48.56 C ATOM 3307 O GLU A 427 9.528 31.258 9.118 1.00 48.61 O ATOM 3308 CB GLU A 427 7.175 31.380 7.397 1.00 48.80 C ATOM 3309 CG GLU A 427 5.869 31.024 6.673 1.00 49.25 C ATOM 3310 CD GLU A 427 5.340 29.635 6.998 1.00 49.94 C ATOM 3311 OE1 GLU A 427 6.146 28.683 7.099 1.00 51.04 O ATOM 3312 OE2 GLU A 427 4.106 29.494 7.137 1.00 49.68 O ATOM 3313 HA GLU A 427 7.023 30.205 9.212 1.00 0.00 H ATOM 3314 HB2 GLU A 427 7.425 32.412 7.151 1.00 0.00 H ATOM 3315 HB3 GLU A 427 7.957 30.719 7.024 1.00 0.00 H ATOM 3316 HG2 GLU A 427 5.111 31.754 6.955 1.00 0.00 H ATOM 3317 HG3 GLU A 427 6.046 31.081 5.599 1.00 0.00 H ATOM 3318 H GLU A 427 5.637 32.810 9.049 1.00 0.00 H ATOM 3319 N SER A 428 8.405 32.657 10.479 1.00 48.38 N ATOM 3320 CA SER A 428 9.609 33.330 10.980 1.00 48.31 C ATOM 3321 C SER A 428 10.002 32.818 12.359 1.00 47.88 C ATOM 3322 O SER A 428 9.576 33.362 13.388 1.00 48.16 O ATOM 3323 CB SER A 428 9.396 34.846 11.003 1.00 48.32 C ATOM 3324 OG SER A 428 10.629 35.538 11.008 1.00 49.02 O ATOM 3325 HA SER A 428 10.431 33.101 10.301 1.00 0.00 H ATOM 3326 HB2 SER A 428 8.835 35.113 11.899 1.00 0.00 H ATOM 3327 HB3 SER A 428 8.828 35.138 10.120 1.00 0.00 H ATOM 3328 HG SER A 428 10.459 36.513 11.023 1.00 0.00 H ATOM 3329 H SER A 428 7.479 32.910 10.880 1.00 0.00 H ATOM 3330 N SER A 429 10.823 31.772 12.370 1.00 47.18 N ATOM 3331 CA SER A 429 11.178 31.065 13.601 1.00 46.29 C ATOM 3332 C SER A 429 11.947 31.931 14.599 1.00 45.62 C ATOM 3333 O SER A 429 12.947 32.568 14.246 1.00 45.42 O ATOM 3334 CB SER A 429 11.962 29.784 13.290 1.00 46.34 C ATOM 3335 OG SER A 429 12.065 28.966 14.446 1.00 46.38 O ATOM 3336 HA SER A 429 10.234 30.803 14.079 1.00 0.00 H ATOM 3337 HB2 SER A 429 12.963 30.050 12.949 1.00 0.00 H ATOM 3338 HB3 SER A 429 11.447 29.231 12.504 1.00 0.00 H ATOM 3339 HG SER A 429 12.573 28.146 14.224 1.00 0.00 H ATOM 3340 H SER A 429 11.228 31.444 11.470 1.00 0.00 H ATOM 3341 N GLN A 430 11.447 31.953 15.837 1.00 44.63 N ATOM 3342 CA GLN A 430 12.058 32.691 16.952 1.00 43.76 C ATOM 3343 C GLN A 430 12.264 34.191 16.690 1.00 42.89 C ATOM 3344 O GLN A 430 13.181 34.805 17.243 1.00 42.58 O ATOM 3345 CB GLN A 430 13.371 32.018 17.396 1.00 43.84 C ATOM 3346 CG GLN A 430 13.193 30.605 17.958 1.00 44.48 C ATOM 3347 CD GLN A 430 12.502 30.596 19.307 1.00 45.81 C ATOM 3348 OE1 GLN A 430 12.919 31.289 20.231 1.00 45.88 O ATOM 3349 NE2 GLN A 430 11.437 29.808 19.426 1.00 47.12 N ATOM 3350 HA GLN A 430 11.334 32.644 17.765 1.00 0.00 H ATOM 3351 HB2 GLN A 430 14.035 31.962 16.534 1.00 0.00 H ATOM 3352 HB3 GLN A 430 13.829 32.638 18.167 1.00 0.00 H ATOM 3353 HG2 GLN A 430 12.596 30.023 17.256 1.00 0.00 H ATOM 3354 HG3 GLN A 430 14.176 30.146 18.066 1.00 0.00 H ATOM 3355 HE22 GLN A 430 11.119 29.238 18.616 1.00 0.00 H ATOM 3356 HE21 GLN A 430 10.922 29.762 20.329 1.00 0.00 H ATOM 3357 H GLN A 430 10.575 31.417 16.023 1.00 0.00 H ATOM 3358 N LEU A 431 11.402 34.773 15.856 1.00 41.86 N ATOM 3359 CA LEU A 431 11.410 36.217 15.602 1.00 40.99 C ATOM 3360 C LEU A 431 11.280 37.022 16.894 1.00 40.34 C ATOM 3361 O LEU A 431 11.927 38.050 17.054 1.00 39.90 O ATOM 3362 CB LEU A 431 10.297 36.610 14.618 1.00 40.64 C ATOM 3363 CG LEU A 431 10.253 38.086 14.207 1.00 40.23 C ATOM 3364 CD1 LEU A 431 11.592 38.537 13.626 1.00 39.83 C ATOM 3365 CD2 LEU A 431 9.119 38.359 13.227 1.00 38.89 C ATOM 3366 HA LEU A 431 12.374 36.456 15.154 1.00 0.00 H ATOM 3367 HB2 LEU A 431 10.426 36.015 13.714 1.00 0.00 H ATOM 3368 HB3 LEU A 431 9.341 36.364 15.080 1.00 0.00 H ATOM 3369 HG LEU A 431 10.061 38.669 15.108 1.00 0.00 H ATOM 3370 HD21 LEU A 431 9.261 37.755 12.331 1.00 0.00 H ATOM 3371 HD22 LEU A 431 8.168 38.101 13.693 1.00 0.00 H ATOM 3372 HD23 LEU A 431 9.119 39.415 12.958 1.00 0.00 H ATOM 3373 HD11 LEU A 431 12.374 38.407 14.374 1.00 0.00 H ATOM 3374 HD12 LEU A 431 11.826 37.937 12.746 1.00 0.00 H ATOM 3375 HD13 LEU A 431 11.529 39.588 13.344 1.00 0.00 H ATOM 3376 H LEU A 431 10.699 34.182 15.368 1.00 0.00 H ATOM 3377 N PHE A 432 10.438 36.534 17.802 1.00 40.57 N ATOM 3378 CA PHE A 432 10.243 37.129 19.126 1.00 40.77 C ATOM 3379 C PHE A 432 11.577 37.239 19.874 1.00 40.71 C ATOM 3380 O PHE A 432 11.972 38.334 20.301 1.00 40.73 O ATOM 3381 CB PHE A 432 9.190 36.325 19.904 1.00 40.78 C ATOM 3382 CG PHE A 432 8.925 36.822 21.307 1.00 41.08 C ATOM 3383 CD1 PHE A 432 8.367 38.080 21.527 1.00 41.53 C ATOM 3384 CD2 PHE A 432 9.191 36.004 22.407 1.00 40.17 C ATOM 3385 CE1 PHE A 432 8.103 38.530 22.826 1.00 41.63 C ATOM 3386 CE2 PHE A 432 8.927 36.438 23.703 1.00 40.32 C ATOM 3387 CZ PHE A 432 8.389 37.708 23.913 1.00 41.22 C ATOM 3388 HA PHE A 432 9.866 38.146 19.019 1.00 0.00 H ATOM 3389 HB2 PHE A 432 8.254 36.363 19.347 1.00 0.00 H ATOM 3390 HB3 PHE A 432 9.531 35.292 19.968 1.00 0.00 H ATOM 3391 HD2 PHE A 432 9.612 35.011 22.248 1.00 0.00 H ATOM 3392 HE2 PHE A 432 9.140 35.788 24.551 1.00 0.00 H ATOM 3393 HZ PHE A 432 8.193 38.056 24.927 1.00 0.00 H ATOM 3394 HE1 PHE A 432 7.675 39.520 22.986 1.00 0.00 H ATOM 3395 HD1 PHE A 432 8.133 38.721 20.677 1.00 0.00 H ATOM 3396 H PHE A 432 9.889 35.685 17.558 1.00 0.00 H ATOM 3397 N ALA A 433 12.288 36.118 19.979 1.00 40.67 N ATOM 3398 CA ALA A 433 13.636 36.105 20.566 1.00 40.74 C ATOM 3399 C ALA A 433 14.610 37.058 19.857 1.00 40.77 C ATOM 3400 O ALA A 433 15.327 37.823 20.518 1.00 40.89 O ATOM 3401 CB ALA A 433 14.193 34.687 20.590 1.00 40.77 C ATOM 3402 HA ALA A 433 13.536 36.470 21.588 1.00 0.00 H ATOM 3403 HB1 ALA A 433 13.539 34.051 21.187 1.00 0.00 H ATOM 3404 HB2 ALA A 433 14.245 34.301 19.572 1.00 0.00 H ATOM 3405 HB3 ALA A 433 15.191 34.697 21.028 1.00 0.00 H ATOM 3406 H ALA A 433 11.878 35.226 19.636 1.00 0.00 H ATOM 3407 N LYS A 434 14.624 37.020 18.522 1.00 40.59 N ATOM 3408 CA LYS A 434 15.532 37.860 17.731 1.00 40.69 C ATOM 3409 C LYS A 434 15.220 39.348 17.889 1.00 40.19 C ATOM 3410 O LYS A 434 16.139 40.170 17.934 1.00 39.90 O ATOM 3411 CB LYS A 434 15.507 37.466 16.246 1.00 41.11 C ATOM 3412 CG LYS A 434 16.108 36.096 15.930 1.00 43.63 C ATOM 3413 CD LYS A 434 16.131 35.844 14.423 1.00 48.23 C ATOM 3414 CE LYS A 434 15.959 34.361 14.106 1.00 50.41 C ATOM 3415 NZ LYS A 434 16.334 34.049 12.691 1.00 52.77 N ATOM 3416 HA LYS A 434 16.536 37.687 18.119 1.00 0.00 H ATOM 3417 HB2 LYS A 434 14.469 37.465 15.914 1.00 0.00 H ATOM 3418 HB3 LYS A 434 16.065 38.217 15.687 1.00 0.00 H ATOM 3419 HG2 LYS A 434 17.127 36.056 16.314 1.00 0.00 H ATOM 3420 HG3 LYS A 434 15.509 35.324 16.412 1.00 0.00 H ATOM 3421 HD2 LYS A 434 15.320 36.403 13.957 1.00 0.00 H ATOM 3422 HD3 LYS A 434 17.085 36.185 14.020 1.00 0.00 H ATOM 3423 HE2 LYS A 434 14.917 34.084 14.264 1.00 0.00 H ATOM 3424 HE3 LYS A 434 16.593 33.781 14.776 1.00 0.00 H ATOM 3425 HZ1 LYS A 434 15.728 34.594 12.045 1.00 0.00 H ATOM 3426 HZ2 LYS A 434 17.330 34.304 12.533 1.00 0.00 H ATOM 3427 HZ3 LYS A 434 16.203 33.032 12.515 1.00 0.00 H ATOM 3428 H LYS A 434 13.973 36.377 18.028 1.00 0.00 H ATOM 3429 N LEU A 435 13.930 39.689 17.971 1.00 39.78 N ATOM 3430 CA LEU A 435 13.515 41.075 18.217 1.00 39.67 C ATOM 3431 C LEU A 435 13.994 41.591 19.579 1.00 39.90 C ATOM 3432 O LEU A 435 14.540 42.696 19.671 1.00 39.56 O ATOM 3433 CB LEU A 435 11.995 41.246 18.062 1.00 39.49 C ATOM 3434 CG LEU A 435 11.383 42.632 18.325 1.00 38.67 C ATOM 3435 CD1 LEU A 435 12.143 43.757 17.638 1.00 37.75 C ATOM 3436 CD2 LEU A 435 9.917 42.654 17.904 1.00 38.19 C ATOM 3437 HA LEU A 435 13.999 41.686 17.455 1.00 0.00 H ATOM 3438 HB2 LEU A 435 11.743 40.971 17.038 1.00 0.00 H ATOM 3439 HB3 LEU A 435 11.520 40.548 18.752 1.00 0.00 H ATOM 3440 HG LEU A 435 11.459 42.808 19.398 1.00 0.00 H ATOM 3441 HD21 LEU A 435 9.842 42.428 16.840 1.00 0.00 H ATOM 3442 HD22 LEU A 435 9.365 41.907 18.475 1.00 0.00 H ATOM 3443 HD23 LEU A 435 9.500 43.642 18.097 1.00 0.00 H ATOM 3444 HD11 LEU A 435 13.171 43.774 18.001 1.00 0.00 H ATOM 3445 HD12 LEU A 435 12.139 43.591 16.561 1.00 0.00 H ATOM 3446 HD13 LEU A 435 11.662 44.709 17.862 1.00 0.00 H ATOM 3447 H LEU A 435 13.203 38.954 17.858 1.00 0.00 H ATOM 3448 N LEU A 436 13.813 40.789 20.625 1.00 40.41 N ATOM 3449 CA LEU A 436 14.247 41.194 21.969 1.00 41.39 C ATOM 3450 C LEU A 436 15.757 41.400 22.068 1.00 42.02 C ATOM 3451 O LEU A 436 16.215 42.343 22.706 1.00 42.00 O ATOM 3452 CB LEU A 436 13.750 40.219 23.032 1.00 41.00 C ATOM 3453 CG LEU A 436 12.226 40.143 23.184 1.00 41.83 C ATOM 3454 CD1 LEU A 436 11.855 39.091 24.209 1.00 42.63 C ATOM 3455 CD2 LEU A 436 11.602 41.500 23.556 1.00 41.42 C ATOM 3456 HA LEU A 436 13.789 42.165 22.160 1.00 0.00 H ATOM 3457 HB2 LEU A 436 14.114 39.224 22.775 1.00 0.00 H ATOM 3458 HB3 LEU A 436 14.171 40.522 23.991 1.00 0.00 H ATOM 3459 HG LEU A 436 11.819 39.862 22.213 1.00 0.00 H ATOM 3460 HD21 LEU A 436 12.018 41.842 24.504 1.00 0.00 H ATOM 3461 HD22 LEU A 436 11.826 42.228 22.776 1.00 0.00 H ATOM 3462 HD23 LEU A 436 10.522 41.388 23.651 1.00 0.00 H ATOM 3463 HD11 LEU A 436 12.231 38.121 23.884 1.00 0.00 H ATOM 3464 HD12 LEU A 436 12.298 39.350 25.171 1.00 0.00 H ATOM 3465 HD13 LEU A 436 10.770 39.048 24.307 1.00 0.00 H ATOM 3466 H LEU A 436 13.358 39.863 20.490 1.00 0.00 H ATOM 3467 N GLN A 437 16.521 40.535 21.407 1.00 43.41 N ATOM 3468 CA GLN A 437 17.974 40.666 21.345 1.00 44.62 C ATOM 3469 C GLN A 437 18.427 41.982 20.712 1.00 45.22 C ATOM 3470 O GLN A 437 19.546 42.429 20.956 1.00 45.55 O ATOM 3471 CB GLN A 437 18.592 39.461 20.621 1.00 44.91 C ATOM 3472 CG GLN A 437 18.493 38.162 21.428 1.00 47.13 C ATOM 3473 CD GLN A 437 19.168 36.965 20.779 1.00 49.94 C ATOM 3474 OE1 GLN A 437 18.848 36.579 19.649 1.00 51.85 O ATOM 3475 NE2 GLN A 437 20.088 36.344 21.514 1.00 51.49 N ATOM 3476 HA GLN A 437 18.335 40.683 22.373 1.00 0.00 H ATOM 3477 HB2 GLN A 437 18.073 39.322 19.673 1.00 0.00 H ATOM 3478 HB3 GLN A 437 19.644 39.672 20.430 1.00 0.00 H ATOM 3479 HG2 GLN A 437 18.956 38.329 22.401 1.00 0.00 H ATOM 3480 HG3 GLN A 437 17.438 37.925 21.565 1.00 0.00 H ATOM 3481 HE22 GLN A 437 20.327 36.703 22.460 1.00 0.00 H ATOM 3482 HE21 GLN A 437 20.568 35.500 21.142 1.00 0.00 H ATOM 3483 H GLN A 437 16.068 39.737 20.917 1.00 0.00 H ATOM 3484 N LYS A 438 17.556 42.601 19.911 1.00 46.01 N ATOM 3485 CA LYS A 438 17.852 43.886 19.257 1.00 46.89 C ATOM 3486 C LYS A 438 17.889 45.054 20.230 1.00 47.50 C ATOM 3487 O LYS A 438 18.447 46.109 19.916 1.00 47.09 O ATOM 3488 CB LYS A 438 16.848 44.194 18.133 1.00 47.02 C ATOM 3489 CG LYS A 438 16.875 43.222 16.955 1.00 47.08 C ATOM 3490 CD LYS A 438 18.162 43.329 16.140 1.00 47.42 C ATOM 3491 CE LYS A 438 18.332 42.114 15.226 1.00 48.36 C ATOM 3492 NZ LYS A 438 19.606 42.172 14.454 1.00 48.99 N ATOM 3493 HA LYS A 438 18.849 43.771 18.832 1.00 0.00 H ATOM 3494 HB2 LYS A 438 15.846 44.178 18.561 1.00 0.00 H ATOM 3495 HB3 LYS A 438 17.063 45.192 17.752 1.00 0.00 H ATOM 3496 HG2 LYS A 438 16.786 42.205 17.338 1.00 0.00 H ATOM 3497 HG3 LYS A 438 16.029 43.438 16.303 1.00 0.00 H ATOM 3498 HD2 LYS A 438 18.125 44.232 15.531 1.00 0.00 H ATOM 3499 HD3 LYS A 438 19.012 43.386 16.820 1.00 0.00 H ATOM 3500 HE2 LYS A 438 17.497 42.080 14.526 1.00 0.00 H ATOM 3501 HE3 LYS A 438 18.330 41.211 15.836 1.00 0.00 H ATOM 3502 HZ1 LYS A 438 19.613 43.028 13.863 1.00 0.00 H ATOM 3503 HZ2 LYS A 438 20.409 42.198 15.114 1.00 0.00 H ATOM 3504 HZ3 LYS A 438 19.681 41.330 13.848 1.00 0.00 H ATOM 3505 H LYS A 438 16.631 42.157 19.742 1.00 0.00 H ATOM 3506 N MET A 439 17.295 44.859 21.409 1.00 48.67 N ATOM 3507 CA MET A 439 17.323 45.868 22.462 1.00 49.89 C ATOM 3508 C MET A 439 18.740 46.104 22.978 1.00 50.26 C ATOM 3509 O MET A 439 19.044 47.189 23.472 1.00 50.69 O ATOM 3510 CB MET A 439 16.355 45.511 23.595 1.00 50.35 C ATOM 3511 CG MET A 439 14.901 45.840 23.263 1.00 52.11 C ATOM 3512 SD MET A 439 13.671 45.088 24.362 1.00 58.02 S ATOM 3513 CE MET A 439 13.859 46.115 25.827 1.00 56.50 C ATOM 3514 HA MET A 439 16.984 46.809 22.028 1.00 0.00 H ATOM 3515 HB2 MET A 439 16.433 44.442 23.795 1.00 0.00 H ATOM 3516 HB3 MET A 439 16.643 46.068 24.487 1.00 0.00 H ATOM 3517 HG2 MET A 439 14.701 45.498 22.248 1.00 0.00 H ATOM 3518 HG3 MET A 439 14.780 46.922 23.311 1.00 0.00 H ATOM 3519 HE1 MET A 439 14.882 46.036 26.196 1.00 0.00 H ATOM 3520 HE2 MET A 439 13.642 47.152 25.572 1.00 0.00 H ATOM 3521 HE3 MET A 439 13.167 45.777 26.598 1.00 0.00 H ATOM 3522 H MET A 439 16.798 43.962 21.582 1.00 0.00 H ATOM 3523 N THR A 440 19.602 45.093 22.835 1.00 50.70 N ATOM 3524 CA THR A 440 21.036 45.223 23.124 1.00 51.09 C ATOM 3525 C THR A 440 21.691 46.202 22.155 1.00 51.17 C ATOM 3526 O THR A 440 22.511 47.028 22.558 1.00 51.30 O ATOM 3527 CB THR A 440 21.780 43.857 23.026 1.00 51.09 C ATOM 3528 OG1 THR A 440 21.102 42.870 23.812 1.00 52.11 O ATOM 3529 CG2 THR A 440 23.212 43.978 23.514 1.00 50.97 C ATOM 3530 HA THR A 440 21.116 45.592 24.146 1.00 0.00 H ATOM 3531 HB THR A 440 21.788 43.557 21.978 1.00 0.00 H ATOM 3532 HG1 THR A 440 21.583 42.007 23.743 1.00 0.00 H ATOM 3533 HG23 THR A 440 23.735 44.728 22.920 1.00 0.00 H ATOM 3534 HG21 THR A 440 23.213 44.277 24.562 1.00 0.00 H ATOM 3535 HG22 THR A 440 23.713 43.016 23.409 1.00 0.00 H ATOM 3536 H THR A 440 19.242 44.175 22.505 1.00 0.00 H ATOM 3537 N ASP A 441 21.337 46.092 20.876 1.00 51.36 N ATOM 3538 CA ASP A 441 21.867 46.988 19.857 1.00 51.57 C ATOM 3539 C ASP A 441 21.468 48.425 20.158 1.00 51.35 C ATOM 3540 O ASP A 441 22.293 49.331 20.079 1.00 51.45 O ATOM 3541 CB ASP A 441 21.373 46.583 18.464 1.00 51.86 C ATOM 3542 CG ASP A 441 21.791 45.172 18.077 1.00 52.92 C ATOM 3543 OD1 ASP A 441 21.803 44.275 18.949 1.00 54.16 O ATOM 3544 OD2 ASP A 441 22.102 44.958 16.886 1.00 54.45 O ATOM 3545 HA ASP A 441 22.954 46.913 19.870 1.00 0.00 H ATOM 3546 HB2 ASP A 441 20.285 46.640 18.450 1.00 0.00 H ATOM 3547 HB3 ASP A 441 21.782 47.280 17.733 1.00 0.00 H ATOM 3548 H ASP A 441 20.666 45.348 20.598 1.00 0.00 H ATOM 3549 N LEU A 442 20.202 48.617 20.525 1.00 51.28 N ATOM 3550 CA LEU A 442 19.656 49.950 20.799 1.00 51.02 C ATOM 3551 C LEU A 442 20.380 50.656 21.937 1.00 51.12 C ATOM 3552 O LEU A 442 20.782 51.814 21.803 1.00 50.70 O ATOM 3553 CB LEU A 442 18.158 49.870 21.109 1.00 50.79 C ATOM 3554 CG LEU A 442 17.201 49.572 19.955 1.00 50.20 C ATOM 3555 CD1 LEU A 442 15.828 49.310 20.518 1.00 50.14 C ATOM 3556 CD2 LEU A 442 17.167 50.725 18.959 1.00 49.32 C ATOM 3557 HA LEU A 442 19.810 50.539 19.895 1.00 0.00 H ATOM 3558 HB2 LEU A 442 18.022 49.086 21.854 1.00 0.00 H ATOM 3559 HB3 LEU A 442 17.863 50.829 21.535 1.00 0.00 H ATOM 3560 HG LEU A 442 17.549 48.691 19.417 1.00 0.00 H ATOM 3561 HD21 LEU A 442 16.833 51.631 19.465 1.00 0.00 H ATOM 3562 HD22 LEU A 442 18.166 50.882 18.553 1.00 0.00 H ATOM 3563 HD23 LEU A 442 16.478 50.484 18.150 1.00 0.00 H ATOM 3564 HD11 LEU A 442 15.871 48.455 21.193 1.00 0.00 H ATOM 3565 HD12 LEU A 442 15.487 50.190 21.064 1.00 0.00 H ATOM 3566 HD13 LEU A 442 15.137 49.096 19.703 1.00 0.00 H ATOM 3567 H LEU A 442 19.578 47.791 20.621 1.00 0.00 H ATOM 3568 N ARG A 443 20.549 49.953 23.053 1.00 51.80 N ATOM 3569 CA ARG A 443 21.188 50.536 24.233 1.00 52.56 C ATOM 3570 C ARG A 443 22.637 50.978 23.962 1.00 52.45 C ATOM 3571 O ARG A 443 23.069 52.024 24.444 1.00 52.30 O ATOM 3572 CB ARG A 443 21.110 49.570 25.415 1.00 52.98 C ATOM 3573 CG ARG A 443 20.881 50.270 26.738 1.00 54.79 C ATOM 3574 CD ARG A 443 20.603 49.279 27.836 1.00 59.04 C ATOM 3575 NE ARG A 443 19.231 48.767 27.807 1.00 61.59 N ATOM 3576 CZ ARG A 443 18.415 48.739 28.858 1.00 62.15 C ATOM 3577 NH1 ARG A 443 18.824 49.199 30.034 1.00 63.01 N ATOM 3578 NH2 ARG A 443 17.190 48.242 28.737 1.00 62.74 N ATOM 3579 HA ARG A 443 20.636 51.441 24.488 1.00 0.00 H ATOM 3580 HB2 ARG A 443 20.288 48.875 25.242 1.00 0.00 H ATOM 3581 HB3 ARG A 443 22.047 49.015 25.473 1.00 0.00 H ATOM 3582 HG2 ARG A 443 21.770 50.846 26.995 1.00 0.00 H ATOM 3583 HG3 ARG A 443 20.029 50.943 26.642 1.00 0.00 H ATOM 3584 HD2 ARG A 443 20.773 49.766 28.796 1.00 0.00 H ATOM 3585 HD3 ARG A 443 21.290 48.440 27.730 1.00 0.00 H ATOM 3586 HE ARG A 443 18.870 48.400 26.903 1.00 0.00 H ATOM 3587 HH12 ARG A 443 18.183 49.175 30.853 1.00 0.00 H ATOM 3588 HH11 ARG A 443 19.785 49.583 30.136 1.00 0.00 H ATOM 3589 HH22 ARG A 443 16.554 48.221 29.559 1.00 0.00 H ATOM 3590 HH21 ARG A 443 16.867 47.874 27.820 1.00 0.00 H ATOM 3591 H ARG A 443 20.220 48.967 23.088 1.00 0.00 H ATOM 3592 N GLN A 444 23.369 50.198 23.168 1.00 52.78 N ATOM 3593 CA GLN A 444 24.732 50.571 22.768 1.00 53.23 C ATOM 3594 C GLN A 444 24.728 51.806 21.867 1.00 52.58 C ATOM 3595 O GLN A 444 25.613 52.661 21.974 1.00 52.46 O ATOM 3596 CB GLN A 444 25.461 49.402 22.078 1.00 53.68 C ATOM 3597 CG GLN A 444 25.740 48.172 22.976 1.00 56.48 C ATOM 3598 CD GLN A 444 26.996 48.306 23.854 1.00 59.81 C ATOM 3599 OE1 GLN A 444 27.671 49.342 23.854 1.00 61.91 O ATOM 3600 NE2 GLN A 444 27.310 47.247 24.600 1.00 59.45 N ATOM 3601 HA GLN A 444 25.277 50.815 23.680 1.00 0.00 H ATOM 3602 HB2 GLN A 444 24.850 49.073 21.237 1.00 0.00 H ATOM 3603 HB3 GLN A 444 26.417 49.773 21.708 1.00 0.00 H ATOM 3604 HG2 GLN A 444 24.880 48.023 23.629 1.00 0.00 H ATOM 3605 HG3 GLN A 444 25.863 47.300 22.334 1.00 0.00 H ATOM 3606 HE22 GLN A 444 26.715 46.395 24.570 1.00 0.00 H ATOM 3607 HE21 GLN A 444 28.150 47.273 25.212 1.00 0.00 H ATOM 3608 H GLN A 444 22.966 49.304 22.823 1.00 0.00 H ATOM 3609 N ILE A 445 23.729 51.901 20.990 1.00 52.17 N ATOM 3610 CA ILE A 445 23.572 53.071 20.112 1.00 51.67 C ATOM 3611 C ILE A 445 23.357 54.363 20.903 1.00 51.49 C ATOM 3612 O ILE A 445 23.952 55.393 20.579 1.00 51.47 O ATOM 3613 CB ILE A 445 22.449 52.863 19.068 1.00 51.74 C ATOM 3614 CG1 ILE A 445 22.886 51.810 18.048 1.00 51.65 C ATOM 3615 CG2 ILE A 445 22.098 54.177 18.358 1.00 50.79 C ATOM 3616 CD1 ILE A 445 21.757 51.032 17.470 1.00 52.33 C ATOM 3617 HA ILE A 445 24.511 53.176 19.569 1.00 0.00 H ATOM 3618 HB ILE A 445 21.555 52.517 19.587 1.00 0.00 H ATOM 3619 HG12 ILE A 445 23.409 52.314 17.235 1.00 0.00 H ATOM 3620 HG13 ILE A 445 23.567 51.115 18.540 1.00 0.00 H ATOM 3621 HD11 ILE A 445 21.230 50.511 18.269 1.00 0.00 H ATOM 3622 HD12 ILE A 445 21.072 51.711 16.963 1.00 0.00 H ATOM 3623 HD13 ILE A 445 22.146 50.306 16.756 1.00 0.00 H ATOM 3624 HG21 ILE A 445 21.758 54.906 19.093 1.00 0.00 H ATOM 3625 HG22 ILE A 445 22.981 54.559 17.847 1.00 0.00 H ATOM 3626 HG23 ILE A 445 21.306 53.996 17.631 1.00 0.00 H ATOM 3627 H ILE A 445 23.040 51.125 20.924 1.00 0.00 H ATOM 3628 N VAL A 446 22.527 54.298 21.942 1.00 51.50 N ATOM 3629 CA VAL A 446 22.295 55.444 22.828 1.00 51.84 C ATOM 3630 C VAL A 446 23.605 55.898 23.501 1.00 52.14 C ATOM 3631 O VAL A 446 23.944 57.091 23.473 1.00 51.98 O ATOM 3632 CB VAL A 446 21.190 55.152 23.892 1.00 51.76 C ATOM 3633 CG1 VAL A 446 20.989 56.352 24.818 1.00 51.60 C ATOM 3634 CG2 VAL A 446 19.874 54.787 23.219 1.00 51.46 C ATOM 3635 HA VAL A 446 21.931 56.261 22.205 1.00 0.00 H ATOM 3636 HB VAL A 446 21.524 54.305 24.491 1.00 0.00 H ATOM 3637 HG11 VAL A 446 21.923 56.571 25.335 1.00 0.00 H ATOM 3638 HG12 VAL A 446 20.687 57.218 24.228 1.00 0.00 H ATOM 3639 HG13 VAL A 446 20.214 56.120 25.548 1.00 0.00 H ATOM 3640 HG21 VAL A 446 19.547 55.615 22.590 1.00 0.00 H ATOM 3641 HG22 VAL A 446 20.016 53.897 22.606 1.00 0.00 H ATOM 3642 HG23 VAL A 446 19.121 54.588 23.981 1.00 0.00 H ATOM 3643 H VAL A 446 22.027 53.406 22.132 1.00 0.00 H ATOM 3644 N THR A 447 24.340 54.936 24.065 1.00 52.60 N ATOM 3645 CA THR A 447 25.621 55.195 24.744 1.00 52.89 C ATOM 3646 C THR A 447 26.630 55.832 23.790 1.00 53.03 C ATOM 3647 O THR A 447 27.207 56.881 24.094 1.00 53.21 O ATOM 3648 CB THR A 447 26.217 53.901 25.358 1.00 52.96 C ATOM 3649 OG1 THR A 447 25.211 53.209 26.108 1.00 52.31 O ATOM 3650 CG2 THR A 447 27.413 54.219 26.274 1.00 53.40 C ATOM 3651 HA THR A 447 25.415 55.893 25.556 1.00 0.00 H ATOM 3652 HB THR A 447 26.567 53.270 24.541 1.00 0.00 H ATOM 3653 HG1 THR A 447 24.460 52.971 25.509 1.00 0.00 H ATOM 3654 HG23 THR A 447 28.177 54.745 25.702 1.00 0.00 H ATOM 3655 HG21 THR A 447 27.079 54.847 27.100 1.00 0.00 H ATOM 3656 HG22 THR A 447 27.826 53.290 26.666 1.00 0.00 H ATOM 3657 H THR A 447 23.991 53.957 24.023 1.00 0.00 H ATOM 3658 N GLU A 448 26.833 55.202 22.635 1.00 53.24 N ATOM 3659 CA GLU A 448 27.685 55.770 21.593 1.00 53.35 C ATOM 3660 C GLU A 448 27.301 57.223 21.331 1.00 53.12 C ATOM 3661 O GLU A 448 28.159 58.108 21.333 1.00 53.30 O ATOM 3662 CB GLU A 448 27.576 54.964 20.293 1.00 53.50 C ATOM 3663 CG GLU A 448 28.689 53.945 20.055 1.00 55.23 C ATOM 3664 CD GLU A 448 28.822 53.544 18.587 1.00 56.95 C ATOM 3665 OE1 GLU A 448 28.657 54.418 17.700 1.00 57.31 O ATOM 3666 OE2 GLU A 448 29.103 52.354 18.321 1.00 57.73 O ATOM 3667 HA GLU A 448 28.717 55.727 21.942 1.00 0.00 H ATOM 3668 HB2 GLU A 448 26.627 54.428 20.309 1.00 0.00 H ATOM 3669 HB3 GLU A 448 27.581 55.667 19.460 1.00 0.00 H ATOM 3670 HG2 GLU A 448 29.634 54.377 20.385 1.00 0.00 H ATOM 3671 HG3 GLU A 448 28.475 53.052 20.642 1.00 0.00 H ATOM 3672 H GLU A 448 26.374 54.283 22.470 1.00 0.00 H ATOM 3673 N HIS A 449 26.004 57.455 21.127 1.00 52.81 N ATOM 3674 CA HIS A 449 25.488 58.767 20.736 1.00 52.56 C ATOM 3675 C HIS A 449 25.753 59.867 21.767 1.00 52.58 C ATOM 3676 O HIS A 449 26.119 60.983 21.403 1.00 52.67 O ATOM 3677 CB HIS A 449 23.990 58.679 20.424 1.00 52.20 C ATOM 3678 CG HIS A 449 23.444 59.904 19.764 1.00 51.54 C ATOM 3679 ND1 HIS A 449 23.509 60.106 18.404 1.00 50.28 N ATOM 3680 CD2 HIS A 449 22.841 61.001 20.279 1.00 50.79 C ATOM 3681 CE1 HIS A 449 22.961 61.268 18.106 1.00 49.86 C ATOM 3682 NE2 HIS A 449 22.549 61.833 19.226 1.00 50.30 N ATOM 3683 HA HIS A 449 26.037 59.054 19.839 1.00 0.00 H ATOM 3684 HB2 HIS A 449 23.825 57.828 19.763 1.00 0.00 H ATOM 3685 HB3 HIS A 449 23.452 58.522 21.359 1.00 0.00 H ATOM 3686 HD2 HIS A 449 22.627 61.189 21.331 1.00 0.00 H ATOM 3687 HE1 HIS A 449 22.865 61.690 17.106 1.00 0.00 H ATOM 3688 H HIS A 449 25.332 56.671 21.251 1.00 0.00 H ATOM 3689 N VAL A 450 25.558 59.545 23.043 1.00 52.90 N ATOM 3690 CA VAL A 450 25.794 60.484 24.149 1.00 53.33 C ATOM 3691 C VAL A 450 27.255 60.928 24.177 1.00 53.64 C ATOM 3692 O VAL A 450 27.543 62.125 24.245 1.00 53.77 O ATOM 3693 CB VAL A 450 25.372 59.867 25.522 1.00 53.31 C ATOM 3694 CG1 VAL A 450 25.852 60.717 26.698 1.00 53.17 C ATOM 3695 CG2 VAL A 450 23.866 59.688 25.582 1.00 53.26 C ATOM 3696 HA VAL A 450 25.172 61.363 23.978 1.00 0.00 H ATOM 3697 HB VAL A 450 25.850 58.891 25.603 1.00 0.00 H ATOM 3698 HG11 VAL A 450 26.939 60.788 26.674 1.00 0.00 H ATOM 3699 HG12 VAL A 450 25.420 61.715 26.623 1.00 0.00 H ATOM 3700 HG13 VAL A 450 25.538 60.253 27.633 1.00 0.00 H ATOM 3701 HG21 VAL A 450 23.381 60.657 25.464 1.00 0.00 H ATOM 3702 HG22 VAL A 450 23.548 59.021 24.780 1.00 0.00 H ATOM 3703 HG23 VAL A 450 23.591 59.257 26.545 1.00 0.00 H ATOM 3704 H VAL A 450 25.224 58.586 23.268 1.00 0.00 H ATOM 3705 N GLN A 451 28.172 59.961 24.101 1.00 54.15 N ATOM 3706 CA GLN A 451 29.605 60.258 23.993 1.00 54.68 C ATOM 3707 C GLN A 451 29.902 61.211 22.840 1.00 54.65 C ATOM 3708 O GLN A 451 30.728 62.114 22.975 1.00 54.73 O ATOM 3709 CB GLN A 451 30.418 58.979 23.816 1.00 54.68 C ATOM 3710 CG GLN A 451 30.552 58.151 25.076 1.00 56.54 C ATOM 3711 CD GLN A 451 31.479 56.959 24.896 1.00 59.23 C ATOM 3712 OE1 GLN A 451 32.002 56.716 23.803 1.00 60.67 O ATOM 3713 NE2 GLN A 451 31.688 56.208 25.973 1.00 59.73 N ATOM 3714 HA GLN A 451 29.896 60.743 24.925 1.00 0.00 H ATOM 3715 HB2 GLN A 451 29.933 58.368 23.055 1.00 0.00 H ATOM 3716 HB3 GLN A 451 31.418 59.253 23.478 1.00 0.00 H ATOM 3717 HG2 GLN A 451 30.947 58.784 25.870 1.00 0.00 H ATOM 3718 HG3 GLN A 451 29.565 57.786 25.361 1.00 0.00 H ATOM 3719 HE22 GLN A 451 31.227 56.450 26.873 1.00 0.00 H ATOM 3720 HE21 GLN A 451 32.313 55.379 25.915 1.00 0.00 H ATOM 3721 H GLN A 451 27.862 58.968 24.119 1.00 0.00 H ATOM 3722 N LEU A 452 29.222 61.011 21.713 1.00 54.68 N ATOM 3723 CA LEU A 452 29.413 61.862 20.541 1.00 54.86 C ATOM 3724 C LEU A 452 28.868 63.281 20.754 1.00 54.59 C ATOM 3725 O LEU A 452 29.471 64.256 20.296 1.00 54.38 O ATOM 3726 CB LEU A 452 28.802 61.205 19.296 1.00 55.09 C ATOM 3727 CG LEU A 452 29.103 61.694 17.869 1.00 56.30 C ATOM 3728 CD1 LEU A 452 30.389 62.525 17.712 1.00 57.23 C ATOM 3729 CD2 LEU A 452 29.144 60.486 16.943 1.00 57.84 C ATOM 3730 HA LEU A 452 30.486 61.967 20.383 1.00 0.00 H ATOM 3731 HB2 LEU A 452 29.104 60.158 19.327 1.00 0.00 H ATOM 3732 HB3 LEU A 452 27.721 61.273 19.418 1.00 0.00 H ATOM 3733 HG LEU A 452 28.300 62.382 17.607 1.00 0.00 H ATOM 3734 HD21 LEU A 452 29.925 59.802 17.275 1.00 0.00 H ATOM 3735 HD22 LEU A 452 28.180 59.978 16.967 1.00 0.00 H ATOM 3736 HD23 LEU A 452 29.357 60.816 15.926 1.00 0.00 H ATOM 3737 HD11 LEU A 452 30.323 63.416 18.336 1.00 0.00 H ATOM 3738 HD12 LEU A 452 31.246 61.927 18.021 1.00 0.00 H ATOM 3739 HD13 LEU A 452 30.505 62.818 16.669 1.00 0.00 H ATOM 3740 H LEU A 452 28.538 60.229 21.666 1.00 0.00 H ATOM 3741 N LEU A 453 27.744 63.399 21.459 1.00 54.41 N ATOM 3742 CA LEU A 453 27.180 64.720 21.756 1.00 54.26 C ATOM 3743 C LEU A 453 28.078 65.538 22.694 1.00 54.18 C ATOM 3744 O LEU A 453 28.184 66.759 22.548 1.00 53.92 O ATOM 3745 CB LEU A 453 25.758 64.608 22.319 1.00 54.35 C ATOM 3746 CG LEU A 453 24.621 64.119 21.412 1.00 54.39 C ATOM 3747 CD1 LEU A 453 23.366 63.933 22.239 1.00 54.57 C ATOM 3748 CD2 LEU A 453 24.344 65.075 20.254 1.00 53.63 C ATOM 3749 HA LEU A 453 27.128 65.258 20.809 1.00 0.00 H ATOM 3750 HB2 LEU A 453 25.805 63.923 23.165 1.00 0.00 H ATOM 3751 HB3 LEU A 453 25.478 65.601 22.672 1.00 0.00 H ATOM 3752 HG LEU A 453 24.932 63.170 20.975 1.00 0.00 H ATOM 3753 HD21 LEU A 453 24.062 66.051 20.650 1.00 0.00 H ATOM 3754 HD22 LEU A 453 25.242 65.174 19.644 1.00 0.00 H ATOM 3755 HD23 LEU A 453 23.531 64.680 19.645 1.00 0.00 H ATOM 3756 HD11 LEU A 453 23.553 63.196 23.020 1.00 0.00 H ATOM 3757 HD12 LEU A 453 23.088 64.884 22.694 1.00 0.00 H ATOM 3758 HD13 LEU A 453 22.557 63.586 21.596 1.00 0.00 H ATOM 3759 H LEU A 453 27.261 62.545 21.803 1.00 0.00 H ATOM 3760 N GLN A 454 28.732 64.861 23.640 1.00 54.33 N ATOM 3761 CA GLN A 454 29.684 65.522 24.545 1.00 54.50 C ATOM 3762 C GLN A 454 30.858 66.146 23.795 1.00 54.58 C ATOM 3763 O GLN A 454 31.299 67.247 24.140 1.00 54.50 O ATOM 3764 CB GLN A 454 30.196 64.572 25.638 1.00 54.55 C ATOM 3765 CG GLN A 454 29.329 64.539 26.907 1.00 54.55 C ATOM 3766 CD GLN A 454 29.124 65.914 27.555 1.00 55.00 C ATOM 3767 OE1 GLN A 454 27.997 66.287 27.888 1.00 55.01 O ATOM 3768 NE2 GLN A 454 30.210 66.666 27.733 1.00 54.64 N ATOM 3769 HA GLN A 454 29.129 66.326 25.027 1.00 0.00 H ATOM 3770 HB2 GLN A 454 30.234 63.564 25.224 1.00 0.00 H ATOM 3771 HB3 GLN A 454 31.201 64.886 25.919 1.00 0.00 H ATOM 3772 HG2 GLN A 454 28.352 64.134 26.645 1.00 0.00 H ATOM 3773 HG3 GLN A 454 29.809 63.885 27.634 1.00 0.00 H ATOM 3774 HE22 GLN A 454 31.142 66.312 27.437 1.00 0.00 H ATOM 3775 HE21 GLN A 454 30.125 67.607 28.168 1.00 0.00 H ATOM 3776 H GLN A 454 28.564 63.840 23.740 1.00 0.00 H ATOM 3777 N VAL A 455 31.349 65.450 22.770 1.00 54.73 N ATOM 3778 CA VAL A 455 32.389 66.001 21.896 1.00 55.03 C ATOM 3779 C VAL A 455 31.921 67.318 21.274 1.00 55.37 C ATOM 3780 O VAL A 455 32.642 68.320 21.327 1.00 55.53 O ATOM 3781 CB VAL A 455 32.832 65.002 20.784 1.00 55.08 C ATOM 3782 CG1 VAL A 455 33.870 65.638 19.851 1.00 55.02 C ATOM 3783 CG2 VAL A 455 33.391 63.715 21.393 1.00 54.94 C ATOM 3784 HA VAL A 455 33.262 66.187 22.521 1.00 0.00 H ATOM 3785 HB VAL A 455 31.948 64.752 20.197 1.00 0.00 H ATOM 3786 HG11 VAL A 455 33.439 66.519 19.377 1.00 0.00 H ATOM 3787 HG12 VAL A 455 34.747 65.928 20.429 1.00 0.00 H ATOM 3788 HG13 VAL A 455 34.159 64.917 19.086 1.00 0.00 H ATOM 3789 HG21 VAL A 455 34.255 63.953 22.013 1.00 0.00 H ATOM 3790 HG22 VAL A 455 32.623 63.240 22.004 1.00 0.00 H ATOM 3791 HG23 VAL A 455 33.692 63.037 20.594 1.00 0.00 H ATOM 3792 H VAL A 455 30.986 64.493 22.586 1.00 0.00 H ATOM 3793 N ILE A 456 30.707 67.316 20.720 1.00 55.58 N ATOM 3794 CA ILE A 456 30.167 68.481 20.000 1.00 55.85 C ATOM 3795 C ILE A 456 29.920 69.684 20.921 1.00 56.06 C ATOM 3796 O ILE A 456 30.157 70.832 20.534 1.00 56.27 O ATOM 3797 CB ILE A 456 28.877 68.118 19.205 1.00 55.95 C ATOM 3798 CG1 ILE A 456 29.161 66.973 18.222 1.00 55.48 C ATOM 3799 CG2 ILE A 456 28.332 69.339 18.466 1.00 55.75 C ATOM 3800 CD1 ILE A 456 27.923 66.318 17.633 1.00 54.74 C ATOM 3801 HA ILE A 456 30.935 68.778 19.286 1.00 0.00 H ATOM 3802 HB ILE A 456 28.119 67.787 19.914 1.00 0.00 H ATOM 3803 HG12 ILE A 456 29.758 67.370 17.401 1.00 0.00 H ATOM 3804 HG13 ILE A 456 29.732 66.208 18.748 1.00 0.00 H ATOM 3805 HD11 ILE A 456 27.317 65.900 18.437 1.00 0.00 H ATOM 3806 HD12 ILE A 456 27.343 67.064 17.089 1.00 0.00 H ATOM 3807 HD13 ILE A 456 28.224 65.522 16.952 1.00 0.00 H ATOM 3808 HG21 ILE A 456 28.093 70.121 19.186 1.00 0.00 H ATOM 3809 HG22 ILE A 456 29.084 69.705 17.767 1.00 0.00 H ATOM 3810 HG23 ILE A 456 27.432 69.059 17.919 1.00 0.00 H ATOM 3811 H ILE A 456 30.121 66.460 20.800 1.00 0.00 H ATOM 3812 N LYS A 457 29.453 69.408 22.137 1.00 56.34 N ATOM 3813 CA LYS A 457 29.258 70.428 23.166 1.00 56.57 C ATOM 3814 C LYS A 457 30.554 71.198 23.443 1.00 56.69 C ATOM 3815 O LYS A 457 30.541 72.424 23.583 1.00 56.52 O ATOM 3816 CB LYS A 457 28.737 69.774 24.452 1.00 56.73 C ATOM 3817 CG LYS A 457 28.498 70.726 25.615 1.00 57.12 C ATOM 3818 CD LYS A 457 28.009 69.973 26.853 1.00 58.26 C ATOM 3819 CE LYS A 457 27.741 70.920 28.018 1.00 58.75 C ATOM 3820 NZ LYS A 457 26.997 70.243 29.124 1.00 59.49 N ATOM 3821 HA LYS A 457 28.521 71.144 22.803 1.00 0.00 H ATOM 3822 HB2 LYS A 457 27.793 69.281 24.221 1.00 0.00 H ATOM 3823 HB3 LYS A 457 29.466 69.029 24.771 1.00 0.00 H ATOM 3824 HG2 LYS A 457 29.431 71.237 25.854 1.00 0.00 H ATOM 3825 HG3 LYS A 457 27.747 71.461 25.325 1.00 0.00 H ATOM 3826 HD2 LYS A 457 27.087 69.446 26.606 1.00 0.00 H ATOM 3827 HD3 LYS A 457 28.769 69.251 27.151 1.00 0.00 H ATOM 3828 HE2 LYS A 457 27.150 71.763 27.659 1.00 0.00 H ATOM 3829 HE3 LYS A 457 28.693 71.284 28.404 1.00 0.00 H ATOM 3830 HZ1 LYS A 457 26.083 69.899 28.766 1.00 0.00 H ATOM 3831 HZ2 LYS A 457 27.557 69.441 29.477 1.00 0.00 H ATOM 3832 HZ3 LYS A 457 26.835 70.920 29.896 1.00 0.00 H ATOM 3833 H LYS A 457 29.216 68.421 22.365 1.00 0.00 H ATOM 3834 N LYS A 458 31.669 70.469 23.500 1.00 56.87 N ATOM 3835 CA LYS A 458 32.971 71.061 23.815 1.00 56.92 C ATOM 3836 C LYS A 458 33.607 71.797 22.632 1.00 56.99 C ATOM 3837 O LYS A 458 34.336 72.768 22.830 1.00 57.15 O ATOM 3838 CB LYS A 458 33.924 70.002 24.372 1.00 57.12 C ATOM 3839 CG LYS A 458 33.485 69.406 25.715 1.00 57.58 C ATOM 3840 CD LYS A 458 34.636 68.681 26.381 1.00 58.84 C ATOM 3841 CE LYS A 458 34.304 68.272 27.805 1.00 59.75 C ATOM 3842 NZ LYS A 458 33.807 66.873 27.847 1.00 60.37 N ATOM 3843 HA LYS A 458 32.788 71.816 24.579 1.00 0.00 H ATOM 3844 HB2 LYS A 458 33.998 69.192 23.646 1.00 0.00 H ATOM 3845 HB3 LYS A 458 34.904 70.460 24.505 1.00 0.00 H ATOM 3846 HG2 LYS A 458 33.142 70.209 26.368 1.00 0.00 H ATOM 3847 HG3 LYS A 458 32.669 68.703 25.545 1.00 0.00 H ATOM 3848 HD2 LYS A 458 34.870 67.787 25.803 1.00 0.00 H ATOM 3849 HD3 LYS A 458 35.505 69.339 26.397 1.00 0.00 H ATOM 3850 HE2 LYS A 458 33.535 68.937 28.199 1.00 0.00 H ATOM 3851 HE3 LYS A 458 35.201 68.352 28.419 1.00 0.00 H ATOM 3852 HZ1 LYS A 458 32.949 66.794 27.265 1.00 0.00 H ATOM 3853 HZ2 LYS A 458 34.539 66.235 27.475 1.00 0.00 H ATOM 3854 HZ3 LYS A 458 33.586 66.614 28.830 1.00 0.00 H ATOM 3855 H LYS A 458 31.612 69.447 23.315 1.00 0.00 H ATOM 3856 N THR A 459 33.323 71.342 21.413 1.00 56.96 N ATOM 3857 CA THR A 459 33.848 71.981 20.203 1.00 57.03 C ATOM 3858 C THR A 459 33.033 73.222 19.815 1.00 57.04 C ATOM 3859 O THR A 459 33.597 74.270 19.511 1.00 57.10 O ATOM 3860 CB THR A 459 33.890 70.998 18.996 1.00 57.06 C ATOM 3861 OG1 THR A 459 34.495 69.761 19.390 1.00 57.35 O ATOM 3862 CG2 THR A 459 34.686 71.594 17.842 1.00 57.21 C ATOM 3863 HA THR A 459 34.867 72.286 20.442 1.00 0.00 H ATOM 3864 HB THR A 459 32.865 70.821 18.669 1.00 0.00 H ATOM 3865 HG1 THR A 459 33.967 69.355 20.122 1.00 0.00 H ATOM 3866 HG23 THR A 459 34.231 72.536 17.537 1.00 0.00 H ATOM 3867 HG21 THR A 459 35.712 71.772 18.164 1.00 0.00 H ATOM 3868 HG22 THR A 459 34.683 70.899 17.003 1.00 0.00 H ATOM 3869 H THR A 459 32.710 70.508 21.317 1.00 0.00 H ATOM 3870 N GLU A 460 31.708 73.090 19.819 1.00 57.06 N ATOM 3871 CA GLU A 460 30.824 74.177 19.415 1.00 57.16 C ATOM 3872 C GLU A 460 30.190 74.812 20.647 1.00 56.93 C ATOM 3873 O GLU A 460 29.044 74.513 20.991 1.00 56.80 O ATOM 3874 CB GLU A 460 29.729 73.677 18.455 1.00 57.24 C ATOM 3875 CG GLU A 460 30.172 72.665 17.393 1.00 58.17 C ATOM 3876 CD GLU A 460 31.134 73.245 16.366 1.00 59.54 C ATOM 3877 OE1 GLU A 460 31.003 74.434 15.995 1.00 60.41 O ATOM 3878 OE2 GLU A 460 32.031 72.498 15.925 1.00 61.01 O ATOM 3879 HA GLU A 460 31.419 74.923 18.888 1.00 0.00 H ATOM 3880 HB2 GLU A 460 28.948 73.210 19.055 1.00 0.00 H ATOM 3881 HB3 GLU A 460 29.318 74.544 17.938 1.00 0.00 H ATOM 3882 HG2 GLU A 460 30.663 71.831 17.894 1.00 0.00 H ATOM 3883 HG3 GLU A 460 29.287 72.303 16.871 1.00 0.00 H ATOM 3884 H GLU A 460 31.292 72.185 20.119 1.00 0.00 H ATOM 3885 N THR A 461 30.933 75.691 21.313 1.00 56.79 N ATOM 3886 CA THR A 461 30.413 76.348 22.520 1.00 56.60 C ATOM 3887 C THR A 461 29.409 77.461 22.204 1.00 56.40 C ATOM 3888 O THR A 461 28.814 78.042 23.114 1.00 56.35 O ATOM 3889 CB THR A 461 31.537 76.866 23.438 1.00 56.59 C ATOM 3890 OG1 THR A 461 32.586 77.427 22.641 1.00 56.18 O ATOM 3891 CG2 THR A 461 32.086 75.728 24.298 1.00 56.42 C ATOM 3892 HA THR A 461 29.874 75.573 23.064 1.00 0.00 H ATOM 3893 HB THR A 461 31.133 77.635 24.096 1.00 0.00 H ATOM 3894 HG1 THR A 461 33.307 77.759 23.233 1.00 0.00 H ATOM 3895 HG23 THR A 461 31.280 75.308 24.900 1.00 0.00 H ATOM 3896 HG21 THR A 461 32.500 74.954 23.652 1.00 0.00 H ATOM 3897 HG22 THR A 461 32.868 76.113 24.953 1.00 0.00 H ATOM 3898 H THR A 461 31.891 75.916 20.976 1.00 0.00 H ATOM 3899 N ASP A 462 29.218 77.739 20.916 1.00 56.21 N ATOM 3900 CA ASP A 462 28.184 78.668 20.461 1.00 56.21 C ATOM 3901 C ASP A 462 26.870 77.944 20.153 1.00 56.06 C ATOM 3902 O ASP A 462 25.914 78.543 19.655 1.00 55.82 O ATOM 3903 CB ASP A 462 28.665 79.451 19.231 1.00 56.46 C ATOM 3904 CG ASP A 462 28.849 78.569 18.004 1.00 57.19 C ATOM 3905 OD1 ASP A 462 29.528 77.525 18.100 1.00 57.77 O ATOM 3906 OD2 ASP A 462 28.320 78.935 16.934 1.00 58.61 O ATOM 3907 HA ASP A 462 27.993 79.370 21.273 1.00 0.00 H ATOM 3908 HB2 ASP A 462 27.930 80.222 18.999 1.00 0.00 H ATOM 3909 HB3 ASP A 462 29.619 79.921 19.469 1.00 0.00 H ATOM 3910 H ASP A 462 29.826 77.279 20.208 1.00 0.00 H ATOM 3911 N MET A 463 26.824 76.653 20.457 1.00 55.96 N ATOM 3912 CA MET A 463 25.683 75.847 20.072 1.00 56.10 C ATOM 3913 C MET A 463 24.993 75.200 21.261 1.00 55.77 C ATOM 3914 O MET A 463 25.580 75.041 22.333 1.00 55.41 O ATOM 3915 CB MET A 463 26.093 74.801 19.045 1.00 56.47 C ATOM 3916 CG MET A 463 24.990 74.457 18.072 1.00 57.81 C ATOM 3917 SD MET A 463 25.443 73.065 17.035 1.00 60.81 S ATOM 3918 CE MET A 463 25.709 71.784 18.259 1.00 60.02 C ATOM 3919 HA MET A 463 24.954 76.520 19.620 1.00 0.00 H ATOM 3920 HB2 MET A 463 26.945 75.183 18.482 1.00 0.00 H ATOM 3921 HB3 MET A 463 26.385 73.893 19.573 1.00 0.00 H ATOM 3922 HG2 MET A 463 24.793 75.322 17.439 1.00 0.00 H ATOM 3923 HG3 MET A 463 24.089 74.205 18.631 1.00 0.00 H ATOM 3924 HE1 MET A 463 26.503 72.093 18.940 1.00 0.00 H ATOM 3925 HE2 MET A 463 24.789 71.623 18.821 1.00 0.00 H ATOM 3926 HE3 MET A 463 25.997 70.859 17.759 1.00 0.00 H ATOM 3927 H MET A 463 27.613 76.216 20.975 1.00 0.00 H ATOM 3928 N SER A 464 23.745 74.803 21.033 1.00 55.51 N ATOM 3929 CA SER A 464 22.806 74.516 22.100 1.00 55.20 C ATOM 3930 C SER A 464 21.887 73.340 21.786 1.00 54.58 C ATOM 3931 O SER A 464 21.197 73.336 20.770 1.00 54.43 O ATOM 3932 CB SER A 464 21.957 75.770 22.359 1.00 55.58 C ATOM 3933 OG SER A 464 21.671 76.465 21.147 1.00 55.47 O ATOM 3934 HA SER A 464 23.385 74.239 22.981 1.00 0.00 H ATOM 3935 HB2 SER A 464 22.502 76.435 23.029 1.00 0.00 H ATOM 3936 HB3 SER A 464 21.019 75.473 22.827 1.00 0.00 H ATOM 3937 HG SER A 464 21.171 75.868 20.535 1.00 0.00 H ATOM 3938 H SER A 464 23.429 74.694 20.048 1.00 0.00 H ATOM 3939 N LEU A 465 21.875 72.348 22.668 1.00 53.95 N ATOM 3940 CA LEU A 465 20.881 71.288 22.592 1.00 53.10 C ATOM 3941 C LEU A 465 19.519 71.870 22.997 1.00 52.51 C ATOM 3942 O LEU A 465 19.455 72.784 23.824 1.00 52.19 O ATOM 3943 CB LEU A 465 21.277 70.129 23.504 1.00 53.19 C ATOM 3944 CG LEU A 465 21.093 68.688 23.012 1.00 53.87 C ATOM 3945 CD1 LEU A 465 22.096 68.325 21.904 1.00 53.90 C ATOM 3946 CD2 LEU A 465 21.242 67.731 24.176 1.00 54.18 C ATOM 3947 HA LEU A 465 20.819 70.900 21.575 1.00 0.00 H ATOM 3948 HB2 LEU A 465 22.335 70.253 23.735 1.00 0.00 H ATOM 3949 HB3 LEU A 465 20.692 70.230 24.418 1.00 0.00 H ATOM 3950 HG LEU A 465 20.092 68.606 22.588 1.00 0.00 H ATOM 3951 HD21 LEU A 465 22.235 67.842 24.611 1.00 0.00 H ATOM 3952 HD22 LEU A 465 20.487 67.957 24.929 1.00 0.00 H ATOM 3953 HD23 LEU A 465 21.111 66.708 23.823 1.00 0.00 H ATOM 3954 HD11 LEU A 465 21.957 68.995 21.056 1.00 0.00 H ATOM 3955 HD12 LEU A 465 23.111 68.428 22.287 1.00 0.00 H ATOM 3956 HD13 LEU A 465 21.928 67.296 21.587 1.00 0.00 H ATOM 3957 H LEU A 465 22.587 72.328 23.425 1.00 0.00 H ATOM 3958 N HIS A 466 18.444 71.362 22.392 1.00 51.64 N ATOM 3959 CA HIS A 