Browse entries in the PDBbind-CN Database
HEADER 3IOC_COMPLEX COMPND 3IOC_COMPLEX REMARK GENERATED BY SYBYL (TRIPOS, INC.) 15-AUG-21 SEQRES 1 A 69 PRO ALA PHE HIS PRO GLY GLU LEU ASN VAL TYR SER ALA SEQRES 2 A 69 PRO GLY ASP VAL ALA ASP VAL SER ARG ALA LEU ARG LEU SEQRES 3 A 69 THR GLY ARG ARG VAL MET LEU VAL PRO THR MET GLY ALA SEQRES 4 A 69 LEU HIS GLU GLY HIS LEU ALA LEU VAL ARG ALA ALA LYS SEQRES 5 A 69 ARG VAL PRO GLY SER VAL VAL VAL VAL SER ILE PHE VAL SEQRES 6 A 69 ASN PRO MET GLN SEQRES 1 A 204 THR PRO ASP ASP ASP LEU ALA GLN LEU ARG ALA GLU GLY SEQRES 2 A 204 VAL GLU ILE ALA PHE THR PRO THR THR ALA ALA MET TYR SEQRES 3 A 204 PRO ASP GLY LEU ARG THR THR VAL GLN PRO GLY PRO LEU SEQRES 4 A 204 ALA ALA GLU LEU GLU GLY GLY PRO ARG PRO THR HIS PHE SEQRES 5 A 204 ALA GLY VAL LEU THR VAL VAL LEU LYS LEU LEU GLN ILE SEQRES 6 A 204 VAL ARG PRO ASP ARG VAL PHE PHE GLY GLU LYS ASP TYR SEQRES 7 A 204 GLN GLN LEU VAL LEU ILE ARG GLN LEU VAL ALA ASP PHE SEQRES 8 A 204 ASN LEU ASP VAL ALA VAL VAL GLY VAL PRO THR VAL ARG SEQRES 9 A 204 GLU ALA ASP GLY LEU ALA MET SER SER ARG ASN ARG TYR SEQRES 10 A 204 LEU ASP PRO ALA GLN ARG ALA ALA ALA VAL ALA LEU SER SEQRES 11 A 204 ALA ALA LEU THR ALA ALA ALA HIS ALA ALA THR ALA GLY SEQRES 12 A 204 ALA GLN ALA ALA LEU ASP ALA ALA ARG ALA VAL LEU ASP SEQRES 13 A 204 ALA ALA PRO GLY VAL ALA VAL ASP TYR LEU GLU LEU ARG SEQRES 14 A 204 ASP ILE GLY LEU GLY PRO MET PRO LEU ASN GLY SER GLY SEQRES 15 A 204 ARG LEU LEU VAL ALA ALA ARG LEU GLY THR THR ARG LEU SEQRES 16 A 204 LEU ASP ASN ILE ALA ILE GLU ILE GLY SEQRES 1 B 71 ALA ILE PRO ALA PHE HIS PRO GLY GLU LEU ASN VAL TYR SEQRES 2 B 71 SER ALA PRO GLY ASP VAL ALA ASP VAL SER ARG ALA LEU SEQRES 3 B 71 ARG LEU THR GLY ARG ARG VAL MET LEU VAL PRO THR MET SEQRES 4 B 71 GLY ALA LEU HIS GLU GLY HIS LEU ALA LEU VAL ARG ALA SEQRES 5 B 71 ALA LYS ARG VAL PRO GLY SER VAL VAL VAL VAL SER ILE SEQRES 6 B 71 PHE VAL ASN PRO MET GLN SEQRES 1 B 203 PRO ASP ASP ASP LEU ALA GLN LEU ARG ALA GLU GLY VAL SEQRES 2 B 203 GLU ILE ALA PHE THR PRO THR THR ALA ALA MET TYR PRO SEQRES 3 B 203 ASP GLY LEU ARG THR THR VAL GLN PRO GLY PRO LEU ALA SEQRES 4 B 203 ALA GLU LEU GLU GLY GLY PRO ARG PRO THR HIS PHE ALA SEQRES 5 B 203 GLY VAL LEU THR VAL VAL LEU LYS LEU LEU GLN ILE VAL SEQRES 6 B 203 ARG PRO ASP ARG VAL PHE PHE GLY GLU LYS ASP TYR GLN SEQRES 7 B 203 GLN LEU VAL LEU ILE ARG GLN LEU VAL ALA ASP PHE ASN SEQRES 8 B 203 LEU ASP VAL ALA VAL VAL GLY VAL PRO THR VAL ARG GLU SEQRES 9 B 203 ALA ASP GLY LEU ALA MET SER SER ARG ASN ARG TYR LEU SEQRES 10 B 203 ASP PRO ALA GLN ARG ALA ALA ALA VAL ALA LEU SER ALA SEQRES 11 B 203 ALA LEU THR ALA ALA ALA HIS ALA ALA THR ALA GLY ALA SEQRES 12 B 203 GLN ALA ALA LEU ASP ALA ALA ARG ALA VAL LEU ASP ALA SEQRES 13 B 203 ALA PRO GLY VAL ALA VAL ASP TYR LEU GLU LEU ARG ASP SEQRES 14 B 203 ILE GLY LEU GLY PRO MET PRO LEU ASN GLY SER GLY ARG SEQRES 15 B 203 LEU LEU VAL ALA ALA ARG LEU GLY THR THR ARG LEU LEU SEQRES 16 B 203 ASP ASN ILE ALA ILE GLU ILE GLY HET A A 5D 46 ATOM 1 N PRO A 4 -3.791 24.522 20.055 1.00 70.17 N ATOM 2 CA PRO A 4 -3.049 24.060 18.836 1.00 66.47 C ATOM 3 C PRO A 4 -3.826 24.279 17.482 1.00 65.98 C ATOM 4 O PRO A 4 -4.758 23.515 17.173 1.00 59.72 O ATOM 5 CB PRO A 4 -2.779 22.568 19.119 1.00 65.82 C ATOM 6 CG PRO A 4 -3.616 22.223 20.375 1.00 70.53 C ATOM 7 CD PRO A 4 -3.827 23.519 21.135 1.00 70.02 C ATOM 8 HA PRO A 4 -2.140 24.642 18.683 1.00 0.00 H ATOM 9 HD3 PRO A 4 -4.789 23.525 21.648 1.00 0.00 H ATOM 10 HD2 PRO A 4 -3.029 23.688 21.858 1.00 0.00 H ATOM 11 HG3 PRO A 4 -3.080 21.506 20.997 1.00 0.00 H ATOM 12 HG2 PRO A 4 -4.577 21.800 20.081 1.00 0.00 H ATOM 13 HB2 PRO A 4 -3.093 21.957 18.273 1.00 0.00 H ATOM 14 HB3 PRO A 4 -1.719 22.403 19.311 1.00 0.00 H ATOM 15 N ALA A 5 -3.435 25.308 16.704 1.00 61.25 N ATOM 16 CA ALA A 5 -4.202 25.807 15.513 1.00 60.96 C ATOM 17 C ALA A 5 -3.754 25.321 14.116 1.00 55.31 C ATOM 18 O ALA A 5 -2.571 25.396 13.766 1.00 57.55 O ATOM 19 CB ALA A 5 -4.311 27.389 15.510 1.00 56.02 C ATOM 20 HA ALA A 5 -5.175 25.340 15.663 1.00 0.00 H ATOM 21 HB1 ALA A 5 -4.824 27.718 16.413 1.00 0.00 H ATOM 22 HB2 ALA A 5 -3.311 27.821 15.481 1.00 0.00 H ATOM 23 HB3 ALA A 5 -4.873 27.712 14.633 1.00 0.00 H ATOM 24 H ALA A 5 -2.544 25.788 16.944 1.00 0.00 H ATOM 25 N PHE A 6 -4.737 24.881 13.326 1.00 52.41 N ATOM 26 CA PHE A 6 -4.564 24.408 11.954 1.00 48.99 C ATOM 27 C PHE A 6 -5.325 25.276 10.963 1.00 47.98 C ATOM 28 O PHE A 6 -6.528 25.201 10.904 1.00 45.36 O ATOM 29 CB PHE A 6 -5.065 22.970 11.829 1.00 44.30 C ATOM 30 CG PHE A 6 -4.927 22.390 10.436 1.00 46.29 C ATOM 31 CD1 PHE A 6 -3.682 22.247 9.844 1.00 41.21 C ATOM 32 CD2 PHE A 6 -6.051 21.954 9.735 1.00 45.40 C ATOM 33 CE1 PHE A 6 -3.564 21.708 8.577 1.00 44.41 C ATOM 34 CE2 PHE A 6 -5.943 21.434 8.474 1.00 36.07 C ATOM 35 CZ PHE A 6 -4.704 21.295 7.890 1.00 44.45 C ATOM 36 HA PHE A 6 -3.500 24.461 11.723 1.00 0.00 H ATOM 37 HB2 PHE A 6 -4.495 22.347 12.518 1.00 0.00 H ATOM 38 HB3 PHE A 6 -6.119 22.948 12.107 1.00 0.00 H ATOM 39 HD2 PHE A 6 -7.034 22.029 10.200 1.00 0.00 H ATOM 40 HE2 PHE A 6 -6.838 21.130 7.932 1.00 0.00 H ATOM 41 HZ PHE A 6 -4.615 20.863 6.893 1.00 0.00 H ATOM 42 HE1 PHE A 6 -2.582 21.606 8.116 1.00 0.00 H ATOM 43 HD1 PHE A 6 -2.788 22.562 10.382 1.00 0.00 H ATOM 44 H PHE A 6 -5.700 24.874 13.718 1.00 0.00 H ATOM 45 N HIS A 7 -4.617 26.075 10.167 1.00 51.14 N ATOM 46 CA HIS A 7 -5.233 26.914 9.116 1.00 51.27 C ATOM 47 C HIS A 7 -5.240 26.223 7.719 1.00 50.66 C ATOM 48 O HIS A 7 -4.207 26.171 7.051 1.00 51.77 O ATOM 49 CB HIS A 7 -4.570 28.311 9.108 1.00 51.40 C ATOM 50 CG HIS A 7 -4.592 28.983 10.450 1.00 55.26 C ATOM 51 ND1 HIS A 7 -5.765 29.371 11.070 1.00 60.07 N ATOM 52 CD2 HIS A 7 -3.593 29.296 11.312 1.00 53.95 C ATOM 53 CE1 HIS A 7 -5.488 29.890 12.256 1.00 59.92 C ATOM 54 NE2 HIS A 7 -4.177 29.857 12.426 1.00 57.43 N ATOM 55 HA HIS A 7 -6.288 27.048 9.356 1.00 0.00 H ATOM 56 HB2 HIS A 7 -3.533 28.201 8.792 1.00 0.00 H ATOM 57 HB3 HIS A 7 -5.100 28.942 8.395 1.00 0.00 H ATOM 58 HD2 HIS A 7 -2.527 29.134 11.153 1.00 0.00 H ATOM 59 HE1 HIS A 7 -6.215 30.278 12.969 1.00 0.00 H ATOM 60 H HIS A 7 -3.585 26.111 10.290 1.00 0.00 H ATOM 61 N PRO A 8 -6.410 25.703 7.269 1.00 48.41 N ATOM 62 CA PRO A 8 -6.420 24.841 6.072 1.00 49.84 C ATOM 63 C PRO A 8 -6.103 25.583 4.806 1.00 48.15 C ATOM 64 O PRO A 8 -6.301 26.795 4.735 1.00 49.80 O ATOM 65 CB PRO A 8 -7.858 24.284 5.999 1.00 49.77 C ATOM 66 CG PRO A 8 -8.521 24.700 7.263 1.00 53.73 C ATOM 67 CD PRO A 8 -7.759 25.891 7.816 1.00 49.80 C ATOM 68 HA PRO A 8 -5.654 24.070 6.157 1.00 0.00 H ATOM 69 HD3 PRO A 8 -8.194 26.829 7.472 1.00 0.00 H ATOM 70 HD2 PRO A 8 -7.746 25.876 8.906 1.00 0.00 H ATOM 71 HG3 PRO A 8 -8.500 23.880 7.981 1.00 0.00 H ATOM 72 HG2 PRO A 8 -9.555 24.981 7.065 1.00 0.00 H ATOM 73 HB2 PRO A 8 -8.383 24.701 5.140 1.00 0.00 H ATOM 74 HB3 PRO A 8 -7.840 23.197 5.920 1.00 0.00 H ATOM 75 N GLY A 9 -5.609 24.840 3.820 1.00 47.31 N ATOM 76 CA GLY A 9 -5.230 25.409 2.551 1.00 47.05 C ATOM 77 C GLY A 9 -3.916 26.117 2.689 1.00 50.26 C ATOM 78 O GLY A 9 -3.325 26.496 1.696 1.00 48.87 O ATOM 79 HA3 GLY A 9 -5.992 26.118 2.229 1.00 0.00 H ATOM 80 HA2 GLY A 9 -5.138 24.615 1.810 1.00 0.00 H ATOM 81 H GLY A 9 -5.493 23.817 3.969 1.00 0.00 H ATOM 82 N GLU A 10 -3.456 26.273 3.930 1.00 53.26 N ATOM 83 CA GLU A 10 -2.148 26.877 4.236 1.00 56.50 C ATOM 84 C GLU A 10 -1.110 25.915 4.842 1.00 53.94 C ATOM 85 O GLU A 10 -1.444 24.809 5.255 1.00 55.46 O ATOM 86 CB GLU A 10 -2.342 28.059 5.181 1.00 55.13 C ATOM 87 CG GLU A 10 -3.338 29.035 4.630 1.00 63.50 C ATOM 88 CD GLU A 10 -3.291 30.351 5.324 1.00 63.03 C ATOM 89 OE1 GLU A 10 -2.498 30.471 6.277 1.00 66.28 O ATOM 90 OE2 GLU A 10 -4.031 31.262 4.901 1.00 65.92 O ATOM 91 HA GLU A 10 -1.741 27.188 3.274 1.00 0.00 H ATOM 92 HB2 GLU A 10 -2.699 27.691 6.143 1.00 0.00 H ATOM 93 HB3 GLU A 10 -1.387 28.565 5.319 1.00 0.00 H ATOM 94 HG2 GLU A 10 -3.127 29.190 3.572 1.00 0.00 H ATOM 95 HG3 GLU A 10 -4.338 28.616 4.743 1.00 0.00 H ATOM 96 H GLU A 10 -4.050 25.952 4.721 1.00 0.00 H ATOM 97 N LEU A 11 0.143 26.362 4.902 1.00 48.57 N ATOM 98 CA LEU A 11 1.209 25.608 5.517 1.00 41.85 C ATOM 99 C LEU A 11 1.270 25.937 6.988 1.00 40.26 C ATOM 100 O LEU A 11 1.581 27.062 7.335 1.00 40.23 O ATOM 101 CB LEU A 11 2.544 25.954 4.853 1.00 39.94 C ATOM 102 CG LEU A 11 3.840 25.311 5.375 1.00 41.04 C ATOM 103 CD1 LEU A 11 3.805 23.764 5.471 1.00 43.79 C ATOM 104 CD2 LEU A 11 5.017 25.732 4.534 1.00 45.89 C ATOM 105 HA LEU A 11 1.017 24.543 5.390 1.00 0.00 H ATOM 106 HB2 LEU A 11 2.455 25.680 3.802 1.00 0.00 H ATOM 107 HB3 LEU A 11 2.669 27.033 4.937 1.00 0.00 H ATOM 108 HG LEU A 11 3.943 25.678 6.396 1.00 0.00 H ATOM 109 HD21 LEU A 11 4.856 25.417 3.503 1.00 0.00 H ATOM 110 HD22 LEU A 11 5.120 26.816 4.572 1.00 0.00 H ATOM 111 HD23 LEU A 11 5.923 25.266 4.921 1.00 0.00 H ATOM 112 HD11 LEU A 11 3.008 23.461 6.150 1.00 0.00 H ATOM 113 HD12 LEU A 11 3.621 23.344 4.482 1.00 0.00 H ATOM 114 HD13 LEU A 11 4.762 23.403 5.848 1.00 0.00 H ATOM 115 H LEU A 11 0.362 27.291 4.489 1.00 0.00 H ATOM 116 N ASN A 12 0.996 24.939 7.829 1.00 38.19 N ATOM 117 CA ASN A 12 1.029 25.029 9.306 1.00 35.77 C ATOM 118 C ASN A 12 2.249 24.283 9.856 1.00 34.39 C ATOM 119 O ASN A 12 2.397 23.076 9.597 1.00 28.55 O ATOM 120 CB ASN A 12 -0.208 24.334 9.874 1.00 36.07 C ATOM 121 CG ASN A 12 -1.488 24.813 9.232 1.00 37.27 C ATOM 122 OD1 ASN A 12 -2.232 25.547 9.845 1.00 33.04 O ATOM 123 ND2 ASN A 12 -1.749 24.402 7.984 1.00 37.85 N ATOM 124 HA ASN A 12 1.066 26.082 9.587 1.00 0.00 H ATOM 125 HB2 ASN A 12 -0.114 23.261 9.707 1.00 0.00 H ATOM 126 HB3 ASN A 12 -0.259 24.531 10.945 1.00 0.00 H ATOM 127 HD22 ASN A 12 -1.083 23.772 7.494 1.00 0.00 H ATOM 128 HD21 ASN A 12 -2.618 24.713 7.505 1.00 0.00 H ATOM 129 H ASN A 12 0.738 24.022 7.413 1.00 0.00 H ATOM 130 N VAL A 13 3.091 24.970 10.635 1.00 31.63 N ATOM 131 CA VAL A 13 4.392 24.406 11.103 1.00 33.65 C ATOM 132 C VAL A 13 4.360 24.116 12.591 1.00 32.25 C ATOM 133 O VAL A 13 4.198 25.041 13.390 1.00 40.12 O ATOM 134 CB VAL A 13 5.649 25.339 10.761 1.00 29.74 C ATOM 135 CG1 VAL A 13 6.950 24.851 11.420 1.00 29.15 C ATOM 136 CG2 VAL A 13 5.878 25.405 9.296 1.00 30.58 C ATOM 137 HA VAL A 13 4.523 23.474 10.552 1.00 0.00 H ATOM 138 HB VAL A 13 5.401 26.323 11.158 1.00 0.00 H ATOM 139 HG11 VAL A 13 6.826 24.842 12.503 1.00 0.00 H ATOM 140 HG12 VAL A 13 7.177 23.844 11.071 1.00 0.00 H ATOM 141 HG13 VAL A 13 7.766 25.523 11.152 1.00 0.00 H ATOM 142 HG21 VAL A 13 6.071 24.403 8.914 1.00 0.00 H ATOM 143 HG22 VAL A 13 4.994 25.816 8.809 1.00 0.00 H ATOM 144 HG23 VAL A 13 6.737 26.045 9.092 1.00 0.00 H ATOM 145 H VAL A 13 2.830 25.934 10.926 1.00 0.00 H ATOM 146 N TYR A 14 4.517 22.851 12.982 1.00 34.56 N ATOM 147 CA TYR A 14 4.510 22.503 14.415 1.00 32.46 C ATOM 148 C TYR A 14 5.831 21.933 14.833 1.00 32.69 C ATOM 149 O TYR A 14 6.440 21.174 14.081 1.00 37.07 O ATOM 150 CB TYR A 14 3.453 21.470 14.713 1.00 35.75 C ATOM 151 CG TYR A 14 2.128 21.885 14.218 1.00 43.94 C ATOM 152 CD1 TYR A 14 1.323 22.779 14.947 1.00 46.12 C ATOM 153 CD2 TYR A 14 1.660 21.410 12.998 1.00 44.18 C ATOM 154 CE1 TYR A 14 0.078 23.166 14.444 1.00 45.17 C ATOM 155 CE2 TYR A 14 0.449 21.788 12.506 1.00 40.70 C ATOM 156 CZ TYR A 14 -0.339 22.666 13.216 1.00 40.73 C ATOM 157 OH TYR A 14 -1.548 23.015 12.661 1.00 42.51 O ATOM 158 HA TYR A 14 4.305 23.422 14.964 1.00 0.00 H ATOM 159 HB3 TYR A 14 3.397 21.323 15.792 1.00 0.00 H ATOM 160 HB2 TYR A 14 3.731 20.531 14.234 1.00 0.00 H ATOM 161 HD2 TYR A 14 2.277 20.719 12.423 1.00 0.00 H ATOM 162 HE2 TYR A 14 0.103 21.396 11.550 1.00 0.00 H ATOM 163 HE1 TYR A 14 -0.557 23.850 15.007 1.00 0.00 H ATOM 164 HD1 TYR A 14 1.670 23.170 15.904 1.00 0.00 H ATOM 165 HH TYR A 14 -2.016 23.646 13.263 1.00 0.00 H ATOM 166 H TYR A 14 4.645 22.103 12.270 1.00 0.00 H ATOM 167 N SER A 15 6.255 22.288 16.037 1.00 31.19 N ATOM 168 CA SER A 15 7.491 21.791 16.593 1.00 29.42 C ATOM 169 C SER A 15 7.317 20.793 17.694 1.00 27.41 C ATOM 170 O SER A 15 8.167 19.901 17.893 1.00 28.20 O ATOM 171 CB SER A 15 8.304 22.944 17.121 1.00 28.01 C ATOM 172 OG SER A 15 8.989 23.437 16.003 1.00 39.16 O ATOM 173 HA SER A 15 7.995 21.275 15.776 1.00 0.00 H ATOM 174 HB2 SER A 15 9.005 22.603 17.883 1.00 0.00 H ATOM 175 HB3 SER A 15 7.655 23.711 17.544 1.00 0.00 H ATOM 176 HG SER A 15 9.563 22.723 15.628 1.00 0.00 H ATOM 177 H SER A 15 5.679 22.946 16.600 1.00 0.00 H ATOM 178 N ALA A 16 6.252 20.992 18.459 1.00 28.66 N ATOM 179 CA ALA A 16 6.001 20.163 19.621 1.00 25.47 C ATOM 180 C ALA A 16 5.277 18.907 19.134 1.00 26.99 C ATOM 181 O ALA A 16 4.285 18.984 18.359 1.00 28.62 O ATOM 182 CB ALA A 16 5.186 20.903 20.644 1.00 19.62 C ATOM 183 HA ALA A 16 6.937 19.893 20.109 1.00 0.00 H ATOM 184 HB1 ALA A 16 5.726 21.795 20.960 1.00 0.00 H ATOM 185 HB2 ALA A 16 4.230 21.191 20.206 1.00 0.00 H ATOM 186 HB3 ALA A 16 5.013 20.257 21.505 1.00 0.00 H ATOM 187 H ALA A 16 5.586 21.755 18.221 1.00 0.00 H ATOM 188 N PRO A 17 5.815 17.738 19.511 1.00 20.46 N ATOM 189 CA PRO A 17 5.159 16.467 19.187 1.00 21.94 C ATOM 190 C PRO A 17 3.644 16.499 19.507 1.00 25.90 C ATOM 191 O PRO A 17 2.805 16.193 18.624 1.00 24.96 O ATOM 192 CB PRO A 17 5.938 15.453 20.025 1.00 20.91 C ATOM 193 CG PRO A 17 7.349 16.054 20.073 1.00 21.78 C ATOM 194 CD PRO A 17 7.114 17.555 20.178 1.00 19.40 C ATOM 195 HA PRO A 17 5.182 16.223 18.125 1.00 0.00 H ATOM 196 HD3 PRO A 17 7.067 17.872 21.220 1.00 0.00 H ATOM 197 HD2 PRO A 17 7.899 18.111 19.665 1.00 0.00 H ATOM 198 HG3 PRO A 17 7.903 15.812 19.166 1.00 0.00 H ATOM 199 HG2 PRO A 17 7.896 15.687 20.941 1.00 0.00 H ATOM 200 HB2 PRO A 17 5.515 15.365 21.026 1.00 0.00 H ATOM 201 HB3 PRO A 17 5.945 14.473 19.547 1.00 0.00 H ATOM 202 N GLY A 18 3.317 16.966 20.717 1.00 27.57 N ATOM 203 CA GLY A 18 1.944 17.096 21.188 1.00 28.53 C ATOM 204 C GLY A 18 1.054 17.838 20.222 1.00 32.94 C ATOM 205 O GLY A 18 -0.047 17.354 19.955 1.00 36.21 O ATOM 206 HA3 GLY A 18 1.952 17.634 22.136 1.00 0.00 H ATOM 207 HA2 GLY A 18 1.534 16.098 21.341 1.00 0.00 H ATOM 208 H GLY A 18 4.085 17.252 21.357 1.00 0.00 H ATOM 209 N ASP A 19 1.516 18.974 19.661 1.00 38.05 N ATOM 210 CA ASP A 19 0.653 19.789 18.739 1.00 38.92 C ATOM 211 C ASP A 19 0.316 19.001 17.479 1.00 39.24 C ATOM 212 O ASP A 19 -0.850 18.756 17.160 1.00 40.60 O ATOM 213 CB ASP A 19 1.337 21.063 18.267 1.00 39.08 C ATOM 214 CG ASP A 19 1.622 22.044 19.379 1.00 43.60 C ATOM 215 OD1 ASP A 19 0.886 22.073 20.389 1.00 41.70 O ATOM 216 OD2 ASP A 19 2.600 22.810 19.204 1.00 44.09 O ATOM 217 HA ASP A 19 -0.236 20.035 19.319 1.00 0.00 H ATOM 218 HB2 ASP A 19 2.282 20.793 17.795 1.00 0.00 H ATOM 219 HB3 ASP A 19 0.693 21.549 17.535 1.00 0.00 H ATOM 220 H ASP A 19 2.484 19.291 19.870 1.00 0.00 H ATOM 221 N VAL A 20 1.360 18.616 16.754 1.00 40.00 N ATOM 222 CA VAL A 20 1.209 17.779 15.564 1.00 35.00 C ATOM 223 C VAL A 20 0.338 16.535 15.832 1.00 32.29 C ATOM 224 O VAL A 20 -0.470 16.181 15.004 1.00 30.37 O ATOM 225 CB VAL A 20 2.578 17.461 14.908 1.00 33.43 C ATOM 226 CG1 VAL A 20 3.171 16.080 15.360 1.00 30.03 C ATOM 227 CG2 VAL A 20 2.439 17.560 13.414 1.00 34.35 C ATOM 228 HA VAL A 20 0.656 18.356 14.823 1.00 0.00 H ATOM 229 HB VAL A 20 3.302 18.200 15.251 1.00 0.00 H ATOM 230 HG11 VAL A 20 3.315 16.084 16.440 1.00 0.00 H ATOM 231 HG12 VAL A 20 2.480 15.282 15.087 1.00 0.00 H ATOM 232 HG13 VAL A 20 4.129 15.918 14.865 1.00 0.00 H ATOM 233 HG21 VAL A 20 1.691 16.844 13.072 1.00 0.00 H ATOM 234 HG22 VAL A 20 2.127 18.569 13.145 1.00 0.00 H ATOM 235 HG23 VAL A 20 3.398 17.338 12.946 1.00 0.00 H ATOM 236 H VAL A 20 2.313 18.918 17.041 1.00 0.00 H ATOM 237 N ALA A 21 0.445 15.937 17.011 1.00 26.52 N ATOM 238 CA ALA A 21 -0.319 14.764 17.314 1.00 32.54 C ATOM 239 C ALA A 21 -1.833 15.121 17.437 1.00 41.37 C ATOM 240 O ALA A 21 -2.727 14.438 16.884 1.00 36.16 O ATOM 241 CB ALA A 21 0.192 14.178 18.624 1.00 31.94 C ATOM 242 HA ALA A 21 -0.207 14.033 16.513 1.00 0.00 H ATOM 243 HB1 ALA A 21 1.245 13.919 18.518 1.00 0.00 H ATOM 244 HB2 ALA A 21 0.076 14.914 19.420 1.00 0.00 H ATOM 245 HB3 ALA A 21 -0.381 13.283 18.868 1.00 0.00 H ATOM 246 H ALA A 21 1.093 16.325 17.726 1.00 0.00 H ATOM 247 N ASP A 22 -2.096 16.190 18.193 1.00 39.18 N ATOM 248 CA ASP A 22 -3.432 16.641 18.461 1.00 38.54 C ATOM 249 C ASP A 22 -4.144 16.953 17.133 1.00 41.79 C ATOM 250 O ASP A 22 -5.275 16.462 16.888 1.00 48.13 O ATOM 251 CB ASP A 22 -3.386 17.868 19.399 1.00 43.04 C ATOM 252 CG ASP A 22 -2.860 17.535 20.826 1.00 44.75 C ATOM 253 OD1 ASP A 22 -2.805 16.349 21.202 1.00 38.78 O ATOM 254 OD2 ASP A 22 -2.516 18.474 21.592 1.00 49.47 O ATOM 255 HA ASP A 22 -4.001 15.861 18.967 1.00 0.00 H ATOM 256 HB2 ASP A 22 -2.731 18.618 18.955 1.00 0.00 H ATOM 257 HB3 ASP A 22 -4.394 18.274 19.488 1.00 0.00 H ATOM 258 H ASP A 22 -1.300 16.718 18.605 1.00 0.00 H ATOM 259 N VAL A 23 -3.486 17.756 16.289 1.00 35.61 N ATOM 260 CA VAL A 23 -3.989 18.123 14.966 1.00 36.65 C ATOM 261 C VAL A 23 -4.213 16.855 14.090 1.00 35.81 C ATOM 262 O VAL A 23 -5.319 16.551 13.664 1.00 37.60 O ATOM 263 CB VAL A 23 -3.019 19.165 14.309 1.00 38.32 C ATOM 264 CG1 VAL A 23 -3.456 19.513 12.925 1.00 40.69 C ATOM 265 CG2 VAL A 23 -2.926 20.463 15.137 1.00 34.42 C ATOM 266 HA VAL A 23 -4.965 18.600 15.057 1.00 0.00 H ATOM 267 HB VAL A 23 -2.037 18.692 14.276 1.00 0.00 H ATOM 268 HG11 VAL A 23 -3.466 18.612 12.311 1.00 0.00 H ATOM 269 HG12 VAL A 23 -4.457 19.943 12.959 1.00 0.00 H ATOM 270 HG13 VAL A 23 -2.763 20.237 12.498 1.00 0.00 H ATOM 271 HG21 VAL A 23 -3.915 20.916 15.213 1.00 0.00 H ATOM 272 HG22 VAL A 23 -2.554 20.230 16.135 1.00 0.00 H ATOM 273 HG23 VAL A 23 -2.244 21.157 14.646 1.00 0.00 H ATOM 274 H VAL A 23 -2.567 18.140 16.590 1.00 0.00 H ATOM 275 N SER A 24 -3.165 16.079 13.863 1.00 37.18 N ATOM 276 CA SER A 24 -3.297 14.828 13.113 1.00 34.71 C ATOM 277 C SER A 24 -4.564 14.076 13.480 1.00 32.25 C ATOM 278 O SER A 24 -5.274 13.580 12.620 1.00 27.02 O ATOM 279 CB SER A 24 -2.111 13.917 13.390 1.00 26.48 C ATOM 280 OG SER A 24 -2.228 12.738 12.610 1.00 29.72 O ATOM 281 HA SER A 24 -3.337 15.099 12.058 1.00 0.00 H ATOM 282 HB2 SER A 24 -2.094 13.653 14.447 1.00 0.00 H ATOM 283 HB3 SER A 24 -1.187 14.434 13.131 1.00 0.00 H ATOM 284 HG SER A 24 -1.456 12.146 12.791 1.00 0.00 H ATOM 285 H SER A 24 -2.232 16.363 14.223 1.00 0.00 H ATOM 286 N ARG A 25 -4.784 13.989 14.786 1.00 35.75 N ATOM 287 CA ARG A 25 -5.891 13.297 15.383 1.00 41.62 C ATOM 288 C ARG A 25 -7.178 14.024 15.055 1.00 41.46 C ATOM 289 O ARG A 25 -8.119 13.396 14.585 1.00 43.22 O ATOM 290 CB ARG A 25 -5.671 13.199 16.893 1.00 46.86 C ATOM 291 CG ARG A 25 -6.805 12.609 17.735 1.00 56.41 C ATOM 292 CD ARG A 25 -6.574 13.026 19.204 1.00 68.92 C ATOM 293 NE ARG A 25 -7.734 12.871 20.113 1.00 81.28 N ATOM 294 CZ ARG A 25 -8.908 13.535 20.056 1.00 85.96 C ATOM 295 NH1 ARG A 25 -9.172 14.422 19.082 1.00 85.17 N ATOM 296 NH2 ARG A 25 -9.850 13.288 20.981 1.00 84.02 N ATOM 297 HA ARG A 25 -5.964 12.286 14.983 1.00 0.00 H ATOM 298 HB2 ARG A 25 -4.788 12.581 17.055 1.00 0.00 H ATOM 299 HB3 ARG A 25 -5.480 14.207 17.262 1.00 0.00 H ATOM 300 HG2 ARG A 25 -7.764 12.994 17.387 1.00 0.00 H ATOM 301 HG3 ARG A 25 -6.800 11.522 17.653 1.00 0.00 H ATOM 302 HD2 ARG A 25 -6.282 14.076 19.211 1.00 0.00 H ATOM 303 HD3 ARG A 25 -5.758 12.421 19.598 1.00 0.00 H ATOM 304 HE ARG A 25 -7.633 12.174 20.879 1.00 0.00 H ATOM 305 HH12 ARG A 25 -10.086 14.918 19.064 1.00 0.00 H ATOM 306 HH11 ARG A 25 -8.463 14.612 18.346 1.00 0.00 H ATOM 307 HH22 ARG A 25 -10.758 13.794 20.946 1.00 0.00 H ATOM 308 HH21 ARG A 25 -9.671 12.591 21.732 1.00 0.00 H ATOM 309 H ARG A 25 -4.106 14.455 15.422 1.00 0.00 H ATOM 310 N ALA A 26 -7.211 15.336 15.298 1.00 41.03 N ATOM 311 CA ALA A 26 -8.376 16.154 14.956 1.00 40.18 C ATOM 312 C ALA A 26 -8.723 15.856 13.523 1.00 41.99 C ATOM 313 O ALA A 26 -9.786 15.339 13.237 1.00 45.74 O ATOM 314 CB ALA A 26 -8.061 17.602 15.107 1.00 38.61 C ATOM 315 HA ALA A 26 -9.210 15.923 15.619 1.00 0.00 H ATOM 316 HB1 ALA A 26 -7.777 17.805 16.139 1.00 0.00 H ATOM 317 HB2 ALA A 26 -7.237 17.864 14.444 1.00 0.00 H ATOM 318 HB3 ALA A 26 -8.940 18.193 14.848 1.00 0.00 H ATOM 319 H ALA A 26 -6.387 15.789 15.742 1.00 0.00 H ATOM 320 N LEU A 27 -7.791 16.139 12.621 1.00 41.27 N ATOM 321 CA LEU A 27 -8.000 15.901 11.206 1.00 38.43 C ATOM 322 C LEU A 27 -8.538 14.536 10.835 1.00 39.26 C ATOM 323 O LEU A 27 -9.425 14.420 9.999 1.00 46.72 O ATOM 324 CB LEU A 27 -6.706 16.151 10.452 1.00 34.30 C ATOM 325 CG LEU A 27 -6.535 17.652 10.295 1.00 39.03 C ATOM 326 CD1 LEU A 27 -5.212 17.959 9.646 1.00 34.25 C ATOM 327 CD2 LEU A 27 -7.708 18.209 9.457 1.00 46.31 C ATOM 328 HA LEU A 27 -8.784 16.602 10.920 1.00 0.00 H ATOM 329 HB2 LEU A 27 -5.866 15.740 11.012 1.00 0.00 H ATOM 330 HB3 LEU A 27 -6.753 15.679 9.470 1.00 0.00 H ATOM 331 HG LEU A 27 -6.543 18.129 11.275 1.00 0.00 H ATOM 332 HD21 LEU A 27 -7.709 17.735 8.476 1.00 0.00 H ATOM 333 HD22 LEU A 27 -8.649 17.997 9.965 1.00 0.00 H ATOM 334 HD23 LEU A 27 -7.591 19.286 9.341 1.00 0.00 H ATOM 335 HD11 LEU A 27 -4.405 17.570 10.267 1.00 0.00 H ATOM 336 HD12 LEU A 27 -5.174 17.490 8.663 1.00 0.00 H ATOM 337 HD13 LEU A 27 -5.103 19.038 9.540 1.00 0.00 H ATOM 338 H LEU A 27 -6.886 16.542 12.938 1.00 0.00 H ATOM 339 N ARG A 28 -7.999 13.491 11.421 1.00 43.35 N ATOM 340 CA ARG A 28 -8.404 12.169 10.994 1.00 55.17 C ATOM 341 C ARG A 28 -9.880 11.921 11.400 1.00 55.52 C ATOM 342 O ARG A 28 -10.609 11.176 10.721 1.00 52.03 O ATOM 343 CB ARG A 28 -7.456 11.111 11.570 1.00 55.83 C ATOM 344 CG ARG A 28 -7.693 9.632 11.122 1.00 62.71 C ATOM 345 CD ARG A 28 -7.037 8.626 12.126 1.00 65.65 C ATOM 346 NE ARG A 28 -5.872 9.230 12.789 1.00 72.43 N ATOM 347 CZ ARG A 28 -5.867 9.769 14.009 1.00 71.50 C ATOM 348 NH1 ARG A 28 -6.966 9.761 14.756 1.00 69.26 N ATOM 349 NH2 ARG A 28 -4.747 10.314 14.481 1.00 72.56 N ATOM 350 HA ARG A 28 -8.342 12.095 9.908 1.00 0.00 H ATOM 351 HB2 ARG A 28 -6.441 11.385 11.281 1.00 0.00 H ATOM 352 HB3 ARG A 28 -7.545 11.145 12.656 1.00 0.00 H ATOM 353 HG2 ARG A 28 -8.765 9.441 11.076 1.00 0.00 H ATOM 354 HG3 ARG A 28 -7.257 9.485 10.134 1.00 0.00 H ATOM 355 HD2 ARG A 28 -6.717 7.737 11.583 1.00 0.00 H ATOM 356 HD3 ARG A 28 -7.771 8.345 12.881 1.00 0.00 H ATOM 357 HE ARG A 28 -4.976 9.238 12.262 1.00 0.00 H ATOM 358 HH12 ARG A 28 -6.952 10.184 15.706 1.00 0.00 H ATOM 359 HH11 ARG A 28 -7.840 9.332 14.391 1.00 0.00 H ATOM 360 HH22 ARG A 28 -4.735 10.736 15.431 1.00 0.00 H ATOM 361 HH21 ARG A 28 -3.885 10.317 13.899 1.00 0.00 H ATOM 362 H ARG A 28 -7.295 13.611 12.177 1.00 0.00 H ATOM 363 N LEU A 29 -10.314 12.553 12.496 1.00 53.98 N ATOM 364 CA LEU A 29 -11.735 12.583 12.813 1.00 53.81 C ATOM 365 C LEU A 29 -12.525 13.243 11.664 1.00 55.77 C ATOM 366 O LEU A 29 -13.480 12.633 11.210 1.00 56.98 O ATOM 367 CB LEU A 29 -12.025 13.241 14.156 1.00 48.36 C ATOM 368 CG LEU A 29 -11.285 12.670 15.372 1.00 55.99 C ATOM 369 CD1 LEU A 29 -11.772 13.319 16.664 1.00 55.12 C ATOM 370 CD2 LEU A 29 -11.352 11.146 15.506 1.00 56.63 C ATOM 371 HA LEU A 29 -12.071 11.551 12.912 1.00 0.00 H ATOM 372 HB2 LEU A 29 -11.761 14.295 14.072 1.00 0.00 H ATOM 373 HB3 LEU A 29 -13.094 13.149 14.346 1.00 0.00 H ATOM 374 HG LEU A 29 -10.237 12.915 15.197 1.00 0.00 H ATOM 375 HD21 LEU A 29 -12.393 10.836 15.596 1.00 0.00 H ATOM 376 HD22 LEU A 29 -10.910 10.685 14.623 1.00 0.00 H ATOM 377 HD23 LEU A 29 -10.801 10.836 16.394 1.00 0.00 H ATOM 378 HD11 LEU A 29 -11.594 14.393 16.619 1.00 0.00 H ATOM 379 HD12 LEU A 29 -12.839 13.131 16.784 1.00 0.00 H ATOM 380 HD13 LEU A 29 -11.230 12.895 17.509 1.00 0.00 H ATOM 381 H LEU A 29 -9.633 13.025 13.125 1.00 0.00 H ATOM 382 N THR A 30 -12.107 14.414 11.148 1.00 52.33 N ATOM 383 CA THR A 30 -12.857 15.095 10.052 1.00 58.06 C ATOM 384 C THR A 30 -12.990 14.313 8.701 1.00 58.96 C ATOM 385 O THR A 30 -13.617 14.793 7.769 1.00 61.11 O ATOM 386 CB THR A 30 -12.405 16.600 9.797 1.00 59.64 C ATOM 387 OG1 THR A 30 -11.615 16.718 8.598 1.00 61.20 O ATOM 388 CG2 THR A 30 -11.660 17.220 11.014 1.00 63.03 C ATOM 389 HA THR A 30 -13.865 15.109 10.466 1.00 0.00 H ATOM 390 HB THR A 30 -13.322 17.174 9.661 1.00 0.00 H ATOM 391 HG1 THR A 30 -12.149 16.415 7.821 1.00 0.00 H ATOM 392 HG23 THR A 30 -12.277 17.118 11.907 1.00 0.00 H ATOM 393 HG21 THR A 30 -10.714 16.699 11.163 1.00 0.00 H ATOM 394 HG22 THR A 30 -11.468 18.276 10.822 1.00 0.00 H ATOM 395 H THR A 30 -11.242 14.854 11.522 1.00 0.00 H ATOM 396 N GLY A 31 -12.429 13.113 8.596 1.00 56.42 N ATOM 397 CA GLY A 31 -12.577 12.312 7.368 1.00 55.11 C ATOM 398 C GLY A 31 -11.436 12.500 6.388 1.00 50.30 C ATOM 399 O GLY A 31 -11.515 12.134 5.202 1.00 48.96 O ATOM 400 HA3 GLY A 31 -13.506 12.600 6.877 1.00 0.00 H ATOM 401 HA2 GLY A 31 -12.625 11.259 7.645 1.00 0.00 H ATOM 402 H GLY A 31 -11.878 12.734 9.392 1.00 0.00 H ATOM 403 N ARG A 32 -10.373 13.098 6.907 1.00 55.17 N ATOM 404 CA ARG A 32 -9.197 13.466 6.127 1.00 52.58 C ATOM 405 C ARG A 32 -8.218 12.388 6.380 1.00 52.44 C ATOM 406 O ARG A 32 -8.109 11.860 7.488 1.00 59.16 O ATOM 407 CB ARG A 32 -8.591 14.782 6.612 1.00 50.70 C ATOM 408 CG ARG A 32 -9.412 16.016 6.317 1.00 49.83 C ATOM 409 CD ARG A 32 -9.491 16.272 4.809 1.00 47.18 C ATOM 410 NE ARG A 32 -8.315 16.954 4.256 1.00 46.28 N ATOM 411 CZ ARG A 32 -7.817 18.082 4.732 1.00 43.59 C ATOM 412 NH1 ARG A 32 -8.381 18.655 5.789 1.00 48.52 N ATOM 413 NH2 ARG A 32 -6.766 18.644 4.153 1.00 45.28 N ATOM 414 HA ARG A 32 -9.457 13.590 5.076 1.00 0.00 H ATOM 415 HB2 ARG A 32 -8.459 14.715 7.692 1.00 0.00 H ATOM 416 HB3 ARG A 32 -7.618 14.902 6.135 1.00 0.00 H ATOM 417 HG2 ARG A 32 -10.420 15.877 6.709 1.00 0.00 H ATOM 418 HG3 ARG A 32 -8.951 16.876 6.802 1.00 0.00 H ATOM 419 HD2 ARG A 32 -10.369 16.887 4.611 1.00 0.00 H ATOM 420 HD3 ARG A 32 -9.600 15.312 4.304 1.00 0.00 H ATOM 421 HE ARG A 32 -7.843 16.522 3.436 1.00 0.00 H ATOM 422 HH12 ARG A 32 -7.994 19.543 6.168 1.00 0.00 H ATOM 423 HH11 ARG A 32 -9.210 18.216 6.238 1.00 0.00 H ATOM 424 HH22 ARG A 32 -6.377 19.532 4.531 1.00 0.00 H ATOM 425 HH21 ARG A 32 -6.330 18.198 3.321 1.00 0.00 H ATOM 426 H ARG A 32 -10.378 13.316 7.924 1.00 0.00 H ATOM 427 N ARG A 33 -7.491 12.051 5.352 1.00 47.89 N ATOM 428 CA ARG A 33 -6.558 10.999 5.496 1.00 47.19 C ATOM 429 C ARG A 33 -5.107 11.554 5.585 1.00 41.17 C ATOM 430 O ARG A 33 -4.546 12.104 4.636 1.00 43.56 O ATOM 431 CB ARG A 33 -6.783 9.978 4.374 1.00 47.97 C ATOM 432 CG ARG A 33 -7.831 8.893 4.678 1.00 56.53 C ATOM 433 CD ARG A 33 -7.802 7.807 3.596 1.00 58.12 C ATOM 434 NE ARG A 33 -8.158 8.379 2.289 1.00 69.65 N ATOM 435 CZ ARG A 33 -8.257 7.707 1.136 1.00 71.80 C ATOM 436 NH1 ARG A 33 -8.013 6.405 1.092 1.00 72.11 N ATOM 437 NH2 ARG A 33 -8.603 8.345 0.017 1.00 73.86 N ATOM 438 HA ARG A 33 -6.710 10.471 6.437 1.00 0.00 H ATOM 439 HB2 ARG A 33 -7.105 10.519 3.484 1.00 0.00 H ATOM 440 HB3 ARG A 33 -5.833 9.483 4.172 1.00 0.00 H ATOM 441 HG2 ARG A 33 -7.612 8.442 5.646 1.00 0.00 H ATOM 442 HG3 ARG A 33 -8.822 9.347 4.706 1.00 0.00 H ATOM 443 HD2 ARG A 33 -8.516 7.024 3.853 1.00 0.00 H ATOM 444 HD3 ARG A 33 -6.801 7.380 3.541 1.00 0.00 H ATOM 445 HE ARG A 33 -8.351 9.401 2.258 1.00 0.00 H ATOM 446 HH12 ARG A 33 -8.093 5.891 0.191 1.00 0.00 H ATOM 447 HH11 ARG A 33 -7.742 5.897 1.958 1.00 0.00 H ATOM 448 HH22 ARG A 33 -8.679 7.821 -0.878 1.00 0.00 H ATOM 449 HH21 ARG A 33 -8.796 9.367 0.039 1.00 0.00 H ATOM 450 H ARG A 33 -7.595 12.546 4.444 1.00 0.00 H ATOM 451 N VAL A 34 -4.521 11.388 6.748 1.00 32.14 N ATOM 452 CA VAL A 34 -3.141 11.728 7.000 1.00 32.94 C ATOM 453 C VAL A 34 -2.029 10.888 6.290 1.00 32.13 C ATOM 454 O VAL A 34 -1.918 9.661 6.453 1.00 30.87 O ATOM 455 CB VAL A 34 -2.925 11.623 8.482 1.00 32.35 C ATOM 456 CG1 VAL A 34 -1.713 12.390 8.855 1.00 29.91 C ATOM 457 CG2 VAL A 34 -4.186 12.121 9.226 1.00 34.52 C ATOM 458 HA VAL A 34 -3.021 12.725 6.576 1.00 0.00 H ATOM 459 HB VAL A 34 -2.764 10.585 8.772 1.00 0.00 H ATOM 460 HG11 VAL A 34 -0.850 11.981 8.330 1.00 0.00 H ATOM 461 HG12 VAL A 34 -1.847 13.436 8.578 1.00 0.00 H ATOM 462 HG13 VAL A 34 -1.554 12.315 9.931 1.00 0.00 H ATOM 463 HG21 VAL A 34 -4.377 13.161 8.960 1.00 0.00 H ATOM 464 HG22 VAL A 34 -5.041 11.509 8.939 1.00 0.00 H ATOM 465 HG23 VAL A 34 -4.026 12.044 10.301 1.00 0.00 H ATOM 466 H VAL A 34 -5.081 10.990 7.529 1.00 0.00 H ATOM 467 N MET A 35 -1.154 11.591 5.580 1.00 28.84 N ATOM 468 CA MET A 35 -0.077 10.991 4.836 1.00 28.10 C ATOM 469 C MET A 35 1.212 11.577 5.393 1.00 29.42 C ATOM 470 O MET A 35 1.384 12.792 5.349 1.00 34.83 O ATOM 471 CB MET A 35 -0.188 11.426 3.372 1.00 30.07 C ATOM 472 CG MET A 35 -1.536 11.235 2.678 1.00 27.95 C ATOM 473 SD MET A 35 -1.654 9.503 2.159 1.00 36.41 S ATOM 474 CE MET A 35 -2.928 8.906 3.252 1.00 25.89 C ATOM 475 HA MET A 35 -0.104 9.904 4.909 1.00 0.00 H ATOM 476 HB2 MET A 35 0.055 12.488 3.328 1.00 0.00 H ATOM 477 HB3 MET A 35 0.553 10.861 2.807 1.00 0.00 H ATOM 478 HG2 MET A 35 -1.601 11.888 1.808 1.00 0.00 H ATOM 479 HG3 MET A 35 -2.345 11.471 3.369 1.00 0.00 H ATOM 480 HE1 MET A 35 -2.605 9.030 4.286 1.00 0.00 H ATOM 481 HE2 MET A 35 -3.843 9.474 3.085 1.00 0.00 H ATOM 482 HE3 MET A 35 -3.112 7.851 3.051 1.00 0.00 H ATOM 483 H MET A 35 -1.252 12.626 5.560 1.00 0.00 H ATOM 484 N LEU A 36 2.114 10.734 5.887 1.00 19.79 N ATOM 485 CA LEU A 36 3.404 11.192 6.378 1.00 22.26 C ATOM 486 C LEU A 36 4.547 11.050 5.368 1.00 26.41 C ATOM 487 O LEU A 36 4.812 9.959 4.826 1.00 31.53 O ATOM 488 CB LEU A 36 3.809 10.426 7.664 1.00 17.49 C ATOM 489 CG LEU A 36 5.152 10.835 8.296 1.00 21.14 C ATOM 490 CD1 LEU A 36 5.251 12.321 8.744 1.00 16.85 C ATOM 491 CD2 LEU A 36 5.574 9.888 9.438 1.00 20.86 C ATOM 492 HA LEU A 36 3.262 12.255 6.576 1.00 0.00 H ATOM 493 HB2 LEU A 36 3.028 10.585 8.407 1.00 0.00 H ATOM 494 HB3 LEU A 36 3.865 9.366 7.418 1.00 0.00 H ATOM 495 HG LEU A 36 5.862 10.734 7.475 1.00 0.00 H ATOM 496 HD21 LEU A 36 4.814 9.902 10.219 1.00 0.00 H ATOM 497 HD22 LEU A 36 5.678 8.875 9.049 1.00 0.00 H ATOM 498 HD23 LEU A 36 6.527 10.220 9.850 1.00 0.00 H ATOM 499 HD11 LEU A 36 5.104 12.970 7.881 1.00 0.00 H ATOM 500 HD12 LEU A 36 4.483 12.526 9.489 1.00 0.00 H ATOM 501 HD13 LEU A 36 6.235 12.504 9.175 1.00 0.00 H ATOM 502 H LEU A 36 1.891 9.719 5.923 1.00 0.00 H ATOM 503 N VAL A 37 5.284 12.126 5.187 1.00 24.31 N ATOM 504 CA VAL A 37 6.495 12.062 4.388 1.00 29.09 C ATOM 505 C VAL A 37 7.689 12.456 5.258 1.00 23.59 C ATOM 506 O VAL A 37 7.912 13.637 5.494 1.00 31.56 O ATOM 507 CB VAL A 37 6.413 12.949 3.108 1.00 32.25 C ATOM 508 CG1 VAL A 37 7.649 12.716 2.228 1.00 25.81 C ATOM 509 CG2 VAL A 37 5.154 12.624 2.326 1.00 24.64 C ATOM 510 HA VAL A 37 6.619 11.038 4.037 1.00 0.00 H ATOM 511 HB VAL A 37 6.382 13.996 3.408 1.00 0.00 H ATOM 512 HG11 VAL A 37 8.547 12.976 2.789 1.00 0.00 H ATOM 513 HG12 VAL A 37 7.693 11.667 1.936 1.00 0.00 H ATOM 514 HG13 VAL A 37 7.582 13.340 1.337 1.00 0.00 H ATOM 515 HG21 VAL A 37 5.171 11.574 2.033 1.00 0.00 H ATOM 516 HG22 VAL A 37 4.281 12.815 2.950 1.00 0.00 H ATOM 517 HG23 VAL A 37 5.109 13.250 1.435 1.00 0.00 H ATOM 518 H VAL A 37 4.997 13.027 5.619 1.00 0.00 H ATOM 519 N PRO A 38 8.419 11.456 5.785 1.00 26.71 N ATOM 520 CA PRO A 38 9.480 11.751 6.755 1.00 20.91 C ATOM 521 C PRO A 38 10.656 12.218 5.961 1.00 25.65 C ATOM 522 O PRO A 38 11.038 11.529 4.982 1.00 21.31 O ATOM 523 CB PRO A 38 9.778 10.394 7.404 1.00 19.81 C ATOM 524 CG PRO A 38 8.631 9.446 6.906 1.00 25.85 C ATOM 525 CD PRO A 38 8.267 10.002 5.543 1.00 21.99 C ATOM 526 HA PRO A 38 9.229 12.503 7.503 1.00 0.00 H ATOM 527 HD3 PRO A 38 8.951 9.650 4.770 1.00 0.00 H ATOM 528 HD2 PRO A 38 7.244 9.746 5.265 1.00 0.00 H ATOM 529 HG3 PRO A 38 7.776 9.482 7.581 1.00 0.00 H ATOM 530 HG2 PRO A 38 8.984 8.418 6.825 1.00 0.00 H ATOM 531 HB2 PRO A 38 10.751 10.021 7.083 1.00 0.00 H ATOM 532 HB3 PRO A 38 9.762 10.477 8.491 1.00 0.00 H ATOM 533 N THR A 39 11.198 13.399 6.308 1.00 26.10 N ATOM 534 CA THR A 39 12.439 13.866 5.634 1.00 26.30 C ATOM 535 C THR A 39 13.487 14.328 6.613 1.00 24.68 C ATOM 536 O THR A 39 13.232 14.413 7.816 1.00 25.18 O ATOM 537 CB THR A 39 12.197 15.029 4.705 1.00 22.08 C ATOM 538 OG1 THR A 39 12.074 16.196 5.515 1.00 28.75 O ATOM 539 CG2 THR A 39 10.912 14.823 3.899 1.00 22.94 C ATOM 540 HA THR A 39 12.781 12.993 5.078 1.00 0.00 H ATOM 541 HB THR A 39 13.021 15.123 3.997 1.00 0.00 H ATOM 542 HG1 THR A 39 11.314 16.084 6.140 1.00 0.00 H ATOM 543 HG23 THR A 39 11.011 13.930 3.282 1.00 0.00 H ATOM 544 HG21 THR A 39 10.071 14.702 4.582 1.00 0.00 H ATOM 545 HG22 THR A 39 10.742 15.690 3.261 1.00 0.00 H ATOM 546 H THR A 39 10.752 13.983 7.044 1.00 0.00 H ATOM 547 N MET A 40 14.657 14.629 6.062 1.00 31.03 N ATOM 548 CA MET A 40 15.820 15.139 6.794 1.00 35.98 C ATOM 549 C MET A 40 16.195 16.540 6.296 1.00 35.55 C ATOM 550 O MET A 40 17.344 16.969 6.421 1.00 33.01 O ATOM 551 CB MET A 40 17.019 14.189 6.677 1.00 26.42 C ATOM 552 CG MET A 40 16.870 13.005 7.572 1.00 43.70 C ATOM 553 SD MET A 40 18.377 12.055 8.012 1.00 46.55 S ATOM 554 CE MET A 40 18.380 10.977 6.605 1.00 43.33 C ATOM 555 HA MET A 40 15.548 15.202 7.848 1.00 0.00 H ATOM 556 HB2 MET A 40 17.099 13.845 5.646 1.00 0.00 H ATOM 557 HB3 MET A 40 17.926 14.728 6.951 1.00 0.00 H ATOM 558 HG2 MET A 40 16.184 12.314 7.083 1.00 0.00 H ATOM 559 HG3 MET A 40 16.426 13.357 8.503 1.00 0.00 H ATOM 560 HE1 MET A 40 17.455 10.400 6.589 1.00 0.00 H ATOM 561 HE2 MET A 40 18.455 11.571 5.694 1.00 0.00 H ATOM 562 HE3 MET A 40 19.232 10.300 6.670 1.00 0.00 H ATOM 563 H MET A 40 14.755 14.493 5.036 1.00 0.00 H ATOM 564 N GLY A 41 15.217 17.263 5.751 1.00 39.42 N ATOM 565 CA GLY A 41 15.501 18.567 5.135 1.00 40.42 C ATOM 566 C GLY A 41 16.190 18.448 3.772 1.00 39.78 C ATOM 567 O GLY A 41 16.341 17.333 3.232 1.00 40.59 O ATOM 568 HA3 GLY A 41 16.149 19.134 5.804 1.00 0.00 H ATOM 569 HA2 GLY A 41 14.560 19.102 5.003 1.00 0.00 H ATOM 570 H GLY A 41 14.242 16.901 5.762 1.00 0.00 H ATOM 571 N ALA A 42 16.579 19.595 3.211 1.00 34.02 N ATOM 572 CA ALA A 42 17.316 19.645 1.936 1.00 37.60 C ATOM 573 C ALA A 42 16.543 18.943 0.826 1.00 36.67 C ATOM 574 O ALA A 42 17.025 18.018 0.189 1.00 41.66 O ATOM 575 CB ALA A 42 18.714 19.050 2.081 1.00 33.28 C ATOM 576 HA ALA A 42 17.424 20.694 1.661 1.00 0.00 H ATOM 577 HB1 ALA A 42 19.272 19.615 2.828 1.00 0.00 H ATOM 578 HB2 ALA A 42 18.634 18.010 2.396 1.00 0.00 H ATOM 579 HB3 ALA A 42 19.231 19.102 1.123 1.00 0.00 H ATOM 580 H ALA A 42 16.353 20.489 3.693 1.00 0.00 H ATOM 581 N LEU A 43 15.316 19.393 0.647 1.00 37.29 N ATOM 582 CA LEU A 43 14.385 18.804 -0.262 1.00 38.94 C ATOM 583 C LEU A 43 14.713 19.089 -1.738 1.00 43.07 C ATOM 584 O LEU A 43 14.973 20.239 -2.163 1.00 43.84 O ATOM 585 CB LEU A 43 13.001 19.322 0.100 1.00 39.69 C ATOM 586 CG LEU A 43 12.564 19.096 1.557 1.00 38.59 C ATOM 587 CD1 LEU A 43 11.064 19.221 1.698 1.00 36.61 C ATOM 588 CD2 LEU A 43 12.990 17.725 2.056 1.00 49.34 C ATOM 589 HA LEU A 43 14.437 17.720 -0.164 1.00 0.00 H ATOM 590 HB2 LEU A 43 12.984 20.395 -0.092 1.00 0.00 H ATOM 591 HB3 LEU A 43 12.278 18.826 -0.548 1.00 0.00 H ATOM 592 HG LEU A 43 13.052 19.864 2.157 1.00 0.00 H ATOM 593 HD21 LEU A 43 12.534 16.955 1.434 1.00 0.00 H ATOM 594 HD22 LEU A 43 14.075 17.641 2.002 1.00 0.00 H ATOM 595 HD23 LEU A 43 12.665 17.599 3.089 1.00 0.00 H ATOM 596 HD11 LEU A 43 10.753 20.219 1.390 1.00 0.00 H ATOM 597 HD12 LEU A 43 10.578 18.477 1.067 1.00 0.00 H ATOM 598 HD13 LEU A 43 10.783 19.056 2.738 1.00 0.00 H ATOM 599 H LEU A 43 15.010 20.221 1.197 1.00 0.00 H ATOM 600 N HIS A 44 14.738 18.040 -2.533 1.00 39.28 N ATOM 601 CA HIS A 44 15.022 18.244 -3.919 1.00 38.75 C ATOM 602 C HIS A 44 13.909 17.605 -4.675 1.00 46.33 C ATOM 603 O HIS A 44 13.029 16.967 -4.073 1.00 52.79 O ATOM 604 CB HIS A 44 16.365 17.656 -4.269 1.00 45.42 C ATOM 605 CG HIS A 44 16.528 16.230 -3.866 1.00 41.61 C ATOM 606 ND1 HIS A 44 15.765 15.213 -4.401 1.00 36.25 N ATOM 607 CD2 HIS A 44 17.398 15.644 -3.014 1.00 37.18 C ATOM 608 CE1 HIS A 44 16.133 14.064 -3.865 1.00 31.98 C ATOM 609 NE2 HIS A 44 17.128 14.295 -3.028 1.00 36.90 N ATOM 610 HA HIS A 44 15.082 19.303 -4.172 1.00 0.00 H ATOM 611 HB2 HIS A 44 16.498 17.724 -5.349 1.00 0.00 H ATOM 612 HB3 HIS A 44 17.137 18.243 -3.771 1.00 0.00 H ATOM 613 HD2 HIS A 44 18.168 16.145 -2.427 1.00 0.00 H ATOM 614 HE1 HIS A 44 15.691 13.091 -4.077 1.00 0.00 H ATOM 615 H HIS A 44 14.556 17.086 -2.162 1.00 0.00 H ATOM 616 N GLU A 45 13.895 17.804 -5.979 1.00 48.20 N ATOM 617 CA GLU A 45 12.815 17.294 -6.807 1.00 48.38 C ATOM 618 C GLU A 45 12.416 15.866 -6.369 1.00 48.02 C ATOM 619 O GLU A 45 11.236 15.471 -6.418 1.00 48.59 O ATOM 620 CB GLU A 45 13.239 17.388 -8.281 1.00 56.63 C ATOM 621 CG GLU A 45 12.107 17.578 -9.303 1.00 68.91 C ATOM 622 CD GLU A 45 11.016 18.561 -8.846 1.00 73.67 C ATOM 623 OE1 GLU A 45 11.340 19.751 -8.553 1.00 75.40 O ATOM 624 OE2 GLU A 45 9.833 18.121 -8.786 1.00 69.44 O ATOM 625 HA GLU A 45 11.916 17.898 -6.682 1.00 0.00 H ATOM 626 HB2 GLU A 45 13.920 18.233 -8.378 1.00 0.00 H ATOM 627 HB3 GLU A 45 13.766 16.468 -8.535 1.00 0.00 H ATOM 628 HG2 GLU A 45 12.540 17.952 -10.231 1.00 0.00 H ATOM 629 HG3 GLU A 45 11.642 16.609 -9.486 1.00 0.00 H ATOM 630 H GLU A 45 14.671 18.336 -6.423 1.00 0.00 H ATOM 631 N GLY A 46 13.407 15.118 -5.881 1.00 44.21 N ATOM 632 CA GLY A 46 13.211 13.735 -5.420 1.00 37.78 C ATOM 633 C GLY A 46 12.371 13.560 -4.166 1.00 35.30 C ATOM 634 O GLY A 46 11.633 12.627 -4.053 1.00 32.56 O ATOM 635 HA3 GLY A 46 14.194 13.306 -5.225 1.00 0.00 H ATOM 636 HA2 GLY A 46 12.728 13.181 -6.225 1.00 0.00 H ATOM 637 H GLY A 46 14.360 15.531 -5.824 1.00 0.00 H ATOM 638 N HIS A 47 12.458 14.463 -3.211 1.00 37.60 N ATOM 639 CA HIS A 47 11.467 14.463 -2.139 1.00 34.25 C ATOM 640 C HIS A 47 10.095 14.861 -2.669 1.00 32.45 C ATOM 641 O HIS A 47 9.094 14.380 -2.147 1.00 30.32 O ATOM 642 CB HIS A 47 11.888 15.407 -0.990 1.00 37.15 C ATOM 643 CG HIS A 47 13.210 15.057 -0.369 1.00 35.21 C ATOM 644 ND1 HIS A 47 14.417 15.481 -0.893 1.00 37.98 N ATOM 645 CD2 HIS A 47 13.511 14.340 0.742 1.00 37.04 C ATOM 646 CE1 HIS A 47 15.405 15.021 -0.144 1.00 43.86 C ATOM 647 NE2 HIS A 47 14.884 14.336 0.862 1.00 42.60 N ATOM 648 HA HIS A 47 11.408 13.448 -1.745 1.00 0.00 H ATOM 649 HB2 HIS A 47 11.951 16.421 -1.384 1.00 0.00 H ATOM 650 HB3 HIS A 47 11.123 15.367 -0.215 1.00 0.00 H ATOM 651 HD2 HIS A 47 12.801 13.858 1.414 1.00 0.00 H ATOM 652 HE1 HIS A 47 16.468 15.179 -0.324 1.00 0.00 H ATOM 653 H HIS A 47 13.223 15.167 -3.221 1.00 0.00 H ATOM 654 N LEU A 48 10.038 15.708 -3.708 1.00 29.05 N ATOM 655 CA LEU A 48 8.749 16.297 -4.089 1.00 36.56 C ATOM 656 C LEU A 48 7.820 15.226 -4.730 1.00 39.18 C ATOM 657 O LEU A 48 6.572 15.237 -4.545 1.00 41.18 O ATOM 658 CB LEU A 48 8.932 17.530 -4.971 1.00 32.65 C ATOM 659 CG LEU A 48 9.703 18.738 -4.417 1.00 39.36 C ATOM 660 CD1 LEU A 48 9.828 19.843 -5.505 1.00 45.17 C ATOM 661 CD2 LEU A 48 9.129 19.345 -3.156 1.00 36.90 C ATOM 662 HA LEU A 48 8.252 16.647 -3.184 1.00 0.00 H ATOM 663 HB2 LEU A 48 9.454 17.204 -5.871 1.00 0.00 H ATOM 664 HB3 LEU A 48 7.936 17.882 -5.238 1.00 0.00 H ATOM 665 HG LEU A 48 10.680 18.341 -4.141 1.00 0.00 H ATOM 666 HD21 LEU A 48 8.112 19.687 -3.349 1.00 0.00 H ATOM 667 HD22 LEU A 48 9.117 18.594 -2.366 1.00 0.00 H ATOM 668 HD23 LEU A 48 9.745 20.190 -2.848 1.00 0.00 H ATOM 669 HD11 LEU A 48 10.362 19.444 -6.367 1.00 0.00 H ATOM 670 HD12 LEU A 48 8.832 20.165 -5.810 1.00 0.00 H ATOM 671 HD13 LEU A 48 10.377 20.692 -5.097 1.00 0.00 H ATOM 672 H LEU A 48 10.900 15.945 -4.239 1.00 0.00 H ATOM 673 N ALA A 49 8.447 14.294 -5.451 1.00 34.69 N ATOM 674 CA ALA A 49 7.778 13.060 -5.860 1.00 37.53 C ATOM 675 C ALA A 49 7.061 12.452 -4.667 1.00 36.90 C ATOM 676 O ALA A 49 5.863 12.176 -4.735 1.00 41.41 O ATOM 677 CB ALA A 49 8.779 12.056 -6.440 1.00 23.29 C ATOM 678 HA ALA A 49 7.054 13.300 -6.638 1.00 0.00 H ATOM 679 HB1 ALA A 49 9.267 12.494 -7.311 1.00 0.00 H ATOM 680 HB2 ALA A 49 9.527 11.814 -5.685 1.00 0.00 H ATOM 681 HB3 ALA A 49 8.252 11.149 -6.735 1.00 0.00 H ATOM 682 H ALA A 49 9.437 14.450 -5.729 1.00 0.00 H ATOM 683 N LEU A 50 7.783 12.272 -3.560 1.00 34.63 N ATOM 684 CA LEU A 50 7.171 11.688 -2.365 1.00 29.96 C ATOM 685 C LEU A 50 5.938 12.455 -1.947 1.00 30.63 C ATOM 686 O LEU A 50 4.913 11.817 -1.661 1.00 28.06 O ATOM 687 CB LEU A 50 8.176 11.584 -1.230 1.00 29.87 C ATOM 688 CG LEU A 50 9.477 10.816 -1.512 1.00 25.53 C ATOM 689 CD1 LEU A 50 9.987 10.396 -0.222 1.00 26.14 C ATOM 690 CD2 LEU A 50 9.260 9.586 -2.353 1.00 27.28 C ATOM 691 HA LEU A 50 6.853 10.676 -2.615 1.00 0.00 H ATOM 692 HB2 LEU A 50 8.450 12.598 -0.940 1.00 0.00 H ATOM 693 HB3 LEU A 50 7.678 11.091 -0.395 1.00 0.00 H ATOM 694 HG LEU A 50 10.159 11.464 -2.062 1.00 0.00 H ATOM 695 HD21 LEU A 50 8.579 8.909 -1.836 1.00 0.00 H ATOM 696 HD22 LEU A 50 8.829 9.874 -3.312 1.00 0.00 H ATOM 697 HD23 LEU A 50 10.215 9.087 -2.518 1.00 0.00 H ATOM 698 HD11 LEU A 50 10.176 11.274 0.396 1.00 0.00 H ATOM 699 HD12 LEU A 50 9.252 9.757 0.267 1.00 0.00 H ATOM 700 HD13 LEU A 50 10.916 9.843 -0.362 1.00 0.00 H ATOM 701 H LEU A 50 8.786 12.548 -3.546 1.00 0.00 H ATOM 702 N VAL A 51 6.024 13.805 -1.983 1.00 28.18 N ATOM 703 CA VAL A 51 4.907 14.731 -1.621 1.00 21.93 C ATOM 704 C VAL A 51 3.706 14.653 -2.536 1.00 31.48 C ATOM 705 O VAL A 51 2.578 14.558 -2.051 1.00 34.94 O ATOM 706 CB VAL A 51 5.303 16.204 -1.639 1.00 23.82 C ATOM 707 CG1 VAL A 51 4.038 17.101 -1.448 1.00 24.13 C ATOM 708 CG2 VAL A 51 6.381 16.550 -0.569 1.00 22.86 C ATOM 709 HA VAL A 51 4.659 14.386 -0.617 1.00 0.00 H ATOM 710 HB VAL A 51 5.750 16.405 -2.612 1.00 0.00 H ATOM 711 HG11 VAL A 51 3.333 16.909 -2.257 1.00 0.00 H ATOM 712 HG12 VAL A 51 3.569 16.867 -0.492 1.00 0.00 H ATOM 713 HG13 VAL A 51 4.333 18.150 -1.463 1.00 0.00 H ATOM 714 HG21 VAL A 51 5.993 16.320 0.423 1.00 0.00 H ATOM 715 HG22 VAL A 51 7.278 15.960 -0.755 1.00 0.00 H ATOM 716 HG23 VAL A 51 6.623 17.611 -0.629 1.00 0.00 H ATOM 717 H VAL A 51 6.927 14.226 -2.282 1.00 0.00 H ATOM 718 N ARG A 52 3.918 14.755 -3.852 1.00 35.15 N ATOM 719 CA ARG A 52 2.797 14.540 -4.819 1.00 36.35 C ATOM 720 C ARG A 52 2.128 13.194 -4.746 1.00 36.36 C ATOM 721 O ARG A 52 0.896 13.143 -4.777 1.00 34.33 O ATOM 722 CB ARG A 52 3.269 14.679 -6.246 1.00 37.87 C ATOM 723 CG ARG A 52 3.647 16.039 -6.548 1.00 39.99 C ATOM 724 CD ARG A 52 4.782 15.976 -7.415 1.00 38.07 C ATOM 725 NE ARG A 52 5.355 17.297 -7.420 1.00 47.95 N ATOM 726 CZ ARG A 52 6.419 17.625 -8.137 1.00 49.26 C ATOM 727 NH1 ARG A 52 6.991 16.658 -8.864 1.00 46.40 N ATOM 728 NH2 ARG A 52 6.906 18.892 -8.096 1.00 35.86 N ATOM 729 HA ARG A 52 2.079 15.306 -4.528 1.00 0.00 H ATOM 730 HB2 ARG A 52 4.131 14.029 -6.399 1.00 0.00 H ATOM 731 HB3 ARG A 52 2.464 14.377 -6.917 1.00 0.00 H ATOM 732 HG2 ARG A 52 2.825 16.555 -7.044 1.00 0.00 H ATOM 733 HG3 ARG A 52 3.905 16.568 -5.631 1.00 0.00 H ATOM 734 HD2 ARG A 52 4.474 15.693 -8.422 1.00 0.00 H ATOM 735 HD3 ARG A 52 5.505 15.251 -7.040 1.00 0.00 H ATOM 736 HE ARG A 52 4.911 18.030 -6.831 1.00 0.00 H ATOM 737 HH12 ARG A 52 7.829 16.869 -9.443 1.00 0.00 H ATOM 738 HH11 ARG A 52 6.598 15.695 -8.850 1.00 0.00 H ATOM 739 HH22 ARG A 52 7.742 19.146 -8.660 1.00 0.00 H ATOM 740 HH21 ARG A 52 6.443 19.608 -7.500 1.00 0.00 H ATOM 741 H ARG A 52 4.868 14.985 -4.206 1.00 0.00 H ATOM 742 N ALA A 53 2.921 12.101 -4.702 1.00 34.83 N ATOM 743 CA ALA A 53 2.325 10.782 -4.501 1.00 33.69 C ATOM 744 C ALA A 53 1.320 10.877 -3.353 1.00 33.76 C ATOM 745 O ALA A 53 0.186 10.477 -3.510 1.00 41.72 O ATOM 746 CB ALA A 53 3.389 9.708 -4.219 1.00 35.62 C ATOM 747 HA ALA A 53 1.817 10.476 -5.416 1.00 0.00 H ATOM 748 HB1 ALA A 53 4.075 9.648 -5.064 1.00 0.00 H ATOM 749 HB2 ALA A 53 3.942 9.974 -3.318 1.00 0.00 H ATOM 750 HB3 ALA A 53 2.901 8.744 -4.076 1.00 0.00 H ATOM 751 H ALA A 53 3.951 12.198 -4.811 1.00 0.00 H ATOM 752 N ALA A 54 1.726 11.473 -2.225 1.00 36.62 N ATOM 753 CA ALA A 54 0.897 11.515 -1.007 1.00 38.77 C ATOM 754 C ALA A 54 -0.276 12.389 -1.280 1.00 39.52 C ATOM 755 O ALA A 54 -1.395 12.120 -0.861 1.00 49.60 O ATOM 756 CB ALA A 54 1.696 12.079 0.216 1.00 29.76 C ATOM 757 HA ALA A 54 0.584 10.502 -0.755 1.00 0.00 H ATOM 758 HB1 ALA A 54 2.560 11.442 0.409 1.00 0.00 H ATOM 759 HB2 ALA A 54 2.032 13.092 -0.007 1.00 0.00 H ATOM 760 HB3 ALA A 54 1.051 12.094 1.094 1.00 0.00 H ATOM 761 H ALA A 54 2.663 11.924 -2.207 1.00 0.00 H ATOM 762 N LYS A 55 0.008 13.460 -1.992 1.00 40.74 N ATOM 763 CA LYS A 55 -0.979 14.433 -2.310 1.00 43.56 C ATOM 764 C LYS A 55 -2.055 13.845 -3.216 1.00 42.10 C ATOM 765 O LYS A 55 -3.220 14.199 -3.072 1.00 42.72 O ATOM 766 CB LYS A 55 -0.325 15.649 -2.927 1.00 45.15 C ATOM 767 CG LYS A 55 -1.085 16.883 -2.697 1.00 49.20 C ATOM 768 CD LYS A 55 -0.306 18.005 -3.331 1.00 60.81 C ATOM 769 CE LYS A 55 -1.266 18.988 -3.967 1.00 67.04 C ATOM 770 NZ LYS A 55 -2.203 19.502 -2.927 1.00 69.36 N ATOM 771 HA LYS A 55 -1.475 14.747 -1.392 1.00 0.00 H ATOM 772 HB2 LYS A 55 0.669 15.767 -2.496 1.00 0.00 H ATOM 773 HB3 LYS A 55 -0.237 15.489 -4.002 1.00 0.00 H ATOM 774 HG2 LYS A 55 -2.071 16.806 -3.155 1.00 0.00 H ATOM 775 HG3 LYS A 55 -1.195 17.061 -1.627 1.00 0.00 H ATOM 776 HD2 LYS A 55 0.284 18.514 -2.569 1.00 0.00 H ATOM 777 HD3 LYS A 55 0.359 17.600 -4.094 1.00 0.00 H ATOM 778 HE2 LYS A 55 -1.832 18.488 -4.753 1.00 0.00 H ATOM 779 HE3 LYS A 55 -0.706 19.819 -4.396 1.00 0.00 H ATOM 780 HZ1 LYS A 55 -2.736 18.707 -2.519 1.00 0.00 H ATOM 781 HZ2 LYS A 55 -1.661 19.978 -2.178 1.00 0.00 H ATOM 782 HZ3 LYS A 55 -2.864 20.178 -3.361 1.00 0.00 H ATOM 783 H LYS A 55 0.981 13.598 -2.331 1.00 0.00 H ATOM 784 N ARG A 56 -1.722 12.933 -4.114 1.00 41.17 N ATOM 785 CA ARG A 56 -2.800 12.502 -4.974 1.00 43.84 C ATOM 786 C ARG A 56 -3.751 11.527 -4.284 1.00 44.96 C ATOM 787 O ARG A 56 -4.737 11.081 -4.866 1.00 48.77 O ATOM 788 CB ARG A 56 -2.389 12.164 -6.440 1.00 50.30 C ATOM 789 CG ARG A 56 -0.999 11.595 -6.768 1.00 53.31 C ATOM 790 CD ARG A 56 -1.135 10.140 -7.098 1.00 54.74 C ATOM 791 NE ARG A 56 -2.139 9.580 -6.169 1.00 68.74 N ATOM 792 CZ ARG A 56 -2.370 8.278 -5.919 1.00 69.55 C ATOM 793 NH1 ARG A 56 -1.645 7.332 -6.530 1.00 68.34 N ATOM 794 NH2 ARG A 56 -3.331 7.917 -5.048 1.00 60.17 N ATOM 795 HA ARG A 56 -3.414 13.386 -5.144 1.00 0.00 H ATOM 796 HB2 ARG A 56 -3.114 11.436 -6.804 1.00 0.00 H ATOM 797 HB3 ARG A 56 -2.486 13.089 -7.009 1.00 0.00 H ATOM 798 HG2 ARG A 56 -0.578 12.126 -7.622 1.00 0.00 H ATOM 799 HG3 ARG A 56 -0.342 11.715 -5.907 1.00 0.00 H ATOM 800 HD2 ARG A 56 -0.178 9.634 -6.966 1.00 0.00 H ATOM 801 HD3 ARG A 56 -1.469 10.019 -8.128 1.00 0.00 H ATOM 802 HE ARG A 56 -2.729 10.264 -5.654 1.00 0.00 H ATOM 803 HH12 ARG A 56 -1.828 6.328 -6.332 1.00 0.00 H ATOM 804 HH11 ARG A 56 -0.899 7.602 -7.202 1.00 0.00 H ATOM 805 HH22 ARG A 56 -3.508 6.910 -4.856 1.00 0.00 H ATOM 806 HH21 ARG A 56 -3.897 8.645 -4.567 1.00 0.00 H ATOM 807 H ARG A 56 -0.757 12.555 -4.195 1.00 0.00 H ATOM 808 N VAL A 57 -3.509 11.253 -3.006 1.00 43.48 N ATOM 809 CA VAL A 57 -4.458 10.440 -2.233 1.00 41.45 C ATOM 810 C VAL A 57 -5.666 11.275 -1.786 1.00 42.20 C ATOM 811 O VAL A 57 -5.525 12.125 -0.889 1.00 36.90 O ATOM 812 CB VAL A 57 -3.808 9.768 -0.980 1.00 44.64 C ATOM 813 CG1 VAL A 57 -4.821 8.870 -0.235 1.00 44.81 C ATOM 814 CG2 VAL A 57 -2.613 8.979 -1.373 1.00 42.48 C ATOM 815 HA VAL A 57 -4.784 9.647 -2.906 1.00 0.00 H ATOM 816 HB VAL A 57 -3.498 10.562 -0.301 1.00 0.00 H ATOM 817 HG11 VAL A 57 -5.666 9.474 0.094 1.00 0.00 H ATOM 818 HG12 VAL A 57 -5.172 8.086 -0.906 1.00 0.00 H ATOM 819 HG13 VAL A 57 -4.336 8.418 0.631 1.00 0.00 H ATOM 820 HG21 VAL A 57 -2.908 8.202 -2.079 1.00 0.00 H ATOM 821 HG22 VAL A 57 -1.882 9.638 -1.841 1.00 0.00 H ATOM 822 HG23 VAL A 57 -2.175 8.519 -0.487 1.00 0.00 H ATOM 823 H VAL A 57 -2.646 11.615 -2.552 1.00 0.00 H ATOM 824 N PRO A 58 -6.855 11.020 -2.409 1.00 44.96 N ATOM 825 CA PRO A 58 -8.186 11.576 -2.145 1.00 37.89 C ATOM 826 C PRO A 58 -8.484 11.762 -0.667 1.00 42.60 C ATOM 827 O PRO A 58 -8.642 10.761 0.062 1.00 44.64 O ATOM 828 CB PRO A 58 -9.113 10.472 -2.685 1.00 41.58 C ATOM 829 CG PRO A 58 -8.200 9.327 -3.164 1.00 39.83 C ATOM 830 CD PRO A 58 -6.955 10.039 -3.511 1.00 44.00 C ATOM 831 HA PRO A 58 -8.297 12.563 -2.593 1.00 0.00 H ATOM 832 HD3 PRO A 58 -6.100 9.363 -3.521 1.00 0.00 H ATOM 833 HD2 PRO A 58 -7.036 10.534 -4.479 1.00 0.00 H ATOM 834 HG3 PRO A 58 -8.622 8.823 -4.034 1.00 0.00 H ATOM 835 HG2 PRO A 58 -8.030 8.599 -2.371 1.00 0.00 H ATOM 836 HB2 PRO A 58 -9.777 10.119 -1.896 1.00 0.00 H ATOM 837 HB3 PRO A 58 -9.707 10.852 -3.516 1.00 0.00 H ATOM 838 N GLY A 59 -8.600 13.015 -0.219 1.00 39.77 N ATOM 839 CA GLY A 59 -8.874 13.273 1.197 1.00 40.88 C ATOM 840 C GLY A 59 -7.621 13.646 1.985 1.00 43.54 C ATOM 841 O GLY A 59 -7.722 14.160 3.102 1.00 41.24 O ATOM 842 HA3 GLY A 59 -9.308 12.375 1.637 1.00 0.00 H ATOM 843 HA2 GLY A 59 -9.588 14.093 1.270 1.00 0.00 H ATOM 844 H GLY A 59 -8.495 13.812 -0.879 1.00 0.00 H ATOM 845 N SER A 60 -6.448 13.411 1.384 1.00 44.34 N ATOM 846 CA SER A 60 -5.139 13.505 2.031 1.00 38.10 C ATOM 847 C SER A 60 -4.912 14.833 2.764 1.00 41.70 C ATOM 848 O SER A 60 -5.213 15.911 2.241 1.00 36.08 O ATOM 849 CB SER A 60 -4.074 13.379 0.960 1.00 41.48 C ATOM 850 OG SER A 60 -4.180 14.516 0.087 1.00 47.97 O ATOM 851 HA SER A 60 -5.090 12.709 2.774 1.00 0.00 H ATOM 852 HB2 SER A 60 -4.228 12.461 0.392 1.00 0.00 H ATOM 853 HB3 SER A 60 -3.087 13.358 1.421 1.00 0.00 H ATOM 854 HG SER A 60 -4.042 15.346 0.609 1.00 0.00 H ATOM 855 H SER A 60 -6.469 13.141 0.380 1.00 0.00 H ATOM 856 N VAL A 61 -4.418 14.755 3.996 1.00 35.34 N ATOM 857 CA VAL A 61 -3.721 15.882 4.542 1.00 35.56 C ATOM 858 C VAL A 61 -2.251 15.451 4.602 1.00 38.31 C ATOM 859 O VAL A 61 -1.976 14.368 5.107 1.00 37.41 O ATOM 860 CB VAL A 61 -4.326 16.401 5.903 1.00 33.59 C ATOM 861 CG1 VAL A 61 -4.067 15.512 7.118 1.00 27.78 C ATOM 862 CG2 VAL A 61 -3.764 17.729 6.189 1.00 32.03 C ATOM 863 HA VAL A 61 -3.828 16.768 3.917 1.00 0.00 H ATOM 864 HB VAL A 61 -5.406 16.410 5.756 1.00 0.00 H ATOM 865 HG11 VAL A 61 -4.499 14.526 6.944 1.00 0.00 H ATOM 866 HG12 VAL A 61 -2.993 15.417 7.274 1.00 0.00 H ATOM 867 HG13 VAL A 61 -4.525 15.961 7.999 1.00 0.00 H ATOM 868 HG21 VAL A 61 -2.680 17.654 6.269 1.00 0.00 H ATOM 869 HG22 VAL A 61 -4.024 18.414 5.381 1.00 0.00 H ATOM 870 HG23 VAL A 61 -4.174 18.101 7.128 1.00 0.00 H ATOM 871 H VAL A 61 -4.536 13.887 4.556 1.00 0.00 H ATOM 872 N VAL A 62 -1.323 16.244 4.049 1.00 34.33 N ATOM 873 CA VAL A 62 0.092 15.850 4.033 1.00 31.02 C ATOM 874 C VAL A 62 0.868 16.413 5.210 1.00 35.27 C ATOM 875 O VAL A 62 0.855 17.621 5.435 1.00 37.11 O ATOM 876 CB VAL A 62 0.807 16.216 2.702 1.00 33.35 C ATOM 877 CG1 VAL A 62 2.214 15.519 2.610 1.00 27.17 C ATOM 878 CG2 VAL A 62 -0.082 15.828 1.504 1.00 22.32 C ATOM 879 HA VAL A 62 0.082 14.764 4.120 1.00 0.00 H ATOM 880 HB VAL A 62 0.972 17.293 2.678 1.00 0.00 H ATOM 881 HG11 VAL A 62 2.835 15.846 3.444 1.00 0.00 H ATOM 882 HG12 VAL A 62 2.086 14.437 2.653 1.00 0.00 H ATOM 883 HG13 VAL A 62 2.692 15.792 1.669 1.00 0.00 H ATOM 884 HG21 VAL A 62 -0.272 14.755 1.527 1.00 0.00 H ATOM 885 HG22 VAL A 62 -1.027 16.367 1.565 1.00 0.00 H ATOM 886 HG23 VAL A 62 0.427 16.088 0.576 1.00 0.00 H ATOM 887 H VAL A 62 -1.608 17.150 3.626 1.00 0.00 H ATOM 888 N VAL A 63 1.520 15.528 5.980 1.00 34.91 N ATOM 889 CA VAL A 63 2.509 15.933 6.988 1.00 28.40 C ATOM 890 C VAL A 63 3.899 15.619 6.438 1.00 27.57 C ATOM 891 O VAL A 63 4.164 14.496 6.000 1.00 28.32 O ATOM 892 CB VAL A 63 2.294 15.197 8.339 1.00 32.47 C ATOM 893 CG1 VAL A 63 3.462 15.419 9.254 1.00 33.95 C ATOM 894 CG2 VAL A 63 0.986 15.648 9.047 1.00 33.22 C ATOM 895 HA VAL A 63 2.399 16.999 7.185 1.00 0.00 H ATOM 896 HB VAL A 63 2.206 14.135 8.111 1.00 0.00 H ATOM 897 HG11 VAL A 63 4.368 15.037 8.784 1.00 0.00 H ATOM 898 HG12 VAL A 63 3.573 16.486 9.447 1.00 0.00 H ATOM 899 HG13 VAL A 63 3.290 14.895 10.194 1.00 0.00 H ATOM 900 HG21 VAL A 63 1.033 16.719 9.246 1.00 0.00 H ATOM 901 HG22 VAL A 63 0.133 15.434 8.403 1.00 0.00 H ATOM 902 HG23 VAL A 63 0.878 15.107 9.987 1.00 0.00 H ATOM 903 H VAL A 63 1.317 14.515 5.858 1.00 0.00 H ATOM 904 N VAL A 64 4.775 16.605 6.425 1.00 22.74 N ATOM 905 CA VAL A 64 6.145 16.364 6.047 1.00 25.93 C ATOM 906 C VAL A 64 6.951 16.667 7.256 1.00 26.92 C ATOM 907 O VAL A 64 6.812 17.744 7.846 1.00 32.00 O ATOM 908 CB VAL A 64 6.623 17.333 4.958 1.00 27.83 C ATOM 909 CG1 VAL A 64 8.104 17.131 4.718 1.00 22.46 C ATOM 910 CG2 VAL A 64 5.819 17.097 3.653 1.00 24.68 C ATOM 911 HA VAL A 64 6.242 15.344 5.674 1.00 0.00 H ATOM 912 HB VAL A 64 6.457 18.360 5.283 1.00 0.00 H ATOM 913 HG11 VAL A 64 8.650 17.323 5.642 1.00 0.00 H ATOM 914 HG12 VAL A 64 8.282 16.105 4.396 1.00 0.00 H ATOM 915 HG13 VAL A 64 8.443 17.820 3.944 1.00 0.00 H ATOM 916 HG21 VAL A 64 5.970 16.072 3.315 1.00 0.00 H ATOM 917 HG22 VAL A 64 4.759 17.265 3.845 1.00 0.00 H ATOM 918 HG23 VAL A 64 6.164 17.789 2.885 1.00 0.00 H ATOM 919 H VAL A 64 4.475 17.565 6.690 1.00 0.00 H ATOM 920 N SER A 65 7.804 15.742 7.631 1.00 20.74 N ATOM 921 CA SER A 65 8.633 15.993 8.799 1.00 22.55 C ATOM 922 C SER A 65 10.039 16.289 8.331 1.00 24.36 C ATOM 923 O SER A 65 10.590 15.692 7.371 1.00 20.34 O ATOM 924 CB SER A 65 8.626 14.816 9.788 1.00 27.31 C ATOM 925 OG SER A 65 9.309 13.670 9.228 1.00 33.29 O ATOM 926 HA SER A 65 8.224 16.847 9.339 1.00 0.00 H ATOM 927 HB2 SER A 65 7.595 14.543 10.012 1.00 0.00 H ATOM 928 HB3 SER A 65 9.129 15.118 10.707 1.00 0.00 H ATOM 929 HG SER A 65 10.247 13.913 9.026 1.00 0.00 H ATOM 930 H SER A 65 7.885 14.849 7.104 1.00 0.00 H ATOM 931 N ILE A 66 10.625 17.214 9.043 1.00 23.45 N ATOM 932 CA ILE A 66 11.952 17.686 8.730 1.00 31.37 C ATOM 933 C ILE A 66 12.771 17.522 10.006 1.00 31.27 C ATOM 934 O ILE A 66 12.672 18.328 10.927 1.00 38.70 O ATOM 935 CB ILE A 66 11.924 19.188 8.245 1.00 21.40 C ATOM 936 CG1 ILE A 66 11.000 19.311 7.033 1.00 21.02 C ATOM 937 CG2 ILE A 66 13.363 19.610 7.904 1.00 23.67 C ATOM 938 CD1 ILE A 66 10.880 20.724 6.343 1.00 19.11 C ATOM 939 HA ILE A 66 12.392 17.118 7.910 1.00 0.00 H ATOM 940 HB ILE A 66 11.539 19.846 9.024 1.00 0.00 H ATOM 941 HG12 ILE A 66 11.357 18.609 6.279 1.00 0.00 H ATOM 942 HG13 ILE A 66 10.000 19.020 7.355 1.00 0.00 H ATOM 943 HD11 ILE A 66 10.504 21.449 7.065 1.00 0.00 H ATOM 944 HD12 ILE A 66 11.862 21.038 5.988 1.00 0.00 H ATOM 945 HD13 ILE A 66 10.192 20.658 5.500 1.00 0.00 H ATOM 946 HG21 ILE A 66 13.988 19.514 8.792 1.00 0.00 H ATOM 947 HG22 ILE A 66 13.751 18.968 7.113 1.00 0.00 H ATOM 948 HG23 ILE A 66 13.366 20.646 7.566 1.00 0.00 H ATOM 949 H ILE A 66 10.122 17.621 9.857 1.00 0.00 H ATOM 950 N PHE A 67 13.538 16.462 10.108 1.00 31.75 N ATOM 951 CA PHE A 67 14.262 16.266 11.366 1.00 31.85 C ATOM 952 C PHE A 67 15.559 15.613 11.051 1.00 25.90 C ATOM 953 O PHE A 67 15.545 14.588 10.400 1.00 27.47 O ATOM 954 CB PHE A 67 13.459 15.357 12.307 1.00 24.89 C ATOM 955 CG PHE A 67 14.166 15.009 13.584 1.00 21.87 C ATOM 956 CD1 PHE A 67 14.489 15.993 14.517 1.00 22.31 C ATOM 957 CD2 PHE A 67 14.495 13.690 13.870 1.00 23.71 C ATOM 958 CE1 PHE A 67 15.175 15.659 15.684 1.00 23.92 C ATOM 959 CE2 PHE A 67 15.159 13.337 15.060 1.00 18.13 C ATOM 960 CZ PHE A 67 15.483 14.300 15.969 1.00 17.89 C ATOM 961 HA PHE A 67 14.417 17.227 11.856 1.00 0.00 H ATOM 962 HB2 PHE A 67 12.528 15.864 12.560 1.00 0.00 H ATOM 963 HB3 PHE A 67 13.235 14.431 11.778 1.00 0.00 H ATOM 964 HD2 PHE A 67 14.233 12.910 13.156 1.00 0.00 H ATOM 965 HE2 PHE A 67 15.414 12.295 15.254 1.00 0.00 H ATOM 966 HZ PHE A 67 15.973 14.031 16.905 1.00 0.00 H ATOM 967 HE1 PHE A 67 15.476 16.442 16.380 1.00 0.00 H ATOM 968 HD1 PHE A 67 14.204 17.029 14.333 1.00 0.00 H ATOM 969 H PHE A 67 13.629 15.785 9.323 1.00 0.00 H ATOM 970 N VAL A 68 16.672 16.187 11.507 1.00 33.07 N ATOM 971 CA VAL A 68 18.003 15.562 11.286 1.00 38.41 C ATOM 972 C VAL A 68 18.328 14.927 12.585 1.00 41.11 C ATOM 973 O VAL A 68 18.441 15.613 13.592 1.00 42.83 O ATOM 974 CB VAL A 68 19.120 16.562 10.971 1.00 39.65 C ATOM 975 CG1 VAL A 68 20.431 15.828 10.748 1.00 41.79 C ATOM 976 CG2 VAL A 68 18.772 17.427 9.757 1.00 43.13 C ATOM 977 HA VAL A 68 17.947 14.889 10.430 1.00 0.00 H ATOM 978 HB VAL A 68 19.229 17.228 11.827 1.00 0.00 H ATOM 979 HG11 VAL A 68 20.692 15.271 11.648 1.00 0.00 H ATOM 980 HG12 VAL A 68 20.322 15.138 9.911 1.00 0.00 H ATOM 981 HG13 VAL A 68 21.217 16.550 10.525 1.00 0.00 H ATOM 982 HG21 VAL A 68 18.625 16.787 8.887 1.00 0.00 H ATOM 983 HG22 VAL A 68 17.857 17.983 9.959 1.00 0.00 H ATOM 984 HG23 VAL A 68 19.587 18.124 9.564 1.00 0.00 H ATOM 985 H VAL A 68 16.609 17.086 12.026 1.00 0.00 H ATOM 986 N ASN A 69 18.466 13.619 12.567 1.00 43.50 N ATOM 987 CA ASN A 69 18.569 12.869 13.788 1.00 51.96 C ATOM 988 C ASN A 69 20.032 12.704 14.169 1.00 51.60 C ATOM 989 O ASN A 69 20.791 12.200 13.371 1.00 54.99 O ATOM 990 CB ASN A 69 17.895 11.524 13.498 1.00 59.99 C ATOM 991 CG ASN A 69 18.017 10.541 14.635 1.00 64.19 C ATOM 992 OD1 ASN A 69 18.848 10.713 15.526 1.00 65.85 O ATOM 993 ND2 ASN A 69 17.196 9.482 14.599 1.00 65.50 N ATOM 994 HA ASN A 69 18.088 13.365 14.631 1.00 0.00 H ATOM 995 HB2 ASN A 69 16.837 11.701 13.305 1.00 0.00 H ATOM 996 HB3 ASN A 69 18.357 11.088 12.612 1.00 0.00 H ATOM 997 HD22 ASN A 69 16.510 9.382 13.824 1.00 0.00 H ATOM 998 HD21 ASN A 69 17.245 8.760 15.346 1.00 0.00 H ATOM 999 H ASN A 69 18.501 13.120 11.655 1.00 0.00 H ATOM 1000 N PRO A 70 20.444 13.076 15.389 1.00 57.20 N ATOM 1001 CA PRO A 70 21.904 13.088 15.576 1.00 67.23 C ATOM 1002 C PRO A 70 22.525 11.745 16.093 1.00 73.09 C ATOM 1003 O PRO A 70 23.450 11.798 16.907 1.00 77.42 O ATOM 1004 CB PRO A 70 22.067 14.162 16.643 1.00 60.19 C ATOM 1005 CG PRO A 70 20.893 13.933 17.520 1.00 52.79 C ATOM 1006 CD PRO A 70 19.760 13.433 16.643 1.00 53.09 C ATOM 1007 HA PRO A 70 22.416 13.255 14.629 1.00 0.00 H ATOM 1008 HD3 PRO A 70 19.275 12.563 17.087 1.00 0.00 H ATOM 1009 HD2 PRO A 70 19.019 14.215 16.476 1.00 0.00 H ATOM 1010 HG3 PRO A 70 20.604 14.865 18.007 1.00 0.00 H ATOM 1011 HG2 PRO A 70 21.134 13.188 18.278 1.00 0.00 H ATOM 1012 HB2 PRO A 70 22.999 14.032 17.192 1.00 0.00 H ATOM 1013 HB3 PRO A 70 22.041 15.159 16.204 1.00 0.00 H ATOM 1014 N MET A 71 22.050 10.579 15.602 1.00 84.54 N ATOM 1015 CA MET A 71 22.253 9.214 16.244 1.00 87.68 C ATOM 1016 C MET A 71 22.838 8.063 15.348 1.00 93.60 C ATOM 1017 O MET A 71 23.658 7.252 15.823 1.00 91.35 O ATOM 1018 CB MET A 71 20.930 8.732 16.939 1.00 89.38 C ATOM 1019 CG MET A 71 20.632 7.164 16.961 1.00 89.50 C ATOM 1020 SD MET A 71 18.889 6.593 17.177 1.00 88.91 S ATOM 1021 CE MET A 71 19.097 4.982 17.963 1.00 85.91 C ATOM 1022 HA MET A 71 23.047 9.401 16.967 1.00 0.00 H ATOM 1023 HB2 MET A 71 20.963 9.072 17.974 1.00 0.00 H ATOM 1024 HB3 MET A 71 20.098 9.215 16.426 1.00 0.00 H ATOM 1025 HG2 MET A 71 21.213 6.739 17.780 1.00 0.00 H ATOM 1026 HG3 MET A 71 20.988 6.757 16.015 1.00 0.00 H ATOM 1027 HE1 MET A 71 19.677 4.332 17.308 1.00 0.00 H ATOM 1028 HE2 MET A 71 19.622 5.106 18.910 1.00 0.00 H ATOM 1029 HE3 MET A 71 18.118 4.538 18.144 1.00 0.00 H ATOM 1030 H MET A 71 21.504 10.617 14.718 1.00 0.00 H ATOM 1031 N GLN A 72 22.388 7.994 14.085 1.00 95.64 N ATOM 1032 CA GLN A 72 22.787 6.940 13.123 1.00 96.62 C ATOM 1033 C GLN A 72 23.998 7.320 12.233 1.00 94.69 C ATOM 1034 O GLN A 72 24.534 6.494 11.474 1.00 92.56 O ATOM 1035 CB GLN A 72 21.584 6.488 12.256 1.00 95.58 C ATOM 1036 CG GLN A 72 21.005 7.538 11.300 1.00 97.72 C ATOM 1037 CD GLN A 72 19.697 8.150 11.794 1.00101.70 C ATOM 1038 OE1 GLN A 72 18.989 8.837 11.042 1.00102.14 O ATOM 1039 NE2 GLN A 72 19.366 7.902 13.062 1.00102.19 N ATOM 1040 HA GLN A 72 23.120 6.101 13.734 1.00 0.00 H ATOM 1041 HB2 GLN A 72 21.906 5.636 11.658 1.00 0.00 H ATOM 1042 HB3 GLN A 72 20.786 6.176 12.930 1.00 0.00 H ATOM 1043 HG2 GLN A 72 21.737 8.337 11.179 1.00 0.00 H ATOM 1044 HG3 GLN A 72 20.823 7.065 10.335 1.00 0.00 H ATOM 1045 HE22 GLN A 72 19.989 7.321 13.658 1.00 0.00 H ATOM 1046 HE21 GLN A 72 18.485 8.290 13.455 1.00 0.00 H ATOM 1047 H GLN