Browse entries in the PDBbind-CN Database
HEADER 3IME_COMPLEX COMPND 3IME_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 255 PRO ALA PHE HIS PRO GLY GLU LEU ASN VAL TYR SER ALA SEQRES 2 A 255 PRO GLY ASP VAL ALA ASP VAL SER ARG ALA LEU ARG LEU SEQRES 3 A 255 THR GLY ARG ARG VAL MET LEU VAL PRO THR MET GLY ALA SEQRES 4 A 255 LEU HIS GLU GLY HIS LEU ALA LEU VAL ARG ALA ALA LYS SEQRES 5 A 255 ARG VAL PRO GLY SER VAL VAL VAL VAL SER ILE PHE VAL SEQRES 6 A 255 ASN PRO MET GLN PHE GLY ALA GLY GLY ASP LEU ASP ALA SEQRES 7 A 255 TYR PRO ARG THR PRO ASP ASP ASP LEU ALA GLN LEU ARG SEQRES 8 A 255 ALA GLU GLY VAL GLU ILE ALA PHE THR PRO THR THR ALA SEQRES 9 A 255 ALA MET TYR PRO ASP GLY LEU ARG THR THR VAL GLN PRO SEQRES 10 A 255 GLY PRO LEU ALA ALA GLU LEU GLU GLY GLY PRO ARG PRO SEQRES 11 A 255 THR HIS PHE ALA GLY VAL LEU THR VAL VAL LEU LYS LEU SEQRES 12 A 255 LEU GLN ILE VAL ARG PRO ASP ARG VAL PHE PHE GLY GLU SEQRES 13 A 255 LYS ASP TYR GLN GLN LEU VAL LEU ILE ARG GLN LEU VAL SEQRES 14 A 255 ALA ASP PHE ASN LEU ASP VAL ALA VAL VAL GLY VAL PRO SEQRES 15 A 255 THR VAL ARG GLU ALA ASP GLY LEU ALA MET SER SER ARG SEQRES 16 A 255 ASN ARG TYR LEU ASP PRO ALA GLN ARG ALA ALA ALA VAL SEQRES 17 A 255 ALA LEU SER ALA ALA LEU THR ALA ALA ALA HIS ALA ALA SEQRES 18 A 255 THR ALA GLY ALA GLN ALA ALA LEU ASP ALA ALA ARG ALA SEQRES 19 A 255 VAL LEU ASP ALA ALA PRO GLY VAL ALA VAL ASP TYR LEU SEQRES 20 A 255 GLU LEU ARG ASP ILE GLY LEU GLY SEQRES 1 A 27 ASN GLY SER GLY ARG LEU LEU VAL ALA ALA ARG LEU GLY SEQRES 2 A 27 THR THR ARG LEU LEU ASP ASN ILE ALA ILE GLU ILE GLY SEQRES 3 A 27 THR SEQRES 1 B 69 ALA ILE PRO ALA PHE HIS PRO GLY GLU LEU ASN VAL TYR SEQRES 2 B 69 SER ALA PRO GLY ASP VAL ALA ASP VAL SER ARG ALA LEU SEQRES 3 B 69 ARG LEU THR GLY ARG ARG VAL MET LEU VAL PRO THR MET SEQRES 4 B 69 GLY ALA LEU HIS GLU GLY HIS LEU ALA LEU VAL ARG ALA SEQRES 5 B 69 ALA LYS ARG VAL PRO GLY SER VAL VAL VAL VAL SER ILE SEQRES 6 B 69 PHE VAL ASN PRO SEQRES 1 B 204 THR PRO ASP ASP ASP LEU ALA GLN LEU ARG ALA GLU GLY SEQRES 2 B 204 VAL GLU ILE ALA PHE THR PRO THR THR ALA ALA MET TYR SEQRES 3 B 204 PRO ASP GLY LEU ARG THR THR VAL GLN PRO GLY PRO LEU SEQRES 4 B 204 ALA ALA GLU LEU GLU GLY GLY PRO ARG PRO THR HIS PHE SEQRES 5 B 204 ALA GLY VAL LEU THR VAL VAL LEU LYS LEU LEU GLN ILE SEQRES 6 B 204 VAL ARG PRO ASP ARG VAL PHE PHE GLY GLU LYS ASP TYR SEQRES 7 B 204 GLN GLN LEU VAL LEU ILE ARG GLN LEU VAL ALA ASP PHE SEQRES 8 B 204 ASN LEU ASP VAL ALA VAL VAL GLY VAL PRO THR VAL ARG SEQRES 9 B 204 GLU ALA ASP GLY LEU ALA MET SER SER ARG ASN ARG TYR SEQRES 10 B 204 LEU ASP PRO ALA GLN ARG ALA ALA ALA VAL ALA LEU SER SEQRES 11 B 204 ALA ALA LEU THR ALA ALA ALA HIS ALA ALA THR ALA GLY SEQRES 12 B 204 ALA GLN ALA ALA LEU ASP ALA ALA ARG ALA VAL LEU ASP SEQRES 13 B 204 ALA ALA PRO GLY VAL ALA VAL ASP TYR LEU GLU LEU ARG SEQRES 14 B 204 ASP ILE GLY LEU GLY PRO MET PRO LEU ASN GLY SER GLY SEQRES 15 B 204 ARG LEU LEU VAL ALA ALA ARG LEU GLY THR THR ARG LEU SEQRES 16 B 204 LEU ASP ASN ILE ALA ILE GLU ILE GLY HET BZ A 2 17 ATOM 1 N PRO A 4 -3.010 24.077 19.758 1.00 67.24 N ATOM 2 CA PRO A 4 -2.409 24.830 18.652 1.00 64.91 C ATOM 3 C PRO A 4 -3.391 25.094 17.493 1.00 63.93 C ATOM 4 O PRO A 4 -4.302 24.289 17.247 1.00 65.71 O ATOM 5 CB PRO A 4 -1.278 23.909 18.185 1.00 63.47 C ATOM 6 CG PRO A 4 -1.760 22.534 18.505 1.00 64.38 C ATOM 7 CD PRO A 4 -2.557 22.672 19.784 1.00 66.84 C ATOM 8 HA PRO A 4 -2.085 25.821 18.970 1.00 0.00 H ATOM 9 HD3 PRO A 4 -3.406 21.989 19.790 1.00 0.00 H ATOM 10 HD2 PRO A 4 -1.932 22.480 20.656 1.00 0.00 H ATOM 11 HG3 PRO A 4 -0.917 21.859 18.652 1.00 0.00 H ATOM 12 HG2 PRO A 4 -2.391 22.155 17.701 1.00 0.00 H ATOM 13 HB2 PRO A 4 -1.109 24.019 17.114 1.00 0.00 H ATOM 14 HB3 PRO A 4 -0.355 24.129 18.722 1.00 0.00 H ATOM 15 N ALA A 5 -3.186 26.214 16.799 1.00 58.03 N ATOM 16 CA ALA A 5 -3.964 26.596 15.622 1.00 56.35 C ATOM 17 C ALA A 5 -3.684 25.711 14.405 1.00 51.86 C ATOM 18 O ALA A 5 -2.567 25.246 14.210 1.00 52.55 O ATOM 19 CB ALA A 5 -3.685 28.080 15.264 1.00 54.95 C ATOM 20 HA ALA A 5 -5.014 26.459 15.881 1.00 0.00 H ATOM 21 HB1 ALA A 5 -3.968 28.714 16.104 1.00 0.00 H ATOM 22 HB2 ALA A 5 -2.624 28.208 15.051 1.00 0.00 H ATOM 23 HB3 ALA A 5 -4.269 28.357 14.386 1.00 0.00 H ATOM 24 H ALA A 5 -2.428 26.853 17.114 1.00 0.00 H ATOM 25 N PHE A 6 -4.695 25.506 13.571 1.00 48.91 N ATOM 26 CA PHE A 6 -4.484 24.913 12.253 1.00 49.24 C ATOM 27 C PHE A 6 -5.157 25.764 11.207 1.00 49.63 C ATOM 28 O PHE A 6 -6.382 25.762 11.096 1.00 51.43 O ATOM 29 CB PHE A 6 -4.992 23.466 12.160 1.00 46.30 C ATOM 30 CG PHE A 6 -4.777 22.827 10.795 1.00 48.63 C ATOM 31 CD1 PHE A 6 -3.503 22.463 10.367 1.00 45.92 C ATOM 32 CD2 PHE A 6 -5.855 22.580 9.940 1.00 49.06 C ATOM 33 CE1 PHE A 6 -3.307 21.866 9.105 1.00 46.99 C ATOM 34 CE2 PHE A 6 -5.663 21.970 8.680 1.00 45.49 C ATOM 35 CZ PHE A 6 -4.392 21.609 8.271 1.00 45.93 C ATOM 36 HA PHE A 6 -3.408 24.879 12.081 1.00 0.00 H ATOM 37 HB2 PHE A 6 -4.468 22.869 12.906 1.00 0.00 H ATOM 38 HB3 PHE A 6 -6.060 23.462 12.378 1.00 0.00 H ATOM 39 HD2 PHE A 6 -6.861 22.863 10.251 1.00 0.00 H ATOM 40 HE2 PHE A 6 -6.518 21.784 8.030 1.00 0.00 H ATOM 41 HZ PHE A 6 -4.241 21.128 7.305 1.00 0.00 H ATOM 42 HE1 PHE A 6 -2.300 21.604 8.780 1.00 0.00 H ATOM 43 HD1 PHE A 6 -2.646 22.642 11.016 1.00 0.00 H ATOM 44 H PHE A 6 -5.657 25.773 13.861 1.00 0.00 H ATOM 45 N HIS A 7 -4.343 26.486 10.447 1.00 50.04 N ATOM 46 CA HIS A 7 -4.817 27.319 9.333 1.00 51.39 C ATOM 47 C HIS A 7 -4.778 26.567 7.977 1.00 50.30 C ATOM 48 O HIS A 7 -3.712 26.447 7.378 1.00 49.64 O ATOM 49 CB HIS A 7 -4.005 28.626 9.307 1.00 53.13 C ATOM 50 CG HIS A 7 -3.909 29.293 10.648 1.00 60.47 C ATOM 51 ND1 HIS A 7 -5.015 29.762 11.329 1.00 65.71 N ATOM 52 CD2 HIS A 7 -2.844 29.544 11.447 1.00 64.97 C ATOM 53 CE1 HIS A 7 -4.631 30.280 12.484 1.00 70.09 C ATOM 54 NE2 HIS A 7 -3.317 30.161 12.580 1.00 66.64 N ATOM 55 HA HIS A 7 -5.868 27.562 9.493 1.00 0.00 H ATOM 56 HB2 HIS A 7 -2.997 28.400 8.960 1.00 0.00 H ATOM 57 HB3 HIS A 7 -4.482 29.316 8.611 1.00 0.00 H ATOM 58 HD2 HIS A 7 -1.804 29.301 11.231 1.00 0.00 H ATOM 59 HE1 HIS A 7 -5.286 30.729 13.230 1.00 0.00 H ATOM 60 H HIS A 7 -3.323 26.461 10.649 1.00 0.00 H ATOM 61 N PRO A 8 -5.946 26.055 7.493 1.00 51.63 N ATOM 62 CA PRO A 8 -6.016 25.220 6.275 1.00 50.44 C ATOM 63 C PRO A 8 -5.610 25.923 5.009 1.00 48.16 C ATOM 64 O PRO A 8 -5.745 27.144 4.906 1.00 50.67 O ATOM 65 CB PRO A 8 -7.503 24.860 6.154 1.00 52.74 C ATOM 66 CG PRO A 8 -8.084 25.137 7.460 1.00 52.32 C ATOM 67 CD PRO A 8 -7.286 26.258 8.067 1.00 50.70 C ATOM 68 HA PRO A 8 -5.329 24.380 6.377 1.00 0.00 H ATOM 69 HD3 PRO A 8 -7.692 27.228 7.782 1.00 0.00 H ATOM 70 HD2 PRO A 8 -7.263 26.180 9.154 1.00 0.00 H ATOM 71 HG3 PRO A 8 -8.026 24.251 8.092 1.00 0.00 H ATOM 72 HG2 PRO A 8 -9.127 25.436 7.351 1.00 0.00 H ATOM 73 HB2 PRO A 8 -7.981 25.471 5.388 1.00 0.00 H ATOM 74 HB3 PRO A 8 -7.620 23.806 5.902 1.00 0.00 H ATOM 75 N GLY A 9 -5.140 25.127 4.053 1.00 48.66 N ATOM 76 CA GLY A 9 -4.650 25.605 2.756 1.00 52.42 C ATOM 77 C GLY A 9 -3.385 26.427 2.857 1.00 52.46 C ATOM 78 O GLY A 9 -3.014 27.140 1.926 1.00 50.21 O ATOM 79 HA3 GLY A 9 -5.426 26.219 2.298 1.00 0.00 H ATOM 80 HA2 GLY A 9 -4.451 24.741 2.122 1.00 0.00 H ATOM 81 H GLY A 9 -5.119 24.103 4.236 1.00 0.00 H ATOM 82 N GLU A 10 -2.744 26.318 4.015 1.00 55.56 N ATOM 83 CA GLU A 10 -1.536 27.043 4.367 1.00 56.09 C ATOM 84 C GLU A 10 -0.543 26.089 5.049 1.00 50.68 C ATOM 85 O GLU A 10 -0.936 25.055 5.584 1.00 48.57 O ATOM 86 CB GLU A 10 -1.889 28.186 5.325 1.00 56.88 C ATOM 87 CG GLU A 10 -2.843 29.175 4.732 1.00 65.99 C ATOM 88 CD GLU A 10 -2.942 30.442 5.536 1.00 71.87 C ATOM 89 OE1 GLU A 10 -2.660 30.406 6.760 1.00 72.54 O ATOM 90 OE2 GLU A 10 -3.310 31.475 4.929 1.00 77.39 O ATOM 91 HA GLU A 10 -1.082 27.452 3.464 1.00 0.00 H ATOM 92 HB2 GLU A 10 -2.342 27.761 6.221 1.00 0.00 H ATOM 93 HB3 GLU A 10 -0.971 28.708 5.596 1.00 0.00 H ATOM 94 HG2 GLU A 10 -2.505 29.426 3.726 1.00 0.00 H ATOM 95 HG3 GLU A 10 -3.831 28.718 4.679 1.00 0.00 H ATOM 96 H GLU A 10 -3.136 25.665 4.723 1.00 0.00 H ATOM 97 N LEU A 11 0.735 26.445 5.052 1.00 44.39 N ATOM 98 CA LEU A 11 1.686 25.640 5.765 1.00 43.25 C ATOM 99 C LEU A 11 1.665 26.016 7.250 1.00 41.41 C ATOM 100 O LEU A 11 1.900 27.162 7.623 1.00 43.27 O ATOM 101 CB LEU A 11 3.085 25.714 5.121 1.00 42.59 C ATOM 102 CG LEU A 11 4.231 24.776 5.578 1.00 40.95 C ATOM 103 CD1 LEU A 11 3.912 23.251 5.623 1.00 39.59 C ATOM 104 CD2 LEU A 11 5.468 25.031 4.750 1.00 44.11 C ATOM 105 HA LEU A 11 1.402 24.590 5.697 1.00 0.00 H ATOM 106 HB2 LEU A 11 2.944 25.534 4.055 1.00 0.00 H ATOM 107 HB3 LEU A 11 3.441 26.733 5.272 1.00 0.00 H ATOM 108 HG LEU A 11 4.392 25.038 6.624 1.00 0.00 H ATOM 109 HD21 LEU A 11 5.246 24.842 3.700 1.00 0.00 H ATOM 110 HD22 LEU A 11 5.780 26.068 4.876 1.00 0.00 H ATOM 111 HD23 LEU A 11 6.267 24.367 5.079 1.00 0.00 H ATOM 112 HD11 LEU A 11 3.089 23.073 6.316 1.00 0.00 H ATOM 113 HD12 LEU A 11 3.630 22.911 4.627 1.00 0.00 H ATOM 114 HD13 LEU A 11 4.795 22.706 5.958 1.00 0.00 H ATOM 115 H LEU A 11 1.044 27.298 4.543 1.00 0.00 H ATOM 116 N ASN A 12 1.326 25.031 8.074 1.00 35.23 N ATOM 117 CA ASN A 12 1.401 25.111 9.536 1.00 37.71 C ATOM 118 C ASN A 12 2.659 24.433 10.066 1.00 31.73 C ATOM 119 O ASN A 12 2.875 23.267 9.802 1.00 32.34 O ATOM 120 CB ASN A 12 0.145 24.472 10.134 1.00 36.93 C ATOM 121 CG ASN A 12 -1.089 25.162 9.665 1.00 38.02 C ATOM 122 OD1 ASN A 12 -1.434 26.206 10.191 1.00 40.90 O ATOM 123 ND2 ASN A 12 -1.720 24.634 8.622 1.00 32.86 N ATOM 124 HA ASN A 12 1.454 26.159 9.832 1.00 0.00 H ATOM 125 HB2 ASN A 12 0.102 23.425 9.835 1.00 0.00 H ATOM 126 HB3 ASN A 12 0.197 24.536 11.221 1.00 0.00 H ATOM 127 HD22 ASN A 12 -1.385 23.740 8.210 1.00 0.00 H ATOM 128 HD21 ASN A 12 -2.549 25.115 8.218 1.00 0.00 H ATOM 129 H ASN A 12 0.984 24.143 7.654 1.00 0.00 H ATOM 130 N VAL A 13 3.494 25.178 10.781 1.00 31.76 N ATOM 131 CA VAL A 13 4.789 24.652 11.245 1.00 32.11 C ATOM 132 C VAL A 13 4.716 24.399 12.756 1.00 32.84 C ATOM 133 O VAL A 13 4.548 25.342 13.527 1.00 31.73 O ATOM 134 CB VAL A 13 6.009 25.591 10.855 1.00 28.09 C ATOM 135 CG1 VAL A 13 7.350 24.954 11.205 1.00 28.20 C ATOM 136 CG2 VAL A 13 5.998 25.948 9.354 1.00 28.71 C ATOM 137 HA VAL A 13 4.980 23.708 10.734 1.00 0.00 H ATOM 138 HB VAL A 13 5.887 26.503 11.439 1.00 0.00 H ATOM 139 HG11 VAL A 13 7.392 24.765 12.278 1.00 0.00 H ATOM 140 HG12 VAL A 13 7.456 24.013 10.665 1.00 0.00 H ATOM 141 HG13 VAL A 13 8.157 25.630 10.922 1.00 0.00 H ATOM 142 HG21 VAL A 13 6.066 25.034 8.764 1.00 0.00 H ATOM 143 HG22 VAL A 13 5.072 26.470 9.113 1.00 0.00 H ATOM 144 HG23 VAL A 13 6.849 26.591 9.129 1.00 0.00 H ATOM 145 H VAL A 13 3.227 26.155 11.019 1.00 0.00 H ATOM 146 N TYR A 14 4.808 23.126 13.168 1.00 34.23 N ATOM 147 CA TYR A 14 4.892 22.732 14.598 1.00 30.56 C ATOM 148 C TYR A 14 6.215 22.085 14.920 1.00 30.29 C ATOM 149 O TYR A 14 6.692 21.245 14.160 1.00 30.47 O ATOM 150 CB TYR A 14 3.810 21.732 14.961 1.00 30.26 C ATOM 151 CG TYR A 14 2.448 22.118 14.465 1.00 34.68 C ATOM 152 CD1 TYR A 14 1.694 23.106 15.111 1.00 32.95 C ATOM 153 CD2 TYR A 14 1.917 21.515 13.338 1.00 30.29 C ATOM 154 CE1 TYR A 14 0.444 23.468 14.628 1.00 35.12 C ATOM 155 CE2 TYR A 14 0.687 21.877 12.855 1.00 31.31 C ATOM 156 CZ TYR A 14 -0.044 22.839 13.496 1.00 31.92 C ATOM 157 OH TYR A 14 -1.280 23.152 12.988 1.00 37.77 O ATOM 158 HA TYR A 14 4.771 23.653 15.168 1.00 0.00 H ATOM 159 HB3 TYR A 14 3.770 21.645 16.047 1.00 0.00 H ATOM 160 HB2 TYR A 14 4.074 20.766 14.530 1.00 0.00 H ATOM 161 HD2 TYR A 14 2.487 20.739 12.826 1.00 0.00 H ATOM 162 HE2 TYR A 14 0.291 21.398 11.960 1.00 0.00 H ATOM 163 HE1 TYR A 14 -0.144 24.235 15.132 1.00 0.00 H ATOM 164 HD1 TYR A 14 2.092 23.595 16.000 1.00 0.00 H ATOM 165 HH TYR A 14 -1.695 23.857 13.545 1.00 0.00 H ATOM 166 H TYR A 14 4.821 22.375 12.449 1.00 0.00 H ATOM 167 N SER A 15 6.746 22.440 16.068 1.00 30.35 N ATOM 168 CA SER A 15 7.974 21.934 16.618 1.00 30.20 C ATOM 169 C SER A 15 7.799 20.964 17.761 1.00 27.65 C ATOM 170 O SER A 15 8.653 20.167 18.019 1.00 31.77 O ATOM 171 CB SER A 15 8.768 23.083 17.164 1.00 35.27 C ATOM 172 OG SER A 15 9.460 23.733 16.154 1.00 45.68 O ATOM 173 HA SER A 15 8.463 21.407 15.799 1.00 0.00 H ATOM 174 HB2 SER A 15 9.479 22.707 17.899 1.00 0.00 H ATOM 175 HB3 SER A 15 8.090 23.789 17.644 1.00 0.00 H ATOM 176 HG SER A 15 10.080 23.096 15.718 1.00 0.00 H ATOM 177 H SER A 15 6.233 23.150 16.628 1.00 0.00 H ATOM 178 N ALA A 16 6.710 21.078 18.473 1.00 26.29 N ATOM 179 CA ALA A 16 6.434 20.232 19.597 1.00 19.58 C ATOM 180 C ALA A 16 5.689 18.992 19.184 1.00 25.71 C ATOM 181 O ALA A 16 4.748 19.063 18.480 1.00 21.57 O ATOM 182 CB ALA A 16 5.664 20.945 20.562 1.00 21.79 C ATOM 183 HA ALA A 16 7.388 19.931 20.029 1.00 0.00 H ATOM 184 HB1 ALA A 16 6.223 21.819 20.897 1.00 0.00 H ATOM 185 HB2 ALA A 16 4.724 21.264 20.111 1.00 0.00 H ATOM 186 HB3 ALA A 16 5.458 20.295 21.413 1.00 0.00 H ATOM 187 H ALA A 16 6.017 21.810 18.215 1.00 0.00 H ATOM 188 N PRO A 17 6.150 17.853 19.640 1.00 22.92 N ATOM 189 CA PRO A 17 5.471 16.603 19.401 1.00 23.97 C ATOM 190 C PRO A 17 4.036 16.669 19.857 1.00 25.90 C ATOM 191 O PRO A 17 3.199 16.203 19.190 1.00 28.36 O ATOM 192 CB PRO A 17 6.277 15.638 20.234 1.00 21.93 C ATOM 193 CG PRO A 17 7.545 16.172 20.231 1.00 25.05 C ATOM 194 CD PRO A 17 7.448 17.614 20.252 1.00 22.44 C ATOM 195 HA PRO A 17 5.416 16.324 18.349 1.00 0.00 H ATOM 196 HD3 PRO A 17 7.479 17.996 21.272 1.00 0.00 H ATOM 197 HD2 PRO A 17 8.248 18.071 19.670 1.00 0.00 H ATOM 198 HG3 PRO A 17 8.074 15.854 19.332 1.00 0.00 H ATOM 199 HG2 PRO A 17 8.088 15.829 21.111 1.00 0.00 H ATOM 200 HB2 PRO A 17 5.883 15.580 21.249 1.00 0.00 H ATOM 201 HB3 PRO A 17 6.274 14.644 19.787 1.00 0.00 H ATOM 202 N GLY A 18 3.794 17.292 20.989 1.00 29.29 N ATOM 203 CA GLY A 18 2.448 17.410 21.544 1.00 23.05 C ATOM 204 C GLY A 18 1.533 18.128 20.587 1.00 28.82 C ATOM 205 O GLY A 18 0.386 17.695 20.385 1.00 31.18 O ATOM 206 HA3 GLY A 18 2.495 17.967 22.479 1.00 0.00 H ATOM 207 HA2 GLY A 18 2.052 16.413 21.736 1.00 0.00 H ATOM 208 H GLY A 18 4.589 17.716 21.508 1.00 0.00 H ATOM 209 N ASP A 19 2.052 19.203 19.964 1.00 29.30 N ATOM 210 CA ASP A 19 1.293 20.066 19.055 1.00 31.22 C ATOM 211 C ASP A 19 0.903 19.395 17.743 1.00 32.91 C ATOM 212 O ASP A 19 -0.249 19.474 17.340 1.00 37.52 O ATOM 213 CB ASP A 19 2.085 21.312 18.703 1.00 38.27 C ATOM 214 CG ASP A 19 2.126 22.304 19.804 1.00 40.65 C ATOM 215 OD1 ASP A 19 1.560 22.037 20.888 1.00 44.34 O ATOM 216 OD2 ASP A 19 2.782 23.338 19.578 1.00 41.70 O ATOM 217 HA ASP A 19 0.383 20.308 19.603 1.00 0.00 H ATOM 218 HB2 ASP A 19 3.107 21.018 18.462 1.00 0.00 H ATOM 219 HB3 ASP A 19 1.628 21.780 17.831 1.00 0.00 H ATOM 220 H ASP A 19 3.051 19.435 20.138 1.00 0.00 H ATOM 221 N VAL A 20 1.870 18.800 17.046 1.00 32.31 N ATOM 222 CA VAL A 20 1.555 17.948 15.871 1.00 31.78 C ATOM 223 C VAL A 20 0.690 16.712 16.201 1.00 27.99 C ATOM 224 O VAL A 20 -0.150 16.351 15.395 1.00 31.26 O ATOM 225 CB VAL A 20 2.821 17.546 15.071 1.00 32.47 C ATOM 226 CG1 VAL A 20 3.338 16.203 15.497 1.00 28.68 C ATOM 227 CG2 VAL A 20 2.529 17.550 13.580 1.00 31.74 C ATOM 228 HA VAL A 20 0.942 18.584 15.232 1.00 0.00 H ATOM 229 HB VAL A 20 3.595 18.284 15.283 1.00 0.00 H ATOM 230 HG11 VAL A 20 3.594 16.233 16.556 1.00 0.00 H ATOM 231 HG12 VAL A 20 2.569 15.449 15.329 1.00 0.00 H ATOM 232 HG13 VAL A 20 4.225 15.955 14.915 1.00 0.00 H ATOM 233 HG21 VAL A 20 1.732 16.838 13.365 1.00 0.00 H ATOM 234 HG22 VAL A 20 2.218 18.549 13.275 1.00 0.00 H ATOM 235 HG23 VAL A 20 3.429 17.266 13.034 1.00 0.00 H ATOM 236 H VAL A 20 2.862 18.934 17.329 1.00 0.00 H ATOM 237 N ALA A 21 0.878 16.084 17.371 1.00 23.07 N ATOM 238 CA ALA A 21 0.042 14.964 17.762 1.00 27.13 C ATOM 239 C ALA A 21 -1.455 15.397 17.958 1.00 35.15 C ATOM 240 O ALA A 21 -2.401 14.689 17.546 1.00 32.59 O ATOM 241 CB ALA A 21 0.588 14.330 19.003 1.00 21.35 C ATOM 242 HA ALA A 21 0.056 14.230 16.956 1.00 0.00 H ATOM 243 HB1 ALA A 21 1.601 13.974 18.813 1.00 0.00 H ATOM 244 HB2 ALA A 21 0.605 15.065 19.808 1.00 0.00 H ATOM 245 HB3 ALA A 21 -0.045 13.490 19.289 1.00 0.00 H ATOM 246 H ALA A 21 1.635 16.405 18.008 1.00 0.00 H ATOM 247 N ASP A 22 -1.660 16.560 18.584 1.00 35.60 N ATOM 248 CA ASP A 22 -3.009 17.086 18.780 1.00 37.10 C ATOM 249 C ASP A 22 -3.710 17.459 17.466 1.00 36.08 C ATOM 250 O ASP A 22 -4.839 17.029 17.244 1.00 38.97 O ATOM 251 CB ASP A 22 -3.005 18.256 19.770 1.00 40.30 C ATOM 252 CG ASP A 22 -2.587 17.833 21.179 1.00 43.40 C ATOM 253 OD1 ASP A 22 -2.573 16.613 21.487 1.00 38.98 O ATOM 254 OD2 ASP A 22 -2.260 18.736 21.984 1.00 47.80 O ATOM 255 HA ASP A 22 -3.597 16.276 19.211 1.00 0.00 H ATOM 256 HB2 ASP A 22 -2.309 19.014 19.412 1.00 0.00 H ATOM 257 HB3 ASP A 22 -4.009 18.679 19.815 1.00 0.00 H ATOM 258 H ASP A 22 -0.845 17.100 18.938 1.00 0.00 H ATOM 259 N VAL A 23 -3.040 18.214 16.594 1.00 32.88 N ATOM 260 CA VAL A 23 -3.610 18.564 15.293 1.00 38.40 C ATOM 261 C VAL A 23 -3.921 17.336 14.438 1.00 40.77 C ATOM 262 O VAL A 23 -5.024 17.233 13.874 1.00 43.89 O ATOM 263 CB VAL A 23 -2.737 19.562 14.465 1.00 38.96 C ATOM 264 CG1 VAL A 23 -3.520 20.018 13.234 1.00 37.07 C ATOM 265 CG2 VAL A 23 -2.340 20.775 15.310 1.00 34.39 C ATOM 266 HA VAL A 23 -4.542 19.070 15.543 1.00 0.00 H ATOM 267 HB VAL A 23 -1.824 19.053 14.154 1.00 0.00 H ATOM 268 HG11 VAL A 23 -3.766 19.152 12.620 1.00 0.00 H ATOM 269 HG12 VAL A 23 -4.438 20.512 13.552 1.00 0.00 H ATOM 270 HG13 VAL A 23 -2.912 20.714 12.656 1.00 0.00 H ATOM 271 HG21 VAL A 23 -3.239 21.292 15.646 1.00 0.00 H ATOM 272 HG22 VAL A 23 -1.766 20.442 16.175 1.00 0.00 H ATOM 273 HG23 VAL A 23 -1.733 21.452 14.709 1.00 0.00 H ATOM 274 H VAL A 23 -2.092 18.561 16.844 1.00 0.00 H ATOM 275 N SER A 24 -2.947 16.423 14.344 1.00 39.81 N ATOM 276 CA SER A 24 -3.106 15.136 13.640 1.00 34.40 C ATOM 277 C SER A 24 -4.389 14.401 14.007 1.00 30.63 C ATOM 278 O SER A 24 -5.153 13.959 13.148 1.00 30.93 O ATOM 279 CB SER A 24 -1.913 14.202 13.936 1.00 27.53 C ATOM 280 OG SER A 24 -1.806 13.199 12.930 1.00 27.04 O ATOM 281 HA SER A 24 -3.151 15.387 12.580 1.00 0.00 H ATOM 282 HB2 SER A 24 -2.062 13.725 14.905 1.00 0.00 H ATOM 283 HB3 SER A 24 -0.994 14.788 13.958 1.00 0.00 H ATOM 284 HG SER A 24 -1.037 12.609 13.134 1.00 0.00 H ATOM 285 H SER A 24 -2.031 16.631 14.790 1.00 0.00 H ATOM 286 N ARG A 25 -4.573 14.251 15.302 1.00 30.62 N ATOM 287 CA ARG A 25 -5.660 13.492 15.887 1.00 39.47 C ATOM 288 C ARG A 25 -6.968 14.224 15.570 1.00 40.27 C ATOM 289 O ARG A 25 -7.959 13.612 15.168 1.00 38.68 O ATOM 290 CB ARG A 25 -5.415 13.431 17.404 1.00 41.38 C ATOM 291 CG ARG A 25 -6.494 12.828 18.302 1.00 43.56 C ATOM 292 CD ARG A 25 -6.327 13.445 19.708 1.00 53.42 C ATOM 293 NE ARG A 25 -7.519 13.371 20.567 1.00 59.19 N ATOM 294 CZ ARG A 25 -8.681 14.001 20.348 1.00 61.54 C ATOM 295 NH1 ARG A 25 -8.875 14.764 19.261 1.00 59.07 N ATOM 296 NH2 ARG A 25 -9.668 13.853 21.225 1.00 59.96 N ATOM 297 HA ARG A 25 -5.719 12.478 15.491 1.00 0.00 H ATOM 298 HB2 ARG A 25 -4.507 12.848 17.559 1.00 0.00 H ATOM 299 HB3 ARG A 25 -5.251 14.454 17.743 1.00 0.00 H ATOM 300 HG2 ARG A 25 -7.482 13.064 17.907 1.00 0.00 H ATOM 301 HG3 ARG A 25 -6.374 11.746 18.354 1.00 0.00 H ATOM 302 HD2 ARG A 25 -6.062 14.495 19.587 1.00 0.00 H ATOM 303 HD3 ARG A 25 -5.514 12.922 20.212 1.00 0.00 H ATOM 304 HE ARG A 25 -7.454 12.778 21.419 1.00 0.00 H ATOM 305 HH12 ARG A 25 -9.788 15.241 19.117 1.00 0.00 H ATOM 306 HH11 ARG A 25 -8.113 14.878 18.563 1.00 0.00 H ATOM 307 HH22 ARG A 25 -10.577 14.335 21.071 1.00 0.00 H ATOM 308 HH21 ARG A 25 -9.532 13.256 22.065 1.00 0.00 H ATOM 309 H ARG A 25 -3.895 14.706 15.946 1.00 0.00 H ATOM 310 N ALA A 26 -6.950 15.541 15.734 1.00 39.16 N ATOM 311 CA ALA A 26 -8.140 16.338 15.480 1.00 42.54 C ATOM 312 C ALA A 26 -8.534 16.173 14.014 1.00 41.91 C ATOM 313 O ALA A 26 -9.682 15.909 13.738 1.00 46.56 O ATOM 314 CB ALA A 26 -7.921 17.814 15.857 1.00 35.51 C ATOM 315 HA ALA A 26 -8.957 15.985 16.109 1.00 0.00 H ATOM 316 HB1 ALA A 26 -7.677 17.885 16.917 1.00 0.00 H ATOM 317 HB2 ALA A 26 -7.100 18.221 15.266 1.00 0.00 H ATOM 318 HB3 ALA A 26 -8.831 18.378 15.654 1.00 0.00 H ATOM 319 H ALA A 26 -6.075 16.008 16.048 1.00 0.00 H ATOM 320 N LEU A 27 -7.576 16.248 13.090 1.00 42.27 N ATOM 321 CA LEU A 27 -7.879 16.138 11.655 1.00 41.14 C ATOM 322 C LEU A 27 -8.424 14.764 11.256 1.00 42.76 C ATOM 323 O LEU A 27 -9.211 14.621 10.331 1.00 46.40 O ATOM 324 CB LEU A 27 -6.635 16.450 10.839 1.00 40.29 C ATOM 325 CG LEU A 27 -6.277 17.926 10.627 1.00 43.53 C ATOM 326 CD1 LEU A 27 -4.845 18.066 10.161 1.00 44.25 C ATOM 327 CD2 LEU A 27 -7.189 18.586 9.618 1.00 44.23 C ATOM 328 HA LEU A 27 -8.665 16.864 11.445 1.00 0.00 H ATOM 329 HB2 LEU A 27 -5.790 15.978 11.339 1.00 0.00 H ATOM 330 HB3 LEU A 27 -6.770 16.002 9.854 1.00 0.00 H ATOM 331 HG LEU A 27 -6.403 18.424 11.589 1.00 0.00 H ATOM 332 HD21 LEU A 27 -7.103 18.072 8.661 1.00 0.00 H ATOM 333 HD22 LEU A 27 -8.219 18.530 9.970 1.00 0.00 H ATOM 334 HD23 LEU A 27 -6.901 19.630 9.498 1.00 0.00 H ATOM 335 HD11 LEU A 27 -4.177 17.645 10.912 1.00 0.00 H ATOM 336 HD12 LEU A 27 -4.717 17.533 9.219 1.00 0.00 H ATOM 337 HD13 LEU A 27 -4.613 19.121 10.017 1.00 0.00 H ATOM 338 H LEU A 27 -6.590 16.388 13.391 1.00 0.00 H ATOM 339 N ARG A 28 -8.000 13.744 11.964 1.00 46.51 N ATOM 340 CA ARG A 28 -8.431 12.406 11.656 1.00 53.43 C ATOM 341 C ARG A 28 -9.905 12.211 12.091 1.00 52.73 C ATOM 342 O ARG A 28 -10.747 11.690 11.335 1.00 49.98 O ATOM 343 CB ARG A 28 -7.485 11.440 12.351 1.00 56.51 C ATOM 344 CG ARG A 28 -7.611 9.976 11.962 1.00 65.67 C ATOM 345 CD ARG A 28 -6.559 9.192 12.733 1.00 73.45 C ATOM 346 NE ARG A 28 -5.281 9.919 12.739 1.00 77.67 N ATOM 347 CZ ARG A 28 -4.658 10.375 13.824 1.00 77.71 C ATOM 348 NH1 ARG A 28 -5.163 10.176 15.046 1.00 75.42 N ATOM 349 NH2 ARG A 28 -3.511 11.021 13.671 1.00 75.47 N ATOM 350 HA ARG A 28 -8.398 12.216 10.583 1.00 0.00 H ATOM 351 HB2 ARG A 28 -6.466 11.756 12.130 1.00 0.00 H ATOM 352 HB3 ARG A 28 -7.662 11.515 13.424 1.00 0.00 H ATOM 353 HG2 ARG A 28 -8.606 9.610 12.216 1.00 0.00 H ATOM 354 HG3 ARG A 28 -7.446 9.862 10.891 1.00 0.00 H ATOM 355 HD2 ARG A 28 -6.417 8.220 12.261 1.00 0.00 H ATOM 356 HD3 ARG A 28 -6.897 9.050 13.760 1.00 0.00 H ATOM 357 HE ARG A 28 -4.826 10.091 11.820 1.00 0.00 H ATOM 358 HH12 ARG A 28 -4.662 10.540 15.881 1.00 0.00 H ATOM 359 HH11 ARG A 28 -6.057 9.657 15.161 1.00 0.00 H ATOM 360 HH22 ARG A 28 -3.005 11.387 14.503 1.00 0.00 H ATOM 361 HH21 ARG A 28 -3.117 11.162 12.719 1.00 0.00 H ATOM 362 H ARG A 28 -7.345 13.904 12.756 1.00 0.00 H ATOM 363 N LEU A 29 -10.213 12.679 13.293 1.00 50.61 N ATOM 364 CA LEU A 29 -11.580 12.705 13.769 1.00 50.15 C ATOM 365 C LEU A 29 -12.508 13.620 12.952 1.00 52.00 C ATOM 366 O LEU A 29 -13.684 13.673 13.260 1.00 58.77 O ATOM 367 CB LEU A 29 -11.621 13.156 15.224 1.00 50.32 C ATOM 368 CG LEU A 29 -10.890 12.451 16.366 1.00 51.80 C ATOM 369 CD1 LEU A 29 -11.328 13.122 17.674 1.00 50.64 C ATOM 370 CD2 LEU A 29 -11.134 10.942 16.408 1.00 52.33 C ATOM 371 HA LEU A 29 -11.947 11.685 13.658 1.00 0.00 H ATOM 372 HB2 LEU A 29 -11.249 14.181 15.225 1.00 0.00 H ATOM 373 HB3 LEU A 29 -12.675 13.153 15.503 1.00 0.00 H ATOM 374 HG LEU A 29 -9.816 12.553 16.211 1.00 0.00 H ATOM 375 HD21 LEU A 29 -12.200 10.751 16.535 1.00 0.00 H ATOM 376 HD22 LEU A 29 -10.792 10.494 15.475 1.00 0.00 H ATOM 377 HD23 LEU A 29 -10.584 10.509 17.244 1.00 0.00 H ATOM 378 HD11 LEU A 29 -11.063 14.179 17.645 1.00 0.00 H ATOM 379 HD12 LEU A 29 -12.407 13.020 17.790 1.00 0.00 H ATOM 380 HD13 LEU A 29 -10.824 12.643 18.513 1.00 0.00 H ATOM 381 H LEU A 29 -9.454 13.036 13.908 1.00 0.00 H ATOM 382 N THR A 30 -11.997 14.353 11.959 1.00 49.68 N ATOM 383 CA THR A 30 -12.825 15.170 11.051 1.00 50.91 C ATOM 384 C THR A 30 -12.878 14.569 9.652 1.00 54.08 C ATOM 385 O THR A 30 -13.325 15.222 8.686 1.00 53.23 O ATOM 386 CB THR A 30 -12.349 16.676 10.895 1.00 51.89 C ATOM 387 OG1 THR A 30 -11.334 16.799 9.882 1.00 50.36 O ATOM 388 CG2 THR A 30 -11.883 17.292 12.224 1.00 54.70 C ATOM 389 HA THR A 30 -13.806 15.169 11.527 1.00 0.00 H ATOM 390 HB THR A 30 -13.222 17.246 10.576 1.00 0.00 H ATOM 391 HG1 THR A 30 -11.697 16.490 9.014 1.00 0.00 H ATOM 392 HG23 THR A 30 -12.671 17.184 12.969 1.00 0.00 H ATOM 393 HG21 THR A 30 -10.985 16.778 12.566 1.00 0.00 H ATOM 394 HG22 THR A 30 -11.664 18.349 12.076 1.00 0.00 H ATOM 395 H THR A 30 -10.966 14.348 11.819 1.00 0.00 H ATOM 396 N GLY A 31 -12.386 13.342 9.530 1.00 52.98 N ATOM 397 CA GLY A 31 -12.449 12.646 8.262 1.00 50.87 C ATOM 398 C GLY A 31 -11.249 12.788 7.350 1.00 48.30 C ATOM 399 O GLY A 31 -11.131 12.042 6.379 1.00 46.49 O ATOM 400 HA3 GLY A 31 -13.320 13.018 7.723 1.00 0.00 H ATOM 401 HA2 GLY A 31 -12.580 11.585 8.473 1.00 0.00 H ATOM 402 H GLY A 31 -11.952 12.877 10.352 1.00 0.00 H ATOM 403 N ARG A 32 -10.352 13.728 7.644 1.00 47.94 N ATOM 404 CA ARG A 32 -9.204 13.930 6.759 1.00 45.58 C ATOM 405 C ARG A 32 -8.258 12.754 6.980 1.00 46.21 C ATOM 406 O ARG A 32 -8.184 12.212 8.081 1.00 45.97 O ATOM 407 CB ARG A 32 -8.496 15.278 6.988 1.00 45.32 C ATOM 408 CG ARG A 32 -9.393 16.538 7.054 1.00 43.51 C ATOM 409 CD ARG A 32 -9.537 17.228 5.699 1.00 46.95 C ATOM 410 NE ARG A 32 -8.275 17.398 4.962 1.00 44.36 N ATOM 411 CZ ARG A 32 -7.507 18.485 5.027 1.00 46.07 C ATOM 412 NH1 ARG A 32 -7.866 19.496 5.816 1.00 47.73 N ATOM 413 NH2 ARG A 32 -6.373 18.564 4.323 1.00 43.82 N ATOM 414 HA ARG A 32 -9.544 13.969 5.724 1.00 0.00 H ATOM 415 HB2 ARG A 32 -7.954 15.210 7.931 1.00 0.00 H ATOM 416 HB3 ARG A 32 -7.787 15.421 6.173 1.00 0.00 H ATOM 417 HG2 ARG A 32 -10.383 16.244 7.404 1.00 0.00 H ATOM 418 HG3 ARG A 32 -8.954 17.243 7.760 1.00 0.00 H ATOM 419 HD2 ARG A 32 -9.971 18.214 5.864 1.00 0.00 H ATOM 420 HD3 ARG A 32 -10.213 16.633 5.084 1.00 0.00 H ATOM 421 HE ARG A 32 -7.962 16.618 4.350 1.00 0.00 H ATOM 422 HH12 ARG A 32 -7.272 20.348 5.872 1.00 0.00 H ATOM 423 HH11 ARG A 32 -8.740 19.434 6.376 1.00 0.00 H ATOM 424 HH22 ARG A 32 -5.782 19.418 4.382 1.00 0.00 H ATOM 425 HH21 ARG A 32 -6.082 17.771 3.716 1.00 0.00 H ATOM 426 H ARG A 32 -10.467 14.314 8.496 1.00 0.00 H ATOM 427 N ARG A 33 -7.578 12.352 5.913 1.00 45.49 N ATOM 428 CA ARG A 33 -6.627 11.247 5.954 1.00 45.63 C ATOM 429 C ARG A 33 -5.156 11.696 6.028 1.00 40.32 C ATOM 430 O ARG A 33 -4.614 12.333 5.090 1.00 36.99 O ATOM 431 CB ARG A 33 -6.854 10.306 4.774 1.00 47.53 C ATOM 432 CG ARG A 33 -7.981 9.346 5.036 1.00 54.02 C ATOM 433 CD ARG A 33 -7.890 8.219 4.078 1.00 55.18 C ATOM 434 NE ARG A 33 -8.467 8.606 2.804 1.00 56.53 N ATOM 435 CZ ARG A 33 -8.521 7.808 1.746 1.00 60.40 C ATOM 436 NH1 ARG A 33 -8.006 6.582 1.815 1.00 60.54 N ATOM 437 NH2 ARG A 33 -9.073 8.243 0.618 1.00 61.57 N ATOM 438 HA ARG A 33 -6.818 10.712 6.885 1.00 0.00 H ATOM 439 HB2 ARG A 33 -7.092 10.898 3.891 1.00 0.00 H ATOM 440 HB3 ARG A 33 -5.941 9.738 4.594 1.00 0.00 H ATOM 441 HG2 ARG A 33 -7.908 8.966 6.055 1.00 0.00 H ATOM 442 HG3 ARG A 33 -8.935 9.858 4.908 1.00 0.00 H ATOM 443 HD2 ARG A 33 -8.433 7.362 4.476 1.00 0.00 H ATOM 444 HD3 ARG A 33 -6.844 7.950 3.934 1.00 0.00 H ATOM 445 HE ARG A 33 -8.861 9.564 2.715 1.00 0.00 H ATOM 446 HH12 ARG A 33 -8.047 5.954 0.987 1.00 0.00 H ATOM 447 HH11 ARG A 33 -7.563 6.253 2.697 1.00 0.00 H ATOM 448 HH22 ARG A 33 -9.117 7.620 -0.213 1.00 0.00 H ATOM 449 HH21 ARG A 33 -9.461 9.207 0.567 1.00 0.00 H ATOM 450 H ARG A 33 -7.730 12.846 5.010 1.00 0.00 H ATOM 451 N VAL A 34 -4.517 11.309 7.134 1.00 29.07 N ATOM 452 CA VAL A 34 -3.211 11.824 7.456 1.00 31.41 C ATOM 453 C VAL A 34 -2.093 11.113 6.724 1.00 30.49 C ATOM 454 O VAL A 34 -1.823 9.906 6.936 1.00 30.81 O ATOM 455 CB VAL A 34 -2.997 11.881 8.970 1.00 33.57 C ATOM 456 CG1 VAL A 34 -1.595 12.352 9.283 1.00 31.37 C ATOM 457 CG2 VAL A 34 -4.071 12.832 9.613 1.00 35.77 C ATOM 458 HA VAL A 34 -3.174 12.850 7.089 1.00 0.00 H ATOM 459 HB VAL A 34 -3.115 10.884 9.394 1.00 0.00 H ATOM 460 HG11 VAL A 34 -0.875 11.660 8.846 1.00 0.00 H ATOM 461 HG12 VAL A 34 -1.445 13.347 8.864 1.00 0.00 H ATOM 462 HG13 VAL A 34 -1.458 12.387 10.364 1.00 0.00 H ATOM 463 HG21 VAL A 34 -3.967 13.832 9.192 1.00 0.00 H ATOM 464 HG22 VAL A 34 -5.069 12.448 9.400 1.00 0.00 H ATOM 465 HG23 VAL A 34 -3.919 12.873 10.692 1.00 0.00 H ATOM 466 H VAL A 34 -4.969 10.625 7.773 1.00 0.00 H ATOM 467 N MET A 35 -1.444 11.876 5.850 1.00 25.28 N ATOM 468 CA MET A 35 -0.262 11.365 5.140 1.00 29.48 C ATOM 469 C MET A 35 1.045 11.806 5.792 1.00 27.77 C ATOM 470 O MET A 35 1.171 12.948 6.187 1.00 31.37 O ATOM 471 CB MET A 35 -0.314 11.809 3.680 1.00 31.57 C ATOM 472 CG MET A 35 -1.573 11.392 2.912 1.00 18.21 C ATOM 473 SD MET A 35 -1.870 9.605 2.728 1.00 31.18 S ATOM 474 CE MET A 35 -3.121 9.381 3.944 1.00 12.06 C ATOM 475 HA MET A 35 -0.284 10.277 5.194 1.00 0.00 H ATOM 476 HB2 MET A 35 -0.250 12.897 3.656 1.00 0.00 H ATOM 477 HB3 MET A 35 0.549 11.384 3.168 1.00 0.00 H ATOM 478 HG2 MET A 35 -1.506 11.820 1.912 1.00 0.00 H ATOM 479 HG3 MET A 35 -2.432 11.817 3.431 1.00 0.00 H ATOM 480 HE1 MET A 35 -2.732 9.669 4.921 1.00 0.00 H ATOM 481 HE2 MET A 35 -3.982 10.002 3.697 1.00 0.00 H ATOM 482 HE3 MET A 35 -3.422 8.334 3.965 1.00 0.00 H ATOM 483 H MET A 35 -1.776 12.844 5.666 1.00 0.00 H ATOM 484 N LEU A 36 2.015 10.901 5.937 1.00 30.32 N ATOM 485 CA LEU A 36 3.339 11.296 6.503 1.00 28.39 C ATOM 486 C LEU A 36 4.521 11.010 5.576 1.00 26.09 C ATOM 487 O LEU A 36 4.671 9.898 5.086 1.00 26.25 O ATOM 488 CB LEU A 36 3.618 10.717 7.936 1.00 24.87 C ATOM 489 CG LEU A 36 5.044 10.939 8.542 1.00 20.63 C ATOM 490 CD1 LEU A 36 5.430 12.387 8.992 1.00 16.07 C ATOM 491 CD2 LEU A 36 5.362 9.971 9.687 1.00 16.43 C ATOM 492 HA LEU A 36 3.255 12.378 6.599 1.00 0.00 H ATOM 493 HB2 LEU A 36 2.899 11.172 8.618 1.00 0.00 H ATOM 494 HB3 LEU A 36 3.445 9.642 7.893 1.00 0.00 H ATOM 495 HG LEU A 36 5.661 10.734 7.667 1.00 0.00 H ATOM 496 HD21 LEU A 36 4.635 10.106 10.488 1.00 0.00 H ATOM 497 HD22 LEU A 36 5.312 8.946 9.319 1.00 0.00 H ATOM 498 HD23 LEU A 36 6.364 10.175 10.065 1.00 0.00 H ATOM 499 HD11 LEU A 36 5.376 13.059 8.135 1.00 0.00 H ATOM 500 HD12 LEU A 36 4.737 12.723 9.763 1.00 0.00 H ATOM 501 HD13 LEU A 36 6.445 12.384 9.390 1.00 0.00 H ATOM 502 H LEU A 36 1.848 9.914 5.654 1.00 0.00 H ATOM 503 N VAL A 37 5.363 12.031 5.380 1.00 25.03 N ATOM 504 CA VAL A 37 6.599 11.933 4.597 1.00 18.75 C ATOM 505 C VAL A 37 7.794 12.342 5.505 1.00 21.23 C ATOM 506 O VAL A 37 8.036 13.534 5.722 1.00 19.14 O ATOM 507 CB VAL A 37 6.533 12.848 3.363 1.00 24.71 C ATOM 508 CG1 VAL A 37 7.706 12.605 2.438 1.00 21.61 C ATOM 509 CG2 VAL A 37 5.149 12.706 2.601 1.00 23.76 C ATOM 510 HA VAL A 37 6.729 10.909 4.248 1.00 0.00 H ATOM 511 HB VAL A 37 6.599 13.877 3.715 1.00 0.00 H ATOM 512 HG11 VAL A 37 8.635 12.806 2.971 1.00 0.00 H ATOM 513 HG12 VAL A 37 7.694 11.568 2.103 1.00 0.00 H ATOM 514 HG13 VAL A 37 7.630 13.267 1.575 1.00 0.00 H ATOM 515 HG21 VAL A 37 5.021 11.675 2.272 1.00 0.00 H ATOM 516 HG22 VAL A 37 4.336 12.977 3.274 1.00 0.00 H ATOM 517 HG23 VAL A 37 5.143 13.369 1.736 1.00 0.00 H ATOM 518 H VAL A 37 5.127 12.949 5.808 1.00 0.00 H ATOM 519 N PRO A 38 8.478 11.349 6.106 1.00 15.25 N ATOM 520 CA PRO A 38 9.633 11.601 6.960 1.00 19.96 C ATOM 521 C PRO A 38 10.797 11.972 6.087 1.00 21.78 C ATOM 522 O PRO A 38 11.217 11.196 5.206 1.00 22.11 O ATOM 523 CB PRO A 38 9.899 10.241 7.626 1.00 16.93 C ATOM 524 CG PRO A 38 8.567 9.480 7.416 1.00 23.56 C ATOM 525 CD PRO A 38 8.145 9.912 6.053 1.00 17.08 C ATOM 526 HA PRO A 38 9.479 12.401 7.684 1.00 0.00 H ATOM 527 HD3 PRO A 38 8.709 9.397 5.275 1.00 0.00 H ATOM 528 HD2 PRO A 38 7.079 9.752 5.893 1.00 0.00 H ATOM 529 HG3 PRO A 38 7.829 9.768 8.165 1.00 0.00 H ATOM 530 HG2 PRO A 38 8.721 8.402 7.455 1.00 0.00 H ATOM 531 HB2 PRO A 38 10.727 9.723 7.141 1.00 0.00 H ATOM 532 HB3 PRO A 38 10.118 10.361 8.687 1.00 0.00 H ATOM 533 N THR A 39 11.302 13.169 6.310 1.00 19.08 N ATOM 534 CA THR A 39 12.519 13.597 5.630 1.00 21.92 C ATOM 535 C THR A 39 13.557 14.104 6.654 1.00 21.71 C ATOM 536 O THR A 39 13.227 14.389 7.837 1.00 18.94 O ATOM 537 CB THR A 39 12.259 14.761 4.666 1.00 15.92 C ATOM 538 OG1 THR A 39 12.183 15.982 5.443 1.00 21.84 O ATOM 539 CG2 THR A 39 10.987 14.539 3.859 1.00 12.87 C ATOM 540 HA THR A 39 12.882 12.728 5.082 1.00 0.00 H ATOM 541 HB THR A 39 13.074 14.832 3.946 1.00 0.00 H ATOM 542 HG1 THR A 39 11.444 15.910 6.098 1.00 0.00 H ATOM 543 HG23 THR A 39 11.077 13.615 3.288 1.00 0.00 H ATOM 544 HG21 THR A 39 10.136 14.467 4.537 1.00 0.00 H ATOM 545 HG22 THR A 39 10.840 15.376 3.177 1.00 0.00 H ATOM 546 H THR A 39 10.829 13.813 6.976 1.00 0.00 H ATOM 547 N MET A 40 14.785 14.218 6.154 1.00 18.61 N ATOM 548 CA MET A 40 15.909 14.856 6.854 1.00 29.37 C ATOM 549 C MET A 40 16.195 16.274 6.333 1.00 24.28 C ATOM 550 O MET A 40 17.278 16.814 6.537 1.00 26.27 O ATOM 551 CB MET A 40 17.170 13.958 6.799 1.00 20.28 C ATOM 552 CG MET A 40 17.033 12.772 7.743 1.00 31.17 C ATOM 553 SD MET A 40 18.565 11.964 8.255 1.00 41.83 S ATOM 554 CE MET A 40 18.999 11.321 6.623 1.00 34.77 C ATOM 555 HA MET A 40 15.620 14.968 7.899 1.00 0.00 H ATOM 556 HB2 MET A 40 17.303 13.591 5.781 1.00 0.00 H ATOM 557 HB3 MET A 40 18.041 14.546 7.089 1.00 0.00 H ATOM 558 HG2 MET A 40 16.414 12.024 7.247 1.00 0.00 H ATOM 559 HG3 MET A 40 16.527 13.122 8.643 1.00 0.00 H ATOM 560 HE1 MET A 40 18.209 10.657 6.274 1.00 0.00 H ATOM 561 HE2 MET A 40 19.113 12.151 5.925 1.00 0.00 H ATOM 562 HE3 MET A 40 19.937 10.769 6.689 1.00 0.00 H ATOM 563 H MET A 40 14.961 13.830 5.205 1.00 0.00 H ATOM 564 N GLY A 41 15.205 16.884 5.686 1.00 29.37 N ATOM 565 CA GLY A 41 15.393 18.197 5.030 1.00 30.26 C ATOM 566 C GLY A 41 16.275 18.151 3.783 1.00 29.25 C ATOM 567 O GLY A 41 16.452 17.096 3.158 1.00 26.67 O ATOM 568 HA3 GLY A 41 15.851 18.877 5.749 1.00 0.00 H ATOM 569 HA2 GLY A 41 14.414 18.580 4.743 1.00 0.00 H ATOM 570 H GLY A 41 14.273 16.425 5.640 1.00 0.00 H ATOM 571 N ALA A 42 16.848 19.303 3.435 1.00 32.03 N ATOM 572 CA ALA A 42 17.518 19.485 2.142 1.00 28.06 C ATOM 573 C ALA A 42 16.663 18.888 1.012 1.00 23.34 C ATOM 574 O ALA A 42 17.113 18.093 0.234 1.00 29.94 O ATOM 575 CB ALA A 42 18.938 18.895 2.174 1.00 29.28 C ATOM 576 HA ALA A 42 17.624 20.551 1.943 1.00 0.00 H ATOM 577 HB1 ALA A 42 19.521 19.397 2.946 1.00 0.00 H ATOM 578 HB2 ALA A 42 18.882 17.829 2.394 1.00 0.00 H ATOM 579 HB3 ALA A 42 19.413 19.043 1.204 1.00 0.00 H ATOM 580 H ALA A 42 16.819 20.100 4.102 1.00 0.00 H ATOM 581 N LEU A 43 15.401 19.280 0.938 1.00 27.43 N ATOM 582 CA LEU A 43 14.522 18.720 -0.045 1.00 28.22 C ATOM 583 C LEU A 43 14.940 19.055 -1.482 1.00 36.36 C ATOM 584 O LEU A 43 15.472 20.138 -1.779 1.00 38.90 O ATOM 585 CB LEU A 43 13.087 19.149 0.234 1.00 31.94 C ATOM 586 CG LEU A 43 12.613 19.051 1.700 1.00 32.04 C ATOM 587 CD1 LEU A 43 11.137 19.266 1.765 1.00 28.19 C ATOM 588 CD2 LEU A 43 12.959 17.747 2.403 1.00 30.71 C ATOM 589 HA LEU A 43 14.590 17.635 0.037 1.00 0.00 H ATOM 590 HB2 LEU A 43 12.985 20.188 -0.079 1.00 0.00 H ATOM 591 HB3 LEU A 43 12.430 18.523 -0.370 1.00 0.00 H ATOM 592 HG LEU A 43 13.158 19.830 2.233 1.00 0.00 H ATOM 593 HD21 LEU A 43 12.499 16.915 1.870 1.00 0.00 H ATOM 594 HD22 LEU A 43 14.041 17.618 2.415 1.00 0.00 H ATOM 595 HD23 LEU A 43 12.584 17.776 3.426 1.00 0.00 H ATOM 596 HD11 LEU A 43 10.897 20.254 1.372 1.00 0.00 H ATOM 597 HD12 LEU A 43 10.634 18.504 1.169 1.00 0.00 H ATOM 598 HD13 LEU A 43 10.806 19.196 2.801 1.00 0.00 H ATOM 599 H LEU A 43 15.045 20.000 1.598 1.00 0.00 H ATOM 600 N HIS A 44 14.713 18.090 -2.350 1.00 35.15 N ATOM 601 CA HIS A 44 14.964 18.179 -3.763 1.00 32.04 C ATOM 602 C HIS A 44 13.797 17.469 -4.439 1.00 33.36 C ATOM 603 O HIS A 44 12.946 16.907 -3.764 1.00 38.16 O ATOM 604 CB HIS A 44 16.284 17.456 -4.101 1.00 31.66 C ATOM 605 CG HIS A 44 16.382 16.044 -3.580 1.00 27.71 C ATOM 606 ND1 HIS A 44 15.676 14.987 -4.125 1.00 27.83 N ATOM 607 CD2 HIS A 44 17.160 15.506 -2.611 1.00 28.15 C ATOM 608 CE1 HIS A 44 15.989 13.868 -3.496 1.00 24.72 C ATOM 609 NE2 HIS A 44 16.885 14.154 -2.568 1.00 25.46 N ATOM 610 HA HIS A 44 15.052 19.213 -4.095 1.00 0.00 H ATOM 611 HB2 HIS A 44 16.386 17.426 -5.186 1.00 0.00 H ATOM 612 HB3 HIS A 44 17.106 18.033 -3.676 1.00 0.00 H ATOM 613 HD2 HIS A 44 17.871 16.041 -1.982 1.00 0.00 H ATOM 614 HE1 HIS A 44 15.579 12.880 -3.706 1.00 0.00 H ATOM 615 H HIS A 44 14.323 17.197 -1.986 1.00 0.00 H ATOM 616 N GLU A 45 13.770 17.447 -5.762 1.00 38.06 N ATOM 617 CA GLU A 45 12.626 16.890 -6.493 1.00 41.76 C ATOM 618 C GLU A 45 12.239 15.423 -6.133 1.00 39.97 C ATOM 619 O GLU A 45 11.061 15.047 -6.289 1.00 43.18 O ATOM 620 CB GLU A 45 12.841 17.077 -7.995 1.00 48.73 C ATOM 621 CG GLU A 45 11.877 16.311 -8.921 1.00 56.47 C ATOM 622 CD GLU A 45 10.552 17.042 -9.154 1.00 61.66 C ATOM 623 OE1 GLU A 45 10.366 18.175 -8.625 1.00 57.94 O ATOM 624 OE2 GLU A 45 9.706 16.467 -9.886 1.00 66.20 O ATOM 625 HA GLU A 45 11.756 17.458 -6.165 1.00 0.00 H ATOM 626 HB2 GLU A 45 12.741 18.140 -8.216 1.00 0.00 H ATOM 627 HB3 GLU A 45 13.855 16.753 -8.229 1.00 0.00 H ATOM 628 HG2 GLU A 45 12.366 16.164 -9.884 1.00 0.00 H ATOM 629 HG3 GLU A 45 11.663 15.341 -8.472 1.00 0.00 H ATOM 630 H GLU A 45 14.576 17.832 -6.294 1.00 0.00 H ATOM 631 N GLY A 46 13.202 14.615 -5.657 1.00 33.16 N ATOM 632 CA GLY A 46 12.908 13.268 -5.087 1.00 32.19 C ATOM 633 C GLY A 46 11.998 13.271 -3.828 1.00 34.44 C ATOM 634 O GLY A 46 11.118 12.405 -3.664 1.00 28.47 O ATOM 635 HA3 GLY A 46 13.855 12.800 -4.819 1.00 0.00 H ATOM 636 HA2 GLY A 46 12.417 12.674 -5.858 1.00 0.00 H ATOM 637 H GLY A 46 14.189 14.941 -5.687 1.00 0.00 H ATOM 638 N HIS A 47 12.190 14.250 -2.936 1.00 29.19 N ATOM 639 CA HIS A 47 11.255 14.423 -1.836 1.00 27.28 C ATOM 640 C HIS A 47 9.886 14.880 -2.309 1.00 23.63 C ATOM 641 O HIS A 47 8.851 14.415 -1.753 1.00 24.91 O ATOM 642 CB HIS A 47 11.801 15.382 -0.777 1.00 25.82 C ATOM 643 CG HIS A 47 13.014 14.864 -0.089 1.00 23.12 C ATOM 644 ND1 HIS A 47 14.284 15.247 -0.450 1.00 21.75 N ATOM 645 CD2 HIS A 47 13.157 13.990 0.937 1.00 27.94 C ATOM 646 CE1 HIS A 47 15.162 14.627 0.318 1.00 25.26 C ATOM 647 NE2 HIS A 47 14.506 13.867 1.178 1.00 24.91 N ATOM 648 HA HIS A 47 11.135 13.440 -1.380 1.00 0.00 H ATOM 649 HB2 HIS A 47 12.053 16.326 -1.260 1.00 0.00 H ATOM 650 HB3 HIS A 47 11.025 15.553 -0.031 1.00 0.00 H ATOM 651 HD2 HIS A 47 12.355 13.481 1.471 1.00 0.00 H ATOM 652 HE1 HIS A 47 16.246 14.726 0.253 1.00 0.00 H ATOM 653 H HIS A 47 13.007 14.886 -3.030 1.00 0.00 H ATOM 654 N LEU A 48 9.887 15.793 -3.291 1.00 21.85 N ATOM 655 CA LEU A 48 8.655 16.335 -3.915 1.00 20.14 C ATOM 656 C LEU A 48 7.747 15.275 -4.579 1.00 24.50 C ATOM 657 O LEU A 48 6.501 15.344 -4.473 1.00 27.72 O ATOM 658 CB LEU A 48 9.014 17.451 -4.884 1.00 28.59 C ATOM 659 CG LEU A 48 9.605 18.690 -4.133 1.00 34.22 C ATOM 660 CD1 LEU A 48 9.490 19.958 -4.946 1.00 35.92 C ATOM 661 CD2 LEU A 48 8.944 18.944 -2.795 1.00 32.20 C ATOM 662 HA LEU A 48 8.051 16.735 -3.101 1.00 0.00 H ATOM 663 HB2 LEU A 48 9.753 17.080 -5.594 1.00 0.00 H ATOM 664 HB3 LEU A 48 8.117 17.757 -5.422 1.00 0.00 H ATOM 665 HG LEU A 48 10.653 18.436 -3.975 1.00 0.00 H ATOM 666 HD21 LEU A 48 7.880 19.125 -2.945 1.00 0.00 H ATOM 667 HD22 LEU A 48 9.079 18.073 -2.154 1.00 0.00 H ATOM 668 HD23 LEU A 48 9.399 19.816 -2.326 1.00 0.00 H ATOM 669 HD11 LEU A 48 10.034 19.838 -5.883 1.00 0.00 H ATOM 670 HD12 LEU A 48 8.440 20.159 -5.157 1.00 0.00 H ATOM 671 HD13 LEU A 48 9.914 20.789 -4.382 1.00 0.00 H ATOM 672 H LEU A 48 10.805 16.141 -3.635 1.00 0.00 H ATOM 673 N ALA A 49 8.343 14.257 -5.201 1.00 22.51 N ATOM 674 CA ALA A 49 7.535 13.151 -5.739 1.00 31.06 C ATOM 675 C ALA A 49 6.763 12.444 -4.620 1.00 32.28 C ATOM 676 O ALA A 49 5.592 12.073 -4.812 1.00 39.80 O ATOM 677 CB ALA A 49 8.381 12.156 -6.504 1.00 23.34 C ATOM 678 HA ALA A 49 6.820 13.586 -6.438 1.00 0.00 H ATOM 679 HB1 ALA A 49 8.869 12.661 -7.338 1.00 0.00 H ATOM 680 HB2 ALA A 49 9.136 11.737 -5.839 1.00 0.00 H ATOM 681 HB3 ALA A 49 7.745 11.356 -6.884 1.00 0.00 H ATOM 682 H ALA A 49 9.378 14.245 -5.306 1.00 0.00 H ATOM 683 N LEU A 50 7.422 12.275 -3.463 1.00 35.74 N ATOM 684 CA LEU A 50 6.813 11.735 -2.215 1.00 31.61 C ATOM 685 C LEU A 50 5.616 12.572 -1.697 1.00 28.87 C ATOM 686 O LEU A 50 4.556 12.007 -1.370 1.00 22.83 O ATOM 687 CB LEU A 50 7.871 11.574 -1.111 1.00 30.60 C ATOM 688 CG LEU A 50 9.032 10.582 -1.305 1.00 32.34 C ATOM 689 CD1 LEU A 50 9.760 10.379 -0.001 1.00 33.51 C ATOM 690 CD2 LEU A 50 8.495 9.259 -1.793 1.00 34.07 C ATOM 691 HA LEU A 50 6.415 10.755 -2.479 1.00 0.00 H ATOM 692 HB2 LEU A 50 8.317 12.556 -0.955 1.00 0.00 H ATOM 693 HB3 LEU A 50 7.342 11.269 -0.208 1.00 0.00 H ATOM 694 HG LEU A 50 9.725 10.987 -2.043 1.00 0.00 H ATOM 695 HD21 LEU A 50 7.796 8.859 -1.058 1.00 0.00 H ATOM 696 HD22 LEU A 50 7.981 9.405 -2.743 1.00 0.00 H ATOM 697 HD23 LEU A 50 9.321 8.561 -1.929 1.00 0.00 H ATOM 698 HD11 LEU A 50 10.157 11.334 0.344 1.00 0.00 H ATOM 699 HD12 LEU A 50 9.068 9.982 0.742 1.00 0.00 H ATOM 700 HD13 LEU A 50 10.579 9.676 -0.149 1.00 0.00 H ATOM 701 H LEU A 50 8.427 12.539 -3.436 1.00 0.00 H ATOM 702 N VAL A 51 5.787 13.899 -1.634 1.00 26.17 N ATOM 703 CA VAL A 51 4.675 14.821 -1.297 1.00 28.38 C ATOM 704 C VAL A 51 3.500 14.703 -2.277 1.00 29.71 C ATOM 705 O VAL A 51 2.380 14.618 -1.865 1.00 33.27 O ATOM 706 CB VAL A 51 5.122 16.273 -1.339 1.00 27.16 C ATOM 707 CG1 VAL A 51 3.890 17.198 -1.236 1.00 29.36 C ATOM 708 CG2 VAL A 51 6.148 16.563 -0.227 1.00 30.40 C ATOM 709 HA VAL A 51 4.363 14.532 -0.293 1.00 0.00 H ATOM 710 HB VAL A 51 5.618 16.469 -2.290 1.00 0.00 H ATOM 711 HG11 VAL A 51 3.218 17.001 -2.072 1.00 0.00 H ATOM 712 HG12 VAL A 51 3.370 17.006 -0.297 1.00 0.00 H ATOM 713 HG13 VAL A 51 4.215 18.238 -1.266 1.00 0.00 H ATOM 714 HG21 VAL A 51 5.696 16.362 0.744 1.00 0.00 H ATOM 715 HG22 VAL A 51 7.020 15.923 -0.363 1.00 0.00 H ATOM 716 HG23 VAL A 51 6.452 17.608 -0.279 1.00 0.00 H ATOM 717 H VAL A 51 6.729 14.295 -1.827 1.00 0.00 H ATOM 718 N ARG A 52 3.766 14.718 -3.558 1.00 34.46 N ATOM 719 CA ARG A 52 2.745 14.565 -4.561 1.00 34.60 C ATOM 720 C ARG A 52 1.915 13.279 -4.530 1.00 35.29 C ATOM 721 O ARG A 52 0.744 13.330 -4.761 1.00 38.35 O ATOM 722 CB ARG A 52 3.346 14.783 -5.932 1.00 33.89 C ATOM 723 CG ARG A 52 3.866 16.156 -6.120 1.00 33.18 C ATOM 724 CD ARG A 52 4.807 16.205 -7.226 1.00 33.83 C ATOM 725 NE ARG A 52 5.500 17.453 -7.223 1.00 41.51 N ATOM 726 CZ ARG A 52 6.640 17.664 -7.839 1.00 43.38 C ATOM 727 NH1 ARG A 52 7.203 16.692 -8.506 1.00 37.25 N ATOM 728 NH2 ARG A 52 7.207 18.843 -7.783 1.00 38.28 N ATOM 729 HA ARG A 52 2.011 15.332 -4.315 1.00 0.00 H ATOM 730 HB2 ARG A 52 4.166 14.078 -6.069 1.00 0.00 H ATOM 731 HB3 ARG A 52 2.578 14.595 -6.683 1.00 0.00 H ATOM 732 HG2 ARG A 52 3.034 16.828 -6.329 1.00 0.00 H ATOM 733 HG3 ARG A 52 4.370 16.476 -5.208 1.00 0.00 H ATOM 734 HD2 ARG A 52 4.266 16.095 -8.166 1.00 0.00 H ATOM 735 HD3 ARG A 52 5.526 15.392 -7.125 1.00 0.00 H ATOM 736 HE ARG A 52 5.075 18.245 -6.700 1.00 0.00 H ATOM 737 HH12 ARG A 52 8.106 16.853 -8.996 1.00 0.00 H ATOM 738 HH11 ARG A 52 6.748 15.758 -8.547 1.00 0.00 H ATOM 739 HH22 ARG A 52 8.110 19.009 -8.271 1.00 0.00 H ATOM 740 HH21 ARG A 52 6.754 19.613 -7.250 1.00 0.00 H ATOM 741 H ARG A 52 4.752 14.845 -3.863 1.00 0.00 H ATOM 742 N ALA A 53 2.536 12.154 -4.244 1.00 27.58 N ATOM 743 CA ALA A 53 1.862 10.894 -4.031 1.00 28.22 C ATOM 744 C ALA A 53 0.919 10.937 -2.866 1.00 32.04 C ATOM 745 O ALA A 53 -0.135 10.371 -2.900 1.00 38.21 O ATOM 746 CB ALA A 53 2.866 9.792 -3.815 1.00 18.78 C ATOM 747 HA ALA A 53 1.276 10.697 -4.929 1.00 0.00 H ATOM 748 HB1 ALA A 53 3.507 9.709 -4.693 1.00 0.00 H ATOM 749 HB2 ALA A 53 3.474 10.023 -2.940 1.00 0.00 H ATOM 750 HB3 ALA A 53 2.341 8.850 -3.656 1.00 0.00 H ATOM 751 H ALA A 53 3.573 12.173 -4.167 1.00 0.00 H ATOM 752 N ALA A 54 1.339 11.588 -1.815 1.00 33.32 N ATOM 753 CA ALA A 54 0.545 11.746 -0.655 1.00 33.11 C ATOM 754 C ALA A 54 -0.551 12.742 -0.937 1.00 32.50 C ATOM 755 O ALA A 54 -1.634 12.571 -0.501 1.00 36.58 O ATOM 756 CB ALA A 54 1.395 12.170 0.485 1.00 26.59 C ATOM 757 HA ALA A 54 0.082 10.797 -0.384 1.00 0.00 H ATOM 758 HB1 ALA A 54 2.156 11.412 0.670 1.00 0.00 H ATOM 759 HB2 ALA A 54 1.875 13.119 0.245 1.00 0.00 H ATOM 760 HB3 ALA A 54 0.775 12.289 1.374 1.00 0.00 H ATOM 761 H ALA A 54 2.291 12.005 -1.831 1.00 0.00 H ATOM 762 N LYS A 55 -0.247 13.772 -1.707 1.00 41.41 N ATOM 763 CA LYS A 55 -1.220 14.827 -2.099 1.00 43.71 C ATOM 764 C LYS A 55 -2.376 14.238 -2.887 1.00 42.75 C ATOM 765 O LYS A 55 -3.499 14.695 -2.785 1.00 48.35 O ATOM 766 CB LYS A 55 -0.554 15.894 -2.974 1.00 47.86 C ATOM 767 CG LYS A 55 -0.100 17.168 -2.273 1.00 53.15 C ATOM 768 CD LYS A 55 -0.987 18.336 -2.624 1.00 60.09 C ATOM 769 CE LYS A 55 -2.048 18.562 -1.556 1.00 67.93 C ATOM 770 NZ LYS A 55 -3.272 19.195 -2.133 1.00 69.40 N ATOM 771 HA LYS A 55 -1.586 15.275 -1.175 1.00 0.00 H ATOM 772 HB2 LYS A 55 0.323 15.441 -3.438 1.00 0.00 H ATOM 773 HB3 LYS A 55 -1.267 16.179 -3.748 1.00 0.00 H ATOM 774 HG2 LYS A 55 -0.131 17.010 -1.195 1.00 0.00 H ATOM 775 HG3 LYS A 55 0.922 17.395 -2.576 1.00 0.00 H ATOM 776 HD2 LYS A 55 -0.375 19.234 -2.713 1.00 0.00 H ATOM 777 HD3 LYS A 55 -1.478 18.136 -3.577 1.00 0.00 H ATOM 778 HE2 LYS A 55 -1.641 19.214 -0.783 1.00 0.00 H ATOM 779 HE3 LYS A 55 -2.318 17.603 -1.115 1.00 0.00 H ATOM 780 HZ1 LYS A 55 -3.021 20.114 -2.551 1.00 0.00 H ATOM 781 HZ2 LYS A 55 -3.668 18.575 -2.868 1.00 0.00 H ATOM 782 HZ3 LYS A 55 -3.976 19.336 -1.380 1.00 0.00 H ATOM 783 H LYS A 55 0.728 13.850 -2.059 1.00 0.00 H ATOM 784 N ARG A 56 -2.099 13.206 -3.660 1.00 42.39 N ATOM 785 CA ARG A 56 -3.103 12.699 -4.553 1.00 43.94 C ATOM 786 C ARG A 56 -4.010 11.648 -3.926 1.00 43.06 C ATOM 787 O ARG A 56 -4.979 11.221 -4.548 1.00 47.43 O ATOM 788 CB ARG A 56 -2.520 12.339 -5.945 1.00 48.08 C ATOM 789 CG ARG A 56 -1.384 11.361 -6.031 1.00 50.63 C ATOM 790 CD ARG A 56 -1.859 10.058 -6.638 1.00 61.89 C ATOM 791 NE ARG A 56 -3.064 9.519 -5.965 1.00 69.65 N ATOM 792 CZ ARG A 56 -3.074 8.486 -5.109 1.00 69.19 C ATOM 793 NH1 ARG A 56 -1.935 7.867 -4.810 1.00 67.79 N ATOM 794 NH2 ARG A 56 -4.215 8.063 -4.553 1.00 59.68 N ATOM 795 HA ARG A 56 -3.794 13.519 -4.749 1.00 0.00 H ATOM 796 HB2 ARG A 56 -3.338 11.930 -6.538 1.00 0.00 H ATOM 797 HB3 ARG A 56 -2.175 13.269 -6.397 1.00 0.00 H ATOM 798 HG2 ARG A 56 -0.594 11.781 -6.653 1.00 0.00 H ATOM 799 HG3 ARG A 56 -0.995 11.172 -5.030 1.00 0.00 H ATOM 800 HD2 ARG A 56 -1.057 9.324 -6.559 1.00 0.00 H ATOM 801 HD3 ARG A 56 -2.093 10.227 -7.689 1.00 0.00 H ATOM 802 HE ARG A 56 -3.974 9.978 -6.173 1.00 0.00 H ATOM 803 HH12 ARG A 56 -1.937 7.066 -4.147 1.00 0.00 H ATOM 804 HH11 ARG A 56 -1.042 8.184 -5.239 1.00 0.00 H ATOM 805 HH22 ARG A 56 -4.205 7.261 -3.891 1.00 0.00 H ATOM 806 HH21 ARG A 56 -5.112 8.537 -4.782 1.00 0.00 H ATOM 807 H ARG A 56 -1.159 12.762 -3.623 1.00 0.00 H ATOM 808 N VAL A 57 -3.735 11.283 -2.674 1.00 40.80 N ATOM 809 CA VAL A 57 -4.635 10.430 -1.894 1.00 37.42 C ATOM 810 C VAL A 57 -5.851 11.257 -1.423 1.00 43.67 C ATOM 811 O VAL A 57 -5.688 12.199 -0.627 1.00 38.43 O ATOM 812 CB VAL A 57 -3.947 9.805 -0.669 1.00 33.85 C ATOM 813 CG1 VAL A 57 -4.963 9.002 0.159 1.00 30.94 C ATOM 814 CG2 VAL A 57 -2.790 8.918 -1.072 1.00 34.66 C ATOM 815 HA VAL A 57 -4.949 9.615 -2.546 1.00 0.00 H ATOM 816 HB VAL A 57 -3.549 10.618 -0.062 1.00 0.00 H ATOM 817 HG11 VAL A 57 -5.760 9.665 0.496 1.00 0.00 H ATOM 818 HG12 VAL A 57 -5.385 8.208 -0.457 1.00 0.00 H ATOM 819 HG13 VAL A 57 -4.462 8.565 1.023 1.00 0.00 H ATOM 820 HG21 VAL A 57 -3.156 8.113 -1.710 1.00 0.00 H ATOM 821 HG22 VAL A 57 -2.054 9.509 -1.617 1.00 0.00 H ATOM 822 HG23 VAL A 57 -2.330 8.495 -0.179 1.00 0.00 H ATOM 823 H VAL A 57 -2.852 11.615 -2.236 1.00 0.00 H ATOM 824 N PRO A 58 -7.075 10.902 -1.913 1.00 48.04 N ATOM 825 CA PRO A 58 -8.327 11.646 -1.667 1.00 45.25 C ATOM 826 C PRO A 58 -8.618 11.954 -0.188 1.00 45.48 C ATOM 827 O PRO A 58 -8.747 11.024 0.619 1.00 45.51 O ATOM 828 CB PRO A 58 -9.395 10.702 -2.239 1.00 43.50 C ATOM 829 CG PRO A 58 -8.716 9.983 -3.310 1.00 41.25 C ATOM 830 CD PRO A 58 -7.330 9.729 -2.779 1.00 47.54 C ATOM 831 HA PRO A 58 -8.287 12.636 -2.122 1.00 0.00 H ATOM 832 HD3 PRO A 58 -7.296 8.804 -2.204 1.00 0.00 H ATOM 833 HD2 PRO A 58 -6.604 9.678 -3.591 1.00 0.00 H ATOM 834 HG3 PRO A 58 -8.676 10.589 -4.215 1.00 0.00 H ATOM 835 HG2 PRO A 58 -9.224 9.043 -3.525 1.00 0.00 H ATOM 836 HB2 PRO A 58 -9.747 10.010 -1.474 1.00 0.00 H ATOM 837 HB3 PRO A 58 -10.240 11.269 -2.631 1.00 0.00 H ATOM 838 N GLY A 59 -8.746 13.243 0.149 1.00 44.83 N ATOM 839 CA GLY A 59 -9.029 13.675 1.535 1.00 43.58 C ATOM 840 C GLY A 59 -7.785 13.913 2.402 1.00 47.02 C ATOM 841 O GLY A 59 -7.889 14.178 3.602 1.00 48.71 O ATOM 842 HA3 GLY A 59 -9.634 12.905 2.014 1.00 0.00 H ATOM 843 HA2 GLY A 59 -9.595 14.605 1.492 1.00 0.00 H ATOM 844 H GLY A 59 -8.643 13.967 -0.590 1.00 0.00 H ATOM 845 N SER A 60 -6.612 13.804 1.779 1.00 43.50 N ATOM 846 CA SER A 60 -5.350 13.815 2.458 1.00 42.50 C ATOM 847 C SER A 60 -5.091 15.160 3.159 1.00 45.67 C ATOM 848 O SER A 60 -5.490 16.231 2.677 1.00 42.52 O ATOM 849 CB SER A 60 -4.246 13.549 1.441 1.00 44.79 C ATOM 850 OG SER A 60 -4.257 14.559 0.427 1.00 48.05 O ATOM 851 HA SER A 60 -5.363 13.041 3.225 1.00 0.00 H ATOM 852 HB2 SER A 60 -4.407 12.574 0.981 1.00 0.00 H ATOM 853 HB3 SER A 60 -3.280 13.556 1.947 1.00 0.00 H ATOM 854 HG SER A 60 -4.109 15.445 0.844 1.00 0.00 H ATOM 855 H SER A 60 -6.612 13.706 0.744 1.00 0.00 H ATOM 856 N VAL A 61 -4.446 15.088 4.321 1.00 40.00 N ATOM 857 CA VAL A 61 -3.740 16.227 4.861 1.00 38.70 C ATOM 858 C VAL A 61 -2.295 15.706 4.994 1.00 39.54 C ATOM 859 O VAL A 61 -2.089 14.625 5.554 1.00 35.80 O ATOM 860 CB VAL A 61 -4.363 16.737 6.183 1.00 34.81 C ATOM 861 CG1 VAL A 61 -4.334 15.658 7.262 1.00 36.49 C ATOM 862 CG2 VAL A 61 -3.647 17.953 6.659 1.00 37.57 C ATOM 863 HA VAL A 61 -3.791 17.114 4.230 1.00 0.00 H ATOM 864 HB VAL A 61 -5.404 16.991 5.984 1.00 0.00 H ATOM 865 HG11 VAL A 61 -4.901 14.791 6.922 1.00 0.00 H ATOM 866 HG12 VAL A 61 -3.302 15.366 7.454 1.00 0.00 H ATOM 867 HG13 VAL A 61 -4.779 16.049 8.177 1.00 0.00 H ATOM 868 HG21 VAL A 61 -2.598 17.712 6.830 1.00 0.00 H ATOM 869 HG22 VAL A 61 -3.723 18.736 5.905 1.00 0.00 H ATOM 870 HG23 VAL A 61 -4.098 18.298 7.589 1.00 0.00 H ATOM 871 H VAL A 61 -4.450 14.193 4.851 1.00 0.00 H ATOM 872 N VAL A 62 -1.324 16.441 4.425 1.00 39.64 N ATOM 873 CA VAL A 62 0.083 15.997 4.349 1.00 36.47 C ATOM 874 C VAL A 62 0.937 16.558 5.501 1.00 35.54 C ATOM 875 O VAL A 62 0.982 17.790 5.722 1.00 33.97 O ATOM 876 CB VAL A 62 0.790 16.366 2.977 1.00 34.47 C ATOM 877 CG1 VAL A 62 2.111 15.627 2.836 1.00 25.96 C ATOM 878 CG2 VAL A 62 -0.066 16.045 1.797 1.00 26.36 C ATOM 879 HA VAL A 62 0.025 14.911 4.428 1.00 0.00 H ATOM 880 HB VAL A 62 0.963 17.442 2.999 1.00 0.00 H ATOM 881 HG11 VAL A 62 2.771 15.904 3.658 1.00 0.00 H ATOM 882 HG12 VAL A 62 1.929 14.553 2.861 1.00 0.00 H ATOM 883 HG13 VAL A 62 2.577 15.896 1.888 1.00 0.00 H ATOM 884 HG21 VAL A 62 -0.286 14.977 1.789 1.00 0.00 H ATOM 885 HG22 VAL A 62 -0.997 16.608 1.861 1.00 0.00 H ATOM 886 HG23 VAL A 62 0.462 16.316 0.883 1.00 0.00 H ATOM 887 H VAL A 62 -1.575 17.365 4.019 1.00 0.00 H ATOM 888 N VAL A 63 1.619 15.646 6.202 1.00 30.46 N ATOM 889 CA VAL A 63 2.659 15.991 7.185 1.00 25.44 C ATOM 890 C VAL A 63 4.031 15.656 6.589 1.00 21.79 C ATOM 891 O VAL A 63 4.313 14.536 6.191 1.00 21.40 O ATOM 892 CB VAL A 63 2.427 15.333 8.597 1.00 23.65 C ATOM 893 CG1 VAL A 63 3.429 15.840 9.632 1.00 29.71 C ATOM 894 CG2 VAL A 63 1.024 15.676 9.133 1.00 28.80 C ATOM 895 HA VAL A 63 2.608 17.062 7.382 1.00 0.00 H ATOM 896 HB VAL A 63 2.546 14.259 8.454 1.00 0.00 H ATOM 897 HG11 VAL A 63 4.441 15.600 9.305 1.00 0.00 H ATOM 898 HG12 VAL A 63 3.326 16.920 9.737 1.00 0.00 H ATOM 899 HG13 VAL A 63 3.233 15.361 10.591 1.00 0.00 H ATOM 900 HG21 VAL A 63 0.927 16.758 9.227 1.00 0.00 H ATOM 901 HG22 VAL A 63 0.270 15.301 8.441 1.00 0.00 H ATOM 902 HG23 VAL A 63 0.886 15.211 10.109 1.00 0.00 H ATOM 903 H VAL A 63 1.403 14.641 6.045 1.00 0.00 H ATOM 904 N VAL A 64 4.879 16.657 6.484 1.00 20.67 N ATOM 905 CA VAL A 64 6.263 16.409 6.137 1.00 19.98 C ATOM 906 C VAL A 64 7.027 16.642 7.405 1.00 22.63 C ATOM 907 O VAL A 64 6.836 17.657 8.034 1.00 27.73 O ATOM 908 CB VAL A 64 6.709 17.294 4.968 1.00 19.59 C ATOM 909 CG1 VAL A 64 8.138 16.951 4.579 1.00 11.89 C ATOM 910 CG2 VAL A 64 5.744 16.998 3.753 1.00 15.88 C ATOM 911 HA VAL A 64 6.437 15.396 5.775 1.00 0.00 H ATOM 912 HB VAL A 64 6.669 18.347 5.247 1.00 0.00 H ATOM 913 HG11 VAL A 64 8.796 17.120 5.432 1.00 0.00 H ATOM 914 HG12 VAL A 64 8.190 15.904 4.280 1.00 0.00 H ATOM 915 HG13 VAL A 64 8.449 17.584 3.748 1.00 0.00 H ATOM 916 HG21 VAL A 64 5.815 15.944 3.483 1.00 0.00 H ATOM 917 HG22 VAL A 64 4.719 17.233 4.039 1.00 0.00 H ATOM 918 HG23 VAL A 64 6.035 17.613 2.902 1.00 0.00 H ATOM 919 H VAL A 64 4.554 17.631 6.651 1.00 0.00 H ATOM 920 N SER A 65 7.834 15.682 7.836 1.00 22.95 N ATOM 921 CA SER A 65 8.684 15.960 8.984 1.00 22.93 C ATOM 922 C SER A 65 10.099 16.232 8.524 1.00 21.04 C ATOM 923 O SER A 65 10.590 15.640 7.548 1.00 24.77 O ATOM 924 CB SER A 65 8.649 14.819 10.017 1.00 23.60 C ATOM 925 OG SER A 65 9.290 13.655 9.512 1.00 21.79 O ATOM 926 HA SER A 65 8.296 16.848 9.482 1.00 0.00 H ATOM 927 HB2 SER A 65 7.611 14.582 10.251 1.00 0.00 H ATOM 928 HB3 SER A 65 9.160 15.143 10.924 1.00 0.00 H ATOM 929 HG SER A 65 10.234 13.865 9.302 1.00 0.00 H ATOM 930 H SER A 65 7.859 14.755 7.366 1.00 0.00 H ATOM 931 N ILE A 66 10.765 17.132 9.228 1.00 23.19 N ATOM 932 CA ILE A 66 12.189 17.454 8.950 1.00 26.05 C ATOM 933 C ILE A 66 13.037 17.301 10.210 1.00 24.76 C ATOM 934 O ILE A 66 12.977 18.134 11.121 1.00 27.97 O ATOM 935 CB ILE A 66 12.330 18.917 8.410 1.00 26.23 C ATOM 936 CG1 ILE A 66 11.374 19.108 7.244 1.00 15.37 C ATOM 937 CG2 ILE A 66 13.857 19.315 8.114 1.00 17.85 C ATOM 938 CD1 ILE A 66 11.464 20.497 6.564 1.00 25.69 C ATOM 939 HA ILE A 66 12.543 16.754 8.193 1.00 0.00 H ATOM 940 HB ILE A 66 12.035 19.629 9.181 1.00 0.00 H ATOM 941 HG12 ILE A 66 11.593 18.347 6.495 1.00 0.00 H ATOM 942 HG13 ILE A 66 10.357 18.973 7.611 1.00 0.00 H ATOM 943 HD11 ILE A 66 11.235 21.273 7.294 1.00 0.00 H ATOM 944 HD12 ILE A 66 12.472 20.646 6.177 1.00 0.00 H ATOM 945 HD13 ILE A 66 10.748 20.546 5.744 1.00 0.00 H ATOM 946 HG21 ILE A 66 14.436 19.238 9.034 1.00 0.00 H ATOM 947 HG22 ILE A 66 14.269 18.638 7.366 1.00 0.00 H ATOM 948 HG23 ILE A 66 13.899 20.339 7.742 1.00 0.00 H ATOM 949 H ILE A 66 10.277 17.630 10.000 1.00 0.00 H ATOM 950 N PHE A 67 13.829 16.250 10.270 1.00 18.44 N ATOM 951 CA PHE A 67 14.596 15.971 11.472 1.00 18.89 C ATOM 952 C PHE A 67 15.861 15.266 11.072 1.00 22.35 C ATOM 953 O PHE A 67 15.818 14.207 10.449 1.00 25.55 O ATOM 954 CB PHE A 67 13.767 15.151 12.492 1.00 19.49 C ATOM 955 CG PHE A 67 14.466 14.929 13.812 1.00 17.65 C ATOM 956 CD1 PHE A 67 14.865 16.000 14.597 1.00 16.75 C ATOM 957 CD2 PHE A 67 14.766 13.635 14.251 1.00 19.73 C ATOM 958 CE1 PHE A 67 15.595 15.787 15.791 1.00 17.46 C ATOM 959 CE2 PHE A 67 15.485 13.419 15.432 1.00 16.97 C ATOM 960 CZ PHE A 67 15.885 14.484 16.209 1.00 16.70 C ATOM 961 HA PHE A 67 14.852 16.904 11.975 1.00 0.00 H ATOM 962 HB2 PHE A 67 12.834 15.682 12.682 1.00 0.00 H ATOM 963 HB3 PHE A 67 13.547 14.178 12.052 1.00 0.00 H ATOM 964 HD2 PHE A 67 14.434 12.780 13.663 1.00 0.00 H ATOM 965 HE2 PHE A 67 15.730 12.402 15.739 1.00 0.00 H ATOM 966 HZ PHE A 67 16.423 14.313 17.141 1.00 0.00 H ATOM 967 HE1 PHE A 67 15.931 16.638 16.384 1.00 0.00 H ATOM 968 HD1 PHE A 67 14.614 17.016 14.292 1.00 0.00 H ATOM 969 H PHE A 67 13.906 15.615 9.450 1.00 0.00 H ATOM 970 N VAL A 68 16.998 15.891 11.352 1.00 31.17 N ATOM 971 CA VAL A 68 18.303 15.241 11.125 1.00 30.58 C ATOM 972 C VAL A 68 18.565 14.505 12.395 1.00 28.82 C ATOM 973 O VAL A 68 18.745 15.101 13.459 1.00 32.49 O ATOM 974 CB VAL A 68 19.403 16.255 10.778 1.00 33.08 C ATOM 975 CG1 VAL A 68 20.765 15.586 10.677 1.00 32.55 C ATOM 976 CG2 VAL A 68 19.058 16.953 9.456 1.00 29.38 C ATOM 977 HA VAL A 68 18.295 14.571 10.265 1.00 0.00 H ATOM 978 HB VAL A 68 19.455 16.992 11.580 1.00 0.00 H ATOM 979 HG11 VAL A 68 21.012 15.121 11.632 1.00 0.00 H ATOM 980 HG12 VAL A 68 20.738 14.825 9.897 1.00 0.00 H ATOM 981 HG13 VAL A 68 21.518 16.334 10.430 1.00 0.00 H ATOM 982 HG21 VAL A 68 18.985 16.210 8.662 1.00 0.00 H ATOM 983 HG22 VAL A 68 18.105 17.471 9.558 1.00 0.00 H ATOM 984 HG23 VAL A 68 19.840 17.672 9.211 1.00 0.00 H ATOM 985 H VAL A 68 16.969 16.856 11.738 1.00 0.00 H ATOM 986 N ASN A 69 18.489 13.197 12.304 1.00 29.48 N ATOM 987 CA ASN A 69 18.383 12.381 13.480 1.00 31.76 C ATOM 988 C ASN A 69 19.761 11.961 13.975 1.00 37.88 C ATOM 989 O ASN A 69 20.399 11.134 13.318 1.00 47.87 O ATOM 990 CB ASN A 69 17.532 11.172 13.075 1.00 40.53 C ATOM 991 CG ASN A 69 17.606 10.021 14.074 1.00 43.04 C ATOM 992 OD1 ASN A 69 17.474 8.846 13.696 1.00 42.42 O ATOM 993 ND2 ASN A 69 17.835 10.349 15.345 1.00 44.64 N ATOM 994 HA ASN A 69 17.922 12.921 14.307 1.00 0.00 H ATOM 995 HB2 ASN A 69 16.493 11.492 12.991 1.00 0.00 H ATOM 996 HB3 ASN A 69 17.879 10.813 12.106 1.00 0.00 H ATOM 997 HD22 ASN A 69 17.939 11.348 15.614 1.00 0.00 H ATOM 998 HD21 ASN A 69 17.910 9.606 16.068 1.00 0.00 H ATOM 999 H ASN A 69 18.506 12.746 11.367 1.00 0.00 H ATOM 1000 N PRO A 70 20.238 12.484 15.127 1.00 38.15 N ATOM 1001 CA PRO A 70 21.638 12.140 15.400 1.00 43.62 C ATOM 1002 C PRO A 70 21.876 10.662 15.800 1.00 54.89 C ATOM 1003 O PRO A 70 23.028 10.275 16.106 1.00 62.17 O ATOM 1004 CB PRO A 70 22.045 13.109 16.525 1.00 37.30 C ATOM 1005 CG PRO A 70 20.790 13.580 17.126 1.00 33.65 C ATOM 1006 CD PRO A 70 19.643 13.287 16.210 1.00 35.35 C ATOM 1007 HA PRO A 70 22.241 12.241 14.497 1.00 0.00 H ATOM 1008 HD3 PRO A 70 18.868 12.722 16.729 1.00 0.00 H ATOM 1009 HD2 PRO A 70 19.217 14.210 15.817 1.00 0.00 H ATOM 1010 HG3 PRO A 70 20.852 14.655 17.296 1.00 0.00 H ATOM 1011 HG2 PRO A 70 20.632 13.072 18.077 1.00 0.00 H ATOM 1012 HB2 PRO A 70 22.652 12.593 17.269 1.00 0.00 H ATOM 1013 HB3 PRO A 70 22.609 13.948 16.117 1.00 0.00 H ATOM 1014 N MET A 71 20.825 9.834 15.773 1.00 60.38 N ATOM 1015 CA MET A 71 20.966 8.406 16.142 1.00 62.73 C ATOM 1016 C MET A 71 21.373 7.486 14.966 1.00 63.34 C ATOM 1017 O MET A 71 21.956 6.400 15.181 1.00 62.20 O ATOM 1018 CB MET A 71 19.707 7.878 16.860 1.00 62.76 C ATOM 1019 CG MET A 71 19.912 6.530 17.563 1.00 62.97 C ATOM 1020 SD MET A 71 18.411 5.626 18.066 1.00 64.23 S ATOM 1021 CE MET A 71 19.151 4.013 18.398 1.00 62.01 C ATOM 1022 HA MET A 71 21.801 8.371 16.842 1.00 0.00 H ATOM 1023 HB2 MET A 71 19.404 8.612 17.606 1.00 0.00 H ATOM 1024 HB3 MET A 71 18.913 7.763 16.122 1.00 0.00 H ATOM 1025 HG2 MET A 71 20.503 6.713 18.460 1.00 0.00 H ATOM 1026 HG3 MET A 71 20.473 5.887 16.885 1.00 0.00 H ATOM 1027 HE1 MET A 71 19.621 3.637 17.490 1.00 0.00 H ATOM 1028 HE2 MET A 71 19.901 4.113 19.182 1.00 0.00 H ATOM 1029 HE3 MET A 71 18.376 3.319 18.722 1.00 0.00 H ATOM 1030 H MET A 71 19.894 10.199 15.488 1.00 0.00 H ATOM 1031 N GLN A 72 21.066 7.914 13.737 1.00 63.47 N ATOM 1032 CA GLN A 72 21.379 7.098 12.546 1.00 62.86 C ATOM 1033 C GLN A 72 22.774 7.381 11.942 1.00 65.38 C ATOM 1034 O GLN A 72 23.286 6.613 11.096 1.00 63.57 O ATOM 1035 CB GLN A 72 20.251 7.170 11.510 1.00 56.38 C ATOM 1036 CG GLN A 72 20.114 8.471 10.735 1.00 50.25 C ATOM 1037 CD GLN A 72 18.727 8.586 10.109 1.00 49.06 C ATOM 1038 OE1 GLN A 72 17.716 8.625 10.817 1.00 42.80 O ATOM 1039 NE2 GLN A 72 18.671 8.606 8.778 1.00 47.20 N ATOM 1040 HA GLN A 72 21.439 6.065 12.889 1.00 0.00 H ATOM 1041 HB2 GLN A 72 20.415 6.371 10.787 1.00 0.00 H ATOM 1042 HB3 GLN A 72 19.311 6.997 12.033 1.00 0.00 H ATOM 1043 HG2 GLN A 72 20.271 9.310 11.413 1.00 0.00 H ATOM 1044 HG3 GLN A 72 20.866 8.498 9.946 1.00 0.00 H ATOM 1045 HE22 GLN A 72 19.548 8.571 8.220 1.00 0.00 H ATOM 1046 HE21 GLN A 72 17.750 8.656 8.297 1.00 0.00 H ATOM 1047 H GLN A 72 20.600 8.836 13.618 1.00 0.00 H ATOM 1048 N PHE A 73 23.367 8.484 12.410 1.00 68.22 N ATOM 1049 CA PHE A 73 24.758 8.848 12.132 1.00 72.16 C ATOM 1050 C PHE A 73 25.694 8.279 13.217 1.00 76.58 C ATOM 1051 O PHE A 73 25.273 8.022 14.354 1.00 74.91 O ATOM 1052 CB PHE A 73 24.915 10.381 12.047 1.00 69.87 C ATOM 1053 CG PHE A 73 24.112 11.029 10.940 1.00 67.58 C ATOM 1054 CD1 PHE A 73 22.765 11.351 11.123 1.00 66.52 C ATOM 1055 CD2 PHE A 73 24.708 11.343 9.724 1.00 66.22 C ATOM 1056 CE1 PHE A 73 22.014 11.946 10.091 1.00 67.49 C ATOM 1057 CE2 PHE A 73 23.969 11.957 8.690 1.00 67.65 C ATOM 1058 CZ PHE A 73 22.619 12.249 8.874 1.00 66.26 C ATOM 1059 HA PHE A 73 25.035 8.417 11.170 1.00 0.00 H ATOM 1060 HB2 PHE A 73 24.596 10.810 12.997 1.00 0.00 H ATOM 1061 HB3 PHE A 73 25.968 10.608 11.883 1.00 0.00 H ATOM 1062 HD2 PHE A 73 25.761 11.112 9.567 1.00 0.00 H ATOM 1063 HE2 PHE A 73 24.455 12.203 7.746 1.00 0.00 H ATOM 1064 HZ PHE A 73 22.042 12.710 8.073 1.00 0.00 H ATOM 1065 HE1 PHE A 73 20.958 12.170 10.245 1.00 0.00 H ATOM 1066 HD1 PHE A 73 22.288 11.138 12.080 1.00 0.00 H ATOM 1067 H PHE A 73 22.806 9.123 13.009 1.00 0.00 H ATOM 