466 17.075 71.768 22.731 1.00 50.86 C ATOM 3960 C HIS A 466 16.815 71.413 24.192 1.00 50.32 C ATOM 3961 O HIS A 466 17.218 70.334 24.633 1.00 50.24 O ATOM 3962 CB HIS A 466 16.075 71.043 21.821 1.00 50.75 C ATOM 3963 CG HIS A 466 14.677 71.586 21.870 1.00 50.34 C ATOM 3964 ND1 HIS A 466 13.833 71.387 22.944 1.00 50.58 N ATOM 3965 CD2 HIS A 466 13.956 72.273 20.950 1.00 49.52 C ATOM 3966 CE1 HIS A 466 12.665 71.957 22.696 1.00 49.78 C ATOM 3967 NE2 HIS A 466 12.711 72.495 21.491 1.00 49.59 N ATOM 3968 HA HIS A 466 16.954 72.841 22.585 1.00 0.00 H ATOM 3969 HB2 HIS A 466 16.433 71.118 20.794 1.00 0.00 H ATOM 3970 HB3 HIS A 466 16.043 69.995 22.118 1.00 0.00 H ATOM 3971 HD2 HIS A 466 14.299 72.590 19.965 1.00 0.00 H ATOM 3972 HE1 HIS A 466 11.810 71.979 23.372 1.00 0.00 H ATOM 3973 H HIS A 466 18.582 70.648 21.649 1.00 0.00 H ATOM 3974 N PRO A 467 16.165 72.324 24.952 1.00 49.87 N ATOM 3975 CA PRO A 467 15.862 72.120 26.374 1.00 49.55 C ATOM 3976 C PRO A 467 15.264 70.755 26.678 1.00 49.06 C ATOM 3977 O PRO A 467 15.720 70.079 27.608 1.00 49.00 O ATOM 3978 CB PRO A 467 14.859 73.235 26.677 1.00 49.33 C ATOM 3979 CG PRO A 467 15.312 74.342 25.815 1.00 49.81 C ATOM 3980 CD PRO A 467 15.785 73.684 24.524 1.00 50.06 C ATOM 3981 HA PRO A 467 16.764 72.152 26.985 1.00 0.00 H ATOM 3982 HD3 PRO A 467 14.983 73.651 23.786 1.00 0.00 H ATOM 3983 HD2 PRO A 467 16.640 74.215 24.106 1.00 0.00 H ATOM 3984 HG3 PRO A 467 16.130 74.884 26.289 1.00 0.00 H ATOM 3985 HG2 PRO A 467 14.491 75.030 25.614 1.00 0.00 H ATOM 3986 HB2 PRO A 467 13.845 72.929 26.420 1.00 0.00 H ATOM 3987 HB3 PRO A 467 14.896 73.519 27.729 1.00 0.00 H ATOM 3988 N LEU A 468 14.275 70.346 25.886 1.00 48.77 N ATOM 3989 CA LEU A 468 13.668 69.025 26.044 1.00 48.62 C ATOM 3990 C LEU A 468 14.715 67.909 25.972 1.00 48.67 C ATOM 3991 O LEU A 468 14.679 66.984 26.777 1.00 48.74 O ATOM 3992 CB LEU A 468 12.534 68.805 25.039 1.00 48.34 C ATOM 3993 CG LEU A 468 11.666 67.544 25.162 1.00 48.23 C ATOM 3994 CD1 LEU A 468 11.116 67.350 26.584 1.00 47.52 C ATOM 3995 CD2 LEU A 468 10.526 67.573 24.131 1.00 46.95 C ATOM 3996 HA LEU A 468 13.228 68.987 27.041 1.00 0.00 H ATOM 3997 HB2 LEU A 468 11.866 69.662 25.118 1.00 0.00 H ATOM 3998 HB3 LEU A 468 12.985 68.788 24.047 1.00 0.00 H ATOM 3999 HG LEU A 468 12.307 66.688 24.953 1.00 0.00 H ATOM 4000 HD21 LEU A 468 9.903 68.451 24.304 1.00 0.00 H ATOM 4001 HD22 LEU A 468 10.947 67.617 23.127 1.00 0.00 H ATOM 4002 HD23 LEU A 468 9.922 66.671 24.234 1.00 0.00 H ATOM 4003 HD11 LEU A 468 11.946 67.258 27.284 1.00 0.00 H ATOM 4004 HD12 LEU A 468 10.503 68.210 26.856 1.00 0.00 H ATOM 4005 HD13 LEU A 468 10.509 66.445 26.617 1.00 0.00 H ATOM 4006 H LEU A 468 13.927 70.980 25.139 1.00 0.00 H ATOM 4007 N LEU A 469 15.662 68.022 25.041 1.00 48.85 N ATOM 4008 CA LEU A 469 16.723 67.020 24.897 1.00 49.26 C ATOM 4009 C LEU A 469 17.777 67.121 25.995 1.00 49.67 C ATOM 4010 O LEU A 469 18.299 66.102 26.442 1.00 49.58 O ATOM 4011 CB LEU A 469 17.375 67.078 23.507 1.00 48.96 C ATOM 4012 CG LEU A 469 16.484 66.835 22.278 1.00 48.98 C ATOM 4013 CD1 LEU A 469 17.308 66.919 20.993 1.00 48.08 C ATOM 4014 CD2 LEU A 469 15.715 65.506 22.353 1.00 47.12 C ATOM 4015 HA LEU A 469 16.240 66.049 25.004 1.00 0.00 H ATOM 4016 HB2 LEU A 469 17.815 68.069 23.397 1.00 0.00 H ATOM 4017 HB3 LEU A 469 18.165 66.327 23.488 1.00 0.00 H ATOM 4018 HG LEU A 469 15.734 67.626 22.269 1.00 0.00 H ATOM 4019 HD21 LEU A 469 16.424 64.681 22.419 1.00 0.00 H ATOM 4020 HD22 LEU A 469 15.074 65.508 23.235 1.00 0.00 H ATOM 4021 HD23 LEU A 469 15.104 65.390 21.458 1.00 0.00 H ATOM 4022 HD11 LEU A 469 17.757 67.909 20.915 1.00 0.00 H ATOM 4023 HD12 LEU A 469 18.093 66.163 21.016 1.00 0.00 H ATOM 4024 HD13 LEU A 469 16.659 66.744 20.135 1.00 0.00 H ATOM 4025 H LEU A 469 15.648 68.841 24.401 1.00 0.00 H ATOM 4026 N GLN A 470 18.085 68.345 26.423 1.00 50.25 N ATOM 4027 CA GLN A 470 18.970 68.564 27.568 1.00 50.97 C ATOM 4028 C GLN A 470 18.425 67.863 28.809 1.00 51.26 C ATOM 4029 O GLN A 470 19.157 67.137 29.496 1.00 50.94 O ATOM 4030 CB GLN A 470 19.144 70.055 27.849 1.00 51.06 C ATOM 4031 CG GLN A 470 20.303 70.689 27.102 1.00 52.66 C ATOM 4032 CD GLN A 470 20.313 72.203 27.208 1.00 54.32 C ATOM 4033 OE1 GLN A 470 19.280 72.832 27.426 1.00 56.29 O ATOM 4034 NE2 GLN A 470 21.480 72.795 27.037 1.00 55.18 N ATOM 4035 HA GLN A 470 19.944 68.142 27.321 1.00 0.00 H ATOM 4036 HB2 GLN A 470 18.227 70.569 27.560 1.00 0.00 H ATOM 4037 HB3 GLN A 470 19.311 70.186 28.918 1.00 0.00 H ATOM 4038 HG2 GLN A 470 21.236 70.304 27.515 1.00 0.00 H ATOM 4039 HG3 GLN A 470 20.232 70.414 26.050 1.00 0.00 H ATOM 4040 HE22 GLN A 470 22.330 72.225 26.855 1.00 0.00 H ATOM 4041 HE21 GLN A 470 21.549 73.832 27.085 1.00 0.00 H ATOM 4042 H GLN A 470 17.685 69.168 25.929 1.00 0.00 H ATOM 4043 N GLU A 471 17.135 68.072 29.080 1.00 51.45 N ATOM 4044 CA GLU A 471 16.482 67.452 30.229 1.00 51.83 C ATOM 4045 C GLU A 471 16.559 65.923 30.175 1.00 51.63 C ATOM 4046 O GLU A 471 16.879 65.281 31.182 1.00 51.36 O ATOM 4047 CB GLU A 471 15.029 67.923 30.345 1.00 52.13 C ATOM 4048 CG GLU A 471 14.394 67.623 31.689 1.00 54.03 C ATOM 4049 CD GLU A 471 15.170 68.231 32.844 1.00 56.03 C ATOM 4050 OE1 GLU A 471 15.409 69.465 32.834 1.00 57.97 O ATOM 4051 OE2 GLU A 471 15.553 67.469 33.753 1.00 56.10 O ATOM 4052 HA GLU A 471 17.021 67.770 31.121 1.00 0.00 H ATOM 4053 HB2 GLU A 471 15.003 69.001 30.185 1.00 0.00 H ATOM 4054 HB3 GLU A 471 14.444 67.428 29.570 1.00 0.00 H ATOM 4055 HG2 GLU A 471 13.381 68.027 31.696 1.00 0.00 H ATOM 4056 HG3 GLU A 471 14.354 66.542 31.824 1.00 0.00 H ATOM 4057 H GLU A 471 16.581 68.693 28.456 1.00 0.00 H ATOM 4058 N ILE A 472 16.287 65.354 28.998 1.00 51.43 N ATOM 4059 CA ILE A 472 16.356 63.904 28.787 1.00 51.52 C ATOM 4060 C ILE A 472 17.758 63.336 29.053 1.00 51.87 C ATOM 4061 O ILE A 472 17.902 62.332 29.752 1.00 51.56 O ATOM 4062 CB ILE A 472 15.841 63.494 27.373 1.00 51.23 C ATOM 4063 CG1 ILE A 472 14.320 63.664 27.294 1.00 51.34 C ATOM 4064 CG2 ILE A 472 16.215 62.051 27.046 1.00 50.66 C ATOM 4065 CD1 ILE A 472 13.783 63.833 25.884 1.00 50.62 C ATOM 4066 HA ILE A 472 15.687 63.459 29.524 1.00 0.00 H ATOM 4067 HB ILE A 472 16.317 64.147 26.641 1.00 0.00 H ATOM 4068 HG12 ILE A 472 13.854 62.782 27.734 1.00 0.00 H ATOM 4069 HG13 ILE A 472 14.044 64.546 27.873 1.00 0.00 H ATOM 4070 HD11 ILE A 472 14.228 64.719 25.431 1.00 0.00 H ATOM 4071 HD12 ILE A 472 14.038 62.954 25.292 1.00 0.00 H ATOM 4072 HD13 ILE A 472 12.700 63.947 25.920 1.00 0.00 H ATOM 4073 HG21 ILE A 472 17.300 61.945 27.066 1.00 0.00 H ATOM 4074 HG22 ILE A 472 15.770 61.385 27.785 1.00 0.00 H ATOM 4075 HG23 ILE A 472 15.842 61.796 26.054 1.00 0.00 H ATOM 4076 H ILE A 472 16.016 65.963 28.200 1.00 0.00 H ATOM 4077 N TYR A 473 18.782 63.971 28.491 1.00 52.59 N ATOM 4078 CA TYR A 473 20.161 63.531 28.714 1.00 53.54 C ATOM 4079 C TYR A 473 20.629 63.905 30.130 1.00 54.00 C ATOM 4080 O TYR A 473 20.409 65.027 30.574 1.00 54.08 O ATOM 4081 CB TYR A 473 21.089 64.106 27.637 1.00 53.40 C ATOM 4082 CG TYR A 473 20.888 63.486 26.259 1.00 53.70 C ATOM 4083 CD1 TYR A 473 21.058 62.113 26.060 1.00 53.50 C ATOM 4084 CD2 TYR A 473 20.538 64.271 25.155 1.00 53.23 C ATOM 4085 CE1 TYR A 473 20.875 61.535 24.808 1.00 53.35 C ATOM 4086 CE2 TYR A 473 20.356 63.703 23.894 1.00 53.19 C ATOM 4087 CZ TYR A 473 20.535 62.331 23.729 1.00 53.49 C ATOM 4088 OH TYR A 473 20.364 61.739 22.498 1.00 53.57 O ATOM 4089 HA TYR A 473 20.199 62.444 28.635 1.00 0.00 H ATOM 4090 HB3 TYR A 473 22.121 63.935 27.944 1.00 0.00 H ATOM 4091 HB2 TYR A 473 20.907 65.178 27.562 1.00 0.00 H ATOM 4092 HD2 TYR A 473 20.405 65.345 25.283 1.00 0.00 H ATOM 4093 HE2 TYR A 473 20.076 64.327 23.045 1.00 0.00 H ATOM 4094 HE1 TYR A 473 20.999 60.460 24.678 1.00 0.00 H ATOM 4095 HD1 TYR A 473 21.340 61.482 26.903 1.00 0.00 H ATOM 4096 HH TYR A 473 19.437 61.891 22.186 1.00 0.00 H ATOM 4097 H TYR A 473 18.601 64.795 27.882 1.00 0.00 H ATOM 4098 N LYS A 474 21.246 62.952 30.831 1.00 54.80 N ATOM 4099 CA LYS A 474 21.676 63.103 32.247 1.00 55.69 C ATOM 4100 C LYS A 474 21.932 61.735 32.886 1.00 55.92 C ATOM 4101 O LYS A 474 21.544 61.486 34.032 1.00 56.52 O ATOM 4102 CB LYS A 474 20.667 63.909 33.095 1.00 55.42 C ATOM 4103 CG LYS A 474 20.901 65.428 33.060 1.00 56.63 C ATOM 4104 CD LYS A 474 19.767 66.240 33.694 1.00 57.36 C ATOM 4105 CE LYS A 474 20.101 66.632 35.132 1.00 58.34 C ATOM 4106 NZ LYS A 474 19.231 67.741 35.641 1.00 58.70 N ATOM 4107 HA LYS A 474 22.606 63.671 32.230 1.00 0.00 H ATOM 4108 HB2 LYS A 474 19.664 63.707 32.720 1.00 0.00 H ATOM 4109 HB3 LYS A 474 20.741 63.573 34.129 1.00 0.00 H ATOM 4110 HG2 LYS A 474 21.824 65.647 33.597 1.00 0.00 H ATOM 4111 HG3 LYS A 474 21.006 65.737 32.020 1.00 0.00 H ATOM 4112 HD2 LYS A 474 19.607 67.145 33.107 1.00 0.00 H ATOM 4113 HD3 LYS A 474 18.857 65.641 33.691 1.00 0.00 H ATOM 4114 HE2 LYS A 474 21.141 66.956 35.174 1.00 0.00 H ATOM 4115 HE3 LYS A 474 19.967 65.760 35.772 1.00 0.00 H ATOM 4116 HZ1 LYS A 474 19.357 68.582 35.042 1.00 0.00 H ATOM 4117 HZ2 LYS A 474 18.236 67.440 35.613 1.00 0.00 H ATOM 4118 HZ3 LYS A 474 19.499 67.968 36.620 1.00 0.00 H ATOM 4119 H LYS A 474 21.438 62.046 30.357 1.00 0.00 H TER 4120 LYS A 474 ATOM 4121 N GLU B 207 9.776 19.151 16.874 1.00 62.34 N ATOM 4122 CA GLU B 207 9.183 18.201 17.858 1.00 62.47 C ATOM 4123 C GLU B 207 9.638 18.509 19.282 1.00 62.10 C ATOM 4124 O GLU B 207 10.811 18.819 19.508 1.00 62.20 O ATOM 4125 CB GLU B 207 9.544 16.752 17.498 1.00 62.58 C ATOM 4126 CG GLU B 207 8.748 16.182 16.332 1.00 63.77 C ATOM 4127 CD GLU B 207 7.271 16.011 16.655 1.00 65.42 C ATOM 4128 OE1 GLU B 207 6.949 15.221 17.576 1.00 66.01 O ATOM 4129 OE2 GLU B 207 6.435 16.662 15.985 1.00 65.37 O ATOM 4130 HA GLU B 207 8.101 18.322 17.813 1.00 0.00 H ATOM 4131 HB2 GLU B 207 10.602 16.717 17.239 1.00 0.00 H ATOM 4132 HB3 GLU B 207 9.364 16.127 18.373 1.00 0.00 H ATOM 4133 HG2 GLU B 207 8.843 16.857 15.482 1.00 0.00 H ATOM 4134 HG3 GLU B 207 9.163 15.209 16.070 1.00 0.00 H ATOM 4135 HN3 GLU B 207 10.813 19.083 16.910 1.00 0.00 H ATOM 4136 HN2 GLU B 207 9.483 20.121 17.110 1.00 0.00 H ATOM 4137 HN1 GLU B 207 9.444 18.910 15.918 1.00 0.00 H ATOM 4138 N SER B 208 8.704 18.415 20.232 1.00 61.49 N ATOM 4139 CA SER B 208 9.005 18.603 21.654 1.00 60.67 C ATOM 4140 C SER B 208 9.988 17.551 22.153 1.00 60.07 C ATOM 4141 O SER B 208 10.858 17.842 22.971 1.00 60.17 O ATOM 4142 CB SER B 208 7.726 18.568 22.491 1.00 60.73 C ATOM 4143 OG SER B 208 7.037 19.805 22.424 1.00 60.85 O ATOM 4144 HA SER B 208 9.467 19.584 21.765 1.00 0.00 H ATOM 4145 HB2 SER B 208 7.985 18.361 23.529 1.00 0.00 H ATOM 4146 HB3 SER B 208 7.076 17.778 22.115 1.00 0.00 H ATOM 4147 HG SER B 208 6.215 19.754 22.974 1.00 0.00 H ATOM 4148 H SER B 208 7.726 18.200 19.952 1.00 0.00 H ATOM 4149 N ALA B 209 9.842 16.332 21.641 1.00 59.43 N ATOM 4150 CA ALA B 209 10.740 15.223 21.957 1.00 58.63 C ATOM 4151 C ALA B 209 12.201 15.545 21.639 1.00 57.90 C ATOM 4152 O ALA B 209 13.088 15.264 22.446 1.00 57.79 O ATOM 4153 CB ALA B 209 10.299 13.956 21.225 1.00 58.63 C ATOM 4154 HA ALA B 209 10.678 15.056 23.032 1.00 0.00 H ATOM 4155 HB1 ALA B 209 9.287 13.693 21.533 1.00 0.00 H ATOM 4156 HB2 ALA B 209 10.318 14.134 20.150 1.00 0.00 H ATOM 4157 HB3 ALA B 209 10.979 13.140 21.472 1.00 0.00 H ATOM 4158 H ALA B 209 9.053 16.160 20.986 1.00 0.00 H ATOM 4159 N ASP B 210 12.437 16.135 20.467 1.00 56.98 N ATOM 4160 CA ASP B 210 13.783 16.506 20.025 1.00 56.11 C ATOM 4161 C ASP B 210 14.342 17.664 20.849 1.00 55.07 C ATOM 4162 O ASP B 210 15.534 17.692 21.152 1.00 54.85 O ATOM 4163 CB ASP B 210 13.795 16.860 18.528 1.00 56.37 C ATOM 4164 CG ASP B 210 13.586 15.641 17.624 1.00 57.24 C ATOM 4165 OD1 ASP B 210 13.417 14.509 18.138 1.00 58.24 O ATOM 4166 OD2 ASP B 210 13.595 15.819 16.387 1.00 57.57 O ATOM 4167 HA ASP B 210 14.426 15.640 20.180 1.00 0.00 H ATOM 4168 HB2 ASP B 210 12.998 17.578 18.334 1.00 0.00 H ATOM 4169 HB3 ASP B 210 14.757 17.312 18.285 1.00 0.00 H ATOM 4170 H ASP B 210 11.632 16.340 19.841 1.00 0.00 H ATOM 4171 N LEU B 211 13.471 18.606 21.206 1.00 53.87 N ATOM 4172 CA LEU B 211 13.841 19.751 22.036 1.00 52.68 C ATOM 4173 C LEU B 211 14.240 19.322 23.441 1.00 52.08 C ATOM 4174 O LEU B 211 15.258 19.776 23.963 1.00 51.84 O ATOM 4175 CB LEU B 211 12.700 20.767 22.101 1.00 52.44 C ATOM 4176 CG LEU B 211 12.324 21.502 20.814 1.00 51.86 C ATOM 4177 CD1 LEU B 211 11.149 22.431 21.074 1.00 51.63 C ATOM 4178 CD2 LEU B 211 13.509 22.273 20.244 1.00 51.25 C ATOM 4179 HA LEU B 211 14.706 20.221 21.569 1.00 0.00 H ATOM 4180 HB2 LEU B 211 11.812 20.237 22.444 1.00 0.00 H ATOM 4181 HB3 LEU B 211 12.978 21.521 22.837 1.00 0.00 H ATOM 4182 HG LEU B 211 12.032 20.761 20.070 1.00 0.00 H ATOM 4183 HD21 LEU B 211 13.848 23.007 20.975 1.00 0.00 H ATOM 4184 HD22 LEU B 211 14.319 21.579 20.021 1.00 0.00 H ATOM 4185 HD23 LEU B 211 13.204 22.782 19.330 1.00 0.00 H ATOM 4186 HD11 LEU B 211 10.295 21.847 21.418 1.00 0.00 H ATOM 4187 HD12 LEU B 211 11.425 23.159 21.837 1.00 0.00 H ATOM 4188 HD13 LEU B 211 10.887 22.951 20.152 1.00 0.00 H ATOM 4189 H LEU B 211 12.487 18.524 20.881 1.00 0.00 H ATOM 4190 N ARG B 212 13.435 18.445 24.043 1.00 51.32 N ATOM 4191 CA ARG B 212 13.733 17.876 25.360 1.00 50.57 C ATOM 4192 C ARG B 212 14.972 16.977 25.333 1.00 49.33 C ATOM 4193 O ARG B 212 15.683 16.861 26.331 1.00 49.63 O ATOM 4194 CB ARG B 212 12.531 17.100 25.898 1.00 51.05 C ATOM 4195 CG ARG B 212 11.363 17.985 26.313 1.00 53.20 C ATOM 4196 CD ARG B 212 10.204 17.154 26.855 1.00 57.61 C ATOM 4197 NE ARG B 212 10.419 16.706 28.237 1.00 60.46 N ATOM 4198 CZ ARG B 212 9.512 16.057 28.967 1.00 61.60 C ATOM 4199 NH1 ARG B 212 8.317 15.772 28.458 1.00 61.90 N ATOM 4200 NH2 ARG B 212 9.799 15.690 30.212 1.00 62.10 N ATOM 4201 HA ARG B 212 13.946 18.711 26.027 1.00 0.00 H ATOM 4202 HB2 ARG B 212 12.186 16.418 25.121 1.00 0.00 H ATOM 4203 HB3 ARG B 212 12.853 16.526 26.767 1.00 0.00 H ATOM 4204 HG2 ARG B 212 11.698 18.676 27.087 1.00 0.00 H ATOM 4205 HG3 ARG B 212 11.020 18.551 25.447 1.00 0.00 H ATOM 4206 HD2 ARG B 212 10.078 16.277 26.220 1.00 0.00 H ATOM 4207 HD3 ARG B 212 9.297 17.758 26.822 1.00 0.00 H ATOM 4208 HE ARG B 212 11.340 16.909 28.675 1.00 0.00 H ATOM 4209 HH12 ARG B 212 7.614 15.265 29.033 1.00 0.00 H ATOM 4210 HH11 ARG B 212 8.085 16.056 27.485 1.00 0.00 H ATOM 4211 HH22 ARG B 212 9.091 15.184 30.781 1.00 0.00 H ATOM 4212 HH21 ARG B 212 10.732 15.909 30.617 1.00 0.00 H ATOM 4213 H ARG B 212 12.562 18.154 23.559 1.00 0.00 H ATOM 4214 N ALA B 213 15.221 16.344 24.189 1.00 47.79 N ATOM 4215 CA ALA B 213 16.426 15.551 23.974 1.00 46.19 C ATOM 4216 C ALA B 213 17.663 16.447 23.955 1.00 45.18 C ATOM 4217 O ALA B 213 18.668 16.144 24.599 1.00 44.40 O ATOM 4218 CB ALA B 213 16.316 14.764 22.675 1.00 46.08 C ATOM 4219 HA ALA B 213 16.528 14.846 24.799 1.00 0.00 H ATOM 4220 HB1 ALA B 213 15.455 14.097 22.727 1.00 0.00 H ATOM 4221 HB2 ALA B 213 16.191 15.456 21.842 1.00 0.00 H ATOM 4222 HB3 ALA B 213 17.223 14.177 22.529 1.00 0.00 H ATOM 4223 H ALA B 213 14.528 16.418 23.417 1.00 0.00 H ATOM 4224 N LEU B 214 17.573 17.550 23.211 1.00 44.18 N ATOM 4225 CA LEU B 214 18.635 18.555 23.156 1.00 43.31 C ATOM 4226 C LEU B 214 18.906 19.158 24.543 1.00 42.88 C ATOM 4227 O LEU B 214 20.059 19.372 24.924 1.00 42.81 O ATOM 4228 CB LEU B 214 18.277 19.650 22.143 1.00 43.11 C ATOM 4229 CG LEU B 214 19.204 20.856 21.953 1.00 42.56 C ATOM 4230 CD1 LEU B 214 20.636 20.434 21.698 1.00 41.97 C ATOM 4231 CD2 LEU B 214 18.701 21.722 20.814 1.00 41.88 C ATOM 4232 HA LEU B 214 19.551 18.064 22.828 1.00 0.00 H ATOM 4233 HB2 LEU B 214 18.191 19.163 21.171 1.00 0.00 H ATOM 4234 HB3 LEU B 214 17.304 20.045 22.437 1.00 0.00 H ATOM 4235 HG LEU B 214 19.193 21.431 22.879 1.00 0.00 H ATOM 4236 HD21 LEU B 214 18.681 21.136 19.895 1.00 0.00 H ATOM 4237 HD22 LEU B 214 17.695 22.074 21.044 1.00 0.00 H ATOM 4238 HD23 LEU B 214 19.366 22.576 20.687 1.00 0.00 H ATOM 4239 HD11 LEU B 214 20.999 19.854 22.547 1.00 0.00 H ATOM 4240 HD12 LEU B 214 20.679 19.825 20.795 1.00 0.00 H ATOM 4241 HD13 LEU B 214 21.257 21.320 21.569 1.00 0.00 H ATOM 4242 H LEU B 214 16.713 17.702 22.647 1.00 0.00 H ATOM 4243 N ALA B 215 17.831 19.407 25.290 1.00 42.20 N ATOM 4244 CA ALA B 215 17.921 19.997 26.621 1.00 41.78 C ATOM 4245 C ALA B 215 18.661 19.096 27.611 1.00 41.31 C ATOM 4246 O ALA B 215 19.544 19.564 28.330 1.00 40.90 O ATOM 4247 CB ALA B 215 16.531 20.344 27.142 1.00 41.63 C ATOM 4248 HA ALA B 215 18.506 20.912 26.530 1.00 0.00 H ATOM 4249 HB1 ALA B 215 16.059 21.058 26.467 1.00 0.00 H ATOM 4250 HB2 ALA B 215 15.927 19.438 27.194 1.00 0.00 H ATOM 4251 HB3 ALA B 215 16.616 20.783 28.136 1.00 0.00 H ATOM 4252 H ALA B 215 16.892 19.172 24.910 1.00 0.00 H ATOM 4253 N LYS B 216 18.298 17.810 27.638 1.00 41.06 N ATOM 4254 CA LYS B 216 18.943 16.833 28.525 1.00 40.77 C ATOM 4255 C LYS B 216 20.403 16.587 28.142 1.00 39.76 C ATOM 4256 O LYS B 216 21.254 16.424 29.008 1.00 40.07 O ATOM 4257 CB LYS B 216 18.145 15.515 28.575 1.00 41.46 C ATOM 4258 CG LYS B 216 18.906 14.340 29.216 1.00 43.01 C ATOM 4259 CD LYS B 216 17.975 13.339 29.872 1.00 46.53 C ATOM 4260 CE LYS B 216 18.709 12.066 30.284 1.00 47.10 C ATOM 4261 NZ LYS B 216 19.977 12.314 31.036 1.00 49.00 N ATOM 4262 HA LYS B 216 18.946 17.261 29.528 1.00 0.00 H ATOM 4263 HB2 LYS B 216 17.235 15.688 29.150 1.00 0.00 H ATOM 4264 HB3 LYS B 216 17.881 15.236 27.555 1.00 0.00 H ATOM 4265 HG2 LYS B 216 19.480 13.830 28.442 1.00 0.00 H ATOM 4266 HG3 LYS B 216 19.586 14.733 29.971 1.00 0.00 H ATOM 4267 HD2 LYS B 216 17.535 13.795 30.759 1.00 0.00 H ATOM 4268 HD3 LYS B 216 17.184 13.078 29.168 1.00 0.00 H ATOM 4269 HE2 LYS B 216 18.949 11.501 29.383 1.00 0.00 H ATOM 4270 HE3 LYS B 216 18.045 11.476 30.916 1.00 0.00 H ATOM 4271 HZ1 LYS B 216 20.628 12.867 30.443 1.00 0.00 H ATOM 4272 HZ2 LYS B 216 19.765 12.843 31.906 1.00 0.00 H ATOM 4273 HZ3 LYS B 216 20.417 11.404 31.281 1.00 0.00 H ATOM 4274 H LYS B 216 17.533 17.490 27.010 1.00 0.00 H ATOM 4275 N HIS B 217 20.689 16.578 26.846 1.00 38.86 N ATOM 4276 CA HIS B 217 22.058 16.456 26.354 1.00 37.87 C ATOM 4277 C HIS B 217 22.929 17.613 26.847 1.00 37.64 C ATOM 4278 O HIS B 217 24.035 17.403 27.343 1.00 37.49 O ATOM 4279 CB HIS B 217 22.072 16.385 24.823 1.00 37.80 C ATOM 4280 CG HIS B 217 23.447 16.376 24.234 1.00 36.74 C ATOM 4281 ND1 HIS B 217 24.026 17.498 23.684 1.00 36.42 N ATOM 4282 CD2 HIS B 217 24.369 15.388 24.138 1.00 36.76 C ATOM 4283 CE1 HIS B 217 25.243 17.200 23.266 1.00 36.65 C ATOM 4284 NE2 HIS B 217 25.476 15.926 23.528 1.00 36.20 N ATOM 4285 HA HIS B 217 22.477 15.531 26.750 1.00 0.00 H ATOM 4286 HB2 HIS B 217 21.560 15.473 24.516 1.00 0.00 H ATOM 4287 HB3 HIS B 217 21.536 17.250 24.433 1.00 0.00 H ATOM 4288 HD2 HIS B 217 24.254 14.360 24.480 1.00 0.00 H ATOM 4289 HE1 HIS B 217 25.938 17.889 22.786 1.00 0.00 H ATOM 4290 H HIS B 217 19.913 16.661 26.159 1.00 0.00 H ATOM 4291 N LEU B 218 22.426 18.836 26.710 1.00 37.28 N ATOM 4292 CA LEU B 218 23.163 20.010 27.171 1.00 37.01 C ATOM 4293 C LEU B 218 23.375 19.998 28.682 1.00 36.83 C ATOM 4294 O LEU B 218 24.449 20.348 29.166 1.00 35.95 O ATOM 4295 CB LEU B 218 22.463 21.297 26.730 1.00 36.93 C ATOM 4296 CG LEU B 218 22.509 21.621 25.237 1.00 37.36 C ATOM 4297 CD1 LEU B 218 21.717 22.888 24.977 1.00 37.89 C ATOM 4298 CD2 LEU B 218 23.953 21.754 24.726 1.00 36.95 C ATOM 4299 HA LEU B 218 24.149 19.974 26.708 1.00 0.00 H ATOM 4300 HB2 LEU B 218 21.415 21.221 27.021 1.00 0.00 H ATOM 4301 HB3 LEU B 218 22.927 22.126 27.264 1.00 0.00 H ATOM 4302 HG LEU B 218 22.059 20.795 24.687 1.00 0.00 H ATOM 4303 HD21 LEU B 218 24.456 22.556 25.267 1.00 0.00 H ATOM 4304 HD22 LEU B 218 24.483 20.816 24.890 1.00 0.00 H ATOM 4305 HD23 LEU B 218 23.940 21.984 23.661 1.00 0.00 H ATOM 4306 HD11 LEU B 218 20.683 22.739 25.288 1.00 0.00 H ATOM 4307 HD12 LEU B 218 22.153 23.710 25.544 1.00 0.00 H ATOM 4308 HD13 LEU B 218 21.748 23.122 23.913 1.00 0.00 H ATOM 4309 H LEU B 218 21.493 18.959 26.268 1.00 0.00 H ATOM 4310 N TYR B 219 22.350 19.580 29.422 1.00 37.71 N ATOM 4311 CA TYR B 219 22.467 19.445 30.875 1.00 38.54 C ATOM 4312 C TYR B 219 23.576 18.461 31.236 1.00 38.67 C ATOM 4313 O TYR B 219 24.461 18.782 32.025 1.00 38.90 O ATOM 4314 CB TYR B 219 21.141 19.013 31.512 1.00 38.46 C ATOM 4315 CG TYR B 219 21.264 18.765 33.005 1.00 40.10 C ATOM 4316 CD1 TYR B 219 21.417 19.824 33.895 1.00 40.50 C ATOM 4317 CD2 TYR B 219 21.250 17.465 33.525 1.00 41.40 C ATOM 4318 CE1 TYR B 219 21.530 19.603 35.271 1.00 41.38 C ATOM 4319 CE2 TYR B 219 21.374 17.234 34.894 1.00 41.51 C ATOM 4320 CZ TYR B 219 21.513 18.311 35.756 1.00 41.71 C ATOM 4321 OH TYR B 219 21.634 18.102 37.103 1.00 42.63 O ATOM 4322 HA TYR B 219 22.723 20.426 31.275 1.00 0.00 H ATOM 4323 HB3 TYR B 219 20.806 18.094 31.032 1.00 0.00 H ATOM 4324 HB2 TYR B 219 20.402 19.798 31.348 1.00 0.00 H ATOM 4325 HD2 TYR B 219 21.140 16.619 32.847 1.00 0.00 H ATOM 4326 HE2 TYR B 219 21.362 16.216 35.283 1.00 0.00 H ATOM 4327 HE1 TYR B 219 21.631 20.445 35.956 1.00 0.00 H ATOM 4328 HD1 TYR B 219 21.449 20.844 33.512 1.00 0.00 H ATOM 4329 HH TYR B 219 21.723 18.973 37.564 1.00 0.00 H ATOM 4330 H TYR B 219 21.449 19.345 28.959 1.00 0.00 H ATOM 4331 N ASP B 220 23.530 17.270 30.640 1.00 39.03 N ATOM 4332 CA ASP B 220 24.557 16.253 30.875 1.00 39.37 C ATOM 4333 C ASP B 220 25.967 16.774 30.583 1.00 39.26 C ATOM 4334 O ASP B 220 26.873 16.556 31.381 1.00 39.01 O ATOM 4335 CB ASP B 220 24.251 14.959 30.107 1.00 39.48 C ATOM 4336 CG ASP B 220 22.971 14.269 30.596 1.00 40.71 C ATOM 4337 OD1 ASP B 220 22.606 14.428 31.780 1.00 41.95 O ATOM 4338 OD2 ASP B 220 22.322 13.555 29.796 1.00 42.95 O ATOM 4339 HA ASP B 220 24.532 16.013 31.938 1.00 0.00 H ATOM 4340 HB2 ASP B 220 24.136 15.199 29.050 1.00 0.00 H ATOM 4341 HB3 ASP B 220 25.088 14.272 30.233 1.00 0.00 H ATOM 4342 H ASP B 220 22.745 17.057 29.992 1.00 0.00 H ATOM 4343 N SER B 221 26.144 17.499 29.475 1.00 38.98 N ATOM 4344 CA SER B 221 27.469 18.056 29.137 1.00 38.93 C ATOM 4345 C SER B 221 27.923 19.174 30.068 1.00 38.47 C ATOM 4346 O SER B 221 29.112 19.303 30.365 1.00 38.52 O ATOM 4347 CB SER B 221 27.496 18.573 27.703 1.00 38.81 C ATOM 4348 OG SER B 221 26.838 17.675 26.835 1.00 41.44 O ATOM 4349 HA SER B 221 28.164 17.225 29.257 1.00 0.00 H ATOM 4350 HB2 SER B 221 28.532 18.686 27.383 1.00 0.00 H ATOM 4351 HB3 SER B 221 26.997 19.541 27.662 1.00 0.00 H ATOM 4352 HG SER B 221 25.896 17.573 27.121 1.00 0.00 H ATOM 4353 H SER B 221 25.338 17.673 28.842 1.00 0.00 H ATOM 4354 N TYR B 222 26.969 20.005 30.482 1.00 38.12 N ATOM 4355 CA TYR B 222 27.192 21.079 31.445 1.00 37.65 C ATOM 4356 C TYR B 222 27.689 20.500 32.771 1.00 37.35 C ATOM 4357 O TYR B 222 28.636 21.015 33.356 1.00 37.31 O ATOM 4358 CB TYR B 222 25.879 21.848 31.605 1.00 37.19 C ATOM 4359 CG TYR B 222 25.777 22.900 32.680 1.00 37.26 C ATOM 4360 CD1 TYR B 222 25.483 22.551 33.999 1.00 38.83 C ATOM 4361 CD2 TYR B 222 25.873 24.256 32.369 1.00 36.91 C ATOM 4362 CE1 TYR B 222 25.337 23.526 34.991 1.00 37.87 C ATOM 4363 CE2 TYR B 222 25.727 25.237 33.353 1.00 37.12 C ATOM 4364 CZ TYR B 222 25.456 24.861 34.659 1.00 38.01 C ATOM 4365 OH TYR B 222 25.309 25.819 35.643 1.00 39.24 O ATOM 4366 HA TYR B 222 27.963 21.766 31.095 1.00 0.00 H ATOM 4367 HB3 TYR B 222 25.099 21.112 31.802 1.00 0.00 H ATOM 4368 HB2 TYR B 222 25.679 22.342 30.654 1.00 0.00 H ATOM 4369 HD2 TYR B 222 26.066 24.556 31.339 1.00 0.00 H ATOM 4370 HE2 TYR B 222 25.826 26.291 33.095 1.00 0.00 H ATOM 4371 HE1 TYR B 222 25.130 23.234 36.021 1.00 0.00 H ATOM 4372 HD1 TYR B 222 25.365 21.499 34.261 1.00 0.00 H ATOM 4373 HH TYR B 222 25.121 25.376 36.508 1.00 0.00 H ATOM 4374 H TYR B 222 26.011 19.882 30.098 1.00 0.00 H ATOM 4375 N ILE B 223 27.055 19.425 33.230 1.00 37.60 N ATOM 4376 CA ILE B 223 27.491 18.714 34.443 1.00 38.32 C ATOM 4377 C ILE B 223 28.943 18.223 34.333 1.00 38.49 C ATOM 4378 O ILE B 223 29.727 18.347 35.274 1.00 38.78 O ATOM 4379 CB ILE B 223 26.532 17.538 34.783 1.00 38.33 C ATOM 4380 CG1 ILE B 223 25.183 18.066 35.300 1.00 38.43 C ATOM 4381 CG2 ILE B 223 27.173 16.541 35.773 1.00 38.93 C ATOM 4382 CD1 ILE B 223 25.248 18.854 36.604 1.00 37.40 C ATOM 4383 HA ILE B 223 27.452 19.432 35.263 1.00 0.00 H ATOM 4384 HB ILE B 223 26.344 16.987 33.862 1.00 0.00 H ATOM 4385 HG12 ILE B 223 24.760 18.716 34.534 1.00 0.00 H ATOM 4386 HG13 ILE B 223 24.524 17.212 35.455 1.00 0.00 H ATOM 4387 HD11 ILE B 223 25.654 18.219 37.391 1.00 0.00 H ATOM 4388 HD12 ILE B 223 25.891 19.724 36.470 1.00 0.00 H ATOM 4389 HD13 ILE B 223 24.245 19.180 36.880 1.00 0.00 H ATOM 4390 HG21 ILE B 223 28.080 16.127 35.333 1.00 0.00 H ATOM 4391 HG22 ILE B 223 27.421 17.059 36.699 1.00 0.00 H ATOM 4392 HG23 ILE B 223 26.469 15.736 35.983 1.00 0.00 H ATOM 4393 H ILE B 223 26.223 19.075 32.714 1.00 0.00 H ATOM 4394 N LYS B 224 29.290 17.694 33.167 1.00 38.90 N ATOM 4395 CA LYS B 224 30.605 17.123 32.904 1.00 39.58 C ATOM 4396 C LYS B 224 31.679 18.204 32.772 1.00 39.38 C ATOM 4397 O LYS B 224 32.854 17.950 33.059 1.00 39.33 O ATOM 4398 CB LYS B 224 30.523 16.273 31.630 1.00 40.04 C ATOM 4399 CG LYS B 224 31.780 15.503 31.236 1.00 43.12 C ATOM 4400 CD LYS B 224 31.593 14.880 29.850 1.00 46.43 C ATOM 4401 CE LYS B 224 32.917 14.658 29.126 1.00 48.47 C ATOM 4402 NZ LYS B 224 33.714 13.530 29.721 1.00 49.22 N ATOM 4403 HA LYS B 224 30.896 16.499 33.749 1.00 0.00 H ATOM 4404 HB2 LYS B 224 29.721 15.548 31.768 1.00 0.00 H ATOM 4405 HB3 LYS B 224 30.271 16.939 30.804 1.00 0.00 H ATOM 4406 HG2 LYS B 224 32.631 16.184 31.215 1.00 0.00 H ATOM 4407 HG3 LYS B 224 31.965 14.715 31.966 1.00 0.00 H ATOM 4408 HD2 LYS B 224 31.091 13.919 29.963 1.00 0.00 H ATOM 4409 HD3 LYS B 224 30.972 15.544 29.249 1.00 0.00 H ATOM 4410 HE2 LYS B 224 33.506 15.573 29.185 1.00 0.00 H ATOM 4411 HE3 LYS B 224 32.710 14.428 28.081 1.00 0.00 H ATOM 4412 HZ1 LYS B 224 33.924 13.743 30.717 1.00 0.00 H ATOM 4413 HZ2 LYS B 224 33.164 12.650 29.662 1.00 0.00 H ATOM 4414 HZ3 LYS B 224 34.604 13.420 29.194 1.00 0.00 H ATOM 4415 H LYS B 224 28.587 17.686 32.401 1.00 0.00 H ATOM 4416 N SER B 225 31.274 19.409 32.357 1.00 38.70 N ATOM 4417 CA SER B 225 32.228 20.479 32.047 1.00 38.12 C ATOM 4418 C SER B 225 32.489 21.466 33.179 1.00 37.62 C ATOM 4419 O SER B 225 33.565 22.048 33.253 1.00 37.02 O ATOM 4420 CB SER B 225 31.798 21.247 30.794 1.00 37.99 C ATOM 4421 OG SER B 225 31.536 20.371 29.712 1.00 39.11 O ATOM 4422 HA SER B 225 33.171 19.959 31.879 1.00 0.00 H ATOM 4423 HB2 SER B 225 32.595 21.934 30.509 1.00 0.00 H ATOM 4424 HB3 SER B 225 30.894 21.813 31.018 1.00 0.00 H ATOM 4425 HG SER B 225 30.809 19.747 29.962 1.00 0.00 H ATOM 4426 H SER B 225 30.256 19.592 32.251 1.00 0.00 H ATOM 4427 N PHE B 226 31.502 21.681 34.039 1.00 37.84 N ATOM 4428 CA PHE B 226 31.646 22.662 35.111 1.00 38.13 C ATOM 4429 C PHE B 226 31.628 21.997 36.481 1.00 39.00 C ATOM 4430 O PHE B 226 30.594 21.497 36.910 1.00 39.46 O ATOM 4431 CB PHE B 226 30.566 23.753 35.014 1.00 37.74 C ATOM 4432 CG PHE B 226 30.483 24.406 33.664 1.00 36.15 C ATOM 4433 CD1 PHE B 226 31.449 25.323 33.254 1.00 35.08 C ATOM 4434 CD2 PHE B 226 29.433 24.111 32.801 1.00 35.27 C ATOM 4435 CE1 PHE B 226 31.371 25.936 31.993 1.00 34.04 C ATOM 4436 CE2 PHE B 226 29.344 24.717 31.541 1.00 33.65 C ATOM 4437 CZ PHE B 226 30.322 25.628 31.136 1.00 32.78 C ATOM 4438 HA PHE B 226 32.618 23.140 34.989 1.00 0.00 H ATOM 4439 HB2 PHE B 226 29.600 23.301 35.237 1.00 0.00 H ATOM 4440 HB3 PHE B 226 30.786 24.522 35.755 1.00 0.00 H ATOM 4441 HD2 PHE B 226 28.668 23.398 33.109 1.00 0.00 H ATOM 4442 HE2 PHE B 226 28.513 24.478 30.878 1.00 0.00 H ATOM 4443 HZ PHE B 226 30.263 26.095 30.153 1.00 0.00 H ATOM 4444 HE1 PHE B 226 32.133 26.653 31.687 1.00 0.00 H ATOM 4445 HD1 PHE B 226 32.276 25.568 33.921 1.00 0.00 H ATOM 4446 H PHE B 226 30.616 21.145 33.949 1.00 0.00 H ATOM 4447 N PRO B 227 32.781 21.984 37.172 1.00 39.84 N ATOM 4448 CA PRO B 227 32.860 21.350 38.494 1.00 40.36 C ATOM 4449 C PRO B 227 31.800 21.891 39.455 1.00 40.55 C ATOM 4450 O PRO B 227 30.946 21.132 39.929 1.00 40.86 O ATOM 4451 CB PRO B 227 34.272 21.724 38.985 1.00 40.43 C ATOM 4452 CG PRO B 227 35.058 21.976 37.748 1.00 40.50 C ATOM 4453 CD PRO B 227 34.071 22.569 36.761 1.00 40.03 C ATOM 4454 HA PRO B 227 32.683 20.276 38.445 1.00 0.00 H ATOM 4455 HD3 PRO B 227 34.048 23.656 36.837 1.00 0.00 H ATOM 4456 HD2 PRO B 227 34.321 22.283 35.739 1.00 0.00 H ATOM 4457 HG3 PRO B 227 35.472 21.045 37.362 1.00 0.00 H ATOM 4458 HG2 PRO B 227 35.868 22.677 37.946 1.00 0.00 H ATOM 4459 HB2 PRO B 227 34.237 22.619 39.606 1.00 0.00 H ATOM 4460 HB3 PRO B 227 34.709 20.905 39.556 1.00 0.00 H ATOM 4461 N LEU B 228 31.835 23.195 39.713 1.00 40.49 N ATOM 4462 CA LEU B 228 30.949 23.786 40.704 1.00 40.44 C ATOM 4463 C LEU B 228 29.678 24.336 40.057 1.00 40.51 C ATOM 4464 O LEU B 228 29.664 25.436 39.502 1.00 40.74 O ATOM 4465 CB LEU B 228 31.692 24.846 41.518 1.00 40.32 C ATOM 4466 CG LEU B 228 30.979 25.610 42.638 1.00 40.79 C ATOM 4467 CD1 LEU B 228 30.253 24.687 43.629 1.00 41.26 C ATOM 4468 CD2 LEU B 228 31.994 26.484 43.335 1.00 40.14 C ATOM 4469 HA LEU B 228 30.631 23.005 41.395 1.00 0.00 H ATOM 4470 HB2 LEU B 228 32.546 24.346 41.975 1.00 0.00 H ATOM 4471 HB3 LEU B 228 32.047 25.593 40.808 1.00 0.00 H ATOM 4472 HG LEU B 228 30.195 26.224 42.195 1.00 0.00 H ATOM 4473 HD21 LEU B 228 32.784 25.859 43.752 1.00 0.00 H ATOM 4474 HD22 LEU B 228 32.422 27.184 42.618 1.00 0.00 H ATOM 4475 HD23 LEU B 228 31.505 27.037 44.137 1.00 0.00 H ATOM 4476 HD11 LEU B 228 29.502 24.103 43.097 1.00 0.00 H ATOM 4477 HD12 LEU B 228 30.975 24.016 44.094 1.00 0.00 H ATOM 4478 HD13 LEU B 228 29.769 25.290 44.397 1.00 0.00 H ATOM 4479 H LEU B 228 32.506 23.801 39.199 1.00 0.00 H ATOM 4480 N THR B 229 28.621 23.537 40.145 1.00 40.49 N ATOM 4481 CA THR B 229 27.312 23.848 39.589 1.00 40.28 C ATOM 4482 C THR B 229 26.547 24.786 40.515 1.00 40.03 C ATOM 4483 O THR B 229 26.956 24.989 41.661 1.00 39.81 O ATOM 4484 CB THR B 229 26.486 22.565 39.432 1.00 40.28 C ATOM 4485 OG1 THR B 229 26.233 22.008 40.727 1.00 41.02 O ATOM 4486 CG2 THR B 229 27.224 21.538 38.577 1.00 39.84 C ATOM 4487 HA THR B 229 27.466 24.323 38.620 1.00 0.00 H ATOM 4488 HB THR B 229 25.548 22.815 38.937 1.00 0.00 H ATOM 4489 HG1 THR B 229 25.700 21.179 40.630 1.00 0.00 H ATOM 4490 HG23 THR B 229 27.418 21.960 37.591 1.00 0.00 H ATOM 4491 HG21 THR B 229 28.169 21.281 39.055 1.00 0.00 H ATOM 4492 HG22 THR B 229 26.611 20.643 38.476 1.00 0.00 H ATOM 4493 H THR B 229 28.736 22.631 40.643 1.00 0.00 H ATOM 4494 N LYS B 230 25.441 25.349 40.021 1.00 39.64 N ATOM 4495 CA LYS B 230 24.577 26.198 40.843 1.00 39.60 C ATOM 4496 C LYS B 230 23.933 25.416 41.989 1.00 40.17 C ATOM 4497 O LYS B 230 23.864 25.915 43.105 1.00 40.13 O ATOM 4498 CB LYS B 230 23.487 26.895 40.012 1.00 39.05 C ATOM 4499 CG LYS B 230 22.753 28.002 40.791 1.00 37.19 C ATOM 4500 CD LYS B 230 21.631 28.657 39.998 1.00 34.19 C ATOM 4501 CE LYS B 230 20.992 29.778 40.813 1.00 33.14 C ATOM 4502 NZ LYS B 230 19.978 30.556 40.040 1.00 31.92 N ATOM 4503 HA LYS B 230 25.226 26.965 41.267 1.00 0.00 H ATOM 4504 HB2 LYS B 230 23.952 27.339 39.132 1.00 0.00 H ATOM 4505 HB3 LYS B 230 22.758 26.148 39.699 1.00 0.00 H ATOM 4506 HG2 LYS B 230 22.328 27.565 41.695 1.00 0.00 H ATOM 4507 HG3 LYS B 230 23.476 28.770 41.065 1.00 0.00 H ATOM 4508 HD2 LYS B 230 22.036 29.070 39.074 1.00 0.00 H ATOM 4509 HD3 LYS B 230 20.875 27.909 39.759 1.00 0.00 H ATOM 4510 HE2 LYS B 230 21.777 30.460 41.142 1.00 0.00 H ATOM 4511 HE3 LYS B 230 20.504 29.340 41.684 1.00 0.00 H ATOM 4512 HZ1 LYS B 230 20.433 30.987 39.210 1.00 0.00 H ATOM 4513 HZ2 LYS B 230 19.218 29.918 39.728 1.00 0.00 H ATOM 4514 HZ3 LYS B 230 19.580 31.302 40.646 1.00 0.00 H ATOM 4515 H LYS B 230 25.187 25.180 39.027 1.00 0.00 H ATOM 4516 N ALA B 231 23.446 24.209 41.696 1.00 40.90 N ATOM 4517 CA ALA B 231 22.889 23.318 42.716 1.00 42.09 C ATOM 4518 C ALA B 231 23.877 23.147 43.866 1.00 42.97 C ATOM 4519 O ALA B 231 23.523 23.339 45.025 1.00 42.77 O ATOM 4520 CB ALA B 231 22.536 21.954 42.111 1.00 41.66 C ATOM 4521 HA ALA B 231 21.975 23.769 43.103 1.00 0.00 H ATOM 4522 HB1 ALA B 231 21.799 22.089 41.320 1.00 0.00 H ATOM 4523 HB2 ALA B 231 23.435 21.498 41.697 1.00 0.00 H ATOM 4524 HB3 ALA B 231 22.124 21.309 42.887 1.00 0.00 H ATOM 4525 H ALA B 231 23.463 23.889 40.707 1.00 0.00 H ATOM 4526 N LYS B 232 25.121 22.806 43.527 1.00 44.47 N ATOM 4527 CA LYS B 232 26.179 22.608 44.520 1.00 45.88 C ATOM 4528 C LYS B 232 26.553 23.905 45.239 1.00 46.53 C ATOM 4529 O LYS B 232 26.836 23.891 46.441 1.00 46.79 O ATOM 4530 CB LYS B 232 27.403 21.938 43.887 1.00 46.07 C ATOM 4531 CG LYS B 232 27.158 20.453 43.555 1.00 48.22 C ATOM 4532 CD LYS B 232 28.338 19.790 42.835 1.00 50.26 C ATOM 4533 CE LYS B 232 28.033 18.315 42.542 1.00 51.31 C ATOM 4534 NZ LYS B 232 29.105 17.647 41.736 1.00 52.30 N ATOM 4535 HA LYS B 232 25.785 21.937 45.283 1.00 0.00 H ATOM 4536 HB2 LYS B 232 27.654 22.465 42.967 1.00 0.00 H ATOM 4537 HB3 LYS B 232 28.239 22.007 44.583 1.00 0.00 H ATOM 4538 HG2 LYS B 232 26.974 19.916 44.485 1.00 0.00 H ATOM 4539 HG3 LYS B 232 26.278 20.382 42.916 1.00 0.00 H ATOM 4540 HD2 LYS B 232 28.523 20.311 41.896 1.00 0.00 H ATOM 4541 HD3 LYS B 232 29.225 19.854 43.466 1.00 0.00 H ATOM 4542 HE2 LYS B 232 27.095 18.256 41.990 1.00 0.00 H ATOM 4543 HE3 LYS B 232 27.929 17.786 43.489 1.00 0.00 H ATOM 4544 HZ1 LYS B 232 29.208 18.137 40.824 1.00 0.00 H ATOM 4545 HZ2 LYS B 232 30.005 17.688 42.256 1.00 0.00 H ATOM 4546 HZ3 LYS B 232 28.844 16.654 41.570 1.00 0.00 H ATOM 4547 H LYS B 232 25.348 22.676 42.520 1.00 0.00 H ATOM 4548 N ALA B 233 26.520 25.023 44.513 1.00 46.96 N ATOM 4549 CA ALA B 233 26.855 26.324 45.093 1.00 47.67 C ATOM 4550 C ALA B 233 25.755 26.898 45.991 1.00 48.29 C ATOM 4551 O ALA B 233 26.063 27.552 46.985 1.00 48.04 O ATOM 4552 CB ALA B 233 27.236 27.328 44.009 1.00 47.17 C ATOM 4553 HA ALA B 233 27.717 26.146 45.736 1.00 0.00 H ATOM 4554 HB1 ALA B 233 28.102 26.957 43.460 1.00 0.00 H ATOM 4555 HB2 ALA B 233 26.398 27.457 43.324 1.00 0.00 H ATOM 4556 HB3 ALA B 233 27.480 28.285 44.471 1.00 0.00 H ATOM 4557 H ALA B 233 26.250 24.969 43.510 1.00 0.00 H ATOM 4558 N ARG B 234 24.488 26.675 45.635 1.00 49.21 N ATOM 4559 CA ARG B 234 23.365 27.115 46.478 1.00 50.56 C ATOM 4560 C ARG B 234 23.335 26.363 47.806 1.00 51.33 C ATOM 4561 O ARG B 234 23.045 26.952 48.846 1.00 51.36 O ATOM 4562 CB ARG B 234 22.010 26.953 45.771 1.00 50.47 C ATOM 4563 CG ARG B 234 21.659 28.033 44.737 1.00 50.98 C ATOM 4564 CD ARG B 234 21.778 29.460 45.278 1.00 50.85 C ATOM 4565 NE ARG B 234 22.873 30.171 44.625 1.00 51.04 N ATOM 4566 CZ ARG B 234 23.157 31.465 44.786 1.00 51.47 C ATOM 4567 NH1 ARG B 234 22.437 32.234 45.603 1.00 50.72 N ATOM 4568 NH2 ARG B 234 24.178 31.993 44.123 1.00 49.31 N ATOM 4569 HA ARG B 234 23.528 28.175 46.671 1.00 0.00 H ATOM 4570 HB2 ARG B 234 22.012 25.990 45.261 1.00 0.00 H ATOM 4571 HB3 ARG B 234 21.232 26.956 46.535 1.00 0.00 H ATOM 4572 HG2 ARG B 234 22.333 27.929 43.887 1.00 0.00 H ATOM 4573 HG3 ARG B 234 20.633 27.874 44.407 1.00 0.00 H ATOM 4574 HD2 ARG B 234 21.966 29.421 46.351 1.00 0.00 H ATOM 4575 HD3 ARG B 234 20.845 29.992 45.093 1.00 0.00 H ATOM 4576 HE ARG B 234 23.481 29.625 43.982 1.00 0.00 H ATOM 4577 HH12 ARG B 234 22.675 33.240 45.714 1.00 0.00 H ATOM 4578 HH11 ARG B 234 21.637 31.828 46.129 1.00 0.00 H ATOM 4579 HH22 ARG B 234 24.409 33.000 44.240 1.00 0.00 H ATOM 4580 HH21 ARG B 234 24.747 31.400 43.486 1.00 0.00 H ATOM 4581 H ARG B 234 24.290 26.179 44.742 1.00 0.00 H ATOM 4582 N ALA B 235 23.631 25.065 47.752 1.00 52.38 N ATOM 4583 CA ALA B 235 23.715 24.232 48.942 1.00 53.81 C ATOM 4584 C ALA B 235 24.772 24.781 49.902 1.00 54.83 C ATOM 4585 O ALA B 235 24.492 24.967 51.090 1.00 54.69 O ATOM 4586 CB ALA B 235 24.012 22.786 48.564 1.00 53.60 C ATOM 4587 HA ALA B 235 22.752 24.252 49.452 1.00 0.00 H ATOM 4588 HB1 ALA B 235 23.215 22.408 47.923 1.00 0.00 H ATOM 4589 HB2 ALA B 235 24.962 22.739 48.031 1.00 0.00 H ATOM 4590 HB3 ALA B 235 24.071 22.180 49.468 1.00 0.00 H ATOM 4591 H ALA B 235 23.809 24.631 46.824 1.00 0.00 H ATOM 4592 N ILE B 236 25.963 25.065 49.365 1.00 56.25 N ATOM 4593 CA ILE B 236 27.080 25.667 50.116 1.00 57.43 C ATOM 4594 C ILE B 236 26.746 27.051 50.695 1.00 58.58 C ATOM 4595 O ILE B 236 27.148 27.374 51.814 1.00 58.91 O ATOM 4596 CB ILE B 236 28.375 25.762 49.253 1.00 57.17 C ATOM 4597 CG1 ILE B 236 28.869 24.369 48.862 1.00 56.97 C ATOM 4598 CG2 ILE B 236 29.476 26.505 50.000 1.00 57.07 C ATOM 4599 CD1 ILE B 236 29.861 24.352 47.721 1.00 56.07 C ATOM 4600 HA ILE B 236 27.256 24.992 50.953 1.00 0.00 H ATOM 4601 HB ILE B 236 28.128 26.318 48.349 1.00 0.00 H ATOM 4602 HG12 ILE B 236 29.345 23.919 49.734 1.00 0.00 H ATOM 4603 HG13 ILE B 236 28.006 23.771 48.572 1.00 0.00 H ATOM 4604 HD11 ILE B 236 29.400 24.786 46.834 1.00 0.00 H ATOM 4605 HD12 ILE B 236 30.740 24.935 47.997 1.00 0.00 H ATOM 4606 HD13 ILE B 236 30.156 23.323 47.513 1.00 0.00 H ATOM 4607 HG21 ILE B 236 29.137 27.514 50.235 1.00 0.00 H ATOM 4608 HG22 ILE B 236 29.709 25.974 50.923 1.00 0.00 H ATOM 4609 HG23 ILE B 236 30.367 26.556 49.374 1.00 0.00 H ATOM 4610 H ILE B 236 26.110 24.849 48.358 1.00 0.00 H ATOM 4611 N LEU B 237 26.015 27.864 49.938 1.00 59.94 N ATOM 4612 CA LEU B 237 25.719 