A 72 21.720 8.723 13.763 1.00 0.00 H TER 1048 GLN A 72 ATOM 1049 N THR A 85 18.722 23.890 5.687 1.00 77.78 N ATOM 1050 CA THR A 85 17.883 24.841 4.902 1.00 73.77 C ATOM 1051 C THR A 85 16.348 24.908 5.269 1.00 70.80 C ATOM 1052 O THR A 85 15.488 24.819 4.338 1.00 61.15 O ATOM 1053 CB THR A 85 18.083 24.652 3.332 1.00 75.62 C ATOM 1054 OG1 THR A 85 17.900 23.277 2.956 1.00 72.95 O ATOM 1055 CG2 THR A 85 19.467 25.122 2.883 1.00 76.59 C ATOM 1056 HA THR A 85 18.269 25.813 5.210 1.00 0.00 H ATOM 1057 HB THR A 85 17.330 25.265 2.836 1.00 0.00 H ATOM 1058 HG1 THR A 85 16.984 22.989 3.199 1.00 0.00 H ATOM 1059 HG23 THR A 85 19.605 26.165 3.168 1.00 0.00 H ATOM 1060 HG21 THR A 85 20.231 24.509 3.361 1.00 0.00 H ATOM 1061 HG22 THR A 85 19.548 25.026 1.800 1.00 0.00 H ATOM 1062 HN3 THR A 85 18.359 22.924 5.560 1.00 0.00 H ATOM 1063 HN2 THR A 85 18.684 24.146 6.694 1.00 0.00 H ATOM 1064 HN1 THR A 85 19.705 23.939 5.352 1.00 0.00 H ATOM 1065 N PRO A 86 16.008 25.085 6.602 1.00 67.18 N ATOM 1066 CA PRO A 86 14.568 25.042 7.099 1.00 64.74 C ATOM 1067 C PRO A 86 13.585 25.878 6.259 1.00 59.55 C ATOM 1068 O PRO A 86 12.624 25.335 5.714 1.00 50.14 O ATOM 1069 CB PRO A 86 14.639 25.536 8.565 1.00 58.76 C ATOM 1070 CG PRO A 86 16.086 25.962 8.778 1.00 64.42 C ATOM 1071 CD PRO A 86 16.959 25.311 7.715 1.00 63.33 C ATOM 1072 HA PRO A 86 14.168 24.032 7.014 1.00 0.00 H ATOM 1073 HD3 PRO A 86 17.769 25.974 7.411 1.00 0.00 H ATOM 1074 HD2 PRO A 86 17.377 24.370 8.072 1.00 0.00 H ATOM 1075 HG3 PRO A 86 16.418 25.646 9.767 1.00 0.00 H ATOM 1076 HG2 PRO A 86 16.163 27.046 8.700 1.00 0.00 H ATOM 1077 HB2 PRO A 86 13.966 26.380 8.716 1.00 0.00 H ATOM 1078 HB3 PRO A 86 14.372 24.733 9.252 1.00 0.00 H ATOM 1079 N ASP A 87 13.887 27.168 6.132 1.00 57.39 N ATOM 1080 CA ASP A 87 13.183 28.112 5.273 1.00 58.66 C ATOM 1081 C ASP A 87 12.926 27.625 3.853 1.00 57.69 C ATOM 1082 O ASP A 87 11.775 27.425 3.458 1.00 63.44 O ATOM 1083 CB ASP A 87 13.988 29.411 5.211 1.00 61.60 C ATOM 1084 CG ASP A 87 14.395 29.893 6.581 1.00 63.93 C ATOM 1085 OD1 ASP A 87 13.509 29.931 7.456 1.00 60.22 O ATOM 1086 OD2 ASP A 87 15.596 30.188 6.792 1.00 67.93 O ATOM 1087 HA ASP A 87 12.199 28.250 5.722 1.00 0.00 H ATOM 1088 HB2 ASP A 87 14.886 29.240 4.617 1.00 0.00 H ATOM 1089 HB3 ASP A 87 13.379 30.179 4.734 1.00 0.00 H ATOM 1090 H ASP A 87 14.687 27.530 6.689 1.00 0.00 H ATOM 1091 N ASP A 88 13.987 27.452 3.074 1.00 54.02 N ATOM 1092 CA ASP A 88 13.825 26.931 1.728 1.00 53.10 C ATOM 1093 C ASP A 88 12.863 25.726 1.673 1.00 51.11 C ATOM 1094 O ASP A 88 11.894 25.748 0.899 1.00 45.69 O ATOM 1095 CB ASP A 88 15.180 26.609 1.103 1.00 53.34 C ATOM 1096 CG ASP A 88 15.972 27.864 0.815 1.00 63.09 C ATOM 1097 OD1 ASP A 88 15.358 28.880 0.398 1.00 67.61 O ATOM 1098 OD2 ASP A 88 17.200 27.855 1.017 1.00 64.81 O ATOM 1099 HA ASP A 88 13.360 27.715 1.131 1.00 0.00 H ATOM 1100 HB2 ASP A 88 15.747 25.982 1.791 1.00 0.00 H ATOM 1101 HB3 ASP A 88 15.020 26.069 0.170 1.00 0.00 H ATOM 1102 H ASP A 88 14.935 27.690 3.428 1.00 0.00 H ATOM 1103 N ASP A 89 13.125 24.711 2.503 1.00 38.77 N ATOM 1104 CA ASP A 89 12.343 23.502 2.476 1.00 39.61 C ATOM 1105 C ASP A 89 10.884 23.909 2.653 1.00 38.44 C ATOM 1106 O ASP A 89 9.995 23.449 1.915 1.00 35.68 O ATOM 1107 CB ASP A 89 12.825 22.471 3.548 1.00 34.05 C ATOM 1108 CG ASP A 89 14.284 22.020 3.333 1.00 33.60 C ATOM 1109 OD1 ASP A 89 14.659 21.932 2.158 1.00 33.21 O ATOM 1110 OD2 ASP A 89 15.058 21.767 4.317 1.00 35.68 O ATOM 1111 HA ASP A 89 12.465 22.984 1.525 1.00 0.00 H ATOM 1112 HB2 ASP A 89 12.744 22.930 4.533 1.00 0.00 H ATOM 1113 HB3 ASP A 89 12.179 21.594 3.503 1.00 0.00 H ATOM 1114 H ASP A 89 13.909 24.796 3.181 1.00 0.00 H ATOM 1115 N LEU A 90 10.657 24.824 3.583 1.00 34.47 N ATOM 1116 CA LEU A 90 9.306 25.284 3.869 1.00 40.77 C ATOM 1117 C LEU A 90 8.688 25.953 2.671 1.00 44.18 C ATOM 1118 O LEU A 90 7.538 25.657 2.341 1.00 44.63 O ATOM 1119 CB LEU A 90 9.295 26.248 5.047 1.00 38.91 C ATOM 1120 CG LEU A 90 9.594 25.514 6.344 1.00 45.25 C ATOM 1121 CD1 LEU A 90 9.671 26.457 7.580 1.00 39.96 C ATOM 1122 CD2 LEU A 90 8.576 24.382 6.511 1.00 42.03 C ATOM 1123 HA LEU A 90 8.716 24.403 4.122 1.00 0.00 H ATOM 1124 HB2 LEU A 90 10.051 27.017 4.888 1.00 0.00 H ATOM 1125 HB3 LEU A 90 8.313 26.715 5.118 1.00 0.00 H ATOM 1126 HG LEU A 90 10.594 25.084 6.283 1.00 0.00 H ATOM 1127 HD21 LEU A 90 7.570 24.801 6.545 1.00 0.00 H ATOM 1128 HD22 LEU A 90 8.657 23.695 5.668 1.00 0.00 H ATOM 1129 HD23 LEU A 90 8.779 23.846 7.438 1.00 0.00 H ATOM 1130 HD11 LEU A 90 10.462 27.191 7.427 1.00 0.00 H ATOM 1131 HD12 LEU A 90 8.717 26.970 7.704 1.00 0.00 H ATOM 1132 HD13 LEU A 90 9.887 25.868 8.472 1.00 0.00 H ATOM 1133 H LEU A 90 11.456 25.220 4.117 1.00 0.00 H ATOM 1134 N ALA A 91 9.442 26.860 2.029 1.00 46.13 N ATOM 1135 CA ALA A 91 8.968 27.515 0.788 1.00 49.24 C ATOM 1136 C ALA A 91 8.479 26.489 -0.248 1.00 45.73 C ATOM 1137 O ALA A 91 7.313 26.504 -0.671 1.00 45.66 O ATOM 1138 CB ALA A 91 10.041 28.450 0.183 1.00 47.65 C ATOM 1139 HA ALA A 91 8.115 28.134 1.066 1.00 0.00 H ATOM 1140 HB1 ALA A 91 10.293 29.227 0.905 1.00 0.00 H ATOM 1141 HB2 ALA A 91 10.933 27.871 -0.055 1.00 0.00 H ATOM 1142 HB3 ALA A 91 9.651 28.909 -0.725 1.00 0.00 H ATOM 1143 H ALA A 91 10.377 27.107 2.411 1.00 0.00 H ATOM 1144 N GLN A 92 9.365 25.583 -0.630 1.00 45.29 N ATOM 1145 CA GLN A 92 8.990 24.460 -1.499 1.00 49.85 C ATOM 1146 C GLN A 92 7.668 23.780 -1.106 1.00 44.86 C ATOM 1147 O GLN A 92 6.886 23.367 -1.950 1.00 40.51 O ATOM 1148 CB GLN A 92 10.081 23.409 -1.452 1.00 51.72 C ATOM 1149 CG GLN A 92 11.423 23.836 -1.999 1.00 58.14 C ATOM 1150 CD GLN A 92 12.015 22.732 -2.866 1.00 63.39 C ATOM 1151 OE1 GLN A 92 11.351 22.206 -3.780 1.00 62.53 O ATOM 1152 NE2 GLN A 92 13.255 22.360 -2.574 1.00 65.01 N ATOM 1153 HA GLN A 92 8.859 24.881 -2.496 1.00 0.00 H ATOM 1154 HB2 GLN A 92 10.220 23.116 -0.411 1.00 0.00 H ATOM 1155 HB3 GLN A 92 9.742 22.548 -2.028 1.00 0.00 H ATOM 1156 HG2 GLN A 92 11.297 24.737 -2.600 1.00 0.00 H ATOM 1157 HG3 GLN A 92 12.100 24.045 -1.170 1.00 0.00 H ATOM 1158 HE22 GLN A 92 13.770 22.829 -1.802 1.00 0.00 H ATOM 1159 HE21 GLN A 92 13.712 21.600 -3.118 1.00 0.00 H ATOM 1160 H GLN A 92 10.350 25.668 -0.307 1.00 0.00 H ATOM 1161 N LEU A 93 7.460 23.658 0.197 1.00 43.53 N ATOM 1162 CA LEU A 93 6.337 22.967 0.743 1.00 39.89 C ATOM 1163 C LEU A 93 5.054 23.801 0.572 1.00 43.81 C ATOM 1164 O LEU A 93 4.030 23.277 0.080 1.00 40.11 O ATOM 1165 CB LEU A 93 6.625 22.621 2.215 1.00 41.40 C ATOM 1166 CG LEU A 93 7.635 21.500 2.587 1.00 39.94 C ATOM 1167 CD1 LEU A 93 7.402 20.961 4.013 1.00 37.83 C ATOM 1168 CD2 LEU A 93 7.584 20.344 1.668 1.00 30.09 C ATOM 1169 HA LEU A 93 6.173 22.034 0.204 1.00 0.00 H ATOM 1170 HB2 LEU A 93 6.989 23.535 2.684 1.00 0.00 H ATOM 1171 HB3 LEU A 93 5.671 22.340 2.661 1.00 0.00 H ATOM 1172 HG LEU A 93 8.611 21.980 2.513 1.00 0.00 H ATOM 1173 HD21 LEU A 93 6.585 19.909 1.689 1.00 0.00 H ATOM 1174 HD22 LEU A 93 7.816 20.676 0.656 1.00 0.00 H ATOM 1175 HD23 LEU A 93 8.313 19.598 1.984 1.00 0.00 H ATOM 1176 HD11 LEU A 93 7.516 21.774 4.730 1.00 0.00 H ATOM 1177 HD12 LEU A 93 6.395 20.550 4.085 1.00 0.00 H ATOM 1178 HD13 LEU A 93 8.131 20.180 4.228 1.00 0.00 H ATOM 1179 H LEU A 93 8.146 24.085 0.851 1.00 0.00 H ATOM 1180 N ARG A 94 5.117 25.084 0.982 1.00 42.08 N ATOM 1181 CA ARG A 94 4.000 26.035 0.903 1.00 38.92 C ATOM 1182 C ARG A 94 3.505 26.010 -0.536 1.00 43.38 C ATOM 1183 O ARG A 94 2.288 26.000 -0.791 1.00 38.82 O ATOM 1184 CB ARG A 94 4.506 27.433 1.257 1.00 38.86 C ATOM 1185 CG ARG A 94 3.779 28.068 2.397 1.00 38.62 C ATOM 1186 CD ARG A 94 4.392 29.359 2.916 1.00 39.37 C ATOM 1187 NE ARG A 94 5.488 29.185 3.865 1.00 46.88 N ATOM 1188 CZ ARG A 94 6.759 29.441 3.541 1.00 57.61 C ATOM 1189 NH1 ARG A 94 7.057 29.853 2.312 1.00 56.68 N ATOM 1190 NH2 ARG A 94 7.745 29.303 4.424 1.00 62.73 N ATOM 1191 HA ARG A 94 3.199 25.772 1.594 1.00 0.00 H ATOM 1192 HB2 ARG A 94 5.561 27.360 1.520 1.00 0.00 H ATOM 1193 HB3 ARG A 94 4.395 28.071 0.380 1.00 0.00 H ATOM 1194 HG2 ARG A 94 2.762 28.285 2.070 1.00 0.00 H ATOM 1195 HG3 ARG A 94 3.751 27.353 3.219 1.00 0.00 H ATOM 1196 HD2 ARG A 94 3.606 29.933 3.408 1.00 0.00 H ATOM 1197 HD3 ARG A 94 4.770 29.921 2.062 1.00 0.00 H ATOM 1198 HE ARG A 94 5.272 28.850 4.826 1.00 0.00 H ATOM 1199 HH12 ARG A 94 8.045 30.053 2.056 1.00 0.00 H ATOM 1200 HH11 ARG A 94 6.302 29.975 1.607 1.00 0.00 H ATOM 1201 HH22 ARG A 94 8.725 29.509 4.145 1.00 0.00 H ATOM 1202 HH21 ARG A 94 7.535 28.989 5.393 1.00 0.00 H ATOM 1203 H ARG A 94 6.016 25.423 1.381 1.00 0.00 H ATOM 1204 N ALA A 95 4.498 25.930 -1.438 1.00 39.49 N ATOM 1205 CA ALA A 95 4.369 25.811 -2.896 1.00 42.03 C ATOM 1206 C ALA A 95 3.865 24.462 -3.457 1.00 43.83 C ATOM 1207 O ALA A 95 3.107 24.444 -4.425 1.00 51.49 O ATOM 1208 CB ALA A 95 5.707 26.193 -3.575 1.00 40.60 C ATOM 1209 HA ALA A 95 3.568 26.509 -3.141 1.00 0.00 H ATOM 1210 HB1 ALA A 95 5.963 27.221 -3.318 1.00 0.00 H ATOM 1211 HB2 ALA A 95 6.494 25.524 -3.227 1.00 0.00 H ATOM 1212 HB3 ALA A 95 5.603 26.102 -4.656 1.00 0.00 H ATOM 1213 H ALA A 95 5.467 25.955 -1.061 1.00 0.00 H ATOM 1214 N GLU A 96 4.262 23.335 -2.887 1.00 38.02 N ATOM 1215 CA GLU A 96 3.647 22.074 -3.276 1.00 31.48 C ATOM 1216 C GLU A 96 2.231 21.817 -2.688 1.00 30.84 C ATOM 1217 O GLU A 96 1.623 20.743 -2.902 1.00 29.24 O ATOM 1218 CB GLU A 96 4.577 20.947 -2.891 1.00 35.71 C ATOM 1219 CG GLU A 96 5.712 20.784 -3.848 1.00 40.99 C ATOM 1220 CD GLU A 96 5.244 20.312 -5.198 1.00 46.48 C ATOM 1221 OE1 GLU A 96 4.231 19.585 -5.264 1.00 49.18 O ATOM 1222 OE2 GLU A 96 5.897 20.668 -6.205 1.00 54.90 O ATOM 1223 HA GLU A 96 3.495 22.128 -4.354 1.00 0.00 H ATOM 1224 HB2 GLU A 96 4.983 21.152 -1.900 1.00 0.00 H ATOM 1225 HB3 GLU A 96 4.007 20.018 -2.864 1.00 0.00 H ATOM 1226 HG2 GLU A 96 6.215 21.744 -3.965 1.00 0.00 H ATOM 1227 HG3 GLU A 96 6.413 20.054 -3.443 1.00 0.00 H ATOM 1228 H GLU A 96 5.010 23.350 -2.165 1.00 0.00 H ATOM 1229 N GLY A 97 1.723 22.787 -1.934 1.00 27.86 N ATOM 1230 CA GLY A 97 0.410 22.684 -1.319 1.00 27.05 C ATOM 1231 C GLY A 97 0.353 21.912 -0.020 1.00 38.57 C ATOM 1232 O GLY A 97 -0.724 21.417 0.351 1.00 48.49 O ATOM 1233 HA3 GLY A 97 -0.255 22.194 -2.030 1.00 0.00 H ATOM 1234 HA2 GLY A 97 0.051 23.695 -1.124 1.00 0.00 H ATOM 1235 H GLY A 97 2.284 23.649 -1.779 1.00 0.00 H ATOM 1236 N VAL A 98 1.477 21.796 0.699 1.00 38.77 N ATOM 1237 CA VAL A 98 1.516 20.959 1.924 1.00 30.02 C ATOM 1238 C VAL A 98 0.969 21.743 3.090 1.00 34.63 C ATOM 1239 O VAL A 98 1.415 22.849 3.350 1.00 39.28 O ATOM 1240 CB VAL A 98 2.947 20.395 2.226 1.00 28.83 C ATOM 1241 CG1 VAL A 98 3.162 19.947 3.744 1.00 21.64 C ATOM 1242 CG2 VAL A 98 3.262 19.265 1.292 1.00 20.60 C ATOM 1243 HA VAL A 98 0.885 20.087 1.755 1.00 0.00 H ATOM 1244 HB VAL A 98 3.641 21.219 2.061 1.00 0.00 H ATOM 1245 HG11 VAL A 98 3.008 20.804 4.400 1.00 0.00 H ATOM 1246 HG12 VAL A 98 2.447 19.163 3.995 1.00 0.00 H ATOM 1247 HG13 VAL A 98 4.177 19.569 3.870 1.00 0.00 H ATOM 1248 HG21 VAL A 98 2.528 18.470 1.425 1.00 0.00 H ATOM 1249 HG22 VAL A 98 3.228 19.625 0.264 1.00 0.00 H ATOM 1250 HG23 VAL A 98 4.258 18.881 1.511 1.00 0.00 H ATOM 1251 H VAL A 98 2.335 22.300 0.395 1.00 0.00 H ATOM 1252 N GLU A 99 0.018 21.143 3.799 1.00 38.83 N ATOM 1253 CA GLU A 99 -0.640 21.766 4.946 1.00 36.78 C ATOM 1254 C GLU A 99 0.142 21.684 6.306 1.00 37.94 C ATOM 1255 O GLU A 99 0.066 22.581 7.140 1.00 40.56 O ATOM 1256 CB GLU A 99 -2.084 21.247 5.025 1.00 40.15 C ATOM 1257 CG GLU A 99 -2.940 21.629 3.762 1.00 35.16 C ATOM 1258 CD GLU A 99 -4.369 21.038 3.730 1.00 41.48 C ATOM 1259 OE1 GLU A 99 -4.555 19.822 3.467 1.00 40.20 O ATOM 1260 OE2 GLU A 99 -5.330 21.831 3.904 1.00 47.01 O ATOM 1261 HA GLU A 99 -0.651 22.842 4.771 1.00 0.00 H ATOM 1262 HB2 GLU A 99 -2.059 20.161 5.114 1.00 0.00 H ATOM 1263 HB3 GLU A 99 -2.559 21.672 5.909 1.00 0.00 H ATOM 1264 HG2 GLU A 99 -3.023 22.715 3.727 1.00 0.00 H ATOM 1265 HG3 GLU A 99 -2.410 21.278 2.877 1.00 0.00 H ATOM 1266 H GLU A 99 -0.272 20.183 3.524 1.00 0.00 H ATOM 1267 N ILE A 100 0.925 20.640 6.518 1.00 30.51 N ATOM 1268 CA ILE A 100 1.573 20.476 7.795 1.00 33.84 C ATOM 1269 C ILE A 100 3.072 20.126 7.730 1.00 30.70 C ATOM 1270 O ILE A 100 3.493 19.134 7.102 1.00 28.46 O ATOM 1271 CB ILE A 100 0.828 19.445 8.660 1.00 34.80 C ATOM 1272 CG1 ILE A 100 -0.516 20.016 9.097 1.00 33.53 C ATOM 1273 CG2 ILE A 100 1.683 19.047 9.890 1.00 37.71 C ATOM 1274 CD1 ILE A 100 -1.431 18.996 9.808 1.00 39.57 C ATOM 1275 HA ILE A 100 1.524 21.463 8.256 1.00 0.00 H ATOM 1276 HB ILE A 100 0.652 18.546 8.069 1.00 0.00 H ATOM 1277 HG12 ILE A 100 -0.331 20.845 9.780 1.00 0.00 H ATOM 1278 HG13 ILE A 100 -1.036 20.385 8.213 1.00 0.00 H ATOM 1279 HD11 ILE A 100 -1.638 18.164 9.135 1.00 0.00 H ATOM 1280 HD12 ILE A 100 -0.932 18.625 10.703 1.00 0.00 H ATOM 1281 HD13 ILE A 100 -2.366 19.481 10.086 1.00 0.00 H ATOM 1282 HG21 ILE A 100 2.623 18.612 9.552 1.00 0.00 H ATOM 1283 HG22 ILE A 100 1.887 19.933 10.491 1.00 0.00 H ATOM 1284 HG23 ILE A 100 1.138 18.317 10.489 1.00 0.00 H ATOM 1285 H ILE A 100 1.073 19.938 5.765 1.00 0.00 H ATOM 1286 N ALA A 101 3.869 20.934 8.415 1.00 25.25 N ATOM 1287 CA ALA A 101 5.276 20.583 8.588 1.00 23.27 C ATOM 1288 C ALA A 101 5.627 20.376 10.067 1.00 27.79 C ATOM 1289 O ALA A 101 5.427 21.270 10.935 1.00 27.13 O ATOM 1290 CB ALA A 101 6.146 21.550 7.941 1.00 14.57 C ATOM 1291 HA ALA A 101 5.444 19.627 8.092 1.00 0.00 H ATOM 1292 HB1 ALA A 101 5.924 21.579 6.874 1.00 0.00 H ATOM 1293 HB2 ALA A 101 5.978 22.535 8.376 1.00 0.00 H ATOM 1294 HB3 ALA A 101 7.186 21.258 8.090 1.00 0.00 H ATOM 1295 H ALA A 101 3.495 21.813 8.827 1.00 0.00 H ATOM 1296 N PHE A 102 6.094 19.160 10.358 1.00 25.78 N ATOM 1297 CA PHE A 102 6.519 18.821 11.722 1.00 29.74 C ATOM 1298 C PHE A 102 8.032 18.999 11.864 1.00 31.74 C ATOM 1299 O PHE A 102 8.786 18.225 11.262 1.00 28.48 O ATOM 1300 CB PHE A 102 6.122 17.382 12.025 1.00 33.19 C ATOM 1301 CG PHE A 102 6.513 16.937 13.375 1.00 33.67 C ATOM 1302 CD1 PHE A 102 6.420 17.816 14.455 1.00 27.18 C ATOM 1303 CD2 PHE A 102 6.976 15.619 13.582 1.00 30.81 C ATOM 1304 CE1 PHE A 102 6.833 17.415 15.737 1.00 27.61 C ATOM 1305 CE2 PHE A 102 7.367 15.194 14.842 1.00 28.78 C ATOM 1306 CZ PHE A 102 7.291 16.091 15.940 1.00 30.66 C ATOM 1307 HA PHE A 102 6.030 19.487 12.433 1.00 0.00 H ATOM 1308 HB2 PHE A 102 5.039 17.296 11.933 1.00 0.00 H ATOM 1309 HB3 PHE A 102 6.601 16.730 11.294 1.00 0.00 H ATOM 1310 HD2 PHE A 102 7.026 14.928 12.741 1.00 0.00 H ATOM 1311 HE2 PHE A 102 7.731 14.177 14.989 1.00 0.00 H ATOM 1312 HZ PHE A 102 7.585 15.761 16.937 1.00 0.00 H ATOM 1313 HE1 PHE A 102 6.801 18.118 16.569 1.00 0.00 H ATOM 1314 HD1 PHE A 102 6.024 18.820 14.303 1.00 0.00 H ATOM 1315 H PHE A 102 6.158 18.442 9.608 1.00 0.00 H ATOM 1316 N THR A 103 8.479 20.018 12.623 1.00 27.41 N ATOM 1317 CA THR A 103 9.940 20.265 12.813 1.00 26.85 C ATOM 1318 C THR A 103 10.410 20.168 14.291 1.00 27.20 C ATOM 1319 O THR A 103 10.655 21.219 14.924 1.00 30.14 O ATOM 1320 CB THR A 103 10.348 21.673 12.278 1.00 15.77 C ATOM 1321 OG1 THR A 103 9.681 22.635 13.065 1.00 17.27 O ATOM 1322 CG2 THR A 103 9.930 21.859 10.867 1.00 14.96 C ATOM 1323 HA THR A 103 10.427 19.471 12.247 1.00 0.00 H ATOM 1324 HB THR A 103 11.432 21.774 12.332 1.00 0.00 H ATOM 1325 HG1 THR A 103 9.953 22.532 14.011 1.00 0.00 H ATOM 1326 HG23 THR A 103 10.435 21.124 10.240 1.00 0.00 H ATOM 1327 HG21 THR A 103 8.851 21.726 10.788 1.00 0.00 H ATOM 1328 HG22 THR A 103 10.198 22.863 10.539 1.00 0.00 H ATOM 1329 H THR A 103 7.792 20.646 13.087 1.00 0.00 H ATOM 1330 N PRO A 104 10.507 18.925 14.847 1.00 28.88 N ATOM 1331 CA PRO A 104 10.846 18.779 16.257 1.00 27.84 C ATOM 1332 C PRO A 104 12.279 19.138 16.570 1.00 29.49 C ATOM 1333 O PRO A 104 13.118 19.051 15.689 1.00 30.67 O ATOM 1334 CB PRO A 104 10.661 17.284 16.497 1.00 27.08 C ATOM 1335 CG PRO A 104 10.844 16.697 15.171 1.00 24.07 C ATOM 1336 CD PRO A 104 10.222 17.602 14.239 1.00 20.63 C ATOM 1337 HA PRO A 104 10.236 19.438 16.875 1.00 0.00 H ATOM 1338 HD3 PRO A 104 10.669 17.518 13.248 1.00 0.00 H ATOM 1339 HD2 PRO A 104 9.149 17.422 14.169 1.00 0.00 H ATOM 1340 HG3 PRO A 104 10.367 15.718 15.122 1.00 0.00 H ATOM 1341 HG2 PRO A 104 11.906 16.594 14.947 1.00 0.00 H ATOM 1342 HB2 PRO A 104 11.407 16.907 17.196 1.00 0.00 H ATOM 1343 HB3 PRO A 104 9.664 17.072 16.882 1.00 0.00 H ATOM 1344 N THR A 105 12.541 19.504 17.830 1.00 27.03 N ATOM 1345 CA THR A 105 13.884 19.694 18.330 1.00 20.22 C ATOM 1346 C THR A 105 14.488 18.326 18.715 1.00 22.98 C ATOM 1347 O THR A 105 13.786 17.325 18.845 1.00 24.67 O ATOM 1348 CB THR A 105 13.885 20.630 19.563 1.00 26.23 C ATOM 1349 OG1 THR A 105 13.014 20.106 20.602 1.00 22.92 O ATOM 1350 CG2 THR A 105 13.441 22.046 19.150 1.00 25.88 C ATOM 1351 HA THR A 105 14.485 20.156 17.547 1.00 0.00 H ATOM 1352 HB THR A 105 14.898 20.682 19.962 1.00 0.00 H ATOM 1353 HG1 THR A 105 13.027 20.717 21.381 1.00 0.00 H ATOM 1354 HG23 THR A 105 14.105 22.421 18.371 1.00 0.00 H ATOM 1355 HG21 THR A 105 12.420 22.009 18.771 1.00 0.00 H ATOM 1356 HG22 THR A 105 13.485 22.706 20.016 1.00 0.00 H ATOM 1357 H THR A 105 11.743 19.659 18.479 1.00 0.00 H ATOM 1358 N THR A 106 15.789 18.297 18.929 1.00 16.14 N ATOM 1359 CA THR A 106 16.420 17.123 19.374 1.00 26.16 C ATOM 1360 C THR A 106 15.996 16.765 20.785 1.00 32.62 C ATOM 1361 O THR A 106 15.830 15.546 21.102 1.00 23.24 O ATOM 1362 CB THR A 106 17.899 17.277 19.250 1.00 30.21 C ATOM 1363 OG1 THR A 106 18.174 17.370 17.860 1.00 35.37 O ATOM 1364 CG2 THR A 106 18.615 16.031 19.775 1.00 36.34 C ATOM 1365 HA THR A 106 16.109 16.290 18.744 1.00 0.00 H ATOM 1366 HB THR A 106 18.235 18.147 19.814 1.00 0.00 H ATOM 1367 HG1 THR A 106 19.149 17.474 17.724 1.00 0.00 H ATOM 1368 HG23 THR A 106 18.425 15.928 20.843 1.00 0.00 H ATOM 1369 HG21 THR A 106 18.241 15.151 19.251 1.00 0.00 H ATOM 1370 HG22 THR A 106 19.687 16.130 19.603 1.00 0.00 H ATOM 1371 H THR A 106 16.355 19.154 18.766 1.00 0.00 H ATOM 1372 N ALA A 107 15.800 17.811 21.609 1.00 27.77 N ATOM 1373 CA ALA A 107 15.411 17.639 23.003 1.00 23.75 C ATOM 1374 C ALA A 107 14.052 17.045 23.007 1.00 31.06 C ATOM 1375 O ALA A 107 13.739 16.213 23.873 1.00 36.10 O ATOM 1376 CB ALA A 107 15.374 18.946 23.738 1.00 24.18 C ATOM 1377 HA ALA A 107 16.140 17.002 23.504 1.00 0.00 H ATOM 1378 HB1 ALA A 107 16.363 19.404 23.713 1.00 0.00 H ATOM 1379 HB2 ALA A 107 14.653 19.609 23.261 1.00 0.00 H ATOM 1380 HB3 ALA A 107 15.080 18.771 24.773 1.00 0.00 H ATOM 1381 H ALA A 107 15.930 18.774 21.239 1.00 0.00 H ATOM 1382 N ALA A 108 13.207 17.454 22.067 1.00 29.30 N ATOM 1383 CA ALA A 108 11.846 16.976 22.201 1.00 23.64 C ATOM 1384 C ALA A 108 11.780 15.545 21.708 1.00 27.65 C ATOM 1385 O ALA A 108 10.983 14.773 22.214 1.00 32.44 O ATOM 1386 CB ALA A 108 10.879 17.856 21.513 1.00 19.11 C ATOM 1387 HA ALA A 108 11.559 16.999 23.252 1.00 0.00 H ATOM 1388 HB1 ALA A 108 10.932 18.857 21.941 1.00 0.00 H ATOM 1389 HB2 ALA A 108 11.121 17.900 20.451 1.00 0.00 H ATOM 1390 HB3 ALA A 108 9.872 17.458 21.641 1.00 0.00 H ATOM 1391 H ALA A 108 13.503 18.076 21.287 1.00 0.00 H ATOM 1392 N MET A 109 12.640 15.164 20.772 1.00 25.52 N ATOM 1393 CA MET A 109 12.647 13.753 20.296 1.00 30.83 C ATOM 1394 C MET A 109 13.429 12.774 21.173 1.00 35.24 C ATOM 1395 O MET A 109 13.087 11.593 21.217 1.00 40.18 O ATOM 1396 CB MET A 109 13.180 13.621 18.868 1.00 24.99 C ATOM 1397 CG MET A 109 12.369 14.408 17.859 1.00 24.98 C ATOM 1398 SD MET A 109 10.759 13.674 17.620 1.00 31.59 S ATOM 1399 CE MET A 109 11.225 12.189 16.709 1.00 17.91 C ATOM 1400 HA MET A 109 11.593 13.480 20.346 1.00 0.00 H ATOM 1401 HB2 MET A 109 14.208 13.982 18.846 1.00 0.00 H ATOM 1402 HB3 MET A 109 13.160 12.568 18.585 1.00 0.00 H ATOM 1403 HG2 MET A 109 12.900 14.421 16.907 1.00 0.00 H ATOM 1404 HG3 MET A 109 12.246 15.429 18.219 1.00 0.00 H ATOM 1405 HE1 MET A 109 11.724 12.474 15.783 1.00 0.00 H ATOM 1406 HE2 MET A 109 11.901 11.588 17.318 1.00 0.00 H ATOM 1407 HE3 MET A 109 10.331 11.611 16.478 1.00 0.00 H ATOM 1408 H MET A 109 13.310 15.851 20.371 1.00 0.00 H ATOM 1409 N TYR A 110 14.464 13.267 21.858 1.00 33.74 N ATOM 1410 CA TYR A 110 15.254 12.460 22.781 1.00 27.84 C ATOM 1411 C TYR A 110 15.291 13.045 24.192 1.00 27.29 C ATOM 1412 O TYR A 110 16.364 13.283 24.708 1.00 24.50 O ATOM 1413 CB TYR A 110 16.697 12.235 22.234 1.00 29.90 C ATOM 1414 CG TYR A 110 16.664 11.546 20.899 1.00 29.03 C ATOM 1415 CD1 TYR A 110 16.319 10.189 20.813 1.00 38.64 C ATOM 1416 CD2 TYR A 110 16.894 12.237 19.729 1.00 29.01 C ATOM 1417 CE1 TYR A 110 16.197 9.521 19.575 1.00 32.15 C ATOM 1418 CE2 TYR A 110 16.786 11.588 18.469 1.00 38.69 C ATOM 1419 CZ TYR A 110 16.424 10.219 18.412 1.00 35.11 C ATOM 1420 OH TYR A 110 16.307 9.547 17.204 1.00 36.66 O ATOM 1421 HA TYR A 110 14.756 11.493 22.854 1.00 0.00 H ATOM 1422 HB3 TYR A 110 17.254 11.619 22.940 1.00 0.00 H ATOM 1423 HB2 TYR A 110 17.192 13.200 22.126 1.00 0.00 H ATOM 1424 HD2 TYR A 110 17.162 13.293 19.770 1.00 0.00 H ATOM 1425 HE2 TYR A 110 16.981 12.141 17.550 1.00 0.00 H ATOM 1426 HE1 TYR A 110 15.926 8.466 19.542 1.00 0.00 H ATOM 1427 HD1 TYR A 110 16.139 9.632 21.732 1.00 0.00 H ATOM 1428 HH TYR A 110 17.176 9.570 16.729 1.00 0.00 H ATOM 1429 H TYR A 110 14.717 14.267 21.728 1.00 0.00 H ATOM 1430 N PRO A 111 14.129 13.255 24.844 1.00 26.13 N ATOM 1431 CA PRO A 111 14.290 13.811 26.219 1.00 30.12 C ATOM 1432 C PRO A 111 15.194 12.977 27.145 1.00 33.70 C ATOM 1433 O PRO A 111 15.793 13.525 28.073 1.00 32.12 O ATOM 1434 CB PRO A 111 12.856 13.868 26.777 1.00 21.05 C ATOM 1435 CG PRO A 111 11.989 12.961 25.785 1.00 20.38 C ATOM 1436 CD PRO A 111 12.712 13.053 24.468 1.00 25.05 C ATOM 1437 HA PRO A 111 14.789 14.779 26.172 1.00 0.00 H ATOM 1438 HD3 PRO A 111 12.591 12.133 23.895 1.00 0.00 H ATOM 1439 HD2 PRO A 111 12.343 13.895 23.882 1.00 0.00 H ATOM 1440 HG3 PRO A 111 10.974 13.347 25.696 1.00 0.00 H ATOM 1441 HG2 PRO A 111 11.954 11.929 26.135 1.00 0.00 H ATOM 1442 HB2 PRO A 111 12.823 13.468 27.790 1.00 0.00 H ATOM 1443 HB3 PRO A 111 12.486 14.893 26.781 1.00 0.00 H ATOM 1444 N ASP A 112 15.308 11.672 26.847 1.00 37.74 N ATOM 1445 CA ASP A 112 15.975 10.701 27.708 1.00 29.27 C ATOM 1446 C ASP A 112 17.133 10.041 27.025 1.00 31.71 C ATOM 1447 O ASP A 112 17.652 9.030 27.531 1.00 22.75 O ATOM 1448 CB ASP A 112 14.997 9.624 28.128 1.00 26.84 C ATOM 1449 CG ASP A 112 13.953 10.136 29.089 1.00 29.99 C ATOM 1450 OD1 ASP A 112 14.266 10.260 30.274 1.00 39.43 O ATOM 1451 OD2 ASP A 112 12.824 10.442 28.675 1.00 33.80 O ATOM 1452 HA ASP A 112 16.347 11.249 28.574 1.00 0.00 H ATOM 1453 HB2 ASP A 112 14.496 9.240 27.239 1.00 0.00 H ATOM 1454 HB3 ASP A 112 15.550 8.817 28.609 1.00 0.00 H ATOM 1455 H ASP A 112 14.898 11.335 25.953 1.00 0.00 H ATOM 1456 N GLY A 113 17.532 10.580 25.872 1.00 30.10 N ATOM 1457 CA GLY A 113 18.689 10.032 25.152 1.00 31.06 C ATOM 1458 C GLY A 113 18.302 8.726 24.505 1.00 30.13 C ATOM 1459 O GLY A 113 17.134 8.516 24.208 1.00 38.25 O ATOM 1460 HA3 GLY A 113 19.507 9.863 25.852 1.00 0.00 H ATOM 1461 HA2 GLY A 113 19.008 10.738 24.385 1.00 0.00 H ATOM 1462 H GLY A 113 17.019 11.395 25.479 1.00 0.00 H ATOM 1463 N LEU A 114 19.268 7.864 24.238 1.00 30.12 N ATOM 1464 CA LEU A 114 18.942 6.569 23.665 1.00 32.94 C ATOM 1465 C LEU A 114 18.679 5.688 24.817 1.00 27.31 C ATOM 1466 O LEU A 114 19.610 5.361 25.562 1.00 24.39 O ATOM 1467 CB LEU A 114 20.111 5.944 22.910 1.00 36.95 C ATOM 1468 CG LEU A 114 20.481 6.763 21.709 1.00 39.51 C ATOM 1469 CD1 LEU A 114 21.482 5.959 20.900 1.00 36.79 C ATOM 1470 CD2 LEU A 114 19.181 6.956 20.966 1.00 44.13 C ATOM 1471 HA LEU A 114 18.112 6.688 22.969 1.00 0.00 H ATOM 1472 HB2 LEU A 114 20.971 5.880 23.576 1.00 0.00 H ATOM 1473 HB3 LEU A 114 19.830 4.942 22.585 1.00 0.00 H ATOM 1474 HG LEU A 114 20.937 7.727 21.937 1.00 0.00 H ATOM 1475 HD21 LEU A 114 18.776 5.983 20.686 1.00 0.00 H ATOM 1476 HD22 LEU A 114 18.470 7.475 21.609 1.00 0.00 H ATOM 1477 HD23 LEU A 114 19.361 7.548 20.069 1.00 0.00 H ATOM 1478 HD11 LEU A 114 22.362 5.757 21.510 1.00 0.00 H ATOM 1479 HD12 LEU A 114 21.027 5.017 20.594 1.00 0.00 H ATOM 1480 HD13 LEU A 114 21.773 6.527 20.017 1.00 0.00 H ATOM 1481 H LEU A 114 20.258 8.112 24.437 1.00 0.00 H ATOM 1482 N ARG A 115 17.419 5.328 24.969 1.00 18.41 N ATOM 1483 CA ARG A 115 17.036 4.452 25.998 1.00 21.39 C ATOM 1484 C ARG A 115 16.384 3.229 25.358 1.00 26.25 C ATOM 1485 O ARG A 115 17.103 2.287 24.990 1.00 30.98 O ATOM 1486 CB ARG A 115 16.163 5.179 27.006 1.00 22.64 C ATOM 1487 CG ARG A 115 16.115 4.416 28.355 1.00 28.84 C ATOM 1488 CD ARG A 115 15.338 5.111 29.452 1.00 21.98 C ATOM 1489 NE ARG A 115 14.013 5.563 29.055 1.00 22.47 N ATOM 1490 CZ ARG A 115 13.337 6.473 29.741 1.00 19.96 C ATOM 1491 NH1 ARG A 115 13.891 6.937 30.824 1.00 24.13 N ATOM 1492 NH2 ARG A 115 12.122 6.893 29.392 1.00 18.81 N ATOM 1493 HA ARG A 115 17.893 4.098 26.571 1.00 0.00 H ATOM 1494 HB2 ARG A 115 16.569 6.176 27.175 1.00 0.00 H ATOM 1495 HB3 ARG A 115 15.152 5.262 26.607 1.00 0.00 H ATOM 1496 HG2 ARG A 115 15.656 3.443 28.178 1.00 0.00 H ATOM 1497 HG3 ARG A 115 17.139 4.275 28.702 1.00 0.00 H ATOM 1498 HD2 ARG A 115 15.911 5.979 29.779 1.00 0.00 H ATOM 1499 HD3 ARG A 115 15.227 4.416 30.284 1.00 0.00 H ATOM 1500 HE ARG A 115 13.580 5.157 28.201 1.00 0.00 H ATOM 1501 HH12 ARG A 115 13.398 7.653 31.395 1.00 0.00 H ATOM 1502 HH11 ARG A 115 14.827 6.592 31.118 1.00 0.00 H ATOM 1503 HH22 ARG A 115 11.635 7.610 29.966 1.00 0.00 H ATOM 1504 HH21 ARG A 115 11.661 6.504 28.545 1.00 0.00 H ATOM 1505 H ARG A 115 16.698 5.698 24.317 1.00 0.00 H ATOM 1506 N THR A 116 15.060 3.228 25.207 1.00 21.39 N ATOM 1507 CA THR A 116 14.402 2.187 24.397 1.00 25.58 C ATOM 1508 C THR A 116 14.675 2.474 22.921 1.00 28.11 C ATOM 1509 O THR A 116 14.420 3.577 22.436 1.00 24.10 O ATOM 1510 CB THR A 116 12.819 2.117 24.607 1.00 21.35 C ATOM 1511 OG1 THR A 116 12.490 2.344 25.979 1.00 21.79 O ATOM 1512 CG2 THR A 116 12.286 0.720 24.217 1.00 22.25 C ATOM 1513 HA THR A 116 14.813 1.230 24.718 1.00 0.00 H ATOM 1514 HB THR A 116 12.366 2.883 23.978 1.00 0.00 H ATOM 1515 HG1 THR A 116 12.813 3.239 26.251 1.00 0.00 H ATOM 1516 HG23 THR A 116 12.524 0.520 23.172 1.00 0.00 H ATOM 1517 HG21 THR A 116 12.754 -0.035 24.848 1.00 0.00 H ATOM 1518 HG22 THR A 116 11.205 0.693 24.356 1.00 0.00 H ATOM 1519 H THR A 116 14.487 3.966 25.664 1.00 0.00 H ATOM 1520 N THR A 117 15.192 1.493 22.197 1.00 28.06 N ATOM 1521 CA THR A 117 15.419 1.698 20.760 1.00 27.25 C ATOM 1522 C THR A 117 14.864 0.500 19.931 1.00 29.07 C ATOM 1523 O THR A 117 14.431 -0.491 20.484 1.00 29.74 O ATOM 1524 CB THR A 117 16.924 1.931 20.500 1.00 25.78 C ATOM 1525 OG1 THR A 117 17.634 0.778 20.931 1.00 13.63 O ATOM 1526 CG2 THR A 117 17.413 3.101 21.328 1.00 20.00 C ATOM 1527 HA THR A 117 14.876 2.585 20.434 1.00 0.00 H ATOM 1528 HB THR A 117 17.082 2.128 19.440 1.00 0.00 H ATOM 1529 HG1 THR A 117 17.474 0.635 21.897 1.00 0.00 H ATOM 1530 HG23 THR A 117 16.887 4.006 21.023 1.00 0.00 H ATOM 1531 HG21 THR A 117 17.219 2.905 22.382 1.00 0.00 H ATOM 1532 HG22 THR A 117 18.484 3.232 21.173 1.00 0.00 H ATOM 1533 H THR A 117 15.435 0.585 22.642 1.00 0.00 H ATOM 1534 N VAL A 118 14.842 0.585 18.610 1.00 25.85 N ATOM 1535 CA VAL A 118 14.432 -0.567 17.860 1.00 21.06 C ATOM 1536 C VAL A 118 15.685 -1.308 17.443 1.00 19.28 C ATOM 1537 O VAL A 118 16.658 -0.692 17.017 1.00 26.85 O ATOM 1538 CB VAL A 118 13.610 -0.142 16.648 1.00 22.31 C ATOM 1539 CG1 VAL A 118 13.255 -1.298 15.824 1.00 23.94 C ATOM 1540 CG2 VAL A 118 12.363 0.467 17.106 1.00 27.70 C ATOM 1541 HA VAL A 118 13.800 -1.219 18.463 1.00 0.00 H ATOM 1542 HB VAL A 118 14.207 0.557 16.063 1.00 0.00 H ATOM 1543 HG11 VAL A 118 14.165 -1.788 15.476 1.00 0.00 H ATOM 1544 HG12 VAL A 118 12.668 -1.999 16.417 1.00 0.00 H ATOM 1545 HG13 VAL A 118 12.669 -0.966 14.967 1.00 0.00 H ATOM 1546 HG21 VAL A 118 11.801 -0.258 17.695 1.00 0.00 H ATOM 1547 HG22 VAL A 118 12.590 1.339 17.720 1.00 0.00 H ATOM 1548 HG23 VAL A 118 11.771 0.773 16.243 1.00 0.00 H ATOM 1549 H VAL A 118 15.115 1.465 18.128 1.00 0.00 H ATOM 1550 N GLN A 119 15.684 -2.631 17.556 1.00 20.92 N ATOM 1551 CA GLN A 119 16.760 -3.393 16.942 1.00 22.70 C ATOM 1552 C GLN A 119 16.333 -4.074 15.633 1.00 20.82 C ATOM 1553 O GLN A 119 15.480 -4.955 15.670 1.00 28.59 O ATOM 1554 CB GLN A 119 17.271 -4.467 17.871 1.00 23.33 C ATOM 1555 CG GLN A 119 18.305 -5.299 17.112 1.00 30.07 C ATOM 1556 CD GLN A 119 19.296 -5.846 18.030 1.00 45.27 C ATOM 1557 OE1 GLN A 119 19.161 -7.004 18.520 1.00 44.17 O ATOM 1558 NE2 GLN A 119 20.295 -5.001 18.365 1.00 45.15 N ATOM 1559 HA GLN A 119 17.543 -2.665 16.728 1.00 0.00 H ATOM 1560 HB2 GLN A 119 17.734 -4.010 18.746 1.00 0.00 H ATOM 1561 HB3 GLN A 119 16.446 -5.104 18.190 1.00 0.00 H ATOM 1562 HG2 GLN A 119 17.800 -6.118 16.600 1.00 0.00 H ATOM 1563 HG3 GLN A 119 18.806 -4.667 16.379 1.00 0.00 H ATOM 1564 HE22 GLN A 119 20.350 -4.060 17.925 1.00 0.00 H ATOM 1565 HE21 GLN A 119 21.009 -5.291 19.063 1.00 0.00 H ATOM 1566 H GLN A 119 14.925 -3.115 18.076 1.00 0.00 H ATOM 1567 N PRO A 120 16.907 -3.663 14.483 1.00 19.62 N ATOM 1568 CA PRO A 120 16.472 -4.212 13.194 1.00 25.75 C ATOM 1569 C PRO A 120 16.784 -5.673 13.175 1.00 28.59 C ATOM 1570 O PRO A 120 17.524 -6.114 14.031 1.00 32.01 O ATOM 1571 CB PRO A 120 17.397 -3.514 12.174 1.00 20.24 C ATOM 1572 CG PRO A 120 17.779 -2.247 12.867 1.00 23.94 C ATOM 1573 CD PRO A 120 17.951 -2.644 14.307 1.00 21.32 C ATOM 1574 HA PRO A 120 15.410 -4.066 12.997 1.00 0.00 H ATOM 1575 HD3 PRO A 120 18.942 -3.060 14.485 1.00 0.00 H ATOM 1576 HD2 PRO A 120 17.790 -1.795 14.972 1.00 0.00 H ATOM 1577 HG3 PRO A 120 16.993 -1.499 12.764 1.00 0.00 H ATOM 1578 HG2 PRO A 120 18.710 -1.851 12.462 1.00 0.00 H ATOM 1579 HB2 PRO A 120 18.275 -4.124 11.962 1.00 0.00 H ATOM 1580 HB3 PRO A 120 16.867 -3.306 11.244 1.00 0.00 H ATOM 1581 N GLY A 121 16.257 -6.384 12.180 1.00 24.71 N ATOM 1582 CA GLY A 121 16.655 -7.723 11.852 1.00 27.12 C ATOM 1583 C GLY A 121 18.044 -7.748 11.202 1.00 31.14 C ATOM 1584 O GLY A 121 18.609 -6.692 10.865 1.00 26.72 O ATOM 1585 HA3 GLY A 121 15.930 -8.149 11.158 1.00 0.00 H ATOM 1586 HA2 GLY A 121 16.678 -8.320 12.764 1.00 0.00 H ATOM 1587 H GLY A 121 15.511 -5.942 11.606 1.00 0.00 H ATOM 1588 N PRO A 122 18.623 -8.956 11.062 1.00 29.71 N ATOM 1589 CA PRO A 122 19.943 -9.193 10.432 1.00 28.72 C ATOM 1590 C PRO A 122 20.164 -8.465 9.069 1.00 28.27 C ATOM 1591 O PRO A 122 21.312 -8.107 8.749 1.00 27.29 O ATOM 1592 CB PRO A 122 20.002 -10.702 10.271 1.00 24.55 C ATOM 1593 CG PRO A 122 18.576 -11.234 10.628 1.00 29.39 C ATOM 1594 CD PRO A 122 18.007 -10.200 11.552 1.00 32.73 C ATOM 1595 HA PRO A 122 20.739 -8.782 11.053 1.00 0.00 H ATOM 1596 HD3 PRO A 122 16.921 -10.158 11.475 1.00 0.00 H ATOM 1597 HD2 PRO A 122 18.289 -10.398 12.586 1.00 0.00 H ATOM 1598 HG3 PRO A 122 18.639 -12.202 11.125 1.00 0.00 H ATOM 1599 HG2 PRO A 122 17.964 -11.327 9.731 1.00 0.00 H ATOM 1600 HB2 PRO A 122 20.257 -10.963 9.244 1.00 0.00 H ATOM 1601 HB3 PRO A 122 20.744 -11.126 10.947 1.00 0.00 H ATOM 1602 N LEU A 123 19.100 -8.152 8.327 1.00 24.19 N ATOM 1603 CA LEU A 123 19.298 -7.355 7.089 1.00 32.71 C ATOM 1604 C LEU A 123 20.034 -6.012 7.337 1.00 37.12 C ATOM 1605 O LEU A 123 20.717 -5.503 6.444 1.00 38.89 O ATOM 1606 CB LEU A 123 17.970 -7.160 6.284 1.00 32.33 C ATOM 1607 CG LEU A 123 17.986 -6.054 5.197 1.00 32.92 C ATOM 1608 CD1 LEU A 123 19.119 -6.239 4.147 1.00 36.45 C ATOM 1609 CD2 LEU A 123 16.642 -5.788 4.509 1.00 27.03 C ATOM 1610 HA LEU A 123 19.962 -7.949 6.462 1.00 0.00 H ATOM 1611 HB2 LEU A 123 17.736 -8.105 5.794 1.00 0.00 H ATOM 1612 HB3 LEU A 123 17.182 -6.916 6.996 1.00 0.00 H ATOM 1613 HG LEU A 123 18.203 -5.155 5.774 1.00 0.00 H ATOM 1614 HD21 LEU A 123 16.300 -6.699 4.018 1.00 0.00 H ATOM 1615 HD22 LEU A 123 15.909 -5.478 5.254 1.00 0.00 H ATOM 1616 HD23 LEU A 123 16.765 -4.998 3.768 1.00 0.00 H ATOM 1617 HD11 LEU A 123 20.086 -6.219 4.650 1.00 0.00 H ATOM 1618 HD12 LEU A 123 18.991 -7.196 3.641 1.00 0.00 H ATOM 1619 HD13 LEU A 123 19.072 -5.431 3.417 1.00 0.00 H ATOM 1620 H LEU A 123 18.148 -8.461 8.611 1.00 0.00 H ATOM 1621 N ALA A 124 19.902 -5.447 8.542 1.00 36.69 N ATOM 1622 CA ALA A 124 20.504 -4.147 8.856 1.00 36.68 C ATOM 1623 C ALA A 124 22.036 -4.156 8.952 1.00 38.04 C ATOM 1624 O ALA A 124 22.657 -3.100 9.028 1.00 35.83 O ATOM 1625 CB ALA A 124 19.936 -3.642 10.141 1.00 36.53 C ATOM 1626 HA ALA A 124 20.260 -3.493 8.019 1.00 0.00 H ATOM 1627 HB1 ALA A 124 18.856 -3.532 10.041 1.00 0.00 H ATOM 1628 HB2 ALA A 124 20.158 -4.351 10.938 1.00 0.00 H ATOM 1629 HB3 ALA A 124 20.381 -2.676 10.378 1.00 0.00 H ATOM 1630 H ALA A 124 19.358 -5.943 9.276 1.00 0.00 H ATOM 1631 N ALA A 125 22.641 -5.340 9.025 1.00 39.33 N ATOM 1632 CA ALA A 125 24.100 -5.440 9.142 1.00 35.38 C ATOM 1633 C ALA A 125 24.762 -5.621 7.753 1.00 40.01 C ATOM 1634 O ALA A 125 26.011 -5.648 7.612 1.00 42.68 O ATOM 1635 CB ALA A 125 24.446 -6.540 10.058 1.00 27.64 C ATOM 1636 HA ALA A 125 24.489 -4.510 9.556 1.00 0.00 H ATOM 1637 HB1 ALA A 125 24.015 -6.343 11.040 1.00 0.00 H ATOM 1638 HB2 ALA A 125 24.048 -7.476 9.666 1.00 0.00 H ATOM 1639 HB3 ALA A 125 25.530 -6.613 10.143 1.00 0.00 H ATOM 1640 H ALA A 125 22.070 -6.209 8.999 1.00 0.00 H ATOM 1641 N GLU A 126 23.917 -5.666 6.719 1.00 32.74 N ATOM 1642 CA GLU A 126 24.410 -5.871 5.407 1.00 27.50 C ATOM 1643 C GLU A 126 24.338 -4.624 4.617 1.00 33.88 C ATOM 1644 O GLU A 126 23.707 -3.641 5.008 1.00 36.19 O ATOM 1645 CB GLU A 126 23.645 -6.954 4.710 1.00 28.61 C ATOM 1646 CG GLU A 126 23.971 -8.386 5.180 1.00 27.98 C ATOM 1647 CD GLU A 126 22.888 -9.351 4.806 1.00 32.11 C ATOM 1648 OE1 GLU A 126 22.038 -8.986 3.980 1.00 36.75 O ATOM 1649 OE2 GLU A 126 22.833 -10.468 5.351 1.00 43.09 O ATOM 1650 HA GLU A 126 25.453 -6.176 5.492 1.00 0.00 H ATOM 1651 HB2 GLU A 126 22.582 -6.777 4.874 1.00 0.00 H ATOM 1652 HB3 GLU A 126 23.862 -6.890 3.644 1.00 0.00 H ATOM 1653 HG2 GLU A 126 24.905 -8.706 4.718 1.00 0.00 H ATOM 1654 HG3 GLU A 126 24.085 -8.385 6.264 1.00 0.00 H ATOM 1655 H GLU A 126 22.896 -5.550 6.878 1.00 0.00 H ATOM 1656 N LEU A 127 25.032 -4.665 3.491 1.00 32.88 N ATOM 1657 CA LEU A 127 25.024 -3.594 2.536 1.00 31.62 C ATOM 1658 C LEU A 127 25.420 -2.257 3.104 1.00 31.91 C ATOM 1659 O LEU A 127 26.592 -2.002 3.328 1.00 31.10 O ATOM 1660 CB LEU A 127 23.703 -3.553 1.798 1.00 34.62 C ATOM 1661 CG LEU A 127 23.572 -4.892 1.046 1.00 43.24 C ATOM 1662 CD1 LEU A 127 22.097 -5.162 0.684 1.00 44.83 C ATOM 1663 CD2 LEU A 127 24.489 -4.980 -0.214 1.00 42.12 C ATOM 1664 HA LEU A 127 25.810 -3.814 1.814 1.00 0.00 H ATOM 1665 HB2 LEU A 127 22.881 -3.437 2.505 1.00 0.00 H ATOM 1666 HB3 LEU A 127 23.693 -2.723 1.092 1.00 0.00 H ATOM 1667 HG LEU A 127 23.919 -5.672 1.724 1.00 0.00 H ATOM 1668 HD21 LEU A 127 24.226 -4.183 -0.910 1.00 0.00 H ATOM 1669 HD22 LEU A 127 25.531 -4.871 0.088 1.00 0.00 H ATOM 1670 HD23 LEU A 127 24.349 -5.947 -0.697 1.00 0.00 H ATOM 1671 HD11 LEU A 127 21.503 -5.207 1.597 1.00 0.00 H ATOM 1672 HD12 LEU A 127 21.728 -4.358 0.047 1.00 0.00 H ATOM 1673 HD13 LEU A 127 22.022 -6.111 0.154 1.00 0.00 H ATOM 1674 H LEU A 127 25.607 -5.508 3.290 1.00 0.00 H ATOM 1675 N GLU A 128 24.451 -1.376 3.285 1.00 38.80 N ATOM 1676 CA GLU A 128 24.731 -0.084 3.875 1.00 32.97 C ATOM 1677 C GLU A 128 25.033 -0.221 5.372 1.00 39.36 C ATOM 1678 O GLU A 128 25.669 0.663 5.951 1.00 39.51 O ATOM 1679 CB GLU A 128 23.519 0.785 3.716 1.00 31.58 C ATOM 1680 CG GLU A 128 23.277 1.182 2.365 1.00 25.28 C ATOM 1681 CD GLU A 128 24.452 1.917 1.840 1.00 43.72 C ATOM 1682 OE1 GLU A 128 24.637 3.101 2.298 1.00 39.49 O ATOM 1683 OE2 GLU A 128 25.190 1.301 0.997 1.00 41.69 O ATOM 1684 HA GLU A 128 25.598 0.350 3.376 1.00 0.00 H ATOM 1685 HB2 GLU A 128 22.650 0.235 4.075 1.00 0.00 H ATOM 1686 HB3 GLU A 128 23.655 1.682 4.321 1.00 0.00 H ATOM 1687 HG2 GLU A 128 23.100 0.297 1.754 1.00 0.00 H ATOM 1688 HG3 GLU A 128 22.400 1.828 2.329 1.00 0.00 H ATOM 1689 H GLU A 128 23.479 -1.613 3.001 1.00 0.00 H ATOM 1690 N GLY A 129 24.556 -1.308 5.992 1.00 35.33 N ATOM 1691 CA GLY A 129 24.800 -1.549 7.398 1.00 39.99 C ATOM 1692 C GLY A 129 26.103 -2.284 7.696 1.00 42.86 C ATOM 1693 O GLY A 129 26.440 -2.594 8.862 1.00 38.40 O ATOM 1694 HA3 GLY A 129 23.975 -2.144 7.790 1.00 0.00 H ATOM 1695 HA2 GLY A 129 24.827 -0.587 7.909 1.00 0.00 H ATOM 1696 H GLY A 129 23.996 -1.996 5.449 1.00 0.00 H ATOM 1697 N GLY A 130 26.847 -2.574 6.642 1.00 45.93 N ATOM 1698 CA GLY A 130 28.098 -3.324 6.786 1.00 47.99 C ATOM 1699 C GLY A 130 29.185 -2.521 7.482 1.00 42.01 C ATOM 1700 O GLY A 130 29.729 -2.993 8.457 1.00 39.13 O ATOM 1701 HA3 GLY A 130 28.452 -3.606 5.794 1.00 0.00 H ATOM 1702 HA2 GLY A 130 27.901 -4.224 7.369 1.00 0.00 H ATOM 1703 H GLY A 130 26.540 -2.266 5.697 1.00 0.00 H ATOM 1704 N PRO A 131 29.532 -1.331 6.948 1.00 46.50 N ATOM 1705 CA PRO A 131 30.416 -0.366 7.644 1.00 49.05 C ATOM 1706 C PRO A 131 29.813 0.309 8.871 1.00 54.14 C ATOM 1707 O PRO A 131 30.538 0.555 9.833 1.00 58.03 O ATOM 1708 CB PRO A 131 30.715 0.706 6.588 1.00 43.40 C ATOM 1709 CG PRO A 131 29.676 0.559 5.517 1.00 47.94 C ATOM 1710 CD PRO A 131 29.178 -0.883 5.583 1.00 49.02 C ATOM 1711 HA PRO A 131 31.285 -0.900 8.029 1.00 0.00 H ATOM 1712 HD3 PRO A 131 28.100 -0.927 5.430 1.00 0.00 H ATOM 1713 HD2 PRO A 131 29.676 -1.498 4.833 1.00 0.00 H ATOM 1714 HG3 PRO A 131 30.113 0.761 4.539 1.00 0.00 H ATOM 1715 HG2 PRO A 131 28.852 1.250 5.695 1.00 0.00 H ATOM 1716 HB2 PRO A 131 30.657 1.699 7.034 1.00 0.00 H ATOM 1717 HB3 PRO A 131 31.710 0.554 6.170 1.00 0.00 H ATOM 1718 N ARG A 132 28.510 0.589 8.836 1.00 56.80 N ATOM 1719 CA ARG A 132 27.843 1.492 9.775 1.00 48.09 C ATOM 1720 C ARG A 132 26.722 0.690 10.476 1.00 48.72 C ATOM 1721 O ARG A 132 25.530 0.889 10.190 1.00 47.43 O ATOM 1722 CB ARG A 132 27.284 2.680 8.984 1.00 40.54 C ATOM 1723 HA ARG A 132 28.524 1.880 10.532 1.00 0.00 H ATOM 1724 HB2 ARG A 132 28.102 3.198 8.483 1.00 0.00 H ATOM 1725 HB3 ARG A 132 26.572 2.318 8.242 1.00 0.00 H ATOM 1726 H ARG A 132 27.933 0.139 8.097 1.00 0.00 H ATOM 1727 N PRO A 133 27.086 -0.206 11.422 1.00 44.76 N ATOM 1728 CA PRO A 133 26.093 -1.228 11.916 1.00 44.98 C ATOM 1729 C PRO A 133 25.005 -0.816 12.964 1.00 42.63 C ATOM 1730 O PRO A 133 24.247 -1.673 13.447 1.00 36.91 O ATOM 1731 CB PRO A 133 26.976 -2.380 12.450 1.00 43.43 C ATOM 1732 CG PRO A 133 28.406 -1.760 12.571 1.00 47.97 C ATOM 1733 CD PRO A 133 28.377 -0.306 12.120 1.00 38.25 C ATOM 1734 HA PRO A 133 25.440 -1.467 11.077 1.00 0.00 H ATOM 1735 HD3 PRO A 133 28.416 0.371 12.974 1.00 0.00 H ATOM 1736 HD2 PRO A 133 29.206 -0.087 11.447 1.00 0.00 H ATOM 1737 HG3 PRO A 133 29.098 -2.320 11.943 1.00 0.00 H ATOM 1738 HG2 PRO A 133 28.736 -1.811 13.608 1.00 0.00 H ATOM 1739 HB2 PRO A 133 26.620 -2.719 13.423 1.00 0.00 H ATOM 1740 HB3 PRO A 133 26.978 -3.218 11.753 1.00 0.00 H ATOM 1741 N THR A 134 24.881 0.466 13.286 1.00 37.40 N ATOM 1742 CA THR A 134 23.788 0.887 14.168 1.00 35.07 C ATOM 1743 C THR A 134 22.893 1.891 13.424 1.00 34.57 C ATOM 1744 O THR A 134 21.839 2.296 13.911 1.00 36.77 O ATOM 1745 CB THR A 134 24.332 1.466 15.505 1.00 40.62 C ATOM 1746 OG1 THR A 134 25.333 2.470 15.210 1.00 40.66 O ATOM 1747 CG2 THR A 134 24.916 0.322 16.483 1.00 30.05 C ATOM 1748 HA THR A 134 23.185 0.019 14.434 1.00 0.00 H ATOM 1749 HB THR A 134 23.503 1.923 16.045 1.00 0.00 H ATOM 1750 HG1 THR A 134 25.684 2.843 16.057 1.00 0.00 H ATOM 1751 HG23 THR A 134 24.138 -0.415 16.683 1.00 0.00 H ATOM 1752 HG21 THR A 134 25.765 -0.165 16.004 1.00 0.00 H ATOM 1753 HG22 THR A 134 25.238 0.776 17.420 1.00 0.00 H ATOM 1754 H THR A 134 25.554 1.167 12.915 1.00 0.00 H ATOM 1755 N HIS A 135 23.316 2.244 12.216 1.00 30.47 N ATOM 1756 CA HIS A 135 22.614 3.200 11.387 1.00 33.20 C ATOM 1757 C HIS A 135 21.143 2.826 11.195 1.00 35.71 C ATOM 1758 O HIS A 135 20.265 3.672 11.323 1.00 35.18 O ATOM 1759 CB HIS A 135 23.311 3.346 10.025 1.00 36.27 C ATOM 1760 CG HIS A 135 22.500 4.103 9.019 1.00 28.88 C ATOM 1761 ND1 HIS A 135 22.524 5.479 8.931 1.00 29.30 N ATOM 1762 CD2 HIS A 135 21.610 3.677 8.094 1.00 26.68 C ATOM 1763 CE1 HIS A 135 21.678 5.865 7.990 1.00 29.49 C ATOM 1764 NE2 HIS A 135 21.103 4.788 7.479 1.00 30.68 N ATOM 1765 HA HIS A 135 22.641 4.158 11.906 1.00 0.00 H ATOM 1766 HB2 HIS A 135 24.254 3.871 10.174 1.00 0.00 H ATOM 1767 HB3 HIS A 135 23.510 2.350 9.630 1.00 0.00 H ATOM 1768 HD2 HIS A 135 21.346 2.641 7.879 1.00 0.00 H ATOM 1769 HE1 HIS A 135 21.487 6.895 7.687 1.00 0.00 H ATOM 1770 H HIS A 135 24.190 1.815 11.850 1.00 0.00 H ATOM 1771 N PHE A 136 20.850 1.565 10.888 1.00 31.80 N ATOM 1772 CA PHE A 136 19.435 1.231 10.729 1.00 26.28 C ATOM 1773 C PHE A 136 18.643 1.228 12.023 1.00 26.53 C ATOM 1774 O PHE A 136 17.421 1.527 12.021 1.00 26.26 O ATOM 1775 CB PHE A 136 19.228 0.002 9.857 1.00 23.43 C ATOM 1776 CG PHE A 136 19.427 0.315 8.400 1.00 34.09 C ATOM 1777 CD1 PHE A 136 18.702 1.351 7.802 1.00 29.87 C ATOM 1778 CD2 PHE A 136 20.377 -0.355 7.635 1.00 35.32 C ATOM 1779 CE1 PHE A 136 18.878 1.657 6.468 1.00 33.74 C ATOM 1780 CE2 PHE A 136 20.574 -0.023 6.279 1.00 28.41 C ATOM 1781 CZ PHE A 136 19.820 0.957 5.706 1.00 29.77 C ATOM 1782 HA PHE A 136 18.994 2.060 10.175 1.00 0.00 H ATOM 1783 HB2 PHE A 136 19.941 -0.767 10.154 1.00 0.00 H ATOM 1784 HB3 PHE A 136 18.214 -0.369 10.004 1.00 0.00 H ATOM 1785 HD2 PHE A 136 20.975 -1.145 8.089 1.00 0.00 H ATOM 1786 HE2 PHE A 136 21.327 -0.548 5.691 1.00 0.00 H ATOM 1787 HZ PHE A 136 19.951 1.196 4.651 1.00 0.00 H ATOM 1788 HE1 PHE A 136 18.282 2.445 6.007 1.00 0.00 H ATOM 1789 HD1 PHE A 136 17.990 1.923 8.397 1.00 0.00 H ATOM 1790 H PHE A 136 21.594 0.849 10.766 1.00 0.00 H ATOM 1791 N ALA A 137 19.322 0.943 13.134 1.00 13.30 N ATOM 1792 CA ALA A 137 18.648 1.036 14.433 1.00 18.07 C ATOM 1793 C ALA A 137 18.218 2.495 14.645 1.00 17.87 C ATOM 1794 O ALA A 137 17.051 2.764 14.920 1.00 23.91 O ATOM 1795 CB ALA A 137 19.542 0.579 15.528 1.00 16.20 C ATOM 1796 HA ALA A 137 17.772 0.387 14.445 1.00 0.00 H ATOM 1797 HB1 ALA A 137 19.827 -0.459 15.354 1.00 0.00 H ATOM 1798 HB2 ALA A 137 20.435 1.203 15.551 1.00 0.00 H ATOM 1799 HB3 ALA A 137 19.018 0.658 16.480 1.00 0.00 H ATOM 1800 H ALA A 137 20.321 0.657 13.080 1.00 0.00 H ATOM 1801 N GLY A 138 19.160 3.418 14.441 1.00 17.29 N ATOM 1802 CA GLY A 138 18.898 4.841 14.464 1.00 14.93 C ATOM 1803 C GLY A 138 17.723 5.192 13.611 1.00 21.57 C ATOM 1804 O GLY A 138 16.785 5.803 14.093 1.00 31.53 O ATOM 1805 HA3 GLY A 138 19.776 5.370 14.094 1.00 0.00 H ATOM 1806 HA2 GLY A 138 18.696 5.148 15.490 1.00 0.00 H ATOM 1807 H GLY A 138 20.132 3.098 14.256 1.00 0.00 H ATOM 1808 N VAL A 139 17.744 4.751 12.356 1.00 22.35 N ATOM 1809 CA VAL A 139 16.704 5.107 11.400 1.00 25.44 C ATOM 1810 C VAL A 139 15.272 4.595 11.786 1.00 25.42 C ATOM 1811 O VAL A 139 14.298 5.370 11.871 1.00 22.22 O ATOM 1812 CB VAL A 139 17.148 4.600 10.012 1.00 28.23 C ATOM 1813 CG1 VAL A 139 16.003 4.585 9.020 1.00 21.20 C ATOM 1814 CG2 VAL A 139 18.264 5.487 9.497 1.00 24.25 C ATOM 1815 HA VAL A 139 16.597 6.192 11.397 1.00 0.00 H ATOM 1816 HB VAL A 139 17.497 3.573 10.120 1.00 0.00 H ATOM 1817 HG11 VAL A 139 15.215 3.928 9.387 1.00 0.00 H ATOM 1818 HG12 VAL A 139 15.611 5.595 8.904 1.00 0.00 H ATOM 1819 HG13 VAL A 139 16.363 4.221 8.057 1.00 0.00 H ATOM 1820 HG21 VAL A 139 17.904 6.513 9.417 1.00 0.00 H ATOM 1821 HG22 VAL A 139 19.105 5.449 10.189 1.00 0.00 H ATOM 1822 HG23 VAL A 139 18.583 5.135 8.516 1.00 0.00 H ATOM 1823 H VAL A 139 18.524 4.135 12.049 1.00 0.00 H ATOM 1824 N LEU A 140 15.164 3.295 12.037 1.00 23.28 N ATOM 1825 CA LEU A 140 13.897 2.660 12.420 1.00 19.01 C ATOM 1826 C LEU A 140 13.296 3.206 13.740 1.00 20.23 C ATOM 1827 O LEU A 140 12.043 3.224 13.942 1.00 16.55 O ATOM 1828 CB LEU A 140 14.081 1.132 12.578 1.00 13.58 C ATOM 1829 CG LEU A 140 14.484 0.166 11.459 1.00 18.90 C ATOM 1830 CD1 LEU A 140 13.885 -1.307 11.612 1.00 15.48 C ATOM 1831 CD2 LEU A 140 14.050 0.759 10.200 1.00 19.13 C ATOM 1832 HA LEU A 140 13.204 2.896 11.612 1.00 0.00 H ATOM 1833 HB2 LEU A 140 14.840 1.011 13.351 1.00 0.00 H ATOM 1834 HB3 LEU A 140 13.125 0.763 12.948 1.00 0.00 H ATOM 1835 HG LEU A 140 15.565 0.033 11.502 1.00 0.00 H ATOM 1836 HD21 LEU A 140 12.969 0.896 10.218 1.00 0.00 H ATOM 1837 HD22 LEU A 140 14.538 1.725 10.068 1.00 0.00 H ATOM 1838 HD23 LEU A 140 14.320 0.098 9.376 1.00 0.00 H ATOM 1839 HD11 LEU A 140 14.231 -1.743 12.549 1.00 0.00 H ATOM 1840 HD12 LEU A 140 12.796 -1.257 11.613 1.00 0.00 H ATOM 1841 HD13 LEU A 140 14.221 -1.923 10.778 1.00 0.00 H ATOM 1842 H LEU A 140 16.014 2.701 11.959 1.00 0.00 H ATOM 1843 N THR A 141 14.183 3.577 14.659 1.00 16.54 N ATOM 1844 CA THR A 141 13.758 4.119 15.967 1.00 21.31 C ATOM 1845 C THR A 141 13.009 5.470 15.694 1.00 22.86 C ATOM 1846 O THR A 141 11.875 5.673 16.147 1.00 19.96 O ATOM 1847 CB THR A 141 14.998 4.324 16.934 1.00 18.14 C ATOM 1848 OG1 THR A 141 15.538 3.053 17.369 1.00 12.50 O ATOM 1849 CG2 THR A 141 14.562 5.086 18.111 1.00 13.73 C ATOM 1850 HA THR A 141 13.093 3.418 16.472 1.00 0.00 H ATOM 1851 HB THR A 141 15.776 4.862 16.392 1.00 0.00 H ATOM 1852 HG1 THR A 141 15.835 2.534 16.580 1.00 0.00 H ATOM 1853 HG23 THR A 141 14.154 6.045 17.791 1.00 0.00 H ATOM 1854 HG21 THR A 141 13.795 4.523 18.643 1.00 0.00 H ATOM 1855 HG22 THR A 141 15.414 5.254 18.770 1.00 0.00 H ATOM 1856 H THR A 141 15.198 3.484 14.453 1.00 0.00 H ATOM 1857 N VAL A 142 13.608 6.355 14.884 1.00 17.92 N ATOM 1858 CA VAL A 142 12.988 7.625 14.645 1.00 20.43 C ATOM 1859 C VAL A 142 11.719 7.435 13.800 1.00 21.15 C ATOM 1860 O VAL A 142 10.686 8.107 14.016 1.00 24.29 O ATOM 1861 CB VAL A 142 14.025 8.656 14.130 1.00 29.31 C ATOM 1862 CG1 VAL A 142 14.153 8.615 12.642 1.00 29.15 C ATOM 1863 CG2 VAL A 142 13.655 10.071 14.587 1.00 35.92 C ATOM 1864 HA VAL A 142 12.631 8.072 15.573 1.00 0.00 H ATOM 1865 HB VAL A 142 14.990 8.386 14.558 1.00 0.00 H ATOM 1866 HG11 VAL A 142 14.475 7.620 12.334 1.00 0.00 H ATOM 1867 HG12 VAL A 142 13.188 8.843 12.189 1.00 0.00 H ATOM 1868 HG13 VAL A 142 14.889 9.352 12.321 1.00 0.00 H ATOM 1869 HG21 VAL A 142 12.672 10.333 14.195 1.00 0.00 H ATOM 1870 HG22 VAL A 142 13.634 10.106 15.676 1.00 0.00 H ATOM 1871 HG23 VAL A 142 14.397 10.777 14.214 1.00 0.00 H ATOM 1872 H VAL A 142 14.515 6.122 14.433 1.00 0.00 H ATOM 1873 N VAL A 143 11.729 6.450 12.905 1.00 19.35 N ATOM 1874 CA VAL A 143 10.555 6.264 12.096 1.00 15.10 C ATOM 1875 C VAL A 143 9.418 5.705 12.923 1.00 17.72 C ATOM 1876 O VAL A 143 8.218 5.968 12.690 1.00 24.76 O ATOM 1877 CB VAL A 143 10.860 5.493 10.820 1.00 17.40 C ATOM 1878 CG1 VAL A 143 9.541 5.082 10.016 1.00 17.50 C ATOM 1879 CG2 VAL A 143 11.682 6.369 9.945 1.00 18.62 C ATOM 1880 HA VAL A 143 10.210 7.236 11.744 1.00 0.00 H ATOM 1881 HB VAL A 143 11.377 4.574 11.097 1.00 0.00 H ATOM 1882 HG11 VAL A 143 8.915 4.451 10.646 1.00 0.00 H ATOM 1883 HG12 VAL A 143 8.991 5.981 9.739 1.00 0.00 H ATOM 1884 HG13 VAL A 143 9.821 4.535 9.116 1.00 0.00 H ATOM 1885 HG21 VAL A 143 11.124 7.277 9.715 1.00 0.00 H ATOM 1886 HG22 VAL A 143 12.607 6.630 10.460 1.00 0.00 H ATOM 1887 HG23 VAL A 143 11.916 5.841 9.021 1.00 0.00 H ATOM 1888 H VAL A 143 12.560 5.834 12.794 1.00 0.00 H ATOM 1889 N LEU A 144 9.774 4.918 13.918 1.00 26.59 N ATOM 1890 CA LEU A 144 8.730 4.448 14.807 1.00 27.75 C ATOM 1891 C LEU A 144 8.143 5.613 15.599 1.00 23.52 C ATOM 1892 O LEU A 144 6.955 5.764 15.646 1.00 24.77 O ATOM 1893 CB LEU A 144 9.261 3.404 15.737 1.00 26.02 C ATOM 1894 CG LEU A 144 8.187 2.915 16.685 1.00 22.99 C ATOM 1895 CD1 LEU A 144 7.034 2.423 15.887 1.00 27.44 C ATOM 1896 CD2 LEU A 144 8.816 1.823 17.435 1.00 21.84 C ATOM 1897 HA LEU A 144 7.940 4.002 14.203 1.00 0.00 H ATOM 1898 HB2 LEU A 144 9.629 2.561 15.152 1.00 0.00 H ATOM 1899 HB3 LEU A 144 10.081 3.828 16.317 1.00 0.00 H ATOM 1900 HG LEU A 144 7.814 3.689 17.356 1.00 0.00 H ATOM 1901 HD21 LEU A 144 9.130 1.042 16.743 1.00 0.00 H ATOM 1902 HD22 LEU A 144 9.685 2.205 17.971 1.00 0.00 H ATOM 1903 HD23 LEU A 144 8.100 1.413 18.147 1.00 0.00 H ATOM 1904 HD11 LEU A 144 6.645 3.236 15.274 1.00 0.00 H ATOM 1905 HD12 LEU A 144 7.361 1.606 15.244 1.00 0.00 H ATOM 1906 HD13 LEU A 144 6.253 2.068 16.560 1.00 0.00 H ATOM 1907 H LEU A 144 10.767 4.644 14.060 1.00 0.00 H ATOM 1908 N LYS A 145 8.988 6.453 16.185 1.00 24.98 N ATOM 1909 CA LYS A 145 8.487 7.671 16.888 1.00 22.06 C ATOM 1910 C LYS A 145 7.651 8.610 15.990 1.00 21.44 C ATOM 1911 O LYS A 145 6.568 9.055 16.376 1.00 17.96 O ATOM 1912 CB LYS A 145 9.645 8.382 17.586 1.00 18.10 C ATOM 1913 CG LYS A 145 10.356 7.450 18.653 1.00 14.05 C ATOM 1914 CD LYS A 145 11.671 8.052 19.110 1.00 17.73 C ATOM 1915 CE LYS A 145 11.536 9.566 19.449 1.00 13.25 C ATOM 1916 NZ LYS A 145 10.703 9.634 20.676 1.00 3.18 N ATOM 1917 HA LYS A 145 7.780 7.342 17.650 1.00 0.00 H ATOM 1918 HB2 LYS A 145 10.377 8.682 16.837 1.00 0.00 H ATOM 1919 HB3 LYS A 145 9.261 9.268 18.092 1.00 0.00 H ATOM 1920 HG2 LYS A 145 9.700 7.330 19.515 1.00 0.00 H ATOM 1921 HG3 LYS A 145 10.547 6.475 18.204 1.00 0.00 H ATOM 1922 HD2 LYS A 145 12.011 7.521 19.999 1.00 0.00 H ATOM 1923 HD3 LYS A 145 12.407 7.934 18.315 1.00 0.00 H ATOM 1924 HE2 LYS A 145 11.050 10.097 18.630 1.00 0.00 H ATOM 1925 HE3 LYS A 145 12.518 10.003 19.632 1.00 0.00 H ATOM 1926 HZ1 LYS A 145 9.775 9.205 20.487 1.00 0.00 H ATOM 1927 HZ2 LYS A 145 11.176 9.116 21.444 1.00 0.00 H ATOM 1928 HZ3 LYS A 145 10.577 10.628 20.953 1.00 0.00 H ATOM 1929 H LYS A 145 10.010 6.260 16.154 1.00 0.00 H ATOM 1930 N LEU A 146 8.116 8.863 14.770 1.00 25.22 N ATOM 1931 CA LEU A 146 7.334 9.689 13.853 1.00 20.58 C ATOM 1932 C LEU A 146 5.956 9.089 13.585 1.00 26.17 C ATOM 1933 O LEU A 146 4.940 9.802 13.550 1.00 28.48 O ATOM 1934 CB LEU A 146 8.120 9.931 12.565 1.00 24.00 C ATOM 1935 CG LEU A 146 9.341 10.820 12.925 1.00 26.84 C ATOM 1936 CD1 LEU A 146 10.390 10.753 11.879 1.00 29.16 C ATOM 1937 CD2 LEU A 146 9.003 12.245 13.163 1.00 21.82 C ATOM 1938 HA LEU A 146 7.156 10.655 14.325 1.00 0.00 H ATOM 1939 HB2 LEU A 146 8.459 8.981 12.152 1.00 0.00 H ATOM 1940 HB3 LEU A 146 7.491 10.440 11.835 1.00 0.00 H ATOM 1941 HG LEU A 146 9.711 10.406 13.863 1.00 0.00 H ATOM 1942 HD21 LEU A 146 8.553 12.665 12.264 1.00 0.00 H ATOM 1943 HD22 LEU A 146 8.298 12.316 13.991 1.00 0.00 H ATOM 1944 HD23 LEU A 146 9.911 12.796 13.408 1.00 0.00 H ATOM 1945 HD11 LEU A 146 10.731 9.723 11.774 1.00 0.00 H ATOM 1946 HD12 LEU A 146 9.978 11.099 10.931 1.00 0.00 H ATOM 1947 HD13 LEU A 146 11.228 11.388 12.166 1.00 0.00 H ATOM 1948 H LEU A 146 9.033 8.474 14.470 1.00 0.00 H ATOM 1949 N LEU A 147 5.889 7.773 13.398 1.00 24.24 N ATOM 1950 CA LEU A 147 4.591 7.198 13.036 1.00 26.10 C ATOM 1951 C LEU A 147 3.678 7.166 14.250 1.00 27.96 C ATOM 1952 O LEU A 147 2.475 7.195 14.067 1.00 30.75 O ATOM 1953 CB LEU A 147 4.720 5.791 12.490 1.00 27.90 C ATOM 1954 CG LEU A 147 5.469 5.443 11.213 1.00 32.69 C ATOM 1955 CD1 LEU A 147 5.422 3.925 11.073 1.00 22.45 C ATOM 1956 CD2 LEU A 147 4.856 6.141 9.978 1.00 35.83 C ATOM 1957 HA LEU A 147 4.170 7.832 12.256 1.00 0.00 H ATOM 1958 HB2 LEU A 147 5.195 5.209 13.280 1.00 0.00 H ATOM 1959 HB3 LEU A 147 3.700 5.436 12.342 1.00 0.00 H ATOM 1960 HG LEU A 147 6.499 5.795 11.270 1.00 0.00 H ATOM 1961 HD21 LEU A 147 3.819 5.827 9.863 1.00 0.00 H ATOM 1962 HD22 LEU A 147 4.897 7.222 10.115 1.00 0.00 H ATOM 1963 HD23 LEU A 147 5.422 5.865 9.088 1.00 0.00 H ATOM 1964 HD11 LEU A 147 5.899 3.467 11.939 1.00 0.00 H ATOM 1965 HD12 LEU A 147 4.384 3.599 11.014 1.00 0.00 H ATOM 1966 HD13 LEU A 147 5.949 3.629 10.166 1.00 0.00 H ATOM 1967 H LEU A 147 6.731 7.172 13.505 1.00 0.00 H ATOM 1968 N GLN A 148 4.243 7.096 15.473 1.00 26.48 N ATOM 1969 CA GLN A 148 3.435 7.184 16.703 1.00 27.03 C ATOM 1970 C GLN A 148 2.991 8.598 16.944 1.00 27.26 C ATOM 1971 O GLN A 148 1.947 8.809 17.421 1.00 21.57 O ATOM 1972 CB GLN A 148 4.159 6.679 17.952 1.00 32.27 C ATOM 1973 CG GLN A 148 4.516 5.149 17.955 1.00 30.36 C ATOM 1974 CD GLN A 148 3.443 4.265 17.431 1.00 31.81 C ATOM 1975 OE1 GLN A 148 3.638 3.622 16.401 1.00 38.01 O ATOM 1976 NE2 GLN A 148 2.288 4.227 18.107 1.00 33.82 N ATOM 1977 HA GLN A 148 2.578 6.532 16.534 1.00 0.00 H ATOM 1978 HB2 GLN A 148 5.088 7.241 18.052 1.00 0.00 H ATOM 1979 HB3 GLN A 148 3.521 6.877 18.813 1.00 0.00 H ATOM 1980 HG2 GLN A 148 5.406 5.005 17.342 1.00 0.00 H ATOM 1981 HG3 GLN A 148 4.732 4.851 18.981 1.00 0.00 H ATOM 1982 HE22 GLN A 148 2.174 4.790 18.974 1.00 0.00 H ATOM 1983 HE21 GLN A 148 1.505 3.634 17.765 1.00 0.00 H ATOM 1984 H GLN A 148 5.273 6.977 15.550 1.00 0.00 H ATOM 1985 N ILE A 149 3.803 9.584 16.605 1.00 31.35 N ATOM 1986 CA ILE A 149 3.437 10.946 16.842 1.00 22.68 C ATOM 1987 C ILE A 149 2.310 11.302 15.908 1.00 29.12 C ATOM 1988 O ILE A 149 1.310 11.904 16.324 1.00 28.33 O ATOM 1989 CB ILE A 149 4.627 11.811 16.568 1.00 24.23 C ATOM 1990 CG1 ILE A 149 5.711 11.468 17.633 1.00 26.75 C ATOM 1991 CG2 ILE A 149 4.218 13.328 16.433 1.00 18.66 C ATOM 1992 CD1 ILE A 149 6.808 12.459 17.795 1.00 12.20 C ATOM 1993 HA ILE A 149 3.115 11.093 17.873 1.00 0.00 H ATOM 1994 HB ILE A 149 5.074 11.607 15.595 1.00 0.00 H ATOM 1995 HG12 ILE A 149 5.211 11.365 18.596 1.00 0.00 H ATOM 1996 HG13 ILE A 149 6.161 10.515 17.355 1.00 0.00 H ATOM 1997 HD11 ILE A 149 7.339 12.570 16.849 1.00 0.00 H ATOM 1998 HD12 ILE A 149 6.387 13.420 18.091 1.00 0.00 H ATOM 1999 HD13 ILE A 149 7.500 12.111 18.563 1.00 0.00 H ATOM 2000 HG21 ILE A 149 3.511 13.441 15.611 1.00 0.00 H ATOM 2001 HG22 ILE A 149 3.754 13.662 17.361 1.00 0.00 H ATOM 2002 HG23 ILE A 149 5.107 13.926 16.234 1.00 0.00 H ATOM 2003 H ILE A 149 4.718 9.367 16.161 1.00 0.00 H ATOM 2004 N VAL A 150 2.470 10.919 14.644 1.00 28.72 N ATOM 2005 CA VAL A 150 1.548 11.351 13.594 1.00 25.18 C ATOM 2006 C VAL A 150 0.442 10.353 13.238 1.00 23.10 C ATOM 2007 O VAL A 150 -0.558 10.766 12.700 1.00 30.18 O ATOM 2008 CB VAL A 150 2.305 11.797 12.348 1.00 27.88 C ATOM 2009 CG1 VAL A 150 1.365 12.193 11.235 1.00 27.22 C ATOM 2010 CG2 VAL A 150 3.237 12.975 12.661 1.00 22.51 C ATOM 2011 HA VAL A 150 1.021 12.202 14.026 1.00 0.00 H ATOM 2012 HB VAL A 150 2.897 10.943 12.019 1.00 0.00 H ATOM 2013 HG11 VAL A 150 0.739 11.341 10.970 1.00 0.00 H ATOM 2014 HG12 VAL A 150 0.736 13.018 11.569 1.00 0.00 H ATOM 2015 HG13 VAL A 150 1.944 12.504 10.366 1.00 0.00 H ATOM 2016 HG21 VAL A 150 2.648 13.814 13.031 1.00 0.00 H ATOM 2017 HG22 VAL A 150 3.959 12.674 13.420 1.00 0.00 H ATOM 2018 HG23 VAL A 150 3.763 13.271 11.754 1.00 0.00 H ATOM 2019 H VAL A 150 3.268 10.299 14.397 1.00 0.00 H ATOM 2020 N ARG A 151 0.586 9.069 13.569 1.00 28.57 N ATOM 2021 CA ARG A 151 -0.432 8.042 13.278 1.00 31.50 C ATOM 2022 C ARG A 151 -0.998 8.193 11.851 1.00 36.17 C ATOM 2023 O ARG A 151 -2.208 8.283 11.665 1.00 33.22 O ATOM 2024 CB ARG A 151 -1.565 8.080 14.320 1.00 41.71 C ATOM 2025 CG ARG A 151 -1.941 6.710 14.991 1.00 52.80 C ATOM 2026 CD ARG A 151 -1.288 6.515 16.403 1.00 55.94 C ATOM 2027 NE ARG A 151 -1.859 5.450 17.294 1.00 58.48 N ATOM 2028 CZ ARG A 151 -1.592 4.115 17.261 1.00 52.88 C ATOM 2029 NH1 ARG A 151 -0.804 3.574 16.355 1.00 38.37 N ATOM 2030 NH2 ARG A 151 -2.148 3.289 18.146 1.00 51.92 N ATOM 2031 HA ARG A 151 0.058 7.070 13.339 1.00 0.00 H ATOM 2032 HB2 ARG A 151 -1.265 8.767 15.112 1.00 0.00 H ATOM 2033 HB3 ARG A 151 -2.458 8.464 13.826 1.00 0.00 H ATOM 2034 HG2 ARG A 151 -3.024 6.663 15.100 1.00 0.00 H ATOM 2035 HG3 ARG A 151 -1.608 5.902 14.340 1.00 0.00 H ATOM 2036 HD2 ARG A 151 -1.371 7.463 16.934 1.00 0.00 H ATOM 2037 HD3 ARG A 151 -0.236 6.279 16.246 1.00 0.00 H ATOM 2038 HE ARG A 151 -2.535 5.768 18.018 1.00 0.00 H ATOM 2039 HH12 ARG A 151 -0.626 2.549 16.365 1.00 0.00 H ATOM 2040 HH11 ARG A 151 -0.359 4.171 15.629 1.00 0.00 H ATOM 2041 HH22 ARG A 151 -1.937 2.271 18.111 1.00 0.00 H ATOM 2042 HH21 ARG A 151 -2.793 3.662 18.871 1.00 0.00 H ATOM 2043 H ARG A 151 1.458 8.778 14.056 1.00 0.00 H ATOM 2044 N PRO A 152 -0.133 8.215 10.821 1.00 33.06 N ATOM 2045 CA PRO A 152 -0.696 8.465 9.467 1.00 33.74 C ATOM 2046 C PRO A 152 -1.359 7.231 8.909 1.00 32.39 C ATOM 2047 O PRO A 152 -1.188 6.149 9.470 1.00 34.89 O ATOM 2048 CB PRO A 152 0.541 8.821 8.602 1.00 32.92 C ATOM 2049 CG PRO A 152 1.680 8.161 9.290 1.00 36.34 C ATOM 2050 CD PRO A 152 1.316 7.989 10.795 1.00 32.64 C ATOM 2051 HA PRO A 152 -1.456 9.246 9.485 1.00 0.00 H ATOM 2052 HD3 PRO A 152 1.561 6.986 11.144 1.00 0.00 H ATOM 2053 HD2 PRO A 152 1.837 8.723 11.409 1.00 0.00 H ATOM 2054 HG3 PRO A 152 2.574 8.777 9.196 1.00 0.00 H ATOM 2055 HG2 PRO A 152 1.865 7.185 8.842 1.00 0.00 H ATOM 2056 HB2 PRO A 152 0.427 8.435 7.589 1.00 0.00 H ATOM 2057 HB3 PRO A 152 0.687 9.901 8.564 1.00 0.00 H ATOM 2058 N ASP A 153 -2.083 7.384 7.803 1.00 35.89 N ATOM 2059 CA ASP A 153 -2.727 6.256 7.123 1.00 34.22 C ATOM 2060 C ASP A 153 -1.741 5.501 6.288 1.00 31.78 C ATOM 2061 O ASP A 153 -1.711 4.248 6.296 1.00 26.98 O ATOM 2062 CB ASP A 153 -3.841 6.757 6.230 1.00 43.60 C ATOM 2063 CG ASP A 153 -5.039 7.171 7.018 1.00 48.66 C ATOM 2064 OD1 ASP A 153 -4.923 8.144 7.793 1.00 57.91 O ATOM 2065 OD2 ASP A 153 -6.086 6.523 6.872 1.00 50.82 O ATOM 2066 HA ASP A 153 -3.131 5.591 7.887 1.00 0.00 H ATOM 2067 HB2 ASP A 153 -3.479 7.613 5.661 1.00 0.00 H ATOM 2068 HB3 ASP A 153 -4.128 5.961 5.543 1.00 0.00 H ATOM 2069 H ASP A 153 -2.196 8.339 7.406 1.00 0.00 H ATOM 2070 N ARG A 154 -0.922 6.294 5.598 1.00 31.37 N ATOM 2071 CA ARG A 154 0.219 5.855 4.771 1.00 32.00 C ATOM 2072 C ARG A 154 1.475 6.673 5.026 1.00 28.91 C ATOM 2073 O ARG A 154 1.436 7.893 5.353 1.00 24.49 O ATOM 2074 CB ARG A 154 -0.080 6.042 3.293 1.00 29.98 C ATOM 2075 CG ARG A 154 -1.458 5.695 2.936 1.00 37.20 C ATOM 2076 CD ARG A 154 -1.652 5.582 1.431 1.00 40.30 C ATOM 2077 NE ARG A 154 -3.062 5.260 1.249 1.00 51.70 N ATOM 2078 CZ ARG A 154 -3.664 5.002 0.099 1.00 49.29 C ATOM 2079 NH1 ARG A 154 -2.988 4.989 -1.036 1.00 49.54 N ATOM 2080 NH2 ARG A 154 -4.962 4.764 0.104 1.00 48.29 N ATOM 2081 HA ARG A 154 0.376 4.810 5.038 1.00 0.00 H ATOM 2082 HB2 ARG A 154 0.093 7.086 3.033 1.00 0.00 H ATOM 2083 HB3 ARG A 154 0.597 5.409 2.719 1.00 0.00 H ATOM 2084 HG2 ARG A 154 -1.710 4.739 3.395 1.00 0.00 H ATOM 2085 HG3 ARG A 154 -2.125 6.467 3.319 1.00 0.00 H ATOM 2086 HD2 ARG A 154 -1.023 4.791 1.023 1.00 0.00 H ATOM 2087 HD3 ARG A 154 -1.409 6.526 0.942 1.00 0.00 H ATOM 2088 HE ARG A 154 -3.652 5.230 2.105 1.00 0.00 H ATOM 2089 HH12 ARG A 154 -3.477 4.784 -1.930 1.00 0.00 H ATOM 2090 HH11 ARG A 154 -1.966 5.183 -1.035 1.00 0.00 H ATOM 2091 HH22 ARG A 154 -5.456 4.559 -0.788 1.00 0.00 H ATOM 2092 HH21 ARG A 154 -5.490 4.782 1.000 1.00 0.00 H ATOM 2093 H ARG A 154 -1.104 7.317 5.647 1.00 0.00 H ATOM 2094 N VAL A 155 2.597 6.005 4.797 1.00 27.09 N ATOM 2095 CA VAL A 155 3.882 6.628 4.959 1.00 27.05 C ATOM 2096 C VAL A 155 4.754 6.384 3.739 1.00 27.40 C ATOM 2097 O VAL A 155 4.889 5.271 3.279 1.00 30.54 O ATOM 2098 CB VAL A 155 4.560 6.104 6.197 1.00 24.52 C ATOM 2099 CG1 VAL A 155 4.965 4.582 6.029 1.00 16.90 C ATOM 2100 CG2 VAL A 155 5.721 6.950 6.473 1.00 13.77 C ATOM 2101 HA VAL A 155 3.734 7.703 5.066 1.00 0.00 H ATOM 2102 HB VAL A 155 3.874 6.144 7.043 1.00 0.00 H ATOM 2103 HG11 VAL A 155 4.070 3.988 5.844 1.00 0.00 H ATOM 2104 HG12 VAL A 155 5.650 4.480 5.188 1.00 0.00 H ATOM 2105 HG13 VAL A 155 5.452 4.234 6.940 1.00 0.00 H ATOM 2106 HG21 VAL A 155 6.405 6.913 5.626 1.00 0.00 H ATOM 2107 HG22 VAL A 155 5.391 7.977 6.631 1.00 0.00 H ATOM 2108 HG23 VAL A 155 6.228 6.588 7.367 1.00 0.00 H ATOM 2109 H VAL A 155 2.546 5.011 4.494 1.00 0.00 H ATOM 2110 N PHE A 156 5.379 7.448 3.263 1.00 30.27 N ATOM 2111 CA PHE A 156 6.060 7.461 1.964 1.00 32.23 C ATOM 2112 C PHE A 156 7.555 7.443 2.026 1.00 29.50 C ATOM 2113 O PHE A 156 8.154 8.224 2.763 1.00 31.15 O ATOM 2114 CB PHE A 156 5.575 8.669 1.156 1.00 27.30 C ATOM 2115 CG PHE A 156 4.132 8.589 0.877 1.00 28.38 C ATOM 2116 CD1 PHE A 156 3.209 8.755 1.911 1.00 26.14 C ATOM 2117 CD2 PHE A 