1068 N GLY A 74 26.961 8.079 12.856 1.00 80.91 N ATOM 1069 CA GLY A 74 27.977 7.619 13.803 1.00 87.92 C ATOM 1070 C GLY A 74 29.216 8.482 13.691 1.00 92.65 C ATOM 1071 O GLY A 74 29.369 9.227 12.716 1.00 94.92 O ATOM 1072 HA3 GLY A 74 28.236 6.584 13.581 1.00 0.00 H ATOM 1073 HA2 GLY A 74 27.582 7.684 14.817 1.00 0.00 H ATOM 1074 H GLY A 74 27.237 8.256 11.869 1.00 0.00 H ATOM 1075 N ALA A 75 30.096 8.400 14.689 1.00 96.50 N ATOM 1076 CA ALA A 75 31.359 9.147 14.661 1.00 99.34 C ATOM 1077 C ALA A 75 32.159 8.808 13.376 1.00101.87 C ATOM 1078 O ALA A 75 31.945 7.738 12.785 1.00102.10 O ATOM 1079 CB ALA A 75 32.176 8.887 15.942 1.00 98.21 C ATOM 1080 HA ALA A 75 31.138 10.214 14.635 1.00 0.00 H ATOM 1081 HB1 ALA A 75 31.598 9.204 16.810 1.00 0.00 H ATOM 1082 HB2 ALA A 75 32.398 7.823 16.020 1.00 0.00 H ATOM 1083 HB3 ALA A 75 33.108 9.451 15.898 1.00 0.00 H ATOM 1084 H ALA A 75 29.883 7.793 15.506 1.00 0.00 H ATOM 1085 N GLY A 76 33.039 9.695 12.900 1.00103.64 N ATOM 1086 CA GLY A 76 33.352 10.996 13.487 1.00105.41 C ATOM 1087 C GLY A 76 32.194 11.954 13.735 1.00107.76 C ATOM 1088 O GLY A 76 31.926 12.283 14.899 1.00108.20 O ATOM 1089 HA3 GLY A 76 34.052 11.496 12.818 1.00 0.00 H ATOM 1090 HA2 GLY A 76 33.836 10.813 14.446 1.00 0.00 H ATOM 1091 H GLY A 76 33.548 9.435 12.031 1.00 0.00 H ATOM 1092 N GLY A 77 31.508 12.433 12.685 1.00107.84 N ATOM 1093 CA GLY A 77 31.779 12.133 11.268 1.00106.46 C ATOM 1094 C GLY A 77 30.757 12.781 10.329 1.00106.66 C ATOM 1095 O GLY A 77 30.932 13.938 9.900 1.00106.92 O ATOM 1096 HA3 GLY A 77 31.749 11.053 11.127 1.00 0.00 H ATOM 1097 HA2 GLY A 77 32.772 12.504 11.015 1.00 0.00 H ATOM 1098 H GLY A 77 30.714 13.073 12.890 1.00 0.00 H ATOM 1099 N ASP A 78 29.678 12.043 10.036 1.00103.00 N ATOM 1100 CA ASP A 78 28.656 12.451 9.045 1.00 97.84 C ATOM 1101 C ASP A 78 27.589 13.463 9.542 1.00 92.61 C ATOM 1102 O ASP A 78 26.934 14.116 8.717 1.00 90.87 O ATOM 1103 CB ASP A 78 27.930 11.227 8.422 1.00100.94 C ATOM 1104 CG ASP A 78 28.616 9.880 8.722 1.00102.43 C ATOM 1105 OD1 ASP A 78 29.782 9.681 8.313 1.00103.83 O ATOM 1106 OD2 ASP A 78 27.961 9.006 9.342 1.00101.04 O ATOM 1107 HA ASP A 78 29.248 12.975 8.295 1.00 0.00 H ATOM 1108 HB2 ASP A 78 26.915 11.192 8.817 1.00 0.00 H ATOM 1109 HB3 ASP A 78 27.894 11.362 7.341 1.00 0.00 H ATOM 1110 H ASP A 78 29.552 11.137 10.530 1.00 0.00 H ATOM 1111 N LEU A 79 27.417 13.575 10.867 1.00 84.22 N ATOM 1112 CA LEU A 79 26.351 14.391 11.494 1.00 78.22 C ATOM 1113 C LEU A 79 26.475 15.917 11.267 1.00 75.52 C ATOM 1114 O LEU A 79 25.517 16.550 10.772 1.00 72.78 O ATOM 1115 CB LEU A 79 26.195 14.053 13.001 1.00 78.61 C ATOM 1116 CG LEU A 79 25.276 14.873 13.939 1.00 76.13 C ATOM 1117 CD1 LEU A 79 23.812 14.768 13.545 1.00 71.24 C ATOM 1118 CD2 LEU A 79 25.457 14.492 15.416 1.00 74.45 C ATOM 1119 HA LEU A 79 25.438 14.107 10.970 1.00 0.00 H ATOM 1120 HB2 LEU A 79 25.837 13.024 13.047 1.00 0.00 H ATOM 1121 HB3 LEU A 79 27.195 14.108 13.431 1.00 0.00 H ATOM 1122 HG LEU A 79 25.585 15.912 13.821 1.00 0.00 H ATOM 1123 HD21 LEU A 79 25.219 13.437 15.549 1.00 0.00 H ATOM 1124 HD22 LEU A 79 26.490 14.674 15.713 1.00 0.00 H ATOM 1125 HD23 LEU A 79 24.790 15.096 16.030 1.00 0.00 H ATOM 1126 HD11 LEU A 79 23.682 15.144 12.530 1.00 0.00 H ATOM 1127 HD12 LEU A 79 23.499 13.725 13.590 1.00 0.00 H ATOM 1128 HD13 LEU A 79 23.209 15.360 14.233 1.00 0.00 H ATOM 1129 H LEU A 79 28.070 13.059 11.491 1.00 0.00 H ATOM 1130 N ASP A 80 27.636 16.488 11.625 1.00 69.16 N ATOM 1131 CA ASP A 80 27.939 17.931 11.377 1.00 65.07 C ATOM 1132 C ASP A 80 27.948 18.338 9.879 1.00 63.84 C ATOM 1133 O ASP A 80 27.688 19.513 9.542 1.00 59.89 O ATOM 1134 CB ASP A 80 29.252 18.371 12.067 1.00 58.28 C ATOM 1135 CG ASP A 80 29.098 18.587 13.598 1.00 57.90 C ATOM 1136 OD1 ASP A 80 27.967 18.898 14.057 1.00 49.02 O ATOM 1137 OD2 ASP A 80 30.120 18.463 14.342 1.00 56.19 O ATOM 1138 HA ASP A 80 27.104 18.467 11.829 1.00 0.00 H ATOM 1139 HB2 ASP A 80 30.006 17.602 11.900 1.00 0.00 H ATOM 1140 HB3 ASP A 80 29.583 19.307 11.617 1.00 0.00 H ATOM 1141 H ASP A 80 28.355 15.902 12.095 1.00 0.00 H ATOM 1142 N ALA A 81 28.223 17.354 9.006 1.00 63.06 N ATOM 1143 CA ALA A 81 28.323 17.528 7.539 1.00 61.43 C ATOM 1144 C ALA A 81 26.995 17.427 6.717 1.00 61.08 C ATOM 1145 O ALA A 81 26.977 17.815 5.529 1.00 60.44 O ATOM 1146 CB ALA A 81 29.410 16.579 6.962 1.00 61.76 C ATOM 1147 HA ALA A 81 28.608 18.573 7.415 1.00 0.00 H ATOM 1148 HB1 ALA A 81 30.373 16.812 7.417 1.00 0.00 H ATOM 1149 HB2 ALA A 81 29.143 15.546 7.183 1.00 0.00 H ATOM 1150 HB3 ALA A 81 29.474 16.716 5.883 1.00 0.00 H ATOM 1151 H ALA A 81 28.377 16.400 9.389 1.00 0.00 H ATOM 1152 N TYR A 82 25.908 16.924 7.334 1.00 56.93 N ATOM 1153 CA TYR A 82 24.594 16.811 6.658 1.00 53.44 C ATOM 1154 C TYR A 82 24.069 18.174 6.159 1.00 52.24 C ATOM 1155 O TYR A 82 24.078 19.129 6.944 1.00 56.22 O ATOM 1156 CB TYR A 82 23.524 16.089 7.522 1.00 49.73 C ATOM 1157 CG TYR A 82 22.495 15.480 6.593 1.00 48.04 C ATOM 1158 CD1 TYR A 82 22.738 14.241 5.977 1.00 48.82 C ATOM 1159 CD2 TYR A 82 21.343 16.185 6.238 1.00 44.20 C ATOM 1160 CE1 TYR A 82 21.840 13.707 5.072 1.00 48.83 C ATOM 1161 CE2 TYR A 82 20.441 15.671 5.325 1.00 44.73 C ATOM 1162 CZ TYR A 82 20.696 14.433 4.742 1.00 47.76 C ATOM 1163 OH TYR A 82 19.802 13.908 3.840 1.00 50.09 O ATOM 1164 HA TYR A 82 24.774 16.184 5.785 1.00 0.00 H ATOM 1165 HB3 TYR A 82 23.042 16.805 8.187 1.00 0.00 H ATOM 1166 HB2 TYR A 82 23.996 15.305 8.115 1.00 0.00 H ATOM 1167 HD2 TYR A 82 21.151 17.159 6.689 1.00 0.00 H ATOM 1168 HE2 TYR A 82 19.541 16.228 5.065 1.00 0.00 H ATOM 1169 HE1 TYR A 82 22.024 12.731 4.622 1.00 0.00 H ATOM 1170 HD1 TYR A 82 23.649 13.692 6.216 1.00 0.00 H ATOM 1171 HH TYR A 82 20.132 13.030 3.524 1.00 0.00 H ATOM 1172 H TYR A 82 25.994 16.604 8.320 1.00 0.00 H ATOM 1173 N PRO A 83 23.637 18.282 4.861 1.00 49.24 N ATOM 1174 CA PRO A 83 23.190 19.624 4.366 1.00 47.94 C ATOM 1175 C PRO A 83 21.933 20.129 5.090 1.00 50.10 C ATOM 1176 O PRO A 83 20.979 19.361 5.291 1.00 49.51 O ATOM 1177 CB PRO A 83 22.925 19.418 2.867 1.00 43.24 C ATOM 1178 CG PRO A 83 22.877 17.908 2.651 1.00 46.72 C ATOM 1179 CD PRO A 83 23.553 17.228 3.820 1.00 48.66 C ATOM 1180 HA PRO A 83 23.944 20.387 4.556 1.00 0.00 H ATOM 1181 HD3 PRO A 83 22.959 16.384 4.172 1.00 0.00 H ATOM 1182 HD2 PRO A 83 24.548 16.880 3.542 1.00 0.00 H ATOM 1183 HG3 PRO A 83 23.397 17.653 1.728 1.00 0.00 H ATOM 1184 HG2 PRO A 83 21.840 17.580 2.585 1.00 0.00 H ATOM 1185 HB2 PRO A 83 21.975 19.872 2.584 1.00 0.00 H ATOM 1186 HB3 PRO A 83 23.727 19.860 2.276 1.00 0.00 H ATOM 1187 N ARG A 84 21.921 21.380 5.489 1.00 53.58 N ATOM 1188 CA ARG A 84 20.756 21.922 6.171 1.00 56.87 C ATOM 1189 C ARG A 84 20.161 23.131 5.473 1.00 57.92 C ATOM 1190 O ARG A 84 20.807 24.113 5.347 1.00 62.48 O ATOM 1191 CB ARG A 84 21.097 22.254 7.613 1.00 53.64 C ATOM 1192 CG ARG A 84 20.972 21.082 8.540 1.00 54.66 C ATOM 1193 CD ARG A 84 22.118 21.019 9.490 1.00 54.70 C ATOM 1194 NE ARG A 84 22.008 20.026 10.552 1.00 49.46 N ATOM 1195 CZ ARG A 84 22.906 19.066 10.745 1.00 50.47 C ATOM 1196 NH1 ARG A 84 23.924 18.962 9.935 1.00 44.17 N ATOM 1197 NH2 ARG A 84 22.789 18.209 11.733 1.00 44.22 N ATOM 1198 HA ARG A 84 19.991 21.146 6.146 1.00 0.00 H ATOM 1199 HB2 ARG A 84 22.124 22.617 7.651 1.00 0.00 H ATOM 1200 HB3 ARG A 84 20.423 23.039 7.956 1.00 0.00 H ATOM 1201 HG2 ARG A 84 20.045 21.174 9.107 1.00 0.00 H ATOM 1202 HG3 ARG A 84 20.947 20.165 7.952 1.00 0.00 H ATOM 1203 HD2 ARG A 84 22.220 21.999 9.957 1.00 0.00 H ATOM 1204 HD3 ARG A 84 23.017 20.796 8.915 1.00 0.00 H ATOM 1205 HE ARG A 84 21.187 20.071 11.189 1.00 0.00 H ATOM 1206 HH12 ARG A 84 24.630 18.213 10.081 1.00 0.00 H ATOM 1207 HH11 ARG A 84 24.029 19.629 9.144 1.00 0.00 H ATOM 1208 HH22 ARG A 84 23.505 17.466 11.864 1.00 0.00 H ATOM 1209 HH21 ARG A 84 21.981 18.273 12.384 1.00 0.00 H ATOM 1210 H ARG A 84 22.748 21.986 5.317 1.00 0.00 H ATOM 1211 N THR A 85 18.910 23.065 5.042 1.00 59.43 N ATOM 1212 CA THR A 85 18.318 24.200 4.331 1.00 60.38 C ATOM 1213 C THR A 85 16.824 24.495 4.582 1.00 60.48 C ATOM 1214 O THR A 85 16.039 24.561 3.670 1.00 58.63 O ATOM 1215 CB THR A 85 18.603 24.095 2.835 1.00 61.32 C ATOM 1216 OG1 THR A 85 17.473 23.569 2.174 1.00 61.84 O ATOM 1217 CG2 THR A 85 19.720 23.161 2.592 1.00 62.56 C ATOM 1218 HA THR A 85 18.817 25.064 4.770 1.00 0.00 H ATOM 1219 HB THR A 85 18.849 25.091 2.466 1.00 0.00 H ATOM 1220 HG1 THR A 85 16.698 24.167 2.321 1.00 0.00 H ATOM 1221 HG23 THR A 85 20.617 23.532 3.088 1.00 0.00 H ATOM 1222 HG21 THR A 85 19.464 22.179 2.989 1.00 0.00 H ATOM 1223 HG22 THR A 85 19.901 23.085 1.520 1.00 0.00 H ATOM 1224 H THR A 85 18.348 22.206 5.209 1.00 0.00 H ATOM 1225 N PRO A 86 16.460 24.697 5.836 1.00 58.35 N ATOM 1226 CA PRO A 86 15.068 24.850 6.252 1.00 59.53 C ATOM 1227 C PRO A 86 14.270 25.960 5.578 1.00 59.99 C ATOM 1228 O PRO A 86 13.122 25.784 5.297 1.00 56.29 O ATOM 1229 CB PRO A 86 15.195 25.139 7.736 1.00 57.59 C ATOM 1230 CG PRO A 86 16.562 25.459 7.936 1.00 59.54 C ATOM 1231 CD PRO A 86 17.366 24.784 6.975 1.00 55.36 C ATOM 1232 HA PRO A 86 14.506 23.958 5.977 1.00 0.00 H ATOM 1233 HD3 PRO A 86 18.259 25.359 6.729 1.00 0.00 H ATOM 1234 HD2 PRO A 86 17.658 23.794 7.326 1.00 0.00 H ATOM 1235 HG3 PRO A 86 16.862 25.152 8.938 1.00 0.00 H ATOM 1236 HG2 PRO A 86 16.700 26.535 7.831 1.00 0.00 H ATOM 1237 HB2 PRO A 86 14.560 25.979 8.018 1.00 0.00 H ATOM 1238 HB3 PRO A 86 14.917 24.263 8.322 1.00 0.00 H ATOM 1239 N ASP A 87 14.883 27.102 5.369 1.00 61.68 N ATOM 1240 CA ASP A 87 14.316 28.191 4.560 1.00 61.89 C ATOM 1241 C ASP A 87 13.728 27.644 3.275 1.00 55.62 C ATOM 1242 O ASP A 87 12.521 27.615 3.100 1.00 55.60 O ATOM 1243 CB ASP A 87 15.413 29.214 4.175 1.00 68.02 C ATOM 1244 CG ASP A 87 15.908 30.039 5.359 1.00 71.44 C ATOM 1245 OD1 ASP A 87 15.086 30.814 5.914 1.00 67.54 O ATOM 1246 OD2 ASP A 87 17.122 29.918 5.711 1.00 72.51 O ATOM 1247 HA ASP A 87 13.543 28.674 5.158 1.00 0.00 H ATOM 1248 HB2 ASP A 87 16.259 28.672 3.752 1.00 0.00 H ATOM 1249 HB3 ASP A 87 15.006 29.893 3.425 1.00 0.00 H ATOM 1250 H ASP A 87 15.819 27.244 5.799 1.00 0.00 H ATOM 1251 N ASP A 88 14.616 27.231 2.380 1.00 50.10 N ATOM 1252 CA ASP A 88 14.258 26.534 1.162 1.00 52.14 C ATOM 1253 C ASP A 88 13.212 25.437 1.425 1.00 49.59 C ATOM 1254 O ASP A 88 12.132 25.445 0.809 1.00 45.68 O ATOM 1255 CB ASP A 88 15.510 25.907 0.531 1.00 58.49 C ATOM 1256 CG ASP A 88 16.377 26.922 -0.235 1.00 67.01 C ATOM 1257 OD1 ASP A 88 16.757 28.000 0.311 1.00 65.99 O ATOM 1258 OD2 ASP A 88 16.712 26.603 -1.400 1.00 71.94 O ATOM 1259 HA ASP A 88 13.823 27.262 0.478 1.00 0.00 H ATOM 1260 HB2 ASP A 88 16.113 25.465 1.324 1.00 0.00 H ATOM 1261 HB3 ASP A 88 15.195 25.127 -0.162 1.00 0.00 H ATOM 1262 H ASP A 88 15.623 27.418 2.563 1.00 0.00 H ATOM 1263 N ASP A 89 13.521 24.520 2.350 1.00 38.94 N ATOM 1264 CA ASP A 89 12.650 23.370 2.550 1.00 39.73 C ATOM 1265 C ASP A 89 11.191 23.836 2.714 1.00 36.71 C ATOM 1266 O ASP A 89 10.297 23.392 1.968 1.00 30.37 O ATOM 1267 CB ASP A 89 13.102 22.477 3.741 1.00 33.46 C ATOM 1268 CG ASP A 89 14.501 21.881 3.558 1.00 34.96 C ATOM 1269 OD1 ASP A 89 15.005 21.742 2.403 1.00 32.94 O ATOM 1270 OD2 ASP A 89 15.106 21.549 4.597 1.00 28.18 O ATOM 1271 HA ASP A 89 12.721 22.743 1.661 1.00 0.00 H ATOM 1272 HB2 ASP A 89 13.100 23.082 4.647 1.00 0.00 H ATOM 1273 HB3 ASP A 89 12.389 21.659 3.850 1.00 0.00 H ATOM 1274 H ASP A 89 14.381 24.629 2.925 1.00 0.00 H ATOM 1275 N LEU A 90 10.978 24.740 3.676 1.00 31.70 N ATOM 1276 CA LEU A 90 9.649 25.259 3.987 1.00 38.96 C ATOM 1277 C LEU A 90 8.957 25.924 2.795 1.00 37.82 C ATOM 1278 O LEU A 90 7.774 25.645 2.552 1.00 38.70 O ATOM 1279 CB LEU A 90 9.672 26.177 5.220 1.00 42.52 C ATOM 1280 CG LEU A 90 9.998 25.571 6.609 1.00 43.70 C ATOM 1281 CD1 LEU A 90 9.995 26.629 7.765 1.00 36.44 C ATOM 1282 CD2 LEU A 90 9.103 24.366 6.962 1.00 40.80 C ATOM 1283 HA LEU A 90 9.040 24.388 4.231 1.00 0.00 H ATOM 1284 HB2 LEU A 90 10.415 26.951 5.027 1.00 0.00 H ATOM 1285 HB3 LEU A 90 8.685 26.634 5.295 1.00 0.00 H ATOM 1286 HG LEU A 90 11.020 25.204 6.518 1.00 0.00 H ATOM 1287 HD21 LEU A 90 8.060 24.681 6.973 1.00 0.00 H ATOM 1288 HD22 LEU A 90 9.240 23.583 6.217 1.00 0.00 H ATOM 1289 HD23 LEU A 90 9.379 23.986 7.945 1.00 0.00 H ATOM 1290 HD11 LEU A 90 10.743 27.394 7.557 1.00 0.00 H ATOM 1291 HD12 LEU A 90 9.010 27.090 7.831 1.00 0.00 H ATOM 1292 HD13 LEU A 90 10.231 26.136 8.708 1.00 0.00 H ATOM 1293 H LEU A 90 11.791 25.087 4.224 1.00 0.00 H ATOM 1294 N ALA A 91 9.704 26.743 2.042 1.00 37.43 N ATOM 1295 CA ALA A 91 9.231 27.349 0.772 1.00 37.25 C ATOM 1296 C ALA A 91 8.756 26.318 -0.235 1.00 39.78 C ATOM 1297 O ALA A 91 7.646 26.459 -0.770 1.00 39.01 O ATOM 1298 CB ALA A 91 10.307 28.223 0.126 1.00 42.03 C ATOM 1299 HA ALA A 91 8.379 27.969 1.049 1.00 0.00 H ATOM 1300 HB1 ALA A 91 10.579 29.027 0.810 1.00 0.00 H ATOM 1301 HB2 ALA A 91 11.186 27.615 -0.090 1.00 0.00 H ATOM 1302 HB3 ALA A 91 9.921 28.647 -0.801 1.00 0.00 H ATOM 1303 H ALA A 91 10.667 26.966 2.365 1.00 0.00 H ATOM 1304 N GLN A 92 9.583 25.298 -0.499 1.00 36.39 N ATOM 1305 CA GLN A 92 9.172 24.187 -1.366 1.00 37.07 C ATOM 1306 C GLN A 92 7.879 23.555 -0.910 1.00 37.09 C ATOM 1307 O GLN A 92 7.046 23.183 -1.733 1.00 39.48 O ATOM 1308 CB GLN A 92 10.207 23.092 -1.416 1.00 37.88 C ATOM 1309 CG GLN A 92 11.565 23.578 -1.760 1.00 46.02 C ATOM 1310 CD GLN A 92 12.315 22.550 -2.528 1.00 45.77 C ATOM 1311 OE1 GLN A 92 11.888 22.151 -3.618 1.00 45.86 O ATOM 1312 NE2 GLN A 92 13.455 22.111 -1.980 1.00 46.66 N ATOM 1313 HA GLN A 92 9.046 24.633 -2.353 1.00 0.00 H ATOM 1314 HB2 GLN A 92 10.249 22.612 -0.438 1.00 0.00 H ATOM 1315 HB3 GLN A 92 9.901 22.362 -2.165 1.00 0.00 H ATOM 1316 HG2 GLN A 92 11.479 24.482 -2.362 1.00 0.00 H ATOM 1317 HG3 GLN A 92 12.107 23.805 -0.842 1.00 0.00 H ATOM 1318 HE22 GLN A 92 13.766 22.482 -1.060 1.00 0.00 H ATOM 1319 HE21 GLN A 92 14.029 21.399 -2.475 1.00 0.00 H ATOM 1320 H GLN A 92 10.535 25.293 -0.081 1.00 0.00 H ATOM 1321 N LEU A 93 7.711 23.447 0.402 1.00 35.33 N ATOM 1322 CA LEU A 93 6.509 22.853 0.957 1.00 32.68 C ATOM 1323 C LEU A 93 5.274 23.744 0.785 1.00 37.16 C ATOM 1324 O LEU A 93 4.195 23.223 0.474 1.00 32.71 O ATOM 1325 CB LEU A 93 6.727 22.463 2.435 1.00 32.17 C ATOM 1326 CG LEU A 93 7.816 21.418 2.785 1.00 28.39 C ATOM 1327 CD1 LEU A 93 7.671 20.931 4.233 1.00 21.27 C ATOM 1328 CD2 LEU A 93 7.787 20.234 1.831 1.00 23.34 C ATOM 1329 HA LEU A 93 6.308 21.945 0.388 1.00 0.00 H ATOM 1330 HB2 LEU A 93 6.977 23.377 2.973 1.00 0.00 H ATOM 1331 HB3 LEU A 93 5.779 22.073 2.805 1.00 0.00 H ATOM 1332 HG LEU A 93 8.780 21.916 2.678 1.00 0.00 H ATOM 1333 HD21 LEU A 93 6.813 19.747 1.887 1.00 0.00 H ATOM 1334 HD22 LEU A 93 7.961 20.584 0.814 1.00 0.00 H ATOM 1335 HD23 LEU A 93 8.566 19.524 2.111 1.00 0.00 H ATOM 1336 HD11 LEU A 93 7.770 21.778 4.912 1.00 0.00 H ATOM 1337 HD12 LEU A 93 6.691 20.471 4.364 1.00 0.00 H ATOM 1338 HD13 LEU A 93 8.449 20.199 4.448 1.00 0.00 H ATOM 1339 H LEU A 93 8.453 23.794 1.043 1.00 0.00 H ATOM 1340 N ARG A 94 5.420 25.066 1.007 1.00 38.75 N ATOM 1341 CA ARG A 94 4.350 26.045 0.695 1.00 40.36 C ATOM 1342 C ARG A 94 3.934 25.952 -0.761 1.00 40.64 C ATOM 1343 O ARG A 94 2.743 25.945 -1.070 1.00 44.07 O ATOM 1344 CB ARG A 94 4.806 27.475 0.955 1.00 45.29 C ATOM 1345 CG ARG A 94 4.253 28.058 2.226 1.00 50.08 C ATOM 1346 CD ARG A 94 4.993 29.320 2.618 1.00 51.67 C ATOM 1347 NE ARG A 94 5.196 29.351 4.069 1.00 51.81 N ATOM 1348 CZ ARG A 94 6.382 29.337 4.677 1.00 52.82 C ATOM 1349 NH1 ARG A 94 7.523 29.316 3.966 1.00 49.63 N ATOM 1350 NH2 ARG A 94 6.423 29.363 6.011 1.00 50.85 N ATOM 1351 HA ARG A 94 3.511 25.800 1.346 1.00 0.00 H ATOM 1352 HB2 ARG A 94 5.894 27.485 1.015 1.00 0.00 H ATOM 1353 HB3 ARG A 94 4.484 28.098 0.120 1.00 0.00 H ATOM 1354 HG2 ARG A 94 3.199 28.295 2.080 1.00 0.00 H ATOM 1355 HG3 ARG A 94 4.352 27.325 3.026 1.00 0.00 H ATOM 1356 HD2 ARG A 94 4.409 30.190 2.316 1.00 0.00 H ATOM 1357 HD3 ARG A 94 5.961 29.342 2.117 1.00 0.00 H ATOM 1358 HE ARG A 94 4.349 29.387 4.671 1.00 0.00 H ATOM 1359 HH12 ARG A 94 8.441 29.305 4.455 1.00 0.00 H ATOM 1360 HH11 ARG A 94 7.488 29.310 2.927 1.00 0.00 H ATOM 1361 HH22 ARG A 94 7.339 29.353 6.503 1.00 0.00 H ATOM 1362 HH21 ARG A 94 5.539 29.394 6.558 1.00 0.00 H ATOM 1363 H ARG A 94 6.314 25.411 1.411 1.00 0.00 H ATOM 1364 N ALA A 95 4.938 25.871 -1.635 1.00 37.55 N ATOM 1365 CA ALA A 95 4.779 25.773 -3.076 1.00 36.60 C ATOM 1366 C ALA A 95 4.124 24.449 -3.502 1.00 41.12 C ATOM 1367 O ALA A 95 3.590 24.327 -4.611 1.00 42.58 O ATOM 1368 CB ALA A 95 6.150 25.923 -3.743 1.00 38.60 C ATOM 1369 HA ALA A 95 4.113 26.574 -3.397 1.00 0.00 H ATOM 1370 HB1 ALA A 95 6.574 26.894 -3.485 1.00 0.00 H ATOM 1371 HB2 ALA A 95 6.812 25.131 -3.392 1.00 0.00 H ATOM 1372 HB3 ALA A 95 6.036 25.850 -4.825 1.00 0.00 H ATOM 1373 H ALA A 95 5.907 25.879 -1.257 1.00 0.00 H ATOM 1374 N GLU A 96 4.184 23.447 -2.632 1.00 39.04 N ATOM 1375 CA GLU A 96 3.552 22.171 -2.934 1.00 36.01 C ATOM 1376 C GLU A 96 2.158 22.061 -2.358 1.00 37.91 C ATOM 1377 O GLU A 96 1.413 21.125 -2.728 1.00 37.29 O ATOM 1378 CB GLU A 96 4.398 21.008 -2.459 1.00 32.21 C ATOM 1379 CG GLU A 96 5.664 20.900 -3.195 1.00 33.58 C ATOM 1380 CD GLU A 96 5.463 20.661 -4.658 1.00 38.17 C ATOM 1381 OE1 GLU A 96 4.520 19.895 -5.044 1.00 31.15 O ATOM 1382 OE2 GLU A 96 6.291 21.232 -5.416 1.00 42.51 O ATOM 1383 HA GLU A 96 3.467 22.128 -4.020 1.00 0.00 H ATOM 1384 HB2 GLU A 96 4.619 21.145 -1.400 1.00 0.00 H ATOM 1385 HB3 GLU A 96 3.834 20.085 -2.595 1.00 0.00 H ATOM 1386 HG2 GLU A 96 6.223 21.827 -3.066 1.00 0.00 H ATOM 1387 HG3 GLU A 96 6.238 20.071 -2.782 1.00 0.00 H ATOM 1388 H GLU A 96 4.685 23.575 -1.730 1.00 0.00 H ATOM 1389 N GLY A 97 1.819 23.000 -1.461 1.00 34.15 N ATOM 1390 CA GLY A 97 0.488 23.054 -0.836 1.00 37.80 C ATOM 1391 C GLY A 97 0.371 22.035 0.292 1.00 38.42 C ATOM 1392 O GLY A 97 -0.686 21.438 0.514 1.00 40.95 O ATOM 1393 HA3 GLY A 97 -0.269 22.839 -1.590 1.00 0.00 H ATOM 1394 HA2 GLY A 97 0.324 24.053 -0.432 1.00 0.00 H ATOM 1395 H GLY A 97 2.524 23.717 -1.197 1.00 0.00 H ATOM 1396 N VAL A 98 1.486 21.818 0.978 1.00 38.16 N ATOM 1397 CA VAL A 98 1.555 20.957 2.153 1.00 33.62 C ATOM 1398 C VAL A 98 1.081 21.795 3.325 1.00 33.61 C ATOM 1399 O VAL A 98 1.425 22.973 3.456 1.00 33.49 O ATOM 1400 CB VAL A 98 3.008 20.440 2.372 1.00 33.25 C ATOM 1401 CG1 VAL A 98 3.231 19.859 3.796 1.00 35.43 C ATOM 1402 CG2 VAL A 98 3.367 19.406 1.311 1.00 33.21 C ATOM 1403 HA VAL A 98 0.930 20.072 2.036 1.00 0.00 H ATOM 1404 HB VAL A 98 3.670 21.301 2.277 1.00 0.00 H ATOM 1405 HG11 VAL A 98 3.037 20.634 4.538 1.00 0.00 H ATOM 1406 HG12 VAL A 98 2.551 19.022 3.956 1.00 0.00 H ATOM 1407 HG13 VAL A 98 4.261 19.515 3.889 1.00 0.00 H ATOM 1408 HG21 VAL A 98 2.676 18.566 1.376 1.00 0.00 H ATOM 1409 HG22 VAL A 98 3.296 19.861 0.323 1.00 0.00 H ATOM 1410 HG23 VAL A 98 4.385 19.055 1.478 1.00 0.00 H ATOM 1411 H VAL A 98 2.358 22.287 0.660 1.00 0.00 H ATOM 1412 N GLU A 99 0.291 21.188 4.187 1.00 35.80 N ATOM 1413 CA GLU A 99 -0.290 21.950 5.268 1.00 38.66 C ATOM 1414 C GLU A 99 0.414 21.850 6.612 1.00 35.47 C ATOM 1415 O GLU A 99 0.261 22.722 7.453 1.00 34.36 O ATOM 1416 CB GLU A 99 -1.762 21.602 5.400 1.00 39.04 C ATOM 1417 CG GLU A 99 -2.579 22.253 4.318 1.00 44.36 C ATOM 1418 CD GLU A 99 -3.857 21.525 4.133 1.00 46.30 C ATOM 1419 OE1 GLU A 99 -3.794 20.336 3.716 1.00 39.76 O ATOM 1420 OE2 GLU A 99 -4.907 22.136 4.453 1.00 47.07 O ATOM 1421 HA GLU A 99 -0.158 22.994 4.985 1.00 0.00 H ATOM 1422 HB2 GLU A 99 -1.879 20.520 5.331 1.00 0.00 H ATOM 1423 HB3 GLU A 99 -2.122 21.944 6.371 1.00 0.00 H ATOM 1424 HG2 GLU A 99 -2.790 23.285 4.597 1.00 0.00 H ATOM 1425 HG3 GLU A 99 -2.017 22.238 3.384 1.00 0.00 H ATOM 1426 H GLU A 99 0.088 20.173 4.090 1.00 0.00 H ATOM 1427 N ILE A 100 1.139 20.763 6.822 1.00 34.54 N ATOM 1428 CA ILE A 100 1.830 20.544 8.080 1.00 31.59 C ATOM 1429 C ILE A 100 3.315 20.237 7.858 1.00 28.50 C ATOM 1430 O ILE A 100 3.663 19.371 7.070 1.00 21.23 O ATOM 1431 CB ILE A 100 1.141 19.452 8.904 1.00 33.97 C ATOM 1432 CG1 ILE A 100 -0.294 19.902 9.275 1.00 33.38 C ATOM 1433 CG2 ILE A 100 1.980 19.116 10.154 1.00 36.09 C ATOM 1434 CD1 ILE A 100 -1.169 18.798 9.919 1.00 36.05 C ATOM 1435 HA ILE A 100 1.778 21.469 8.654 1.00 0.00 H ATOM 1436 HB ILE A 100 1.063 18.541 8.310 1.00 0.00 H ATOM 1437 HG12 ILE A 100 -0.220 20.731 9.979 1.00 0.00 H ATOM 1438 HG13 ILE A 100 -0.790 20.242 8.366 1.00 0.00 H ATOM 1439 HD11 ILE A 100 -1.268 17.964 9.225 1.00 0.00 H ATOM 1440 HD12 ILE A 100 -0.697 18.453 10.839 1.00 0.00 H ATOM 1441 HD13 ILE A 100 -2.155 19.203 10.145 1.00 0.00 H ATOM 1442 HG21 ILE A 100 2.964 18.763 9.845 1.00 0.00 H ATOM 1443 HG22 ILE A 100 2.090 20.010 10.768 1.00 0.00 H ATOM 1444 HG23 ILE A 100 1.477 18.338 10.729 1.00 0.00 H ATOM 1445 H ILE A 100 1.216 20.050 6.069 1.00 0.00 H ATOM 1446 N ALA A 101 4.173 21.010 8.520 1.00 26.25 N ATOM 1447 CA ALA A 101 5.608 20.693 8.643 1.00 27.08 C ATOM 1448 C ALA A 101 5.907 20.430 10.130 1.00 26.04 C ATOM 1449 O ALA A 101 5.540 21.224 11.005 1.00 23.85 O ATOM 1450 CB ALA A 101 6.506 21.826 8.078 1.00 19.29 C ATOM 1451 HA ALA A 101 5.837 19.808 8.050 1.00 0.00 H ATOM 1452 HB1 ALA A 101 6.280 21.975 7.022 1.00 0.00 H ATOM 1453 HB2 ALA A 101 6.313 22.748 8.626 1.00 0.00 H ATOM 1454 HB3 ALA A 101 7.554 21.548 8.190 1.00 0.00 H ATOM 1455 H ALA A 101 3.815 21.876 8.971 1.00 0.00 H ATOM 1456 N PHE A 102 6.533 19.290 10.411 1.00 18.41 N ATOM 1457 CA PHE A 102 6.860 18.925 11.786 1.00 19.78 C ATOM 1458 C PHE A 102 8.364 19.015 11.914 1.00 19.56 C ATOM 1459 O PHE A 102 9.098 18.203 11.347 1.00 22.38 O ATOM 1460 CB PHE A 102 6.381 17.497 12.078 1.00 23.08 C ATOM 1461 CG PHE A 102 6.786 16.976 13.439 1.00 25.23 C ATOM 1462 CD1 PHE A 102 6.622 17.775 14.598 1.00 17.27 C ATOM 1463 CD2 PHE A 102 7.311 15.666 13.561 1.00 22.19 C ATOM 1464 CE1 PHE A 102 7.021 17.281 15.858 1.00 24.38 C ATOM 1465 CE2 PHE A 102 7.684 15.147 14.781 1.00 12.76 C ATOM 1466 CZ PHE A 102 7.531 15.950 15.959 1.00 20.30 C ATOM 1467 HA PHE A 102 6.370 19.589 12.499 1.00 0.00 H ATOM 1468 HB2 PHE A 102 5.293 17.481 12.015 1.00 0.00 H ATOM 1469 HB3 PHE A 102 6.797 16.834 11.320 1.00 0.00 H ATOM 1470 HD2 PHE A 102 7.423 15.053 12.667 1.00 0.00 H ATOM 1471 HE2 PHE A 102 8.091 14.138 14.850 1.00 0.00 H ATOM 1472 HZ PHE A 102 7.804 15.544 16.933 1.00 0.00 H ATOM 1473 HE1 PHE A 102 6.941 17.909 16.746 1.00 0.00 H ATOM 1474 HD1 PHE A 102 6.188 18.771 14.516 1.00 0.00 H ATOM 1475 H PHE A 102 6.794 18.647 9.636 1.00 0.00 H ATOM 1476 N THR A 103 8.846 20.025 12.619 1.00 19.08 N ATOM 1477 CA THR A 103 10.310 20.188 12.776 1.00 22.38 C ATOM 1478 C THR A 103 10.670 20.133 14.284 1.00 20.84 C ATOM 1479 O THR A 103 10.728 21.180 14.905 1.00 23.38 O ATOM 1480 CB THR A 103 10.731 21.574 12.204 1.00 15.38 C ATOM 1481 OG1 THR A 103 10.045 22.572 12.943 1.00 14.53 O ATOM 1482 CG2 THR A 103 10.307 21.733 10.796 1.00 10.28 C ATOM 1483 HA THR A 103 10.830 19.392 12.243 1.00 0.00 H ATOM 1484 HB THR A 103 11.816 21.656 12.271 1.00 0.00 H ATOM 1485 HG1 THR A 103 10.294 22.503 13.899 1.00 0.00 H ATOM 1486 HG23 THR A 103 10.808 20.986 10.180 1.00 0.00 H ATOM 1487 HG21 THR A 103 9.228 21.599 10.726 1.00 0.00 H ATOM 1488 HG22 THR A 103 10.574 22.731 10.448 1.00 0.00 H ATOM 1489 H THR A 103 8.197 20.705 13.063 1.00 0.00 H ATOM 1490 N PRO A 104 10.788 18.917 14.894 1.00 24.05 N ATOM 1491 CA PRO A 104 11.203 18.803 16.304 1.00 21.40 C ATOM 1492 C PRO A 104 12.676 19.111 16.601 1.00 24.54 C ATOM 1493 O PRO A 104 13.537 18.979 15.736 1.00 24.69 O ATOM 1494 CB PRO A 104 10.966 17.321 16.611 1.00 29.07 C ATOM 1495 CG PRO A 104 11.170 16.640 15.291 1.00 25.37 C ATOM 1496 CD PRO A 104 10.450 17.591 14.344 1.00 18.08 C ATOM 1497 HA PRO A 104 10.650 19.531 16.898 1.00 0.00 H ATOM 1498 HD3 PRO A 104 10.818 17.483 13.324 1.00 0.00 H ATOM 1499 HD2 PRO A 104 9.373 17.422 14.360 1.00 0.00 H ATOM 1500 HG3 PRO A 104 10.718 15.648 15.280 1.00 0.00 H ATOM 1501 HG2 PRO A 104 12.229 16.558 15.044 1.00 0.00 H ATOM 1502 HB2 PRO A 104 11.682 16.959 17.349 1.00 0.00 H ATOM 1503 HB3 PRO A 104 9.953 17.158 16.979 1.00 0.00 H ATOM 1504 N THR A 105 12.943 19.463 17.853 1.00 17.80 N ATOM 1505 CA THR A 105 14.274 19.607 18.379 1.00 19.47 C ATOM 1506 C THR A 105 14.803 18.226 18.802 1.00 20.02 C ATOM 1507 O THR A 105 14.008 17.321 19.080 1.00 16.97 O ATOM 1508 CB THR A 105 14.246 20.576 19.596 1.00 25.10 C ATOM 1509 OG1 THR A 105 13.450 19.999 20.655 1.00 25.79 O ATOM 1510 CG2 THR A 105 13.601 21.917 19.207 1.00 23.26 C ATOM 1511 HA THR A 105 14.935 20.020 17.617 1.00 0.00 H ATOM 1512 HB THR A 105 15.273 20.738 19.922 1.00 0.00 H ATOM 1513 HG1 THR A 105 13.434 20.617 21.428 1.00 0.00 H ATOM 1514 HG23 THR A 105 14.180 22.379 18.407 1.00 0.00 H ATOM 1515 HG21 THR A 105 12.581 21.742 18.864 1.00 0.00 H ATOM 1516 HG22 THR A 105 13.586 22.577 20.074 1.00 0.00 H ATOM 1517 H THR A 105 12.142 19.645 18.491 1.00 0.00 H ATOM 1518 N THR A 106 16.144 18.072 18.839 1.00 18.72 N ATOM 1519 CA THR A 106 16.813 16.888 19.369 1.00 21.48 C ATOM 1520 C THR A 106 16.372 16.596 20.802 1.00 24.30 C ATOM 1521 O THR A 106 16.017 15.452 21.122 1.00 23.25 O ATOM 1522 CB THR A 106 18.306 17.071 19.334 1.00 28.94 C ATOM 1523 OG1 THR A 106 18.700 17.327 17.973 1.00 34.17 O ATOM 1524 CG2 THR A 106 19.017 15.807 19.883 1.00 25.97 C ATOM 1525 HA THR A 106 16.533 16.043 18.740 1.00 0.00 H ATOM 1526 HB THR A 106 18.594 17.913 19.964 1.00 0.00 H ATOM 1527 HG1 THR A 106 19.681 17.450 17.932 1.00 0.00 H ATOM 1528 HG23 THR A 106 18.704 15.634 20.913 1.00 0.00 H ATOM 1529 HG21 THR A 106 18.749 14.946 19.271 1.00 0.00 H ATOM 1530 HG22 THR A 106 20.096 15.956 19.850 1.00 0.00 H ATOM 1531 H THR A 106 16.735 18.843 18.468 1.00 0.00 H ATOM 1532 N ALA A 107 16.309 17.649 21.622 1.00 18.72 N ATOM 1533 CA ALA A 107 15.838 17.562 22.995 1.00 22.90 C ATOM 1534 C ALA A 107 14.437 17.022 23.103 1.00 28.11 C ATOM 1535 O ALA A 107 14.157 16.236 24.010 1.00 34.88 O ATOM 1536 CB ALA A 107 15.922 18.946 23.703 1.00 23.85 C ATOM 1537 HA ALA A 107 16.500 16.855 23.495 1.00 0.00 H ATOM 1538 HB1 ALA A 107 16.957 19.287 23.709 1.00 0.00 H ATOM 1539 HB2 ALA A 107 15.304 19.666 23.166 1.00 0.00 H ATOM 1540 HB3 ALA A 107 15.563 18.851 24.728 1.00 0.00 H ATOM 1541 H ALA A 107 16.612 18.576 21.261 1.00 0.00 H ATOM 1542 N ALA A 108 13.541 17.442 22.210 1.00 24.46 N ATOM 1543 CA ALA A 108 12.155 16.988 22.323 1.00 24.59 C ATOM 1544 C ALA A 108 12.035 15.531 21.901 1.00 25.26 C ATOM 1545 O ALA A 108 11.165 14.810 22.400 1.00 23.63 O ATOM 1546 CB ALA A 108 11.227 17.854 21.507 1.00 19.79 C ATOM 1547 HA ALA A 108 11.859 17.074 23.368 1.00 0.00 H ATOM 1548 HB1 ALA A 108 11.286 18.883 21.862 1.00 0.00 H ATOM 1549 HB2 ALA A 108 11.522 17.813 20.458 1.00 0.00 H ATOM 1550 HB3 ALA A 108 10.205 17.490 21.613 1.00 0.00 H ATOM 1551 H ALA A 108 13.824 18.084 21.443 1.00 0.00 H ATOM 1552 N MET A 109 12.904 15.106 20.979 1.00 18.97 N ATOM 1553 CA MET A 109 12.864 13.707 20.473 1.00 18.89 C ATOM 1554 C MET A 109 13.610 12.733 21.366 1.00 24.33 C ATOM 1555 O MET A 109 13.228 11.549 21.468 1.00 25.99 O ATOM 1556 CB MET A 109 13.463 13.621 19.066 1.00 9.54 C ATOM 1557 CG MET A 109 12.616 14.355 18.036 1.00 11.70 C ATOM 1558 SD MET A 109 10.968 13.637 17.968 1.00 21.03 S ATOM 1559 CE MET A 109 11.289 12.356 16.760 1.00 6.37 C ATOM 1560 HA MET A 109 11.811 13.427 20.462 1.00 0.00 H ATOM 1561 HB2 MET A 109 14.460 14.062 19.081 1.00 0.00 H ATOM 1562 HB3 MET A 109 13.536 12.572 18.778 1.00 0.00 H ATOM 1563 HG2 MET A 109 13.087 14.272 17.056 1.00 0.00 H ATOM 1564 HG3 MET A 109 12.541 15.406 18.314 1.00 0.00 H ATOM 1565 HE1 MET A 109 11.626 12.812 15.829 1.00 0.00 H ATOM 1566 HE2 MET A 109 12.062 11.687 17.138 1.00 0.00 H ATOM 1567 HE3 MET A 109 10.374 11.791 16.579 1.00 0.00 H ATOM 1568 H MET A 109 13.620 15.764 20.609 1.00 0.00 H ATOM 1569 N TYR A 110 14.682 13.250 21.996 1.00 24.64 N ATOM 1570 CA TYR A 110 15.600 12.467 22.821 1.00 21.72 C ATOM 1571 C TYR A 110 15.823 13.095 24.176 1.00 23.52 C ATOM 1572 O TYR A 110 16.999 13.329 24.528 1.00 16.85 O ATOM 1573 CB TYR A 110 16.972 12.307 22.122 1.00 18.36 C ATOM 1574 CG TYR A 110 16.853 11.524 20.855 1.00 22.52 C ATOM 1575 CD1 TYR A 110 16.616 10.145 20.897 1.00 22.86 C ATOM 1576 CD2 TYR A 110 16.894 12.146 19.603 1.00 18.49 C ATOM 1577 CE1 TYR A 110 16.444 9.410 19.741 1.00 18.41 C ATOM 1578 CE2 TYR A 110 16.725 11.392 18.421 1.00 21.33 C ATOM 1579 CZ TYR A 110 16.520 10.023 18.511 1.00 20.29 C ATOM 1580 OH TYR A 110 16.357 9.239 17.382 1.00 24.81 O ATOM 1581 HA TYR A 110 15.133 11.491 22.957 1.00 0.00 H ATOM 1582 HB3 TYR A 110 17.655 11.789 22.796 1.00 0.00 H ATOM 1583 HB2 TYR A 110 17.370 13.295 21.892 1.00 0.00 H ATOM 1584 HD2 TYR A 110 17.058 13.222 19.539 1.00 0.00 H ATOM 1585 HE2 TYR A 110 16.755 11.881 17.447 1.00 0.00 H ATOM 1586 HE1 TYR A 110 16.247 8.340 19.803 1.00 0.00 H ATOM 1587 HD1 TYR A 110 16.566 9.641 21.862 1.00 0.00 H ATOM 1588 HH TYR A 110 16.224 8.296 17.653 1.00 0.00 H ATOM 1589 H TYR A 110 14.868 14.268 21.889 1.00 0.00 H ATOM 1590 N PRO A 111 14.725 13.354 24.943 1.00 19.46 N ATOM 1591 CA PRO A 111 14.862 13.861 26.317 1.00 21.90 C ATOM 1592 C PRO A 111 15.591 12.905 27.269 1.00 25.47 C ATOM 1593 O PRO A 111 16.138 13.357 28.263 1.00 24.19 O ATOM 1594 CB PRO A 111 13.413 14.060 26.778 1.00 15.09 C ATOM 1595 CG PRO A 111 12.622 13.059 25.931 1.00 16.27 C ATOM 1596 CD PRO A 111 13.303 13.175 24.585 1.00 21.39 C ATOM 1597 HA PRO A 111 15.469 14.766 26.331 1.00 0.00 H ATOM 1598 HD3 PRO A 111 13.159 12.271 23.994 1.00 0.00 H ATOM 1599 HD2 PRO A 111 12.928 14.034 24.029 1.00 0.00 H ATOM 1600 HG3 PRO A 111 11.570 13.338 25.868 1.00 0.00 H ATOM 1601 HG2 PRO A 111 12.705 12.049 26.331 1.00 0.00 H ATOM 1602 HB2 PRO A 111 13.309 13.839 27.840 1.00 0.00 H ATOM 1603 HB3 PRO A 111 13.080 15.080 26.586 1.00 0.00 H ATOM 1604 N ASP A 112 15.592 11.599 26.985 1.00 26.75 N ATOM 1605 CA ASP A 112 16.239 10.674 27.908 1.00 24.46 C ATOM 1606 C ASP A 112 17.410 10.022 27.264 1.00 26.85 C ATOM 1607 O ASP A 112 17.911 9.054 27.780 1.00 24.95 O ATOM 1608 CB ASP A 112 15.281 9.619 28.439 1.00 26.76 C ATOM 1609 CG ASP A 112 14.324 10.174 29.434 1.00 24.90 C ATOM 1610 OD1 ASP A 112 14.706 10.384 30.611 1.00 32.71 O ATOM 1611 OD2 ASP A 112 13.186 10.421 29.044 1.00 23.35 O ATOM 1612 HA ASP A 112 16.579 11.265 28.759 1.00 0.00 H ATOM 1613 HB2 ASP A 112 14.717 9.205 27.603 1.00 0.00 H ATOM 1614 HB3 ASP A 112 15.860 8.827 28.913 1.00 0.00 H ATOM 1615 H ASP A 112 15.138 11.247 26.118 1.00 0.00 H ATOM 1616 N GLY A 113 17.843 10.589 26.143 1.00 25.10 N ATOM 1617 CA GLY A 113 19.013 10.130 25.440 1.00 26.31 C ATOM 1618 C GLY A 113 18.647 8.878 24.690 1.00 30.52 C ATOM 1619 O GLY A 113 17.492 8.690 24.291 1.00 26.82 O ATOM 1620 HA3 GLY A 113 19.811 9.915 26.151 1.00 0.00 H ATOM 1621 HA2 GLY A 113 19.348 10.896 24.740 1.00 0.00 H ATOM 1622 H GLY A 113 17.315 11.398 25.757 1.00 0.00 H ATOM 1623 N LEU A 114 19.628 7.997 24.519 1.00 32.55 N ATOM 1624 CA LEU A 114 19.333 6.691 23.974 1.00 26.85 C ATOM 1625 C LEU A 114 19.019 5.743 25.101 1.00 27.01 C ATOM 1626 O LEU A 114 19.915 5.282 25.817 1.00 34.16 O ATOM 1627 CB LEU A 114 20.461 6.192 23.070 1.00 32.29 C ATOM 1628 CG LEU A 114 20.522 6.948 21.732 1.00 32.14 C ATOM 1629 CD1 LEU A 114 21.679 6.449 20.844 1.00 33.11 C ATOM 1630 CD2 LEU A 114 19.165 6.822 21.025 1.00 30.88 C ATOM 1631 HA LEU A 114 18.454 6.754 23.333 1.00 0.00 H ATOM 1632 HB2 LEU A 114 21.410 6.324 23.590 1.00 0.00 H ATOM 1633 HB3 LEU A 114 20.304 5.133 22.866 1.00 0.00 H ATOM 1634 HG LEU A 114 20.725 8.001 21.928 1.00 0.00 H ATOM 1635 HD21 LEU A 114 18.948 5.769 20.844 1.00 0.00 H ATOM 1636 HD22 LEU A 114 18.387 7.252 21.656 1.00 0.00 H ATOM 1637 HD23 LEU A 114 19.201 7.356 20.075 1.00 0.00 H ATOM 1638 HD11 LEU A 114 22.625 6.597 21.365 1.00 0.00 H ATOM 1639 HD12 LEU A 114 21.542 5.389 20.632 1.00 0.00 H ATOM 1640 HD13 LEU A 114 21.686 7.009 19.909 1.00 0.00 H ATOM 1641 H LEU A 114 20.604 8.247 24.776 1.00 0.00 H ATOM 1642 N ARG A 115 17.724 5.493 25.282 1.00 23.44 N ATOM 1643 CA ARG A 115 17.246 4.545 26.292 1.00 22.74 C ATOM 1644 C ARG A 115 16.528 3.303 25.689 1.00 19.12 C ATOM 1645 O ARG A 115 17.201 2.344 25.387 1.00 28.61 O ATOM 1646 CB ARG A 115 16.430 5.279 27.367 1.00 13.78 C ATOM 1647 CG ARG A 115 16.180 4.424 28.550 1.00 16.59 C ATOM 1648 CD ARG A 115 15.562 5.188 29.694 1.00 15.56 C ATOM 1649 NE ARG A 115 14.261 5.741 29.373 1.00 18.12 N ATOM 1650 CZ ARG A 115 13.621 6.584 30.174 1.00 23.26 C ATOM 1651 NH1 ARG A 115 14.200 6.955 31.326 1.00 24.17 N ATOM 1652 NH2 ARG A 115 12.416 7.033 29.841 1.00 19.10 N ATOM 1653 HA ARG A 115 18.119 4.117 26.786 1.00 0.00 H ATOM 1654 HB2 ARG A 115 16.979 6.166 27.683 1.00 0.00 H ATOM 1655 HB3 ARG A 115 15.473 5.579 26.940 1.00 0.00 H ATOM 1656 HG2 ARG A 115 15.505 3.618 28.263 1.00 0.00 H ATOM 1657 HG3 ARG A 115 17.128 4.001 28.883 1.00 0.00 H ATOM 1658 HD2 ARG A 115 16.229 6.006 29.966 1.00 0.00 H ATOM 1659 HD3 ARG A 115 15.452 4.513 30.543 1.00 0.00 H ATOM 1660 HE ARG A 115 13.810 5.466 28.477 1.00 0.00 H ATOM 1661 HH12 ARG A 115 13.712 7.615 31.965 1.00 0.00 H ATOM 1662 HH11 ARG A 115 15.137 6.583 31.580 1.00 0.00 H ATOM 1663 HH22 ARG A 115 11.915 7.693 30.469 1.00 0.00 H ATOM 1664 HH21 ARG A 115 11.973 6.724 28.952 1.00 0.00 H ATOM 1665 H ARG A 115 17.029 5.987 24.687 1.00 0.00 H ATOM 1666 N THR A 116 15.196 3.304 25.544 1.00 18.83 N ATOM 1667 CA THR A 116 14.480 2.300 24.748 1.00 15.95 C ATOM 1668 C THR A 116 14.716 2.558 23.266 1.00 22.40 C ATOM 1669 O THR A 116 14.490 3.681 22.766 1.00 26.81 O ATOM 1670 CB THR A 116 12.944 2.308 24.978 1.00 19.23 C ATOM 1671 OG1 THR A 116 12.659 2.436 26.368 1.00 16.44 O ATOM 1672 CG2 THR A 116 12.296 1.018 24.496 1.00 13.60 C ATOM 1673 HA THR A 116 14.870 1.333 25.067 1.00 0.00 H ATOM 1674 HB THR A 116 12.543 3.150 24.414 1.00 0.00 H ATOM 1675 HG1 THR A 116 13.044 3.283 26.706 1.00 0.00 H ATOM 1676 HG23 THR A 116 12.495 0.888 23.432 1.00 0.00 H ATOM 1677 HG21 THR A 116 12.711 0.176 25.050 1.00 0.00 H ATOM 1678 HG22 THR A 116 11.220 1.069 24.662 1.00 0.00 H ATOM 1679 H THR A 116 14.645 4.049 26.016 1.00 0.00 H ATOM 1680 N THR A 117 15.166 1.526 22.554 1.00 20.77 N ATOM 1681 CA THR A 117 15.410 1.659 21.122 1.00 20.29 C ATOM 1682 C THR A 117 14.834 0.480 20.336 1.00 22.78 C ATOM 1683 O THR A 117 14.439 -0.585 20.889 1.00 21.56 O ATOM 1684 CB THR A 117 16.939 1.746 20.758 1.00 19.13 C ATOM 1685 OG1 THR A 117 17.565 0.551 21.164 1.00 27.48 O ATOM 1686 CG2 THR A 117 17.652 2.936 21.388 1.00 13.98 C ATOM 1687 HA THR A 117 14.916 2.591 20.849 1.00 0.00 H ATOM 1688 HB THR A 117 17.007 1.888 19.679 1.00 0.00 H ATOM 1689 HG1 THR A 117 18.529 0.592 20.941 1.00 0.00 H ATOM 1690 HG23 THR A 117 17.165 3.859 21.072 1.00 0.00 H ATOM 1691 HG21 THR A 117 17.605 2.853 22.474 1.00 0.00 H ATOM 1692 HG22 THR A 117 18.694 2.945 21.067 1.00 0.00 H ATOM 1693 H THR A 117 15.345 0.616 23.024 1.00 0.00 H ATOM 1694 N VAL A 118 14.809 0.663 19.026 1.00 16.91 N ATOM 1695 CA VAL A 118 14.435 -0.430 18.159 1.00 21.62 C ATOM 1696 C VAL A 118 15.677 -1.248 17.733 1.00 21.39 C ATOM 1697 O VAL A 118 16.731 -0.713 17.327 1.00 19.33 O ATOM 1698 CB VAL A 118 13.605 0.085 16.976 1.00 16.25 C ATOM 1699 CG1 VAL A 118 13.469 -0.971 15.968 1.00 15.46 C ATOM 1700 CG2 VAL A 118 12.271 0.472 17.486 1.00 18.05 C ATOM 1701 HA VAL A 118 13.796 -1.122 18.707 1.00 0.00 H ATOM 1702 HB VAL A 118 14.094 0.942 16.514 1.00 0.00 H ATOM 1703 HG11 VAL A 118 14.458 -1.264 15.615 1.00 0.00 H ATOM 1704 HG12 VAL A 118 12.970 -1.833 16.411 1.00 0.00 H ATOM 1705 HG13 VAL A 118 12.879 -0.599 15.131 1.00 0.00 H ATOM 1706 HG21 VAL A 118 11.789 -0.397 17.935 1.00 0.00 H ATOM 1707 HG22 VAL A 118 12.383 1.255 18.236 1.00 0.00 H ATOM 1708 HG23 VAL A 118 11.662 0.842 16.662 1.00 0.00 H ATOM 1709 H VAL A 118 15.057 1.589 18.623 1.00 0.00 H ATOM 1710 N GLN A 119 15.562 -2.549 17.866 1.00 19.98 N ATOM 1711 CA GLN A 119 16.654 -3.415 17.439 1.00 23.70 C ATOM 1712 C GLN A 119 16.201 -4.095 16.102 1.00 24.22 C ATOM 1713 O GLN A 119 15.264 -4.919 16.108 1.00 26.78 O ATOM 1714 CB GLN A 119 16.914 -4.413 18.570 1.00 28.32 C ATOM 1715 CG GLN A 119 17.728 -5.619 18.212 1.00 39.75 C ATOM 1716 CD GLN A 119 19.093 -5.191 17.911 1.00 46.81 C ATOM 1717 OE1 GLN A 119 19.794 -4.692 18.785 1.00 53.08 O ATOM 1718 NE2 GLN A 119 19.476 -5.293 16.651 1.00 53.72 N ATOM 1719 HA GLN A 119 17.588 -2.886 17.247 1.00 0.00 H ATOM 1720 HB2 GLN A 119 17.435 -3.884 19.368 1.00 0.00 H ATOM 1721 HB3 GLN A 119 15.948 -4.760 18.937 1.00 0.00 H ATOM 1722 HG2 GLN A 119 17.738 -6.317 19.049 1.00 0.00 H ATOM 1723 HG3 GLN A 119 17.296 -6.108 17.339 1.00 0.00 H ATOM 1724 HE22 GLN A 119 18.843 -5.725 15.948 1.00 0.00 H ATOM 1725 HE21 GLN A 119 20.411 -4.941 16.362 1.00 0.00 H ATOM 1726 H GLN A 119 14.697 -2.959 18.273 1.00 0.00 H ATOM 1727 N PRO A 120 16.803 -3.704 14.940 1.00 21.53 N ATOM 1728 CA PRO A 120 16.381 -4.309 13.665 1.00 18.76 C ATOM 1729 C PRO A 120 16.679 -5.795 13.599 1.00 21.87 C ATOM 1730 O PRO A 120 17.392 -6.296 14.454 1.00 26.76 O ATOM 1731 CB PRO A 120 17.254 -3.584 12.613 1.00 21.00 C ATOM 1732 CG PRO A 120 17.786 -2.341 13.292 1.00 10.32 C ATOM 1733 CD PRO A 120 17.892 -2.712 14.746 1.00 19.95 C ATOM 1734 HA PRO A 120 15.306 -4.206 13.519 1.00 0.00 H ATOM 1735 HD3 PRO A 120 18.864 -3.154 14.964 1.00 0.00 H ATOM 1736 HD2 PRO A 120 17.741 -1.840 15.382 1.00 0.00 H ATOM 1737 HG3 PRO A 120 17.099 -1.506 13.158 1.00 0.00 H ATOM 1738 HG2 PRO A 120 18.764 -2.073 12.892 1.00 0.00 H ATOM 1739 HB2 PRO A 120 18.077 -4.225 12.298 1.00 0.00 H ATOM 1740 HB3 PRO A 120 16.653 -3.313 11.745 1.00 0.00 H ATOM 1741 N GLY A 121 16.146 -6.467 12.571 1.00 20.86 N ATOM 1742 CA GLY A 121 16.539 -7.824 12.171 1.00 22.08 C ATOM 1743 C GLY A 121 17.933 -7.812 11.530 1.00 26.54 C ATOM 1744 O GLY A 121 18.549 -6.747 11.349 1.00 23.75 O ATOM 1745 HA3 GLY A 121 15.816 -8.210 11.452 1.00 0.00 H ATOM 1746 HA2 GLY A 121 16.554 -8.468 13.051 1.00 0.00 H ATOM 1747 H GLY A 121 15.402 -5.995 12.018 1.00 0.00 H ATOM 1748 N PRO A 122 18.467 -9.008 11.233 1.00 28.66 N ATOM 1749 CA PRO A 122 19.851 -9.203 10.705 1.00 23.50 C ATOM 1750 C PRO A 122 20.134 -8.481 9.381 1.00 28.79 C ATOM 1751 O PRO A 122 21.296 -8.157 9.112 1.00 33.43 O ATOM 1752 CB PRO A 122 19.959 -10.701 10.499 1.00 20.51 C ATOM 1753 CG PRO A 122 18.556 -11.271 10.728 1.00 20.44 C ATOM 1754 CD PRO A 122 17.743 -10.271 11.470 1.00 21.28 C ATOM 1755 HA PRO A 122 20.576 -8.784 11.403 1.00 0.00 H ATOM 1756 HD3 PRO A 122 16.728 -10.221 11.075 1.00 0.00 H ATOM 1757 HD2 PRO A 122 17.706 -10.508 12.533 1.00 0.00 H ATOM 1758 HG3 PRO A 122 18.625 -12.190 11.309 1.00 0.00 H ATOM 1759 HG2 PRO A 122 18.086 -11.484 9.768 1.00 0.00 H ATOM 1760 HB2 PRO A 122 20.294 -10.919 9.485 1.00 0.00 H ATOM 1761 HB3 PRO A 122 20.662 -11.130 11.213 1.00 0.00 H ATOM 1762 N LEU A 123 19.090 -8.194 8.590 1.00 26.78 N ATOM 1763 CA LEU A 123 19.252 -7.331 7.408 1.00 28.03 C ATOM 1764 C LEU A 123 19.897 -5.959 7.714 1.00 26.72 C ATOM 1765 O LEU A 123 20.485 -5.320 6.817 1.00 26.51 O ATOM 1766 CB LEU A 123 17.896 -7.131 6.678 1.00 31.99 C ATOM 1767 CG LEU A 123 17.932 -6.167 5.470 1.00 30.84 C ATOM 1768 CD1 LEU A 123 18.987 -6.543 4.389 1.00 30.46 C ATOM 1769 CD2 LEU A 123 16.605 -5.921 4.867 1.00 18.74 C ATOM 1770 HA LEU A 123 19.948 -7.859 6.756 1.00 0.00 H ATOM 1771 HB2 LEU A 123 17.558 -8.104 6.323 1.00 0.00 H ATOM 1772 HB3 LEU A 123 17.179 -6.740 7.400 1.00 0.00 H ATOM 1773 HG LEU A 123 18.261 -5.223 5.904 1.00 0.00 H ATOM 1774 HD21 LEU A 123 16.185 -6.865 4.518 1.00 0.00 H ATOM 1775 HD22 LEU A 123 15.944 -5.482 5.614 1.00 0.00 H ATOM 1776 HD23 LEU A 123 16.711 -5.236 4.026 1.00 0.00 H ATOM 1777 HD11 LEU A 123 19.981 -6.536 4.836 1.00 0.00 H ATOM 1778 HD12 LEU A 123 18.769 -7.538 4.000 1.00 0.00 H ATOM 1779 HD13 LEU A 123 18.947 -5.817 3.577 1.00 0.00 H ATOM 1780 H LEU A 123 18.153 -8.586 8.814 1.00 0.00 H ATOM 1781 N ALA A 124 19.742 -5.481 8.952 1.00 25.35 N ATOM 1782 CA ALA A 124 20.360 -4.215 9.361 1.00 26.33 C ATOM 1783 C ALA A 124 21.894 -4.336 9.389 1.00 28.28 C ATOM 1784 O ALA A 124 22.557 -3.352 9.222 1.00 24.48 O ATOM 1785 CB ALA A 124 19.810 -3.757 10.729 1.00 28.05 C ATOM 1786 HA ALA A 124 20.102 -3.455 8.624 1.00 0.00 H ATOM 1787 HB1 ALA A 124 18.731 -3.616 10.657 1.00 0.00 H ATOM 1788 HB2 ALA A 124 20.029 -4.516 11.480 1.00 0.00 H ATOM 1789 HB3 ALA A 124 20.282 -2.816 11.013 1.00 0.00 H ATOM 1790 H ALA A 124 19.173 -6.016 9.638 1.00 0.00 H ATOM 1791 N ALA A 125 22.429 -5.559 9.570 1.00 30.72 N ATOM 1792 CA ALA A 125 23.881 -5.821 9.588 1.00 30.14 C ATOM 1793 C ALA A 125 24.539 -5.930 8.175 1.00 29.59 C ATOM 1794 O ALA A 125 25.764 -6.006 8.049 1.00 30.17 O ATOM 1795 CB ALA A 125 24.210 -7.089 10.453 1.00 22.29 C ATOM 1796 HA ALA A 125 24.326 -4.939 10.049 1.00 0.00 H ATOM 1797 HB1 ALA A 125 23.869 -6.928 11.476 1.00 0.00 H ATOM 1798 HB2 ALA A 125 23.702 -7.956 10.032 1.00 0.00 H ATOM 1799 HB3 ALA A 125 25.286 -7.260 10.450 1.00 0.00 H ATOM 1800 H ALA A 125 21.783 -6.363 9.704 1.00 0.00 H ATOM 1801 N GLU A 126 23.741 -5.907 7.122 1.00 27.71 N ATOM 1802 CA GLU A 126 24.299 -6.086 5.786 1.00 29.53 C ATOM 1803 C GLU A 126 24.280 -4.836 4.961 1.00 29.94 C ATOM 1804 O GLU A 126 23.625 -3.846 5.307 1.00 32.61 O ATOM 1805 CB GLU A 126 23.528 -7.165 5.058 1.00 30.23 C ATOM 1806 CG GLU A 126 23.676 -8.502 5.732 1.00 40.26 C ATOM 1807 CD GLU A 126 22.689 -9.478 5.217 1.00 45.64 C ATOM 1808 OE1 GLU A 126 22.151 -9.203 4.132 1.00 39.25 O ATOM 1809 OE2 GLU A 126 22.438 -10.499 5.905 1.00 52.62 O ATOM 1810 HA GLU A 126 25.343 -6.368 5.920 1.00 0.00 H ATOM 1811 HB2 GLU A 126 22.473 -6.894 5.038 1.00 0.00 H ATOM 1812 HB3 GLU A 126 23.902 -7.240 4.037 1.00 0.00 H ATOM 1813 HG2 GLU A 126 24.681 -8.883 5.549 1.00 0.00 H ATOM 1814 HG3 GLU A 126 23.526 -8.378 6.804 1.00 0.00 H ATOM 1815 H GLU A 126 22.719 -5.762 7.245 1.00 0.00 H ATOM 1816 N LEU A 127 24.980 -4.904 3.835 1.00 29.87 N ATOM 1817 CA LEU A 127 24.943 -3.854 2.841 1.00 27.88 C ATOM 1818 C LEU A 127 25.351 -2.521 3.475 1.00 28.22 C ATOM 1819 O LEU A 127 26.515 -2.338 3.831 1.00 31.46 O ATOM 1820 CB LEU A 127 23.571 -3.799 2.170 1.00 24.91 C ATOM 1821 CG LEU A 127 23.367 -5.052 1.322 1.00 34.32 C ATOM 1822 CD1 LEU A 127 21.869 -5.351 1.067 1.00 30.55 C ATOM 1823 CD2 LEU A 127 24.168 -4.954 -0.010 1.00 34.98 C ATOM 1824 HA LEU A 127 25.664 -4.069 2.053 1.00 0.00 H ATOM 1825 HB2 LEU A 127 22.795 -3.747 2.934 1.00 0.00 H ATOM 1826 HB3 LEU A 127 23.513 -2.916 1.534 1.00 0.00 H ATOM 1827 HG LEU A 127 23.757 -5.896 1.890 1.00 0.00 H ATOM 1828 HD21 LEU A 127 23.826 -4.087 -0.575 1.00 0.00 H ATOM 1829 HD22 LEU A 127 25.230 -4.849 0.213 1.00 0.00 H ATOM 1830 HD23 LEU A 127 24.007 -5.858 -0.597 1.00 0.00 H ATOM 1831 HD11 LEU A 127 21.362 -5.501 2.020 1.00 0.00 H ATOM 1832 HD12 LEU A 127 21.416 -4.510 0.542 1.00 0.00 H ATOM 1833 HD13 LEU A 127 21.778 -6.251 0.460 1.00 0.00 H ATOM 1834 H LEU A 127 25.574 -5.740 3.662 1.00 0.00 H ATOM 1835 N GLU A 128 24.401 -1.611 3.636 1.00 28.59 N ATOM 1836 CA GLU A 128 24.717 -0.313 4.183 1.00 28.11 C ATOM 1837 C GLU A 128 25.110 -0.406 5.656 1.00 28.41 C ATOM 1838 O GLU A 128 25.830 0.454 6.153 1.00 30.52 O ATOM 1839 CB GLU A 128 23.560 0.661 4.017 1.00 22.04 C ATOM 1840 CG GLU A 128 23.330 1.080 2.595 1.00 29.89 C ATOM 1841 CD GLU A 128 24.514 1.828 2.042 1.00 31.53 C ATOM 1842 OE1 GLU A 128 24.672 3.005 2.429 1.00 30.49 O ATOM 1843 OE2 GLU A 128 25.294 1.244 1.241 1.00 34.57 O ATOM 1844 HA GLU A 128 25.570 0.065 3.620 1.00 0.00 H ATOM 1845 HB2 GLU A 128 22.652 0.185 4.388 1.00 0.00 H ATOM 1846 HB3 GLU A 128 23.770 1.551 4.610 1.00 0.00 H ATOM 1847 HG2 GLU A 128 23.156 0.192 1.987 1.00 0.00 H ATOM 1848 HG3 GLU A 128 22.452 1.725 2.553 1.00 0.00 H ATOM 1849 H GLU A 128 23.421 -1.834 3.366 1.00 0.00 H ATOM 1850 N GLY A 129 24.630 -1.435 6.340 1.00 18.39 N ATOM 1851 CA GLY A 129 24.889 -1.564 7.749 1.00 34.44 C ATOM 1852 C GLY A 129 26.166 -2.333 8.080 1.00 38.29 C ATOM 1853 O GLY A 129 26.425 -2.649 9.240 1.00 33.01 O ATOM 1854 HA3 GLY A 129 24.047 -2.085 8.206 1.00 0.00 H ATOM 1855 HA2 GLY A 129 24.971 -0.564 8.175 1.00 0.00 H ATOM 1856 H GLY A 129 24.060 -2.156 5.853 1.00 0.00 H ATOM 1857 N GLY A 130 26.940 -2.656 7.050 1.00 41.09 N ATOM 1858 CA GLY A 130 28.148 -3.451 7.209 1.00 47.35 C ATOM 1859 C GLY A 130 29.217 -2.673 7.952 1.00 49.70 C ATOM 1860 O GLY A 130 29.685 -3.140 9.006 1.00 48.77 O ATOM 1861 HA3 GLY A 130 28.526 -3.726 6.224 1.00 0.00 H ATOM 1862 HA2 GLY A 130 27.909 -4.354 7.770 1.00 0.00 H ATOM 1863 H GLY A 130 26.674 -2.330 6.099 1.00 0.00 H ATOM 1864 N PRO A 131 29.615 -1.504 7.393 1.00 51.34 N ATOM 1865 CA PRO A 131 30.502 -0.516 8.018 1.00 55.66 C ATOM 1866 C PRO A 131 29.855 0.247 9.181 1.00 58.79 C ATOM 1867 O PRO A 131 30.564 0.670 10.099 1.00 60.47 O ATOM 1868 CB PRO A 131 30.778 0.479 6.875 1.00 56.05 C ATOM 1869 CG PRO A 131 29.567 0.389 5.978 1.00 54.31 C ATOM 1870 CD PRO A 131 29.216 -1.081 6.030 1.00 53.17 C ATOM 1871 HA PRO A 131 31.380 -1.003 8.443 1.00 0.00 H ATOM 1872 HD3 PRO A 131 28.147 -1.229 5.877 1.00 0.00 H ATOM 1873 HD2 PRO A 131 29.770 -1.638 5.275 1.00 0.00 H ATOM 1874 HG3 PRO A 131 29.808 0.699 4.961 1.00 0.00 H ATOM 1875 HG2 PRO A 131 28.750 1.001 6.359 1.00 0.00 H ATOM 1876 HB2 PRO A 131 30.891 1.490 7.266 1.00 0.00 H ATOM 1877 HB3 PRO A 131 31.680 0.198 6.331 1.00 0.00 H ATOM 1878 N ARG A 132 28.529 0.430 9.121 1.00 58.66 N ATOM 1879 CA ARG A 132 27.773 1.272 10.062 1.00 54.86 C ATOM 1880 C ARG A 132 26.718 0.444 10.828 1.00 49.10 C ATOM 1881 O ARG A 132 25.502 0.647 10.638 1.00 45.99 O ATOM 1882 CB ARG A 132 27.119 2.428 9.298 1.00 54.23 C ATOM 1883 CG ARG A 132 28.047 3.103 8.295 1.00 60.65 C ATOM 1884 CD ARG A 132 27.405 4.327 7.642 1.00 63.93 C ATOM 1885 NE ARG A 132 28.423 5.238 7.105 1.00 70.60 N ATOM 1886 CZ ARG A 132 29.154 6.082 7.840 1.00 70.23 C ATOM 1887 NH1 ARG A 132 28.990 6.155 9.159 1.00 70.45 N ATOM 1888 NH2 ARG A 132 30.052 6.861 7.258 1.00 67.51 N ATOM 1889 HA ARG A 132 28.461 1.680 10.803 1.00 0.00 H ATOM 1890 HB2 ARG A 132 26.254 2.040 8.760 1.00 0.00 H ATOM 1891 HB3 ARG A 132 26.790 3.175 10.020 1.00 0.00 H ATOM 1892 HG2 ARG A 132 28.954 3.417 8.812 1.00 0.00 H ATOM 1893 HG3 ARG A 132 28.304 2.385 7.517 1.00 0.00 H ATOM 1894 HD2 ARG A 132 26.811 4.857 8.386 1.00 0.00 H ATOM 1895 HD3 ARG A 132 26.758 3.998 6.829 1.00 0.00 H ATOM 1896 HE ARG A 132 28.587 5.226 6.078 1.00 0.00 H ATOM 1897 HH12 ARG A 132 29.565 6.816 9.719 1.00 0.00 H ATOM 1898 HH11 ARG A 132 28.286 5.551 9.630 1.00 0.00 H ATOM 1899 HH22 ARG A 132 30.620 7.517 7.831 1.00 0.00 H ATOM 1900 HH21 ARG A 132 30.189 6.817 6.228 1.00 0.00 H ATOM 1901 H ARG A 132 28.003 -0.052 8.364 1.00 0.00 H ATOM 1902 N PRO A 133 27.136 -0.468 11.673 1.00 43.72 N ATOM 1903 CA PRO A 133 26.218 -1.432 12.267 1.00 41.37 C ATOM 1904 C PRO A 133 25.139 -0.901 13.226 1.00 36.01 C ATOM 1905 O PRO A 133 24.294 -1.639 13.590 1.00 32.07 O ATOM 1906 CB PRO A 133 27.160 -2.436 12.925 1.00 41.27 C ATOM 1907 CG PRO A 133 28.386 -1.778 13.032 1.00 45.96 C ATOM 1908 CD PRO A 133 28.519 -0.832 11.933 1.00 45.31 C ATOM 1909 HA PRO A 133 25.568 -1.847 11.496 1.00 0.00 H ATOM 1910 HD3 PRO A 133 29.108 0.037 12.228 1.00 0.00 H ATOM 1911 HD2 PRO A 133 28.976 -1.300 11.061 1.00 0.00 H ATOM 1912 HG3 PRO A 133 29.196 -2.506 12.987 1.00 0.00 H ATOM 1913 HG2 PRO A 133 28.432 -1.244 13.981 1.00 0.00 H ATOM 1914 HB2 PRO A 133 26.790 -2.717 13.911 1.00 0.00 H ATOM 1915 HB3 PRO A 133 27.258 -3.329 12.307 1.00 0.00 H ATOM 1916 N THR A 134 25.143 0.375 13.551 1.00 35.22 N ATOM 1917 CA THR A 134 24.084 0.939 14.348 1.00 36.21 C ATOM 1918 C THR A 134 23.175 1.874 13.560 1.00 34.61 C ATOM 1919 O THR A 134 22.236 2.391 14.086 1.00 28.71 O ATOM 1920 CB THR A 134 24.589 1.608 15.677 1.00 37.36 C ATOM 1921 OG1 THR A 134 25.136 2.892 15.423 1.00 38.59 O ATOM 1922 CG2 THR A 134 25.591 0.768 16.368 1.00 36.31 C ATOM 1923 HA THR A 134 23.477 0.084 14.645 1.00 0.00 H ATOM 1924 HB THR A 134 23.722 1.712 16.329 1.00 0.00 H ATOM 1925 HG1 THR A 134 24.442 3.471 15.019 1.00 0.00 H ATOM 1926 HG23 THR A 134 25.166 -0.217 16.561 1.00 0.00 H ATOM 1927 HG21 THR A 134 26.475 0.667 15.738 1.00 0.00 H ATOM 1928 HG22 THR A 134 25.868 1.237 17.312 1.00 0.00 H ATOM 1929 H THR A 134 25.922 0.984 13.228 1.00 0.00 H ATOM 1930 N HIS A 135 23.470 2.056 12.292 1.00 30.88 N ATOM 1931 CA HIS A 135 22.700 2.955 11.462 1.00 32.35 C ATOM 1932 C HIS A 135 21.186 2.666 11.347 1.00 27.79 C ATOM 1933 O HIS A 135 20.411 3.565 11.507 1.00 23.60 O ATOM 1934 CB HIS A 135 23.328 3.127 10.070 1.00 32.95 C ATOM 1935 CG HIS A 135 22.446 3.842 9.098 1.00 26.70 C ATOM 1936 ND1 HIS A 135 22.300 5.198 9.090 1.00 31.93 N ATOM 1937 CD2 HIS A 135 21.626 3.377 8.144 1.00 26.33 C ATOM 1938 CE1 HIS A 135 21.447 5.537 8.158 1.00 26.77 C ATOM 1939 NE2 HIS A 135 21.036 4.450 7.559 1.00 21.96 N ATOM 1940 HA HIS A 135 22.752 3.896 12.010 1.00 0.00 H ATOM 1941 HB2 HIS A 135 24.253 3.693 10.177 1.00 0.00 H ATOM 1942 HB3 HIS A 135 23.553 2.139 9.669 1.00 0.00 H ATOM 1943 HD2 HIS A 135 21.463 2.330 7.886 1.00 0.00 H ATOM 1944 HE1 HIS A 135 21.132 6.553 7.921 1.00 0.00 H ATOM 1945 H HIS A 135 24.274 1.543 11.877 1.00 0.00 H ATOM 1946 N PHE A 136 20.788 1.433 11.077 1.00 20.09 N ATOM 1947 CA PHE A 136 19.318 1.173 10.924 1.00 23.46 C ATOM 1948 C PHE A 136 18.479 1.192 12.208 1.00 20.77 C ATOM 1949 O PHE A 136 17.306 1.596 12.193 1.00 25.00 O ATOM 1950 CB PHE A 136 19.005 -0.002 9.988 1.00 20.41 C ATOM 1951 CG PHE A 136 19.333 0.300 8.547 1.00 26.43 C ATOM 1952 CD1 PHE A 136 18.570 1.238 7.816 1.00 22.74 C ATOM 1953 CD2 PHE A 136 20.447 -0.289 7.930 1.00 29.49 C ATOM 1954 CE1 PHE A 136 18.878 1.534 6.479 1.00 25.68 C ATOM 1955 CE2 PHE A 136 20.776 0.005 6.579 1.00 26.92 C ATOM 1956 CZ PHE A 136 20.004 0.928 5.862 1.00 22.85 C ATOM 1957 HA PHE A 136 18.964 2.070 10.415 1.00 0.00 H ATOM 1958 HB2 PHE A 136 19.588 -0.866 10.305 1.00 0.00 H ATOM 1959 HB3 PHE A 136 17.943 -0.235 10.063 1.00 0.00 H ATOM 1960 HD2 PHE A 136 21.070 -0.983 8.495 1.00 0.00 H ATOM 1961 HE2 PHE A 136 21.625 -0.485 6.103 1.00 0.00 H ATOM 1962 HZ PHE A 136 20.267 1.180 4.835 1.00 0.00 H ATOM 1963 HE1 PHE A 136 18.254 2.228 5.916 1.00 0.00 H ATOM 1964 HD1 PHE A 136 17.730 1.739 8.297 1.00 0.00 H ATOM 1965 H PHE A 136 21.478 0.662 10.973 1.00 0.00 H ATOM 1966 N ALA A 137 19.107 0.837 13.323 1.00 22.51 N ATOM 1967 CA ALA A 137 18.514 0.960 14.663 1.00 24.99 C ATOM 1968 C ALA A 137 18.137 2.442 14.920 1.00 23.43 C ATOM 1969 O ALA A 137 17.030 2.771 15.364 1.00 24.57 O ATOM 1970 CB ALA A 137 19.534 0.438 15.707 1.00 19.20 C ATOM 1971 HA ALA A 137 17.604 0.365 14.743 1.00 0.00 H ATOM 1972 HB1 ALA A 137 19.764 -0.607 15.497 1.00 0.00 H ATOM 1973 HB2 ALA A 137 20.447 1.031 15.649 1.00 0.00 H ATOM 1974 HB3 ALA A 137 19.106 0.524 16.706 1.00 0.00 H ATOM 1975 H ALA A 137 20.070 0.451 13.244 1.00 0.00 H ATOM 1976 N GLY A 138 19.046 3.340 14.577 1.00 23.44 N ATOM 1977 CA GLY A 138 18.751 4.782 14.664 1.00 23.95 C ATOM 1978 C GLY A 138 17.610 5.223 13.766 1.00 24.16 C ATOM 1979 O GLY A 138 16.717 5.957 14.206 1.00 28.54 O ATOM 1980 HA3 GLY A 138 19.647 5.335 14.381 1.00 0.00 H ATOM 1981 HA2 GLY A 138 18.490 5.019 15.695 1.00 0.00 H ATOM 1982 H GLY A 138 19.979 3.025 14.242 1.00 0.00 H ATOM 1983 N VAL A 139 17.660 4.805 12.498 1.00 22.40 N ATOM 1984 CA VAL A 139 16.570 5.052 11.525 1.00 19.63 C ATOM 1985 C VAL A 139 15.197 4.509 11.970 1.00 19.31 C ATOM 1986 O VAL A 139 14.192 5.234 11.946 1.00 23.17 O ATOM 1987 CB VAL A 139 16.945 4.443 10.122 1.00 23.47 C ATOM 1988 CG1 VAL A 139 15.761 4.492 9.143 1.00 14.11 C ATOM 1989 CG2 VAL A 139 18.183 5.150 9.550 1.00 18.59 C ATOM 1990 HA VAL A 139 16.470 6.135 11.460 1.00 0.00 H ATOM 1991 HB VAL A 139 17.188 3.390 10.264 1.00 0.00 H ATOM 1992 HG11 VAL A 139 14.928 3.921 9.553 1.00 0.00 H ATOM 1993 HG12 VAL A 139 15.455 5.528 8.996 1.00 0.00 H ATOM 1994 HG13 VAL A 139 16.063 4.062 8.188 1.00 0.00 H ATOM 1995 HG21 VAL A 139 17.971 6.213 9.433 1.00 0.00 H ATOM 1996 HG22 VAL A 139 19.023 5.018 10.232 1.00 0.00 H ATOM 1997 HG23 VAL A 139 18.430 4.719 8.580 1.00 0.00 H ATOM 1998 H VAL A 139 18.501 4.283 12.180 1.00 0.00 H ATOM 1999 N LEU A 140 15.139 3.252 12.406 1.00 17.65 N ATOM 2000 CA LEU A 140 13.844 2.644 12.761 1.00 14.88 C ATOM 2001 C LEU A 140 13.287 3.211 14.061 1.00 10.10 C ATOM 2002 O LEU A 140 12.058 3.337 14.249 1.00 17.75 O ATOM 2003 CB LEU A 140 13.941 1.113 12.868 1.00 18.90 C ATOM 2004 CG LEU A 140 14.318 0.265 11.642 1.00 24.96 C ATOM 2005 CD1 LEU A 140 13.805 -1.201 11.790 1.00 17.99 C ATOM 2006 CD2 LEU A 140 13.857 0.911 10.352 1.00 20.07 C ATOM 2007 HA LEU A 140 13.159 2.895 11.951 1.00 0.00 H ATOM 2008 HB2 LEU A 140 14.685 0.900 13.635 1.00 0.00 H ATOM 2009 HB3 LEU A 140 12.965 0.761 13.203 1.00 0.00 H ATOM 2010 HG LEU A 140 15.406 0.217 11.592 1.00 0.00 H ATOM 2011 HD21 LEU A 140 12.773 1.025 10.371 1.00 0.00 H ATOM 2012 HD22 LEU A 140 14.325 1.890 10.250 1.00 0.00 H ATOM 2013 HD23 LEU A 140 14.142 0.281 9.509 1.00 0.00 H ATOM 2014 HD11 LEU A 140 14.251 -1.653 12.676 1.00 0.00 H ATOM 2015 HD12 LEU A 140 12.720 -1.196 11.890 1.00 0.00 H ATOM 2016 HD13 LEU A 140 14.088 -1.774 10.907 1.00 0.00 H ATOM 2017 H LEU A 140 16.013 2.696 12.497 1.00 0.00 H ATOM 2018 N THR A 141 14.185 3.619 14.935 1.00 15.07 N ATOM 2019 CA THR A 141 13.782 4.220 16.225 1.00 19.14 C ATOM 2020 C THR A 141 13.072 5.533 15.961 1.00 19.81 C ATOM 2021 O THR A 141 11.985 5.775 16.491 1.00 22.38 O ATOM 2022 CB THR A 141 15.015 4.401 17.191 1.00 17.83 C ATOM 2023 OG1 THR A 141 15.482 3.093 17.621 1.00 14.86 O ATOM 2024 CG2 THR A 141 14.643 5.205 18.409 1.00 4.78 C ATOM 2025 HA THR A 141 13.094 3.545 16.734 1.00 0.00 H ATOM 2026 HB THR A 141 15.797 4.932 16.648 1.00 0.00 H ATOM 2027 HG1 THR A 141 15.754 2.564 16.829 1.00 0.00 H ATOM 2028 HG23 THR A 141 14.291 6.189 18.100 1.00 0.00 H ATOM 2029 HG21 THR A 141 13.853 4.690 18.955 1.00 0.00 H ATOM 2030 HG22 THR A 141 15.517 5.316 19.051 1.00 0.00 H ATOM 2031 H THR A 141 15.196 3.516 14.714 1.00 0.00 H ATOM 2032 N VAL A 142 13.658 6.376 15.118 1.00 19.28 N ATOM 2033 CA VAL A 142 13.047 7.672 14.917 1.00 15.80 C ATOM 2034 C VAL A 142 11.800 7.493 14.037 1.00 17.60 C ATOM 2035 O VAL A 142 10.754 8.160 14.273 1.00 21.27 O ATOM 2036 CB VAL A 142 14.062 8.707 14.385 1.00 21.51 C ATOM 2037 CG1 VAL A 142 14.326 8.505 12.886 1.00 24.30 C ATOM 2038 CG2 VAL A 142 13.591 10.130 14.682 1.00 27.85 C ATOM 2039 HA VAL A 142 12.719 8.090 15.869 1.00 0.00 H ATOM 2040 HB VAL A 142 15.007 8.553 14.906 1.00 0.00 H ATOM 2041 HG11 VAL A 142 14.728 7.506 12.721 1.00 0.00 H ATOM 2042 HG12 VAL A 142 13.392 8.618 12.335 1.00 0.00 H ATOM 2043 HG13 VAL A 142 15.044 9.249 12.541 1.00 0.00 H ATOM 2044 HG21 VAL A 142 12.628 10.301 14.200 1.00 0.00 H ATOM 2045 HG22 VAL A 142 13.487 10.260 15.759 1.00 0.00 H ATOM 2046 HG23 VAL A 142 14.322 10.841 14.298 1.00 0.00 H ATOM 2047 H VAL A 142 14.530 6.112 14.617 1.00 0.00 H ATOM 2048 N VAL A 143 11.863 6.585 13.057 1.00 14.92 N ATOM 2049 CA VAL A 143 10.659 6.329 12.258 1.00 17.60 C ATOM 2050 C VAL A 143 9.494 5.828 13.148 1.00 20.95 C ATOM 2051 O VAL A 143 8.356 6.267 12.977 1.00 25.46 O ATOM 2052 CB VAL A 143 10.887 5.385 11.060 1.00 19.69 C ATOM 2053 CG1 VAL A 143 9.493 4.906 10.455 1.00 13.60 C ATOM 2054 CG2 VAL A 143 11.711 6.098 9.979 1.00 17.56 C ATOM 2055 HA VAL A 143 10.385 7.291 11.825 1.00 0.00 H ATOM 2056 HB VAL A 143 11.435 4.509 11.407 1.00 0.00 H ATOM 2057 HG11 VAL A 143 8.928 4.376 11.222 1.00 0.00 H ATOM 2058 HG12 VAL A 143 8.926 5.775 10.120 1.00 0.00 H ATOM 2059 HG13 VAL A 143 9.674 4.241 9.611 1.00 0.00 H ATOM 2060 HG21 VAL A 143 11.175 6.985 9.641 1.00 0.00 H ATOM 2061 HG22 VAL A 143 12.675 6.392 10.394 1.00 0.00 H ATOM 2062 HG23 VAL A 143 11.866 5.423 9.138 1.00 0.00 H ATOM 2063 H VAL A 143 12.747 6.071 12.865 1.00 0.00 H ATOM 2064 N LEU A 144 9.765 4.934 14.111 1.00 21.27 N ATOM 2065 CA LEU A 144 8.706 4.515 15.007 1.00 15.50 C ATOM 2066 C LEU A 144 8.192 5.730 15.799 1.00 17.68 C ATOM 2067 O LEU A 144 6.987 5.920 15.984 1.00 10.65 O ATOM 2068 CB LEU A 144 9.202 3.422 15.980 1.00 16.49 C ATOM 2069 CG LEU A 144 8.169 2.790 16.943 1.00 22.11 C ATOM 2070 CD1 LEU A 144 7.067 1.963 16.184 1.00 17.19 C ATOM 2071 CD2 LEU A 144 8.880 1.906 17.946 1.00 19.79 C ATOM 2072 HA LEU A 144 7.895 4.095 14.412 1.00 0.00 H ATOM 2073 HB2 LEU A 144 9.621 2.616 15.378 1.00 0.00 H ATOM 2074 HB3 LEU A 144 9.989 3.864 16.591 1.00 0.00 H ATOM 2075 HG LEU A 144 7.661 3.606 17.458 1.00 0.00 H ATOM 2076 HD21 LEU A 144 9.413 1.116 17.418 1.00 0.00 H ATOM 2077 HD22 LEU A 144 9.589 2.505 18.518 1.00 0.00 H ATOM 2078 HD23 LEU A 144 8.148 1.464 18.622 1.00 0.00 H ATOM 2079 HD11 LEU A 144 6.531 2.619 15.498 1.00 0.00 H ATOM 2080 HD12 LEU A 144 7.541 1.158 15.623 1.00 0.00 H ATOM 2081 HD13 LEU A 144 6.368 1.542 16.907 1.00 0.00 H ATOM 2082 H LEU A 144 10.724 4.546 14.213 1.00 0.00 H ATOM 2083 N LYS A 145 9.100 6.546 16.317 1.00 11.77 N ATOM 2084 CA LYS A 145 8.622 7.644 17.178 1.00 15.65 C ATOM 2085 C LYS A 145 7.699 8.563 16.375 1.00 12.62 C ATOM 2086 O LYS A 145 6.690 9.009 16.880 1.00 19.87 O ATOM 2087 CB LYS A 145 9.810 8.394 17.796 1.00 16.82 C ATOM 2088 CG LYS A 145 10.414 7.618 18.956 1.00 10.50 C ATOM 2089 CD LYS A 145 11.799 8.022 19.293 1.00 11.46 C ATOM 2090 CE LYS A 145 11.920 9.461 19.833 1.00 12.00 C ATOM 2091 NZ LYS A 145 10.971 9.715 21.000 1.00 7.78 N ATOM 2092 HA LYS A 145 8.041 7.239 18.007 1.00 0.00 H ATOM 2093 HB2 LYS A 145 10.573 8.541 17.032 1.00 0.00 H ATOM 2094 HB3 LYS A 145 9.468 9.364 18.158 1.00 0.00 H ATOM 2095 HG2 LYS A 145 9.788 7.772 19.835 1.00 0.00 H ATOM 2096 HG3 LYS A 145 10.419 6.560 18.696 1.00 0.00 H ATOM 2097 HD2 LYS A 145 12.181 7.338 20.051 1.00 0.00 H ATOM 2098 HD3 LYS A 145 12.408 7.941 18.393 1.00 0.00 H ATOM 2099 HE2 LYS A 145 11.685 10.160 19.030 1.00 0.00 H ATOM 2100 HE3 LYS A 145 12.944 9.626 20.169 1.00 0.00 H ATOM 2101 HZ1 LYS A 145 9.991 9.566 20.687 1.00 0.00 H ATOM 2102 HZ2 LYS A 145 11.192 9.057 21.775 1.00 0.00 H ATOM 2103 HZ3 LYS A 145 11.086 10.694 21.332 1.00 0.00 H ATOM 2104 H LYS A 145 10.113 6.416 16.123 1.00 0.00 H ATOM 2105 N LEU A 146 8.051 8.794 15.115 1.00 15.13 N ATOM 2106 CA LEU A 146 7.340 9.668 14.204 1.00 19.45 C ATOM 2107 C LEU A 146 5.956 9.181 13.857 1.00 22.91 C ATOM 2108 O LEU A 146 5.006 9.971 13.817 1.00 24.90 O ATOM 2109 CB LEU A 146 8.145 9.898 12.927 1.00 22.66 C ATOM 2110 CG LEU A 146 9.426 10.750 13.133 1.00 24.68 C ATOM 2111 CD1 LEU A 146 10.274 10.648 11.897 1.00 20.52 C ATOM 2112 CD2 LEU A 146 9.185 12.236 13.500 1.00 13.99 C ATOM 2113 HA LEU A 146 7.218 10.611 14.736 1.00 0.00 H ATOM 2114 HB2 LEU A 146 8.439 8.927 12.527 1.00 0.00 H ATOM 2115 HB3 LEU A 146 7.506 10.408 12.206 1.00 0.00 H ATOM 2116 HG LEU A 146 9.931 10.335 14.005 1.00 0.00 H ATOM 2117 HD21 LEU A 146 8.618 12.718 12.704 1.00 0.00 H ATOM 2118 HD22 LEU A 146 8.624 12.292 14.433 1.00 0.00 H ATOM 2119 HD23 LEU A 146 10.144 12.739 13.621 1.00 0.00 H ATOM 2120 HD11 LEU A 146 10.544 9.606 11.728 1.00 0.00 H ATOM 2121 HD12 LEU A 146 9.713 11.022 11.041 1.00 0.00 H ATOM 2122 HD13 LEU A 146 11.178 11.242 12.028 1.00 0.00 H ATOM 2123 H LEU A 146 8.900 8.312 14.756 1.00 0.00 H ATOM 2124 N LEU A 147 5.829 7.884 13.628 1.00 23.53 N ATOM 2125 CA LEU A 147 4.521 7.269 13.361 1.00 21.52 C ATOM 2126 C LEU A 147 3.621 7.302 14.586 1.00 23.30 C ATOM 2127 O LEU A 147 2.397 7.326 14.471 1.00 29.41 O ATOM 2128 CB LEU A 147 4.734 5.818 12.938 1.00 24.72 C ATOM 2129 CG LEU A 147 5.479 5.585 11.629 1.00 22.09 C ATOM 2130 CD1 LEU A 147 5.797 4.103 11.444 1.00 21.91 C ATOM 2131 CD2 LEU A 147 4.592 6.077 10.497 1.00 21.03 C ATOM 2132 HA LEU A 147 4.033 7.838 12.569 1.00 0.00 H ATOM 2133 HB2 LEU A 147 5.296 5.323 13.730 1.00 0.00 H ATOM 2134 HB3 LEU A 147 3.752 5.354 12.846 1.00 0.00 H ATOM 2135 HG LEU A 147 6.425 6.126 11.637 1.00 0.00 H ATOM 2136 HD21 LEU A 147 3.654 5.521 10.504 1.00 0.00 H ATOM 2137 HD22 LEU A 147 4.387 7.139 10.633 1.00 0.00 H ATOM 2138 HD23 LEU A 147 5.100 5.923 9.545 1.00 0.00 H ATOM 2139 HD11 LEU A 147 6.420 3.761 12.270 1.00 0.00 H ATOM 2140 HD12 LEU A 147 4.868 3.533 11.427 1.00 0.00 H ATOM 2141 HD13 LEU A 147 6.329 3.962 10.503 1.00 0.00 H ATOM 2142 H LEU A 147 6.678 7.283 13.637 1.00 0.00 H ATOM 2143 N GLN A 148 4.233 7.258 15.768 1.00 27.10 N ATOM 2144 CA GLN A 148 3.513 7.287 17.045 1.00 26.07 C ATOM 2145 C GLN A 148 3.017 8.678 17.313 1.00 25.10 C ATOM 2146 O GLN A 148 1.859 8.848 17.595 1.00 33.47 O ATOM 2147 CB GLN A 148 4.349 6.758 18.217 1.00 26.20 C ATOM 2148 CG GLN A 148 4.717 5.235 18.139 1.00 25.78 C ATOM 2149 CD GLN A 148 3.545 4.329 17.750 1.00 23.97 C ATOM 2150 OE1 GLN A 148 3.601 3.635 16.752 1.00 28.16 O ATOM 2151 NE2 GLN A 148 2.505 4.339 18.530 1.00 18.51 N ATOM 2152 HA GLN A 148 2.663 6.610 16.959 1.00 0.00 H ATOM 2153 HB2 GLN A 148 5.277 7.328 18.254 1.00 0.00 H ATOM 2154 HB3 GLN A 148 3.786 6.923 19.135 1.00 0.00 H ATOM 2155 HG2 GLN A 148 5.507 5.111 17.398 1.00 0.00 H ATOM 2156 HG3 GLN A 148 5.084 4.920 19.116 1.00 0.00 H ATOM 2157 HE22 GLN A 148 2.494 4.946 19.375 1.00 0.00 H ATOM 2158 HE21 GLN A 148 1.684 3.740 18.309 1.00 0.00 H ATOM 