29.227 50.368 1.00 61.37 C ATOM 4613 C LEU B 237 24.624 29.278 51.430 1.00 62.69 C ATOM 4614 O LEU B 237 24.770 29.968 52.438 1.00 62.77 O ATOM 4615 CB LEU B 237 25.371 30.121 49.174 1.00 61.07 C ATOM 4616 CG LEU B 237 26.538 30.580 48.287 1.00 61.16 C ATOM 4617 CD1 LEU B 237 26.035 31.111 46.956 1.00 60.31 C ATOM 4618 CD2 LEU B 237 27.411 31.621 48.982 1.00 60.57 C ATOM 4619 HA LEU B 237 26.627 29.615 50.831 1.00 0.00 H ATOM 4620 HB2 LEU B 237 24.673 29.571 48.542 1.00 0.00 H ATOM 4621 HB3 LEU B 237 24.881 31.014 49.562 1.00 0.00 H ATOM 4622 HG LEU B 237 27.158 29.704 48.100 1.00 0.00 H ATOM 4623 HD21 LEU B 237 26.807 32.494 49.228 1.00 0.00 H ATOM 4624 HD22 LEU B 237 27.825 31.195 49.896 1.00 0.00 H ATOM 4625 HD23 LEU B 237 28.223 31.915 48.317 1.00 0.00 H ATOM 4626 HD11 LEU B 237 25.488 30.325 46.436 1.00 0.00 H ATOM 4627 HD12 LEU B 237 25.374 31.960 47.131 1.00 0.00 H ATOM 4628 HD13 LEU B 237 26.883 31.429 46.349 1.00 0.00 H ATOM 4629 H LEU B 237 25.649 27.524 49.026 1.00 0.00 H ATOM 4630 N THR B 238 23.533 28.552 51.190 1.00 64.44 N ATOM 4631 CA THR B 238 22.406 28.451 52.121 1.00 66.24 C ATOM 4632 C THR B 238 21.524 27.272 51.712 1.00 67.30 C ATOM 4633 O THR B 238 20.609 27.421 50.897 1.00 67.42 O ATOM 4634 CB THR B 238 21.531 29.736 52.148 1.00 66.32 C ATOM 4635 OG1 THR B 238 22.364 30.905 52.172 1.00 67.04 O ATOM 4636 CG2 THR B 238 20.606 29.741 53.374 1.00 66.87 C ATOM 4637 HA THR B 238 22.823 28.312 53.118 1.00 0.00 H ATOM 4638 HB THR B 238 20.919 29.746 51.246 1.00 0.00 H ATOM 4639 HG1 THR B 238 22.935 30.885 52.980 1.00 0.00 H ATOM 4640 HG23 THR B 238 19.974 28.853 53.354 1.00 0.00 H ATOM 4641 HG21 THR B 238 21.209 29.740 54.282 1.00 0.00 H ATOM 4642 HG22 THR B 238 19.981 30.634 53.352 1.00 0.00 H ATOM 4643 H THR B 238 23.478 28.028 50.293 1.00 0.00 H ATOM 4644 N GLY B 239 21.807 26.103 52.274 1.00 68.69 N ATOM 4645 CA GLY B 239 21.020 24.902 51.999 1.00 70.20 C ATOM 4646 C GLY B 239 21.250 23.833 53.044 1.00 71.32 C ATOM 4647 O GLY B 239 22.237 23.888 53.790 1.00 71.35 O ATOM 4648 HA3 GLY B 239 21.303 24.509 51.023 1.00 0.00 H ATOM 4649 HA2 GLY B 239 19.963 25.166 51.990 1.00 0.00 H ATOM 4650 H GLY B 239 22.612 26.040 52.929 1.00 0.00 H ATOM 4651 N LYS B 240 20.349 22.851 53.084 1.00 72.44 N ATOM 4652 CA LYS B 240 20.425 21.738 54.044 1.00 73.73 C ATOM 4653 C LYS B 240 21.720 20.901 53.968 1.00 74.22 C ATOM 4654 O LYS B 240 21.791 19.796 54.524 1.00 74.38 O ATOM 4655 CB LYS B 240 19.182 20.842 53.945 1.00 73.88 C ATOM 4656 CG LYS B 240 17.954 21.407 54.659 1.00 74.61 C ATOM 4657 CD LYS B 240 17.057 20.294 55.203 1.00 75.79 C ATOM 4658 CE LYS B 240 17.650 19.662 56.466 1.00 76.26 C ATOM 4659 NZ LYS B 240 16.902 18.445 56.887 1.00 76.99 N ATOM 4660 HA LYS B 240 20.454 22.211 55.025 1.00 0.00 H ATOM 4661 HB2 LYS B 240 18.936 20.710 52.891 1.00 0.00 H ATOM 4662 HB3 LYS B 240 19.420 19.874 54.385 1.00 0.00 H ATOM 4663 HG2 LYS B 240 18.284 22.033 55.488 1.00 0.00 H ATOM 4664 HG3 LYS B 240 17.382 22.011 53.955 1.00 0.00 H ATOM 4665 HD2 LYS B 240 16.079 20.712 55.441 1.00 0.00 H ATOM 4666 HD3 LYS B 240 16.946 19.524 54.440 1.00 0.00 H ATOM 4667 HE2 LYS B 240 17.617 20.393 57.274 1.00 0.00 H ATOM 4668 HE3 LYS B 240 18.686 19.387 56.269 1.00 0.00 H ATOM 4669 HZ1 LYS B 240 15.913 18.699 57.084 1.00 0.00 H ATOM 4670 HZ2 LYS B 240 16.934 17.739 56.124 1.00 0.00 H ATOM 4671 HZ3 LYS B 240 17.338 18.051 57.745 1.00 0.00 H ATOM 4672 H LYS B 240 19.559 22.872 52.408 1.00 0.00 H ATOM 4673 N THR B 241 22.730 21.436 53.278 1.00 74.84 N ATOM 4674 CA THR B 241 24.098 20.926 53.352 1.00 75.31 C ATOM 4675 C THR B 241 24.826 21.648 54.487 1.00 75.60 C ATOM 4676 O THR B 241 25.000 22.875 54.455 1.00 75.71 O ATOM 4677 CB THR B 241 24.867 21.107 52.014 1.00 75.39 C ATOM 4678 OG1 THR B 241 24.251 20.308 50.993 1.00 75.72 O ATOM 4679 CG2 THR B 241 26.353 20.704 52.159 1.00 75.12 C ATOM 4680 HA THR B 241 24.058 19.854 53.546 1.00 0.00 H ATOM 4681 HB THR B 241 24.825 22.161 51.739 1.00 0.00 H ATOM 4682 HG1 THR B 241 24.743 20.425 50.142 1.00 0.00 H ATOM 4683 HG23 THR B 241 26.819 21.312 52.935 1.00 0.00 H ATOM 4684 HG21 THR B 241 26.417 19.651 52.433 1.00 0.00 H ATOM 4685 HG22 THR B 241 26.866 20.866 51.211 1.00 0.00 H ATOM 4686 H THR B 241 22.535 22.251 52.661 1.00 0.00 H ATOM 4687 N THR B 242 25.219 20.874 55.496 1.00 75.76 N ATOM 4688 CA THR B 242 26.007 21.375 56.622 1.00 75.84 C ATOM 4689 C THR B 242 27.179 20.411 56.843 1.00 75.70 C ATOM 4690 O THR B 242 27.606 20.165 57.980 1.00 75.78 O ATOM 4691 CB THR B 242 25.150 21.525 57.920 1.00 75.92 C ATOM 4692 OG1 THR B 242 23.774 21.758 57.584 1.00 76.11 O ATOM 4693 CG2 THR B 242 25.664 22.684 58.781 1.00 76.23 C ATOM 4694 HA THR B 242 26.376 22.374 56.388 1.00 0.00 H ATOM 4695 HB THR B 242 25.234 20.598 58.487 1.00 0.00 H ATOM 4696 HG1 THR B 242 23.244 21.851 58.415 1.00 0.00 H ATOM 4697 HG23 THR B 242 26.709 22.509 59.037 1.00 0.00 H ATOM 4698 HG21 THR B 242 25.577 23.616 58.223 1.00 0.00 H ATOM 4699 HG22 THR B 242 25.071 22.748 59.693 1.00 0.00 H ATOM 4700 H THR B 242 24.954 19.868 55.483 1.00 0.00 H ATOM 4701 N ASP B 243 27.689 19.866 55.736 1.00 75.32 N ATOM 4702 CA ASP B 243 28.783 18.890 55.766 1.00 74.90 C ATOM 4703 C ASP B 243 30.148 19.564 55.867 1.00 74.31 C ATOM 4704 O ASP B 243 30.926 19.265 56.776 1.00 74.41 O ATOM 4705 CB ASP B 243 28.728 17.979 54.535 1.00 75.07 C ATOM 4706 CG ASP B 243 27.453 17.161 54.472 1.00 75.61 C ATOM 4707 OD1 ASP B 243 27.038 16.603 55.512 1.00 76.39 O ATOM 4708 OD2 ASP B 243 26.864 17.074 53.377 1.00 76.88 O ATOM 4709 HA ASP B 243 28.650 18.284 56.662 1.00 0.00 H ATOM 4710 HB2 ASP B 243 28.791 18.597 53.640 1.00 0.00 H ATOM 4711 HB3 ASP B 243 29.579 17.298 54.566 1.00 0.00 H ATOM 4712 H ASP B 243 27.294 20.145 54.815 1.00 0.00 H ATOM 4713 N LYS B 244 30.428 20.464 54.925 1.00 73.45 N ATOM 4714 CA LYS B 244 31.677 21.228 54.906 1.00 72.48 C ATOM 4715 C LYS B 244 31.373 22.730 54.878 1.00 71.54 C ATOM 4716 O LYS B 244 30.236 23.136 54.612 1.00 71.69 O ATOM 4717 CB LYS B 244 32.555 20.804 53.718 1.00 72.70 C ATOM 4718 CG LYS B 244 33.036 19.338 53.777 1.00 73.11 C ATOM 4719 CD LYS B 244 33.934 18.965 52.596 1.00 73.61 C ATOM 4720 CE LYS B 244 35.354 19.500 52.772 1.00 74.02 C ATOM 4721 NZ LYS B 244 36.227 19.164 51.615 1.00 74.23 N ATOM 4722 HA LYS B 244 32.238 21.015 55.816 1.00 0.00 H ATOM 4723 HB2 LYS B 244 31.979 20.938 52.802 1.00 0.00 H ATOM 4724 HB3 LYS B 244 33.432 21.451 53.693 1.00 0.00 H ATOM 4725 HG2 LYS B 244 33.595 19.191 54.701 1.00 0.00 H ATOM 4726 HG3 LYS B 244 32.164 18.684 53.773 1.00 0.00 H ATOM 4727 HD2 LYS B 244 33.974 17.879 52.512 1.00 0.00 H ATOM 4728 HD3 LYS B 244 33.509 19.384 51.684 1.00 0.00 H ATOM 4729 HE2 LYS B 244 35.784 19.066 53.675 1.00 0.00 H ATOM 4730 HE3 LYS B 244 35.311 20.584 52.877 1.00 0.00 H ATOM 4731 HZ1 LYS B 244 36.280 18.131 51.511 1.00 0.00 H ATOM 4732 HZ2 LYS B 244 35.829 19.580 50.749 1.00 0.00 H ATOM 4733 HZ3 LYS B 244 37.180 19.547 51.779 1.00 0.00 H ATOM 4734 H LYS B 244 29.730 20.631 54.172 1.00 0.00 H ATOM 4735 N SER B 245 32.376 23.556 55.162 1.00 70.07 N ATOM 4736 CA SER B 245 32.134 24.987 55.324 1.00 68.64 C ATOM 4737 C SER B 245 33.251 25.840 54.726 1.00 67.33 C ATOM 4738 O SER B 245 34.412 25.707 55.129 1.00 67.52 O ATOM 4739 CB SER B 245 31.933 25.330 56.805 1.00 68.66 C ATOM 4740 OG SER B 245 31.350 26.612 56.958 1.00 69.16 O ATOM 4741 HA SER B 245 31.223 25.222 54.773 1.00 0.00 H ATOM 4742 HB2 SER B 245 32.900 25.316 57.308 1.00 0.00 H ATOM 4743 HB3 SER B 245 31.279 24.585 57.257 1.00 0.00 H ATOM 4744 HG SER B 245 31.232 26.807 57.921 1.00 0.00 H ATOM 4745 H SER B 245 33.340 23.180 55.269 1.00 0.00 H ATOM 4746 N PRO B 246 32.900 26.721 53.764 1.00 65.78 N ATOM 4747 CA PRO B 246 33.871 27.621 53.139 1.00 64.41 C ATOM 4748 C PRO B 246 34.532 28.557 54.143 1.00 62.98 C ATOM 4749 O PRO B 246 33.891 29.009 55.088 1.00 62.72 O ATOM 4750 CB PRO B 246 33.024 28.428 52.143 1.00 64.36 C ATOM 4751 CG PRO B 246 31.622 28.281 52.617 1.00 65.02 C ATOM 4752 CD PRO B 246 31.547 26.913 53.210 1.00 65.60 C ATOM 4753 HA PRO B 246 34.691 27.070 52.679 1.00 0.00 H ATOM 4754 HD3 PRO B 246 30.791 26.866 53.994 1.00 0.00 H ATOM 4755 HD2 PRO B 246 31.325 26.166 52.448 1.00 0.00 H ATOM 4756 HG3 PRO B 246 30.925 28.375 51.784 1.00 0.00 H ATOM 4757 HG2 PRO B 246 31.392 29.036 53.368 1.00 0.00 H ATOM 4758 HB2 PRO B 246 33.322 29.476 52.148 1.00 0.00 H ATOM 4759 HB3 PRO B 246 33.132 28.026 51.135 1.00 0.00 H ATOM 4760 N PHE B 247 35.813 28.828 53.933 1.00 61.51 N ATOM 4761 CA PHE B 247 36.533 29.799 54.735 1.00 60.28 C ATOM 4762 C PHE B 247 36.103 31.206 54.321 1.00 59.51 C ATOM 4763 O PHE B 247 36.110 31.533 53.136 1.00 59.12 O ATOM 4764 CB PHE B 247 38.042 29.622 54.558 1.00 60.14 C ATOM 4765 CG PHE B 247 38.861 30.505 55.452 1.00 60.32 C ATOM 4766 CD1 PHE B 247 39.332 30.032 56.677 1.00 60.40 C ATOM 4767 CD2 PHE B 247 39.159 31.814 55.077 1.00 60.15 C ATOM 4768 CE1 PHE B 247 40.089 30.851 57.513 1.00 60.49 C ATOM 4769 CE2 PHE B 247 39.906 32.644 55.909 1.00 59.96 C ATOM 4770 CZ PHE B 247 40.375 32.162 57.125 1.00 60.25 C ATOM 4771 HA PHE B 247 36.299 29.647 55.789 1.00 0.00 H ATOM 4772 HB2 PHE B 247 38.295 28.584 54.774 1.00 0.00 H ATOM 4773 HB3 PHE B 247 38.296 29.849 53.523 1.00 0.00 H ATOM 4774 HD2 PHE B 247 38.802 32.193 54.119 1.00 0.00 H ATOM 4775 HE2 PHE B 247 40.122 33.669 55.607 1.00 0.00 H ATOM 4776 HZ PHE B 247 40.966 32.807 57.776 1.00 0.00 H ATOM 4777 HE1 PHE B 247 40.456 30.470 58.466 1.00 0.00 H ATOM 4778 HD1 PHE B 247 39.106 29.011 56.984 1.00 0.00 H ATOM 4779 H PHE B 247 36.316 28.330 53.171 1.00 0.00 H ATOM 4780 N VAL B 248 35.735 32.032 55.297 1.00 58.59 N ATOM 4781 CA VAL B 248 35.235 33.378 55.013 1.00 57.78 C ATOM 4782 C VAL B 248 36.338 34.429 55.023 1.00 57.42 C ATOM 4783 O VAL B 248 37.099 34.551 55.984 1.00 57.08 O ATOM 4784 CB VAL B 248 34.085 33.810 55.966 1.00 57.79 C ATOM 4785 CG1 VAL B 248 33.541 35.178 55.566 1.00 57.28 C ATOM 4786 CG2 VAL B 248 32.961 32.774 55.965 1.00 57.69 C ATOM 4787 HA VAL B 248 34.830 33.318 54.003 1.00 0.00 H ATOM 4788 HB VAL B 248 34.491 33.878 56.975 1.00 0.00 H ATOM 4789 HG11 VAL B 248 34.341 35.916 55.620 1.00 0.00 H ATOM 4790 HG12 VAL B 248 33.157 35.131 54.547 1.00 0.00 H ATOM 4791 HG13 VAL B 248 32.737 35.461 56.246 1.00 0.00 H ATOM 4792 HG21 VAL B 248 32.562 32.673 54.956 1.00 0.00 H ATOM 4793 HG22 VAL B 248 33.353 31.814 56.300 1.00 0.00 H ATOM 4794 HG23 VAL B 248 32.169 33.099 56.639 1.00 0.00 H ATOM 4795 H VAL B 248 35.804 31.714 56.285 1.00 0.00 H ATOM 4796 N ILE B 249 36.407 35.184 53.931 1.00 57.07 N ATOM 4797 CA ILE B 249 37.326 36.303 53.812 1.00 56.86 C ATOM 4798 C ILE B 249 36.515 37.602 53.826 1.00 56.85 C ATOM 4799 O ILE B 249 35.761 37.885 52.894 1.00 56.69 O ATOM 4800 CB ILE B 249 38.198 36.178 52.541 1.00 56.58 C ATOM 4801 CG1 ILE B 249 38.978 34.859 52.568 1.00 56.89 C ATOM 4802 CG2 ILE B 249 39.143 37.369 52.424 1.00 56.15 C ATOM 4803 CD1 ILE B 249 39.371 34.327 51.205 1.00 57.07 C ATOM 4804 HA ILE B 249 38.016 36.306 54.655 1.00 0.00 H ATOM 4805 HB ILE B 249 37.549 36.177 51.665 1.00 0.00 H ATOM 4806 HG12 ILE B 249 39.888 35.014 53.147 1.00 0.00 H ATOM 4807 HG13 ILE B 249 38.359 34.109 53.060 1.00 0.00 H ATOM 4808 HD11 ILE B 249 38.473 34.150 50.613 1.00 0.00 H ATOM 4809 HD12 ILE B 249 40.003 35.057 50.700 1.00 0.00 H ATOM 4810 HD13 ILE B 249 39.918 33.392 51.325 1.00 0.00 H ATOM 4811 HG21 ILE B 249 38.561 38.289 52.366 1.00 0.00 H ATOM 4812 HG22 ILE B 249 39.793 37.403 53.299 1.00 0.00 H ATOM 4813 HG23 ILE B 249 39.749 37.264 51.524 1.00 0.00 H ATOM 4814 H ILE B 249 35.779 34.965 53.131 1.00 0.00 H ATOM 4815 N TYR B 250 36.674 38.377 54.896 1.00 57.10 N ATOM 4816 CA TYR B 250 35.863 39.577 55.132 1.00 57.45 C ATOM 4817 C TYR B 250 36.735 40.820 55.311 1.00 58.00 C ATOM 4818 O TYR B 250 36.240 41.947 55.235 1.00 57.88 O ATOM 4819 CB TYR B 250 34.961 39.373 56.359 1.00 57.28 C ATOM 4820 CG TYR B 250 35.715 38.844 57.553 1.00 57.18 C ATOM 4821 CD1 TYR B 250 36.301 39.712 58.469 1.00 57.24 C ATOM 4822 CD2 TYR B 250 35.872 37.472 57.751 1.00 57.66 C ATOM 4823 CE1 TYR B 250 37.015 39.232 59.559 1.00 57.83 C ATOM 4824 CE2 TYR B 250 36.584 36.980 58.839 1.00 58.15 C ATOM 4825 CZ TYR B 250 37.154 37.869 59.736 1.00 58.10 C ATOM 4826 OH TYR B 250 37.870 37.397 60.809 1.00 59.30 O ATOM 4827 HA TYR B 250 35.239 39.737 54.253 1.00 0.00 H ATOM 4828 HB3 TYR B 250 34.175 38.664 56.100 1.00 0.00 H ATOM 4829 HB2 TYR B 250 34.512 40.330 56.625 1.00 0.00 H ATOM 4830 HD2 TYR B 250 35.429 36.774 57.041 1.00 0.00 H ATOM 4831 HE2 TYR B 250 36.693 35.905 58.985 1.00 0.00 H ATOM 4832 HE1 TYR B 250 37.463 39.926 60.270 1.00 0.00 H ATOM 4833 HD1 TYR B 250 36.198 40.788 58.329 1.00 0.00 H ATOM 4834 HH TYR B 250 38.204 38.161 61.343 1.00 0.00 H ATOM 4835 H TYR B 250 37.402 38.122 55.593 1.00 0.00 H ATOM 4836 N ASP B 251 38.026 40.598 55.562 1.00 58.98 N ATOM 4837 CA ASP B 251 39.027 41.669 55.684 1.00 60.21 C ATOM 4838 C ASP B 251 40.457 41.173 55.369 1.00 61.18 C ATOM 4839 O ASP B 251 40.655 40.003 55.020 1.00 61.09 O ATOM 4840 CB ASP B 251 38.950 42.355 57.068 1.00 60.11 C ATOM 4841 CG ASP B 251 39.476 41.484 58.210 1.00 59.59 C ATOM 4842 OD1 ASP B 251 39.596 42.015 59.330 1.00 60.20 O ATOM 4843 OD2 ASP B 251 39.770 40.287 58.012 1.00 58.68 O ATOM 4844 HA ASP B 251 38.786 42.419 54.931 1.00 0.00 H ATOM 4845 HB2 ASP B 251 39.539 43.271 57.033 1.00 0.00 H ATOM 4846 HB3 ASP B 251 37.908 42.602 57.274 1.00 0.00 H ATOM 4847 H ASP B 251 38.342 39.614 55.678 1.00 0.00 H ATOM 4848 N MET B 252 41.438 42.066 55.509 1.00 62.59 N ATOM 4849 CA MET B 252 42.837 41.786 55.146 1.00 64.07 C ATOM 4850 C MET B 252 43.456 40.627 55.937 1.00 64.66 C ATOM 4851 O MET B 252 44.144 39.774 55.364 1.00 64.70 O ATOM 4852 CB MET B 252 43.697 43.050 55.299 1.00 64.30 C ATOM 4853 CG MET B 252 43.046 44.333 54.767 1.00 65.93 C ATOM 4854 SD MET B 252 43.075 44.483 52.965 1.00 70.03 S ATOM 4855 CE MET B 252 44.734 45.114 52.688 1.00 69.36 C ATOM 4856 HA MET B 252 42.821 41.474 54.102 1.00 0.00 H ATOM 4857 HB2 MET B 252 43.910 43.191 56.359 1.00 0.00 H ATOM 4858 HB3 MET B 252 44.631 42.893 54.760 1.00 0.00 H ATOM 4859 HG2 MET B 252 43.575 45.187 55.190 1.00 0.00 H ATOM 4860 HG3 MET B 252 42.007 44.352 55.096 1.00 0.00 H ATOM 4861 HE1 MET B 252 44.849 46.068 53.203 1.00 0.00 H ATOM 4862 HE2 MET B 252 45.462 44.401 53.074 1.00 0.00 H ATOM 4863 HE3 MET B 252 44.894 45.255 51.619 1.00 0.00 H ATOM 4864 H MET B 252 41.204 43.004 55.893 1.00 0.00 H ATOM 4865 N ASN B 253 43.202 40.601 57.245 1.00 65.56 N ATOM 4866 CA ASN B 253 43.712 39.549 58.126 1.00 66.33 C ATOM 4867 C ASN B 253 43.170 38.160 57.783 1.00 66.79 C ATOM 4868 O ASN B 253 43.913 37.176 57.818 1.00 66.66 O ATOM 4869 CB ASN B 253 43.426 39.888 59.596 1.00 66.45 C ATOM 4870 CG ASN B 253 44.113 41.175 60.054 1.00 67.17 C ATOM 4871 OD1 ASN B 253 43.562 41.933 60.856 1.00 67.57 O ATOM 4872 ND2 ASN B 253 45.320 41.424 59.548 1.00 67.11 N ATOM 4873 HA ASN B 253 44.790 39.511 57.967 1.00 0.00 H ATOM 4874 HB2 ASN B 253 42.350 40.003 59.724 1.00 0.00 H ATOM 4875 HB3 ASN B 253 43.778 39.065 60.218 1.00 0.00 H ATOM 4876 HD22 ASN B 253 45.749 40.758 58.874 1.00 0.00 H ATOM 4877 HD21 ASN B 253 45.833 42.284 59.827 1.00 0.00 H ATOM 4878 H ASN B 253 42.619 41.358 57.656 1.00 0.00 H ATOM 4879 N SER B 254 41.880 38.091 57.448 1.00 67.54 N ATOM 4880 CA SER B 254 41.242 36.827 57.055 1.00 68.35 C ATOM 4881 C SER B 254 41.723 36.321 55.691 1.00 69.02 C ATOM 4882 O SER B 254 41.784 35.112 55.463 1.00 68.85 O ATOM 4883 CB SER B 254 39.710 36.939 57.085 1.00 68.26 C ATOM 4884 OG SER B 254 39.241 38.008 56.282 1.00 68.09 O ATOM 4885 HA SER B 254 41.548 36.087 57.795 1.00 0.00 H ATOM 4886 HB2 SER B 254 39.389 37.104 58.114 1.00 0.00 H ATOM 4887 HB3 SER B 254 39.281 36.007 56.717 1.00 0.00 H ATOM 4888 HG SER B 254 39.621 38.860 56.614 1.00 0.00 H ATOM 4889 H SER B 254 41.308 38.959 57.466 1.00 0.00 H ATOM 4890 N LEU B 255 42.062 37.247 54.794 1.00 70.06 N ATOM 4891 CA LEU B 255 42.674 36.897 53.511 1.00 71.24 C ATOM 4892 C LEU B 255 44.022 36.196 53.715 1.00 72.28 C ATOM 4893 O LEU B 255 44.233 35.092 53.203 1.00 72.09 O ATOM 4894 CB LEU B 255 42.842 38.138 52.626 1.00 71.06 C ATOM 4895 CG LEU B 255 43.716 37.976 51.376 1.00 70.75 C ATOM 4896 CD1 LEU B 255 43.007 37.178 50.276 1.00 70.15 C ATOM 4897 CD2 LEU B 255 44.140 39.332 50.873 1.00 70.27 C ATOM 4898 HA LEU B 255 42.004 36.203 53.003 1.00 0.00 H ATOM 4899 HB2 LEU B 255 41.850 38.448 52.298 1.00 0.00 H ATOM 4900 HB3 LEU B 255 43.283 38.924 53.239 1.00 0.00 H ATOM 4901 HG LEU B 255 44.601 37.405 51.655 1.00 0.00 H ATOM 4902 HD21 LEU B 255 43.256 39.918 50.623 1.00 0.00 H ATOM 4903 HD22 LEU B 255 44.709 39.844 51.649 1.00 0.00 H ATOM 4904 HD23 LEU B 255 44.761 39.211 49.985 1.00 0.00 H ATOM 4905 HD11 LEU B 255 42.762 36.184 50.651 1.00 0.00 H ATOM 4906 HD12 LEU B 255 42.092 37.695 49.986 1.00 0.00 H ATOM 4907 HD13 LEU B 255 43.665 37.090 49.411 1.00 0.00 H ATOM 4908 H LEU B 255 41.886 38.249 55.012 1.00 0.00 H ATOM 4909 N MET B 256 44.915 36.854 54.461 1.00 73.63 N ATOM 4910 CA MET B 256 46.200 36.282 54.873 1.00 75.03 C ATOM 4911 C MET B 256 45.989 34.898 55.484 1.00 75.68 C ATOM 4912 O MET B 256 46.688 33.945 55.140 1.00 75.75 O ATOM 4913 CB MET B 256 46.891 37.199 55.894 1.00 75.22 C ATOM 4914 CG MET B 256 47.445 38.525 55.342 1.00 76.78 C ATOM 4915 SD MET B 256 49.255 38.596 55.176 1.00 79.61 S ATOM 4916 CE MET B 256 49.786 38.617 56.892 1.00 78.68 C ATOM 4917 HA MET B 256 46.835 36.191 53.992 1.00 0.00 H ATOM 4918 HB2 MET B 256 46.166 37.438 56.672 1.00 0.00 H ATOM 4919 HB3 MET B 256 47.722 36.646 56.331 1.00 0.00 H ATOM 4920 HG2 MET B 256 47.136 39.326 56.013 1.00 0.00 H ATOM 4921 HG3 MET B 256 47.009 38.689 54.357 1.00 0.00 H ATOM 4922 HE1 MET B 256 49.367 39.492 57.390 1.00 0.00 H ATOM 4923 HE2 MET B 256 49.437 37.712 57.390 1.00 0.00 H ATOM 4924 HE3 MET B 256 50.874 38.660 56.934 1.00 0.00 H ATOM 4925 H MET B 256 44.686 37.822 54.765 1.00 0.00 H ATOM 4926 N MET B 257 45.009 34.807 56.383 1.00 76.58 N ATOM 4927 CA MET B 257 44.618 33.555 57.023 1.00 77.57 C ATOM 4928 C MET B 257 44.154 32.525 55.990 1.00 78.19 C ATOM 4929 O MET B 257 44.462 31.338 56.105 1.00 78.28 O ATOM 4930 CB MET B 257 43.504 33.825 58.040 1.00 77.67 C ATOM 4931 CG MET B 257 43.205 32.680 59.001 1.00 78.12 C ATOM 4932 SD MET B 257 44.360 32.587 60.377 1.00 79.21 S ATOM 4933 CE MET B 257 43.922 34.049 61.324 1.00 78.72 C ATOM 4934 HA MET B 257 45.487 33.143 57.536 1.00 0.00 H ATOM 4935 HB2 MET B 257 43.791 34.694 58.631 1.00 0.00 H ATOM 4936 HB3 MET B 257 42.591 34.048 57.488 1.00 0.00 H ATOM 4937 HG2 MET B 257 43.250 31.742 58.447 1.00 0.00 H ATOM 4938 HG3 MET B 257 42.200 32.817 59.401 1.00 0.00 H ATOM 4939 HE1 MET B 257 44.061 34.936 60.706 1.00 0.00 H ATOM 4940 HE2 MET B 257 42.879 33.981 61.634 1.00 0.00 H ATOM 4941 HE3 MET B 257 44.561 34.114 62.205 1.00 0.00 H ATOM 4942 H MET B 257 44.496 35.674 56.642 1.00 0.00 H ATOM 4943 N GLY B 258 43.416 32.992 54.984 1.00 79.01 N ATOM 4944 CA GLY B 258 42.880 32.122 53.935 1.00 80.08 C ATOM 4945 C GLY B 258 43.920 31.680 52.923 1.00 80.80 C ATOM 4946 O GLY B 258 43.769 30.640 52.279 1.00 80.67 O ATOM 4947 HA3 GLY B 258 42.093 32.662 53.408 1.00 0.00 H ATOM 4948 HA2 GLY B 258 42.457 31.234 54.406 1.00 0.00 H ATOM 4949 H GLY B 258 43.213 34.011 54.942 1.00 0.00 H ATOM 4950 N GLU B 259 44.976 32.480 52.797 1.00 81.67 N ATOM 4951 CA GLU B 259 46.081 32.218 51.879 1.00 82.60 C ATOM 4952 C GLU B 259 46.956 31.056 52.363 1.00 83.13 C ATOM 4953 O GLU B 259 47.556 30.349 51.552 1.00 83.18 O ATOM 4954 CB GLU B 259 46.923 33.491 51.710 1.00 82.62 C ATOM 4955 CG GLU B 259 47.860 33.499 50.503 1.00 83.22 C ATOM 4956 CD GLU B 259 48.746 34.738 50.444 1.00 83.90 C ATOM 4957 OE1 GLU B 259 48.223 35.870 50.579 1.00 84.14 O ATOM 4958 OE2 GLU B 259 49.970 34.575 50.249 1.00 83.73 O ATOM 4959 HA GLU B 259 45.662 31.929 50.915 1.00 0.00 H ATOM 4960 HB2 GLU B 259 46.241 34.336 51.613 1.00 0.00 H ATOM 4961 HB3 GLU B 259 47.529 33.616 52.608 1.00 0.00 H ATOM 4962 HG2 GLU B 259 48.499 32.617 50.553 1.00 0.00 H ATOM 4963 HG3 GLU B 259 47.258 33.459 49.595 1.00 0.00 H ATOM 4964 H GLU B 259 45.016 33.338 53.384 1.00 0.00 H ATOM 4965 N ASP B 260 47.018 30.868 53.682 1.00 83.91 N ATOM 4966 CA ASP B 260 47.852 29.831 54.303 1.00 84.54 C ATOM 4967 C ASP B 260 47.181 28.458 54.336 1.00 84.90 C ATOM 4968 O ASP B 260 47.811 27.447 54.011 1.00 85.01 O ATOM 4969 CB ASP B 260 48.274 30.248 55.720 1.00 84.56 C ATOM 4970 CG ASP B 260 49.472 31.186 55.727 1.00 84.81 C ATOM 4971 OD1 ASP B 260 50.544 30.802 55.210 1.00 84.79 O ATOM 4972 OD2 ASP B 260 49.344 32.306 56.267 1.00 85.02 O ATOM 4973 HA ASP B 260 48.737 29.735 53.673 1.00 0.00 H ATOM 4974 HB2 ASP B 260 47.435 30.751 56.200 1.00 0.00 H ATOM 4975 HB3 ASP B 260 48.530 29.352 56.285 1.00 0.00 H ATOM 4976 H ASP B 260 46.450 31.484 54.299 1.00 0.00 H ATOM 4977 N LYS B 261 45.912 28.424 54.741 1.00 85.36 N ATOM 4978 CA LYS B 261 45.156 27.172 54.805 1.00 85.81 C ATOM 4979 C LYS B 261 44.871 26.653 53.397 1.00 85.92 C ATOM 4980 O LYS B 261 45.456 25.652 52.971 1.00 86.07 O ATOM 4981 CB LYS B 261 43.861 27.350 55.609 1.00 85.86 C ATOM 4982 CG LYS B 261 44.061 27.428 57.124 1.00 86.54 C ATOM 4983 CD LYS B 261 44.102 26.045 57.786 1.00 87.15 C ATOM 4984 CE LYS B 261 44.272 26.165 59.298 1.00 87.26 C ATOM 4985 NZ LYS B 261 43.640 25.032 60.024 1.00 87.37 N ATOM 4986 HA LYS B 261 45.761 26.429 55.325 1.00 0.00 H ATOM 4987 HB2 LYS B 261 43.380 28.271 55.281 1.00 0.00 H ATOM 4988 HB3 LYS B 261 43.208 26.504 55.395 1.00 0.00 H ATOM 4989 HG2 LYS B 261 45.002 27.940 57.326 1.00 0.00 H ATOM 4990 HG3 LYS B 261 43.238 27.998 57.556 1.00 0.00 H ATOM 4991 HD2 LYS B 261 43.171 25.520 57.573 1.00 0.00 H ATOM 4992 HD3 LYS B 261 44.939 25.479 57.377 1.00 0.00 H ATOM 4993 HE2 LYS B 261 43.813 27.096 59.631 1.00 0.00 H ATOM 4994 HE3 LYS B 261 45.336 26.183 59.532 1.00 0.00 H ATOM 4995 HZ1 LYS B 261 42.622 25.011 59.813 1.00 0.00 H ATOM 4996 HZ2 LYS B 261 44.077 24.139 59.718 1.00 0.00 H ATOM 4997 HZ3 LYS B 261 43.781 25.156 61.047 1.00 0.00 H ATOM 4998 H LYS B 261 45.446 29.311 55.019 1.00 0.00 H ATOM 4999 N ILE B 262 43.981 27.340 52.683 1.00 85.92 N ATOM 5000 CA ILE B 262 43.755 27.078 51.265 1.00 85.93 C ATOM 5001 C ILE B 262 44.883 27.744 50.487 1.00 85.85 C ATOM 5002 O ILE B 262 45.201 28.915 50.718 1.00 85.92 O ATOM 5003 CB ILE B 262 42.390 27.624 50.793 1.00 85.90 C ATOM 5004 CG1 ILE B 262 41.254 26.890 51.506 1.00 86.20 C ATOM 5005 CG2 ILE B 262 42.239 27.490 49.276 1.00 85.87 C ATOM 5006 CD1 ILE B 262 39.995 27.721 51.673 1.00 86.86 C ATOM 5007 HA ILE B 262 43.743 26.002 51.093 1.00 0.00 H ATOM 5008 HB ILE B 262 42.341 28.683 51.045 1.00 0.00 H ATOM 5009 HG12 ILE B 262 41.004 26.000 50.928 1.00 0.00 H ATOM 5010 HG13 ILE B 262 41.604 26.594 52.495 1.00 0.00 H ATOM 5011 HD11 ILE B 262 40.224 28.611 52.260 1.00 0.00 H ATOM 5012 HD12 ILE B 262 39.624 28.017 50.692 1.00 0.00 H ATOM 5013 HD13 ILE B 262 39.237 27.130 52.187 1.00 0.00 H ATOM 5014 HG21 ILE B 262 43.031 28.053 48.782 1.00 0.00 H ATOM 5015 HG22 ILE B 262 42.311 26.439 48.996 1.00 0.00 H ATOM 5016 HG23 ILE B 262 41.268 27.883 48.973 1.00 0.00 H ATOM 5017 H ILE B 262 43.429 28.087 53.151 1.00 0.00 H ATOM 5018 N LYS B 263 45.495 26.990 49.579 1.00 85.67 N ATOM 5019 CA LYS B 263 46.612 27.507 48.792 1.00 85.47 C ATOM 5020 C LYS B 263 46.203 27.938 47.383 1.00 85.22 C ATOM 5021 O LYS B 263 45.476 27.225 46.684 1.00 85.10 O ATOM 5022 CB LYS B 263 47.781 26.513 48.778 1.00 85.46 C ATOM 5023 CG LYS B 263 48.846 26.843 49.818 1.00 85.59 C ATOM 5024 CD LYS B 263 49.156 25.668 50.731 1.00 85.68 C ATOM 5025 CE LYS B 263 50.026 26.118 51.902 1.00 85.64 C ATOM 5026 NZ LYS B 263 49.945 25.193 53.067 1.00 85.29 N ATOM 5027 HA LYS B 263 46.953 28.416 49.287 1.00 0.00 H ATOM 5028 HB2 LYS B 263 47.393 25.515 48.980 1.00 0.00 H ATOM 5029 HB3 LYS B 263 48.241 26.529 47.790 1.00 0.00 H ATOM 5030 HG2 LYS B 263 49.760 27.135 49.301 1.00 0.00 H ATOM 5031 HG3 LYS B 263 48.493 27.675 50.427 1.00 0.00 H ATOM 5032 HD2 LYS B 263 48.223 25.255 51.114 1.00 0.00 H ATOM 5033 HD3 LYS B 263 49.685 24.902 50.164 1.00 0.00 H ATOM 5034 HE2 LYS B 263 49.699 27.108 52.219 1.00 0.00 H ATOM 5035 HE3 LYS B 263 51.062 26.168 51.568 1.00 0.00 H ATOM 5036 HZ1 LYS B 263 48.961 25.143 53.401 1.00 0.00 H ATOM 5037 HZ2 LYS B 263 50.263 24.246 52.779 1.00 0.00 H ATOM 5038 HZ3 LYS B 263 50.554 25.547 53.832 1.00 0.00 H ATOM 5039 H LYS B 263 45.172 26.013 49.426 1.00 0.00 H ATOM 5040 N PHE B 264 46.664 29.122 46.994 1.00 84.86 N ATOM 5041 CA PHE B 264 46.423 29.647 45.661 1.00 84.55 C ATOM 5042 C PHE B 264 47.483 29.120 44.701 1.00 84.28 C ATOM 5043 O PHE B 264 48.665 29.475 44.799 1.00 84.15 O ATOM 5044 CB PHE B 264 46.402 31.179 45.669 1.00 84.61 C ATOM 5045 CG PHE B 264 45.477 31.773 46.697 1.00 84.95 C ATOM 5046 CD1 PHE B 264 44.265 31.152 47.018 1.00 85.39 C ATOM 5047 CD2 PHE B 264 45.805 32.969 47.330 1.00 85.21 C ATOM 5048 CE1 PHE B 264 43.405 31.702 47.970 1.00 85.63 C ATOM 5049 CE2 PHE B 264 44.950 33.534 48.278 1.00 85.58 C ATOM 5050 CZ PHE B 264 43.747 32.898 48.600 1.00 85.63 C ATOM 5051 HA PHE B 264 45.444 29.309 45.323 1.00 0.00 H ATOM 5052 HB2 PHE B 264 47.412 31.535 45.870 1.00 0.00 H ATOM 5053 HB3 PHE B 264 46.086 31.523 44.684 1.00 0.00 H ATOM 5054 HD2 PHE B 264 46.741 33.470 47.082 1.00 0.00 H ATOM 5055 HE2 PHE B 264 45.220 34.470 48.767 1.00 0.00 H ATOM 5056 HZ PHE B 264 43.079 33.336 49.341 1.00 0.00 H ATOM 5057 HE1 PHE B 264 42.471 31.199 48.220 1.00 0.00 H ATOM 5058 HD1 PHE B 264 43.988 30.224 46.517 1.00 0.00 H ATOM 5059 H PHE B 264 47.216 29.692 47.666 1.00 0.00 H ATOM 5060 N LYS B 265 47.041 28.264 43.784 1.00 83.86 N ATOM 5061 CA LYS B 265 47.909 27.617 42.802 1.00 83.48 C ATOM 5062 C LYS B 265 48.311 28.554 41.658 1.00 83.20 C ATOM 5063 O LYS B 265 48.344 29.775 41.811 1.00 82.84 O ATOM 5064 CB LYS B 265 47.228 26.355 42.249 1.00 83.40 C ATOM 5065 CG LYS B 265 45.814 26.588 41.724 1.00 83.37 C ATOM 5066 CD LYS B 265 45.077 25.288 41.453 1.00 82.97 C ATOM 5067 CE LYS B 265 43.666 25.569 40.950 1.00 83.06 C ATOM 5068 NZ LYS B 265 43.008 24.370 40.357 1.00 82.90 N ATOM 5069 HA LYS B 265 48.829 27.340 43.318 1.00 0.00 H ATOM 5070 HB2 LYS B 265 47.837 25.967 41.432 1.00 0.00 H ATOM 5071 HB3 LYS B 265 47.179 25.615 43.047 1.00 0.00 H ATOM 5072 HG2 LYS B 265 45.255 27.160 42.464 1.00 0.00 H ATOM 5073 HG3 LYS B 265 45.874 27.157 40.796 1.00 0.00 H ATOM 5074 HD2 LYS B 265 45.620 24.718 40.699 1.00 0.00 H ATOM 5075 HD3 LYS B 265 45.021 24.708 42.374 1.00 0.00 H ATOM 5076 HE2 LYS B 265 43.717 26.349 40.190 1.00 0.00 H ATOM 5077 HE3 LYS B 265 43.062 25.918 41.787 1.00 0.00 H ATOM 5078 HZ1 LYS B 265 43.570 24.031 39.550 1.00 0.00 H ATOM 5079 HZ2 LYS B 265 42.944 23.620 41.075 1.00 0.00 H ATOM 5080 HZ3 LYS B 265 42.053 24.625 40.034 1.00 0.00 H ATOM 5081 H LYS B 265 46.025 28.044 43.765 1.00 0.00 H TER 5082 LYS B 265 ATOM 5083 N LYS B 275 54.036 42.252 47.161 1.00 62.79 N ATOM 5084 CA LYS B 275 52.941 42.386 46.204 1.00 62.69 C ATOM 5085 C LYS B 275 51.670 42.810 46.936 1.00 62.24 C ATOM 5086 O LYS B 275 51.297 42.209 47.942 1.00 62.45 O ATOM 5087 CB LYS B 275 52.719 41.073 45.440 1.00 63.01 C ATOM 5088 CG LYS B 275 54.010 40.421 44.924 1.00 64.03 C ATOM 5089 CD LYS B 275 53.781 39.600 43.663 1.00 65.17 C ATOM 5090 CE LYS B 275 55.113 39.274 42.979 1.00 66.04 C ATOM 5091 NZ LYS B 275 54.980 39.207 41.487 1.00 66.30 N ATOM 5092 HA LYS B 275 53.201 43.153 45.474 1.00 0.00 H ATOM 5093 HB2 LYS B 275 52.222 40.368 46.107 1.00 0.00 H ATOM 5094 HB3 LYS B 275 52.074 41.279 44.586 1.00 0.00 H ATOM 5095 HG2 LYS B 275 54.735 41.205 44.705 1.00 0.00 H ATOM 5096 HG3 LYS B 275 54.407 39.767 45.701 1.00 0.00 H ATOM 5097 HD2 LYS B 275 53.277 38.670 43.928 1.00 0.00 H ATOM 5098 HD3 LYS B 275 53.155 40.168 42.975 1.00 0.00 H ATOM 5099 HE2 LYS B 275 55.469 38.311 43.344 1.00 0.00 H ATOM 5100 HE3 LYS B 275 55.837 40.048 43.233 1.00 0.00 H ATOM 5101 HZ1 LYS B 275 54.296 38.466 41.234 1.00 0.00 H ATOM 5102 HZ2 LYS B 275 54.647 40.125 41.128 1.00 0.00 H ATOM 5103 HZ3 LYS B 275 55.905 38.984 41.067 1.00 0.00 H ATOM 5104 HN3 LYS B 275 53.789 41.533 47.870 1.00 0.00 H ATOM 5105 HN2 LYS B 275 54.196 43.165 47.633 1.00 0.00 H ATOM 5106 HN1 LYS B 275 54.900 41.963 46.659 1.00 0.00 H ATOM 5107 N GLU B 276 51.014 43.850 46.433 1.00 61.56 N ATOM 5108 CA GLU B 276 49.862 44.437 47.116 1.00 60.81 C ATOM 5109 C GLU B 276 48.639 43.520 47.086 1.00 60.05 C ATOM 5110 O GLU B 276 48.444 42.764 46.131 1.00 59.96 O ATOM 5111 CB GLU B 276 49.517 45.793 46.503 1.00 61.00 C ATOM 5112 CG GLU B 276 48.890 46.754 47.480 1.00 62.02 C ATOM 5113 CD GLU B 276 47.655 47.429 46.922 1.00 63.35 C ATOM 5114 OE1 GLU B 276 47.767 48.118 45.881 1.00 63.98 O ATOM 5115 OE2 GLU B 276 46.573 47.270 47.536 1.00 63.35 O ATOM 5116 HA GLU B 276 50.142 44.571 48.161 1.00 0.00 H ATOM 5117 HB2 GLU B 276 50.433 46.241 46.118 1.00 0.00 H ATOM 5118 HB3 GLU B 276 48.819 45.633 45.681 1.00 0.00 H ATOM 5119 HG2 GLU B 276 48.612 46.205 48.380 1.00 0.00 H ATOM 5120 HG3 GLU B 276 49.622 47.520 47.735 1.00 0.00 H ATOM 5121 H GLU B 276 51.328 44.258 45.529 1.00 0.00 H ATOM 5122 N VAL B 277 47.824 43.599 48.137 1.00 58.91 N ATOM 5123 CA VAL B 277 46.639 42.754 48.290 1.00 57.81 C ATOM 5124 C VAL B 277 45.640 42.885 47.130 1.00 56.97 C ATOM 5125 O VAL B 277 45.225 41.875 46.559 1.00 56.68 O ATOM 5126 CB VAL B 277 45.961 42.971 49.673 1.00 57.94 C ATOM 5127 CG1 VAL B 277 44.453 42.728 49.616 1.00 57.79 C ATOM 5128 CG2 VAL B 277 46.606 42.068 50.712 1.00 57.97 C ATOM 5129 HA VAL B 277 46.994 41.724 48.252 1.00 0.00 H ATOM 5130 HB VAL B 277 46.109 44.013 49.957 1.00 0.00 H ATOM 5131 HG11 VAL B 277 44.002 43.418 48.903 1.00 0.00 H ATOM 5132 HG12 VAL B 277 44.263 41.702 49.300 1.00 0.00 H ATOM 5133 HG13 VAL B 277 44.022 42.891 50.604 1.00 0.00 H ATOM 5134 HG21 VAL B 277 46.486 41.027 50.411 1.00 0.00 H ATOM 5135 HG22 VAL B 277 47.667 42.306 50.790 1.00 0.00 H ATOM 5136 HG23 VAL B 277 46.125 42.226 51.677 1.00 0.00 H ATOM 5137 H VAL B 277 48.040 44.292 48.882 1.00 0.00 H ATOM 5138 N ALA B 278 45.287 44.123 46.781 1.00 55.96 N ATOM 5139 CA ALA B 278 44.361 44.401 45.677 1.00 54.99 C ATOM 5140 C ALA B 278 44.863 43.886 44.317 1.00 54.45 C ATOM 5141 O ALA B 278 44.062 43.501 43.460 1.00 54.09 O ATOM 5142 CB ALA B 278 44.053 45.880 45.607 1.00 54.99 C ATOM 5143 HA ALA B 278 43.446 43.850 45.893 1.00 0.00 H ATOM 5144 HB1 ALA B 278 43.596 46.199 46.544 1.00 0.00 H ATOM 5145 HB2 ALA B 278 44.977 46.435 45.444 1.00 0.00 H ATOM 5146 HB3 ALA B 278 43.365 46.068 44.783 1.00 0.00 H ATOM 5147 H ALA B 278 45.684 44.924 47.313 1.00 0.00 H ATOM 5148 N ILE B 279 46.183 43.876 44.133 1.00 53.75 N ATOM 5149 CA ILE B 279 46.800 43.341 42.919 1.00 53.30 C ATOM 5150 C ILE B 279 46.737 41.809 42.906 1.00 52.83 C ATOM 5151 O ILE B 279 46.303 41.213 41.918 1.00 53.01 O ATOM 5152 CB ILE B 279 48.246 43.887 42.711 1.00 53.46 C ATOM 5153 CG1 ILE B 279 48.185 45.330 42.193 1.00 54.02 C ATOM 5154 CG2 ILE B 279 49.054 43.007 41.746 1.00 53.35 C ATOM 5155 CD1 ILE B 279 49.474 46.123 42.376 1.00 54.57 C ATOM 5156 HA ILE B 279 46.223 43.693 42.064 1.00 0.00 H ATOM 5157 HB ILE B 279 48.756 43.867 43.674 1.00 0.00 H ATOM 5158 HG12 ILE B 279 47.952 45.300 41.129 1.00 0.00 H ATOM 5159 HG13 ILE B 279 47.387 45.849 42.724 1.00 0.00 H ATOM 5160 HD11 ILE B 279 49.719 46.177 43.437 1.00 0.00 H ATOM 5161 HD12 ILE B 279 50.283 45.627 41.840 1.00 0.00 H ATOM 5162 HD13 ILE B 279 49.339 47.130 41.982 1.00 0.00 H ATOM 5163 HG21 ILE B 279 49.123 41.997 42.149 1.00 0.00 H ATOM 5164 HG22 ILE B 279 48.555 42.979 40.777 1.00 0.00 H ATOM 5165 HG23 ILE B 279 50.055 43.423 41.629 1.00 0.00 H ATOM 5166 H ILE B 279 46.796 44.262 44.879 1.00 0.00 H ATOM 5167 N ARG B 280 47.140 41.181 44.008 1.00 52.04 N ATOM 5168 CA ARG B 280 47.061 39.725 44.149 1.00 51.49 C ATOM 5169 C ARG B 280 45.661 39.156 43.886 1.00 50.44 C ATOM 5170 O ARG B 280 45.532 38.122 43.231 1.00 50.18 O ATOM 5171 CB ARG B 280 47.580 39.284 45.523 1.00 51.77 C ATOM 5172 CG ARG B 280 48.991 38.692 45.487 1.00 53.62 C ATOM 5173 CD ARG B 280 49.797 39.016 46.741 1.00 55.56 C ATOM 5174 NE ARG B 280 49.129 38.625 47.982 1.00 57.84 N ATOM 5175 CZ ARG B 280 49.294 39.250 49.149 1.00 59.50 C ATOM 5176 NH1 ARG B 280 50.100 40.303 49.236 1.00 58.67 N ATOM 5177 NH2 ARG B 280 48.648 38.830 50.234 1.00 60.01 N ATOM 5178 HA ARG B 280 47.704 39.311 43.373 1.00 0.00 H ATOM 5179 HB2 ARG B 280 47.587 40.151 46.183 1.00 0.00 H ATOM 5180 HB3 ARG B 280 46.901 38.531 45.922 1.00 0.00 H ATOM 5181 HG2 ARG B 280 48.913 37.609 45.392 1.00 0.00 H ATOM 5182 HG3 ARG B 280 49.516 39.094 44.621 1.00 0.00 H ATOM 5183 HD2 ARG B 280 49.975 40.091 46.769 1.00 0.00 H ATOM 5184 HD3 ARG B 280 50.751 38.492 46.683 1.00 0.00 H ATOM 5185 HE ARG B 280 48.485 37.809 47.953 1.00 0.00 H ATOM 5186 HH12 ARG B 280 50.226 40.788 50.148 1.00 0.00 H ATOM 5187 HH11 ARG B 280 50.605 40.643 48.393 1.00 0.00 H ATOM 5188 HH22 ARG B 280 48.781 39.321 51.141 1.00 0.00 H ATOM 5189 HH21 ARG B 280 48.010 38.010 50.175 1.00 0.00 H ATOM 5190 H ARG B 280 47.524 41.742 44.795 1.00 0.00 H ATOM 5191 N ILE B 281 44.630 39.831 44.395 1.00 49.35 N ATOM 5192 CA ILE B 281 43.239 39.423 44.165 1.00 48.45 C ATOM 5193 C ILE B 281 42.889 39.510 42.675 1.00 47.86 C ATOM 5194 O ILE B 281 42.379 38.551 42.099 1.00 47.51 O ATOM 5195 CB ILE B 281 42.239 40.232 45.034 1.00 48.31 C ATOM 5196 CG1 ILE B 281 42.448 39.903 46.518 1.00 48.60 C ATOM 5197 CG2 ILE B 281 40.795 39.952 44.616 1.00 47.54 C ATOM 5198 CD1 ILE B 281 41.687 40.803 47.478 1.00 48.26 C ATOM 5199 HA ILE B 281 43.148 38.382 44.476 1.00 0.00 H ATOM 5200 HB ILE B 281 42.428 41.294 44.879 1.00 0.00 H ATOM 5201 HG12 ILE B 281 42.127 38.875 46.687 1.00 0.00 H ATOM 5202 HG13 ILE B 281 43.512 39.991 46.740 1.00 0.00 H ATOM 5203 HD11 ILE B 281 42.004 41.836 47.334 1.00 0.00 H ATOM 5204 HD12 ILE B 281 40.618 40.719 47.282 1.00 0.00 H ATOM 5205 HD13 ILE B 281 41.895 40.497 48.503 1.00 0.00 H ATOM 5206 HG21 ILE B 281 40.659 40.235 43.572 1.00 0.00 H ATOM 5207 HG22 ILE B 281 40.583 38.890 44.737 1.00 0.00 H ATOM 5208 HG23 ILE B 281 40.118 40.533 45.242 1.00 0.00 H ATOM 5209 H ILE B 281 44.818 40.674 44.974 1.00 0.00 H ATOM 5210 N PHE B 282 43.196 40.655 42.067 1.00 47.29 N ATOM 5211 CA PHE B 282 43.025 40.878 40.626 1.00 46.98 C ATOM 5212 C PHE B 282 43.631 39.747 39.776 1.00 46.31 C ATOM 5213 O PHE B 282 42.958 39.200 38.900 1.00 46.00 O ATOM 5214 CB PHE B 282 43.620 42.240 40.237 1.00 47.15 C ATOM 5215 CG PHE B 282 43.480 42.583 38.777 1.00 48.24 C ATOM 5216 CD1 PHE B 282 42.286 43.090 38.280 1.00 48.64 C ATOM 5217 CD2 PHE B 282 44.556 42.416 37.904 1.00 49.38 C ATOM 5218 CE1 PHE B 282 42.156 43.410 36.935 1.00 49.85 C ATOM 5219 CE2 PHE B 282 44.437 42.737 36.555 1.00 49.87 C ATOM 5220 CZ PHE B 282 43.233 43.230 36.067 1.00 49.57 C ATOM 5221 HA PHE B 282 41.955 40.878 40.416 1.00 0.00 H ATOM 5222 HB2 PHE B 282 43.116 43.012 40.819 1.00 0.00 H ATOM 5223 HB3 PHE B 282 44.681 42.233 40.486 1.00 0.00 H ATOM 5224 HD2 PHE B 282 45.502 42.029 38.284 1.00 0.00 H ATOM 5225 HE2 PHE B 282 45.285 42.602 35.884 1.00 0.00 H ATOM 5226 HZ PHE B 282 43.131 43.475 35.010 1.00 0.00 H ATOM 5227 HE1 PHE B 282 41.212 43.802 36.557 1.00 0.00 H ATOM 5228 HD1 PHE B 282 41.442 43.238 38.953 1.00 0.00 H ATOM 5229 H PHE B 282 43.577 41.432 42.644 1.00 0.00 H ATOM 5230 N GLN B 283 44.886 39.396 40.068 1.00 45.51 N ATOM 5231 CA GLN B 283 45.619 38.337 39.368 1.00 44.82 C ATOM 5232 C GLN B 283 45.002 36.953 39.592 1.00 44.13 C ATOM 5233 O GLN B 283 45.005 36.110 38.695 1.00 44.01 O ATOM 5234 CB GLN B 283 47.095 38.336 39.800 1.00 45.22 C ATOM 5235 CG GLN B 283 47.908 39.574 39.355 1.00 46.10 C ATOM 5236 CD GLN B 283 49.252 39.736 40.089 1.00 48.50 C ATOM 5237 OE1 GLN B 283 49.462 39.202 41.190 1.00 49.10 O ATOM 5238 NE2 GLN B 283 50.161 40.489 39.480 1.00 47.87 N ATOM 5239 HA GLN B 283 45.552 38.551 38.301 1.00 0.00 H ATOM 5240 HB2 GLN B 283 47.129 38.282 40.888 1.00 0.00 H ATOM 5241 HB3 GLN B 283 47.570 37.450 39.379 1.00 0.00 H ATOM 5242 HG2 GLN B 283 48.108 39.487 38.287 1.00 0.00 H ATOM 5243 HG3 GLN B 283 47.307 40.464 39.540 1.00 0.00 H ATOM 5244 HE22 GLN B 283 49.947 40.919 38.558 1.00 0.00 H ATOM 5245 HE21 GLN B 283 51.087 40.648 39.925 1.00 0.00 H ATOM 5246 H GLN B 283 45.371 39.903 40.836 1.00 0.00 H ATOM 5247 N GLY B 284 44.483 36.720 40.795 1.00 43.32 N ATOM 5248 CA GLY B 284 43.788 35.474 41.111 1.00 41.91 C ATOM 5249 C GLY B 284 42.524 35.338 40.284 1.00 41.21 C ATOM 5250 O GLY B 284 42.178 34.240 39.853 1.00 41.13 O ATOM 5251 HA3 GLY B 284 43.526 35.469 42.169 1.00 0.00 H ATOM 5252 HA2 GLY B 284 44.447 34.633 40.898 1.00 0.00 H ATOM 5253 H GLY B 284 44.575 37.447 41.533 1.00 0.00 H ATOM 5254 N CYS B 285 41.845 36.461 40.054 1.00 40.42 N ATOM 5255 CA CYS B 285 40.652 36.487 39.215 1.00 40.21 C ATOM 5256 C CYS B 285 41.003 36.156 37.768 1.00 39.77 C ATOM 5257 O CYS B 285 40.243 35.481 37.085 1.00 39.79 O ATOM 5258 CB CYS B 285 39.944 37.840 39.314 1.00 40.33 C ATOM 5259 SG CYS B 285 39.113 38.100 40.907 1.00 41.16 S ATOM 5260 HA CYS B 285 39.964 35.724 39.578 1.00 0.00 H ATOM 5261 HB2 CYS B 285 39.199 37.900 38.521 1.00 0.00 H ATOM 5262 HB3 CYS B 285 40.684 38.629 39.176 1.00 0.00 H ATOM 5263 HG CYS B 285 40.044 38.041 41.924 1.00 0.00 H ATOM 5264 H CYS B 285 42.176 37.347 40.486 1.00 0.00 H ATOM 5265 N GLN B 