156 3.676 8.244 -0.379 1.00 28.77 C ATOM 2118 CE1 PHE A 156 1.833 8.607 1.663 1.00 31.93 C ATOM 2119 CE2 PHE A 156 2.308 8.087 -0.624 1.00 34.44 C ATOM 2120 CZ PHE A 156 1.388 8.272 0.391 1.00 26.42 C ATOM 2121 HA PHE A 156 5.793 6.524 1.476 1.00 0.00 H ATOM 2122 HB2 PHE A 156 5.776 9.578 1.723 1.00 0.00 H ATOM 2123 HB3 PHE A 156 6.117 8.704 0.211 1.00 0.00 H ATOM 2124 HD2 PHE A 156 4.390 8.092 -1.189 1.00 0.00 H ATOM 2125 HE2 PHE A 156 1.965 7.817 -1.623 1.00 0.00 H ATOM 2126 HZ PHE A 156 0.322 8.156 0.195 1.00 0.00 H ATOM 2127 HE1 PHE A 156 1.115 8.755 2.470 1.00 0.00 H ATOM 2128 HD1 PHE A 156 3.556 9.000 2.915 1.00 0.00 H ATOM 2129 H PHE A 156 5.388 8.316 3.836 1.00 0.00 H ATOM 2130 N PHE A 157 8.143 6.571 1.206 1.00 28.16 N ATOM 2131 CA PHE A 157 9.581 6.469 1.059 1.00 24.95 C ATOM 2132 C PHE A 157 10.021 6.249 -0.373 1.00 27.53 C ATOM 2133 O PHE A 157 9.343 5.558 -1.125 1.00 29.38 O ATOM 2134 CB PHE A 157 10.090 5.328 1.924 1.00 27.09 C ATOM 2135 CG PHE A 157 10.063 5.637 3.417 1.00 25.40 C ATOM 2136 CD1 PHE A 157 11.057 6.380 3.991 1.00 23.70 C ATOM 2137 CD2 PHE A 157 9.036 5.162 4.233 1.00 25.96 C ATOM 2138 CE1 PHE A 157 11.033 6.644 5.369 1.00 33.45 C ATOM 2139 CE2 PHE A 157 9.005 5.418 5.585 1.00 26.01 C ATOM 2140 CZ PHE A 157 10.001 6.167 6.154 1.00 25.16 C ATOM 2141 HA PHE A 157 10.004 7.422 1.376 1.00 0.00 H ATOM 2142 HB2 PHE A 157 9.467 4.452 1.741 1.00 0.00 H ATOM 2143 HB3 PHE A 157 11.118 5.108 1.636 1.00 0.00 H ATOM 2144 HD2 PHE A 157 8.236 4.571 3.787 1.00 0.00 H ATOM 2145 HE2 PHE A 157 8.193 5.027 6.199 1.00 0.00 H ATOM 2146 HZ PHE A 157 9.979 6.386 7.222 1.00 0.00 H ATOM 2147 HE1 PHE A 157 11.833 7.229 5.823 1.00 0.00 H ATOM 2148 HD1 PHE A 157 11.870 6.768 3.377 1.00 0.00 H ATOM 2149 H PHE A 157 7.541 5.934 0.646 1.00 0.00 H ATOM 2150 N GLY A 158 11.176 6.820 -0.726 1.00 29.23 N ATOM 2151 CA GLY A 158 11.747 6.733 -2.039 1.00 18.97 C ATOM 2152 C GLY A 158 12.390 5.387 -2.248 1.00 27.60 C ATOM 2153 O GLY A 158 13.025 4.889 -1.371 1.00 27.47 O ATOM 2154 HA3 GLY A 158 12.500 7.512 -2.155 1.00 0.00 H ATOM 2155 HA2 GLY A 158 10.962 6.875 -2.782 1.00 0.00 H ATOM 2156 H GLY A 158 11.693 7.361 -0.004 1.00 0.00 H ATOM 2157 N GLU A 159 12.243 4.798 -3.439 1.00 31.18 N ATOM 2158 CA GLU A 159 12.962 3.540 -3.747 1.00 31.31 C ATOM 2159 C GLU A 159 14.502 3.737 -3.798 1.00 27.29 C ATOM 2160 O GLU A 159 15.274 2.756 -3.810 1.00 29.53 O ATOM 2161 CB GLU A 159 12.413 2.863 -5.027 1.00 26.27 C ATOM 2162 CG GLU A 159 10.929 2.438 -4.947 1.00 31.28 C ATOM 2163 CD GLU A 159 10.398 1.698 -6.178 1.00 34.58 C ATOM 2164 OE1 GLU A 159 11.105 1.599 -7.216 1.00 38.81 O ATOM 2165 OE2 GLU A 159 9.249 1.221 -6.094 1.00 36.85 O ATOM 2166 HA GLU A 159 12.770 2.856 -2.920 1.00 0.00 H ATOM 2167 HB2 GLU A 159 12.522 3.563 -5.855 1.00 0.00 H ATOM 2168 HB3 GLU A 159 13.011 1.973 -5.224 1.00 0.00 H ATOM 2169 HG2 GLU A 159 10.811 1.784 -4.083 1.00 0.00 H ATOM 2170 HG3 GLU A 159 10.327 3.336 -4.807 1.00 0.00 H ATOM 2171 H GLU A 159 11.620 5.226 -4.154 1.00 0.00 H ATOM 2172 N LYS A 160 14.935 4.998 -3.837 1.00 32.21 N ATOM 2173 CA LYS A 160 16.360 5.361 -3.911 1.00 31.10 C ATOM 2174 C LYS A 160 17.094 4.666 -2.785 1.00 28.39 C ATOM 2175 O LYS A 160 18.161 4.075 -2.978 1.00 28.35 O ATOM 2176 CB LYS A 160 16.496 6.874 -3.743 1.00 33.79 C ATOM 2177 CG LYS A 160 17.566 7.576 -4.577 1.00 35.56 C ATOM 2178 CD LYS A 160 18.958 7.144 -4.218 1.00 37.25 C ATOM 2179 CE LYS A 160 19.883 8.278 -4.398 1.00 35.90 C ATOM 2180 NZ LYS A 160 19.638 9.037 -3.151 1.00 51.03 N ATOM 2181 HA LYS A 160 16.778 5.059 -4.871 1.00 0.00 H ATOM 2182 HB2 LYS A 160 15.535 7.320 -3.999 1.00 0.00 H ATOM 2183 HB3 LYS A 160 16.718 7.069 -2.694 1.00 0.00 H ATOM 2184 HG2 LYS A 160 17.391 7.351 -5.629 1.00 0.00 H ATOM 2185 HG3 LYS A 160 17.483 8.651 -4.418 1.00 0.00 H ATOM 2186 HD2 LYS A 160 18.981 6.817 -3.179 1.00 0.00 H ATOM 2187 HD3 LYS A 160 19.262 6.320 -4.864 1.00 0.00 H ATOM 2188 HE2 LYS A 160 19.631 8.865 -5.281 1.00 0.00 H ATOM 2189 HE3 LYS A 160 20.918 7.944 -4.468 1.00 0.00 H ATOM 2190 HZ1 LYS A 160 18.638 9.318 -3.108 1.00 0.00 H ATOM 2191 HZ2 LYS A 160 19.867 8.439 -2.332 1.00 0.00 H ATOM 2192 HZ3 LYS A 160 20.238 9.886 -3.140 1.00 0.00 H ATOM 2193 H LYS A 160 14.231 5.763 -3.814 1.00 0.00 H ATOM 2194 N ASP A 161 16.509 4.726 -1.592 1.00 23.72 N ATOM 2195 CA ASP A 161 17.164 4.114 -0.471 1.00 25.13 C ATOM 2196 C ASP A 161 16.389 2.858 -0.190 1.00 29.37 C ATOM 2197 O ASP A 161 15.602 2.746 0.754 1.00 27.08 O ATOM 2198 CB ASP A 161 17.249 5.072 0.717 1.00 26.02 C ATOM 2199 CG ASP A 161 17.896 6.392 0.350 1.00 29.67 C ATOM 2200 OD1 ASP A 161 17.186 7.293 -0.195 1.00 32.12 O ATOM 2201 OD2 ASP A 161 19.114 6.524 0.601 1.00 32.95 O ATOM 2202 HA ASP A 161 18.205 3.867 -0.679 1.00 0.00 H ATOM 2203 HB2 ASP A 161 16.241 5.266 1.083 1.00 0.00 H ATOM 2204 HB3 ASP A 161 17.836 4.601 1.505 1.00 0.00 H ATOM 2205 H ASP A 161 15.595 5.207 -1.474 1.00 0.00 H ATOM 2206 N TYR A 162 16.630 1.906 -1.069 1.00 29.88 N ATOM 2207 CA TYR A 162 15.789 0.733 -1.164 1.00 31.77 C ATOM 2208 C TYR A 162 15.894 -0.187 0.056 1.00 29.91 C ATOM 2209 O TYR A 162 14.870 -0.655 0.551 1.00 30.20 O ATOM 2210 CB TYR A 162 16.088 -0.020 -2.470 1.00 33.03 C ATOM 2211 CG TYR A 162 15.195 -1.218 -2.721 1.00 25.59 C ATOM 2212 CD1 TYR A 162 15.531 -2.467 -2.220 1.00 27.01 C ATOM 2213 CD2 TYR A 162 14.077 -1.102 -3.487 1.00 25.57 C ATOM 2214 CE1 TYR A 162 14.753 -3.552 -2.450 1.00 30.33 C ATOM 2215 CE2 TYR A 162 13.262 -2.193 -3.747 1.00 29.06 C ATOM 2216 CZ TYR A 162 13.595 -3.394 -3.214 1.00 32.57 C ATOM 2217 OH TYR A 162 12.803 -4.467 -3.441 1.00 31.52 O ATOM 2218 HA TYR A 162 14.754 1.076 -1.179 1.00 0.00 H ATOM 2219 HB3 TYR A 162 17.121 -0.366 -2.435 1.00 0.00 H ATOM 2220 HB2 TYR A 162 15.967 0.676 -3.300 1.00 0.00 H ATOM 2221 HD2 TYR A 162 13.816 -0.130 -3.906 1.00 0.00 H ATOM 2222 HE2 TYR A 162 12.372 -2.087 -4.367 1.00 0.00 H ATOM 2223 HE1 TYR A 162 15.025 -4.528 -2.047 1.00 0.00 H ATOM 2224 HD1 TYR A 162 16.440 -2.578 -1.629 1.00 0.00 H ATOM 2225 HH TYR A 162 13.184 -5.259 -2.985 1.00 0.00 H ATOM 2226 H TYR A 162 17.444 2.000 -1.709 1.00 0.00 H ATOM 2227 N GLN A 163 17.112 -0.461 0.521 1.00 23.88 N ATOM 2228 CA GLN A 163 17.311 -1.174 1.796 1.00 22.53 C ATOM 2229 C GLN A 163 16.559 -0.508 2.984 1.00 17.61 C ATOM 2230 O GLN A 163 15.891 -1.179 3.761 1.00 17.87 O ATOM 2231 CB GLN A 163 18.809 -1.243 2.132 1.00 24.70 C ATOM 2232 CG GLN A 163 19.088 -2.093 3.378 1.00 14.67 C ATOM 2233 CD GLN A 163 20.581 -2.281 3.646 1.00 25.31 C ATOM 2234 OE1 GLN A 163 21.452 -1.482 3.173 1.00 24.68 O ATOM 2235 NE2 GLN A 163 20.900 -3.353 4.420 1.00 18.66 N ATOM 2236 HA GLN A 163 16.900 -2.174 1.660 1.00 0.00 H ATOM 2237 HB2 GLN A 163 19.339 -1.678 1.285 1.00 0.00 H ATOM 2238 HB3 GLN A 163 19.176 -0.232 2.308 1.00 0.00 H ATOM 2239 HG2 GLN A 163 18.638 -1.603 4.242 1.00 0.00 H ATOM 2240 HG3 GLN A 163 18.633 -3.074 3.240 1.00 0.00 H ATOM 2241 HE22 GLN A 163 20.149 -3.975 4.782 1.00 0.00 H ATOM 2242 HE21 GLN A 163 21.895 -3.550 4.650 1.00 0.00 H ATOM 2243 H GLN A 163 17.943 -0.165 -0.029 1.00 0.00 H ATOM 2244 N GLN A 164 16.677 0.802 3.146 1.00 20.61 N ATOM 2245 CA GLN A 164 15.844 1.498 4.140 1.00 25.68 C ATOM 2246 C GLN A 164 14.332 1.223 3.957 1.00 28.44 C ATOM 2247 O GLN A 164 13.588 1.053 4.937 1.00 36.38 O ATOM 2248 CB GLN A 164 16.105 2.989 4.052 1.00 26.69 C ATOM 2249 CG GLN A 164 15.479 3.832 5.112 1.00 28.28 C ATOM 2250 CD GLN A 164 15.746 5.275 4.840 1.00 31.40 C ATOM 2251 OE1 GLN A 164 16.499 5.901 5.565 1.00 35.39 O ATOM 2252 NE2 GLN A 164 15.195 5.807 3.735 1.00 38.19 N ATOM 2253 HA GLN A 164 16.120 1.114 5.122 1.00 0.00 H ATOM 2254 HB2 GLN A 164 17.183 3.141 4.099 1.00 0.00 H ATOM 2255 HB3 GLN A 164 15.732 3.336 3.088 1.00 0.00 H ATOM 2256 HG2 GLN A 164 14.403 3.659 5.122 1.00 0.00 H ATOM 2257 HG3 GLN A 164 15.898 3.563 6.082 1.00 0.00 H ATOM 2258 HE22 GLN A 164 14.557 5.235 3.145 1.00 0.00 H ATOM 2259 HE21 GLN A 164 15.407 6.790 3.470 1.00 0.00 H ATOM 2260 H GLN A 164 17.358 1.338 2.571 1.00 0.00 H ATOM 2261 N LEU A 165 13.885 1.172 2.709 1.00 21.77 N ATOM 2262 CA LEU A 165 12.521 0.894 2.401 1.00 21.08 C ATOM 2263 C LEU A 165 12.122 -0.500 2.913 1.00 26.11 C ATOM 2264 O LEU A 165 11.160 -0.646 3.693 1.00 27.28 O ATOM 2265 CB LEU A 165 12.300 1.019 0.903 1.00 18.45 C ATOM 2266 CG LEU A 165 10.884 0.850 0.357 1.00 24.14 C ATOM 2267 CD1 LEU A 165 9.968 1.954 0.885 1.00 25.80 C ATOM 2268 CD2 LEU A 165 10.966 0.885 -1.180 1.00 17.00 C ATOM 2269 HA LEU A 165 11.884 1.621 2.905 1.00 0.00 H ATOM 2270 HB2 LEU A 165 12.642 2.011 0.609 1.00 0.00 H ATOM 2271 HB3 LEU A 165 12.922 0.265 0.422 1.00 0.00 H ATOM 2272 HG LEU A 165 10.461 -0.100 0.685 1.00 0.00 H ATOM 2273 HD21 LEU A 165 11.384 1.840 -1.499 1.00 0.00 H ATOM 2274 HD22 LEU A 165 11.606 0.073 -1.527 1.00 0.00 H ATOM 2275 HD23 LEU A 165 9.967 0.766 -1.599 1.00 0.00 H ATOM 2276 HD11 LEU A 165 9.935 1.907 1.974 1.00 0.00 H ATOM 2277 HD12 LEU A 165 10.354 2.925 0.573 1.00 0.00 H ATOM 2278 HD13 LEU A 165 8.964 1.814 0.484 1.00 0.00 H ATOM 2279 H LEU A 165 14.552 1.340 1.929 1.00 0.00 H ATOM 2280 N VAL A 166 12.872 -1.521 2.505 1.00 21.82 N ATOM 2281 CA VAL A 166 12.557 -2.883 2.911 1.00 18.01 C ATOM 2282 C VAL A 166 12.526 -3.005 4.433 1.00 23.81 C ATOM 2283 O VAL A 166 11.707 -3.722 4.985 1.00 22.79 O ATOM 2284 CB VAL A 166 13.592 -3.898 2.318 1.00 19.89 C ATOM 2285 CG1 VAL A 166 13.267 -5.345 2.787 1.00 17.57 C ATOM 2286 CG2 VAL A 166 13.532 -3.881 0.810 1.00 9.30 C ATOM 2287 HA VAL A 166 11.568 -3.123 2.520 1.00 0.00 H ATOM 2288 HB VAL A 166 14.582 -3.603 2.665 1.00 0.00 H ATOM 2289 HG11 VAL A 166 13.309 -5.391 3.875 1.00 0.00 H ATOM 2290 HG12 VAL A 166 12.268 -5.619 2.449 1.00 0.00 H ATOM 2291 HG13 VAL A 166 13.997 -6.035 2.364 1.00 0.00 H ATOM 2292 HG21 VAL A 166 12.530 -4.160 0.484 1.00 0.00 H ATOM 2293 HG22 VAL A 166 13.766 -2.879 0.450 1.00 0.00 H ATOM 2294 HG23 VAL A 166 14.256 -4.591 0.411 1.00 0.00 H ATOM 2295 H VAL A 166 13.692 -1.344 1.890 1.00 0.00 H ATOM 2296 N LEU A 167 13.426 -2.294 5.102 1.00 26.81 N ATOM 2297 CA LEU A 167 13.590 -2.411 6.533 1.00 28.27 C ATOM 2298 C LEU A 167 12.420 -1.780 7.225 1.00 27.25 C ATOM 2299 O LEU A 167 11.832 -2.327 8.176 1.00 25.95 O ATOM 2300 CB LEU A 167 14.887 -1.734 6.937 1.00 31.39 C ATOM 2301 CG LEU A 167 16.028 -2.740 6.953 1.00 33.55 C ATOM 2302 CD1 LEU A 167 17.351 -2.067 7.275 1.00 30.25 C ATOM 2303 CD2 LEU A 167 15.732 -3.860 7.929 1.00 27.04 C ATOM 2304 HA LEU A 167 13.634 -3.461 6.823 1.00 0.00 H ATOM 2305 HB2 LEU A 167 15.116 -0.942 6.224 1.00 0.00 H ATOM 2306 HB3 LEU A 167 14.773 -1.304 7.932 1.00 0.00 H ATOM 2307 HG LEU A 167 16.116 -3.171 5.955 1.00 0.00 H ATOM 2308 HD21 LEU A 167 15.610 -3.445 8.930 1.00 0.00 H ATOM 2309 HD22 LEU A 167 14.815 -4.368 7.630 1.00 0.00 H ATOM 2310 HD23 LEU A 167 16.559 -4.570 7.927 1.00 0.00 H ATOM 2311 HD11 LEU A 167 17.565 -1.310 6.521 1.00 0.00 H ATOM 2312 HD12 LEU A 167 17.288 -1.596 8.256 1.00 0.00 H ATOM 2313 HD13 LEU A 167 18.145 -2.813 7.279 1.00 0.00 H ATOM 2314 H LEU A 167 14.033 -1.631 4.579 1.00 0.00 H ATOM 2315 N ILE A 168 12.027 -0.638 6.701 1.00 25.30 N ATOM 2316 CA ILE A 168 10.778 -0.042 7.174 1.00 24.89 C ATOM 2317 C ILE A 168 9.507 -0.933 7.047 1.00 21.80 C ATOM 2318 O ILE A 168 8.621 -0.896 7.894 1.00 28.79 O ATOM 2319 CB ILE A 168 10.639 1.331 6.575 1.00 21.46 C ATOM 2320 CG1 ILE A 168 11.624 2.251 7.274 1.00 20.70 C ATOM 2321 CG2 ILE A 168 9.260 1.862 6.694 1.00 21.99 C ATOM 2322 CD1 ILE A 168 11.904 3.490 6.395 1.00 34.02 C ATOM 2323 HA ILE A 168 10.852 0.048 8.258 1.00 0.00 H ATOM 2324 HB ILE A 168 10.854 1.272 5.508 1.00 0.00 H ATOM 2325 HG12 ILE A 168 11.205 2.572 8.228 1.00 0.00 H ATOM 2326 HG13 ILE A 168 12.557 1.715 7.450 1.00 0.00 H ATOM 2327 HD11 ILE A 168 12.325 3.170 5.442 1.00 0.00 H ATOM 2328 HD12 ILE A 168 10.972 4.028 6.220 1.00 0.00 H ATOM 2329 HD13 ILE A 168 12.612 4.143 6.905 1.00 0.00 H ATOM 2330 HG21 ILE A 168 8.570 1.196 6.176 1.00 0.00 H ATOM 2331 HG22 ILE A 168 8.985 1.924 7.747 1.00 0.00 H ATOM 2332 HG23 ILE A 168 9.214 2.855 6.246 1.00 0.00 H ATOM 2333 H ILE A 168 12.593 -0.169 5.965 1.00 0.00 H ATOM 2334 N ARG A 169 9.427 -1.751 6.006 1.00 25.07 N ATOM 2335 CA ARG A 169 8.291 -2.639 5.812 1.00 18.34 C ATOM 2336 C ARG A 169 8.296 -3.783 6.814 1.00 22.25 C ATOM 2337 O ARG A 169 7.258 -4.362 7.105 1.00 24.88 O ATOM 2338 CB ARG A 169 8.335 -3.222 4.423 1.00 22.17 C ATOM 2339 CG ARG A 169 8.047 -2.254 3.257 1.00 21.27 C ATOM 2340 CD ARG A 169 7.964 -3.123 2.017 1.00 25.07 C ATOM 2341 NE ARG A 169 7.897 -2.420 0.744 1.00 29.15 N ATOM 2342 CZ ARG A 169 6.821 -1.769 0.296 1.00 27.06 C ATOM 2343 NH1 ARG A 169 5.709 -1.633 1.030 1.00 27.47 N ATOM 2344 NH2 ARG A 169 6.883 -1.201 -0.874 1.00 22.10 N ATOM 2345 HA ARG A 169 7.385 -2.050 5.956 1.00 0.00 H ATOM 2346 HB2 ARG A 169 9.331 -3.637 4.270 1.00 0.00 H ATOM 2347 HB3 ARG A 169 7.598 -4.024 4.377 1.00 0.00 H ATOM 2348 HG2 ARG A 169 7.104 -1.732 3.420 1.00 0.00 H ATOM 2349 HG3 ARG A 169 8.852 -1.526 3.159 1.00 0.00 H ATOM 2350 HD2 ARG A 169 7.071 -3.742 2.103 1.00 0.00 H ATOM 2351 HD3 ARG A 169 8.847 -3.762 1.998 1.00 0.00 H ATOM 2352 HE ARG A 169 8.745 -2.425 0.142 1.00 0.00 H ATOM 2353 HH12 ARG A 169 4.891 -1.118 0.645 1.00 0.00 H ATOM 2354 HH11 ARG A 169 5.663 -2.042 1.985 1.00 0.00 H ATOM 2355 HH22 ARG A 169 6.059 -0.687 -1.247 1.00 0.00 H ATOM 2356 HH21 ARG A 169 7.756 -1.261 -1.436 1.00 0.00 H ATOM 2357 H ARG A 169 10.198 -1.758 5.308 1.00 0.00 H ATOM 2358 N GLN A 170 9.479 -4.116 7.322 1.00 26.30 N ATOM 2359 CA GLN A 170 9.657 -5.215 8.252 1.00 24.95 C ATOM 2360 C GLN A 170 9.237 -4.668 9.592 1.00 28.17 C ATOM 2361 O GLN A 170 8.684 -5.380 10.449 1.00 29.12 O ATOM 2362 CB GLN A 170 11.139 -5.569 8.347 1.00 19.92 C ATOM 2363 CG GLN A 170 11.687 -6.215 7.103 1.00 24.47 C ATOM 2364 CD GLN A 170 13.085 -6.786 7.300 1.00 28.13 C ATOM 2365 OE1 GLN A 170 13.807 -6.397 8.207 1.00 27.40 O ATOM 2366 NE2 GLN A 170 13.473 -7.712 6.424 1.00 27.34 N ATOM 2367 HA GLN A 170 9.093 -6.096 7.945 1.00 0.00 H ATOM 2368 HB2 GLN A 170 11.700 -4.654 8.536 1.00 0.00 H ATOM 2369 HB3 GLN A 170 11.276 -6.257 9.181 1.00 0.00 H ATOM 2370 HG2 GLN A 170 11.019 -7.024 6.807 1.00 0.00 H ATOM 2371 HG3 GLN A 170 11.724 -5.468 6.310 1.00 0.00 H ATOM 2372 HE22 GLN A 170 12.827 -8.015 5.667 1.00 0.00 H ATOM 2373 HE21 GLN A 170 14.422 -8.132 6.497 1.00 0.00 H ATOM 2374 H GLN A 170 10.314 -3.564 7.040 1.00 0.00 H ATOM 2375 N LEU A 171 9.536 -3.390 9.760 1.00 23.45 N ATOM 2376 CA LEU A 171 9.316 -2.709 11.000 1.00 18.61 C ATOM 2377 C LEU A 171 7.841 -2.732 11.132 1.00 21.95 C ATOM 2378 O LEU A 171 7.339 -3.261 12.086 1.00 28.45 O ATOM 2379 CB LEU A 171 9.823 -1.275 10.897 1.00 22.80 C ATOM 2380 CG LEU A 171 9.193 -0.370 11.938 1.00 22.22 C ATOM 2381 CD1 LEU A 171 9.694 -0.831 13.320 1.00 13.82 C ATOM 2382 CD2 LEU A 171 9.410 1.121 11.701 1.00 14.35 C ATOM 2383 HA LEU A 171 9.828 -3.161 11.849 1.00 0.00 H ATOM 2384 HB2 LEU A 171 10.904 -1.273 11.038 1.00 0.00 H ATOM 2385 HB3 LEU A 171 9.586 -0.889 9.906 1.00 0.00 H ATOM 2386 HG LEU A 171 8.110 -0.470 11.870 1.00 0.00 H ATOM 2387 HD21 LEU A 171 10.479 1.336 11.701 1.00 0.00 H ATOM 2388 HD22 LEU A 171 8.982 1.401 10.738 1.00 0.00 H ATOM 2389 HD23 LEU A 171 8.924 1.688 12.495 1.00 0.00 H ATOM 2390 HD11 LEU A 171 9.397 -1.867 13.486 1.00 0.00 H ATOM 2391 HD12 LEU A 171 10.781 -0.753 13.356 1.00 0.00 H ATOM 2392 HD13 LEU A 171 9.258 -0.198 14.093 1.00 0.00 H ATOM 2393 H LEU A 171 9.945 -2.862 8.963 1.00 0.00 H ATOM 2394 N VAL A 172 7.147 -2.214 10.118 1.00 27.45 N ATOM 2395 CA VAL A 172 5.704 -2.101 10.117 1.00 21.25 C ATOM 2396 C VAL A 172 5.037 -3.478 10.299 1.00 26.88 C ATOM 2397 O VAL A 172 4.041 -3.596 11.033 1.00 26.29 O ATOM 2398 CB VAL A 172 5.237 -1.341 8.847 1.00 28.03 C ATOM 2399 CG1 VAL A 172 3.795 -1.729 8.390 1.00 29.33 C ATOM 2400 CG2 VAL A 172 5.384 0.243 9.030 1.00 30.52 C ATOM 2401 HA VAL A 172 5.381 -1.510 10.974 1.00 0.00 H ATOM 2402 HB VAL A 172 5.903 -1.656 8.044 1.00 0.00 H ATOM 2403 HG11 VAL A 172 3.761 -2.795 8.166 1.00 0.00 H ATOM 2404 HG12 VAL A 172 3.089 -1.501 9.188 1.00 0.00 H ATOM 2405 HG13 VAL A 172 3.533 -1.161 7.498 1.00 0.00 H ATOM 2406 HG21 VAL A 172 4.775 0.568 9.873 1.00 0.00 H ATOM 2407 HG22 VAL A 172 6.429 0.490 9.218 1.00 0.00 H ATOM 2408 HG23 VAL A 172 5.048 0.745 8.123 1.00 0.00 H ATOM 2409 H VAL A 172 7.669 -1.874 9.285 1.00 0.00 H ATOM 2410 N ALA A 173 5.581 -4.513 9.659 1.00 26.18 N ATOM 2411 CA ALA A 173 5.010 -5.840 9.773 1.00 26.71 C ATOM 2412 C ALA A 173 5.309 -6.453 11.134 1.00 27.64 C ATOM 2413 O ALA A 173 4.427 -6.983 11.781 1.00 24.73 O ATOM 2414 CB ALA A 173 5.523 -6.736 8.650 1.00 26.13 C ATOM 2415 HA ALA A 173 3.927 -5.753 9.680 1.00 0.00 H ATOM 2416 HB1 ALA A 173 5.241 -6.308 7.688 1.00 0.00 H ATOM 2417 HB2 ALA A 173 6.609 -6.809 8.712 1.00 0.00 H ATOM 2418 HB3 ALA A 173 5.085 -7.729 8.750 1.00 0.00 H ATOM 2419 H ALA A 173 6.426 -4.366 9.070 1.00 0.00 H ATOM 2420 N ASP A 174 6.559 -6.385 11.567 1.00 25.76 N ATOM 2421 CA ASP A 174 6.958 -7.096 12.804 1.00 27.44 C ATOM 2422 C ASP A 174 6.271 -6.518 14.043 1.00 28.45 C ATOM 2423 O ASP A 174 6.058 -7.232 15.023 1.00 29.46 O ATOM 2424 CB ASP A 174 8.501 -7.084 13.001 1.00 28.20 C ATOM 2425 CG ASP A 174 9.249 -7.785 11.863 1.00 25.56 C ATOM 2426 OD1 ASP A 174 8.593 -8.519 11.100 1.00 17.25 O ATOM 2427 OD2 ASP A 174 10.471 -7.597 11.717 1.00 25.37 O ATOM 2428 HA ASP A 174 6.631 -8.129 12.683 1.00 0.00 H ATOM 2429 HB2 ASP A 174 8.838 -6.049 13.054 1.00 0.00 H ATOM 2430 HB3 ASP A 174 8.737 -7.590 13.937 1.00 0.00 H ATOM 2431 H ASP A 174 7.262 -5.831 11.037 1.00 0.00 H ATOM 2432 N PHE A 175 5.939 -5.219 13.994 1.00 28.47 N ATOM 2433 CA PHE A 175 5.311 -4.514 15.122 1.00 26.68 C ATOM 2434 C PHE A 175 3.810 -4.300 14.949 1.00 24.41 C ATOM 2435 O PHE A 175 3.212 -3.618 15.757 1.00 26.27 O ATOM 2436 CB PHE A 175 5.982 -3.132 15.378 1.00 25.92 C ATOM 2437 CG PHE A 175 7.405 -3.202 15.938 1.00 18.66 C ATOM 2438 CD1 PHE A 175 7.922 -4.375 16.472 1.00 17.07 C ATOM 2439 CD2 PHE A 175 8.178 -2.048 16.024 1.00 19.32 C ATOM 2440 CE1 PHE A 175 9.210 -4.434 17.020 1.00 19.16 C ATOM 2441 CE2 PHE A 175 9.496 -2.081 16.602 1.00 23.33 C ATOM 2442 CZ PHE A 175 10.012 -3.281 17.083 1.00 19.92 C ATOM 2443 HA PHE A 175 5.462 -5.170 15.979 1.00 0.00 H ATOM 2444 HB2 PHE A 175 6.016 -2.591 14.432 1.00 0.00 H ATOM 2445 HB3 PHE A 175 5.365 -2.582 16.088 1.00 0.00 H ATOM 2446 HD2 PHE A 175 7.780 -1.106 15.648 1.00 0.00 H ATOM 2447 HE2 PHE A 175 10.089 -1.168 16.663 1.00 0.00 H ATOM 2448 HZ PHE A 175 11.018 -3.326 17.500 1.00 0.00 H ATOM 2449 HE1 PHE A 175 9.593 -5.381 17.400 1.00 0.00 H ATOM 2450 HD1 PHE A 175 7.308 -5.276 16.465 1.00 0.00 H ATOM 2451 H PHE A 175 6.134 -4.688 13.121 1.00 0.00 H ATOM 2452 N ASN A 176 3.224 -4.843 13.882 1.00 30.86 N ATOM 2453 CA ASN A 176 1.801 -4.735 13.605 1.00 24.86 C ATOM 2454 C ASN A 176 1.334 -3.292 13.457 1.00 35.41 C ATOM 2455 O ASN A 176 0.204 -2.991 13.849 1.00 42.46 O ATOM 2456 CB ASN A 176 1.019 -5.407 14.726 1.00 26.53 C ATOM 2457 CG ASN A 176 1.380 -6.878 14.855 1.00 28.03 C ATOM 2458 OD1 ASN A 176 2.325 -7.259 15.538 1.00 34.54 O ATOM 2459 ND2 ASN A 176 0.663 -7.691 14.162 1.00 19.15 N ATOM 2460 HA ASN A 176 1.618 -5.231 12.652 1.00 0.00 H ATOM 2461 HB2 ASN A 176 1.244 -4.903 15.666 1.00 0.00 H ATOM 2462 HB3 ASN A 176 -0.047 -5.321 14.515 1.00 0.00 H ATOM 2463 HD22 ASN A 176 -0.131 -7.330 13.595 1.00 0.00 H ATOM 2464 HD21 ASN A 176 0.877 -8.709 14.169 1.00 0.00 H ATOM 2465 H ASN A 176 3.817 -5.373 13.211 1.00 0.00 H ATOM 2466 N LEU A 177 2.166 -2.397 12.898 1.00 33.45 N ATOM 2467 CA LEU A 177 1.777 -0.962 12.803 1.00 31.23 C ATOM 2468 C LEU A 177 0.730 -0.788 11.778 1.00 32.72 C ATOM 2469 O LEU A 177 0.825 -1.347 10.679 1.00 29.73 O ATOM 2470 CB LEU A 177 2.946 -0.032 12.433 1.00 29.16 C ATOM 2471 CG LEU A 177 4.206 -0.289 13.227 1.00 28.58 C ATOM 2472 CD1 LEU A 177 5.307 0.669 12.827 1.00 22.44 C ATOM 2473 CD2 LEU A 177 3.812 -0.154 14.670 1.00 24.02 C ATOM 2474 HA LEU A 177 1.422 -0.687 13.796 1.00 0.00 H ATOM 2475 HB2 LEU A 177 3.172 -0.168 11.375 1.00 0.00 H ATOM 2476 HB3 LEU A 177 2.634 0.998 12.607 1.00 0.00 H ATOM 2477 HG LEU A 177 4.615 -1.281 13.037 1.00 0.00 H ATOM 2478 HD21 LEU A 177 3.429 0.851 14.848 1.00 0.00 H ATOM 2479 HD22 LEU A 177 3.039 -0.886 14.904 1.00 0.00 H ATOM 2480 HD23 LEU A 177 4.683 -0.329 15.301 1.00 0.00 H ATOM 2481 HD11 LEU A 177 5.530 0.542 11.768 1.00 0.00 H ATOM 2482 HD12 LEU A 177 4.981 1.693 13.011 1.00 0.00 H ATOM 2483 HD13 LEU A 177 6.200 0.460 13.415 1.00 0.00 H ATOM 2484 H LEU A 177 3.087 -2.708 12.529 1.00 0.00 H ATOM 2485 N ASP A 178 -0.273 0.004 12.125 1.00 39.00 N ATOM 2486 CA ASP A 178 -1.417 0.126 11.255 1.00 45.21 C ATOM 2487 C ASP A 178 -1.125 1.324 10.375 1.00 45.86 C ATOM 2488 O ASP A 178 -1.463 2.440 10.743 1.00 44.58 O ATOM 2489 CB ASP A 178 -2.689 0.340 12.066 1.00 48.14 C ATOM 2490 CG ASP A 178 -3.947 -0.109 11.300 1.00 63.98 C ATOM 2491 OD1 ASP A 178 -3.993 -1.265 10.781 1.00 70.35 O ATOM 2492 OD2 ASP A 178 -4.905 0.693 11.213 1.00 69.23 O ATOM 2493 HA ASP A 178 -1.578 -0.776 10.664 1.00 0.00 H ATOM 2494 HB2 ASP A 178 -2.617 -0.233 12.991 1.00 0.00 H ATOM 2495 HB3 ASP A 178 -2.781 1.400 12.303 1.00 0.00 H ATOM 2496 H ASP A 178 -0.236 0.534 13.019 1.00 0.00 H ATOM 2497 N VAL A 179 -0.429 1.097 9.264 1.00 34.64 N ATOM 2498 CA VAL A 179 -0.011 2.176 8.358 1.00 31.57 C ATOM 2499 C VAL A 179 0.394 1.446 7.102 1.00 32.76 C ATOM 2500 O VAL A 179 0.913 0.315 7.149 1.00 33.02 O ATOM 2501 CB VAL A 179 1.218 3.043 8.909 1.00 33.56 C ATOM 2502 CG1 VAL A 179 2.384 2.173 9.254 1.00 23.49 C ATOM 2503 CG2 VAL A 179 1.689 4.103 7.920 1.00 24.77 C ATOM 2504 HA VAL A 179 -0.814 2.900 8.222 1.00 0.00 H ATOM 2505 HB VAL A 179 0.842 3.544 9.801 1.00 0.00 H ATOM 2506 HG11 VAL A 179 2.089 1.460 10.024 1.00 0.00 H ATOM 2507 HG12 VAL A 179 2.710 1.634 8.364 1.00 0.00 H ATOM 2508 HG13 VAL A 179 3.201 2.792 9.625 1.00 0.00 H ATOM 2509 HG21 VAL A 179 2.011 3.620 6.997 1.00 0.00 H ATOM 2510 HG22 VAL A 179 0.869 4.788 7.706 1.00 0.00 H ATOM 2511 HG23 VAL A 179 2.523 4.656 8.352 1.00 0.00 H ATOM 2512 H VAL A 179 -0.171 0.118 9.027 1.00 0.00 H ATOM 2513 N ALA A 180 0.130 2.072 5.974 1.00 29.60 N ATOM 2514 CA ALA A 180 0.536 1.526 4.701 1.00 24.59 C ATOM 2515 C ALA A 180 1.842 2.225 4.337 1.00 28.98 C ATOM 2516 O ALA A 180 1.931 3.481 4.431 1.00 23.32 O ATOM 2517 CB ALA A 180 -0.564 1.828 3.660 1.00 23.02 C ATOM 2518 HA ALA A 180 0.680 0.446 4.733 1.00 0.00 H ATOM 2519 HB1 ALA A 180 -1.500 1.369 3.979 1.00 0.00 H ATOM 2520 HB2 ALA A 180 -0.697 2.907 3.576 1.00 0.00 H ATOM 2521 HB3 ALA A 180 -0.269 1.420 2.693 1.00 0.00 H ATOM 2522 H ALA A 180 -0.381 2.977 6.001 1.00 0.00 H ATOM 2523 N VAL A 181 2.825 1.413 3.900 1.00 27.42 N ATOM 2524 CA VAL A 181 4.130 1.887 3.417 1.00 19.03 C ATOM 2525 C VAL A 181 4.174 1.936 1.882 1.00 24.30 C ATOM 2526 O VAL A 181 4.177 0.915 1.220 1.00 24.12 O ATOM 2527 CB VAL A 181 5.300 0.989 3.915 1.00 17.34 C ATOM 2528 CG1 VAL A 181 6.665 1.505 3.430 1.00 11.56 C ATOM 2529 CG2 VAL A 181 5.333 0.920 5.405 1.00 16.65 C ATOM 2530 HA VAL A 181 4.254 2.891 3.823 1.00 0.00 H ATOM 2531 HB VAL A 181 5.119 -0.002 3.499 1.00 0.00 H ATOM 2532 HG11 VAL A 181 6.682 1.515 2.340 1.00 0.00 H ATOM 2533 HG12 VAL A 181 6.825 2.515 3.807 1.00 0.00 H ATOM 2534 HG13 VAL A 181 7.453 0.849 3.800 1.00 0.00 H ATOM 2535 HG21 VAL A 181 5.467 1.923 5.811 1.00 0.00 H ATOM 2536 HG22 VAL A 181 4.395 0.502 5.769 1.00 0.00 H ATOM 2537 HG23 VAL A 181 6.161 0.285 5.720 1.00 0.00 H ATOM 2538 H VAL A 181 2.649 0.388 3.905 1.00 0.00 H ATOM 2539 N VAL A 182 4.285 3.138 1.329 1.00 29.18 N ATOM 2540 CA VAL A 182 4.309 3.325 -0.114 1.00 27.43 C ATOM 2541 C VAL A 182 5.715 3.621 -0.583 1.00 27.34 C ATOM 2542 O VAL A 182 6.267 4.619 -0.237 1.00 30.55 O ATOM 2543 CB VAL A 182 3.388 4.473 -0.482 1.00 26.62 C ATOM 2544 CG1 VAL A 182 3.431 4.738 -1.941 1.00 22.84 C ATOM 2545 CG2 VAL A 182 1.941 4.137 -0.041 1.00 24.90 C ATOM 2546 HA VAL A 182 3.969 2.411 -0.601 1.00 0.00 H ATOM 2547 HB VAL A 182 3.725 5.372 0.034 1.00 0.00 H ATOM 2548 HG11 VAL A 182 4.449 4.997 -2.232 1.00 0.00 H ATOM 2549 HG12 VAL A 182 3.113 3.846 -2.481 1.00 0.00 H ATOM 2550 HG13 VAL A 182 2.762 5.565 -2.179 1.00 0.00 H ATOM 2551 HG21 VAL A 182 1.610 3.229 -0.546 1.00 0.00 H ATOM 2552 HG22 VAL A 182 1.918 3.984 1.038 1.00 0.00 H ATOM 2553 HG23 VAL A 182 1.281 4.963 -0.306 1.00 0.00 H ATOM 2554 H VAL A 182 4.357 3.972 1.946 1.00 0.00 H ATOM 2555 N GLY A 183 6.318 2.745 -1.364 1.00 29.61 N ATOM 2556 CA GLY A 183 7.624 3.086 -1.886 1.00 22.18 C ATOM 2557 C GLY A 183 7.437 3.790 -3.208 1.00 23.84 C ATOM 2558 O GLY A 183 6.618 3.389 -4.021 1.00 27.00 O ATOM 2559 HA3 GLY A 183 8.212 2.179 -2.031 1.00 0.00 H ATOM 2560 HA2 GLY A 183 8.140 3.744 -1.187 1.00 0.00 H ATOM 2561 H GLY A 183 5.868 1.837 -1.597 1.00 0.00 H ATOM 2562 N VAL A 184 8.207 4.847 -3.422 1.00 30.19 N ATOM 2563 CA VAL A 184 8.052 5.706 -4.554 1.00 26.51 C ATOM 2564 C VAL A 184 9.294 5.599 -5.458 1.00 33.72 C ATOM 2565 O VAL A 184 10.446 5.693 -4.983 1.00 40.92 O ATOM 2566 CB VAL A 184 7.784 7.061 -4.028 1.00 26.78 C ATOM 2567 CG1 VAL A 184 7.710 8.103 -5.129 1.00 34.10 C ATOM 2568 CG2 VAL A 184 6.499 7.006 -3.370 1.00 28.21 C ATOM 2569 HA VAL A 184 7.215 5.425 -5.194 1.00 0.00 H ATOM 2570 HB VAL A 184 8.594 7.348 -3.358 1.00 0.00 H ATOM 2571 HG11 VAL A 184 8.658 8.130 -5.666 1.00 0.00 H ATOM 2572 HG12 VAL A 184 6.907 7.844 -5.819 1.00 0.00 H ATOM 2573 HG13 VAL A 184 7.511 9.081 -4.690 1.00 0.00 H ATOM 2574 HG21 VAL A 184 5.736 6.712 -4.090 1.00 0.00 H ATOM 2575 HG22 VAL A 184 6.537 6.277 -2.561 1.00 0.00 H ATOM 2576 HG23 VAL A 184 6.258 7.988 -2.964 1.00 0.00 H ATOM 2577 H VAL A 184 8.958 5.061 -2.735 1.00 0.00 H ATOM 2578 N PRO A 185 9.074 5.392 -6.768 1.00 34.49 N ATOM 2579 CA PRO A 185 10.221 5.127 -7.639 1.00 33.76 C ATOM 2580 C PRO A 185 11.120 6.330 -7.745 1.00 34.75 C ATOM 2581 O PRO A 185 10.654 7.496 -7.684 1.00 27.22 O ATOM 2582 CB PRO A 185 9.593 4.808 -9.009 1.00 29.88 C ATOM 2583 CG PRO A 185 8.225 5.338 -8.978 1.00 26.63 C ATOM 2584 CD PRO A 185 7.796 5.423 -7.521 1.00 37.44 C ATOM 2585 HA PRO A 185 10.843 4.318 -7.257 1.00 0.00 H ATOM 2586 HD3 PRO A 185 7.255 6.350 -7.329 1.00 0.00 H ATOM 2587 HD2 PRO A 185 7.167 4.575 -7.252 1.00 0.00 H ATOM 2588 HG3 PRO A 185 7.556 4.673 -9.524 1.00 0.00 H ATOM 2589 HG2 PRO A 185 8.200 6.329 -9.431 1.00 0.00 H ATOM 2590 HB2 PRO A 185 10.164 5.286 -9.805 1.00 0.00 H ATOM 2591 HB3 PRO A 185 9.575 3.731 -9.173 1.00 0.00 H ATOM 2592 N THR A 186 12.407 6.022 -7.901 1.00 33.56 N ATOM 2593 CA THR A 186 13.492 7.006 -7.894 1.00 30.05 C ATOM 2594 C THR A 186 13.249 8.101 -8.918 1.00 33.07 C ATOM 2595 O THR A 186 12.672 7.834 -9.974 1.00 31.67 O ATOM 2596 CB THR A 186 14.775 6.290 -8.248 1.00 30.99 C ATOM 2597 OG1 THR A 186 14.916 5.212 -7.336 1.00 31.34 O ATOM 2598 CG2 THR A 186 16.011 7.210 -8.155 1.00 28.98 C ATOM 2599 HA THR A 186 13.548 7.465 -6.907 1.00 0.00 H ATOM 2600 HB THR A 186 14.719 5.948 -9.281 1.00 0.00 H ATOM 2601 HG1 THR A 186 15.749 4.717 -7.538 1.00 0.00 H ATOM 2602 HG23 THR A 186 15.900 8.037 -8.856 1.00 0.00 H ATOM 2603 HG21 THR A 186 16.096 7.601 -7.141 1.00 0.00 H ATOM 2604 HG22 THR A 186 16.906 6.640 -8.402 1.00 0.00 H ATOM 2605 H THR A 186 12.656 5.021 -8.036 1.00 0.00 H ATOM 2606 N VAL A 187 13.723 9.309 -8.641 1.00 34.10 N ATOM 2607 CA VAL A 187 13.562 10.429 -9.591 1.00 37.72 C ATOM 2608 C VAL A 187 14.940 10.750 -10.133 1.00 39.38 C ATOM 2609 O VAL A 187 15.896 10.820 -9.360 1.00 34.09 O ATOM 2610 CB VAL A 187 12.847 11.633 -8.931 1.00 36.42 C ATOM 2611 CG1 VAL A 187 12.996 12.933 -9.750 1.00 39.62 C ATOM 2612 CG2 VAL A 187 11.384 11.273 -8.735 1.00 30.58 C ATOM 2613 HA VAL A 187 12.912 10.158 -10.423 1.00 0.00 H ATOM 2614 HB VAL A 187 13.317 11.834 -7.968 1.00 0.00 H ATOM 2615 HG11 VAL A 187 14.053 13.182 -9.845 1.00 0.00 H ATOM 2616 HG12 VAL A 187 12.565 12.788 -10.740 1.00 0.00 H ATOM 2617 HG13 VAL A 187 12.475 13.744 -9.240 1.00 0.00 H ATOM 2618 HG21 VAL A 187 10.932 11.055 -9.703 1.00 0.00 H ATOM 2619 HG22 VAL A 187 11.310 10.396 -8.092 1.00 0.00 H ATOM 2620 HG23 VAL A 187 10.864 12.111 -8.270 1.00 0.00 H ATOM 2621 H VAL A 187 14.216 9.470 -7.740 1.00 0.00 H ATOM 2622 N ARG A 188 15.032 10.910 -11.461 1.00 41.78 N ATOM 2623 CA ARG A 188 16.338 10.921 -12.186 1.00 39.66 C ATOM 2624 C ARG A 188 16.593 12.214 -12.979 1.00 36.27 C ATOM 2625 O ARG A 188 15.672 12.826 -13.516 1.00 38.61 O ATOM 2626 CB ARG A 188 16.440 9.693 -13.112 1.00 37.84 C ATOM 2627 CG ARG A 188 16.663 8.381 -12.337 1.00 36.93 C ATOM 2628 CD ARG A 188 16.817 7.141 -13.249 1.00 28.01 C ATOM 2629 NE ARG A 188 16.460 5.945 -12.515 1.00 27.58 N ATOM 2630 CZ ARG A 188 17.267 5.258 -11.707 1.00 31.32 C ATOM 2631 NH1 ARG A 188 18.526 5.622 -11.552 1.00 26.49 N ATOM 2632 NH2 ARG A 188 16.809 4.184 -11.047 1.00 34.90 N ATOM 2633 HA ARG A 188 17.115 10.877 -11.423 1.00 0.00 H ATOM 2634 HB2 ARG A 188 15.515 9.608 -13.683 1.00 0.00 H ATOM 2635 HB3 ARG A 188 17.275 9.840 -13.796 1.00 0.00 H ATOM 2636 HG2 ARG A 188 17.568 8.484 -11.739 1.00 0.00 H ATOM 2637 HG3 ARG A 188 15.810 8.221 -11.678 1.00 0.00 H ATOM 2638 HD2 ARG A 188 17.851 7.065 -13.585 1.00 0.00 H ATOM 2639 HD3 ARG A 188 16.162 7.244 -14.114 1.00 0.00 H ATOM 2640 HE ARG A 188 15.489 5.591 -12.628 1.00 0.00 H ATOM 2641 HH12 ARG A 188 19.150 5.081 -10.920 1.00 0.00 H ATOM 2642 HH11 ARG A 188 18.894 6.450 -12.062 1.00 0.00 H ATOM 2643 HH22 ARG A 188 17.443 3.651 -10.418 1.00 0.00 H ATOM 2644 HH21 ARG A 188 15.820 3.884 -11.165 1.00 0.00 H ATOM 2645 H ARG A 188 14.157 11.032 -12.010 1.00 0.00 H ATOM 2646 N GLU A 189 17.838 12.640 -13.044 1.00 35.76 N ATOM 2647 CA GLU A 189 18.197 13.715 -13.961 1.00 40.78 C ATOM 2648 C GLU A 189 18.007 13.179 -15.381 1.00 44.70 C ATOM 2649 O GLU A 189 17.883 11.949 -15.562 1.00 42.88 O ATOM 2650 CB GLU A 189 19.649 14.110 -13.771 1.00 45.65 C ATOM 2651 CG GLU A 189 20.114 14.125 -12.337 1.00 53.05 C ATOM 2652 CD GLU A 189 20.239 15.527 -11.779 1.00 59.78 C ATOM 2653 OE1 GLU A 189 19.456 16.409 -12.235 1.00 64.69 O ATOM 2654 OE2 GLU A 189 21.112 15.726 -10.880 1.00 60.95 O ATOM 2655 HA GLU A 189 17.575 14.591 -13.777 1.00 0.00 H ATOM 2656 HB2 GLU A 189 20.269 13.403 -14.322 1.00 0.00 H ATOM 2657 HB3 GLU A 189 19.786 15.110 -14.183 1.00 0.00 H ATOM 2658 HG2 GLU A 189 19.397 13.571 -11.732 1.00 0.00 H ATOM 2659 HG3 GLU A 189 21.088 13.639 -12.281 1.00 0.00 H ATOM 2660 H GLU A 189 18.566 12.208 -12.440 1.00 0.00 H ATOM 2661 N ALA A 190 17.991 14.077 -16.378 1.00 42.90 N ATOM 2662 CA ALA A 190 17.697 13.690 -17.775 1.00 42.64 C ATOM 2663 C ALA A 190 18.688 12.609 -18.352 1.00 39.47 C ATOM 2664 O ALA A 190 18.325 11.797 -19.185 1.00 35.39 O ATOM 2665 CB ALA A 190 17.581 14.952 -18.695 1.00 38.02 C ATOM 2666 HA ALA A 190 16.725 13.198 -17.763 1.00 0.00 H ATOM 2667 HB1 ALA A 190 16.776 15.592 -18.332 1.00 0.00 H ATOM 2668 HB2 ALA A 190 18.522 15.502 -18.675 1.00 0.00 H ATOM 2669 HB3 ALA A 190 17.365 14.637 -19.716 1.00 0.00 H ATOM 2670 H ALA A 190 18.191 15.074 -16.162 1.00 0.00 H ATOM 2671 N ASP A 191 19.916 12.579 -17.867 1.00 38.03 N ATOM 2672 CA ASP A 191 20.840 11.535 -18.267 1.00 44.10 C ATOM 2673 C ASP A 191 20.631 10.237 -17.450 1.00 42.74 C ATOM 2674 O ASP A 191 21.293 9.248 -17.700 1.00 49.33 O ATOM 2675 CB ASP A 191 22.302 12.023 -18.076 1.00 44.32 C ATOM 2676 CG ASP A 191 22.650 12.230 -16.597 1.00 49.52 C ATOM 2677 OD1 ASP A 191 21.694 12.491 -15.820 1.00 51.66 O ATOM 2678 OD2 ASP A 191 23.847 12.123 -16.199 1.00 47.27 O ATOM 2679 HA ASP A 191 20.648 11.314 -19.317 1.00 0.00 H ATOM 2680 HB2 ASP A 191 22.979 11.280 -18.496 1.00 0.00 H ATOM 2681 HB3 ASP A 191 22.430 12.968 -18.603 1.00 0.00 H ATOM 2682 H ASP A 191 20.223 13.309 -17.193 1.00 0.00 H ATOM 2683 N GLY A 192 19.777 10.234 -16.440 1.00 39.33 N ATOM 2684 CA GLY A 192 19.617 9.015 -15.631 1.00 37.31 C ATOM 2685 C GLY A 192 20.215 8.946 -14.213 1.00 34.09 C ATOM 2686 O GLY A 192 19.923 8.021 -13.463 1.00 33.11 O ATOM 2687 HA3 GLY A 192 20.062 8.199 -16.200 1.00 0.00 H ATOM 2688 HA2 GLY A 192 18.545 8.843 -15.529 1.00 0.00 H ATOM 2689 H GLY A 192 19.223 11.086 -16.219 1.00 0.00 H ATOM 2690 N LEU A 193 21.055 9.905 -13.846 1.00 33.75 N ATOM 2691 CA LEU A 193 21.621 9.962 -12.496 1.00 33.53 C ATOM 2692 C LEU A 193 20.558 10.114 -11.386 1.00 32.68 C ATOM 2693 O LEU A 193 19.691 10.996 -11.462 1.00 35.96 O ATOM 2694 CB LEU A 193 22.591 11.123 -12.415 1.00 31.30 C ATOM 2695 CG LEU A 193 23.251 11.247 -11.041 1.00 32.51 C ATOM 2696 CD1 LEU A 193 24.204 10.073 -10.701 1.00 25.25 C ATOM 2697 CD2 LEU A 193 23.957 12.574 -10.943 1.00 27.42 C ATOM 2698 HA LEU A 193 22.122 9.009 -12.324 1.00 0.00 H ATOM 2699 HB2 LEU A 193 23.370 10.980 -13.164 1.00 0.00 H ATOM 2700 HB3 LEU A 193 22.050 12.045 -12.627 1.00 0.00 H ATOM 2701 HG LEU A 193 22.458 11.195 -10.295 1.00 0.00 H ATOM 2702 HD21 LEU A 193 24.718 12.637 -11.720 1.00 0.00 H ATOM 2703 HD22 LEU A 193 23.234 13.379 -11.074 1.00 0.00 H ATOM 2704 HD23 LEU A 193 24.427 12.662 -9.964 1.00 0.00 H ATOM 2705 HD11 LEU A 193 23.644 9.138 -10.710 1.00 0.00 H ATOM 2706 HD12 LEU A 193 25.002 10.028 -11.443 1.00 0.00 H ATOM 2707 HD13 LEU A 193 24.634 10.231 -9.712 1.00 0.00 H ATOM 2708 H LEU A 193 21.319 10.637 -14.536 1.00 0.00 H ATOM 2709 N ALA A 194 20.611 9.275 -10.353 1.00 31.10 N ATOM 2710 CA ALA A 194 19.562 9.367 -9.293 1.00 38.49 C ATOM 2711 C ALA A 194 19.709 10.696 -8.557 1.00 37.97 C ATOM 2712 O ALA A 194 20.825 11.037 -8.151 1.00 43.40 O ATOM 2713 CB ALA A 194 19.628 8.171 -8.321 1.00 28.68 C ATOM 2714 HA ALA A 194 18.580 9.327 -9.764 1.00 0.00 H ATOM 2715 HB1 ALA A 194 19.476 7.245 -8.876 1.00 0.00 H ATOM 2716 HB2 ALA A 194 20.605 8.151 -7.838 1.00 0.00 H ATOM 2717 HB3 ALA A 194 18.849 8.275 -7.565 1.00 0.00 H ATOM 2718 H ALA A 194 21.370 8.567 -10.285 1.00 0.00 H ATOM 2719 N MET A 195 18.630 11.471 -8.450 1.00 42.24 N ATOM 2720 CA MET A 195 18.678 12.753 -7.710 1.00 47.64 C ATOM 2721 C MET A 195 19.083 12.549 -6.235 1.00 52.33 C ATOM 2722 O MET A 195 18.543 11.694 -5.517 1.00 55.24 O ATOM 2723 CB MET A 195 17.350 13.496 -7.792 1.00 43.30 C ATOM 2724 CG MET A 195 17.078 14.110 -9.118 1.00 44.16 C ATOM 2725 SD MET A 195 16.229 15.698 -8.976 1.00 51.59 S ATOM 2726 CE MET A 195 15.889 16.069 -10.732 1.00 42.16 C ATOM 2727 HA MET A 195 19.444 13.362 -8.190 1.00 0.00 H ATOM 2728 HB2 MET A 195 16.549 12.791 -7.570 1.00 0.00 H ATOM 2729 HB3 MET A 195 17.354 14.287 -7.042 1.00 0.00 H ATOM 2730 HG2 MET A 195 16.455 13.430 -9.699 1.00 0.00 H ATOM 2731 HG3 MET A 195 18.025 14.264 -9.635 1.00 0.00 H ATOM 2732 HE1 MET A 195 16.830 16.126 -11.279 1.00 0.00 H ATOM 2733 HE2 MET A 195 15.268 15.279 -11.155 1.00 0.00 H ATOM 2734 HE3 MET A 195 15.366 17.023 -10.806 1.00 0.00 H ATOM 2735 H MET A 195 17.739 11.170 -8.894 1.00 0.00 H ATOM 2736 N SER A 196 20.078 13.293 -5.784 1.00 55.65 N ATOM 2737 CA SER A 196 20.502 13.161 -4.399 1.00 58.37 C ATOM 2738 C SER A 196 21.014 14.508 -4.029 1.00 60.61 C ATOM 2739 O SER A 196 21.411 15.276 -4.905 1.00 60.82 O ATOM 2740 CB SER A 196 21.585 12.089 -4.214 1.00 52.76 C ATOM 2741 OG SER A 196 21.734 11.735 -2.835 1.00 48.94 O ATOM 2742 HA SER A 196 19.677 12.837 -3.765 1.00 0.00 H ATOM 2743 HB2 SER A 196 22.534 12.474 -4.587 1.00 0.00 H ATOM 2744 HB3 SER A 196 21.307 11.201 -4.781 1.00 0.00 H ATOM 2745 HG SER A 196 22.437 11.044 -2.747 1.00 0.00 H ATOM 2746 H SER A 196 20.555 13.968 -6.415 1.00 0.00 H ATOM 2747 N SER A 197 20.969 14.819 -2.741 1.00 68.95 N ATOM 2748 CA SER A 197 21.583 16.048 -2.266 1.00 73.61 C ATOM 2749 C SER A 197 23.074 15.949 -2.626 1.00 75.54 C ATOM 2750 O SER A 197 23.622 16.859 -3.263 1.00 72.94 O ATOM 2751 CB SER A 197 21.370 16.204 -0.761 1.00 74.74 C ATOM 2752 OG SER A 197 21.923 15.087 -0.076 1.00 80.70 O ATOM 2753 HA SER A 197 21.138 16.929 -2.728 1.00 0.00 H ATOM 2754 HB2 SER A 197 20.302 16.265 -0.551 1.00 0.00 H ATOM 2755 HB3 SER A 197 21.859 17.116 -0.419 1.00 0.00 H ATOM 2756 HG SER A 197 21.781 15.195 0.898 1.00 0.00 H ATOM 2757 H SER A 197 20.494 14.183 -2.070 1.00 0.00 H ATOM 2758 N ARG A 198 23.689 14.807 -2.273 1.00 76.17 N ATOM 2759 CA ARG A 198 25.122 14.549 -2.496 1.00 74.92 C ATOM 2760 C ARG A 198 25.692 14.917 -3.892 1.00 75.60 C ATOM 2761 O ARG A 198 26.878 15.228 -4.005 1.00 72.94 O ATOM 2762 CB ARG A 198 25.482 13.113 -2.100 1.00 73.10 C ATOM 2763 CG ARG A 198 26.310 13.053 -0.832 1.00 75.23 C ATOM 2764 CD ARG A 198 25.505 12.726 0.437 1.00 73.38 C ATOM 2765 NE ARG A 198 25.521 11.293 0.752 1.00 72.72 N ATOM 2766 CZ ARG A 198 26.600 10.592 1.120 1.00 71.56 C ATOM 2767 NH1 ARG A 198 27.789 11.185 1.208 1.00 72.04 N ATOM 2768 NH2 ARG A 198 26.502 9.286 1.384 1.00 65.48 N ATOM 2769 HA ARG A 198 25.622 15.257 -1.835 1.00 0.00 H ATOM 2770 HB2 ARG A 198 24.561 12.551 -1.944 1.00 0.00 H ATOM 2771 HB3 ARG A 198 26.050 12.658 -2.911 1.00 0.00 H ATOM 2772 HG2 ARG A 198 27.074 12.286 -0.959 1.00 0.00 H ATOM 2773 HG3 ARG A 198 26.790 14.022 -0.692 1.00 0.00 H ATOM 2774 HD2 ARG A 198 24.472 13.041 0.288 1.00 0.00 H ATOM 2775 HD3 ARG A 198 25.934 13.275 1.276 1.00 0.00 H ATOM 2776 HE ARG A 198 24.619 10.780 0.684 1.00 0.00 H ATOM 2777 HH12 ARG A 198 28.624 10.635 1.494 1.00 0.00 H ATOM 2778 HH11 ARG A 198 27.882 12.198 0.990 1.00 0.00 H ATOM 2779 HH22 ARG A 198 27.345 8.748 1.669 1.00 0.00 H ATOM 2780 HH21 ARG A 198 25.582 8.807 1.304 1.00 0.00 H ATOM 2781 H ARG A 198 23.121 14.064 -1.817 1.00 0.00 H ATOM 2782 N ASN A 199 24.844 14.905 -4.930 1.00 75.46 N ATOM 2783 CA ASN A 199 25.246 15.283 -6.301 1.00 74.13 C ATOM 2784 C ASN A 199 25.554 16.770 -6.450 1.00 75.56 C ATOM 2785 O ASN A 199 26.041 17.187 -7.509 1.00 77.92 O ATOM 2786 CB ASN A 199 24.163 14.949 -7.350 1.00 75.55 C ATOM 2787 CG ASN A 199 23.649 13.508 -7.282 1.00 73.57 C ATOM 2788 OD1 ASN A 199 24.245 12.632 -6.649 1.00 75.18 O ATOM 2789 ND2 ASN A 199 22.523 13.265 -7.956 1.00 72.86 N ATOM 2790 HA ASN A 199 26.147 14.696 -6.477 1.00 0.00 H ATOM 2791 HB2 ASN A 199 23.319 15.621 -7.197 1.00 0.00 H ATOM 2792 HB3 ASN A 199 24.584 15.116 -8.342 1.00 0.00 H ATOM 2793 HD22 ASN A 199 22.053 14.033 -8.477 1.00 0.00 H ATOM 2794 HD21 ASN A 199 22.116 12.308 -7.961 1.00 0.00 H ATOM 2795 H ASN A 199 23.859 14.617 -4.763 1.00 0.00 H ATOM 2796 N ARG A 200 25.205 17.570 -5.435 1.00 74.55 N ATOM 2797 CA ARG A 200 25.642 18.964 -5.359 1.00 71.98 C ATOM 2798 C ARG A 200 27.186 18.966 -5.330 1.00 71.97 C ATOM 2799 O ARG A 200 27.802 19.599 -6.209 1.00 68.52 O ATOM 2800 CB ARG A 200 25.034 19.692 -4.150 1.00 68.44 C ATOM 2801 HA ARG A 200 25.289 19.516 -6.230 1.00 0.00 H ATOM 2802 HB2 ARG A 200 23.947 19.679 -4.229 1.00 0.00 H ATOM 2803 HB3 ARG A 200 25.339 19.188 -3.233 1.00 0.00 H ATOM 2804 H ARG A 200 24.604 17.188 -4.677 1.00 0.00 H ATOM 2805 N TYR A 201 27.792 18.253 -4.351 1.00 66.70 N ATOM 2806 CA TYR A 201 29.228 17.855 -4.399 1.00 68.33 C ATOM 2807 C TYR A 201 29.437 17.187 -5.786 1.00 71.97 C ATOM 2808 O TYR A 201 28.464 16.626 -6.330 1.00 75.95 O ATOM 2809 CB TYR A 201 29.608 16.887 -3.236 1.00 54.94 C ATOM 2810 HA TYR A 201 29.876 18.722 -4.272 1.00 0.00 H ATOM 2811 HB3 TYR A 201 29.002 15.983 -3.304 1.00 0.00 H ATOM 2812 HB2 TYR A 201 29.423 17.378 -2.281 1.00 0.00 H ATOM 2813 H TYR A 201 27.228 17.969 -3.525 1.00 0.00 H ATOM 2814 N LEU A 202 30.640 17.281 -6.380 1.00 65.97 N ATOM 2815 CA LEU A 202 30.990 16.582 -7.647 1.00 65.42 C ATOM 2816 C LEU A 202 31.378 17.569 -8.722 1.00 66.87 C ATOM 2817 O LEU A 202 30.508 18.248 -9.272 1.00 65.25 O ATOM 2818 CB LEU A 202 29.870 15.651 -8.230 1.00 63.30 C ATOM 2819 CG LEU A 202 29.413 14.223 -7.776 1.00 60.59 C ATOM 2820 CD1 LEU A 202 28.315 13.683 -8.675 1.00 57.56 C ATOM 2821 CD2 LEU A 202 30.511 13.182 -7.647 1.00 54.23 C ATOM 2822 HA LEU A 202 31.826 15.942 -7.366 1.00 0.00 H ATOM 2823 HB2 LEU A 202 28.964 16.253 -8.168 1.00 0.00 H ATOM 2824 HB3 LEU A 202 30.148 15.522 -9.276 1.00 0.00 H ATOM 2825 HG LEU A 202 29.043 14.388 -6.764 1.00 0.00 H ATOM 2826 HD21 LEU A 202 31.001 13.051 -8.612 1.00 0.00 H ATOM 2827 HD22 LEU A 202 31.241 13.515 -6.910 1.00 0.00 H ATOM 2828 HD23 LEU A 202 30.076 12.235 -7.327 1.00 0.00 H ATOM 2829 HD11 LEU A 202 27.455 14.351 -8.637 1.00 0.00 H ATOM 2830 HD12 LEU A 202 28.683 13.621 -9.699 1.00 0.00 H ATOM 2831 HD13 LEU A 202 28.021 12.691 -8.332 1.00 0.00 H ATOM 2832 H LEU A 202 31.366 17.875 -5.930 1.00 0.00 H ATOM 2833 N ASP A 203 32.677 17.625 -9.039 1.00 71.32 N ATOM 2834 CA ASP A 203 33.175 18.409 -10.190 1.00 75.01 C ATOM 2835 C ASP A 203 32.568 17.844 -11.489 1.00 77.04 C ATOM 2836 O ASP A 203 32.254 16.648 -11.531 1.00 80.01 O ATOM 2837 CB ASP A 203 34.721 18.431 -10.253 1.00 74.57 C ATOM 2838 CG ASP A 203 35.375 17.198 -9.613 1.00 75.87 C ATOM 2839 OD1 ASP A 203 34.905 16.753 -8.542 1.00 74.00 O ATOM 2840 OD2 ASP A 203 36.382 16.699 -10.164 1.00 74.99 O ATOM 2841 HA ASP A 203 32.860 19.445 -10.066 1.00 0.00 H ATOM 2842 HB2 ASP A 203 35.024 18.479 -11.299 1.00 0.00 H ATOM 2843 HB3 ASP A 203 35.076 19.320 -9.732 1.00 0.00 H ATOM 2844 H ASP A 203 33.359 17.099 -8.456 1.00 0.00 H ATOM 2845 N PRO A 204 32.402 18.684 -12.545 1.00 74.64 N ATOM 2846 CA PRO A 204 31.867 18.198 -13.851 1.00 75.59 C ATOM 2847 C PRO A 204 32.737 17.053 -14.390 1.00 74.47 C ATOM 2848 O PRO A 204 32.433 16.462 -15.444 1.00 70.77 O ATOM 2849 CB PRO A 204 31.991 19.426 -14.771 1.00 75.44 C ATOM 2850 CG PRO A 204 33.015 20.307 -14.066 1.00 73.11 C ATOM 2851 CD PRO A 204 32.762 20.110 -12.604 1.00 71.94 C ATOM 2852 HA PRO A 204 30.849 17.816 -13.776 1.00 0.00 H ATOM 2853 HD3 PRO A 204 33.656 20.318 -12.016 1.00 0.00 H ATOM 2854 HD2 PRO A 204 31.944 20.740 -12.255 1.00 0.00 H ATOM 2855 HG3 PRO A 204 32.874 21.352 -14.341 1.00 0.00 H ATOM 2856 HG2 PRO A 204 34.028 19.998 -14.324 1.00 0.00 H ATOM 2857 HB2 PRO A 204 32.344 19.136 -15.761 1.00 0.00 H ATOM 2858 HB3 PRO A 204 31.034 19.940 -14.864 1.00 0.00 H ATOM 2859 N ALA A 205 33.830 16.819 -13.653 1.00 69.33 N ATOM 2860 CA ALA A 205 34.702 15.669 -13.741 1.00 69.67 C ATOM 2861 C ALA A 205 33.929 14.492 -13.200 1.00 70.72 C ATOM 2862 O ALA A 205 33.246 13.803 -13.958 1.00 71.72 O ATOM 2863 CB ALA A 205 35.939 15.899 -12.893 1.00 65.93 C ATOM 2864 HA ALA A 205 35.018 15.494 -14.769 1.00 0.00 H ATOM 2865 HB1 ALA A 205 36.467 16.782 -13.254 1.00 0.00 H ATOM 2866 HB2 ALA A 205 35.643 16.050 -11.855 1.00 0.00 H ATOM 2867 HB3 ALA A 205 36.593 15.030 -12.963 1.00 0.00 H ATOM 2868 H ALA A 205 34.077 17.539 -12.944 1.00 0.00 H ATOM 2869 N GLN A 206 34.040 14.290 -11.886 1.00 69.68 N ATOM 2870 CA GLN A 206 33.230 13.333 -11.132 1.00 70.00 C ATOM 2871 C GLN A 206 31.722 13.262 -11.517 1.00 70.07 C ATOM 2872 O GLN A 206 31.119 12.191 -11.494 1.00 73.54 O ATOM 2873 CB GLN A 206 33.320 13.634 -9.638 1.00 70.37 C ATOM 2874 CG GLN A 206 34.691 13.529 -8.999 1.00 71.71 C ATOM 2875 CD GLN A 206 34.663 13.954 -7.531 1.00 69.78 C ATOM 2876 OE1 GLN A 206 33.755 14.656 -7.079 1.00 71.41 O ATOM 2877 NE2 GLN A 206 35.661 13.536 -6.785 1.00 70.02 N ATOM 2878 HA GLN A 206 33.657 12.364 -11.392 1.00 0.00 H ATOM 2879 HB2 GLN A 206 32.962 14.652 -9.485 1.00 0.00 H ATOM 2880 HB3 GLN A 206 32.661 12.937 -9.121 1.00 0.00 H ATOM 2881 HG2 GLN A 206 35.032 12.496 -9.062 1.00 0.00 H ATOM 2882 HG3 GLN A 206 35.384 14.173 -9.541 1.00 0.00 H ATOM 2883 HE22 GLN A 206 36.409 12.945 -7.201 1.00 0.00 H ATOM 2884 HE21 GLN A 206 35.703 13.796 -5.779 1.00 0.00 H ATOM 2885 H GLN A 206 34.747 14.848 -11.365 1.00 0.00 H ATOM 2886 N ARG A 207 31.102 14.380 -11.861 1.00 64.86 N ATOM 2887 CA ARG A 207 29.656 14.375 -12.058 1.00 60.28 C ATOM 2888 C ARG A 207 29.279 13.825 -13.432 1.00 57.58 C ATOM 2889 O ARG A 207 28.234 13.178 -13.586 1.00 51.27 O ATOM 2890 CB ARG A 207 29.066 15.768 -11.798 1.00 57.88 C ATOM 2891 CG ARG A 207 27.708 16.006 -12.392 1.00 57.89 C ATOM 2892 CD ARG A 207 26.560 15.197 -11.708 1.00 55.03 C ATOM 2893 NE ARG A 207 25.300 15.370 -12.460 1.00 48.42 N ATOM 2894 CZ ARG A 207 24.900 14.598 -13.473 1.00 46.57 C ATOM 2895 NH1 ARG A 207 25.640 13.557 -13.826 1.00 48.33 N ATOM 2896 NH2 ARG A 207 23.748 14.843 -14.126 1.00 40.52 N ATOM 2897 HA ARG A 207 29.214 13.698 -11.327 1.00 0.00 H ATOM 2898 HB2 ARG A 207 28.992 15.908 -10.720 1.00 0.00 H ATOM 2899 HB3 ARG A 207 29.751 16.508 -12.213 1.00 0.00 H ATOM 2900 HG2 ARG A 207 27.478 17.068 -12.305 1.00 0.00 H ATOM 2901 HG3 ARG A 207 27.742 15.728 -13.445 1.00 0.00 H ATOM 2902 HD2 ARG A 207 26.424 15.556 -10.688 1.00 0.00 H ATOM 2903 HD3 ARG A 207 26.826 14.140 -11.687 1.00 0.00 H ATOM 2904 HE ARG A 207 24.677 16.154 -12.178 1.00 0.00 H ATOM 2905 HH12 ARG A 207 25.339 12.948 -14.614 1.00 0.00 H ATOM 2906 HH11 ARG A 207 26.522 13.349 -13.316 1.00 0.00 H ATOM 2907 HH22 ARG A 207 23.455 14.229 -14.913 1.00 0.00 H ATOM 2908 HH21 ARG A 207 23.151 15.646 -13.844 1.00 0.00 H ATOM 2909 H ARG A 207 31.643 15.259 -11.990 1.00 0.00 H ATOM 2910 N ALA A 208 30.129 14.065 -14.429 1.00 55.56 N ATOM 2911 CA ALA A 208 29.957 13.377 -15.709 1.00 55.66 C ATOM 2912 C ALA A 208 30.286 11.823 -15.647 1.00 56.04 C ATOM 2913 O ALA A 208 29.658 11.017 -16.361 1.00 50.24 O ATOM 2914 CB ALA A 208 30.712 14.106 -16.826 1.00 55.50 C ATOM 2915 HA ALA A 208 28.895 13.418 -15.949 1.00 0.00 H ATOM 2916 HB1 ALA A 208 30.329 15.122 -16.919 1.00 0.00 H ATOM 2917 HB2 ALA A 208 31.774 14.138 -16.584 1.00 0.00 H ATOM 2918 HB3 ALA A 208 30.568 13.575 -17.767 1.00 0.00 H ATOM 2919 H ALA A 208 30.911 14.738 -14.298 1.00 0.00 H ATOM 2920 N ALA A 209 31.220 11.412 -14.776 1.00 50.95 N ATOM 2921 CA ALA A 209 31.432 9.967 -14.444 1.00 52.62 C ATOM 2922 C ALA A 209 30.295 9.339 -13.622 1.00 51.55 C ATOM 2923 O ALA A 209 30.098 8.116 -13.652 1.00 46.20 O ATOM 2924 CB ALA A 209 32.769 9.734 -13.707 1.00 51.01 C ATOM 2925 HA ALA A 209 31.451 9.470 -15.414 1.00 0.00 H ATOM 2926 HB1 ALA A 209 33.593 10.063 -14.340 1.00 0.00 H ATOM 2927 HB2 ALA A 209 32.774 10.302 -12.777 1.00 0.00 H ATOM 2928 HB3 ALA A 209 32.881 8.672 -13.486 1.00 0.00 H ATOM 2929 H ALA A 209 31.820 12.124 -14.313 1.00 0.00 H ATOM 2930 N ALA A 210 29.559 10.180 -12.891 1.00 47.60 N ATOM 2931 CA ALA A 210 28.511 9.731 -11.994 1.00 41.36 C ATOM 2932 C ALA A 210 27.394 8.977 -12.722 1.00 44.07 C ATOM 2933 O ALA A 210 26.681 8.158 -12.134 1.00 45.20 O ATOM 2934 CB ALA A 210 27.966 10.895 -11.265 1.00 40.54 C ATOM 2935 HA ALA A 210 28.951 9.023 -11.292 1.00 0.00 H ATOM 2936 HB1 ALA A 210 28.763 11.368 -10.691 1.00 0.00 H ATOM 2937 HB2 ALA A 210 27.557 11.610 -11.979 1.00 0.00 H ATOM 2938 HB3 ALA A 210 27.178 10.563 -10.589 1.00 0.00 H ATOM 2939 H ALA A 210 29.745 11.200 -12.968 1.00 0.00 H ATOM 2940 N VAL A 211 27.262 9.230 -14.011 1.00 39.89 N ATOM 2941 CA VAL A 211 26.197 8.649 -14.785 1.00 41.22 C ATOM 2942 C VAL A 211 26.426 7.102 -14.966 1.00 42.08 C ATOM 2943 O VAL A 211 25.536 6.338 -15.369 1.00 41.80 O ATOM 2944 CB VAL A 211 26.024 9.454 -16.121 1.00 40.76 C ATOM 2945 CG1 VAL A 211 27.157 9.151 -17.060 1.00 34.83 C ATOM 2946 CG2 VAL A 211 24.659 9.143 -16.793 1.00 43.64 C ATOM 2947 HA VAL A 211 25.246 8.730 -14.259 1.00 0.00 H ATOM 2948 HB VAL A 211 26.041 10.517 -15.881 1.00 0.00 H ATOM 2949 HG11 VAL A 211 28.100 9.433 -16.592 1.00 0.00 H ATOM 2950 HG12 VAL A 211 27.166 8.084 -17.284 1.00 0.00 H ATOM 2951 HG13 VAL A 211 27.024 9.716 -17.982 1.00 0.00 H ATOM 2952 HG21 VAL A 211 24.601 8.078 -17.018 1.00 0.00 H ATOM 2953 HG22 VAL A 211 23.851 9.417 -16.115 1.00 0.00 H ATOM 2954 HG23 VAL A 211 24.571 9.716 -17.716 1.00 0.00 H ATOM 2955 H VAL A 211 27.943 9.863 -14.477 1.00 0.00 H ATOM 2956 N ALA A 212 27.614 6.651 -14.625 1.00 38.44 N ATOM 2957 CA ALA A 212 27.943 5.236 -14.747 1.00 41.60 C ATOM 2958 C ALA A 212 27.062 4.322 -13.907 1.00 42.15 C ATOM 2959 O ALA A 212 26.786 3.167 -14.300 1.00 42.82 O ATOM 2960 CB ALA A 212 29.396 5.004 -14.377 1.00 43.20 C ATOM 2961 HA ALA A 212 27.761 4.978 -15.790 1.00 0.00 H ATOM 2962 HB1 ALA A 212 30.036 5.579 -15.046 1.00 0.00 H ATOM 2963 HB2 ALA A 212 29.563 5.323 -13.348 1.00 0.00 H ATOM 2964 HB3 ALA A 212 29.629 3.943 -14.472 1.00 0.00 H ATOM 2965 H ALA A 212 28.329 7.314 -14.263 1.00 0.00 H ATOM 2966 N LEU A 213 26.661 4.816 -12.744 1.00 32.68 N ATOM 2967 CA LEU A 213 25.859 4.012 -11.840 1.00 29.22 C ATOM 2968 C LEU A 213 24.602 3.608 -12.550 1.00 25.74 C ATOM 2969 O LEU A 213 24.341 2.413 -12.764 1.00 28.32 O ATOM 2970 CB LEU A 213 25.529 4.770 -10.559 1.00 26.66 C ATOM 2971 CG LEU A 213 26.605 4.590 -9.478 1.00 26.96 C ATOM 2972 CD1 LEU A 213 27.889 5.297 -9.751 1.00 13.24 C ATOM 2973 CD2 LEU A 213 26.070 4.969 -8.094 1.00 24.47 C ATOM 2974 HA LEU A 213 26.427 3.128 -11.550 1.00 0.00 H ATOM 2975 HB2 LEU A 213 25.441 5.831 -10.793 1.00 0.00 H ATOM 2976 HB3 LEU A 213 24.578 4.405 -10.171 1.00 0.00 H ATOM 2977 HG LEU A 213 26.844 3.527 -9.499 1.00 0.00 H ATOM 2978 HD21 LEU A 213 25.755 6.012 -8.101 1.00 0.00 H ATOM 2979 HD22 LEU A 213 25.220 4.333 -7.848 1.00 0.00 H ATOM 2980 HD23 LEU A 213 26.856 4.830 -7.352 1.00 0.00 H ATOM 2981 HD11 LEU A 213 28.315 4.927 -10.684 1.00 0.00 H ATOM 2982 HD12 LEU A 213 27.702 6.368 -9.834 1.00 0.00 H ATOM 2983 HD13 LEU A 213 28.586 5.111 -8.934 1.00 0.00 H ATOM 2984 H LEU A 213 26.923 5.787 -12.477 1.00 0.00 H ATOM 2985 N SER A 214 23.816 4.578 -12.945 1.00 20.56 N ATOM 2986 CA SER A 214 22.548 4.195 -13.576 1.00 27.58 C ATOM 2987 C SER A 214 22.767 3.509 -14.933 1.00 25.18 C ATOM 2988 O SER A 214 21.967 2.708 -15.333 1.00 29.94 O ATOM 2989 CB SER A 214 21.650 5.419 -13.775 1.00 27.72 C ATOM 2990 OG SER A 214 22.271 6.299 -14.692 1.00 19.47 O ATOM 2991 HA SER A 214 22.063 3.487 -12.904 1.00 0.00 H ATOM 2992 HB2 SER A 214 21.506 5.926 -12.821 1.00 0.00 H ATOM 2993 HB3 SER A 214 20.683 5.104 -14.167 1.00 0.00 H ATOM 2994 HG SER A 214 22.401 5.835 -15.557 1.00 0.00 H ATOM 2995 H SER A 214 24.079 5.576 -12.817 1.00 0.00 H ATOM 2996 N ALA A 215 23.807 3.865 -15.679 1.00 23.94 N ATOM 2997 CA ALA A 215 23.959 3.239 -16.957 1.00 21.34 C ATOM 2998 C ALA A 215 24.237 1.716 -16.716 1.00 27.20 C ATOM 2999 O ALA A 215 23.693 0.830 -17.415 1.00 24.93 O ATOM 3000 CB ALA A 215 25.075 3.864 -17.719 1.00 21.79 C ATOM 3001 HA ALA A 215 23.052 3.366 -17.548 1.00 0.00 H ATOM 3002 HB1 ALA A 215 24.864 4.923 -17.867 1.00 0.00 H ATOM 3003 HB2 ALA A 215 26.003 3.752 -17.159 1.00 0.00 H ATOM 3004 HB3 ALA A 215 25.172 3.373 -18.687 1.00 0.00 H ATOM 3005 H ALA A 215 24.489 4.576 -15.345 1.00 0.00 H ATOM 3006 N ALA A 216 25.066 1.417 -15.725 1.00 19.86 N ATOM 3007 CA ALA A 216 25.440 0.040 -15.444 1.00 21.38 C ATOM 3008 C ALA A 216 24.206 -0.737 -15.003 1.00 24.04 C ATOM 3009 O ALA A 216 23.978 -1.902 -15.418 1.00 24.33 O ATOM 3010 CB ALA A 216 26.607 -0.028 -14.399 1.00 19.30 C ATOM 3011 HA ALA A 216 25.824 -0.428 -16.351 1.00 0.00 H ATOM 3012 HB1 ALA A 216 27.477 0.496 -14.794 1.00 0.00 H ATOM 3013 HB2 ALA A 216 26.288 0.443 -13.469 1.00 0.00 H ATOM 3014 HB3 ALA A 216 26.864 -1.070 -14.210 1.00 0.00 H ATOM 3015 H ALA A 216 25.456 2.182 -15.138 1.00 0.00 H ATOM 3016 N LEU A 217 23.363 -0.067 -14.229 1.00 23.93 N ATOM 3017 CA LEU A 217 22.113 -0.676 -13.780 1.00 26.63 C ATOM 3018 C LEU A 217 21.141 -0.946 -14.931 1.00 31.30 C ATOM 3019 O LEU A 217 20.495 -2.027 -15.009 1.00 26.30 O ATOM 3020 CB LEU A 217 21.429 0.211 -12.746 1.00 25.94 C ATOM 3021 CG LEU A 217 22.133 0.391 -11.406 1.00 28.39 C ATOM 3022 CD1 LEU A 217 21.174 0.995 -10.404 1.00 28.26 C ATOM 3023 CD2 LEU A 217 22.660 -0.916 -10.916 1.00 14.80 C ATOM 3024 HA LEU A 217 22.379 -1.635 -13.336 1.00 0.00 H ATOM 3025 HB2 LEU A 217 21.310 1.200 -13.189 1.00 0.00 H ATOM 3026 HB3 LEU A 217 20.447 -0.217 -12.546 1.00 0.00 H ATOM 3027 HG LEU A 217 22.978 1.068 -11.533 1.00 0.00 H ATOM 3028 HD21 LEU A 217 21.834 -1.616 -10.793 1.00 0.00 H ATOM 3029 HD22 LEU A 217 23.370 -1.314 -11.640 1.00 0.00 H ATOM 3030 HD23 LEU A 217 23.159 -0.769 -9.958 1.00 0.00 H ATOM 3031 HD11 LEU A 217 20.834 1.965 -10.768 1.00 0.00 H ATOM 3032 HD12 LEU A 217 20.318 0.332 -10.277 1.00 0.00 H ATOM 3033 HD13 LEU A 217 21.682 1.122 -9.448 1.00 0.00 H ATOM 3034 H LEU A 217 23.595 0.904 -13.938 1.00 0.00 H ATOM 3035 N THR A 218 21.026 0.023 -15.841 1.00 25.23 N ATOM 3036 CA THR A 218 19.975 -0.144 -16.822 1.00 28.42 C ATOM 3037 C THR A 218 20.475 -1.162 -17.842 1.00 23.01 C ATOM 3038 O THR A 218 19.695 -1.877 -18.402 1.00 31.27 O ATOM 3039 CB THR A 218 19.585 1.151 -17.460 1.00 20.24 C ATOM 3040 OG1 THR A 218 20.716 1.592 -18.186 1.00 36.14 O ATOM 3041 CG2 THR A 218 19.284 2.238 -16.374 1.00 19.64 C ATOM 3042 HA THR A 218 19.065 -0.504 -16.343 1.00 0.00 H ATOM 3043 HB THR A 218 18.699 1.008 -18.079 1.00 0.00 H ATOM 3044 HG1 THR A 218 21.477 1.716 -17.565 1.00 0.00 H ATOM 3045 HG23 THR A 218 18.415 1.935 -15.790 1.00 0.00 H ATOM 3046 HG21 THR A 218 20.147 2.342 -15.717 1.00 0.00 H ATOM 3047 HG22 THR A 218 19.081 3.191 -16.862 1.00 0.00 H ATOM 3048 H THR A 218 21.655 0.851 -15.845 1.00 0.00 H ATOM 3049 N ALA A 219 21.785 -1.234 -18.043 1.00 20.76 N ATOM 3050 CA ALA A 219 22.369 -2.214 -18.942 1.00 28.67 C ATOM 3051 C ALA A 219 22.114 -3.615 -18.394 1.00 32.71 C ATOM 3052 O ALA A 219 21.633 -4.502 -19.120 1.00 33.02 O ATOM 3053 CB ALA A 219 23.863 -1.987 -19.108 1.00 14.57 C ATOM 3054 HA ALA A 219 21.903 -2.108 -19.922 1.00 0.00 H ATOM 3055 HB1 ALA A 219 24.035 -0.992 -19.519 1.00 0.00 H ATOM 3056 HB2 ALA A 219 24.352 -2.070 -18.137 1.00 0.00 H ATOM 3057 HB3 ALA A 219 24.270 -2.737 -19.787 1.00 0.00 H ATOM 3058 H ALA A 219 22.411 -0.570 -17.543 1.00 0.00 H ATOM 3059 N ALA A 220 22.405 -3.768 -17.098 1.00 31.83 N ATOM 3060 CA ALA A 220 22.320 -5.039 -16.398 1.00 28.73 C ATOM 3061 C ALA A 220 20.914 -5.543 -16.535 1.00 26.87 C ATOM 3062 O ALA A 220 20.686 -6.719 -16.789 1.00 33.88 O ATOM 3063 CB ALA A 220 22.661 -4.809 -14.966 1.00 31.48 C ATOM 3064 HA ALA A 220 23.010 -5.775 -16.810 1.00 0.00 H ATOM 3065 HB1 ALA A 220 23.673 -4.409 -14.894 1.00 0.00 H ATOM 3066 HB2 ALA A 220 21.956 -4.097 -14.536 1.00 0.00 H ATOM 3067 HB3 ALA A 220 22.603 -5.753 -14.424 1.00 0.00 H ATOM 3068 H ALA A 220 22.709 -2.931 -16.561 1.00 0.00 H ATOM 3069 N ALA A 221 19.972 -4.618 -16.421 1.00 28.39 N ATOM 3070 CA ALA A 221 18.531 -4.899 -16.529 1.00 29.18 C ATOM 3071 C ALA A 221 18.169 -5.374 -17.913 1.00 32.15 C ATOM 3072 O ALA A 221 17.268 -6.208 -18.049 1.00 36.02 O ATOM 3073 CB ALA A 221 17.651 -3.639 -16.113 1.00 19.41 C ATOM 3074 HA ALA A 221 18.307 -5.702 -15.827 1.00 0.00 H ATOM 3075 HB1 ALA A 221 17.871 -3.368 -15.080 1.00 0.00 H ATOM 3076 HB2 ALA A 221 17.887 -2.800 -16.768 1.00 0.00 H ATOM 3077 HB3 ALA A 221 16.594 -3.889 -16.207 1.00 0.00 H ATOM 3078 H ALA A 221 20.268 -3.637 -16.245 1.00 0.00 H ATOM 3079 N HIS A 222 18.863 -4.875 -18.944 1.00 32.76 N ATOM 3080 CA HIS A 222 18.581 -5.360 -20.317 1.00 30.22 C ATOM 3081 C HIS A 222 19.257 -6.652 -20.678 1.00 26.53 C ATOM 3082 O HIS A 222 18.697 -7.477 -21.391 1.00 31.61 O ATOM 3083 CB HIS A 222 18.728 -4.253 -21.359 1.00 27.91 C ATOM 3084 CG HIS A 222 17.683 -3.199 -21.185 1.00 30.24 C ATOM 3085 ND1 HIS A 222 16.499 -3.207 -21.893 1.00 31.34 N ATOM 3086 CD2 HIS A 222 17.558 -2.220 -20.260 1.00 27.50 C ATOM 3087 CE1 HIS A 222 15.714 -2.239 -21.452 1.00 28.09 C ATOM 3088 NE2 HIS A 222 16.340 -1.616 -20.475 1.00 32.11 N ATOM 3089 HA HIS A 222 17.526 -5.635 -20.322 1.00 0.00 H ATOM 3090 HB2 HIS A 222 19.713 -3.797 -21.256 1.00 0.00 H ATOM 3091 HB3 HIS A 222 18.632 -4.687 -22.354 1.00 0.00 H ATOM 3092 HD2 HIS A 222 18.284 -1.959 -19.490 1.00 0.00 H ATOM 3093 HE1 HIS A 222 14.721 -1.998 -21.831 1.00 0.00 H ATOM 3094 H HIS A 222 19.594 -4.153 -18.783 1.00 0.00 H ATOM 3095 N ALA A 223 20.436 -6.829 -20.124 1.00 18.01 N ATOM 3096 CA ALA A 223 21.247 -7.966 -20.352 1.00 19.65 C ATOM 3097 C ALA A 223 20.675 -9.224 -19.618 1.00 21.48 C ATOM 3098 O ALA A 223 21.088 -10.359 -19.841 1.00 24.01 O ATOM 3099 CB ALA A 223 22.635 -7.621 -19.821 1.00 10.90 C ATOM 3100 HA ALA A 223 21.278 -8.211 -21.414 1.00 0.00 H ATOM 3101 HB1 ALA A 223 23.021 -6.753 -20.355 1.00 0.00 H ATOM 3102 HB2 ALA A 223 22.570 -7.395 -18.757 1.00 0.00 H ATOM 3103 HB3 ALA A 223 23.302 -8.469 -19.974 1.00 0.00 H ATOM 3104 H ALA A 223 20.793 -6.092 -19.482 1.00 0.00 H ATOM 3105 N ALA A 224 19.723 -9.002 -18.723 1.00 30.76 N ATOM 3106 CA ALA A 224 19.245 -10.046 -17.814 1.00 30.56 C ATOM 3107 C ALA A 224 18.506 -11.200 -18.499 1.00 31.70 C ATOM 3108 O ALA A 224 18.393 -12.305 -17.921 1.00 35.92 O ATOM 3109 CB ALA A 224 18.367 -9.421 -16.747 1.00 24.88 C ATOM 3110 HA ALA A 224 20.135 -10.496 -17.373 1.00 0.00 H ATOM 3111 HB1 ALA A 224 18.945 -8.686 -16.187 1.00 0.00 H ATOM 3112 HB2 ALA A 224 17.516 -8.931 -17.220 1.00 0.00 H ATOM 3113 HB3 ALA A 224 18.011 -10.198 -16.070 1.00 0.00 H ATOM 3114 H ALA A 224 19.301 -8.053 -18.664 1.00 0.00 H ATOM 3115 N THR A 225 18.001 -10.948 -19.713 1.00 28.75 N ATOM 3116 CA THR A 225 17.444 -12.003 -20.558 1.00 24.46 C ATOM 3117 C THR A 225 18.498 -13.084 -20.647 1.00 23.79 C ATOM 3118 O THR A 225 18.170 -14.258 -20.635 1.00 35.03 O ATOM 3119 CB THR A 225 17.008 -11.521 -21.977 1.00 24.09 C ATOM 3120 OG1 THR A 225 18.080 -10.839 -22.633 1.00 36.47 O ATOM 3121 CG2 THR A 225 15.795 -10.596 -21.922 1.00 22.25 C ATOM 3122 HA THR A 225 16.521 -12.368 -20.107 1.00 0.00 H ATOM 3123 HB THR A 225 16.737 -12.415 -22.539 1.00 0.00 H ATOM 3124 HG1 THR A 225 17.782 -10.543 -23.529 1.00 0.00 H ATOM 3125 HG23 THR A 225 14.972 -11.108 -21.423 1.00 0.00 H ATOM 3126 HG21 THR A 225 16.053 -9.693 -21.368 1.00 0.00 H ATOM 3127 HG22 THR A 225 15.497 -10.329 -22.936 1.00 0.00 H ATOM 3128 H THR A 225 18.005 -9.970 -20.066 1.00 0.00 H ATOM 3129 N ALA A 226 19.772 -12.715 -20.684 1.00 20.63 N ATOM 3130 CA ALA A 226 20.837 -13.749 -20.746 1.00 25.24 C ATOM 3131 C ALA A 226 21.191 -14.347 -19.399 1.00 25.52 C ATOM 3132 O ALA A 226 22.173 -15.089 -19.273 1.00 31.71 O ATOM 3133 CB ALA A 226 22.092 -13.206 -21.391 1.00 15.70 C ATOM 3134 HA ALA A 226 20.417 -14.549 -21.356 1.00 0.00 H ATOM 3135 HB1 ALA A 226 21.865 -12.879 -22.406 1.00 0.00 H ATOM 3136 HB2 ALA A 226 22.461 -12.361 -20.810 1.00 0.00 H ATOM 3137 HB3 ALA A 226 22.851 -13.988 -21.421 1.00 0.00 H ATOM 3138 H ALA A 226 20.024 -11.706 -20.670 1.00 0.00 H ATOM 3139 N GLY A 227 20.418 -14.009 -18.383 1.00 26.13 N ATOM 3140 CA GLY A 227 20.741 -14.480 -17.068 1.00 26.11 C ATOM 3141 C GLY A 227 21.384 -13.496 -16.116 1.00 33.58 C ATOM 3142 O GLY A 227 22.032 -12.519 -16.532 1.00 35.38 O ATOM 3143 HA3 GLY A 227 21.425 -15.322 -17.180 1.00 0.00 H ATOM 3144 HA2 GLY A 227 19.815 -14.825 -16.607 1.00 0.00 H ATOM 3145 H GLY A 227 19.583 -13.407 -18.535 1.00 0.00 H ATOM 3146 N ALA A 228 21.196 -13.796 -14.827 1.00 33.87 N ATOM 3147 CA ALA A 228 21.868 -13.153 -13.688 1.00 32.27 C ATOM 3148 C ALA A 228 23.350 -12.858 -13.895 1.00 30.49 C ATOM 3149 O ALA A 228 23.818 -11.717 -13.738 1.00 32.67 O ATOM 3150 CB ALA A 228 21.695 -14.026 -12.438 1.00 29.70 C ATOM 3151 HA ALA A 228 21.387 -12.181 -13.574 1.00 0.00 H ATOM 3152 HB1 ALA A 228 20.633 -14.139 -12.219 1.00 0.00 H ATOM 3153 HB2 ALA A 228 22.137 -15.006 -12.617 1.00 0.00 H ATOM 3154 HB3 ALA A 228 22.193 -13.551 -11.593 1.00 0.00 H ATOM 3155 H ALA A 228 20.514 -14.551 -14.611 1.00 0.00 H ATOM 3156 N GLN A 229 24.091 -13.880 -14.246 1.00 22.87 N ATOM 3157 CA GLN A 229 25.506 -13.711 -14.522 1.00 31.50 C ATOM 3158 C GLN A 229 25.896 -12.675 -15.650 1.00 31.79 C ATOM 3159 O GLN A 229 26.933 -11.973 -15.560 1.00 34.93 O ATOM 3160 CB GLN A 229 26.066 -15.090 -14.846 1.00 36.36 C ATOM 3161 CG GLN A 229 27.479 -15.071 -15.350 1.00 44.45 C ATOM 3162 CD GLN A 229 28.431 -14.565 -14.323 1.00 50.62 C ATOM 3163 OE1 GLN A 229 28.352 -14.917 -13.135 1.00 58.78 O ATOM 3164 NE2 GLN A 229 29.351 -13.729 -14.760 1.00 57.64 N ATOM 3165 HA GLN A 229 25.944 -13.266 -13.628 1.00 0.00 H ATOM 3166 HB2 GLN A 229 26.033 -15.695 -13.940 1.00 0.00 H ATOM 3167 HB3 GLN A 229 25.435 -15.546 -15.609 1.00 0.00 H ATOM 3168 HG2 GLN A 229 27.767 -16.085 -15.628 1.00 0.00 H ATOM 3169 HG3 GLN A 229 27.531 -14.426 -16.227 1.00 0.00 H ATOM 3170 HE22 GLN A 229 29.377 -13.464 -15.765 1.00 0.00 H ATOM 3171 HE21 