2159 H GLN A 148 5.271 7.200 15.786 1.00 0.00 H ATOM 2160 N ILE A 149 3.886 9.662 17.164 1.00 25.26 N ATOM 2161 CA ILE A 149 3.543 11.095 17.241 1.00 20.04 C ATOM 2162 C ILE A 149 2.417 11.525 16.285 1.00 19.96 C ATOM 2163 O ILE A 149 1.408 12.031 16.725 1.00 21.87 O ATOM 2164 CB ILE A 149 4.824 11.952 17.014 1.00 21.75 C ATOM 2165 CG1 ILE A 149 5.809 11.756 18.175 1.00 19.21 C ATOM 2166 CG2 ILE A 149 4.490 13.398 16.798 1.00 19.93 C ATOM 2167 CD1 ILE A 149 7.217 12.279 17.886 1.00 20.55 C ATOM 2168 HA ILE A 149 3.148 11.268 18.242 1.00 0.00 H ATOM 2169 HB ILE A 149 5.310 11.607 16.101 1.00 0.00 H ATOM 2170 HG12 ILE A 149 5.420 12.280 19.048 1.00 0.00 H ATOM 2171 HG13 ILE A 149 5.876 10.690 18.393 1.00 0.00 H ATOM 2172 HD11 ILE A 149 7.627 11.757 17.022 1.00 0.00 H ATOM 2173 HD12 ILE A 149 7.171 13.348 17.678 1.00 0.00 H ATOM 2174 HD13 ILE A 149 7.853 12.104 18.753 1.00 0.00 H ATOM 2175 HG21 ILE A 149 3.851 13.495 15.920 1.00 0.00 H ATOM 2176 HG22 ILE A 149 3.968 13.784 17.674 1.00 0.00 H ATOM 2177 HG23 ILE A 149 5.409 13.963 16.643 1.00 0.00 H ATOM 2178 H ILE A 149 4.878 9.410 16.980 1.00 0.00 H ATOM 2179 N VAL A 150 2.592 11.283 14.991 1.00 24.67 N ATOM 2180 CA VAL A 150 1.651 11.676 13.927 1.00 24.25 C ATOM 2181 C VAL A 150 0.528 10.614 13.634 1.00 29.08 C ATOM 2182 O VAL A 150 -0.510 10.950 13.125 1.00 23.74 O ATOM 2183 CB VAL A 150 2.481 11.977 12.635 1.00 25.50 C ATOM 2184 CG1 VAL A 150 1.622 12.408 11.435 1.00 24.61 C ATOM 2185 CG2 VAL A 150 3.538 12.971 12.924 1.00 13.02 C ATOM 2186 HA VAL A 150 1.114 12.561 14.269 1.00 0.00 H ATOM 2187 HB VAL A 150 2.945 11.037 12.337 1.00 0.00 H ATOM 2188 HG11 VAL A 150 0.917 11.614 11.191 1.00 0.00 H ATOM 2189 HG12 VAL A 150 1.075 13.316 11.689 1.00 0.00 H ATOM 2190 HG13 VAL A 150 2.267 12.599 10.578 1.00 0.00 H ATOM 2191 HG21 VAL A 150 3.080 13.895 13.277 1.00 0.00 H ATOM 2192 HG22 VAL A 150 4.204 12.578 13.692 1.00 0.00 H ATOM 2193 HG23 VAL A 150 4.106 13.170 12.015 1.00 0.00 H ATOM 2194 H VAL A 150 3.457 10.779 14.708 1.00 0.00 H ATOM 2195 N ARG A 151 0.723 9.336 13.951 1.00 33.33 N ATOM 2196 CA ARG A 151 -0.275 8.289 13.609 1.00 34.53 C ATOM 2197 C ARG A 151 -0.939 8.471 12.238 1.00 36.75 C ATOM 2198 O ARG A 151 -2.157 8.605 12.166 1.00 41.69 O ATOM 2199 CB ARG A 151 -1.316 8.081 14.735 1.00 39.39 C ATOM 2200 CG ARG A 151 -0.750 7.220 15.938 1.00 49.60 C ATOM 2201 CD ARG A 151 -1.560 7.230 17.263 1.00 52.39 C ATOM 2202 NE ARG A 151 -0.652 7.190 18.425 1.00 67.78 N ATOM 2203 CZ ARG A 151 -0.194 6.082 19.037 1.00 73.34 C ATOM 2204 NH1 ARG A 151 -0.568 4.847 18.647 1.00 76.48 N ATOM 2205 NH2 ARG A 151 0.653 6.208 20.057 1.00 66.46 N ATOM 2206 HA ARG A 151 0.304 7.370 13.523 1.00 0.00 H ATOM 2207 HB2 ARG A 151 -1.618 9.057 15.116 1.00 0.00 H ATOM 2208 HB3 ARG A 151 -2.184 7.570 14.318 1.00 0.00 H ATOM 2209 HG2 ARG A 151 -0.687 6.186 15.600 1.00 0.00 H ATOM 2210 HG3 ARG A 151 0.251 7.589 16.163 1.00 0.00 H ATOM 2211 HD2 ARG A 151 -2.215 6.359 17.290 1.00 0.00 H ATOM 2212 HD3 ARG A 151 -2.162 8.138 17.309 1.00 0.00 H ATOM 2213 HE ARG A 151 -0.336 8.104 18.807 1.00 0.00 H ATOM 2214 HH12 ARG A 151 -0.196 4.011 19.141 1.00 0.00 H ATOM 2215 HH11 ARG A 151 -1.229 4.730 17.852 1.00 0.00 H ATOM 2216 HH22 ARG A 151 1.015 5.361 20.540 1.00 0.00 H ATOM 2217 HH21 ARG A 151 0.952 7.153 20.371 1.00 0.00 H ATOM 2218 H ARG A 151 1.594 9.064 14.450 1.00 0.00 H ATOM 2219 N PRO A 152 -0.143 8.485 11.140 1.00 32.77 N ATOM 2220 CA PRO A 152 -0.735 8.603 9.819 1.00 28.05 C ATOM 2221 C PRO A 152 -1.382 7.328 9.291 1.00 30.59 C ATOM 2222 O PRO A 152 -1.058 6.226 9.765 1.00 31.85 O ATOM 2223 CB PRO A 152 0.462 8.963 8.954 1.00 25.91 C ATOM 2224 CG PRO A 152 1.563 8.290 9.585 1.00 28.92 C ATOM 2225 CD PRO A 152 1.326 8.472 11.052 1.00 32.07 C ATOM 2226 HA PRO A 152 -1.552 9.325 9.825 1.00 0.00 H ATOM 2227 HD3 PRO A 152 1.748 7.646 11.625 1.00 0.00 H ATOM 2228 HD2 PRO A 152 1.750 9.412 11.406 1.00 0.00 H ATOM 2229 HG3 PRO A 152 2.510 8.740 9.289 1.00 0.00 H ATOM 2230 HG2 PRO A 152 1.568 7.232 9.324 1.00 0.00 H ATOM 2231 HB2 PRO A 152 0.324 8.607 7.933 1.00 0.00 H ATOM 2232 HB3 PRO A 152 0.622 10.041 8.943 1.00 0.00 H ATOM 2233 N ASP A 153 -2.275 7.492 8.308 1.00 27.67 N ATOM 2234 CA ASP A 153 -2.876 6.374 7.550 1.00 29.22 C ATOM 2235 C ASP A 153 -1.815 5.705 6.694 1.00 25.24 C ATOM 2236 O ASP A 153 -1.664 4.494 6.700 1.00 26.27 O ATOM 2237 CB ASP A 153 -3.991 6.886 6.618 1.00 35.08 C ATOM 2238 CG ASP A 153 -5.266 7.291 7.356 1.00 47.30 C ATOM 2239 OD1 ASP A 153 -5.246 7.892 8.472 1.00 49.42 O ATOM 2240 OD2 ASP A 153 -6.331 7.015 6.771 1.00 57.48 O ATOM 2241 HA ASP A 153 -3.293 5.666 8.266 1.00 0.00 H ATOM 2242 HB2 ASP A 153 -3.616 7.754 6.076 1.00 0.00 H ATOM 2243 HB3 ASP A 153 -4.239 6.095 5.910 1.00 0.00 H ATOM 2244 H ASP A 153 -2.563 8.461 8.063 1.00 0.00 H ATOM 2245 N ARG A 154 -1.072 6.525 5.963 1.00 26.05 N ATOM 2246 CA ARG A 154 0.047 6.077 5.141 1.00 26.00 C ATOM 2247 C ARG A 154 1.318 6.878 5.391 1.00 18.90 C ATOM 2248 O ARG A 154 1.286 8.056 5.755 1.00 21.55 O ATOM 2249 CB ARG A 154 -0.304 6.207 3.658 1.00 25.75 C ATOM 2250 CG ARG A 154 -1.641 5.596 3.309 1.00 34.70 C ATOM 2251 CD ARG A 154 -1.947 5.672 1.827 1.00 29.85 C ATOM 2252 NE ARG A 154 -3.395 5.663 1.670 1.00 39.74 N ATOM 2253 CZ ARG A 154 -4.050 5.419 0.529 1.00 40.10 C ATOM 2254 NH1 ARG A 154 -3.375 5.174 -0.592 1.00 36.87 N ATOM 2255 NH2 ARG A 154 -5.389 5.433 0.512 1.00 34.63 N ATOM 2256 HA ARG A 154 0.230 5.038 5.415 1.00 0.00 H ATOM 2257 HB2 ARG A 154 -0.328 7.265 3.398 1.00 0.00 H ATOM 2258 HB3 ARG A 154 0.469 5.708 3.073 1.00 0.00 H ATOM 2259 HG2 ARG A 154 -1.636 4.549 3.612 1.00 0.00 H ATOM 2260 HG3 ARG A 154 -2.421 6.127 3.855 1.00 0.00 H ATOM 2261 HD2 ARG A 154 -1.513 4.814 1.314 1.00 0.00 H ATOM 2262 HD3 ARG A 154 -1.534 6.590 1.410 1.00 0.00 H ATOM 2263 HE ARG A 154 -3.967 5.863 2.515 1.00 0.00 H ATOM 2264 HH12 ARG A 154 -3.888 4.985 -1.477 1.00 0.00 H ATOM 2265 HH11 ARG A 154 -2.335 5.172 -0.583 1.00 0.00 H ATOM 2266 HH22 ARG A 154 -5.900 5.244 -0.374 1.00 0.00 H ATOM 2267 HH21 ARG A 154 -5.918 5.633 1.385 1.00 0.00 H ATOM 2268 H ARG A 154 -1.299 7.540 5.976 1.00 0.00 H ATOM 2269 N VAL A 155 2.432 6.232 5.112 1.00 24.18 N ATOM 2270 CA VAL A 155 3.745 6.828 5.227 1.00 22.12 C ATOM 2271 C VAL A 155 4.547 6.577 3.950 1.00 21.02 C ATOM 2272 O VAL A 155 4.593 5.452 3.440 1.00 20.78 O ATOM 2273 CB VAL A 155 4.465 6.317 6.540 1.00 25.94 C ATOM 2274 CG1 VAL A 155 4.857 4.782 6.488 1.00 16.91 C ATOM 2275 CG2 VAL A 155 5.643 7.207 6.883 1.00 26.02 C ATOM 2276 HA VAL A 155 3.658 7.910 5.329 1.00 0.00 H ATOM 2277 HB VAL A 155 3.740 6.391 7.350 1.00 0.00 H ATOM 2278 HG11 VAL A 155 3.956 4.183 6.354 1.00 0.00 H ATOM 2279 HG12 VAL A 155 5.537 4.610 5.654 1.00 0.00 H ATOM 2280 HG13 VAL A 155 5.346 4.501 7.421 1.00 0.00 H ATOM 2281 HG21 VAL A 155 6.358 7.195 6.060 1.00 0.00 H ATOM 2282 HG22 VAL A 155 5.292 8.226 7.046 1.00 0.00 H ATOM 2283 HG23 VAL A 155 6.124 6.838 7.789 1.00 0.00 H ATOM 2284 H VAL A 155 2.364 5.244 4.793 1.00 0.00 H ATOM 2285 N PHE A 156 5.180 7.625 3.437 1.00 19.19 N ATOM 2286 CA PHE A 156 5.905 7.539 2.172 1.00 21.60 C ATOM 2287 C PHE A 156 7.449 7.504 2.266 1.00 19.18 C ATOM 2288 O PHE A 156 8.046 8.286 2.982 1.00 25.23 O ATOM 2289 CB PHE A 156 5.397 8.634 1.222 1.00 16.35 C ATOM 2290 CG PHE A 156 3.900 8.591 1.026 1.00 21.90 C ATOM 2291 CD1 PHE A 156 3.046 8.909 2.063 1.00 14.31 C ATOM 2292 CD2 PHE A 156 3.349 8.210 -0.194 1.00 23.07 C ATOM 2293 CE1 PHE A 156 1.660 8.843 1.875 1.00 22.25 C ATOM 2294 CE2 PHE A 156 1.970 8.143 -0.391 1.00 21.38 C ATOM 2295 CZ PHE A 156 1.124 8.439 0.634 1.00 18.57 C ATOM 2296 HA PHE A 156 5.680 6.553 1.766 1.00 0.00 H ATOM 2297 HB2 PHE A 156 5.667 9.606 1.635 1.00 0.00 H ATOM 2298 HB3 PHE A 156 5.879 8.506 0.253 1.00 0.00 H ATOM 2299 HD2 PHE A 156 4.014 7.957 -1.019 1.00 0.00 H ATOM 2300 HE2 PHE A 156 1.570 7.854 -1.363 1.00 0.00 H ATOM 2301 HZ PHE A 156 0.045 8.365 0.497 1.00 0.00 H ATOM 2302 HE1 PHE A 156 0.990 9.106 2.694 1.00 0.00 H ATOM 2303 HD1 PHE A 156 3.451 9.212 3.029 1.00 0.00 H ATOM 2304 H PHE A 156 5.159 8.530 3.949 1.00 0.00 H ATOM 2305 N PHE A 157 8.073 6.607 1.504 1.00 23.05 N ATOM 2306 CA PHE A 157 9.535 6.516 1.377 1.00 25.53 C ATOM 2307 C PHE A 157 9.966 6.313 -0.073 1.00 27.27 C ATOM 2308 O PHE A 157 9.309 5.583 -0.823 1.00 28.27 O ATOM 2309 CB PHE A 157 10.049 5.350 2.246 1.00 25.53 C ATOM 2310 CG PHE A 157 9.967 5.630 3.741 1.00 26.88 C ATOM 2311 CD1 PHE A 157 10.951 6.388 4.378 1.00 29.62 C ATOM 2312 CD2 PHE A 157 8.888 5.164 4.501 1.00 30.40 C ATOM 2313 CE1 PHE A 157 10.887 6.651 5.740 1.00 29.93 C ATOM 2314 CE2 PHE A 157 8.815 5.423 5.864 1.00 28.04 C ATOM 2315 CZ PHE A 157 9.824 6.180 6.480 1.00 30.20 C ATOM 2316 HA PHE A 157 9.966 7.457 1.719 1.00 0.00 H ATOM 2317 HB2 PHE A 157 9.452 4.465 2.026 1.00 0.00 H ATOM 2318 HB3 PHE A 157 11.090 5.158 1.986 1.00 0.00 H ATOM 2319 HD2 PHE A 157 8.096 4.591 4.018 1.00 0.00 H ATOM 2320 HE2 PHE A 157 7.980 5.041 6.451 1.00 0.00 H ATOM 2321 HZ PHE A 157 9.767 6.396 7.547 1.00 0.00 H ATOM 2322 HE1 PHE A 157 11.675 7.228 6.223 1.00 0.00 H ATOM 2323 HD1 PHE A 157 11.785 6.781 3.796 1.00 0.00 H ATOM 2324 H PHE A 157 7.492 5.932 0.968 1.00 0.00 H ATOM 2325 N GLY A 158 11.046 6.966 -0.487 1.00 28.62 N ATOM 2326 CA GLY A 158 11.640 6.705 -1.822 1.00 26.52 C ATOM 2327 C GLY A 158 12.271 5.317 -1.910 1.00 25.21 C ATOM 2328 O GLY A 158 12.774 4.802 -0.910 1.00 29.32 O ATOM 2329 HA3 GLY A 158 12.408 7.453 -2.017 1.00 0.00 H ATOM 2330 HA2 GLY A 158 10.857 6.784 -2.577 1.00 0.00 H ATOM 2331 H GLY A 158 11.484 7.674 0.136 1.00 0.00 H ATOM 2332 N GLU A 159 12.253 4.704 -3.096 1.00 23.11 N ATOM 2333 CA GLU A 159 12.969 3.446 -3.336 1.00 23.52 C ATOM 2334 C GLU A 159 14.506 3.579 -3.414 1.00 24.11 C ATOM 2335 O GLU A 159 15.237 2.570 -3.361 1.00 27.87 O ATOM 2336 CB GLU A 159 12.450 2.741 -4.586 1.00 25.94 C ATOM 2337 CG GLU A 159 11.017 2.194 -4.472 1.00 26.31 C ATOM 2338 CD GLU A 159 10.446 1.721 -5.805 1.00 31.09 C ATOM 2339 OE1 GLU A 159 11.190 1.717 -6.827 1.00 34.40 O ATOM 2340 OE2 GLU A 159 9.248 1.385 -5.837 1.00 35.02 O ATOM 2341 HA GLU A 159 12.760 2.843 -2.452 1.00 0.00 H ATOM 2342 HB2 GLU A 159 12.477 3.452 -5.412 1.00 0.00 H ATOM 2343 HB3 GLU A 159 13.115 1.906 -4.805 1.00 0.00 H ATOM 2344 HG2 GLU A 159 11.021 1.353 -3.779 1.00 0.00 H ATOM 2345 HG3 GLU A 159 10.375 2.983 -4.080 1.00 0.00 H ATOM 2346 H GLU A 159 11.714 5.132 -3.875 1.00 0.00 H ATOM 2347 N LYS A 160 14.994 4.807 -3.535 1.00 24.28 N ATOM 2348 CA LYS A 160 16.423 5.072 -3.591 1.00 28.19 C ATOM 2349 C LYS A 160 17.123 4.411 -2.404 1.00 26.29 C ATOM 2350 O LYS A 160 18.134 3.728 -2.571 1.00 24.61 O ATOM 2351 CB LYS A 160 16.685 6.587 -3.642 1.00 32.90 C ATOM 2352 CG LYS A 160 17.962 6.970 -4.430 1.00 40.99 C ATOM 2353 CD LYS A 160 19.196 7.090 -3.540 1.00 41.73 C ATOM 2354 CE LYS A 160 19.150 8.413 -2.789 1.00 49.10 C ATOM 2355 NZ LYS A 160 19.478 8.239 -1.344 1.00 53.57 N ATOM 2356 HA LYS A 160 16.836 4.640 -4.503 1.00 0.00 H ATOM 2357 HB2 LYS A 160 15.830 7.069 -4.116 1.00 0.00 H ATOM 2358 HB3 LYS A 160 16.787 6.954 -2.621 1.00 0.00 H ATOM 2359 HG2 LYS A 160 18.149 6.204 -5.183 1.00 0.00 H ATOM 2360 HG3 LYS A 160 17.793 7.928 -4.922 1.00 0.00 H ATOM 2361 HD2 LYS A 160 19.212 6.266 -2.826 1.00 0.00 H ATOM 2362 HD3 LYS A 160 20.094 7.052 -4.156 1.00 0.00 H ATOM 2363 HE2 LYS A 160 18.148 8.834 -2.876 1.00 0.00 H ATOM 2364 HE3 LYS A 160 19.871 9.098 -3.235 1.00 0.00 H ATOM 2365 HZ1 LYS A 160 18.790 7.591 -0.909 1.00 0.00 H ATOM 2366 HZ2 LYS A 160 20.435 7.843 -1.252 1.00 0.00 H ATOM 2367 HZ3 LYS A 160 19.436 9.162 -0.867 1.00 0.00 H ATOM 2368 H LYS A 160 14.332 5.607 -3.592 1.00 0.00 H ATOM 2369 N ASP A 161 16.570 4.616 -1.210 1.00 20.93 N ATOM 2370 CA ASP A 161 17.069 3.970 -0.017 1.00 22.39 C ATOM 2371 C ASP A 161 16.257 2.723 0.217 1.00 22.94 C ATOM 2372 O ASP A 161 15.402 2.656 1.107 1.00 20.42 O ATOM 2373 CB ASP A 161 17.010 4.948 1.143 1.00 24.64 C ATOM 2374 CG ASP A 161 17.968 6.080 0.948 1.00 31.45 C ATOM 2375 OD1 ASP A 161 19.168 5.873 1.247 1.00 36.28 O ATOM 2376 OD2 ASP A 161 17.536 7.130 0.418 1.00 32.01 O ATOM 2377 HA ASP A 161 18.112 3.673 -0.123 1.00 0.00 H ATOM 2378 HB2 ASP A 161 15.999 5.347 1.220 1.00 0.00 H ATOM 2379 HB3 ASP A 161 17.263 4.423 2.064 1.00 0.00 H ATOM 2380 H ASP A 161 15.756 5.259 -1.134 1.00 0.00 H ATOM 2381 N TYR A 162 16.501 1.760 -0.667 1.00 27.03 N ATOM 2382 CA TYR A 162 15.718 0.535 -0.783 1.00 23.82 C ATOM 2383 C TYR A 162 15.817 -0.318 0.462 1.00 20.80 C ATOM 2384 O TYR A 162 14.805 -0.746 1.004 1.00 24.79 O ATOM 2385 CB TYR A 162 16.165 -0.253 -2.012 1.00 25.81 C ATOM 2386 CG TYR A 162 15.195 -1.350 -2.373 1.00 24.45 C ATOM 2387 CD1 TYR A 162 13.969 -1.056 -2.966 1.00 17.84 C ATOM 2388 CD2 TYR A 162 15.492 -2.688 -2.065 1.00 21.73 C ATOM 2389 CE1 TYR A 162 13.075 -2.081 -3.263 1.00 26.62 C ATOM 2390 CE2 TYR A 162 14.612 -3.694 -2.343 1.00 20.94 C ATOM 2391 CZ TYR A 162 13.405 -3.395 -2.956 1.00 25.58 C ATOM 2392 OH TYR A 162 12.562 -4.433 -3.258 1.00 24.26 O ATOM 2393 HA TYR A 162 14.671 0.816 -0.897 1.00 0.00 H ATOM 2394 HB3 TYR A 162 17.139 -0.699 -1.808 1.00 0.00 H ATOM 2395 HB2 TYR A 162 16.250 0.432 -2.856 1.00 0.00 H ATOM 2396 HD2 TYR A 162 16.445 -2.928 -1.594 1.00 0.00 H ATOM 2397 HE2 TYR A 162 14.856 -4.724 -2.085 1.00 0.00 H ATOM 2398 HE1 TYR A 162 12.119 -1.853 -3.735 1.00 0.00 H ATOM 2399 HD1 TYR A 162 13.710 -0.023 -3.198 1.00 0.00 H ATOM 2400 HH TYR A 162 12.317 -4.911 -2.426 1.00 0.00 H ATOM 2401 H TYR A 162 17.302 1.889 -1.318 1.00 0.00 H ATOM 2402 N GLN A 163 17.038 -0.528 0.928 1.00 21.49 N ATOM 2403 CA GLN A 163 17.278 -1.275 2.139 1.00 24.20 C ATOM 2404 C GLN A 163 16.498 -0.695 3.313 1.00 24.22 C ATOM 2405 O GLN A 163 15.855 -1.442 4.074 1.00 20.12 O ATOM 2406 CB GLN A 163 18.782 -1.335 2.470 1.00 29.61 C ATOM 2407 CG GLN A 163 19.063 -2.176 3.709 1.00 23.58 C ATOM 2408 CD GLN A 163 20.525 -2.488 3.941 1.00 25.45 C ATOM 2409 OE1 GLN A 163 21.427 -1.832 3.395 1.00 25.74 O ATOM 2410 NE2 GLN A 163 20.771 -3.491 4.801 1.00 22.27 N ATOM 2411 HA GLN A 163 16.926 -2.292 1.966 1.00 0.00 H ATOM 2412 HB2 GLN A 163 19.312 -1.770 1.622 1.00 0.00 H ATOM 2413 HB3 GLN A 163 19.145 -0.322 2.643 1.00 0.00 H ATOM 2414 HG2 GLN A 163 18.688 -1.636 4.579 1.00 0.00 H ATOM 2415 HG3 GLN A 163 18.526 -3.119 3.609 1.00 0.00 H ATOM 2416 HE22 GLN A 163 19.981 -4.011 5.233 1.00 0.00 H ATOM 2417 HE21 GLN A 163 21.752 -3.747 5.035 1.00 0.00 H ATOM 2418 H GLN A 163 17.850 -0.142 0.405 1.00 0.00 H ATOM 2419 N GLN A 164 16.593 0.619 3.480 1.00 19.90 N ATOM 2420 CA GLN A 164 15.747 1.348 4.436 1.00 24.52 C ATOM 2421 C GLN A 164 14.243 1.055 4.290 1.00 25.99 C ATOM 2422 O GLN A 164 13.566 0.746 5.269 1.00 30.39 O ATOM 2423 CB GLN A 164 15.944 2.855 4.203 1.00 22.66 C ATOM 2424 CG GLN A 164 15.514 3.726 5.351 1.00 30.38 C ATOM 2425 CD GLN A 164 15.822 5.172 5.079 1.00 31.00 C ATOM 2426 OE1 GLN A 164 16.820 5.680 5.574 1.00 31.87 O ATOM 2427 NE2 GLN A 164 14.999 5.835 4.236 1.00 26.59 N ATOM 2428 HA GLN A 164 16.050 1.022 5.431 1.00 0.00 H ATOM 2429 HB2 GLN A 164 17.003 3.035 4.017 1.00 0.00 H ATOM 2430 HB3 GLN A 164 15.368 3.142 3.323 1.00 0.00 H ATOM 2431 HG2 GLN A 164 14.440 3.613 5.501 1.00 0.00 H ATOM 2432 HG3 GLN A 164 16.041 3.413 6.252 1.00 0.00 H ATOM 2433 HE22 GLN A 164 14.163 5.357 3.842 1.00 0.00 H ATOM 2434 HE21 GLN A 164 15.202 6.823 3.981 1.00 0.00 H ATOM 2435 H GLN A 164 17.288 1.149 2.917 1.00 0.00 H ATOM 2436 N LEU A 165 13.703 1.228 3.077 1.00 24.08 N ATOM 2437 CA LEU A 165 12.303 0.913 2.821 1.00 22.12 C ATOM 2438 C LEU A 165 11.995 -0.529 3.270 1.00 19.31 C ATOM 2439 O LEU A 165 10.965 -0.773 3.884 1.00 23.93 O ATOM 2440 CB LEU A 165 11.947 1.096 1.334 1.00 21.63 C ATOM 2441 CG LEU A 165 10.586 0.738 0.676 1.00 22.64 C ATOM 2442 CD1 LEU A 165 9.349 1.578 1.165 1.00 20.08 C ATOM 2443 CD2 LEU A 165 10.696 0.888 -0.829 1.00 21.36 C ATOM 2444 HA LEU A 165 11.691 1.607 3.397 1.00 0.00 H ATOM 2445 HB2 LEU A 165 12.093 2.157 1.132 1.00 0.00 H ATOM 2446 HB3 LEU A 165 12.691 0.517 0.787 1.00 0.00 H ATOM 2447 HG LEU A 165 10.393 -0.290 0.983 1.00 0.00 H ATOM 2448 HD21 LEU A 165 10.958 1.918 -1.072 1.00 0.00 H ATOM 2449 HD22 LEU A 165 11.469 0.217 -1.204 1.00 0.00 H ATOM 2450 HD23 LEU A 165 9.740 0.636 -1.289 1.00 0.00 H ATOM 2451 HD11 LEU A 165 9.217 1.437 2.238 1.00 0.00 H ATOM 2452 HD12 LEU A 165 9.522 2.633 0.955 1.00 0.00 H ATOM 2453 HD13 LEU A 165 8.454 1.244 0.640 1.00 0.00 H ATOM 2454 H LEU A 165 14.293 1.594 2.303 1.00 0.00 H ATOM 2455 N VAL A 166 12.858 -1.482 2.931 1.00 15.42 N ATOM 2456 CA VAL A 166 12.570 -2.879 3.287 1.00 17.22 C ATOM 2457 C VAL A 166 12.485 -3.030 4.804 1.00 18.49 C ATOM 2458 O VAL A 166 11.552 -3.659 5.301 1.00 22.71 O ATOM 2459 CB VAL A 166 13.552 -3.889 2.633 1.00 22.32 C ATOM 2460 CG1 VAL A 166 13.319 -5.321 3.172 1.00 23.76 C ATOM 2461 CG2 VAL A 166 13.389 -3.871 1.106 1.00 19.81 C ATOM 2462 HA VAL A 166 11.595 -3.133 2.870 1.00 0.00 H ATOM 2463 HB VAL A 166 14.568 -3.588 2.890 1.00 0.00 H ATOM 2464 HG11 VAL A 166 13.474 -5.331 4.251 1.00 0.00 H ATOM 2465 HG12 VAL A 166 12.298 -5.631 2.947 1.00 0.00 H ATOM 2466 HG13 VAL A 166 14.021 -6.006 2.696 1.00 0.00 H ATOM 2467 HG21 VAL A 166 12.367 -4.147 0.848 1.00 0.00 H ATOM 2468 HG22 VAL A 166 13.602 -2.870 0.731 1.00 0.00 H ATOM 2469 HG23 VAL A 166 14.083 -4.583 0.659 1.00 0.00 H ATOM 2470 H VAL A 166 13.730 -1.241 2.418 1.00 0.00 H ATOM 2471 N LEU A 167 13.430 -2.424 5.536 1.00 15.18 N ATOM 2472 CA LEU A 167 13.449 -2.521 7.005 1.00 19.77 C ATOM 2473 C LEU A 167 12.273 -1.814 7.617 1.00 19.65 C ATOM 2474 O LEU A 167 11.700 -2.263 8.611 1.00 22.19 O ATOM 2475 CB LEU A 167 14.769 -2.022 7.590 1.00 23.86 C ATOM 2476 CG LEU A 167 15.942 -2.997 7.312 1.00 22.82 C ATOM 2477 CD1 LEU A 167 17.244 -2.238 7.335 1.00 21.11 C ATOM 2478 CD2 LEU A 167 15.985 -4.172 8.274 1.00 19.93 C ATOM 2479 HA LEU A 167 13.365 -3.578 7.259 1.00 0.00 H ATOM 2480 HB2 LEU A 167 15.005 -1.054 7.148 1.00 0.00 H ATOM 2481 HB3 LEU A 167 14.655 -1.909 8.668 1.00 0.00 H ATOM 2482 HG LEU A 167 15.780 -3.426 6.323 1.00 0.00 H ATOM 2483 HD21 LEU A 167 16.098 -3.802 9.293 1.00 0.00 H ATOM 2484 HD22 LEU A 167 15.058 -4.740 8.194 1.00 0.00 H ATOM 2485 HD23 LEU A 167 16.829 -4.814 8.023 1.00 0.00 H ATOM 2486 HD11 LEU A 167 17.225 -1.464 6.568 1.00 0.00 H ATOM 2487 HD12 LEU A 167 17.378 -1.778 8.314 1.00 0.00 H ATOM 2488 HD13 LEU A 167 18.067 -2.925 7.139 1.00 0.00 H ATOM 2489 H LEU A 167 14.168 -1.872 5.055 1.00 0.00 H ATOM 2490 N ILE A 168 11.848 -0.734 6.989 1.00 22.40 N ATOM 2491 CA ILE A 168 10.631 -0.102 7.453 1.00 19.43 C ATOM 2492 C ILE A 168 9.385 -0.997 7.306 1.00 20.00 C ATOM 2493 O ILE A 168 8.518 -1.015 8.165 1.00 24.42 O ATOM 2494 CB ILE A 168 10.445 1.294 6.851 1.00 15.84 C ATOM 2495 CG1 ILE A 168 11.424 2.263 7.530 1.00 21.02 C ATOM 2496 CG2 ILE A 168 9.013 1.779 7.116 1.00 15.32 C ATOM 2497 CD1 ILE A 168 11.936 3.353 6.556 1.00 31.94 C ATOM 2498 HA ILE A 168 10.750 0.039 8.527 1.00 0.00 H ATOM 2499 HB ILE A 168 10.630 1.256 5.778 1.00 0.00 H ATOM 2500 HG12 ILE A 168 10.917 2.747 8.365 1.00 0.00 H ATOM 2501 HG13 ILE A 168 12.277 1.697 7.904 1.00 0.00 H ATOM 2502 HD11 ILE A 168 12.451 2.879 5.721 1.00 0.00 H ATOM 2503 HD12 ILE A 168 11.091 3.931 6.182 1.00 0.00 H ATOM 2504 HD13 ILE A 168 12.625 4.014 7.082 1.00 0.00 H ATOM 2505 HG21 ILE A 168 8.306 1.088 6.657 1.00 0.00 H ATOM 2506 HG22 ILE A 168 8.838 1.820 8.191 1.00 0.00 H ATOM 2507 HG23 ILE A 168 8.882 2.772 6.687 1.00 0.00 H ATOM 2508 H ILE A 168 12.375 -0.346 6.180 1.00 0.00 H ATOM 2509 N ARG A 169 9.301 -1.751 6.221 1.00 25.70 N ATOM 2510 CA ARG A 169 8.186 -2.661 6.042 1.00 23.00 C ATOM 2511 C ARG A 169 8.292 -3.736 7.126 1.00 21.01 C ATOM 2512 O ARG A 169 7.282 -4.253 7.586 1.00 27.83 O ATOM 2513 CB ARG A 169 8.233 -3.267 4.636 1.00 25.19 C ATOM 2514 CG ARG A 169 7.994 -2.300 3.443 1.00 29.55 C ATOM 2515 CD ARG A 169 7.571 -3.092 2.181 1.00 26.30 C ATOM 2516 NE ARG A 169 7.573 -2.262 0.982 1.00 34.21 N ATOM 2517 CZ ARG A 169 6.544 -1.513 0.545 1.00 36.84 C ATOM 2518 NH1 ARG A 169 5.363 -1.476 1.199 1.00 24.56 N ATOM 2519 NH2 ARG A 169 6.716 -0.773 -0.553 1.00 33.32 N ATOM 2520 HA ARG A 169 7.231 -2.144 6.137 1.00 0.00 H ATOM 2521 HB2 ARG A 169 9.217 -3.716 4.504 1.00 0.00 H ATOM 2522 HB3 ARG A 169 7.471 -4.045 4.587 1.00 0.00 H ATOM 2523 HG2 ARG A 169 7.206 -1.594 3.705 1.00 0.00 H ATOM 2524 HG3 ARG A 169 8.914 -1.754 3.233 1.00 0.00 H ATOM 2525 HD2 ARG A 169 6.566 -3.486 2.334 1.00 0.00 H ATOM 2526 HD3 ARG A 169 8.266 -3.919 2.036 1.00 0.00 H ATOM 2527 HE ARG A 169 8.445 -2.248 0.416 1.00 0.00 H ATOM 2528 HH12 ARG A 169 4.586 -0.887 0.836 1.00 0.00 H ATOM 2529 HH11 ARG A 169 5.230 -2.036 2.065 1.00 0.00 H ATOM 2530 HH22 ARG A 169 5.936 -0.185 -0.911 1.00 0.00 H ATOM 2531 HH21 ARG A 169 7.630 -0.784 -1.050 1.00 0.00 H ATOM 2532 H ARG A 169 10.040 -1.690 5.492 1.00 0.00 H ATOM 2533 N GLN A 170 9.523 -4.094 7.501 1.00 21.13 N ATOM 2534 CA GLN A 170 9.769 -5.025 8.615 1.00 23.31 C ATOM 2535 C GLN A 170 9.304 -4.476 9.948 1.00 23.83 C ATOM 2536 O GLN A 170 8.601 -5.169 10.659 1.00 23.44 O ATOM 2537 CB GLN A 170 11.226 -5.466 8.703 1.00 15.21 C ATOM 2538 CG GLN A 170 11.555 -6.318 7.545 1.00 22.21 C ATOM 2539 CD GLN A 170 12.939 -6.884 7.575 1.00 19.61 C ATOM 2540 OE1 GLN A 170 13.734 -6.647 8.478 1.00 23.51 O ATOM 2541 NE2 GLN A 170 13.229 -7.681 6.582 1.00 23.88 N ATOM 2542 HA GLN A 170 9.168 -5.906 8.389 1.00 0.00 H ATOM 2543 HB2 GLN A 170 11.872 -4.588 8.703 1.00 0.00 H ATOM 2544 HB3 GLN A 170 11.380 -6.029 9.624 1.00 0.00 H ATOM 2545 HG2 GLN A 170 10.847 -7.146 7.517 1.00 0.00 H ATOM 2546 HG3 GLN A 170 11.449 -5.721 6.639 1.00 0.00 H ATOM 2547 HE22 GLN A 170 12.528 -7.857 5.835 1.00 0.00 H ATOM 2548 HE21 GLN A 170 14.161 -8.140 6.539 1.00 0.00 H ATOM 2549 H GLN A 170 10.337 -3.701 6.987 1.00 0.00 H ATOM 2550 N LEU A 171 9.705 -3.242 10.271 1.00 20.45 N ATOM 2551 CA LEU A 171 9.282 -2.596 11.501 1.00 20.38 C ATOM 2552 C LEU A 171 7.749 -2.625 11.591 1.00 20.32 C ATOM 2553 O LEU A 171 7.159 -3.062 12.588 1.00 22.31 O ATOM 2554 CB LEU A 171 9.809 -1.171 11.504 1.00 19.19 C ATOM 2555 CG LEU A 171 9.213 -0.196 12.506 1.00 22.38 C ATOM 2556 CD1 LEU A 171 9.879 -0.358 13.867 1.00 19.84 C ATOM 2557 CD2 LEU A 171 9.285 1.251 12.001 1.00 13.50 C ATOM 2558 HA LEU A 171 9.680 -3.120 12.370 1.00 0.00 H ATOM 2559 HB2 LEU A 171 10.881 -1.221 11.697 1.00 0.00 H ATOM 2560 HB3 LEU A 171 9.639 -0.759 10.509 1.00 0.00 H ATOM 2561 HG LEU A 171 8.155 -0.432 12.621 1.00 0.00 H ATOM 2562 HD21 LEU A 171 10.327 1.524 11.833 1.00 0.00 H ATOM 2563 HD22 LEU A 171 8.730 1.336 11.067 1.00 0.00 H ATOM 2564 HD23 LEU A 171 8.849 1.917 12.746 1.00 0.00 H ATOM 2565 HD11 LEU A 171 9.725 -1.375 14.227 1.00 0.00 H ATOM 2566 HD12 LEU A 171 10.947 -0.162 13.773 1.00 0.00 H ATOM 2567 HD13 LEU A 171 9.439 0.348 14.572 1.00 0.00 H ATOM 2568 H LEU A 171 10.338 -2.730 9.623 1.00 0.00 H ATOM 2569 N VAL A 172 7.114 -2.201 10.508 1.00 22.96 N ATOM 2570 CA VAL A 172 5.674 -2.065 10.457 1.00 19.36 C ATOM 2571 C VAL A 172 4.943 -3.391 10.659 1.00 26.94 C ATOM 2572 O VAL A 172 4.051 -3.453 11.527 1.00 25.63 O ATOM 2573 CB VAL A 172 5.254 -1.244 9.233 1.00 22.73 C ATOM 2574 CG1 VAL A 172 3.722 -1.301 8.989 1.00 20.81 C ATOM 2575 CG2 VAL A 172 5.692 0.224 9.470 1.00 20.85 C ATOM 2576 HA VAL A 172 5.344 -1.484 11.318 1.00 0.00 H ATOM 2577 HB VAL A 172 5.734 -1.661 8.348 1.00 0.00 H ATOM 2578 HG11 VAL A 172 3.420 -2.335 8.825 1.00 0.00 H ATOM 2579 HG12 VAL A 172 3.202 -0.903 9.860 1.00 0.00 H ATOM 2580 HG13 VAL A 172 3.473 -0.704 8.111 1.00 0.00 H ATOM 2581 HG21 VAL A 172 5.205 0.607 10.367 1.00 0.00 H ATOM 2582 HG22 VAL A 172 6.774 0.263 9.598 1.00 0.00 H ATOM 2583 HG23 VAL A 172 5.404 0.831 8.611 1.00 0.00 H ATOM 2584 H VAL A 172 7.671 -1.957 9.664 1.00 0.00 H ATOM 2585 N ALA A 173 5.361 -4.449 9.936 1.00 25.66 N ATOM 2586 CA ALA A 173 4.776 -5.808 10.097 1.00 21.60 C ATOM 2587 C ALA A 173 5.028 -6.370 11.471 1.00 19.53 C ATOM 2588 O ALA A 173 4.107 -6.801 12.134 1.00 19.63 O ATOM 2589 CB ALA A 173 5.347 -6.811 9.044 1.00 12.07 C ATOM 2590 HA ALA A 173 3.703 -5.690 9.946 1.00 0.00 H ATOM 2591 HB1 ALA A 173 5.115 -6.454 8.041 1.00 0.00 H ATOM 2592 HB2 ALA A 173 6.428 -6.886 9.164 1.00 0.00 H ATOM 2593 HB3 ALA A 173 4.895 -7.791 9.195 1.00 0.00 H ATOM 2594 H ALA A 173 6.121 -4.310 9.240 1.00 0.00 H ATOM 2595 N ASP A 174 6.304 -6.420 11.845 1.00 22.11 N ATOM 2596 CA ASP A 174 6.788 -6.979 13.125 1.00 19.37 C ATOM 2597 C ASP A 174 6.136 -6.348 14.369 1.00 21.85 C ATOM 2598 O ASP A 174 5.893 -7.036 15.345 1.00 24.18 O ATOM 2599 CB ASP A 174 8.328 -6.818 13.232 1.00 17.42 C ATOM 2600 CG ASP A 174 9.111 -7.634 12.182 1.00 20.39 C ATOM 2601 OD1 ASP A 174 8.528 -8.406 11.427 1.00 24.94 O ATOM 2602 OD2 ASP A 174 10.335 -7.532 12.113 1.00 23.98 O ATOM 2603 HA ASP A 174 6.503 -8.031 13.112 1.00 0.00 H ATOM 2604 HB2 ASP A 174 8.574 -5.764 13.103 1.00 0.00 H ATOM 2605 HB3 ASP A 174 8.640 -7.144 14.224 1.00 0.00 H ATOM 2606 H ASP A 174 7.014 -6.037 11.188 1.00 0.00 H ATOM 2607 N PHE A 175 5.878 -5.035 14.342 1.00 27.10 N ATOM 2608 CA PHE A 175 5.253 -4.349 15.474 1.00 21.81 C ATOM 2609 C PHE A 175 3.771 -4.088 15.321 1.00 28.10 C ATOM 2610 O PHE A 175 3.179 -3.354 16.149 1.00 21.65 O ATOM 2611 CB PHE A 175 5.973 -3.030 15.797 1.00 23.26 C ATOM 2612 CG PHE A 175 7.360 -3.228 16.379 1.00 25.18 C ATOM 2613 CD1 PHE A 175 7.781 -4.490 16.831 1.00 20.55 C ATOM 2614 CD2 PHE A 175 8.233 -2.169 16.482 1.00 16.97 C ATOM 2615 CE1 PHE A 175 9.039 -4.668 17.375 1.00 22.87 C ATOM 2616 CE2 PHE A 175 9.491 -2.338 17.025 1.00 20.01 C ATOM 2617 CZ PHE A 175 9.906 -3.587 17.480 1.00 17.37 C ATOM 2618 HA PHE A 175 5.358 -5.050 16.302 1.00 0.00 H ATOM 2619 HB2 PHE A 175 6.063 -2.451 14.878 1.00 0.00 H ATOM 2620 HB3 PHE A 175 5.372 -2.475 16.517 1.00 0.00 H ATOM 2621 HD2 PHE A 175 7.927 -1.184 16.130 1.00 0.00 H ATOM 2622 HE2 PHE A 175 10.166 -1.485 17.098 1.00 0.00 H ATOM 2623 HZ PHE A 175 10.898 -3.715 17.913 1.00 0.00 H ATOM 2624 HE1 PHE A 175 9.350 -5.654 17.721 1.00 0.00 H ATOM 2625 HD1 PHE A 175 7.105 -5.342 16.751 1.00 0.00 H ATOM 2626 H PHE A 175 6.128 -4.487 13.494 1.00 0.00 H ATOM 2627 N ASN A 176 3.170 -4.689 14.282 1.00 27.53 N ATOM 2628 CA ASN A 176 1.727 -4.563 14.018 1.00 22.94 C ATOM 2629 C ASN A 176 1.250 -3.116 13.866 1.00 24.40 C ATOM 2630 O ASN A 176 0.215 -2.752 14.417 1.00 32.55 O ATOM 2631 CB ASN A 176 0.939 -5.190 15.163 1.00 18.43 C ATOM 2632 CG ASN A 176 1.218 -6.662 15.319 1.00 22.58 C ATOM 2633 OD1 ASN A 176 2.091 -7.054 16.096 1.00 22.54 O ATOM 2634 ND2 ASN A 176 0.491 -7.502 14.551 1.00 15.33 N ATOM 2635 HA ASN A 176 1.554 -5.074 13.071 1.00 0.00 H ATOM 2636 HB2 ASN A 176 1.207 -4.683 16.090 1.00 0.00 H ATOM 2637 HB3 ASN A 176 -0.125 -5.054 14.970 1.00 0.00 H ATOM 2638 HD22 ASN A 176 -0.235 -7.123 13.910 1.00 0.00 H ATOM 2639 HD21 ASN A 176 0.657 -8.527 14.601 1.00 0.00 H ATOM 2640 H ASN A 176 3.747 -5.267 13.638 1.00 0.00 H ATOM 2641 N LEU A 177 1.980 -2.282 13.146 1.00 25.93 N ATOM 2642 CA LEU A 177 1.598 -0.859 13.066 1.00 24.76 C ATOM 2643 C LEU A 177 0.485 -0.650 12.057 1.00 25.36 C ATOM 2644 O LEU A 177 0.536 -1.155 10.910 1.00 23.06 O ATOM 2645 CB LEU A 177 2.801 0.014 12.740 1.00 23.71 C ATOM 2646 CG LEU A 177 4.028 -0.221 13.655 1.00 25.66 C ATOM 2647 CD1 LEU A 177 5.186 0.649 13.256 1.00 18.18 C ATOM 2648 CD2 LEU A 177 3.719 0.039 15.091 1.00 26.22 C ATOM 2649 HA LEU A 177 1.224 -0.559 14.045 1.00 0.00 H ATOM 2650 HB2 LEU A 177 3.099 -0.186 11.711 1.00 0.00 H ATOM 2651 HB3 LEU A 177 2.501 1.058 12.833 1.00 0.00 H ATOM 2652 HG LEU A 177 4.293 -1.271 13.532 1.00 0.00 H ATOM 2653 HD21 LEU A 177 3.400 1.074 15.211 1.00 0.00 H ATOM 2654 HD22 LEU A 177 2.921 -0.628 15.416 1.00 0.00 H ATOM 2655 HD23 LEU A 177 4.611 -0.140 15.691 1.00 0.00 H ATOM 2656 HD11 LEU A 177 5.472 0.422 12.229 1.00 0.00 H ATOM 2657 HD12 LEU A 177 4.894 1.697 13.331 1.00 0.00 H ATOM 2658 HD13 LEU A 177 6.029 0.457 13.920 1.00 0.00 H ATOM 2659 H LEU A 177 2.820 -2.627 12.638 1.00 0.00 H ATOM 2660 N ASP A 178 -0.553 0.063 12.483 1.00 33.31 N ATOM 2661 CA ASP A 178 -1.682 0.317 11.580 1.00 38.70 C ATOM 2662 C ASP A 178 -1.356 1.531 10.740 1.00 37.42 C ATOM 2663 O ASP A 178 -1.869 2.628 10.984 1.00 43.03 O ATOM 2664 CB ASP A 178 -3.025 0.487 12.303 1.00 41.22 C ATOM 2665 CG ASP A 178 -4.224 0.173 11.367 1.00 52.31 C ATOM 2666 OD1 ASP A 178 -4.014 -0.553 10.355 1.00 55.81 O ATOM 2667 OD2 ASP A 178 -5.363 0.643 11.627 1.00 50.69 O ATOM 2668 HA ASP A 178 -1.812 -0.563 10.950 1.00 0.00 H ATOM 2669 HB2 ASP A 178 -3.056 -0.190 13.156 1.00 0.00 H ATOM 2670 HB3 ASP A 178 -3.110 1.515 12.654 1.00 0.00 H ATOM 2671 H ASP A 178 -0.565 0.439 13.452 1.00 0.00 H ATOM 2672 N VAL A 179 -0.479 1.326 9.775 1.00 32.55 N ATOM 2673 CA VAL A 179 -0.072 2.296 8.788 1.00 33.29 C ATOM 2674 C VAL A 179 0.286 1.539 7.540 1.00 26.34 C ATOM 2675 O VAL A 179 0.837 0.505 7.603 1.00 24.21 O ATOM 2676 CB VAL A 179 1.138 3.157 9.253 1.00 29.20 C ATOM 2677 CG1 VAL A 179 2.247 2.309 9.677 1.00 30.32 C ATOM 2678 CG2 VAL A 179 1.579 4.088 8.202 1.00 21.56 C ATOM 2679 HA VAL A 179 -0.893 2.993 8.617 1.00 0.00 H ATOM 2680 HB VAL A 179 0.805 3.749 10.105 1.00 0.00 H ATOM 2681 HG11 VAL A 179 1.925 1.679 10.506 1.00 0.00 H ATOM 2682 HG12 VAL A 179 2.562 1.681 8.843 1.00 0.00 H ATOM 2683 HG13 VAL A 179 3.080 2.935 9.997 1.00 0.00 H ATOM 2684 HG21 VAL A 179 1.878 3.522 7.320 1.00 0.00 H ATOM 2685 HG22 VAL A 179 0.759 4.758 7.945 1.00 0.00 H ATOM 2686 HG23 VAL A 179 2.425 4.671 8.566 1.00 0.00 H ATOM 2687 H VAL A 179 -0.044 0.383 9.722 1.00 0.00 H ATOM 2688 N ALA A 180 -0.031 2.094 6.403 1.00 26.06 N ATOM 2689 CA ALA A 180 0.410 1.521 5.130 1.00 28.04 C ATOM 2690 C ALA A 180 1.687 2.216 4.612 1.00 28.87 C ATOM 2691 O ALA A 180 1.802 3.471 4.552 1.00 26.90 O ATOM 2692 CB ALA A 180 -0.719 1.634 4.091 1.00 29.89 C ATOM 2693 HA ALA A 180 0.649 0.470 5.292 1.00 0.00 H ATOM 2694 HB1 ALA A 180 -1.595 1.092 4.448 1.00 0.00 H ATOM 2695 HB2 ALA A 180 -0.974 2.684 3.946 1.00 0.00 H ATOM 2696 HB3 ALA A 180 -0.385 1.206 3.146 1.00 0.00 H ATOM 2697 H ALA A 180 -0.608 2.959 6.401 1.00 0.00 H ATOM 2698 N VAL A 181 2.644 1.390 4.216 1.00 26.54 N ATOM 2699 CA VAL A 181 3.903 1.888 3.721 1.00 20.95 C ATOM 2700 C VAL A 181 3.888 1.954 2.183 1.00 27.45 C ATOM 2701 O VAL A 181 3.748 0.904 1.490 1.00 22.63 O ATOM 2702 CB VAL A 181 5.089 1.048 4.213 1.00 15.45 C ATOM 2703 CG1 VAL A 181 6.364 1.578 3.626 1.00 7.39 C ATOM 2704 CG2 VAL A 181 5.109 0.968 5.725 1.00 14.19 C ATOM 2705 HA VAL A 181 4.033 2.895 4.118 1.00 0.00 H ATOM 2706 HB VAL A 181 4.980 0.021 3.866 1.00 0.00 H ATOM 2707 HG11 VAL A 181 6.311 1.526 2.539 1.00 0.00 H ATOM 2708 HG12 VAL A 181 6.502 2.614 3.935 1.00 0.00 H ATOM 2709 HG13 VAL A 181 7.202 0.977 3.979 1.00 0.00 H ATOM 2710 HG21 VAL A 181 5.196 1.972 6.140 1.00 0.00 H ATOM 2711 HG22 VAL A 181 4.185 0.508 6.075 1.00 0.00 H ATOM 2712 HG23 VAL A 181 5.960 0.367 6.045 1.00 0.00 H ATOM 2713 H VAL A 181 2.484 0.363 4.263 1.00 0.00 H ATOM 2714 N VAL A 182 4.053 3.185 1.669 1.00 23.86 N ATOM 2715 CA VAL A 182 4.062 3.452 0.230 1.00 27.43 C ATOM 2716 C VAL A 182 5.491 3.688 -0.242 1.00 31.89 C ATOM 2717 O VAL A 182 6.042 4.756 0.061 1.00 31.46 O ATOM 2718 CB VAL A 182 3.144 4.664 -0.138 1.00 25.05 C ATOM 2719 CG1 VAL A 182 3.097 4.887 -1.646 1.00 23.42 C ATOM 2720 CG2 VAL A 182 1.735 4.426 0.389 1.00 22.67 C ATOM 2721 HA VAL A 182 3.659 2.578 -0.282 1.00 0.00 H ATOM 2722 HB VAL A 182 3.564 5.557 0.326 1.00 0.00 H ATOM 2723 HG11 VAL A 182 4.103 5.089 -2.014 1.00 0.00 H ATOM 2724 HG12 VAL A 182 2.704 3.994 -2.132 1.00 0.00 H ATOM 2725 HG13 VAL A 182 2.450 5.736 -1.866 1.00 0.00 H ATOM 2726 HG21 VAL A 182 1.330 3.518 -0.058 1.00 0.00 H ATOM 2727 HG22 VAL A 182 1.768 4.315 1.473 1.00 0.00 H ATOM 2728 HG23 VAL A 182 1.103 5.275 0.128 1.00 0.00 H ATOM 2729 H VAL A 182 4.180 3.983 2.323 1.00 0.00 H ATOM 2730 N GLY A 183 6.089 2.686 -0.939 1.00 26.71 N ATOM 2731 CA GLY A 183 7.341 2.884 -1.701 1.00 18.18 C ATOM 2732 C GLY A 183 7.127 3.729 -2.957 1.00 19.58 C ATOM 2733 O GLY A 183 6.168 3.486 -3.690 1.00 32.10 O ATOM 2734 HA3 GLY A 183 7.730 1.910 -1.996 1.00 0.00 H ATOM 2735 HA2 GLY A 183 8.066 3.385 -1.060 1.00 0.00 H ATOM 2736 H GLY A 183 5.649 1.744 -0.936 1.00 0.00 H ATOM 2737 N VAL A 184 7.963 4.738 -3.208 1.00 24.12 N ATOM 2738 CA VAL A 184 7.794 5.638 -4.378 1.00 23.56 C ATOM 2739 C VAL A 184 9.054 5.589 -5.288 1.00 30.42 C ATOM 2740 O VAL A 184 10.186 5.649 -4.786 1.00 28.29 O ATOM 2741 CB VAL A 184 7.385 7.063 -3.961 1.00 23.97 C ATOM 2742 CG1 VAL A 184 7.197 8.049 -5.184 1.00 21.73 C ATOM 2743 CG2 VAL A 184 6.119 7.004 -3.226 1.00 18.33 C ATOM 2744 HA VAL A 184 6.960 5.273 -4.977 1.00 0.00 H ATOM 2745 HB VAL A 184 8.198 7.451 -3.347 1.00 0.00 H ATOM 2746 HG11 VAL A 184 8.135 8.126 -5.735 1.00 0.00 H ATOM 2747 HG12 VAL A 184 6.418 7.665 -5.842 1.00 0.00 H ATOM 2748 HG13 VAL A 184 6.909 9.033 -4.815 1.00 0.00 H ATOM 2749 HG21 VAL A 184 5.349 6.574 -3.866 1.00 0.00 H ATOM 2750 HG22 VAL A 184 6.244 6.384 -2.338 1.00 0.00 H ATOM 2751 HG23 VAL A 184 5.826 8.011 -2.929 1.00 0.00 H ATOM 2752 H VAL A 184 8.761 4.900 -2.562 1.00 0.00 H ATOM 2753 N PRO A 185 8.854 5.383 -6.623 1.00 28.49 N ATOM 2754 CA PRO A 185 10.026 5.177 -7.483 1.00 30.67 C ATOM 2755 C PRO A 185 11.032 6.331 -7.434 1.00 30.55 C ATOM 2756 O PRO A 185 10.666 7.472 -7.130 1.00 31.84 O ATOM 2757 CB PRO A 185 9.418 4.951 -8.880 1.00 30.31 C ATOM 2758 CG PRO A 185 7.958 4.367 -8.587 1.00 29.22 C ATOM 2759 CD PRO A 185 7.582 5.219 -7.363 1.00 32.10 C ATOM 2760 HA PRO A 185 10.632 4.332 -7.156 1.00 0.00 H ATOM 2761 HD3 PRO A 185 7.188 6.187 -7.673 1.00 0.00 H ATOM 2762 HD2 PRO A 185 6.841 4.707 -6.749 1.00 0.00 H ATOM 2763 HG3 PRO A 185 7.986 3.304 -8.349 1.00 0.00 H ATOM 2764 HG2 PRO A 185 7.278 4.534 -9.423 1.00 0.00 H ATOM 2765 HB2 PRO A 185 9.355 5.890 -9.430 1.00 0.00 H ATOM 2766 HB3 PRO A 185 10.013 4.237 -9.449 1.00 0.00 H ATOM 2767 N THR A 186 12.291 6.024 -7.706 1.00 26.62 N ATOM 2768 CA THR A 186 13.371 7.024 -7.662 1.00 27.23 C ATOM 2769 C THR A 186 13.218 8.093 -8.761 1.00 28.00 C ATOM 2770 O THR A 186 12.900 7.764 -9.917 1.00 23.11 O ATOM 2771 CB THR A 186 14.658 6.288 -7.884 1.00 26.76 C ATOM 2772 OG1 THR A 186 14.740 5.241 -6.906 1.00 38.49 O ATOM 2773 CG2 THR A 186 15.807 7.162 -7.746 1.00 24.09 C ATOM 2774 HA THR A 186 13.343 7.538 -6.701 1.00 0.00 H ATOM 2775 HB THR A 186 14.668 5.889 -8.898 1.00 0.00 H ATOM 2776 HG1 THR A 186 13.970 4.628 -7.015 1.00 0.00 H ATOM 2777 HG23 THR A 186 15.747 7.958 -8.488 1.00 0.00 H ATOM 2778 HG21 THR A 186 15.814 7.595 -6.746 1.00 0.00 H ATOM 2779 HG22 THR A 186 16.720 6.587 -7.901 1.00 0.00 H ATOM 2780 H THR A 186 12.525 5.043 -7.959 1.00 0.00 H ATOM 2781 N VAL A 187 13.453 9.355 -8.403 1.00 29.36 N ATOM 2782 CA VAL A 187 13.454 10.445 -9.385 1.00 31.90 C ATOM 2783 C VAL A 187 14.873 10.637 -9.884 1.00 31.19 C ATOM 2784 O VAL A 187 15.816 10.675 -9.092 1.00 25.81 O ATOM 2785 CB VAL A 187 12.817 11.812 -8.882 1.00 30.45 C ATOM 2786 CG1 VAL A 187 12.626 12.799 -10.079 1.00 33.27 C ATOM 2787 CG2 VAL A 187 11.477 11.577 -8.212 1.00 27.77 C ATOM 2788 HA VAL A 187 12.793 10.144 -10.197 1.00 0.00 H ATOM 2789 HB VAL A 187 13.503 12.247 -8.156 1.00 0.00 H ATOM 2790 HG11 VAL A 187 13.594 13.005 -10.536 1.00 0.00 H ATOM 2791 HG12 VAL A 187 11.963 12.349 -10.817 1.00 0.00 H ATOM 2792 HG13 VAL A 187 12.189 13.729 -9.715 1.00 0.00 H ATOM 2793 HG21 VAL A 187 10.793 11.114 -8.923 1.00 0.00 H ATOM 2794 HG22 VAL A 187 11.612 10.918 -7.354 1.00 0.00 H ATOM 2795 HG23 VAL A 187 11.067 12.530 -7.879 1.00 0.00 H ATOM 2796 H VAL A 187 13.640 9.572 -7.403 1.00 0.00 H ATOM 2797 N ARG A 188 15.013 10.766 -11.203 1.00 29.55 N ATOM 2798 CA ARG A 188 16.347 10.807 -11.785 1.00 32.88 C ATOM 2799 C ARG A 188 16.569 12.100 -12.564 1.00 31.83 C ATOM 2800 O ARG A 188 15.604 12.714 -13.081 1.00 28.03 O ATOM 2801 CB ARG A 188 16.599 9.581 -12.678 1.00 32.55 C ATOM 2802 CG ARG A 188 16.252 8.281 -12.006 1.00 32.34 C ATOM 2803 CD ARG A 188 16.608 7.078 -12.852 1.00 20.53 C ATOM 2804 NE ARG A 188 16.461 5.905 -12.009 1.00 23.49 N ATOM 2805 CZ ARG A 188 17.444 5.300 -11.343 1.00 31.77 C ATOM 2806 NH1 ARG A 188 18.694 5.751 -11.421 1.00 30.78 N ATOM 2807 NH2 ARG A 188 17.170 4.219 -10.597 1.00 34.33 N ATOM 2808 HA ARG A 188 17.066 10.781 -10.966 1.00 0.00 H ATOM 2809 HB2 ARG A 188 15.994 9.678 -13.580 1.00 0.00 H ATOM 2810 HB3 ARG A 188 17.654 9.560 -12.950 1.00 0.00 H ATOM 2811 HG2 ARG A 188 16.795 8.219 -11.063 1.00 0.00 H ATOM 2812 HG3 ARG A 188 15.180 8.265 -11.808 1.00 0.00 H ATOM 2813 HD2 ARG A 188 17.636 7.159 -13.204 1.00 0.00 H ATOM 2814 HD3 ARG A 188 15.936 7.010 -13.708 1.00 0.00 H ATOM 2815 HE ARG A 188 15.507 5.502 -11.917 1.00 0.00 H ATOM 2816 HH12 ARG A 188 19.454 5.271 -10.897 1.00 0.00 H ATOM 2817 HH11 ARG A 188 18.911 6.583 -12.006 1.00 0.00 H ATOM 2818 HH22 ARG A 188 17.932 3.741 -10.074 1.00 0.00 H ATOM 2819 HH21 ARG A 188 16.196 3.859 -10.541 1.00 0.00 H ATOM 2820 H ARG A 188 14.174 10.837 -11.813 1.00 0.00 H ATOM 2821 N GLU A 189 17.814 12.508 -12.646 1.00 26.25 N ATOM 2822 CA GLU A 189 18.180 13.591 -13.488 1.00 34.47 C ATOM 2823 C GLU A 189 17.951 13.096 -14.891 1.00 37.80 C ATOM 2824 O GLU A 189 17.690 11.943 -15.083 1.00 37.15 O ATOM 2825 CB GLU A 189 19.621 14.026 -13.263 1.00 32.48 C ATOM 2826 CG GLU A 189 19.976 14.493 -11.883 1.00 35.07 C ATOM 2827 CD GLU A 189 19.448 15.856 -11.521 1.00 41.56 C ATOM 2828 OE1 GLU A 189 18.522 16.351 -12.140 1.00 46.89 O ATOM 2829 OE2 GLU A 189 19.960 16.445 -10.596 1.00 42.75 O ATOM 2830 HA GLU A 189 17.587 14.481 -13.277 1.00 0.00 H ATOM 2831 HB2 GLU A 189 20.263 13.178 -13.500 1.00 0.00 H ATOM 2832 HB3 GLU A 189 19.831 14.843 -13.953 1.00 0.00 H ATOM 2833 HG2 GLU A 189 19.576 13.774 -11.168 1.00 0.00 H ATOM 2834 HG3 GLU A 189 21.063 14.518 -11.802 1.00 0.00 H ATOM 2835 H GLU A 189 18.546 12.029 -12.084 1.00 0.00 H ATOM 2836 N ALA A 190 18.028 13.980 -15.859 1.00 37.46 N ATOM 2837 CA ALA A 190 17.765 13.641 -17.237 1.00 41.40 C ATOM 2838 C ALA A 190 18.748 12.659 -17.843 1.00 39.49 C ATOM 2839 O ALA A 190 18.437 11.993 -18.799 1.00 40.13 O ATOM 2840 CB ALA A 190 17.658 14.890 -18.077 1.00 41.37 C ATOM 2841 HA ALA A 190 16.808 13.119 -17.235 1.00 0.00 H ATOM 2842 HB1 ALA A 190 16.843 15.510 -17.702 1.00 0.00 H ATOM 2843 HB2 ALA A 190 18.594 15.445 -18.021 1.00 0.00 H ATOM 2844 HB3 ALA A 190 17.460 14.614 -19.113 1.00 0.00 H ATOM 2845 H ALA A 190 18.288 14.959 -15.624 1.00 0.00 H ATOM 2846 N ASP A 191 19.911 12.540 -17.240 1.00 34.49 N ATOM 2847 CA ASP A 191 20.817 11.490 -17.615 1.00 32.14 C ATOM 2848 C ASP A 191 20.682 10.172 -16.867 1.00 32.52 C ATOM 2849 O ASP A 191 21.420 9.277 -17.119 1.00 29.67 O ATOM 2850 CB ASP A 191 22.262 11.965 -17.613 1.00 32.38 C ATOM 2851 CG ASP A 191 22.822 12.182 -16.253 1.00 37.22 C ATOM 2852 OD1 ASP A 191 22.081 12.400 -15.316 1.00 41.42 O ATOM 2853 OD2 ASP A 191 24.037 12.156 -16.119 1.00 42.72 O ATOM 2854 HA ASP A 191 20.506 11.251 -18.632 1.00 0.00 H ATOM 2855 HB2 ASP A 191 22.871 11.216 -18.120 1.00 0.00 H ATOM 2856 HB3 ASP A 191 22.315 12.906 -18.161 1.00 0.00 H ATOM 2857 H ASP A 191 20.176 13.209 -16.489 1.00 0.00 H ATOM 2858 N GLY A 192 19.741 10.067 -15.955 1.00 31.10 N ATOM 2859 CA GLY A 192 19.616 8.853 -15.104 1.00 29.29 C ATOM 2860 C GLY A 192 20.137 8.885 -13.648 1.00 33.03 C ATOM 2861 O GLY A 192 19.739 8.047 -12.824 1.00 29.96 O ATOM 2862 HA3 GLY A 192 20.150 8.052 -15.614 1.00 0.00 H ATOM 2863 HA2 GLY A 192 18.555 8.607 -15.056 1.00 0.00 H ATOM 2864 H GLY A 192 19.069 10.850 -15.825 1.00 0.00 H ATOM 2865 N LEU A 193 21.036 9.817 -13.316 1.00 36.44 N ATOM 2866 CA LEU A 193 21.547 9.953 -11.926 1.00 35.07 C ATOM 2867 C LEU A 193 20.378 10.082 -10.970 1.00 32.35 C ATOM 2868 O LEU A 193 19.527 10.977 -11.156 1.00 26.44 O ATOM 2869 CB LEU A 193 22.447 11.185 -11.749 1.00 34.61 C ATOM 2870 CG LEU A 193 23.152 11.285 -10.395 1.00 35.16 C ATOM 2871 CD1 LEU A 193 24.034 10.074 -10.064 1.00 32.78 C ATOM 2872 CD2 LEU A 193 23.990 12.549 -10.339 1.00 36.20 C ATOM 2873 HA LEU A 193 22.139 9.062 -11.715 1.00 0.00 H ATOM 2874 HB2 LEU A 193 23.211 11.160 -12.526 1.00 0.00 H ATOM 2875 HB3 LEU A 193 21.830 12.075 -11.875 1.00 0.00 H ATOM 2876 HG LEU A 193 22.362 11.311 -9.645 1.00 0.00 H ATOM 2877 HD21 LEU A 193 24.737 12.524 -11.132 1.00 0.00 H ATOM 2878 HD22 LEU A 193 23.345 13.417 -10.473 1.00 0.00 H ATOM 2879 HD23 LEU A 193 24.488 12.611 -9.371 1.00 0.00 H ATOM 2880 HD11 LEU A 193 23.420 9.174 -10.044 1.00 0.00 H ATOM 2881 HD12 LEU A 193 24.808 9.971 -10.825 1.00 0.00 H ATOM 2882 HD13 LEU A 193 24.499 10.220 -9.089 1.00 0.00 H ATOM 2883 H LEU A 193 21.388 10.465 -14.050 1.00 0.00 H ATOM 2884 N ALA A 194 20.343 9.153 -10.002 1.00 18.29 N ATOM 2885 CA ALA A 194 19.378 9.116 -8.904 1.00 24.68 C ATOM 2886 C ALA A 194 19.540 10.374 -8.063 1.00 28.57 C ATOM 2887 O ALA A 194 20.638 10.646 -7.528 1.00 27.91 O ATOM 2888 CB ALA A 194 19.619 7.878 -8.048 1.00 17.62 C ATOM 2889 HA ALA A 194 18.364 9.072 -9.302 1.00 0.00 H ATOM 2890 HB1 ALA A 194 19.502 6.985 -8.662 1.00 0.00 H ATOM 2891 HB2 ALA A 194 20.629 7.911 -7.640 1.00 0.00 H ATOM 2892 HB3 ALA A 194 18.897 7.856 -7.232 1.00 0.00 H ATOM 2893 H ALA A 194 21.059 8.400 -10.035 1.00 0.00 H ATOM 2894 N MET A 195 18.472 11.156 -7.961 1.00 36.65 N ATOM 2895 CA MET A 195 18.538 12.394 -7.191 1.00 43.93 C ATOM 2896 C MET A 195 18.782 12.136 -5.714 1.00 41.22 C ATOM 2897 O MET A 195 18.206 11.231 -5.114 1.00 44.12 O ATOM 2898 CB MET A 195 17.300 13.236 -7.415 1.00 47.26 C ATOM 2899 CG MET A 195 17.311 13.887 -8.767 1.00 51.51 C ATOM 2900 SD MET A 195 15.986 15.060 -8.880 1.00 57.70 S ATOM 2901 CE MET A 195 16.811 16.549 -8.286 1.00 62.76 C ATOM 2902 HA MET A 195 19.397 12.959 -7.554 1.00 0.00 H ATOM 2903 HB2 MET A 195 16.419 12.598 -7.336 1.00 0.00 H ATOM 2904 HB3 MET A 195 17.256 14.011 -6.650 1.00 0.00 H ATOM 2905 HG2 MET A 195 17.187 13.125 -9.537 1.00 0.00 H ATOM 2906 HG3 MET A 195 18.262 14.399 -8.915 1.00 0.00 H ATOM 2907 HE1 MET A 195 17.166 16.385 -7.269 1.00 0.00 H ATOM 2908 HE2 MET A 195 17.656 16.778 -8.935 1.00 0.00 H ATOM 2909 HE3 MET A 195 16.107 17.381 -8.297 1.00 0.00 H ATOM 2910 H MET A 195 17.585 10.885 -8.432 1.00 0.00 H ATOM 2911 N SER A 196 19.688 12.916 -5.151 1.00 41.42 N ATOM 2912 CA SER A 196 20.106 12.780 -3.760 1.00 37.89 C ATOM 2913 C SER A 196 20.730 14.132 -3.419 1.00 39.15 C ATOM 2914 O SER A 196 21.309 14.778 -4.293 1.00 33.10 O ATOM 2915 CB SER A 196 21.153 11.653 -3.608 1.00 31.91 C ATOM 2916 OG SER A 196 21.693 11.577 -2.293 1.00 34.44 O ATOM 2917 HA SER A 196 19.275 12.521 -3.103 1.00 0.00 H ATOM 2918 HB2 SER A 196 21.967 11.836 -4.309 1.00 0.00 H ATOM 2919 HB3 SER A 196 20.678 10.701 -3.846 1.00 0.00 H ATOM 2920 HG SER A 196 22.355 10.842 -2.251 1.00 0.00 H ATOM 2921 H SER A 196 20.124 13.663 -5.728 1.00 0.00 H ATOM 2922 N SER A 197 20.616 14.529 -2.148 1.00 46.28 N ATOM 2923 CA SER A 197 21.299 15.709 -1.607 1.00 48.89 C ATOM 2924 C SER A 197 22.811 15.470 -1.400 1.00 52.90 C ATOM 2925 O SER A 197 23.592 16.430 -1.360 1.00 55.41 O ATOM 2926 CB SER A 197 20.624 16.183 -0.325 1.00 50.78 C ATOM 2927 OG SER A 197 20.339 15.088 0.523 1.00 57.13 O ATOM 2928 HA SER A 197 21.213 16.503 -2.349 1.00 0.00 H ATOM 2929 HB2 SER A 197 19.694 16.693 -0.577 1.00 0.00 H ATOM 2930 HB3 SER A 197 21.287 16.875 0.194 1.00 0.00 H ATOM 2931 HG SER A 197 19.734 14.459 0.056 1.00 0.00 H ATOM 2932 H SER A 197 20.012 13.973 -1.510 1.00 0.00 H ATOM 2933 N ARG A 198 23.238 14.208 -1.313 1.00 50.72 N ATOM 2934 CA ARG A 198 24.677 13.916 -1.380 1.00 54.76 C ATOM 2935 C ARG A 198 25.310 14.320 -2.733 1.00 51.95 C ATOM 2936 O ARG A 198 26.520 14.442 -2.828 1.00 51.32 O ATOM 2937 CB ARG A 198 24.997 12.451 -0.995 1.00 58.84 C ATOM 2938 CG ARG A 198 25.839 12.280 0.324 1.00 67.42 C ATOM 2939 CD ARG A 198 25.185 12.900 1.618 1.00 76.29 C ATOM 2940 NE ARG A 198 24.044 12.095 2.081 1.00 81.60 N ATOM 2941 CZ ARG A 198 22.755 12.444 2.006 1.00 80.88 C ATOM 2942 NH1 ARG A 198 22.393 13.632 1.529 1.00 77.34 N ATOM 2943 NH2 ARG A 198 21.821 11.596 2.436 1.00 80.41 N ATOM 2944 HA ARG A 198 25.148 14.548 -0.627 1.00 0.00 H ATOM 2945 HB2 ARG A 198 24.053 11.921 -0.866 1.00 0.00 H ATOM 2946 HB3 ARG A 198 25.556 12.000 -1.815 1.00 0.00 H ATOM 2947 HG2 ARG A 198 25.985 11.214 0.496 1.00 0.00 H ATOM 2948 HG3 ARG A 198 26.807 12.758 0.172 1.00 0.00 H ATOM 2949 HD2 ARG A 198 24.839 13.909 1.393 1.00 0.00 H ATOM 2950 HD3 ARG A 198 25.934 12.942 2.409 1.00 0.00 H ATOM 2951 HE ARG A 198 24.259 11.170 2.505 1.00 0.00 H ATOM 2952 HH12 ARG A 198 21.386 13.887 1.478 1.00 0.00 H ATOM 2953 HH11 ARG A 198 23.117 14.306 1.207 1.00 0.00 H ATOM 2954 HH22 ARG A 198 20.816 11.858 2.382 1.00 0.00 H ATOM 2955 HH21 ARG A 198 22.097 10.672 2.826 1.00 0.00 H ATOM 2956 H ARG A 198 22.554 13.433 -1.198 1.00 0.00 H ATOM 2957 N ASN A 199 24.483 14.566 -3.749 1.00 46.48 N ATOM 2958 CA ASN A 199 24.952 14.914 -5.088 1.00 42.28 C ATOM 2959 C ASN A 199 25.632 16.281 -5.198 1.00 43.71 C ATOM 2960 O ASN A 199 26.553 16.458 -6.016 1.00 37.48 O ATOM 2961 CB ASN A 199 23.786 14.836 -6.094 1.00 41.43 C ATOM 2962 CG ASN A 199 23.361 13.380 -6.415 1.00 40.68 C ATOM 2963 OD1 ASN A 199 24.045 12.417 -6.021 1.00 28.77 O ATOM 2964 ND2 ASN A 199 22.257 13.227 -7.162 1.00 30.04 N ATOM 2965 HA ASN A 199 25.722 14.179 -5.322 1.00 0.00 H ATOM 2966 HB2 ASN A 199 22.929 15.364 -5.675 1.00 0.00 H ATOM 2967 HB3 ASN A 199 24.093 15.321 -7.021 1.00 0.00 H ATOM 2968 HD22 ASN A 199 21.717 14.061 -7.468 1.00 0.00 H ATOM 2969 HD21 ASN A 199 21.942 12.274 -7.435 1.00 0.00 H ATOM 2970 H ASN A 199 23.458 14.508 -3.581 1.00 0.00 H ATOM 2971 N ARG A 200 25.164 17.252 -4.401 1.00 48.10 N ATOM 2972 CA ARG A 200 25.758 18.596 -4.393 1.00 48.37 C ATOM 2973 C ARG A 200 27.275 18.531 -4.109 1.00 47.13 C ATOM 2974 O ARG A 200 28.028 19.380 -4.578 1.00 40.26 O ATOM 2975 CB ARG A 200 25.044 19.525 -3.418 1.00 49.39 C ATOM 2976 CG ARG A 200 25.593 19.483 -1.998 1.00 59.59 C ATOM 2977 CD ARG A 200 24.574 20.048 -1.016 1.00 67.91 C ATOM 2978 NE ARG A 200 23.273 19.389 -1.165 1.00 70.04 N ATOM 2979 CZ ARG A 200 22.094 19.979 -0.995 1.00 69.74 C ATOM 2980 NH1 ARG A 200 22.021 21.264 -0.663 1.00 72.83 N ATOM 2981 NH2 ARG A 200 20.983 19.275 -1.157 1.00 70.25 N ATOM 2982 HA ARG A 200 25.625 19.019 -5.389 1.00 0.00 H ATOM 2983 HB2 ARG A 200 25.135 20.546 -3.790 1.00 0.00 H ATOM 2984 HB3 ARG A 200 23.991 19.244 -3.386 1.00 0.00 H ATOM 2985 HG2 ARG A 200 25.816 18.450 -1.730 1.00 0.00 H ATOM 2986 HG3 ARG A 200 26.506 20.076 -1.948 1.00 0.00 H ATOM 2987 HD2 ARG A 200 24.455 21.116 -1.201 1.00 0.00 H ATOM 2988 HD3 ARG A 200 24.936 19.895 0.001 1.00 0.00 H ATOM 2989 HE ARG A 200 23.272 18.382 -1.424 1.00 0.00 H ATOM 2990 HH12 ARG A 200 21.093 21.715 -0.533 1.00 0.00 H ATOM 2991 HH11 ARG A 200 22.892 21.818 -0.534 1.00 0.00 H ATOM 2992 HH22 ARG A 200 20.056 19.728 -1.026 1.00 0.00 H ATOM 2993 HH21 ARG A 200 21.038 18.269 -1.415 1.00 0.00 H ATOM 2994 H ARG A 200 24.360 17.049 -3.773 1.00 0.00 H ATOM 2995 N TYR A 201 27.708 17.471 -3.412 1.00 49.02 N ATOM 2996 CA TYR A 201 29.129 17.216 -3.096 1.00 48.67 C ATOM 2997 C TYR A 201 29.966 16.620 -4.234 1.00 47.95 C ATOM 2998 O TYR A 201 31.137 16.253 -4.006 1.00 44.70 O ATOM 2999 CB TYR A 201 29.260 16.329 -1.831 1.00 57.08 C ATOM 3000 CG TYR A 201 28.519 16.879 -0.643 1.00 59.08 C ATOM 3001 CD1 TYR A 201 28.888 18.108 -0.083 1.00 63.27 C ATOM 3002 CD2 TYR A 201 27.433 16.193 -0.096 1.00 60.86 C ATOM 3003 CE1 TYR A 201 28.196 18.638 0.999 1.00 67.87 C ATOM 3004 CE2 TYR A 201 26.730 16.706 0.999 1.00 64.50 C ATOM 3005 CZ TYR A 201 27.116 17.930 1.540 1.00 64.26 C ATOM 3006 OH TYR A 201 26.445 18.460 2.618 1.00 60.86 O ATOM 3007 HA TYR A 201 29.546 18.208 -2.920 1.00 0.00 H ATOM 3008 HB3 TYR A 201 30.316 16.246 -1.573 1.00 0.00 H ATOM 3009 HB2 TYR A 201 28.864 15.339 -2.059 1.00 0.00 H ATOM 3010 HD2 TYR A 201 27.128 15.241 -0.530 1.00 0.00 H ATOM 3011 HE2 TYR A 201 25.891 16.155 1.423 1.00 0.00 H ATOM 3012 HE1 TYR A 201 28.492 19.597 1.423 1.00 0.00 H ATOM 3013 HD1 TYR A 201 29.731 18.657 -0.502 1.00 0.00 H ATOM 3014 HH TYR A 201 26.506 17.835 3.383 1.00 0.00 H ATOM 3015 H TYR A 201 27.002 16.787 -3.073 1.00 0.00 H ATOM 3016 N LEU A 202 29.372 16.508 -5.432 1.00 42.80 N ATOM 3017 CA LEU A 202 30.110 16.097 -6.644 1.00 44.34 C ATOM 3018 C LEU A 202 30.605 17.302 -7.437 1.00 42.68 C ATOM 3019 O LEU A 202 29.828 18.198 -7.733 1.00 41.88 O ATOM 3020 CB LEU A 202 29.252 15.195 -7.565 1.00 37.61 C ATOM 3021 CG LEU A 202 28.769 13.827 -7.046 1.00 36.45 C ATOM 3022 CD1 LEU A 202 27.788 13.276 -8.017 1.00 27.50 C ATOM 3023 CD2 LEU A 202 29.944 12.844 -6.760 1.00 27.94 C ATOM 3024 HA LEU A 202 30.970 15.524 -6.297 1.00 0.00 H ATOM 3025 HB2 LEU A 202 28.363 15.766 -7.831 1.00 0.00 H ATOM 3026 HB3 LEU A 202 29.841 15.005 -8.462 1.00 0.00 H ATOM 3027 HG LEU A 202 28.281 13.963 -6.081 1.00 0.00 H ATOM 3028 HD21 LEU A 202 30.506 12.674 -7.679 1.00 0.00 H ATOM 3029 HD22 LEU A 202 30.601 13.275 -6.005 1.00 0.00 H ATOM 3030 HD23 LEU A 202 29.544 11.897 -6.397 1.00 0.00 H ATOM 3031 HD11 LEU A 202 26.944 13.960 -8.107 1.00 0.00 H ATOM 3032 HD12 LEU A 202 28.267 13.158 -8.989 1.00 0.00 H ATOM 3033 HD13 LEU A 202 27.435 12.307 -7.665 1.00 0.00 H ATOM 3034 H LEU A 202 28.356 16.718 -5.510 1.00 0.00 H ATOM 3035 N ASP A 203 31.888 17.320 -7.790 1.00 44.78 N ATOM 3036 CA ASP A 203 32.375 18.328 -8.748 1.00 46.44 C ATOM 3037 C ASP A 203 32.035 17.889 -10.158 1.00 48.97 C ATOM 3038 O ASP A 203 31.689 16.723 -10.363 1.00 49.82 O ATOM 3039 CB ASP A 203 33.885 18.588 -8.606 1.00 44.46 C ATOM 3040 CG ASP A 203 34.725 17.370 -8.902 1.00 42.94 C ATOM 3041 OD1 ASP A 203 34.409 16.601 -9.834 1.00 47.25 O ATOM 3042 OD2 ASP A 203 35.717 17.173 -8.190 1.00 41.87 O ATOM 3043 HA ASP A 203 31.875 19.271 -8.528 1.00 0.00 H ATOM 3044 HB2 ASP A 203 34.167 19.381 -9.298 1.00 0.00 H ATOM 3045 HB3 ASP A 203 34.088 18.910 -7.584 1.00 0.00 H ATOM 3046 H ASP A 203 32.547 16.622 -7.390 1.00 0.00 H ATOM 3047 N PRO A 204 32.121 18.824 -11.133 1.00 54.02 N ATOM 3048 CA PRO A 204 31.975 18.607 -12.576 1.00 52.97 C ATOM 3049 C PRO A 204 32.424 17.247 -13.152 1.00 50.87 C ATOM 3050 O PRO A 204 31.725 16.702 -14.002 1.00 46.83 O ATOM 3051 CB PRO A 204 32.812 19.753 -13.148 1.00 50.79 C ATOM 3052 CG PRO A 204 32.459 20.871 -12.263 1.00 52.03 C ATOM 3053 CD PRO A 204 32.332 20.263 -10.867 1.00 54.95 C ATOM 3054 HA PRO A 204 30.918 18.589 -12.843 1.00 0.00 H ATOM 3055 HD3 PRO A 204 33.242 20.423 -10.288 1.00 0.00 H ATOM 3056 HD2 PRO A 204 31.483 20.689 -10.332 1.00 0.00 H ATOM 3057 HG3 PRO A 204 31.514 21.318 -12.572 1.00 0.00 H ATOM 3058 HG2 PRO A 204 33.241 21.631 -12.278 1.00 0.00 H ATOM 3059 HB2 PRO A 204 33.877 19.529 -13.095 1.00 0.00 H ATOM 3060 HB3 PRO A 204 32.537 19.965 -14.181 1.00 0.00 H ATOM 3061 N ALA A 205 33.579 16.744 -12.710 1.00 50.35 N ATOM 3062 CA ALA A 205 34.157 15.484 -13.203 1.00 51.05 C ATOM 3063 C ALA A 205 33.433 14.265 -12.651 1.00 50.04 C ATOM 3064 O ALA A 205 32.899 13.475 -13.431 1.00 51.09 O ATOM 3065 CB ALA A 205 35.663 15.397 -12.878 1.00 46.68 C ATOM 3066 HA ALA A 205 34.029 15.485 -14.285 1.00 0.00 H ATOM 3067 HB1 ALA A 205 36.184 16.229 -13.352 1.00 0.00 H ATOM 3068 HB2 ALA A 205 35.804 15.446 -11.798 1.00 0.00 H ATOM 3069 HB3 ALA A 205 36.061 14.455 -13.255 1.00 0.00 H ATOM 3070 H ALA A 205 34.098 17.271 -11.978 1.00 0.00 H ATOM 3071 N GLN A 206 33.450 14.121 -11.316 1.00 47.52 N ATOM 3072 CA GLN A 206 32.636 13.138 -10.570 1.00 41.22 C ATOM 3073 C GLN A 206 31.157 13.206 -10.936 1.00 42.08 C ATOM 3074 O GLN A 206 30.509 12.182 -11.116 1.00 44.27 O ATOM 3075 CB GLN A 206 32.762 13.372 -9.084 1.00 38.24 C ATOM 3076 CG GLN A 206 34.190 13.309 -8.582 1.00 39.92 C ATOM 3077 CD GLN A 206 34.374 13.930 -7.216 1.00 41.00 C ATOM 3078 OE1 GLN A 206 33.613 14.825 -6.785 1.00 40.86 O ATOM 3079 NE2 GLN A 206 35.400 13.470 -6.520 1.00 47.83 N ATOM 3080 HA GLN A 206 33.018 12.154 -10.843 1.00 0.00 H ATOM 3081 HB2 GLN A 206 32.358 14.358 -8.854 1.00 0.00 H ATOM 3082 HB3 GLN A 206 32.179 12.612 -8.564 1.00 0.00 H ATOM 3083 HG2 GLN A 206 34.492 12.263 -8.530 1.00 0.00 H ATOM 3084 HG3 GLN A 206 34.829 13.836 -9.290 1.00 0.00 H ATOM 3085 HE22 GLN A 206 36.006 12.725 -6.918 1.00 0.00 H ATOM 3086 HE21 GLN A 206 35.601 13.853 -5.574 1.00 0.00 H ATOM 3087 H GLN A 206 34.079 14.744 -10.770 1.00 0.00 H ATOM 3088 N ARG A 207 30.600 14.402 -11.057 1.00 39.40 N ATOM 3089 CA ARG A 207 29.233 14.486 -11.551 1.00 38.81 C ATOM 3090 C ARG A 207 29.109 13.781 -12.936 1.00 40.92 C ATOM 3091 O ARG A 207 28.065 13.169 -13.257 1.00 38.47 O ATOM 3092 CB ARG A 207 28.734 15.937 -11.591 1.00 35.29 C ATOM 3093 CG ARG A 207 27.349 16.079 -12.213 1.00 38.70 C ATOM 3094 CD ARG A 207 26.271 15.144 -11.539 1.00 35.33 C ATOM 3095 NE ARG A 207 24.982 15.344 -12.210 1.00 35.22 N ATOM 3096 CZ ARG A 207 24.501 14.596 -13.206 1.00 29.32 C ATOM 3097 NH1 ARG A 207 25.144 13.511 -13.661 1.00 30.64 N ATOM 3098 NH2 ARG A 207 23.346 14.926 -13.740 1.00 26.71 N ATOM 3099 HA ARG A 207 28.584 13.957 -10.853 1.00 0.00 H ATOM 3100 HB2 ARG A 207 28.697 16.319 -10.571 1.00 0.00 H ATOM 3101 HB3 ARG A 207 29.438 16.530 -12.174 1.00 0.00 H ATOM 3102 HG2 ARG A 207 27.025 17.115 -12.108 1.00 0.00 H ATOM 3103 HG3 ARG A 207 27.416 15.826 -13.271 1.00 0.00 H ATOM 3104 HD2 ARG A 207 26.177 15.396 -10.483 1.00 0.00 H ATOM 3105 HD3 ARG A 207 26.577 14.102 -11.637 1.00 0.00 H ATOM 3106 HE ARG A 207 24.393 16.136 -11.882 1.00 0.00 H ATOM 3107 HH12 ARG A 207 24.737 12.954 -14.439 1.00 0.00 H ATOM 3108 HH11 ARG A 207 26.050 13.227 -13.236 1.00 0.00 H ATOM 3109 HH22 ARG A 207 22.951 14.358 -14.517 1.00 0.00 H ATOM 3110 HH21 ARG A 207 22.827 15.755 -13.386 1.00 0.00 H ATOM 3111 H ARG A 207 31.128 15.262 -10.805 1.00 0.00 H ATOM 3112 N ALA A 208 30.181 13.850 -13.732 1.00 34.95 N ATOM 3113 CA ALA A 208 30.151 13.279 -15.050 1.00 36.90 C ATOM 3114 C ALA A 208 30.277 11.762 -14.925 1.00 35.55 C ATOM 3115 O ALA A 208 29.551 11.007 -15.569 1.00 40.75 O ATOM 3116 CB ALA A 208 31.263 13.850 -15.894 1.00 34.76 C ATOM 3117 HA ALA A 208 29.209 13.522 -15.542 1.00 0.00 H ATOM 3118 HB1 ALA A 208 31.141 14.930 -15.971 1.00 0.00 H ATOM 3119 HB2 ALA A 208 32.223 13.624 -15.430 1.00 0.00 H ATOM 3120 HB3 ALA A 208 31.226 13.407 -16.889 1.00 0.00 H ATOM 3121 H ALA A 208 31.044 14.321 -13.394 1.00 0.00 H ATOM 3122 N ALA A 209 31.194 11.332 -14.071 1.00 33.17 N ATOM 3123 CA ALA A 209 31.460 9.919 -13.826 1.00 30.40 C ATOM 3124 C ALA A 209 30.253 9.224 -13.152 1.00 30.67 C ATOM 3125 O ALA A 209 30.048 8.013 -13.316 1.00 36.63 O ATOM 3126 CB ALA A 209 32.732 9.774 -12.976 1.00 21.34 C ATOM 3127 HA ALA A 209 31.617 9.423 -14.784 1.00 0.00 H ATOM 3128 HB1 ALA A 209 33.575 10.215 -13.508 1.00 0.00 H ATOM 3129 HB2 ALA A 209 32.592 10.287 -12.025 1.00 0.00 H ATOM 3130 HB3 ALA A 209 32.928 8.717 -12.795 1.00 0.00 H ATOM 3131 H ALA A 209 31.752 12.037 -13.549 1.00 0.00 H ATOM 3132 N ALA A 210 29.458 10.008 -12.421 1.00 31.83 N ATOM 3133 CA ALA A 210 28.391 9.512 -11.540 1.00 30.84 C ATOM 3134 C ALA A 210 27.265 8.811 -12.297 1.00 31.39 C ATOM 3135 O ALA A 210 26.538 7.983 -11.733 1.00 31.50 O ATOM 3136 CB ALA A 210 27.821 10.658 -10.753 1.00 29.46 C ATOM 3137 HA ALA A 210 28.842 8.771 -10.880 1.00 0.00 H ATOM 3138 HB1 ALA A 210 28.609 11.112 -10.152 1.00 0.00 H ATOM 3139 HB2 ALA A 210 27.412 11.400 -11.439 1.00 0.00 H ATOM 3140 HB3 ALA A 210 27.030 10.290 -10.100 1.00 0.00 H ATOM 3141 H ALA A 210 29.603 11.036 -12.478 1.00 0.00 H ATOM 3142 N VAL A 211 27.108 9.185 -13.561 1.00 28.01 N ATOM 3143 CA VAL A 211 26.119 8.596 -14.425 1.00 27.11 C ATOM 3144 C VAL A 211 26.292 7.065 -14.583 1.00 28.27 C ATOM 3145 O VAL A 211 25.327 6.377 -14.925 1.00 31.80 O ATOM 3146 CB VAL A 211 26.159 9.258 -15.828 1.00 26.20 C ATOM 3147 CG1 VAL A 211 27.398 8.777 -16.600 1.00 24.59 C ATOM 3148 CG2 VAL A 211 24.924 8.913 -16.570 1.00 18.39 C ATOM 3149 HA VAL A 211 25.154 8.775 -13.950 1.00 0.00 H ATOM 3150 HB VAL A 211 26.218 10.341 -15.718 1.00 0.00 H ATOM 3151 HG11 VAL A 211 28.297 9.050 -16.048 1.00 0.00 H ATOM 3152 HG12 VAL A 211 27.355 7.694 -16.715 1.00 0.00 H ATOM 3153 HG13 VAL A 211 27.417 9.247 -17.583 1.00 0.00 H ATOM 3154 HG21 VAL A 211 24.858 7.831 -16.679 1.00 0.00 H ATOM 3155 HG22 VAL A 211 24.057 9.278 -16.019 1.00 0.00 H ATOM 3156 HG23 VAL A 211 24.952 9.378 -17.555 1.00 0.00 H ATOM 3157 H VAL A 211 27.723 9.932 -13.942 1.00 0.00 H ATOM 3158 N ALA A 212 27.503 6.561 -14.347 1.00 22.63 N ATOM 3159 CA ALA A 212 27.822 5.111 -14.414 1.00 30.23 C ATOM 3160 C ALA A 212 26.994 4.185 -13.550 1.00 30.47 C ATOM 3161 O ALA A 212 26.881 2.975 -13.832 1.00 29.79 O ATOM 3162 CB ALA A 212 29.278 4.885 -14.068 1.00 31.18 C ATOM 3163 HA ALA A 212 27.578 4.850 -15.444 1.00 0.00 H ATOM 3164 HB1 ALA A 212 29.906 5.424 -14.777 1.00 0.00 H ATOM 3165 HB2 ALA A 212 29.471 5.249 -13.059 1.00 0.00 H ATOM 3166 HB3 ALA A 212 29.501 3.819 -14.120 1.00 0.00 H ATOM 3167 H ALA A 212 28.269 7.220 -14.102 1.00 0.00 H ATOM 3168 N LEU A 213 26.460 4.712 -12.458 1.00 29.28 N ATOM 3169 CA LEU A 213 25.735 3.834 -11.552 1.00 26.73 C ATOM 3170 C LEU A 213 24.435 3.457 -12.164 1.00 26.51 C ATOM 3171 O LEU A 213 24.135 2.260 -12.217 1.00 20.28 O ATOM 3172 CB LEU A 213 25.481 4.477 -10.217 1.00 26.21 C ATOM 3173 CG LEU A 213 26.588 4.312 -9.188 1.00 28.91 C ATOM 3174 CD1 LEU A 213 27.843 5.161 -9.550 1.00 24.94 C ATOM 3175 CD2 LEU A 213 25.966 4.733 -7.861 1.00 22.77 C ATOM 3176 HA LEU A 213 26.354 2.952 -11.386 1.00 0.00 H ATOM 3177 HB2 LEU A 213 25.332 5.544 -10.381 1.00 0.00 H ATOM 3178 HB3 LEU A 213 24.571 4.043 -9.803 1.00 0.00 H ATOM 3179 HG LEU A 213 26.953 3.286 -9.145 1.00 0.00 H ATOM 3180 HD21 LEU A 213 25.633 5.769 -7.930 1.00 0.00 H ATOM 3181 HD22 LEU A 213 25.114 4.090 -7.640 1.00 0.00 H ATOM 3182 HD23 LEU A 213 26.708 4.640 -7.068 1.00 0.00 H ATOM 3183 HD11 LEU A 213 28.226 4.845 -10.520 1.00 0.00 H ATOM 3184 HD12 LEU A 213 27.567 6.215 -9.592 1.00 0.00 H ATOM 3185 HD13 LEU A 213 28.610 5.015 -8.790 1.00 0.00 H ATOM 3186 H LEU A 213 26.557 5.727 -12.254 1.00 0.00 H ATOM 3187 N SER A 214 23.661 4.473 -12.582 1.00 19.33 N ATOM 3188 CA SER A 214 22.387 4.241 -13.249 1.00 23.75 C ATOM 3189 C SER A 214 22.577 3.492 -14.561 1.00 23.81 C ATOM 3190 O SER A 214 21.804 2.615 -14.855 1.00 31.26 O ATOM 3191 CB SER A 214 21.610 5.545 -13.510 1.00 18.32 C ATOM 3192 OG SER A 214 22.391 6.444 -14.287 1.00 24.31 O ATOM 3193 HA SER A 214 21.798 3.629 -12.566 1.00 0.00 H ATOM 3194 HB2 SER A 214 21.365 6.014 -12.557 1.00 0.00 H ATOM 3195 HB3 SER A 214 20.690 5.313 -14.046 1.00 0.00 H ATOM 3196 HG SER A 214 23.226 6.659 -13.801 1.00 0.00 H ATOM 3197 H SER A 214 23.980 5.450 -12.425 1.00 0.00 H ATOM 3198 N ALA A 215 23.591 3.841 -15.351 1.00 21.56 N ATOM 3199 CA ALA A 215 23.831 3.153 -16.621 1.00 21.57 C ATOM 3200 C ALA A 215 24.096 1.644 -16.441 1.00 19.64 C ATOM 3201 O ALA A 215 23.559 0.820 -17.209 1.00 21.57 O ATOM 3202 CB ALA A 215 24.930 3.815 -17.420 1.00 8.54 C ATOM 3203 HA ALA A 215 22.908 3.241 -17.193 1.00 0.00 H ATOM 3204 HB1 ALA A 215 24.650 4.846 -17.637 1.00 0.00 H ATOM 3205 HB2 ALA A 215 25.855 3.802 -16.843 1.00 0.00 H ATOM 3206 HB3 ALA A 215 25.075 3.273 -18.354 1.00 0.00 H ATOM 3207 H ALA A 215 24.223 4.615 -15.061 1.00 0.00 H ATOM 3208 N ALA A 216 24.891 1.280 -15.434 1.00 21.07 N ATOM 3209 CA ALA A 216 25.231 -0.145 -15.162 1.00 20.55 C ATOM 3210 C ALA A 216 23.964 -0.869 -14.776 1.00 24.12 C ATOM 3211 O ALA A 216 23.714 -2.016 -15.187 1.00 20.35 O ATOM 3212 CB ALA A 216 26.256 -0.273 -14.011 1.00 21.00 C ATOM 3213 HA ALA A 216 25.675 -0.577 -16.059 1.00 0.00 H ATOM 3214 HB1 ALA A 216 27.171 0.255 -14.280 1.00 0.00 H ATOM 3215 HB2 ALA A 216 25.837 0.162 -13.103 1.00 0.00 H ATOM 3216 HB3 ALA A 216 26.480 -1.326 -13.841 1.00 0.00 H ATOM 3217 H ALA A 216 25.288 2.017 -14.817 1.00 0.00 H ATOM 3218 N LEU A 217 23.174 -0.196 -13.949 1.00 18.57 N ATOM 3219 CA LEU A 217 22.002 -0.801 -13.408 1.00 16.95 C ATOM 3220 C LEU A 217 21.047 -1.032 -14.528 1.00 22.00 C ATOM 3221 O LEU A 217 20.528 -2.154 -14.644 1.00 20.58 O ATOM 3222 CB LEU A 217 21.379 0.069 -12.316 1.00 25.43 C ATOM 3223 CG LEU A 217 22.181 0.003 -10.995 1.00 28.51 C ATOM 3224 CD1 LEU A 217 21.627 1.002 -9.985 1.00 33.65 C ATOM 3225 CD2 LEU A 217 22.197 -1.345 -10.377 1.00 25.99 C ATOM 3226 HA LEU A 217 22.258 -1.750 -12.936 1.00 0.00 H ATOM 3227 HB2 LEU A 217 21.353 1.103 -12.661 1.00 0.00 H ATOM 3228 HB3 LEU A 217 20.362 -0.276 -12.128 1.00 0.00 H ATOM 3229 HG LEU A 217 23.208 0.252 -11.260 1.00 0.00 H ATOM 3230 HD21 LEU A 217 21.176 -1.653 -10.154 1.00 0.00 H ATOM 3231 HD22 LEU A 217 22.649 -2.055 -11.069 1.00 0.00 H ATOM 3232 HD23 LEU A 217 22.778 -1.314 -9.455 1.00 0.00 H ATOM 3233 HD11 LEU A 217 21.700 2.009 -10.395 1.00 0.00 H ATOM 3234 HD12 LEU A 217 20.583 0.767 -9.779 1.00 0.00 H ATOM 3235 HD13 LEU A 217 22.204 0.941 -9.062 1.00 0.00 H ATOM 3236 H LEU A 217 23.412 0.783 -13.693 1.00 0.00 H ATOM 3237 N THR A 218 20.852 -0.017 -15.391 1.00 19.40 N ATOM 3238 CA THR A 218 19.868 -0.146 -16.481 1.00 25.06 C ATOM 3239 C THR A 218 20.394 -1.111 -17.545 1.00 22.50 C ATOM 3240 O THR A 218 19.616 -1.775 -18.191 1.00 29.28 