286 42.170 36.624 37.327 1.00 39.26 N ATOM 5266 CA GLN B 286 42.697 36.325 36.004 1.00 39.05 C ATOM 5267 C GLN B 286 42.981 34.838 35.814 1.00 38.46 C ATOM 5268 O GLN B 286 42.655 34.266 34.773 1.00 38.38 O ATOM 5269 CB GLN B 286 43.961 37.142 35.737 1.00 39.31 C ATOM 5270 CG GLN B 286 43.693 38.581 35.338 1.00 41.31 C ATOM 5271 CD GLN B 286 44.962 39.395 35.213 1.00 45.67 C ATOM 5272 OE1 GLN B 286 45.660 39.639 36.203 1.00 48.97 O ATOM 5273 NE2 GLN B 286 45.271 39.824 33.995 1.00 46.22 N ATOM 5274 HA GLN B 286 41.928 36.602 35.283 1.00 0.00 H ATOM 5275 HB2 GLN B 286 44.566 37.144 36.644 1.00 0.00 H ATOM 5276 HB3 GLN B 286 44.517 36.661 34.932 1.00 0.00 H ATOM 5277 HG2 GLN B 286 43.178 38.587 34.378 1.00 0.00 H ATOM 5278 HG3 GLN B 286 43.056 39.040 36.094 1.00 0.00 H ATOM 5279 HE22 GLN B 286 44.653 39.594 33.190 1.00 0.00 H ATOM 5280 HE21 GLN B 286 46.131 40.390 33.846 1.00 0.00 H ATOM 5281 H GLN B 286 42.731 37.232 37.958 1.00 0.00 H ATOM 5282 N PHE B 287 43.587 34.223 36.827 1.00 37.63 N ATOM 5283 CA PHE B 287 43.880 32.803 36.816 1.00 36.58 C ATOM 5284 C PHE B 287 42.584 32.003 36.693 1.00 36.48 C ATOM 5285 O PHE B 287 42.497 31.078 35.878 1.00 35.86 O ATOM 5286 CB PHE B 287 44.641 32.405 38.092 1.00 36.37 C ATOM 5287 CG PHE B 287 45.078 30.961 38.118 1.00 35.06 C ATOM 5288 CD1 PHE B 287 44.184 29.951 38.467 1.00 33.37 C ATOM 5289 CD2 PHE B 287 46.385 30.615 37.799 1.00 34.03 C ATOM 5290 CE1 PHE B 287 44.578 28.618 38.488 1.00 33.63 C ATOM 5291 CE2 PHE B 287 46.792 29.286 37.828 1.00 34.56 C ATOM 5292 CZ PHE B 287 45.889 28.284 38.169 1.00 33.25 C ATOM 5293 HA PHE B 287 44.511 32.579 35.956 1.00 0.00 H ATOM 5294 HB2 PHE B 287 45.528 33.034 38.173 1.00 0.00 H ATOM 5295 HB3 PHE B 287 43.991 32.583 38.949 1.00 0.00 H ATOM 5296 HD2 PHE B 287 47.098 31.392 37.524 1.00 0.00 H ATOM 5297 HE2 PHE B 287 47.822 29.028 37.583 1.00 0.00 H ATOM 5298 HZ PHE B 287 46.208 27.242 38.186 1.00 0.00 H ATOM 5299 HE1 PHE B 287 43.863 27.839 38.753 1.00 0.00 H ATOM 5300 HD1 PHE B 287 43.158 30.210 38.728 1.00 0.00 H ATOM 5301 H PHE B 287 43.861 34.783 37.659 1.00 0.00 H ATOM 5302 N ARG B 288 41.583 32.360 37.504 1.00 36.48 N ATOM 5303 CA ARG B 288 40.297 31.668 37.468 1.00 36.37 C ATOM 5304 C ARG B 288 39.599 31.891 36.123 1.00 35.80 C ATOM 5305 O ARG B 288 38.958 30.976 35.597 1.00 35.25 O ATOM 5306 CB ARG B 288 39.362 32.057 38.632 1.00 36.89 C ATOM 5307 CG ARG B 288 39.968 32.317 40.040 1.00 39.82 C ATOM 5308 CD ARG B 288 40.881 31.231 40.664 1.00 43.53 C ATOM 5309 NE ARG B 288 40.312 29.882 40.737 1.00 46.53 N ATOM 5310 CZ ARG B 288 40.998 28.801 41.127 1.00 48.38 C ATOM 5311 NH1 ARG B 288 42.272 28.909 41.497 1.00 48.51 N ATOM 5312 NH2 ARG B 288 40.418 27.601 41.143 1.00 49.15 N ATOM 5313 HA ARG B 288 40.518 30.607 37.589 1.00 0.00 H ATOM 5314 HB2 ARG B 288 38.846 32.970 38.334 1.00 0.00 H ATOM 5315 HB3 ARG B 288 38.637 31.250 38.741 1.00 0.00 H ATOM 5316 HG2 ARG B 288 40.556 33.233 39.974 1.00 0.00 H ATOM 5317 HG3 ARG B 288 39.135 32.470 40.726 1.00 0.00 H ATOM 5318 HD2 ARG B 288 41.129 31.545 41.678 1.00 0.00 H ATOM 5319 HD3 ARG B 288 41.792 31.178 40.069 1.00 0.00 H ATOM 5320 HE ARG B 288 39.315 29.757 40.470 1.00 0.00 H ATOM 5321 HH12 ARG B 288 42.799 28.065 41.799 1.00 0.00 H ATOM 5322 HH11 ARG B 288 42.740 29.838 41.484 1.00 0.00 H ATOM 5323 HH22 ARG B 288 40.958 26.766 41.447 1.00 0.00 H ATOM 5324 HH21 ARG B 288 39.425 27.499 40.851 1.00 0.00 H ATOM 5325 H ARG B 288 41.722 33.144 38.173 1.00 0.00 H ATOM 5326 N SER B 289 39.741 33.099 35.570 1.00 35.59 N ATOM 5327 CA SER B 289 39.178 33.450 34.254 1.00 35.54 C ATOM 5328 C SER B 289 39.697 32.493 33.183 1.00 35.36 C ATOM 5329 O SER B 289 38.921 31.901 32.423 1.00 35.75 O ATOM 5330 CB SER B 289 39.529 34.902 33.895 1.00 35.94 C ATOM 5331 OG SER B 289 38.806 35.380 32.769 1.00 36.36 O ATOM 5332 HA SER B 289 38.093 33.358 34.302 1.00 0.00 H ATOM 5333 HB2 SER B 289 40.595 34.959 33.675 1.00 0.00 H ATOM 5334 HB3 SER B 289 39.302 35.538 34.751 1.00 0.00 H ATOM 5335 HG SER B 289 39.069 36.316 32.582 1.00 0.00 H ATOM 5336 H SER B 289 40.273 33.824 36.092 1.00 0.00 H ATOM 5337 N VAL B 290 41.015 32.312 33.172 1.00 34.98 N ATOM 5338 CA VAL B 290 41.694 31.397 32.262 1.00 34.08 C ATOM 5339 C VAL B 290 41.221 29.940 32.422 1.00 34.05 C ATOM 5340 O VAL B 290 41.065 29.233 31.427 1.00 33.73 O ATOM 5341 CB VAL B 290 43.232 31.558 32.385 1.00 34.04 C ATOM 5342 CG1 VAL B 290 43.963 30.418 31.722 1.00 33.09 C ATOM 5343 CG2 VAL B 290 43.677 32.900 31.775 1.00 33.62 C ATOM 5344 HA VAL B 290 41.418 31.668 31.243 1.00 0.00 H ATOM 5345 HB VAL B 290 43.484 31.544 33.445 1.00 0.00 H ATOM 5346 HG11 VAL B 290 43.675 29.479 32.195 1.00 0.00 H ATOM 5347 HG12 VAL B 290 43.703 30.388 30.664 1.00 0.00 H ATOM 5348 HG13 VAL B 290 45.038 30.566 31.829 1.00 0.00 H ATOM 5349 HG21 VAL B 290 43.398 32.929 30.722 1.00 0.00 H ATOM 5350 HG22 VAL B 290 43.189 33.718 32.305 1.00 0.00 H ATOM 5351 HG23 VAL B 290 44.758 32.999 31.868 1.00 0.00 H ATOM 5352 H VAL B 290 41.592 32.852 33.848 1.00 0.00 H ATOM 5353 N GLU B 291 40.971 29.499 33.656 1.00 33.68 N ATOM 5354 CA GLU B 291 40.398 28.162 33.879 1.00 33.69 C ATOM 5355 C GLU B 291 38.973 28.053 33.332 1.00 33.79 C ATOM 5356 O GLU B 291 38.591 27.017 32.772 1.00 34.00 O ATOM 5357 CB GLU B 291 40.353 27.814 35.357 1.00 33.36 C ATOM 5358 CG GLU B 291 41.673 27.625 36.041 1.00 34.44 C ATOM 5359 CD GLU B 291 41.469 27.131 37.457 1.00 35.47 C ATOM 5360 OE1 GLU B 291 40.882 27.892 38.252 1.00 36.56 O ATOM 5361 OE2 GLU B 291 41.873 25.988 37.771 1.00 35.11 O ATOM 5362 HA GLU B 291 41.050 27.468 33.349 1.00 0.00 H ATOM 5363 HB2 GLU B 291 39.826 28.618 35.871 1.00 0.00 H ATOM 5364 HB3 GLU B 291 39.790 26.887 35.462 1.00 0.00 H ATOM 5365 HG2 GLU B 291 42.263 26.895 35.487 1.00 0.00 H ATOM 5366 HG3 GLU B 291 42.204 28.576 36.066 1.00 0.00 H ATOM 5367 H GLU B 291 41.184 30.108 34.471 1.00 0.00 H ATOM 5368 N ALA B 292 38.188 29.115 33.528 1.00 33.64 N ATOM 5369 CA ALA B 292 36.798 29.168 33.068 1.00 33.89 C ATOM 5370 C ALA B 292 36.687 29.110 31.542 1.00 33.67 C ATOM 5371 O ALA B 292 35.793 28.446 31.008 1.00 33.64 O ATOM 5372 CB ALA B 292 36.085 30.418 33.627 1.00 33.86 C ATOM 5373 HA ALA B 292 36.298 28.280 33.455 1.00 0.00 H ATOM 5374 HB1 ALA B 292 36.095 30.384 34.716 1.00 0.00 H ATOM 5375 HB2 ALA B 292 36.604 31.314 33.286 1.00 0.00 H ATOM 5376 HB3 ALA B 292 35.055 30.436 33.272 1.00 0.00 H ATOM 5377 H ALA B 292 38.579 29.939 34.028 1.00 0.00 H ATOM 5378 N VAL B 293 37.606 29.779 30.849 1.00 33.45 N ATOM 5379 CA VAL B 293 37.649 29.735 29.382 1.00 33.50 C ATOM 5380 C VAL B 293 37.716 28.302 28.867 1.00 33.62 C ATOM 5381 O VAL B 293 36.961 27.931 27.965 1.00 33.48 O ATOM 5382 CB VAL B 293 38.820 30.559 28.815 1.00 33.81 C ATOM 5383 CG1 VAL B 293 38.959 30.367 27.301 1.00 33.88 C ATOM 5384 CG2 VAL B 293 38.638 32.033 29.155 1.00 33.70 C ATOM 5385 HA VAL B 293 36.720 30.185 29.031 1.00 0.00 H ATOM 5386 HB VAL B 293 39.740 30.201 29.277 1.00 0.00 H ATOM 5387 HG11 VAL B 293 39.140 29.314 27.085 1.00 0.00 H ATOM 5388 HG12 VAL B 293 38.040 30.688 26.810 1.00 0.00 H ATOM 5389 HG13 VAL B 293 39.795 30.963 26.936 1.00 0.00 H ATOM 5390 HG21 VAL B 293 37.705 32.392 28.721 1.00 0.00 H ATOM 5391 HG22 VAL B 293 38.607 32.154 30.238 1.00 0.00 H ATOM 5392 HG23 VAL B 293 39.473 32.604 28.748 1.00 0.00 H ATOM 5393 H VAL B 293 38.311 30.347 31.360 1.00 0.00 H ATOM 5394 N GLN B 294 38.594 27.491 29.463 1.00 33.54 N ATOM 5395 CA GLN B 294 38.777 26.105 29.031 1.00 33.17 C ATOM 5396 C GLN B 294 37.569 25.218 29.327 1.00 32.99 C ATOM 5397 O GLN B 294 37.250 24.316 28.550 1.00 32.38 O ATOM 5398 CB GLN B 294 40.058 25.506 29.625 1.00 33.48 C ATOM 5399 CG GLN B 294 41.345 26.218 29.155 1.00 34.55 C ATOM 5400 CD GLN B 294 41.411 26.422 27.637 1.00 35.37 C ATOM 5401 OE1 GLN B 294 40.962 25.577 26.861 1.00 34.73 O ATOM 5402 NE2 GLN B 294 41.998 27.540 27.215 1.00 36.88 N ATOM 5403 HA GLN B 294 38.877 26.135 27.946 1.00 0.00 H ATOM 5404 HB2 GLN B 294 40.001 25.577 30.711 1.00 0.00 H ATOM 5405 HB3 GLN B 294 40.117 24.458 29.333 1.00 0.00 H ATOM 5406 HG2 GLN B 294 41.395 27.194 29.637 1.00 0.00 H ATOM 5407 HG3 GLN B 294 42.203 25.619 29.461 1.00 0.00 H ATOM 5408 HE22 GLN B 294 42.364 28.228 27.904 1.00 0.00 H ATOM 5409 HE21 GLN B 294 42.091 27.726 26.196 1.00 0.00 H ATOM 5410 H GLN B 294 39.162 27.854 30.255 1.00 0.00 H ATOM 5411 N GLU B 295 36.893 25.487 30.440 1.00 32.89 N ATOM 5412 CA GLU B 295 35.679 24.759 30.787 1.00 32.92 C ATOM 5413 C GLU B 295 34.538 25.073 29.809 1.00 32.49 C ATOM 5414 O GLU B 295 33.846 24.153 29.334 1.00 32.27 O ATOM 5415 CB GLU B 295 35.266 25.066 32.222 1.00 33.28 C ATOM 5416 CG GLU B 295 36.258 24.561 33.268 1.00 35.78 C ATOM 5417 CD GLU B 295 35.906 25.021 34.683 1.00 39.66 C ATOM 5418 OE1 GLU B 295 35.037 25.909 34.838 1.00 41.64 O ATOM 5419 OE2 GLU B 295 36.500 24.489 35.643 1.00 42.00 O ATOM 5420 HA GLU B 295 35.892 23.693 30.709 1.00 0.00 H ATOM 5421 HB2 GLU B 295 35.172 26.147 32.330 1.00 0.00 H ATOM 5422 HB3 GLU B 295 34.300 24.598 32.410 1.00 0.00 H ATOM 5423 HG2 GLU B 295 36.264 23.471 33.246 1.00 0.00 H ATOM 5424 HG3 GLU B 295 37.251 24.934 33.016 1.00 0.00 H ATOM 5425 H GLU B 295 37.238 26.233 31.077 1.00 0.00 H ATOM 5426 N ILE B 296 34.359 26.362 29.509 1.00 31.75 N ATOM 5427 CA ILE B 296 33.373 26.827 28.521 1.00 31.28 C ATOM 5428 C ILE B 296 33.705 26.288 27.117 1.00 31.11 C ATOM 5429 O ILE B 296 32.822 25.820 26.388 1.00 30.52 O ATOM 5430 CB ILE B 296 33.280 28.375 28.514 1.00 31.16 C ATOM 5431 CG1 ILE B 296 32.737 28.878 29.862 1.00 30.69 C ATOM 5432 CG2 ILE B 296 32.389 28.867 27.377 1.00 31.18 C ATOM 5433 CD1 ILE B 296 33.127 30.311 30.205 1.00 28.04 C ATOM 5434 HA ILE B 296 32.398 26.435 28.810 1.00 0.00 H ATOM 5435 HB ILE B 296 34.283 28.774 28.359 1.00 0.00 H ATOM 5436 HG12 ILE B 296 31.649 28.818 29.835 1.00 0.00 H ATOM 5437 HG13 ILE B 296 33.116 28.224 30.647 1.00 0.00 H ATOM 5438 HD11 ILE B 296 34.213 30.390 30.251 1.00 0.00 H ATOM 5439 HD12 ILE B 296 32.745 30.984 29.437 1.00 0.00 H ATOM 5440 HD13 ILE B 296 32.701 30.581 31.171 1.00 0.00 H ATOM 5441 HG21 ILE B 296 32.803 28.538 26.424 1.00 0.00 H ATOM 5442 HG22 ILE B 296 31.386 28.458 27.500 1.00 0.00 H ATOM 5443 HG23 ILE B 296 32.343 29.956 27.398 1.00 0.00 H ATOM 5444 H ILE B 296 34.944 27.070 29.997 1.00 0.00 H ATOM 5445 N THR B 297 34.985 26.337 26.760 1.00 31.11 N ATOM 5446 CA THR B 297 35.462 25.819 25.480 1.00 31.30 C ATOM 5447 C THR B 297 35.112 24.343 25.326 1.00 31.72 C ATOM 5448 O THR B 297 34.624 23.926 24.265 1.00 31.69 O ATOM 5449 CB THR B 297 36.977 26.066 25.302 1.00 31.14 C ATOM 5450 OG1 THR B 297 37.191 27.471 25.125 1.00 32.07 O ATOM 5451 CG2 THR B 297 37.528 25.324 24.086 1.00 30.24 C ATOM 5452 HA THR B 297 34.952 26.365 24.686 1.00 0.00 H ATOM 5453 HB THR B 297 37.495 25.697 26.187 1.00 0.00 H ATOM 5454 HG1 THR B 297 36.860 27.957 25.922 1.00 0.00 H ATOM 5455 HG23 THR B 297 37.369 24.253 24.213 1.00 0.00 H ATOM 5456 HG21 THR B 297 37.012 25.666 23.189 1.00 0.00 H ATOM 5457 HG22 THR B 297 38.595 25.526 23.992 1.00 0.00 H ATOM 5458 H THR B 297 35.672 26.760 27.416 1.00 0.00 H ATOM 5459 N GLU B 298 35.307 23.575 26.398 1.00 32.21 N ATOM 5460 CA GLU B 298 34.968 22.158 26.380 1.00 33.53 C ATOM 5461 C GLU B 298 33.470 21.978 26.236 1.00 33.29 C ATOM 5462 O GLU B 298 33.028 21.137 25.458 1.00 33.79 O ATOM 5463 CB GLU B 298 35.471 21.402 27.624 1.00 33.83 C ATOM 5464 CG GLU B 298 35.261 19.886 27.487 1.00 37.40 C ATOM 5465 CD GLU B 298 35.063 19.143 28.809 1.00 41.45 C ATOM 5466 OE1 GLU B 298 35.766 19.439 29.797 1.00 44.00 O ATOM 5467 OE2 GLU B 298 34.210 18.229 28.850 1.00 43.78 O ATOM 5468 HA GLU B 298 35.478 21.727 25.518 1.00 0.00 H ATOM 5469 HB2 GLU B 298 36.535 21.602 27.754 1.00 0.00 H ATOM 5470 HB3 GLU B 298 34.926 21.757 28.499 1.00 0.00 H ATOM 5471 HG2 GLU B 298 34.378 19.720 26.869 1.00 0.00 H ATOM 5472 HG3 GLU B 298 36.135 19.466 26.989 1.00 0.00 H ATOM 5473 H GLU B 298 35.708 23.994 27.261 1.00 0.00 H ATOM 5474 N TYR B 299 32.696 22.754 26.998 1.00 33.22 N ATOM 5475 CA TYR B 299 31.238 22.722 26.888 1.00 32.86 C ATOM 5476 C TYR B 299 30.761 23.013 25.466 1.00 33.04 C ATOM 5477 O TYR B 299 29.894 22.307 24.946 1.00 33.47 O ATOM 5478 CB TYR B 299 30.573 23.694 27.873 1.00 32.60 C ATOM 5479 CG TYR B 299 29.063 23.682 27.775 1.00 32.25 C ATOM 5480 CD1 TYR B 299 28.344 22.532 28.103 1.00 30.85 C ATOM 5481 CD2 TYR B 299 28.351 24.807 27.342 1.00 31.44 C ATOM 5482 CE1 TYR B 299 26.975 22.490 28.015 1.00 30.08 C ATOM 5483 CE2 TYR B 299 26.949 24.775 27.257 1.00 31.33 C ATOM 5484 CZ TYR B 299 26.274 23.606 27.594 1.00 31.61 C ATOM 5485 OH TYR B 299 24.900 23.525 27.515 1.00 29.87 O ATOM 5486 HA TYR B 299 30.936 21.707 27.145 1.00 0.00 H ATOM 5487 HB3 TYR B 299 30.929 24.703 27.662 1.00 0.00 H ATOM 5488 HB2 TYR B 299 30.859 23.414 28.887 1.00 0.00 H ATOM 5489 HD2 TYR B 299 28.889 25.715 27.069 1.00 0.00 H ATOM 5490 HE2 TYR B 299 26.396 25.656 26.931 1.00 0.00 H ATOM 5491 HE1 TYR B 299 26.440 21.577 28.277 1.00 0.00 H ATOM 5492 HD1 TYR B 299 28.883 21.645 28.437 1.00 0.00 H ATOM 5493 HH TYR B 299 24.496 24.203 28.113 1.00 0.00 H ATOM 5494 H TYR B 299 33.140 23.396 27.685 1.00 0.00 H ATOM 5495 N ALA B 300 31.328 24.044 24.844 1.00 33.18 N ATOM 5496 CA ALA B 300 30.922 24.466 23.499 1.00 33.60 C ATOM 5497 C ALA B 300 30.993 23.315 22.497 1.00 34.06 C ATOM 5498 O ALA B 300 30.081 23.126 21.700 1.00 33.97 O ATOM 5499 CB ALA B 300 31.765 25.640 23.032 1.00 33.27 C ATOM 5500 HA ALA B 300 29.881 24.784 23.554 1.00 0.00 H ATOM 5501 HB1 ALA B 300 31.635 26.475 23.720 1.00 0.00 H ATOM 5502 HB2 ALA B 300 32.814 25.346 23.010 1.00 0.00 H ATOM 5503 HB3 ALA B 300 31.448 25.938 22.032 1.00 0.00 H ATOM 5504 H ALA B 300 32.085 24.568 25.328 1.00 0.00 H ATOM 5505 N LYS B 301 32.062 22.526 22.586 1.00 34.93 N ATOM 5506 CA LYS B 301 32.278 21.379 21.708 1.00 35.70 C ATOM 5507 C LYS B 301 31.156 20.360 21.775 1.00 35.57 C ATOM 5508 O LYS B 301 30.875 19.689 20.786 1.00 35.92 O ATOM 5509 CB LYS B 301 33.630 20.717 21.997 1.00 36.29 C ATOM 5510 CG LYS B 301 34.823 21.592 21.622 1.00 37.84 C ATOM 5511 CD LYS B 301 36.117 20.794 21.644 1.00 42.34 C ATOM 5512 CE LYS B 301 37.256 21.579 21.011 1.00 43.94 C ATOM 5513 NZ LYS B 301 38.430 20.687 20.788 1.00 46.98 N ATOM 5514 HA LYS B 301 32.285 21.768 20.690 1.00 0.00 H ATOM 5515 HB2 LYS B 301 33.686 20.494 23.062 1.00 0.00 H ATOM 5516 HB3 LYS B 301 33.689 19.789 21.429 1.00 0.00 H ATOM 5517 HG2 LYS B 301 34.669 21.993 20.620 1.00 0.00 H ATOM 5518 HG3 LYS B 301 34.899 22.414 22.334 1.00 0.00 H ATOM 5519 HD2 LYS B 301 36.375 20.562 22.677 1.00 0.00 H ATOM 5520 HD3 LYS B 301 35.973 19.866 21.090 1.00 0.00 H ATOM 5521 HE2 LYS B 301 37.544 22.395 21.673 1.00 0.00 H ATOM 5522 HE3 LYS B 301 36.926 21.987 20.056 1.00 0.00 H ATOM 5523 HZ1 LYS B 301 38.747 20.299 21.699 1.00 0.00 H ATOM 5524 HZ2 LYS B 301 38.157 19.909 20.154 1.00 0.00 H ATOM 5525 HZ3 LYS B 301 39.202 21.234 20.355 1.00 0.00 H ATOM 5526 H LYS B 301 32.775 22.736 23.313 1.00 0.00 H ATOM 5527 N SER B 302 30.486 20.267 22.920 1.00 35.35 N ATOM 5528 CA SER B 302 29.357 19.351 23.051 1.00 35.01 C ATOM 5529 C SER B 302 28.050 19.874 22.434 1.00 34.73 C ATOM 5530 O SER B 302 27.105 19.113 22.279 1.00 34.81 O ATOM 5531 CB SER B 302 29.133 18.990 24.514 1.00 35.40 C ATOM 5532 OG SER B 302 28.437 20.038 25.172 1.00 37.67 O ATOM 5533 HA SER B 302 29.629 18.463 22.481 1.00 0.00 H ATOM 5534 HB2 SER B 302 30.097 18.836 25.000 1.00 0.00 H ATOM 5535 HB3 SER B 302 28.546 18.073 24.574 1.00 0.00 H ATOM 5536 HG SER B 302 28.970 20.871 25.119 1.00 0.00 H ATOM 5537 H SER B 302 30.769 20.853 23.731 1.00 0.00 H ATOM 5538 N ILE B 303 27.981 21.154 22.073 1.00 34.27 N ATOM 5539 CA ILE B 303 26.735 21.683 21.492 1.00 34.13 C ATOM 5540 C ILE B 303 26.532 21.182 20.060 1.00 33.89 C ATOM 5541 O ILE B 303 27.330 21.506 19.185 1.00 33.92 O ATOM 5542 CB ILE B 303 26.684 23.226 21.507 1.00 33.73 C ATOM 5543 CG1 ILE B 303 26.825 23.760 22.938 1.00 32.98 C ATOM 5544 CG2 ILE B 303 25.391 23.732 20.824 1.00 33.40 C ATOM 5545 CD1 ILE B 303 27.230 25.241 23.012 1.00 31.61 C ATOM 5546 HA ILE B 303 25.928 21.311 22.123 1.00 0.00 H ATOM 5547 HB ILE B 303 27.528 23.611 20.935 1.00 0.00 H ATOM 5548 HG12 ILE B 303 25.868 23.640 23.446 1.00 0.00 H ATOM 5549 HG13 ILE B 303 27.584 23.170 23.452 1.00 0.00 H ATOM 5550 HD11 ILE B 303 28.192 25.378 22.519 1.00 0.00 H ATOM 5551 HD12 ILE B 303 26.475 25.848 22.513 1.00 0.00 H ATOM 5552 HD13 ILE B 303 27.309 25.543 24.056 1.00 0.00 H ATOM 5553 HG21 ILE B 303 25.368 23.386 19.791 1.00 0.00 H ATOM 5554 HG22 ILE B 303 24.524 23.343 21.358 1.00 0.00 H ATOM 5555 HG23 ILE B 303 25.373 24.822 20.844 1.00 0.00 H ATOM 5556 H ILE B 303 28.803 21.778 22.201 1.00 0.00 H ATOM 5557 N PRO B 304 25.455 20.406 19.812 1.00 34.19 N ATOM 5558 CA PRO B 304 25.234 19.847 18.468 1.00 34.27 C ATOM 5559 C PRO B 304 25.434 20.891 17.381 1.00 34.19 C ATOM 5560 O PRO B 304 24.885 22.002 17.472 1.00 33.65 O ATOM 5561 CB PRO B 304 23.769 19.398 18.510 1.00 34.23 C ATOM 5562 CG PRO B 304 23.573 19.016 19.927 1.00 34.50 C ATOM 5563 CD PRO B 304 24.354 20.049 20.723 1.00 34.03 C ATOM 5564 HA PRO B 304 25.933 19.044 18.234 1.00 0.00 H ATOM 5565 HD3 PRO B 304 23.736 20.918 20.951 1.00 0.00 H ATOM 5566 HD2 PRO B 304 24.735 19.623 21.651 1.00 0.00 H ATOM 5567 HG3 PRO B 304 23.962 18.015 20.112 1.00 0.00 H ATOM 5568 HG2 PRO B 304 22.516 19.048 20.190 1.00 0.00 H ATOM 5569 HB2 PRO B 304 23.102 20.213 18.229 1.00 0.00 H ATOM 5570 HB3 PRO B 304 23.601 18.548 17.849 1.00 0.00 H ATOM 5571 N GLY B 305 26.253 20.531 16.393 1.00 33.95 N ATOM 5572 CA GLY B 305 26.576 21.402 15.271 1.00 34.03 C ATOM 5573 C GLY B 305 27.807 22.271 15.455 1.00 34.22 C ATOM 5574 O GLY B 305 28.410 22.689 14.472 1.00 34.24 O ATOM 5575 HA3 GLY B 305 25.723 22.059 15.098 1.00 0.00 H ATOM 5576 HA2 GLY B 305 26.734 20.775 14.393 1.00 0.00 H ATOM 5577 H GLY B 305 26.681 19.584 16.425 1.00 0.00 H ATOM 5578 N PHE B 306 28.191 22.545 16.705 1.00 34.37 N ATOM 5579 CA PHE B 306 29.278 23.504 16.975 1.00 34.23 C ATOM 5580 C PHE B 306 30.616 23.135 16.326 1.00 34.87 C ATOM 5581 O PHE B 306 31.270 24.004 15.719 1.00 34.94 O ATOM 5582 CB PHE B 306 29.467 23.765 18.485 1.00 33.93 C ATOM 5583 CG PHE B 306 30.561 24.773 18.798 1.00 32.51 C ATOM 5584 CD1 PHE B 306 30.285 26.137 18.819 1.00 29.85 C ATOM 5585 CD2 PHE B 306 31.871 24.350 19.050 1.00 31.03 C ATOM 5586 CE1 PHE B 306 31.292 27.073 19.092 1.00 30.82 C ATOM 5587 CE2 PHE B 306 32.894 25.278 19.322 1.00 30.61 C ATOM 5588 CZ PHE B 306 32.604 26.637 19.348 1.00 31.01 C ATOM 5589 HA PHE B 306 28.947 24.428 16.500 1.00 0.00 H ATOM 5590 HB2 PHE B 306 28.527 24.140 18.890 1.00 0.00 H ATOM 5591 HB3 PHE B 306 29.719 22.821 18.969 1.00 0.00 H ATOM 5592 HD2 PHE B 306 32.103 23.285 19.035 1.00 0.00 H ATOM 5593 HE2 PHE B 306 33.910 24.932 19.512 1.00 0.00 H ATOM 5594 HZ PHE B 306 33.389 27.361 19.566 1.00 0.00 H ATOM 5595 HE1 PHE B 306 31.058 28.138 19.106 1.00 0.00 H ATOM 5596 HD1 PHE B 306 29.271 26.483 18.620 1.00 0.00 H ATOM 5597 H PHE B 306 27.715 22.074 17.501 1.00 0.00 H ATOM 5598 N VAL B 307 31.034 21.873 16.457 1.00 35.50 N ATOM 5599 CA VAL B 307 32.334 21.461 15.907 1.00 36.74 C ATOM 5600 C VAL B 307 32.364 21.417 14.376 1.00 37.18 C ATOM 5601 O VAL B 307 33.424 21.514 13.768 1.00 37.20 O ATOM 5602 CB VAL B 307 32.928 20.177 16.565 1.00 37.25 C ATOM 5603 CG1 VAL B 307 33.334 20.466 18.019 1.00 37.08 C ATOM 5604 CG2 VAL B 307 31.970 18.992 16.488 1.00 37.16 C ATOM 5605 HA VAL B 307 33.014 22.264 16.193 1.00 0.00 H ATOM 5606 HB VAL B 307 33.817 19.897 15.999 1.00 0.00 H ATOM 5607 HG11 VAL B 307 34.085 21.256 18.035 1.00 0.00 H ATOM 5608 HG12 VAL B 307 32.457 20.784 18.583 1.00 0.00 H ATOM 5609 HG13 VAL B 307 33.747 19.562 18.466 1.00 0.00 H ATOM 5610 HG21 VAL B 307 31.044 19.241 17.006 1.00 0.00 H ATOM 5611 HG22 VAL B 307 31.754 18.768 15.443 1.00 0.00 H ATOM 5612 HG23 VAL B 307 32.430 18.123 16.959 1.00 0.00 H ATOM 5613 H VAL B 307 30.437 21.179 16.950 1.00 0.00 H ATOM 5614 N ASN B 308 31.188 21.338 13.763 1.00 37.91 N ATOM 5615 CA ASN B 308 31.071 21.316 12.310 1.00 38.45 C ATOM 5616 C ASN B 308 31.095 22.700 11.642 1.00 38.46 C ATOM 5617 O ASN B 308 31.130 22.808 10.415 1.00 38.74 O ATOM 5618 CB ASN B 308 29.832 20.522 11.916 1.00 38.68 C ATOM 5619 CG ASN B 308 29.890 19.096 12.417 1.00 40.85 C ATOM 5620 OD1 ASN B 308 30.756 18.322 12.015 1.00 43.35 O ATOM 5621 ND2 ASN B 308 28.979 18.744 13.316 1.00 43.83 N ATOM 5622 HA ASN B 308 31.967 20.824 11.931 1.00 0.00 H ATOM 5623 HB2 ASN B 308 28.953 21.008 12.339 1.00 0.00 H ATOM 5624 HB3 ASN B 308 29.752 20.510 10.829 1.00 0.00 H ATOM 5625 HD22 ASN B 308 28.264 19.431 13.628 1.00 0.00 H ATOM 5626 HD21 ASN B 308 28.980 17.781 13.708 1.00 0.00 H ATOM 5627 H ASN B 308 30.323 21.290 14.338 1.00 0.00 H ATOM 5628 N LEU B 309 31.091 23.751 12.454 1.00 38.34 N ATOM 5629 CA LEU B 309 31.259 25.108 11.961 1.00 38.21 C ATOM 5630 C LEU B 309 32.696 25.353 11.527 1.00 38.31 C ATOM 5631 O LEU B 309 33.630 24.756 12.073 1.00 38.79 O ATOM 5632 CB LEU B 309 30.899 26.123 13.056 1.00 38.11 C ATOM 5633 CG LEU B 309 29.487 26.082 13.654 1.00 38.80 C ATOM 5634 CD1 LEU B 309 29.430 26.927 14.944 1.00 37.20 C ATOM 5635 CD2 LEU B 309 28.434 26.534 12.620 1.00 38.10 C ATOM 5636 HA LEU B 309 30.595 25.233 11.105 1.00 0.00 H ATOM 5637 HB2 LEU B 309 31.601 25.975 13.877 1.00 0.00 H ATOM 5638 HB3 LEU B 309 31.041 27.118 12.633 1.00 0.00 H ATOM 5639 HG LEU B 309 29.248 25.052 13.920 1.00 0.00 H ATOM 5640 HD21 LEU B 309 28.651 27.555 12.305 1.00 0.00 H ATOM 5641 HD22 LEU B 309 28.467 25.871 11.756 1.00 0.00 H ATOM 5642 HD23 LEU B 309 27.443 26.495 13.072 1.00 0.00 H ATOM 5643 HD11 LEU B 309 30.138 26.527 15.670 1.00 0.00 H ATOM 5644 HD12 LEU B 309 29.690 27.960 14.712 1.00 0.00 H ATOM 5645 HD13 LEU B 309 28.422 26.889 15.358 1.00 0.00 H ATOM 5646 H LEU B 309 30.964 23.598 13.475 1.00 0.00 H ATOM 5647 N ASP B 310 32.857 26.231 10.542 1.00 38.02 N ATOM 5648 CA ASP B 310 34.136 26.842 10.195 1.00 38.27 C ATOM 5649 C ASP B 310 35.006 27.092 11.435 1.00 38.10 C ATOM 5650 O ASP B 310 34.565 27.724 12.401 1.00 38.21 O ATOM 5651 CB ASP B 310 33.863 28.163 9.466 1.00 38.43 C ATOM 5652 CG ASP B 310 35.123 28.876 9.042 1.00 40.02 C ATOM 5653 OD1 ASP B 310 35.431 28.840 7.840 1.00 41.34 O ATOM 5654 OD2 ASP B 310 35.796 29.501 9.893 1.00 43.32 O ATOM 5655 HA ASP B 310 34.687 26.157 9.551 1.00 0.00 H ATOM 5656 HB2 ASP B 310 33.267 27.953 8.578 1.00 0.00 H ATOM 5657 HB3 ASP B 310 33.301 28.818 10.132 1.00 0.00 H ATOM 5658 H ASP B 310 32.021 26.499 9.985 1.00 0.00 H ATOM 5659 N LEU B 311 36.247 26.608 11.387 1.00 37.71 N ATOM 5660 CA LEU B 311 37.162 26.653 12.526 1.00 37.02 C ATOM 5661 C LEU B 311 37.391 28.061 13.048 1.00 36.22 C ATOM 5662 O LEU B 311 37.448 28.266 14.261 1.00 35.74 O ATOM 5663 CB LEU B 311 38.506 25.994 12.174 1.00 37.23 C ATOM 5664 CG LEU B 311 38.534 24.477 11.977 1.00 38.11 C ATOM 5665 CD1 LEU B 311 39.640 24.056 10.981 1.00 38.10 C ATOM 5666 CD2 LEU B 311 38.703 23.769 13.304 1.00 39.19 C ATOM 5667 HA LEU B 311 36.682 26.090 13.326 1.00 0.00 H ATOM 5668 HB2 LEU B 311 38.857 26.448 11.247 1.00 0.00 H ATOM 5669 HB3 LEU B 311 39.203 26.229 12.978 1.00 0.00 H ATOM 5670 HG LEU B 311 37.577 24.179 11.549 1.00 0.00 H ATOM 5671 HD21 LEU B 311 39.640 24.083 13.765 1.00 0.00 H ATOM 5672 HD22 LEU B 311 37.870 24.025 13.959 1.00 0.00 H ATOM 5673 HD23 LEU B 311 38.720 22.692 13.140 1.00 0.00 H ATOM 5674 HD11 LEU B 311 39.456 24.527 10.015 1.00 0.00 H ATOM 5675 HD12 LEU B 311 40.611 24.373 11.362 1.00 0.00 H ATOM 5676 HD13 LEU B 311 39.630 22.972 10.866 1.00 0.00 H ATOM 5677 H LEU B 311 36.579 26.179 10.500 1.00 0.00 H ATOM 5678 N ASN B 312 37.525 29.023 12.137 1.00 35.46 N ATOM 5679 CA ASN B 312 37.673 30.426 12.520 1.00 35.03 C ATOM 5680 C ASN B 312 36.439 30.963 13.247 1.00 34.34 C ATOM 5681 O ASN B 312 36.568 31.748 14.191 1.00 34.26 O ATOM 5682 CB ASN B 312 37.979 31.298 11.309 1.00 35.39 C ATOM 5683 CG ASN B 312 39.233 30.861 10.584 1.00 36.33 C ATOM 5684 OD1 ASN B 312 40.337 31.207 10.979 1.00 37.54 O ATOM 5685 ND2 ASN B 312 39.062 30.109 9.509 1.00 36.45 N ATOM 5686 HA ASN B 312 38.514 30.469 13.212 1.00 0.00 H ATOM 5687 HB2 ASN B 312 37.138 31.244 10.618 1.00 0.00 H ATOM 5688 HB3 ASN B 312 38.108 32.328 11.643 1.00 0.00 H ATOM 5689 HD22 ASN B 312 38.103 29.839 9.210 1.00 0.00 H ATOM 5690 HD21 ASN B 312 39.887 29.788 8.963 1.00 0.00 H ATOM 5691 H ASN B 312 37.524 28.770 11.128 1.00 0.00 H ATOM 5692 N ASP B 313 35.254 30.533 12.812 1.00 33.41 N ATOM 5693 CA ASP B 313 34.008 30.947 13.454 1.00 32.92 C ATOM 5694 C ASP B 313 33.901 30.392 14.886 1.00 32.46 C ATOM 5695 O ASP B 313 33.502 31.110 15.801 1.00 32.25 O ATOM 5696 CB ASP B 313 32.795 30.573 12.594 1.00 32.68 C ATOM 5697 CG ASP B 313 32.590 31.530 11.430 1.00 33.06 C ATOM 5698 OD1 ASP B 313 33.359 32.515 11.320 1.00 33.36 O ATOM 5699 OD2 ASP B 313 31.644 31.318 10.636 1.00 32.31 O ATOM 5700 HA ASP B 313 34.018 32.034 13.540 1.00 0.00 H ATOM 5701 HB2 ASP B 313 32.943 29.568 12.199 1.00 0.00 H ATOM 5702 HB3 ASP B 313 31.903 30.588 13.221 1.00 0.00 H ATOM 5703 H ASP B 313 35.216 29.888 11.997 1.00 0.00 H ATOM 5704 N GLN B 314 34.289 29.135 15.078 1.00 31.74 N ATOM 5705 CA GLN B 314 34.358 28.550 16.424 1.00 31.57 C ATOM 5706 C GLN B 314 35.167 29.416 17.393 1.00 31.51 C ATOM 5707 O GLN B 314 34.712 29.711 18.504 1.00 31.27 O ATOM 5708 CB GLN B 314 34.980 27.156 16.375 1.00 31.24 C ATOM 5709 CG GLN B 314 34.188 26.139 15.564 1.00 30.65 C ATOM 5710 CD GLN B 314 34.750 24.740 15.733 1.00 31.22 C ATOM 5711 OE1 GLN B 314 35.229 24.385 16.811 1.00 30.56 O ATOM 5712 NE2 GLN B 314 34.707 23.938 14.663 1.00 31.75 N ATOM 5713 HA GLN B 314 33.332 28.491 16.788 1.00 0.00 H ATOM 5714 HB2 GLN B 314 35.974 27.242 15.936 1.00 0.00 H ATOM 5715 HB3 GLN B 314 35.066 26.785 17.396 1.00 0.00 H ATOM 5716 HG2 GLN B 314 33.151 26.148 15.899 1.00 0.00 H ATOM 5717 HG3 GLN B 314 34.231 26.414 14.510 1.00 0.00 H ATOM 5718 HE22 GLN B 314 34.293 24.281 13.773 1.00 0.00 H ATOM 5719 HE21 GLN B 314 35.088 22.972 14.722 1.00 0.00 H ATOM 5720 H GLN B 314 34.550 28.553 14.257 1.00 0.00 H ATOM 5721 N VAL B 315 36.366 29.810 16.957 1.00 30.96 N ATOM 5722 CA VAL B 315 37.289 30.612 17.755 1.00 30.94 C ATOM 5723 C VAL B 315 36.720 32.002 18.006 1.00 31.18 C ATOM 5724 O VAL B 315 36.886 32.565 19.097 1.00 31.08 O ATOM 5725 CB VAL B 315 38.682 30.723 17.057 1.00 31.10 C ATOM 5726 CG1 VAL B 315 39.524 31.895 17.612 1.00 30.04 C ATOM 5727 CG2 VAL B 315 39.433 29.411 17.160 1.00 30.40 C ATOM 5728 HA VAL B 315 37.421 30.109 18.713 1.00 0.00 H ATOM 5729 HB VAL B 315 38.503 30.939 16.004 1.00 0.00 H ATOM 5730 HG11 VAL B 315 38.990 32.832 17.453 1.00 0.00 H ATOM 5731 HG12 VAL B 315 39.691 31.747 18.679 1.00 0.00 H ATOM 5732 HG13 VAL B 315 40.483 31.929 17.094 1.00 0.00 H ATOM 5733 HG21 VAL B 315 39.581 29.160 18.210 1.00 0.00 H ATOM 5734 HG22 VAL B 315 38.855 28.624 16.675 1.00 0.00 H ATOM 5735 HG23 VAL B 315 40.401 29.508 16.668 1.00 0.00 H ATOM 5736 H VAL B 315 36.658 29.531 15.999 1.00 0.00 H ATOM 5737 N THR B 316 36.050 32.543 16.987 1.00 31.39 N ATOM 5738 CA THR B 316 35.389 33.848 17.076 1.00 31.38 C ATOM 5739 C THR B 316 34.247 33.850 18.113 1.00 31.05 C ATOM 5740 O THR B 316 34.184 34.744 18.954 1.00 31.14 O ATOM 5741 CB THR B 316 34.870 34.314 15.693 1.00 31.46 C ATOM 5742 OG1 THR B 316 35.986 34.642 14.850 1.00 32.17 O ATOM 5743 CG2 THR B 316 33.989 35.545 15.838 1.00 31.03 C ATOM 5744 HA THR B 316 36.143 34.558 17.416 1.00 0.00 H ATOM 5745 HB THR B 316 34.286 33.506 15.253 1.00 0.00 H ATOM 5746 HG1 THR B 316 35.654 34.940 13.966 1.00 0.00 H ATOM 5747 HG23 THR B 316 33.138 35.308 16.476 1.00 0.00 H ATOM 5748 HG21 THR B 316 34.567 36.353 16.286 1.00 0.00 H ATOM 5749 HG22 THR B 316 33.633 35.853 14.855 1.00 0.00 H ATOM 5750 H THR B 316 35.994 32.017 16.092 1.00 0.00 H ATOM 5751 N LEU B 317 33.368 32.850 18.038 1.00 30.36 N ATOM 5752 CA LEU B 317 32.254 32.699 18.968 1.00 30.15 C ATOM 5753 C LEU B 317 32.750 32.549 20.415 1.00 30.44 C ATOM 5754 O LEU B 317 32.191 33.155 21.332 1.00 30.18 O ATOM 5755 CB LEU B 317 31.372 31.499 18.582 1.00 29.67 C ATOM 5756 CG LEU B 317 30.654 31.503 17.220 1.00 29.31 C ATOM 5757 CD1 LEU B 317 29.942 30.198 16.972 1.00 26.60 C ATOM 5758 CD2 LEU B 317 29.673 32.668 17.097 1.00 29.07 C ATOM 5759 HA LEU B 317 31.653 33.606 18.906 1.00 0.00 H ATOM 5760 HB2 LEU B 317 32.009 30.615 18.604 1.00 0.00 H ATOM 5761 HB3 LEU B 317 30.602 31.410 19.348 1.00 0.00 H ATOM 5762 HG LEU B 317 31.425 31.629 16.460 1.00 0.00 H ATOM 5763 HD21 LEU B 317 28.919 32.591 17.881 1.00 0.00 H ATOM 5764 HD22 LEU B 317 30.213 33.609 17.202 1.00 0.00 H ATOM 5765 HD23 LEU B 317 29.189 32.632 16.121 1.00 0.00 H ATOM 5766 HD11 LEU B 317 30.666 29.383 16.980 1.00 0.00 H ATOM 5767 HD12 LEU B 317 29.201 30.035 17.755 1.00 0.00 H ATOM 5768 HD13 LEU B 317 29.446 30.235 16.002 1.00 0.00 H ATOM 5769 H LEU B 317 33.482 32.145 17.282 1.00 0.00 H ATOM 5770 N LEU B 318 33.803 31.756 20.611 1.00 30.40 N ATOM 5771 CA LEU B 318 34.375 31.591 21.940 1.00 30.97 C ATOM 5772 C LEU B 318 35.019 32.872 22.455 1.00 31.31 C ATOM 5773 O LEU B 318 34.767 33.273 23.586 1.00 31.32 O ATOM 5774 CB LEU B 318 35.358 30.417 21.986 1.00 30.81 C ATOM 5775 CG LEU B 318 34.636 29.071 21.922 1.00 30.96 C ATOM 5776 CD1 LEU B 318 35.633 27.931 21.774 1.00 29.66 C ATOM 5777 CD2 LEU B 318 33.741 28.860 23.152 1.00 30.71 C ATOM 5778 HA LEU B 318 33.548 31.360 22.611 1.00 0.00 H ATOM 5779 HB2 LEU B 318 36.039 30.493 21.139 1.00 0.00 H ATOM 5780 HB3 LEU B 318 35.927 30.469 22.914 1.00 0.00 H ATOM 5781 HG LEU B 318 33.993 29.078 21.042 1.00 0.00 H ATOM 5782 HD21 LEU B 318 34.353 28.884 24.054 1.00 0.00 H ATOM 5783 HD22 LEU B 318 32.995 29.653 23.197 1.00 0.00 H ATOM 5784 HD23 LEU B 318 33.242 27.894 23.075 1.00 0.00 H ATOM 5785 HD11 LEU B 318 36.206 28.068 20.857 1.00 0.00 H ATOM 5786 HD12 LEU B 318 36.309 27.928 22.629 1.00 0.00 H ATOM 5787 HD13 LEU B 318 35.096 26.984 21.731 1.00 0.00 H ATOM 5788 H LEU B 318 34.221 31.249 19.805 1.00 0.00 H ATOM 5789 N LYS B 319 35.812 33.518 21.608 1.00 31.53 N ATOM 5790 CA LYS B 319 36.491 34.766 21.948 1.00 32.53 C ATOM 5791 C LYS B 319 35.543 35.845 22.474 1.00 32.69 C ATOM 5792 O LYS B 319 35.834 36.488 23.483 1.00 31.78 O ATOM 5793 CB LYS B 319 37.231 35.300 20.722 1.00 32.86 C ATOM 5794 CG LYS B 319 37.818 36.681 20.887 1.00 34.99 C ATOM 5795 CD LYS B 319 38.667 37.048 19.669 1.00 39.56 C ATOM 5796 CE LYS B 319 39.662 38.166 19.989 1.00 41.33 C ATOM 5797 NZ LYS B 319 39.009 39.446 20.390 1.00 43.84 N ATOM 5798 HA LYS B 319 37.189 34.533 22.752 1.00 0.00 H ATOM 5799 HB2 LYS B 319 38.044 34.612 20.490 1.00 0.00 H ATOM 5800 HB3 LYS B 319 36.530 35.327 19.888 1.00 0.00 H ATOM 5801 HG2 LYS B 319 37.010 37.405 20.993 1.00 0.00 H ATOM 5802 HG3 LYS B 319 38.443 36.702 21.780 1.00 0.00 H ATOM 5803 HD2 LYS B 319 39.219 36.166 19.344 1.00 0.00 H ATOM 5804 HD3 LYS B 319 38.009 37.380 18.866 1.00 0.00 H ATOM 5805 HE2 LYS B 319 40.270 38.351 19.104 1.00 0.00 H ATOM 5806 HE3 LYS B 319 40.303 37.835 20.806 1.00 0.00 H ATOM 5807 HZ1 LYS B 319 38.401 39.781 19.616 1.00 0.00 H ATOM 5808 HZ2 LYS B 319 38.433 39.288 21.241 1.00 0.00 H ATOM 5809 HZ3 LYS B 319 39.740 40.158 20.592 1.00 0.00 H ATOM 5810 H LYS B 319 35.956 33.117 20.659 1.00 0.00 H ATOM 5811 N TYR B 320 34.426 36.047 21.773 1.00 32.44 N ATOM 5812 CA TYR B 320 33.490 37.104 22.136 1.00 32.83 C ATOM 5813 C TYR B 320 32.424 36.648 23.126 1.00 32.63 C ATOM 5814 O TYR B 320 31.704 37.467 23.663 1.00 33.14 O ATOM 5815 CB TYR B 320 32.838 37.719 20.888 1.00 32.86 C ATOM 5816 CG TYR B 320 33.786 38.558 20.071 1.00 33.86 C ATOM 5817 CD1 TYR B 320 34.348 38.059 18.895 1.00 34.60 C ATOM 5818 CD2 TYR B 320 34.142 39.842 20.482 1.00 34.83 C ATOM 5819 CE1 TYR B 320 35.237 38.819 18.147 1.00 35.27 C ATOM 5820 CE2 TYR B 320 35.030 40.613 19.739 1.00 36.20 C ATOM 5821 CZ TYR B 320 35.570 40.093 18.573 1.00 36.49 C ATOM 5822 OH TYR B 320 36.445 40.843 17.829 1.00 38.28 O ATOM 5823 HA TYR B 320 34.080 37.869 22.641 1.00 0.00 H ATOM 5824 HB3 TYR B 320 32.006 38.347 21.206 1.00 0.00 H ATOM 5825 HB2 TYR B 320 32.462 36.911 20.260 1.00 0.00 H ATOM 5826 HD2 TYR B 320 33.718 40.248 21.400 1.00 0.00 H ATOM 5827 HE2 TYR B 320 35.299 41.616 20.070 1.00 0.00 H ATOM 5828 HE1 TYR B 320 35.669 38.415 17.231 1.00 0.00 H ATOM 5829 HD1 TYR B 320 34.085 37.056 18.558 1.00 0.00 H ATOM 5830 HH TYR B 320 36.731 40.324 17.036 1.00 0.00 H ATOM 5831 H TYR B 320 34.220 35.440 20.954 1.00 0.00 H ATOM 5832 N GLY B 321 32.346 35.347 23.386 1.00 32.65 N ATOM 5833 CA GLY B 321 31.266 34.793 24.200 1.00 32.14 C ATOM 5834 C GLY B 321 31.645 34.460 25.633 1.00 32.05 C ATOM 5835 O GLY B 321 30.776 34.450 26.514 1.00 31.71 O ATOM 5836 HA3 GLY B 321 30.917 33.878 23.721 1.00 0.00 H ATOM 5837 HA2 GLY B 321 30.455 35.520 24.225 1.00 0.00 H ATOM 5838 H GLY B 321 33.071 34.708 23.001 1.00 0.00 H ATOM 5839 N VAL B 322 32.931 34.187 25.869 1.00 31.41 N ATOM 5840 CA VAL B 322 33.370 33.645 27.164 1.00 31.62 C ATOM 5841 C VAL B 322 33.059 34.546 28.346 1.00 31.53 C ATOM 5842 O VAL B 322 32.638 34.065 29.399 1.00 31.60 O ATOM 5843 CB VAL B 322 34.871 33.183 27.203 1.00 31.42 C ATOM 5844 CG1 VAL B 322 35.055 31.899 26.403 1.00 31.33 C ATOM 5845 CG2 VAL B 322 35.809 34.267 26.715 1.00 30.71 C ATOM 5846 HA VAL B 322 32.762 32.747 27.268 1.00 0.00 H ATOM 5847 HB VAL B 322 35.128 32.983 28.243 1.00 0.00 H ATOM 5848 HG11 VAL B 322 34.431 31.114 26.830 1.00 0.00 H ATOM 5849 HG12 VAL B 322 34.764 32.073 25.367 1.00 0.00 H ATOM 5850 HG13 VAL B 322 36.101 31.595 26.442 1.00 0.00 H ATOM 5851 HG21 VAL B 322 35.558 34.527 25.687 1.00 0.00 H ATOM 5852 HG22 VAL B 322 35.706 35.148 27.349 1.00 0.00 H ATOM 5853 HG23 VAL B 322 36.836 33.904 26.759 1.00 0.00 H ATOM 5854 H VAL B 322 33.635 34.361 25.123 1.00 0.00 H ATOM 5855 N HIS B 323 33.232 35.847 28.162 1.00 31.23 N ATOM 5856 CA HIS B 323 33.032 36.774 29.264 1.00 32.03 C ATOM 5857 C HIS B 323 31.561 36.908 29.657 1.00 31.84 C ATOM 5858 O HIS B 323 31.245 36.959 30.839 1.00 32.66 O ATOM 5859 CB HIS B 323 33.702 38.122 28.989 1.00 31.88 C ATOM 5860 CG HIS B 323 35.180 38.095 29.202 1.00 34.33 C ATOM 5861 ND1 HIS B 323 36.077 37.885 28.178 1.00 35.86 N ATOM 5862 CD2 HIS B 323 35.920 38.201 30.334 1.00 37.57 C ATOM 5863 CE1 HIS B 323 37.308 37.890 28.664 1.00 37.42 C ATOM 5864 NE2 HIS B 323 37.242 38.078 29.971 1.00 37.29 N ATOM 5865 HA HIS B 323 33.528 36.350 30.137 1.00 0.00 H ATOM 5866 HB2 HIS B 323 33.505 38.403 27.954 1.00 0.00 H ATOM 5867 HB3 HIS B 323 33.269 38.868 29.655 1.00 0.00 H ATOM 5868 HD2 HIS B 323 35.539 38.355 31.343 1.00 0.00 H ATOM 5869 HE1 HIS B 323 38.222 37.761 28.084 1.00 0.00 H ATOM 5870 H HIS B 323 33.512 36.206 27.227 1.00 0.00 H ATOM 5871 N GLU B 324 30.673 36.928 28.671 1.00 31.18 N ATOM 5872 CA GLU B 324 29.240 36.933 28.932 1.00 31.15 C ATOM 5873 C GLU B 324 28.833 35.715 29.774 1.00 30.79 C ATOM 5874 O GLU B 324 28.030 35.833 30.705 1.00 29.97 O ATOM 5875 CB GLU B 324 28.448 36.988 27.618 1.00 30.54 C ATOM 5876 CG GLU B 324 28.573 38.323 26.887 1.00 31.49 C ATOM 5877 CD GLU B 324 27.895 38.353 25.511 1.00 32.70 C ATOM 5878 OE1 GLU B 324 27.198 37.390 25.127 1.00 32.72 O ATOM 5879 OE2 GLU B 324 28.056 39.361 24.802 1.00 34.89 O ATOM 5880 HA GLU B 324 29.001 37.829 29.505 1.00 0.00 H ATOM 5881 HB2 GLU B 324 28.814 36.199 26.961 1.00 0.00 H ATOM 5882 HB3 GLU B 324 27.395 36.814 27.842 1.00 0.00 H ATOM 5883 HG2 GLU B 324 28.121 39.097 27.508 1.00 0.00 H ATOM 5884 HG3 GLU B 324 29.632 38.541 26.751 1.00 0.00 H ATOM 5885 H GLU B 324 31.009 36.940 27.687 1.00 0.00 H ATOM 5886 N ILE B 325 29.405 34.558 29.436 1.00 30.47 N ATOM 5887 CA ILE B 325 29.153 33.314 30.150 1.00 30.34 C ATOM 5888 C ILE B 325 29.809 33.315 31.539 1.00 30.75 C ATOM 5889 O ILE B 325 29.198 32.881 32.509 1.00 30.40 O ATOM 5890 CB ILE B 325 29.611 32.091 29.312 1.00 30.67 C ATOM 5891 CG1 ILE B 325 28.712 31.954 28.083 1.00 30.02 C ATOM 5892 CG2 ILE B 325 29.584 30.786 30.129 1.00 28.65 C ATOM 5893 CD1 ILE B 325 29.296 31.106 27.012 1.00 30.48 C ATOM 5894 HA ILE B 325 28.077 33.234 30.302 1.00 0.00 H ATOM 5895 HB ILE B 325 30.643 32.262 29.006 1.00 0.00 H ATOM 5896 HG12 ILE B 325 27.766 31.513 28.395 1.00 0.00 H ATOM 5897 HG13 ILE B 325 28.531 32.949 27.675 1.00 0.00 H ATOM 5898 HD11 ILE B 325 30.239 31.540 26.680 1.00 0.00 H ATOM 5899 HD12 ILE B 325 29.473 30.103 27.400 1.00 0.00 H ATOM 5900 HD13 ILE B 325 28.603 31.055 26.172 1.00 0.00 H ATOM 5901 HG21 ILE B 325 30.252 30.881 30.985 1.00 0.00 H ATOM 5902 HG22 ILE B 325 28.569 30.598 30.478 1.00 0.00 H ATOM 5903 HG23 ILE B 325 29.912 29.958 29.500 1.00 0.00 H ATOM 5904 H ILE B 325 30.059 34.544 28.628 1.00 0.00 H ATOM 5905 N ILE B 326 31.043 33.807 31.632 1.00 31.30 N ATOM 5906 CA ILE B 326 31.726 33.893 32.923 1.00 32.12 C ATOM 5907 C ILE B 326 30.898 34.716 33.910 1.00 32.53 C ATOM 5908 O ILE B 326 30.700 34.298 35.043 1.00 32.35 O ATOM 5909 CB ILE B 326 33.154 34.465 32.796 1.00 32.45 C ATOM 5910 CG1 ILE B 326 34.083 33.428 32.133 1.00 32.82 C ATOM 5911 CG2 ILE B 326 33.701 34.919 34.167 1.00 32.12 C ATOM 5912 CD1 ILE B 326 35.363 34.022 31.589 1.00 32.68 C ATOM 5913 HA ILE B 326 31.826 32.877 33.304 1.00 0.00 H ATOM 5914 HB ILE B 326 33.117 35.349 32.159 1.00 0.00 H ATOM 5915 HG12 ILE B 326 34.341 32.672 32.875 1.00 0.00 H ATOM 5916 HG13 ILE B 326 33.544 32.958 31.310 1.00 