GLN A 229 30.051 -13.335 -14.100 1.00 0.00 H ATOM 3172 H GLN A 229 23.660 -14.823 -14.328 1.00 0.00 H ATOM 3173 N ALA A 230 25.097 -12.591 -16.712 1.00 26.90 N ATOM 3174 CA ALA A 230 25.376 -11.623 -17.774 1.00 27.42 C ATOM 3175 C ALA A 230 25.025 -10.228 -17.278 1.00 25.34 C ATOM 3176 O ALA A 230 25.597 -9.210 -17.699 1.00 24.07 O ATOM 3177 CB ALA A 230 24.556 -11.940 -19.028 1.00 30.44 C ATOM 3178 HA ALA A 230 26.434 -11.677 -18.031 1.00 0.00 H ATOM 3179 HB1 ALA A 230 24.812 -12.938 -19.385 1.00 0.00 H ATOM 3180 HB2 ALA A 230 23.494 -11.900 -18.786 1.00 0.00 H ATOM 3181 HB3 ALA A 230 24.781 -11.207 -19.803 1.00 0.00 H ATOM 3182 H ALA A 230 24.270 -13.217 -16.787 1.00 0.00 H ATOM 3183 N ALA A 231 24.067 -10.194 -16.369 1.00 18.49 N ATOM 3184 CA ALA A 231 23.520 -8.928 -15.948 1.00 26.99 C ATOM 3185 C ALA A 231 24.565 -8.240 -15.094 1.00 25.95 C ATOM 3186 O ALA A 231 24.672 -7.009 -15.053 1.00 26.72 O ATOM 3187 CB ALA A 231 22.210 -9.139 -15.202 1.00 16.36 C ATOM 3188 HA ALA A 231 23.286 -8.296 -16.804 1.00 0.00 H ATOM 3189 HB1 ALA A 231 21.495 -9.635 -15.859 1.00 0.00 H ATOM 3190 HB2 ALA A 231 22.389 -9.759 -14.324 1.00 0.00 H ATOM 3191 HB3 ALA A 231 21.811 -8.174 -14.891 1.00 0.00 H ATOM 3192 H ALA A 231 23.708 -11.079 -15.958 1.00 0.00 H ATOM 3193 N LEU A 232 25.334 -9.056 -14.401 1.00 30.27 N ATOM 3194 CA LEU A 232 26.257 -8.501 -13.436 1.00 35.51 C ATOM 3195 C LEU A 232 27.489 -8.049 -14.128 1.00 31.92 C ATOM 3196 O LEU A 232 27.944 -6.927 -13.901 1.00 34.68 O ATOM 3197 CB LEU A 232 26.618 -9.532 -12.382 1.00 38.79 C ATOM 3198 CG LEU A 232 25.555 -9.507 -11.283 1.00 43.26 C ATOM 3199 CD1 LEU A 232 25.528 -10.848 -10.471 1.00 42.85 C ATOM 3200 CD2 LEU A 232 25.714 -8.255 -10.397 1.00 35.97 C ATOM 3201 HA LEU A 232 25.777 -7.654 -12.945 1.00 0.00 H ATOM 3202 HB2 LEU A 232 26.653 -10.523 -12.835 1.00 0.00 H ATOM 3203 HB3 LEU A 232 27.592 -9.294 -11.955 1.00 0.00 H ATOM 3204 HG LEU A 232 24.574 -9.432 -11.752 1.00 0.00 H ATOM 3205 HD21 LEU A 232 26.700 -8.263 -9.933 1.00 0.00 H ATOM 3206 HD22 LEU A 232 25.607 -7.361 -11.011 1.00 0.00 H ATOM 3207 HD23 LEU A 232 24.947 -8.260 -9.623 1.00 0.00 H ATOM 3208 HD11 LEU A 232 25.306 -11.675 -11.145 1.00 0.00 H ATOM 3209 HD12 LEU A 232 26.500 -11.009 -10.005 1.00 0.00 H ATOM 3210 HD13 LEU A 232 24.759 -10.789 -9.700 1.00 0.00 H ATOM 3211 H LEU A 232 25.278 -10.084 -14.546 1.00 0.00 H ATOM 3212 N ASP A 233 28.025 -8.943 -14.958 1.00 23.55 N ATOM 3213 CA ASP A 233 29.162 -8.654 -15.789 1.00 17.48 C ATOM 3214 C ASP A 233 28.892 -7.394 -16.573 1.00 17.43 C ATOM 3215 O ASP A 233 29.704 -6.480 -16.529 1.00 25.82 O ATOM 3216 CB ASP A 233 29.419 -9.855 -16.681 1.00 27.02 C ATOM 3217 CG ASP A 233 30.073 -11.062 -15.904 1.00 26.48 C ATOM 3218 OD1 ASP A 233 30.413 -10.951 -14.710 1.00 26.33 O ATOM 3219 OD2 ASP A 233 30.294 -12.133 -16.502 1.00 23.40 O ATOM 3220 HA ASP A 233 30.059 -8.478 -15.196 1.00 0.00 H ATOM 3221 HB2 ASP A 233 28.470 -10.185 -17.104 1.00 0.00 H ATOM 3222 HB3 ASP A 233 30.089 -9.554 -17.486 1.00 0.00 H ATOM 3223 H ASP A 233 27.602 -9.892 -15.007 1.00 0.00 H ATOM 3224 N ALA A 234 27.735 -7.282 -17.218 1.00 15.96 N ATOM 3225 CA ALA A 234 27.343 -6.035 -17.874 1.00 22.47 C ATOM 3226 C ALA A 234 27.560 -4.773 -16.997 1.00 27.88 C ATOM 3227 O ALA A 234 28.304 -3.805 -17.360 1.00 21.57 O ATOM 3228 CB ALA A 234 25.891 -6.104 -18.376 1.00 23.37 C ATOM 3229 HA ALA A 234 28.011 -5.930 -18.729 1.00 0.00 H ATOM 3230 HB1 ALA A 234 25.794 -6.920 -19.092 1.00 0.00 H ATOM 3231 HB2 ALA A 234 25.224 -6.278 -17.532 1.00 0.00 H ATOM 3232 HB3 ALA A 234 25.630 -5.162 -18.859 1.00 0.00 H ATOM 3233 H ALA A 234 27.094 -8.100 -17.257 1.00 0.00 H ATOM 3234 N ALA A 235 26.955 -4.805 -15.815 1.00 27.12 N ATOM 3235 CA ALA A 235 27.059 -3.685 -14.903 1.00 24.53 C ATOM 3236 C ALA A 235 28.537 -3.538 -14.482 1.00 24.32 C ATOM 3237 O ALA A 235 29.074 -2.440 -14.459 1.00 25.01 O ATOM 3238 CB ALA A 235 26.076 -3.875 -13.670 1.00 24.81 C ATOM 3239 HA ALA A 235 26.750 -2.760 -15.389 1.00 0.00 H ATOM 3240 HB1 ALA A 235 25.050 -3.942 -14.032 1.00 0.00 H ATOM 3241 HB2 ALA A 235 26.336 -4.790 -13.138 1.00 0.00 H ATOM 3242 HB3 ALA A 235 26.170 -3.023 -12.997 1.00 0.00 H ATOM 3243 H ALA A 235 26.402 -5.642 -15.542 1.00 0.00 H ATOM 3244 N ARG A 236 29.206 -4.641 -14.191 1.00 21.61 N ATOM 3245 CA ARG A 236 30.553 -4.540 -13.634 1.00 29.54 C ATOM 3246 C ARG A 236 31.405 -3.923 -14.751 1.00 29.18 C ATOM 3247 O ARG A 236 32.152 -2.985 -14.500 1.00 29.68 O ATOM 3248 CB ARG A 236 30.965 -5.890 -12.928 1.00 31.76 C ATOM 3249 CG ARG A 236 32.324 -6.538 -13.075 1.00 41.96 C ATOM 3250 CD ARG A 236 33.386 -6.289 -11.953 1.00 58.86 C ATOM 3251 NE ARG A 236 32.957 -5.520 -10.764 1.00 66.53 N ATOM 3252 CZ ARG A 236 33.127 -4.193 -10.588 1.00 66.74 C ATOM 3253 NH1 ARG A 236 33.704 -3.435 -11.527 1.00 63.40 N ATOM 3254 NH2 ARG A 236 32.706 -3.610 -9.465 1.00 60.37 N ATOM 3255 HA ARG A 236 30.688 -3.870 -12.785 1.00 0.00 H ATOM 3256 HB2 ARG A 236 30.833 -5.718 -11.860 1.00 0.00 H ATOM 3257 HB3 ARG A 236 30.244 -6.634 -13.267 1.00 0.00 H ATOM 3258 HG2 ARG A 236 32.164 -7.614 -13.136 1.00 0.00 H ATOM 3259 HG3 ARG A 236 32.753 -6.182 -14.012 1.00 0.00 H ATOM 3260 HD2 ARG A 236 34.220 -5.752 -12.406 1.00 0.00 H ATOM 3261 HD3 ARG A 236 33.729 -7.264 -11.605 1.00 0.00 H ATOM 3262 HE ARG A 236 32.485 -6.046 -10.001 1.00 0.00 H ATOM 3263 HH12 ARG A 236 33.825 -2.414 -11.370 1.00 0.00 H ATOM 3264 HH11 ARG A 236 34.032 -3.867 -12.415 1.00 0.00 H ATOM 3265 HH22 ARG A 236 32.837 -2.587 -9.329 1.00 0.00 H ATOM 3266 HH21 ARG A 236 32.247 -4.178 -8.725 1.00 0.00 H ATOM 3267 H ARG A 236 28.777 -5.573 -14.357 1.00 0.00 H ATOM 3268 N ALA A 237 31.133 -4.319 -16.001 1.00 26.81 N ATOM 3269 CA ALA A 237 31.832 -3.771 -17.176 1.00 27.50 C ATOM 3270 C ALA A 237 31.661 -2.264 -17.348 1.00 28.68 C ATOM 3271 O ALA A 237 32.571 -1.560 -17.781 1.00 34.43 O ATOM 3272 CB ALA A 237 31.389 -4.487 -18.466 1.00 18.03 C ATOM 3273 HA ALA A 237 32.891 -3.953 -16.991 1.00 0.00 H ATOM 3274 HB1 ALA A 237 31.618 -5.550 -18.387 1.00 0.00 H ATOM 3275 HB2 ALA A 237 30.316 -4.354 -18.604 1.00 0.00 H ATOM 3276 HB3 ALA A 237 31.921 -4.062 -19.317 1.00 0.00 H ATOM 3277 H ALA A 237 30.400 -5.042 -16.148 1.00 0.00 H ATOM 3278 N VAL A 238 30.465 -1.774 -17.075 1.00 30.94 N ATOM 3279 CA VAL A 238 30.189 -0.355 -17.208 1.00 29.84 C ATOM 3280 C VAL A 238 30.929 0.495 -16.156 1.00 32.85 C ATOM 3281 O VAL A 238 31.526 1.476 -16.516 1.00 29.19 O ATOM 3282 CB VAL A 238 28.686 -0.083 -17.243 1.00 26.26 C ATOM 3283 CG1 VAL A 238 28.412 1.411 -17.248 1.00 26.14 C ATOM 3284 CG2 VAL A 238 28.121 -0.723 -18.457 1.00 17.50 C ATOM 3285 HA VAL A 238 30.591 -0.037 -18.170 1.00 0.00 H ATOM 3286 HB VAL A 238 28.215 -0.500 -16.353 1.00 0.00 H ATOM 3287 HG11 VAL A 238 28.831 1.859 -16.347 1.00 0.00 H ATOM 3288 HG12 VAL A 238 28.873 1.861 -18.127 1.00 0.00 H ATOM 3289 HG13 VAL A 238 27.336 1.582 -17.273 1.00 0.00 H ATOM 3290 HG21 VAL A 238 28.597 -0.302 -19.343 1.00 0.00 H ATOM 3291 HG22 VAL A 238 28.305 -1.797 -18.419 1.00 0.00 H ATOM 3292 HG23 VAL A 238 27.048 -0.538 -18.497 1.00 0.00 H ATOM 3293 H VAL A 238 29.709 -2.415 -16.760 1.00 0.00 H ATOM 3294 N LEU A 239 30.938 0.075 -14.889 1.00 40.16 N ATOM 3295 CA LEU A 239 31.683 0.783 -13.804 1.00 43.45 C ATOM 3296 C LEU A 239 33.177 0.755 -13.998 1.00 44.62 C ATOM 3297 O LEU A 239 33.874 1.745 -13.732 1.00 49.17 O ATOM 3298 CB LEU A 239 31.359 0.178 -12.415 1.00 38.61 C ATOM 3299 CG LEU A 239 29.836 0.146 -12.188 1.00 30.66 C ATOM 3300 CD1 LEU A 239 29.469 -0.710 -11.025 1.00 27.09 C ATOM 3301 CD2 LEU A 239 29.239 1.562 -12.035 1.00 30.80 C ATOM 3302 HA LEU A 239 31.350 1.820 -13.853 1.00 0.00 H ATOM 3303 HB2 LEU A 239 31.752 -0.837 -12.364 1.00 0.00 H ATOM 3304 HB3 LEU A 239 31.826 0.786 -11.640 1.00 0.00 H ATOM 3305 HG LEU A 239 29.401 -0.298 -13.083 1.00 0.00 H ATOM 3306 HD21 LEU A 239 29.699 2.058 -11.181 1.00 0.00 H ATOM 3307 HD22 LEU A 239 29.435 2.137 -12.940 1.00 0.00 H ATOM 3308 HD23 LEU A 239 28.163 1.486 -11.877 1.00 0.00 H ATOM 3309 HD11 LEU A 239 29.811 -1.729 -11.204 1.00 0.00 H ATOM 3310 HD12 LEU A 239 29.942 -0.319 -10.124 1.00 0.00 H ATOM 3311 HD13 LEU A 239 28.386 -0.705 -10.899 1.00 0.00 H ATOM 3312 H LEU A 239 30.403 -0.783 -14.646 1.00 0.00 H ATOM 3313 N ASP A 240 33.663 -0.407 -14.417 1.00 44.66 N ATOM 3314 CA ASP A 240 35.071 -0.580 -14.773 1.00 47.19 C ATOM 3315 C ASP A 240 35.503 0.390 -15.849 1.00 44.60 C ATOM 3316 O ASP A 240 36.648 0.763 -15.873 1.00 47.07 O ATOM 3317 CB ASP A 240 35.391 -2.041 -15.176 1.00 45.10 C ATOM 3318 CG ASP A 240 35.446 -2.938 -13.992 1.00 47.57 C ATOM 3319 OD1 ASP A 240 35.729 -2.397 -12.920 1.00 52.23 O ATOM 3320 OD2 ASP A 240 35.172 -4.150 -14.083 1.00 53.20 O ATOM 3321 HA ASP A 240 35.649 -0.355 -13.877 1.00 0.00 H ATOM 3322 HB2 ASP A 240 34.617 -2.398 -15.855 1.00 0.00 H ATOM 3323 HB3 ASP A 240 36.356 -2.065 -15.683 1.00 0.00 H ATOM 3324 H ASP A 240 33.021 -1.222 -14.495 1.00 0.00 H ATOM 3325 N ALA A 241 34.596 0.810 -16.727 1.00 48.82 N ATOM 3326 CA ALA A 241 35.002 1.706 -17.824 1.00 50.79 C ATOM 3327 C ALA A 241 34.851 3.173 -17.461 1.00 51.70 C ATOM 3328 O ALA A 241 35.018 4.047 -18.325 1.00 54.90 O ATOM 3329 CB ALA A 241 34.292 1.374 -19.158 1.00 45.19 C ATOM 3330 HA ALA A 241 36.065 1.523 -17.979 1.00 0.00 H ATOM 3331 HB1 ALA A 241 34.534 0.353 -19.453 1.00 0.00 H ATOM 3332 HB2 ALA A 241 33.214 1.470 -19.028 1.00 0.00 H ATOM 3333 HB3 ALA A 241 34.630 2.066 -19.930 1.00 0.00 H ATOM 3334 H ALA A 241 33.605 0.507 -16.639 1.00 0.00 H ATOM 3335 N ALA A 242 34.556 3.427 -16.184 1.00 50.37 N ATOM 3336 CA ALA A 242 34.332 4.785 -15.674 1.00 49.90 C ATOM 3337 C ALA A 242 35.461 5.322 -14.782 1.00 46.95 C ATOM 3338 O ALA A 242 35.722 4.793 -13.720 1.00 39.53 O ATOM 3339 CB ALA A 242 32.946 4.916 -14.964 1.00 47.40 C ATOM 3340 HA ALA A 242 34.331 5.419 -16.561 1.00 0.00 H ATOM 3341 HB1 ALA A 242 32.152 4.680 -15.673 1.00 0.00 H ATOM 3342 HB2 ALA A 242 32.902 4.222 -14.124 1.00 0.00 H ATOM 3343 HB3 ALA A 242 32.820 5.936 -14.601 1.00 0.00 H ATOM 3344 H ALA A 242 34.482 2.628 -15.522 1.00 0.00 H ATOM 3345 N PRO A 243 36.061 6.444 -15.199 1.00 53.91 N ATOM 3346 CA PRO A 243 37.145 7.143 -14.516 1.00 54.79 C ATOM 3347 C PRO A 243 36.774 7.585 -13.094 1.00 50.31 C ATOM 3348 O PRO A 243 35.948 8.492 -12.907 1.00 40.40 O ATOM 3349 CB PRO A 243 37.384 8.390 -15.405 1.00 61.89 C ATOM 3350 CG PRO A 243 36.037 8.598 -16.154 1.00 64.11 C ATOM 3351 CD PRO A 243 35.609 7.169 -16.415 1.00 61.57 C ATOM 3352 HA PRO A 243 38.016 6.499 -14.395 1.00 0.00 H ATOM 3353 HD3 PRO A 243 34.527 7.101 -16.530 1.00 0.00 H ATOM 3354 HD2 PRO A 243 36.094 6.774 -17.308 1.00 0.00 H ATOM 3355 HG3 PRO A 243 36.180 9.147 -17.085 1.00 0.00 H ATOM 3356 HG2 PRO A 243 35.312 9.123 -15.532 1.00 0.00 H ATOM 3357 HB2 PRO A 243 37.623 9.260 -14.793 1.00 0.00 H ATOM 3358 HB3 PRO A 243 38.194 8.210 -16.112 1.00 0.00 H ATOM 3359 N GLY A 244 37.382 6.936 -12.107 1.00 44.08 N ATOM 3360 CA GLY A 244 37.284 7.420 -10.746 1.00 47.03 C ATOM 3361 C GLY A 244 35.954 7.104 -10.109 1.00 48.07 C ATOM 3362 O GLY A 244 35.394 7.911 -9.365 1.00 52.49 O ATOM 3363 HA3 GLY A 244 37.421 8.501 -10.750 1.00 0.00 H ATOM 3364 HA2 GLY A 244 38.073 6.957 -10.154 1.00 0.00 H ATOM 3365 H GLY A 244 37.931 6.077 -12.313 1.00 0.00 H ATOM 3366 N VAL A 245 35.432 5.929 -10.409 1.00 41.54 N ATOM 3367 CA VAL A 245 34.296 5.454 -9.696 1.00 38.67 C ATOM 3368 C VAL A 245 34.843 4.272 -8.961 1.00 37.46 C ATOM 3369 O VAL A 245 35.257 3.317 -9.584 1.00 34.13 O ATOM 3370 CB VAL A 245 33.181 5.004 -10.690 1.00 47.17 C ATOM 3371 CG1 VAL A 245 32.085 4.165 -9.973 1.00 48.54 C ATOM 3372 CG2 VAL A 245 32.573 6.208 -11.463 1.00 32.95 C ATOM 3373 HA VAL A 245 33.844 6.203 -9.046 1.00 0.00 H ATOM 3374 HB VAL A 245 33.651 4.358 -11.431 1.00 0.00 H ATOM 3375 HG11 VAL A 245 32.538 3.275 -9.536 1.00 0.00 H ATOM 3376 HG12 VAL A 245 31.626 4.765 -9.187 1.00 0.00 H ATOM 3377 HG13 VAL A 245 31.325 3.869 -10.696 1.00 0.00 H ATOM 3378 HG21 VAL A 245 32.135 6.910 -10.753 1.00 0.00 H ATOM 3379 HG22 VAL A 245 33.358 6.706 -12.032 1.00 0.00 H ATOM 3380 HG23 VAL A 245 31.801 5.849 -12.144 1.00 0.00 H ATOM 3381 H VAL A 245 35.851 5.351 -11.166 1.00 0.00 H ATOM 3382 N ALA A 246 34.865 4.339 -7.638 1.00 35.21 N ATOM 3383 CA ALA A 246 35.304 3.208 -6.840 1.00 36.62 C ATOM 3384 C ALA A 246 34.081 2.513 -6.202 1.00 39.36 C ATOM 3385 O ALA A 246 33.370 3.116 -5.379 1.00 38.89 O ATOM 3386 CB ALA A 246 36.285 3.657 -5.776 1.00 38.54 C ATOM 3387 HA ALA A 246 35.814 2.494 -7.486 1.00 0.00 H ATOM 3388 HB1 ALA A 246 37.153 4.112 -6.253 1.00 0.00 H ATOM 3389 HB2 ALA A 246 35.803 4.385 -5.124 1.00 0.00 H ATOM 3390 HB3 ALA A 246 36.602 2.795 -5.189 1.00 0.00 H ATOM 3391 H ALA A 246 34.563 5.214 -7.164 1.00 0.00 H ATOM 3392 N VAL A 247 33.841 1.257 -6.584 1.00 31.94 N ATOM 3393 CA VAL A 247 32.634 0.579 -6.188 1.00 35.47 C ATOM 3394 C VAL A 247 32.765 0.145 -4.754 1.00 43.83 C ATOM 3395 O VAL A 247 33.792 -0.442 -4.413 1.00 51.49 O ATOM 3396 CB VAL A 247 32.317 -0.656 -7.094 1.00 31.89 C ATOM 3397 CG1 VAL A 247 31.133 -1.390 -6.546 1.00 29.58 C ATOM 3398 CG2 VAL A 247 31.994 -0.195 -8.516 1.00 29.18 C ATOM 3399 HA VAL A 247 31.804 1.276 -6.302 1.00 0.00 H ATOM 3400 HB VAL A 247 33.188 -1.311 -7.111 1.00 0.00 H ATOM 3401 HG11 VAL A 247 31.354 -1.730 -5.534 1.00 0.00 H ATOM 3402 HG12 VAL A 247 30.271 -0.723 -6.527 1.00 0.00 H ATOM 3403 HG13 VAL A 247 30.915 -2.250 -7.180 1.00 0.00 H ATOM 3404 HG21 VAL A 247 31.127 0.466 -8.494 1.00 0.00 H ATOM 3405 HG22 VAL A 247 32.850 0.340 -8.926 1.00 0.00 H ATOM 3406 HG23 VAL A 247 31.775 -1.063 -9.137 1.00 0.00 H ATOM 3407 H VAL A 247 34.536 0.760 -7.177 1.00 0.00 H ATOM 3408 N ASP A 248 31.774 0.452 -3.905 1.00 45.59 N ATOM 3409 CA ASP A 248 31.706 -0.213 -2.594 1.00 47.04 C ATOM 3410 C ASP A 248 31.014 -1.554 -2.686 1.00 43.18 C ATOM 3411 O ASP A 248 31.537 -2.516 -2.212 1.00 47.61 O ATOM 3412 CB ASP A 248 31.144 0.685 -1.483 1.00 52.67 C ATOM 3413 CG ASP A 248 32.170 1.732 -1.019 1.00 66.47 C ATOM 3414 OD1 ASP A 248 33.357 1.371 -0.767 1.00 71.74 O ATOM 3415 OD2 ASP A 248 31.817 2.928 -0.921 1.00 71.47 O ATOM 3416 HA ASP A 248 32.735 -0.411 -2.292 1.00 0.00 H ATOM 3417 HB2 ASP A 248 30.260 1.200 -1.859 1.00 0.00 H ATOM 3418 HB3 ASP A 248 30.866 0.062 -0.633 1.00 0.00 H ATOM 3419 H ASP A 248 31.057 1.157 -4.172 1.00 0.00 H ATOM 3420 N TYR A 249 29.849 -1.637 -3.314 1.00 47.26 N ATOM 3421 CA TYR A 249 29.254 -2.941 -3.618 1.00 39.34 C ATOM 3422 C TYR A 249 28.389 -2.976 -4.890 1.00 31.85 C ATOM 3423 O TYR A 249 27.890 -1.966 -5.339 1.00 30.91 O ATOM 3424 CB TYR A 249 28.501 -3.502 -2.400 1.00 45.38 C ATOM 3425 CG TYR A 249 27.300 -2.700 -1.949 1.00 48.28 C ATOM 3426 CD1 TYR A 249 26.082 -2.805 -2.609 1.00 49.32 C ATOM 3427 CD2 TYR A 249 27.377 -1.858 -0.845 1.00 44.29 C ATOM 3428 CE1 TYR A 249 24.983 -2.096 -2.185 1.00 48.64 C ATOM 3429 CE2 TYR A 249 26.295 -1.140 -0.423 1.00 43.20 C ATOM 3430 CZ TYR A 249 25.095 -1.262 -1.089 1.00 46.73 C ATOM 3431 OH TYR A 249 23.996 -0.534 -0.686 1.00 45.87 O ATOM 3432 HA TYR A 249 30.096 -3.596 -3.843 1.00 0.00 H ATOM 3433 HB3 TYR A 249 29.202 -3.555 -1.567 1.00 0.00 H ATOM 3434 HB2 TYR A 249 28.159 -4.507 -2.650 1.00 0.00 H ATOM 3435 HD2 TYR A 249 28.320 -1.769 -0.306 1.00 0.00 H ATOM 3436 HE2 TYR A 249 26.380 -0.474 0.436 1.00 0.00 H ATOM 3437 HE1 TYR A 249 24.032 -2.191 -2.709 1.00 0.00 H ATOM 3438 HD1 TYR A 249 25.996 -3.460 -3.476 1.00 0.00 H ATOM 3439 HH TYR A 249 24.202 0.433 -0.746 1.00 0.00 H ATOM 3440 H TYR A 249 29.352 -0.767 -3.594 1.00 0.00 H ATOM 3441 N LEU A 250 28.247 -4.153 -5.487 1.00 28.49 N ATOM 3442 CA LEU A 250 27.324 -4.327 -6.568 1.00 25.03 C ATOM 3443 C LEU A 250 26.685 -5.694 -6.406 1.00 30.48 C ATOM 3444 O LEU A 250 27.348 -6.733 -6.453 1.00 26.19 O ATOM 3445 CB LEU A 250 27.954 -4.059 -7.955 1.00 26.34 C ATOM 3446 CG LEU A 250 27.085 -4.298 -9.207 1.00 26.85 C ATOM 3447 CD1 LEU A 250 25.993 -3.213 -9.359 1.00 29.20 C ATOM 3448 CD2 LEU A 250 27.938 -4.335 -10.462 1.00 24.68 C ATOM 3449 HA LEU A 250 26.539 -3.572 -6.524 1.00 0.00 H ATOM 3450 HB2 LEU A 250 28.267 -3.015 -7.972 1.00 0.00 H ATOM 3451 HB3 LEU A 250 28.831 -4.701 -8.042 1.00 0.00 H ATOM 3452 HG LEU A 250 26.598 -5.264 -9.075 1.00 0.00 H ATOM 3453 HD21 LEU A 250 28.459 -3.384 -10.574 1.00 0.00 H ATOM 3454 HD22 LEU A 250 28.666 -5.142 -10.381 1.00 0.00 H ATOM 3455 HD23 LEU A 250 27.299 -4.505 -11.329 1.00 0.00 H ATOM 3456 HD11 LEU A 250 25.345 -3.226 -8.483 1.00 0.00 H ATOM 3457 HD12 LEU A 250 26.465 -2.235 -9.449 1.00 0.00 H ATOM 3458 HD13 LEU A 250 25.402 -3.416 -10.252 1.00 0.00 H ATOM 3459 H LEU A 250 28.815 -4.962 -5.164 1.00 0.00 H ATOM 3460 N GLU A 251 25.370 -5.689 -6.175 1.00 30.91 N ATOM 3461 CA GLU A 251 24.757 -6.858 -5.596 1.00 29.22 C ATOM 3462 C GLU A 251 23.355 -7.166 -6.095 1.00 28.07 C ATOM 3463 O GLU A 251 22.476 -6.301 -6.250 1.00 28.13 O ATOM 3464 CB GLU A 251 24.758 -6.722 -4.065 1.00 34.60 C ATOM 3465 CG GLU A 251 26.025 -7.198 -3.359 1.00 40.19 C ATOM 3466 CD GLU A 251 25.741 -7.965 -2.046 1.00 53.60 C ATOM 3467 OE1 GLU A 251 24.804 -8.815 -1.999 1.00 58.65 O ATOM 3468 OE2 GLU A 251 26.473 -7.721 -1.056 1.00 57.42 O ATOM 3469 HA GLU A 251 25.361 -7.706 -5.920 1.00 0.00 H ATOM 3470 HB2 GLU A 251 24.614 -5.669 -3.822 1.00 0.00 H ATOM 3471 HB3 GLU A 251 23.920 -7.301 -3.677 1.00 0.00 H ATOM 3472 HG2 GLU A 251 26.571 -7.857 -4.034 1.00 0.00 H ATOM 3473 HG3 GLU A 251 26.640 -6.328 -3.126 1.00 0.00 H ATOM 3474 H GLU A 251 24.796 -4.854 -6.409 1.00 0.00 H ATOM 3475 N LEU A 252 23.150 -8.443 -6.316 1.00 27.49 N ATOM 3476 CA LEU A 252 21.938 -8.917 -6.924 1.00 32.76 C ATOM 3477 C LEU A 252 21.143 -9.663 -5.879 1.00 32.49 C ATOM 3478 O LEU A 252 21.654 -10.584 -5.276 1.00 23.92 O ATOM 3479 CB LEU A 252 22.283 -9.824 -8.093 1.00 26.63 C ATOM 3480 CG LEU A 252 21.179 -10.334 -8.969 1.00 30.95 C ATOM 3481 CD1 LEU A 252 20.009 -9.400 -8.999 1.00 33.96 C ATOM 3482 CD2 LEU A 252 21.780 -10.548 -10.371 1.00 33.17 C ATOM 3483 HA LEU A 252 21.343 -8.085 -7.302 1.00 0.00 H ATOM 3484 HB2 LEU A 252 22.970 -9.272 -8.734 1.00 0.00 H ATOM 3485 HB3 LEU A 252 22.793 -10.695 -7.682 1.00 0.00 H ATOM 3486 HG LEU A 252 20.786 -11.272 -8.576 1.00 0.00 H ATOM 3487 HD21 LEU A 252 22.166 -9.601 -10.748 1.00 0.00 H ATOM 3488 HD22 LEU A 252 22.591 -11.274 -10.310 1.00 0.00 H ATOM 3489 HD23 LEU A 252 21.007 -10.920 -11.043 1.00 0.00 H ATOM 3490 HD11 LEU A 252 19.615 -9.280 -7.990 1.00 0.00 H ATOM 3491 HD12 LEU A 252 20.329 -8.431 -9.383 1.00 0.00 H ATOM 3492 HD13 LEU A 252 19.234 -9.811 -9.646 1.00 0.00 H ATOM 3493 H LEU A 252 23.883 -9.129 -6.044 1.00 0.00 H ATOM 3494 N ARG A 253 19.885 -9.263 -5.680 1.00 32.16 N ATOM 3495 CA ARG A 253 19.136 -9.805 -4.593 1.00 34.64 C ATOM 3496 C ARG A 253 17.727 -10.036 -5.005 1.00 35.08 C ATOM 3497 O ARG A 253 17.302 -9.564 -6.062 1.00 34.60 O ATOM 3498 CB ARG A 253 19.214 -8.854 -3.409 1.00 28.88 C ATOM 3499 CG ARG A 253 20.605 -8.901 -2.829 1.00 33.09 C ATOM 3500 CD ARG A 253 20.660 -8.559 -1.375 1.00 36.99 C ATOM 3501 NE ARG A 253 22.012 -8.695 -0.810 1.00 40.74 N ATOM 3502 CZ ARG A 253 22.244 -8.937 0.481 1.00 38.52 C ATOM 3503 NH1 ARG A 253 21.194 -9.083 1.297 1.00 29.57 N ATOM 3504 NH2 ARG A 253 23.504 -9.027 0.964 1.00 34.92 N ATOM 3505 HA ARG A 253 19.557 -10.766 -4.298 1.00 0.00 H ATOM 3506 HB2 ARG A 253 18.990 -7.840 -3.740 1.00 0.00 H ATOM 3507 HB3 ARG A 253 18.492 -9.155 -2.650 1.00 0.00 H ATOM 3508 HG2 ARG A 253 21.000 -9.908 -2.961 1.00 0.00 H ATOM 3509 HG3 ARG A 253 21.230 -8.193 -3.374 1.00 0.00 H ATOM 3510 HD2 ARG A 253 19.987 -9.225 -0.834 1.00 0.00 H ATOM 3511 HD3 ARG A 253 20.330 -7.528 -1.246 1.00 0.00 H ATOM 3512 HE ARG A 253 22.827 -8.598 -1.449 1.00 0.00 H ATOM 3513 HH12 ARG A 253 21.344 -9.272 2.309 1.00 0.00 H ATOM 3514 HH11 ARG A 253 20.228 -9.007 0.920 1.00 0.00 H ATOM 3515 HH22 ARG A 253 23.661 -9.216 1.974 1.00 0.00 H ATOM 3516 HH21 ARG A 253 24.316 -8.907 0.325 1.00 0.00 H ATOM 3517 H ARG A 253 19.453 -8.560 -6.314 1.00 0.00 H ATOM 3518 N ASP A 254 17.013 -10.782 -4.175 1.00 33.13 N ATOM 3519 CA ASP A 254 15.596 -10.896 -4.325 1.00 37.76 C ATOM 3520 C ASP A 254 14.882 -9.535 -3.940 1.00 38.38 C ATOM 3521 O ASP A 254 15.490 -8.616 -3.360 1.00 36.94 O ATOM 3522 CB ASP A 254 15.167 -12.139 -3.534 1.00 45.72 C ATOM 3523 CG ASP A 254 14.182 -11.840 -2.430 1.00 51.65 C ATOM 3524 OD1 ASP A 254 14.564 -11.347 -1.346 1.00 53.74 O ATOM 3525 OD2 ASP A 254 12.995 -12.104 -2.677 1.00 60.89 O ATOM 3526 HA ASP A 254 15.284 -11.050 -5.358 1.00 0.00 H ATOM 3527 HB2 ASP A 254 14.707 -12.846 -4.225 1.00 0.00 H ATOM 3528 HB3 ASP A 254 16.055 -12.590 -3.092 1.00 0.00 H ATOM 3529 H ASP A 254 17.490 -11.292 -3.404 1.00 0.00 H ATOM 3530 N ILE A 255 13.609 -9.362 -4.273 1.00 36.36 N ATOM 3531 CA ILE A 255 13.033 -8.062 -3.986 1.00 33.10 C ATOM 3532 C ILE A 255 12.940 -7.752 -2.482 1.00 33.66 C ATOM 3533 O ILE A 255 12.879 -6.581 -2.085 1.00 26.18 O ATOM 3534 CB ILE A 255 11.678 -7.851 -4.631 1.00 34.68 C ATOM 3535 CG1 ILE A 255 10.725 -8.937 -4.178 1.00 39.42 C ATOM 3536 CG2 ILE A 255 11.792 -7.792 -6.120 1.00 37.07 C ATOM 3537 CD1 ILE A 255 9.429 -8.351 -3.718 1.00 48.65 C ATOM 3538 HA ILE A 255 13.737 -7.360 -4.433 1.00 0.00 H ATOM 3539 HB ILE A 255 11.277 -6.889 -4.311 1.00 0.00 H ATOM 3540 HG12 ILE A 255 10.535 -9.615 -5.010 1.00 0.00 H ATOM 3541 HG13 ILE A 255 11.179 -9.490 -3.356 1.00 0.00 H ATOM 3542 HD11 ILE A 255 9.613 -7.675 -2.883 1.00 0.00 H ATOM 3543 HD12 ILE A 255 8.969 -7.800 -4.539 1.00 0.00 H ATOM 3544 HD13 ILE A 255 8.763 -9.152 -3.398 1.00 0.00 H ATOM 3545 HG21 ILE A 255 12.444 -6.965 -6.401 1.00 0.00 H ATOM 3546 HG22 ILE A 255 12.211 -8.728 -6.488 1.00 0.00 H ATOM 3547 HG23 ILE A 255 10.803 -7.640 -6.553 1.00 0.00 H ATOM 3548 H ILE A 255 13.053 -10.120 -4.717 1.00 0.00 H ATOM 3549 N GLY A 256 12.916 -8.793 -1.648 1.00 34.04 N ATOM 3550 CA GLY A 256 12.813 -8.600 -0.205 1.00 27.86 C ATOM 3551 C GLY A 256 14.209 -8.589 0.405 1.00 35.74 C ATOM 3552 O GLY A 256 14.351 -8.692 1.636 1.00 28.83 O ATOM 3553 HA3 GLY A 256 12.232 -9.413 0.230 1.00 0.00 H ATOM 3554 HA2 GLY A 256 12.318 -7.651 0.001 1.00 0.00 H ATOM 3555 H GLY A 256 12.972 -9.758 -2.032 1.00 0.00 H ATOM 3556 N LEU A 257 15.223 -8.491 -0.472 1.00 30.54 N ATOM 3557 CA LEU A 257 16.653 -8.474 -0.121 1.00 35.26 C ATOM 3558 C LEU A 257 17.251 -9.773 0.496 1.00 38.98 C ATOM 3559 O LEU A 257 18.366 -9.775 1.027 1.00 35.73 O ATOM 3560 CB LEU A 257 17.053 -7.198 0.660 1.00 28.61 C ATOM 3561 CG LEU A 257 16.974 -5.888 -0.121 1.00 23.29 C ATOM 3562 CD1 LEU A 257 17.684 -4.816 0.619 1.00 12.32 C ATOM 3563 CD2 LEU A 257 17.514 -5.980 -1.590 1.00 22.77 C ATOM 3564 HA LEU A 257 17.138 -8.442 -1.097 1.00 0.00 H ATOM 3565 HB2 LEU A 257 16.393 -7.113 1.523 1.00 0.00 H ATOM 3566 HB3 LEU A 257 18.081 -7.323 1.001 1.00 0.00 H ATOM 3567 HG LEU A 257 15.913 -5.653 -0.210 1.00 0.00 H ATOM 3568 HD21 LEU A 257 18.562 -6.279 -1.572 1.00 0.00 H ATOM 3569 HD22 LEU A 257 16.933 -6.718 -2.144 1.00 0.00 H ATOM 3570 HD23 LEU A 257 17.421 -5.007 -2.072 1.00 0.00 H ATOM 3571 HD11 LEU A 257 17.220 -4.682 1.596 1.00 0.00 H ATOM 3572 HD12 LEU A 257 18.729 -5.096 0.748 1.00 0.00 H ATOM 3573 HD13 LEU A 257 17.623 -3.885 0.055 1.00 0.00 H ATOM 3574 H LEU A 257 14.978 -8.422 -1.480 1.00 0.00 H ATOM 3575 N GLY A 258 16.546 -10.892 0.355 1.00 44.19 N ATOM 3576 CA GLY A 258 17.215 -12.200 0.456 1.00 47.03 C ATOM 3577 C GLY A 258 18.053 -12.591 -0.768 1.00 57.26 C ATOM 3578 O GLY A 258 18.262 -11.787 -1.686 1.00 45.38 O ATOM 3579 HA3 GLY A 258 16.449 -12.962 0.601 1.00 0.00 H ATOM 3580 HA2 GLY A 258 17.873 -12.178 1.325 1.00 0.00 H ATOM 3581 H GLY A 258 15.523 -10.843 0.174 1.00 0.00 H ATOM 3582 N PRO A 259 18.502 -13.862 -0.791 1.00 66.12 N ATOM 3583 CA PRO A 259 19.499 -14.528 -1.622 1.00 71.97 C ATOM 3584 C PRO A 259 19.782 -14.057 -3.048 1.00 73.91 C ATOM 3585 O PRO A 259 20.376 -13.009 -3.268 1.00 76.73 O ATOM 3586 CB PRO A 259 19.022 -15.993 -1.597 1.00 70.30 C ATOM 3587 CG PRO A 259 18.661 -16.164 -0.187 1.00 69.66 C ATOM 3588 CD PRO A 259 17.946 -14.837 0.172 1.00 69.77 C ATOM 3589 HA PRO A 259 20.479 -14.302 -1.201 1.00 0.00 H ATOM 3590 HD3 PRO A 259 16.867 -14.932 0.049 1.00 0.00 H ATOM 3591 HD2 PRO A 259 18.169 -14.541 1.197 1.00 0.00 H ATOM 3592 HG3 PRO A 259 19.550 -16.306 0.428 1.00 0.00 H ATOM 3593 HG2 PRO A 259 17.991 -17.014 -0.057 1.00 0.00 H ATOM 3594 HB2 PRO A 259 18.161 -16.142 -2.249 1.00 0.00 H ATOM 3595 HB3 PRO A 259 19.820 -16.676 -1.889 1.00 0.00 H ATOM 3596 N MET A 260 19.447 -14.900 -4.002 1.00 77.80 N ATOM 3597 CA MET A 260 19.903 -14.717 -5.359 1.00 77.95 C ATOM 3598 C MET A 260 18.634 -15.135 -6.081 1.00 78.74 C ATOM 3599 O MET A 260 18.352 -16.336 -6.180 1.00 77.07 O ATOM 3600 CB MET A 260 21.100 -15.643 -5.643 1.00 74.12 C ATOM 3601 HA MET A 260 20.271 -13.729 -5.635 1.00 0.00 H ATOM 3602 HB2 MET A 260 21.912 -15.405 -4.956 1.00 0.00 H ATOM 3603 HB3 MET A 260 20.796 -16.680 -5.503 1.00 0.00 H ATOM 3604 H MET A 260 18.842 -15.714 -3.773 1.00 0.00 H ATOM 3605 N PRO A 261 17.859 -14.132 -6.574 1.00 77.94 N ATOM 3606 CA PRO A 261 16.415 -14.134 -6.827 1.00 77.29 C ATOM 3607 C PRO A 261 15.848 -15.436 -7.418 1.00 79.01 C ATOM 3608 O PRO A 261 14.910 -15.390 -8.226 1.00 80.00 O ATOM 3609 CB PRO A 261 16.234 -12.954 -7.811 1.00 74.88 C ATOM 3610 CG PRO A 261 17.583 -12.508 -8.181 1.00 71.76 C ATOM 3611 CD PRO A 261 18.452 -12.865 -7.031 1.00 73.97 C ATOM 3612 HA PRO A 261 15.864 -14.043 -5.891 1.00 0.00 H ATOM 3613 HD3 PRO A 261 19.487 -13.003 -7.345 1.00 0.00 H ATOM 3614 HD2 PRO A 261 18.409 -12.104 -6.252 1.00 0.00 H ATOM 3615 HG3 PRO A 261 17.595 -11.431 -8.348 1.00 0.00 H ATOM 3616 HG2 PRO A 261 17.918 -13.018 -9.084 1.00 0.00 H ATOM 3617 HB2 PRO A 261 15.690 -13.282 -8.696 1.00 0.00 H ATOM 3618 HB3 PRO A 261 15.688 -12.143 -7.330 1.00 0.00 H ATOM 3619 N LEU A 262 16.393 -16.579 -6.982 1.00 80.79 N ATOM 3620 CA LEU A 262 16.161 -17.904 -7.600 1.00 79.11 C ATOM 3621 C LEU A 262 16.733 -17.913 -9.032 1.00 77.78 C ATOM 3622 O LEU A 262 17.885 -18.309 -9.261 1.00 74.20 O ATOM 3623 CB LEU A 262 14.669 -18.267 -7.557 1.00 76.99 C ATOM 3624 HA LEU A 262 16.683 -18.673 -7.031 1.00 0.00 H ATOM 3625 HB2 LEU A 262 14.333 -18.297 -6.520 1.00 0.00 H ATOM 3626 HB3 LEU A 262 14.098 -17.517 -8.104 1.00 0.00 H ATOM 3627 H LEU A 262 17.021 -16.533 -6.154 1.00 0.00 H ATOM 3628 N ASN A 263 15.891 -17.474 -9.970 1.00 76.78 N ATOM 3629 CA ASN A 263 16.275 -16.994 -11.291 1.00 73.29 C ATOM 3630 C ASN A 263 15.112 -16.218 -11.919 1.00 71.13 C ATOM 3631 O ASN A 263 14.940 -16.197 -13.151 1.00 66.10 O ATOM 3632 CB ASN A 263 16.697 -18.145 -12.198 1.00 75.31 C ATOM 3633 CG ASN A 263 17.858 -17.756 -13.089 1.00 81.27 C ATOM 3634 OD1 ASN A 263 18.935 -17.369 -12.589 1.00 82.97 O ATOM 3635 ND2 ASN A 263 17.649 -17.816 -14.414 1.00 78.06 N ATOM 3636 HA ASN A 263 17.132 -16.330 -11.179 1.00 0.00 H ATOM 3637 HB2 ASN A 263 16.994 -18.992 -11.580 1.00 0.00 H ATOM 3638 HB3 ASN A 263 15.851 -18.431 -12.823 1.00 0.00 H ATOM 3639 HD22 ASN A 263 16.734 -18.146 -14.782 1.00 0.00 H ATOM 3640 HD21 ASN A 263 18.402 -17.533 -15.073 1.00 0.00 H ATOM 3641 H ASN A 263 14.877 -17.475 -9.739 1.00 0.00 H ATOM 3642 N GLY A 264 14.314 -15.585 -11.056 1.00 66.17 N ATOM 3643 CA GLY A 264 12.997 -15.096 -11.443 1.00 65.09 C ATOM 3644 C GLY A 264 12.880 -13.607 -11.700 1.00 63.47 C ATOM 3645 O GLY A 264 12.442 -13.198 -12.777 1.00 69.44 O ATOM 3646 HA3 GLY A 264 12.300 -15.351 -10.644 1.00 0.00 H ATOM 3647 HA2 GLY A 264 12.706 -15.614 -12.356 1.00 0.00 H ATOM 3648 H GLY A 264 14.641 -15.437 -10.080 1.00 0.00 H ATOM 3649 N SER A 265 13.307 -12.814 -10.716 1.00 54.28 N ATOM 3650 CA SER A 265 12.957 -11.409 -10.570 1.00 48.78 C ATOM 3651 C SER A 265 13.441 -10.867 -9.200 1.00 49.52 C ATOM 3652 O SER A 265 13.256 -11.524 -8.168 1.00 49.87 O ATOM 3653 CB SER A 265 11.442 -11.201 -10.690 1.00 46.01 C ATOM 3654 OG SER A 265 10.993 -10.350 -9.648 1.00 36.61 O ATOM 3655 HA SER A 265 13.452 -10.862 -11.372 1.00 0.00 H ATOM 3656 HB2 SER A 265 10.937 -12.164 -10.615 1.00 0.00 H ATOM 3657 HB3 SER A 265 11.214 -10.746 -11.654 1.00 0.00 H ATOM 3658 HG SER A 265 11.200 -10.764 -8.773 1.00 0.00 H ATOM 3659 H SER A 265 13.936 -13.230 -10.000 1.00 0.00 H ATOM 3660 N GLY A 266 14.038 -9.668 -9.186 1.00 44.73 N ATOM 3661 CA GLY A 266 14.689 -9.152 -7.974 1.00 42.27 C ATOM 3662 C GLY A 266 15.246 -7.744 -8.082 1.00 38.55 C ATOM 3663 O GLY A 266 14.749 -6.938 -8.858 1.00 36.26 O ATOM 3664 HA3 GLY A 266 15.512 -9.821 -7.724 1.00 0.00 H ATOM 3665 HA2 GLY A 266 13.956 -9.163 -7.168 1.00 0.00 H ATOM 3666 H GLY A 266 14.041 -9.090 -10.051 1.00 0.00 H ATOM 3667 N ARG A 267 16.303 -7.461 -7.314 1.00 34.57 N ATOM 3668 CA ARG A 267 16.824 -6.125 -7.232 1.00 32.65 C ATOM 3669 C ARG A 267 18.303 -6.133 -7.362 1.00 33.91 C ATOM 3670 O ARG A 267 18.951 -7.035 -6.816 1.00 29.31 O ATOM 3671 CB ARG A 267 16.434 -5.444 -5.912 1.00 30.51 C ATOM 3672 CG ARG A 267 16.298 -3.922 -6.046 1.00 28.11 C ATOM 3673 CD ARG A 267 14.946 -3.519 -6.656 1.00 27.95 C ATOM 3674 NE ARG A 267 14.879 -2.066 -6.859 1.00 22.57 N ATOM 3675 CZ ARG A 267 13.788 -1.403 -7.265 1.00 24.87 C ATOM 3676 NH1 ARG A 267 12.674 -2.056 -7.548 1.00 21.20 N ATOM 3677 NH2 ARG A 267 13.810 -0.083 -7.401 1.00 24.21 N ATOM 3678 HA ARG A 267 16.387 -5.559 -8.055 1.00 0.00 H ATOM 3679 HB2 ARG A 267 15.480 -5.851 -5.578 1.00 0.00 H ATOM 3680 HB3 ARG A 267 17.200 -5.661 -5.168 1.00 0.00 H ATOM 3681 HG2 ARG A 267 16.387 -3.472 -5.057 1.00 0.00 H ATOM 3682 HG3 ARG A 267 17.098 -3.551 -6.686 1.00 0.00 H ATOM 3683 HD2 ARG A 267 14.145 -3.824 -5.983 1.00 0.00 H ATOM 3684 HD3 ARG A 267 14.823 -4.021 -7.616 1.00 0.00 H ATOM 3685 HE ARG A 267 15.740 -1.512 -6.674 1.00 0.00 H ATOM 3686 HH12 ARG A 267 11.831 -1.534 -7.863 1.00 0.00 H ATOM 3687 HH11 ARG A 267 12.640 -3.091 -7.456 1.00 0.00 H ATOM 3688 HH22 ARG A 267 12.957 0.421 -7.717 1.00 0.00 H ATOM 3689 HH21 ARG A 267 14.680 0.447 -7.192 1.00 0.00 H ATOM 3690 H ARG A 267 16.756 -8.221 -6.767 1.00 0.00 H ATOM 3691 N LEU A 268 18.802 -5.124 -8.100 1.00 26.51 N ATOM 3692 CA LEU A 268 20.230 -4.887 -8.297 1.00 31.16 C ATOM 3693 C LEU A 268 20.596 -3.614 -7.590 1.00 28.12 C ATOM 3694 O LEU A 268 19.925 -2.608 -7.795 1.00 28.20 O ATOM 3695 CB LEU A 268 20.587 -4.711 -9.793 1.00 30.69 C ATOM 3696 CG LEU A 268 22.073 -4.402 -10.103 1.00 29.30 C ATOM 3697 CD1 LEU A 268 23.009 -5.378 -9.410 1.00 21.39 C ATOM 3698 CD2 LEU A 268 22.318 -4.537 -11.556 1.00 20.15 C ATOM 3699 HA LEU A 268 20.772 -5.749 -7.908 1.00 0.00 H ATOM 3700 HB2 LEU A 268 20.323 -5.633 -10.310 1.00 0.00 H ATOM 3701 HB3 LEU A 268 19.986 -3.891 -10.186 1.00 0.00 H ATOM 3702 HG LEU A 268 22.266 -3.389 -9.749 1.00 0.00 H ATOM 3703 HD21 LEU A 268 22.087 -5.555 -11.869 1.00 0.00 H ATOM 3704 HD22 LEU A 268 21.682 -3.836 -12.097 1.00 0.00 H ATOM 3705 HD23 LEU A 268 23.365 -4.319 -11.769 1.00 0.00 H ATOM 3706 HD11 LEU A 268 22.864 -5.315 -8.332 1.00 0.00 H ATOM 3707 HD12 LEU A 268 22.792 -6.391 -9.749 1.00 0.00 H ATOM 3708 HD13 LEU A 268 24.041 -5.125 -9.654 1.00 0.00 H ATOM 3709 H LEU A 268 18.131 -4.474 -8.557 1.00 0.00 H ATOM 3710 N LEU A 269 21.669 -3.649 -6.795 1.00 25.17 N ATOM 3711 CA LEU A 269 21.995 -2.530 -5.939 1.00 19.24 C ATOM 3712 C LEU A 269 23.420 -2.138 -6.091 1.00 27.30 C ATOM 3713 O LEU A 269 24.345 -2.979 -6.163 1.00 27.89 O ATOM 3714 CB LEU A 269 21.724 -2.824 -4.467 1.00 25.40 C ATOM 3715 CG LEU A 269 20.281 -3.194 -4.116 1.00 25.03 C ATOM 3716 CD1 LEU A 269 20.281 -4.702 -3.821 1.00 27.77 C ATOM 3717 CD2 LEU A 269 19.785 -2.477 -2.918 1.00 23.90 C ATOM 3718 HA LEU A 269 21.348 -1.712 -6.254 1.00 0.00 H ATOM 3719 HB2 LEU A 269 22.364 -3.654 -4.168 1.00 0.00 H ATOM 3720 HB3 LEU A 269 21.991 -1.936 -3.894 1.00 0.00 H ATOM 3721 HG LEU A 269 19.628 -2.919 -4.944 1.00 0.00 H ATOM 3722 HD21 LEU A 269 20.413 -2.725 -2.062 1.00 0.00 H ATOM 3723 HD22 LEU A 269 19.822 -1.403 -3.098 1.00 0.00 H ATOM 3724 HD23 LEU A 269 18.757 -2.778 -2.716 1.00 0.00 H ATOM 3725 HD11 LEU A 269 20.620 -5.244 -4.704 1.00 0.00 H ATOM 3726 HD12 LEU A 269 20.952 -4.908 -2.987 1.00 0.00 H ATOM 3727 HD13 LEU A 269 19.271 -5.021 -3.564 1.00 0.00 H ATOM 3728 H LEU A 269 22.278 -4.492 -6.792 1.00 0.00 H ATOM 3729 N VAL A 270 23.604 -0.831 -6.106 1.00 24.44 N ATOM 3730 CA VAL A 270 24.929 -0.307 -6.231 1.00 28.73 C ATOM 3731 C VAL A 270 25.214 0.898 -5.282 1.00 29.49 C ATOM 3732 O VAL A 270 24.354 1.794 -5.099 1.00 31.64 O ATOM 3733 CB VAL A 270 25.249 -0.005 -7.751 1.00 29.33 C ATOM 3734 CG1 VAL A 270 24.529 1.252 -8.252 1.00 19.33 C ATOM 3735 CG2 VAL A 270 26.757 0.065 -7.977 1.00 23.92 C ATOM 3736 HA VAL A 270 25.625 -1.074 -5.891 1.00 0.00 H ATOM 3737 HB VAL A 270 24.862 -0.832 -8.346 1.00 0.00 H ATOM 3738 HG11 VAL A 270 23.452 1.117 -8.151 1.00 0.00 H ATOM 3739 HG12 VAL A 270 24.846 2.111 -7.660 1.00 0.00 H ATOM 3740 HG13 VAL A 270 24.779 1.419 -9.300 1.00 0.00 H ATOM 3741 HG21 VAL A 270 27.179 0.859 -7.361 1.00 0.00 H ATOM 3742 HG22 VAL A 270 27.209 -0.888 -7.702 1.00 0.00 H ATOM 3743 HG23 VAL A 270 26.956 0.273 -9.028 1.00 0.00 H ATOM 3744 H VAL A 270 22.791 -0.187 -6.027 1.00 0.00 H ATOM 3745 N ALA A 271 26.448 0.893 -4.756 1.00 22.18 N ATOM 3746 CA ALA A 271 27.051 1.895 -3.902 1.00 31.16 C ATOM 3747 C ALA A 271 28.466 2.174 -4.404 1.00 35.62 C ATOM 3748 O ALA A 271 29.273 1.220 -4.577 1.00 38.77 O ATOM 3749 CB ALA A 271 27.111 1.367 -2.446 1.00 25.94 C ATOM 3750 HA ALA A 271 26.460 2.810 -3.925 1.00 0.00 H ATOM 3751 HB1 ALA A 271 26.101 1.152 -2.097 1.00 0.00 H ATOM 3752 HB2 ALA A 271 27.709 0.456 -2.416 1.00 0.00 H ATOM 3753 HB3 ALA A 271 27.565 2.123 -1.805 1.00 0.00 H ATOM 3754 H ALA A 271 27.042 0.072 -4.989 1.00 0.00 H ATOM 3755 N ALA A 272 28.794 3.458 -4.607 1.00 31.99 N ATOM 3756 CA ALA A 272 30.139 3.850 -5.127 1.00 35.50 C ATOM 3757 C ALA A 272 30.633 5.256 -4.746 1.00 34.98 C ATOM 3758 O ALA A 272 29.829 6.184 -4.610 1.00 37.45 O ATOM 3759 CB ALA A 272 30.217 3.669 -6.644 1.00 31.67 C ATOM 3760 HA ALA A 272 30.817 3.165 -4.618 1.00 0.00 H ATOM 3761 HB1 ALA A 272 30.037 2.623 -6.894 1.00 0.00 H ATOM 3762 HB2 ALA A 272 29.462 4.293 -7.122 1.00 0.00 H ATOM 3763 HB3 ALA A 272 31.207 3.962 -6.993 1.00 0.00 H ATOM 3764 H ALA A 272 28.095 4.199 -4.397 1.00 0.00 H ATOM 3765 N ARG A 273 31.957 5.406 -4.580 1.00 42.28 N ATOM 3766 CA ARG A 273 32.573 6.699 -4.197 1.00 45.42 C ATOM 3767 C ARG A 273 33.006 7.458 -5.433 1.00 45.45 C ATOM 3768 O ARG A 273 33.537 6.853 -6.378 1.00 45.34 O ATOM 3769 CB ARG A 273 33.746 6.505 -3.222 1.00 42.61 C ATOM 3770 CG ARG A 273 33.298 6.367 -1.746 1.00 53.54 C ATOM 3771 CD ARG A 273 34.296 5.667 -0.792 1.00 54.74 C ATOM 3772 NE ARG A 273 34.612 4.300 -1.236 1.00 68.38 N ATOM 3773 CZ ARG A 273 35.846 3.803 -1.408 1.00 73.71 C ATOM 3774 NH1 ARG A 273 36.913 4.554 -1.145 1.00 72.11 N ATOM 3775 NH2 ARG A 273 36.023 2.538 -1.824 1.00 72.23 N ATOM 3776 HA ARG A 273 31.821 7.289 -3.674 1.00 0.00 H ATOM 3777 HB2 ARG A 273 34.287 5.602 -3.506 1.00 0.00 H ATOM 3778 HB3 ARG A 273 34.410 7.365 -3.303 1.00 0.00 H ATOM 3779 HG2 ARG A 273 33.114 7.369 -1.359 1.00 0.00 H ATOM 3780 HG3 ARG A 273 32.369 5.797 -1.732 1.00 0.00 H ATOM 3781 HD2 ARG A 273 33.858 5.622 0.205 1.00 0.00 H ATOM 3782 HD3 ARG A 273 35.217 6.248 -0.757 1.00 0.00 H ATOM 3783 HE ARG A 273 33.811 3.666 -1.433 1.00 0.00 H ATOM 3784 HH12 ARG A 273 37.868 4.165 -1.279 1.00 0.00 H ATOM 3785 HH11 ARG A 273 36.791 5.529 -0.805 1.00 0.00 H ATOM 3786 HH22 ARG A 273 36.984 2.163 -1.954 1.00 0.00 H ATOM 3787 HH21 ARG A 273 35.199 1.934 -2.016 1.00 0.00 H ATOM 3788 H ARG A 273 32.575 4.582 -4.726 1.00 0.00 H ATOM 3789 N LEU A 274 32.720 8.760 -5.463 1.00 47.24 N ATOM 3790 CA LEU A 274 33.452 9.691 -6.355 1.00 54.81 C ATOM 3791 C LEU A 274 34.128 10.832 -5.570 1.00 58.46 C ATOM 3792 O LEU A 274 33.474 11.842 -5.212 1.00 59.78 O ATOM 3793 CB LEU A 274 32.575 10.262 -7.463 1.00 56.56 C ATOM 3794 CG LEU A 274 32.377 9.404 -8.712 1.00 60.99 C ATOM 3795 CD1 LEU A 274 30.990 8.807 -8.731 1.00 61.89 C ATOM 3796 CD2 LEU A 274 32.589 10.211 -9.966 1.00 59.38 C ATOM 3797 HA LEU A 274 34.229 9.091 -6.828 1.00 0.00 H ATOM 3798 HB2 LEU A 274 31.590 10.452 -7.036 1.00 0.00 H ATOM 3799 HB3 LEU A 274 33.020 11.205 -7.780 1.00 0.00 H ATOM 3800 HG LEU A 274 33.116 8.604 -8.680 1.00 0.00 H ATOM 3801 HD21 LEU A 274 31.875 11.034 -9.992 1.00 0.00 H ATOM 3802 HD22 LEU A 274 33.604 10.608 -9.974 1.00 0.00 H ATOM 3803 HD23 LEU A 274 32.441 9.572 -10.837 1.00 0.00 H ATOM 3804 HD11 LEU A 274 30.852 8.184 -7.848 1.00 0.00 H ATOM 3805 HD12 LEU A 274 30.251 9.608 -8.731 1.00 0.00 H ATOM 3806 HD13 LEU A 274 30.869 8.200 -9.628 1.00 0.00 H ATOM 3807 H LEU A 274 31.968 9.130 -4.848 1.00 0.00 H ATOM 3808 N GLY A 275 35.435 10.688 -5.325 1.00 59.43 N ATOM 3809 CA GLY A 275 36.100 11.502 -4.318 1.00 55.79 C ATOM 3810 C GLY A 275 35.646 10.945 -2.981 1.00 58.59 C ATOM 3811 O GLY A 275 35.621 9.709 -2.789 1.00 58.08 O ATOM 3812 HA3 GLY A 275 35.804 12.547 -4.416 1.00 0.00 H ATOM 3813 HA2 GLY A 275 37.183 11.421 -4.417 1.00 0.00 H ATOM 3814 H GLY A 275 35.983 9.985 -5.861 1.00 0.00 H ATOM 3815 N THR A 276 35.268 11.834 -2.062 1.00 58.48 N ATOM 3816 CA THR A 276 34.672 11.377 -0.775 1.00 64.35 C ATOM 3817 C THR A 276 33.126 11.253 -0.816 1.00 60.45 C ATOM 3818 O THR A 276 32.511 10.850 0.173 1.00 59.76 O ATOM 3819 CB THR A 276 35.134 12.245 0.461 1.00 64.35 C ATOM 3820 OG1 THR A 276 35.880 13.383 -0.004 1.00 58.31 O ATOM 3821 CG2 THR A 276 35.968 11.402 1.494 1.00 59.59 C ATOM 3822 HA THR A 276 35.066 10.370 -0.636 1.00 0.00 H ATOM 3823 HB THR A 276 34.245 12.591 0.989 1.00 0.00 H ATOM 3824 HG1 THR A 276 36.169 13.926 0.772 1.00 0.00 H ATOM 3825 HG23 THR A 276 35.377 10.549 1.827 1.00 0.00 H ATOM 3826 HG21 THR A 276 36.883 11.048 1.018 1.00 0.00 H ATOM 3827 HG22 THR A 276 36.221 12.027 2.351 1.00 0.00 H ATOM 3828 H THR A 276 35.390 12.851 -2.244 1.00 0.00 H ATOM 3829 N THR A 277 32.542 11.587 -1.971 1.00 53.02 N ATOM 3830 CA THR A 277 31.099 11.601 -2.186 1.00 52.95 C ATOM 3831 C THR A 277 30.529 10.210 -2.510 1.00 52.84 C ATOM 3832 O THR A 277 30.664 9.723 -3.651 1.00 54.76 O ATOM 3833 CB THR A 277 30.740 12.510 -3.369 1.00 52.88 C ATOM 3834 OG1 THR A 277 31.361 13.792 -3.218 1.00 59.30 O ATOM 3835 CG2 THR A 277 29.270 12.709 -3.422 1.00 52.55 C ATOM 3836 HA THR A 277 30.668 11.961 -1.252 1.00 0.00 H ATOM 3837 HB THR A 277 31.092 12.034 -4.285 1.00 0.00 H ATOM 3838 HG1 THR A 277 31.121 14.367 -3.988 1.00 0.00 H ATOM 3839 HG23 THR A 277 28.778 11.743 -3.537 1.00 0.00 H ATOM 3840 HG21 THR A 277 28.935 13.181 -2.499 1.00 0.00 H ATOM 3841 HG22 THR A 277 29.021 13.348 -4.269 1.00 0.00 H ATOM 3842 H THR A 277 33.155 11.854 -2.767 1.00 0.00 H ATOM 3843 N ARG A 278 29.875 9.584 -1.532 1.00 45.63 N ATOM 3844 CA ARG A 278 29.306 8.241 -1.725 1.00 42.76 C ATOM 3845 C ARG A 278 27.932 8.249 -2.436 1.00 44.51 C ATOM 3846 O ARG A 278 27.031 8.962 -1.995 1.00 44.38 O ATOM 3847 CB ARG A 278 29.158 7.557 -0.378 1.00 42.04 C ATOM 3848 CG ARG A 278 29.497 6.096 -0.454 1.00 42.46 C ATOM 3849 CD ARG A 278 29.554 5.497 0.896 1.00 40.44 C ATOM 3850 NE ARG A 278 29.229 4.076 0.822 1.00 39.18 N ATOM 3851 CZ ARG A 278 28.014 3.589 0.992 1.00 33.33 C ATOM 3852 NH1 ARG A 278 27.032 4.435 1.220 1.00 40.72 N ATOM 3853 NH2 ARG A 278 27.779 2.282 0.918 1.00 29.49 N ATOM 3854 HA ARG A 278 29.998 7.701 -2.371 1.00 0.00 H ATOM 3855 HB2 ARG A 278 29.825 8.038 0.337 1.00 0.00 H ATOM 3856 HB3 ARG A 278 28.127 7.663 -0.039 1.00 0.00 H ATOM 3857 HG2 ARG A 278 28.735 5.583 -1.041 1.00 0.00 H ATOM 3858 HG3 ARG A 278 30.467 5.979 -0.938 1.00 0.00 H ATOM 3859 HD2 ARG A 278 28.837 5.999 1.545 1.00 0.00 H ATOM 3860 HD3 ARG A 278 30.558 5.618 1.304 1.00 0.00 H ATOM 3861 HE ARG A 278 30.001 3.407 0.624 1.00 0.00 H ATOM 3862 HH12 ARG A 278 26.063 4.082 1.358 1.00 0.00 H ATOM 3863 HH11 ARG A 278 27.225 5.456 1.262 1.00 0.00 H ATOM 3864 HH22 ARG A 278 26.814 1.919 1.055 1.00 0.00 H ATOM 3865 HH21 ARG A 278 28.560 1.623 0.723 1.00 0.00 H ATOM 3866 H ARG A 278 29.764 10.055 -0.612 1.00 0.00 H ATOM 3867 N LEU A 279 27.763 7.483 -3.531 1.00 42.45 N ATOM 3868 CA LEU A 279 26.446 7.436 -4.231 1.00 37.30 C ATOM 3869 C LEU A 279 25.799 6.047 -4.202 1.00 36.84 C ATOM 3870 O LEU A 279 26.498 5.015 -4.155 1.00 36.56 O ATOM 3871 CB LEU A 279 26.490 8.006 -5.659 1.00 33.69 C ATOM 3872 CG LEU A 279 27.279 9.272 -5.970 1.00 38.21 C ATOM 3873 CD1 LEU A 279 27.483 9.311 -7.428 1.00 40.30 C ATOM 3874 CD2 LEU A 279 26.604 10.574 -5.519 1.00 42.49 C ATOM 3875 HA LEU A 279 25.803 8.099 -3.652 1.00 0.00 H ATOM 3876 HB2 LEU A 279 26.899 7.221 -6.295 1.00 0.00 H ATOM 3877 HB3 LEU A 279 25.458 8.204 -5.947 1.00 0.00 H ATOM 3878 HG LEU A 279 28.212 9.222 -5.409 1.00 0.00 H ATOM 3879 HD21 LEU A 279 25.639 10.673 -6.016 1.00 0.00 H ATOM 3880 HD22 LEU A 279 26.457 10.550 -4.439 1.00 0.00 H ATOM 3881 HD23 LEU A 279 27.238 11.421 -5.782 1.00 0.00 H ATOM 3882 HD11 LEU A 279 28.038 8.426 -7.740 1.00 0.00 H ATOM 3883 HD12 LEU A 279 26.515 9.329 -7.929 1.00 0.00 H ATOM 3884 HD13 LEU A 279 28.046 10.206 -7.691 1.00 0.00 H ATOM 3885 H LEU A 279 28.558 6.919 -3.892 1.00 0.00 H ATOM 3886 N LEU A 280 24.466 6.023 -4.155 1.00 30.31 N ATOM 3887 CA LEU A 280 23.737 4.748 -4.175 1.00 30.82 C ATOM 3888 C LEU A 280 22.735 4.887 -5.273 1.00 32.39 C ATOM 3889 O LEU A 280 22.336 6.042 -5.636 1.00 27.53 O ATOM 3890 CB LEU A 280 22.936 4.453 -2.903 1.00 26.36 C ATOM 3891 CG LEU A 280 23.412 4.875 -1.537 1.00 31.41 C ATOM 3892 CD1 LEU A 280 22.429 4.462 -0.457 1.00 32.35 C ATOM 3893 CD2 LEU A 280 24.742 4.208 -1.279 1.00 41.23 C ATOM 3894 HA LEU A 280 24.466 3.945 -4.288 1.00 0.00 H ATOM 3895 HB2 LEU A 280 21.961 4.919 -3.043 1.00 0.00 H ATOM 3896 HB3 LEU A 280 22.817 3.370 -2.863 1.00 0.00 H ATOM 3897 HG LEU A 280 23.503 5.961 -1.511 1.00 0.00 H ATOM 3898 HD21 LEU A 280 24.618 3.126 -1.317 1.00 0.00 H ATOM 3899 HD22 LEU A 280 25.457 4.520 -2.040 1.00 0.00 H ATOM 3900 HD23 LEU A 280 25.108 4.499 -0.294 1.00 0.00 H ATOM 3901 HD11 LEU A 280 21.463 4.930 -0.648 1.00 0.00 H ATOM 3902 HD12 LEU A 280 22.316 3.378 -0.465 1.00 0.00 H ATOM 3903 HD13 LEU A 280 22.804 4.782 0.515 1.00 0.00 H ATOM 3904 H LEU A 280 23.937 6.917 -4.104 1.00 0.00 H ATOM 3905 N ASP A 281 22.341 3.699 -5.762 1.00 25.05 N ATOM 3906 CA ASP A 281 21.369 3.513 -6.813 1.00 21.77 C ATOM 3907 C ASP A 281 20.989 2.014 -6.836 1.00 24.68 C ATOM 3908 O ASP A 281 21.710 1.152 -6.305 1.00 26.87 O ATOM 3909 CB ASP A 281 21.913 4.024 -8.160 1.00 27.55 C ATOM 3910 CG ASP A 281 20.800 4.434 -9.148 1.00 30.52 C ATOM 3911 OD1 ASP A 281 19.609 4.113 -8.925 1.00 36.01 O ATOM 3912 OD2 ASP A 281 21.130 5.071 -10.174 1.00 28.65 O ATOM 3913 HA ASP A 281 20.469 4.099 -6.627 1.00 0.00 H ATOM 3914 HB2 ASP A 281 22.547 4.891 -7.972 1.00 0.00 H ATOM 3915 HB3 ASP A 281 22.508 3.233 -8.616 1.00 0.00 H ATOM 3916 H ASP A 281 22.770 2.846 -5.351 1.00 0.00 H ATOM 3917 N ASN A 282 19.805 1.729 -7.365 1.00 23.72 N ATOM 3918 CA ASN A 282 19.289 0.375 -7.500 1.00 24.70 C ATOM 3919 C ASN A 282 18.193 0.358 -8.598 1.00 27.73 C ATOM 3920 O ASN A 282 17.782 1.431 -9.118 1.00 21.19 O ATOM 3921 CB ASN A 282 18.787 -0.188 -6.187 1.00 23.75 C ATOM 3922 CG ASN A 282 17.512 0.442 -5.764 1.00 29.72 C ATOM 3923 OD1 ASN A 282 16.399 0.052 -6.218 1.00 23.46 O ATOM 3924 ND2 ASN A 282 17.638 1.467 -4.908 1.00 27.76 N ATOM 3925 HA ASN A 282 20.106 -0.280 -7.802 1.00 0.00 H ATOM 3926 HB2 ASN A 282 18.629 -1.261 -6.301 1.00 0.00 H ATOM 3927 HB3 ASN A 282 19.539 -0.012 -5.418 1.00 0.00 H ATOM 3928 HD22 ASN A 282 18.580 1.746 -4.566 1.00 0.00 H ATOM 3929 HD21 ASN A 282 16.794 1.983 -4.587 1.00 0.00 H ATOM 3930 H ASN A 282 19.214 2.516 -7.701 1.00 0.00 H ATOM 3931 N ILE A 283 17.820 -0.859 -9.010 1.00 22.45 N ATOM 3932 CA ILE A 283 16.891 -1.034 -10.088 1.00 25.91 C ATOM 3933 C ILE A 283 16.252 -2.403 -9.922 1.00 30.21 C ATOM 3934 O ILE A 283 16.874 -3.325 -9.366 1.00 31.52 O ATOM 3935 CB ILE A 283 17.675 -1.006 -11.422 1.00 31.61 C ATOM 3936 CG1 ILE A 283 16.825 -0.492 -12.556 1.00 19.34 C ATOM 3937 CG2 ILE A 283 18.326 -2.396 -11.767 1.00 29.24 C ATOM 3938 CD1 ILE A 283 17.619 -0.387 -13.878 1.00 18.68 C ATOM 3939 HA ILE A 283 16.134 -0.250 -10.087 1.00 0.00 H ATOM 3940 HB ILE A 283 18.497 -0.304 -11.285 1.00 0.00 H ATOM 3941 HG12 ILE A 283 15.986 -1.172 -12.703 1.00 0.00 H ATOM 3942 HG13 ILE A 283 16.448 0.496 -12.293 1.00 0.00 H ATOM 3943 HD11 ILE A 283 18.457 0.298 -13.744 1.00 0.00 H ATOM 3944 HD12 ILE A 283 17.994 -1.372 -14.154 1.00 0.00 H ATOM 3945 HD13 ILE A 283 16.964 -0.012 -14.665 1.00 0.00 H ATOM 3946 HG21 ILE A 283 19.020 -2.677 -10.975 1.00 0.00 H ATOM 3947 HG22 ILE A 283 17.544 -3.151 -11.852 1.00 0.00 H ATOM 3948 HG23 ILE A 283 18.863 -2.319 -12.712 1.00 0.00 H ATOM 3949 H ILE A 283 18.213 -1.698 -8.537 1.00 0.00 H ATOM 3950 N ALA A 284 14.997 -2.495 -10.378 1.00 29.58 N ATOM 3951 CA ALA A 284 14.302 -3.740 -10.744 1.00 26.71 C ATOM 3952 C ALA A 284 15.088 -4.502 -11.797 1.00 28.22 C ATOM 3953 O ALA A 284 15.586 -3.911 -12.731 1.00 30.13 O ATOM 3954 CB ALA A 284 12.966 -3.376 -11.336 1.00 19.54 C ATOM 3955 HA ALA A 284 14.193 -4.362 -9.855 1.00 0.00 H ATOM 3956 HB1 ALA A 284 12.383 -2.823 -10.600 1.00 0.00 H ATOM 3957 HB2 ALA A 284 13.118 -2.757 -12.220 1.00 0.00 H ATOM 3958 HB3 ALA A 284 12.434 -4.285 -11.615 1.00 0.00 H ATOM 3959 H ALA A 284 14.465 -1.607 -10.483 1.00 0.00 H ATOM 3960 N ILE A 285 15.081 -5.820 -11.692 1.00 28.26 N ATOM 3961 CA ILE A 285 15.759 -6.744 -12.571 1.00 30.95 C ATOM 3962 C ILE A 285 14.865 -8.053 -12.748 1.00 34.79 C ATOM 3963 O ILE A 285 14.427 -8.627 -11.754 1.00 25.75 O ATOM 3964 CB ILE A 285 17.090 -7.169 -11.853 1.00 32.28 C ATOM 3965 CG1 ILE A 285 18.125 -6.065 -11.940 1.00 47.25 C ATOM 3966 CG2 ILE A 285 17.756 -8.372 -12.513 1.00 34.45 C ATOM 3967 CD1 ILE A 285 19.245 -6.328 -13.058 1.00 47.34 C ATOM 3968 HA ILE A 285 15.945 -6.285 -13.542 1.00 0.00 H ATOM 3969 HB ILE A 285 16.796 -7.396 -10.828 1.00 0.00 H ATOM 3970 HG12 ILE A 285 17.615 -5.131 -12.175 1.00 0.00 H ATOM 3971 HG13 ILE A 285 18.617 -5.976 -10.972 1.00 0.00 H ATOM 3972 HD11 ILE A 285 19.772 -7.255 -12.831 1.00 0.00 H ATOM 3973 HD12 ILE A 285 18.769 -6.409 -14.035 1.00 0.00 H ATOM 3974 HD13 ILE A 285 19.952 -5.498 -13.064 1.00 0.00 H ATOM 3975 HG21 ILE A 285 17.075 -9.223 -12.486 1.00 0.00 H ATOM 3976 HG22 ILE A 285 17.997 -8.130 -13.548 1.00 0.00 H ATOM 3977 HG23 ILE A 285 18.671 -8.620 -11.974 1.00 0.00 H ATOM 3978 H ILE A 285 14.538 -6.229 -10.905 1.00 0.00 H ATOM 3979 N GLU A 286 14.619 -8.544 -13.973 1.00 39.07 N ATOM 3980 CA GLU A 286 14.142 -9.943 -14.128 1.00 39.80 C ATOM 3981 C GLU A 286 15.163 -10.773 -14.845 1.00 36.57 C ATOM 3982 O GLU A 286 15.669 -10.363 -15.875 1.00 32.13 O ATOM 3983 CB GLU A 286 12.801 -10.077 -14.863 1.00 44.20 C ATOM 3984 CG GLU A 286 11.638 -9.416 -14.158 1.00 53.90 C ATOM 3985 CD GLU A 286 11.677 -7.942 -14.451 1.00 60.09 C ATOM 3986 OE1 GLU A 286 12.171 -7.627 -15.557 1.00 62.38 O ATOM 3987 OE2 GLU A 286 11.265 -7.103 -13.606 1.00 64.86 O ATOM 3988 HA GLU A 286 13.988 -10.301 -13.110 1.00 0.00 H ATOM 3989 HB2 GLU A 286 12.905 -9.625 -15.849 1.00 0.00 H ATOM 3990 HB3 GLU A 286 12.576 -11.138 -14.973 1.00 0.00 H ATOM 3991 HG2 GLU A 286 10.700 -9.838 -14.520 1.00 0.00 H ATOM 3992 HG3 GLU A 286 11.718 -9.580 -13.083 1.00 0.00 H ATOM 3993 H GLU A 286 14.762 -7.946 -14.812 1.00 0.00 H ATOM 3994 N ILE A 287 15.459 -11.929 -14.270 1.00 36.31 N ATOM 3995 CA ILE A 287 16.331 -12.927 -14.861 1.00 41.07 C ATOM 3996 C ILE A 287 15.479 -13.859 -15.774 1.00 46.48 C ATOM 3997 O ILE A 287 14.466 -14.409 -15.318 1.00 48.26 O ATOM 3998 CB ILE A 287 17.001 -13.785 -13.743 1.00 40.66 C ATOM 3999 CG1 ILE A 287 17.252 -12.983 -12.443 1.00 42.49 C ATOM 4000 CG2 ILE A 287 18.236 -14.500 -14.238 1.00 45.42 C ATOM 4001 CD1 ILE A 287 18.007 -11.725 -12.586 1.00 26.11 C ATOM 4002 HA ILE A 287 17.107 -12.430 -15.442 1.00 0.00 H ATOM 4003 HB ILE A 287 16.283 -14.561 -13.476 1.00 0.00 H ATOM 4004 HG12 ILE A 287 16.282 -12.741 -12.010 1.00 0.00 H ATOM 4005 HG13 ILE A 287 17.804 -13.626 -11.758 1.00 0.00 H ATOM 4006 HD11 ILE A 287 18.992 -11.939 -13.001 1.00 0.00 H ATOM 4007 HD12 ILE A 287 17.468 -11.053 -13.254 1.00 0.00 H ATOM 4008 HD13 ILE A 287 18.118 -11.256 -11.608 1.00 0.00 H ATOM 4009 HG21 ILE A 287 17.965 -15.163 -15.059 1.00 0.00 H ATOM 4010 HG22 ILE A 287 18.964 -13.767 -14.586 1.00 0.00 H ATOM 4011 HG23 ILE A 287 18.667 -15.084 -13.425 1.00 0.00 H ATOM 4012 H ILE A 287 15.042 -12.134 -13.340 1.00 0.00 H ATOM 4013 N GLY A 288 15.870 -14.007 -17.047 1.00 45.58 N ATOM 4014 CA GLY A 288 15.278 -14.997 -17.937 1.00 45.50 C ATOM 4015 C GLY A 288 13.991 -14.499 -18.545 1.00 50.39 C ATOM 4016 O GLY A 288 13.930 -13.386 -19.061 1.00 52.40 O ATOM 4017 HA3 GLY A 288 15.073 -15.905 -17.370 1.00 0.00 H ATOM 4018 HA2 GLY A 288 15.984 -15.221 -18.737 1.00 0.00 H ATOM 4019 H GLY A 288 16.624 -13.392 -17.414 1.00 0.00 H TER 4020 GLY A 288 ATOM 4021 N ALA B 2 -16.709 -6.374 5.901 1.00 48.09 N ATOM 4022 CA ALA B 2 -17.340 -6.068 7.226 1.00 55.88 C ATOM 4023 C ALA B 2 -16.374 -6.232 8.422 1.00 54.72 C ATOM 4024 O ALA B 2 -15.573 -7.156 8.424 1.00 57.44 O ATOM 4025 CB ALA B 2 -18.637 -6.942 7.452 1.00 43.23 C ATOM 4026 HA ALA B 2 -17.615 -5.014 7.186 1.00 0.00 H ATOM 4027 HB1 ALA B 2 -19.359 -6.729 6.663 1.00 0.00 H ATOM 4028 HB2 ALA B 2 -18.370 -7.999 7.427 1.00 0.00 H ATOM 4029 HB3 ALA B 2 -19.073 -6.699 8.421 1.00 0.00 H ATOM 4030 HN3 ALA B 2 -16.373 -7.358 5.898 1.00 0.00 H ATOM 4031 HN2 ALA B 2 -15.906 -5.732 5.744 1.00 0.00 H ATOM 4032 HN1 ALA B 2 -17.412 -6.244 5.145 1.00 0.00 H ATOM 4033 N ILE B 3 -16.458 -5.332 9.415 1.00 55.26 N ATOM 4034 CA ILE B 3 -16.062 -5.619 10.806 1.00 54.34 C ATOM 4035 C ILE B 3 -16.437 -7.089 11.165 1.00 57.00 C ATOM 4036 O ILE B 3 -17.487 -7.570 10.731 1.00 55.96 O ATOM 4037 CB ILE B 3 -16.804 -4.658 11.793 1.00 51.54 C ATOM 4038 CG1 ILE B 3 -16.772 -3.193 11.312 1.00 48.37 C ATOM 4039 CG2 ILE B 3 -16.261 -4.804 13.208 1.00 53.41 C ATOM 4040 CD1 ILE B 3 -15.400 -2.499 11.365 1.00 50.08 C ATOM 4041 HA ILE B 3 -14.986 -5.472 10.896 1.00 0.00 H ATOM 4042 HB ILE B 3 -17.853 -4.953 11.809 1.00 0.00 H ATOM 4043 HG12 ILE B 3 -17.117 -3.173 10.278 1.00 0.00 H ATOM 4044 HG13 ILE B 3 -17.460 -2.621 11.935 1.00 0.00 H ATOM 4045 HD11 ILE B 3 -15.038 -2.490 12.393 1.00 0.00 H ATOM 4046 HD12 ILE B 3 -14.695 -3.042 10.735 1.00 0.00 H ATOM 4047 HD13 ILE B 3 -15.498 -1.475 11.004 1.00 0.00 H ATOM 4048 HG21 ILE B 3 -16.402 -5.831 13.546 1.00 0.00 H ATOM 4049 HG22 ILE B 3 -15.198 -4.561 13.215 1.00 0.00 H ATOM 4050 HG23 ILE B 3 -16.795 -4.125 13.873 1.00 0.00 H ATOM 4051 H ILE B 3 -16.821 -4.383 9.191 1.00 0.00 H ATOM 4052 N PRO B 4 -15.579 -7.828 11.912 1.00 56.75 N ATOM 4053 CA PRO B 4 -16.125 -9.155 12.275 1.00 55.33 C ATOM 4054 C PRO B 4 -17.268 -9.159 13.321 1.00 51.87 C ATOM 4055 O PRO B 4 -17.713 -8.103 13.816 1.00 50.53 O ATOM 4056 CB PRO B 4 -14.891 -9.950 12.736 1.00 55.16 C ATOM 4057 CG PRO B 4 -13.883 -8.923 13.124 1.00 55.07 C ATOM 4058 CD PRO B 4 -14.194 -7.636 12.381 1.00 54.78 C ATOM 4059 HA PRO B 4 -16.634 -9.598 11.419 1.00 0.00 H ATOM 4060 HD3 PRO B 4 -14.125 -6.776 13.047 1.00 0.00 H ATOM 4061 HD2 PRO B 4 -13.514 -7.498 11.540 1.00 0.00 H ATOM 4062 HG3 PRO B 4 -12.884 -9.269 12.858 1.00 0.00 H ATOM 4063 HG2 PRO B 4 -13.931 -8.748 14.199 1.00 0.00 H ATOM 4064 HB2 PRO B 4 -15.140 -10.582 13.589 1.00 0.00 H ATOM 4065 HB3 PRO B 4 -14.511 -10.570 11.924 1.00 0.00 H ATOM 4066 N ALA B 5 -17.767 -10.351 13.608 1.00 53.15 N ATOM 4067 CA ALA B 5 -18.956 -10.510 14.440 1.00 58.27 C ATOM 4068 C ALA B 5 -18.733 -10.051 15.929 1.00 61.08 C ATOM 4069 O ALA B 5 -17.949 -10.689 16.672 1.00 57.44 O ATOM 4070 CB ALA B 5 -19.417 -11.987 14.360 1.00 59.06 C ATOM 4071 HA ALA B 5 -19.737 -9.854 14.055 1.00 0.00 H ATOM 4072 HB1 ALA B 5 -19.650 -12.238 13.325 1.00 0.00 H ATOM 4073 HB2 ALA B 5 -18.619 -12.635 14.722 1.00 0.00 H ATOM 4074 HB3 ALA B 5 -20.305 -12.123 14.977 1.00 0.00 H ATOM 4075 H ALA B 5 -17.298 -11.199 13.230 1.00 0.00 H ATOM 4076 N PHE B 6 -19.386 -8.949 16.350 1.00 55.00 N ATOM 4077 CA PHE B 6 -19.369 -8.516 17.786 1.00 56.16 C ATOM 4078 C PHE B 6 -20.748 -8.487 18.520 1.00 53.26 C ATOM 4079 O PHE B 6 -21.639 -7.729 18.122 1.00 55.38 O ATOM 4080 CB PHE B 6 -18.624 -7.168 18.002 1.00 45.38 C ATOM 4081 CG PHE B 6 -18.558 -6.727 19.471 1.00 47.93 C ATOM 4082 CD1 PHE B 6 -17.577 -7.231 20.333 1.00 43.15 C ATOM 4083 CD2 PHE B 6 -19.479 -5.806 19.991 1.00 46.08 C ATOM 4084 CE1 PHE B 6 -17.513 -6.837 21.658 1.00 36.42 C ATOM 4085 CE2 PHE B 6 -19.414 -5.411 21.340 1.00 45.02 C ATOM 4086 CZ PHE B 6 -18.427 -5.949 22.175 1.00 42.17 C ATOM 4087 HA PHE B 6 -18.808 -9.323 18.258 1.00 0.00 H ATOM 4088 HB2 PHE B 6 -17.606 -7.274 17.628 1.00 0.00 H ATOM 4089 HB3 PHE B 6 -19.140 -6.394 17.433 1.00 0.00 H ATOM 4090 HD2 PHE B 6 -20.253 -5.392 19.344 1.00 0.00 H ATOM 4091 HE2 PHE B 6 -20.129 -4.689 21.734 1.00 0.00 H ATOM 4092 HZ PHE B 6 -18.383 -5.666 23.227 1.00 0.00 H ATOM 4093 HE1 PHE B 6 -16.728 -7.236 22.300 1.00 0.00 H ATOM 4094 HD1 PHE B 6 -16.849 -7.948 19.953 1.00 0.00 H ATOM 4095 H PHE B 6 -19.917 -8.382 15.658 1.00 0.00 H ATOM 4096 N HIS B 7 -20.867 -9.266 19.608 1.00 53.68 N ATOM 4097 CA HIS B 7 -22.096 -9.378 20.439 1.00 58.08 C ATOM 4098 C HIS B 7 -21.947 -8.737 21.807 1.00 59.25 C ATOM 4099 O HIS B 7 -21.403 -9.413 22.694 1.00 58.61 O ATOM 4100 CB HIS B 7 -22.420 -10.845 20.740 1.00 61.83 C ATOM 4101 CG HIS B 7 -22.429 -11.724 19.537 1.00 68.45 C ATOM 4102 ND1 HIS B 7 -23.200 -11.451 18.424 1.00 70.32 N ATOM 4103 CD2 HIS B 7 -21.773 -12.881 19.275 1.00 69.17 C ATOM 4104 CE1 HIS B 7 -22.998 -12.393 17.518 1.00 72.21 C ATOM 4105 NE2 HIS B 7 -22.139 -13.273 18.009 1.00 71.98 N ATOM 4106 HA HIS B 7 -22.869 -8.879 19.854 1.00 0.00 H ATOM 4107 HB2 HIS B 7 -21.673 -11.225 21.437 1.00 0.00 H ATOM 4108 HB3 HIS B 7 -23.405 -10.890 21.205 1.00 0.00 H ATOM 4109 HD2 HIS B 7 -21.086 -13.402 19.942 1.00 0.00 H ATOM 4110 HE1 HIS B 7 -23.461 -12.438 16.532 1.00 0.00 H ATOM 4111 H HIS B 7 -20.041 -9.831 19.890 1.00 0.00 H ATOM 4112 N PRO B 8 -22.432 -7.464 22.004 1.00 58.48 N ATOM 4113 CA PRO B 8 -22.293 -6.790 23.327 1.00 61.19 C ATOM 4114 C PRO B 8 -22.713 -7.640 24.555 1.00 61.19 C ATOM 4115 O PRO B 8 -23.412 -8.647 24.403 1.00 63.00 O ATOM 4116 CB PRO B 8 -23.143 -5.498 23.199 1.00 57.37 C ATOM 4117 CG PRO B 8 -23.651 -5.455 21.812 1.00 57.61 C ATOM 4118 CD PRO B 8 -23.068 -6.583 21.002 1.00 55.66 C ATOM 4119 HA PRO B 8 -21.240 -6.597 23.533 1.00 0.00 H ATOM 4120 HD3 PRO B 8 -23.851 -7.115 20.462 1.00 0.00 H ATOM 4121 HD2 PRO B 8 -22.330 -6.208 20.293 1.00 0.00 H ATOM 4122 HG3 PRO B 8 -23.372 -4.505 21.357 1.00 0.00 H ATOM 4123 HG2 PRO B 8 -24.737 -5.546 21.824 1.00 0.00 H ATOM 4124 HB2 PRO B 8 -23.975 -5.525 23.903 1.00 0.00 H ATOM 4125 HB3 PRO B 8 -22.527 -4.622 23.400 1.00 0.00 H ATOM 4126 N GLY B 9 -22.246 -7.259 25.744 1.00 61.11 N ATOM 4127 CA GLY B 9 -22.525 -8.005 26.975 1.00 57.74 C ATOM 4128 C GLY B 9 -22.064 -9.457 27.084 1.00 58.79 C ATOM 4129 O GLY B 9 -22.278 -10.071 28.127 1.00 63.70 O ATOM 4130 HA3 GLY B 9 -23.606 -8.002 27.112 1.00 0.00 H ATOM 4131 HA2 GLY B 9 -22.055 -7.459 27.793 1.00 0.00 H ATOM 4132 H GLY B 9 -21.662 -6.400 25.801 1.00 0.00 H ATOM 4133 N GLU B 10 -21.455 -10.030 26.040 1.00 58.37 N ATOM 4134 CA GLU B 10 -20.849 -11.396 26.149 1.00 60.44 C ATOM 4135 C GLU B 10 -19.336 -11.497 25.822 1.00 56.78 C ATOM 4136 O GLU B 10 -18.715 -10.569 25.228 1.00 48.41 O ATOM 4137 CB GLU B 10 -21.569 -12.444 25.280 1.00 63.68 C ATOM 4138 CG GLU B 10 -23.031 -12.231 25.004 1.00 69.81 C ATOM 4139 CD GLU B 10 -23.444 -12.869 23.688 1.00 74.10 C ATOM 4140 OE1 GLU B 10 -22.563 -13.471 23.019 1.00 68.28 O ATOM 4141 OE2 GLU B 10 -24.645 -12.749 23.328 1.00 77.28 O ATOM 4142 HA GLU B 10 -20.979 -11.604 27.211 1.00 0.00 H ATOM 4143 HB2 GLU B 10 -21.057 -12.479 24.319 1.00 0.00 H ATOM 4144 HB3 GLU B 10 -21.468 -13.408 25.779 1.00 0.00 H ATOM 4145 HG2 GLU B 10 -23.613 -12.674 25.812 1.00 0.00 H ATOM 4146 HG3 GLU B 10 -23.232 -11.161 24.958 1.00 0.00 H ATOM 4147 H GLU B 10 -21.401 -9.518 25.136 1.00 0.00 H ATOM 4148 N LEU B 11 -18.767 -12.661 26.159 1.00 53.00 N ATOM 4149 CA LEU B 11 -17.333 -12.914 25.914 1.00 51.08 C ATOM 4150 C LEU B 11 -17.190 -13.207 24.444 1.00 46.84 C ATOM 4151 O LEU B 11 -17.665 -14.243 24.032 1.00 51.78 O ATOM 4152 CB LEU B 11 -16.767 -14.080 26.784 1.00 47.20 C ATOM 4153 CG LEU B 11 -15.263 -14.435 26.626 1.00 47.21 C ATOM 4154 CD1 LEU B 11 -14.372 -13.275 27.085 1.00 47.71 C ATOM 4155 CD2 LEU B 11 -14.844 -15.731 27.296 1.00 42.70 C ATOM 4156 HA LEU B 11 -16.750 -12.039 26.201 1.00 0.00 H ATOM 4157 HB2 LEU B 11 -16.931 -13.816 27.829 1.00 0.00 H ATOM 4158 HB3 LEU B 11 -17.340 -14.975 26.542 1.00 0.00 H ATOM 4159 HG LEU B 11 -15.122 -14.602 25.558 1.00 0.00 H ATOM 4160 HD21 LEU B 11 -15.043 -15.666 28.366 1.00 0.00 H ATOM 4161 HD22 LEU B 11 -15.411 -16.559 26.869 1.00 0.00 H ATOM 4162 HD23 LEU B 11 -13.779 -15.895 27.132 1.00 0.00 H ATOM 4163 HD11 LEU B 11 -14.588 -12.392 26.483 1.00 0.00 H ATOM 4164 HD12 LEU B 11 -14.572 -13.058 28.134 1.00 0.00 H ATOM 4165 HD13 LEU B 11 -13.325 -13.552 26.963 1.00 0.00 H ATOM 4166 H LEU B 11 -19.347 -13.402 26.602 1.00 0.00 H ATOM 4167 N ASN B 12 -16.588 -12.299 23.662 1.00 44.36 N ATOM 4168 CA ASN B 12 -16.293 -12.564 22.244 1.00 44.74 C ATOM 4169 C ASN B 12 -14.825 -12.884 22.176 1.00 46.94 C ATOM 4170 O ASN B 12 -13.988 -12.089 22.645 1.00 50.84 O ATOM 4171 CB ASN B 12 -16.530 -11.359 21.294 1.00 46.79 C ATOM 4172 CG ASN B 12 -17.944 -10.708 21.404 1.00 52.07 C ATOM 4173 OD1 ASN B 12 -18.734 -10.753 20.434 1.00 55.67 O ATOM 4174 ND2 ASN B 12 -18.233 -10.051 22.539 1.00 40.94 N ATOM 4175 HA ASN B 12 -16.961 -13.361 21.916 1.00 0.00 H ATOM 4176 HB2 ASN B 12 -15.786 -10.596 21.522 1.00 0.00 H ATOM 4177 HB3 ASN B 12 -16.393 -11.703 20.269 1.00 0.00 H ATOM 4178 HD22 ASN B 12 -17.548 -10.038 23.321 1.00 0.00 H ATOM 4179 HD21 ASN B 12 -19.142 -9.555 22.636 1.00 0.00 H ATOM 4180 H ASN B 12 -16.321 -11.380 24.069 1.00 0.00 H ATOM 4181 N VAL B 13 -14.507 -14.016 21.554 1.00 44.78 N ATOM 4182 CA VAL B 13 -13.120 -14.426 21.342 1.00 45.82 C ATOM 4183 C VAL B 13 -12.720 -14.268 19.876 1.00 41.63 C ATOM 4184 O VAL B 13 -13.518 -14.536 18.992 1.00 44.97 O ATOM 4185 CB VAL B 13 -12.894 -15.904 21.787 1.00 44.80 C ATOM 4186 CG1 VAL B 13 -11.410 -16.280 21.798 1.00 40.56 C ATOM 4187 CG2 VAL B 13 -13.508 -16.139 23.144 1.00 46.83 C ATOM 4188 HA VAL B 13 -12.494 -13.775 21.953 1.00 0.00 H ATOM 4189 HB VAL B 13 -13.385 -16.546 21.056 1.00 0.00 H ATOM 4190 HG11 VAL B 13 -10.998 -16.159 20.796 1.00 0.00 H ATOM 4191 HG12 VAL B 13 -10.877 -15.630 22.492 1.00 0.00 H ATOM 4192 HG13 VAL B 13 -11.302 -17.318 22.114 1.00 0.00 H ATOM 4193 HG21 VAL B 13 -13.045 -15.472 23.871 1.00 0.00 H ATOM 4194 HG22 VAL B 13 -14.579 -15.940 23.096 1.00 0.00 H ATOM 4195 HG23 VAL B 13 -13.343 -17.174 23.442 1.00 0.00 H ATOM 4196 H VAL B 13 -15.271 -14.630 21.207 1.00 0.00 H ATOM 4197 N TYR B 14 -11.474 -13.826 19.658 1.00 46.44 N ATOM 4198 CA TYR B 14 -10.784 -13.764 18.344 1.00 37.86 C ATOM 4199 C TYR B 14 -9.343 -14.115 18.606 1.00 38.79 C ATOM 4200 O TYR B 14 -8.846 -13.873 19.718 1.00 40.57 O ATOM 4201 CB TYR B 14 -10.785 -12.355 17.734 1.00 39.08 C ATOM 4202 CG TYR B 14 -12.077 -11.584 17.869 1.00 40.83 C ATOM 4203 CD1 TYR B 14 -13.092 -11.691 16.905 1.00 39.71 C ATOM 4204 CD2 TYR B 14 -12.295 -10.758 18.952 1.00 37.81 C ATOM 4205 CE1 TYR B 14 -14.275 -10.981 17.022 1.00 34.85 C ATOM 4206 CE2 TYR B 14 -13.495 -10.058 19.082 1.00 40.95 C ATOM 4207 CZ TYR B 14 -14.477 -10.175 18.098 1.00 38.55 C ATOM 4208 OH TYR B 14 -15.671 -9.488 18.229 1.00 44.70 O ATOM 4209 HA TYR B 14 -11.297 -14.435 17.654 1.00 0.00 H ATOM 4210 HB3 TYR B 14 -10.560 -12.449 16.672 1.00 0.00 H ATOM 4211 HB2 TYR B 14 -9.998 -11.779 18.220 1.00 0.00 H ATOM 4212 HD2 TYR B 14 -11.522 -10.651 19.714 1.00 0.00 H ATOM 4213 HE2 TYR B 14 -13.665 -9.421 19.950 1.00 0.00 H ATOM 4214 HE1 TYR B 14 -15.043 -11.068 