O ATOM 3241 CB THR A 218 19.516 1.172 -17.148 1.00 24.72 C ATOM 3242 OG1 THR A 218 20.708 1.720 -17.717 1.00 39.71 O ATOM 3243 CG2 THR A 218 18.930 2.168 -16.151 1.00 31.48 C ATOM 3244 HA THR A 218 18.957 -0.525 -16.019 1.00 0.00 H ATOM 3245 HB THR A 218 18.764 0.987 -17.915 1.00 0.00 H ATOM 3246 HG1 THR A 218 21.376 1.869 -17.001 1.00 0.00 H ATOM 3247 HG23 THR A 218 18.021 1.752 -15.716 1.00 0.00 H ATOM 3248 HG21 THR A 218 19.657 2.361 -15.362 1.00 0.00 H ATOM 3249 HG22 THR A 218 18.695 3.100 -16.666 1.00 0.00 H ATOM 3250 H THR A 218 21.398 0.862 -15.288 1.00 0.00 H ATOM 3251 N ALA A 219 21.711 -1.173 -17.711 1.00 16.48 N ATOM 3252 CA ALA A 219 22.327 -2.138 -18.594 1.00 22.54 C ATOM 3253 C ALA A 219 22.029 -3.593 -18.111 1.00 23.81 C ATOM 3254 O ALA A 219 21.552 -4.459 -18.890 1.00 23.20 O ATOM 3255 CB ALA A 219 23.847 -1.860 -18.703 1.00 15.47 C ATOM 3256 HA ALA A 219 21.899 -2.039 -19.592 1.00 0.00 H ATOM 3257 HB1 ALA A 219 24.004 -0.857 -19.100 1.00 0.00 H ATOM 3258 HB2 ALA A 219 24.301 -1.936 -17.715 1.00 0.00 H ATOM 3259 HB3 ALA A 219 24.302 -2.592 -19.370 1.00 0.00 H ATOM 3260 H ALA A 219 22.317 -0.507 -17.190 1.00 0.00 H ATOM 3261 N ALA A 220 22.266 -3.815 -16.819 1.00 19.59 N ATOM 3262 CA ALA A 220 21.949 -5.049 -16.133 1.00 22.26 C ATOM 3263 C ALA A 220 20.473 -5.393 -16.280 1.00 23.73 C ATOM 3264 O ALA A 220 20.123 -6.528 -16.527 1.00 26.92 O ATOM 3265 CB ALA A 220 22.300 -4.906 -14.672 1.00 24.69 C ATOM 3266 HA ALA A 220 22.529 -5.857 -16.578 1.00 0.00 H ATOM 3267 HB1 ALA A 220 23.365 -4.695 -14.574 1.00 0.00 H ATOM 3268 HB2 ALA A 220 21.725 -4.087 -14.240 1.00 0.00 H ATOM 3269 HB3 ALA A 220 22.063 -5.833 -14.150 1.00 0.00 H ATOM 3270 H ALA A 220 22.708 -3.052 -16.268 1.00 0.00 H ATOM 3271 N ALA A 221 19.590 -4.414 -16.136 1.00 26.33 N ATOM 3272 CA ALA A 221 18.155 -4.712 -16.205 1.00 24.43 C ATOM 3273 C ALA A 221 17.827 -5.326 -17.543 1.00 26.87 C ATOM 3274 O ALA A 221 17.034 -6.255 -17.592 1.00 25.63 O ATOM 3275 CB ALA A 221 17.297 -3.484 -15.948 1.00 22.10 C ATOM 3276 HA ALA A 221 17.924 -5.425 -15.413 1.00 0.00 H ATOM 3277 HB1 ALA A 221 17.513 -3.093 -14.954 1.00 0.00 H ATOM 3278 HB2 ALA A 221 17.520 -2.723 -16.696 1.00 0.00 H ATOM 3279 HB3 ALA A 221 16.244 -3.759 -16.010 1.00 0.00 H ATOM 3280 H ALA A 221 19.913 -3.439 -15.975 1.00 0.00 H ATOM 3281 N HIS A 222 18.453 -4.862 -18.611 1.00 25.36 N ATOM 3282 CA HIS A 222 18.227 -5.366 -19.956 1.00 28.41 C ATOM 3283 C HIS A 222 18.972 -6.623 -20.399 1.00 22.58 C ATOM 3284 O HIS A 222 18.446 -7.422 -21.100 1.00 21.99 O ATOM 3285 CB HIS A 222 18.387 -4.252 -20.969 1.00 26.44 C ATOM 3286 CG HIS A 222 17.400 -3.163 -20.791 1.00 30.68 C ATOM 3287 ND1 HIS A 222 16.200 -3.133 -21.449 1.00 31.63 N ATOM 3288 CD2 HIS A 222 17.397 -2.110 -19.958 1.00 25.59 C ATOM 3289 CE1 HIS A 222 15.523 -2.083 -21.055 1.00 34.11 C ATOM 3290 NE2 HIS A 222 16.227 -1.451 -20.149 1.00 29.54 N ATOM 3291 HA HIS A 222 17.198 -5.722 -19.909 1.00 0.00 H ATOM 3292 HB2 HIS A 222 19.388 -3.833 -20.870 1.00 0.00 H ATOM 3293 HB3 HIS A 222 18.267 -4.671 -21.968 1.00 0.00 H ATOM 3294 HD2 HIS A 222 18.187 -1.836 -19.259 1.00 0.00 H ATOM 3295 HE1 HIS A 222 14.540 -1.785 -21.420 1.00 0.00 H ATOM 3296 H HIS A 222 19.144 -4.096 -18.482 1.00 0.00 H ATOM 3297 N ALA A 223 20.187 -6.769 -19.948 1.00 21.03 N ATOM 3298 CA ALA A 223 20.979 -7.947 -20.137 1.00 19.35 C ATOM 3299 C ALA A 223 20.408 -9.142 -19.364 1.00 21.91 C ATOM 3300 O ALA A 223 20.722 -10.256 -19.600 1.00 21.75 O ATOM 3301 CB ALA A 223 22.318 -7.662 -19.694 1.00 5.46 C ATOM 3302 HA ALA A 223 20.973 -8.217 -21.193 1.00 0.00 H ATOM 3303 HB1 ALA A 223 22.725 -6.837 -20.279 1.00 0.00 H ATOM 3304 HB2 ALA A 223 22.300 -7.387 -18.640 1.00 0.00 H ATOM 3305 HB3 ALA A 223 22.940 -8.547 -19.829 1.00 0.00 H ATOM 3306 H ALA A 223 20.607 -5.980 -19.417 1.00 0.00 H ATOM 3307 N ALA A 224 19.535 -8.866 -18.433 1.00 26.85 N ATOM 3308 CA ALA A 224 18.977 -9.900 -17.602 1.00 26.96 C ATOM 3309 C ALA A 224 18.224 -11.011 -18.314 1.00 26.20 C ATOM 3310 O ALA A 224 18.096 -12.037 -17.771 1.00 27.99 O ATOM 3311 CB ALA A 224 18.144 -9.321 -16.533 1.00 18.97 C ATOM 3312 HA ALA A 224 19.854 -10.395 -17.184 1.00 0.00 H ATOM 3313 HB1 ALA A 224 18.755 -8.664 -15.914 1.00 0.00 H ATOM 3314 HB2 ALA A 224 17.329 -8.750 -16.978 1.00 0.00 H ATOM 3315 HB3 ALA A 224 17.734 -10.123 -15.919 1.00 0.00 H ATOM 3316 H ALA A 224 19.237 -7.880 -18.289 1.00 0.00 H ATOM 3317 N THR A 225 17.735 -10.801 -19.520 1.00 27.65 N ATOM 3318 CA THR A 225 17.032 -11.880 -20.268 1.00 30.48 C ATOM 3319 C THR A 225 18.014 -13.042 -20.521 1.00 27.96 C ATOM 3320 O THR A 225 17.607 -14.144 -20.857 1.00 34.80 O ATOM 3321 CB THR A 225 16.477 -11.433 -21.659 1.00 25.56 C ATOM 3322 OG1 THR A 225 17.545 -10.881 -22.425 1.00 23.40 O ATOM 3323 CG2 THR A 225 15.350 -10.393 -21.550 1.00 24.20 C ATOM 3324 HA THR A 225 16.184 -12.169 -19.647 1.00 0.00 H ATOM 3325 HB THR A 225 16.056 -12.316 -22.140 1.00 0.00 H ATOM 3326 HG1 THR A 225 17.202 -10.595 -23.309 1.00 0.00 H ATOM 3327 HG23 THR A 225 14.529 -10.808 -20.965 1.00 0.00 H ATOM 3328 HG21 THR A 225 15.730 -9.497 -21.059 1.00 0.00 H ATOM 3329 HG22 THR A 225 14.994 -10.139 -22.548 1.00 0.00 H ATOM 3330 H THR A 225 17.842 -9.864 -19.958 1.00 0.00 H ATOM 3331 N ALA A 226 19.309 -12.748 -20.416 1.00 25.14 N ATOM 3332 CA ALA A 226 20.363 -13.721 -20.613 1.00 23.57 C ATOM 3333 C ALA A 226 20.772 -14.283 -19.264 1.00 24.38 C ATOM 3334 O ALA A 226 21.729 -15.066 -19.167 1.00 25.58 O ATOM 3335 CB ALA A 226 21.539 -13.085 -21.314 1.00 13.67 C ATOM 3336 HA ALA A 226 20.003 -14.534 -21.243 1.00 0.00 H ATOM 3337 HB1 ALA A 226 21.220 -12.704 -22.284 1.00 0.00 H ATOM 3338 HB2 ALA A 226 21.921 -12.264 -20.708 1.00 0.00 H ATOM 3339 HB3 ALA A 226 22.323 -13.830 -21.455 1.00 0.00 H ATOM 3340 H ALA A 226 19.576 -11.771 -20.181 1.00 0.00 H ATOM 3341 N GLY A 227 20.048 -13.874 -18.215 1.00 24.33 N ATOM 3342 CA GLY A 227 20.245 -14.433 -16.874 1.00 21.56 C ATOM 3343 C GLY A 227 21.053 -13.522 -15.973 1.00 25.46 C ATOM 3344 O GLY A 227 21.528 -12.460 -16.403 1.00 23.00 O ATOM 3345 HA3 GLY A 227 20.767 -15.385 -16.966 1.00 0.00 H ATOM 3346 HA2 GLY A 227 19.269 -14.598 -16.418 1.00 0.00 H ATOM 3347 H GLY A 227 19.326 -13.139 -18.355 1.00 0.00 H ATOM 3348 N ALA A 228 21.232 -13.971 -14.733 1.00 25.57 N ATOM 3349 CA ALA A 228 21.852 -13.194 -13.663 1.00 27.48 C ATOM 3350 C ALA A 228 23.354 -12.941 -13.799 1.00 26.25 C ATOM 3351 O ALA A 228 23.799 -11.814 -13.539 1.00 31.96 O ATOM 3352 CB ALA A 228 21.525 -13.802 -12.300 1.00 25.73 C ATOM 3353 HA ALA A 228 21.407 -12.203 -13.754 1.00 0.00 H ATOM 3354 HB1 ALA A 228 20.445 -13.806 -12.155 1.00 0.00 H ATOM 3355 HB2 ALA A 228 21.902 -14.824 -12.260 1.00 0.00 H ATOM 3356 HB3 ALA A 228 21.996 -13.209 -11.516 1.00 0.00 H ATOM 3357 H ALA A 228 20.910 -14.935 -14.512 1.00 0.00 H ATOM 3358 N GLN A 229 24.144 -13.920 -14.245 1.00 26.55 N ATOM 3359 CA GLN A 229 25.570 -13.635 -14.442 1.00 25.32 C ATOM 3360 C GLN A 229 25.745 -12.541 -15.524 1.00 27.86 C ATOM 3361 O GLN A 229 26.520 -11.607 -15.369 1.00 29.60 O ATOM 3362 CB GLN A 229 26.341 -14.894 -14.815 1.00 31.77 C ATOM 3363 CG GLN A 229 27.848 -14.711 -14.963 1.00 29.68 C ATOM 3364 CD GLN A 229 28.551 -14.598 -13.613 1.00 43.82 C ATOM 3365 OE1 GLN A 229 28.225 -15.326 -12.672 1.00 50.04 O ATOM 3366 NE2 GLN A 229 29.520 -13.680 -13.506 1.00 45.19 N ATOM 3367 HA GLN A 229 25.980 -13.269 -13.501 1.00 0.00 H ATOM 3368 HB2 GLN A 229 26.166 -15.640 -14.039 1.00 0.00 H ATOM 3369 HB3 GLN A 229 25.950 -15.260 -15.764 1.00 0.00 H ATOM 3370 HG2 GLN A 229 28.255 -15.568 -15.500 1.00 0.00 H ATOM 3371 HG3 GLN A 229 28.037 -13.802 -15.535 1.00 0.00 H ATOM 3372 HE22 GLN A 229 29.765 -13.085 -14.323 1.00 0.00 H ATOM 3373 HE21 GLN A 229 30.027 -13.562 -12.606 1.00 0.00 H ATOM 3374 H GLN A 229 23.758 -14.864 -14.448 1.00 0.00 H ATOM 3375 N ALA A 230 24.965 -12.637 -16.590 1.00 24.80 N ATOM 3376 CA ALA A 230 24.996 -11.656 -17.646 1.00 23.98 C ATOM 3377 C ALA A 230 24.645 -10.215 -17.136 1.00 23.69 C ATOM 3378 O ALA A 230 25.289 -9.231 -17.539 1.00 20.34 O ATOM 3379 CB ALA A 230 24.056 -12.117 -18.808 1.00 22.93 C ATOM 3380 HA ALA A 230 26.016 -11.588 -18.025 1.00 0.00 H ATOM 3381 HB1 ALA A 230 24.399 -13.078 -19.192 1.00 0.00 H ATOM 3382 HB2 ALA A 230 23.038 -12.217 -18.432 1.00 0.00 H ATOM 3383 HB3 ALA A 230 24.078 -11.376 -19.607 1.00 0.00 H ATOM 3384 H ALA A 230 24.312 -13.443 -16.667 1.00 0.00 H ATOM 3385 N ALA A 231 23.655 -10.097 -16.246 1.00 18.94 N ATOM 3386 CA ALA A 231 23.252 -8.766 -15.721 1.00 22.74 C ATOM 3387 C ALA A 231 24.311 -8.175 -14.817 1.00 26.67 C ATOM 3388 O ALA A 231 24.612 -6.977 -14.876 1.00 30.66 O ATOM 3389 CB ALA A 231 21.895 -8.844 -14.982 1.00 17.94 C ATOM 3390 HA ALA A 231 23.140 -8.105 -16.581 1.00 0.00 H ATOM 3391 HB1 ALA A 231 21.127 -9.194 -15.672 1.00 0.00 H ATOM 3392 HB2 ALA A 231 21.978 -9.538 -14.146 1.00 0.00 H ATOM 3393 HB3 ALA A 231 21.628 -7.855 -14.610 1.00 0.00 H ATOM 3394 H ALA A 231 23.159 -10.949 -15.916 1.00 0.00 H ATOM 3395 N LEU A 232 24.889 -9.029 -13.977 1.00 30.78 N ATOM 3396 CA LEU A 232 25.941 -8.601 -13.066 1.00 32.34 C ATOM 3397 C LEU A 232 27.224 -8.218 -13.787 1.00 29.64 C ATOM 3398 O LEU A 232 27.858 -7.216 -13.463 1.00 30.31 O ATOM 3399 CB LEU A 232 26.212 -9.666 -11.997 1.00 31.91 C ATOM 3400 CG LEU A 232 25.195 -9.681 -10.844 1.00 34.23 C ATOM 3401 CD1 LEU A 232 25.243 -11.029 -10.111 1.00 31.66 C ATOM 3402 CD2 LEU A 232 25.349 -8.451 -9.864 1.00 26.22 C ATOM 3403 HA LEU A 232 25.577 -7.700 -12.573 1.00 0.00 H ATOM 3404 HB2 LEU A 232 26.197 -10.644 -12.478 1.00 0.00 H ATOM 3405 HB3 LEU A 232 27.201 -9.484 -11.577 1.00 0.00 H ATOM 3406 HG LEU A 232 24.203 -9.568 -11.281 1.00 0.00 H ATOM 3407 HD21 LEU A 232 26.347 -8.461 -9.425 1.00 0.00 H ATOM 3408 HD22 LEU A 232 25.204 -7.525 -10.420 1.00 0.00 H ATOM 3409 HD23 LEU A 232 24.602 -8.522 -9.074 1.00 0.00 H ATOM 3410 HD11 LEU A 232 25.002 -11.830 -10.810 1.00 0.00 H ATOM 3411 HD12 LEU A 232 26.243 -11.186 -9.707 1.00 0.00 H ATOM 3412 HD13 LEU A 232 24.518 -11.025 -9.297 1.00 0.00 H ATOM 3413 H LEU A 232 24.583 -10.023 -13.971 1.00 0.00 H ATOM 3414 N ASP A 233 27.582 -9.013 -14.776 1.00 29.38 N ATOM 3415 CA ASP A 233 28.780 -8.777 -15.575 1.00 27.31 C ATOM 3416 C ASP A 233 28.640 -7.517 -16.433 1.00 22.27 C ATOM 3417 O ASP A 233 29.586 -6.796 -16.619 1.00 29.05 O ATOM 3418 CB ASP A 233 29.111 -10.042 -16.397 1.00 20.48 C ATOM 3419 CG ASP A 233 29.738 -11.167 -15.525 1.00 31.42 C ATOM 3420 OD1 ASP A 233 29.902 -11.002 -14.298 1.00 41.71 O ATOM 3421 OD2 ASP A 233 30.093 -12.231 -16.038 1.00 32.18 O ATOM 3422 HA ASP A 233 29.626 -8.586 -14.915 1.00 0.00 H ATOM 3423 HB2 ASP A 233 28.192 -10.418 -16.847 1.00 0.00 H ATOM 3424 HB3 ASP A 233 29.816 -9.774 -17.184 1.00 0.00 H ATOM 3425 H ASP A 233 26.989 -9.839 -14.995 1.00 0.00 H ATOM 3426 N ALA A 234 27.454 -7.204 -16.889 1.00 22.24 N ATOM 3427 CA ALA A 234 27.191 -5.988 -17.628 1.00 21.79 C ATOM 3428 C ALA A 234 27.300 -4.704 -16.812 1.00 17.55 C ATOM 3429 O ALA A 234 27.874 -3.759 -17.231 1.00 21.63 O ATOM 3430 CB ALA A 234 25.857 -6.075 -18.344 1.00 8.68 C ATOM 3431 HA ALA A 234 27.993 -5.916 -18.362 1.00 0.00 H ATOM 3432 HB1 ALA A 234 25.873 -6.914 -19.039 1.00 0.00 H ATOM 3433 HB2 ALA A 234 25.062 -6.223 -17.613 1.00 0.00 H ATOM 3434 HB3 ALA A 234 25.680 -5.150 -18.893 1.00 0.00 H ATOM 3435 H ALA A 234 26.665 -7.858 -16.712 1.00 0.00 H ATOM 3436 N ALA A 235 26.753 -4.724 -15.623 1.00 23.28 N ATOM 3437 CA ALA A 235 26.879 -3.641 -14.695 1.00 27.22 C ATOM 3438 C ALA A 235 28.310 -3.501 -14.228 1.00 23.42 C ATOM 3439 O ALA A 235 28.826 -2.443 -14.128 1.00 25.41 O ATOM 3440 CB ALA A 235 25.921 -3.838 -13.532 1.00 28.75 C ATOM 3441 HA ALA A 235 26.611 -2.710 -15.195 1.00 0.00 H ATOM 3442 HB1 ALA A 235 24.898 -3.872 -13.907 1.00 0.00 H ATOM 3443 HB2 ALA A 235 26.155 -4.774 -13.025 1.00 0.00 H ATOM 3444 HB3 ALA A 235 26.025 -3.009 -12.832 1.00 0.00 H ATOM 3445 H ALA A 235 26.204 -5.561 -15.341 1.00 0.00 H ATOM 3446 N ARG A 236 28.957 -4.610 -13.989 1.00 25.78 N ATOM 3447 CA ARG A 236 30.318 -4.610 -13.557 1.00 26.59 C ATOM 3448 C ARG A 236 31.202 -3.916 -14.573 1.00 32.20 C ATOM 3449 O ARG A 236 32.022 -3.113 -14.236 1.00 29.78 O ATOM 3450 CB ARG A 236 30.753 -6.029 -13.372 1.00 30.63 C ATOM 3451 CG ARG A 236 32.004 -6.229 -12.647 1.00 46.70 C ATOM 3452 CD ARG A 236 32.460 -5.052 -11.837 1.00 55.01 C ATOM 3453 NE ARG A 236 32.446 -5.316 -10.407 1.00 63.26 N ATOM 3454 CZ ARG A 236 32.854 -4.459 -9.482 1.00 65.19 C ATOM 3455 NH1 ARG A 236 33.348 -3.288 -9.838 1.00 59.41 N ATOM 3456 NH2 ARG A 236 32.795 -4.791 -8.202 1.00 60.20 N ATOM 3457 HA ARG A 236 30.405 -4.067 -12.616 1.00 0.00 H ATOM 3458 HB2 ARG A 236 29.966 -6.551 -12.828 1.00 0.00 H ATOM 3459 HB3 ARG A 236 30.866 -6.474 -14.360 1.00 0.00 H ATOM 3460 HG2 ARG A 236 31.873 -7.075 -11.972 1.00 0.00 H ATOM 3461 HG3 ARG A 236 32.783 -6.463 -13.373 1.00 0.00 H ATOM 3462 HD2 ARG A 236 31.800 -4.210 -12.043 1.00 0.00 H ATOM 3463 HD3 ARG A 236 33.477 -4.796 -12.135 1.00 0.00 H ATOM 3464 HE ARG A 236 32.092 -6.240 -10.088 1.00 0.00 H ATOM 3465 HH12 ARG A 236 33.668 -2.616 -9.112 1.00 0.00 H ATOM 3466 HH11 ARG A 236 33.417 -3.037 -10.845 1.00 0.00 H ATOM 3467 HH22 ARG A 236 33.115 -4.119 -7.475 1.00 0.00 H ATOM 3468 HH21 ARG A 236 32.429 -5.724 -7.923 1.00 0.00 H ATOM 3469 H ARG A 236 28.467 -5.519 -14.117 1.00 0.00 H ATOM 3470 N ALA A 237 30.986 -4.231 -15.834 1.00 27.01 N ATOM 3471 CA ALA A 237 31.771 -3.707 -16.909 1.00 22.73 C ATOM 3472 C ALA A 237 31.602 -2.227 -17.067 1.00 26.38 C ATOM 3473 O ALA A 237 32.521 -1.534 -17.363 1.00 30.82 O ATOM 3474 CB ALA A 237 31.448 -4.429 -18.197 1.00 17.17 C ATOM 3475 HA ALA A 237 32.819 -3.879 -16.662 1.00 0.00 H ATOM 3476 HB1 ALA A 237 31.666 -5.491 -18.082 1.00 0.00 H ATOM 3477 HB2 ALA A 237 30.392 -4.297 -18.431 1.00 0.00 H ATOM 3478 HB3 ALA A 237 32.054 -4.018 -19.004 1.00 0.00 H ATOM 3479 H ALA A 237 30.212 -4.889 -16.057 1.00 0.00 H ATOM 3480 N VAL A 238 30.407 -1.746 -16.841 1.00 27.89 N ATOM 3481 CA VAL A 238 30.138 -0.360 -16.980 1.00 25.55 C ATOM 3482 C VAL A 238 30.838 0.355 -15.848 1.00 29.57 C ATOM 3483 O VAL A 238 31.425 1.384 -16.023 1.00 31.56 O ATOM 3484 CB VAL A 238 28.636 -0.102 -17.006 1.00 25.87 C ATOM 3485 CG1 VAL A 238 28.303 1.332 -16.812 1.00 17.93 C ATOM 3486 CG2 VAL A 238 28.030 -0.667 -18.234 1.00 16.22 C ATOM 3487 HA VAL A 238 30.518 0.022 -17.928 1.00 0.00 H ATOM 3488 HB VAL A 238 28.196 -0.621 -16.154 1.00 0.00 H ATOM 3489 HG11 VAL A 238 28.685 1.665 -15.847 1.00 0.00 H ATOM 3490 HG12 VAL A 238 28.759 1.921 -17.608 1.00 0.00 H ATOM 3491 HG13 VAL A 238 27.221 1.459 -16.839 1.00 0.00 H ATOM 3492 HG21 VAL A 238 28.484 -0.201 -19.109 1.00 0.00 H ATOM 3493 HG22 VAL A 238 28.204 -1.743 -18.262 1.00 0.00 H ATOM 3494 HG23 VAL A 238 26.958 -0.471 -18.232 1.00 0.00 H ATOM 3495 H VAL A 238 29.642 -2.390 -16.555 1.00 0.00 H ATOM 3496 N LEU A 239 30.812 -0.226 -14.680 1.00 30.77 N ATOM 3497 CA LEU A 239 31.449 0.452 -13.547 1.00 31.95 C ATOM 3498 C LEU A 239 32.956 0.490 -13.683 1.00 33.67 C ATOM 3499 O LEU A 239 33.589 1.510 -13.343 1.00 39.11 O ATOM 3500 CB LEU A 239 31.002 -0.118 -12.209 1.00 22.07 C ATOM 3501 CG LEU A 239 29.537 0.241 -11.880 1.00 24.11 C ATOM 3502 CD1 LEU A 239 29.063 -0.612 -10.769 1.00 20.19 C ATOM 3503 CD2 LEU A 239 29.327 1.752 -11.498 1.00 18.20 C ATOM 3504 HA LEU A 239 31.108 1.487 -13.568 1.00 0.00 H ATOM 3505 HB2 LEU A 239 31.099 -1.203 -12.240 1.00 0.00 H ATOM 3506 HB3 LEU A 239 31.646 0.281 -11.425 1.00 0.00 H ATOM 3507 HG LEU A 239 28.961 0.065 -12.789 1.00 0.00 H ATOM 3508 HD21 LEU A 239 29.925 1.990 -10.619 1.00 0.00 H ATOM 3509 HD22 LEU A 239 29.637 2.383 -12.331 1.00 0.00 H ATOM 3510 HD23 LEU A 239 28.273 1.927 -11.280 1.00 0.00 H ATOM 3511 HD11 LEU A 239 29.125 -1.659 -11.065 1.00 0.00 H ATOM 3512 HD12 LEU A 239 29.687 -0.443 -9.891 1.00 0.00 H ATOM 3513 HD13 LEU A 239 28.029 -0.360 -10.535 1.00 0.00 H ATOM 3514 H LEU A 239 30.350 -1.149 -14.556 1.00 0.00 H ATOM 3515 N ASP A 240 33.527 -0.586 -14.219 1.00 34.22 N ATOM 3516 CA ASP A 240 34.990 -0.651 -14.455 1.00 37.83 C ATOM 3517 C ASP A 240 35.477 0.341 -15.524 1.00 37.60 C ATOM 3518 O ASP A 240 36.604 0.771 -15.479 1.00 38.11 O ATOM 3519 CB ASP A 240 35.415 -2.069 -14.833 1.00 37.17 C ATOM 3520 CG ASP A 240 35.182 -3.053 -13.708 1.00 45.83 C ATOM 3521 OD1 ASP A 240 35.046 -2.608 -12.536 1.00 51.58 O ATOM 3522 OD2 ASP A 240 35.122 -4.268 -13.987 1.00 42.73 O ATOM 3523 HA ASP A 240 35.460 -0.364 -13.514 1.00 0.00 H ATOM 3524 HB2 ASP A 240 34.841 -2.388 -15.703 1.00 0.00 H ATOM 3525 HB3 ASP A 240 36.476 -2.064 -15.081 1.00 0.00 H ATOM 3526 H ASP A 240 32.934 -1.400 -14.478 1.00 0.00 H ATOM 3527 N ALA A 241 34.603 0.712 -16.462 1.00 41.17 N ATOM 3528 CA ALA A 241 34.948 1.639 -17.533 1.00 42.68 C ATOM 3529 C ALA A 241 34.828 3.083 -17.086 1.00 45.98 C ATOM 3530 O ALA A 241 34.988 3.989 -17.909 1.00 45.27 O ATOM 3531 CB ALA A 241 34.066 1.388 -18.794 1.00 38.35 C ATOM 3532 HA ALA A 241 35.990 1.455 -17.794 1.00 0.00 H ATOM 3533 HB1 ALA A 241 34.223 0.369 -19.148 1.00 0.00 H ATOM 3534 HB2 ALA A 241 33.016 1.527 -18.535 1.00 0.00 H ATOM 3535 HB3 ALA A 241 34.345 2.093 -19.577 1.00 0.00 H ATOM 3536 H ALA A 241 33.638 0.325 -16.428 1.00 0.00 H ATOM 3537 N ALA A 242 34.525 3.298 -15.799 1.00 50.08 N ATOM 3538 CA ALA A 242 34.202 4.650 -15.293 1.00 48.98 C ATOM 3539 C ALA A 242 35.257 5.151 -14.323 1.00 50.77 C ATOM 3540 O ALA A 242 35.644 4.434 -13.387 1.00 42.93 O ATOM 3541 CB ALA A 242 32.798 4.720 -14.669 1.00 43.99 C ATOM 3542 HA ALA A 242 34.202 5.313 -16.158 1.00 0.00 H ATOM 3543 HB1 ALA A 242 32.054 4.453 -15.420 1.00 0.00 H ATOM 3544 HB2 ALA A 242 32.738 4.023 -13.833 1.00 0.00 H ATOM 3545 HB3 ALA A 242 32.610 5.733 -14.313 1.00 0.00 H ATOM 3546 H ALA A 242 34.517 2.494 -15.139 1.00 0.00 H ATOM 3547 N PRO A 243 35.694 6.405 -14.529 1.00 55.30 N ATOM 3548 CA PRO A 243 36.938 6.870 -13.930 1.00 57.95 C ATOM 3549 C PRO A 243 36.814 7.244 -12.452 1.00 54.27 C ATOM 3550 O PRO A 243 36.041 8.153 -12.097 1.00 54.20 O ATOM 3551 CB PRO A 243 37.309 8.092 -14.801 1.00 62.61 C ATOM 3552 CG PRO A 243 35.992 8.611 -15.339 1.00 62.65 C ATOM 3553 CD PRO A 243 35.011 7.461 -15.317 1.00 58.04 C ATOM 3554 HA PRO A 243 37.697 6.088 -13.921 1.00 0.00 H ATOM 3555 HD3 PRO A 243 34.079 7.758 -14.837 1.00 0.00 H ATOM 3556 HD2 PRO A 243 34.802 7.113 -16.329 1.00 0.00 H ATOM 3557 HG3 PRO A 243 36.122 8.971 -16.360 1.00 0.00 H ATOM 3558 HG2 PRO A 243 35.627 9.424 -14.712 1.00 0.00 H ATOM 3559 HB2 PRO A 243 37.804 8.855 -14.199 1.00 0.00 H ATOM 3560 HB3 PRO A 243 37.965 7.794 -15.619 1.00 0.00 H ATOM 3561 N GLY A 244 37.582 6.564 -11.597 1.00 50.77 N ATOM 3562 CA GLY A 244 37.515 6.872 -10.154 1.00 50.70 C ATOM 3563 C GLY A 244 36.052 6.901 -9.709 1.00 47.90 C ATOM 3564 O GLY A 244 35.519 7.896 -9.194 1.00 40.80 O ATOM 3565 HA3 GLY A 244 37.972 7.844 -9.968 1.00 0.00 H ATOM 3566 HA2 GLY A 244 38.051 6.107 -9.593 1.00 0.00 H ATOM 3567 H GLY A 244 38.223 5.823 -11.945 1.00 0.00 H ATOM 3568 N VAL A 245 35.390 5.804 -10.022 1.00 42.52 N ATOM 3569 CA VAL A 245 34.230 5.361 -9.319 1.00 40.91 C ATOM 3570 C VAL A 245 34.775 4.179 -8.527 1.00 42.60 C ATOM 3571 O VAL A 245 35.323 3.244 -9.127 1.00 44.41 O ATOM 3572 CB VAL A 245 33.165 4.895 -10.320 1.00 37.54 C ATOM 3573 CG1 VAL A 245 32.343 3.777 -9.728 1.00 40.15 C ATOM 3574 CG2 VAL A 245 32.303 6.100 -10.793 1.00 29.67 C ATOM 3575 HA VAL A 245 33.758 6.123 -8.699 1.00 0.00 H ATOM 3576 HB VAL A 245 33.650 4.490 -11.208 1.00 0.00 H ATOM 3577 HG11 VAL A 245 32.995 2.938 -9.485 1.00 0.00 H ATOM 3578 HG12 VAL A 245 31.850 4.130 -8.822 1.00 0.00 H ATOM 3579 HG13 VAL A 245 31.592 3.458 -10.451 1.00 0.00 H ATOM 3580 HG21 VAL A 245 31.809 6.552 -9.933 1.00 0.00 H ATOM 3581 HG22 VAL A 245 32.945 6.838 -11.274 1.00 0.00 H ATOM 3582 HG23 VAL A 245 31.552 5.752 -11.503 1.00 0.00 H ATOM 3583 H VAL A 245 35.731 5.233 -10.822 1.00 0.00 H ATOM 3584 N ALA A 246 34.682 4.218 -7.196 1.00 38.19 N ATOM 3585 CA ALA A 246 35.161 3.068 -6.440 1.00 35.69 C ATOM 3586 C ALA A 246 34.009 2.269 -5.827 1.00 33.27 C ATOM 3587 O ALA A 246 33.293 2.727 -4.933 1.00 27.60 O ATOM 3588 CB ALA A 246 36.201 3.471 -5.390 1.00 32.05 C ATOM 3589 HA ALA A 246 35.663 2.407 -7.147 1.00 0.00 H ATOM 3590 HB1 ALA A 246 37.054 3.936 -5.885 1.00 0.00 H ATOM 3591 HB2 ALA A 246 35.755 4.179 -4.692 1.00 0.00 H ATOM 3592 HB3 ALA A 246 36.532 2.584 -4.849 1.00 0.00 H ATOM 3593 H ALA A 246 34.279 5.046 -6.712 1.00 0.00 H ATOM 3594 N VAL A 247 33.863 1.045 -6.298 1.00 30.10 N ATOM 3595 CA VAL A 247 32.686 0.282 -5.967 1.00 35.44 C ATOM 3596 C VAL A 247 32.772 -0.276 -4.559 1.00 39.87 C ATOM 3597 O VAL A 247 33.678 -1.043 -4.247 1.00 41.17 O ATOM 3598 CB VAL A 247 32.388 -0.820 -7.027 1.00 35.52 C ATOM 3599 CG1 VAL A 247 31.304 -1.751 -6.525 1.00 35.42 C ATOM 3600 CG2 VAL A 247 31.995 -0.177 -8.401 1.00 31.68 C ATOM 3601 HA VAL A 247 31.835 0.963 -5.990 1.00 0.00 H ATOM 3602 HB VAL A 247 33.293 -1.407 -7.185 1.00 0.00 H ATOM 3603 HG11 VAL A 247 31.633 -2.225 -5.600 1.00 0.00 H ATOM 3604 HG12 VAL A 247 30.394 -1.180 -6.338 1.00 0.00 H ATOM 3605 HG13 VAL A 247 31.107 -2.516 -7.276 1.00 0.00 H ATOM 3606 HG21 VAL A 247 31.104 0.438 -8.272 1.00 0.00 H ATOM 3607 HG22 VAL A 247 32.817 0.443 -8.759 1.00 0.00 H ATOM 3608 HG23 VAL A 247 31.792 -0.966 -9.125 1.00 0.00 H ATOM 3609 H VAL A 247 34.597 0.631 -6.908 1.00 0.00 H ATOM 3610 N ASP A 248 31.816 0.127 -3.719 1.00 40.69 N ATOM 3611 CA ASP A 248 31.601 -0.452 -2.396 1.00 34.98 C ATOM 3612 C ASP A 248 30.924 -1.815 -2.512 1.00 32.93 C ATOM 3613 O ASP A 248 31.451 -2.813 -2.077 1.00 32.96 O ATOM 3614 CB ASP A 248 30.695 0.473 -1.605 1.00 44.09 C ATOM 3615 CG ASP A 248 31.402 1.184 -0.503 1.00 50.78 C ATOM 3616 OD1 ASP A 248 32.513 1.738 -0.722 1.00 56.73 O ATOM 3617 OD2 ASP A 248 30.814 1.192 0.602 1.00 60.46 O ATOM 3618 HA ASP A 248 32.564 -0.574 -1.899 1.00 0.00 H ATOM 3619 HB2 ASP A 248 30.278 1.215 -2.285 1.00 0.00 H ATOM 3620 HB3 ASP A 248 29.887 -0.118 -1.174 1.00 0.00 H ATOM 3621 H ASP A 248 31.188 0.898 -4.025 1.00 0.00 H ATOM 3622 N TYR A 249 29.728 -1.876 -3.076 1.00 31.76 N ATOM 3623 CA TYR A 249 29.171 -3.195 -3.361 1.00 32.29 C ATOM 3624 C TYR A 249 28.317 -3.163 -4.610 1.00 27.59 C ATOM 3625 O TYR A 249 27.967 -2.097 -5.115 1.00 32.11 O ATOM 3626 CB TYR A 249 28.428 -3.823 -2.144 1.00 30.53 C ATOM 3627 CG TYR A 249 27.277 -2.981 -1.620 1.00 32.46 C ATOM 3628 CD1 TYR A 249 26.042 -2.986 -2.270 1.00 29.98 C ATOM 3629 CD2 TYR A 249 27.424 -2.176 -0.467 1.00 28.56 C ATOM 3630 CE1 TYR A 249 25.003 -2.204 -1.833 1.00 28.16 C ATOM 3631 CE2 TYR A 249 26.370 -1.409 -0.009 1.00 25.96 C ATOM 3632 CZ TYR A 249 25.163 -1.434 -0.701 1.00 31.33 C ATOM 3633 OH TYR A 249 24.101 -0.675 -0.297 1.00 29.71 O ATOM 3634 HA TYR A 249 30.013 -3.860 -3.554 1.00 0.00 H ATOM 3635 HB3 TYR A 249 29.147 -3.961 -1.337 1.00 0.00 H ATOM 3636 HB2 TYR A 249 28.033 -4.793 -2.446 1.00 0.00 H ATOM 3637 HD2 TYR A 249 28.376 -2.160 0.064 1.00 0.00 H ATOM 3638 HE2 TYR A 249 26.482 -0.792 0.883 1.00 0.00 H ATOM 3639 HE1 TYR A 249 24.058 -2.192 -2.377 1.00 0.00 H ATOM 3640 HD1 TYR A 249 25.900 -3.624 -3.142 1.00 0.00 H ATOM 3641 HH TYR A 249 24.355 0.282 -0.314 1.00 0.00 H ATOM 3642 H TYR A 249 29.201 -1.010 -3.309 1.00 0.00 H ATOM 3643 N LEU A 250 28.028 -4.342 -5.129 1.00 24.30 N ATOM 3644 CA LEU A 250 27.153 -4.463 -6.263 1.00 25.95 C ATOM 3645 C LEU A 250 26.467 -5.827 -6.136 1.00 25.35 C ATOM 3646 O LEU A 250 27.056 -6.867 -6.393 1.00 24.75 O ATOM 3647 CB LEU A 250 27.950 -4.311 -7.566 1.00 22.70 C ATOM 3648 CG LEU A 250 27.207 -4.670 -8.852 1.00 22.65 C ATOM 3649 CD1 LEU A 250 26.022 -3.730 -9.100 1.00 19.28 C ATOM 3650 CD2 LEU A 250 28.234 -4.608 -9.940 1.00 25.43 C ATOM 3651 HA LEU A 250 26.398 -3.678 -6.288 1.00 0.00 H ATOM 3652 HB2 LEU A 250 28.268 -3.271 -7.643 1.00 0.00 H ATOM 3653 HB3 LEU A 250 28.828 -4.954 -7.497 1.00 0.00 H ATOM 3654 HG LEU A 250 26.761 -5.663 -8.800 1.00 0.00 H ATOM 3655 HD21 LEU A 250 28.650 -3.602 -9.988 1.00 0.00 H ATOM 3656 HD22 LEU A 250 29.030 -5.322 -9.728 1.00 0.00 H ATOM 3657 HD23 LEU A 250 27.767 -4.856 -10.893 1.00 0.00 H ATOM 3658 HD11 LEU A 250 25.323 -3.801 -8.267 1.00 0.00 H ATOM 3659 HD12 LEU A 250 26.384 -2.706 -9.186 1.00 0.00 H ATOM 3660 HD13 LEU A 250 25.519 -4.017 -10.023 1.00 0.00 H ATOM 3661 H LEU A 250 28.441 -5.199 -4.710 1.00 0.00 H ATOM 3662 N GLU A 251 25.206 -5.810 -5.731 1.00 26.81 N ATOM 3663 CA GLU A 251 24.571 -7.018 -5.282 1.00 26.30 C ATOM 3664 C GLU A 251 23.214 -7.219 -5.871 1.00 22.63 C ATOM 3665 O GLU A 251 22.434 -6.285 -5.995 1.00 21.13 O ATOM 3666 CB GLU A 251 24.511 -7.035 -3.744 1.00 33.49 C ATOM 3667 CG GLU A 251 25.879 -7.374 -3.112 1.00 40.87 C ATOM 3668 CD GLU A 251 25.765 -8.135 -1.817 1.00 46.19 C ATOM 3669 OE1 GLU A 251 24.947 -9.080 -1.736 1.00 46.26 O ATOM 3670 OE2 GLU A 251 26.514 -7.798 -0.877 1.00 53.08 O ATOM 3671 HA GLU A 251 25.178 -7.852 -5.633 1.00 0.00 H ATOM 3672 HB2 GLU A 251 24.196 -6.052 -3.394 1.00 0.00 H ATOM 3673 HB3 GLU A 251 23.783 -7.783 -3.429 1.00 0.00 H ATOM 3674 HG2 GLU A 251 26.447 -7.978 -3.820 1.00 0.00 H ATOM 3675 HG3 GLU A 251 26.412 -6.443 -2.921 1.00 0.00 H ATOM 3676 H GLU A 251 24.673 -4.917 -5.738 1.00 0.00 H ATOM 3677 N LEU A 252 22.944 -8.472 -6.228 1.00 26.05 N ATOM 3678 CA LEU A 252 21.665 -8.870 -6.799 1.00 30.23 C ATOM 3679 C LEU A 252 20.888 -9.674 -5.765 1.00 28.04 C ATOM 3680 O LEU A 252 21.330 -10.710 -5.313 1.00 26.88 O ATOM 3681 CB LEU A 252 21.866 -9.662 -8.108 1.00 29.30 C ATOM 3682 CG LEU A 252 20.605 -10.208 -8.799 1.00 34.29 C ATOM 3683 CD1 LEU A 252 19.602 -9.109 -9.063 1.00 40.00 C ATOM 3684 CD2 LEU A 252 20.961 -10.911 -10.102 1.00 36.93 C ATOM 3685 HA LEU A 252 21.088 -7.982 -7.057 1.00 0.00 H ATOM 3686 HB2 LEU A 252 22.369 -9.004 -8.816 1.00 0.00 H ATOM 3687 HB3 LEU A 252 22.511 -10.512 -7.882 1.00 0.00 H ATOM 3688 HG LEU A 252 20.151 -10.931 -8.122 1.00 0.00 H ATOM 3689 HD21 LEU A 252 21.451 -10.205 -10.772 1.00 0.00 H ATOM 3690 HD22 LEU A 252 21.634 -11.742 -9.893 1.00 0.00 H ATOM 3691 HD23 LEU A 252 20.052 -11.288 -10.570 1.00 0.00 H ATOM 3692 HD11 LEU A 252 19.309 -8.652 -8.118 1.00 0.00 H ATOM 3693 HD12 LEU A 252 20.052 -8.355 -9.709 1.00 0.00 H ATOM 3694 HD13 LEU A 252 18.724 -9.530 -9.552 1.00 0.00 H ATOM 3695 H LEU A 252 23.677 -9.197 -6.094 1.00 0.00 H ATOM 3696 N ARG A 253 19.731 -9.174 -5.363 1.00 28.97 N ATOM 3697 CA ARG A 253 19.015 -9.830 -4.306 1.00 27.70 C ATOM 3698 C ARG A 253 17.594 -10.111 -4.681 1.00 32.98 C ATOM 3699 O ARG A 253 17.062 -9.603 -5.684 1.00 30.11 O ATOM 3700 CB ARG A 253 19.076 -8.988 -3.041 1.00 28.47 C ATOM 3701 CG ARG A 253 20.477 -8.918 -2.501 1.00 31.68 C ATOM 3702 CD ARG A 253 20.457 -9.057 -1.037 1.00 31.66 C ATOM 3703 NE ARG A 253 21.795 -8.959 -0.472 1.00 35.74 N ATOM 3704 CZ ARG A 253 22.036 -9.034 0.836 1.00 36.05 C ATOM 3705 NH1 ARG A 253 21.002 -9.202 1.668 1.00 30.93 N ATOM 3706 NH2 ARG A 253 23.292 -8.954 1.312 1.00 30.07 N ATOM 3707 HA ARG A 253 19.495 -10.792 -4.125 1.00 0.00 H ATOM 3708 HB2 ARG A 253 18.731 -7.979 -3.268 1.00 0.00 H ATOM 3709 HB3 ARG A 253 18.426 -9.431 -2.287 1.00 0.00 H ATOM 3710 HG2 ARG A 253 21.072 -9.723 -2.933 1.00 0.00 H ATOM 3711 HG3 ARG A 253 20.920 -7.958 -2.767 1.00 0.00 H ATOM 3712 HD2 ARG A 253 20.034 -10.028 -0.779 1.00 0.00 H ATOM 3713 HD3 ARG A 253 19.835 -8.267 -0.615 1.00 0.00 H ATOM 3714 HE ARG A 253 22.599 -8.824 -1.118 1.00 0.00 H ATOM 3715 HH12 ARG A 253 21.164 -9.263 2.693 1.00 0.00 H ATOM 3716 HH11 ARG A 253 20.036 -9.271 1.289 1.00 0.00 H ATOM 3717 HH22 ARG A 253 23.465 -9.014 2.336 1.00 0.00 H ATOM 3718 HH21 ARG A 253 24.090 -8.832 0.656 1.00 0.00 H ATOM 3719 H ARG A 253 19.345 -8.316 -5.807 1.00 0.00 H ATOM 3720 N ASP A 254 16.977 -10.951 -3.869 1.00 33.73 N ATOM 3721 CA ASP A 254 15.550 -11.005 -3.830 1.00 31.75 C ATOM 3722 C ASP A 254 14.955 -9.591 -3.480 1.00 31.13 C ATOM 3723 O ASP A 254 15.612 -8.732 -2.878 1.00 31.85 O ATOM 3724 CB ASP A 254 15.181 -12.060 -2.801 1.00 37.31 C ATOM 3725 CG ASP A 254 13.734 -12.070 -2.507 1.00 42.38 C ATOM 3726 OD1 ASP A 254 12.979 -12.352 -3.480 1.00 43.60 O ATOM 3727 OD2 ASP A 254 13.378 -11.755 -1.334 1.00 43.30 O ATOM 3728 HA ASP A 254 15.130 -11.274 -4.799 1.00 0.00 H ATOM 3729 HB2 ASP A 254 15.469 -13.039 -3.183 1.00 0.00 H ATOM 3730 HB3 ASP A 254 15.726 -11.857 -1.879 1.00 0.00 H ATOM 3731 H ASP A 254 17.534 -11.577 -3.254 1.00 0.00 H ATOM 3732 N ILE A 255 13.715 -9.334 -3.858 1.00 28.72 N ATOM 3733 CA ILE A 255 13.159 -8.040 -3.588 1.00 27.39 C ATOM 3734 C ILE A 255 12.932 -7.684 -2.099 1.00 35.53 C ATOM 3735 O ILE A 255 12.746 -6.480 -1.765 1.00 37.13 O ATOM 3736 CB ILE A 255 11.857 -7.753 -4.384 1.00 25.11 C ATOM 3737 CG1 ILE A 255 10.653 -8.476 -3.798 1.00 30.43 C ATOM 3738 CG2 ILE A 255 12.047 -7.944 -5.879 1.00 27.14 C ATOM 3739 CD1 ILE A 255 9.368 -7.593 -3.929 1.00 37.87 C ATOM 3740 HA ILE A 255 13.959 -7.387 -3.938 1.00 0.00 H ATOM 3741 HB ILE A 255 11.625 -6.694 -4.268 1.00 0.00 H ATOM 3742 HG12 ILE A 255 10.501 -9.413 -4.334 1.00 0.00 H ATOM 3743 HG13 ILE A 255 10.838 -8.687 -2.745 1.00 0.00 H ATOM 3744 HD11 ILE A 255 9.516 -6.656 -3.392 1.00 0.00 H ATOM 3745 HD12 ILE A 255 9.179 -7.383 -4.982 1.00 0.00 H ATOM 3746 HD13 ILE A 255 8.517 -8.126 -3.505 1.00 0.00 H ATOM 3747 HG21 ILE A 255 12.820 -7.264 -6.236 1.00 0.00 H ATOM 3748 HG22 ILE A 255 12.347 -8.973 -6.077 1.00 0.00 H ATOM 3749 HG23 ILE A 255 11.110 -7.732 -6.393 1.00 0.00 H ATOM 3750 H ILE A 255 13.151 -10.060 -4.344 1.00 0.00 H ATOM 3751 N GLY A 256 12.967 -8.691 -1.245 1.00 33.23 N ATOM 3752 CA GLY A 256 12.808 -8.538 0.169 1.00 27.74 C ATOM 3753 C GLY A 256 14.169 -8.510 0.772 1.00 36.23 C ATOM 3754 O GLY A 256 14.321 -8.344 1.941 1.00 34.80 O ATOM 3755 HA3 GLY A 256 12.239 -9.375 0.573 1.00 0.00 H ATOM 3756 HA2 GLY A 256 12.285 -7.607 0.386 1.00 0.00 H ATOM 3757 H GLY A 256 13.119 -9.649 -1.621 1.00 0.00 H ATOM 3758 N LEU A 257 15.148 -8.679 -0.090 1.00 37.17 N ATOM 3759 CA LEU A 257 16.550 -8.484 0.181 1.00 34.44 C ATOM 3760 C LEU A 257 17.198 -9.678 0.867 1.00 38.25 C ATOM 3761 O LEU A 257 18.177 -9.553 1.519 1.00 35.19 O ATOM 3762 CB LEU A 257 16.805 -7.156 0.888 1.00 29.32 C ATOM 3763 CG LEU A 257 16.772 -5.859 0.089 1.00 26.79 C ATOM 3764 CD1 LEU A 257 17.260 -4.687 0.858 1.00 16.52 C ATOM 3765 CD2 LEU A 257 17.523 -5.974 -1.176 1.00 24.54 C ATOM 3766 HA LEU A 257 17.054 -8.418 -0.783 1.00 0.00 H ATOM 3767 HB2 LEU A 257 16.053 -7.065 1.671 1.00 0.00 H ATOM 3768 HB3 LEU A 257 17.794 -7.223 1.342 1.00 0.00 H ATOM 3769 HG LEU A 257 15.720 -5.688 -0.138 1.00 0.00 H ATOM 3770 HD21 LEU A 257 18.563 -6.216 -0.959 1.00 0.00 H ATOM 3771 HD22 LEU A 257 17.085 -6.764 -1.787 1.00 0.00 H ATOM 3772 HD23 LEU A 257 17.473 -5.027 -1.714 1.00 0.00 H ATOM 3773 HD11 LEU A 257 16.635 -4.547 1.740 1.00 0.00 H ATOM 3774 HD12 LEU A 257 18.292 -4.859 1.165 1.00 0.00 H ATOM 3775 HD13 LEU A 257 17.210 -3.797 0.231 1.00 0.00 H ATOM 3776 H LEU A 257 14.888 -8.980 -1.051 1.00 0.00 H ATOM 3777 N GLY A 258 16.626 -10.852 0.666 1.00 47.37 N ATOM 3778 CA GLY A 258 17.217 -12.109 1.095 1.00 51.68 C ATOM 3779 C GLY A 258 18.313 -12.673 0.195 1.00 50.64 C ATOM 3780 O GLY A 258 18.344 -12.479 -1.009 1.00 43.04 O ATOM 3781 HA3 GLY A 258 16.420 -12.850 1.155 1.00 0.00 H ATOM 3782 HA2 GLY A 258 17.644 -11.956 2.086 1.00 0.00 H ATOM 3783 H GLY A 258 15.708 -10.878 0.177 1.00 0.00 H TER 3784 GLY A 258 ATOM 3785 N ASN A 263 16.347 -16.356 -9.369 1.00 83.19 N ATOM 3786 CA ASN A 263 15.751 -15.979 -10.664 1.00 77.01 C ATOM 3787 C ASN A 263 14.369 -15.360 -10.493 1.00 74.65 C ATOM 3788 O ASN A 263 13.830 -15.277 -9.386 1.00 76.42 O ATOM 3789 CB ASN A 263 15.647 -17.165 -11.643 1.00 75.82 C ATOM 3790 CG ASN A 263 16.371 -18.432 -11.153 1.00 77.93 C ATOM 3791 OD1 ASN A 263 16.894 -18.524 -10.022 1.00 75.92 O ATOM 3792 ND2 ASN A 263 16.393 -19.430 -12.027 1.00 81.05 N ATOM 3793 HA ASN A 263 16.431 -15.240 -11.088 1.00 0.00 H ATOM 3794 HB2 ASN A 263 14.593 -17.403 -11.786 1.00 0.00 H ATOM 3795 HB3 ASN A 263 16.083 -16.865 -12.596 1.00 0.00 H ATOM 3796 HD22 ASN A 263 15.946 -19.315 -12.959 1.00 0.00 H ATOM 3797 HD21 ASN A 263 16.857 -20.327 -11.780 1.00 0.00 H ATOM 3798 HN3 ASN A 263 15.734 -17.050 -8.896 1.00 0.00 H ATOM 3799 HN2 ASN A 263 16.440 -15.510 -8.772 1.00 0.00 H ATOM 3800 HN1 ASN A 263 17.286 -16.773 -9.529 1.00 0.00 H ATOM 3801 N GLY A 264 13.775 -14.948 -11.599 1.00 72.52 N ATOM 3802 CA GLY A 264 12.488 -14.288 -11.521 1.00 65.89 C ATOM 3803 C GLY A 264 12.748 -12.837 -11.201 1.00 60.42 C ATOM 3804 O GLY A 264 13.478 -12.165 -11.921 1.00 61.46 O ATOM 3805 HA3 GLY A 264 11.883 -14.741 -10.736 1.00 0.00 H ATOM 3806 HA2 GLY A 264 11.966 -14.373 -12.474 1.00 0.00 H ATOM 3807 H GLY A 264 14.230 -15.097 -12.522 1.00 0.00 H ATOM 3808 N SER A 265 12.180 -12.370 -10.100 1.00 56.51 N ATOM 3809 CA SER A 265 12.193 -10.954 -9.792 1.00 51.30 C ATOM 3810 C SER A 265 13.061 -10.625 -8.601 1.00 49.67 C ATOM 3811 O SER A 265 12.969 -11.266 -7.549 1.00 42.06 O ATOM 3812 CB SER A 265 10.782 -10.418 -9.654 1.00 51.97 C ATOM 3813 OG SER A 265 10.146 -10.538 -10.921 1.00 56.15 O ATOM 3814 HA SER A 265 12.655 -10.441 -10.636 1.00 0.00 H ATOM 3815 HB2 SER A 265 10.810 -9.371 -9.351 1.00 0.00 H ATOM 3816 HB3 SER A 265 10.236 -10.996 -8.908 1.00 0.00 H ATOM 3817 HG SER A 265 9.220 -10.194 -10.858 1.00 0.00 H ATOM 3818 H SER A 265 11.716 -13.031 -9.445 1.00 0.00 H ATOM 3819 N GLY A 266 13.944 -9.644 -8.815 1.00 41.32 N ATOM 3820 CA GLY A 266 14.940 -9.283 -7.832 1.00 34.70 C ATOM 3821 C GLY A 266 15.215 -7.792 -7.813 1.00 30.47 C ATOM 3822 O GLY A 266 14.493 -6.992 -8.380 1.00 26.33 O ATOM 3823 HA3 GLY A 266 15.867 -9.808 -8.063 1.00 0.00 H ATOM 3824 HA2 GLY A 266 14.587 -9.587 -6.847 1.00 0.00 H ATOM 3825 H GLY A 266 13.913 -9.125 -9.716 1.00 0.00 H ATOM 3826 N ARG A 267 16.256 -7.409 -7.113 1.00 25.72 N ATOM 3827 CA ARG A 267 16.597 -6.022 -7.034 1.00 25.40 C ATOM 3828 C ARG A 267 18.088 -6.054 -7.092 1.00 23.95 C ATOM 3829 O ARG A 267 18.694 -6.837 -6.364 1.00 25.12 O ATOM 3830 CB ARG A 267 16.154 -5.392 -5.707 1.00 22.92 C ATOM 3831 CG ARG A 267 16.107 -3.870 -5.757 1.00 23.75 C ATOM 3832 CD ARG A 267 14.721 -3.440 -6.369 1.00 25.52 C ATOM 3833 NE ARG A 267 14.672 -1.987 -6.454 1.00 22.17 N ATOM 3834 CZ ARG A 267 13.634 -1.255 -6.844 1.00 22.28 C ATOM 3835 NH1 ARG A 267 12.491 -1.821 -7.248 1.00 20.89 N ATOM 3836 NH2 ARG A 267 13.760 0.068 -6.823 1.00 17.79 N ATOM 3837 HA ARG A 267 16.118 -5.433 -7.816 1.00 0.00 H ATOM 3838 HB2 ARG A 267 15.159 -5.763 -5.461 1.00 0.00 H ATOM 3839 HB3 ARG A 267 16.855 -5.693 -4.928 1.00 0.00 H ATOM 3840 HG2 ARG A 267 16.208 -3.464 -4.750 1.00 0.00 H ATOM 3841 HG3 ARG A 267 16.918 -3.496 -6.381 1.00 0.00 H ATOM 3842 HD2 ARG A 267 13.913 -3.797 -5.731 1.00 0.00 H ATOM 3843 HD3 ARG A 267 14.612 -3.869 -7.365 1.00 0.00 H ATOM 3844 HE ARG A 267 15.534 -1.472 -6.183 1.00 0.00 H ATOM 3845 HH12 ARG A 267 11.693 -1.225 -7.548 1.00 0.00 H ATOM 3846 HH11 ARG A 267 12.400 -2.857 -7.262 1.00 0.00 H ATOM 3847 HH22 ARG A 267 12.967 0.671 -7.122 1.00 0.00 H ATOM 3848 HH21 ARG A 267 14.652 0.500 -6.508 1.00 0.00 H ATOM 3849 H ARG A 267 16.835 -8.115 -6.615 1.00 0.00 H ATOM 3850 N LEU A 268 18.641 -5.203 -7.964 1.00 24.37 N ATOM 3851 CA LEU A 268 20.078 -4.953 -8.078 1.00 25.83 C ATOM 3852 C LEU A 268 20.513 -3.669 -7.383 1.00 23.49 C ATOM 3853 O LEU A 268 19.962 -2.604 -7.639 1.00 27.06 O ATOM 3854 CB LEU A 268 20.503 -4.925 -9.551 1.00 21.16 C ATOM 3855 CG LEU A 268 21.974 -4.658 -9.764 1.00 26.79 C ATOM 3856 CD1 LEU A 268 22.811 -5.811 -9.094 1.00 22.89 C ATOM 3857 CD2 LEU A 268 22.222 -4.532 -11.229 1.00 24.54 C ATOM 3858 HA LEU A 268 20.579 -5.777 -7.569 1.00 0.00 H ATOM 3859 HB2 LEU A 268 20.262 -5.891 -9.995 1.00 0.00 H ATOM 3860 HB3 LEU A 268 19.936 -4.143 -10.056 1.00 0.00 H ATOM 3861 HG LEU A 268 22.286 -3.726 -9.294 1.00 0.00 H ATOM 3862 HD21 LEU A 268 21.935 -5.459 -11.726 1.00 0.00 H ATOM 3863 HD22 LEU A 268 21.631 -3.707 -11.627 1.00 0.00 H ATOM 3864 HD23 LEU A 268 23.281 -4.339 -11.402 1.00 0.00 H ATOM 3865 HD11 LEU A 268 22.595 -5.842 -8.026 1.00 0.00 H ATOM 3866 HD12 LEU A 268 22.542 -6.765 -9.548 1.00 0.00 H ATOM 3867 HD13 LEU A 268 23.874 -5.622 -9.246 1.00 0.00 H ATOM 3868 H LEU A 268 18.006 -4.684 -8.604 1.00 0.00 H ATOM 3869 N LEU A 269 21.533 -3.768 -6.526 1.00 23.70 N ATOM 3870 CA LEU A 269 21.877 -2.649 -5.662 1.00 23.65 C ATOM 3871 C LEU A 269 23.339 -2.364 -5.771 1.00 21.85 C ATOM 3872 O LEU A 269 24.152 -3.274 -5.798 1.00 29.70 O ATOM 3873 CB LEU A 269 21.489 -2.878 -4.174 1.00 21.94 C ATOM 3874 CG LEU A 269 20.088 -3.294 -3.737 1.00 22.95 C ATOM 3875 CD1 LEU A 269 20.049 -4.791 -3.591 1.00 33.12 C ATOM 3876 CD2 LEU A 269 19.739 -2.703 -2.398 1.00 25.30 C ATOM 3877 HA LEU A 269 21.295 -1.793 -6.004 1.00 0.00 H ATOM 3878 HB2 LEU A 269 22.162 -3.651 -3.803 1.00 0.00 H ATOM 3879 HB3 LEU A 269 21.698 -1.939 -3.661 1.00 0.00 H ATOM 3880 HG LEU A 269 19.380 -2.941 -4.487 1.00 0.00 H ATOM 3881 HD21 LEU A 269 20.454 -3.049 -1.652 1.00 0.00 H ATOM 3882 HD22 LEU A 269 19.776 -1.615 -2.462 1.00 0.00 H ATOM 3883 HD23 LEU A 269 18.735 -3.018 -2.114 1.00 0.00 H ATOM 3884 HD11 LEU A 269 20.291 -5.254 -4.547 1.00 0.00 H ATOM 3885 HD12 LEU A 269 20.777 -5.101 -2.841 1.00 0.00 H ATOM 3886 HD13 LEU A 269 19.051 -5.098 -3.279 1.00 0.00 H ATOM 3887 H LEU A 269 22.084 -4.649 -6.476 1.00 0.00 H ATOM 3888 N VAL A 270 23.646 -1.079 -5.832 1.00 21.76 N ATOM 3889 CA VAL A 270 24.987 -0.579 -5.960 1.00 24.60 C ATOM 3890 C VAL A 270 25.253 0.553 -4.935 1.00 30.24 C ATOM 3891 O VAL A 270 24.349 1.361 -4.636 1.00 23.08 O ATOM 3892 CB VAL A 270 25.316 -0.128 -7.434 1.00 25.06 C ATOM 3893 CG1 VAL A 270 24.570 1.144 -7.829 1.00 20.98 C ATOM 3894 CG2 VAL A 270 26.848 0.037 -7.613 1.00 16.08 C ATOM 3895 HA VAL A 270 25.666 -1.400 -5.733 1.00 0.00 H ATOM 3896 HB VAL A 270 24.968 -0.912 -8.107 1.00 0.00 H ATOM 3897 HG11 VAL A 270 23.496 0.970 -7.759 1.00 0.00 H ATOM 3898 HG12 VAL A 270 24.853 1.953 -7.156 1.00 0.00 H ATOM 3899 HG13 VAL A 270 24.830 1.413 -8.853 1.00 0.00 H ATOM 3900 HG21 VAL A 270 27.215 0.792 -6.918 1.00 0.00 H ATOM 3901 HG22 VAL A 270 27.341 -0.914 -7.411 1.00 0.00 H ATOM 3902 HG23 VAL A 270 27.062 0.349 -8.635 1.00 0.00 H ATOM 3903 H VAL A 270 22.870 -0.389 -5.784 1.00 0.00 H ATOM 3904 N ALA A 271 26.468 0.540 -4.371 1.00 25.80 N ATOM 3905 CA ALA A 271 27.007 1.608 -3.555 1.00 30.91 C ATOM 3906 C ALA A 271 28.421 1.811 -4.028 1.00 30.64 C ATOM 3907 O ALA A 271 29.160 0.846 -4.136 1.00 38.50 O ATOM 3908 CB ALA A 271 27.030 1.215 -2.078 1.00 26.36 C ATOM 3909 HA ALA A 271 26.398 2.507 -3.647 1.00 0.00 H ATOM 3910 HB1 ALA A 271 26.015 1.000 -1.745 1.00 0.00 H ATOM 3911 HB2 ALA A 271 27.652 0.329 -1.949 1.00 0.00 H ATOM 3912 HB3 ALA A 271 27.440 2.037 -1.491 1.00 0.00 H ATOM 3913 H ALA A 271 27.066 -0.296 -4.530 1.00 0.00 H ATOM 3914 N ALA A 272 28.798 3.061 -4.273 1.00 33.51 N ATOM 3915 CA ALA A 272 30.136 3.445 -4.769 1.00 33.68 C ATOM 3916 C ALA A 272 30.549 4.832 -4.232 1.00 34.24 C ATOM 3917 O ALA A 272 29.684 5.647 -3.908 1.00 36.59 O ATOM 3918 CB ALA A 272 30.166 3.440 -6.297 1.00 28.31 C ATOM 3919 HA ALA A 272 30.852 2.709 -4.403 1.00 0.00 H ATOM 3920 HB1 ALA A 272 29.928 2.440 -6.661 1.00 0.00 H ATOM 3921 HB2 ALA A 272 29.431 4.150 -6.676 1.00 0.00 H ATOM 3922 HB3 ALA A 272 31.160 3.726 -6.641 1.00 0.00 H ATOM 3923 H ALA A 272 28.106 3.819 -4.105 1.00 0.00 H ATOM 3924 N ARG A 273 31.861 5.076 -4.130 1.00 33.21 N ATOM 3925 CA ARG A 273 32.417 6.380 -3.735 1.00 34.69 C ATOM 3926 C ARG A 273 32.921 7.159 -4.958 1.00 37.11 C ATOM 3927 O ARG A 273 33.393 6.560 -5.936 1.00 40.52 O ATOM 3928 CB ARG A 273 33.542 6.188 -2.709 1.00 36.74 C ATOM 3929 CG ARG A 273 33.075 5.873 -1.277 1.00 38.72 C ATOM 3930 CD ARG A 273 34.184 5.416 -0.384 1.00 42.30 C ATOM 3931 NE ARG A 273 34.621 4.061 -0.737 1.00 54.37 N ATOM 3932 CZ ARG A 273 35.716 3.745 -1.454 1.00 55.35 C ATOM 3933 NH1 ARG A 273 36.552 4.695 -1.906 1.00 48.66 N ATOM 3934 NH2 ARG A 273 35.980 2.456 -1.716 1.00 47.95 N ATOM 3935 HA ARG A 273 31.622 6.966 -3.274 1.00 0.00 H ATOM 3936 HB2 ARG A 273 34.171 5.365 -3.048 1.00 0.00 H ATOM 3937 HB3 ARG A 273 34.131 7.105 -2.678 1.00 0.00 H ATOM 3938 HG2 ARG A 273 32.634 6.774 -0.850 1.00 0.00 H ATOM 3939 HG3 ARG A 273 32.321 5.088 -1.323 1.00 0.00 H ATOM 3940 HD2 ARG A 273 33.835 5.420 0.649 1.00 0.00 H ATOM 3941 HD3 ARG A 273 35.027 6.100 -0.484 1.00 0.00 H ATOM 3942 HE ARG A 273 34.031 3.272 -0.403 1.00 0.00 H ATOM 3943 HH12 ARG A 273 37.392 4.429 -2.458 1.00 0.00 H ATOM 3944 HH11 ARG A 273 36.359 5.697 -1.704 1.00 0.00 H ATOM 3945 HH22 ARG A 273 36.823 2.200 -2.269 1.00 0.00 H ATOM 3946 HH21 ARG A 273 35.342 1.713 -1.366 1.00 0.00 H ATOM 3947 H ARG A 273 32.523 4.302 -4.341 1.00 0.00 H ATOM 3948 N LEU A 274 32.772 8.482 -4.922 1.00 37.03 N ATOM 3949 CA LEU A 274 33.368 9.382 -5.916 1.00 35.86 C ATOM 3950 C LEU A 274 34.030 10.517 -5.154 1.00 36.29 C ATOM 3951 O LEU A 274 33.357 11.455 -4.723 1.00 40.97 O ATOM 3952 CB LEU A 274 32.348 9.954 -6.918 1.00 30.67 C ATOM 3953 CG LEU A 274 31.814 8.995 -7.990 1.00 33.76 C ATOM 3954 CD1 LEU A 274 30.450 8.437 -7.619 1.00 34.22 C ATOM 3955 CD2 LEU A 274 31.746 9.623 -9.337 1.00 29.21 C ATOM 3956 HA LEU A 274 34.081 8.812 -6.512 1.00 0.00 H ATOM 3957 HB2 LEU A 274 31.494 10.318 -6.347 1.00 0.00 H ATOM 3958 HB3 LEU A 274 32.823 10.790 -7.431 1.00 0.00 H ATOM 3959 HG LEU A 274 32.531 8.176 -8.035 1.00 0.00 H ATOM 3960 HD21 LEU A 274 31.083 10.488 -9.300 1.00 0.00 H ATOM 3961 HD22 LEU A 274 32.744 9.941 -9.639 1.00 0.00 H ATOM 3962 HD23 LEU A 274 31.361 8.899 -10.055 1.00 0.00 H ATOM 3963 HD11 LEU A 274 30.526 7.892 -6.678 1.00 0.00 H ATOM 3964 HD12 LEU A 274 29.741 9.257 -7.509 1.00 0.00 H ATOM 3965 HD13 LEU A 274 30.109 7.763 -8.405 1.00 0.00 H ATOM 3966 H LEU A 274 32.207 8.897 -4.154 1.00 0.00 H ATOM 3967 N GLY A 275 35.350 10.440 -5.021 1.00 37.35 N ATOM 3968 CA GLY A 275 36.062 11.191 -4.011 1.00 39.22 C ATOM 3969 C GLY A 275 35.655 10.630 -2.655 1.00 40.67 C ATOM 3970 O GLY A 275 35.784 9.436 -2.399 1.00 39.03 O ATOM 3971 HA3 GLY A 275 35.795 12.246 -4.073 1.00 0.00 H ATOM 3972 HA2 GLY A 275 37.137 11.080 -4.153 1.00 0.00 H ATOM 3973 H GLY A 275 35.887 9.821 -5.662 1.00 0.00 H ATOM 3974 N THR A 276 35.132 11.503 -1.797 1.00 45.24 N ATOM 3975 CA THR A 276 34.660 11.120 -0.459 1.00 45.61 C ATOM 3976 C THR A 276 33.152 10.833 -0.454 1.00 44.97 C ATOM 3977 O THR A 276 32.609 10.336 0.553 1.00 44.73 O ATOM 3978 CB THR A 276 34.998 12.223 0.611 1.00 51.19 C ATOM 3979 OG1 THR A 276 34.861 13.536 0.034 1.00 50.71 O ATOM 3980 CG2 THR A 276 36.417 12.061 1.129 1.00 48.88 C ATOM 3981 HA THR A 276 35.187 10.205 -0.191 1.00 0.00 H ATOM 3982 HB THR A 276 34.299 12.107 1.439 1.00 0.00 H ATOM 3983 HG1 THR A 276 35.076 14.219 0.717 1.00 0.00 H ATOM 3984 HG23 THR A 276 36.531 11.070 1.568 1.00 0.00 H ATOM 3985 HG21 THR A 276 37.119 12.177 0.304 1.00 0.00 H ATOM 3986 HG22 THR A 276 36.615 12.820 1.886 1.00 0.00 H ATOM 3987 H THR A 276 35.054 12.499 -2.086 1.00 0.00 H ATOM 3988 N THR A 277 32.510 11.139 -1.589 1.00 38.65 N ATOM 3989 CA THR A 277 31.058 11.127 -1.770 1.00 40.03 C ATOM 3990 C THR A 277 30.491 9.755 -2.142 1.00 40.50 C ATOM 3991 O THR A 277 30.682 9.240 -3.253 1.00 43.57 O ATOM 3992 CB THR A 277 30.681 12.068 -2.862 1.00 40.81 C ATOM 3993 OG1 THR A 277 31.396 13.288 -2.670 1.00 48.69 O ATOM 3994 CG2 THR A 277 29.211 12.335 -2.824 1.00 39.07 C ATOM 3995 HA THR A 277 30.641 11.417 -0.806 1.00 0.00 H ATOM 3996 HB THR A 277 30.930 11.632 -3.830 1.00 0.00 H ATOM 3997 HG1 THR A 277 31.157 13.926 -3.388 1.00 0.00 H ATOM 3998 HG23 THR A 277 28.669 11.401 -2.971 1.00 0.00 H ATOM 3999 HG21 THR A 277 28.945 12.762 -1.857 1.00 0.00 H ATOM 4000 HG22 THR A 277 28.950 13.036 -3.616 1.00 0.00 H ATOM 4001 H THR A 277 33.091 11.407 -2.409 1.00 0.00 H ATOM 4002 N ARG A 278 29.774 9.182 -1.199 1.00 35.51 N ATOM 4003 CA ARG A 278 29.255 7.871 -1.351 1.00 38.21 C ATOM 4004 C ARG A 278 27.878 7.948 -1.993 1.00 38.43 C ATOM 4005 O ARG A 278 26.993 8.675 -1.511 1.00 40.76 O ATOM 4006 CB ARG A 278 29.209 7.204 0.015 1.00 41.01 C ATOM 4007 CG ARG A 278 29.420 5.722 -0.079 1.00 38.91 C ATOM 4008 CD ARG A 278 29.738 5.141 1.244 1.00 38.59 C ATOM 4009 NE ARG A 278 29.532 3.698 1.191 1.00 39.86 N ATOM 4010 CZ ARG A 278 28.372 3.102 1.427 1.00 38.11 C ATOM 4011 NH1 ARG A 278 27.305 3.842 1.730 1.00 41.87 N ATOM 4012 NH2 ARG A 278 28.281 1.776 1.361 1.00 34.12 N ATOM 4013 HA ARG A 278 29.891 7.272 -2.003 1.00 0.00 H ATOM 4014 HB2 ARG A 278 29.990 7.632 0.643 1.00 0.00 H ATOM 4015 HB3 ARG A 278 28.236 7.394 0.468 1.00 0.00 H ATOM 4016 HG2 ARG A 278 28.512 5.257 -0.463 1.00 0.00 H ATOM 4017 HG3 ARG A 278 30.245 5.523 -0.763 1.00 0.00 H ATOM 4018 HD2 ARG A 278 29.085 5.576 2.001 1.00 0.00 H ATOM 4019 HD3 ARG A 278 30.777 5.353 1.496 1.00 0.00 H ATOM 4020 HE ARG A 278 30.348 3.098 0.953 1.00 0.00 H ATOM 4021 HH12 ARG A 278 26.390 3.384 1.917 1.00 0.00 H ATOM 4022 HH11 ARG A 278 27.387 4.878 1.779 1.00 0.00 H ATOM 4023 HH22 ARG A 278 27.371 1.307 1.546 1.00 0.00 H ATOM 4024 HH21 ARG A 278 29.120 1.208 1.124 1.00 0.00 H ATOM 4025 H ARG A 278 29.583 9.704 -0.320 1.00 0.00 H ATOM 4026 N LEU A 279 27.708 7.245 -3.109 1.00 34.12 N ATOM 4027 CA LEU A 279 26.384 7.174 -3.762 1.00 33.63 C ATOM 4028 C LEU A 279 25.766 5.771 -3.761 1.00 29.36 C ATOM 4029 O LEU A 279 26.466 4.768 -3.817 1.00 28.45 O ATOM 4030 CB LEU A 279 26.414 7.730 -5.190 1.00 30.45 C ATOM 4031 CG LEU A 279 27.000 9.107 -5.486 1.00 30.25 C ATOM 4032 CD1 LEU A 279 27.221 9.209 -6.984 1.00 24.57 C ATOM 4033 CD2 LEU A 279 26.099 10.197 -4.972 1.00 24.41 C ATOM 4034 HA LEU A 279 25.742 7.806 -3.149 1.00 0.00 H ATOM 4035 HB2 LEU A 279 26.981 7.017 -5.788 1.00 0.00 H ATOM 4036 HB3 LEU A 279 25.381 7.752 -5.536 1.00 0.00 H ATOM 4037 HG LEU A 279 27.953 9.233 -4.972 1.00 0.00 H ATOM 4038 HD21 LEU A 279 25.125 10.119 -5.455 1.00 0.00 H ATOM 4039 HD22 LEU A 279 25.981 10.091 -3.894 1.00 0.00 H ATOM 4040 HD23 LEU A 279 26.541 11.168 -5.196 1.00 0.00 H ATOM 4041 HD11 LEU A 279 27.912 8.428 -7.302 1.00 0.00 H ATOM 4042 HD12 LEU A 279 26.269 9.085 -7.500 1.00 0.00 H ATOM 4043 HD13 LEU A 279 27.640 10.186 -7.222 1.00 0.00 H ATOM 4044 H LEU A 279 28.515 6.740 -3.527 1.00 0.00 H ATOM 4045 N LEU A 280 24.440 5.740 -3.686 1.00 32.69 N ATOM 4046 CA LEU A 280 23.642 4.510 -3.739 1.00 28.64 C ATOM 4047 C LEU A 280 22.719 4.598 -4.909 1.00 27.79 C ATOM 4048 O LEU A 280 22.232 5.706 -5.277 1.00 28.57 O ATOM 4049 CB LEU A 280 22.700 4.397 -2.529 1.00 31.99 C ATOM 4050 CG LEU A 280 23.057 4.631 -1.065 1.00 37.53 C ATOM 4051 CD1 LEU A 280 22.010 3.860 -0.309 1.00 33.23 C ATOM 4052 CD2 LEU A 280 24.492 4.206 -0.664 1.00 35.74 C ATOM 4053 HA LEU A 280 24.340 3.673 -3.779 1.00 0.00 H ATOM 4054 HB2 LEU A 280 21.890 5.097 -2.736 1.00 0.00 H ATOM 4055 HB3 LEU A 280 22.316 3.378 -2.566 1.00 0.00 H ATOM 4056 HG LEU A 280 23.062 5.697 -0.840 1.00 0.00 H ATOM 4057 HD21 LEU A 280 24.619 3.140 -0.850 1.00 0.00 H ATOM 4058 HD22 LEU A 280 25.215 4.768 -1.256 1.00 0.00 H ATOM 4059 HD23 LEU A 280 24.648 4.413 0.395 1.00 0.00 H ATOM 4060 HD11 LEU A 280 21.023 4.249 -0.559 1.00 0.00 H ATOM 4061 HD12 LEU A 280 22.067 2.807 -0.583 1.00 0.00 H ATOM 4062 HD13 LEU A 280 22.184 3.968 0.762 1.00 0.00 H ATOM 4063 H LEU A 280 23.936 6.644 -3.583 1.00 0.00 H ATOM 4064 N ASP A 281 22.427 3.440 -5.482 1.00 23.51 N ATOM 4065 CA ASP A 281 21.339 3.364 -6.458 1.00 25.73 C ATOM 4066 C ASP A 281 20.862 1.911 -6.493 1.00 21.59 C ATOM 4067 O ASP A 281 21.586 1.005 -6.075 1.00 23.62 O ATOM 4068 CB ASP A 281 21.809 3.907 -7.839 1.00 22.84 C ATOM 4069 CG ASP A 281 20.657 4.324 -8.761 1.00 29.18 C ATOM 4070 OD1 ASP A 281 19.464 4.064 -8.456 1.00 30.93 O ATOM 4071 OD2 ASP A 281 20.957 4.920 -9.828 1.00 28.78 O ATOM 4072 HA ASP A 281 20.496 3.995 -6.178 1.00 0.00 H ATOM 4073 HB2 ASP A 281 22.446 4.775 -7.669 1.00 0.00 H ATOM 4074 HB3 ASP A 281 22.385 3.127 -8.338 1.00 0.00 H ATOM 4075 H ASP A 281 22.970 2.587 -5.239 1.00 0.00 H ATOM 4076 N ASN A 282 19.643 1.692 -6.968 1.00 18.76 N ATOM 4077 CA ASN A 282 19.126 0.331 -7.187 1.00 23.83 C ATOM 4078 C ASN A 282 18.096 0.312 -8.296 1.00 25.59 C ATOM 4079 O ASN A 282 17.605 1.355 -8.752 1.00 25.62 O ATOM 4080 CB ASN A 282 18.525 -0.275 -5.900 1.00 17.83 C ATOM 4081 CG ASN A 282 17.321 0.460 -5.453 1.00 23.69 C ATOM 4082 OD1 ASN A 282 16.204 0.144 -5.874 1.00 13.98 O ATOM 4083 ND2 ASN A 282 17.531 1.514 -4.651 1.00 18.30 N ATOM 4084 HA ASN A 282 19.976 -0.284 -7.482 1.00 0.00 H ATOM 4085 HB2 ASN A 282 18.253 -1.313 -6.093 1.00 0.00 H ATOM 4086 HB3 ASN A 282 19.275 -0.238 -5.109 1.00 0.00 H ATOM 4087 HD22 ASN A 282 18.493 1.736 -4.325 1.00 0.00 H ATOM 4088 HD21 ASN A 282 16.732 2.110 -4.355 1.00 0.00 H ATOM 4089 H ASN A 282 19.035 2.505 -7.192 1.00 0.00 H ATOM 4090 N ILE A 283 17.782 -0.885 -8.754 1.00 26.96 N ATOM 4091 CA ILE A 283 16.821 -1.024 -9.800 1.00 23.30 C ATOM 4092 C ILE A 283 16.177 -2.408 -9.588 1.00 28.22 C ATOM 4093 O ILE A 283 16.820 -3.321 -9.019 1.00 26.32 O ATOM 4094 CB ILE A 283 17.549 -0.912 -11.185 1.00 26.66 C ATOM 4095 CG1 ILE A 283 16.575 -0.498 -12.282 1.00 21.11 C ATOM 4096 CG2 ILE A 283 18.425 -2.248 -11.561 1.00 18.38 C ATOM 4097 CD1 ILE A 283 17.244 0.215 -13.419 1.00 18.75 C ATOM 4098 HA ILE A 283 16.055 -0.248 -9.787 1.00 0.00 H ATOM 4099 HB ILE A 283 18.288 -0.115 -11.100 1.00 0.00 H ATOM 4100 HG12 ILE A 283 16.088 -1.392 -12.671 1.00 0.00 H ATOM 4101 HG13 ILE A 283 15.825 0.164 -11.850 1.00 0.00 H ATOM 4102 HD11 ILE A 283 17.728 1.118 -13.046 1.00 0.00 H ATOM 4103 HD12 ILE A 283 17.991 -0.440 -13.868 1.00 0.00 H ATOM 4104 HD13 ILE A 283 16.498 0.483 -14.167 1.00 0.00 H ATOM 4105 HG21 ILE A 283 19.187 -2.408 -10.798 1.00 0.00 H ATOM 4106 HG22 ILE A 283 17.764 -3.114 -11.603 1.00 0.00 H ATOM 4107 HG23 ILE A 283 18.903 -2.106 -12.530 1.00 0.00 H ATOM 4108 H ILE A 283 18.236 -1.730 -8.352 1.00 0.00 H ATOM 4109 N ALA A 284 14.930 -2.543 -10.049 1.00 23.76 N ATOM 4110 CA ALA A 284 14.247 -3.832 -10.227 1.00 23.43 C ATOM 4111 C ALA A 284 14.881 -4.638 -11.343 1.00 25.55 C ATOM 4112 O ALA A 284 15.353 -4.079 -12.338 1.00 30.88 O ATOM 4113 CB ALA A 284 12.770 -3.597 -10.543 1.00 19.58 C ATOM 4114 HA ALA A 284 14.341 -4.396 -9.299 1.00 0.00 H ATOM 4115 HB1 ALA A 284 12.306 -3.053 -9.720 1.00 0.00 H ATOM 4116 HB2 ALA A 284 12.684 -3.014 -11.460 1.00 0.00 H ATOM 4117 HB3 ALA A 284 12.270 -4.557 -10.674 1.00 0.00 H ATOM 4118 H ALA A 284 14.408 -1.679 -10.298 1.00 0.00 H ATOM 4119 N ILE A 285 14.888 -5.954 -11.198 1.00 29.66 N ATOM 4120 CA ILE A 285 15.534 -6.844 -12.191 1.00 33.37 C ATOM 4121 C ILE A 285 14.592 -8.020 -12.377 1.00 30.01 C ATOM 4122 O ILE A 285 14.108 -8.572 -11.383 1.00 24.80 O ATOM 4123 CB ILE A 285 16.940 -7.339 -11.700 1.00 31.74 C ATOM 4124 CG1 ILE A 285 17.918 -6.196 -11.725 1.00 37.15 C ATOM 4125 CG2 ILE A 285 17.540 -8.436 -12.611 1.00 35.36 C ATOM 4126 CD1 ILE A 285 18.876 -6.236 -12.895 1.00 37.05 C ATOM 4127 HA ILE A 285 15.709 -6.312 -13.126 1.00 0.00 H ATOM 4128 HB ILE A 285 16.785 -7.738 -10.698 1.00 0.00 H ATOM 4129 HG12 ILE A 285 17.356 -5.263 -11.773 1.00 0.00 H ATOM 4130 HG13 ILE A 285 18.500 -6.221 -10.804 1.00 0.00 H ATOM 4131 HD11 ILE A 285 19.456 -7.158 -12.856 1.00 0.00 H ATOM 4132 HD12 ILE A 285 18.311 -6.199 -13.827 1.00 0.00 H ATOM 4133 HD13 ILE A 285 19.548 -5.380 -12.842 1.00 0.00 H ATOM 4134 HG21 ILE A 285 16.871 -9.296 -12.630 1.00 0.00 H ATOM 4135 HG22 ILE A 285 17.658 -8.043 -13.621 1.00 0.00 H ATOM 4136 HG23 ILE A 285 18.512 -8.739 -12.221 1.00 0.00 H ATOM 4137 H ILE A 285 14.428 -6.374 -10.365 1.00 0.00 H ATOM 4138 N GLU A 286 14.302 -8.362 -13.638 1.00 36.67 N ATOM 4139 CA GLU A 286 13.524 -9.577 -13.982 1.00 38.25 C ATOM 4140 C GLU A 286 14.420 -10.527 -14.725 1.00 37.98 C ATOM 4141 O GLU A 286 14.896 -10.224 -15.827 1.00 34.33 O ATOM 4142 CB GLU A 286 12.294 -9.267 -14.837 1.00 41.80 C ATOM 4143 CG GLU A 286 11.187 -8.496 -14.124 1.00 56.34 C ATOM 4144 CD GLU A 286 11.084 -7.038 -14.600 1.00 67.08 C ATOM 4145 OE1 GLU A 286 11.149 -6.809 -15.839 1.00 70.34 O ATOM 4146 OE2 GLU A 286 10.926 -6.123 -13.738 1.00 74.65 O ATOM 4147 HA GLU A 286 13.165 -10.018 -13.052 1.00 0.00 H ATOM 4148 HB2 GLU A 286 12.618 -8.677 -15.694 1.00 0.00 H ATOM 4149 HB3 GLU A 286 11.877 -10.212 -15.185 1.00 0.00 H ATOM 4150 HG2 GLU A 286 10.236 -8.994 -14.314 1.00 0.00 H ATOM 4151 HG3 GLU A 286 11.391 -8.501 -13.053 1.00 0.00 H ATOM 4152 H GLU A 286 14.636 -7.750 -14.409 1.00 0.00 H ATOM 4153 N ILE A 287 14.674 -11.658 -14.111 1.00 40.98 N ATOM 4154 CA ILE A 287 15.544 -12.654 -14.686 1.00 46.90 C ATOM 4155 C ILE A 287 14.762 -13.519 -15.651 1.00 49.80 C ATOM 4156 O ILE A 287 13.803 -14.145 -15.275 1.00 48.65 O ATOM 4157 CB ILE A 287 16.180 -13.509 -13.608 1.00 46.98 C ATOM 4158 CG1 ILE A 287 16.925 -12.629 -12.638 1.00 45.55 C ATOM 4159 CG2 ILE A 287 17.176 -14.448 -14.196 1.00 44.69 C ATOM 4160 CD1 ILE A 287 17.895 -11.820 -13.292 1.00 46.54 C ATOM 4161 HA ILE A 287 16.344 -12.146 -15.225 1.00 0.00 H ATOM 4162 HB ILE A 287 15.383 -14.064 -13.113 1.00 0.00 H ATOM 4163 HG12 ILE A 287 16.211 -11.981 -12.129 1.00 0.00 H ATOM 4164 HG13 ILE A 287 17.428 -13.259 -11.905 1.00 0.00 H ATOM 4165 HD11 ILE A 287 18.618 -12.460 -13.798 1.00 0.00 H ATOM 4166 HD12 ILE A 287 17.400 -11.180 -14.023 1.00 0.00 H ATOM 4167 HD13 ILE A 287 18.408 -11.202 -12.555 1.00 0.00 H ATOM 4168 HG21 ILE A 287 16.679 -15.100 -14.914 1.00 0.00 H ATOM 4169 HG22 ILE A 287 17.957 -13.879 -14.700 1.00 0.00 H ATOM 4170 HG23 ILE A 287 17.618 -15.050 -13.402 1.00 0.00 H ATOM 4171 H ILE A 287 14.237 -11.841 -13.185 1.00 0.00 H ATOM 4172 N GLY A 288 15.166 -13.524 -16.905 1.00 48.71 N ATOM 4173 CA GLY A 288 14.446 -14.237 -17.922 1.00 54.63 C ATOM 4174 C GLY A 288 13.369 -13.420 -18.596 1.00 57.37 C ATOM 4175 O GLY A 288 12.758 -13.873 -19.523 1.00 59.91 O ATOM 4176 HA3 GLY A 288 13.980 -15.110 -17.465 1.00 0.00 H ATOM 4177 HA2 GLY A 288 15.157 -14.562 -18.682 1.00 0.00 H ATOM 4178 H GLY A 288 16.026 -13.000 -17.164 1.00 0.00 H ATOM 4179 N THR A 289 13.136 -12.219 -18.099 1.00 64.46 N ATOM 4180 CA THR A 289 12.181 -11.274 -18.663 1.00 66.56 C ATOM 4181 C THR A 289 12.923 -10.020 -19.093 1.00 67.23 C ATOM 4182 O THR A 289 13.972 -9.683 -18.555 1.00 63.06 O ATOM 4183 CB THR A 289 11.071 -10.843 -17.657 1.00 67.47 C ATOM 4184 OG1 THR A 289 10.456 -11.983 -17.049 1.00 66.85 O ATOM 4185 CG2 THR A 289 10.024 -10.052 -18.357 1.00 66.95 C ATOM 4186 HA THR A 289 11.699 -11.780 -19.499 1.00 0.00 H ATOM 4187 HB THR A 289 11.543 -10.237 -16.884 1.00 0.00 H ATOM 4188 HG1 THR A 289 9.757 -11.681 -16.416 1.00 0.00 H ATOM 4189 HG23 THR A 289 10.481 -9.180 -18.825 1.00 0.00 H ATOM 4190 HG21 THR A 289 9.553 -10.671 -19.121 1.00 0.00 H ATOM 4191 HG22 THR A 289 9.273 -9.728 -17.637 1.00 0.00 H ATOM 4192 H THR A 289 13.667 -11.930 -17.253 1.00 0.00 H TER 4193 THR A 289 ATOM 4194 N ALA B 2 -16.056 -4.783 6.892 1.00 69.17 N ATOM 4195 CA ALA B 2 -16.833 -6.027 7.191 1.00 67.92 C ATOM 4196 C ALA B 2 -16.405 -6.626 8.550 1.00 65.97 C ATOM 4197 O ALA B 2 -15.971 -7.784 8.637 1.00 66.64 O ATOM 4198 CB ALA B 2 -16.697 -7.041 6.031 1.00 70.10 C ATOM 4199 HA ALA B 2 -17.890 -5.773 7.275 1.00 0.00 H ATOM 4200 HB1 ALA B 2 -17.080 -6.595 5.113 1.00 0.00 H ATOM 4201 HB2 ALA B 2 -15.647 -7.301 5.899 1.00 0.00 H ATOM 4202 HB3 ALA B 2 -17.268 -7.939 6.266 1.00 0.00 H ATOM 4203 HN3 ALA B 2 -15.042 -5.010 6.855 1.00 0.00 H ATOM 4204 HN2 ALA B 2 -16.229 -4.080 7.639 1.00 0.00 H ATOM 4205 HN1 ALA B 2 -16.360 -4.398 5.975 1.00 0.00 H ATOM 4206 N ILE B 3 -16.563 -5.811 9.603 1.00 64.52 N ATOM 4207 CA ILE B 3 -16.119 -6.092 10.994 1.00 58.21 C ATOM 4208 C ILE B 3 -16.576 -7.462 11.549 1.00 58.66 C ATOM 4209 O ILE B 3 -17.689 -7.926 11.266 1.00 57.03 O ATOM 4210 CB ILE B 3 -16.531 -4.921 11.950 1.00 58.74 C ATOM 4211 CG1 ILE B 3 -16.190 -3.570 11.315 1.00 60.05 C ATOM 4212 CG2 ILE B 3 -15.849 -5.006 13.319 1.00 56.38 C ATOM 4213 CD1 ILE B 3 -16.724 -2.381 12.064 1.00 58.08 C ATOM 4214 HA ILE B 3 -15.032 -6.157 10.952 1.00 0.00 H ATOM 4215 HB ILE B 3 -17.607 -5.013 12.102 1.00 0.00 H ATOM 4216 HG12 ILE B 3 -15.105 -3.481 11.263 1.00 0.00 H ATOM 4217 HG13 ILE B 3 -16.604 -3.552 10.307 1.00 0.00 H ATOM 4218 HD11 ILE B 3 -17.811 -2.444 12.116 1.00 0.00 H ATOM 4219 HD12 ILE B 3 -16.311 -2.373 13.073 1.00 0.00 H ATOM 4220 HD13 ILE B 3 -16.436 -1.467 11.545 1.00 0.00 H ATOM 4221 HG21 ILE B 3 -16.123 -5.944 13.802 1.00 0.00 H ATOM 4222 HG22 ILE B 3 -14.768 -4.965 13.188 1.00 0.00 H ATOM 4223 HG23 ILE B 3 -16.173 -4.169 13.937 1.00 0.00 H ATOM 4224 H ILE B 3 -17.038 -4.902 9.432 1.00 0.00 H ATOM 4225 N PRO B 4 -15.683 -8.153 12.290 1.00 58.49 N ATOM 4226 CA PRO B 4 -16.123 -9.367 12.992 1.00 55.41 C ATOM 4227 C PRO B 4 -17.266 -9.098 13.971 1.00 53.82 C ATOM 4228 O PRO B 4 -17.434 -7.970 14.456 1.00 50.49 O ATOM 4229 CB PRO B 4 -14.869 -9.811 13.733 1.00 58.08 C ATOM 4230 CG PRO B 4 -13.718 -9.210 12.885 1.00 55.61 C ATOM 4231 CD PRO B 4 -14.240 -7.894 12.473 1.00 54.13 C ATOM 4232 HA PRO B 4 -16.519 -10.117 12.307 1.00 0.00 H ATOM 4233 HD3 PRO B 4 -14.071 -7.145 13.247 1.00 0.00 H ATOM 4234 HD2 PRO B 4 -13.780 -7.563 11.542 1.00 0.00 H ATOM 4235 HG3 PRO B 4 -13.507 -9.834 12.017 1.00 0.00 H ATOM 4236 HG2 PRO B 4 -12.812 -9.100 13.481 1.00 0.00 H ATOM 4237 HB2 PRO B 4 -14.854 -9.414 14.748 1.00 0.00 H ATOM 4238 HB3 PRO B 4 -14.801 -10.898 13.768 1.00 0.00 H ATOM 4239 N ALA B 5 -18.056 -10.138 14.221 1.00 52.25 N ATOM 4240 CA ALA B 5 -19.195 -10.088 15.130 1.00 53.08 C ATOM 4241 C ALA B 5 -18.800 -9.791 16.588 1.00 53.19 C ATOM 4242 O ALA B 5 -17.932 -10.461 17.170 1.00 50.47 O ATOM 4243 CB ALA B 5 -19.998 -11.401 15.043 1.00 53.41 C ATOM 4244 HA ALA B 5 -19.818 -9.253 14.808 1.00 0.00 H ATOM 4245 HB1 ALA B 5 -20.358 -11.538 14.023 1.00 0.00 H ATOM 4246 HB2 ALA B 5 -19.355 -12.237 15.318 1.00 0.00 H ATOM 4247 HB3 ALA B 5 -20.846 -11.353 15.726 1.00 0.00 H ATOM 4248 H ALA B 5 -17.850 -11.037 13.741 1.00 0.00 H ATOM 4249 N PHE B 6 -19.451 -8.775 17.159 1.00 52.02 N ATOM 4250 CA PHE B 6 -19.272 -8.413 18.566 1.00 48.15 C ATOM 4251 C PHE B 6 -20.615 -8.315 19.284 1.00 47.84 C ATOM 4252 O PHE B 6 -21.424 -7.443 18.961 1.00 50.90 O ATOM 4253 CB PHE B 6 -18.492 -7.077 18.712 1.00 41.33 C ATOM 4254 CG PHE B 6 -18.404 -6.578 20.150 1.00 36.68 C ATOM 4255 CD1 PHE B 6 -17.491 -7.147 21.051 1.00 34.58 C ATOM 4256 CD2 PHE B 6 -19.253 -5.572 20.610 1.00 31.37 C ATOM 4257 CE1 PHE B 6 -17.426 -6.715 22.381 1.00 29.97 C ATOM 4258 CE2 PHE B 6 -19.187 -5.129 21.947 1.00 32.54 C ATOM 4259 CZ PHE B 6 -18.273 -5.713 22.829 1.00 34.34 C ATOM 4260 HA PHE B 6 -18.686 -9.206 19.031 1.00 0.00 H ATOM 4261 HB2 PHE B 6 -17.480 -7.225 18.335 1.00 0.00 H ATOM 4262 HB3 PHE B 6 -18.994 -6.317 18.113 1.00 0.00 H ATOM 4263 HD2 PHE B 6 -19.976 -5.123 19.929 1.00 0.00 H ATOM 4264 HE2 PHE B 6 -19.847 -4.333 22.292 1.00 0.00 H ATOM 4265 HZ PHE B 6 -18.226 -5.381 23.866 1.00 0.00 H ATOM 4266 HE1 PHE B 6 -16.708 -7.167 23.065 1.00 0.00 H ATOM 4267 HD1 PHE B 6 -16.822 -7.937 20.710 1.00 0.00 H ATOM 4268 H PHE B 6 -20.112 -8.218 16.581 1.00 0.00 H ATOM 4269 N HIS B 7 -20.825 -9.166 20.287 1.00 47.21 N ATOM 4270 CA HIS B 7 -22.029 -9.107 21.121 1.00 45.56 C ATOM 4271 C HIS B 7 -21.761 -8.474 22.485 1.00 49.35 C ATOM 4272 O HIS B 7 -21.087 -9.084 23.334 1.00 46.38 O ATOM 4273 CB HIS B 7 -22.598 -10.498 21.328 1.00 49.37 C ATOM 4274 CG HIS B 7 -22.453 -11.390 20.134 1.00 56.37 C ATOM 4275 ND1 HIS B 7 -23.253 -11.270 19.016 1.00 56.15 N ATOM 4276 CD2 HIS B 7 -21.591 -12.407 19.880 1.00 53.34 C ATOM 4277 CE1 HIS B 7 -22.891 -12.181 18.128 1.00 59.15 C ATOM 4278 NE2 HIS B 7 -21.881 -12.877 18.626 1.00 57.13 N ATOM 4279 HA HIS B 7 -22.746 -8.481 20.590 1.00 0.00 H ATOM 4280 HB2 HIS B 7 -22.081 -10.960 22.169 1.00 0.00 H ATOM 4281 HB3 HIS B 7 -23.658 -10.405 21.562 1.00 0.00 H ATOM 4282 HD2 HIS B 7 -20.814 -12.780 20.548 1.00 0.00 H ATOM 4283 HE1 HIS B 7 -23.348 -12.333 17.150 1.00 0.00 H ATOM 4284 H HIS B 7 -20.111 -9.896 20.485 1.00 0.00 H ATOM 4285 N PRO B 8 -22.316 -7.256 22.716 1.00 51.36 N ATOM 4286 CA PRO B 8 -22.159 -6.489 23.960 1.00 50.69 C ATOM 4287 C PRO B 8 -22.622 -7.271 25.189 1.00 53.55 C ATOM 4288 O PRO B 8 -23.360 -8.243 25.065 1.00 55.68 O ATOM 4289 CB PRO B 8 -23.061 -5.265 23.743 1.00 51.46 C ATOM 4290 CG PRO B 8 -23.240 -5.155 22.279 1.00 51.55 C ATOM 4291 CD PRO B 8 -23.155 -6.544 21.729 1.00 51.65 C ATOM 4292 HA PRO B 8 -21.115 -6.241 24.152 1.00 0.00 H ATOM 4293 HD3 PRO B 8 -24.144 -6.997 21.659 1.00 0.00 H ATOM 4294 HD2 PRO B 8 -22.686 -6.546 20.745 1.00 0.00 H ATOM 4295 HG3 PRO B 8 -22.455 -4.532 21.850 1.00 0.00 H ATOM 4296 HG2 PRO B 8 -24.213 -4.719 22.051 1.00 0.00 H ATOM 4297 HB2 PRO B 8 -24.023 -5.410 24.234 1.00 0.00 H ATOM 4298 HB3 PRO B 8 -22.585 -4.367 24.137 1.00 0.00 H ATOM 4299 N GLY B 9 -22.194 -6.852 26.371 1.00 53.79 N ATOM 4300 CA GLY B 9 -22.474 -7.605 27.602 1.00 56.67 C ATOM 4301 C GLY B 9 -22.055 -9.076 27.629 1.00 56.65 C ATOM 4302 O GLY B 9 -22.395 -9.796 28.566 1.00 58.23 O ATOM 4303 HA3 GLY B 9 -23.550 -7.566 27.773 1.00 0.00 H ATOM 4304 HA2 GLY B 9 -21.959 -7.101 28.420 1.00 0.00 H ATOM 4305 H GLY B 9 -21.647 -5.969 26.429 1.00 0.00 H ATOM 4306 N GLU B 10 -21.321 -9.530 26.614 1.00 54.07 N ATOM 4307 CA GLU B 10 -20.892 -10.936 26.533 1.00 54.33 C ATOM 4308 C GLU B 10 -19.381 -11.075 26.366 1.00 48.68 C ATOM 4309 O GLU B 10 -18.712 -10.137 25.915 1.00 48.40 O ATOM 4310 CB GLU B 10 -21.534 -11.598 25.317 1.00 57.49 C ATOM 4311 CG GLU B 10 -22.849 -12.263 25.534 1.00 63.44 C ATOM 4312 CD GLU B 10 -23.316 -12.933 24.257 1.00 69.13 C ATOM 4313 OE1 GLU B 10 -22.450 -13.423 23.491 1.00 69.60 O ATOM 4314 OE2 GLU B 10 -24.539 -12.961 24.009 1.00 72.01 O ATOM 4315 HA GLU B 10 -21.197 -11.408 27.467 1.00 0.00 H ATOM 4316 HB2 GLU B 10 -21.674 -10.829 24.557 1.00 0.00 H ATOM 4317 HB3 GLU B 10 -20.840 -12.352 24.946 1.00 0.00 H ATOM 4318 HG2 GLU B 10 -22.748 -13.013 26.318 1.00 0.00 H ATOM 4319 HG3 GLU B 10 -23.583 -11.518 25.839 1.00 0.00 H ATOM 4320 H GLU B 10 -21.043 -8.873 25.858 1.00 0.00 H ATOM 4321 N LEU B 11 -18.850 -12.260 26.656 1.00 39.83 N ATOM 4322 CA LEU B 11 -17.442 -12.507 26.376 1.00 36.89 C ATOM 4323 C LEU B 11 -17.270 -12.915 24.937 1.00 36.89 C ATOM 4324 O LEU B 11 -17.699 -13.992 24.565 1.00 37.54 O ATOM 4325 CB LEU B 11 -16.822 -13.566 27.294 1.00 35.37 C ATOM 4326 CG LEU B 11 -15.296 -13.744 27.164 1.00 35.33 C ATOM 4327 CD1 LEU B 11 -14.554 -12.468 27.570 1.00 29.44 C ATOM 4328 CD2 LEU B 11 -14.775 -14.937 27.972 1.00 35.24 C ATOM 4329 HA LEU B 11 -16.914 -11.573 26.570 1.00 0.00 H ATOM 4330 HB2 LEU B 11 -17.042 -13.288 28.325 1.00 0.00 H ATOM 4331 HB3 LEU B 11 -17.293 -14.523 27.069 1.00 0.00 H ATOM 4332 HG LEU B 11 -15.098 -13.948 26.112 1.00 0.00 H ATOM 4333 HD21 LEU B 11 -15.008 -14.790 29.027 1.00 0.00 H ATOM 4334 HD22 LEU B 11 -15.252 -15.851 27.617 1.00 0.00 H ATOM 4335 HD23 LEU B 11 -13.695 -15.016 27.845 1.00 0.00 H ATOM 4336 HD11 LEU B 11 -14.865 -11.647 26.924 1.00 0.00 H ATOM 4337 HD12 LEU B 11 -14.790 -12.226 28.606 1.00 0.00 H ATOM 4338 HD13 LEU B 11 -13.480 -12.625 27.467 1.00 0.00 H ATOM 4339 H LEU B 11 -19.437 -13.006 27.080 1.00 0.00 H ATOM 4340 N ASN B 12 -16.627 -12.043 24.150 1.00 37.13 N ATOM 4341 CA ASN B 12 -16.234 -12.320 22.761 1.00 34.36 C ATOM 4342 C ASN B 12 -14.742 -12.680 22.689 1.00 33.36 C ATOM 4343 O ASN B 12 -13.876 -11.906 23.127 1.00 30.27 O ATOM 4344 CB ASN B 12 -16.509 -11.092 21.868 1.00 34.30 C ATOM 4345 CG ASN B 12 -17.959 -10.605 21.951 1.00 35.87 C ATOM 4346 OD1 ASN B 12 -18.774 -10.914 21.066 1.00 37.18 O ATOM 4347 ND2 ASN B 12 -18.288 -9.859 23.010 1.00 23.13 N ATOM 4348 HA ASN B 12 -16.825 -13.163 22.402 1.00 0.00 H ATOM 4349 HB2 ASN B 12 -15.851 -10.281 22.180 1.00 0.00 H ATOM 4350 HB3 ASN B 12 -16.290 -11.358 20.834 1.00 0.00 H ATOM 4351 HD22 ASN B 12 -17.570 -9.626 23.725 1.00 0.00 H ATOM 4352 HD21 ASN B 12 -19.262 -9.511 23.119 1.00 0.00 H ATOM 4353 H ASN B 12 -16.391 -11.111 24.547 1.00 0.00 H ATOM 4354 N VAL B 13 -14.443 -13.838 22.109 1.00 28.39 N ATOM 4355 CA VAL B 13 -13.073 -14.272 21.983 1.00 33.53 C ATOM 4356 C VAL B 13 -12.579 -14.167 20.537 1.00 36.91 C ATOM 4357 O VAL B 13 -13.283 -14.564 19.590 1.00 42.32 O ATOM 4358 CB VAL B 13 -12.894 -15.708 22.472 1.00 30.36 C ATOM 4359 CG1 VAL B 13 -11.433 -16.098 22.404 1.00 29.30 C ATOM 4360 CG2 VAL B 13 -13.452 -15.852 23.869 1.00 28.29 C ATOM 4361 HA VAL B 13 -12.478 -13.606 22.609 1.00 0.00 H ATOM 4362 HB VAL B 13 -13.448 -16.388 21.825 1.00 0.00 H ATOM 4363 HG11 VAL B 13 -11.086 -16.023 21.374 1.00 0.00 H ATOM 4364 HG12 VAL B 13 -10.850 -15.428 23.035 1.00 0.00 H ATOM 4365 HG13 VAL B 13 -11.315 -17.123 22.755 1.00 0.00 H ATOM 4366 HG21 VAL B 13 -12.924 -15.175 24.541 1.00 0.00 H ATOM 4367 HG22 VAL B 13 -14.514 -15.605 23.862 1.00 0.00 H ATOM 4368 HG23 VAL B 13 -13.319 -16.879 24.208 1.00 0.00 H ATOM 4369 H VAL B 13 -15.207 -14.440 21.741 1.00 0.00 H ATOM 4370 N TYR B 14 -11.371 -13.622 20.378 1.00 36.24 N ATOM 4371 CA TYR B 14 -10.717 -13.499 19.077 1.00 32.92 C ATOM 4372 C TYR B 14 -9.284 -13.964 19.250 1.00 32.83 C ATOM 4373 O TYR B 14 -8.636 -13.703 20.284 1.00 26.39 O ATOM 4374 CB TYR B 14 -10.755 -12.049 18.559 1.00 35.75 C ATOM 4375 CG TYR B 14 -12.118 -11.363 18.658 1.00 37.11 C ATOM 4376 CD1 TYR B 14 -12.511 -10.742 19.835 1.00 37.49 C ATOM 4377 CD2 TYR B 14 -13.018 -11.338 17.567 1.00 35.73 C ATOM 4378 CE1 TYR B 14 -13.753 -10.111 19.947 1.00 37.21 C ATOM 4379 CE2 TYR B 14 -14.267 -10.698 17.668 1.00 32.58 C ATOM 4380 CZ TYR B 14 -14.625 -10.082 18.874 1.00 38.27 C ATOM 4381 OH TYR B 14 -15.853 -9.433 19.047 1.00 40.60 O ATOM 4382 HA TYR B 14 -11.239 -14.107 18.339 1.00 0.00 H ATOM 4383 HB3 TYR B 14 -10.455 -12.056 17.511 1.00 0.00 H ATOM 4384 HB2 TYR B 14 -10.039 -11.464 19.137 1.00 0.00 H ATOM 4385 HD2 TYR B 14 -12.739 -11.823 16.632 1.00 0.00 H ATOM 4386 HE2 TYR B 14 -14.948 -10.682 16.817 1.00 0.00 H ATOM 4387 HE1 TYR B 14 -14.037 -9.638 20.887 1.00 0.00 H ATOM 4388 HD1 TYR B 14 -11.836 -10.746 20.691 1.00 0.00 H ATOM 4389 HH TYR B 14 -16.589 -10.079 18.904 1.00 0.00 H ATOM 4390 H TYR B 14 -10.872 -13.268 21.219 1.00 0.00 H ATOM 4391 N SER B 15 -8.814 -14.699 18.251 1.00 34.90 N ATOM 4392 CA SER B 15 -7.431 -15.173 18.162 1.00 38.57 C ATOM 4393 C SER B 15 -6.680 -14.488 17.029 1.00 36.81 C ATOM 4394 O SER B 15 -5.452 -14.562 16.959 1.00 40.72 O ATOM 4395 CB SER B 15 -7.427 -16.680 17.916 1.00 40.04 C ATOM 4396 OG SER B 15 -8.323 -17.296 18.818 1.00 48.29 O ATOM 4397 HA SER B 15 -6.932 -14.936 19.102 1.00 0.00 H ATOM 4398 HB2 SER B 15 -6.423 -17.073 18.072 1.00 0.00 H ATOM 4399 HB3 SER B 15 -7.741 -16.884 16.892 1.00 0.00 H ATOM 4400 HG SER B 15 -8.036 -17.108 19.747 1.00 0.00 H ATOM 4401 H SER B 15 -9.468 -14.955 17.484 1.00 0.00 H ATOM 4402 N ALA B 16 -7.427 -13.884 16.110 1.00 34.09 N ATOM 4403 CA ALA B 16 -6.834 -13.139 15.018 1.00 37.65 C ATOM 4404 C ALA B 16 -6.538 -11.710 15.488 1.00 36.42 C ATOM 4405 O ALA B 16 -7.458 -10.996 15.951 1.00 35.50 O ATOM 4406 CB ALA B 16 -7.770 -13.141 13.768 1.00 41.14 C ATOM 4407 HA ALA B 16 -5.900 -13.616 14.721 1.00 0.00 H ATOM 4408 HB1 ALA B 16 -7.937 -14.168 13.442 1.00 0.00 H ATOM 4409 HB2 ALA B 16 -8.723 -12.682 14.029 1.00 0.00 H ATOM 4410 HB3 ALA B 16 -7.301 -12.575 12.963 1.00 0.00 H ATOM 4411 H ALA B 16 -8.463 -13.948 16.177 1.00 0.00 H ATOM 4412 N PRO B 17 -5.246 -11.298 15.420 1.00 34.70 N ATOM 4413 CA PRO B 17 -4.906 -9.910 15.706 1.00 33.37 C ATOM 4414 C PRO B 17 -5.792 -8.914 14.947 1.00 33.34 C ATOM 4415 O PRO B 17 -6.321 -7.973 15.545 1.00 34.86 O ATOM 4416 CB PRO B 17 -3.440 -9.840 15.262 1.00 36.56 C ATOM 4417 CG PRO B 17 -2.914 -11.201 15.651 1.00 30.66 C ATOM 4418 CD PRO B 17 -4.027 -12.086 15.128 1.00 34.04 C ATOM 4419 HA PRO B 17 -5.061 -9.636 16.750 1.00 0.00 H ATOM 4420 HD3 PRO B 17 -3.920 -12.259 14.057 1.00 0.00 H ATOM 4421 HD2 PRO B 17 -4.045 -13.043 15.650 1.00 0.00 H ATOM 4422 HG3 PRO B 17 -2.798 -11.295 16.731 1.00 0.00 H ATOM 4423 HG2 PRO B 17 -1.963 -11.420 15.165 1.00 0.00 H ATOM 4424 HB2 PRO B 17 -3.361 -9.680 14.187 1.00 0.00 H ATOM 4425 HB3 PRO B 17 -2.907 -9.047 15.786 1.00 0.00 H ATOM 4426 N GLY B 18 -5.978 -9.137 13.646 1.00 35.80 N ATOM 4427 CA GLY B 18 -6.712 -8.204 12.796 1.00 28.22 C ATOM 4428 C GLY B 18 -8.156 -8.075 13.190 1.00 31.09 C ATOM 4429 O GLY B 18 -8.755 -7.044 12.953 1.00 35.26 O ATOM 4430 HA3 GLY B 18 -6.661 -8.556 11.766 1.00 0.00 H ATOM 4431 HA2 GLY B 18 -6.242 -7.223 12.867 1.00 0.00 H ATOM 4432 H GLY B 18 -5.588 -10.003 13.223 1.00 0.00 H ATOM 4433 N ASP B 19 -8.707 -9.122 13.808 1.00 29.80 N ATOM 4434 CA ASP B 19 -10.098 -9.142 14.274 1.00 28.77 C ATOM 4435 C ASP B 19 -10.290 -8.289 15.513 1.00 29.68 C ATOM 4436 O ASP B 19 -11.213 -7.439 15.615 1.00 31.50 O ATOM 4437 CB ASP B 19 -10.487 -10.584 14.628 1.00 31.68 C ATOM 4438 CG ASP B 19 -11.044 -11.378 13.434 1.00 34.59 C ATOM 4439 OD1 ASP B 19 -10.819 -10.990 12.254 1.00 37.73 O ATOM 4440 OD2 ASP B 19 -11.735 -12.397 13.686 1.00 35.15 O ATOM 4441 HA ASP B 19 -10.721 -8.744 13.473 1.00 0.00 H ATOM 4442 HB2 ASP B 19 -9.602 -11.099 15.003 1.00 0.00 H ATOM 4443 HB3 ASP B 19 -11.247 -10.555 15.409 1.00 0.00 H ATOM 4444 H ASP B 19 -8.121 -9.966 13.967 1.00 0.00 H ATOM 4445 N VAL B 20 -9.435 -8.541 16.487 1.00 26.60 N ATOM 4446 CA VAL B 20 -9.479 -7.752 17.705 1.00 30.67 C ATOM 4447 C VAL B 20 -9.142 -6.253 17.399 1.00 29.06 C ATOM 4448 O VAL B 20 -9.713 -5.339 18.016 1.00 27.26 O ATOM 4449 CB VAL B 20 -8.618 -8.428 18.823 1.00 28.24 C ATOM 4450 CG1 VAL B 20 -7.125 -8.116 18.648 1.00 31.10 C ATOM 4451 CG2 VAL B 20 -9.078 -8.003 20.179 1.00 26.80 C ATOM 4452 HA VAL B 20 -10.490 -7.728 18.111 1.00 0.00 H ATOM 4453 HB VAL B 20 -8.752 -9.506 18.730 1.00 0.00 H ATOM 4454 HG11 VAL B 20 -6.789 -8.487 17.680 1.00 0.00 H ATOM 4455 HG12 VAL B 20 -6.972 -7.038 18.698 1.00 0.00 H ATOM 4456 HG13 VAL B 20 -6.558 -8.602 19.442 1.00 0.00 H ATOM 4457 HG21 VAL B 20 -8.985 -6.921 20.270 1.00 0.00 H ATOM 4458 HG22 VAL B 20 -10.120 -8.292 20.315 1.00 0.00 H ATOM 4459 HG23 VAL B 20 -8.463 -8.487 20.938 1.00 0.00 H ATOM 4460 H VAL B 20 -8.733 -9.301 16.382 1.00 0.00 H ATOM 4461 N ALA B 21 -8.277 -6.016 16.408 1.00 26.42 N ATOM 4462 CA ALA B 21 -7.935 -4.650 15.987 1.00 30.28 C ATOM 4463 C ALA B 21 -9.141 -3.970 15.417 1.00 35.90 C ATOM 4464 O ALA B 21 -9.324 -2.765 15.697 1.00 41.37 O ATOM 4465 CB ALA B 21 -6.806 -4.615 14.958 1.00 29.40 C ATOM 4466 HA ALA B 21 -7.588 -4.125 16.877 1.00 0.00 H ATOM 4467 HB1 ALA B 21 -5.911 -5.067 15.387 1.00 0.00 H ATOM 4468 HB2 ALA B 21 -7.107 -5.173 14.071 1.00 0.00 H ATOM 4469 HB3 ALA B 21 -6.597 -3.581 14.685 1.00 0.00 H ATOM 4470 H ALA B 21 -7.833 -6.821 15.921 1.00 0.00 H ATOM 4471 N ASP B 22 -9.932 -4.717 14.614 1.00 34.68 N ATOM 4472 CA ASP B 22 -11.156 -4.197 13.938 1.00 37.12 C ATOM 4473 C ASP B 22 -12.247 -3.909 14.938 1.00 35.60 C ATOM 4474 O ASP B 22 -12.845 -2.835 14.911 1.00 32.55 O ATOM 4475 CB ASP B 22 -11.739 -5.173 12.897 1.00 43.57 C ATOM 4476 CG ASP B 22 -10.829 -5.390 11.691 1.00 43.33 C ATOM 4477 OD1 ASP B 22 -9.903 -4.577 11.471 1.00 43.66 O ATOM 4478 OD2 ASP B 22 -11.041 -6.401 10.975 1.00 45.02 O ATOM 4479 HA ASP B 22 -10.833 -3.288 13.431 1.00 0.00 H ATOM 4480 HB2 ASP B 22 -11.906 -6.135 13.381 1.00 0.00 H ATOM 4481 HB3 ASP B 22 -12.690 -4.775 12.545 1.00 0.00 H ATOM 4482 H ASP B 22 -9.672 -5.712 14.459 1.00 0.00 H ATOM 4483 N VAL B 23 -12.502 -4.867 15.827 1.00 32.92 N ATOM 4484 CA VAL B 23 -13.501 -4.658 16.868 1.00 29.36 C ATOM 4485 C VAL B 23 -13.108 -3.410 17.692 1.00 34.73 C ATOM 4486 O VAL B 23 -13.898 -2.463 17.817 1.00 34.82 O ATOM 4487 CB VAL B 23 -13.708 -5.933 17.761 1.00 28.02 C ATOM 4488 CG1 VAL B 23 -14.780 -5.706 18.886 1.00 27.42 C ATOM 4489 CG2 VAL B 23 -14.111 -7.144 16.893 1.00 27.84 C ATOM 4490 HA VAL B 23 -14.471 -4.480 16.403 1.00 0.00 H ATOM 4491 HB VAL B 23 -12.754 -6.135 18.248 1.00 0.00 H ATOM 4492 HG11 VAL B 23 -14.459 -4.889 19.532 1.00 0.00 H ATOM 4493 HG12 VAL B 23 -15.737 -5.455 18.429 1.00 0.00 H ATOM 4494 HG13 VAL B 23 -14.885 -6.617 19.475 1.00 0.00 H ATOM 4495 HG21 VAL B 23 -15.042 -6.922 16.372 1.00 0.00 H ATOM 4496 HG22 VAL B 23 -13.325 -7.345 16.165 1.00 0.00 H ATOM 4497 HG23 VAL B 23 -14.249 -8.017 17.531 1.00 0.00 H ATOM 4498 H VAL B 23 -11.986 -5.769 15.778 1.00 0.00 H ATOM 4499 N SER B 24 -11.885 -3.401 18.224 1.00 31.20 N ATOM 4500 CA SER B 24 -11.462 -2.328 19.121 1.00 34.31 C ATOM 4501 C SER B 24 -11.674 -0.950 18.460 1.00 34.98 C ATOM 4502 O SER B 24 -12.279 -0.068 19.069 1.00 31.50 O ATOM 4503 CB SER B 24 -9.993 -2.534 19.576 1.00 32.86 C ATOM 4504 OG SER B 24 -9.447 -1.345 20.132 1.00 26.95 O ATOM 4505 HA SER B 24 -12.083 -2.359 20.016 1.00 0.00 H ATOM 4506 HB2 SER B 24 -9.394 -2.830 18.715 1.00 0.00 H ATOM 4507 HB3 SER B 24 -9.962 -3.323 20.327 1.00 0.00 H ATOM 4508 HG SER B 24 -8.512 -1.512 20.411 1.00 0.00 H ATOM 4509 H SER B 24 -11.222 -4.170 17.997 1.00 0.00 H ATOM 4510 N ARG B 25 -11.208 -0.795 17.213 1.00 40.98 N ATOM 4511 CA ARG B 25 -11.327 0.466 16.443 1.00 44.47 C ATOM 4512 C ARG B 25 -12.779 0.914 16.267 1.00 42.60 C ATOM 4513 O ARG B 25 -13.094 2.085 16.517 1.00 40.49 O ATOM 4514 CB ARG B 25 -10.631 0.338 15.078 1.00 49.71 C ATOM 4515 CG ARG B 25 -10.574 1.627 14.187 1.00 52.54 C ATOM 4516 CD ARG B 25 -10.025 1.373 12.751 1.00 54.40 C ATOM 4517 NE ARG B 25 -8.897 0.422 12.758 1.00 64.29 N ATOM 4518 CZ ARG B 25 -8.906 -0.780 12.162 1.00 63.30 C ATOM 4519 NH1 ARG B 25 -9.975 -1.180 11.477 1.00 58.92 N ATOM 4520 NH2 ARG B 25 -7.839 -1.581 12.240 1.00 60.83 N ATOM 4521 HA ARG B 25 -10.825 1.239 17.026 1.00 0.00 H ATOM 4522 HB2 ARG B 25 -9.605 0.017 15.260 1.00 0.00 H ATOM 4523 HB3 ARG B 25 -11.156 -0.431 14.511 1.00 0.00 H ATOM 4524 HG2 ARG B 25 -11.582 2.033 14.103 1.00 0.00 H ATOM 4525 HG3 ARG B 25 -9.930 2.357 14.678 1.00 0.00 H ATOM 4526 HD2 ARG B 25 -9.687 2.320 12.329 1.00 0.00 H ATOM 4527 HD3 ARG B 25 -10.826 0.967 12.133 1.00 0.00 H ATOM 4528 HE ARG B 25 -8.032 0.704 13.262 1.00 0.00 H ATOM 4529 HH12 ARG B 25 -9.978 -2.112 11.016 1.00 0.00 H ATOM 4530 HH11 ARG B 25 -10.807 -0.560 11.403 1.00 0.00 H ATOM 4531 HH22 ARG B 25 -7.852 -2.512 11.776 1.00 0.00 H ATOM 4532 HH21 ARG B 25 -6.995 -1.274 12.765 1.00 0.00 H ATOM 4533 H ARG B 25 -10.737 -1.604 16.761 1.00 0.00 H ATOM 4534 N ALA B 26 -13.640 -0.029 15.869 1.00 37.43 N ATOM 4535 CA ALA B 26 -15.090 0.191 15.740 1.00 40.78 C ATOM 4536 C ALA B 26 -15.771 0.564 17.062 1.00 40.19 C ATOM 4537 O ALA B 26 -16.708 1.375 17.084 1.00 39.86 O ATOM 4538 CB ALA B 26 -15.772 -1.046 15.139 1.00 31.26 C ATOM 4539 HA ALA B 26 -15.206 1.044 15.071 1.00 0.00 H ATOM 4540 HB1 ALA B 26 -15.355 -1.246 14.152 1.00 0.00 H ATOM 4541 HB2 ALA B 26 -15.601 -1.905 15.788 1.00 0.00 H ATOM 4542 HB3 ALA B 26 -16.843 -0.863 15.052 1.00 0.00 H ATOM 4543 H ALA B 26 -13.264 -0.971 15.638 1.00 0.00 H ATOM 4544 N LEU B 27 -15.307 -0.035 18.159 1.00 40.55 N ATOM 4545 CA LEU B 27 -15.884 0.264 19.491 1.00 40.99 C ATOM 4546 C LEU B 27 -15.559 1.670 19.999 1.00 39.76 C ATOM 4547 O LEU B 27 -16.441 2.334 20.530 1.00 41.98 O ATOM 4548 CB LEU B 27 -15.529 -0.810 20.534 1.00 33.14 C ATOM 4549 CG LEU B 27 -16.359 -2.070 20.367 1.00 33.89 C ATOM 4550 CD1 LEU B 27 -15.884 -3.121 21.312 1.00 33.59 C ATOM 4551 CD2 LEU B 27 -17.858 -1.765 20.621 1.00 38.60 C ATOM 4552 HA LEU B 27 -16.964 0.239 19.347 1.00 0.00 H ATOM 4553 HB2 LEU B 27 -14.475 -1.067 20.428 1.00 0.00 H ATOM 4554 HB3 LEU B 27 -15.704 -0.404 21.530 1.00 0.00 H ATOM 4555 HG LEU B 27 -16.245 -2.432 19.345 1.00 0.00 H ATOM 4556 HD21 LEU B 27 -17.984 -1.387 21.636 1.00 0.00 H ATOM 4557 HD22 LEU B 27 -18.201 -1.015 19.908 1.00 0.00 H ATOM 4558 HD23 LEU B 27 -18.439 -2.679 20.497 1.00 0.00 H ATOM 4559 HD11 LEU B 27 -14.838 -3.349 21.104 1.00 0.00 H ATOM 4560 HD12 LEU B 27 -15.982 -2.759 22.335 1.00 0.00 H ATOM 4561 HD13 LEU B 27 -16.486 -4.021 21.185 1.00 0.00 H ATOM 4562 H LEU B 27 -14.530 -0.721 18.079 1.00 0.00 H ATOM 4563 N ARG B 28 -14.310 2.106 19.824 1.00 37.23 N ATOM 4564 CA ARG B 28 -13.902 3.477 20.147 1.00 44.93 C ATOM 4565 C ARG B 28 -14.663 4.582 19.389 1.00 47.27 C ATOM 4566 O ARG B 28 -15.027 5.599 19.992 1.00 49.56 O ATOM 4567 CB ARG B 28 -12.406 3.682 19.943 1.00 43.65 C ATOM 4568 CG ARG B 28 -11.882 4.698 20.935 1.00 50.83 C ATOM 4569 CD ARG B 28 -10.402 5.066 20.748 1.00 54.91 C ATOM 4570 NE ARG B 28 -10.001 6.057 21.756 1.00 58.28 N ATOM 4571 CZ ARG B 28 -10.536 7.279 21.869 1.00 58.01 C ATOM 4572 NH1 ARG B 28 -11.504 7.668 21.047 1.00 58.72 N ATOM 4573 NH2 ARG B 28 -10.120 8.121 22.810 1.00 57.45 N ATOM 4574 HA ARG B 28 -14.163 3.581 21.200 1.00 0.00 H ATOM 4575 HB2 ARG B 28 -11.888 2.734 20.089 1.00 0.00 H ATOM 4576 HB3 ARG B 28 -12.225 4.040 18.930 1.00 0.00 H ATOM 4577 HG2 ARG B 28 -12.474 5.608 20.836 1.00 0.00 H ATOM 4578 HG3 ARG B 28 -12.008 4.291 21.938 1.00 0.00 H ATOM 4579 HD2 ARG B 28 -10.256 5.484 19.752 1.00 0.00 H ATOM 4580 HD3 ARG B 28 -9.790 4.171 20.858 1.00 0.00 H ATOM 4581 HE ARG B 28 -9.252 5.791 22.426 1.00 0.00 H ATOM 4582 HH12 ARG B 28 -11.915 8.619 21.141 1.00 0.00 H ATOM 4583 HH11 ARG B 28 -11.851 7.022 20.310 1.00 0.00 H ATOM 4584 HH22 ARG B 28 -10.545 9.067 22.886 1.00 0.00 H ATOM 4585 HH21 ARG B 28 -9.370 7.833 23.470 1.00 0.00 H ATOM 4586 H ARG B 28 -13.599 1.449 19.444 1.00 0.00 H ATOM 4587 N LEU B 29 -14.888 4.392 18.085 1.00 45.79 N ATOM 4588 CA LEU B 29 -15.729 5.313 17.294 1.00 48.15 C ATOM 4589 C LEU B 29 -17.141 5.480 17.890 1.00 48.80 C ATOM 4590 O LEU B 29 -17.683 6.593 17.867 1.00 44.02 O ATOM 4591 CB LEU B 29 -15.800 4.922 15.809 1.00 47.88 C ATOM 4592 CG LEU B 29 -14.484 4.960 15.010 1.00 50.63 C ATOM 4593 CD1 LEU B 29 -14.685 4.314 13.658 1.00 48.90 C ATOM 4594 CD2 LEU B 29 -13.868 6.386 14.864 1.00 51.35 C ATOM 4595 HA LEU B 29 -15.234 6.283 17.349 1.00 0.00 H ATOM 4596 HB2 LEU B 29 -16.188 3.905 15.755 1.00 0.00 H ATOM 4597 HB3 LEU B 29 -16.499 5.602 15.323 1.00 0.00 H ATOM 4598 HG LEU B 29 -13.755 4.392 15.587 1.00 0.00 H ATOM 4599 HD21 LEU B 29 -14.576 7.035 14.348 1.00 0.00 H ATOM 4600 HD22 LEU B 29 -13.655 6.791 15.853 1.00 0.00 H ATOM 4601 HD23 LEU B 29 -12.944 6.324 14.289 1.00 0.00 H ATOM 4602 HD11 LEU B 29 -14.994 3.278 13.794 1.00 0.00 H ATOM 4603 HD12 LEU B 29 -15.456 4.855 13.109 1.00 0.00 H ATOM 4604 HD13 LEU B 29 -13.750 4.345 13.099 1.00 0.00 H ATOM 4605 H LEU B 29 -14.458 3.571 17.613 1.00 0.00 H ATOM 4606 N THR B 30 -17.690 4.397 18.459 1.00 44.61 N ATOM 4607 CA THR B 30 -18.981 4.456 19.131 1.00 48.50 C ATOM 4608 C THR B 30 -18.901 4.915 20.607 1.00 49.83 C ATOM 4609 O THR B 30 -19.842 4.725 21.390 1.00 49.69 O ATOM 4610 CB THR B 30 -19.809 3.131 18.978 1.00 52.26 C ATOM 4611 OG1 THR B 30 -19.316 2.107 19.852 1.00 50.98 O ATOM 4612 CG2 THR B 30 -19.796 2.636 17.535 1.00 57.04 C ATOM 4613 HA THR B 30 -19.528 5.239 18.605 1.00 0.00 H ATOM 4614 HB THR B 30 -20.838 3.359 19.257 1.00 0.00 H ATOM 4615 HG1 THR B 30 -18.370 1.915 19.633 1.00 0.00 H ATOM 4616 HG23 THR B 30 -20.172 3.421 16.879 1.00 0.00 H ATOM 4617 HG21 THR B 30 -18.776 2.380 17.249 1.00 0.00 H ATOM 4618 HG22 THR B 30 -20.431 1.754 17.449 1.00 0.00 H ATOM 4619 H THR B 30 -17.181 3.491 18.419 1.00 0.00 H ATOM 4620 N GLY B 31 -17.786 5.535 20.979 1.00 47.45 N ATOM 4621 CA GLY B 31 -17.621 6.060 22.332 1.00 49.63 C ATOM 4622 C GLY B 31 -17.504 5.066 23.488 1.00 46.27 C ATOM 4623 O GLY B 31 -18.068 5.307 24.562 1.00 55.19 O ATOM 4624 HA3 GLY B 31 -18.482 6.695 22.539 1.00 0.00 H ATOM 4625 HA2 GLY B 31 -16.715 6.666 22.335 1.00 0.00 H ATOM 4626 H GLY B 31 -17.014 5.649 20.292 1.00 0.00 H ATOM 4627 N ARG B 32 -16.804 3.950 23.289 1.00 39.88 N ATOM 4628 CA ARG B 32 -16.376 3.149 24.421 1.00 34.93 C ATOM 4629 C ARG B 32 -14.935 3.518 24.583 1.00 34.22 C ATOM 4630 O ARG B 32 -14.315 3.923 23.615 1.00 37.33 O ATOM 4631 CB ARG B 32 -16.499 1.643 24.159 1.00 39.81 C ATOM 4632 CG ARG B 32 -17.932 1.067 23.899 1.00 38.80 C ATOM 4633 CD ARG B 32 -18.870 1.061 25.097 1.00 37.07 C ATOM 4634 NE ARG B 32 -18.627 0.039 26.112 1.00 39.61 N ATOM 4635 CZ ARG B 32 -18.917 -1.267 25.996 1.00 42.00 C ATOM 4636 NH1 ARG B 32 -19.423 -1.762 24.868 1.00 29.70 N ATOM 4637 NH2 ARG B 32 -18.662 -2.101 27.014 1.00 37.48 N ATOM 4638 HA ARG B 32 -16.990 3.341 25.301 1.00 0.00 H ATOM 4639 HB2 ARG B 32 -15.891 1.413 23.284 1.00 0.00 H ATOM 4640 HB3 ARG B 32 -16.092 1.126 25.028 1.00 0.00 H ATOM 4641 HG2 ARG B 32 -18.396 1.664 23.114 1.00 0.00 H ATOM 4642 HG3 ARG B 32 -17.822 0.039 23.555 1.00 0.00 H ATOM 4643 HD2 ARG B 32 -19.884 0.921 24.723 1.00 0.00 H ATOM 4644 HD3 ARG B 32 -18.794 2.034 25.582 1.00 0.00 H ATOM 4645 HE ARG B 32 -18.191 0.350 27.003 1.00 0.00 H ATOM 4646 HH12 ARG B 32 -19.641 -2.776 24.797 1.00 0.00 H ATOM 4647 HH11 ARG B 32 -19.600 -1.134 24.058 1.00 0.00 H ATOM 4648 HH22 ARG B 32 -18.886 -3.113 26.926 1.00 0.00 H ATOM 4649 HH21 ARG B 32 -18.240 -1.736 27.892 1.00 0.00 H ATOM 4650 H ARG B 32 -16.564 3.653 22.322 1.00 0.00 H ATOM 4651 N ARG B 33 -14.404 3.406 25.800 1.00 35.74 N ATOM 4652 CA ARG B 33 -12.970 3.558 26.071 1.00 28.51 C ATOM 4653 C ARG B 33 -12.362 2.175 26.250 1.00 25.71 C ATOM 4654 O ARG B 33 -12.682 1.479 27.190 1.00 32.24 O ATOM 4655 CB ARG B 33 -12.751 4.411 27.329 1.00 32.19 C ATOM 4656 CG ARG B 33 -13.220 5.897 27.218 1.00 37.40 C ATOM 4657 CD ARG B 33 -12.255 6.678 26.284 1.00 50.18 C ATOM 4658 NE ARG B 33 -12.757 7.907 25.640 1.00 53.84 N ATOM 4659 CZ ARG B 33 -13.458 7.963 24.497 1.00 55.87 C ATOM 4660 NH1 ARG B 33 -13.812 6.846 23.849 1.00 56.93 N ATOM 4661 NH2 ARG B 33 -13.828 9.149 24.006 1.00 44.21 N ATOM 4662 HA ARG B 33 -12.487 4.066 25.236 1.00 0.00 H ATOM 4663 HB2 ARG B 33 -13.296 3.946 28.151 1.00 0.00 H ATOM 4664 HB3 ARG B 33 -11.685 4.410 27.555 1.00 0.00 H ATOM 4665 HG2 ARG B 33 -14.229 5.930 26.807 1.00 0.00 H ATOM 4666 HG3 ARG B 33 -13.217 6.354 28.208 1.00 0.00 H ATOM 4667 HD2 ARG B 33 -11.950 5.997 25.490 1.00 0.00 H ATOM 4668 HD3 ARG B 33 -11.383 6.955 26.877 1.00 0.00 H ATOM 4669 HE ARG B 33 -12.549 8.809 26.114 1.00 0.00 H ATOM 4670 HH12 ARG B 33 -14.355 6.908 22.964 1.00 0.00 H ATOM 4671 HH11 ARG B 33 -13.544 5.916 24.230 1.00 0.00 H ATOM 4672 HH22 ARG B 33 -14.371 9.199 23.121 1.00 0.00 H ATOM 4673 HH21 ARG B 33 -13.573 10.023 24.509 1.00 0.00 H ATOM 4674 H ARG B 33 -15.038 3.200 26.598 1.00 0.00 H ATOM 4675 N VAL B 34 -11.473 1.785 25.341 1.00 27.39 N ATOM 4676 CA VAL B 34 -10.772 0.492 25.367 1.00 27.10 C ATOM 4677 C VAL B 34 -9.620 0.387 26.418 1.00 28.02 C ATOM 4678 O VAL B 34 -8.657 1.173 26.401 1.00 35.87 O ATOM 4679 CB VAL B 34 -10.243 0.138 23.975 1.00 23.03 C ATOM 4680 CG1 VAL B 34 -9.896 -1.353 23.907 1.00 21.69 C ATOM 4681 CG2 VAL B 34 -11.272 0.579 22.894 1.00 20.21 C ATOM 4682 HA VAL B 34 -11.525 -0.229 25.683 1.00 0.00 H ATOM 4683 HB VAL B 34 -9.319 0.681 23.773 1.00 0.00 H ATOM 4684 HG11 VAL B 34 -9.131 -1.581 24.650 1.00 0.00 H ATOM 4685 HG12 VAL B 34 -10.790 -1.942 24.111 1.00 0.00 H ATOM 4686 HG13 VAL B 34 -9.521 -1.592 22.912 1.00 0.00 H ATOM 4687 HG21 VAL B 34 -12.218 0.064 23.063 1.00 0.00 H ATOM 4688 HG22 VAL B 34 -11.426 1.656 22.959 1.00 0.00 H ATOM 4689 HG23 VAL B 34 -10.890 0.324 21.905 1.00 0.00 H ATOM 4690 H VAL B 34 -11.259 2.438 24.560 1.00 0.00 H ATOM 4691 N MET B 35 -9.759 -0.581 27.317 1.00 21.17 N ATOM 4692 CA MET B 35 -8.830 -0.844 28.419 1.00 24.22 C ATOM 4693 C MET B 35 -8.235 -2.184 28.117 1.00 27.03 C ATOM 4694 O MET B 35 -8.994 -3.137 27.850 1.00 28.99 O ATOM 4695 CB MET B 35 -9.535 -0.951 29.790 1.00 19.33 C ATOM 4696 CG MET B 35 -10.450 0.246 30.126 1.00 20.41 C ATOM 4697 SD MET B 35 -9.527 1.732 30.456 1.00 28.33 S ATOM 4698 CE MET B 35 -10.198 2.902 29.322 1.00 20.93 C ATOM 4699 HA MET B 35 -8.110 -0.028 28.488 1.00 0.00 H ATOM 4700 HB2 MET B 35 -10.141 -1.857 29.793 1.00 0.00 H ATOM 4701 HB3 MET B 35 -8.770 -1.025 30.563 1.00 0.00 H ATOM 4702 HG2 MET B 35 -11.042 -0.002 31.007 1.00 0.00 H ATOM 4703 HG3 MET B 35 -11.115 0.427 29.282 1.00 0.00 H ATOM 4704 HE1 MET B 35 -10.053 2.543 28.303 1.00 0.00 H ATOM 4705 HE2 MET B 35 -11.263 3.025 29.517 1.00 0.00 H ATOM 4706 HE3 MET B 35 -9.691 3.859 29.447 1.00 0.00 H ATOM 4707 H MET B 35 -10.591 -1.199 27.232 1.00 0.00 H ATOM 4708 N LEU B 36 -6.892 -2.237 28.130 1.00 21.40 N ATOM 4709 CA LEU B 36 -6.152 -3.462 27.928 1.00 23.88 C ATOM 4710 C LEU B 36 -5.493 -3.990 29.201 1.00 26.27 C ATOM 4711 O LEU B 36 -4.714 -3.279 29.889 1.00 25.50 O ATOM 4712 CB LEU B 36 -5.096 -3.281 26.843 1.00 20.82 C ATOM 4713 CG LEU B 36 -4.215 -4.496 26.479 1.00 22.25 C ATOM 4714 CD1 LEU B 36 -4.999 -5.704 25.973 1.00 23.03 C ATOM 4715 CD2 LEU B 36 -3.097 -4.097 25.477 1.00 20.11 C ATOM 4716 HA LEU B 36 -6.885 -4.205 27.615 1.00 0.00 H ATOM 4717 HB2 LEU B 36 -5.614 -2.972 25.935 1.00 0.00 H ATOM 4718 HB3 LEU B 36 -4.429 -2.483 27.169 1.00 0.00 H ATOM 4719 HG LEU B 36 -3.755 -4.814 27.414 1.00 0.00 H ATOM 4720 HD21 LEU B 36 -3.550 -3.709 24.565 1.00 0.00 H ATOM 4721 HD22 LEU B 36 -2.466 -3.330 25.926 1.00 0.00 H ATOM 4722 HD23 LEU B 36 -2.494 -4.973 25.240 1.00 0.00 H ATOM 4723 HD11 LEU B 36 -5.696 -6.032 26.744 1.00 0.00 H ATOM 4724 HD12 LEU B 36 -5.552 -5.427 25.075 1.00 0.00 H ATOM 4725 HD13 LEU B 36 -4.307 -6.513 25.740 1.00 0.00 H ATOM 4726 H LEU B 36 -6.362 -1.357 28.293 1.00 0.00 H ATOM 4727 N VAL B 37 -5.776 -5.267 29.454 1.00 25.75 N ATOM 4728 CA VAL B 37 -5.148 -6.052 30.521 1.00 25.85 C ATOM 4729 C VAL B 37 -4.394 -7.265 29.951 1.00 26.79 C ATOM 4730 O VAL B 37 -4.975 -8.346 29.728 1.00 19.70 O ATOM 4731 CB VAL B 37 -6.145 -6.546 31.554 1.00 23.66 C ATOM 4732 CG1 VAL B 37 -5.424 -7.467 32.540 1.00 27.07 C ATOM 4733 CG2 VAL B 37 -6.840 -5.361 32.268 1.00 24.39 C ATOM 4734 HA VAL B 37 -4.450 -5.373 31.011 1.00 0.00 H ATOM 4735 HB VAL B 37 -6.934 -7.114 31.060 1.00 0.00 H ATOM 4736 HG11 VAL B 37 -5.001 -8.315 32.001 1.00 0.00 H ATOM 4737 HG12 VAL B 37 -4.625 -6.914 33.034 1.00 0.00 H ATOM 4738 HG13 VAL B 37 -6.134 -7.826 33.285 1.00 0.00 H ATOM 4739 HG21 VAL B 37 -6.090 -4.751 32.770 1.00 0.00 H ATOM 4740 HG22 VAL B 37 -7.370 -4.756 31.533 1.00 0.00 H ATOM 4741 HG23 VAL B 37 -7.548 -5.746 33.002 1.00 0.00 H ATOM 4742 H VAL B 37 -6.487 -5.736 28.857 1.00 0.00 H ATOM 4743 N PRO B 38 -3.092 -7.077 29.685 1.00 25.15 N ATOM 4744 CA PRO B 38 -2.270 -8.151 29.120 1.00 21.74 C ATOM 4745 C PRO B 38 -2.020 -9.239 30.153 1.00 27.83 C ATOM 4746 O PRO B 38 -1.538 -8.947 31.218 1.00 26.35 O ATOM 4747 CB PRO B 38 -0.958 -7.447 28.747 1.00 25.65 C ATOM 4748 CG PRO B 38 -1.259 -5.911 28.823 1.00 27.95 C ATOM 4749 CD PRO B 38 -2.370 -5.798 29.849 1.00 23.73 C ATOM 4750 HA PRO B 38 -2.744 -8.643 28.271 1.00 0.00 H ATOM 4751 HD3 PRO B 38 -1.967 -5.700 30.857 1.00 0.00 H ATOM 4752 HD2 PRO B 38 -3.019 -4.949 29.635 1.00 0.00 H ATOM 4753 HG3 PRO B 38 -1.587 -5.533 27.855 1.00 0.00 H ATOM 4754 HG2 PRO B 38 -0.376 -5.360 29.147 1.00 0.00 H ATOM 4755 HB2 PRO B 38 -0.170 -7.715 29.451 1.00 0.00 H ATOM 4756 HB3 PRO B 38 -0.652 -7.724 27.738 1.00 0.00 H ATOM 4757 N THR B 39 -2.401 -10.483 29.881 1.00 29.21 N ATOM 4758 CA THR B 39 -2.034 -11.541 30.808 1.00 28.82 C ATOM 4759 C THR B 39 -1.350 -12.685 30.097 1.00 31.69 C ATOM 4760 O THR B 39 -1.305 -12.737 28.859 1.00 31.53 O ATOM 4761 CB THR B 39 -3.236 -12.092 31.647 1.00 27.18 C ATOM 4762 OG1 THR B 39 -3.994 -13.031 30.871 1.00 33.02 O ATOM 4763 CG2 THR B 39 -4.126 -10.978 32.129 1.00 26.16 C ATOM 4764 HA THR B 39 -1.341 -11.075 31.508 1.00 0.00 H ATOM 4765 HB THR B 39 -2.829 -12.598 32.522 1.00 0.00 H ATOM 4766 HG1 THR B 39 -4.343 -12.582 30.061 1.00 0.00 H ATOM 4767 HG23 THR B 39 -3.538 -10.273 32.716 1.00 0.00 H ATOM 4768 HG21 THR B 39 -4.560 -10.465 31.271 1.00 0.00 H ATOM 4769 HG22 THR B 39 -4.922 -11.392 32.747 1.00 0.00 H ATOM 4770 H THR B 39 -2.950 -10.695 29.023 1.00 0.00 H ATOM 4771 N MET B 40 -0.823 -13.596 30.903 1.00 34.71 N ATOM 4772 CA MET B 40 -0.158 -14.782 30.422 1.00 42.61 C ATOM 4773 C MET B 40 -0.937 -16.006 30.873 1.00 46.27 C ATOM 4774 O MET B 40 -0.355 -17.090 31.018 1.00 51.60 O ATOM 4775 CB MET B 40 1.247 -14.852 30.993 1.00 39.65 C ATOM 4776 CG MET B 40 2.251 -14.042 30.221 1.00 46.68 C ATOM 4777 SD MET B 40 3.933 -14.526 30.672 1.00 52.72 S ATOM 4778 CE MET B 40 3.819 -14.521 32.480 1.00 53.21 C ATOM 4779 HA MET B 40 -0.106 -14.750 29.334 1.00 0.00 H ATOM 4780 HB2 MET B 40 1.221 -14.483 32.018 1.00 0.00 H ATOM 4781 HB3 MET B 40 1.569 -15.893 30.991 1.00 0.00 H ATOM 4782 HG2 MET B 40 2.109 -12.985 30.446 1.00 0.00 H ATOM 4783 HG3 MET B 40 2.103 -14.209 29.154 1.00 0.00 H ATOM 4784 HE1 MET B 40 3.546 -13.523 32.823 1.00 0.00 H ATOM 4785 HE2 MET B 40 3.060 -15.236 32.797 1.00 0.00 H ATOM 4786 HE3 MET B 40 4.783 -14.801 32.904 1.00 0.00 H ATOM 4787 H MET B 40 -0.892 -13.449 31.930 1.00 0.00 H ATOM 4788 N GLY B 41 -2.242 -15.821 31.109 1.00 45.44 N ATOM 4789 CA GLY B 41 -3.151 -16.907 31.480 1.00 40.27 C ATOM 4790 C GLY B 41 -3.029 -17.344 32.924 1.00 38.50 C ATOM 4791 O GLY B 41 -2.348 -16.686 33.704 1.00 37.40 O ATOM 4792 HA3 GLY B 41 -2.939 -17.765 30.842 1.00 0.00 H ATOM 4793 HA2 GLY B 41 -4.174 -16.572 31.308 1.00 0.00 H ATOM 4794 H GLY B 41 -2.629 -14.859 31.025 1.00 0.00 H ATOM 4795 N ALA B 42 -3.687 -18.453 33.277 1.00 34.40 N ATOM 4796 CA ALA B 42 -3.689 -18.961 34.656 1.00 32.09 C ATOM 4797 C ALA B 42 -4.031 -17.830 35.641 1.00 36.58 C ATOM 4798 O ALA B 42 -3.265 -17.494 36.575 1.00 33.73 O ATOM 4799 CB ALA B 42 -2.348 -19.662 34.999 1.00 27.80 C ATOM 4800 HA ALA B 42 -4.465 -19.720 34.749 1.00 0.00 H ATOM 4801 HB1 ALA B 42 -2.194 -20.500 34.320 1.00 0.00 H ATOM 4802 HB2 ALA B 42 -1.530 -18.950 34.892 1.00 0.00 H ATOM 4803 HB3 ALA B 42 -2.382 -20.026 36.026 1.00 0.00 H ATOM 4804 H ALA B 42 -4.216 -18.975 32.550 1.00 0.00 H ATOM 4805 N LEU B 43 -5.207 -17.237 35.419 1.00 39.08 N ATOM 4806 CA LEU B 43 -5.577 -16.038 36.152 1.00 38.01 C ATOM 4807 C LEU B 43 -5.865 -16.363 37.594 1.00 43.00 C ATOM 4808 O LEU B 43 -6.516 -17.369 37.912 1.00 51.89 O ATOM 4809 CB LEU B 43 -6.768 -15.339 35.498 1.00 37.84 C ATOM 4810 CG LEU B 43 -6.676 -15.271 33.971 1.00 37.23 C ATOM 4811 CD1 LEU B 43 -7.927 -14.692 33.385 1.00 40.72 C ATOM 4812 CD2 LEU B 43 -5.442 -14.529 33.510 1.00 36.28 C ATOM 4813 HA LEU B 43 -4.732 -15.350 36.122 1.00 0.00 H ATOM 4814 HB2 LEU B 43 -7.675 -15.881 35.765 1.00 0.00 H ATOM 4815 HB3 LEU B 43 -6.826 -14.322 35.886 1.00 0.00 H ATOM 4816 HG LEU B 43 -6.579 -16.292 33.602 1.00 0.00 H ATOM 4817 HD21 LEU B 43 -5.467 -13.510 33.896 1.00 0.00 H ATOM 4818 HD22 LEU B 43 -4.553 -15.038 33.883 1.00 0.00 H ATOM 4819 HD23 LEU B 43 -5.419 -14.506 32.420 1.00 0.00 H ATOM 4820 HD11 LEU B 43 -8.777 -15.317 33.658 1.00 0.00 H ATOM 4821 HD12 LEU B 43 -8.076 -13.684 33.773 1.00 0.00 H ATOM 4822 HD13 LEU B 43 -7.835 -14.655 32.300 1.00 0.00 H ATOM 4823 H LEU B 43 -5.862 -17.636 34.717 1.00 0.00 H ATOM 4824 N HIS B 44 -5.347 -15.529 38.470 1.00 38.11 N ATOM 4825 CA HIS B 44 -5.733 -15.558 39.868 1.00 36.97 C ATOM 4826 C HIS B 44 -6.262 -14.161 40.258 1.00 36.35 C ATOM 4827 O HIS B 44 -6.432 -13.274 39.401 1.00 38.64 O ATOM 4828 CB HIS B 44 -4.539 -15.998 40.745 1.00 34.86 C ATOM 4829 CG HIS B 44 -3.319 -15.155 40.564 1.00 31.18 C ATOM 4830 ND1 HIS B 44 -3.300 -13.808 40.860 1.00 34.32 N ATOM 4831 CD2 HIS B 44 -2.088 -15.456 40.088 1.00 29.92 C ATOM 4832 CE1 HIS B 44 -2.107 -13.316 40.587 1.00 35.99 C ATOM 4833 NE2 HIS B 44 -1.352 -14.297 40.118 1.00 40.25 N ATOM 4834 HA HIS B 44 -6.526 -16.287 40.032 1.00 0.00 H ATOM 4835 HB2 HIS B 44 -4.842 -15.946 41.791 1.00 0.00 H ATOM 4836 HB3 HIS B 44 -4.287 -17.028 40.492 1.00 0.00 H ATOM 4837 HD2 HIS B 44 -1.746 -16.433 39.746 1.00 0.00 H ATOM 4838 HE1 HIS B 44 -1.796 -12.280 40.724 1.00 0.00 H ATOM 4839 H HIS B 44 -4.644 -14.832 38.152 1.00 0.00 H ATOM 4840 N GLU B 45 -6.490 -13.955 41.543 1.00 34.48 N ATOM 4841 CA GLU B 45 -7.170 -12.759 42.016 1.00 38.03 C ATOM 4842 C GLU B 45 -6.407 -11.495 41.616 1.00 39.02 C ATOM 4843 O GLU B 45 -7.015 -10.427 41.307 1.00 37.59 O ATOM 4844 CB GLU B 45 -7.348 -12.835 43.530 1.00 39.66 C ATOM 4845 CG GLU B 45 -8.660 -13.451 43.955 1.00 54.95 C ATOM 4846 CD GLU B 45 -9.814 -12.439 43.892 1.00 63.93 C ATOM 4847 OE1 GLU B 45 -9.657 -11.322 44.475 1.00 63.72 O ATOM 4848 OE2 GLU B 45 -10.863 -12.769 43.260 1.00 64.94 O ATOM 4849 HA GLU B 45 -8.153 -12.706 41.547 1.00 0.00 H ATOM 4850 HB2 GLU B 45 -6.536 -13.434 43.943 1.00 0.00 H ATOM 4851 HB3 GLU B 45 -7.295 -11.824 43.935 1.00 0.00 H ATOM 4852 HG2 GLU B 45 -8.888 -14.287 43.294 1.00 0.00 H ATOM 4853 HG3 GLU B 45 -8.564 -13.814 44.978 1.00 0.00 H ATOM 4854 H GLU B 45 -6.175 -14.666 42.234 1.00 0.00 H ATOM 4855 N GLY B 46 -5.078 -11.628 41.658 1.00 34.47 N ATOM 4856 CA GLY B 46 -4.144 -10.573 41.223 1.00 34.59 C ATOM 4857 C GLY B 46 -4.461 -10.031 39.837 1.00 27.64 C ATOM 4858 O GLY B 46 -4.449 -8.840 39.653 1.00 34.72 O ATOM 4859 HA3 GLY B 46 -3.135 -10.985 41.212 1.00 0.00 H ATOM 4860 HA2 GLY B 46 -4.192 -9.751 41.937 1.00 0.00 H ATOM 4861 H GLY B 46 -4.682 -12.521 42.016 1.00 0.00 H ATOM 4862 N HIS B 47 -4.758 -10.911 38.883 1.00 26.54 N ATOM 4863 CA HIS B 47 -5.238 -10.524 37.554 1.00 32.95 C ATOM 4864 C HIS B 47 -6.641 -9.853 37.576 1.00 36.25 C ATOM 4865 O HIS B 47 -6.867 -8.813 36.942 1.00 36.96 O ATOM 4866 CB HIS B 47 -5.278 -11.755 36.637 1.00 33.14 C ATOM 4867 CG HIS B 47 -3.949 -12.422 36.450 1.00 31.73 C ATOM 4868 ND1 HIS B 47 -3.576 -13.562 37.142 1.00 39.99 N ATOM 4869 CD2 HIS B 47 -2.915 -12.125 35.633 1.00 25.14 C ATOM 4870 CE1 HIS B 47 -2.369 -13.942 36.751 1.00 36.69 C ATOM 4871 NE2 HIS B 47 -1.943 -13.082 35.840 1.00 37.32 N ATOM 4872 HA HIS B 47 -4.536 -9.782 37.175 1.00 0.00 H ATOM 4873 HB2 HIS B 47 -5.968 -12.481 37.068 1.00 0.00 H ATOM 4874 HB3 HIS B 47 -5.645 -11.442 35.659 1.00 0.00 H ATOM 4875 HD2 HIS B 47 -2.859 -11.286 34.940 1.00 0.00 H ATOM 4876 HE1 HIS B 47 -1.822 -14.811 37.116 1.00 0.00 H ATOM 4877 H HIS B 47 -4.644 -11.923 39.092 1.00 0.00 H ATOM 4878 N LEU B 48 -7.570 -10.474 38.299 1.00 35.90 N ATOM 4879 CA LEU B 48 -8.887 -9.918 38.570 1.00 33.63 C ATOM 4880 C LEU B 48 -8.879 -8.495 39.153 1.00 34.70 C ATOM 4881 O LEU B 48 -9.753 -7.685 38.791 1.00 30.80 O ATOM 4882 CB LEU B 48 -9.652 -10.861 39.504 1.00 37.41 C ATOM 4883 CG LEU B 48 -9.848 -12.334 39.092 1.00 37.08 C ATOM 4884 CD1 LEU B 48 -10.868 -12.971 40.036 1.00 36.99 C ATOM 4885 CD2 LEU B 48 -10.246 -12.553 37.600 1.00 31.94 C ATOM 4886 HA LEU B 48 -9.382 -9.831 37.603 1.00 0.00 H ATOM 4887 HB2 LEU B 48 -9.122 -10.864 40.457 1.00 0.00 H ATOM 4888 HB3 LEU B 48 -10.645 -10.434 39.644 1.00 0.00 H ATOM 4889 HG LEU B 48 -8.877 -12.820 39.180 1.00 0.00 H ATOM 4890 HD21 LEU B 48 -11.188 -12.043 37.398 1.00 0.00 H ATOM 4891 HD22 LEU B 48 -9.467 -12.148 36.954 1.00 0.00 H ATOM 4892 HD23 LEU B 48 -10.360 -13.620 37.409 1.00 0.00 H ATOM 4893 HD11 LEU B 48 -10.497 -12.917 41.060 1.00 0.00 H ATOM 4894 HD12 LEU B 48 -11.814 -12.435 39.962 1.00 0.00 H ATOM 4895 HD13 LEU B 48 -11.017 -14.014 39.757 1.00 0.00 H ATOM 4896 H LEU B 48 -7.342 -11.409 38.692 1.00 0.00 H ATOM 4897 N ALA B 49 -7.920 -8.172 40.035 1.00 25.63 N ATOM 4898 CA ALA B 49 -7.840 -6.773 40.522 1.00 30.36 C ATOM 4899 C ALA B 49 -7.532 -5.789 39.382 1.00 27.22 C ATOM 4900 O ALA B 49 -7.955 -4.630 39.431 1.00 35.88 O ATOM 4901 CB ALA B 49 -6.826 -6.613 41.647 1.00 26.58 C ATOM 4902 HA ALA B 49 -8.825 -6.533 40.924 1.00 0.00 H ATOM 4903 HB1 ALA B 49 -7.112 -7.248 42.485 1.00 0.00 H ATOM 4904 HB2 ALA B 49 -5.839 -6.905 41.289 1.00 0.00 H ATOM 4905 HB3 ALA B 49 -6.804 -5.572 41.969 1.00 0.00 H ATOM 4906 H ALA B 49 -7.246 -8.889 40.371 1.00 0.00 H ATOM 4907 N LEU B 50 -6.803 -6.260 38.367 1.00 27.90 N ATOM 4908 CA LEU B 50 -6.463 -5.468 37.166 1.00 25.98 C ATOM 4909 C LEU B 50 -7.702 -5.246 36.321 1.00 25.41 C ATOM 4910 O LEU B 50 -8.048 -4.115 35.991 1.00 23.17 O ATOM 4911 CB LEU B 50 -5.401 -6.192 36.349 1.00 25.80 C ATOM 4912 CG LEU B 50 -3.922 -5.834 36.544 1.00 24.54 C ATOM 4913 CD1 LEU B 50 -3.578 -5.598 37.959 1.00 20.79 C ATOM 4914 CD2 LEU B 50 -3.087 -6.932 35.970 1.00 24.84 C ATOM 4915 HA LEU B 50 -6.072 -4.501 37.481 1.00 0.00 H ATOM 4916 HB2 LEU B 50 -5.502 -7.255 36.569 1.00 0.00 H ATOM 4917 HB3 LEU B 50 -5.634 -6.016 35.299 1.00 0.00 H ATOM 4918 HG LEU B 50 -3.723 -4.897 36.025 1.00 0.00 H ATOM 4919 HD21 LEU B 50 -3.314 -7.866 36.484 1.00 0.00 H ATOM 4920 HD22 LEU B 50 -3.307 -7.037 34.908 1.00 0.00 H ATOM 4921 HD23 LEU B 50 -2.032 -6.691 36.101 1.00 0.00 H ATOM 4922 HD11 LEU B 50 -4.177 -4.773 38.344 1.00 0.00 H ATOM 4923 HD12 LEU B 50 -3.784 -6.499 38.537 1.00 0.00 H ATOM 4924 HD13 LEU B 50 -2.520 -5.349 38.038 1.00 0.00 H ATOM 4925 H LEU B 50 -6.455 -7.238 38.425 1.00 0.00 H ATOM 4926 N VAL B 51 -8.374 -6.345 36.001 1.00 28.48 N ATOM 4927 CA VAL B 51 -9.701 -6.325 35.374 1.00 30.22 C ATOM 4928 C VAL B 51 -10.730 -5.392 36.055 1.00 37.70 C ATOM 4929 O VAL B 51 -11.487 -4.684 35.362 1.00 42.45 O ATOM 4930 CB VAL B 51 -10.272 -7.748 35.280 1.00 26.85 C ATOM 4931 CG1 VAL B 51 -11.669 -7.725 34.701 1.00 31.61 C ATOM 4932 CG2 VAL B 51 -9.380 -8.640 34.438 1.00 19.64 C ATOM 4933 HA VAL B 51 -9.537 -5.910 34.380 1.00 0.00 H ATOM 4934 HB VAL B 51 -10.314 -8.155 36.290 1.00 0.00 H ATOM 4935 HG11 VAL B 51 -12.317 -7.126 35.341 1.00 0.00 H ATOM 4936 HG12 VAL B 51 -11.640 -7.289 33.702 1.00 0.00 H ATOM 4937 HG13 VAL B 51 -12.054 -8.743 34.644 1.00 0.00 H ATOM 4938 HG21 VAL B 51 -9.302 -8.228 33.432 1.00 0.00 H ATOM 4939 HG22 VAL B 51 -8.389 -8.691 34.889 1.00 0.00 H ATOM 4940 HG23 VAL B 51 -9.810 -9.640 34.390 1.00 0.00 H ATOM 4941 H VAL B 51 -7.938 -7.267 36.205 1.00 0.00 H ATOM 4942 N ARG B 52 -10.760 -5.384 37.394 1.00 34.76 N ATOM 4943 CA ARG B 52 -11.712 -4.562 38.126 1.00 28.98 C ATOM 4944 C ARG B 52 -11.430 -3.081 38.011 1.00 32.31 C ATOM 4945 O ARG B 52 -12.352 -2.278 37.915 1.00 34.06 O ATOM 4946 CB ARG B 52 -11.734 -4.971 39.596 1.00 36.88 C ATOM 4947 CG ARG B 52 -12.698 -6.096 39.864 1.00 38.36 C ATOM 4948 CD ARG B 52 -12.311 -6.912 41.027 1.00 38.15 C ATOM 4949 NE ARG B 52 -12.827 -8.265 40.844 1.00 39.52 N ATOM 4950 CZ ARG B 52 -12.439 -9.313 41.563 1.00 39.88 C ATOM 4951 NH1 ARG B 52 -11.496 -9.173 42.510 1.00 37.27 N ATOM 4952 NH2 ARG B 52 -12.966 -10.499 41.308 1.00 35.57 N ATOM 4953 HA ARG B 52 -12.688 -4.735 37.672 1.00 0.00 H ATOM 4954 HB2 ARG B 52 -10.733 -5.291 39.886 1.00 0.00 H ATOM 4955 HB3 ARG B 52 -12.026 -4.109 40.195 1.00 0.00 H ATOM 4956 HG2 ARG B 52 -13.686 -5.673 40.048 1.00 0.00 H ATOM 4957 HG3 ARG B 52 -12.737 -6.739 38.984 1.00 0.00 H ATOM 4958 HD2 ARG B 52 -12.731 -6.479 41.935 1.00 0.00 H ATOM 4959 HD3 ARG B 52 -11.224 -6.942 41.109 1.00 0.00 H ATOM 4960 HE ARG B 52 -13.543 -8.418 40.105 1.00 0.00 H ATOM 4961 HH12 ARG B 52 -11.195 -9.996 43.070 1.00 0.00 H ATOM 4962 HH11 ARG B 52 -11.067 -8.242 42.683 1.00 0.00 H ATOM 4963 HH22 ARG B 52 -12.672 -11.329 41.862 1.00 0.00 H ATOM 4964 HH21 ARG B 52 -13.674 -10.602 40.553 1.00 0.00 H ATOM 4965 H ARG B 52 -10.089 -5.978 37.922 1.00 0.00 H ATOM 4966 N ALA B 53 -10.150 -2.726 38.045 1.00 35.64 N ATOM 4967 CA ALA B 53 -9.683 -1.354 37.817 1.00 34.62 C ATOM 4968 C ALA B 53 -10.074 -0.884 36.421 1.00 32.30 C ATOM 4969 O ALA B 53 -10.562 0.238 36.243 1.00 37.33 O ATOM 4970 CB ALA B 53 -8.167 -1.269 37.997 1.00 32.40 C ATOM 4971 HA ALA B 53 -10.158 -0.702 38.550 1.00 0.00 H ATOM 4972 HB1 ALA B 53 -7.905 -1.569 39.012 1.00 0.00 H ATOM 4973 HB2 ALA B 53 -7.680 -1.933 37.283 1.00 0.00 H ATOM 4974 HB3 ALA B 53 -7.839 -0.244 37.824 1.00 0.00 H ATOM 4975 H ALA B 53 -9.441 -3.460 38.244 1.00 0.00 H ATOM 4976 N ALA B 54 -9.851 -1.730 35.434 1.00 24.91 N ATOM 4977 CA ALA B 54 -10.237 -1.401 34.081 1.00 30.84 C ATOM 4978 C ALA B 54 -11.774 -1.259 33.902 1.00 33.12 C ATOM 4979 O ALA B 54 -12.241 -0.391 33.177 1.00 35.71 O ATOM 4980 CB ALA B 54 -9.670 -2.405 33.138 1.00 30.78 C ATOM 4981 HA ALA B 54 -9.823 -0.419 33.853 1.00 0.00 H ATOM 4982 HB1 ALA B 54 -8.583 -2.401 33.215 1.00 0.00 H ATOM 4983 HB2 ALA B 54 -10.049 -3.395 33.392 1.00 0.00 H ATOM 4984 HB3 ALA B 54 -9.964 -2.152 32.120 1.00 0.00 H ATOM 4985 H ALA B 54 -9.393 -2.643 35.631 1.00 0.00 H ATOM 4986 N LYS B 55 -12.564 -2.074 34.595 1.00 37.35 N ATOM 4987 CA LYS B 55 -14.015 -1.875 34.568 1.00 35.76 C ATOM 4988 C LYS B 55 -14.440 -0.579 35.217 1.00 36.90 C ATOM 4989 O LYS B 55 -15.411 0.023 34.788 1.00 39.94 O ATOM 4990 CB LYS B 55 -14.775 -3.037 35.187 1.00 35.24 C ATOM 4991 CG LYS B 55 -15.148 -4.089 34.192 1.00 34.22 C ATOM 4992 CD LYS B 55 -15.889 -5.210 34.879 1.00 48.81 C ATOM 4993 CE LYS B 55 -17.406 -5.176 34.603 1.00 49.54 C ATOM 4994 NZ LYS B 55 -17.715 -5.789 33.273 1.00 50.27 N ATOM 4995 HA LYS B 55 -14.274 -1.823 33.510 1.00 0.00 H ATOM 4996 HB2 LYS B 55 -14.149 -3.492 35.955 1.00 0.00 H ATOM 4997 HB3 LYS B 55 -15.687 -2.652 35.644 1.00 0.00 H ATOM 4998 HG2 LYS B 55 -15.787 -3.651 33.425 1.00 0.00 H ATOM 4999 HG3 LYS B 55 -14.244 -4.484 33.728 1.00 0.00 H ATOM 5000 HD2 LYS B 55 -15.491 -6.161 34.525 1.00 0.00 H ATOM 5001 HD3 LYS B 55 -15.728 -5.128 35.954 1.00 0.00 H ATOM 5002 HE2 LYS B 55 -17.748 -4.141 34.609 1.00 0.00 H ATOM 5003 HE3 LYS B 55 -17.925 -5.733 35.383 1.00 0.00 H ATOM 5004 HZ1 LYS B 55 -17.225 -5.258 32.525 1.00 0.00 H ATOM 5005 HZ2 LYS B 55 -17.393 -6.778 33.265 1.00 0.00 H ATOM 5006 HZ3 LYS B 55 -18.741 -5.756 33.107 1.00 0.00 H ATOM 5007 H LYS B 55 -12.153 -2.849 35.154 1.00 0.00 H ATOM 5008 N ARG B 56 -13.724 -0.137 36.242 1.00 36.29 N ATOM 5009 CA ARG B 56 -14.084 1.111 36.897 1.00 39.24 C ATOM 5010 C ARG B 56 -14.280 2.282 35.930 1.00 39.02 C ATOM 5011 O ARG B 56 -15.181 3.078 36.110 1.00 40.59 O ATOM 5012 CB ARG B 56 -13.093 1.463 37.998 1.00 40.23 C ATOM 5013 CG ARG B 56 -13.446 0.727 39.265 1.00 45.69 C ATOM 5014 CD ARG B 56 -12.777 1.298 40.506 1.00 55.88 C ATOM 5015 NE ARG B 56 -11.512 0.611 40.759 1.00 64.40 N ATOM 5016 CZ ARG B 56 -11.392 -0.577 41.357 1.00 66.98 C ATOM 5017 NH1 ARG B 56 -12.464 -1.237 41.796 1.00 69.01 N ATOM 5018 NH2 ARG B 56 -10.189 -1.111 41.508 1.00 65.97 N ATOM 5019 HA ARG B 56 -15.059 0.936 37.351 1.00 0.00 H ATOM 5020 HB2 ARG B 56 -12.088 1.180 37.684 1.00 0.00 H ATOM 5021 HB3 ARG B 56 -13.125 2.537 38.183 1.00 0.00 H ATOM 5022 HG2 ARG B 56 -14.526 0.775 39.402 1.00 0.00 H ATOM 5023 HG3 ARG B 56 -13.141 -0.314 39.156 1.00 0.00 H ATOM 5024 HD2 ARG B 56 -13.436 1.166 41.364 1.00 0.00 H ATOM 5025 HD3 ARG B 56 -12.586 2.361 40.356 1.00 0.00 H ATOM 5026 HE ARG B 56 -10.639 1.083 40.450 1.00 0.00 H ATOM 5027 HH12 ARG B 56 -12.352 -2.161 42.259 1.00 0.00 H ATOM 5028 HH11 ARG B 56 -13.412 -0.828 41.675 1.00 0.00 H ATOM 5029 HH22 ARG B 56 -10.085 -2.036 41.972 1.00 0.00 H ATOM 5030 HH21 ARG B 56 -9.349 -0.605 41.162 1.00 0.00 H ATOM 5031 H ARG B 56 -12.905 -0.683 36.578 1.00 0.00 H ATOM 5032 N VAL B 57 -13.453 2.375 34.901 1.00 36.68 N ATOM 5033 CA VAL B 57 -13.487 3.508 33.973 1.00 36.55 C ATOM 5034 C VAL B 57 -14.843 3.663 33.245 1.00 32.44 C ATOM 5035 O VAL B 57 -15.292 2.739 32.560 1.00 27.97 O ATOM 5036 CB VAL B 57 -12.338 3.406 32.964 1.00 36.79 C ATOM 5037 CG1 VAL B 57 -12.361 4.620 32.009 1.00 38.26 C ATOM 5038 CG2 VAL B 57 -11.014 3.282 33.712 1.00 32.89 C ATOM 5039 HA VAL B 57 -13.361 4.408 34.576 1.00 0.00 H ATOM 5040 HB VAL B 57 -12.457 2.513 32.350 1.00 0.00 H ATOM 5041 HG11 VAL B 57 -13.309 4.640 31.472 1.00 0.00 H ATOM 5042 HG12 VAL B 57 -12.250 5.537 32.587 1.00 0.00 H ATOM 5043 HG13 VAL B 57 -11.540 4.536 31.297 1.00 0.00 H ATOM 5044 HG21 VAL B 57 -10.870 4.161 34.341 1.00 0.00 H ATOM 5045 HG22 VAL B 57 -11.032 2.387 34.335 1.00 0.00 H ATOM 5046 HG23 VAL B 57 -10.198 3.210 32.993 1.00 0.00 H ATOM 5047 H VAL B 57 -12.756 1.619 34.746 1.00 0.00 H ATOM 5048 N PRO B 58 -15.505 4.830 33.417 1.00 33.16 N ATOM 5049 CA PRO B 58 -16.740 5.171 32.692 1.00 31.40 C ATOM 5050 C PRO B 58 -16.608 4.961 31.188 1.00 32.83 C ATOM 5051 O PRO B 58 -15.789 5.622 30.530 1.00 25.98 O ATOM 5052 CB PRO B 58 -16.929 6.657 33.016 1.00 31.89 C ATOM 5053 CG PRO B 58 -16.391 6.753 34.421 1.00 32.86 C ATOM 5054 CD PRO B 58 -15.138 5.896 34.376 1.00 34.87 C ATOM 5055 HA PRO B 58 -17.580 4.543 32.988 1.00 0.00 H ATOM 5056 HD3 PRO B 58 -14.282 6.469 34.018 1.00 0.00 H ATOM 5057 HD2 PRO B 58 -14.911 5.480 35.358 1.00 0.00 H ATOM 5058 HG3 PRO B 58 -17.108 6.359 35.142 1.00 0.00 H ATOM 5059 HG2 PRO B 58 -16.150 7.785 34.677 1.00 0.00 H ATOM 5060 HB2 PRO B 58 -16.360 7.286 32.332 1.00 0.00 H ATOM 5061 HB3 PRO B 58 -17.981 6.939 32.976 1.00 0.00 H ATOM 5062 N GLY B 59 -17.372 4.010 30.655 1.00 28.65 N ATOM 5063 CA GLY B 59 -17.356 3.799 29.219 1.00 30.23 C ATOM 5064 C GLY B 59 -16.502 2.644 28.769 1.00 31.30 C ATOM 5065 O GLY B 59 -16.463 2.342 27.601 1.00 30.40 O ATOM 5066 HA3 GLY B 59 -16.980 4.706 28.745 1.00 0.00 H ATOM 5067 HA2 GLY B 59 -18.379 3.616 28.890 1.00 0.00 H ATOM 5068 H GLY B 59 -17.976 3.422 31.264 1.00 0.00 H ATOM 5069 N SER B 60 -15.831 1.982 29.703 1.00 32.69 N ATOM 5070 CA SER B 60 -14.868 0.931 29.365 1.00 28.37 C ATOM 5071 C SER B 60 -15.454 -0.251 28.602 1.00 29.81 C ATOM 5072 O SER B 60 -16.605 -0.645 28.823 1.00 33.69 O ATOM 5073 CB SER B 60 -14.248 0.412 30.646 1.00 26.78 C ATOM 5074 OG SER B 60 -15.280 -0.152 31.442 1.00 32.93 O ATOM 5075 HA SER B 60 -14.138 1.393 28.701 1.00 0.00 H ATOM 5076 HB2 SER B 60 -13.772 1.232 31.185 1.00 0.00 H ATOM 5077 HB3 SER B 60 -13.503 -0.349 30.414 1.00 0.00 H ATOM 5078 HG SER B 60 -15.709 -0.894 30.946 1.00 0.00 H ATOM 5079 H SER B 60 -15.993 2.216 30.703 1.00 0.00 H ATOM 5080 N VAL B 61 -14.665 -0.791 27.713 1.00 27.45 N ATOM 5081 CA VAL B 61 -14.773 -2.142 27.284 1.00 26.31 C ATOM 5082 C VAL B 61 -13.429 -2.773 27.611 1.00 34.44 C ATOM 5083 O VAL B 61 -12.387 -2.235 27.297 1.00 27.79 O ATOM 5084 CB VAL B 61 -15.138 -2.286 25.817 1.00 30.75 C ATOM 5085 CG1 VAL B 61 -14.121 -1.659 24.901 1.00 28.37 C ATOM 5086 CG2 VAL B 61 -15.355 -3.705 25.481 1.00 28.98 C ATOM 5087 HA VAL B 61 -15.594 -2.644 27.796 1.00 0.00 H ATOM 5088 HB VAL B 61 -16.068 -1.740 25.660 1.00 0.00 H ATOM 5089 HG11 VAL B 61 -14.041 -0.595 25.123 1.00 0.00 H ATOM 5090 HG12 VAL B 61 -13.153 -2.137 25.053 1.00 0.00 H ATOM 5091 HG13 VAL B 61 -14.435 -1.793 23.866 1.00 0.00 H ATOM 5092 HG21 VAL B 61 -14.442 -4.267 25.678 1.00 0.00 H ATOM 5093 HG22 VAL B 61 -16.167 -4.101 26.091 1.00 0.00 H ATOM 5094 HG23 VAL B 61 -15.616 -3.792 24.426 1.00 0.00 H ATOM 5095 H VAL B 61 -13.917 -0.201 27.296 1.00 0.00 H ATOM 5096 N VAL B 62 -13.481 -3.906 28.274 1.00 26.05 N ATOM 5097 CA VAL B 62 -12.283 -4.556 28.709 1.00 28.41 C ATOM 5098 C VAL B 62 -11.801 -5.634 27.745 1.00 30.48 C ATOM 5099 O VAL B 62 -12.534 -6.498 27.332 1.00 28.39 O ATOM 5100 CB VAL B 62 -12.355 -5.065 30.182 1.00 26.69 C ATOM 5101 CG1 VAL B 62 -11.033 -5.550 30.617 1.00 31.40 C ATOM 5102 CG2 VAL B 62 -12.784 -4.020 31.101 1.00 16.37 C ATOM 5103 HA VAL B 62 -11.520 -3.777 28.699 1.00 0.00 H ATOM 5104 HB VAL B 62 -13.087 -5.872 30.202 1.00 0.00 H ATOM 5105 HG11 VAL B 62 -10.717 -6.369 29.971 1.00 0.00 H ATOM 5106 HG12 VAL B 62 -10.310 -4.736 30.555 1.00 0.00 H ATOM 5107 HG13 VAL B 62 -11.097 -5.902 31.647 1.00 0.00 H ATOM 5108 HG21 VAL B 62 -12.078 -3.191 31.061 1.00 0.00 H ATOM 5109 HG22 VAL B 62 -13.775 -3.669 30.813 1.00 0.00 H ATOM 5110 HG23 VAL B 62 -12.819 -4.421 32.114 1.00 0.00 H ATOM 5111 H VAL B 62 -14.404 -4.336 28.485 1.00 0.00 H ATOM 5112 N VAL B 63 -10.545 -5.482 27.374 1.00 26.62 N ATOM 5113 CA VAL B 63 -9.792 -6.424 26.620 1.00 23.62 C ATOM 5114 C VAL B 63 -8.720 -7.005 27.470 1.00 24.96 C ATOM 5115 O VAL B 63 -7.883 -6.338 27.944 1.00 24.83 O ATOM 5116 CB VAL B 63 -9.081 -5.801 25.435 1.00 22.51 C ATOM 5117 CG1 VAL B 63 -8.500 -6.820 24.586 1.00 16.09 C ATOM 5118 CG2 VAL B 63 -9.976 -5.015 24.660 1.00 27.65 C ATOM 5119 HA VAL B 63 -10.511 -7.166 26.272 1.00 0.00 H ATOM 5120 HB VAL B 63 -8.290 -5.164 25.832 1.00 0.00 H ATOM 5121 HG11 VAL B 63 -7.780 -7.403 25.161 1.00 0.00 H ATOM 5122 HG12 VAL B 63 -9.288 -7.476 24.217 1.00 0.00 H ATOM 5123 HG13 VAL B 63 -7.996 -6.346 23.744 1.00 0.00 H ATOM 5124 HG21 VAL B 63 -10.785 -5.645 24.291 1.00 0.00 H ATOM 5125 HG22 VAL B 63 -10.388 -4.218 25.280 1.00 0.00 H ATOM 5126 HG23 VAL B 63 -9.439 -4.580 23.817 1.00 0.00 H ATOM 5127 H VAL B 63 -10.066 -4.603 27.655 1.00 0.00 H ATOM 5128 N VAL B 64 -8.787 -8.307 27.592 1.00 26.38 N ATOM 5129 CA VAL B 64 -7.797 -9.094 28.315 1.00 27.62 C ATOM 5130 C VAL B 64 -7.068 -9.953 27.320 1.00 27.84 C ATOM 5131 O VAL B 64 -7.666 -10.813 26.694 1.00 32.95 O ATOM 5132 CB VAL B 64 -8.481 -10.029 29.371 1.00 29.85 C ATOM 5133 CG1 VAL B 64 -7.463 -10.982 29.984 1.00 26.97 C ATOM 5134 CG2 VAL B 64 -9.133 -9.178 30.495 1.00 26.61 C ATOM 5135 HA VAL B 64 -7.118 -8.419 28.836 1.00 0.00 H ATOM 5136 HB VAL B 64 -9.250 -10.611 28.863 1.00 0.00 H ATOM 5137 HG11 VAL B 64 -7.024 -11.598 29.199 1.00 0.00 H ATOM 5138 HG12 VAL B 64 -6.679 -10.407 30.477 1.00 0.00 H ATOM 5139 HG13 VAL B 64 -7.959 -11.621 30.714 1.00 0.00 H ATOM 5140 HG21 VAL B 64 -8.366 -8.581 30.989 1.00 0.00 H ATOM 5141 HG22 VAL B 64 -9.884 -8.519 30.060 1.00 0.00 H ATOM 5142 HG23 VAL B 64 -9.605 -9.839 31.222 1.00 0.00 H ATOM 5143 H VAL B 64 -9.587 -8.804 27.151 1.00 0.00 H ATOM 5144 N SER B 65 -5.787 -9.713 27.111 1.00 27.57 N ATOM 5145 CA SER B 65 -5.055 -10.587 26.222 1.00 21.12 C ATOM 5146 C SER B 65 -4.578 -11.747 27.087 1.00 23.90 C ATOM 5147 O SER B 65 -4.330 -11.565 28.281 1.00 20.91 O ATOM 5148 CB SER B 65 -3.895 -9.863 25.584 1.00 20.22 C ATOM 5149 OG SER B 65 -2.952 -9.407 26.559 1.00 22.83 O ATOM 5150 HA SER B 65 -5.678 -10.937 25.399 1.00 0.00 H ATOM 5151 HB2 SER B 65 -4.276 -9.004 25.032 1.00 0.00 H ATOM 5152 HB3 SER B 65 -3.391 -10.541 24.896 1.00 0.00 H ATOM 5153 HG SER B 65 -2.597 -10.183 27.061 1.00 0.00 H ATOM 5154 H SER B 65 -5.314 -8.912 27.576 1.00 0.00 H ATOM 5155 N ILE B 66 -4.500 -12.940 26.516 1.00 29.16 N ATOM 5156 CA ILE B 66 -3.782 -14.020 27.190 1.00 35.73 C ATOM 5157 C ILE B 66 -2.872 -14.670 26.197 1.00 35.16 C ATOM 5158 O ILE B 66 -3.320 -15.168 25.166 1.00 36.72 O ATOM 5159 CB ILE B 66 -4.668 -15.063 27.999 1.00 37.92 C ATOM 5160 CG1 ILE B 66 -4.291 -16.497 27.638 1.00 37.11 C ATOM 5161 CG2 ILE B 66 -6.175 -14.834 27.841 1.00 37.99 C ATOM 5162 CD1 ILE B 66 -4.789 -17.562 28.627 1.00 44.48 C ATOM 5163 HA ILE B 66 -3.207 -13.561 27.994 1.00 0.00 H ATOM 5164 HB ILE B 66 -4.446 -14.896 29.053 1.00 0.00 H ATOM 5165 HG12 ILE B 66 -4.711 -16.722 26.657 1.00 0.00 H ATOM 5166 HG13 ILE B 66 -3.204 -16.560 27.590 1.00 0.00 H ATOM 5167 HD11 ILE B 66 -4.369 -17.365 29.613 1.00 0.00 H ATOM 5168 HD12 ILE B 66 -5.877 -17.526 28.680 1.00 0.00 H ATOM 5169 HD13 ILE B 66 -4.473 -18.548 28.287 1.00 0.00 H ATOM 5170 HG21 ILE B 66 -6.430 -13.838 28.202 1.00 0.00 H ATOM 5171 HG22 ILE B 66 -6.446 -14.920 26.789 1.00 0.00 H ATOM 5172 HG23 ILE B 66 -6.717 -15.582 28.420 1.00 0.00 H ATOM 5173 H ILE B 66 -4.948 -13.107 25.592 1.00 0.00 H ATOM 5174 N PHE B 67 -1.584 -14.619 26.507 1.00 31.31 N ATOM 5175 CA PHE B 67 -0.560 -15.066 25.592 1.00 34.26 C ATOM 5176 C PHE B 67 0.765 -15.412 26.332 1.00 40.16 C ATOM 5177 O PHE B 67 1.316 -14.604 27.107 1.00 41.11 O ATOM 5178 CB PHE B 67 -0.373 -14.035 24.456 1.00 30.95 C ATOM 5179 CG PHE B 67 0.766 -14.356 23.531 1.00 30.55 C ATOM 5180 CD1 PHE B 67 0.637 -15.364 22.565 1.00 30.47 C ATOM 5181 CD2 PHE B 67 1.994 -13.675 23.654 1.00 26.66 C ATOM 5182 CE1 PHE B 67 1.719 -15.676 21.702 1.00 36.03 C ATOM 5183 CE2 PHE B 67 3.090 -13.971 22.819 1.00 33.50 C ATOM 5184 CZ PHE B 67 2.960 -14.962 21.829 1.00 35.65 C ATOM 5185 HA PHE B 67 -0.885 -15.998 25.130 1.00 0.00 H ATOM 5186 HB2 PHE B 67 -1.292 -13.997 23.871 1.00 0.00 H ATOM 5187 HB3 PHE B 67 -0.188 -13.059 24.904 1.00 0.00 H ATOM 5188 HD2 PHE B 67 2.098 -12.900 24.414 1.00 0.00 H ATOM 5189 HE2 PHE B 67 4.032 -13.436 22.939 1.00 0.00 H ATOM 5190 HZ PHE B 67 3.794 -15.187 21.164 1.00 0.00 H ATOM 5191 HE1 PHE B 67 1.610 -16.454 20.946 1.00 0.00 H ATOM 5192 HD1 PHE B 67 -0.301 -15.912 22.476 1.00 0.00 H ATOM 5193 H PHE B 67 -1.303 -14.246 27.436 1.00 0.00 H ATOM 5194 N VAL B 68 1.260 -16.628 26.107 1.00 47.50 N ATOM 5195 CA VAL B 68 2.525 -17.044 26.698 1.00 54.26 C ATOM 5196 C VAL B 68 3.664 -16.762 25.750 1.00 58.61 C ATOM 5197 O VAL B 68 3.744 -17.317 24.640 1.00 60.21 O ATOM 5198 CB VAL B 68 2.532 -18.528 27.111 1.00 58.12 C ATOM 5199 CG1 VAL B 68 3.489 -18.732 28.304 1.00 53.57 C ATOM 5200 CG2 VAL B 68 1.101 -18.995 27.447 1.00 59.18 C ATOM 5201 HA VAL B 68 2.654 -16.460 27.609 1.00 0.00 H ATOM 5202 HB VAL B 68 2.891 -19.135 26.280 1.00 0.00 H ATOM 5203 HG11 VAL B 68 4.496 -18.432 28.015 1.00 0.00 H ATOM 5204 HG12 VAL B 68 3.154 -18.124 29.145 1.00 0.00 H ATOM 5205 HG13 VAL B 68 3.490 -19.783 28.592 1.00 0.00 H ATOM 5206 HG21 VAL B 68 0.709 -18.397 28.270 1.00 0.00 H ATOM 5207 HG22 VAL B 68 0.465 -18.871 26.571 1.00 0.00 H ATOM 5208 HG23 VAL B 68 1.122 -20.045 27.737 1.00 0.00 H ATOM 5209 H VAL B 68 0.736 -17.290 25.500 1.00 0.00 H ATOM 5210 N ASN B 69 4.550 -15.890 26.216 1.00 66.81 N ATOM 5211 CA ASN B 69 5.625 -15.333 25.402 1.00 72.97 C ATOM 5212 C ASN B 69 6.861 -16.231 25.379 1.00 77.50 C ATOM 5213 O ASN B 69 7.509 -16.397 26.421 1.00 81.73 O ATOM 5214 CB ASN B 69 5.989 -13.942 25.936 1.00 74.43 C ATOM 5215 CG ASN B 69 6.856 -13.158 24.980 1.00 74.04 C ATOM 5216 OD1 ASN B 69 6.418 -12.806 23.884 1.00 75.30 O ATOM 5217 ND2 ASN B 69 8.096 -12.872 25.393 1.00 73.85 N ATOM 5218 HA ASN B 69 5.268 -15.261 24.375 1.00 0.00 H ATOM 5219 HB2 ASN B 69 5.069 -13.384 26.111 1.00 0.00 H ATOM 5220 HB3 ASN B 69 6.526 -14.059 26.877 1.00 0.00 H ATOM 5221 HD22 ASN B 69 8.419 -13.192 26.328 1.00 0.00 H ATOM 5222 HD21 ASN B 69 8.737 -12.330 24.779 1.00 0.00 H ATOM 5223 H ASN B 69 4.474 -15.590 27.209 1.00 0.00 H ATOM 5224 N PRO B 70 7.182 -16.839 24.208 1.00 79.99 N ATOM 5225 CA PRO B 70 8.408 -17.653 24.056 1.00 79.50 C ATOM 5226 C PRO B 70 9.647 -16.848 23.654 1.00 79.87 C ATOM 5227 O PRO B 70 10.074 -15.951 24.388 1.00 78.55 O ATOM 5228 CB PRO B 70 8.040 -18.638 22.936 1.00 78.28 C ATOM 5229 CG PRO B 70 6.621 -18.249 22.484 1.00 79.32 C ATOM 5230 CD PRO B 70 6.387 -16.859 22.970 1.00 78.33 C ATOM 5231 HA PRO B 70 8.684 -18.116 25.003 1.00 0.00 H ATOM 5232 HD3 PRO B 70 6.748 -16.121 22.254 1.00 0.00 H ATOM 5233 HD2 PRO B 70 5.331 -16.681 23.172 1.00 0.00 H ATOM 5234 HG3 PRO B 70 5.888 -18.928 22.918 1.00 0.00 H ATOM 5235 HG2 PRO B 70 6.549 -18.285 21.397 1.00 0.00 H ATOM 5236 HB2 PRO B 70 8.741 -18.548 22.106 1.00 0.00 H ATOM 5237 HB3 PRO B 70 8.052 -19.661 23.311 1.00 0.00 H TER 5238 PRO B 70 ATOM 5239 N THR B 85 -5.375 -23.922 32.015 1.00 83.99 N ATOM 5240 CA THR B 85 -6.525 -23.124 32.471 1.00 82.70 C ATOM 5241 C THR B 85 -7.424 -22.501 31.361 1.00 81.73 C ATOM 5242 O THR B 85 -8.314 -21.721 31.693 1.00 79.02 O ATOM 5243 CB THR B 85 -6.077 -21.989 33.461 1.00 79.01 C ATOM 5244 OG1 THR B 85 -4.860 -21.411 32.988 1.00 74.51 O ATOM 5245 CG2 THR B 85 -5.870 -22.516 34.891 1.00 76.18 C ATOM 5246 HA THR B 85 -7.149 -23.864 32.971 1.00 0.00 H ATOM 5247 HB THR B 85 -6.870 -21.243 33.497 1.00 0.00 H ATOM 5248 HG1 THR B 85 -5.006 -21.029 32.086 1.00 0.00 H ATOM 5249 HG23 THR B 85 -6.799 -22.957 35.252 1.00 0.00 H ATOM 5250 HG21 THR B 85 -5.084 -23.272 34.888 1.00 0.00 H ATOM 5251 HG22 THR B 85 -5.581 -21.691 35.542 1.00 0.00 H ATOM 5252 HN3 THR B 85 -4.746 -23.325 31.441 1.00 0.00 H ATOM 5253 HN2 THR B 85 -5.714 -24.721 31.442 1.00 0.00 H ATOM 5254 HN1 THR B 85 -4.855 -24.282 32.841 1.00 0.00 H ATOM 5255 N PRO B 86 -7.194 -22.836 30.060 1.00 83.12 N ATOM 5256 CA PRO B 86 -7.923 -22.185 28.944 1.00 83.95 C ATOM 5257 C PRO B 86 -9.408 -21.844 29.180 1.00 84.07 C ATOM 5258 O PRO B 86 -9.788 -20.666 29.088 1.00 83.00 O ATOM 5259 CB PRO B 86 -7.748 -23.176 27.784 1.00 85.82 C ATOM 5260 CG PRO B 86 -6.374 -23.749 28.020 1.00 85.67 C ATOM 5261 CD PRO B 86 -6.210 -23.817 29.544 1.00 84.91 C ATOM 5262 HA PRO B 86 -7.511 -21.191 28.771 1.00 0.00 H ATOM 5263 HD3 PRO B 86 -6.432 -24.818 29.913 1.00 0.00 H ATOM 5264 HD2 PRO B 86 -5.197 -23.540 29.837 1.00 0.00 H ATOM 5265 HG3 PRO B 86 -5.612 -23.103 27.584 1.00 0.00 H ATOM 5266 HG2 PRO B 86 -6.297 -24.745 27.584 1.00 0.00 H ATOM 5267 HB2 PRO B 86 -8.508 -23.957 27.819 1.00 0.00 H ATOM 5268 HB3 PRO B 86 -7.798 -22.665 26.823 1.00 0.00 H ATOM 5269 N ASP B 87 -10.225 -22.849 29.497 1.00 83.47 N ATOM 5270 CA ASP B 87 -11.665 -22.644 29.775 1.00 80.61 C ATOM 5271 C ASP B 87 -11.963 -22.038 31.141 1.00 74.15 C ATOM 5272 O ASP B 87 -13.008 -21.392 31.320 1.00 69.91 O ATOM 5273 CB ASP B 87 -12.429 -23.959 29.647 1.00 84.80 C ATOM 5274 CG ASP B 87 -12.174 -24.638 28.328 1.00 88.56 C ATOM 5275 OD1 ASP B 87 -11.038 -25.147 28.134 1.00 89.16 O ATOM 5276 OD2 ASP B 87 -13.105 -24.642 27.489 1.00 89.95 O ATOM 5277 HA ASP B 87 -11.996 -21.923 29.027 1.00 0.00 H ATOM 5278 HB2 ASP B 87 -12.118 -24.626 30.451 1.00 0.00 H ATOM 5279 HB3 ASP B 87 -13.496 -23.756 29.737 1.00 0.00 H ATOM 5280 H ASP B 87 -9.837 -23.812 29.551 1.00 0.00 H ATOM 5281 N ASP B 88 -11.054 -22.273 32.088 1.00 67.14 N ATOM 5282 CA ASP B 88 -11.146 -21.729 33.442 1.00 64.07 C ATOM 5283 C ASP B 88 -10.904 -20.205 33.433 1.00 58.99 C ATOM 5284 O ASP B 88 -11.674 -19.417 34.031 1.00 54.82 O ATOM 5285 CB ASP B 88 -10.150 -22.454 34.358 1.00 67.01 C ATOM 5286 CG ASP B 88 -10.394 -22.186 35.855 1.00 73.86 C ATOM 5287 OD1 ASP B 88 -11.463 -21.642 36.253 1.00 74.43 O ATOM 5288 OD2 ASP B 88 -9.492 -22.540 36.649 1.00 78.95 O ATOM 5289 HA ASP B 88 -12.151 -21.895 33.830 1.00 0.00 H ATOM 5290 HB2 ASP B 88 -10.233 -23.526 34.180 1.00 0.00 H ATOM 5291 HB3 ASP B 88 -9.143 -22.122 34.106 1.00 0.00 H ATOM 5292 H ASP B 88 -10.239 -22.874 31.852 1.00 0.00 H ATOM 5293 N ASP B 89 -9.848 -19.797 32.735 1.00 50.10 N ATOM 5294 CA ASP B 89 -9.554 -18.380 32.546 1.00 47.04 C ATOM 5295 C ASP B 89 -10.715 -17.579 31.952 1.00 43.94 C ATOM 5296 O ASP B 89 -11.097 -16.546 32.531 1.00 38.72 O ATOM 5297 CB ASP B 89 -8.289 -18.205 31.714 1.00 45.52 C ATOM 5298 CG ASP B 89 -7.033 -18.616 32.462 1.00 43.92 C ATOM 5299 OD1 ASP B 89 -7.039 -18.699 33.735 1.00 40.11 O ATOM 5300 OD2 ASP B 89 -6.036 -18.851 31.747 1.00 42.61 O ATOM 5301 HA ASP B 89 -9.393 -17.968 33.542 1.00 0.00 H ATOM 5302 HB2 ASP B 89 -8.375 -18.816 30.815 1.00 0.00 H ATOM 5303 HB3 ASP B 89 -8.199 -17.156 31.432 1.00 0.00 H ATOM 5304 H ASP B 89 -9.215 -20.506 32.313 1.00 0.00 H ATOM 5305 N LEU B 90 -11.279 -18.072 30.834 1.00 41.52 N ATOM 5306 CA LEU B 90 -12.461 -17.439 30.173 1.00 43.63 C ATOM 5307 C LEU B 90 -13.696 -17.383 31.075 1.00 45.45 C ATOM 5308 O LEU B 90 -14.431 -16.377 31.088 1.00 42.77 O ATOM 5309 CB LEU B 90 -12.826 -18.121 28.840 1.00 40.59 C ATOM 5310 CG LEU B 90 -11.784 -18.295 27.725 1.00 46.66 C ATOM 5311 CD1 LEU B 90 -12.325 -19.137 26.569 1.00 49.51 C ATOM 5312 CD2 LEU B 90 -11.222 -16.990 27.160 1.00 44.16 C ATOM 5313 HA LEU B 90 -12.149 -16.415 29.967 1.00 0.00 H ATOM 5314 HB2 LEU B 90 -13.181 -19.121 29.091 1.00 0.00 H ATOM 5315 HB3 LEU B 90 -13.645 -17.543 28.411 1.00 0.00 H ATOM 5316 HG LEU B 90 -10.961 -18.810 28.220 1.00 0.00 H ATOM 5317 HD21 LEU B 90 -12.035 -16.397 26.740 1.00 0.00 H ATOM 5318 HD22 LEU B 90 -10.737 -16.429 27.959 1.00 0.00 H ATOM 5319 HD23 LEU B 90 -10.495 -17.217 26.380 1.00 0.00 H ATOM 5320 HD11 LEU B 90 -12.600 -20.125 26.938 1.00 0.00 H ATOM 5321 HD12 LEU B 90 -13.203 -18.649 26.145 1.00 0.00 H ATOM 5322 HD13 LEU B 90 -11.557 -19.235 25.802 1.00 0.00 H ATOM 5323 H LEU B 90 -10.875 -18.932 30.411 1.00 0.00 H ATOM 5324 N ALA B 91 -13.915 -18.474 31.824 1.00 46.16 N ATOM 5325 CA ALA B 91 -14.979 -18.551 32.812 1.00 44.59 C ATOM 5326 C ALA B 91 -14.875 -17.453 33.898 1.00 48.16 C ATOM 5327 O ALA B 91 -15.915 -16.916 34.350 1.00 49.95 O ATOM 5328 CB ALA B 91 -15.021 -19.936 33.435 1.00 46.72 C ATOM 5329 HA ALA B 91 -15.917 -18.370 32.287 1.00 0.00 H ATOM 5330 HB1 ALA B 91 -15.203 -20.678 32.657 1.00 0.00 H ATOM 5331 HB2 ALA B 91 -14.068 -20.143 33.921 1.00 0.00 H ATOM 5332 HB3 ALA B 91 -15.823 -19.977 34.172 1.00 0.00 H ATOM 5333 H ALA B 91 -13.297 -19.300 31.692 1.00 0.00 H ATOM 5334 N GLN B 92 -13.643 -17.129 34.312 1.00 45.02 N ATOM 5335 CA GLN B 92 -13.385 -16.000 35.229 1.00 41.99 C ATOM 5336 C GLN B 92 -13.633 -14.646 34.557 1.00 39.33 C ATOM 5337 O GLN B 92 -14.075 -13.688 35.181 1.00 40.89 O ATOM 5338 CB GLN B 92 -11.949 -16.046 35.743 1.00 42.21 C ATOM 5339 CG GLN B 92 -11.611 -17.356 36.406 1.00 44.60 C ATOM 5340 CD GLN B 92 -10.305 -17.307 37.189 1.00 49.32 C ATOM 5341 OE1 GLN B 92 -10.181 -16.592 38.202 1.00 52.09 O ATOM 5342 NE2 GLN B 92 -9.330 -18.099 36.743 1.00 46.13 N ATOM 5343 HA GLN B 92 -14.081 -16.103 36.061 1.00 0.00 H ATOM 5344 HB2 GLN B 92 -11.272 -15.896 34.902 1.00 0.00 H ATOM 5345 HB3 GLN B 92 -11.811 -15.243 36.467 1.00 0.00 H ATOM 5346 HG2 GLN B 92 -12.418 -17.617 37.091 1.00 0.00 H ATOM 5347 HG3 GLN B 92 -11.527 -18.123 35.637 1.00 0.00 H ATOM 5348 HE22 GLN B 92 -9.479 -18.679 35.892 1.00 0.00 H ATOM 5349 HE21 GLN B 92 -8.420 -18.137 37.246 1.00 0.00 H ATOM 5350 H GLN B 92 -12.837 -17.694 33.975 1.00 0.00 H ATOM 5351 N LEU B 93 -13.341 -14.571 33.267 1.00 38.25 N ATOM 5352 CA LEU B 93 -13.499 -13.328 32.539 1.00 32.68 C ATOM 5353 C LEU B 93 -14.979 -13.056 32.324 1.00 32.99 C ATOM 5354 O LEU B 93 -15.450 -11.977 32.643 1.00 34.52 O ATOM 5355 CB LEU B 93 -12.712 -13.374 31.231 1.00 27.82 C ATOM 5356 CG LEU B 93 -11.186 -13.512 31.341 1.00 32.43 C ATOM 5357 CD1 LEU B 93 -10.553 -13.459 29.945 1.00 33.81 C ATOM 5358 CD2 LEU B 93 -10.541 -12.478 32.286 1.00 19.63 C ATOM 5359 HA LEU B 93 -13.091 -12.500 33.118 1.00 0.00 H ATOM 5360 HB2 LEU B 93 -13.079 -14.224 30.656 1.00 0.00 H ATOM 5361 HB3 LEU B 93 -12.921 -12.452 30.688 1.00 0.00 H ATOM 5362 HG LEU B 93 -10.987 -14.484 31.792 1.00 0.00 H ATOM 5363 HD21 LEU B 93 -10.753 -11.473 31.922 1.00 0.00 H ATOM 5364 HD22 LEU B 93 -10.953 -12.597 33.288 1.00 0.00 H ATOM 5365 HD23 LEU B 93 -9.463 -12.636 32.314 1.00 0.00 H ATOM 5366 HD11 LEU B 93 -10.945 -14.276 29.339 1.00 0.00 H ATOM 5367 HD12 LEU B 93 -10.795 -12.506 29.474 1.00 0.00 H ATOM 5368 HD13 LEU B 93 -9.471 -13.558 30.034 1.00 0.00 H ATOM 5369 H LEU B 93 -12.994 -15.416 32.770 1.00 0.00 H ATOM 5370 N ARG B 94 -15.701 -14.061 31.818 1.00 41.33 N ATOM 5371 CA ARG B 94 -17.166 -14.052 31.754 1.00 47.00 C ATOM 5372 C ARG B 94 -17.719 -13.676 33.147 1.00 50.31 C ATOM 5373 O ARG B 94 -18.500 -12.714 33.278 1.00 52.70 O ATOM 5374 CB ARG B 94 -17.703 -15.409 31.241 1.00 47.38 C ATOM 5375 CG ARG B 94 -18.887 -15.239 30.272 1.00 55.54 C ATOM 5376 CD ARG B 94 -19.431 -16.537 29.639 1.00 54.80 C ATOM 5377 NE ARG B 