0.00 H ATOM 5917 HD11 ILE B 326 35.122 34.773 30.836 1.00 0.00 H ATOM 5918 HD12 ILE B 326 35.921 34.487 32.402 1.00 0.00 H ATOM 5919 HD13 ILE B 326 35.965 33.233 31.138 1.00 0.00 H ATOM 5920 HG21 ILE B 326 33.052 35.693 34.577 1.00 0.00 H ATOM 5921 HG22 ILE B 326 33.727 34.067 34.846 1.00 0.00 H ATOM 5922 HG23 ILE B 326 34.708 35.316 34.041 1.00 0.00 H ATOM 5923 H ILE B 326 31.529 34.135 30.773 1.00 0.00 H ATOM 5924 N TYR B 327 30.388 35.866 33.468 1.00 32.78 N ATOM 5925 CA TYR B 327 29.592 36.701 34.360 1.00 33.29 C ATOM 5926 C TYR B 327 28.248 36.084 34.689 1.00 33.25 C ATOM 5927 O TYR B 327 27.787 36.204 35.816 1.00 33.73 O ATOM 5928 CB TYR B 327 29.479 38.137 33.845 1.00 33.44 C ATOM 5929 CG TYR B 327 30.837 38.761 33.652 1.00 34.65 C ATOM 5930 CD1 TYR B 327 31.895 38.458 34.517 1.00 35.94 C ATOM 5931 CD2 TYR B 327 31.081 39.631 32.600 1.00 36.11 C ATOM 5932 CE1 TYR B 327 33.157 39.009 34.330 1.00 36.29 C ATOM 5933 CE2 TYR B 327 32.336 40.189 32.410 1.00 35.88 C ATOM 5934 CZ TYR B 327 33.364 39.876 33.277 1.00 35.84 C ATOM 5935 OH TYR B 327 34.598 40.445 33.086 1.00 37.61 O ATOM 5936 HA TYR B 327 30.130 36.754 35.307 1.00 0.00 H ATOM 5937 HB3 TYR B 327 28.916 38.729 34.566 1.00 0.00 H ATOM 5938 HB2 TYR B 327 28.952 38.131 32.891 1.00 0.00 H ATOM 5939 HD2 TYR B 327 30.273 39.880 31.912 1.00 0.00 H ATOM 5940 HE2 TYR B 327 32.510 40.872 31.579 1.00 0.00 H ATOM 5941 HE1 TYR B 327 33.974 38.759 35.007 1.00 0.00 H ATOM 5942 HD1 TYR B 327 31.726 37.778 35.352 1.00 0.00 H ATOM 5943 HH TYR B 327 34.518 41.430 33.143 1.00 0.00 H ATOM 5944 H TYR B 327 30.558 36.167 32.487 1.00 0.00 H ATOM 5945 N THR B 328 27.658 35.377 33.726 1.00 33.16 N ATOM 5946 CA THR B 328 26.431 34.619 33.947 1.00 33.24 C ATOM 5947 C THR B 328 26.579 33.568 35.045 1.00 33.47 C ATOM 5948 O THR B 328 25.788 33.524 35.989 1.00 33.10 O ATOM 5949 CB THR B 328 25.978 33.921 32.652 1.00 33.41 C ATOM 5950 OG1 THR B 328 25.759 34.910 31.639 1.00 34.26 O ATOM 5951 CG2 THR B 328 24.697 33.132 32.875 1.00 33.39 C ATOM 5952 HA THR B 328 25.682 35.343 34.266 1.00 0.00 H ATOM 5953 HB THR B 328 26.757 33.226 32.340 1.00 0.00 H ATOM 5954 HG1 THR B 328 26.601 35.404 31.475 1.00 0.00 H ATOM 5955 HG23 THR B 328 24.865 32.380 33.646 1.00 0.00 H ATOM 5956 HG21 THR B 328 23.905 33.810 33.193 1.00 0.00 H ATOM 5957 HG22 THR B 328 24.407 32.643 31.945 1.00 0.00 H ATOM 5958 H THR B 328 28.089 35.365 32.780 1.00 0.00 H ATOM 5959 N MET B 329 27.586 32.711 34.904 1.00 33.50 N ATOM 5960 CA MET B 329 27.787 31.598 35.823 1.00 33.73 C ATOM 5961 C MET B 329 28.334 32.044 37.175 1.00 33.46 C ATOM 5962 O MET B 329 28.109 31.390 38.185 1.00 33.03 O ATOM 5963 CB MET B 329 28.702 30.559 35.187 1.00 34.33 C ATOM 5964 CG MET B 329 28.125 29.999 33.885 1.00 35.06 C ATOM 5965 SD MET B 329 29.121 28.669 33.236 1.00 39.11 S ATOM 5966 CE MET B 329 28.761 27.400 34.449 1.00 36.86 C ATOM 5967 HA MET B 329 26.811 31.153 36.015 1.00 0.00 H ATOM 5968 HB2 MET B 329 29.665 31.023 34.973 1.00 0.00 H ATOM 5969 HB3 MET B 329 28.843 29.738 35.890 1.00 0.00 H ATOM 5970 HG2 MET B 329 28.080 30.799 33.146 1.00 0.00 H ATOM 5971 HG3 MET B 329 27.119 29.626 34.077 1.00 0.00 H ATOM 5972 HE1 MET B 329 29.068 27.745 35.436 1.00 0.00 H ATOM 5973 HE2 MET B 329 27.691 27.194 34.451 1.00 0.00 H ATOM 5974 HE3 MET B 329 29.306 26.491 34.195 1.00 0.00 H ATOM 5975 H MET B 329 28.250 32.839 34.114 1.00 0.00 H ATOM 5976 N LEU B 330 29.040 33.167 37.183 1.00 33.42 N ATOM 5977 CA LEU B 330 29.493 33.791 38.416 1.00 34.01 C ATOM 5978 C LEU B 330 28.309 34.117 39.348 1.00 33.92 C ATOM 5979 O LEU B 330 28.420 34.006 40.564 1.00 34.15 O ATOM 5980 CB LEU B 330 30.273 35.055 38.076 1.00 34.00 C ATOM 5981 CG LEU B 330 31.156 35.720 39.122 1.00 35.79 C ATOM 5982 CD1 LEU B 330 32.154 34.741 39.746 1.00 36.13 C ATOM 5983 CD2 LEU B 330 31.873 36.883 38.459 1.00 36.48 C ATOM 5984 HA LEU B 330 30.140 33.093 38.948 1.00 0.00 H ATOM 5985 HB2 LEU B 330 30.918 34.807 37.233 1.00 0.00 H ATOM 5986 HB3 LEU B 330 29.541 35.800 37.765 1.00 0.00 H ATOM 5987 HG LEU B 330 30.533 36.076 39.943 1.00 0.00 H ATOM 5988 HD21 LEU B 330 32.480 36.511 37.634 1.00 0.00 H ATOM 5989 HD22 LEU B 330 31.138 37.593 38.080 1.00 0.00 H ATOM 5990 HD23 LEU B 330 32.514 37.377 39.189 1.00 0.00 H ATOM 5991 HD11 LEU B 330 31.611 33.929 40.229 1.00 0.00 H ATOM 5992 HD12 LEU B 330 32.799 34.336 38.967 1.00 0.00 H ATOM 5993 HD13 LEU B 330 32.760 35.264 40.486 1.00 0.00 H ATOM 5994 H LEU B 330 29.278 33.617 36.276 1.00 0.00 H ATOM 5995 N ALA B 331 27.172 34.482 38.760 1.00 33.89 N ATOM 5996 CA ALA B 331 25.956 34.785 39.516 1.00 33.88 C ATOM 5997 C ALA B 331 25.522 33.586 40.350 1.00 34.20 C ATOM 5998 O ALA B 331 25.050 33.748 41.473 1.00 34.00 O ATOM 5999 CB ALA B 331 24.839 35.233 38.578 1.00 33.43 C ATOM 6000 HA ALA B 331 26.174 35.605 40.200 1.00 0.00 H ATOM 6001 HB1 ALA B 331 25.154 36.128 38.041 1.00 0.00 H ATOM 6002 HB2 ALA B 331 24.624 34.437 37.865 1.00 0.00 H ATOM 6003 HB3 ALA B 331 23.944 35.453 39.160 1.00 0.00 H ATOM 6004 H ALA B 331 27.147 34.555 37.723 1.00 0.00 H ATOM 6005 N SER B 332 25.715 32.388 39.795 1.00 34.42 N ATOM 6006 CA SER B 332 25.476 31.132 40.498 1.00 34.59 C ATOM 6007 C SER B 332 26.279 31.014 41.789 1.00 35.24 C ATOM 6008 O SER B 332 25.885 30.301 42.692 1.00 35.50 O ATOM 6009 CB SER B 332 25.857 29.948 39.603 1.00 34.51 C ATOM 6010 OG SER B 332 25.018 29.842 38.477 1.00 32.79 O ATOM 6011 HA SER B 332 24.415 31.120 40.746 1.00 0.00 H ATOM 6012 HB2 SER B 332 25.782 29.029 40.185 1.00 0.00 H ATOM 6013 HB3 SER B 332 26.885 30.080 39.264 1.00 0.00 H ATOM 6014 HG SER B 332 25.299 29.067 37.929 1.00 0.00 H ATOM 6015 H SER B 332 26.053 32.348 38.812 1.00 0.00 H ATOM 6016 N LEU B 333 27.423 31.683 41.858 1.00 36.08 N ATOM 6017 CA LEU B 333 28.304 31.548 43.007 1.00 36.76 C ATOM 6018 C LEU B 333 28.181 32.759 43.930 1.00 37.14 C ATOM 6019 O LEU B 333 28.948 32.888 44.887 1.00 37.37 O ATOM 6020 CB LEU B 333 29.763 31.370 42.551 1.00 36.78 C ATOM 6021 CG LEU B 333 30.141 30.246 41.574 1.00 37.16 C ATOM 6022 CD1 LEU B 333 31.646 30.031 41.507 1.00 35.74 C ATOM 6023 CD2 LEU B 333 29.470 28.967 41.957 1.00 38.77 C ATOM 6024 HA LEU B 333 28.002 30.660 43.563 1.00 0.00 H ATOM 6025 HB2 LEU B 333 30.060 32.307 42.080 1.00 0.00 H ATOM 6026 HB3 LEU B 333 30.356 31.214 43.452 1.00 0.00 H ATOM 6027 HG LEU B 333 29.799 30.555 40.586 1.00 0.00 H ATOM 6028 HD21 LEU B 333 29.782 28.681 42.962 1.00 0.00 H ATOM 6029 HD22 LEU B 333 28.389 29.105 41.936 1.00 0.00 H ATOM 6030 HD23 LEU B 333 29.752 28.185 41.252 1.00 0.00 H ATOM 6031 HD11 LEU B 333 32.128 30.950 41.173 1.00 0.00 H ATOM 6032 HD12 LEU B 333 32.018 29.763 42.496 1.00 0.00 H ATOM 6033 HD13 LEU B 333 31.866 29.227 40.804 1.00 0.00 H ATOM 6034 H LEU B 333 27.694 32.314 41.077 1.00 0.00 H ATOM 6035 N MET B 334 27.224 33.638 43.632 1.00 37.14 N ATOM 6036 CA MET B 334 27.036 34.878 44.381 1.00 37.72 C ATOM 6037 C MET B 334 25.701 34.941 45.118 1.00 38.26 C ATOM 6038 O MET B 334 24.715 34.320 44.720 1.00 37.92 O ATOM 6039 CB MET B 334 27.094 36.086 43.442 1.00 37.46 C ATOM 6040 CG MET B 334 28.478 36.608 43.110 1.00 37.56 C ATOM 6041 SD MET B 334 28.420 37.720 41.673 1.00 36.61 S ATOM 6042 CE MET B 334 29.965 38.565 41.871 1.00 34.17 C ATOM 6043 HA MET B 334 27.843 34.899 45.114 1.00 0.00 H ATOM 6044 HB2 MET B 334 26.611 35.804 42.506 1.00 0.00 H ATOM 6045 HB3 MET B 334 26.535 36.897 43.908 1.00 0.00 H ATOM 6046 HG2 MET B 334 29.133 35.767 42.885 1.00 0.00 H ATOM 6047 HG3 MET B 334 28.870 37.153 43.969 1.00 0.00 H ATOM 6048 HE1 MET B 334 29.975 39.082 42.831 1.00 0.00 H ATOM 6049 HE2 MET B 334 30.780 37.842 41.838 1.00 0.00 H ATOM 6050 HE3 MET B 334 30.088 39.289 41.065 1.00 0.00 H ATOM 6051 H MET B 334 26.587 33.433 42.836 1.00 0.00 H ATOM 6052 N ASN B 335 25.695 35.711 46.202 1.00 38.92 N ATOM 6053 CA ASN B 335 24.469 36.286 46.739 1.00 39.52 C ATOM 6054 C ASN B 335 24.765 37.771 46.909 1.00 40.06 C ATOM 6055 O ASN B 335 25.833 38.219 46.484 1.00 40.10 O ATOM 6056 CB ASN B 335 24.028 35.599 48.047 1.00 39.22 C ATOM 6057 CG ASN B 335 25.095 35.638 49.138 1.00 38.91 C ATOM 6058 OD1 ASN B 335 25.858 36.594 49.258 1.00 39.56 O ATOM 6059 ND2 ASN B 335 25.135 34.596 49.950 1.00 38.92 N ATOM 6060 HA ASN B 335 23.621 36.134 46.071 1.00 0.00 H ATOM 6061 HB2 ASN B 335 23.135 36.101 48.418 1.00 0.00 H ATOM 6062 HB3 ASN B 335 23.793 34.557 47.829 1.00 0.00 H ATOM 6063 HD22 ASN B 335 24.472 33.806 49.815 1.00 0.00 H ATOM 6064 HD21 ASN B 335 25.830 34.566 50.723 1.00 0.00 H ATOM 6065 H ASN B 335 26.596 35.909 46.683 1.00 0.00 H ATOM 6066 N LYS B 336 23.851 38.527 47.522 1.00 40.74 N ATOM 6067 CA LYS B 336 24.045 39.976 47.736 1.00 41.37 C ATOM 6068 C LYS B 336 25.194 40.342 48.688 1.00 41.03 C ATOM 6069 O LYS B 336 25.603 41.502 48.745 1.00 40.86 O ATOM 6070 CB LYS B 336 22.739 40.655 48.194 1.00 41.93 C ATOM 6071 CG LYS B 336 22.159 40.136 49.518 1.00 44.28 C ATOM 6072 CD LYS B 336 20.816 40.800 49.838 1.00 47.91 C ATOM 6073 CE LYS B 336 20.269 40.334 51.190 1.00 50.89 C ATOM 6074 NZ LYS B 336 18.963 40.999 51.543 1.00 53.60 N ATOM 6075 HA LYS B 336 24.337 40.359 46.758 1.00 0.00 H ATOM 6076 HB2 LYS B 336 22.935 41.721 48.307 1.00 0.00 H ATOM 6077 HB3 LYS B 336 21.990 40.505 47.416 1.00 0.00 H ATOM 6078 HG2 LYS B 336 22.013 39.058 49.444 1.00 0.00 H ATOM 6079 HG3 LYS B 336 22.862 40.352 50.322 1.00 0.00 H ATOM 6080 HD2 LYS B 336 20.952 41.881 49.864 1.00 0.00 H ATOM 6081 HD3 LYS B 336 20.099 40.544 49.058 1.00 0.00 H ATOM 6082 HE2 LYS B 336 21.001 40.568 51.963 1.00 0.00 H ATOM 6083 HE3 LYS B 336 20.114 39.256 51.152 1.00 0.00 H ATOM 6084 HZ1 LYS B 336 19.101 42.029 51.590 1.00 0.00 H ATOM 6085 HZ2 LYS B 336 18.254 40.776 50.815 1.00 0.00 H ATOM 6086 HZ3 LYS B 336 18.636 40.649 52.466 1.00 0.00 H ATOM 6087 H LYS B 336 22.974 38.081 47.860 1.00 0.00 H ATOM 6088 N ASP B 337 25.726 39.355 49.409 1.00 41.23 N ATOM 6089 CA ASP B 337 26.763 39.599 50.430 1.00 41.25 C ATOM 6090 C ASP B 337 28.151 39.021 50.114 1.00 41.19 C ATOM 6091 O ASP B 337 29.108 39.276 50.852 1.00 41.03 O ATOM 6092 CB ASP B 337 26.292 39.076 51.794 1.00 41.63 C ATOM 6093 CG ASP B 337 25.045 39.779 52.292 1.00 41.18 C ATOM 6094 OD1 ASP B 337 25.084 41.010 52.452 1.00 40.64 O ATOM 6095 OD2 ASP B 337 24.030 39.094 52.520 1.00 41.75 O ATOM 6096 HA ASP B 337 26.893 40.681 50.441 1.00 0.00 H ATOM 6097 HB2 ASP B 337 26.080 38.011 51.705 1.00 0.00 H ATOM 6098 HB3 ASP B 337 27.091 39.226 52.520 1.00 0.00 H ATOM 6099 H ASP B 337 25.399 38.381 49.247 1.00 0.00 H ATOM 6100 N GLY B 338 28.266 38.235 49.043 1.00 40.98 N ATOM 6101 CA GLY B 338 29.583 37.733 48.628 1.00 40.68 C ATOM 6102 C GLY B 338 29.623 36.668 47.548 1.00 40.30 C ATOM 6103 O GLY B 338 28.587 36.254 47.030 1.00 40.00 O ATOM 6104 HA3 GLY B 338 30.067 37.319 49.512 1.00 0.00 H ATOM 6105 HA2 GLY B 338 30.158 38.586 48.266 1.00 0.00 H ATOM 6106 H GLY B 338 27.419 37.976 48.498 1.00 0.00 H ATOM 6107 N VAL B 339 30.840 36.215 47.236 1.00 40.34 N ATOM 6108 CA VAL B 339 31.090 35.259 46.152 1.00 40.37 C ATOM 6109 C VAL B 339 31.938 34.071 46.611 1.00 40.68 C ATOM 6110 O VAL B 339 32.947 34.238 47.298 1.00 40.68 O ATOM 6111 CB VAL B 339 31.751 35.956 44.930 1.00 40.05 C ATOM 6112 CG1 VAL B 339 33.099 36.576 45.310 1.00 39.73 C ATOM 6113 CG2 VAL B 339 31.893 34.991 43.750 1.00 39.92 C ATOM 6114 HA VAL B 339 30.118 34.870 45.848 1.00 0.00 H ATOM 6115 HB VAL B 339 31.093 36.766 44.613 1.00 0.00 H ATOM 6116 HG11 VAL B 339 32.948 37.317 46.095 1.00 0.00 H ATOM 6117 HG12 VAL B 339 33.768 35.795 45.670 1.00 0.00 H ATOM 6118 HG13 VAL B 339 33.536 37.056 44.435 1.00 0.00 H ATOM 6119 HG21 VAL B 339 32.514 34.146 44.046 1.00 0.00 H ATOM 6120 HG22 VAL B 339 30.907 34.633 43.455 1.00 0.00 H ATOM 6121 HG23 VAL B 339 32.359 35.510 42.912 1.00 0.00 H ATOM 6122 H VAL B 339 31.651 36.557 47.789 1.00 0.00 H ATOM 6123 N LEU B 340 31.510 32.869 46.242 1.00 41.25 N ATOM 6124 CA LEU B 340 32.282 31.667 46.514 1.00 41.65 C ATOM 6125 C LEU B 340 33.513 31.662 45.621 1.00 42.62 C ATOM 6126 O LEU B 340 33.416 31.941 44.420 1.00 42.81 O ATOM 6127 CB LEU B 340 31.451 30.423 46.249 1.00 41.27 C ATOM 6128 CG LEU B 340 30.275 30.078 47.162 1.00 41.32 C ATOM 6129 CD1 LEU B 340 29.507 28.923 46.558 1.00 41.00 C ATOM 6130 CD2 LEU B 340 30.735 29.722 48.564 1.00 40.53 C ATOM 6131 HA LEU B 340 32.579 31.662 47.563 1.00 0.00 H ATOM 6132 HB2 LEU B 340 31.048 30.523 45.241 1.00 0.00 H ATOM 6133 HB3 LEU B 340 32.135 29.575 46.283 1.00 0.00 H ATOM 6134 HG LEU B 340 29.633 30.955 47.245 1.00 0.00 H ATOM 6135 HD21 LEU B 340 31.399 28.859 48.519 1.00 0.00 H ATOM 6136 HD22 LEU B 340 31.268 30.569 48.996 1.00 0.00 H ATOM 6137 HD23 LEU B 340 29.868 29.484 49.180 1.00 0.00 H ATOM 6138 HD11 LEU B 340 29.138 29.209 45.573 1.00 0.00 H ATOM 6139 HD12 LEU B 340 30.166 28.060 46.463 1.00 0.00 H ATOM 6140 HD13 LEU B 340 28.666 28.670 47.204 1.00 0.00 H ATOM 6141 H LEU B 340 30.600 32.785 45.746 1.00 0.00 H ATOM 6142 N ILE B 341 34.669 31.374 46.212 1.00 43.26 N ATOM 6143 CA ILE B 341 35.925 31.356 45.469 1.00 44.18 C ATOM 6144 C ILE B 341 36.607 29.997 45.578 1.00 45.13 C ATOM 6145 O ILE B 341 36.277 29.186 46.457 1.00 44.93 O ATOM 6146 CB ILE B 341 36.895 32.471 45.934 1.00 44.07 C ATOM 6147 CG1 ILE B 341 37.401 32.194 47.359 1.00 43.76 C ATOM 6148 CG2 ILE B 341 36.222 33.839 45.820 1.00 43.86 C ATOM 6149 CD1 ILE B 341 38.522 33.108 47.818 1.00 42.54 C ATOM 6150 HA ILE B 341 35.673 31.545 44.426 1.00 0.00 H ATOM 6151 HB ILE B 341 37.767 32.477 45.280 1.00 0.00 H ATOM 6152 HG12 ILE B 341 36.563 32.311 48.047 1.00 0.00 H ATOM 6153 HG13 ILE B 341 37.762 31.166 47.399 1.00 0.00 H ATOM 6154 HD11 ILE B 341 39.376 32.996 47.150 1.00 0.00 H ATOM 6155 HD12 ILE B 341 38.177 34.142 47.799 1.00 0.00 H ATOM 6156 HD13 ILE B 341 38.815 32.840 48.833 1.00 0.00 H ATOM 6157 HG21 ILE B 341 35.942 34.019 44.782 1.00 0.00 H ATOM 6158 HG22 ILE B 341 35.330 33.857 46.447 1.00 0.00 H ATOM 6159 HG23 ILE B 341 36.916 34.612 46.150 1.00 0.00 H ATOM 6160 H ILE B 341 34.678 31.156 47.229 1.00 0.00 H ATOM 6161 N SER B 342 37.536 29.750 44.661 1.00 46.17 N ATOM 6162 CA SER B 342 38.391 28.570 44.706 1.00 47.86 C ATOM 6163 C SER B 342 37.635 27.252 44.946 1.00 48.37 C ATOM 6164 O SER B 342 37.851 26.584 45.961 1.00 48.59 O ATOM 6165 CB SER B 342 39.486 28.778 45.761 1.00 47.70 C ATOM 6166 OG SER B 342 40.266 27.607 45.900 1.00 50.61 O ATOM 6167 HA SER B 342 38.835 28.463 43.716 1.00 0.00 H ATOM 6168 HB2 SER B 342 39.022 29.017 46.718 1.00 0.00 H ATOM 6169 HB3 SER B 342 40.128 29.603 45.454 1.00 0.00 H ATOM 6170 HG SER B 342 39.685 26.856 46.181 1.00 0.00 H ATOM 6171 H SER B 342 37.658 30.425 43.880 1.00 0.00 H ATOM 6172 N GLU B 343 36.748 26.897 44.012 1.00 49.11 N ATOM 6173 CA GLU B 343 35.975 25.636 44.057 1.00 50.16 C ATOM 6174 C GLU B 343 34.975 25.573 45.231 1.00 49.83 C ATOM 6175 O GLU B 343 34.497 24.498 45.614 1.00 50.13 O ATOM 6176 CB GLU B 343 36.919 24.406 44.013 1.00 50.53 C ATOM 6177 CG GLU B 343 36.264 23.019 44.216 1.00 53.20 C ATOM 6178 CD GLU B 343 35.629 22.417 42.953 1.00 56.70 C ATOM 6179 OE1 GLU B 343 35.855 22.945 41.837 1.00 58.10 O ATOM 6180 OE2 GLU B 343 34.906 21.396 43.087 1.00 57.25 O ATOM 6181 HA GLU B 343 35.357 25.612 43.159 1.00 0.00 H ATOM 6182 HB2 GLU B 343 37.410 24.401 43.040 1.00 0.00 H ATOM 6183 HB3 GLU B 343 37.667 24.536 44.795 1.00 0.00 H ATOM 6184 HG2 GLU B 343 37.030 22.330 44.572 1.00 0.00 H ATOM 6185 HG3 GLU B 343 35.486 23.118 44.973 1.00 0.00 H ATOM 6186 H GLU B 343 36.593 27.541 43.211 1.00 0.00 H ATOM 6187 N GLY B 344 34.646 26.735 45.781 1.00 49.68 N ATOM 6188 CA GLY B 344 33.707 26.817 46.891 1.00 49.43 C ATOM 6189 C GLY B 344 34.335 26.511 48.239 1.00 49.41 C ATOM 6190 O GLY B 344 33.628 26.385 49.239 1.00 49.33 O ATOM 6191 HA3 GLY B 344 32.902 26.104 46.715 1.00 0.00 H ATOM 6192 HA2 GLY B 344 33.297 27.826 46.922 1.00 0.00 H ATOM 6193 H GLY B 344 35.070 27.609 45.410 1.00 0.00 H ATOM 6194 N GLN B 345 35.663 26.393 48.271 1.00 49.29 N ATOM 6195 CA GLN B 345 36.389 26.224 49.527 1.00 49.36 C ATOM 6196 C GLN B 345 36.432 27.553 50.283 1.00 48.69 C ATOM 6197 O GLN B 345 36.728 27.579 51.478 1.00 48.86 O ATOM 6198 CB GLN B 345 37.812 25.685 49.291 1.00 49.71 C ATOM 6199 CG GLN B 345 37.896 24.219 48.845 1.00 51.70 C ATOM 6200 CD GLN B 345 37.958 23.230 50.009 1.00 55.65 C ATOM 6201 OE1 GLN B 345 38.962 23.152 50.728 1.00 56.86 O ATOM 6202 NE2 GLN B 345 36.886 22.454 50.187 1.00 56.46 N ATOM 6203 HA GLN B 345 35.860 25.486 50.130 1.00 0.00 H ATOM 6204 HB2 GLN B 345 38.281 26.298 48.521 1.00 0.00 H ATOM 6205 HB3 GLN B 345 38.369 25.786 50.223 1.00 0.00 H ATOM 6206 HG2 GLN B 345 37.016 23.990 48.244 1.00 0.00 H ATOM 6207 HG3 GLN B 345 38.792 24.094 48.237 1.00 0.00 H ATOM 6208 HE22 GLN B 345 36.063 22.553 49.559 1.00 0.00 H ATOM 6209 HE21 GLN B 345 36.874 21.751 50.953 1.00 0.00 H ATOM 6210 H GLN B 345 36.196 26.422 47.378 1.00 0.00 H ATOM 6211 N GLY B 346 36.116 28.647 49.586 1.00 47.78 N ATOM 6212 CA GLY B 346 36.149 29.983 50.177 1.00 46.68 C ATOM 6213 C GLY B 346 34.923 30.854 49.947 1.00 45.96 C ATOM 6214 O GLY B 346 34.027 30.511 49.180 1.00 45.73 O ATOM 6215 HA3 GLY B 346 37.011 30.507 49.765 1.00 0.00 H ATOM 6216 HA2 GLY B 346 36.277 29.867 51.253 1.00 0.00 H ATOM 6217 H GLY B 346 35.837 28.545 48.589 1.00 0.00 H ATOM 6218 N PHE B 347 34.891 31.989 50.633 1.00 45.48 N ATOM 6219 CA PHE B 347 33.826 32.969 50.483 1.00 45.29 C ATOM 6220 C PHE B 347 34.372 34.358 50.740 1.00 45.21 C ATOM 6221 O PHE B 347 34.734 34.702 51.863 1.00 45.32 O ATOM 6222 CB PHE B 347 32.650 32.672 51.426 1.00 45.37 C ATOM 6223 CG PHE B 347 31.478 33.604 51.245 1.00 45.47 C ATOM 6224 CD1 PHE B 347 30.568 33.411 50.200 1.00 46.15 C ATOM 6225 CD2 PHE B 347 31.287 34.678 52.109 1.00 44.88 C ATOM 6226 CE1 PHE B 347 29.482 34.279 50.031 1.00 46.00 C ATOM 6227 CE2 PHE B 347 30.207 35.552 51.946 1.00 45.22 C ATOM 6228 CZ PHE B 347 29.303 35.349 50.908 1.00 45.97 C ATOM 6229 HA PHE B 347 33.449 32.911 49.462 1.00 0.00 H ATOM 6230 HB2 PHE B 347 32.311 31.652 51.243 1.00 0.00 H ATOM 6231 HB3 PHE B 347 33.003 32.757 52.454 1.00 0.00 H ATOM 6232 HD2 PHE B 347 31.990 34.841 52.926 1.00 0.00 H ATOM 6233 HE2 PHE B 347 30.074 36.390 52.630 1.00 0.00 H ATOM 6234 HZ PHE B 347 28.457 36.024 50.780 1.00 0.00 H ATOM 6235 HE1 PHE B 347 28.777 34.119 49.215 1.00 0.00 H ATOM 6236 HD1 PHE B 347 30.705 32.578 49.511 1.00 0.00 H ATOM 6237 H PHE B 347 35.659 32.187 51.306 1.00 0.00 H ATOM 6238 N MET B 348 34.439 35.154 49.687 1.00 45.33 N ATOM 6239 CA MET B 348 34.920 36.519 49.800 1.00 45.44 C ATOM 6240 C MET B 348 33.715 37.465 49.808 1.00 45.24 C ATOM 6241 O MET B 348 32.832 37.359 48.955 1.00 44.95 O ATOM 6242 CB MET B 348 35.877 36.833 48.649 1.00 45.55 C ATOM 6243 CG MET B 348 36.691 38.096 48.838 1.00 46.40 C ATOM 6244 SD MET B 348 37.947 38.274 47.571 1.00 48.39 S ATOM 6245 CE MET B 348 39.191 37.106 48.119 1.00 47.18 C ATOM 6246 HA MET B 348 35.474 36.651 50.729 1.00 0.00 H ATOM 6247 HB2 MET B 348 36.567 35.996 48.541 1.00 0.00 H ATOM 6248 HB3 MET B 348 35.290 36.939 47.737 1.00 0.00 H ATOM 6249 HG2 MET B 348 37.176 38.061 49.814 1.00 0.00 H ATOM 6250 HG3 MET B 348 36.023 38.956 48.796 1.00 0.00 H ATOM 6251 HE1 MET B 348 39.541 37.389 49.112 1.00 0.00 H ATOM 6252 HE2 MET B 348 38.758 36.106 48.156 1.00 0.00 H ATOM 6253 HE3 MET B 348 40.028 37.115 47.421 1.00 0.00 H ATOM 6254 H MET B 348 34.141 34.795 48.758 1.00 0.00 H ATOM 6255 N THR B 349 33.680 38.372 50.784 1.00 45.09 N ATOM 6256 CA THR B 349 32.511 39.229 50.991 1.00 45.21 C ATOM 6257 C THR B 349 32.468 40.373 49.997 1.00 45.45 C ATOM 6258 O THR B 349 33.510 40.832 49.507 1.00 45.16 O ATOM 6259 CB THR B 349 32.426 39.808 52.434 1.00 45.00 C ATOM 6260 OG1 THR B 349 33.493 40.744 52.650 1.00 44.71 O ATOM 6261 CG2 THR B 349 32.497 38.699 53.463 1.00 44.87 C ATOM 6262 HA THR B 349 31.651 38.578 50.835 1.00 0.00 H ATOM 6263 HB THR B 349 31.470 40.320 52.544 1.00 0.00 H ATOM 6264 HG1 THR B 349 33.419 41.484 51.996 1.00 0.00 H ATOM 6265 HG23 THR B 349 31.684 37.994 53.292 1.00 0.00 H ATOM 6266 HG21 THR B 349 33.453 38.183 53.373 1.00 0.00 H ATOM 6267 HG22 THR B 349 32.405 39.126 54.462 1.00 0.00 H ATOM 6268 H THR B 349 34.502 38.473 51.413 1.00 0.00 H ATOM 6269 N ARG B 350 31.251 40.827 49.707 1.00 45.97 N ATOM 6270 CA ARG B 350 31.041 41.973 48.836 1.00 46.58 C ATOM 6271 C ARG B 350 31.699 43.240 49.401 1.00 47.35 C ATOM 6272 O ARG B 350 32.276 44.024 48.640 1.00 47.21 O ATOM 6273 CB ARG B 350 29.547 42.189 48.622 1.00 46.40 C ATOM 6274 CG ARG B 350 29.195 43.188 47.533 1.00 45.96 C ATOM 6275 CD ARG B 350 27.694 43.263 47.379 1.00 44.58 C ATOM 6276 NE ARG B 350 27.275 44.198 46.343 1.00 44.71 N ATOM 6277 CZ ARG B 350 26.014 44.357 45.951 1.00 44.74 C ATOM 6278 NH1 ARG B 350 25.042 43.640 46.503 1.00 44.95 N ATOM 6279 NH2 ARG B 350 25.723 45.231 44.999 1.00 44.86 N ATOM 6280 HA ARG B 350 31.514 41.765 47.876 1.00 0.00 H ATOM 6281 HB2 ARG B 350 29.100 41.230 48.360 1.00 0.00 H ATOM 6282 HB3 ARG B 350 29.118 42.544 49.559 1.00 0.00 H ATOM 6283 HG2 ARG B 350 29.582 44.171 47.803 1.00 0.00 H ATOM 6284 HG3 ARG B 350 29.641 42.870 46.591 1.00 0.00 H ATOM 6285 HD2 ARG B 350 27.262 43.580 48.328 1.00 0.00 H ATOM 6286 HD3 ARG B 350 27.320 42.271 47.124 1.00 0.00 H ATOM 6287 HE ARG B 350 28.006 44.776 45.882 1.00 0.00 H ATOM 6288 HH12 ARG B 350 24.058 43.770 46.191 1.00 0.00 H ATOM 6289 HH11 ARG B 350 25.264 42.948 47.247 1.00 0.00 H ATOM 6290 HH22 ARG B 350 24.737 45.356 44.692 1.00 0.00 H ATOM 6291 HH21 ARG B 350 26.480 45.792 44.559 1.00 0.00 H ATOM 6292 H ARG B 350 30.424 40.347 50.116 1.00 0.00 H ATOM 6293 N GLU B 351 31.622 43.422 50.727 1.00 48.31 N ATOM 6294 CA GLU B 351 32.168 44.614 51.407 1.00 49.58 C ATOM 6295 C GLU B 351 33.680 44.674 51.286 1.00 49.55 C ATOM 6296 O GLU B 351 34.236 45.736 51.001 1.00 50.05 O ATOM 6297 CB GLU B 351 31.761 44.672 52.895 1.00 49.78 C ATOM 6298 CG GLU B 351 32.304 45.907 53.682 1.00 52.14 C ATOM 6299 CD GLU B 351 33.727 45.730 54.276 1.00 54.97 C ATOM 6300 OE1 GLU B 351 34.208 44.580 54.406 1.00 56.02 O ATOM 6301 OE2 GLU B 351 34.366 46.755 54.625 1.00 55.33 O ATOM 6302 HA GLU B 351 31.738 45.480 50.904 1.00 0.00 H ATOM 6303 HB2 GLU B 351 30.672 44.690 52.947 1.00 0.00 H ATOM 6304 HB3 GLU B 351 32.132 43.771 53.382 1.00 0.00 H ATOM 6305 HG2 GLU B 351 32.324 46.759 53.003 1.00 0.00 H ATOM 6306 HG3 GLU B 351 31.618 46.114 54.503 1.00 0.00 H ATOM 6307 H GLU B 351 31.157 42.691 51.303 1.00 0.00 H ATOM 6308 N PHE B 352 34.337 43.540 51.516 1.00 49.71 N ATOM 6309 CA PHE B 352 35.785 43.469 51.411 1.00 49.94 C ATOM 6310 C PHE B 352 36.258 43.775 49.992 1.00 50.07 C ATOM 6311 O PHE B 352 37.234 44.504 49.814 1.00 50.06 O ATOM 6312 CB PHE B 352 36.317 42.115 51.878 1.00 50.07 C ATOM 6313 CG PHE B 352 37.779 41.912 51.585 1.00 51.19 C ATOM 6314 CD1 PHE B 352 38.744 42.719 52.187 1.00 51.26 C ATOM 6315 CD2 PHE B 352 38.190 40.925 50.691 1.00 51.56 C ATOM 6316 CE1 PHE B 352 40.094 42.538 51.909 1.00 52.30 C ATOM 6317 CE2 PHE B 352 39.534 40.734 50.409 1.00 51.49 C ATOM 6318 CZ PHE B 352 40.490 41.541 51.018 1.00 52.24 C ATOM 6319 HA PHE B 352 36.191 44.234 52.073 1.00 0.00 H ATOM 6320 HB2 PHE B 352 36.166 42.037 52.955 1.00 0.00 H ATOM 6321 HB3 PHE B 352 35.752 41.330 51.376 1.00 0.00 H ATOM 6322 HD2 PHE B 352 37.444 40.294 50.207 1.00 0.00 H ATOM 6323 HE2 PHE B 352 39.841 39.954 49.712 1.00 0.00 H ATOM 6324 HZ PHE B 352 41.548 41.394 50.799 1.00 0.00 H ATOM 6325 HE1 PHE B 352 40.840 43.173 52.386 1.00 0.00 H ATOM 6326 HD1 PHE B 352 38.437 43.500 52.883 1.00 0.00 H ATOM 6327 H PHE B 352 33.803 42.686 51.776 1.00 0.00 H ATOM 6328 N LEU B 353 35.566 43.227 48.990 1.00 50.08 N ATOM 6329 CA LEU B 353 35.857 43.562 47.591 1.00 50.28 C ATOM 6330 C LEU B 353 35.622 45.046 47.286 1.00 50.79 C ATOM 6331 O LEU B 353 36.429 45.663 46.596 1.00 50.78 O ATOM 6332 CB LEU B 353 35.096 42.651 46.615 1.00 49.82 C ATOM 6333 CG LEU B 353 35.669 41.232 46.516 1.00 48.84 C ATOM 6334 CD1 LEU B 353 34.654 40.255 45.962 1.00 47.64 C ATOM 6335 CD2 LEU B 353 36.955 41.212 45.696 1.00 47.81 C ATOM 6336 HA LEU B 353 36.921 43.377 47.441 1.00 0.00 H ATOM 6337 HB2 LEU B 353 34.060 42.581 46.947 1.00 0.00 H ATOM 6338 HB3 LEU B 353 35.129 43.105 45.625 1.00 0.00 H ATOM 6339 HG LEU B 353 35.912 40.910 47.529 1.00 0.00 H ATOM 6340 HD21 LEU B 353 36.748 41.575 44.689 1.00 0.00 H ATOM 6341 HD22 LEU B 353 37.697 41.855 46.170 1.00 0.00 H ATOM 6342 HD23 LEU B 353 37.336 40.192 45.645 1.00 0.00 H ATOM 6343 HD11 LEU B 353 33.782 40.229 46.616 1.00 0.00 H ATOM 6344 HD12 LEU B 353 34.352 40.574 44.964 1.00 0.00 H ATOM 6345 HD13 LEU B 353 35.100 39.262 45.908 1.00 0.00 H ATOM 6346 H LEU B 353 34.806 42.550 49.205 1.00 0.00 H ATOM 6347 N LYS B 354 34.542 45.614 47.825 1.00 51.67 N ATOM 6348 CA LYS B 354 34.252 47.059 47.715 1.00 52.63 C ATOM 6349 C LYS B 354 35.380 47.975 48.210 1.00 53.04 C ATOM 6350 O LYS B 354 35.542 49.088 47.711 1.00 53.08 O ATOM 6351 CB LYS B 354 32.979 47.419 48.500 1.00 52.75 C ATOM 6352 CG LYS B 354 31.697 47.568 47.687 1.00 53.24 C ATOM 6353 CD LYS B 354 30.643 48.302 48.516 1.00 54.58 C ATOM 6354 CE LYS B 354 29.460 48.768 47.682 1.00 56.09 C ATOM 6355 NZ LYS B 354 28.371 47.733 47.625 1.00 57.36 N ATOM 6356 HA LYS B 354 34.130 47.232 46.646 1.00 0.00 H ATOM 6357 HB2 LYS B 354 32.813 46.636 49.240 1.00 0.00 H ATOM 6358 HB3 LYS B 354 33.160 48.365 49.009 1.00 0.00 H ATOM 6359 HG2 LYS B 354 31.906 48.137 46.781 1.00 0.00 H ATOM 6360 HG3 LYS B 354 31.322 46.581 47.416 1.00 0.00 H ATOM 6361 HD2 LYS B 354 30.279 47.629 49.293 1.00 0.00 H ATOM 6362 HD3 LYS B 354 31.108 49.172 48.980 1.00 0.00 H ATOM 6363 HE2 LYS B 354 29.803 48.975 46.668 1.00 0.00 H ATOM 6364 HE3 LYS B 354 29.057 49.680 48.121 1.00 0.00 H ATOM 6365 HZ1 LYS B 354 28.746 46.860 47.201 1.00 0.00 H ATOM 6366 HZ2 LYS B 354 28.033 47.534 48.588 1.00 0.00 H ATOM 6367 HZ3 LYS B 354 27.584 48.091 47.047 1.00 0.00 H ATOM 6368 H LYS B 354 33.873 45.012 48.347 1.00 0.00 H ATOM 6369 N SER B 355 36.143 47.510 49.198 1.00 53.76 N ATOM 6370 CA SER B 355 37.097 48.371 49.903 1.00 54.44 C ATOM 6371 C SER B 355 38.551 48.272 49.421 1.00 55.20 C ATOM 6372 O SER B 355 39.451 48.844 50.045 1.00 55.33 O ATOM 6373 CB SER B 355 37.020 48.111 51.413 1.00 54.31 C ATOM 6374 OG SER B 355 37.544 46.839 51.752 1.00 54.16 O ATOM 6375 HA SER B 355 36.791 49.391 49.668 1.00 0.00 H ATOM 6376 HB2 SER B 355 35.978 48.159 51.728 1.00 0.00 H ATOM 6377 HB3 SER B 355 37.591 48.879 51.934 1.00 0.00 H ATOM 6378 HG SER B 355 37.026 46.135 51.287 1.00 0.00 H ATOM 6379 H SER B 355 36.060 46.511 49.476 1.00 0.00 H ATOM 6380 N LEU B 356 38.785 47.583 48.307 1.00 56.11 N ATOM 6381 CA LEU B 356 40.157 47.282 47.883 1.00 57.23 C ATOM 6382 C LEU B 356 41.077 48.491 47.628 1.00 57.91 C ATOM 6383 O LEU B 356 42.201 48.520 48.138 1.00 58.06 O ATOM 6384 CB LEU B 356 40.182 46.296 46.707 1.00 57.15 C ATOM 6385 CG LEU B 356 39.864 44.834 47.053 1.00 57.34 C ATOM 6386 CD1 LEU B 356 40.114 43.938 45.850 1.00 57.02 C ATOM 6387 CD2 LEU B 356 40.676 44.348 48.252 1.00 57.29 C ATOM 6388 HA LEU B 356 40.596 46.807 48.761 1.00 0.00 H ATOM 6389 HB2 LEU B 356 39.450 46.633 45.972 1.00 0.00 H ATOM 6390 HB3 LEU B 356 41.178 46.326 46.266 1.00 0.00 H ATOM 6391 HG LEU B 356 38.809 44.782 47.323 1.00 0.00 H ATOM 6392 HD21 LEU B 356 41.739 44.424 48.024 1.00 0.00 H ATOM 6393 HD22 LEU B 356 40.444 44.965 49.120 1.00 0.00 H ATOM 6394 HD23 LEU B 356 40.422 43.310 48.464 1.00 0.00 H ATOM 6395 HD11 LEU B 356 39.477 44.255 45.024 1.00 0.00 H ATOM 6396 HD12 LEU B 356 41.160 44.014 45.553 1.00 0.00 H ATOM 6397 HD13 LEU B 356 39.883 42.906 46.113 1.00 0.00 H ATOM 6398 H LEU B 356 37.985 47.254 47.729 1.00 0.00 H ATOM 6399 N ARG B 357 40.611 49.469 46.853 1.00 58.81 N ATOM 6400 CA ARG B 357 41.413 50.666 46.535 1.00 59.84 C ATOM 6401 C ARG B 357 40.700 51.602 45.559 1.00 60.43 C ATOM 6402 O ARG B 357 39.473 51.545 45.410 1.00 60.97 O ATOM 6403 CB ARG B 357 42.798 50.284 45.992 1.00 59.98 C ATOM 6404 HA ARG B 357 41.544 51.207 47.472 1.00 0.00 H ATOM 6405 HB2 ARG B 357 43.331 49.698 46.741 1.00 0.00 H ATOM 6406 HB3 ARG B 357 42.680 49.694 45.083 1.00 0.00 H ATOM 6407 H ARG B 357 39.652 49.386 46.460 1.00 0.00 H ATOM 6408 N LYS B 358 41.475 52.465 44.902 1.00 60.82 N ATOM 6409 CA LYS B 358 40.921 53.468 43.985 1.00 60.89 C ATOM 6410 C LYS B 358 40.539 52.905 42.614 1.00 60.85 C ATOM 6411 O LYS B 358 39.520 53.323 42.053 1.00 61.34 O ATOM 6412 CB LYS B 358 41.870 54.662 43.841 1.00 61.07 C ATOM 6413 HA LYS B 358 39.990 53.807 44.440 1.00 0.00 H ATOM 6414 HB2 LYS B 358 42.021 55.124 44.817 1.00 0.00 H ATOM 6415 HB3 LYS B 358 42.827 54.319 43.448 1.00 0.00 H ATOM 6416 H LYS B 358 42.505 52.426 45.044 1.00 0.00 H ATOM 6417 N PRO B 359 41.355 51.980 42.053 1.00 60.51 N ATOM 6418 CA PRO B 359 40.895 51.317 40.820 1.00 60.07 C ATOM 6419 C PRO B 359 40.286 49.914 41.011 1.00 59.60 C ATOM 6420 O PRO B 359 39.342 49.552 40.295 1.00 59.49 O ATOM 6421 CB PRO B 359 42.167 51.244 39.965 1.00 60.08 C ATOM 6422 CG PRO B 359 43.318 51.313 40.947 1.00 60.28 C ATOM 6423 CD PRO B 359 42.794 51.744 42.297 1.00 60.45 C ATOM 6424 HA PRO B 359 40.072 51.877 40.375 1.00 0.00 H ATOM 6425 HD3 PRO B 359 42.939 50.960 43.040 1.00 0.00 H ATOM 6426 HD2 PRO B 359 43.287 52.656 42.633 1.00 0.00 H ATOM 6427 HG3 PRO B 359 44.056 52.034 40.595 1.00 0.00 H ATOM 6428 HG2 PRO B 359 43.784 50.331 41.033 1.00 0.00 H ATOM 6429 HB2 PRO B 359 42.198 50.309 39.406 1.00 0.00 H ATOM 6430 HB3 PRO B 359 42.208 52.083 39.270 1.00 0.00 H ATOM 6431 N PHE B 360 40.810 49.146 41.969 1.00 58.70 N ATOM 6432 CA PHE B 360 40.450 47.731 42.127 1.00 57.79 C ATOM 6433 C PHE B 360 39.146 47.463 42.877 1.00 57.10 C ATOM 6434 O PHE B 360 38.628 46.346 42.847 1.00 57.13 O ATOM 6435 CB PHE B 360 41.604 46.959 42.772 1.00 57.77 C ATOM 6436 CG PHE B 360 42.885 47.038 41.995 1.00 58.36 C ATOM 6437 CD1 PHE B 360 43.115 46.185 40.921 1.00 57.98 C ATOM 6438 CD2 PHE B 360 43.855 47.980 42.323 1.00 59.07 C ATOM 6439 CE1 PHE B 360 44.293 46.260 40.195 1.00 58.27 C ATOM 6440 CE2 PHE B 360 45.040 48.063 41.599 1.00 59.03 C ATOM 6441 CZ PHE B 360 45.257 47.198 40.531 1.00 58.30 C ATOM 6442 HA PHE B 360 40.267 47.374 41.114 1.00 0.00 H ATOM 6443 HB2 PHE B 360 41.778 47.367 43.768 1.00 0.00 H ATOM 6444 HB3 PHE B 360 41.315 45.911 42.855 1.00 0.00 H ATOM 6445 HD2 PHE B 360 43.684 48.661 43.157 1.00 0.00 H ATOM 6446 HE2 PHE B 360 45.795 48.802 41.867 1.00 0.00 H ATOM 6447 HZ PHE B 360 46.183 47.258 39.960 1.00 0.00 H ATOM 6448 HE1 PHE B 360 44.462 45.581 39.359 1.00 0.00 H ATOM 6449 HD1 PHE B 360 42.360 45.449 40.647 1.00 0.00 H ATOM 6450 H PHE B 360 41.498 49.565 42.627 1.00 0.00 H ATOM 6451 N GLY B 361 38.608 48.483 43.536 1.00 56.29 N ATOM 6452 CA GLY B 361 37.394 48.313 44.335 1.00 55.31 C ATOM 6453 C GLY B 361 36.091 48.395 43.557 1.00 54.53 C ATOM 6454 O GLY B 361 35.015 48.308 44.147 1.00 54.46 O ATOM 6455 HA3 GLY B 361 37.381 49.091 45.099 1.00 0.00 H ATOM 6456 HA2 GLY B 361 37.440 47.335 44.815 1.00 0.00 H ATOM 6457 H GLY B 361 39.058 49.419 43.483 1.00 0.00 H ATOM 6458 N ASP B 362 36.186 48.549 42.236 1.00 53.90 N ATOM 6459 CA ASP B 362 35.009 48.767 41.380 1.00 53.28 C ATOM 6460 C ASP B 362 34.684 47.625 40.399 1.00 52.27 C ATOM 6461 O ASP B 362 33.594 47.610 39.828 1.00 52.36 O ATOM 6462 CB ASP B 362 35.149 50.077 40.574 1.00 53.70 C ATOM 6463 CG ASP B 362 35.297 51.318 41.457 1.00 55.01 C ATOM 6464 OD1 ASP B 362 34.360 51.636 42.224 1.00 56.40 O ATOM 6465 OD2 ASP B 362 36.347 51.992 41.355 1.00 55.94 O ATOM 6466 HA ASP B 362 34.179 48.818 42.085 1.00 0.00 H ATOM 6467 HB2 ASP B 362 36.029 49.999 39.936 1.00 0.00 H ATOM 6468 HB3 ASP B 362 34.262 50.198 39.953 1.00 0.00 H ATOM 6469 H ASP B 362 37.127 48.514 41.794 1.00 0.00 H ATOM 6470 N PHE B 363 35.607 46.686 40.181 1.00 50.77 N ATOM 6471 CA PHE B 363 35.397 45.690 39.124 1.00 49.42 C ATOM 6472 C PHE B 363 34.379 44.589 39.456 1.00 48.59 C ATOM 6473 O PHE B 363 33.741 44.056 38.550 1.00 48.45 O ATOM 6474 CB PHE B 363 36.731 45.165 38.529 1.00 49.53 C ATOM 6475 CG PHE B 363 37.405 44.078 39.337 1.00 49.35 C ATOM 6476 CD1 PHE B 363 37.259 42.736 38.979 1.00 49.18 C ATOM 6477 CD2 PHE B 363 38.215 44.395 40.425 1.00 49.05 C ATOM 6478 CE1 PHE B 363 37.893 41.722 39.708 1.00 49.54 C ATOM 6479 CE2 PHE B 363 38.849 43.393 41.170 1.00 49.13 C ATOM 6480 CZ PHE B 363 38.689 42.052 40.810 1.00 49.51 C ATOM 6481 HA PHE B 363 34.904 46.237 38.320 1.00 0.00 H ATOM 6482 HB2 PHE B 363 36.526 44.770 37.534 1.00 0.00 H ATOM 6483 HB3 PHE B 363 37.421 46.005 38.450 1.00 0.00 H ATOM 6484 HD2 PHE B 363 38.358 45.440 40.701 1.00 0.00 H ATOM 6485 HE2 PHE B 363 39.466 43.658 42.029 1.00 0.00 H ATOM 6486 HZ PHE B 363 39.182 41.268 41.385 1.00 0.00 H ATOM 6487 HE1 PHE B 363 37.767 40.679 39.418 1.00 0.00 H ATOM 6488 HD1 PHE B 363 36.642 42.474 38.119 1.00 0.00 H ATOM 6489 H PHE B 363 36.472 46.660 40.758 1.00 0.00 H ATOM 6490 N MET B 364 34.195 44.278 40.740 1.00 47.65 N ATOM 6491 CA MET B 364 33.259 43.210 41.153 1.00 46.74 C ATOM 6492 C MET B 364 31.844 43.702 41.462 1.00 46.04 C ATOM 6493 O MET B 364 30.873 42.956 41.312 1.00 45.81 O ATOM 6494 CB MET B 364 33.801 42.426 42.356 1.00 46.81 C ATOM 6495 CG MET B 364 35.013 41.542 42.059 1.00 47.09 C ATOM 6496 SD MET B 364 34.714 40.258 40.816 1.00 47.41 S ATOM 6497 CE MET B 364 33.465 39.262 41.612 1.00 45.49 C ATOM 6498 HA MET B 364 33.184 42.555 40.285 1.00 0.00 H ATOM 6499 HB2 MET B 364 34.086 43.143 43.126 1.00 0.00 H ATOM 6500 HB3 MET B 364 33.001 41.788 42.732 1.00 0.00 H ATOM 6501 HG2 MET B 364 35.316 41.056 42.986 1.00 0.00 H ATOM 6502 HG3 MET B 364 35.822 42.180 41.703 1.00 0.00 H ATOM 6503 HE1 MET B 364 33.859 38.868 42.549 1.00 0.00 H ATOM 6504 HE2 MET B 364 32.587 39.876 41.814 1.00 0.00 H ATOM 6505 HE3 MET B 364 33.189 38.436 40.957 1.00 0.00 H ATOM 6506 H MET B 364 34.723 44.799 41.469 1.00 0.00 H ATOM 6507 N GLU B 365 31.733 44.954 41.899 1.00 45.26 N ATOM 6508 CA GLU B 365 30.440 45.539 42.266 1.00 44.57 C ATOM 6509 C GLU B 365 29.361 45.435 41.167 1.00 43.62 C ATOM 6510 O GLU B 365 28.235 45.022 41.467 1.00 43.85 O ATOM 6511 CB GLU B 365 30.609 46.982 42.782 1.00 44.90 C ATOM 6512 CG GLU B 365 29.364 47.594 43.438 1.00 45.84 C ATOM 6513 CD GLU B 365 28.820 46.791 44.626 1.00 48.28 C ATOM 6514 OE1 GLU B 365 29.525 45.907 45.162 1.00 48.44 O ATOM 6515 OE2 GLU B 365 27.665 47.050 45.031 1.00 49.96 O ATOM 6516 HA GLU B 365 30.059 44.927 43.084 1.00 0.00 H ATOM 6517 HB2 GLU B 365 31.413 46.985 43.518 1.00 0.00 H ATOM 6518 HB3 GLU B 365 30.889 47.611 41.937 1.00 0.00 H ATOM 6519 HG2 GLU B 365 29.619 48.594 43.789 1.00 0.00 H ATOM 6520 HG3 GLU B 365 28.580 47.664 42.684 1.00 0.00 H ATOM 6521 H GLU B 365 32.591 45.536 41.983 1.00 0.00 H ATOM 6522 N PRO B 366 29.696 45.772 39.901 1.00 42.66 N ATOM 6523 CA PRO B 366 28.713 45.609 38.816 1.00 42.08 C ATOM 6524 C PRO B 366 28.292 44.161 38.593 1.00 41.51 C ATOM 6525 O PRO B 366 27.153 43.910 38.197 1.00 41.76 O ATOM 6526 CB PRO B 366 29.457 46.118 37.576 1.00 42.01 C ATOM 6527 CG PRO B 366 30.571 46.949 38.093 1.00 42.48 C ATOM 6528 CD PRO B 366 30.962 46.332 39.396 1.00 42.86 C ATOM 6529 HA PRO B 366 27.791 46.143 39.046 1.00 0.00 H ATOM 6530 HD3 PRO B 366 31.705 45.548 39.250 1.00 0.00 H ATOM 6531 HD2 PRO B 366 31.358 47.082 40.080 1.00 0.00 H ATOM 6532 HG3 PRO B 366 30.241 47.977 38.242 1.00 0.00 H ATOM 6533 HG2 PRO B 366 31.411 46.935 37.398 1.00 0.00 H ATOM 6534 HB2 PRO B 366 29.844 45.282 36.994 1.00 0.00 H ATOM 6535 HB3 PRO B 366 28.793 46.717 36.952 1.00 0.00 H ATOM 6536 N LYS B 367 29.199 43.220 38.847 1.00 40.78 N ATOM 6537 CA LYS B 367 28.889 41.795 38.729 1.00 40.32 C ATOM 6538 C LYS B 367 27.894 41.358 39.811 1.00 39.62 C ATOM 6539 O LYS B 367 26.956 40.603 39.522 1.00 39.25 O ATOM 6540 CB LYS B 367 30.168 40.948 38.781 1.00 40.45 C ATOM 6541 CG LYS B 367 31.397 41.599 38.128 1.00 41.47 C ATOM 6542 CD LYS B 367 31.410 41.456 36.620 1.00 42.51 C ATOM 6543 CE LYS B 367 32.759 41.877 36.044 1.00 43.44 C ATOM 6544 NZ LYS B 367 32.947 43.351 35.905 1.00 43.20 N ATOM 6545 HA LYS B 367 28.420 41.633 37.759 1.00 0.00 H ATOM 6546 HB2 LYS B 367 30.403 40.752 39.827 1.00 0.00 H ATOM 6547 HB3 LYS B 367 29.972 40.005 38.271 1.00 0.00 H ATOM 6548 HG2 LYS B 367 31.402 42.660 38.377 1.00 0.00 H ATOM 6549 HG3 LYS B 367 32.294 41.129 38.530 1.00 0.00 H ATOM 6550 HD2 LYS B 367 31.219 40.415 36.358 1.00 0.00 H ATOM 6551 HD3 LYS B 367 30.628 42.085 36.195 1.00 0.00 H ATOM 6552 HE2 LYS B 367 32.862 41.427 35.057 1.00 0.00 H ATOM 6553 HE3 LYS B 367 33.542 41.495 36.699 1.00 0.00 H ATOM 6554 HZ1 LYS B 367 32.217 43.734 35.271 1.00 0.00 H ATOM 6555 HZ2 LYS B 367 32.866 43.799 36.840 1.00 0.00 H ATOM 6556 HZ3 LYS B 367 33.889 43.543 35.507 1.00 0.00 H ATOM 6557 H LYS B 367 30.156 43.506 39.138 1.00 0.00 H ATOM 6558 N PHE B 368 28.096 41.847 41.040 1.00 39.01 N ATOM 6559 CA PHE B 368 27.152 41.630 42.152 1.00 39.07 C ATOM 6560 C PHE B 368 25.775 42.205 41.844 1.00 39.21 C ATOM 6561 O PHE B 368 24.756 41.565 42.099 1.00 39.08 O ATOM 6562 CB PHE B 368 27.673 42.223 43.480 1.00 39.07 C ATOM 6563 CG PHE B 368 28.718 41.372 44.176 1.00 38.46 C ATOM 6564 CD1 PHE B 368 28.373 40.162 44.764 1.00 38.54 C ATOM 6565 CD2 PHE B 368 30.037 41.796 44.250 1.00 38.33 C ATOM 6566 CE1 PHE B 368 29.336 39.380 45.408 1.00 39.36 C ATOM 6567 CE2 PHE B 368 31.008 41.030 44.890 1.00 38.79 C ATOM 6568 CZ PHE B 368 30.660 39.820 45.468 1.00 39.35 C ATOM 6569 HA PHE