16.253 1.00 0.00 H ATOM 4215 HD1 TYR B 14 -12.946 -12.347 16.047 1.00 0.00 H ATOM 4216 HH TYR B 14 -16.249 -9.682 17.449 1.00 0.00 H ATOM 4217 H TYR B 14 -10.940 -13.495 20.487 1.00 0.00 H ATOM 4218 N SER B 15 -8.677 -14.638 17.572 1.00 38.00 N ATOM 4219 CA SER B 15 -7.271 -14.989 17.604 1.00 42.97 C ATOM 4220 C SER B 15 -6.611 -14.429 16.386 1.00 44.12 C ATOM 4221 O SER B 15 -5.381 -14.578 16.201 1.00 44.13 O ATOM 4222 CB SER B 15 -7.129 -16.485 17.528 1.00 40.54 C ATOM 4223 OG SER B 15 -8.372 -17.004 17.886 1.00 48.56 O ATOM 4224 HA SER B 15 -6.824 -14.600 18.519 1.00 0.00 H ATOM 4225 HB2 SER B 15 -6.360 -16.829 18.220 1.00 0.00 H ATOM 4226 HB3 SER B 15 -6.867 -16.791 16.515 1.00 0.00 H ATOM 4227 HG SER B 15 -8.337 -17.993 17.853 1.00 0.00 H ATOM 4228 H SER B 15 -9.201 -14.804 16.689 1.00 0.00 H ATOM 4229 N ALA B 16 -7.423 -13.847 15.506 1.00 45.25 N ATOM 4230 CA ALA B 16 -6.865 -13.116 14.348 1.00 42.72 C ATOM 4231 C ALA B 16 -6.454 -11.730 14.864 1.00 38.78 C ATOM 4232 O ALA B 16 -7.309 -10.938 15.334 1.00 32.20 O ATOM 4233 CB ALA B 16 -7.891 -13.026 13.187 1.00 41.42 C ATOM 4234 HA ALA B 16 -6.003 -13.638 13.933 1.00 0.00 H ATOM 4235 HB1 ALA B 16 -8.162 -14.031 12.864 1.00 0.00 H ATOM 4236 HB2 ALA B 16 -8.782 -12.501 13.531 1.00 0.00 H ATOM 4237 HB3 ALA B 16 -7.447 -12.482 12.353 1.00 0.00 H ATOM 4238 H ALA B 16 -8.453 -13.907 15.633 1.00 0.00 H ATOM 4239 N PRO B 17 -5.136 -11.457 14.888 1.00 39.80 N ATOM 4240 CA PRO B 17 -4.791 -10.059 15.114 1.00 37.92 C ATOM 4241 C PRO B 17 -5.769 -9.091 14.400 1.00 39.99 C ATOM 4242 O PRO B 17 -6.342 -8.185 15.034 1.00 46.23 O ATOM 4243 CB PRO B 17 -3.393 -9.997 14.536 1.00 36.55 C ATOM 4244 CG PRO B 17 -2.816 -11.321 14.900 1.00 31.10 C ATOM 4245 CD PRO B 17 -3.926 -12.299 14.770 1.00 35.45 C ATOM 4246 HA PRO B 17 -4.849 -9.751 16.158 1.00 0.00 H ATOM 4247 HD3 PRO B 17 -3.893 -12.802 13.804 1.00 0.00 H ATOM 4248 HD2 PRO B 17 -3.888 -13.042 15.567 1.00 0.00 H ATOM 4249 HG3 PRO B 17 -2.444 -11.304 15.924 1.00 0.00 H ATOM 4250 HG2 PRO B 17 -2.002 -11.579 14.223 1.00 0.00 H ATOM 4251 HB2 PRO B 17 -3.422 -9.867 13.454 1.00 0.00 H ATOM 4252 HB3 PRO B 17 -2.820 -9.184 14.983 1.00 0.00 H ATOM 4253 N GLY B 18 -6.010 -9.320 13.115 1.00 36.19 N ATOM 4254 CA GLY B 18 -6.815 -8.403 12.318 1.00 32.91 C ATOM 4255 C GLY B 18 -8.240 -8.195 12.808 1.00 37.55 C ATOM 4256 O GLY B 18 -8.781 -7.076 12.708 1.00 35.55 O ATOM 4257 HA3 GLY B 18 -6.862 -8.792 11.301 1.00 0.00 H ATOM 4258 HA2 GLY B 18 -6.316 -7.434 12.312 1.00 0.00 H ATOM 4259 H GLY B 18 -5.616 -10.172 12.667 1.00 0.00 H ATOM 4260 N ASP B 19 -8.855 -9.268 13.310 1.00 33.80 N ATOM 4261 CA ASP B 19 -10.243 -9.218 13.737 1.00 35.42 C ATOM 4262 C ASP B 19 -10.385 -8.333 14.962 1.00 37.13 C ATOM 4263 O ASP B 19 -11.295 -7.485 15.031 1.00 38.52 O ATOM 4264 CB ASP B 19 -10.758 -10.607 14.097 1.00 39.31 C ATOM 4265 CG ASP B 19 -10.986 -11.494 12.881 1.00 49.23 C ATOM 4266 OD1 ASP B 19 -10.817 -11.024 11.719 1.00 54.80 O ATOM 4267 OD2 ASP B 19 -11.354 -12.674 13.094 1.00 42.92 O ATOM 4268 HA ASP B 19 -10.824 -8.816 12.907 1.00 0.00 H ATOM 4269 HB2 ASP B 19 -10.028 -11.090 14.747 1.00 0.00 H ATOM 4270 HB3 ASP B 19 -11.703 -10.499 14.630 1.00 0.00 H ATOM 4271 H ASP B 19 -8.329 -10.161 13.398 1.00 0.00 H ATOM 4272 N VAL B 20 -9.526 -8.564 15.951 1.00 32.65 N ATOM 4273 CA VAL B 20 -9.594 -7.763 17.168 1.00 38.28 C ATOM 4274 C VAL B 20 -9.189 -6.271 16.943 1.00 39.44 C ATOM 4275 O VAL B 20 -9.733 -5.370 17.608 1.00 36.63 O ATOM 4276 CB VAL B 20 -8.853 -8.441 18.334 1.00 37.07 C ATOM 4277 CG1 VAL B 20 -7.508 -8.913 17.889 1.00 42.90 C ATOM 4278 CG2 VAL B 20 -8.759 -7.514 19.559 1.00 29.82 C ATOM 4279 HA VAL B 20 -10.643 -7.717 17.462 1.00 0.00 H ATOM 4280 HB VAL B 20 -9.429 -9.312 18.645 1.00 0.00 H ATOM 4281 HG11 VAL B 20 -7.626 -9.630 17.077 1.00 0.00 H ATOM 4282 HG12 VAL B 20 -6.922 -8.062 17.541 1.00 0.00 H ATOM 4283 HG13 VAL B 20 -6.997 -9.390 18.725 1.00 0.00 H ATOM 4284 HG21 VAL B 20 -8.218 -6.608 19.287 1.00 0.00 H ATOM 4285 HG22 VAL B 20 -9.763 -7.253 19.893 1.00 0.00 H ATOM 4286 HG23 VAL B 20 -8.229 -8.027 20.362 1.00 0.00 H ATOM 4287 H VAL B 20 -8.810 -9.312 15.857 1.00 0.00 H ATOM 4288 N ALA B 21 -8.299 -6.022 15.974 1.00 38.31 N ATOM 4289 CA ALA B 21 -8.015 -4.670 15.541 1.00 39.40 C ATOM 4290 C ALA B 21 -9.171 -3.971 14.801 1.00 43.71 C ATOM 4291 O ALA B 21 -9.326 -2.729 14.965 1.00 46.35 O ATOM 4292 CB ALA B 21 -6.756 -4.626 14.723 1.00 38.57 C ATOM 4293 HA ALA B 21 -7.878 -4.100 16.460 1.00 0.00 H ATOM 4294 HB1 ALA B 21 -5.921 -4.986 15.324 1.00 0.00 H ATOM 4295 HB2 ALA B 21 -6.873 -5.260 13.844 1.00 0.00 H ATOM 4296 HB3 ALA B 21 -6.564 -3.600 14.409 1.00 0.00 H ATOM 4297 H ALA B 21 -7.801 -6.816 15.523 1.00 0.00 H ATOM 4298 N ASP B 22 -9.959 -4.722 13.998 1.00 43.07 N ATOM 4299 CA ASP B 22 -11.138 -4.150 13.258 1.00 42.41 C ATOM 4300 C ASP B 22 -12.273 -3.774 14.202 1.00 41.12 C ATOM 4301 O ASP B 22 -12.933 -2.766 14.009 1.00 36.85 O ATOM 4302 CB ASP B 22 -11.721 -5.120 12.241 1.00 45.52 C ATOM 4303 CG ASP B 22 -10.870 -5.272 11.020 1.00 49.33 C ATOM 4304 OD1 ASP B 22 -10.038 -4.390 10.777 1.00 50.41 O ATOM 4305 OD2 ASP B 22 -11.022 -6.295 10.313 1.00 53.40 O ATOM 4306 HA ASP B 22 -10.744 -3.269 12.752 1.00 0.00 H ATOM 4307 HB2 ASP B 22 -11.827 -6.096 12.714 1.00 0.00 H ATOM 4308 HB3 ASP B 22 -12.702 -4.756 11.937 1.00 0.00 H ATOM 4309 H ASP B 22 -9.742 -5.733 13.888 1.00 0.00 H ATOM 4310 N VAL B 23 -12.468 -4.624 15.212 1.00 39.64 N ATOM 4311 CA VAL B 23 -13.485 -4.509 16.240 1.00 32.03 C ATOM 4312 C VAL B 23 -13.123 -3.441 17.265 1.00 36.04 C ATOM 4313 O VAL B 23 -13.985 -2.636 17.670 1.00 37.19 O ATOM 4314 CB VAL B 23 -13.564 -5.822 16.978 1.00 28.17 C ATOM 4315 CG1 VAL B 23 -14.519 -5.747 18.122 1.00 28.97 C ATOM 4316 CG2 VAL B 23 -13.984 -6.927 16.031 1.00 35.41 C ATOM 4317 HA VAL B 23 -14.426 -4.245 15.759 1.00 0.00 H ATOM 4318 HB VAL B 23 -12.573 -6.041 17.376 1.00 0.00 H ATOM 4319 HG11 VAL B 23 -14.189 -4.977 18.819 1.00 0.00 H ATOM 4320 HG12 VAL B 23 -15.513 -5.499 17.749 1.00 0.00 H ATOM 4321 HG13 VAL B 23 -14.551 -6.710 18.631 1.00 0.00 H ATOM 4322 HG21 VAL B 23 -14.962 -6.692 15.612 1.00 0.00 H ATOM 4323 HG22 VAL B 23 -13.253 -7.012 15.227 1.00 0.00 H ATOM 4324 HG23 VAL B 23 -14.037 -7.870 16.576 1.00 0.00 H ATOM 4325 H VAL B 23 -11.832 -5.445 15.267 1.00 0.00 H ATOM 4326 N SER B 24 -11.869 -3.462 17.734 1.00 31.81 N ATOM 4327 CA SER B 24 -11.401 -2.427 18.651 1.00 32.68 C ATOM 4328 C SER B 24 -11.659 -1.029 18.068 1.00 40.79 C ATOM 4329 O SER B 24 -12.370 -0.211 18.656 1.00 42.52 O ATOM 4330 CB SER B 24 -9.922 -2.584 18.937 1.00 28.63 C ATOM 4331 OG SER B 24 -9.478 -1.480 19.742 1.00 25.01 O ATOM 4332 HA SER B 24 -11.956 -2.538 19.582 1.00 0.00 H ATOM 4333 HB2 SER B 24 -9.368 -2.598 17.998 1.00 0.00 H ATOM 4334 HB3 SER B 24 -9.751 -3.518 19.472 1.00 0.00 H ATOM 4335 HG SER B 24 -8.511 -1.579 19.931 1.00 0.00 H ATOM 4336 H SER B 24 -11.222 -4.223 17.442 1.00 0.00 H ATOM 4337 N ARG B 25 -11.097 -0.787 16.883 1.00 46.30 N ATOM 4338 CA ARG B 25 -11.281 0.458 16.143 1.00 51.42 C ATOM 4339 C ARG B 25 -12.745 0.904 16.142 1.00 50.19 C ATOM 4340 O ARG B 25 -13.031 2.069 16.425 1.00 53.85 O ATOM 4341 CB ARG B 25 -10.775 0.298 14.695 1.00 52.95 C ATOM 4342 CG ARG B 25 -9.867 1.459 14.172 1.00 63.48 C ATOM 4343 CD ARG B 25 -9.770 1.562 12.589 1.00 63.03 C ATOM 4344 NE ARG B 25 -10.041 0.289 11.910 1.00 70.33 N ATOM 4345 CZ ARG B 25 -9.164 -0.707 11.731 1.00 76.73 C ATOM 4346 NH1 ARG B 25 -7.904 -0.608 12.161 1.00 77.74 N ATOM 4347 NH2 ARG B 25 -9.554 -1.822 11.110 1.00 78.03 N ATOM 4348 HA ARG B 25 -10.698 1.230 16.645 1.00 0.00 H ATOM 4349 HB2 ARG B 25 -10.204 -0.628 14.638 1.00 0.00 H ATOM 4350 HB3 ARG B 25 -11.644 0.228 14.040 1.00 0.00 H ATOM 4351 HG2 ARG B 25 -10.266 2.400 14.550 1.00 0.00 H ATOM 4352 HG3 ARG B 25 -8.862 1.308 14.565 1.00 0.00 H ATOM 4353 HD2 ARG B 25 -8.765 1.890 12.324 1.00 0.00 H ATOM 4354 HD3 ARG B 25 -10.494 2.300 12.244 1.00 0.00 H ATOM 4355 HE ARG B 25 -11.000 0.148 11.534 1.00 0.00 H ATOM 4356 HH12 ARG B 25 -7.240 -1.394 12.011 1.00 0.00 H ATOM 4357 HH11 ARG B 25 -7.586 0.255 12.646 1.00 0.00 H ATOM 4358 HH22 ARG B 25 -8.879 -2.601 10.967 1.00 0.00 H ATOM 4359 HH21 ARG B 25 -10.532 -1.912 10.769 1.00 0.00 H ATOM 4360 H ARG B 25 -10.496 -1.525 16.464 1.00 0.00 H ATOM 4361 N ALA B 26 -13.656 -0.023 15.836 1.00 45.37 N ATOM 4362 CA ALA B 26 -15.053 0.307 15.563 1.00 48.97 C ATOM 4363 C ALA B 26 -15.810 0.661 16.848 1.00 52.49 C ATOM 4364 O ALA B 26 -16.562 1.637 16.900 1.00 57.53 O ATOM 4365 CB ALA B 26 -15.735 -0.841 14.820 1.00 46.05 C ATOM 4366 HA ALA B 26 -15.072 1.190 14.925 1.00 0.00 H ATOM 4367 HB1 ALA B 26 -15.220 -1.018 13.876 1.00 0.00 H ATOM 4368 HB2 ALA B 26 -15.695 -1.742 15.432 1.00 0.00 H ATOM 4369 HB3 ALA B 26 -16.775 -0.579 14.625 1.00 0.00 H ATOM 4370 H ALA B 26 -13.360 -1.019 15.790 1.00 0.00 H ATOM 4371 N LEU B 27 -15.585 -0.120 17.899 1.00 51.58 N ATOM 4372 CA LEU B 27 -16.138 0.226 19.180 1.00 48.06 C ATOM 4373 C LEU B 27 -15.663 1.619 19.579 1.00 45.71 C ATOM 4374 O LEU B 27 -16.478 2.477 19.945 1.00 45.12 O ATOM 4375 CB LEU B 27 -15.768 -0.826 20.215 1.00 44.96 C ATOM 4376 CG LEU B 27 -16.412 -2.164 19.916 1.00 43.85 C ATOM 4377 CD1 LEU B 27 -15.787 -3.167 20.846 1.00 47.48 C ATOM 4378 CD2 LEU B 27 -17.935 -2.136 20.090 1.00 39.86 C ATOM 4379 HA LEU B 27 -17.226 0.248 19.121 1.00 0.00 H ATOM 4380 HB2 LEU B 27 -14.685 -0.949 20.221 1.00 0.00 H ATOM 4381 HB3 LEU B 27 -16.099 -0.487 21.197 1.00 0.00 H ATOM 4382 HG LEU B 27 -16.241 -2.428 18.872 1.00 0.00 H ATOM 4383 HD21 LEU B 27 -18.177 -1.869 21.119 1.00 0.00 H ATOM 4384 HD22 LEU B 27 -18.363 -1.398 19.412 1.00 0.00 H ATOM 4385 HD23 LEU B 27 -18.344 -3.121 19.863 1.00 0.00 H ATOM 4386 HD11 LEU B 27 -14.713 -3.206 20.667 1.00 0.00 H ATOM 4387 HD12 LEU B 27 -15.974 -2.870 21.878 1.00 0.00 H ATOM 4388 HD13 LEU B 27 -16.223 -4.149 20.665 1.00 0.00 H ATOM 4389 H LEU B 27 -15.010 -0.980 17.795 1.00 0.00 H ATOM 4390 N ARG B 28 -14.356 1.859 19.494 1.00 43.88 N ATOM 4391 CA ARG B 28 -13.836 3.199 19.771 1.00 46.00 C ATOM 4392 C ARG B 28 -14.636 4.302 19.040 1.00 47.07 C ATOM 4393 O ARG B 28 -15.084 5.244 19.680 1.00 47.55 O ATOM 4394 CB ARG B 28 -12.365 3.298 19.425 1.00 44.12 C ATOM 4395 CG ARG B 28 -11.834 4.693 19.601 1.00 48.30 C ATOM 4396 CD ARG B 28 -10.673 4.676 20.523 1.00 52.43 C ATOM 4397 NE ARG B 28 -10.837 5.592 21.648 1.00 58.74 N ATOM 4398 CZ ARG B 28 -10.758 6.926 21.553 1.00 62.92 C ATOM 4399 NH1 ARG B 28 -10.569 7.528 20.376 1.00 63.77 N ATOM 4400 NH2 ARG B 28 -10.877 7.676 22.637 1.00 58.20 N ATOM 4401 HA ARG B 28 -13.955 3.363 20.842 1.00 0.00 H ATOM 4402 HB2 ARG B 28 -11.805 2.624 20.074 1.00 0.00 H ATOM 4403 HB3 ARG B 28 -12.227 2.998 18.386 1.00 0.00 H ATOM 4404 HG2 ARG B 28 -11.522 5.087 18.634 1.00 0.00 H ATOM 4405 HG3 ARG B 28 -12.616 5.329 20.016 1.00 0.00 H ATOM 4406 HD2 ARG B 28 -9.780 4.962 19.967 1.00 0.00 H ATOM 4407 HD3 ARG B 28 -10.549 3.665 20.911 1.00 0.00 H ATOM 4408 HE ARG B 28 -11.028 5.182 22.585 1.00 0.00 H ATOM 4409 HH12 ARG B 28 -10.511 8.565 20.326 1.00 0.00 H ATOM 4410 HH11 ARG B 28 -10.480 6.960 19.510 1.00 0.00 H ATOM 4411 HH22 ARG B 28 -10.816 8.711 22.562 1.00 0.00 H ATOM 4412 HH21 ARG B 28 -11.032 7.230 23.564 1.00 0.00 H ATOM 4413 H ARG B 28 -13.704 1.093 19.230 1.00 0.00 H ATOM 4414 N LEU B 29 -14.852 4.155 17.723 1.00 48.71 N ATOM 4415 CA LEU B 29 -15.551 5.182 16.920 1.00 50.90 C ATOM 4416 C LEU B 29 -16.945 5.454 17.442 1.00 52.12 C ATOM 4417 O LEU B 29 -17.512 6.496 17.167 1.00 51.88 O ATOM 4418 CB LEU B 29 -15.623 4.803 15.441 1.00 48.74 C ATOM 4419 CG LEU B 29 -14.351 5.147 14.650 1.00 54.28 C ATOM 4420 CD1 LEU B 29 -14.520 4.837 13.157 1.00 54.40 C ATOM 4421 CD2 LEU B 29 -13.848 6.609 14.856 1.00 49.78 C ATOM 4422 HA LEU B 29 -14.959 6.092 17.015 1.00 0.00 H ATOM 4423 HB2 LEU B 29 -15.793 3.729 15.369 1.00 0.00 H ATOM 4424 HB3 LEU B 29 -16.462 5.333 14.991 1.00 0.00 H ATOM 4425 HG LEU B 29 -13.575 4.502 15.062 1.00 0.00 H ATOM 4426 HD21 LEU B 29 -14.623 7.307 14.538 1.00 0.00 H ATOM 4427 HD22 LEU B 29 -13.624 6.770 15.911 1.00 0.00 H ATOM 4428 HD23 LEU B 29 -12.947 6.769 14.263 1.00 0.00 H ATOM 4429 HD11 LEU B 29 -14.731 3.775 13.029 1.00 0.00 H ATOM 4430 HD12 LEU B 29 -15.347 5.424 12.757 1.00 0.00 H ATOM 4431 HD13 LEU B 29 -13.602 5.092 12.628 1.00 0.00 H ATOM 4432 H LEU B 29 -14.517 3.291 17.252 1.00 0.00 H ATOM 4433 N THR B 30 -17.483 4.512 18.213 1.00 55.12 N ATOM 4434 CA THR B 30 -18.802 4.676 18.801 1.00 54.74 C ATOM 4435 C THR B 30 -18.771 5.215 20.245 1.00 49.78 C ATOM 4436 O THR B 30 -19.795 5.317 20.879 1.00 46.06 O ATOM 4437 CB THR B 30 -19.649 3.355 18.729 1.00 54.95 C ATOM 4438 OG1 THR B 30 -19.323 2.508 19.832 1.00 60.03 O ATOM 4439 CG2 THR B 30 -19.412 2.603 17.460 1.00 56.67 C ATOM 4440 HA THR B 30 -19.290 5.435 18.190 1.00 0.00 H ATOM 4441 HB THR B 30 -20.699 3.645 18.765 1.00 0.00 H ATOM 4442 HG1 THR B 30 -18.360 2.281 19.799 1.00 0.00 H ATOM 4443 HG23 THR B 30 -19.658 3.240 16.610 1.00 0.00 H ATOM 4444 HG21 THR B 30 -18.364 2.309 17.404 1.00 0.00 H ATOM 4445 HG22 THR B 30 -20.042 1.714 17.443 1.00 0.00 H ATOM 4446 H THR B 30 -16.948 3.640 18.399 1.00 0.00 H ATOM 4447 N GLY B 31 -17.613 5.564 20.779 1.00 52.07 N ATOM 4448 CA GLY B 31 -17.602 6.148 22.130 1.00 52.97 C ATOM 4449 C GLY B 31 -17.341 5.193 23.302 1.00 56.23 C ATOM 4450 O GLY B 31 -17.407 5.624 24.453 1.00 60.79 O ATOM 4451 HA3 GLY B 31 -18.574 6.613 22.295 1.00 0.00 H ATOM 4452 HA2 GLY B 31 -16.826 6.914 22.151 1.00 0.00 H ATOM 4453 H GLY B 31 -16.726 5.428 20.254 1.00 0.00 H ATOM 4454 N ARG B 32 -17.046 3.912 23.039 1.00 49.70 N ATOM 4455 CA ARG B 32 -16.480 3.031 24.064 1.00 45.21 C ATOM 4456 C ARG B 32 -15.015 3.370 24.191 1.00 45.39 C ATOM 4457 O ARG B 32 -14.372 3.626 23.178 1.00 46.52 O ATOM 4458 CB ARG B 32 -16.605 1.561 23.678 1.00 42.90 C ATOM 4459 CG ARG B 32 -18.031 1.063 23.411 1.00 41.63 C ATOM 4460 CD ARG B 32 -18.968 1.145 24.607 1.00 39.79 C ATOM 4461 NE ARG B 32 -18.685 0.159 25.639 1.00 43.01 N ATOM 4462 CZ ARG B 32 -18.910 -1.153 25.511 1.00 45.80 C ATOM 4463 NH1 ARG B 32 -19.409 -1.612 24.386 1.00 41.54 N ATOM 4464 NH2 ARG B 32 -18.631 -2.017 26.496 1.00 41.80 N ATOM 4465 HA ARG B 32 -17.021 3.180 24.999 1.00 0.00 H ATOM 4466 HB2 ARG B 32 -16.019 1.401 22.773 1.00 0.00 H ATOM 4467 HB3 ARG B 32 -16.188 0.965 24.490 1.00 0.00 H ATOM 4468 HG2 ARG B 32 -18.455 1.663 22.606 1.00 0.00 H ATOM 4469 HG3 ARG B 32 -17.974 0.021 23.095 1.00 0.00 H ATOM 4470 HD2 ARG B 32 -19.989 0.993 24.256 1.00 0.00 H ATOM 4471 HD3 ARG B 32 -18.880 2.139 25.046 1.00 0.00 H ATOM 4472 HE ARG B 32 -18.281 0.497 26.536 1.00 0.00 H ATOM 4473 HH12 ARG B 32 -19.589 -2.630 24.274 1.00 0.00 H ATOM 4474 HH11 ARG B 32 -19.625 -0.957 23.607 1.00 0.00 H ATOM 4475 HH22 ARG B 32 -18.817 -3.032 26.366 1.00 0.00 H ATOM 4476 HH21 ARG B 32 -18.228 -1.673 27.391 1.00 0.00 H ATOM 4477 H ARG B 32 -17.223 3.535 22.086 1.00 0.00 H ATOM 4478 N ARG B 33 -14.497 3.403 25.418 1.00 43.96 N ATOM 4479 CA ARG B 33 -13.066 3.569 25.631 1.00 43.01 C ATOM 4480 C ARG B 33 -12.467 2.160 25.818 1.00 42.05 C ATOM 4481 O ARG B 33 -12.851 1.447 26.742 1.00 39.80 O ATOM 4482 CB ARG B 33 -12.789 4.470 26.850 1.00 45.76 C ATOM 4483 CG ARG B 33 -13.428 5.881 26.781 1.00 55.07 C ATOM 4484 CD ARG B 33 -12.491 6.949 26.071 1.00 64.20 C ATOM 4485 NE ARG B 33 -13.156 8.092 25.382 1.00 59.79 N ATOM 4486 CZ ARG B 33 -13.780 8.036 24.183 1.00 66.37 C ATOM 4487 NH1 ARG B 33 -13.897 6.887 23.493 1.00 61.86 N ATOM 4488 NH2 ARG B 33 -14.315 9.141 23.661 1.00 63.10 N ATOM 4489 HA ARG B 33 -12.604 4.063 24.776 1.00 0.00 H ATOM 4490 HB2 ARG B 33 -13.174 3.967 27.737 1.00 0.00 H ATOM 4491 HB3 ARG B 33 -11.710 4.591 26.943 1.00 0.00 H ATOM 4492 HG2 ARG B 33 -14.363 5.813 26.224 1.00 0.00 H ATOM 4493 HG3 ARG B 33 -13.635 6.220 27.796 1.00 0.00 H ATOM 4494 HD2 ARG B 33 -11.896 6.419 25.327 1.00 0.00 H ATOM 4495 HD3 ARG B 33 -11.832 7.365 26.833 1.00 0.00 H ATOM 4496 HE ARG B 33 -13.139 9.013 25.865 1.00 0.00 H ATOM 4497 HH12 ARG B 33 -14.383 6.880 22.574 1.00 0.00 H ATOM 4498 HH11 ARG B 33 -13.501 6.006 23.879 1.00 0.00 H ATOM 4499 HH22 ARG B 33 -14.795 9.101 22.739 1.00 0.00 H ATOM 4500 HH21 ARG B 33 -14.252 10.043 24.176 1.00 0.00 H ATOM 4501 H ARG B 33 -15.127 3.308 26.240 1.00 0.00 H ATOM 4502 N VAL B 34 -11.535 1.759 24.948 1.00 41.65 N ATOM 4503 CA VAL B 34 -10.877 0.404 25.015 1.00 40.45 C ATOM 4504 C VAL B 34 -9.739 0.249 26.069 1.00 38.69 C ATOM 4505 O VAL B 34 -8.819 1.081 26.127 1.00 39.48 O ATOM 4506 CB VAL B 34 -10.324 0.035 23.668 1.00 35.67 C ATOM 4507 CG1 VAL B 34 -9.847 -1.411 23.672 1.00 36.79 C ATOM 4508 CG2 VAL B 34 -11.433 0.274 22.593 1.00 35.37 C ATOM 4509 HA VAL B 34 -11.676 -0.265 25.335 1.00 0.00 H ATOM 4510 HB VAL B 34 -9.461 0.657 23.429 1.00 0.00 H ATOM 4511 HG11 VAL B 34 -9.067 -1.533 24.424 1.00 0.00 H ATOM 4512 HG12 VAL B 34 -10.685 -2.068 23.906 1.00 0.00 H ATOM 4513 HG13 VAL B 34 -9.449 -1.664 22.689 1.00 0.00 H ATOM 4514 HG21 VAL B 34 -12.299 -0.346 22.822 1.00 0.00 H ATOM 4515 HG22 VAL B 34 -11.724 1.324 22.601 1.00 0.00 H ATOM 4516 HG23 VAL B 34 -11.046 0.010 21.609 1.00 0.00 H ATOM 4517 H VAL B 34 -11.251 2.412 24.190 1.00 0.00 H ATOM 4518 N MET B 35 -9.832 -0.791 26.905 1.00 32.16 N ATOM 4519 CA MET B 35 -8.876 -1.042 27.996 1.00 29.67 C ATOM 4520 C MET B 35 -8.176 -2.362 27.652 1.00 29.98 C ATOM 4521 O MET B 35 -8.850 -3.323 27.335 1.00 29.77 O ATOM 4522 CB MET B 35 -9.620 -1.201 29.337 1.00 29.66 C ATOM 4523 CG MET B 35 -10.559 -0.081 29.697 1.00 24.73 C ATOM 4524 SD MET B 35 -9.658 1.421 30.120 1.00 39.92 S ATOM 4525 CE MET B 35 -10.496 2.721 29.224 1.00 32.51 C ATOM 4526 HA MET B 35 -8.173 -0.215 28.096 1.00 0.00 H ATOM 4527 HB2 MET B 35 -10.199 -2.123 29.292 1.00 0.00 H ATOM 4528 HB3 MET B 35 -8.874 -1.280 30.127 1.00 0.00 H ATOM 4529 HG2 MET B 35 -11.163 -0.385 30.552 1.00 0.00 H ATOM 4530 HG3 MET B 35 -11.210 0.123 28.847 1.00 0.00 H ATOM 4531 HE1 MET B 35 -10.453 2.510 28.155 1.00 0.00 H ATOM 4532 HE2 MET B 35 -11.537 2.769 29.545 1.00 0.00 H ATOM 4533 HE3 MET B 35 -10.008 3.674 29.427 1.00 0.00 H ATOM 4534 H MET B 35 -10.621 -1.457 26.778 1.00 0.00 H ATOM 4535 N LEU B 36 -6.844 -2.444 27.680 1.00 29.63 N ATOM 4536 CA LEU B 36 -6.273 -3.776 27.468 1.00 33.89 C ATOM 4537 C LEU B 36 -5.604 -4.345 28.701 1.00 37.53 C ATOM 4538 O LEU B 36 -4.934 -3.615 29.428 1.00 41.61 O ATOM 4539 CB LEU B 36 -5.327 -3.777 26.297 1.00 28.87 C ATOM 4540 CG LEU B 36 -4.252 -4.819 26.168 1.00 30.14 C ATOM 4541 CD1 LEU B 36 -4.842 -6.088 25.635 1.00 27.26 C ATOM 4542 CD2 LEU B 36 -3.293 -4.233 25.169 1.00 29.15 C ATOM 4543 HA LEU B 36 -7.113 -4.434 27.244 1.00 0.00 H ATOM 4544 HB2 LEU B 36 -5.943 -3.855 25.401 1.00 0.00 H ATOM 4545 HB3 LEU B 36 -4.822 -2.811 26.306 1.00 0.00 H ATOM 4546 HG LEU B 36 -3.773 -5.058 27.117 1.00 0.00 H ATOM 4547 HD21 LEU B 36 -3.813 -4.060 24.227 1.00 0.00 H ATOM 4548 HD22 LEU B 36 -2.905 -3.288 25.550 1.00 0.00 H ATOM 4549 HD23 LEU B 36 -2.468 -4.927 25.009 1.00 0.00 H ATOM 4550 HD11 LEU B 36 -5.612 -6.445 26.319 1.00 0.00 H ATOM 4551 HD12 LEU B 36 -5.283 -5.899 24.656 1.00 0.00 H ATOM 4552 HD13 LEU B 36 -4.059 -6.841 25.543 1.00 0.00 H ATOM 4553 H LEU B 36 -6.245 -1.609 27.843 1.00 0.00 H ATOM 4554 N VAL B 37 -5.834 -5.639 28.923 1.00 32.06 N ATOM 4555 CA VAL B 37 -5.188 -6.420 29.964 1.00 35.03 C ATOM 4556 C VAL B 37 -4.365 -7.590 29.360 1.00 35.38 C ATOM 4557 O VAL B 37 -4.891 -8.626 28.959 1.00 39.15 O ATOM 4558 CB VAL B 37 -6.236 -6.961 30.984 1.00 33.63 C ATOM 4559 CG1 VAL B 37 -5.579 -7.876 32.020 1.00 25.24 C ATOM 4560 CG2 VAL B 37 -6.985 -5.817 31.657 1.00 29.20 C ATOM 4561 HA VAL B 37 -4.500 -5.760 30.493 1.00 0.00 H ATOM 4562 HB VAL B 37 -6.963 -7.556 30.431 1.00 0.00 H ATOM 4563 HG11 VAL B 37 -5.117 -8.723 31.513 1.00 0.00 H ATOM 4564 HG12 VAL B 37 -4.818 -7.318 32.565 1.00 0.00 H ATOM 4565 HG13 VAL B 37 -6.336 -8.237 32.716 1.00 0.00 H ATOM 4566 HG21 VAL B 37 -6.275 -5.182 32.188 1.00 0.00 H ATOM 4567 HG22 VAL B 37 -7.504 -5.229 30.900 1.00 0.00 H ATOM 4568 HG23 VAL B 37 -7.709 -6.224 32.363 1.00 0.00 H ATOM 4569 H VAL B 37 -6.522 -6.122 28.310 1.00 0.00 H ATOM 4570 N PRO B 38 -3.066 -7.394 29.235 1.00 36.09 N ATOM 4571 CA PRO B 38 -2.142 -8.438 28.782 1.00 32.17 C ATOM 4572 C PRO B 38 -1.973 -9.516 29.819 1.00 33.92 C ATOM 4573 O PRO B 38 -1.630 -9.218 30.946 1.00 33.17 O ATOM 4574 CB PRO B 38 -0.832 -7.678 28.621 1.00 32.42 C ATOM 4575 CG PRO B 38 -1.303 -6.203 28.440 1.00 35.48 C ATOM 4576 CD PRO B 38 -2.405 -6.098 29.417 1.00 33.57 C ATOM 4577 HA PRO B 38 -2.488 -8.939 27.878 1.00 0.00 H ATOM 4578 HD3 PRO B 38 -2.029 -5.979 30.433 1.00 0.00 H ATOM 4579 HD2 PRO B 38 -3.074 -5.271 29.179 1.00 0.00 H ATOM 4580 HG3 PRO B 38 -1.658 -6.024 27.425 1.00 0.00 H ATOM 4581 HG2 PRO B 38 -0.502 -5.502 28.673 1.00 0.00 H ATOM 4582 HB2 PRO B 38 -0.206 -7.784 29.507 1.00 0.00 H ATOM 4583 HB3 PRO B 38 -0.283 -8.024 27.746 1.00 0.00 H ATOM 4584 N THR B 39 -2.247 -10.765 29.457 1.00 38.72 N ATOM 4585 CA THR B 39 -1.988 -11.864 30.386 1.00 36.00 C ATOM 4586 C THR B 39 -1.384 -13.027 29.655 1.00 34.76 C ATOM 4587 O THR B 39 -1.438 -13.131 28.430 1.00 41.23 O ATOM 4588 CB THR B 39 -3.256 -12.429 30.993 1.00 36.15 C ATOM 4589 OG1 THR B 39 -3.809 -13.367 30.068 1.00 39.16 O ATOM 4590 CG2 THR B 39 -4.280 -11.352 31.268 1.00 33.99 C ATOM 4591 HA THR B 39 -1.338 -11.443 31.153 1.00 0.00 H ATOM 4592 HB THR B 39 -3.006 -12.900 31.944 1.00 0.00 H ATOM 4593 HG1 THR B 39 -4.013 -12.907 29.216 1.00 0.00 H ATOM 4594 HG23 THR B 39 -3.867 -10.631 31.973 1.00 0.00 H ATOM 4595 HG21 THR B 39 -4.533 -10.846 30.336 1.00 0.00 H ATOM 4596 HG22 THR B 39 -5.176 -11.804 31.692 1.00 0.00 H ATOM 4597 H THR B 39 -2.644 -10.960 28.516 1.00 0.00 H ATOM 4598 N MET B 40 -0.850 -13.941 30.425 1.00 39.60 N ATOM 4599 CA MET B 40 -0.247 -15.130 29.869 1.00 45.32 C ATOM 4600 C MET B 40 -1.055 -16.413 30.229 1.00 44.01 C ATOM 4601 O MET B 40 -0.528 -17.526 30.141 1.00 48.64 O ATOM 4602 CB MET B 40 1.193 -15.234 30.333 1.00 41.79 C ATOM 4603 CG MET B 40 2.098 -14.220 29.728 1.00 45.14 C ATOM 4604 SD MET B 40 3.766 -14.891 29.800 1.00 54.88 S ATOM 4605 CE MET B 40 3.890 -15.542 31.474 1.00 51.66 C ATOM 4606 HA MET B 40 -0.263 -15.049 28.782 1.00 0.00 H ATOM 4607 HB2 MET B 40 1.214 -15.110 31.416 1.00 0.00 H ATOM 4608 HB3 MET B 40 1.566 -16.225 30.074 1.00 0.00 H ATOM 4609 HG2 MET B 40 2.045 -13.288 30.290 1.00 0.00 H ATOM 4610 HG3 MET B 40 1.813 -14.035 28.692 1.00 0.00 H ATOM 4611 HE1 MET B 40 3.738 -14.734 32.189 1.00 0.00 H ATOM 4612 HE2 MET B 40 3.129 -16.308 31.622 1.00 0.00 H ATOM 4613 HE3 MET B 40 4.878 -15.977 31.621 1.00 0.00 H ATOM 4614 H MET B 40 -0.860 -13.809 31.456 1.00 0.00 H ATOM 4615 N GLY B 41 -2.331 -16.236 30.599 1.00 43.23 N ATOM 4616 CA GLY B 41 -3.282 -17.328 30.880 1.00 39.60 C ATOM 4617 C GLY B 41 -3.179 -17.780 32.331 1.00 42.01 C ATOM 4618 O GLY B 41 -2.347 -17.252 33.049 1.00 36.18 O ATOM 4619 HA3 GLY B 41 -3.060 -18.172 30.227 1.00 0.00 H ATOM 4620 HA2 GLY B 41 -4.296 -16.977 30.686 1.00 0.00 H ATOM 4621 H GLY B 41 -2.675 -15.259 30.695 1.00 0.00 H ATOM 4622 N ALA B 42 -3.987 -18.768 32.761 1.00 44.04 N ATOM 4623 CA ALA B 42 -3.895 -19.290 34.132 1.00 43.71 C ATOM 4624 C ALA B 42 -4.120 -18.100 35.076 1.00 46.47 C ATOM 4625 O ALA B 42 -3.232 -17.639 35.798 1.00 45.19 O ATOM 4626 CB ALA B 42 -2.516 -19.958 34.378 1.00 42.90 C ATOM 4627 HA ALA B 42 -4.644 -20.062 34.308 1.00 0.00 H ATOM 4628 HB1 ALA B 42 -2.383 -20.783 33.678 1.00 0.00 H ATOM 4629 HB2 ALA B 42 -1.726 -19.223 34.228 1.00 0.00 H ATOM 4630 HB3 ALA B 42 -2.474 -20.336 35.400 1.00 0.00 H ATOM 4631 H ALA B 42 -4.691 -19.170 32.109 1.00 0.00 H ATOM 4632 N LEU B 43 -5.330 -17.581 35.027 1.00 46.06 N ATOM 4633 CA LEU B 43 -5.642 -16.361 35.742 1.00 46.30 C ATOM 4634 C LEU B 43 -5.968 -16.672 37.180 1.00 47.04 C ATOM 4635 O LEU B 43 -6.304 -17.819 37.507 1.00 50.26 O ATOM 4636 CB LEU B 43 -6.834 -15.660 35.071 1.00 45.66 C ATOM 4637 CG LEU B 43 -6.655 -15.366 33.589 1.00 39.05 C ATOM 4638 CD1 LEU B 43 -7.900 -15.669 32.862 1.00 46.54 C ATOM 4639 CD2 LEU B 43 -6.291 -13.916 33.452 1.00 44.93 C ATOM 4640 HA LEU B 43 -4.776 -15.700 35.715 1.00 0.00 H ATOM 4641 HB2 LEU B 43 -7.710 -16.298 35.186 1.00 0.00 H ATOM 4642 HB3 LEU B 43 -7.004 -14.714 35.586 1.00 0.00 H ATOM 4643 HG LEU B 43 -5.867 -15.987 33.163 1.00 0.00 H ATOM 4644 HD21 LEU B 43 -7.090 -13.301 33.867 1.00 0.00 H ATOM 4645 HD22 LEU B 43 -5.364 -13.723 33.992 1.00 0.00 H ATOM 4646 HD23 LEU B 43 -6.156 -13.675 32.398 1.00 0.00 H ATOM 4647 HD11 LEU B 43 -8.148 -16.722 32.992 1.00 0.00 H ATOM 4648 HD12 LEU B 43 -8.708 -15.053 33.256 1.00 0.00 H ATOM 4649 HD13 LEU B 43 -7.762 -15.455 31.802 1.00 0.00 H ATOM 4650 H LEU B 43 -6.070 -18.053 34.468 1.00 0.00 H ATOM 4651 N HIS B 44 -5.883 -15.644 38.025 1.00 44.17 N ATOM 4652 CA HIS B 44 -6.307 -15.725 39.414 1.00 41.97 C ATOM 4653 C HIS B 44 -6.690 -14.354 39.912 1.00 46.26 C ATOM 4654 O HIS B 44 -6.814 -13.422 39.130 1.00 49.80 O ATOM 4655 CB HIS B 44 -5.235 -16.341 40.292 1.00 40.65 C ATOM 4656 CG HIS B 44 -3.896 -15.689 40.178 1.00 40.69 C ATOM 4657 ND1 HIS B 44 -3.662 -14.389 40.577 1.00 32.33 N ATOM 4658 CD2 HIS B 44 -2.701 -16.187 39.759 1.00 38.33 C ATOM 4659 CE1 HIS B 44 -2.381 -14.109 40.381 1.00 38.99 C ATOM 4660 NE2 HIS B 44 -1.776 -15.188 39.898 1.00 33.11 N ATOM 4661 HA HIS B 44 -7.178 -16.378 39.467 1.00 0.00 H ATOM 4662 HB2 HIS B 44 -5.562 -16.271 41.330 1.00 0.00 H ATOM 4663 HB3 HIS B 44 -5.129 -17.390 40.016 1.00 0.00 H ATOM 4664 HD2 HIS B 44 -2.515 -17.193 39.383 1.00 0.00 H ATOM 4665 HE1 HIS B 44 -1.903 -13.151 40.583 1.00 0.00 H ATOM 4666 H HIS B 44 -5.496 -14.744 37.675 1.00 0.00 H ATOM 4667 N GLU B 45 -6.881 -14.207 41.209 1.00 48.16 N ATOM 4668 CA GLU B 45 -7.302 -12.918 41.723 1.00 50.59 C ATOM 4669 C GLU B 45 -6.476 -11.808 41.099 1.00 46.80 C ATOM 4670 O GLU B 45 -7.037 -10.796 40.639 1.00 43.75 O ATOM 4671 CB GLU B 45 -7.234 -12.869 43.248 1.00 54.30 C ATOM 4672 CG GLU B 45 -8.159 -13.871 43.928 1.00 69.41 C ATOM 4673 CD GLU B 45 -9.642 -13.708 43.543 1.00 78.41 C ATOM 4674 OE1 GLU B 45 -10.189 -12.572 43.649 1.00 79.95 O ATOM 4675 OE2 GLU B 45 -10.254 -14.732 43.137 1.00 82.08 O ATOM 4676 HA GLU B 45 -8.346 -12.769 41.446 1.00 0.00 H ATOM 4677 HB2 GLU B 45 -6.210 -13.080 43.555 1.00 0.00 H ATOM 4678 HB3 GLU B 45 -7.511 -11.866 43.574 1.00 0.00 H ATOM 4679 HG2 GLU B 45 -7.840 -14.876 43.652 1.00 0.00 H ATOM 4680 HG3 GLU B 45 -8.068 -13.746 45.007 1.00 0.00 H ATOM 4681 H GLU B 45 -6.731 -15.007 41.856 1.00 0.00 H ATOM 4682 N GLY B 46 -5.157 -12.026 41.047 1.00 41.20 N ATOM 4683 CA GLY B 46 -4.219 -10.983 40.619 1.00 35.83 C ATOM 4684 C GLY B 46 -4.625 -10.390 39.291 1.00 30.98 C ATOM 4685 O GLY B 46 -4.852 -9.184 39.160 1.00 39.52 O ATOM 4686 HA3 GLY B 46 -3.224 -11.417 40.525 1.00 0.00 H ATOM 4687 HA2 GLY B 46 -4.200 -10.193 41.370 1.00 0.00 H ATOM 4688 H GLY B 46 -4.787 -12.960 41.317 1.00 0.00 H ATOM 4689 N HIS B 47 -4.753 -11.259 38.316 1.00 33.82 N ATOM 4690 CA HIS B 47 -5.261 -10.879 37.019 1.00 40.81 C ATOM 4691 C HIS B 47 -6.638 -10.255 37.166 1.00 44.21 C ATOM 4692 O HIS B 47 -6.909 -9.236 36.518 1.00 51.32 O ATOM 4693 CB HIS B 47 -5.324 -12.083 36.110 1.00 39.68 C ATOM 4694 CG HIS B 47 -4.072 -12.899 36.122 1.00 41.86 C ATOM 4695 ND1 HIS B 47 -3.804 -13.834 37.096 1.00 46.91 N ATOM 4696 CD2 HIS B 47 -3.013 -12.926 35.280 1.00 46.96 C ATOM 4697 CE1 HIS B 47 -2.637 -14.408 36.850 1.00 45.99 C ATOM 4698 NE2 HIS B 47 -2.138 -13.877 35.751 1.00 48.79 N ATOM 4699 HA HIS B 47 -4.588 -10.146 36.575 1.00 0.00 H ATOM 4700 HB2 HIS B 47 -6.152 -12.715 36.430 1.00 0.00 H ATOM 4701 HB3 HIS B 47 -5.503 -11.739 35.091 1.00 0.00 H ATOM 4702 HD2 HIS B 47 -2.878 -12.308 34.392 1.00 0.00 H ATOM 4703 HE1 HIS B 47 -2.169 -15.186 37.453 1.00 0.00 H ATOM 4704 H HIS B 47 -4.481 -12.249 38.482 1.00 0.00 H ATOM 4705 N LEU B 48 -7.483 -10.807 38.054 1.00 43.65 N ATOM 4706 CA LEU B 48 -8.878 -10.377 38.134 1.00 35.83 C ATOM 4707 C LEU B 48 -8.973 -8.939 38.659 1.00 33.96 C ATOM 4708 O LEU B 48 -9.867 -8.184 38.231 1.00 33.36 O ATOM 4709 CB LEU B 48 -9.805 -11.366 38.900 1.00 41.10 C ATOM 4710 CG LEU B 48 -10.057 -12.858 38.548 1.00 42.79 C ATOM 4711 CD1 LEU B 48 -11.291 -13.401 39.311 1.00 41.15 C ATOM 4712 CD2 LEU B 48 -10.199 -13.139 37.041 1.00 40.37 C ATOM 4713 HA LEU B 48 -9.266 -10.388 37.115 1.00 0.00 H ATOM 4714 HB2 LEU B 48 -9.426 -11.376 39.922 1.00 0.00 H ATOM 4715 HB3 LEU B 48 -10.791 -10.901 38.884 1.00 0.00 H ATOM 4716 HG LEU B 48 -9.159 -13.386 38.869 1.00 0.00 H ATOM 4717 HD21 LEU B 48 -11.041 -12.571 36.644 1.00 0.00 H ATOM 4718 HD22 LEU B 48 -9.284 -12.840 36.529 1.00 0.00 H ATOM 4719 HD23 LEU B 48 -10.373 -14.204 36.886 1.00 0.00 H ATOM 4720 HD11 LEU B 48 -11.119 -13.316 40.384 1.00 0.00 H ATOM 4721 HD12 LEU B 48 -12.171 -12.820 39.036 1.00 0.00 H ATOM 4722 HD13 LEU B 48 -11.448 -14.447 39.048 1.00 0.00 H ATOM 4723 H LEU B 48 -7.139 -11.551 38.694 1.00 0.00 H ATOM 4724 N ALA B 49 -8.060 -8.510 39.534 1.00 30.58 N ATOM 4725 CA ALA B 49 -8.152 -7.092 39.949 1.00 25.94 C ATOM 4726 C ALA B 49 -7.676 -6.186 38.827 1.00 24.54 C ATOM 4727 O ALA B 49 -8.070 -5.021 38.780 1.00 27.61 O ATOM 4728 CB ALA B 49 -7.459 -6.808 41.236 1.00 24.50 C ATOM 4729 HA ALA B 49 -9.203 -6.879 40.143 1.00 0.00 H ATOM 4730 HB1 ALA B 49 -7.903 -7.412 42.027 1.00 0.00 H ATOM 4731 HB2 ALA B 49 -6.402 -7.054 41.140 1.00 0.00 H ATOM 4732 HB3 ALA B 49 -7.566 -5.751 41.480 1.00 0.00 H ATOM 4733 H ALA B 49 -7.321 -9.141 39.905 1.00 0.00 H ATOM 4734 N LEU B 50 -6.913 -6.737 37.871 1.00 22.84 N ATOM 4735 CA LEU B 50 -6.545 -5.965 36.650 1.00 28.51 C ATOM 4736 C LEU B 50 -7.785 -5.720 35.870 1.00 26.71 C ATOM 4737 O LEU B 50 -8.133 -4.598 35.555 1.00 30.32 O ATOM 4738 CB LEU B 50 -5.523 -6.699 35.774 1.00 27.38 C ATOM 4739 CG LEU B 50 -4.102 -6.288 36.183 1.00 33.12 C ATOM 4740 CD1 LEU B 50 -3.766 -6.753 37.597 1.00 31.72 C ATOM 4741 CD2 LEU B 50 -3.129 -6.850 35.215 1.00 33.70 C ATOM 4742 HA LEU B 50 -6.079 -5.030 36.962 1.00 0.00 H ATOM 4743 HB2 LEU B 50 -5.641 -7.775 35.903 1.00 0.00 H ATOM 4744 HB3 LEU B 50 -5.689 -6.440 34.728 1.00 0.00 H ATOM 4745 HG LEU B 50 -4.045 -5.200 36.174 1.00 0.00 H ATOM 4746 HD21 LEU B 50 -3.208 -7.937 35.212 1.00 0.00 H ATOM 4747 HD22 LEU B 50 -3.347 -6.466 34.218 1.00 0.00 H ATOM 4748 HD23 LEU B 50 -2.120 -6.558 35.505 1.00 0.00 H ATOM 4749 HD11 LEU B 50 -4.469 -6.308 38.301 1.00 0.00 H ATOM 4750 HD12 LEU B 50 -3.838 -7.839 37.648 1.00 0.00 H ATOM 4751 HD13 LEU B 50 -2.752 -6.443 37.849 1.00 0.00 H ATOM 4752 H LEU B 50 -6.574 -7.714 37.983 1.00 0.00 H ATOM 4753 N VAL B 51 -8.478 -6.811 35.624 1.00 30.57 N ATOM 4754 CA VAL B 51 -9.764 -6.810 34.991 1.00 31.58 C ATOM 4755 C VAL B 51 -10.795 -5.864 35.659 1.00 38.69 C ATOM 4756 O VAL B 51 -11.520 -5.184 34.924 1.00 40.53 O ATOM 4757 CB VAL B 51 -10.254 -8.267 34.868 1.00 33.29 C ATOM 4758 CG1 VAL B 51 -11.625 -8.353 34.191 1.00 37.29 C ATOM 4759 CG2 VAL B 51 -9.240 -9.083 34.076 1.00 25.12 C ATOM 4760 HA VAL B 51 -9.656 -6.387 33.992 1.00 0.00 H ATOM 4761 HB VAL B 51 -10.355 -8.670 35.876 1.00 0.00 H ATOM 4762 HG11 VAL B 51 -12.354 -7.795 34.778 1.00 0.00 H ATOM 4763 HG12 VAL B 51 -11.562 -7.928 33.189 1.00 0.00 H ATOM 4764 HG13 VAL B 51 -11.931 -9.397 34.125 1.00 0.00 H ATOM 4765 HG21 VAL B 51 -9.127 -8.653 33.081 1.00 0.00 H ATOM 4766 HG22 VAL B 51 -8.280 -9.066 34.591 1.00 0.00 H ATOM 4767 HG23 VAL B 51 -9.590 -10.112 33.991 1.00 0.00 H ATOM 4768 H VAL B 51 -8.070 -7.725 35.905 1.00 0.00 H ATOM 4769 N ARG B 52 -10.854 -5.771 37.005 1.00 38.82 N ATOM 4770 CA ARG B 52 -11.908 -4.926 37.629 1.00 36.24 C ATOM 4771 C ARG B 52 -11.616 -3.442 37.485 1.00 33.79 C ATOM 4772 O ARG B 52 -12.543 -2.623 37.360 1.00 38.07 O ATOM 4773 CB ARG B 52 -12.153 -5.225 39.114 1.00 33.88 C ATOM 4774 CG ARG B 52 -12.932 -6.442 39.381 1.00 38.77 C ATOM 4775 CD ARG B 52 -11.984 -7.448 39.898 1.00 43.68 C ATOM 4776 NE ARG B 52 -12.448 -8.827 39.831 1.00 43.20 N ATOM 4777 CZ ARG B 52 -12.758 -9.542 40.907 1.00 44.69 C ATOM 4778 NH1 ARG B 52 -12.679 -8.978 42.101 1.00 46.46 N ATOM 4779 NH2 ARG B 52 -13.145 -10.810 40.805 1.00 41.48 N ATOM 4780 HA ARG B 52 -12.811 -5.187 37.076 1.00 0.00 H ATOM 4781 HB2 ARG B 52 -11.184 -5.329 39.603 1.00 0.00 H ATOM 4782 HB3 ARG B 52 -12.688 -4.379 39.546 1.00 0.00 H ATOM 4783 HG2 ARG B 52 -13.705 -6.238 40.122 1.00 0.00 H ATOM 4784 HG3 ARG B 52 -13.396 -6.800 38.462 1.00 0.00 H ATOM 4785 HD2 ARG B 52 -11.776 -7.212 40.942 1.00 0.00 H ATOM 4786 HD3 ARG B 52 -11.063 -7.373 39.320 1.00 0.00 H ATOM 4787 HE ARG B 52 -12.541 -9.273 38.896 1.00 0.00 H ATOM 4788 HH12 ARG B 52 -12.919 -9.526 42.952 1.00 0.00 H ATOM 4789 HH11 ARG B 52 -12.377 -7.987 42.189 1.00 0.00 H ATOM 4790 HH22 ARG B 52 -13.383 -11.351 41.660 1.00 0.00 H ATOM 4791 HH21 ARG B 52 -13.210 -11.260 39.870 1.00 0.00 H ATOM 4792 H ARG B 52 -10.171 -6.284 37.598 1.00 0.00 H ATOM 4793 N ALA B 53 -10.330 -3.099 37.545 1.00 35.94 N ATOM 4794 CA ALA B 53 -9.868 -1.713 37.384 1.00 29.22 C ATOM 4795 C ALA B 53 -10.129 -1.298 35.955 1.00 27.69 C ATOM 4796 O ALA B 53 -10.546 -0.188 35.693 1.00 38.33 O ATOM 4797 CB ALA B 53 -8.381 -1.626 37.703 1.00 30.16 C ATOM 4798 HA ALA B 53 -10.400 -1.049 38.065 1.00 0.00 H ATOM 4799 HB1 ALA B 53 -8.212 -1.946 38.731 1.00 0.00 H ATOM 4800 HB2 ALA B 53 -7.826 -2.273 37.024 1.00 0.00 H ATOM 4801 HB3 ALA B 53 -8.044 -0.596 37.582 1.00 0.00 H ATOM 4802 H ALA B 53 -9.623 -3.843 37.713 1.00 0.00 H ATOM 4803 N ALA B 54 -9.901 -2.192 35.013 1.00 31.26 N ATOM 4804 CA ALA B 54 -10.263 -1.885 33.636 1.00 40.94 C ATOM 4805 C ALA B 54 -11.800 -1.623 33.480 1.00 41.51 C ATOM 4806 O ALA B 54 -12.206 -0.586 32.923 1.00 40.78 O ATOM 4807 CB ALA B 54 -9.747 -2.986 32.670 1.00 34.67 C ATOM 4808 HA ALA B 54 -9.768 -0.954 33.359 1.00 0.00 H ATOM 4809 HB1 ALA B 54 -8.661 -3.051 32.742 1.00 0.00 H ATOM 4810 HB2 ALA B 54 -10.188 -3.944 32.944 1.00 0.00 H ATOM 4811 HB3 ALA B 54 -10.030 -2.733 31.648 1.00 0.00 H ATOM 4812 H ALA B 54 -9.467 -3.107 35.251 1.00 0.00 H ATOM 4813 N LYS B 55 -12.630 -2.530 34.014 1.00 40.39 N ATOM 4814 CA LYS B 55 -14.090 -2.356 34.042 1.00 38.78 C ATOM 4815 C LYS B 55 -14.556 -1.050 34.676 1.00 38.57 C ATOM 4816 O LYS B 55 -15.483 -0.429 34.174 1.00 40.68 O ATOM 4817 CB LYS B 55 -14.752 -3.519 34.730 1.00 39.19 C ATOM 4818 CG LYS B 55 -15.754 -4.153 33.859 1.00 47.18 C ATOM 4819 CD LYS B 55 -15.777 -5.644 34.033 1.00 53.68 C ATOM 4820 CE LYS B 55 -17.234 -6.127 33.969 1.00 59.53 C ATOM 4821 NZ LYS B 55 -17.980 -5.932 35.271 1.00 58.05 N ATOM 4822 HA LYS B 55 -14.393 -2.314 32.996 1.00 0.00 H ATOM 4823 HB2 LYS B 55 -13.993 -4.255 34.994 1.00 0.00 H ATOM 4824 HB3 LYS B 55 -15.242 -3.164 35.636 1.00 0.00 H ATOM 4825 HG2 LYS B 55 -16.738 -3.753 34.103 1.00 0.00 H ATOM 4826 HG3 LYS B 55 -15.517 -3.922 32.821 1.00 0.00 H ATOM 4827 HD2 LYS B 55 -15.199 -6.115 33.238 1.00 0.00 H ATOM 4828 HD3 LYS B 55 -15.345 -5.907 34.999 1.00 0.00 H ATOM 4829 HE2 LYS B 55 -17.238 -7.189 33.722 1.00 0.00 H ATOM 4830 HE3 LYS B 55 -17.750 -5.571 33.186 1.00 0.00 H ATOM 4831 HZ1 LYS B 55 -17.503 -6.465 36.026 1.00 0.00 H ATOM 4832 HZ2 LYS B 55 -17.992 -4.921 35.514 1.00 0.00 H ATOM 4833 HZ3 LYS B 55 -18.956 -6.276 35.165 1.00 0.00 H ATOM 4834 H LYS B 55 -12.224 -3.394 34.426 1.00 0.00 H ATOM 4835 N ARG B 56 -13.902 -0.590 35.737 1.00 35.90 N ATOM 4836 CA ARG B 56 -14.431 0.586 36.404 1.00 42.47 C ATOM 4837 C ARG B 56 -14.204 1.975 35.720 1.00 42.61 C ATOM 4838 O ARG B 56 -14.315 3.030 36.327 1.00 43.17 O ATOM 4839 CB ARG B 56 -14.181 0.520 37.929 1.00 45.38 C ATOM 4840 CG ARG B 56 -12.909 1.057 38.489 1.00 47.68 C ATOM 4841 CD ARG B 56 -13.016 0.988 40.009 1.00 48.76 C ATOM 4842 NE ARG B 56 -11.799 0.441 40.611 1.00 60.35 N ATOM 4843 CZ ARG B 56 -11.442 -0.855 40.629 1.00 57.98 C ATOM 4844 NH1 ARG B 56 -12.200 -1.790 40.074 1.00 59.90 N ATOM 4845 NH2 ARG B 56 -10.307 -1.217 41.208 1.00 50.14 N ATOM 4846 HA ARG B 56 -15.510 0.530 36.260 1.00 0.00 H ATOM 4847 HB2 ARG B 56 -14.994 1.066 38.407 1.00 0.00 H ATOM 4848 HB3 ARG B 56 -14.234 -0.531 38.214 1.00 0.00 H ATOM 4849 HG2 ARG B 56 -12.067 0.455 38.147 1.00 0.00 H ATOM 4850 HG3 ARG B 56 -12.768 2.090 38.171 1.00 0.00 H ATOM 4851 HD2 ARG B 56 -13.860 0.352 40.276 1.00 0.00 H ATOM 4852 HD3 ARG B 56 -13.183 1.992 40.398 1.00 0.00 H ATOM 4853 HE ARG B 56 -11.152 1.116 41.066 1.00 0.00 H ATOM 4854 HH12 ARG B 56 -11.901 -2.786 40.102 1.00 0.00 H ATOM 4855 HH11 ARG B 56 -13.094 -1.528 39.611 1.00 0.00 H ATOM 4856 HH22 ARG B 56 -10.028 -2.219 41.224 1.00 0.00 H ATOM 4857 HH21 ARG B 56 -9.695 -0.500 41.647 1.00 0.00 H ATOM 4858 H ARG B 56 -13.038 -1.058 36.079 1.00 0.00 H ATOM 4859 N VAL B 57 -13.924 1.951 34.432 1.00 41.66 N ATOM 4860 CA VAL B 57 -13.818 3.154 33.640 1.00 41.06 C ATOM 4861 C VAL B 57 -15.173 3.348 32.911 1.00 43.51 C ATOM 4862 O VAL B 57 -15.636 2.450 32.171 1.00 44.18 O ATOM 4863 CB VAL B 57 -12.633 3.037 32.612 1.00 41.90 C ATOM 4864 CG1 VAL B 57 -12.613 4.217 31.657 1.00 40.83 C ATOM 4865 CG2 VAL B 57 -11.292 2.930 33.330 1.00 39.49 C ATOM 4866 HA VAL B 57 -13.605 4.015 34.273 1.00 0.00 H ATOM 4867 HB VAL B 57 -12.795 2.127 32.035 1.00 0.00 H ATOM 4868 HG11 VAL B 57 -13.551 4.251 31.103 1.00 0.00 H ATOM 4869 HG12 VAL B 57 -12.491 5.140 32.224 1.00 0.00 H ATOM 4870 HG13 VAL B 57 -11.782 4.105 30.960 1.00 0.00 H ATOM 4871 HG21 VAL B 57 -11.137 3.819 33.942 1.00 0.00 H ATOM 4872 HG22 VAL B 57 -11.291 2.045 33.966 1.00 0.00 H ATOM 4873 HG23 VAL B 57 -10.492 2.850 32.594 1.00 0.00 H ATOM 4874 H VAL B 57 -13.774 1.032 33.969 1.00 0.00 H ATOM 4875 N PRO B 58 -15.849 4.488 33.162 1.00 42.53 N ATOM 4876 CA PRO B 58 -17.000 4.904 32.383 1.00 41.87 C ATOM 4877 C PRO B 58 -16.910 4.587 30.877 1.00 42.94 C ATOM 4878 O PRO B 58 -16.148 5.222 30.145 1.00 46.02 O ATOM 4879 CB PRO B 58 -17.034 6.421 32.630 1.00 41.65 C ATOM 4880 CG PRO B 58 -16.545 6.580 34.039 1.00 40.30 C ATOM 4881 CD PRO B 58 -15.592 5.426 34.281 1.00 46.01 C ATOM 4882 HA PRO B 58 -17.900 4.368 32.686 1.00 0.00 H ATOM 4883 HD3 PRO B 58 -14.558 5.771 34.265 1.00 0.00 H ATOM 4884 HD2 PRO B 58 -15.800 4.949 35.239 1.00 0.00 H ATOM 4885 HG3 PRO B 58 -17.380 6.535 34.738 1.00 0.00 H ATOM 4886 HG2 PRO B 58 -16.026 7.531 34.155 1.00 0.00 H ATOM 4887 HB2 PRO B 58 -16.377 6.941 31.932 1.00 0.00 H ATOM 4888 HB3 PRO B 58 -18.048 6.806 32.528 1.00 0.00 H ATOM 4889 N GLY B 59 -17.704 3.617 30.430 1.00 44.74 N ATOM 4890 CA GLY B 59 -17.843 3.321 29.004 1.00 44.81 C ATOM 4891 C GLY B 59 -16.833 2.320 28.463 1.00 46.26 C ATOM 4892 O GLY B 59 -16.747 2.080 27.238 1.00 49.79 O ATOM 4893 HA3 GLY B 59 -17.728 4.253 28.450 1.00 0.00 H ATOM 4894 HA2 GLY B 59 -18.843 2.920 28.836 1.00 0.00 H ATOM 4895 H GLY B 59 -18.243 3.051 31.116 1.00 0.00 H ATOM 4896 N SER B 60 -16.063 1.730 29.369 1.00 44.67 N ATOM 4897 CA SER B 60 -15.021 0.746 28.999 1.00 42.74 C ATOM 4898 C SER B 60 -15.539 -0.410 28.161 1.00 38.35 C ATOM 4899 O SER B 60 -16.667 -0.855 28.332 1.00 44.50 O ATOM 4900 CB SER B 60 -14.321 0.194 30.247 1.00 43.76 C ATOM 4901 OG SER B 60 -15.111 0.356 31.439 1.00 41.77 O ATOM 4902 HA SER B 60 -14.311 1.296 28.382 1.00 0.00 H ATOM 4903 HB2 SER B 60 -13.376 0.720 30.380 1.00 0.00 H ATOM 4904 HB3 SER B 60 -14.126 -0.868 30.098 1.00 0.00 H ATOM 4905 HG SER B 60 -15.287 1.319 31.588 1.00 0.00 H ATOM 4906 H SER B 60 -16.196 1.967 30.373 1.00 0.00 H ATOM 4907 N VAL B 61 -14.738 -0.869 27.221 1.00 33.59 N ATOM 4908 CA VAL B 61 -14.847 -2.245 26.803 1.00 36.83 C ATOM 4909 C VAL B 61 -13.515 -2.878 27.151 1.00 40.36 C ATOM 4910 O VAL B 61 -12.470 -2.311 26.814 1.00 41.24 O ATOM 4911 CB VAL B 61 -15.158 -2.422 25.320 1.00 37.41 C ATOM 4912 CG1 VAL B 61 -14.077 -1.768 24.464 1.00 39.34 C ATOM 4913 CG2 VAL B 61 -15.285 -3.933 25.011 1.00 30.81 C ATOM 4914 HA VAL B 61 -15.689 -2.716 27.310 1.00 0.00 H ATOM 4915 HB VAL B 61 -16.101 -1.931 25.080 1.00 0.00 H ATOM 4916 HG11 VAL B 61 -14.030 -0.703 24.691 1.00 0.00 H ATOM 4917 HG12 VAL B 61 -13.114 -2.230 24.682 1.00 0.00 H ATOM 4918 HG13 VAL B 61 -14.317 -1.905 23.410 1.00 0.00 H ATOM 4919 HG21 VAL B 61 -14.347 -4.432 25.253 1.00 0.00 H ATOM 4920 HG22 VAL B 61 -16.090 -4.359 25.610 1.00 0.00 H ATOM 4921 HG23 VAL B 61 -15.507 -4.069 23.953 1.00 0.00 H ATOM 4922 H VAL B 61 -14.032 -0.243 26.783 1.00 0.00 H ATOM 4923 N VAL B 62 -13.539 -4.018 27.847 1.00 40.68 N ATOM 4924 CA VAL B 62 -12.288 -4.624 28.323 1.00 43.04 C ATOM 4925 C VAL B 62 -11.736 -5.693 27.368 1.00 37.84 C ATOM 4926 O VAL B 62 -12.489 -6.535 26.896 1.00 33.54 O ATOM 4927 CB VAL B 62 -12.405 -5.166 29.791 1.00 44.14 C ATOM 4928 CG1 VAL B 62 -11.063 -5.779 30.236 1.00 43.55 C ATOM 4929 CG2 VAL B 62 -12.877 -4.018 30.768 1.00 43.77 C ATOM 4930 HA VAL B 62 -11.558 -3.814 28.336 1.00 0.00 H ATOM 4931 HB VAL B 62 -13.159 -5.952 29.824 1.00 0.00 H ATOM 4932 HG11 VAL B 62 -10.802 -6.601 29.570 1.00 0.00 H ATOM 4933 HG12 VAL B 62 -10.286 -5.016 30.196 1.00 0.00 H ATOM 4934 HG13 VAL B 62 -11.156 -6.152 31.256 1.00 0.00 H ATOM 4935 HG21 VAL B 62 -12.152 -3.204 30.747 1.00 0.00 H ATOM 4936 HG22 VAL B 62 -13.851 -3.648 30.448 1.00 0.00 H ATOM 4937 HG23 VAL B 62 -12.952 -4.413 31.781 1.00 0.00 H ATOM 4938 H VAL B 62 -14.448 -4.479 28.053 1.00 0.00 H ATOM 4939 N VAL B 63 -10.427 -5.648 27.091 1.00 30.15 N ATOM 4940 CA VAL B 63 -9.825 -6.622 26.208 1.00 32.81 C ATOM 4941 C VAL B 63 -8.780 -7.360 27.004 1.00 36.92 C ATOM 4942 O VAL B 63 -7.876 -6.726 27.505 1.00 39.87 O ATOM 4943 CB VAL B 63 -9.184 -5.963 24.924 1.00 38.46 C ATOM 4944 CG1 VAL B 63 -8.589 -7.023 23.961 1.00 31.27 C ATOM 4945 CG2 VAL B 63 -10.200 -5.006 24.159 1.00 35.30 C ATOM 4946 HA VAL B 63 -10.595 -7.300 25.840 1.00 0.00 H ATOM 4947 HB VAL B 63 -8.363 -5.342 25.283 1.00 0.00 H ATOM 4948 HG11 VAL B 63 -7.813 -7.587 24.478 1.00 0.00 H ATOM 4949 HG12 VAL B 63 -9.378 -7.702 23.638 1.00 0.00 H ATOM 4950 HG13 VAL B 63 -8.160 -6.523 23.093 1.00 0.00 H ATOM 4951 HG21 VAL B 63 -11.071 -5.581 23.843 1.00 0.00 H ATOM 4952 HG22 VAL B 63 -10.515 -4.204 24.827 1.00 0.00 H ATOM 4953 HG23 VAL B 63 -9.708 -4.580 23.285 1.00 0.00 H ATOM 4954 H VAL B 63 -9.837 -4.904 27.516 1.00 0.00 H ATOM 4955 N VAL B 64 -8.938 -8.684 27.166 1.00 37.80 N ATOM 4956 CA VAL B 64 -7.913 -9.507 27.779 1.00 34.11 C ATOM 4957 C VAL B 64 -7.231 -10.346 26.724 1.00 35.43 C ATOM 4958 O VAL B 64 -7.866 -11.125 26.022 1.00 36.82 O ATOM 4959 CB VAL B 64 -8.431 -10.450 28.879 1.00 37.19 C ATOM 4960 CG1 VAL B 64 -7.279 -11.335 29.391 1.00 31.43 C ATOM 4961 CG2 VAL B 64 -9.069 -9.667 30.013 1.00 30.27 C ATOM 4962 HA VAL B 64 -7.224 -8.807 28.252 1.00 0.00 H ATOM 4963 HB VAL B 64 -9.203 -11.093 28.456 1.00 0.00 H ATOM 4964 HG11 VAL B 64 -6.882 -11.926 28.566 1.00 0.00 H ATOM 4965 HG12 VAL B 64 -6.490 -10.703 29.799 1.00 0.00 H ATOM 4966 HG13 VAL B 64 -7.652 -12.000 30.170 1.00 0.00 H ATOM 4967 HG21 VAL B 64 -8.331 -8.994 30.449 1.00 0.00 H ATOM 4968 HG22 VAL B 64 -9.907 -9.087 29.626 1.00 0.00 H ATOM 4969 HG23 VAL B 64 -9.426 -10.360 30.775 1.00 0.00 H ATOM 4970 H VAL B 64 -9.820 -9.131 26.843 1.00 0.00 H ATOM 4971 N SER B 65 -5.939 -10.150 26.591 1.00 24.69 N ATOM 4972 CA SER B 65 -5.207 -10.981 25.700 1.00 29.26 C ATOM 4973 C SER B 65 -4.689 -12.164 26.528 1.00 30.52 C ATOM 4974 O SER B 65 -4.483 -12.067 27.736 1.00 33.07 O ATOM 4975 CB SER B 65 -4.061 -10.198 25.064 1.00 26.41 C ATOM 4976 OG SER B 65 -3.145 -9.731 26.050 1.00 20.16 O ATOM 4977 HA SER B 65 -5.833 -11.337 24.882 1.00 0.00 H ATOM 4978 HB2 SER B 65 -4.470 -9.343 24.525 1.00 0.00 H ATOM 4979 HB3 SER B 65 -3.532 -10.846 24.366 1.00 0.00 H ATOM 4980 HG SER B 65 -2.766 -10.504 26.539 1.00 0.00 H ATOM 4981 H SER B 65 -5.460 -9.400 27.128 1.00 0.00 H ATOM 4982 N ILE B 66 -4.495 -13.283 25.862 1.00 26.88 N ATOM 4983 CA ILE B 66 -3.970 -14.467 26.489 1.00 32.01 C ATOM 4984 C ILE B 66 -3.027 -14.945 25.440 1.00 31.59 C ATOM 4985 O ILE B 66 -3.449 -15.220 24.313 1.00 31.00 O ATOM 4986 CB ILE B 66 -5.052 -15.572 26.765 1.00 32.24 C ATOM 4987 CG1 ILE B 66 -5.839 -15.272 28.029 1.00 36.63 C ATOM 4988 CG2 ILE B 66 -4.426 -16.938 27.040 1.00 31.85 C ATOM 4989 CD1 ILE B 66 -7.239 -14.852 27.768 1.00 41.52 C ATOM 4990 HA ILE B 66 -3.542 -14.262 27.470 1.00 0.00 H ATOM 4991 HB ILE B 66 -5.673 -15.579 25.869 1.00 0.00 H ATOM 4992 HG12 ILE B 66 -5.857 -16.170 28.646 1.00 0.00 H ATOM 4993 HG13 ILE B 66 -5.333 -14.472 28.569 1.00 0.00 H ATOM 4994 HD11 ILE B 66 -7.238 -13.947 27.160 1.00 0.00 H ATOM 4995 HD12 ILE B 66 -7.763 -15.647 27.237 1.00 0.00 H ATOM 4996 HD13 ILE B 66 -7.740 -14.654 28.715 1.00 0.00 H ATOM 4997 HG21 ILE B 66 -3.838 -17.248 26.176 1.00 0.00 H ATOM 4998 HG22 ILE B 66 -3.780 -16.871 27.915 1.00 0.00 H ATOM 4999 HG23 ILE B 66 -5.215 -17.667 27.225 1.00 0.00 H ATOM 5000 H ILE B 66 -4.729 -13.312 24.849 1.00 0.00 H ATOM 5001 N PHE B 67 -1.752 -15.024 25.786 1.00 29.24 N ATOM 5002 CA PHE B 67 -0.764 -15.480 24.833 1.00 36.06 C ATOM 5003 C PHE B 67 0.466 -15.676 25.650 1.00 42.73 C ATOM 5004 O PHE B 67 0.683 -14.943 26.643 1.00 45.91 O ATOM 5005 CB PHE B 67 -0.500 -14.399 23.773 1.00 38.85 C ATOM 5006 CG PHE B 67 0.665 -14.679 22.900 1.00 39.59 C ATOM 5007 CD1 PHE B 67 0.596 -15.655 21.911 1.00 43.02 C ATOM 5008 CD2 PHE B 67 1.841 -13.964 23.049 1.00 45.94 C ATOM 5009 CE1 PHE B 67 1.697 -15.920 21.061 1.00 43.75 C ATOM 5010 CE2 PHE B 67 2.959 -14.215 22.212 1.00 49.28 C ATOM 5011 CZ PHE B 67 2.881 -15.190 21.210 1.00 44.97 C ATOM 5012 HA PHE B 67 -1.083 -16.380 24.308 1.00 0.00 H ATOM 5013 HB2 PHE B 67 -1.386 -14.312 23.144 1.00 0.00 H ATOM 5014 HB3 PHE B 67 -0.325 -13.453 24.285 1.00 0.00 H ATOM 5015 HD2 PHE B 67 1.909 -13.197 23.821 1.00 0.00 H ATOM 5016 HE2 PHE B 67 3.880 -13.648 22.349 1.00 0.00 H ATOM 5017 HZ PHE B 67 3.732 -15.378 20.555 1.00 0.00 H ATOM 5018 HE1 PHE B 67 1.622 -16.690 20.293 1.00 0.00 H ATOM 5019 HD1 PHE B 67 -0.324 -16.227 21.788 1.00 0.00 H ATOM 5020 H PHE B 67 -1.459 -14.757 26.748 1.00 0.00 H ATOM 5021 N VAL B 68 1.248 -16.676 25.243 1.00 46.31 N ATOM 5022 CA VAL B 68 2.442 -17.081 25.951 1.00 44.17 C ATOM 5023 C VAL B 68 3.660 -16.744 25.111 1.00 51.98 C ATOM 5024 O VAL B 68 3.824 -17.244 23.988 1.00 53.58 O ATOM 5025 CB VAL B 68 2.428 -18.559 26.264 1.00 44.57 C ATOM 5026 CG1 VAL B 68 3.797 -18.985 26.908 1.00 41.00 C ATOM 5027 CG2 VAL B 68 1.175 -18.910 27.144 1.00 39.04 C ATOM 5028 HA VAL B 68 2.479 -16.542 26.898 1.00 0.00 H ATOM 5029 HB VAL B 68 2.329 -19.140 25.347 1.00 0.00 H ATOM 5030 HG11 VAL B 68 4.607 -18.773 26.210 1.00 0.00 H ATOM 5031 HG12 VAL B 68 3.954 -18.424 27.829 1.00 0.00 H ATOM 5032 HG13 VAL B 68 3.776 -20.052 27.130 1.00 0.00 H ATOM 5033 HG21 VAL B 68 1.217 -18.346 28.076 1.00 0.00 H ATOM 5034 HG22 VAL B 68 0.267 -18.649 26.601 1.00 0.00 H ATOM 5035 HG23 VAL B 68 1.175 -19.978 27.364 1.00 0.00 H ATOM 5036 H VAL B 68 0.987 -17.188 24.376 1.00 0.00 H ATOM 5037 N ASN B 69 4.545 -15.955 25.730 1.00 58.37 N ATOM 5038 CA ASN B 69 5.562 -15.094 25.076 1.00 67.26 C ATOM 5039 C ASN B 69 6.929 -15.563 24.553 1.00 66.42 C ATOM 5040 O ASN B 69 7.826 -14.692 24.539 1.00 64.32 O ATOM 5041 CB ASN B 69 5.930 -13.926 26.042 1.00 62.66 C ATOM 5042 CG ASN B 69 4.775 -12.962 26.316 1.00 63.92 C ATOM 5043 OD1 ASN B 69 3.600 -13.186 25.884 1.00 64.71 O ATOM 5044 ND2 ASN B 69 5.089 -11.867 27.064 1.00 60.35 N ATOM 5045 HA ASN B 69 5.000 -14.920 24.158 1.00 0.00 H ATOM 5046 HB2 ASN B 69 6.253 -14.354 26.991 1.00 0.00 H ATOM 5047 HB3 ASN B 69 6.752 -13.361 25.601 1.00 0.00 H ATOM 5048 HD22 ASN B 69 6.065 -11.726 27.395 1.00 0.00 H ATOM 5049 HD21 ASN B 69 4.353 -11.172 27.304 1.00 0.00 H ATOM 5050 H ASN B 69 4.518 -15.944 26.770 1.00 0.00 H ATOM 5051 N PRO B 70 7.102 -16.789 23.981 1.00 78.67 N ATOM 5052 CA PRO B 70 8.468 -17.398 23.817 1.00 85.67 C ATOM 5053 C PRO B 70 9.766 -16.699 24.400 1.00 92.57 C ATOM 5054 O PRO B 70 10.269 -17.185 25.429 1.00 95.67 O ATOM 5055 CB PRO B 70 8.536 -17.671 22.282 1.00 84.55 C ATOM 5056 CG PRO B 70 6.945 -17.713 21.849 1.00 82.50 C ATOM 5057 CD PRO B 70 6.153 -17.581 23.179 1.00 79.82 C ATOM 5058 HA PRO B 70 8.527 -18.266 24.473 1.00 0.00 H ATOM 5059 HD3 PRO B 70 5.210 -17.054 23.035 1.00 0.00 H ATOM 5060 HD2 PRO B 70 5.959 -18.554 23.630 1.00 0.00 H ATOM 5061 HG3 PRO B 70 6.708 -18.656 21.356 1.00 0.00 H ATOM 5062 HG2 PRO B 70 6.709 -16.885 21.180 1.00 0.00 H ATOM 5063 HB2 PRO B 70 9.064 -16.871 21.763 1.00 0.00 H ATOM 5064 HB3 PRO B 70 9.026 -18.622 22.073 1.00 0.00 H ATOM 5065 N MET B 71 10.286 -15.609 23.781 1.00 98.98 N ATOM 5066 CA MET B 71 11.600 -14.927 24.171 1.00 99.82 C ATOM 5067 C MET B 71 11.659 -14.093 25.507 1.00103.15 C ATOM 5068 O MET B 71 12.534 -13.204 25.671 1.00101.13 O ATOM 5069 CB MET B 71 12.198 -14.110 22.995 1.00 98.42 C ATOM 5070 HA MET B 71 12.218 -15.793 24.405 1.00 0.00 H ATOM 5071 HB2 MET B 71 12.394 -14.776 22.154 1.00 0.00 H ATOM 5072 HB3 MET B 71 11.489 -13.339 22.692 1.00 0.00 H ATOM 5073 H MET B 71 9.753 -15.208 22.983 1.00 0.00 H ATOM 5074 N GLN B 72 10.731 -14.408 26.430 1.00103.10 N ATOM 5075 CA GLN B 72 10.676 -13.891 27.812 1.00 99.41 C ATOM 5076 C GLN B 72 11.067 -14.997 28.823 1.00 97.87 C ATOM 5077 O GLN B 72 12.177 -15.014 29.369 1.00 93.09 O ATOM 5078 CB GLN B 72 9.262 -13.358 28.114 1.00 95.90 C ATOM 5079 CG GLN B 72 8.242 -14.418 28.527 1.00 94.80 C ATOM 5080 CD GLN B 72 8.048 -14.502 30.038 1.00 96.12 C ATOM 5081 OE1 GLN B 72 7.503 -13.592 30.657 1.00 95.11 O ATOM 5082 NE2 GLN B 72 8.486 -15.604 30.633 1.00 97.18 N ATOM 5083 HA GLN B 72 11.390 -13.074 27.911 1.00 0.00 H ATOM 5084 HB2 GLN B 72 9.341 -12.632 28.923 1.00 0.00 H ATOM 5085 HB3 GLN B 72 8.890 -12.862 27.218 1.00 0.00 H ATOM 5086 HG2 GLN B 72 7.284 -14.177 28.066 1.00 0.00 H ATOM 5087 HG3 GLN B 72 8.583 -15.388 28.166 1.00 0.00 H ATOM 5088 HE22 GLN B 72 8.942 -16.352 30.072 1.00 0.00 H ATOM 5089 HE21 GLN B 72 8.373 -15.720 31.660 1.00 0.00 H ATOM 5090 H GLN B 72 9.986 -15.075 26.144 1.00 0.00 H TER 5091 GLN B 72 ATOM 5092 N PRO B 86 -7.863 -23.162 30.415 1.00 86.02 N ATOM 5093 CA PRO B 86 -8.064 -22.634 29.057 1.00 85.39 C ATOM 5094 C PRO B 86 -9.461 -22.046 28.812 1.00 84.61 C ATOM 5095 O PRO B 86 -9.549 -20.860 28.509 1.00 83.34 O ATOM 5096 CB PRO B 86 -7.744 -23.835 28.156 1.00 85.93 C ATOM 5097 CG PRO B 86 -6.608 -24.551 28.944 1.00 86.92 C ATOM 5098 CD PRO B 86 -6.771 -24.164 30.443 1.00 88.35 C ATOM 5099 HA PRO B 86 -7.424 -21.775 28.857 1.00 0.00 H ATOM 5100 HD3 PRO B 86 -7.050 -25.030 31.043 1.00 0.00 H ATOM 5101 HD2 PRO B 86 -5.852 -23.731 30.838 1.00 0.00 H ATOM 5102 HG3 PRO B 86 -5.635 -24.223 28.577 1.00 0.00 H ATOM 5103 HG2 PRO B 86 -6.695 -25.631 28.826 1.00 0.00 H ATOM 5104 HB2 PRO B 86 -8.612 -24.483 28.039 1.00 0.00 H ATOM 5105 HB3 PRO B 86 -7.399 -23.511 27.174 1.00 0.00 H ATOM 5106 N ASP B 87 -10.537 -22.832 28.954 1.00 84.14 N ATOM 5107 CA ASP B 87 -11.922 -22.255 28.994 1.00 83.37 C ATOM 5108 C ASP B 87 -12.303 -22.018 30.443 1.00 78.71 C ATOM 5109 O ASP B 87 -13.259 -21.286 30.760 1.00 76.28 O ATOM 5110 CB ASP B 87 -12.986 -23.148 28.348 1.00 88.93 C ATOM 5111 CG ASP B 87 -12.392 -24.273 27.523 1.00 95.58 C ATOM 5112 OD1 ASP B 87 -11.351 -24.058 26.835 1.00100.25 O ATOM 5113 OD2 ASP B 87 -12.977 -25.381 27.574 1.00 94.26 O ATOM 5114 HA ASP B 87 -11.896 -21.331 28.416 1.00 0.00 H ATOM 5115 HB2 ASP B 87 -13.601 -23.582 29.136 1.00 0.00 H ATOM 5116 HB3 ASP B 87 -13.610 -22.533 27.699 1.00 0.00 H ATOM 5117 H ASP B 87 -10.410 -23.861 29.038 1.00 0.00 H ATOM 5118 N ASP B 88 -11.566 -22.725 31.295 1.00 71.55 N ATOM 5119 CA ASP B 88 -11.267 -22.326 32.644 1.00 67.63 C ATOM 5120 C ASP B 88 -11.062 -20.786 32.714 1.00 67.17 C ATOM 5121 O ASP B 88 -11.803 -20.030 33.404 1.00 63.94 O ATOM 5122 CB ASP B 88 -9.979 -23.042 33.008 1.00 67.15 C ATOM 5123 CG ASP B 88 -9.719 -23.062 34.483 1.00 72.30 C ATOM 5124 OD1 ASP B 88 -10.591 -22.640 35.279 1.00 71.30 O ATOM 5125 OD2 ASP B 88 -8.619 -23.517 34.851 1.00 78.60 O ATOM 5126 HA ASP B 88 -12.077 -22.579 33.329 1.00 0.00 H ATOM 5127 HB2 ASP B 88 -10.040 -24.070 32.651 1.00 0.00 H ATOM 5128 HB3 ASP B 88 -9.149 -22.536 32.515 1.00 0.00 H ATOM 5129 H ASP B 88 -11.178 -23.631 30.962 1.00 0.00 H ATOM 5130 N ASP B 89 -10.057 -20.344 31.956 1.00 63.31 N ATOM 5131 CA ASP B 89 -9.639 -18.958 31.903 1.00 57.23 C ATOM 5132 C ASP B 89 -10.759 -18.056 31.359 1.00 57.92 C ATOM 5133 O ASP B 89 -11.143 -17.061 31.988 1.00 61.66 O ATOM 5134 CB ASP B 89 -8.367 -18.846 31.047 1.00 54.94 C ATOM 5135 CG ASP B 89 -7.093 -19.182 31.813 1.00 47.43 C ATOM 5136 OD1 ASP B 89 -7.060 -19.009 33.053 1.00 43.46 O ATOM 5137 OD2 ASP B 89 -6.113 -19.592 31.155 1.00 44.85 O ATOM 5138 HA ASP B 89 -9.420 -18.614 32.914 1.00 0.00 H ATOM 5139 HB2 ASP B 89 -8.455 -19.532 30.204 1.00 0.00 H ATOM 5140 HB3 ASP B 89 -8.288 -17.824 30.676 1.00 0.00 H ATOM 5141 H ASP B 89 -9.545 -21.034 31.370 1.00 0.00 H ATOM 5142 N LEU B 90 -11.295 -18.417 30.203 1.00 53.06 N ATOM 5143 CA LEU B 90 -12.356 -17.636 29.582 1.00 53.07 C ATOM 5144 C LEU B 90 -13.608 -17.590 30.424 1.00 52.99 C ATOM 5145 O LEU B 90 -14.364 -16.626 30.338 1.00 55.22 O ATOM 5146 CB LEU B 90 -12.719 -18.224 28.230 1.00 54.45 C ATOM 5147 CG LEU B 90 -11.525 -18.664 27.382 1.00 58.91 C ATOM 5148 CD1 LEU B 90 -11.996 -19.353 26.100 1.00 61.55 C ATOM 5149 CD2 LEU B 90 -10.607 -17.490 27.067 1.00 55.94 C ATOM 5150 HA LEU B 90 -11.970 -16.622 29.476 1.00 0.00 H ATOM 5151 HB2 LEU B 90 -13.355 -19.093 28.397 1.00 0.00 H ATOM 5152 HB3 LEU B 90 -13.274 -17.471 27.670 1.00 0.00 H ATOM 5153 HG LEU B 90 -10.949 -19.384 27.963 1.00 0.00 H ATOM 5154 HD21 LEU B 90 -11.164 -16.732 26.516 1.00 0.00 H ATOM 5155 HD22 LEU B 90 -10.233 -17.063 27.998 1.00 0.00 H ATOM 5156 HD23 LEU B 90 -9.769 -17.838 26.463 1.00 0.00 H ATOM 5157 HD11 LEU B 90 -12.588 -20.231 26.357 1.00 0.00 H ATOM 5158 HD12 LEU B 90 -12.605 -18.660 25.519 1.00 0.00 H ATOM 5159 HD13 LEU B 90 -11.129 -19.657 25.513 1.00 0.00 H ATOM 5160 H LEU B 90 -10.951 -19.276 29.729 1.00 0.00 H ATOM 5161 N ALA B 91 -13.838 -18.642 31.209 1.00 50.06 N ATOM 5162 CA ALA B 91 -15.014 -18.704 32.036 1.00 49.70 C ATOM 5163 C ALA B 91 -14.842 -17.713 33.133 1.00 51.78 C ATOM 5164 O ALA B 91 -15.810 -17.021 33.502 1.00 56.30 O ATOM 5165 CB ALA B 91 -15.199 -20.068 32.599 1.00 54.87 C ATOM 5166 HA ALA B 91 -15.900 -18.476 31.443 1.00 0.00 H ATOM 5167 HB1 ALA B 91 -15.306 -20.784 31.785 1.00 0.00 H ATOM 5168 HB2 ALA B 91 -14.331 -20.331 33.204 1.00 0.00 H ATOM 5169 HB3 ALA B 91 -16.095 -20.085 33.219 1.00 0.00 H ATOM 5170 H ALA B 91 -13.158 -19.429 31.224 1.00 0.00 H ATOM 5171 N GLN B 92 -13.627 -17.616 33.665 1.00 48.61 N ATOM 5172 CA GLN B 92 -13.343 -16.505 34.596 1.00 52.65 C ATOM 5173 C GLN B 92 -13.661 -15.100 34.013 1.00 52.53 C ATOM 5174 O GLN B 92 -14.229 -14.203 34.697 1.00 49.02 O ATOM 5175 CB GLN B 92 -11.897 -16.543 35.031 1.00 49.36 C ATOM 5176 CG GLN B 92 -11.546 -17.755 35.844 1.00 52.23 C ATOM 5177 CD GLN B 92 -10.380 -17.464 36.742 1.00 49.30 C ATOM 5178 OE1 GLN B 92 -10.410 -16.518 37.541 1.00 56.71 O ATOM 5179 NE2 GLN B 92 -9.312 -18.229 36.580 1.00 44.16 N ATOM 5180 HA GLN B 92 -14.008 -16.655 35.447 1.00 0.00 H ATOM 5181 HB2 GLN B 92 -11.268 -16.531 34.141 1.00 0.00 H ATOM 5182 HB3 GLN B 92 -11.693 -15.655 35.630 1.00 0.00 H ATOM 5183 HG2 GLN B 92 -12.405 -18.041 36.451 1.00 0.00 H ATOM 5184 HG3 GLN B 92 -11.287 -18.575 35.174 1.00 0.00 H ATOM 5185 HE22 GLN B 92 -9.333 -19.013 35.897 1.00 0.00 H ATOM 5186 HE21 GLN B 92 -8.452 -18.046 37.136 1.00 0.00 H ATOM 5187 H GLN B 92 -12.890 -18.310 33.430 1.00 0.00 H ATOM 5188 N LEU B 93 -13.290 -14.929 32.739 1.00 50.88 N ATOM 5189 CA LEU B 93 -13.500 -13.678 32.010 1.00 48.55 C ATOM 5190 C LEU B 93 -14.973 -13.373 31.805 1.00 46.72 C ATOM 5191 O LEU B 93 -15.387 -12.228 31.967 1.00 46.12 O ATOM 5192 CB LEU B 93 -12.747 -13.721 30.673 1.00 48.50 C ATOM 5193 CG LEU B 93 -11.242 -13.937 30.868 1.00 47.34 C ATOM 5194 CD1 LEU B 93 -10.556 -14.112 29.549 1.00 46.39 C ATOM 5195 CD2 LEU B 93 -10.575 -12.832 31.697 1.00 42.92 C ATOM 5196 HA LEU B 93 -13.099 -12.865 32.615 1.00 0.00 H ATOM 5197 HB2 LEU B 93 -13.145 -14.538 30.071 1.00 0.00 H ATOM 5198 HB3 LEU B 93 -12.903 -12.777 30.151 1.00 0.00 H ATOM 5199 HG LEU B 93 -11.133 -14.855 31.445 1.00 0.00 H ATOM 5200 HD21 LEU B 93 -10.708 -11.873 31.196 1.00 0.00 H ATOM 5201 HD22 LEU B 93 -11.033 -12.794 32.685 1.00 0.00 H ATOM 5202 HD23 LEU B 93 -9.511 -13.046 31.797 1.00 0.00 H ATOM 5203 HD11 LEU B 93 -10.973 -14.979 29.036 1.00 0.00 H ATOM 5204 HD12 LEU B 93 -10.708 -13.220 28.941 1.00 0.00 H ATOM 5205 HD13 LEU B 93 -9.489 -14.264 29.713 1.00 0.00 H ATOM 5206 H LEU B 93 -12.832 -15.721 32.245 1.00 0.00 H ATOM 5207 N ARG B 94 -15.749 -14.408 31.461 1.00 48.87 N ATOM 5208 CA ARG B 94 -17.203 -14.313 31.297 1.00 50.50 C ATOM 5209 C ARG B 94 -17.776 -13.883 32.620 1.00 50.28 C ATOM 5210 O ARG B 94 -18.313 -12.774 32.745 1.00 48.92 O ATOM 5211 CB ARG B 94 -17.791 -15.647 30.861 1.00 54.91 C ATOM 5212 CG ARG B 94 -18.947 -15.477 29.888 1.00 61.96 C ATOM 5213 CD ARG B 94 -19.446 -16.811 29.328 1.00 61.72 C ATOM 5214 NE ARG B 94 -18.777 -17.227 28.091 1.00 61.34 N ATOM 5215 CZ ARG B 94 -17.833 -18.169 28.001 1.00 56.64 C ATOM 5216 NH1 ARG B 94 -17.412 -18.798 29.101 1.00 52.86 N ATOM 5217 NH2 ARG B 94 -17.307 -18.470 26.802 1.00 47.68 N ATOM 5218 HA ARG B 94 -17.450 -13.590 30.520 1.00 0.00 H ATOM 5219 HB2 ARG B 94 -17.010 -16.234 30.378 1.00 0.00 H ATOM 5220 HB3 ARG B 94 -18.150 -16.177 31.743 1.00 0.00 H ATOM 5221 HG2 ARG B 94 -19.770 -14.986 30.406 1.00 0.00 H ATOM 5222 HG3 ARG B 94 -18.617 -14.852 29.059 1.00 0.00 H ATOM 5223 HD2 ARG B 94 -20.513 -16.721 29.127 1.00 0.00 H ATOM 5224 HD3 ARG B 94 -19.283 -17.582 30.082 1.00 0.00 H ATOM 5225 HE ARG B 94 -19.060 -16.750 27.211 1.00 0.00 H ATOM 5226 HH12 ARG B 94 -16.678 -19.531 29.032 1.00 0.00 H ATOM 5227 HH11 ARG B 94 -17.819 -18.555 30.027 1.00 0.00 H ATOM 5228 HH22 ARG B 94 -16.572 -19.202 26.725 1.00 0.00 H ATOM 5229 HH21 ARG B 94 -17.635 -17.971 25.950 1.00 0.00 H ATOM 5230 H ARG B 94 -15.296 -15.330 31.301 1.00 0.00 H ATOM 5231 N ALA B 95 -17.581 -14.726 33.630 1.00 50.45 N ATOM 5232 CA ALA B 95 -17.903 -14.370 35.015 1.00 50.91 C ATOM 5233 C ALA B 95 -17.543 -12.894 35.386 1.00 54.19 C ATOM 5234 O ALA B 95 -18.329 -12.203 36.070 1.00 53.33 O ATOM 5235 CB ALA B 95 -17.278 -15.405 36.008 1.00 45.45 C ATOM 5236 HA ALA B 95 -18.988 -14.420 35.108 1.00 0.00 H ATOM 5237 HB1 ALA B 95 -17.677 -16.397 35.795 1.00 0.00 H ATOM 5238 HB2 ALA B 95 -16.195 -15.414 35.887 1.00 0.00 H ATOM 5239 HB3 ALA B 95 -17.529 -15.123 37.031 1.00 0.00 H ATOM 5240 H ALA B 95 -17.187 -15.668 33.431 1.00 0.00 H ATOM 5241 N GLU B 96 -16.392 -12.385 34.915 1.00 53.28 N ATOM 5242 CA GLU B 96 -16.015 -10.982 35.220 1.00 43.00 C ATOM 5243 C GLU B 96 -16.688 -9.926 34.310 1.00 45.11 C ATOM 5244 O GLU B 96 -16.483 -8.705 34.490 1.00 43.64 O ATOM 5245 CB GLU B 96 -14.492 -10.826 35.230 1.00 42.53 C ATOM 5246 CG GLU B 96 -13.803 -11.382 36.439 1.00 42.94 C ATOM 5247 CD GLU B 96 -14.319 -10.793 37.760 1.00 46.69 C ATOM 5248 OE1 GLU B 96 -14.661 -9.585 37.860 1.00 46.77 O ATOM 5249 OE2 GLU B 96 -14.375 -11.563 38.727 1.00 55.06 O ATOM 5250 HA GLU B 96 -16.403 -10.778 36.218 1.00 0.00 H ATOM 5251 HB2 GLU B 96 -14.095 -11.334 34.351 1.00 0.00 H ATOM 5252 HB3 GLU B 96 -14.261 -9.763 35.169 1.00 0.00 H ATOM 5253 HG2 GLU B 96 -13.956 -12.461 36.458 1.00 0.00 H ATOM 5254 HG3 GLU B 96 -12.737 -11.169 36.358 1.00 0.00 H ATOM 5255 H GLU B 96 -15.763 -12.976 34.335 1.00 0.00 H ATOM 5256 N GLY B 97 -17.495 -10.384 33.346 1.00 45.83 N ATOM 5257 CA GLY B 97 -18.171 -9.469 32.388 1.00 47.03 C ATOM 5258 C GLY B 97 -17.290 -8.773 31.351 1.00 42.54 C ATOM 5259 O GLY B 97 -17.527 -7.632 30.995 1.00 45.29 O ATOM 5260 HA3 GLY B 97 -18.669 -8.693 32.970 1.00 0.00 H ATOM 5261 HA2 GLY B 97 -18.917 -10.052 31.848 1.00 0.00 H ATOM 5262 H GLY B 97 -17.654 -11.409 33.264 1.00 0.00 H ATOM 5263 N VAL B 98 -16.261 -9.477 30.892 1.00 39.95 N ATOM 5264 CA VAL B 98 -15.251 -8.970 29.998 1.00 35.58 C ATOM 5265 C VAL B 98 -15.855 -9.315 28.672 1.00 37.76 C ATOM 5266 O VAL B 98 -16.344 -10.435 28.546 1.00 33.60 O ATOM 5267 CB VAL B 98 -13.906 -9.776 30.192 1.00 31.18 C ATOM 5268 CG1 VAL B 98 -13.043 -9.848 28.912 1.00 28.12 C ATOM 5269 CG2 VAL B 98 -13.105 -9.239 31.368 1.00 35.03 C ATOM 5270 HA VAL B 98 -15.007 -7.917 30.135 1.00 0.00 H ATOM 5271 HB VAL B 98 -14.200 -10.802 30.415 1.00 0.00 H ATOM 5272 HG11 VAL B 98 -13.609 -10.340 28.121 1.00 0.00 H ATOM 5273 HG12 VAL B 98 -12.778 -8.839 28.597 1.00 0.00 H ATOM 5274 HG13 VAL B 98 -12.136 -10.416 29.119 1.00 0.00 H ATOM 5275 HG21 VAL B 98 -12.860 -8.192 31.191 1.00 0.00 H ATOM 5276 HG22 VAL B 98 -13.697 -9.326 32.279 1.00 0.00 H ATOM 5277 HG23 VAL B 98 -12.186 -9.816 31.474 1.00 0.00 H ATOM 5278 H VAL B 98 -16.178 -10.467 31.201 1.00 0.00 H ATOM 5279 N GLU B 99 -15.810 -8.395 27.690 1.00 39.23 N ATOM 5280 CA GLU B 99 -16.440 -8.664 26.373 1.00 39.93 C ATOM 5281 C GLU B 99 -15.503 -9.120 25.252 1.00 40.17 C ATOM 5282 O GLU B 99 -15.942 -9.756 24.276 1.00 40.61 O ATOM 5283 CB GLU B 99 -17.324 -7.517 25.904 1.00 42.95 C ATOM 5284 CG GLU B 99 -18.493 -7.117 26.813 1.00 36.61 C ATOM 5285 CD GLU B 99 -18.864 -5.662 26.556 1.00 41.33 C ATOM 5286 OE1 GLU B 99 -19.599 -5.397 25.594 1.00 48.23 O ATOM 5287 OE2 GLU B 99 -18.402 -4.763 27.276 1.00 42.70 O ATOM 5288 HA GLU B 99 -17.063 -9.534 26.582 1.00 0.00 H ATOM 5289 HB2 GLU B 99 -16.688 -6.640 25.783 1.00 0.00 H ATOM 5290 HB3 GLU B 99 -17.741 -7.798 24.937 1.00 0.00 H ATOM 5291 HG2 GLU B 99 -19.352 -7.754 26.601 1.00 0.00 H ATOM 5292 HG3 GLU B 99 -18.200 -7.239 27.856 1.00 0.00 H ATOM 5293 H GLU B 99 -15.330 -7.488 27.856 1.00 0.00 H ATOM 5294 N ILE B 100 -14.217 -8.793 25.381 1.00 38.61 N ATOM 5295 CA ILE B 100 -13.231 -9.287 24.419 1.00 39.34 C ATOM 5296 C ILE B 100 -12.004 -9.974 24.985 1.00 46.28 C ATOM 5297 O ILE B 100 -11.206 -9.328 25.718 1.00 50.05 O ATOM 5298 CB ILE B 100 -12.673 -8.199 23.529 1.00 39.40 C ATOM 5299 CG1 ILE B 100 -13.790 -7.228 23.042 1.00 40.67 C ATOM 5300 CG2 ILE B 100 -11.923 -8.888 22.396 1.00 21.97 C ATOM 5301 CD1 ILE B 100 -13.283 -6.103 22.083 1.00 36.72 C ATOM 5302 HA ILE B 100 -13.840 -10.016 23.885 1.00 0.00 H ATOM 5303 HB ILE B 100 -11.980 -7.559 24.075 1.00 0.00 H ATOM 5304 HG12 ILE B 100 -14.546 -7.811 22.516 1.00 0.00 H ATOM 5305 HG13 ILE B 100 -14.239 -6.757 23.916 1.00 0.00 H ATOM 5306 HD11 ILE B 100 -12.534 -5.500 22.596 1.00 0.00 H ATOM 5307 HD12 ILE B 100 -12.841 -6.556 21.196 1.00 0.00 H ATOM 5308 HD13 ILE B 100 -14.122 -5.471 21.791 1.00 0.00 H ATOM 5309 HG21 ILE B 100 -11.119 -9.496 22.811 1.00 0.00 H ATOM 5310 HG22 ILE B 100 -12.612 -9.524 21.840 1.00 0.00 H ATOM 5311 HG23 ILE B 100 -11.504 -8.135 21.729 1.00 0.00 H ATOM 5312 H ILE B 100 -13.913 -8.185 26.168 1.00 0.00 H ATOM 5313 N ALA B 101 -11.844 -11.251 24.593 1.00 41.68 N ATOM 5314 CA ALA B 101 -10.623 -12.022 24.780 1.00 39.65 C ATOM 5315 C ALA B 101 -9.894 -12.138 23.479 1.00 44.32 C ATOM 5316 O ALA B 101 -10.524 -12.283 22.423 1.00 49.42 O ATOM 5317 CB ALA B 101 -10.927 -13.357 25.243 1.00 39.20 C ATOM 5318 HA ALA B 101 -10.010 -11.507 25.520 1.00 0.00 H ATOM 5319 HB1 ALA B 101 -11.456 -13.299 26.194 1.00 0.00 H ATOM 5320 HB2 ALA B 101 -11.553 -13.861 24.507 1.00 0.00 H ATOM 5321 HB3 ALA B 101 -10.000 -13.914 25.376 1.00 0.00 H ATOM 5322 H ALA B 101 -12.646 -11.719 24.125 1.00 0.00 H ATOM 5323 N PHE B 102 -8.564 -12.127 23.561 1.00 45.60 N ATOM 5324 CA PHE B 102 -7.722 -12.209 22.384 1.00 42.72 C ATOM 5325 C PHE B 102 -6.653 -13.287 22.515 1.00 43.01 C ATOM 5326 O PHE B 102 -5.763 -13.194 23.343 1.00 43.51 O ATOM 5327 CB PHE B 102 -7.101 -10.853 22.079 1.00 37.83 C ATOM 5328 CG PHE B 102 -6.110 -10.889 20.938 1.00 44.52 C ATOM 5329 CD1 PHE B 102 -6.338 -11.705 19.815 1.00 44.72 C ATOM 5330 CD2 PHE B 102 -4.962 -10.094 20.961 1.00 41.46 C ATOM 5331 CE1 PHE B 102 -5.417 -11.755 18.769 1.00 42.29 C ATOM 5332 CE2 PHE B 102 -4.039 -10.129 19.895 1.00 39.75 C ATOM 5333 CZ PHE B 102 -4.268 -10.960 18.803 1.00 39.92 C ATOM 5334 HA PHE B 102 -8.357 -12.497 21.546 1.00 0.00 H ATOM 5335 HB2 PHE B 102 -7.899 -10.157 21.822 1.00 0.00 H ATOM 5336 HB3 PHE B 102 -6.587 -10.499 22.973 1.00 0.00 H ATOM 5337 HD2 PHE B 102 -4.777 -9.439 21.812 1.00 0.00 H ATOM 5338 HE2 PHE B 102 -3.146 -9.505 19.927 1.00 0.00 H ATOM 5339 HZ PHE B 102 -3.555 -10.991 17.979 1.00 0.00 H ATOM 5340 HE1 PHE B 102 -5.594 -12.417 17.921 1.00 0.00 H ATOM 5341 HD1 PHE B 102 -7.246 -12.306 19.762 1.00 0.00 H ATOM 5342 H PHE B 102 -8.117 -12.058 24.497 1.00 0.00 H ATOM 5343 N THR B 103 -6.725 -14.298 21.661 1.00 43.74 N ATOM 5344 CA THR B 103 -6.021 -15.551 21.930 1.00 45.19 C ATOM 5345 C THR B 103 -5.265 -16.097 20.718 1.00 48.70 C ATOM 5346 O THR B 103 -5.478 -17.231 20.296 1.00 54.83 O ATOM 5347 CB THR B 103 -7.012 -16.614 22.386 1.00 41.92 C ATOM 5348 OG1 THR B 103 -8.027 -16.724 21.393 1.00 37.60 O ATOM 5349 CG2 THR B 103 -7.681 -16.224 23.726 1.00 40.65 C ATOM 5350 HA THR B 103 -5.290 -15.324 22.706 1.00 0.00 H ATOM 5351 HB THR B 103 -6.479 -17.554 22.527 1.00 0.00 H ATOM 5352 HG1 THR B 103 -7.617 -16.986 20.531 1.00 0.00 H ATOM 5353 HG23 THR B 103 -6.918 -16.135 24.499 1.00 0.00 H ATOM 5354 HG21 THR B 103 -8.195 -15.270 23.610 1.00 0.00 H ATOM 5355 HG22 THR B 103 -8.399 -16.993 24.009 1.00 0.00 H ATOM 5356 H THR B 103 -7.287 -14.199 20.792 1.00 0.00 H ATOM 5357 N PRO B 104 -4.315 -15.318 20.198 1.00 49.05 N ATOM 5358 CA PRO B 104 -3.709 -15.653 18.924 1.00 44.42 C ATOM 5359 C PRO B 104 -2.681 -16.739 19.122 1.00 41.49 C ATOM 5360 O PRO B 104 -2.278 -16.998 20.238 1.00 35.90 O ATOM 5361 CB PRO B 104 -2.990 -14.365 18.573 1.00 45.19 C ATOM 5362 CG PRO B 104 -2.535 -13.881 19.950 1.00 39.40 C ATOM 5363 CD PRO B 104 -3.701 -14.116 20.804 1.00 44.50 C ATOM 5364 HA PRO B 104 -4.420 -16.000 18.174 1.00 0.00 H ATOM 5365 HD3 PRO B 104 -3.401 -14.305 21.835 1.00 0.00 H ATOM 5366 HD2 PRO B 104 -4.386 -13.268 20.776 1.00 0.00 H ATOM 5367 HG3 PRO B 104 -2.279 -12.822 19.925 1.00 0.00 H ATOM 5368 HG2 PRO B 104 -1.676 -14.453 20.299 1.00 0.00 H ATOM 5369 HB2 PRO B 104 -2.141 -14.550 17.915 1.00 0.00 H ATOM 5370 HB3 PRO B 104 -3.663 -13.649 18.102 1.00 0.00 H ATOM 5371 N THR B 105 -2.239 -17.336 18.037 1.00 38.07 N ATOM 5372 CA THR B 105 -1.314 -18.449 18.109 1.00 46.24 C ATOM 5373 C THR B 105 0.058 -17.875 17.985 1.00 49.21 C ATOM 5374 O THR B 105 0.228 -16.725 17.538 1.00 51.54 O ATOM 5375 CB THR B 105 -1.494 -19.392 16.891 1.00 49.92 C ATOM 5376 OG1 THR B 105 -1.420 -18.622 15.666 1.00 43.27 O ATOM 5377 CG2 THR B 105 -2.838 -20.171 16.979 1.00 47.23 C ATOM 5378 HA THR B 105 -1.480 -18.999 19.035 1.00 0.00 H ATOM 5379 HB THR B 105 -0.691 -20.129 16.895 1.00 0.00 H ATOM 5380 HG1 THR B 105 -2.137 -17.939 15.663 1.00 0.00 H ATOM 5381 HG23 THR B 105 -2.866 -20.740 17.908 1.00 0.00 H ATOM 5382 HG21 THR B 105 -3.668 -19.465 16.959 1.00 0.00 H ATOM 5383 HG22 THR B 105 -2.918 -20.852 16.132 1.00 0.00 H ATOM 5384 H THR B 105 -2.561 -17.002 17.106 1.00 0.00 H ATOM 5385 N THR B 106 1.053 -18.677 18.325 1.00 49.00 N ATOM 5386 CA THR B 106 2.408 -18.177 18.237 1.00 47.00 C ATOM 5387 C THR B 106 2.672 -17.672 16.805 1.00 49.86 C ATOM 5388 O THR B 106 3.233 -16.577 16.579 1.00 51.76 O ATOM 5389 CB THR B 106 3.439 -19.202 18.756 1.00 45.69 C ATOM 5390 OG1 THR B 106 3.439 -19.181 20.195 1.00 45.74 O ATOM 5391 CG2 THR B 106 4.785 -18.829 18.315 1.00 43.36 C ATOM 5392 HA THR B 106 2.530 -17.323 18.903 1.00 0.00 H ATOM 5393 HB THR B 106 3.174 -20.187 18.373 1.00 0.00 H ATOM 5394 HG1 THR B 106 4.099 -19.837 20.533 1.00 0.00 H ATOM 5395 HG23 THR B 106 4.823 -18.834 17.226 1.00 0.00 H ATOM 5396 HG21 THR B 106 5.023 -17.831 18.684 1.00 0.00 H ATOM 5397 HG22 THR B 106 5.506 -19.545 18.709 1.00 0.00 H ATOM 5398 H THR B 106 0.865 -19.647 18.649 1.00 0.00 H ATOM 5399 N ALA B 107 2.190 -18.444 15.846 1.00 47.59 N ATOM 5400 CA ALA B 107 2.408 -18.154 14.437 1.00 44.90 C ATOM 5401 C ALA B 107 1.728 -16.839 13.965 1.00 42.34 C ATOM 5402 O ALA B 107 2.238 -16.137 13.087 1.00 39.89 O ATOM 5403 CB ALA B 107 1.930 -19.363 13.591 1.00 41.83 C ATOM 5404 HA ALA B 107 3.477 -17.996 14.295 1.00 0.00 H ATOM 5405 HB1 ALA B 107 2.496 -20.250 13.875 1.00 0.00 H ATOM 5406 HB2 ALA B 107 0.869 -19.534 13.771 1.00 0.00 H ATOM 5407 HB3 ALA B 107 2.091 -19.151 12.534 1.00 0.00 H ATOM 5408 H ALA B 107 1.637 -19.285 16.107 1.00 0.00 H ATOM 5409 N ALA B 108 0.564 -16.529 14.531 1.00 40.77 N ATOM 5410 CA ALA B 108 -0.108 -15.300 14.214 1.00 37.53 C ATOM 5411 C ALA B 108 0.690 -14.094 14.775 1.00 41.23 C ATOM 5412 O ALA B 108 0.783 -13.055 14.131 1.00 36.86 O ATOM 5413 CB ALA B 108 -1.502 -15.315 14.752 1.00 37.23 C ATOM 5414 HA ALA B 108 -0.165 -15.198 13.130 1.00 0.00 H ATOM 5415 HB1 ALA B 108 -2.052 -16.146 14.309 1.00 0.00 H ATOM 5416 HB2 ALA B 108 -1.471 -15.434 15.835 1.00 0.00 H ATOM 5417 HB3 ALA B 108 -1.996 -14.376 14.503 1.00 0.00 H ATOM 5418 H ALA B 108 0.135 -17.186 15.213 1.00 0.00 H ATOM 5419 N MET B 109 1.288 -14.246 15.952 1.00 39.39 N ATOM 5420 CA MET B 109 2.061 -13.155 16.502 1.00 38.20 C ATOM 5421 C MET B 109 3.400 -12.982 15.835 1.00 39.90 C ATOM 5422 O MET B 109 3.889 -11.863 15.818 1.00 40.56 O ATOM 5423 CB MET B 109 2.285 -13.297 18.004 1.00 37.38 C ATOM 5424 CG MET B 109 1.039 -13.171 18.834 1.00 36.18 C ATOM 5425 SD MET B 109 0.329 -11.540 18.784 1.00 44.13 S ATOM 5426 CE MET B 109 1.316 -10.698 20.007 1.00 31.72 C ATOM 5427 HA MET B 109 1.455 -12.270 16.307 1.00 0.00 H ATOM 5428 HB2 MET B 109 2.722 -14.278 18.192 1.00 0.00 H ATOM 5429 HB3 MET B 109 2.984 -12.522 18.319 1.00 0.00 H ATOM 5430 HG2 MET B 109 1.285 -13.411 19.868 1.00 0.00 H ATOM 5431 HG3 MET B 109 0.301 -13.882 18.463 1.00 0.00 H ATOM 5432 HE1 MET B 109 1.199 -11.194 20.971 1.00 0.00 H ATOM 5433 HE2 MET B 109 2.364 -10.725 19.708 1.00 0.00 H ATOM 5434 HE3 MET B 109 0.987 -9.662 20.087 1.00 0.00 H ATOM 5435 H MET B 109 1.201 -15.142 16.473 1.00 0.00 H ATOM 5436 N TYR B 110 3.969 -14.064 15.290 1.00 40.99 N ATOM 5437 CA TYR B 110 5.345 -14.075 14.787 1.00 39.71 C ATOM 5438 C TYR B 110 5.523 -14.706 13.366 1.00 42.33 C ATOM 5439 O TYR B 110 6.510 -15.421 13.115 1.00 33.72 O ATOM 5440 CB TYR B 110 6.270 -14.769 15.801 1.00 46.41 C ATOM 5441 CG TYR B 110 6.437 -14.054 17.138 1.00 49.26 C ATOM 5442 CD1 TYR B 110 7.389 -13.058 17.309 1.00 53.48 C ATOM 5443 CD2 TYR B 110 5.642 -14.381 18.233 1.00 50.99 C ATOM 5444 CE1 TYR B 110 7.545 -12.388 18.552 1.00 54.04 C ATOM 5445 CE2 TYR B 110 5.789 -13.726 19.478 1.00 53.19 C ATOM 5446 CZ TYR B 110 6.741 -12.726 19.626 1.00 52.40 C ATOM 5447 OH TYR B 110 6.891 -12.080 20.846 1.00 54.33 O ATOM 5448 HA TYR B 110 5.622 -13.027 14.670 1.00 0.00 H ATOM 5449 HB3 TYR B 110 7.256 -14.864 15.346 1.00 0.00 H ATOM 5450 HB2 TYR B 110 5.866 -15.762 15.999 1.00 0.00 H ATOM 5451 HD2 TYR B 110 4.888 -15.161 18.128 1.00 0.00 H ATOM 5452 HE2 TYR B 110 5.156 -14.006 20.320 1.00 0.00 H ATOM 5453 HE1 TYR B 110 8.298 -11.608 18.660 1.00 0.00 H ATOM 5454 HD1 TYR B 110 8.031 -12.784 16.471 1.00 0.00 H ATOM 5455 HH TYR B 110 7.608 -11.402 20.773 1.00 0.00 H ATOM 5456 H TYR B 110 3.408 -14.937 15.220 1.00 0.00 H ATOM 5457 N PRO B 111 4.655 -14.339 12.394 1.00 39.36 N ATOM 5458 CA PRO B 111 4.674 -15.016 11.083 1.00 42.05 C ATOM 5459 C PRO B 111 6.013 -15.018 10.356 1.00 41.52 C ATOM 5460 O PRO B 111 6.152 -15.767 9.409 1.00 42.20 O ATOM 5461 CB PRO B 111 3.614 -14.274 10.252 1.00 38.23 C ATOM 5462 CG PRO B 111 3.506 -12.918 10.924 1.00 42.24 C ATOM 5463 CD PRO B 111 3.682 -13.233 12.408 1.00 43.47 C ATOM 5464 HA PRO B 111 4.475 -16.078 11.229 1.00 0.00 H ATOM 5465 HD3 PRO B 111 4.074 -12.372 12.949 1.00 0.00 H ATOM 5466 HD2 PRO B 111 2.739 -13.545 12.858 1.00 0.00 H ATOM 5467 HG3 PRO B 111 2.532 -12.467 10.735 1.00 0.00 H ATOM 5468 HG2 PRO B 111 4.290 -12.247 10.573 1.00 0.00 H ATOM 5469 HB2 PRO B 111 3.937 -14.169 9.216 1.00 0.00 H ATOM 5470 HB3 PRO B 111 2.659 -14.799 10.283 1.00 0.00 H ATOM 5471 N ASP B 112 6.981 -14.212 10.787 1.00 39.92 N ATOM 5472 CA ASP B 112 8.304 -14.247 10.160 1.00 33.88 C ATOM 5473 C ASP B 112 9.404 -14.527 11.187 1.00 37.12 C ATOM 5474 O ASP B 112 10.586 -14.304 10.940 1.00 37.13 O ATOM 5475 CB ASP B 112 8.595 -12.955 9.425 1.00 32.98 C ATOM 5476 CG ASP B 112 7.529 -12.585 8.468 1.00 39.97 C ATOM 5477 OD1 ASP B 112 7.273 -13.431 7.589 1.00 51.04 O ATOM 5478 OD2 ASP B 112 6.942 -11.457 8.566 1.00 43.05 O ATOM 5479 HA ASP B 112 8.295 -15.063 9.438 1.00 0.00 H ATOM 5480 HB2 ASP B 112 8.699 -12.154 10.157 1.00 0.00 H ATOM 5481 HB3 ASP B 112 9.530 -13.069 8.877 1.00 0.00 H ATOM 5482 H ASP B 112 6.797 -13.555 11.572 1.00 0.00 H ATOM 5483 N GLY B 113 9.036 -15.025 12.355 1.00 34.65 N ATOM 5484 CA GLY B 113 10.086 -15.351 13.293 1.00 40.83 C ATOM 5485 C GLY B 113 10.513 -14.096 13.990 1.00 43.91 C ATOM 5486 O GLY B 113 9.902 -13.031 13.773 1.00 47.97 O ATOM 5487 HA3 GLY B 113 10.934 -15.782 12.760 1.00 0.00 H ATOM 5488 HA2 GLY B 113 9.715 -16.069 14.024 1.00 0.00 H ATOM 5489 H GLY B 113 8.034 -15.176 12.589 1.00 0.00 H ATOM 5490 N LEU B 114 11.492 -14.221 14.882 1.00 39.14 N ATOM 5491 CA LEU B 114 11.940 -13.054 15.602 1.00 42.35 C ATOM 5492 C LEU B 114 12.682 -12.203 14.584 1.00 41.76 C ATOM 5493 O LEU B 114 13.549 -12.694 13.901 1.00 37.11 O ATOM 5494 CB LEU B 114 12.802 -13.460 16.773 1.00 46.63 C ATOM 5495 CG LEU B 114 11.826 -13.859 17.884 1.00 55.50 C ATOM 5496 CD1 LEU B 114 12.185 -15.192 18.688 1.00 58.39 C ATOM 5497 CD2 LEU B 114 11.565 -12.641 18.791 1.00 52.58 C ATOM 5498 HA LEU B 114 11.117 -12.484 16.034 1.00 0.00 H ATOM 5499 HB2 LEU B 114 13.438 -14.303 16.504 1.00 0.00 H ATOM 5500 HB3 LEU B 114 13.425 -12.625 17.095 1.00 0.00 H ATOM 5501 HG LEU B 114 10.897 -14.149 17.393 1.00 0.00 H ATOM 5502 HD21 LEU B 114 12.505 -12.309 19.231 1.00 0.00 H ATOM 5503 HD22 LEU B 114 11.135 -11.834 18.198 1.00 0.00 H ATOM 5504 HD23 LEU B 114 10.871 -12.922 19.583 1.00 0.00 H ATOM 5505 HD11 LEU B 114 12.218 -16.034 17.997 1.00 0.00 H ATOM 5506 HD12 LEU B 114 13.157 -15.075 19.167 1.00 0.00 H ATOM 5507 HD13 LEU B 114 11.424 -15.373 19.447 1.00 0.00 H ATOM 5508 H LEU B 114 11.929 -15.148 15.058 1.00 0.00 H ATOM 5509 N ARG B 115 12.261 -10.966 14.365 1.00 38.11 N ATOM 5510 CA ARG B 115 12.986 -10.175 13.365 1.00 36.91 C ATOM 5511 C ARG B 115 13.304 -8.812 13.942 1.00 32.75 C ATOM 5512 O ARG B 115 14.333 -8.644 14.619 1.00 26.35 O ATOM 5513 CB ARG B 115 12.286 -10.144 11.975 1.00 37.45 C ATOM 5514 CG ARG B 115 13.262 -9.882 10.788 1.00 33.80 C ATOM 5515 CD ARG B 115 12.569 -9.874 9.427 1.00 31.81 C ATOM 5516 NE ARG B 115 11.152 -9.507 9.489 1.00 31.21 N ATOM 5517 CZ ARG B 115 10.326 -9.442 8.434 1.00 28.75 C ATOM 5518 NH1 ARG B 115 10.771 -9.686 7.223 1.00 23.11 N ATOM 5519 NH2 ARG B 115 9.044 -9.140 8.566 1.00 24.14 N ATOM 5520 HA ARG B 115 13.934 -10.667 13.146 1.00 0.00 H ATOM 5521 HB2 ARG B 115 11.798 -11.105 11.814 1.00 0.00 H ATOM 5522 HB3 ARG B 115 11.535 -9.354 11.985 1.00 0.00 H ATOM 5523 HG2 ARG B 115 13.739 -8.914 10.939 1.00 0.00 H ATOM 5524 HG3 ARG B 115 14.022 -10.664 10.785 1.00 0.00 H ATOM 5525 HD2 ARG B 115 12.648 -10.872 8.995 1.00 0.00 H ATOM 5526 HD3 ARG B 115 13.082 -9.159 8.784 1.00 0.00 H ATOM 5527 HE ARG B 115 10.756 -9.279 10.423 1.00 0.00 H ATOM 5528 HH12 ARG B 115 10.124 -9.633 6.411 1.00 0.00 H ATOM 5529 HH11 ARG B 115 11.771 -9.932 7.076 1.00 0.00 H ATOM 5530 HH22 ARG B 115 8.431 -9.098 7.727 1.00 0.00 H ATOM 5531 HH21 ARG B 115 8.650 -8.945 9.509 1.00 0.00 H ATOM 5532 H ARG B 115 11.449 -10.572 14.881 1.00 0.00 H ATOM 5533 N THR B 116 12.409 -7.857 13.713 1.00 29.11 N ATOM 5534 CA THR B 116 12.508 -6.592 14.403 1.00 25.95 C ATOM 5535 C THR B 116 12.030 -6.729 15.852 1.00 29.91 C ATOM 5536 O THR B 116 10.967 -7.315 16.118 1.00 27.95 O ATOM 5537 CB THR B 116 11.734 -5.567 13.667 1.00 22.41 C ATOM 5538 OG1 THR B 116 12.082 -5.688 12.280 1.00 20.10 O ATOM 5539 CG2 THR B 116 12.104 -4.228 14.159 1.00 16.68 C ATOM 5540 HA THR B 116 13.551 -6.277 14.437 1.00 0.00 H ATOM 5541 HB THR B 116 10.662 -5.706 13.810 1.00 0.00 H ATOM 5542 HG1 THR B 116 11.581 -5.015 11.755 1.00 0.00 H ATOM 5543 HG23 THR B 116 11.837 -4.143 15.212 1.00 0.00 H ATOM 5544 HG21 THR B 116 13.178 -4.083 14.042 1.00 0.00 H ATOM 5545 HG22 THR B 116 11.570 -3.471 13.585 1.00 0.00 H ATOM 5546 H THR B 116 11.636 -8.021 13.036 1.00 0.00 H ATOM 5547 N THR B 117 12.844 -6.225 16.780 1.00 26.81 N ATOM 5548 CA THR B 117 12.509 -6.274 18.190 1.00 21.74 C ATOM 5549 C THR B 117 12.859 -4.945 18.877 1.00 22.63 C ATOM 5550 O THR B 117 13.604 -4.088 18.324 1.00 22.86 O ATOM 5551 CB THR B 117 13.312 -7.383 18.923 1.00 25.68 C ATOM 5552 OG1 THR B 117 14.699 -7.082 18.810 1.00 22.75 O ATOM 5553 CG2 THR B 117 13.035 -8.809 18.369 1.00 10.59 C ATOM 5554 HA THR B 117 11.440 -6.476 18.248 1.00 0.00 H ATOM 5555 HB THR B 117 12.992 -7.392 19.965 1.00 0.00 H ATOM 5556 HG1 THR B 117 15.226 -7.781 19.273 1.00 0.00 H ATOM 5557 HG23 THR B 117 11.972 -9.032 18.459 1.00 0.00 H ATOM 5558 HG21 THR B 117 13.330 -8.854 17.321 1.00 0.00 H ATOM 5559 HG22 THR B 117 13.610 -9.538 18.941 1.00 0.00 H ATOM 5560 H THR B 117 13.740 -5.787 16.486 1.00 0.00 H ATOM 5561 N VAL B 118 12.321 -4.797 20.080 1.00 21.29 N ATOM 5562 CA VAL B 118 12.562 -3.635 20.929 1.00 25.69 C ATOM 5563 C VAL B 118 13.804 -3.921 21.751 1.00 27.15 C ATOM 5564 O VAL B 118 13.959 -4.999 22.359 1.00 26.68 O ATOM 5565 CB VAL B 118 11.447 -3.493 21.953 1.00 24.54 C ATOM 5566 CG1 VAL B 118 11.670 -2.270 22.869 1.00 27.52 C ATOM 5567 CG2 VAL B 118 10.202 -3.397 21.275 1.00 22.00 C ATOM 5568 HA VAL B 118 12.641 -2.749 20.299 1.00 0.00 H ATOM 5569 HB VAL B 118 11.445 -4.374 22.594 1.00 0.00 H ATOM 5570 HG11 VAL B 118 12.615 -2.384 23.401 1.00 0.00 H ATOM 5571 HG12 VAL B 118 11.699 -1.364 22.263 1.00 0.00 H ATOM 5572 HG13 VAL B 118 10.853 -2.202 23.587 1.00 0.00 H ATOM 5573 HG21 VAL B 118 10.212 -2.526 20.620 1.00 0.00 H ATOM 5574 HG22 VAL B 118 10.043 -4.297 20.681 1.00 0.00 H ATOM 5575 HG23 VAL B 118 9.399 -3.295 22.005 1.00 0.00 H ATOM 5576 H VAL B 118 11.695 -5.547 20.437 1.00 0.00 H ATOM 5577 N GLN B 119 14.668 -2.935 21.804 1.00 25.94 N ATOM 5578 CA GLN B 119 15.846 -3.002 22.612 1.00 25.46 C ATOM 5579 C GLN B 119 15.642 -2.029 23.799 1.00 28.49 C ATOM 5580 O GLN B 119 15.470 -0.814 23.576 1.00 37.54 O ATOM 5581 CB GLN B 119 17.005 -2.665 21.723 1.00 20.33 C ATOM 5582 CG GLN B 119 18.201 -2.156 22.456 1.00 36.71 C ATOM 5583 CD GLN B 119 19.163 -3.224 22.810 1.00 46.38 C ATOM 5584 OE1 GLN B 119 18.848 -4.421 22.776 1.00 49.09 O ATOM 5585 NE2 GLN B 119 20.366 -2.807 23.181 1.00 56.07 N ATOM 5586 HA GLN B 119 16.045 -3.985 23.039 1.00 0.00 H ATOM 5587 HB2 GLN B 119 17.293 -3.564 21.178 1.00 0.00 H ATOM 5588 HB3 GLN B 119 16.684 -1.900 21.016 1.00 0.00 H ATOM 5589 HG2 GLN B 119 18.709 -1.426 21.826 1.00 0.00 H ATOM 5590 HG3 GLN B 119 17.866 -1.672 23.374 1.00 0.00 H ATOM 5591 HE22 GLN B 119 20.583 -1.790 23.193 1.00 0.00 H ATOM 5592 HE21 GLN B 119 21.092 -3.497 23.460 1.00 0.00 H ATOM 5593 H GLN B 119 14.491 -2.079 21.241 1.00 0.00 H ATOM 5594 N PRO B 120 15.538 -2.567 25.056 1.00 31.39 N ATOM 5595 CA PRO B 120 15.273 -1.774 26.287 1.00 20.47 C ATOM 5596 C PRO B 120 16.423 -0.919 26.703 1.00 22.95 C ATOM 5597 O PRO B 120 17.552 -1.152 26.272 1.00 23.11 O ATOM 5598 CB PRO B 120 15.064 -2.872 27.340 1.00 28.29 C ATOM 5599 CG PRO B 120 14.619 -4.105 26.527 1.00 22.62 C ATOM 5600 CD PRO B 120 15.559 -4.014 25.377 1.00 26.17 C ATOM 5601 HA PRO B 120 14.441 -1.083 26.147 1.00 0.00 H ATOM 5602 HD3 PRO B 120 16.560 -4.340 25.660 1.00 0.00 H ATOM 5603 HD2 PRO B 120 15.209 -4.610 24.534 1.00 0.00 H ATOM 5604 HG3 PRO B 120 13.580 -4.025 26.207 1.00 0.00 H ATOM 5605 HG2 PRO B 120 14.755 -5.030 27.088 1.00 0.00 H ATOM 5606 HB2 PRO B 120 15.992 -3.076 27.874 1.00 0.00 H ATOM 5607 HB3 PRO B 120 14.293 -2.581 28.053 1.00 0.00 H ATOM 5608 N GLY B 121 16.177 0.036 27.596 1.00 29.09 N ATOM 5609 CA GLY B 121 17.264 0.834 28.189 1.00 22.15 C ATOM 5610 C GLY B 121 18.058 -0.039 29.124 1.00 20.09 C ATOM 5611 O GLY B 121 17.764 -1.196 29.267 1.00 23.12 O ATOM 5612 HA3 GLY B 121 16.842 1.673 28.742 1.00 0.00 H ATOM 5613 HA2 GLY B 121 17.914 1.211 27.399 1.00 0.00 H ATOM 5614 H GLY B 121 15.195 0.223 27.882 1.00 0.00 H ATOM 5615 N PRO B 122 19.097 0.495 29.760 1.00 27.50 N ATOM 5616 CA PRO B 122 19.992 -0.324 30.651 1.00 25.39 C ATOM 5617 C PRO B 122 19.250 -1.012 31.832 1.00 29.47 C ATOM 5618 O PRO B 122 19.754 -1.971 32.462 1.00 28.22 O ATOM 5619 CB PRO B 122 20.959 0.707 31.232 1.00 25.45 C ATOM 5620 CG PRO B 122 20.924 1.891 30.306 1.00 28.61 C ATOM 5621 CD PRO B 122 19.537 1.892 29.617 1.00 24.21 C ATOM 5622 HA PRO B 122 20.449 -1.133 30.081 1.00 0.00 H ATOM 5623 HD3 PRO B 122 18.850 2.573 30.119 1.00 0.00 H ATOM 5624 HD2 PRO B 122 19.621 2.171 28.567 1.00 0.00 H ATOM 5625 HG3 PRO B 122 21.713 1.805 29.559 1.00 0.00 H ATOM 5626 HG2 PRO B 122 21.061 2.812 30.872 1.00 0.00 H ATOM 5627 HB2 PRO B 122 20.641 1.001 32.232 1.00 0.00 H ATOM 5628 HB3 PRO B 122 21.967 0.294 31.279 1.00 0.00 H ATOM 5629 N LEU B 123 18.035 -0.545 32.100 1.00 25.40 N ATOM 5630 CA LEU B 123 17.308 -1.018 33.244 1.00 26.11 C ATOM 5631 C LEU B 123 16.971 -2.481 33.070 1.00 26.12 C ATOM 5632 O LEU B 123 16.747 -3.180 34.045 1.00 28.97 O ATOM 5633 CB LEU B 123 16.051 -0.148 33.513 1.00 25.83 C ATOM 5634 CG LEU B 123 15.096 -0.664 34.619 1.00 28.31 C ATOM 5635 CD1 LEU B 123 15.889 -0.860 35.893 1.00 23.75 C ATOM 5636 CD2 LEU B 123 13.889 0.270 34.877 1.00 26.89 C ATOM 5637 HA LEU B 123 17.938 -0.925 34.128 1.00 0.00 H ATOM 5638 HB2 LEU B 123 16.389 0.848 33.801 1.00 0.00 H ATOM 5639 HB3 LEU B 123 15.484 -0.084 32.584 1.00 0.00 H ATOM 5640 HG LEU B 123 14.674 -1.608 34.274 1.00 0.00 H ATOM 5641 HD21 LEU B 123 14.250 1.251 35.188 1.00 0.00 H ATOM 5642 HD22 LEU B 123 13.306 0.369 33.961 1.00 0.00 H ATOM 5643 HD23 LEU B 123 13.264 -0.154 35.663 1.00 0.00 H ATOM 5644 HD11 LEU B 123 16.681 -1.588 35.718 1.00 0.00 H ATOM 5645 HD12 LEU B 123 16.328 0.091 36.196 1.00 0.00 H ATOM 5646 HD13 LEU B 123 15.227 -1.223 36.679 1.00 0.00 H ATOM 5647 H LEU B 123 17.607 0.169 31.476 1.00 0.00 H ATOM 5648 N ALA B 124 16.926 -2.926 31.817 1.00 26.42 N ATOM 5649 CA ALA B 124 16.609 -4.291 31.486 1.00 26.33 C ATOM 5650 C ALA B 124 17.726 -5.221 31.895 1.00 30.38 C ATOM 5651 O ALA B 124 17.477 -6.413 32.020 1.00 34.22 O ATOM 5652 CB ALA B 124 16.297 -4.437 29.978 1.00 26.38 C ATOM 5653 HA ALA B 124 15.716 -4.571 32.045 1.00 0.00 H ATOM 5654 HB1 ALA B 124 15.445 -3.807 29.722 1.00 0.00 H ATOM 5655 HB2 ALA B 124 17.166 -4.128 29.397 1.00 0.00 H ATOM 5656 HB3 ALA B 124 16.061 -5.478 29.756 1.00 0.00 H ATOM 5657 H ALA B 124 17.128 -2.260 31.044 1.00 0.00 H ATOM 5658 N ALA B 125 18.948 -4.703 32.104 1.00 32.30 N ATOM 5659 CA ALA B 125 20.083 -5.542 32.600 1.00 36.81 C ATOM 5660 C ALA B 125 20.080 -5.852 34.124 1.00 37.61 C ATOM 5661 O ALA B 125 20.501 -6.895 34.573 1.00 38.55 O ATOM 5662 CB ALA B 125 21.422 -4.912 32.219 1.00 35.49 C ATOM 5663 HA ALA B 125 19.939 -6.502 32.105 1.00 0.00 H ATOM 5664 HB1 ALA B 125 21.489 -4.832 31.134 1.00 0.00 H ATOM 5665 HB2 ALA B 125 21.495 -3.919 32.663 1.00 0.00 H ATOM 5666 HB3 ALA B 125 22.235 -5.537 32.589 1.00 0.00 H ATOM 5667 H ALA B 125 19.109 -3.693 31.916 1.00 0.00 H ATOM 5668 N GLU B 126 19.611 -4.908 34.908 1.00 38.04 N ATOM 5669 CA GLU B 126 19.536 -5.033 36.345 1.00 33.28 C ATOM 5670 C GLU B 126 18.478 -5.986 36.890 1.00 35.33 C ATOM 5671 O GLU B 126 17.570 -6.438 36.151 1.00 37.76 O ATOM 5672 CB GLU B 126 19.255 -3.645 36.857 1.00 29.78 C ATOM 5673 CG GLU B 126 20.269 -2.699 36.271 1.00 34.85 C ATOM 5674 CD GLU B 126 20.039 -1.325 36.719 1.00 46.66 C ATOM 5675 OE1 GLU B 126 18.882 -0.877 36.676 1.00 55.52 O ATOM 5676 OE2 GLU B 126 21.010 -0.669 37.121 1.00 60.95 O ATOM 5677 HA GLU B 126 20.477 -5.468 36.683 1.00 0.00 H ATOM 5678 HB2 GLU B 126 18.252 -3.340 36.558 1.00 0.00 H ATOM 5679 HB3 GLU B 126 19.328 -3.633 37.945 1.00 0.00 H ATOM 5680 HG2 GLU B 126 21.266 -3.011 36.581 1.00 0.00 H ATOM 5681 HG3 GLU B 126 20.200 -2.734 35.184 1.00 0.00 H ATOM 5682 H GLU B 126 19.277 -4.025 34.472 1.00 0.00 H ATOM 5683 N LEU B 127 18.614 -6.296 38.189 1.00 33.05 N ATOM 5684 CA LEU B 127 17.525 -6.867 38.978 1.00 25.17 C ATOM 5685 C LEU B 127 17.056 -8.148 38.309 1.00 31.52 C ATOM 5686 O LEU B 127 17.850 -9.076 38.211 1.00 33.13 O ATOM 5687 CB LEU B 127 16.388 -5.827 39.180 1.00 28.02 C ATOM 5688 CG LEU B 127 16.670 -4.461 39.899 1.00 25.40 C ATOM 5689 CD1 LEU B 127 15.420 -3.536 39.941 1.00 21.78 C ATOM 5690 CD2 LEU B 127 17.157 -4.712 41.306 1.00 27.62 C ATOM 5691 HA LEU B 127 17.872 -7.122 39.979 1.00 0.00 H ATOM 5692 HB2 LEU B 127 16.008 -5.584 38.188 1.00 0.00 H ATOM 5693 HB3 LEU B 127 15.608 -6.326 39.754 1.00 0.00 H ATOM 5694 HG LEU B 127 17.437 -3.948 39.318 1.00 0.00 H ATOM 5695 HD21 LEU B 127 16.395 -5.260 41.860 1.00 0.00 H ATOM 5696 HD22 LEU B 127 18.076 -5.298 41.272 1.00 0.00 H ATOM 5697 HD23 LEU B 127 17.350 -3.759 41.798 1.00 0.00 H ATOM 5698 HD11 LEU B 127 15.097 -3.318 38.923 1.00 0.00 H ATOM 5699 HD12 LEU B 127 14.616 -4.038 40.479 1.00 0.00 H ATOM 5700 HD13 LEU B 127 15.675 -2.606 40.450 1.00 0.00 H ATOM 5701 H LEU B 127 19.529 -6.123 38.651 1.00 0.00 H ATOM 5702 N GLU B 128 15.814 -8.210 37.814 1.00 28.76 N ATOM 5703 CA GLU B 128 15.340 -9.434 37.217 1.00 23.69 C ATOM 5704 C GLU B 128 16.061 -9.737 35.927 1.00 27.53 C ATOM 5705 O GLU B 128 15.981 -10.860 35.443 1.00 25.15 O ATOM 5706 CB GLU B 128 13.856 -9.344 36.890 1.00 28.70 C ATOM 5707 CG GLU B 128 13.012 -9.479 38.057 1.00 37.50 C ATOM 5708 CD GLU B 128 13.298 -10.769 38.764 1.00 39.60 C ATOM 5709 OE1 GLU B 128 12.875 -11.825 38.273 1.00 35.99 O ATOM 5710 OE2 GLU B 128 13.969 -10.706 39.801 1.00 41.63 O ATOM 5711 HA GLU B 128 15.527 -10.221 37.947 1.00 0.00 H ATOM 5712 HB2 GLU B 128 13.660 -8.376 36.429 1.00 0.00 H ATOM 5713 HB3 GLU B 128 13.606 -10.138 36.186 1.00 0.00 H ATOM 5714 HG2 GLU B 128 13.202 -8.648 38.736 1.00 0.00 H ATOM 5715 HG3 GLU B 128 11.967 -9.463 37.748 1.00 0.00 H ATOM 5716 H GLU B 128 15.192 -7.377 37.860 1.00 0.00 H ATOM 5717 N GLY B 129 16.712 -8.732 35.336 1.00 27.17 N ATOM 5718 CA GLY B 129 17.443 -8.932 34.082 1.00 31.80 C ATOM 5719 C GLY B 129 18.869 -9.401 34.307 1.00 31.70 C ATOM 5720 O GLY B 129 19.622 -9.551 33.363 1.00 34.41 O ATOM 5721 HA3 GLY B 129 17.467 -7.988 33.537 1.00 0.00 H ATOM 5722 HA2 GLY B 129 16.919 -9.680 33.487 1.00 0.00 H ATOM 5723 H GLY B 129 16.700 -7.789 35.774 1.00 0.00 H ATOM 5724 N GLY B 130 19.259 -9.564 35.571 1.00 35.99 N ATOM 5725 CA GLY B 130 20.493 -10.281 35.944 1.00 43.17 C ATOM 5726 C GLY B 130 20.489 -11.764 35.524 1.00 46.61 C ATOM 5727 O GLY B 130 21.226 -12.153 34.611 1.00 47.88 O ATOM 5728 HA3 GLY B 130 20.610 -10.228 37.026 1.00 0.00 H ATOM 5729 HA2 GLY B 130 21.338 -9.788 35.464 1.00 0.00 H ATOM 5730 H GLY B 130 18.667 -9.168 36.328 1.00 0.00 H ATOM 5731 N PRO B 131 19.647 -12.601 36.168 1.00 51.26 N ATOM 5732 CA PRO B 131 19.421 -13.962 35.643 1.00 54.95 C ATOM 5733 C PRO B 131 19.036 -14.050 34.134 1.00 60.33 C ATOM 5734 O PRO B 131 19.609 -14.876 33.412 1.00 62.20 O ATOM 5735 CB PRO B 131 18.275 -14.491 36.532 1.00 55.57 C ATOM 5736 CG PRO B 131 18.421 -13.723 37.851 1.00 52.03 C ATOM 5737 CD PRO B 131 18.869 -12.350 37.410 1.00 51.95 C ATOM 5738 HA PRO B 131 20.344 -14.540 35.683 1.00 0.00 H ATOM 5739 HD3 PRO B 131 18.011 -11.710 37.206 1.00 0.00 H ATOM 5740 HD2 PRO B 131 19.495 -11.884 38.171 1.00 0.00 H ATOM 5741 HG3 PRO B 131 19.168 -14.189 38.494 1.00 0.00 H ATOM 5742 HG2 PRO B 131 17.469 -13.672 38.380 1.00 0.00 H ATOM 5743 HB2 PRO B 131 17.307 -14.288 36.074 1.00 0.00 H ATOM 5744 HB3 PRO B 131 18.380 -15.563 36.697 1.00 0.00 H ATOM 5745 N ARG B 132 18.103 -13.211 33.662 1.00 60.79 N ATOM 5746 CA ARG B 132 17.547 -13.356 32.304 1.00 60.23 C ATOM 5747 C ARG B 132 17.795 -12.139 31.407 1.00 56.87 C ATOM 5748 O ARG B 132 16.861 -11.386 31.114 1.00 54.35 O ATOM 5749 CB ARG B 132 16.051 -13.680 32.373 1.00 61.56 C ATOM 5750 CG ARG B 132 15.719 -15.061 32.932 1.00 67.98 C ATOM 5751 CD ARG B 132 14.399 -15.039 33.723 1.00 72.69 C ATOM 5752 NE ARG B 132 13.194 -15.161 32.884 1.00 77.27 N ATOM 5753 CZ ARG B 132 11.937 -14.900 33.290 1.00 77.61 C ATOM 5754 NH1 ARG B 132 11.680 -14.496 34.535 1.00 69.58 N ATOM 5755 NH2 ARG B 132 10.915 -15.048 32.442 1.00 77.32 N ATOM 5756 HA ARG B 132 18.080 -14.186 31.840 1.00 0.00 H ATOM 5757 HB2 ARG B 132 15.571 -12.934 33.006 1.00 0.00 H ATOM 5758 HB3 ARG B 132 15.643 -13.615 31.364 1.00 0.00 H ATOM 5759 HG2 ARG B 132 15.627 -15.766 32.106 1.00 0.00 H ATOM 5760 HG3 ARG B 132 16.525 -15.380 33.593 1.00 0.00 H ATOM 5761 HD2 ARG B 132 14.342 -14.098 34.269 1.00 0.00 H ATOM 5762 HD3 ARG B 132 14.409 -15.868 34.431 1.00 0.00 H ATOM 5763 HE ARG B 132 13.325 -15.473 31.901 1.00 0.00 H ATOM 5764 HH12 ARG B 132 10.701 -14.300 34.827 1.00 0.00 H ATOM 5765 HH11 ARG B 132 12.459 -14.377 35.214 1.00 0.00 H ATOM 5766 HH22 ARG B 132 9.945 -14.846 32.757 1.00 0.00 H ATOM 5767 HH21 ARG B 132 11.090 -15.365 31.467 1.00 0.00 H ATOM 5768 H ARG B 132 17.763 -12.438 34.269 1.00 0.00 H ATOM 5769 N PRO B 133 19.023 -12.014 30.872 1.00 52.53 N ATOM 5770 CA PRO B 133 19.564 -10.780 30.277 1.00 51.05 C ATOM 5771 C PRO B 133 18.773 -10.308 29.031 1.00 51.17 C ATOM 5772 O PRO B 133 18.845 -9.140 28.642 1.00 46.28 O ATOM 5773 CB PRO B 133 20.990 -11.177 29.849 1.00 52.25 C ATOM 5774 CG PRO B 133 21.218 -12.584 30.357 1.00 49.09 C ATOM 5775 CD PRO B 133 19.899 -13.180 30.644 1.00 52.74 C ATOM 5776 HA PRO B 133 19.514 -9.953 30.986 1.00 0.00 H ATOM 5777 HD3 PRO B 133 19.547 -13.770 29.797 1.00 0.00 H ATOM 5778 HD2 PRO B 133 19.943 -13.811 31.531 1.00 0.00 H ATOM 5779 HG3 PRO B 133 21.819 -12.557 31.266 1.00 0.00 H ATOM 5780 HG2 PRO B 133 21.734 -13.173 29.599 1.00 0.00 H ATOM 5781 HB2 PRO B 133 21.078 -11.150 28.763 1.00 0.00 H ATOM 5782 HB3 PRO B 133 21.718 -10.495 30.288 1.00 0.00 H ATOM 5783 N THR B 134 18.027 -11.218 28.418 1.00 46.93 N ATOM 5784 CA THR B 134 17.191 -10.866 27.284 1.00 44.98 C ATOM 5785 C THR B 134 15.659 -10.973 27.519 1.00 37.19 C ATOM 5786 O THR B 134 14.872 -10.860 26.582 1.00 33.11 O ATOM 5787 CB THR B 134 17.586 -11.723 26.052 1.00 49.67 C ATOM 5788 OG1 THR B 134 17.253 -13.103 26.302 1.00 45.05 O ATOM 5789 CG2 THR B 134 19.113 -11.549 25.695 1.00 47.02 C ATOM 5790 HA THR B 134 17.382 -9.806 27.114 1.00 0.00 H ATOM 5791 HB THR B 134 17.022 -11.378 25.185 1.00 0.00 H ATOM 5792 HG1 THR B 134 17.505 -13.650 25.516 1.00 0.00 H ATOM 5793 HG23 THR B 134 19.325 -10.495 25.513 1.00 0.00 H ATOM 5794 HG21 THR B 134 19.722 -11.905 26.526 1.00 0.00 H ATOM 5795 HG22 THR B 134 19.344 -12.127 24.800 1.00 0.00 H ATOM 5796 H THR B 134 18.041 -12.201 28.756 1.00 0.00 H ATOM 5797 N HIS B 135 15.248 -11.173 28.764 1.00 34.67 N ATOM 5798 CA HIS B 135 13.827 -11.403 29.114 1.00 34.92 C ATOM 5799 C HIS B 135 12.838 -10.248 28.776 1.00 36.78 C ATOM 5800 O HIS B 135 11.704 -10.470 28.255 1.00 38.19 O ATOM 5801 CB HIS B 135 13.747 -11.728 30.623 1.00 40.50 C ATOM 5802 CG HIS B 135 12.398 -11.495 31.230 1.00 37.55 C ATOM 5803 ND1 HIS B 135 11.330 -12.333 31.005 1.00 31.66 N ATOM 5804 CD2 HIS B 135 11.932 -10.493 32.014 1.00 37.58 C ATOM 5805 CE1 HIS B 135 10.262 -11.857 31.623 1.00 29.87 C ATOM 5806 NE2 HIS B 135 10.601 -10.741 32.245 1.00 32.84 N ATOM 5807 HA HIS B 135 13.499 -12.230 28.484 1.00 0.00 H ATOM 5808 HB2 HIS B 135 14.008 -12.777 30.761 1.00 0.00 H ATOM 5809 HB3 HIS B 135 14.470 -11.103 31.147 1.00 0.00 H ATOM 5810 HD2 HIS B 135 12.507 -9.647 32.391 1.00 0.00 H ATOM 5811 HE1 HIS B 135 9.270 -12.309 31.620 1.00 0.00 H ATOM 5812 H HIS B 135 15.954 -11.168 29.528 1.00 0.00 H ATOM 5813 N PHE B 136 13.267 -9.033 29.124 1.00 28.23 N ATOM 5814 CA PHE B 136 12.481 -7.845 28.933 1.00 25.04 C ATOM 5815 C PHE B 136 12.451 -7.435 27.486 1.00 24.83 C ATOM 5816 O PHE B 136 11.444 -6.892 27.033 1.00 30.75 O ATOM 5817 CB PHE B 136 13.023 -6.706 29.819 1.00 26.60 C ATOM 5818 CG PHE B 136 12.774 -6.916 31.313 1.00 22.78 C ATOM 5819 CD1 PHE B 136 11.478 -6.962 31.824 1.00 24.46 C ATOM 5820 CD2 PHE B 136 13.838 -7.063 32.191 1.00 19.14 C ATOM 5821 CE1 PHE B 136 11.251 -7.171 33.220 1.00 24.70 C ATOM 5822 CE2 PHE B 136 13.656 -7.257 33.509 1.00 20.32 C ATOM 5823 CZ PHE B 136 12.361 -7.319 34.055 1.00 22.35 C ATOM 5824 HA PHE B 136 11.455 -8.061 29.230 1.00 0.00 H ATOM 5825 HB2 PHE B 136 14.098 -6.626 29.657 1.00 0.00 H ATOM 5826 HB3 PHE B 136 12.541 -5.776 29.517 1.00 0.00 H ATOM 5827 HD2 PHE B 136 14.854 -7.020 31.800 1.00 0.00 H ATOM 5828 HE2 PHE B 136 14.522 -7.367 34.162 1.00 0.00 H ATOM 5829 HZ PHE B 136 12.224 -7.482 35.124 1.00 0.00 H ATOM 5830 HE1 PHE B 136 10.239 -7.214 33.622 1.00 0.00 H ATOM 5831 HD1 PHE B 136 10.629 -6.837 31.152 1.00 0.00 H ATOM 5832 H PHE B 136 14.211 -8.942 29.552 1.00 0.00 H ATOM 5833 N ALA B 137 13.527 -7.678 26.731 1.00 22.69 N ATOM 5834 CA ALA B 137 13.422 -7.408 25.266 1.00 27.26 C ATOM 5835 C ALA B 137 12.237 -8.176 24.734 1.00 25.42 C ATOM 5836 O ALA B 137 11.412 -7.616 24.025 1.00 31.03 O ATOM 5837 CB ALA B 137 14.694 -7.706 24.462 1.00 14.36 C ATOM 5838 HA ALA B 137 13.283 -6.334 25.139 1.00 0.00 H ATOM 5839 HB1 ALA B 137 15.512 -7.091 24.837 1.00 0.00 H ATOM 5840 HB2 ALA B 137 14.952 -8.760 24.569 1.00 0.00 H ATOM 5841 HB3 ALA B 137 14.519 -7.479 23.410 1.00 0.00 H ATOM 5842 H ALA B 137 14.407 -8.042 27.149 1.00 0.00 H ATOM 5843 N GLY B 138 12.116 -9.441 25.152 1.00 29.24 N ATOM 5844 CA GLY B 138 10.981 -10.259 24.781 1.00 20.42 C ATOM 5845 C GLY B 138 9.679 -9.662 25.323 1.00 36.13 C ATOM 5846 O GLY B 138 8.640 -9.572 24.597 1.00 29.65 O ATOM 5847 HA3 GLY B 138 11.113 -11.260 25.191 1.00 0.00 H ATOM 5848 HA2 GLY B 138 10.922 -10.317 23.694 1.00 0.00 H ATOM 5849 H GLY B 138 12.856 -9.847 25.759 1.00 0.00 H ATOM 5850 N VAL B 139 9.711 -9.248 26.594 1.00 27.39 N ATOM 5851 CA VAL B 139 8.512 -8.720 27.161 1.00 30.31 C ATOM 5852 C VAL B 139 8.020 -7.462 26.412 1.00 36.03 C ATOM 5853 O VAL B 139 6.851 -7.421 26.071 1.00 32.53 O ATOM 5854 CB VAL B 139 8.684 -8.420 28.623 1.00 34.11 C ATOM 5855 CG1 VAL B 139 7.530 -7.594 29.093 1.00 25.18 C ATOM 5856 CG2 VAL B 139 8.762 -9.729 29.423 1.00 28.84 C ATOM 5857 HA VAL B 139 7.750 -9.492 27.052 1.00 0.00 H ATOM 5858 HB VAL B 139 9.610 -7.866 28.776 1.00 0.00 H ATOM 5859 HG11 VAL B 139 7.498 -6.662 28.528 1.00 0.00 H ATOM 5860 HG12 VAL B 139 6.603 -8.146 28.938 1.00 0.00 H ATOM 5861 HG13 VAL B 139 7.651 -7.374 30.154 1.00 0.00 H ATOM 5862 HG21 VAL B 139 7.843 -10.297 29.279 1.00 0.00 H ATOM 5863 HG22 VAL B 139 9.612 -10.316 29.075 1.00 0.00 H ATOM 5864 HG23 VAL B 139 8.887 -9.500 30.481 1.00 0.00 H ATOM 5865 H VAL B 139 10.585 -9.309 27.154 1.00 0.00 H ATOM 5866 N LEU B 140 8.901 -6.480 26.152 1.00 26.98 N ATOM 5867 CA LEU B 140 8.517 -5.216 25.511 1.00 32.30 C ATOM 5868 C LEU B 140 8.152 -5.396 24.036 1.00 29.79 C ATOM 5869 O LEU B 140 7.200 -4.795 23.532 1.00 27.15 O ATOM 5870 CB LEU B 140 9.633 -4.124 25.615 1.00 32.07 C ATOM 5871 CG LEU B 140 10.146 -3.623 26.969 1.00 30.06 C ATOM 5872 CD1 LEU B 140 10.959 -2.339 26.887 1.00 25.04 C ATOM 5873 CD2 LEU B 140 9.007 -3.481 27.962 1.00 30.32 C ATOM 5874 HA LEU B 140 7.638 -4.881 26.061 1.00 0.00 H ATOM 5875 HB2 LEU B 140 10.500 -4.520 25.086 1.00 0.00 H ATOM 5876 HB3 LEU B 140 9.255 -3.248 25.087 1.00 0.00 H ATOM 5877 HG LEU B 140 10.837 -4.388 27.324 1.00 0.00 H ATOM 5878 HD21 LEU B 140 8.278 -2.768 27.577 1.00 0.00 H ATOM 5879 HD22 LEU B 140 8.528 -4.450 28.105 1.00 0.00 H ATOM 5880 HD23 LEU B 140 9.399 -3.124 28.914 1.00 0.00 H ATOM 5881 HD11 LEU B 140 11.830 -2.502 26.253 1.00 0.00 H ATOM 5882 HD12 LEU B 140 10.342 -1.547 26.463 1.00 0.00 H ATOM 5883 HD13 LEU B 140 11.284 -2.052 27.887 1.00 0.00 H ATOM 5884 H LEU B 140 9.897 -6.622 26.416 1.00 0.00 H ATOM 5885 N THR B 141 8.897 -6.225 23.336 1.00 27.10 N ATOM 5886 CA THR B 141 8.512 -6.507 21.965 1.00 26.41 C ATOM 5887 C THR B 141 7.039 -6.943 21.851 1.00 24.73 C ATOM 5888 O THR B 141 6.343 -6.487 20.953 1.00 27.41 O ATOM 5889 CB THR B 141 9.400 -7.528 21.311 1.00 27.16 C ATOM 5890 OG1 THR B 141 10.771 -7.085 21.365 1.00 31.21 O ATOM 5891 CG2 THR B 141 8.937 -7.797 19.844 1.00 20.22 C ATOM 5892 HA THR B 141 8.635 -5.565 21.431 1.00 0.00 H ATOM 5893 HB THR B 141 9.326 -8.472 21.852 1.00 0.00 H ATOM 5894 HG1 THR B 141 11.042 -6.970 22.310 1.00 0.00 H ATOM 5895 HG23 THR B 141 7.899 -8.129 19.847 1.00 0.00 H ATOM 5896 HG21 THR B 141 9.025 -6.879 19.263 1.00 0.00 H ATOM 5897 HG22 THR B 141 9.566 -8.570 19.402 1.00 0.00 H ATOM 5898 H THR B 141 9.740 -6.667 23.755 1.00 0.00 H ATOM 5899 N VAL B 142 6.545 -7.802 22.736 1.00 24.03 N ATOM 5900 CA VAL B 142 5.128 -8.243 22.560 1.00 29.77 C ATOM 5901 C VAL B 142 4.124 -7.257 23.095 1.00 21.48 C ATOM 5902 O VAL B 142 3.077 -7.081 22.511 1.00 33.80 O ATOM 5903 CB VAL B 142 4.785 -9.773 22.876 1.00 25.57 C ATOM 5904 CG1 VAL B 142 5.776 -10.428 23.744 1.00 38.85 C ATOM 5905 CG2 VAL B 142 3.483 -9.886 23.494 1.00 25.53 C ATOM 5906 HA VAL B 142 5.020 -8.232 21.475 1.00 0.00 H ATOM 5907 HB VAL B 142 4.800 -10.282 21.912 1.00 0.00 H ATOM 5908 HG11 VAL B 142 6.753 -10.404 23.260 1.00 0.00 H ATOM 5909 HG12 VAL B 142 5.828 -9.901 24.696 1.00 0.00 H ATOM 5910 HG13 VAL B 142 5.479 -11.463 23.916 1.00 0.00 H ATOM 5911 HG21 VAL B 142 3.475 -9.322 24.427 1.00 0.00 H ATOM 5912 HG22 VAL B 142 2.726 -9.486 22.819 1.00 0.00 H ATOM 5913 HG23 VAL B 142 3.270 -10.935 23.700 1.00 0.00 H ATOM 5914 H VAL B 142 7.124 -8.155 23.524 1.00 0.00 H ATOM 5915 N VAL B 143 4.465 -6.552 24.157 1.00 25.93 N ATOM 5916 CA VAL B 143 3.626 -5.452 24.603 1.00 23.25 C ATOM 5917 C VAL B 143 3.468 -4.457 23.487 1.00 18.91 C ATOM 5918 O VAL B 143 2.357 -4.027 23.177 1.00 29.59 O ATOM 5919 CB VAL B 143 4.094 -4.740 25.907 1.00 24.17 C ATOM 5920 CG1 VAL B 143 3.203 -3.514 26.172 1.00 15.22 C ATOM 5921 CG2 VAL B 143 4.059 -5.719 27.101 1.00 15.61 C ATOM 5922 HA VAL B 143 2.668 -5.901 24.866 1.00 0.00 H ATOM 5923 HB VAL B 143 5.124 -4.404 25.784 1.00 0.00 H ATOM 5924 HG11 VAL B 143 3.280 -2.823 25.333 1.00 0.00 H ATOM 5925 HG12 VAL B 143 2.168 -3.836 26.285 1.00 0.00 H ATOM 5926 HG13 VAL B 143 3.532 -3.018 27.085 1.00 0.00 H ATOM 5927 HG21 VAL B 143 3.041 -6.083 27.241 1.00 0.00 H ATOM 5928 HG22 VAL B 143 4.722 -6.560 26.899 1.00 0.00 H ATOM 5929 HG23 VAL B 143 4.389 -5.203 28.002 1.00 0.00 H ATOM 5930 H VAL B 143 5.336 -6.784 24.676 1.00 0.00 H ATOM 5931 N LEU B 144 4.545 -4.092 22.852 1.00 20.53 N ATOM 5932 CA LEU B 144 4.360 -3.156 21.736 1.00 27.58 C ATOM 5933 C LEU B 144 3.294 -3.683 20.763 1.00 28.24 C ATOM 5934 O LEU B 144 2.324 -2.942 20.424 1.00 24.15 O ATOM 5935 CB LEU B 144 5.679 -2.845 21.011 1.00 26.50 C ATOM 5936 CG LEU B 144 5.756 -1.826 19.838 1.00 32.86 C ATOM 5937 CD1 LEU B 144 5.355 -0.379 20.189 1.00 28.31 C ATOM 5938 CD2 LEU B 144 7.170 -1.847 19.240 1.00 25.46 C ATOM 5939 HA LEU B 144 4.008 -2.213 22.154 1.00 0.00 H ATOM 5940 HB2 LEU B 144 6.369 -2.485 21.774 1.00 0.00 H ATOM 5941 HB3 LEU B 144 6.041 -3.794 20.615 1.00 0.00 H ATOM 5942 HG LEU B 144 5.010 -2.155 19.115 1.00 0.00 H ATOM 5943 HD21 LEU B 144 7.893 -1.574 20.009 1.00 0.00 H ATOM 5944 HD22 LEU B 144 7.392 -2.848 18.870 1.00 0.00 H ATOM 5945 HD23 LEU B 144 7.226 -1.134 18.418 1.00 0.00 H ATOM 5946 HD11 LEU B 144 4.324 -0.365 20.543 1.00 0.00 H ATOM 5947 HD12 LEU B 144 6.014 -0.000 20.970 1.00 0.00 H ATOM 5948 HD13 LEU B 144 5.445 0.247 19.301 1.00 0.00 H ATOM 5949 H LEU B 144 5.486 -4.445 23.121 1.00 0.00 H ATOM 5950 N LYS B 145 3.467 -4.953 20.363 1.00 18.07 N ATOM 5951 CA LYS B 145 2.603 -5.580 19.374 1.00 20.45 C ATOM 5952 C LYS B 145 1.150 -5.488 19.805 1.00 22.64 C ATOM 5953 O LYS B 145 0.316 -4.981 19.056 1.00 25.96 O ATOM 5954 CB LYS B 145 3.052 -7.034 19.067 1.00 23.76 C ATOM 5955 CG LYS B 145 4.347 -7.125 18.159 1.00 20.97 C ATOM 5956 CD LYS B 145 5.031 -8.523 18.119 1.00 22.47 C ATOM 5957 CE LYS B 145 4.276 -9.485 17.159 1.00 21.60 C ATOM 5958 NZ LYS B 145 4.235 -8.940 15.785 1.00 20.57 N ATOM 5959 HA LYS B 145 2.694 -5.034 18.435 1.00 0.00 H ATOM 5960 HB2 LYS B 145 3.258 -7.537 20.012 1.00 0.00 H ATOM 5961 HB3 LYS B 145 2.236 -7.545 18.555 1.00 0.00 H ATOM 5962 HG2 LYS B 145 4.065 -6.858 17.141 1.00 0.00 H ATOM 5963 HG3 LYS B 145 5.074 -6.404 18.534 1.00 0.00 H ATOM 5964 HD2 LYS B 145 6.058 -8.408 17.773 1.00 0.00 H ATOM 5965 HD3 LYS B 145 5.032 -8.949 19.122 1.00 0.00 H ATOM 5966 HE2 LYS B 145 3.256 -9.621 17.519 1.00 0.00 H ATOM 5967 HE3 LYS B 145 4.786 -10.448 17.145 1.00 0.00 H ATOM 5968 HZ1 LYS B 145 3.745 -8.023 15.792 1.00 0.00 H ATOM 5969 HZ2 LYS B 145 5.206 -8.813 15.435 1.00 0.00 H ATOM 5970 HZ3 LYS B 145 3.725 -9.602 15.166 1.00 0.00 H ATOM 5971 H LYS B 145 4.245 -5.507 20.774 1.00 0.00 H ATOM 5972 N LEU B 146 0.843 -5.921 21.022 1.00 17.30 N ATOM 5973 CA LEU B 146 -0.529 -5.893 21.465 1.00 23.25 C ATOM 5974 C LEU B 146 -1.048 -4.479 21.420 1.00 23.34 C ATOM 5975 O LEU B 146 -2.167 -4.257 20.980 1.00 33.17 O ATOM 5976 CB LEU B 146 -0.640 -6.409 22.910 1.00 31.83 C ATOM 5977 CG LEU B 146 -0.097 -7.838 23.011 1.00 37.84 C ATOM 5978 CD1 LEU B 146 0.170 -8.298 24.471 1.00 39.30 C ATOM 5979 CD2 LEU B 146 -1.079 -8.728 22.322 1.00 26.64 C ATOM 5980 HA LEU B 146 -1.115 -6.532 20.805 1.00 0.00 H ATOM 5981 HB2 LEU B 146 -0.065 -5.759 23.569 1.00 0.00 H ATOM 5982 HB3 LEU B 146 -1.686 -6.400 23.215 1.00 0.00 H ATOM 5983 HG LEU B 146 0.881 -7.886 22.531 1.00 0.00 H ATOM 5984 HD21 LEU B 146 -2.048 -8.648 22.815 1.00 0.00 H ATOM 5985 HD22 LEU B 146 -1.174 -8.424 21.280 1.00 0.00 H ATOM 5986 HD23 LEU B 146 -0.729 -9.759 22.371 1.00 0.00 H ATOM 5987 HD11 LEU B 146 0.904 -7.636 24.931 1.00 0.00 H ATOM 5988 HD12 LEU B 146 -0.760 -8.261 25.038 1.00 0.00 H ATOM 5989 HD13 LEU B 146 0.553 -9.319 24.465 1.00 0.00 H ATOM 5990 H LEU B 146 1.589 -6.279 21.653 1.00 0.00 H ATOM 5991 N LEU B 147 -0.261 -3.522 21.912 1.00 20.83 N ATOM 5992 CA LEU B 147 -0.638 -2.105 21.821 1.00 22.67 C ATOM 5993 C LEU B 147 -1.061 -1.711 20.395 1.00 19.54 C ATOM 5994 O LEU B 147 -2.119 -1.156 20.170 1.00 19.02 O ATOM 5995 CB LEU B 147 0.466 -1.182 22.370 1.00 18.65 C ATOM 5996 CG LEU B 147 0.644 -1.154 23.910 1.00 19.20 C ATOM 5997 CD1 LEU B 147 1.837 -0.253 24.270 1.00 13.29 C ATOM 5998 CD2 LEU B 147 -0.598 -0.615 24.628 1.00 21.77 C ATOM 5999 HA LEU B 147 -1.512 -1.968 22.457 1.00 0.00 H ATOM 6000 HB2 LEU B 147 1.412 -1.501 21.933 1.00 0.00 H ATOM 6001 HB3 LEU B 147 0.241 -0.166 22.044 1.00 0.00 H ATOM 6002 HG LEU B 147 0.811 -2.181 24.235 1.00 0.00 H ATOM 6003 HD21 LEU B 147 -0.798 0.402 24.292 1.00 0.00 H ATOM 6004 HD22 LEU B 147 -1.454 -1.250 24.397 1.00 0.00 H ATOM 6005 HD23 LEU B 147 -0.423 -0.616 25.704 1.00 0.00 H ATOM 6006 HD11 LEU B 147 2.741 -0.647 23.806 1.00 0.00 H ATOM 6007 HD12 LEU B 147 1.650 0.757 23.906 1.00 0.00 H ATOM 6008 HD13 LEU B 147 1.962 -0.233 25.353 1.00 0.00 H ATOM 6009 H LEU B 147 0.636 -3.783 22.369 1.00 0.00 H ATOM 6010 N GLN B 148 -0.254 -2.087 19.437 1.00 20.93 N ATOM 6011 CA GLN B 148 -0.504 -1.759 18.080 1.00 24.24 C ATOM 6012 C GLN B 148 -1.703 -2.511 17.543 1.00 28.10 C ATOM 6013 O GLN B 148 -2.438 -1.957 16.745 1.00 35.27 O ATOM 6014 CB GLN B 148 0.758 -2.035 17.266 1.00 19.46 C ATOM 6015 CG GLN B 148 1.879 -1.132 17.734 1.00 29.22 C ATOM 6016 CD GLN B 148 1.558 0.311 17.394 1.00 34.68 C ATOM 6017 OE1 GLN B 148 0.919 0.579 16.355 1.00 42.19 O ATOM 6018 NE2 GLN B 148 1.969 1.244 18.246 1.00 30.23 N ATOM 6019 HA GLN B 148 -0.750 -0.700 18.000 1.00 0.00 H ATOM 6020 HB2 GLN B 148 1.053 -3.076 17.397 1.00 0.00 H ATOM 6021 HB3 GLN B 148 0.557 -1.846 16.211 1.00 0.00 H ATOM 6022 HG2 GLN B 148 1.997 -1.232 18.813 1.00 0.00 H ATOM 6023 HG3 GLN B 148 2.807 -1.422 17.240 1.00 0.00 H ATOM 6024 HE22 GLN B 148 2.499 0.972 19.099 1.00 0.00 H ATOM 6025 HE21 GLN B 148 1.761 2.246 18.060 1.00 0.00 H ATOM 6026 H GLN B 148 0.593 -2.641 19.676 1.00 0.00 H ATOM 6027 N ILE B 149 -1.919 -3.762 17.960 1.00 32.92 N ATOM 6028 CA ILE B 149 -3.091 -4.488 17.476 1.00 30.43 C ATOM 6029 C ILE B 149 -4.394 -3.936 18.040 1.00 32.63 C ATOM 6030 O ILE B 149 -5.348 -3.683 17.303 1.00 39.31 O ATOM 6031 CB ILE B 149 -2.997 -5.962 17.762 1.00 30.11 C ATOM 6032 CG1 ILE B 149 -1.861 -6.574 16.912 1.00 29.15 C ATOM 6033 CG2 ILE B 149 -4.350 -6.625 17.494 1.00 24.61 C ATOM 6034 CD1 ILE B 149 -1.283 -7.855 17.503 1.00 27.39 C ATOM 6035 HA ILE B 149 -3.102 -4.342 16.396 1.00 0.00 H ATOM 6036 HB ILE B 149 -2.755 -6.134 18.811 1.00 0.00 H ATOM 6037 HG12 ILE B 149 -2.254 -6.798 15.920 1.00 0.00 H ATOM 6038 HG13 ILE B 149 -1.059 -5.840 16.827 1.00 0.00 H ATOM 6039 HD11 ILE B 149 -0.875 -7.646 18.492 1.00 0.00 H ATOM 6040 HD12 ILE B 149 -2.071 -8.604 17.584 1.00 0.00 H ATOM 6041 HD13 ILE B 149 -0.491 -8.228 16.854 1.00 0.00 H ATOM 6042 HG21 ILE B 149 -5.106 -6.178 18.139 1.00 0.00 H ATOM 6043 HG22 ILE B 149 -4.626 -6.475 16.450 1.00 0.00 H ATOM 6044 HG23 ILE B 149 -4.278 -7.692 17.702 1.00 0.00 H ATOM 6045 H ILE B 149 -1.259 -4.215 18.623 1.00 0.00 H ATOM 6046 N VAL B 150 -4.431 -3.720 19.342 1.00 30.72 N ATOM 6047 CA VAL B 150 -5.682 -3.341 20.006 1.00 27.37 C ATOM 6048 C VAL B 150 -5.891 -1.811 20.108 1.00 32.64 C ATOM 6049 O VAL B 150 -7.037 -1.358 20.135 1.00 28.44 O ATOM 6050 CB VAL B 150 -5.761 -4.063 21.373 1.00 28.76 C ATOM 6051 CG1 VAL B 150 -6.933 -3.591 22.207 1.00 29.15 C ATOM 6052 CG2 VAL B 150 -5.734 -5.628 21.171 1.00 27.33 C ATOM 6053 HA VAL B 150 -6.516 -3.671 19.386 1.00 0.00 H ATOM 6054 HB VAL B 150 -4.876 -3.795 21.950 1.00 0.00 H ATOM 6055 HG11 VAL B 150 -6.836 -2.522 22.395 1.00 0.00 H ATOM 6056 HG12 VAL B 150 -7.861 -3.784 21.669 1.00 0.00 H ATOM 6057 HG13 VAL B 150 -6.942 -4.129 23.155 1.00 0.00 H ATOM 6058 HG21 VAL B 150 -6.585 -5.929 20.560 1.00 0.00 H ATOM 6059 HG22 VAL B 150 -4.808 -5.913 20.671 1.00 0.00 H ATOM 6060 HG23 VAL B 150 -5.790 -6.119 22.142 1.00 0.00 H ATOM 6061 H VAL B 150 -3.562 -3.820 19.904 1.00 0.00 H ATOM 6062 N ARG B 151 -4.793 -1.039 20.142 1.00 29.99 N ATOM 6063 CA ARG B 151 -4.806 0.402 20.276 1.00 33.60 C ATOM 6064 C ARG B 151 -5.792 0.758 21.355 1.00 28.22 C ATOM 6065 O ARG B 151 -6.789 1.342 21.053 1.00 24.29 O ATOM 6066 CB ARG B 151 -5.158 1.135 18.940 1.00 36.12 C ATOM 6067 CG ARG B 151 -4.101 0.989 17.836 1.00 44.66 C ATOM 6068 CD ARG B 151 -4.404 1.716 16.463 1.00 54.70 C ATOM 6069 NE ARG B 151 -5.588 1.192 15.750 1.00 68.13 N ATOM 6070 CZ ARG B 151 -5.802 -0.091 15.388 1.00 69.13 C ATOM 6071 NH1 ARG B 151 -4.927 -1.058 15.652 1.00 60.55 N ATOM 6072 NH2 ARG B 151 -6.935 -0.419 14.769 1.00 68.62 N ATOM 6073 HA ARG B 151 -3.803 0.736 20.540 1.00 0.00 H ATOM 6074 HB2 ARG B 151 -6.099 0.730 18.567 1.00 0.00 H ATOM 6075 HB3 ARG B 151 -5.281 2.196 19.156 1.00 0.00 H ATOM 6076 HG2 ARG B 151 -3.163 1.388 18.222 1.00 0.00 H ATOM 6077 HG3 ARG B 151 -3.984 -0.075 17.628 1.00 0.00 H ATOM 6078 HD2 ARG B 151 -3.535 1.600 15.815 1.00 0.00 H ATOM 6079 HD3 ARG B 151 -4.567 2.775 16.665 1.00 0.00 H ATOM 6080 HE ARG B 151 -6.329 1.879 15.503 1.00 0.00 H ATOM 6081 HH12 ARG B 151 -5.127 -2.035 15.357 1.00 0.00 H ATOM 6082 HH11 ARG B 151 -4.043 -0.837 16.153 1.00 0.00 H ATOM 6083 HH22 ARG B 151 -7.107 -1.405 14.487 1.00 0.00 H ATOM 6084 HH21 ARG B 151 -7.648 0.311 14.568 1.00 0.00 H ATOM 6085 H ARG B 151 -3.869 -1.509 20.067 1.00 0.00 H ATOM 6086 N PRO B 152 -5.522 0.382 22.624 1.00 34.05 N ATOM 6087 CA PRO B 152 -6.428 0.721 23.736 1.00 26.87 C ATOM 6088 C PRO B 152 -6.189 2.161 24.234 1.00 24.86 C ATOM 6089 O PRO B 152 -5.166 2.757 23.922 1.00 27.94 O ATOM 6090 CB PRO B 152 -5.962 -0.255 24.826 1.00 25.57 C ATOM 6091 CG PRO B 152 -4.439 -0.340 24.564 1.00 23.60 C ATOM 6092 CD PRO B 152 -4.330 -0.379 23.098 1.00 31.55 C ATOM 6093 HA PRO B 152 -7.481 0.654 23.463 1.00 0.00 H ATOM 6094 HD3 PRO B 152 -3.408 0.098 22.765 1.00 0.00 H ATOM 6095 HD2 PRO B 152 -4.357 -1.406 22.735 1.00 0.00 H ATOM 6096 HG3 PRO B 152 -4.019 -1.243 25.008 1.00 0.00 H ATOM 6097 HG2 PRO B 152 -3.927 0.534 24.967 1.00 0.00 H ATOM 6098 HB2 PRO B 152 -6.170 0.136 25.822 1.00 0.00 H ATOM 6099 HB3 PRO B 152 -6.437 -1.229 24.713 1.00 0.00 H ATOM 6100 N ASP B 153 -7.083 2.701 25.047 1.00 20.72 N ATOM 6101 CA ASP B 153 -6.853 4.010 25.627 1.00 29.48 C ATOM 6102 C ASP B 153 -5.908 3.869 26.804 1.00 35.82 C ATOM 6103 O ASP B 153 -4.932 4.660 26.964 1.00 38.39 O ATOM 6104 CB ASP B 153 -8.189 4.652 26.018 1.00 35.34 C ATOM 6105 CG ASP B 153 -8.986 5.039 24.806 1.00 40.75 C ATOM 6106 OD1 ASP B 153 -8.619 6.056 24.199 1.00 46.22 O ATOM 6107 OD2 ASP B 153 -9.916 4.302 24.405 1.00 49.14 O ATOM 6108 HA ASP B 153 -6.385 4.674 24.900 1.00 0.00 H ATOM 6109 HB2 ASP B 153 -8.765 3.940 26.609 1.00 0.00 H ATOM 6110 HB3 ASP B 153 -7.994 5.544 26.614 1.00 0.00 H ATOM 6111 H ASP B 153 -7.956 2.183 25.271 1.00 0.00 H ATOM 6112 N ARG B 154 -6.177 2.822 27.589 1.00 29.17 N ATOM 6113 CA ARG B 154 -5.392 2.491 28.739 1.00 33.31 C ATOM 6114 C ARG B 154 -4.964 1.046 28.650 1.00 33.58 C ATOM 6115 O ARG B 154 -5.699 0.194 28.124 1.00 37.76 O ATOM 6116 CB ARG B 154 -6.209 2.683 30.010 1.00 34.07 C ATOM 6117 CG ARG B 154 -6.485 4.102 30.322 1.00 35.65 C ATOM 6118 CD ARG B 154 -7.591 4.271 31.335 1.00 38.91 C ATOM 6119 NE ARG B 154 -8.056 5.660 31.343 1.00 45.77 N ATOM 6120 CZ ARG B 154 -8.820 6.211 32.287 1.00 47.13 C ATOM 6121 NH1 ARG B 154 -9.226 5.506 33.333 1.00 47.61 N ATOM 6122 NH2 ARG B 154 -9.172 7.477 32.185 1.00 44.03 N ATOM 6123 HA ARG B 154 -4.520 3.144 28.769 1.00 0.00 H ATOM 6124 HB2 ARG B 154 -7.160 2.164 29.892 1.00 0.00 H ATOM 6125 HB3 ARG B 154 -5.659 2.246 30.844 1.00 0.00 H ATOM 6126 HG2 ARG B 154 -5.576 4.555 30.718 1.00 0.00 H ATOM 6127 HG3 ARG B 154 -6.773 4.612 29.403 1.00 0.00 H ATOM 6128 HD2 ARG B 154 -7.217 4.010 32.325 1.00 0.00 H ATOM 6129 HD3 ARG B 154 -8.421 3.614 31.076 1.00 0.00 H ATOM 6130 HE ARG B 154 -7.767 6.265 30.548 1.00 0.00 H ATOM 6131 HH12 ARG B 154 -9.821 5.951 34.060 1.00 0.00 H ATOM 6132 HH11 ARG B 154 -8.949 4.508 33.427 1.00 0.00 H ATOM 6133 HH22 ARG B 154 -9.768 7.912 32.918 1.00 0.00 H ATOM 6134 HH21 ARG B 154 -8.854 8.041 31.371 1.00 0.00 H ATOM 6135 H ARG B 154 -6.993 2.221 27.354 1.00 0.00 H ATOM 6136 N VAL B 155 -3.780 0.778 29.184 1.00 27.06 N ATOM 6137 CA VAL B 155 -3.301 -0.574 29.308 1.00 29.11 C ATOM 6138 C VAL B 155 -2.859 -0.824 30.781 1.00 33.27 C ATOM 6139 O VAL B 155 -2.279 0.098 31.412 1.00 32.97 O ATOM 6140 CB VAL B 155 -2.159 -0.812 28.319 1.00 26.33 C ATOM 6141 CG1 VAL B 155 -0.916 -0.017 28.761 1.00 19.80 C ATOM 6142 CG2 VAL B 155 -1.833 -2.281 28.280 1.00 23.47 C ATOM 6143 HA VAL B 155 -4.094 -1.282 29.066 1.00 0.00 H ATOM 6144 HB VAL B 155 -2.462 -0.479 27.326 1.00 0.00 H ATOM 6145 HG11 VAL B 155 -1.157 1.046 28.788 1.00 0.00 H ATOM 6146 HG12 VAL B 155 -0.610 -0.346 29.754 1.00 0.00 H ATOM 6147 HG13 VAL B 155 -0.105 -0.190 28.053 1.00 0.00 H ATOM 6148 HG21 VAL B 155 -1.531 -2.611 29.274 1.00 0.00 H ATOM 6149 HG22 VAL B 155 -2.714 -2.839 27.963 1.00 0.00 H ATOM 6150 HG23 VAL B 155 -1.019 -2.453 27.576 1.00 0.00 H ATOM 6151 H VAL B 155 -3.185 1.562 29.520 1.00 0.00 H ATOM 6152 N PHE B 156 -3.122 -2.049 31.292 1.00 31.74 N ATOM 6153 CA PHE B 156 -3.047 -2.448 32.756 1.00 34.62 C ATOM 6154 C PHE B 156 -2.004 -3.558 33.137 1.00 29.20 C ATOM 6155 O PHE B 156 -1.971 -4.638 32.547 1.00 24.45 O ATOM 6156 CB PHE B 156 -4.449 -2.863 33.327 1.00 31.99 C ATOM 6157 CG PHE B 156 -5.460 -1.776 33.259 1.00 31.19 C ATOM 6158 CD1 PHE B 156 -6.152 -1.517 32.069 1.00 34.16 C ATOM 6159 CD2 PHE B 156 -5.735 -1.004 34.364 1.00 32.81 C ATOM 6160 CE1 PHE B 156 -7.109 -0.484 31.985 1.00 38.61 C ATOM 6161 CE2 PHE B 156 -6.688 0.047 34.305 1.00 27.27 C ATOM 6162 CZ PHE B 156 -7.385 0.302 33.131 1.00 33.46 C ATOM 6163 HA PHE B 156 -2.686 -1.529 33.219 1.00 0.00 H ATOM 6164 HB2 PHE B 156 -4.817 -3.714 32.754 1.00 0.00 H ATOM 6165 HB3 PHE B 156 -4.325 -3.155 34.370 1.00 0.00 H ATOM 6166 HD2 PHE B 156 -5.213 -1.202 35.300 1.00 0.00 H ATOM 6167 HE2 PHE B 156 -6.874 0.658 35.188 1.00 0.00 H ATOM 6168 HZ PHE B 156 -8.133 1.094 33.092 1.00 0.00 H ATOM 6169 HE1 PHE B 156 -7.631 -0.292 31.048 1.00 0.00 H ATOM 6170 HD1 PHE B 156 -5.947 -2.127 31.189 1.00 0.00 H ATOM 6171 H PHE B 156 -3.403 -2.789 30.617 1.00 0.00 H ATOM 6172 N PHE B 157 -1.178 -3.254 34.143 1.00 28.59 N ATOM 6173 CA PHE B 157 -0.218 -4.177 34.703 1.00 22.90 C ATOM 6174 C PHE B 157 -0.178 -4.155 36.260 1.00 26.23 C ATOM 6175 O PHE B 157 -0.499 -3.152 36.913 1.00 25.44 O ATOM 6176 CB PHE B 157 1.153 -3.895 34.102 1.00 28.70 C ATOM 6177 CG PHE B 157 1.235 -4.135 32.615 1.00 25.89 C ATOM 6178 CD1 PHE B 157 1.387 -5.424 32.110 1.00 25.28 C ATOM 6179 CD2 PHE B 157 1.187 -3.071 31.718 1.00 27.26 C ATOM 6180 CE1 PHE B 157 1.450 -5.675 30.721 1.00 23.49 C ATOM 6181 CE2 PHE B 157 1.267 -3.310 30.301 1.00 21.62 C ATOM 6182 CZ PHE B 157 1.400 -4.611 29.823 1.00 23.88 C ATOM 6183 HA PHE B 157 -0.533 -5.187 34.441 1.00 0.00 H ATOM 6184 HB2 PHE B 157 1.404 -2.852 34.295 1.00 0.00 H ATOM 6185 HB3 PHE B 157 1.882 -4.539 34.594 1.00 0.00 H ATOM 6186 HD2 PHE B 157 1.088 -2.052 32.091 1.00 0.00 H ATOM 6187 HE2 PHE B 157 1.224 -2.474 29.603 1.00 0.00 H ATOM 6188 HZ PHE B 157 1.465 -4.796 28.751 1.00 0.00 H ATOM 6189 HE1 PHE B 157 1.537 -6.697 30.353 1.00 0.00 H ATOM 6190 HD1 PHE B 157 1.459 -6.261 32.804 1.00 0.00 H ATOM 6191 H PHE B 157 -1.229 -2.297 34.546 1.00 0.00 H ATOM 6192 N GLY B 158 0.167 -5.297 36.850 1.00 30.52 N ATOM 6193 CA GLY B 158 0.283 -5.398 38.278 1.00 27.03 C ATOM 6194 C GLY B 158 1.651 -4.890 38.702 1.00 33.51 C ATOM 6195 O GLY B 158 2.671 -5.081 37.974 1.00 27.78 O ATOM 6196 HA3 GLY B 158 0.170 -6.439 38.581 1.00 0.00 H ATOM 6197 HA2 GLY B 158 -0.493 -4.796 38.751 1.00 0.00 H ATOM 6198 H GLY B 158 0.357 -6.135 36.264 1.00 0.00 H ATOM 6199 N GLU B 159 1.669 -4.269 39.890 1.00 29.44 N ATOM 6200 CA GLU B 159 2.892 -3.727 40.490 1.00 27.89 C ATOM 6201 C GLU B 159 3.720 -4.853 40.997 1.00 30.03 C ATOM 6202 O GLU B 159 4.894 -4.687 41.322 1.00 30.51 O ATOM 6203 CB GLU B 159 2.549 -2.806 41.668 1.00 32.17 C ATOM 6204 CG GLU B 159 1.858 -1.514 41.303 1.00 22.10 C ATOM 6205 CD GLU B 159 1.456 -0.729 42.506 1.00 30.32 C ATOM 6206 OE1 GLU B 159 1.603 -1.220 43.651 1.00 35.46 O ATOM 6207 OE2 GLU B 159 0.976 0.411 42.305 1.00 35.88 O ATOM 6208 HA GLU B 159 3.433 -3.158 39.734 1.00 0.00 H ATOM 6209 HB2 GLU B 159 1.897 -3.356 42.346 1.00 0.00 H ATOM 6210 HB3 GLU B 159 3.478 -2.557 42.182 1.00 0.00 H ATOM 6211 HG2 GLU B 159 2.537 -0.911 40.701 1.00 0.00 H ATOM 6212 HG3 GLU B 159 0.966 -1.745 40.721 1.00 0.00 H ATOM 6213 H GLU B 159 0.774 -4.167 40.410 1.00 0.00 H ATOM 6214 N LYS B 160 3.061 -5.998 41.106 1.00 34.47 N ATOM 6215 CA LYS B 160 3.695 -7.218 41.507 1.00 37.14 C ATOM 6216 C LYS B 160 5.038 -7.353 40.791 1.00 34.30 C ATOM 6217 O LYS B 160 6.055 -7.661 41.431 1.00 33.91 O ATOM 6218 CB LYS B 160 2.755 -8.409 41.188 1.00 41.73 C ATOM 6219 CG LYS B 160 3.466 -9.772 41.189 1.00 38.54 C ATOM 6220 CD LYS B 160 2.873 -10.714 42.184 1.00 40.48 C ATOM 6221 CE LYS B 160 3.917 -11.620 42.764 1.00 37.67 C ATOM 6222 NZ LYS B 160 5.153 -11.689 41.976 1.00 37.80 N ATOM 6223 HA LYS B 160 3.886 -7.213 42.580 1.00 0.00 H ATOM 6224 HB2 LYS B 160 1.963 -8.433 41.936 1.00 0.00 H ATOM 6225 HB3 LYS B 160 2.318 -8.249 40.202 1.00 0.00 H ATOM 6226 HG2 LYS B 160 3.384 -10.212 40.195 1.00 0.00 H ATOM 6227 HG3 LYS B 160 4.518 -9.620 41.432 1.00 0.00 H ATOM 6228 HD2 LYS B 160 2.414 -10.139 42.989 1.00 0.00 H ATOM 6229 HD3 LYS B 160 2.111 -11.319 41.691 1.00 0.00 H ATOM 6230 HE2 LYS B 160 3.499 -12.624 42.835 1.00 0.00 H ATOM 6231 HE3 LYS B 160 4.166 -11.261 43.762 1.00 0.00 H ATOM 6232 HZ1 LYS B 160 4.935 -12.042 41.022 1.00 0.00 H ATOM 6233 HZ2 LYS B 160 5.573 -10.740 41.908 1.00 0.00 H ATOM 6234 HZ3 LYS B 160 5.824 -12.334 42.441 1.00 0.00 H ATOM 6235 H LYS B 160 2.043 -6.011 40.892 1.00 0.00 H ATOM 6236 N ASP B 161 4.989 -7.155 39.463 1.00 33.85 N ATOM 6237 CA ASP B 161 6.136 -7.136 38.552 1.00 33.57 C ATOM 6238 C ASP B 161 6.428 -5.666 38.248 1.00 30.37 C ATOM 6239 O ASP B 161 6.224 -5.167 37.130 1.00 24.72 O ATOM 6240 CB ASP B 161 5.816 -7.840 37.218 1.00 34.80 C ATOM 6241 CG ASP B 161 5.538 -9.292 37.378 1.00 37.75 C ATOM 6242 OD1 ASP B 161 6.503 -10.050 37.588 1.00 40.01 O ATOM 6243 OD2 ASP B 161 4.354 -9.674 37.267 1.00 38.58 O ATOM 6244 HA ASP B 161 6.976 -7.653 39.016 1.00 0.00 H ATOM 6245 HB2 ASP B 161 4.940 -7.365 36.776 1.00 0.00 H ATOM 6246 HB3 ASP B 161 6.668 -7.721 36.549 1.00 0.00 H ATOM 6247 H ASP B 161 4.050 -7.001 39.043 1.00 0.00 H ATOM 6248 N TYR B 162 6.935 -5.000 39.261 1.00 25.01 N ATOM 6249 CA TYR B 162 7.242 -3.603 39.210 1.00 26.40 C ATOM 6250 C TYR B 162 8.297 -3.156 38.182 1.00 25.00 C ATOM 6251 O TYR B 162 8.145 -2.086 37.588 1.00 26.14 O ATOM 6252 CB TYR B 162 7.635 -3.135 40.612 1.00 23.80 C ATOM 6253 CG TYR B 162 7.607 -1.642 40.740 1.00 19.11 C ATOM 6254 CD1 TYR B 162 6.382 -0.955 40.852 1.00 23.34 C ATOM 6255 CD2 TYR B 162 8.792 -0.903 40.736 1.00 17.00 C ATOM 6256 CE1 TYR B 162 6.358 0.450 40.942 1.00 25.00 C ATOM 6257 CE2 TYR B 162 8.778 0.498 40.843 1.00 14.01 C ATOM 6258 CZ TYR B 162 7.574 1.150 40.929 1.00 17.43 C ATOM 6259 OH TYR B 162 7.564 2.495 40.997 1.00 24.53 O ATOM 6260 HA TYR B 162 6.329 -3.127 38.853 1.00 0.00 H ATOM 6261 HB3 TYR B 162 8.643 -3.487 40.830 1.00 0.00 H ATOM 6262 HB2 TYR B 162 6.938 -3.562 41.333 1.00 0.00 H ATOM 6263 HD2 TYR B 162 9.746 -1.423 40.648 1.00 0.00 H ATOM 6264 HE2 TYR B 162 9.712 1.060 40.857 1.00 0.00 H ATOM 6265 HE1 TYR B 162 5.411 0.985 41.020 1.00 0.00 H ATOM 6266 HD1 TYR B 162 5.447 -1.515 40.869 1.00 0.00 H ATOM 6267 HH TYR B 162 7.992 2.868 40.186 1.00 0.00 H ATOM 6268 H TYR B 162 7.123 -5.514 40.145 1.00 0.00 H ATOM 6269 N GLN B 163 9.387 -3.902 38.015 1.00 29.00 N ATOM 6270 CA GLN B 163 10.447 -3.524 37.008 1.00 30.08 C ATOM 6271 C GLN B 163 9.893 -3.590 35.541 1.00 28.56 C ATOM 6272 O GLN B 163 10.088 -2.705 34.702 1.00 28.31 O ATOM 6273 CB GLN B 163 11.654 -4.423 37.168 1.00 23.84 C ATOM 6274 CG GLN B 163 12.667 -4.257 36.095 1.00 23.86 C ATOM 6275 CD GLN B 163 13.920 -5.054 36.393 1.00 28.26 C ATOM 6276 OE1 GLN B 163 13.886 -6.013 37.164 1.00 27.28 O ATOM 6277 NE2 GLN B 163 15.036 -4.669 35.775 1.00 23.18 N ATOM 6278 HA GLN B 163 10.746 -2.493 37.197 1.00 0.00 H ATOM 6279 HB2 GLN B 163 12.126 -4.200 38.125 1.00 0.00 H ATOM 6280 HB3 GLN B 163 11.315 -5.459 37.165 1.00 0.00 H ATOM 6281 HG2 GLN B 163 12.244 -4.600 35.151 1.00 0.00 H ATOM 6282 HG3 GLN B 163 12.928 -3.202 36.013 1.00 0.00 H ATOM 6283 HE22 GLN B 163 15.019 -3.852 35.131 1.00 0.00 H ATOM 6284 HE21 GLN B 163 15.924 -5.185 35.936 1.00 0.00 H ATOM 6285 H GLN B 163 9.511 -4.761 38.588 1.00 0.00 H ATOM 6286 N GLN B 164 9.112 -4.623 35.306 1.00 26.36 N ATOM 6287 CA GLN B 164 8.358 -4.753 34.103 1.00 30.56 C ATOM 6288 C GLN B 164 7.594 -3.472 33.844 1.00 28.62 C ATOM 6289 O GLN B 164 7.765 -2.878 32.786 1.00 28.37 O ATOM 6290 CB GLN B 164 7.370 -5.915 34.217 1.00 29.91 C ATOM 6291 CG GLN B 164 7.087 -6.525 32.898 1.00 32.80 C ATOM 6292 CD GLN B 164 5.976 -7.544 32.923 1.00 34.76 C ATOM 6293 OE1 GLN B 164 6.183 -8.691 32.504 1.00 26.49 O ATOM 6294 NE2 GLN B 164 4.777 -7.138 33.406 1.00 36.72 N ATOM 6295 HA GLN B 164 9.044 -4.949 33.279 1.00 0.00 H ATOM 6296 HB2 GLN B 164 7.792 -6.675 34.875 1.00 0.00 H ATOM 6297 HB3 GLN B 164 6.437 -5.545 34.643 1.00 0.00 H ATOM 6298 HG2 GLN B 164 6.810 -5.731 32.205 1.00 0.00 H ATOM 6299 HG3 GLN B 164 7.994 -7.014 32.544 1.00 0.00 H ATOM 6300 HE22 GLN B 164 4.657 -6.162 33.746 1.00 0.00 H ATOM 6301 HE21 GLN B 164 3.977 -7.802 33.437 1.00 0.00 H ATOM 6302 H GLN B 164 9.042 -5.372 36.024 1.00 0.00 H ATOM 6303 N LEU B 165 6.783 -3.069 34.818 1.00 19.50 N ATOM 6304 CA LEU B 165 5.904 -1.946 34.682 1.00 23.44 C ATOM 6305 C LEU B 165 6.658 -0.650 34.453 1.00 27.96 C ATOM 6306 O LEU B 165 6.205 0.184 33.695 1.00 26.82 O ATOM 6307 CB LEU B 165 4.967 -1.824 35.887 1.00 21.23 C ATOM 6308 CG LEU B 165 4.208 -0.489 35.979 1.00 20.88 C ATOM 6309 CD1 LEU B 165 3.003 -0.371 35.037 1.00 18.49 C ATOM 6310 CD2 LEU B 165 3.708 -0.272 37.394 1.00 20.75 C ATOM 6311 HA LEU B 165 5.298 -2.128 33.794 1.00 0.00 H ATOM 6312 HB2 LEU B 165 4.234 -2.628 35.830 1.00 0.00 H ATOM 6313 HB3 LEU B 165 5.562 -1.940 36.793 1.00 0.00 H