94 -18.756 -16.884 28.384 1.00 53.48 N ATOM 5378 CZ ARG B 94 -17.742 -17.742 28.299 1.00 50.83 C ATOM 5379 NH1 ARG B 94 -17.298 -18.351 29.400 1.00 55.69 N ATOM 5380 NH2 ARG B 94 -17.166 -17.990 27.126 1.00 41.53 N ATOM 5381 HA ARG B 94 -17.509 -13.305 31.038 1.00 0.00 H ATOM 5382 HB2 ARG B 94 -16.899 -15.932 30.724 1.00 0.00 H ATOM 5383 HB3 ARG B 94 -18.031 -16.002 32.095 1.00 0.00 H ATOM 5384 HG2 ARG B 94 -19.702 -14.767 30.820 1.00 0.00 H ATOM 5385 HG3 ARG B 94 -18.566 -14.582 29.464 1.00 0.00 H ATOM 5386 HD2 ARG B 94 -20.495 -16.408 29.438 1.00 0.00 H ATOM 5387 HD3 ARG B 94 -19.293 -17.354 30.347 1.00 0.00 H ATOM 5388 HE ARG B 94 -19.090 -16.433 27.508 1.00 0.00 H ATOM 5389 HH12 ARG B 94 -16.506 -19.022 29.339 1.00 0.00 H ATOM 5390 HH11 ARG B 94 -17.744 -18.154 30.319 1.00 0.00 H ATOM 5391 HH22 ARG B 94 -16.374 -18.662 27.067 1.00 0.00 H ATOM 5392 HH21 ARG B 94 -17.507 -17.512 26.268 1.00 0.00 H ATOM 5393 H ARG B 94 -15.197 -14.893 31.450 1.00 0.00 H ATOM 5394 N ALA B 95 -17.259 -14.385 34.186 1.00 48.12 N ATOM 5395 CA ALA B 95 -17.589 -14.047 35.578 1.00 50.61 C ATOM 5396 C ALA B 95 -17.218 -12.616 36.052 1.00 51.40 C ATOM 5397 O ALA B 95 -17.803 -12.126 37.027 1.00 50.90 O ATOM 5398 CB ALA B 95 -17.036 -15.109 36.550 1.00 50.26 C ATOM 5399 HA ALA B 95 -18.679 -14.051 35.593 1.00 0.00 H ATOM 5400 HB1 ALA B 95 -17.472 -16.079 36.312 1.00 0.00 H ATOM 5401 HB2 ALA B 95 -15.952 -15.162 36.450 1.00 0.00 H ATOM 5402 HB3 ALA B 95 -17.295 -14.834 37.572 1.00 0.00 H ATOM 5403 H ALA B 95 -16.646 -15.205 34.001 1.00 0.00 H ATOM 5404 N GLU B 96 -16.267 -11.944 35.390 1.00 47.78 N ATOM 5405 CA GLU B 96 -15.979 -10.560 35.758 1.00 43.10 C ATOM 5406 C GLU B 96 -16.714 -9.588 34.856 1.00 42.41 C ATOM 5407 O GLU B 96 -16.738 -8.364 35.112 1.00 43.61 O ATOM 5408 CB GLU B 96 -14.485 -10.255 35.825 1.00 40.63 C ATOM 5409 CG GLU B 96 -13.759 -10.955 36.948 1.00 40.06 C ATOM 5410 CD GLU B 96 -14.052 -10.403 38.340 1.00 38.42 C ATOM 5411 OE1 GLU B 96 -14.214 -9.178 38.527 1.00 39.64 O ATOM 5412 OE2 GLU B 96 -14.091 -11.221 39.274 1.00 43.55 O ATOM 5413 HA GLU B 96 -16.354 -10.425 36.773 1.00 0.00 H ATOM 5414 HB2 GLU B 96 -14.031 -10.560 34.882 1.00 0.00 H ATOM 5415 HB3 GLU B 96 -14.361 -9.180 35.955 1.00 0.00 H ATOM 5416 HG2 GLU B 96 -14.044 -12.007 36.933 1.00 0.00 H ATOM 5417 HG3 GLU B 96 -12.688 -10.867 36.767 1.00 0.00 H ATOM 5418 H GLU B 96 -15.739 -12.403 34.621 1.00 0.00 H ATOM 5419 N GLY B 97 -17.348 -10.136 33.831 1.00 37.86 N ATOM 5420 CA GLY B 97 -18.153 -9.327 32.921 1.00 35.80 C ATOM 5421 C GLY B 97 -17.331 -8.681 31.820 1.00 37.25 C ATOM 5422 O GLY B 97 -17.759 -7.689 31.236 1.00 33.31 O ATOM 5423 HA3 GLY B 97 -18.644 -8.541 33.495 1.00 0.00 H ATOM 5424 HA2 GLY B 97 -18.908 -9.966 32.463 1.00 0.00 H ATOM 5425 H GLY B 97 -17.271 -11.161 33.671 1.00 0.00 H ATOM 5426 N VAL B 98 -16.141 -9.246 31.576 1.00 32.92 N ATOM 5427 CA VAL B 98 -15.244 -8.883 30.500 1.00 27.58 C ATOM 5428 C VAL B 98 -15.871 -9.218 29.138 1.00 35.13 C ATOM 5429 O VAL B 98 -16.513 -10.262 28.980 1.00 36.57 O ATOM 5430 CB VAL B 98 -13.899 -9.645 30.672 1.00 27.76 C ATOM 5431 CG1 VAL B 98 -13.039 -9.613 29.402 1.00 27.26 C ATOM 5432 CG2 VAL B 98 -13.134 -9.092 31.853 1.00 25.92 C ATOM 5433 HA VAL B 98 -15.061 -7.809 30.536 1.00 0.00 H ATOM 5434 HB VAL B 98 -14.140 -10.691 30.860 1.00 0.00 H ATOM 5435 HG11 VAL B 98 -13.586 -10.078 28.582 1.00 0.00 H ATOM 5436 HG12 VAL B 98 -12.809 -8.579 29.146 1.00 0.00 H ATOM 5437 HG13 VAL B 98 -12.113 -10.160 29.578 1.00 0.00 H ATOM 5438 HG21 VAL B 98 -12.927 -8.035 31.688 1.00 0.00 H ATOM 5439 HG22 VAL B 98 -13.730 -9.210 32.758 1.00 0.00 H ATOM 5440 HG23 VAL B 98 -12.195 -9.634 31.962 1.00 0.00 H ATOM 5441 H VAL B 98 -15.836 -10.009 32.213 1.00 0.00 H ATOM 5442 N GLU B 99 -15.655 -8.338 28.153 1.00 34.26 N ATOM 5443 CA GLU B 99 -16.323 -8.426 26.868 1.00 30.83 C ATOM 5444 C GLU B 99 -15.421 -8.823 25.726 1.00 28.44 C ATOM 5445 O GLU B 99 -15.908 -9.211 24.658 1.00 29.79 O ATOM 5446 CB GLU B 99 -17.046 -7.125 26.525 1.00 31.18 C ATOM 5447 CG GLU B 99 -18.453 -6.978 27.073 1.00 25.18 C ATOM 5448 CD GLU B 99 -18.877 -5.507 26.999 1.00 39.82 C ATOM 5449 OE1 GLU B 99 -18.227 -4.684 27.681 1.00 38.11 O ATOM 5450 OE2 GLU B 99 -19.823 -5.157 26.234 1.00 44.12 O ATOM 5451 HA GLU B 99 -17.048 -9.231 26.987 1.00 0.00 H ATOM 5452 HB2 GLU B 99 -16.449 -6.300 26.914 1.00 0.00 H ATOM 5453 HB3 GLU B 99 -17.102 -7.051 25.439 1.00 0.00 H ATOM 5454 HG2 GLU B 99 -19.139 -7.585 26.482 1.00 0.00 H ATOM 5455 HG3 GLU B 99 -18.476 -7.312 28.110 1.00 0.00 H ATOM 5456 H GLU B 99 -14.983 -7.561 28.315 1.00 0.00 H ATOM 5457 N ILE B 100 -14.115 -8.719 25.932 1.00 33.34 N ATOM 5458 CA ILE B 100 -13.148 -9.228 24.949 1.00 26.67 C ATOM 5459 C ILE B 100 -11.938 -9.907 25.588 1.00 30.38 C ATOM 5460 O ILE B 100 -11.248 -9.302 26.435 1.00 31.23 O ATOM 5461 CB ILE B 100 -12.639 -8.123 24.012 1.00 21.91 C ATOM 5462 CG1 ILE B 100 -13.808 -7.307 23.440 1.00 25.42 C ATOM 5463 CG2 ILE B 100 -11.863 -8.752 22.885 1.00 22.76 C ATOM 5464 CD1 ILE B 100 -13.424 -6.082 22.603 1.00 19.33 C ATOM 5465 HA ILE B 100 -13.705 -9.971 24.379 1.00 0.00 H ATOM 5466 HB ILE B 100 -11.997 -7.449 24.580 1.00 0.00 H ATOM 5467 HG12 ILE B 100 -14.401 -7.970 22.810 1.00 0.00 H ATOM 5468 HG13 ILE B 100 -14.416 -6.963 24.277 1.00 0.00 H ATOM 5469 HD11 ILE B 100 -12.843 -5.393 23.216 1.00 0.00 H ATOM 5470 HD12 ILE B 100 -12.828 -6.400 21.748 1.00 0.00 H ATOM 5471 HD13 ILE B 100 -14.329 -5.585 22.253 1.00 0.00 H ATOM 5472 HG21 ILE B 100 -11.018 -9.306 23.293 1.00 0.00 H ATOM 5473 HG22 ILE B 100 -12.513 -9.431 22.333 1.00 0.00 H ATOM 5474 HG23 ILE B 100 -11.499 -7.972 22.216 1.00 0.00 H ATOM 5475 H ILE B 100 -13.769 -8.270 26.804 1.00 0.00 H ATOM 5476 N ALA B 101 -11.716 -11.163 25.173 1.00 29.87 N ATOM 5477 CA ALA B 101 -10.460 -11.890 25.331 1.00 27.61 C ATOM 5478 C ALA B 101 -9.735 -12.014 23.997 1.00 28.06 C ATOM 5479 O ALA B 101 -10.360 -12.243 22.972 1.00 37.05 O ATOM 5480 CB ALA B 101 -10.679 -13.295 25.943 1.00 27.00 C ATOM 5481 HA ALA B 101 -9.843 -11.314 26.021 1.00 0.00 H ATOM 5482 HB1 ALA B 101 -11.141 -13.194 26.925 1.00 0.00 H ATOM 5483 HB2 ALA B 101 -11.331 -13.876 25.291 1.00 0.00 H ATOM 5484 HB3 ALA B 101 -9.718 -13.800 26.043 1.00 0.00 H ATOM 5485 H ALA B 101 -12.500 -11.658 24.702 1.00 0.00 H ATOM 5486 N PHE B 102 -8.413 -11.886 24.038 1.00 27.27 N ATOM 5487 CA PHE B 102 -7.546 -11.929 22.875 1.00 27.09 C ATOM 5488 C PHE B 102 -6.568 -13.062 23.110 1.00 27.82 C ATOM 5489 O PHE B 102 -5.637 -12.942 23.908 1.00 25.89 O ATOM 5490 CB PHE B 102 -6.805 -10.582 22.668 1.00 23.32 C ATOM 5491 CG PHE B 102 -5.889 -10.566 21.450 1.00 24.79 C ATOM 5492 CD1 PHE B 102 -6.257 -11.220 20.270 1.00 25.04 C ATOM 5493 CD2 PHE B 102 -4.651 -9.919 21.491 1.00 26.31 C ATOM 5494 CE1 PHE B 102 -5.417 -11.233 19.156 1.00 28.79 C ATOM 5495 CE2 PHE B 102 -3.804 -9.921 20.385 1.00 23.97 C ATOM 5496 CZ PHE B 102 -4.188 -10.574 19.212 1.00 29.63 C ATOM 5497 HA PHE B 102 -8.126 -12.095 21.967 1.00 0.00 H ATOM 5498 HB2 PHE B 102 -7.549 -9.794 22.549 1.00 0.00 H ATOM 5499 HB3 PHE B 102 -6.203 -10.381 23.554 1.00 0.00 H ATOM 5500 HD2 PHE B 102 -4.344 -9.405 22.402 1.00 0.00 H ATOM 5501 HE2 PHE B 102 -2.841 -9.413 20.435 1.00 0.00 H ATOM 5502 HZ PHE B 102 -3.530 -10.569 18.343 1.00 0.00 H ATOM 5503 HE1 PHE B 102 -5.719 -11.755 18.248 1.00 0.00 H ATOM 5504 HD1 PHE B 102 -7.219 -11.730 20.220 1.00 0.00 H ATOM 5505 H PHE B 102 -7.969 -11.745 24.968 1.00 0.00 H ATOM 5506 N THR B 103 -6.795 -14.169 22.408 1.00 35.19 N ATOM 5507 CA THR B 103 -6.090 -15.420 22.692 1.00 40.67 C ATOM 5508 C THR B 103 -5.367 -15.949 21.463 1.00 40.95 C ATOM 5509 O THR B 103 -5.728 -17.003 20.945 1.00 44.57 O ATOM 5510 CB THR B 103 -7.056 -16.507 23.161 1.00 36.56 C ATOM 5511 OG1 THR B 103 -8.083 -16.650 22.170 1.00 41.46 O ATOM 5512 CG2 THR B 103 -7.660 -16.158 24.555 1.00 27.32 C ATOM 5513 HA THR B 103 -5.369 -15.189 23.477 1.00 0.00 H ATOM 5514 HB THR B 103 -6.524 -17.451 23.278 1.00 0.00 H ATOM 5515 HG1 THR B 103 -7.673 -16.907 21.306 1.00 0.00 H ATOM 5516 HG23 THR B 103 -6.855 -16.057 25.283 1.00 0.00 H ATOM 5517 HG21 THR B 103 -8.210 -15.220 24.487 1.00 0.00 H ATOM 5518 HG22 THR B 103 -8.335 -16.955 24.867 1.00 0.00 H ATOM 5519 H THR B 103 -7.492 -14.145 21.637 1.00 0.00 H ATOM 5520 N PRO B 104 -4.325 -15.231 21.018 1.00 41.85 N ATOM 5521 CA PRO B 104 -3.670 -15.534 19.745 1.00 38.29 C ATOM 5522 C PRO B 104 -2.670 -16.667 19.856 1.00 39.76 C ATOM 5523 O PRO B 104 -2.197 -16.958 20.969 1.00 42.76 O ATOM 5524 CB PRO B 104 -2.924 -14.233 19.439 1.00 40.27 C ATOM 5525 CG PRO B 104 -2.550 -13.689 20.845 1.00 40.73 C ATOM 5526 CD PRO B 104 -3.721 -14.066 21.711 1.00 40.22 C ATOM 5527 HA PRO B 104 -4.385 -15.850 18.985 1.00 0.00 H ATOM 5528 HD3 PRO B 104 -3.389 -14.341 22.712 1.00 0.00 H ATOM 5529 HD2 PRO B 104 -4.433 -13.244 21.778 1.00 0.00 H ATOM 5530 HG3 PRO B 104 -2.421 -12.607 20.819 1.00 0.00 H ATOM 5531 HG2 PRO B 104 -1.634 -14.155 21.209 1.00 0.00 H ATOM 5532 HB2 PRO B 104 -2.030 -14.426 18.846 1.00 0.00 H ATOM 5533 HB3 PRO B 104 -3.567 -13.531 18.908 1.00 0.00 H ATOM 5534 N THR B 105 -2.316 -17.260 18.713 1.00 33.57 N ATOM 5535 CA THR B 105 -1.246 -18.271 18.644 1.00 39.00 C ATOM 5536 C THR B 105 0.182 -17.680 18.580 1.00 38.67 C ATOM 5537 O THR B 105 0.367 -16.486 18.376 1.00 39.06 O ATOM 5538 CB THR B 105 -1.459 -19.234 17.448 1.00 42.72 C ATOM 5539 OG1 THR B 105 -1.467 -18.487 16.221 1.00 36.90 O ATOM 5540 CG2 THR B 105 -2.786 -20.005 17.593 1.00 43.84 C ATOM 5541 HA THR B 105 -1.319 -18.819 19.583 1.00 0.00 H ATOM 5542 HB THR B 105 -0.641 -19.954 17.435 1.00 0.00 H ATOM 5543 HG1 THR B 105 -1.603 -19.106 15.460 1.00 0.00 H ATOM 5544 HG23 THR B 105 -2.776 -20.570 18.525 1.00 0.00 H ATOM 5545 HG21 THR B 105 -3.616 -19.298 17.604 1.00 0.00 H ATOM 5546 HG22 THR B 105 -2.901 -20.689 16.752 1.00 0.00 H ATOM 5547 H THR B 105 -2.814 -16.998 17.838 1.00 0.00 H ATOM 5548 N THR B 106 1.202 -18.513 18.783 1.00 39.31 N ATOM 5549 CA THR B 106 2.569 -18.013 18.682 1.00 35.53 C ATOM 5550 C THR B 106 2.831 -17.546 17.223 1.00 38.71 C ATOM 5551 O THR B 106 3.352 -16.446 17.004 1.00 37.52 O ATOM 5552 CB THR B 106 3.593 -19.040 19.227 1.00 35.77 C ATOM 5553 OG1 THR B 106 3.389 -19.234 20.650 1.00 31.02 O ATOM 5554 CG2 THR B 106 5.015 -18.570 18.985 1.00 36.50 C ATOM 5555 HA THR B 106 2.702 -17.141 19.322 1.00 0.00 H ATOM 5556 HB THR B 106 3.441 -19.982 18.700 1.00 0.00 H ATOM 5557 HG1 THR B 106 4.047 -19.891 20.990 1.00 0.00 H ATOM 5558 HG23 THR B 106 5.171 -18.423 17.916 1.00 0.00 H ATOM 5559 HG21 THR B 106 5.180 -17.629 19.510 1.00 0.00 H ATOM 5560 HG22 THR B 106 5.713 -19.321 19.356 1.00 0.00 H ATOM 5561 H THR B 106 1.025 -19.512 19.012 1.00 0.00 H ATOM 5562 N ALA B 107 2.363 -18.332 16.243 1.00 35.37 N ATOM 5563 CA ALA B 107 2.511 -18.006 14.814 1.00 35.72 C ATOM 5564 C ALA B 107 1.762 -16.726 14.385 1.00 33.61 C ATOM 5565 O ALA B 107 2.152 -16.040 13.436 1.00 33.24 O ATOM 5566 CB ALA B 107 2.066 -19.219 13.927 1.00 31.07 C ATOM 5567 HA ALA B 107 3.571 -17.803 14.660 1.00 0.00 H ATOM 5568 HB1 ALA B 107 2.686 -20.085 14.160 1.00 0.00 H ATOM 5569 HB2 ALA B 107 1.021 -19.453 14.132 1.00 0.00 H ATOM 5570 HB3 ALA B 107 2.182 -18.960 12.875 1.00 0.00 H ATOM 5571 H ALA B 107 1.873 -19.212 16.503 1.00 0.00 H ATOM 5572 N ALA B 108 0.656 -16.446 15.056 1.00 34.23 N ATOM 5573 CA ALA B 108 -0.108 -15.256 14.777 1.00 35.28 C ATOM 5574 C ALA B 108 0.657 -14.009 15.241 1.00 35.61 C ATOM 5575 O ALA B 108 0.612 -12.969 14.579 1.00 28.60 O ATOM 5576 CB ALA B 108 -1.450 -15.335 15.468 1.00 34.39 C ATOM 5577 HA ALA B 108 -0.267 -15.182 13.701 1.00 0.00 H ATOM 5578 HB1 ALA B 108 -1.994 -16.207 15.104 1.00 0.00 H ATOM 5579 HB2 ALA B 108 -1.299 -15.423 16.544 1.00 0.00 H ATOM 5580 HB3 ALA B 108 -2.022 -14.432 15.253 1.00 0.00 H ATOM 5581 H ALA B 108 0.332 -17.097 15.799 1.00 0.00 H ATOM 5582 N MET B 109 1.334 -14.133 16.382 1.00 29.35 N ATOM 5583 CA MET B 109 2.056 -13.024 16.967 1.00 32.44 C ATOM 5584 C MET B 109 3.432 -12.889 16.363 1.00 37.36 C ATOM 5585 O MET B 109 3.924 -11.766 16.218 1.00 35.26 O ATOM 5586 CB MET B 109 2.181 -13.172 18.475 1.00 26.33 C ATOM 5587 CG MET B 109 0.858 -12.988 19.196 1.00 29.01 C ATOM 5588 SD MET B 109 0.353 -11.239 19.284 1.00 37.59 S ATOM 5589 CE MET B 109 1.580 -10.599 20.422 1.00 29.41 C ATOM 5590 HA MET B 109 1.481 -12.124 16.749 1.00 0.00 H ATOM 5591 HB2 MET B 109 2.563 -14.168 18.697 1.00 0.00 H ATOM 5592 HB3 MET B 109 2.885 -12.424 18.841 1.00 0.00 H ATOM 5593 HG2 MET B 109 0.954 -13.376 20.210 1.00 0.00 H ATOM 5594 HG3 MET B 109 0.089 -13.549 18.665 1.00 0.00 H ATOM 5595 HE1 MET B 109 1.502 -11.127 21.373 1.00 0.00 H ATOM 5596 HE2 MET B 109 2.575 -10.748 20.003 1.00 0.00 H ATOM 5597 HE3 MET B 109 1.407 -9.535 20.580 1.00 0.00 H ATOM 5598 H MET B 109 1.344 -15.053 16.866 1.00 0.00 H ATOM 5599 N TYR B 110 4.039 -14.026 16.006 1.00 33.67 N ATOM 5600 CA TYR B 110 5.362 -14.029 15.420 1.00 35.14 C ATOM 5601 C TYR B 110 5.413 -14.674 13.990 1.00 38.46 C ATOM 5602 O TYR B 110 6.217 -15.583 13.740 1.00 31.26 O ATOM 5603 CB TYR B 110 6.356 -14.651 16.415 1.00 39.89 C ATOM 5604 CG TYR B 110 6.499 -13.848 17.704 1.00 47.83 C ATOM 5605 CD1 TYR B 110 7.226 -12.636 17.724 1.00 53.28 C ATOM 5606 CD2 TYR B 110 5.897 -14.272 18.905 1.00 49.20 C ATOM 5607 CE1 TYR B 110 7.355 -11.854 18.910 1.00 48.99 C ATOM 5608 CE2 TYR B 110 6.019 -13.504 20.090 1.00 51.10 C ATOM 5609 CZ TYR B 110 6.748 -12.286 20.077 1.00 49.19 C ATOM 5610 OH TYR B 110 6.884 -11.516 21.231 1.00 48.48 O ATOM 5611 HA TYR B 110 5.661 -12.996 15.241 1.00 0.00 H ATOM 5612 HB3 TYR B 110 7.333 -14.714 15.936 1.00 0.00 H ATOM 5613 HB2 TYR B 110 6.012 -15.654 16.668 1.00 0.00 H ATOM 5614 HD2 TYR B 110 5.330 -15.203 18.923 1.00 0.00 H ATOM 5615 HE2 TYR B 110 5.552 -13.849 21.013 1.00 0.00 H ATOM 5616 HE1 TYR B 110 7.926 -10.925 18.898 1.00 0.00 H ATOM 5617 HD1 TYR B 110 7.702 -12.289 16.807 1.00 0.00 H ATOM 5618 HH TYR B 110 7.339 -12.049 21.930 1.00 0.00 H ATOM 5619 H TYR B 110 3.548 -14.931 16.153 1.00 0.00 H ATOM 5620 N PRO B 111 4.579 -14.184 13.033 1.00 37.52 N ATOM 5621 CA PRO B 111 4.536 -14.888 11.729 1.00 37.96 C ATOM 5622 C PRO B 111 5.866 -14.900 10.977 1.00 40.54 C ATOM 5623 O PRO B 111 6.045 -15.720 10.067 1.00 44.65 O ATOM 5624 CB PRO B 111 3.482 -14.118 10.909 1.00 34.61 C ATOM 5625 CG PRO B 111 3.285 -12.800 11.639 1.00 39.49 C ATOM 5626 CD PRO B 111 3.678 -13.012 13.073 1.00 39.32 C ATOM 5627 HA PRO B 111 4.301 -15.941 11.886 1.00 0.00 H ATOM 5628 HD3 PRO B 111 4.198 -12.138 13.465 1.00 0.00 H ATOM 5629 HD2 PRO B 111 2.802 -13.218 13.688 1.00 0.00 H ATOM 5630 HG3 PRO B 111 2.240 -12.495 11.581 1.00 0.00 H ATOM 5631 HG2 PRO B 111 3.913 -12.029 11.191 1.00 0.00 H ATOM 5632 HB2 PRO B 111 3.841 -13.942 9.895 1.00 0.00 H ATOM 5633 HB3 PRO B 111 2.547 -14.676 10.870 1.00 0.00 H ATOM 5634 N ASP B 112 6.781 -14.011 11.352 1.00 37.33 N ATOM 5635 CA ASP B 112 8.052 -13.881 10.676 1.00 37.55 C ATOM 5636 C ASP B 112 9.219 -14.194 11.623 1.00 37.93 C ATOM 5637 O ASP B 112 10.346 -13.753 11.394 1.00 39.34 O ATOM 5638 CB ASP B 112 8.188 -12.465 10.115 1.00 40.13 C ATOM 5639 CG ASP B 112 7.349 -12.233 8.857 1.00 40.76 C ATOM 5640 OD1 ASP B 112 7.649 -12.904 7.839 1.00 47.48 O ATOM 5641 OD2 ASP B 112 6.427 -11.363 8.869 1.00 35.27 O ATOM 5642 HA ASP B 112 8.086 -14.601 9.858 1.00 0.00 H ATOM 5643 HB2 ASP B 112 7.869 -11.757 10.880 1.00 0.00 H ATOM 5644 HB3 ASP B 112 9.235 -12.288 9.871 1.00 0.00 H ATOM 5645 H ASP B 112 6.575 -13.388 12.159 1.00 0.00 H ATOM 5646 N GLY B 113 8.952 -14.950 12.688 1.00 34.53 N ATOM 5647 CA GLY B 113 9.962 -15.207 13.740 1.00 30.56 C ATOM 5648 C GLY B 113 10.305 -13.966 14.530 1.00 33.43 C ATOM 5649 O GLY B 113 9.580 -12.954 14.480 1.00 43.82 O ATOM 5650 HA3 GLY B 113 10.870 -15.583 13.269 1.00 0.00 H ATOM 5651 HA2 GLY B 113 9.570 -15.960 14.424 1.00 0.00 H ATOM 5652 H GLY B 113 8.006 -15.372 12.783 1.00 0.00 H ATOM 5653 N LEU B 114 11.406 -14.022 15.257 1.00 32.34 N ATOM 5654 CA LEU B 114 11.946 -12.851 15.923 1.00 35.18 C ATOM 5655 C LEU B 114 12.832 -12.079 14.950 1.00 35.89 C ATOM 5656 O LEU B 114 13.943 -12.515 14.568 1.00 37.52 O ATOM 5657 CB LEU B 114 12.748 -13.251 17.157 1.00 38.92 C ATOM 5658 CG LEU B 114 11.823 -13.826 18.211 1.00 46.44 C ATOM 5659 CD1 LEU B 114 12.270 -15.251 18.643 1.00 53.76 C ATOM 5660 CD2 LEU B 114 11.666 -12.868 19.382 1.00 45.54 C ATOM 5661 HA LEU B 114 11.120 -12.218 16.246 1.00 0.00 H ATOM 5662 HB2 LEU B 114 13.489 -14.000 16.879 1.00 0.00 H ATOM 5663 HB3 LEU B 114 13.254 -12.373 17.560 1.00 0.00 H ATOM 5664 HG LEU B 114 10.832 -13.941 17.772 1.00 0.00 H ATOM 5665 HD21 LEU B 114 12.641 -12.686 19.834 1.00 0.00 H ATOM 5666 HD22 LEU B 114 11.248 -11.926 19.026 1.00 0.00 H ATOM 5667 HD23 LEU B 114 10.997 -13.307 20.122 1.00 0.00 H ATOM 5668 HD11 LEU B 114 12.260 -15.912 17.776 1.00 0.00 H ATOM 5669 HD12 LEU B 114 13.278 -15.205 19.055 1.00 0.00 H ATOM 5670 HD13 LEU B 114 11.584 -15.632 19.400 1.00 0.00 H ATOM 5671 H LEU B 114 11.901 -14.932 15.355 1.00 0.00 H ATOM 5672 N ARG B 115 12.330 -10.934 14.525 1.00 32.19 N ATOM 5673 CA ARG B 115 13.063 -10.137 13.575 1.00 32.11 C ATOM 5674 C ARG B 115 13.333 -8.775 14.242 1.00 24.48 C ATOM 5675 O ARG B 115 14.320 -8.648 14.963 1.00 27.68 O ATOM 5676 CB ARG B 115 12.323 -10.124 12.205 1.00 28.14 C ATOM 5677 CG ARG B 115 13.077 -9.457 11.068 1.00 29.36 C ATOM 5678 CD ARG B 115 12.431 -9.775 9.716 1.00 25.09 C ATOM 5679 NE ARG B 115 11.028 -9.382 9.718 1.00 28.93 N ATOM 5680 CZ ARG B 115 10.221 -9.438 8.663 1.00 25.21 C ATOM 5681 NH1 ARG B 115 10.657 -9.922 7.511 1.00 30.85 N ATOM 5682 NH2 ARG B 115 8.961 -9.061 8.768 1.00 18.57 N ATOM 5683 HA ARG B 115 14.040 -10.547 13.318 1.00 0.00 H ATOM 5684 HB2 ARG B 115 12.125 -11.157 11.919 1.00 0.00 H ATOM 5685 HB3 ARG B 115 11.378 -9.598 12.337 1.00 0.00 H ATOM 5686 HG2 ARG B 115 13.070 -8.378 11.221 1.00 0.00 H ATOM 5687 HG3 ARG B 115 14.106 -9.816 11.064 1.00 0.00 H ATOM 5688 HD2 ARG B 115 12.504 -10.846 9.526 1.00 0.00 H ATOM 5689 HD3 ARG B 115 12.955 -9.231 8.930 1.00 0.00 H ATOM 5690 HE ARG B 115 10.628 -9.031 10.612 1.00 0.00 H ATOM 5691 HH12 ARG B 115 10.020 -9.963 6.690 1.00 0.00 H ATOM 5692 HH11 ARG B 115 11.636 -10.262 7.427 1.00 0.00 H ATOM 5693 HH22 ARG B 115 8.334 -9.107 7.940 1.00 0.00 H ATOM 5694 HH21 ARG B 115 8.595 -8.718 9.679 1.00 0.00 H ATOM 5695 H ARG B 115 11.407 -10.608 14.876 1.00 0.00 H ATOM 5696 N THR B 116 12.455 -7.791 14.049 1.00 24.82 N ATOM 5697 CA THR B 116 12.589 -6.512 14.749 1.00 25.94 C ATOM 5698 C THR B 116 12.153 -6.677 16.190 1.00 27.85 C ATOM 5699 O THR B 116 11.080 -7.233 16.468 1.00 25.40 O ATOM 5700 CB THR B 116 11.716 -5.406 14.151 1.00 27.39 C ATOM 5701 OG1 THR B 116 11.755 -5.474 12.719 1.00 17.65 O ATOM 5702 CG2 THR B 116 12.209 -4.022 14.640 1.00 20.77 C ATOM 5703 HA THR B 116 13.637 -6.225 14.658 1.00 0.00 H ATOM 5704 HB THR B 116 10.686 -5.545 14.479 1.00 0.00 H ATOM 5705 HG1 THR B 116 11.415 -6.355 12.422 1.00 0.00 H ATOM 5706 HG23 THR B 116 12.173 -3.989 15.729 1.00 0.00 H ATOM 5707 HG21 THR B 116 13.234 -3.863 14.305 1.00 0.00 H ATOM 5708 HG22 THR B 116 11.566 -3.243 14.230 1.00 0.00 H ATOM 5709 H THR B 116 11.662 -7.934 13.391 1.00 0.00 H ATOM 5710 N THR B 117 12.970 -6.186 17.104 1.00 19.20 N ATOM 5711 CA THR B 117 12.585 -6.226 18.489 1.00 22.95 C ATOM 5712 C THR B 117 12.847 -4.881 19.182 1.00 24.38 C ATOM 5713 O THR B 117 13.508 -4.000 18.609 1.00 22.30 O ATOM 5714 CB THR B 117 13.343 -7.343 19.270 1.00 23.63 C ATOM 5715 OG1 THR B 117 14.749 -7.045 19.230 1.00 21.99 O ATOM 5716 CG2 THR B 117 13.038 -8.753 18.688 1.00 13.40 C ATOM 5717 HA THR B 117 11.517 -6.443 18.502 1.00 0.00 H ATOM 5718 HB THR B 117 13.004 -7.363 20.306 1.00 0.00 H ATOM 5719 HG1 THR B 117 15.248 -7.745 19.722 1.00 0.00 H ATOM 5720 HG23 THR B 117 11.965 -8.940 18.736 1.00 0.00 H ATOM 5721 HG21 THR B 117 13.369 -8.796 17.650 1.00 0.00 H ATOM 5722 HG22 THR B 117 13.566 -9.507 19.271 1.00 0.00 H ATOM 5723 H THR B 117 13.883 -5.774 16.825 1.00 0.00 H ATOM 5724 N VAL B 118 12.321 -4.768 20.410 1.00 21.81 N ATOM 5725 CA VAL B 118 12.618 -3.687 21.307 1.00 23.70 C ATOM 5726 C VAL B 118 13.888 -4.020 22.088 1.00 27.51 C ATOM 5727 O VAL B 118 14.025 -5.108 22.676 1.00 27.70 O ATOM 5728 CB VAL B 118 11.452 -3.440 22.293 1.00 25.28 C ATOM 5729 CG1 VAL B 118 11.806 -2.332 23.347 1.00 19.40 C ATOM 5730 CG2 VAL B 118 10.172 -3.094 21.512 1.00 16.67 C ATOM 5731 HA VAL B 118 12.763 -2.779 20.721 1.00 0.00 H ATOM 5732 HB VAL B 118 11.277 -4.357 22.856 1.00 0.00 H ATOM 5733 HG11 VAL B 118 12.680 -2.643 23.920 1.00 0.00 H ATOM 5734 HG12 VAL B 118 12.023 -1.397 22.830 1.00 0.00 H ATOM 5735 HG13 VAL B 118 10.961 -2.189 24.020 1.00 0.00 H ATOM 5736 HG21 VAL B 118 10.341 -2.194 20.920 1.00 0.00 H ATOM 5737 HG22 VAL B 118 9.916 -3.922 20.851 1.00 0.00 H ATOM 5738 HG23 VAL B 118 9.356 -2.921 22.213 1.00 0.00 H ATOM 5739 H VAL B 118 11.661 -5.505 20.731 1.00 0.00 H ATOM 5740 N GLN B 119 14.809 -3.066 22.050 1.00 22.99 N ATOM 5741 CA GLN B 119 15.975 -2.998 22.920 1.00 26.26 C ATOM 5742 C GLN B 119 15.689 -2.054 24.141 1.00 25.39 C ATOM 5743 O GLN B 119 15.652 -0.824 23.993 1.00 30.48 O ATOM 5744 CB GLN B 119 17.142 -2.447 22.104 1.00 26.28 C ATOM 5745 CG GLN B 119 18.433 -2.247 22.883 1.00 38.02 C ATOM 5746 CD GLN B 119 19.131 -3.547 23.159 1.00 48.09 C ATOM 5747 OE1 GLN B 119 18.503 -4.528 23.569 1.00 52.59 O ATOM 5748 NE2 GLN B 119 20.438 -3.581 22.909 1.00 53.08 N ATOM 5749 HA GLN B 119 16.212 -3.990 23.304 1.00 0.00 H ATOM 5750 HB2 GLN B 119 17.343 -3.142 21.289 1.00 0.00 H ATOM 5751 HB3 GLN B 119 16.842 -1.483 21.693 1.00 0.00 H ATOM 5752 HG2 GLN B 119 19.098 -1.606 22.304 1.00 0.00 H ATOM 5753 HG3 GLN B 119 18.200 -1.764 23.832 1.00 0.00 H ATOM 5754 HE22 GLN B 119 20.924 -2.728 22.565 1.00 0.00 H ATOM 5755 HE21 GLN B 119 20.973 -4.460 23.058 1.00 0.00 H ATOM 5756 H GLN B 119 14.689 -2.310 21.346 1.00 0.00 H ATOM 5757 N PRO B 120 15.515 -2.623 25.350 1.00 23.88 N ATOM 5758 CA PRO B 120 15.276 -1.813 26.544 1.00 21.35 C ATOM 5759 C PRO B 120 16.483 -0.948 26.910 1.00 19.85 C ATOM 5760 O PRO B 120 17.589 -1.247 26.507 1.00 18.78 O ATOM 5761 CB PRO B 120 15.060 -2.883 27.640 1.00 24.64 C ATOM 5762 CG PRO B 120 14.845 -4.184 26.935 1.00 20.37 C ATOM 5763 CD PRO B 120 15.586 -4.068 25.670 1.00 21.69 C ATOM 5764 HA PRO B 120 14.446 -1.119 26.410 1.00 0.00 H ATOM 5765 HD3 PRO B 120 16.620 -4.388 25.795 1.00 0.00 H ATOM 5766 HD2 PRO B 120 15.115 -4.663 24.888 1.00 0.00 H ATOM 5767 HG3 PRO B 120 13.784 -4.344 26.743 1.00 0.00 H ATOM 5768 HG2 PRO B 120 15.233 -5.010 27.531 1.00 0.00 H ATOM 5769 HB2 PRO B 120 15.938 -2.945 28.283 1.00 0.00 H ATOM 5770 HB3 PRO B 120 14.187 -2.633 28.242 1.00 0.00 H ATOM 5771 N GLY B 121 16.298 0.077 27.727 1.00 21.81 N ATOM 5772 CA GLY B 121 17.457 0.796 28.308 1.00 19.71 C ATOM 5773 C GLY B 121 18.176 -0.104 29.326 1.00 22.41 C ATOM 5774 O GLY B 121 17.714 -1.208 29.603 1.00 24.28 O ATOM 5775 HA3 GLY B 121 17.108 1.700 28.808 1.00 0.00 H ATOM 5776 HA2 GLY B 121 18.150 1.067 27.512 1.00 0.00 H ATOM 5777 H GLY B 121 15.332 0.380 27.963 1.00 0.00 H ATOM 5778 N PRO B 122 19.304 0.364 29.891 1.00 21.66 N ATOM 5779 CA PRO B 122 20.204 -0.271 30.909 1.00 21.16 C ATOM 5780 C PRO B 122 19.545 -0.911 32.134 1.00 25.75 C ATOM 5781 O PRO B 122 20.076 -1.870 32.702 1.00 31.05 O ATOM 5782 CB PRO B 122 21.042 0.893 31.417 1.00 22.96 C ATOM 5783 CG PRO B 122 20.646 2.134 30.582 1.00 22.55 C ATOM 5784 CD PRO B 122 19.804 1.684 29.439 1.00 19.05 C ATOM 5785 HA PRO B 122 20.719 -1.098 30.420 1.00 0.00 H ATOM 5786 HD3 PRO B 122 18.980 2.376 29.263 1.00 0.00 H ATOM 5787 HD2 PRO B 122 20.397 1.588 28.529 1.00 0.00 H ATOM 5788 HG3 PRO B 122 21.543 2.627 30.207 1.00 0.00 H ATOM 5789 HG2 PRO B 122 20.083 2.831 31.203 1.00 0.00 H ATOM 5790 HB2 PRO B 122 20.836 1.070 32.473 1.00 0.00 H ATOM 5791 HB3 PRO B 122 22.102 0.676 31.286 1.00 0.00 H ATOM 5792 N LEU B 123 18.399 -0.382 32.538 1.00 28.03 N ATOM 5793 CA LEU B 123 17.643 -0.926 33.654 1.00 25.67 C ATOM 5794 C LEU B 123 17.212 -2.377 33.451 1.00 26.74 C ATOM 5795 O LEU B 123 16.969 -3.085 34.425 1.00 24.74 O ATOM 5796 CB LEU B 123 16.416 -0.054 33.933 1.00 24.91 C ATOM 5797 CG LEU B 123 15.494 -0.539 35.063 1.00 26.22 C ATOM 5798 CD1 LEU B 123 16.193 -0.454 36.411 1.00 21.82 C ATOM 5799 CD2 LEU B 123 14.127 0.201 35.082 1.00 26.80 C ATOM 5800 HA LEU B 123 18.316 -0.919 34.512 1.00 0.00 H ATOM 5801 HB2 LEU B 123 16.767 0.945 34.193 1.00 0.00 H ATOM 5802 HB3 LEU B 123 15.826 -0.004 33.018 1.00 0.00 H ATOM 5803 HG LEU B 123 15.271 -1.587 34.861 1.00 0.00 H ATOM 5804 HD21 LEU B 123 14.295 1.269 35.223 1.00 0.00 H ATOM 5805 HD22 LEU B 123 13.612 0.035 34.136 1.00 0.00 H ATOM 5806 HD23 LEU B 123 13.519 -0.183 35.901 1.00 0.00 H ATOM 5807 HD11 LEU B 123 17.086 -1.078 36.396 1.00 0.00 H ATOM 5808 HD12 LEU B 123 16.474 0.580 36.608 1.00 0.00 H ATOM 5809 HD13 LEU B 123 15.517 -0.803 37.192 1.00 0.00 H ATOM 5810 H LEU B 123 18.028 0.452 32.039 1.00 0.00 H ATOM 5811 N ALA B 124 17.061 -2.798 32.193 1.00 22.50 N ATOM 5812 CA ALA B 124 16.747 -4.172 31.864 1.00 23.24 C ATOM 5813 C ALA B 124 17.910 -5.135 32.234 1.00 27.77 C ATOM 5814 O ALA B 124 17.711 -6.329 32.267 1.00 34.18 O ATOM 5815 CB ALA B 124 16.407 -4.282 30.376 1.00 22.59 C ATOM 5816 HA ALA B 124 15.882 -4.473 32.455 1.00 0.00 H ATOM 5817 HB1 ALA B 124 15.546 -3.651 30.154 1.00 0.00 H ATOM 5818 HB2 ALA B 124 17.262 -3.955 29.784 1.00 0.00 H ATOM 5819 HB3 ALA B 124 16.171 -5.318 30.134 1.00 0.00 H ATOM 5820 H ALA B 124 17.173 -2.112 31.419 1.00 0.00 H ATOM 5821 N ALA B 125 19.106 -4.622 32.505 1.00 27.38 N ATOM 5822 CA ALA B 125 20.249 -5.469 32.848 1.00 31.51 C ATOM 5823 C ALA B 125 20.398 -5.667 34.359 1.00 34.96 C ATOM 5824 O ALA B 125 21.109 -6.557 34.816 1.00 35.42 O ATOM 5825 CB ALA B 125 21.526 -4.876 32.291 1.00 29.91 C ATOM 5826 HA ALA B 125 20.064 -6.446 32.401 1.00 0.00 H ATOM 5827 HB1 ALA B 125 21.448 -4.803 31.206 1.00 0.00 H ATOM 5828 HB2 ALA B 125 21.678 -3.883 32.713 1.00 0.00 H ATOM 5829 HB3 ALA B 125 22.368 -5.517 32.554 1.00 0.00 H ATOM 5830 H ALA B 125 19.233 -3.590 32.472 1.00 0.00 H ATOM 5831 N GLU B 126 19.717 -4.839 35.133 1.00 36.11 N ATOM 5832 CA GLU B 126 19.794 -4.926 36.580 1.00 33.67 C ATOM 5833 C GLU B 126 18.708 -5.793 37.181 1.00 37.03 C ATOM 5834 O GLU B 126 17.684 -6.111 36.542 1.00 38.62 O ATOM 5835 CB GLU B 126 19.654 -3.553 37.170 1.00 28.80 C ATOM 5836 CG GLU B 126 20.603 -2.568 36.578 1.00 34.90 C ATOM 5837 CD GLU B 126 20.285 -1.169 37.028 1.00 36.06 C ATOM 5838 OE1 GLU B 126 19.485 -1.005 37.947 1.00 42.64 O ATOM 5839 OE2 GLU B 126 20.833 -0.221 36.471 1.00 46.12 O ATOM 5840 HA GLU B 126 20.760 -5.376 36.811 1.00 0.00 H ATOM 5841 HB2 GLU B 126 18.636 -3.202 36.998 1.00 0.00 H ATOM 5842 HB3 GLU B 126 19.840 -3.614 38.242 1.00 0.00 H ATOM 5843 HG2 GLU B 126 21.617 -2.820 36.888 1.00 0.00 H ATOM 5844 HG3 GLU B 126 20.534 -2.617 35.491 1.00 0.00 H ATOM 5845 H GLU B 126 19.115 -4.112 34.697 1.00 0.00 H ATOM 5846 N LEU B 127 18.864 -6.091 38.448 1.00 37.80 N ATOM 5847 CA LEU B 127 17.872 -6.796 39.213 1.00 29.50 C ATOM 5848 C LEU B 127 17.426 -8.129 38.649 1.00 32.55 C ATOM 5849 O LEU B 127 18.047 -9.122 38.874 1.00 31.36 O ATOM 5850 CB LEU B 127 16.696 -5.898 39.517 1.00 25.74 C ATOM 5851 CG LEU B 127 17.041 -4.674 40.332 1.00 31.41 C ATOM 5852 CD1 LEU B 127 16.023 -3.661 40.251 1.00 19.02 C ATOM 5853 CD2 LEU B 127 17.423 -5.013 41.771 1.00 27.86 C ATOM 5854 HA LEU B 127 18.377 -7.066 40.140 1.00 0.00 H ATOM 5855 HB2 LEU B 127 16.265 -5.568 38.572 1.00 0.00 H ATOM 5856 HB3 LEU B 127 15.957 -6.479 40.069 1.00 0.00 H ATOM 5857 HG LEU B 127 17.936 -4.246 39.880 1.00 0.00 H ATOM 5858 HD21 LEU B 127 16.587 -5.515 42.259 1.00 0.00 H ATOM 5859 HD22 LEU B 127 18.293 -5.670 41.770 1.00 0.00 H ATOM 5860 HD23 LEU B 127 17.661 -4.095 42.308 1.00 0.00 H ATOM 5861 HD11 LEU B 127 15.901 -3.353 39.213 1.00 0.00 H ATOM 5862 HD12 LEU B 127 15.082 -4.063 40.626 1.00 0.00 H ATOM 5863 HD13 LEU B 127 16.318 -2.802 40.854 1.00 0.00 H ATOM 5864 H LEU B 127 19.745 -5.805 38.921 1.00 0.00 H ATOM 5865 N GLU B 128 16.329 -8.117 37.928 1.00 28.76 N ATOM 5866 CA GLU B 128 15.723 -9.301 37.394 1.00 30.63 C ATOM 5867 C GLU B 128 16.296 -9.985 36.149 1.00 28.70 C ATOM 5868 O GLU B 128 16.074 -11.131 35.997 1.00 37.44 O ATOM 5869 CB GLU B 128 14.250 -9.065 37.155 1.00 23.28 C ATOM 5870 CG GLU B 128 13.334 -9.322 38.275 1.00 30.84 C ATOM 5871 CD GLU B 128 13.480 -10.678 38.883 1.00 39.74 C ATOM 5872 OE1 GLU B 128 12.931 -11.667 38.374 1.00 30.63 O ATOM 5873 OE2 GLU B 128 14.134 -10.720 39.902 1.00 37.71 O ATOM 5874 HA GLU B 128 15.959 -10.011 38.187 1.00 0.00 H ATOM 5875 HB2 GLU B 128 14.128 -8.021 36.866 1.00 0.00 H ATOM 5876 HB3 GLU B 128 13.945 -9.708 36.329 1.00 0.00 H ATOM 5877 HG2 GLU B 128 13.522 -8.578 39.049 1.00 0.00 H ATOM 5878 HG3 GLU B 128 12.311 -9.217 37.912 1.00 0.00 H ATOM 5879 H GLU B 128 15.876 -7.201 37.734 1.00 0.00 H ATOM 5880 N GLY B 129 16.840 -9.301 35.167 1.00 33.60 N ATOM 5881 CA GLY B 129 18.013 -8.498 35.149 1.00 38.27 C ATOM 5882 C GLY B 129 19.251 -9.304 34.886 1.00 38.44 C ATOM 5883 O GLY B 129 19.511 -9.701 33.789 1.00 40.01 O ATOM 5884 HA3 GLY B 129 18.115 -8.004 36.115 1.00 0.00 H ATOM 5885 HA2 GLY B 129 17.911 -7.746 34.367 1.00 0.00 H ATOM 5886 H GLY B 129 16.333 -9.356 34.261 1.00 0.00 H ATOM 5887 N GLY B 130 20.012 -9.537 35.933 1.00 37.34 N ATOM 5888 CA GLY B 130 21.118 -10.476 35.923 1.00 45.96 C ATOM 5889 C GLY B 130 20.826 -11.971 35.737 1.00 45.37 C ATOM 5890 O GLY B 130 21.477 -12.610 34.907 1.00 47.10 O ATOM 5891 HA3 GLY B 130 21.637 -10.368 36.875 1.00 0.00 H ATOM 5892 HA2 GLY B 130 21.783 -10.177 35.113 1.00 0.00 H ATOM 5893 H GLY B 130 19.811 -9.022 36.814 1.00 0.00 H ATOM 5894 N PRO B 131 19.896 -12.560 36.524 1.00 44.09 N ATOM 5895 CA PRO B 131 19.584 -13.940 36.118 1.00 47.18 C ATOM 5896 C PRO B 131 19.065 -14.062 34.654 1.00 52.75 C ATOM 5897 O PRO B 131 19.596 -14.886 33.913 1.00 53.90 O ATOM 5898 CB PRO B 131 18.563 -14.427 37.162 1.00 45.72 C ATOM 5899 CG PRO B 131 18.166 -13.231 37.977 1.00 42.54 C ATOM 5900 CD PRO B 131 19.163 -12.133 37.742 1.00 44.22 C ATOM 5901 HA PRO B 131 20.480 -14.560 36.102 1.00 0.00 H ATOM 5902 HD3 PRO B 131 18.658 -11.181 37.576 1.00 0.00 H ATOM 5903 HD2 PRO B 131 19.842 -12.040 38.589 1.00 0.00 H ATOM 5904 HG3 PRO B 131 18.154 -13.495 39.034 1.00 0.00 H ATOM 5905 HG2 PRO B 131 17.173 -12.896 37.676 1.00 0.00 H ATOM 5906 HB2 PRO B 131 17.690 -14.848 36.664 1.00 0.00 H ATOM 5907 HB3 PRO B 131 19.014 -15.184 37.803 1.00 0.00 H ATOM 5908 N ARG B 132 18.112 -13.222 34.219 1.00 54.82 N ATOM 5909 CA ARG B 132 17.532 -13.337 32.855 1.00 53.38 C ATOM 5910 C ARG B 132 17.767 -12.115 31.903 1.00 55.89 C ATOM 5911 O ARG B 132 16.836 -11.308 31.677 1.00 53.69 O ATOM 5912 CB ARG B 132 16.036 -13.696 32.949 1.00 58.78 C ATOM 5913 CG ARG B 132 15.683 -14.912 33.860 1.00 66.63 C ATOM 5914 CD ARG B 132 14.418 -14.700 34.746 1.00 70.80 C ATOM 5915 NE ARG B 132 13.154 -14.975 34.036 1.00 78.92 N ATOM 5916 CZ ARG B 132 11.921 -14.740 34.513 1.00 81.59 C ATOM 5917 NH1 ARG B 132 11.736 -14.211 35.723 1.00 81.14 N ATOM 5918 NH2 ARG B 132 10.854 -15.028 33.770 1.00 79.18 N ATOM 5919 HA ARG B 132 18.088 -14.143 32.376 1.00 0.00 H ATOM 5920 HB2 ARG B 132 15.507 -12.825 33.335 1.00 0.00 H ATOM 5921 HB3 ARG B 132 15.682 -13.919 31.942 1.00 0.00 H ATOM 5922 HG2 ARG B 132 15.513 -15.779 33.222 1.00 0.00 H ATOM 5923 HG3 ARG B 132 16.532 -15.106 34.516 1.00 0.00 H ATOM 5924 HD2 ARG B 132 14.405 -13.665 35.088 1.00 0.00 H ATOM 5925 HD3 ARG B 132 14.483 -15.365 35.607 1.00 0.00 H ATOM 5926 HE ARG B 132 13.224 -15.387 33.083 1.00 0.00 H ATOM 5927 HH12 ARG B 132 10.772 -14.037 36.073 1.00 0.00 H ATOM 5928 HH11 ARG B 132 12.556 -13.972 36.317 1.00 0.00 H ATOM 5929 HH22 ARG B 132 9.899 -14.846 34.139 1.00 0.00 H ATOM 5930 HH21 ARG B 132 10.976 -15.435 32.821 1.00 0.00 H ATOM 5931 H ARG B 132 17.771 -12.471 34.853 1.00 0.00 H ATOM 5932 N PRO B 133 18.981 -12.019 31.278 1.00 53.68 N ATOM 5933 CA PRO B 133 19.484 -10.848 30.512 1.00 50.62 C ATOM 5934 C PRO B 133 18.608 -10.371 29.306 1.00 48.13 C ATOM 5935 O PRO B 133 18.777 -9.265 28.802 1.00 43.34 O ATOM 5936 CB PRO B 133 20.834 -11.341 29.981 1.00 52.22 C ATOM 5937 CG PRO B 133 21.215 -12.484 30.847 1.00 49.75 C ATOM 5938 CD PRO B 133 19.941 -13.140 31.216 1.00 52.65 C ATOM 5939 HA PRO B 133 19.502 -9.975 31.165 1.00 0.00 H ATOM 5940 HD3 PRO B 133 19.643 -13.867 30.460 1.00 0.00 H ATOM 5941 HD2 PRO B 133 20.024 -13.636 32.183 1.00 0.00 H ATOM 5942 HG3 PRO B 133 21.735 -12.131 31.738 1.00 0.00 H ATOM 5943 HG2 PRO B 133 21.858 -13.177 30.304 1.00 0.00 H ATOM 5944 HB2 PRO B 133 20.739 -11.665 28.944 1.00 0.00 H ATOM 5945 HB3 PRO B 133 21.580 -10.549 30.047 1.00 0.00 H ATOM 5946 N THR B 134 17.687 -11.200 28.847 1.00 45.71 N ATOM 5947 CA THR B 134 16.929 -10.883 27.650 1.00 41.73 C ATOM 5948 C THR B 134 15.429 -10.899 27.945 1.00 39.52 C ATOM 5949 O THR B 134 14.610 -10.703 27.023 1.00 40.71 O ATOM 5950 CB THR B 134 17.235 -11.914 26.488 1.00 42.06 C ATOM 5951 OG1 THR B 134 17.059 -13.249 26.968 1.00 42.32 O ATOM 5952 CG2 THR B 134 18.655 -11.763 25.929 1.00 37.73 C ATOM 5953 HA THR B 134 17.230 -9.886 27.329 1.00 0.00 H ATOM 5954 HB THR B 134 16.536 -11.703 25.679 1.00 0.00 H ATOM 5955 HG1 THR B 134 17.252 -13.889 26.238 1.00 0.00 H ATOM 5956 HG23 THR B 134 18.793 -10.746 25.562 1.00 0.00 H ATOM 5957 HG21 THR B 134 19.378 -11.967 26.718 1.00 0.00 H ATOM 5958 HG22 THR B 134 18.799 -12.469 25.111 1.00 0.00 H ATOM 5959 H THR B 134 17.503 -12.091 29.350 1.00 0.00 H ATOM 5960 N HIS B 135 15.071 -11.146 29.212 1.00 32.98 N ATOM 5961 CA HIS B 135 13.658 -11.270 29.618 1.00 29.08 C ATOM 5962 C HIS B 135 12.811 -10.025 29.220 1.00 33.46 C ATOM 5963 O HIS B 135 11.679 -10.140 28.675 1.00 37.53 O ATOM 5964 CB HIS B 135 13.545 -11.597 31.148 1.00 27.46 C ATOM 5965 CG HIS B 135 12.151 -11.480 31.701 1.00 25.21 C ATOM 5966 ND1 HIS B 135 11.117 -12.326 31.329 1.00 28.47 N ATOM 5967 CD2 HIS B 135 11.611 -10.592 32.572 1.00 23.63 C ATOM 5968 CE1 HIS B 135 10.005 -11.967 31.945 1.00 29.06 C ATOM 5969 NE2 HIS B 135 10.271 -10.900 32.688 1.00 32.89 N ATOM 5970 HA HIS B 135 13.233 -12.108 29.066 1.00 0.00 H ATOM 5971 HB2 HIS B 135 13.892 -12.618 31.306 1.00 0.00 H ATOM 5972 HB3 HIS B 135 14.189 -10.907 31.694 1.00 0.00 H ATOM 5973 HD2 HIS B 135 12.137 -9.786 33.084 1.00 0.00 H ATOM 5974 HE1 HIS B 135 9.037 -12.461 31.858 1.00 0.00 H ATOM 5975 H HIS B 135 15.813 -11.254 29.933 1.00 0.00 H ATOM 5976 N PHE B 136 13.350 -8.837 29.489 1.00 22.53 N ATOM 5977 CA PHE B 136 12.530 -7.662 29.372 1.00 23.84 C ATOM 5978 C PHE B 136 12.393 -7.191 27.937 1.00 21.69 C ATOM 5979 O PHE B 136 11.381 -6.556 27.592 1.00 25.77 O ATOM 5980 CB PHE B 136 13.041 -6.568 30.296 1.00 26.43 C ATOM 5981 CG PHE B 136 12.802 -6.855 31.773 1.00 28.79 C ATOM 5982 CD1 PHE B 136 11.498 -6.968 32.274 1.00 31.31 C ATOM 5983 CD2 PHE B 136 13.879 -6.986 32.665 1.00 21.97 C ATOM 5984 CE1 PHE B 136 11.272 -7.247 33.643 1.00 31.02 C ATOM 5985 CE2 PHE B 136 13.661 -7.219 34.016 1.00 22.54 C ATOM 5986 CZ PHE B 136 12.379 -7.369 34.511 1.00 23.37 C ATOM 5987 HA PHE B 136 11.521 -7.925 29.690 1.00 0.00 H ATOM 5988 HB2 PHE B 136 14.113 -6.455 30.136 1.00 0.00 H ATOM 5989 HB3 PHE B 136 12.536 -5.637 30.040 1.00 0.00 H ATOM 5990 HD2 PHE B 136 14.900 -6.904 32.291 1.00 0.00 H ATOM 5991 HE2 PHE B 136 14.511 -7.284 34.695 1.00 0.00 H ATOM 5992 HZ PHE B 136 12.223 -7.581 35.569 1.00 0.00 H ATOM 5993 HE1 PHE B 136 10.257 -7.366 34.022 1.00 0.00 H ATOM 5994 HD1 PHE B 136 10.649 -6.840 31.602 1.00 0.00 H ATOM 5995 H PHE B 136 14.346 -8.761 29.778 1.00 0.00 H ATOM 5996 N ALA B 137 13.406 -7.480 27.115 1.00 20.96 N ATOM 5997 CA ALA B 137 13.338 -7.319 25.640 1.00 22.56 C ATOM 5998 C ALA B 137 12.150 -8.056 25.110 1.00 23.83 C ATOM 5999 O ALA B 137 11.356 -7.483 24.363 1.00 25.60 O ATOM 6000 CB ALA B 137 14.605 -7.834 24.968 1.00 23.54 C ATOM 6001 HA ALA B 137 13.244 -6.256 25.416 1.00 0.00 H ATOM 6002 HB1 ALA B 137 15.464 -7.276 25.339 1.00 0.00 H ATOM 6003 HB2 ALA B 137 14.732 -8.892 25.197 1.00 0.00 H ATOM 6004 HB3 ALA B 137 14.522 -7.701 23.889 1.00 0.00 H ATOM 6005 H ALA B 137 14.290 -7.837 27.531 1.00 0.00 H ATOM 6006 N GLY B 138 11.995 -9.320 25.536 1.00 24.94 N ATOM 6007 CA GLY B 138 10.823 -10.121 25.173 1.00 21.53 C ATOM 6008 C GLY B 138 9.533 -9.450 25.651 1.00 26.59 C ATOM 6009 O GLY B 138 8.570 -9.266 24.893 1.00 26.05 O ATOM 6010 HA3 GLY B 138 10.906 -11.105 25.635 1.00 0.00 H ATOM 6011 HA2 GLY B 138 10.788 -10.231 24.089 1.00 0.00 H ATOM 6012 H GLY B 138 12.728 -9.743 26.141 1.00 0.00 H ATOM 6013 N VAL B 139 9.529 -9.064 26.918 1.00 22.73 N ATOM 6014 CA VAL B 139 8.374 -8.417 27.508 1.00 23.37 C ATOM 6015 C VAL B 139 7.984 -7.125 26.761 1.00 19.49 C ATOM 6016 O VAL B 139 6.876 -7.038 26.248 1.00 24.22 O ATOM 6017 CB VAL B 139 8.570 -8.217 29.044 1.00 23.70 C ATOM 6018 CG1 VAL B 139 7.487 -7.351 29.625 1.00 18.89 C ATOM 6019 CG2 VAL B 139 8.578 -9.577 29.724 1.00 18.17 C ATOM 6020 HA VAL B 139 7.518 -9.081 27.390 1.00 0.00 H ATOM 6021 HB VAL B 139 9.521 -7.712 29.214 1.00 0.00 H ATOM 6022 HG11 VAL B 139 7.507 -6.374 29.142 1.00 0.00 H ATOM 6023 HG12 VAL B 139 6.518 -7.821 29.457 1.00 0.00 H ATOM 6024 HG13 VAL B 139 7.654 -7.232 30.696 1.00 0.00 H ATOM 6025 HG21 VAL B 139 7.630 -10.081 29.537 1.00 0.00 H ATOM 6026 HG22 VAL B 139 9.395 -10.177 29.324 1.00 0.00 H ATOM 6027 HG23 VAL B 139 8.715 -9.444 30.797 1.00 0.00 H ATOM 6028 H VAL B 139 10.373 -9.229 27.502 1.00 0.00 H ATOM 6029 N LEU B 140 8.889 -6.166 26.650 1.00 15.18 N ATOM 6030 CA LEU B 140 8.578 -4.944 25.913 1.00 19.84 C ATOM 6031 C LEU B 140 8.141 -5.159 24.443 1.00 19.18 C ATOM 6032 O LEU B 140 7.248 -4.452 23.944 1.00 16.17 O ATOM 6033 CB LEU B 140 9.734 -3.947 25.982 1.00 18.75 C ATOM 6034 CG LEU B 140 10.342 -3.563 27.335 1.00 25.85 C ATOM 6035 CD1 LEU B 140 11.260 -2.296 27.300 1.00 21.96 C ATOM 6036 CD2 LEU B 140 9.244 -3.375 28.307 1.00 17.13 C ATOM 6037 HA LEU B 140 7.705 -4.534 26.420 1.00 0.00 H ATOM 6038 HB2 LEU B 140 10.543 -4.362 25.381 1.00 0.00 H ATOM 6039 HB3 LEU B 140 9.380 -3.024 25.524 1.00 0.00 H ATOM 6040 HG LEU B 140 11.000 -4.380 27.630 1.00 0.00 H ATOM 6041 HD21 LEU B 140 8.583 -2.582 27.957 1.00 0.00 H ATOM 6042 HD22 LEU B 140 8.681 -4.304 28.402 1.00 0.00 H ATOM 6043 HD23 LEU B 140 9.661 -3.101 29.276 1.00 0.00 H ATOM 6044 HD11 LEU B 140 12.091 -2.470 26.617 1.00 0.00 H ATOM 6045 HD12 LEU B 140 10.681 -1.438 26.958 1.00 0.00 H ATOM 6046 HD13 LEU B 140 11.645 -2.100 28.301 1.00 0.00 H ATOM 6047 H LEU B 140 9.825 -6.283 27.089 1.00 0.00 H ATOM 6048 N THR B 141 8.704 -6.125 23.769 1.00 17.20 N ATOM 6049 CA THR B 141 8.328 -6.380 22.423 1.00 15.40 C ATOM 6050 C THR B 141 6.904 -6.825 22.315 1.00 18.65 C ATOM 6051 O THR B 141 6.208 -6.395 21.482 1.00 22.76 O ATOM 6052 CB THR B 141 9.246 -7.383 21.728 1.00 19.41 C ATOM 6053 OG1 THR B 141 10.577 -6.954 21.825 1.00 14.34 O ATOM 6054 CG2 THR B 141 8.908 -7.468 20.297 1.00 13.76 C ATOM 6055 HA THR B 141 8.434 -5.426 21.906 1.00 0.00 H ATOM 6056 HB THR B 141 9.119 -8.354 22.208 1.00 0.00 H ATOM 6057 HG1 THR B 141 10.831 -6.883 22.779 1.00 0.00 H ATOM 6058 HG23 THR B 141 7.876 -7.800 20.188 1.00 0.00 H ATOM 6059 HG21 THR B 141 9.026 -6.486 19.838 1.00 0.00 H ATOM 6060 HG22 THR B 141 9.574 -8.180 19.809 1.00 0.00 H ATOM 6061 H THR B 141 9.433 -6.712 24.221 1.00 0.00 H ATOM 6062 N VAL B 142 6.475 -7.692 23.185 1.00 19.06 N ATOM 6063 CA VAL B 142 5.160 -8.240 23.090 1.00 19.74 C ATOM 6064 C VAL B 142 4.146 -7.211 23.520 1.00 16.08 C ATOM 6065 O VAL B 142 3.111 -7.105 22.964 1.00 20.69 O ATOM 6066 CB VAL B 142 5.046 -9.619 23.799 1.00 18.54 C ATOM 6067 CG1 VAL B 142 4.658 -9.523 25.167 1.00 23.54 C ATOM 6068 CG2 VAL B 142 4.099 -10.415 23.163 1.00 24.15 C ATOM 6069 HA VAL B 142 4.935 -8.471 22.049 1.00 0.00 H ATOM 6070 HB VAL B 142 6.045 -10.053 23.746 1.00 0.00 H ATOM 6071 HG11 VAL B 142 5.396 -8.934 25.712 1.00 0.00 H ATOM 6072 HG12 VAL B 142 3.684 -9.039 25.234 1.00 0.00 H ATOM 6073 HG13 VAL B 142 4.599 -10.523 25.598 1.00 0.00 H ATOM 6074 HG21 VAL B 142 3.129 -9.918 23.194 1.00 0.00 H ATOM 6075 HG22 VAL B 142 4.396 -10.572 22.126 1.00 0.00 H ATOM 6076 HG23 VAL B 142 4.033 -11.376 23.673 1.00 0.00 H ATOM 6077 H VAL B 142 7.099 -7.990 23.961 1.00 0.00 H ATOM 6078 N VAL B 143 4.495 -6.437 24.514 1.00 18.19 N ATOM 6079 CA VAL B 143 3.671 -5.342 24.956 1.00 15.37 C ATOM 6080 C VAL B 143 3.529 -4.261 23.929 1.00 14.43 C ATOM 6081 O VAL B 143 2.468 -3.783 23.761 1.00 19.93 O ATOM 6082 CB VAL B 143 4.118 -4.729 26.271 1.00 15.60 C ATOM 6083 CG1 VAL B 143 3.282 -3.588 26.640 1.00 13.49 C ATOM 6084 CG2 VAL B 143 4.079 -5.719 27.345 1.00 17.60 C ATOM 6085 HA VAL B 143 2.696 -5.803 25.116 1.00 0.00 H ATOM 6086 HB VAL B 143 5.143 -4.384 26.132 1.00 0.00 H ATOM 6087 HG11 VAL B 143 3.346 -2.826 25.863 1.00 0.00 H ATOM 6088 HG12 VAL B 143 2.248 -3.916 26.745 1.00 0.00 H ATOM 6089 HG13 VAL B 143 3.631 -3.174 27.586 1.00 0.00 H ATOM 6090 HG21 VAL B 143 3.061 -6.091 27.458 1.00 0.00 H ATOM 6091 HG22 VAL B 143 4.744 -6.547 27.099 1.00 0.00 H ATOM 6092 HG23 VAL B 143 4.404 -5.256 28.277 1.00 0.00 H ATOM 6093 H VAL B 143 5.396 -6.618 25.001 1.00 0.00 H ATOM 6094 N LEU B 144 4.599 -3.884 23.251 1.00 16.03 N ATOM 6095 CA LEU B 144 4.480 -2.944 22.110 1.00 19.22 C ATOM 6096 C LEU B 144 3.429 -3.406 21.086 1.00 20.07 C ATOM 6097 O LEU B 144 2.624 -2.634 20.610 1.00 25.04 O ATOM 6098 CB LEU B 144 5.830 -2.752 21.399 1.00 22.46 C ATOM 6099 CG LEU B 144 5.878 -1.694 20.258 1.00 24.61 C ATOM 6100 CD1 LEU B 144 5.284 -0.326 20.664 1.00 20.80 C ATOM 6101 CD2 LEU B 144 7.297 -1.503 19.722 1.00 18.06 C ATOM 6102 HA LEU B 144 4.157 -1.992 22.532 1.00 0.00 H ATOM 6103 HB2 LEU B 144 6.561 -2.458 22.152 1.00 0.00 H ATOM 6104 HB3 LEU B 144 6.117 -3.712 20.971 1.00 0.00 H ATOM 6105 HG LEU B 144 5.248 -2.100 19.466 1.00 0.00 H ATOM 6106 HD21 LEU B 144 7.947 -1.167 20.530 1.00 0.00 H ATOM 6107 HD22 LEU B 144 7.666 -2.450 19.328 1.00 0.00 H ATOM 6108 HD23 LEU B 144 7.287 -0.757 18.928 1.00 0.00 H ATOM 6109 HD11 LEU B 144 4.240 -0.455 20.948 1.00 0.00 H ATOM 6110 HD12 LEU B 144 5.845 0.076 21.508 1.00 0.00 H ATOM 6111 HD13 LEU B 144 5.350 0.362 19.821 1.00 0.00 H ATOM 6112 H LEU B 144 5.534 -4.250 23.520 1.00 0.00 H ATOM 6113 N LYS B 145 3.451 -4.697 20.775 1.00 28.08 N ATOM 6114 CA LYS B 145 2.618 -5.308 19.743 1.00 24.42 C ATOM 6115 C LYS B 145 1.180 -5.319 20.172 1.00 26.36 C ATOM 6116 O LYS B 145 0.280 -5.033 19.347 1.00 22.03 O ATOM 6117 CB LYS B 145 3.095 -6.747 19.428 1.00 25.23 C ATOM 6118 CG LYS B 145 4.447 -6.806 18.641 1.00 26.52 C ATOM 6119 CD LYS B 145 5.138 -8.175 18.727 1.00 28.09 C ATOM 6120 CE LYS B 145 4.389 -9.279 17.951 1.00 22.09 C ATOM 6121 NZ LYS B 145 4.140 -8.895 16.507 1.00 21.59 N ATOM 6122 HA LYS B 145 2.710 -4.712 18.835 1.00 0.00 H ATOM 6123 HB2 LYS B 145 3.221 -7.281 20.370 1.00 0.00 H ATOM 6124 HB3 LYS B 145 2.328 -7.241 18.832 1.00 0.00 H ATOM 6125 HG2 LYS B 145 4.248 -6.583 17.593 1.00 0.00 H ATOM 6126 HG3 LYS B 145 5.119 -6.052 19.050 1.00 0.00 H ATOM 6127 HD2 LYS B 145 6.144 -8.083 18.317 1.00 0.00 H ATOM 6128 HD3 LYS B 145 5.200 -8.468 19.775 1.00 0.00 H ATOM 6129 HE2 LYS B 145 3.430 -9.461 18.437 1.00 0.00 H ATOM 6130 HE3 LYS B 145 4.985 -10.191 17.974 1.00 0.00 H ATOM 6131 HZ1 LYS B 145 3.565 -8.029 16.474 1.00 0.00 H ATOM 6132 HZ2 LYS B 145 5.050 -8.726 16.033 1.00 0.00 H ATOM 6133 HZ3 LYS B 145 3.635 -9.667 16.026 1.00 0.00 H ATOM 6134 H LYS B 145 4.104 -5.313 21.301 1.00 0.00 H ATOM 6135 N LEU B 146 0.943 -5.633 21.452 1.00 24.55 N ATOM 6136 CA LEU B 146 -0.453 -5.691 21.949 1.00 22.72 C ATOM 6137 C LEU B 146 -0.987 -4.297 21.884 1.00 23.42 C ATOM 6138 O LEU B 146 -2.138 -4.090 21.488 1.00 26.93 O ATOM 6139 CB LEU B 146 -0.572 -6.231 23.404 1.00 22.56 C ATOM 6140 CG LEU B 146 -0.034 -7.640 23.649 1.00 20.45 C ATOM 6141 CD1 LEU B 146 0.096 -8.022 25.153 1.00 16.82 C ATOM 6142 CD2 LEU B 146 -0.885 -8.586 22.894 1.00 19.79 C ATOM 6143 HA LEU B 146 -1.018 -6.387 21.330 1.00 0.00 H ATOM 6144 HB2 LEU B 146 -0.028 -5.549 24.057 1.00 0.00 H ATOM 6145 HB3 LEU B 146 -1.628 -6.227 23.675 1.00 0.00 H ATOM 6146 HG LEU B 146 0.994 -7.686 23.289 1.00 0.00 H ATOM 6147 HD21 LEU B 146 -1.914 -8.507 23.245 1.00 0.00 H ATOM 6148 HD22 LEU B 146 -0.842 -8.343 21.832 1.00 0.00 H ATOM 6149 HD23 LEU B 146 -0.524 -9.602 23.051 1.00 0.00 H ATOM 6150 HD11 LEU B 146 0.778 -7.329 25.645 1.00 0.00 H ATOM 6151 HD12 LEU B 146 -0.884 -7.967 25.627 1.00 0.00 H ATOM 6152 HD13 LEU B 146 0.485 -9.037 25.236 1.00 0.00 H ATOM 6153 H LEU B 146 1.735 -5.835 22.095 1.00 0.00 H ATOM 6154 N LEU B 147 -0.150 -3.320 22.255 1.00 22.29 N ATOM 6155 CA LEU B 147 -0.588 -1.913 22.185 1.00 22.14 C ATOM 6156 C LEU B 147 -0.981 -1.489 20.765 1.00 21.34 C ATOM 6157 O LEU B 147 -1.914 -0.704 20.548 1.00 21.02 O ATOM 6158 CB LEU B 147 0.459 -0.981 22.773 1.00 13.89 C ATOM 6159 CG LEU B 147 0.720 -1.140 24.278 1.00 19.53 C ATOM 6160 CD1 LEU B 147 2.049 -0.398 24.693 1.00 17.80 C ATOM 6161 CD2 LEU B 147 -0.479 -0.708 25.107 1.00 15.34 C ATOM 6162 HA LEU B 147 -1.489 -1.834 22.793 1.00 0.00 H ATOM 6163 HB2 LEU B 147 1.398 -1.158 22.249 1.00 0.00 H ATOM 6164 HB3 LEU B 147 0.133 0.044 22.595 1.00 0.00 H ATOM 6165 HG LEU B 147 0.863 -2.200 24.490 1.00 0.00 H ATOM 6166 HD21 LEU B 147 -0.699 0.340 24.906 1.00 0.00 H ATOM 6167 HD22 LEU B 147 -1.342 -1.319 24.842 1.00 0.00 H ATOM 6168 HD23 LEU B 147 -0.253 -0.836 26.165 1.00 0.00 H ATOM 6169 HD11 LEU B 147 2.888 -0.823 24.142 1.00 0.00 H ATOM 6170 HD12 LEU B 147 1.959 0.663 24.460 1.00 0.00 H ATOM 6171 HD13 LEU B 147 2.215 -0.523 25.763 1.00 0.00 H ATOM 6172 H LEU B 147 0.806 -3.552 22.592 1.00 0.00 H ATOM 6173 N GLN B 148 -0.278 -2.043 19.796 1.00 22.38 N ATOM 6174 CA GLN B 148 -0.465 -1.651 18.410 1.00 19.61 C ATOM 6175 C GLN B 148 -1.690 -2.298 17.822 1.00 24.26 C ATOM 6176 O GLN B 148 -2.504 -1.616 17.192 1.00 30.25 O ATOM 6177 CB GLN B 148 0.809 -1.954 17.624 1.00 17.37 C ATOM 6178 CG GLN B 148 1.977 -1.074 18.027 1.00 17.42 C ATOM 6179 CD GLN B 148 1.638 0.426 17.950 1.00 25.16 C ATOM 6180 OE1 GLN B 148 0.785 0.840 17.178 1.00 33.57 O ATOM 6181 NE2 GLN B 148 2.307 1.220 18.739 1.00 31.61 N ATOM 6182 HA GLN B 148 -0.643 -0.577 18.352 1.00 0.00 H ATOM 6183 HB2 GLN B 148 1.083 -2.995 17.794 1.00 0.00 H ATOM 6184 HB3 GLN B 148 0.608 -1.801 16.564 1.00 0.00 H ATOM 6185 HG2 GLN B 148 2.261 -1.317 19.051 1.00 0.00 H ATOM 6186 HG3 GLN B 148 2.815 -1.278 17.361 1.00 0.00 H ATOM 6187 HE22 GLN B 148 3.025 0.830 19.382 1.00 0.00 H ATOM 6188 HE21 GLN B 148 2.122 2.243 18.725 1.00 0.00 H ATOM 6189 H GLN B 148 0.424 -2.774 20.029 1.00 0.00 H ATOM 6190 N ILE B 149 -1.843 -3.602 18.083 1.00 28.17 N ATOM 6191 CA ILE B 149 -3.045 -4.354 17.782 1.00 23.96 C ATOM 6192 C ILE B 149 -4.308 -3.748 18.404 1.00 25.95 C ATOM 6193 O ILE B 149 -5.238 -3.432 17.683 1.00 29.98 O ATOM 6194 CB ILE B 149 -2.909 -5.814 18.220 1.00 26.72 C ATOM 6195 CG1 ILE B 149 -1.809 -6.516 17.423 1.00 28.59 C ATOM 6196 CG2 ILE B 149 -4.207 -6.574 17.971 1.00 26.38 C ATOM 6197 CD1 ILE B 149 -1.073 -7.646 18.186 1.00 26.48 C ATOM 6198 HA ILE B 149 -3.158 -4.306 16.699 1.00 0.00 H ATOM 6199 HB ILE B 149 -2.667 -5.810 19.283 1.00 0.00 H ATOM 6200 HG12 ILE B 149 -2.260 -6.948 16.530 1.00 0.00 H ATOM 6201 HG13 ILE B 149 -1.072 -5.768 17.131 1.00 0.00 H ATOM 6202 HD11 ILE B 149 -0.601 -7.233 19.077 1.00 0.00 H ATOM 6203 HD12 ILE B 149 -1.790 -8.414 18.476 1.00 0.00 H ATOM 6204 HD13 ILE B 149 -0.312 -8.083 17.540 1.00 0.00 H ATOM 6205 HG21 ILE B 149 -5.013 -6.109 18.538 1.00 0.00 H ATOM 6206 HG22 ILE B 149 -4.445 -6.545 16.908 1.00 0.00 H ATOM 6207 HG23 ILE B 149 -4.087 -7.609 18.290 1.00 0.00 H ATOM 6208 H ILE B 149 -1.051 -4.107 18.529 1.00 0.00 H ATOM 6209 N VAL B 150 -4.346 -3.589 19.731 1.00 27.94 N ATOM 6210 CA VAL B 150 -5.578 -3.203 20.444 1.00 21.52 C ATOM 6211 C VAL B 150 -5.789 -1.686 20.475 1.00 25.70 C ATOM 6212 O VAL B 150 -6.926 -1.233 20.494 1.00 22.41 O ATOM 6213 CB VAL B 150 -5.633 -3.763 21.924 1.00 23.50 C ATOM 6214 CG1 VAL B 150 -6.912 -3.287 22.676 1.00 26.16 C ATOM 6215 CG2 VAL B 150 -5.541 -5.280 21.985 1.00 17.10 C ATOM 6216 HA VAL B 150 -6.385 -3.659 19.870 1.00 0.00 H ATOM 6217 HB VAL B 150 -4.755 -3.354 22.423 1.00 0.00 H ATOM 6218 HG11 VAL B 150 -6.921 -2.198 22.721 1.00 0.00 H ATOM 6219 HG12 VAL B 150 -7.796 -3.637 22.144 1.00 0.00 H ATOM 6220 HG13 VAL B 150 -6.910 -3.694 23.687 1.00 0.00 H ATOM 6221 HG21 VAL B 150 -6.374 -5.716 21.433 1.00 0.00 H ATOM 6222 HG22 VAL B 150 -4.600 -5.604 21.541 1.00 0.00 H ATOM 6223 HG23 VAL B 150 -5.584 -5.604 23.025 1.00 0.00 H ATOM 6224 H VAL B 150 -3.476 -3.743 20.280 1.00 0.00 H ATOM 6225 N ARG B 151 -4.701 -0.918 20.504 1.00 23.85 N ATOM 6226 CA ARG B 151 -4.735 0.524 20.676 1.00 28.22 C ATOM 6227 C ARG B 151 -5.707 0.905 21.791 1.00 26.34 C ATOM 6228 O ARG B 151 -6.746 1.506 21.544 1.00 25.85 O ATOM 6229 CB ARG B 151 -5.003 1.262 19.340 1.00 35.32 C ATOM 6230 CG ARG B 151 -3.713 1.480 18.507 1.00 45.18 C ATOM 6231 CD ARG B 151 -3.902 1.364 16.962 1.00 50.18 C ATOM 6232 NE ARG B 151 -5.087 0.566 16.591 1.00 62.15 N ATOM 6233 CZ ARG B 151 -5.110 -0.513 15.805 1.00 58.28 C ATOM 6234 NH1 ARG B 151 -3.996 -0.975 15.254 1.00 58.01 N ATOM 6235 NH2 ARG B 151 -6.269 -1.128 15.578 1.00 56.05 N ATOM 6236 HA ARG B 151 -3.747 0.860 20.991 1.00 0.00 H ATOM 6237 HB2 ARG B 151 -5.704 0.672 18.750 1.00 0.00 H ATOM 6238 HB3 ARG B 151 -5.444 2.234 19.561 1.00 0.00 H ATOM 6239 HG2 ARG B 151 -3.331 2.477 18.728 1.00 0.00 H ATOM 6240 HG3 ARG B 151 -2.980 0.735 18.816 1.00 0.00 H ATOM 6241 HD2 ARG B 151 -3.016 0.892 16.537 1.00 0.00 H ATOM 6242 HD3 ARG B 151 -4.013 2.366 16.548 1.00 0.00 H ATOM 6243 HE ARG B 151 -5.999 0.877 16.983 1.00 0.00 H ATOM 6244 HH12 ARG B 151 -4.028 -1.816 14.644 1.00 0.00 H ATOM 6245 HH11 ARG B 151 -3.090 -0.496 15.432 1.00 0.00 H ATOM 6246 HH22 ARG B 151 -6.300 -1.969 14.968 1.00 0.00 H ATOM 6247 HH21 ARG B 151 -7.143 -0.767 16.011 1.00 0.00 H ATOM 6248 H ARG B 151 -3.774 -1.377 20.397 1.00 0.00 H ATOM 6249 N PRO B 152 -5.363 0.565 23.052 1.00 25.91 N ATOM 6250 CA PRO B 152 -6.257 0.948 24.117 1.00 19.96 C ATOM 6251 C PRO B 152 -6.005 2.405 24.549 1.00 17.74 C ATOM 6252 O PRO B 152 -4.947 2.921 24.289 1.00 18.63 O ATOM 6253 CB PRO B 152 -5.826 0.012 25.253 1.00 22.57 C ATOM 6254 CG PRO B 152 -4.369 -0.215 25.002 1.00 15.06 C ATOM 6255 CD PRO B 152 -4.163 -0.141 23.558 1.00 21.18 C ATOM 6256 HA PRO B 152 -7.308 0.879 23.838 1.00 0.00 H ATOM 6257 HD3 PRO B 152 -3.258 0.420 23.325 1.00 0.00 H ATOM 6258 HD2 PRO B 152 -4.091 -1.139 23.126 1.00 0.00 H ATOM 6259 HG3 PRO B 152 -4.075 -1.197 25.372 1.00 0.00 H ATOM 6260 HG2 PRO B 152 -3.779 0.552 25.504 1.00 0.00 H ATOM 6261 HB2 PRO B 152 -5.984 0.482 26.224 1.00 0.00 H ATOM 6262 HB3 PRO B 152 -6.378 -0.927 25.212 1.00 0.00 H ATOM 6263 N ASP B 153 -6.959 3.013 25.245 1.00 15.00 N ATOM 6264 CA ASP B 153 -6.736 4.255 25.987 1.00 24.89 C ATOM 6265 C ASP B 153 -5.864 4.013 27.225 1.00 27.43 C ATOM 6266 O ASP B 153 -5.011 4.840 27.570 1.00 33.05 O ATOM 6267 CB ASP B 153 -8.086 4.886 26.342 1.00 23.73 C ATOM 6268 CG ASP B 153 -8.944 5.093 25.102 1.00 31.49 C ATOM 6269 OD1 ASP B 153 -8.752 6.120 24.485 1.00 37.58 O ATOM 6270 OD2 ASP B 153 -9.747 4.223 24.678 1.00 41.14 O ATOM 6271 HA ASP B 153 -6.187 4.957 25.359 1.00 0.00 H ATOM 6272 HB2 ASP B 153 -8.614 4.230 27.034 1.00 0.00 H ATOM 6273 HB3 ASP B 153 -7.913 5.851 26.819 1.00 0.00 H ATOM 6274 H ASP B 153 -7.908 2.587 25.264 1.00 0.00 H ATOM 6275 N ARG B 154 -6.043 2.859 27.863 1.00 22.97 N ATOM 6276 CA ARG B 154 -5.303 2.553 29.056 1.00 22.58 C ATOM 6277 C ARG B 154 -4.885 1.099 29.125 1.00 27.25 C ATOM 6278 O ARG B 154 -5.555 0.196 28.592 1.00 24.85 O ATOM 6279 CB ARG B 154 -6.095 2.938 30.296 1.00 27.91 C ATOM 6280 CG ARG B 154 -6.541 4.394 30.305 1.00 21.59 C ATOM 6281 CD ARG B 154 -7.265 4.750 31.586 1.00 25.37 C ATOM 6282 NE ARG B 154 -8.052 5.972 31.429 1.00 33.50 N ATOM 6283 CZ ARG B 154 -8.795 6.527 32.386 1.00 29.92 C ATOM 6284 NH1 ARG B 154 -8.877 5.983 33.589 1.00 33.88 N ATOM 6285 NH2 ARG B 154 -9.450 7.637 32.133 1.00 28.62 N ATOM 6286 HA ARG B 154 -4.390 3.147 29.019 1.00 0.00 H ATOM 6287 HB2 ARG B 154 -6.981 2.305 30.350 1.00 0.00 H ATOM 6288 HB3 ARG B 154 -5.471 2.763 31.172 1.00 0.00 H ATOM 6289 HG2 ARG B 154 -5.664 5.033 30.205 1.00 0.00 H ATOM 6290 HG3 ARG B 154 -7.210 4.564 29.462 1.00 0.00 H ATOM 6291 HD2 ARG B 154 -6.532 4.899 32.379 1.00 0.00 H ATOM 6292 HD3 ARG B 154 -7.931 3.931 31.857 1.00 0.00 H ATOM 6293 HE ARG B 154 -8.030 6.443 30.502 1.00 0.00 H ATOM 6294 HH12 ARG B 154 -9.462 6.430 34.323 1.00 0.00 H ATOM 6295 HH11 ARG B 154 -8.357 5.108 33.801 1.00 0.00 H ATOM 6296 HH22 ARG B 154 -10.032 8.077 32.874 1.00 0.00 H ATOM 6297 HH21 ARG B 154 -9.386 8.075 31.192 1.00 0.00 H ATOM 6298 H ARG B 154 -6.728 2.169 27.493 1.00 0.00 H ATOM 6299 N VAL B 155 -3.722 0.903 29.743 1.00 26.91 N ATOM 6300 CA VAL B 155 -3.139 -0.395 29.899 1.00 26.29 C ATOM 6301 C VAL B 155 -2.778 -0.589 31.365 1.00 23.90 C ATOM 6302 O VAL B 155 -2.212 0.312 31.994 1.00 26.45 O ATOM 6303 CB VAL B 155 -1.954 -0.631 28.896 1.00 26.47 C ATOM 6304 CG1 VAL B 155 -0.782 0.295 29.146 1.00 23.29 C ATOM 6305 CG2 VAL B 155 -1.518 -2.140 28.871 1.00 22.39 C ATOM 6306 HA VAL B 155 -3.859 -1.170 29.634 1.00 0.00 H ATOM 6307 HB VAL B 155 -2.328 -0.380 27.903 1.00 0.00 H ATOM 6308 HG11 VAL B 155 -1.109 1.329 29.040 1.00 0.00 H ATOM 6309 HG12 VAL B 155 -0.403 0.134 30.155 1.00 0.00 H ATOM 6310 HG13 VAL B 155 0.006 0.085 28.423 1.00 0.00 H ATOM 6311 HG21 VAL B 155 -1.194 -2.440 29.868 1.00 0.00 H ATOM 6312 HG22 VAL B 155 -2.362 -2.756 28.562 1.00 0.00 H ATOM 6313 HG23 VAL B 155 -0.696 -2.268 28.167 1.00 0.00 H ATOM 6314 H VAL B 155 -3.217 1.726 30.128 1.00 0.00 H ATOM 6315 N PHE B 156 -3.133 -1.767 31.874 1.00 22.65 N ATOM 6316 CA PHE B 156 -3.081 -2.141 33.305 1.00 22.71 C ATOM 6317 C PHE B 156 -2.007 -3.186 33.644 1.00 23.99 C ATOM 6318 O PHE B 156 -1.956 -4.289 33.044 1.00 21.82 O ATOM 6319 CB PHE B 156 -4.490 -2.617 33.785 1.00 23.93 C ATOM 6320 CG PHE B 156 -5.500 -1.531 33.748 1.00 17.81 C ATOM 6321 CD1 PHE B 156 -6.184 -1.235 32.549 1.00 20.89 C ATOM 6322 CD2 PHE B 156 -5.694 -0.727 34.848 1.00 21.17 C ATOM 6323 CE1 PHE B 156 -7.088 -0.179 32.476 1.00 21.23 C ATOM 6324 CE2 PHE B 156 -6.584 0.364 34.804 1.00 22.57 C ATOM 6325 CZ PHE B 156 -7.285 0.645 33.612 1.00 27.48 C ATOM 6326 HA PHE B 156 -2.789 -1.241 33.845 1.00 0.00 H ATOM 6327 HB2 PHE B 156 -4.824 -3.428 33.138 1.00 0.00 H ATOM 6328 HB3 PHE B 156 -4.406 -2.982 34.809 1.00 0.00 H ATOM 6329 HD2 PHE B 156 -5.150 -0.938 35.769 1.00 0.00 H ATOM 6330 HE2 PHE B 156 -6.730 0.988 35.686 1.00 0.00 H ATOM 6331 HZ PHE B 156 -7.973 1.489 33.565 1.00 0.00 H ATOM 6332 HE1 PHE B 156 -7.639 0.012 31.555 1.00 0.00 H ATOM 6333 HD1 PHE B 156 -6.001 -1.845 31.664 1.00 0.00 H ATOM 6334 H PHE B 156 -3.477 -2.487 31.208 1.00 0.00 H ATOM 6335 N PHE B 157 -1.139 -2.827 34.597 1.00 21.60 N ATOM 6336 CA PHE B 157 -0.075 -3.751 35.031 1.00 16.81 C ATOM 6337 C PHE B 157 -0.006 -3.787 36.520 1.00 16.02 C ATOM 6338 O PHE B 157 -0.276 -2.796 37.176 1.00 27.42 O ATOM 6339 CB PHE B 157 1.276 -3.361 34.433 1.00 19.95 C ATOM 6340 CG PHE B 157 1.362 -3.586 32.952 1.00 20.87 C ATOM 6341 CD1 PHE B 157 1.548 -4.900 32.435 1.00 13.09 C ATOM 6342 CD2 PHE B 157 1.253 -2.498 32.071 1.00 14.33 C ATOM 6343 CE1 PHE B 157 1.642 -5.147 31.054 1.00 13.90 C ATOM 6344 CE2 PHE B 157 1.322 -2.720 30.652 1.00 23.96 C ATOM 6345 CZ PHE B 157 1.510 -4.065 30.148 1.00 19.36 C ATOM 6346 HA PHE B 157 -0.318 -4.749 34.667 1.00 0.00 H ATOM 6347 HB2 PHE B 157 1.450 -2.304 34.632 1.00 0.00 H ATOM 6348 HB3 PHE B 157 2.052 -3.953 34.918 1.00 0.00 H ATOM 6349 HD2 PHE B 157 1.117 -1.489 32.461 1.00 0.00 H ATOM 6350 HE2 PHE B 157 1.233 -1.882 29.960 1.00 0.00 H ATOM 6351 HZ PHE B 157 1.550 -4.245 29.074 1.00 0.00 H ATOM 6352 HE1 PHE B 157 1.814 -6.158 30.685 1.00 0.00 H ATOM 6353 HD1 PHE B 157 1.619 -5.737 33.129 1.00 0.00 H ATOM 6354 H PHE B 157 -1.216 -1.887 35.036 1.00 0.00 H ATOM 6355 N GLY B 158 0.260 -4.957 37.066 1.00 20.23 N ATOM 6356 CA GLY B 158 0.385 -5.106 38.493 1.00 17.75 C ATOM 6357 C GLY B 158 1.753 -4.599 38.938 1.00 19.94 C ATOM 6358 O GLY B 158 2.732 -4.686 38.214 1.00 22.51 O ATOM 6359 HA3 GLY B 158 0.283 -6.158 38.759 1.00 0.00 H ATOM 6360 HA2 GLY B 158 -0.396 -4.529 38.989 1.00 0.00 H ATOM 6361 H GLY B 158 0.382 -5.789 36.454 1.00 0.00 H ATOM 6362 N GLU B 159 1.793 -4.104 40.160 1.00 22.19 N ATOM 6363 CA GLU B 159 2.982 -3.559 40.785 1.00 26.07 C ATOM 6364 C GLU B 159 3.853 -4.648 41.338 1.00 24.37 C ATOM 6365 O GLU B 159 5.026 -4.419 41.549 1.00 28.23 O ATOM 6366 CB GLU B 159 2.568 -2.640 41.933 1.00 22.67 C ATOM 6367 CG GLU B 159 2.366 -1.242 41.532 1.00 25.99 C ATOM 6368 CD GLU B 159 1.912 -0.418 42.674 1.00 31.96 C ATOM 6369 OE1 GLU B 159 1.961 -0.895 43.838 1.00 35.97 O ATOM 6370 OE2 GLU B 159 1.502 0.720 42.404 1.00 41.23 O ATOM 6371 HA GLU B 159 3.543 -3.010 40.029 1.00 0.00 H ATOM 6372 HB2 GLU B 159 1.635 -3.015 42.354 1.00 0.00 H ATOM 6373 HB3 GLU B 159 3.347 -2.670 42.695 1.00 0.00 H ATOM 6374 HG2 GLU B 159 3.307 -0.840 41.155 1.00 0.00 H ATOM 6375 HG3 GLU B 159 1.614 -1.203 40.744 1.00 0.00 H ATOM 6376 H GLU B 159 0.912 -4.105 40.712 1.00 0.00 H ATOM 6377 N LYS B 160 3.265 -5.821 41.586 1.00 29.03 N ATOM 6378 CA LYS B 160 4.044 -7.020 41.914 1.00 36.48 C ATOM 6379 C LYS B 160 5.323 -7.115 41.067 1.00 33.98 C ATOM 6380 O LYS B 160 6.426 -7.275 41.606 1.00 39.99 O ATOM 6381 CB LYS B 160 3.215 -8.316 41.751 1.00 39.33 C ATOM 6382 CG LYS B 160 4.144 -9.533 41.716 1.00 42.24 C ATOM 6383 CD LYS B 160 3.541 -10.762 42.267 1.00 43.80 C ATOM 6384 CE LYS B 160 4.593 -11.524 43.026 1.00 43.10 C ATOM 6385 NZ LYS B 160 5.809 -11.728 42.193 1.00 44.32 N ATOM 6386 HA LYS B 160 4.324 -6.922 42.963 1.00 0.00 H ATOM 6387 HB2 LYS B 160 2.526 -8.412 42.590 1.00 0.00 H ATOM 6388 HB3 LYS B 160 2.648 -8.268 40.821 1.00 0.00 H ATOM 6389 HG2 LYS B 160 4.423 -9.722 40.679 1.00 0.00 H ATOM 6390 HG3 LYS B 160 5.038 -9.300 42.295 1.00 0.00 H ATOM 6391 HD2 LYS B 160 2.723 -10.499 42.938 1.00 0.00 H ATOM 6392 HD3 LYS B 160 3.158 -11.378 41.454 1.00 0.00 H ATOM 6393 HE2 LYS B 160 4.191 -12.495 43.315 1.00 0.00 H ATOM 6394 HE3 LYS B 160 4.864 -10.964 43.921 1.00 0.00 H ATOM 6395 HZ1 LYS B 160 5.557 -12.266 41.340 1.00 0.00 H ATOM 6396 HZ2 LYS B 160 6.199 -10.804 41.919 1.00 0.00 H ATOM 6397 HZ3 LYS B 160 6.518 -12.256 42.741 1.00 0.00 H ATOM 6398 H LYS B 160 2.228 -5.886 41.546 1.00 0.00 H ATOM 6399 N ASP B 161 5.150 -7.026 39.745 1.00 35.20 N ATOM 6400 CA ASP B 161 6.279 -6.940 38.808 1.00 34.48 C ATOM 6401 C ASP B 161 6.618 -5.500 38.534 1.00 31.53 C ATOM 6402 O ASP B 161 6.308 -4.976 37.467 1.00 35.16 O ATOM 6403 CB ASP B 161 5.928 -7.611 37.497 1.00 34.58 C ATOM 6404 CG ASP B 161 5.740 -9.089 37.651 1.00 40.02 C ATOM 6405 OD1 ASP B 161 6.741 -9.769 38.026 1.00 39.52 O ATOM 6406 OD2 ASP B 161 4.604 -9.547 37.390 1.00 36.38 O ATOM 6407 HA ASP B 161 7.134 -7.442 39.261 1.00 0.00 H ATOM 6408 HB2 ASP B 161 5.003 -7.177 37.117 1.00 0.00 H ATOM 6409 HB3 ASP B 161 6.733 -7.432 36.784 1.00 0.00 H ATOM 6410 H ASP B 161 4.182 -7.017 39.366 1.00 0.00 H ATOM 6411 N TYR B 162 7.262 -4.876 39.505 1.00 25.20 N ATOM 6412 CA TYR B 162 7.493 -3.447 39.494 1.00 30.27 C ATOM 6413 C TYR B 162 8.578 -2.923 38.507 1.00 27.90 C ATOM 6414 O TYR B 162 8.387 -1.889 37.862 1.00 20.20 O ATOM 6415 CB TYR B 162 7.775 -2.976 40.922 1.00 24.35 C ATOM 6416 CG TYR B 162 7.812 -1.487 41.042 1.00 24.44 C ATOM 6417 CD1 TYR B 162 6.647 -0.762 41.303 1.00 21.15 C ATOM 6418 CD2 TYR B 162 9.006 -0.792 40.901 1.00 18.85 C ATOM 6419 CE1 TYR B 162 6.677 0.623 41.427 1.00 17.80 C ATOM 6420 CE2 TYR B 162 9.026 0.590 41.004 1.00 21.03 C ATOM 6421 CZ TYR B 162 7.853 1.282 41.277 1.00 17.82 C ATOM 6422 OH TYR B 162 7.868 2.660 41.405 1.00 22.19 O ATOM 6423 HA TYR B 162 6.574 -3.010 39.103 1.00 0.00 H ATOM 6424 HB3 TYR B 162 8.739 -3.375 41.237 1.00 0.00 H ATOM 6425 HB2 TYR B 162 6.993 -3.359 41.577 1.00 0.00 H ATOM 6426 HD2 TYR B 162 9.931 -1.335 40.709 1.00 0.00 H ATOM 6427 HE2 TYR B 162 9.961 1.133 40.871 1.00 0.00 H ATOM 6428 HE1 TYR B 162 5.762 1.175 41.643 1.00 0.00 H ATOM 6429 HD1 TYR B 162 5.700 -1.290 41.411 1.00 0.00 H ATOM 6430 HH TYR B 162 8.191 3.065 40.561 1.00 0.00 H ATOM 6431 H TYR B 162 7.617 -5.433 40.308 1.00 0.00 H ATOM 6432 N GLN B 163 9.724 -3.598 38.454 1.00 28.13 N ATOM 6433 CA GLN B 163 10.723 -3.349 37.407 1.00 29.49 C ATOM 6434 C GLN B 163 10.092 -3.436 36.025 1.00 29.50 C ATOM 6435 O GLN B 163 10.320 -2.583 35.179 1.00 30.26 O ATOM 6436 CB GLN B 163 11.855 -4.364 37.461 1.00 25.32 C ATOM 6437 CG GLN B 163 12.958 -4.078 36.441 1.00 23.40 C ATOM 6438 CD GLN B 163 14.220 -4.897 36.718 1.00 29.68 C ATOM 6439 OE1 GLN B 163 14.159 -5.936 37.389 1.00 22.09 O ATOM 6440 NE2 GLN B 163 15.364 -4.443 36.190 1.00 26.53 N ATOM 6441 HA GLN B 163 11.116 -2.348 37.586 1.00 0.00 H ATOM 6442 HB2 GLN B 163 12.291 -4.347 38.460 1.00 0.00 H ATOM 6443 HB3 GLN B 163 11.445 -5.354 37.262 1.00 0.00 H ATOM 6444 HG2 GLN B 163 12.590 -4.324 35.445 1.00 0.00 