B 368 27.064 40.550 42.267 1.00 0.00 H ATOM 6570 HB2 PHE B 368 28.111 43.199 43.270 1.00 0.00 H ATOM 6571 HB3 PHE B 368 26.826 42.345 44.155 1.00 0.00 H ATOM 6572 HD2 PHE B 368 30.319 42.747 43.798 1.00 0.00 H ATOM 6573 HE2 PHE B 368 32.039 41.381 44.936 1.00 0.00 H ATOM 6574 HZ PHE B 368 31.416 39.214 45.967 1.00 0.00 H ATOM 6575 HE1 PHE B 368 29.054 38.430 45.862 1.00 0.00 H ATOM 6576 HD1 PHE B 368 27.339 39.818 44.723 1.00 0.00 H ATOM 6577 H PHE B 368 28.956 42.404 41.219 1.00 0.00 H ATOM 6578 N GLU B 369 25.755 43.412 41.281 1.00 39.83 N ATOM 6579 CA GLU B 369 24.502 44.084 40.928 1.00 40.30 C ATOM 6580 C GLU B 369 23.712 43.267 39.909 1.00 39.75 C ATOM 6581 O GLU B 369 22.526 43.037 40.104 1.00 39.57 O ATOM 6582 CB GLU B 369 24.757 45.501 40.404 1.00 40.42 C ATOM 6583 CG GLU B 369 25.264 46.471 41.460 1.00 43.63 C ATOM 6584 CD GLU B 369 25.363 47.905 40.960 1.00 47.56 C ATOM 6585 OE1 GLU B 369 25.008 48.164 39.784 1.00 49.85 O ATOM 6586 OE2 GLU B 369 25.797 48.779 41.743 1.00 49.43 O ATOM 6587 HA GLU B 369 23.906 44.166 41.837 1.00 0.00 H ATOM 6588 HB2 GLU B 369 25.499 45.443 39.607 1.00 0.00 H ATOM 6589 HB3 GLU B 369 23.822 45.891 40.001 1.00 0.00 H ATOM 6590 HG2 GLU B 369 24.581 46.446 42.309 1.00 0.00 H ATOM 6591 HG3 GLU B 369 26.254 46.147 41.782 1.00 0.00 H ATOM 6592 H GLU B 369 26.657 43.892 41.086 1.00 0.00 H ATOM 6593 N PHE B 370 24.381 42.820 38.842 1.00 39.34 N ATOM 6594 CA PHE B 370 23.776 41.913 37.852 1.00 38.73 C ATOM 6595 C PHE B 370 23.285 40.603 38.473 1.00 38.40 C ATOM 6596 O PHE B 370 22.182 40.140 38.170 1.00 38.33 O ATOM 6597 CB PHE B 370 24.762 41.626 36.702 1.00 38.94 C ATOM 6598 CG PHE B 370 24.325 40.510 35.786 1.00 38.49 C ATOM 6599 CD1 PHE B 370 23.402 40.745 34.776 1.00 38.24 C ATOM 6600 CD2 PHE B 370 24.828 39.227 35.945 1.00 38.03 C ATOM 6601 CE1 PHE B 370 22.986 39.716 33.936 1.00 38.99 C ATOM 6602 CE2 PHE B 370 24.418 38.192 35.103 1.00 38.95 C ATOM 6603 CZ PHE B 370 23.494 38.439 34.101 1.00 37.96 C ATOM 6604 HA PHE B 370 22.900 42.425 37.453 1.00 0.00 H ATOM 6605 HB2 PHE B 370 24.872 42.534 36.109 1.00 0.00 H ATOM 6606 HB3 PHE B 370 25.726 41.358 37.135 1.00 0.00 H ATOM 6607 HD2 PHE B 370 25.551 39.025 36.736 1.00 0.00 H ATOM 6608 HE2 PHE B 370 24.825 37.189 35.234 1.00 0.00 H ATOM 6609 HZ PHE B 370 23.168 37.631 33.445 1.00 0.00 H ATOM 6610 HE1 PHE B 370 22.260 39.916 33.148 1.00 0.00 H ATOM 6611 HD1 PHE B 370 22.998 41.748 34.639 1.00 0.00 H ATOM 6612 H PHE B 370 25.366 43.124 38.706 1.00 0.00 H ATOM 6613 N ALA B 371 24.107 40.010 39.337 1.00 38.73 N ATOM 6614 CA ALA B 371 23.790 38.715 39.959 1.00 38.53 C ATOM 6615 C ALA B 371 22.527 38.782 40.801 1.00 38.79 C ATOM 6616 O ALA B 371 21.653 37.915 40.689 1.00 39.21 O ATOM 6617 CB ALA B 371 24.949 38.230 40.792 1.00 38.37 C ATOM 6618 HA ALA B 371 23.609 38.004 39.152 1.00 0.00 H ATOM 6619 HB1 ALA B 371 25.827 38.112 40.157 1.00 0.00 H ATOM 6620 HB2 ALA B 371 25.161 38.957 41.576 1.00 0.00 H ATOM 6621 HB3 ALA B 371 24.694 37.271 41.243 1.00 0.00 H ATOM 6622 H ALA B 371 25.003 40.478 39.580 1.00 0.00 H ATOM 6623 N VAL B 372 22.421 39.816 41.637 1.00 38.89 N ATOM 6624 CA VAL B 372 21.223 40.014 42.451 1.00 38.93 C ATOM 6625 C VAL B 372 19.956 39.977 41.583 1.00 38.96 C ATOM 6626 O VAL B 372 19.015 39.259 41.897 1.00 38.91 O ATOM 6627 CB VAL B 372 21.312 41.302 43.305 1.00 38.94 C ATOM 6628 CG1 VAL B 372 19.939 41.696 43.874 1.00 38.77 C ATOM 6629 CG2 VAL B 372 22.320 41.106 44.423 1.00 39.06 C ATOM 6630 HA VAL B 372 21.158 39.184 43.155 1.00 0.00 H ATOM 6631 HB VAL B 372 21.644 42.118 42.663 1.00 0.00 H ATOM 6632 HG11 VAL B 372 19.244 41.873 43.053 1.00 0.00 H ATOM 6633 HG12 VAL B 372 19.563 40.889 44.503 1.00 0.00 H ATOM 6634 HG13 VAL B 372 20.040 42.604 44.468 1.00 0.00 H ATOM 6635 HG21 VAL B 372 22.004 40.275 45.053 1.00 0.00 H ATOM 6636 HG22 VAL B 372 23.298 40.888 43.994 1.00 0.00 H ATOM 6637 HG23 VAL B 372 22.379 42.015 45.021 1.00 0.00 H ATOM 6638 H VAL B 372 23.206 40.494 41.711 1.00 0.00 H ATOM 6639 N LYS B 373 19.955 40.725 40.486 1.00 39.39 N ATOM 6640 CA LYS B 373 18.816 40.738 39.558 1.00 39.91 C ATOM 6641 C LYS B 373 18.685 39.415 38.824 1.00 39.62 C ATOM 6642 O LYS B 373 17.599 38.837 38.778 1.00 40.19 O ATOM 6643 CB LYS B 373 18.946 41.878 38.542 1.00 40.28 C ATOM 6644 CG LYS B 373 18.843 43.284 39.143 1.00 41.82 C ATOM 6645 CD LYS B 373 18.980 44.375 38.073 1.00 43.94 C ATOM 6646 CE LYS B 373 20.372 44.384 37.444 1.00 45.20 C ATOM 6647 NZ LYS B 373 20.605 45.583 36.591 1.00 47.15 N ATOM 6648 HA LYS B 373 17.918 40.896 40.155 1.00 0.00 H ATOM 6649 HB2 LYS B 373 19.915 41.788 38.052 1.00 0.00 H ATOM 6650 HB3 LYS B 373 18.154 41.766 37.802 1.00 0.00 H ATOM 6651 HG2 LYS B 373 17.874 43.389 39.631 1.00 0.00 H ATOM 6652 HG3 LYS B 373 19.636 43.411 39.880 1.00 0.00 H ATOM 6653 HD2 LYS B 373 18.241 44.198 37.292 1.00 0.00 H ATOM 6654 HD3 LYS B 373 18.795 45.346 38.533 1.00 0.00 H ATOM 6655 HE2 LYS B 373 20.484 43.491 36.830 1.00 0.00 H ATOM 6656 HE3 LYS B 373 21.116 44.371 38.241 1.00 0.00 H ATOM 6657 HZ1 LYS B 373 19.905 45.601 35.822 1.00 0.00 H ATOM 6658 HZ2 LYS B 373 20.509 46.442 37.169 1.00 0.00 H ATOM 6659 HZ3 LYS B 373 21.563 45.540 36.189 1.00 0.00 H ATOM 6660 H LYS B 373 20.783 41.318 40.278 1.00 0.00 H ATOM 6661 N PHE B 374 19.790 38.926 38.263 1.00 38.99 N ATOM 6662 CA PHE B 374 19.763 37.665 37.518 1.00 38.25 C ATOM 6663 C PHE B 374 19.277 36.509 38.385 1.00 37.76 C ATOM 6664 O PHE B 374 18.469 35.693 37.936 1.00 37.41 O ATOM 6665 CB PHE B 374 21.143 37.360 36.915 1.00 37.94 C ATOM 6666 CG PHE B 374 21.149 36.234 35.913 1.00 37.20 C ATOM 6667 CD1 PHE B 374 20.685 36.434 34.612 1.00 36.32 C ATOM 6668 CD2 PHE B 374 21.660 34.984 36.256 1.00 36.08 C ATOM 6669 CE1 PHE B 374 20.713 35.402 33.676 1.00 36.31 C ATOM 6670 CE2 PHE B 374 21.701 33.949 35.320 1.00 35.92 C ATOM 6671 CZ PHE B 374 21.220 34.154 34.034 1.00 34.96 C ATOM 6672 HA PHE B 374 19.050 37.779 36.701 1.00 0.00 H ATOM 6673 HB2 PHE B 374 21.505 38.260 36.419 1.00 0.00 H ATOM 6674 HB3 PHE B 374 21.820 37.097 37.728 1.00 0.00 H ATOM 6675 HD2 PHE B 374 22.032 34.812 37.266 1.00 0.00 H ATOM 6676 HE2 PHE B 374 22.111 32.979 35.599 1.00 0.00 H ATOM 6677 HZ PHE B 374 21.239 33.342 33.307 1.00 0.00 H ATOM 6678 HE1 PHE B 374 20.339 35.570 32.666 1.00 0.00 H ATOM 6679 HD1 PHE B 374 20.295 37.411 34.324 1.00 0.00 H ATOM 6680 H PHE B 374 20.685 39.447 38.355 1.00 0.00 H ATOM 6681 N ASN B 375 19.757 36.440 39.626 1.00 37.86 N ATOM 6682 CA ASN B 375 19.372 35.340 40.524 1.00 38.08 C ATOM 6683 C ASN B 375 17.893 35.364 40.934 1.00 38.39 C ATOM 6684 O ASN B 375 17.340 34.322 41.312 1.00 38.21 O ATOM 6685 CB ASN B 375 20.287 35.267 41.752 1.00 37.88 C ATOM 6686 CG ASN B 375 21.697 34.783 41.407 1.00 38.42 C ATOM 6687 OD1 ASN B 375 22.652 35.024 42.153 1.00 37.50 O ATOM 6688 ND2 ASN B 375 21.831 34.107 40.272 1.00 37.26 N ATOM 6689 HA ASN B 375 19.506 34.429 39.941 1.00 0.00 H ATOM 6690 HB2 ASN B 375 20.357 36.260 42.195 1.00 0.00 H ATOM 6691 HB3 ASN B 375 19.848 34.579 42.474 1.00 0.00 H ATOM 6692 HD22 ASN B 375 21.000 33.926 39.673 1.00 0.00 H ATOM 6693 HD21 ASN B 375 22.767 33.758 39.982 1.00 0.00 H ATOM 6694 H ASN B 375 20.412 37.173 39.964 1.00 0.00 H ATOM 6695 N ALA B 376 17.260 36.540 40.828 1.00 38.75 N ATOM 6696 CA ALA B 376 15.818 36.692 41.098 1.00 39.67 C ATOM 6697 C ALA B 376 14.972 35.875 40.125 1.00 39.85 C ATOM 6698 O ALA B 376 13.851 35.500 40.443 1.00 40.59 O ATOM 6699 CB ALA B 376 15.388 38.186 41.089 1.00 39.49 C ATOM 6700 HA ALA B 376 15.640 36.301 42.100 1.00 0.00 H ATOM 6701 HB1 ALA B 376 15.941 38.727 41.857 1.00 0.00 H ATOM 6702 HB2 ALA B 376 15.603 38.619 40.112 1.00 0.00 H ATOM 6703 HB3 ALA B 376 14.319 38.256 41.292 1.00 0.00 H ATOM 6704 H ALA B 376 17.807 37.378 40.544 1.00 0.00 H ATOM 6705 N LEU B 377 15.522 35.581 38.950 1.00 40.06 N ATOM 6706 CA LEU B 377 14.886 34.665 37.994 1.00 39.90 C ATOM 6707 C LEU B 377 14.851 33.210 38.474 1.00 39.58 C ATOM 6708 O LEU B 377 14.111 32.388 37.930 1.00 39.48 O ATOM 6709 CB LEU B 377 15.577 34.751 36.627 1.00 40.08 C ATOM 6710 CG LEU B 377 15.645 36.119 35.943 1.00 40.79 C ATOM 6711 CD1 LEU B 377 16.533 36.044 34.717 1.00 40.55 C ATOM 6712 CD2 LEU B 377 14.257 36.629 35.570 1.00 41.59 C ATOM 6713 HA LEU B 377 13.849 34.990 37.906 1.00 0.00 H ATOM 6714 HB2 LEU B 377 16.601 34.402 36.758 1.00 0.00 H ATOM 6715 HB3 LEU B 377 15.049 34.077 35.953 1.00 0.00 H ATOM 6716 HG LEU B 377 16.075 36.828 36.650 1.00 0.00 H ATOM 6717 HD21 LEU B 377 13.784 35.924 34.886 1.00 0.00 H ATOM 6718 HD22 LEU B 377 13.652 36.724 36.472 1.00 0.00 H ATOM 6719 HD23 LEU B 377 14.347 37.602 35.087 1.00 0.00 H ATOM 6720 HD11 LEU B 377 17.537 35.742 35.015 1.00 0.00 H ATOM 6721 HD12 LEU B 377 16.125 35.314 34.018 1.00 0.00 H ATOM 6722 HD13 LEU B 377 16.574 37.023 34.239 1.00 0.00 H ATOM 6723 H LEU B 377 16.434 36.015 38.700 1.00 0.00 H ATOM 6724 N GLU B 378 15.662 32.892 39.481 1.00 39.84 N ATOM 6725 CA GLU B 378 15.676 31.551 40.104 1.00 40.16 C ATOM 6726 C GLU B 378 15.856 30.406 39.099 1.00 39.59 C ATOM 6727 O GLU B 378 15.236 29.342 39.208 1.00 39.23 O ATOM 6728 CB GLU B 378 14.424 31.346 40.981 1.00 40.75 C ATOM 6729 CG GLU B 378 14.219 32.486 42.004 1.00 42.96 C ATOM 6730 CD GLU B 378 13.241 32.150 43.121 1.00 46.53 C ATOM 6731 OE1 GLU B 378 12.232 31.455 42.863 1.00 47.67 O ATOM 6732 OE2 GLU B 378 13.481 32.603 44.268 1.00 48.67 O ATOM 6733 HA GLU B 378 16.560 31.516 40.741 1.00 0.00 H ATOM 6734 HB2 GLU B 378 13.549 31.297 40.333 1.00 0.00 H ATOM 6735 HB3 GLU B 378 14.527 30.406 41.522 1.00 0.00 H ATOM 6736 HG2 GLU B 378 15.184 32.721 42.453 1.00 0.00 H ATOM 6737 HG3 GLU B 378 13.844 33.360 41.472 1.00 0.00 H ATOM 6738 H GLU B 378 16.313 33.617 39.845 1.00 0.00 H ATOM 6739 N LEU B 379 16.716 30.632 38.115 1.00 39.11 N ATOM 6740 CA LEU B 379 17.026 29.593 37.145 1.00 38.84 C ATOM 6741 C LEU B 379 17.836 28.491 37.814 1.00 38.75 C ATOM 6742 O LEU B 379 18.479 28.727 38.841 1.00 38.93 O ATOM 6743 CB LEU B 379 17.793 30.189 35.966 1.00 38.65 C ATOM 6744 CG LEU B 379 17.080 31.298 35.186 1.00 37.91 C ATOM 6745 CD1 LEU B 379 18.074 31.979 34.291 1.00 37.85 C ATOM 6746 CD2 LEU B 379 15.883 30.768 34.380 1.00 36.32 C ATOM 6747 HA LEU B 379 16.098 29.163 36.767 1.00 0.00 H ATOM 6748 HB2 LEU B 379 18.727 30.600 36.350 1.00 0.00 H ATOM 6749 HB3 LEU B 379 18.013 29.380 35.269 1.00 0.00 H ATOM 6750 HG LEU B 379 16.673 32.015 35.899 1.00 0.00 H ATOM 6751 HD21 LEU B 379 16.230 30.021 33.665 1.00 0.00 H ATOM 6752 HD22 LEU B 379 15.161 30.315 35.059 1.00 0.00 H ATOM 6753 HD23 LEU B 379 15.412 31.593 33.846 1.00 0.00 H ATOM 6754 HD11 LEU B 379 18.872 32.408 34.897 1.00 0.00 H ATOM 6755 HD12 LEU B 379 18.494 31.251 33.597 1.00 0.00 H ATOM 6756 HD13 LEU B 379 17.575 32.770 33.732 1.00 0.00 H ATOM 6757 H LEU B 379 17.174 31.562 38.036 1.00 0.00 H ATOM 6758 N ASP B 380 17.779 27.285 37.264 1.00 38.66 N ATOM 6759 CA ASP B 380 18.683 26.222 37.710 1.00 38.95 C ATOM 6760 C ASP B 380 19.657 25.789 36.609 1.00 38.35 C ATOM 6761 O ASP B 380 19.683 26.372 35.520 1.00 38.60 O ATOM 6762 CB ASP B 380 17.920 25.025 38.303 1.00 39.18 C ATOM 6763 CG ASP B 380 16.943 24.401 37.330 1.00 40.62 C ATOM 6764 OD1 ASP B 380 17.275 24.228 36.134 1.00 42.32 O ATOM 6765 OD2 ASP B 380 15.827 24.059 37.778 1.00 42.34 O ATOM 6766 HA ASP B 380 19.285 26.645 38.514 1.00 0.00 H ATOM 6767 HB2 ASP B 380 18.643 24.267 38.603 1.00 0.00 H ATOM 6768 HB3 ASP B 380 17.368 25.365 39.179 1.00 0.00 H ATOM 6769 H ASP B 380 17.088 27.093 36.511 1.00 0.00 H ATOM 6770 N ASP B 381 20.460 24.774 36.916 1.00 37.58 N ATOM 6771 CA ASP B 381 21.502 24.281 36.032 1.00 36.57 C ATOM 6772 C ASP B 381 20.976 23.839 34.665 1.00 36.30 C ATOM 6773 O ASP B 381 21.564 24.184 33.637 1.00 35.98 O ATOM 6774 CB ASP B 381 22.253 23.135 36.709 1.00 36.47 C ATOM 6775 CG ASP B 381 23.116 23.609 37.858 1.00 36.68 C ATOM 6776 OD1 ASP B 381 23.011 23.025 38.958 1.00 37.72 O ATOM 6777 OD2 ASP B 381 23.904 24.563 37.668 1.00 36.74 O ATOM 6778 HA ASP B 381 22.180 25.113 35.844 1.00 0.00 H ATOM 6779 HB2 ASP B 381 21.527 22.417 37.090 1.00 0.00 H ATOM 6780 HB3 ASP B 381 22.890 22.649 35.970 1.00 0.00 H ATOM 6781 H ASP B 381 20.335 24.309 37.838 1.00 0.00 H ATOM 6782 N SER B 382 19.873 23.089 34.655 1.00 35.59 N ATOM 6783 CA SER B 382 19.280 22.643 33.401 1.00 35.97 C ATOM 6784 C SER B 382 18.801 23.807 32.528 1.00 35.33 C ATOM 6785 O SER B 382 18.926 23.731 31.310 1.00 35.41 O ATOM 6786 CB SER B 382 18.179 21.584 33.614 1.00 36.11 C ATOM 6787 OG SER B 382 17.092 22.108 34.348 1.00 38.37 O ATOM 6788 HA SER B 382 20.081 22.153 32.847 1.00 0.00 H ATOM 6789 HB2 SER B 382 18.600 20.739 34.159 1.00 0.00 H ATOM 6790 HB3 SER B 382 17.820 21.245 32.642 1.00 0.00 H ATOM 6791 HG SER B 382 17.410 22.413 35.235 1.00 0.00 H ATOM 6792 H SER B 382 19.430 22.818 35.556 1.00 0.00 H ATOM 6793 N ASP B 383 18.288 24.875 33.151 1.00 34.83 N ATOM 6794 CA ASP B 383 17.976 26.132 32.452 1.00 33.87 C ATOM 6795 C ASP B 383 19.253 26.809 31.928 1.00 33.50 C ATOM 6796 O ASP B 383 19.325 27.205 30.762 1.00 33.36 O ATOM 6797 CB ASP B 383 17.253 27.141 33.372 1.00 33.92 C ATOM 6798 CG ASP B 383 15.953 26.606 33.962 1.00 33.99 C ATOM 6799 OD1 ASP B 383 15.216 25.882 33.272 1.00 35.05 O ATOM 6800 OD2 ASP B 383 15.661 26.926 35.131 1.00 33.70 O ATOM 6801 HA ASP B 383 17.323 25.860 31.623 1.00 0.00 H ATOM 6802 HB2 ASP B 383 17.922 27.401 34.192 1.00 0.00 H ATOM 6803 HB3 ASP B 383 17.026 28.035 32.792 1.00 0.00 H ATOM 6804 H ASP B 383 18.102 24.814 34.172 1.00 0.00 H ATOM 6805 N LEU B 384 20.246 26.961 32.802 1.00 32.69 N ATOM 6806 CA LEU B 384 21.470 27.677 32.453 1.00 32.52 C ATOM 6807 C LEU B 384 22.280 26.999 31.337 1.00 32.31 C ATOM 6808 O LEU B 384 22.836 27.688 30.477 1.00 32.55 O ATOM 6809 CB LEU B 384 22.335 27.922 33.689 1.00 32.46 C ATOM 6810 CG LEU B 384 21.750 28.858 34.751 1.00 32.46 C ATOM 6811 CD1 LEU B 384 22.466 28.644 36.085 1.00 32.34 C ATOM 6812 CD2 LEU B 384 21.812 30.323 34.318 1.00 32.19 C ATOM 6813 HA LEU B 384 21.152 28.639 32.052 1.00 0.00 H ATOM 6814 HB2 LEU B 384 22.520 26.957 34.162 1.00 0.00 H ATOM 6815 HB3 LEU B 384 23.280 28.349 33.354 1.00 0.00 H ATOM 6816 HG LEU B 384 20.695 28.613 34.874 1.00 0.00 H ATOM 6817 HD21 LEU B 384 22.851 30.607 34.148 1.00 0.00 H ATOM 6818 HD22 LEU B 384 21.243 30.453 33.397 1.00 0.00 H ATOM 6819 HD23 LEU B 384 21.387 30.950 35.101 1.00 0.00 H ATOM 6820 HD11 LEU B 384 22.335 27.610 36.405 1.00 0.00 H ATOM 6821 HD12 LEU B 384 23.528 28.856 35.964 1.00 0.00 H ATOM 6822 HD13 LEU B 384 22.044 29.314 36.834 1.00 0.00 H ATOM 6823 H LEU B 384 20.147 26.560 33.757 1.00 0.00 H ATOM 6824 N ALA B 385 22.312 25.666 31.338 1.00 31.81 N ATOM 6825 CA ALA B 385 22.980 24.890 30.289 1.00 31.84 C ATOM 6826 C ALA B 385 22.562 25.344 28.880 1.00 31.58 C ATOM 6827 O ALA B 385 23.417 25.649 28.032 1.00 31.20 O ATOM 6828 CB ALA B 385 22.724 23.378 30.479 1.00 31.61 C ATOM 6829 HA ALA B 385 24.050 25.075 30.382 1.00 0.00 H ATOM 6830 HB1 ALA B 385 23.110 23.065 31.449 1.00 0.00 H ATOM 6831 HB2 ALA B 385 21.652 23.184 30.433 1.00 0.00 H ATOM 6832 HB3 ALA B 385 23.230 22.823 29.689 1.00 0.00 H ATOM 6833 H ALA B 385 21.844 25.156 32.114 1.00 0.00 H ATOM 6834 N ILE B 386 21.253 25.416 28.648 1.00 31.52 N ATOM 6835 CA ILE B 386 20.731 25.870 27.354 1.00 31.49 C ATOM 6836 C ILE B 386 21.015 27.360 27.122 1.00 31.55 C ATOM 6837 O ILE B 386 21.396 27.761 26.019 1.00 31.80 O ATOM 6838 CB ILE B 386 19.225 25.570 27.188 1.00 31.56 C ATOM 6839 CG1 ILE B 386 18.928 24.114 27.573 1.00 31.46 C ATOM 6840 CG2 ILE B 386 18.789 25.834 25.745 1.00 31.07 C ATOM 6841 CD1 ILE B 386 17.460 23.770 27.626 1.00 29.45 C ATOM 6842 HA ILE B 386 21.262 25.299 26.592 1.00 0.00 H ATOM 6843 HB ILE B 386 18.663 26.229 27.850 1.00 0.00 H ATOM 6844 HG12 ILE B 386 19.405 23.463 26.840 1.00 0.00 H ATOM 6845 HG13 ILE B 386 19.358 23.927 28.557 1.00 0.00 H ATOM 6846 HD11 ILE B 386 16.967 24.402 28.365 1.00 0.00 H ATOM 6847 HD12 ILE B 386 17.013 23.938 26.646 1.00 0.00 H ATOM 6848 HD13 ILE B 386 17.343 22.723 27.906 1.00 0.00 H ATOM 6849 HG21 ILE B 386 18.975 26.879 25.496 1.00 0.00 H ATOM 6850 HG22 ILE B 386 19.357 25.192 25.072 1.00 0.00 H ATOM 6851 HG23 ILE B 386 17.725 25.618 25.643 1.00 0.00 H ATOM 6852 H ILE B 386 20.587 25.145 29.399 1.00 0.00 H ATOM 6853 N PHE B 387 20.859 28.166 28.166 1.00 31.41 N ATOM 6854 CA PHE B 387 21.091 29.606 28.068 1.00 31.41 C ATOM 6855 C PHE B 387 22.521 29.920 27.644 1.00 31.32 C ATOM 6856 O PHE B 387 22.738 30.758 26.764 1.00 31.52 O ATOM 6857 CB PHE B 387 20.761 30.300 29.401 1.00 31.53 C ATOM 6858 CG PHE B 387 20.996 31.793 29.398 1.00 31.61 C ATOM 6859 CD1 PHE B 387 20.333 32.622 28.493 1.00 31.82 C ATOM 6860 CD2 PHE B 387 21.865 32.365 30.315 1.00 30.86 C ATOM 6861 CE1 PHE B 387 20.545 33.987 28.508 1.00 31.87 C ATOM 6862 CE2 PHE B 387 22.091 33.722 30.332 1.00 30.10 C ATOM 6863 CZ PHE B 387 21.433 34.541 29.429 1.00 31.50 C ATOM 6864 HA PHE B 387 20.425 29.992 27.296 1.00 0.00 H ATOM 6865 HB2 PHE B 387 19.711 30.120 29.630 1.00 0.00 H ATOM 6866 HB3 PHE B 387 21.382 29.858 30.180 1.00 0.00 H ATOM 6867 HD2 PHE B 387 22.378 31.728 31.035 1.00 0.00 H ATOM 6868 HE2 PHE B 387 22.786 34.151 31.054 1.00 0.00 H ATOM 6869 HZ PHE B 387 21.609 35.617 29.439 1.00 0.00 H ATOM 6870 HE1 PHE B 387 20.019 34.629 27.801 1.00 0.00 H ATOM 6871 HD1 PHE B 387 19.643 32.190 27.769 1.00 0.00 H ATOM 6872 H PHE B 387 20.564 27.762 29.078 1.00 0.00 H ATOM 6873 N ILE B 388 23.506 29.258 28.254 1.00 30.87 N ATOM 6874 CA ILE B 388 24.888 29.584 27.896 1.00 30.42 C ATOM 6875 C ILE B 388 25.199 29.161 26.453 1.00 29.83 C ATOM 6876 O ILE B 388 25.970 29.828 25.757 1.00 29.53 O ATOM 6877 CB ILE B 388 25.953 29.123 28.950 1.00 30.76 C ATOM 6878 CG1 ILE B 388 26.114 27.615 28.995 1.00 31.28 C ATOM 6879 CG2 ILE B 388 25.609 29.653 30.340 1.00 30.24 C ATOM 6880 CD1 ILE B 388 27.157 27.181 30.010 1.00 33.23 C ATOM 6881 HA ILE B 388 24.973 30.670 27.927 1.00 0.00 H ATOM 6882 HB ILE B 388 26.906 29.544 28.630 1.00 0.00 H ATOM 6883 HG12 ILE B 388 25.157 27.167 29.261 1.00 0.00 H ATOM 6884 HG13 ILE B 388 26.416 27.264 28.008 1.00 0.00 H ATOM 6885 HD11 ILE B 388 28.121 27.618 29.748 1.00 0.00 H ATOM 6886 HD12 ILE B 388 26.860 27.521 31.002 1.00 0.00 H ATOM 6887 HD13 ILE B 388 27.236 26.094 30.005 1.00 0.00 H ATOM 6888 HG21 ILE B 388 25.587 30.743 30.317 1.00 0.00 H ATOM 6889 HG22 ILE B 388 24.632 29.275 30.640 1.00 0.00 H ATOM 6890 HG23 ILE B 388 26.364 29.319 31.052 1.00 0.00 H ATOM 6891 H ILE B 388 23.297 28.529 28.966 1.00 0.00 H ATOM 6892 N ALA B 389 24.551 28.090 26.002 1.00 29.04 N ATOM 6893 CA ALA B 389 24.638 27.652 24.610 1.00 28.66 C ATOM 6894 C ALA B 389 24.077 28.698 23.635 1.00 28.72 C ATOM 6895 O ALA B 389 24.676 28.960 22.587 1.00 28.38 O ATOM 6896 CB ALA B 389 23.933 26.300 24.431 1.00 28.59 C ATOM 6897 HA ALA B 389 25.695 27.533 24.370 1.00 0.00 H ATOM 6898 HB1 ALA B 389 24.410 25.556 25.069 1.00 0.00 H ATOM 6899 HB2 ALA B 389 22.884 26.399 24.708 1.00 0.00 H ATOM 6900 HB3 ALA B 389 24.007 25.988 23.389 1.00 0.00 H ATOM 6901 H ALA B 389 23.962 27.545 26.663 1.00 0.00 H ATOM 6902 N VAL B 390 22.936 29.305 23.982 1.00 28.70 N ATOM 6903 CA VAL B 390 22.367 30.395 23.173 1.00 28.19 C ATOM 6904 C VAL B 390 23.387 31.525 23.070 1.00 28.30 C ATOM 6905 O VAL B 390 23.635 32.066 21.983 1.00 28.45 O ATOM 6906 CB VAL B 390 21.010 30.911 23.760 1.00 28.51 C ATOM 6907 CG1 VAL B 390 20.570 32.210 23.096 1.00 28.05 C ATOM 6908 CG2 VAL B 390 19.930 29.846 23.622 1.00 27.12 C ATOM 6909 HA VAL B 390 22.148 30.012 22.176 1.00 0.00 H ATOM 6910 HB VAL B 390 21.164 31.118 24.819 1.00 0.00 H ATOM 6911 HG11 VAL B 390 21.329 32.975 23.259 1.00 0.00 H ATOM 6912 HG12 VAL B 390 20.442 32.045 22.026 1.00 0.00 H ATOM 6913 HG13 VAL B 390 19.625 32.536 23.530 1.00 0.00 H ATOM 6914 HG21 VAL B 390 19.792 29.605 22.568 1.00 0.00 H ATOM 6915 HG22 VAL B 390 20.233 28.950 24.164 1.00 0.00 H ATOM 6916 HG23 VAL B 390 18.995 30.223 24.035 1.00 0.00 H ATOM 6917 H VAL B 390 22.440 28.999 24.843 1.00 0.00 H ATOM 6918 N ILE B 391 24.004 31.858 24.201 1.00 28.34 N ATOM 6919 CA ILE B 391 25.011 32.917 24.246 1.00 28.55 C ATOM 6920 C ILE B 391 26.186 32.619 23.311 1.00 28.96 C ATOM 6921 O ILE B 391 26.678 33.529 22.640 1.00 29.00 O ATOM 6922 CB ILE B 391 25.505 33.193 25.685 1.00 28.25 C ATOM 6923 CG1 ILE B 391 24.437 33.948 26.480 1.00 29.33 C ATOM 6924 CG2 ILE B 391 26.784 34.024 25.690 1.00 29.10 C ATOM 6925 CD1 ILE B 391 24.765 34.074 27.980 1.00 29.05 C ATOM 6926 HA ILE B 391 24.523 33.825 23.892 1.00 0.00 H ATOM 6927 HB ILE B 391 25.706 32.225 26.144 1.00 0.00 H ATOM 6928 HG12 ILE B 391 24.339 34.950 26.062 1.00 0.00 H ATOM 6929 HG13 ILE B 391 23.490 33.418 26.377 1.00 0.00 H ATOM 6930 HD11 ILE B 391 24.856 33.079 28.416 1.00 0.00 H ATOM 6931 HD12 ILE B 391 25.705 34.612 28.101 1.00 0.00 H ATOM 6932 HD13 ILE B 391 23.965 34.620 28.481 1.00 0.00 H ATOM 6933 HG21 ILE B 391 27.567 33.487 25.154 1.00 0.00 H ATOM 6934 HG22 ILE B 391 26.597 34.980 25.201 1.00 0.00 H ATOM 6935 HG23 ILE B 391 27.099 34.197 26.719 1.00 0.00 H ATOM 6936 H ILE B 391 23.763 31.351 25.077 1.00 0.00 H ATOM 6937 N ILE B 392 26.611 31.352 23.254 1.00 29.07 N ATOM 6938 CA ILE B 392 27.784 30.965 22.465 1.00 29.68 C ATOM 6939 C ILE B 392 27.540 31.131 20.961 1.00 29.79 C ATOM 6940 O ILE B 392 28.364 31.694 20.247 1.00 29.92 O ATOM 6941 CB ILE B 392 28.278 29.533 22.817 1.00 29.38 C ATOM 6942 CG1 ILE B 392 28.907 29.539 24.207 1.00 29.96 C ATOM 6943 CG2 ILE B 392 29.322 29.046 21.808 1.00 29.38 C ATOM 6944 CD1 ILE B 392 29.078 28.173 24.825 1.00 31.06 C ATOM 6945 HA ILE B 392 28.587 31.651 22.736 1.00 0.00 H ATOM 6946 HB ILE B 392 27.419 28.862 22.788 1.00 0.00 H ATOM 6947 HG12 ILE B 392 29.890 30.005 24.134 1.00 0.00 H ATOM 6948 HG13 ILE B 392 28.273 30.133 24.865 1.00 0.00 H ATOM 6949 HD11 ILE B 392 28.103 27.694 24.920 1.00 0.00 H ATOM 6950 HD12 ILE B 392 29.722 27.566 24.189 1.00 0.00 H ATOM 6951 HD13 ILE B 392 29.532 28.276 25.811 1.00 0.00 H ATOM 6952 HG21 ILE B 392 28.881 29.028 20.811 1.00 0.00 H ATOM 6953 HG22 ILE B 392 30.177 29.722 21.817 1.00 0.00 H ATOM 6954 HG23 ILE B 392 29.648 28.042 22.080 1.00 0.00 H ATOM 6955 H ILE B 392 26.095 30.621 23.784 1.00 0.00 H ATOM 6956 N LEU B 393 26.381 30.674 20.508 1.00 30.56 N ATOM 6957 CA LEU B 393 26.005 30.752 19.102 1.00 30.78 C ATOM 6958 C LEU B 393 25.294 32.044 18.684 1.00 31.23 C ATOM 6959 O LEU B 393 24.218 31.998 18.086 1.00 31.05 O ATOM 6960 CB LEU B 393 25.209 29.499 18.710 1.00 30.78 C ATOM 6961 CG LEU B 393 26.223 28.345 18.681 1.00 31.65 C ATOM 6962 CD1 LEU B 393 26.170 27.478 19.927 1.00 30.60 C ATOM 6963 CD2 LEU B 393 26.117 27.518 17.425 1.00 31.78 C ATOM 6964 HA LEU B 393 26.938 30.786 18.540 1.00 0.00 H ATOM 6965 HB2 LEU B 393 24.429 29.300 19.445 1.00 0.00 H ATOM 6966 HB3 LEU B 393 24.756 29.630 17.727 1.00 0.00 H ATOM 6967 HG LEU B 393 27.205 28.818 18.673 1.00 0.00 H ATOM 6968 HD21 LEU B 393 25.117 27.090 17.357 1.00 0.00 H ATOM 6969 HD22 LEU B 393 26.302 28.152 16.558 1.00 0.00 H ATOM 6970 HD23 LEU B 393 26.855 26.717 17.456 1.00 0.00 H ATOM 6971 HD11 LEU B 393 26.388 28.089 20.803 1.00 0.00 H ATOM 6972 HD12 LEU B 393 25.175 27.043 20.024 1.00 0.00 H ATOM 6973 HD13 LEU B 393 26.909 26.681 19.845 1.00 0.00 H ATOM 6974 H LEU B 393 25.715 30.244 21.181 1.00 0.00 H ATOM 6975 N SER B 394 25.916 33.189 18.971 1.00 31.88 N ATOM 6976 CA SER B 394 25.424 34.496 18.506 1.00 33.00 C ATOM 6977 C SER B 394 26.009 34.840 17.133 1.00 33.82 C ATOM 6978 O SER B 394 27.229 34.863 16.964 1.00 33.47 O ATOM 6979 CB SER B 394 25.811 35.617 19.477 1.00 32.74 C ATOM 6980 OG SER B 394 25.485 35.295 20.809 1.00 33.06 O ATOM 6981 HA SER B 394 24.338 34.420 18.447 1.00 0.00 H ATOM 6982 HB2 SER B 394 25.281 36.527 19.194 1.00 0.00 H ATOM 6983 HB3 SER B 394 26.885 35.788 19.408 1.00 0.00 H ATOM 6984 HG SER B 394 25.967 34.473 21.076 1.00 0.00 H ATOM 6985 H SER B 394 26.782 33.157 19.546 1.00 0.00 H ATOM 6986 N GLY B 395 25.135 35.138 16.175 1.00 34.45 N ATOM 6987 CA GLY B 395 25.543 35.424 14.807 1.00 35.55 C ATOM 6988 C GLY B 395 25.994 36.845 14.563 1.00 36.47 C ATOM 6989 O GLY B 395 26.417 37.182 13.450 1.00 36.82 O ATOM 6990 HA3 GLY B 395 24.697 35.219 14.151 1.00 0.00 H ATOM 6991 HA2 GLY B 395 26.368 34.758 14.553 1.00 0.00 H ATOM 6992 H GLY B 395 24.123 35.168 16.412 1.00 0.00 H ATOM 6993 N ASP B 396 25.924 37.681 15.596 1.00 36.78 N ATOM 6994 CA ASP B 396 26.328 39.074 15.466 1.00 37.43 C ATOM 6995 C ASP B 396 27.761 39.327 15.926 1.00 37.41 C ATOM 6996 O ASP B 396 28.202 40.474 15.984 1.00 37.57 O ATOM 6997 CB ASP B 396 25.334 40.018 16.182 1.00 38.13 C ATOM 6998 CG ASP B 396 25.366 39.875 17.706 1.00 39.45 C ATOM 6999 OD1 ASP B 396 25.718 38.791 18.204 1.00 40.94 O ATOM 7000 OD2 ASP B 396 25.029 40.853 18.411 1.00 41.08 O ATOM 7001 HA ASP B 396 26.304 39.299 14.400 1.00 0.00 H ATOM 7002 HB2 ASP B 396 25.584 41.047 15.924 1.00 0.00 H ATOM 7003 HB3 ASP B 396 24.327 39.792 15.833 1.00 0.00 H ATOM 7004 H ASP B 396 25.575 37.334 16.512 1.00 0.00 H ATOM 7005 N ARG B 397 28.500 38.270 16.247 1.00 37.30 N ATOM 7006 CA ARG B 397 29.895 38.464 16.627 1.00 37.34 C ATOM 7007 C ARG B 397 30.651 39.032 15.441 1.00 37.46 C ATOM 7008 O ARG B 397 30.399 38.639 14.310 1.00 37.78 O ATOM 7009 CB ARG B 397 30.556 37.166 17.094 1.00 36.96 C ATOM 7010 CG ARG B 397 29.848 36.473 18.232 1.00 36.56 C ATOM 7011 CD ARG B 397 29.648 37.356 19.461 1.00 34.43 C ATOM 7012 NE ARG B 397 29.132 36.541 20.558 1.00 35.83 N ATOM 7013 CZ ARG B 397 28.723 36.994 21.742 1.00 35.28 C ATOM 7014 NH1 ARG B 397 28.757 38.290 22.028 1.00 33.53 N ATOM 7015 NH2 ARG B 397 28.278 36.129 22.645 1.00 33.91 N ATOM 7016 HA ARG B 397 29.924 39.157 17.468 1.00 0.00 H ATOM 7017 HB2 ARG B 397 30.593 36.480 16.248 1.00 0.00 H ATOM 7018 HB3 ARG B 397 31.571 37.398 17.416 1.00 0.00 H ATOM 7019 HG2 ARG B 397 28.869 36.146 17.880 1.00 0.00 H ATOM 7020 HG3 ARG B 397 30.437 35.604 18.525 1.00 0.00 H ATOM 7021 HD2 ARG B 397 28.937 38.149 19.229 1.00 0.00 H ATOM 7022 HD3 ARG B 397 30.601 37.798 19.752 1.00 0.00 H ATOM 7023 HE ARG B 397 29.079 35.514 20.400 1.00 0.00 H ATOM 7024 HH12 ARG B 397 28.434 38.626 22.958 1.00 0.00 H ATOM 7025 HH11 ARG B 397 29.107 38.969 21.322 1.00 0.00 H ATOM 7026 HH22 ARG B 397 27.955 36.467 23.574 1.00 0.00 H ATOM 7027 HH21 ARG B 397 28.252 35.113 22.424 1.00 0.00 H ATOM 7028 H ARG B 397 28.088 37.315 16.227 1.00 0.00 H ATOM 7029 N PRO B 398 31.563 39.979 15.689 1.00 37.63 N ATOM 7030 CA PRO B 398 32.302 40.504 14.553 1.00 37.93 C ATOM 7031 C PRO B 398 33.283 39.482 13.969 1.00 38.00 C ATOM 7032 O PRO B 398 33.806 38.632 14.696 1.00 38.13 O ATOM 7033 CB PRO B 398 33.035 41.720 15.128 1.00 38.03 C ATOM 7034 CG PRO B 398 33.031 41.522 16.599 1.00 38.35 C ATOM 7035 CD PRO B 398 31.836 40.712 16.936 1.00 37.60 C ATOM 7036 HA PRO B 398 31.646 40.756 13.719 1.00 0.00 H ATOM 7037 HD3 PRO B 398 32.048 40.025 17.755 1.00 0.00 H ATOM 7038 HD2 PRO B 398 30.995 41.350 17.207 1.00 0.00 H ATOM 7039 HG3 PRO B 398 32.982 42.486 17.105 1.00 0.00 H ATOM 7040 HG2 PRO B 398 33.936 40.997 16.907 1.00 0.00 H ATOM 7041 HB2 PRO B 398 34.057 41.763 14.751 1.00 0.00 H ATOM 7042 HB3 PRO B 398 32.513 42.640 14.865 1.00 0.00 H ATOM 7043 N GLY B 399 33.483 39.562 12.653 1.00 37.88 N ATOM 7044 CA GLY B 399 34.443 38.731 11.935 1.00 37.39 C ATOM 7045 C GLY B 399 33.934 37.365 11.507 1.00 37.27 C ATOM 7046 O GLY B 399 34.681 36.595 10.915 1.00 37.20 O ATOM 7047 HA3 GLY B 399 35.307 38.580 12.582 1.00 0.00 H ATOM 7048 HA2 GLY B 399 34.751 39.271 11.039 1.00 0.00 H ATOM 7049 H GLY B 399 32.926 40.253 12.111 1.00 0.00 H ATOM 7050 N LEU B 400 32.672 37.053 11.788 1.00 36.92 N ATOM 7051 CA LEU B 400 32.144 35.738 11.422 1.00 37.13 C ATOM 7052 C LEU B 400 32.140 35.540 9.899 1.00 37.44 C ATOM 7053 O LEU B 400 31.938 36.498 9.140 1.00 37.68 O ATOM 7054 CB LEU B 400 30.752 35.500 12.032 1.00 36.76 C ATOM 7055 CG LEU B 400 30.676 35.201 13.541 1.00 36.71 C ATOM 7056 CD1 LEU B 400 29.221 35.093 14.024 1.00 34.92 C ATOM 7057 CD2 LEU B 400 31.447 33.915 13.911 1.00 35.39 C ATOM 7058 HA LEU B 400 32.812 34.987 11.844 1.00 0.00 H ATOM 7059 HB2 LEU B 400 30.157 36.394 11.846 1.00 0.00 H ATOM 7060 HB3 LEU B 400 30.307 34.654 11.509 1.00 0.00 H ATOM 7061 HG LEU B 400 31.149 36.043 14.047 1.00 0.00 H ATOM 7062 HD21 LEU B 400 31.020 33.069 13.372 1.00 0.00 H ATOM 7063 HD22 LEU B 400 32.496 34.030 13.637 1.00 0.00 H ATOM 7064 HD23 LEU B 400 31.368 33.741 14.984 1.00 0.00 H ATOM 7065 HD11 LEU B 400 28.705 36.034 13.833 1.00 0.00 H ATOM 7066 HD12 LEU B 400 28.720 34.287 13.487 1.00 0.00 H ATOM 7067 HD13 LEU B 400 29.209 34.882 15.093 1.00 0.00 H ATOM 7068 H LEU B 400 32.060 37.744 12.268 1.00 0.00 H ATOM 7069 N LEU B 401 32.371 34.302 9.462 1.00 37.30 N ATOM 7070 CA LEU B 401 32.425 33.982 8.034 1.00 37.23 C ATOM 7071 C LEU B 401 31.133 33.352 7.510 1.00 36.91 C ATOM 7072 O LEU B 401 30.684 33.657 6.409 1.00 37.16 O ATOM 7073 CB LEU B 401 33.625 33.068 7.716 1.00 37.12 C ATOM 7074 CG LEU B 401 35.032 33.619 7.970 1.00 37.59 C ATOM 7075 CD1 LEU B 401 36.059 32.503 7.829 1.00 38.66 C ATOM 7076 CD2 LEU B 401 35.375 34.802 7.058 1.00 36.25 C ATOM 7077 HA LEU B 401 32.550 34.934 7.518 1.00 0.00 H ATOM 7078 HB2 LEU B 401 33.515 32.166 8.318 1.00 0.00 H ATOM 7079 HB3 LEU B 401 33.564 32.807 6.659 1.00 0.00 H ATOM 7080 HG LEU B 401 35.056 34.002 8.990 1.00 0.00 H ATOM 7081 HD21 LEU B 401 35.322 34.484 6.017 1.00 0.00 H ATOM 7082 HD22 LEU B 401 34.663 35.609 7.229 1.00 0.00 H ATOM 7083 HD23 LEU B 401 36.383 35.151 7.282 1.00 0.00 H ATOM 7084 HD11 LEU B 401 35.843 31.718 8.554 1.00 0.00 H ATOM 7085 HD12 LEU B 401 36.010 32.091 6.821 1.00 0.00 H ATOM 7086 HD13 LEU B 401 37.056 32.904 8.011 1.00 0.00 H ATOM 7087 H LEU B 401 32.517 33.541 10.156 1.00 0.00 H ATOM 7088 N ASN B 402 30.555 32.451 8.287 1.00 36.64 N ATOM 7089 CA ASN B 402 29.349 31.762 7.869 1.00 36.52 C ATOM 7090 C ASN B 402 28.270 31.866 8.941 1.00 36.77 C ATOM 7091 O ASN B 402 28.075 30.941 9.735 1.00 36.47 O ATOM 7092 CB ASN B 402 29.646 30.299 7.512 1.00 36.01 C ATOM 7093 CG ASN B 402 28.484 29.627 6.796 1.00 36.10 C ATOM 7094 OD1 ASN B 402 27.463 30.262 6.509 1.00 36.16 O ATOM 7095 ND2 ASN B 402 28.627 28.339 6.510 1.00 34.52 N ATOM 7096 HA ASN B 402 28.973 32.248 6.969 1.00 0.00 H ATOM 7097 HB2 ASN B 402 30.522 30.268 6.864 1.00 0.00 H ATOM 7098 HB3 ASN B 402 29.856 29.750 8.430 1.00 0.00 H ATOM 7099 HD22 ASN B 402 29.503 27.843 6.770 1.00 0.00 H ATOM 7100 HD21 ASN B 402 27.863 27.826 6.026 1.00 0.00 H ATOM 7101 H ASN B 402 30.973 32.233 9.214 1.00 0.00 H ATOM 7102 N VAL B 403 27.577 33.004 8.947 1.00 37.15 N ATOM 7103 CA VAL B 403 26.568 33.305 9.965 1.00 37.75 C ATOM 7104 C VAL B 403 25.367 32.357 9.931 1.00 38.28 C ATOM 7105 O VAL B 403 24.760 32.097 10.969 1.00 39.06 O ATOM 7106 CB VAL B 403 26.100 34.776 9.877 1.00 37.83 C ATOM 7107 CG1 VAL B 403 25.024 35.075 10.918 1.00 37.19 C ATOM 7108 CG2 VAL B 403 27.294 35.728 10.031 1.00 36.75 C ATOM 7109 HA VAL B 403 27.062 33.148 10.924 1.00 0.00 H ATOM 7110 HB VAL B 403 25.659 34.935 8.893 1.00 0.00 H ATOM 7111 HG11 VAL B 403 24.166 34.425 10.748 1.00 0.00 H ATOM 7112 HG12 VAL B 403 25.425 34.896 11.915 1.00 0.00 H ATOM 7113 HG13 VAL B 403 24.716 36.117 10.831 1.00 0.00 H ATOM 7114 HG21 VAL B 403 27.766 35.563 10.999 1.00 0.00 H ATOM 7115 HG22 VAL B 403 28.015 35.536 9.236 1.00 0.00 H ATOM 7116 HG23 VAL B 403 26.946 36.759 9.966 1.00 0.00 H ATOM 7117 H VAL B 403 27.759 33.705 8.201 1.00 0.00 H ATOM 7118 N LYS B 404 25.045 31.808 8.764 1.00 38.57 N ATOM 7119 CA LYS B 404 23.839 30.974 8.625 1.00 38.82 C ATOM 7120 C LYS B 404 23.722 29.791 9.598 1.00 38.45 C ATOM 7121 O LYS B 404 22.739 29.725 10.340 1.00 38.86 O ATOM 7122 CB LYS B 404 23.629 30.504 7.171 1.00 39.32 C ATOM 7123 CG LYS B 404 22.492 29.487 6.998 1.00 40.14 C ATOM 7124 CD LYS B 404 21.817 29.619 5.638 1.00 42.57 C ATOM 7125 CE LYS B 404 20.568 28.772 5.565 1.00 44.22 C ATOM 7126 NZ LYS B 404 20.930 27.340 5.413 1.00 46.42 N ATOM 7127 HA LYS B 404 23.033 31.650 8.911 1.00 0.00 H ATOM 7128 HB2 LYS B 404 23.404 31.377 6.558 1.00 0.00 H ATOM 7129 HB3 LYS B 404 24.554 30.046 6.822 1.00 0.00 H ATOM 7130 HG2 LYS B 404 22.900 28.481 7.093 1.00 0.00 H ATOM 7131 HG3 LYS B 404 21.749 29.652 7.778 1.00 0.00 H ATOM 7132 HD2 LYS B 404 21.550 30.663 5.473 1.00 0.00 H ATOM 7133 HD3 LYS B 404 22.512 29.296 4.863 1.00 0.00 H ATOM 7134 HE2 LYS B 404 19.969 29.085 4.710 1.00 0.00 H ATOM 7135 HE3 LYS B 404 19.990 28.903 6.480 1.00 0.00 H ATOM 7136 HZ1 LYS B 404 21.480 27.214 4.539 1.00 0.00 H ATOM 7137 HZ2 LYS B 404 21.500 27.039 6.229 1.00 0.00 H ATOM 7138 HZ3 LYS B 404 20.063 26.768 5.364 1.00 0.00 H ATOM 7139 H LYS B 404 25.654 31.970 7.937 1.00 0.00 H ATOM 7140 N PRO B 405 24.694 28.845 9.587 1.00 38.01 N ATOM 7141 CA PRO B 405 24.539 27.674 10.463 1.00 37.52 C ATOM 7142 C PRO B 405 24.592 28.024 11.948 1.00 37.28 C ATOM 7143 O PRO B 405 24.045 27.292 12.762 1.00 37.08 O ATOM 7144 CB PRO B 405 25.711 26.763 10.067 1.00 37.17 C ATOM 7145 CG PRO B 405 26.700 27.668 9.410 1.00 37.33 C ATOM 7146 CD PRO B 405 25.899 28.734 8.740 1.00 38.04 C ATOM 7147 HA PRO B 405 23.563 27.206 10.334 1.00 0.00 H ATOM 7148 HD3 PRO B 405 26.447 29.676 8.716 1.00 0.00 H ATOM 7149 HD2 PRO B 405 25.635 28.443 7.723 1.00 0.00 H ATOM 7150 HG3 PRO B 405 27.288 27.118 8.676 1.00 0.00 H ATOM 7151 HG2 PRO B 405 27.366 28.105 10.154 1.00 0.00 H ATOM 7152 HB2 PRO B 405 26.147 26.294 10.949 1.00 0.00 H ATOM 7153 HB3 PRO B 405 25.379 25.990 9.374 1.00 0.00 H ATOM 7154 N ILE B 406 25.221 29.145 12.288 1.00 37.38 N ATOM 7155 CA ILE B 406 25.220 29.638 13.665 1.00 37.53 C ATOM 7156 C ILE B 406 23.798 30.021 14.104 1.00 38.08 C ATOM 7157 O ILE B 406 23.293 29.513 15.113 1.00 37.64 O ATOM 7158 CB ILE B 406 26.205 30.804 13.848 1.00 37.28 C ATOM 7159 CG1 ILE B 406 27.641 30.292 13.690 1.00 36.94 C ATOM 7160 CG2 ILE B 406 26.005 31.475 15.208 1.00 36.90 C ATOM 7161 CD1 ILE B 406 28.679 31.356 13.509 1.00 35.81 C ATOM 7162 HA ILE B 406 25.562 28.830 14.312 1.00 0.00 H ATOM 7163 HB ILE B 406 26.015 31.555 13.082 1.00 0.00 H ATOM 7164 HG12 ILE B 406 27.896 29.720 14.582 1.00 0.00 H ATOM 7165 HG13 ILE B 406 27.672 29.638 12.819 1.00 0.00 H ATOM 7166 HD11 ILE B 406 28.453 31.933 12.612 1.00 0.00 H ATOM 7167 HD12 ILE B 406 28.677 32.015 14.377 1.00 0.00 H ATOM 7168 HD13 ILE B 406 29.660 30.891 13.406 1.00 0.00 H ATOM 7169 HG21 ILE B 406 24.987 31.860 15.276 1.00 0.00 H ATOM 7170 HG22 ILE B 406 26.172 30.745 16.000 1.00 0.00 H ATOM 7171 HG23 ILE B 406 26.713 32.297 15.314 1.00 0.00 H ATOM 7172 H ILE B 406 25.726 29.685 11.557 1.00 0.00 H ATOM 7173 N GLU B 407 23.160 30.900 13.330 1.00 38.73 N ATOM 7174 CA GLU B 407 21.766 31.293 13.561 1.00 39.24 C ATOM 7175 C GLU B 407 20.820 30.105 13.511 1.00 39.15 C ATOM 7176 O GLU B 407 19.881 30.053 14.288 1.00 39.41 O ATOM 7177 CB GLU B 407 21.319 32.387 12.581 1.00 39.44 C ATOM 7178 CG GLU B 407 21.904 33.754 12.903 1.00 41.38 C ATOM 7179 CD GLU B 407 21.451 34.871 11.964 1.00 44.82 C ATOM 7180 OE1 GLU B 407 21.042 34.583 10.812 1.00 45.00 O ATOM 7181 OE2 GLU B 407 21.538 36.052 12.386 1.00 45.62 O ATOM 7182 HA GLU B 407 21.721 31.703 14.570 1.00 0.00 H ATOM 7183 HB2 GLU B 407 21.634 32.103 11.577 1.00 0.00 H ATOM 7184 HB3 GLU B 407 20.232 32.459 12.613 1.00 0.00 H ATOM 7185 HG2 GLU B 407 21.609 34.021 13.918 1.00 0.00 H ATOM 7186 HG3 GLU B 407 22.990 33.682 12.848 1.00 0.00 H ATOM 7187 H GLU B 407 23.672 31.324 12.530 1.00 0.00 H ATOM 7188 N ASP B 408 21.075 29.144 12.619 1.00 39.40 N ATOM 7189 CA ASP B 408 20.288 27.903 12.572 1.00 39.35 C ATOM 7190 C ASP B 408 20.342 27.133 13.900 1.00 39.13 C ATOM 7191 O ASP B 408 19.321 26.613 14.369 1.00 39.05 O ATOM 7192 CB ASP B 408 20.773 26.975 11.453 1.00 39.71 C ATOM 7193 CG ASP B 408 20.316 27.411 10.056 1.00 41.03 C ATOM 7194 OD1 ASP B 408 19.575 28.414 9.914 1.00 41.43 O ATOM 7195 OD2 ASP B 408 20.719 26.724 9.085 1.00 42.57 O ATOM 7196 HA ASP B 408 19.259 28.208 12.379 1.00 0.00 H ATOM 7197 HB2 ASP B 408 21.863 26.955 11.469 1.00 0.00 H ATOM 7198 HB3 ASP B 408 20.389 25.973 11.645 1.00 0.00 H ATOM 7199 H ASP B 408 21.851 29.277 11.940 1.00 0.00 H ATOM 7200 N ILE B 409 21.534 27.043 14.490 1.00 38.47 N ATOM 7201 CA ILE B 409 21.710 26.318 15.749 1.00 37.87 C ATOM 7202 C ILE B 409 21.109 27.097 16.929 1.00 37.80 C ATOM 7203 O ILE B 409 20.426 26.522 17.775 1.00 37.57 O ATOM 7204 CB ILE B 409 23.198 25.920 16.006 1.00 37.74 C ATOM 7205 CG1 ILE B 409 23.727 25.068 14.839 1.00 37.58 C ATOM 7206 CG2 ILE B 409 23.343 25.156 17.334 1.00 36.34 C ATOM 7207 CD1 ILE B 409 25.248 24.813 14.841 1.00 36.67 C ATOM 7208 HA ILE B 409 21.158 25.383 15.659 1.00 0.00 H ATOM 7209 HB ILE B 409 23.789 26.833 16.075 1.00 0.00 H ATOM 7210 HG12 ILE B 409 23.224 24.102 14.873 1.00 0.00 H ATOM 7211 HG13 ILE B 409 23.472 25.576 13.909 1.00 0.00 H ATOM 7212 HD11 ILE B 409 25.775 25.766 14.791 1.00 0.00 H ATOM 7213 HD12 ILE B 409 25.526 24.290 15.756 1.00 0.00 H ATOM 7214 HD13 ILE B 409 25.514 24.204 13.977 1.00 0.00 H ATOM 7215 HG21 ILE B 409 23.003 25.788 18.154 1.00 0.00 H ATOM 7216 HG22 ILE B 409 22.739 24.249 17.298 1.00 0.00 H ATOM 7217 HG23 ILE B 409 24.389 24.891 17.487 1.00 0.00 H ATOM 7218 H ILE B 409 22.357 27.498 14.046 1.00 0.00 H ATOM 7219 N GLN B 410 21.339 28.406 16.961 1.00 37.89 N ATOM 7220 CA GLN B 410 20.810 29.241 18.028 1.00 38.39 C ATOM 7221 C GLN B 410 19.282 29.231 18.059 1.00 39.11 C