ATOM 6314 HG LEU B 165 4.933 0.266 35.677 1.00 0.00 H ATOM 6315 HD21 LEU B 165 3.037 -1.086 37.670 1.00 0.00 H ATOM 6316 HD22 LEU B 165 4.556 -0.251 38.078 1.00 0.00 H ATOM 6317 HD23 LEU B 165 3.172 0.676 37.447 1.00 0.00 H ATOM 6318 HD11 LEU B 165 3.339 -0.473 34.005 1.00 0.00 H ATOM 6319 HD12 LEU B 165 2.286 -1.159 35.267 1.00 0.00 H ATOM 6320 HD13 LEU B 165 2.531 0.602 35.172 1.00 0.00 H ATOM 6321 H LEU B 165 6.787 -3.592 35.717 1.00 0.00 H ATOM 6322 N VAL B 166 7.846 -0.497 35.024 1.00 32.81 N ATOM 6323 CA VAL B 166 8.647 0.730 34.789 1.00 26.13 C ATOM 6324 C VAL B 166 9.201 0.747 33.359 1.00 27.00 C ATOM 6325 O VAL B 166 9.320 1.806 32.709 1.00 30.36 O ATOM 6326 CB VAL B 166 9.811 0.851 35.839 1.00 31.67 C ATOM 6327 CG1 VAL B 166 10.648 2.130 35.622 1.00 33.11 C ATOM 6328 CG2 VAL B 166 9.263 0.842 37.302 1.00 31.31 C ATOM 6329 HA VAL B 166 7.991 1.592 34.913 1.00 0.00 H ATOM 6330 HB VAL B 166 10.451 -0.019 35.690 1.00 0.00 H ATOM 6331 HG11 VAL B 166 11.087 2.111 34.624 1.00 0.00 H ATOM 6332 HG12 VAL B 166 10.005 3.005 35.721 1.00 0.00 H ATOM 6333 HG13 VAL B 166 11.441 2.175 36.368 1.00 0.00 H ATOM 6334 HG21 VAL B 166 8.584 1.683 37.439 1.00 0.00 H ATOM 6335 HG22 VAL B 166 8.729 -0.091 37.483 1.00 0.00 H ATOM 6336 HG23 VAL B 166 10.095 0.927 38.001 1.00 0.00 H ATOM 6337 H VAL B 166 8.220 -1.245 35.643 1.00 0.00 H ATOM 6338 N LEU B 167 9.564 -0.430 32.862 1.00 23.66 N ATOM 6339 CA LEU B 167 10.081 -0.533 31.506 1.00 19.16 C ATOM 6340 C LEU B 167 8.986 -0.292 30.428 1.00 25.86 C ATOM 6341 O LEU B 167 9.236 0.416 29.438 1.00 23.81 O ATOM 6342 CB LEU B 167 10.755 -1.868 31.332 1.00 17.52 C ATOM 6343 CG LEU B 167 12.127 -1.984 32.070 1.00 21.07 C ATOM 6344 CD1 LEU B 167 12.555 -3.411 32.140 1.00 12.02 C ATOM 6345 CD2 LEU B 167 13.198 -1.251 31.316 1.00 11.19 C ATOM 6346 HA LEU B 167 10.815 0.260 31.358 1.00 0.00 H ATOM 6347 HB2 LEU B 167 10.091 -2.641 31.718 1.00 0.00 H ATOM 6348 HB3 LEU B 167 10.922 -2.032 30.268 1.00 0.00 H ATOM 6349 HG LEU B 167 11.996 -1.561 33.066 1.00 0.00 H ATOM 6350 HD21 LEU B 167 13.296 -1.679 30.319 1.00 0.00 H ATOM 6351 HD22 LEU B 167 12.928 -0.198 31.236 1.00 0.00 H ATOM 6352 HD23 LEU B 167 14.145 -1.345 31.848 1.00 0.00 H ATOM 6353 HD11 LEU B 167 11.807 -3.987 32.684 1.00 0.00 H ATOM 6354 HD12 LEU B 167 12.658 -3.808 31.130 1.00 0.00 H ATOM 6355 HD13 LEU B 167 13.512 -3.477 32.657 1.00 0.00 H ATOM 6356 H LEU B 167 9.478 -1.285 33.447 1.00 0.00 H ATOM 6357 N ILE B 168 7.788 -0.883 30.618 1.00 21.68 N ATOM 6358 CA ILE B 168 6.593 -0.536 29.825 1.00 20.59 C ATOM 6359 C ILE B 168 6.311 0.972 29.798 1.00 20.70 C ATOM 6360 O ILE B 168 6.164 1.557 28.742 1.00 23.17 O ATOM 6361 CB ILE B 168 5.308 -1.253 30.270 1.00 22.92 C ATOM 6362 CG1 ILE B 168 5.466 -2.786 30.306 1.00 20.88 C ATOM 6363 CG2 ILE B 168 4.116 -0.806 29.381 1.00 24.09 C ATOM 6364 CD1 ILE B 168 5.597 -3.420 29.021 1.00 26.02 C ATOM 6365 HA ILE B 168 6.852 -0.884 28.825 1.00 0.00 H ATOM 6366 HB ILE B 168 5.099 -0.958 31.298 1.00 0.00 H ATOM 6367 HG12 ILE B 168 6.356 -3.020 30.890 1.00 0.00 H ATOM 6368 HG13 ILE B 168 4.589 -3.204 30.800 1.00 0.00 H ATOM 6369 HD11 ILE B 168 4.709 -3.213 28.423 1.00 0.00 H ATOM 6370 HD12 ILE B 168 6.478 -3.029 28.512 1.00 0.00 H ATOM 6371 HD13 ILE B 168 5.702 -4.496 29.157 1.00 0.00 H ATOM 6372 HG21 ILE B 168 3.978 0.271 29.476 1.00 0.00 H ATOM 6373 HG22 ILE B 168 4.326 -1.057 28.341 1.00 0.00 H ATOM 6374 HG23 ILE B 168 3.211 -1.320 29.704 1.00 0.00 H ATOM 6375 H ILE B 168 7.703 -1.613 31.354 1.00 0.00 H ATOM 6376 N ARG B 169 6.345 1.628 30.936 1.00 22.66 N ATOM 6377 CA ARG B 169 6.364 3.086 30.895 1.00 29.88 C ATOM 6378 C ARG B 169 7.469 3.741 30.042 1.00 26.36 C ATOM 6379 O ARG B 169 7.266 4.807 29.461 1.00 26.11 O ATOM 6380 CB ARG B 169 6.406 3.613 32.295 1.00 27.34 C ATOM 6381 CG ARG B 169 5.132 3.249 33.048 1.00 32.03 C ATOM 6382 CD ARG B 169 5.040 4.221 34.117 1.00 33.42 C ATOM 6383 NE ARG B 169 4.455 3.721 35.327 1.00 37.89 N ATOM 6384 CZ ARG B 169 3.183 3.914 35.657 1.00 40.46 C ATOM 6385 NH1 ARG B 169 2.348 4.533 34.802 1.00 27.94 N ATOM 6386 NH2 ARG B 169 2.750 3.441 36.828 1.00 36.60 N ATOM 6387 HA ARG B 169 5.445 3.366 30.380 1.00 0.00 H ATOM 6388 HB2 ARG B 169 7.263 3.183 32.813 1.00 0.00 H ATOM 6389 HB3 ARG B 169 6.507 4.698 32.266 1.00 0.00 H ATOM 6390 HG2 ARG B 169 4.265 3.318 32.391 1.00 0.00 H ATOM 6391 HG3 ARG B 169 5.201 2.239 33.452 1.00 0.00 H ATOM 6392 HD2 ARG B 169 4.435 5.057 33.766 1.00 0.00 H ATOM 6393 HD3 ARG B 169 6.046 4.573 34.345 1.00 0.00 H ATOM 6394 HE ARG B 169 5.057 3.180 35.979 1.00 0.00 H ATOM 6395 HH12 ARG B 169 1.353 4.682 35.064 1.00 0.00 H ATOM 6396 HH11 ARG B 169 2.698 4.862 33.880 1.00 0.00 H ATOM 6397 HH22 ARG B 169 1.758 3.579 37.110 1.00 0.00 H ATOM 6398 HH21 ARG B 169 3.404 2.935 37.458 1.00 0.00 H ATOM 6399 H ARG B 169 6.358 1.120 31.844 1.00 0.00 H ATOM 6400 N GLN B 170 8.629 3.115 29.984 1.00 23.45 N ATOM 6401 CA GLN B 170 9.747 3.718 29.248 1.00 26.07 C ATOM 6402 C GLN B 170 9.502 3.466 27.761 1.00 25.46 C ATOM 6403 O GLN B 170 9.641 4.372 26.953 1.00 35.16 O ATOM 6404 CB GLN B 170 11.112 3.149 29.692 1.00 18.90 C ATOM 6405 CG GLN B 170 11.429 3.277 31.114 1.00 19.94 C ATOM 6406 CD GLN B 170 12.906 2.933 31.459 1.00 26.14 C ATOM 6407 OE1 GLN B 170 13.605 2.227 30.725 1.00 18.16 O ATOM 6408 NE2 GLN B 170 13.369 3.453 32.603 1.00 21.12 N ATOM 6409 HA GLN B 170 9.790 4.787 29.457 1.00 0.00 H ATOM 6410 HB2 GLN B 170 11.129 2.089 29.441 1.00 0.00 H ATOM 6411 HB3 GLN B 170 11.888 3.667 29.129 1.00 0.00 H ATOM 6412 HG2 GLN B 170 11.235 4.305 31.419 1.00 0.00 H ATOM 6413 HG3 GLN B 170 10.779 2.604 31.674 1.00 0.00 H ATOM 6414 HE22 GLN B 170 12.749 4.043 33.194 1.00 0.00 H ATOM 6415 HE21 GLN B 170 14.348 3.267 32.900 1.00 0.00 H ATOM 6416 H GLN B 170 8.751 2.197 30.458 1.00 0.00 H ATOM 6417 N LEU B 171 9.119 2.246 27.393 1.00 28.22 N ATOM 6418 CA LEU B 171 8.528 1.978 26.039 1.00 28.37 C ATOM 6419 C LEU B 171 7.536 3.061 25.585 1.00 26.43 C ATOM 6420 O LEU B 171 7.614 3.561 24.464 1.00 28.65 O ATOM 6421 CB LEU B 171 7.833 0.611 26.022 1.00 26.07 C ATOM 6422 CG LEU B 171 7.234 0.155 24.703 1.00 22.32 C ATOM 6423 CD1 LEU B 171 8.305 -0.420 23.830 1.00 11.64 C ATOM 6424 CD2 LEU B 171 6.231 -0.978 25.003 1.00 10.43 C ATOM 6425 HA LEU B 171 9.361 1.988 25.336 1.00 0.00 H ATOM 6426 HB2 LEU B 171 8.568 -0.135 26.324 1.00 0.00 H ATOM 6427 HB3 LEU B 171 7.027 0.643 26.755 1.00 0.00 H ATOM 6428 HG LEU B 171 6.759 1.001 24.207 1.00 0.00 H ATOM 6429 HD21 LEU B 171 6.752 -1.804 25.487 1.00 0.00 H ATOM 6430 HD22 LEU B 171 5.449 -0.604 25.663 1.00 0.00 H ATOM 6431 HD23 LEU B 171 5.786 -1.324 24.070 1.00 0.00 H ATOM 6432 HD11 LEU B 171 9.063 0.340 23.638 1.00 0.00 H ATOM 6433 HD12 LEU B 171 8.762 -1.273 24.332 1.00 0.00 H ATOM 6434 HD13 LEU B 171 7.867 -0.745 22.886 1.00 0.00 H ATOM 6435 H LEU B 171 9.232 1.457 28.061 1.00 0.00 H ATOM 6436 N VAL B 172 6.636 3.453 26.487 1.00 20.68 N ATOM 6437 CA VAL B 172 5.539 4.308 26.117 1.00 25.65 C ATOM 6438 C VAL B 172 6.032 5.731 25.951 1.00 20.50 C ATOM 6439 O VAL B 172 5.681 6.427 25.021 1.00 24.15 O ATOM 6440 CB VAL B 172 4.306 4.118 27.061 1.00 29.14 C ATOM 6441 CG1 VAL B 172 3.282 5.278 26.985 1.00 21.13 C ATOM 6442 CG2 VAL B 172 3.624 2.819 26.665 1.00 29.23 C ATOM 6443 HA VAL B 172 5.150 4.017 25.141 1.00 0.00 H ATOM 6444 HB VAL B 172 4.668 4.101 28.089 1.00 0.00 H ATOM 6445 HG11 VAL B 172 3.770 6.211 27.269 1.00 0.00 H ATOM 6446 HG12 VAL B 172 2.903 5.360 25.966 1.00 0.00 H ATOM 6447 HG13 VAL B 172 2.455 5.076 27.666 1.00 0.00 H ATOM 6448 HG21 VAL B 172 3.303 2.881 25.625 1.00 0.00 H ATOM 6449 HG22 VAL B 172 4.325 1.992 26.781 1.00 0.00 H ATOM 6450 HG23 VAL B 172 2.757 2.655 27.305 1.00 0.00 H ATOM 6451 H VAL B 172 6.728 3.136 27.473 1.00 0.00 H ATOM 6452 N ALA B 173 6.959 6.117 26.767 1.00 21.44 N ATOM 6453 CA ALA B 173 7.461 7.462 26.616 1.00 22.71 C ATOM 6454 C ALA B 173 8.413 7.517 25.414 1.00 23.91 C ATOM 6455 O ALA B 173 8.338 8.427 24.591 1.00 33.68 O ATOM 6456 CB ALA B 173 8.131 7.914 27.893 1.00 6.39 C ATOM 6457 HA ALA B 173 6.637 8.149 26.425 1.00 0.00 H ATOM 6458 HB1 ALA B 173 7.408 7.891 28.709 1.00 0.00 H ATOM 6459 HB2 ALA B 173 8.961 7.246 28.122 1.00 0.00 H ATOM 6460 HB3 ALA B 173 8.505 8.930 27.766 1.00 0.00 H ATOM 6461 H ALA B 173 7.328 5.482 27.504 1.00 0.00 H ATOM 6462 N ASP B 174 9.299 6.543 25.292 1.00 21.17 N ATOM 6463 CA ASP B 174 10.353 6.661 24.297 1.00 19.18 C ATOM 6464 C ASP B 174 9.824 6.526 22.877 1.00 22.44 C ATOM 6465 O ASP B 174 10.398 7.059 21.934 1.00 19.59 O ATOM 6466 CB ASP B 174 11.427 5.618 24.577 1.00 16.77 C ATOM 6467 CG ASP B 174 12.153 5.852 25.903 1.00 20.35 C ATOM 6468 OD1 ASP B 174 12.117 6.974 26.428 1.00 28.16 O ATOM 6469 OD2 ASP B 174 12.784 4.919 26.429 1.00 26.21 O ATOM 6470 HA ASP B 174 10.782 7.660 24.373 1.00 0.00 H ATOM 6471 HB2 ASP B 174 10.958 4.634 24.606 1.00 0.00 H ATOM 6472 HB3 ASP B 174 12.159 5.647 23.770 1.00 0.00 H ATOM 6473 H ASP B 174 9.243 5.702 25.901 1.00 0.00 H ATOM 6474 N PHE B 175 8.723 5.785 22.732 1.00 24.92 N ATOM 6475 CA PHE B 175 8.171 5.525 21.420 1.00 23.39 C ATOM 6476 C PHE B 175 6.959 6.422 21.150 1.00 23.76 C ATOM 6477 O PHE B 175 6.348 6.347 20.093 1.00 24.73 O ATOM 6478 CB PHE B 175 7.848 4.019 21.261 1.00 13.84 C ATOM 6479 CG PHE B 175 9.080 3.156 21.073 1.00 18.36 C ATOM 6480 CD1 PHE B 175 10.349 3.744 20.895 1.00 15.82 C ATOM 6481 CD2 PHE B 175 8.981 1.769 21.036 1.00 14.06 C ATOM 6482 CE1 PHE B 175 11.487 2.975 20.676 1.00 13.99 C ATOM 6483 CE2 PHE B 175 10.106 0.983 20.853 1.00 13.48 C ATOM 6484 CZ PHE B 175 11.361 1.565 20.673 1.00 19.39 C ATOM 6485 HA PHE B 175 8.916 5.775 20.664 1.00 0.00 H ATOM 6486 HB2 PHE B 175 7.323 3.682 22.154 1.00 0.00 H ATOM 6487 HB3 PHE B 175 7.202 3.894 20.392 1.00 0.00 H ATOM 6488 HD2 PHE B 175 8.006 1.295 21.152 1.00 0.00 H ATOM 6489 HE2 PHE B 175 10.010 -0.103 20.850 1.00 0.00 H ATOM 6490 HZ PHE B 175 12.240 0.937 20.531 1.00 0.00 H ATOM 6491 HE1 PHE B 175 12.455 3.448 20.510 1.00 0.00 H ATOM 6492 HD1 PHE B 175 10.441 4.830 20.930 1.00 0.00 H ATOM 6493 H PHE B 175 8.256 5.390 23.573 1.00 0.00 H ATOM 6494 N ASN B 176 6.601 7.236 22.128 1.00 22.20 N ATOM 6495 CA ASN B 176 5.579 8.225 21.949 1.00 25.99 C ATOM 6496 C ASN B 176 4.226 7.545 21.749 1.00 32.71 C ATOM 6497 O ASN B 176 3.340 7.999 20.994 1.00 31.28 O ATOM 6498 CB ASN B 176 5.944 9.082 20.749 1.00 22.86 C ATOM 6499 CG ASN B 176 7.260 9.779 20.923 1.00 22.55 C ATOM 6500 OD1 ASN B 176 8.244 9.412 20.315 1.00 20.53 O ATOM 6501 ND2 ASN B 176 7.273 10.841 21.714 1.00 27.78 N ATOM 6502 HA ASN B 176 5.504 8.859 22.833 1.00 0.00 H ATOM 6503 HB2 ASN B 176 5.999 8.444 19.867 1.00 0.00 H ATOM 6504 HB3 ASN B 176 5.167 9.832 20.605 1.00 0.00 H ATOM 6505 HD22 ASN B 176 6.409 11.124 22.219 1.00 0.00 H ATOM 6506 HD21 ASN B 176 8.147 11.392 21.831 1.00 0.00 H ATOM 6507 H ASN B 176 7.073 7.157 23.051 1.00 0.00 H ATOM 6508 N LEU B 177 4.079 6.420 22.422 1.00 32.59 N ATOM 6509 CA LEU B 177 2.832 5.705 22.371 1.00 29.75 C ATOM 6510 C LEU B 177 1.647 6.461 23.027 1.00 36.74 C ATOM 6511 O LEU B 177 1.770 7.206 24.052 1.00 29.12 O ATOM 6512 CB LEU B 177 3.038 4.359 23.029 1.00 25.92 C ATOM 6513 CG LEU B 177 4.066 3.542 22.286 1.00 25.79 C ATOM 6514 CD1 LEU B 177 4.247 2.231 22.965 1.00 32.29 C ATOM 6515 CD2 LEU B 177 3.633 3.287 20.894 1.00 33.23 C ATOM 6516 HA LEU B 177 2.552 5.594 21.324 1.00 0.00 H ATOM 6517 HB2 LEU B 177 3.377 4.512 24.054 1.00 0.00 H ATOM 6518 HB3 LEU B 177 2.092 3.818 23.038 1.00 0.00 H ATOM 6519 HG LEU B 177 5.000 4.103 22.277 1.00 0.00 H ATOM 6520 HD21 LEU B 177 2.690 2.741 20.903 1.00 0.00 H ATOM 6521 HD22 LEU B 177 3.499 4.237 20.377 1.00 0.00 H ATOM 6522 HD23 LEU B 177 4.392 2.696 20.381 1.00 0.00 H ATOM 6523 HD11 LEU B 177 4.585 2.397 23.988 1.00 0.00 H ATOM 6524 HD12 LEU B 177 3.298 1.695 22.977 1.00 0.00 H ATOM 6525 HD13 LEU B 177 4.990 1.644 22.426 1.00 0.00 H ATOM 6526 H LEU B 177 4.867 6.049 22.991 1.00 0.00 H ATOM 6527 N ASP B 178 0.486 6.191 22.454 1.00 37.14 N ATOM 6528 CA ASP B 178 -0.767 6.888 22.729 1.00 48.39 C ATOM 6529 C ASP B 178 -1.566 6.461 23.986 1.00 46.29 C ATOM 6530 O ASP B 178 -2.740 6.729 24.066 1.00 51.25 O ATOM 6531 CB ASP B 178 -1.680 6.599 21.539 1.00 53.58 C ATOM 6532 CG ASP B 178 -2.095 7.846 20.845 1.00 63.21 C ATOM 6533 OD1 ASP B 178 -2.476 8.807 21.559 1.00 64.58 O ATOM 6534 OD2 ASP B 178 -1.989 7.874 19.595 1.00 68.95 O ATOM 6535 HA ASP B 178 -0.486 7.927 22.901 1.00 0.00 H ATOM 6536 HB2 ASP B 178 -1.148 5.962 20.832 1.00 0.00 H ATOM 6537 HB3 ASP B 178 -2.570 6.080 21.895 1.00 0.00 H ATOM 6538 H ASP B 178 0.464 5.423 21.753 1.00 0.00 H ATOM 6539 N VAL B 179 -0.957 5.791 24.945 1.00 35.55 N ATOM 6540 CA VAL B 179 -1.726 5.005 25.860 1.00 35.06 C ATOM 6541 C VAL B 179 -1.332 5.379 27.266 1.00 28.74 C ATOM 6542 O VAL B 179 -0.207 5.735 27.546 1.00 31.94 O ATOM 6543 CB VAL B 179 -1.539 3.449 25.559 1.00 38.06 C ATOM 6544 CG1 VAL B 179 -0.062 3.035 25.651 1.00 35.13 C ATOM 6545 CG2 VAL B 179 -2.399 2.576 26.452 1.00 33.38 C ATOM 6546 HA VAL B 179 -2.789 5.211 25.739 1.00 0.00 H ATOM 6547 HB VAL B 179 -1.877 3.290 24.535 1.00 0.00 H ATOM 6548 HG11 VAL B 179 0.519 3.601 24.923 1.00 0.00 H ATOM 6549 HG12 VAL B 179 0.310 3.241 26.655 1.00 0.00 H ATOM 6550 HG13 VAL B 179 0.029 1.969 25.440 1.00 0.00 H ATOM 6551 HG21 VAL B 179 -2.132 2.751 27.494 1.00 0.00 H ATOM 6552 HG22 VAL B 179 -3.449 2.824 26.298 1.00 0.00 H ATOM 6553 HG23 VAL B 179 -2.232 1.528 26.204 1.00 0.00 H ATOM 6554 H VAL B 179 0.078 5.834 25.036 1.00 0.00 H ATOM 6555 N ALA B 180 -2.295 5.355 28.148 1.00 26.37 N ATOM 6556 CA ALA B 180 -2.007 5.558 29.521 1.00 22.77 C ATOM 6557 C ALA B 180 -1.746 4.145 30.115 1.00 26.26 C ATOM 6558 O ALA B 180 -2.523 3.213 29.907 1.00 28.65 O ATOM 6559 CB ALA B 180 -3.205 6.272 30.196 1.00 24.12 C ATOM 6560 HA ALA B 180 -1.137 6.194 29.683 1.00 0.00 H ATOM 6561 HB1 ALA B 180 -3.373 7.234 29.712 1.00 0.00 H ATOM 6562 HB2 ALA B 180 -4.097 5.654 30.097 1.00 0.00 H ATOM 6563 HB3 ALA B 180 -2.985 6.429 31.252 1.00 0.00 H ATOM 6564 H ALA B 180 -3.275 5.187 27.842 1.00 0.00 H ATOM 6565 N VAL B 181 -0.607 3.997 30.784 1.00 23.56 N ATOM 6566 CA VAL B 181 -0.213 2.786 31.469 1.00 26.97 C ATOM 6567 C VAL B 181 -0.748 2.866 32.897 1.00 36.61 C ATOM 6568 O VAL B 181 -0.460 3.816 33.630 1.00 37.02 O ATOM 6569 CB VAL B 181 1.302 2.722 31.576 1.00 25.17 C ATOM 6570 CG1 VAL B 181 1.767 1.391 32.269 1.00 25.69 C ATOM 6571 CG2 VAL B 181 1.911 2.881 30.191 1.00 21.99 C ATOM 6572 HA VAL B 181 -0.594 1.921 30.926 1.00 0.00 H ATOM 6573 HB VAL B 181 1.653 3.540 32.206 1.00 0.00 H ATOM 6574 HG11 VAL B 181 1.344 1.338 33.272 1.00 0.00 H ATOM 6575 HG12 VAL B 181 1.423 0.539 31.683 1.00 0.00 H ATOM 6576 HG13 VAL B 181 2.855 1.376 32.330 1.00 0.00 H ATOM 6577 HG21 VAL B 181 1.556 2.078 29.545 1.00 0.00 H ATOM 6578 HG22 VAL B 181 1.614 3.843 29.773 1.00 0.00 H ATOM 6579 HG23 VAL B 181 2.997 2.835 30.266 1.00 0.00 H ATOM 6580 H VAL B 181 0.045 4.807 30.817 1.00 0.00 H ATOM 6581 N VAL B 182 -1.530 1.879 33.318 1.00 36.74 N ATOM 6582 CA VAL B 182 -2.077 1.959 34.673 1.00 33.33 C ATOM 6583 C VAL B 182 -1.503 0.784 35.452 1.00 36.59 C ATOM 6584 O VAL B 182 -1.531 -0.402 34.993 1.00 29.92 O ATOM 6585 CB VAL B 182 -3.631 2.055 34.643 1.00 33.74 C ATOM 6586 CG1 VAL B 182 -4.263 1.948 36.019 1.00 33.53 C ATOM 6587 CG2 VAL B 182 -4.048 3.343 33.993 1.00 31.04 C ATOM 6588 HA VAL B 182 -1.782 2.872 35.190 1.00 0.00 H ATOM 6589 HB VAL B 182 -3.988 1.203 34.064 1.00 0.00 H ATOM 6590 HG11 VAL B 182 -4.000 0.989 36.465 1.00 0.00 H ATOM 6591 HG12 VAL B 182 -3.895 2.756 36.651 1.00 0.00 H ATOM 6592 HG13 VAL B 182 -5.347 2.022 35.927 1.00 0.00 H ATOM 6593 HG21 VAL B 182 -3.645 4.182 34.560 1.00 0.00 H ATOM 6594 HG22 VAL B 182 -3.664 3.375 32.973 1.00 0.00 H ATOM 6595 HG23 VAL B 182 -5.136 3.404 33.975 1.00 0.00 H ATOM 6596 H VAL B 182 -1.748 1.071 32.701 1.00 0.00 H ATOM 6597 N GLY B 183 -0.905 1.124 36.595 1.00 35.51 N ATOM 6598 CA GLY B 183 -0.231 0.121 37.427 1.00 32.52 C ATOM 6599 C GLY B 183 -1.156 -0.273 38.564 1.00 36.62 C ATOM 6600 O GLY B 183 -1.653 0.585 39.296 1.00 33.20 O ATOM 6601 HA3 GLY B 183 0.690 0.540 37.832 1.00 0.00 H ATOM 6602 HA2 GLY B 183 0.004 -0.757 36.825 1.00 0.00 H ATOM 6603 H GLY B 183 -0.917 2.118 36.902 1.00 0.00 H ATOM 6604 N VAL B 184 -1.387 -1.572 38.709 1.00 32.68 N ATOM 6605 CA VAL B 184 -2.432 -2.042 39.568 1.00 31.98 C ATOM 6606 C VAL B 184 -1.944 -2.717 40.886 1.00 35.65 C ATOM 6607 O VAL B 184 -1.186 -3.709 40.882 1.00 34.84 O ATOM 6608 CB VAL B 184 -3.361 -2.935 38.750 1.00 33.93 C ATOM 6609 CG1 VAL B 184 -4.351 -3.697 39.685 1.00 30.50 C ATOM 6610 CG2 VAL B 184 -4.061 -2.084 37.695 1.00 22.04 C ATOM 6611 HA VAL B 184 -2.979 -1.173 39.934 1.00 0.00 H ATOM 6612 HB VAL B 184 -2.791 -3.704 38.229 1.00 0.00 H ATOM 6613 HG11 VAL B 184 -3.787 -4.317 40.382 1.00 0.00 H ATOM 6614 HG12 VAL B 184 -4.951 -2.977 40.241 1.00 0.00 H ATOM 6615 HG13 VAL B 184 -5.005 -4.328 39.083 1.00 0.00 H ATOM 6616 HG21 VAL B 184 -4.639 -1.301 38.186 1.00 0.00 H ATOM 6617 HG22 VAL B 184 -3.315 -1.631 37.042 1.00 0.00 H ATOM 6618 HG23 VAL B 184 -4.727 -2.714 37.105 1.00 0.00 H ATOM 6619 H VAL B 184 -0.801 -2.258 38.192 1.00 0.00 H ATOM 6620 N PRO B 185 -2.379 -2.167 42.024 1.00 35.09 N ATOM 6621 CA PRO B 185 -1.929 -2.719 43.319 1.00 34.87 C ATOM 6622 C PRO B 185 -1.982 -4.270 43.485 1.00 34.03 C ATOM 6623 O PRO B 185 -3.031 -4.902 43.298 1.00 34.51 O ATOM 6624 CB PRO B 185 -2.784 -1.954 44.333 1.00 36.87 C ATOM 6625 CG PRO B 185 -3.146 -0.601 43.607 1.00 34.01 C ATOM 6626 CD PRO B 185 -3.243 -0.971 42.163 1.00 32.45 C ATOM 6627 HA PRO B 185 -0.856 -2.575 43.448 1.00 0.00 H ATOM 6628 HD3 PRO B 185 -4.273 -1.207 41.894 1.00 0.00 H ATOM 6629 HD2 PRO B 185 -2.881 -0.159 41.532 1.00 0.00 H ATOM 6630 HG3 PRO B 185 -2.365 0.143 43.764 1.00 0.00 H ATOM 6631 HG2 PRO B 185 -4.096 -0.210 43.970 1.00 0.00 H ATOM 6632 HB2 PRO B 185 -3.687 -2.514 44.576 1.00 0.00 H ATOM 6633 HB3 PRO B 185 -2.220 -1.762 45.246 1.00 0.00 H ATOM 6634 N THR B 186 -0.816 -4.858 43.797 1.00 31.15 N ATOM 6635 CA THR B 186 -0.676 -6.247 44.206 1.00 28.49 C ATOM 6636 C THR B 186 -1.722 -6.860 45.183 1.00 28.31 C ATOM 6637 O THR B 186 -1.971 -6.382 46.296 1.00 30.52 O ATOM 6638 CB THR B 186 0.659 -6.428 44.828 1.00 30.81 C ATOM 6639 OG1 THR B 186 1.591 -5.735 44.005 1.00 31.47 O ATOM 6640 CG2 THR B 186 1.013 -7.971 44.938 1.00 30.08 C ATOM 6641 HA THR B 186 -0.837 -6.783 43.271 1.00 0.00 H ATOM 6642 HB THR B 186 0.683 -6.031 45.843 1.00 0.00 H ATOM 6643 HG1 THR B 186 2.500 -5.830 44.385 1.00 0.00 H ATOM 6644 HG23 THR B 186 0.279 -8.466 45.574 1.00 0.00 H ATOM 6645 HG21 THR B 186 0.995 -8.418 43.944 1.00 0.00 H ATOM 6646 HG22 THR B 186 2.007 -8.084 45.371 1.00 0.00 H ATOM 6647 H THR B 186 0.047 -4.280 43.742 1.00 0.00 H ATOM 6648 N VAL B 187 -2.307 -7.938 44.720 1.00 28.67 N ATOM 6649 CA VAL B 187 -3.294 -8.682 45.418 1.00 31.84 C ATOM 6650 C VAL B 187 -2.495 -9.716 46.175 1.00 34.94 C ATOM 6651 O VAL B 187 -1.575 -10.347 45.625 1.00 28.62 O ATOM 6652 CB VAL B 187 -4.209 -9.340 44.375 1.00 34.47 C ATOM 6653 CG1 VAL B 187 -5.160 -10.335 44.996 1.00 25.91 C ATOM 6654 CG2 VAL B 187 -4.936 -8.254 43.584 1.00 37.15 C ATOM 6655 HA VAL B 187 -3.922 -8.094 46.087 1.00 0.00 H ATOM 6656 HB VAL B 187 -3.595 -9.919 43.685 1.00 0.00 H ATOM 6657 HG11 VAL B 187 -4.589 -11.121 45.490 1.00 0.00 H ATOM 6658 HG12 VAL B 187 -5.789 -9.827 45.727 1.00 0.00 H ATOM 6659 HG13 VAL B 187 -5.785 -10.773 44.218 1.00 0.00 H ATOM 6660 HG21 VAL B 187 -5.534 -7.649 44.265 1.00 0.00 H ATOM 6661 HG22 VAL B 187 -4.205 -7.621 43.081 1.00 0.00 H ATOM 6662 HG23 VAL B 187 -5.586 -8.719 42.843 1.00 0.00 H ATOM 6663 H VAL B 187 -2.028 -8.271 43.775 1.00 0.00 H ATOM 6664 N ARG B 188 -2.856 -9.879 47.445 1.00 37.14 N ATOM 6665 CA ARG B 188 -2.070 -10.700 48.389 1.00 41.70 C ATOM 6666 C ARG B 188 -2.920 -11.774 49.055 1.00 40.60 C ATOM 6667 O ARG B 188 -4.113 -11.574 49.214 1.00 38.55 O ATOM 6668 CB ARG B 188 -1.448 -9.795 49.482 1.00 38.12 C ATOM 6669 CG ARG B 188 -0.623 -8.667 48.906 1.00 33.62 C ATOM 6670 CD ARG B 188 0.083 -7.777 49.939 1.00 35.12 C ATOM 6671 NE ARG B 188 1.115 -6.963 49.271 1.00 26.34 N ATOM 6672 CZ ARG B 188 2.329 -7.404 48.948 1.00 31.65 C ATOM 6673 NH1 ARG B 188 2.702 -8.663 49.244 1.00 32.49 N ATOM 6674 NH2 ARG B 188 3.181 -6.601 48.320 1.00 28.01 N ATOM 6675 HA ARG B 188 -1.286 -11.195 47.816 1.00 0.00 H ATOM 6676 HB2 ARG B 188 -2.252 -9.368 50.081 1.00 0.00 H ATOM 6677 HB3 ARG B 188 -0.808 -10.406 50.118 1.00 0.00 H ATOM 6678 HG2 ARG B 188 0.139 -9.103 48.260 1.00 0.00 H ATOM 6679 HG3 ARG B 188 -1.284 -8.035 48.312 1.00 0.00 H ATOM 6680 HD2 ARG B 188 0.551 -8.404 50.698 1.00 0.00 H ATOM 6681 HD3 ARG B 188 -0.647 -7.120 50.411 1.00 0.00 H ATOM 6682 HE ARG B 188 0.879 -5.978 49.036 1.00 0.00 H ATOM 6683 HH12 ARG B 188 3.653 -8.998 48.987 1.00 0.00 H ATOM 6684 HH11 ARG B 188 2.040 -9.301 49.729 1.00 0.00 H ATOM 6685 HH22 ARG B 188 4.130 -6.945 48.067 1.00 0.00 H ATOM 6686 HH21 ARG B 188 2.899 -5.629 48.081 1.00 0.00 H ATOM 6687 H ARG B 188 -3.721 -9.413 47.785 1.00 0.00 H ATOM 6688 N GLU B 189 -2.324 -12.901 49.459 1.00 40.22 N ATOM 6689 CA GLU B 189 -3.037 -13.815 50.352 1.00 41.03 C ATOM 6690 C GLU B 189 -3.379 -13.105 51.695 1.00 44.68 C ATOM 6691 O GLU B 189 -3.059 -11.920 51.906 1.00 41.43 O ATOM 6692 CB GLU B 189 -2.267 -15.101 50.591 1.00 41.22 C ATOM 6693 CG GLU B 189 -1.541 -15.692 49.346 1.00 51.56 C ATOM 6694 CD GLU B 189 -2.410 -16.582 48.427 1.00 55.08 C ATOM 6695 OE1 GLU B 189 -3.591 -16.223 48.224 1.00 59.22 O ATOM 6696 OE2 GLU B 189 -1.897 -17.612 47.879 1.00 49.68 O ATOM 6697 HA GLU B 189 -3.968 -14.095 49.860 1.00 0.00 H ATOM 6698 HB2 GLU B 189 -1.516 -14.905 51.356 1.00 0.00 H ATOM 6699 HB3 GLU B 189 -2.970 -15.850 50.957 1.00 0.00 H ATOM 6700 HG2 GLU B 189 -1.165 -14.860 48.750 1.00 0.00 H ATOM 6701 HG3 GLU B 189 -0.703 -16.292 49.700 1.00 0.00 H ATOM 6702 H GLU B 189 -1.360 -13.126 49.141 1.00 0.00 H ATOM 6703 N ALA B 190 -4.061 -13.809 52.592 1.00 41.88 N ATOM 6704 CA ALA B 190 -4.350 -13.227 53.903 1.00 40.20 C ATOM 6705 C ALA B 190 -3.068 -13.018 54.744 1.00 38.25 C ATOM 6706 O ALA B 190 -3.032 -12.124 55.576 1.00 35.88 O ATOM 6707 CB ALA B 190 -5.391 -14.063 54.661 1.00 33.86 C ATOM 6708 HA ALA B 190 -4.776 -12.239 53.730 1.00 0.00 H ATOM 6709 HB1 ALA B 190 -6.315 -14.101 54.084 1.00 0.00 H ATOM 6710 HB2 ALA B 190 -5.009 -15.074 54.804 1.00 0.00 H ATOM 6711 HB3 ALA B 190 -5.585 -13.606 55.631 1.00 0.00 H ATOM 6712 H ALA B 190 -4.388 -14.769 52.363 1.00 0.00 H ATOM 6713 N ASP B 191 -2.008 -13.804 54.521 1.00 31.80 N ATOM 6714 CA ASP B 191 -0.819 -13.557 55.313 1.00 30.79 C ATOM 6715 C ASP B 191 0.062 -12.457 54.721 1.00 30.31 C ATOM 6716 O ASP B 191 1.057 -12.042 55.336 1.00 34.13 O ATOM 6717 CB ASP B 191 -0.054 -14.843 55.630 1.00 26.54 C ATOM 6718 CG ASP B 191 0.404 -15.557 54.408 1.00 28.93 C ATOM 6719 OD1 ASP B 191 0.394 -15.017 53.317 1.00 37.57 O ATOM 6720 OD2 ASP B 191 0.771 -16.709 54.519 1.00 43.37 O ATOM 6721 HA ASP B 191 -1.158 -13.171 56.274 1.00 0.00 H ATOM 6722 HB2 ASP B 191 0.818 -14.590 56.233 1.00 0.00 H ATOM 6723 HB3 ASP B 191 -0.707 -15.506 56.197 1.00 0.00 H ATOM 6724 H ASP B 191 -2.036 -14.561 53.809 1.00 0.00 H ATOM 6725 N GLY B 192 -0.345 -11.955 53.555 1.00 27.70 N ATOM 6726 CA GLY B 192 0.351 -10.864 52.853 1.00 28.75 C ATOM 6727 C GLY B 192 1.226 -11.347 51.668 1.00 36.17 C ATOM 6728 O GLY B 192 1.795 -10.505 50.936 1.00 32.85 O ATOM 6729 HA3 GLY B 192 0.992 -10.348 53.567 1.00 0.00 H ATOM 6730 HA2 GLY B 192 -0.396 -10.169 52.469 1.00 0.00 H ATOM 6731 H GLY B 192 -1.200 -12.355 53.118 1.00 0.00 H ATOM 6732 N LEU B 193 1.334 -12.678 51.479 1.00 29.00 N ATOM 6733 CA LEU B 193 2.062 -13.278 50.343 1.00 35.47 C ATOM 6734 C LEU B 193 1.495 -12.825 49.002 1.00 34.20 C ATOM 6735 O LEU B 193 0.272 -12.895 48.761 1.00 33.47 O ATOM 6736 CB LEU B 193 2.006 -14.818 50.384 1.00 33.43 C ATOM 6737 CG LEU B 193 2.824 -15.534 49.295 1.00 35.32 C ATOM 6738 CD1 LEU B 193 4.352 -15.209 49.328 1.00 23.51 C ATOM 6739 CD2 LEU B 193 2.597 -17.040 49.333 1.00 31.05 C ATOM 6740 HA LEU B 193 3.094 -12.940 50.439 1.00 0.00 H ATOM 6741 HB2 LEU B 193 2.380 -15.143 51.355 1.00 0.00 H ATOM 6742 HB3 LEU B 193 0.964 -15.121 50.277 1.00 0.00 H ATOM 6743 HG LEU B 193 2.451 -15.139 48.350 1.00 0.00 H ATOM 6744 HD21 LEU B 193 2.900 -17.427 50.306 1.00 0.00 H ATOM 6745 HD22 LEU B 193 1.540 -17.251 49.169 1.00 0.00 H ATOM 6746 HD23 LEU B 193 3.189 -17.515 48.551 1.00 0.00 H ATOM 6747 HD11 LEU B 193 4.497 -14.138 49.187 1.00 0.00 H ATOM 6748 HD12 LEU B 193 4.765 -15.510 50.291 1.00 0.00 H ATOM 6749 HD13 LEU B 193 4.855 -15.753 48.529 1.00 0.00 H ATOM 6750 H LEU B 193 0.882 -13.313 52.167 1.00 0.00 H ATOM 6751 N ALA B 194 2.363 -12.371 48.114 1.00 27.64 N ATOM 6752 CA ALA B 194 1.837 -11.923 46.831 1.00 27.95 C ATOM 6753 C ALA B 194 1.390 -13.126 46.002 1.00 29.02 C ATOM 6754 O ALA B 194 2.143 -14.121 45.855 1.00 25.58 O ATOM 6755 CB ALA B 194 2.837 -11.070 46.097 1.00 31.24 C ATOM 6756 HA ALA B 194 0.965 -11.294 47.009 1.00 0.00 H ATOM 6757 HB1 ALA B 194 3.076 -10.194 46.699 1.00 0.00 H ATOM 6758 HB2 ALA B 194 3.744 -11.648 45.918 1.00 0.00 H ATOM 6759 HB3 ALA B 194 2.412 -10.753 45.144 1.00 0.00 H ATOM 6760 H ALA B 194 3.381 -12.335 48.323 1.00 0.00 H ATOM 6761 N MET B 195 0.144 -13.058 45.523 1.00 25.70 N ATOM 6762 CA MET B 195 -0.422 -14.142 44.719 1.00 31.82 C ATOM 6763 C MET B 195 0.348 -14.246 43.424 1.00 32.99 C ATOM 6764 O MET B 195 0.721 -13.240 42.810 1.00 33.07 O ATOM 6765 CB MET B 195 -1.898 -13.932 44.348 1.00 30.82 C ATOM 6766 CG MET B 195 -2.751 -13.616 45.432 1.00 28.81 C ATOM 6767 SD MET B 195 -4.337 -13.962 44.773 1.00 43.73 S ATOM 6768 CE MET B 195 -5.332 -13.591 46.227 1.00 41.46 C ATOM 6769 HA MET B 195 -0.351 -15.042 45.330 1.00 0.00 H ATOM 6770 HB2 MET B 195 -1.952 -13.117 43.627 1.00 0.00 H ATOM 6771 HB3 MET B 195 -2.264 -14.849 43.886 1.00 0.00 H ATOM 6772 HG2 MET B 195 -2.660 -12.567 45.713 1.00 0.00 H ATOM 6773 HG3 MET B 195 -2.538 -14.243 46.298 1.00 0.00 H ATOM 6774 HE1 MET B 195 -5.032 -14.243 47.047 1.00 0.00 H ATOM 6775 HE2 MET B 195 -5.180 -12.551 46.514 1.00 0.00 H ATOM 6776 HE3 MET B 195 -6.385 -13.755 45.997 1.00 0.00 H ATOM 6777 H MET B 195 -0.435 -12.218 45.726 1.00 0.00 H ATOM 6778 N SER B 196 0.522 -15.490 43.005 1.00 41.79 N ATOM 6779 CA SER B 196 1.350 -15.882 41.886 1.00 44.39 C ATOM 6780 C SER B 196 1.047 -17.327 41.700 1.00 46.26 C ATOM 6781 O SER B 196 0.843 -18.075 42.693 1.00 46.37 O ATOM 6782 CB SER B 196 2.833 -15.775 42.221 1.00 42.96 C ATOM 6783 OG SER B 196 3.538 -16.721 41.429 1.00 52.47 O ATOM 6784 HA SER B 196 1.153 -15.253 41.018 1.00 0.00 H ATOM 6785 HB2 SER B 196 2.989 -15.990 43.278 1.00 0.00 H ATOM 6786 HB3 SER B 196 3.190 -14.769 41.999 1.00 0.00 H ATOM 6787 HG SER B 196 4.505 -16.666 41.634 1.00 0.00 H ATOM 6788 H SER B 196 0.025 -16.244 43.521 1.00 0.00 H ATOM 6789 N SER B 197 1.033 -17.722 40.433 1.00 47.85 N ATOM 6790 CA SER B 197 0.785 -19.110 40.081 1.00 51.08 C ATOM 6791 C SER B 197 1.841 -20.020 40.728 1.00 46.05 C ATOM 6792 O SER B 197 1.576 -21.173 41.062 1.00 46.14 O ATOM 6793 CB SER B 197 0.700 -19.293 38.552 1.00 51.34 C ATOM 6794 OG SER B 197 1.866 -18.817 37.892 1.00 58.33 O ATOM 6795 HA SER B 197 -0.186 -19.406 40.478 1.00 0.00 H ATOM 6796 HB2 SER B 197 -0.165 -18.744 38.179 1.00 0.00 H ATOM 6797 HB3 SER B 197 0.578 -20.353 38.331 1.00 0.00 H ATOM 6798 HG SER B 197 1.770 -18.953 36.916 1.00 0.00 H ATOM 6799 H SER B 197 1.202 -17.026 39.679 1.00 0.00 H ATOM 6800 N ARG B 198 3.022 -19.481 40.945 1.00 43.46 N ATOM 6801 CA ARG B 198 4.104 -20.275 41.523 1.00 47.51 C ATOM 6802 C ARG B 198 3.895 -20.730 42.992 1.00 41.66 C ATOM 6803 O ARG B 198 4.431 -21.725 43.444 1.00 48.90 O ATOM 6804 CB ARG B 198 5.416 -19.521 41.326 1.00 49.04 C ATOM 6805 CG ARG B 198 5.853 -19.439 39.855 1.00 48.76 C ATOM 6806 CD ARG B 198 7.040 -18.529 39.794 1.00 53.35 C ATOM 6807 NE ARG B 198 7.488 -18.280 38.437 1.00 53.65 N ATOM 6808 CZ ARG B 198 8.717 -17.864 38.148 1.00 54.13 C ATOM 6809 NH1 ARG B 198 9.585 -17.660 39.136 1.00 55.59 N ATOM 6810 NH2 ARG B 198 9.078 -17.643 36.881 1.00 46.85 N ATOM 6811 HA ARG B 198 4.124 -21.223 40.986 1.00 0.00 H ATOM 6812 HB2 ARG B 198 5.294 -18.508 41.708 1.00 0.00 H ATOM 6813 HB3 ARG B 198 6.197 -20.030 41.892 1.00 0.00 H ATOM 6814 HG2 ARG B 198 6.123 -20.430 39.490 1.00 0.00 H ATOM 6815 HG3 ARG B 198 5.043 -19.037 39.247 1.00 0.00 H ATOM 6816 HD2 ARG B 198 7.857 -18.984 40.353 1.00 0.00 H ATOM 6817 HD3 ARG B 198 6.773 -17.577 40.253 1.00 0.00 H ATOM 6818 HE ARG B 198 6.818 -18.434 37.656 1.00 0.00 H ATOM 6819 HH12 ARG B 198 10.549 -17.335 38.922 1.00 0.00 H ATOM 6820 HH11 ARG B 198 9.299 -17.826 40.122 1.00 0.00 H ATOM 6821 HH22 ARG B 198 10.042 -17.318 36.664 1.00 0.00 H ATOM 6822 HH21 ARG B 198 8.395 -17.796 36.112 1.00 0.00 H ATOM 6823 H ARG B 198 3.186 -18.483 40.703 1.00 0.00 H ATOM 6824 N ASN B 199 3.060 -20.026 43.713 1.00 38.49 N ATOM 6825 CA ASN B 199 2.758 -20.398 45.059 1.00 36.53 C ATOM 6826 C ASN B 199 2.166 -21.781 45.250 1.00 42.12 C ATOM 6827 O ASN B 199 2.172 -22.292 46.404 1.00 40.56 O ATOM 6828 CB ASN B 199 1.796 -19.369 45.647 1.00 34.88 C ATOM 6829 CG ASN B 199 2.435 -18.003 45.781 1.00 31.79 C ATOM 6830 OD1 ASN B 199 3.619 -17.827 45.497 1.00 22.66 O ATOM 6831 ND2 ASN B 199 1.653 -17.032 46.215 1.00 25.20 N ATOM 6832 HA ASN B 199 3.720 -20.425 45.571 1.00 0.00 H ATOM 6833 HB2 ASN B 199 0.926 -19.288 44.995 1.00 0.00 H ATOM 6834 HB3 ASN B 199 1.479 -19.707 46.633 1.00 0.00 H ATOM 6835 HD22 ASN B 199 0.657 -17.229 46.443 1.00 0.00 H ATOM 6836 HD21 ASN B 199 2.032 -16.070 46.329 1.00 0.00 H ATOM 6837 H ASN B 199 2.610 -19.184 43.300 1.00 0.00 H ATOM 6838 N ARG B 200 1.629 -22.378 44.172 1.00 44.47 N ATOM 6839 CA ARG B 200 0.947 -23.699 44.289 1.00 50.30 C ATOM 6840 C ARG B 200 2.026 -24.730 44.619 1.00 53.63 C ATOM 6841 O ARG B 200 1.757 -25.723 45.308 1.00 46.84 O ATOM 6842 CB ARG B 200 0.164 -24.107 43.015 1.00 46.43 C ATOM 6843 HA ARG B 200 0.193 -23.639 45.074 1.00 0.00 H ATOM 6844 HB2 ARG B 200 -0.603 -23.361 42.807 1.00 0.00 H ATOM 6845 HB3 ARG B 200 0.852 -24.168 42.171 1.00 0.00 H ATOM 6846 H ARG B 200 1.690 -21.912 43.244 1.00 0.00 H ATOM 6847 N TYR B 201 3.261 -24.425 44.183 1.00 54.34 N ATOM 6848 CA TYR B 201 4.389 -25.350 44.285 1.00 58.51 C ATOM 6849 C TYR B 201 5.133 -25.489 45.634 1.00 59.55 C ATOM 6850 O TYR B 201 5.755 -26.524 45.875 1.00 62.39 O ATOM 6851 CB TYR B 201 5.369 -25.086 43.139 1.00 64.91 C ATOM 6852 CG TYR B 201 4.702 -25.167 41.771 1.00 70.18 C ATOM 6853 CD1 TYR B 201 3.490 -25.872 41.607 1.00 70.10 C ATOM 6854 CD2 TYR B 201 5.280 -24.562 40.638 1.00 71.12 C ATOM 6855 CE1 TYR B 201 2.873 -25.953 40.384 1.00 70.03 C ATOM 6856 CE2 TYR B 201 4.660 -24.646 39.393 1.00 70.03 C ATOM 6857 CZ TYR B 201 3.466 -25.354 39.292 1.00 69.22 C ATOM 6858 OH TYR B 201 2.824 -25.459 38.105 1.00 72.69 O ATOM 6859 HA TYR B 201 3.911 -26.327 44.212 1.00 0.00 H ATOM 6860 HB3 TYR B 201 6.167 -25.827 43.184 1.00 0.00 H ATOM 6861 HB2 TYR B 201 5.793 -24.089 43.263 1.00 0.00 H ATOM 6862 HD2 TYR B 201 6.222 -24.023 40.736 1.00 0.00 H ATOM 6863 HE2 TYR B 201 5.100 -24.168 38.518 1.00 0.00 H ATOM 6864 HE1 TYR B 201 1.927 -26.484 40.277 1.00 0.00 H ATOM 6865 HD1 TYR B 201 3.036 -26.361 42.468 1.00 0.00 H ATOM 6866 HH TYR B 201 1.999 -25.994 38.223 1.00 0.00 H ATOM 6867 H TYR B 201 3.421 -23.491 43.755 1.00 0.00 H ATOM 6868 N LEU B 202 5.071 -24.471 46.504 1.00 58.02 N ATOM 6869 CA LEU B 202 5.780 -24.494 47.802 1.00 53.13 C ATOM 6870 C LEU B 202 5.215 -25.544 48.769 1.00 50.35 C ATOM 6871 O LEU B 202 4.002 -25.559 48.998 1.00 43.09 O ATOM 6872 CB LEU B 202 5.693 -23.125 48.461 1.00 46.37 C ATOM 6873 CG LEU B 202 6.133 -21.992 47.549 1.00 45.23 C ATOM 6874 CD1 LEU B 202 5.419 -20.672 47.991 1.00 39.34 C ATOM 6875 CD2 LEU B 202 7.677 -21.864 47.458 1.00 31.96 C ATOM 6876 HA LEU B 202 6.816 -24.759 47.590 1.00 0.00 H ATOM 6877 HB2 LEU B 202 4.659 -22.949 48.759 1.00 0.00 H ATOM 6878 HB3 LEU B 202 6.330 -23.125 49.346 1.00 0.00 H ATOM 6879 HG LEU B 202 5.825 -22.216 46.528 1.00 0.00 H ATOM 6880 HD21 LEU B 202 8.084 -21.672 48.451 1.00 0.00 H ATOM 6881 HD22 LEU B 202 8.095 -22.791 47.066 1.00 0.00 H ATOM 6882 HD23 LEU B 202 7.933 -21.039 46.793 1.00 0.00 H ATOM 6883 HD11 LEU B 202 4.339 -20.803 47.919 1.00 0.00 H ATOM 6884 HD12 LEU B 202 5.691 -20.441 49.021 1.00 0.00 H ATOM 6885 HD13 LEU B 202 5.731 -19.856 47.340 1.00 0.00 H ATOM 6886 H LEU B 202 4.504 -23.635 46.257 1.00 0.00 H ATOM 6887 N ASP B 203 6.069 -26.408 49.335 1.00 46.30 N ATOM 6888 CA ASP B 203 5.582 -27.316 50.410 1.00 49.22 C ATOM 6889 C ASP B 203 5.042 -26.454 51.565 1.00 45.03 C ATOM 6890 O ASP B 203 5.131 -25.241 51.503 1.00 47.11 O ATOM 6891 CB ASP B 203 6.651 -28.332 50.879 1.00 45.87 C ATOM 6892 CG ASP B 203 7.954 -27.674 51.317 1.00 53.68 C ATOM 6893 OD1 ASP B 203 7.890 -26.779 52.213 1.00 47.03 O ATOM 6894 OD2 ASP B 203 9.040 -28.071 50.765 1.00 49.98 O ATOM 6895 HA ASP B 203 4.778 -27.935 50.010 1.00 0.00 H ATOM 6896 HB2 ASP B 203 6.248 -28.896 51.720 1.00 0.00 H ATOM 6897 HB3 ASP B 203 6.866 -29.013 50.056 1.00 0.00 H ATOM 6898 H ASP B 203 7.062 -26.444 49.027 1.00 0.00 H ATOM 6899 N PRO B 204 4.422 -27.060 52.579 1.00 47.31 N ATOM 6900 CA PRO B 204 3.953 -26.270 53.746 1.00 48.24 C ATOM 6901 C PRO B 204 5.029 -25.484 54.569 1.00 47.39 C ATOM 6902 O PRO B 204 4.719 -24.394 55.091 1.00 39.40 O ATOM 6903 CB PRO B 204 3.241 -27.320 54.618 1.00 50.22 C ATOM 6904 CG PRO B 204 2.911 -28.467 53.636 1.00 50.35 C ATOM 6905 CD PRO B 204 4.027 -28.481 52.664 1.00 47.83 C ATOM 6906 HA PRO B 204 3.330 -25.449 53.393 1.00 0.00 H ATOM 6907 HD3 PRO B 204 4.852 -29.095 53.025 1.00 0.00 H ATOM 6908 HD2 PRO B 204 3.696 -28.853 51.694 1.00 0.00 H ATOM 6909 HG3 PRO B 204 1.965 -28.276 53.129 1.00 0.00 H ATOM 6910 HG2 PRO B 204 2.853 -29.418 54.165 1.00 0.00 H ATOM 6911 HB2 PRO B 204 3.897 -27.670 55.415 1.00 0.00 H ATOM 6912 HB3 PRO B 204 2.330 -26.909 55.053 1.00 0.00 H ATOM 6913 N ALA B 205 6.255 -26.030 54.669 1.00 37.59 N ATOM 6914 CA ALA B 205 7.374 -25.356 55.330 1.00 34.88 C ATOM 6915 C ALA B 205 7.778 -24.085 54.570 1.00 33.38 C ATOM 6916 O ALA B 205 8.028 -23.027 55.138 1.00 38.66 O ATOM 6917 CB ALA B 205 8.602 -26.331 55.471 1.00 29.27 C ATOM 6918 HA ALA B 205 7.049 -25.063 56.328 1.00 0.00 H ATOM 6919 HB1 ALA B 205 8.310 -27.197 56.065 1.00 0.00 H ATOM 6920 HB2 ALA B 205 8.920 -26.658 54.481 1.00 0.00 H ATOM 6921 HB3 ALA B 205 9.423 -25.811 55.965 1.00 0.00 H ATOM 6922 H ALA B 205 6.415 -26.972 54.259 1.00 0.00 H ATOM 6923 N GLN B 206 7.886 -24.246 53.274 1.00 31.75 N ATOM 6924 CA GLN B 206 8.180 -23.189 52.375 1.00 33.57 C ATOM 6925 C GLN B 206 7.024 -22.186 52.333 1.00 31.98 C ATOM 6926 O GLN B 206 7.262 -20.991 52.341 1.00 29.46 O ATOM 6927 CB GLN B 206 8.429 -23.799 50.986 1.00 34.11 C ATOM 6928 CG GLN B 206 9.768 -24.518 50.839 1.00 31.62 C ATOM 6929 CD GLN B 206 9.873 -25.278 49.515 1.00 36.46 C ATOM 6930 OE1 GLN B 206 8.847 -25.606 48.880 1.00 40.97 O ATOM 6931 NE2 GLN B 206 11.120 -25.576 49.092 1.00 32.97 N ATOM 6932 HA GLN B 206 9.068 -22.649 52.705 1.00 0.00 H ATOM 6933 HB2 GLN B 206 7.634 -24.516 50.781 1.00 0.00 H ATOM 6934 HB3 GLN B 206 8.391 -22.996 50.250 1.00 0.00 H ATOM 6935 HG2 GLN B 206 10.570 -23.781 50.886 1.00 0.00 H ATOM 6936 HG3 GLN B 206 9.879 -25.226 51.660 1.00 0.00 H ATOM 6937 HE22 GLN B 206 11.944 -25.282 49.654 1.00 0.00 H ATOM 6938 HE21 GLN B 206 11.257 -26.100 48.204 1.00 0.00 H ATOM 6939 H GLN B 206 7.749 -25.200 52.884 1.00 0.00 H ATOM 6940 N ARG B 207 5.780 -22.663 52.271 1.00 28.12 N ATOM 6941 CA ARG B 207 4.651 -21.739 52.155 1.00 32.40 C ATOM 6942 C ARG B 207 4.751 -20.819 53.326 1.00 32.09 C ATOM 6943 O ARG B 207 4.611 -19.612 53.167 1.00 34.11 O ATOM 6944 CB ARG B 207 3.273 -22.455 52.194 1.00 40.91 C ATOM 6945 CG ARG B 207 1.954 -21.519 52.290 1.00 32.28 C ATOM 6946 CD ARG B 207 1.903 -20.590 51.129 1.00 37.46 C ATOM 6947 NE ARG B 207 0.808 -19.649 51.161 1.00 34.96 N ATOM 6948 CZ ARG B 207 0.765 -18.553 51.913 1.00 32.29 C ATOM 6949 NH1 ARG B 207 1.749 -18.258 52.738 1.00 27.35 N ATOM 6950 NH2 ARG B 207 -0.285 -17.756 51.831 1.00 30.20 N ATOM 6951 HA ARG B 207 4.704 -21.225 51.195 1.00 0.00 H ATOM 6952 HB2 ARG B 207 3.187 -23.051 51.285 1.00 0.00 H ATOM 6953 HB3 ARG B 207 3.271 -23.115 53.061 1.00 0.00 H ATOM 6954 HG2 ARG B 207 1.064 -22.148 52.289 1.00 0.00 H ATOM 6955 HG3 ARG B 207 1.988 -20.941 53.214 1.00 0.00 H ATOM 6956 HD2 ARG B 207 1.814 -21.185 50.220 1.00 0.00 H ATOM 6957 HD3 ARG B 207 2.836 -20.026 51.103 1.00 0.00 H ATOM 6958 HE ARG B 207 -0.010 -19.843 50.549 1.00 0.00 H ATOM 6959 HH12 ARG B 207 1.700 -17.397 53.319 1.00 0.00 H ATOM 6960 HH11 ARG B 207 2.575 -18.886 52.808 1.00 0.00 H ATOM 6961 HH22 ARG B 207 -0.332 -16.896 52.413 1.00 0.00 H ATOM 6962 HH21 ARG B 207 -1.065 -17.989 51.184 1.00 0.00 H ATOM 6963 H ARG B 207 5.613 -23.689 52.305 1.00 0.00 H ATOM 6964 N ALA B 208 5.015 -21.423 54.489 1.00 27.53 N ATOM 6965 CA ALA B 208 5.229 -20.732 55.768 1.00 29.56 C ATOM 6966 C ALA B 208 6.356 -19.681 55.827 1.00 23.12 C ATOM 6967 O ALA B 208 6.097 -18.588 56.260 1.00 25.11 O ATOM 6968 CB ALA B 208 5.410 -21.771 56.926 1.00 32.72 C ATOM 6969 HA ALA B 208 4.319 -20.145 55.889 1.00 0.00 H ATOM 6970 HB1 ALA B 208 4.515 -22.389 57.001 1.00 0.00 H ATOM 6971 HB2 ALA B 208 6.273 -22.403 56.714 1.00 0.00 H ATOM 6972 HB3 ALA B 208 5.567 -21.242 57.866 1.00 0.00 H ATOM 6973 H ALA B 208 5.073 -22.461 54.488 1.00 0.00 H ATOM 6974 N ALA B 209 7.580 -20.053 55.444 1.00 19.77 N ATOM 6975 CA ALA B 209 8.760 -19.190 55.353 1.00 22.04 C ATOM 6976 C ALA B 209 8.602 -18.086 54.273 1.00 26.43 C ATOM 6977 O ALA B 209 9.157 -16.955 54.417 1.00 26.71 O ATOM 6978 CB ALA B 209 10.101 -20.064 55.023 1.00 16.87 C ATOM 6979 HA ALA B 209 8.861 -18.709 56.326 1.00 0.00 H ATOM 6980 HB1 ALA B 209 10.262 -20.794 55.816 1.00 0.00 H ATOM 6981 HB2 ALA B 209 9.971 -20.581 54.072 1.00 0.00 H ATOM 6982 HB3 ALA B 209 10.961 -19.398 54.961 1.00 0.00 H ATOM 6983 H ALA B 209 7.708 -21.052 55.185 1.00 0.00 H ATOM 6984 N ALA B 210 7.888 -18.453 53.198 1.00 22.57 N ATOM 6985 CA ALA B 210 7.435 -17.572 52.133 1.00 26.27 C ATOM 6986 C ALA B 210 6.781 -16.247 52.629 1.00 31.90 C ATOM 6987 O ALA B 210 6.817 -15.241 51.902 1.00 33.96 O ATOM 6988 CB ALA B 210 6.448 -18.346 51.201 1.00 20.96 C ATOM 6989 HA ALA B 210 8.327 -17.269 51.585 1.00 0.00 H ATOM 6990 HB1 ALA B 210 6.958 -19.207 50.769 1.00 0.00 H ATOM 6991 HB2 ALA B 210 5.591 -18.684 51.783 1.00 0.00 H ATOM 6992 HB3 ALA B 210 6.109 -17.685 50.403 1.00 0.00 H ATOM 6993 H ALA B 210 7.636 -19.459 53.119 1.00 0.00 H ATOM 6994 N VAL B 211 6.189 -16.228 53.834 1.00 27.46 N ATOM 6995 CA VAL B 211 5.557 -14.989 54.345 1.00 26.93 C ATOM 6996 C VAL B 211 6.607 -13.904 54.604 1.00 26.13 C ATOM 6997 O VAL B 211 6.288 -12.712 54.649 1.00 26.61 O ATOM 6998 CB VAL B 211 4.773 -15.242 55.665 1.00 30.09 C ATOM 6999 CG1 VAL B 211 5.731 -15.799 56.748 1.00 32.82 C ATOM 7000 CG2 VAL B 211 4.166 -13.948 56.204 1.00 27.33 C ATOM 7001 HA VAL B 211 4.861 -14.656 53.575 1.00 0.00 H ATOM 7002 HB VAL B 211 3.979 -15.955 55.442 1.00 0.00 H ATOM 7003 HG11 VAL B 211 6.164 -16.737 56.401 1.00 0.00 H ATOM 7004 HG12 VAL B 211 6.526 -15.077 56.934 1.00 0.00 H ATOM 7005 HG13 VAL B 211 5.174 -15.973 57.669 1.00 0.00 H ATOM 7006 HG21 VAL B 211 4.962 -13.230 56.404 1.00 0.00 H ATOM 7007 HG22 VAL B 211 3.480 -13.535 55.465 1.00 0.00 H ATOM 7008 HG23 VAL B 211 3.625 -14.159 57.127 1.00 0.00 H ATOM 7009 H VAL B 211 6.174 -17.091 54.414 1.00 0.00 H ATOM 7010 N ALA B 212 7.863 -14.332 54.782 1.00 21.98 N ATOM 7011 CA ALA B 212 8.918 -13.445 55.203 1.00 18.76 C ATOM 7012 C ALA B 212 9.157 -12.337 54.245 1.00 21.39 C ATOM 7013 O ALA B 212 9.662 -11.274 54.634 1.00 30.60 O ATOM 7014 CB ALA B 212 10.230 -14.240 55.448 1.00 18.37 C ATOM 7015 HA ALA B 212 8.590 -12.989 56.137 1.00 0.00 H ATOM 7016 HB1 ALA B 212 10.062 -14.986 56.225 1.00 0.00 H ATOM 7017 HB2 ALA B 212 10.530 -14.736 54.525 1.00 0.00 H ATOM 7018 HB3 ALA B 212 11.015 -13.554 55.765 1.00 0.00 H ATOM 7019 H ALA B 212 8.084 -15.334 54.611 1.00 0.00 H ATOM 7020 N LEU B 213 8.865 -12.576 52.973 1.00 23.02 N ATOM 7021 CA LEU B 213 9.105 -11.544 51.949 1.00 24.38 C ATOM 7022 C LEU B 213 8.263 -10.278 52.136 1.00 22.94 C ATOM 7023 O LEU B 213 8.789 -9.151 52.218 1.00 29.80 O ATOM 7024 CB LEU B 213 8.857 -12.123 50.554 1.00 29.08 C ATOM 7025 CG LEU B 213 10.009 -12.724 49.753 1.00 27.91 C ATOM 7026 CD1 LEU B 213 10.295 -14.104 50.257 1.00 22.07 C ATOM 7027 CD2 LEU B 213 9.692 -12.719 48.220 1.00 23.98 C ATOM 7028 HA LEU B 213 10.147 -11.244 52.061 1.00 0.00 H ATOM 7029 HB2 LEU B 213 8.111 -12.910 50.669 1.00 0.00 H ATOM 7030 HB3 LEU B 213 8.442 -11.317 49.949 1.00 0.00 H ATOM 7031 HG LEU B 213 10.901 -12.113 49.890 1.00 0.00 H ATOM 7032 HD21 LEU B 213 8.793 -13.307 48.034 1.00 0.00 H ATOM 7033 HD22 LEU B 213 9.532 -11.694 47.887 1.00 0.00 H ATOM 7034 HD23 LEU B 213 10.531 -13.153 47.675 1.00 0.00 H ATOM 7035 HD11 LEU B 213 10.569 -14.055 51.311 1.00 0.00 H ATOM 7036 HD12 LEU B 213 9.406 -14.724 50.140 1.00 0.00 H ATOM 7037 HD13 LEU B 213 11.118 -14.535 49.686 1.00 0.00 H ATOM 7038 H LEU B 213 8.465 -13.496 52.698 1.00 0.00 H ATOM 7039 N SER B 214 6.953 -10.458 52.203 1.00 17.04 N ATOM 7040 CA SER B 214 6.063 -9.353 52.478 1.00 22.57 C ATOM 7041 C SER B 214 6.258 -8.812 53.896 1.00 24.64 C ATOM 7042 O SER B 214 6.303 -7.583 54.102 1.00 28.79 O ATOM 7043 CB SER B 214 4.604 -9.726 52.196 1.00 16.37 C ATOM 7044 OG SER B 214 4.253 -10.907 52.866 1.00 21.65 O ATOM 7045 HA SER B 214 6.321 -8.544 51.795 1.00 0.00 H ATOM 7046 HB2 SER B 214 4.473 -9.871 51.124 1.00 0.00 H ATOM 7047 HB3 SER B 214 3.956 -8.917 52.534 1.00 0.00 H ATOM 7048 HG SER B 214 4.837 -11.645 52.559 1.00 0.00 H ATOM 7049 H SER B 214 6.558 -11.409 52.056 1.00 0.00 H ATOM 7050 N ALA B 215 6.435 -9.716 54.856 1.00 21.30 N ATOM 7051 CA ALA B 215 6.698 -9.256 56.198 1.00 27.57 C ATOM 7052 C ALA B 215 7.881 -8.270 56.201 1.00 23.40 C ATOM 7053 O ALA B 215 7.778 -7.207 56.806 1.00 24.14 O ATOM 7054 CB ALA B 215 6.907 -10.431 57.198 1.00 25.03 C ATOM 7055 HA ALA B 215 5.814 -8.724 56.549 1.00 0.00 H ATOM 7056 HB1 ALA B 215 6.009 -11.049 57.223 1.00 0.00 H ATOM 7057 HB2 ALA B 215 7.756 -11.034 56.876 1.00 0.00 H ATOM 7058 HB3 ALA B 215 7.101 -10.030 58.193 1.00 0.00 H ATOM 7059 H ALA B 215 6.385 -10.733 54.644 1.00 0.00 H ATOM 7060 N ALA B 216 8.972 -8.587 55.495 1.00 21.85 N ATOM 7061 CA ALA B 216 10.119 -7.665 55.473 1.00 24.66 C ATOM 7062 C ALA B 216 9.864 -6.341 54.747 1.00 23.09 C ATOM 7063 O ALA B 216 10.494 -5.347 55.058 1.00 21.47 O ATOM 7064 CB ALA B 216 11.315 -8.315 54.903 1.00 23.22 C ATOM 7065 HA ALA B 216 10.287 -7.414 56.520 1.00 0.00 H ATOM 7066 HB1 ALA B 216 11.578 -9.183 55.507 1.00 0.00 H ATOM 7067 HB2 ALA B 216 11.103 -8.632 53.882 1.00 0.00 H ATOM 7068 HB3 ALA B 216 12.145 -7.608 54.901 1.00 0.00 H ATOM 7069 H ALA B 216 9.010 -9.481 54.964 1.00 0.00 H ATOM 7070 N LEU B 217 8.992 -6.354 53.752 1.00 22.37 N ATOM 7071 CA LEU B 217 8.775 -5.180 52.942 1.00 26.09 C ATOM 7072 C LEU B 217 7.901 -4.227 53.755 1.00 28.95 C ATOM 7073 O LEU B 217 8.163 -3.028 53.805 1.00 31.01 O ATOM 7074 CB LEU B 217 8.180 -5.524 51.538 1.00 19.86 C ATOM 7075 CG LEU B 217 9.152 -6.115 50.487 1.00 21.96 C ATOM 7076 CD1 LEU B 217 8.556 -6.346 49.126 1.00 18.53 C ATOM 7077 CD2 LEU B 217 10.266 -5.183 50.253 1.00 25.29 C ATOM 7078 HA LEU B 217 9.724 -4.695 52.711 1.00 0.00 H ATOM 7079 HB2 LEU B 217 7.379 -6.248 51.689 1.00 0.00 H ATOM 7080 HB3 LEU B 217 7.765 -4.606 51.123 1.00 0.00 H ATOM 7081 HG LEU B 217 9.448 -7.072 50.916 1.00 0.00 H ATOM 7082 HD21 LEU B 217 9.874 -4.234 49.887 1.00 0.00 H ATOM 7083 HD22 LEU B 217 10.803 -5.019 51.187 1.00 0.00 H ATOM 7084 HD23 LEU B 217 10.944 -5.608 49.513 1.00 0.00 H ATOM 7085 HD11 LEU B 217 7.724 -7.045 49.209 1.00 0.00 H ATOM 7086 HD12 LEU B 217 8.198 -5.399 48.722 1.00 0.00 H ATOM 7087 HD13 LEU B 217 9.316 -6.761 48.464 1.00 0.00 H ATOM 7088 H LEU B 217 8.456 -7.222 53.551 1.00 0.00 H ATOM 7089 N THR B 218 6.886 -4.755 54.432 1.00 30.07 N ATOM 7090 CA THR B 218 5.988 -3.872 55.197 1.00 31.13 C ATOM 7091 C THR B 218 6.701 -3.349 56.461 1.00 25.57 C ATOM 7092 O THR B 218 6.568 -2.181 56.807 1.00 26.03 O ATOM 7093 CB THR B 218 4.577 -4.539 55.461 1.00 33.27 C ATOM 7094 OG1 THR B 218 4.718 -5.649 56.341 1.00 42.06 O ATOM 7095 CG2 THR B 218 4.044 -5.138 54.214 1.00 33.01 C ATOM 7096 HA THR B 218 5.756 -2.993 54.595 1.00 0.00 H ATOM 7097 HB THR B 218 3.930 -3.758 55.860 1.00 0.00 H ATOM 7098 HG1 THR B 218 5.323 -6.318 55.932 1.00 0.00 H ATOM 7099 HG23 THR B 218 3.901 -4.355 53.469 1.00 0.00 H ATOM 7100 HG21 THR B 218 4.751 -5.876 53.836 1.00 0.00 H ATOM 7101 HG22 THR B 218 3.090 -5.621 54.424 1.00 0.00 H ATOM 7102 H THR B 218 6.727 -5.783 54.422 1.00 0.00 H ATOM 7103 N ALA B 219 7.490 -4.211 57.121 1.00 18.67 N ATOM 7104 CA ALA B 219 8.357 -3.781 58.215 1.00 20.37 C ATOM 7105 C ALA B 219 9.221 -2.633 57.739 1.00 21.44 C ATOM 7106 O ALA B 219 9.380 -1.623 58.411 1.00 29.91 O ATOM 7107 CB ALA B 219 9.217 -4.905 58.669 1.00 15.17 C ATOM 7108 HA ALA B 219 7.741 -3.457 59.054 1.00 0.00 H ATOM 7109 HB1 ALA B 219 8.588 -5.725 59.016 1.00 0.00 H ATOM 7110 HB2 ALA B 219 9.836 -5.246 57.839 1.00 0.00 H ATOM 7111 HB3 ALA B 219 9.856 -4.566 59.484 1.00 0.00 H ATOM 7112 H ALA B 219 7.484 -5.214 56.846 1.00 0.00 H ATOM 7113 N ALA B 220 9.766 -2.792 56.550 1.00 18.42 N ATOM 7114 CA ALA B 220 10.695 -1.827 55.956 1.00 20.61 C ATOM 7115 C ALA B 220 9.979 -0.506 55.776 1.00 27.76 C ATOM 7116 O ALA B 220 10.554 0.556 56.057 1.00 24.22 O ATOM 7117 CB ALA B 220 11.104 -2.335 54.617 1.00 14.33 C ATOM 7118 HA ALA B 220 11.566 -1.694 56.597 1.00 0.00 H ATOM 7119 HB1 ALA B 220 11.592 -3.303 54.731 1.00 0.00 H ATOM 7120 HB2 ALA B 220 10.222 -2.443 53.986 1.00 0.00 H ATOM 7121 HB3 ALA B 220 11.797 -1.629 54.158 1.00 0.00 H ATOM 7122 H ALA B 220 9.525 -3.645 56.006 1.00 0.00 H ATOM 7123 N ALA B 221 8.712 -0.597 55.327 1.00 19.39 N ATOM 7124 CA ALA B 221 7.966 0.555 54.926 1.00 20.35 C ATOM 7125 C ALA B 221 7.643 1.357 56.162 1.00 27.52 C ATOM 7126 O ALA B 221 7.611 2.590 56.093 1.00 30.91 O ATOM 7127 CB ALA B 221 6.680 0.162 54.209 1.00 14.75 C ATOM 7128 HA ALA B 221 8.561 1.145 54.228 1.00 0.00 H ATOM 7129 HB1 ALA B 221 6.924 -0.420 53.320 1.00 0.00 H ATOM 7130 HB2 ALA B 221 6.061 -0.436 54.878 1.00 0.00 H ATOM 7131 HB3 ALA B 221 6.138 1.062 53.918 1.00 0.00 H ATOM 7132 H ALA B 221 8.263 -1.533 55.270 1.00 0.00 H ATOM 7133 N HIS B 222 7.405 0.674 57.284 1.00 26.57 N ATOM 7134 CA HIS B 222 7.134 1.377 58.559 1.00 25.38 C ATOM 7135 C HIS B 222 8.427 1.754 59.318 1.00 28.66 C ATOM 7136 O HIS B 222 8.445 2.758 60.001 1.00 31.61 O ATOM 7137 CB HIS B 222 6.136 0.605 59.419 1.00 20.13 C ATOM 7138 CG HIS B 222 4.742 0.531 58.821 1.00 30.58 C ATOM 7139 ND1 HIS B 222 4.345 -0.473 57.964 1.00 30.70 N ATOM 7140 CD2 HIS B 222 3.670 1.357 58.944 1.00 32.53 C ATOM 7141 CE1 HIS B 222 3.103 -0.255 57.568 1.00 38.16 C ATOM 7142 NE2 HIS B 222 2.668 0.850 58.151 1.00 39.27 N ATOM 7143 HA HIS B 222 6.662 2.327 58.310 1.00 0.00 H ATOM 7144 HB2 HIS B 222 6.509 -0.411 59.550 1.00 0.00 H ATOM 7145 HB3 HIS B 222 6.068 1.094 60.391 1.00 0.00 H ATOM 7146 HD2 HIS B 222 3.615 2.256 59.558 1.00 0.00 H ATOM 7147 HE1 HIS B 222 2.534 -0.879 56.879 1.00 0.00 H ATOM 7148 H HIS B 222 7.410 -0.366 57.262 1.00 0.00 H ATOM 7149 N ALA B 223 9.506 0.974 59.194 1.00 24.14 N ATOM 7150 CA ALA B 223 10.776 1.359 59.780 1.00 23.43 C ATOM 7151 C ALA B 223 11.240 2.648 59.109 1.00 29.91 C ATOM 7152 O ALA B 223 12.117 3.320 59.630 1.00 27.91 O ATOM 7153 CB ALA B 223 11.803 0.314 59.494 1.00 19.24 C ATOM 7154 HA ALA B 223 10.655 1.484 60.856 1.00 0.00 H ATOM 7155 HB1 ALA B 223 11.482 -0.636 59.921 1.00 0.00 H ATOM 7156 HB2 ALA B 223 11.921 0.208 58.416 1.00 0.00 H ATOM 7157 HB3 ALA B 223 12.754 0.610 59.937 1.00 0.00 H ATOM 7158 H ALA B 223 9.434 0.079 58.670 1.00 0.00 H ATOM 7159 N ALA B 224 10.712 2.934 57.905 1.00 29.82 N ATOM 7160 CA ALA B 224 11.340 3.919 57.009 1.00 29.70 C ATOM 7161 C ALA B 224 11.311 5.402 57.477 1.00 32.80 C ATOM 7162 O ALA B 224 12.116 6.211 57.018 1.00 33.69 O ATOM 7163 CB ALA B 224 10.788 3.799 55.598 1.00 29.33 C ATOM 7164 HA ALA B 224 12.396 3.651 57.034 1.00 0.00 H ATOM 7165 HB1 ALA B 224 10.988 2.798 55.215 1.00 0.00 H ATOM 7166 HB2 ALA B 224 9.712 3.975 55.614 1.00 0.00 H ATOM 7167 HB3 ALA B 224 11.269 4.538 54.957 1.00 0.00 H ATOM 7168 H ALA B 224 9.843 2.450 57.601 1.00 0.00 H ATOM 7169 N THR B 225 10.399 5.755 58.375 1.00 26.31 N ATOM 7170 CA THR B 225 10.384 7.091 58.939 1.00 25.88 C ATOM 7171 C THR B 225 11.658 7.406 59.629 1.00 27.34 C ATOM 7172 O THR B 225 11.909 8.581 59.910 1.00 37.68 O ATOM 7173 CB THR B 225 9.281 7.284 59.982 1.00 25.87 C ATOM 7174 OG1 THR B 225 9.498 6.361 61.050 1.00 33.93 O ATOM 7175 CG2 THR B 225 7.927 7.044 59.381 1.00 28.18 C ATOM 7176 HA THR B 225 10.216 7.747 58.085 1.00 0.00 H ATOM 7177 HB THR B 225 9.313 8.310 60.350 1.00 0.00 H ATOM 7178 HG1 THR B 225 8.790 6.476 61.733 1.00 0.00 H ATOM 7179 HG23 THR B 225 7.762 7.749 58.566 1.00 0.00 H ATOM 7180 HG21 THR B 225 7.877 6.025 58.997 1.00 0.00 H ATOM 7181 HG22 THR B 225 7.162 7.184 60.145 1.00 0.00 H ATOM 7182 H THR B 225 9.685 5.063 58.679 1.00 0.00 H ATOM 7183 N ALA B 226 12.446 6.383 59.949 1.00 29.69 N ATOM 7184 CA ALA B 226 13.830 6.602 60.438 1.00 27.59 C ATOM 7185 C ALA B 226 14.880 6.634 59.346 1.00 27.41 C ATOM 7186 O ALA B 226 16.074 6.637 59.639 1.00 29.78 O ATOM 7187 CB ALA B 226 14.222 5.594 61.484 1.00 14.63 C ATOM 7188 HA ALA B 226 13.804 7.597 60.882 1.00 0.00 H ATOM 7189 HB1 ALA B 226 13.543 5.671 62.333 1.00 0.00 H ATOM 7190 HB2 ALA B 226 14.164 4.591 61.060 1.00 0.00 H ATOM 7191 HB3 ALA B 226 15.242 5.792 61.813 1.00 0.00 H ATOM 7192 H ALA B 226 12.086 5.412 59.855 1.00 0.00 H ATOM 7193 N GLY B 227 14.452 6.649 58.087 1.00 25.55 N ATOM 7194 CA GLY B 227 15.436 6.638 57.020 1.00 27.40 C ATOM 7195 C GLY B 227 15.786 5.325 56.333 1.00 29.45 C ATOM 7196 O GLY B 227 15.319 4.261 56.708 1.00 33.95 O ATOM 7197 HA3 GLY B 227 16.362 7.033 57.439 1.00 0.00 H ATOM 7198 HA2 GLY B 227 15.071 7.313 56.246 1.00 0.00 H ATOM 7199 H GLY B 227 13.435 6.668 57.872 1.00 0.00 H ATOM 7200 N ALA B 228 16.673 5.423 55.354 1.00 33.12 N ATOM 7201 CA ALA B 228 16.920 4.382 54.403 1.00 36.28 C ATOM 7202 C ALA B 228 17.630 3.162 54.979 1.00 36.09 C ATOM 7203 O ALA B 228 17.166 2.031 54.771 1.00 32.28 O ATOM 7204 CB ALA B 228 17.690 4.943 53.210 1.00 40.06 C ATOM 7205 HA ALA B 228 15.942 4.021 54.083 1.00 0.00 H ATOM 7206 HB1 ALA B 228 17.103 5.731 52.738 1.00 0.00 H ATOM 7207 HB2 ALA B 228 18.641 5.352 53.552 1.00 0.00 H ATOM 7208 HB3 ALA B 228 17.874 4.145 52.491 1.00 0.00 H ATOM 7209 H ALA B 228 17.220 6.304 55.272 1.00 0.00 H ATOM 7210 N GLN B 229 18.724 3.374 55.702 1.00 33.52 N ATOM 7211 CA GLN B 229 19.434 2.242 56.273 1.00 33.11 C ATOM 7212 C GLN B 229 18.533 1.501 57.280 1.00 37.16 C ATOM 7213 O GLN B 229 18.733 0.294 57.516 1.00 36.75 O ATOM 7214 CB GLN B 229 20.742 2.693 56.974 1.00 36.63 C ATOM 7215 CG GLN B 229 21.802 1.571 57.164 1.00 42.02 C ATOM 7216 CD GLN B 229 22.149 0.909 55.804 1.00 46.36 C ATOM 7217 OE1 GLN B 229 22.474 1.603 54.836 1.00 47.99 O ATOM 7218 NE2 GLN B 229 22.034 -0.420 55.722 1.00 43.11 N ATOM 7219 HA GLN B 229 19.697 1.568 55.458 1.00 0.00 H ATOM 7220 HB2 GLN B 229 21.191 3.486 56.376 1.00 0.00 H ATOM 7221 HB3 GLN B 229 20.482 3.084 57.958 1.00 0.00 H ATOM 7222 HG2 GLN B 229 22.706 2.002 57.594 1.00 0.00 H ATOM 7223 HG3 GLN B 229 21.405 0.814 57.840 1.00 0.00 H ATOM 7224 HE22 GLN B 229 21.758 -0.971 56.560 1.00 0.00 H ATOM 7225 HE21 GLN B 229 22.221 -0.903 54.820 1.00 0.00 H ATOM 7226 H GLN B 229 19.070 4.342 55.858 1.00 0.00 H ATOM 7227 N ALA B 230 17.581 2.219 57.907 1.00 31.39 N ATOM 7228 CA ALA B 230 16.751 1.596 58.919 1.00 26.73 C ATOM 7229 C ALA B 230 15.824 0.601 58.207 1.00 29.81 C ATOM 7230 O ALA B 230 15.669 -0.530 58.640 1.00 23.09 O ATOM 7231 CB ALA B 230 15.937 2.626 59.687 1.00 30.41 C ATOM 7232 HA ALA B 230 17.380 1.086 59.649 1.00 0.00 H ATOM 7233 HB1 ALA B 230 16.611 3.327 60.178 1.00 0.00 H ATOM 7234 HB2 ALA B 230 15.290 3.166 58.995 1.00 0.00 H ATOM 7235 HB3 ALA B 230 15.328 2.121 60.436 1.00 0.00 H ATOM 7236 H ALA B 230 17.442 3.221 57.665 1.00 0.00 H ATOM 7237 N ALA B 231 15.215 1.060 57.119 1.00 26.13 N ATOM 7238 CA ALA B 231 14.226 0.322 56.394 1.00 26.42 C ATOM 7239 C ALA B 231 14.850 -0.930 55.813 1.00 30.26 C ATOM 7240 O ALA B 231 14.202 -1.965 55.762 1.00 31.01 O ATOM 7241 CB ALA B 231 13.657 1.172 55.261 1.00 22.02 C ATOM 7242 HA ALA B 231 13.421 0.051 57.077 1.00 0.00 H ATOM 7243 HB1 ALA B 231 13.199 2.070 55.677 1.00 0.00 H ATOM 7244 HB2 ALA B 231 14.461 1.454 54.581 1.00 0.00 H ATOM 7245 HB3 ALA B 231 12.906 0.597 54.719 1.00 0.00 H ATOM 7246 H ALA B 231 15.471 2.008 56.775 1.00 0.00 H ATOM 7247 N LEU B 232 16.103 -0.830 55.382 1.00 25.70 N ATOM 7248 CA LEU B 232 16.781 -1.962 54.777 1.00 33.56 C ATOM 7249 C LEU B 232 17.210 -2.988 55.827 1.00 29.98 C ATOM 7250 O LEU B 232 17.134 -4.175 55.604 1.00 28.09 O ATOM 7251 CB LEU B 232 18.023 -1.507 53.978 1.00 34.37 C ATOM 7252 CG LEU B 232 18.018 -1.026 52.528 1.00 37.37 C ATOM 7253 CD1 LEU B 232 19.408 -0.433 52.212 1.00 33.03 C ATOM 7254 CD2 LEU B 232 17.736 -2.181 51.577 1.00 36.05 C ATOM 7255 HA LEU B 232 16.067 -2.429 54.099 1.00 0.00 H ATOM 7256 HB2 LEU B 232 18.451 -0.686 54.553 1.00 0.00 H ATOM 7257 HB3 LEU B 232 18.706 -2.357 53.998 1.00 0.00 H ATOM 7258 HG LEU B 232 17.237 -0.277 52.398 1.00 0.00 H ATOM 7259 HD21 LEU B 232 18.508 -2.942 51.693 1.00 0.00 H ATOM 7260 HD22 LEU B 232 16.762 -2.611 51.809 1.00 0.00 H ATOM 7261 HD23 LEU B 232 17.738 -1.814 50.551 1.00 0.00 H ATOM 7262 HD11 LEU B 232 19.607 0.402 52.884 1.00 0.00 H ATOM 7263 HD12 LEU B 232 20.169 -1.201 52.350 1.00 0.00 H ATOM 7264 HD13 LEU B 232 19.426 -0.083 51.180 1.00 0.00 H ATOM 7265 H LEU B 232 16.606 0.075 55.480 1.00 0.00 H ATOM 7266 N ASP B 233 17.717 -2.506 56.950 1.00 30.10 N ATOM 7267 CA ASP B 233 18.095 -3.372 58.031 1.00 29.28 C ATOM 7268 C ASP B 233 16.845 -4.078 58.570 1.00 30.93 C ATOM 7269 O ASP B 233 16.915 -5.264 58.926 1.00 24.60 O ATOM 7270 CB ASP B 233 18.773 -2.572 59.140 1.00 31.94 C ATOM 7271 CG ASP B 233 20.104 -1.978 58.712 1.00 32.00 C ATOM 7272 OD1 ASP B 233 20.483 -2.055 57.509 1.00 34.73 O ATOM 7273 OD2 ASP B 233 20.785 -1.440 59.587 1.00 29.46 O ATOM 7274 HA ASP B 233 18.803 -4.117 57.668 1.00 0.00 H ATOM 7275 HB2 ASP B 233 18.110 -1.760 59.439 1.00 0.00 H ATOM 7276 HB3 ASP B 233 18.944 -3.232 59.991 1.00 0.00 H ATOM 7277 H ASP B 233 17.844 -1.479 57.052 1.00 0.00 H ATOM 7278 N ALA B 234 15.708 -3.379 58.615 1.00 22.42 N ATOM 7279 CA ALA B 234 14.498 -4.027 59.153 1.00 32.22 C ATOM 7280 C ALA B 234 14.120 -5.224 58.253 1.00 30.47 C ATOM 7281 O ALA B 234 13.818 -6.333 58.728 1.00 24.94 O ATOM 7282 CB ALA B 234 13.270 -3.021 59.323 1.00 25.92 C ATOM 7283 HA ALA B 234 14.729 -4.379 60.158 1.00 0.00 H ATOM 7284 HB1 ALA B 234 13.549 -2.221 60.009 1.00 0.00 H ATOM 7285 HB2 ALA B 234 13.013 -2.596 58.353 1.00 0.00 H ATOM 7286 HB3 ALA B 234 12.412 -3.561 59.723 1.00 0.00 H ATOM 7287 H ALA B 234 15.677 -2.396 58.277 1.00 0.00 H ATOM 7288 N ALA B 235 14.203 -4.986 56.950 1.00 25.24 N ATOM 7289 CA ALA B 235 13.782 -5.954 55.991 1.00 23.86 C ATOM 7290 C ALA B 235 14.737 -7.132 56.033 1.00 21.93 C ATOM 7291 O ALA B 235 14.302 -8.277 56.037 1.00 20.75 O ATOM 7292 CB ALA B 235 13.744 -5.324 54.630 1.00 26.02 C ATOM 7293 HA ALA B 235 12.779 -6.313 56.222 1.00 0.00 H ATOM 7294 HB1 ALA B 235 13.043 -4.489 54.637 1.00 0.00 H ATOM 7295 HB2 ALA B 235 14.739 -4.963 54.370 1.00 0.00 H ATOM 7296 HB3 ALA B 235 13.422 -6.064 53.897 1.00 0.00 H ATOM 7297 H ALA B 235 14.583 -4.075 56.622 1.00 0.00 H ATOM 7298 N ARG B 236 16.033 -6.840 56.107 1.00 20.13 N ATOM 7299 CA ARG B 236 17.054 -7.861 56.196 1.00 22.04 C ATOM 7300 C ARG B 236 16.900 -8.719 57.443 1.00 21.96 C ATOM 7301 O ARG B 236 17.061 -9.935 57.415 1.00 24.65 O ATOM 7302 CB ARG B 236 18.472 -7.241 56.052 1.00 26.26 C ATOM 7303 CG ARG B 236 19.608 -8.243 56.217 1.00 35.65 C ATOM 7304 CD ARG B 236 19.492 -9.391 55.248 1.00 46.56 C ATOM 7305 NE ARG B 236 19.803 -8.886 53.906 1.00 58.38 N ATOM 7306 CZ ARG B 236 19.836 -9.602 52.780 1.00 50.56 C ATOM 7307 NH1 ARG B 236 19.572 -10.915 52.756 1.00 51.53 N ATOM 7308 NH2 ARG B 236 20.159 -8.971 51.682 1.00 42.44 N ATOM 7309 HA ARG B 236 16.921 -8.543 55.356 1.00 0.00 H ATOM 7310 HB2 ARG B 236 18.551 -6.793 55.061 1.00 0.00 H ATOM 7311 HB3 ARG B 236 18.586 -6.466 56.810 1.00 0.00 H ATOM 7312 HG2 ARG B 236 20.556 -7.732 56.047 1.00 0.00 H ATOM 7313 HG3 ARG B 236 19.586 -8.636 57.233 1.00 0.00 H ATOM 7314 HD2 ARG B 236 18.478 -9.791 55.267 1.00 0.00 H ATOM 7315 HD3 ARG B 236 20.196 -10.177 55.520 1.00 0.00 H ATOM 7316 HE ARG B 236 20.019 -7.872 53.824 1.00 0.00 H ATOM 7317 HH12 ARG B 236 19.609 -11.436 51.857 1.00 0.00 H ATOM 7318 HH11 ARG B 236 19.330 -11.413 53.636 1.00 0.00 H ATOM 7319 HH22 ARG B 236 20.199 -9.485 50.779 1.00 0.00 H ATOM 7320 HH21 ARG B 236 20.376 -7.954 51.711 1.00 0.00 H ATOM 7321 H ARG B 236 16.323 -5.841 56.101 1.00 0.00 H ATOM 7322 N ALA B 237 16.554 -8.106 58.560 1.00 26.84 N ATOM 7323 CA ALA B 237 16.340 -8.901 59.771 1.00 21.02 C ATOM 7324 C ALA B 237 15.196 -9.885 59.572 1.00 23.82 C ATOM 7325 O ALA B 237 15.359 -11.049 59.925 1.00 27.12 O ATOM 7326 CB ALA B 237 16.060 -8.028 60.933 1.00 16.63 C ATOM 7327 HA ALA B 237 17.254 -9.460 59.970 1.00 0.00 H ATOM 7328 HB1 ALA B 237 16.906 -7.360 61.096 1.00 0.00 H ATOM 7329 HB2 ALA B 237 15.164 -7.440 60.736 1.00 0.00 H ATOM 7330 HB3 ALA B 237 15.905 -8.643 61.819 1.00 0.00 H ATOM 7331 H ALA B 237 16.435 -7.073 58.580 1.00 0.00 H ATOM 7332 N VAL B 238 14.049 -9.428 59.033 1.00 16.64 N ATOM 7333 CA VAL B 238 12.917 -10.320 58.831 1.00 18.27 C ATOM 7334 C VAL B 238 13.320 -11.521 57.951 1.00 25.39 C ATOM 7335 O VAL B 238 12.980 -12.669 58.244 1.00 29.44 O ATOM 7336 CB VAL B 238 11.715 -9.601 58.258 1.00 20.93 C ATOM 7337 CG1 VAL B 238 10.573 -10.600 57.935 1.00 12.66 C ATOM 7338 CG2 VAL B 238 11.230 -8.506 59.234 1.00 14.91 C ATOM 7339 HA VAL B 238 12.621 -10.694 59.811 1.00 0.00 H ATOM 7340 HB VAL B 238 12.013 -9.123 57.324 1.00 0.00 H ATOM 7341 HG11 VAL B 238 10.926 -11.330 57.206 1.00 0.00 H ATOM 7342 HG12 VAL B 238 10.272 -11.113 58.848 1.00 0.00 H ATOM 7343 HG13 VAL B 238 9.722 -10.057 57.525 1.00 0.00 H ATOM 7344 HG21 VAL B 238 10.952 -8.964 60.183 1.00 0.00 H ATOM 7345 HG22 VAL B 238 12.032 -7.786 59.398 1.00 0.00 H ATOM 7346 HG23 VAL B 238 10.365 -7.998 58.807 1.00 0.00 H ATOM 7347 H VAL B 238 13.972 -8.428 58.759 1.00 0.00 H ATOM 7348 N LEU B 239 14.114 -11.249 56.925 1.00 27.27 N ATOM 7349 CA LEU B 239 14.575 -12.269 56.032 1.00 29.42 C ATOM 7350 C LEU B 239 15.600 -13.255 56.634 1.00 24.01 C ATOM 7351 O LEU B 239 15.617 -14.412 56.263 1.00 20.42 O ATOM 7352 CB LEU B 239 15.095 -11.615 54.742 1.00 26.64 C ATOM 7353 CG LEU B 239 13.944 -11.082 53.934 1.00 23.55 C ATOM 7354 CD1 LEU B 239 14.455 -10.109 52.923 1.00 14.28 C ATOM 7355 CD2 LEU B 239 13.185 -12.267 53.237 1.00 24.30 C ATOM 7356 HA LEU B 239 13.715 -12.901 55.812 1.00 0.00 H ATOM 7357 HB2 LEU B 239 15.767 -10.795 54.998 1.00 0.00 H ATOM 7358 HB3 LEU B 239 15.636 -12.356 54.154 1.00 0.00 H ATOM 7359 HG LEU B 239 13.242 -10.568 54.590 1.00 0.00 H ATOM 7360 HD21 LEU B 239 13.871 -12.799 52.578 1.00 0.00 H ATOM 7361 HD22 LEU B 239 12.805 -12.950 53.997 1.00 0.00 H ATOM 7362 HD23 LEU B 239 12.353 -11.871 52.654 1.00 0.00 H ATOM 7363 HD11 LEU B 239 14.954 -9.285 53.433 1.00 0.00 H ATOM 7364 HD12 LEU B 239 15.162 -10.611 52.263 1.00 0.00 H ATOM 7365 HD13 LEU B 239 13.620 -9.723 52.338 1.00 0.00 H ATOM 7366 H LEU B 239 14.411 -10.265 56.764 1.00 0.00 H ATOM 7367 N ASP B 240 16.432 -12.775 57.543 1.00 24.08 N ATOM 7368 CA ASP B 240 17.406 -13.597 58.276 1.00 24.31 C ATOM 7369 C ASP B 240 16.721 -14.481 59.274 1.00 25.57 C ATOM 7370 O ASP B 240 17.368 -15.375 59.877 1.00 24.14 O ATOM 7371 CB ASP B 240 18.362 -12.704 59.064 1.00 20.74 C ATOM 7372 CG ASP B 240 19.394 -12.100 58.194 1.00 30.85 C ATOM 7373 OD1 ASP B 240 19.649 -12.672 57.100 1.00 24.72 O ATOM 7374 OD2 ASP B 240 19.956 -11.059 58.592 1.00 39.49 O ATOM 7375 HA ASP B 240 17.939 -14.196 57.538 1.00 0.00 H ATOM 7376 HB2 ASP B 240 17.790 -11.907 59.539 1.00 0.00 H ATOM 7377 HB3 ASP B 240 18.853 -13.303 59.831 1.00 0.00 H ATOM 7378 H ASP B 240 16.395 -11.757 57.751 1.00 0.00 H ATOM 7379 N ALA B 241 15.434 -14.211 59.510 1.00 14.55 N ATOM 7380 CA ALA B 241 14.747 -14.990 60.525 1.00 16.17 C ATOM 7381 C ALA B 241 13.972 -16.090 59.834 1.00 19.33 C ATOM 7382 O ALA B 241 13.200 -16.810 60.454 1.00 26.61 O ATOM 7383 CB ALA B 241 13.864 -14.131 61.349 1.00 4.39 C ATOM 7384 HA ALA B 241 15.471 -15.433 61.209 1.00 0.00 H ATOM 7385 HB1 ALA B 241 14.462 -13.364 61.842 1.00 0.00 H ATOM 7386 HB2 ALA B 241 13.120 -13.657 60.709 1.00 0.00 H ATOM 7387 HB3 ALA B 241 13.363 -14.742 62.100 1.00 0.00 H ATOM 7388 H ALA B 241 14.938 -13.464 58.982 1.00 0.00 H ATOM 7389 N ALA B 242 14.211 -16.250 58.540 1.00 24.83 N ATOM 7390 CA ALA B 242 13.534 -17.286 57.740 1.00 22.67 C ATOM 7391 C ALA B 242 14.476 -18.369 57.287 1.00 21.72 C ATOM 7392 O ALA B 242 15.517 -18.053 56.659 1.00 27.91 O ATOM 7393 CB ALA B 242 12.945 -16.675 56.551 1.00 24.34 C ATOM 7394 HA ALA B 242 12.773 -17.734 58.378 1.00 0.00 H ATOM 7395 HB1 ALA B 242 12.222 -15.918 56.854 1.00 0.00 H ATOM 7396 HB2 ALA B 242 13.731 -16.211 55.955 1.00 0.00 H ATOM 7397 HB3 ALA B 242 12.445 -17.442 55.960 1.00 0.00 H ATOM 7398 H ALA B 242 14.899 -15.624 58.074 1.00 0.00 H ATOM 7399 N PRO B 243 14.087 -19.645 57.487 1.00 18.91 N ATOM 7400 CA PRO B 243 14.901 -20.779 56.987 1.00 21.56 C ATOM 7401 C PRO B 243 14.533 -21.118 55.521 1.00 25.67 C ATOM 7402 O PRO B 243 13.362 -21.007 55.110 1.00 28.85 O ATOM 7403 CB PRO B 243 14.489 -21.928 57.906 1.00 23.07 C ATOM 7404 CG PRO B 243 12.938 -21.659 58.161 1.00 17.56 C ATOM 7405 CD PRO B 243 12.810 -20.101 58.076 1.00 22.30 C ATOM 7406 HA PRO B 243 15.971 -20.570 56.995 1.00 0.00 H ATOM 7407 HD3 PRO B 243 11.971 -19.819 57.439 1.00 0.00 H ATOM 7408 HD2 PRO B 243 12.671 -19.673 59.069 1.00 0.00 H ATOM 7409 HG3 PRO B 243 12.637 -22.021 59.144 1.00 0.00 H ATOM 7410 HG2 PRO B 243 12.329 -22.141 57.396 1.00 0.00 H ATOM 7411 HB2 PRO B 243 14.643 -22.891 57.420 1.00 0.00 H ATOM 7412 HB3 PRO B 243 15.049 -21.900 58.841 1.00 0.00 H ATOM 7413 N GLY B 244 15.528 -21.517 54.736 1.00 26.95 N ATOM 7414 CA GLY B 244 15.284 -21.922 53.373 1.00 27.37 C ATOM 7415 C GLY B 244 14.863 -20.816 52.418 1.00 27.39 C ATOM 7416 O GLY B 244 14.227 -21.092 51.415 1.00 33.61 O ATOM 7417 HA3 GLY B 244 14.494 -22.673 53.384 1.00 0.00 H ATOM 7418 HA2 GLY B 244 16.201 -22.366 52.987 1.00 0.00 H ATOM 7419 H GLY B 244 16.498 -21.538 55.110 1.00 0.00 H ATOM 7420 N VAL B 245 15.241 -19.579 52.711 1.00 27.38 N ATOM 7421 CA VAL B 245 14.953 -18.441 51.861 1.00 22.44 C ATOM 7422 C VAL B 245 16.265 -17.775 51.422 1.00 23.91 C ATOM 7423 O VAL B 245 16.827 -16.935 52.121 1.00 25.34 O ATOM 7424 CB VAL B 245 13.987 -17.485 52.616 1.00 24.20 C ATOM 7425 CG1 VAL B 245 13.610 -16.239 51.828 1.00 22.06 C ATOM 7426 CG2 VAL B 245 12.742 -18.237 52.934 1.00 25.50 C ATOM 7427 HA VAL B 245 14.450 -18.748 50.944 1.00 0.00 H ATOM 7428 HB VAL B 245 14.510 -17.144 53.509 1.00 0.00 H ATOM 7429 HG11 VAL B 245 14.511 -15.671 51.596 1.00 0.00 H ATOM 7430 HG12 VAL B 245 13.116 -16.532 50.902 1.00 0.00 H ATOM 7431 HG13 VAL B 245 12.934 -15.625 52.423 1.00 0.00 H ATOM 7432 HG21 VAL B 245 12.281 -18.582 52.008 1.00 0.00 H ATOM 7433 HG22 VAL B 245 12.987 -19.094 53.561 1.00 0.00 H ATOM 7434 HG23 VAL B 245 12.050 -17.583 53.465 1.00 0.00 H ATOM 7435 H VAL B 245 15.769 -19.418 53.592 1.00 0.00 H ATOM 7436 N ALA B 246 16.716 -18.137 50.223 1.00 22.39 N ATOM 7437 CA ALA B 246 17.908 -17.589 49.643 1.00 22.93 C ATOM 7438 C ALA B 246 17.591 -16.316 48.855 1.00 33.18 C ATOM 7439 O ALA B 246 16.904 -16.376 47.810 1.00 32.56 O ATOM 7440 CB ALA B 246 18.545 -18.610 48.759 1.00 18.74 C ATOM 7441 HA ALA B 246 18.602 -17.323 50.440 1.00 0.00 H ATOM 7442 HB1 ALA B 246 18.798 -19.491 49.348 1.00 0.00 H ATOM 7443 HB2 ALA B 246 17.849 -18.888 47.967 1.00 0.00 H ATOM 7444 HB3 ALA B 246 19.451 -18.193 48.319 1.00 0.00 H ATOM 7445 H ALA B 246 16.181 -18.848 49.684 1.00 0.00 H ATOM 7446 N VAL B 247 18.092 -15.171 49.347 1.00 33.63 N ATOM 7447 CA VAL B 247 17.782 -13.860 48.741 1.00 32.02 C ATOM 7448 C VAL B 247 18.624 -13.580 47.470 1.00 37.89 C ATOM 7449 O VAL B 247 19.862 -13.584 47.536 1.00 38.69 O ATOM 7450 CB VAL B 247 17.987 -12.677 49.738 1.00 31.90 C ATOM 7451 CG1 VAL B 247 17.599 -11.320 49.082 1.00 19.70 C ATOM 7452 CG2 VAL B 247 17.220 -12.903 51.107 1.00 27.85 C ATOM 7453 HA VAL B 247 16.728 -13.921 48.468 1.00 0.00 H ATOM 7454 HB VAL B 247 19.049 -12.642 49.980 1.00 0.00 H ATOM 7455 HG11 VAL B 247 18.223 -11.150 48.205 1.00 0.00 H ATOM 7456 HG12 VAL B 247 16.551 -11.349 48.784 1.00 0.00 H ATOM 7457 HG13 VAL B 247 17.752 -10.514 49.800 1.00 0.00 H ATOM 7458 HG21 VAL B 247 16.152 -12.999 50.912 1.00 0.00 H ATOM 7459 HG22 VAL B 247 17.587 -13.813 51.582 1.00 0.00 H ATOM 7460 HG23 VAL B 247 17.395 -12.052 51.765 1.00 0.00 H ATOM 7461 H VAL B 247 18.716 -15.209 50.178 1.00 0.00 H ATOM 7462 N ASP B 248 17.975 -13.356 46.324 1.00 33.59 N ATOM 7463 CA ASP B 248 18.734 -12.977 45.110 1.00 38.96 C ATOM 7464 C ASP B 248 19.185 -11.485 45.218 1.00 33.73 C ATOM 7465 O ASP B 248 20.310 -11.188 44.952 1.00 32.30 O ATOM 7466 CB ASP B 248 18.000 -13.359 43.778 1.00 37.03 C ATOM 7467 CG ASP B 248 18.167 -14.894 43.405 1.00 46.04 C ATOM 7468 OD1 ASP B 248 19.047 -15.584 43.993 1.00 41.58 O ATOM 7469 OD2 ASP B 248 17.424 -15.418 42.513 1.00 45.27 O ATOM 7470 HA ASP B 248 19.643 -13.576 45.058 1.00 0.00 H ATOM 7471 HB2 ASP B 248 16.938 -13.140 43.890 1.00 0.00 H ATOM 7472 HB3 ASP B 248 18.411 -12.756 42.968 1.00 0.00 H ATOM 7473 H ASP B 248 16.940 -13.447 46.284 1.00 0.00 H ATOM 7474 N TYR B 249 18.317 -10.576 45.667 1.00 30.76 N ATOM 7475 CA TYR B 249 18.707 -9.205 45.981 1.00 25.30 C ATOM 7476 C TYR B 249 17.650 -8.621 46.869 1.00 26.86 C ATOM 7477 O TYR B 249 16.495 -9.071 46.890 1.00 31.91 O ATOM 7478 CB TYR B 249 18.776 -8.326 44.708 1.00 28.65 C ATOM 7479 CG TYR B 249 17.536 -8.403 43.804 1.00 24.60 C ATOM 7480 CD1 TYR B 249 16.369 -7.758 44.170 1.00 22.79 C ATOM 7481 CD2 TYR B 249 17.542 -9.122 42.596 1.00 25.57 C ATOM 7482 CE1 TYR B 249 15.221 -7.796 43.402 1.00 21.20 C ATOM 7483 CE2 TYR B 249 16.368 -9.181 41.787 1.00 25.37 C ATOM 7484 CZ TYR B 249 15.210 -8.476 42.224 1.00 30.05 C ATOM 7485 OH TYR B 249 14.018 -8.413 41.516 1.00 32.42 O ATOM 7486 HA TYR B 249 19.690 -9.224 46.452 1.00 0.00 H ATOM 7487 HB3 TYR B 249 19.641 -8.641 44.125 1.00 0.00 H ATOM 7488 HB2 TYR B 249 18.906 -7.289 45.018 1.00 0.00 H ATOM 7489 HD2 TYR B 249 18.448 -9.637 42.276 1.00 0.00 H ATOM 7490 HE2 TYR B 249 16.358 -9.751 40.858 1.00 0.00 H ATOM 7491 HE1 TYR B 249 14.323 -7.280 43.741 1.00 0.00 H ATOM 7492 HD1 TYR B 249 16.354 -7.196 45.104 1.00 0.00 H ATOM 7493 HH TYR B 249 14.182 -7.999 40.632 1.00 0.00 H ATOM 7494 H TYR B 249 17.324 -10.856 45.798 1.00 0.00 H ATOM 7495 N LEU B 250 18.029 -7.568 47.550 1.00 26.02 N ATOM 7496 CA LEU B 250 17.093 -6.791 48.291 1.00 24.94 C ATOM 7497 C LEU B 250 17.532 -5.362 48.036 1.00 23.68 C ATOM 7498 O LEU B 250 18.589 -4.942 48.507 1.00 26.06 O ATOM 7499 CB LEU B 250 17.207 -7.133 49.781 1.00 21.78 C ATOM 7500 CG LEU B 250 16.499 -6.181 50.753 1.00 22.91 C ATOM 7501 CD1 LEU B 250 14.993 -6.225 50.487 1.00 16.78 C ATOM 7502 CD2 LEU B 250 16.821 -6.490 52.188 1.00 21.20 C ATOM 7503 HA LEU B 250 16.057 -6.967 48.003 1.00 0.00 H ATOM 7504 HB2 LEU B 250 16.788 -8.129 49.926 1.00 0.00 H ATOM 7505 HB3 LEU B 250 18.266 -7.145 50.039 1.00 0.00 H ATOM 7506 HG LEU B 250 16.864 -5.169 50.579 1.00 0.00 H ATOM 7507 HD21 LEU B 250 16.504 -7.507 52.419 1.00 0.00 H ATOM 7508 HD22 LEU B 250 17.896 -6.398 52.346 1.00 0.00 H ATOM 7509 HD23 LEU B 250 16.296 -5.788 52.836 1.00 0.00 H ATOM 7510 HD11 LEU B 250 14.797 -5.915 49.461 1.00 0.00 H ATOM 7511 HD12 LEU B 250 14.628 -7.241 50.637 1.00 0.00 H ATOM 7512 HD13 LEU B 250 14.484 -5.550 51.175 1.00 0.00 H ATOM 7513 H LEU B 250 19.032 -7.294 47.550 1.00 0.00 H ATOM 7514 N GLU B 251 16.735 -4.592 47.311 1.00 27.16 N ATOM 7515 CA GLU B 251 17.219 -3.298 46.873 1.00 28.63 C ATOM 7516 C GLU B 251 16.212 -2.204 46.965 1.00 30.31 C ATOM 7517 O GLU B 251 15.051 -2.431 46.647 1.00 39.03 O ATOM 7518 CB GLU B 251 17.767 -3.435 45.457 1.00 34.80 C ATOM 7519 CG GLU B 251 19.205 -3.991 45.486 1.00 35.15 C ATOM 7520 CD GLU B 251 19.920 -3.727 44.237 1.00 48.88 C ATOM 7521 OE1 GLU B 251 20.110 -2.520 43.909 1.00 58.18 O ATOM 7522 OE2 GLU B 251 20.272 -4.722 43.563 1.00 54.38 O ATOM 7523 HA GLU B 251 18.010 -2.996 47.560 1.00 0.00 H ATOM 7524 HB2 GLU B 251 17.131 -4.114 44.890 1.00 0.00 H ATOM 7525 HB3 GLU B 251 17.770 -2.456 44.977 1.00 0.00 H ATOM 7526 HG2 GLU B 251 19.747 -3.523 46.308 1.00 0.00 H ATOM 7527 HG3 GLU B 251 19.163 -5.068 45.647 1.00 0.00 H ATOM 7528 H GLU B 251 15.777 -4.911 47.060 1.00 0.00 H ATOM 7529 N LEU B 252 16.639 -1.028 47.445 1.00 32.68 N ATOM 7530 CA LEU B 252 15.782 0.163 47.417 1.00 30.37 C ATOM 7531 C LEU B 252 16.267 1.152 46.394 1.00 30.47 C ATOM 7532 O LEU B 252 17.467 1.379 46.271 1.00 31.65 O ATOM 7533 CB LEU B 252 15.749 0.809 48.776 1.00 37.00 C ATOM 7534 CG LEU B 252 15.244 2.204 49.049 1.00 30.70 C ATOM 7535 CD1 LEU B 252 13.738 2.223 49.169 1.00 25.20 C ATOM 7536 CD2 LEU B 252 15.912 2.549 50.383 1.00 24.39 C ATOM 7537 HA LEU B 252 14.775 -0.151 47.142 1.00 0.00 H ATOM 7538 HB2 LEU B 252 15.143 0.151 49.398 1.00 0.00 H ATOM 7539 HB3 LEU B 252 16.779 0.796 49.132 1.00 0.00 H ATOM 7540 HG LEU B 252 15.477 2.913 48.255 1.00 0.00 H ATOM 7541 HD21 LEU B 252 15.599 1.831 51.141 1.00 0.00 H ATOM 7542 HD22 LEU B 252 16.995 2.508 50.267 1.00 0.00 H ATOM 7543 HD23 LEU B 252 15.616 3.553 50.687 1.00 0.00 H ATOM 7544 HD11 LEU B 252 13.296 1.867 48.238 1.00 0.00 H ATOM 7545 HD12 LEU B 252 13.432 1.574 49.989 1.00 0.00 H ATOM 7546 HD13 LEU B 252 13.403 3.242 49.366 1.00 0.00 H ATOM 7547 H LEU B 252 17.596 -0.958 47.845 1.00 0.00 H ATOM 7548 N ARG B 253 15.308 1.734 45.672 1.00 30.69 N ATOM 7549 CA ARG B 253 15.536 2.535 44.468 1.00 30.97 C ATOM 7550 C ARG B 253 14.559 3.733 44.437 1.00 35.24 C ATOM 7551 O ARG B 253 13.522 3.691 45.128 1.00 29.31 O ATOM 7552 CB ARG B 253 15.275 1.635 43.254 1.00 30.76 C ATOM 7553 CG ARG B 253 16.246 0.464 43.099 1.00 34.71 C ATOM 7554 CD ARG B 253 17.764 0.911 42.843 1.00 39.71 C ATOM 7555 NE ARG B 253 18.634 -0.217 42.458 1.00 39.03 N ATOM 7556 CZ ARG B 253 18.660 -0.807 41.254 1.00 40.43 C ATOM 7557 NH1 ARG B 253 17.872 -0.401 40.252 1.00 33.33 N ATOM 7558 NH2 ARG B 253 19.478 -1.839 41.054 1.00 43.80 N ATOM 7559 HA ARG B 253 16.557 2.918 44.457 1.00 0.00 H ATOM 7560 HB2 ARG B 253 14.267 1.230 43.343 1.00 0.00 H ATOM 7561 HB3 ARG B 253 15.340 2.250 42.356 1.00 0.00 H ATOM 7562 HG2 ARG B 253 16.212 -0.133 44.010 1.00 0.00 H ATOM 7563 HG3 ARG B 253 15.920 -0.144 42.255 1.00 0.00 H ATOM 7564 HD2 ARG B 253 18.155 1.357 43.757 1.00 0.00 H ATOM 7565 HD3 ARG B 253 17.779 1.652 42.044 1.00 0.00 H ATOM 7566 HE ARG B 253 19.283 -0.586 43.182 1.00 0.00 H ATOM 7567 HH12 ARG B 253 17.916 -0.879 39.330 1.00 0.00 H ATOM 7568 HH11 ARG B 253 17.216 0.393 40.395 1.00 0.00 H ATOM 7569 HH22 ARG B 253 19.508 -2.306 40.125 1.00 0.00 H ATOM 7570 HH21 ARG B 253 20.086 -2.178 41.827 1.00 0.00 H ATOM 7571 H ARG B 253 14.325 1.609 45.988 1.00 0.00 H ATOM 7572 N ASP B 254 14.842 4.789 43.658 1.00 29.66 N ATOM 7573 CA ASP B 254 13.753 5.786 43.454 1.00 33.62 C ATOM 7574 C ASP B 254 12.591 5.090 42.730 1.00 35.12 C ATOM 7575 O ASP B 254 12.699 3.897 42.426 1.00 34.56 O ATOM 7576 CB ASP B 254 14.194 7.127 42.806 1.00 29.66 C ATOM 7577 CG ASP B 254 14.586 6.988 41.342 1.00 38.74 C ATOM 7578 OD1 ASP B 254 13.817 6.385 40.553 1.00 38.65 O ATOM 7579 OD2 ASP B 254 15.686 7.488 40.982 1.00 45.47 O ATOM 7580 HA ASP B 254 13.417 6.123 44.434 1.00 0.00 H ATOM 7581 HB2 ASP B 254 13.368 7.834 42.878 1.00 0.00 H ATOM 7582 HB3 ASP B 254 15.050 7.513 43.359 1.00 0.00 H ATOM 7583 H ASP B 254 15.777 4.906 43.218 1.00 0.00 H ATOM 7584 N ILE B 255 11.491 5.786 42.456 1.00 29.98 N ATOM 7585 CA ILE B 255 10.315 5.049 42.002 1.00 28.97 C ATOM 7586 C ILE B 255 10.333 4.711 40.521 1.00 31.34 C ATOM 7587 O ILE B 255 9.495 3.952 40.067 1.00 34.53 O ATOM 7588 CB ILE B 255 9.002 5.786 42.331 1.00 34.08 C ATOM 7589 CG1 ILE B 255 8.840 7.047 41.492 1.00 33.67 C ATOM 7590 CG2 ILE B 255 8.979 6.197 43.748 1.00 26.43 C ATOM 7591 CD1 ILE B 255 7.442 7.557 41.549 1.00 39.88 C ATOM 7592 HA ILE B 255 10.358 4.112 42.557 1.00 0.00 H ATOM 7593 HB ILE B 255 8.192 5.089 42.114 1.00 0.00 H ATOM 7594 HG12 ILE B 255 9.515 7.815 41.870 1.00 0.00 H ATOM 7595 HG13 ILE B 255 9.094 6.820 40.457 1.00 0.00 H ATOM 7596 HD11 ILE B 255 6.763 6.795 41.167 1.00 0.00 H ATOM 7597 HD12 ILE B 255 7.184 7.791 42.582 1.00 0.00 H ATOM 7598 HD13 ILE B 255 7.360 8.457 40.940 1.00 0.00 H ATOM 7599 HG21 ILE B 255 9.058 5.314 44.382 1.00 0.00 H ATOM 7600 HG22 ILE B 255 9.818 6.864 43.945 1.00 0.00 H ATOM 7601 HG23 ILE B 255 8.044 6.715 43.959 1.00 0.00 H ATOM 7602 H ILE B 255 11.469 6.820 42.562 1.00 0.00 H ATOM 7603 N GLY B 256 11.227 5.340 39.760 1.00 25.45 N ATOM 7604 CA GLY B 256 11.473 4.939 38.399 1.00 17.12 C ATOM 7605 C GLY B 256 12.665 3.959 38.335 1.00 31.40 C ATOM 7606 O GLY B 256 13.127 3.564 37.247 1.00 26.84 O ATOM 7607 HA3 GLY B 256 11.700 5.821 37.800 1.00 0.00 H ATOM 7608 HA2 GLY B 256 10.584 4.450 38.002 1.00 0.00 H ATOM 7609 H GLY B 256 11.760 6.139 40.158 1.00 0.00 H ATOM 7610 N LEU B 257 13.159 3.552 39.500 1.00 28.86 N ATOM 7611 CA LEU B 257 14.183 2.496 39.628 1.00 27.64 C ATOM 7612 C LEU B 257 15.629 2.942 39.476 1.00 27.94 C ATOM 7613 O LEU B 257 16.550 2.113 39.382 1.00 25.79 O ATOM 7614 CB LEU B 257 13.849 1.210 38.857 1.00 28.37 C ATOM 7615 CG LEU B 257 12.629 0.426 39.393 1.00 36.16 C ATOM 7616 CD1 LEU B 257 12.409 -0.867 38.655 1.00 25.47 C ATOM 7617 CD2 LEU B 257 12.695 0.129 40.898 1.00 34.44 C ATOM 7618 HA LEU B 257 14.122 2.233 40.684 1.00 0.00 H ATOM 7619 HB2 LEU B 257 13.649 1.479 37.820 1.00 0.00 H ATOM 7620 HB3 LEU B 257 14.718 0.554 38.900 1.00 0.00 H ATOM 7621 HG LEU B 257 11.787 1.096 39.217 1.00 0.00 H ATOM 7622 HD21 LEU B 257 13.582 -0.467 41.111 1.00 0.00 H ATOM 7623 HD22 LEU B 257 12.745 1.067 41.450 1.00 0.00 H ATOM 7624 HD23 LEU B 257 11.804 -0.423 41.197 1.00 0.00 H ATOM 7625 HD11 LEU B 257 12.238 -0.657 37.599 1.00 0.00 H ATOM 7626 HD12 LEU B 257 13.290 -1.500 38.762 1.00 0.00 H ATOM 7627 HD13 LEU B 257 11.541 -1.378 39.071 1.00 0.00 H ATOM 7628 H LEU B 257 12.805 4.002 40.368 1.00 0.00 H ATOM 7629 N GLY B 258 15.841 4.252 39.557 1.00 31.78 N ATOM 7630 CA GLY B 258 17.184 4.780 39.661 1.00 35.73 C ATOM 7631 C GLY B 258 17.744 4.615 41.068 1.00 46.19 C ATOM 7632 O GLY B 258 17.067 4.072 41.958 1.00 42.03 O ATOM 7633 HA3 GLY B 258 17.168 5.840 39.408 1.00 0.00 H ATOM 7634 HA2 GLY B 258 17.828 4.250 38.959 1.00 0.00 H ATOM 7635 H GLY B 258 15.032 4.905 39.545 1.00 0.00 H ATOM 7636 N PRO B 259 18.996 5.067 41.267 1.00 52.80 N ATOM 7637 CA PRO B 259 19.707 5.155 42.536 1.00 53.87 C ATOM 7638 C PRO B 259 18.816 5.360 43.755 1.00 57.73 C ATOM 7639 O PRO B 259 17.833 6.158 43.729 1.00 57.79 O ATOM 7640 CB PRO B 259 20.616 6.389 42.342 1.00 55.99 C ATOM 7641 CG PRO B 259 20.769 6.556 40.822 1.00 55.58 C ATOM 7642 CD PRO B 259 19.859 5.520 40.159 1.00 54.11 C ATOM 7643 HA PRO B 259 20.226 4.220 42.746 1.00 0.00 H ATOM 7644 HD3 PRO B 259 19.268 5.972 39.363 1.00 0.00 H ATOM 7645 HD2 PRO B 259 20.440 4.692 39.753 1.00 0.00 H ATOM 7646 HG3 PRO B 259 21.805 6.385 40.530 1.00 0.00 H ATOM 7647 HG2 PRO B 259 20.470 7.561 40.524 1.00 0.00 H ATOM 7648 HB2 PRO B 259 20.154 7.275 42.778 1.00 0.00 H ATOM 7649 HB3 PRO B 259 21.588 6.223 42.806 1.00 0.00 H ATOM 7650 N MET B 260 19.181 4.605 44.801 1.00 61.19 N ATOM 7651 CA MET B 260 18.605 4.695 46.140 1.00 60.42 C ATOM 7652 C MET B 260 18.406 6.184 46.520 1.00 59.50 C ATOM 7653 O MET B 260 19.361 6.981 46.492 1.00 60.86 O ATOM 7654 CB MET B 260 19.508 3.933 47.122 1.00 59.54 C ATOM 7655 CG MET B 260 18.948 3.736 48.554 1.00 62.76 C ATOM 7656 SD MET B 260 20.000 2.701 49.627 1.00 61.72 S ATOM 7657 CE MET B 260 20.253 1.211 48.613 1.00 53.77 C ATOM 7658 HA MET B 260 17.620 4.230 46.177 1.00 0.00 H ATOM 7659 HB2 MET B 260 19.700 2.946 46.701 1.00 0.00 H ATOM 7660 HB3 MET B 260 20.447 4.480 47.204 1.00 0.00 H ATOM 7661 HG2 MET B 260 17.968 3.265 48.477 1.00 0.00 H ATOM 7662 HG3 MET B 260 18.843 4.716 49.019 1.00 0.00 H ATOM 7663 HE1 MET B 260 19.288 0.752 48.397 1.00 0.00 H ATOM 7664 HE2 MET B 260 20.743 1.487 47.679 1.00 0.00 H ATOM 7665 HE3 MET B 260 20.879 0.504 49.158 1.00 0.00 H ATOM 7666 H MET B 260 19.931 3.902 44.647 1.00 0.00 H ATOM 7667 N PRO B 261 17.162 6.577 46.840 1.00 57.96 N ATOM 7668 CA PRO B 261 16.993 8.020 47.014 1.00 56.94 C ATOM 7669 C PRO B 261 17.383 8.454 48.438 1.00 60.76 C ATOM 7670 O PRO B 261 17.624 7.599 49.317 1.00 58.59 O ATOM 7671 CB PRO B 261 15.502 8.238 46.734 1.00 56.93 C ATOM 7672 CG PRO B 261 14.828 6.830 46.961 1.00 54.32 C ATOM 7673 CD PRO B 261 15.925 5.812 47.117 1.00 53.87 C ATOM 7674 HA PRO B 261 17.630 8.612 46.357 1.00 0.00 H ATOM 7675 HD3 PRO B 261 15.938 5.407 48.129 1.00 0.00 H ATOM 7676 HD2 PRO B 261 15.804 4.998 46.402 1.00 0.00 H ATOM 7677 HG3 PRO B 261 14.205 6.575 46.104 1.00 0.00 H ATOM 7678 HG2 PRO B 261 14.214 6.854 47.861 1.00 0.00 H ATOM 7679 HB2 PRO B 261 15.088 8.976 47.421 1.00 0.00 H ATOM 7680 HB3 PRO B 261 15.351 8.574 45.708 1.00 0.00 H ATOM 7681 N LEU B 262 17.481 9.768 48.661 1.00 64.89 N ATOM 7682 CA LEU B 262 17.845 10.289 49.987 1.00 62.83 C ATOM 7683 C LEU B 262 16.638 10.552 50.907 1.00 61.96 C ATOM 7684 O LEU B 262 16.736 10.348 52.115 1.00 59.60 O ATOM 7685 CB LEU B 262 18.802 11.505 49.899 1.00 65.82 C ATOM 7686 CG LEU B 262 20.327 11.190 49.792 1.00 69.79 C ATOM 7687 CD1 LEU B 262 21.215 12.468 49.797 1.00 64.90 C ATOM 7688 CD2 LEU B 262 20.873 10.101 50.829 1.00 68.83 C ATOM 7689 HA LEU B 262 18.399 9.484 50.471 1.00 0.00 H ATOM 7690 HB2 LEU B 262 18.521 12.084 49.019 1.00 0.00 H ATOM 7691 HB3 LEU B 262 18.651 12.110 50.793 1.00 0.00 H ATOM 7692 HG LEU B 262 20.416 10.724 48.811 1.00 0.00 H ATOM 7693 HD21 LEU B 262 20.699 10.451 51.847 1.00 0.00 H ATOM 7694 HD22 LEU B 262 20.349 9.158 50.673 1.00 0.00 H ATOM 7695 HD23 LEU B 262 21.942 9.955 50.672 1.00 0.00 H ATOM 7696 HD11 LEU B 262 20.947 13.099 48.949 1.00 0.00 H ATOM 7697 HD12 LEU B 262 21.054 13.017 50.725 1.00 0.00 H ATOM 7698 HD13 LEU B 262 22.264 12.181 49.720 1.00 0.00 H ATOM 7699 H LEU B 262 17.297 10.434 47.883 1.00 0.00 H ATOM 7700 N ASN B 263 15.509 10.964 50.339 1.00 51.85 N ATOM 7701 CA ASN B 263 14.328 11.194 51.124 1.00 55.71 C ATOM 7702 C ASN B 263 13.127 11.045 50.216 1.00 57.41 C ATOM 7703 O ASN B 263 13.306 10.830 49.019 1.00 63.12 O ATOM 7704 CB ASN B 263 14.397 12.588 51.741 1.00 62.22 C ATOM 7705 CG ASN B 263 14.948 13.629 50.771 1.00 68.50 C ATOM 7706 OD1 ASN B 263 16.125 14.019 50.855 1.00 70.87 O ATOM 7707 ND2 ASN B 263 14.108 14.070 49.830 1.00 67.92 N ATOM 7708 HA ASN B 263 14.247 10.475 51.939 1.00 0.00 H ATOM 7709 HB2 ASN B 263 13.393 12.887 52.043 1.00 0.00 H ATOM 7710 HB3 ASN B 263 15.043 12.551 52.618 1.00 0.00 H ATOM 7711 HD22 ASN B 263 13.131 13.716 49.798 1.00 0.00 H ATOM 7712 HD21 ASN B 263 14.431 14.768 49.130 1.00 0.00 H ATOM 7713 H ASN B 263 15.480 11.122 49.311 1.00 0.00 H ATOM 7714 N GLY B 264 11.906 11.144 50.752 1.00 56.92 N ATOM 7715 CA GLY B 264 10.686 11.107 49.900 1.00 50.99 C ATOM 7716 C GLY B 264 10.544 9.791 49.141 1.00 47.18 C ATOM 7717 O GLY B 264 11.259 8.819 49.429 1.00 40.66 O ATOM 7718 HA3 GLY B 264 10.738 11.923 49.179 1.00 0.00 H ATOM 7719 HA2 GLY B 264 9.811 11.240 50.536 1.00 0.00 H ATOM 7720 H GLY B 264 11.807 11.249 51.782 1.00 0.00 H ATOM 7721 N SER B 265 9.663 9.763 48.146 1.00 40.41 N ATOM 7722 CA SER B 265 9.241 8.493 47.570 1.00 41.47 C ATOM 7723 C SER B 265 10.367 7.625 47.056 1.00 41.23 C ATOM 7724 O SER B 265 11.450 8.130 46.731 1.00 43.20 O ATOM 7725 CB SER B 265 8.183 8.674 46.500 1.00 36.97 C ATOM 7726 OG SER B 265 7.017 9.187 47.100 1.00 41.25 O ATOM 7727 HA SER B 265 8.806 7.954 48.411 1.00 0.00 H ATOM 7728 HB2 SER B 265 7.964 7.713 46.034 1.00 0.00 H ATOM 7729 HB3 SER B 265 8.543 9.370 45.742 1.00 0.00 H ATOM 7730 HG SER B 265 6.695 8.552 47.788 1.00 0.00 H ATOM 7731 H SER B 265 9.273 10.653 47.776 1.00 0.00 H ATOM 7732 N GLY B 266 10.095 6.317 47.030 1.00 36.87 N ATOM 7733 CA GLY B 266 11.065 5.288 46.674 1.00 34.85 C ATOM 7734 C GLY B 266 10.377 3.937 46.588 1.00 34.44 C ATOM 7735 O GLY B 266 9.172 3.860 46.803 1.00 38.03 O ATOM 7736 HA3 GLY B 266 11.846 5.249 47.434 1.00 0.00 H ATOM 7737 HA2 GLY B 266 11.510 5.529 45.709 1.00 0.00 H ATOM 7738 H GLY B 266 9.132 6.014 47.279 1.00 0.00 H ATOM 7739 N ARG B 267 11.136 2.881 46.269 1.00 28.97 N ATOM 7740 CA ARG B 267 10.598 1.539 46.080 1.00 25.03 C ATOM 7741 C ARG B 267 11.586 0.470 46.540 1.00 31.37 C ATOM 7742 O ARG B 267 12.808 0.549 46.301 1.00 32.91 O ATOM 7743 CB ARG B 267 10.249 1.303 44.608 1.00 23.37 C ATOM 7744 CG ARG B 267 9.232 0.175 44.374 1.00 23.64 C ATOM 7745 CD ARG B 267 7.785 0.651 44.594 1.00 21.90 C ATOM 7746 NE ARG B 267 6.796 -0.413 44.466 1.00 20.26 N ATOM 7747 CZ ARG B 267 5.480 -0.229 44.573 1.00 27.64 C ATOM 7748 NH1 ARG B 267 4.983 1.001 44.817 1.00 23.13 N ATOM 7749 NH2 ARG B 267 4.666 -1.279 44.459 1.00 13.76 N ATOM 7750 HA ARG B 267 9.696 1.463 46.687 1.00 0.00 H ATOM 7751 HB2 ARG B 267 9.835 2.226 44.202 1.00 0.00 H ATOM 7752 HB3 ARG B 267 11.166 1.053 44.075 1.00 0.00 H ATOM 7753 HG2 ARG B 267 9.333 -0.184 43.350 1.00 0.00 H ATOM 7754 HG3 ARG B 267 9.444 -0.640 45.066 1.00 0.00 H ATOM 7755 HD2 ARG B 267 7.560 1.422 43.857 1.00 0.00 H ATOM 7756 HD3 ARG B 267 7.709 1.074 45.596 1.00 0.00 H ATOM 7757 HE ARG B 267 7.139 -1.377 44.279 1.00 0.00 H ATOM 7758 HH12 ARG B 267 3.956 1.140 44.900 1.00 0.00 H ATOM 7759 HH11 ARG B 267 5.627 1.811 44.922 1.00 0.00 H ATOM 7760 HH22 ARG B 267 3.637 -1.151 44.540 1.00 0.00 H ATOM 7761 HH21 ARG B 267 5.060 -2.226 44.289 1.00 0.00 H ATOM 7762 H ARG B 267 12.159 3.025 46.150 1.00 0.00 H ATOM 7763 N LEU B 268 11.059 -0.552 47.208 1.00 31.54 N ATOM 7764 CA LEU B 268 11.910 -1.602 47.734 1.00 23.34 C ATOM 7765 C LEU B 268 11.536 -2.928 47.103 1.00 30.36 C ATOM 7766 O LEU B 268 10.327 -3.301 47.116 1.00 29.35 O ATOM 7767 CB LEU B 268 11.718 -1.670 49.235 1.00 23.59 C ATOM 7768 CG LEU B 268 12.510 -2.725 50.024 1.00 24.45 C ATOM 7769 CD1 LEU B 268 13.991 -2.408 49.917 1.00 21.61 C ATOM 7770 CD2 LEU B 268 12.045 -2.684 51.496 1.00 19.23 C ATOM 7771 HA LEU B 268 12.954 -1.389 47.504 1.00 0.00 H ATOM 7772 HB2 LEU B 268 11.988 -0.694 49.640 1.00 0.00 H ATOM 7773 HB3 LEU B 268 10.660 -1.858 49.417 1.00 0.00 H ATOM 7774 HG LEU B 268 12.338 -3.724 49.624 1.00 0.00 H ATOM 7775 HD21 LEU B 268 12.232 -1.692 51.907 1.00 0.00 H ATOM 7776 HD22 LEU B 268 10.979 -2.904 51.545 1.00 0.00 H ATOM 7777 HD23 LEU B 268 12.597 -3.427 52.071 1.00 0.00 H ATOM 7778 HD11 LEU B 268 14.291 -2.428 48.869 1.00 0.00 H ATOM 7779 HD12 LEU B 268 14.180 -1.418 50.331 1.00 0.00 H ATOM 7780 HD13 LEU B 268 14.562 -3.151 50.474 1.00 0.00 H ATOM 7781 H LEU B 268 10.030 -0.599 47.354 1.00 0.00 H ATOM 7782 N LEU B 269 12.542 -3.638 46.561 1.00 22.17 N ATOM 7783 CA LEU B 269 12.251 -4.834 45.767 1.00 28.15 C ATOM 7784 C LEU B 269 13.013 -5.934 46.368 1.00 27.53 C ATOM 7785 O LEU B 269 14.134 -5.657 46.826 1.00 24.70 O ATOM 7786 CB LEU B 269 12.701 -4.702 44.296 1.00 27.41 C ATOM 7787 CG LEU B 269 12.033 -3.510 43.631 1.00 33.66 C ATOM 7788 CD1 LEU B 269 13.044 -2.364 43.575 1.00 35.12 C ATOM 7789 CD2 LEU B 269 11.439 -3.896 42.242 1.00 31.17 C ATOM 7790 HA LEU B 269 11.173 -4.996 45.768 1.00 0.00 H ATOM 7791 HB2 LEU B 269 13.782 -4.570 44.264 1.00 0.00 H ATOM 7792 HB3 LEU B 269 12.431 -5.610 43.757 1.00 0.00 H ATOM 7793 HG LEU B 269 11.176 -3.174 44.214 1.00 0.00 H ATOM 7794 HD21 LEU B 269 12.239 -4.253 41.593 1.00 0.00 H ATOM 7795 HD22 LEU B 269 10.696 -4.683 42.372 1.00 0.00 H ATOM 7796 HD23 LEU B 269 10.969 -3.021 41.794 1.00 0.00 H ATOM 7797 HD11 LEU B 269 13.353 -2.104 44.587 1.00 0.00 H ATOM 7798 HD12 LEU B 269 13.914 -2.677 42.997 1.00 0.00 H ATOM 7799 HD13 LEU B 269 12.583 -1.498 43.100 1.00 0.00 H ATOM 7800 H LEU B 269 13.527 -3.337 46.706 1.00 0.00 H ATOM 7801 N VAL B 270 12.431 -7.153 46.369 1.00 15.61 N ATOM 7802 CA VAL B 270 13.156 -8.317 46.847 1.00 20.24 C ATOM 7803 C VAL B 270 12.941 -9.537 45.945 1.00 27.84 C ATOM 7804 O VAL B 270 11.868 -9.652 45.324 1.00 27.77 O ATOM 7805 CB VAL B 270 12.734 -8.695 48.302 1.00 17.86 C ATOM 7806 CG1 VAL B 270 11.267 -9.139 48.369 1.00 16.38 C ATOM 7807 CG2 VAL B 270 13.604 -9.803 48.788 1.00 8.07 C ATOM 7808 HA VAL B 270 14.211 -8.043 46.831 1.00 0.00 H ATOM 7809 HB VAL B 270 12.848 -7.811 48.930 1.00 0.00 H ATOM 7810 HG11 VAL B 270 10.627 -8.327 48.025 1.00 0.00 H ATOM 7811 HG12 VAL B 270 11.123 -10.011 47.731 1.00 0.00 H ATOM 7812 HG13 VAL B 270 11.012 -9.393 49.398 1.00 0.00 H ATOM 7813 HG21 VAL B 270 13.488 -10.668 48.135 1.00 0.00 H ATOM 7814 HG22 VAL B 270 14.644 -9.477 48.780 1.00 0.00 H ATOM 7815 HG23 VAL B 270 13.314 -10.072 49.804 1.00 0.00 H ATOM 7816 H VAL B 270 11.455 -7.259 46.025 1.00 0.00 H ATOM 7817 N ALA B 271 13.918 -10.467 45.922 1.00 26.82 N ATOM 7818 CA ALA B 271 13.722 -11.760 45.243 1.00 20.81 C ATOM 7819 C ALA B 271 14.469 -12.885 45.906 1.00 26.14 C ATOM 7820 O ALA B 271 15.598 -12.704 46.408 1.00 19.79 O ATOM 7821 CB ALA B 271 14.108 -11.682 43.790 1.00 35.93 C ATOM 7822 HA ALA B 271 12.657 -11.978 45.320 1.00 0.00 H ATOM 7823 HB1 ALA B 271 13.493 -10.932 43.292 1.00 0.00 H ATOM 7824 HB2 ALA B 271 15.159 -11.404 43.709 1.00 0.00 H ATOM 7825 HB3 ALA B 271 13.951 -12.653 43.321 1.00 0.00 H ATOM 7826 H ALA B 271 14.825 -10.268 46.391 1.00 0.00 H ATOM 7827 N ALA B 272 13.842 -14.063 45.904 1.00 21.43 N ATOM 7828 CA ALA B 272 14.331 -15.122 46.770 1.00 24.80 C ATOM 7829 C ALA B 272 13.903 -16.489 46.271 1.00 28.67 C ATOM 7830 O ALA B 272 12.739 -16.676 45.775 1.00 26.98 O ATOM 7831 CB ALA B 272 13.815 -14.891 48.235 1.00 21.92 C ATOM 7832 HA ALA B 272 15.421 -15.093 46.761 1.00 0.00 H ATOM 7833 HB1 ALA B 272 14.178 -13.930 48.599 1.00 0.00 H ATOM 7834 HB2 ALA B 272 12.725 -14.895 48.240 1.00 0.00 H ATOM 7835 HB3 ALA B 272 14.185 -15.689 48.879 1.00 0.00 H ATOM 7836 H ALA B 272 13.016 -14.221 45.292 1.00 0.00 H ATOM 7837 N ARG B 273 14.817 -17.452 46.417 1.00 29.53 N ATOM 7838 CA ARG B 273 14.514 -18.855 46.059 1.00 29.08 C ATOM 7839 C ARG B 273 14.134 -19.708 47.248 1.00 29.57 C ATOM 7840 O ARG B 273 14.865 -19.785 48.225 1.00 34.02 O ATOM 7841 CB ARG B 273 15.635 -19.475 45.240 1.00 30.76 C ATOM 7842 CG ARG B 273 15.813 -18.798 43.860 1.00 37.06 C ATOM 7843 CD ARG B 273 17.198 -19.020 43.258 1.00 41.14 C ATOM 7844 NE ARG B 273 18.242 -18.634 44.211 1.00 46.02 N ATOM 7845 CZ ARG B 273 19.035 -19.495 44.860 1.00 48.45 C ATOM 7846 NH1 ARG B 273 18.897 -20.802 44.629 1.00 46.05 N ATOM 7847 NH2 ARG B 273 19.962 -19.056 45.735 1.00 42.29 N ATOM 7848 HA ARG B 273 13.625 -18.825 45.429 1.00 0.00 H ATOM 7849 HB2 ARG B 273 16.567 -19.381 45.797 1.00 0.00 H ATOM 7850 HB3 ARG B 273 15.411 -20.530 45.084 1.00 0.00 H ATOM 7851 HG2 ARG B 273 15.068 -19.204 43.176 1.00 0.00 H ATOM 7852 HG3 ARG B 273 15.653 -17.726 43.976 1.00 0.00 H ATOM 7853 HD2 ARG B 273 17.297 -18.418 42.354 1.00 0.00 H ATOM 7854 HD3 ARG B 273 17.315 -20.074 43.006 1.00 0.00 H ATOM 7855 HE ARG B 273 18.376 -17.619 44.396 1.00 0.00 H ATOM 7856 HH12 ARG B 273 19.505 -21.485 45.125 1.00 0.00 H ATOM 7857 HH11 ARG B 273 18.181 -21.138 43.953 1.00 0.00 H ATOM 7858 HH22 ARG B 273 20.571 -19.737 46.232 1.00 0.00 H ATOM 7859 HH21 ARG B 273 20.068 -18.037 45.913 1.00 0.00 H ATOM 7860 H ARG B 273 15.758 -17.211 46.789 1.00 0.00 H ATOM 7861 N LEU B 274 12.932 -20.272 47.200 1.00 31.92 N ATOM 7862 CA LEU B 274 12.547 -21.328 48.128 1.00 35.61 C ATOM 7863 C LEU B 274 12.475 -22.653 47.399 1.00 40.94 C ATOM 7864 O LEU B 274 11.542 -22.891 46.604 1.00 47.50 O ATOM 7865 CB LEU B 274 11.218 -21.046 48.776 1.00 25.20 C ATOM 7866 CG LEU B 274 11.188 -19.953 49.834 1.00 32.08 C ATOM 7867 CD1 LEU B 274 10.983 -18.523 49.239 1.00 19.31 C ATOM 7868 CD2 LEU B 274 10.043 -20.364 50.832 1.00 34.48 C ATOM 7869 HA LEU B 274 13.305 -21.370 48.910 1.00 0.00 H ATOM 7870 HB2 LEU B 274 10.521 -20.762 47.988 1.00 0.00 H ATOM 7871 HB3 LEU B 274 10.877 -21.969 49.245 1.00 0.00 H ATOM 7872 HG LEU B 274 12.150 -19.879 50.341 1.00 0.00 H ATOM 7873 HD21 LEU B 274 9.097 -20.423 50.293 1.00 0.00 H ATOM 7874 HD22 LEU B 274 10.275 -21.335 51.269 1.00 0.00 H ATOM 7875 HD23 LEU B 274 9.966 -19.617 51.622 1.00 0.00 H ATOM 7876 HD11 LEU B 274 11.800 -18.295 48.554 1.00 0.00 H ATOM 7877 HD12 LEU B 274 10.035 -18.487 48.702 1.00 0.00 H ATOM 7878 HD13 LEU B 274 10.971 -17.793 50.048 1.00 0.00 H ATOM 7879 H LEU B 274 12.250 -19.952 46.483 1.00 0.00 H ATOM 7880 N GLY B 275 13.450 -23.516 47.680 1.00 43.68 N ATOM 7881 CA GLY B 275 13.604 -24.777 46.965 1.00 48.12 C ATOM 7882 C GLY B 275 13.891 -24.393 45.536 1.00 51.26 C ATOM 7883 O GLY B 275 14.893 -23.716 45.249 1.00 51.45 O ATOM 7884 HA3 GLY B 275 12.688 -25.365 47.026 1.00 0.00 H ATOM 7885 HA2 GLY B 275 14.432 -25.352 47.379 1.00 0.00 H ATOM 7886 H GLY B 275 14.125 -23.282 48.436 1.00 0.00 H ATOM 7887 N THR B 276 12.999 -24.776 44.632 1.00 49.39 N ATOM 7888 CA THR B 276 13.200 -24.362 43.245 1.00 50.09 C ATOM 7889 C THR B 276 12.256 -23.238 42.816 1.00 45.39 C ATOM 7890 O THR B 276 12.178 -22.911 41.625 1.00 45.73 O ATOM 7891 CB THR B 276 13.160 -25.573 42.244 1.00 52.79 C ATOM 7892 OG1 THR B 276 12.100 -26.461 42.613 1.00 50.23 O ATOM 7893 CG2 THR B 276 14.578 -26.320 42.202 1.00 52.05 C ATOM 7894 HA THR B 276 14.208 -23.950 43.204 1.00 0.00 H ATOM 7895 HB THR B 276 12.964 -25.207 41.236 1.00 0.00 H ATOM 7896 HG1 THR B 276 12.075 -27.224 41.982 1.00 0.00 H ATOM 7897 HG23 THR B 276 15.354 -25.609 41.918 1.00 0.00 H ATOM 7898 HG21 THR B 276 14.801 -26.728 43.188 1.00 0.00 H ATOM 7899 HG22 THR B 276 14.540 -27.129 41.472 1.00 0.00 H ATOM 7900 H THR B 276 12.179 -25.355 44.903 1.00 0.00 H ATOM 7901 N THR B 277 11.545 -22.658 43.774 1.00 24.46 N ATOM 7902 CA THR B 277 10.660 -21.644 43.431 1.00 26.60 C ATOM 7903 C THR B 277 11.298 -20.252 43.686 1.00 34.63 C ATOM 7904 O THR B 277 11.893 -19.979 44.725 1.00 38.54 O ATOM 7905 CB THR B 277 9.312 -21.795 44.118 1.00 29.98 C ATOM 7906 OG1 THR B 277 8.799 -23.109 43.924 1.00 31.42 O ATOM 7907 CG2 THR B 277 8.286 -20.785 43.535 1.00 34.16 C ATOM 7908 HA THR B 277 10.460 -21.727 42.363 1.00 0.00 H ATOM 7909 HB THR B 277 9.460 -21.604 45.181 1.00 0.00 H ATOM 7910 HG1 THR B 277 7.922 -23.190 44.377 1.00 0.00 H ATOM 7911 HG23 THR B 277 8.659 -19.770 43.673 1.00 0.00 H ATOM 7912 HG21 THR B 277 8.148 -20.982 42.472 1.00 0.00 H ATOM 7913 HG22 THR B 277 7.333 -20.897 44.053 1.00 0.00 H ATOM 7914 H THR B 277 11.648 -22.957 44.765 1.00 0.00 H ATOM 7915 N ARG B 278 11.183 -19.389 42.693 1.00 32.73 N ATOM 7916 CA ARG B 278 11.645 -18.038 42.786 1.00 37.86 C ATOM 7917 C ARG B 278 10.443 -17.115 42.954 1.00 33.69 C ATOM 7918 O ARG B 278 9.575 -17.069 42.079 1.00 39.08 O ATOM 7919 CB ARG B 278 12.432 -17.662 41.538 1.00 30.70 C ATOM 7920 CG ARG B 278 13.235 -16.429 41.778 1.00 29.61 C ATOM 7921 CD ARG B 278 14.319 -16.336 40.770 1.00 29.62 C ATOM 7922 NE ARG B 278 15.103 -15.133 41.041 1.00 38.49 N ATOM 7923 CZ ARG B 278 14.844 -13.944 40.500 1.00 35.23 C ATOM 7924 NH1 ARG B 278 13.831 -13.851 39.657 1.00 31.16 N ATOM 7925 NH2 ARG B 278 15.595 -12.869 40.795 1.00 31.85 N ATOM 7926 HA ARG B 278 12.306 -17.936 43.647 1.00 0.00 H ATOM 7927 HB2 ARG B 278 13.102 -18.481 41.276 1.00 0.00 H ATOM 7928 HB3 ARG B 278 11.738 -17.484 40.716 1.00 0.00 H ATOM 7929 HG2 ARG B 278 12.589 -15.554 41.698 1.00 0.00 H ATOM 7930 HG3 ARG B 278 13.670 -16.468 42.777 1.00 0.00 H ATOM 7931 HD2 ARG B 278 13.888 -16.277 39.771 1.00 0.00 H ATOM 7932 HD3 ARG B 278 14.960 -17.215 40.837 1.00 0.00 H ATOM 7933 HE ARG B 278 15.909 -15.210 41.694 1.00 0.00 H ATOM 7934 HH12 ARG B 278 13.603 -12.937 39.217 1.00 0.00 H ATOM 7935 HH11 ARG B 278 13.262 -14.692 39.433 1.00 0.00 H ATOM 7936 HH22 ARG B 278 15.378 -11.948 40.363 1.00 0.00 H ATOM 7937 HH21 ARG B 278 16.393 -12.958 41.455 1.00 0.00 H ATOM 7938 H ARG B 278 10.738 -19.704 41.807 1.00 0.00 H ATOM 7939 N LEU B 279 10.427 -16.398 44.079 1.00 33.54 N ATOM 7940 CA LEU B 279 9.375 -15.438 44.458 1.00 29.65 C ATOM 7941 C LEU B 279 9.876 -13.992 44.407 1.00 23.43 C ATOM 7942 O LEU B 279 11.064 -13.732 44.605 1.00 24.18 O ATOM 7943 CB LEU B 279 8.850 -15.750 45.865 1.00 29.48 C ATOM 7944 CG LEU B 279 8.147 -17.097 46.066 1.00 31.88 C ATOM 7945 CD1 LEU B 279 7.676 -17.296 47.513 1.00 32.55 C ATOM 7946 CD2 LEU B 279 6.968 -17.174 45.127 1.00 39.62 C ATOM 7947 HA LEU B 279 8.567 -15.542 43.733 1.00 0.00 H ATOM 7948 HB2 LEU B 279 9.700 -15.718 46.547 1.00 0.00 H ATOM 7949 HB3 LEU B 279 8.141 -14.966 46.132 1.00 0.00 H ATOM 7950 HG LEU B 279 8.862 -17.891 45.851 1.00 0.00 H ATOM 7951 HD21 LEU B 279 6.277 -16.360 45.346 1.00 0.00 H ATOM 7952 HD22 LEU B 279 7.318 -17.089 44.098 1.00 0.00 H ATOM 7953 HD23 LEU B 279 6.460 -18.129 45.261 1.00 0.00 H ATOM 7954 HD11 LEU B 279 8.536 -17.259 48.182 1.00 0.00 H ATOM 7955 HD12 LEU B 279 6.974 -16.505 47.777 1.00 0.00 H ATOM 7956 HD13 LEU B 279 7.184 -18.265 47.604 1.00 0.00 H ATOM 7957 H LEU B 279 11.219 -16.527 44.740 1.00 0.00 H ATOM 7958 N LEU B 280 8.963 -13.050 44.167 1.00 26.26 N ATOM 7959 CA LEU B 280 9.329 -11.628 44.010 1.00 24.98 C ATOM 7960 C LEU B 280 8.300 -10.868 44.760 1.00 27.36 C ATOM 7961 O LEU B 280 7.185 -11.357 44.898 1.00 28.71 O ATOM 7962 CB LEU B 280 9.149 -11.128 42.557 1.00 26.02 C ATOM 7963 CG LEU B 280 9.795 -11.761 41.331 1.00 33.25 C ATOM 7964 CD1 LEU B 280 9.433 -10.939 40.052 1.00 38.77 C ATOM 7965 CD2 LEU B 280 11.301 -11.931 41.532 1.00 31.55 C ATOM 7966 HA LEU B 280 10.364 -11.504 44.330 1.00 0.00 H ATOM 7967 HB2 LEU B 280 8.076 -11.159 42.369 1.00 0.00 H ATOM 7968 HB3 LEU B 280 9.486 -10.092 42.562 1.00 0.00 H ATOM 7969 HG LEU B 280 9.396 -12.765 41.188 1.00 0.00 H ATOM 7970 HD21 LEU B 280 11.756 -10.955 41.703 1.00 0.00 H ATOM 7971 HD22 LEU B 280 11.481 -12.574 42.394 1.00 0.00 H ATOM 7972 HD23 LEU B 280 11.736 -12.385 40.642 1.00 0.00 H ATOM 7973 HD11 LEU B 280 8.351 -10.928 39.923 1.00 0.00 H ATOM 7974 HD12 LEU B 280 9.797 -9.918 40.163 1.00 0.00 H ATOM 7975 HD13 LEU B 280 9.900 -11.400 39.181 1.00 0.00 H ATOM 7976 H LEU B 280 7.963 -13.325 44.088 1.00 0.00 H ATOM 7977 N ASP B 281 8.627 -9.628 45.122 1.00 21.01 N ATOM 7978 CA ASP B 281 7.676 -8.785 45.767 1.00 24.01 C ATOM 7979 C ASP B 281 8.410 -7.450 45.887 1.00 22.22 C ATOM 7980 O ASP B 281 9.641 -7.437 45.855 1.00 17.80 O ATOM 7981 CB ASP B 281 7.324 -9.361 47.155 1.00 19.40 C ATOM 7982 CG ASP B 281 6.060 -8.741 47.756 1.00 31.09 C ATOM 7983 OD1 ASP B 281 5.534 -7.668 47.251 1.00 17.88 O ATOM 7984 OD2 ASP B 281 5.606 -9.338 48.769 1.00 29.89 O ATOM 7985 HA ASP B 281 6.733 -8.692 45.228 1.00 0.00 H ATOM 7986 HB2 ASP B 281 7.171 -10.436 47.057 1.00 0.00 H ATOM 7987 HB3 ASP B 281 8.158 -9.174 47.831 1.00 0.00 H ATOM 7988 H ASP B 281 9.585 -9.272 44.932 1.00 0.00 H ATOM 7989 N ASN B 282 7.636 -6.360 46.028 1.00 16.17 N ATOM 7990 CA ASN B 282 8.142 -4.987 46.158 1.00 25.22 C ATOM 7991 C ASN B 282 7.070 -4.108 46.853 1.00 27.10 C ATOM 7992 O ASN B 282 5.872 -4.456 46.865 1.00 18.34 O ATOM 7993 CB ASN B 282 8.399 -4.401 44.759 1.00 20.64 C ATOM 7994 CG ASN B 282 7.132 -4.369 43.932 1.00 23.15 C ATOM 7995 OD1 ASN B 282 6.353 -3.419 44.031 1.00 26.30 O ATOM 7996 ND2 ASN B 282 6.880 -5.434 43.168 1.00 20.46 N ATOM 7997 HA ASN B 282 9.063 -5.001 46.741 1.00 0.00 H ATOM 7998 HB2 ASN B 282 8.780 -3.385 44.864 1.00 0.00 H ATOM 7999 HB3 ASN B 282 9.141 -5.015 44.248 1.00 0.00 H ATOM 8000 HD22 ASN B 282 7.569 -6.212 43.116 1.00 0.00 H ATOM 8001 HD21 ASN B 282 5.995 -5.486 42.624 1.00 0.00 H ATOM 8002 H ASN B 282 6.605 -6.499 46.046 1.00 0.00 H ATOM 8003 N ILE B 283 7.469 -2.956 47.395 1.00 22.56 N ATOM 8004 CA ILE B 283 6.486 -2.119 48.059 1.00 22.27 C ATOM 8005 C ILE B 283 6.965 -0.686 47.943 1.00 20.36 C ATOM 8006 O ILE B 283 8.189 -0.459 47.839 1.00 19.72 O ATOM 8007 CB ILE B 283 6.328 -2.566 49.562 1.00 17.47 C ATOM 8008 CG1 ILE B 283 5.047 -2.044 50.196 1.00 23.12 C ATOM 8009 CG2 ILE B 283 7.539 -2.150 50.440 1.00 19.69 C ATOM 8010 CD1 ILE B 283 4.898 -2.528 51.633 1.00 22.40 C ATOM 8011 HA ILE B 283 5.503 -2.213 47.597 1.00 0.00 H ATOM 8012 HB ILE B 283 6.281 -3.654 49.527 1.00 0.00 H ATOM 8013 HG12 ILE B 283 5.067 -0.954 50.189 1.00 0.00 H ATOM 8014 HG13 ILE B 283 4.195 -2.394 49.614 1.00 0.00 H ATOM 8015 HD11 ILE B 283 4.872 -3.618 51.647 1.00 0.00 H ATOM 8016 HD12 ILE B 283 5.744 -2.176 52.223 1.00 0.00 H ATOM 8017 HD13 ILE B 283 3.972 -2.135 52.053 1.00 0.00 H ATOM 8018 HG21 ILE B 283 8.446 -2.610 50.047 1.00 0.00 H ATOM 8019 HG22 ILE B 283 7.643 -1.065 50.422 1.00 0.00 H ATOM 8020 HG23 ILE B 283 7.375 -2.484 51.465 1.00 0.00 H ATOM 8021 H ILE B 283 8.466 -2.663 47.343 1.00 0.00 H ATOM 8022 N ALA B 284 6.024 0.259 47.923 1.00 17.64 N ATOM 8023 CA ALA B 284 6.320 1.729 48.055 1.00 25.92 C ATOM 8024 C ALA B 284 7.018 2.035 49.351 1.00 22.62 C ATOM 8025 O ALA B 284 6.694 1.484 50.359 1.00 30.11 O ATOM 8026 CB ALA B 284 5.043 2.572 47.990 1.00 17.27 C ATOM 8027 HA ALA B 284 6.968 1.984 47.217 1.00 0.00 H ATOM 8028 HB1 ALA B 284 4.548 2.406 47.033 1.00 0.00 H ATOM 8029 HB2 ALA B 284 4.376 2.282 48.801 1.00 0.00 H ATOM 8030 HB3 ALA B 284 5.300 3.627 48.089 1.00 0.00 H ATOM 8031 H ALA B 284 5.033 -0.035 47.810 1.00 0.00 H ATOM 8032 N ILE B 285 7.926 2.980 49.324 1.00 28.62 N ATOM 8033 CA ILE B 285 8.593 3.439 50.509 1.00 29.87 C ATOM 8034 C ILE B 285 8.568 5.026 50.513 1.00 34.92 C ATOM 8035 O ILE B 285 8.821 5.680 49.469 1.00 29.11 O ATOM 8036 CB ILE B 285 10.071 2.918 50.507 1.00 30.80 C ATOM 8037 CG1 ILE B 285 10.130 1.452 50.213 1.00 31.37 C ATOM 8038 CG2 ILE B 285 10.677 3.015 51.893 1.00 33.29 C ATOM 8039 CD1 ILE B 285 9.823 0.572 51.529 1.00 27.36 C ATOM 8040 HA ILE B 285 8.092 3.063 51.401 1.00 0.00 H ATOM 8041 HB ILE B 285 10.592 3.521 49.763 1.00 0.00 H ATOM 8042 HG12 ILE B 285 9.392 1.214 49.447 1.00 0.00 H ATOM 8043 HG13 ILE B 285 11.126 1.204 49.845 1.00 0.00 H ATOM 8044 HD11 ILE B 285 10.562 0.800 52.298 1.00 0.00 H ATOM 8045 HD12 ILE B 285 8.826 0.810 51.899 1.00 0.00 H ATOM 8046 HD13 ILE B 285 9.875 -0.487 51.277 1.00 0.00 H ATOM 8047 HG21 ILE B 285 10.671 4.055 52.219 1.00 0.00 H ATOM 8048 HG22 ILE B 285 10.092 2.412 52.587 1.00 0.00 H ATOM 8049 HG23 ILE B 285 11.703 2.648 51.866 1.00 0.00 H ATOM 8050 H ILE B 285 8.172 3.413 48.411 1.00 0.00 H ATOM 8051 N GLU B 286 8.241 5.613 51.672 1.00 36.91 N ATOM 8052 CA GLU B 286 8.474 7.057 51.976 1.00 36.01 C ATOM 8053 C GLU B 286 9.619 7.209 52.979 1.00 39.44 C ATOM 8054 O GLU B 286 9.475 6.818 54.152 1.00 36.42 O ATOM 8055 CB GLU B 286 7.206 7.734 52.509 1.00 30.02 C ATOM 8056 CG GLU B 286 6.062 7.700 51.539 1.00 37.44 C ATOM 8057 CD GLU B 286 6.502 8.043 50.066 1.00 49.25 C ATOM 8058 OE1 GLU B 286 7.243 9.075 49.859 1.00 42.09 O ATOM 8059 OE2 GLU B 286 6.103 7.247 49.141 1.00 47.19 O ATOM 8060 HA GLU B 286 8.747 7.553 51.044 1.00 0.00 H ATOM 8061 HB2 GLU B 286 6.900 7.225 53.423 1.00 0.00 H ATOM 8062 HB3 GLU B 286 7.438 8.775 52.734 1.00 0.00 H ATOM 8063 HG2 GLU B 286 5.626 6.701 51.549 1.00 0.00 H ATOM 8064 HG3 GLU B 286 5.313 8.425 51.857 1.00 0.00 H ATOM 8065 H GLU B 286 7.797 5.026 52.407 1.00 0.00 H ATOM 8066 N ILE B 287 10.757 7.742 52.509 1.00 43.13 N ATOM 8067 CA ILE B 287 12.008 7.796 53.309 1.00 43.89 C ATOM 8068 C ILE B 287 12.035 9.073 54.221 1.00 49.18 C ATOM 8069 O ILE B 287 12.222 10.223 53.731 1.00 53.77 O ATOM 8070 CB ILE B 287 13.280 7.752 52.411 1.00 43.99 C ATOM 8071 CG1 ILE B 287 12.975 7.244 50.985 1.00 50.87 C ATOM 8072 CG2 ILE B 287 14.403 6.992 53.058 1.00 43.87 C ATOM 8073 CD1 ILE B 287 13.197 5.746 50.723 1.00 49.17 C ATOM 8074 HA ILE B 287 12.018 6.908 53.942 1.00 0.00 H ATOM 8075 HB ILE B 287 13.621 8.782 52.304 1.00 0.00 H ATOM 8076 HG12 ILE B 287 11.929 7.465 50.772 1.00 0.00 H ATOM 8077 HG13 ILE B 287 13.610 7.798 50.294 1.00 0.00 H ATOM 8078 HD11 ILE B 287 14.242 5.497 50.909 1.00 0.00 H ATOM 8079 HD12 ILE B 287 12.559 5.164 51.388 1.00 0.00 H ATOM 8080 HD13 ILE B 287 12.947 5.519 49.687 1.00 0.00 H ATOM 8081 HG21 ILE B 287 14.669 7.471 54.000 1.00 0.00 H ATOM 8082 HG22 ILE B 287 14.085 5.967 53.247 1.00 0.00 H ATOM 8083 HG23 ILE B 287 15.268 6.989 52.394 1.00 0.00 H ATOM 8084 H ILE B 287 10.764 8.133 51.545 1.00 0.00 H ATOM 8085 N GLY B 288 11.790 8.849 55.520 1.00 46.16 N ATOM 8086 CA GLY B 288 11.915 9.830 56.573 1.00 40.83 C ATOM 8087 C GLY B 288 10.702 10.719 56.619 1.00 52.20 C ATOM 8088 O GLY B 288 9.609 10.316 56.172 1.00 52.96 O ATOM 8089 HA3 GLY B 288 12.799 10.440 56.391 1.00 0.00 H ATOM 8090 HA2 GLY B 288 12.020 9.317 57.529 1.00 0.00 H ATOM 8091 H GLY B 288 11.486 7.892 55.791 1.00 0.00 H TER 8092 GLY B 288 HETATM 8093 O HOH 1 17.864 28.151 7.533 1.00 35.36 O HETATM 8094 O HOH 2 0.233 23.555 -5.058 1.00 46.03 O HETATM 8095 O HOH 3 15.767 11.311 -20.369 1.00 38.93 O HETATM 8096 O HOH 4 -0.343 26.770 13.294 1.00 32.27 O HETATM 8097 O HOH 5 27.685 9.652 3.816 1.00 48.30 O HETATM 8098 O HOH 6 24.168 7.350 -12.260 1.00 28.00 O HETATM 8099 O HOH 7 14.131 -2.398 -14.430 1.00 44.37 O HETATM 8100 O HOH 8 12.690 3.367 -8.309 1.00 28.47 O HETATM 8101 O HOH 9 17.374 -10.425 -25.312 1.00 27.33 O HETATM 8102 O HOH 10 22.636 7.182 -10.223 1.00 16.90 O HETATM 8103 O HOH 11 22.715 -0.608 10.205 1.00 30.17 O HETATM 8104 O HOH 12 24.461 -15.274 -17.409 1.00 26.95 O HETATM 8105 O HOH 13 10.675 9.416 3.490 1.00 37.84 O HETATM 8106 O HOH 14 16.052 -8.324 8.593 1.00 28.93 O HETATM 8107 O HOH 15 19.003 2.050 1.817 1.00 19.81 O HETATM 8108 O HOH 16 11.952 13.721 9.759 1.00 32.13 O HETATM 8109 O HOH 17 21.946 10.534 5.623 1.00 46.41 O HETATM 8110 O HOH 18 4.528 -3.042 3.438 1.00 33.94 O HETATM 8111 O HOH 19 10.126 12.000 22.021 1.00 30.91 O HETATM 8112 O HOH 20 -2.309 11.675 16.372 1.00 41.54 O HETATM 8113 O HOH 21 4.738 -4.184 5.825 1.00 27.66 O HETATM 8114 O HOH 22 16.383 21.392 7.755 1.00 38.28 O HETATM 8115 O HOH 23 4.365 -9.616 12.790 1.00 31.38 O HETATM 8116 O HOH 24 12.183 21.461 22.809 1.00 22.73 O HETATM 8117 O HOH 25 22.578 0.824 -2.877 1.00 33.02 O HETATM 8118 O HOH 26 4.688 23.686 17.754 1.00 30.64 O HETATM 8119 O HOH 27 31.622 -14.879 -18.036 1.00 25.23 O HETATM 8120 O HOH 28 19.779 0.417 -0.507 1.00 23.44 O HETATM 8121 O HOH 29 -0.417 7.816 -3.601 1.00 38.58 O HETATM 8122 O HOH 30 2.270 -1.826 3.819 1.00 35.83 O HETATM 8123 O HOH 31 22.382 6.462 -17.317 1.00 33.12 O HETATM 8124 O HOH 32 13.083 17.331 26.215 1.00 44.92 O HETATM 8125 O HOH 33 19.933 1.594 -2.888 1.00 28.62 O HETATM 8126 O HOH 34 -0.237 5.080 11.756 1.00 22.58 O HETATM 8127 O HOH 35 12.060 -6.688 -9.505 1.00 44.18 O HETATM 8128 O HOH 36 2.935 27.652 11.183 1.00 43.67 O HETATM 8129 O HOH 37 -1.788 18.956 2.905 1.00 23.57 O HETATM 8130 O HOH 38 34.933 -2.184 -18.862 1.00 32.71 O HETATM 8131 O HOH 39 13.703 19.571 12.931 1.00 25.68 O HETATM 8132 O HOH 40 21.501 3.573 17.265 1.00 58.78 O HETATM 8133 O HOH 41 31.170 -12.317 -18.907 1.00 19.61 O HETATM 8134 O HOH 42 18.397 -0.747 18.369 1.00 33.18 O HETATM 8135 O HOH 43 21.336 -0.941 12.595 1.00 37.07 O HETATM 8136 O HOH 44 6.331 -9.867 10.892 1.00 31.98 O HETATM 8137 O HOH 45 -3.116 23.574 0.548 1.00 38.22 O HETATM 8138 O HOH 46 16.962 18.656 12.474 1.00 39.09 O HETATM 8139 O HOH 47 -0.362 5.684 -1.989 1.00 39.32 O HETATM 8140 O HOH 48 13.598 5.209 -11.756 1.00 46.47 O HETATM 8141 O HOH 49 13.736 0.059 -11.397 1.00 44.90 O HETATM 8142 O HOH 50 12.818 23.387 15.750 1.00 34.77 O HETATM 8143 O HOH 51 12.454 -8.702 3.427 1.00 39.09 O HETATM 8144 O HOH 52 1.210 -0.197 0.445 1.00 32.84 O HETATM 8145 O HOH 53 17.489 -7.613 -23.997 1.00 41.19 O HETATM 8146 O HOH 54 8.398 8.911 -8.512 1.00 40.62 O HETATM 8147 O HOH 55 23.270 7.527 -7.454 1.00 21.82 O HETATM 8148 O HOH 56 21.968 8.354 25.129 1.00 25.18 O HETATM 8149 O HOH 57 8.688 15.471 24.138 1.00 20.12 O HETATM 8150 O HOH 58 0.920 -2.453 6.004 1.00 36.74 O HETATM 8151 O HOH 59 9.523 -2.636 -1.306 1.00 37.32 O HETATM 8152 O HOH 60 20.098 4.132 2.232 1.00 31.78 O HETATM 8153 O HOH 61 -11.017 21.378 22.012 1.00 39.58 O HETATM 8154 O HOH 62 15.973 3.066 -7.293 1.00 36.35 O HETATM 8155 O HOH 63 -2.712 -3.285 13.186 1.00 41.20 O HETATM 8156 O HOH 64 4.712 11.006 -7.366 1.00 31.89 O HETATM 8157 O HOH 65 -2.015 -6.477 12.572 1.00 41.88 O HETATM 8158 O HOH 66 21.374 -5.465 13.335 1.00 34.64 O HETATM 8159 O HOH 67 12.571 10.236 -13.239 1.00 32.07 O HETATM 8160 O HOH 68 5.804 9.024 -8.449 1.00 26.37 O HETATM 8161 O HOH 69 -0.642 24.560 1.513 1.00 43.31 O HETATM 8162 O HOH 70 25.161 -10.568 -6.149 1.00 24.82 O HETATM 8163 O HOH 71 0.908 -7.350 9.868 1.00 39.88 O HETATM 8164 O HOH 72 0.592 -4.039 10.106 1.00 39.95 O HETATM 8165 O HOH 73 21.698 -2.369 15.238 1.00 48.00 O HETATM 8166 O HOH 74 7.107 25.340 17.014 1.00 38.81 O HETATM 8167 O HOH 75 9.856 -7.304 3.817 1.00 45.54 O HETATM 8168 O HOH 76 19.024 16.253 -7.695 1.00 44.60 O HETATM 8169 O HOH 77 22.956 -10.215 7.975 1.00 40.97 O HETATM 8170 O HOH 78 7.446 -7.366 5.114 1.00 31.37 O HETATM 8171 O HOH 79 32.577 10.791 8.013 1.00 34.35 O HETATM 8172 O HOH 80 25.790 11.476 17.014 1.00 37.79 O HETATM 8173 O HOH 81 29.156 -7.276 -3.026 1.00 45.67 O HETATM 8174 O HOH 82 28.985 -3.430 16.330 1.00 51.96 O HETATM 8175 O HOH 83 13.682 15.774 29.669 1.00 46.98 O HETATM 8176 O HOH 84 -3.266 15.502 -6.504 1.00 37.31 O HETATM 8177 O HOH 85 16.555 20.823 10.376 1.00 27.24 O HETATM 8178 O HOH 86 -5.007 4.975 13.619 1.00 44.93 O HETATM 8179 O HOH 87 2.343 -4.296 6.905 1.00 35.44 O HETATM 8180 O HOH 88 17.261 7.249 -17.766 1.00 40.07 O HETATM 8181 O HOH 89 17.978 0.477 23.419 1.00 25.63 O HETATM 8182 O HOH 90 0.916 28.201 3.231 1.00 34.57 O HETATM 8183 O HOH 91 -14.095 18.013 19.639 1.00 37.75 O HETATM 8184 O HOH 92 -7.254 21.335 17.153 1.00 34.82 O HETATM 8185 O HOH 93 22.522 7.744 1.163 1.00 43.97 O HETATM 8186 O HOH 94 24.162 -5.026 17.096 1.00 36.92 O HETATM 8187 O HOH 95 26.038 11.514 7.279 1.00 46.01 O HETATM 8188 O HOH 96 24.406 18.116 -10.552 1.00 42.04 O HETATM 8189 O HOH 97 13.611 -6.072 -20.752 1.00 38.44 O HETATM 8190 O HOH 98 11.995 -1.581 -22.285 1.00 43.16 O HETATM 8191 O HOH 99 16.273 0.289 -26.436 1.00 51.17 O HETATM 8192 O HOH 100 19.210 -17.403 -19.608 1.00 47.96 O HETATM 8193 O HOH 101 22.511 12.989 4.645 1.00 39.05 O HETATM 8194 O HOH 102 26.206 -15.917 -9.834 1.00 50.34 O HETATM 8195 O HOH 103 -4.094 4.278 10.582 1.00 32.93 O HETATM 8196 O HOH 104 -16.479 -6.388 3.236 1.00 35.57 O HETATM 8197 O HOH 105 7.059 4.052 53.911 1.00 28.56 O HETATM 8198 O HOH 106 -15.941 -5.229 28.192 1.00 44.69 O HETATM 8199 O HOH 107 11.623 -22.950 53.974 1.00 26.99 O HETATM 8200 O HOH 108 3.755 -5.393 35.473 1.00 25.82 O HETATM 8201 O HOH 109 20.744 2.409 38.925 1.00 55.02 O HETATM 8202 O HOH 110 6.407 -12.575 38.955 1.00 28.55 O HETATM 8203 O HOH 111 5.568 -12.959 51.551 1.00 20.56 O HETATM 8204 O HOH 112 6.121 -13.849 43.224 1.00 31.28 O HETATM 8205 O HOH 113 1.114 6.651 30.739 1.00 41.21 O HETATM 8206 O HOH 114 10.241 -6.316 39.630 1.00 26.41 O HETATM 8207 O HOH 115 13.849 -5.546 10.587 1.00 29.18 O HETATM 8208 O HOH 116 16.550 1.658 30.899 1.00 20.75 O HETATM 8209 O HOH 117 11.254 -7.673 42.964 1.00 19.10 O HETATM 8210 O HOH 118 17.402 -18.858 54.708 1.00 25.98 O HETATM 8211 O HOH 119 2.359 4.131 61.006 1.00 41.01 O HETATM 8212 O HOH 120 -0.770 -11.607 26.168 1.00 35.40 O HETATM 8213 O HOH 121 15.833 -6.932 21.618 1.00 33.59 O HETATM 8214 O HOH 122 6.200 -13.116 46.759 1.00 33.15 O HETATM 8215 O HOH 123 4.690 6.398 30.563 1.00 37.39 O HETATM 8216 O HOH 124 -3.441 2.983 21.553 1.00 37.01 O HETATM 8217 O HOH 125 13.460 0.722 28.451 1.00 20.31 O HETATM 8218 O HOH 126 2.197 11.290 21.034 1.00 36.33 O HETATM 8219 O HOH 127 -0.671 3.696 37.583 1.00 42.34 O HETATM 8220 O HOH 128 8.560 -9.909 33.766 1.00 30.22 O HETATM 8221 O HOH 129 9.016 -7.321 42.183 1.00 19.27 O HETATM 8222 O HOH 130 7.099 5.379 46.401 1.00 51.33 O HETATM 8223 O HOH 131 3.619 8.493 24.948 1.00 33.32 O HETATM 8224 O HOH 132 9.006 -9.845 36.481 1.00 18.72 O HETATM 8225 O HOH 133 13.130 -6.564 39.889 1.00 40.58 O HETATM 8226 O HOH 134 17.062 -15.101 54.333 1.00 17.65 O HETATM 8227 O HOH 135 12.294 4.751 34.756 1.00 27.62 O HETATM 8228 O HOH 136 3.139 -0.754 47.654 1.00 19.63 O HETATM 8229 O HOH 137 20.547 -7.468 47.267 1.00 30.26 O HETATM 8230 O HOH 138 2.400 -23.612 55.659 1.00 36.40 O HETATM 8231 O HOH 139 19.654 -6.242 59.701 1.00 34.88 O HETATM 8232 O HOH 140 -15.652 -5.467 38.014 1.00 41.44 O HETATM 8233 O HOH 141 -0.906 -20.291 43.417 1.00 45.92 O HETATM 8234 O HOH 142 -0.807 -4.745 48.081 1.00 41.04 O HETATM 8235 O HOH 143 -9.225 -3.750 40.911 1.00 40.93 O HETATM 8236 O HOH 144 4.173 12.628 21.955 1.00 40.01 O HETATM 8237 O HOH 145 19.910 -15.487 51.777 1.00 35.96 O HETATM 8238 O HOH 146 -3.220 -17.246 22.094 1.00 38.02 O HETATM 8239 O HOH 147 18.217 7.741 55.428 1.00 27.20 O HETATM 8240 O HOH 148 -5.342 -16.124 50.861 1.00 39.43 O HETATM 8241 O HOH 149 6.732 6.810 56.297 1.00 40.72 O HETATM 8242 O HOH 150 -4.317 -7.731 48.308 1.00 41.20 O HETATM 8243 O HOH 151 15.265 -13.294 36.802 1.00 28.16 O HETATM 8244 O HOH 152 10.433 -12.321 36.702 1.00 31.94 O HETATM 8245 O HOH 153 5.397 10.280 25.470 1.00 35.85 O HETATM 8246 O HOH 154 5.164 -12.118 48.896 1.00 11.68 O HETATM 8247 O HOH 155 4.271 -15.061 45.536 1.00 28.50 O HETATM 8248 O HOH 156 10.142 -9.684 15.089 1.00 22.25 O HETATM 8249 O HOH 157 9.128 -7.354 37.000 1.00 28.70 O HETATM 8250 O HOH 158 -4.182 -16.728 16.145 1.00 44.47 O HETATM 8251 O HOH 159 -1.627 -17.027 45.153 1.00 45.77 O HETATM 8252 O HOH 160 11.674 -27.719 51.918 1.00 35.05 O HETATM 8253 O HOH 161 13.614 -25.110 59.983 1.00 30.26 O HETATM 8254 O HOH 162 8.956 -22.230 58.541 1.00 43.07 O HETATM 8255 O HOH 163 19.155 -13.306 54.512 1.00 31.06 O HETATM 8256 O HOH 164 11.449 9.592 39.626 1.00 54.22 O HETATM 8257 O HOH 165 9.239 7.369 32.096 1.00 30.44 O HETATM 8258 O HOH 166 -18.623 1.309 31.291 1.00 42.57 O HETATM 8259 O HOH 167 15.873 -7.659 27.513 1.00 36.97 O HETATM 8260 O HOH 168 -5.734 -4.740 43.009 1.00 35.45 O HETATM 8261 O HOH 169 17.875 4.482 31.258 1.00 40.30 O HETATM 8262 O HOH 170 19.387 5.214 29.379 1.00 39.21 O HETATM 8263 O HOH 171 5.642 3.070 37.497 1.00 29.30 O HETATM 8264 O HOH 172 -19.123 -10.946 29.160 1.00 42.81 O HETATM 8265 O HOH 173 20.442 -5.424 54.064 1.00 47.51 O HETATM 8266 O HOH 174 9.346 5.165 34.060 1.00 36.99 O HETATM 8267 O HOH 175 20.807 -4.436 39.720 1.00 46.59 O HETATM 8268 O HOH 176 8.133 4.986 36.581 1.00 37.32 O HETATM 8269 O HOH 177 19.363 -3.455 28.345 1.00 43.19 O HETATM 8270 O HOH 178 14.728 -15.101 29.681 1.00 54.86 O HETATM 8271 O HOH 179 0.884 2.466 39.640 1.00 37.07 O HETATM 8272 O HOH 180 11.752 -15.051 7.175 1.00 29.16 O HETATM 8273 O HOH 181 16.960 -10.241 14.903 1.00 43.42 O HETATM 8274 O HOH 182 -6.848 -0.523 41.316 1.00 29.75 O HETATM 8275 O HOH 183 1.283 -17.130 10.709 1.00 47.52 O HETATM 8276 O HOH 184 21.012 -6.107 51.503 1.00 40.65 O HETATM 8277 O HOH 185 12.220 -18.131 22.819 1.00 60.87 O HETATM 8278 O HOH 186 14.861 -13.175 9.926 1.00 38.90 O HETATM 8279 O HOH 187 -0.824 7.500 32.619 1.00 44.43 O HETATM 8280 O HOH 188 -14.112 10.483 27.399 1.00 48.83 O HETATM 8281 O HOH 189 20.778 -4.970 61.858 1.00 35.07 O HETATM 8282 O HOH 190 4.831 -17.819 58.640 1.00 31.53 O HETATM 8283 O HOH 191 11.083 8.305 43.552 1.00 39.25 O HETATM 8284 O HOH 192 2.388 0.525 49.997 1.00 37.07 O HETATM 8285 O HOH 193 -8.085 11.255 29.973 1.00 46.96 O HETATM 8286 O HOH 194 -12.451 -6.569 45.377 1.00 43.08 O HETATM 8287 O HOH 195 -9.679 -6.378 44.371 1.00 48.25 O HETATM 8288 O HOH 196 -5.768 -0.299 46.381 1.00 48.08 O HETATM 8289 O HOH 197 9.197 11.132 34.310 1.00 33.08 O HETATM 8290 O HOH 198 7.150 10.826 54.042 1.00 42.43 O HETATM 8291 O HOH 199 3.874 13.090 49.206 1.00 49.68 O HETATM 8292 O HOH 200 13.581 -11.854 6.524 1.00 27.32 O HETATM 8293 N1 A A 5 13.999 9.785 -5.605 1.00 -0.27 N HETATM 8294 C2 A A 5 13.056 9.300 -4.803 1.00 0.05 C HETATM 8295 N3 A A 5 13.164 9.425 -3.489 1.00 -0.27 N HETATM 8296 C4 A A 5 14.216 10.043 -2.907 1.00 0.16 C HETATM 8297 C5 A A 5 15.217 10.555 -3.720 1.00 0.10 C HETATM 8298 C6 A A 5 15.094 10.414 -5.114 1.00 0.13 C HETATM 8299 N6 A A 5 16.021 10.872 -5.961 1.00 -0.32 N HETATM 8300 H2 A A 5 16.857 11.352 -5.599 1.00 0.18 H HETATM 8301 H3 A A 5 15.899 10.745 -6.976 1.00 0.18 H HETATM 8302 N7 A A 5 16.119 11.091 -2.909 1.00 -0.30 N HETATM 8303 C8 A A 5 15.720 10.950 -1.647 1.00 0.11 C HETATM 8304 N9 A A 5 14.552 10.307 -1.645 1.00 -0.19 N HETATM 8305 CAZ A A 5 13.803 9.929 -0.446 1.00 0.20 C HETATM 8306 OAP A A 5 13.919 10.955 0.570 1.00 -0.34 O HETATM 8307 CAY A A 5 13.343 10.310 1.746 1.00 0.10 C HETATM 8308 CAL A A 5 13.557 11.043 3.087 1.00 0.03 C HETATM 8309 SAR A A 5 15.258 11.275 3.729 1.00 -0.09 S HETATM 8310 SAQ A A 5 15.713 9.564 4.787 1.00 -0.08 S HETATM 8311 CAK A A 5 14.106 8.832 5.303 1.00 0.04 C HETATM 8312 CAS A A 5 14.036 9.109 6.792 1.00 -0.03 C HETATM 8313 CAG A A 5 13.653 10.369 7.235 1.00 -0.06 C HETATM 8314 CAE A A 5 13.584 10.639 8.594 1.00 -0.07 C HETATM 8315 CAD A A 5 13.924 9.652 9.487 1.00 -0.07 C HETATM 8316 CAF A A 5 14.317 8.396 9.017 1.00 -0.07 C HETATM 8317 CAH A A 5 14.389 8.117 7.667 1.00 -0.06 C HETATM 8318 H11 A A 5 14.714 7.146 7.312 1.00 0.06 H HETATM 8319 H9 A A 5 14.572 7.621 9.731 1.00 0.06 H HETATM 8320 H7 A A 5 13.888 9.847 10.553 1.00 0.06 H HETATM 8321 H8 A A 5 13.267 11.614 8.946 1.00 0.06 H HETATM 8322 H10 A A 5 13.408 11.143 6.517 1.00 0.06 H HETATM 8323 H12 A A 5 14.088 7.750 5.106 1.00 0.05 H HETATM 8324 H13 A A 5 13.270 9.315 4.776 1.00 0.05 H HETATM 8325 H14 A A 5 13.117 12.045 2.977 1.00 0.04 H HETATM 8326 H15 A A 5 13.001 10.480 3.851 1.00 0.04 H HETATM 8327 CAW A A 5 13.831 8.845 1.683 1.00 0.11 C HETATM 8328 OAB A A 5 12.665 8.015 1.747 1.00 -0.39 O HETATM 8329 H5 A A 5 12.276 8.084 2.611 1.00 0.21 H HETATM 8330 CAX A A 5 14.544 8.802 0.302 1.00 0.14 C HETATM 8331 OAC A A 5 14.484 7.560 -0.394 1.00 -0.38 O HETATM 8332 H6 A A 5 14.890 6.883 0.134 1.00 0.21 H HETATM 8333 H17 A A 5 15.606 9.059 0.427 1.00 0.07 H HETATM 8334 H16 A A 5 14.525 8.594 2.499 1.00 0.06 H HETATM 8335 H18 A A 5 12.252 10.292 1.603 1.00 0.06 H HETATM 8336 H19 A A 5 12.761 9.678 -0.695 1.00 0.10 H HETATM 8337 H4 A A 5 16.256 11.300 -0.766 1.00 0.13 H HETATM 8338 H1 A A 5 12.193 8.799 -5.227 1.00 0.10 H CONECT 1049 1050 1062 1063 1064 CONECT 1062 1049 CONECT 1063 1049 CONECT 1064 1049 CONECT 4021 4022 4030 4031 4032 CONECT 4030 4021 CONECT 4031 4021 CONECT 4032 4021 CONECT 8293 8294 8298 CONECT 8294 8293 8295 8338 CONECT 8295 8294 8296 CONECT 8296 8295 8297 8304 CONECT 8297 8296 8298 8302 CONECT 8298 8293 8297 8299 CONECT 8299 8298 8300 8301 CONECT 8300 8299 CONECT 8301 8299 CONECT 8302 8297 8303 CONECT 8303 8302 8304 8337 CONECT 8304 8296 8303 8305 CONECT 8305 8304 8306 8330 8336 CONECT 8306 8305 8307 CONECT 8307 8306 8308 8327 8335 CONECT 8308 8307 8309 8325 8326 CONECT 8309 8308 8310 CONECT 8310 8309 8311 CONECT 8311 8310 8312 8323 8324 CONECT 8312 8311 8313 8317 CONECT 8313 8312 8314 8322 CONECT 8314 8313 8315 8321 CONECT 8315 8314 8316 8320 CONECT 8316 8315 8317 8319 CONECT 8317 8312 8316 8318 CONECT 8318 8317 CONECT 8319 8316 CONECT 8320 8315 CONECT 8321 8314 CONECT 8322 8313 CONECT 8323 8311 CONECT 8324 8311 CONECT 8325 8308 CONECT 8326 8308 CONECT 8327 8307 8328 8330 8334 CONECT 8328 8327 8329 CONECT 8329 8328 CONECT 8330 8305 8327 8331 8333 CONECT 8331 8330 8332 CONECT 8332 8331 CONECT 8333 8330 CONECT 8334 8327 CONECT 8335 8307 CONECT 8336 8305 CONECT 8337 8303 CONECT 8338 8294 MASTER 0 0 0 0 0 0 0 0 8334 4 54 44 END
Display Options:
Structure:
Ligand 2D
Ligand 3D
Protein
Pocket-Ligand
Protein-Ligand
Goto PDB code:
3D presentation of molecule is powered by
3Dmol
, which supports all modern browsers and mobile devices via WebGL.
Hold mouse button:
left to rotate,middle to shift,right to zoom
Related entries of code: 3ioc
Entries with 90% protein sequence similarity cutoff in PDBbind
PDB Code
Check Database
Protein Sequence Similarity
3cow
RCSB PDB
PDBbind
301aa, >3COW_1|Chains... at 99%
3coy
RCSB PDB
PDBbind
301aa, >3COY_1|Chains... at 99%
3coz
RCSB PDB
PDBbind
301aa, >3COZ_1|Chains... at 99%
3imc
RCSB PDB
PDBbind
301aa, >3IMC_1|Chains... at 99%
3ime
RCSB PDB
PDBbind
301aa, >3IME_1|Chains... at 99%
3img
RCSB PDB
PDBbind
301aa, >3IMG_1|Chains... at 99%
3iob
RCSB PDB
PDBbind
301aa, >3IOB_1|Chains... at 99%
3iod
RCSB PDB
PDBbind
301aa, >3IOD_1|Chains... at 99%
3ioe
RCSB PDB
PDBbind
301aa, >3IOE_1|Chains... at 99%
3isj
RCSB PDB
PDBbind
300aa, >3ISJ_1|Chains... at 100%
3iub
RCSB PDB
PDBbind
301aa, >3IUB_1|Chains... at 100%
3iue
RCSB PDB
PDBbind
301aa, >3IUE_1|Chains... at 100%
3ivc
RCSB PDB
PDBbind
301aa, >3IVC_1|Chains... at 100%
3ivg
RCSB PDB
PDBbind
301aa, >3IVG_1|Chains... at 100%
3ivx
RCSB PDB
PDBbind
301aa, >3IVX_1|Chains... at 100%
3le8
RCSB PDB
PDBbind
300aa, >3LE8_1|Chains... at 100%
4ddh
RCSB PDB
PDBbind
301aa, >4DDH_1|Chains... at 100%
4ddk
RCSB PDB
PDBbind
301aa, >4DDK_1|Chains... at 100%
4ddm
RCSB PDB
PDBbind
301aa, >4DDM_1|Chains... at 100%
4de5
RCSB PDB
PDBbind
301aa, >4DE5_1|Chains... at 100%
4ef6
RCSB PDB
PDBbind
300aa, >4EF6_1|Chains... at 100%
4efk
RCSB PDB
PDBbind
300aa, >4EFK_1|Chains... at 100%
4fzj
RCSB PDB
PDBbind
301aa, >4FZJ_1|Chains... at 100%
4g5f
RCSB PDB
PDBbind
309aa, >4G5F_1|Chains... *
4g5y
RCSB PDB
PDBbind
301aa, >4G5Y_1|Chains... at 99%
4mq6
RCSB PDB
PDBbind
309aa, >4MQ6_1|Chains... at 100%
4mue
RCSB PDB
PDBbind
300aa, >4MUE_1|Chains... at 100%
4muf
RCSB PDB
PDBbind
300aa, >4MUF_1|Chains... at 100%
4muk
RCSB PDB
PDBbind
300aa, >4MUK_1|Chains... at 100%
4mul
RCSB PDB
PDBbind
300aa, >4MUL_1|Chains... at 100%
Complexes with the same small molecule ligand
PDB Code
Check Database
Ligand Name
No complexes with the same small molecule ligand are found!
Entry Information
PDB ID
3ioc
Complex Type
Protein-Ligand
PDBbind Subset
refined set
Protein Name
Mycobacterium Tuberculosis Pantothenate Synthetase
Ligand Name
A5D
EC.Number
E.C.6.3.2.1
Resolution
2.5(Å)
Affinity (Kd/Ki/IC50)
Kd=210uM
Release Year
2009
Protein/NA Sequence
Check fasta file
Primary Reference
(2009) Chembiochem Vol. 10: pp. 2772-2779
Ligand Properties
Formula
C
1
7
H
1
9
N
5
O
3
S
2
Molecular Weight
405.494
Exact Mass
405.093
No. of atoms
46
No. of bonds
49
Polar Surface Area
169.91
LOGP Value
0.41 (
Computed with XLOGP3
)
2.19 (
Computed with Open Babel
)
Drug likeness
No. of Hydrogen Bond Donors: 3
No. of Hydrogen Bond Acceptors: 5
No. of Rotatable Bonds: 8
No. of Nitrogen and Oxygen Atoms: 8
No. of Rings: 4
Canonical SMILES
O[C@@H]1[C@@H](CSSCc2ccccc2)O[C@H]([C@@H]1O)n1cnc2c1ncnc2N
InChI String
InChI=1S/C17H19N5O3S2/c18-15-12-16(20-8-19-15)22(9-21-12)17-14(24)13(23)11(25-17)7-27-26-6-10-4-2-1-3-5-10/h1-5,8-9,11,13-14,17,23-24H,6-7H2,(H2,18,19,20)/t11-,13-,14-,17-/m1/s1
Links to External Databases
RCSB PDB
The mother database
PDBsum
Enhanced annotations on PDB entries
Pubchem
Comprehensive collection of chemical and biological data
UniProtKB AC
UniProt accession number (AC):
P9WIL5
Entrez Gene ID
NCBI Entrez Gene ID:
885459
ASD
Information of known allosteric effects of PDB entries
This site has been visited
times since Nov 2007.
Copyright ©2007-2024 涓婃捣鐩堣禌鎬濅俊鎭鎶鏈夐檺鍏徃 缃戠珯澶囨鍙凤細
娌狪CP澶2021015625鍙-3
娌叕缃戝畨澶囷細
姝e湪鐢宠涓
Technical Support锛堟妧鏈敮鎸侊級:
yingsaisi@foxmail.com