H ATOM 6445 HG3 GLN B 163 13.210 -3.018 36.482 1.00 0.00 H ATOM 6446 HE22 GLN B 163 15.367 -3.565 35.633 1.00 0.00 H ATOM 6447 HE21 GLN B 163 16.249 -4.969 36.337 1.00 0.00 H ATOM 6448 H GLN B 163 9.917 -4.322 39.175 1.00 0.00 H ATOM 6449 N GLN B 164 9.296 -4.470 35.804 1.00 23.43 N ATOM 6450 CA GLN B 164 8.564 -4.534 34.581 1.00 24.97 C ATOM 6451 C GLN B 164 7.696 -3.260 34.282 1.00 26.73 C ATOM 6452 O GLN B 164 7.801 -2.708 33.201 1.00 24.30 O ATOM 6453 CB GLN B 164 7.724 -5.797 34.542 1.00 21.17 C ATOM 6454 CG GLN B 164 6.774 -5.767 33.381 1.00 30.85 C ATOM 6455 CD GLN B 164 5.895 -6.924 33.376 1.00 33.60 C ATOM 6456 OE1 GLN B 164 6.356 -8.033 33.085 1.00 31.44 O ATOM 6457 NE2 GLN B 164 4.602 -6.715 33.743 1.00 26.48 N ATOM 6458 HA GLN B 164 9.304 -4.564 33.781 1.00 0.00 H ATOM 6459 HB2 GLN B 164 8.381 -6.661 34.445 1.00 0.00 H ATOM 6460 HB3 GLN B 164 7.155 -5.877 35.468 1.00 0.00 H ATOM 6461 HG2 GLN B 164 6.168 -4.863 33.443 1.00 0.00 H ATOM 6462 HG3 GLN B 164 7.348 -5.755 32.455 1.00 0.00 H ATOM 6463 HE22 GLN B 164 4.276 -5.755 33.976 1.00 0.00 H ATOM 6464 HE21 GLN B 164 3.939 -7.515 33.791 1.00 0.00 H ATOM 6465 H GLN B 164 9.205 -5.226 36.512 1.00 0.00 H ATOM 6466 N LEU B 165 6.834 -2.840 35.213 1.00 28.26 N ATOM 6467 CA LEU B 165 6.031 -1.630 35.067 1.00 26.13 C ATOM 6468 C LEU B 165 6.861 -0.374 34.736 1.00 24.69 C ATOM 6469 O LEU B 165 6.510 0.436 33.841 1.00 24.88 O ATOM 6470 CB LEU B 165 5.200 -1.412 36.338 1.00 31.38 C ATOM 6471 CG LEU B 165 4.289 -0.175 36.565 1.00 27.19 C ATOM 6472 CD1 LEU B 165 3.217 0.032 35.464 1.00 22.74 C ATOM 6473 CD2 LEU B 165 3.632 -0.305 37.942 1.00 22.68 C ATOM 6474 HA LEU B 165 5.375 -1.783 34.210 1.00 0.00 H ATOM 6475 HB2 LEU B 165 4.548 -2.282 36.421 1.00 0.00 H ATOM 6476 HB3 LEU B 165 5.912 -1.413 37.163 1.00 0.00 H ATOM 6477 HG LEU B 165 4.922 0.711 36.514 1.00 0.00 H ATOM 6478 HD21 LEU B 165 3.037 -1.218 37.975 1.00 0.00 H ATOM 6479 HD22 LEU B 165 4.405 -0.346 38.710 1.00 0.00 H ATOM 6480 HD23 LEU B 165 2.988 0.556 38.119 1.00 0.00 H ATOM 6481 HD11 LEU B 165 3.709 0.167 34.501 1.00 0.00 H ATOM 6482 HD12 LEU B 165 2.567 -0.842 35.422 1.00 0.00 H ATOM 6483 HD13 LEU B 165 2.624 0.916 35.698 1.00 0.00 H ATOM 6484 H LEU B 165 6.731 -3.402 36.082 1.00 0.00 H ATOM 6485 N VAL B 166 7.971 -0.217 35.439 1.00 22.75 N ATOM 6486 CA VAL B 166 8.873 0.921 35.229 1.00 20.05 C ATOM 6487 C VAL B 166 9.394 0.931 33.792 1.00 22.79 C ATOM 6488 O VAL B 166 9.353 1.971 33.108 1.00 19.87 O ATOM 6489 CB VAL B 166 10.015 0.936 36.306 1.00 21.23 C ATOM 6490 CG1 VAL B 166 11.168 1.876 35.918 1.00 16.87 C ATOM 6491 CG2 VAL B 166 9.428 1.332 37.699 1.00 15.37 C ATOM 6492 HA VAL B 166 8.318 1.850 35.365 1.00 0.00 H ATOM 6493 HB VAL B 166 10.430 -0.070 36.361 1.00 0.00 H ATOM 6494 HG11 VAL B 166 11.599 1.549 34.972 1.00 0.00 H ATOM 6495 HG12 VAL B 166 10.787 2.892 35.814 1.00 0.00 H ATOM 6496 HG13 VAL B 166 11.932 1.851 36.695 1.00 0.00 H ATOM 6497 HG21 VAL B 166 8.981 2.324 37.635 1.00 0.00 H ATOM 6498 HG22 VAL B 166 8.668 0.608 37.991 1.00 0.00 H ATOM 6499 HG23 VAL B 166 10.227 1.340 38.440 1.00 0.00 H ATOM 6500 H VAL B 166 8.212 -0.923 36.164 1.00 0.00 H ATOM 6501 N LEU B 167 9.817 -0.242 33.313 1.00 20.43 N ATOM 6502 CA LEU B 167 10.331 -0.381 31.960 1.00 19.80 C ATOM 6503 C LEU B 167 9.278 -0.179 30.856 1.00 20.04 C ATOM 6504 O LEU B 167 9.560 0.376 29.803 1.00 23.87 O ATOM 6505 CB LEU B 167 11.058 -1.697 31.811 1.00 20.02 C ATOM 6506 CG LEU B 167 12.464 -1.792 32.421 1.00 20.21 C ATOM 6507 CD1 LEU B 167 12.841 -3.290 32.523 1.00 15.87 C ATOM 6508 CD2 LEU B 167 13.547 -1.033 31.654 1.00 10.99 C ATOM 6509 HA LEU B 167 11.037 0.436 31.815 1.00 0.00 H ATOM 6510 HB2 LEU B 167 10.444 -2.467 32.279 1.00 0.00 H ATOM 6511 HB3 LEU B 167 11.148 -1.904 30.745 1.00 0.00 H ATOM 6512 HG LEU B 167 12.421 -1.312 33.399 1.00 0.00 H ATOM 6513 HD21 LEU B 167 13.616 -1.427 30.640 1.00 0.00 H ATOM 6514 HD22 LEU B 167 13.290 0.026 31.617 1.00 0.00 H ATOM 6515 HD23 LEU B 167 14.504 -1.159 32.160 1.00 0.00 H ATOM 6516 HD11 LEU B 167 12.119 -3.803 33.159 1.00 0.00 H ATOM 6517 HD12 LEU B 167 12.831 -3.734 31.528 1.00 0.00 H ATOM 6518 HD13 LEU B 167 13.838 -3.384 32.954 1.00 0.00 H ATOM 6519 H LEU B 167 9.778 -1.081 33.926 1.00 0.00 H ATOM 6520 N ILE B 168 8.062 -0.633 31.098 1.00 22.38 N ATOM 6521 CA ILE B 168 6.901 -0.321 30.237 1.00 19.23 C ATOM 6522 C ILE B 168 6.588 1.195 30.176 1.00 21.74 C ATOM 6523 O ILE B 168 6.256 1.722 29.104 1.00 23.03 O ATOM 6524 CB ILE B 168 5.642 -1.050 30.753 1.00 18.88 C ATOM 6525 CG1 ILE B 168 5.887 -2.557 30.891 1.00 23.34 C ATOM 6526 CG2 ILE B 168 4.398 -0.723 29.946 1.00 7.91 C ATOM 6527 CD1 ILE B 168 5.359 -3.341 29.829 1.00 25.56 C ATOM 6528 HA ILE B 168 7.167 -0.658 29.235 1.00 0.00 H ATOM 6529 HB ILE B 168 5.440 -0.669 31.754 1.00 0.00 H ATOM 6530 HG12 ILE B 168 6.963 -2.724 30.935 1.00 0.00 H ATOM 6531 HG13 ILE B 168 5.430 -2.892 31.822 1.00 0.00 H ATOM 6532 HD11 ILE B 168 4.280 -3.199 29.776 1.00 0.00 H ATOM 6533 HD12 ILE B 168 5.814 -3.030 28.889 1.00 0.00 H ATOM 6534 HD13 ILE B 168 5.580 -4.393 30.011 1.00 0.00 H ATOM 6535 HG21 ILE B 168 4.206 0.349 29.995 1.00 0.00 H ATOM 6536 HG22 ILE B 168 4.552 -1.018 28.908 1.00 0.00 H ATOM 6537 HG23 ILE B 168 3.547 -1.265 30.357 1.00 0.00 H ATOM 6538 H ILE B 168 7.914 -1.237 31.932 1.00 0.00 H ATOM 6539 N ARG B 169 6.661 1.880 31.319 1.00 19.63 N ATOM 6540 CA ARG B 169 6.474 3.328 31.339 1.00 19.97 C ATOM 6541 C ARG B 169 7.540 4.023 30.520 1.00 21.53 C ATOM 6542 O ARG B 169 7.246 5.008 29.862 1.00 20.17 O ATOM 6543 CB ARG B 169 6.562 3.843 32.742 1.00 26.60 C ATOM 6544 CG ARG B 169 5.437 3.389 33.589 1.00 29.69 C ATOM 6545 CD ARG B 169 5.247 4.391 34.647 1.00 33.03 C ATOM 6546 NE ARG B 169 4.506 3.853 35.771 1.00 36.93 N ATOM 6547 CZ ARG B 169 3.206 4.004 35.944 1.00 37.99 C ATOM 6548 NH1 ARG B 169 2.465 4.682 35.032 1.00 35.35 N ATOM 6549 NH2 ARG B 169 2.661 3.479 37.037 1.00 35.14 N ATOM 6550 HA ARG B 169 5.491 3.536 30.917 1.00 0.00 H ATOM 6551 HB2 ARG B 169 7.495 3.493 33.184 1.00 0.00 H ATOM 6552 HB3 ARG B 169 6.560 4.933 32.714 1.00 0.00 H ATOM 6553 HG2 ARG B 169 4.531 3.304 32.990 1.00 0.00 H ATOM 6554 HG3 ARG B 169 5.671 2.421 34.031 1.00 0.00 H ATOM 6555 HD2 ARG B 169 4.699 5.239 34.236 1.00 0.00 H ATOM 6556 HD3 ARG B 169 6.224 4.726 34.996 1.00 0.00 H ATOM 6557 HE ARG B 169 5.033 3.313 36.487 1.00 0.00 H ATOM 6558 HH12 ARG B 169 1.441 4.797 35.175 1.00 0.00 H ATOM 6559 HH11 ARG B 169 2.921 5.087 34.189 1.00 0.00 H ATOM 6560 HH22 ARG B 169 1.640 3.578 37.208 1.00 0.00 H ATOM 6561 HH21 ARG B 169 3.256 2.970 37.721 1.00 0.00 H ATOM 6562 H ARG B 169 6.854 1.376 32.208 1.00 0.00 H ATOM 6563 N GLN B 170 8.770 3.494 30.575 1.00 20.62 N ATOM 6564 CA GLN B 170 9.882 3.946 29.721 1.00 20.89 C ATOM 6565 C GLN B 170 9.643 3.654 28.238 1.00 18.57 C ATOM 6566 O GLN B 170 9.871 4.509 27.407 1.00 27.08 O ATOM 6567 CB GLN B 170 11.211 3.300 30.126 1.00 18.14 C ATOM 6568 CG GLN B 170 11.742 3.710 31.501 1.00 17.72 C ATOM 6569 CD GLN B 170 13.128 3.159 31.790 1.00 22.06 C ATOM 6570 OE1 GLN B 170 13.718 2.412 30.983 1.00 22.33 O ATOM 6571 NE2 GLN B 170 13.654 3.509 32.949 1.00 13.90 N ATOM 6572 HA GLN B 170 9.933 5.025 29.868 1.00 0.00 H ATOM 6573 HB2 GLN B 170 11.075 2.219 30.126 1.00 0.00 H ATOM 6574 HB3 GLN B 170 11.959 3.571 29.381 1.00 0.00 H ATOM 6575 HG2 GLN B 170 11.784 4.798 31.547 1.00 0.00 H ATOM 6576 HG3 GLN B 170 11.055 3.341 32.263 1.00 0.00 H ATOM 6577 HE22 GLN B 170 13.127 4.134 33.592 1.00 0.00 H ATOM 6578 HE21 GLN B 170 14.596 3.160 33.219 1.00 0.00 H ATOM 6579 H GLN B 170 8.948 2.727 31.254 1.00 0.00 H ATOM 6580 N LEU B 171 9.194 2.454 27.897 1.00 20.34 N ATOM 6581 CA LEU B 171 8.738 2.176 26.537 1.00 19.02 C ATOM 6582 C LEU B 171 7.798 3.273 26.019 1.00 17.69 C ATOM 6583 O LEU B 171 8.055 3.881 25.004 1.00 22.06 O ATOM 6584 CB LEU B 171 8.024 0.835 26.537 1.00 21.66 C ATOM 6585 CG LEU B 171 7.315 0.230 25.308 1.00 26.20 C ATOM 6586 CD1 LEU B 171 8.288 -0.148 24.179 1.00 16.37 C ATOM 6587 CD2 LEU B 171 6.528 -1.058 25.770 1.00 17.63 C ATOM 6588 HA LEU B 171 9.601 2.151 25.872 1.00 0.00 H ATOM 6589 HB2 LEU B 171 8.774 0.102 26.835 1.00 0.00 H ATOM 6590 HB3 LEU B 171 7.260 0.908 27.312 1.00 0.00 H ATOM 6591 HG LEU B 171 6.643 0.988 24.906 1.00 0.00 H ATOM 6592 HD21 LEU B 171 7.229 -1.780 26.189 1.00 0.00 H ATOM 6593 HD22 LEU B 171 5.793 -0.782 26.526 1.00 0.00 H ATOM 6594 HD23 LEU B 171 6.020 -1.499 24.912 1.00 0.00 H ATOM 6595 HD11 LEU B 171 8.823 0.743 23.849 1.00 0.00 H ATOM 6596 HD12 LEU B 171 9.001 -0.886 24.547 1.00 0.00 H ATOM 6597 HD13 LEU B 171 7.728 -0.568 23.344 1.00 0.00 H ATOM 6598 H LEU B 171 9.166 1.697 28.610 1.00 0.00 H ATOM 6599 N VAL B 172 6.721 3.516 26.762 1.00 15.84 N ATOM 6600 CA VAL B 172 5.649 4.413 26.402 1.00 20.95 C ATOM 6601 C VAL B 172 6.134 5.852 26.158 1.00 19.68 C ATOM 6602 O VAL B 172 5.806 6.464 25.152 1.00 18.68 O ATOM 6603 CB VAL B 172 4.509 4.333 27.482 1.00 20.24 C ATOM 6604 CG1 VAL B 172 3.549 5.463 27.356 1.00 9.47 C ATOM 6605 CG2 VAL B 172 3.752 3.011 27.345 1.00 23.82 C ATOM 6606 HA VAL B 172 5.239 4.089 25.445 1.00 0.00 H ATOM 6607 HB VAL B 172 4.982 4.395 28.462 1.00 0.00 H ATOM 6608 HG11 VAL B 172 4.080 6.406 27.487 1.00 0.00 H ATOM 6609 HG12 VAL B 172 3.088 5.438 26.368 1.00 0.00 H ATOM 6610 HG13 VAL B 172 2.778 5.370 28.121 1.00 0.00 H ATOM 6611 HG21 VAL B 172 3.310 2.948 26.350 1.00 0.00 H ATOM 6612 HG22 VAL B 172 4.444 2.181 27.490 1.00 0.00 H ATOM 6613 HG23 VAL B 172 2.965 2.965 28.097 1.00 0.00 H ATOM 6614 H VAL B 172 6.646 3.021 27.673 1.00 0.00 H ATOM 6615 N ALA B 173 6.923 6.351 27.086 1.00 16.10 N ATOM 6616 CA ALA B 173 7.556 7.658 26.986 1.00 17.75 C ATOM 6617 C ALA B 173 8.498 7.784 25.791 1.00 20.12 C ATOM 6618 O ALA B 173 8.494 8.796 25.074 1.00 24.03 O ATOM 6619 CB ALA B 173 8.331 7.962 28.282 1.00 8.46 C ATOM 6620 HA ALA B 173 6.754 8.381 26.837 1.00 0.00 H ATOM 6621 HB1 ALA B 173 7.641 7.958 29.126 1.00 0.00 H ATOM 6622 HB2 ALA B 173 9.096 7.201 28.433 1.00 0.00 H ATOM 6623 HB3 ALA B 173 8.802 8.941 28.201 1.00 0.00 H ATOM 6624 H ALA B 173 7.104 5.781 27.937 1.00 0.00 H ATOM 6625 N ASP B 174 9.329 6.767 25.633 1.00 17.11 N ATOM 6626 CA ASP B 174 10.455 6.775 24.741 1.00 17.43 C ATOM 6627 C ASP B 174 10.028 6.607 23.325 1.00 22.16 C ATOM 6628 O ASP B 174 10.650 7.176 22.432 1.00 23.86 O ATOM 6629 CB ASP B 174 11.407 5.634 25.113 1.00 22.07 C ATOM 6630 CG ASP B 174 12.306 5.981 26.307 1.00 23.29 C ATOM 6631 OD1 ASP B 174 12.209 7.094 26.849 1.00 23.44 O ATOM 6632 OD2 ASP B 174 13.125 5.138 26.695 1.00 24.24 O ATOM 6633 HA ASP B 174 10.956 7.738 24.839 1.00 0.00 H ATOM 6634 HB2 ASP B 174 10.816 4.754 25.365 1.00 0.00 H ATOM 6635 HB3 ASP B 174 12.039 5.412 24.253 1.00 0.00 H ATOM 6636 H ASP B 174 9.156 5.906 26.190 1.00 0.00 H ATOM 6637 N PHE B 175 8.984 5.798 23.114 1.00 24.62 N ATOM 6638 CA PHE B 175 8.444 5.566 21.767 1.00 22.73 C ATOM 6639 C PHE B 175 7.232 6.458 21.453 1.00 22.81 C ATOM 6640 O PHE B 175 6.597 6.309 20.420 1.00 21.02 O ATOM 6641 CB PHE B 175 8.152 4.076 21.559 1.00 19.08 C ATOM 6642 CG PHE B 175 9.414 3.215 21.360 1.00 20.33 C ATOM 6643 CD1 PHE B 175 10.644 3.797 21.046 1.00 19.07 C ATOM 6644 CD2 PHE B 175 9.339 1.828 21.433 1.00 15.80 C ATOM 6645 CE1 PHE B 175 11.790 3.007 20.833 1.00 16.81 C ATOM 6646 CE2 PHE B 175 10.440 1.030 21.233 1.00 20.01 C ATOM 6647 CZ PHE B 175 11.686 1.615 20.930 1.00 19.46 C ATOM 6648 HA PHE B 175 9.208 5.859 21.047 1.00 0.00 H ATOM 6649 HB2 PHE B 175 7.617 3.705 22.434 1.00 0.00 H ATOM 6650 HB3 PHE B 175 7.521 3.969 20.677 1.00 0.00 H ATOM 6651 HD2 PHE B 175 8.380 1.361 21.655 1.00 0.00 H ATOM 6652 HE2 PHE B 175 10.350 -0.054 21.309 1.00 0.00 H ATOM 6653 HZ PHE B 175 12.563 0.987 20.772 1.00 0.00 H ATOM 6654 HE1 PHE B 175 12.746 3.474 20.596 1.00 0.00 H ATOM 6655 HD1 PHE B 175 10.718 4.881 20.964 1.00 0.00 H ATOM 6656 H PHE B 175 8.542 5.320 23.925 1.00 0.00 H ATOM 6657 N ASN B 176 6.934 7.385 22.360 1.00 22.75 N ATOM 6658 CA ASN B 176 5.849 8.377 22.217 1.00 19.54 C ATOM 6659 C ASN B 176 4.430 7.747 22.101 1.00 23.08 C ATOM 6660 O ASN B 176 3.498 8.284 21.422 1.00 21.22 O ATOM 6661 CB ASN B 176 6.155 9.357 21.077 1.00 14.00 C ATOM 6662 CG ASN B 176 7.557 10.016 21.191 1.00 16.10 C ATOM 6663 OD1 ASN B 176 8.469 9.620 20.523 1.00 14.91 O ATOM 6664 ND2 ASN B 176 7.677 11.071 21.966 1.00 12.93 N ATOM 6665 HA ASN B 176 5.820 8.942 23.148 1.00 0.00 H ATOM 6666 HB2 ASN B 176 6.103 8.816 20.132 1.00 0.00 H ATOM 6667 HB3 ASN B 176 5.401 10.144 21.086 1.00 0.00 H ATOM 6668 HD22 ASN B 176 6.868 11.393 22.535 1.00 0.00 H ATOM 6669 HD21 ASN B 176 8.581 11.584 22.010 1.00 0.00 H ATOM 6670 H ASN B 176 7.504 7.413 23.229 1.00 0.00 H ATOM 6671 N LEU B 177 4.257 6.619 22.797 1.00 28.46 N ATOM 6672 CA LEU B 177 2.994 5.854 22.757 1.00 26.48 C ATOM 6673 C LEU B 177 1.822 6.599 23.396 1.00 32.31 C ATOM 6674 O LEU B 177 1.974 7.281 24.431 1.00 23.55 O ATOM 6675 CB LEU B 177 3.164 4.449 23.360 1.00 28.80 C ATOM 6676 CG LEU B 177 4.288 3.593 22.748 1.00 21.83 C ATOM 6677 CD1 LEU B 177 4.264 2.159 23.249 1.00 23.50 C ATOM 6678 CD2 LEU B 177 4.120 3.585 21.275 1.00 22.08 C ATOM 6679 HA LEU B 177 2.743 5.738 21.703 1.00 0.00 H ATOM 6680 HB2 LEU B 177 3.371 4.563 24.424 1.00 0.00 H ATOM 6681 HB3 LEU B 177 2.224 3.912 23.230 1.00 0.00 H ATOM 6682 HG LEU B 177 5.242 4.030 23.044 1.00 0.00 H ATOM 6683 HD21 LEU B 177 3.148 3.161 21.024 1.00 0.00 H ATOM 6684 HD22 LEU B 177 4.180 4.606 20.898 1.00 0.00 H ATOM 6685 HD23 LEU B 177 4.909 2.983 20.824 1.00 0.00 H ATOM 6686 HD11 LEU B 177 4.387 2.152 24.332 1.00 0.00 H ATOM 6687 HD12 LEU B 177 3.311 1.700 22.987 1.00 0.00 H ATOM 6688 HD13 LEU B 177 5.077 1.600 22.786 1.00 0.00 H ATOM 6689 H LEU B 177 5.038 6.268 23.387 1.00 0.00 H ATOM 6690 N ASP B 178 0.657 6.489 22.748 1.00 35.24 N ATOM 6691 CA ASP B 178 -0.522 7.253 23.154 1.00 39.15 C ATOM 6692 C ASP B 178 -1.451 6.457 24.050 1.00 33.86 C ATOM 6693 O ASP B 178 -2.535 6.054 23.636 1.00 41.45 O ATOM 6694 CB ASP B 178 -1.305 7.801 21.942 1.00 41.17 C ATOM 6695 CG ASP B 178 -2.190 9.003 22.320 1.00 48.39 C ATOM 6696 OD1 ASP B 178 -1.993 9.604 23.424 1.00 43.56 O ATOM 6697 OD2 ASP B 178 -3.086 9.341 21.507 1.00 49.78 O ATOM 6698 HA ASP B 178 -0.140 8.096 23.729 1.00 0.00 H ATOM 6699 HB2 ASP B 178 -0.595 8.114 21.177 1.00 0.00 H ATOM 6700 HB3 ASP B 178 -1.939 7.008 21.545 1.00 0.00 H ATOM 6701 H ASP B 178 0.588 5.844 21.935 1.00 0.00 H ATOM 6702 N VAL B 179 -1.027 6.253 25.280 1.00 23.05 N ATOM 6703 CA VAL B 179 -1.692 5.331 26.179 1.00 27.09 C ATOM 6704 C VAL B 179 -1.220 5.660 27.585 1.00 26.65 C ATOM 6705 O VAL B 179 -0.062 5.982 27.814 1.00 30.14 O ATOM 6706 CB VAL B 179 -1.370 3.858 25.830 1.00 24.23 C ATOM 6707 CG1 VAL B 179 0.112 3.580 26.062 1.00 25.31 C ATOM 6708 CG2 VAL B 179 -2.228 2.866 26.669 1.00 22.13 C ATOM 6709 HA VAL B 179 -2.773 5.441 26.091 1.00 0.00 H ATOM 6710 HB VAL B 179 -1.614 3.706 24.778 1.00 0.00 H ATOM 6711 HG11 VAL B 179 0.707 4.238 25.429 1.00 0.00 H ATOM 6712 HG12 VAL B 179 0.355 3.763 27.109 1.00 0.00 H ATOM 6713 HG13 VAL B 179 0.329 2.541 25.814 1.00 0.00 H ATOM 6714 HG21 VAL B 179 -2.026 3.020 27.729 1.00 0.00 H ATOM 6715 HG22 VAL B 179 -3.285 3.043 26.470 1.00 0.00 H ATOM 6716 HG23 VAL B 179 -1.971 1.843 26.394 1.00 0.00 H ATOM 6717 H VAL B 179 -0.189 6.769 25.617 1.00 0.00 H ATOM 6718 N ALA B 180 -2.151 5.642 28.509 1.00 26.94 N ATOM 6719 CA ALA B 180 -1.835 5.762 29.903 1.00 25.88 C ATOM 6720 C ALA B 180 -1.521 4.350 30.457 1.00 28.91 C ATOM 6721 O ALA B 180 -2.255 3.356 30.240 1.00 22.56 O ATOM 6722 CB ALA B 180 -3.045 6.399 30.647 1.00 25.89 C ATOM 6723 HA ALA B 180 -0.966 6.403 30.052 1.00 0.00 H ATOM 6724 HB1 ALA B 180 -3.248 7.386 30.230 1.00 0.00 H ATOM 6725 HB2 ALA B 180 -3.922 5.764 30.523 1.00 0.00 H ATOM 6726 HB3 ALA B 180 -2.810 6.492 31.707 1.00 0.00 H ATOM 6727 H ALA B 180 -3.145 5.538 28.223 1.00 0.00 H ATOM 6728 N VAL B 181 -0.396 4.272 31.153 1.00 30.12 N ATOM 6729 CA VAL B 181 -0.020 3.085 31.897 1.00 25.19 C ATOM 6730 C VAL B 181 -0.644 3.158 33.303 1.00 30.12 C ATOM 6731 O VAL B 181 -0.507 4.158 34.005 1.00 28.41 O ATOM 6732 CB VAL B 181 1.508 2.912 31.908 1.00 21.41 C ATOM 6733 CG1 VAL B 181 1.896 1.557 32.559 1.00 22.08 C ATOM 6734 CG2 VAL B 181 2.013 2.938 30.489 1.00 13.74 C ATOM 6735 HA VAL B 181 -0.411 2.190 31.413 1.00 0.00 H ATOM 6736 HB VAL B 181 1.953 3.722 32.486 1.00 0.00 H ATOM 6737 HG11 VAL B 181 1.528 1.530 33.585 1.00 0.00 H ATOM 6738 HG12 VAL B 181 1.450 0.741 31.990 1.00 0.00 H ATOM 6739 HG13 VAL B 181 2.981 1.452 32.558 1.00 0.00 H ATOM 6740 HG21 VAL B 181 1.554 2.125 29.926 1.00 0.00 H ATOM 6741 HG22 VAL B 181 1.753 3.892 30.030 1.00 0.00 H ATOM 6742 HG23 VAL B 181 3.096 2.816 30.488 1.00 0.00 H ATOM 6743 H VAL B 181 0.242 5.093 31.166 1.00 0.00 H ATOM 6744 N VAL B 182 -1.418 2.142 33.682 1.00 30.87 N ATOM 6745 CA VAL B 182 -1.983 2.137 35.030 1.00 22.63 C ATOM 6746 C VAL B 182 -1.431 0.954 35.835 1.00 26.52 C ATOM 6747 O VAL B 182 -1.492 -0.239 35.416 1.00 25.99 O ATOM 6748 CB VAL B 182 -3.543 2.310 35.016 1.00 28.74 C ATOM 6749 CG1 VAL B 182 -4.147 2.403 36.427 1.00 19.23 C ATOM 6750 CG2 VAL B 182 -3.967 3.536 34.170 1.00 15.14 C ATOM 6751 HA VAL B 182 -1.651 3.020 35.576 1.00 0.00 H ATOM 6752 HB VAL B 182 -3.941 1.407 34.553 1.00 0.00 H ATOM 6753 HG11 VAL B 182 -3.918 1.492 36.980 1.00 0.00 H ATOM 6754 HG12 VAL B 182 -3.722 3.261 36.947 1.00 0.00 H ATOM 6755 HG13 VAL B 182 -5.228 2.522 36.351 1.00 0.00 H ATOM 6756 HG21 VAL B 182 -3.522 4.438 34.591 1.00 0.00 H ATOM 6757 HG22 VAL B 182 -3.623 3.404 33.144 1.00 0.00 H ATOM 6758 HG23 VAL B 182 -5.053 3.626 34.182 1.00 0.00 H ATOM 6759 H VAL B 182 -1.618 1.361 33.026 1.00 0.00 H ATOM 6760 N GLY B 183 -0.807 1.319 36.952 1.00 25.26 N ATOM 6761 CA GLY B 183 -0.177 0.376 37.844 1.00 25.80 C ATOM 6762 C GLY B 183 -1.069 0.056 39.042 1.00 24.58 C ATOM 6763 O GLY B 183 -1.408 0.931 39.826 1.00 22.46 O ATOM 6764 HA3 GLY B 183 0.761 0.800 38.203 1.00 0.00 H ATOM 6765 HA2 GLY B 183 0.028 -0.545 37.299 1.00 0.00 H ATOM 6766 H GLY B 183 -0.772 2.330 37.193 1.00 0.00 H ATOM 6767 N VAL B 184 -1.407 -1.217 39.200 1.00 20.67 N ATOM 6768 CA VAL B 184 -2.437 -1.607 40.138 1.00 19.40 C ATOM 6769 C VAL B 184 -1.721 -2.298 41.321 1.00 27.71 C ATOM 6770 O VAL B 184 -0.916 -3.262 41.118 1.00 26.11 O ATOM 6771 CB VAL B 184 -3.458 -2.516 39.460 1.00 17.65 C ATOM 6772 CG1 VAL B 184 -4.447 -3.164 40.493 1.00 17.40 C ATOM 6773 CG2 VAL B 184 -4.191 -1.777 38.326 1.00 17.55 C ATOM 6774 HA VAL B 184 -3.000 -0.747 40.502 1.00 0.00 H ATOM 6775 HB VAL B 184 -2.913 -3.343 39.004 1.00 0.00 H ATOM 6776 HG11 VAL B 184 -3.882 -3.761 41.210 1.00 0.00 H ATOM 6777 HG12 VAL B 184 -4.988 -2.377 41.019 1.00 0.00 H ATOM 6778 HG13 VAL B 184 -5.155 -3.802 39.965 1.00 0.00 H ATOM 6779 HG21 VAL B 184 -4.712 -0.911 38.735 1.00 0.00 H ATOM 6780 HG22 VAL B 184 -3.467 -1.448 37.581 1.00 0.00 H ATOM 6781 HG23 VAL B 184 -4.912 -2.450 37.862 1.00 0.00 H ATOM 6782 H VAL B 184 -0.923 -1.947 38.640 1.00 0.00 H ATOM 6783 N PRO B 185 -1.992 -1.813 42.550 1.00 28.17 N ATOM 6784 CA PRO B 185 -1.328 -2.433 43.741 1.00 29.79 C ATOM 6785 C PRO B 185 -1.367 -3.980 43.802 1.00 31.06 C ATOM 6786 O PRO B 185 -2.292 -4.608 43.259 1.00 30.78 O ATOM 6787 CB PRO B 185 -2.039 -1.781 44.949 1.00 29.26 C ATOM 6788 CG PRO B 185 -2.631 -0.457 44.408 1.00 29.03 C ATOM 6789 CD PRO B 185 -2.887 -0.674 42.902 1.00 26.25 C ATOM 6790 HA PRO B 185 -0.255 -2.244 43.711 1.00 0.00 H ATOM 6791 HD3 PRO B 185 -3.931 -0.929 42.718 1.00 0.00 H ATOM 6792 HD2 PRO B 185 -2.625 0.217 42.331 1.00 0.00 H ATOM 6793 HG3 PRO B 185 -1.925 0.360 44.556 1.00 0.00 H ATOM 6794 HG2 PRO B 185 -3.565 -0.225 44.919 1.00 0.00 H ATOM 6795 HB2 PRO B 185 -2.831 -2.430 45.322 1.00 0.00 H ATOM 6796 HB3 PRO B 185 -1.327 -1.582 45.750 1.00 0.00 H ATOM 6797 N THR B 186 -0.333 -4.571 44.420 1.00 30.63 N ATOM 6798 CA THR B 186 -0.263 -6.012 44.693 1.00 28.68 C ATOM 6799 C THR B 186 -1.416 -6.561 45.558 1.00 29.54 C ATOM 6800 O THR B 186 -1.654 -6.126 46.697 1.00 30.33 O ATOM 6801 CB THR B 186 1.041 -6.417 45.406 1.00 33.09 C ATOM 6802 OG1 THR B 186 2.164 -5.800 44.755 1.00 35.56 O ATOM 6803 CG2 THR B 186 1.203 -7.979 45.454 1.00 21.83 C ATOM 6804 HA THR B 186 -0.324 -6.444 43.694 1.00 0.00 H ATOM 6805 HB THR B 186 0.997 -6.065 46.437 1.00 0.00 H ATOM 6806 HG1 THR B 186 2.064 -4.816 44.789 1.00 0.00 H ATOM 6807 HG23 THR B 186 0.338 -8.418 45.952 1.00 0.00 H ATOM 6808 HG21 THR B 186 1.274 -8.367 44.438 1.00 0.00 H ATOM 6809 HG22 THR B 186 2.109 -8.232 46.005 1.00 0.00 H ATOM 6810 H THR B 186 0.464 -3.975 44.723 1.00 0.00 H ATOM 6811 N VAL B 187 -2.095 -7.557 45.004 1.00 31.71 N ATOM 6812 CA VAL B 187 -2.982 -8.411 45.757 1.00 32.27 C ATOM 6813 C VAL B 187 -2.126 -9.389 46.594 1.00 29.46 C ATOM 6814 O VAL B 187 -1.161 -9.996 46.094 1.00 32.18 O ATOM 6815 CB VAL B 187 -3.974 -9.100 44.789 1.00 35.29 C ATOM 6816 CG1 VAL B 187 -4.966 -9.983 45.550 1.00 31.26 C ATOM 6817 CG2 VAL B 187 -4.733 -8.012 44.016 1.00 30.79 C ATOM 6818 HA VAL B 187 -3.594 -7.847 46.460 1.00 0.00 H ATOM 6819 HB VAL B 187 -3.418 -9.739 44.103 1.00 0.00 H ATOM 6820 HG11 VAL B 187 -4.421 -10.753 46.096 1.00 0.00 H ATOM 6821 HG12 VAL B 187 -5.532 -9.370 46.251 1.00 0.00 H ATOM 6822 HG13 VAL B 187 -5.649 -10.453 44.842 1.00 0.00 H ATOM 6823 HG21 VAL B 187 -5.276 -7.380 44.719 1.00 0.00 H ATOM 6824 HG22 VAL B 187 -4.023 -7.405 43.454 1.00 0.00 H ATOM 6825 HG23 VAL B 187 -5.437 -8.481 43.329 1.00 0.00 H ATOM 6826 H VAL B 187 -1.983 -7.730 43.985 1.00 0.00 H ATOM 6827 N ARG B 188 -2.444 -9.480 47.882 1.00 28.79 N ATOM 6828 CA ARG B 188 -1.767 -10.406 48.787 1.00 30.64 C ATOM 6829 C ARG B 188 -2.713 -11.403 49.461 1.00 32.88 C ATOM 6830 O ARG B 188 -3.897 -11.143 49.642 1.00 34.58 O ATOM 6831 CB ARG B 188 -1.029 -9.634 49.861 1.00 28.69 C ATOM 6832 CG ARG B 188 -0.487 -8.319 49.376 1.00 31.63 C ATOM 6833 CD ARG B 188 0.386 -7.694 50.424 1.00 26.04 C ATOM 6834 NE ARG B 188 1.363 -6.795 49.829 1.00 32.49 N ATOM 6835 CZ ARG B 188 2.575 -7.163 49.424 1.00 31.19 C ATOM 6836 NH1 ARG B 188 2.970 -8.438 49.555 1.00 32.52 N ATOM 6837 NH2 ARG B 188 3.384 -6.259 48.871 1.00 20.54 N ATOM 6838 HA ARG B 188 -1.075 -10.979 48.170 1.00 0.00 H ATOM 6839 HB2 ARG B 188 -1.716 -9.443 50.685 1.00 0.00 H ATOM 6840 HB3 ARG B 188 -0.197 -10.242 50.216 1.00 0.00 H ATOM 6841 HG2 ARG B 188 0.099 -8.483 48.472 1.00 0.00 H ATOM 6842 HG3 ARG B 188 -1.317 -7.648 49.153 1.00 0.00 H ATOM 6843 HD2 ARG B 188 0.911 -8.481 50.966 1.00 0.00 H ATOM 6844 HD3 ARG B 188 -0.239 -7.131 51.118 1.00 0.00 H ATOM 6845 HE ARG B 188 1.095 -5.797 49.713 1.00 0.00 H ATOM 6846 HH12 ARG B 188 3.918 -8.724 49.238 1.00 0.00 H ATOM 6847 HH11 ARG B 188 2.328 -9.141 49.974 1.00 0.00 H ATOM 6848 HH22 ARG B 188 4.334 -6.538 48.551 1.00 0.00 H ATOM 6849 HH21 ARG B 188 3.065 -5.275 48.759 1.00 0.00 H ATOM 6850 H ARG B 188 -3.200 -8.872 48.258 1.00 0.00 H ATOM 6851 N GLU B 189 -2.171 -12.557 49.822 1.00 36.73 N ATOM 6852 CA GLU B 189 -2.846 -13.531 50.678 1.00 34.58 C ATOM 6853 C GLU B 189 -2.987 -12.863 52.045 1.00 37.22 C ATOM 6854 O GLU B 189 -2.477 -11.760 52.231 1.00 31.30 O ATOM 6855 CB GLU B 189 -2.005 -14.787 50.786 1.00 37.38 C ATOM 6856 CG GLU B 189 -1.363 -15.219 49.461 1.00 42.38 C ATOM 6857 CD GLU B 189 -2.150 -16.289 48.755 1.00 51.97 C ATOM 6858 OE1 GLU B 189 -3.389 -16.262 48.898 1.00 54.51 O ATOM 6859 OE2 GLU B 189 -1.535 -17.155 48.063 1.00 56.81 O ATOM 6860 HA GLU B 189 -3.818 -13.820 50.278 1.00 0.00 H ATOM 6861 HB2 GLU B 189 -1.211 -14.608 51.511 1.00 0.00 H ATOM 6862 HB3 GLU B 189 -2.642 -15.598 51.140 1.00 0.00 H ATOM 6863 HG2 GLU B 189 -1.293 -14.349 48.808 1.00 0.00 H ATOM 6864 HG3 GLU B 189 -0.362 -15.600 49.666 1.00 0.00 H ATOM 6865 H GLU B 189 -1.215 -12.782 49.478 1.00 0.00 H ATOM 6866 N ALA B 190 -3.691 -13.519 52.980 1.00 37.42 N ATOM 6867 CA ALA B 190 -4.088 -12.916 54.266 1.00 34.59 C ATOM 6868 C ALA B 190 -2.890 -12.571 55.125 1.00 32.05 C ATOM 6869 O ALA B 190 -2.939 -11.621 55.917 1.00 31.03 O ATOM 6870 CB ALA B 190 -5.031 -13.825 55.037 1.00 32.67 C ATOM 6871 HA ALA B 190 -4.611 -11.990 54.025 1.00 0.00 H ATOM 6872 HB1 ALA B 190 -5.929 -14.001 54.445 1.00 0.00 H ATOM 6873 HB2 ALA B 190 -4.535 -14.775 55.238 1.00 0.00 H ATOM 6874 HB3 ALA B 190 -5.303 -13.349 55.979 1.00 0.00 H ATOM 6875 H ALA B 190 -3.971 -14.502 52.788 1.00 0.00 H ATOM 6876 N ASP B 191 -1.812 -13.327 54.958 1.00 29.42 N ATOM 6877 CA ASP B 191 -0.595 -13.091 55.730 1.00 29.29 C ATOM 6878 C ASP B 191 0.396 -12.135 55.041 1.00 29.43 C ATOM 6879 O ASP B 191 1.490 -11.905 55.578 1.00 32.77 O ATOM 6880 CB ASP B 191 0.069 -14.420 56.066 1.00 25.36 C ATOM 6881 CG ASP B 191 0.566 -15.132 54.853 1.00 27.63 C ATOM 6882 OD1 ASP B 191 0.258 -14.678 53.746 1.00 33.60 O ATOM 6883 OD2 ASP B 191 1.247 -16.156 54.992 1.00 29.72 O ATOM 6884 HA ASP B 191 -0.895 -12.588 56.649 1.00 0.00 H ATOM 6885 HB2 ASP B 191 0.912 -14.232 56.731 1.00 0.00 H ATOM 6886 HB3 ASP B 191 -0.657 -15.056 56.572 1.00 0.00 H ATOM 6887 H ASP B 191 -1.834 -14.102 54.265 1.00 0.00 H ATOM 6888 N GLY B 192 0.008 -11.579 53.876 1.00 23.49 N ATOM 6889 CA GLY B 192 0.836 -10.637 53.124 1.00 16.44 C ATOM 6890 C GLY B 192 1.630 -11.182 51.906 1.00 23.79 C ATOM 6891 O GLY B 192 2.120 -10.411 51.080 1.00 26.37 O ATOM 6892 HA3 GLY B 192 1.559 -10.212 53.820 1.00 0.00 H ATOM 6893 HA2 GLY B 192 0.180 -9.848 52.758 1.00 0.00 H ATOM 6894 H GLY B 192 -0.925 -11.832 53.493 1.00 0.00 H ATOM 6895 N LEU B 193 1.776 -12.497 51.772 1.00 20.38 N ATOM 6896 CA LEU B 193 2.458 -13.058 50.612 1.00 22.25 C ATOM 6897 C LEU B 193 1.874 -12.568 49.300 1.00 19.31 C ATOM 6898 O LEU B 193 0.669 -12.732 49.020 1.00 20.68 O ATOM 6899 CB LEU B 193 2.443 -14.586 50.612 1.00 24.37 C ATOM 6900 CG LEU B 193 3.231 -15.163 49.418 1.00 27.16 C ATOM 6901 CD1 LEU B 193 4.748 -14.803 49.515 1.00 22.63 C ATOM 6902 CD2 LEU B 193 3.038 -16.680 49.302 1.00 29.86 C ATOM 6903 HA LEU B 193 3.487 -12.709 50.694 1.00 0.00 H ATOM 6904 HB2 LEU B 193 2.892 -14.944 51.538 1.00 0.00 H ATOM 6905 HB3 LEU B 193 1.410 -14.930 50.554 1.00 0.00 H ATOM 6906 HG LEU B 193 2.833 -14.705 48.513 1.00 0.00 H ATOM 6907 HD21 LEU B 193 3.390 -17.161 50.215 1.00 0.00 H ATOM 6908 HD22 LEU B 193 1.980 -16.900 49.159 1.00 0.00 H ATOM 6909 HD23 LEU B 193 3.607 -17.053 48.451 1.00 0.00 H ATOM 6910 HD11 LEU B 193 4.863 -13.719 49.517 1.00 0.00 H ATOM 6911 HD12 LEU B 193 5.160 -15.216 50.436 1.00 0.00 H ATOM 6912 HD13 LEU B 193 5.275 -15.224 48.659 1.00 0.00 H ATOM 6913 H LEU B 193 1.399 -13.133 52.504 1.00 0.00 H ATOM 6914 N ALA B 194 2.737 -11.972 48.485 1.00 20.18 N ATOM 6915 CA ALA B 194 2.299 -11.426 47.218 1.00 21.17 C ATOM 6916 C ALA B 194 1.740 -12.600 46.382 1.00 27.22 C ATOM 6917 O ALA B 194 2.421 -13.637 46.208 1.00 20.30 O ATOM 6918 CB ALA B 194 3.451 -10.754 46.551 1.00 16.92 C ATOM 6919 HA ALA B 194 1.518 -10.675 47.341 1.00 0.00 H ATOM 6920 HB1 ALA B 194 3.820 -9.951 47.189 1.00 0.00 H ATOM 6921 HB2 ALA B 194 4.246 -11.481 46.382 1.00 0.00 H ATOM 6922 HB3 ALA B 194 3.126 -10.341 45.596 1.00 0.00 H ATOM 6923 H ALA B 194 3.737 -11.897 48.760 1.00 0.00 H ATOM 6924 N MET B 195 0.493 -12.468 45.918 1.00 26.76 N ATOM 6925 CA MET B 195 -0.093 -13.509 45.045 1.00 29.46 C ATOM 6926 C MET B 195 0.650 -13.756 43.732 1.00 29.45 C ATOM 6927 O MET B 195 1.135 -12.837 43.090 1.00 26.61 O ATOM 6928 CB MET B 195 -1.550 -13.221 44.735 1.00 29.06 C ATOM 6929 CG MET B 195 -2.469 -13.806 45.715 1.00 33.10 C ATOM 6930 SD MET B 195 -4.115 -13.607 45.087 1.00 42.04 S ATOM 6931 CE MET B 195 -5.086 -13.446 46.591 1.00 28.79 C ATOM 6932 HA MET B 195 0.004 -14.421 45.634 1.00 0.00 H ATOM 6933 HB2 MET B 195 -1.696 -12.141 44.723 1.00 0.00 H ATOM 6934 HB3 MET B 195 -1.784 -13.629 43.752 1.00 0.00 H ATOM 6935 HG2 MET B 195 -2.370 -13.292 46.671 1.00 0.00 H ATOM 6936 HG3 MET B 195 -2.247 -14.865 45.848 1.00 0.00 H ATOM 6937 HE1 MET B 195 -4.969 -14.345 47.196 1.00 0.00 H ATOM 6938 HE2 MET B 195 -4.740 -12.580 47.155 1.00 0.00 H ATOM 6939 HE3 MET B 195 -6.137 -13.316 46.331 1.00 0.00 H ATOM 6940 H MET B 195 -0.068 -11.630 46.172 1.00 0.00 H ATOM 6941 N SER B 196 0.708 -15.023 43.351 1.00 28.40 N ATOM 6942 CA SER B 196 1.450 -15.487 42.213 1.00 32.31 C ATOM 6943 C SER B 196 1.076 -16.959 42.053 1.00 36.60 C ATOM 6944 O SER B 196 0.750 -17.657 43.028 1.00 33.33 O ATOM 6945 CB SER B 196 2.975 -15.348 42.437 1.00 30.57 C ATOM 6946 OG SER B 196 3.706 -16.277 41.637 1.00 31.94 O ATOM 6947 HA SER B 196 1.212 -14.900 41.326 1.00 0.00 H ATOM 6948 HB2 SER B 196 3.198 -15.533 43.488 1.00 0.00 H ATOM 6949 HB3 SER B 196 3.281 -14.335 42.174 1.00 0.00 H ATOM 6950 HG SER B 196 4.675 -16.163 41.803 1.00 0.00 H ATOM 6951 H SER B 196 0.184 -15.725 43.911 1.00 0.00 H ATOM 6952 N SER B 197 1.140 -17.421 40.814 1.00 38.19 N ATOM 6953 CA SER B 197 0.810 -18.794 40.490 1.00 41.02 C ATOM 6954 C SER B 197 1.885 -19.719 41.024 1.00 42.36 C ATOM 6955 O SER B 197 1.615 -20.891 41.284 1.00 39.54 O ATOM 6956 CB SER B 197 0.664 -18.959 38.973 1.00 47.72 C ATOM 6957 OG SER B 197 1.618 -18.150 38.290 1.00 48.97 O ATOM 6958 HA SER B 197 -0.140 -19.053 40.957 1.00 0.00 H ATOM 6959 HB2 SER B 197 -0.341 -18.660 38.674 1.00 0.00 H ATOM 6960 HB3 SER B 197 0.824 -20.004 38.708 1.00 0.00 H ATOM 6961 HG SER B 197 1.473 -17.200 38.527 1.00 0.00 H ATOM 6962 H SER B 197 1.436 -16.779 40.051 1.00 0.00 H ATOM 6963 N ARG B 198 3.103 -19.200 41.218 1.00 41.35 N ATOM 6964 CA ARG B 198 4.149 -20.031 41.852 1.00 33.90 C ATOM 6965 C ARG B 198 3.881 -20.436 43.297 1.00 32.65 C ATOM 6966 O ARG B 198 4.314 -21.485 43.712 1.00 34.13 O ATOM 6967 CB ARG B 198 5.516 -19.401 41.711 1.00 33.01 C ATOM 6968 CG ARG B 198 5.898 -19.311 40.265 1.00 43.56 C ATOM 6969 CD ARG B 198 7.140 -18.507 40.119 1.00 52.81 C ATOM 6970 NE ARG B 198 7.395 -18.147 38.733 1.00 60.83 N ATOM 6971 CZ ARG B 198 8.585 -17.796 38.264 1.00 64.29 C ATOM 6972 NH1 ARG B 198 9.643 -17.778 39.076 1.00 65.60 N ATOM 6973 NH2 ARG B 198 8.716 -17.483 36.981 1.00 68.08 N ATOM 6974 HA ARG B 198 4.121 -20.966 41.293 1.00 0.00 H ATOM 6975 HB2 ARG B 198 5.498 -18.400 42.142 1.00 0.00 H ATOM 6976 HB3 ARG B 198 6.249 -20.009 42.240 1.00 0.00 H ATOM 6977 HG2 ARG B 198 6.068 -20.314 39.873 1.00 0.00 H ATOM 6978 HG3 ARG B 198 5.092 -18.836 39.707 1.00 0.00 H ATOM 6979 HD2 ARG B 198 7.982 -19.089 40.493 1.00 0.00 H ATOM 6980 HD3 ARG B 198 7.041 -17.595 40.707 1.00 0.00 H ATOM 6981 HE ARG B 198 6.595 -18.166 38.069 1.00 0.00 H ATOM 6982 HH12 ARG B 198 10.576 -17.503 38.708 1.00 0.00 H ATOM 6983 HH11 ARG B 198 9.535 -18.039 40.077 1.00 0.00 H ATOM 6984 HH22 ARG B 198 9.646 -17.207 36.605 1.00 0.00 H ATOM 6985 HH21 ARG B 198 7.889 -17.514 36.351 1.00 0.00 H ATOM 6986 H ARG B 198 3.312 -18.224 40.926 1.00 0.00 H ATOM 6987 N ASN B 199 3.146 -19.627 44.052 1.00 31.17 N ATOM 6988 CA ASN B 199 2.982 -19.886 45.468 1.00 34.34 C ATOM 6989 C ASN B 199 2.514 -21.311 45.783 1.00 39.14 C ATOM 6990 O ASN B 199 2.728 -21.821 46.906 1.00 34.93 O ATOM 6991 CB ASN B 199 2.076 -18.815 46.112 1.00 29.96 C ATOM 6992 CG ASN B 199 2.668 -17.402 45.991 1.00 32.13 C ATOM 6993 OD1 ASN B 199 3.824 -17.223 45.616 1.00 28.02 O ATOM 6994 ND2 ASN B 199 1.858 -16.399 46.272 1.00 36.06 N ATOM 6995 HA ASN B 199 3.972 -19.813 45.919 1.00 0.00 H ATOM 6996 HB2 ASN B 199 1.105 -18.832 45.617 1.00 0.00 H ATOM 6997 HB3 ASN B 199 1.948 -19.053 47.168 1.00 0.00 H ATOM 6998 HD22 ASN B 199 0.885 -16.589 46.587 1.00 0.00 H ATOM 6999 HD21 ASN B 199 2.192 -15.419 46.179 1.00 0.00 H ATOM 7000 H ASN B 199 2.684 -18.800 43.623 1.00 0.00 H ATOM 7001 N ARG B 200 1.901 -21.931 44.771 1.00 45.68 N ATOM 7002 CA ARG B 200 1.274 -23.245 44.864 1.00 53.89 C ATOM 7003 C ARG B 200 2.303 -24.364 44.874 1.00 49.92 C ATOM 7004 O ARG B 200 2.017 -25.456 45.368 1.00 48.24 O ATOM 7005 CB ARG B 200 0.246 -23.455 43.731 1.00 59.67 C ATOM 7006 CG ARG B 200 0.839 -23.476 42.310 1.00 65.85 C ATOM 7007 CD ARG B 200 -0.242 -23.541 41.220 1.00 68.30 C ATOM 7008 NE ARG B 200 -0.623 -24.927 40.935 1.00 83.67 N ATOM 7009 CZ ARG B 200 -0.016 -25.722 40.047 1.00 88.60 C ATOM 7010 NH1 ARG B 200 1.013 -25.271 39.327 1.00 91.36 N ATOM 7011 NH2 ARG B 200 -0.440 -26.973 39.870 1.00 89.34 N ATOM 7012 HA ARG B 200 0.743 -23.279 45.816 1.00 0.00 H ATOM 7013 HB2 ARG B 200 -0.257 -24.407 43.902 1.00 0.00 H ATOM 7014 HB3 ARG B 200 -0.483 -22.646 43.781 1.00 0.00 H ATOM 7015 HG2 ARG B 200 1.429 -22.571 42.164 1.00 0.00 H ATOM 7016 HG3 ARG B 200 1.485 -24.349 42.214 1.00 0.00 H ATOM 7017 HD2 ARG B 200 0.143 -23.083 40.309 1.00 0.00 H ATOM 7018 HD3 ARG B 200 -1.121 -22.992 41.557 1.00 0.00 H ATOM 7019 HE ARG B 200 -1.427 -25.323 41.463 1.00 0.00 H ATOM 7020 HH12 ARG B 200 1.479 -25.896 38.639 1.00 0.00 H ATOM 7021 HH11 ARG B 200 1.349 -24.295 39.454 1.00 0.00 H ATOM 7022 HH22 ARG B 200 0.033 -27.590 39.179 1.00 0.00 H ATOM 7023 HH21 ARG B 200 -1.244 -27.333 40.423 1.00 0.00 H ATOM 7024 H ARG B 200 1.868 -21.443 43.853 1.00 0.00 H ATOM 7025 N TYR B 201 3.499 -24.082 44.363 1.00 46.35 N ATOM 7026 CA TYR B 201 4.626 -25.022 44.475 1.00 50.11 C ATOM 7027 C TYR B 201 5.242 -25.192 45.880 1.00 50.37 C ATOM 7028 O TYR B 201 5.918 -26.216 46.129 1.00 49.61 O ATOM 7029 CB TYR B 201 5.719 -24.716 43.446 1.00 59.54 C ATOM 7030 CG TYR B 201 5.176 -24.635 42.037 1.00 66.22 C ATOM 7031 CD1 TYR B 201 4.455 -25.706 41.474 1.00 67.31 C ATOM 7032 CD2 TYR B 201 5.364 -23.482 41.268 1.00 69.67 C ATOM 7033 CE1 TYR B 201 3.942 -25.629 40.186 1.00 69.04 C ATOM 7034 CE2 TYR B 201 4.858 -23.392 39.972 1.00 71.25 C ATOM 7035 CZ TYR B 201 4.150 -24.468 39.443 1.00 70.38 C ATOM 7036 OH TYR B 201 3.648 -24.364 38.171 1.00 72.54 O ATOM 7037 HA TYR B 201 4.167 -25.987 44.260 1.00 0.00 H ATOM 7038 HB3 TYR B 201 6.470 -25.505 43.487 1.00 0.00 H ATOM 7039 HB2 TYR B 201 6.181 -23.762 43.699 1.00 0.00 H ATOM 7040 HD2 TYR B 201 5.915 -22.641 41.689 1.00 0.00 H ATOM 7041 HE2 TYR B 201 5.015 -22.490 39.380 1.00 0.00 H ATOM 7042 HE1 TYR B 201 3.385 -26.464 39.762 1.00 0.00 H ATOM 7043 HD1 TYR B 201 4.297 -26.611 42.060 1.00 0.00 H ATOM 7044 HH TYR B 201 3.173 -25.200 37.935 1.00 0.00 H ATOM 7045 H TYR B 201 3.641 -23.176 43.873 1.00 0.00 H ATOM 7046 N LEU B 202 4.984 -24.246 46.802 1.00 39.69 N ATOM 7047 CA LEU B 202 5.686 -24.254 48.100 1.00 34.87 C ATOM 7048 C LEU B 202 5.205 -25.340 49.060 1.00 30.19 C ATOM 7049 O LEU B 202 4.017 -25.440 49.379 1.00 30.52 O ATOM 7050 CB LEU B 202 5.643 -22.866 48.771 1.00 31.77 C ATOM 7051 CG LEU B 202 6.087 -21.667 47.899 1.00 24.13 C ATOM 7052 CD1 LEU B 202 5.500 -20.386 48.414 1.00 25.70 C ATOM 7053 CD2 LEU B 202 7.573 -21.565 47.750 1.00 14.52 C ATOM 7054 HA LEU B 202 6.722 -24.500 47.867 1.00 0.00 H ATOM 7055 HB2 LEU B 202 4.617 -22.683 49.090 1.00 0.00 H ATOM 7056 HB3 LEU B 202 6.293 -22.900 49.645 1.00 0.00 H ATOM 7057 HG LEU B 202 5.697 -21.850 46.898 1.00 0.00 H ATOM 7058 HD21 LEU B 202 8.028 -21.444 48.733 1.00 0.00 H ATOM 7059 HD22 LEU B 202 7.953 -22.473 47.281 1.00 0.00 H ATOM 7060 HD23 LEU B 202 7.816 -20.704 47.128 1.00 0.00 H ATOM 7061 HD11 LEU B 202 4.412 -20.452 48.393 1.00 0.00 H ATOM 7062 HD12 LEU B 202 5.836 -20.220 49.438 1.00 0.00 H ATOM 7063 HD13 LEU B 202 5.827 -19.559 47.784 1.00 0.00 H ATOM 7064 H LEU B 202 4.285 -23.504 46.598 1.00 0.00 H ATOM 7065 N ASP B 203 6.121 -26.142 49.538 1.00 26.67 N ATOM 7066 CA ASP B 203 5.739 -27.069 50.555 1.00 30.76 C ATOM 7067 C ASP B 203 5.378 -26.270 51.755 1.00 29.86 C ATOM 7068 O ASP B 203 5.415 -25.102 51.736 1.00 29.13 O ATOM 7069 CB ASP B 203 6.802 -28.099 50.853 1.00 34.79 C ATOM 7070 CG ASP B 203 7.992 -27.540 51.527 1.00 38.56 C ATOM 7071 OD1 ASP B 203 7.845 -26.711 52.393 1.00 43.21 O ATOM 7072 OD2 ASP B 203 9.085 -27.967 51.206 1.00 38.69 O ATOM 7073 HA ASP B 203 4.888 -27.658 50.213 1.00 0.00 H ATOM 7074 HB2 ASP B 203 6.369 -28.866 51.496 1.00 0.00 H ATOM 7075 HB3 ASP B 203 7.118 -28.551 49.913 1.00 0.00 H ATOM 7076 H ASP B 203 7.099 -26.106 49.188 1.00 0.00 H ATOM 7077 N PRO B 204 4.982 -26.907 52.808 1.00 33.48 N ATOM 7078 CA PRO B 204 4.461 -26.135 53.903 1.00 34.76 C ATOM 7079 C PRO B 204 5.496 -25.348 54.677 1.00 36.05 C ATOM 7080 O PRO B 204 5.166 -24.339 55.205 1.00 33.58 O ATOM 7081 CB PRO B 204 3.791 -27.194 54.744 1.00 35.64 C ATOM 7082 CG PRO B 204 3.369 -28.124 53.798 1.00 33.87 C ATOM 7083 CD PRO B 204 4.440 -28.255 52.836 1.00 35.73 C ATOM 7084 HA PRO B 204 3.795 -25.341 53.564 1.00 0.00 H ATOM 7085 HD3 PRO B 204 5.186 -28.976 53.169 1.00 0.00 H ATOM 7086 HD2 PRO B 204 4.061 -28.551 51.858 1.00 0.00 H ATOM 7087 HG3 PRO B 204 2.462 -27.774 53.305 1.00 0.00 H ATOM 7088 HG2 PRO B 204 3.174 -29.084 54.276 1.00 0.00 H ATOM 7089 HB2 PRO B 204 4.495 -27.641 55.446 1.00 0.00 H ATOM 7090 HB3 PRO B 204 2.945 -26.781 55.293 1.00 0.00 H ATOM 7091 N ALA B 205 6.726 -25.823 54.715 1.00 32.16 N ATOM 7092 CA ALA B 205 7.795 -25.152 55.385 1.00 29.68 C ATOM 7093 C ALA B 205 8.167 -23.921 54.611 1.00 30.42 C ATOM 7094 O ALA B 205 8.329 -22.889 55.136 1.00 32.89 O ATOM 7095 CB ALA B 205 8.955 -26.045 55.489 1.00 28.33 C ATOM 7096 HA ALA B 205 7.476 -24.869 56.388 1.00 0.00 H ATOM 7097 HB1 ALA B 205 8.677 -26.935 56.054 1.00 0.00 H ATOM 7098 HB2 ALA B 205 9.280 -26.334 54.490 1.00 0.00 H ATOM 7099 HB3 ALA B 205 9.766 -25.527 56.001 1.00 0.00 H ATOM 7100 H ALA B 205 6.926 -26.725 54.237 1.00 0.00 H ATOM 7101 N GLN B 206 8.283 -24.073 53.329 1.00 29.92 N ATOM 7102 CA GLN B 206 8.608 -22.997 52.449 1.00 29.95 C ATOM 7103 C GLN B 206 7.535 -21.927 52.444 1.00 30.87 C ATOM 7104 O GLN B 206 7.872 -20.767 52.259 1.00 29.69 O ATOM 7105 CB GLN B 206 8.799 -23.541 51.032 1.00 27.61 C ATOM 7106 CG GLN B 206 10.067 -24.312 50.857 1.00 25.69 C ATOM 7107 CD GLN B 206 10.140 -24.992 49.514 1.00 31.10 C ATOM 7108 OE1 GLN B 206 9.121 -25.378 48.931 1.00 33.54 O ATOM 7109 NE2 GLN B 206 11.351 -25.153 49.013 1.00 32.85 N ATOM 7110 HA GLN B 206 9.530 -22.538 52.805 1.00 0.00 H ATOM 7111 HB2 GLN B 206 7.961 -24.197 50.798 1.00 0.00 H ATOM 7112 HB3 GLN B 206 8.807 -22.701 50.337 1.00 0.00 H ATOM 7113 HG2 GLN B 206 10.910 -23.627 50.950 1.00 0.00 H ATOM 7114 HG3 GLN B 206 10.128 -25.070 51.638 1.00 0.00 H ATOM 7115 HE22 GLN B 206 12.181 -24.812 49.539 1.00 0.00 H ATOM 7116 HE21 GLN B 206 11.475 -25.621 48.092 1.00 0.00 H ATOM 7117 H GLN B 206 8.133 -25.019 52.924 1.00 0.00 H ATOM 7118 N ARG B 207 6.266 -22.324 52.623 1.00 27.77 N ATOM 7119 CA ARG B 207 5.137 -21.412 52.525 1.00 28.02 C ATOM 7120 C ARG B 207 5.099 -20.611 53.790 1.00 30.40 C ATOM 7121 O ARG B 207 4.771 -19.419 53.798 1.00 30.83 O ATOM 7122 CB ARG B 207 3.809 -22.177 52.325 1.00 28.61 C ATOM 7123 CG ARG B 207 2.504 -21.321 52.358 1.00 28.66 C ATOM 7124 CD ARG B 207 2.459 -20.196 51.293 1.00 31.53 C ATOM 7125 NE ARG B 207 1.293 -19.291 51.386 1.00 27.76 N ATOM 7126 CZ ARG B 207 1.224 -18.210 52.169 1.00 24.92 C ATOM 7127 NH1 ARG B 207 2.223 -17.895 52.990 1.00 22.76 N ATOM 7128 NH2 ARG B 207 0.144 -17.442 52.159 1.00 20.55 N ATOM 7129 HA ARG B 207 5.257 -20.762 51.658 1.00 0.00 H ATOM 7130 HB2 ARG B 207 3.855 -22.675 51.356 1.00 0.00 H ATOM 7131 HB3 ARG B 207 3.735 -22.926 53.114 1.00 0.00 H ATOM 7132 HG2 ARG B 207 1.655 -21.984 52.192 1.00 0.00 H ATOM 7133 HG3 ARG B 207 2.419 -20.863 53.344 1.00 0.00 H ATOM 7134 HD2 ARG B 207 2.447 -20.663 50.308 1.00 0.00 H ATOM 7135 HD3 ARG B 207 3.362 -19.595 51.398 1.00 0.00 H ATOM 7136 HE ARG B 207 0.464 -19.512 50.798 1.00 0.00 H ATOM 7137 HH12 ARG B 207 2.154 -17.050 53.593 1.00 0.00 H ATOM 7138 HH11 ARG B 207 3.073 -18.493 53.029 1.00 0.00 H ATOM 7139 HH22 ARG B 207 0.097 -16.602 52.771 1.00 0.00 H ATOM 7140 HH21 ARG B 207 -0.657 -17.679 51.539 1.00 0.00 H ATOM 7141 H ARG B 207 6.082 -23.324 52.841 1.00 0.00 H ATOM 7142 N ALA B 208 5.442 -21.283 54.874 1.00 32.43 N ATOM 7143 CA ALA B 208 5.588 -20.630 56.168 1.00 32.04 C ATOM 7144 C ALA B 208 6.755 -19.632 56.113 1.00 26.35 C ATOM 7145 O ALA B 208 6.614 -18.529 56.559 1.00 21.65 O ATOM 7146 CB ALA B 208 5.766 -21.668 57.290 1.00 29.57 C ATOM 7147 HA ALA B 208 4.678 -20.075 56.397 1.00 0.00 H ATOM 7148 HB1 ALA B 208 4.893 -22.320 57.322 1.00 0.00 H ATOM 7149 HB2 ALA B 208 6.658 -22.263 57.095 1.00 0.00 H ATOM 7150 HB3 ALA B 208 5.873 -21.154 58.245 1.00 0.00 H ATOM 7151 H ALA B 208 5.613 -22.306 54.802 1.00 0.00 H ATOM 7152 N ALA B 209 7.866 -19.992 55.480 1.00 25.38 N ATOM 7153 CA ALA B 209 9.018 -19.097 55.468 1.00 28.10 C ATOM 7154 C ALA B 209 8.859 -17.915 54.472 1.00 23.30 C ATOM 7155 O ALA B 209 9.478 -16.872 54.651 1.00 21.64 O ATOM 7156 CB ALA B 209 10.337 -19.889 55.219 1.00 19.50 C ATOM 7157 HA ALA B 209 9.075 -18.646 56.459 1.00 0.00 H ATOM 7158 HB1 ALA B 209 10.473 -20.624 56.012 1.00 0.00 H ATOM 7159 HB2 ALA B 209 10.278 -20.397 54.257 1.00 0.00 H ATOM 7160 HB3 ALA B 209 11.179 -19.197 55.215 1.00 0.00 H ATOM 7161 H ALA B 209 7.914 -20.910 54.994 1.00 0.00 H ATOM 7162 N ALA B 210 8.041 -18.117 53.431 1.00 26.50 N ATOM 7163 CA ALA B 210 7.765 -17.143 52.353 1.00 24.31 C ATOM 7164 C ALA B 210 7.101 -15.843 52.870 1.00 26.16 C ATOM 7165 O ALA B 210 7.279 -14.790 52.280 1.00 26.50 O ATOM 7166 CB ALA B 210 6.912 -17.768 51.302 1.00 20.16 C ATOM 7167 HA ALA B 210 8.729 -16.861 51.929 1.00 0.00 H ATOM 7168 HB1 ALA B 210 7.429 -18.630 50.881 1.00 0.00 H ATOM 7169 HB2 ALA B 210 5.969 -18.089 51.745 1.00 0.00 H ATOM 7170 HB3 ALA B 210 6.716 -17.040 50.514 1.00 0.00 H ATOM 7171 H ALA B 210 7.559 -19.037 53.376 1.00 0.00 H ATOM 7172 N VAL B 211 6.356 -15.923 53.977 1.00 26.48 N ATOM 7173 CA VAL B 211 5.822 -14.730 54.645 1.00 31.07 C ATOM 7174 C VAL B 211 6.913 -13.668 54.979 1.00 23.57 C ATOM 7175 O VAL B 211 6.606 -12.497 55.142 1.00 30.15 O ATOM 7176 CB VAL B 211 4.985 -15.116 55.926 1.00 28.66 C ATOM 7177 CG1 VAL B 211 5.900 -15.658 57.000 1.00 35.23 C ATOM 7178 CG2 VAL B 211 4.286 -13.906 56.487 1.00 24.76 C ATOM 7179 HA VAL B 211 5.152 -14.257 53.927 1.00 0.00 H ATOM 7180 HB VAL B 211 4.253 -15.868 55.630 1.00 0.00 H ATOM 7181 HG11 VAL B 211 6.412 -16.545 56.626 1.00 0.00 H ATOM 7182 HG12 VAL B 211 6.634 -14.898 57.267 1.00 0.00 H ATOM 7183 HG13 VAL B 211 5.311 -15.921 57.879 1.00 0.00 H ATOM 7184 HG21 VAL B 211 5.027 -13.155 56.762 1.00 0.00 H ATOM 7185 HG22 VAL B 211 3.612 -13.496 55.735 1.00 0.00 H ATOM 7186 HG23 VAL B 211 3.715 -14.194 57.369 1.00 0.00 H ATOM 7187 H VAL B 211 6.148 -16.860 54.378 1.00 0.00 H ATOM 7188 N ALA B 212 8.174 -14.075 55.069 1.00 25.42 N ATOM 7189 CA ALA B 212 9.282 -13.158 55.431 1.00 23.71 C ATOM 7190 C ALA B 212 9.574 -12.076 54.377 1.00 25.12 C ATOM 7191 O ALA B 212 10.128 -10.989 54.719 1.00 24.29 O ATOM 7192 CB ALA B 212 10.538 -13.938 55.714 1.00 19.66 C ATOM 7193 HA ALA B 212 8.947 -12.635 56.327 1.00 0.00 H ATOM 7194 HB1 ALA B 212 10.359 -14.624 56.542 1.00 0.00 H ATOM 7195 HB2 ALA B 212 10.821 -14.504 54.826 1.00 0.00 H ATOM 7196 HB3 ALA B 212 11.340 -13.249 55.978 1.00 0.00 H ATOM 7197 H ALA B 212 8.393 -15.074 54.879 1.00 0.00 H ATOM 7198 N LEU B 213 9.243 -12.346 53.110 1.00 17.16 N ATOM 7199 CA LEU B 213 9.466 -11.283 52.109 1.00 18.86 C ATOM 7200 C LEU B 213 8.551 -10.065 52.327 1.00 17.78 C ATOM 7201 O LEU B 213 9.051 -8.962 52.404 1.00 22.59 O ATOM 7202 CB LEU B 213 9.339 -11.767 50.680 1.00 17.53 C ATOM 7203 CG LEU B 213 10.396 -12.656 50.045 1.00 24.83 C ATOM 7204 CD1 LEU B 213 10.105 -14.050 50.511 1.00 23.04 C ATOM 7205 CD2 LEU B 213 10.319 -12.536 48.489 1.00 20.60 C ATOM 7206 HA LEU B 213 10.500 -10.974 52.264 1.00 0.00 H ATOM 7207 HB2 LEU B 213 8.400 -12.317 50.624 1.00 0.00 H ATOM 7208 HB3 LEU B 213 9.273 -10.875 50.058 1.00 0.00 H ATOM 7209 HG LEU B 213 11.407 -12.367 50.333 1.00 0.00 H ATOM 7210 HD21 LEU B 213 9.331 -12.849 48.150 1.00 0.00 H ATOM 7211 HD22 LEU B 213 10.494 -11.501 48.197 1.00 0.00 H ATOM 7212 HD23 LEU B 213 11.079 -13.175 48.039 1.00 0.00 H ATOM 7213 HD11 LEU B 213 10.162 -14.087 51.599 1.00 0.00 H ATOM 7214 HD12 LEU B 213 9.104 -14.338 50.189 1.00 0.00 H ATOM 7215 HD13 LEU B 213 10.837 -14.735 50.083 1.00 0.00 H ATOM 7216 H LEU B 213 8.844 -13.268 52.840 1.00 0.00 H ATOM 7217 N SER B 214 7.225 -10.258 52.398 1.00 13.31 N ATOM 7218 CA SER B 214 6.332 -9.164 52.747 1.00 20.70 C ATOM 7219 C SER B 214 6.554 -8.605 54.181 1.00 21.54 C ATOM 7220 O SER B 214 6.563 -7.384 54.373 1.00 22.53 O ATOM 7221 CB SER B 214 4.862 -9.508 52.453 1.00 21.07 C ATOM 7222 OG SER B 214 4.438 -10.624 53.196 1.00 21.59 O ATOM 7223 HA SER B 214 6.599 -8.338 52.088 1.00 0.00 H ATOM 7224 HB2 SER B 214 4.754 -9.727 51.391 1.00 0.00 H ATOM 7225 HB3 SER B 214 4.239 -8.652 52.711 1.00 0.00 H ATOM 7226 HG SER B 214 4.997 -11.407 52.962 1.00 0.00 H ATOM 7227 H SER B 214 6.831 -11.200 52.201 1.00 0.00 H ATOM 7228 N ALA B 215 6.759 -9.499 55.152 1.00 17.67 N ATOM 7229 CA ALA B 215 7.064 -9.103 56.519 1.00 14.63 C ATOM 7230 C ALA B 215 8.248 -8.139 56.548 1.00 17.34 C ATOM 7231 O ALA B 215 8.209 -7.105 57.213 1.00 22.85 O ATOM 7232 CB ALA B 215 7.363 -10.306 57.346 1.00 15.78 C ATOM 7233 HA ALA B 215 6.194 -8.594 56.934 1.00 0.00 H ATOM 7234 HB1 ALA B 215 6.497 -10.967 57.349 1.00 0.00 H ATOM 7235 HB2 ALA B 215 8.221 -10.831 56.925 1.00 0.00 H ATOM 7236 HB3 ALA B 215 7.590 -9.997 58.366 1.00 0.00 H ATOM 7237 H ALA B 215 6.699 -10.512 54.924 1.00 0.00 H ATOM 7238 N ALA B 216 9.302 -8.478 55.811 1.00 16.58 N ATOM 7239 CA ALA B 216 10.511 -7.691 55.789 1.00 14.45 C ATOM 7240 C ALA B 216 10.321 -6.327 55.139 1.00 20.34 C ATOM 7241 O ALA B 216 11.013 -5.378 55.500 1.00 22.47 O ATOM 7242 CB ALA B 216 11.570 -8.430 55.046 1.00 7.04 C ATOM 7243 HA ALA B 216 10.798 -7.525 56.827 1.00 0.00 H ATOM 7244 HB1 ALA B 216 11.763 -9.381 55.542 1.00 0.00 H ATOM 7245 HB2 ALA B 216 11.235 -8.613 54.025 1.00 0.00 H ATOM 7246 HB3 ALA B 216 12.483 -7.835 55.030 1.00 0.00 H ATOM 7247 H ALA B 216 9.253 -9.340 55.231 1.00 0.00 H ATOM 7248 N LEU B 217 9.415 -6.257 54.154 1.00 24.13 N ATOM 7249 CA LEU B 217 9.231 -5.060 53.358 1.00 21.67 C ATOM 7250 C LEU B 217 8.375 -4.058 54.114 1.00 26.74 C ATOM 7251 O LEU B 217 8.629 -2.840 54.033 1.00 30.38 O ATOM 7252 CB LEU B 217 8.673 -5.372 51.947 1.00 22.12 C ATOM 7253 CG LEU B 217 9.573 -6.006 50.833 1.00 21.03 C ATOM 7254 CD1 LEU B 217 8.956 -5.868 49.487 1.00 23.36 C ATOM 7255 CD2 LEU B 217 10.903 -5.421 50.712 1.00 27.42 C ATOM 7256 HA LEU B 217 10.209 -4.608 53.191 1.00 0.00 H ATOM 7257 HB2 LEU B 217 7.835 -6.054 52.091 1.00 0.00 H ATOM 7258 HB3 LEU B 217 8.306 -4.428 51.545 1.00 0.00 H ATOM 7259 HG LEU B 217 9.662 -7.044 51.153 1.00 0.00 H ATOM 7260 HD21 LEU B 217 10.812 -4.361 50.476 1.00 0.00 H ATOM 7261 HD22 LEU B 217 11.438 -5.541 51.654 1.00 0.00 H ATOM 7262 HD23 LEU B 217 11.449 -5.926 49.915 1.00 0.00 H ATOM 7263 HD11 LEU B 217 7.990 -6.372 49.478 1.00 0.00 H ATOM 7264 HD12 LEU B 217 8.818 -4.811 49.259 1.00 0.00 H ATOM 7265 HD13 LEU B 217 9.610 -6.320 48.741 1.00 0.00 H ATOM 7266 H LEU B 217 8.824 -7.089 53.954 1.00 0.00 H ATOM 7267 N THR B 218 7.383 -4.567 54.857 1.00 18.76 N ATOM 7268 CA THR B 218 6.508 -3.726 55.666 1.00 22.20 C ATOM 7269 C THR B 218 7.213 -3.287 56.959 1.00 20.35 C ATOM 7270 O THR B 218 7.088 -2.160 57.370 1.00 26.40 O ATOM 7271 CB THR B 218 5.184 -4.445 55.959 1.00 30.50 C ATOM 7272 OG1 THR B 218 5.485 -5.734 56.519 1.00 39.20 O ATOM 7273 CG2 THR B 218 4.407 -4.703 54.667 1.00 30.41 C ATOM 7274 HA THR B 218 6.275 -2.825 55.099 1.00 0.00 H ATOM 7275 HB THR B 218 4.596 -3.822 56.633 1.00 0.00 H ATOM 7276 HG1 THR B 218 6.020 -6.257 55.871 1.00 0.00 H ATOM 7277 HG23 THR B 218 4.153 -3.751 54.201 1.00 0.00 H ATOM 7278 HG21 THR B 218 5.022 -5.290 53.985 1.00 0.00 H ATOM 7279 HG22 THR B 218 3.493 -5.251 54.897 1.00 0.00 H ATOM 7280 H THR B 218 7.232 -5.596 54.857 1.00 0.00 H ATOM 7281 N ALA B 219 7.996 -4.159 57.586 1.00 20.75 N ATOM 7282 CA ALA B 219 8.915 -3.689 58.615 1.00 20.34 C ATOM 7283 C ALA B 219 9.752 -2.509 58.099 1.00 18.95 C ATOM 7284 O ALA B 219 9.818 -1.459 58.725 1.00 19.38 O ATOM 7285 CB ALA B 219 9.822 -4.825 59.111 1.00 21.46 C ATOM 7286 HA ALA B 219 8.321 -3.343 59.461 1.00 0.00 H ATOM 7287 HB1 ALA B 219 9.208 -5.622 59.530 1.00 0.00 H ATOM 7288 HB2 ALA B 219 10.404 -5.214 58.276 1.00 0.00 H ATOM 7289 HB3 ALA B 219 10.496 -4.442 59.878 1.00 0.00 H ATOM 7290 H ALA B 219 7.953 -5.170 57.344 1.00 0.00 H ATOM 7291 N ALA B 220 10.385 -2.688 56.952 1.00 19.23 N ATOM 7292 CA ALA B 220 11.243 -1.651 56.409 1.00 22.38 C ATOM 7293 C ALA B 220 10.491 -0.326 56.188 1.00 24.88 C ATOM 7294 O ALA B 220 10.964 0.729 56.624 1.00 28.75 O ATOM 7295 CB ALA B 220 11.881 -2.119 55.137 1.00 18.41 C ATOM 7296 HA ALA B 220 12.022 -1.453 57.146 1.00 0.00 H ATOM 7297 HB1 ALA B 220 12.479 -3.008 55.338 1.00 0.00 H ATOM 7298 HB2 ALA B 220 11.105 -2.358 54.409 1.00 0.00 H ATOM 7299 HB3 ALA B 220 12.521 -1.331 54.742 1.00 0.00 H ATOM 7300 H ALA B 220 10.267 -3.582 56.433 1.00 0.00 H ATOM 7301 N ALA B 221 9.318 -0.396 55.545 1.00 20.55 N ATOM 7302 CA ALA B 221 8.481 0.768 55.279 1.00 21.57 C ATOM 7303 C ALA B 221 8.160 1.579 56.546 1.00 20.90 C ATOM 7304 O ALA B 221 8.044 2.811 56.485 1.00 24.12 O ATOM 7305 CB ALA B 221 7.198 0.362 54.540 1.00 10.58 C ATOM 7306 HA ALA B 221 9.060 1.427 54.633 1.00 0.00 H ATOM 7307 HB1 ALA B 221 7.460 -0.107 53.591 1.00 0.00 H ATOM 7308 HB2 ALA B 221 6.635 -0.343 55.152 1.00 0.00 H ATOM 7309 HB3 ALA B 221 6.592 1.248 54.354 1.00 0.00 H ATOM 7310 H ALA B 221 8.988 -1.327 55.219 1.00 0.00 H ATOM 7311 N HIS B 222 8.039 0.882 57.678 1.00 22.71 N ATOM 7312 CA HIS B 222 7.718 1.484 58.998 1.00 23.58 C ATOM 7313 C HIS B 222 8.955 1.934 59.814 1.00 24.37 C ATOM 7314 O HIS B 222 8.868 2.830 60.632 1.00 26.73 O ATOM 7315 CB HIS B 222 6.801 0.537 59.787 1.00 22.68 C ATOM 7316 CG HIS B 222 5.372 0.561 59.304 1.00 23.96 C ATOM 7317 ND1 HIS B 222 4.897 -0.287 58.317 1.00 25.52 N ATOM 7318 CD2 HIS B 222 4.330 1.362 59.648 1.00 24.16 C ATOM 7319 CE1 HIS B 222 3.628 0.003 58.069 1.00 30.33 C ATOM 7320 NE2 HIS B 222 3.263 1.006 58.857 1.00 28.61 N ATOM 7321 HA HIS B 222 7.186 2.415 58.804 1.00 0.00 H ATOM 7322 HB2 HIS B 222 7.184 -0.479 59.689 1.00 0.00 H ATOM 7323 HB3 HIS B 222 6.818 0.831 60.836 1.00 0.00 H ATOM 7324 HD2 HIS B 222 4.338 2.142 60.409 1.00 0.00 H ATOM 7325 HE1 HIS B 222 2.991 -0.498 57.340 1.00 0.00 H ATOM 7326 H HIS B 222 8.178 -0.148 57.633 1.00 0.00 H ATOM 7327 N ALA B 223 10.088 1.290 59.551 1.00 21.61 N ATOM 7328 CA ALA B 223 11.366 1.615 60.104 1.00 23.99 C ATOM 7329 C ALA B 223 11.945 2.848 59.402 1.00 28.11 C ATOM 7330 O ALA B 223 12.971 3.373 59.820 1.00 27.76 O ATOM 7331 CB ALA B 223 12.314 0.422 59.876 1.00 18.66 C ATOM 7332 HA ALA B 223 11.260 1.826 61.168 1.00 0.00 H ATOM 7333 HB1 ALA B 223 11.908 -0.462 60.368 1.00 0.00 H ATOM 7334 HB2 ALA B 223 12.408 0.233 58.807 1.00 0.00 H ATOM 7335 HB3 ALA B 223 13.294 0.654 60.292 1.00 0.00 H ATOM 7336 H ALA B 223 10.041 0.487 58.892 1.00 0.00 H ATOM 7337 N ALA B 224 11.318 3.281 58.312 1.00 25.95 N ATOM 7338 CA ALA B 224 11.922 4.308 57.453 1.00 29.76 C ATOM 7339 C ALA B 224 11.875 5.743 58.007 1.00 20.93 C ATOM 7340 O ALA B 224 12.653 6.567 57.574 1.00 29.30 O ATOM 7341 CB ALA B 224 11.368 4.231 56.011 1.00 24.81 C ATOM 7342 HA ALA B 224 12.984 4.064 57.436 1.00 0.00 H ATOM 7343 HB1 ALA B 224 11.590 3.251 55.590 1.00 0.00 H ATOM 7344 HB2 ALA B 224 10.289 4.384 56.029 1.00 0.00 H ATOM 7345 HB3 ALA B 224 11.836 5.004 55.402 1.00 0.00 H ATOM 7346 H ALA B 224 10.388 2.887 58.065 1.00 0.00 H ATOM 7347 N THR B 225 11.027 6.006 59.003 1.00 23.79 N ATOM 7348 CA THR B 225 11.107 7.258 59.779 1.00 17.75 C ATOM 7349 C THR B 225 12.476 7.498 60.385 1.00 25.43 C ATOM 7350 O THR B 225 12.900 8.644 60.504 1.00 31.36 O ATOM 7351 CB THR B 225 10.086 7.348 60.876 1.00 17.15 C ATOM 7352 OG1 THR B 225 10.276 6.277 61.804 1.00 18.51 O ATOM 7353 CG2 THR B 225 8.687 7.289 60.302 1.00 19.73 C ATOM 7354 HA THR B 225 10.900 8.031 59.038 1.00 0.00 H ATOM 7355 HB THR B 225 10.211 8.299 61.393 1.00 0.00 H ATOM 7356 HG1 THR B 225 9.600 6.342 62.524 1.00 0.00 H ATOM 7357 HG23 THR B 225 8.550 8.108 59.596 1.00 0.00 H ATOM 7358 HG21 THR B 225 8.546 6.338 59.789 1.00 0.00 H ATOM 7359 HG22 THR B 225 7.960 7.379 61.109 1.00 0.00 H ATOM 7360 H THR B 225 10.291 5.310 59.238 1.00 0.00 H ATOM 7361 N ALA B 226 13.160 6.413 60.765 1.00 29.86 N ATOM 7362 CA ALA B 226 14.562 6.455 61.211 1.00 28.20 C ATOM 7363 C ALA B 226 15.572 6.534 60.048 1.00 23.99 C ATOM 7364 O ALA B 226 16.765 6.528 60.290 1.00 27.53 O ATOM 7365 CB ALA B 226 14.882 5.249 62.125 1.00 26.95 C ATOM 7366 HA ALA B 226 14.673 7.378 61.780 1.00 0.00 H ATOM 7367 HB1 ALA B 226 14.233 5.276 63.000 1.00 0.00 H ATOM 7368 HB2 ALA B 226 14.715 4.323 61.575 1.00 0.00 H ATOM 7369 HB3 ALA B 226 15.924 5.301 62.442 1.00 0.00 H ATOM 7370 H ALA B 226 12.676 5.493 60.744 1.00 0.00 H ATOM 7371 N GLY B 227 15.116 6.628 58.802 1.00 20.83 N ATOM 7372 CA GLY B 227 16.049 6.714 57.672 1.00 21.86 C ATOM 7373 C GLY B 227 16.380 5.375 56.953 1.00 30.45 C ATOM 7374 O GLY B 227 15.965 4.270 57.396 1.00 29.96 O ATOM 7375 HA3 GLY B 227 16.984 7.133 58.043 1.00 0.00 H ATOM 7376 HA2 GLY B 227 15.617 7.390 56.934 1.00 0.00 H ATOM 7377 H GLY B 227 14.091 6.641 58.627 1.00 0.00 H ATOM 7378 N ALA B 228 17.161 5.478 55.871 1.00 18.67 N ATOM 7379 CA ALA B 228 17.329 4.414 54.889 1.00 22.10 C ATOM 7380 C ALA B 228 18.109 3.232 55.402 1.00 26.41 C ATOM 7381 O ALA B 228 17.801 2.108 55.015 1.00 33.44 O ATOM 7382 CB ALA B 228 17.983 4.933 53.635 1.00 22.38 C ATOM 7383 HA ALA B 228 16.320 4.065 54.670 1.00 0.00 H ATOM 7384 HB1 ALA B 228 17.361 5.716 53.200 1.00 0.00 H ATOM 7385 HB2 ALA B 228 18.964 5.341 53.880 1.00 0.00 H ATOM 7386 HB3 ALA B 228 18.095 4.117 52.921 1.00 0.00 H ATOM 7387 H ALA B 228 17.678 6.368 55.722 1.00 0.00 H ATOM 7388 N GLN B 229 19.117 3.453 56.246 1.00 21.93 N ATOM 7389 CA GLN B 229 19.848 2.318 56.767 1.00 25.45 C ATOM 7390 C GLN B 229 18.957 1.472 57.687 1.00 25.46 C ATOM 7391 O GLN B 229 18.994 0.255 57.609 1.00 33.70 O ATOM 7392 CB GLN B 229 21.133 2.742 57.479 1.00 26.23 C ATOM 7393 CG GLN B 229 22.191 1.608 57.625 1.00 37.11 C ATOM 7394 CD GLN B 229 22.592 0.966 56.272 1.00 40.09 C ATOM 7395 OE1 GLN B 229 23.168 1.622 55.412 1.00 45.87 O ATOM 7396 NE2 GLN B 229 22.263 -0.308 56.090 1.00 36.53 N ATOM 7397 HA GLN B 229 20.144 1.703 55.917 1.00 0.00 H ATOM 7398 HB2 GLN B 229 21.583 3.558 56.914 1.00 0.00 H ATOM 7399 HB3 GLN B 229 20.870 3.094 58.477 1.00 0.00 H ATOM 7400 HG2 GLN B 229 23.085 2.026 58.089 1.00 0.00 H ATOM 7401 HG3 GLN B 229 21.779 0.831 58.269 1.00 0.00 H ATOM 7402 HE22 GLN B 229 21.774 -0.832 56.844 1.00 0.00 H ATOM 7403 HE21 GLN B 229 22.494 -0.782 55.193 1.00 0.00 H ATOM 7404 H GLN B 229 19.373 4.422 56.524 1.00 0.00 H ATOM 7405 N ALA B 230 18.171 2.120 58.547 1.00 20.69 N ATOM 7406 CA ALA B 230 17.250 1.455 59.452 1.00 21.37 C ATOM 7407 C ALA B 230 16.188 0.631 58.700 1.00 23.57 C ATOM 7408 O ALA B 230 15.860 -0.452 59.133 1.00 28.43 O ATOM 7409 CB ALA B 230 16.550 2.488 60.316 1.00 29.42 C ATOM 7410 HA ALA B 230 17.835 0.771 60.066 1.00 0.00 H ATOM 7411 HB1 ALA B 230 17.292 3.039 60.894 1.00 0.00 H ATOM 7412 HB2 ALA B 230 15.997 3.178 59.679 1.00 0.00 H ATOM 7413 HB3 ALA B 230 15.860 1.985 60.994 1.00 0.00 H ATOM 7414 H ALA B 230 18.220 3.159 58.571 1.00 0.00 H ATOM 7415 N ALA B 231 15.634 1.163 57.606 1.00 16.01 N ATOM 7416 CA ALA B 231 14.781 0.413 56.720 1.00 24.38 C ATOM 7417 C ALA B 231 15.466 -0.864 56.145 1.00 27.19 C ATOM 7418 O ALA B 231 14.945 -1.983 56.272 1.00 25.66 O ATOM 7419 CB ALA B 231 14.232 1.323 55.586 1.00 21.77 C ATOM 7420 HA ALA B 231 13.942 0.058 57.318 1.00 0.00 H ATOM 7421 HB1 ALA B 231 13.657 2.139 56.023 1.00 0.00 H ATOM 7422 HB2 ALA B 231 15.065 1.730 55.013 1.00 0.00 H ATOM 7423 HB3 ALA B 231 13.590 0.736 54.929 1.00 0.00 H ATOM 7424 H ALA B 231 15.827 2.161 57.385 1.00 0.00 H ATOM 7425 N LEU B 232 16.638 -0.693 55.535 1.00 29.73 N ATOM 7426 CA LEU B 232 17.364 -1.825 54.983 1.00 25.77 C ATOM 7427 C LEU B 232 17.679 -2.854 56.046 1.00 23.95 C ATOM 7428 O LEU B 232 17.544 -4.024 55.815 1.00 27.85 O ATOM 7429 CB LEU B 232 18.650 -1.353 54.279 1.00 27.89 C ATOM 7430 CG LEU B 232 18.461 -0.811 52.860 1.00 31.18 C ATOM 7431 CD1 LEU B 232 19.679 -0.010 52.408 1.00 29.87 C ATOM 7432 CD2 LEU B 232 18.096 -1.931 51.854 1.00 22.90 C ATOM 7433 HA LEU B 232 16.721 -2.303 54.244 1.00 0.00 H ATOM 7434 HB2 LEU B 232 19.095 -0.563 54.884 1.00 0.00 H ATOM 7435 HB3 LEU B 232 19.335 -2.199 54.228 1.00 0.00 H ATOM 7436 HG LEU B 232 17.612 -0.128 52.883 1.00 0.00 H ATOM 7437 HD21 LEU B 232 18.895 -2.672 51.832 1.00 0.00 H ATOM 7438 HD22 LEU B 232 17.166 -2.407 52.164 1.00 0.00 H ATOM 7439 HD23 LEU B 232 17.972 -1.499 50.861 1.00 0.00 H ATOM 7440 HD11 LEU B 232 19.831 0.831 53.085 1.00 0.00 H ATOM 7441 HD12 LEU B 232 20.560 -0.652 52.421 1.00 0.00 H ATOM 7442 HD13 LEU B 232 19.513 0.361 51.397 1.00 0.00 H ATOM 7443 H LEU B 232 17.039 0.263 55.453 1.00 0.00 H ATOM 7444 N ASP B 233 18.124 -2.401 57.211 1.00 26.40 N ATOM 7445 CA ASP B 233 18.512 -3.274 58.295 1.00 27.55 C ATOM 7446 C ASP B 233 17.331 -4.016 58.919 1.00 27.22 C ATOM 7447 O ASP B 233 17.480 -5.160 59.345 1.00 28.48 O ATOM 7448 CB ASP B 233 19.180 -2.447 59.380 1.00 32.47 C ATOM 7449 CG ASP B 233 20.617 -2.096 59.070 1.00 33.51 C ATOM 7450 OD1 ASP B 233 21.160 -2.415 57.979 1.00 33.61 O ATOM 7451 OD2 ASP B 233 21.209 -1.510 59.975 1.00 35.79 O ATOM 7452 HA ASP B 233 19.188 -4.019 57.876 1.00 0.00 H ATOM 7453 HB2 ASP B 233 18.617 -1.522 59.505 1.00 0.00 H ATOM 7454 HB3 ASP B 233 19.156 -3.014 60.311 1.00 0.00 H ATOM 7455 H ASP B 233 18.197 -1.373 57.350 1.00 0.00 H ATOM 7456 N ALA B 234 16.168 -3.364 58.989 1.00 23.09 N ATOM 7457 CA ALA B 234 14.958 -4.023 59.510 1.00 22.13 C ATOM 7458 C ALA B 234 14.506 -5.112 58.531 1.00 23.66 C ATOM 7459 O ALA B 234 14.205 -6.227 58.973 1.00 28.08 O ATOM 7460 CB ALA B 234 13.852 -3.048 59.758 1.00 15.49 C ATOM 7461 HA ALA B 234 15.206 -4.475 60.470 1.00 0.00 H ATOM 7462 HB1 ALA B 234 14.179 -2.308 60.489 1.00 0.00 H ATOM 7463 HB2 ALA B 234 13.593 -2.549 58.824 1.00 0.00 H ATOM 7464 HB3 ALA B 234 12.981 -3.579 60.141 1.00 0.00 H ATOM 7465 H ALA B 234 16.116 -2.375 58.671 1.00 0.00 H ATOM 7466 N ALA B 235 14.530 -4.816 57.217 1.00 15.31 N ATOM 7467 CA ALA B 235 14.256 -5.830 56.217 1.00 19.77 C ATOM 7468 C ALA B 235 15.208 -7.013 56.305 1.00 19.58 C ATOM 7469 O ALA B 235 14.771 -8.158 56.240 1.00 17.81 O ATOM 7470 CB ALA B 235 14.250 -5.252 54.840 1.00 15.33 C ATOM 7471 HA ALA B 235 13.257 -6.210 56.432 1.00 0.00 H ATOM 7472 HB1 ALA B 235 13.480 -4.483 54.773 1.00 0.00 H ATOM 7473 HB2 ALA B 235 15.224 -4.811 54.628 1.00 0.00 H ATOM 7474 HB3 ALA B 235 14.041 -6.041 54.117 1.00 0.00 H ATOM 7475 H ALA B 235 14.748 -3.845 56.915 1.00 0.00 H ATOM 7476 N ARG B 236 16.500 -6.742 56.462 1.00 20.98 N ATOM 7477 CA ARG B 236 17.474 -7.824 56.500 1.00 22.72 C ATOM 7478 C ARG B 236 17.359 -8.705 57.737 1.00 24.18 C ATOM 7479 O ARG B 236 17.557 -9.912 57.644 1.00 21.22 O ATOM 7480 CB ARG B 236 18.907 -7.348 56.237 1.00 22.22 C ATOM 7481 CG ARG B 236 19.950 -8.469 56.293 1.00 34.55 C ATOM 7482 CD ARG B 236 19.791 -9.563 55.187 1.00 40.85 C ATOM 7483 NE ARG B 236 20.095 -9.002 53.861 1.00 51.13 N ATOM 7484 CZ ARG B 236 20.090 -9.671 52.707 1.00 48.67 C ATOM 7485 NH1 ARG B 236 19.792 -10.975 52.669 1.00 55.93 N ATOM 7486 NH2 ARG B 236 20.392 -9.022 51.592 1.00 40.13 N ATOM 7487 HA ARG B 236 17.214 -8.471 55.662 1.00 0.00 H ATOM 7488 HB2 ARG B 236 18.943 -6.894 55.247 1.00 0.00 H ATOM 7489 HB3 ARG B 236 19.165 -6.601 56.987 1.00 0.00 H ATOM 7490 HG2 ARG B 236 20.938 -8.020 56.188 1.00 0.00 H ATOM 7491 HG3 ARG B 236 19.875 -8.955 57.266 1.00 0.00 H ATOM 7492 HD2 ARG B 236 18.766 -9.934 55.194 1.00 0.00 H ATOM 7493 HD3 ARG B 236 20.475 -10.386 55.394 1.00 0.00 H ATOM 7494 HE ARG B 236 20.336 -7.991 53.820 1.00 0.00 H ATOM 7495 HH12 ARG B 236 19.792 -11.482 51.761 1.00 0.00 H ATOM 7496 HH11 ARG B 236 19.560 -11.481 53.547 1.00 0.00 H ATOM 7497 HH22 ARG B 236 20.394 -9.525 50.682 1.00 0.00 H ATOM 7498 HH21 ARG B 236 20.627 -8.010 51.627 1.00 0.00 H ATOM 7499 H ARG B 236 16.816 -5.756 56.558 1.00 0.00 H ATOM 7500 N ALA B 237 17.035 -8.103 58.882 1.00 25.41 N ATOM 7501 CA ALA B 237 16.848 -8.835 60.122 1.00 18.64 C ATOM 7502 C ALA B 237 15.737 -9.847 59.942 1.00 22.95 C ATOM 7503 O ALA B 237 15.850 -10.981 60.407 1.00 21.18 O ATOM 7504 CB ALA B 237 16.470 -7.875 61.254 1.00 16.69 C ATOM 7505 HA ALA B 237 17.779 -9.340 60.378 1.00 0.00 H ATOM 7506 HB1 ALA B 237 17.266 -7.143 61.389 1.00 0.00 H ATOM 7507 HB2 ALA B 237 15.542 -7.362 60.999 1.00 0.00 H ATOM 7508 HB3 ALA B 237 16.333 -8.439 62.177 1.00 0.00 H ATOM 7509 H ALA B 237 16.912 -7.070 58.887 1.00 0.00 H ATOM 7510 N VAL B 238 14.642 -9.407 59.320 1.00 16.73 N ATOM 7511 CA VAL B 238 13.479 -10.264 59.117 1.00 20.45 C ATOM 7512 C VAL B 238 13.797 -11.466 58.175 1.00 24.05 C ATOM 7513 O VAL B 238 13.428 -12.635 58.484 1.00 23.60 O ATOM 7514 CB VAL B 238 12.236 -9.458 58.623 1.00 17.12 C ATOM 7515 CG1 VAL B 238 11.142 -10.413 58.258 1.00 15.37 C ATOM 7516 CG2 VAL B 238 11.732 -8.507 59.704 1.00 13.37 C ATOM 7517 HA VAL B 238 13.223 -10.680 60.092 1.00 0.00 H ATOM 7518 HB VAL B 238 12.531 -8.868 57.755 1.00 0.00 H ATOM 7519 HG11 VAL B 238 11.489 -11.074 57.464 1.00 0.00 H ATOM 7520 HG12 VAL B 238 10.871 -11.004 59.133 1.00 0.00 H ATOM 7521 HG13 VAL B 238 10.273 -9.853 57.913 1.00 