ATOM 7222 O GLN B 410 18.698 29.179 19.132 1.00 38.99 O ATOM 7223 CB GLN B 410 21.324 30.671 17.927 1.00 38.05 C ATOM 7224 CG GLN B 410 21.206 31.427 19.247 1.00 37.32 C ATOM 7225 CD GLN B 410 21.327 32.914 19.084 1.00 36.08 C ATOM 7226 OE1 GLN B 410 20.758 33.491 18.165 1.00 36.87 O ATOM 7227 NE2 GLN B 410 22.068 33.552 19.981 1.00 36.00 N ATOM 7228 HA GLN B 410 21.168 28.811 18.963 1.00 0.00 H ATOM 7229 HB2 GLN B 410 22.373 30.646 17.630 1.00 0.00 H ATOM 7230 HB3 GLN B 410 20.745 31.198 17.169 1.00 0.00 H ATOM 7231 HG2 GLN B 410 20.235 31.204 19.690 1.00 0.00 H ATOM 7232 HG3 GLN B 410 21.996 31.085 19.915 1.00 0.00 H ATOM 7233 HE22 GLN B 410 22.533 33.020 20.745 1.00 0.00 H ATOM 7234 HE21 GLN B 410 22.184 34.584 19.921 1.00 0.00 H ATOM 7235 H GLN B 410 21.909 28.842 16.208 1.00 0.00 H ATOM 7236 N ASP B 411 18.651 29.277 16.883 1.00 39.94 N ATOM 7237 CA ASP B 411 17.197 29.167 16.764 1.00 40.98 C ATOM 7238 C ASP B 411 16.692 27.865 17.373 1.00 40.69 C ATOM 7239 O ASP B 411 15.698 27.863 18.095 1.00 41.04 O ATOM 7240 CB ASP B 411 16.746 29.294 15.299 1.00 41.74 C ATOM 7241 CG ASP B 411 16.908 30.709 14.753 1.00 44.40 C ATOM 7242 OD1 ASP B 411 17.239 31.632 15.537 1.00 47.63 O ATOM 7243 OD2 ASP B 411 16.709 30.904 13.533 1.00 47.65 O ATOM 7244 HA ASP B 411 16.759 29.994 17.323 1.00 0.00 H ATOM 7245 HB2 ASP B 411 17.343 28.615 14.690 1.00 0.00 H ATOM 7246 HB3 ASP B 411 15.695 29.012 15.232 1.00 0.00 H ATOM 7247 H ASP B 411 19.215 29.396 16.018 1.00 0.00 H ATOM 7248 N ASN B 412 17.389 26.768 17.093 1.00 40.29 N ATOM 7249 CA ASN B 412 17.059 25.480 17.691 1.00 40.25 C ATOM 7250 C ASN B 412 17.303 25.436 19.205 1.00 39.39 C ATOM 7251 O ASN B 412 16.531 24.825 19.936 1.00 39.40 O ATOM 7252 CB ASN B 412 17.828 24.359 16.995 1.00 40.99 C ATOM 7253 CG ASN B 412 17.328 22.980 17.382 1.00 43.40 C ATOM 7254 OD1 ASN B 412 16.152 22.801 17.709 1.00 47.27 O ATOM 7255 ND2 ASN B 412 18.218 21.992 17.337 1.00 45.03 N ATOM 7256 HA ASN B 412 15.989 25.335 17.545 1.00 0.00 H ATOM 7257 HB2 ASN B 412 17.721 24.479 15.917 1.00 0.00 H ATOM 7258 HB3 ASN B 412 18.881 24.437 17.266 1.00 0.00 H ATOM 7259 HD22 ASN B 412 19.200 22.189 17.056 1.00 0.00 H ATOM 7260 HD21 ASN B 412 17.932 21.023 17.583 1.00 0.00 H ATOM 7261 H ASN B 412 18.189 26.830 16.431 1.00 0.00 H ATOM 7262 N LEU B 413 18.376 26.081 19.663 1.00 38.41 N ATOM 7263 CA LEU B 413 18.670 26.209 21.096 1.00 37.56 C ATOM 7264 C LEU B 413 17.644 27.099 21.798 1.00 37.13 C ATOM 7265 O LEU B 413 17.235 26.800 22.913 1.00 36.51 O ATOM 7266 CB LEU B 413 20.087 26.764 21.324 1.00 37.03 C ATOM 7267 CG LEU B 413 21.283 25.905 20.879 1.00 36.68 C ATOM 7268 CD1 LEU B 413 22.560 26.727 20.856 1.00 36.37 C ATOM 7269 CD2 LEU B 413 21.452 24.681 21.749 1.00 35.94 C ATOM 7270 HA LEU B 413 18.612 25.209 21.527 1.00 0.00 H ATOM 7271 HB2 LEU B 413 20.153 27.712 20.790 1.00 0.00 H ATOM 7272 HB3 LEU B 413 20.197 26.942 22.394 1.00 0.00 H ATOM 7273 HG LEU B 413 21.074 25.560 19.866 1.00 0.00 H ATOM 7274 HD21 LEU B 413 21.618 24.990 22.781 1.00 0.00 H ATOM 7275 HD22 LEU B 413 20.552 24.069 21.692 1.00 0.00 H ATOM 7276 HD23 LEU B 413 22.308 24.104 21.399 1.00 0.00 H ATOM 7277 HD11 LEU B 413 22.444 27.557 20.158 1.00 0.00 H ATOM 7278 HD12 LEU B 413 22.759 27.116 21.855 1.00 0.00 H ATOM 7279 HD13 LEU B 413 23.391 26.097 20.538 1.00 0.00 H ATOM 7280 H LEU B 413 19.031 26.510 18.978 1.00 0.00 H ATOM 7281 N LEU B 414 17.241 28.179 21.127 1.00 37.09 N ATOM 7282 CA LEU B 414 16.222 29.113 21.625 1.00 37.44 C ATOM 7283 C LEU B 414 14.876 28.422 21.828 1.00 37.41 C ATOM 7284 O LEU B 414 14.231 28.612 22.857 1.00 37.58 O ATOM 7285 CB LEU B 414 16.073 30.316 20.681 1.00 37.35 C ATOM 7286 CG LEU B 414 17.118 31.415 20.861 1.00 38.12 C ATOM 7287 CD1 LEU B 414 17.206 32.348 19.647 1.00 37.90 C ATOM 7288 CD2 LEU B 414 16.876 32.197 22.160 1.00 37.92 C ATOM 7289 HA LEU B 414 16.560 29.475 22.596 1.00 0.00 H ATOM 7290 HB2 LEU B 414 16.139 29.951 19.656 1.00 0.00 H ATOM 7291 HB3 LEU B 414 15.089 30.755 20.846 1.00 0.00 H ATOM 7292 HG LEU B 414 18.088 30.923 20.939 1.00 0.00 H ATOM 7293 HD21 LEU B 414 15.888 32.655 22.128 1.00 0.00 H ATOM 7294 HD22 LEU B 414 16.934 31.516 23.009 1.00 0.00 H ATOM 7295 HD23 LEU B 414 17.635 32.973 22.262 1.00 0.00 H ATOM 7296 HD11 LEU B 414 17.476 31.769 18.764 1.00 0.00 H ATOM 7297 HD12 LEU B 414 16.240 32.826 19.487 1.00 0.00 H ATOM 7298 HD13 LEU B 414 17.964 33.110 19.830 1.00 0.00 H ATOM 7299 H LEU B 414 17.672 28.371 20.200 1.00 0.00 H ATOM 7300 N GLN B 415 14.480 27.602 20.857 1.00 37.94 N ATOM 7301 CA GLN B 415 13.277 26.769 20.961 1.00 38.60 C ATOM 7302 C GLN B 415 13.352 25.820 22.148 1.00 38.66 C ATOM 7303 O GLN B 415 12.354 25.602 22.843 1.00 38.57 O ATOM 7304 CB GLN B 415 13.080 25.938 19.694 1.00 38.73 C ATOM 7305 CG GLN B 415 12.367 26.638 18.553 1.00 41.18 C ATOM 7306 CD GLN B 415 12.077 25.689 17.394 1.00 43.30 C ATOM 7307 OE1 GLN B 415 12.906 25.503 16.496 1.00 45.09 O ATOM 7308 NE2 GLN B 415 10.903 25.087 17.411 1.00 43.28 N ATOM 7309 HA GLN B 415 12.437 27.450 21.097 1.00 0.00 H ATOM 7310 HB2 GLN B 415 14.064 25.632 19.337 1.00 0.00 H ATOM 7311 HB3 GLN B 415 12.500 25.054 19.960 1.00 0.00 H ATOM 7312 HG2 GLN B 415 11.424 27.042 18.922 1.00 0.00 H ATOM 7313 HG3 GLN B 415 12.994 27.453 18.193 1.00 0.00 H ATOM 7314 HE22 GLN B 415 10.235 25.272 18.186 1.00 0.00 H ATOM 7315 HE21 GLN B 415 10.646 24.427 16.649 1.00 0.00 H ATOM 7316 H GLN B 415 15.048 27.550 19.987 1.00 0.00 H ATOM 7317 N ALA B 416 14.536 25.247 22.362 1.00 38.72 N ATOM 7318 CA ALA B 416 14.755 24.305 23.459 1.00 38.70 C ATOM 7319 C ALA B 416 14.707 25.014 24.806 1.00 38.58 C ATOM 7320 O ALA B 416 14.221 24.449 25.782 1.00 38.67 O ATOM 7321 CB ALA B 416 16.080 23.574 23.290 1.00 38.42 C ATOM 7322 HA ALA B 416 13.951 23.570 23.432 1.00 0.00 H ATOM 7323 HB1 ALA B 416 16.072 23.023 22.350 1.00 0.00 H ATOM 7324 HB2 ALA B 416 16.895 24.298 23.281 1.00 0.00 H ATOM 7325 HB3 ALA B 416 16.219 22.880 24.119 1.00 0.00 H ATOM 7326 H ALA B 416 15.329 25.477 21.729 1.00 0.00 H ATOM 7327 N LEU B 417 15.220 26.243 24.850 1.00 38.49 N ATOM 7328 CA LEU B 417 15.230 27.037 26.078 1.00 38.88 C ATOM 7329 C LEU B 417 13.807 27.424 26.477 1.00 39.60 C ATOM 7330 O LEU B 417 13.451 27.373 27.653 1.00 39.71 O ATOM 7331 CB LEU B 417 16.093 28.294 25.914 1.00 38.36 C ATOM 7332 CG LEU B 417 16.188 29.286 27.085 1.00 37.48 C ATOM 7333 CD1 LEU B 417 16.658 28.598 28.359 1.00 34.88 C ATOM 7334 CD2 LEU B 417 17.100 30.449 26.733 1.00 36.09 C ATOM 7335 HA LEU B 417 15.663 26.425 26.869 1.00 0.00 H ATOM 7336 HB2 LEU B 417 17.107 27.960 25.694 1.00 0.00 H ATOM 7337 HB3 LEU B 417 15.699 28.844 25.059 1.00 0.00 H ATOM 7338 HG LEU B 417 15.188 29.678 27.270 1.00 0.00 H ATOM 7339 HD21 LEU B 417 18.098 30.072 26.509 1.00 0.00 H ATOM 7340 HD22 LEU B 417 16.703 30.970 25.862 1.00 0.00 H ATOM 7341 HD23 LEU B 417 17.151 31.137 27.577 1.00 0.00 H ATOM 7342 HD11 LEU B 417 15.952 27.812 28.627 1.00 0.00 H ATOM 7343 HD12 LEU B 417 17.643 28.163 28.193 1.00 0.00 H ATOM 7344 HD13 LEU B 417 16.714 29.329 29.166 1.00 0.00 H ATOM 7345 H LEU B 417 15.626 26.650 23.984 1.00 0.00 H ATOM 7346 N GLU B 418 13.014 27.806 25.478 1.00 40.35 N ATOM 7347 CA GLU B 418 11.634 28.235 25.662 1.00 41.08 C ATOM 7348 C GLU B 418 10.773 27.116 26.239 1.00 40.89 C ATOM 7349 O GLU B 418 10.060 27.332 27.215 1.00 41.06 O ATOM 7350 CB GLU B 418 11.063 28.759 24.336 1.00 41.49 C ATOM 7351 CG GLU B 418 9.647 29.341 24.423 1.00 43.52 C ATOM 7352 CD GLU B 418 9.143 29.881 23.090 1.00 45.52 C ATOM 7353 OE1 GLU B 418 9.376 29.240 22.040 1.00 45.29 O ATOM 7354 OE2 GLU B 418 8.506 30.957 23.100 1.00 48.21 O ATOM 7355 HA GLU B 418 11.621 29.049 26.387 1.00 0.00 H ATOM 7356 HB2 GLU B 418 11.728 29.540 23.967 1.00 0.00 H ATOM 7357 HB3 GLU B 418 11.046 27.933 23.625 1.00 0.00 H ATOM 7358 HG2 GLU B 418 8.969 28.557 24.759 1.00 0.00 H ATOM 7359 HG3 GLU B 418 9.649 30.154 25.149 1.00 0.00 H ATOM 7360 H GLU B 418 13.401 27.798 24.513 1.00 0.00 H ATOM 7361 N LEU B 419 10.862 25.922 25.655 1.00 40.81 N ATOM 7362 CA LEU B 419 10.130 24.763 26.161 1.00 40.37 C ATOM 7363 C LEU B 419 10.619 24.353 27.563 1.00 40.35 C ATOM 7364 O LEU B 419 9.811 24.024 28.438 1.00 40.57 O ATOM 7365 CB LEU B 419 10.202 23.592 25.169 1.00 40.27 C ATOM 7366 CG LEU B 419 9.405 22.302 25.448 1.00 39.98 C ATOM 7367 CD1 LEU B 419 7.900 22.557 25.389 1.00 40.52 C ATOM 7368 CD2 LEU B 419 9.778 21.187 24.470 1.00 39.41 C ATOM 7369 HA LEU B 419 9.083 25.048 26.260 1.00 0.00 H ATOM 7370 HB2 LEU B 419 9.861 23.972 24.206 1.00 0.00 H ATOM 7371 HB3 LEU B 419 11.251 23.305 25.094 1.00 0.00 H ATOM 7372 HG LEU B 419 9.668 21.980 26.456 1.00 0.00 H ATOM 7373 HD21 LEU B 419 9.563 21.512 23.452 1.00 0.00 H ATOM 7374 HD22 LEU B 419 10.841 20.963 24.565 1.00 0.00 H ATOM 7375 HD23 LEU B 419 9.195 20.295 24.699 1.00 0.00 H ATOM 7376 HD11 LEU B 419 7.629 23.302 26.137 1.00 0.00 H ATOM 7377 HD12 LEU B 419 7.633 22.923 24.397 1.00 0.00 H ATOM 7378 HD13 LEU B 419 7.367 21.628 25.590 1.00 0.00 H ATOM 7379 H LEU B 419 11.468 25.812 24.817 1.00 0.00 H ATOM 7380 N GLN B 420 11.935 24.386 27.768 1.00 39.94 N ATOM 7381 CA GLN B 420 12.541 24.096 29.072 1.00 39.55 C ATOM 7382 C GLN B 420 11.961 24.984 30.184 1.00 39.67 C ATOM 7383 O GLN B 420 11.506 24.481 31.212 1.00 39.45 O ATOM 7384 CB GLN B 420 14.066 24.253 28.989 1.00 39.29 C ATOM 7385 CG GLN B 420 14.811 24.265 30.326 1.00 38.47 C ATOM 7386 CD GLN B 420 14.736 22.949 31.078 1.00 36.50 C ATOM 7387 OE1 GLN B 420 14.569 21.886 30.484 1.00 36.53 O ATOM 7388 NE2 GLN B 420 14.871 23.016 32.392 1.00 35.38 N ATOM 7389 HA GLN B 420 12.303 23.064 29.330 1.00 0.00 H ATOM 7390 HB2 GLN B 420 14.455 23.425 28.397 1.00 0.00 H ATOM 7391 HB3 GLN B 420 14.278 25.193 28.480 1.00 0.00 H ATOM 7392 HG2 GLN B 420 15.860 24.493 30.134 1.00 0.00 H ATOM 7393 HG3 GLN B 420 14.380 25.045 30.953 1.00 0.00 H ATOM 7394 HE22 GLN B 420 15.011 23.937 32.854 1.00 0.00 H ATOM 7395 HE21 GLN B 420 14.838 22.148 32.963 1.00 0.00 H ATOM 7396 H GLN B 420 12.558 24.627 26.971 1.00 0.00 H ATOM 7397 N LEU B 421 11.967 26.295 29.953 1.00 39.81 N ATOM 7398 CA LEU B 421 11.420 27.275 30.892 1.00 40.37 C ATOM 7399 C LEU B 421 9.912 27.126 31.129 1.00 41.14 C ATOM 7400 O LEU B 421 9.437 27.307 32.247 1.00 40.93 O ATOM 7401 CB LEU B 421 11.758 28.701 30.433 1.00 40.10 C ATOM 7402 CG LEU B 421 13.258 29.044 30.377 1.00 39.59 C ATOM 7403 CD1 LEU B 421 13.479 30.461 29.882 1.00 38.90 C ATOM 7404 CD2 LEU B 421 13.917 28.837 31.736 1.00 38.62 C ATOM 7405 HA LEU B 421 11.896 27.077 31.853 1.00 0.00 H ATOM 7406 HB2 LEU B 421 11.345 28.839 29.434 1.00 0.00 H ATOM 7407 HB3 LEU B 421 11.280 29.397 31.122 1.00 0.00 H ATOM 7408 HG LEU B 421 13.726 28.364 29.666 1.00 0.00 H ATOM 7409 HD21 LEU B 421 13.438 29.482 32.473 1.00 0.00 H ATOM 7410 HD22 LEU B 421 13.807 27.795 32.037 1.00 0.00 H ATOM 7411 HD23 LEU B 421 14.976 29.087 31.667 1.00 0.00 H ATOM 7412 HD11 LEU B 421 13.061 30.564 28.881 1.00 0.00 H ATOM 7413 HD12 LEU B 421 12.987 31.161 30.557 1.00 0.00 H ATOM 7414 HD13 LEU B 421 14.548 30.672 29.854 1.00 0.00 H ATOM 7415 H LEU B 421 12.380 26.639 29.063 1.00 0.00 H ATOM 7416 N LYS B 422 9.175 26.779 30.078 1.00 42.20 N ATOM 7417 CA LYS B 422 7.736 26.566 30.180 1.00 43.58 C ATOM 7418 C LYS B 422 7.377 25.313 30.982 1.00 44.00 C ATOM 7419 O LYS B 422 6.395 25.308 31.712 1.00 44.14 O ATOM 7420 CB LYS B 422 7.089 26.550 28.793 1.00 43.77 C ATOM 7421 CG LYS B 422 6.846 27.955 28.265 1.00 45.28 C ATOM 7422 CD LYS B 422 6.316 27.988 26.840 1.00 47.36 C ATOM 7423 CE LYS B 422 5.707 29.365 26.559 1.00 48.03 C ATOM 7424 NZ LYS B 422 5.402 29.583 25.124 1.00 48.96 N ATOM 7425 HA LYS B 422 7.329 27.409 30.738 1.00 0.00 H ATOM 7426 HB2 LYS B 422 7.747 26.023 28.103 1.00 0.00 H ATOM 7427 HB3 LYS B 422 6.135 26.026 28.855 1.00 0.00 H ATOM 7428 HG2 LYS B 422 6.121 28.446 28.914 1.00 0.00 H ATOM 7429 HG3 LYS B 422 7.788 28.502 28.295 1.00 0.00 H ATOM 7430 HD2 LYS B 422 7.133 27.801 26.143 1.00 0.00 H ATOM 7431 HD3 LYS B 422 5.553 27.220 26.717 1.00 0.00 H ATOM 7432 HE2 LYS B 422 6.412 30.130 26.884 1.00 0.00 H ATOM 7433 HE3 LYS B 422 4.783 29.459 27.129 1.00 0.00 H ATOM 7434 HZ1 LYS B 422 6.278 29.506 24.569 1.00 0.00 H ATOM 7435 HZ2 LYS B 422 4.722 28.865 24.802 1.00 0.00 H ATOM 7436 HZ3 LYS B 422 4.993 30.531 24.998 1.00 0.00 H ATOM 7437 H LYS B 422 9.639 26.656 29.155 1.00 0.00 H ATOM 7438 N LEU B 423 8.189 24.268 30.861 1.00 44.68 N ATOM 7439 CA LEU B 423 7.959 23.031 31.604 1.00 45.24 C ATOM 7440 C LEU B 423 8.513 23.102 33.029 1.00 45.54 C ATOM 7441 O LEU B 423 7.910 22.573 33.964 1.00 45.45 O ATOM 7442 CB LEU B 423 8.586 21.839 30.877 1.00 45.44 C ATOM 7443 CG LEU B 423 8.023 21.348 29.540 1.00 45.76 C ATOM 7444 CD1 LEU B 423 8.999 20.352 28.918 1.00 46.25 C ATOM 7445 CD2 LEU B 423 6.648 20.711 29.697 1.00 46.13 C ATOM 7446 HA LEU B 423 6.879 22.898 31.665 1.00 0.00 H ATOM 7447 HB2 LEU B 423 9.630 22.098 30.698 1.00 0.00 H ATOM 7448 HB3 LEU B 423 8.535 20.994 31.564 1.00 0.00 H ATOM 7449 HG LEU B 423 7.903 22.211 28.885 1.00 0.00 H ATOM 7450 HD21 LEU B 423 6.719 19.857 30.370 1.00 0.00 H ATOM 7451 HD22 LEU B 423 5.955 21.444 30.110 1.00 0.00 H ATOM 7452 HD23 LEU B 423 6.290 20.378 28.723 1.00 0.00 H ATOM 7453 HD11 LEU B 423 9.959 20.841 28.753 1.00 0.00 H ATOM 7454 HD12 LEU B 423 9.131 19.506 29.592 1.00 0.00 H ATOM 7455 HD13 LEU B 423 8.601 20.001 27.966 1.00 0.00 H ATOM 7456 H LEU B 423 9.007 24.332 30.222 1.00 0.00 H ATOM 7457 N ASN B 424 9.661 23.761 33.181 1.00 45.74 N ATOM 7458 CA ASN B 424 10.386 23.799 34.451 1.00 45.71 C ATOM 7459 C ASN B 424 9.908 24.915 35.373 1.00 45.72 C ATOM 7460 O ASN B 424 10.105 24.859 36.583 1.00 45.83 O ATOM 7461 CB ASN B 424 11.893 23.930 34.185 1.00 45.65 C ATOM 7462 CG ASN B 424 12.735 23.611 35.400 1.00 45.64 C ATOM 7463 OD1 ASN B 424 12.428 22.693 36.158 1.00 45.82 O ATOM 7464 ND2 ASN B 424 13.807 24.372 35.592 1.00 45.53 N ATOM 7465 HA ASN B 424 10.182 22.861 34.968 1.00 0.00 H ATOM 7466 HB2 ASN B 424 12.166 23.244 33.383 1.00 0.00 H ATOM 7467 HB3 ASN B 424 12.104 24.953 33.874 1.00 0.00 H ATOM 7468 HD22 ASN B 424 14.027 25.138 34.924 1.00 0.00 H ATOM 7469 HD21 ASN B 424 14.426 24.202 36.410 1.00 0.00 H ATOM 7470 H ASN B 424 10.057 24.269 32.364 1.00 0.00 H ATOM 7471 N HIS B 425 9.286 25.933 34.793 1.00 45.96 N ATOM 7472 CA HIS B 425 8.772 27.059 35.560 1.00 46.11 C ATOM 7473 C HIS B 425 7.384 27.406 35.045 1.00 46.64 C ATOM 7474 O HIS B 425 7.178 28.516 34.544 1.00 46.49 O ATOM 7475 CB HIS B 425 9.675 28.278 35.399 1.00 45.83 C ATOM 7476 CG HIS B 425 11.104 28.039 35.760 1.00 45.75 C ATOM 7477 ND1 HIS B 425 11.636 28.414 36.975 1.00 46.31 N ATOM 7478 CD2 HIS B 425 12.122 27.490 35.057 1.00 44.95 C ATOM 7479 CE1 HIS B 425 12.917 28.096 37.009 1.00 45.51 C ATOM 7480 NE2 HIS B 425 13.236 27.534 35.857 1.00 45.27 N ATOM 7481 HA HIS B 425 8.737 26.783 36.614 1.00 0.00 H ATOM 7482 HB2 HIS B 425 9.635 28.597 34.358 1.00 0.00 H ATOM 7483 HB3 HIS B 425 9.291 29.074 36.037 1.00 0.00 H ATOM 7484 HD2 HIS B 425 12.067 27.088 34.045 1.00 0.00 H ATOM 7485 HE1 HIS B 425 13.595 28.268 37.845 1.00 0.00 H ATOM 7486 H HIS B 425 9.162 25.927 33.760 1.00 0.00 H ATOM 7487 N PRO B 426 6.423 26.463 35.152 1.00 47.22 N ATOM 7488 CA PRO B 426 5.122 26.697 34.514 1.00 47.73 C ATOM 7489 C PRO B 426 4.403 27.942 35.035 1.00 48.00 C ATOM 7490 O PRO B 426 3.627 28.548 34.306 1.00 48.32 O ATOM 7491 CB PRO B 426 4.332 25.419 34.828 1.00 47.76 C ATOM 7492 CG PRO B 426 5.014 24.826 36.023 1.00 47.85 C ATOM 7493 CD PRO B 426 6.458 25.174 35.868 1.00 47.42 C ATOM 7494 HA PRO B 426 5.229 26.891 33.447 1.00 0.00 H ATOM 7495 HD3 PRO B 426 6.941 25.280 36.840 1.00 0.00 H ATOM 7496 HD2 PRO B 426 6.982 24.417 35.284 1.00 0.00 H ATOM 7497 HG3 PRO B 426 4.882 23.744 36.040 1.00 0.00 H ATOM 7498 HG2 PRO B 426 4.615 25.254 36.942 1.00 0.00 H ATOM 7499 HB2 PRO B 426 3.293 25.657 35.058 1.00 0.00 H ATOM 7500 HB3 PRO B 426 4.367 24.729 33.985 1.00 0.00 H ATOM 7501 N GLU B 427 4.692 28.344 36.266 1.00 48.47 N ATOM 7502 CA GLU B 427 3.999 29.486 36.867 1.00 49.10 C ATOM 7503 C GLU B 427 4.743 30.821 36.753 1.00 48.78 C ATOM 7504 O GLU B 427 4.239 31.855 37.195 1.00 48.78 O ATOM 7505 CB GLU B 427 3.597 29.170 38.318 1.00 49.39 C ATOM 7506 CG GLU B 427 2.506 28.101 38.393 1.00 51.29 C ATOM 7507 CD GLU B 427 1.910 27.911 39.784 1.00 55.17 C ATOM 7508 OE1 GLU B 427 2.304 28.622 40.746 1.00 56.18 O ATOM 7509 OE2 GLU B 427 1.026 27.037 39.907 1.00 56.09 O ATOM 7510 HA GLU B 427 3.097 29.633 36.274 1.00 0.00 H ATOM 7511 HB2 GLU B 427 4.475 28.815 38.857 1.00 0.00 H ATOM 7512 HB3 GLU B 427 3.229 30.082 38.788 1.00 0.00 H ATOM 7513 HG2 GLU B 427 1.703 28.384 37.713 1.00 0.00 H ATOM 7514 HG3 GLU B 427 2.935 27.152 38.072 1.00 0.00 H ATOM 7515 H GLU B 427 5.421 27.841 36.812 1.00 0.00 H ATOM 7516 N SER B 428 5.923 30.792 36.133 1.00 48.55 N ATOM 7517 CA SER B 428 6.739 31.990 35.910 1.00 47.94 C ATOM 7518 C SER B 428 6.448 32.578 34.519 1.00 47.33 C ATOM 7519 O SER B 428 7.000 32.125 33.504 1.00 47.37 O ATOM 7520 CB SER B 428 8.224 31.639 36.062 1.00 48.24 C ATOM 7521 OG SER B 428 9.045 32.796 36.120 1.00 49.26 O ATOM 7522 HA SER B 428 6.485 32.745 36.654 1.00 0.00 H ATOM 7523 HB2 SER B 428 8.531 31.033 35.210 1.00 0.00 H ATOM 7524 HB3 SER B 428 8.358 31.067 36.980 1.00 0.00 H ATOM 7525 HG SER B 428 9.992 32.523 36.218 1.00 0.00 H ATOM 7526 H SER B 428 6.281 29.877 35.792 1.00 0.00 H ATOM 7527 N SER B 429 5.580 33.590 34.477 1.00 46.19 N ATOM 7528 CA SER B 429 5.097 34.137 33.213 1.00 44.67 C ATOM 7529 C SER B 429 6.172 34.904 32.454 1.00 43.58 C ATOM 7530 O SER B 429 6.834 35.783 33.012 1.00 42.95 O ATOM 7531 CB SER B 429 3.869 35.028 33.432 1.00 44.94 C ATOM 7532 OG SER B 429 3.368 35.497 32.188 1.00 45.03 O ATOM 7533 HA SER B 429 4.813 33.283 32.599 1.00 0.00 H ATOM 7534 HB2 SER B 429 4.149 35.880 34.051 1.00 0.00 H ATOM 7535 HB3 SER B 429 3.093 34.453 33.938 1.00 0.00 H ATOM 7536 HG SER B 429 2.576 36.070 32.347 1.00 0.00 H ATOM 7537 H SER B 429 5.238 34.000 35.369 1.00 0.00 H ATOM 7538 N GLN B 430 6.339 34.551 31.181 1.00 42.29 N ATOM 7539 CA GLN B 430 7.211 35.296 30.284 1.00 41.55 C ATOM 7540 C GLN B 430 8.694 35.272 30.716 1.00 40.41 C ATOM 7541 O GLN B 430 9.462 36.176 30.377 1.00 40.65 O ATOM 7542 CB GLN B 430 6.679 36.735 30.162 1.00 41.78 C ATOM 7543 CG GLN B 430 6.861 37.382 28.818 1.00 43.28 C ATOM 7544 CD GLN B 430 6.174 36.656 27.669 1.00 44.63 C ATOM 7545 OE1 GLN B 430 5.294 35.817 27.861 1.00 46.65 O ATOM 7546 NE2 GLN B 430 6.582 36.989 26.456 1.00 45.09 N ATOM 7547 HA GLN B 430 7.193 34.809 29.309 1.00 0.00 H ATOM 7548 HB2 GLN B 430 5.612 36.719 30.385 1.00 0.00 H ATOM 7549 HB3 GLN B 430 7.194 37.347 30.902 1.00 0.00 H ATOM 7550 HG2 GLN B 430 6.460 38.394 28.870 1.00 0.00 H ATOM 7551 HG3 GLN B 430 7.929 37.426 28.603 1.00 0.00 H ATOM 7552 HE22 GLN B 430 7.329 37.703 26.336 1.00 0.00 H ATOM 7553 HE21 GLN B 430 6.156 36.537 25.622 1.00 0.00 H ATOM 7554 H GLN B 430 5.832 33.719 30.817 1.00 0.00 H ATOM 7555 N LEU B 431 9.082 34.233 31.460 1.00 38.97 N ATOM 7556 CA LEU B 431 10.471 34.015 31.889 1.00 37.79 C ATOM 7557 C LEU B 431 11.466 34.036 30.716 1.00 36.55 C ATOM 7558 O LEU B 431 12.531 34.641 30.819 1.00 35.84 O ATOM 7559 CB LEU B 431 10.599 32.693 32.683 1.00 37.51 C ATOM 7560 CG LEU B 431 11.915 32.427 33.433 1.00 37.81 C ATOM 7561 CD1 LEU B 431 12.298 33.607 34.316 1.00 36.76 C ATOM 7562 CD2 LEU B 431 11.869 31.137 34.263 1.00 36.84 C ATOM 7563 HA LEU B 431 10.730 34.849 32.541 1.00 0.00 H ATOM 7564 HB2 LEU B 431 9.796 32.678 33.420 1.00 0.00 H ATOM 7565 HB3 LEU B 431 10.457 31.875 31.977 1.00 0.00 H ATOM 7566 HG LEU B 431 12.681 32.297 32.668 1.00 0.00 H ATOM 7567 HD21 LEU B 431 11.070 31.210 35.001 1.00 0.00 H ATOM 7568 HD22 LEU B 431 11.680 30.289 33.604 1.00 0.00 H ATOM 7569 HD23 LEU B 431 12.824 30.999 34.771 1.00 0.00 H ATOM 7570 HD11 LEU B 431 12.424 34.496 33.698 1.00 0.00 H ATOM 7571 HD12 LEU B 431 11.510 33.782 35.049 1.00 0.00 H ATOM 7572 HD13 LEU B 431 13.233 33.385 34.831 1.00 0.00 H ATOM 7573 H LEU B 431 8.363 33.541 31.752 1.00 0.00 H ATOM 7574 N PHE B 432 11.098 33.387 29.613 1.00 35.80 N ATOM 7575 CA PHE B 432 11.922 33.336 28.394 1.00 35.70 C ATOM 7576 C PHE B 432 12.331 34.740 27.927 1.00 35.89 C ATOM 7577 O PHE B 432 13.533 35.055 27.831 1.00 35.18 O ATOM 7578 CB PHE B 432 11.178 32.548 27.308 1.00 35.61 C ATOM 7579 CG PHE B 432 11.911 32.431 25.991 1.00 35.69 C ATOM 7580 CD1 PHE B 432 13.149 31.804 25.909 1.00 34.20 C ATOM 7581 CD2 PHE B 432 11.320 32.899 24.816 1.00 35.80 C ATOM 7582 CE1 PHE B 432 13.814 31.675 24.683 1.00 34.60 C ATOM 7583 CE2 PHE B 432 11.979 32.768 23.578 1.00 35.72 C ATOM 7584 CZ PHE B 432 13.227 32.149 23.518 1.00 34.30 C ATOM 7585 HA PHE B 432 12.853 32.815 28.614 1.00 0.00 H ATOM 7586 HB2 PHE B 432 10.995 31.542 27.685 1.00 0.00 H ATOM 7587 HB3 PHE B 432 10.225 33.044 27.123 1.00 0.00 H ATOM 7588 HD2 PHE B 432 10.338 33.371 24.857 1.00 0.00 H ATOM 7589 HE2 PHE B 432 11.514 33.150 22.669 1.00 0.00 H ATOM 7590 HZ PHE B 432 13.739 32.038 22.562 1.00 0.00 H ATOM 7591 HE1 PHE B 432 14.795 31.201 24.644 1.00 0.00 H ATOM 7592 HD1 PHE B 432 13.610 31.406 26.813 1.00 0.00 H ATOM 7593 H PHE B 432 10.183 32.892 29.613 1.00 0.00 H ATOM 7594 N ALA B 433 11.328 35.589 27.696 1.00 35.91 N ATOM 7595 CA ALA B 433 11.541 36.996 27.359 1.00 35.96 C ATOM 7596 C ALA B 433 12.472 37.707 28.340 1.00 36.23 C ATOM 7597 O ALA B 433 13.398 38.397 27.921 1.00 36.56 O ATOM 7598 CB ALA B 433 10.204 37.723 27.273 1.00 35.95 C ATOM 7599 HA ALA B 433 12.034 37.020 26.387 1.00 0.00 H ATOM 7600 HB1 ALA B 433 9.589 37.259 26.502 1.00 0.00 H ATOM 7601 HB2 ALA B 433 9.694 37.658 28.234 1.00 0.00 H ATOM 7602 HB3 ALA B 433 10.376 38.769 27.021 1.00 0.00 H ATOM 7603 H ALA B 433 10.352 35.235 27.758 1.00 0.00 H ATOM 7604 N LYS B 434 12.228 37.540 29.641 1.00 36.75 N ATOM 7605 CA LYS B 434 13.024 38.209 30.686 1.00 37.33 C ATOM 7606 C LYS B 434 14.470 37.736 30.758 1.00 36.82 C ATOM 7607 O LYS B 434 15.363 38.531 31.039 1.00 36.57 O ATOM 7608 CB LYS B 434 12.383 38.048 32.064 1.00 37.71 C ATOM 7609 CG LYS B 434 11.083 38.797 32.217 1.00 41.09 C ATOM 7610 CD LYS B 434 10.311 38.280 33.411 1.00 45.65 C ATOM 7611 CE LYS B 434 8.893 38.781 33.341 1.00 48.04 C ATOM 7612 NZ LYS B 434 7.985 38.039 34.253 1.00 49.58 N ATOM 7613 HA LYS B 434 13.036 39.260 30.396 1.00 0.00 H ATOM 7614 HB2 LYS B 434 12.192 36.988 32.234 1.00 0.00 H ATOM 7615 HB3 LYS B 434 13.083 38.415 32.815 1.00 0.00 H ATOM 7616 HG2 LYS B 434 11.294 39.857 32.357 1.00 0.00 H ATOM 7617 HG3 LYS B 434 10.483 38.663 31.317 1.00 0.00 H ATOM 7618 HD2 LYS B 434 10.313 37.190 33.402 1.00 0.00 H ATOM 7619 HD3 LYS B 434 10.778 38.636 34.329 1.00 0.00 H ATOM 7620 HE2 LYS B 434 8.532 38.668 32.319 1.00 0.00 H ATOM 7621 HE3 LYS B 434 8.880 39.836 33.615 1.00 0.00 H ATOM 7622 HZ1 LYS B 434 7.984 37.032 33.995 1.00 0.00 H ATOM 7623 HZ2 LYS B 434 8.316 38.146 35.233 1.00 0.00 H ATOM 7624 HZ3 LYS B 434 7.022 38.421 34.168 1.00 0.00 H ATOM 7625 H LYS B 434 11.448 36.915 29.928 1.00 0.00 H ATOM 7626 N LEU B 435 14.683 36.440 30.540 1.00 36.67 N ATOM 7627 CA LEU B 435 16.025 35.895 30.418 1.00 36.88 C ATOM 7628 C LEU B 435 16.758 36.530 29.224 1.00 37.30 C ATOM 7629 O LEU B 435 17.891 37.017 29.361 1.00 36.53 O ATOM 7630 CB LEU B 435 15.973 34.368 30.311 1.00 36.72 C ATOM 7631 CG LEU B 435 17.289 33.587 30.282 1.00 36.90 C ATOM 7632 CD1 LEU B 435 18.304 34.141 31.291 1.00 35.80 C ATOM 7633 CD2 LEU B 435 17.036 32.099 30.527 1.00 36.05 C ATOM 7634 HA LEU B 435 16.591 36.142 31.316 1.00 0.00 H ATOM 7635 HB2 LEU B 435 15.404 34.006 31.167 1.00 0.00 H ATOM 7636 HB3 LEU B 435 15.438 34.129 29.392 1.00 0.00 H ATOM 7637 HG LEU B 435 17.721 33.708 29.289 1.00 0.00 H ATOM 7638 HD21 LEU B 435 16.567 31.967 31.502 1.00 0.00 H ATOM 7639 HD22 LEU B 435 16.377 31.711 29.750 1.00 0.00 H ATOM 7640 HD23 LEU B 435 17.984 31.562 30.502 1.00 0.00 H ATOM 7641 HD11 LEU B 435 18.519 35.183 31.054 1.00 0.00 H ATOM 7642 HD12 LEU B 435 17.888 34.074 32.296 1.00 0.00 H ATOM 7643 HD13 LEU B 435 19.223 33.558 31.237 1.00 0.00 H ATOM 7644 H LEU B 435 13.867 35.800 30.455 1.00 0.00 H ATOM 7645 N LEU B 436 16.089 36.566 28.074 1.00 38.14 N ATOM 7646 CA LEU B 436 16.659 37.171 26.861 1.00 39.43 C ATOM 7647 C LEU B 436 17.045 38.634 27.058 1.00 40.12 C ATOM 7648 O LEU B 436 18.061 39.083 26.526 1.00 40.06 O ATOM 7649 CB LEU B 436 15.704 37.025 25.670 1.00 39.51 C ATOM 7650 CG LEU B 436 15.374 35.598 25.228 1.00 40.32 C ATOM 7651 CD1 LEU B 436 14.433 35.619 24.055 1.00 41.16 C ATOM 7652 CD2 LEU B 436 16.634 34.795 24.892 1.00 40.50 C ATOM 7653 HA LEU B 436 17.577 36.623 26.646 1.00 0.00 H ATOM 7654 HB2 LEU B 436 14.767 37.515 25.935 1.00 0.00 H ATOM 7655 HB3 LEU B 436 16.153 37.539 24.820 1.00 0.00 H ATOM 7656 HG LEU B 436 14.887 35.100 26.066 1.00 0.00 H ATOM 7657 HD21 LEU B 436 17.172 35.287 24.081 1.00 0.00 H ATOM 7658 HD22 LEU B 436 17.274 34.740 25.773 1.00 0.00 H ATOM 7659 HD23 LEU B 436 16.350 33.789 24.583 1.00 0.00 H ATOM 7660 HD11 LEU B 436 13.511 36.126 24.339 1.00 0.00 H ATOM 7661 HD12 LEU B 436 14.900 36.150 23.226 1.00 0.00 H ATOM 7662 HD13 LEU B 436 14.208 34.596 23.753 1.00 0.00 H ATOM 7663 H LEU B 436 15.135 36.154 28.032 1.00 0.00 H ATOM 7664 N GLN B 437 16.241 39.358 27.838 1.00 41.38 N ATOM 7665 CA GLN B 437 16.485 40.768 28.146 1.00 42.87 C ATOM 7666 C GLN B 437 17.759 40.950 28.963 1.00 43.69 C ATOM 7667 O GLN B 437 18.402 41.994 28.878 1.00 43.89 O ATOM 7668 CB GLN B 437 15.307 41.374 28.919 1.00 43.07 C ATOM 7669 CG GLN B 437 14.052 41.671 28.103 1.00 44.75 C ATOM 7670 CD GLN B 437 12.986 42.397 28.931 1.00 47.21 C ATOM 7671 OE1 GLN B 437 12.557 41.910 29.982 1.00 48.62 O ATOM 7672 NE2 GLN B 437 12.559 43.562 28.456 1.00 47.03 N ATOM 7673 HA GLN B 437 16.599 41.284 27.193 1.00 0.00 H ATOM 7674 HB2 GLN B 437 15.033 40.676 29.710 1.00 0.00 H ATOM 7675 HB3 GLN B 437 15.646 42.310 29.363 1.00 0.00 H ATOM 7676 HG2 GLN B 437 14.325 42.297 27.253 1.00 0.00 H ATOM 7677 HG3 GLN B 437 13.637 40.730 27.741 1.00 0.00 H ATOM 7678 HE22 GLN B 437 12.948 43.935 27.566 1.00 0.00 H ATOM 7679 HE21 GLN B 437 11.836 44.101 28.974 1.00 0.00 H ATOM 7680 H GLN B 437 15.402 38.899 28.246 1.00 0.00 H ATOM 7681 N LYS B 438 18.104 39.942 29.766 1.00 44.57 N ATOM 7682 CA LYS B 438 19.338 39.952 30.556 1.00 45.74 C ATOM 7683 C LYS B 438 20.606 39.987 29.699 1.00 46.60 C ATOM 7684 O LYS B 438 21.653 40.451 30.168 1.00 46.77 O ATOM 7685 CB LYS B 438 19.403 38.750 31.515 1.00 45.73 C ATOM 7686 CG LYS B 438 18.316 38.704 32.583 1.00 45.76 C ATOM 7687 CD LYS B 438 18.487 39.809 33.601 1.00 47.05 C ATOM 7688 CE LYS B 438 17.224 39.984 34.441 1.00 48.57 C ATOM 7689 NZ LYS B 438 17.401 41.090 35.428 1.00 49.59 N ATOM 7690 HA LYS B 438 19.304 40.877 31.131 1.00 0.00 H ATOM 7691 HB2 LYS B 438 19.328 37.840 30.919 1.00 0.00 H ATOM 7692 HB3 LYS B 438 20.369 38.774 32.019 1.00 0.00 H ATOM 7693 HG2 LYS B 438 17.343 38.813 32.103 1.00 0.00 H ATOM 7694 HG3 LYS B 438 18.362 37.742 33.094 1.00 0.00 H ATOM 7695 HD2 LYS B 438 19.321 39.562 34.258 1.00 0.00 H ATOM 7696 HD3 LYS B 438 18.701 40.743 33.081 1.00 0.00 H ATOM 7697 HE2 LYS B 438 17.016 39.057 34.975 1.00 0.00 H ATOM 7698 HE3 LYS B 438 16.386 40.219 33.785 1.00 0.00 H ATOM 7699 HZ1 LYS B 438 18.198 40.867 36.058 1.00 0.00 H ATOM 7700 HZ2 LYS B 438 17.596 41.977 34.921 1.00 0.00 H ATOM 7701 HZ3 LYS B 438 16.532 41.194 35.990 1.00 0.00 H ATOM 7702 H LYS B 438 17.473 39.118 29.834 1.00 0.00 H ATOM 7703 N MET B 439 20.520 39.506 28.456 1.00 47.59 N ATOM 7704 CA MET B 439 21.671 39.518 27.542 1.00 48.67 C ATOM 7705 C MET B 439 22.188 40.930 27.315 1.00 49.10 C ATOM 7706 O MET B 439 23.374 41.121 27.061 1.00 49.47 O ATOM 7707 CB MET B 439 21.350 38.827 26.217 1.00 48.96 C ATOM 7708 CG MET B 439 21.371 37.310 26.308 1.00 50.27 C ATOM 7709 SD MET B 439 20.515 36.520 24.924 1.00 55.74 S ATOM 7710 CE MET B 439 20.369 34.844 25.512 1.00 53.61 C ATOM 7711 HA MET B 439 22.466 38.948 28.022 1.00 0.00 H ATOM 7712 HB2 MET B 439 20.357 39.141 25.895 1.00 0.00 H ATOM 7713 HB3 MET B 439 22.086 39.139 25.477 1.00 0.00 H ATOM 7714 HG2 MET B 439 20.886 37.009 27.237 1.00 0.00 H ATOM 7715 HG3 MET B 439 22.408 36.974 26.315 1.00 0.00 H ATOM 7716 HE1 MET B 439 21.363 34.437 25.695 1.00 0.00 H ATOM 7717 HE2 MET B 439 19.795 34.834 26.438 1.00 0.00 H ATOM 7718 HE3 MET B 439 19.860 34.240 24.761 1.00 0.00 H ATOM 7719 H MET B 439 19.615 39.113 28.126 1.00 0.00 H ATOM 7720 N THR B 440 21.298 41.910 27.453 1.00 49.70 N ATOM 7721 CA THR B 440 21.654 43.326 27.386 1.00 50.22 C ATOM 7722 C THR B 440 22.473 43.761 28.608 1.00 50.13 C ATOM 7723 O THR B 440 23.467 44.490 28.481 1.00 50.11 O ATOM 7724 CB THR B 440 20.394 44.228 27.249 1.00 50.48 C ATOM 7725 OG1 THR B 440 19.684 44.261 28.490 1.00 52.04 O ATOM 7726 CG2 THR B 440 19.462 43.704 26.163 1.00 50.21 C ATOM 7727 HA THR B 440 22.268 43.451 26.494 1.00 0.00 H ATOM 7728 HB THR B 440 20.726 45.230 26.978 1.00 0.00 H ATOM 7729 HG1 THR B 440 19.405 43.343 28.734 1.00 0.00 H ATOM 7730 HG23 THR B 440 19.994 43.675 25.212 1.00 0.00 H ATOM 7731 HG21 THR B 440 19.129 42.700 26.425 1.00 0.00 H ATOM 7732 HG22 THR B 440 18.599 44.364 26.078 1.00 0.00 H ATOM 7733 H THR B 440 20.303 41.656 27.616 1.00 0.00 H ATOM 7734 N ASP B 441 22.048 43.310 29.788 1.00 49.91 N ATOM 7735 CA ASP B 441 22.795 43.536 31.025 1.00 49.38 C ATOM 7736 C ASP B 441 24.202 42.946 30.940 1.00 48.62 C ATOM 7737 O ASP B 441 25.168 43.579 31.371 1.00 48.70 O ATOM 7738 CB ASP B 441 22.049 42.942 32.223 1.00 49.72 C ATOM 7739 CG ASP B 441 20.829 43.751 32.615 1.00 51.08 C ATOM 7740 OD1 ASP B 441 20.987 44.922 33.037 1.00 51.68 O ATOM 7741 OD2 ASP B 441 19.711 43.205 32.508 1.00 52.61 O ATOM 7742 HA ASP B 441 22.885 44.614 31.163 1.00 0.00 H ATOM 7743 HB2 ASP B 441 21.730 41.931 31.969 1.00 0.00 H ATOM 7744 HB3 ASP B 441 22.730 42.904 33.073 1.00 0.00 H ATOM 7745 H ASP B 441 21.155 42.779 29.831 1.00 0.00 H ATOM 7746 N LEU B 442 24.306 41.740 30.383 1.00 47.79 N ATOM 7747 CA LEU B 442 25.593 41.062 30.197 1.00 47.04 C ATOM 7748 C LEU B 442 26.550 41.827 29.290 1.00 46.80 C ATOM 7749 O LEU B 442 27.713 42.025 29.645 1.00 46.62 O ATOM 7750 CB LEU B 442 25.390 39.651 29.635 1.00 46.61 C ATOM 7751 CG LEU B 442 24.974 38.545 30.596 1.00 46.07 C ATOM 7752 CD1 LEU B 442 24.668 37.287 29.813 1.00 45.43 C ATOM 7753 CD2 LEU B 442 26.052 38.294 31.642 1.00 45.35 C ATOM 7754 HA LEU B 442 26.046 41.011 31.187 1.00 0.00 H ATOM 7755 HB2 LEU B 442 24.621 39.717 28.866 1.00 0.00 H ATOM 7756 HB3 LEU B 442 26.332 39.346 29.179 1.00 0.00 H ATOM 7757 HG LEU B 442 24.075 38.857 31.129 1.00 0.00 H ATOM 7758 HD21 LEU B 442 26.976 37.997 31.146 1.00 0.00 H ATOM 7759 HD22 LEU B 442 26.222 39.207 32.213 1.00 0.00 H ATOM 7760 HD23 LEU B 442 25.727 37.500 32.314 1.00 0.00 H ATOM 7761 HD11 LEU B 442 23.857 37.485 29.112 1.00 0.00 H ATOM 7762 HD12 LEU B 442 25.557 36.977 29.264 1.00 0.00 H ATOM 7763 HD13 LEU B 442 24.370 36.496 30.501 1.00 0.00 H ATOM 7764 H LEU B 442 23.439 41.260 30.067 1.00 0.00 H ATOM 7765 N ARG B 443 26.055 42.251 28.125 1.00 46.81 N ATOM 7766 CA ARG B 443 26.882 42.959 27.142 1.00 47.03 C ATOM 7767 C ARG B 443 27.363 44.309 27.649 1.00 47.07 C ATOM 7768 O ARG B 443 28.488 44.721 27.369 1.00 47.30 O ATOM 7769 CB ARG B 443 26.156 43.106 25.803 1.00 46.86 C ATOM 7770 CG ARG B 443 25.937 41.778 25.119 1.00 47.18 C ATOM 7771 CD ARG B 443 26.288 41.838 23.661 1.00 47.40 C ATOM 7772 NE ARG B 443 25.971 40.587 22.977 1.00 47.36 N ATOM 7773 CZ ARG B 443 25.748 40.493 21.669 1.00 47.28 C ATOM 7774 NH1 ARG B 443 25.797 41.583 20.911 1.00 48.69 N ATOM 7775 NH2 ARG B 443 25.464 39.318 21.121 1.00 46.59 N ATOM 7776 HA ARG B 443 27.768 42.344 26.984 1.00 0.00 H ATOM 7777 HB2 ARG B 443 25.187 43.574 25.979 1.00 0.00 H ATOM 7778 HB3 ARG B 443 26.752 43.743 25.149 1.00 0.00 H ATOM 7779 HG2 ARG B 443 26.560 41.025 25.602 1.00 0.00 H ATOM 7780 HG3 ARG B 443 24.888 41.498 25.219 1.00 0.00 H ATOM 7781 HD2 ARG B 443 27.356 42.034 23.562 1.00 0.00 H ATOM 7782 HD3 ARG B 443 25.726 42.648 23.195 1.00 0.00 H ATOM 7783 HE ARG B 443 25.916 39.718 23.546 1.00 0.00 H ATOM 7784 HH12 ARG B 443 25.623 41.513 19.888 1.00 0.00 H ATOM 7785 HH11 ARG B 443 26.009 42.506 21.341 1.00 0.00 H ATOM 7786 HH22 ARG B 443 25.290 39.250 20.098 1.00 0.00 H ATOM 7787 HH21 ARG B 443 25.415 38.466 21.715 1.00 0.00 H ATOM 7788 H ARG B 443 25.053 42.074 27.908 1.00 0.00 H ATOM 7789 N GLN B 444 26.510 44.975 28.417 1.00 47.29 N ATOM 7790 CA GLN B 444 26.839 46.250 29.037 1.00 47.64 C ATOM 7791 C GLN B 444 27.927 46.051 30.089 1.00 47.10 C ATOM 7792 O GLN B 444 28.838 46.874 30.220 1.00 46.85 O ATOM 7793 CB GLN B 444 25.578 46.846 29.674 1.00 48.04 C ATOM 7794 CG GLN B 444 25.548 48.361 29.785 1.00 50.39 C ATOM 7795 CD GLN B 444 24.133 48.892 30.037 1.00 54.16 C ATOM 7796 OE1 GLN B 444 23.138 48.210 29.759 1.00 55.55 O ATOM 7797 NE2 GLN B 444 24.041 50.114 30.563 1.00 54.87 N ATOM 7798 HA GLN B 444 27.213 46.939 28.280 1.00 0.00 H ATOM 7799 HB2 GLN B 444 24.722 46.537 29.074 1.00 0.00 H ATOM 7800 HB3 GLN B 444 25.484 46.435 30.679 1.00 0.00 H ATOM 7801 HG2 GLN B 444 26.191 48.666 30.611 1.00 0.00 H ATOM 7802 HG3 GLN B 444 25.924 48.789 28.856 1.00 0.00 H ATOM 7803 HE22 GLN B 444 24.904 50.652 30.781 1.00 0.00 H ATOM 7804 HE21 GLN B 444 23.107 50.529 30.755 1.00 0.00 H ATOM 7805 H GLN B 444 25.567 44.569 28.583 1.00 0.00 H ATOM 7806 N ILE B 445 27.824 44.952 30.834 1.00 46.83 N ATOM 7807 CA ILE B 445 28.781 44.640 31.890 1.00 46.44 C ATOM 7808 C ILE B 445 30.139 44.245 31.326 1.00 45.87 C ATOM 7809 O ILE B 445 31.166 44.643 31.872 1.00 45.30 O ATOM 7810 CB ILE B 445 28.217 43.593 32.880 1.00 46.73 C ATOM 7811 CG1 ILE B 445 27.473 44.333 33.996 1.00 47.68 C ATOM 7812 CG2 ILE B 445 29.315 42.699 33.454 1.00 46.23 C ATOM 7813 CD1 ILE B 445 27.146 43.493 35.206 1.00 49.78 C ATOM 7814 HA ILE B 445 28.943 45.552 32.464 1.00 0.00 H ATOM 7815 HB ILE B 445 27.532 42.934 32.347 1.00 0.00 H ATOM 7816 HG12 ILE B 445 28.093 45.168 34.321 1.00 0.00 H ATOM 7817 HG13 ILE B 445 26.538 44.714 33.585 1.00 0.00 H ATOM 7818 HD11 ILE B 445 26.513 42.658 34.907 1.00 0.00 H ATOM 7819 HD12 ILE B 445 28.069 43.112 35.643 1.00 0.00 H ATOM 7820 HD13 ILE B 445 26.620 44.104 35.940 1.00 0.00 H ATOM 7821 HG21 ILE B 445 29.811 42.168 32.642 1.00 0.00 H ATOM 7822 HG22 ILE B 445 30.042 43.314 33.985 1.00 0.00 H ATOM 7823 HG23 ILE B 445 28.873 41.980 34.143 1.00 0.00 H ATOM 7824 H ILE B 445 27.037 44.296 30.658 1.00 0.00 H ATOM 7825 N VAL B 446 30.136 43.491 30.225 1.00 45.58 N ATOM 7826 CA VAL B 446 31.383 43.123 29.544 1.00 45.50 C ATOM 7827 C VAL B 446 32.091 44.387 29.054 1.00 45.81 C ATOM 7828 O VAL B 446 33.290 44.559 29.282 1.00 45.35 O ATOM 7829 CB VAL B 446 31.159 42.127 28.368 1.00 45.24 C ATOM 7830 CG1 VAL B 446 32.398 42.015 27.498 1.00 44.54 C ATOM 7831 CG2 VAL B 446 30.763 40.763 28.888 1.00 44.80 C ATOM 7832 HA VAL B 446 32.011 42.605 30.268 1.00 0.00 H ATOM 7833 HB VAL B 446 30.346 42.518 27.756 1.00 0.00 H ATOM 7834 HG11 VAL B 446 32.639 42.994 27.084 1.00 0.00 H ATOM 7835 HG12 VAL B 446 33.233 41.659 28.101 1.00 0.00 H ATOM 7836 HG13 VAL B 446 32.208 41.312 26.687 1.00 0.00 H ATOM 7837 HG21 VAL B 446 31.554 40.377 29.531 1.00 0.00 H ATOM 7838 HG22 VAL B 446 29.838 40.848 29.459 1.00 0.00 H ATOM 7839 HG23 VAL B 446 30.612 40.085 28.048 1.00 0.00 H ATOM 7840 H VAL B 446 29.229 43.156 29.841 1.00 0.00 H ATOM 7841 N THR B 447 31.331 45.272 28.412 1.00 46.28 N ATOM 7842 CA THR B 447 31.869 46.509 27.835 1.00 47.07 C ATOM 7843 C THR B 447 32.503 47.422 28.888 1.00 47.55 C ATOM 7844 O THR B 447 33.599 47.949 28.684 1.00 47.56 O ATOM 7845 CB THR B 447 30.790 47.252 26.987 1.00 47.10 C ATOM 7846 OG1 THR B 447 30.608 46.551 25.752 1.00 47.22 O ATOM 7847 CG2 THR B 447 31.198 48.686 26.677 1.00 46.64 C ATOM 7848 HA THR B 447 32.676 46.222 27.161 1.00 0.00 H ATOM 7849 HB THR B 447 29.867 47.279 27.567 1.00 0.00 H ATOM 7850 HG1 THR B 447 30.309 45.626 25.940 1.00 0.00 H ATOM 7851 HG23 THR B 447 31.340 49.232 27.610 1.00 0.00 H ATOM 7852 HG21 THR B 447 32.129 48.683 26.111 1.00 0.00 H ATOM 7853 HG22 THR B 447 30.416 49.166 26.089 1.00 0.00 H ATOM 7854 H THR B 447 30.314 45.078 28.316 1.00 0.00 H ATOM 7855 N GLU B 448 31.833 47.592 30.022 1.00 48.55 N ATOM 7856 CA GLU B 448 32.360 48.480 31.057 1.00 49.37 C ATOM 7857 C GLU B 448 33.519 47.845 31.822 1.00 49.41 C ATOM 7858 O GLU B 448 34.332 48.552 32.422 1.00 49.21 O ATOM 7859 CB GLU B 448 31.256 48.995 31.992 1.00 49.57 C ATOM 7860 CG GLU B 448 30.774 48.031 33.061 1.00 51.68 C ATOM 7861 CD GLU B 448 29.872 48.707 34.094 1.00 54.37 C ATOM 7862 OE1 GLU B 448 29.228 49.734 33.771 1.00 55.15 O ATOM 7863 OE2 GLU B 448 29.805 48.207 35.233 1.00 54.86 O ATOM 7864 HA GLU B 448 32.767 49.353 30.547 1.00 0.00 H ATOM 7865 HB2 GLU B 448 31.635 49.885 32.494 1.00 0.00 H ATOM 7866 HB3 GLU B 448 30.398 49.264 31.376 1.00 0.00 H ATOM 7867 HG2 GLU B 448 30.216 47.227 32.581 1.00 0.00 H ATOM 7868 HG3 GLU B 448 31.641 47.614 33.573 1.00 0.00 H ATOM 7869 H GLU B 448 30.933 47.093 30.174 1.00 0.00 H ATOM 7870 N HIS B 449 33.591 46.513 31.779 1.00 49.63 N ATOM 7871 CA HIS B 449 34.698 45.773 32.379 1.00 49.91 C ATOM 7872 C HIS B 449 35.996 46.002 31.598 1.00 50.38 C ATOM 7873 O HIS B 449 37.032 46.316 32.190 1.00 50.02 O ATOM 7874 CB HIS B 449 34.374 44.279 32.480 1.00 49.59 C ATOM 7875 CG HIS B 449 35.452 43.469 33.131 1.00 49.16 C ATOM 7876 