0.00 H ATOM 7522 HG21 VAL B 238 11.448 -9.080 60.587 1.00 0.00 H ATOM 7523 HG22 VAL B 238 12.523 -7.804 59.965 1.00 0.00 H ATOM 7524 HG23 VAL B 238 10.866 -7.960 59.330 1.00 0.00 H ATOM 7525 H VAL B 238 14.617 -8.428 58.971 1.00 0.00 H ATOM 7526 N LEU B 239 14.457 -11.184 57.045 1.00 16.86 N ATOM 7527 CA LEU B 239 14.935 -12.264 56.154 1.00 21.45 C ATOM 7528 C LEU B 239 15.865 -13.216 56.866 1.00 20.65 C ATOM 7529 O LEU B 239 15.731 -14.443 56.720 1.00 22.47 O ATOM 7530 CB LEU B 239 15.619 -11.688 54.893 1.00 17.17 C ATOM 7531 CG LEU B 239 14.593 -10.888 54.063 1.00 18.25 C ATOM 7532 CD1 LEU B 239 15.272 -9.941 53.149 1.00 21.19 C ATOM 7533 CD2 LEU B 239 13.542 -11.796 53.322 1.00 17.40 C ATOM 7534 HA LEU B 239 14.055 -12.828 55.845 1.00 0.00 H ATOM 7535 HB2 LEU B 239 16.435 -11.030 55.192 1.00 0.00 H ATOM 7536 HB3 LEU B 239 16.015 -12.505 54.290 1.00 0.00 H ATOM 7537 HG LEU B 239 14.007 -10.302 54.771 1.00 0.00 H ATOM 7538 HD21 LEU B 239 14.062 -12.469 52.640 1.00 0.00 H ATOM 7539 HD22 LEU B 239 12.986 -12.379 54.056 1.00 0.00 H ATOM 7540 HD23 LEU B 239 12.853 -11.167 52.759 1.00 0.00 H ATOM 7541 HD11 LEU B 239 15.872 -9.242 53.732 1.00 0.00 H ATOM 7542 HD12 LEU B 239 15.918 -10.495 52.468 1.00 0.00 H ATOM 7543 HD13 LEU B 239 14.525 -9.391 52.577 1.00 0.00 H ATOM 7544 H LEU B 239 14.636 -10.192 56.790 1.00 0.00 H ATOM 7545 N ASP B 240 16.808 -12.653 57.637 1.00 17.88 N ATOM 7546 CA ASP B 240 17.721 -13.432 58.504 1.00 19.50 C ATOM 7547 C ASP B 240 17.104 -14.406 59.495 1.00 24.35 C ATOM 7548 O ASP B 240 17.764 -15.347 59.930 1.00 25.25 O ATOM 7549 CB ASP B 240 18.661 -12.521 59.228 1.00 20.34 C ATOM 7550 CG ASP B 240 19.736 -12.050 58.336 1.00 29.33 C ATOM 7551 OD1 ASP B 240 19.746 -12.463 57.151 1.00 32.03 O ATOM 7552 OD2 ASP B 240 20.571 -11.284 58.804 1.00 39.12 O ATOM 7553 HA ASP B 240 18.233 -14.075 57.788 1.00 0.00 H ATOM 7554 HB2 ASP B 240 18.106 -11.661 59.602 1.00 0.00 H ATOM 7555 HB3 ASP B 240 19.104 -13.059 60.066 1.00 0.00 H ATOM 7556 H ASP B 240 16.902 -11.617 57.625 1.00 0.00 H ATOM 7557 N ALA B 241 15.840 -14.187 59.819 1.00 20.32 N ATOM 7558 CA ALA B 241 15.161 -14.969 60.803 1.00 21.65 C ATOM 7559 C ALA B 241 14.416 -16.078 60.096 1.00 27.82 C ATOM 7560 O ALA B 241 13.724 -16.849 60.747 1.00 31.18 O ATOM 7561 CB ALA B 241 14.208 -14.120 61.544 1.00 13.74 C ATOM 7562 HA ALA B 241 15.877 -15.389 61.509 1.00 0.00 H ATOM 7563 HB1 ALA B 241 14.749 -13.312 62.035 1.00 0.00 H ATOM 7564 HB2 ALA B 241 13.480 -13.702 60.849 1.00 0.00 H ATOM 7565 HB3 ALA B 241 13.693 -14.722 62.293 1.00 0.00 H ATOM 7566 H ALA B 241 15.324 -13.421 59.342 1.00 0.00 H ATOM 7567 N ALA B 242 14.562 -16.182 58.771 1.00 28.66 N ATOM 7568 CA ALA B 242 13.813 -17.199 58.012 1.00 23.74 C ATOM 7569 C ALA B 242 14.731 -18.285 57.503 1.00 25.81 C ATOM 7570 O ALA B 242 15.796 -17.987 56.901 1.00 31.07 O ATOM 7571 CB ALA B 242 13.063 -16.579 56.864 1.00 24.56 C ATOM 7572 HA ALA B 242 13.091 -17.647 58.695 1.00 0.00 H ATOM 7573 HB1 ALA B 242 12.358 -15.842 57.248 1.00 0.00 H ATOM 7574 HB2 ALA B 242 13.769 -16.092 56.191 1.00 0.00 H ATOM 7575 HB3 ALA B 242 12.521 -17.355 56.324 1.00 0.00 H ATOM 7576 H ALA B 242 15.210 -15.540 58.272 1.00 0.00 H ATOM 7577 N PRO B 243 14.350 -19.561 57.732 1.00 23.22 N ATOM 7578 CA PRO B 243 15.138 -20.665 57.201 1.00 23.73 C ATOM 7579 C PRO B 243 14.777 -20.948 55.706 1.00 24.26 C ATOM 7580 O PRO B 243 13.633 -20.713 55.280 1.00 25.96 O ATOM 7581 CB PRO B 243 14.728 -21.807 58.112 1.00 26.44 C ATOM 7582 CG PRO B 243 13.245 -21.592 58.268 1.00 20.62 C ATOM 7583 CD PRO B 243 13.164 -20.061 58.455 1.00 33.02 C ATOM 7584 HA PRO B 243 16.213 -20.484 57.192 1.00 0.00 H ATOM 7585 HD3 PRO B 243 12.247 -19.663 58.021 1.00 0.00 H ATOM 7586 HD2 PRO B 243 13.210 -19.794 59.511 1.00 0.00 H ATOM 7587 HG3 PRO B 243 12.857 -22.119 59.139 1.00 0.00 H ATOM 7588 HG2 PRO B 243 12.702 -21.913 57.379 1.00 0.00 H ATOM 7589 HB2 PRO B 243 14.939 -22.772 57.652 1.00 0.00 H ATOM 7590 HB3 PRO B 243 15.238 -21.745 59.074 1.00 0.00 H ATOM 7591 N GLY B 244 15.747 -21.417 54.928 1.00 23.75 N ATOM 7592 CA GLY B 244 15.509 -21.896 53.564 1.00 23.35 C ATOM 7593 C GLY B 244 15.196 -20.797 52.550 1.00 28.37 C ATOM 7594 O GLY B 244 14.645 -21.094 51.479 1.00 24.61 O ATOM 7595 HA3 GLY B 244 14.666 -22.587 53.588 1.00 0.00 H ATOM 7596 HA2 GLY B 244 16.401 -22.425 53.228 1.00 0.00 H ATOM 7597 H GLY B 244 16.716 -21.445 55.303 1.00 0.00 H ATOM 7598 N VAL B 245 15.548 -19.561 52.861 1.00 23.29 N ATOM 7599 CA VAL B 245 15.248 -18.414 52.029 1.00 22.22 C ATOM 7600 C VAL B 245 16.473 -17.737 51.442 1.00 19.47 C ATOM 7601 O VAL B 245 17.125 -16.995 52.061 1.00 23.62 O ATOM 7602 CB VAL B 245 14.369 -17.375 52.744 1.00 22.28 C ATOM 7603 CG1 VAL B 245 14.149 -16.188 51.899 1.00 25.12 C ATOM 7604 CG2 VAL B 245 13.094 -17.928 53.148 1.00 21.88 C ATOM 7605 HA VAL B 245 14.684 -18.835 51.197 1.00 0.00 H ATOM 7606 HB VAL B 245 14.911 -17.077 53.641 1.00 0.00 H ATOM 7607 HG11 VAL B 245 15.109 -15.728 51.664 1.00 0.00 H ATOM 7608 HG12 VAL B 245 13.652 -16.488 50.976 1.00 0.00 H ATOM 7609 HG13 VAL B 245 13.524 -15.473 52.434 1.00 0.00 H ATOM 7610 HG21 VAL B 245 12.557 -18.280 52.267 1.00 0.00 H ATOM 7611 HG22 VAL B 245 13.261 -18.761 53.831 1.00 0.00 H ATOM 7612 HG23 VAL B 245 12.508 -17.158 53.649 1.00 0.00 H ATOM 7613 H VAL B 245 16.067 -19.404 53.749 1.00 0.00 H ATOM 7614 N ALA B 246 16.761 -18.002 50.204 1.00 16.80 N ATOM 7615 CA ALA B 246 17.942 -17.474 49.605 1.00 21.42 C ATOM 7616 C ALA B 246 17.737 -16.129 48.914 1.00 27.13 C ATOM 7617 O ALA B 246 17.090 -16.042 47.919 1.00 20.84 O ATOM 7618 CB ALA B 246 18.540 -18.491 48.684 1.00 16.03 C ATOM 7619 HA ALA B 246 18.644 -17.264 50.412 1.00 0.00 H ATOM 7620 HB1 ALA B 246 18.792 -19.388 49.250 1.00 0.00 H ATOM 7621 HB2 ALA B 246 17.820 -18.741 47.905 1.00 0.00 H ATOM 7622 HB3 ALA B 246 19.442 -18.082 48.229 1.00 0.00 H ATOM 7623 H ALA B 246 16.125 -18.605 49.644 1.00 0.00 H ATOM 7624 N VAL B 247 18.322 -15.086 49.482 1.00 28.08 N ATOM 7625 CA VAL B 247 18.126 -13.730 49.000 1.00 30.14 C ATOM 7626 C VAL B 247 19.000 -13.364 47.822 1.00 35.42 C ATOM 7627 O VAL B 247 20.187 -13.271 47.935 1.00 37.67 O ATOM 7628 CB VAL B 247 18.279 -12.674 50.105 1.00 30.92 C ATOM 7629 CG1 VAL B 247 18.223 -11.292 49.538 1.00 26.50 C ATOM 7630 CG2 VAL B 247 17.241 -12.835 51.131 1.00 23.83 C ATOM 7631 HA VAL B 247 17.092 -13.725 48.654 1.00 0.00 H ATOM 7632 HB VAL B 247 19.255 -12.821 50.567 1.00 0.00 H ATOM 7633 HG11 VAL B 247 19.030 -11.163 48.817 1.00 0.00 H ATOM 7634 HG12 VAL B 247 17.264 -11.143 49.042 1.00 0.00 H ATOM 7635 HG13 VAL B 247 18.334 -10.566 50.343 1.00 0.00 H ATOM 7636 HG21 VAL B 247 16.258 -12.724 50.673 1.00 0.00 H ATOM 7637 HG22 VAL B 247 17.324 -13.826 51.578 1.00 0.00 H ATOM 7638 HG23 VAL B 247 17.372 -12.075 51.901 1.00 0.00 H ATOM 7639 H VAL B 247 18.943 -15.243 50.301 1.00 0.00 H ATOM 7640 N ASP B 248 18.379 -13.160 46.684 1.00 33.85 N ATOM 7641 CA ASP B 248 19.098 -12.764 45.460 1.00 35.00 C ATOM 7642 C ASP B 248 19.491 -11.277 45.459 1.00 29.13 C ATOM 7643 O ASP B 248 20.571 -10.919 45.022 1.00 32.18 O ATOM 7644 CB ASP B 248 18.331 -13.204 44.184 1.00 34.63 C ATOM 7645 CG ASP B 248 18.437 -14.747 43.915 1.00 38.66 C ATOM 7646 OD1 ASP B 248 19.124 -15.492 44.652 1.00 40.45 O ATOM 7647 OD2 ASP B 248 17.831 -15.236 42.949 1.00 40.49 O ATOM 7648 HA ASP B 248 20.045 -13.304 45.450 1.00 0.00 H ATOM 7649 HB2 ASP B 248 17.280 -12.942 44.301 1.00 0.00 H ATOM 7650 HB3 ASP B 248 18.744 -12.671 43.327 1.00 0.00 H ATOM 7651 H ASP B 248 17.347 -13.282 46.645 1.00 0.00 H ATOM 7652 N TYR B 249 18.628 -10.421 45.978 1.00 30.10 N ATOM 7653 CA TYR B 249 18.937 -8.977 46.190 1.00 24.26 C ATOM 7654 C TYR B 249 17.920 -8.428 47.119 1.00 25.45 C ATOM 7655 O TYR B 249 16.779 -8.929 47.177 1.00 24.64 O ATOM 7656 CB TYR B 249 18.901 -8.130 44.888 1.00 20.74 C ATOM 7657 CG TYR B 249 17.591 -8.168 44.065 1.00 20.81 C ATOM 7658 CD1 TYR B 249 16.516 -7.331 44.355 1.00 17.08 C ATOM 7659 CD2 TYR B 249 17.478 -9.002 42.947 1.00 19.53 C ATOM 7660 CE1 TYR B 249 15.321 -7.364 43.557 1.00 19.94 C ATOM 7661 CE2 TYR B 249 16.338 -9.037 42.166 1.00 16.12 C ATOM 7662 CZ TYR B 249 15.257 -8.212 42.462 1.00 21.17 C ATOM 7663 OH TYR B 249 14.111 -8.292 41.678 1.00 23.92 O ATOM 7664 HA TYR B 249 19.952 -8.919 46.582 1.00 0.00 H ATOM 7665 HB3 TYR B 249 19.706 -8.482 44.243 1.00 0.00 H ATOM 7666 HB2 TYR B 249 19.087 -7.092 45.165 1.00 0.00 H ATOM 7667 HD2 TYR B 249 18.317 -9.646 42.683 1.00 0.00 H ATOM 7668 HE2 TYR B 249 16.285 -9.714 41.314 1.00 0.00 H ATOM 7669 HE1 TYR B 249 14.473 -6.728 43.810 1.00 0.00 H ATOM 7670 HD1 TYR B 249 16.582 -6.643 45.197 1.00 0.00 H ATOM 7671 HH TYR B 249 13.438 -7.648 42.013 1.00 0.00 H ATOM 7672 H TYR B 249 17.688 -10.771 46.252 1.00 0.00 H ATOM 7673 N LEU B 250 18.315 -7.370 47.819 1.00 28.34 N ATOM 7674 CA LEU B 250 17.385 -6.581 48.598 1.00 24.92 C ATOM 7675 C LEU B 250 17.836 -5.169 48.323 1.00 24.31 C ATOM 7676 O LEU B 250 18.929 -4.802 48.688 1.00 23.93 O ATOM 7677 CB LEU B 250 17.497 -6.928 50.090 1.00 25.79 C ATOM 7678 CG LEU B 250 16.854 -5.988 51.131 1.00 27.54 C ATOM 7679 CD1 LEU B 250 15.373 -6.144 51.077 1.00 25.91 C ATOM 7680 CD2 LEU B 250 17.346 -6.161 52.573 1.00 21.61 C ATOM 7681 HA LEU B 250 16.340 -6.751 48.340 1.00 0.00 H ATOM 7682 HB2 LEU B 250 17.043 -7.910 50.224 1.00 0.00 H ATOM 7683 HB3 LEU B 250 18.560 -6.985 50.325 1.00 0.00 H ATOM 7684 HG LEU B 250 17.166 -4.982 50.852 1.00 0.00 H ATOM 7685 HD21 LEU B 250 17.138 -7.177 52.907 1.00 0.00 H ATOM 7686 HD22 LEU B 250 18.419 -5.976 52.614 1.00 0.00 H ATOM 7687 HD23 LEU B 250 16.829 -5.452 53.219 1.00 0.00 H ATOM 7688 HD11 LEU B 250 15.018 -5.886 50.079 1.00 0.00 H ATOM 7689 HD12 LEU B 250 15.109 -7.177 51.302 1.00 0.00 H ATOM 7690 HD13 LEU B 250 14.912 -5.482 51.810 1.00 0.00 H ATOM 7691 H LEU B 250 19.320 -7.102 47.807 1.00 0.00 H ATOM 7692 N GLU B 251 17.013 -4.379 47.643 1.00 29.52 N ATOM 7693 CA GLU B 251 17.468 -3.064 47.155 1.00 20.99 C ATOM 7694 C GLU B 251 16.433 -1.964 47.255 1.00 23.83 C ATOM 7695 O GLU B 251 15.250 -2.173 46.954 1.00 27.24 O ATOM 7696 CB GLU B 251 17.967 -3.165 45.717 1.00 26.74 C ATOM 7697 CG GLU B 251 19.429 -3.591 45.610 1.00 38.67 C ATOM 7698 CD GLU B 251 19.983 -3.388 44.246 1.00 48.61 C ATOM 7699 OE1 GLU B 251 20.002 -2.209 43.770 1.00 54.76 O ATOM 7700 OE2 GLU B 251 20.398 -4.412 43.653 1.00 49.86 O ATOM 7701 HA GLU B 251 18.282 -2.781 47.823 1.00 0.00 H ATOM 7702 HB2 GLU B 251 17.354 -3.896 45.189 1.00 0.00 H ATOM 7703 HB3 GLU B 251 17.856 -2.190 45.243 1.00 0.00 H ATOM 7704 HG2 GLU B 251 20.017 -3.005 46.317 1.00 0.00 H ATOM 7705 HG3 GLU B 251 19.505 -4.648 45.865 1.00 0.00 H ATOM 7706 H GLU B 251 16.039 -4.691 47.453 1.00 0.00 H ATOM 7707 N LEU B 252 16.914 -0.802 47.690 1.00 18.27 N ATOM 7708 CA LEU B 252 16.179 0.437 47.764 1.00 26.60 C ATOM 7709 C LEU B 252 16.564 1.359 46.608 1.00 29.02 C ATOM 7710 O LEU B 252 17.745 1.714 46.447 1.00 24.74 O ATOM 7711 CB LEU B 252 16.540 1.136 49.080 1.00 30.81 C ATOM 7712 CG LEU B 252 15.785 2.395 49.527 1.00 32.30 C ATOM 7713 CD1 LEU B 252 14.301 2.164 49.517 1.00 24.43 C ATOM 7714 CD2 LEU B 252 16.265 2.786 50.913 1.00 28.38 C ATOM 7715 HA LEU B 252 15.112 0.222 47.710 1.00 0.00 H ATOM 7716 HB2 LEU B 252 16.412 0.397 49.871 1.00 0.00 H ATOM 7717 HB3 LEU B 252 17.592 1.412 49.009 1.00 0.00 H ATOM 7718 HG LEU B 252 15.989 3.208 48.830 1.00 0.00 H ATOM 7719 HD21 LEU B 252 16.068 1.970 51.608 1.00 0.00 H ATOM 7720 HD22 LEU B 252 17.336 2.988 50.882 1.00 0.00 H ATOM 7721 HD23 LEU B 252 15.735 3.680 51.241 1.00 0.00 H ATOM 7722 HD11 LEU B 252 13.982 1.904 48.508 1.00 0.00 H ATOM 7723 HD12 LEU B 252 14.057 1.349 50.198 1.00 0.00 H ATOM 7724 HD13 LEU B 252 13.791 3.072 49.838 1.00 0.00 H ATOM 7725 H LEU B 252 17.905 -0.786 48.004 1.00 0.00 H ATOM 7726 N ARG B 253 15.568 1.772 45.822 1.00 24.66 N ATOM 7727 CA ARG B 253 15.819 2.626 44.656 1.00 29.47 C ATOM 7728 C ARG B 253 14.843 3.767 44.695 1.00 31.25 C ATOM 7729 O ARG B 253 13.916 3.756 45.522 1.00 35.90 O ATOM 7730 CB ARG B 253 15.618 1.862 43.346 1.00 29.51 C ATOM 7731 CG ARG B 253 16.462 0.608 43.124 1.00 28.23 C ATOM 7732 CD ARG B 253 17.879 0.896 42.745 1.00 36.86 C ATOM 7733 NE ARG B 253 18.560 -0.334 42.306 1.00 42.78 N ATOM 7734 CZ ARG B 253 18.698 -0.733 41.031 1.00 40.75 C ATOM 7735 NH1 ARG B 253 18.219 -0.015 40.018 1.00 31.53 N ATOM 7736 NH2 ARG B 253 19.348 -1.857 40.759 1.00 43.79 N ATOM 7737 HA ARG B 253 16.851 2.975 44.694 1.00 0.00 H ATOM 7738 HB2 ARG B 253 14.571 1.564 43.299 1.00 0.00 H ATOM 7739 HB3 ARG B 253 15.835 2.551 42.529 1.00 0.00 H ATOM 7740 HG2 ARG B 253 16.464 0.026 44.046 1.00 0.00 H ATOM 7741 HG3 ARG B 253 16.005 0.022 42.327 1.00 0.00 H ATOM 7742 HD2 ARG B 253 18.404 1.308 43.607 1.00 0.00 H ATOM 7743 HD3 ARG B 253 17.892 1.622 41.932 1.00 0.00 H ATOM 7744 HE ARG B 253 18.967 -0.943 43.044 1.00 0.00 H ATOM 7745 HH12 ARG B 253 18.341 -0.349 39.041 1.00 0.00 H ATOM 7746 HH11 ARG B 253 17.723 0.880 40.204 1.00 0.00 H ATOM 7747 HH22 ARG B 253 19.457 -2.169 39.773 1.00 0.00 H ATOM 7748 HH21 ARG B 253 19.749 -2.426 41.532 1.00 0.00 H ATOM 7749 H ARG B 253 14.593 1.482 46.041 1.00 0.00 H ATOM 7750 N ASP B 254 15.008 4.752 43.813 1.00 30.65 N ATOM 7751 CA ASP B 254 13.942 5.734 43.696 1.00 33.20 C ATOM 7752 C ASP B 254 12.789 5.079 42.945 1.00 31.94 C ATOM 7753 O ASP B 254 12.922 3.923 42.523 1.00 29.88 O ATOM 7754 CB ASP B 254 14.383 7.136 43.186 1.00 40.17 C ATOM 7755 CG ASP B 254 14.717 7.180 41.716 1.00 50.00 C ATOM 7756 OD1 ASP B 254 13.821 6.993 40.853 1.00 51.77 O ATOM 7757 OD2 ASP B 254 15.900 7.481 41.427 1.00 63.04 O ATOM 7758 HA ASP B 254 13.592 6.008 44.691 1.00 0.00 H ATOM 7759 HB2 ASP B 254 13.572 7.840 43.374 1.00 0.00 H ATOM 7760 HB3 ASP B 254 15.266 7.442 43.747 1.00 0.00 H ATOM 7761 H ASP B 254 15.867 4.816 43.230 1.00 0.00 H ATOM 7762 N ILE B 255 11.657 5.779 42.832 1.00 29.28 N ATOM 7763 CA ILE B 255 10.458 5.195 42.262 1.00 28.86 C ATOM 7764 C ILE B 255 10.626 4.805 40.765 1.00 30.32 C ATOM 7765 O ILE B 255 9.949 3.887 40.302 1.00 27.07 O ATOM 7766 CB ILE B 255 9.164 6.034 42.558 1.00 33.21 C ATOM 7767 CG1 ILE B 255 9.258 7.440 41.968 1.00 38.47 C ATOM 7768 CG2 ILE B 255 8.918 6.140 44.051 1.00 30.94 C ATOM 7769 CD1 ILE B 255 7.919 8.016 41.538 1.00 44.83 C ATOM 7770 HA ILE B 255 10.306 4.251 42.785 1.00 0.00 H ATOM 7771 HB ILE B 255 8.332 5.510 42.087 1.00 0.00 H ATOM 7772 HG12 ILE B 255 9.691 8.100 42.720 1.00 0.00 H ATOM 7773 HG13 ILE B 255 9.913 7.404 41.097 1.00 0.00 H ATOM 7774 HD11 ILE B 255 7.476 7.374 40.776 1.00 0.00 H ATOM 7775 HD12 ILE B 255 7.254 8.070 42.400 1.00 0.00 H ATOM 7776 HD13 ILE B 255 8.069 9.016 41.130 1.00 0.00 H ATOM 7777 HG21 ILE B 255 8.792 5.141 44.469 1.00 0.00 H ATOM 7778 HG22 ILE B 255 9.769 6.629 44.524 1.00 0.00 H ATOM 7779 HG23 ILE B 255 8.016 6.726 44.229 1.00 0.00 H ATOM 7780 H ILE B 255 11.635 6.766 43.160 1.00 0.00 H ATOM 7781 N GLY B 256 11.536 5.459 40.032 1.00 19.40 N ATOM 7782 CA GLY B 256 11.882 4.991 38.681 1.00 21.86 C ATOM 7783 C GLY B 256 13.061 4.003 38.642 1.00 23.11 C ATOM 7784 O GLY B 256 13.603 3.709 37.591 1.00 24.32 O ATOM 7785 HA3 GLY B 256 12.141 5.858 38.074 1.00 0.00 H ATOM 7786 HA2 GLY B 256 11.008 4.499 38.255 1.00 0.00 H ATOM 7787 H GLY B 256 12.002 6.304 40.421 1.00 0.00 H ATOM 7788 N LEU B 257 13.475 3.507 39.805 1.00 22.99 N ATOM 7789 CA LEU B 257 14.522 2.491 39.919 1.00 19.97 C ATOM 7790 C LEU B 257 15.949 3.007 39.650 1.00 24.96 C ATOM 7791 O LEU B 257 16.910 2.218 39.567 1.00 27.71 O ATOM 7792 CB LEU B 257 14.159 1.183 39.153 1.00 20.52 C ATOM 7793 CG LEU B 257 12.953 0.392 39.670 1.00 24.07 C ATOM 7794 CD1 LEU B 257 12.616 -0.911 38.896 1.00 17.62 C ATOM 7795 CD2 LEU B 257 13.114 0.132 41.157 1.00 19.11 C ATOM 7796 HA LEU B 257 14.554 2.221 40.975 1.00 0.00 H ATOM 7797 HB2 LEU B 257 13.957 1.453 38.116 1.00 0.00 H ATOM 7798 HB3 LEU B 257 15.027 0.525 39.193 1.00 0.00 H ATOM 7799 HG LEU B 257 12.086 1.026 39.486 1.00 0.00 H ATOM 7800 HD21 LEU B 257 14.025 -0.442 41.328 1.00 0.00 H ATOM 7801 HD22 LEU B 257 13.178 1.083 41.686 1.00 0.00 H ATOM 7802 HD23 LEU B 257 12.255 -0.431 41.521 1.00 0.00 H ATOM 7803 HD11 LEU B 257 12.398 -0.668 37.856 1.00 0.00 H ATOM 7804 HD12 LEU B 257 13.468 -1.590 38.941 1.00 0.00 H ATOM 7805 HD13 LEU B 257 11.746 -1.387 39.349 1.00 0.00 H ATOM 7806 H LEU B 257 13.032 3.859 40.678 1.00 0.00 H ATOM 7807 N GLY B 258 16.102 4.333 39.571 1.00 28.94 N ATOM 7808 CA GLY B 258 17.411 4.957 39.715 1.00 26.37 C ATOM 7809 C GLY B 258 17.861 4.851 41.176 1.00 39.98 C ATOM 7810 O GLY B 258 17.151 4.283 42.017 1.00 36.34 O ATOM 7811 HA3 GLY B 258 17.349 6.007 39.428 1.00 0.00 H ATOM 7812 HA2 GLY B 258 18.131 4.448 39.074 1.00 0.00 H ATOM 7813 H GLY B 258 15.269 4.932 39.403 1.00 0.00 H ATOM 7814 N PRO B 259 19.046 5.396 41.497 1.00 42.90 N ATOM 7815 CA PRO B 259 19.589 5.259 42.840 1.00 43.91 C ATOM 7816 C PRO B 259 18.784 6.026 43.882 1.00 47.40 C ATOM 7817 O PRO B 259 18.120 7.030 43.559 1.00 37.83 O ATOM 7818 CB PRO B 259 20.996 5.873 42.716 1.00 45.78 C ATOM 7819 CG PRO B 259 21.305 5.898 41.256 1.00 44.59 C ATOM 7820 CD PRO B 259 19.959 6.152 40.619 1.00 47.16 C ATOM 7821 HA PRO B 259 19.576 4.221 43.173 1.00 0.00 H ATOM 7822 HD3 PRO B 259 19.717 7.215 40.619 1.00 0.00 H ATOM 7823 HD2 PRO B 259 19.928 5.773 39.597 1.00 0.00 H ATOM 7824 HG3 PRO B 259 21.719 4.944 40.928 1.00 0.00 H ATOM 7825 HG2 PRO B 259 22.007 6.698 41.019 1.00 0.00 H ATOM 7826 HB2 PRO B 259 21.006 6.884 43.123 1.00 0.00 H ATOM 7827 HB3 PRO B 259 21.725 5.261 43.248 1.00 0.00 H ATOM 7828 N MET B 260 18.866 5.549 45.126 1.00 49.64 N ATOM 7829 CA MET B 260 18.122 6.153 46.223 1.00 53.06 C ATOM 7830 C MET B 260 18.517 7.590 46.458 1.00 54.65 C ATOM 7831 O MET B 260 19.695 7.859 46.732 1.00 54.03 O ATOM 7832 CB MET B 260 18.336 5.393 47.522 1.00 54.21 C ATOM 7833 CG MET B 260 17.344 5.839 48.563 1.00 54.09 C ATOM 7834 SD MET B 260 15.735 6.006 47.754 1.00 51.30 S ATOM 7835 CE MET B 260 14.661 6.598 49.066 1.00 51.64 C ATOM 7836 HA MET B 260 17.074 6.110 45.928 1.00 0.00 H ATOM 7837 HB2 MET B 260 18.209 4.326 47.339 1.00 0.00 H ATOM 7838 HB3 MET B 260 19.346 5.580 47.885 1.00 0.00 H ATOM 7839 HG2 MET B 260 17.651 6.798 48.982 1.00 0.00 H ATOM 7840 HG3 MET B 260 17.284 5.098 49.360 1.00 0.00 H ATOM 7841 HE1 MET B 260 14.644 5.869 49.876 1.00 0.00 H ATOM 7842 HE2 MET B 260 15.037 7.550 49.440 1.00 0.00 H ATOM 7843 HE3 MET B 260 13.652 6.733 48.675 1.00 0.00 H ATOM 7844 H MET B 260 19.475 4.728 45.316 1.00 0.00 H ATOM 7845 N PRO B 261 17.546 8.523 46.340 1.00 57.48 N ATOM 7846 CA PRO B 261 17.841 9.893 46.774 1.00 60.56 C ATOM 7847 C PRO B 261 17.846 9.944 48.319 1.00 62.43 C ATOM 7848 O PRO B 261 17.243 9.065 48.966 1.00 59.75 O ATOM 7849 CB PRO B 261 16.691 10.713 46.163 1.00 61.32 C ATOM 7850 CG PRO B 261 15.546 9.732 46.009 1.00 56.86 C ATOM 7851 CD PRO B 261 16.176 8.387 45.798 1.00 56.50 C ATOM 7852 HA PRO B 261 18.813 10.272 46.459 1.00 0.00 H ATOM 7853 HD3 PRO B 261 15.625 7.616 46.336 1.00 0.00 H ATOM 7854 HD2 PRO B 261 16.205 8.138 44.737 1.00 0.00 H ATOM 7855 HG3 PRO B 261 14.930 10.001 45.151 1.00 0.00 H ATOM 7856 HG2 PRO B 261 14.930 9.725 46.908 1.00 0.00 H ATOM 7857 HB2 PRO B 261 16.409 11.530 46.827 1.00 0.00 H ATOM 7858 HB3 PRO B 261 16.982 11.118 45.194 1.00 0.00 H ATOM 7859 N LEU B 262 18.520 10.939 48.899 1.00 60.64 N ATOM 7860 CA LEU B 262 18.720 10.953 50.359 1.00 65.23 C ATOM 7861 C LEU B 262 17.447 11.046 51.244 1.00 62.88 C ATOM 7862 O LEU B 262 17.332 10.335 52.249 1.00 61.29 O ATOM 7863 CB LEU B 262 19.838 11.921 50.770 1.00 67.14 C ATOM 7864 CG LEU B 262 21.189 11.183 50.666 1.00 73.27 C ATOM 7865 CD1 LEU B 262 22.379 12.144 50.391 1.00 76.19 C ATOM 7866 CD2 LEU B 262 21.455 10.250 51.888 1.00 74.69 C ATOM 7867 HA LEU B 262 19.057 9.942 50.586 1.00 0.00 H ATOM 7868 HB2 LEU B 262 19.839 12.785 50.106 1.00 0.00 H ATOM 7869 HB3 LEU B 262 19.678 12.253 51.796 1.00 0.00 H ATOM 7870 HG LEU B 262 21.110 10.536 49.792 1.00 0.00 H ATOM 7871 HD21 LEU B 262 21.466 10.844 52.802 1.00 0.00 H ATOM 7872 HD22 LEU B 262 20.666 9.500 51.950 1.00 0.00 H ATOM 7873 HD23 LEU B 262 22.418 9.756 51.763 1.00 0.00 H ATOM 7874 HD11 LEU B 262 22.211 12.668 49.450 1.00 0.00 H ATOM 7875 HD12 LEU B 262 22.455 12.868 51.203 1.00 0.00 H ATOM 7876 HD13 LEU B 262 23.302 11.568 50.328 1.00 0.00 H ATOM 7877 H LEU B 262 18.907 11.709 48.317 1.00 0.00 H ATOM 7878 N ASN B 263 16.503 11.897 50.860 1.00 58.79 N ATOM 7879 CA ASN B 263 15.155 11.866 51.436 1.00 62.32 C ATOM 7880 C ASN B 263 14.249 11.487 50.295 1.00 59.58 C ATOM 7881 O ASN B 263 14.726 11.325 49.165 1.00 64.19 O ATOM 7882 CB ASN B 263 14.714 13.240 51.968 1.00 65.69 C ATOM 7883 CG ASN B 263 15.877 14.199 52.171 1.00 69.93 C ATOM 7884 OD1 ASN B 263 16.368 14.369 53.295 1.00 71.91 O ATOM 7885 ND2 ASN B 263 16.342 14.816 51.076 1.00 68.89 N ATOM 7886 HA ASN B 263 15.123 11.173 52.277 1.00 0.00 H ATOM 7887 HB2 ASN B 263 14.019 13.682 51.254 1.00 0.00 H ATOM 7888 HB3 ASN B 263 14.210 13.097 52.924 1.00 0.00 H ATOM 7889 HD22 ASN B 263 15.897 14.642 50.152 1.00 0.00 H ATOM 7890 HD21 ASN B 263 17.148 15.469 51.150 1.00 0.00 H ATOM 7891 H ASN B 263 16.726 12.605 50.131 1.00 0.00 H ATOM 7892 N GLY B 264 12.952 11.362 50.561 1.00 55.47 N ATOM 7893 CA GLY B 264 11.978 11.267 49.470 1.00 49.70 C ATOM 7894 C GLY B 264 11.413 9.887 49.256 1.00 46.13 C ATOM 7895 O GLY B 264 11.753 8.945 49.974 1.00 43.92 O ATOM 7896 HA3 GLY B 264 12.467 11.582 48.548 1.00 0.00 H ATOM 7897 HA2 GLY B 264 11.152 11.943 49.691 1.00 0.00 H ATOM 7898 H GLY B 264 12.627 11.331 51.548 1.00 0.00 H ATOM 7899 N SER B 265 10.530 9.791 48.267 1.00 41.92 N ATOM 7900 CA SER B 265 9.866 8.557 47.914 1.00 37.06 C ATOM 7901 C SER B 265 10.851 7.568 47.336 1.00 34.40 C ATOM 7902 O SER B 265 11.742 7.966 46.592 1.00 36.60 O ATOM 7903 CB SER B 265 8.772 8.841 46.902 1.00 37.41 C ATOM 7904 OG SER B 265 7.762 9.601 47.525 1.00 37.45 O ATOM 7905 HA SER B 265 9.430 8.125 48.814 1.00 0.00 H ATOM 7906 HB2 SER B 265 8.354 7.901 46.541 1.00 0.00 H ATOM 7907 HB3 SER B 265 9.186 9.399 46.062 1.00 0.00 H ATOM 7908 HG SER B 265 7.390 9.091 48.288 1.00 0.00 H ATOM 7909 H SER B 265 10.306 10.647 47.720 1.00 0.00 H ATOM 7910 N GLY B 266 10.715 6.281 47.695 1.00 29.88 N ATOM 7911 CA GLY B 266 11.532 5.224 47.081 1.00 8.93 C ATOM 7912 C GLY B 266 10.757 3.950 46.903 1.00 25.68 C ATOM 7913 O GLY B 266 9.530 3.897 47.158 1.00 21.60 O ATOM 7914 HA3 GLY B 266 12.393 5.027 47.720 1.00 0.00 H ATOM 7915 HA2 GLY B 266 11.877 5.566 46.105 1.00 0.00 H ATOM 7916 H GLY B 266 10.017 6.027 48.423 1.00 0.00 H ATOM 7917 N ARG B 267 11.483 2.897 46.528 1.00 22.67 N ATOM 7918 CA ARG B 267 10.869 1.585 46.379 1.00 25.27 C ATOM 7919 C ARG B 267 11.877 0.576 46.882 1.00 25.10 C ATOM 7920 O ARG B 267 13.059 0.700 46.610 1.00 32.69 O ATOM 7921 CB ARG B 267 10.447 1.319 44.905 1.00 23.10 C ATOM 7922 CG ARG B 267 9.364 0.257 44.734 1.00 17.80 C ATOM 7923 CD ARG B 267 7.965 0.816 45.026 1.00 17.22 C ATOM 7924 NE ARG B 267 6.939 -0.241 44.933 1.00 15.46 N ATOM 7925 CZ ARG B 267 5.618 -0.048 44.919 1.00 24.26 C ATOM 7926 NH1 ARG B 267 5.118 1.197 45.003 1.00 23.48 N ATOM 7927 NH2 ARG B 267 4.791 -1.116 44.844 1.00 16.21 N ATOM 7928 HA ARG B 267 9.948 1.514 46.957 1.00 0.00 H ATOM 7929 HB2 ARG B 267 10.076 2.253 44.484 1.00 0.00 H ATOM 7930 HB3 ARG B 267 11.329 0.997 44.352 1.00 0.00 H ATOM 7931 HG2 ARG B 267 9.390 -0.112 43.709 1.00 0.00 H ATOM 7932 HG3 ARG B 267 9.565 -0.566 45.420 1.00 0.00 H ATOM 7933 HD2 ARG B 267 7.736 1.599 44.303 1.00 0.00 H ATOM 7934 HD3 ARG B 267 7.952 1.237 46.031 1.00 0.00 H ATOM 7935 HE ARG B 267 7.275 -1.223 44.873 1.00 0.00 H ATOM 7936 HH12 ARG B 267 4.089 1.346 44.992 1.00 0.00 H ATOM 7937 HH11 ARG B 267 5.760 2.011 45.079 1.00 0.00 H ATOM 7938 HH22 ARG B 267 3.761 -0.976 44.832 1.00 0.00 H ATOM 7939 HH21 ARG B 267 5.186 -2.077 44.798 1.00 0.00 H ATOM 7940 H ARG B 267 12.499 3.014 46.340 1.00 0.00 H ATOM 7941 N LEU B 268 11.422 -0.382 47.680 1.00 24.55 N ATOM 7942 CA LEU B 268 12.311 -1.403 48.202 1.00 21.76 C ATOM 7943 C LEU B 268 11.884 -2.689 47.536 1.00 22.36 C ATOM 7944 O LEU B 268 10.687 -3.056 47.579 1.00 22.99 O ATOM 7945 CB LEU B 268 12.209 -1.510 49.720 1.00 18.32 C ATOM 7946 CG LEU B 268 13.043 -2.617 50.382 1.00 23.68 C ATOM 7947 CD1 LEU B 268 14.496 -2.226 50.220 1.00 16.66 C ATOM 7948 CD2 LEU B 268 12.665 -2.872 51.900 1.00 15.40 C ATOM 7949 HA LEU B 268 13.354 -1.167 47.991 1.00 0.00 H ATOM 7950 HB2 LEU B 268 12.527 -0.557 50.142 1.00 0.00 H ATOM 7951 HB3 LEU B 268 11.163 -1.687 49.971 1.00 0.00 H ATOM 7952 HG LEU B 268 12.835 -3.569 49.894 1.00 0.00 H ATOM 7953 HD21 LEU B 268 12.824 -1.957 52.471 1.00 0.00 H ATOM 7954 HD22 LEU B 268 11.618 -3.167 51.968 1.00 0.00 H ATOM 7955 HD23 LEU B 268 13.294 -3.666 52.301 1.00 0.00 H ATOM 7956 HD11 LEU B 268 14.733 -2.144 49.159 1.00 0.00 H ATOM 7957 HD12 LEU B 268 14.669 -1.266 50.707 1.00 0.00 H ATOM 7958 HD13 LEU B 268 15.129 -2.987 50.677 1.00 0.00 H ATOM 7959 H LEU B 268 10.414 -0.401 47.935 1.00 0.00 H ATOM 7960 N LEU B 269 12.836 -3.319 46.856 1.00 20.58 N ATOM 7961 CA LEU B 269 12.558 -4.585 46.119 1.00 27.52 C ATOM 7962 C LEU B 269 13.393 -5.708 46.678 1.00 17.31 C ATOM 7963 O LEU B 269 14.522 -5.456 47.059 1.00 20.24 O ATOM 7964 CB LEU B 269 12.867 -4.446 44.620 1.00 22.92 C ATOM 7965 CG LEU B 269 12.365 -3.119 44.081 1.00 27.73 C ATOM 7966 CD1 LEU B 269 13.565 -2.161 43.845 1.00 23.43 C ATOM 7967 CD2 LEU B 269 11.521 -3.342 42.828 1.00 28.15 C ATOM 7968 HA LEU B 269 11.497 -4.804 46.243 1.00 0.00 H ATOM 7969 HB2 LEU B 269 13.945 -4.507 44.471 1.00 0.00 H ATOM 7970 HB3 LEU B 269 12.381 -5.258 44.079 1.00 0.00 H ATOM 7971 HG LEU B 269 11.713 -2.641 44.812 1.00 0.00 H ATOM 7972 HD21 LEU B 269 12.127 -3.830 42.065 1.00 0.00 H ATOM 7973 HD22 LEU B 269 10.667 -3.973 43.074 1.00 0.00 H ATOM 7974 HD23 LEU B 269 11.168 -2.381 42.453 1.00 0.00 H ATOM 7975 HD11 LEU B 269 14.086 -1.995 44.788 1.00 0.00 H ATOM 7976 HD12 LEU B 269 14.249 -2.609 43.124 1.00 0.00 H ATOM 7977 HD13 LEU B 269 13.199 -1.210 43.458 1.00 0.00 H ATOM 7978 H LEU B 269 13.796 -2.920 46.837 1.00 0.00 H ATOM 7979 N VAL B 270 12.835 -6.922 46.683 1.00 21.74 N ATOM 7980 CA VAL B 270 13.499 -8.164 47.188 1.00 23.73 C ATOM 7981 C VAL B 270 13.219 -9.346 46.252 1.00 21.77 C ATOM 7982 O VAL B 270 12.136 -9.469 45.687 1.00 25.49 O ATOM 7983 CB VAL B 270 13.068 -8.532 48.671 1.00 19.86 C ATOM 7984 CG1 VAL B 270 11.617 -8.945 48.740 1.00 25.10 C ATOM 7985 CG2 VAL B 270 13.981 -9.663 49.326 1.00 13.16 C ATOM 7986 HA VAL B 270 14.569 -7.958 47.204 1.00 0.00 H ATOM 7987 HB VAL B 270 13.210 -7.620 49.251 1.00 0.00 H ATOM 7988 HG11 VAL B 270 10.990 -8.124 48.392 1.00 0.00 H ATOM 7989 HG12 VAL B 270 11.459 -9.819 48.108 1.00 0.00 H ATOM 7990 HG13 VAL B 270 11.359 -9.189 49.770 1.00 0.00 H ATOM 7991 HG21 VAL B 270 13.916 -10.572 48.728 1.00 0.00 H ATOM 7992 HG22 VAL B 270 15.015 -9.320 49.358 1.00 0.00 H ATOM 7993 HG23 VAL B 270 13.633 -9.868 50.339 1.00 0.00 H ATOM 7994 H VAL B 270 11.869 -7.010 46.309 1.00 0.00 H ATOM 7995 N ALA B 271 14.210 -10.199 46.068 1.00 20.81 N ATOM 7996 CA ALA B 271 14.010 -11.434 45.348 1.00 18.76 C ATOM 7997 C ALA B 271 14.687 -12.519 46.133 1.00 18.74 C ATOM 7998 O ALA B 271 15.795 -12.329 46.640 1.00 20.91 O ATOM 7999 CB ALA B 271 14.635 -11.364 43.984 1.00 20.79 C ATOM 8000 HA ALA B 271 12.943 -11.624 45.227 1.00 0.00 H ATOM 8001 HB1 ALA B 271 14.181 -10.550 43.419 1.00 0.00 H ATOM 8002 HB2 ALA B 271 15.705 -11.185 44.085 1.00 0.00 H ATOM 8003 HB3 ALA B 271 14.471 -12.306 43.462 1.00 0.00 H ATOM 8004 H ALA B 271 15.152 -9.977 46.449 1.00 0.00 H ATOM 8005 N ALA B 272 14.065 -13.683 46.183 1.00 21.94 N ATOM 8006 CA ALA B 272 14.658 -14.776 46.920 1.00 23.74 C ATOM 8007 C ALA B 272 14.211 -16.172 46.404 1.00 25.41 C ATOM 8008 O ALA B 272 13.129 -16.323 45.799 1.00 23.41 O ATOM 8009 CB ALA B 272 14.388 -14.581 48.419 1.00 16.21 C ATOM 8010 HA ALA B 272 15.735 -14.757 46.754 1.00 0.00 H ATOM 8011 HB1 ALA B 272 14.827 -13.638 48.746 1.00 0.00 H ATOM 8012 HB2 ALA B 272 13.312 -14.563 48.594 1.00 0.00 H ATOM 8013 HB3 ALA B 272 14.834 -15.404 48.977 1.00 0.00 H ATOM 8014 H ALA B 272 13.155 -13.812 45.696 1.00 0.00 H ATOM 8015 N ARG B 273 15.058 -17.172 46.632 1.00 25.37 N ATOM 8016 CA ARG B 273 14.816 -18.535 46.171 1.00 28.94 C ATOM 8017 C ARG B 273 14.490 -19.449 47.346 1.00 31.18 C ATOM 8018 O ARG B 273 15.206 -19.468 48.367 1.00 32.11 O ATOM 8019 CB ARG B 273 16.013 -19.068 45.410 1.00 26.29 C ATOM 8020 CG ARG B 273 16.047 -18.711 43.920 1.00 36.22 C ATOM 8021 CD ARG B 273 17.445 -18.936 43.282 1.00 40.72 C ATOM 8022 NE ARG B 273 18.507 -18.310 44.081 1.00 54.03 N ATOM 8023 CZ ARG B 273 19.282 -18.954 44.969 1.00 58.93 C ATOM 8024 NH1 ARG B 273 19.125 -20.280 45.168 1.00 56.17 N ATOM 8025 NH2 ARG B 273 20.222 -18.272 45.652 1.00 55.35 N ATOM 8026 HA ARG B 273 13.960 -18.515 45.496 1.00 0.00 H ATOM 8027 HB2 ARG B 273 16.914 -18.668 45.874 1.00 0.00 H ATOM 8028 HB3 ARG B 273 16.013 -20.154 45.497 1.00 0.00 H ATOM 8029 HG2 ARG B 273 15.320 -19.331 43.396 1.00 0.00 H ATOM 8030 HG3 ARG B 273 15.776 -17.661 43.806 1.00 0.00 H ATOM 8031 HD2 ARG B 273 17.452 -18.504 42.281 1.00 0.00 H ATOM 8032 HD3 ARG B 273 17.636 -20.007 43.215 1.00 0.00 H ATOM 8033 HE ARG B 273 18.671 -17.292 43.949 1.00 0.00 H ATOM 8034 HH12 ARG B 273 19.726 -20.777 45.856 1.00 0.00 H ATOM 8035 HH11 ARG B 273 18.403 -20.804 44.633 1.00 0.00 H ATOM 8036 HH22 ARG B 273 20.825 -18.766 46.341 1.00 0.00 H ATOM 8037 HH21 ARG B 273 20.345 -17.252 45.490 1.00 0.00 H ATOM 8038 H ARG B 273 15.931 -16.974 47.162 1.00 0.00 H ATOM 8039 N LEU B 274 13.358 -20.139 47.228 1.00 25.84 N ATOM 8040 CA LEU B 274 12.916 -21.079 48.235 1.00 27.98 C ATOM 8041 C LEU B 274 12.800 -22.385 47.473 1.00 30.41 C ATOM 8042 O LEU B 274 11.838 -22.573 46.695 1.00 29.30 O ATOM 8043 CB LEU B 274 11.566 -20.684 48.855 1.00 19.41 C ATOM 8044 CG LEU B 274 11.497 -19.470 49.791 1.00 21.06 C ATOM 8045 CD1 LEU B 274 11.480 -18.098 49.056 1.00 21.55 C ATOM 8046 CD2 LEU B 274 10.322 -19.601 50.664 1.00 14.15 C ATOM 8047 HA LEU B 274 13.605 -21.127 49.079 1.00 0.00 H ATOM 8048 HB2 LEU B 274 10.881 -20.489 48.030 1.00 0.00 H ATOM 8049 HB3 LEU B 274 11.212 -21.545 49.423 1.00 0.00 H ATOM 8050 HG LEU B 274 12.416 -19.471 50.377 1.00 0.00 H ATOM 8051 HD21 LEU B 274 9.420 -19.645 50.053 1.00 0.00 H ATOM 8052 HD22 LEU B 274 10.409 -20.514 51.253 1.00 0.00 H ATOM 8053 HD23 LEU B 274 10.269 -18.741 51.331 1.00 0.00 H ATOM 8054 HD11 LEU B 274 12.388 -17.994 48.462 1.00 0.00 H ATOM 8055 HD12 LEU B 274 10.609 -18.048 48.402 1.00 0.00 H ATOM 8056 HD13 LEU B 274 11.430 -17.294 49.791 1.00 0.00 H ATOM 8057 H LEU B 274 12.770 -19.997 46.382 1.00 0.00 H ATOM 8058 N GLY B 275 13.796 -23.246 47.703 1.00 29.66 N ATOM 8059 CA GLY B 275 14.022 -24.481 46.948 1.00 36.91 C ATOM 8060 C GLY B 275 14.254 -24.106 45.498 1.00 41.74 C ATOM 8061 O GLY B 275 15.234 -23.386 45.171 1.00 42.08 O ATOM 8062 HA3 GLY B 275 13.149 -25.129 47.028 1.00 0.00 H ATOM 8063 HA2 GLY B 275 14.896 -25.001 47.341 1.00 0.00 H ATOM 8064 H GLY B 275 14.458 -23.023 48.473 1.00 0.00 H ATOM 8065 N THR B 276 13.315 -24.532 44.649 1.00 36.97 N ATOM 8066 CA THR B 276 13.362 -24.230 43.209 1.00 39.61 C ATOM 8067 C THR B 276 12.493 -23.026 42.844 1.00 32.36 C ATOM 8068 O THR B 276 12.495 -22.583 41.702 1.00 27.52 O ATOM 8069 CB THR B 276 12.920 -25.473 42.344 1.00 41.41 C ATOM 8070 OG1 THR B 276 11.537 -25.796 42.622 1.00 46.81 O ATOM 8071 CG2 THR B 276 13.833 -26.721 42.621 1.00 34.01 C ATOM 8072 HA THR B 276 14.400 -23.987 42.984 1.00 0.00 H ATOM 8073 HB THR B 276 13.028 -25.209 41.292 1.00 0.00 H ATOM 8074 HG1 THR B 276 11.266 -26.576 42.077 1.00 0.00 H ATOM 8075 HG23 THR B 276 14.871 -26.465 42.408 1.00 0.00 H ATOM 8076 HG21 THR B 276 13.737 -27.015 43.666 1.00 0.00 H ATOM 8077 HG22 THR B 276 13.522 -27.546 41.980 1.00 0.00 H ATOM 8078 H THR B 276 12.523 -25.097 45.018 1.00 0.00 H ATOM 8079 N THR B 277 11.738 -22.515 43.807 1.00 28.99 N ATOM 8080 CA THR B 277 10.767 -21.473 43.498 1.00 31.01 C ATOM 8081 C THR B 277 11.286 -20.059 43.852 1.00 31.29 C ATOM 8082 O THR B 277 11.577 -19.742 45.008 1.00 28.77 O ATOM 8083 CB THR B 277 9.383 -21.702 44.185 1.00 35.77 C ATOM 8084 OG1 THR B 277 8.918 -23.036 43.955 1.00 39.15 O ATOM 8085 CG2 THR B 277 8.341 -20.665 43.691 1.00 28.71 C ATOM 8086 HA THR B 277 10.625 -21.537 42.419 1.00 0.00 H ATOM 8087 HB THR B 277 9.512 -21.566 45.259 1.00 0.00 H ATOM 8088 HG1 THR B 277 8.041 -23.160 44.398 1.00 0.00 H ATOM 8089 HG23 THR B 277 8.716 -19.658 43.876 1.00 0.00 H ATOM 8090 HG21 THR B 277 8.173 -20.801 42.623 1.00 0.00 H ATOM 8091 HG22 THR B 277 7.404 -20.809 44.228 1.00 0.00 H ATOM 8092 H THR B 277 11.839 -22.858 44.784 1.00 0.00 H ATOM 8093 N ARG B 278 11.330 -19.217 42.835 1.00 29.05 N ATOM 8094 CA ARG B 278 11.818 -17.868 42.966 1.00 33.71 C ATOM 8095 C ARG B 278 10.681 -16.890 43.233 1.00 29.57 C ATOM 8096 O ARG B 278 9.740 -16.781 42.425 1.00 23.03 O ATOM 8097 CB ARG B 278 12.589 -17.481 41.706 1.00 35.83 C ATOM 8098 CG ARG B 278 13.368 -16.221 41.891 1.00 41.85 C ATOM 8099 CD ARG B 278 14.726 -16.317 41.225 1.00 45.96 C ATOM 8100 NE ARG B 278 15.414 -15.062 41.457 1.00 39.96 N ATOM 8101 CZ ARG B 278 15.108 -13.956 40.797 1.00 35.68 C ATOM 8102 NH1 ARG B 278 14.166 -14.032 39.875 1.00 21.39 N ATOM 8103 NH2 ARG B 278 15.753 -12.811 41.032 1.00 33.40 N ATOM 8104 HA ARG B 278 12.489 -17.821 43.823 1.00 0.00 H ATOM 8105 HB2 ARG B 278 13.278 -18.287 41.453 1.00 0.00 H ATOM 8106 HB3 ARG B 278 11.881 -17.340 40.889 1.00 0.00 H ATOM 8107 HG2 ARG B 278 12.814 -15.392 41.452 1.00 0.00 H ATOM 8108 HG3 ARG B 278 13.506 -16.040 42.957 1.00 0.00 H ATOM 8109 HD2 ARG B 278 14.605 -16.483 40.155 1.00 0.00 H ATOM 8110 HD3 ARG B 278 15.296 -17.140 41.657 1.00 0.00 H ATOM 8111 HE ARG B 278 16.174 -15.030 42.166 1.00 0.00 H ATOM 8112 HH12 ARG B 278 13.897 -13.185 39.335 1.00 0.00 H ATOM 8113 HH11 ARG B 278 13.693 -14.939 39.689 1.00 0.00 H ATOM 8114 HH22 ARG B 278 15.498 -11.953 40.503 1.00 0.00 H ATOM 8115 HH21 ARG B 278 16.510 -12.777 41.744 1.00 0.00 H ATOM 8116 H ARG B 278 10.999 -19.541 41.904 1.00 0.00 H ATOM 8117 N LEU B 279 10.752 -16.223 44.388 1.00 27.12 N ATOM 8118 CA LEU B 279 9.732 -15.235 44.781 1.00 25.15 C ATOM 8119 C LEU B 279 10.250 -13.793 44.720 1.00 24.50 C ATOM 8120 O LEU B 279 11.422 -13.519 44.978 1.00 26.94 O ATOM 8121 CB LEU B 279 9.160 -15.541 46.169 1.00 27.99 C ATOM 8122 CG LEU B 279 8.435 -16.894 46.280 1.00 27.93 C ATOM 8123 CD1 LEU B 279 7.848 -17.174 47.662 1.00 21.55 C ATOM 8124 CD2 LEU B 279 7.393 -17.064 45.191 1.00 18.91 C ATOM 8125 HA LEU B 279 8.929 -15.321 44.048 1.00 0.00 H ATOM 8126 HB2 LEU B 279 9.982 -15.536 46.884 1.00 0.00 H ATOM 8127 HB3 LEU B 279 8.452 -14.753 46.426 1.00 0.00 H ATOM 8128 HG LEU B 279 9.209 -17.647 46.132 1.00 0.00 H ATOM 8129 HD21 LEU B 279 6.651 -16.269 45.272 1.00 0.00 H ATOM 8130 HD22 LEU B 279 7.877 -17.013 44.216 1.00 0.00 H ATOM 8131 HD23 LEU B 279 6.904 -18.032 45.305 1.00 0.00 H ATOM 8132 HD11 LEU B 279 8.649 -17.176 48.402 1.00 0.00 H ATOM 8133 HD12 LEU B 279 7.123 -16.399 47.911 1.00 0.00 H ATOM 8134 HD13 LEU B 279 7.355 -18.146 47.656 1.00 0.00 H ATOM 8135 H LEU B 279 11.550 -16.406 45.029 1.00 0.00 H ATOM 8136 N LEU B 280 9.358 -12.885 44.355 1.00 23.53 N ATOM 8137 CA LEU B 280 9.635 -11.438 44.326 1.00 24.74 C ATOM 8138 C LEU B 280 8.655 -10.661 45.172 1.00 23.93 C ATOM 8139 O LEU B 280 7.472 -11.033 45.309 1.00 21.41 O ATOM 8140 CB LEU B 280 9.484 -10.875 42.918 1.00 25.96 C ATOM 8141 CG LEU B 280 10.086 -11.438 41.662 1.00 28.13 C ATOM 8142 CD1 LEU B 280 9.954 -10.290 40.663 1.00 30.52 C ATOM 8143 CD2 LEU B 280 11.550 -11.825 41.904 1.00 32.09 C ATOM 8144 HA LEU B 280 10.653 -11.331 44.700 1.00 0.00 H ATOM 8145 HB2 LEU B 280 8.410 -10.856 42.734 1.00 0.00 H ATOM 8146 HB3 LEU B 280 9.859 -9.853 42.979 1.00 0.00 H ATOM 8147 HG LEU B 280 9.600 -12.347 41.308 1.00 0.00 H ATOM 8148 HD21 LEU B 280 12.113 -10.942 42.205 1.00 0.00 H ATOM 8149 HD22 LEU B 280 11.600 -12.576 42.692 1.00 0.00 H ATOM 8150 HD23 LEU B 280 11.974 -12.231 40.986 1.00 0.00 H ATOM 8151 HD11 LEU B 280 8.901 -10.034 40.542 1.00 0.00 H ATOM 8152 HD12 LEU B 280 10.500 -9.422 41.034 1.00 0.00 H ATOM 8153 HD13 LEU B 280 10.367 -10.597 39.702 1.00 0.00 H ATOM 8154 H LEU B 280 8.411 -13.211 44.074 1.00 0.00 H ATOM 8155 N ASP B 281 9.144 -9.559 45.727 1.00 24.71 N ATOM 8156 CA ASP B 281 8.252 -8.572 46.308 1.00 22.77 C ATOM 8157 C ASP B 281 8.901 -7.186 46.280 1.00 19.58 C ATOM 8158 O ASP B 281 10.133 -7.066 46.103 1.00 16.82 O ATOM 8159 CB ASP B 281 7.790 -8.982 47.718 1.00 25.00 C ATOM 8160 CG ASP B 281 6.408 -8.419 48.069 1.00 31.74 C ATOM 8161 OD1 ASP B 281 5.993 -7.389 47.423 1.00 27.67 O ATOM 8162 OD2 ASP B 281 5.746 -9.012 48.977 1.00 27.06 O ATOM 8163 HA ASP B 281 7.349 -8.522 45.700 1.00 0.00 H ATOM 8164 HB2 ASP B 281 7.748 -10.070 47.770 1.00 0.00 H ATOM 8165 HB3 ASP B 281 8.513 -8.612 48.445 1.00 0.00 H ATOM 8166 H ASP B 281 10.172 -9.402 45.746 1.00 0.00 H ATOM 8167 N ASN B 282 8.063 -6.171 46.440 1.00 14.55 N ATOM 8168 CA ASN B 282 8.429 -4.765 46.439 1.00 18.05 C ATOM 8169 C ASN B 282 7.504 -3.843 47.236 1.00 17.97 C ATOM 8170 O ASN B 282 6.342 -4.028 47.278 1.00 14.79 O ATOM 8171 CB ASN B 282 8.600 -4.262 45.008 1.00 16.33 C ATOM 8172 CG ASN B 282 7.277 -4.038 44.279 1.00 24.08 C ATOM 8173 OD1 ASN B 282 6.732 -2.994 44.338 1.00 21.70 O ATOM 8174 ND2 ASN B 282 6.812 -5.022 43.585 1.00 15.69 N ATOM 8175 HA ASN B 282 9.380 -4.720 46.970 1.00 0.00 H ATOM 8176 HB2 ASN B 282 9.143 -3.317 45.037 1.00 0.00 H ATOM 8177 HB3 ASN B 282 9.181 -4.997 44.451 1.00 0.00 H ATOM 8178 HD22 ASN B 282 7.323 -5.927 43.559 1.00 0.00 H ATOM 8179 HD21 ASN B 282 5.926 -4.909 43.052 1.00 0.00 H ATOM 8180 H ASN B 282 7.058 -6.401 46.578 1.00 0.00 H ATOM 8181 N ILE B 283 8.039 -2.823 47.866 1.00 22.28 N ATOM 8182 CA ILE B 283 7.184 -1.905 48.596 1.00 17.77 C ATOM 8183 C ILE B 283 7.526 -0.457 48.414 1.00 22.23 C ATOM 8184 O ILE B 283 8.647 -0.112 48.194 1.00 23.98 O ATOM 8185 CB ILE B 283 7.085 -2.271 50.117 1.00 20.86 C ATOM 8186 CG1 ILE B 283 5.812 -1.718 50.729 1.00 19.42 C ATOM 8187 CG2 ILE B 283 8.253 -1.817 50.883 1.00 12.49 C ATOM 8188 CD1 ILE B 283 5.577 -2.118 52.101 1.00 16.05 C ATOM 8189 HA ILE B 283 6.200 -2.036 48.145 1.00 0.00 H ATOM 8190 HB ILE B 283 7.062 -3.359 50.171 1.00 0.00 H ATOM 8191 HG12 ILE B 283 5.864 -0.630 50.696 1.00 0.00 H ATOM 8192 HG13 ILE B 283 4.970 -2.058 50.127 1.00 0.00 H ATOM 8193 HD11 ILE B 283 5.507 -3.204 52.154 1.00 0.00 H ATOM 8194 HD12 ILE B 283 6.402 -1.775 52.725 1.00 0.00 H ATOM 8195 HD13 ILE B 283 4.645 -1.675 52.453 1.00 0.00 H ATOM 8196 HG21 ILE B 283 9.153 -2.285 50.483 1.00 0.00 H ATOM 8197 HG22 ILE B 283 8.339 -0.733 50.803 1.00 0.00 H ATOM 8198 HG23 ILE B 283 8.131 -2.097 51.929 1.00 0.00 H ATOM 8199 H ILE B 283 9.068 -2.674 47.842 1.00 0.00 H ATOM 8200 N ALA B 284 6.536 0.395 48.545 1.00 21.43 N ATOM 8201 CA ALA B 284 6.779 1.817 48.603 1.00 28.11 C ATOM 8202 C ALA B 284 7.379 2.221 49.926 1.00 24.92 C ATOM 8203 O ALA B 284 7.048 1.694 50.930 1.00 30.07 O ATOM 8204 CB ALA B 284 5.534 2.585 48.328 1.00 22.37 C ATOM 8205 HA ALA B 284 7.503 2.057 47.824 1.00 0.00 H ATOM 8206 HB1 ALA B 284 5.166 2.334 47.333 1.00 0.00 H ATOM 8207 HB2 ALA B 284 4.779 2.329 49.071 1.00 0.00 H ATOM 8208 HB3 ALA B 284 5.748 3.652 48.379 1.00 0.00 H ATOM 8209 H ALA B 284 5.561 0.040 48.608 1.00 0.00 H ATOM 8210 N ILE B 285 8.291 3.165 49.858 1.00 33.56 N ATOM 8211 CA ILE B 285 9.076 3.639 50.959 1.00 29.29 C ATOM 8212 C ILE B 285 9.167 5.162 50.984 1.00 35.08 C ATOM 8213 O ILE B 285 9.339 5.794 50.001 1.00 30.20 O ATOM 8214 CB ILE B 285 10.483 3.095 50.870 1.00 28.40 C ATOM 8215 CG1 ILE B 285 10.493 1.595 50.985 1.00 31.44 C ATOM 8216 CG2 ILE B 285 11.291 3.667 51.931 1.00 31.13 C ATOM 8217 CD1 ILE B 285 10.687 1.058 52.347 1.00 26.41 C ATOM 8218 HA ILE B 285 8.580 3.295 51.867 1.00 0.00 H ATOM 8219 HB ILE B 285 10.895 3.367 49.898 1.00 0.00 H ATOM 8220 HG12 ILE B 285 9.539 1.224 50.611 1.00 0.00 H ATOM 8221 HG13 ILE B 285 11.300 1.216 50.357 1.00 0.00 H ATOM 8222 HD11 ILE B 285 11.645 1.401 52.739 1.00 0.00 H ATOM 8223 HD12 ILE B 285 9.882 1.409 52.993 1.00 0.00 H ATOM 8224 HD13 ILE B 285 10.677 -0.031 52.311 1.00 0.00 H ATOM 8225 HG21 ILE B 285 11.313 4.752 51.825 1.00 0.00 H ATOM 8226 HG22 ILE B 285 10.859 3.404 52.897 1.00 0.00 H ATOM 8227 HG23 ILE B 285 12.305 3.274 51.866 1.00 0.00 H ATOM 8228 H ILE B 285 8.456 3.604 48.930 1.00 0.00 H ATOM 8229 N GLU B 286 9.077 5.743 52.157 1.00 39.32 N ATOM 8230 CA GLU B 286 9.239 7.181 52.325 1.00 37.23 C ATOM 8231 C GLU B 286 10.357 7.403 53.324 1.00 37.71 C ATOM 8232 O GLU B 286 10.227 7.023 54.487 1.00 40.14 O ATOM 8233 CB GLU B 286 7.931 7.777 52.840 1.00 39.43 C ATOM 8234 CG GLU B 286 6.728 7.556 51.921 1.00 45.38 C ATOM 8235 CD GLU B 286 7.006 8.063 50.501 1.00 52.02 C ATOM 8236 OE1 GLU B 286 7.588 9.170 50.371 1.00 54.29 O ATOM 8237 OE2 GLU B 286 6.666 7.344 49.528 1.00 52.14 O ATOM 8238 HA GLU B 286 9.486 7.664 51.380 1.00 0.00 H ATOM 8239 HB2 GLU B 286 7.708 7.326 53.807 1.00 0.00 H ATOM 8240 HB3 GLU B 286 8.072 8.851 52.965 1.00 0.00 H ATOM 8241 HG2 GLU B 286 6.505 6.490 51.880 1.00 0.00 H ATOM 8242 HG3 GLU B 286 5.869 8.091 52.327 1.00 0.00 H ATOM 8243 H GLU B 286 8.884 5.158 52.995 1.00 0.00 H ATOM 8244 N ILE B 287 11.461 7.996 52.882 1.00 45.66 N ATOM 8245 CA ILE B 287 12.651 8.120 53.738 1.00 51.59 C ATOM 8246 C ILE B 287 12.618 9.413 54.556 1.00 58.65 C ATOM 8247 O ILE B 287 12.641 10.527 53.990 1.00 58.77 O ATOM 8248 CB ILE B 287 13.966 7.967 52.944 1.00 52.77 C ATOM 8249 CG1 ILE B 287 14.082 6.545 52.380 1.00 54.35 C ATOM 8250 CG2 ILE B 287 15.171 8.273 53.833 1.00 51.14 C ATOM 8251 CD1 ILE B 287 13.981 5.449 53.456 1.00 47.59 C ATOM 8252 HA ILE B 287 12.624 7.289 54.443 1.00 0.00 H ATOM 8253 HB ILE B 287 13.952 8.678 52.118 1.00 0.00 H ATOM 8254 HG12 ILE B 287 13.281 6.394 51.656 1.00 0.00 H ATOM 8255 HG13 ILE B 287 15.045 6.450 51.879 1.00 0.00 H ATOM 8256 HD11 ILE B 287 14.783 5.580 54.182 1.00 0.00 H ATOM 8257 HD12 ILE B 287 13.017 5.524 53.960 1.00 0.00 H ATOM 8258 HD13 ILE B 287 14.071 4.470 52.985 1.00 0.00 H ATOM 8259 HG21 ILE B 287 15.098 9.296 54.202 1.00 0.00 H ATOM 8260 HG22 ILE B 287 15.184 7.581 54.675 1.00 0.00 H ATOM 8261 HG23 ILE B 287 16.087 8.159 53.253 1.00 0.00 H ATOM 8262 H ILE B 287 11.484 8.379 51.915 1.00 0.00 H ATOM 8263 N GLY B 288 12.570 9.239 55.885 1.00 59.62 N ATOM 8264 CA GLY B 288 12.138 10.282 56.798 1.00 62.60 C ATOM 8265 C GLY B 288 10.636 10.107 56.957 1.00 65.06 C ATOM 8266 O GLY B 288 10.188 9.119 57.519 1.00 67.93 O ATOM 8267 HA3 GLY B 288 12.363 11.265 56.384 1.00 0.00 H ATOM 8268 HA2 GLY B 288 12.636 10.172 57.761 1.00 0.00 H ATOM 8269 H GLY B 288 12.854 8.319 56.278 1.00 0.00 H TER 8270 GLY B 288 HETATM 8271 O HOH 1 15.994 -8.394 8.907 1.00 31.68 O HETATM 8272 O HOH 2 18.826 1.895 2.083 1.00 24.89 O HETATM 8273 O HOH 3 7.397 -9.757 15.477 1.00 32.13 O HETATM 8274 O HOH 4 22.450 7.020 -9.788 1.00 17.24 O HETATM 8275 O HOH 5 14.121 -5.503 11.039 1.00 16.69 O HETATM 8276 O HOH 6 11.848 13.247 9.805 1.00 17.26 O HETATM 8277 O HOH 7 13.693 4.405 1.728 1.00 20.24 O HETATM 8278 O HOH 8 23.857 7.195 -12.125 1.00 16.74 O HETATM 8279 O HOH 9 17.064 -10.247 -25.251 1.00 27.28 O HETATM 8280 O HOH 10 22.582 -0.910 10.611 1.00 27.37 O HETATM 8281 O HOH 11 23.915 -15.487 -17.481 1.00 21.82 O HETATM 8282 O HOH 12 10.579 9.603 3.160 1.00 18.64 O HETATM 8283 O HOH 13 -0.311 25.194 1.890 1.00 39.97 O HETATM 8284 O HOH 14 21.455 -1.273 0.327 1.00 25.97 O HETATM 8285 O HOH 15 14.986 -6.754 -15.819 1.00 23.11 O HETATM 8286 O HOH 16 16.337 6.153 33.063 1.00 21.94 O HETATM 8287 O HOH 17 4.110 -3.017 4.061 1.00 28.71 O HETATM 8288 O HOH 18 5.012 -3.819 6.276 1.00 38.94 O HETATM 8289 O HOH 19 4.275 -9.433 13.179 1.00 23.45 O HETATM 8290 O HOH 20 12.631 21.403 22.563 1.00 32.80 O HETATM 8291 O HOH 21 22.816 9.730 -6.100 1.00 21.06 O HETATM 8292 O HOH 22 22.443 0.651 -2.669 1.00 23.51 O HETATM 8293 O HOH 23 5.118 18.357 23.219 1.00 43.75 O HETATM 8294 O HOH 24 4.866 23.903 18.174 1.00 38.83 O HETATM 8295 O HOH 25 31.227 -15.094 -17.520 1.00 23.42 O HETATM 8296 O HOH 26 19.743 0.468 -0.048 1.00 25.90 O HETATM 8297 O HOH 27 -0.319 8.139 -3.537 1.00 46.19 O HETATM 8298 O HOH 28 22.431 8.262 -3.850 1.00 29.80 O HETATM 8299 O HOH 29 2.030 -1.754 4.401 1.00 37.99 O HETATM 8300 O HOH 30 10.318 20.237 19.469 1.00 43.96 O HETATM 8301 O HOH 31 22.477 6.426 -16.915 1.00 30.71 O HETATM 8302 O HOH 32 13.097 17.847 26.199 1.00 38.61 O HETATM 8303 O HOH 33 19.776 1.367 -2.834 1.00 27.43 O HETATM 8304 O HOH 34 -0.125 5.212 11.989 1.00 42.58 O HETATM 8305 O HOH 35 3.153 28.004 11.277 1.00 39.44 O HETATM 8306 O HOH 36 -1.678 18.879 2.968 1.00 27.35 O HETATM 8307 O HOH 37 18.584 19.201 6.466 1.00 35.09 O HETATM 8308 O HOH 38 12.643 3.220 -8.150 1.00 31.41 O HETATM 8309 O HOH 39 34.732 -2.354 -18.441 1.00 24.40 O HETATM 8310 O HOH 40 13.757 19.477 13.026 1.00 18.77 O HETATM 8311 O HOH 41 36.876 7.616 -6.640 1.00 41.04 O HETATM 8312 O HOH 42 30.778 -12.354 -18.435 1.00 27.28 O HETATM 8313 O HOH 43 15.815 15.776 28.834 1.00 33.58 O HETATM 8314 O HOH 44 21.132 -1.165 13.043 1.00 33.73 O HETATM 8315 O HOH 45 23.665 -16.878 -14.181 1.00 37.04 O HETATM 8316 O HOH 46 0.375 27.274 12.661 1.00 42.70 O HETATM 8317 O HOH 47 6.013 -9.914 11.404 1.00 37.87 O HETATM 8318 O HOH 48 22.208 17.723 -3.953 1.00 43.44 O HETATM 8319 O HOH 49 16.885 18.752 12.915 1.00 30.70 O HETATM 8320 O HOH 50 -0.710 5.955 -1.466 1.00 34.33 O HETATM 8321 O HOH 51 4.524 0.358 -1.891 1.00 29.71 O HETATM 8322 O HOH 52 14.249 3.750 -11.311 1.00 47.09 O HETATM 8323 O HOH 53 13.431 -0.079 -10.778 1.00 27.99 O HETATM 8324 O HOH 54 13.905 23.614 15.526 1.00 28.67 O HETATM 8325 O HOH 55 12.295 -8.396 3.841 1.00 24.73 O HETATM 8326 O HOH 56 27.728 12.093 -17.911 1.00 46.07 O HETATM 8327 O HOH 57 32.042 -7.902 -16.331 1.00 32.27 O HETATM 8328 O HOH 58 0.936 -3.232 10.239 1.00 37.94 O HETATM 8329 O HOH 59 11.333 0.309 -9.311 1.00 35.83 O HETATM 8330 O HOH 60 16.458 19.619 15.148 1.00 46.34 O HETATM 8331 O HOH 61 1.043 0.126 0.757 1.00 34.20 O HETATM 8332 O HOH 62 23.522 7.553 -7.523 1.00 22.93 O HETATM 8333 O HOH 63 14.391 11.726 10.760 1.00 31.05 O HETATM 8334 O HOH 64 24.591 5.420 5.707 1.00 31.21 O HETATM 8335 O HOH 65 19.416 5.498 29.798 1.00 31.52 O HETATM 8336 O HOH 66 18.041 4.234 31.720 1.00 34.64 O HETATM 8337 O HOH 67 9.312 15.463 24.293 1.00 21.06 O HETATM 8338 O HOH 68 5.438 -0.051 -4.117 1.00 42.37 O HETATM 8339 O HOH 69 9.920 -2.547 -0.459 1.00 38.68 O HETATM 8340 O HOH 70 19.885 3.705 2.868 1.00 32.00 O HETATM 8341 O HOH 71 14.853 -15.012 -21.439 1.00 24.41 O HETATM 8342 O HOH 72 19.331 5.246 5.613 1.00 37.85 O HETATM 8343 O HOH 73 4.906 10.995 -7.553 1.00 27.04 O HETATM 8344 O HOH 74 23.769 24.529 6.655 1.00 36.45 O HETATM 8345 O HOH 75 10.893 25.200 12.499 1.00 41.46 O HETATM 8346 O HOH 76 12.331 10.545 -13.106 1.00 35.97 O HETATM 8347 O HOH 77 -2.658 -3.530 13.406 1.00 30.77 O HETATM 8348 O HOH 78 36.115 11.453 -11.616 1.00 47.55 O HETATM 8349 O HOH 79 21.184 -6.287 13.198 1.00 40.00 O HETATM 8350 O HOH 80 15.620 -11.384 8.944 1.00 34.60 O HETATM 8351 O HOH 81 17.932 8.133 -19.000 1.00 42.20 O HETATM 8352 O HOH 82 15.498 3.252 -7.195 1.00 46.49 O HETATM 8353 O HOH 83 8.546 -1.583 -2.426 1.00 40.35 O HETATM 8354 O HOH 84 19.190 9.013 -21.130 1.00 53.44 O HETATM 8355 O HOH 85 15.886 -6.645 -22.803 1.00 36.59 O HETATM 8356 O HOH 86 23.581 -4.796 12.882 1.00 38.38 O HETATM 8357 O HOH 87 -7.425 14.981 -2.808 1.00 52.13 O HETATM 8358 O HOH 88 15.848 10.497 -16.459 1.00 51.42 O HETATM 8359 O HOH 89 -2.229 -6.651 13.176 1.00 36.15 O HETATM 8360 O HOH 90 10.029 9.059 31.223 1.00 26.78 O HETATM 8361 O HOH 91 3.816 7.239 -6.670 1.00 45.27 O HETATM 8362 O HOH 92 2.088 20.036 23.794 1.00 54.04 O HETATM 8363 O HOH 93 0.568 23.256 -5.220 1.00 42.54 O HETATM 8364 O HOH 94 9.951 -5.510 0.611 1.00 30.46 O HETATM 8365 O HOH 95 16.871 21.375 8.568 1.00 42.98 O HETATM 8366 O HOH 96 19.001 8.474 30.127 1.00 37.89 O HETATM 8367 O HOH 97 21.568 -2.516 15.598 1.00 36.74 O HETATM 8368 O HOH 98 7.593 -7.130 5.433 1.00 37.22 O HETATM 8369 O HOH 99 15.401 17.840 27.543 1.00 31.55 O HETATM 8370 O HOH 100 21.777 7.849 1.161 1.00 41.90 O HETATM 8371 O HOH 101 19.504 15.721 -6.674 1.00 39.95 O HETATM 8372 O HOH 102 25.376 21.887 7.485 1.00 38.09 O HETATM 8373 O HOH 103 36.136 -0.735 -7.704 1.00 32.48 O HETATM 8374 O HOH 104 24.371 4.632 14.307 1.00 34.74 O HETATM 8375 O HOH 105 18.774 12.706 -0.370 1.00 26.05 O HETATM 8376 O HOH 106 14.665 10.756 -0.992 1.00 44.02 O HETATM 8377 O HOH 107 22.283 9.238 6.121 1.00 40.93 O HETATM 8378 O HOH 108 0.445 31.807 3.689 1.00 36.04 O HETATM 8379 O HOH 109 11.688 26.304 18.791 1.00 35.26 O HETATM 8380 O HOH 110 21.295 10.174 20.234 1.00 42.77 O HETATM 8381 O HOH 111 21.553 1.169 18.937 1.00 33.62 O HETATM 8382 O HOH 112 38.073 17.649 -10.712 1.00 39.52 O HETATM 8383 O HOH 113 24.131 17.682 -9.776 1.00 48.97 O HETATM 8384 O HOH 114 30.730 18.101 17.386 1.00 44.00 O HETATM 8385 O HOH 115 14.633 0.234 -18.167 1.00 40.82 O HETATM 8386 O HOH 116 13.864 -6.260 -20.155 1.00 43.90 O HETATM 8387 O HOH 117 0.428 -9.796 11.365 1.00 33.48 O HETATM 8388 O HOH 118 -1.337 24.749 25.335 1.00 46.41 O HETATM 8389 O HOH 119 19.620 17.865 -5.418 1.00 42.78 O HETATM 8390 O HOH 120 5.605 -12.650 51.808 1.00 28.83 O HETATM 8391 O HOH 121 10.146 -6.236 40.144 1.00 11.26 O HETATM 8392 O HOH 122 16.613 1.853 31.172 1.00 20.55 O HETATM 8393 O HOH 123 7.464 4.416 54.159 1.00 28.97 O HETATM 8394 O HOH 124 -16.015 -5.274 28.920 1.00 33.75 O HETATM 8395 O HOH 125 12.293 -22.769 53.841 1.00 37.37 O HETATM 8396 O HOH 126 3.871 -5.095 35.742 1.00 27.23 O HETATM 8397 O HOH 127 16.134 -8.519 30.893 1.00 33.90 O HETATM 8398 O HOH 128 22.793 -1.863 33.875 1.00 39.63 O HETATM 8399 O HOH 129 1.169 6.800 31.220 1.00 30.32 O HETATM 8400 O HOH 130 7.471 -29.107 54.983 1.00 34.77 O HETATM 8401 O HOH 131 -14.924 -7.164 37.169 1.00 30.36 O HETATM 8402 O HOH 132 11.516 -7.560 43.333 1.00 23.62 O HETATM 8403 O HOH 133 17.680 -18.776 54.936 1.00 31.46 O HETATM 8404 O HOH 134 7.232 -11.924 13.550 1.00 26.79 O HETATM 8405 O HOH 135 -1.070 -11.098 26.701 1.00 25.86 O HETATM 8406 O HOH 136 15.667 -6.809 21.770 1.00 31.40 O HETATM 8407 O HOH 137 6.538 -12.964 47.211 1.00 22.48 O HETATM 8408 O HOH 138 10.212 12.030 22.463 1.00 15.00 O HETATM 8409 O HOH 139 -0.586 -7.221 33.281 1.00 37.33 O HETATM 8410 O HOH 140 18.563 5.028 59.248 1.00 28.95 O HETATM 8411 O HOH 141 5.455 6.804 30.552 1.00 18.63 O HETATM 8412 O HOH 142 -3.037 3.017 22.289 1.00 33.53 O HETATM 8413 O HOH 143 13.692 0.806 28.553 1.00 18.97 O HETATM 8414 O HOH 144 1.778 10.718 21.311 1.00 35.97 O HETATM 8415 O HOH 145 19.828 -1.040 48.215 1.00 29.72 O HETATM 8416 O HOH 146 1.522 -3.194 45.323 1.00 33.28 O HETATM 8417 O HOH 147 -0.359 3.862 37.842 1.00 38.28 O HETATM 8418 O HOH 148 2.107 -10.206 14.521 1.00 34.84 O HETATM 8419 O HOH 149 4.722 -7.630 45.379 1.00 45.33 O HETATM 8420 O HOH 150 8.755 -9.610 33.977 1.00 41.71 O HETATM 8421 O HOH 151 9.141 -6.830 42.434 1.00 21.77 O HETATM 8422 O HOH 152 7.507 5.650 47.279 1.00 37.25 O HETATM 8423 O HOH 153 4.014 8.671 25.419 1.00 29.48 O HETATM 8424 O HOH 154 11.576 9.579 26.841 1.00 25.53 O HETATM 8425 O HOH 155 9.166 -10.018 36.641 1.00 27.13 O HETATM 8426 O HOH 156 12.852 -6.130 40.133 1.00 19.84 O HETATM 8427 O HOH 157 17.287 -15.151 54.379 1.00 28.74 O HETATM 8428 O HOH 158 12.561 5.113 35.100 1.00 17.77 O HETATM 8429 O HOH 159 -6.938 -16.128 43.517 1.00 40.50 O HETATM 8430 O HOH 160 -10.765 -14.050 15.261 1.00 35.06 O HETATM 8431 O HOH 161 3.491 -0.242 48.339 1.00 30.57 O HETATM 8432 O HOH 162 -5.312 -19.838 20.975 1.00 33.47 O HETATM 8433 O HOH 163 21.047 -7.162 47.567 1.00 37.63 O HETATM 8434 O HOH 164 2.703 -23.288 55.677 1.00 36.33 O HETATM 8435 O HOH 165 20.352 -6.466 60.583 1.00 22.47 O HETATM 8436 O HOH 166 -14.768 -2.829 38.790 1.00 41.22 O HETATM 8437 O HOH 167 -0.582 -4.128 48.446 1.00 32.93 O HETATM 8438 O HOH 168 -8.808 -3.339 41.537 1.00 35.61 O HETATM 8439 O HOH 169 3.520 6.338 32.424 1.00 37.82 O HETATM 8440 O HOH 170 1.955 -20.991 17.116 1.00 37.88 O HETATM 8441 O HOH 171 -13.448 7.378 30.476 1.00 34.89 O HETATM 8442 O HOH 172 -5.101 -11.298 11.826 1.00 42.16 O HETATM 8443 O HOH 173 20.457 -15.209 51.816 1.00 43.15 O HETATM 8444 O HOH 174 -3.134 -17.365 23.360 1.00 40.91 O HETATM 8445 O HOH 175 18.337 8.099 55.442 1.00 34.11 O HETATM 8446 O HOH 176 7.971 6.918 56.759 1.00 38.38 O HETATM 8447 O HOH 177 -4.309 -7.312 48.993 1.00 28.45 O HETATM 8448 O HOH 178 10.274 10.550 24.768 1.00 32.29 O HETATM 8449 O HOH 179 -1.559 6.258 34.481 1.00 37.93 O HETATM 8450 O HOH 180 20.336 5.989 56.742 1.00 42.77 O HETATM 8451 O HOH 181 11.096 -12.085 36.741 1.00 36.59 O HETATM 8452 O HOH 182 21.576 -10.791 49.564 1.00 39.79 O HETATM 8453 O HOH 183 5.767 10.408 25.137 1.00 28.60 O HETATM 8454 O HOH 184 5.521 -11.761 49.138 1.00 8.63 O HETATM 8455 O HOH 185 4.581 -14.532 45.676 1.00 21.51 O HETATM 8456 O HOH 186 9.993 -9.658 15.663 1.00 22.03 O HETATM 8457 O HOH 187 9.640 -6.957 37.607 1.00 39.57 O HETATM 8458 O HOH 188 -4.237 -16.743 16.725 1.00 29.64 O HETATM 8459 O HOH 189 9.724 -23.130 57.476 1.00 36.43 O HETATM 8460 O HOH 190 19.297 -13.494 54.677 1.00 28.60 O HETATM 8461 O HOH 191 19.266 -10.402 62.873 1.00 38.32 O HETATM 8462 O HOH 192 11.337 11.164 60.671 1.00 32.72 O HETATM 8463 O HOH 193 12.124 9.834 40.258 1.00 35.38 O HETATM 8464 O HOH 194 3.543 12.922 21.431 1.00 38.21 O HETATM 8465 O HOH 195 -16.932 -2.429 31.537 1.00 30.55 O HETATM 8466 O HOH 196 16.045 -7.618 28.042 1.00 30.41 O HETATM 8467 O HOH 197 -20.766 1.603 27.921 1.00 47.58 O HETATM 8468 O HOH 198 20.942 -5.652 53.396 1.00 38.59 O HETATM 8469 O HOH 199 1.485 7.991 29.018 1.00 40.29 O HETATM 8470 O HOH 200 6.490 -13.792 43.627 1.00 29.87 O HETATM 8471 O HOH 201 -19.176 -10.215 29.911 1.00 44.84 O HETATM 8472 O HOH 202 -4.812 -4.155 44.015 1.00 34.06 O HETATM 8473 O HOH 203 20.078 -9.263 60.721 1.00 28.90 O HETATM 8474 O HOH 204 8.192 4.763 37.117 1.00 33.79 O HETATM 8475 O HOH 205 -12.477 -1.364 12.911 1.00 39.35 O HETATM 8476 O HOH 206 -16.971 -14.808 20.565 1.00 32.28 O HETATM 8477 O HOH 207 -5.220 -15.808 51.543 1.00 38.45 O HETATM 8478 O HOH 208 -2.175 -19.159 13.862 1.00 35.08 O HETATM 8479 O HOH 209 21.246 -5.061 62.434 1.00 23.00 O HETATM 8480 O HOH 210 -20.690 -14.503 27.441 1.00 47.86 O HETATM 8481 O HOH 211 9.236 -11.090 4.996 1.00 36.17 O HETATM 8482 O HOH 212 1.881 1.038 45.949 1.00 47.39 O HETATM 8483 O HOH 213 -0.482 -13.120 12.454 1.00 46.72 O HETATM 8484 O HOH 214 -3.301 -14.821 58.681 1.00 35.79 O HETATM 8485 O HOH 215 -9.344 -16.618 40.801 1.00 44.51 O HETATM 8486 O HOH 216 22.150 -5.941 58.242 1.00 38.32 O HETATM 8487 O HOH 217 -0.619 -27.875 44.138 1.00 46.45 O HETATM 8488 O HOH 218 -5.397 -33.360 41.559 1.00 33.73 O HETATM 8489 O HOH 219 2.518 2.459 40.500 1.00 43.35 O HETATM 8490 O HOH 220 18.068 8.431 62.723 1.00 40.70 O HETATM 8491 O HOH 221 20.488 3.024 45.632 1.00 43.86 O HETATM 8492 O HOH 222 -3.389 -17.871 43.632 1.00 39.05 O HETATM 8493 O HOH 223 5.450 3.021 38.054 1.00 37.17 O HETATM 8494 O HOH 224 0.699 -7.109 35.614 1.00 32.93 O HETATM 8495 O HOH 225 23.060 0.277 60.342 1.00 48.11 O HETATM 8496 O HOH 226 -9.037 1.124 19.598 1.00 40.57 O HETATM 8497 O HOH 227 12.526 -25.086 56.365 1.00 48.89 O HETATM 8498 O HOH 228 -0.534 -9.182 37.693 1.00 35.51 O HETATM 8499 O HOH 229 -0.282 -6.330 41.377 1.00 36.38 O HETATM 8500 O HOH 230 1.412 -14.929 38.784 1.00 38.26 O HETATM 8501 O HOH 231 24.439 -3.596 59.248 1.00 36.42 O HETATM 8502 O HOH 232 10.070 -14.704 7.290 1.00 36.91 O HETATM 8503 O HOH 233 -8.225 -9.624 9.574 1.00 43.84 O HETATM 8504 O HOH 234 -20.558 -9.725 11.036 1.00 37.97 O HETATM 8505 O HOH 235 -25.109 -6.020 17.092 1.00 51.49 O HETATM 8506 O HOH 236 -18.836 -3.665 16.548 1.00 44.72 O HETATM 8507 O HOH 237 -17.265 10.500 21.771 1.00 44.16 O HETATM 8508 O HOH 238 -17.594 -10.366 40.904 1.00 46.69 O HETATM 8509 O HOH 239 -14.936 -14.090 42.272 1.00 47.82 O HETATM 8510 O HOH 240 0.897 -18.972 22.967 1.00 46.74 O HETATM 8511 O HOH 241 9.692 5.019 34.926 1.00 36.55 O HETATM 8512 O HOH 242 9.125 -16.910 58.801 1.00 43.31 O HETATM 8513 O HOH 243 3.715 2.622 55.782 1.00 34.32 O HETATM 8514 O HOH 244 22.010 3.768 52.946 1.00 44.57 O HETATM 8515 O HOH 245 9.738 -13.707 28.377 1.00 48.47 O HETATM 8516 O HOH 246 -22.498 -9.794 40.564 1.00 37.20 O HETATM 8517 O HOH 247 9.947 -18.963 59.797 1.00 29.42 O HETATM 8518 O HOH 248 9.501 -21.299 59.148 1.00 32.17 O HETATM 8519 OAA BZ A 2 15.339 12.919 3.530 1.00 -0.56 O HETATM 8520 CAI BZ A 2 15.355 11.663 3.424 1.00 0.10 C HETATM 8521 OAB BZ A 2 15.768 11.045 2.429 1.00 -0.56 O HETATM 8522 CAJ BZ A 2 14.956 10.794 4.614 1.00 0.15 C HETATM 8523 CAG BZ A 2 14.679 11.302 5.810 1.00 -0.03 C HETATM 8524 CAK BZ A 2 14.408 10.321 6.668 1.00 -0.00 C HETATM 8525 CAE BZ A 2 14.062 10.345 8.022 1.00 -0.07 C HETATM 8526 CAC BZ A 2 13.844 9.169 8.710 1.00 -0.07 C HETATM 8527 CAD BZ A 2 13.977 7.968 8.018 1.00 -0.07 C HETATM 8528 CAF BZ A 2 14.320 7.939 6.670 1.00 -0.03 C HETATM 8529 CAL BZ A 2 14.540 9.122 5.971 1.00 0.13 C HETATM 8530 OAH BZ A 2 14.891 9.421 4.655 1.00 -0.25 O HETATM 8531 H4 BZ A 2 14.417 6.987 6.160 1.00 0.06 H HETATM 8532 H2 BZ A 2 13.809 7.034 8.542 1.00 0.06 H HETATM 8533 H1 BZ A 2 13.576 9.180 9.760 1.00 0.05 H HETATM 8534 H3 BZ A 2 13.964 11.295 8.536 1.00 0.06 H HETATM 8535 H5 BZ A 2 14.674 12.364 6.053 1.00 0.04 H CONECT 3785 3786 3798 3799 3800 CONECT 3798 3785 CONECT 3799 3785 CONECT 3800 3785 CONECT 4194 4195 4203 4204 4205 CONECT 4203 4194 CONECT 4204 4194 CONECT 4205 4194 CONECT 5239 5240 5252 5253 5254 CONECT 5252 5239 CONECT 5253 5239 CONECT 5254 5239 CONECT 8519 8520 CONECT 8520 8519 8521 8522 CONECT 8521 8520 CONECT 8522 8520 8523 8530 CONECT 8523 8522 8524 8535 CONECT 8524 8523 8525 8529 CONECT 8525 8524 8526 8534 CONECT 8526 8525 8527 8533 CONECT 8527 8526 8528 8532 CONECT 8528 8527 8529 8531 CONECT 8529 8524 8528 8530 CONECT 8530 8522 8529 CONECT 8531 8528 CONECT 8532 8527 CONECT 8533 8526 CONECT 8534 8525 CONECT 8535 8523 MASTER 0 0 0 0 0 0 0 0 8531 4 29 45 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 3ime
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
3cow
RCSB PDB
PDBbind
301aa, >3COW_1|Chains... at 99%
3coy
RCSB PDB
PDBbind
301aa, >3COY_1|Chains... at 99%
3coz
RCSB PDB
PDBbind
301aa, >3COZ_1|Chains... at 99%
3imc
RCSB PDB
PDBbind
301aa, >3IMC_1|Chains... at 99%
3img
RCSB PDB
PDBbind
301aa, >3IMG_1|Chains... at 99%
3iob
RCSB PDB
PDBbind
301aa, >3IOB_1|Chains... at 99%
3ioc
RCSB PDB
PDBbind
301aa, >3IOC_1|Chains... at 99%
3iod
RCSB PDB
PDBbind
301aa, >3IOD_1|Chains... at 99%
3ioe
RCSB PDB
PDBbind
301aa, >3IOE_1|Chains... at 99%
3isj
RCSB PDB
PDBbind
300aa, >3ISJ_1|Chains... at 100%
3iub
RCSB PDB
PDBbind
301aa, >3IUB_1|Chains... at 100%
3iue
RCSB PDB
PDBbind
301aa, >3IUE_1|Chains... at 100%
3ivc
RCSB PDB
PDBbind
301aa, >3IVC_1|Chains... at 100%
3ivg
RCSB PDB
PDBbind
301aa, >3IVG_1|Chains... at 100%
3ivx
RCSB PDB
PDBbind
301aa, >3IVX_1|Chains... at 100%
3le8
RCSB PDB
PDBbind
300aa, >3LE8_1|Chains... at 100%
4ddh
RCSB PDB
PDBbind
301aa, >4DDH_1|Chains... at 100%
4ddk
RCSB PDB
PDBbind
301aa, >4DDK_1|Chains... at 100%
4ddm
RCSB PDB
PDBbind
301aa, >4DDM_1|Chains... at 100%
4de5
RCSB PDB
PDBbind
301aa, >4DE5_1|Chains... at 100%
4ef6
RCSB PDB
PDBbind
300aa, >4EF6_1|Chains... at 100%
4efk
RCSB PDB
PDBbind
300aa, >4EFK_1|Chains... at 100%
4fzj
RCSB PDB
PDBbind
301aa, >4FZJ_1|Chains... at 100%
4g5f
RCSB PDB
PDBbind
309aa, >4G5F_1|Chains... *
4g5y
RCSB PDB
PDBbind
301aa, >4G5Y_1|Chains... at 99%
4mq6
RCSB PDB
PDBbind
309aa, >4MQ6_1|Chains... at 100%
4mue
RCSB PDB
PDBbind
300aa, >4MUE_1|Chains... at 100%
4muf
RCSB PDB
PDBbind
300aa, >4MUF_1|Chains... at 100%
4muk
RCSB PDB
PDBbind
300aa, >4MUK_1|Chains... at 100%
4mul
RCSB PDB
PDBbind
300aa, >4MUL_1|Chains... at 100%
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
4oyp
RCSB PDB
PDBbind
BZ2
Entry Information
PDB ID
3ime
Complex Type
Protein-Ligand
PDBbind Subset
refined set
Protein Name
M. tuberculosis pantothenate synthetase
Ligand Name
BZ2
EC.Number
E.C.6.3.2.1
Resolution
2.39(Å)
Affinity (Kd/Ki/IC50)
Kd=1000uM
Release Year
2009
Protein/NA Sequence
Check fasta file
Primary Reference
(2009) Angew.Chem.Int.Ed.Engl. Vol. 48: pp. 8452-8456
Ligand Properties
Formula
C
9
H
6
O
3
Molecular Weight
162.142
Exact Mass
162.032
No. of atoms
18
No. of bonds
19
Polar Surface Area
50.44
LOGP Value
2.97 (
Computed with XLOGP3
)
2.13 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 0
No. of Hydrogen Bond Acceptors: 2
No. of Rotatable Bonds: 0
No. of Nitrogen and Oxygen Atoms: 3
No. of Rings: 2
Canonical SMILES
OC(=O)c1cc2c(o1)cccc2
InChI String
InChI=1S/C9H6O3/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H,(H,10,11)
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
P9WIL5
Entrez Gene ID
NCBI Entrez Gene ID:
885459
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com