ND1 HIS B 449 35.451 43.173 34.476 1.00 49.27 N ATOM 7877 CD2 HIS B 449 36.569 42.898 32.623 1.00 48.89 C ATOM 7878 CE1 HIS B 449 36.516 42.450 34.770 1.00 48.76 C ATOM 7879 NE2 HIS B 449 37.212 42.269 33.663 1.00 48.82 N ATOM 7880 HA HIS B 449 34.843 46.151 33.391 1.00 0.00 H ATOM 7881 HB2 HIS B 449 33.459 44.164 33.061 1.00 0.00 H ATOM 7882 HB3 HIS B 449 34.214 43.893 31.473 1.00 0.00 H ATOM 7883 HD2 HIS B 449 36.897 42.931 31.584 1.00 0.00 H ATOM 7884 HE1 HIS B 449 36.776 42.068 35.757 1.00 0.00 H ATOM 7885 H HIS B 449 32.833 45.984 31.302 1.00 0.00 H ATOM 7886 N VAL B 450 35.934 45.858 30.273 1.00 51.46 N ATOM 7887 CA VAL B 450 37.107 46.104 29.425 1.00 52.43 C ATOM 7888 C VAL B 450 37.566 47.554 29.598 1.00 53.29 C ATOM 7889 O VAL B 450 38.759 47.841 29.603 1.00 53.26 O ATOM 7890 CB VAL B 450 36.880 45.727 27.915 1.00 52.43 C ATOM 7891 CG1 VAL B 450 36.178 44.378 27.777 1.00 52.07 C ATOM 7892 CG2 VAL B 450 36.121 46.799 27.164 1.00 52.42 C ATOM 7893 HA VAL B 450 37.902 45.437 29.758 1.00 0.00 H ATOM 7894 HB VAL B 450 37.869 45.649 27.463 1.00 0.00 H ATOM 7895 HG11 VAL B 450 36.789 43.603 28.240 1.00 0.00 H ATOM 7896 HG12 VAL B 450 35.208 44.422 28.273 1.00 0.00 H ATOM 7897 HG13 VAL B 450 36.037 44.149 26.721 1.00 0.00 H ATOM 7898 HG21 VAL B 450 35.145 46.943 27.627 1.00 0.00 H ATOM 7899 HG22 VAL B 450 36.683 47.732 27.199 1.00 0.00 H ATOM 7900 HG23 VAL B 450 35.990 46.491 26.127 1.00 0.00 H ATOM 7901 H VAL B 450 35.038 45.566 29.833 1.00 0.00 H ATOM 7902 N GLN B 451 36.593 48.442 29.777 1.00 54.54 N ATOM 7903 CA GLN B 451 36.814 49.853 30.059 1.00 56.15 C ATOM 7904 C GLN B 451 37.490 50.064 31.424 1.00 56.76 C ATOM 7905 O GLN B 451 38.313 50.966 31.584 1.00 57.08 O ATOM 7906 CB GLN B 451 35.470 50.590 29.991 1.00 56.27 C ATOM 7907 CG GLN B 451 35.544 52.108 29.910 1.00 58.09 C ATOM 7908 CD GLN B 451 34.166 52.764 29.755 1.00 60.41 C ATOM 7909 OE1 GLN B 451 33.214 52.144 29.258 1.00 60.56 O ATOM 7910 NE2 GLN B 451 34.060 54.029 30.177 1.00 60.21 N ATOM 7911 HA GLN B 451 37.493 50.259 29.309 1.00 0.00 H ATOM 7912 HB2 GLN B 451 34.939 50.234 29.108 1.00 0.00 H ATOM 7913 HB3 GLN B 451 34.902 50.331 30.884 1.00 0.00 H ATOM 7914 HG2 GLN B 451 36.008 52.483 30.822 1.00 0.00 H ATOM 7915 HG3 GLN B 451 36.159 52.382 29.052 1.00 0.00 H ATOM 7916 HE22 GLN B 451 34.885 54.511 30.588 1.00 0.00 H ATOM 7917 HE21 GLN B 451 33.153 54.530 30.094 1.00 0.00 H ATOM 7918 H GLN B 451 35.611 48.107 29.711 1.00 0.00 H ATOM 7919 N LEU B 452 37.153 49.231 32.403 1.00 57.61 N ATOM 7920 CA LEU B 452 37.785 49.321 33.715 1.00 58.70 C ATOM 7921 C LEU B 452 39.214 48.775 33.665 1.00 59.35 C ATOM 7922 O LEU B 452 40.085 49.224 34.412 1.00 59.21 O ATOM 7923 CB LEU B 452 36.953 48.601 34.780 1.00 58.69 C ATOM 7924 CG LEU B 452 36.838 49.324 36.130 1.00 59.57 C ATOM 7925 CD1 LEU B 452 35.489 49.049 36.808 1.00 59.54 C ATOM 7926 CD2 LEU B 452 38.007 49.002 37.065 1.00 59.94 C ATOM 7927 HA LEU B 452 37.836 50.373 33.995 1.00 0.00 H ATOM 7928 HB2 LEU B 452 35.946 48.465 34.385 1.00 0.00 H ATOM 7929 HB3 LEU B 452 37.407 47.626 34.958 1.00 0.00 H ATOM 7930 HG LEU B 452 36.888 50.391 35.915 1.00 0.00 H ATOM 7931 HD21 LEU B 452 38.032 47.929 37.258 1.00 0.00 H ATOM 7932 HD22 LEU B 452 38.941 49.310 36.596 1.00 0.00 H ATOM 7933 HD23 LEU B 452 37.877 49.538 38.005 1.00 0.00 H ATOM 7934 HD11 LEU B 452 34.682 49.396 36.163 1.00 0.00 H ATOM 7935 HD12 LEU B 452 35.383 47.978 36.981 1.00 0.00 H ATOM 7936 HD13 LEU B 452 35.448 49.578 37.760 1.00 0.00 H ATOM 7937 H LEU B 452 36.429 48.505 32.232 1.00 0.00 H ATOM 7938 N LEU B 453 39.446 47.821 32.767 1.00 60.21 N ATOM 7939 CA LEU B 453 40.771 47.225 32.585 1.00 61.34 C ATOM 7940 C LEU B 453 41.753 48.140 31.843 1.00 62.21 C ATOM 7941 O LEU B 453 42.959 48.096 32.105 1.00 62.19 O ATOM 7942 CB LEU B 453 40.666 45.868 31.880 1.00 61.02 C ATOM 7943 CG LEU B 453 40.650 44.574 32.705 1.00 61.35 C ATOM 7944 CD1 LEU B 453 39.673 44.603 33.885 1.00 61.66 C ATOM 7945 CD2 LEU B 453 40.346 43.392 31.791 1.00 61.01 C ATOM 7946 HA LEU B 453 41.178 47.080 33.586 1.00 0.00 H ATOM 7947 HB2 LEU B 453 39.742 45.884 31.302 1.00 0.00 H ATOM 7948 HB3 LEU B 453 41.517 45.799 31.202 1.00 0.00 H ATOM 7949 HG LEU B 453 41.642 44.470 33.145 1.00 0.00 H ATOM 7950 HD21 LEU B 453 39.372 43.537 31.323 1.00 0.00 H ATOM 7951 HD22 LEU B 453 41.114 43.323 31.021 1.00 0.00 H ATOM 7952 HD23 LEU B 453 40.335 42.474 32.378 1.00 0.00 H ATOM 7953 HD11 LEU B 453 39.945 45.414 34.560 1.00 0.00 H ATOM 7954 HD12 LEU B 453 38.661 44.762 33.513 1.00 0.00 H ATOM 7955 HD13 LEU B 453 39.721 43.653 34.418 1.00 0.00 H ATOM 7956 H LEU B 453 38.659 47.487 32.174 1.00 0.00 H ATOM 7957 N GLN B 454 41.241 48.958 30.923 1.00 63.37 N ATOM 7958 CA GLN B 454 42.082 49.910 30.190 1.00 64.60 C ATOM 7959 C GLN B 454 42.632 50.981 31.129 1.00 65.15 C ATOM 7960 O GLN B 454 43.768 51.420 30.967 1.00 65.38 O ATOM 7961 CB GLN B 454 41.339 50.526 28.989 1.00 64.70 C ATOM 7962 CG GLN B 454 40.439 51.732 29.305 1.00 65.91 C ATOM 7963 CD GLN B 454 39.628 52.227 28.105 1.00 67.30 C ATOM 7964 OE1 GLN B 454 39.962 51.955 26.947 1.00 67.58 O ATOM 7965 NE2 GLN B 454 38.557 52.966 28.386 1.00 67.35 N ATOM 7966 HA GLN B 454 42.929 49.359 29.782 1.00 0.00 H ATOM 7967 HB2 GLN B 454 42.086 50.847 28.263 1.00 0.00 H ATOM 7968 HB3 GLN B 454 40.715 49.749 28.548 1.00 0.00 H ATOM 7969 HG2 GLN B 454 39.745 51.446 30.095 1.00 0.00 H ATOM 7970 HG3 GLN B 454 41.069 52.549 29.655 1.00 0.00 H ATOM 7971 HE22 GLN B 454 38.312 53.171 29.376 1.00 0.00 H ATOM 7972 HE21 GLN B 454 37.965 53.338 27.616 1.00 0.00 H ATOM 7973 H GLN B 454 40.222 48.920 30.720 1.00 0.00 H ATOM 7974 N VAL B 455 41.830 51.371 32.119 1.00 66.05 N ATOM 7975 CA VAL B 455 42.249 52.327 33.148 1.00 67.05 C ATOM 7976 C VAL B 455 43.274 51.687 34.097 1.00 67.84 C ATOM 7977 O VAL B 455 44.262 52.325 34.472 1.00 67.92 O ATOM 7978 CB VAL B 455 41.034 52.891 33.946 1.00 66.97 C ATOM 7979 CG1 VAL B 455 41.493 53.752 35.123 1.00 67.20 C ATOM 7980 CG2 VAL B 455 40.099 53.689 33.034 1.00 66.72 C ATOM 7981 HA VAL B 455 42.722 53.167 32.640 1.00 0.00 H ATOM 7982 HB VAL B 455 40.482 52.040 34.344 1.00 0.00 H ATOM 7983 HG11 VAL B 455 42.101 53.149 35.797 1.00 0.00 H ATOM 7984 HG12 VAL B 455 42.083 54.590 34.751 1.00 0.00 H ATOM 7985 HG13 VAL B 455 40.621 54.129 35.658 1.00 0.00 H ATOM 7986 HG21 VAL B 455 40.646 54.523 32.595 1.00 0.00 H ATOM 7987 HG22 VAL B 455 39.726 53.040 32.241 1.00 0.00 H ATOM 7988 HG23 VAL B 455 39.261 54.070 33.618 1.00 0.00 H ATOM 7989 H VAL B 455 40.867 50.981 32.163 1.00 0.00 H ATOM 7990 N ILE B 456 43.029 50.429 34.470 1.00 68.84 N ATOM 7991 CA ILE B 456 43.955 49.643 35.298 1.00 69.92 C ATOM 7992 C ILE B 456 45.318 49.476 34.614 1.00 70.92 C ATOM 7993 O ILE B 456 46.361 49.617 35.254 1.00 71.07 O ATOM 7994 CB ILE B 456 43.347 48.260 35.685 1.00 69.87 C ATOM 7995 CG1 ILE B 456 42.328 48.429 36.819 1.00 69.58 C ATOM 7996 CG2 ILE B 456 44.436 47.253 36.081 1.00 69.56 C ATOM 7997 CD1 ILE B 456 41.454 47.209 37.071 1.00 69.23 C ATOM 7998 HA ILE B 456 44.114 50.202 36.220 1.00 0.00 H ATOM 7999 HB ILE B 456 42.838 47.861 34.808 1.00 0.00 H ATOM 8000 HG12 ILE B 456 42.873 48.653 37.736 1.00 0.00 H ATOM 8001 HG13 ILE B 456 41.678 49.268 36.570 1.00 0.00 H ATOM 8002 HD11 ILE B 456 40.889 46.976 36.169 1.00 0.00 H ATOM 8003 HD12 ILE B 456 42.085 46.360 37.335 1.00 0.00 H ATOM 8004 HD13 ILE B 456 40.765 47.420 37.889 1.00 0.00 H ATOM 8005 HG21 ILE B 456 45.117 47.107 35.242 1.00 0.00 H ATOM 8006 HG22 ILE B 456 44.990 47.637 36.937 1.00 0.00 H ATOM 8007 HG23 ILE B 456 43.972 46.302 36.344 1.00 0.00 H ATOM 8008 H ILE B 456 42.141 49.984 34.160 1.00 0.00 H ATOM 8009 N LYS B 457 45.296 49.197 33.312 1.00 72.08 N ATOM 8010 CA LYS B 457 46.506 49.097 32.498 1.00 73.30 C ATOM 8011 C LYS B 457 47.417 50.323 32.677 1.00 74.00 C ATOM 8012 O LYS B 457 48.628 50.247 32.460 1.00 74.00 O ATOM 8013 CB LYS B 457 46.115 48.924 31.028 1.00 73.38 C ATOM 8014 CG LYS B 457 47.258 48.556 30.103 1.00 74.17 C ATOM 8015 CD LYS B 457 46.990 49.070 28.700 1.00 75.55 C ATOM 8016 CE LYS B 457 48.290 49.306 27.945 1.00 76.41 C ATOM 8017 NZ LYS B 457 48.042 49.918 26.609 1.00 76.94 N ATOM 8018 HA LYS B 457 47.073 48.227 32.830 1.00 0.00 H ATOM 8019 HB2 LYS B 457 45.363 48.137 30.968 1.00 0.00 H ATOM 8020 HB3 LYS B 457 45.685 49.863 30.679 1.00 0.00 H ATOM 8021 HG2 LYS B 457 48.181 48.999 30.478 1.00 0.00 H ATOM 8022 HG3 LYS B 457 47.362 47.471 30.075 1.00 0.00 H ATOM 8023 HD2 LYS B 457 46.392 48.336 28.160 1.00 0.00 H ATOM 8024 HD3 LYS B 457 46.440 50.009 28.764 1.00 0.00 H ATOM 8025 HE2 LYS B 457 48.799 48.352 27.809 1.00 0.00 H ATOM 8026 HE3 LYS B 457 48.923 49.974 28.529 1.00 0.00 H ATOM 8027 HZ1 LYS B 457 47.443 49.283 26.044 1.00 0.00 H ATOM 8028 HZ2 LYS B 457 47.561 50.832 26.732 1.00 0.00 H ATOM 8029 HZ3 LYS B 457 48.949 50.065 26.122 1.00 0.00 H ATOM 8030 H LYS B 457 44.375 49.043 32.853 1.00 0.00 H ATOM 8031 N LYS B 458 46.817 51.441 33.084 1.00 75.01 N ATOM 8032 CA LYS B 458 47.534 52.688 33.369 1.00 75.86 C ATOM 8033 C LYS B 458 47.689 52.917 34.888 1.00 76.45 C ATOM 8034 O LYS B 458 47.518 54.034 35.387 1.00 76.50 O ATOM 8035 CB LYS B 458 46.813 53.872 32.709 1.00 75.92 C ATOM 8036 CG LYS B 458 46.550 53.712 31.205 1.00 75.99 C ATOM 8037 CD LYS B 458 45.319 54.503 30.747 1.00 76.39 C ATOM 8038 CE LYS B 458 45.579 56.009 30.674 1.00 76.78 C ATOM 8039 NZ LYS B 458 44.373 56.771 30.224 1.00 76.54 N ATOM 8040 HA LYS B 458 48.537 52.607 32.949 1.00 0.00 H ATOM 8041 HB2 LYS B 458 45.853 54.005 33.208 1.00 0.00 H ATOM 8042 HB3 LYS B 458 47.423 54.763 32.853 1.00 0.00 H ATOM 8043 HG2 LYS B 458 47.421 54.068 30.656 1.00 0.00 H ATOM 8044 HG3 LYS B 458 46.391 52.656 30.986 1.00 0.00 H ATOM 8045 HD2 LYS B 458 45.026 54.151 29.758 1.00 0.00 H ATOM 8046 HD3 LYS B 458 44.506 54.323 31.451 1.00 0.00 H ATOM 8047 HE2 LYS B 458 46.392 56.191 29.971 1.00 0.00 H ATOM 8048 HE3 LYS B 458 45.869 56.363 31.663 1.00 0.00 H ATOM 8049 HZ1 LYS B 458 44.092 56.445 29.277 1.00 0.00 H ATOM 8050 HZ2 LYS B 458 43.593 56.610 30.893 1.00 0.00 H ATOM 8051 HZ3 LYS B 458 44.598 57.786 30.190 1.00 0.00 H ATOM 8052 H LYS B 458 45.784 51.429 33.206 1.00 0.00 H ATOM 8053 N THR B 459 47.995 51.840 35.608 1.00 77.14 N ATOM 8054 CA THR B 459 48.345 51.876 37.034 1.00 77.91 C ATOM 8055 C THR B 459 49.271 50.690 37.286 1.00 78.33 C ATOM 8056 O THR B 459 50.403 50.865 37.740 1.00 78.45 O ATOM 8057 CB THR B 459 47.091 51.833 37.965 1.00 78.06 C ATOM 8058 OG1 THR B 459 46.393 53.084 37.886 1.00 78.30 O ATOM 8059 CG2 THR B 459 47.477 51.571 39.430 1.00 77.86 C ATOM 8060 HA THR B 459 48.838 52.818 37.272 1.00 0.00 H ATOM 8061 HB THR B 459 46.455 51.015 37.626 1.00 0.00 H ATOM 8062 HG1 THR B 459 46.106 53.242 36.952 1.00 0.00 H ATOM 8063 HG23 THR B 459 48.008 50.622 39.500 1.00 0.00 H ATOM 8064 HG21 THR B 459 48.121 52.376 39.784 1.00 0.00 H ATOM 8065 HG22 THR B 459 46.575 51.530 40.040 1.00 0.00 H ATOM 8066 H THR B 459 47.986 50.916 35.131 1.00 0.00 H ATOM 8067 N GLU B 460 48.783 49.489 36.975 1.00 78.92 N ATOM 8068 CA GLU B 460 49.625 48.298 36.885 1.00 79.49 C ATOM 8069 C GLU B 460 50.268 48.305 35.493 1.00 79.69 C ATOM 8070 O GLU B 460 49.920 47.501 34.618 1.00 79.85 O ATOM 8071 CB GLU B 460 48.796 47.023 37.123 1.00 79.67 C ATOM 8072 CG GLU B 460 49.576 45.824 37.695 1.00 80.11 C ATOM 8073 CD GLU B 460 50.230 44.943 36.632 1.00 80.63 C ATOM 8074 OE1 GLU B 460 49.647 44.765 35.539 1.00 81.05 O ATOM 8075 OE2 GLU B 460 51.326 44.406 36.899 1.00 80.55 O ATOM 8076 HA GLU B 460 50.398 48.308 37.654 1.00 0.00 H ATOM 8077 HB2 GLU B 460 47.996 47.268 37.821 1.00 0.00 H ATOM 8078 HB3 GLU B 460 48.364 46.719 36.169 1.00 0.00 H ATOM 8079 HG2 GLU B 460 50.357 46.205 38.352 1.00 0.00 H ATOM 8080 HG3 GLU B 460 48.885 45.209 38.272 1.00 0.00 H ATOM 8081 H GLU B 460 47.764 49.396 36.789 1.00 0.00 H ATOM 8082 N THR B 461 51.192 49.244 35.294 1.00 79.75 N ATOM 8083 CA THR B 461 51.874 49.420 34.013 1.00 79.77 C ATOM 8084 C THR B 461 53.019 48.425 33.855 1.00 79.73 C ATOM 8085 O THR B 461 53.311 47.650 34.767 1.00 79.74 O ATOM 8086 CB THR B 461 52.424 50.853 33.853 1.00 79.78 C ATOM 8087 OG1 THR B 461 53.191 51.206 35.012 1.00 79.98 O ATOM 8088 CG2 THR B 461 51.289 51.857 33.680 1.00 79.67 C ATOM 8089 HA THR B 461 51.131 49.239 33.237 1.00 0.00 H ATOM 8090 HB THR B 461 53.054 50.880 32.964 1.00 0.00 H ATOM 8091 HG1 THR B 461 52.613 51.163 35.815 1.00 0.00 H ATOM 8092 HG23 THR B 461 50.703 51.593 32.800 1.00 0.00 H ATOM 8093 HG21 THR B 461 50.650 51.837 34.563 1.00 0.00 H ATOM 8094 HG22 THR B 461 51.706 52.856 33.554 1.00 0.00 H ATOM 8095 H THR B 461 51.438 49.877 36.082 1.00 0.00 H TER 8096 THR B 461 ATOM 8097 N HIS B 466 57.430 37.092 34.145 1.00 75.00 N ATOM 8098 CA HIS B 466 56.337 38.063 34.032 1.00 75.09 C ATOM 8099 C HIS B 466 56.002 38.476 32.585 1.00 74.65 C ATOM 8100 O HIS B 466 54.825 38.649 32.265 1.00 74.77 O ATOM 8101 CB HIS B 466 56.576 39.294 34.919 1.00 75.32 C ATOM 8102 CG HIS B 466 55.322 40.041 35.263 1.00 76.28 C ATOM 8103 ND1 HIS B 466 54.936 41.193 34.609 1.00 77.21 N ATOM 8104 CD2 HIS B 466 54.365 39.798 36.191 1.00 76.81 C ATOM 8105 CE1 HIS B 466 53.798 41.628 35.121 1.00 77.36 C ATOM 8106 NE2 HIS B 466 53.428 40.798 36.081 1.00 77.07 N ATOM 8107 HA HIS B 466 55.455 37.538 34.398 1.00 0.00 H ATOM 8108 HB2 HIS B 466 57.046 38.965 35.846 1.00 0.00 H ATOM 8109 HB3 HIS B 466 57.248 39.972 34.393 1.00 0.00 H ATOM 8110 HD2 HIS B 466 54.342 38.965 36.894 1.00 0.00 H ATOM 8111 HE1 HIS B 466 53.256 42.520 34.805 1.00 0.00 H ATOM 8112 HN3 HIS B 466 58.296 37.497 33.736 1.00 0.00 H ATOM 8113 HN2 HIS B 466 57.176 36.224 33.632 1.00 0.00 H ATOM 8114 HN1 HIS B 466 57.591 36.868 35.148 1.00 0.00 H ATOM 8115 N PRO B 467 57.021 38.644 31.709 1.00 74.18 N ATOM 8116 CA PRO B 467 56.683 38.794 30.285 1.00 73.83 C ATOM 8117 C PRO B 467 55.986 37.546 29.724 1.00 73.42 C ATOM 8118 O PRO B 467 55.205 37.643 28.772 1.00 73.33 O ATOM 8119 CB PRO B 467 58.047 38.987 29.617 1.00 73.81 C ATOM 8120 CG PRO B 467 58.915 39.539 30.684 1.00 73.93 C ATOM 8121 CD PRO B 467 58.456 38.885 31.951 1.00 74.16 C ATOM 8122 HA PRO B 467 55.988 39.616 30.112 1.00 0.00 H ATOM 8123 HD3 PRO B 467 58.986 37.948 32.121 1.00 0.00 H ATOM 8124 HD2 PRO B 467 58.603 39.545 32.806 1.00 0.00 H ATOM 8125 HG3 PRO B 467 58.798 40.621 30.749 1.00 0.00 H ATOM 8126 HG2 PRO B 467 59.960 39.299 30.488 1.00 0.00 H ATOM 8127 HB2 PRO B 467 58.437 38.035 29.258 1.00 0.00 H ATOM 8128 HB3 PRO B 467 57.972 39.685 28.783 1.00 0.00 H ATOM 8129 N LEU B 468 56.271 36.393 30.325 1.00 72.88 N ATOM 8130 CA LEU B 468 55.622 35.142 29.966 1.00 72.58 C ATOM 8131 C LEU B 468 54.244 35.041 30.622 1.00 72.44 C ATOM 8132 O LEU B 468 53.342 34.383 30.090 1.00 72.36 O ATOM 8133 CB LEU B 468 56.508 33.957 30.357 1.00 72.41 C ATOM 8134 CG LEU B 468 56.392 32.654 29.564 1.00 72.33 C ATOM 8135 CD1 LEU B 468 56.196 32.894 28.071 1.00 71.96 C ATOM 8136 CD2 LEU B 468 57.621 31.793 29.811 1.00 71.83 C ATOM 8137 HA LEU B 468 55.478 35.119 28.886 1.00 0.00 H ATOM 8138 HB2 LEU B 468 57.543 34.290 30.276 1.00 0.00 H ATOM 8139 HB3 LEU B 468 56.285 33.720 31.397 1.00 0.00 H ATOM 8140 HG LEU B 468 55.502 32.132 29.915 1.00 0.00 H ATOM 8141 HD21 LEU B 468 58.512 32.333 29.491 1.00 0.00 H ATOM 8142 HD22 LEU B 468 57.695 31.564 30.874 1.00 0.00 H ATOM 8143 HD23 LEU B 468 57.534 30.866 29.244 1.00 0.00 H ATOM 8144 HD11 LEU B 468 55.282 33.466 27.913 1.00 0.00 H ATOM 8145 HD12 LEU B 468 57.047 33.451 27.679 1.00 0.00 H ATOM 8146 HD13 LEU B 468 56.120 31.936 27.557 1.00 0.00 H ATOM 8147 H LEU B 468 56.986 36.386 31.081 1.00 0.00 H ATOM 8148 N LEU B 469 54.095 35.701 31.773 1.00 72.17 N ATOM 8149 CA LEU B 469 52.809 35.817 32.467 1.00 71.75 C ATOM 8150 C LEU B 469 51.838 36.705 31.692 1.00 71.45 C ATOM 8151 O LEU B 469 50.652 36.388 31.574 1.00 71.34 O ATOM 8152 CB LEU B 469 53.003 36.370 33.886 1.00 71.81 C ATOM 8153 CG LEU B 469 53.394 35.401 35.006 1.00 71.82 C ATOM 8154 CD1 LEU B 469 53.919 36.154 36.226 1.00 71.81 C ATOM 8155 CD2 LEU B 469 52.214 34.521 35.387 1.00 71.26 C ATOM 8156 HA LEU B 469 52.382 34.816 32.533 1.00 0.00 H ATOM 8157 HB2 LEU B 469 53.783 37.129 33.831 1.00 0.00 H ATOM 8158 HB3 LEU B 469 52.063 36.838 34.180 1.00 0.00 H ATOM 8159 HG LEU B 469 54.196 34.763 34.635 1.00 0.00 H ATOM 8160 HD21 LEU B 469 51.392 35.148 35.732 1.00 0.00 H ATOM 8161 HD22 LEU B 469 51.895 33.947 34.517 1.00 0.00 H ATOM 8162 HD23 LEU B 469 52.513 33.840 36.184 1.00 0.00 H ATOM 8163 HD11 LEU B 469 54.798 36.734 35.943 1.00 0.00 H ATOM 8164 HD12 LEU B 469 53.144 36.824 36.599 1.00 0.00 H ATOM 8165 HD13 LEU B 469 54.188 35.440 37.004 1.00 0.00 H ATOM 8166 H LEU B 469 54.930 36.154 32.197 1.00 0.00 H ATOM 8167 N GLN B 470 52.353 37.813 31.163 1.00 71.14 N ATOM 8168 CA GLN B 470 51.558 38.724 30.342 1.00 70.96 C ATOM 8169 C GLN B 470 51.152 38.110 29.001 1.00 70.54 C ATOM 8170 O GLN B 470 50.231 38.601 28.348 1.00 70.40 O ATOM 8171 CB GLN B 470 52.281 40.061 30.151 1.00 71.14 C ATOM 8172 CG GLN B 470 51.994 41.053 31.278 1.00 71.75 C ATOM 8173 CD GLN B 470 53.002 42.179 31.367 1.00 72.27 C ATOM 8174 OE1 GLN B 470 53.941 42.256 30.573 1.00 73.37 O ATOM 8175 NE2 GLN B 470 52.815 43.060 32.344 1.00 72.25 N ATOM 8176 HA GLN B 470 50.631 38.912 30.885 1.00 0.00 H ATOM 8177 HB2 GLN B 470 53.354 39.875 30.114 1.00 0.00 H ATOM 8178 HB3 GLN B 470 51.957 40.501 29.208 1.00 0.00 H ATOM 8179 HG2 GLN B 470 51.007 41.486 31.113 1.00 0.00 H ATOM 8180 HG3 GLN B 470 51.998 40.511 32.224 1.00 0.00 H ATOM 8181 HE22 GLN B 470 52.008 42.955 32.991 1.00 0.00 H ATOM 8182 HE21 GLN B 470 53.476 43.854 32.461 1.00 0.00 H ATOM 8183 H GLN B 470 53.353 38.037 31.340 1.00 0.00 H ATOM 8184 N GLU B 471 51.833 37.036 28.602 1.00 70.11 N ATOM 8185 CA GLU B 471 51.413 36.254 27.440 1.00 69.74 C ATOM 8186 C GLU B 471 50.221 35.370 27.780 1.00 69.44 C ATOM 8187 O GLU B 471 49.270 35.283 26.999 1.00 69.33 O ATOM 8188 CB GLU B 471 52.563 35.410 26.867 1.00 69.79 C ATOM 8189 CG GLU B 471 53.615 36.204 26.090 1.00 70.12 C ATOM 8190 CD GLU B 471 53.027 37.160 25.049 1.00 71.22 C ATOM 8191 OE1 GLU B 471 52.030 36.804 24.369 1.00 70.89 O ATOM 8192 OE2 GLU B 471 53.579 38.276 24.909 1.00 71.78 O ATOM 8193 HA GLU B 471 51.112 36.964 26.670 1.00 0.00 H ATOM 8194 HB2 GLU B 471 53.061 34.907 27.696 1.00 0.00 H ATOM 8195 HB3 GLU B 471 52.136 34.665 26.196 1.00 0.00 H ATOM 8196 HG2 GLU B 471 54.199 36.788 26.801 1.00 0.00 H ATOM 8197 HG3 GLU B 471 54.269 35.498 25.578 1.00 0.00 H ATOM 8198 H GLU B 471 52.682 36.748 29.129 1.00 0.00 H ATOM 8199 N ILE B 472 50.273 34.724 28.946 1.00 69.02 N ATOM 8200 CA ILE B 472 49.191 33.849 29.397 1.00 68.80 C ATOM 8201 C ILE B 472 47.910 34.656 29.584 1.00 68.92 C ATOM 8202 O ILE B 472 46.816 34.168 29.297 1.00 68.73 O ATOM 8203 CB ILE B 472 49.566 33.082 30.699 1.00 68.76 C ATOM 8204 CG1 ILE B 472 50.761 32.149 30.448 1.00 68.38 C ATOM 8205 CG2 ILE B 472 48.375 32.279 31.228 1.00 68.59 C ATOM 8206 CD1 ILE B 472 51.500 31.707 31.699 1.00 67.92 C ATOM 8207 HA ILE B 472 49.024 33.097 28.626 1.00 0.00 H ATOM 8208 HB ILE B 472 49.844 33.819 31.453 1.00 0.00 H ATOM 8209 HG12 ILE B 472 50.394 31.258 29.938 1.00 0.00 H ATOM 8210 HG13 ILE B 472 51.468 32.670 29.803 1.00 0.00 H ATOM 8211 HD11 ILE B 472 51.889 32.583 32.218 1.00 0.00 H ATOM 8212 HD12 ILE B 472 50.814 31.170 32.354 1.00 0.00 H ATOM 8213 HD13 ILE B 472 52.325 31.052 31.420 1.00 0.00 H ATOM 8214 HG21 ILE B 472 47.550 32.957 31.447 1.00 0.00 H ATOM 8215 HG22 ILE B 472 48.062 31.556 30.475 1.00 0.00 H ATOM 8216 HG23 ILE B 472 48.667 31.754 32.138 1.00 0.00 H ATOM 8217 H ILE B 472 51.109 34.846 29.553 1.00 0.00 H ATOM 8218 N TYR B 473 48.063 35.906 30.021 1.00 69.11 N ATOM 8219 CA TYR B 473 46.920 36.755 30.359 1.00 69.30 C ATOM 8220 C TYR B 473 46.591 37.865 29.346 1.00 69.50 C ATOM 8221 O TYR B 473 46.027 38.899 29.713 1.00 69.48 O ATOM 8222 CB TYR B 473 47.092 37.331 31.771 1.00 69.12 C ATOM 8223 CG TYR B 473 47.212 36.275 32.851 1.00 68.93 C ATOM 8224 CD1 TYR B 473 46.347 35.178 32.884 1.00 68.54 C ATOM 8225 CD2 TYR B 473 48.183 36.379 33.853 1.00 68.79 C ATOM 8226 CE1 TYR B 473 46.453 34.203 33.879 1.00 68.41 C ATOM 8227 CE2 TYR B 473 48.294 35.412 34.857 1.00 68.42 C ATOM 8228 CZ TYR B 473 47.425 34.328 34.861 1.00 67.94 C ATOM 8229 OH TYR B 473 47.523 33.374 35.842 1.00 66.86 O ATOM 8230 HA TYR B 473 46.053 36.096 30.320 1.00 0.00 H ATOM 8231 HB3 TYR B 473 46.228 37.956 31.995 1.00 0.00 H ATOM 8232 HB2 TYR B 473 47.994 37.942 31.786 1.00 0.00 H ATOM 8233 HD2 TYR B 473 48.865 37.229 33.851 1.00 0.00 H ATOM 8234 HE2 TYR B 473 49.056 35.508 35.630 1.00 0.00 H ATOM 8235 HE1 TYR B 473 45.776 33.349 33.884 1.00 0.00 H ATOM 8236 HD1 TYR B 473 45.576 35.081 32.120 1.00 0.00 H ATOM 8237 HH TYR B 473 46.834 32.679 35.695 1.00 0.00 H ATOM 8238 H TYR B 473 49.024 36.290 30.125 1.00 0.00 H ATOM 8239 N LYS B 474 46.922 37.643 28.074 1.00 69.89 N ATOM 8240 CA LYS B 474 46.547 38.587 27.015 1.00 70.29 C ATOM 8241 C LYS B 474 45.042 38.517 26.736 1.00 70.28 C ATOM 8242 O LYS B 474 44.412 39.525 26.415 1.00 70.51 O ATOM 8243 CB LYS B 474 47.355 38.336 25.731 1.00 70.42 C ATOM 8244 CG LYS B 474 46.946 37.087 24.948 1.00 71.27 C ATOM 8245 CD LYS B 474 47.622 37.015 23.581 1.00 72.40 C ATOM 8246 CE LYS B 474 46.972 35.948 22.693 1.00 73.16 C ATOM 8247 NZ LYS B 474 45.543 36.270 22.362 1.00 73.19 N ATOM 8248 HA LYS B 474 46.784 39.592 27.363 1.00 0.00 H ATOM 8249 HB2 LYS B 474 47.232 39.201 25.079 1.00 0.00 H ATOM 8250 HB3 LYS B 474 48.405 38.236 26.005 1.00 0.00 H ATOM 8251 HG2 LYS B 474 47.224 36.205 25.524 1.00 0.00 H ATOM 8252 HG3 LYS B 474 45.865 37.100 24.805 1.00 0.00 H ATOM 8253 HD2 LYS B 474 47.537 37.985 23.091 1.00 0.00 H ATOM 8254 HD3 LYS B 474 48.675 36.770 23.718 1.00 0.00 H ATOM 8255 HE2 LYS B 474 47.004 34.992 23.215 1.00 0.00 H ATOM 8256 HE3 LYS B 474 47.538 35.873 21.765 1.00 0.00 H ATOM 8257 HZ1 LYS B 474 44.991 36.336 23.241 1.00 0.00 H ATOM 8258 HZ2 LYS B 474 45.502 37.178 21.856 1.00 0.00 H ATOM 8259 HZ3 LYS B 474 45.150 35.518 21.760 1.00 0.00 H ATOM 8260 H LYS B 474 47.456 36.785 27.828 1.00 0.00 H TER 8261 LYS B 474 HETATM 8262 O HOH 1 -2.203 54.712 30.141 1.00 31.44 O HETATM 8263 O HOH 2 3.676 48.536 8.223 1.00 30.08 O HETATM 8264 O HOH 3 12.021 45.276 10.843 1.00 37.55 O HETATM 8265 O HOH 4 11.140 33.374 20.103 1.00 48.53 O HETATM 8266 O HOH 5 0.421 61.674 33.931 1.00 34.79 O HETATM 8267 O HOH 6 0.824 47.024 10.107 1.00 36.11 O HETATM 8268 O HOH 7 -0.886 51.089 36.294 1.00 29.45 O HETATM 8269 O HOH 8 5.862 52.554 38.850 1.00 38.95 O HETATM 8270 O HOH 9 11.869 46.000 6.823 1.00 29.52 O HETATM 8271 O HOH 10 -0.358 50.985 -8.881 1.00 32.43 O HETATM 8272 O HOH 11 -2.074 39.935 17.691 1.00 43.61 O HETATM 8273 O HOH 12 -0.347 57.506 11.267 1.00 26.66 O HETATM 8274 O HOH 13 5.897 59.922 12.529 1.00 39.47 O HETATM 8275 O HOH 14 8.020 53.232 12.583 1.00 28.04 O HETATM 8276 O HOH 15 13.986 70.758 4.615 1.00 56.45 O HETATM 8277 O HOH 16 29.527 71.775 7.227 1.00 48.75 O HETATM 8278 O HOH 17 13.561 64.546 9.657 1.00 57.71 O HETATM 8279 O HOH 18 16.305 58.352 25.862 1.00 35.52 O HETATM 8280 O HOH 19 25.243 65.258 26.048 1.00 56.70 O HETATM 8281 O HOH 20 11.892 48.370 10.706 1.00 39.80 O HETATM 8282 O HOH 21 11.212 57.315 39.074 1.00 39.48 O HETATM 8283 O HOH 22 26.364 61.988 10.365 1.00 46.59 O HETATM 8284 O HOH 23 22.621 36.146 20.601 1.00 46.28 O HETATM 8285 O HOH 24 18.336 48.950 1.992 1.00 55.05 O HETATM 8286 O HOH 25 11.946 48.889 1.333 1.00 54.58 O HETATM 8287 O HOH 26 -6.036 38.322 14.842 1.00 59.14 O HETATM 8288 O HOH 27 10.427 49.023 43.394 1.00 52.05 O HETATM 8289 O HOH 28 20.949 41.748 18.671 1.00 63.22 O HETATM 8290 O HOH 29 23.040 75.070 25.098 1.00 52.89 O HETATM 8291 O HOH 30 36.203 74.939 19.481 1.00 55.08 O HETATM 8292 O HOH 31 -6.625 55.796 33.390 1.00 42.90 O HETATM 8293 O HOH 32 -0.684 45.402 16.702 1.00 31.39 O HETATM 8294 O HOH 33 11.002 38.194 9.907 1.00 50.03 O HETATM 8295 O HOH 34 8.636 57.199 -4.680 1.00 51.08 O HETATM 8296 O HOH 35 1.216 62.837 17.941 1.00 43.21 O HETATM 8297 O HOH 36 3.809 50.240 1.941 1.00 43.59 O HETATM 8298 O HOH 37 8.009 34.645 17.092 1.00 49.31 O HETATM 8299 O HOH 38 25.811 60.865 -1.882 1.00 61.85 O HETATM 8300 O HOH 39 -8.699 57.103 20.045 1.00 40.07 O HETATM 8301 O HOH 40 7.137 61.864 -0.516 1.00 38.62 O HETATM 8302 O HOH 41 8.698 47.180 43.159 1.00 53.63 O HETATM 8303 O HOH 42 14.238 46.096 38.310 1.00 57.53 O HETATM 8304 O HOH 43 0.650 38.289 8.008 1.00 55.61 O HETATM 8305 O HOH 44 13.763 53.782 44.355 1.00 48.67 O HETATM 8306 O HOH 45 4.634 61.834 0.393 1.00 55.05 O HETATM 8307 O HOH 46 9.909 58.122 16.756 1.00 42.16 O HETATM 8308 O HOH 47 6.411 63.638 -6.176 1.00 55.61 O HETATM 8309 O HOH 48 8.131 55.750 11.678 1.00 42.71 O HETATM 8310 O HOH 49 12.364 60.507 11.970 1.00 59.89 O HETATM 8311 O HOH 50 24.252 56.567 0.035 1.00 32.74 O HETATM 8312 O HOH 51 -1.420 39.819 20.176 1.00 35.80 O HETATM 8313 O HOH 52 11.354 50.354 12.237 1.00 26.90 O HETATM 8314 O HOH 53 17.973 45.760 5.646 1.00 39.28 O HETATM 8315 O HOH 54 -6.926 51.439 13.702 1.00 41.08 O HETATM 8316 O HOH 55 -10.191 52.488 15.235 1.00 47.13 O HETATM 8317 O HOH 56 26.150 72.352 30.671 1.00 58.31 O HETATM 8318 O HOH 57 21.313 40.450 22.710 1.00 50.49 O HETATM 8319 O HOH 58 23.959 46.561 15.136 1.00 59.18 O HETATM 8320 O HOH 59 18.230 53.758 13.678 1.00 35.59 O HETATM 8321 O HOH 60 0.468 47.556 36.749 1.00 42.68 O HETATM 8322 O HOH 61 -3.650 45.340 28.823 1.00 58.46 O HETATM 8323 O HOH 62 12.248 58.239 15.032 1.00 37.13 O HETATM 8324 O HOH 63 9.215 69.836 7.337 1.00 48.58 O HETATM 8325 O HOH 64 -7.154 50.840 11.286 1.00 50.20 O HETATM 8326 O HOH 65 1.126 64.372 15.776 1.00 48.57 O HETATM 8327 O HOH 66 18.571 32.774 38.025 1.00 35.80 O HETATM 8328 O HOH 67 29.648 20.420 18.538 1.00 36.50 O HETATM 8329 O HOH 68 23.779 31.746 37.143 1.00 28.20 O HETATM 8330 O HOH 69 21.652 32.219 38.521 1.00 32.64 O HETATM 8331 O HOH 70 35.412 34.082 12.259 1.00 28.19 O HETATM 8332 O HOH 71 13.567 21.672 25.593 1.00 37.51 O HETATM 8333 O HOH 72 30.171 29.472 10.769 1.00 29.86 O HETATM 8334 O HOH 73 27.750 34.524 6.644 1.00 38.84 O HETATM 8335 O HOH 74 21.480 36.381 44.780 1.00 40.37 O HETATM 8336 O HOH 75 31.992 26.513 37.616 1.00 54.72 O HETATM 8337 O HOH 76 36.476 28.614 36.999 1.00 56.67 O HETATM 8338 O HOH 77 35.027 22.132 11.091 1.00 46.28 O HETATM 8339 O HOH 78 8.303 32.793 21.331 1.00 61.58 O HETATM 8340 O HOH 79 36.657 37.886 14.601 1.00 47.78 O HETATM 8341 O HOH 80 39.084 33.932 14.861 1.00 43.22 O HETATM 8342 O HOH 81 29.578 40.571 20.326 1.00 42.97 O HETATM 8343 O HOH 82 38.448 31.564 21.099 1.00 47.40 O HETATM 8344 O HOH 83 34.783 31.644 41.599 1.00 54.63 O HETATM 8345 O HOH 84 36.919 25.803 8.536 1.00 54.36 O HETATM 8346 O HOH 85 22.409 24.814 9.338 1.00 65.75 O HETATM 8347 O HOH 86 19.071 21.662 37.190 1.00 46.89 O HETATM 8348 O HOH 87 37.373 40.715 22.217 1.00 54.92 O HETATM 8349 O HOH 88 29.618 33.945 20.998 1.00 24.38 O HETATM 8350 O HOH 89 26.017 27.947 36.852 1.00 33.52 O HETATM 8351 O HOH 90 18.515 21.155 30.219 1.00 34.41 O HETATM 8352 O HOH 91 31.763 29.964 57.573 1.00 66.28 O HETATM 8353 O HOH 92 8.820 31.109 29.683 1.00 41.87 O HETATM 8354 O HOH 93 29.919 47.456 52.135 1.00 55.23 O HETATM 8355 O HOH 94 15.022 20.525 36.301 1.00 57.66 O HETATM 8356 O HOH 95 13.243 26.967 40.359 1.00 57.36 O HETATM 8357 O HOH 96 41.085 25.339 24.092 1.00 51.87 O HETATM 8358 O HOH 97 26.962 14.086 32.701 1.00 47.36 O HETATM 8359 O HOH 98 22.050 43.770 46.823 1.00 48.07 O HETATM 8360 O HOH 99 36.872 36.870 9.983 1.00 48.61 O HETATM 8361 O HOH 100 28.111 38.436 37.450 1.00 39.16 O HETATM 8362 O HOH 101 21.245 44.926 41.613 1.00 39.40 O HETATM 8363 O HOH 102 44.486 29.360 34.900 1.00 27.53 O HETATM 8364 O HOH 103 9.955 30.356 45.043 1.00 61.37 O HETATM 8365 O HOH 104 42.120 29.786 28.727 1.00 37.25 O HETATM 8366 O HOH 105 13.950 24.766 39.509 1.00 50.26 O HETATM 8367 O HOH 106 52.620 52.339 37.435 1.00 79.68 O HETATM 8368 O HOH 107 17.602 27.331 41.447 1.00 46.64 O HETATM 8369 O HOH 108 29.961 41.091 25.040 1.00 42.53 O HETATM 8370 O HOH 109 18.642 37.999 44.002 1.00 50.67 O HETATM 8371 O HOH 110 44.435 35.204 28.032 1.00 52.05 O HETATM 8372 O HOH 111 50.307 35.020 57.654 1.00 65.52 O HETATM 8373 O HOH 112 26.614 43.278 18.804 1.00 53.69 O HETATM 8374 O HOH 113 40.544 51.208 50.507 1.00 67.39 O HETATM 8375 O1 UNT A 114 20.112 63.187 20.209 1.00 -0.57 O HETATM 8376 C2 UNT A 114 18.933 63.415 19.811 1.00 0.07 C HETATM 8377 O3 UNT A 114 17.892 63.578 20.505 1.00 -0.57 O HETATM 8378 C4 UNT A 114 18.703 63.517 18.301 1.00 0.16 C HETATM 8379 N5 UNT A 114 19.865 64.186 17.729 1.00 -0.11 N HETATM 8380 N6 UNT A 114 19.842 65.521 17.597 1.00 -0.17 N HETATM 8381 C7 UNT A 114 21.037 65.744 17.051 1.00 0.03 C HETATM 8382 C8 UNT A 114 21.719 64.516 16.884 1.00 0.03 C HETATM 8383 N9 UNT A 114 20.955 63.516 17.323 1.00 -0.17 N HETATM 8384 H3 UNT A 114 22.716 64.405 16.461 1.00 0.07 H HETATM 8385 H2 UNT A 114 21.429 66.722 16.776 1.00 0.07 H HETATM 8386 C10 UNT A 114 18.603 62.053 17.894 1.00 0.02 C HETATM 8387 C11 UNT A 114 18.267 61.926 16.437 1.00 -0.04 C HETATM 8388 C12 UNT A 114 16.970 62.032 15.973 1.00 -0.07 C HETATM 8389 C13 UNT A 114 16.692 61.911 14.629 1.00 -0.07 C HETATM 8390 C14 UNT A 114 17.719 61.684 13.733 1.00 -0.05 C HETATM 8391 C15 UNT A 114 19.010 61.575 14.194 1.00 -0.07 C HETATM 8392 C16 UNT A 114 19.281 61.694 15.533 1.00 -0.07 C HETATM 8393 H9 UNT A 114 20.303 61.605 15.884 1.00 0.05 H HETATM 8394 H8 UNT A 114 19.818 61.394 13.495 1.00 0.05 H HETATM 8395 C17 UNT A 114 17.505 61.532 12.267 1.00 -0.02 C HETATM 8396 C18 UNT A 114 16.540 62.518 11.671 1.00 -0.04 C HETATM 8397 C19 UNT A 114 16.702 62.424 10.171 1.00 -0.02 C HETATM 8398 C20 UNT A 114 17.215 63.677 9.600 1.00 0.01 C HETATM 8399 N21 UNT A 114 16.423 64.795 9.535 1.00 -0.31 N HETATM 8400 C22 UNT A 114 17.202 65.696 8.979 1.00 0.19 C HETATM 8401 O23 UNT A 114 18.450 65.256 8.667 1.00 -0.24 O HETATM 8402 C24 UNT A 114 18.452 63.960 9.069 1.00 0.11 C HETATM 8403 C25 UNT A 114 19.691 63.195 8.859 1.00 -0.00 C HETATM 8404 H16 UNT A 114 20.446 63.842 8.389 1.00 0.04 H HETATM 8405 H17 UNT A 114 19.485 62.336 8.203 1.00 0.04 H HETATM 8406 H18 UNT A 114 20.068 62.835 9.828 1.00 0.04 H HETATM 8407 C26 UNT A 114 16.914 67.069 8.656 1.00 0.03 C HETATM 8408 C27 UNT A 114 17.892 67.886 8.127 1.00 -0.05 C HETATM 8409 C28 UNT A 114 17.606 69.199 7.822 1.00 -0.06 C HETATM 8410 C29 UNT A 114 16.343 69.701 8.046 1.00 -0.06 C HETATM 8411 C30 UNT A 114 15.364 68.889 8.574 1.00 -0.06 C HETATM 8412 C31 UNT A 114 15.652 67.577 8.879 1.00 -0.05 C HETATM 8413 H23 UNT A 114 14.881 66.940 9.297 1.00 0.06 H HETATM 8414 H22 UNT A 114 14.369 69.281 8.749 1.00 0.06 H HETATM 8415 H21 UNT A 114 16.120 70.734 7.807 1.00 0.06 H HETATM 8416 H20 UNT A 114 18.376 69.838 7.405 1.00 0.06 H HETATM 8417 H19 UNT A 114 18.887 67.494 7.951 1.00 0.06 H HETATM 8418 H14 UNT A 114 15.724 62.201 9.720 1.00 0.04 H HETATM 8419 H15 UNT A 114 17.407 61.612 9.939 1.00 0.04 H HETATM 8420 H12 UNT A 114 16.775 63.536 12.015 1.00 0.03 H HETATM 8421 H13 UNT A 114 15.509 62.263 11.959 1.00 0.03 H HETATM 8422 H10 UNT A 114 17.120 60.519 12.079 1.00 0.04 H HETATM 8423 H11 UNT A 114 18.476 61.654 11.764 1.00 0.04 H HETATM 8424 H7 UNT A 114 15.671 61.994 14.276 1.00 0.05 H HETATM 8425 H6 UNT A 114 16.163 62.212 16.674 1.00 0.05 H HETATM 8426 H4 UNT A 114 17.816 61.566 18.489 1.00 0.05 H HETATM 8427 H5 UNT A 114 19.567 61.559 18.086 1.00 0.05 H HETATM 8428 H1 UNT A 114 17.784 64.066 18.051 1.00 0.09 H CONECT 1 2 15 16 17 CONECT 15 1 CONECT 16 1 CONECT 17 1 CONECT 880 881 894 895 896 CONECT 894 880 CONECT 895 880 CONECT 896 880 CONECT 4121 4122 4135 4136 4137 CONECT 4135 4121 CONECT 4136 4121 CONECT 4137 4121 CONECT 5083 5084 5104 5105 5106 CONECT 5104 5083 CONECT 5105 5083 CONECT 5106 5083 CONECT 8097 8098 8112 8113 8114 CONECT 8112 8097 CONECT 8113 8097 CONECT 8114 8097 CONECT 8375 8376 CONECT 8376 8375 8377 8378 CONECT 8377 8376 CONECT 8378 8376 8379 8386 8428 CONECT 8379 8378 8380 8383 CONECT 8380 8379 8381 CONECT 8381 8380 8382 8385 CONECT 8382 8381 8383 8384 CONECT 8383 8379 8382 CONECT 8384 8382 CONECT 8385 8381 CONECT 8386 8378 8387 8426 8427 CONECT 8387 8386 8388 8392 CONECT 8388 8387 8389 8425 CONECT 8389 8388 8390 8424 CONECT 8390 8389 8391 8395 CONECT 8391 8390 8392 8394 CONECT 8392 8387 8391 8393 CONECT 8393 8392 CONECT 8394 8391 CONECT 8395 8390 8396 8422 8423 CONECT 8396 8395 8397 8420 8421 CONECT 8397 8396 8398 8418 8419 CONECT 8398 8397 8399 8402 CONECT 8399 8398 8400 CONECT 8400 8399 8401 8407 CONECT 8401 8400 8402 CONECT 8402 8398 8401 8403 CONECT 8403 8402 8404 8405 8406 CONECT 8404 8403 CONECT 8405 8403 CONECT 8406 8403 CONECT 8407 8400 8408 8412 CONECT 8408 8407 8409 8417 CONECT 8409 8408 8410 8416 CONECT 8410 8409 8411 8415 CONECT 8411 8410 8412 8414 CONECT 8412 8407 8411 8413 CONECT 8413 8412 CONECT 8414 8411 CONECT 8415 8410 CONECT 8416 8409 CONECT 8417 8408 CONECT 8418 8397 CONECT 8419 8397 CONECT 8420 8396 CONECT 8421 8396 CONECT 8422 8395 CONECT 8423 8395 CONECT 8424 8389 CONECT 8425 8388 CONECT 8426 8386 CONECT 8427 8386 CONECT 8428 8378 MASTER 0 0 0 0 0 0 0 0 8423 5 74 42 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 3ia6
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
1i7i
RCSB PDB
PDBbind
292aa, >1I7I_1|Chains... at 98%
1nyx
RCSB PDB
PDBbind
276aa, >1NYX_1|Chains... at 100%
1zeo
RCSB PDB
PDBbind
277aa, >1ZEO_1|Chains... at 99%
2ath
RCSB PDB
PDBbind
271aa, >2ATH_1|Chains... at 100%
2f4b
RCSB PDB
PDBbind
271aa, >2F4B_1|Chains... at 100%
2g0g
RCSB PDB
PDBbind
271aa, >2G0G_1|Chains... at 100%
2g0h
RCSB PDB
PDBbind
271aa, >2G0H_1|Chains... at 100%
2gtk
RCSB PDB
PDBbind
271aa, >2GTK_1|Chain... at 100%
2i4j
RCSB PDB
PDBbind
286aa, >2I4J_1|Chains... at 100%
2i4p
RCSB PDB
PDBbind
286aa, >2I4P_1|Chains... at 100%
2i4z
RCSB PDB
PDBbind
286aa, >2I4Z_1|Chains... at 100%
2p4y
RCSB PDB
PDBbind
277aa, >2P4Y_1|Chains... at 99%
2q8s
RCSB PDB
PDBbind
271aa, >2Q8S_1|Chains... at 100%
2yfe
RCSB PDB
PDBbind
287aa, >2YFE_1|Chains... at 100%
3ads
RCSB PDB
PDBbind
287aa, >3ADS_1|Chains... at 100%
3adt
RCSB PDB
PDBbind
287aa, >3ADT_1|Chains... at 100%
3adu
RCSB PDB
PDBbind
287aa, >3ADU_1|Chains... at 100%
3adv
RCSB PDB
PDBbind
287aa, >3ADV_1|Chains... at 100%
3bc5
RCSB PDB
PDBbind
296aa, >3BC5_1|Chain... at 100%
3osi
RCSB PDB
PDBbind
285aa, >3OSI_1|Chains... at 100%
3osw
RCSB PDB
PDBbind
285aa, >3OSW_1|Chains... at 100%
3r5n
RCSB PDB
PDBbind
274aa, >3R5N_1|Chain... at 100%
3r8i
RCSB PDB
PDBbind
287aa, >3R8I_1|Chains... at 100%
3sz1
RCSB PDB
PDBbind
278aa, >3SZ1_1|Chains... at 100%
3ty0
RCSB PDB
PDBbind
277aa, >3TY0_1|Chains... at 99%
3u9q
RCSB PDB
PDBbind
269aa, >3U9Q_1|Chain... at 100%
4a4v
RCSB PDB
PDBbind
287aa, >4A4V_1|Chains... at 100%
4a4w
RCSB PDB
PDBbind
287aa, >4A4W_1|Chains... at 100%
4jaz
RCSB PDB
PDBbind
287aa, >4JAZ_1|Chains... at 100%
4prg
RCSB PDB
PDBbind
270aa, >4PRG_1|Chains... at 100%
4r06
RCSB PDB
PDBbind
273aa, >4R06_1|Chains... at 100%
4xta
RCSB PDB
PDBbind
278aa, >4XTA_1|Chains... at 100%
4xuh
RCSB PDB
PDBbind
278aa, >4XUH_1|Chains... at 100%
4xum
RCSB PDB
PDBbind
278aa, >4XUM_1|Chains... at 100%
4y29
RCSB PDB
PDBbind
269aa, >4Y29_1|Chain... at 100%
5f9b
RCSB PDB
PDBbind
287aa, >5F9B_1|Chains... at 100%
5lsg
RCSB PDB
PDBbind
304aa, >5LSG_1|Chains... *
5u5l
RCSB PDB
PDBbind
273aa, >5U5L_1|Chains... at 100%
6an1
RCSB PDB
PDBbind
286aa, >6AN1_1|Chains... at 100%
6c5q
RCSB PDB
PDBbind
281aa, >6C5Q_1|Chain... at 100%
6c5t
RCSB PDB
PDBbind
276aa, >6C5T_1|Chain... at 99%
6o68
RCSB PDB
PDBbind
275aa, >6O68_1|Chains... at 100%
6md4
RCSB PDB
PDBbind
275aa, >6MD4_1|Chains... at 100%
6md0
RCSB PDB
PDBbind
275aa, >6MD0_1|Chains... at 100%
6fzg
RCSB PDB
PDBbind
276aa, >6FZG_1|Chain... at 99%
6dgr
RCSB PDB
PDBbind
297aa, >6DGR_1|Chains... at 95%
6dgq
RCSB PDB
PDBbind
276aa, >6DGQ_1|Chains... at 99%
6dgo
RCSB PDB
PDBbind
275aa, >6DGO_1|Chains... at 100%
6dgl
RCSB PDB
PDBbind
276aa, >6DGL_1|Chains... at 99%
6avi
RCSB PDB
PDBbind
276aa, >6AVI_1|Chains... at 99%
5ugm
RCSB PDB
PDBbind
271aa, >5UGM_1|Chains... at 100%
6dha
RCSB PDB
PDBbind
271aa, >6DHA_1|Chains... at 100%
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
No complexes with the same small molecule ligand are found!
Entry Information
PDB ID
3ia6
Complex Type
Protein-Ligand
PDBbind Subset
general set
Protein Name
nuclear hormone receptor PPAR-gamma
Ligand Name
UNT
EC.Number
E.C.-.-.-.-
Resolution
2.31(Å)
Affinity (Kd/Ki/IC50)
IC50=3nM
Release Year
2009
Protein/NA Sequence
Check fasta file
Primary Reference
(2009) Bioorg.Med.Chem. Vol. 17: pp. 7113-7125
Ligand Properties
Formula
C
2
4
H
2
4
N
4
O
3
Molecular Weight
416.472
Exact Mass
416.185
No. of atoms
55
No. of bonds
58
Polar Surface Area
94.04
LOGP Value
5.90 (
Computed with XLOGP3
)
4.29 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 0
No. of Hydrogen Bond Acceptors: 5
No. of Rotatable Bonds: 8
No. of Nitrogen and Oxygen Atoms: 7
No. of Rings: 4
Canonical SMILES
OC(=O)[C@@H](n1nccn1)Cc1ccc(cc1)CCCc1nc(oc1C)c1ccccc1
InChI String
InChI=1S/C24H24N4O3/c1-17-21(27-23(31-17)20-7-3-2-4-8-20)9-5-6-18-10-12-19(13-11-18)16-22(24(29)30)28-25-14-15-26-28/h2-4,7-8,10-15,22H,5-6,9,16H2,1H3,(H,29,30)/t22-/m0/s1
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
P37231
Entrez Gene ID
NCBI Entrez Gene ID:
5468
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com